repo_name
stringlengths
6
69
path
stringlengths
6
178
copies
stringclasses
278 values
size
stringlengths
4
7
content
stringlengths
671
917k
license
stringclasses
15 values
medoo313m/bmo-bot2
plugins/banhammer.lua
1
12546
local function pre_process(msg) local data = load_data(_config.moderation.data) -- SERVICE MESSAGE if msg.action and msg.action.type then local action = msg.action.type -- Check if banned user joins chat by link if action == 'chat_add_user_link' then local user_id = msg.from.id print('Checking invited user '..user_id) local banned = is_banned(user_id, msg.to.id) if banned or is_gbanned(user_id) then -- Check it with redis print('User is banned!') local print_name = user_print_name(msg.from):gsub("‮", "") local name = print_name:gsub("_", "") savelog(msg.to.id, name.." ["..msg.from.id.."] is banned and kicked ! ")-- Save to logs kick_user(user_id, msg.to.id) end end -- Check if banned user joins chat if action == 'chat_add_user' then local user_id = msg.action.user.id print('Checking invited user '..user_id) local banned = is_banned(user_id, msg.to.id) if banned and not is_momod2(msg.from.id, msg.to.id) or is_gbanned(user_id) and not is_admin2(msg.from.id) then -- Check it with redis print('User is banned!') local print_name = user_print_name(msg.from):gsub("‮", "") local name = print_name:gsub("_", "") savelog(msg.to.id, name.." ["..msg.from.id.."] added a banned user >"..msg.action.user.id)-- Save to logs kick_user(user_id, msg.to.id) local banhash = 'addedbanuser:'..msg.to.id..':'..msg.from.id redis:incr(banhash) local banhash = 'addedbanuser:'..msg.to.id..':'..msg.from.id local banaddredis = redis:get(banhash) if banaddredis then if tonumber(banaddredis) >= 4 and not is_owner(msg) then kick_user(msg.from.id, msg.to.id)-- Kick user who adds ban ppl more than 3 times end if tonumber(banaddredis) >= 8 and not is_owner(msg) then ban_user(msg.from.id, msg.to.id)-- Kick user who adds ban ppl more than 7 times local banhash = 'addedbanuser:'..msg.to.id..':'..msg.from.id redis:set(banhash, 0)-- Reset the Counter end end end if data[tostring(msg.to.id)] then if data[tostring(msg.to.id)]['settings'] then if data[tostring(msg.to.id)]['settings']['lock_bots'] then bots_protection = data[tostring(msg.to.id)]['settings']['lock_bots'] end end end if msg.action.user.username ~= nil then if string.sub(msg.action.user.username:lower(), -3) == 'bot' and not is_momod(msg) and bots_protection == "yes" then --- Will kick bots added by normal users local print_name = user_print_name(msg.from):gsub("‮", "") local name = print_name:gsub("_", "") savelog(msg.to.id, name.." ["..msg.from.id.."] added a bot > @".. msg.action.user.username)-- Save to logs kick_user(msg.action.user.id, msg.to.id) end end end -- No further checks return msg end -- banned user is talking ! if msg.to.type == 'chat' or msg.to.type == 'channel' then local group = msg.to.id local texttext = 'groups' --if not data[tostring(texttext)][tostring(msg.to.id)] and not is_realm(msg) then -- Check if this group is one of my groups or not --chat_del_user('chat#id'..msg.to.id,'user#id'..our_id,ok_cb,false) --return --end local user_id = msg.from.id local chat_id = msg.to.id local banned = is_banned(user_id, chat_id) if banned or is_gbanned(user_id) then -- Check it with redis print('Banned user talking!') local print_name = user_print_name(msg.from):gsub("‮", "") local name = print_name:gsub("_", "") savelog(msg.to.id, name.." ["..msg.from.id.."] banned user is talking !")-- Save to logs kick_user(user_id, chat_id) msg.text = '' end end return msg end local function kick_ban_res(extra, success, result) local chat_id = extra.chat_id local chat_type = extra.chat_type if chat_type == "chat" then receiver = 'chat#id'..chat_id else receiver = 'channel#id'..chat_id end if success == 0 then return send_large_msg(receiver, "Cannot find user by that username!") end local member_id = result.peer_id local user_id = member_id local member = result.username local from_id = extra.from_id local get_cmd = extra.get_cmd if get_cmd == "kick" then if member_id == from_id then send_large_msg(receiver, "You can't kick yourself") return end if is_momod2(member_id, chat_id) and not is_admin2(sender) then send_large_msg(receiver, "You can't kick mods/owner/admins") return end kick_user(member_id, chat_id) elseif get_cmd == 'ban' then if is_momod2(member_id, chat_id) and not is_admin2(sender) then send_large_msg(receiver, "You can't ban mods/owner/admins") return end send_large_msg(receiver, 'User @'..member..' ['..member_id..'] banned') ban_user(member_id, chat_id) elseif get_cmd == 'unban' then send_large_msg(receiver, 'User @'..member..' ['..member_id..'] unbanned') local hash = 'banned:'..chat_id redis:srem(hash, member_id) return 'User '..user_id..' unbanned' elseif get_cmd == 'banall' then send_large_msg(receiver, 'User @'..member..' ['..member_id..'] globally banned') banall_user(member_id) elseif get_cmd == 'unbanall' then send_large_msg(receiver, 'User @'..member..' ['..member_id..'] globally unbanned') unbanall_user(member_id) end end local function run(msg, matches) local support_id = msg.from.id if matches[1]:lower() == 'id' and msg.to.type == "chat" or msg.to.type == "user" then if msg.to.type == "user" then return "Bot ID: "..msg.to.id.. "\n\nYour ID: "..msg.from.id end if type(msg.reply_id) ~= "nil" then local print_name = user_print_name(msg.from):gsub("‮", "") local name = print_name:gsub("_", "") savelog(msg.to.id, name.." ["..msg.from.id.."] used /id ") id = get_message(msg.reply_id,get_message_callback_id, false) elseif matches[1]:lower() == 'id' then local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] used /id ") return "Group ID for " ..string.gsub(msg.to.print_name, "_", " ").. ":\n\n"..msg.to.id end end if matches[1]:lower() == 'kickme' and msg.to.type == "chat" then-- /kickme local receiver = get_receiver(msg) if msg.to.type == 'chat' then local print_name = user_print_name(msg.from):gsub("‮", "") local name = print_name:gsub("_", "") savelog(msg.to.id, name.." ["..msg.from.id.."] left using kickme ")-- Save to logs chat_del_user("chat#id"..msg.to.id, "user#id"..msg.from.id, ok_cb, false) end end if not is_momod(msg) then -- Ignore normal users return end if matches[1]:lower() == "banlist" then -- Ban list ! local chat_id = msg.to.id if matches[2] and is_admin1(msg) then chat_id = matches[2] end return ban_list(chat_id) end if matches[1]:lower() == 'ban' then-- /ban if type(msg.reply_id)~="nil" and is_momod(msg) then if is_admin1(msg) then msgr = get_message(msg.reply_id,ban_by_reply_admins, false) else msgr = get_message(msg.reply_id,ban_by_reply, false) end local user_id = matches[2] local chat_id = msg.to.id elseif string.match(matches[2], '^%d+$') then if tonumber(matches[2]) == tonumber(our_id) then return end if not is_admin1(msg) and is_momod2(matches[2], msg.to.id) then return "you can't ban mods/owner/admins" end if tonumber(matches[2]) == tonumber(msg.from.id) then return "You can't ban your self !" end local print_name = user_print_name(msg.from):gsub("‮", "") local name = print_name:gsub("_", "") local receiver = get_receiver(msg) savelog(msg.to.id, name.." ["..msg.from.id.."] baned user ".. matches[2]) ban_user(matches[2], msg.to.id) send_large_msg(receiver, 'User ['..matches[2]..'] banned') else local cbres_extra = { chat_id = msg.to.id, get_cmd = 'ban', from_id = msg.from.id, chat_type = msg.to.type } local username = string.gsub(matches[2], '@', '') resolve_username(username, kick_ban_res, cbres_extra) end end if matches[1]:lower() == 'unban' then -- /unban if type(msg.reply_id)~="nil" and is_momod(msg) then local msgr = get_message(msg.reply_id,unban_by_reply, false) end local user_id = matches[2] local chat_id = msg.to.id local targetuser = matches[2] if string.match(targetuser, '^%d+$') then local user_id = targetuser local hash = 'banned:'..chat_id redis:srem(hash, user_id) local print_name = user_print_name(msg.from):gsub("‮", "") local name = print_name:gsub("_", "") savelog(msg.to.id, name.." ["..msg.from.id.."] unbaned user ".. matches[2]) return 'User '..user_id..' unbanned' else local cbres_extra = { chat_id = msg.to.id, get_cmd = 'unban', from_id = msg.from.id, chat_type = msg.to.type } local username = string.gsub(matches[2], '@', '') resolve_username(username, kick_ban_res, cbres_extra) end end if matches[1]:lower() == 'kick' then if type(msg.reply_id)~="nil" and is_momod(msg) then if is_admin1(msg) then msgr = get_message(msg.reply_id,Kick_by_reply_admins, false) else msgr = get_message(msg.reply_id,Kick_by_reply, false) end elseif string.match(matches[2], '^%d+$') then if tonumber(matches[2]) == tonumber(our_id) then return end if not is_admin1(msg) and is_momod2(matches[2], msg.to.id) then return "you can't kick mods/owner/admins" end if tonumber(matches[2]) == tonumber(msg.from.id) then return "You can't kick your self !" end local user_id = matches[2] local chat_id = msg.to.id local print_name = user_print_name(msg.from):gsub("‮", "") local name = print_name:gsub("_", "") savelog(msg.to.id, name.." ["..msg.from.id.."] kicked user ".. matches[2]) kick_user(user_id, chat_id) else local cbres_extra = { chat_id = msg.to.id, get_cmd = 'kick', from_id = msg.from.id, chat_type = msg.to.type } local username = string.gsub(matches[2], '@', '') resolve_username(username, kick_ban_res, cbres_extra) end end if not is_admin1(msg) and not is_support(support_id) then return end if matches[1]:lower() == 'banall' and is_admin1(msg) then -- Global ban if type(msg.reply_id) ~="nil" and is_admin1(msg) then banall = get_message(msg.reply_id,banall_by_reply, false) end local user_id = matches[2] local chat_id = msg.to.id local targetuser = matches[2] if string.match(targetuser, '^%d+$') then if tonumber(matches[2]) == tonumber(our_id) then return false end banall_user(targetuser) return 'User ['..user_id..' ] globally banned' else local cbres_extra = { chat_id = msg.to.id, get_cmd = 'banall', from_id = msg.from.id, chat_type = msg.to.type } local username = string.gsub(matches[2], '@', '') resolve_username(username, kick_ban_res, cbres_extra) end end if matches[1]:lower() == 'unbanall' then -- Global unban local user_id = matches[2] local chat_id = msg.to.id if string.match(matches[2], '^%d+$') then if tonumber(matches[2]) == tonumber(our_id) then return false end unbanall_user(user_id) return 'User ['..user_id..' ] globally unbanned' else local cbres_extra = { chat_id = msg.to.id, get_cmd = 'unbanall', from_id = msg.from.id, chat_type = msg.to.type } local username = string.gsub(matches[2], '@', '') resolve_username(username, kick_ban_res, cbres_extra) end end if matches[1]:lower() == "gbanlist" then -- Global ban list return banall_list() end end return { patterns = { "^[#]([Bb]anall) (.*)$", "^[#]([Bb]anall)$", "^[#]([Bb]anlist) (.*)$", "^[#]([Bb]anlist)$", "^[#]([Gg]banlist)$", "^[#]([Kk]ickme)", "^[#]([Kk]ick)$", "^[#]([Bb]an)$", "^[#]([Bb]an) (.*)$", "^[#]([Uu]nban) (.*)$", "^[#]([Uu]nbanall) (.*)$", "^[#]([Uu]nbanall)$", "^[#]([Kk]ick) (.*)$", "^[#]([Uu]nban)$", "^[#]([Ii]d)$", "^!!tgservice (.+)$" }, run = run, pre_process = pre_process }
gpl-2.0
shingenko/darkstar
scripts/zones/Uleguerand_Range/npcs/HomePoint#1.lua
19
1189
----------------------------------- -- Area: Uleguerand_Range -- NPC: HomePoint#1 -- @pos ----------------------------------- package.loaded["scripts/zones/Uleguerand_Range/TextIDs"] = nil; require("scripts/globals/settings"); require("scripts/zones/Uleguerand_Range/TextIDs"); require("scripts/globals/homepoint"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) homepointMenu( player, 0x21fc, 76); end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); if (csid == 0x21fc) then if (option == 1) then player:setHomePoint(); player:messageSpecial(HOMEPOINT_SET); else hpTeleport( player, option); end end end;
gpl-3.0
shingenko/darkstar
scripts/zones/RoMaeve/Zone.lua
16
2428
----------------------------------- -- -- Zone: RoMaeve (122) -- ----------------------------------- package.loaded["scripts/zones/RoMaeve/TextIDs"] = nil; ----------------------------------- require("scripts/globals/settings"); require("scripts/zones/RoMaeve/TextIDs"); require("scripts/globals/zone"); ----------------------------------- -- onInitialize ----------------------------------- function onInitialize(zone) local manuals = {17277227,17277228}; SetFieldManual(manuals); end; ----------------------------------- -- onConquestUpdate ----------------------------------- function onConquestUpdate(zone, updatetype) local players = zone:getPlayers(); for name, player in pairs(players) do conquestUpdate(zone, player, updatetype, CONQUEST_BASE); end end; ----------------------------------- -- onZoneIn ----------------------------------- function onZoneIn(player,prevZone) local cs = -1; if ((player:getXPos() == 0) and (player:getYPos() == 0) and (player:getZPos() == 0)) then player:setPos(-0.008,-33.595,123.478,62); end if (player:getCurrentMission(WINDURST) == VAIN and player:getVar("MissionStatus") ==1) then cs = 0x0003; -- doll telling "you're in the right area" end return cs; end; ----------------------------------- -- onRegionEnter ----------------------------------- function onRegionEnter(player,region) end; ----------------------------------- -- onGameDay ----------------------------------- function onGameDay() -- Moongates local Moongate_Offset = 17277195; -- _3e0 in npc_list local direction = VanadielMoonDirection(); local phase = VanadielMoonPhase(); if (((direction == 2 and phase >= 90) or (direction == 1 and phase >= 95)) and GetNPCByID(Moongate_Offset):getWeather() == 0) then GetNPCByID(Moongate_Offset):openDoor(432); GetNPCByID(Moongate_Offset+1):openDoor(432); end end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); end;
gpl-3.0
yuin/silkylog
themes/default/theme.lua
1
1197
config { extra_files = { {src = "css/*", dst = "statics/css/", template = false}, {src = "js/*", dst = "statics/js/", template = false}, {src = "img/*", dst = "statics/img/", template = false} } } about_this_site = [[ <div> <p><i class="icon-male"></i> Author: Your Name</p> <p>Your profile</p> </div> ]] find_me_on = [[ <ul class="icons-ul"> <li style="margin-bottom: 0.5em;"><i class="icon-li icon-large icon-github"></i><a href="https://github.com/example">GitHub</a></li> </ul> ]] function seealso(art, tags) local buf = {"<ul><h3>See Also</h3>"} local seen = {} seen[art.permlink_path] = 1 local i = 0 for j, tag in ipairs(art.tags or {}) do for k, article in ipairs(tags[tag] or {}) do if seen[article.permlink_path] == nil then table.insert(buf, string.format("<li><a href=\"%s\">%s</a></li>", article.permlink_path, silkylog.htmlescape(article.title))) seen[article.permlink_path] = 1 i = i + 1 if i > 4 then break end end end if i > 4 then break end end table.insert(buf, "</ul>") if i == 0 then return "" end return table.concat(buf, "\n") end
mit
rosejn/lua-fn
fn/init.lua
2
6175
require('util') -- Short-hand operator functions for use in map, filter, reduce... fn = { mod = math.mod; pow = math.pow; add = function(n,m) return n + m end; sub = function(n,m) return n - m end; mul = function(n,m) return n * m end; div = function(n,m) return n / m end; gt = function(n,m) return m > n end; lt = function(n,m) return m < n end; eq = function(n,m) return n == m end; le = function(n,m) return n <= m end; ge = function(n,m) return n >= m end; ne = function(n,m) return n ~= m end; } function fn.inc(v) return v + 1 end function fn.dec(v) return v - 1 end function fn.id(v) return v end function fn.const(x) return function() return x end end ------------------------------------------------------------ -- Treating tables as sequences ----------------------------------------------------------- -- Returns the size of a table function fn.count(tbl) return #tbl end -- Predicate test if a table is empty function fn.is_empty(tbl) return #tbl == 0 end -- Append an element onto the end of a table function fn.append(tbl, val) table.insert(tbl, val) return tbl end -- Returns the first element of a table function fn.first(tbl) return tbl[1] end -- Returns the second element of a table function fn.second(tbl) return tbl[2] end -- Get the last element of a table function fn.last(tbl) return tbl[#tbl] end -- Returns a new table with everything but the first element of a table, -- or nil if the table is empty. function fn.rest(tbl) if fn.is_empty(tbl) then return nil else local new_array = {} for i = 2, #tbl do table.insert(new_array, tbl[i]) end return new_array end end -- Returns a new table containing the first n elements of tbl function fn.take(n, tbl) local new_tbl = {} for i=1, n do fn.append(new_tbl, tbl[i]) end return new_tbl end -- Returns a new table without the first n elements of tbl function fn.drop(n, tbl) local new_tbl = {} for i=n+1, #tbl do fn.append(new_tbl, tbl[i]) end return new_tbl end ------------------------------------------------------------ -- Making use of functions ----------------------------------------------------------- -- is(checker_function, expected_value) -- @brief -- check function generator. return the function to return boolean, -- if the condition was expected then true, else false. Helpful -- for filtering and other functions that take a predicate. -- @example -- local is_table = fn.is(type, "table") -- local is_even = fn.is(fn.partial(math.mod, 2), 1) -- local is_odd = fn.is(fn.partial(math.mod, 2), 0) function fn.is(check, expected) return function (...) if (check(unpack(...)) == expected) then return true else return false end end end -- comp(f,g) -- Returns a function that is the composition of functions f and g: f(g(...)) -- e.g: printf = comp(io.write, string.format) -- -> function(...) return io.write(string.format(unpack(arg))) end function fn.comp(f,g) return function (...) return f(g(...)) end end -- partial(f, args) -- Returns a new function, which will call f with args and any additional -- arguments passed to the new function. function fn.partial(f, ...) local pargs = {...} return function(...) local args = {} for _,v in ipairs(pargs) do fn.append(args, v) end for _,v in ipairs({...}) do fn.append(args, v) end return f(unpack(args)) end end -- thread(value, f, ...) function fn.thread(val, ...) local functions = {...} for _, fun in ipairs(functions) do val = fun(val) end return val end --[[ apply(f, args..., tbl) Call function f, passing args as the arguments, with the values in tbl appended to the argument list. e.g. function compute(m, x, b) return m * x + b end -- apply a list of args to a function fn.apply(compute, {2, 3, 4}) -- prepend some args to the list that is applied fn.apply(compute, 2, {3, 4}) fn.apply(compute, 2, 3, {4}) ]] function fn.apply(f, ...) local pargs = {} local args = {...} if #args > 1 then for i=1, (#args - 1) do fn.append(pargs, args[i]) end end local full_args = util.concat(pargs, args[#args]) return f(unpack(full_args)) end -- map(function, table) -- e.g: map(double, {1,2,3}) -> {2,4,6} function fn.map(func, tbl) local newtbl = {} for i,v in pairs(tbl) do newtbl[i] = func(v) end return newtbl end -- filter(function, table) -- e.g: filter(is_even, {1,2,3,4}) -> {2,4} function fn.filter(func, tbl) local newtbl= {} for i,v in ipairs(tbl) do if func(v) then fn.append(newtbl, v) end end return newtbl end -- reduce(function, init_val, table) -- e.g: -- reduce(fn.mul, 1, {1,2,3,4,5}) -> 120 -- reduce(fn.add, 0, {1,2,3,4}) -> 10 function fn.reduce(func, val, tbl) for _,v in pairs(tbl) do val = func(val, v) end return val end -- Returns a map with keys mapped to corresponding vals. -- e.g. -- zipmap({1,2,3}, {'a', 'b', 'c'}) -- => {1 = 'a', 2 = 'b', 3 = 'c'} function fn.zipmap(keys, vals) local m = {} for i, key in ipairs(keys) do m[key] = vals[i] end return m end -- zip(table, table) -- e.g. -- zip({1,2,3}, {'a', 'b', 'c'}) -> {{1,'a'}, {2,'b'}, {3,'c'}} -- zip({1,2,3}, {'a', 'b', 'c', 'd'}) -> {{1,'a'}, {2,'b'}, {3,'c'}} function fn.zip(tbl_a, tbl_b) local len = math.min(#tbl_a, #tbl_b) local newtbl = {} for i = 1,len do table.insert(newtbl, {tbl_a[i], tbl_b[i]}) end return newtbl end -- zip_with(function, table, table) -- e.g.: -- zip_with(fn.add, {1,2,3}, {1,2,3}) -> {2,4,6} -- zip_with(fn.add, {1,2,3}, {1,2,3,4}) -> {2,4,6} function fn.zip_with(func, tbl_a, tbl_b) return fn.map(function(x) return func(unpack(x)) end, fn.zip(tbl_a, tbl_b)) end
bsd-3-clause
mrvigeo/salib2
plugins/banhammer.lua
7
11698
local function pre_process(msg) -- SERVICE MESSAGE if msg.action and msg.action.type then local action = msg.action.type -- Check if banned user joins chat by link if action == 'chat_add_user_link' then local user_id = msg.from.id print('Checking invited user '..user_id) local banned = is_banned(user_id, msg.to.id) if banned or is_gbanned(user_id) then -- Check it with redis print('User is banned!') local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] is banned and kicked ! ")-- Save to logs kick_user(user_id, msg.to.id) end end -- Check if banned user joins chat if action == 'chat_add_user' then local user_id = msg.action.user.id print('Checking invited user '..user_id) local banned = is_banned(user_id, msg.to.id) if banned or is_gbanned(user_id) then -- Check it with redis print('User is banned!') local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] added a banned user >"..msg.action.user.id)-- Save to logs kick_user(user_id, msg.to.id) local banhash = 'addedbanuser:'..msg.to.id..':'..msg.from.id redis:incr(banhash) local banhash = 'addedbanuser:'..msg.to.id..':'..msg.from.id local banaddredis = redis:get(banhash) if banaddredis then if tonumber(banaddredis) == 4 and not is_owner(msg) then kick_user(msg.from.id, msg.to.id)-- Kick user who adds ban ppl more than 3 times end if tonumber(banaddredis) == 8 and not is_owner(msg) then ban_user(msg.from.id, msg.to.id)-- Kick user who adds ban ppl more than 7 times local banhash = 'addedbanuser:'..msg.to.id..':'..msg.from.id redis:set(banhash, 0)-- Reset the Counter end end end if data[tostring(msg.to.id)] then if data[tostring(msg.to.id)]['settings'] then if data[tostring(msg.to.id)]['settings']['lock_bots'] then bots_protection = data[tostring(msg.to.id)]['settings']['lock_bots'] end end end if msg.action.user.username ~= nil then if string.sub(msg.action.user.username:lower(), -3) == 'bot' and not is_momod(msg) and bots_protection == "yes" then --- Will kick bots added by normal users local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] added a bot > @".. msg.action.user.username)-- Save to logs kick_user(msg.action.user.id, msg.to.id) end end end -- No further checks return msg end -- banned user is talking ! if msg.to.type == 'chat' then local data = load_data(_config.moderation.data) local group = msg.to.id local texttext = 'groups' --if not data[tostring(texttext)][tostring(msg.to.id)] and not is_realm(msg) then -- Check if this group is one of my groups or not --chat_del_user('chat#id'..msg.to.id,'user#id'..our_id,ok_cb,false) --return --end local user_id = msg.from.id local chat_id = msg.to.id local banned = is_banned(user_id, chat_id) if banned or is_gbanned(user_id) then -- Check it with redis print('Banned user talking!') local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] banned user is talking !")-- Save to logs kick_user(user_id, chat_id) msg.text = '' end end return msg end local function kick_ban_res(extra, success, result) --vardump(result) --vardump(extra) local member_id = result.id local user_id = member_id local member = result.username local chat_id = extra.chat_id local from_id = extra.from_id local get_cmd = extra.get_cmd local receiver = "chat#id"..chat_id if get_cmd == "kick" then if member_id == from_id then return send_large_msg(receiver, "تو نمیتونی خودتو کیک کنی") end if is_momod2(member_id, chat_id) and not is_admin2(sender) then return send_large_msg(receiver, "من نمیتونم ادمینو کاریش کنم") end return kick_user(member_id, chat_id) elseif get_cmd == 'ban' then if is_momod2(member_id, chat_id) and not is_admin2(sender) then return send_large_msg(receiver, "نمیتونم ادمینو کاریش کنم") end send_large_msg(receiver, 'User @'..member..' ['..member_id..'] banned') return ban_user(member_id, chat_id) elseif get_cmd == 'unban' then send_large_msg(receiver, 'User @'..member..' ['..member_id..'] unbanned') local hash = 'banned:'..chat_id redis:srem(hash, member_id) return 'User '..user_id..' unbanned' elseif get_cmd == 'banall' then send_large_msg(receiver, 'User @'..member..' ['..member_id..'] از همه گروه ها بن شد') return banall_user(member_id, chat_id) elseif get_cmd == 'unbanall' then send_large_msg(receiver, 'User @'..member..' ['..member_id..'] از بن همه گروه ها خارج شد') return unbanall_user(member_id, chat_id) end end local function run(msg, matches) if matches[1]:lower() == 'id' then if msg.to.type == "user" then return "Bot ID: "..msg.to.id.. "\n\nYour ID: "..msg.from.id end if type(msg.reply_id) ~= "nil" then local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] used /id ") id = get_message(msg.reply_id,get_message_callback_id, false) elseif matches[1]:lower() == 'id' then local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] used /id ") return "Group ID for " ..string.gsub(msg.to.print_name, "_", " ").. ":\n\n"..msg.to.id end end if matches[1]:lower() == 'kickme' then-- /kickme local receiver = get_receiver(msg) if msg.to.type == 'chat' then local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] left using kickme ")-- Save to logs chat_del_user("chat#id"..msg.to.id, "user#id"..msg.from.id, ok_cb, false) end end if not is_momod(msg) then -- Ignore normal users return end if matches[1]:lower() == "banlist" then -- Ban list ! local chat_id = msg.to.id if matches[2] and is_admin(msg) then chat_id = matches[2] end return ban_list(chat_id) end if matches[1]:lower() == 'ban' then-- /ban if type(msg.reply_id)~="nil" and is_momod(msg) then if is_admin(msg) then local msgr = get_message(msg.reply_id,ban_by_reply_admins, false) else msgr = get_message(msg.reply_id,ban_by_reply, false) end end local user_id = matches[2] local chat_id = msg.to.id if string.match(matches[2], '^%d+$') then if tonumber(matches[2]) == tonumber(our_id) then return end if not is_admin(msg) and is_momod2(matches[2], msg.to.id) then return "من نمیتونم ادمینو کاریش کنم" end if tonumber(matches[2]) == tonumber(msg.from.id) then return "تو نمیتونی خودتو بن کنی" end local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] baned user ".. matches[2]) ban_user(user_id, chat_id) else local cbres_extra = { chat_id = msg.to.id, get_cmd = 'ban', from_id = msg.from.id } local username = matches[2] local username = string.gsub(matches[2], '@', '') res_user(username, kick_ban_res, cbres_extra) end end if matches[1]:lower() == 'unban' then -- /unban if type(msg.reply_id)~="nil" and is_momod(msg) then local msgr = get_message(msg.reply_id,unban_by_reply, false) end local user_id = matches[2] local chat_id = msg.to.id local targetuser = matches[2] if string.match(targetuser, '^%d+$') then local user_id = targetuser local hash = 'banned:'..chat_id redis:srem(hash, user_id) local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] unbaned user ".. matches[2]) return 'کاربر '..user_id..' آنبن شد' else local cbres_extra = { chat_id = msg.to.id, get_cmd = 'unban', from_id = msg.from.id } local username = matches[2] local username = string.gsub(matches[2], '@', '') res_user(username, kick_ban_res, cbres_extra) end end if matches[1]:lower() == 'kick' then if type(msg.reply_id)~="nil" and is_momod(msg) then if is_admin(msg) then local msgr = get_message(msg.reply_id,Kick_by_reply_admins, false) else msgr = get_message(msg.reply_id,Kick_by_reply, false) end end if string.match(matches[2], '^%d+$') then if tonumber(matches[2]) == tonumber(our_id) then return end if not is_admin(msg) and is_momod2(matches[2], msg.to.id) then return "نمیتونم ادمینو کاریش کنم" end if tonumber(matches[2]) == tonumber(msg.from.id) then return "تو نمیتونی خودتو کیک کنی" end local user_id = matches[2] local chat_id = msg.to.id name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] kicked user ".. matches[2]) kick_user(user_id, chat_id) else local cbres_extra = { chat_id = msg.to.id, get_cmd = 'kick', from_id = msg.from.id } local username = matches[2] local username = string.gsub(matches[2], '@', '') res_user(username, kick_ban_res, cbres_extra) end end if not is_admin(msg) then return end if matches[1]:lower() == 'banall' then -- Global ban if type(msg.reply_id) ~="nil" and is_admin(msg) then return get_message(msg.reply_id,banall_by_reply, false) end local user_id = matches[2] local chat_id = msg.to.id local targetuser = matches[2] if string.match(targetuser, '^%d+$') then if tonumber(matches[2]) == tonumber(our_id) then return false end banall_user(targetuser) return 'کاربر ['..user_id..' ] سوپر بن شد' else local cbres_extra = { chat_id = msg.to.id, get_cmd = 'banall', from_id = msg.from.id } local username = matches[2] local username = string.gsub(matches[2], '@', '') res_user(username, kick_ban_res, cbres_extra) end end if matches[1]:lower() == 'unbanall' then -- Global unban local user_id = matches[2] local chat_id = msg.to.id if string.match(matches[2], '^%d+$') then if tonumber(matches[2]) == tonumber(our_id) then return false end unbanall_user(user_id) return 'کاربر ['..user_id..' ] از لیست سوپر بن ها حذف شد' else local cbres_extra = { chat_id = msg.to.id, get_cmd = 'unbanall', from_id = msg.from.id } local username = matches[2] local username = string.gsub(matches[2], '@', '') res_user(username, kick_ban_res, cbres_extra) end end if matches[1]:lower() == "gbanlist" then -- Global ban list return banall_list() end end return { patterns = { "^(banall) (.*)$", "^(banall)$", "^([Bb]anlist) (.*)$", "^([Bb]anlist)$", "^([Gg]banlist)$", "^([Bb]an) (.*)$", "^([Kk]ick)$", "^([Uu]nban) (.*)$", "^([Uu]nbanall) (.*)$", "^([Uu]nbanall)$", "^([Kk]ick) (.*)$", "^([Kk]ickme)$", "^([Bb]an)$", "^([Uu]nban)$", "^([Ii]d)$", "^!!tgservice (.+)$" }, run = run, pre_process = pre_process }
gpl-2.0
coronalabs/framework-widget
unitTestListing.lua
1
6859
-- Abstract: Widget test listing -- Code is MIT licensed; see https://www.coronalabs.com/links/code/license --------------------------------------------------------------------------------------- local widget = require( "widget" ) local composer = require( "composer" ) local scene = composer.newScene() local USE_IOS_THEME = false local USE_IOS7_THEME = false local USE_ANDROID_THEME = false local USE_ANDROID_HOLO_LIGHT_THEME = false local USE_ANDROID_HOLO_DARK_THEME = false local isGraphicsV1 = ( 1 == display.getDefault( "graphicsCompatibility" ) ) local topGrayColor = { 0.92, 0.92, 0.92, 1 } local separatorColor = { 0.77, 0.77, 0.77, 1 } local headerTextColor = { 0, 0, 0, 1 } if isGraphicsV1 then widget._convertColorToV1( topGrayColor ) widget._convertColorToV1( separatorColor ) widget._convertColorToV1( headerTextColor ) end function scene:create( event ) local group = self.view -- Set theme if USE_ANDROID_THEME then widget.setTheme( "widget_theme_android" ) end if USE_IOS_THEME then widget.setTheme( "widget_theme_ios" ) end if USE_IOS7_THEME then widget.setTheme( "widget_theme_ios7" ) end if USE_ANDROID_HOLO_LIGHT_THEME then widget.setTheme( "widget_theme_android_holo_light" ) end if USE_ANDROID_HOLO_DARK_THEME then widget.setTheme( "widget_theme_android_holo_dark" ) end local xAnchor, yAnchor if not isGraphicsV1 then xAnchor = display.contentCenterX yAnchor = display.contentCenterY else xAnchor = 0 yAnchor = 0 end local background = display.newRect( xAnchor, yAnchor, display.contentWidth, display.contentHeight ) if USE_IOS_THEME then if isGraphicsV1 then background:setFillColor( 197, 204, 212, 255 ) else background:setFillColor( 197/255, 204/255, 212/255, 1 ) end widget.USE_IOS_THEME = true elseif USE_ANDROID_HOLO_LIGHT_THEME then if isGraphicsV1 then background:setFillColor( 255, 255, 255, 255 ) else background:setFillColor( 1, 1, 1, 1 ) end widget.USE_ANDROID_HOLO_LIGHT_THEME = true elseif USE_ANDROID_HOLO_DARK_THEME then if isGraphicsV1 then background:setFillColor( 34, 34, 34, 255 ) else background:setFillColor( 34/255, 34/255, 34/255, 1 ) end widget.USE_ANDROID_HOLO_DARK_THEME = true headerTextColor = { 0.5 } else if isGraphicsV1 then background:setFillColor( 255, 255, 255, 255 ) else background:setFillColor( 1, 1, 1, 1 ) end end group:insert( background ) -- create some skinning variables local fontUsed = native.systemFont local headerTextSize = 20 local separatorColor = { unpack( separatorColor ) } local title = display.newText( group, "Select a unit test to view", 0, 0, fontUsed, headerTextSize ) title:setFillColor( unpack( headerTextColor ) ) title.x, title.y = display.contentCenterX, 20 group:insert( title ) if USE_IOS7_THEME then local separator = display.newRect( group, display.contentCenterX, title.contentHeight + title.y, display.contentWidth, 0.5 ) separator:setFillColor( unpack ( separatorColor ) ) end --Go to selected unit test local function gotoSelection( event ) local phase = event.phase if "ended" == phase then local targetScene = event.target.id composer.gotoScene( targetScene ) end return true end local buttonX = 160 -- spinner unit test local spinnerButton = widget.newButton { id = "spinner", x = buttonX, y = 75, label = "Spinner", width = 200, height = 34, emboss = false, onEvent = gotoSelection } group:insert( spinnerButton ) -- switch unit test local switchButton = widget.newButton { id = "switch", x = buttonX, y = spinnerButton.y + 36, label = "Switch", width = 200, height = 34, emboss = false, onEvent = gotoSelection } group:insert( switchButton ) -- Stepper unit test local stepperButton = widget.newButton { id = "stepper", x = buttonX, y = switchButton.y + 36, label = "Stepper", width = 200, height = 34, emboss = false, onEvent = gotoSelection } group:insert( stepperButton ) -- Search field unit test --[[ local searchFieldButton = widget.newButton { id = "searchField", x = buttonX, y = stepperButton.y + 36, label = "Search Field", width = 200, height = 34, emboss = false, onEvent = gotoSelection } group:insert( searchFieldButton ) --]] -- progressView unit test local progressViewButton = widget.newButton { id = "progressView", x = buttonX, y = stepperButton.y + 36, label = "ProgressView", width = 200, height = 34, emboss = false, onEvent = gotoSelection } group:insert( progressViewButton ) -- segmentedControl unit test local segmentedControlButton = widget.newButton { id = "segmentedControl", x = buttonX, y = progressViewButton.y + 36, label = "SegmentedControl", width = 200, height = 34, emboss = false, onEvent = gotoSelection } group:insert( segmentedControlButton ) -- button unit test local buttonButton = widget.newButton { id = "button", x = buttonX, y = segmentedControlButton.y + 36, label = "Button", width = 200, height = 34, emboss = false, onEvent = gotoSelection } group:insert( buttonButton ) -- tabBar unit test local tabBarButton = widget.newButton { id = "tabBar", x = buttonX, y = buttonButton.y + 36, label = "TabBar", width = 200, height = 34, emboss = false, onEvent = gotoSelection } group:insert( tabBarButton ) -- slider unit test local sliderButton = widget.newButton { id = "slider", x = buttonX, y = tabBarButton.y + 36, label = "Slider", width = 200, height = 34, emboss = false, onEvent = gotoSelection } group:insert( sliderButton ) -- picker unit test local pickerButton = widget.newButton { id = "picker", x = buttonX, y = sliderButton.y + 36, label = "PickerWheel", width = 200, height = 34, emboss = false, onEvent = gotoSelection } group:insert( pickerButton ) -- tableView unit test local tableViewButton = widget.newButton { id = "tableView", x = buttonX, y = pickerButton.y + 36, label = "TableView", width = 200, height = 34, emboss = false, onEvent = gotoSelection } group:insert( tableViewButton ) -- scrollView unit test local scrollViewButton = widget.newButton { id = "scrollView", x = buttonX, y = tableViewButton.y + 36, label = "ScrollView", width = 200, height = 34, emboss = false, onEvent = gotoSelection } group:insert( scrollViewButton ) end function scene:hide( event ) if ( "did" == event.phase ) then composer.removeHidden( false ) end end scene:addEventListener( "create", scene ) scene:addEventListener( "hide", scene ) return scene
mit
luadch/luadch
scripts/cmd_slots.lua
1
2191
--[[ cmd_slots.lua by pulsar usage: [+!#]slots v0.1: - this script shows all users with free slots ]]-- -------------- --[SETTINGS]-- -------------- local scriptname = "cmd_slots" local scriptversion = "0.1" local cmd = "slots" local minlevel = cfg.get "cmd_slots_minlevel" ---------- --[CODE]-- ---------- --// table lookups local utf_match = utf.match local utf_format = utf.format local hub_getbot = hub.getbot() local hub_getusers = hub.getusers local hub_import = hub.import local hub_debug = hub.debug --// imports local help, ucmd, hubcmd --// msgs local scriptlang = cfg.get( "language" ) local lang, err = cfg.loadlanguage( scriptlang, scriptname ); lang = lang or {}; err = err and hub.debug( err ) local help_title = lang.help_title or "Slots" local help_usage = lang.help_usage or "[+!#]slots" local help_desc = lang.help_desc or "shows users with free slots" local ucmd_menu = lang.ucmd_menu or { "User", "Free Slots" } local msg_out = lang.msg_out or [[ === FREE SLOTS ==================== %s ==================== FREE SLOTS === ]] local onbmsg = function( user ) local tbl = {} for sid, user in pairs( hub_getusers() ) do if not user:isbot() then local nick = user:nick() local slots = user:slots() if slots > 0 then tbl[ #tbl + 1 ] = " " .. nick .. " | " .. slots .. "\n" end end end tbl = table.concat( tbl ) local msg = utf_format( msg_out, tbl ) user:reply( msg, hub_getbot ) return PROCESSED end hub.setlistener( "onStart", { }, function( ) help = hub_import( "cmd_help" ) ucmd = hub_import( "etc_usercommands" ) hubcmd = hub_import( "etc_hubcommands" ) if help then help.reg( help_title, help_usage, help_desc, minlevel ) end if ucmd then ucmd.add( ucmd_menu, cmd, {}, { "CT1" }, minlevel ) end assert( hubcmd ) assert( hubcmd.add( cmd, onbmsg ) ) return nil end ) hub_debug( "** Loaded " .. scriptname .. " " .. scriptversion .. " **" )
gpl-3.0
mohammadtofani/seedmn
plugins/banhammer.lua
34
11497
local function pre_process(msg) -- SERVICE MESSAGE if msg.action and msg.action.type then local action = msg.action.type -- Check if banned user joins chat by link if action == 'chat_add_user_link' then local user_id = msg.from.id print('Checking invited user '..user_id) local banned = is_banned(user_id, msg.to.id) if banned or is_gbanned(user_id) then -- Check it with redis print('User is banned!') local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] is banned and kicked ! ")-- Save to logs kick_user(user_id, msg.to.id) end end -- Check if banned user joins chat if action == 'chat_add_user' then local user_id = msg.action.user.id print('Checking invited user '..user_id) local banned = is_banned(user_id, msg.to.id) if banned or is_gbanned(user_id) then -- Check it with redis print('User is banned!') local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] added a banned user >"..msg.action.user.id)-- Save to logs kick_user(user_id, msg.to.id) local banhash = 'addedbanuser:'..msg.to.id..':'..msg.from.id redis:incr(banhash) local banhash = 'addedbanuser:'..msg.to.id..':'..msg.from.id local banaddredis = redis:get(banhash) if banaddredis then if tonumber(banaddredis) == 4 and not is_owner(msg) then kick_user(msg.from.id, msg.to.id)-- Kick user who adds ban ppl more than 3 times end if tonumber(banaddredis) == 8 and not is_owner(msg) then ban_user(msg.from.id, msg.to.id)-- Kick user who adds ban ppl more than 7 times local banhash = 'addedbanuser:'..msg.to.id..':'..msg.from.id redis:set(banhash, 0)-- Reset the Counter end end end if data[tostring(msg.to.id)] then if data[tostring(msg.to.id)]['settings'] then if data[tostring(msg.to.id)]['settings']['lock_bots'] then bots_protection = data[tostring(msg.to.id)]['settings']['lock_bots'] end end end if msg.action.user.username ~= nil then if string.sub(msg.action.user.username:lower(), -3) == 'bot' and not is_momod(msg) and bots_protection == "yes" then --- Will kick bots added by normal users local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] added a bot > @".. msg.action.user.username)-- Save to logs kick_user(msg.action.user.id, msg.to.id) end end end -- No further checks return msg end -- banned user is talking ! if msg.to.type == 'chat' then local data = load_data(_config.moderation.data) local group = msg.to.id local texttext = 'groups' --if not data[tostring(texttext)][tostring(msg.to.id)] and not is_realm(msg) then -- Check if this group is one of my groups or not --chat_del_user('chat#id'..msg.to.id,'user#id'..our_id,ok_cb,false) --return --end local user_id = msg.from.id local chat_id = msg.to.id local banned = is_banned(user_id, chat_id) if banned or is_gbanned(user_id) then -- Check it with redis print('Banned user talking!') local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] banned user is talking !")-- Save to logs kick_user(user_id, chat_id) msg.text = '' end end return msg end local function kick_ban_res(extra, success, result) --vardump(result) --vardump(extra) local member_id = result.id local user_id = member_id local member = result.username local chat_id = extra.chat_id local from_id = extra.from_id local get_cmd = extra.get_cmd local receiver = "chat#id"..chat_id if get_cmd == "kick" then if member_id == from_id then return send_large_msg(receiver, "You can't kick yourself") end if is_momod2(member_id, chat_id) and not is_admin2(sender) then return send_large_msg(receiver, "You can't kick mods/owner/admins") end return kick_user(member_id, chat_id) elseif get_cmd == 'ban' then if is_momod2(member_id, chat_id) and not is_admin2(sender) then return send_large_msg(receiver, "You can't ban mods/owner/admins") end send_large_msg(receiver, 'User @'..member..' ['..member_id..'] banned') return ban_user(member_id, chat_id) elseif get_cmd == 'unban' then send_large_msg(receiver, 'User @'..member..' ['..member_id..'] unbanned') local hash = 'banned:'..chat_id redis:srem(hash, member_id) return 'User '..user_id..' unbanned' elseif get_cmd == 'banall' then send_large_msg(receiver, 'User @'..member..' ['..member_id..'] globally banned') return banall_user(member_id, chat_id) elseif get_cmd == 'unbanall' then send_large_msg(receiver, 'User @'..member..' ['..member_id..'] un-globally banned') return unbanall_user(member_id, chat_id) end end local function run(msg, matches) if matches[1]:lower() == 'id' then if msg.to.type == "user" then return "Bot ID: "..msg.to.id.. "\n\nYour ID: "..msg.from.id end if type(msg.reply_id) ~= "nil" then local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] used /id ") id = get_message(msg.reply_id,get_message_callback_id, false) elseif matches[1]:lower() == 'id' then local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] used /id ") return "Group ID for " ..string.gsub(msg.to.print_name, "_", " ").. ":\n\n"..msg.to.id end end if matches[1]:lower() == 'kickme' then-- /kickme local receiver = get_receiver(msg) if msg.to.type == 'chat' then local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] left using kickme ")-- Save to logs chat_del_user("chat#id"..msg.to.id, "user#id"..msg.from.id, ok_cb, false) end end if not is_momod(msg) then -- Ignore normal users return end if matches[1]:lower() == "banlist" then -- Ban list ! local chat_id = msg.to.id if matches[2] and is_admin(msg) then chat_id = matches[2] end return ban_list(chat_id) end if matches[1]:lower() == 'ban' then-- /ban if type(msg.reply_id)~="nil" and is_momod(msg) then if is_admin(msg) then local msgr = get_message(msg.reply_id,ban_by_reply_admins, false) else msgr = get_message(msg.reply_id,ban_by_reply, false) end end local user_id = matches[2] local chat_id = msg.to.id if string.match(matches[2], '^%d+$') then if tonumber(matches[2]) == tonumber(our_id) then return end if not is_admin(msg) and is_momod2(matches[2], msg.to.id) then return "you can't ban mods/owner/admins" end if tonumber(matches[2]) == tonumber(msg.from.id) then return "You can't ban your self !" end local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] baned user ".. matches[2]) ban_user(user_id, chat_id) else local cbres_extra = { chat_id = msg.to.id, get_cmd = 'ban', from_id = msg.from.id } local username = matches[2] local username = string.gsub(matches[2], '@', '') res_user(username, kick_ban_res, cbres_extra) end end if matches[1]:lower() == 'unban' then -- /unban if type(msg.reply_id)~="nil" and is_momod(msg) then local msgr = get_message(msg.reply_id,unban_by_reply, false) end local user_id = matches[2] local chat_id = msg.to.id local targetuser = matches[2] if string.match(targetuser, '^%d+$') then local user_id = targetuser local hash = 'banned:'..chat_id redis:srem(hash, user_id) local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] unbaned user ".. matches[2]) return 'User '..user_id..' unbanned' else local cbres_extra = { chat_id = msg.to.id, get_cmd = 'unban', from_id = msg.from.id } local username = matches[2] local username = string.gsub(matches[2], '@', '') res_user(username, kick_ban_res, cbres_extra) end end if matches[1]:lower() == 'kick' then if type(msg.reply_id)~="nil" and is_momod(msg) then if is_admin(msg) then local msgr = get_message(msg.reply_id,Kick_by_reply_admins, false) else msgr = get_message(msg.reply_id,Kick_by_reply, false) end end if string.match(matches[2], '^%d+$') then if tonumber(matches[2]) == tonumber(our_id) then return end if not is_admin(msg) and is_momod2(matches[2], msg.to.id) then return "you can't kick mods/owner/admins" end if tonumber(matches[2]) == tonumber(msg.from.id) then return "You can't kick your self !" end local user_id = matches[2] local chat_id = msg.to.id name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] kicked user ".. matches[2]) kick_user(user_id, chat_id) else local cbres_extra = { chat_id = msg.to.id, get_cmd = 'kick', from_id = msg.from.id } local username = matches[2] local username = string.gsub(matches[2], '@', '') res_user(username, kick_ban_res, cbres_extra) end end if not is_admin(msg) then return end if matches[1]:lower() == 'banall' then -- Global ban if type(msg.reply_id) ~="nil" and is_admin(msg) then return get_message(msg.reply_id,banall_by_reply, false) end local user_id = matches[2] local chat_id = msg.to.id local targetuser = matches[2] if string.match(targetuser, '^%d+$') then if tonumber(matches[2]) == tonumber(our_id) then return false end banall_user(targetuser) return 'User ['..user_id..' ] globally banned' else local cbres_extra = { chat_id = msg.to.id, get_cmd = 'banall', from_id = msg.from.id } local username = matches[2] local username = string.gsub(matches[2], '@', '') res_user(username, kick_ban_res, cbres_extra) end end if matches[1]:lower() == 'unbanall' then -- Global unban local user_id = matches[2] local chat_id = msg.to.id if string.match(matches[2], '^%d+$') then if tonumber(matches[2]) == tonumber(our_id) then return false end unbanall_user(user_id) return 'User ['..user_id..' ] removed from global ban list' else local cbres_extra = { chat_id = msg.to.id, get_cmd = 'unbanall', from_id = msg.from.id } local username = matches[2] local username = string.gsub(matches[2], '@', '') res_user(username, kick_ban_res, cbres_extra) end end if matches[1]:lower() == "gbanlist" then -- Global ban list return banall_list() end end return { patterns = { "^([Bb]anall) (.*)$", "^([Bb]anall)$", "^([Bb]anlist) (.*)$", "^([Bb]anlist)$", "^([Gg]banlist)$", "^([Bb]an) (.*)$", "^([Kk]ick)$", "^([Uu]nban) (.*)$", "^([Uu]nbanall) (.*)$", "^([Uu]nbanall)$", "^([Kk]ick) (.*)$", "^([Kk]ickme)$", "^([Bb]an)$", "^([Uu]nban)$", "^([Ii]d)$", "^!!tgservice (.+)$" }, run = run, pre_process = pre_process }
gpl-2.0
RuiChen1113/luci
modules/luci-base/luasrc/tools/webadmin.lua
59
2301
-- Copyright 2008 Steven Barth <steven@midlink.org> -- Copyright 2008-2015 Jo-Philipp Wich <jow@openwrt.org> -- Licensed to the public under the Apache License 2.0. module("luci.tools.webadmin", package.seeall) local util = require "luci.util" local uci = require "luci.model.uci" local ip = require "luci.ip" function byte_format(byte) local suff = {"B", "KB", "MB", "GB", "TB"} for i=1, 5 do if byte > 1024 and i < 5 then byte = byte / 1024 else return string.format("%.2f %s", byte, suff[i]) end end end function date_format(secs) local suff = {"min", "h", "d"} local mins = 0 local hour = 0 local days = 0 secs = math.floor(secs) if secs > 60 then mins = math.floor(secs / 60) secs = secs % 60 end if mins > 60 then hour = math.floor(mins / 60) mins = mins % 60 end if hour > 24 then days = math.floor(hour / 24) hour = hour % 24 end if days > 0 then return string.format("%.0fd %02.0fh %02.0fmin %02.0fs", days, hour, mins, secs) else return string.format("%02.0fh %02.0fmin %02.0fs", hour, mins, secs) end end function cbi_add_networks(field) uci.cursor():foreach("network", "interface", function (section) if section[".name"] ~= "loopback" then field:value(section[".name"]) end end ) field.titleref = luci.dispatcher.build_url("admin", "network", "network") end function cbi_add_knownips(field) local _, n for _, n in ipairs(ip.neighbors({ family = 4 })) do if n.dest then field:value(n.dest:string()) end end end function firewall_find_zone(name) local find luci.model.uci.cursor():foreach("firewall", "zone", function (section) if section.name == name then find = section[".name"] end end ) return find end function iface_get_network(iface) local link = ip.link(tostring(iface)) if link.master then iface = link.master end local cur = uci.cursor() local dump = util.ubus("network.interface", "dump", { }) if dump then local _, net for _, net in ipairs(dump.interface) do if net.l3_device == iface or net.device == iface then -- cross check with uci to filter out @name style aliases local uciname = cur:get("network", net.interface, "ifname") if not uciname or uciname:sub(1, 1) ~= "@" then return net.interface end end end end end
apache-2.0
zhukunqian/slua-1
build/luajit-2.1.0/src/jit/dis_x86.lua
61
29376
---------------------------------------------------------------------------- -- LuaJIT x86/x64 disassembler module. -- -- Copyright (C) 2005-2015 Mike Pall. All rights reserved. -- Released under the MIT license. See Copyright Notice in luajit.h ---------------------------------------------------------------------------- -- This is a helper module used by the LuaJIT machine code dumper module. -- -- Sending small code snippets to an external disassembler and mixing the -- output with our own stuff was too fragile. So I had to bite the bullet -- and write yet another x86 disassembler. Oh well ... -- -- The output format is very similar to what ndisasm generates. But it has -- been developed independently by looking at the opcode tables from the -- Intel and AMD manuals. The supported instruction set is quite extensive -- and reflects what a current generation Intel or AMD CPU implements in -- 32 bit and 64 bit mode. Yes, this includes MMX, SSE, SSE2, SSE3, SSSE3, -- SSE4.1, SSE4.2, SSE4a and even privileged and hypervisor (VMX/SVM) -- instructions. -- -- Notes: -- * The (useless) a16 prefix, 3DNow and pre-586 opcodes are unsupported. -- * No attempt at optimization has been made -- it's fast enough for my needs. -- * The public API may change when more architectures are added. ------------------------------------------------------------------------------ local type = type local sub, byte, format = string.sub, string.byte, string.format local match, gmatch, gsub = string.match, string.gmatch, string.gsub local lower, rep = string.lower, string.rep local bit = require("bit") local tohex = bit.tohex -- Map for 1st opcode byte in 32 bit mode. Ugly? Well ... read on. local map_opc1_32 = { --0x [0]="addBmr","addVmr","addBrm","addVrm","addBai","addVai","push es","pop es", "orBmr","orVmr","orBrm","orVrm","orBai","orVai","push cs","opc2*", --1x "adcBmr","adcVmr","adcBrm","adcVrm","adcBai","adcVai","push ss","pop ss", "sbbBmr","sbbVmr","sbbBrm","sbbVrm","sbbBai","sbbVai","push ds","pop ds", --2x "andBmr","andVmr","andBrm","andVrm","andBai","andVai","es:seg","daa", "subBmr","subVmr","subBrm","subVrm","subBai","subVai","cs:seg","das", --3x "xorBmr","xorVmr","xorBrm","xorVrm","xorBai","xorVai","ss:seg","aaa", "cmpBmr","cmpVmr","cmpBrm","cmpVrm","cmpBai","cmpVai","ds:seg","aas", --4x "incVR","incVR","incVR","incVR","incVR","incVR","incVR","incVR", "decVR","decVR","decVR","decVR","decVR","decVR","decVR","decVR", --5x "pushUR","pushUR","pushUR","pushUR","pushUR","pushUR","pushUR","pushUR", "popUR","popUR","popUR","popUR","popUR","popUR","popUR","popUR", --6x "sz*pushaw,pusha","sz*popaw,popa","boundVrm","arplWmr", "fs:seg","gs:seg","o16:","a16", "pushUi","imulVrmi","pushBs","imulVrms", "insb","insVS","outsb","outsVS", --7x "joBj","jnoBj","jbBj","jnbBj","jzBj","jnzBj","jbeBj","jaBj", "jsBj","jnsBj","jpeBj","jpoBj","jlBj","jgeBj","jleBj","jgBj", --8x "arith!Bmi","arith!Vmi","arith!Bmi","arith!Vms", "testBmr","testVmr","xchgBrm","xchgVrm", "movBmr","movVmr","movBrm","movVrm", "movVmg","leaVrm","movWgm","popUm", --9x "nop*xchgVaR|pause|xchgWaR|repne nop","xchgVaR","xchgVaR","xchgVaR", "xchgVaR","xchgVaR","xchgVaR","xchgVaR", "sz*cbw,cwde,cdqe","sz*cwd,cdq,cqo","call farViw","wait", "sz*pushfw,pushf","sz*popfw,popf","sahf","lahf", --Ax "movBao","movVao","movBoa","movVoa", "movsb","movsVS","cmpsb","cmpsVS", "testBai","testVai","stosb","stosVS", "lodsb","lodsVS","scasb","scasVS", --Bx "movBRi","movBRi","movBRi","movBRi","movBRi","movBRi","movBRi","movBRi", "movVRI","movVRI","movVRI","movVRI","movVRI","movVRI","movVRI","movVRI", --Cx "shift!Bmu","shift!Vmu","retBw","ret","$lesVrm","$ldsVrm","movBmi","movVmi", "enterBwu","leave","retfBw","retf","int3","intBu","into","iretVS", --Dx "shift!Bm1","shift!Vm1","shift!Bmc","shift!Vmc","aamBu","aadBu","salc","xlatb", "fp*0","fp*1","fp*2","fp*3","fp*4","fp*5","fp*6","fp*7", --Ex "loopneBj","loopeBj","loopBj","sz*jcxzBj,jecxzBj,jrcxzBj", "inBau","inVau","outBua","outVua", "callVj","jmpVj","jmp farViw","jmpBj","inBad","inVad","outBda","outVda", --Fx "lock:","int1","repne:rep","rep:","hlt","cmc","testb!Bm","testv!Vm", "clc","stc","cli","sti","cld","std","incb!Bm","incd!Vm", } assert(#map_opc1_32 == 255) -- Map for 1st opcode byte in 64 bit mode (overrides only). local map_opc1_64 = setmetatable({ [0x06]=false, [0x07]=false, [0x0e]=false, [0x16]=false, [0x17]=false, [0x1e]=false, [0x1f]=false, [0x27]=false, [0x2f]=false, [0x37]=false, [0x3f]=false, [0x60]=false, [0x61]=false, [0x62]=false, [0x63]="movsxdVrDmt", [0x67]="a32:", [0x40]="rex*", [0x41]="rex*b", [0x42]="rex*x", [0x43]="rex*xb", [0x44]="rex*r", [0x45]="rex*rb", [0x46]="rex*rx", [0x47]="rex*rxb", [0x48]="rex*w", [0x49]="rex*wb", [0x4a]="rex*wx", [0x4b]="rex*wxb", [0x4c]="rex*wr", [0x4d]="rex*wrb", [0x4e]="rex*wrx", [0x4f]="rex*wrxb", [0x82]=false, [0x9a]=false, [0xc4]=false, [0xc5]=false, [0xce]=false, [0xd4]=false, [0xd5]=false, [0xd6]=false, [0xea]=false, }, { __index = map_opc1_32 }) -- Map for 2nd opcode byte (0F xx). True CISC hell. Hey, I told you. -- Prefix dependent MMX/SSE opcodes: (none)|rep|o16|repne, -|F3|66|F2 local map_opc2 = { --0x [0]="sldt!Dmp","sgdt!Ump","larVrm","lslVrm",nil,"syscall","clts","sysret", "invd","wbinvd",nil,"ud1",nil,"$prefetch!Bm","femms","3dnowMrmu", --1x "movupsXrm|movssXrm|movupdXrm|movsdXrm", "movupsXmr|movssXmr|movupdXmr|movsdXmr", "movhlpsXrm$movlpsXrm|movsldupXrm|movlpdXrm|movddupXrm", "movlpsXmr||movlpdXmr", "unpcklpsXrm||unpcklpdXrm", "unpckhpsXrm||unpckhpdXrm", "movlhpsXrm$movhpsXrm|movshdupXrm|movhpdXrm", "movhpsXmr||movhpdXmr", "$prefetcht!Bm","hintnopVm","hintnopVm","hintnopVm", "hintnopVm","hintnopVm","hintnopVm","hintnopVm", --2x "movUmx$","movUmy$","movUxm$","movUym$","movUmz$",nil,"movUzm$",nil, "movapsXrm||movapdXrm", "movapsXmr||movapdXmr", "cvtpi2psXrMm|cvtsi2ssXrVmt|cvtpi2pdXrMm|cvtsi2sdXrVmt", "movntpsXmr|movntssXmr|movntpdXmr|movntsdXmr", "cvttps2piMrXm|cvttss2siVrXm|cvttpd2piMrXm|cvttsd2siVrXm", "cvtps2piMrXm|cvtss2siVrXm|cvtpd2piMrXm|cvtsd2siVrXm", "ucomissXrm||ucomisdXrm", "comissXrm||comisdXrm", --3x "wrmsr","rdtsc","rdmsr","rdpmc","sysenter","sysexit",nil,"getsec", "opc3*38",nil,"opc3*3a",nil,nil,nil,nil,nil, --4x "cmovoVrm","cmovnoVrm","cmovbVrm","cmovnbVrm", "cmovzVrm","cmovnzVrm","cmovbeVrm","cmovaVrm", "cmovsVrm","cmovnsVrm","cmovpeVrm","cmovpoVrm", "cmovlVrm","cmovgeVrm","cmovleVrm","cmovgVrm", --5x "movmskpsVrXm$||movmskpdVrXm$","sqrtpsXrm|sqrtssXrm|sqrtpdXrm|sqrtsdXrm", "rsqrtpsXrm|rsqrtssXrm","rcppsXrm|rcpssXrm", "andpsXrm||andpdXrm","andnpsXrm||andnpdXrm", "orpsXrm||orpdXrm","xorpsXrm||xorpdXrm", "addpsXrm|addssXrm|addpdXrm|addsdXrm","mulpsXrm|mulssXrm|mulpdXrm|mulsdXrm", "cvtps2pdXrm|cvtss2sdXrm|cvtpd2psXrm|cvtsd2ssXrm", "cvtdq2psXrm|cvttps2dqXrm|cvtps2dqXrm", "subpsXrm|subssXrm|subpdXrm|subsdXrm","minpsXrm|minssXrm|minpdXrm|minsdXrm", "divpsXrm|divssXrm|divpdXrm|divsdXrm","maxpsXrm|maxssXrm|maxpdXrm|maxsdXrm", --6x "punpcklbwPrm","punpcklwdPrm","punpckldqPrm","packsswbPrm", "pcmpgtbPrm","pcmpgtwPrm","pcmpgtdPrm","packuswbPrm", "punpckhbwPrm","punpckhwdPrm","punpckhdqPrm","packssdwPrm", "||punpcklqdqXrm","||punpckhqdqXrm", "movPrVSm","movqMrm|movdquXrm|movdqaXrm", --7x "pshufwMrmu|pshufhwXrmu|pshufdXrmu|pshuflwXrmu","pshiftw!Pmu", "pshiftd!Pmu","pshiftq!Mmu||pshiftdq!Xmu", "pcmpeqbPrm","pcmpeqwPrm","pcmpeqdPrm","emms|", "vmreadUmr||extrqXmuu$|insertqXrmuu$","vmwriteUrm||extrqXrm$|insertqXrm$", nil,nil, "||haddpdXrm|haddpsXrm","||hsubpdXrm|hsubpsXrm", "movVSmMr|movqXrm|movVSmXr","movqMmr|movdquXmr|movdqaXmr", --8x "joVj","jnoVj","jbVj","jnbVj","jzVj","jnzVj","jbeVj","jaVj", "jsVj","jnsVj","jpeVj","jpoVj","jlVj","jgeVj","jleVj","jgVj", --9x "setoBm","setnoBm","setbBm","setnbBm","setzBm","setnzBm","setbeBm","setaBm", "setsBm","setnsBm","setpeBm","setpoBm","setlBm","setgeBm","setleBm","setgBm", --Ax "push fs","pop fs","cpuid","btVmr","shldVmru","shldVmrc",nil,nil, "push gs","pop gs","rsm","btsVmr","shrdVmru","shrdVmrc","fxsave!Dmp","imulVrm", --Bx "cmpxchgBmr","cmpxchgVmr","$lssVrm","btrVmr", "$lfsVrm","$lgsVrm","movzxVrBmt","movzxVrWmt", "|popcntVrm","ud2Dp","bt!Vmu","btcVmr", "bsfVrm","bsrVrm|lzcntVrm|bsrWrm","movsxVrBmt","movsxVrWmt", --Cx "xaddBmr","xaddVmr", "cmppsXrmu|cmpssXrmu|cmppdXrmu|cmpsdXrmu","$movntiVmr|", "pinsrwPrWmu","pextrwDrPmu", "shufpsXrmu||shufpdXrmu","$cmpxchg!Qmp", "bswapVR","bswapVR","bswapVR","bswapVR","bswapVR","bswapVR","bswapVR","bswapVR", --Dx "||addsubpdXrm|addsubpsXrm","psrlwPrm","psrldPrm","psrlqPrm", "paddqPrm","pmullwPrm", "|movq2dqXrMm|movqXmr|movdq2qMrXm$","pmovmskbVrMm||pmovmskbVrXm", "psubusbPrm","psubuswPrm","pminubPrm","pandPrm", "paddusbPrm","padduswPrm","pmaxubPrm","pandnPrm", --Ex "pavgbPrm","psrawPrm","psradPrm","pavgwPrm", "pmulhuwPrm","pmulhwPrm", "|cvtdq2pdXrm|cvttpd2dqXrm|cvtpd2dqXrm","$movntqMmr||$movntdqXmr", "psubsbPrm","psubswPrm","pminswPrm","porPrm", "paddsbPrm","paddswPrm","pmaxswPrm","pxorPrm", --Fx "|||lddquXrm","psllwPrm","pslldPrm","psllqPrm", "pmuludqPrm","pmaddwdPrm","psadbwPrm","maskmovqMrm||maskmovdquXrm$", "psubbPrm","psubwPrm","psubdPrm","psubqPrm", "paddbPrm","paddwPrm","padddPrm","ud", } assert(map_opc2[255] == "ud") -- Map for three-byte opcodes. Can't wait for their next invention. local map_opc3 = { ["38"] = { -- [66] 0f 38 xx --0x [0]="pshufbPrm","phaddwPrm","phadddPrm","phaddswPrm", "pmaddubswPrm","phsubwPrm","phsubdPrm","phsubswPrm", "psignbPrm","psignwPrm","psigndPrm","pmulhrswPrm", nil,nil,nil,nil, --1x "||pblendvbXrma",nil,nil,nil, "||blendvpsXrma","||blendvpdXrma",nil,"||ptestXrm", nil,nil,nil,nil, "pabsbPrm","pabswPrm","pabsdPrm",nil, --2x "||pmovsxbwXrm","||pmovsxbdXrm","||pmovsxbqXrm","||pmovsxwdXrm", "||pmovsxwqXrm","||pmovsxdqXrm",nil,nil, "||pmuldqXrm","||pcmpeqqXrm","||$movntdqaXrm","||packusdwXrm", nil,nil,nil,nil, --3x "||pmovzxbwXrm","||pmovzxbdXrm","||pmovzxbqXrm","||pmovzxwdXrm", "||pmovzxwqXrm","||pmovzxdqXrm",nil,"||pcmpgtqXrm", "||pminsbXrm","||pminsdXrm","||pminuwXrm","||pminudXrm", "||pmaxsbXrm","||pmaxsdXrm","||pmaxuwXrm","||pmaxudXrm", --4x "||pmulddXrm","||phminposuwXrm", --Fx [0xf0] = "|||crc32TrBmt",[0xf1] = "|||crc32TrVmt", }, ["3a"] = { -- [66] 0f 3a xx --0x [0x00]=nil,nil,nil,nil,nil,nil,nil,nil, "||roundpsXrmu","||roundpdXrmu","||roundssXrmu","||roundsdXrmu", "||blendpsXrmu","||blendpdXrmu","||pblendwXrmu","palignrPrmu", --1x nil,nil,nil,nil, "||pextrbVmXru","||pextrwVmXru","||pextrVmSXru","||extractpsVmXru", nil,nil,nil,nil,nil,nil,nil,nil, --2x "||pinsrbXrVmu","||insertpsXrmu","||pinsrXrVmuS",nil, --4x [0x40] = "||dppsXrmu", [0x41] = "||dppdXrmu", [0x42] = "||mpsadbwXrmu", --6x [0x60] = "||pcmpestrmXrmu",[0x61] = "||pcmpestriXrmu", [0x62] = "||pcmpistrmXrmu",[0x63] = "||pcmpistriXrmu", }, } -- Map for VMX/SVM opcodes 0F 01 C0-FF (sgdt group with register operands). local map_opcvm = { [0xc1]="vmcall",[0xc2]="vmlaunch",[0xc3]="vmresume",[0xc4]="vmxoff", [0xc8]="monitor",[0xc9]="mwait", [0xd8]="vmrun",[0xd9]="vmmcall",[0xda]="vmload",[0xdb]="vmsave", [0xdc]="stgi",[0xdd]="clgi",[0xde]="skinit",[0xdf]="invlpga", [0xf8]="swapgs",[0xf9]="rdtscp", } -- Map for FP opcodes. And you thought stack machines are simple? local map_opcfp = { -- D8-DF 00-BF: opcodes with a memory operand. -- D8 [0]="faddFm","fmulFm","fcomFm","fcompFm","fsubFm","fsubrFm","fdivFm","fdivrFm", "fldFm",nil,"fstFm","fstpFm","fldenvVm","fldcwWm","fnstenvVm","fnstcwWm", -- DA "fiaddDm","fimulDm","ficomDm","ficompDm", "fisubDm","fisubrDm","fidivDm","fidivrDm", -- DB "fildDm","fisttpDm","fistDm","fistpDm",nil,"fld twordFmp",nil,"fstp twordFmp", -- DC "faddGm","fmulGm","fcomGm","fcompGm","fsubGm","fsubrGm","fdivGm","fdivrGm", -- DD "fldGm","fisttpQm","fstGm","fstpGm","frstorDmp",nil,"fnsaveDmp","fnstswWm", -- DE "fiaddWm","fimulWm","ficomWm","ficompWm", "fisubWm","fisubrWm","fidivWm","fidivrWm", -- DF "fildWm","fisttpWm","fistWm","fistpWm", "fbld twordFmp","fildQm","fbstp twordFmp","fistpQm", -- xx C0-FF: opcodes with a pseudo-register operand. -- D8 "faddFf","fmulFf","fcomFf","fcompFf","fsubFf","fsubrFf","fdivFf","fdivrFf", -- D9 "fldFf","fxchFf",{"fnop"},nil, {"fchs","fabs",nil,nil,"ftst","fxam"}, {"fld1","fldl2t","fldl2e","fldpi","fldlg2","fldln2","fldz"}, {"f2xm1","fyl2x","fptan","fpatan","fxtract","fprem1","fdecstp","fincstp"}, {"fprem","fyl2xp1","fsqrt","fsincos","frndint","fscale","fsin","fcos"}, -- DA "fcmovbFf","fcmoveFf","fcmovbeFf","fcmovuFf",nil,{nil,"fucompp"},nil,nil, -- DB "fcmovnbFf","fcmovneFf","fcmovnbeFf","fcmovnuFf", {nil,nil,"fnclex","fninit"},"fucomiFf","fcomiFf",nil, -- DC "fadd toFf","fmul toFf",nil,nil, "fsub toFf","fsubr toFf","fdivr toFf","fdiv toFf", -- DD "ffreeFf",nil,"fstFf","fstpFf","fucomFf","fucompFf",nil,nil, -- DE "faddpFf","fmulpFf",nil,{nil,"fcompp"}, "fsubrpFf","fsubpFf","fdivrpFf","fdivpFf", -- DF nil,nil,nil,nil,{"fnstsw ax"},"fucomipFf","fcomipFf",nil, } assert(map_opcfp[126] == "fcomipFf") -- Map for opcode groups. The subkey is sp from the ModRM byte. local map_opcgroup = { arith = { "add", "or", "adc", "sbb", "and", "sub", "xor", "cmp" }, shift = { "rol", "ror", "rcl", "rcr", "shl", "shr", "sal", "sar" }, testb = { "testBmi", "testBmi", "not", "neg", "mul", "imul", "div", "idiv" }, testv = { "testVmi", "testVmi", "not", "neg", "mul", "imul", "div", "idiv" }, incb = { "inc", "dec" }, incd = { "inc", "dec", "callUmp", "$call farDmp", "jmpUmp", "$jmp farDmp", "pushUm" }, sldt = { "sldt", "str", "lldt", "ltr", "verr", "verw" }, sgdt = { "vm*$sgdt", "vm*$sidt", "$lgdt", "vm*$lidt", "smsw", nil, "lmsw", "vm*$invlpg" }, bt = { nil, nil, nil, nil, "bt", "bts", "btr", "btc" }, cmpxchg = { nil, "sz*,cmpxchg8bQmp,cmpxchg16bXmp", nil, nil, nil, nil, "vmptrld|vmxon|vmclear", "vmptrst" }, pshiftw = { nil, nil, "psrlw", nil, "psraw", nil, "psllw" }, pshiftd = { nil, nil, "psrld", nil, "psrad", nil, "pslld" }, pshiftq = { nil, nil, "psrlq", nil, nil, nil, "psllq" }, pshiftdq = { nil, nil, "psrlq", "psrldq", nil, nil, "psllq", "pslldq" }, fxsave = { "$fxsave", "$fxrstor", "$ldmxcsr", "$stmxcsr", nil, "lfenceDp$", "mfenceDp$", "sfenceDp$clflush" }, prefetch = { "prefetch", "prefetchw" }, prefetcht = { "prefetchnta", "prefetcht0", "prefetcht1", "prefetcht2" }, } ------------------------------------------------------------------------------ -- Maps for register names. local map_regs = { B = { "al", "cl", "dl", "bl", "ah", "ch", "dh", "bh", "r8b", "r9b", "r10b", "r11b", "r12b", "r13b", "r14b", "r15b" }, B64 = { "al", "cl", "dl", "bl", "spl", "bpl", "sil", "dil", "r8b", "r9b", "r10b", "r11b", "r12b", "r13b", "r14b", "r15b" }, W = { "ax", "cx", "dx", "bx", "sp", "bp", "si", "di", "r8w", "r9w", "r10w", "r11w", "r12w", "r13w", "r14w", "r15w" }, D = { "eax", "ecx", "edx", "ebx", "esp", "ebp", "esi", "edi", "r8d", "r9d", "r10d", "r11d", "r12d", "r13d", "r14d", "r15d" }, Q = { "rax", "rcx", "rdx", "rbx", "rsp", "rbp", "rsi", "rdi", "r8", "r9", "r10", "r11", "r12", "r13", "r14", "r15" }, M = { "mm0", "mm1", "mm2", "mm3", "mm4", "mm5", "mm6", "mm7", "mm0", "mm1", "mm2", "mm3", "mm4", "mm5", "mm6", "mm7" }, -- No x64 ext! X = { "xmm0", "xmm1", "xmm2", "xmm3", "xmm4", "xmm5", "xmm6", "xmm7", "xmm8", "xmm9", "xmm10", "xmm11", "xmm12", "xmm13", "xmm14", "xmm15" }, } local map_segregs = { "es", "cs", "ss", "ds", "fs", "gs", "segr6", "segr7" } -- Maps for size names. local map_sz2n = { B = 1, W = 2, D = 4, Q = 8, M = 8, X = 16, } local map_sz2prefix = { B = "byte", W = "word", D = "dword", Q = "qword", M = "qword", X = "xword", F = "dword", G = "qword", -- No need for sizes/register names for these two. } ------------------------------------------------------------------------------ -- Output a nicely formatted line with an opcode and operands. local function putop(ctx, text, operands) local code, pos, hex = ctx.code, ctx.pos, "" local hmax = ctx.hexdump if hmax > 0 then for i=ctx.start,pos-1 do hex = hex..format("%02X", byte(code, i, i)) end if #hex > hmax then hex = sub(hex, 1, hmax)..". " else hex = hex..rep(" ", hmax-#hex+2) end end if operands then text = text.." "..operands end if ctx.o16 then text = "o16 "..text; ctx.o16 = false end if ctx.a32 then text = "a32 "..text; ctx.a32 = false end if ctx.rep then text = ctx.rep.." "..text; ctx.rep = false end if ctx.rex then local t = (ctx.rexw and "w" or "")..(ctx.rexr and "r" or "").. (ctx.rexx and "x" or "")..(ctx.rexb and "b" or "") if t ~= "" then text = "rex."..t.." "..text end ctx.rexw = false; ctx.rexr = false; ctx.rexx = false; ctx.rexb = false ctx.rex = false end if ctx.seg then local text2, n = gsub(text, "%[", "["..ctx.seg..":") if n == 0 then text = ctx.seg.." "..text else text = text2 end ctx.seg = false end if ctx.lock then text = "lock "..text; ctx.lock = false end local imm = ctx.imm if imm then local sym = ctx.symtab[imm] if sym then text = text.."\t->"..sym end end ctx.out(format("%08x %s%s\n", ctx.addr+ctx.start, hex, text)) ctx.mrm = false ctx.start = pos ctx.imm = nil end -- Clear all prefix flags. local function clearprefixes(ctx) ctx.o16 = false; ctx.seg = false; ctx.lock = false; ctx.rep = false ctx.rexw = false; ctx.rexr = false; ctx.rexx = false; ctx.rexb = false ctx.rex = false; ctx.a32 = false end -- Fallback for incomplete opcodes at the end. local function incomplete(ctx) ctx.pos = ctx.stop+1 clearprefixes(ctx) return putop(ctx, "(incomplete)") end -- Fallback for unknown opcodes. local function unknown(ctx) clearprefixes(ctx) return putop(ctx, "(unknown)") end -- Return an immediate of the specified size. local function getimm(ctx, pos, n) if pos+n-1 > ctx.stop then return incomplete(ctx) end local code = ctx.code if n == 1 then local b1 = byte(code, pos, pos) return b1 elseif n == 2 then local b1, b2 = byte(code, pos, pos+1) return b1+b2*256 else local b1, b2, b3, b4 = byte(code, pos, pos+3) local imm = b1+b2*256+b3*65536+b4*16777216 ctx.imm = imm return imm end end -- Process pattern string and generate the operands. local function putpat(ctx, name, pat) local operands, regs, sz, mode, sp, rm, sc, rx, sdisp local code, pos, stop = ctx.code, ctx.pos, ctx.stop -- Chars used: 1DFGIMPQRSTUVWXacdfgijmoprstuwxyz for p in gmatch(pat, ".") do local x = nil if p == "V" or p == "U" then if ctx.rexw then sz = "Q"; ctx.rexw = false elseif ctx.o16 then sz = "W"; ctx.o16 = false elseif p == "U" and ctx.x64 then sz = "Q" else sz = "D" end regs = map_regs[sz] elseif p == "T" then if ctx.rexw then sz = "Q"; ctx.rexw = false else sz = "D" end regs = map_regs[sz] elseif p == "B" then sz = "B" regs = ctx.rex and map_regs.B64 or map_regs.B elseif match(p, "[WDQMXFG]") then sz = p regs = map_regs[sz] elseif p == "P" then sz = ctx.o16 and "X" or "M"; ctx.o16 = false regs = map_regs[sz] elseif p == "S" then name = name..lower(sz) elseif p == "s" then local imm = getimm(ctx, pos, 1); if not imm then return end x = imm <= 127 and format("+0x%02x", imm) or format("-0x%02x", 256-imm) pos = pos+1 elseif p == "u" then local imm = getimm(ctx, pos, 1); if not imm then return end x = format("0x%02x", imm) pos = pos+1 elseif p == "w" then local imm = getimm(ctx, pos, 2); if not imm then return end x = format("0x%x", imm) pos = pos+2 elseif p == "o" then -- [offset] if ctx.x64 then local imm1 = getimm(ctx, pos, 4); if not imm1 then return end local imm2 = getimm(ctx, pos+4, 4); if not imm2 then return end x = format("[0x%08x%08x]", imm2, imm1) pos = pos+8 else local imm = getimm(ctx, pos, 4); if not imm then return end x = format("[0x%08x]", imm) pos = pos+4 end elseif p == "i" or p == "I" then local n = map_sz2n[sz] if n == 8 and ctx.x64 and p == "I" then local imm1 = getimm(ctx, pos, 4); if not imm1 then return end local imm2 = getimm(ctx, pos+4, 4); if not imm2 then return end x = format("0x%08x%08x", imm2, imm1) else if n == 8 then n = 4 end local imm = getimm(ctx, pos, n); if not imm then return end if sz == "Q" and (imm < 0 or imm > 0x7fffffff) then imm = (0xffffffff+1)-imm x = format(imm > 65535 and "-0x%08x" or "-0x%x", imm) else x = format(imm > 65535 and "0x%08x" or "0x%x", imm) end end pos = pos+n elseif p == "j" then local n = map_sz2n[sz] if n == 8 then n = 4 end local imm = getimm(ctx, pos, n); if not imm then return end if sz == "B" and imm > 127 then imm = imm-256 elseif imm > 2147483647 then imm = imm-4294967296 end pos = pos+n imm = imm + pos + ctx.addr if imm > 4294967295 and not ctx.x64 then imm = imm-4294967296 end ctx.imm = imm if sz == "W" then x = format("word 0x%04x", imm%65536) elseif ctx.x64 then local lo = imm % 0x1000000 x = format("0x%02x%06x", (imm-lo) / 0x1000000, lo) else x = "0x"..tohex(imm) end elseif p == "R" then local r = byte(code, pos-1, pos-1)%8 if ctx.rexb then r = r + 8; ctx.rexb = false end x = regs[r+1] elseif p == "a" then x = regs[1] elseif p == "c" then x = "cl" elseif p == "d" then x = "dx" elseif p == "1" then x = "1" else if not mode then mode = ctx.mrm if not mode then if pos > stop then return incomplete(ctx) end mode = byte(code, pos, pos) pos = pos+1 end rm = mode%8; mode = (mode-rm)/8 sp = mode%8; mode = (mode-sp)/8 sdisp = "" if mode < 3 then if rm == 4 then if pos > stop then return incomplete(ctx) end sc = byte(code, pos, pos) pos = pos+1 rm = sc%8; sc = (sc-rm)/8 rx = sc%8; sc = (sc-rx)/8 if ctx.rexx then rx = rx + 8; ctx.rexx = false end if rx == 4 then rx = nil end end if mode > 0 or rm == 5 then local dsz = mode if dsz ~= 1 then dsz = 4 end local disp = getimm(ctx, pos, dsz); if not disp then return end if mode == 0 then rm = nil end if rm or rx or (not sc and ctx.x64 and not ctx.a32) then if dsz == 1 and disp > 127 then sdisp = format("-0x%x", 256-disp) elseif disp >= 0 and disp <= 0x7fffffff then sdisp = format("+0x%x", disp) else sdisp = format("-0x%x", (0xffffffff+1)-disp) end else sdisp = format(ctx.x64 and not ctx.a32 and not (disp >= 0 and disp <= 0x7fffffff) and "0xffffffff%08x" or "0x%08x", disp) end pos = pos+dsz end end if rm and ctx.rexb then rm = rm + 8; ctx.rexb = false end if ctx.rexr then sp = sp + 8; ctx.rexr = false end end if p == "m" then if mode == 3 then x = regs[rm+1] else local aregs = ctx.a32 and map_regs.D or ctx.aregs local srm, srx = "", "" if rm then srm = aregs[rm+1] elseif not sc and ctx.x64 and not ctx.a32 then srm = "rip" end ctx.a32 = false if rx then if rm then srm = srm.."+" end srx = aregs[rx+1] if sc > 0 then srx = srx.."*"..(2^sc) end end x = format("[%s%s%s]", srm, srx, sdisp) end if mode < 3 and (not match(pat, "[aRrgp]") or match(pat, "t")) then -- Yuck. x = map_sz2prefix[sz].." "..x end elseif p == "r" then x = regs[sp+1] elseif p == "g" then x = map_segregs[sp+1] elseif p == "p" then -- Suppress prefix. elseif p == "f" then x = "st"..rm elseif p == "x" then if sp == 0 and ctx.lock and not ctx.x64 then x = "CR8"; ctx.lock = false else x = "CR"..sp end elseif p == "y" then x = "DR"..sp elseif p == "z" then x = "TR"..sp elseif p == "t" then else error("bad pattern `"..pat.."'") end end if x then operands = operands and operands..", "..x or x end end ctx.pos = pos return putop(ctx, name, operands) end -- Forward declaration. local map_act -- Fetch and cache MRM byte. local function getmrm(ctx) local mrm = ctx.mrm if not mrm then local pos = ctx.pos if pos > ctx.stop then return nil end mrm = byte(ctx.code, pos, pos) ctx.pos = pos+1 ctx.mrm = mrm end return mrm end -- Dispatch to handler depending on pattern. local function dispatch(ctx, opat, patgrp) if not opat then return unknown(ctx) end if match(opat, "%|") then -- MMX/SSE variants depending on prefix. local p if ctx.rep then p = ctx.rep=="rep" and "%|([^%|]*)" or "%|[^%|]*%|[^%|]*%|([^%|]*)" ctx.rep = false elseif ctx.o16 then p = "%|[^%|]*%|([^%|]*)"; ctx.o16 = false else p = "^[^%|]*" end opat = match(opat, p) if not opat then return unknown(ctx) end -- ctx.rep = false; ctx.o16 = false --XXX fails for 66 f2 0f 38 f1 06 crc32 eax,WORD PTR [esi] --XXX remove in branches? end if match(opat, "%$") then -- reg$mem variants. local mrm = getmrm(ctx); if not mrm then return incomplete(ctx) end opat = match(opat, mrm >= 192 and "^[^%$]*" or "%$(.*)") if opat == "" then return unknown(ctx) end end if opat == "" then return unknown(ctx) end local name, pat = match(opat, "^([a-z0-9 ]*)(.*)") if pat == "" and patgrp then pat = patgrp end return map_act[sub(pat, 1, 1)](ctx, name, pat) end -- Get a pattern from an opcode map and dispatch to handler. local function dispatchmap(ctx, opcmap) local pos = ctx.pos local opat = opcmap[byte(ctx.code, pos, pos)] pos = pos + 1 ctx.pos = pos return dispatch(ctx, opat) end -- Map for action codes. The key is the first char after the name. map_act = { -- Simple opcodes without operands. [""] = function(ctx, name, pat) return putop(ctx, name) end, -- Operand size chars fall right through. B = putpat, W = putpat, D = putpat, Q = putpat, V = putpat, U = putpat, T = putpat, M = putpat, X = putpat, P = putpat, F = putpat, G = putpat, -- Collect prefixes. [":"] = function(ctx, name, pat) ctx[pat == ":" and name or sub(pat, 2)] = name if ctx.pos - ctx.start > 5 then return unknown(ctx) end -- Limit #prefixes. end, -- Chain to special handler specified by name. ["*"] = function(ctx, name, pat) return map_act[name](ctx, name, sub(pat, 2)) end, -- Use named subtable for opcode group. ["!"] = function(ctx, name, pat) local mrm = getmrm(ctx); if not mrm then return incomplete(ctx) end return dispatch(ctx, map_opcgroup[name][((mrm-(mrm%8))/8)%8+1], sub(pat, 2)) end, -- o16,o32[,o64] variants. sz = function(ctx, name, pat) if ctx.o16 then ctx.o16 = false else pat = match(pat, ",(.*)") if ctx.rexw then local p = match(pat, ",(.*)") if p then pat = p; ctx.rexw = false end end end pat = match(pat, "^[^,]*") return dispatch(ctx, pat) end, -- Two-byte opcode dispatch. opc2 = function(ctx, name, pat) return dispatchmap(ctx, map_opc2) end, -- Three-byte opcode dispatch. opc3 = function(ctx, name, pat) return dispatchmap(ctx, map_opc3[pat]) end, -- VMX/SVM dispatch. vm = function(ctx, name, pat) return dispatch(ctx, map_opcvm[ctx.mrm]) end, -- Floating point opcode dispatch. fp = function(ctx, name, pat) local mrm = getmrm(ctx); if not mrm then return incomplete(ctx) end local rm = mrm%8 local idx = pat*8 + ((mrm-rm)/8)%8 if mrm >= 192 then idx = idx + 64 end local opat = map_opcfp[idx] if type(opat) == "table" then opat = opat[rm+1] end return dispatch(ctx, opat) end, -- REX prefix. rex = function(ctx, name, pat) if ctx.rex then return unknown(ctx) end -- Only 1 REX prefix allowed. for p in gmatch(pat, ".") do ctx["rex"..p] = true end ctx.rex = true end, -- Special case for nop with REX prefix. nop = function(ctx, name, pat) return dispatch(ctx, ctx.rex and pat or "nop") end, } ------------------------------------------------------------------------------ -- Disassemble a block of code. local function disass_block(ctx, ofs, len) if not ofs then ofs = 0 end local stop = len and ofs+len or #ctx.code ofs = ofs + 1 ctx.start = ofs ctx.pos = ofs ctx.stop = stop ctx.imm = nil ctx.mrm = false clearprefixes(ctx) while ctx.pos <= stop do dispatchmap(ctx, ctx.map1) end if ctx.pos ~= ctx.start then incomplete(ctx) end end -- Extended API: create a disassembler context. Then call ctx:disass(ofs, len). local function create(code, addr, out) local ctx = {} ctx.code = code ctx.addr = (addr or 0) - 1 ctx.out = out or io.write ctx.symtab = {} ctx.disass = disass_block ctx.hexdump = 16 ctx.x64 = false ctx.map1 = map_opc1_32 ctx.aregs = map_regs.D return ctx end local function create64(code, addr, out) local ctx = create(code, addr, out) ctx.x64 = true ctx.map1 = map_opc1_64 ctx.aregs = map_regs.Q return ctx end -- Simple API: disassemble code (a string) at address and output via out. local function disass(code, addr, out) create(code, addr, out):disass() end local function disass64(code, addr, out) create64(code, addr, out):disass() end -- Return register name for RID. local function regname(r) if r < 8 then return map_regs.D[r+1] end return map_regs.X[r-7] end local function regname64(r) if r < 16 then return map_regs.Q[r+1] end return map_regs.X[r-15] end -- Public module functions. return { create = create, create64 = create64, disass = disass, disass64 = disass64, regname = regname, regname64 = regname64 }
mit
Lautitia/newfies-dialer
lua/libs/uuid4.lua
12
3046
--[[ The MIT License (MIT) Copyright (c) 2012 Toby Jennings Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. --]] local M = {} ----- math.randomseed( os.time() ) math.random() ----- local function num2bs(num) local _mod = math.fmod or math.mod local _floor = math.floor -- local result = "" if(num == 0) then return "0" end while(num > 0) do result = _mod(num,2) .. result num = _floor(num*0.5) end return result end -- local function bs2num(num) local _sub = string.sub local index, result = 0, 0 if(num == "0") then return 0; end for p=#num,1,-1 do local this_val = _sub( num, p,p ) if this_val == "1" then result = result + ( 2^index ) end index=index+1 end return result end -- local function padbits(num,bits) if #num == bits then return num end if #num > bits then print("too many bits") end local pad = bits - #num for i=1,pad do num = "0" .. num end return num end -- local function getUUID() local _rnd = math.random local _fmt = string.format -- _rnd() -- local time_low_a = _rnd(0, 65535) local time_low_b = _rnd(0, 65535) -- local time_mid = _rnd(0, 65535) -- local time_hi = _rnd(0, 4095 ) time_hi = padbits( num2bs(time_hi), 12 ) local time_hi_and_version = bs2num( "0100" .. time_hi ) -- local clock_seq_hi_res = _rnd(0,63) clock_seq_hi_res = padbits( num2bs(clock_seq_hi_res), 6 ) clock_seq_hi_res = "10" .. clock_seq_hi_res -- local clock_seq_low = _rnd(0,255) clock_seq_low = padbits( num2bs(clock_seq_low), 8 ) -- local clock_seq = bs2num(clock_seq_hi_res .. clock_seq_low) -- local node = {} for i=1,6 do node[i] = _rnd(0,255) end -- local guid = "" guid = guid .. padbits(_fmt("%X",time_low_a), 4) guid = guid .. padbits(_fmt("%X",time_low_b), 4) .. "-" guid = guid .. padbits(_fmt("%X",time_mid), 4) .. "-" guid = guid .. padbits(_fmt("%X",time_hi_and_version), 4) .. "-" guid = guid .. padbits(_fmt("%X",clock_seq), 4) .. "-" -- for i=1,6 do guid = guid .. padbits(_fmt("%X",node[i]), 2) end -- return guid end -- M.getUUID = getUUID return M
mpl-2.0
cogwerkz/DiabolicUI
locale/locale-esES.lua
2
1325
local _, Engine = ... local L = Engine:NewLocale("esES") if not L then return end -- actionbar module --------------------------------------------------------------------- -- keybinds L["Alt"] = "A" L["Ctrl"] = "C" L["Shift"] = "S" L["NumPad"] = "N" L["Backspace"] = "BS" L["Button1"] = "B1" L["Button2"] = "B2" L["Button3"] = "B3" L["Button4"] = "B4" L["Button5"] = "B5" L["Button6"] = "B6" L["Button7"] = "B7" L["Button8"] = "B8" L["Button9"] = "B9" L["Button10"] = "B10" L["Button11"] = "B11" L["Button12"] = "B12" L["Button13"] = "B13" L["Button14"] = "B14" L["Button15"] = "B15" L["Button16"] = "B16" L["Button17"] = "B17" L["Button18"] = "B18" L["Button19"] = "B19" L["Button20"] = "B20" L["Button21"] = "B21" L["Button22"] = "B22" L["Button23"] = "B23" L["Button24"] = "B24" L["Button25"] = "B25" L["Button26"] = "B26" L["Button27"] = "B27" L["Button28"] = "B28" L["Button29"] = "B29" L["Button30"] = "B30" L["Button31"] = "B31" L["Capslock"] = "Cp" L["Clear"] = "Cl" L["Delete"] = "Del" L["End"] = "Fin" L["Home"] = "Ini" L["Insert"] = "Ins" L["Mouse Wheel Down"] = "AW" L["Mouse Wheel Up"] = "RW" L["Num Lock"] = "NL" L["Page Down"] = "AP" L["Page Up"] = "RP" L["Scroll Lock"] = "SL" L["Spacebar"] = "Sp" L["Tab"] = "Tb" L["Down Arrow"] = "Ar" L["Left Arrow"] = "Ab" L["Right Arrow"] = "Iz" L["Up Arrow"] = "De"
mit
Noneatme/mta-lostresources
[gameplay]/megakills/server/CMegaKills.lua
1
6229
-- ####################################### -- ## Project: MTA Mega Kills ## -- ## For MTA: San Andreas ## -- ## Name: MegaKills.lua ## -- ## Author: Noneatme ## -- ## Version: 1.0 ## -- ## License: See top Folder ## -- ####################################### -- FUNCTIONS / METHODS -- local cFunc = {}; -- Local Functions local cSetting = {}; -- Local Settings MegaKills = {}; MegaKills.__index = MegaKills; --[[ ]] -- /////////////////////////////// -- ///// New ////// -- ///// Returns: Object ////// -- /////////////////////////////// function MegaKills:New(...) local obj = setmetatable({}, {__index = self}); if obj.Constructor then obj:Constructor(...); end return obj; end -- /////////////////////////////// -- ///// PlayerKill ////// -- ///// Returns: void ////// -- /////////////////////////////// function MegaKills:PlayerKill(ammo, killer) if(killer) and (getElementType(killer) == "player") then local player = source; -- Reset player stats, player killed self.playerKillCount[player] = 0; self.playerTempCount[player] = 0; -- Set killer stats if not(self.playerKillCount[killer]) then self.playerKillCount[killer] = 0; self.playerTempCount[killer] = 0; self.playerTickCount[killer] = getTickCount(); self.playerMegaKill[killer] = "-"; end self.playerKillCount[killer] = self.playerKillCount[killer]+1; self.playerTempCount[killer] = self.playerTempCount[killer]+1; if(getTickCount()-self.playerTickCount[killer] > 5000) then self.playerTempCount[killer] = 0; end self.playerTickCount[killer] = getTickCount(); self:UpdatePlayerTitle(killer, source); end end -- /////////////////////////////// -- ///// UpdatePlayerTitle ////// -- ///// Returns: void ////// -- /////////////////////////////// function MegaKills:UpdatePlayerTitle(player, victim) local temp_kills = self.playerTempCount[player]; local rampage_kills = #getElementsByType("player")-1; local kills = self.playerKillCount[player]; local old_megakill = self.playerMegaKill[player]; -- FIRSTBLOOD -- if(self.firstBloodDone == false) then self:AnnounceFirstBlood(player, victim); self.firstBloodDone = true; end -- SERIEN -- local old_megakill = self.playerMegaKill[player]; if(temp_kills == 2) then self.playerMegaKill[player] = "DOUBLE_KILL"; elseif(temp_kills == 3) then self.playerMegaKill[player] = "TRIPPLE_KILL"; end -- Mega kills erst ab 5 spieler, da man diese boni schon bekommen wuerde -- Wenn man die Haelfter der Spieler killt -- Und bei 2-3 spielern ist das nicht viel. if(rampage_kills >= 5) then if(temp_kills >= rampage_kills/2) then self.playerMegaKill[player] = "MEGA_KILL"; elseif(temp_kills == rampage_kills-1) then self.playerMegaKill[player] = "ULTRA_KILL"; elseif(temp_kills >= rampage_kills) then self.playerMegaKill[player] = "RAMPAGE"; end end -- KILLS -- local old_killstreak = self.playerKillStreak[player]; if(self.playerMegaKill[player] ~= "-") then if(kills == 3) then self.playerKillStreak[player] = "KILLING_SPREE"; elseif(kills == 4) then self.playerKillStreak[player] = "DOMINATING"; elseif(kills == 6) then self.playerKillStreak[player] = "UNSTOPPABLE"; elseif(kills == 7) then self.playerKillStreak[player] = "WICKED_SICK"; elseif(kills == 8) then self.playerKillStreak[player] = "MONSTER_KILL"; elseif(kills == 9) then self.playerKillStreak[player] = "GODLIKE"; elseif(kills > 9) then self.playerKillStreak[player] = "HOLY_SHIT"; end end -- kill streak local kill_streak local mega_kill if(self.playerKillStreak[player] ~= old_killstreak) then kill_streak = true; outputChatBox("Player: "..getPlayerName(player).." is on a "..self.playerKillStreak[player].." kill streak!", getRootElement(), 0, 255, 255) end if(kills > 5) then self.playerOwnage[player] = true; else self.playerOwnage[player] = false; end -- ANNOUNCE if(old_megakill == self.playerMegaKill[player]) then -- Do Nothing else mega_kill = true; outputChatBox("Player: "..getPlayerName(player).." has a "..self.playerMegaKill[player].."!", getRootElement(), 0, 255, 255) end triggerClientEvent(getRootElement(), "onPlayerKillingSpree", getRootElement(), player, mega_kill, self.playerMegaKill[player], kill_streak, self.playerKillStreak[player]); end -- /////////////////////////////// -- ///// AnnounceFirstBlood ////// -- ///// Returns: void ////// -- /////////////////////////////// function MegaKills:AnnounceFirstBlood(player) -- FIRST BLOOD! triggerClientEvent(getRootElement(), "onPlayerFirstBlood", getRootElement(), player); end -- /////////////////////////////// -- ///// ResetVars() ////// -- ///// Returns: void ////// -- ///// Resets first blood and player variables ////// -- /////////////////////////////// function MegaKills:ResetVars() this.firstBloodDone = false; -- Instanzen self.playerKillCount = {}; -- All in count for killing sprees self.playerTempCount = {}; -- Temp count for mega kills self.playerMegaKill = {}; -- Player mega kill self.playerKillStreak = {}; -- Player kill streak end -- /////////////////////////////// -- ///// Constructor ////// -- ///// Returns: void ////// -- /////////////////////////////// function MegaKills:Constructor(...) outputChatBox("[MegaKills] Geladen!", getRootElement(), 255, 255, 0) -- Instanzen self.playerKillCount = {}; -- All in count for killing sprees self.playerTempCount = {}; -- Temp count for mega kills self.playerTickCount = {}; -- Player Tick Count self.playerMegaKill = {}; -- Player mega kill self.playerKillStreak = {}; -- Player kill streak self.playerOwnage = {}; -- Player Ownage? (5+ kills in a row) self.firstBloodDone = false; -- First Blood -- Funktionen self.playerKillFunc = function(...) self:PlayerKill(...) end; self.resetKillStreak = function(player) self:ResetKillSteak(player) end; -- Events --addEventHandler("onPedWasted", getRootElement(), self.playerKillFunc); addEventHandler("onPlayerWasted", getRootElement(), self.playerKillFunc); outputDebugString("[CALLING] MegaKills: Constructor"); end -- EVENT HANDLER --
gpl-2.0
LuaDist2/luaposix
specs/spec_helper.lua
1
3666
local unpack = table.unpack or unpack if os.getenv "installcheck" == nil then -- Unless we're running inside `make installcheck`, add the dev-tree -- directories to the module search paths. local std = require "specl.std" local top_srcdir = os.getenv "top_srcdir" or "." local top_builddir = os.getenv "top_builddir" or "." package.path = std.package.normalize ( top_builddir .. "/lib/?.lua", top_srcdir .. "/lib/?.lua", top_builddir .. "/lib/?/init.lua", top_srcdir .. "/lib/?/init.lua", package.path) package.cpath = std.package.normalize ( top_builddir .. "/ext/posix/.libs/?.so", top_srcdir .. "/ext/posix/.libs/?.so", top_builddir .. "/ext/posix/_libs/?.dll", top_srcdir .. "/ext/posix/_libs/?.dll", package.cpath) end local bit = require "bit32" band, bnot, bor = bit.band, bit.bnot, bit.bor badargs = require "specl.badargs" hell = require "specl.shell" posix = require "posix" -- Allow user override of LUA binary used by hell.spawn, falling -- back to environment PATH search for "lua" if nothing else works. local LUA = os.getenv "LUA" or "lua" -- Easily check for std.object.type compatibility. function prototype (o) return (getmetatable (o) or {})._type or io.type (o) or type (o) end local function mkscript (code) local f = os.tmpname () local h = io.open (f, "w") h:write (code) h:close () return f end --- Run some Lua code with the given arguments and input. -- @string code valid Lua code -- @tparam[opt={}] string|table arg single argument, or table of -- arguments for the script invocation -- @string[opt] stdin standard input contents for the script process -- @treturn specl.shell.Process|nil status of resulting process if -- execution was successful, otherwise nil function luaproc (code, arg, stdin) local f = mkscript (code) if type (arg) ~= "table" then arg = {arg} end local cmd = {LUA, f, unpack (arg)} -- inject env and stdin keys separately to avoid truncating `...` in -- cmd constructor cmd.stdin = stdin cmd.env = { LUA = LUA, LUA_CPATH = package.cpath, LUA_PATH = package.path, LUA_INIT = "", LUA_INIT_5_2 = "", LUA_INIT_5_3 = "", PATH = os.getenv "PATH" } local proc = hell.spawn (cmd) os.remove (f) return proc end -- Use a consistent template for all temporary files. TMPDIR = posix.getenv ("TMPDIR") or "/tmp" template = TMPDIR .. "/luaposix-test-XXXXXX" -- Allow comparison against the error message of a function call result. function Emsg (_, msg) return msg or "" end -- Collect stdout from a shell command, and strip surrounding whitespace. function cmd_output (cmd) return hell.spawn (cmd).output:gsub ("^%s+", ""):gsub ("%s+$", "") end local st = require "posix.sys.stat" local stat, S_ISDIR = st.lstat, st.S_ISDIR -- Recursively remove a temporary directory. function rmtmp (dir) for f in posix.files (dir) do if f ~= "." and f ~= ".." then local path = dir .. "/" .. f if S_ISDIR (stat (path).st_mode) ~= 0 then rmtmp (path) else os.remove (path) end end end os.remove (dir) end -- Create an empty file at PATH. function touch (path) io.open (path, "w+"):close () end -- Format a bad argument type error. local function typeerrors (fname, i, want, field, got) return { badargs.format ("?", i, want, field, got), -- LuaJIT badargs.format (fname, i, want, field, got), -- PUC-Rio } end function init (M, fname) return M[fname], function (...) return typeerrors (fname, ...) end end pack = table.pack or function(...) return {n=select("#", ...), ...} end
mit
liuxuezhan/skynet
lualib/skynet/sharemap.lua
30
1503
local stm = require "skynet.stm" local sprotoloader = require "sprotoloader" local sproto = require "sproto" local setmetatable = setmetatable local sharemap = {} function sharemap.register(protofile) -- use global slot 0 for type define sprotoloader.register(protofile, 0) end local sprotoobj local function loadsp() if sprotoobj == nil then sprotoobj = sprotoloader.load(0) end return sprotoobj end function sharemap:commit() self.__obj(sprotoobj:encode(self.__typename, self.__data)) end function sharemap:copy() return stm.copy(self.__obj) end function sharemap.writer(typename, obj) local sp = loadsp() obj = obj or {} local stmobj = stm.new(sp:encode(typename,obj)) local ret = { __typename = typename, __obj = stmobj, __data = obj, commit = sharemap.commit, copy = sharemap.copy, } return setmetatable(ret, { __index = obj, __newindex = obj }) end local function decode(msg, sz, self) local data = self.__data for k in pairs(data) do data[k] = nil end return sprotoobj:decode(self.__typename, msg, sz, data) end function sharemap:update() return self.__obj(decode, self) end function sharemap.reader(typename, stmcpy) local sp = loadsp() local stmobj = stm.newcopy(stmcpy) local _, data = stmobj(function(msg, sz) return sp:decode(typename, msg, sz) end) local obj = { __typename = typename, __obj = stmobj, __data = data, update = sharemap.update, } return setmetatable(obj, { __index = data, __newindex = error }) end return sharemap
mit
mms92/wire
lua/entities/gmod_wire_addressbus.lua
9
2451
AddCSLuaFile() DEFINE_BASECLASS( "base_wire_entity" ) ENT.PrintName = "Wire Address Bus" ENT.WireDebugName = "AddressBus" if CLIENT then return end -- No more client function ENT:Initialize() self:PhysicsInit(SOLID_VPHYSICS) self:SetMoveType(MOVETYPE_VPHYSICS) self:SetSolid(SOLID_VPHYSICS) self:SetUseType(SIMPLE_USE) self.Outputs = Wire_CreateOutputs(self, {"Memory"}) self.Inputs = Wire_CreateInputs(self,{"Memory1","Memory2","Memory3","Memory4"}) self.DataRate = 0 self.DataBytes = 0 self.Memory = {} self.MemStart = {} self.MemEnd = {} for i = 1,4 do self.Memory[i] = nil self.MemStart[i] = 0 self.MemEnd[i] = 0 end self:SetOverlayText("Data rate: 0 bps") end function ENT:Setup(Mem1st, Mem2st, Mem3st, Mem4st, Mem1sz, Mem2sz, Mem3sz, Mem4sz) local starts = {Mem1st,Mem2st,Mem3st,Mem4st} local sizes = {Mem1sz,Mem2sz,Mem3sz,Mem4sz} for i = 1,4 do starts[i] = tonumber(starts[i]) or 0 sizes[i] = tonumber(sizes[i]) or 0 self.MemStart[i] = starts[i] self.MemEnd[i] = starts[i] + sizes[i] - 1 self["Mem"..i.."st"] = starts[i] self["Mem"..i.."sz"] = sizes[i] end end function ENT:Think() self.BaseClass.Think(self) self.DataRate = self.DataBytes self.DataBytes = 0 Wire_TriggerOutput(self, "Memory", self.DataRate) self:SetOverlayText("Data rate: "..math.floor(self.DataRate*2).." bps") self:NextThink(CurTime()+0.5) return true end function ENT:ReadCell(Address) for i = 1,4 do if (Address >= self.MemStart[i]) and (Address <= self.MemEnd[i]) then if self.Memory[i] then if self.Memory[i].ReadCell then self.DataBytes = self.DataBytes + 1 local val = self.Memory[i]:ReadCell(Address - self.MemStart[i]) return val or 0 end else return 0 end end end return nil end function ENT:WriteCell(Address, value) local res = false for i = 1,4 do if (Address >= self.MemStart[i]) and (Address <= self.MemEnd[i]) then if self.Memory[i] then if self.Memory[i].WriteCell then self.Memory[i]:WriteCell(Address - self.MemStart[i], value) end end self.DataBytes = self.DataBytes + 1 res = true end end return res end function ENT:TriggerInput(iname, value) for i = 1,4 do if iname == "Memory"..i then self.Memory[i] = self.Inputs["Memory"..i].Src end end end duplicator.RegisterEntityClass("gmod_wire_addressbus", WireLib.MakeWireEnt, "Data", "Mem1st", "Mem2st", "Mem3st", "Mem4st", "Mem1sz", "Mem2sz", "Mem3sz", "Mem4sz")
apache-2.0
tomasguisasola/luaexpat
src/lxp/totable.lua
1
2800
-- See Copyright Notice in license.html -- Based on Luiz Henrique de Figueiredo's lxml: -- http://www.tecgraf.puc-rio.br/~lhf/ftp/lua/#lxml local lxp = require "lxp" local table = require"table" local tinsert, tremove = table.insert, table.remove local assert, pairs, tostring, type = assert, pairs, tostring, type -- auxiliary functions ------------------------------------------------------- local function starttag (p, tag, attr) local stack = p:getcallbacks().stack local newelement = {[0] = tag} for i = 1, #attr do local attrname = attr[i] local attrvalue = attr[attrname] newelement[attrname] = attrvalue end tinsert(stack, newelement) end local function endtag (p, tag) local stack = p:getcallbacks().stack local element = tremove(stack) assert(element[0] == tag, "Error while closing element: table[0] should be `"..tostring(tag).."' but is `"..tostring(element[0]).."'") local level = #stack tinsert(stack[level], element) end local function text (p, txt) local stack = p:getcallbacks().stack local element = stack[#stack] local n = #element if type(element[n]) == "string" and n > 0 then element[n] = element[n] .. txt else tinsert(element, txt) end end -- main function ------------------------------------------------------------- local function parse (o) local c = { StartElement = starttag, EndElement = endtag, CharacterData = text, _nonstrict = true, stack = {{}}, } local p = lxp.new(c) if type(o) == "string" then local status, err, line, col, pos = p:parse(o) if not status then return nil, err, line, col, pos end else for l in pairs(o) do local status, err, line, col, pos = p:parse(l) if not status then return nil, err, line, col, pos end end end local status, err, line, col, pos = p:parse() -- close document if not status then return nil, err, line, col, pos end p:close() return c.stack[1][1] end -- utility functions --------------------------------------------------------- local function compact (t) -- remove empty entries local n = 0 for i = 1, #t do local v = t[i] if v then n = n+1 if n ~= i then t[n] = v t[i] = nil end else t[i] = nil end end end local function clean (t) -- remove empty strings for i = 1, #t do local v = t[i] local tv = type(v) if tv == "table" then clean (v) elseif tv == "string" and v:match"^%s*$" then t[i] = false end end compact (t) end local function torecord (t) -- move 1-value subtables to table entries for i = 1, #t do local v = t[i] if type(v) == "table" then if #v == 1 and type(v[1]) == "string" and t[v[0]] == nil then t[v[0]] = v[1] t[i] = false else torecord (v) end end end compact (t) end return { clean = clean, compact = compact, parse = parse, torecord = torecord, }
mit
sk89q/PlayX
src/PlayX/lua/playx/client/vgui/PlayXBrowser.lua
2
2578
-- PlayX -- Copyright (c) 2009, 2010 sk89q <http://www.sk89q.com> -- -- This program is free software: you can redistribute it and/or modify -- it under the terms of the GNU General Public License as published by -- the Free Software Foundation, either version 2 of the License, or -- (at your option) any later version. -- -- This program is distributed in the hope that it will be useful, -- but WITHOUT ANY WARRANTY; without even the implied warranty of -- MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the -- GNU General Public License for more details. -- -- You should have received a copy of the GNU General Public License -- along with this program. If not, see <http://www.gnu.org/licenses/>. -- -- $Id$ local PANEL = {} function PANEL:Init() self.Chrome = vgui.Create("DHTMLControls", self); self.Chrome:Dock(TOP) self.Chrome.HomeURL = "http://navigator.playx.sk89q.com/" end function PANEL:OpeningVideo(provider, uri) end function PANEL:Open(provider, uri) MsgN("PlayXBrowser: Requested to open <" .. provider .. "> / <" .. uri .. ">") PlayX.RequestOpenMedia(provider, uri, 0, false, GetConVar("playx_use_jw"):GetBool(), GetConVar("playx_ignore_length"):GetBool()) self:OpeningVideo(provider, uri) end function PANEL:Paint() if not self.Started then self.Started = true self.HTML = vgui.Create("HTML", self) self.HTML:Dock(FILL) self.Chrome:SetHTML(self.HTML) local oldOpenURL = self.HTML.OpeningURL self.HTML.OpeningURL = function(_, url, target, postdata) local activity, value = url:match("^playx://([^/]+)/(.*)$") if activity and value then value = playxlib.URLUnescape(value) if activity == "open" then self:Open("", value) elseif activity == "open-provider" then local provider, uri = value:match("^([^/]+)/(.*)$") self:Open(provider, uri) end return true end local value = url:match("youtube.*v=([^&]+)") if value then self:Open("", "http://www.youtube.com/watch?v=" .. value) return true end oldOpenURL(_, url, target, postdata) end self.HTML:OpenURL(self.Chrome.HomeURL); self:InvalidateLayout() end end vgui.Register("PlayXBrowser", PANEL, "Panel")
lgpl-3.0
liuxuezhan/skynet
test/testbson.lua
29
1541
local bson = require "bson" local sub = bson.encode_order( "hello", 1, "world", 2 ) do -- check decode encode_order local d = bson.decode(sub) assert(d.hello == 1 ) assert(d.world == 2 ) end local function tbl_next(...) print("--- next.a", ...) local k, v = next(...) print("--- next.b", k, v) return k, v end local function tbl_pairs(obj) return tbl_next, obj.__data, nil end local obj_a = { __data = { ["1"] = 2, ["3"] = 4, ["5"] = 6, } } setmetatable( obj_a, { __index = obj_a.__data, __pairs = tbl_pairs, } ) local obj_b = { __data = { ["7"] = 8, ["9"] = 10, ["11"] = obj_a, } } setmetatable( obj_b, { __index = obj_b.__data, __pairs = tbl_pairs, } ) local metaarray = setmetatable({ n = 5 }, { __len = function(self) return self.n end, __index = function(self, idx) return tostring(idx) end, }) b = bson.encode { a = 1, b = true, c = bson.null, d = { 1,2,3,4 }, e = bson.binary "hello", f = bson.regex ("*","i"), g = bson.regex "hello", h = bson.date (os.time()), i = bson.timestamp(os.time()), j = bson.objectid(), k = { a = false, b = true }, l = {}, m = bson.minkey, n = bson.maxkey, o = sub, p = 2^32-1, q = obj_b, r = metaarray, } print "\n[before replace]" t = b:decode() for k, v in pairs(t) do print(k,type(v)) end for k,v in ipairs(t.r) do print(k,v) end b:makeindex() b.a = 2 b.b = false b.h = bson.date(os.time()) b.i = bson.timestamp(os.time()) b.j = bson.objectid() print "\n[after replace]" t = b:decode() print("o.hello", bson.type(t.o.hello))
mit
AbolDalton/king
plugins/anti_spam.lua
191
5291
--An empty table for solving multiple kicking problem(thanks to @topkecleon ) kicktable = {} do local TIME_CHECK = 2 -- seconds -- Save stats, ban user local function pre_process(msg) -- Ignore service msg if msg.service then return msg end if msg.from.id == our_id then return msg end -- Save user on Redis if msg.from.type == 'user' then local hash = 'user:'..msg.from.id print('Saving user', hash) if msg.from.print_name then redis:hset(hash, 'print_name', msg.from.print_name) end if msg.from.first_name then redis:hset(hash, 'first_name', msg.from.first_name) end if msg.from.last_name then redis:hset(hash, 'last_name', msg.from.last_name) end end -- Save stats on Redis if msg.to.type == 'chat' then -- User is on chat local hash = 'chat:'..msg.to.id..':users' redis:sadd(hash, msg.from.id) end -- Save stats on Redis if msg.to.type == 'channel' then -- User is on channel local hash = 'channel:'..msg.to.id..':users' redis:sadd(hash, msg.from.id) end if msg.to.type == 'user' then -- User is on chat local hash = 'PM:'..msg.from.id redis:sadd(hash, msg.from.id) end -- Total user msgs local hash = 'msgs:'..msg.from.id..':'..msg.to.id redis:incr(hash) --Load moderation data local data = load_data(_config.moderation.data) if data[tostring(msg.to.id)] then --Check if flood is on or off if data[tostring(msg.to.id)]['settings']['flood'] == 'no' then return msg end end -- Check flood if msg.from.type == 'user' then local hash = 'user:'..msg.from.id..':msgs' local msgs = tonumber(redis:get(hash) or 0) local data = load_data(_config.moderation.data) local NUM_MSG_MAX = 5 if data[tostring(msg.to.id)] then if data[tostring(msg.to.id)]['settings']['flood_msg_max'] then NUM_MSG_MAX = tonumber(data[tostring(msg.to.id)]['settings']['flood_msg_max'])--Obtain group flood sensitivity end end local max_msg = NUM_MSG_MAX * 1 if msgs > max_msg then local user = msg.from.id local chat = msg.to.id local whitelist = "whitelist" local is_whitelisted = redis:sismember(whitelist, user) -- Ignore mods,owner and admins if is_momod(msg) then return msg end if is_whitelisted == true then return msg end local receiver = get_receiver(msg) if msg.to.type == 'user' then local max_msg = 7 * 1 print(msgs) if msgs >= max_msg then print("Pass2") send_large_msg("user#id"..msg.from.id, "User ["..msg.from.id.."] blocked for spam.") savelog(msg.from.id.." PM", "User ["..msg.from.id.."] blocked for spam.") block_user("user#id"..msg.from.id,ok_cb,false)--Block user if spammed in private end end if kicktable[user] == true then return end delete_msg(msg.id, ok_cb, false) kick_user(user, chat) local username = msg.from.username local print_name = user_print_name(msg.from):gsub("‮", "") local name_log = print_name:gsub("_", "") if msg.to.type == 'chat' or msg.to.type == 'channel' then if username then savelog(msg.to.id, name_log.." @"..username.." ["..msg.from.id.."] kicked for #spam") send_large_msg(receiver , "Flooding is not allowed here\n@"..username.."["..msg.from.id.."]\nStatus: User kicked") else savelog(msg.to.id, name_log.." ["..msg.from.id.."] kicked for #spam") send_large_msg(receiver , "Flooding is not allowed here\nName:"..name_log.."["..msg.from.id.."]\nStatus: User kicked") end end -- incr it on redis local gbanspam = 'gban:spam'..msg.from.id redis:incr(gbanspam) local gbanspam = 'gban:spam'..msg.from.id local gbanspamonredis = redis:get(gbanspam) --Check if user has spammed is group more than 4 times if gbanspamonredis then if tonumber(gbanspamonredis) == 4 and not is_owner(msg) then --Global ban that user banall_user(msg.from.id) local gbanspam = 'gban:spam'..msg.from.id --reset the counter redis:set(gbanspam, 0) if msg.from.username ~= nil then username = msg.from.username else username = "---" end local print_name = user_print_name(msg.from):gsub("‮", "") local name = print_name:gsub("_", "") --Send this to that chat send_large_msg("chat#id"..msg.to.id, "User [ "..name.." ]"..msg.from.id.." globally banned (spamming)") send_large_msg("channel#id"..msg.to.id, "User [ "..name.." ]"..msg.from.id.." globally banned (spamming)") local GBan_log = 'GBan_log' local GBan_log = data[tostring(GBan_log)] for k,v in pairs(GBan_log) do log_SuperGroup = v gban_text = "User [ "..name.." ] ( @"..username.." )"..msg.from.id.." Globally banned from ( "..msg.to.print_name.." ) [ "..msg.to.id.." ] (spamming)" --send it to log group/channel send_large_msg(log_SuperGroup, gban_text) end end end kicktable[user] = true msg = nil end redis:setex(hash, TIME_CHECK, msgs+1) end return msg end local function cron() --clear that table on the top of the plugins kicktable = {} end return { patterns = {}, cron = cron, pre_process = pre_process } end
gpl-2.0
AbolDalton/king
plugins/abohava.lua
2
4795
local function temps(K) local F = (K*1.8)-459.67 local C = K-273.15 return F,C end local function run(msg, matches) local res = http.request("http://api.openweathermap.org/data/2.5/weather?q="..URL.escape(matches[2]).."&appid=269ed82391822cc692c9afd59f4aabba") local jtab = JSON.decode(res) if jtab.name then if jtab.weather[1].main == "Thunderstorm" then status = "طوفاني" elseif jtab.weather[1].main == "Drizzle" then status = "نمنم باران" elseif jtab.weather[1].main == "Rain" then status = "باراني" elseif jtab.weather[1].main == "Snow" then status = "برفي" elseif jtab.weather[1].main == "Atmosphere" then status = "مه - غباز آلود" elseif jtab.weather[1].main == "Clear" then status = "صاف" elseif jtab.weather[1].main == "Clouds" then status = "ابري" elseif jtab.weather[1].main == "Extreme" then status = "-------" elseif jtab.weather[1].main == "Additional" then status = "-------" else status = "-------" end local F1,C1 = temps(jtab.main.temp) local F2,C2 = temps(jtab.main.temp_min) local F3,C3 = temps(jtab.main.temp_max) send_document(get_receiver(msg), "weather/"..jtab.weather[1].icon..".webp", ok_cb, false) if jtab.rain then rain = jtab.rain["3h"].." ميليمتر" else rain = "-----" end if jtab.snow then snow = jtab.snow["3h"].." ميليمتر" else snow = "-----" end today = "هم اکنون دماي هوا در "..jtab.name.."\n" .." "..C1.."° درجه سانتيگراد (سلسيوس)\n" .." "..F1.."° فارنهايت\n" .." "..jtab.main.temp.."° کلوين\n" .."بوده و هوا "..status.." ميباشد\n\n" .."حداقل دماي امروز: C"..C2.."° \n" .."حداکثر دماي امروز: C"..C3.."° \n" .."رطوبت هوا: "..jtab.main.humidity.."% درصد\n" .."مقدار ابر آسمان: "..jtab.clouds.all.."% درصد\n" .."سرعت باد: "..(jtab.wind.speed or "------").."m/s متر بر ثانيه\n" .."جهت باد: "..(jtab.wind.deg or "------").."° درجه\n" .."فشار هوا: "..(jtab.main.pressure/1000).." بار (اتمسفر)\n" .."بارندگي 3ساعت اخير: "..rain.."\n" .."بارش برف 3ساعت اخير: "..snow.."\n\n" after = "" local res = http.request("http://api.openweathermap.org/data/2.5/forecast?q="..URL.escape(matches[2]).."&appid=269ed82391822cc692c9afd59f4aabba") local jtab = JSON.decode(res) for i=1,5 do local F1,C1 = temps(jtab.list[i].main.temp_min) local F2,C2 = temps(jtab.list[i].main.temp_max) if jtab.list[i].weather[1].main == "Thunderstorm" then status = "طوفاني" elseif jtab.list[i].weather[1].main == "Drizzle" then status = "نمنم باران" elseif jtab.list[i].weather[1].main == "Rain" then status = "باراني" elseif jtab.list[i].weather[1].main == "Snow" then status = "برفي" elseif jtab.list[i].weather[1].main == "Atmosphere" then status = "مه - غباز آلود" elseif jtab.list[i].weather[1].main == "Clear" then status = "صاف" elseif jtab.list[i].weather[1].main == "Clouds" then status = "ابري" elseif jtab.list[i].weather[1].main == "Extreme" then status = "-------" elseif jtab.list[i].weather[1].main == "Additional" then status = "-------" else status = "-------" end local file = io.open("./file/weatherIcon/"..jtab.list[i].weather[1].icon..".char") if file then local file = io.open("./file/weatherIcon/"..jtab.list[i].weather[1].icon..".char", "r") icon = file:read("*all") else icon = "" end if i == 1 then day = "فردا هوا " elseif i == 2 then day = "پس فردا هوا " elseif i == 3 then day = "3روز بعد هوا " elseif i == 4 then day = "4روز بعد هوا " elseif i == 5 then day = "5روز بعد هوا " end after = after.."- "..day..status.." ميباشد. "..icon.."\n🔺C"..C2.."° \n🔻C"..C1.."° \n" end return today.."وضعيت آب و هوا در سه روز آينده:\n"..after.."\n\n@Tele_Mega" else return "مکان وارد شده صحيح نيست" end end return { description = "Weather Status", usagehtm = '<tr><td align="center">weather شهر</td><td align="right">اين پلاگين به شما اين امکان را ميدهد که به کاملترين شکل ممکن از وضعيت آب و هواي شهر مورد نظر آگاه شويد همپنين اطلاعات آب و هواي پنجج روز آينده نيز اراه ميشود. دقت کنيد نام شهر را لاتين وارد کنيد</td></tr>', usage = {"weather (city) : وضعيت آب و هوا"}, patterns = {"^[!/]([Ww]eather) (.*)$"}, run = run, }
gpl-2.0
Noneatme/mta-lostresources
[gamemodes]/Multistunt/main/stunts/server/airport/cars.lua
1
12296
local liftcar = {} local car = {} -- einfach so rumstehende liftcar[1] = createVehicle(451, -1394.716796875, -257.779296875, 25.14368057251, 359.53308105469, 359.99450683594, 50.707397460938) -- Turismo liftcar[2] = createVehicle(451, -1396.5302734375, -259.9296875, 25.142911911011, 359.53857421875, 0, 49.493408203125) -- Turismo liftcar[3] = createVehicle(451, -1398.607421875, -262.45703125, 25.144889831543, 359.53308105469, 359.99450683594, 51.13037109375) -- Turismo liftcar[4] = createVehicle(411, -1400.52734375, -264.9892578125, 25.164575576782, 0, 0, 48.5595703125) -- Infernus liftcar[5] = createVehicle(411, -1402.6787109375, -267.6474609375, 25.164573669434, 0, 0, 48.158569335938) -- Infernus liftcar[6] = createVehicle(411, -1404.724609375, -270.05078125, 25.164653778076, 0, 0, 49.202270507813) -- Infernus liftcar[7] = createVehicle(411, -1406.951171875, -272.5888671875, 25.165079116821, 0, 0, 52.943115234375) -- Infernus liftcar[8] = createVehicle(480, -1408.955078125, -275.0537109375, 25.209121704102, 359.736328125, 359.99450683594, 47.565307617188) -- Comet liftcar[9] = createVehicle(480, -1411.0634765625, -277.357421875, 25.209945678711, 359.736328125, 0, 48.619995117188) -- Comet liftcar[10] = createVehicle(480, -1413.3857421875, -280.0986328125, 25.209503173828, 359.736328125, 0, 49.647216796875) -- Comet liftcar[11] = createVehicle(480, -1415.3701171875, -282.5673828125, 25.211093902588, 359.74182128906, 0, 53.256225585938) -- Comet liftcar[12] = createVehicle(480, -1417.8212890625, -285.427734375, 25.211019515991, 359.74182128906, 0, 49.257202148438) -- Comet car[1] = createVehicle(411, -1404.5380859375, -235.1767578125, 13.875508308411, 0, 0, 328.65051269531) -- Infernus car[2] = createVehicle(411, -1401.173828125, -237.779296875, 13.875513076782, 0, 0, 322.90466308594) -- Infernus car[3] = createVehicle(411, -1397.26953125, -241.189453125, 13.8755235672, 0, 0, 326.59606933594) -- Infernus car[4] = createVehicle(411, -1391.080078125, -245.78125, 13.871929168701, 0.032958984375, 0.06591796875, 324.77233886719) -- Infernus car[5] = createVehicle(451, -1382.7666015625, -251.50390625, 13.850735664368, 359.53308105469, 359.99450683594, 310.869140625) -- Turismo car[6] = createVehicle(451, -1379.85546875, -255.2734375, 13.850296020508, 359.53308105469, 0, 320.30090332031) -- Turismo car[7] = createVehicle(451, -1375.0009765625, -259.3369140625, 13.850509643555, 359.52758789063, 0.032958984375, 316.68640136719) -- Turismo car[8] = createVehicle(451, -1372.6953125, -262.0517578125, 13.852767944336, 359.50561523438, 359.96154785156, 307.44140625) -- Turismo car[9] = createVehicle(451, -1369.2998046875, -265.7587890625, 13.855900764465, 359.52758789063, 359.9560546875, 317.52685546875) -- Turismo car[10] = createVehicle(522, -1340.9697265625, -211.03125, 13.720824241638, 358.99475097656, 359.99450683594, 177.25341796875) -- NRG-500 car[11] = createVehicle(522, -1339.365234375, -211.1865234375, 13.722512245178, 359.23645019531, 359.99450683594, 166.45935058594) -- NRG-500 car[12] = createVehicle(522, -1337.9482421875, -211.52734375, 13.72275352478, 359.02221679688, 0.0054931640625, 164.44885253906) -- NRG-500 car[13] = createVehicle(522, -1336.8818359375, -211.982421875, 13.724202156067, 358.84094238281, 359.99450683594, 155.64331054688) -- NRG-500 car[14] = createVehicle(522, -1335.419921875, -212.0322265625, 13.721248626709, 0.087890625, 359.97253417969, 161.77917480469) -- NRG-500 car[15] = createVehicle(522, -1334.1650390625, -212.3134765625, 13.724352836609, 359.02770996094, 359.99450683594, 163.50952148438) -- NRG-500 car[16] = createVehicle(522, -1328.7333984375, -134.0859375, 13.722295761108, 359.89013671875, 0, 95.707397460938) -- NRG-500 car[17] = createVehicle(522, -1314.3369140625, -135.6015625, 13.702938079834, 357.85217285156, 359.96154785156, 267.61596679688) -- NRG-500 car[18] = createVehicle(522, -1315.0556640625, -125.228515625, 13.713015556335, 358.30810546875, 359.99450683594, 94.50439453125) -- NRG-500 car[19] = createVehicle(522, -1327.8662109375, -126.23828125, 13.741177558899, 358.85192871094, 0, 94.50439453125) -- NRG-500 car[20] = createVehicle(480, -1357.28515625, -158.5849609375, 13.92249584198, 359.74182128906, 0.010986328125, 331.962890625) -- Comet car[21] = createVehicle(480, -1360.833984375, -151.7216796875, 13.921065330505, 359.73083496094, 0, 297.82287597656) -- Comet car[22] = createVehicle(480, -1363.2001953125, -148.3916015625, 13.919672966003, 359.73083496094, 359.99450683594, 303.33251953125) -- Comet car[23] = createVehicle(480, -1364.634765625, -145.728515625, 13.922396659851, 359.74182128906, 359.98901367188, 302.33825683594) -- Comet car[24] = createVehicle(480, -1366.140625, -143.140625, 13.923365592957, 359.75830078125, 0.010986328125, 299.82788085938) -- Comet car[25] = createVehicle(480, -1367.583984375, -140.7685546875, 13.921555519104, 359.71984863281, 0, 300.26184082031) -- Comet car[26] = createVehicle(480, -1369.0361328125, -138.2548828125, 13.920283317566, 359.73083496094, 359.9560546875, 300.44311523438) -- Comet car[27] = createVehicle(480, -1370.3701171875, -135.4931640625, 13.921028137207, 359.736328125, 0, 298.44360351563) -- Comet car[28] = createVehicle(480, -1371.9912109375, -132.9296875, 13.922368049622, 359.74182128906, 359.99450683594, 300.7177734375) -- Comet car[29] = createVehicle(480, -1371.9912109375, -132.9296875, 13.922368049622, 359.74182128906, 0, 300.7177734375) -- Comet car[30] = createVehicle(541, -1373.798828125, -129.8212890625, 13.773409843445, 359.5166015625, 359.97253417969, 296.52648925781) -- Bullet car[31] = createVehicle(541, -1374.75, -127.296875, 13.773162841797, 359.50012207031, 359.97253417969, 297.421875) -- Bullet car[32] = createVehicle(541, -1382.9482421875, -116.9482421875, 13.773177146912, 359.51110839844, 0.0054931640625, 32.025146484375) -- Bullet car[33] = createVehicle(541, -1387.357421875, -109.46875, 13.773262023926, 359.51110839844, 0, 30.003662109375) -- Bullet car[34] = createVehicle(541, -1335.8876953125, -24.685546875, 13.773493766785, 359.50561523438, 359.94506835938, 75.833129882813) -- Bullet car[35] = createVehicle(541, -1324.7158203125, -45.9462890625, 13.773273468018, 359.5166015625, 0.0164794921875, 199.51171875) -- Bullet car[36] = createVehicle(541, -1321.1142578125, -52.7939453125, 13.773312568665, 359.50561523438, 0, 207.05383300781) -- Bullet car[37] = createVehicle(444, -1213.6259765625, -123.216796875, 14.517558097839, 0.0604248046875, 359.99450683594, 130.02319335938) -- Monster 1v car[38] = createVehicle(444, -1221.2041015625, -129.3017578125, 14.519762992859, 0, 0, 128.97399902344) -- Monster 1 car[39] = createVehicle(444, -1210.9326171875, -127.7119140625, 14.515151023865, 0.0054931640625, 359.76928710938, 154.82482910156) -- Monster 1 car[40] = createVehicle(444, -1218.3974609375, -134.787109375, 14.519737243652, 359.96154785156, 0, 134.12658691406) -- Monster 1 car[41] = createVehicle(556, -1207.7412109375, -134.048828125, 14.520263671875, 0.0439453125, 359.97802734375, 154.5556640625) -- Monster 2 car[42] = createVehicle(556, -1201.419921875, -136.7412109375, 14.521766662598, 359.98352050781, 0.0054931640625, 123.29956054688) -- Monster 2 car[43] = createVehicle(556, -1198.4404296875, -142.5341796875, 14.51934337616, 0, 0, 113.71398925781) -- Monster 2 car[44] = createVehicle(556, -1201.875, -150.38671875, 14.522372245789, 0.054931640625, 0.054931640625, 53.827514648438) -- Monster 2 car[45] = createVehicle(539, -1212.4169921875, -140.88671875, 13.516910552979, 359.62097167969, 359.17053222656, 147.26623535156) -- Vortex car[46] = createVehicle(539, -1209.8603515625, -146.783203125, 13.507345199585, 0.120849609375, 0.120849609375, 154.87426757813) -- Vortex car[47] = createVehicle(468, -1317.4169921875, -199.7294921875, 13.815145492554, 359.81872558594, 359.99450683594, 78.46435546875) -- Sanchez car[48] = createVehicle(468, -1325.2041015625, -198.2080078125, 13.814884185791, 0.0274658203125, 359.98901367188, 81.029663085938) -- Sanchez car[49] = createVehicle(468, -1332.765625, -197.208984375, 13.815965652466, 359.21447753906, 359.99450683594, 82.496337890625) -- Sanchez car[50] = createVehicle(468, -1336.29296875, -211.4404296875, 13.815237045288, 0.340576171875, 359.96704101563, 258.18969726563) -- Sanchez car[51] = createVehicle(468, -1340.97265625, -210.06640625, 13.816826820374, 0.6976318359375, 0.010986328125, 259.85961914063) -- Sanchez car[52] = createVehicle(468, -1322.2548828125, -214.841796875, 13.816783905029, 0.4998779296875, 359.99450683594, 250.42236328125) -- Sanchez car[53] = createVehicle(468, -1317.3330078125, -216.5908203125, 13.814199447632, 0.4010009765625, 359.99450683594, 250.42236328125) -- Sanchez car[54] = createVehicle(468, -1310.66796875, -216.7822265625, 13.816697120667, 359.28588867188, 359.99450683594, 337.95043945313) -- Sanchez car[55] = createVehicle(468, -1372.2197265625, -190.1416015625, 13.815312385559, 359.87365722656, 0.0439453125, 242.17712402344) -- Sanchez car[56] = createVehicle(468, -1372.1923828125, -188.65234375, 13.815075874329, 359.80224609375, 0, 245.41809082031) -- Sanchez car[57] = createVehicle(468, -1371.7568359375, -187.7451171875, 13.817624092102, 359.85168457031, 359.98901367188, 242.40234375) -- Sanchez car[58] = createVehicle(468, -1371.0458984375, -186.7333984375, 13.817604064941, 359.89013671875, 359.96154785156, 245.00610351563) -- Sanchez car[59] = createVehicle(468, -1370.5869140625, -185.734375, 13.817420005798, 0.0164794921875, 359.9560546875, 239.3701171875) -- Sanchez car[60] = createVehicle(522, -1376.302734375, -197.564453125, 13.717838287354, 358.98376464844, 359.99450683594, 240.63354492188) -- NRG-500 car[61] = createVehicle(522, -1375.685546875, -196.4736328125, 13.715802192688, 359.27490234375, 0.0054931640625, 240.99609375) -- NRG-500 car[62] = createVehicle(522, -1375.025390625, -195.640625, 13.714548110962, 359.03869628906, 359.97802734375, 247.90649414063) -- NRG-500 car[63] = createVehicle(522, -1374.1728515625, -195.2353515625, 13.720200538635, 359.48364257813, 359.98901367188, 238.32092285156) -- NRG-500 car[64] = createVehicle(522, -1374.2783203125, -193.99609375, 13.728161811829, 359.27490234375, 0, 234.67895507813) -- NRG-500 car[65] = createVehicle(522, -1319.5107421875, -279.419921875, 13.716691017151, 359.51110839844, 0.0164794921875, 12.3486328125) -- NRG-500 car[66] = createVehicle(522, -1318.5595703125, -282.8623046875, 13.720718383789, 0.0494384765625, 359.98352050781, 20.555419921875) -- NRG-500 car[67] = createVehicle(522, -1326.9326171875, -283.9287109375, 13.717542648315, 359.04968261719, 359.99450683594, 48.790283203125) -- NRG-500 car[68] = createVehicle(522, -1323.724609375, -286.5458984375, 13.716648101807, 359.35729980469, 359.97253417969, 49.476928710938) -- NRG-500 car[69] = createVehicle(582, -1338.86328125, -308.0888671875, 14.210793495178, 359.58251953125, 0, 289.33044433594) -- Newsvan car[70] = createVehicle(582, -1328.5029296875, -304.875, 14.201406478882, 359.44519042969, 0.0714111328125, 289.52270507813) -- Newsvan car[71] = createVehicle(582, -1318.060546875, -301.0693359375, 14.205302238464, 359.37377929688, 359.86267089844, 290.02258300781) -- Newsvan car[72] = createVehicle(409, -1323.58984375, -298.921875, 13.947038650513, 359.97802734375, 359.89562988281, 290.9619140625) -- Stretch7 for v = 1, #car, 1 do setVehicleColor(car[v], math.random(50, 250), math.random(50, 250), math.random(20, 60), 0, 0, 0) setElementData(car[v], "mv.typ", "Freecar") setElementData(car[v], "mv.besitzer", "-") setElementData(car[v], "mv.stuntcar", "airportsf") toggleVehicleRespawn ( car[v], true ) setVehicleRespawnDelay ( car[v], 5000 ) setVehicleIdleRespawnDelay ( car[v], IdleCarRespawn*1000*60 ) giveVehicleBetterEngine(car[v]) giveVehiclePanzerung(car[v]) end for v = 1, #liftcar, 1 do setVehicleColor(liftcar[v], 0, 255, math.random(20, 60), 0, 0, 0) setElementData(liftcar[v], "mv.typ", "Freecar") setElementData(liftcar[v], "mv.besitzer", "-") setElementData(liftcar[v], "mv.stuntcar", "airportsf") toggleVehicleRespawn ( liftcar[v], true ) setVehicleRespawnDelay ( liftcar[v], 5000 ) setVehicleIdleRespawnDelay ( liftcar[v], IdleCarRespawn*1000*60 ) giveVehicleBetterEngine(liftcar[v]) giveVehiclePanzerung(liftcar[v]) end
gpl-2.0
zaully/cr0w13y_rp
crgunshops/server/server_gunshops.lua
1
1975
carriedWeapons = {} armory = {} function TableSize(map) local count = 0 if map ~= nil then for _ in pairs(map) do count = count + 1 end end return count end local function SavePlayerWeaponInventory(identifier, carried) local jsonString = '{}' if TableSize(carried) > 0 then jsonString = json.encode(carried) end debugp(jsonString) MySQL.Async.execute("update users set cr_carried_weapons=@carried WHERE identifier = @identifier", { ['@carried'] = jsonString, ['@identifier'] = identifier}, function (result) end) end local function StreamWeaponPrices(src) TriggerClientEvent('cr:receiveWeaponPrices', src, kWeaponPrices) end function UpdatePlayerCarriedWeapons(identifier, carried) for k in pairs(carriedWeapons[identifier]) do carriedWeapons[identifier][k] = nil end for k, v in pairs(carried) do carriedWeapons[identifier][k] = v end SavePlayerWeaponInventory(identifier, carried) end AddEventHandler('ws:giveweapons', function(src) TriggerClientEvent('cr:removeAllWeapons', src) local identifier = getPlayerIDFromSource(src) if carriedWeapons[identifier] then for k, v in pairs(carriedWeapons[identifier]) do carriedWeapons[identifier][k] = v TriggerClientEvent('cr:giveAmmo', src, k, v) end end end) AddEventHandler('cr:playerSignedIn', function(identifier, record, src) TriggerClientEvent('cr:removeAllWeapons', src) carriedWeapons[identifier] = {} if (record.cr_carried_weapons) then local carried = json.decode(record.cr_carried_weapons) if carried then for k, v in pairs(carried) do carriedWeapons[identifier][k] = v TriggerClientEvent('cr:giveAmmo', src, k, v) end end end StreamWeaponPrices(src) end) AddEventHandler('cr:playerLoggedOff', function(identifier) SavePlayerWeaponInventory(identifier, carriedWeapons[identifier]) carriedWeapons[identifier] = {} end)
mit
FliPPeh/Gibbous
scheme/builtins/typeconv.lua
1
2727
local m = {} local util = require "scheme.util" local types = require "scheme.types" local expect = util.expect local expect_argc = util.expect_argc local number_new = types.number.new local char_new = types.char.new local str_new = types.str.new local list_new = types.list.new local bool_new = types.boolean.new --[[ -- Type stuff --]] local function is_type(typ) return function(self, env, args) expect_argc(self, 1, #args) return bool_new(args[1].type == typ) end end for i, t in ipairs{ "symbol", "pair", "list", "number", "string", "boolean", "char", "procedure", "port", "eof-object", "error"} do m[t .. "?"] = is_type(t) end -- Special functions for input and output ports m["input-port?"] = function(self, env, args) expect_argc(self, 1, #args) return bool_new(args[1].type == "port" and args[1].mode == "r") end m["output-port?"] = function(self, env, args) expect_argc(self, 1, #args) return bool_new(args[1].type == "port" and args[1].mode == "w") end m["type"] = function(self, env, args) expect_argc(self, 1, #args) return str_new(args[1].type) end m["symbol->string"] = function(self, env, args) expect_argc(self, 1, #args) expect(args[1], "symbol") return str_new(args[1]:getval()) end m["string->symbol"] = function(self, env, args) expect_argc(self, 1, #args) expect(args[1], "string") return env:intern(args[1]:getval()) end m["list->string"] = function(self, env, args) expect_argc(self, 1, #args) expect(args[1], "list") local buf = "" for i, c in ipairs(args[1]:getval()) do expect(c, "char") buf = buf .. c:getval() end return str_new(buf) end m["string->list"] = function(self, env, args) expect_argc(self, 1, #args) expect(args[1], "string") local ls = {} for i = 1, #args[1]:getval() do table.insert(ls, char_new(args[1]:getval():sub(i, i))) end return list_new(ls) end m["number->string"] = function(self, env, args) expect_argc(self, 1, #args) expect(args[1], "number") return str_new(tonumber(args[1]:getval())) end m["string->number"] = function(self, env, args) expect_argc(self, 1, #args) expect(args[1], "string") return number_new(tostring(args[1]:getval())) end m["char->integer"] = function(self, env, args) expect_argc(self, 1, #args) expect(args[1], "char") return number_new(args[1]:getval():byte(1)) end m["integer->char"] = function(self, env, args) expect_argc(self, 1, #args) expect(args[1], "number") return char_new(string.char(args[1]:getval())) end return m
bsd-2-clause
Team-CC-Corp/JVML-JIT
CCLib/src/java/lang/native/Method.lua
2
4207
natives["java.lang.reflect.Method"] = natives["java.lang.reflect.Method"] or {} natives["java.lang.reflect.Method"]["invoke(Ljava/lang/Object;[Ljava/lang/Object;)Ljava/lang/Object;"] = function(this, target, args) local methodName = toLString(getObjectField(this, "name")) local class if target then class = target[1] else local declaringClass = getObjectField(this, "declaringClass") local className = toLString(getObjectField(declaringClass, "name")) class = classByName(className) end local mt = assert(findMethod(class, methodName), "Couldn't find method: " .. methodName .. " in class: " .. class.name) -- Check static assert((target == nil) == (bit.band(mt.acc, METHOD_ACC.STATIC) > 0), "Mismatch in target or static invocation") local newArgs = {target} -- if target is nil, this array is empty so no work needed there for i=1, #mt.desc-1 do -- last is return value local newArg local v = mt.desc[i] if v.array_depth == 0 and not v.type:find("^L") then -- primitive. Time to unbox! newArg = getObjectField(args[5][i], "value") -- sidestep the need to check each type for the typeValue() call else newArg = args[5][i] end table.insert(newArgs, newArg) end local ret = mt[1](unpack(newArgs)) local retType = mt.desc[#mt.desc] if retType.array_depth == 0 and not retType.type:find("^L") and retType.type ~= "V" then -- return type is primitive. Need to box the primitive to return Object ret = wrapPrimitive(ret, retType.type) end return ret end natives["java.lang.reflect.Method"]["getAnnotation(Ljava/lang/Class;)Ljava/lang/annotation/Annotation;"] = function(this, annot) local declaringClass = getObjectField(this, "declaringClass") local thisClassName = toLString(getObjectField(declaringClass, "name")) local thisClass = classByName(thisClassName) local methodName = toLString(getObjectField(this, "name")) local mt = assert(findMethod(thisClass, methodName), "Couldn't find method: " .. methodName) local annotClassName = toLString(getObjectField(annot, "name")) return findMethodAnnotation(mt, classByName(annotClassName)) end natives["java.lang.reflect.Method"]["getParameterTypes()[Ljava/lang/Class;"] = function(this) local methodName = toLString(getObjectField(this, "name")) local declaringClass = getObjectField(this, "declaringClass") local className = toLString(getObjectField(declaringClass, "name")) local class = classByName(className) local mt = assert(findMethod(class, methodName), "Couldn't find method: " .. methodName) local arr = newArray(getArrayClass("[java.lang.Class;"), #mt.desc - 1) for i=1, #mt.desc-1 do -- last is return value, first is target local class local type = mt.desc[i].type if type:find("^L") then class = getJClass(type:gsub("^L", ""):gsub(";$", ""):gsub("/", ".")) elseif type:find("^[") then class = getJClass(type:gsub("/", ".")) elseif type:find("^B") then class = getJClass("byte") elseif type:find("^C") then class = getJClass("char") elseif type:find("^D") then class = getJClass("double") elseif type:find("^F") then class = getJClass("float") elseif type:find("^I") then class = getJClass("int") elseif type:find("^J") then class = getJClass("long") elseif type:find("^S") then class = getJClass("short") elseif type:find("^Z") then class = getJClass("boolean") end arr[5][i] = class end return arr end natives["java.lang.reflect.Method"]["getParameterCount()I"] = function(this) local methodName = toLString(getObjectField(this, "name")) local declaringClass = getObjectField(this, "declaringClass") local className = toLString(getObjectField(declaringClass, "name")) local class = classByName(className) local mt = assert(findMethod(class, methodName), "Couldn't find method: " .. methodName) return #mt.desc - 1 end
mit
AbolDalton/king
plugins/op.lua
1
1674
local function run(msg, matches) if is_momod(msg) then return end local data = load_data(_config.moderation.data) if data[tostring(msg.to.id)] then if data[tostring(msg.to.id)]['settings'] then if data[tostring(msg.to.id)]['settings']['operator'] then lock_operator = data[tostring(msg.to.id)]['settings']['operator'] end end end local chat = get_receiver(msg) local user = "user#id"..msg.from.id if lock_operator == "yes" then delete_msg(msg.id, ok_cb, true) end end return { patterns = { "شارژ(.*)", "ایرانسل(.*)", "irancell(.*)", "ir-mci(.*)", "RighTel(.*)", "همراه اول(.*)", "رایتل(.*)", "تالیا.(.*)", 'بسته.(.*)", "اینترنت.(.*)", }, run = run } local function run(msg, matches) if is_momod(msg) then return end local data = load_data(_config.moderation.data) if data[tostring(msg.to.id)] then if data[tostring(msg.to.id)]['settings'] then if data[tostring(msg.to.id)]['settings']['operator'] then lock_operator = data[tostring(msg.to.id)]['settings']['operator'] end end end local chat = get_receiver(msg) local user = "user#id"..msg.from.id if lock_operator == "yes" then delete_msg(msg.id, ok_cb, true) end end return { patterns = { "شارژ(.*)", "ایرانسل(.*)", "irancell(.*)", "ir-mci(.*)", "RighTel(.*)", "همراه اول(.*)", "رایتل(.*)", "تالیا.(.*)", "بسته.(.*)", "اینترنت.(.*)", }, run = run }
gpl-2.0
Ettercap/ettercap
src/lua/share/third-party/stdlib/mkrockspecs.lua
12
1359
-- Generate rockspecs from a prototype with variants require "std" if select ("#", ...) < 2 then io.stderr:write "Usage: mkrockspecs PACKAGE VERSION\n" os.exit () end package_name = select (1, ...) version = select (2, ...) function format (x, indent) indent = indent or "" if type (x) == "table" then local s = "{\n" for i, v in pairs (x) do if type (i) ~= "number" then s = s..indent..i.." = "..format (v, indent.." ")..",\n" end end for i, v in ipairs (x) do s = s..indent..format (v, indent.." ")..",\n" end return s..indent:sub (1, -3).."}" elseif type (x) == "string" then return string.format ("%q", x) else return tostring (x) end end for f, spec in pairs (loadfile ("rockspecs.lua") ()) do if f ~= "default" then local specfile = package_name.."-"..(f ~= "" and f:lower ().."-" or "")..version.."-2.rockspec" h = io.open (specfile, "w") assert (h) flavour = f -- a global, visible in loadfile local specs = loadfile ("rockspecs.lua") () -- reload to get current flavour interpolated local spec = tree.merge (tree.new (specs.default), tree.new (specs[f])) local s = "" for i, v in pairs (spec) do s = s..i.." = "..format (v, " ").."\n" end h:write (s) h:close () os.execute ("luarocks lint " .. specfile) end end
gpl-2.0
luadch/luadch
lua/test/sort.lua
889
1494
-- two implementations of a sort function -- this is an example only. Lua has now a built-in function "sort" -- extracted from Programming Pearls, page 110 function qsort(x,l,u,f) if l<u then local m=math.random(u-(l-1))+l-1 -- choose a random pivot in range l..u x[l],x[m]=x[m],x[l] -- swap pivot to first position local t=x[l] -- pivot value m=l local i=l+1 while i<=u do -- invariant: x[l+1..m] < t <= x[m+1..i-1] if f(x[i],t) then m=m+1 x[m],x[i]=x[i],x[m] -- swap x[i] and x[m] end i=i+1 end x[l],x[m]=x[m],x[l] -- swap pivot to a valid place -- x[l+1..m-1] < x[m] <= x[m+1..u] qsort(x,l,m-1,f) qsort(x,m+1,u,f) end end function selectionsort(x,n,f) local i=1 while i<=n do local m,j=i,i+1 while j<=n do if f(x[j],x[m]) then m=j end j=j+1 end x[i],x[m]=x[m],x[i] -- swap x[i] and x[m] i=i+1 end end function show(m,x) io.write(m,"\n\t") local i=1 while x[i] do io.write(x[i]) i=i+1 if x[i] then io.write(",") end end io.write("\n") end function testsorts(x) local n=1 while x[n] do n=n+1 end; n=n-1 -- count elements show("original",x) qsort(x,1,n,function (x,y) return x<y end) show("after quicksort",x) selectionsort(x,n,function (x,y) return x>y end) show("after reverse selection sort",x) qsort(x,1,n,function (x,y) return x<y end) show("after quicksort again",x) end -- array to be sorted x={"Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"} testsorts(x)
gpl-3.0
reesun/redis-2.8
deps/lua/test/sort.lua
889
1494
-- two implementations of a sort function -- this is an example only. Lua has now a built-in function "sort" -- extracted from Programming Pearls, page 110 function qsort(x,l,u,f) if l<u then local m=math.random(u-(l-1))+l-1 -- choose a random pivot in range l..u x[l],x[m]=x[m],x[l] -- swap pivot to first position local t=x[l] -- pivot value m=l local i=l+1 while i<=u do -- invariant: x[l+1..m] < t <= x[m+1..i-1] if f(x[i],t) then m=m+1 x[m],x[i]=x[i],x[m] -- swap x[i] and x[m] end i=i+1 end x[l],x[m]=x[m],x[l] -- swap pivot to a valid place -- x[l+1..m-1] < x[m] <= x[m+1..u] qsort(x,l,m-1,f) qsort(x,m+1,u,f) end end function selectionsort(x,n,f) local i=1 while i<=n do local m,j=i,i+1 while j<=n do if f(x[j],x[m]) then m=j end j=j+1 end x[i],x[m]=x[m],x[i] -- swap x[i] and x[m] i=i+1 end end function show(m,x) io.write(m,"\n\t") local i=1 while x[i] do io.write(x[i]) i=i+1 if x[i] then io.write(",") end end io.write("\n") end function testsorts(x) local n=1 while x[n] do n=n+1 end; n=n-1 -- count elements show("original",x) qsort(x,1,n,function (x,y) return x<y end) show("after quicksort",x) selectionsort(x,n,function (x,y) return x>y end) show("after reverse selection sort",x) qsort(x,1,n,function (x,y) return x<y end) show("after quicksort again",x) end -- array to be sorted x={"Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"} testsorts(x)
bsd-3-clause
Justinon/LorePlay
unused/LoreChat/LoreChat.lua
1
4775
local LoreChat = LorePlay LoreChat.tabName = "|c8c7037LoreChat" local tabs = {} --[[ CREATE A FUNCTION FOR SETTINGS ON WHETHER TO ENABLE OR DISABLE ZONE IN LORECHAT TAB ]] -- function LoreChat.UpdateChannelTypesForTab(containerNumber, tabIndex) -- Recycling English Zone as the Roleplay/LoreChat tab since not popular tabs[tabIndex].isEnZoneChecked = IsChatContainerTabCategoryEnabled(containerNumber, tabIndex, CHAT_CATEGORY_ZONE_ENGLISH) tabs[tabIndex].isZoneChecked = IsChatContainerTabCategoryEnabled(containerNumber, tabIndex, CHAT_CATEGORY_ZONE) tabs[tabIndex].isSayChecked = IsChatContainerTabCategoryEnabled(containerNumber, tabIndex, CHAT_CATEGORY_SAY) tabs[tabIndex].isTellChecked = IsChatContainerTabCategoryEnabled(containerNumber, tabIndex, CHAT_CATEGORY_WHISPER_INCOMING) tabs[tabIndex].isYellChecked = IsChatContainerTabCategoryEnabled(containerNumber, tabIndex, CHAT_CATEGORY_YELL) tabs[tabIndex].isNPCChecked = IsChatContainerTabCategoryEnabled(containerNumber, tabIndex, CHAT_CATEGORY_MONSTER_SAY) end function LoreChat.UpdateTabInfo(containerNumber) local numContainerTabs = GetNumChatContainerTabs(containerNumber) for tabIndex = 1, numContainerTabs, 1 do tabs[tabIndex] = {} tabs[tabIndex].name, tabs[tabIndex].isLocked, tabs[tabIndex].isInteractable, tabs[tabIndex].isCombatLog, tabs[tabIndex].areTimestampsEnabled = GetChatContainerTabInfo(1, tabIndex) LoreChat.UpdateChannelTypesForTab(containerNumber, tabIndex) end end function LoreChat.DoesLoreChatTabExist(containerNumber) local numContainerTabs = GetNumChatContainerTabs(containerNumber) -- Basic checks that should be good enough to not conflict with other's addons for tabIndex = 1, numContainerTabs, 1 do if (tabs[tabIndex].name == LoreChat.tabName) then return true end end return false end function LoreChat.AddChatChannelSwitch(desiredCommandAlias, existingCommand) CHAT_SYSTEM.switchLookup[desiredCommandAlias] = CHAT_SYSTEM.switchLookup[existingCommand] end --[[ Zone OFF by default, EnZone ON be default]] function LoreChat.SetLoreChatTabSettings(containerNumber) local numContainerTabs = GetNumChatContainerTabs(containerNumber) for tabIndex = 1, numContainerTabs, 1 do local loreTab = tabs[tabIndex] if loreTab.name == LoreChat.tabName then if not loreTab.isEnZoneChecked then SetChatContainerTabCategoryEnabled(containerNumber, tabIndex, CHAT_CATEGORY_ZONE_ENGLISH, true) end if loreTab.isZoneChecked then SetChatContainerTabCategoryEnabled(containerNumber, tabIndex, CHAT_CATEGORY_ZONE, false) end if not loreTab.isSayChecked then SetChatContainerTabCategoryEnabled(containerNumber, tabIndex, CHAT_CATEGORY_SAY, true) end if not loreTab.isTellChecked then SetChatContainerTabCategoryEnabled(containerNumber, tabIndex, CHAT_CATEGORY_WHISPER_INCOMING, true) end if not loreTab.isYellChecked then SetChatContainerTabCategoryEnabled(containerNumber, tabIndex, CHAT_CATEGORY_YELL, true) end if not loreTab.isNPCChecked then SetChatContainerTabCategoryEnabled(containerNumber, tabIndex, CHAT_CATEGORY_MONSTER_SAY, true) end break end end end -- Function to enforce certain features for the LoreChat tab, such as EnZone and Say channels being checked function LoreChat.ConfigureLoreChat(containerNumber) LoreChat.SetLoreChatTabSettings(containerNumber) local channelInfo = ZO_ChatSystem_GetChannelInfo() channelInfo[CHAT_CHANNEL_ZONE_LANGUAGE_1].name = "Roleplay" --ResetChatCategoryColorToDefault(CHAT_CATEGORY_CODE) SetChatCategoryColor(CHAT_CATEGORY_ZONE_ENGLISH, .55, .44, .21) LoreChat.AddChatChannelSwitch("/rp", "/enzone") LoreChat.AddChatChannelSwitch("/roleplay", "/enzone") LoreChat.AddChatChannelSwitch("/lorechat", "/enzone") LoreChat.AddChatChannelSwitch("/loreplay", "/enzone") end function LoreChat.ShiftChatTabs(containerNumber) local numContainerTabs = GetNumChatContainerTabs(containerNumber) local nextTab for currTab = (numContainerTabs-1), 1, -1 do nextTab = (currTab + 1) -- "Transfer" exchanges tabs, therefore bubbling LoreChat to the front TransferChatContainerTab(containerNumber, currTab, containerNumber, nextTab) end LoreChat.UpdateTabInfo(containerNumber) end function LoreChat.CreateLoreChatTab(containerNumber) AddChatContainerTab(containerNumber, LoreChat.tabName, false) LoreChat.ShiftChatTabs(containerNumber) LoreChat.ConfigureLoreChat(containerNumber) end function LoreChat.InitializeChat() -- Passing in 1 to just update the primary chat container for our purposes LoreChat.UpdateTabInfo(1) if (not LoreChat.DoesLoreChatTabExist(1)) then LoreChat.CreateLoreChatTab(1) elseif(LoreChat.DoesLoreChatTabExist(1)) then LoreChat.ConfigureLoreChat(1) end end LorePlay = LoreChat
artistic-2.0
uzlonewolf/proxmark3
client/scripts/tnp3dump.lua
6
7183
local cmds = require('commands') local getopt = require('getopt') local bin = require('bin') local lib14a = require('read14a') local utils = require('utils') local md5 = require('md5') local dumplib = require('html_dumplib') local toys = require('default_toys') example =[[ script run tnp3dump script run tnp3dump -n script run tnp3dump -p script run tnp3dump -k aabbccddeeff script run tnp3dump -k aabbccddeeff -n script run tnp3dump -o myfile script run tnp3dump -n -o myfile script run tnp3dump -p -o myfile script run tnp3dump -k aabbccddeeff -n -o myfile ]] author = "Iceman" usage = "script run tnp3dump -k <key> -n -p -o <filename>" desc =[[ This script will try to dump the contents of a Mifare TNP3xxx card. It will need a valid KeyA in order to find the other keys and decode the card. Arguments: -h : this help -k <key> : Sector 0 Key A. -n : Use the nested cmd to find all keys -p : Use the precalc to find all keys -o : filename for the saved dumps ]] local RANDOM = '20436F707972696768742028432920323031302041637469766973696F6E2E20416C6C205269676874732052657365727665642E20' local TIMEOUT = 2000 -- Shouldn't take longer than 2 seconds local DEBUG = false -- the debug flag local numBlocks = 64 local numSectors = 16 --- -- A debug printout-function function dbg(args) if not DEBUG then return end if type(args) == "table" then local i = 1 while result[i] do dbg(result[i]) i = i+1 end else print("###", args) end end --- -- This is only meant to be used when errors occur function oops(err) print("ERROR: ",err) end --- -- Usage help function help() print(desc) print("Example usage") print(example) end -- -- Exit message function ExitMsg(msg) print( string.rep('--',20) ) print( string.rep('--',20) ) print(msg) print() end local function readdumpkeys(infile) t = infile:read("*all") len = string.len(t) local len,hex = bin.unpack(("H%d"):format(len),t) return hex end local function waitCmd() local response = core.WaitForResponseTimeout(cmds.CMD_ACK,TIMEOUT) if response then local count,cmd,arg0 = bin.unpack('LL',response) if(arg0==1) then local count,arg1,arg2,data = bin.unpack('LLH511',response,count) return data:sub(1,32) else return nil, "Couldn't read block.." end end return nil, "No response from device" end local function main(args) print( string.rep('--',20) ) print( string.rep('--',20) ) local keyA local cmd local err local useNested = false local usePreCalc = false local cmdReadBlockString = 'hf mf rdbl %d A %s' local input = "dumpkeys.bin" local outputTemplate = os.date("toydump_%Y-%m-%d_%H%M%S"); -- Arguments for the script for o, a in getopt.getopt(args, 'hk:npo:') do if o == "h" then return help() end if o == "k" then keyA = a end if o == "n" then useNested = true end if o == "p" then usePreCalc = true end if o == "o" then outputTemplate = a end end -- validate input args. keyA = keyA or '4b0b20107ccb' if #(keyA) ~= 12 then return oops( string.format('Wrong length of write key (was %d) expected 12', #keyA)) end -- Turn off Debug local cmdSetDbgOff = "hf mf dbg 0" core.console( cmdSetDbgOff) result, err = lib14a.read14443a(false, true) if not result then return oops(err) end core.clearCommandBuffer() -- Show tag info print((' Found tag %s'):format(result.name)) dbg(('Using keyA : %s'):format(keyA)) --Trying to find the other keys if useNested then core.console( ('hf mf nested 1 0 A %s d'):format(keyA) ) end core.clearCommandBuffer() local akeys = '' if usePreCalc then local pre = require('precalc') akeys = pre.GetAll(result.uid) else print('Loading dumpkeys.bin') local hex, err = utils.ReadDumpFile(input) if not hex then return oops(err) end akeys = hex:sub(0,12*16) end -- Read block 0 cmd = Command:new{cmd = cmds.CMD_MIFARE_READBL, arg1 = 0,arg2 = 0,arg3 = 0, data = keyA} err = core.SendCommand(cmd:getBytes()) if err then return oops(err) end local block0, err = waitCmd() if err then return oops(err) end -- Read block 1 cmd = Command:new{cmd = cmds.CMD_MIFARE_READBL, arg1 = 1,arg2 = 0,arg3 = 0, data = keyA} err = core.SendCommand(cmd:getBytes()) if err then return oops(err) end local block1, err = waitCmd() if err then return oops(err) end local tmpHash = block0..block1..'%02x'..RANDOM local key local pos = 0 local blockNo local blocks = {} print('Reading card data') core.clearCommandBuffer() -- main loop io.write('Reading blocks > ') for blockNo = 0, numBlocks-1, 1 do if core.ukbhit() then print("aborted by user") break end pos = (math.floor( blockNo / 4 ) * 12)+1 key = akeys:sub(pos, pos + 11 ) cmd = Command:new{cmd = cmds.CMD_MIFARE_READBL, arg1 = blockNo ,arg2 = 0,arg3 = 0, data = key} local err = core.SendCommand(cmd:getBytes()) if err then return oops(err) end local blockdata, err = waitCmd() if err then return oops(err) end if blockNo%4 ~= 3 then if blockNo < 8 then -- Block 0-7 not encrypted blocks[blockNo+1] = ('%02d :: %s'):format(blockNo,blockdata) else -- blocks with zero not encrypted. if string.find(blockdata, '^0+$') then blocks[blockNo+1] = ('%02d :: %s'):format(blockNo,blockdata) else local baseStr = utils.ConvertHexToAscii(tmpHash:format(blockNo)) local key = md5.sumhexa(baseStr) local aestest = core.aes128_decrypt(key, blockdata) local hex = utils.ConvertAsciiToBytes(aestest) hex = utils.ConvertBytesToHex(hex) blocks[blockNo+1] = ('%02d :: %s'):format(blockNo,hex) io.write(blockNo..',') end end else -- Sectorblocks, not encrypted blocks[blockNo+1] = ('%02d :: %s%s'):format(blockNo,key,blockdata:sub(13,32)) end end io.write('\n') core.clearCommandBuffer() -- Print results local bindata = {} local emldata = '' for _,s in pairs(blocks) do local slice = s:sub(8,#s) local str = utils.ConvertBytesToAscii( utils.ConvertHexToBytes(slice) ) emldata = emldata..slice..'\n' for c in (str):gmatch('.') do bindata[#bindata+1] = c end end print( string.rep('--',20) ) local uid = block0:sub(1,8) local toytype = block1:sub(1,4) local cardidLsw = block1:sub(9,16) local cardidMsw = block1:sub(16,24) local cardid = block1:sub(9,24) local subtype = block1:sub(25,28) -- Write dump to files if not DEBUG then local foo = dumplib.SaveAsBinary(bindata, outputTemplate..'-'..uid..'.bin') print(("Wrote a BIN dump to: %s"):format(foo)) local bar = dumplib.SaveAsText(emldata, outputTemplate..'-'..uid..'.eml') print(("Wrote a EML dump to: %s"):format(bar)) end print( string.rep('--',20) ) -- Show info local item = toys.Find(toytype, subtype) if item then print((' ITEM TYPE : %s - %s (%s)'):format(item[6],item[5], item[4]) ) else print((' ITEM TYPE : 0x%s 0x%s'):format(toytype, subtype)) end print( (' UID : 0x%s'):format(uid) ) print( (' CARDID : 0x%s'):format(cardid ) ) print( string.rep('--',20) ) core.clearCommandBuffer() end main(args)
gpl-2.0
nkcfan/Dotfiles
.config/nvim/lua/treesitter_config.lua
1
5326
local define_modules = require("nvim-treesitter").define_modules local query = require("nvim-treesitter.query") local foldmethod_backups = {} local foldexpr_backups = {} -- folding module -- ref: https://github.com/nvim-treesitter/nvim-treesitter/issues/475#issuecomment-748532035 define_modules( { folding = { enable = true, attach = function(bufnr) -- Fold settings are actually window based... foldmethod_backups[bufnr] = vim.wo.foldmethod foldexpr_backups[bufnr] = vim.wo.foldexpr vim.wo.foldmethod = "expr" vim.wo.foldexpr = "nvim_treesitter#foldexpr()" end, detach = function(bufnr) vim.wo.foldmethod = foldmethod_backups[bufnr] vim.wo.foldexpr = foldexpr_backups[bufnr] foldmethod_backups[bufnr] = nil foldexpr_backups[bufnr] = nil end, is_supported = query.has_folds } } ) require "nvim-treesitter.configs".setup { ensure_installed = { "ocaml_interface", "fortran", "python", "c_sharp", "gomod", "json5", "gowork", "todotxt", "graphql", "typescript", "ruby", "perl", "supercollider", "fish", "slint", "php", "haskell", "java", "hjson", "kotlin", "tlaplus", "regex", "julia", "llvm", "toml", "css", "scss", "prisma", "pug", "rasi", "vue", "foam", "norg", "jsonc", "gleam", "cpp", "elm", "javascript", "yaml", "eex", "yang", "heex", "lalrpop", "ninja", "vala", "tsx", "nix", "hcl", "cooklang", "glimmer", "solidity", "verilog", "rst", "latex", "json", "vim", "teal", "elvish", "markdown", "ql", "astro", "hack", "go", "wgsl", "pascal", "make", "http", "scheme", "hocon", "pioasm", "help", "lua", "cmake", "jsdoc", "zig", "ocaml", "rego", "sparql", "beancount", "r", "gdscript", "clojure", "svelte", "devicetree", "commonlisp", "turtle", "query", "comment", "cuda", "phpdoc", "d", "fennel", "dart", "scala", "glsl", "html", "dockerfile", "bash", "c", "dot", "erlang", "elixir", "rust", "surface", "fusion", "bibtex", "ocamllex", "ledger" }, -- one of "all" or a list of languages folding, context_commentstring = { enable = true }, highlight = { enable = true, -- false will disable the whole extension disable = {}, -- list of language that will be disabled -- Setting this to true will run `:h syntax` and tree-sitter at the same time. -- Set this to `true` if you depend on 'syntax' being enabled (like for indentation). -- Using this option may slow down your editor, and you may see some duplicate highlights. -- Instead of true it can also be a list of languages additional_vim_regex_highlighting = true, }, incremental_selection = { enable = true, keymaps = { init_selection = "vii", scope_incremental = "ii", node_incremental = "<CR>", node_decremental = "<S-CR>" } }, refactor = { highlight_definitions = {enable = true}, highlight_current_scope = {enable = false} }, textobjects = { select = { enable = true, keymaps = { -- You can use the capture groups defined in textobjects.scm ["ab"] = "@block.outer", ["ib"] = "@block.inner", ["af"] = "@function.outer", ["if"] = "@function.inner", ["ac"] = "@class.outer", ["ic"] = "@class.inner", ["aa"] = "@parameter.outer", ["ia"] = "@parameter.inner", ["cc"] = "@comment.outer", ["ss"] = "@statement.outer", -- Or you can define your own textobjects like this -- ["iF"] = { -- python = "(function_definition) @function", -- cpp = "(function_definition) @function", -- c = "(function_definition) @function", -- java = "(method_declaration) @function" -- } } }, swap = { enable = true, swap_next = { ["<LocalLeader><LocalLeader>a"] = "@parameter.inner", ["<LocalLeader><LocalLeader>s"] = "@statement.outer" }, swap_previous = { ["<LocalLeader><LocalLeader>A"] = "@parameter.inner", ["<LocalLeader><LocalLeader>S"] = "@statement.outer" } }, move = { enable = true, goto_next_start = { ["]m"] = "@function.outer", ["]]"] = "@class.outer", }, goto_next_end = { ["]M"] = "@function.outer", ["]["] = "@class.outer", }, goto_previous_start = { ["[m"] = "@function.outer", ["[["] = "@class.outer", }, goto_previous_end = { ["[M"] = "@function.outer", ["[]"] = "@class.outer", }, }, } } vim.api.nvim_set_keymap('n', '<LocalLeader>th', '<cmd>TSBufToggle highlight<CR>', {})
mit
nikai3d/codecombat-scripts
desert/bookkeeper.lua
1
2049
function bestCoin(xs) local r, maxR = nil, 0 for i = 1, #xs do local v = xs[i].value/self:distanceTo(xs[i]) if v > maxR then r, maxR = xs[i], v end end return r end local phase, count = 0, 0 local nx, ny = 59, 33 loop -- Fight enemies for 15 seconds. -- Keep count whenever an enemy is defeated. if phase == 0 then local e = self:findNearest(self:findEnemies()) if self:now() > 15 then phase = 1 elseif e then while e.health > 0 do self:attack(e) end count = count + 1 else self:move({x=nx, y=ny}) end -- Tell Naria how many enemies you defeated. elseif phase == 1 then self:moveXY(nx, ny) self:say(count) phase, count = 2, self.gold -- Collect coins until the clock reaches 30 seconds. elseif phase == 2 then local c = bestCoin(self:findItems()) if self:now() > 30 then phase = 3 elseif c then self:move(c.pos) else self:move({x=nx, y=ny}) end -- Tell Naria how much gold you collected. elseif phase == 3 then self:moveXY(nx, ny) self:say(self.gold - count) phase, count = 4, 0 -- Fight enemies until the clock reaches 45 seconds. -- Remember to reset the count of defeated enemies! elseif phase == 4 then local e = self:findNearest(self:findEnemies()) if self:now() > 45 then phase = 5 elseif e then while e.health > 0 do self:attack(e) end count = count + 1 else self:move({x=nx, y=ny}) end -- Tell Naria how many enemies you defeated. elseif phase == 5 then self:moveXY(nx, ny) self:say(count) phase, count = 6, 0 else local c = bestCoin(self:findItems()) if c then self:move(c.pos) else self:move({x=nx, y=ny}) end end end
mit
LuaDist2/kong-cassandra
spec/type_fixtures.lua
8
3178
local cassandra = require "cassandra" return { {name='ascii', value='string'}, {name='ascii', insert_value=cassandra.null, read_value=nil}, {name='bigint', insert_value=cassandra.bigint(42000000000), read_value=42000000000}, {name='bigint', insert_value=cassandra.bigint(-42000000000), read_value=-42000000000}, {name='bigint', insert_value=cassandra.bigint(-42), read_value=-42}, {name='blob', value="\005\042"}, {name='blob', value=string.rep("blob", 10000)}, {name='boolean', value=true}, {name='boolean', value=false}, -- counters are not here because they are used with UPDATE instead of INSERT -- todo: decimal, {name='double', insert_value=cassandra.double(1.0000000000000004), read_test=function(value) return math.abs(value - 1.0000000000000004) < 0.000000000000001 end}, {name='double', insert_value=cassandra.double(-1.0000000000000004), read_value=-1.0000000000000004}, {name='double', insert_value=cassandra.double(0), read_test=function(value) return math.abs(value - 0) < 0.000000000000001 end}, {name='double', insert_value=cassandra.double(314151), read_test=function(value) return math.abs(value - 314151) < 0.000000000000001 end}, {name='float', insert_value=3.14151, read_test=function(value) return math.abs(value - 3.14151) < 0.0000001 end}, {name='float', insert_value=cassandra.float(3.14151), read_test=function(value) return math.abs(value - 3.14151) < 0.0000001 end}, {name='float', insert_value=cassandra.float(0), read_test=function(value) return math.abs(value - 0) < 0.0000001 end}, {name='float', insert_value=-3.14151, read_test=function(value) return math.abs(value + 3.14151) < 0.0000001 end}, {name='float', insert_value=cassandra.float(314151), read_test=function(value) return math.abs(value - 314151) < 0.0000001 end}, {name='int', value=4200}, {name='int', value=-42}, {name='text', value='string'}, {name='timestamp', insert_value=cassandra.timestamp(1405356926), read_value=1405356926}, {name='uuid', insert_value=cassandra.uuid("1144bada-852c-11e3-89fb-e0b9a54a6d11"), read_value="1144bada-852c-11e3-89fb-e0b9a54a6d11"}, {name='varchar', value='string'}, {name='blob', value=string.rep("string", 10000)}, {name='varint', value=4200}, {name='varint', value=-42}, {name='timeuuid', insert_value=cassandra.uuid("1144bada-852c-11e3-89fb-e0b9a54a6d11"), read_value="1144bada-852c-11e3-89fb-e0b9a54a6d11"}, {name='inet', insert_value=cassandra.inet("127.0.0.1"), read_value="127.0.0.1"}, {name='inet', insert_value=cassandra.inet("2001:0db8:85a3:0042:1000:8a2e:0370:7334"), read_value="2001:0db8:85a3:0042:1000:8a2e:0370:7334"}, {name='list<text>', insert_value=cassandra.list({'abc', 'def'}), read_value={'abc', 'def'}}, {name='list<int>', insert_value=cassandra.list({4, 2, 7}), read_value={4, 2, 7}}, {name='map<text,text>', insert_value=cassandra.map({k1='v1', k2='v2'}), read_value={k1='v1', k2='v2'}}, {name='map<text,int>', insert_value=cassandra.map({k1=3, k2=4}), read_value={k1=3, k2=4}}, {name='map<text,text>', insert_value=cassandra.map({}), read_value=nil}, {name='set<text>', insert_value=cassandra.set({'abc', 'def'}), read_value={'abc', 'def'}} }
mit
hksonngan/Polycode
Examples/Lua/Game_Demos/Pong/Scripts/Main.lua
10
4305
------------------------------------------------ -- Polycode Pong example by Ivan Safrin, 2013 ------------------------------------------------ -- create a new Screen and set its height to 480 scene = PhysicsScene2D(1.0, 30) scene:getDefaultCamera():setOrthoSize(0.0, 4.0) -- load the playing field from the entity file and add it to the scene field = SceneEntityInstance(scene, "Resources/field.entity") scene:addChild(field) -- get a handle to the player paddles and ball in the scene file and begin tracking collision ball = field:getEntityById("ball", true) scene:trackCollisionChild(ball, PhysicsScene2DEntity.ENTITY_RECT) p1 = field:getEntityById("p1", true) scene:trackCollisionChild(p1, PhysicsScene2DEntity.ENTITY_RECT) p2 = field:getEntityById("p2", true) scene:trackCollisionChild(p2, PhysicsScene2DEntity.ENTITY_RECT) topWall = field:getEntityById("topWall", true) scene:trackCollisionChild(topWall, PhysicsScene2DEntity.ENTITY_RECT) bottomWall = field:getEntityById("bottomWall", true) scene:trackCollisionChild(bottomWall, PhysicsScene2DEntity.ENTITY_RECT) --load sounds hitSound = Sound("Resources/hit.wav") scoreSound = Sound("Resources/score.wav") ballSpeed = 4.0 ballDirection = Vector2(1.0, 0.0) -- initialize scores and get references to the player score labels on the field p1scoreLabel = cast(field:getEntityById("p1ScoreLabel", true), SceneLabel) p2scoreLabel = cast(field:getEntityById("p2ScoreLabel", true), SceneLabel) p1Score = 0 p2Score = 0 function onCollision(t, event) -- we need to cast the event to PhysicsScreenEvent because this is a PhysicsScreen event physicsEvent = cast(event, PhysicsScene2DEvent) -- check if the colliding entity is the ball if physicsEvent.entity1 == ball then -- if colliding with player 1 or player 2 paddle if physicsEvent.entity2 == p1 or physicsEvent.entity2 == p2 then -- reverse the horizontal direction ballDirection.x = ballDirection.x * -1 -- adjust the vertical direction based on where on the paddle it hit ballDirection.y = (ball:getPosition().y - physicsEvent:getSecondEntity():getPosition().y)/1.0 if ballDirection.y > 1.0 then ballDirection.y = 1.0 end if ballDirection.y < -1.0 then ballDirection.y = -1.0 end else -- if collliding with the walls, simply reverse the vertical direction ballDirection.y = ballDirection.y * -1 end -- play the hit sound hitSound:Play() end end -- add a collision listener to the Physics Screen -- onCollision will now be called every time there is a collion between -- entities that we are tracking scene:addEventListener(nil, onCollision, PhysicsScene2DEvent.EVENT_NEW_SHAPE_COLLISION) -- Update is called automatically every frame function Update(elapsed) -- check player 1 input if Services.Input:getKeyState(KEY_a) == true then p1:setPositionY( p1:getPosition().y + (3.0 * elapsed)) elseif Services.Input:getKeyState(KEY_z) == true then p1:setPositionY( p1:getPosition().y - (3.0 * elapsed)) end -- check player 2 input if Services.Input:getKeyState(KEY_UP) == true then p2:setPositionY( p2:getPosition().y + (3.0 * elapsed)) elseif Services.Input:getKeyState(KEY_DOWN) == true then p2:setPositionY( p2:getPosition().y - (3.0 * elapsed)) end -- limit the paddle positions so they don't go offscreen if p1:getPosition().y < -1.3 then p1:setPositionY(-1.3) end if p1:getPosition().y > 1.3 then p1:setPositionY(1.3) end if p2:getPosition().y < -1.3 then p2:setPositionY(-1.3) end if p2:getPosition().y > 1.3 then p2:setPositionY(1.3) end -- update the ball position ball:setPositionX(ball:getPosition().x + (ballDirection.x * ballSpeed * elapsed)) ball:setPositionY( ball:getPosition().y + (ballDirection.y * ballSpeed * elapsed)) -- check if the ball beyond player 1's paddle and increment player 2's score if ball:getPosition().x < -3 then ball:setPosition(0.0, 0.0) ballDirection.x = 1.0 ballDirection.y = 0.0 scoreSound:Play() p2Score = p2Score + 1 p2scoreLabel:setText(""..p2Score) end -- check if the ball beyond player 2's paddle and increment player 1's score if ball:getPosition().x > 3 then ball:setPosition(0.0, 0.0) ball:setPositionY(0) ballDirection.x = -1.0 ballDirection.y = 0.0 scoreSound:Play() p1Score = p1Score + 1 p1scoreLabel:setText(""..p1Score) end end
mit
mms92/wire
lua/entities/gmod_wire_egp_hud/init.lua
9
2380
AddCSLuaFile("cl_init.lua") AddCSLuaFile("shared.lua") include('shared.lua') AddCSLuaFile("HUDDraw.lua") include("HUDDraw.lua") ENT.WireDebugName = "E2 Graphics Processor HUD" function ENT:Initialize() self:PhysicsInit(SOLID_VPHYSICS) self:SetMoveType(MOVETYPE_VPHYSICS) self:SetSolid(SOLID_VPHYSICS) self.RenderTable = {} self:SetUseType(SIMPLE_USE) self.Inputs = WireLib.CreateInputs( self, { "0 to 512" } ) WireLib.CreateWirelinkOutput( nil, self, {true} ) self.xScale = { 0, 512 } self.yScale = { 0, 512 } self.Scaling = false self.TopLeft = false end function ENT:TriggerInput( name, value ) if (name == "0 to 512") then self:SetNWBool( "Resolution", value != 0 ) end end function ENT:Use( ply ) umsg.Start( "EGP_HUD_Use", ply ) umsg.Entity( self ) umsg.End() end function ENT:SetEGPOwner( ply ) self.ply = ply self.plyID = ply:UniqueID() end function ENT:GetEGPOwner() if (!self.ply or !self.ply:IsValid()) then local ply = player.GetByUniqueID( self.plyID ) if (ply) then self.ply = ply end return ply else return self.ply end return false end function ENT:UpdateTransmitState() return TRANSMIT_ALWAYS end function ENT:LinkEnt( ent ) if IsValid( ent ) and ent:IsVehicle() then if self.LinkedVehicles and self.LinkedVehicles[ent] then return false end EGP:LinkHUDToVehicle( self, ent ) ent:CallOnRemove( "EGP HUD unlink on remove", function( ent ) EGP:UnlinkHUDFromVehicle( self, ent ) end) return true else return false, tostring(ent) .. " is invalid or is not a vehicle" end end function ENT:OnRemove() if self.Marks then for i=1,#self.Marks do self.Marks[i]:RemoveCallOnRemove( "EGP HUD unlink on remove" ) end end EGP:UnlinkHUDFromVehicle( self ) end function ENT:BuildDupeInfo() local info = self.BaseClass.BuildDupeInfo(self) or {} local vehicles = self.LinkedVehicles if vehicles then local _vehicles = {} for k,v in pairs( vehicles ) do _vehicles[#_vehicles+1] = k:EntIndex() end info.egp_hud_vehicles = _vehicles end return info end function ENT:ApplyDupeInfo(ply, ent, info, GetEntByID) self.BaseClass.ApplyDupeInfo(self, ply, ent, info, GetEntByID) local vehicles = info.egp_hud_vehicles if vehicles then for i=1,#vehicles do local vehicle = GetEntByID( vehicles[i] ) if IsValid( vehicle ) then self:LinkEnt( vehicle ) end end end end
apache-2.0
luadch/luadch
scripts/etc_keyprint.lua
1
2989
--[[ etc_keyprint.lua by blastbeat - this script tries to compute the keyprint of the hub cert (if availabe), and saves it in cfg.tbl - using the script, the hub admin does not need to manually fiddle around with this shit anymore ]]-- local scriptname = "etc_keyprint" local scriptversion = "0.01" local hash_table = { } -- this table stores the correspondence between keyprint type and cert.digest method hash_table[ "/?kp=SHA256/" ] = "sha256" -- atm we only care for sha256 -- note: we should NOT use the onStart listener here, to ensure that the other scripts get the right keyprint settings. otherwise you need to restart the hub twice, to get the settings working local luasec = require "ssl" -- we need the modules luasec.. local basexx = require "basexx" -- ..and basexx.. if luasec and basexx then local x509 = require "ssl.x509" -- ..and x509 stuff local ssl_params = cfg.get( "ssl_params" ) -- this should give us at least a default ssl param table, hardcoded in luadch local cert_path = ssl_params.certificate -- we need the cert location if not cert_path then return -- ssl params are invalid which really should not happen; cancel operation end local fd = io.open( tostring( cert_path ), "r" ) if fd then -- check, whether file can be opened.. local cert_str = fd:read "*all" -- ..and read content if not cert_str then fd:close( ) -- we are done because.. return -- ..something is wrong with the file; cancel operation.. end local cert = x509.load( cert_str ) -- create a luasec cert object if not cert then fd:close( ) -- we are done because.. return -- ..file did not contain a valid cert; cancel operation.. end local keyprint_type = cfg.get "keyprint_type" local method if keyprint_type and hash_table[ keyprint_type ] then method = hash_table[ keyprint_type ] else fd:close( ) -- we are done because.. return -- ..if this happends, either cfg.get failed, which means that the default settings are wrecked, or somebody needs to complete the hash table end local digest = cert:digest( method ) if not digest then fd:close( ) -- we are done because.. return -- ..the method provided in the hash table was fucked up; cancel operation end local keyprint = basexx.to_base32( basexx.from_hex( digest ) ):gsub( "=", "" ) -- calculate keyprint; this should not fail, but how knows; let's trust basexx cfg.set( "keyprint_hash", keyprint, true ) cfg.set( "use_keyprint", true, true ) -- activate keyprint usage, but do not save it into cfg.tbl fd:close( ) -- we are done. end end hub.debug( "** Loaded " .. scriptname .. " " .. scriptversion .. " **" )
gpl-3.0
puustina/openjam
src/splash.lua
1
1369
local splash = { love = love.graphics.newImage("assets/love-logo.png"), piskel = love.graphics.newImage("assets/logo_transparent_small_compact.png"), gimp = love.graphics.newImage("assets/wilber-big.png") } local menu = require "src.menu" function splash:init() self.timer = Timer.new() self.timer:add(3, function() Venus.switch(menu) end) end function splash:keypressed(key, scancode, isRepeat) if Game.paused then return end self.timer:clear() Venus.switch(menu) end function splash:update(dt) if Game.paused then return end self.timer:update(dt) end function splash:draw() preDraw() love.graphics.setBackgroundColor(170, 170, 170) love.graphics.setColor(255, 255, 255) local s = math.min(Game.original.w/self.love:getWidth(), Game.original.h/self.love:getHeight()) love.graphics.draw(self.love, Game.original.w/2, Game.original.h/2 - 70, 0, s, s, self.love:getWidth()/2, self.love:getHeight()/2) love.graphics.draw(self.piskel, 40, Game.original.h/2 + s * (self.love:getHeight()/2) - 40) love.graphics.draw(self.gimp, 250, Game.original.h/2 + s * (self.love:getHeight()/2) - 70, 0, 0.4, 0.4) love.graphics.setFont(Game.font14) local t = "SFX: Bfxr + Bosca Ceoil, Music: Incompetech" love.graphics.setColor(50, 50, 50) love.graphics.print(t, Game.original.w/2 - Game.font14:getWidth(t)/2, Game.original.h - 20) postDraw() end return splash
gpl-3.0
mpreisler/ember
src/components/ogre/widgets/Compass.lua
2
5040
Compass = {} function Compass:Refresh_Clicked(args) self.helper:refresh() self.helper:getMap():render() return true end function Compass:ZoomIn_Clicked(args) local newResolution = self.helper:getMap():getResolution() - 0.2 --prevent the user from zooming in to much (at which point only one pixel from the head of the avatar will be seen if newResolution > 0.2 then self.helper:getMap():setResolution(newResolution) self.helper:getMap():render() self.helper:refresh() end return true end function Compass:ZoomOut_Clicked(args) local newResolution = self.helper:getMap():getResolution() + 0.2 --we'll use the arbitrary resolution of 5 as the max if newResolution < 5 then self.helper:getMap():setResolution(self.helper:getMap():getResolution() + 0.2) self.helper:getMap():render() self.helper:refresh() end return true end function Compass:repositionAtAvatar() local pos = emberOgre:getWorld():getAvatar():getClientSideAvatarPosition() self.helper:reposition(pos.x(), -pos.y()) end function Compass:framestarted(frameEvent) if self.updateFrameCountDown > 0 then self.updateFrameCountDown = self.updateFrameCountDown - 1 if self.updateFrameCountDown == 0 then --if we haven't created any anchor yet, it means that the whole compass is uninitialized and needs to be shown, else we can just rerender the map if self.anchor == nil then self:initialize() else self.helper:getMap():render() self.helper:refresh() end self.updateFrameCountDown = -1 end end end function Compass:TerrainPageGeometryUpdated(page) --wait six frames until we rerender the map. This is a hack because apparently the event this listens for doesn't actually guarantee that the page will be rendered next frame. We need to add another event which is emitted when a page actually is rendered the first time. self.updateFrameCountDown = 6 end function Compass:initialize() self.anchor = Ember.OgreView.Gui.CompassCameraAnchor:new(self.helper, emberOgre:getWorld():getMainCamera():getCamera()) if self.widget ~= nil then self.widget:show() end end function Compass:CreatedAvatarEntity(avatarEntity) connect(self.connectors, self.widget.EventFrameStarted, self.framestarted, self) end function Compass:shutdown() disconnectAll(self.connectors) guiManager:destroyWidget(self.widget) deleteSafe(self.helper) deleteSafe(self.helperImpl) deleteSafe(self.anchor) end function Compass:buildWidget(terrainManager) self.helperImpl = Ember.OgreView.Gui.RenderedCompassImpl:new() self.helper = Ember.OgreView.Gui.Compass:new(self.helperImpl, terrainManager:getScene():getSceneManager(), terrainManager:getAdapter()) self.map = self.helper:getMap() self:buildCEGUIWidget() --don't show the compass here, instead wait until we've gotten some terrain (by listening connect(self.connectors, emberOgre.EventCreatedAvatarEntity, self.CreatedAvatarEntity, self) connect(self.connectors, terrainManager.EventTerrainPageGeometryUpdated, self.TerrainPageGeometryUpdated, self) end -- Call this method to build the cegui widget. function Compass:buildCEGUIWidget() self.widget = guiManager:createWidget() self.widget:loadMainSheet("Compass.layout", "Compass/") self.widget:setIsActiveWindowOpaque(false) self.renderImage = self.widget:getWindow("RenderImage") self.pointerImage = self.widget:getWindow("Pointer") local assetManager = Ember.OgreView.Gui.AssetsManager:new_local() --set up the main background image if self.helperImpl:getTexture():isNull() == false then local texturePair = assetManager:createTextureImage(self.helperImpl:getTexture(), "CompassMap") if texturePair:hasData() then self.renderImage:setProperty("Image", CEGUI.PropertyHelper:imageToString(texturePair:getTextureImage())) end end if self.helperImpl:getPointerTexture():isNull() == false then --also set up the pointer image local texturePair = assetManager:createTextureImage(self.helperImpl:getPointerTexture(), "CompassPointer") if texturePair:hasData() then self.pointerImage:setProperty("Image", CEGUI.PropertyHelper:imageToString(texturePair:getTextureImage())) end end self.widget:getWindow("ZoomOut"):subscribeEvent("Clicked", self.ZoomOut_Clicked, self) self.widget:getWindow("ZoomIn"):subscribeEvent("Clicked", self.ZoomIn_Clicked, self) self.widget:hide() end connect(connectors, emberOgre.EventTerrainManagerCreated, function(terrainManager) compass = { connectors={}, map = nil, widget = nil, renderImage = nil, helper = nil, previousPosX = 0, previousPosY = 0, updateFrameCountDown = -1, --this is used for triggering delayed render updates. If it's more than zero, it's decreased each frame until it's zero, and a render is then carried out. If it's below zero nothing is done. zoomInButton = nil, anchor = nil } setmetatable(compass, {__index = Compass}) compass:buildWidget(terrainManager) connect(compass.connectors, emberOgre.EventTerrainManagerBeingDestroyed, function() compass:shutdown() compass = nil end) end)
gpl-3.0
keneanung/mudlet
src/mudlet-lua/lua/geyser/GeyserColor.lua
19
6003
-------------------------------------- -- -- -- The Geyser Layout Manager by guy -- -- -- -------------------------------------- Geyser.Color = {} --- Converts color to 3 hex values as a string, no alpha, css style -- @return The color formatted as a hex string, as accepted by html/css function Geyser.Color.hex (r,g,b) return string.format("#%02x%02x%02x", Geyser.Color.parse(r, g, b)) end --- Converts color to 4 hex values as a string, with alpha, css style -- @return The color formatted as a hex string, as accepted by html/css function Geyser.Color.hexa (r,g,b,a) return string.format("#%02x%02x%02x%02x", Geyser.Color.parse(r, g, b, a)) end --- Converts color to 3 hex values as a string, no alpha, hecho style -- @return The color formatted as a hex string, as accepted by hecho function Geyser.Color.hhex (r,g,b) return string.format("|c%02x%02x%02x", Geyser.Color.parse(r, g, b)) end --- Converts color to 4 hex values as a string, with alpha, hecho style -- @return The color formatted as a hex string, as accepted by hecho function Geyser.Color.hhexa (r,g,b,a) return string.format("|c%02x%02x%02x%02x", Geyser.Color.parse(r, g, b, a)) end --- Converts color to 3 decimal values as a string, no alpha, decho style -- @return The color formatted as a decho() style string function Geyser.Color.hdec (r,g,b) return string.format("<%d,%d,%d>", Geyser.Color.parse(r, g, b)) end --- Converts color to 4 decimal values as a string, with alpha, decho style -- @return The color formatted as a decho() style string function Geyser.Color.hdeca (r,g,b,a) return string.format("<%d,%d,%d,%d>", Geyser.Color.parse(r, g, b, a)) end --- Returns 4 color components from (nearly any) acceptable format. Colors can be -- specified in two ways. First: as a single word in english ("purple") or -- hex ("#AA00FF", "|cAA00FF", or "0xAA00FF") or decimal ("<190,0,255>"). If -- the hex or decimal representations contain a fourth element then alpha is -- set too - otherwise alpha can't be set this way. Second: by passing in -- distinct components as unsigned integers (e.g. 23 or 0xA7). When using the -- second way, at least three values must be passed. If only three are -- passed, then alpha is 255. Third: by passing in a table that has explicit -- values for some, all or none of the keys r,g,b, and a. -- @param red Either a valid string representation or the red component. -- @param green The green component. -- @param blue The blue component. -- @param alpha The alpha component. function Geyser.Color.parse(red, green, blue, alpha) local r,g,b,a = 0,0,0,255 -- have to have something to set, else can't do anything! if not red then print("No color supplied.\n") return end -- function to return next number local next_num = nil local base = 10 -- assigns all the colors, used after we figure out how the color is -- represented as a string local assign_colors = function () r = tonumber(next_num(), base) g = tonumber(next_num(), base) b = tonumber(next_num(), base) local has_a = next_num() if has_a then a = tonumber(has_a, base) end end -- Check if we were passed a string or table that needs to be parsed, i.e., -- there is only a valid red value, and other params are nil. if not green or not blue then if type(red) == "table" then -- Here just copy over the appropriate values with sensible defaults r = red.r or 127 g = red.g or 127 b = red.b or 127 a = red.a or 255 return r,g,b,a elseif type(red) == "string" then -- first case is a hex string, where first char is '#' if string.find(red, "^#") then local pure_hex = string.sub(red, 2) -- strip format char next_num = string.gmatch(pure_hex, "%w%w") base = 16 -- second case is a hex string, where first chars are '|c' or '0x' elseif string.find(red, "^[|0][cx]") then local pure_hex = string.sub(red, 3) -- strip format chars next_num = string.gmatch(pure_hex, "%w%w") base = 16 -- third case is a decimal string, of the format "<dd,dd,dd>" elseif string.find(red, "^<") then next_num = string.gmatch(red, "%d+") -- fourth case is a named string elseif color_table[red] then local i = 0 local n = #color_table[red] next_num = function () -- create a simple iterator i = i + 1 if i <= n then return color_table[red][i] else return nil end end else -- finally, no matches, do nothing return end end else -- Otherwise we weren't passed a complete string, but instead discrete -- components as either decimal or hex -- Yes, this is a little silly to do this way, but it fits with the -- rest of the parsing going on... local i = 0 next_num = function () i = i + 1 if i == 1 then return red elseif i == 2 then return green elseif i == 3 then return blue elseif i == 4 then return alpha else return nil end end end assign_colors() return r,g,b,a end --- Applies colors to a window drawing from defaults and overridden values. -- @param cons The window to apply colors to function Geyser.Color.applyColors(cons) cons:setFgColor(cons.fgColor) cons:setBgColor(cons.bgColor) cons:setColor(cons.color) end
gpl-2.0
Tele-Fox/best
plugins/rss.lua
700
5434
local function get_base_redis(id, option, extra) local ex = '' if option ~= nil then ex = ex .. ':' .. option if extra ~= nil then ex = ex .. ':' .. extra end end return 'rss:' .. id .. ex end local function prot_url(url) local url, h = string.gsub(url, "http://", "") local url, hs = string.gsub(url, "https://", "") local protocol = "http" if hs == 1 then protocol = "https" end return url, protocol end local function get_rss(url, prot) local res, code = nil, 0 if prot == "http" then res, code = http.request(url) elseif prot == "https" then res, code = https.request(url) end if code ~= 200 then return nil, "Error while doing the petition to " .. url end local parsed = feedparser.parse(res) if parsed == nil then return nil, "Error decoding the RSS.\nAre you sure that " .. url .. " it's a RSS?" end return parsed, nil end local function get_new_entries(last, nentries) local entries = {} for k,v in pairs(nentries) do if v.id == last then return entries else table.insert(entries, v) end end return entries end local function print_subs(id) local uhash = get_base_redis(id) local subs = redis:smembers(uhash) local text = id .. ' are subscribed to:\n---------\n' for k,v in pairs(subs) do text = text .. k .. ") " .. v .. '\n' end return text end local function subscribe(id, url) local baseurl, protocol = prot_url(url) local prothash = get_base_redis(baseurl, "protocol") local lasthash = get_base_redis(baseurl, "last_entry") local lhash = get_base_redis(baseurl, "subs") local uhash = get_base_redis(id) if redis:sismember(uhash, baseurl) then return "You are already subscribed to " .. url end local parsed, err = get_rss(url, protocol) if err ~= nil then return err end local last_entry = "" if #parsed.entries > 0 then last_entry = parsed.entries[1].id end local name = parsed.feed.title redis:set(prothash, protocol) redis:set(lasthash, last_entry) redis:sadd(lhash, id) redis:sadd(uhash, baseurl) return "You had been subscribed to " .. name end local function unsubscribe(id, n) if #n > 3 then return "I don't think that you have that many subscriptions." end n = tonumber(n) local uhash = get_base_redis(id) local subs = redis:smembers(uhash) if n < 1 or n > #subs then return "Subscription id out of range!" end local sub = subs[n] local lhash = get_base_redis(sub, "subs") redis:srem(uhash, sub) redis:srem(lhash, id) local left = redis:smembers(lhash) if #left < 1 then -- no one subscribed, remove it local prothash = get_base_redis(sub, "protocol") local lasthash = get_base_redis(sub, "last_entry") redis:del(prothash) redis:del(lasthash) end return "You had been unsubscribed from " .. sub end local function cron() -- sync every 15 mins? local keys = redis:keys(get_base_redis("*", "subs")) for k,v in pairs(keys) do local base = string.match(v, "rss:(.+):subs") -- Get the URL base local prot = redis:get(get_base_redis(base, "protocol")) local last = redis:get(get_base_redis(base, "last_entry")) local url = prot .. "://" .. base local parsed, err = get_rss(url, prot) if err ~= nil then return end local newentr = get_new_entries(last, parsed.entries) local subscribers = {} local text = '' -- Send only one message with all updates for k2, v2 in pairs(newentr) do local title = v2.title or 'No title' local link = v2.link or v2.id or 'No Link' text = text .. "[rss](" .. link .. ") - " .. title .. '\n' end if text ~= '' then local newlast = newentr[1].id redis:set(get_base_redis(base, "last_entry"), newlast) for k2, receiver in pairs(redis:smembers(v)) do send_msg(receiver, text, ok_cb, false) end end end end local function run(msg, matches) local id = "user#id" .. msg.from.id if is_chat_msg(msg) then id = "chat#id" .. msg.to.id end if matches[1] == "!rss"then return print_subs(id) end if matches[1] == "sync" then if not is_sudo(msg) then return "Only sudo users can sync the RSS." end cron() end if matches[1] == "subscribe" or matches[1] == "sub" then return subscribe(id, matches[2]) end if matches[1] == "unsubscribe" or matches[1] == "uns" then return unsubscribe(id, matches[2]) end end return { description = "Manage User/Chat RSS subscriptions. If you are in a chat group, the RSS subscriptions will be of that chat. If you are in an one-to-one talk with the bot, the RSS subscriptions will be yours.", usage = { "!rss: Get your rss (or chat rss) subscriptions", "!rss subscribe (url): Subscribe to that url", "!rss unsubscribe (id): Unsubscribe of that id", "!rss sync: Download now the updates and send it. Only sudo users can use this option." }, patterns = { "^!rss$", "^!rss (subscribe) (https?://[%w-_%.%?%.:/%+=&]+)$", "^!rss (sub) (https?://[%w-_%.%?%.:/%+=&]+)$", "^!rss (unsubscribe) (%d+)$", "^!rss (uns) (%d+)$", "^!rss (sync)$" }, run = run, cron = cron }
gpl-2.0
xsrc/prosody
files/mod_carbons.lua
2
5155
-- XEP-0280: Message Carbons implementation for Prosody -- Copyright (C) 2011 Kim Alvefur -- -- This file is MIT/X11 licensed. local st = require "util.stanza"; local jid_bare = require "util.jid".bare; local xmlns_carbons = "urn:xmpp:carbons:2"; local xmlns_carbons_old = "urn:xmpp:carbons:1"; local xmlns_carbons_really_old = "urn:xmpp:carbons:0"; local xmlns_forward = "urn:xmpp:forward:0"; local full_sessions, bare_sessions = full_sessions, bare_sessions; local function toggle_carbons(event) local origin, stanza = event.origin, event.stanza; local state = stanza.tags[1].attr.mode or stanza.tags[1].name; module:log("debug", "%s %sd carbons", origin.full_jid, state); origin.want_carbons = state == "enable" and stanza.tags[1].attr.xmlns; return origin.send(st.reply(stanza)); end module:hook("iq-set/self/"..xmlns_carbons..":disable", toggle_carbons); module:hook("iq-set/self/"..xmlns_carbons..":enable", toggle_carbons); -- COMPAT module:hook("iq-set/self/"..xmlns_carbons_old..":disable", toggle_carbons); module:hook("iq-set/self/"..xmlns_carbons_old..":enable", toggle_carbons); module:hook("iq-set/self/"..xmlns_carbons_really_old..":carbons", toggle_carbons); local function message_handler(event, c2s) local origin, stanza = event.origin, event.stanza; local orig_type = stanza.attr.type; local orig_from = stanza.attr.from; local orig_to = stanza.attr.to; if not (orig_type == nil or orig_type == "normal" or orig_type == "chat") then return -- No carbons for messages of type error or headline end -- Stanza sent by a local client local bare_jid = jid_bare(orig_from); local target_session = origin; local top_priority = false; local user_sessions = bare_sessions[bare_jid]; -- Stanza about to be delivered to a local client if not c2s then bare_jid = jid_bare(orig_to); target_session = full_sessions[orig_to]; user_sessions = bare_sessions[bare_jid]; if not target_session and user_sessions then -- The top resources will already receive this message per normal routing rules, -- so we are going to skip them in order to avoid sending duplicated messages. local top_resources = user_sessions.top_resources; top_priority = top_resources and top_resources[1].priority end end if not user_sessions then module:log("debug", "Skip carbons for offline user"); return -- No use in sending carbons to an offline user end if stanza:get_child("private", xmlns_carbons) then stanza:maptags(function(tag) if not ( tag.attr.xmlns == xmlns_carbons and tag.name == "private" ) then return tag; end end); module:log("debug", "Message tagged private, ignoring"); return elseif stanza:get_child("no-copy", "urn:xmpp:hints") then module:log("debug", "Message has no-copy hint, ignoring"); return elseif stanza:get_child("x", "http://jabber.org/protocol/muc#user") then module:log("debug", "MUC PM, ignoring"); return end -- Create the carbon copy and wrap it as per the Stanza Forwarding XEP local copy = st.clone(stanza); copy.attr.xmlns = "jabber:client"; local carbon = st.message{ from = bare_jid, type = orig_type, } :tag(c2s and "sent" or "received", { xmlns = xmlns_carbons }) :tag("forwarded", { xmlns = xmlns_forward }) :add_child(copy):reset(); -- COMPAT local carbon_old = st.message{ from = bare_jid, type = orig_type, } :tag(c2s and "sent" or "received", { xmlns = xmlns_carbons_old }):up() :tag("forwarded", { xmlns = xmlns_forward }) :add_child(copy):reset(); -- COMPAT local carbon_really_old = st.clone(stanza) :tag(c2s and "sent" or "received", { xmlns = xmlns_carbons_really_old }):up() user_sessions = user_sessions and user_sessions.sessions; for _, session in pairs(user_sessions) do -- Carbons are sent to resources that have enabled it if session.want_carbons -- but not the resource that sent the message, or the one that it's directed to and session ~= target_session -- and isn't among the top resources that would receive the message per standard routing rules and (c2s or session.priority ~= top_priority) -- don't send v0 carbons (or copies) for c2s and (not c2s or session.want_carbons ~= xmlns_carbons_really_old) then carbon.attr.to = session.full_jid; module:log("debug", "Sending carbon to %s", session.full_jid); local carbon = session.want_carbons == xmlns_carbons_old and carbon_old -- COMPAT or session.want_carbons == xmlns_carbons_really_old and carbon_really_old -- COMPAT or carbon; session.send(carbon); end end end local function c2s_message_handler(event) return message_handler(event, true) end -- Stanzas sent by local clients module:hook("pre-message/host", c2s_message_handler, 1); module:hook("pre-message/bare", c2s_message_handler, 1); module:hook("pre-message/full", c2s_message_handler, 1); -- Stanzas to local clients module:hook("message/bare", message_handler, 1); module:hook("message/full", message_handler, 1); module:add_feature(xmlns_carbons); module:add_feature(xmlns_carbons_old); if module:get_option_boolean("carbons_v0") then module:add_feature(xmlns_carbons_really_old); end
gpl-3.0
MRAHS/SBSS-Pro
plugins/welcome.lua
190
3526
local add_user_cfg = load_from_file('data/add_user_cfg.lua') local function template_add_user(base, to_username, from_username, chat_name, chat_id) base = base or '' to_username = '@' .. (to_username or '') from_username = '@' .. (from_username or '') chat_name = string.gsub(chat_name, '_', ' ') or '' chat_id = "chat#id" .. (chat_id or '') if to_username == "@" then to_username = '' end if from_username == "@" then from_username = '' end base = string.gsub(base, "{to_username}", to_username) base = string.gsub(base, "{from_username}", from_username) base = string.gsub(base, "{chat_name}", chat_name) base = string.gsub(base, "{chat_id}", chat_id) return base end function chat_new_user_link(msg) local pattern = add_user_cfg.initial_chat_msg local to_username = msg.from.username local from_username = 'link (@' .. (msg.action.link_issuer.username or '') .. ')' local chat_name = msg.to.print_name local chat_id = msg.to.id pattern = template_add_user(pattern, to_username, from_username, chat_name, chat_id) if pattern ~= '' then local receiver = get_receiver(msg) send_msg(receiver, pattern, ok_cb, false) end end function chat_new_user(msg) local pattern = add_user_cfg.initial_chat_msg local to_username = msg.action.user.username local from_username = msg.from.username local chat_name = msg.to.print_name local chat_id = msg.to.id pattern = template_add_user(pattern, to_username, from_username, chat_name, chat_id) if pattern ~= '' then local receiver = get_receiver(msg) send_msg(receiver, pattern, ok_cb, false) end end local function description_rules(msg, nama) local data = load_data(_config.moderation.data) if data[tostring(msg.to.id)] then local about = "" local rules = "" if data[tostring(msg.to.id)]["description"] then about = data[tostring(msg.to.id)]["description"] about = "\nAbout :\n"..about.."\n" end if data[tostring(msg.to.id)]["rules"] then rules = data[tostring(msg.to.id)]["rules"] rules = "\nRules :\n"..rules.."\n" end local sambutan = "Hi "..nama.."\nWelcome to '"..string.gsub(msg.to.print_name, "_", " ").."'\nYou can use /help for see bot commands\n" local text = sambutan..about..rules.."\n" local receiver = get_receiver(msg) send_large_msg(receiver, text, ok_cb, false) end end local function run(msg, matches) if not msg.service then return "Are you trying to troll me?" end --vardump(msg) if matches[1] == "chat_add_user" then if not msg.action.user.username then nama = string.gsub(msg.action.user.print_name, "_", " ") else nama = "@"..msg.action.user.username end chat_new_user(msg) description_rules(msg, nama) elseif matches[1] == "chat_add_user_link" then if not msg.from.username then nama = string.gsub(msg.from.print_name, "_", " ") else nama = "@"..msg.from.username end chat_new_user_link(msg) description_rules(msg, nama) elseif matches[1] == "chat_del_user" then local bye_name = msg.action.user.first_name return 'Bye '..bye_name end end return { description = "Welcoming Message", usage = "send message to new member", patterns = { "^!!tgservice (chat_add_user)$", "^!!tgservice (chat_add_user_link)$", "^!!tgservice (chat_del_user)$", }, run = run }
gpl-2.0
Habbie/hammerspoon
extensions/redshift/init.lua
2
20346
--- === hs.redshift === --- --- Inverts and/or lowers the color temperature of the screen(s) on a schedule, for a more pleasant experience at night --- --- Usage: --- ``` --- -- make a windowfilterDisable for redshift: VLC, Photos and screensaver/login window will disable color adjustment and inversion --- local wfRedshift=hs.window.filter.new({VLC={focused=true},Photos={focused=true},loginwindow={visible=true,allowRoles='*'}},'wf-redshift') --- -- start redshift: 2800K + inverted from 21 to 7, very long transition duration (19->23 and 5->9) --- hs.redshift.start(2800,'21:00','7:00','4h',true,wfRedshift) --- -- allow manual control of inverted colors --- hs.hotkey.bind(HYPER,'f1','Invert',hs.redshift.toggleInvert) --- ``` --- --- Note: --- * As of macOS 10.12.4, Apple provides "Night Shift", which implements a simple red-shift effect, as part of the OS. It seems unlikely that `hs.redshift` will see significant future development. local screen=require'hs.screen' local timer=require'hs.timer' local windowfilter=require'hs.window.filter' local settings=require'hs.settings' local log=require'hs.logger'.new('redshift') local redshift={setLogLevel=log.setLogLevel} -- module local type,ipairs,pairs,next,floor,abs,min,max,sformat=type,ipairs,pairs,next,math.floor,math.abs,math.min,math.max,string.format local SETTING_INVERTED_OVERRIDE='hs.redshift.inverted.override' local SETTING_DISABLED_OVERRIDE='hs.redshift.disabled.override' --local BLACKPOINT = {red=0.00000001,green=0.00000001,blue=0.00000001} local BLACKPOINT = {red=0,green=0,blue=0} --local COLORRAMP local running,nightStart,nightEnd,dayStart,dayEnd,nightTemp,dayTemp local tmr,tmrNext,applyGamma,screenWatcher local invertRequests,invertCallbacks,invertAtNight,invertUser,prevInvert={},{} local disableRequests,disableUser={} local wfDisable,modulewfDisable local function round(v) return floor(0.5+v) end local function lerprgb(p,a,b) return {red=a[1]*(1-p)+b[1]*p,green=a[2]*(1-p)+b[2]*p,blue=a[3]*(1-p)+b[3]*p} end local function ilerp(v,s,e,a,b) if s>e then if v<e then v=v+86400 end e=e+86400 end local p=(v-s)/(e-s) return a*(1-p)+b*p end local function getGamma(temp) local R,lb,ub=redshift.COLORRAMP for k,_ in pairs(R) do if k<=temp then lb=max(lb or 0,k) else ub=min(ub or 10000,k) end end if lb==nil or ub==nil then local t=R[ub or lb] return {red=t[1],green=t[2],blue=t[3]} end local p=(temp-lb)/(ub-lb) return lerprgb(p,R[lb],R[ub]) -- local idx=floor(temp/100)-9 -- local p=(temp%100)/100 -- return lerprgb(p,COLORRAMP[idx],COLORRAMP[idx+1]) end local function between(v,s,e) if s<=e then return v>=s and v<=e else return v>=s or v<=e end end local function isInverted() if not running then return false end if invertUser~=nil then return invertUser and 'user' else return next(invertRequests) or false end end local function isDisabled() if not running then return true end if disableUser~=nil then return disableUser and 'user' else return next(disableRequests) or false end end -- core fn applyGamma=function() if tmrNext then tmrNext:stop() tmrNext=nil end local now=timer.localTime() local temp,timeNext,invertReq if isDisabled() then temp=6500 timeNext=now-1 log.i('disabled') elseif between(now,nightStart,nightEnd) then temp=ilerp(now,nightStart,nightEnd,dayTemp,nightTemp) --dusk elseif between(now,dayStart,dayEnd) then temp=ilerp(now,dayStart,dayEnd,nightTemp,dayTemp) --dawn elseif between(now,dayEnd,nightStart) then temp=dayTemp timeNext=nightStart log.i('daytime')--day elseif between(now,nightEnd,dayStart) then invertReq=invertAtNight temp=nightTemp timeNext=dayStart log.i('nighttime')--night else error('wtf') end redshift.requestInvert('redshift-night',invertReq) local invert=isInverted() local gamma=getGamma(temp) log.df('set color temperature %dK (gamma %d,%d,%d)%s',floor(temp),round(gamma.red*100), round(gamma.green*100),round(gamma.blue*100),invert and (' - inverted by '..invert) or '') for _,scr in ipairs(screen.allScreens()) do scr:setGamma(invert and BLACKPOINT or gamma,invert and gamma or BLACKPOINT) end if invert~=prevInvert then log.i('inverted status changed',next(invertCallbacks) and '- notifying callbacks' or '') for _,fn in pairs(invertCallbacks) do fn(invert) end prevInvert=invert end if timeNext then tmrNext=timer.doAt(timeNext,applyGamma) else tmr:start() end end --- hs.redshift.invertSubscribe([id,]fn) --- Function --- Subscribes a callback to be notified when the color inversion status changes --- --- You can use this to dynamically adjust the UI colors in your modules or configuration, if appropriate. --- --- Parameters: --- * id - (optional) a string identifying the requester (usually the module name); if omitted, `fn` --- itself will be the identifier; this identifier must be passed to `hs.redshift.invertUnsubscribe()` --- * fn - a function that will be called whenever color inversion status changes; it must accept a --- single parameter, a string or false as per the return value of `hs.redshift.isInverted()` --- --- Returns: --- * None function redshift.invertSubscribe(key,fn) if type(key)=='function' then fn=key end if type(key)~='string' and type(key)~='function' then error('invalid key',2) end if type(fn)~='function' then error('invalid callback',2) end invertCallbacks[key]=fn log.i('add invert callback',key) return running and fn(isInverted()) end --- hs.redshift.invertUnsubscribe(id) --- Function --- Unsubscribes a previously subscribed color inversion change callback --- --- Parameters: --- * id - a string identifying the requester or the callback function itself, depending on how you --- called `hs.redshift.invertSubscribe()` --- --- Returns: --- * None function redshift.invertUnsubscribe(key) if not invertCallbacks[key] then return end log.i('remove invert callback',key) invertCallbacks[key]=nil end --- hs.redshift.isInverted() -> string or false --- Function --- Checks if the colors are currently inverted --- --- Parameters: --- * None --- --- Returns: --- * false if the colors are not currently inverted; otherwise, a string indicating the reason, one of: --- * "user" for the user override (see `hs.redshift.toggleInvert()`) --- * "redshift-night" if `hs.redshift.start()` was called with `invertAtNight` set to true, --- and it's currently night time --- * the ID string (usually the module name) provided to `hs.redshift.requestInvert()`, if another module requested color inversion redshift.isInverted=isInverted redshift.isDisabled=isDisabled --- hs.redshift.requestInvert(id,v) --- Function --- Sets or clears a request for color inversion --- --- Parameters: --- * id - a string identifying the requester (usually the module name) --- * v - a boolean indicating whether to invert the colors (if true) or clear any previous requests (if false or nil) --- --- Returns: --- * None --- --- Notes: --- * you can use this function e.g. to automatically invert colors if the ambient light sensor reading drops below --- a certain threshold (`hs.brightness.DDCauto()` can optionally do exactly that) --- * if the user's configuration doesn't explicitly start the redshift module, calling this will have no effect local function request(t,k,v) if type(k)~='string' then error('key must be a string',3) end if v==false then v=nil end if t[k]~=v then t[k]=v return true end end function redshift.requestInvert(key,v) if request(invertRequests,key,v) then log.f('invert request from %s %s',key,v and '' or 'canceled') return running and applyGamma() end end function redshift.requestDisable(key,v) if request(disableRequests,key,v) then log.f('disable color adjustment request from %s %s',key,v and '' or 'canceled') return running and applyGamma() end end --- hs.redshift.toggleInvert([v]) --- Function --- Sets or clears the user override for color inversion. --- --- This function should be bound to a hotkey, e.g.: --- `hs.hotkey.bind('ctrl-cmd','=','Invert',hs.redshift.toggleInvert)` --- --- Parameters: --- * v - (optional) a boolean; if true, the override will invert the colors no matter what; if false, --- the override will disable color inversion no matter what; if omitted or nil, it will toggle the --- override, i.e. clear it if it's currently enforced, or set it to the opposite of the current --- color inversion status otherwise. --- --- Returns: --- * None function redshift.toggleInvert(v) if not running then return end if v==nil and invertUser==nil then v=not isInverted() end if v~=nil and type(v)~='boolean' then error ('v must be a boolean or nil',2) end log.f('invert user override%s',v==true and ': inverted' or (v==false and ': not inverted' or ' cancelled')) if v==nil then settings.clear(SETTING_INVERTED_OVERRIDE) else settings.set(SETTING_INVERTED_OVERRIDE,v) end invertUser=v return applyGamma() end --- hs.redshift.toggle([v]) --- Function --- Sets or clears the user override for color temperature adjustment. --- --- This function should be bound to a hotkey, e.g.: --- `hs.hotkey.bind('ctrl-cmd','-','Redshift',hs.redshift.toggle)` --- --- Parameters: --- * v - (optional) a boolean; if true, the override will enable color temperature adjustment on --- the given schedule; if false, the override will disable color temperature adjustment; --- if omitted or nil, it will toggle the override, i.e. clear it if it's currently enforced, or --- set it to the opposite of the current color temperature adjustment status otherwise. --- --- Returns: --- * None function redshift.toggle(v) if not running then return end if v==nil then if disableUser==nil then v=not isDisabled() end elseif type(v)~='boolean' then error ('v must be a boolean or nil',2) else v=not v end log.f('color adjustment user override%s',v==true and ': disabled' or (v==false and ': enabled' or ' cancelled')) if v==nil then settings.clear(SETTING_DISABLED_OVERRIDE) else settings.set(SETTING_DISABLED_OVERRIDE,v) end disableUser=v return applyGamma() end --- hs.redshift.stop() --- Function --- Stops the module and disables color adjustment and color inversion --- --- Parameters: --- * None --- --- Returns: --- * None function redshift.stop() if not running then return end log.i('stopped') tmr:stop() screen.restoreGamma() if wfDisable then if modulewfDisable then modulewfDisable:delete() modulewfDisable=nil else wfDisable:unsubscribe(redshift.wfsubs) end wfDisable=nil end if tmrNext then tmrNext:stop() tmrNext=nil end screenWatcher:stop() screenWatcher=nil running=nil end local function gc(t) return t.stop()end local function stime(time) return sformat('%02d:%02d:%02d',floor(time/3600),floor(time/60)%60,floor(time%60)) end tmr=timer.delayed.new(10,applyGamma) --- hs.redshift.start(colorTemp,nightStart,nightEnd[,transition[,invertAtNight[,windowfilterDisable[,dayColorTemp]]]]) --- Function --- Sets the schedule and (re)starts the module --- --- Parameters: --- * colorTemp - a number indicating the desired color temperature (Kelvin) during the night cycle; --- the recommended range is between 3600K and 1400K; lower values (minimum 1000K) result in a more pronounced adjustment --- * nightStart - a string in the format "HH:MM" (24-hour clock) or number of seconds after midnight --- (see `hs.timer.seconds()`) indicating when the night cycle should start --- * nightEnd - a string in the format "HH:MM" (24-hour clock) or number of seconds after midnight --- (see `hs.timer.seconds()`) indicating when the night cycle should end --- * transition - (optional) a string or number of seconds (see `hs.timer.seconds()`) indicating the duration of --- the transition to the night color temperature and back; if omitted, defaults to 1 hour --- * invertAtNight - (optional) a boolean indicating whether the colors should be inverted (in addition to --- the color temperature shift) during the night; if omitted, defaults to false --- * windowfilterDisable - (optional) an `hs.window.filter` instance that will disable color adjustment --- (and color inversion) whenever any window is allowed; alternatively, you can just provide a list of application --- names (typically media apps and/or apps for color-sensitive work) and a windowfilter will be created --- for you that disables color adjustment whenever one of these apps is focused --- * dayColorTemp - (optional) a number indicating the desired color temperature (in Kelvin) during the day cycle; --- you can use this to maintain some degree of "redshift" during the day as well, or, if desired, you can --- specify a value higher than 6500K (up to 10000K) for more bluish colors, although that's not recommended; --- if omitted, defaults to 6500K, which disables color adjustment and restores your screens' original color profiles --- --- Returns: --- * None function redshift.start(nTemp,nStart,nEnd,dur,invert,wf,dTemp) if not dTemp then dTemp=6500 end if nTemp<1000 or nTemp>10000 or dTemp<1000 or dTemp>10000 then error('invalid color temperature',2) end nStart,nEnd=timer.seconds(nStart),timer.seconds(nEnd) dur=timer.seconds(dur or 3600) if dur>14400 then error('max transition time is 4h',2) end if abs(nStart-nEnd)<dur or abs(nStart-nEnd+86400)<dur or abs(nStart-nEnd-86400)<dur then error('nightTime too close to dayTime',2) end nightTemp,dayTemp=floor(nTemp),floor(dTemp) redshift.stop() invertAtNight=invert nightStart,nightEnd=(nStart-dur/2)%86400,(nStart+dur/2)%86400 dayStart,dayEnd=(nEnd-dur/2)%86400,(nEnd+dur/2)%86400 log.f('started: %dK @ %s -> %dK @ %s,%s %dK @ %s -> %dK @ %s', dayTemp,stime(nightStart),nightTemp,stime(nightEnd),invert and ' inverted,' or '',nightTemp,stime(dayStart),dayTemp,stime(dayEnd)) running=true tmr:setDelay(max(1,dur/200)) screenWatcher=screen.watcher.new(function()tmr:start(5)end):start() invertUser=settings.get(SETTING_INVERTED_OVERRIDE) disableUser=settings.get(SETTING_DISABLED_OVERRIDE) applyGamma() if wf~=nil then if windowfilter.iswf(wf) then wfDisable=wf else wfDisable=windowfilter.new(wf,'wf-redshift',log.getLogLevel()) modulewfDisable=wfDisable if type(wf=='table') then local isAppList=true for k,v in pairs(wf) do if type(k)~='number' or type(v)~='string' then isAppList=false break end end if isAppList then wfDisable:setOverrideFilter{focused=true} end end end redshift.wfsubs={ [windowfilter.hasWindow]=function()redshift.requestDisable('wf-redshift',true)end, [windowfilter.hasNoWindows]=function()redshift.requestDisable('wf-redshift')end, } wfDisable:subscribe(redshift.wfsubs,true) end end --- hs.redshift.COLORRAMP --- Variable --- A table holding the gamma values for given color temperatures; each key must be a color temperature number in K (useful values are between --- 1400 and 6500), and each value must be a list of 3 gamma numbers between 0 and 1 for red, green and blue respectively. --- The table must have at least two entries (a lower and upper bound); the actual gamma values used for a given color temperature --- are linearly interpolated between the two closest entries; linear interpolation isn't particularly precise for this use case, --- so you should provide as many values as possible. --- --- Notes: --- * `hs.inspect(hs.redshift.COLORRAMP)` from the console will show you how the table is built --- * the default ramp has entries from 1000K to 10000K every 100K redshift.COLORRAMP={ -- from https://github.com/jonls/redshift/blob/master/src/colorramp.c [1000]={1.00000000, 0.18172716, 0.00000000}, -- 1000K [1100]={1.00000000, 0.25503671, 0.00000000}, -- 1100K [1200]={1.00000000, 0.30942099, 0.00000000}, -- 1200K [1300]={1.00000000, 0.35357379, 0.00000000}, -- ... [1400]={1.00000000, 0.39091524, 0.00000000}, [1500]={1.00000000, 0.42322816, 0.00000000}, [1600]={1.00000000, 0.45159884, 0.00000000}, [1700]={1.00000000, 0.47675916, 0.00000000}, [1800]={1.00000000, 0.49923747, 0.00000000}, [1900]={1.00000000, 0.51943421, 0.00000000}, [2000]={1.00000000, 0.54360078, 0.08679949}, [2100]={1.00000000, 0.56618736, 0.14065513}, [2200]={1.00000000, 0.58734976, 0.18362641}, [2300]={1.00000000, 0.60724493, 0.22137978}, [2400]={1.00000000, 0.62600248, 0.25591950}, [2500]={1.00000000, 0.64373109, 0.28819679}, [2600]={1.00000000, 0.66052319, 0.31873863}, [2700]={1.00000000, 0.67645822, 0.34786758}, [2800]={1.00000000, 0.69160518, 0.37579588}, [2900]={1.00000000, 0.70602449, 0.40267128}, [3000]={1.00000000, 0.71976951, 0.42860152}, [3100]={1.00000000, 0.73288760, 0.45366838}, [3200]={1.00000000, 0.74542112, 0.47793608}, [3300]={1.00000000, 0.75740814, 0.50145662}, [3400]={1.00000000, 0.76888303, 0.52427322}, [3500]={1.00000000, 0.77987699, 0.54642268}, [3600]={1.00000000, 0.79041843, 0.56793692}, [3700]={1.00000000, 0.80053332, 0.58884417}, [3800]={1.00000000, 0.81024551, 0.60916971}, [3900]={1.00000000, 0.81957693, 0.62893653}, [4000]={1.00000000, 0.82854786, 0.64816570}, [4100]={1.00000000, 0.83717703, 0.66687674}, [4200]={1.00000000, 0.84548188, 0.68508786}, [4300]={1.00000000, 0.85347859, 0.70281616}, [4400]={1.00000000, 0.86118227, 0.72007777}, [4500]={1.00000000, 0.86860704, 0.73688797}, [4600]={1.00000000, 0.87576611, 0.75326132}, [4700]={1.00000000, 0.88267187, 0.76921169}, [4800]={1.00000000, 0.88933596, 0.78475236}, [4900]={1.00000000, 0.89576933, 0.79989606}, [5000]={1.00000000, 0.90198230, 0.81465502}, [5100]={1.00000000, 0.90963069, 0.82838210}, [5200]={1.00000000, 0.91710889, 0.84190889}, [5300]={1.00000000, 0.92441842, 0.85523742}, [5400]={1.00000000, 0.93156127, 0.86836903}, [5500]={1.00000000, 0.93853986, 0.88130458}, [5600]={1.00000000, 0.94535695, 0.89404470}, [5700]={1.00000000, 0.95201559, 0.90658983}, [5800]={1.00000000, 0.95851906, 0.91894041}, [5900]={1.00000000, 0.96487079, 0.93109690}, [6000]={1.00000000, 0.97107439, 0.94305985}, [6100]={1.00000000, 0.97713351, 0.95482993}, [6200]={1.00000000, 0.98305189, 0.96640795}, [6300]={1.00000000, 0.98883326, 0.97779486}, [6400]={1.00000000, 0.99448139, 0.98899179}, [6500]={1.00000000, 1.00000000, 1.00000000}, -- 6500K -- [6500]={0.99999997, 0.99999997, 0.99999997}, --6500K [6600]={0.98947904, 0.99348723, 1.00000000}, [6700]={0.97940448, 0.98722715, 1.00000000}, [6800]={0.96975025, 0.98120637, 1.00000000}, [6900]={0.96049223, 0.97541240, 1.00000000}, [7000]={0.95160805, 0.96983355, 1.00000000}, [7100]={0.94303638, 0.96443333, 1.00000000}, [7200]={0.93480451, 0.95923080, 1.00000000}, [7300]={0.92689056, 0.95421394, 1.00000000}, [7400]={0.91927697, 0.94937330, 1.00000000}, [7500]={0.91194747, 0.94470005, 1.00000000}, [7600]={0.90488690, 0.94018594, 1.00000000}, [7700]={0.89808115, 0.93582323, 1.00000000}, [7800]={0.89151710, 0.93160469, 1.00000000}, [7900]={0.88518247, 0.92752354, 1.00000000}, [8000]={0.87906581, 0.92357340, 1.00000000}, [8100]={0.87315640, 0.91974827, 1.00000000}, [8200]={0.86744421, 0.91604254, 1.00000000}, [8300]={0.86191983, 0.91245088, 1.00000000}, [8400]={0.85657444, 0.90896831, 1.00000000}, [8500]={0.85139976, 0.90559011, 1.00000000}, [8600]={0.84638799, 0.90231183, 1.00000000}, [8700]={0.84153180, 0.89912926, 1.00000000}, [8800]={0.83682430, 0.89603843, 1.00000000}, [8900]={0.83225897, 0.89303558, 1.00000000}, [9000]={0.82782969, 0.89011714, 1.00000000}, [9100]={0.82353066, 0.88727974, 1.00000000}, [9200]={0.81935641, 0.88452017, 1.00000000}, [9300]={0.81530175, 0.88183541, 1.00000000}, [9400]={0.81136180, 0.87922257, 1.00000000}, [9500]={0.80753191, 0.87667891, 1.00000000}, [9600]={0.80380769, 0.87420182, 1.00000000}, [9700]={0.80018497, 0.87178882, 1.00000000}, [9800]={0.79665980, 0.86943756, 1.00000000}, [9900]={0.79322843, 0.86714579, 1.00000000}, [10000]={0.78988728, 0.86491137, 1.00000000}, -- 10000K } return setmetatable(redshift,{__gc=gc})
mit
keneanung/mudlet
src/mudlet-lua/lua/TableUtils.lua
12
8643
---------------------------------------------------------------------------------- --- Mudlet Table Utils ---------------------------------------------------------------------------------- --- Tests if a table is empty: this is useful in situations where you find --- yourself wanting to do 'if my_table == {}' and such. --- --- @usage Testing if the table is empty. --- <pre> --- myTable = {} --- if table.is_empty(myTable) then --- echo("myTable is empty") --- end --- </pre> function table.is_empty(tbl) for k, v in pairs(tbl) do return false end return true end --- Lua debug function that prints the content of a Lua table on the screen, split up in keys and values. --- Useful if you want to see what the capture groups contain i. e. the Lua table "matches". --- --- @see display function printTable( map ) echo("-------------------------------------------------------\n"); for k, v in pairs( map ) do echo( "key=" .. k .. " value=" .. v .. "\n" ) end echo("-------------------------------------------------------\n"); end -- NOT LUADOC -- This is supporting function for printTable(). function __printTable( k, v ) insertText ("\nkey = " .. tostring (k) .. " value = " .. tostring( v ) ) end --- Lua debug function that prints the content of a Lua table on the screen. <br/> --- There are currently 3 functions with similar behaviour. --- --- @see display --- @see printTable function listPrint( map ) echo("-------------------------------------------------------\n"); for k,v in ipairs( map ) do echo( k .. ". ) "..v .. "\n" ); end echo("-------------------------------------------------------\n"); end --- <b><u>TODO</u></b> listAdd( list, what ) function listAdd( list, what ) table.insert( list, what ); end --- <b><u>TODO</u></b> listRemove( list, what ) function listRemove( list, what ) for k,v in ipairs( list ) do if v == what then table.remove( list, k ) end end end --- Gets the actual size of non-index based tables. <br/><br/> --- --- For index based tables you can get the size with the # operator: <br/> --- This is the standard Lua way of getting the size of index tables i.e. ipairs() type of tables with --- numerical indices. To get the size of tables that use user defined keys instead of automatic indices --- (pairs() type) you need to use the function table.size() referenced above. --- <pre> --- myTableSize = # myTable --- </pre> function table.size(t) if not t then return 0 end local i = 0 for k, v in pairs(t) do i = i + 1 end return i end --- Determines if a table contains a value as a key or as a value (recursive). function table.contains(t, value) for k, v in pairs(t) do if v == value then return true elseif k == value then return true elseif type(v) == "table" then if table.contains(v, value) then return true end end end return false end --- Table Union. --- --- @return Returns a table that is the union of the provided tables. This is a union of key/value --- pairs. If two or more tables contain different values associated with the same key, --- that key in the returned table will contain a subtable containing all relevant values. --- See table.n_union() for a union of values. Note that the resulting table may not be --- reliably traversable with ipairs() due to the fact that it preserves keys. If there --- is a gap in numerical indices, ipairs() will cease traversal. --- --- @usage Example: --- <pre> --- tableA = { --- [1] = 123, --- [2] = 456, --- ["test"] = "test", --- } --- --- tableB = { --- [1] = 23, --- [3] = 7, --- ["test2"] = function() return true end, --- } --- --- tableC = { --- [5] = "c", --- } --- --- table.union(tableA, tableB, tableC) will return: --- { --- [1] = { --- 123, --- 23, --- }, --- [2] = 456, --- [3] = 7, --- [5] = "c", --- ["test"] = "test", --- ["test2"] = function() return true end, --- } --- </pre> function table.union(...) local sets = {...} local union = {} for _, set in ipairs(sets) do for key, val in pairs(set) do if union[key] and union[key] ~= val then if type(union[key]) == 'table' then table.insert(union[key], val) else union[key] = { union[key], val } end else union[key] = val end end end return union end --- Table Union. --- --- @return Returns a numerically indexed table that is the union of the provided tables. This is --- a union of unique values. The order and keys of the input tables are not preserved. function table.n_union(...) local sets = {...} local union = {} local union_keys = {} for _, set in ipairs(sets) do for key, val in pairs(set) do if not union_keys[val] then union_keys[val] = true table.insert(union, val) end end end return union end --- Table Intersection. --- --- @return Returns a table that is the intersection of the provided tables. This is an --- intersection of key/value pairs. See table.n_intersection() for an intersection of values. --- Note that the resulting table may not be reliably traversable with ipairs() due to --- the fact that it preserves keys. If there is a gap in numerical indices, ipairs() will --- cease traversal. --- --- @usage Example: --- <pre> --- tableA = { --- [1] = 123, --- [2] = 456, --- [4] = { 1, 2 }, --- [5] = "c", --- ["test"] = "test", --- } --- --- tableB = { --- [1] = 123, --- [2] = 4, --- [3] = 7, --- [4] = { 1, 2 }, --- ["test"] = function() return true end, --- } --- --- tableC = { --- [1] = 123, --- [4] = { 1, 2 }, --- [5] = "c", --- } --- --- table.intersection(tableA, tableB, tableC) will return: --- { --- [1] = 123, --- [4] = { 1, 2 }, --- } --- </pre> function table.intersection(...) sets = {...} if #sets < 2 then return false end local intersection = {} local function intersect(set1, set2) local result = {} for key, val in pairs(set1) do if set2[key] then if _comp(val, set2[key]) then result[key] = val end end end return result end intersection = intersect(sets[1], sets[2]) for i, _ in ipairs(sets) do if i > 2 then intersection = intersect(intersection, sets[i]) end end return intersection end --- Table Intersection. --- --- @return Returns a numerically indexed table that is the intersection of the provided tables. --- This is an intersection of unique values. The order and keys of the input tables are --- not preserved. function table.n_intersection(...) sets = {...} if #sets < 2 then return false end local intersection = {} local function intersect(set1, set2) local intersection_keys = {} local result = {} for _, val1 in pairs(set1) do for _, val2 in pairs(set2) do if _comp(val1, val2) and not intersection_keys[val1] then table.insert(result, val1) intersection_keys[val1] = true end end end return result end intersection = intersect(sets[1], sets[2]) for i, _ in ipairs(sets) do if i > 2 then intersection = intersect(intersection, sets[i]) end end return intersection end --- Table Complement. --- --- @return Returns a table that is the relative complement of the first table with respect to --- the second table. Returns a complement of key/value pairs. function table.complement(set1, set2) if not set1 and set2 then return false end if type(set1) ~= 'table' or type(set2) ~= 'table' then return false end local complement = {} for key, val in pairs(set1) do if not _comp(set2[key], val) then complement[key] = val end end return complement end --- Table Complement. --- --- @return Returns a table that is the relative complement of the first table with respect to --- the second table. Returns a complement of values. function table.n_complement(set1, set2) if not set1 and set2 then return false end local complement = {} for _, val1 in pairs(set1) do local insert = true for _, val2 in pairs(set2) do if _comp(val1, val2) then insert = false end end if insert then table.insert(complement, val1) end end return complement end --- <b><u>TODO</u></b> table:update(t1, t2) function table:update(t1, t2) for k,v in pairs(t2) do if type(v) == "table" then t1[k] = self.update(t1[k] or {}, v) else t1[k] = v end end return t1 end ---Returns the index of the value in a table function table.index_of(table, element) for index, value in ipairs(table) do if value == element then return index end end return nil end
gpl-2.0
yuin/silkylog
config.lua
1
2810
silkylog = require("silkylog") config { debug = false, site_url = "http://example.com/", editor = {"vim"}, numthreads = 8, timezone = "JST +09:00", theme = "default", pagination1 = 3, pagination2 = 50, trim_html = true, params = { author = "Your name", site_name = "Your site", site_description = "Your site description", google_analytics_id = "", disqus_short_name = "", }, top_url_path = "", article_url_path = [[articles/{{ .PostedAt.Year | printf "%04d" }}/{{ .PostedAt.Month | printf "%02d" }}/{{ .PostedAt.Day | printf "%02d" }}/{{ .Slug }}.html]], article_title = [[{{ .App.Config.Params.SiteName }} :: {{ .Article.Title }}]], index_url_path = [[{{if (eq .Page 0)}}index.html{{else}}page/{{ .Page }}/index.html{{end}}]], index_title = [[{{.App.Config.Params.SiteName}}]], tag_url_path = [[articles/tag/{{ .Tag }}/{{if (ne .Page 0)}}page/{{ .Page }}/{{end}}index.html]], tag_title = [[{{.App.Config.Params.SiteName}} :: tag :: {{.Tag}}]], annual_url_path = [[articles/{{ .Year | printf "%04d" }}/{{if (ne .Page 0)}}page/{{ .Page }}/{{end}}index.html]], annual_title = [[{{.App.Config.Params.SiteName}} :: annual archive :: {{.Year}}]], monthly_url_path = [[articles/{{ .Year | printf "%04d" }}/{{ .Month | printf "%02d" }}/{{if (ne .Page 0)}}page/{{ .Page }}/{{end}}index.html]], monthly_title = [[{{.App.Config.Params.SiteName}} :: monthly archive :: {{.Year}}.{{.Month}}]], include_url_path = [[include/{{ .Name }}]], feed_url_path = [[{{ .Name }}]], file_url_path = [[{{ .Path }}]], content_dir = "src", output_dir = "public_html", theme_dir = "themes", extra_files = { {src = "favicon.ico", dst = "", template = false}, {src = "404.html", dst = "", template = false}, {src = "CNAME", dst = "", template = false}, {src = "profile.html", dst = "", template = true} }, clean = { "articles", "page", }, markup_processors = { [".md"] = { name = "blackfriday", htmlopts = { "HTML_USE_XHTML", "HTML_USE_SMARTYPANTS", "HTML_SMARTYPANTS_FRACTIONS", "HTML_SMARTYPANTS_LATEX_DASHES" }, exts = { "EXTENSION_NO_INTRA_EMPHASIS", "EXTENSION_TABLES", "EXTENSION_FENCED_CODE", "EXTENSION_AUTOLINK", "EXTENSION_STRIKETHROUGH", "EXTENSION_SPACE_HEADERS", "EXTENSION_HEADER_IDS" } }, [".rst"] = function(text) local html = assert(silkylog.runprocessor([[python]],[[rst2html.py]], text)) return html end } }
mit
mms92/wire
lua/entities/gmod_wire_egp/lib/egplib/umsgsystem.lua
18
1133
-------------------------------------------------------- -- Custom umsg System -------------------------------------------------------- local EGP = EGP local CurSender local LastErrorTime = 0 --[[ Transmit Sizes: Angle = 12 Bool = 1 Char = 1 Entity = 2 Float = 4 Long = 4 Short = 2 String = string length Vector = 12 VectorNormal = 12 ]] EGP.umsg = {} function EGP.umsg.Start( name, sender ) if CurSender then if (LastErrorTime + 1 < CurTime()) then ErrorNoHalt("[EGP] Umsg error. It seems another umsg is already sending, but it occured over 1 second ago. Ending umsg.") EGP.umsg.End() else ErrorNoHalt("[EGP] Umsg error. Another umsg is already sending!") if (LastErrorTime + 2 < CurTime()) then LastErrorTime = CurTime() end return false end end CurSender = sender net.Start( name ) return true end function EGP.umsg.End() if CurSender then if not EGP.IntervalCheck[CurSender] then EGP.IntervalCheck[CurSender] = { bytes = 0, time = 0 } end EGP.IntervalCheck[CurSender].bytes = EGP.IntervalCheck[CurSender].bytes + net.BytesWritten() end net.Broadcast() CurSender = nil end
apache-2.0
AlexarJING/space-war
lib/loveframes/objects/internal/scrollable/scrollbody.lua
17
6652
--[[------------------------------------------------ -- Love Frames - A GUI library for LOVE -- -- Copyright (c) 2012-2014 Kenny Shields -- --]]------------------------------------------------ -- get the current require path local path = string.sub(..., 1, string.len(...) - string.len(".objects.internal.scrollable.scrollbody")) local loveframes = require(path .. ".libraries.common") -- scrollbar class local newobject = loveframes.NewObject("scrollbody", "loveframes_object_scrollbody", true) --[[--------------------------------------------------------- - func: initialize() - desc: initializes the object --]]--------------------------------------------------------- function newobject:initialize(parent, bartype) self.type = "scrollbody" self.bartype = bartype self.parent = parent self.x = 0 self.y = 0 self.internal = true self.internals = {} if self.bartype == "vertical" then self.width = 16 self.height = self.parent.height self.staticx = self.parent.width - self.width self.staticy = 0 elseif self.bartype == "horizontal" then self.width = self.parent.width self.height = 16 self.staticx = 0 self.staticy = self.parent.height - self.height end table.insert(self.internals, loveframes.objects["scrollarea"]:new(self, bartype)) local bar = self.internals[1].internals[1] if self.bartype == "vertical" then local upbutton = loveframes.objects["scrollbutton"]:new("up") upbutton.staticx = 0 + self.width - upbutton.width upbutton.staticy = 0 upbutton.parent = self upbutton.Update = function(object, dt) upbutton.staticx = 0 + self.width - upbutton.width upbutton.staticy = 0 if object.down and object.hover then local dtscrolling = self.parent.dtscrolling if dtscrolling then local dt = love.timer.getDelta() bar:Scroll(-self.parent.buttonscrollamount * dt) else bar:Scroll(-self.parent.buttonscrollamount) end end end local downbutton = loveframes.objects["scrollbutton"]:new("down") downbutton.parent = self downbutton.staticx = 0 + self.width - downbutton.width downbutton.staticy = 0 + self.height - downbutton.height downbutton.Update = function(object, dt) downbutton.staticx = 0 + self.width - downbutton.width downbutton.staticy = 0 + self.height - downbutton.height downbutton.x = downbutton.parent.x + downbutton.staticx downbutton.y = downbutton.parent.y + downbutton.staticy if object.down and object.hover then local dtscrolling = self.parent.dtscrolling if dtscrolling then local dt = love.timer.getDelta() bar:Scroll(self.parent.buttonscrollamount * dt) else bar:Scroll(self.parent.buttonscrollamount) end end end table.insert(self.internals, upbutton) table.insert(self.internals, downbutton) elseif self.bartype == "horizontal" then local leftbutton = loveframes.objects["scrollbutton"]:new("left") leftbutton.parent = self leftbutton.staticx = 0 leftbutton.staticy = 0 leftbutton.Update = function(object, dt) leftbutton.staticx = 0 leftbutton.staticy = 0 if object.down and object.hover then local dtscrolling = self.parent.dtscrolling if dtscrolling then local dt = love.timer.getDelta() bar:Scroll(-self.parent.buttonscrollamount * dt) else bar:Scroll(-self.parent.buttonscrollamount) end end end local rightbutton = loveframes.objects["scrollbutton"]:new("right") rightbutton.parent = self rightbutton.staticx = 0 + self.width - rightbutton.width rightbutton.staticy = 0 rightbutton.Update = function(object, dt) rightbutton.staticx = 0 + self.width - rightbutton.width rightbutton.staticy = 0 rightbutton.x = rightbutton.parent.x + rightbutton.staticx rightbutton.y = rightbutton.parent.y + rightbutton.staticy if object.down and object.hover then local dtscrolling = self.parent.dtscrolling if dtscrolling then local dt = love.timer.getDelta() bar:Scroll(self.parent.buttonscrollamount * dt) else bar:Scroll(self.parent.buttonscrollamount) end end end table.insert(self.internals, leftbutton) table.insert(self.internals, rightbutton) end local parentstate = parent.state self:SetState(parentstate) -- apply template properties to the object loveframes.templates.ApplyToObject(self) end --[[--------------------------------------------------------- - func: update(deltatime) - desc: updates the object --]]--------------------------------------------------------- function newobject:update(dt) local visible = self.visible local alwaysupdate = self.alwaysupdate if not visible then if not alwaysupdate then return end end self:CheckHover() local parent = self.parent local base = loveframes.base local update = self.Update local internals = self.internals -- move to parent if there is a parent if parent ~= base then self.x = parent.x + self.staticx self.y = parent.y + self.staticy end -- resize to parent if parent ~= base then if self.bartype == "vertical" then self.height = self.parent.height self.staticx = self.parent.width - self.width if parent.hbar then self.height = self.height - parent:GetHorizontalScrollBody().height end elseif self.bartype == "horizontal" then self.width = self.parent.width self.staticy = self.parent.height - self.height if parent.vbar then self.width = self.width - parent:GetVerticalScrollBody().width end end end for k, v in ipairs(internals) do v:update(dt) end if update then update(self, dt) end end --[[--------------------------------------------------------- - func: draw() - desc: draws the object --]]--------------------------------------------------------- function newobject:draw() local visible = self.visible if not visible then return end local skins = loveframes.skins.available local skinindex = loveframes.config["ACTIVESKIN"] local defaultskin = loveframes.config["DEFAULTSKIN"] local selfskin = self.skin local skin = skins[selfskin] or skins[skinindex] local drawfunc = skin.DrawScrollBody or skins[defaultskin].DrawScrollBody local draw = self.Draw local drawcount = loveframes.drawcount local internals = self.internals -- set the object's draw order self:SetDrawOrder() if draw then draw(self) else drawfunc(self) end for k, v in ipairs(internals) do v:draw() end end --[[--------------------------------------------------------- - func: GetScrollBar() - desc: gets the object's scroll bar --]]--------------------------------------------------------- function newobject:GetScrollBar() return self.internals[1].internals[1] end
apache-2.0
vipteam1/VIPTEAM
plugins/dletemsg.lua
1
1535
--[[ ▀▄ ▄▀▀▄▄▀▀▄▄▀▀▄▄▀▀▄▄▀▀▄▄▀▀▄▄▀▀▄▀▄▄▀▀▄▄▀▀▄▄▀ ▀▄ ▄▀ ▀▄ ▄▀ ▀▄ ▄▀ Team name : ( 🌐 VIP_TEAM 🌐 )▀▄ ▄▀ ▀▄ ▄▀ ▀▄ ▄▀ ▀▄ ▄▀ File name : ( #dletemsg ) ▀▄ ▄▀ ▀▄ ▄▀ ▀▄ ▄▀ ▀▄ ▄▀ Guenat team: ( @VIP_TEAM1 ) ▀▄ ▄▀ ▀▄ ▄▀ ▀▄ ▄▀ ▀▄▀▀▄▄▀▀▄▄▀▄▄▀▀▄▄▀▀▄▄▀▄▄▀▀▄▄▀▀▄▄▀▄▄▀▀▄▄▀▀▄▄ —]] local function history(extra, suc, result) for i=1, #result do delete_msg(result[i].id, ok_cb, false) end if tonumber(extra.con) == #result then send_msg(extra.chatid, '⛔️ "'..#result..'" The msgs is cleaned !', ok_cb, false) else send_msg(extra.chatid, '⛔️ The msgs is cleaned !', ok_cb, false) end end local function run(msg, matches) if matches[1] == 'حذف' and is_owner(msg) then if msg.to.type == 'channel' then if tonumber(matches[2]) > 1000000 or tonumber(matches[2]) < 1 then return "only from num 1 to 1000000 !!" end get_history(msg.to.peer_id, matches[2] + 1 , history , {chatid = msg.to.peer_id, con = matches[2]}) else return "4 owner only" end else return end end return { patterns = { '^(حذف) (%d*)$' }, run = run }
gpl-2.0
thenumbernine/hydro-cl-lua
tests/running two solvers at once/run.lua
1
5233
#!/usr/bin/env luajit require 'ext' local ffi = require 'ffi' local unistd = require 'ffi.c.unistd' require 'ffi.c.stdlib' local dirp = unistd.getcwd(nil, 0) local dir = ffi.string(dirp) ffi.C.free(dirp) unistd.chdir'../..' -- honestly what's App used for anyways, beyond the gui? -- the cl.env ... can I build a solver without app, but just with a cl.env? local App = class(require 'hydro.app') function App:setup() local args = { app = self, dim = 1, integrator = 'forward Euler', fluxLimiter = 'superbee', coord = 'cartesian', mins = {-1, -1, -1}, maxs = {1, 1, 1}, gridSize = {256, 256, 256}, boundary = { xmin='freeflow', xmax='freeflow', ymin='freeflow', ymax='freeflow', zmin='freeflow', zmax='freeflow', }, initState = 'Sod', --initState = 'self-gravitation test 1', } -- [=[ two-solver testing ... -- running two solvers at once causes errors local app = self local cl = require 'hydro.solver.roe' args.eqn = 'euler' --args.eqn = 'maxwell' --args.eqn = 'mhd' self.solvers:insert(cl(args)) self.solvers:insert(cl(args)) local s1, s2 = self.solvers:unpack() local numReals = s1.numCells * s1.eqn.numStates local ptr1 = ffi.new('real[?]', numReals) local ptr2 = ffi.new('real[?]', numReals) local function compare(buf1, buf2) app.cmds:enqueueReadBuffer{buffer=buf1, block=true, size=ffi.sizeof(app.real) * numReals, ptr=ptr1} app.cmds:enqueueReadBuffer{buffer=buf2, block=true, size=ffi.sizeof(app.real) * numReals, ptr=ptr2} local diff for i=0,numReals-1 do if ptr1[i] ~= ptr2[i] then diff = i break end end if diff then for i=0,numReals-1 do io.write(('%7d '):format(i)) for j,v in ipairs{ptr1, ptr2} do io.write(({' ','/'})[j]) local vi = v[i] local s = vi and ('%.8e'):format(v[i]) or 'nil' local ip = ffi.cast('int*', v+i) s = s .. '(' .. (ip and (('%08x'):format(ip[1]):sub(-8) .. ('%08x'):format(ip[0]):sub(-8)) or 'nil') .. ')' io.write(s) end local col = 1 if i%col==col-1 then print() end end print() local ch = diff % s1.eqn.numStates local x = math.floor(diff / tonumber(s1.eqn.numStates * s1.gridSize.x)) % tonumber(s1.gridSize.y) local y = math.floor(diff / tonumber(s1.eqn.numStates * s1.gridSize.x * s1.gridSize.y)) print('index '..diff ..' coord '..x..', '..y..' ch '..ch ..' differs:',ptr1[diff], ptr2[diff]) s1:save's1' s2:save's2' error'here' end end --for _,s in ipairs(self.solvers) do s.useFixedDT = true s.fixedDT = .025 end --s2.integrator = s1.integrator --function s2:update() self.t = self.t + .1 end --function s2:boundary() end --function s2:calcDT() return s1.fixedDT end -- [==[ messing with step to find the problem function s2:step(dt) --[[ fails s1.integrator:integrate(dt, function(derivBufObj) self:calcDeriv(derivBufObj, dt) end) --]] --[[ seems to work fine, but we're not adding to UBuf self:calcDeriv(s1.integrator.derivBufObj, dt) --]] --[[ works as well .. but doesn't add to s2's UBuf self:calcDeriv(self.integrator.derivBufObj, dt) --]] -- [[ fails with inline forward euler -- calcDeriv runs fine on its own -- everything except calcDeriv runs on its own -- but as soon as the two are put together, it dies app.cmds:enqueueFillBuffer{buffer=self.integrator.derivBufObj.obj, size=self.numCells * self.eqn.numStates * ffi.sizeof(app.real)} -- this produces crap in s2 -- if it's not added into s2's UBuf then we're safe -- if it isn't called and zero is added to s2's UBuf then we're safe self:calcDeriv(self.integrator.derivBufObj, dt) -- why does derivBufObj differ? -- something is corrupting every numStates data ... like something is writing out of bounds ... --compare(s1.integrator.derivBufObj.obj, s2.integrator.derivBufObj.obj) self.multAddKernelObj( self.UBuf, s1.UBuf, -- using self.integrator.derivBufObj.obj fails -- but using s1.integrator.derivBufObj.obj works ... worked .... s1.integrator.derivBufObj.obj, ffi.new('real[1]', dt)) --]] --[[ fails with the other solver's forward-euler and multAddKernel app.cmds:finish() app.cmds:enqueueFillBuffer{buffer=s1.integrator.derivBufObj.obj, size=self.numCells * self.eqn.numStates * ffi.sizeof(app.real)} self:calcDeriv(s1.integrator.derivBufObj, dt) s1.multAddKernelObj(self.UBuf, self.UBuf, s1.integrator.derivBufObj.obj, ffi.new('real[1]', dt)) app.cmds:finish() --]] --[[ just adding s1's deriv to s2? works fine s1.multAddKernelObj(self.UBuf, self.UBuf, s1.integrator.derivBufObj.obj, ffi.new('real[1]', dt)) s1.multAddKernelObj.obj:setArgs(s1.UBuf, s1.UBuf, s1.integrator.derivBufObj.obj, ffi.new('real[1]', dt)) --]] -- so the code in common is when calcDeriv is called by the 2nd solver ... -- ... regardless of what buffer it is written to end --]==] --[==[ comparing buffers. tends to die on the boundaries even if it is working (why is that?) function s2:update() s1.update(self) -- ...annd even when using s1's derivBufObj, this dies once the wave hits a boundary -- complains about negative'd values (with mirror boundary conditions) compare(s1.UBuf, s2.UBuf) end --]==] --]=] end App():run()
mit
Tele-Sped/Tele-Sped
plugins/all.lua
1321
4661
do data = load_data(_config.moderation.data) local function get_msgs_user_chat(user_id, chat_id) local user_info = {} local uhash = 'user:'..user_id local user = redis:hgetall(uhash) local um_hash = 'msgs:'..user_id..':'..chat_id user_info.msgs = tonumber(redis:get(um_hash) or 0) user_info.name = user_print_name(user)..' ['..user_id..']' return user_info end local function chat_stats(chat_id) local hash = 'chat:'..chat_id..':users' local users = redis:smembers(hash) local users_info = {} for i = 1, #users do local user_id = users[i] local user_info = get_msgs_user_chat(user_id, chat_id) table.insert(users_info, user_info) end table.sort(users_info, function(a, b) if a.msgs and b.msgs then return a.msgs > b.msgs end end) local text = 'Chat stats:\n' for k,user in pairs(users_info) do text = text..user.name..' = '..user.msgs..'\n' end return text end local function get_group_type(target) local data = load_data(_config.moderation.data) local group_type = data[tostring(target)]['group_type'] if not group_type or group_type == nil then return 'No group type available.' end return group_type end local function show_group_settings(target) local data = load_data(_config.moderation.data) if data[tostring(target)] then if data[tostring(target)]['settings']['flood_msg_max'] then NUM_MSG_MAX = tonumber(data[tostring(target)]['settings']['flood_msg_max']) print('custom'..NUM_MSG_MAX) else NUM_MSG_MAX = 5 end end local settings = data[tostring(target)]['settings'] local text = "Lock group name : "..settings.lock_name.."\nLock group photo : "..settings.lock_photo.."\nLock group member : "..settings.lock_member.."\nflood sensitivity : "..NUM_MSG_MAX return text end local function get_description(target) local data = load_data(_config.moderation.data) local data_cat = 'description' if not data[tostring(target)][data_cat] then return 'No description available.' end local about = data[tostring(target)][data_cat] return about end local function get_rules(target) local data = load_data(_config.moderation.data) local data_cat = 'rules' if not data[tostring(target)][data_cat] then return 'No rules available.' end local rules = data[tostring(target)][data_cat] return rules end local function modlist(target) local data = load_data(_config.moderation.data) local groups = 'groups' if not data[tostring(groups)] or not data[tostring(groups)][tostring(target)] then return 'Group is not added or is Realm.' end if next(data[tostring(target)]['moderators']) == nil then return 'No moderator in this group.' end local i = 1 local message = '\nList of moderators :\n' for k,v in pairs(data[tostring(target)]['moderators']) do message = message ..i..' - @'..v..' [' ..k.. '] \n' i = i + 1 end return message end local function get_link(target) local data = load_data(_config.moderation.data) local group_link = data[tostring(target)]['settings']['set_link'] if not group_link or group_link == nil then return "No link" end return "Group link:\n"..group_link end local function all(target, receiver) local text = "All the things I know about this group\n\n" local group_type = get_group_type(target) text = text.."Group Type: \n"..group_type local settings = show_group_settings(target) text = text.."\n\nGroup settings: \n"..settings local rules = get_rules(target) text = text.."\n\nRules: \n"..rules local description = get_description(target) text = text.."\n\nAbout: \n"..description local modlist = modlist(target) text = text.."\n\nMods: \n"..modlist local link = get_link(target) text = text.."\n\nLink: \n"..link local stats = chat_stats(target) text = text.."\n\n"..stats local ban_list = ban_list(target) text = text.."\n\n"..ban_list local file = io.open("./groups/all/"..target.."all.txt", "w") file:write(text) file:flush() file:close() send_document(receiver,"./groups/all/"..target.."all.txt", ok_cb, false) return end function run(msg, matches) if matches[1] == "all" and matches[2] and is_owner2(msg.from.id, matches[2]) then local receiver = get_receiver(msg) local target = matches[2] return all(target, receiver) end if not is_owner(msg) then return end if matches[1] == "all" and not matches[2] then local receiver = get_receiver(msg) if not is_owner(msg) then return end return all(msg.to.id, receiver) end end return { patterns = { "^[!/](all)$", "^[!/](all) (%d+)$" }, run = run } end
agpl-3.0
fidlej/optim
adagrad.lua
10
1621
--[[ ADAGRAD implementation for SGD ARGS: - `opfunc` : a function that takes a single input (X), the point of evaluation, and returns f(X) and df/dX - `x` : the initial point - `state` : a table describing the state of the optimizer; after each call the state is modified - `state.learningRate` : learning rate - `state.paramVariance` : vector of temporal variances of parameters RETURN: - `x` : the new x vector - `f(x)` : the function, evaluated before the update ]] function optim.adagrad(opfunc, x, config, state) -- (0) get/update state if config == nil and state == nil then print('no state table, ADAGRAD initializing') end local config = config or {} local state = state or config local lr = config.learningRate or 1e-3 local lrd = config.learningRateDecay or 0 state.evalCounter = state.evalCounter or 0 local nevals = state.evalCounter -- (1) evaluate f(x) and df/dx local fx,dfdx = opfunc(x) -- (3) learning rate decay (annealing) local clr = lr / (1 + nevals*lrd) -- (4) parameter update with single or individual learning rates if not state.paramVariance then state.paramVariance = torch.Tensor():typeAs(x):resizeAs(dfdx):zero() state.paramStd = torch.Tensor():typeAs(x):resizeAs(dfdx) end state.paramVariance:addcmul(1,dfdx,dfdx) state.paramStd:resizeAs(state.paramVariance):copy(state.paramVariance):sqrt() x:addcdiv(-clr, dfdx,state.paramStd:add(1e-10)) -- (5) update evaluation counter state.evalCounter = state.evalCounter + 1 -- return x*, f(x) before optimization return x,{fx} end
bsd-3-clause
vipteam1/VIPTEAM
plugins/lock_media.lua
1
1691
--[[ ▀▄ ▄▀▀▄▄▀▀▄▄▀▀▄▄▀▀▄▄▀▀▄▄▀▀▄▄▀▀▄▀▄▄▀▀▄▄▀▀▄▄▀ ▀▄ ▄▀ ▀▄ ▄▀ ▀▄ ▄▀ Team name : ( 🌐 VIP_TEAM 🌐 )▀▄ ▄▀ ▀▄ ▄▀ ▀▄ ▄▀ ▀▄ ▄▀ File name : ( #اسم الملف هنا ) ▀▄ ▄▀ ▀▄ ▄▀ ▀▄ ▄▀ ▀▄ ▄▀ Guenat team: ( @VIP_TEAM1 ) ▀▄ ▄▀ ▀▄ ▄▀ ▀▄ ▄▀ ▀▄▀▀▄▄▀▀▄▄▀▄▄▀▀▄▄▀▀▄▄▀▄▄▀▀▄▄▀▀▄▄▀▄▄▀▀▄▄▀▀▄▄ —]] local function vip_team1(msg, matches) if is_momod(msg) then return end local data = load_data(_config.moderation.data) if data[tostring(msg.to.id)] then if data[tostring(msg.to.id)]['settings'] then if data[tostring(msg.to.id)]['settings']['media'] then lock_media = data[tostring(msg.to.id)]['settings']['media'] end end end local chat = get_receiver(msg) local user = "user#id"..msg.from.id if lock_media == "yes" then delete_msg(msg.id, ok_cb, true) send_large_msg(get_receiver(msg), 'عزيزي " '..msg.from.first_name..' "\nممنوع مشاركة " الصور - الروابط - الاعلانات - المواقع " هنا التزم بقوانين المجموعة 👮\n#Username : @'..msg.from.username) end end return { patterns = { "%[(photo)%]", "%[(document)%]", "%[(video)%]", "%[(audio)%]", "%[(gif)%]", "%[(sticker)%]", }, run = vip_team1 }
gpl-2.0
Ettercap/ettercap
src/lua/share/core/hook_points.lua
9
6396
--- -- Provides hook point values for those setting up ettercap lua scripts. -- -- These values are defined in include/ec_hook.h, so this module will need -- to be updated if that file ever changes! -- -- Copyright (C) Ryan Linn and Mike Ryan -- -- This program is free software; you can redistribute it and/or modify -- it under the terms of the GNU General Public License as published by -- the Free Software Foundation; either version 2 of the License, or -- (at your option) any later version. -- -- This program is distributed in the hope that it will be useful, -- but WITHOUT ANY WARRANTY; without even the implied warranty of -- MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the -- GNU General Public License for more details. -- -- You should have received a copy of the GNU General Public License -- along with this program; if not, write to the Free Software -- Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. -- -- @module hook_points --- @usage local usage = [[ ... hook_point = ettercap.hook_points.tcp ... ]] local ffi = require("ettercap_ffi") local hook_points = {} --- All raw packets, prior to any dissecting. -- <br/>Defined in include/ec_hook.h as HOOK_RECEIVED hook_points.packet_received = ffi.C.HOOK_RECEIVED --- All packets, after protocol dissecting has been done. -- <br/>Defined in include/ec_hook.h as HOOK_DECODED hook_points.protocol_decoded = ffi.C.HOOK_DECODED --- Packets, just prior to being forwarded (if it has to be forwarded). -- <br/>Defined in include/ec_hook.h as HOOK_PRE_FORWARD hook_points.pre_forward = ffi.C.HOOK_PRE_FORWARD --- Packets at the top of the stack, but before the decision of PO_INGORE. -- <br/>Defined in include/ec_hook.h as HOOK_HANDLED hook_points.handled = ffi.C.HOOK_HANDLED --- All packets at the content filtering point. -- <br/>Defined in include/ec_hook.h as HOOK_FILTER hook_points.filter = ffi.C.HOOK_FILTER --- Packets in the TOP HALF (the packet is a copy). -- <br/>Defined in include/ec_hook.h as HOOK_DISPATCHER hook_points.dispatcher = ffi.C.HOOK_DISPATCHER --- Any ethernet packet. -- <br/>Defined in include/ec_hook.h as HOOK_PACKET_ETH hook_points.eth = ffi.C.HOOK_PACKET_ETH --- Any FDDI packet. -- <br/>Defined in include/ec_hook.h as HOOK_PACKET_FDDI hook_points.fddi = ffi.C.HOOK_PACKET_FDDI --- Any token ring packet. -- <br/>Defined in include/ec_hook.h as HOOK_PACKET_TR hook_points.token_ring = ffi.C.HOOK_PACKET_TR --- Any wifi packet. -- <br/>Defined in include/ec_hook.h as HOOK_PACKET_WIFI hook_points.wifi = ffi.C.HOOK_PACKET_WIFI --- Any ARP packet. -- <br/>Defined in include/ec_hook.h as HOOK_PACKET_ARP hook_points.arp = ffi.C.HOOK_PACKET_ARP --- ARP requests. -- <br/>Defined in include/ec_hook.h as HOOK_PACKET_ARP_RQ hook_points.arp_request = ffi.C.HOOK_PACKET_ARP_RQ --- ARP replies. -- <br/>Defined in include/ec_hook.h as HOOK_PACKET_ARP_RP hook_points.arp_reply = ffi.C.HOOK_PACKET_ARP_RP --- Any IP packet. -- <br/>Defined in include/ec_hook.h as HOOK_PACKET_IP hook_points.ip = ffi.C.HOOK_PACKET_IP --- Any IPv6 packet. -- <br/>Defined in include/ec_hook.h as HOOK_PACKET_IP6 hook_points.ipv6 = ffi.C.HOOK_PACKET_IP6 --- Any VLAN packet. -- <br/>Defined in include/ec_hook.h as HOOK_PACKET_VLAN hook_points.vlan = ffi.C.HOOK_PACKET_VLAN --- Any UDP packet. -- <br/>Defined in include/ec_hook.h as HOOK_PACKET_UDP hook_points.udp = ffi.C.HOOK_PACKET_UDP --- Any TCP packet. -- <br/>Defined in include/ec_hook.h as HOOK_PACKET_TCP hook_points.tcp = ffi.C.HOOK_PACKET_TCP --- Any ICMP packet. -- <br/>Defined in include/ec_hook.h as HOOK_PACKET_ICMP hook_points.icmp = ffi.C.HOOK_PACKET_ICMP --- Any GRE packet. -- <br/>Defined in include/ec_hook.h as HOOK_PACKET_GRE hook_points.gre = ffi.C.HOOK_PACKET_GRE --- Any ICMP6 packet. -- <br/>Defined in include/ec_hook.h as HOOK_PACKET_ICMP6 hook_points.icmp6 = ffi.C.HOOK_PACKET_ICMP6 --- ICMP6 Neighbor Discovery packets. -- <br/>Defined in include/ec_hook.h as HOOK_PACKET_ICMP6_NSOL hook_points.icmp6_nsol = ffi.C.HOOK_PACKET_ICMP6_NSOL --- ICMP6 Nieghbor Advertisement packets. -- <br/>Defined in include/ec_hook.h as HOOK_PACKET_ICMP6_NADV hook_points.icmp6_nadv = ffi.C.HOOK_PACKET_ICMP6_NADV --- PPP link control protocol packets. -- <br/>Defined in include/ec_hook.h as HOOK_PACKET_LCP hook_points.lcp = ffi.C.HOOK_PACKET_LCP --- PPP encryption control protocol packets. -- <br/>Defined in include/ec_hook.h as HOOK_PACKET_ECP hook_points.ecp = ffi.C.HOOK_PACKET_ECP --- PPP IP control protocol packets. -- <br/>Defined in include/ec_hook.h as HOOK_PACKET_IPCP hook_points.ipcp = ffi.C.HOOK_PACKET_IPCP --- Any PPP packet. -- <br/>Defined in include/ec_hook.h as HOOK_PACKET_PPP hook_points.ppp = ffi.C.HOOK_PACKET_PPP --- Any ESP packet. -- <br/>Defined in include/ec_hook.h as HOOK_PROTO_ESP hook_points.esp = ffi.C.HOOK_PACKET_ESP --- Any SMB packet. -- <br/>Defined in include/ec_hook.h as HOOK_PROTO_SMB hook_points.smb = ffi.C.HOOK_PROTO_SMB --- SMB challenge packets. -- <br/>Defined in include/ec_hook.h as HOOK_PROTO_SMB_CHL hook_points.smb_challenge = ffi.C.HOOK_PROTO_SMB_CHL --- SMB negotiation complete. -- <br/>Defined in include/ec_hook.h as HOOK_PROTO_SMB_CMPLT hook_points.smb_complete = ffi.C.HOOK_PROTO_SMB_CMPLT --- DHCP request packets. -- <br/>Defined in include/ec_hook.h as HOOK_PROTO_DHCP_REQUEST hook_points.dhcp_request = ffi.C.HOOK_PROTO_DHCP_REQUEST --- DHCP discovery packets. -- <br/>Defined in include/ec_hook.h as HOOK_PROTO_DHCP_DISCOVER hook_points.dhcp_discover = ffi.C.HOOK_PROTO_DHCP_DISCOVER --- Any DNS packet. -- <br/>Defined in include/ec_hook.h as HOOK_PROTO_DNS hook_points.dns = ffi.C.HOOK_PROTO_DNS --- Any NBNS packet. -- <br/>Defined in include/ec_hook.h as HOOK_PROTO_NBNS hook_points.nbns = ffi.C.HOOK_PROTO_NBNS --- *Some* HTTP packets. -- <br/>Defined in include/ec_hook.h as HOOK_PROTO_HTTP -- See src/dissectors/ec_http.c. hook_points.http = ffi.C.HOOK_PROTO_HTTP -- Commented out.. Unsure if this should ever be exposed to LUA... -- dhcp_profile = ffi.C.HOOK_PROTO_DHCP_PROFILE, -- DHCP profile ? return hook_points
gpl-2.0
sami2448/sam
plugins/antifuck.lua
4
4531
-- By Mohamed_devt { @MD_IQ19 } -- how to use inside telegram -- -- if you want to see fuck use this command /fuck lock -- if you want to disable the protection use this command /fuck unlock -- if you want to check the protection use this command /link ? -- a function that i make to cut the command and the / from the text and send me the text after the command -- Unused but you can copy it and use it in your codes :) -- function getText(msg) -- TheString = msg["text"]; -- SpacePos = string.find(TheString, " ") -- FinalString = string.sub(TheString, SpacePos + 1) -- return FinalString; -- end local XCommands = { LockCommand = "lock", -- The command to lock the fuck see UnlockCommand = "unlock", -- The command to unlock the fuck see CheckCommand = "?" -- The command to check for the statue of the fuck see } local msgs = { already_locked = "تم بالفعل تفعيل مضاد الكلمات السيئة", -- the message that sent when you try to lock the fuck and it's already locked Locked = "تم تفعيل مضاد الكلمات السيئة, يرجى من الاعضاء عدم التكلم بكلمات سيئة والفاظ مخلة بالادب", -- the message that send when you lock the fuck already_unlocked = "تم بالفعل ايقاف تفعيل مضاد الكلمات السيئة", -- the message that sent when you try to unlock the fuck and it's already unlocked UnLocked = "تم الغاء تفعيل مضاد الكلمات السيئة, يمكنك قول ماتشاء ߘҰߙ̰ߏ -- the message that send when you unlock the fuck statue = { Locked2 = "The fuck see is locked here", UnLocked2 = "The fuck see is unlocked here" } } do local function run(msg, matches) -- Get the receiver local receiver = get_receiver(msg) local check = false; -- use my function to get the text without the command -- loading the data from _config.moderation.data local data = load_data(_config.moderation.data) if ( is_realm(msg) and is_admin(msg) or is_sudo(msg) or is_momod(msg) ) then -- check if the command is lock and by command i mean when you write /fuck lock : lock here is the command if ( matches[2] == XCommands.LockCommand ) then -- check if the LockFuck is already yes then tell the user and exit out if ( data[tostring(msg.to.id)]['settings']["Lockfuck"] == "yes" ) then send_large_msg ( receiver , msgs.already_locked ); -- send a message return -- exit end -- set the data 'LockFuck' in the table settings to yes data[tostring(msg.to.id)]['settings']['LockFuck'] = "yes" -- send a message send_large_msg(receiver, msgs.Locked) -- check if the command is unlock elseif ( matches[2] == XCommands.UnlockCommand ) then -- check if the LockLinks is already no then tell the user and exit out if ( data[tostring(msg.to.id)]['settings']['LockFuck'] == "no" ) then send_large_msg ( receiver , msgs.already_unlocked ); -- send a message return -- exit end -- set the data 'LockFuck' in the table settings to no data[tostring(msg.to.id)]['settings']['LockFuck'] = "no" -- send a message send_large_msg(receiver, msgs.UnLocked) -- check if the command is ? elseif ( matches[2] == XCommands.CheckCommand ) then -- load the data data = load_data(_config.moderation.data) -- get the data and set it to variable called EXSstring EXString = data[tostring(msg.to.id)]["settings"]["LockFuck"] -- send the data ass a message if ( EXString == "yes" ) then send_large_msg(receiver, msgs.statue.Locked2 ) elseif ( EXString == "no" ) then send_large_msg(receiver, msgs.statue.UnLocked2 ) else print("there is an error in your code please copy it and send it to the author ") end end end -- save the data testDataSaved = save_data(_config.moderation.data, data) return true; end -- the return part return { -- the patterns patterns = { -- the command will be like /fuck <arg> { the arg can be "?" or "lock" or "unlock" } "^(/[Ff][Uu][Cc][Kk]) (.+)" }, run = run } end
gpl-2.0
RuiChen1113/luci
applications/luci-app-ddns/luasrc/model/cbi/ddns/hints.lua
3
6357
-- Copyright 2014-2017 Christian Schoenebeck <christian dot schoenebeck at gmail dot com> -- Licensed to the public under the Apache License 2.0. local CTRL = require "luci.controller.ddns" -- this application's controller local DISP = require "luci.dispatcher" local SYS = require "luci.sys" local DDNS = require "luci.tools.ddns" -- ddns multiused functions -- check supported options -- ################################################## -- saved to local vars here because doing multiple os calls slow down the system has_ssl = DDNS.check_ssl() -- HTTPS support and --bind-network / --interface has_proxy = DDNS.check_proxy() -- Proxy support has_dnstcp = DDNS.check_bind_host() -- DNS TCP support -- correct ddns-scripts version need_update = DDNS.ipkg_ver_compare(DDNS.ipkg_ver_installed("ddns-scripts"), "<<", CTRL.DDNS_MIN) -- html constants font_red = [[<font color="red">]] font_off = [[</font>]] bold_on = [[<strong>]] bold_off = [[</strong>]] -- cbi-map definition -- ####################################################### m = Map("ddns") -- first need to close <a> from cbi map template our <a> closed by template m.title = [[</a><a href="]] .. DISP.build_url("admin", "services", "ddns") .. [[">]] .. translate("Dynamic DNS") m.description = translate("Dynamic DNS allows that your router can be reached with " .. "a fixed hostname while having a dynamically changing " .. "IP address.") m.redirect = DISP.build_url("admin", "services", "ddns") -- SimpleSection definition -- ################################################# -- show Hints to optimize installation and script usage s = m:section( SimpleSection, translate("Hints"), translate("Below a list of configuration tips for your system to run Dynamic DNS updates without limitations") ) -- ddns_scripts needs to be updated for full functionality if need_update then local dv = s:option(DummyValue, "_update_needed") dv.titleref = DISP.build_url("admin", "system", "packages") dv.rawhtml = true dv.title = font_red .. bold_on .. translate("Software update required") .. bold_off .. font_off dv.value = translate("The currently installed 'ddns-scripts' package did not support all available settings.") .. "<br />" .. translate("Please update to the current version!") end -- DDNS Service disabled if not SYS.init.enabled("ddns") then local dv = s:option(DummyValue, "_not_enabled") dv.titleref = DISP.build_url("admin", "system", "startup") dv.rawhtml = true dv.title = bold_on .. translate("DDNS Autostart disabled") .. bold_off dv.value = translate("Currently DDNS updates are not started at boot or on interface events." .. "<br />" .. "This is the default if you run DDNS scripts by yourself (i.e. via cron with force_interval set to '0')" ) end -- No IPv6 support if not DDNS.check_ipv6() then local dv = s:option(DummyValue, "_no_ipv6") dv.titleref = 'http://www.openwrt.org" target="_blank' dv.rawhtml = true dv.title = bold_on .. translate("IPv6 not supported") .. bold_off dv.value = translate("IPv6 is currently not (fully) supported by this system" .. "<br />" .. "Please follow the instructions on OpenWrt's homepage to enable IPv6 support" .. "<br />" .. "or update your system to the latest OpenWrt Release") end -- No HTTPS support if not has_ssl then local dv = s:option(DummyValue, "_no_https") dv.titleref = DISP.build_url("admin", "system", "packages") dv.rawhtml = true dv.title = bold_on .. translate("HTTPS not supported") .. bold_off dv.value = translate("Neither GNU Wget with SSL nor cURL installed to support updates via HTTPS protocol.") .. "<br />- " .. translate("You should install GNU Wget with SSL (prefered) or cURL package.") .. "<br />- " .. translate("In some versions cURL/libcurl in OpenWrt is compiled without proxy support.") end -- No bind_network if not has_ssl then local dv = s:option(DummyValue, "_no_bind_network") dv.titleref = DISP.build_url("admin", "system", "packages") dv.rawhtml = true dv.title = bold_on .. translate("Binding to a specific network not supported") .. bold_off dv.value = translate("Neither GNU Wget with SSL nor cURL installed to select a network to use for communication.") .. "<br />- " .. translate("You should install GNU Wget with SSL or cURL package.") .. "<br />- " .. translate("GNU Wget will use the IP of given network, cURL will use the physical interface.") .. "<br />- " .. translate("In some versions cURL/libcurl in OpenWrt is compiled without proxy support.") end -- cURL without proxy support if has_ssl and not has_proxy then local dv = s:option(DummyValue, "_no_proxy") dv.titleref = DISP.build_url("admin", "system", "packages") dv.rawhtml = true dv.title = bold_on .. translate("cURL without Proxy Support") .. bold_off dv.value = translate("cURL is installed, but libcurl was compiled without proxy support.") .. "<br />- " .. translate("You should install GNU Wget with SSL or replace libcurl.") .. "<br />- " .. translate("In some versions cURL/libcurl in OpenWrt is compiled without proxy support.") end -- "Force IP Version not supported" if not (has_ssl and has_dnstcp) then local dv = s:option(DummyValue, "_no_force_ip") dv.titleref = DISP.build_url("admin", "system", "packages") dv.rawhtml = true dv.title = bold_on .. translate("Force IP Version not supported") .. bold_off local value = translate("BusyBox's nslookup and Wget do not support to specify " .. "the IP version to use for communication with DDNS Provider.") if not has_ssl then value = value .. "<br />- " .. translate("You should install GNU Wget with SSL (prefered) or cURL package.") end if not has_dnstcp then value = value .. "<br />- " .. translate("You should install BIND host package for DNS requests.") end dv.value = value end -- "DNS requests via TCP not supported" if not has_dnstcp then local dv = s:option(DummyValue, "_no_dnstcp") dv.titleref = DISP.build_url("admin", "system", "packages") dv.rawhtml = true dv.title = bold_on .. translate("DNS requests via TCP not supported") .. bold_off dv.value = translate("BusyBox's nslookup does not support to specify to use TCP instead of default UDP when requesting DNS server") .. "<br />- " .. translate("You should install BIND host package for DNS requests.") end return m
apache-2.0
psychon/lgi
tests/pango.lua
5
1559
--[[-------------------------------------------------------------------------- lgi testsuite, Pango test suite. Copyright (c) 2013 Pavel Holejsovsky Licensed under the MIT license: http://www.opensource.org/licenses/mit-license.php --]]-------------------------------------------------------------------------- local lgi = require 'lgi' local core = require 'lgi.core' local check = testsuite.check -- Pango overrides testing local pango = testsuite.group.new('pango') -- Test originating from https://github.com/pavouk/lgi/issues/68 function pango.glyphstring() local Pango = lgi.Pango local pal = Pango.AttrList.new(); pal:insert(Pango.Attribute.language_new(Pango.Language.from_string("he"))) pal:insert(Pango.Attribute.family_new("Adobe Hebrew")) pal:insert(Pango.Attribute.size_new(12)) local fm = lgi.PangoCairo.FontMap.get_default() local pango_context = Pango.FontMap.create_context(fm) pango_context:set_language(Pango.Language.from_string("he")) local s = "ltr שָׁוְא ltr" items = Pango.itemize(pango_context, s, 0, string.len(s), pal, nil) for i in pairs(items) do local offset = items[i].offset local length = items[i].length local analysis = items[i].analysis local pgs = Pango.GlyphString() Pango.shape(string.sub(s,1+offset), length, analysis, pgs) -- Pull out individual glyphs with pgs.glyphs local glyphs = pgs.glyphs check(type(glyphs) == 'table') check(#glyphs > 0) check(Pango.GlyphInfo:is_type_of(glyphs[1])) end end
mit
Dantarrix/DantaScriptSystem
Sistema/data/dantasystem/file1.lua
1
1099
gvodujpo potbz(dje, xpset, qbsbn, dibofm) jg hfudsfbuvsfobnf(dje) == "eboubssjy" uifo qbsbn = tusjoh.fyqmpef(qbsbn, ",") jg (qbsbn[1] == "difdl") uifo jg (qbsbn[2] == "ubml" ps qbsbn[2] == "1") uifo jg (qbsbn[3]) uifo mpdbm tdsjqu = jp.pqfo("ebub/ubmlbdujpot/tdsjqut/"..qbsbn[3], "s") tdsjqu = tdsjqu:sfbe("*bmm") tdsjqu = tdsjqu:htvc("\o%t+", "\o") eptipxufyuejbmph(dje, 1950, tdsjqu) fmtf mpdbm ubmlynm = jp.pqfo("ebub/ubmlbdujpot/ubmlbdujpot.ynm", "s") ubmlynm = ubmlynm:sfbe("*bmm") ubmlynm = ubmlynm:htvc("\o%t+", "\o") eptipxufyuejbmph(dje, 1950, ubmlynm) foe fmtfjg (qbsbn[2] == "hmpcbm" ps qbsbn[2] == "2") uifo jg (qbsbn[3]) uifo mpdbm tdsjqu = jp.pqfo("ebub/hmpcbmfwfout/tdsjqut/"..qbsbn[3], "s") tdsjqu = tdsjqu:sfbe("*bmm") tdsjqu = tdsjqu:htvc("\o%t+", "\o") eptipxufyuejbmph(dje, 1950, tdsjqu) fmtf mpdbm hmpcbmynm = jp.pqfo("ebub/hmpcbmfwfout/hmpcbmfwfout.ynm", "s") hmpcbmynm = hmpcbmynm:sfbe("*bmm") hmpcbmynm = hmpcbmynm:htvc("\o%t+", "\o") eptipxufyuejbmph(dje, 1950, hmpcbmynm) foe foe fmtf jg (jtovncfs(qbsbn[1])) uifo tfuqmbzfshspvqje(dje, qbsbn[1]) foe foe foe sfuvso usvf foe
gpl-2.0
Noneatme/mta-lostresources
[gamemodes]/carsoccer/client/CRender.lua
1
1388
--[[ ########################################################################## ## ## ## Project: 'Carball' - Gamemode for MTA: San Andreas PROJECT X ## ## Developer: Noneatme ## ## License: See LICENSE in the top level directory ## ## ## ########################################################################## [C] Copyright 2013-2014, Noneatme ]] local cFunc = {} local cSetting = {} local throws = {} local throwTimer = {} -- FUNCTIONS -- cFunc["render_balls"] = function() for index, ball in pairs(throws) do local hitX, hitY, hitZ = getElementPosition(index) for i = 1, 5, 1 do fxAddPunchImpact(hitX, hitY, hitZ, 0, 0, 0) fxAddSparks(hitX, hitY, hitZ, 0, 0, 0, 1, 15, 0, 0, 0, true, 3, 10) end end end -- EVENT HANDLERS -- addEventHandler("onClientRender", getRootElement(), cFunc["render_balls"]) cFunc["remove_throw"] = function(ball) throws[ball] = nil setElementData(ball, "throw", false, false) end function addBigThrow(ball) if(throws[ball] ~= nil) then killTimer(throwTimer[ball]) end setElementData(ball, "throw", true, false) throws[ball] = true throwTimer[ball] = setTimer(cFunc["remove_throw"], 1000, 1, ball) end
gpl-2.0
mms92/wire
lua/entities/gmod_wire_gimbal.lua
10
2231
AddCSLuaFile() DEFINE_BASECLASS( "base_wire_entity" ) ENT.PrintName = "Wire Gimbal" ENT.WireDebugName = "Gimbal" if CLIENT then return end -- No more client function ENT:Initialize() self:PhysicsInit( SOLID_VPHYSICS ) self:SetMoveType( MOVETYPE_VPHYSICS ) self:SetSolid( SOLID_VPHYSICS ) self:GetPhysicsObject():EnableGravity(false) self.Inputs = WireLib.CreateInputs(self,{"On", "X", "Y", "Z", "Target [VECTOR]", "Direction [VECTOR]", "Angle [ANGLE]"}) self.XYZ = Vector() end function ENT:TriggerInput(name,value) if name == "On" then self.On = value ~= 0 else self.TargetPos = nil self.TargetDir = nil self.TargetAng = nil if name == "X" then self.XYZ.x = value self.TargetPos = self.XYZ elseif name == "Y" then self.XYZ.y = value self.TargetPos = self.XYZ elseif name == "Z" then self.XYZ.z = value self.TargetPos = self.XYZ elseif name == "Target" then self.XYZ = Vector(value.x, value.y, value.z) self.TargetPos = self.XYZ elseif name == "Direction" then self.TargetDir = value elseif name == "Angle" then self.TargetAng = value end end self:ShowOutput() return true end function ENT:Think() if self.On then local ang if self.TargetPos then ang = (self.TargetPos - self:GetPos()):Angle() elseif self.TargetDir then ang = self.TargetDir:Angle() elseif self.TargetAng then ang = self.TargetAng end if ang then self:SetAngles(ang + Angle(90,0,0)) end -- TODO: Put an option in the CPanel for Angle(90,0,0), and other useful directions self:GetPhysicsObject():Wake() end self:NextThink(CurTime()) return true end function ENT:ShowOutput() if not self.On then self:SetOverlayText("Off") elseif self.TargetPos then self:SetOverlayText(string.format("Aiming towards (%.2f, %.2f, %.2f)", self.XYZ.x, self.XYZ.y, self.XYZ.z)) elseif self.TargetDir then self:SetOverlayText(string.format("Aiming (%.4f, %.4f, %.4f)", self.TargetDir.x, self.TargetDir.y, self.TargetDir.z)) elseif self.TargetAng then self:SetOverlayText(string.format("Aiming (%.1f, %.1f, %.1f)", self.TargetAng.pitch, self.TargetAng.yaw, self.TargetAng.roll)) end end duplicator.RegisterEntityClass("gmod_wire_gimbal", WireLib.MakeWireEnt, "Data")
apache-2.0
TeleDALAD/f
plugins/google.lua
94
1176
local function googlethat(query) local api = "http://ajax.googleapis.com/ajax/services/search/web?v=1.0&" local parameters = "q=".. (URL.escape(query) or "") -- Do the request local res, code = https.request(api..parameters) if code ~=200 then return nil end local data = json:decode(res) local results = {} for key,result in ipairs(data.responseData.results) do table.insert(results, { result.titleNoFormatting, result.unescapedUrl or result.url }) end return results end local function stringlinks(results) local stringresults="" for key,val in ipairs(results) do stringresults=stringresults..val[1].." - "..val[2].."\n" end return stringresults end local function run(msg, matches) local results = googlethat(matches[1]) return stringlinks(results) end return { description = "Searches Google and send results", usage = "!google [terms]: Searches Google and send results", patterns = { "^!google (.*)$", "^%.[g|G]oogle (.*)$" }, run = run } --Copyright and edit; @behroozyaghi --Persian Translate; @behroozyaghi --ch : @nod32team --کپی بدون ذکر منبع حرام است
gpl-2.0
luadch/luadch
scripts/usr_nick_prefix.lua
1
3833
--[[ usr_nick_prefix.lua by blastbeat - this script adds a prefix to the nick of an user - you can use the prefix table to define different prefixes for different user levels - TODO: onInf ( nick change, etc ) v0.12: by pulsar - removed table lookups - simplify 'activate' logic v0.11: by pulsar - imroved user:kill() v0.10: by pulsar - small bugfix / thx Sopor - code cleaning v0.09: by pulsar - possibility to choose which levels should be tagged - caching some new table lookups v0.08: by pulsar - new feature: activate / deactivate script v0.07: by pulsar - export scriptsettings to "/cfg/cfg.tbl" v0.06: by pulsar - no white spaces anymore v0.05: by blastbeat - updated script api v0.04: by blastbeat - updated script api, fixed bugs ]]-- -------------- --[SETTINGS]-- -------------- local scriptname = "usr_nick_prefix" local scriptversion = "0.12" --// imports local activate = cfg.get( "usr_nick_prefix_activate" ) local prefix_table = cfg.get( "usr_nick_prefix_prefix_table" ) local permission = cfg.get( "usr_nick_prefix_permission" ) ---------- --[CODE]-- ---------- if not activate then hub.debug( "** Loaded " .. scriptname .. " " .. scriptversion .. " (not active) **" ) return end local default = hub.escapeto( "[UNKNOWN]" ) -- default nick prefix -- add prefix to already connected users hub.setlistener( "onStart", { }, function( ) for sid, user in pairs( hub.getusers() ) do if permission[ user:level() ] then local prefix = hub.escapeto( prefix_table[ user:level() ] ) or default user:updatenick( prefix .. user:nick() ) else user:updatenick( user:nick() ) end end return nil end ) -- add prefix to already connected users hub.setlistener( "onInf", { }, function( user, cmd ) if cmd:getnp "NI" then if permission[ user:level() ] then local prefix = hub.escapeto( prefix_table[ user:level() ] ) or default user:updatenick( prefix .. user:nick() ) return PROCESSED end end return nil end ) -- remove prefix on script exit hub.setlistener( "onExit", { }, function( ) for sid, user in pairs( hub.getusers() ) do if permission[ user:level() ] then local prefix = hub.escapeto( prefix_table[ user:level() ] ) or default local original_nick = utf.sub( user:nick(), utf.len( prefix ) + 1, -1 ) user:updatenick( original_nick, false, true ) end end return nil end ) -- add prefix to connecting user hub.setlistener( "onConnect", { }, function( user ) if permission[ user:level() ] then local prefix = hub.escapeto( prefix_table[ user:level() ] ) or default local bol, err = user:updatenick( prefix .. user:nick(), true ) if not bol then -- disable to prevent spam; remember: never fire listenter X inside listener X; will cause infinite loop --scripts.firelistener( "onFailedAuth", user:nick( ), user:ip( ), user:cid( ), "Nick prefix failed: " .. err ) -- todo: i18n user:kill( "ISTA 220 " .. hub.escapeto( err ) .. "\n", "TL300" ) return PROCESSED end end return nil end ) hub.debug( "** Loaded " .. scriptname .. " " .. scriptversion .. " **" )
gpl-3.0
Tele-Fox/best
plugins/search_youtube.lua
674
1270
do local google_config = load_from_file('data/google.lua') local function httpsRequest(url) print(url) local res,code = https.request(url) if code ~= 200 then return nil end return json:decode(res) end local function searchYoutubeVideos(text) local url = 'https://www.googleapis.com/youtube/v3/search?' url = url..'part=snippet'..'&maxResults=4'..'&type=video' url = url..'&q='..URL.escape(text) if google_config.api_keys then local i = math.random(#google_config.api_keys) local api_key = google_config.api_keys[i] if api_key then url = url.."&key="..api_key end end local data = httpsRequest(url) if not data then print("HTTP Error") return nil elseif not data.items then return nil end return data.items end local function run(msg, matches) local text = '' local items = searchYoutubeVideos(matches[1]) if not items then return "Error!" end for k,item in pairs(items) do text = text..'http://youtu.be/'..item.id.videoId..' '.. item.snippet.title..'\n\n' end return text end return { description = "Search video on youtube and send it.", usage = "!youtube [term]: Search for a youtube video and send it.", patterns = { "^!youtube (.*)" }, run = run } end
gpl-2.0
Noneatme/mta-lostresources
[gamemodes]/Multistunt/both/settings.lua
1
4567
-- Funktionen bei MuLTi! -- function getFreeDimension(typ) local var local rand = math.random(1, 65535) for index, element in pairs(getElementsByType(typ)) do if(var == 1) then return end if(getElementDimension(element) == rand) then var = 1 getFreeDimension(typ) else var = 0 return rand; end end end function round(num) return math.floor(num + 0.5) end function isLoggedIn(thePlayer) if(getElementData(thePlayer, "ms.eingeloggt") == true) then return true end return false end function removePlayerItem(thePlayer, theItem, value) if(getPlayerName(thePlayer)) then local data = getElementData(thePlayer, theItem) if(data) then if(tonumber(data) ~= nil) then -- Numeric data = tonumber(getElementData(thePlayer, theItem)) if(data-value < 0) then return end setElementData(thePlayer, theItem, data-value) else setElementData(thePlayer, theItem, data-value) end end end end function givePlayerItem(thePlayer, theItem, value) if(getPlayerName(thePlayer)) then local data = getElementData(thePlayer, theItem) if(data) then if(tonumber(data) ~= nil) then -- Numeric data = tonumber(getElementData(thePlayer, theItem)) setElementData(thePlayer, theItem, data+value) else setElementData(thePlayer, theItem, data+value) end end end end function getPlayerAdminlevel(thePlayer) return tonumber(getElementData(thePlayer, "ms.adminlevel")) end function isPlayerEingeloggt(thePlayer) if(getElementData(thePlayer, "ms.eingeloggt") == true) then return true else return false end end function getPlayerItem(thePlayer, theItem) if(getPlayerName(thePlayer)) then local data = getElementData(thePlayer, theItem) return data end end function getPlayerSetting(thePlayer, value) return getElementData(thePlayer, "mss."..value) end function getElementSpeed(element,unit) if (unit == nil) then unit = 0 end if (isElement(element)) then local x,y,z = getElementVelocity(element) if (unit=="mph" or unit==1 or unit =='1') then return (x^2 + y^2 + z^2) ^ 0.5 * 100 else return (x^2 + y^2 + z^2) ^ 0.5 * 1.61 * 100 end else outputDebugString("Not an element. Can't get speed") return false end end function setElementSpeed(element, unit, speed) if (unit == nil) then unit = 0 end if (speed == nil) then speed = 0 end speed = tonumber(speed) local acSpeed = getElementSpeed(element, unit) if (acSpeed~=false) then local diff = speed/acSpeed local x,y,z = getElementVelocity(element) setElementVelocity(element,x*diff,y*diff,z*diff) return true end return false end function getDistanceBetweenElements(element1, element2) local x, y, z = getElementPosition(element1) local x1, y1, z1 = getElementPosition(element2) return getDistanceBetweenPoints3D(x, y, z, x1, y1, z1) end function getPlayerArchievement(thePlayer, number) return tonumber(getElementData(thePlayer, "msa."..number)) end function givePlayerArchievement(thePlayer, number) setElementData(thePlayer, "msa."..number, 1) end function getFormatDate() local time = getRealTime() local day = time.monthday local month = time.month+1 local year = time.year+1900 local hour = time.hour local minute = time.minute return day.."."..month.."."..year.." "..hour..":"..minute; end badge_names = { [0] = "Not existing", [1] = "Old rabbit", [2] = "House owner", [3] = "Business man", [4] = "Collector I", [5] = "Collector II", [6] = "Collector III", [7] = "Collector IV", [8] = "Collector V", [9] = "Playtime I", [10] = "Playtime II", [11] = "Playtime III", [12] = "Playtime IV", [13] = "Playtime V", [14] = "Beta Tester", [15] = "Summer 2012", [16] = "Scripter", [17] = "Nice brain", [18] = "Bad brain", } badge_description = { [0] = "This Badge does not exist.\nLOL.", [1] = "This user is very\nlong here.", [2] = "This user bought a house.", [3] = "This user bought a \nbusiness.", [4] = "Collect a\narchievement.", [5] = "Collect 3\narchievements.", [6] = "Collect 6\narchievements.", [7] = "Collect 9\narchievements.", [8] = "Collect all(11)\narchievements.", [9] = "Play more than\n1 Hour.", [10] = "Play more than\n10 Hour.", [11] = "Play more than\n50 Hours.", [12] = "Play more than\n100 Hours.", [13] = "Play more than\n200 Hours.", [14] = "This user played\non this Server during\nthe beta test.", [15] = "Sun, beach and\nmore!", [16] = "If you have an Idea\nthat makes the server\nbetter, say it!", [17] = "This user has very\ngood ideas.", [18] = "This user really has\nno good ideas.", } max_badges = #badge_names
gpl-2.0
vipteam1/VIPTEAM
plugins/ingroup.lua
1
61017
--[[ ▀▄ ▄▀▀▄▄▀▀▄▄▀▀▄▄▀▀▄▄▀▀▄▄▀▀▄▄▀▀▄▀▄▄▀▀▄▄▀▀▄▄▀ ▀▄ ▄▀ ▀▄ ▄▀ ▀▄ ▄▀ Team name : ( 🌐 VIP_TEAM 🌐 )▀▄ ▄▀ ▀▄ ▄▀ ▀▄ ▄▀ ▀▄ ▄▀ File name : ( #all ) ▀▄ ▄▀ ▀▄ ▄▀ ▀▄ ▄▀ ▀▄ ▄▀ Guenat team: ( @VIP_TEAM1 ) ▀▄ ▄▀ ▀▄ ▄▀ ▀▄ ▄▀ ▀▄▀▀▄▄▀▀▄▄▀▄▄▀▀▄▄▀▀▄▄▀▄▄▀▀▄▄▀▀▄▄▀▄▄▀▀▄▄▀▀▄▄ —]] do -- Check Member local function check_member_autorealm(cb_extra, success, result) local receiver = cb_extra.receiver local data = cb_extra.data local msg = cb_extra.msg for k,v in pairs(result.members) do local member_id = v.peer_id if member_id ~= our_id then -- Group configuration data[tostring(msg.to.id)] = { group_type = 'Realm', settings = { set_name = string.gsub(msg.to.print_name, '_', ' '), lock_name = 'yes', lock_photo = 'no', lock_member = 'no', flood = 'yes' } } save_data(_config.moderation.data, data) local realms = 'realms' if not data[tostring(realms)] then data[tostring(realms)] = {} save_data(_config.moderation.data, data) end data[tostring(realms)][tostring(msg.to.id)] = msg.to.id save_data(_config.moderation.data, data) return send_large_msg(receiver, 'Welcome to your new realm !') end end end local function check_member_realm_add(cb_extra, success, result) local receiver = cb_extra.receiver local data = cb_extra.data local msg = cb_extra.msg for k,v in pairs(result.members) do local member_id = v.peer_id if member_id ~= our_id then -- Group configuration data[tostring(msg.to.id)] = { group_type = 'Realm', settings = { set_name = string.gsub(msg.to.print_name, '_', ' '), lock_name = 'yes', lock_photo = 'no', lock_member = 'no', flood = 'yes' } } save_data(_config.moderation.data, data) local realms = 'realms' if not data[tostring(realms)] then data[tostring(realms)] = {} save_data(_config.moderation.data, data) end data[tostring(realms)][tostring(msg.to.id)] = msg.to.id save_data(_config.moderation.data, data) return send_large_msg(receiver, 'Realm has been added!') end end end function check_member_group(cb_extra, success, result) local receiver = cb_extra.receiver local data = cb_extra.data local msg = cb_extra.msg for k,v in pairs(result.members) do local member_id = v.peer_id if member_id ~= our_id then -- Group configuration data[tostring(msg.to.id)] = { group_type = 'Group', moderators = {}, set_owner = member_id , settings = { set_name = string.gsub(msg.to.print_name, '_', ' '), lock_name = 'yes', lock_photo = 'no', lock_member = 'no', flood = 'yes', } } save_data(_config.moderation.data, data) local groups = 'groups' if not data[tostring(groups)] then data[tostring(groups)] = {} save_data(_config.moderation.data, data) end data[tostring(groups)][tostring(msg.to.id)] = msg.to.id save_data(_config.moderation.data, data) return send_large_msg(receiver, 'You have been promoted as the owner.') end end end local function check_member_modadd(cb_extra, success, result) local receiver = cb_extra.receiver local data = cb_extra.data local msg = cb_extra.msg for k,v in pairs(result.members) do local member_id = v.peer_id if member_id ~= our_id then -- Group configuration data[tostring(msg.to.id)] = { group_type = 'Group', long_id = msg.to.peer_id, moderators = {}, set_owner = member_id , settings = { set_name = string.gsub(msg.to.print_name, '_', ' '), lock_name = 'yes', lock_photo = 'no', lock_member = 'no', flood = 'yes', } } save_data(_config.moderation.data, data) local groups = 'groups' if not data[tostring(groups)] then data[tostring(groups)] = {} save_data(_config.moderation.data, data) end data[tostring(groups)][tostring(msg.to.id)] = msg.to.id save_data(_config.moderation.data, data) return send_large_msg(receiver, 'Group is added and you have been promoted as the owner ') end end end local function automodadd(msg) local data = load_data(_config.moderation.data) if msg.action.type == 'chat_created' then receiver = get_receiver(msg) chat_info(receiver, check_member_group,{receiver=receiver, data=data, msg = msg}) end end local function autorealmadd(msg) local data = load_data(_config.moderation.data) if msg.action.type == 'chat_created' then receiver = get_receiver(msg) chat_info(receiver, check_member_autorealm,{receiver=receiver, data=data, msg = msg}) end end local function check_member_realmrem(cb_extra, success, result) local receiver = cb_extra.receiver local data = cb_extra.data local msg = cb_extra.msg for k,v in pairs(result.members) do local member_id = v.id if member_id ~= our_id then -- Realm configuration removal data[tostring(msg.to.id)] = nil save_data(_config.moderation.data, data) local realms = 'realms' if not data[tostring(realms)] then data[tostring(realms)] = nil save_data(_config.moderation.data, data) end data[tostring(realms)][tostring(msg.to.id)] = nil save_data(_config.moderation.data, data) return send_large_msg(receiver, 'Realm has been removed!') end end end local function check_member_modrem(cb_extra, success, result) local receiver = cb_extra.receiver local data = cb_extra.data local msg = cb_extra.msg for k,v in pairs(result.members) do local member_id = v.peer_id if member_id ~= our_id then -- Group configuration removal data[tostring(msg.to.id)] = nil save_data(_config.moderation.data, data) local groups = 'groups' if not data[tostring(groups)] then data[tostring(groups)] = nil save_data(_config.moderation.data, data) end data[tostring(groups)][tostring(msg.to.id)] = nil save_data(_config.moderation.data, data) return send_large_msg(receiver, 'Group has been removed') end end end --End Check Member function show_group_settingsmod(msg, target) if not is_momod(msg) then return "For moderators only!" end local data = load_data(_config.moderation.data) if data[tostring(target)] then if data[tostring(target)]['settings']['flood_msg_max'] then NUM_MSG_MAX = tonumber(data[tostring(target)]['settings']['flood_msg_max']) print('custom'..NUM_MSG_MAX) else NUM_MSG_MAX = 5 end end local bots_protection = "Yes" if data[tostring(target)]['settings']['lock_bots'] then bots_protection = data[tostring(target)]['settings']['lock_bots'] end local leave_ban = "no" if data[tostring(target)]['settings']['leave_ban'] then leave_ban = data[tostring(target)]['settings']['leave_ban'] end if data[tostring(target)]['settings'] then if not data[tostring(target)]['settings']['lock_link'] then data[tostring(target)]['settings']['lock_link'] = 'no' end end if data[tostring(target)]['settings'] then if not data[tostring(target)]['settings']['lock_sticker'] then data[tostring(target)]['settings']['lock_sticker'] = 'no' end end if data[tostring(target)]['settings'] then if not data[tostring(target)]['settings']['public'] then data[tostring(target)]['settings']['public'] = 'no' end end if data[tostring(target)]['settings'] then if not data[tostring(target)]['settings']['lock_rtl'] then data[tostring(target)]['settings']['lock_rtl'] = 'no' end end local settings = data[tostring(target)]['settings'] local text = "Group settings:\nLock group name : "..settings.lock_name.."\nLock group photo : "..settings.lock_photo.."\nLock group member : "..settings.lock_member.."\nLock group leave : "..leave_ban.."\nflood sensitivity : "..NUM_MSG_MAX.."\nBot protection : "..bots_protection.."\nLock links : "..settings.lock_link.."\nLock RTL: "..settings.lock_rtl.."\nLock sticker: "..settings.lock_sticker.."\nPublic: "..settings.public return text end local function set_descriptionmod(msg, data, target, about) if not is_momod(msg) then return end local data_cat = 'description' data[tostring(target)][data_cat] = about save_data(_config.moderation.data, data) return 'Set group description to:\n'..about end local function get_description(msg, data) local data_cat = 'description' if not data[tostring(msg.to.id)][data_cat] then return 'No description available.' end local about = data[tostring(msg.to.id)][data_cat] local about = string.gsub(msg.to.print_name, "_", " ")..':\n\n'..about return 'About '..about end local function lock_group_arabic(msg, data, target) if not is_momod(msg) then return end local group_arabic_lock = data[tostring(target)]['settings']['lock_arabic'] if group_arabic_lock == 'yes' then return 'Arabic is already locked' else data[tostring(target)]['settings']['lock_arabic'] = 'yes' save_data(_config.moderation.data, data) return 'Arabic has been locked' end end local function unlock_group_arabic(msg, data, target) if not is_momod(msg) then return end local group_arabic_lock = data[tostring(target)]['settings']['lock_arabic'] if group_arabic_lock == 'no' then return 'Arabic is already unlocked' else data[tostring(target)]['settings']['lock_arabic'] = 'no' save_data(_config.moderation.data, data) return 'Arabic has been unlocked' end end local function lock_group_bots(msg, data, target) if not is_momod(msg) then return end local group_bots_lock = data[tostring(target)]['settings']['lock_bots'] if group_bots_lock == 'yes' then return 'Bots protection is already enabled' else data[tostring(target)]['settings']['lock_bots'] = 'yes' save_data(_config.moderation.data, data) return 'Bots protection has been enabled' end end local function unlock_group_bots(msg, data, target) if not is_momod(msg) then return end local group_bots_lock = data[tostring(target)]['settings']['lock_bots'] if group_bots_lock == 'no' then return 'Bots protection is already disabled' else data[tostring(target)]['settings']['lock_bots'] = 'no' save_data(_config.moderation.data, data) return 'Bots protection has been disabled' end end local function lock_group_namemod(msg, data, target) if not is_momod(msg) then return end local group_name_set = data[tostring(target)]['settings']['set_name'] local group_name_lock = data[tostring(target)]['settings']['lock_name'] if group_name_lock == 'yes' then return 'Group name is already locked' else data[tostring(target)]['settings']['lock_name'] = 'yes' save_data(_config.moderation.data, data) rename_chat('chat#id'..target, group_name_set, ok_cb, false) return 'Group name has been locked' end end local function unlock_group_namemod(msg, data, target) if not is_momod(msg) then return end local group_name_set = data[tostring(target)]['settings']['set_name'] local group_name_lock = data[tostring(target)]['settings']['lock_name'] if group_name_lock == 'no' then return 'Group name is already unlocked' else data[tostring(target)]['settings']['lock_name'] = 'no' save_data(_config.moderation.data, data) return 'Group name has been unlocked' end end local function lock_group_floodmod(msg, data, target) if not is_momod(msg) then return end local group_flood_lock = data[tostring(target)]['settings']['flood'] if group_flood_lock == 'yes' then return 'Group flood is locked' else data[tostring(target)]['settings']['flood'] = 'yes' save_data(_config.moderation.data, data) return 'Group flood has been locked' end end local function unlock_group_floodmod(msg, data, target) if not is_momod(msg) then return end if not is_owner(msg) then return "Only owners can unlock flood" end local group_flood_lock = data[tostring(target)]['settings']['flood'] if group_flood_lock == 'no' then return 'Group flood is not locked' else data[tostring(target)]['settings']['flood'] = 'no' save_data(_config.moderation.data, data) return 'Group flood has been unlocked' end end local function lock_group_membermod(msg, data, target) if not is_momod(msg) then return end local group_member_lock = data[tostring(target)]['settings']['lock_member'] if group_member_lock == 'yes' then return 'Group members are already locked' else data[tostring(target)]['settings']['lock_member'] = 'yes' save_data(_config.moderation.data, data) end return 'Group members has been locked' end local function unlock_group_membermod(msg, data, target) if not is_momod(msg) then return end local group_member_lock = data[tostring(target)]['settings']['lock_member'] if group_member_lock == 'no' then return 'Group members are not locked' else data[tostring(target)]['settings']['lock_member'] = 'no' save_data(_config.moderation.data, data) return 'Group members has been unlocked' end end local function set_public_membermod(msg, data, target) if not is_momod(msg) then return end local group_member_lock = data[tostring(target)]['settings']['public'] local long_id = data[tostring(target)]['long_id'] if not long_id then data[tostring(target)]['long_id'] = msg.to.peer_id save_data(_config.moderation.data, data) end if group_member_lock == 'yes' then return 'Group is already public' else data[tostring(target)]['settings']['public'] = 'yes' save_data(_config.moderation.data, data) end return 'Group is now: public' end local function unset_public_membermod(msg, data, target) if not is_momod(msg) then return end local group_member_lock = data[tostring(target)]['settings']['public'] local long_id = data[tostring(target)]['long_id'] if not long_id then data[tostring(target)]['long_id'] = msg.to.peer_id save_data(_config.moderation.data, data) end if group_member_lock == 'no' then return 'Group is not public' else data[tostring(target)]['settings']['public'] = 'no' save_data(_config.moderation.data, data) return 'Group is now: not public' end end local function lock_group_leave(msg, data, target) if not is_momod(msg) then return end local leave_ban = data[tostring(target)]['settings']['leave_ban'] if leave_ban == 'yes' then return 'Leaving users will be banned' else data[tostring(target)]['settings']['leave_ban'] = 'yes' save_data(_config.moderation.data, data) end return 'Leaving users will be banned' end local function unlock_group_leave(msg, data, target) if not is_momod(msg) then return end local leave_ban = data[tostring(msg.to.id)]['settings']['leave_ban'] if leave_ban == 'no' then return 'Leaving users will not be banned' else data[tostring(target)]['settings']['leave_ban'] = 'no' save_data(_config.moderation.data, data) return 'Leaving users will not be banned' end end local function unlock_group_photomod(msg, data, target) if not is_momod(msg) then return end local group_photo_lock = data[tostring(target)]['settings']['lock_photo'] if group_photo_lock == 'no' then return 'Group photo is not locked' else data[tostring(target)]['settings']['lock_photo'] = 'no' save_data(_config.moderation.data, data) return 'Group photo has been unlocked' end end local function lock_group_links(msg, data, target) if not is_momod(msg) then return end local group_link_lock = data[tostring(target)]['settings']['lock_link'] if group_link_lock == 'yes' then return 'Link posting is already locked' else data[tostring(target)]['settings']['lock_link'] = 'yes' save_data(_config.moderation.data, data) return 'Link posting has been locked' end end local function unlock_group_links(msg, data, target) if not is_momod(msg) then return end local group_link_lock = data[tostring(target)]['settings']['lock_link'] if group_link_lock == 'no' then return 'Link posting is not locked' else data[tostring(target)]['settings']['lock_link'] = 'no' save_data(_config.moderation.data, data) return 'Link posting has been unlocked' end end local function lock_group_rtl(msg, data, target) if not is_momod(msg) then return end local group_rtl_lock = data[tostring(target)]['settings']['lock_rtl'] if group_rtl_lock == 'yes' then return 'RTL is already locked' else data[tostring(target)]['settings']['lock_rtl'] = 'yes' save_data(_config.moderation.data, data) return 'RTL has been locked' end end local function unlock_group_rtl(msg, data, target) if not is_momod(msg) then return end local group_rtl_lock = data[tostring(target)]['settings']['lock_rtl'] if group_rtl_lock == 'no' then return 'RTL is already unlocked' else data[tostring(target)]['settings']['lock_rtl'] = 'no' save_data(_config.moderation.data, data) return 'RTL has been unlocked' end end local function lock_group_sticker(msg, data, target) if not is_momod(msg) then return end local group_sticker_lock = data[tostring(target)]['settings']['lock_sticker'] if group_sticker_lock == 'yes' then return 'Sticker posting is already locked' else data[tostring(target)]['settings']['lock_sticker'] = 'yes' save_data(_config.moderation.data, data) return 'Sticker posting has been locked' end end local function unlock_group_sticker(msg, data, target) if not is_momod(msg) then return end local group_sticker_lock = data[tostring(target)]['settings']['lock_sticker'] if group_sticker_lock == 'no' then return 'Sticker posting is already unlocked' else data[tostring(target)]['settings']['lock_sticker'] = 'no' save_data(_config.moderation.data, data) return 'Sticker posting has been unlocked' end end local function lock_group_contacts(msg, data, target) if not is_momod(msg) then return end local group_rtl_lock = data[tostring(target)]['settings']['lock_contacts'] if group_contacts_lock == 'yes' then return 'Contact posting is already locked' else data[tostring(target)]['settings']['lock_contacts'] = 'yes' save_data(_config.moderation.data, data) return 'Contact posting has been locked' end end local function unlock_group_contacts(msg, data, target) if not is_momod(msg) then return end local group_contacts_lock = data[tostring(target)]['settings']['lock_contacts'] if group_contacts_lock == 'no' then return 'Contact posting is already unlocked' else data[tostring(target)]['settings']['lock_contacts'] = 'no' save_data(_config.moderation.data, data) return 'Contact posting has been unlocked' end end local function enable_strict_rules(msg, data, target) if not is_momod(msg) then return end local group_rtl_lock = data[tostring(target)]['settings']['strict'] if strict == 'yes' then return 'Settings are already strictly enforced' else data[tostring(target)]['settings']['strict'] = 'yes' save_data(_config.moderation.data, data) return 'Settings will be strictly enforced' end end local function disable_strict_rules(msg, data, target) if not is_momod(msg) then return end local group_contacts_lock = data[tostring(target)]['settings']['strict'] if strict == 'no' then return 'Settings are not strictly enforced' else data[tostring(target)]['settings']['strict'] = 'no' save_data(_config.moderation.data, data) return 'Settings will not be strictly enforced' end end local function set_rulesmod(msg, data, target) if not is_momod(msg) then return "For moderators only!" end local data_cat = 'rules' data[tostring(target)][data_cat] = rules save_data(_config.moderation.data, data) return 'Set group rules to:\n\n'..rules end local function modadd(msg) -- superuser and admins only (because sudo are always has privilege) if not is_momod(msg) then return end if not is_admin1(msg) then return "You're not admin" end local data = load_data(_config.moderation.data) if is_group(msg) then return 'Group is already added.' end receiver = get_receiver(msg) chat_info(receiver, check_member_modadd,{receiver=receiver, data=data, msg = msg}) end local function realmadd(msg) -- superuser and admins only (because sudo are always has privilege) if not is_momod(msg) then return end if not is_admin1(msg) then return "You're not admin" end local data = load_data(_config.moderation.data) if is_realm(msg) then return 'Realm is already added.' end receiver = get_receiver(msg) chat_info(receiver, check_member_realm_add,{receiver=receiver, data=data, msg = msg}) end -- Global functions function modrem(msg) -- superuser and admins only (because sudo are always has privilege) if not is_admin1(msg) then return "You're not admin" end local data = load_data(_config.moderation.data) if not is_group(msg) then return 'Group is not added.' end receiver = get_receiver(msg) chat_info(receiver, check_member_modrem,{receiver=receiver, data=data, msg = msg}) end function realmrem(msg) -- superuser and admins only (because sudo are always has privilege) if not is_admin1(msg) then return "You're not admin" end local data = load_data(_config.moderation.data) if not is_realm(msg) then return 'Realm is not added.' end receiver = get_receiver(msg) chat_info(receiver, check_member_realmrem,{receiver=receiver, data=data, msg = msg}) end local function get_rules(msg, data) local data_cat = 'rules' if not data[tostring(msg.to.id)][data_cat] then return 'No rules available.' end local rules = data[tostring(msg.to.id)][data_cat] local rules = 'Chat rules:\n\n'..rules return rules end local function set_group_photo(msg, success, result) local data = load_data(_config.moderation.data) local receiver = get_receiver(msg) if success then local file = 'data/photos/chat_photo_'..msg.to.id..'.jpg' print('File downloaded to:', result) os.rename(result, file) print('File moved to:', file) chat_set_photo (receiver, file, ok_cb, false) data[tostring(msg.to.id)]['settings']['set_photo'] = file save_data(_config.moderation.data, data) data[tostring(msg.to.id)]['settings']['lock_photo'] = 'yes' save_data(_config.moderation.data, data) send_large_msg(receiver, 'Photo saved!', ok_cb, false) else print('Error downloading: '..msg.id) send_large_msg(receiver, 'Failed, please try again!', ok_cb, false) end end local function promote(receiver, member_username, member_id) local data = load_data(_config.moderation.data) local group = string.gsub(receiver, 'chat#id', '') if not data[group] then return send_large_msg(receiver, 'Group is not added.') end if data[group]['moderators'][tostring(member_id)] then return send_large_msg(receiver, member_username..' is already a moderator.') end data[group]['moderators'][tostring(member_id)] = member_username save_data(_config.moderation.data, data) return send_large_msg(receiver, member_username..' has been promoted.') end local function promote_by_reply(extra, success, result) local msg = result local full_name = (msg.from.first_name or '')..' '..(msg.from.last_name or '') if msg.from.username then member_username = '@'.. msg.from.username else member_username = full_name end local member_id = msg.from.peer_id if msg.to.peer_type == 'chat' then return promote(get_receiver(msg), member_username, member_id) end end local function demote(receiver, member_username, member_id) local data = load_data(_config.moderation.data) local group = string.gsub(receiver, 'chat#id', '') if not data[group] then return send_large_msg(receiver, 'Group is not added.') end if not data[group]['moderators'][tostring(member_id)] then return send_large_msg(receiver, member_username..' is not a moderator.') end data[group]['moderators'][tostring(member_id)] = nil save_data(_config.moderation.data, data) return send_large_msg(receiver, member_username..' has been demoted.') end local function demote_by_reply(extra, success, result) local msg = result local full_name = (msg.from.first_name or '')..' '..(msg.from.last_name or '') if msg.from.username then member_username = '@'..msg.from.username else member_username = full_name end local member_id = msg.from.peer_id if msg.to.peer_type == 'chat' then return demote(get_receiver(msg), member_username, member_id) end end local function setowner_by_reply(extra, success, result) local msg = result local receiver = get_receiver(msg) local data = load_data(_config.moderation.data) local name_log = msg.from.print_name:gsub("_", " ") data[tostring(msg.to.id)]['set_owner'] = tostring(msg.from.id) save_data(_config.moderation.data, data) savelog(msg.to.id, name_log.." ["..msg.from.id.."] set ["..msg.from.id.."] as owner") local text = msg.from.print_name:gsub("_", " ").." is the owner now" return send_large_msg(receiver, text) end local function promote_demote_res(extra, success, result) --vardump(result) --vardump(extra) local member_id = result.peer_id local member_username = "@"..result.username local chat_id = extra.chat_id local mod_cmd = extra.mod_cmd local receiver = "chat#id"..chat_id if mod_cmd == 'promote' then return promote(receiver, member_username, member_id) elseif mod_cmd == 'demote' then return demote(receiver, member_username, member_id) end end local function mute_user_callback(extra, success, result) if result.service then local action = result.action.type if action == 'chat_add_user' or action == 'chat_del_user' or action == 'chat_rename' or action == 'chat_change_photo' then if result.action.user then user_id = result.action.user.peer_id end end else user_id = result.from.peer_id end local receiver = extra.receiver local chat_id = string.gsub(receiver, 'channel#id', '') if is_muted_user(chat_id, user_id) then mute_user(chat_id, user_id) send_large_msg(receiver, "["..user_id.."] removed from the muted user list") else unmute_user(chat_id, user_id) send_large_msg(receiver, " ["..user_id.."] added to the muted user list") end end local function modlist(msg) local data = load_data(_config.moderation.data) local groups = "groups" if not data[tostring(groups)][tostring(msg.to.id)] then return 'Group is not added.' end -- determine if table is empty if next(data[tostring(msg.to.id)]['moderators']) == nil then --fix way return 'No moderator in this group.' end local i = 1 local message = '\nList of moderators for ' .. string.gsub(msg.to.print_name, '_', ' ') .. ':\n' for k,v in pairs(data[tostring(msg.to.id)]['moderators']) do message = message ..i..' - '..v..' [' ..k.. '] \n' i = i + 1 end return message end local function callbackres(extra, success, result) local user = result.peer_id local name = string.gsub(result.print_name, "_", " ") local chat = 'chat#id'..extra.chatid send_large_msg(chat, user..'\n'..name) return user end local function callback_mute_res(extra, success, result) local user_id = result.peer_id local receiver = extra.receiver local chat_id = string.gsub(receiver, 'chat#id', '') if is_muted_user(chat_id, user_id) then unmute_user(chat_id, user_id) send_large_msg(receiver, " ["..user_id.."] removed from muted user list") else mute_user(chat_id, user_id) send_large_msg(receiver, " ["..user_id.."] added to muted user list") end end local function help() local help_text = tostring(_config.help_text) return help_text end local function cleanmember(cb_extra, success, result) local receiver = cb_extra.receiver local chat_id = "chat#id"..result.id local chatname = result.print_name for k,v in pairs(result.members) do kick_user(v.id, result.peer_id) end end local function killchat(cb_extra, success, result) local receiver = cb_extra.receiver local chat_id = "chat#id"..result.id local chatname = result.print_name for k,v in pairs(result.members) do kick_user_any(v.id, result.peer_id) end end local function killrealm(cb_extra, success, result) local receiver = cb_extra.receiver local chat_id = "chat#id"..result.id local chatname = result.print_name for k,v in pairs(result.members) do kick_user_any(v.id, result.peer_id) end end --[[local function user_msgs(user_id, chat_id) local user_info local uhash = 'user:'..user_id local user = redis:hgetall(uhash) local um_hash = 'msgs:'..user_id..':'..chat_id user_info = tonumber(redis:get(um_hash) or 0) return user_info end local function kick_zero(cb_extra, success, result) local chat_id = cb_extra.chat_id local chat = "chat#id"..chat_id local ci_user local re_user for k,v in pairs(result.members) do local si = false ci_user = v.peer_id local hash = 'chat:'..chat_id..':users' local users = redis:smembers(hash) for i = 1, #users do re_user = users[i] if tonumber(ci_user) == tonumber(re_user) then si = true end end if not si then if ci_user ~= our_id then if not is_momod2(ci_user, chat_id) then chat_del_user(chat, 'user#id'..ci_user, ok_cb, true) end end end end end local function kick_inactive(chat_id, num, receiver) local hash = 'chat:'..chat_id..':users' local users = redis:smembers(hash) -- Get user info for i = 1, #users do local user_id = users[i] local user_info = user_msgs(user_id, chat_id) local nmsg = user_info if tonumber(nmsg) < tonumber(num) then if not is_momod2(user_id, chat_id) then chat_del_user('chat#id'..chat_id, 'user#id'..user_id, ok_cb, true) end end end return chat_info(receiver, kick_zero, {chat_id = chat_id}) end]] local function run(msg, matches) local data = load_data(_config.moderation.data) local receiver = get_receiver(msg) local name_log = user_print_name(msg.from) local group = msg.to.id if msg.media then if msg.media.type == 'photo' and data[tostring(msg.to.id)] and data[tostring(msg.to.id)]['settings']['set_photo'] == 'waiting' and is_chat_msg(msg) and is_momod(msg) then load_photo(msg.id, set_group_photo, msg) end end if msg.to.type == 'chat' then if is_admin1(msg) or not is_support(msg.from.id) then-- Admin only if matches[1] == 'add' and not matches[2] then if not is_admin1(msg) and not is_support(msg.from.id) then-- Admin only savelog(msg.to.id, name_log.." ["..msg.from.id.."] attempted to add group [ "..msg.to.id.." ]") return end if is_realm(msg) then return 'Error: Already a realm.' end savelog(msg.to.id, name_log.." ["..msg.from.id.."] added group [ "..msg.to.id.." ]") print("group "..msg.to.print_name.."("..msg.to.id..") added") return modadd(msg) end if matches[1] == 'add' and matches[2] == 'realm' then if not is_sudo(msg) then-- Admin only savelog(msg.to.id, name_log.." ["..msg.from.id.."] attempted to add realm [ "..msg.to.id.." ]") return end if is_group(msg) then return 'Error: Already a group.' end savelog(msg.to.id, name_log.." ["..msg.from.id.."] added realm [ "..msg.to.id.." ]") print("group "..msg.to.print_name.."("..msg.to.id..") added as a realm") return realmadd(msg) end if matches[1] == 'rem' and not matches[2] then if not is_admin1(msg) and not is_support(msg.from.id) then-- Admin only savelog(msg.to.id, name_log.." ["..msg.from.id.."] attempted to remove group [ "..msg.to.id.." ]") return end if not is_group(msg) then return 'Error: Not a group.' end savelog(msg.to.id, name_log.." ["..msg.from.id.."] removed group [ "..msg.to.id.." ]") print("group "..msg.to.print_name.."("..msg.to.id..") removed") return modrem(msg) end if matches[1] == 'rem' and matches[2] == 'realm' then if not is_sudo(msg) then-- Sudo only savelog(msg.to.id, name_log.." ["..msg.from.id.."] attempted to remove realm [ "..msg.to.id.." ]") return end if not is_realm(msg) then return 'Error: Not a realm.' end savelog(msg.to.id, name_log.." ["..msg.from.id.."] removed realm [ "..msg.to.id.." ]") print("group "..msg.to.print_name.."("..msg.to.id..") removed as a realm") return realmrem(msg) end end if matches[1] == 'chat_created' and msg.from.id == 0 and group_type == "group" then return automodadd(msg) end --[[Experimental if matches[1] == 'chat_created' and msg.from.id == 0 and group_type == "super_group" then local chat_id = get_receiver(msg) users = {[1]="user#id167472799",[2]="user#id170131770"} for k,v in pairs(users) do chat_add_user(chat_id, v, ok_cb, false) end --chat_upgrade(chat_id, ok_cb, false) end ]] if matches[1] == 'chat_created' and msg.from.id == 0 and group_type == "realm" then return autorealmadd(msg) end if msg.to.id and data[tostring(msg.to.id)] then local settings = data[tostring(msg.to.id)]['settings'] if matches[1] == 'chat_add_user' then if not msg.service then return end local group_member_lock = settings.lock_member local user = 'user#id'..msg.action.user.id local chat = 'chat#id'..msg.to.id if group_member_lock == 'yes' and not is_owner2(msg.action.user.id, msg.to.id) then chat_del_user(chat, user, ok_cb, true) elseif group_member_lock == 'yes' and tonumber(msg.from.id) == tonumber(our_id) then return nil elseif group_member_lock == 'no' then return nil end end if matches[1] == 'chat_del_user' then if not msg.service then -- return "Are you trying to troll me?" end local user = 'user#id'..msg.action.user.id local chat = 'chat#id'..msg.to.id savelog(msg.to.id, name_log.." ["..msg.from.id.."] deleted user "..user) end if matches[1] == 'chat_delete_photo' then if not msg.service then return end local group_photo_lock = settings.lock_photo if group_photo_lock == 'yes' then local picturehash = 'picture:changed:'..msg.to.id..':'..msg.from.id redis:incr(picturehash) --- local picturehash = 'picture:changed:'..msg.to.id..':'..msg.from.id local picprotectionredis = redis:get(picturehash) if picprotectionredis then if tonumber(picprotectionredis) == 4 and not is_owner(msg) then kick_user(msg.from.id, msg.to.id) end if tonumber(picprotectionredis) == 8 and not is_owner(msg) then ban_user(msg.from.id, msg.to.id) local picturehash = 'picture:changed:'..msg.to.id..':'..msg.from.id redis:set(picturehash, 0) end end savelog(msg.to.id, name_log.." ["..msg.from.id.."] tried to deleted picture but failed ") chat_set_photo(receiver, settings.set_photo, ok_cb, false) elseif group_photo_lock == 'no' then return nil end end if matches[1] == 'chat_change_photo' and msg.from.id ~= 0 then if not msg.service then return end local group_photo_lock = settings.lock_photo if group_photo_lock == 'yes' then local picturehash = 'picture:changed:'..msg.to.id..':'..msg.from.id redis:incr(picturehash) --- local picturehash = 'picture:changed:'..msg.to.id..':'..msg.from.id local picprotectionredis = redis:get(picturehash) if picprotectionredis then if tonumber(picprotectionredis) == 4 and not is_owner(msg) then kick_user(msg.from.id, msg.to.id) end if tonumber(picprotectionredis) == 8 and not is_owner(msg) then ban_user(msg.from.id, msg.to.id) local picturehash = 'picture:changed:'..msg.to.id..':'..msg.from.id redis:set(picturehash, 0) end end savelog(msg.to.id, name_log.." ["..msg.from.id.."] tried to change picture but failed ") chat_set_photo(receiver, settings.set_photo, ok_cb, false) elseif group_photo_lock == 'no' then return nil end end if matches[1] == 'chat_rename' then if not msg.service then return end local group_name_set = settings.set_name local group_name_lock = settings.lock_name local to_rename = 'chat#id'..msg.to.id if group_name_lock == 'yes' then if group_name_set ~= tostring(msg.to.print_name) then local namehash = 'name:changed:'..msg.to.id..':'..msg.from.id redis:incr(namehash) local namehash = 'name:changed:'..msg.to.id..':'..msg.from.id local nameprotectionredis = redis:get(namehash) if nameprotectionredis then if tonumber(nameprotectionredis) == 4 and not is_owner(msg) then kick_user(msg.from.id, msg.to.id) end if tonumber(nameprotectionredis) == 8 and not is_owner(msg) then ban_user(msg.from.id, msg.to.id) local namehash = 'name:changed:'..msg.to.id..':'..msg.from.id redis:set(namehash, 0) end end savelog(msg.to.id, name_log.." ["..msg.from.id.."] tried to change name but failed ") rename_chat(to_rename, group_name_set, ok_cb, false) end elseif group_name_lock == 'no' then return nil end end if matches[1] == 'setname' and is_momod(msg) then local new_name = string.gsub(matches[2], '_', ' ') data[tostring(msg.to.id)]['settings']['set_name'] = new_name save_data(_config.moderation.data, data) local group_name_set = data[tostring(msg.to.id)]['settings']['set_name'] local to_rename = 'chat#id'..msg.to.id rename_chat(to_rename, group_name_set, ok_cb, false) savelog(msg.to.id, "Group { "..msg.to.print_name.." } name changed to [ "..new_name.." ] by "..name_log.." ["..msg.from.id.."]") end if matches[1] == 'setphoto' and is_momod(msg) then data[tostring(msg.to.id)]['settings']['set_photo'] = 'waiting' save_data(_config.moderation.data, data) return 'Please send me new group photo now' end if matches[1] == 'promote' and not matches[2] then if not is_momod(msg) then return end if not is_owner(msg) then return "Only the owner can prmote new moderators" end if type(msg.reply_id)~="nil" then msgr = get_message(msg.reply_id, promote_by_reply, false) end end if matches[1] == 'promote' and matches[2] then if not is_momod(msg) then return end if not is_owner(msg) then return "Only owner can promote" end local member = matches[2] savelog(msg.to.id, name_log.." ["..msg.from.id.."] promoted @".. member) local cbres_extra = { chat_id = msg.to.id, mod_cmd = 'promote', from_id = msg.from.id } local username = matches[2] local username = string.gsub(matches[2], '@', '') return resolve_username(username, promote_demote_res, cbres_extra) end if matches[1] == 'demote' and not matches[2] then if not is_momod(msg) then return end if not is_owner(msg) then return "Only the owner can demote moderators" end if type(msg.reply_id)~="nil" then msgr = get_message(msg.reply_id, demote_by_reply, false) end end if matches[1] == 'demote' and matches[2] then if not is_momod(msg) then return end if not is_owner(msg) then return "Only owner can demote" end if string.gsub(matches[2], "@", "") == msg.from.username and not is_owner(msg) then return "You can't demote yourself" end local member = matches[2] savelog(msg.to.id, name_log.." ["..msg.from.id.."] demoted @".. member) local cbres_extra = { chat_id = msg.to.id, mod_cmd = 'demote', from_id = msg.from.id } local username = matches[2] local username = string.gsub(matches[2], '@', '') return resolve_username(username, promote_demote_res, cbres_extra) end if matches[1] == 'modlist' then savelog(msg.to.id, name_log.." ["..msg.from.id.."] requested group modlist") return modlist(msg) end if matches[1] == 'about' then savelog(msg.to.id, name_log.." ["..msg.from.id.."] requested group description") return get_description(msg, data) end if matches[1] == 'rules' then savelog(msg.to.id, name_log.." ["..msg.from.id.."] requested group rules") return get_rules(msg, data) end if matches[1] == 'set' then if matches[2] == 'rules' then rules = matches[3] local target = msg.to.id savelog(msg.to.id, name_log.." ["..msg.from.id.."] has changed group rules to ["..matches[3].."]") return set_rulesmod(msg, data, target) end if matches[2] == 'about' then local data = load_data(_config.moderation.data) local target = msg.to.id local about = matches[3] savelog(msg.to.id, name_log.." ["..msg.from.id.."] has changed group description to ["..matches[3].."]") return set_descriptionmod(msg, data, target, about) end end end --Begin chat settings if matches[1] == 'lock' then local target = msg.to.id if matches[2] == 'name' then savelog(msg.to.id, name_log.." ["..msg.from.id.."] locked name ") return lock_group_namemod(msg, data, target) end if matches[2] == 'member' then savelog(msg.to.id, name_log.." ["..msg.from.id.."] locked member ") return lock_group_membermod(msg, data, target) end if matches[2] == 'flood' then savelog(msg.to.id, name_log.." ["..msg.from.id.."] locked flood ") return lock_group_floodmod(msg, data, target) end if matches[2] == 'arabic' then savelog(msg.to.id, name_log.." ["..msg.from.id.."] locked arabic ") return lock_group_arabic(msg, data, target) end if matches[2] == 'bots' then savelog(msg.to.id, name_log.." ["..msg.from.id.."] locked bots ") return lock_group_bots(msg, data, target) end if matches[2] == 'leave' then savelog(msg.to.id, name_log.." ["..msg.from.id.."] locked leaving ") return lock_group_leave(msg, data, target) end if matches[2] == 'links' then savelog(msg.to.id, name_log.." ["..msg.from.id.."] locked link posting ") return lock_group_links(msg, data, target) end if matches[2]:lower() == 'rtl' then savelog(msg.to.id, name_log.." ["..msg.from.id.."] locked rtl chars. in names") return lock_group_rtl(msg, data, target) end if matches[2] == 'sticker' then savelog(msg.to.id, name_log.." ["..msg.from.id.."] locked sticker posting") return lock_group_sticker(msg, data, target) end if matches[2] == 'contacts' then savelog(msg.to.id, name_log.." ["..msg.from.id.."] locked contact posting") return lock_group_contacts(msg, data, target) end end if matches[1] == 'unlock' then local target = msg.to.id if matches[2] == 'name' then savelog(msg.to.id, name_log.." ["..msg.from.id.."] unlocked name ") return unlock_group_namemod(msg, data, target) end if matches[2] == 'member' then savelog(msg.to.id, name_log.." ["..msg.from.id.."] unlocked member ") return unlock_group_membermod(msg, data, target) end if matches[2] == 'photo' then savelog(msg.to.id, name_log.." ["..msg.from.id.."] unlocked photo ") return unlock_group_photomod(msg, data, target) end if matches[2] == 'flood' then savelog(msg.to.id, name_log.." ["..msg.from.id.."] unlocked flood ") return unlock_group_floodmod(msg, data, target) end if matches[2] == 'arabic' then savelog(msg.to.id, name_log.." ["..msg.from.id.."] unlocked arabic ") return unlock_group_arabic(msg, data, target) end if matches[2] == 'bots' then savelog(msg.to.id, name_log.." ["..msg.from.id.."] unlocked bots ") return unlock_group_bots(msg, data, target) end if matches[2] == 'leave' then savelog(msg.to.id, name_log.." ["..msg.from.id.."] unlocked leaving ") return unlock_group_leave(msg, data, target) end if matches[2] == 'links' then savelog(msg.to.id, name_log.." ["..msg.from.id.."] unlocked link posting") return unlock_group_links(msg, data, target) end if matches[2]:lower() == 'rtl' then savelog(msg.to.id, name_log.." ["..msg.from.id.."] unlocked RTL chars. in names") return unlock_group_rtl(msg, data, target) end if matches[2] == 'sticker' then savelog(msg.to.id, name_log.." ["..msg.from.id.."] unlocked sticker posting") return unlock_group_sticker(msg, data, target) end if matches[2] == 'contacts' then savelog(msg.to.id, name_log.." ["..msg.from.id.."] unlocked contact posting") return unlock_group_contacts(msg, data, target) end end --End chat settings --Begin Chat mutes if matches[1] == 'mute' and is_owner(msg) then local chat_id = msg.to.id if matches[2] == 'audio' then local msg_type = 'Audio' if not is_muted(chat_id, msg_type..': yes') then savelog(msg.to.id, name_log.." ["..msg.from.id.."] set group to: mute "..msg_type) mute(chat_id, msg_type) return "Group "..matches[2].." has been muted" else return "Group mute "..matches[2].." is already on" end end if matches[2] == 'photo' then local msg_type = 'Photo' if not is_muted(chat_id, msg_type..': yes') then savelog(msg.to.id, name_log.." ["..msg.from.id.."] set group to: mute "..msg_type) mute(chat_id, msg_type) return "Group "..matches[2].." has been muted" else return "Group mute "..matches[2].." is already on" end end if matches[2] == 'video' then local msg_type = 'Video' if not is_muted(chat_id, msg_type..': yes') then savelog(msg.to.id, name_log.." ["..msg.from.id.."] set group to: mute "..msg_type) mute(chat_id, msg_type) return "Group "..matches[2].." has been muted" else return "Group mute "..matches[2].." is already on" end end if matches[2] == 'gifs' then local msg_type = 'Gifs' if not is_muted(chat_id, msg_type..': yes') then savelog(msg.to.id, name_log.." ["..msg.from.id.."] set group to: mute "..msg_type) mute(chat_id, msg_type) return msg_type.." have been muted" else return "Group mute "..msg_type.." is already on" end end if matches[2] == 'documents' then local msg_type = 'Documents' if not is_muted(chat_id, msg_type..': yes') then savelog(msg.to.id, name_log.." ["..msg.from.id.."] set group to: mute "..msg_type) mute(chat_id, msg_type) return msg_type.." have been muted" else return "Group mute "..msg_type.." is already on" end end if matches[2] == 'text' then local msg_type = 'Text' if not is_muted(chat_id, msg_type..': yes') then savelog(msg.to.id, name_log.." ["..msg.from.id.."] set group to: mute "..msg_type) mute(chat_id, msg_type) return "Group text has been muted" else return "Group mute text is already on" end end if matches[2] == 'all' then local msg_type = 'All' if not is_muted(chat_id, msg_type..': yes') then savelog(msg.to.id, name_log.." ["..msg.from.id.."] set group to: mute "..msg_type) mute(chat_id, msg_type) return "Mute "..msg_type.." has been enabled" else return "Mute "..msg_type.." is already on" end end end if matches[1] == 'unmute' and is_owner(msg) then local chat_id = msg.to.id if matches[2] == 'audio' then local msg_type = 'Audio' if is_muted(chat_id, msg_type..': yes') then savelog(msg.to.id, name_log.." ["..msg.from.id.."] set group to: unmute "..msg_type) unmute(chat_id, msg_type) return "Group "..msg_type.." has been unmuted" else return "Group mute "..msg_type.." is already off" end end if matches[2] == 'photo' then local msg_type = 'Photo' if is_muted(chat_id, msg_type..': yes') then savelog(msg.to.id, name_log.." ["..msg.from.id.."] set group to: unmute "..msg_type) unmute(chat_id, msg_type) return "Group "..msg_type.." has been unmuted" else return "Group mute "..msg_type.." is already off" end end if matches[2] == 'Video' then local msg_type = 'Video' if is_muted(chat_id, msg_type..': yes') then savelog(msg.to.id, name_log.." ["..msg.from.id.."] set group to: unmute "..msg_type) unmute(chat_id, msg_type) return "Group "..msg_type.." has been unmuted" else return "Group mute "..msg_type.." is already off" end end if matches[2] == 'gifs' then local msg_type = 'Gifs' if is_muted(chat_id, msg_type..': yes') then savelog(msg.to.id, name_log.." ["..msg.from.id.."] set group to: unmute "..msg_type) unmute(chat_id, msg_type) return msg_type.." have been unmuted" else return "Mute "..msg_type.." is already off" end end if matches[2] == 'documents' then local msg_type = 'Documents' if is_muted(chat_id, msg_type..': yes') then savelog(msg.to.id, name_log.." ["..msg.from.id.."] set group to: unmute "..msg_type) unmute(chat_id, msg_type) return msg_type.." have been unmuted" else return "Mute "..msg_type.." is already off" end end if matches[2] == 'text' then local msg_type = 'Text' if is_muted(chat_id, msg_type..': yes') then savelog(msg.to.id, name_log.." ["..msg.from.id.."] set group to: unmute message") unmute(chat_id, msg_type) return "Group text has been unmuted" else return "Group mute text is already off" end end if matches[2] == 'all' then local msg_type = 'All' if is_muted(chat_id, msg_type..': yes') then savelog(msg.to.id, name_log.." ["..msg.from.id.."] set group to: unmute "..msg_type) unmute(chat_id, msg_type) return "Mute "..msg_type.." has been disabled" else return "Mute "..msg_type.." is already disabled" end end end --Begin chat muteuser if matches[1] == "muteuser" and is_momod(msg) then local chat_id = msg.to.id local hash = "mute_user"..chat_id local user_id = "" if type(msg.reply_id) ~= "nil" then local receiver = get_receiver(msg) local get_cmd = "mute_user" get_message(msg.reply_id, mute_user_callback, {receiver = receiver, get_cmd = get_cmd}) elseif matches[1] == "muteuser" and string.match(matches[2], '^%d+$') then local user_id = matches[2] if is_muted_user(chat_id, user_id) then mute_user(chat_id, user_id) return "["..user_id.."] removed from the muted users list" else unmute_user(chat_id, user_id) return "["..user_id.."] added to the muted user list" end elseif matches[1] == "muteuser" and not string.match(matches[2], '^%d+$') then local receiver = get_receiver(msg) local get_cmd = "mute_user" local username = matches[2] local username = string.gsub(matches[2], '@', '') resolve_username(username, callback_mute_res, {receiver = receiver, get_cmd = get_cmd}) end end --End Chat muteuser if matches[1] == "muteslist" and is_momod(msg) then local chat_id = msg.to.id if not has_mutes(chat_id) then set_mutes(chat_id) return mutes_list(chat_id) end savelog(msg.to.id, name_log.." ["..msg.from.id.."] requested SuperGroup muteslist") return mutes_list(chat_id) end if matches[1] == "mutelist" and is_momod(msg) then local chat_id = msg.to.id savelog(msg.to.id, name_log.." ["..msg.from.id.."] requested SuperGroup mutelist") return muted_user_list(chat_id) end if matches[1] == 'settings' and is_momod(msg) then local target = msg.to.id savelog(msg.to.id, name_log.." ["..msg.from.id.."] requested group settings ") return show_group_settingsmod(msg, target) end if matches[1] == 'public' and is_momod(msg) then local target = msg.to.id if matches[2] == 'yes' then savelog(msg.to.id, name_log.." ["..msg.from.id.."] set group to: public") return set_public_membermod(msg, data, target) end if matches[2] == 'no' then savelog(msg.to.id, name_log.." ["..msg.from.id.."] set group to: not public") return unset_public_membermod(msg, data, target) end end if msg.to.type == 'chat' then if matches[1] == 'newlink' and not is_realm(msg) then if not is_momod(msg) then return "For moderators only!" end local function callback (extra , success, result) local receiver = 'chat#'..msg.to.id if success == 0 then return send_large_msg(receiver, '*Error: Invite link failed* \nReason: Not creator.') end send_large_msg(receiver, "Created a new link") data[tostring(msg.to.id)]['settings']['set_link'] = result save_data(_config.moderation.data, data) end local receiver = 'chat#'..msg.to.id savelog(msg.to.id, name_log.." ["..msg.from.id.."] revoked group link ") return export_chat_link(receiver, callback, true) end if matches[1] == 'link' then if not is_momod(msg) then return "For moderators only!" end local group_link = data[tostring(msg.to.id)]['settings']['set_link'] if not group_link then return "Create a link using /newlink first !" end savelog(msg.to.id, name_log.." ["..msg.from.id.."] requested group link ["..group_link.."]") return "Group link:\n"..group_link end if matches[1] == 'setowner' and matches[2] then if not is_owner(msg) then return "For owner only!" end data[tostring(msg.to.id)]['set_owner'] = matches[2] save_data(_config.moderation.data, data) savelog(msg.to.id, name_log.." ["..msg.from.id.."] set ["..matches[2].."] as owner") local text = matches[2].." added as owner" return text end if matches[1] == 'setowner' and not matches[2] then if not is_owner(msg) then return "only for the owner!" end if type(msg.reply_id)~="nil" then msgr = get_message(msg.reply_id, setowner_by_reply, false) end end end if matches[1] == 'owner' then local group_owner = data[tostring(msg.to.id)]['set_owner'] if not group_owner then return "no owner,ask admins in support groups to set owner for your group" end savelog(msg.to.id, name_log.." ["..msg.from.id.."] used /owner") return "Group owner is ["..group_owner..']' end if matches[1] == 'setgpowner' then local receiver = "chat#id"..matches[2] if not is_admin1(msg) then return "For admins only!" end data[tostring(matches[2])]['set_owner'] = matches[3] save_data(_config.moderation.data, data) local text = matches[3].." added as owner" send_large_msg(receiver, text) return end if matches[1] == 'setflood' then if not is_momod(msg) then return "For moderators only!" end if tonumber(matches[2]) < 5 or tonumber(matches[2]) > 20 then return "Wrong number,range is [5-20]" end local flood_max = matches[2] data[tostring(msg.to.id)]['settings']['flood_msg_max'] = flood_max save_data(_config.moderation.data, data) savelog(msg.to.id, name_log.." ["..msg.from.id.."] set flood to ["..matches[2].."]") return 'Group flood has been set to '..matches[2] end if msg.to.type == 'chat' then if matches[1] == 'clean' then if not is_owner(msg) then return "Only owner can clean" end if matches[2] == 'member' then if not is_owner(msg) then return "Only admins can clean members" end local receiver = get_receiver(msg) chat_info(receiver, cleanmember, {receiver=receiver}) end end if matches[2] == 'modlist' then if next(data[tostring(msg.to.id)]['moderators']) == nil then --fix way return 'No moderator in this group.' end local message = '\nList of moderators for ' .. string.gsub(msg.to.print_name, '_', ' ') .. ':\n' for k,v in pairs(data[tostring(msg.to.id)]['moderators']) do data[tostring(msg.to.id)]['moderators'][tostring(k)] = nil save_data(_config.moderation.data, data) end savelog(msg.to.id, name_log.." ["..msg.from.id.."] cleaned modlist") end if matches[2] == 'rules' then local data_cat = 'rules' data[tostring(msg.to.id)][data_cat] = nil save_data(_config.moderation.data, data) savelog(msg.to.id, name_log.." ["..msg.from.id.."] cleaned rules") end if matches[2] == 'about' then local data_cat = 'description' data[tostring(msg.to.id)][data_cat] = nil save_data(_config.moderation.data, data) savelog(msg.to.id, name_log.." ["..msg.from.id.."] cleaned about") end end if msg.to.type == 'chat' then if matches[1] == 'kill' and matches[2] == 'chat' then if not is_admin1(msg) then return nil end if not is_realm(msg) then local receiver = get_receiver(msg) return modrem(msg), print("Closing Group..."), chat_info(receiver, killchat, {receiver=receiver}) else return 'This is a realm' end end if matches[1] == 'kill' and matches[2] == 'realm' then if not is_admin1(msg) then return nil end if not is_group(msg) then local receiver = get_receiver(msg) return realmrem(msg), print("Closing Realm..."), chat_info(receiver, killrealm, {receiver=receiver}) else return 'This is a group' end end if matches[1] == 'help' then if not is_momod(msg) or is_realm(msg) then return end savelog(msg.to.id, name_log.." ["..msg.from.id.."] Used /help") return help() end if matches[1] == 'res' then local cbres_extra = { chatid = msg.to.id } local username = matches[2] local username = username:gsub("@","") resolve_username(username, callbackres, cbres_extra) return end if matches[1] == 'kickinactive' then --send_large_msg('chat#id'..msg.to.id, 'I\'m in matches[1]') if not is_momod(msg) then return 'Only a moderator can kick inactive users' end local num = 1 if matches[2] then num = matches[2] end local chat_id = msg.to.id local receiver = get_receiver(msg) return kick_inactive(chat_id, num, receiver) end end end end local function pre_process(msg) if not msg.text and msg.media then msg.text = '['..msg.media.type..']' end return msg end return { patterns = { "^[#!/](add)$", "^[#!/](add) (realm)$", "^[#!/](rem)$", "^[#!/](rem) (realm)$", "^[#!/](rules)$", "^[#!/](about)$", "^[#!/](setname) (.*)$", "^[#!/](setphoto)$", "^[#!/](promote) (.*)$", "^[#!/](promote)", "^[#!/](help)$", "^[#!/](clean) (.*)$", "^[#!/](kill) (chat)$", "^[#!/](kill) (realm)$", "^[#!/](demote) (.*)$", "^[#!/](demote)", "^[#!/](set) ([^%s]+) (.*)$", "^[#!/](lock) (.*)$", "^[#!/](setowner) (%d+)$", "^[#!/](setowner)", "^[#!/](owner)$", "^[#!/](res) (.*)$", "^[#!/](setgpowner) (%d+) (%d+)$",-- (group id) (owner id) "^[#!/](unlock) (.*)$", "^[#!/](setflood) (%d+)$", "^[#!/](settings)$", "^[#!/](public) (.*)$", "^[#!/](modlist)$", "^[#!/](newlink)$", "^[#!/](link)$", "^[#!/]([Mm]ute) ([^%s]+)$", "^[#!/]([Uu]nmute) ([^%s]+)$", "^[#!/]([Mm]uteuser)$", "^[#!/]([Mm]uteuser) (.*)$", "^[#!/]([Mm]uteslist)$", "^[#!/]([Mm]utelist)$", "^[#!/](kickinactive)$", "^[#!/](kickinactive) (%d+)$", "%[(document)%]", "%[(photo)%]", "%[(video)%]", "%[(audio)%]", "^!!tgservice (.+)$", }, run = run, pre_process = pre_process } end
gpl-2.0
eniallator/platformer
src/optionData.lua
1
6834
optionGenerator = require 'src.optionGenerator' local optionData = {} optionData.main = { display = function() local default = {w = screenDim.x / 4, h = screenDim.y / 8} default.x = screenDim.x / 2 - default.w / 2 local boxGap = screenDim.y / 30 local returnTbl = { play = {name = 'Play', x = default.x, y = screenDim.y / 2 - default.h - boxGap / 2, w = default.w, h = default.h}, createMap = {name = 'Map Creator', x = default.x, y = screenDim.y / 2 + boxGap / 2, w = default.w, h = default.h} } if not isSmartPhone then returnTbl.play = {name = 'Play', x = default.x, y = screenDim.y / 2 - default.h * 1.5 - boxGap, w = default.w, h = default.h} returnTbl.createMap = {name = 'Map Creator', x = default.x, y = screenDim.y / 2 - default.h / 2, w = default.w, h = default.h} returnTbl.controls = {name = 'Controls', x = default.x, y = screenDim.y / 2 + default.h / 2 + boxGap, w = default.w, h = default.h} end return returnTbl end, funcs = { play = function() currMenu = 'play' optionGenerator.currOptionPage = 1 end, controls = function() currMenu = 'controls' end, createMap = function() selected = 'createMap' formattedMap = {} formattedMap.foreground = {} formattedMap.background = {} map.makeGrid(256, screenDim.y / blockSize) firstLoad = true resetPlayer = true showBlockMenuHelpText = true currSelectedGrid = 'foreground' end } } optionData.controls = { display = function() return optionGenerator.loadOptions( optionGenerator.tblToStr(controls), 'controls', function(box) controls.waitForPress = box.controlIndex end ) end } optionData.escMenu = { display = function() local default = {w = screenDim.x / 4, h = screenDim.y / 8} default.x = screenDim.x / 2 - default.w / 2 local boxGap = screenDim.y / 30 local returnTbl = { close = {name = 'Close', x = screenDim.x - screenDim.x / 4, y = screenDim.y / 18, w = screenDim.x / 5, h = screenDim.y / 9}, modeSwitch = {name = 'Mode: ' .. selected, x = default.x, y = screenDim.y / 2 - boxGap / 2 - default.h, w = default.w, h = default.h}, backToMenu = {name = 'Back To Menu', x = default.x, y = screenDim.y / 2 + boxGap / 2, w = default.w, h = default.h} } if selected == 'createMap' then returnTbl.save = {name = 'Save Map', x = default.x, y = screenDim.y / 2 - boxGap - default.h * 1.5, w = default.w, h = default.h} returnTbl.modeSwitch.y = screenDim.y / 2 - default.h * 0.5 returnTbl.backToMenu.y = screenDim.y / 2 + boxGap + default.h / 2 end return returnTbl end, funcs = { close = function() end, save = function() utilsData.textBox.selected = 'saveMap' if isSmartPhone then love.keyboard.setTextInput(true) end end, backToMenu = function() selected = 'menu' currMenu = 'main' cameraTranslation = 0 newCameraTranslation = 0 end, modeSwitch = function() if selected == 'game' then selected = 'createMap' currSelectedGrid = 'foreground' else local playerDim = entity.player.dim() if entity.player.pos.x + playerDim.w / 2 > screenDim.x / 2 then if entity.player.pos.x + playerDim.w / 2 > 255 * blockSize - screenDim.x / 2 then cameraTranslation = -(255 * blockSize - screenDim.x) newCameraTranslation = -(255 * blockSize - screenDim.x) else cameraTranslation = -(entity.player.pos.x - screenDim.x / 2) newCameraTranslation = -(entity.player.pos.x - screenDim.x / 2) end else cameraTranslation = 0 newCameraTranslation = 0 end if resetPlayer then entity.player.reset() resetPlayer = false else entity.player.pos = {x = entity.player.spawnPos.x, y = entity.player.spawnPos.y} entity.player.vel = {x = 0, y = 0} end selected = 'game' timeCounter = 0 end end } } optionData.play = { display = function() return optionGenerator.loadOptions( optionGenerator.filterFiles(love.filesystem.getDirectoryItems('maps')), 'play', function(box) formattedMap = {} if defaultMaps[box.name] then formattedMap = defaultMaps[box.name] else formattedMap = map.readTable('maps/' .. box.name .. '.map') end map.makeGrid(256, screenDim.y / blockSize) selected = 'game' currMenu = 'main' entity.player.reset() timeCounter = 0 end ) end } optionData.blockMenu = { display = function() return optionGenerator.loadBlockOptions() end, funcs = { nextPage = function() optionGenerator.currBlockPage = optionGenerator.currBlockPage + 1 end, prevPage = function() optionGenerator.currBlockPage = optionGenerator.currBlockPage - 1 end, toggleMapGrid = function() currSelectedGrid = currSelectedGrid == 'foreground' and 'background' or 'foreground' end, togglePlaceMode = function() destroyMode = not destroyMode end } } optionData.winMenu = { display = function() local default = {w = screenDim.x / 4, h = screenDim.y / 8} default.x = screenDim.x / 2 - default.w / 2 local boxGap = screenDim.y / 30 return { backToMenu = {name = 'Back To Menu', x = default.x, y = screenDim.y / 2 - default.h / 2, w = default.w, h = default.h} } end, funcs = { backToMenu = function() selected = 'menu' currMenu = 'main' cameraTranslation = 0 newCameraTranslation = 0 reachedGoal = false end } } optionData.smartPhoneEscMenu = { display = function() local box = { name = 'esc', y = 0, w = screenDim.x / 5, h = screenDim.y / 15 } box.x = screenDim.x - box.w return box end } optionData.smartPhoneMapCreator = { toggleBlockMenu = { x = screenDim.x / 2 - screenDim.x / 10, y = screenDim.y / 2 - screenDim.y / 24 }, displayIcon = function() local currCoords = optionData.smartPhoneMapCreator.toggleBlockMenu return { x = currCoords.x, y = currCoords.y, r = screenDim.y / 30 } end, display = function() return { toggleBlockMenu = { name = (mapCreatorMenu and 'hide' or 'show') .. ' block menu', x = optionData.smartPhoneMapCreator.toggleBlockMenu.x, y = optionData.smartPhoneMapCreator.toggleBlockMenu.y, w = screenDim.x / 5, h = screenDim.y / 12 } } end, funcs = { toggleBlockMenu = function() mapCreatorMenu = not mapCreatorMenu end } } return optionData
gpl-3.0
mirbot/zdgbbbrblsb-vbv
plugins/boobs.lua
731
1601
do -- Recursive function local function getRandomButts(attempt) attempt = attempt or 0 attempt = attempt + 1 local res,status = http.request("http://api.obutts.ru/noise/1") if status ~= 200 then return nil end local data = json:decode(res)[1] -- The OpenBoobs API sometimes returns an empty array if not data and attempt <= 3 then print('Cannot get that butts, trying another one...') return getRandomButts(attempt) end return 'http://media.obutts.ru/' .. data.preview end local function getRandomBoobs(attempt) attempt = attempt or 0 attempt = attempt + 1 local res,status = http.request("http://api.oboobs.ru/noise/1") if status ~= 200 then return nil end local data = json:decode(res)[1] -- The OpenBoobs API sometimes returns an empty array if not data and attempt < 10 then print('Cannot get that boobs, trying another one...') return getRandomBoobs(attempt) end return 'http://media.oboobs.ru/' .. data.preview end local function run(msg, matches) local url = nil if matches[1] == "!boobs" then url = getRandomBoobs() end if matches[1] == "!butts" then url = getRandomButts() end if url ~= nil then local receiver = get_receiver(msg) send_photo_from_url(receiver, url) else return 'Error getting boobs/butts for you, please try again later.' end end return { description = "Gets a random boobs or butts pic", usage = { "!boobs: Get a boobs NSFW image. 🔞", "!butts: Get a butts NSFW image. 🔞" }, patterns = { "^!boobs$", "^!butts$" }, run = run } end
gpl-2.0
roelofr/HorrorStory
gamemodes/horrorstory/gamemode/cl_init.lua
1
3639
--[[--------------------------------------------------------- {TMG} Horror Story - Client init -----------------------------------------------------------]] include( 'shared.lua' ) include( 'cl_settings.lua' ) include( 'sh_messages.lua' ) include( 'sh_openplugins.lua' ) include( 'sh_vgui.lua' ) include( 'skin/horror-story.lua' ) -- -- Make BaseClass available -- DEFINE_BASECLASS( "gamemode_base" ) --[[--------------------------------------------------------- Called after a game loaded or reloaded -----------------------------------------------------------]] function GM:HorrorStoryReady() if _G.hs_vgui != nil then if _G.hs_vgui.healthBar != nil and IsValid( _G.hs_vgui.healthBar ) then _G.hs_vgui.healthBar:Remove() end if _G.hs_vgui.notifications != nil and IsValid( _G.hs_vgui.notifications ) then _G.hs_vgui.notifications:Remove() end end GAMEMODE.gameDone = false net.Receive( "GameCompleted", function( length ) local oldGameDone = tobool( GAMEMODE.gameDone ) GAMEMODE.gameDone = tobool( net.ReadBit() ) if GAMEMODE.gameDone != oldGameDone then if GAMEMODE.gameDone then GAMEMODE.notifications:AddNotification( { ["text"] = "The map has been finished. Ask the host to change level", ["color"] = "green", ["time"] = 30 }) -- Add a notification end end end) net.Receive( "HorrorStoryNotify", function( length ) local readTable = net.ReadTable() GAMEMODE.notifications:AddNotification( readTable ) end ) GAMEMODE.healthBar = vgui.Create( "horrorstory_hud" ) GAMEMODE.notifications = vgui.Create( "horrorstory_notifications" ) if _G.hs_vgui == nil then _G.hs_vgui = {} end _G.hs_vgui.healthBar = GAMEMODE.healthBar _G.hs_vgui.notifications = GAMEMODE.notifications openPlugins:FlushHooks() --[[ Add OpenPlugins from gamemode ]]-- print("[HorrorStory] Adding gamemode plugins" ) openPlugins:AddDirectory( "horrorstory/gamemode/plugins", true, true ) --[[ Add OpenPlugins from user ]]-- if file.Exists( "plugins/horrorstory", "LUA" ) and file.IsDir( "plugins/horrorstory", "LUA" ) then print("[HorrorStory] Adding user plugins" ) openPlugins:AddDirectory( "plugins/horrorstory", true, true ) end net.Receive( "HorrorStoryHelp", function( u ) gamemode.Call( "ShowHelp" ) end ) GAMEMODE.SettingsPanel = nil end --[[--------------------------------------------------------- Called after the game has finished loading -----------------------------------------------------------]] function GM:Initialize() gamemode.Call( "HorrorStoryReady" ) BaseClass.Initialize( self ) end --[[--------------------------------------------------------- Called after the game has reloaded -----------------------------------------------------------]] function GM:OnReloaded() gamemode.Call( "HorrorStoryReady" ) BaseClass.OnReloaded( self ) end --[[--------------------------------------------------------- Decides if stuff should or should not be drawn -----------------------------------------------------------]] function GM:HUDShouldDraw( name ) for k, v in pairs({"CHudHealth", "CHudBattery"}) do if name == v then return false end end return true end --[[--------------------------------------------------------- Force a darker VGUI theme -----------------------------------------------------------]] function GM:ForceDermaSkin() return "HorrorStoryV2" end --[[--------------------------------------------------------- Need some help here! -----------------------------------------------------------]] function GM:ShowHelp() GAMEMODE.SettingsPanel = vgui.Create( "horrorstory_settings" ) end
agpl-3.0
Noneatme/mta-lostresources
[gamemodes]/prophunt/client/mainmenu/CMainMenu_Wallpaper.lua
1
4199
-- ####################################### -- ## Project: MTA Prop Hunt ## -- ## For MTA: San Andreas ## -- ## Name: MainMenu_Wallpaper.lua ## -- ## Author: Noneatme ## -- ## Version: 1.0 ## -- ## License: See top Folder ## -- ####################################### -- FUNCTIONS / METHODS -- local cFunc = {}; -- Local Functions local cSetting = {}; -- Local Settings MainMenu_Wallpaper = {}; MainMenu_Wallpaper.__index = MainMenu_Wallpaper; --[[ ]] -- /////////////////////////////// -- ///// New ////// -- ///// Returns: Object ////// -- /////////////////////////////// function MainMenu_Wallpaper:New(...) local obj = setmetatable({}, {__index = self}); if obj.Constructor then obj:Constructor(...); end return obj; end -- /////////////////////////////// -- ///// Render ////// -- ///// Returns: void ////// -- /////////////////////////////// function MainMenu_Wallpaper:Render() if(getTickCount()-self.startTick > 10000) then self:ChangeWallpaper(); self.startTick = getTickCount(); self.changedstate = not (self.changedstate); self.changed = true; end -- Background -- local asx, asy = 1920, 1080 -- if(g.sx > asx) or (g.sy > asy) then -- Lawl asx = g.sx; asy = g.sy; end if not(self.changedstate) then dxDrawRectangle(0, 0, g.sx, g.sy, tocolor(0, 0, 0, 255), false) dxDrawImageSection(0, 0, asx, asy, 0, 0, g.sx, g.sy, "files/images/mainmenu/wp-"..self.lastWallpaper..".jpg", 0, 0, 0, tocolor(255, 255, 255, self.lastWallpaperAlpha), false) dxDrawImageSection(0, 0, asx, asy, 0, 0, g.sx, g.sy, "files/images/mainmenu/wp-"..self.firstWallpaper..".jpg", 0, 0, 0, tocolor(255, 255, 255, self.firstWallpaperAlpha), false) else dxDrawRectangle(0, 0, g.sx, g.sy, tocolor(0, 0, 0, 255), false) dxDrawImageSection(0, 0, asx, asy, 0, 0, g.sx, g.sy, "files/images/mainmenu/wp-"..self.firstWallpaper..".jpg", 0, 0, 0, tocolor(255, 255, 255, self.lastWallpaperAlpha), false) dxDrawImageSection(0, 0, asx, asy, 0, 0, g.sx, g.sy, "files/images/mainmenu/wp-"..self.lastWallpaper..".jpg", 0, 0, 0, tocolor(255, 255, 255, self.firstWallpaperAlpha), false) end if(self.changed == true) then if (self.changedstate) then self.firstWallpaperAlpha = self.firstWallpaperAlpha+2; self.lastWallpaperAlpha = self.lastWallpaperAlpha-2; if(self.firstWallpaperAlpha >= 255) or (self.lastWallpaperAlpha <= 0) then self.changed = false; self.firstWallpaperAlpha = 255; self.lastWallpaperAlpha = 0; end else self.firstWallpaperAlpha = self.firstWallpaperAlpha-2; self.lastWallpaperAlpha = self.lastWallpaperAlpha+2; if(self.lastWallpaperAlpha >= 255) or (self.firstWallpaperAlpha <= 0) then self.changed = false; self.firstWallpaperAlpha = 0; self.lastWallpaperAlpha = 255; end end end -- Logo dxDrawImage(1329/g.aesx*g.sx, 12/g.aesy*g.sx, (500/2)/g.aesx*g.sx, (352/2)/g.aesy*g.sy, "files/images/mainmenu/prophunt-"..self.logoID..".png") -- outputChatBox(self.firstWallpaperAlpha..", "..self.lastWallpaperAlpha..", "..self.firstWallpaper..", "..self.lastWallpaper) end -- /////////////////////////////// -- ///// ChangeWallpaper ////// -- ///// Returns: void ////// -- /////////////////////////////// function MainMenu_Wallpaper:ChangeWallpaper() self.firstWallpaper = self.lastWallpaper; self.lastWallpaper = math.random(1, self.maxWallpaper); end -- /////////////////////////////// -- ///// Constructor ////// -- ///// Returns: void ////// -- /////////////////////////////// function MainMenu_Wallpaper:Constructor(...) -- Instanzen self.maxWallpaper = 5; self.firstWallpaper = 1; self.lastWallpaper = 2; self.firstWallpaperAlpha = 0; self.lastWallpaperAlpha = 0; self.startTick = getTickCount(); self.changedstate = false; self.changed = true; self.alpha = 0; self.logoID = math.random(1, 2); -- Funktionen -- Events outputDebugString("[CALLING] MainMenu_Wallpaper: Constructor"); end -- /////////////////////////////// -- ///// Destructor ////// -- ///// Returns: void ////// -- /////////////////////////////// function MainMenu_Wallpaper:Destructor(...) end -- EVENT HANDLER --
gpl-2.0
shkan/telebot7
plugins/add_bot.lua
189
1492
--[[ Bot can join into a group by replying a message contain an invite link or by typing !add [invite link]. URL.parse cannot parsing complicated message. So, this plugin only works for single [invite link] in a post. [invite link] may be preceeded but must not followed by another characters. --]] do local function parsed_url(link) local parsed_link = URL.parse(link) local parsed_path = URL.parse_path(parsed_link.path) i = 0 for k,segment in pairs(parsed_path) do i = i + 1 if segment == 'joinchat' then invite_link = string.gsub(parsed_path[i+1], '[ %c].+$', '') break end end return invite_link end local function action_by_reply(extra, success, result) local hash = parsed_url(result.text) join = import_chat_link(hash, ok_cb, false) end function run(msg, matches) if is_sudo(msg) then if msg.reply_id then msgr = get_message(msg.reply_id, action_by_reply, {msg=msg}) elseif matches[1] then local hash = parsed_url(matches[1]) join = import_chat_link(hash, ok_cb, false) end end end return { description = 'Invite the bot into a group chat via its invite link.', usage = { '!AddBot : Join a group by replying a message containing invite link.', '!AddBot [invite_link] : Join into a group by providing their [invite_link].' }, patterns = { '^[/!](addBot)$', '^[/!](ddBot) (.*)$' }, run = run } end
gpl-2.0
emoon/ProDBG
bin/macosx/tundra/scripts/tundra/nodegen.lua
20
26246
module(..., package.seeall) local unitgen = require "tundra.unitgen" local util = require "tundra.util" local path = require "tundra.path" local depgraph = require "tundra.depgraph" local buildfile = require "tundra.buildfile" local native = require "tundra.native" local ide_backend = nil local current = nil local _nodegen = { } _nodegen.__index = _nodegen local function syntax_error(msg, ...) error { Class = 'syntax error', Message = string.format(msg, ...) } end local function validate_boolean(name, value) if type(value) == "boolean" then return value end syntax_error("%s: expected boolean value, got %q", name, type(value)) end local function validate_string(name, value) if type(value) == "string" then return value end syntax_error("%s: expected string value, got %q", name, type(value)) end local function validate_pass(name, value) if type(value) == "string" then return value else syntax_error("%s: expected pass name, got %q", name, type(value)) end end local function validate_table(name, value) -- A single string can be converted into a table value very easily local t = type(value) if t == "table" then return value elseif t == "string" then return { value } else syntax_error("%s: expected table value, got %q", name, t) end end local function validate_config(name, value) if type(value) == "table" or type(value) == "string" then return value end syntax_error("%s: expected config, got %q", name, type(value)) end local validators = { ["string"] = validate_string, ["pass"] = validate_pass, ["table"] = validate_table, ["filter_table"] = validate_table, ["source_list"] = validate_table, ["boolean"] = validate_boolean, ["config"] = validate_config, } function _nodegen:validate() local decl = self.Decl for name, detail in pairs(assert(self.Blueprint)) do local val = decl[name] if not val then if detail.Required then syntax_error("%s: missing argument: '%s'", self.Keyword, name) end -- ok, optional value else local validator = validators[detail.Type] decl[name] = validator(name, val) end end for name, detail in pairs(decl) do if not self.Blueprint[name] then syntax_error("%s: unsupported argument: '%s'", self.Keyword, name) end end end function _nodegen:customize_env(env, raw_data) -- available for subclasses end function _nodegen:configure_env(env, deps) local build_id = env:get('BUILD_ID') local propagate_blocks = {} local decl = self.Decl for _, dep_obj in util.nil_ipairs(deps) do local data = dep_obj.Decl.Propagate if data then propagate_blocks[#propagate_blocks + 1] = data end end local function push_bindings(env_key, data) if data then for _, item in util.nil_ipairs(flatten_list(build_id, data)) do env:append(env_key, item) end end end local function replace_bindings(env_key, data) if data then local first = true for _, item in util.nil_ipairs(flatten_list(build_id, data)) do if first then env:replace(env_key, item) first = false else env:append(env_key, item) end end end end -- Push Libs, Defines and so in into the environment of this unit. -- These are named for convenience but are aliases for syntax niceness. for decl_key, env_key in util.nil_pairs(self.DeclToEnvMappings) do -- First pick settings from our own unit. push_bindings(env_key, decl[decl_key]) for _, data in ipairs(propagate_blocks) do push_bindings(env_key, data[decl_key]) end end -- Push Env blocks as is for k, v in util.nil_pairs(decl.Env) do push_bindings(k, v) end for k, v in util.nil_pairs(decl.ReplaceEnv) do replace_bindings(k, v) end for _, block in util.nil_ipairs(propagate_blocks) do for k, v in util.nil_pairs(block.Env) do push_bindings(k, v) end for k, v in util.nil_pairs(block.ReplaceEnv) do replace_bindings(k, v) end end end local function resolve_sources(env, items, accum, base_dir) local ignored_exts = util.make_lookup_table(env:get_list("IGNORED_AUTOEXTS", {})) for _, item in util.nil_ipairs(items) do local type_name = type(item) assert(type_name ~= "function") if type_name == "userdata" then accum[#accum + 1] = item elseif type_name == "table" then if depgraph.is_node(item) then accum[#accum + 1] = item elseif getmetatable(item) then accum[#accum + 1] = item:get_dag(env) else resolve_sources(env, item, accum, item.SourceDir or base_dir) end else assert(type_name == "string") local ext = path.get_extension(item) if not ignored_exts[ext] then if not base_dir or path.is_absolute(item) then accum[#accum + 1] = item else local p = path.join(base_dir, item) accum[#accum + 1] = p end end end end return accum end -- Analyze source list, returning list of input files and list of dependencies. -- -- This is so you can pass a mix of actions producing files and regular -- filenames as inputs to the next step in the chain and the output files of -- such nodes will be used automatically. -- -- list - list of source files and nodes that produce source files -- suffixes - acceptable source suffixes to pick up from nodes in source list local function analyze_sources(env, pass, list, suffixes) if not list then return nil end list = util.flatten(list) local deps = {} local function implicit_make(source_file) local t = type(source_file) if t == "table" then return source_file end assert(t == "string") local make = env:get_implicit_make_fn(source_file) if make then return make(env, pass, source_file) else return nil end end local function transform(output, fn) if type(fn) ~= "string" then error(util.tostring(fn) .. " is not a string", 2) end local t = implicit_make(fn) if t then deps[#deps + 1] = t t:insert_output_files(output, suffixes) else output[#output + 1] = fn end end local files = {} for _, src in ipairs(list) do if depgraph.is_node(src) then deps[#deps + 1] = src src:insert_output_files(files, suffixes) elseif type(src) == "table" then error("non-DAG node in source list at this point") else files[#files + 1] = src end end while true do local result = {} local old_dep_count = #deps for _, src in ipairs(files) do transform(result, src) end files = result if #deps == old_dep_count then --print("scan", util.tostring(list), util.tostring(suffixes), util.tostring(result)) return result, deps end end end local function x_identity(self, name, info, value, env, out_deps) return value end local function x_source_list(self, name, info, value, env, out_deps) local build_id = env:get('BUILD_ID') local source_files if build_id then source_files = filter_structure(build_id, value) else source_files = value end local sources = resolve_sources(env, source_files, {}, self.Decl.SourceDir) local source_exts = env:get_list(info.ExtensionKey) local inputs, ideps = analyze_sources(env, resolve_pass(self.Decl.Pass), sources, source_exts) if ideps then util.append_table(out_deps, ideps) end return inputs end local function x_filter_table(self, name, info, value, env, out_deps) local build_id = env:get('BUILD_ID') return flatten_list(build_id, value) end local function find_named_node(name_or_dag) if type(name_or_dag) == "table" then return name_or_dag:get_dag(current.default_env) elseif type(name_or_dag) == "string" then local generator = current.units[name_or_dag] if not generator then errorf("unknown node specified: %q", tostring(name_or_dag)) end return generator:get_dag(current.default_env) else errorf("illegal node specified: %q", tostring(name_or_dag)) end end -- Special resolver for dependencies in a nested (config-filtered) list. local function resolve_dependencies(decl, raw_deps, env) if not raw_deps then return {} end local build_id = env:get('BUILD_ID') local deps = flatten_list(build_id, raw_deps) return util.map_in_place(deps, function (i) if type(i) == "string" then local n = current.units[i] if not n then errorf("%s: Unknown 'Depends' target %q", decl.Name, i) end return n elseif type(i) == "table" and getmetatable(i) and i.Decl then return i else errorf("bad 'Depends' value of type %q", type(i)) end end) end local function x_pass(self, name, info, value, env, out_deps) return resolve_pass(value) end local decl_transformers = { -- the x_identity data types have already been checked at script time through validate_xxx ["string"] = x_identity, ["table"] = x_identity, ["config"] = x_identity, ["boolean"] = x_identity, ["pass"] = x_pass, ["source_list"] = x_source_list, ["filter_table"] = x_filter_table, } -- Create input data for the generator's DAG creation function based on the -- blueprint passed in when the generator was registered. This is done here -- centrally rather than in all the different node generators to reduce code -- duplication and keep the generators miminal. If you need to do something -- special, you can override create_input_data() in your subclass. function _nodegen:create_input_data(env) local decl = self.Decl local data = {} local deps = {} for name, detail in pairs(assert(self.Blueprint)) do local val = decl[name] if val then local xform = decl_transformers[detail.Type] data[name] = xform(self, name, detail, val, env, deps) end end return data, deps end function get_pass(self, name) if not name then return nil end end local pattern_cache = {} local function get_cached_pattern(p) local v = pattern_cache[p] if not v then local comp = '[%w_]+' local sub_pattern = p:gsub('*', '[%%w_]+') local platform, tool, variant, subvariant = unitgen.match_build_id(sub_pattern, comp) v = string.format('^%s%%-%s%%-%s%%-%s$', platform, tool, variant, subvariant) pattern_cache[p] = v end return v end local function config_matches(pattern, build_id) local ptype = type(pattern) if ptype == "nil" then return true elseif ptype == "string" then local fpattern = get_cached_pattern(pattern) return build_id:match(fpattern) elseif ptype == "table" then for _, pattern_item in ipairs(pattern) do if config_matches(pattern_item, build_id) then return true end end return false else error("bad 'Config' pattern type: " .. ptype) end end local function make_unit_env(unit) -- Select an environment for this unit based on its SubConfig tag -- to support cross compilation. local env local subconfig = unit.Decl.SubConfig or current.default_subconfig if subconfig and current.base_envs then env = current.base_envs[subconfig] if Options.VeryVerbose then if env then printf("%s: using subconfig %s (%s)", unit.Decl.Name, subconfig, env:get('BUILD_ID')) else if current.default_subconfig then errorf("%s: couldn't find a subconfig env", unit.Decl.Name) else printf("%s: no subconfig %s found; using default env", unit.Decl.Name, subconfig) end end end end if not env then env = current.default_env end return env:clone() end local anon_count = 1 function _nodegen:get_dag(parent_env) local build_id = parent_env:get('BUILD_ID') local dag = self.DagCache[build_id] if not dag then if build_id:len() > 0 and not config_matches(self.Decl.Config, build_id) then -- Unit has been filtered out via Config attribute. -- Create a fresh dummy node for it. local name if not self.Decl.Name then name = string.format("Dummy node %d", anon_count) else name = string.format("Dummy node %d for %s", anon_count, self.Decl.Name) end anon_count = anon_count + 1 dag = depgraph.make_node { Env = parent_env, Pass = resolve_pass(self.Decl.Pass), Label = name, } else local unit_env = make_unit_env(self) if self.Decl.Name then unit_env:set('UNIT_PREFIX', '__' .. self.Decl.Name) end local function do_it() -- Before accessing the unit's dependencies, resolve them via filtering. local deps = resolve_dependencies(self.Decl, self.Decl.Depends, unit_env) self:configure_env(unit_env, deps) self:customize_env(unit_env, self.Decl, deps) local input_data, input_deps = self:create_input_data(unit_env, parent_env) -- Copy over dependencies which have been pre-resolved input_data.Depends = deps for _, dep in util.nil_ipairs(deps) do input_deps[#input_deps + 1] = dep:get_dag(parent_env) end dag = self:create_dag(unit_env, input_data, input_deps, parent_env) if not dag then error("create_dag didn't generate a result node") end end local success, result = xpcall(do_it, debug.traceback) if not success then croak("Error while generating DAG for unit %s:\n%s", self.Decl.Name or "UNNAMED", util.tostring(result)) end end self.DagCache[build_id] = dag end return dag end local _generator = { Evaluators = {}, } _generator.__index = _generator local function new_generator(s) s = s or {} s.units = {} return setmetatable(s, _generator) end local function create_unit_map(state, raw_nodes) -- Build name=>decl mapping for _, unit in ipairs(raw_nodes) do assert(unit.Decl) local name = unit.Decl.Name if name and type(name) == "string" then if state.units[name] then errorf("duplicate unit name: %s", name) end state.units[name] = unit end end end function _generate_dag(args) local envs = assert(args.Envs) local raw_nodes = assert(args.Declarations) local state = new_generator { base_envs = envs, root_env = envs["__default"], -- the outmost config's env in a cross-compilation scenario config = assert(args.Config), variant = assert(args.Variant), passes = assert(args.Passes), } current = state create_unit_map(state, raw_nodes) local subconfigs = state.config.SubConfigs -- Pick a default environment which is used for -- 1. Nodes without a SubConfig declaration -- 2. Nodes with a missing SubConfig declaration -- 3. All nodes if there are no SubConfigs set for the current config if subconfigs then state.default_subconfig = assert(state.config.DefaultSubConfig) state.default_env = assert(envs[state.default_subconfig], "unknown DefaultSubConfig specified") else state.default_env = assert(envs["__default"]) end local always_lut = util.make_lookup_table(args.AlwaysNodes) local default_lut = util.make_lookup_table(args.DefaultNodes) local always_nodes = util.map(args.AlwaysNodes, find_named_node) local default_nodes = util.map(args.DefaultNodes, find_named_node) local named_nodes = {} for name, _ in pairs(state.units) do named_nodes[name] = find_named_node(name) end current = nil return { always_nodes, default_nodes, named_nodes } end function generate_dag(args) local success, result = xpcall(function () return _generate_dag(args) end, buildfile.syntax_error_catcher) if success then return result[1], result[2], result[3] else croak("%s", result) end end function resolve_pass(name) assert(current) if name then local p = current.passes[name] if not p then syntax_error("%q is not a valid pass name", name) end return p else return nil end end function get_target(data, suffix, prefix) local target = data.Target if not target then assert(data.Name) target = "$(OBJECTDIR)/" .. (prefix or "") .. data.Name .. (suffix or "") end return target end function get_evaluator(name) return _generator.Evaluators[name] end function is_evaluator(name) if _generator.Evaluators[name] then return true else return false end end local common_blueprint = { Propagate = { Help = "Declarations to propagate to dependent units", Type = "filter_table", }, Depends = { Help = "Dependencies for this node", Type = "table", -- handled specially }, Env = { Help = "Data to append to the environment for the unit", Type = "filter_table", }, ReplaceEnv = { Help = "Data to replace in the environment for the unit", Type = "filter_table", }, Pass = { Help = "Specify build pass", Type = "pass", }, SourceDir = { Help = "Specify base directory for source files", Type = "string", }, Config = { Help = "Specify configuration this unit will build in", Type = "config", }, SubConfig = { Help = "Specify sub-configuration this unit will build in", Type = "config", }, __DagNodes = { Help = "Internal node to keep track of DAG nodes generated so far", Type = "table", } } function create_eval_subclass(meta_tbl, base) base = base or _nodegen setmetatable(meta_tbl, base) meta_tbl.__index = meta_tbl return meta_tbl end function add_evaluator(name, meta_tbl, blueprint) assert(type(name) == "string") assert(type(meta_tbl) == "table") assert(type(blueprint) == "table") -- Set up this metatable as a subclass of _nodegen unless it is already -- configured. if not getmetatable(meta_tbl) then setmetatable(meta_tbl, _nodegen) meta_tbl.__index = meta_tbl end -- Install common blueprint items. for name, val in pairs(common_blueprint) do if not blueprint[name] then blueprint[name] = val end end -- Expand environment shortcuts into options. for decl_key, env_key in util.nil_pairs(meta_tbl.DeclToEnvMappings) do blueprint[decl_key] = { Type = "filter_table", Help = "Shortcut for environment key " .. env_key, } end for name, val in pairs(blueprint) do local type_ = assert(val.Type) if not validators[type_] then errorf("unsupported blueprint type %q", type_) end if val.Type == "source_list" and not val.ExtensionKey then errorf("%s: source_list must provide ExtensionKey", name) end end -- Record blueprint for use when validating user constructs. meta_tbl.Keyword = name meta_tbl.Blueprint = blueprint -- Store this evaluator under the keyword that will trigger it. _generator.Evaluators[name] = meta_tbl end -- Called when processing build scripts, keywords is something previously -- registered as an evaluator here. function evaluate(eval_keyword, data) local meta_tbl = assert(_generator.Evaluators[eval_keyword]) -- Give the evaluator change to fix up the data before we validate it. data = meta_tbl:preprocess_data(data) local object = setmetatable({ DagCache = {}, -- maps BUILD_ID -> dag node Decl = data }, meta_tbl) -- Expose the dag cache to the raw input data so the IDE generator can find it later data.__DagNodes = object.DagCache object.__index = object -- Validate data according to Blueprint settings object:validate() return object end -- Given a list of strings or nested lists, flatten the structure to a single -- list of strings while applying configuration filters. Configuration filters -- match against the current build identifier like this: -- -- { "a", "b", { "nixfile1", "nixfile2"; Config = "unix-*-*" }, "bar", { "debugfile"; Config = "*-*-debug" }, } -- -- If 'exclusive' is set, then: -- If 'build_id' is set, only values _with_ a 'Config' filter are included. -- If 'build_id' is nil, only values _without_ a 'Config' filter are included. function flatten_list(build_id, list, exclusive) if not list then return nil end local filter_defined = build_id ~= nil -- Helper function to apply filtering recursively and append results to an -- accumulator table. local function iter(node, accum, filtered) local node_type = type(node) if node_type == "table" and not getmetatable(node) then if node.Config then filtered = true end if not filter_defined or config_matches(node.Config, build_id) then for _, item in ipairs(node) do iter(item, accum, filtered) end end elseif not exclusive or (filtered == filter_defined) then accum[#accum + 1] = node end end local results = {} iter(list, results, false) return results end -- Conceptually similar to flatten_list(), but retains table structure. -- Use to keep source tables as they are passed in, to retain nested SourceDir attributes. local empty_leaf = {} -- constant function filter_structure(build_id, data, exclusive) if type(data) == "table" then if getmetatable(data) then return data -- it's already a DAG node; use as-is end local filtered = data.Config and true or false if not data.Config or config_matches(data.Config, build_id) then local result = {} for k, item in pairs(data) do if type(k) == "number" then -- Filter array elements. result[#result + 1] = filter_structure(build_id, item, filtered) elseif k ~= "Config" then -- Copy key-value data through. result[k] = item end end return result else return empty_leaf end else return data end end -- Processes an "Env" table. For each value, the corresponding variable in -- 'env' is appended to if its "Config" filter matches 'build_id'. If -- 'build_id' is nil, filtered values are skipped. function append_filtered_env_vars(env, values_to_append, build_id, exclusive) for key, val in util.pairs(values_to_append) do if type(val) == "table" then local list = flatten_list(build_id, val, exclusive) for _, subvalue in ipairs(list) do env:append(key, subvalue) end elseif not (exclusive and build_id) then env:append(key, val) end end end -- Like append_filtered_env_vars(), but replaces existing variables instead -- of appending to them. function replace_filtered_env_vars(env, values_to_replace, build_id, exclusive) for key, val in util.pairs(values_to_replace) do if type(val) == "table" then local list = flatten_list(build_id, val, exclusive) if #list > 0 then env:replace(key, list) end elseif not (exclusive and build_id) then env:replace(key, val) end end end function generate_ide_files(config_tuples, default_names, raw_nodes, env, hints, ide_script) local state = new_generator { default_env = env } assert(state.default_env) create_unit_map(state, raw_nodes) local backend_fn = assert(ide_backend) backend_fn(state, config_tuples, raw_nodes, env, default_names, hints, ide_script) end function set_ide_backend(backend_fn) ide_backend = backend_fn end -- Expose the DefRule helper which is used to register builder syntax in a -- simplified way. function _G.DefRule(ruledef) local name = assert(ruledef.Name, "Missing Name string in DefRule") local setup_fn = assert(ruledef.Setup, "Missing Setup function in DefRule " .. name) local cmd = assert(ruledef.Command, "Missing Command string in DefRule " .. name) local blueprint = assert(ruledef.Blueprint, "Missing Blueprint in DefRule " .. name) local mt = create_eval_subclass {} local annot = ruledef.Annotation if not annot then annot = name .. " $(<)" end local preproc = ruledef.Preprocess local function verify_table(v, tag) if not v then errorf("No %s returned from DefRule %s", tag, name) end if type(v) ~= "table" then errorf("%s returned from DefRule %s is not a table", tag, name) end end local function make_node(input_files, output_files, env, data, deps, scanner, action) return depgraph.make_node { Env = env, Label = annot, Action = action, Pass = data.Pass or resolve_pass(ruledef.Pass), InputFiles = input_files, OutputFiles = output_files, ImplicitInputs = ruledef.ImplicitInputs, Scanner = scanner, Dependencies = deps, } end if ruledef.ConfigInvariant then local cache = {} function mt:create_dag(env, data, deps) local setup_data = setup_fn(env, data) local input_files = setup_data.InputFiles local output_files = setup_data.OutputFiles verify_table(input_files, "InputFiles") verify_table(output_files, "OutputFiles") local mashup = { } for _, input in util.nil_ipairs(input_files) do mashup[#mashup + 1] = input end mashup[#mashup + 1] = "@@" for _, output in util.nil_ipairs(output_files) do mashup[#mashup + 1] = output end mashup[#mashup + 1] = "@@" for _, implicit_input in util.nil_ipairs(setup_data.ImplicitInputs) do mashup[#mashup + 1] = implicit_input end local key = native.digest_guid(table.concat(mashup, ';')) local key = util.tostring(key) if cache[key] then return cache[key] else local node = make_node(input_files, output_files, env, data, deps, setup_data.Scanner, setup_data.Command or cmd) cache[key] = node return node end end else function mt:create_dag(env, data, deps) local setup_data = setup_fn(env, data) verify_table(setup_data.InputFiles, "InputFiles") verify_table(setup_data.OutputFiles, "OutputFiles") return make_node(setup_data.InputFiles, setup_data.OutputFiles, env, data, deps, setup_data.Scanner, setup_data.Command or cmd) end end if preproc then function mt:preprocess_data(raw_data) return preproc(raw_data) end end add_evaluator(name, mt, blueprint) end function _nodegen:preprocess_data(data) return data end
mit
RuiChen1113/luci
libs/luci-lib-nixio/axTLS/www/lua/download.lua
180
1550
#!/usr/local/bin/lua require"luasocket" function receive (connection) connection:settimeout(0) local s, status = connection:receive (2^10) if status == "timeout" then coroutine.yield (connection) end return s, status end function download (host, file, outfile) --local f = assert (io.open (outfile, "w")) local c = assert (socket.connect (host, 80)) c:send ("GET "..file.." HTTP/1.0\r\n\r\n") while true do local s, status = receive (c) --f:write (s) if status == "closed" then break end end c:close() --f:close() end local threads = {} function get (host, file, outfile) print (string.format ("Downloading %s from %s to %s", file, host, outfile)) local co = coroutine.create (function () return download (host, file, outfile) end) table.insert (threads, co) end function dispatcher () while true do local n = table.getn (threads) if n == 0 then break end local connections = {} for i = 1, n do local status, res = coroutine.resume (threads[i]) if not res then table.remove (threads, i) break else table.insert (connections, res) end end if table.getn (connections) == n then socket.select (connections) end end end local url = arg[1] if not url then print (string.format ("usage: %s url [times]", arg[0])) os.exit() end local times = arg[2] or 5 url = string.gsub (url, "^http.?://", "") local _, _, host, file = string.find (url, "^([^/]+)(/.*)") local _, _, fn = string.find (file, "([^/]+)$") for i = 1, times do get (host, file, fn..i) end dispatcher ()
apache-2.0
wsy495/sipml5
asterisk/etc/extensions.lua
317
5827
CONSOLE = "Console/dsp" -- Console interface for demo --CONSOLE = "DAHDI/1" --CONSOLE = "Phone/phone0" IAXINFO = "guest" -- IAXtel username/password --IAXINFO = "myuser:mypass" TRUNK = "DAHDI/G2" TRUNKMSD = 1 -- TRUNK = "IAX2/user:pass@provider" -- -- Extensions are expected to be defined in a global table named 'extensions'. -- The 'extensions' table should have a group of tables in it, each -- representing a context. Extensions are defined in each context. See below -- for examples. -- -- Extension names may be numbers, letters, or combinations thereof. If -- an extension name is prefixed by a '_' character, it is interpreted as -- a pattern rather than a literal. In patterns, some characters have -- special meanings: -- -- X - any digit from 0-9 -- Z - any digit from 1-9 -- N - any digit from 2-9 -- [1235-9] - any digit in the brackets (in this example, 1,2,3,5,6,7,8,9) -- . - wildcard, matches anything remaining (e.g. _9011. matches -- anything starting with 9011 excluding 9011 itself) -- ! - wildcard, causes the matching process to complete as soon as -- it can unambiguously determine that no other matches are possible -- -- For example the extension _NXXXXXX would match normal 7 digit -- dialings, while _1NXXNXXXXXX would represent an area code plus phone -- number preceded by a one. -- -- If your extension has special characters in it such as '.' and '!' you must -- explicitly make it a string in the tabale definition: -- -- ["_special."] = function; -- ["_special!"] = function; -- -- There are no priorities. All extensions to asterisk appear to have a single -- priority as if they consist of a single priority. -- -- Each context is defined as a table in the extensions table. The -- context names should be strings. -- -- One context may be included in another context using the 'includes' -- extension. This extension should be set to a table containing a list -- of context names. Do not put references to tables in the includes -- table. -- -- include = {"a", "b", "c"}; -- -- Channel variables can be accessed thorugh the global 'channel' table. -- -- v = channel.var_name -- v = channel["var_name"] -- v.value -- v:get() -- -- channel.var_name = "value" -- channel["var_name"] = "value" -- v:set("value") -- -- channel.func_name(1,2,3):set("value") -- value = channel.func_name(1,2,3):get() -- -- channel["func_name(1,2,3)"]:set("value") -- channel["func_name(1,2,3)"] = "value" -- value = channel["func_name(1,2,3)"]:get() -- -- Note the use of the ':' operator to access the get() and set() -- methods. -- -- Also notice the absence of the following constructs from the examples above: -- channel.func_name(1,2,3) = "value" -- this will NOT work -- value = channel.func_name(1,2,3) -- this will NOT work as expected -- -- -- Dialplan applications can be accessed through the global 'app' table. -- -- app.Dial("DAHDI/1") -- app.dial("DAHDI/1") -- -- More examples can be found below. -- -- An autoservice is automatically run while lua code is executing. The -- autoservice can be stopped and restarted using the autoservice_stop() and -- autoservice_start() functions. The autservice should be running before -- starting long running operations. The autoservice will automatically be -- stopped before executing applications and dialplan functions and will be -- restarted afterwards. The autoservice_status() function can be used to -- check the current status of the autoservice and will return true if an -- autoservice is currently running. -- function outgoing_local(c, e) app.dial("DAHDI/1/" .. e, "", "") end function demo_instruct() app.background("demo-instruct") app.waitexten() end function demo_congrats() app.background("demo-congrats") demo_instruct() end -- Answer the chanel and play the demo sound files function demo_start(context, exten) app.wait(1) app.answer() channel.TIMEOUT("digit"):set(5) channel.TIMEOUT("response"):set(10) -- app.set("TIMEOUT(digit)=5") -- app.set("TIMEOUT(response)=10") demo_congrats(context, exten) end function demo_hangup() app.playback("demo-thanks") app.hangup() end extensions = { demo = { s = demo_start; ["2"] = function() app.background("demo-moreinfo") demo_instruct() end; ["3"] = function () channel.LANGUAGE():set("fr") -- set the language to french demo_congrats() end; ["1000"] = function() app.goto("demo", "s", 1) end; ["1234"] = function() app.playback("transfer", "skip") -- do a dial here end; ["1235"] = function() app.voicemail("1234", "u") end; ["1236"] = function() app.dial("Console/dsp") app.voicemail(1234, "b") end; ["#"] = demo_hangup; t = demo_hangup; i = function() app.playback("invalid") demo_instruct() end; ["500"] = function() app.playback("demo-abouttotry") app.dial("IAX2/guest@misery.digium.com/s@default") app.playback("demo-nogo") demo_instruct() end; ["600"] = function() app.playback("demo-echotest") app.echo() app.playback("demo-echodone") demo_instruct() end; ["8500"] = function() app.voicemailmain() demo_instruct() end; }; default = { -- by default, do the demo include = {"demo"}; }; public = { -- ATTENTION: If your Asterisk is connected to the internet and you do -- not have allowguest=no in sip.conf, everybody out there may use your -- public context without authentication. In that case you want to -- double check which services you offer to the world. -- include = {"demo"}; }; ["local"] = { ["_NXXXXXX"] = outgoing_local; }; } hints = { demo = { [1000] = "SIP/1000"; [1001] = "SIP/1001"; }; default = { ["1234"] = "SIP/1234"; }; }
bsd-3-clause
jgibbon/sipml5
asterisk/etc/extensions.lua
317
5827
CONSOLE = "Console/dsp" -- Console interface for demo --CONSOLE = "DAHDI/1" --CONSOLE = "Phone/phone0" IAXINFO = "guest" -- IAXtel username/password --IAXINFO = "myuser:mypass" TRUNK = "DAHDI/G2" TRUNKMSD = 1 -- TRUNK = "IAX2/user:pass@provider" -- -- Extensions are expected to be defined in a global table named 'extensions'. -- The 'extensions' table should have a group of tables in it, each -- representing a context. Extensions are defined in each context. See below -- for examples. -- -- Extension names may be numbers, letters, or combinations thereof. If -- an extension name is prefixed by a '_' character, it is interpreted as -- a pattern rather than a literal. In patterns, some characters have -- special meanings: -- -- X - any digit from 0-9 -- Z - any digit from 1-9 -- N - any digit from 2-9 -- [1235-9] - any digit in the brackets (in this example, 1,2,3,5,6,7,8,9) -- . - wildcard, matches anything remaining (e.g. _9011. matches -- anything starting with 9011 excluding 9011 itself) -- ! - wildcard, causes the matching process to complete as soon as -- it can unambiguously determine that no other matches are possible -- -- For example the extension _NXXXXXX would match normal 7 digit -- dialings, while _1NXXNXXXXXX would represent an area code plus phone -- number preceded by a one. -- -- If your extension has special characters in it such as '.' and '!' you must -- explicitly make it a string in the tabale definition: -- -- ["_special."] = function; -- ["_special!"] = function; -- -- There are no priorities. All extensions to asterisk appear to have a single -- priority as if they consist of a single priority. -- -- Each context is defined as a table in the extensions table. The -- context names should be strings. -- -- One context may be included in another context using the 'includes' -- extension. This extension should be set to a table containing a list -- of context names. Do not put references to tables in the includes -- table. -- -- include = {"a", "b", "c"}; -- -- Channel variables can be accessed thorugh the global 'channel' table. -- -- v = channel.var_name -- v = channel["var_name"] -- v.value -- v:get() -- -- channel.var_name = "value" -- channel["var_name"] = "value" -- v:set("value") -- -- channel.func_name(1,2,3):set("value") -- value = channel.func_name(1,2,3):get() -- -- channel["func_name(1,2,3)"]:set("value") -- channel["func_name(1,2,3)"] = "value" -- value = channel["func_name(1,2,3)"]:get() -- -- Note the use of the ':' operator to access the get() and set() -- methods. -- -- Also notice the absence of the following constructs from the examples above: -- channel.func_name(1,2,3) = "value" -- this will NOT work -- value = channel.func_name(1,2,3) -- this will NOT work as expected -- -- -- Dialplan applications can be accessed through the global 'app' table. -- -- app.Dial("DAHDI/1") -- app.dial("DAHDI/1") -- -- More examples can be found below. -- -- An autoservice is automatically run while lua code is executing. The -- autoservice can be stopped and restarted using the autoservice_stop() and -- autoservice_start() functions. The autservice should be running before -- starting long running operations. The autoservice will automatically be -- stopped before executing applications and dialplan functions and will be -- restarted afterwards. The autoservice_status() function can be used to -- check the current status of the autoservice and will return true if an -- autoservice is currently running. -- function outgoing_local(c, e) app.dial("DAHDI/1/" .. e, "", "") end function demo_instruct() app.background("demo-instruct") app.waitexten() end function demo_congrats() app.background("demo-congrats") demo_instruct() end -- Answer the chanel and play the demo sound files function demo_start(context, exten) app.wait(1) app.answer() channel.TIMEOUT("digit"):set(5) channel.TIMEOUT("response"):set(10) -- app.set("TIMEOUT(digit)=5") -- app.set("TIMEOUT(response)=10") demo_congrats(context, exten) end function demo_hangup() app.playback("demo-thanks") app.hangup() end extensions = { demo = { s = demo_start; ["2"] = function() app.background("demo-moreinfo") demo_instruct() end; ["3"] = function () channel.LANGUAGE():set("fr") -- set the language to french demo_congrats() end; ["1000"] = function() app.goto("demo", "s", 1) end; ["1234"] = function() app.playback("transfer", "skip") -- do a dial here end; ["1235"] = function() app.voicemail("1234", "u") end; ["1236"] = function() app.dial("Console/dsp") app.voicemail(1234, "b") end; ["#"] = demo_hangup; t = demo_hangup; i = function() app.playback("invalid") demo_instruct() end; ["500"] = function() app.playback("demo-abouttotry") app.dial("IAX2/guest@misery.digium.com/s@default") app.playback("demo-nogo") demo_instruct() end; ["600"] = function() app.playback("demo-echotest") app.echo() app.playback("demo-echodone") demo_instruct() end; ["8500"] = function() app.voicemailmain() demo_instruct() end; }; default = { -- by default, do the demo include = {"demo"}; }; public = { -- ATTENTION: If your Asterisk is connected to the internet and you do -- not have allowguest=no in sip.conf, everybody out there may use your -- public context without authentication. In that case you want to -- double check which services you offer to the world. -- include = {"demo"}; }; ["local"] = { ["_NXXXXXX"] = outgoing_local; }; } hints = { demo = { [1000] = "SIP/1000"; [1001] = "SIP/1001"; }; default = { ["1234"] = "SIP/1234"; }; }
bsd-3-clause
Teraku/Skill-Overhaul
SkillOverhaul/lua/units/sentrygunbrain.lua
1
1494
--Thanks to LazyOzzy from UnknownCheats for the code. --Sentries no longer target shields. local _select_focus_attention_original = SentryGunBrain._select_focus_attention local _upd_fire_original = SentryGunBrain._upd_fire function SentryGunBrain:_select_focus_attention(...) local is_criminal = self._unit:movement():team().id == "criminal1" local all_targets = self._detected_attention_objects if is_criminal then local valid_targets = {} local obstructed_targets = {} all_targets = {} for key, data in pairs(self._detected_attention_objects) do all_targets[key] = data if self._unit:weapon():check_lof(data.unit, data.handler:get_attention_m_pos()) then valid_targets[key] = data else obstructed_targets[key] = data end end if next(valid_targets) ~= nil then self._fire_at_will = true self._detected_attention_objects = valid_targets else self._fire_at_will = false self._detected_attention_objects = obstructed_targets end end _select_focus_attention_original(self, ...) self._detected_attention_objects = all_targets end function SentryGunBrain:_upd_fire(...) if self._fire_at_will or self._fire_at_will == nil then _upd_fire_original(self, ...) elseif self._firing then self._unit:weapon():stop_autofire() self._firing = false end end
gpl-2.0
dan9550/OpenRA
mods/cnc/maps/nod06b/nod06b.lua
12
6915
NodUnitsVehicle1 = { 'bggy', 'bggy', 'bike', 'bike', 'bike' } NodUnitsVehicle2 = { 'ltnk', 'ltnk', 'ltnk' } NodUnitsGunner = { 'e1', 'e1', 'e1', 'e1', 'e1', 'e1' } NodUnitsRocket = { 'e3', 'e3', 'e3', 'e3', 'e3', 'e3' } Gdi1Units = { 'e1', 'e1', 'e2', 'e2', 'e2' } HuntCellTriggerActivator = { CPos.New(61,34), CPos.New(60,34), CPos.New(59,34), CPos.New(58,34), CPos.New(57,34), CPos.New(56,34), CPos.New(55,34), CPos.New(61,33), CPos.New(60,33), CPos.New(59,33), CPos.New(58,33), CPos.New(57,33), CPos.New(56,33) } DzneCellTriggerActivator = { CPos.New(50,30), CPos.New(49,30), CPos.New(48,30), CPos.New(47,30), CPos.New(46,30), CPos.New(45,30), CPos.New(50,29), CPos.New(49,29), CPos.New(48,29), CPos.New(47,29), CPos.New(46,29), CPos.New(45,29), CPos.New(50,28), CPos.New(49,28), CPos.New(48,28), CPos.New(47,28), CPos.New(46,28), CPos.New(45,28), CPos.New(50,27), CPos.New(49,27), CPos.New(46,27), CPos.New(45,27), CPos.New(50,26), CPos.New(49,26), CPos.New(48,26), CPos.New(47,26), CPos.New(46,26), CPos.New(45,26), CPos.New(50,25), CPos.New(49,25), CPos.New(48,25), CPos.New(47,25), CPos.New(46,25), CPos.New(45,25) } Win1CellTriggerActivator = { CPos.New(47,27) } Win2CellTriggerActivator = { CPos.New(57,57), CPos.New(56,57), CPos.New(55,57), CPos.New(57,56), CPos.New(56,56), CPos.New(55,56), CPos.New(57,55), CPos.New(56,55), CPos.New(55,55), CPos.New(57,54), CPos.New(56,54), CPos.New(55,54), CPos.New(57,53), CPos.New(56,53), CPos.New(55,53), CPos.New(57,52), CPos.New(56,52), CPos.New(55,52) } ChnCellTriggerActivator = { CPos.New(61,52), CPos.New(60,52), CPos.New(59,52), CPos.New(58,52), CPos.New(61,51), CPos.New(60,51), CPos.New(59,51), CPos.New(58,51), CPos.New(61,50), CPos.New(60,50), CPos.New(59,50), CPos.New(58,50) } Chn1ActorTriggerActivator = { Chn1Actor1, Chn1Actor2 } Chn2ActorTriggerActivator = { Chn2Actor1 } Atk1ActorTriggerActivator = { Atk1Actor1, Atk1Actor2 } Atk2ActorTriggerActivator = { Atk2Actor1, Atk2Actor2 } Chn1Waypoints = { ChnEntry.Location, waypoint0.Location } Chn2Waypoints = { ChnEntry.Location, waypoint0.Location } Gdi5Waypoint = { waypoint1, waypoint2, waypoint3, waypoint4, waypoint5, waypoint6, waypoint7 } HuntTriggerFunction = function() local list = GDI.GetGroundAttackers() Utils.Do(list, function(unit) IdleHunt(unit) end) end Win1TriggerFunction = function() NodObjective2 = Nod.AddPrimaryObjective("Move to the evacuation point.") Nod.MarkCompletedObjective(NodObjective1) end Chn1TriggerFunction = function() if not Chn1Switch then local cargo = Reinforcements.ReinforceWithTransport(GDI, 'tran', Gdi1Units, Chn1Waypoints, { ChnEntry.Location })[2] Utils.Do(cargo, function(actor) IdleHunt(actor) end) Chn1Switch = true end end Atk1TriggerFunction = function() if not Atk1Switch then for type, count in pairs({ ['e2'] = 2, ['jeep'] = 1, ['e1'] = 2}) do MyActors = Utils.Take(count, GDI.GetActorsByType(type)) Utils.Do(MyActors, function(actor) IdleHunt(actor) end) end Atk1Switch = true end end Atk2TriggerFunction = function() if not Atk2Switch then for type, count in pairs({ ['e2'] = 2, ['e1'] = 2}) do MyActors = Utils.Take(count, GDI.GetActorsByType(type)) Utils.Do(MyActors, function(actor) MoveAndHunt(actor, Gdi5Waypoint) end) end Atk2Switch = true end end Chn2TriggerFunction = function() if not Chn2Switch then local cargo = Reinforcements.ReinforceWithTransport(GDI, 'tran', Gdi1Units, Chn2Waypoints, { ChnEntry.Location })[2] Utils.Do(cargo, function(actor) IdleHunt(actor) end) Chn2Switch = true end end MoveAndHunt = function(unit, waypoints) if unit ~= nil then Utils.Do(waypoints, function(waypoint) unit.AttackMove(waypoint.Location) end) IdleHunt(unit) end end InsertNodUnits = function() Media.PlaySpeechNotification(Nod, "Reinforce") Camera.Position = UnitsRallyVehicle2.CenterPosition Reinforcements.Reinforce(Nod, NodUnitsVehicle1, { UnitsEntryVehicle.Location, UnitsRallyVehicle1.Location }, 10) Reinforcements.Reinforce(Nod, NodUnitsVehicle2, { UnitsEntryVehicle.Location, UnitsRallyVehicle2.Location }, 15) Reinforcements.Reinforce(Nod, NodUnitsGunner, { UnitsEntryGunner.Location, UnitsRallyGunner.Location }, 15) Reinforcements.Reinforce(Nod, NodUnitsRocket, { UnitsEntryRocket.Location, UnitsRallyRocket.Location }, 25) end WorldLoaded = function() GDI = Player.GetPlayer("GDI") Nod = Player.GetPlayer("Nod") Trigger.OnObjectiveAdded(Nod, function(p, id) Media.DisplayMessage(p.GetObjectiveDescription(id), "New " .. string.lower(p.GetObjectiveType(id)) .. " objective") end) Trigger.OnObjectiveCompleted(Nod, function(p, id) Media.DisplayMessage(p.GetObjectiveDescription(id), "Objective completed") end) Trigger.OnObjectiveFailed(Nod, function(p, id) Media.DisplayMessage(p.GetObjectiveDescription(id), "Objective failed") end) Trigger.OnPlayerWon(Nod, function() Media.PlaySpeechNotification(Nod, "Win") end) Trigger.OnPlayerLost(Nod, function() Media.PlaySpeechNotification(Nod, "Lose") end) NodObjective1 = Nod.AddPrimaryObjective("Steal the GDI nuclear detonator.") GDIObjective = GDI.AddPrimaryObjective("Stop the Nod taskforce from escaping with the detonator.") InsertNodUnits() Trigger.OnEnteredFootprint(HuntCellTriggerActivator, function(a, id) if a.Owner == Nod then HuntTriggerFunction() Trigger.RemoveFootprintTrigger(id) end end) Trigger.OnEnteredFootprint(DzneCellTriggerActivator, function(a, id) if a.Owner == Nod then Actor.Create('flare', true, { Owner = Nod, Location = waypoint17.Location }) Trigger.RemoveFootprintTrigger(id) end end) Trigger.OnEnteredFootprint(Win1CellTriggerActivator, function(a, id) if a.Owner == Nod then Win1TriggerFunction() Trigger.RemoveFootprintTrigger(id) end end) Trigger.OnEnteredFootprint(Win2CellTriggerActivator, function(a, id) if a.Owner == Nod and NodObjective2 then Nod.MarkCompletedObjective(NodObjective2) Trigger.RemoveFootprintTrigger(id) end end) OnAnyDamaged(Chn1ActorTriggerActivator, Chn1TriggerFunction) OnAnyDamaged(Atk1ActorTriggerActivator, Atk1TriggerFunction) OnAnyDamaged(Atk2ActorTriggerActivator, Atk2TriggerFunction) OnAnyDamaged(Chn2ActorTriggerActivator, Chn2TriggerFunction) Trigger.OnEnteredFootprint(ChnCellTriggerActivator, function(a, id) if a.Owner == Nod then Media.PlaySpeechNotification(Nod, "Reinforce") Reinforcements.ReinforceWithTransport(Nod, 'tran', nil, { ChnEntry.Location, waypoint17.Location }, nil, nil, nil) Trigger.RemoveFootprintTrigger(id) end end) end Tick = function() if Nod.HasNoRequiredUnits() then if DateTime.GameTime > 2 then GDI.MarkCompletedObjective(GDIObjective) end end end IdleHunt = function(unit) if not unit.IsDead then Trigger.OnIdle(unit, unit.Hunt) end end OnAnyDamaged = function(actors, func) Utils.Do(actors, function(actor) Trigger.OnDamaged(actor, func) end) end
gpl-3.0
bocaaust/SoundView
Libs/RuntimeResources.bundle/socket.lua
6
4446
----------------------------------------------------------------------------- -- LuaSocket helper module -- Author: Diego Nehab ----------------------------------------------------------------------------- ----------------------------------------------------------------------------- -- Declare module and import dependencies ----------------------------------------------------------------------------- local base = _G local string = require("string") local math = require("math") local socket = require("socket") local _M = socket ----------------------------------------------------------------------------- -- Exported auxiliar functions ----------------------------------------------------------------------------- function _M.connect4(address, port, laddress, lport) return socket.connect(address, port, laddress, lport, "inet") end function _M.connect6(address, port, laddress, lport) return socket.connect(address, port, laddress, lport, "inet6") end function _M.bind(host, port, backlog) if host == "*" then host = "0.0.0.0" end local addrinfo, err = socket.dns.getaddrinfo(host); if not addrinfo then return nil, err end local sock, res err = "no info on address" for i, alt in base.ipairs(addrinfo) do if alt.family == "inet" then sock, err = socket.tcp() else sock, err = socket.tcp6() end if not sock then return nil, err end sock:setoption("reuseaddr", true) res, err = sock:bind(alt.addr, port) if not res then sock:close() else res, err = sock:listen(backlog) if not res then sock:close() else return sock end end end return nil, err end _M.try = _M.newtry() function _M.choose(table) return function(name, opt1, opt2) if base.type(name) ~= "string" then name, opt1, opt2 = "default", name, opt1 end local f = table[name or "nil"] if not f then base.error("unknown key (".. base.tostring(name) ..")", 3) else return f(opt1, opt2) end end end ----------------------------------------------------------------------------- -- Socket sources and sinks, conforming to LTN12 ----------------------------------------------------------------------------- -- create namespaces inside LuaSocket namespace local sourcet, sinkt = {}, {} _M.sourcet = sourcet _M.sinkt = sinkt _M.BLOCKSIZE = 2048 sinkt["close-when-done"] = function(sock) return base.setmetatable({ getfd = function() return sock:getfd() end, dirty = function() return sock:dirty() end }, { __call = function(self, chunk, err) if not chunk then sock:close() return 1 else return sock:send(chunk) end end }) end sinkt["keep-open"] = function(sock) return base.setmetatable({ getfd = function() return sock:getfd() end, dirty = function() return sock:dirty() end }, { __call = function(self, chunk, err) if chunk then return sock:send(chunk) else return 1 end end }) end sinkt["default"] = sinkt["keep-open"] _M.sink = _M.choose(sinkt) sourcet["by-length"] = function(sock, length) return base.setmetatable({ getfd = function() return sock:getfd() end, dirty = function() return sock:dirty() end }, { __call = function() if length <= 0 then return nil end local size = math.min(socket.BLOCKSIZE, length) local chunk, err = sock:receive(size) if err then return nil, err end length = length - string.len(chunk) return chunk end }) end sourcet["until-closed"] = function(sock) local done return base.setmetatable({ getfd = function() return sock:getfd() end, dirty = function() return sock:dirty() end }, { __call = function() if done then return nil end local chunk, err, partial = sock:receive(socket.BLOCKSIZE) if not err then return chunk elseif err == "closed" then sock:close() done = 1 return partial else return nil, err end end }) end sourcet["default"] = sourcet["until-closed"] _M.source = _M.choose(sourcet) return _M
apache-2.0
mahdib9/mb
plugins/bot_manager.lua
89
6427
local function set_bot_photo(msg, success, result) local receiver = get_receiver(msg) if success then local file = 'data/photos/bot.jpg' print('File downloaded to:', result) os.rename(result, file) print('File moved to:', file) set_profile_photo(file, ok_cb, false) send_large_msg(receiver, 'عکس پروفایل ربات تغییر کرد', ok_cb, false) redis:del("bot:photo") else print('Error downloading: '..msg.id) send_large_msg(receiver, 'Failed, please try again!', ok_cb, false) end end local function parsed_url(link) local parsed_link = URL.parse(link) local parsed_path = URL.parse_path(parsed_link.path) return parsed_path[2] end local function get_contact_list_callback (cb_extra, success, result) local text = " " for k,v in pairs(result) do if v.print_name and v.id and v.phone then text = text..string.gsub(v.print_name , "_" , " ").." ["..v.id.."] = "..v.phone.."\n" end end local file = io.open("contact_list.txt", "w") file:write(text) file:flush() file:close() send_document("user#id"..cb_extra.target,"contact_list.txt", ok_cb, false)--.txt format local file = io.open("contact_list.json", "w") file:write(json:encode_pretty(result)) file:flush() file:close() send_document("user#id"..cb_extra.target,"contact_list.json", ok_cb, false)--json format end local function user_info_callback(cb_extra, success, result) result.access_hash = nil result.flags = nil result.phone = nil if result.username then result.username = '@'..result.username end result.print_name = result.print_name:gsub("_","") local text = serpent.block(result, {comment=false}) text = text:gsub("[{}]", "") text = text:gsub('"', "") text = text:gsub(",","") if cb_extra.msg.to.type == "chat" then send_large_msg("chat#id"..cb_extra.msg.to.id, text) else send_large_msg("user#id"..cb_extra.msg.to.id, text) end end local function get_dialog_list_callback(cb_extra, success, result) local text = "" for k,v in pairs(result) do if v.peer then if v.peer.type == "chat" then text = text.."group{"..v.peer.title.."}["..v.peer.id.."]("..v.peer.members_num..")" else if v.peer.print_name and v.peer.id then text = text.."user{"..v.peer.print_name.."}["..v.peer.id.."]" end if v.peer.username then text = text.."("..v.peer.username..")" end if v.peer.phone then text = text.."'"..v.peer.phone.."'" end end end if v.message then text = text..'\nlast msg >\nmsg id = '..v.message.id if v.message.text then text = text .. "\n text = "..v.message.text end if v.message.action then text = text.."\n"..serpent.block(v.message.action, {comment=false}) end if v.message.from then if v.message.from.print_name then text = text.."\n From > \n"..string.gsub(v.message.from.print_name, "_"," ").."["..v.message.from.id.."]" end if v.message.from.username then text = text.."( "..v.message.from.username.." )" end if v.message.from.phone then text = text.."' "..v.message.from.phone.." '" end end end text = text.."\n\n" end local file = io.open("dialog_list.txt", "w") file:write(text) file:flush() file:close() send_document("user#id"..cb_extra.target,"dialog_list.txt", ok_cb, false)--.txt format local file = io.open("dialog_list.json", "w") file:write(json:encode_pretty(result)) file:flush() file:close() send_document("user#id"..cb_extra.target,"dialog_list.json", ok_cb, false)--json format end local function run(msg,matches) local data = load_data(_config.moderation.data) local receiver = get_receiver(msg) local group = msg.to.id if not is_admin(msg) then return end if msg.media then if msg.media.type == 'photo' and redis:get("bot:photo") then if redis:get("bot:photo") == 'waiting' then load_photo(msg.id, set_bot_photo, msg) end end end if matches[1] == "setbotphoto" then redis:set("bot:photo", "waiting") return 'عکس رباتو بفرست بیاد' end if matches[1] == "markread" then if matches[2] == "on" then redis:set("bot:markread", "on") return "Mark read > on" end if matches[2] == "off" then redis:del("bot:markread") return "Mark read > off" end return end if matches[1] == "pm" then send_large_msg("user#id"..matches[2],matches[3]) return "پیام شما از طریق پیوی ربات ارسال شد" end if matches[1] == "block" then if is_admin2(matches[2]) then return "شما نمیتوانید ادمین را بلاک کنید" end block_user("user#id"..matches[2],ok_cb,false) return "یوزر مورد نظر از ربات بلاک شد" end if matches[1] == "unblock" then unblock_user("user#id"..matches[2],ok_cb,false) return "یوزر انبلاک شد" end if matches[1] == "import" then--join by group link local hash = parsed_url(matches[2]) import_chat_link(hash,ok_cb,false) end if matches[1] == "contactlist" then get_contact_list(get_contact_list_callback, {target = msg.from.id}) return "I've sent contact list with both json and text format to your private" end if matches[1] == "delcontact" then del_contact("user#id"..matches[2],ok_cb,false) return "User "..matches[2].." removed from contact list" end if matches[1] == "dialoglist" then get_dialog_list(get_dialog_list_callback, {target = msg.from.id}) return "I've sent dialog list with both json and text format to your private" end if matches[1] == "whois" then user_info("user#id"..matches[2],user_info_callback,{msg=msg}) end return end return { patterns = { "^[!/](pm) (%d+) (.*)$", "^[!/](import) (.*)$", "^[!/](unblock) (%d+)$", "^[!/](block) (%d+)$", "^[!/](markread) (on)$", "^[!/](markread) (off)$", "^[!/](setbotphoto)$", "%[(photo)%]", "^[!/](contactlist)$", "^[!/](dialoglist)$", "^[!/](delcontact) (%d+)$", "^[!/](whois) (%d+)$" }, run = run, } --Copyright and edit; @behroozyaghi --Persian Translate; @behroozyaghi --ch : @nod32team --کپی بدون ذکر منبع حرام است
gpl-2.0
Habbie/hammerspoon
extensions/uielement/init.lua
2
6427
--- === hs.uielement === --- --- A generalized framework for working with OSX UI elements local uielement = require("hs.uielement.internal") uielement.watcher = require("hs.uielement.watcher") local fnutils = require "hs.fnutils" local appWatcher = require "hs.application.watcher" local USERDATA_TAG = "hs.uielement" local objectMT = hs.getObjectMetatable(USERDATA_TAG) local watcherMT = hs.getObjectMetatable("hs.uielement.watcher") --- hs.uielement:isApplication() -> bool --- Method --- Returns whether the UI element represents an application. --- --- Parameters: --- * None --- --- Returns: --- * A boolean, true if the UI element is an application function objectMT.isApplication(self) return self:role() == "AXApplication" end --- === hs.uielement.watcher === --- --- Watch for events on certain UI elements (including windows and applications) --- --- You can watch the following events: --- ### Application-level events --- See hs.application.watcher for more events you can watch. --- * hs.uielement.watcher.applicationActivated: The current application switched to this one. --- * hs.uielement.watcher.applicationDeactivated: The current application is no longer this one. --- * hs.uielement.watcher.applicationHidden: The application was hidden. --- * hs.uielement.watcher.applicationShown: The application was shown. --- --- #### Focus change events --- These events are watched on the application level, but send the relevant child element to the handler. --- * hs.uielement.watcher.mainWindowChanged: The main window of the application was changed. --- * hs.uielement.watcher.focusedWindowChanged: The focused window of the application was changed. Note that the application may not be activated itself. --- * hs.uielement.watcher.focusedElementChanged: The focused UI element of the application was changed. --- --- ### Window-level events --- * hs.uielement.watcher.windowCreated: A window was created. You should watch for this event on the application, or the parent window. --- * hs.uielement.watcher.windowMoved: The window was moved. --- * hs.uielement.watcher.windowResized: The window was resized. --- * hs.uielement.watcher.windowMinimized: The window was minimized. --- * hs.uielement.watcher.windowUnminimized: The window was unminimized. --- --- ### Element-level events --- These work on all UI elements, including windows. --- * hs.uielement.watcher.elementDestroyed: The element was destroyed. --- * hs.uielement.watcher.titleChanged: The element's title was changed. uielement.watcher.applicationActivated = "AXApplicationActivated" uielement.watcher.applicationDeactivated = "AXApplicationDeactivated" uielement.watcher.applicationHidden = "AXApplicationHidden" uielement.watcher.applicationShown = "AXApplicationShown" uielement.watcher.mainWindowChanged = "AXMainWindowChanged" uielement.watcher.focusedWindowChanged = "AXFocusedWindowChanged" uielement.watcher.focusedElementChanged = "AXFocusedUIElementChanged" uielement.watcher.windowCreated = "AXWindowCreated" uielement.watcher.windowMoved = "AXWindowMoved" uielement.watcher.windowResized = "AXWindowResized" uielement.watcher.windowMinimized = "AXWindowMiniaturized" uielement.watcher.windowUnminimized = "AXWindowDeminiaturized" uielement.watcher.elementDestroyed = "AXUIElementDestroyed" uielement.watcher.titleChanged = "AXTitleChanged" -- Keep track of apps, to automatically stop watchers on apps AND their elements when apps quit. local appWatchers = {} local function appCallback(_, event, app) if app and (appWatchers[app:pid()] and event == application.watcher.terminated) then fnutils.each(appWatchers[app:pid()], function(watcher) watcher:_stop() end) appWatchers[app:pid()] = nil end end local globalAppWatcher = appWatcher.new(appCallback) globalAppWatcher:start() -- Keep track of all other UI elements to automatically stop their watchers. local function handleEvent(callback, element, event, watcher, userData) if event == watcher.elementDestroyed then -- element is newly created from a dead UI element and may not have critical fields like pid and id. -- Use the existing watcher element instead. if element == watcher:element() then element = watcher:element() end -- Pass along event if wanted. if watcher:watchDestroyed() then callback(element, event, watcher, userData) end -- Stop watcher. if element == watcher:element() then watcher:stop() -- also removes from appWatchers end else callback(element, event, watcher, userData) end end --- hs.uielement.watcher:start(events) -> hs.uielement.watcher --- Method --- Tells the watcher to start watching for the given list of events. --- --- Parameters: --- * An array of events to be watched for. --- --- Returns: --- * hs.uielement.watcher --- --- Notes: --- * See hs.uielement.watcher for a list of events. You may also specify arbitrary event names as strings. --- * Does nothing if the watcher has already been started. To start with different events, stop it first. function watcherMT.start(self, events) -- Track all watchers in appWatchers. local pid = self:pid() if not appWatchers[pid] then appWatchers[pid] = {} end table.insert(appWatchers[pid], self) -- For normal elements, listen for elementDestroyed events. if not self:element():isApplication() then if fnutils.contains(events, self.elementDestroyed) then self:watchDestroyed(true) else self:watchDestroyed(false) events = fnutils.copy(events) table.insert(events, self.elementDestroyed) end end -- Actually start the watcher. return self:_start(events) end --- hs.uielement.watcher:stop() -> hs.uielement.watcher --- Method --- Tells the watcher to stop listening for events. --- --- Parameters: --- * None --- --- Returns: --- * hs.uielement.watcher --- --- Notes: --- * This is automatically called if the element is destroyed. function watcherMT.stop(self) -- Remove self from appWatchers. local pid = self:pid() if appWatchers[pid] then local idx = fnutils.indexOf(appWatchers[pid], self) if idx then table.remove(appWatchers[pid], idx) end end return self:_stop() end return uielement
mit
Habbie/hammerspoon
extensions/window/init.lua
1
45475
--- === hs.window === --- --- Inspect/manipulate windows --- --- Notes: --- * See `hs.screen` and `hs.geometry` for more information on how Hammerspoon uses window/screen frames and coordinates local application = require "hs.application" local window = require("hs.window.internal") local geometry = require "hs.geometry" local gtype=geometry.type local screen = require "hs.screen" local timer = require "hs.timer" require "hs.image" -- make sure we know about HSImage userdata type local pairs,ipairs,next,min,max,abs,cos,type = pairs,ipairs,next,math.min,math.max,math.abs,math.cos,type local tinsert,tremove,tsort,tunpack,tpack = table.insert,table.remove,table.sort,table.unpack,table.pack local USERDATA_TAG = "hs.window" local objectMT = hs.getObjectMetatable(USERDATA_TAG) --- hs.window.animationDuration (number) --- Variable --- The default duration for animations, in seconds. Initial value is 0.2; set to 0 to disable animations. --- --- Usage: --- ``` --- hs.window.animationDuration = 0 -- disable animations --- hs.window.animationDuration = 3 -- if you have time on your hands --- ``` window.animationDuration = 0.2 --- hs.window.desktop() -> hs.window object --- Function --- Returns the desktop "window" --- --- Parameters: --- * None --- --- Returns: --- * An `hs.window` object representing the desktop, or nil if Finder is not running --- --- Notes: --- * The desktop belongs to Finder.app: when Finder is the active application, you can focus the desktop by cycling --- through windows via cmd-` --- * The desktop window has no id, a role of `AXScrollArea` and no subrole --- * The desktop is filtered out from `hs.window.allWindows()` (and downstream uses) function window.desktop() local finder = application.get('com.apple.finder') if not finder then return nil end for _,w in ipairs(finder:allWindows()) do if w:role()=='AXScrollArea' then return w end end end --- hs.window.allWindows() -> list of hs.window objects --- Function --- Returns all windows --- --- Parameters: --- * None --- --- Returns: --- * A list of `hs.window` objects representing all open windows --- --- Notes: --- * `visibleWindows()`, `orderedWindows()`, `get()`, `find()`, and several more functions and methods in this and other --- modules make use of this function, so it is important to understand its limitations --- * This function queries all applications for their windows every time it is invoked; if you need to call it a lot and --- performance is not acceptable consider using the `hs.window.filter` module --- * This function can only return windows in the current Mission Control Space; if you need to address windows across --- different Spaces you can use the `hs.window.filter` module --- - if `Displays have separate Spaces` is *on* (in System Preferences>Mission Control) the current Space is defined --- as the union of all currently visible Spaces --- - minimized windows and hidden windows (i.e. belonging to hidden apps, e.g. via cmd-h) are always considered --- to be in the current Space --- * This function filters out the desktop "window"; use `hs.window.desktop()` to address it. (Note however that --- `hs.application.get'Finder':allWindows()` *will* include the desktop in the returned list) --- * Beside the limitations discussed above, this function will return *all* windows as reported by OSX, including some --- "windows" that one wouldn't expect: for example, every Google Chrome (actual) window has a companion window for its --- status bar; therefore you might get unexpected results - in the Chrome example, calling `hs.window.focusWindowSouth()` --- from a Chrome window would end up "focusing" its status bar, and therefore the proper window itself, seemingly resulting --- in a no-op. In order to avoid such surprises you can use the `hs.window.filter` module, and more specifically --- the default windowfilter (`hs.window.filter.default`) which filters out known cases of not-actual-windows --- * Some windows will not be reported by OSX - e.g. things that are on different Spaces, or things that are Full Screen local SKIP_APPS={ ['com.apple.WebKit.WebContent']=true,['com.apple.qtserver']=true,['com.google.Chrome.helper']=true, ['org.pqrs.Karabiner-AXNotifier']=true,['com.adobe.PDApp.AAMUpdatesNotifier']=true, ['com.adobe.csi.CS5.5ServiceManager']=true,['com.mcafee.McAfeeReporter']=true} -- so apparently OSX enforces a 6s limit on apps to respond to AX queries; -- Karabiner's AXNotifier and Adobe Update Notifier fail in that fashion function window.allWindows() local r={} for _,app in ipairs(application.runningApplications()) do if app:kind()>=0 then local bid=app:bundleID() or 'N/A' --just for safety; universalaccessd has no bundleid (but it's kind()==-1 anyway) if bid=='com.apple.finder' then --exclude the desktop "window" -- check the role explicitly, instead of relying on absent :id() - sometimes minimized windows have no :id() (El Cap Notes.app) for _,w in ipairs(app:allWindows()) do if w:role()=='AXWindow' then r[#r+1]=w end end elseif not SKIP_APPS[bid] then for _,w in ipairs(app:allWindows()) do r[#r+1]=w end end end end return r end function window._timed_allWindows() local r={} for _,app in ipairs(application.runningApplications()) do local starttime=timer.secondsSinceEpoch() local _,bid=app:allWindows(),app:bundleID() or 'N/A' r[bid]=(r[bid] or 0) + timer.secondsSinceEpoch()-starttime end for app,time in pairs(r) do if time>0.05 then print(string.format('took %.2fs for %s',time,app)) end end -- print('known exclusions:') print(hs.inspect(SKIP_APPS)) return r end --- hs.window.visibleWindows() -> list of hs.window objects --- Function --- Gets all visible windows --- --- Parameters: --- * None --- --- Returns: --- * A list containing `hs.window` objects representing all windows that are visible as per `hs.window:isVisible()` function window.visibleWindows() local r={} for _,app in ipairs(application.runningApplications()) do if app:kind()>0 and not app:isHidden() then for _,w in ipairs(app:visibleWindows()) do r[#r+1]=w end end -- speedup by excluding hidden apps end return r end --- hs.window.invisibleWindows() -> list of hs.window objects --- Function --- Gets all invisible windows --- --- Parameters: --- * None --- --- Returns: --- * A list containing `hs.window` objects representing all windows that are not visible as per `hs.window:isVisible()` function window.invisibleWindows() local r = {} for _, win in ipairs(window.allWindows()) do if not win:isVisible() then r[#r + 1] = win end end return r end --- hs.window.minimizedWindows() -> list of hs.window objects --- Function --- Gets all minimized windows --- --- Parameters: --- * None --- --- Returns: --- * A list containing `hs.window` objects representing all windows that are minimized as per `hs.window:isMinimized()` function window.minimizedWindows() local r = {} for _, win in ipairs(window.allWindows()) do if win:isMinimized() then r[#r + 1] = win end end return r end --- hs.window.orderedWindows() -> list of hs.window objects --- Function --- Returns all visible windows, ordered from front to back --- --- Parameters: --- * None --- --- Returns: --- * A list of `hs.window` objects representing all visible windows, ordered from front to back function window.orderedWindows() local r,winset,ids = {},{},window._orderedwinids() for _,w in ipairs(window.visibleWindows()) do winset[w:id()or -1]=w end for _,id in ipairs(ids) do r[#r+1]=winset[id] end -- no inner loop with a set, seems about 5% faster (iterating with prepoluated tables it's 50x faster) return r end --- hs.window.get(hint) -> hs.window object --- Constructor --- Gets a specific window --- --- Parameters: --- * hint - search criterion for the desired window; it can be: --- - an id number as per `hs.window:id()` --- - a window title string as per `hs.window:title()` --- --- Returns: --- * the first hs.window object that matches the supplied search criterion, or `nil` if not found --- --- Notes: --- * see also `hs.window.find` and `hs.application:getWindow()` function window.get(hint) return tpack(window.find(hint,true),nil)[1] -- just to be sure, discard extra results end window.windowForID=window.get --- hs.window.find(hint) -> hs.window object(s) --- Constructor --- Finds windows --- --- Parameters: --- * hint - search criterion for the desired window(s); it can be: --- - an id number as per `hs.window:id()` --- - a string pattern that matches (via `string.find`) the window title as per `hs.window:title()` (for convenience, the matching will be done on lowercased strings) --- --- Returns: --- * one or more hs.window objects that match the supplied search criterion, or `nil` if none found --- --- Notes: --- * for convenience you can call this as `hs.window(hint)` --- * see also `hs.window.get` --- * for more sophisticated use cases and/or for better performance if you call this a lot, consider using `hs.window.filter` --- --- Usage: --- ``` --- -- by id --- hs.window(8812):title() --> Hammerspoon Console --- -- by title --- hs.window'bash':application():name() --> Terminal --- ``` function window.find(hint,exact,wins) if hint==nil then return end local typ,r=type(hint),{} wins=wins or window.allWindows() if typ=='number' then for _,w in ipairs(wins) do if w:id()==hint then return w end end return elseif typ~='string' then error('hint must be a number or string',2) end if exact then for _,w in ipairs(wins) do if w:title()==hint then r[#r+1]=w end end else hint=hint:lower() for _,w in ipairs(wins) do local wtitle=w:title() if wtitle and wtitle:lower():find(hint) then r[#r+1]=w end end end if #r>0 then return tunpack(r) end end --- hs.window:isVisible() -> boolean --- Method --- Determines if a window is visible (i.e. not hidden and not minimized) --- --- Parameters: --- * None --- --- Returns: --- * `true` if the window is visible, otherwise `false` --- --- Notes: --- * This does not mean the user can see the window - it may be obscured by other windows, or it may be off the edge of the screen function objectMT.isVisible(self) if not self:application() then return false end return not self:application():isHidden() and not self:isMinimized() end local animations, animTimer = {} local DISTANT_FUTURE=315360000 -- 10 years (roughly) --[[ local function quad(x,s,len) local l=max(0,min(2,(x-s)*2/len)) if l<1 then return l*l/2 else l=2-l return 1-(l*l/2) end end --]] local function quadOut(x,s,len) local l=1-max(0,min(1,(x-s)/len)) return 1-l*l end local function animate() local time = timer.secondsSinceEpoch() for id,anim in pairs(animations) do local r = quadOut(time,anim.time,anim.duration) local f = {} if r>=1 then f=anim.endFrame animations[id] = nil else for _,k in pairs{'x','y','w','h'} do f[k] = anim.startFrame[k] + (anim.endFrame[k]-anim.startFrame[k])*r end end anim.window:_setFrame(f) end if not next(animations) then animTimer:setNextTrigger(DISTANT_FUTURE) end end animTimer = timer.new(0.017,animate) animTimer:start() --keep this split local function getAnimationFrame(win) local id = win:id() if animations[id] then return animations[id].endFrame end end local function stopAnimation(win,snap,id) if not id then id = win:id() end local anim = animations[id] if not anim then return end animations[id] = nil if not next(animations) then animTimer:setNextTrigger(DISTANT_FUTURE) end if snap then win:_setFrame(anim.endFrame) end end function objectMT._frame(self) -- get actual window frame right now return geometry(self:_topLeft(),self:_size()) end function objectMT._setFrame(self, f) -- set window frame instantly self:_setSize(f) self:_setTopLeft(f) return self:_setSize(f) end local function setFrameAnimated(self,id,f,duration) local frame = self:_frame() if not animations[id] then animations[id] = {window=self} end local anim = animations[id] anim.time=timer.secondsSinceEpoch() anim.duration=duration anim.startFrame=frame anim.endFrame=f animTimer:setNextTrigger(0.01) return self end local function setFrameWithWorkarounds(self,f,duration) local originalFrame=geometry(self:_frame()) local safeBounds=self:screen():frame() if duration>0 then -- if no animation, skip checking for possible trouble if not originalFrame:inside(safeBounds) then duration=0 -- window straddling screens or partially offscreen else local testSize=geometry.size(originalFrame.w-1,originalFrame.h-1) self:_setSize(testSize) -- find out if it's a terminal, or a window already shrunk to minimum, or a window on a 'sticky' edge local newSize=self:_size() if originalFrame.size==newSize -- terminal or minimum size or (testSize~=newSize and (abs(f.x2-originalFrame.x2)<100 or abs(f.y2-originalFrame.y2)<100)) then --sticky edge, and not going far enough duration=0 end -- don't animate troublesome windows end end local safeFrame=geometry.new(originalFrame.xy,f.size) --apply the desired size safeBounds:move(30,30) -- offset safeBounds.w=safeBounds.w-60 safeBounds.h=safeBounds.h-60 -- and shrink self:_setFrame(safeFrame:fit(safeBounds)) -- put it within a 'safe' area in the current screen, and insta-resize local actualSize=geometry(self:_size()) -- get the *actual* size the window resized to if actualSize.area>f.area then f.size=actualSize end -- if it's bigger apply it if duration==0 then self:_setSize(f.size) -- apply the final size while the window is still in the safe area self:_setTopLeft(f) return self:_setSize(f.size) end self:_setFrame(originalFrame) -- restore the original frame and start the animation return setFrameAnimated(self,self:id(),f,duration) end local function setFrame(self,f,duration,workarounds) if duration==nil then duration = window.animationDuration end if type(duration)~='number' then duration=0 end f=geometry(f):floor() if gtype(f)~='rect' then error('invalid rect: '..f.string,3) end local id=self:id() if id then stopAnimation(self,false,id) else duration=0 end if workarounds then return setFrameWithWorkarounds(self,f,duration) elseif duration<=0 then return self:_setFrame(f) else return setFrameAnimated(self,id,f,duration) end end --- hs.window:setFrame(rect[, duration]) -> hs.window object --- Method --- Sets the frame of the window in absolute coordinates --- --- Parameters: --- * rect - An hs.geometry rect, or constructor argument, describing the frame to be applied to the window --- * duration - (optional) The number of seconds to animate the transition. Defaults to the value of `hs.window.animationDuration` --- --- Returns: --- * The `hs.window` object function objectMT.setFrame(self, f, duration) return setFrame(self,f,duration,window.setFrameCorrectness) end --- hs.window:setFrameWithWorkarounds(rect[, duration]) -> hs.window object --- Method --- Sets the frame of the window in absolute coordinates, using the additional workarounds described in `hs.window.setFrameCorrectness` --- --- Parameters: --- * rect - An hs.geometry rect, or constructor argument, describing the frame to be applied to the window --- * duration - (optional) The number of seconds to animate the transition. Defaults to the value of `hs.window.animationDuration` --- --- Returns: --- * The `hs.window` object function objectMT.setFrameWithWorkarounds(self, f, duration) return setFrame(self,f,duration,true) end --- hs.window.setFrameCorrectness --- Variable --- Using `hs.window:setFrame()` in some cases does not work as expected: namely, the bottom (or Dock) edge, and edges between screens, might --- exhibit some "stickiness"; consequently, trying to make a window abutting one of those edges just *slightly* smaller could --- result in no change at all (you can verify this by trying to resize such a window with the mouse: at first it won't budge, --- and, as you drag further away, suddenly snap to the new size); and similarly in some cases windows along screen edges --- might erroneously end up partially on the adjacent screen after a move/resize. Additionally some windows (no matter --- their placement on screen) only allow being resized at "discrete" steps of several screen points; the typical example --- is Terminal windows, which only resize to whole rows and columns. Both these OSX issues can cause incorrect behavior --- when using `:setFrame()` directly or in downstream uses, such as `hs.window:move()` and the `hs.grid` and `hs.window.layout` modules. --- --- Setting this variable to `true` will make `:setFrame()` perform additional checks and workarounds for these potential --- issues. However, as a side effect the window might appear to jump around briefly before setting toward its destination --- frame, and, in some cases, the move/resize animation (if requested) might be skipped entirely - these tradeoffs are --- necessary to ensure the desired result. --- --- The default value is `false`, in order to avoid the possibly annoying or distracting window wiggling; set to `true` if you see --- incorrect results in `:setFrame()` or downstream modules and don't mind the the wiggling. window.setFrameCorrectness = false --- hs.window:setFrameInScreenBounds([rect][, duration]) -> hs.window object --- Method --- Sets the frame of the window in absolute coordinates, possibly adjusted to ensure it is fully inside the screen --- --- Parameters: --- * rect - An hs.geometry rect, or constructor argument, describing the frame to be applied to the window; if omitted, --- the current window frame will be used --- * duration - (optional) The number of seconds to animate the transition. Defaults to the value of `hs.window.animationDuration` --- --- Returns: --- * The `hs.window` object function objectMT.setFrameInScreenBounds(self, f, duration) if type(f)=='number' then duration=f f=nil end f = f and geometry(f):floor() or self:frame() return self:setFrame(f:fit(screen.find(f):frame()),duration) end window.ensureIsInScreenBounds=window.setFrameInScreenBounds --backward compatible --- hs.window:frame() -> hs.geometry rect --- Method --- Gets the frame of the window in absolute coordinates --- --- Parameters: --- * None --- --- Returns: --- * An hs.geometry rect containing the co-ordinates of the top left corner of the window and its width and height function objectMT.frame(self) return getAnimationFrame(self) or self:_frame() end -- wrapping these Lua-side for dealing with animations cache function objectMT.size(self) local f=getAnimationFrame(self) return f and f.size or geometry(self:_size()) end function objectMT.topLeft(self) local f=getAnimationFrame(self) return f and f.xy or geometry(self:_topLeft()) end function objectMT.setSize(self, ...) stopAnimation(self,true) return self:_setSize(geometry.size(...)) end function objectMT.setTopLeft(self, ...) stopAnimation(self,true) return self:_setTopLeft(geometry.point(...)) end function objectMT.minimize(self) stopAnimation(self,true) return self:_minimize() end function objectMT.unminimize(self) stopAnimation(self,true) return self:_unminimize() end function objectMT.toggleZoom(self) stopAnimation(self,true) return self:_toggleZoom() end function objectMT.setFullScreen(self, v) stopAnimation(self,true) return self:_setFullScreen(v) end function objectMT.close(self) stopAnimation(self,true) return self:_close() end --- hs.window:otherWindowsSameScreen() -> list of hs.window objects --- Method --- Gets other windows on the same screen --- --- Parameters: --- * None --- --- Returns: --- * A table of `hs.window` objects representing the visible windows other than this one that are on the same screen function objectMT.otherWindowsSameScreen(self) local r=window.visibleWindows() for i=#r,1,-1 do if r[i]==self or r[i]:screen()~=self:screen() then tremove(r,i) end end return r end --- hs.window:otherWindowsAllScreens() -> list of hs.window objects --- Method --- Gets every window except this one --- --- Parameters: --- * None --- --- Returns: --- * A table containing `hs.window` objects representing all visible windows other than this one function objectMT.otherWindowsAllScreens(self) local r=window.visibleWindows() for i=#r,1,-1 do if r[i]==self then tremove(r,i) break end end return r end local desktopFocusWorkaroundTimer --workaround for the desktop taking over --- hs.window:focus() -> hs.window object --- Method --- Focuses the window --- --- Parameters: --- * None --- --- Returns: --- * The `hs.window` object function objectMT.focus(self) local app=self:application() if app then self:becomeMain() app:_bringtofront() if app:bundleID()=='com.apple.finder' then --workaround for the desktop taking over -- it may look like this should ideally go inside :becomeMain(), but the problem is actually -- triggered by :_bringtofront(), so the workaround belongs here if desktopFocusWorkaroundTimer then desktopFocusWorkaroundTimer:stop() end desktopFocusWorkaroundTimer=timer.doAfter(0.3,function() -- 0.3s comes from https://github.com/Hammerspoon/hammerspoon/issues/581 -- it'd be slightly less ugly to use a "space change completed" callback (as per issue above) rather than -- a crude timer, althought that route is a lot more complicated self:becomeMain() desktopFocusWorkaroundTimer=nil --cleanup the timer end) self:becomeMain() --ensure space change actually takes place when necessary end end return self end --- hs.window:sendToBack() -> hs.window object --- Method --- Sends the window to the back --- --- This method works by focusing all overlapping windows behind this one, front to back. --- If called on the focused window, this method will switch focus to the topmost window under this one; otherwise, the --- currently focused window will regain focus after this window has been sent to the back. --- --- Parameters: --- * None --- --- Returns: --- * The `hs.window` object --- --- Notes: --- * Due to the way this method works and OSX limitations, calling this method when you have a lot of randomly overlapping --- (as opposed to neatly tiled) windows might be visually jarring, and take a fair amount of time to complete. --- So if you don't use orderly layouts, or if you have a lot of windows in general, you're probably better off using --- `hs.application:hide()` (or simply `cmd-h`) local WINDOW_ROLES={AXStandardWindow=true,AXDialog=true,AXSystemDialog=true} function objectMT.sendToBack(self) local id,frame=self:id(),self:frame() local fw=window.focusedWindow() local wins=window.orderedWindows() for z=#wins,1,-1 do local w=wins[z] if id==w:id() or not WINDOW_ROLES[w:subrole()] then tremove(wins,z) end end local toRaise,topz,didwork={} repeat for z=#wins,1,-1 do didwork=nil local wf=wins[z]:frame() if frame:intersect(wf).area>0 then topz=z if not toRaise[z] then didwork=true toRaise[z]=true frame=frame:union(wf) break end end end until not didwork if topz then for z=#wins,1,-1 do if toRaise[z] then wins[z]:focus() timer.usleep(80000) end end wins[topz]:focus() if fw and fw:id()~=id then fw:focus() end end return self end --- hs.window:maximize([duration]) -> hs.window object --- Method --- Maximizes the window --- --- Parameters: --- * duration - (optional) The number of seconds to animate the transition. Defaults to the value of `hs.window.animationDuration` --- --- Returns: --- * The `hs.window` object --- --- Notes: --- * The window will be resized as large as possible, without obscuring the dock/menu function objectMT.maximize(self, duration) return self:setFrame(self:screen():frame(), duration) end --- hs.window:toggleFullScreen() -> hs.window object --- Method --- Toggles the fullscreen state of the window --- --- Parameters: --- * None --- --- Returns: --- * The `hs.window` object --- --- Notes: --- * Not all windows support being full-screened function objectMT.toggleFullScreen(self) self:setFullScreen(not self:isFullScreen()) return self end -- aliases objectMT.toggleFullscreen=objectMT.toggleFullScreen objectMT.isFullscreen=objectMT.isFullScreen objectMT.setFullscreen=objectMT.setFullScreen --- hs.window:screen() -> hs.screen object --- Method --- Gets the screen which the window is on --- --- Parameters: --- * None --- --- Returns: --- * An `hs.screen` object representing the screen which most contains the window (by area) function objectMT.screen(self) return screen.find(self:frame())--findScreenForFrame(self:frame()) end local function isFullyBehind(f1,w2) local f2=geometry(w2:frame()) return f1:intersect(f2).area>=f2.area*0.95 end local function windowsInDirection(fromWindow, numRotations, candidateWindows, frontmost, strict) -- assume looking to east -- use the score distance/cos(A/2), where A is the angle by which it -- differs from the straight line in the direction you're looking -- for. (may have to manually prevent division by zero.) local fromFrame=geometry(fromWindow:frame()) local winset,fromz,fromid={},99999,fromWindow:id() or -1 for z,w in ipairs(candidateWindows or window.orderedWindows()) do if fromid==(w:id() or -2) then fromz=z --workaround the fact that userdata keep changing elseif not candidateWindows or w:isVisible() then winset[w]=z end --make a set, avoid inner loop (if using .orderedWindows skip the visible check as it's done upstream) end if frontmost then for w,z in pairs(winset) do if z>fromz and isFullyBehind(fromFrame,w) then winset[w]=nil end end end local p1,wins=fromFrame.center,{} for win,z in pairs(winset) do local frame=geometry(win:frame()) local delta = p1:vector(frame.center:rotateCCW(p1,numRotations)) if delta.x > (strict and abs(delta.y) or 0) then wins[#wins+1]={win=win,score=delta.length/cos(delta:angle()/2)+z,z=z,frame=frame} end end tsort(wins,function(a,b)return a.score<b.score end) if frontmost then local i=1 while i<=#wins do for j=i+1,#wins do if wins[j].z<wins[i].z then local r=wins[i].frame:intersect(wins[j].frame) if r.w>5 and r.h>5 then --TODO var for threshold --this window is further away, but it occludes the closest local swap=wins[i] wins[i]=wins[j] wins[j]=swap i=i-1 break end end end i=i+1 end end for i=1,#wins do wins[i]=wins[i].win end return wins end --TODO zorder direct manipulation (e.g. sendtoback) local function focus_first_valid_window(ordered_wins) for _,win in ipairs(ordered_wins) do if win:focus() then return true end end return false end --- hs.window:windowsToEast([candidateWindows[, frontmost[, strict]]]) -> list of hs.window objects --- Method --- Gets all windows to the east of this window --- --- Parameters: --- * candidateWindows - (optional) a list of candidate windows to consider; if nil, all visible windows to the east are candidates. --- * frontmost - (optional) boolean, if true unoccluded windows will be placed before occluded ones in the result list --- * strict - (optional) boolean, if true only consider windows at an angle between 45° and -45° on the eastward axis --- --- Returns: --- * A list of `hs.window` objects representing all windows positioned east (i.e. right) of the window, in ascending order of distance --- --- Notes: --- * If you don't pass `candidateWindows`, Hammerspoon will query for the list of all visible windows every time this method is called; this can be slow, and some undesired "windows" could be included (see the notes for `hs.window.allWindows()`); consider using the equivalent methods in `hs.window.filter` instead --- hs.window:windowsToWest([candidateWindows[, frontmost[, strict]]]) -> list of hs.window objects --- Method --- Gets all windows to the west of this window --- --- Parameters: --- * candidateWindows - (optional) a list of candidate windows to consider; if nil, all visible windows to the west are candidates. --- * frontmost - (optional) boolean, if true unoccluded windows will be placed before occluded ones in the result list --- * strict - (optional) boolean, if true only consider windows at an angle between 45° and -45° on the westward axis --- --- Returns: --- * A list of `hs.window` objects representing all windows positioned west (i.e. left) of the window, in ascending order of distance --- --- Notes: --- * If you don't pass `candidateWindows`, Hammerspoon will query for the list of all visible windows every time this method is called; this can be slow, and some undesired "windows" could be included (see the notes for `hs.window.allWindows()`); consider using the equivalent methods in `hs.window.filter` instead --- hs.window:windowsToNorth([candidateWindows[, frontmost[, strict]]]) -> list of hs.window objects --- Method --- Gets all windows to the north of this window --- --- Parameters: --- * candidateWindows - (optional) a list of candidate windows to consider; if nil, all visible windows to the north are candidates. --- * frontmost - (optional) boolean, if true unoccluded windows will be placed before occluded ones in the result list --- * strict - (optional) boolean, if true only consider windows at an angle between 45° and -45° on the northward axis --- --- Returns: --- * A list of `hs.window` objects representing all windows positioned north (i.e. up) of the window, in ascending order of distance --- --- Notes: --- * If you don't pass `candidateWindows`, Hammerspoon will query for the list of all visible windows every time this method is called; this can be slow, and some undesired "windows" could be included (see the notes for `hs.window.allWindows()`); consider using the equivalent methods in `hs.window.filter` instead --- hs.window:windowsToSouth([candidateWindows[, frontmost[, strict]]]) -> list of hs.window objects --- Method --- Gets all windows to the south of this window --- --- Parameters: --- * candidateWindows - (optional) a list of candidate windows to consider; if nil, all visible windows to the south are candidates. --- * frontmost - (optional) boolean, if true unoccluded windows will be placed before occluded ones in the result list --- * strict - (optional) boolean, if true only consider windows at an angle between 45° and -45° on the southward axis --- --- Returns: --- * A list of `hs.window` objects representing all windows positioned south (i.e. down) of the window, in ascending order of distance --- --- Notes: --- * If you don't pass `candidateWindows`, Hammerspoon will query for the list of all visible windows every time this method is called; this can be slow, and some undesired "windows" could be included (see the notes for `hs.window.allWindows()`); consider using the equivalent methods in `hs.window.filter` instead --- hs.window.frontmostWindow() -> hs.window object --- Constructor --- Returns the focused window or, if no window has focus, the frontmost one --- --- Parameters: --- * None --- --- Returns: --- * An `hs.window` object representing the frontmost window, or `nil` if there are no visible windows function window.frontmostWindow() local w=window.focusedWindow() if w then return w end for _,ww in ipairs(window.orderedWindows()) do local app=ww:application() if (app and app:title()~='Hammerspoon') or ww:subrole()~='AXUnknown' then return ww end end end for n,dir in pairs{['0']='East','North','West','South'}do objectMT['windowsTo'..dir]=function(self,...) self=self or window.frontmostWindow() return self and windowsInDirection(self,n,...) end objectMT['focusWindow'..dir]=function(self,wins,...) self=self or window.frontmostWindow() if not self then return end if wins==true then -- legacy sameApp parameter wins=self:application():visibleWindows() end return self and focus_first_valid_window(objectMT['windowsTo'..dir](self,wins,...)) end objectMT['moveOneScreen'..dir]=function(self,...) local s=self:screen() return self:moveToScreen(s['to'..dir](s),...) end end --- hs.window:focusWindowEast([candidateWindows[, frontmost[, strict]]]) -> boolean --- Method --- Focuses the nearest possible window to the east (i.e. right) --- --- Parameters: --- * candidateWindows - (optional) a list of candidate windows to consider; if nil, all visible windows --- to the east are candidates. --- * frontmost - (optional) boolean, if true focuses the nearest window that isn't occluded by any other window --- * strict - (optional) boolean, if true only consider windows at an angle between 45° and -45° on the --- eastward axis --- --- Returns: --- * `true` if a window was found and focused, `false` otherwise; `nil` if the search couldn't take place --- --- Notes: --- * If you don't pass `candidateWindows`, Hammerspoon will query for the list of all visible windows --- every time this method is called; this can be slow, and some undesired "windows" could be included --- (see the notes for `hs.window.allWindows()`); consider using the equivalent methods in --- `hs.window.filter` instead --- hs.window:focusWindowWest([candidateWindows[, frontmost[, strict]]]) -> boolean --- Method --- Focuses the nearest possible window to the west (i.e. left) --- --- Parameters: --- * candidateWindows - (optional) a list of candidate windows to consider; if nil, all visible windows --- to the east are candidates. --- * frontmost - (optional) boolean, if true focuses the nearest window that isn't occluded by any other window --- * strict - (optional) boolean, if true only consider windows at an angle between 45° and -45° on the --- eastward axis --- --- Returns: --- * `true` if a window was found and focused, `false` otherwise; `nil` if the search couldn't take place --- --- Notes: --- * If you don't pass `candidateWindows`, Hammerspoon will query for the list of all visible windows --- every time this method is called; this can be slow, and some undesired "windows" could be included --- (see the notes for `hs.window.allWindows()`); consider using the equivalent methods in --- `hs.window.filter` instead --- hs.window:focusWindowNorth([candidateWindows[, frontmost[, strict]]]) -> boolean --- Method --- Focuses the nearest possible window to the north (i.e. up) --- --- Parameters: --- * candidateWindows - (optional) a list of candidate windows to consider; if nil, all visible windows --- to the east are candidates. --- * frontmost - (optional) boolean, if true focuses the nearest window that isn't occluded by any other window --- * strict - (optional) boolean, if true only consider windows at an angle between 45° and -45° on the --- eastward axis --- --- Returns: --- * `true` if a window was found and focused, `false` otherwise; `nil` if the search couldn't take place --- --- Notes: --- * If you don't pass `candidateWindows`, Hammerspoon will query for the list of all visible windows --- every time this method is called; this can be slow, and some undesired "windows" could be included --- (see the notes for `hs.window.allWindows()`); consider using the equivalent methods in --- `hs.window.filter` instead --- hs.window:focusWindowSouth([candidateWindows[, frontmost[, strict]]]) -> boolean --- Method --- Focuses the nearest possible window to the south (i.e. down) --- --- Parameters: --- * candidateWindows - (optional) a list of candidate windows to consider; if nil, all visible windows --- to the east are candidates. --- * frontmost - (optional) boolean, if true focuses the nearest window that isn't occluded by any other window --- * strict - (optional) boolean, if true only consider windows at an angle between 45° and -45° on the --- eastward axis --- --- Returns: --- * `true` if a window was found and focused, `false` otherwise; `nil` if the search couldn't take place --- --- Notes: --- * If you don't pass `candidateWindows`, Hammerspoon will query for the list of all visible windows --- every time this method is called; this can be slow, and some undesired "windows" could be included --- (see the notes for `hs.window.allWindows()`); consider using the equivalent methods in --- `hs.window.filter` instead --- hs.window:centerOnScreen([screen][, ensureInScreenBounds][, duration]) --> hs.window object --- Method --- Centers the window on a screen --- --- Parameters: --- * screen - (optional) An `hs.screen` object or argument for `hs.screen.find`; if nil, use the screen the window is currently on --- * ensureInScreenBounds - (optional) if `true`, use `setFrameInScreenBounds()` to ensure the resulting window frame is fully contained within --- the window's screen --- * duration - (optional) The number of seconds to animate the transition. Defaults to the value of `hs.window.animationDuration` --- --- Returns: --- * The `hs.window` object function objectMT.centerOnScreen(self, toScreen,inBounds,duration) if type(toScreen)=='boolean' then duration=inBounds inBounds=toScreen toScreen=nil elseif type(toScreen)=='number' then duration=toScreen inBounds=nil toScreen=nil end if type(inBounds)=='number' then duration=inBounds inBounds=nil end toScreen=screen.find(toScreen) or self:screen() local sf,wf=toScreen:fullFrame(),self:frame() local frame=geometry(toScreen:localToAbsolute((geometry(sf.w,sf.h)-geometry(wf.w,wf.h))*0.5),wf.size) if inBounds then return self:setFrameInScreenBounds(frame,duration) else return self:setFrame(frame,duration) end end --- hs.window:moveToUnit(unitrect[, duration]) -> hs.window object --- Method --- Moves and resizes the window to occupy a given fraction of the screen --- --- Parameters: --- * unitrect - An `hs.geometry` unit rect, or constructor argument to create one --- * duration - (optional) The number of seconds to animate the transition. Defaults to the value of `hs.window.animationDuration` --- --- Returns: --- * The `hs.window` object --- --- Notes: --- * An example, which would make a window fill the top-left quarter of the screen: `win:moveToUnit'[0,0,50,50]'` function objectMT.moveToUnit(self, unit, duration) return self:setFrame(self:screen():fromUnitRect(unit),duration) end --- hs.window:moveToScreen(screen[, noResize, ensureInScreenBounds][, duration]) -> hs.window object --- Method --- Moves the window to a given screen, retaining its relative position and size --- --- Parameters: --- * screen - An `hs.screen` object, or an argument for `hs.screen.find()`, representing the screen to move the window to --- * noResize - (optional) if `true`, maintain the window's absolute size --- * ensureInScreenBounds - (optional) if `true`, use `setFrameInScreenBounds()` to ensure the resulting window frame is fully contained within --- the window's screen --- * duration - (optional) The number of seconds to animate the transition. Defaults to the value of `hs.window.animationDuration` --- --- Returns: --- * The `hs.window` object function objectMT.moveToScreen(self, toScreen,noResize,inBounds,duration) if not toScreen then return end local theScreen=screen.find(toScreen) if not theScreen then print('window:moveToScreen(): screen not found: '..toScreen) return self end if type(noResize)=='number' then duration=noResize noResize=nil inBounds=nil end local frame=theScreen:fromUnitRect(self:screen():toUnitRect(self:frame())) if noResize then frame.size=self:size() end -- local frame=theScreen:localToAbsolute(self:screen():absoluteToLocal(self:frame())) if inBounds then return self:setFrameInScreenBounds(frame,duration) else return self:setFrame(frame,duration) end -- else return self:setFrame(theScreen:fromUnitRect(self:screen():toUnitRect(self:frame())),duration) end end --- hs.window:move(rect[, screen][, ensureInScreenBounds][, duration]) --> hs.window object --- Method --- Moves the window --- --- Parameters: --- * rect - It can be: --- - an `hs.geometry` point, or argument to construct one; will move the screen by this delta, keeping its size constant; `screen` is ignored --- - an `hs.geometry` rect, or argument to construct one; will set the window frame to this rect, in absolute coordinates; `screen` is ignored --- - an `hs.geometry` unit rect, or argument to construct one; will set the window frame to this rect relative to the desired screen; --- if `screen` is nil, use the screen the window is currently on --- * screen - (optional) An `hs.screen` object or argument for `hs.screen.find`; only valid if `rect` is a unit rect --- * ensureInScreenBounds - (optional) if `true`, use `setFrameInScreenBounds()` to ensure the resulting window frame is fully contained within --- the window's screen --- * duration - (optional) The number of seconds to animate the transition. Defaults to the value of `hs.window.animationDuration` --- --- Returns: --- * The `hs.window` object function objectMT.move(self, rect,toScreen,inBounds,duration) if type(toScreen)=='boolean' then duration=inBounds inBounds=toScreen toScreen=nil elseif type(toScreen)=='number' then duration=toScreen inBounds=nil toScreen=nil end if type(inBounds)=='number' then duration=inBounds inBounds=nil end rect=geometry(rect) local rtype,frame=rect:type() if rtype=='point' then frame=geometry(self:frame()):move(rect) if type(toScreen)=='number' then inBounds=nil duration=toScreen end elseif rtype=='rect' then frame=rect if type(toScreen)=='number' then inBounds=nil duration=toScreen end elseif rtype=='unitrect' then local theScreen if toScreen then theScreen=screen.find(toScreen) if not theScreen then print('window:move(): screen not found: '..toScreen) return self end else theScreen=self:screen() end frame=rect:fromUnitRect(theScreen:frame()) else error('rect must be a point, rect, or unit rect',2) end if inBounds then return self:setFrameInScreenBounds(frame,duration) else return self:setFrame(frame,duration) end end --- hs.window:moveOneScreenEast([noResize, ensureInScreenBounds][, duration]) -> hs.window object --- Method --- Moves the window one screen east (i.e. right) --- --- Parameters: --- * noResize - (optional) if `true`, maintain the window's absolute size --- * ensureInScreenBounds - (optional) if `true`, use `setFrameInScreenBounds()` to ensure the resulting window frame is fully contained within --- the window's screen --- * duration - (optional) The number of seconds to animate the transition. Defaults to the value of `hs.window.animationDuration` --- --- Returns: --- * The `hs.window` object --- hs.window:moveOneScreenWest([noResize, ensureInScreenBounds][, duration]) -> hs.window object --- Method --- Moves the window one screen west (i.e. left) --- --- Parameters: --- * noResize - (optional) if `true`, maintain the window's absolute size --- * ensureInScreenBounds - (optional) if `true`, use `setFrameInScreenBounds()` to ensure the resulting window frame is fully contained within --- the window's screen --- * duration - (optional) The number of seconds to animate the transition. Defaults to the value of `hs.window.animationDuration` --- --- Returns: --- * The `hs.window` object --- hs.window:moveOneScreenNorth([noResize, ensureInScreenBounds][, duration]) -> hs.window object --- Method --- Moves the window one screen north (i.e. up) --- --- --- Parameters: --- * noResize - (optional) if `true`, maintain the window's absolute size --- * ensureInScreenBounds - (optional) if `true`, use `setFrameInScreenBounds()` to ensure the resulting window frame is fully contained within --- the window's screen --- * duration - (optional) The number of seconds to animate the transition. Defaults to the value of `hs.window.animationDuration` --- --- Returns: --- * The `hs.window` object --- hs.window:moveOneScreenSouth([noResize, ensureInScreenBounds][, duration]) -> hs.window object --- Method --- Moves the window one screen south (i.e. down) --- --- --- Parameters: --- * noResize - (optional) if `true`, maintain the window's absolute size --- * ensureInScreenBounds - (optional) if `true`, use `setFrameInScreenBounds()` to ensure the resulting window frame is fully contained within --- the window's screen --- * duration - (optional) The number of seconds to animate the transition. Defaults to the value of `hs.window.animationDuration` --- --- Returns: --- * The `hs.window` object do local submodules={filter=true,layout=true,tiling=true,switcher=true,highlight=true} local function loadSubModule(k) print("-- Loading extensions: window."..k) window[k]=require('hs.window.'..k) return window[k] end local mt=getmetatable(window) --inject "lazy loading" for submodules mt.__index=function(_,k) if submodules[k] then return loadSubModule(k) else return nil -- if it's already in the module, __index is never called end end -- whoever gets it first (window vs application) if not mt.__call then mt.__call=function(t,...) return t.find(...) end end end return window
mit
RuiChen1113/luci
applications/luci-app-statistics/luasrc/model/cbi/luci_statistics/unixsock.lua
73
1191
-- Copyright 2008 Freifunk Leipzig / Jo-Philipp Wich <jow@openwrt.org> -- Licensed to the public under the Apache License 2.0. m = Map("luci_statistics", translate("Unixsock Plugin Configuration"), translate( "The unixsock plugin creates a unix socket which can be used " .. "to read collected data from a running collectd instance." )) -- collectd_unixsock config section s = m:section( NamedSection, "collectd_unixsock", "luci_statistics" ) -- collectd_unixsock.enable enable = s:option( Flag, "enable", translate("Enable this plugin") ) enable.default = 0 -- collectd_unixsock.socketfile (SocketFile) socketfile = s:option( Value, "SocketFile" ) socketfile.default = "/var/run/collect-query.socket" socketfile:depends( "enable", 1 ) -- collectd_unixsock.socketgroup (SocketGroup) socketgroup = s:option( Value, "SocketGroup" ) socketgroup.default = "nobody" socketgroup.rmempty = true socketgroup.optional = true socketgroup:depends( "enable", 1 ) -- collectd_unixsock.socketperms (SocketPerms) socketperms = s:option( Value, "SocketPerms" ) socketperms.default = "0770" socketperms.rmempty = true socketperms.optional = true socketperms:depends( "enable", 1 ) return m
apache-2.0
Silencer2K/wow-mount-farm-helper
AltCraftFrame.lua
1
3235
local addonName, addon = ... local L = LibStub('AceLocale-3.0'):GetLocale(addonName) local LIST_SCROLL_ITEM_HEIGHT = 60 local frame = AltCraftMFHTabFrame function frame:OnInitialize() self.Title:SetText("Mount Farm Helper") self.RestoreButton:SetText(L.btn_restore_all) self.ListScroll:OnInitialize() end function frame:OnShow() local parent = self:GetParent() parent.TopLeft:SetTexture('Interface\\Addons\\AltCraft\\assets\\frame\\tl') parent.Top:SetTexture('Interface\\Addons\\AltCraft\\assets\\frame\\t') parent.TopRight:SetTexture('Interface\\Addons\\AltCraft\\assets\\frame\\tr') parent.BottomLeft:SetTexture('Interface\\Addons\\AltCraft\\assets\\frame\\bl') parent.Portrait:SetTexture('Interface\\ICONS\\ABILITY_MOUNT_GOLDENGRYPHON') self:Update() end function frame:OnSelectItem(button) if self.selectedItem and self.selectedItem == button.data.itemId then self.selectedItem = nil else self.selectedItem = button.data.itemId end self:Update() end function frame:OnDeleteClick() end function frame:OnRestoreClick() end function frame:Update(what) if what then return end self.ListScroll:Update() end function frame.ListScroll:OnInitialize() self.scrollBar.doNotHide = 1 HybridScrollFrame_OnLoad(self) self.update = function() self:Update() end HybridScrollFrame_CreateButtons(self, 'AltCraftMFHButtonTemplate', 0, 0) self:Update() end function frame.ListScroll:OnUpdate() local button for button in table.s2k_values(self.buttons) do if button:IsMouseOver() then button.Highlight:Show() if GameTooltip:IsOwned(button.Icon) then GameTooltip:SetOwner(button.Icon, "ANCHOR_RIGHT") GameTooltip:SetItemByID(button.data.itemId) end elseif self:GetParent().selectedItem == button.data.itemId then button.Highlight:Show() else button.Highlight:Hide() end end end function frame.ListScroll:Update() local list = addon:BuildAltCraftList() local numRows = #list HybridScrollFrame_Update(self, numRows * LIST_SCROLL_ITEM_HEIGHT, self:GetHeight()) local scrollOffset = HybridScrollFrame_GetOffset(self) local i for i = 1, #self.buttons do local button = self.buttons[i] local item = list[i + scrollOffset] if scrollOffset + i <= numRows then button.data = item button:Show() button.Icon.Texture:SetTexture(item.icon) button.Item:SetText(item.link:gsub('[%[%]]', '')) if item.sources[1].comment then button.Zone:SetText(string.format('%s (%s)', item.sources[1].zone, item.sources[1].comment)) else button.Zone:SetText(item.sources[1].zone) end local numSources = table.s2k_len(item.sources) if numSources > 1 then button.Source:SetText(string.format("%s (+%d)", item.sources[1].source, numSources - 1)) else button.Source:SetText(item.sources[1].source) end else button:Hide() end end end
mit
sigma-random/PrefSDK
formats/bitmap/definition.lua
1
4256
local pref = require("pref") local BitmapBPP = require("formats.bitmap.bpp") local DataType = pref.datatype local BitmapFormat = pref.format.create("Bitmap Image", "Imaging", "Dax", "1.1") function BitmapFormat:validate(validator) local validbpp = {1, 4, 8, 16, 24, 32} validator:checkAscii(0, "BM") -- Bitmap's Signature validator:checkType(14, 40, DataType.UInt32_LE) -- BitmapInfoHeader.biSize validator:checkType(26, 0x00000001, DataType.UInt16_LE) -- BitmapInfoHseader.biPlanes for _, bpp in pairs(validbpp) do if validator:checkType(28, bpp, DataType.UInt16_LE, false) == true then -- BitmapInfoHeader.biBitCount return end end validator:error("Invalid BPP") end function BitmapFormat:parse(formattree) local bitmapfileheader = formattree:addStructure("BitmapFileHeader") bitmapfileheader:addField(DataType.UInt16_LE, "bfType") bitmapfileheader:addField(DataType.UInt32_LE, "bfSize") bitmapfileheader:addField(DataType.UInt16_LE, "bfReserved1") bitmapfileheader:addField(DataType.UInt16_LE, "bfReserved2") bitmapfileheader:addField(DataType.UInt32_LE, "bfOffBits") local bitmapinfoheader = formattree:addStructure("BitmapInfoHeader") bitmapinfoheader:addField(DataType.UInt32_LE, "biSize") bitmapinfoheader:addField(DataType.Int32_LE, "biWidth"):dynamicInfo(BitmapFormat.displaySize) bitmapinfoheader:addField(DataType.Int32_LE, "biHeight"):dynamicInfo(BitmapFormat.displaySize) bitmapinfoheader:addField(DataType.UInt16_LE, "biPlanes") bitmapinfoheader:addField(DataType.UInt16_LE, "biBitCount"):dynamicInfo(BitmapFormat.displayBpp) bitmapinfoheader:addField(DataType.UInt32_LE, "biCompression") bitmapinfoheader:addField(DataType.UInt32_LE, "biSizeImage") bitmapinfoheader:addField(DataType.Int32_LE, "biXPelsPerMeter") bitmapinfoheader:addField(DataType.Int32_LE, "biYPelsPerMeter") bitmapinfoheader:addField(DataType.UInt32_LE, "biClrUsed") bitmapinfoheader:addField(DataType.UInt32_LE, "biClrImportant") local bitcount = bitmapinfoheader.biBitCount.value if bitcount < 24 then self:parseColorTable(formattree, bitmapinfoheader, bitcount) end formattree:addStructure("BitmapBits"):dynamicParser(bitmapinfoheader.biSizeImage.value > 0, BitmapFormat.parseBits) end function BitmapFormat:view(formattree) if formattree.BitmapInfoHeader.biBitCount.value >= 24 then -- No Color Table return nil end return pref.format.loadview("formats/bitmap/ui/ColorTable.qml", formattree) end function BitmapFormat:parseColorTable(formattree, bitmapinfoheader, bitcount) local clrused = bitmapinfoheader.biClrUsed.value local colortable = formattree:addStructure("ColorTable") local tablesize = (clrused and clrused or bit.lshift(1, bitcount)) for i = 1, tablesize do local colorentry = colortable:addStructure(string.format("Color_%d", i - 1)):dynamicInfo(BitmapFormat.displayColorHex) colorentry:addField(DataType.UInt8, "Blue") colorentry:addField(DataType.UInt8, "Green") colorentry:addField(DataType.UInt8, "Red") colorentry:addField(DataType.UInt8, "Reserved") end end function BitmapFormat.parseBits(bitmapbits, formattree) local w = formattree.BitmapInfoHeader.biWidth.value local h = formattree.BitmapInfoHeader.biHeight.value local bpp = formattree.BitmapInfoHeader.biBitCount.value local rowsize = (((bpp * w) + 31) / 32) * 4 local line = 0 if h < 0 then h = math.abs(h) end while line < h do bitmapbits:addField(DataType.UInt8, string.format("ScanLine_%d", line), rowsize) line = line + 1 end end function BitmapFormat.displaySize(sizefield, formattree) if sizefield.value < 0 then return string.format("%dpx (Reversed)", math.abs(sizefield.value)) end return string.format("%dpx", sizefield.value) end function BitmapFormat.displayBpp(bitcountfield, formattree) local bpp = BitmapBPP[bitcountfield.value] if bpp == nil then return "Invalid BPP" end return bpp end function BitmapFormat.displayColorHex(colorentry, formattree) return string.format("#%02X%02X%02X%02X", colorentry.Reserved.value, colorentry.Red.value, colorentry.Green.value, colorentry.Blue.value) end return BitmapFormat
gpl-3.0
nikai3d/codecombat-scripts
mountain/zoo-keeper.lua
1
1134
local points = {} points[1] = {x=33, y=42} points[2] = {x=47, y=42} points[3] = {x=33, y=26} points[4] = {x=47, y=26} function distance2(a, b) local x, y = a.pos.x - b.pos.x, a.pos.y - b.pos.y return x*x + y*y end function findClosest(t) local d, dmin = nil, 4e4 for i = 1, #es do local dis = distance2(es[i], t) if dis < dmin then d, dmin = es[i], dis end end return d end while self.gold < 4 * self:costOf("soldier") do local i = self:findNearest(self:findItems()) self:move(i.pos) end for i = 1, 4 do self:summon("soldier") end loop es = self:findEnemies() local friends = self:findFriends() for j = 1, #friends do local point = points[j] local friend = friends[j] local enemy = findClosest(friend) if enemy then if enemy.team == "ogres" and friend:distanceTo(enemy) < 5 then self:command(friend, "attack", enemy) else self:command(friend, "move", point) end else self:command(friend, "move", point) end end end
mit
greg-hellings/FrameworkBenchmarks
frameworks/Lua/lapis/web.lua
72
5957
local lapis = require("lapis") local db = require("lapis.db") local Model do local _obj_0 = require("lapis.db.model") Model = _obj_0.Model end local config do local _obj_0 = require("lapis.config") config = _obj_0.config end local insert do local _obj_0 = table insert = _obj_0.insert end local sort do local _obj_0 = table sort = _obj_0.sort end local min, random do local _obj_0 = math min, random = _obj_0.min, _obj_0.random end local Fortune do local _parent_0 = Model local _base_0 = { } _base_0.__index = _base_0 setmetatable(_base_0, _parent_0.__base) local _class_0 = setmetatable({ __init = function(self, ...) return _parent_0.__init(self, ...) end, __base = _base_0, __name = "Fortune", __parent = _parent_0 }, { __index = function(cls, name) local val = rawget(_base_0, name) if val == nil then return _parent_0[name] else return val end end, __call = function(cls, ...) local _self_0 = setmetatable({}, _base_0) cls.__init(_self_0, ...) return _self_0 end }) _base_0.__class = _class_0 if _parent_0.__inherited then _parent_0.__inherited(_parent_0, _class_0) end Fortune = _class_0 end local World do local _parent_0 = Model local _base_0 = { } _base_0.__index = _base_0 setmetatable(_base_0, _parent_0.__base) local _class_0 = setmetatable({ __init = function(self, ...) return _parent_0.__init(self, ...) end, __base = _base_0, __name = "World", __parent = _parent_0 }, { __index = function(cls, name) local val = rawget(_base_0, name) if val == nil then return _parent_0[name] else return val end end, __call = function(cls, ...) local _self_0 = setmetatable({}, _base_0) cls.__init(_self_0, ...) return _self_0 end }) _base_0.__class = _class_0 if _parent_0.__inherited then _parent_0.__inherited(_parent_0, _class_0) end World = _class_0 end local Benchmark do local _parent_0 = lapis.Application local _base_0 = { ["/"] = function(self) return { json = { message = "Hello, World!" } } end, ["/db"] = function(self) local w = World:find(random(1, 10000)) return { json = { id = w.id, randomNumber = w.randomnumber } } end, ["/queries"] = function(self) local num_queries = tonumber(self.params.queries) or 1 if num_queries < 2 then local w = World:find(random(1, 10000)) return { json = { { id = w.id, randomNumber = w.randomnumber } } } end local worlds = { } num_queries = min(500, num_queries) for i = 1, num_queries do local w = World:find(random(1, 10000)) insert(worlds, { id = w.id, randomNumber = w.randomnumber }) end return { json = worlds } end, ["/fortunes"] = function(self) self.fortunes = Fortune:select("") insert(self.fortunes, { id = 0, message = "Additional fortune added at request time." }) sort(self.fortunes, function(a, b) return a.message < b.message end) return { layout = false }, self:html(function() raw('<!DOCTYPE HTML>') return html(function() head(function() return title("Fortunes") end) return body(function() return element("table", function() tr(function() th(function() return text("id") end) return th(function() return text("message") end) end) local _list_0 = self.fortunes for _index_0 = 1, #_list_0 do local fortune = _list_0[_index_0] tr(function() td(function() return text(fortune.id) end) return td(function() return text(fortune.message) end) end) end end) end) end) end) end, ["/update"] = function(self) local num_queries = tonumber(self.params.queries) or 1 if num_queries == 0 then num_queries = 1 end local worlds = { } num_queries = min(500, num_queries) for i = 1, num_queries do local wid = random(1, 10000) local world = World:find(wid) world.randomnumber = random(1, 10000) world:update("randomnumber") insert(worlds, { id = world.id, randomNumber = world.randomnumber }) end if num_queries < 2 then return { json = { worlds[1] } } end return { json = worlds } end, ["/plaintext"] = function(self) return { content_type = "text/plain", layout = false }, "Hello, World!" end } _base_0.__index = _base_0 setmetatable(_base_0, _parent_0.__base) local _class_0 = setmetatable({ __init = function(self, ...) return _parent_0.__init(self, ...) end, __base = _base_0, __name = "Benchmark", __parent = _parent_0 }, { __index = function(cls, name) local val = rawget(_base_0, name) if val == nil then return _parent_0[name] else return val end end, __call = function(cls, ...) local _self_0 = setmetatable({}, _base_0) cls.__init(_self_0, ...) return _self_0 end }) _base_0.__class = _class_0 if _parent_0.__inherited then _parent_0.__inherited(_parent_0, _class_0) end Benchmark = _class_0 return _class_0 end
bsd-3-clause
thenumbernine/hydro-cl-lua
hydro/draw/vector_lic.lua
1
5725
local ffi = require 'ffi' local class = require 'ext.class' local file = require 'ext.file' local gl = require 'ffi.OpenGL' local GLTex2D = require 'gl.tex2d' local Draw = require 'hydro.draw.draw' local DrawVectorLIC = class(Draw) DrawVectorLIC.integralMaxIter = 10 --[[ the xmin/xmax/ymin/ymax passed as arguments is the one shared with all graphs but for LIC, we just need the cartesian range --]] function DrawVectorLIC:drawSolverWithVar(var, shader, xmin, xmax, ymin, ymax) local solver = self.solver local app = solver.app -- hmm ... this is needed for sub-solvers local origSolver = var.solver var.solver = solver local uniforms = shader.uniforms solver:calcDisplayVarToTex(var) local tex = solver:getTex(var) tex:bind(0) self.noiseTex:bind(2) tex:setParameter(gl.GL_TEXTURE_MAG_FILTER, app.displayBilinearTextures and gl.GL_LINEAR or gl.GL_NEAREST) gl.glBegin(gl.GL_QUADS) gl.glVertex2d(xmin, ymin) gl.glVertex2d(xmax, ymin) gl.glVertex2d(xmax, ymax) gl.glVertex2d(xmin, ymax) gl.glEnd() self.noiseTex:unbind(2) tex:unbind(0) var.solver = origSolver end function DrawVectorLIC:showDisplayVar(var, varName, ar, xmin, xmax, ymin, ymax) local solver = self.solver local app = solver.app -- TODO allow a fixed, manual colormap range -- NOTICE with AMR this will only get from the root node -- which should at least have blitters of the children local valueMin, valueMax if var.heatMapFixedRange then valueMin = var.heatMapValueMin valueMax = var.heatMapValueMax else local component = solver.displayComponentFlatList[var.component] local vectorField = solver:isVarTypeAVectorField(component.type) if vectorField then -- calc range of magnitude of vector variable valueMin, valueMax = solver:calcDisplayVarRange(var, component.magn) else valueMin, valueMax = solver:calcDisplayVarRange(var) end var.heatMapValueMin = valueMin var.heatMapValueMax = valueMax end if not self.noiseTex then local noiseVol = app.drawVectorLICNoiseSize * app.drawVectorLICNoiseSize * 4 local noiseData = ffi.new('float[?]', noiseVol) for i=0,noiseVol-1 do noiseData[i] = math.random() end self.noiseTex = GLTex2D{ internalFormat = gl.GL_RGBA32F, width = app.drawVectorLICNoiseSize, height = app.drawVectorLICNoiseSize, format = gl.GL_RGBA, type = gl.GL_FLOAT, data = noiseData, minFilter = gl.GL_NEAREST, magFilter = gl.GL_LINEAR, wrap = { s = gl.GL_REPEAT, t = gl.GL_REPEAT, }, } end local shader = solver.vectorLICShader shader:use() app.gradientTex:bind(1) self:setupDisplayVarShader(shader, var, valueMin, valueMax) if shader.uniforms.integralMaxIter then gl.glUniform1i(shader.uniforms.integralMaxIter.loc, self.integralMaxIter) end gl.glBlendFunc(gl.GL_SRC_ALPHA, gl.GL_ONE_MINUS_SRC_ALPHA) gl.glEnable(gl.GL_BLEND) self:drawSolverWithVar(var, shader, xmin, xmax, ymin, ymax) -- [[ if solver.amr then local tmp = self.solver for k,subsolver in pairs(solver.amr.child) do self.solver = subsolver self:drawSolverWithVar(var, shader, xmin, xmax, ymin, ymax) end self.solver = tmp end --]] gl.glDisable(gl.GL_BLEND) app.gradientTex:unbind(1) gl.glActiveTexture(gl.GL_TEXTURE0) shader:useNone() -- gl.glDisable(gl.GL_DEPTH_TEST) -- TODO only draw the first app:drawGradientLegend(solver, var, varName, ar, valueMin, valueMax) -- gl.glEnable(gl.GL_DEPTH_TEST) end function DrawVectorLIC:display(varName, ar, graph_xmin, graph_xmax, graph_ymin, graph_ymax) local solver = self.solver local app = solver.app app.view:setup(ar) local xmin, xmax, ymin, ymax if app.view.getOrthoBounds then xmin, xmax, ymin, ymax = app.view:getOrthoBounds(ar) else xmin = solver.cartesianMin.x ymin = solver.cartesianMin.y xmax = solver.cartesianMax.x ymax = solver.cartesianMax.y end -- gl.glEnable(gl.GL_DEPTH_TEST) local gridz = 0 --.1 gl.glColor3f(.1, .1, .1) local xrange = xmax - xmin local xstep = 10^math.floor(math.log(xrange, 10) - .5) local xticmin = math.floor(xmin/xstep) local xticmax = math.ceil(xmax/xstep) gl.glBegin(gl.GL_LINES) for x=xticmin,xticmax do gl.glVertex3f(x*xstep,ymin, gridz) gl.glVertex3f(x*xstep,ymax, gridz) end gl.glEnd() local yrange = ymax - ymin local ystep = 10^math.floor(math.log(yrange, 10) - .5) local yticmin = math.floor(ymin/ystep) local yticmax = math.ceil(ymax/ystep) gl.glBegin(gl.GL_LINES) for y=yticmin,yticmax do gl.glVertex3f(xmin,y*ystep, gridz) gl.glVertex3f(xmax,y*ystep, gridz) end gl.glEnd() gl.glColor3f(.5, .5, .5) gl.glBegin(gl.GL_LINES) gl.glVertex3f(xmin, 0, gridz) gl.glVertex3f(xmax, 0, gridz) gl.glVertex3f(0, ymin, gridz) gl.glVertex3f(0, ymax, gridz) gl.glEnd() -- NOTICE overlays of multiple solvers won't be helpful. It'll just draw over the last solver. -- I've got to rethink the visualization if not require 'hydro.solver.meshsolver':isa(solver) then local var = solver.displayVarForName[varName] if var and var.enabled then self:prepareShader() self:showDisplayVar(var, varName, ar, xmin, xmax, ymin, ymax) end end -- gl.glDisable(gl.GL_DEPTH_TEST) end function DrawVectorLIC:prepareShader() local solver = self.solver if solver.vectorLICShader then return end local vectorLICCode = assert(file'hydro/draw/vector_lic.shader':read()) solver.vectorLICShader = solver.GLProgram{ name = 'vector_lic', vertexCode = solver.eqn:template(vectorLICCode, { draw = self, vertexShader = true, }), fragmentCode = solver.eqn:template(vectorLICCode, { draw = self, fragmentShader = true, }), uniforms = { valueMin = 0, valueMax = 0, tex = 0, gradientTex = 1, noiseTex = 2, }, } end return DrawVectorLIC
mit
shkan/telebot7
plugins/img_google.lua
660
3196
do local mime = require("mime") local google_config = load_from_file('data/google.lua') local cache = {} --[[ local function send_request(url) local t = {} local options = { url = url, sink = ltn12.sink.table(t), method = "GET" } local a, code, headers, status = http.request(options) return table.concat(t), code, headers, status end]]-- local function get_google_data(text) local url = "http://ajax.googleapis.com/ajax/services/search/images?" url = url.."v=1.0&rsz=5" url = url.."&q="..URL.escape(text) url = url.."&imgsz=small|medium|large" if google_config.api_keys then local i = math.random(#google_config.api_keys) local api_key = google_config.api_keys[i] if api_key then url = url.."&key="..api_key end end local res, code = http.request(url) if code ~= 200 then print("HTTP Error code:", code) return nil end local google = json:decode(res) return google end -- Returns only the useful google data to save on cache local function simple_google_table(google) local new_table = {} new_table.responseData = {} new_table.responseDetails = google.responseDetails new_table.responseStatus = google.responseStatus new_table.responseData.results = {} local results = google.responseData.results for k,result in pairs(results) do new_table.responseData.results[k] = {} new_table.responseData.results[k].unescapedUrl = result.unescapedUrl new_table.responseData.results[k].url = result.url end return new_table end local function save_to_cache(query, data) -- Saves result on cache if string.len(query) <= 7 then local text_b64 = mime.b64(query) if not cache[text_b64] then local simple_google = simple_google_table(data) cache[text_b64] = simple_google end end end local function process_google_data(google, receiver, query) if google.responseStatus == 403 then local text = 'ERROR: Reached maximum searches per day' send_msg(receiver, text, ok_cb, false) elseif google.responseStatus == 200 then local data = google.responseData if not data or not data.results or #data.results == 0 then local text = 'Image not found.' send_msg(receiver, text, ok_cb, false) return false end -- Random image from table local i = math.random(#data.results) local url = data.results[i].unescapedUrl or data.results[i].url local old_timeout = http.TIMEOUT or 10 http.TIMEOUT = 5 send_photo_from_url(receiver, url) http.TIMEOUT = old_timeout save_to_cache(query, google) else local text = 'ERROR!' send_msg(receiver, text, ok_cb, false) end end function run(msg, matches) local receiver = get_receiver(msg) local text = matches[1] local text_b64 = mime.b64(text) local cached = cache[text_b64] if cached then process_google_data(cached, receiver, text) else local data = get_google_data(text) process_google_data(data, receiver, text) end end return { description = "Search image with Google API and sends it.", usage = "!img [term]: Random search an image with Google API.", patterns = { "^!img (.*)$" }, run = run } end
gpl-2.0
TH3GENERAL/GENERAL
DevTSHAKE/utils.lua
74
30284
URL = require "socket.url" http = require "socket.http" https = require "ssl.https" ltn12 = require "ltn12" serpent = (loadfile "./libs/serpent.lua")() feedparser = (loadfile "./libs/feedparser.lua")() json = (loadfile "./libs/JSON.lua")() mimetype = (loadfile "./libs/mimetype.lua")() redis = (loadfile "./libs/redis.lua")() JSON = (loadfile "./libs/dkjson.lua")() http.TIMEOUT = 10 function get_receiver(msg) if msg.to.type == 'user' then return 'user#id'..msg.from.id end if msg.to.type == 'chat' then return 'chat#id'..msg.to.id end if msg.to.type == 'encr_chat' then return msg.to.print_name end if msg.to.type == 'channel' then return 'channel#id'..msg.to.id end end function is_chat_msg( msg ) if msg.to.type == 'chat' then return true end return false end function string.random(length) local str = ""; for i = 1, length do math.random(97, 122) str = str..string.char(math.random(97, 122)); end return str; end function string.random(length) local str = ""; for i = 1, length do math.random(97, 122) str = str..string.char(math.random(97, 122)); end return str; end function string:split(sep) local sep, fields = sep or ":", {} local pattern = string.format("([^%s]+)", sep) self:gsub(pattern, function(c) fields[#fields+1] = c end) return fields end -- DEPRECATED function string.trim(s) print("string.trim(s) is DEPRECATED use string:trim() instead") return s:gsub("^%s*(.-)%s*$", "%1") end -- Removes spaces function string:trim() return self:gsub("^%s*(.-)%s*$", "%1") end function get_http_file_name(url, headers) -- Eg: foo.var local file_name = url:match("[^%w]+([%.%w]+)$") -- Any delimited alphanumeric on the url file_name = file_name or url:match("[^%w]+(%w+)[^%w]+$") -- Random name, hope content-type works file_name = file_name or str:random(5) local content_type = headers["content-type"] local extension = nil if content_type then extension = mimetype.get_mime_extension(content_type) end if extension then file_name = file_name.."."..extension end local disposition = headers["content-disposition"] if disposition then -- attachment; filename=CodeCogsEqn.png file_name = disposition:match('filename=([^;]+)') or file_name end return file_name end -- Saves file to /tmp/. If file_name isn't provided, -- will get the text after the last "/" for filename -- and content-type for extension function download_to_file(url, file_name) print("url to download: "..url) local respbody = {} local options = { url = url, sink = ltn12.sink.table(respbody), redirect = true } -- nil, code, headers, status local response = nil if url:starts('https') then options.redirect = false response = {https.request(options)} else response = {http.request(options)} end local code = response[2] local headers = response[3] local status = response[4] if code ~= 200 then return nil end file_name = file_name or get_http_file_name(url, headers) local file_path = "data/tmp/"..file_name print("Saved to: "..file_path) file = io.open(file_path, "w+") file:write(table.concat(respbody)) file:close() return file_path end function vardump(value) print(serpent.block(value, {comment=false})) end -- taken from http://stackoverflow.com/a/11130774/3163199 function scandir(directory) local i, t, popen = 0, {}, io.popen for filename in popen('ls -a "'..directory..'"'):lines() do i = i + 1 t[i] = filename end return t end -- http://www.lua.org/manual/5.2/manual.html#pdf-io.popen function run_command(str) local cmd = io.popen(str) local result = cmd:read('*all') cmd:close() return result end -- User has privileges function is_sudo(msg) local var = false -- Check users id in config for v,user in pairs(_config.sudo_users) do if user == msg.from.id then var = true end end return var end -- Returns the name of the sender function get_name(msg) local name = msg.from.first_name if name == nil then name = msg.from.id end return name end -- Returns at table of lua files inside plugins function plugins_names( ) local files = {} for k, v in pairs(scandir("plugins")) do -- Ends with .lua if (v:match(".lua$")) then table.insert(files, v) end end return files end -- Function name explains what it does. function file_exists(name) local f = io.open(name,"r") if f ~= nil then io.close(f) return true else return false end end -- Save into file the data serialized for lua. -- Set uglify true to minify the file. function serialize_to_file(data, file, uglify) file = io.open(file, 'w+') local serialized if not uglify then serialized = serpent.block(data, { comment = false, name = '_' }) else serialized = serpent.dump(data) end file:write(serialized) file:close() end -- Returns true if the string is empty function string:isempty() return self == nil or self == '' end -- Returns true if the string is blank function string:isblank() self = self:trim() return self:isempty() end -- DEPRECATED!!!!! function string.starts(String, Start) print("string.starts(String, Start) is DEPRECATED use string:starts(text) instead") return Start == string.sub(String,1,string.len(Start)) end -- Returns true if String starts with Start function string:starts(text) return text == string.sub(self,1,string.len(text)) end -- Send image to user and delete it when finished. -- cb_function and cb_extra are optionals callback function _send_photo(receiver, file_path, cb_function, cb_extra) local cb_extra = { file_path = file_path, cb_function = cb_function, cb_extra = cb_extra } -- Call to remove with optional callback send_photo(receiver, file_path, cb_function, cb_extra) end -- Download the image and send to receiver, it will be deleted. -- cb_function and cb_extra are optionals callback function send_photo_from_url(receiver, url, cb_function, cb_extra) -- If callback not provided cb_function = cb_function or ok_cb cb_extra = cb_extra or false local file_path = download_to_file(url, false) if not file_path then -- Error local text = 'Error downloading the image' send_msg(receiver, text, cb_function, cb_extra) else print("File path: "..file_path) _send_photo(receiver, file_path, cb_function, cb_extra) end end -- Same as send_photo_from_url but as callback function function send_photo_from_url_callback(cb_extra, success, result) local receiver = cb_extra.receiver local url = cb_extra.url local file_path = download_to_file(url, false) if not file_path then -- Error local text = 'Error downloading the image' send_msg(receiver, text, ok_cb, false) else print("File path: "..file_path) _send_photo(receiver, file_path, ok_cb, false) end end -- Send multiple images asynchronous. -- param urls must be a table. function send_photos_from_url(receiver, urls) local cb_extra = { receiver = receiver, urls = urls, remove_path = nil } send_photos_from_url_callback(cb_extra) end -- Use send_photos_from_url. -- This function might be difficult to understand. function send_photos_from_url_callback(cb_extra, success, result) -- cb_extra is a table containing receiver, urls and remove_path local receiver = cb_extra.receiver local urls = cb_extra.urls local remove_path = cb_extra.remove_path -- The previously image to remove if remove_path ~= nil then os.remove(remove_path) print("Deleted: "..remove_path) end -- Nil or empty, exit case (no more urls) if urls == nil or #urls == 0 then return false end -- Take the head and remove from urls table local head = table.remove(urls, 1) local file_path = download_to_file(head, false) local cb_extra = { receiver = receiver, urls = urls, remove_path = file_path } -- Send first and postpone the others as callback send_photo(receiver, file_path, send_photos_from_url_callback, cb_extra) end -- Callback to remove a file function rmtmp_cb(cb_extra, success, result) local file_path = cb_extra.file_path local cb_function = cb_extra.cb_function or ok_cb local cb_extra = cb_extra.cb_extra if file_path ~= nil then os.remove(file_path) print("Deleted: "..file_path) end -- Finally call the callback cb_function(cb_extra, success, result) end -- Send document to user and delete it when finished. -- cb_function and cb_extra are optionals callback function _send_document(receiver, file_path, cb_function, cb_extra) local cb_extra = { file_path = file_path, cb_function = cb_function or ok_cb, cb_extra = cb_extra or false } -- Call to remove with optional callback send_document(receiver, file_path, rmtmp_cb, cb_extra) end -- Download the image and send to receiver, it will be deleted. -- cb_function and cb_extra are optionals callback function send_document_from_url(receiver, url, cb_function, cb_extra) local file_path = download_to_file(url, false) print("File path: "..file_path) _send_document(receiver, file_path, cb_function, cb_extra) end -- Parameters in ?a=1&b=2 style function format_http_params(params, is_get) local str = '' -- If is get add ? to the beginning if is_get then str = '?' end local first = true -- Frist param for k,v in pairs (params) do if v then -- nil value if first then first = false str = str..k.. "="..v else str = str.."&"..k.. "="..v end end end return str end -- Check if user can use the plugin and warns user -- Returns true if user was warned and false if not warned (is allowed) function warns_user_not_allowed(plugin, msg) if not user_allowed(plugin, msg) then local text = 'This plugin requires privileged user' local receiver = get_receiver(msg) send_msg(receiver, text, ok_cb, false) return true else return false end end -- Check if user can use the plugin function user_allowed(plugin, msg) if plugin.privileged and not is_sudo(msg) then return false end return true end function send_order_msg(destination, msgs) local cb_extra = { destination = destination, msgs = msgs } send_order_msg_callback(cb_extra, true) end function send_order_msg_callback(cb_extra, success, result) local destination = cb_extra.destination local msgs = cb_extra.msgs local file_path = cb_extra.file_path if file_path ~= nil then os.remove(file_path) print("Deleted: " .. file_path) end if type(msgs) == 'string' then send_large_msg(destination, msgs) elseif type(msgs) ~= 'table' then return end if #msgs < 1 then return end local msg = table.remove(msgs, 1) local new_cb_extra = { destination = destination, msgs = msgs } if type(msg) == 'string' then send_msg(destination, msg, send_order_msg_callback, new_cb_extra) elseif type(msg) == 'table' then local typ = msg[1] local nmsg = msg[2] new_cb_extra.file_path = nmsg if typ == 'document' then send_document(destination, nmsg, send_order_msg_callback, new_cb_extra) elseif typ == 'image' or typ == 'photo' then send_photo(destination, nmsg, send_order_msg_callback, new_cb_extra) elseif typ == 'audio' then send_audio(destination, nmsg, send_order_msg_callback, new_cb_extra) elseif typ == 'video' then send_video(destination, nmsg, send_order_msg_callback, new_cb_extra) else send_file(destination, nmsg, send_order_msg_callback, new_cb_extra) end end end -- Same as send_large_msg_callback but friendly params function send_large_msg(destination, text) local cb_extra = { destination = destination, text = text } send_large_msg_callback(cb_extra, true) end -- If text is longer than 4096 chars, send multiple msg. -- https://core.telegram.org/method/messages.sendMessage function send_large_msg_callback(cb_extra, success, result) local text_max = 4096 local destination = cb_extra.destination local text = cb_extra.text if not text or type(text) == 'boolean' then return end local text_len = string.len(text) local num_msg = math.ceil(text_len / text_max) if num_msg <= 1 then send_msg(destination, text, ok_cb, false) else local my_text = string.sub(text, 1, 4096) local rest = string.sub(text, 4096, text_len) local cb_extra = { destination = destination, text = rest } send_msg(destination, my_text, send_large_msg_callback, cb_extra) end end function post_large_msg(destination, text) local cb_extra = { destination = destination, text = text } post_large_msg_callback(cb_extra, true) end function post_large_msg_callback(cb_extra, success, result) local text_max = 4096 local destination = cb_extra.destination local text = cb_extra.text local text_len = string.len(text) local num_msg = math.ceil(text_len / text_max) if num_msg <= 1 then post_msg(destination, text, ok_cb, false) else local my_text = string.sub(text, 1, 4096) local rest = string.sub(text, 4096, text_len) local cb_extra = { destination = destination, text = rest } post_msg(destination, my_text, post_large_msg_callback, cb_extra) end end -- Returns a table with matches or nil function match_pattern(pattern, text, lower_case) if text then local matches = {} if lower_case then matches = { string.match(text:lower(), pattern) } else matches = { string.match(text, pattern) } end if next(matches) then return matches end end -- nil end -- Function to read data from files function load_from_file(file, default_data) local f = io.open(file, "r+") -- If file doesn't exists if f == nil then -- Create a new empty table default_data = default_data or {} serialize_to_file(default_data, file) print ('Created file', file) else print ('Data loaded from file', file) f:close() end return loadfile (file)() end -- See http://stackoverflow.com/a/14899740 function unescape_html(str) local map = { ["lt"] = "<", ["gt"] = ">", ["amp"] = "&", ["quot"] = '"', ["apos"] = "'" } new = string.gsub(str, '(&(#?x?)([%d%a]+);)', function(orig, n, s) var = map[s] or n == "#" and string.char(s) var = var or n == "#x" and string.char(tonumber(s,16)) var = var or orig return var end) return new end -- Workarrond to format the message as previously was received function backward_msg_format (msg) for k,name in pairs({'from', 'to'}) do local longid = msg[name].id msg[name].id = msg[name].peer_id msg[name].peer_id = longid msg[name].type = msg[name].peer_type end if msg.action and (msg.action.user or msg.action.link_issuer) then local user = msg.action.user or msg.action.link_issuer local longid = user.id user.id = user.peer_id user.peer_id = longid user.type = user.peer_type end return msg end --Table Sort function pairsByKeys (t, f) local a = {} for n in pairs(t) do table.insert(a, n) end table.sort(a, f) local i = 0 -- iterator variable local iter = function () -- iterator function i = i + 1 if a[i] == nil then return nil else return a[i], t[a[i]] end end return iter end --End Table Sort --Check if this chat is realm or not function is_realm(msg) local var = false local realms = 'realms' local data = load_data(_config.moderation.data) local chat = msg.to.id if data[tostring(realms)] then if data[tostring(realms)][tostring(chat)] then var = true end return var end end --Check if this chat is a group or not function is_group(msg) local var = false local data = load_data(_config.moderation.data) local groups = 'groups' local chat = msg.to.id if data[tostring(groups)] then if data[tostring(groups)][tostring(chat)] then if msg.to.type == 'chat' then var = true end end return var end end function is_super_group(msg) local var = false local data = load_data(_config.moderation.data) local groups = 'groups' local chat = msg.to.id if data[tostring(groups)] then if data[tostring(groups)][tostring(chat)] then if msg.to.type == 'channel' then var = true end return var end end end function is_log_group(msg) local var = false local data = load_data(_config.moderation.data) local GBan_log = 'GBan_log' if data[tostring(GBan_log)] then if data[tostring(GBan_log)][tostring(msg.to.id)] then if msg.to.type == 'channel' then var = true end return var end end end function savelog(group, logtxt) local text = (os.date("[ %c ]=> "..logtxt.."\n \n")) local file = io.open("./groups/logs/"..group.."log.txt", "a") file:write(text) file:close() end function user_print_name(user) if user.print_name then return user.print_name end local text = '' if user.first_name then text = user.last_name..' ' end if user.lastname then text = text..user.last_name end return text end --Check if user is the owner of that group or not function is_owner(msg) local var = false local data = load_data(_config.moderation.data) local user = msg.from.id if data[tostring(msg.to.id)] then if data[tostring(msg.to.id)]['set_owner'] then if data[tostring(msg.to.id)]['set_owner'] == tostring(user) then var = true end end end local hash = 'support' local support = redis:sismember(hash, user) if support then var = true end if data['admins'] then if data['admins'][tostring(user)] then var = true end end for v,user in pairs(_config.sudo_users) do if user == msg.from.id then var = true end end return var end function is_owner2(user_id, group_id) local var = false local data = load_data(_config.moderation.data) local user = user_id if data[tostring(group_id)] then if data[tostring(group_id)]['set_owner'] then if data[tostring(group_id)]['set_owner'] == tostring(user_id) then var = true end end end local hash = 'support' local support = redis:sismember(hash, user) if support then var = true end if data['admins'] then if data['admins'][tostring(user_id)] then var = true end end for v,user in pairs(_config.sudo_users) do if user == user_id then var = true end end return var end --Check if user is admin or not function is_admin1(msg) local var = false local data = load_data(_config.moderation.data) local user = msg.from.id local admins = 'admins' if data[tostring(admins)] then if data[tostring(admins)][tostring(user)] then var = true end end for v,user in pairs(_config.sudo_users) do if user == msg.from.id then var = true end end return var end function is_admin2(user_id) local var = false local data = load_data(_config.moderation.data) local user = user_id local admins = 'admins' if data[tostring(admins)] then if data[tostring(admins)][tostring(user)] then var = true end end for v,user in pairs(_config.sudo_users) do if user == user_id then var = true end end return var end --Check if user is the mod of that group or not function is_momod(msg) local var = false local data = load_data(_config.moderation.data) local user = msg.from.id if data[tostring(msg.to.id)] then if data[tostring(msg.to.id)]['moderators'] then if data[tostring(msg.to.id)]['moderators'][tostring(user)] then var = true end end end if data[tostring(msg.to.id)] then if data[tostring(msg.to.id)]['set_owner'] then if data[tostring(msg.to.id)]['set_owner'] == tostring(user) then var = true end end end local hash = 'support' local support = redis:sismember(hash, user) if support then var = true end if data['admins'] then if data['admins'][tostring(user)] then var = true end end for v,user in pairs(_config.sudo_users) do if user == msg.from.id then var = true end end return var end function is_momod2(user_id, group_id) local var = false local data = load_data(_config.moderation.data) local usert = user_id if data[tostring(group_id)] then if data[tostring(group_id)]['moderators'] then if data[tostring(group_id)]['moderators'][tostring(usert)] then var = true end end end if data[tostring(group_id)] then if data[tostring(group_id)]['set_owner'] then if data[tostring(group_id)]['set_owner'] == tostring(user_id) then var = true end end end local hash = 'support' local support = redis:sismember(hash, user_id) if support then var = true end if data['admins'] then if data['admins'][tostring(user_id)] then var = true end end for v,user in pairs(_config.sudo_users) do if user == usert then var = true end end return var end -- Returns the name of the sender function kick_user_any(user_id, chat_id) local channel = 'channel#id'..chat_id local chat = 'chat#id'..chat_id local user = 'user#id'..user_id chat_del_user(chat, user, ok_cb, true) channel_kick(channel, user, ok_cb, false) end -- Returns the name of the sender function kick_user(user_id, chat_id) if tonumber(user_id) == tonumber(our_id) then -- Ignore bot return end if is_admin2(user_id) then -- Ignore admins return end local channel = 'channel#id'..chat_id local chat = 'chat#id'..chat_id local user = 'user#id'..user_id chat_del_user(chat, user, ok_cb, false) channel_kick(channel, user, ok_cb, false) end -- Ban function ban_user(user_id, chat_id) if tonumber(user_id) == tonumber(our_id) then -- Ignore bot return end if is_admin2(user_id) then -- Ignore admins return end -- Save to redis local hash = 'banned:'..chat_id redis:sadd(hash, user_id) -- Kick from chat kick_user(user_id, chat_id) end -- Global ban function banall_user(user_id) if tonumber(user_id) == tonumber(our_id) then -- Ignore bot return end if is_admin2(user_id) then -- Ignore admins return end -- Save to redis local hash = 'gbanned' redis:sadd(hash, user_id) end -- Global unban function unbanall_user(user_id) --Save on redis local hash = 'gbanned' redis:srem(hash, user_id) end -- Check if user_id is banned in chat_id or not function is_banned(user_id, chat_id) --Save on redis local hash = 'banned:'..chat_id local banned = redis:sismember(hash, user_id) return banned or false end -- Check if user_id is globally banned or not function is_gbanned(user_id) --Save on redis local hash = 'gbanned' local banned = redis:sismember(hash, user_id) return banned or false end -- Returns chat_id ban list function ban_list(chat_id) local hash = 'banned:'..chat_id local list = redis:smembers(hash) local text = "Ban list for: [ID: "..chat_id.." ]:\n\n" for k,v in pairs(list) do local user_info = redis:hgetall('user:'..v) if user_info and user_info.print_name then local print_name = string.gsub(user_info.print_name, "_", " ") local print_name = string.gsub(print_name, "‮", "") text = text..k.." - "..print_name.." ["..v.."]\n" else text = text..k.." - "..v.."\n" end end return text end -- Returns globally ban list function banall_list() local hash = 'gbanned' local list = redis:smembers(hash) local text = "Global bans!\n\n" for k,v in pairs(list) do local user_info = redis:hgetall('user:'..v) if user_info and user_info.print_name then local print_name = string.gsub(user_info.print_name, "_", " ") local print_name = string.gsub(print_name, "‮", "") text = text..k.." - "..print_name.." ["..v.."]\n" else text = text..k.." - "..v.."\n" end end return text end -- Support Team function support_add(support_id) -- Save to redis local hash = 'support' redis:sadd(hash, support_id) end function is_support(support_id) --Save on redis local hash = 'support' local support = redis:sismember(hash, support_id) return support or false end function support_remove(support_id) --Save on redis local hash = 'support' redis:srem(hash, support_id) end -- Whitelist function is_whitelisted(user_id) --Save on redis local hash = 'whitelist' local is_whitelisted = redis:sismember(hash, user_id) return is_whitelisted or false end --Begin Chat Mutes function set_mutes(chat_id) mutes = {[1]= "Audio: no",[2]= "Photo: no",[3]= "All: no",[4]="Documents: no",[5]="Text: no",[6]= "Video: no",[7]= "Gifs: no"} local hash = 'mute:'..chat_id for k,v in pairsByKeys(mutes) do setting = v redis:sadd(hash, setting) end end function has_mutes(chat_id) mutes = {[1]= "Audio: no",[2]= "Photo: no",[3]= "All: no",[4]="Documents: no",[5]="Text: no",[6]= "Video: no",[7]= "Gifs: no"} local hash = 'mute:'..chat_id for k,v in pairsByKeys(mutes) do setting = v local has_mutes = redis:sismember(hash, setting) return has_mutes or false end end function rem_mutes(chat_id) local hash = 'mute:'..chat_id redis:del(hash) end function mute(chat_id, msg_type) local hash = 'mute:'..chat_id local yes = "yes" local no = 'no' local old_setting = msg_type..': '..no local setting = msg_type..': '..yes redis:srem(hash, old_setting) redis:sadd(hash, setting) end function is_muted(chat_id, msg_type) local hash = 'mute:'..chat_id local setting = msg_type local muted = redis:sismember(hash, setting) return muted or false end function unmute(chat_id, msg_type) --Save on redis local hash = 'mute:'..chat_id local yes = 'yes' local no = 'no' local old_setting = msg_type..': '..yes local setting = msg_type..': '..no redis:srem(hash, old_setting) redis:sadd(hash, setting) end function mute_user(chat_id, user_id) local hash = 'mute_user:'..chat_id redis:sadd(hash, user_id) end function is_muted_user(chat_id, user_id) local hash = 'mute_user:'..chat_id local muted = redis:sismember(hash, user_id) return muted or false end function unmute_user(chat_id, user_id) --Save on redis local hash = 'mute_user:'..chat_id redis:srem(hash, user_id) end -- Returns chat_id mute list function mutes_list(chat_id) local hash = 'mute:'..chat_id local list = redis:smembers(hash) local text = "Mutes for: [ID: "..chat_id.." ]:\n\n" for k,v in pairsByKeys(list) do text = text.."Mute "..v.."\n" end return text end -- Returns chat_user mute list function muted_user_list(chat_id) local hash = 'mute_user:'..chat_id local list = redis:smembers(hash) local text = "Muted Users for: [ID: "..chat_id.." ]:\n\n" for k,v in pairsByKeys(list) do local user_info = redis:hgetall('user:'..v) if user_info and user_info.print_name then local print_name = string.gsub(user_info.print_name, "_", " ") local print_name = string.gsub(print_name, "‮", "") text = text..k.." - "..print_name.." ["..v.."]\n" else text = text..k.." - [ "..v.." ]\n" end end return text end --End Chat Mutes -- /id by reply function get_message_callback_id(extra, success, result) if type(result) == 'boolean' then print('Old message :(') return false end if result.to.type == 'chat' then local chat = 'chat#id'..result.to.peer_id send_large_msg(chat, result.from.peer_id) else return end end -- kick by reply for mods and owner function Kick_by_reply(extra, success, result) if type(result) == 'boolean' then print('Old message :(') return false end if result.to.type == 'chat' or result.to.type == 'channel' then local chat = 'chat#id'..result.to.peer_id if tonumber(result.from.peer_id) == tonumber(our_id) then -- Ignore bot return end if is_momod2(result.from.peer_id, result.to.peer_id) then -- Ignore mods,owner,admin return "you can't kick mods,owner and admins" end chat_del_user(chat, 'user#id'..result.from.peer_id, ok_cb, false) channel_kick(channel, 'user#id'..result.from.peer_id, ok_cb, false) else return end end -- Kick by reply for admins function Kick_by_reply_admins(extra, success, result) if type(result) == 'boolean' then print('Old message :(') return false end if result.to.type == 'chat' or result.to.type == 'channel' then local chat = 'chat#id'..result.to.peer_id local channel = 'channel#id'..result.to.peer_id if tonumber(result.from.peer_id) == tonumber(our_id) then -- Ignore bot return end if is_admin2(result.from.peer_id) then -- Ignore admins return end chat_del_user(chat, 'user#id'..result.from.peer_id, ok_cb, false) channel_kick(channel, 'user#id'..result.from.peer_id, ok_cb, false) else return end end --Ban by reply for admins function ban_by_reply(extra, success, result) if type(result) == 'boolean' then print('Old message :(') return false end if result.to.type == 'chat' or result.to.type == 'channel' then local chat = 'chat#id'..result.to.peer_id local channel = 'channel#id'..result.to.peer_id if tonumber(result.from.peer_id) == tonumber(our_id) then -- Ignore bot return end if is_momod2(result.from.peer_id, result.to.peer_id) then -- Ignore mods,owner,admin return "you can't kick mods,owner and admins" end ban_user(result.from.peer_id, result.to.peer_id) send_large_msg(chat, "User "..result.from.peer_id.." Banned") else return end end -- Ban by reply for admins function ban_by_reply_admins(extra, success, result) if type(result) == 'boolean' then print('Old message :(') return false end if result.to.peer_type == 'chat' or result.to.peer_type == 'channel' then local chat = 'chat#id'..result.to.peer_id local channel = 'channel#id'..result.to.peer_id if tonumber(result.from.peer_id) == tonumber(our_id) then -- Ignore bot return end if is_admin2(result.from.peer_id) then -- Ignore admins return end ban_user(result.from.peer_id, result.to.peer_id) send_large_msg(chat, "User "..result.from.peer_id.." Banned") send_large_msg(channel, "User "..result.from.peer_id.." Banned") else return end end
gpl-2.0
hafez16/senator
plugins/domaintools.lua
359
1494
local ltn12 = require "ltn12" local https = require "ssl.https" -- Edit data/mashape.lua with your Mashape API key -- http://docs.mashape.com/api-keys local mashape = load_from_file('data/mashape.lua', { api_key = '' }) local function check(name) local api = "https://domainsearch.p.mashape.com/index.php?" local param = "name="..name local url = api..param local api_key = mashape.api_key if api_key:isempty() then return 'Configure your Mashape API Key' end local headers = { ["X-Mashape-Key"] = api_key, ["Accept"] = "application/json" } local respbody = {} local body, code = https.request{ url = url, method = "GET", headers = headers, sink = ltn12.sink.table(respbody), protocol = "tlsv1" } if code ~= 200 then return code end local body = table.concat(respbody) local body = json:decode(body) --vardump(body) local domains = "List of domains for '"..name.."':\n" for k,v in pairs(body) do print(k) local status = " ❌ " if v == "Available" then status = " ✔ " end domains = domains..k..status.."\n" end return domains end local function run(msg, matches) if matches[1] == "check" then local name = matches[2] return check(name) end end return { description = "Domain tools", usage = {"!domain check [domain] : Check domain name availability.", }, patterns = { "^!domain (check) (.*)$", }, run = run }
gpl-2.0
omid1212/hgbok
plugins/domaintools.lua
359
1494
local ltn12 = require "ltn12" local https = require "ssl.https" -- Edit data/mashape.lua with your Mashape API key -- http://docs.mashape.com/api-keys local mashape = load_from_file('data/mashape.lua', { api_key = '' }) local function check(name) local api = "https://domainsearch.p.mashape.com/index.php?" local param = "name="..name local url = api..param local api_key = mashape.api_key if api_key:isempty() then return 'Configure your Mashape API Key' end local headers = { ["X-Mashape-Key"] = api_key, ["Accept"] = "application/json" } local respbody = {} local body, code = https.request{ url = url, method = "GET", headers = headers, sink = ltn12.sink.table(respbody), protocol = "tlsv1" } if code ~= 200 then return code end local body = table.concat(respbody) local body = json:decode(body) --vardump(body) local domains = "List of domains for '"..name.."':\n" for k,v in pairs(body) do print(k) local status = " ❌ " if v == "Available" then status = " ✔ " end domains = domains..k..status.."\n" end return domains end local function run(msg, matches) if matches[1] == "check" then local name = matches[2] return check(name) end end return { description = "Domain tools", usage = {"!domain check [domain] : Check domain name availability.", }, patterns = { "^!domain (check) (.*)$", }, run = run }
gpl-2.0
mirbot/zdgbbbrblsb-vbv
plugins/webshot.lua
919
1473
local helpers = require "OAuth.helpers" local base = 'https://screenshotmachine.com/' local url = base .. 'processor.php' local function get_webshot_url(param) local response_body = {} local request_constructor = { url = url, method = "GET", sink = ltn12.sink.table(response_body), headers = { referer = base, dnt = "1", origin = base, ["User-Agent"] = "Mozilla/5.0 (Windows NT 6.2; WOW64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/41.0.2272.101 Safari/537.36" }, redirect = false } local arguments = { urlparam = param, size = "FULL" } request_constructor.url = url .. "?" .. helpers.url_encode_arguments(arguments) local ok, response_code, response_headers, response_status_line = https.request(request_constructor) if not ok or response_code ~= 200 then return nil end local response = table.concat(response_body) return string.match(response, "href='(.-)'") end local function run(msg, matches) local find = get_webshot_url(matches[1]) if find then local imgurl = base .. find local receiver = get_receiver(msg) send_photo_from_url(receiver, imgurl) end end return { description = "Send an screenshot of a website.", usage = { "!webshot [url]: Take an screenshot of the web and send it back to you." }, patterns = { "^!webshot (https?://[%w-_%.%?%.:/%+=&]+)$", }, run = run }
gpl-2.0
mms92/wire
lua/entities/gmod_wire_expression2/core/angle.lua
10
10065
/******************************************************************************\ Angle support \******************************************************************************/ // wow... this is basically just vector-support, but renamed angle-support :P // pitch, yaw, roll registerType("angle", "a", { 0, 0, 0 }, function(self, input) return { input.p, input.y, input.r } end, function(self, output) return Angle(output[1], output[2], output[3]) end, function(retval) if !istable(retval) then error("Return value is not a table, but a "..type(retval).."!",0) end if #retval ~= 3 then error("Return value does not have exactly 3 entries!",0) end end, function(v) return !istable(v) or #v ~= 3 end ) local pi = math.pi local floor, ceil = math.floor, math.ceil /******************************************************************************/ __e2setcost(1) -- approximated e2function angle ang() return { 0, 0, 0 } end __e2setcost(2) e2function angle ang(rv1) return { rv1, rv1, rv1 } end e2function angle ang(rv1, rv2, rv3) return { rv1, rv2, rv3 } end // Convert Vector -> Angle e2function angle ang(vector rv1) return {rv1[1],rv1[2],rv1[3]} end /******************************************************************************/ registerOperator("ass", "a", "a", function(self, args) local op1, op2, scope = args[2], args[3], args[4] local rv2 = op2[1](self, op2) self.Scopes[scope][op1] = rv2 self.Scopes[scope].vclk[op1] = true return rv2 end) /******************************************************************************/ e2function number operator_is(angle rv1) if rv1[1] != 0 || rv1[2] != 0 || rv1[3] != 0 then return 1 else return 0 end end __e2setcost(3) e2function number operator==(angle rv1, angle rv2) if rv1[1] - rv2[1] <= delta && rv2[1] - rv1[1] <= delta && rv1[2] - rv2[2] <= delta && rv2[2] - rv1[2] <= delta && rv1[3] - rv2[3] <= delta && rv2[3] - rv1[3] <= delta then return 1 else return 0 end end e2function number operator!=(angle rv1, angle rv2) if rv1[1] - rv2[1] > delta || rv2[1] - rv1[1] > delta || rv1[2] - rv2[2] > delta || rv2[2] - rv1[2] > delta || rv1[3] - rv2[3] > delta || rv2[3] - rv1[3] > delta then return 1 else return 0 end end e2function number operator>=(angle rv1, angle rv2) if rv2[1] - rv1[1] <= delta && rv2[2] - rv1[2] <= delta && rv2[3] - rv1[3] <= delta then return 1 else return 0 end end e2function number operator<=(angle rv1, angle rv2) if rv1[1] - rv2[1] <= delta && rv1[2] - rv2[2] <= delta && rv1[3] - rv2[3] <= delta then return 1 else return 0 end end e2function number operator>(angle rv1, angle rv2) if rv1[1] - rv2[1] > delta && rv1[2] - rv2[2] > delta && rv1[3] - rv2[3] > delta then return 1 else return 0 end end e2function number operator<(angle rv1, angle rv2) if rv2[1] - rv1[1] > delta && rv2[2] - rv1[2] > delta && rv2[3] - rv1[3] > delta then return 1 else return 0 end end /******************************************************************************/ registerOperator("dlt", "a", "a", function(self, args) local op1, scope = args[2], args[3] local rv1, rv2 = self.Scopes[scope][op1], self.Scopes[scope]["$" .. op1] return { rv1[1] - rv2[1], rv1[2] - rv2[2], rv1[3] - rv2[3] } end) __e2setcost(2) e2function angle operator_neg(angle rv1) return { -rv1[1], -rv1[2], -rv1[3] } end e2function angle operator+(rv1, angle rv2) return { rv1 + rv2[1], rv1 + rv2[2], rv1 + rv2[3] } end e2function angle operator+(angle rv1, rv2) return { rv1[1] + rv2, rv1[2] + rv2, rv1[3] + rv2 } end e2function angle operator+(angle rv1, angle rv2) return { rv1[1] + rv2[1], rv1[2] + rv2[2], rv1[3] + rv2[3] } end e2function angle operator-(rv1, angle rv2) return { rv1 - rv2[1], rv1 - rv2[2], rv1 - rv2[3] } end e2function angle operator-(angle rv1, rv2) return { rv1[1] - rv2, rv1[2] - rv2, rv1[3] - rv2 } end e2function angle operator-(angle rv1, angle rv2) return { rv1[1] - rv2[1], rv1[2] - rv2[2], rv1[3] - rv2[3] } end e2function angle operator*(angle rv1, angle rv2) return { rv1[1] * rv2[1], rv1[2] * rv2[2], rv1[3] * rv2[3] } end e2function angle operator*(rv1, angle rv2) return { rv1 * rv2[1], rv1 * rv2[2], rv1 * rv2[3] } end e2function angle operator*(angle rv1, rv2) return { rv1[1] * rv2, rv1[2] * rv2, rv1[3] * rv2 } end e2function angle operator/(rv1, angle rv2) return { rv1 / rv2[1], rv1 / rv2[2], rv1 / rv2[3] } end e2function angle operator/(angle rv1, rv2) return { rv1[1] / rv2, rv1[2] / rv2, rv1[3] / rv2 } end e2function angle operator/(angle rv1, angle rv2) return { rv1[1] / rv2[1], rv1[2] / rv2[2], rv1[3] / rv2[3] } end e2function number angle:operator[](index) return this[floor(math.Clamp(index, 1, 3) + 0.5)] end e2function number angle:operator[](index, value) this[floor(math.Clamp(index, 1, 3) + 0.5)] = value return value end /******************************************************************************/ __e2setcost(5) e2function angle angnorm(angle rv1) return {(rv1[1] + 180) % 360 - 180,(rv1[2] + 180) % 360 - 180,(rv1[3] + 180) % 360 - 180} end e2function number angnorm(rv1) return (rv1 + 180) % 360 - 180 end __e2setcost(1) e2function number angle:pitch() return this[1] end e2function number angle:yaw() return this[2] end e2function number angle:roll() return this[3] end __e2setcost(2) // SET methods that returns angles e2function angle angle:setPitch(rv2) return { rv2, this[2], this[3] } end e2function angle angle:setYaw(rv2) return { this[1], rv2, this[3] } end e2function angle angle:setRoll(rv2) return { this[1], this[2], rv2 } end /******************************************************************************/ __e2setcost(5) e2function angle round(angle rv1) return { floor(rv1[1] + 0.5), floor(rv1[2] + 0.5), floor(rv1[3] + 0.5) } end e2function angle round(angle rv1, decimals) local shf = 10 ^ decimals return { floor(rv1[1] * shf + 0.5) / shf, floor(rv1[2] * shf + 0.5) / shf, floor(rv1[3] * shf + 0.5) / shf } end e2function angle ceil(angle rv1) return { ceil(rv1[1]), ceil(rv1[2]), ceil(rv1[3]) } end e2function angle ceil(angle rv1, decimals) local shf = 10 ^ decimals return { ceil(rv1[1] * shf) / shf, ceil(rv1[2] * shf) / shf, ceil(rv1[3] * shf) / shf } end e2function angle floor(angle rv1) return { floor(rv1[1]), floor(rv1[2]), floor(rv1[3]) } end e2function angle floor(angle rv1, decimals) local shf = 10 ^ decimals return { floor(rv1[1] * shf) / shf, floor(rv1[2] * shf) / shf, floor(rv1[3] * shf) / shf } end // Performs modulo on p,y,r separately e2function angle mod(angle rv1, rv2) local p,y,r if rv1[1] >= 0 then p = rv1[1] % rv2 else p = rv1[1] % -rv2 end if rv1[2] >= 0 then y = rv1[2] % rv2 else y = rv1[2] % -rv2 end if rv1[3] >= 0 then r = rv1[3] % rv2 else r = rv1[3] % -rv2 end return {p, y, r} end // Modulo where divisors are defined as an angle e2function angle mod(angle rv1, angle rv2) local p,y,r if rv1[1] >= 0 then p = rv1[1] % rv2[1] else p = rv1[1] % -rv2[1] end if rv1[2] >= 0 then y = rv1[2] % rv2[2] else y = rv1[2] % -rv2[2] end if rv1[3] >= 0 then y = rv1[3] % rv2[3] else y = rv1[3] % -rv2[3] end return {p, y, r} end // Clamp each p,y,r separately e2function angle clamp(angle rv1, rv2, rv3) local p,y,r if rv1[1] < rv2 then p = rv2 elseif rv1[1] > rv3 then p = rv3 else p = rv1[1] end if rv1[2] < rv2 then y = rv2 elseif rv1[2] > rv3 then y = rv3 else y = rv1[2] end if rv1[3] < rv2 then r = rv2 elseif rv1[3] > rv3 then r = rv3 else r = rv1[3] end return {p, y, r} end // Clamp according to limits defined by two min/max angles e2function angle clamp(angle rv1, angle rv2, angle rv3) local p,y,r if rv1[1] < rv2[1] then p = rv2[1] elseif rv1[1] > rv3[1] then p = rv3[1] else p = rv1[1] end if rv1[2] < rv2[2] then y = rv2[2] elseif rv1[2] > rv3[2] then y = rv3[2] else y = rv1[2] end if rv1[3] < rv2[3] then r = rv2[3] elseif rv1[3] > rv3[3] then r = rv3[3] else r = rv1[3] end return {p, y, r} end // Mix two angles by a given proportion (between 0 and 1) e2function angle mix(angle rv1, angle rv2, rv3) local p = rv1[1] * rv3 + rv2[1] * (1-rv3) local y = rv1[2] * rv3 + rv2[2] * (1-rv3) local r = rv1[3] * rv3 + rv2[3] * (1-rv3) return {p, y, r} end __e2setcost(2) // Circular shift function: shiftr( p,y,r ) = ( r,p,y ) e2function angle shiftR(angle rv1) return {rv1[3], rv1[1], rv1[2]} end e2function angle shiftL(angle rv1) return {rv1[2], rv1[3], rv1[1]} end __e2setcost(5) // Returns 1 if the angle lies between (or is equal to) the min/max angles e2function normal inrange(angle rv1, angle rv2, angle rv3) if rv1[1] < rv2[1] then return 0 end if rv1[2] < rv2[2] then return 0 end if rv1[3] < rv2[3] then return 0 end if rv1[1] > rv3[1] then return 0 end if rv1[2] > rv3[2] then return 0 end if rv1[3] > rv3[3] then return 0 end return 1 end // Rotate an angle around a vector by the given number of degrees e2function angle angle:rotateAroundAxis(vector axis, degrees) local ang = Angle(this[1], this[2], this[3]) local vec = Vector(axis[1], axis[2], axis[3]):GetNormal() ang:RotateAroundAxis(vec, degrees) return {ang.p, ang.y, ang.r} end // Convert the magnitude of the angle to radians e2function angle toRad(angle rv1) return {rv1[1] * pi / 180, rv1[2] * pi / 180, rv1[3] * pi / 180} end // Convert the magnitude of the angle to degrees e2function angle toDeg(angle rv1) return {rv1[1] * 180 / pi, rv1[2] * 180 / pi, rv1[3] * 180 / pi} end /******************************************************************************/ e2function vector angle:forward() return Angle(this[1], this[2], this[3]):Forward() end e2function vector angle:right() return Angle(this[1], this[2], this[3]):Right() end e2function vector angle:up() return Angle(this[1], this[2], this[3]):Up() end e2function string toString(angle a) return ("[%s,%s,%s]"):format(a[1],a[2],a[3]) end e2function string angle:toString() = e2function string toString(angle a)
apache-2.0
mirbot/zdgbbbrblsb-vbv
plugins/time.lua
771
2865
-- Implement a command !time [area] which uses -- 2 Google APIs to get the desired result: -- 1. Geocoding to get from area to a lat/long pair -- 2. Timezone to get the local time in that lat/long location -- Globals -- If you have a google api key for the geocoding/timezone api api_key = nil base_api = "https://maps.googleapis.com/maps/api" dateFormat = "%A %d %B - %H:%M:%S" -- Need the utc time for the google api function utctime() return os.time(os.date("!*t")) end -- Use the geocoding api to get the lattitude and longitude with accuracy specifier -- CHECKME: this seems to work without a key?? function get_latlong(area) local api = base_api .. "/geocode/json?" local parameters = "address=".. (URL.escape(area) or "") if api_key ~= nil then parameters = parameters .. "&key="..api_key end -- Do the request local res, code = https.request(api..parameters) if code ~=200 then return nil end local data = json:decode(res) if (data.status == "ZERO_RESULTS") then return nil end if (data.status == "OK") then -- Get the data lat = data.results[1].geometry.location.lat lng = data.results[1].geometry.location.lng acc = data.results[1].geometry.location_type types= data.results[1].types return lat,lng,acc,types end end -- Use timezone api to get the time in the lat, -- Note: this needs an API key function get_time(lat,lng) local api = base_api .. "/timezone/json?" -- Get a timestamp (server time is relevant here) local timestamp = utctime() local parameters = "location=" .. URL.escape(lat) .. "," .. URL.escape(lng) .. "&timestamp="..URL.escape(timestamp) if api_key ~=nil then parameters = parameters .. "&key="..api_key end local res,code = https.request(api..parameters) if code ~= 200 then return nil end local data = json:decode(res) if (data.status == "ZERO_RESULTS") then return nil end if (data.status == "OK") then -- Construct what we want -- The local time in the location is: -- timestamp + rawOffset + dstOffset local localTime = timestamp + data.rawOffset + data.dstOffset return localTime, data.timeZoneId end return localTime end function getformattedLocalTime(area) if area == nil then return "The time in nowhere is never" end lat,lng,acc = get_latlong(area) if lat == nil and lng == nil then return 'It seems that in "'..area..'" they do not have a concept of time.' end local localTime, timeZoneId = get_time(lat,lng) return "The local time in "..timeZoneId.." is: ".. os.date(dateFormat,localTime) end function run(msg, matches) return getformattedLocalTime(matches[1]) end return { description = "Displays the local time in an area", usage = "!time [area]: Displays the local time in that area", patterns = {"^!time (.*)$"}, run = run }
gpl-2.0
vipteam1/VIPTEAM
plugins/lock_emoji.lua
1
2756
--[[ ▀▄ ▄▀▀▄▄▀▀▄▄▀▀▄▄▀▀▄▄▀▀▄▄▀▀▄▄▀▀▄▀▄▄▀▀▄▄▀▀▄▄▀ ▀▄ ▄▀ ▀▄ ▄▀ ▀▄ ▄▀ Team name : ( 🌐 VIP_TEAM 🌐 )▀▄ ▄▀ ▀▄ ▄▀ ▀▄ ▄▀ ▀▄ ▄▀ File name : ( #اسم الملف هنا ) ▀▄ ▄▀ ▀▄ ▄▀ ▀▄ ▄▀ ▀▄ ▄▀ Guenat team: ( @VIP_TEAM1 ) ▀▄ ▄▀ ▀▄ ▄▀ ▀▄ ▄▀ ▀▄▀▀▄▄▀▀▄▄▀▄▄▀▀▄▄▀▀▄▄▀▄▄▀▀▄▄▀▀▄▄▀▄▄▀▀▄▄▀▀▄▄ —]] local function run(msg) local data = load_data(_config.moderation.data) if data[tostring(msg.to.id)]['settings']['emoji'] == 'yes' then if not is_momod(msg) then delete_msg(msg.id, ok_cb, true) end end end return {patterns = { "😞(.+)", "😞", "😐(.+)", "😐", "🙁(.+)", "🙁", "🌝(.+)", "🌝", "🤖(.+)", "🤖", "😲(.+)", "😲", "💋(.+)", "💋", "🙄(.+)", "🙄", "🤗(.+)", "🤗", "😱(.+)", "😱", "🤐(.+)", "🤐", "💩(.+)", "💩", "🌹(.+)", "🌹", "🖐(.+)", "🖐", "❤️(.+)", "❤️", "💗(.+)", "💗", "🤔(.+)", "🤔", "😖(.+)", "😖", "☹️(.+)", "☹️", "😔(.+)", "😔", "👾(.+)", "👾", "🚀(.+)", "🚀", "🌎🌍(.+)", "🌍", "🍦", "😸(.+)", "😺", "😯(.+)", "😯", "🤒(.+)", "🤒", "😷(.+)", "😷", "🙀(.+)", "🙀", "🎪(.+)", "🌚", "🌚(.+)", "😂", "😂(.+)", "😳", "😳(.+)", "😛", "😛(.+)", "😢", "😢(.+)", "😓", "😓(.+)", "😾", "😾(.+)", "👊🏻", "👊🏻(.+)", "✊🏻", "✊🏻(.+)", "👿", "👿(.+)", "👅", "👅(.+)", "🖕🏿", "🖕🏿(.+)", "😲", "😲(.+)", "👹", "👹(.+)", "😴", "😴(.+)", "☂", "☂(.+)", "🗣", "🗣(.+)", "⛄️", "⛄️(.+)", "😻", "😻(.+)", "😀(.+)", "😀", "😬(.+)", "😬", "😁(.+)", "😁", "😂(.+)", "😂", "😃(.+)", "😃", "😄(.+)", "😄", "😅", "😆(.+)", "😆", "😇(.+)", "😇", "😉(.+)", "😉", "😊(.+)", "😊", "🙂(.+)", "🙂", "🙃(.+)", "🙃", "☺️(.+)", "☺️", "😋(.+)", "😋", "😌", "😍(.+)", "😍", "😘(.+)", "😘", "😗(.+)", "😗", "😙(.+)", "😙", "😚(.+)", "😚", "😜(.+)", "😜", "😝(.+)", "😝", "🤑(.+)", "🤑", "🤓(.+)", "🤓", "😎(.+)", "😎", "🤗(.+)", "🤗", "😏(.+)", "😏", "😶(.+)", "😶", "😺(.+)", "😺", "😹", "😼", "😿", "🌝", "🌚", "🌶", "🖐🏼", },run = run}
gpl-2.0
sami2448/sam
plugins/wiki.lua
2
4097
-- http://git.io/vUA4M local socket = require "socket" local JSON = require "cjson" local wikiusage = { "!wiki [text]: Read extract from default Wikipedia (EN)", "!wiki(lang) [text]: Read extract from 'lang' Wikipedia. Example: !wikies hola", "!wiki search [text]: Search articles on default Wikipedia (EN)", "!wiki(lang) search [text]: Search articles on 'lang' Wikipedia. Example: !wikies search hola", } local Wikipedia = { -- http://meta.wikimedia.org/wiki/List_of_Wikipedias wiki_server = "https://%s.wikipedia.org", wiki_path = "/w/api.php", wiki_load_params = { action = "query", prop = "extracts", format = "json", exchars = 300, exsectionformat = "plain", explaintext = "", redirects = "" }, wiki_search_params = { action = "query", list = "search", srlimit = 20, format = "json", }, default_lang = "en", } function Wikipedia:getWikiServer(lang) return string.format(self.wiki_server, lang or self.default_lang) end --[[ -- return decoded JSON table from Wikipedia --]] function Wikipedia:loadPage(text, lang, intro, plain, is_search) local request, sink = {}, {} local query = "" local parsed if is_search then for k,v in pairs(self.wiki_search_params) do query = query .. k .. '=' .. v .. '&' end parsed = URL.parse(self:getWikiServer(lang)) parsed.path = self.wiki_path parsed.query = query .. "srsearch=" .. URL.escape(text) else self.wiki_load_params.explaintext = plain and "" or nil for k,v in pairs(self.wiki_load_params) do query = query .. k .. '=' .. v .. '&' end parsed = URL.parse(self:getWikiServer(lang)) parsed.path = self.wiki_path parsed.query = query .. "titles=" .. URL.escape(text) end -- HTTP request request['url'] = URL.build(parsed) print(request['url']) request['method'] = 'GET' request['sink'] = ltn12.sink.table(sink) local httpRequest = parsed.scheme == 'http' and http.request or https.request local code, headers, status = socket.skip(1, httpRequest(request)) if not headers or not sink then return nil end local content = table.concat(sink) if content ~= "" then local ok, result = pcall(JSON.decode, content) if ok and result then return result else return nil end else return nil end end -- extract intro passage in wiki page function Wikipedia:wikintro(text, lang) local result = self:loadPage(text, lang, true, true) if result and result.query then local query = result.query if query and query.normalized then text = query.normalized[1].to or text end local page = query.pages[next(query.pages)] if page and page.extract then return text..": "..page.extract else local text = "Extract not found for "..text text = text..'\n'..table.concat(wikiusage, '\n') return text end else return "Sorry an error happened" end end -- search for term in wiki function Wikipedia:wikisearch(text, lang) local result = self:loadPage(text, lang, true, true, true) if result and result.query then local titles = "" for i,item in pairs(result.query.search) do titles = titles .. "\n" .. item["title"] end titles = titles ~= "" and titles or "No results found" return titles else return "Sorry, an error occurred" end end local function run(msg, matches) -- TODO: Remember language (i18 on future version) -- TODO: Support for non Wikipedias but Mediawikis local search, term, lang if matches[1] == "search" then search = true term = matches[2] lang = nil elseif matches[2] == "search" then search = true term = matches[3] lang = matches[1] else term = matches[2] lang = matches[1] end if not term then term = lang lang = nil end if term == "" then local text = "Usage:\n" text = text..table.concat(wikiusage, '\n') return text end local result if search then result = Wikipedia:wikisearch(term, lang) else -- TODO: Show the link result = Wikipedia:wikintro(term, lang)
gpl-2.0
RobertoMalatesta/ProDBG
tundra.lua
1
4753
----------------------------------------------------------------------------------------------------------------------- local mac_opts = { "-Wall", "-I.", "-DPRODBG_MAC", "-Weverything", "-Werror", "-Wno-unknown-warning-option", "-Wno-c11-extensions", "-Wno-variadic-macros", "-Wno-c++98-compat-pedantic", "-Wno-old-style-cast", "-Wno-documentation", "-Wno-reserved-id-macro", "-Wno-missing-prototypes", "-Wno-deprecated-declarations", "-Wno-cast-qual", "-Wno-gnu-anonymous-struct", "-Wno-nested-anon-types", "-Wno-padded", "-Wno-c99-extensions", "-Wno-missing-field-initializers", "-Wno-weak-vtables", "-Wno-format-nonliteral", "-Wno-non-virtual-dtor", "-DOBJECT_DIR=\\\"$(OBJECTDIR)\\\"", { "-O0", "-g"; Config = "*-*-debug" }, { "-O3", "-g"; Config = "*-*-release" }, } local macosx = { Env = { CCOPTS = { mac_opts, }, CXXOPTS = { mac_opts, "-std=c++11", }, SHLIBOPTS = { "-lstdc++" }, PROGCOM = { "-lstdc++" }, BGFX_SHADERC = "$(OBJECTDIR)$(SEP)bgfx_shaderc$(PROGSUFFIX)", }, Frameworks = { "Cocoa" }, } local macosx_wx = { Env = { CCOPTS = { mac_opts, "-PRODBG_WX", }, CXXOPTS = { mac_opts, "-PRODBG_WX", }, }, Frameworks = { "Cocoa" }, } local macosx_test = { Env = { CCOPTS = { mac_opts, "-Wno-everything", "-coverage", }, CXXOPTS = { mac_opts, "-Wno-everything", "-coverage", "-std=c++11", }, SHLIBOPTS = { "-lstdc++", "-coverage" }, PROGCOM = { "-lstdc++", "-coverage" }, BGFX_SHADERC = "$(OBJECTDIR)$(SEP)bgfx_shaderc$(PROGSUFFIX)", }, Frameworks = { "Cocoa" }, } ----------------------------------------------------------------------------------------------------------------------- local gcc_opts = { "-I.", "-Wno-array-bounds", "-Wno-attributes", "-Wno-unused-value", "-DOBJECT_DIR=\\\"$(OBJECTDIR)\\\"", "-Wall", "-DPRODBG_UNIX", "-fPIC", { "-O0", "-g"; Config = "*-*-debug" }, { "-O3", "-g"; Config = "*-*-release" }, } local gcc_env = { Env = { CCOPTS = { gcc_opts, }, CXXOPTS = { gcc_opts, "-std=c++11", }, BGFX_SHADERC = "$(OBJECTDIR)$(SEP)bgfx_shaderc$(PROGSUFFIX)", }, ReplaceEnv = { PROGCOM = "$(LD) $(PROGOPTS) $(LIBPATH:p-L) -o $(@) -Wl,--start-group $(LIBS:p-l) $(<) -Wl,--end-group" }, } ----------------------------------------------------------------------------------------------------------------------- local win64_opts = { "/DPRODBG_WIN", "/EHsc", "/FS", "/MT", "/W3", "/I.", "/WX", "/DUNICODE", "/D_UNICODE", "/DWIN32", "/D_CRT_SECURE_NO_WARNINGS", "/wd4200", "/wd4152", "/wd4996", "/wd4389", "/wd4201", "/wd4152", "/wd4996", "/wd4389", "\"/DOBJECT_DIR=$(OBJECTDIR:#)\"", { "/Od"; Config = "*-*-debug" }, { "/O2"; Config = "*-*-release" }, } local win64 = { Env = { GENERATE_PDB = "1", CCOPTS = { win64_opts, }, CXXOPTS = { win64_opts, }, BGFX_SHADERC = "$(OBJECTDIR)$(SEP)bgfx_shaderc$(PROGSUFFIX)", OBJCCOM = "meh", }, } ----------------------------------------------------------------------------------------------------------------------- Build { Passes = { BuildTools = { Name="Build Tools", BuildOrder = 1 }, GenerateSources = { Name="Generate sources", BuildOrder = 2 }, }, Units = { "units.tools.lua", "units.libs.lua", "units.misc.lua", "units.plugins.lua", "units.prodbg.lua", "units.tests.lua", }, Configs = { Config { Name = "macosx-clang", DefaultOnHost = "macosx", Inherit = macosx, Tools = { "clang-osx" } }, Config { Name = "macosx_test-clang", SupportedHosts = { "macosx" }, Inherit = macosx_test, Tools = { "clang-osx" } }, Config { Name = "macosx_wx-clang", SupportedHosts = { "macosx" }, Inherit = macosx_test, Tools = { "clang-osx" } }, Config { Name = "win64-msvc", DefaultOnHost = { "windows" }, Inherit = win64, Tools = { { "msvc" }, "generic-asm" } }, Config { Name = "linux-gcc", DefaultOnHost = { "linux" }, Inherit = gcc_env, Tools = { "gcc" } }, }, IdeGenerationHints = { Msvc = { -- Remap config names to MSVC platform names (affects things like header scanning & debugging) PlatformMappings = { ['win64-msvc'] = 'x64', }, -- Remap variant names to MSVC friendly names VariantMappings = { ['release'] = 'Release', ['debug'] = 'Debug', }, }, MsvcSolutions = { ['ProDBG.sln'] = { } -- will get everything }, }, }
mit
mms92/wire
lua/entities/gmod_wire_fx_emitter.lua
10
3723
AddCSLuaFile() DEFINE_BASECLASS( "base_wire_entity" ) ENT.PrintName = "Wire FX Emitter" ENT.WireDebugName = "FX Emitter" function ENT:SetupDataTables() self:NetworkVar( "Bool", 0, "On" ) self:NetworkVar( "Int", 0, "Effect" ) self:NetworkVar( "Float", 0, "Delay" ) self:NetworkVar( "Vector", 0, "FXDir" ) end function ENT:GetFXPos() return self:GetPos() end -- Effect registration ENT.Effects = {} ENT.fxcount = 0 local fx_emitter = ENT ComboBox_Wire_FX_Emitter_Options = {} function AddFXEmitterEffect(name, func, nicename) fx_emitter.fxcount = fx_emitter.fxcount+1 // Maintain a global reference for these effects ComboBox_Wire_FX_Emitter_Options[name] = fx_emitter.fxcount if CLIENT then fx_emitter.Effects[fx_emitter.fxcount] = func language.Add( "wire_fx_emitter_"..name, nicename ) end end -- Modular effect adding.. stuff include( "wire/fx_emitter_default.lua" ) if CLIENT then ENT.Delay = 0.05 function ENT:Draw() // Don't draw if we are in camera mode local ply = LocalPlayer() local wep = ply:GetActiveWeapon() if ( wep:IsValid() ) then local weapon_name = wep:GetClass() if ( weapon_name == "gmod_camera" ) then return end end self.BaseClass.Draw( self ) end function ENT:Think() if not self:GetOn() then return end if ( self.Delay > CurTime() ) then return end self.Delay = CurTime() + self:GetDelay() local Effect = self:GetEffect() // Missing effect... replace it if possible :/ if ( !self.Effects[ Effect ] ) then if ( self.Effects[1] ) then Effect = 1 else return end end local Angle = self:GetAngles() local FXDir = self:GetFXDir() if FXDir and not FXDir:IsZero() then Angle = FXDir:Angle() else self:GetUp():Angle() end local FXPos = self:GetFXPos() if not FXPos or FXDir:IsZero() then FXPos=self:GetPos() + Angle:Forward() * 12 end local b, e = pcall( self.Effects[Effect], FXPos, Angle ) if (!b) then // Report the error Print(self.Effects) Print(FXPos) Print(Angle) Msg("Error in Emitter "..tostring(Effect).."\n -> "..tostring(e).."\n") // Remove the naughty function self.Effects[ Effect ] = nil end end return -- No more client end -- Server function ENT:Initialize() self:SetModel( "models/props_lab/tpplug.mdl" ) self:PhysicsInit( SOLID_VPHYSICS ) self:SetMoveType( MOVETYPE_VPHYSICS ) self:SetSolid( SOLID_VPHYSICS ) self:DrawShadow( false ) self:SetCollisionGroup( COLLISION_GROUP_WEAPON ) local phys = self:GetPhysicsObject() if phys:IsValid() then phys:Wake() end self.Inputs = WireLib.CreateInputs(self, {"On", "Effect", "Delay", "Direction [VECTOR]"}) end function ENT:Setup(delay, effect) if delay then self:SetDelay(delay) end if effect then self:SetEffect(effect) end end function ENT:TriggerInput( inputname, value, iter ) if inputname == "Direction" then self:SetFXDir(value:GetNormal()) elseif inputname == "Effect" then self:SetEffect(math.Clamp(value - value % 1, 1, self.fxcount)) elseif inputname == "On" then self:SetOn(value ~= 0) elseif inputname == "Delay" then self:SetDelay(math.Clamp(value, 0.05, 20)) --elseif (inputname == "Position") then -- removed for excessive mingability -- self:SetFXPos(value) end end function ENT:ApplyDupeInfo(ply, ent, info, GetEntByID) self.BaseClass.ApplyDupeInfo(self, ply, ent, info, GetEntByID) -- Old dupes stored this info here rather than as RegisterEntityClass vars if info.Effect then self:SetEffect(info.Effect) end if info.Delay then self:SetDelay(info.Delay) end end duplicator.RegisterEntityClass("gmod_wire_fx_emitter", WireLib.MakeWireEnt, "Data", "delay", "effect" ) -- Note: delay and effect are here for backwards compatibility, they're now stored in the DataTable
apache-2.0
uzlonewolf/proxmark3
client/scripts/formatMifare.lua
6
5285
local cmds = require('commands') local getopt = require('getopt') local bin = require('bin') local lib14a = require('read14a') local utils = require('utils') example =[[ 1. script run formatMifare 2. script run formatMifare -k aabbccddeeff -n 112233445566 -a FF0780 ]] author = "Iceman" usage = "script run formatMifare -k <key>" desc =[[ This script will generate 'hf mf wrbl' commands for each block to format a Mifare card. Alla datablocks gets 0x00 As default the script sets the keys A/B to 0xFFFFFFFFFFFF and the access bytes will become 0x78,0x77,0x88 The GDB will become 0x00 The script will skip the manufactoring block 0. Arguments: -h - this help -k <key> - the current six byte key with write access -n <key> - the new key that will be written to the card -a <access> - the new access bytes that will be written to the card ]] local TIMEOUT = 2000 -- Shouldn't take longer than 2 seconds local DEBUG = true -- the debug flag local CmdString = 'hf mf wrbl %d B %s %s' local numBlocks = 64 local numSectors = 16 --- -- A debug printout-function function dbg(args) if not DEBUG then return end if type(args) == "table" then local i = 1 while result[i] do dbg(result[i]) i = i+1 end else print("###", args) end end --- -- This is only meant to be used when errors occur function oops(err) print("ERROR: ",err) end --- -- Usage help function help() print(desc) print("Example usage") print(example) end -- -- Exit message function ExitMsg(msg) print( string.rep('--',20) ) print( string.rep('--',20) ) print(msg) print() end -- -- Read information from a card function GetCardInfo() result, err = lib14a.read14443a(false, true) if not result then print(err) return end print(("Found: %s"):format(result.name)) core.clearCommandBuffer() if 0x18 == result.sak then -- NXP MIFARE Classic 4k | Plus 4k -- IFARE Classic 4K offers 4096 bytes split into forty sectors, -- of which 32 are same size as in the 1K with eight more that are quadruple size sectors. numSectors = 40 elseif 0x08 == result.sak then -- NXP MIFARE CLASSIC 1k | Plus 2k -- 1K offers 1024 bytes of data storage, split into 16 sector numSectors = 16 elseif 0x09 == result.sak then -- NXP MIFARE Mini 0.3k -- MIFARE Classic mini offers 320 bytes split into five sectors. numSectors = 5 elseif 0x10 == result.sak then -- NXP MIFARE Plus 2k numSectors = 32 elseif 0x01 == result.sak then -- NXP MIFARE TNP3xxx 1K numSectors = 16 else print("I don't know how many sectors there are on this type of card, defaulting to 16") end --[[ The mifare Classic 1k card has 16 sectors of 4 data blocks each. The first 32 sectors of a mifare Classic 4k card consists of 4 data blocks and the remaining 8 sectors consist of 16 data blocks. --]] -- Defaults to 16 * 4 = 64 - 1 = 63 numBlocks = numSectors * 4 - 1 if numSectors > 32 then numBlocks = 32*4+ (numSectors-32)*16 -1 end end local function main(args) print( string.rep('--',20) ) print( string.rep('--',20) ) print() local OldKey local NewKey local Accessbytes -- Arguments for the script for o, a in getopt.getopt(args, 'hk:n:a:') do if o == "h" then return help() end if o == "k" then OldKey = a end if o == "n" then NewKey = a end if o == "a" then Accessbytes = a end end -- validate input args. OldKey = OldKey or 'FFFFFFFFFFFF' if #(OldKey) ~= 12 then return oops( string.format('Wrong length of write key (was %d) expected 12', #OldKey)) end NewKey = NewKey or 'FFFFFFFFFFFF' if #(NewKey) ~= 12 then return oops( string.format('Wrong length of new key (was %d) expected 12', #NewKey)) end --Accessbytes = Accessbytes or '787788' Accessbytes = Accessbytes or 'FF0780' if #(Accessbytes) ~= 6 then return oops( string.format('Wrong length of accessbytes (was %d) expected 12', #Accessbytes)) end GetCardInfo() -- Show info print( string.format('Estimating number of blocks: %d', numBlocks)) print( string.format('Old key: %s', OldKey)) print( string.format('New key: %s', NewKey)) print( string.format('New Access: %s', Accessbytes)) print( string.rep('--',20) ) -- Set new block data local EMPTY_BL = string.rep('00',16) local EMPTY_SECTORTRAIL = string.format('%s%s%s%s',NewKey,Accessbytes,'00',NewKey) dbg( string.format('New sector-trailer : %s',EMPTY_SECTORTRAIL)) dbg( string.format('New emptyblock: %s',EMPTY_BL)) dbg('') -- Ask local dialogResult = utils.confirm("Do you want to erase this card") if dialogResult == false then return ExitMsg('Quiting it is then. Your wish is my command...') end print( string.rep('--',20) ) -- main loop for block=0,numBlocks,1 do local reminder = (block+1) % 4 local cmd if reminder == 0 then cmd = CmdString:format(block, OldKey , EMPTY_SECTORTRAIL) else cmd = CmdString:format(block, OldKey , EMPTY_BL) end if block ~= 0 then print(cmd) --core.console(cmd) end if core.ukbhit() then print("aborted by user") break end end end main(args)
gpl-2.0
DJDaemonix/Roboports-Extended
prototypes/roboports/roboport-mk2.lua
1
6047
data:extend ( { { type = "roboport", name = "roboport-mk2", icon = "__base__/graphics/icons/roboport.png", icon_size = 32, flags = {"placeable-player", "player-creation"}, minable = {hardness = 0.2, mining_time = 0.5, result = "roboport-mk2"}, max_health = 750, corpse = "big-remnants", collision_box = {{-1.7, -1.7}, {1.7, 1.7}}, selection_box = {{-2, -2}, {2, 2}}, resistances = { { type = "fire", percent = 60 }, { type = "impact", percent = 30 } }, dying_explosion = "medium-explosion", energy_source = { type = "electric", usage_priority = "secondary-input", input_flow_limit = "10MW", buffer_capacity = "200MJ" }, recharge_minimum = "60MJ", energy_usage = "75kW", -- per one charge slot charging_energy = "1500kW", logistics_radius = 50, construction_radius = 110, charge_approach_distance = 5, robot_slots_count = 10, material_slots_count = 10, stationing_offset = {0, 0}, charging_offsets = { {-1.5, -0.5}, {1.5, -0.5}, {1.5, 1.5}, {-1.5, 1.5}, }, base = { layers = { { filename = "__base__/graphics/entity/roboport/roboport-base.png", width = 143, height = 135, shift = {0.5, 0.25}, hr_version = { filename = "__base__/graphics/entity/roboport/hr-roboport-base.png", width = 228, height = 277, shift = util.by_pixel(2, 7.75), scale = 0.5 } }, { filename = "__base__/graphics/entity/roboport/roboport-shadow.png", width = 147, height = 102, draw_as_shadow = true, shift = util.by_pixel(28.5, 19.25), hr_version = { filename = "__base__/graphics/entity/roboport/hr-roboport-shadow.png", width = 294, height = 201, draw_as_shadow = true, shift = util.by_pixel(28.5, 19.25), scale = 0.5 } } } }, base_patch = { filename = "__base__/graphics/entity/roboport/roboport-base-patch.png", priority = "medium", width = 69, height = 50, frame_count = 1, shift = {0.03125, 0.203125}, hr_version = { filename = "__base__/graphics/entity/roboport/hr-roboport-base-patch.png", priority = "medium", width = 138, height = 100, frame_count = 1, shift = util.by_pixel(1.5, 5), scale = 0.5 } }, base_animation = { filename = "__base__/graphics/entity/roboport/roboport-base-animation.png", priority = "medium", width = 42, height = 31, frame_count = 8, animation_speed = 0.5, shift = {-0.5315, -1.9375}, hr_version = { filename = "__base__/graphics/entity/roboport/hr-roboport-base-animation.png", priority = "medium", width = 83, height = 59, frame_count = 8, animation_speed = 0.5, shift = util.by_pixel(-17.75, -61.25), scale = 0.5 } }, door_animation_up = { filename = "__base__/graphics/entity/roboport/roboport-door-up.png", priority = "medium", width = 52, height = 20, frame_count = 16, shift = {0.015625, -0.890625}, hr_version = { filename = "__base__/graphics/entity/roboport/hr-roboport-door-up.png", priority = "medium", width = 97, height = 38, frame_count = 16, shift = util.by_pixel(-0.25, -29.5), scale = 0.5 } }, door_animation_down = { filename = "__base__/graphics/entity/roboport/roboport-door-down.png", priority = "medium", width = 52, height = 22, frame_count = 16, shift = {0.015625, -0.234375}, hr_version = { filename = "__base__/graphics/entity/roboport/hr-roboport-door-down.png", priority = "medium", width = 97, height = 41, frame_count = 16, shift = util.by_pixel(-0.25,-9.75), scale = 0.5 } }, recharging_animation = { filename = "__base__/graphics/entity/roboport/roboport-recharging.png", priority = "high", width = 37, height = 35, frame_count = 16, scale = 1.5, animation_speed = 0.5 }, vehicle_impact_sound = { filename = "__base__/sound/car-metal-impact.ogg", volume = 0.65 }, working_sound = { sound = { filename = "__base__/sound/roboport-working.ogg", volume = 0.6 }, max_sounds_per_type = 3, audible_distance_modifier = 0.5, probability = 1 / (5 * 60) -- average pause between the sound is 5 seconds }, recharging_light = {intensity = 0.4, size = 5, color = {r = 1.0, g = 1.0, b = 1.0}}, request_to_open_door_timeout = 15, spawn_and_station_height = -0.1, draw_logistic_radius_visualization = true, draw_construction_radius_visualization = true, open_door_trigger_effect = { { type = "play-sound", sound = { filename = "__base__/sound/roboport-door.ogg", volume = 1.2 } }, }, close_door_trigger_effect = { { type = "play-sound", sound = { filename = "__base__/sound/roboport-door.ogg", volume = 0.75 } }, }, circuit_wire_connection_point = circuit_connector_definitions["roboport"].points, circuit_connector_sprites = circuit_connector_definitions["roboport"].sprites, circuit_wire_max_distance = default_circuit_wire_max_distance, default_available_logistic_output_signal = {type = "virtual", name = "signal-X"}, default_total_logistic_output_signal = {type = "virtual", name = "signal-Y"}, default_available_construction_output_signal = {type = "virtual", name = "signal-Z"}, default_total_construction_output_signal = {type = "virtual", name = "signal-T"}, }, } )
gpl-3.0