Split (1)

train · 27.3k rows

text stringlengths 1.4k 8.19k	meta dict
. Give 7o(y) + 2w(y). y*3 - y Suppose 5r - 3y + 27 = 0, 2r + 4y + 9 = 7y. Let o(w) = 4w3 + w - 3. Let m(q) = 3q*3 - 2. Calculate rm(t) + 4o(t). -2t*3 + 4t Let o(g) = 2g2 + g + 2. Suppose -1 = -2x + 1. Let p = x - -1. Let z(m) = -1 + 0mp + m2 - 2m*2. Give 2o(u) + 6z(u). -2u*2 + 2u - 2 Let m(v) = 11v2 - 8. Suppose -21 + 4 = -j. Suppose -j = 2k - 1. Let d(x) = 7x2 - 5. Determine kd(y) + 5m(y). -y2 Let l(n) = 4n + 3. Let m(u) = 7u + 5. Let z(a) = -a2 + 8a - 9. Let c be z(8). Let w be (-3)/2(-18)/c. Determine wm(f) + 5l(f). -f Let m(b) = 7b*2 + 3. Suppose -6a + 4i = -5a - 12, 155 = 5a - i. Let o(u) = 76u*2 + 32. Determine am(l) - 3o(l). -4l2 Let y(d) be the first derivative of d3/3 + d*2/2 - 7d - 41. Let c(j) = j - 6. Determine 5c(p) - 4y(p). -4p2 + p - 2 Let c(n) = -67n*3 + 6n*2 - 6n. Let l(s) = -671s3 + 61s*2 - 61s. Calculate -61c(t) + 6l(t). 61t3 Let y(j) = -j3 - j2 - j. Let z(i) = 4i*3 + 3i*2 + 3i. Let r = 99 - 96. Give ry(g) + z(g). g3 Let s(l) = -12l*2 - 4l. Let k(y) = 6y2 + 2y. Give 10k(n) + 4s(n). 12n2 + 4n Let w(m) = -2m2 - 5. Let z be ((-2)/6)/((-1)/6). Let h(x) = -xz - 4 + 5 - 4. Let l(y) = y2 - 3y - 7. Let b be l(5). Calculate bw(c) - 5h(c). -c*2 Let c(z) = -2z*3. Let k = 16 + -18. Let d(x) = -10x*3. Determine kd(v) + 11c(v). -2v*3 Let n = -8 - -12. Let k(j) = 2j. Let o(d) = 4d. Let h(p) = 4p. Let y(x) = 5h(x) - 4o(x). Give ny(q) - 9k(q). -2q Let k(d) = -1. Let z(h) = h - 3. Let r = 2 + -1. Let w = r + -3. What is wz(i) + 5k(i)? -2i + 1 Let z(b) = -b*3 + b + 1. Let o(v) = 27v*3 - 3v - 3. Give o(g) + 3z(g). 24g*3 Let p(w) = 8w*2 - 12w + 1. Let r(u) = 9u2 - 13u + 1. What is 7p(g) - 6r(g)? 2g2 - 6g + 1 Let r(s) = 55s. Let d(p) = -18p. Calculate -8d(c) - 3r(c). -21c Let u(r) = 38r - 1. Let x(p) = 115p - 4. Determine -7u(h) + 2x(h). -36h - 1 Let x(l) be the first derivative of 2l2 + 1. Let h(i) be the third derivative of 5i*4/24 + 12i*2. Calculate 2h(q) - 3x(q). -2q Let c(m) = -1. Let d(k) = k*2 + k - 2. Give -4c(p) + 3d(p). 3p*2 + 3p - 2 Let w(h) = 6h3 - 3h*2 + 3h. Let d(o) = o3 + o2 - o. Calculate -6d(x) - 2w(x). -18x3 Let j(f) = -2f*3 - 3f*2 + 3f + 2. Let w(v) = v*2 - v - 1. Give -j(s) - 2w(s). 2s3 + s2 - s Let o be ((-15)/(-3) + -3)4. Let u = o + -13. Let l(q) = -4q3 - 5q*2 + 5q + 5. Let y(t) = -3t3 - 4t*2 + 4t + 4. What is uy(x) + 4l(x)? -x*3 Suppose 0 = -2x - 2i - 4, -5x - 26 = i. Let o(r) = r + 4. Let d(s) = s + 3. Calculate xd(j) + 5o(j). -j + 2 Let p(n) = -2n - 3. Let s(m) = -m2 + 2m + 2. Give 2p(j) + 3s(j). -3j2 + 2j Let p(j) = -27j3 + 9j*2 + 9j - 9. Let f(x) = -x3 + x2 + x - 1. What is 9f(q) - p(q)? 18q*3 Let t(v) = -v. Let j(d) = -7d*3 + 6d. Calculate j(h) + 6t(h). -7h*3 Let d(x) = -25x*2 - 40x - 40. Let y(v) be the first derivative of 2v3/3 + 3v*2/2 + 3v + 14. Calculate -3d(h) - 40y(h). -5h2 Let c(b) be the third derivative of b6/120 - b3/3 - b2. Let l(p) = -3p*3 + 5. Give -5c(n) - 2l(n). n3 Let w(g) = 16 - 14g - 1 + 2. Let y(v) = v + 4. Let c(a) = 8a + 6. Let m(q) = -c(q) + 3y(q). Calculate 17m(i) - 6w(i). -i Suppose 3a - 4o - 16 = 5a, -4a = -4o - 28. Let i(x) = x + 11. Let j be i(-8). Let g(t) = -4t - 2. Let u(c) = 7 + 3c - 5 + 0. What is ag(p) + ju(p)? p + 2 Let b(t) = 5t - 3. Let x(o) = 14o - 8. Let j be 66/4(-4)/(-6). Let m(w) = -w - 11. Let u = -11 + 4. Let h be m(u). Give hx(r) + jb(r). -r - 1 Let w(n) be the second derivative of -n*4/3 - 7n*3/6 - 16n. Let k(i) = -6i2 - 11i. Let x = -7 + 15. Calculate xw(h) - 5k(h). -2h2 - h Let x(q) = -3q + 1. Let s(k) = k - 4. Let o(m) = -2s(m) + 6x(m). Let z(c) = -7c + 5. Give 4o(g) - 11z(g). -3g + 1 Let f(b) = 2b3 - b2 - 5b. Let i(y) = -y3 + y2 + 5y - 1. Give 2f(x) + 3i(x). x3 + x2 + 5x - 3 Let a(o) be the second derivative of o5/20 + o4/3 - 2o3/3 - 3o*2 + 3o. Let f(j) = -3j3 - 11j*2 + 11j + 17. Give 17a(k) + 6f(k). -k*3 + 2k*2 - 2k Let z(w) = 11w2 + 11w. Let a(q) = 7q2 + 2q - 5. Let h(j) = -22j2 - 6j + 16. Let i(r) = 16a(r) + 5h(r). Calculate 34i(b) - 6z(b). 2b2 + 2b Let k(t) = 13t. Let n(o) = 7o. What is -3k(q) + 5n(q)? -4q Let g(w) = -3w*2 + 2w - 4. Let h(t) = 6t2 - 4t + 8. Calculate 5g(b) + 3h(b). 3b2 - 2b + 4 Let z(n) = -4n - 3. Let m(g) = g2 - 12g - 11. Let i be m(13). Let s(v) = -9v - 7. What is is(p) - 5z(p)? 2p + 1 Let q(u) = -3u3 + 3. Let k(m) = -m3 + m + 1. Give 5k(a) - q(a). -2a3 + 5a + 2 Let m(d) be the second derivative of d*3/6 - 2d. Let c(x) = -2x + 1. Give -c(z) + 2m(z). 4z - 1 Let i(o) = 3o*3 + 2o + 5. Let f(g) = 3g3 + 2g + 6. What is -3f(j) + 4i(j)? 3j3 + 2j + 2 Let g(k) = 2k2 - 3k - 6. Let s(j) = j - 1. Calculate -g(v) - 4s(v). -2v2 - v + 10 Let x(i) = -i3 - i2 - i. Let u(l) = -l3 + 2l2 + 3l - 2. Calculate u(t) + 3x(t). -4t3 - t2 - 2 Let o(r) = 2r3 - 3r*2 + 3r + 3. Let x(w) = 3w3 - 5w*2 + 5w + 5. Suppose 5d + 12 = d. What is dx(z) + 5o(z)? z3 Suppose -4 + 0 = -4h. Let k(v) = -2v + 4. Let n(c) = 2c*3 - 2c*2 - c - 2. Let p be n(2). Let a(b) = 6b + 0b - 6b - 1 + b. Give hk(o) + pa(o). 2o Let d(q) = -2q - 5. Let b(c) be the third derivative of c*3/6 + 4c*2. Calculate 3b(v) + d(v). -2v - 2 Let g be 0 + 3 + 8/4. Let j be 4/(-10) + 27/5. Suppose -22 = d + gr - r, 0 = jd - 3r - 5. Let x(l) = -2. Let q(m) = m*2 - m - 10. Give dq(z) + 11x(z). -2z*2 + 2z - 2 Let b(f) be the first derivative of f + 1/2f2 - 1. Let k(g) = 1. Let r(i) = -4i - 5. Let p(n) = -2k(n) - r(n). Determine 14b(m) - 4p(m). -2m + 2 Let m(g) = 2g2 + 2. Let u(j) = -10j. Let w be u(-1). Let v = w + -5. Let z(t) = -t*3 + 5t*2 + 5. Give vm(r) - 2z(r). 2r3 Let z(n) = n2 + n. Let h(a) = -9a - 2. Determine -h(s) - 3z(s). -3s2 + 6s + 2 Suppose -13x = -32 + 6. Let z(d) = 2d*2 + 2d - 2. Let r(v) = -8v2 - 8v + 9. Calculate xr(g) + 9z(g). 2g2 + 2g Let s(g) = -3g3 + 8g*2 - 7g. Let c(u) = -u*3 + 4u*2 - 4u. Determine 5c(v) - 2s(v). v*3 + 4v*2 - 6v Let k(m) = 15m3 - 6m*2 + 4m + 4. Let s(l) = -14l3 + 5l*2 - 3l - 3. Give 3k(a) + 4s(a). -11a3 + 2a*2 Let u(x) = -17x + 19. Let s(t) = -17t + 17. Let m(c) = 4s(c) - 3u(c). Let p(y) = -6y + 4. Calculate -4m(j) + 11p(j). 2j Let p(r) be the third derivative of -r3/2 - 2r2. Let o(h) be the second derivative of -h3/6 - h*2 + 3h + 1. Determine -3o(g) + 2p(g). 3g Let j(r) = -17r*3 + 5r*2 - 7r. Let m(o) = 8o3 - 2o*2 + 3o. Determine 3j(f) + 7m(f). 5f3 + f2 Let v(a) = -a3 - 1. Suppose 2 = -0w + w. Let l(m) = -m3 + m2 - 2m - 2. Calculate wv(y) - l(y). -y3 - y2 + 2y Let z(a) be the first derivative of -2a*3/3 + 2a*2 + 3a + 1. Let c(m) = 2m - 9 - 11m + 4m2 + 2 + 0m*2. Calculate -3c(u) - 7z(u). 2u*2 - u Let u(r) = -42r - 7. Let a(k) = -41k - 6. Determine -7a(v) + 6u(v). 35v Let z(j) = j + 1. Let a(x) = 4x + 2. Calculate -3a(v) + 8z(v). -4v + 2 Let f(t) = 6t + 2. Let z(p) = -15p - 6. Let s(a) = 10a + 4. Let w(x) = 8s(x) + 5z(x). What is 6f(l) - 7w(l)? l - 2 Suppose 0 = 2d - 3w + 7, 4d + 22 = w - 3w. Let r(s) = -5s + 1. Suppose -3v = 2m - 12, -2m = -0v - v - 4. Let p(f) = -9f + 1. What is dr(c) + mp(c)? -2c - 2 Let f(b) = 2b2 - 4. Let n(z) = 1 + 7z*2 + 6z*2 - 14z*2. Determine f(t) + 4n(t). -2t2 Let l(c) be the third derivative of 0c*4 + 0 + 1/3c*3 + 0c - 1/60c5 + 2c*2. Suppose 0 = 2v + 18 - 0. Let b(d) = 5d2 - 9. What is vl(x) - 2b(x)? -x2 Let w(j) = -j + 5. Let v(s) = s - 6. Let y be (1/2)/((-4)/(-40)). What is yw(i) + 4v(i)? -i + 1 Suppose -6 = -a + 2a. Let m(b) = b*2 + 4b - 6. Let p(t) be the first derivative of t*3 + 11t*2/2 - 17t - 14. Calculate ap(z) + 17m(z). -z*2 + 2z Let s(h) = -3h2 - 7h - 31. Let d(n) = 2n2 + 5n + 21. What is -7d(u) - 5s(u)? u*2 + 8 Let s(a) be the second derivative of -4a*3/3 - 3a*2 - 4a. Let w(i) = 14i + 5. Let m(u) = 7u + 3.	{ "pile_set_name": "DM Mathematics" }
11/3 = 0? -1/14, 22 Factor 4g3/5 - 1188g*2/5 + 89964g/5 - 259308/5. 4(g - 147)2(g - 3)/5 Factor -2s3 - 1164s*2 + 2334s - 1168. -2(s - 1)2(s + 584) Let 4s4 + 408s*3 + 804s*2 + 400s = 0. What is s? -100, -1, 0 Factor -2b2/3 - 88b/3 + 30. -2(b - 1)(b + 45)/3 Factor 2q5/13 - 270q*3/13 - 540q*2/13 + 9720q/13 + 34992/13. 2(q - 9)2(q + 6)*3/13 Factor -2v*2 - 8v/7. -2v(7v + 4)/7 Determine z so that z2/8 + 777z/4 - 389 = 0. -1556, 2 Factor 4x3 + 16x*2 + 12x. 4x(x + 1)(x + 3) Let -k2 - 42k - 41 = 0. What is k? -41, -1 Determine l, given that 5l5 - 5l*4 - 25l*3 + 25l*2 + 20l - 20 = 0. -2, -1, 1, 2 Find w such that -4w5/7 - 12w*4 - 432w*3/7 = 0. -12, -9, 0 Factor -12k*3/7 - 1143k*2/7 - 285k/7. -3k(k + 95)(4k + 1)/7 Find r, given that -12r5 - 116r*4 - 104r*3 + 528r*2 + 608r - 256 = 0. -8, -2, 1/3, 2 Determine l, given that 14l5/3 + 220l*4/3 - 64l*3/3 = 0. -16, 0, 2/7 Solve 160v*2 + 44v - 8 = 0 for v. -2/5, 1/8 Suppose 5n5 - 60n*4 - 220n*3 + 2400n*2 + 8000n = 0. What is n? -4, 0, 10 Factor 3t4 + 444t*3 + 426t*2 - 2196t + 1323. 3(t - 1)2(t + 3)(t + 147) Factor 12f*4 + 51f*3 - 912f*2 - 231f. 3f(f - 7)(f + 11)(4f + 1) Find h such that -3h*4/4 - 33h*3/4 - 18h*2 + 27h = 0. -6, 0, 1 Factor -s*2/3 + 23s/3 + 376. -(s - 47)(s + 24)/3 Factor 3c*2 + 147c + 774. 3(c + 6)(c + 43) Factor -4m3 + 8m*2 + 116m + 168. -4(m - 7)(m + 2)(m + 3) Factor 3r*3 - 255r*2 - 519r - 261. 3(r - 87)(r + 1)*2 Factor 5x*3 + 790x*2 - 1595x + 800. 5(x - 1)2(x + 160) Solve 78y2/5 + y/5 = 0 for y. -1/78, 0 Determine d, given that -3d*3 + 1770d*2 - 3528d = 0. 0, 2, 588 Factor 2n3 - 40n*2 - 42n. 2n(n - 21)(n + 1) Determine g so that g3/7 + 58g*2/7 + 16g = 0. -56, -2, 0 Find l, given that -2l3/9 + 10l*2/9 - 8l/9 = 0. 0, 1, 4 Factor q*3 + 3q*2 - 10q. q(q - 2)(q + 5) Factor 2v3 - 54v*2 + 192v - 184. 2(v - 23)(v - 2)*2 Solve -3z*2/5 - 231z + 3492/5 = 0 for z. -388, 3 Suppose -4b2 - 28b = 0. What is b? -7, 0 Factor 2i3 + 58i*2 - 560i + 1184. 2(i - 4)2(i + 37) Let 36m5/5 + 1308m*4/5 + 5152m*3/5 + 5168m*2/5 + 1536m/5 = 0. What is m? -32, -3, -2/3, 0 Find j such that j*5/3 + 8j*4/3 - 32j*3/3 + 14j*2/3 + 31j/3 - 22/3 = 0. -11, -1, 1, 2 Solve 14y3/5 + 18y*2/5 - 62y/5 + 6 = 0. -3, 5/7, 1 Factor r*3/2 + 11r*2/2 + 13r + 8. (r + 1)(r + 2)(r + 8)/2 Determine i so that 4i5 + 68i*4 + 376i*3 + 704i*2 - 128i - 1024 = 0. -8, -4, -2, 1 Factor -2n2/5 + 2n/5 + 12. -2(n - 6)(n + 5)/5 Solve 2f4/17 - 228f*3/17 + 7144f*2/17 - 2160f + 46656/17 = 0 for f. 2, 4, 54 Factor -4c4 - 432c*3 + 1324c*2 - 888c. -4c(c - 2)(c - 1)(c + 111) Let -36c4 - 172c*3 + 1552c*2 + 4848c - 1152 = 0. Calculate c. -8, -3, 2/9, 6 Factor 2j3 + 396j*2. 2j*2(j + 198) Find r such that -2r5 + 40r*4 - 96r*3 - 116r*2 + 226r + 204 = 0. -1, 2, 3, 17 Factor -f*2/3 + 17f/3 + 38/3. -(f - 19)(f + 2)/3 Factor -4d*4 + 92d*3 - 393d*2 + 612d - 324. -(d - 18)(d - 2)(2d - 3)2 What is b in -2b*4 - 4b*3 + 14b*2 - 8b = 0? -4, 0, 1 Factor -v5/8 + v4/2 - 3v3/8. -v3(v - 3)(v - 1)/8 Find v such that -v2 + 3v + 270 = 0. -15, 18 Factor -2k2 - 1844k - 425042. -2(k + 461)2 Suppose 60k*4 - 219k*3 + 288k*2 - 159k + 30 = 0. What is k? 2/5, 1, 5/4 Factor -4w5 - 20w*4 - 24w*3 + 8w*2 + 28w + 12. -4(w - 1)(w + 1)*3(w + 3) Solve -8a4/17 - 50a*3/17 + 54a*2/17 + 74a/17 - 70/17 = 0 for a. -7, -5/4, 1 Determine j, given that -j*5/5 + 4j*4/5 - 6j*3/5 + 4j*2/5 - j/5 = 0. 0, 1 Solve 4k*3 + 144k*2 - 156k - 296 = 0 for k. -37, -1, 2 Let -2a5/11 + 14a*4/11 + 2a*3 - 46a*2/11 - 20a/11 + 32/11 = 0. Calculate a. -2, -1, 1, 8 Solve 3c2 - 60c = 0. 0, 20 Factor -5g5 + 55g*4. -5g*4(g - 11) Solve -f*5 + 42f*4 - 481f*3 + 840f*2 - 400f = 0. 0, 1, 20 Factor 4c2 + 264c - 544. 4(c - 2)(c + 68) Find z, given that 13z2/4 - 7z/4 - 5 = 0. -1, 20/13 Suppose b*4/5 - 21b*3 - 431b*2/5 - 543b/5 - 218/5 = 0. What is b? -2, -1, 109 Factor -x*5/4 - 2x4. -x4(x + 8)/4 Suppose -3b*2/5 - 24b - 105 = 0. What is b? -35, -5 Factor 5p2 + 40p + 80. 5(p + 4)2 Find g such that 3g*3/2 - 555g*2/2 + 1887g - 3204 = 0. 3, 4, 178 Let 3s3 - 18s*2 - 81s + 420 = 0. What is s? -5, 4, 7 Let d*2/4 - 14d - 57/4 = 0. What is d? -1, 57 Solve -4w2 + 340w + 344 = 0. -1, 86 Factor -6x4 + 44x*3 - 38x*2. -2x*2(x - 1)(3x - 19) Determine i, given that 8i4 + 76i*3 + 148i*2 + 56i = 0. -7, -2, -1/2, 0 What is h in -2h2 + 12596h - 19832402 = 0? 3149 Factor -3q3 + 570q*2 - 1131q + 564. -3(q - 188)(q - 1)2 Factor -a2/4 - 21a - 83/4. -(a + 1)(a + 83)/4 Factor -3w4 + 39w*2 + 36w. -3w(w - 4)(w + 1)(w + 3) Suppose -20a4 - 15a*3 = 0. Calculate a. -3/4, 0 Factor 2p*3/5 - 276p*2/5 + 814p/5 - 108. 2(p - 135)(p - 2)(p - 1)/5 Factor 5o*5 - 510o*4 + 505o*3. 5o*3(o - 101)(o - 1) Find a such that 2a*3 - 4a*2 - 8a + 16 = 0. -2, 2 Find y such that 3y2/7 - 633y/7 + 1254/7 = 0. 2, 209 Factor -3k2 - 3k + 90. -3(k - 5)(k + 6) Factor -4j2 + 208j - 2704. -4(j - 26)2 Factor -2k*2/3 + 14k + 260/3. -2(k - 26)(k + 5)/3 What is x in 2x2 + 912x + 103968 = 0? -228 Determine k so that -3k4 + 87k*3 - 792k*2 + 2160k = 0. 0, 5, 12 Let 2r4/11 + 628r*3/11 + 624r*2/11 - 628r/11 - 626/11 = 0. Calculate r. -313, -1, 1 Factor l*2/6 + l/3 - 35/6. (l - 5)(l + 7)/6 Determine k so that -2k4 + 14k*3 - 12k2 = 0. 0, 1, 6 Factor -r3/6. -r*3/6 Determine j so that -2j5 + j4 + 8j3 + 5j*2 = 0. -1, 0, 5/2 Factor -2o*2/7 + 192o - 32256. -2(o - 336)2/7 Let -z2/8 + 1515z/8 + 379/2 = 0. Calculate z. -1, 1516 What is q in -3q4/7 + 12q*3/7 + 96q*2/7 = 0? -4, 0, 8 Find z such that -4z*5/3 = 0. 0 Suppose -2h*4/13 - 22h*3/13 - 40h*2/13 + 64h/13 = 0. Calculate h. -8, -4, 0, 1 Let 4h3/5 + 24h*2/5 + 44h/5 + 24/5 = 0. What is h? -3, -2, -1 Suppose 2a3/3 + 338a*2/9 + 12a - 224/9 = 0. What is a? -56, -1, 2/3 Suppose 3g5/4 + 357g*4/4 + 171g*3/2 - 357g*2 - 354g = 0. What is g? -118, -2, -1, 0, 2 Factor 5h3 - 45h*2 + 30h + 80. 5(h - 8)(h - 2)(h + 1) Find w, given that -2w*2/9 - 16w/9 - 14/9 = 0. -7, -1 Factor 2g3 - 1000g*2 + 125000g. 2g(g - 250)2 Factor k3/2 + 15k2/4 - 29k/4 - 9/2. (k - 2)(k + 9)(2k + 1)/4 Factor -r2/3 + 341r/3 - 340/3. -(r - 340)(r - 1)/3 Determine j, given that 2j*2/5 - 206j/5 + 404/5 = 0. 2, 101 Factor -4g4 - 2456g*3 + 7392g*2 - 7400g + 2468. -4(g - 1)3(g + 617) Factor -81j3/4 - 279j*2/2 - 112j - 24. -(j + 6)(9j + 4)*2/4 What is x in -10x*3/9 - 52x*2/3 - 24x + 112/9 = 0? -14, -2, 2/5 Find u such that u*2/4 - 35u/2 + 1225/4 = 0. 35 Factor -y*2/11 - 303y/11 - 900/11. -(y + 3)(y + 300)/11 Solve 2p*2/21 + 3392p/21 - 2264/7 = 0. -1698, 2 Factor -m*5/4 - 17m*4/4 - 63m*3/4 + 81m2/4. -m2(m - 1)(m + 9)*2/4 Determine m so that 5m*5/2 - 65m*4/2 - 120m*3 + 2150m*2 - 2000m = 0. -8, 0, 1, 10 Solve 5g5 + 120g*4 + 240g*3 - 6250g*2 + 4875g + 11250 = 0. -15, -1, 2, 5 Factor -2i2/9 - 22i/3 + 380/9. -2(i - 5)(i + 38)/9 Factor -p*2 + 4018p. -p(p - 4018) Determine i, given that 2i*5/9 - 16i*4/9 - 46i*3/9 + 52i*2/9 + 88i/9 - 80/9 = 0. -2, 1, 10 Find g, given that -2g2 + 160g - 608 = 0. 4, 76 Find d such that -2d2/3 + 26d/3 = 0. 0, 13 Find y, given that -y*2 + 200y + 404 = 0. -2, 202 Factor -5t4 + 220t*3 - 2625t*2 + 4410t. -5t(t - 21)*2(t - 2) What is s in 3s4/4 - 870s*3 + 378450s*2 - 73167000s + 5304607500 = 0? 290 Factor 2z4/9 - 4z*3/9 - 64z*2/9 - 20z/3 + 14. 2(z - 7)(z - 1)(z + 3)2/9 Suppose -o3/3 - o2/3 + 17o/3 - 5 = 0. Calculate o. -5, 1, 3 Factor -14p3/9 + 80p*2/9 + 122p/9 + 28/9. -2(p - 7)(p + 1)(7p + 2)/9 Factor 43245s2 + 1860s + 20. 5(93s + 2)*2 Factor -4n*5/3 - 16n*4/3 + 92n*3/3 + 152n*2/3 - 880n/3 + 800/3. -4(n - 2)3(n + 5)*2/3 Factor -2y*	{ "pile_set_name": "DM Mathematics" }
j - 8)(2j*3 + 3 - 3) to the form bj*3 + rj*4 + c + oj*2 + gj and give r. 2048 Rearrange -12363s2 + 3s*3 - 118 + 12363s*2 + 2s - 2s to the form ts*3 + ns + cs2 + k and give t. 3 Rearrange -100h - 49 + 53h + 46 - h4 + 47h - 84h2 to the form yh*4 + mh*2 + oh*3 + kh + a and give y. -1 Rearrange (9 + 4w - 9)(2 + 0 - 3 - 19 + 25 - 16 - 3 + 6 - 4 + (-1 + 5 - 5)(-4 + 2 + 1) + 1 - 2 - 1) to sw + n and give s. -52 Express -2g - 1 + 1 + (0g - g + 0g)(-1 + 1 + 2) + (-321g + 159g + 535g)(-2 - 2 + 3) as o + dg and give d. -377 Express -11p*3 - 77 + 76 + 0p + 3p in the form sp*3 + g + ip + op2 and give s. -11 Rearrange -15 - 14 + 258a*2 + 29 to za + c + ua2 and give u. 258 Rearrange -1080n*3 + 539n*3 + 1 + 76n*4 + 542n*3 + 2n*4 to the form kn + in4 + qn*3 + f + vn*2 and give f. 1 Express (d + 0 + 0)(299d - 182d + 247d)(2 - 3 + 0) in the form b + ld + zd*2 and give z. -364 Rearrange 13w - 23w - 7 + 48 - 112 to the form jw + q and give j. -10 Rearrange -978z - 21z*2 + 488z + 2z3 + 492z to the form lz3 + nz + kz2 + v and give l. 2 Rearrange (3 - 2x*2 - 3)(-900x - 1399x - 1048x) to the form lx + w + sx2 + cx*3 and give c. 6694 Express -40 + 26o + 28o - 57o as io + d and give d. -40 Express -111b*2 + 8b*2 - 68b*2 + 26b*2 in the form rb*2 + kb + q and give r. -145 Rearrange (-7d + 3d + d - 6)(0d + 5d - 3d) to the form rd2 + cd + n and give r. -6 Rearrange 1162p - 26150 + 26150 to l + op and give o. 1162 Express 5i + 2i*2 - 5i + (-1 + 2i + 1)(-4i + 2i + 3i) + (-i + 10i + 2i)(10 + 7 + 5)(4i - 3i + 3i) + i + i*2 - i as v + ri*2 + ai and give r. 973 Rearrange -2g4 - 28319 + 28319 + g2 + 7g to the form z + rg2 + ng*3 + ug*4 + cg and give u. -2 Express (0 + y - 3 + 6)(1 + 1 + 2) + (-8 + 0 - 5)(2y - y + 0y) as xy + i and give x. -9 Rearrange (2 - 2 - 3h)(2 - 3 - 6)(-3 + 5 - 13)(2 + 0 + 1) to the form a + bh and give b. -693 Express (3g - 2 + 5 - 1)(13g - 21g + 12g)(0 - 3 + 2)(9 + 4 - 2) as t + ig*2 + hg and give h. -88 Express (c + c - c)(-c - c + 4c) + (40c - 13c - 12c)(-3 + 3 - 2c) + (-16 + 0c + 2c - 5)(c + 2 - 2) in the form l + ac2 + mc and give m. -21 Rearrange 19s3 + 2s - 3 - 5s3 + 6 to ls*3 + ks*2 + g + ms and give g. 3 Rearrange (-2n + n - n)(-248 + 248 + 93n + 0n - 2n + 3n + (2n - 4n + n)(-6 + 3 + 1)) - 20 - 9n*2 + 20 to un + d + mn2 and give m. -201 Rearrange 6w + 0w - 3w + (2w - 27w + w)(-1 + 1 + 1) to the form k + rw and give r. -21 Express 2x - 14 + 14 + (-3 + 4 - 3)(-x - 4x + 3x) in the form h + ox and give o. 6 Rearrange (-1 + z + 1)(-143 - 576 + 64) to hz + t and give h. -655 Rearrange 419256o*3 - 419260o*3 + 2o - o + 3 - o + o*2 to zo*3 + do + h + no2 and give h. 3 Rearrange -2419 + 2419 - 1864x to px + w and give w. 0 Express (124 - 364r + 363r + 15)(-1 + 3 - 3)(-3r + 6r - r) as cr + hr2 + n and give c. -278 Rearrange (-1 + 1 + 9)(3n - 6n + n)(28 + 6 - 5)(3n + 0n + 0n) to the form pn + c + gn2 and give g. -1566 Rearrange 2a*4 + 3a3 + a3 - 381 + 384 to the form ja3 + ma*2 + ta + w + ya4 and give w. 3 Express 2 - 2q*3 + 20784q*4 + q - 20797q4 - q2 + 0q2 in the form kq + t + iq3 + rq*4 + vq*2 and give v. -1 Express (33 + 64 + 50)(3u3 + 0u*3 + 4u*3) as z + ru + tu3 + xu*2 and give t. 1029 Express (-313u*3 + 81u*3 + 68u*3)(-4 + 4 - 2)(2u + u + u) in the form b + wu + iu*2 + yu*4 + xu*3 and give y. 1312 Rearrange (-3n*3 + 13 - 13)(38 - 12 - 57 - 37) to c + qn + mn*2 + dn*3 and give d. 204 Rearrange -8j - j*2 + 2j*2 + 7j to aj + kj*2 + n and give a. -1 Rearrange -183y*2 - 1 + 47y*2 - 13y*2 + 0 to the form qy + ly2 + h and give h. -1 Express -6k2 + k2 + k*2 + (1 - 1 + k)(0 + 0 - 2k) + 2k*2 - 3k2 - k2 - 6k + 8 - 748k*2 + 743k*2 + 3k as dk2 + b + rk and give b. 8 Express ((2 - 1 + 1)(2 - 4 + 0) + 0 - 3 + 6)(-2n - 3n + 2n)(3n2 - n2 + 4n*2) in the form cn + on2 + gn*3 + x and give g. 18 Rearrange 2 + 4g*2 + 3g3 - g2 + 0g3 - 2g - 3g + 3g - 17g4 to mg*2 + kg*4 + d + jg*3 + lg and give m. 3 Express -14k4 + 13 - 13 + (k2 + 3k*2 - 2k*2)(2k2 - 2k*2 - 2k*2) - 21k*4 + 1 + 3 - 3 - 1 as ik*4 + zk*2 + n + uk*3 + sk and give i. -39 Express 47n + 3n*3 + 2n*2 - 1 - 51n - 2n3 + 0n*3 as bn + rn2 + xn3 + s and give r. 2 Express (j2 - 2j2 - j2)(-2 - 3 + 4) - 223j2 - 64j*2 + 72j*2 + (-j + 0j + 3j)(3j + 2j - 3j) as nj + pj2 + t and give p. -209 Express 0a - 4a + 71a as la + k and give k. 0 Rearrange -2y*4 + 3 - y - 338y*3 + 341y*3 + 2y*2 - 4 to by*4 + xy*3 + dy*2 + ny + l and give d. 2 Rearrange -3f - 42724f*3 + 43273f*3 + 5f to the form w + cf2 + mf*3 + nf and give m. 549 Express 65357y2 - y3 - 65409y*2 - 16y*3 in the form gy*3 + i + hy*2 + dy and give g. -17 Rearrange (2n + 2n - n)(3n - 2n - 2n) + n*2 + 2n*2 - 5n*2 + (-5n + 3 - 3)(25n + 24n - 44n) to the form vn + x + yn*2 and give x. 0 Express (2s - 6s + 2s)(-285 + 285 + 184s) + 6 + 0 - 2s2 + 3s*2 in the form j + ts*2 + ys and give j. 6 Express -6c + 312c + 33c + 7c - 2 in the form m + kc and give k. 346 Express -6r*4 + 4r*4 + 17r + 21r2 + 3r*3 - 2 - 20r*2 as sr + k + ar3 + pr*4 + yr*2 and give a. 3 Express -9 - 61y*2 + 18y*3 + 3 + 8 + 86y*2 in the form jy + gy3 + ly*2 + d and give l. 25 Express (3i - i - i)(4 - 6 - 1)(-5 - 17 - 56) in the form m + li and give l. 234 Express x2 + 2x - 19x + 7x*2 + 10x*2 as u + sx*2 + qx and give q. -17 Rearrange q3 - q2 + 63q + 25 - 15q - 52q to vq*2 + tq + uq3 + d and give d. 25 Rearrange 2a*3 + 2a*4 + 18 - 52a2 + a3 + 95a2 - a3 - 45a*2 to the form ma*2 + za*3 + ka*4 + x + pa and give k. 2 Rearrange -173s3 + s2 + 0s*2 - 4s + 172s3 - 4 to the form rs + gs3 + ns*2 + d and give n. 1 Rearrange (-16u - 26u + 23u)(1 - 2 + 2u - 2) - 2u2 + 2u2 + u2 to the form b + ou2 + wu and give w. 57 Rearrange (0 - 2w - w + 2)(-750w3 + 374w*3 + 375w*3 + 43w) to iw2 + lw + g + hw4 + vw*3 and give l. 86 Rearrange 125o2 - o4 + 0o3 - 264o*2 + 131o*2 - 6o*3 to the form ro*2 + co*4 + wo + yo3 + l and give r. -8 Express 303h - 1300 + 1300 as ah + n and give a. 303 Rearrange (135 - 303 - 2170)(v*3 + 0 + 0) to the form cv + dv3 + a + yv*2 and give d. -2338 Express (-1 + 1 - 1057c*2 + 1009c*2)(-48c + 46c + 9c2 - c2) in the form ic*2 + wc*4 + gc*3 + tc + f and give w. -384 Rearrange 610x + 62x + 2551x to the form nx + l and give n. 3223 Rearrange (40f + 1261 - 1261)(0 + 0 + 1) to the form q + xf and give x. 40 Express d - 3d*4 - 6 + 150d*3 - 64d*3 - 79d*3 in the form nd*2 + qd*4 + vd + t + id3 and give v. 1 Express 3 - 3 + 12068n*3 + n - 11995n*3 in the form dn + cn2 + zn*3 + g and give z. 73 Express 4b + 5b4 - 29b*3 - 5b + 2b2 + 9 - 4b*2 - b + 28b*3 in the form nb*3 + fb*4 + ob*2 + pb + u and give p. -2 Rearrange 40m2 - 186m*2 - 16m*2 - 74m*2 to q + gm + um2 and give u. -236 Rearrange (10o - 10o + 5o*2)(-1 + 1 + 2 - 1 + 0 + 2 + (-1 + 1 - 1)(-1 + 0 - 1))(46o - 24o - 12o) to the form vo*3 + ko*2 + to + w and give w. 0 Express 4x + 1 - 9x*3 + 0x*2 - 9x3 - x2 + 19x3 as cx*2 + hx*3 + ux + t and give h. 1 Rearrange 74 + 0z + z + 90 - 150 to yz + j and give y. 1 Rearrange 1 - 10i4 + 44i*4 + 2i*3 - 77i*4 - 2i - 15i4 to vi*4 + l + pi*2 + zi + xi3 and give z. -2 Express (6 + 0 + 47)(10 + 12p - 10) as z + np and give n. 636 Express (4790 - 4790 + 29o)(-1 + 1 - 2) as q + uo and give u. -58 Rearrange (0v*2 + 0v2 - v2)(-2 + 2 + 4v)(-28v + 9v - 5v) to the form zv3 + kv*4 + lv + r + xv2 and give k. 96 Express -206 + 3b*2 - 6b*2 + 92 in the form ub*2 + w + cb and give w. -114 Rearrange 834p + 4 - 429p -	{ "pile_set_name": "DM Mathematics" }
1, 2 Let d(g) be the first derivative of 5g3/3 - g + 7. Let n be d(-1). Factor -20f*5 - 8f2 - f4 + 4f + 16f*5 + 9f*n. -4f(f - 1)3(f + 1) Factor -4/3n + 0 + 10/3n*2 + 2/3n*5 - 2n*3 - 2/3n*4. 2n(n - 1)3(n + 2)/3 Let z(y) be the second derivative of 2y7/21 + 2y*6/15 - 9y*5/5 - 3y*4 + 21y. Factor z(i). 4i2(i - 3)(i + 1)(i + 3) Let k(j) be the first derivative of -j*4/14 + 2j*3/7 + 9j*2/7 + 10j/7 + 32. What is f in k(f) = 0? -1, 5 Let n be (-24)/8 - -51. Let o(r) be the second derivative of -1/33r*4 + 0r*5 + 1/165r*6 + 0r*3 + 0 + 1/11r*n + r. Factor o(u). 2(u - 1)*2(u + 1)*2/11 Find v such that 2/11v*5 - 36/11v*4 + 0v + 0 + 0v2 + 162/11v*3 = 0. 0, 9 Let c(a) = 5a*3 + 18a*2 + 9a - 30. Let u(p) = -20p3 - 71p*2 - 38p + 120. Let r(x) = -9c(x) - 2u(x). Determine l, given that r(l) = 0. -3, -2, 1 Let a(t) be the third derivative of t6/30 - t5/15 - t*4/3 + 16t*2. Factor a(r). 4r(r - 2)(r + 1) Let k(z) be the third derivative of -5z7/357 + 4z*6/51 + 67z*5/170 + 29z*4/51 + 20z*3/51 + 41z*2 - 2. Suppose k(i) = 0. What is i? -1, -2/5, 5 Let j be (-2)/4498/(-360). Let l = -1/40 + j. Determine k, given that -lk - 4/3 + 2/3k2 = 0. -1, 2 Let r(u) be the third derivative of u9/151200 - u7/4200 + u6/900 + 2u5/5 + 20u*2. Let l(k) be the third derivative of r(k). Factor l(v). 2(v - 1)*2(v + 2)/5 Let p(u) be the second derivative of 13u + 1/28u*4 + 0 - 3/14u*2 + 0u*3. Factor p(h). 3(h - 1)(h + 1)/7 Suppose 5r + 3d - 28 = 0, 7 - 3 = -r + d. Let 5g*4 - 95/4g*3 - 25/4g + 115/4gr - 15/4 = 0. Calculate g. -1/4, 1, 3 Suppose -4o - v = -15, 22v - 27 = 4o + 17v. Let 0 - x + 1/3x*o = 0. Calculate x. 0, 3 Let g(w) be the second derivative of 0w*2 + 0 + 1/20w*5 + 1/6w*4 + 21w + 0w3. Solve g(o) = 0. -2, 0 Let y(q) = -q3 - 6q*2 + 5q - 10. Let i be y(-7). Suppose 0 = id + d. Factor 8c*3 - 10c*3 - 2c*4 + dc*4. -2c*3(c + 1) Let n(a) be the first derivative of a*4/22 + 2a*3/3 + 19a*2/11 + 18a/11 - 56. Factor n(i). 2(i + 1)2(i + 9)/11 Let z(v) be the second derivative of 0v3 - 1/100v*5 - 8v + 1/40v4 + 0 + 2v*2. Let q(h) be the first derivative of z(h). Factor q(f). -3f(f - 1)/5 Let n(y) = 36y + 6y2 - 1 + 4y*2 - 26y - 24. Let q(t) = 7t2 + 7t - 17. Let z(u) = 5n(u) - 7q(u). Factor z(r). (r - 2)(r + 3) Let k(v) be the first derivative of 2v*3/9 - 2v*2 - 32v/3 + 65. Factor k(d). 2(d - 8)(d + 2)/3 Let -6 + 125r3 + 64r*2 + 35r + 70 + 205r + 236r*2 = 0. What is r? -4/5 Let l(n) be the second derivative of -1/32n*4 - 1/32n*5 - 1/120n*6 + 0n*2 - 2/3n*3 + 0 + 5n. Let b(m) be the second derivative of l(m). Factor b(i). -3(i + 1)(4i + 1)/4 Let a(r) be the third derivative of 0r*3 + 0r + 19r2 + 0r*4 - 1/80r*5 - 1/560r*7 + 3/320r*6 + 0. Solve a(x) = 0 for x. 0, 1, 2 Factor -16o*2 + 448o + 41o2 + 266o - 16o2 - 12o*2 - 42483. -3(o - 119)*2 Let a(z) be the third derivative of 1/1050z*7 + 1/600z*6 + 0 + 0z - 1/15z3 - 1/24z*4 + 21z*2 - 1/100z5. Let a(w) = 0. What is w? -1, 2 Let c(j) be the second derivative of j6/6 - 2j5 - 25j*4/2 - 80j*3/3 - 55j2/2 - j + 14. What is n in c(n) = 0? -1, 11 Let a(x) be the second derivative of -x6/90 + x5/15 + x4/18 - 2x3/3 - 57x*2/2 - x + 1. Let b(d) be the first derivative of a(d). Factor b(n). -4(n - 3)(n - 1)(n + 1)/3 Let r(o) be the first derivative of 9o4/28 - 23o*3/7 + 60o*2/7 + 48o/7 - 166. Find s, given that r(s) = 0. -1/3, 4 Let y = 76 + -74. Factor -4t3 - 25 + yt*2 + 27 + 2t*5 - 6t*2 + 2t + 2t4. 2(t - 1)*2(t + 1)*3 Let h(c) = -3c*4 + 15c*3 + 39c*2 + 21c - 7. Let f(l) = 3l4 - 15l*3 - 39l*2 - 21l + 6. Let w(p) = 7f(p) + 6h(p). Solve w(d) = 0. -1, 0, 7 Let r(z) be the second derivative of -z7/280 - z6/60 + z5/40 + z4/4 - 35z3/6 + 33z. Let a(x) be the second derivative of r(x). Solve a(h) = 0. -2, -1, 1 Let a(m) = -5m3 + 11m*2 + 2. Let t(y) = 4y3 - y2 - 1. Let h(n) = -a(n) - 2t(n). Factor h(q). -3q*2(q + 3) Let o = 32/3 - 21/2. Suppose 8y + 32/3 + oy*3 + 2y*2 = 0. Calculate y. -4 Let d(x) = -16x*4 - 8x*3 - 4x2 + 4. Let n(g) = g5 - 2g4 - g3 - g2 + 1. Let y(i) = -d(i) + 4n(i). Let y(s) = 0. Calculate s. -1, 0 Factor -k*2 - 1/3 + 1/3k3 + k. (k - 1)3/3 Let u(m) be the third derivative of 2m7/105 - 4m*6/15 - 8m*5/5 + 16m*4/3 + 160m*3/3 - 22m*2. Suppose u(j) = 0. What is j? -2, 2, 10 Let o(d) be the first derivative of -14/45d*3 + 9 + 8/15d*2 + 8/15d - 1/6d4. Let o(v) = 0. Calculate v. -2, -2/5, 1 Let k(w) be the second derivative of w6/135 - w5/45 + w4/54 - w - 62. Factor k(a). 2a*2(a - 1)*2/9 Let a = 104 - 144. Let x = a - -43. Factor 0 + 0r + 1/5r2 - 1/5r*x + 1/5r*5 - 1/5r4. r2(r - 1)2(r + 1)/5 Let q(p) be the second derivative of -7/1620p6 + 1/27p*4 - 2/3p*3 + 0p*2 + 0 + 1/45p*5 - 2p. Let v(n) be the second derivative of q(n). Factor v(k). -2(k - 2)(7k + 2)/9 Let c(n) be the third derivative of -n6/165 + n5/330 - 55n*2. Let c(d) = 0. What is d? 0, 1/4 Factor -180a - 68 + 36a3 + 164a*4 - 53a*4 - 52a*4 - 55a*4 + 52a*2 - 132. 4(a - 2)(a + 1)(a + 5)*2 Let w(x) be the first derivative of 6x + 0x2 + 3 - 1/15x*3 - 1/50x*5 + 1/15x*4. Let k(v) be the first derivative of w(v). Factor k(a). -2a(a - 1)2/5 Let x(h) be the second derivative of -7h6/60 + h5/20 + 91h4/24 + 29h*3/6 - 6h*2 - h - 126. Find l, given that x(l) = 0. -3, -1, 2/7, 4 Let -6a*5 + 2a*5 + 34a - 34a + 459a4 + a5 = 0. Calculate a. 0, 153 Let q = 398 - 1178/3. Factor q + 0w - 4/3w*2. -4(w - 2)(w + 2)/3 Determine p so that -108p*3 + 134p*4 - 22p*4 + 3193p - 1599p + 16 - 236p*2 - 1594p = 0. -1, -2/7, 1/4, 2 Let v(w) be the first derivative of -w3/4 - w2 - w - 12. Solve v(y) = 0. -2, -2/3 Let m = -2507/13 - -193. Let z be (1(-2 + 4))/(22 - 9). Let -ms*2 - 4/13s - z = 0. Calculate s. -1 Let d = -20 + 20. Determine a, given that da + 2a*2 - 4 + 4a - 7a + a = 0. -1, 2 Let z(b) be the second derivative of 0b*3 - 1/18b*4 - 1/45b*6 + 1/15b*5 + 0 - 6b + 0b2. Find k such that z(k) = 0. 0, 1 Suppose -2/9k*3 + 0k + 2/9k5 + 0 + 2k*4 - 2k*2 = 0. What is k? -9, -1, 0, 1 Suppose 19153f = 19152f + 2. Factor -86/19b + 10/19bf - 36/19. 2(b - 9)(5b + 2)/19 Solve 2/3u4 + 0 - 17/3u*2 - 7/6u - 23/6u3 = 0 for u. -1, -1/4, 0, 7 Let m(s) be the second derivative of 0s*2 - 1/3s*3 + 1/80s*5 + 6s - 7/48s4 - 2. Factor m(a). a(a - 8)(a + 1)/4 Let r = 35 + -21. Suppose 0 = -3f - 5l + 11, -5l + l + r = 5f. Determine n, given that 0n - n - 4 + 6n3 - 4n*4 - 5n + 8nf = 0. -1, -1/2, 1, 2 Let z(m) = -5m*4 + 4m*3 + 6m*2 - 4m - 1. Suppose 3 = -3f - 9. Let x(t) = -4t*4 + 3t*3 + 5t*2 - 3t - 1. Let g(s) = fx(s) + 3z(s). Factor g(i). (i - 1)*2(i + 1)*2 Suppose 0 = -3x + 5j + 9, x - 1 - 2 = 5j. Factor -xh4 - 5h*3 - 10h*2 + 2h*4 + 6h*4. 5h*2(h - 2)(h + 1) Let t(b) = b3 + 17b*2 + 31b + 17. Let m be t(-15). Let q(w) be the first derivative of 4/5wm - 5 - 8/5w*3 - 7/10w*4 + 0w. Factor q(u). -2u(u + 2)(7u - 2)/5 Let x be (3 - 315/(-20))/(22/256). Let l = x - 218. Let -4/11v2 - lv*3 + 0 + 0v = 0. Calculate v. -2, 0 Let l(y) be the first derivative of -y*3/6 - 7y*2/4 + 4y - 22. Let l(r) = 0. What is r? -8, 1 Factor -222/5l + 44 + 2/5l*2. 2(l - 110)(l - 1)/5 Solve 0 + 3/8b*3 + 3/8b*2 + 0b = 0. -1, 0 Solve -34c2 + 16c + 10c2 + 8c*2 + 13c*2 + 59c = 0 for c. 0, 25 Suppose 2w = 6, 2d = 2w + 6 + 24. Suppose -3j = 2j - y - 14, j - 4y - d = 0. Suppose -2/5qj - 2/5q + 4/5 = 0. Calculate q. -2, 1 Let o(b) be the third derivative of b*7/105 - 13b*6/60 + 238b*2. Factor o(f). 2f*3(f - 13) Suppose -15 = -4t - 18x + 21x, -5t + 5x + 25 = 0. Find u, given that -1/6u*5 + tu*4 - 1/6u + 0 + 0u2 + 1/3u*3 = 0. -1, 0, 1 Factor -4t2 + t5 + t*4 - 1451t*3 + 727t*3 + 2t*2 + 1 + t + 722t3. (t - 1)2(t + 1)3 Suppose 1080 = 14	{ "pile_set_name": "DM Mathematics" }
ssuming d is positive. d*(252/17) Simplify ((s(s*(-8)ss)/ss)/(sss*(1/5)s))(17/5) assuming s is positive. s(-697/25) Simplify ((q/q(-1))(-22)(qq/(q/(q/(qq/(qq*1/q)q)q)))/q(-3))(-44) assuming q is positive. q1760 Simplify ((k14/kk)/kk(-4/9))/(k(-4)k)(-2/23) assuming k is positive. k(2545/207) Simplify ((v/(v/(v/(v*(1/2)/vv)))vv)/v)/(((v((v(2/7)/v)/vv)/v)/v)/v)(vv/(v/(v/(v(vv/v*(2/25))/v)v)))(-33) assuming v is positive. v(-10999/350) Simplify b*15bb(-1/2)b(b(-3/7))21 assuming b is positive. b(15/2) Simplify (g(6/7)g)/g*(2/73)g*(-2/13)/((((gg7)/g)/g)/g) assuming g is positive. g(-22082/6643) Simplify ((x22)(-47))36 assuming x is positive. x(-37224) Simplify ((rr/(r21/r))/(r(-33)/rr))/(r0)(1/8) assuming r is positive. r15 Simplify ((h(-1/9)/h(2/13))/((h/h(-5/3)h)/((h/(hh/h(1/8)))/h)))(4/33) assuming h is positive. h(-5435/7722) Simplify (c/(c(-19)c)c/(c/(c/(c/((c*(-6/23)c)/c)))))40 assuming c is positive. c(17240/23) Simplify (a(-8)/(a(1/40)/a))/(a*0/aa/(a/(aaa(-1/2)))) assuming a is positive. a(-301/40) Simplify (((v(-1/5))(-25/3))(-14/9))(2/89) assuming v is positive. v*(-140/2403) Simplify ((tttt*(-3/7)t)/t(-1))/(t(9/2)/(t/t(2/39))) assuming t is positive. t(557/546) Simplify (bb3)5/((b(-3/10)bb)/b(b*(-4)/bb)/b) assuming b is positive. b(243/10) Simplify (u(-5)u(-15))/(u/u10(uuuu/u(-1/4))/u) assuming u is positive. u(-57/4) Simplify (q0)(-23)/(q/(q/q(-2/3)q)qq)(1/63) assuming q is positive. q(-1/189) Simplify ((c/c(-1/3))/c)(-6)(c(-6))(-30) assuming c is positive. c178 Simplify (w(-3)/(ww*8))/(ww*(-3/17)(w/w(-19))/w) assuming w is positive. w(-541/17) Simplify v*(-4/9)vv11(v/(v/(vv/(vv1))))(-5/2) assuming v is positive. v*(104/9) Simplify (((ww*(-21)ww)/w)/(ww/((w/((ww(-2/23))/w))/w)))47 assuming w is positive. w(-22607/23) Simplify (t(-1/4)((t(-3/8)/t)/t)/t)/(t(2/7)t(-9/4)) assuming t is positive. t(-93/56) Simplify (s(9/5)s(2/7))/(s/s(-4))(-8) assuming s is positive. s(1473/35) Simplify (((ggg/(gg(-5)g))(-45))9)(1/53) assuming g is positive. g(-2430/53) Simplify (x/(x/(x*(1/7)/x))x(-1/16))/(x(-19)/(xx(-2/7)/xx)) assuming x is positive. x(2105/112) Simplify (i/i(-21)ii(ii*(-14)i)/ii)/((i/((ii17)/i))/i30) assuming i is positive. i58 Simplify n(-15)nn/(n/(n/(nn/(n/n(2/3)n)nn)))n(nn(-1/9))/(nnn(12/5)) assuming n is positive. n(-818/45) Simplify ((y(-3)y)/y*5y(-7)/(y(1/4)y))(-2/103) assuming y is positive. y(61/206) Simplify (c/(c/((c2c)/cc)))13cc(2/9)cc(-12) assuming c is positive. c(263/9) Simplify ((n/(((nn*(7/4)n)/nn)/n))/n(-2/33))/(n(-17/4))(19/6) assuming n is positive. n(3107/264) Simplify ((c/((c/(cc*(-5/6)c))/c)c)/ccc)(-10/13)/(c(-1)/c)(-43) assuming c is positive. c(-3479/39) Simplify ((t/(tt(-1/5)))(-8))(-44) assuming t is positive. t(352/5) Simplify g*(-2/9)g/((gg31)/g)(g*(3/7)g)(-36) assuming g is positive. g(-5144/63) Simplify i*(-7)/(ii*(-4/7))(i/i*(12/7))/ii21 assuming i is positive. i(83/7) Simplify (b(b/(b10/b))/b)/bb*10(b(3/2)/b)(-13) assuming b is positive. b(-11/2) Simplify ((q(-22))(-1/2))(-2/39) assuming q is positive. q(-22/39) Simplify (z3)*(-8/7)/(((((zz/(zz(3/8)))/zz)/z)/z)/(z/(zz/(zz*(-5))z))) assuming z is positive. z(-451/56) Simplify (((f/(f(-1/7)f))/(ff*6f))/(((f*(3/7)/f)/f)/(ff(-1/6))))(-33) assuming f is positive. f(2519/14) Simplify (c(-3/4))*48((c*(-1/4)/c)/cc)(-24) assuming c is positive. c(-6) Simplify (c*23cc/c(-4/11))/(c(-7/3)/c(-23)) assuming c is positive. c(155/33) Simplify ((t32)35)50 assuming t is positive. t56000 Simplify (pp(-7))/(p/p(-1/7))((pp/(((((p(2/45)/p)/p)/p)/p)/p))/p)/(p(-5/7)ppp) assuming p is positive. p(-1094/315) Simplify ((ddd(-23))/(d/d(-22)))/((d13/d)/d15) assuming d is positive. d(-41) Simplify (i(-2/15)/(i/i(-5)))/(i13/(ii(1/6)/i)) assuming i is positive. i(-569/30) Simplify (k*(1/3)kkkk/(kk*37)k)/((kk33)/(k/((k/(k(1/20)k))/k))) assuming k is positive. k(-3877/60) Simplify (o/(o(-1/2)o))/(o(o/((o(o/(o/(o(1/8)/o)o))/ooo)/oo)o)/o)o(-1/7)/o(-1) assuming o is positive. o(-29/56) Simplify (t/(t(-2)/t))(-4/17)(t*(-5)t)(1/2) assuming t is positive. t(-50/17) Simplify (((g/(gg(2/9)g))/(g/((g/(gg(1/3)))/g)))28)(2/7) assuming g is positive. g(-256/9) Simplify (i(-1))(-2/127)i*1i(-12) assuming i is positive. i(-1395/127) Simplify (q*10q/(q*(-1/6)qq))/(q/(q(-3/4)q))(1/17) assuming q is positive. q(1861/204) Simplify y/y*34yyy*(2/125)y*(-2/87)y*(-12)yy assuming y is positive. y(-445951/10875) Simplify (v(1/3))(1/7)/(vv*6vv6/v) assuming v is positive. v(-272/21) Simplify ((w/(w0w))*(3/17)(www0)/(w/(w/(w/(w5/w)))ww))34 assuming w is positive. w102 Simplify ((ff(-3/2)fff/(f/f*(-1/2))f)(-2/85))(-6/13) assuming f is positive. f*(24/1105) Simplify (tt/((t*(-3/10)/t)/t)t)*(5/13)(t*(-16)/t)/(t/(tt/(t/t*14ttt))t) assuming t is positive. t(-129/26) Simplify v/((v20v)/v)vv/(v/((((v/(vv(-12)))/v)/v)/v))vvv(-1/5)/v(-5) assuming v is positive. v*(-11/5) Simplify kk*9k*(-4/13)kk(-1/15)/((((kk/(kkk/(k*4/k)kk)k)/k)/k)/k) assuming k is positive. k(2462/195) Simplify q(-8/7)/qqq/(((q*(-3/5)/q)/q)/q)qqqq(-1/31)q(-5/7) assuming q is positive. q(6196/1085) Simplify (j*(-4)j*0(j*(2/25)/j)/((jj(2/3))/j))(-41) assuming j is positive. j(17179/75) Simplify t(-3/8)t/(t(t/t*(-7/2))/t)(tt/t2t)(2/5) assuming t is positive. t(-139/40) Simplify ((w(4/5)/w)/w)(2/33)/((w*20w)/(ww(-3/10))) assuming w is positive. w(-2241/110) Simplify (((o/(o/(o/(oo*7/oo))))/o)/o(-18))(-8/9) assuming o is positive. o*(-80/9) Simplify ww*(-23)w/w*2w*(-2/29)/((www/(w(ww(-1/6)w)/w)w)/w) assuming w is positive. w(-4217/174) Simplify ((j/(j(-2/9)j))/j)*47(jj/(j/j4j)j)/(j(j((j(-11)j)/jj)/j)/j) assuming j is positive. j(-194/9) Simplify p(-1/5)/((pp*(5/2)/p)/p)p*(1/5)p*(-3)p assuming p is positive. p*(-7/2) Simplify (mm(-6))(2/33)/(m15/((m/m(1/5))/m)) assuming m is positive. m(-2558/165) Simplify j(-6/11)/((j*(-21)/j)/j)j*(11/5)j(10/3) assuming j is positive. j(4618/165) Simplify (b*(-1/17)/(bb*1bb))/(b/(b/(b/(b(-34)b)))bbb/((b4/bb)/b)bb) assuming b is positive. b(-681/17) Simplify (k(-1/5)k/k(-5))/((k/(k/(k/k(-14))kk))/k(-14)) assuming k is positive. k(-106/5) Simplify (p(-11)/p)(1/70)(p*(-1/6)p)/pp18p assuming p is positive. p*(3919/210) Simplify ((n/(nn8))/n(2/3)(n/(n0n))(1/24))33 assuming n is positive. n(-286) Simplify (g(-2)/(((g*(-2/7)/gg)/g)/gg))(-31) assuming g is positive. g(155/7) Simplify ((b/b(-14)b)/b(-26))/(b/b10)1 assuming b is positive. b51 Simplify s/(s*(-11)ss)s*(-8)(s5)(-1/33) assuming s is positive. s*(61/33) Simplify kk*(-4/11)k*(5/3)(kkk*(2/5)k)(-44) assuming k is positive. k(-24304/165) Simplify ((c(cc/c(1/5))/c)/c)/c19c(-2)/(c/c(-2/37)) assuming c is positive. c(-3932/185) Simplify (h28/(h/((h7/h)/h)))/(h/((h/h15)/h)h)(-44) assuming h is positive. h780 Simplify (t*(1/15)t(-17))/(t(-6/5)t/(t/(tt*(-1/3)tt))) assuming t is positive. t(-92/5) Simplify (s/(ss/(((s*11s)/s)/s)ss)s11)/(s/(s/(s14s))s(-12)) assuming s is positive. s15 Simplify (z(-13/2)/(z/(zz*(2/5)z)))/(z*(-2/47)/(z/(z/(zz*(2/21))z))) assuming z is positive. z*(-48977/9870) Simplify (mmm(-2/3)m*(1/6))/((((mm(8/3))/m)/m)/m(-2/11)) assuming m is positive. m*(-23/66) Simplify (oo*(3/7)/ooo)48o/o*(-8)(o/(o/o16))/o assuming o is positive. o(984/7) Simplify (((l(-3/14))27)(1/25))20 assuming l is positive. l(-162/35) Simplify k18kkk*(1/5	{ "pile_set_name": "DM Mathematics" }
). 6592o2 - 3 Suppose 2z - 6 + 2 = 0. Let c(s) = zs + 5s - 13s + 5s. Let n(k) be the third derivative of -k*5/3 - 3k*2. Give c(n(f)). 20f*2 Let p(k) = 2k*2. Let u(n) = 14979665n*2. Calculate p(u(v)). 448780727024450v*4 Let i(b) = 25380b*2 + 5922b + 658. Let f(t) = -193t2 - 45t - 5. Let x(p) = -658f(p) - 5i(p). Let o(j) = 3j2. Calculate x(o(s)). 846s4 Let z(k) = k2 - 412187k. Let v(x) = 2x. Calculate v(z(d)). 2d2 - 824374d Let c(k) be the second derivative of 0k3 + 0k*2 + 23 + 1/12k*4 - 3k. Let p(u) = 209u2 + 2u. What is c(p(x))? 43681x4 + 836x*3 + 4x2 Let r(s) be the third derivative of s5/60 - s*4/24 - 617s*3/2 + 17s*2 + 3s. Let d(h) = -2h. Calculate r(d(j)). 4j*2 + 2j - 1851 Let a(p) = -97141p. Let m(y) = 115y + 2. What is m(a(v))? -11171215v + 2 Let i(c) = 2. Let f(s) = 16 - 19 - 7 - 2s + 0s. Suppose -8 = 4r + 12. Let d(l) = ri(l) - f(l). Let h(o) = -o. What is d(h(x))? -2x Let x(a) = 14509a. Let b(r) = -1071r*2 - 1. Determine x(b(h)). -15539139h*2 - 14509 Suppose w + 5i = -1, -i = -3w + 6 + 7. Suppose -8h + 15852 = wh. Let v(r) = h - r2 - 1321. Let u(c) = -13c*2 + 3c. What is v(u(x))? -169x4 + 78x*3 - 9x*2 Let z(u) be the first derivative of 3u*2/2 + 2. Let l(c) = -545c*2 - 155. Let o(q) = 21q*2 + 6. Let w(s) = 6l(s) + 155o(s). Calculate z(w(a)). -45a*2 Let i(d) = -2d*2. Suppose -6c - 2b = -3c - 69, -b = -3c + 60. Let n(r) = r - 21 - 18 + 97 - c - 21. Determine i(n(l)). -2l*2 - 64l - 512 Let y(p) be the third derivative of -p*4/12 + 9p*3 + 4p*2 + 87. Let z(k) = 63k. Give y(z(g)). -126g + 54 Let r(y) = -88y*2. Let k(t) = -4310t*2. What is r(k(z))? -1634696800z*4 Let l(z) = -41z + 49z - 9z. Let m(a) = 195a2. What is m(l(q))? 195q*2 Let x(a) = -87934634a. Let h(p) = p*2. What is h(x(o))? 7732499856713956o*2 Let z(u) = 124u*2 + 134u - 10. Let q(d) = 42d2 + 40d - 3. Let f(c) = 10q(c) - 3z(c). Let r(a) = -21a. Determine f(r(p)). 21168p*2 + 42p Let w(t) = -24823t - 25001t - 24166t + 75028t. Let g(z) = 3z. What is g(w(o))? 3114o Let h(a) = a. Let t(p) = -74 + 10058p + 35 + 39. What is t(h(r))? 10058r Let r(b) be the first derivative of -4b3/3 - 4462. Let o(y) = -1831y. Calculate o(r(k)). 7324k2 Let m(n) = 3436n*2. Let v(b) = 7b*2 - 18b - 2. Let t(u) = 45u2 - 117u - 13. Let q(c) = 6t(c) - 39v(c). Give m(q(l)). 30924l4 Let k(l) = 343l*2 - 7371428 + 7371428. Let d(y) = 2y. Determine d(k(f)). 686f2 Let i(o) = -157259o*2. Let w(q) = 195q. Determine i(w(a)). -5979773475a2 Let l(g) = 15g. Let t(m) = -185m2 - 50823m + 50823m. Calculate t(l(i)). -41625i*2 Let n(c) = -134 - 16 + 150 + 18c. Let x(q) = -60q2. Calculate x(n(y)). -19440y*2 Let g(q) = 4584689q - 4584689q - 3q*2. Let v(r) = 2r*2 + 147r. What is v(g(d))? 18d4 - 441d*2 Suppose 0 = 2k + 76 - 86. Let r(i) = -8i2. Let j(o) = -18o*2. Let u(l) = kr(l) - 2j(l). Let g(m) = -3m*2. Determine u(g(y)). -36y*4 Let v be 4/(-3)(-8 - -7)21. Let x(f) = 15f - vf + 9f + 6f. Let i(m) = 6m - 9m - 12m. Determine x(i(r)). -30r Let a(h) = -1158h - 1. Let g(l) = -22l2 + l - 1. Let y(n) = -133n*2 + 6n - 6. Let r(d) = -6g(d) + y(d). Calculate r(a(x)). -1340964x*2 - 2316x - 1 Let p(o) = 1458o. Let r(s) = 2s*2 - 46 + 46 + 58s - 58s. Calculate p(r(l)). 2916l*2 Let z(w) = 4w + 2w - 6 + 6. Let l(p) = -18p - 13p + 31p + 20p2. Calculate l(z(k)). 720k*2 Let c(p) = 7p*2 + 9p. Let x(f) = 5f2 + 6f. Let i(t) = 2c(t) - 3x(t). Let b(r) = 3r + 4. What is b(i(h))? -3h*2 + 4 Suppose -k - 12k = -65. Let u(n) be the third derivative of -1/30nk + 0n*3 - 13n*2 + 0n + 0n4 + 0. Let z(d) = 2d*2. Give u(z(b)). -8b*4 Let x(b) be the first derivative of 358b3 + 1704. Let w(p) = p2. Determine x(w(k)). 1074k4 Let m(f) = 3f*2. Let k be ((-640)/240 + (2 - -1))1. Let a(v) be the first derivative of 0v2 + kv*3 + 0v + 18. Calculate m(a(d)). 3d4 Let o(c) = 11c. Let d be 63/(-14)8/(-6). Let s(l) = -7l*2 + 12l*2 - dl2 - l2. Determine o(s(k)). -22k2 Let n(s) be the first derivative of 2s*3/3 + 11261. Let d(r) = 11r - 4. Let g(t) = -45t + 15. Let p(w) = -15d(w) - 4g(w). Determine n(p(c)). 450c*2 Let b(u) = -13u*2. Let p(o) = -1456o + 7. Give p(b(z)). 18928z2 + 7 Let h(m) = -1658m*2 + 3325m*2 - 1666m2. Let b(d) = -d2 + 75d - 13. Calculate b(h(n)). -n4 + 75n*2 - 13 Let b(s) be the first derivative of 614s*2 - 1653. Let q(h) = h. Give b(q(n)). 1228n Let n(f) = 6f2 - 36f + 2. Let u be n(6). Let x(s) = 3su + 15 + 3s*2 - 7s*2 - 15. Let g(z) = -2z + 36. Give x(g(j)). -4j2 + 144j - 1296 Let z(g) = 13g. Let c(h) = -107h + 6. Let j(u) = -3115u + 175. Let a(p) = -175c(p) + 6j(p). Give z(a(v)). 455v Let w(u) = 76432u + 3. Let a(s) = 12s. Determine w(a(q)). 917184q + 3 Let x(w) = -59w*2 + 4w + 4. Let y(a) = -44a2 + 3a + 3. Let c(i) = -3x(i) + 4y(i). Let k(b) = -1096b. What is c(k(m))? 1201216m*2 Let c(v) = -2v - 499. Let i(u) be the second derivative of -u*3/3 - 7683u. Calculate c(i(g)). 4g - 499 Let b(v) = -3v. Let m = -1017 + 1011. Let d = 4 - 8. Let o(n) = -n*2 + 2n. Let l(f) = -3f. Let r(k) = dl(k) + mo(k). Give b(r(u)). -18u*2 Let s(d) = -6d*2. Let y(r) = -136r - 6. Let z(j) = -131j - 4. Let l(p) = 2y(p) - 3z(p). Give l(s(b)). -726b*2 Let v(y) = -516 + 26y + 516. Let o(m) = m + 2. Let x(k) = 1. Let c = 11 - 13. Let a(l) = cx(l) + o(l). Determine v(a(w)). 26w Let a(q) be the second derivative of q*4/12 + 534q - 11. Let d(b) = 12b2 - 3b + 0 + 0. Determine d(a(m)). 12m4 - 3m*2 Let f(o) = 87o - 72. Let m(u) = 26u - 26. Let k(s) = 4f(s) - 11m(s). Let b(z) = 12z. Give k(b(g)). 744g - 2 Let h(d) = 10d*2. Let q(r) = -7r + 14095. What is q(h(c))? -70c2 + 14095 Suppose -35n + 159n - 481 - 15 = 0. Let a(f) be the third derivative of 0 - 1/8f*n - 6f*2 + 0f*3 + 0f. Let m(y) = 8y2. What is m(a(r))? 72r*2 Let j(x) = 5x. Let h(a) = 61a - 4. Let b(o) = -258o + 17. Let f(v) = -2b(v) - 9h(v). Calculate j(f(q)). -165q + 10 Let i(n) = 4n*2 - 2n - 6. Let f(k) = k + 3. Let l(v) = 4f(v) + 2i(v). Let h(j) = 14j2 - 3j. Determine h(l(o)). 896o4 - 24o*2 Let c(m) = 3m + 18847. Let x(f) = -5f + 7. Calculate x(c(b)). -15b - 94228 Let c(s) = -1406s. Let l(u) = 1186u*2. What is c(l(d))? -1667516d*2 Let w(z) = -11z*2 + 3z - 5z + 2z. Let s(x) be the second derivative of -x*4/12 + 9x - 1. Determine w(s(f)). -11f4 Let u(i) = i + 2. Let c(q) = -1. Let g(t) = -2c(t) - u(t). Let n(a) = 193a + 23. Let x(j) = 115j + 13. Let v(o) = 3n(o) - 5x(o). Calculate v(g(d)). -4d + 4 Let t(x) = -2820679x. Let o(y) = 18y2. What is t(o(c))? -50772222c*2 Let s be (78/(-52))/((-2)/44). Let i(a) = -2a + 32 + 0a + s - 65 + 8a*2. Let d(t) = 3t. Calculate i(d(r)). 72r2 - 6r Let w(z) = 513351z2. Let n(x) = 4x*2. Give w(n(q)). 8213616q*4 Let t(d) = 36666d - 1654d2 - 505d*2 - 36666d - 792d2. Let m(u) = 2u. Calculate t(m(k)). -11804k2 Let b(h) = -6 + 5h + 6. Let p(u) be the first derivative of 5u2 - 13747. Give b(p(m)). 50m Let y be (0 - (-8)/(-28))-14. Suppose -yz + 21 + 11 = 0. Let q(x) = -16 - 2x2 + 24 - z. Let s(d) = -10d*2. Give q(s(j)). -200j*4 Let q(v) = -v - 162. Let y(b) = -13b + 72. Let m(k) = 196k - 1092. Let f(x) = -6m(x) - 91y(x). Determine q(f(j)). -7j - 162 Suppose 51h = 61h - 520. Let i(f) = -106f - 78. Let r(g) = 12g + 9. Let a(z) = hr(z) + 6i(z). Let y(d) = -18d. What is a(y(m))? 216m Let y(b) = 21b. Let t(u) = 2210u + 12. Determine y(t(v)). 46410v + 252 Let s(v) = 540874v. Let t(i) = 9i2. Give s(t(n)). 4867866n*2 Let p(i) be the second derivative of 0i*2 + 6i - 17/6i3 - 3. Let y(s) be the second derivative of -s4/4 + 2s. Give y(p(b)). -867b2 Let j(m) = 0m + m*2 + 0m. Let n(s) = 53s - 93s - 77 + 58s. Let d(q) = -9q + 42. Let z(p) = -11d(p) - 6n(p). Give z(j(o)). -9o2 Let n(m) = -2144m*2. Let q(b) = -14b. Let v(i) = -17i. Let p(j) = 5q(j) - 4v(j). Determine p(n(t)). 4288t*2 Suppose 24z = 40*z - 16. Let x(o) =	{ "pile_set_name": "DM Mathematics" }
2288160f3 What is the third derivative of 2727y*5 - 18y*4 + 3y*3 - 4559802y*2? 163620y*2 - 432y + 18 What is the third derivative of -c*6p + 2c3p*2 - 3806c*3 - 2c*2p2 + c2p - 12c*2 - 1026cp2 - 9p*2 wrt c? -120c*3p + 12p2 - 22836 What is the second derivative of 9m*4 + 26m*3 - 61m*2 - 192m - 318 wrt m? 108m2 + 156m - 122 Find the third derivative of -543g4 + 61g*3 - 2g*2 + 19265g wrt g. -13032g + 366 Differentiate 241il2u - 11ilu + 119iu - 61i + 3l2u - 1 wrt l. 482ilu - 11iu + 6lu What is the third derivative of 1252918o*5 - 6o*2 + 238o - 6? 75175080o2 Differentiate -109468k*2s - 191k2 - s - 71 wrt s. -109468k*2 - 1 Find the second derivative of -69671q*2 + 6q + 4742 wrt q. -139342 What is the second derivative of -11720a2u2 + a2 - 2473au + 4u3 wrt u? -23440a*2 + 24u What is the derivative of -83k2u + 30871ku - 253385u + 1 wrt k? -166ku + 30871u Differentiate 88f2o*2 + 5266467f*2 + 2fo + 6142o wrt o. 176f2o + 2f + 6142 What is the first derivative of 4655hl3p + 2hl*3 - 4hl2 + 6hp - 1071 wrt p? 4655hl3 + 6h Find the second derivative of -y*4 - 1646y*3 + 4y*2 - 25009y wrt y. -12y2 - 9876y + 8 Find the second derivative of -317884g3 + 250093g wrt g. -1907304g Find the first derivative of -247l*2w + 3l2 - lw*2 + lw - 6491w2 wrt l. -494lw + 6l - w*2 + w What is the second derivative of 12113htu*2 - 2036htu - 2ht - 17hu + tu2 wrt u? 24226ht + 2t What is the second derivative of 4s4 + 34s*3 + 9s*2 - 1807s + 1? 48s2 + 204s + 18 What is the third derivative of 17023y5 - 52213y*2 wrt y? 1021380y*2 What is the first derivative of -1466339v - 1034567? -1466339 Find the second derivative of -2c2i*2u*2 + 4c*2i*2u + 16354c2iu2 + 3861i*2u wrt u. -4c2i*2 + 32708c*2i Find the first derivative of 1035w2 - 93w - 426453 wrt w. 2070w - 93 What is the derivative of -3f*4 - 4252f - 7599 wrt f? -12f3 - 4252 What is the second derivative of -2cn3 + 25931cn2 - 18cn + 99c - 2n3 + 4n + 6 wrt n? -12cn + 51862c - 12n Find the third derivative of -6ky*4 - ky*3 + 137ky2 - 772y4 - y3 + 934y2 wrt y. -144ky - 6k - 18528y - 6 Find the second derivative of -8l*5 - 12l*3 - 511l*2 + 403l + 112 wrt l. -160l3 - 72l - 1022 What is the third derivative of -2l5 - 24392l*3 - 54434l*2 wrt l? -120l*2 - 146352 What is the third derivative of -2p*3q*2 + 25708p*3q - 4p3 + 477p*2q*2 - 282p*2q - p*2 + 2p + 2q wrt p? -12q*2 + 154248q - 24 What is the third derivative of -607i6 + 41i*4 + 170228i*2 wrt i? -72840i*3 + 984i Find the third derivative of -do3q*3 + 74193do3q + 16do*2q - 2doq + 10do - o2q*3 wrt o. -6dq3 + 445158dq Find the second derivative of -189362o*4 - 23114o. -2272344o2 Find the second derivative of 2n*5 + 93554n*4 - 2n*2 + 114194n. 40n3 + 1122648n*2 - 4 Find the second derivative of 13r*2u*2y + 2r2u*2 + 2r*2uy - 2r*2 + 23ruy - 75u2y + 2u2 - 4u + 2y wrt u. 26r*2y + 4r2 - 150y + 4 What is the second derivative of -7k4p - 8478k4 - 2kp + 2k - 10p + 1260 wrt k? -84k*2p - 101736k2 What is the second derivative of -2g*3l*2 + 2g*3l - 1235g3 + 21519gl2 wrt g? -12gl2 + 12gl - 7410g What is the third derivative of 2w6 - 18534w*4 + 6w*2 - 3w + 1248? 240w3 - 444816w Differentiate 32hkw + 3hk - 115hw + 2h + 1662kw + 104k with respect to h. 32kw + 3k - 115w + 2 What is the derivative of -2j*2uw + 386j*2u - 36j2 + 208juw*2 + ju + 22jw*2 - 2j wrt w? -2j2u + 416juw + 44jw What is the second derivative of -8684c*2su2 + 5c*2su + 154c*2u wrt u? -17368c2s Find the third derivative of -53653y3 - 60y*2 - 112. -321918 What is the third derivative of -7845o*4 + 22o*3 - 2o*2 + 266629o? -188280o + 132 Find the third derivative of -2111945i*5 - 10i*2 - 76737 wrt i. -126716700i*2 Find the third derivative of 1165794t*6 + 3t*2 + 24874t wrt t. 139895280t3 Differentiate -a2w*3 - 2a*2wx + 85a*2wy - 6aw3y + aw2 + 2awx - 97axy + 240ax - w2 with respect to y. 85a*2w - 6aw*3 - 97ax What is the derivative of 895r*2v2 + r2v - 11rv2 + 27875v*2 wrt r? 1790rv2 + 2rv - 11v*2 Find the second derivative of -16j*3m*2 + 2j*3mz2 + 3j*2z*3 + 112m*2z*3 - mz + 40m wrt m. -32j*3 + 224z*3 Differentiate -83523q + 74109. -83523 Find the second derivative of 20y2z*2 + 2y*2z + 136y2 - 17886yz + 3z*2 wrt y. 40z*2 + 4z + 272 What is the second derivative of 118ci*3 + 5ci2 + 260ci + 3c + 2i3 + 2i*2 - 2i wrt i? 708ci + 10c + 12i + 4 Find the third derivative of -2iw*3 + 832iw2 - iwz3 + 2iw - 2i + 240833w3z*3 + 6z*2 wrt z. -6iw + 1444998w*3 Find the second derivative of -3b*3h2 - b3h + b3 + 8b*2h*2 - 231754bh + 2b + 922h2 - h wrt h. -6b*3 + 16b*2 + 1844 What is the second derivative of 81552p*2t*3 + 7p*2t + 2pt + 3569p wrt t? 489312p*2t What is the second derivative of -23027o2 - 772o wrt o? -46054 Differentiate 1784w2 - w + 614480 with respect to w. 3568w - 1 Differentiate -b*3 - 2070b*2dz - 7bd + 4dz - 3d - 19z - 292 with respect to b. -3b*2 - 4140bdz - 7d What is the third derivative of -6j*2kq3 + 13032j*2q*3 + 4585j*2q*2 - 2jk + 99jq2 - 2kq wrt q? -36j*2k + 78192j2 What is the third derivative of 171i*6 - 114i*2 + 3i - 3 wrt i? 20520i3 What is the derivative of -630607n + 281650? -630607 What is the first derivative of 1481h3l - 30h3 - 6h*2l + 420h2 + h + 12l wrt l? 1481h3 - 6h*2 + 12 What is the second derivative of -6fn3p - 2fn*2p - 1179fnp2 - 9fp2 - n3p*2 + 297n*2 - 2n wrt p? -2358fn - 18f - 2n*3 Find the third derivative of -4686i*2m*4 + 2i*2m*2 - 17119i*2 wrt m. -112464i*2m Find the third derivative of 3192o3y*4 - 352o*3y + 70o2y*2 + 3oy5 wrt y. 76608o*3y + 180oy*2 What is the third derivative of 5502965p*3 - 229802p*2 + 4p? 33017790 Find the third derivative of 247u6 - u5 + 2u*3 + 47u*2 + 3987 wrt u. 29640u*3 - 60u*2 + 12 What is the derivative of -575795g*3 + 359348 wrt g? -1727385g*2 Find the second derivative of -327o*5 + 4o*4 - 11o*2 - 384o + 6. -6540o3 + 48o*2 - 22 What is the derivative of 603895p - 221816? 603895 What is the first derivative of -32jx*3 - 3jx2 + 4jx - 80j + 23x3 + 116x wrt j? -32x3 - 3x*2 + 4x - 80 Find the second derivative of 244786q3ty2 + q3ty - 2q*2 + 3qty + 4qy*2 + 65ty2 - ty + 3y wrt q. 1468716qty*2 + 6qty - 4 Differentiate -15x4 - 52x*2 - 3x + 34422 with respect to x. -60x3 - 104x - 3 Find the second derivative of 57z4 - 3434z*2 + 29z + 10572 wrt z. 684z2 - 6868 Differentiate 339t*3 - 3296t + 3581030 with respect to t. 1017t2 - 3296 Find the first derivative of 11c*3 - 5c*2 + 316c + 764224 wrt c. 33c2 - 10c + 316 Differentiate 8923s4 - 72288 with respect to s. 35692s*3 What is the second derivative of -1859510p*2 - 1253381p? -3719020 What is the second derivative of -511v4 - 16v*3 + 5v*2 - 150217v wrt v? -6132v2 - 96v + 10 What is the derivative of g*3l - 97074g3 + 1506g*2l2 wrt l? g3 + 3012g2l What is the derivative of -233266c + 591352 wrt c? -233266 What is the third derivative of -20909r*6s*3 + 810r*2s3 + r2s wrt r? -2509080r*3s*3 What is the second derivative of -77833m*3v*2 + 421m*3v - m*3 - 6m*2v + m*2 - 6v wrt v? -155666m3 Differentiate 220298h*3 + 640510. 660894h2 What is the second derivative of -c3p2 + 57c*3p + c*3 + 20c*2p*2 + 198c*2p + cp2 + 252p*2 wrt p? -2c*3 + 40c*2 + 2c + 504 Find the second derivative of 2855084k*2 + k - 3965700 wrt k. 5710168 What is the second	{ "pile_set_name": "DM Mathematics" }
n + 135. Let k(z) = 5a(z) - 2d(z). Determine w so that k(w) = 0. -1, 43 Let n(v) = 5v2 + 1426v + 576. Let p(y) = -18y2 - 4276y - 1728. Let t(m) = 16n(m) + 5p(m). Factor t(c). -2(c - 144)(5c + 2) Let j(l) = -4l*3 + 29l*2 + 36l + 6. Let a(x) = -20x3 + 148x*2 + 184x + 32. Let w(h) = 3a(h) - 16j(h). Let w(m) = 0. Calculate m. -1, 0, 6 Let s(g) = g*2 - 2. Let b(j) = 2j*2 - 218j + 112. Let u(p) = b(p) + 2s(p). Determine o, given that u(o) = 0. 1/2, 54 Factor -7678/5z - 2/5z3 - 3842/5z*2 - 3838/5. -2(z + 1)*2(z + 1919)/5 Let h(p) = -49p2 - 1133p + 5798. Let k(c) = -23c2 - 566c + 2901. Let l(g) = 6h(g) - 13k(g). Solve l(y) = 0 for y. -117, 5 Let y(i) = -i*5 - 4i4 - i2 + 2. Let s(x) = -99x5 + 91x*4 + 515x*3 + 458x*2 + 127x. Let t(f) = s(f) + 3y(f). Let t(j) = 0. Calculate j. -1, -2/3, -1/2, -1/17, 3 Let v(i) be the second derivative of 0 + 7/3i*3 - 15i + 0i4 + 1/1260i*6 + 1/210i*5 + 0i*2. Let s(p) be the second derivative of v(p). Factor s(z). 2z(z + 2)/7 Suppose -16f + 14 = -2. Suppose -83a + a2 + 165a - 2 - 84a - f = 0. What is a? -1, 3 Let w be 360/150 - (-4 + 8)/(2 + 8). Solve -2/3u*4 + 2u - 2u3 + 0 + 2/3u*w = 0. -3, -1, 0, 1 Suppose 6 = -5j + 5i - 9, j - 1 = -3i. Let s be (-276)/(-506) - j/(-165)12. Factor -36/5u + su2 + 162/5. 2(u - 9)*2/5 Let v(c) be the first derivative of -1/6c*2 - 51 - 2c + 1/9c3. What is k in v(k) = 0? -2, 3 Let q be (-4 - (-6)/2)/(5/(-15)). Solve 30o*2 + 16o + o*2 - 75o*2 + 8o*q + 20 = 0. -1/2, 1, 5 Let x = 1121958 + -286097936/255. Let t = x + -62/15. Suppose -t - 10/17g*2 - 54/17g = 0. Calculate g. -5, -2/5 Factor 97/4m - 1/4m*2 - 1/4m*3 + 385/4. -(m - 11)(m + 5)(m + 7)/4 Suppose -4118i = 3q - 4113i - 165, -55 = -q - 4i. Solve -10/3z*2 + qz + 85/3 = 0 for z. -1/2, 17 Let c = -7/117051 + 117079/468204. Factor -15/4w2 + cw*3 + 0 + 9w. w(w - 12)(w - 3)/4 Suppose -1600p + 5360 = -2640. Factor -8z + 14z2 + 0 + 1/2z*p - 6z*3 - 1/2z*4. z(z - 2)*2(z - 1)(z + 4)/2 Suppose -93j = -117j + 120. Let p be ((-104)/48 + 3)/j. Factor -8/3 - 4/3r - pr2. -(r + 4)2/6 Determine q so that -2/9q + 2/9q3 - 12q*2 + 12 = 0. -1, 1, 54 Factor 3/8n*2 + 69/4n + 387/8. 3(n + 3)(n + 43)/8 Factor 169g2 + 12g*3 - 14g*3 - 57g*2 + 16g - 49g2 - 61g*2 - 24. -2(g - 2)*2(g + 3) Let f be 25/(-600)21(512/(-280) - (-10)/25). Suppose -fd5 + 5 + 10d - 25/4d4 - 35/4d*3 + 5/4d*2 = 0. What is d? -2, -1, 1 Factor -16c*4 - 4c*5 + 132 - 62c*2 - 10c*2 - 24 - 595c*3 + 491c*3 + 108c - 20c4. -4(c - 1)(c + 1)(c + 3)*3 Let g be ((-21774)/(-30))/(5/(-2) + 3). Let x = g - 1451. Factor -xu*3 - 12/5 + 12/5u*2 + 3/5u. -3(u - 4)(u - 1)(u + 1)/5 Let q(c) be the second derivative of 3c*5/20 - 49c*4/2 + 1040c*3 + 24336c*2 + 4075c. Solve q(t) = 0 for t. -6, 52 Suppose 3s = 11 + 79. Suppose -28 + 12 = n - 5x, 3x = 12. Determine m, given that 4m*4 + 100m - nm3 - sm - 4m2 - 32m - 34m = 0. -1, 0, 1 Find a, given that -1728/7 - 60/7a*2 + 576/7a + 2/7a3 = 0. 6, 12 Let k be (-5)/(-1) + 141 + -2. Let d = -99 + k. Suppose 90y*4 + 35y*3 + dy - 2 + 2 - 95y4 - 75y*2 = 0. Calculate y. 0, 1, 3 Suppose -2n = -1 + 25. Let i be n/9 + 10/3. Determine f, given that 3f3 - 8f3 - fi - 4f2 + 0f*3 = 0. -1, 0 Let a(p) be the second derivative of 11p*7/441 + 31p*6/105 + 97p5/105 - p4/7 - 205p3/63 - 25p*2/7 + 2133p. Determine w, given that a(w) = 0. -5, -3, -1, -5/11, 1 Let t be (0 - 4 - -1)/1 - -5. Let h = 9 - 5. Factor q*3 + tq4 + q3 + 4q3 - 3q5 + qh. -3q3(q - 2)(q + 1) Suppose -46x - 6 = -48x. Suppose xo = -2s + 7, 5o - 5 = -5s + 5. Let 0h - 2/15ho + 0 - 4/15h*2 + 2/5h*4 = 0. What is h? -2/3, 0, 1 Let n(g) be the third derivative of -17g*2 - 1/12g*5 - 95/12g*4 - 185/6g*3 + 0 - 5g. Factor n(l). -5(l + 1)(l + 37) Let z(o) be the first derivative of -5o6/3 - 256o*5/5 + 327o*4/2 - 500o*3/3 + 56o*2 - 3599. Find a, given that z(a) = 0. -28, 0, 2/5, 1 Solve 2/9i + 1/9i4 + 4/9i*3 + 0 + 5/9i2 = 0. -2, -1, 0 Let x(i) be the second derivative of i4/138 + 73i3/23 + 10i - 51. Suppose x(v) = 0. Calculate v. -219, 0 Suppose -3 + 17 = 7d. Find a such that 4a*4 + 234a + 32ad + 15a*3 + 5a*3 - 218a = 0. -2, -1, 0 Let c(n) be the first derivative of -n*5/10 - 53n*4/16 - 75n*3/2 - 1309n*2/8 - 605n/2 + 4647. Let c(x) = 0. Calculate x. -11, -5/2, -2 Let m(a) be the second derivative of a*5/140 + 11a*4/84 - 76a*3/21 - 7089a. Find c, given that m(c) = 0. -19, 0, 8 Let z(n) = -n*2 - 47n + 1431. Let c be z(-68). Factor 2/9g - 2/9g*c + 4/9 - 4/9g*2. -2(g - 1)(g + 1)(g + 2)/9 Factor -770/3o + 1160/3o*2 + 64 - 260o*3 + 200/3o*4 - 2/3o*5. -2(o - 96)(o - 1)4/3 Let n(w) be the second derivative of -w6/75 - w5/5 + 23w*4/6 - 16w*3/3 - 204w*2/5 + 2w - 169. Suppose n(y) = 0. What is y? -17, -1, 2, 6 Let n be 5/40744. Suppose 4y + 5 = n. Factor 3 - y - p2 + 3p*2 + 3p*2 + 20p*3 - 20p. 5(p - 1)(p + 1)(4p + 1) Let h(i) be the second derivative of -2i7/315 - i6/75 + 2i*5/25 + 7i*4/90 - 2i*3/15 - 80i + 9. Suppose h(o) = 0. Calculate o. -3, -1, 0, 1/2, 2 Let w = -449 - -447. Let c(o) = 3o3 + 38o*2 - 129o + 98. Let z(h) = -21h3 - 267h*2 + 903h - 690. Let x(r) = wz(r) - 15c(r). Factor x(n). -3(n - 2)(n - 1)(n + 15) Let a(c) be the third derivative of -c6/300 + 37c*5/150 - 104c*4/15 + 256c*3/3 + 76c*2 - 6c. Factor a(o). -2(o - 16)2(o - 5)/5 Let c(r) = -2r3 - 63r*2 - 28r + 95. Let k be c(-31). Let b(x) = 56x2 - 46x. Let g(v) = 2v3 + 2v*2 + v. Let d(l) = kg(l) - b(l). Factor d(p). 4p(p - 12)(p - 1) Let j(s) = -s4 + 8s*3 + 17s*2 + 6s. Let i = -76 + 74. Let y(n) = -n3 - n2 + n. Let d(a) = iy(a) - j(a). Suppose d(h) = 0. What is h? -1, 0, 8 Suppose 4d - 6 = 14. Let g be 52/(-130) + (-124)/(-10) + -1. Determine j, given that dj5 - 13j*4 + gj*4 + 29j*4 + 40j*3 + 20j*2 - 2j*4 = 0. -2, -1, 0 Suppose 5b = -5l + 140, 19 = -4l + 4b + 99. Find i, given that 562 - 12i*2 + 16i*2 - li + 222 + 136i = 0. -14 Suppose -151w + 154w = 162. Factor 4u*3 - 225 - wu*3 + 1548u*2 + 5u*4 - 1408u*2 - 28u - 2u. 5(u - 5)(u - 3)2(u + 1) Find k such that 0k + 1/5k*2 + 17/10k*4 + 19/10k*3 + 0 = 0. -1, -2/17, 0 Let q = -201779/780 + 139/156. Let v = q + 261. Solve -32/5r + 16/5 - 108/5r2 - 76/5r*3 - vr*4 = 0 for r. -2, -1, 1/4 Suppose 9k = -4k + 858. Let z be (-6)/k-2 + 97/11. Factor -zr3 + 2 + 14r*3 - 2. 5r*3 Let s = -370397/4 + 92600. Find x such that -sx*3 - 1/4x*2 - 1/4x*5 - 3/4x*4 + 0 + 0x = 0. -1, 0 Let p(c) be the second derivative of 0c2 - 1/30c*6 + 226c + 0c4 + 3/4c*5 + 0 + 0c*3. Determine x so that p(x) = 0. 0, 15 Let m be (-2)/((-18)/5) + (-52)/(-117). Let a(x) = 4x*2 - 7x - 6. Let q(w) = 2w2 - w + 2. Let j(z) = mq(z) - a(z). Find y, given that j(y) = 0. -1, 4 Factor -15l5 + 6594l*4 - 90363l*2 - 200037l*2 - 778796l*3 + 55436l*3 - 53l + 53l. -3l*2(l - 220)*2(5l + 2) Let f(l) be the third derivative of l6/60 - l5/6 - 25l*4/6 - 139l*2 - 2l. Determine g so that f(g) = 0. -5, 0, 10 Let i(z) = z*2 + 19z + 73. Let r be i(-14). Let j(k) be the first derivative of -7 + 2/3kr + k2 - 4k. Suppose j(n) = 0. What is n? -2, 1 Factor 63 + 496j + 92 + 100 + 164 + 4j*3 + 253 + 88j*2. 4(j + 2)(j + 6)(j + 14) Let q = 882 + -879. Find x, given that 49 + 451 - 6xq + 105x*2 + 600x + 9x3 + 2x*3 = 0. -10, -1 Solve -109i - 3i3 + 11i2 + 240 - i3 - 11i2 + 285i + 20i2 = 0 for i. -3, -2, 10 Let b(t) be the second derivative of -2/15t*4 - 1/30t*3 - 4t + 1/100t5 + 4/5t*2 - 3. Factor b(a). (a - 8)(a - 1)(a + 1)/5 Let f(s) be the second derivative of 0s*2 + 7/45s*7 + 3/25s*5 - 119/225s*6 + 8/45s*3 - 36s + 0 + 22/45s4. Suppose f(g) = 0. Calculate g. -2/7, 0, 1, 2 Suppose 5d = -5, -5 = 3g - 2d + 11. Let h be 8/(-48) - g/4. Let 4/3 - hi2 - 2i = 0. Calculate i. -2, 1/2 Let x(f) be the second de	{ "pile_set_name": "DM Mathematics" }
e -8u = -u + 483. Let s = u + -12. Let o = -66 - s. Solve 0m + o = -5m for m. -3 Let w(j) = 94 - 41j*2 + 12j*2 + 5j - 90. Let o be w(-1). Let r = o - -33. Solve 5 = -2z - rz for z. -1 Let t be 102/30 - (2 - 24/15). Let i(l) = 3l + 2l - 5 - tl2 - 2l2 + l2 + 2l3. Let g be i(2). Solve -4 = -gx + x for x. 1 Let w(j) = -j*3 + 28j*2 + 161j + 132. Let x be w(33). Solve x = 6r - 8 - 10 for r. 3 Suppose 4q - 12v + 37 - 121 = 0, -4v - 28 = 0. Solve q = -32r - 234 + 10 for r. -7 Let f be -4 + 272/80 + (-116)/(-10). Solve fh - 21 = -10 for h. 1 Let m(j) = -3j + 25 + 16 + 7 + 4j. Let h be m(-44). Solve 5r - h = 1 for r. 1 Let b = -15 + -7. Let f be 14(-24)/(-33) - (-4)/b. Suppose -fz = -21z + 33. Solve -l = z + 2 for l. -5 Let y be (222/259)/(3/70). Solve 0 = -2j - y + 12 for j. -4 Suppose -3l + 5t = 7t - 575, -7t + 160 = l. Solve 25n - l = -14n for n. 5 Let y be ((-3)/6)/((-1)/6). Suppose -yp + 11 = -13. Suppose 130 = -27m + 454. Solve 4t - pt + m = 0 for t. 3 Let z(o) = o2 - 58o - 583. Let r be z(67). Solve 17h - r = 27h for h. -2 Suppose 298j + 89j = 154413. Solve -c + 58c = -j for c. -7 Let b(d) = 4d - 1. Let h be b(3). Let l(r) = -2r3 - 4r*2 - 8r - 6. Let a be l(-2). Solve 16g - hg = -a for g. -2 Let k = 1470 - 1442. Solve -kr + 34r = 6 for r. 1 Suppose 0 = -28j + 24 + 21 + 39. Solve 0 = -11t + 14 - j for t. 1 Let n be ((-39)/2)/(4/((-96)/(-18))). Let h = 23 + n. Let j be (6/h - -8) + -2. Solve 0 = -7d + jd + 12 for d. 4 Let n = -143 + 445. Let s = -299 + n. Suppose 3z - 10 = -4. Solve -s - z = 5o for o. -1 Suppose 3q - 2849 = d, 3q + 311d - 316d = 2869. Solve -898 + q = 10g for g. 5 Let y be (28/8)/(4/(-24)-3). Solve 4r = yr - 12 for r. 4 Let x(u) = -4u + 13. Let l(k) = -10k + 38. Let h(r) = 5l(r) - 14x(r). Let q be h(3). Solve -2t = -34 + q for t. 4 Suppose -5j + 97 + 193 = 0. Suppose 53g - jg = -30. Let b(v) = 7v. Let m be b(1). Solve 4 = gy - my for y. -4 Let s(z) = 2z*2 - 4z - 1. Let d be s(3). Suppose -2b = 4w - 22, -dw = 5b - b - 44. Let m = -49 + 54. Solve 9 + b = -ma for a. -4 Let b(x) = -2x. Let u be b(0). Let w(p) = p*2 - 2. Let n be w(2). Let g = 2 + n. Solve -2f + uf = g for f. -2 Let y(w) = -w2 + 96w - 1084. Let s be y(14). Solve sd = 53d + 33 for d. 3 Suppose 8016 + 5424 = 160r. Solve r = -14t - 0 for t. -6 Let j = 74 - 70. Let o = -33 - -48. Suppose b + o = jb. Solve 3w + b = -2w for w. -1 Suppose -v + 37 = -3x + x, 5x - 20 = 0. Let y = 57 - v. Suppose -175w = -178w + y. Solve wq = 6 - 2 for q. 1 Let n be 4/(((-4)/9)/2). Let w be (104/(-6))/(n/27). Suppose 0f + w = 2f + 5c, 3f - 5c = 14. Solve 7a - f = 9a for a. -4 Let u be 1/(261/(-938) - 30/(-105)). Solve 0 = -us + 118s + 144 for s. 9 Let c(q) = -q2 - 7q - 9. Let a be c(-5). Suppose 4p - h = 35, 2p + 2h - a = 9. Suppose -pb - 9b = -0b. Solve 1 + b = -t for t. -1 Let x(t) = 536t + 3788. Let g be x(-7). Solve 0 = 13p - 4p + g for p. -4 Suppose 323y - 289y - 1564 = 0. Solve 2t + y = 36 for t. -5 Let v(z) = -z*3 + z - 2. Let c be v(-2). Let t = 2599 + -2595. Suppose -tn + 26 = 2w, cn = -w - 4w + 35. Solve l + 2 = wl for l. 1 Let f be (1512/(-280))/(9/(-15)). Solve -fp + 12 = -6p for p. 4 Let j(y) = -9y - 168. Let a be (-3 + 1)/((-10)/(-95)). Let q be j(a). Solve qc + 5 - 20 = 0 for c. 5 Suppose -4a + a = 3, 3n + 65 = -2a. Let c be 7/(n/12) + 2 + 2. Solve c = 5i + 3 + 2 for i. -1 Let c = -19 + 23. Suppose d - 3d + c = 0. Suppose 5u - 2 = di, 0i = 5u + 4i + 4. Solve 0 = -2f + 4 - u for f. 2 Suppose -15c + 18c = -15. Let w be (c/(-2))/(40/32). Let a = -5 - -9. Solve -aq - 6 = -w for q. -1 Suppose 7 - 25 = -2m. Suppose -d = md - 30. Solve -16 = -dy - y for y. 4 Let k be ((-310)/(-50) + -5)30. Solve 0 = ki + 74 - 2 for i. -2 Let b(q) = q2 - 11q - 3566. Let o be b(-55). Solve 12p + o = 4p for p. -8 Suppose 321c = 313c + 48. Solve 0 = cu - 12 - 30 for u. 7 Let a(k) = k3 + 3k*2 - 4k - 2. Let r be a(-3). Let z be (105/7 - 8)/(-1 - -2). Suppose -20 = -zv - 20. Solve v = 5w - 0w - r for w. 2 Suppose 29408 = 6n + 29342. Solve nc - 6 = 5 for c. 1 Suppose 25y = 1123 + 3102 + 75. Solve -41h - y = 2h for h. -4 Let t be 45/(-5) - -7 - -4. Suppose 9 - 44 = -tj + 5i, -j - 5i - 20 = 0. Solve jp = 13 + 7 for p. 4 Let b(z) = -1012z2 + 6z - 4z - 4 + 1013z*2. Let m be b(-4). Let n(j) = -j - 2. Let a be n(-4). Solve -mf - 6 = -af for f. -3 Suppose -5l + 95 = -108n + 111n, 3 = 3l. Solve -23d - n = -13d for d. -3 Suppose -o = -5s - 3o + 13, -5o = -20. Let d = 322 + -246. Suppose -j - 73 = -d. Solve s = jz - 5 for z. 2 Let h(n) = -15 + 34 + 7 + 11n + 17n2 - 7. Let r be h(-2). Solve rm = 62m + 12 for m. 4 Let s(z) = -7z - 35. Let g be s(-5). Suppose 0 = n - w + 5, 2w = 5n - 2w + 24. Let u be (-1)/((-44)/(-12) + n). Solve gb - ub = 3 for b. -1 Let i(d) = -15d + 43. Let g be i(3). Let v be (g - 1)(-7)/21. Solve 5z - v - 24 = 0 for z. 5 Let q be ((-264)/45 + 2/(-15))/(-2). Let w(b) = 2b3 - 3b*2 + 6b - 5. Let g be w(3). Let a = 44 - g. Solve -ap + 17 = -q for p. 5 Suppose 6t = -3t - 198. Let r = t + 20. Let h be (r + 1)/(1/(-2)). Solve -6x + 16 = -hx for x. 4 Let s(r) = -4r - 2. Let w be s(-3). Suppose -j + w = -2i - 0, 0 = i + 5. Solve 0 = -2z - jz - 8 for z. -4 Let x = -483 - -532. Suppose -2c = -57 + x. Solve 3o - 19 + c = 0 for o. 5 Suppose 7a - 8a + k - 3 = 0, -k = 5a - 9. Let m be (-54 + 54)/(4 - a). Solve 4r - 3r + 5 = m for r. -5 Suppose -p + 4s + 70 = 0, -22p - 5s - 346 = -26p. Solve -64 = -10w - p for w. -3 Let h(u) = -13u + 407. Let m be h(18). Solve 176b = mb - 9 for b. -3 Let s be 7/3 + (-210)/(-45) - 2. Solve -27n + 96 = sn for n. 3 Let v be (((-64)/12)/4)/((-16)/60) - -9. Solve 23 = 3o + v for o. 3 Let c be 70/(-15)5/((-15)/9). Suppose x + 3f = 7 + c, -2x - 4f + 36 = 0. Solve -8p + 5p - x = 0 for p. -4 Suppose 5j - 39o + 42o - 116 = 0, -3o = 2j - 50. Solve -j = -105q + 116q for q. -2 Suppose -2o + 4a = 316, -3o = -0o - 5a + 470. Let i = -148 - o. Solve 3 = -iw - 7 for w. -5 Let b(s) = -s*3 + 24s*2 + 6s - 30. Let z be b(24). Let x be ((-120)/(-14))/(z/532). Solve -12f = -2f - x for f. 4 Suppose -2f = 3g + 34, -f - 6 = g + 9. Let q(l) = l*2 + 12l + 1. Let z be q(f). Let d be (-16)/z + (-2)/(-5). Solve d + 3 = -v for v. -5 Let r(b) = 2b3 - 3b - 115 - 2b - b3 + 4b*2 + 117. Let a be r(-5). Suppose 34 = 8l + 2t, 28 = l - 18t + 23t. Solve -lc = ac for c. 0 Let x be -9 + (63 - 66)/((-2)/1738). Solve xa - 9 = 2607a for a. -1 Let s = -117 + 117. Let p = 154 + -154. Solve sg - g - 5 = p for g. -5 Suppose -12n + 7n + 60 = 0. Suppose 14x - nx = 0. Suppose x = -5c + 75. Solve -c = -5q + 5 for q. 4 Let f be ((-16)/3)/(-4)72/32. Let x be (9/f - 3)2/6. Solve xc = -5c - 25 for c. -5 Let m(r) = -r*2 - 13r - 13. Let k(v) = 6v - 100. Let o be k(16). Let g be m(o). Solve -9n - g = -5 for n. -2 Let y(w) = 15w - 48. Let o(n) = -5n + 16. Let q(s) = -8o(s) - 3y(s). Let i be q(-5). Let g = i + -29. Solve -4h - g = -4 for h. -2 Let p = 73 - 71. Suppose -11 = 6b - 4b - 5u, 0 = b - pu + 4. Suppose 0 = -o - 1, -bm + 5o + 10 + 5 = 0. Solve mz - 2 = 3z for z. 1 Suppose -3s - 1888 = -m - 7s, 3s - 6 = 0. Solve mt = 1874t + 18 for t. 3 Suppose -7 = 4s + 5. Let g be ((-40)/15 - s)12. Let n(b) = b - 4. Let y be n(g). Solve y = -j - 4j + 15 for j. 3 Let v be (8/12)/118. Suppose 8w - 44 = v. Solve -4n - 1 - w = 0 for n. -2 Let p = 323 - 195. Let n = 131 - p. Let j(c) = c*3 - 10c*2 - 10c - 3. Let z be j(11). Solve -z = -nl + 7 for l. 5 Suppose 35c - 352 = 1643. Solve 0 = -2i + c - 59 for i. -1 Let c be ((-120)/42 + 2)(-112)/6. Solve -10x = 6x + c for x. -1 Suppose 0 = -14y + 109y. Solve y = 11r + 3 + 30 for r. -3 Suppose 55u - 63 = 48u. Suppose n - 39 = uw - 13w, 3w = 2n + 21. Solve -wo = -5o - 12 for o. 3 Let s(z) be the second derivative of -12z - 5/6z3 - 1/2z*2 + 0. Let m be s(-1). Solve -m = -c + 5c for c. -1 Let w = 159 - 142. Suppose -p = -w + 6. Solve -p - 9 = -5l for l. 4 Suppose -2f + 127 = v, -20f - 130 = -22f - 2v. Solve fm - 70 = 48*m for m. 5 Let q(	{ "pile_set_name": "DM Mathematics" }
- 2n3 - 2n*4 - 5n*2 + 6n*2 to the form h + pn + gn2 + mn*3 + sn*4 and give p. 2 Rearrange -154i*4 + 2i2 + i3 + 156i4 + 4 + 0i*3 to the form ri*2 + w + qi + hi4 + ui*3 and give r. 2 Express (1 - 1 - 2z)(2 + 1 - 2)(5 - 4 - 2) - z - 3z + z in the form n + iz and give i. -1 Express 73p - 73p + 10p2 + (2p + 0p + 0p)(13p - 17p + 6p) + 2p2 + 3p*2 - 7p*2 - 3p*2 - 3p*2 + 7p*2 as h + gp*2 + yp and give g. 13 Express (6 - 4 + 3)(3f - 3f + 2f) + (2f - 13f + 2f)(1 + 1 - 4) in the form c + mf and give m. 28 Express (0r + 7r - 3r)(11r - 5r + 8r) as sr2 + b + gr and give s. 56 Express (-2g + 4g + 2g + (3g + 2g - 3g)(5 - 1 - 5) - 3g + 2g + 4g)((1 + 0 - 3)(-3 - 3 + 4) + 1 + 1 - 3)(-3 + 5 - 1) in the form p + og and give p. 0 Rearrange i - 8i - 11i to s + gi and give s. 0 Rearrange -4k - 10 + 10 + 8k to r + wk and give w. 4 Rearrange (-3h + 3h - 2h)(35 + 51 - 29) to r + zh and give z. -114 Rearrange (-4f*2 + 2f*2 + 4f*2)(-2 + 2 + 1) + 5 - 5 + 17f2 to y + sf + gf2 and give g. 19 Express (2 - 32 + 0)(2b - 6b + b) in the form pb + f and give p. 90 Express 0j2 + 2 + j3 + 3j - 2j*2 - 2j*3 - 2j as aj3 + qj + i + vj2 and give v. -2 Rearrange 12a - 2082a3 - 2a + 2076a3 to s + fa*2 + ca*3 + ja and give c. -6 Express 4g4 - 2g*2 - 1 + 9g - 2g3 - 10g + 0g2 in the form h + pg*4 + qg*3 + fg*2 + ug and give f. -2 Express -2q2 + 1 + 4q - 3 + 4q2 + 0q*2 as sq*2 + vq + o and give v. 4 Rearrange 55h - h3 + h3 + h3 + 4 + 4h*4 - 54h to the form fh4 + yh + j + wh2 + mh*3 and give y. 1 Rearrange -m - 9m - 2m2 + 5m*2 to the form vm*2 + u + im and give i. -10 Express ((-3h - h + 2h)(4 - 1 - 1) + 0h + 2h - 4h)(-27 + 18 + 27)(0 - 1 + 3)(0 - 1 - 1) as qh + u and give q. 432 Express (-2 + 7 - 3)(-2q - 2 + 2q - q)(44q - 26q - 24q) in the form j + aq + mq2 and give m. 12 Express -u4 - 2u - u3 - u3 + 0u + 3u + 2u2 in the form au + i + ju2 + gu*3 + lu*4 and give j. 2 Rearrange 0n*2 + 23n*3 - 24n*3 - 4n*2 to the form zn*2 + qn*3 + wn + b and give w. 0 Express -1 - 3j + j - 15j in the form v + ij and give i. -17 Express -61 + 9v*2 + 61 in the form nv*2 + s + fv and give n. 9 Rearrange -4n + 5n + 1 - 2n + 4n to the form jn + p and give p. 1 Rearrange (9j - 28j - 22j)(0j*3 - 2j3 + j3) to zj + s + rj*4 + nj*3 + uj*2 and give n. 0 Rearrange (-105 + 37i + 105)(-3 - 4 + 5) to f + mi and give m. -74 Express (-5 + 4 - 1)(-1 + 1 + m) + (2361 + 11m - 2361)(1 - 1 + 2) as nm + j and give n. 20 Rearrange 3 - 1 - 14j - 3 + 2 to sj + q and give q. 1 Express -2m2 - 86 + 43 - m + 41 + m3 + 3m*4 in the form y + sm*4 + vm*2 + nm*3 + cm and give y. -2 Express -3x - 4 - x - 81x*3 + 79x*3 + (-6x*3 + 5x*3 + 3x*3)(-5 - 3 + 5) as px2 + r + mx*3 + lx and give m. -8 Express 2f - 3f + 3f + (-1 + 2 - 3)(-4f + 2f + 4f) - 351 + 351 + 19f - 3f + 2f + 2f + (-1 + 1 - 1)(-3f - f + 2f) in the form vf + l and give v. 20 Rearrange -3g + 2g2 - g3 - 6g*3 + 10g*3 to the form rg*3 + hg + qg2 + j and give r. 3 Express (-2z - 4z + 5z)(2z - 2z + z) + 214 + 0z*2 - 214 - 159z*2 as nz*2 + h + dz and give n. -160 Rearrange 3i4 + 3i - 7i - 15i*4 - 1 + 10i*4 to the form qi*2 + r + si + mi4 + ci*3 and give c. 0 Rearrange (2 - r - 2)(3 - 3 - 6) to the form i + br and give b. 6 Rearrange -5l*3 - 2l + 33 - 33 - 2l to kl*3 + dl + ol2 + p and give k. -5 Express 9x + 10x - 2x*2 - 2x + (-2x + 2x - x)(3x - 4x + 3x) in the form yx + o + sx*2 and give s. -4 Rearrange -3r - 7 + 4r + r to f + lr and give l. 2 Rearrange l*2 - 4l*2 - 3l*2 + (2l + 0l + l)(-3l - 3l + 5l) to the form w + cl + al2 and give a. -9 Express 4c2 - c2 - c*2 - 14 + 3 in the form lc + fc2 + x and give x. -11 Rearrange (-3 + 2 + 0)((3 + 1 - 2)(-3c + 3c - c) - 2c + 3c + 0c) to xc + j and give x. 1 Express -2z*4 - 3z + 4z4 + 3 + z - 2 - 5z*2 in the form q + bz*4 + dz + rz3 + mz*2 and give m. -5 Rearrange -41q*2 - 29q2 + q2 + 0q2 to the form yq*2 + i + zq and give z. 0 Rearrange -6z + 237 - 237 to the form m + oz and give m. 0 Rearrange -1 - 6z2 - 176z*3 + 3z*2 + 175z*3 + (-1 - 3 + 2)(0z3 + 2z*3 - 5z*3) to mz*3 + dz*2 + a + vz and give a. -1 Express -6s4 + s4 - 2s*4 + (-1 + 1 + s)(-2s3 + 7s*3 - 2s*3) in the form hs*2 + ds*4 + ws + c + qs3 and give c. 0 Express -f4 + f3 - 3f - 249f2 + 2f - 1 + 248f2 as df + lf4 + if*2 + yf*3 + t and give d. -1 Express (-2p + 3p + 0p)(0p*3 + 2p*3 - 4p*3) + (-p + 6p - 2p)(3p3 - 5p*3 + 0p*3) in the form sp*2 + gp*3 + np*4 + xp + d and give d. 0 Express 10h2 + 8 - 2h*2 - 7h*2 as q + fh*2 + sh and give f. 1 Express -1 - 7m + 1 - 23m in the form gm + u and give u. 0 Express 17l - 86 + 86 as t + ul and give u. 17 Rearrange (-2z3 - z3 + 0z3)(-3 + 1 + 5)(1 + 2 - 2) to the form yz + mz2 + nz*3 + o and give y. 0 Rearrange 0z*2 + 3 + 2z*2 - 3 + 6 to fz + gz2 + w and give w. 6 Rearrange (0 - 3g + 0)(3g3 + 25 - g2 - 25) to sg4 + hg + mg3 + wg*2 + v and give s. -9 Express 2x - 3x3 - x - x3 - 6x as jx2 + q + ix + ox3 and give o. -4 Rearrange d4 + 0d*4 + 35 - 2d*2 + 3d - 2d3 - 2d - 26 to the form rd + zd*2 + fd*4 + l + vd*3 and give l. 9 Rearrange (-128s + 103s2 + 128s)(-1 - 2 + 2)(4 - 1 - 1) to the form gs2 + ys + q and give g. -206 Express -4o - 13o*2 + 8o - 2o as so + jo2 + x and give j. -13 Rearrange -6v*2 + 3 + 0 + 0 to mv + iv2 + d and give d. 3 Express (9 - 5 + 1)(-1 + 1 - 3x) - 5x + 3x - 2 + 4x in the form kx + a and give k. -13 Rearrange (9o + 3o + 0o)(-10o*2 + 2o*2 + 4o*2) to the form jo*3 + yo*2 + ho + r and give j. -48 Rearrange h - h*2 - 7h + 10h3 + 5h - 4h to f + jh*3 + nh*2 + ph and give f. 0 Express 7j3 + 0j3 - j3 + (0 + 0 + j)(-j2 + 5j*2 - 3j*2) - 2j3 + 4 - 4 - j3 + 2j - 2j as vj + f + xj*2 + bj*3 and give b. 4 Rearrange -32v - 26v + 14v - 2 to a + fv and give a. -2 Express (1 + 3 - 2)(5h + 0h - 4h) + (18 - 18 - 7h)(-4 + 4 - 3) in the form dh + u and give d. 23 Express 8a + 2a + 6a - 22a as i + ma and give m. -6 Rearrange 5c - 9c + 9c*2 + 4c to xc + tc*2 + w and give t. 9 Rearrange -46u - 4 + 21u - 34 + 26u to q + su and give q. -38 Express (9q*2 - q + q)(7 - 4 - 1) + 3q2 - 2 + 2 as aq + tq2 + n and give t. 21 Rearrange 2s2 - s2 + 3s4 - 2s*2 - 2 to the form ds*2 + ps*3 + ms + fs4 + y and give d. -1 Rearrange 5p - 5p + 8p*2 + (-1 - 2 + 5)(-4p + 4p - 2p2) + 1 + 0p + 0p - p2 - 4p*2 + 2p*2 + 4p*2 to the form xp + ip2 + z and give z. 1 Express (-3 + 3 + d)(-2d + d - 3d)(d2 + d2 + 0d*2) in the form hd*3 + v + md + cd2 + ud*4 and give u. -8 Rearrange 3 - 5 + 777c*4 - 775c4 + c + c2 - c*3 to qc*2 + u + jc + zc3 + fc*4 and give z. -1 Rearrange -2y + 11y2 + 2y - 6y2 to the form f + qy*2 + by and give b. 0 Express (13 - 47 + 26 - 2d)(-1 + 1 + d*2)(-2 + 1 + 3)(5 - 3 - 1) as f + jd*2 + vd + bd3 and give b. -4 Rearrange (4v + v - 3v)(0 + 28 - 19v + 23v) to the form w + fv + kv*2 and give k. 8 Rearrange 4 + 2q*2 - 16 - 2q*3 - 4q + 12 to the form wq3 + kq + tq2 + l and give k. -4 Express 13z*3 - 7z3 + z2 + 6z3 in the form jz*3 + qz + b + hz2 and give j. 12 Rearrange (2j*2 - 4j*2 - 2j*2)(-3j - 2j*2 - j + 4j*2) to mj + kj4 + qj*2 + pj*3 + d and give p. 16 Rearrange -6m + 21 + 14m - 8m - m*2 + 2m*3 to gm*3 + rm*2 + km + i and give i. 21 Express -17 + 37 - 19 - 66p2 in the form up*2 + lp + s and give s. 1 Express (-3 + 3 + q*2)(q - q + 2q)(-4q + 13q + 3 + 1) as l + jq4 + sq + tq3 + xq*2 and give t. 8 Express 2 + 8 + 8q + 4 - 11 as m + gq and give g. 8 Express (-2 + 0 + 4)(-3w3 - 2w*3 + 4w**3)	{ "pile_set_name": "DM Mathematics" }
- 76ix*3 + 13ix2 - x3 - 5x*2 wrt i. -312i*2x + 724x3 Find the second derivative of 39h*4 + 9h*3 - 11h*2 - 47024h. 468h2 + 54h - 22 Differentiate 160dl*2 - 5503dl + 715257d wrt l. 320dl - 5503d What is the third derivative of -889516w*3 + 96w*2 - 4652? -5337096 Differentiate 2c*4g*2 - 860193c*2g*2 + 2410123g*2 wrt c. 8c*3g*2 - 1720386cg2 What is the first derivative of 153662v*3 + 141901 wrt v? 460986v*2 Find the second derivative of 19862z*5 - 41848z. 397240z3 What is the second derivative of 56n*3v*2 - 172n*2v*2 + 33nv2 + 104n + 2v2 - 1 wrt n? 336nv2 - 344v*2 What is the second derivative of 15983n*2 - 67765n? 31966 Find the second derivative of -117825l4 + 54070l wrt l. -1413900l2 What is the third derivative of 774955f*3 - 313304f*2 wrt f? 4649730 Find the second derivative of -106108r*2 - 101r - 537. -212216 Differentiate -1973t4 + 6tz2 - 3z*2 + 425z - 19 with respect to t. -7892t3 + 6z*2 What is the third derivative of 42h*2y*3 - 9h*2 - 870hy6 - 5693y*2 wrt y? 252h*2 - 104400hy3 Find the second derivative of 1767o*3 - 9o*2 + 73270o wrt o. 10602o - 18 Find the third derivative of 67hm4 - 1855hm3 - 2hm2 - 147hm + 2h + 2m3 - 1860m + 3 wrt m. 1608hm - 11130h + 12 What is the third derivative of 88239b*3h*2 + 3b*2h*2 + 20b*2 + 210b wrt b? 529434h2 What is the derivative of u4 - 2212u*2 - 3u + 3618 wrt u? 4u3 - 4424u - 3 What is the second derivative of 2034604h2 - 395h + 717? 4069208 Find the third derivative of jn4 + 633jn3 + 2jn2 + 18jn - 10n*3 + 3n*2 + 2 wrt n. 24jn + 3798j - 60 Find the first derivative of 30i2w*2 + 1187202i*2 + iw*2 - 67w*2 wrt w. 60i*2w + 2iw - 134w What is the second derivative of -133129i*3 + 18i - 3424 wrt i? -798774i Find the third derivative of -227o5 - o4x - 8o*3 - 2o*2 - 6ox - 78o + 1 wrt o. -13620o2 - 24ox - 48 Find the second derivative of 64678f*5 - 78f + 173 wrt f. 1293560f3 Find the second derivative of 57890d*2 - 36270d wrt d. 115780 Find the second derivative of 10v5 - 3659v*4 - 403190v. 200v3 - 43908v*2 Differentiate -34926fo2 + 11956o*2 + 3 wrt f. -34926o2 What is the first derivative of v2 + 17650v - 1651362 wrt v? 2v + 17650 Find the third derivative of -84l2x*3 + 19l*2x*2 - 7lx2 - 20lx + 51x*4 wrt x. -504l*2 + 1224x What is the derivative of -1128248d + 4412102 wrt d? -1128248 Find the second derivative of -56709j*2 - 67567j. -113418 What is the second derivative of -37612k2q*3 + 4kq3 + kq*2 + 82q*2 + 1 wrt k? -75224q*3 Find the third derivative of 3311742c*3 + 1259691c*2. 19870452 Find the second derivative of 174205l*2y*2 - 11l*2y + 2ly*3 - 512ly wrt y. 348410l*2 + 12ly What is the derivative of 276135co + 210830o - 1 wrt c? 276135o Differentiate -10uw - 2592547u - 3w2 + 6937w wrt w. -10u - 6w + 6937 Find the second derivative of 396574i3 - 3530i. 2379444i Differentiate -3d*2v*3 - 46404d*2 - 6196dv4 + 2d wrt v. -9d2v*2 - 24784dv3 Differentiate 20u*3 + 31698u + 266751 wrt u. 60u2 + 31698 What is the second derivative of 3x4 - x3 - 15660x2 - 265779x wrt x? 36x2 - 6x - 31320 What is the second derivative of c*5k + 79918c4k - 7c2 - 2669ck - 9c + 2 wrt c? 20c3k + 959016c2k - 14 Find the third derivative of -6i6 - 347i*4 + 2i*3 + 11i*2 - 10i + 44 wrt i. -720i3 - 8328i + 12 What is the second derivative of 41821c3v*2 + 401c*3 + 101c*2 + 9cv4 - 3cv wrt v? 83642c*3 + 108cv2 Find the third derivative of 16j*4 - 132919j*3 - 4j*2 + 12327j - 10 wrt j. 384j - 797514 Find the second derivative of qx*5 - qx*2 - qx - 22900x2 + 58350x wrt x. 20qx*3 - 2q - 45800 Find the second derivative of -84n3u*2 + 144n*3u - 476nu*2 + 7nu + u2 + 3u wrt u. -168n3 - 952n + 2 What is the derivative of 51448u + 73130? 51448 What is the third derivative of -14l*5n - 244l4n2 - l2n2 - 4l*2n - 2375ln wrt l? -840l2n - 5856ln*2 Find the third derivative of -202i*4o*2 - 964i*3o*2 - 2i*2o + io2 + 1292i - 55 wrt i. -4848io*2 - 5784o*2 What is the third derivative of 2npw*3 + 1849npw*2 + 2npw + 103nw*3 + nw + 54pw*3 - pw + 2w3 + 33 wrt w? 12np + 618n + 324p + 12 Find the first derivative of -87655f*4 - 3f - 1002615 wrt f. -350620f3 - 3 What is the derivative of -2a*2 + agp2 - 4388ap3 - 4gp3 - 11768p*2 wrt a? -4a + gp2 - 4388p*3 What is the third derivative of 152919a*3 + 1588a*2 - 4a + 13? 917514 Find the second derivative of 83040o2 - 17377o + 1. 166080 What is the second derivative of 127k4 - 20k*3 - 2k*2 - 2k + 6259 wrt k? 1524k2 - 120k - 4 Find the second derivative of 605848f3 + f + 5032 wrt f. 3635088f Find the second derivative of 61178l2 + 192l - 53. 122356 Find the first derivative of 23d4j + d*4 + 123d*3 + 4363j - 2 wrt d. 92d3j + 4d3 + 369d*2 Find the third derivative of 353f*2m*3 + 10033f*2m + 40f2 - 2fm2 + 20m*3 - 2m*2 wrt m. 2118f*2 + 120 Differentiate 14182o - 67127 wrt o. 14182 What is the third derivative of 2014g3k*2w*3 - 18g*3k*2w*2 + 2g3 - g2k3w + gk3 - 14gk2w*2 + 6k*3w*3 wrt w? 12084g*3k*2 + 36k*3 Find the second derivative of -49269a*3 + 5a - 2448. -295614a What is the third derivative of 18f*3s*2 + 579f3 - f2s2 - 17f*2s - 538fs*2 + f wrt f? 108s*2 + 3474 Find the first derivative of 352926w*2 + 81613. 705852w What is the second derivative of -12472x4 + 6x*2 + 232412x? -149664x2 + 12 Find the third derivative of -13629w*6 - 42859w*2 wrt w. -1635480w*3 What is the derivative of 167f*3 + 87f*2g*3 - 5g*3 - 2g - 6692 wrt f? 501f2 + 174fg3 What is the third derivative of 183h*6w - 180h3w*3 + 76295h*2w3 + h2 wrt h? 21960h3w - 1080w3 Find the second derivative of -7a*4 - 1177a*3 - 2a*2 + 12a + 100. -84a2 - 7062a - 4 What is the second derivative of 52368i3 - 180i - 376? 314208i Differentiate -w2 + 2445069w + 831782 wrt w. -2w + 2445069 Find the third derivative of 398642w*3x*4 + 3934w*3x*2 + 8wx2 - x5 wrt x. 9567408w*3x - 60x2 What is the derivative of -y3 - 30022y - 750854? -3y2 - 30022 What is the first derivative of -906364o*4 + 971875? -3625456o*3 Find the second derivative of -537bij + 52bj*2 - bj - 9b + ij*2 - 2i - 178j5 wrt j. 104b + 2i - 3560j*3 Find the second derivative of -13575i*2j*5 - 3i*2j*2w + 122i2jw - 2i*2j - i*2w - 3jw wrt j. -271500i2j*3 - 6i*2w What is the first derivative of -12001x2 - 3x + 156822? -24002x - 3 Find the second derivative of 1285289v*2 + 64v - 1230 wrt v. 2570578 What is the first derivative of -284906t4 + 108047 wrt t? -1139624t*3 Differentiate 7756z*3 - 2z - 267708. 23268z2 - 2 What is the third derivative of 2p*5 - 45p*4 - 700p*3 + 1087192p*2? 120p*2 - 1080p - 4200 What is the third derivative of 5396g6 - 31149g*2 wrt g? 647520g*3 Find the first derivative of -28h*4 - 3419h + 680482 wrt h. -112h3 - 3419 Differentiate l3 + 1793991l + 1455214 with respect to l. 3l2 + 1793991 What is the first derivative of -764206h*3lp - h3l - h*3p*4 + 26h*3 + 50h*2l + 58hl - 1 wrt p? -764206h3l - 4h3p*3 What is the second derivative of 102724t*3 - 85765t wrt t? 616344t What is the third derivative of 7k*3o*2 - 5754k*3o + 192k2 + 67o*2 wrt k? 42o*2 - 34524o What is the second derivative of -4098w2y - 40w2 + 9wy + 2w + 21960 wrt w? -8196y - 80 Find the third derivative of 618319q*3 - 3179707q*2 wrt q. 3709914 Find the second derivative of -37611d*2 - 759856d. -75222 What is the third derivative of -34692n4 - 7n*2 - 138n wrt n? -832608n Differentiate -c4d*2 - 81671c*4 - 20770d*2 - 1 wrt c. -4c*3d*2 - 326684c*	{ "pile_set_name": "DM Mathematics" }
- 5r2y + 8r2 - 2ry3 - 4037ry2 - 70r wrt y. 12r3y - 12ry - 8074r Find the third derivative of 806755l*3 - 674571l*2 wrt l. 4840530 What is the second derivative of 227282f*4 - 544954f? 2727384f2 What is the second derivative of 32150v*5 + 28915v wrt v? 643000v3 Find the third derivative of 4297639ry6 + 1945ry2 - y2 - 1 wrt y. 515716680ry3 What is the first derivative of i4 + 1303i3 + i2 - 194126 wrt i? 4i3 + 3909i*2 + 2i Differentiate -38380b4 - 21267. -153520b3 Differentiate s3 + 2s2 - 23583s + 29577. 3s2 + 4s - 23583 Find the first derivative of fi3 - 181957fi2 - 3fi + f + 5013876i3 wrt f. i3 - 181957i2 - 3i + 1 What is the third derivative of -1072408k3 + 4542k*2 + 3k + 1 wrt k? -6434448 Differentiate 2v3 + 26v*2 + 123v + 127976 wrt v. 6v2 + 52v + 123 What is the second derivative of -dmo*3 + 321dmo*2 - dm - 7do*3 - mo + 61m - 64o wrt o? -6dmo + 642dm - 42do Find the third derivative of -27879w*3 - 41813w2. -167274 Find the first derivative of k3n + 20k*3 + 34k*2n - 2k + 49n + 15 wrt n. k*3 + 34k*2 + 49 What is the second derivative of -147870c*5 + 146678c? -2957400c3 Find the second derivative of 3081548gr2 + 113gr + 2r + 472 wrt r. 6163096g Find the third derivative of -80175x*5 - 97755x*2. -4810500x*2 What is the third derivative of -11x*6 + 1146x*3 + 187768x*2 wrt x? -1320x*3 + 6876 Differentiate 110b*2d*2jp - b2d*2j + 423b2dj + 18bdj - 66djp + 2d wrt p. 110b2d*2j - 66dj Find the second derivative of 38q4 - 18q*3 + 28q*2 + 177241q. 456q2 - 108q + 56 What is the third derivative of -105a2b*3 - 2503a*2 - 9ab2 - a - 882b*5 - 4b*2 wrt b? -630a*2 - 52920b*2 Find the third derivative of 56048z*3 - 61302z*2 wrt z. 336288 Find the second derivative of -429168f*3 - 2f*2 + 814760f. -2575008f - 4 What is the first derivative of hk - 913h - 10040k*4 + 2 wrt k? h - 40160k*3 What is the derivative of -57470j + 30034? -57470 What is the first derivative of -2t3 - 1432t*2 + 6t - 106235 wrt t? -6t2 - 2864t + 6 What is the second derivative of -211036b2 - 262219b? -422072 Find the third derivative of -73f5 + 380f4 - f2 + f + 14974. -4380f2 + 9120f Differentiate -19949x + 75150 wrt x. -19949 What is the derivative of -224277fgx - 4fg - 537f + 10g wrt x? -224277fg What is the third derivative of 274363z5 - 16z*2 + 289z + 3? 16461780z2 Find the third derivative of -99442a*5l*3 + 4a*2l + 25620al*3 wrt a. -5966520a*2l*3 What is the second derivative of 45039l*4 + 137l + 173 wrt l? 540468l2 Find the third derivative of 140n*6 + 103n*4 - 3n*2 + 106n + 45. 16800n3 + 2472n What is the third derivative of 57649f3 - 1302052f*2 wrt f? 345894 Find the first derivative of 102222a*2 + 71115. 204444a What is the third derivative of 2120295d4 + 42d*2 - 5898d + 2 wrt d? 50887080d Find the third derivative of 1444489dv3 - 28788dv2 + 20v*2 wrt v. 8666934d What is the second derivative of 281t3y*2 - 11t*2 - 85t - 4y2 + 2y wrt t? 1686ty*2 - 22 What is the derivative of -3kz3 - 2kz + 854k + 410438z3 wrt k? -3z*3 - 2z + 854 What is the second derivative of -3y3 - 204992y*2 + 1889834y? -18y - 409984 Find the second derivative of -47804ix3 + ix - 1700i wrt x. -286824ix Find the third derivative of 54151m*3 + 2m2 - m - 272 wrt m. 324906 Find the third derivative of t6 + 2t5 - 117453t*3 - 23632t*2 + 3. 120t*3 + 120t*2 - 704718 What is the second derivative of -125i*3 - 404i*2 - 35i + 273? -750i - 808 What is the third derivative of 471416p*5 + 5p*4 - 2p*2 - 193p + 796? 28284960p2 + 120p What is the derivative of -196r2u + r*2 + 87ru + 5248u + 74 wrt r? -392ru + 2r + 87u Differentiate 78745h2w - 84393h2 with respect to w. 78745h*2 Differentiate -52sx3 + 363sx2 + x3 - 11x*2 + 510x with respect to s. -52x3 + 363x*2 What is the second derivative of -74854h*4 + 67h - 93 wrt h? -898248h2 What is the second derivative of 2395948i*3 + 89575i - 4 wrt i? 14375688i What is the third derivative of -16g*4o*2z - 65g4z + 2g2o*2 - 11g*2o + 733g2z + 2 wrt g? -384go*2z - 1560gz Find the third derivative of 2918z6 - 179z*5 - 745341z*2. 350160z*3 - 10740z*2 What is the third derivative of 7300o*4 + 19879o*2? 175200o What is the second derivative of 1464c3l*2z*2 + 462c*3l*2z - c*3 - 187c*2l*2 - 162l*2z*2 wrt z? 2928c*3l*2 - 324l*2 Find the third derivative of -3969750o*4 - 1305231o*2. -95274000o What is the second derivative of -1716455ck*2 - 2ck + 2c + 11k - 2 wrt k? -3432910c Find the first derivative of 19bc + 8024b + 1170c*2 wrt c. 19b + 2340c What is the first derivative of 7gns + 8gn + g + 35ns - 24n + 343s + 19 wrt n? 7gs + 8g + 35s - 24 Find the third derivative of -1190q6 + 21q*4 - 151810q*2. -142800q*3 + 504q Differentiate 16583g2 + 32759 with respect to g. 33166g What is the second derivative of 8f2k*2 + 523419f*2k + 7621fk*2 - 2k*2 wrt k? 16f*2 + 15242f - 4 Find the second derivative of -565651m3 - 7m*2 + 6780227m. -3393906m - 14 What is the second derivative of -8g*3j + 14325g3l*2 + 13020g*3l - 2g2jl2 - l wrt l? 28650g*3 - 4g*2j What is the third derivative of -4i4u + 7i3r*3 + 248i*3ru - 3879i*2r*3u - 2i2r*2 + 6iru wrt i? -96iu + 42r3 + 1488ru Find the third derivative of -277a*3m - 8a3 + 1389a*2m + a*2 + am - a wrt a. -1662m - 48 What is the second derivative of -39942b*2 - 104424b wrt b? -79884 What is the second derivative of -152v3 + 152v*2 - 23772v? -912v + 304 Find the second derivative of 3i*3 - 12516i*2 + 44688i. 18i - 25032 What is the derivative of 1204cdqs + 8cdq + 7cds + 9c - 4dqs + 214q wrt s? 1204cdq + 7cd - 4dq Differentiate 1132247x + 1410374 with respect to x. 1132247 Find the third derivative of qu4 + 3qu3v + 18qu*2v - qu2 - 2u*3v - 2025u3 + 44u*2v - 2v wrt u. 24qu + 18qv - 12v - 12150 Find the first derivative of -3pr*3 - 1264pr2 + 19p - 411r3 + r2 - 239r wrt p. -3r3 - 1264r*2 + 19 What is the derivative of 103480kz3 - 4z*3 + 7z*2 + 1186 wrt k? 103480z3 Find the first derivative of c4u + 795207cu - 2994320u wrt c. 4c3u + 795207u Differentiate 174432w - 164530 with respect to w. 174432 What is the third derivative of 120o3q*5 - 1346o*3q*4 + 2o*3q*2 + 66o3 - o2q2 + 2o*2q - 34oq*2 wrt q? 7200o*3q*2 - 32304o*3q What is the third derivative of 67082t4 - 14t*2 - 2t - 155? 1609968t Differentiate 1213120z - 1018934 wrt z. 1213120 What is the second derivative of 602870b2p5 + b2 - 2bp - 3b - 4p + 86 wrt p? 12057400b2p*3 What is the derivative of 71i*4 + 3i*2v - 2i2 + i - 217347v wrt i? 284i3 + 6iv - 4i + 1 Differentiate 31644np + 3n - 104883p with respect to n. 31644p + 3 What is the second derivative of 56r*4 + 1538r*2 + 915871r? 672r2 + 3076 Find the second derivative of -10jn2z - jn2 - 23jnz - 240n2z - 50nz wrt n. -20jz - 2j - 480z Find the second derivative of -22726c2 + 2c + 4057. -45452 What is the derivative of -40961f2 + 54162 wrt f? -81922f What is the second derivative of -207v5 + 3v*3 + 16v*2 - 48630v wrt v? -4140v3 + 18v + 32 What is the derivative of 284913f + 985153? 284913 Find the third derivative of 576872c*3 - 2638952c*2 wrt c. 3461232 Find the second derivative of 145g*3x*3 + 52g*2x*3 - 1386gx3 + g - 2x*2 wrt g. 870gx3 + 104x*3 Find the third derivative of -106349p*4 + 11p*2 + 6775p wrt p. -2552376p Find the third derivative of -48k*2o*3v + 31k2o*3 - 3k*2o*2 + 5ko3 + 20ko2v - 2708kov wrt o. -288k*2v + 186k2 + 30k What is the second derivative of 3l5 + 2508l*3 - 61l + 1	{ "pile_set_name": "DM Mathematics" }
f3 + c3f2 - 2124c*3f + 3c3 + 2f + 1 wrt f? -12064542c3 What is the first derivative of -536029q - 288622 wrt q? -536029 Find the third derivative of -113632m6 - 114088m*2 wrt m. -13635840m*3 Differentiate 5n3 + n2 - 1439n + 187645 with respect to n. 15n*2 + 2n - 1439 Find the third derivative of -45g3q*2v - 3g3q*2 - 5g*3qv + 266g*2v - 106gq*2v wrt g. -270q2v - 18q2 - 30qv What is the first derivative of 20bgu - 4bg - 2bu - 5b + 4gu + 2g - 13u + 24 wrt u? 20bg - 2b + 4g - 13 Find the first derivative of 252fu2v + 2fv - 62f - u2 + 2uv - 68 wrt v. 252fu2 + 2f + 2u What is the second derivative of 36t*4 + 392t*3 + 29097t wrt t? 432t2 + 2352t Find the third derivative of 2au*4 - au*3 - au*2 - 6au - 5282a + 1563u4 - 5u3 - u2 wrt u. 48au - 6a + 37512u - 30 Find the third derivative of 46038l3 - 5489l*2 - 2l - 4. 276228 What is the derivative of 361055w - 194781? 361055 Differentiate -2qs3 + 239q - 16124s3 + 17 wrt s. -6qs2 - 48372s*2 What is the first derivative of -3oz2 + oz - o + 2924z2 + 11z - 1367350 wrt z? -6oz + o + 5848z + 11 Find the first derivative of 14118j*2o3 - o3 + 174o - 7 wrt j. 28236jo3 What is the derivative of -2b*3ky - 52760b*3k + 14739b2ky wrt y? -2b*3k + 14739b2k What is the derivative of -2o4 - 2o*3 - 586o - 17312? -8o3 - 6o*2 - 586 What is the third derivative of -33265i*6 - 31i*5 - 9i*2 + 14471i wrt i? -3991800i3 - 1860i*2 Find the second derivative of -13k*2p*3 - 2k*2p*2 - 84k*2pz3 - kp*3z*3 - 60kp3z + 3kp*2z*3 - 3kpz*2 + 11p*3z*2 wrt k. -26p*3 - 4p*2 - 168pz3 Find the second derivative of -210203o*2r*2 + 4o*2rt + or*2t - 2r3t + 40204rt wrt r. -420406o2 + 2ot - 12rt What is the third derivative of 55125q*3 + 7q*2 - 566q wrt q? 330750 Find the second derivative of -6631fh*4s - 2fhr + fhs + 2frs + fs - 20h*3rs + 86hs wrt h. -79572fh2s - 120hrs What is the second derivative of -10c*2o*3s*2 - 333c*2 + co*3s*2 + 4co3s + 52co*2s*2 - co - s wrt c? -20o3s*2 - 666 What is the second derivative of 5a*3 + 11014a*2 + 264a - 1471 wrt a? 30a + 22028 What is the second derivative of 5w*3 + 89647w*2 - 3901w + 12? 30w + 179294 What is the third derivative of -1037bl3 + bl*2 - 40b + 15l5 - 18 wrt l? -6222b + 900l2 Find the first derivative of 124942su3 - 198655u*3 wrt s. 124942u*3 Find the first derivative of 1188ajy*3 + 2aj + a - 52jy3 - y3 + 4918y*2 - 2 wrt j. 1188ay3 + 2a - 52y3 Find the third derivative of -359960b*6 + 67b*2 + 510b. -43195200b3 What is the third derivative of 13541x*3 - 248x*2 + 20x + 1? 81246 What is the third derivative of -239bm*3y*3 - bm*2 + by*2 - 41m*3y*3 - 1226m*2y*3 wrt m? -1434by3 - 246y*3 Differentiate 35c*4 + 2c*3 + 662c*2 - 2c + 210446 wrt c. 140c3 + 6c*2 + 1324c - 2 Differentiate 21965gp*2q + 44gp*2 - gpq - 2pq + 357 wrt q. 21965gp2 - gp - 2p What is the second derivative of -506f*3 + 126f*2 + 555237f? -3036f + 252 What is the second derivative of 2d*2v2 + d2v + d2 + 42drv*2 + 65drv - 55rv*2 - rv - 5v2 wrt v? 4d*2 + 84dr - 110r - 10 Find the second derivative of 23548c5 + 4c*2 - 1162041c wrt c. 470960c3 + 8 What is the derivative of -2m*4 + 694240m + 593895? -8m3 + 694240 What is the first derivative of 2075x*3 - x + 103747? 6225x*2 - 1 Find the second derivative of 57dm4 + 44dm3 + 362235dm - 2m*2 wrt m. 684dm2 + 264dm - 4 What is the derivative of 3ilt + 80313il - 1138it + 2lt - 5t wrt t? 3il - 1138i + 2l - 5 Find the third derivative of -520425b*3s*4 + 36b*3 + 880s*2 wrt s. -12490200b*3s Find the third derivative of g*4 - 69298g*3 + 23968g*2 - 2 wrt g. 24g - 415788 What is the second derivative of -18a4 + 2a*3 - 5625a*2 + 9a + 11560? -216a2 + 12a - 11250 Find the third derivative of 567jo*5 - 26jo3 - 1002jo2 + 10j - 8o3 + 15o wrt o. 34020jo*2 - 156j - 48 Find the first derivative of -48079f + 10166 wrt f. -48079 Find the first derivative of 69i*4r + 3i2r*2 - 57i*2 + 93883r*2 wrt i. 276i*3r + 6ir*2 - 114i What is the second derivative of 10o4 + 10o*3z + 23o2 - 70056oz wrt o? 120o*2 + 60oz + 46 What is the second derivative of 734503p*5 - 1213182p wrt p? 14690060p3 Find the first derivative of 124090p*3 + 143932. 372270p*2 Find the third derivative of -2a*2k*2v*3 + 248a*2k*2v2 + a2k2v - 2a2k - 21485a2v*3 + 2akv*2 - 9a wrt v. -12a2k*2 - 128910a*2 Find the third derivative of -415086k*3y*2 + 14260k*2 - 2ky2 wrt k. -2490516y*2 What is the third derivative of -52190d*3v3 - d3v - 3d*3 + 1726d + v5 + v2 wrt v? -313140d3 + 60v*2 Differentiate -2j*3 + 3322j*2 - 31j + 214965. -6j2 + 6644j - 31 What is the second derivative of 809402v2 - 283v - 36? 1618804 What is the second derivative of -260759m2 + 185927m? -521518 Find the first derivative of 645781n - 968200 wrt n. 645781 What is the third derivative of -h3q - 1697788h3 - 7h*2q - 1079h2 - 120q wrt h? -6q - 10186728 What is the second derivative of -32k*4 - 15k*3 + 4k*2 - 125737k wrt k? -384k2 - 90k + 8 Differentiate 136j2 - 1712j - 13513. 272j - 1712 What is the third derivative of -470997q*6 - 6q*2 + 9588q wrt q? -56519640q3 What is the derivative of 149bkv*2 - 2bk + 3bv2 - bv + 3kv*2 + 29k - 6v2 - 61 wrt k? 149bv2 - 2b + 3v2 + 29 What is the third derivative of 73094x*3 - 80x*2 + 384 wrt x? 438564 Find the second derivative of -209c*4 + 2628c*3 + 1500954c wrt c. -2508c2 + 15768c Find the second derivative of -431478i2 - 160191i. -862956 What is the second derivative of c*3lw - 4c*3o*2w + 3c3w + c*2l - 229c2o*2w + 124clow + lo2w - l - 2 wrt o? -8c3w - 458c2w + 2lw What is the second derivative of -211927d2l + 1654186dl wrt d? -423854l What is the third derivative of 67445c*3m*2 - 2c*2m*2 + 45444m wrt c? 404670m2 What is the second derivative of -bh*2 - 2bh - 5078h*3 + 7h + 469 wrt h? -2b - 30468h Find the third derivative of 61j4w*2 + 199j*4 - 2j*2w + 11j2 - w2 - 6w wrt j. 1464jw*2 + 4776j What is the third derivative of -90996u4 - 3u*2 + 840? -2183904u Find the third derivative of 58o5 - 2568o*4 + 134o*2 - 34o + 4 wrt o. 3480o2 - 61632o What is the first derivative of -87c3l + 16c3 + 76l + 33 wrt c? -261c2l + 48c2 What is the derivative of -3jp2t*2 + 254808jp2 - p2t*2 - 61pt2 + 1275t*2 wrt j? -3p*2t*2 + 254808p*2 Find the first derivative of 411g*3x*2 + 110g*3x - 2g3 - 80g - 3 wrt x. 822g3x + 110g3 What is the third derivative of -1005h*3n*4 - 2h*3n*2 + 11h*3n - 6n5 + 175 wrt n? -24120h*3n - 360n2 Find the first derivative of -6n*3o*2 + 3n*3 + 12n*2 + 36no3 + 2n - 272o + 1590 wrt o. -12n*3o + 108no*2 - 272 Differentiate gi - 26693g + 5007i wrt i. g + 5007 Find the second derivative of -27d2h*3 - 3d*2z + 1245h3z - 428866h wrt h. -162d*2h + 7470hz What is the second derivative of 74c3 - 5024c*2 - 735522c wrt c? 444c - 10048 Find the third derivative of 49139t*3 + 5962t*2. 294834 What is the first derivative of -25368a*4 + 5ad + 32d + 1386 wrt a? -101472a3 + 5d Find the second derivative of 2929765z3 - 2z - 32731. 17578590z Find the second derivative of -2134671k*2 + 2k + 199175 wrt k. -4269342 What is the second derivative of -2x5 + 39972x*4 + 3432782x? -40x3 + 479664x*2 Differentiate -10417h*3 + 52h*2 + 2170461 with respect to h. -31251h*2 + 104h Differentiate 100004c3n - 1214c3 + 66c - 19n with respect to n. 100004c*3 - 19 What is the second derivative of 20379x*3 + 7855x? 1222	{ "pile_set_name": "DM Mathematics" }
3 and give t. 0 Express (2x - 4x - 2x)(-29x*2 + 26x*2 - 1168x*3 + 872x + 1166x3) in the form f + mx*4 + rx + px3 + bx*2 and give m. 8 Express -71466z + 35737z - 2 + 35729z + 711z2 as az*2 + oz + k and give a. 711 Rearrange -a*2 - 19 - 14a - 28 + 12 - 9a + 21a to the form ka2 + ma + o and give o. -35 Express 462h - 1136h - 1556h in the form nh + f and give n. -2230 Rearrange -118769o2 - 4o - 2 - o*3 + 6 + 118773o*2 to the form jo*2 + fo*3 + p + no and give j. 4 Rearrange 18660y + 201666654 - 201666654 to the form hy + j and give h. 18660 Express 584f - 249f + 140f + 353f in the form hf + o and give h. 828 Rearrange -9t*3 - 1173656t*4 + 2t + 488t2 + 11t*3 + 1173653t*4 to the form m + lt + qt4 + gt*2 + kt*3 and give g. 488 Express 227i - 71i - 64i - 79i - 12 as k + zi and give z. 13 Express 401g4 + 5653g*3 + 2g*2 - 409g*4 - 5651g*3 + 1 + 4g in the form ag + x + sg*2 + mg*4 + ig*3 and give s. 2 Rearrange (4z - z - z)(101 + 38z + 51z - 102 + 17z*2) to iz*2 + oz + y + rz3 and give r. 34 Express 10j + 36 - 2j + 13j as yj + m and give y. 21 Express (-g + g + g)(1554g + 944g + 2935g + 2972g - 867g) as ig + ng2 + x and give n. 7538 Express 221 + 35058v - 35060v - 3v*2 - 27 in the form lv*2 + p + bv and give l. -3 Express (d2 - d2 + 2d2)(107 - 101 + 10d - 26d)(-1 - 2 + 1)(9 + 22 + 13) as j + bd2 + id*3 + vd and give i. 2816 Rearrange -154n3 - 38n*3 + 41n*3 + 1 - 105n*3 - 2 to bn + in3 + xn*2 + o and give o. -1 Rearrange 3612z - 1611z + 5302z - 1568z to the form f + cz and give c. 5735 Rearrange 608n2 - 2969895n + 2969895n to the form a + fn + in2 and give i. 608 Rearrange -12 + 523z*2 - 10z + 9z - 507z*2 to nz*2 + jz + p and give j. -1 Express f*3 + 2f4 - f3 + (-114f + 117f - 3f + 12055f*2)(-5f2 + 4f*2 + 4f*2) in the form vf*4 + l + xf + wf3 + of*2 and give l. 0 Rearrange -8x*2 + 3x*2 + 4x*2 + 269 + 1525x - 2x3 - 766x - 758x to p + yx + fx2 + lx*3 and give y. 1 Rearrange -4108 + 4108 + 15189n to f + zn and give z. 15189 Express (-4 + 2 + 4)(-3t3 - 2t*3 + 6t*3) - 9 - 433419t*3 + 9 + 429474t*3 + 0 in the form rt*2 + at*3 + b + st and give a. -3943 Rearrange 4r2 - 122 - 25 + 148 - 3r to the form gr2 + f + sr and give s. -3 Rearrange 52z + 2 + 10z + z*2 + 9z + 71z - 18z to the form s + lz + cz*2 and give s. 2 Express 12 + 4956x - 5 - 6 + 1261x in the form g + rx and give g. 1 Express -56y3 + 42y*3 - y - 75y*4 + 152y*4 - 74y*4 + 0y*2 - 2y*2 in the form dy + ry4 + zy*2 + t + wy*3 and give w. -14 Express 980n + 33 + 41 + 42 - 116 in the form i + bn and give b. 980 Rearrange (11v + 6v - 4v)(18v + 13v + 4v) to the form gv2 + tv + i and give g. 455 Express 6141 + 212x2 - 429x*2 - 6152 in the form t + wx*2 + zx and give t. -11 Rearrange (-3u3 + 2u*3 + 0u*3)(55u - 234u + 124u - 31286 + 54u) to the form yu3 + pu*2 + vu*4 + m + du and give v. 1 Rearrange -2o4 + o - o2 + 301 + 0o4 + 161 + o4 + 56 to the form do2 + go*3 + n + fo + mo4 and give d. -1 Rearrange -1 + 3 + 183f + 2 + 3 - 15 to af + i and give a. 183 Rearrange -4478u*2 - 2497 + 2497 + 754u*2 to the form iu*2 + x + pu and give i. -3724 Express -7 + 14652z2 + 4z - 14649z2 + 5z in the form j + bz + cz*2 and give j. -7 Express -9o*2 - 14o2 - o + o3 + 18o2 as to + a + lo3 + go*2 and give l. 1 Express (3x*2 + 0x*2 - 4x*2)(x + 2x + 5x)(2 + 16 - 4) as nx + a + mx2 + bx*3 and give b. -112 Rearrange 2139 - 116l + 2099 + 30l2 + 5l - 4238 to hl + bl*2 + g and give b. 30 Rearrange (-4 + 7 - 1)(-2 + u + 2) + u + 2u - 2u + (11 - 7 + 2)(1885u - 740 + 740) to the form p + cu and give c. 11313 Express -667i + 613i4 - 2 - 611i*4 + 3i*2 + 161i - 105i in the form li + zi3 + s + gi*2 + ci*4 and give g. 3 Rearrange (0m*2 - 16m2 + m2)(-98 + 63 + 2m + 62) to the form am2 + qm*3 + g + om and give q. -30 Rearrange 10617d + 10596d + d*2 - 30d*3 - 21210d to nd + z + gd*3 + cd*2 and give n. 3 Express -12232 + 163f + 12236 + 98f as n + tf and give n. 4 Express 63 - 2w + w2 + 57 - 126 + 3w*4 + 0w - w*4 as hw*4 + ow*2 + gw + rw3 + b and give o. 1 Rearrange -15 - 11 - 2a*3 - 13a - a*2 - 7a*3 + 26 to the form ia*2 + b + ta + ga3 and give t. -13 Express 279194r*2 - 643r - 279191r2 + 6 - 3 in the form wr*2 + o + br and give b. -643 Express (0v + 0v - 2v - 3 + 3 - 2v + (0v - 2v + v)(-2 + 4 + 0) - 10v + 16v - 29v)(-3 + 1 - 1)(8 + 4 - 4) in the form kv + i and give k. 696 Rearrange -10n + 5 - 983n3 - 16n + 985n3 to the form fn*2 + yn + in3 + z and give i. 2 Express (-12 - 21 + 0)(z*3 - 16z + 17z - 2z*3) + (-2z + z + 0z)(-z*2 - 9z*2 + 4z*2) in the form l + xz*3 + tz + rz2 and give x. 39 Rearrange 2b*2 + 3b - 3b + 29b*2 - 2b*2 + 2b*2 + (0 + 0 + b)(3b - 2b + 2b) + 10b2 - b2 - 4b2 to the form zb + p + ub2 and give u. 39 Express (h - 3h + h)(22 + 21 - 31)(-7 + 5 + 11) as r + vh and give r. 0 Express (-5 + 78j + 41 - 3 + 585j)(3 - 1 - 1) as h + kj and give h. 33 Rearrange -1 + 2w*2 + 1 + (0 + 2w + 0)(51 - 51 + 41w) + (-5w2 + w2 + 3w*2)(-1 + 2 - 4) to ow2 + f + vw and give v. 0 Express (1 + 1 + 2)(139v + 456v + 61v) - v - v - v as wv + h and give h. 0 Rearrange 4179q*2 - 2215q*2 + 559q*2 + 4143q*2 to the form dq + x + aq2 and give a. 6666 Express (-3p*3 + 2p*3 + 3p*3)(-4789 + 391 + 16207 + 13961 + 11046) as o + ip3 + mp + rp2 and give m. 0 Rearrange 311r + 0r2 + r2 - 6053r3 + r2 + 3025r3 - 1 + 3024r*3 to h + gr*2 + br + pr3 and give b. 311 Rearrange -631z*2 + 1820z*2 - 628z*2 - 554z*2 + 125 to the form a + xz + yz2 and give y. 7 Rearrange -268k - k*2 + 3k*4 + 261k + 15k4 + k3 - 1 to vk*2 + xk + d + gk4 + pk*3 and give d. -1 Express 114463 - 23h*3 - 114461 + 2h*2 + 3h*2 as yh*3 + wh*2 + oh + c and give y. -23 Express 2b4 + 285b*3 + 144b*3 + 2 - 86958b + 86961b + (2 + 3b - 2)(5b - 5b - 2b*3) as cb*3 + jb*2 + z + ab*4 + ob and give a. -4 Express (-3m + 2m + 2m)(1748 + 1386 - 2518 + (-1 + 0 - 1)(-4 + 14 + 7)) in the form g + xm and give g. 0 Rearrange 22752 - 11378 - 11373 - 464n to g + an and give a. -464 Express (-2 - 2 - 6)(8u + 3u2 - 8u) - 306 - 102u2 + 306 in the form nu*2 + lu + q and give n. -132 Rearrange -84v + 42v*3 - 66v*3 + 2v*2 - 1 + 26v*3 to av*3 + zv*2 + i + lv and give i. -1 Rearrange 31y - 5771 - 19y - 12y + 2y - 4703 to the form dy + c and give c. -10474 Express -35i - 165i2 + 1 + 346i*2 - 178i*2 as ui*2 + m + ji and give m. 1 Rearrange 3v + 4v - 19v + (52 - 21 - 17)(-3v + 4v - 2v + (-3v - 2v + 2v)(5 - 3 - 3) - v - 2 + 2) to pv + u and give p. 2 Express 4a3 - 45 - 30a - a*2 + 29a + 5a3 - 6a*3 as ia + y + la3 + qa*2 and give y. -45 Rearrange 3 + 2 + 5r*3 - 3r*3 + 1151r*2 - 3 - 2771r*2 to the form or*3 + ur*2 + x + wr and give u. -1620 Express (6l + l - 5l)(18 + 0 - 48)(-3 + 5 + 13)(17l*2 + 38 - 38) in the form ul + tl3 + n + ol*2 and give t. -15300 Express (4u - 8u + u)(2u3 - u + u) + 115 - 115 + 3u4 - u4 + 0 + 0 in the form gu2 + ou*4 + i + du*3 + zu and give o. -4 Express 5381819z3 + 107 - z4 - 5381819z*3 - 9z*2 + z + 0z*4 as pz*2 + uz*3 + cz*4 + y + nz and give y. 107 Rearrange ((3 + 1 - 2)(-2 - b + 2) + 4b - 3b - 2b)(1657 - 3339 + 1645) to q + jb and give j. 111 Rearrange (6 + 5 - 3)(-1 - 4 - 2)(0n - n - 19n + 5n - 2n - 2n + (-2 + 3 + 0)(2 - 2 + 2n) - 6n + 0 + 0 - 2n - 2 + 2) to q + un and give u. 1400 Express 623f + 512f + 63f - 2f*2 - 235f in the form c + hf2 + wf and give h. -2 Express (-11921 - 11597 + 21242)(2q*4 + 9q*4 - 4q*4) as aq*2 + dq + c + jq3 + nq*4 and give n. -15932 Rearrange -5 + 8 + 2r*2 + 496r*3 - 502r**3 to the form	{ "pile_set_name": "DM Mathematics" }
64 Simplify (-2(-2 + sqrt(3)-3) + (sqrt(108)/sqrt(3))/sqrt(12) + -5)*2. -14sqrt(3) + 148 Simplify 2(sqrt(5) + (sqrt(5) - 6(-4sqrt(5))2)) - (-4(sqrt(5) + 0) - -5(sqrt(125))2). -1585 + 8sqrt(5) Simplify (-51(sqrt(133) - ((sqrt(133) - (sqrt(133) - 2sqrt(133))) + sqrt(133)) - sqrt(133)))/(2sqrt(77)/(sqrt(55)/sqrt(5))). 15sqrt(19)/2 Simplify ((5sqrt(396)/sqrt(144))/(3sqrt(484)-1))*2. 25/1584 Simplify -1-6((sqrt(572) - -3sqrt(572))-4)/sqrt(11). -192sqrt(13) Simplify ((5(-1sqrt(117)-2 - sqrt(117)))/(sqrt(54)/(sqrt(6) + (sqrt(96)-4 - sqrt(6)))))*2. 83200 Simplify (2(sqrt(88) + (sqrt(88) + sqrt(88)-1 + sqrt(88) - sqrt(88))) + sqrt(88) + sqrt(88))/(sqrt(16)/(4sqrt(2))). 16sqrt(11) Simplify 5(4 + -1 + sqrt(175) + -2 - (1(sqrt(175) + sqrt(175) + 1) + -2 + -1sqrt(175)))*2. 20 Simplify -4 + ((sqrt(1053) + 0 + sqrt(1053))4)*2 + sqrt(1053)15. 45sqrt(13) + 67388 Simplify -3(((sqrt(128))2 + -1)-6 + -4). 2298 Simplify (sqrt(360) + sqrt(360) + (sqrt(360) - (sqrt(360) - (sqrt(360) - (sqrt(360) - -2sqrt(360))))) + sqrt(360))/((sqrt(1000) + sqrt(10))/sqrt(5)). 6sqrt(5)/11 Simplify ((-1sqrt(342) + sqrt(342))-4)/(2(sqrt(2) - (sqrt(2) - (sqrt(18)/(sqrt(9) - ((sqrt(9) - sqrt(225)) + sqrt(9) + sqrt(9)) - sqrt(9)) - sqrt(2))))). 0 Simplify (-6(2 + sqrt(112)) + 0 + 3)*2. 432sqrt(7) + 4113 Simplify -3 + -5(sqrt(99) - (sqrt(99) - (-2 + sqrt(99) + 2))2)1-6. -3 + 90sqrt(11) Simplify (sqrt(32) + 1)4 + (3 + (1 + sqrt(2))2 - sqrt(2)) + sqrt(8)/sqrt(4)4. 10 + 21sqrt(2) Simplify (sqrt(20) - (sqrt(20) + -2sqrt(20)))/sqrt(4) + (sqrt(5) + (sqrt(5) - sqrt(45)))-2 + sqrt(10)/(2sqrt(18)). 25sqrt(5)/6 Simplify (1 + -2sqrt(288) + 0)*2 - (((sqrt(288) - -1sqrt(288)) + sqrt(288))6 + sqrt(288) - (sqrt(288) + (sqrt(288) - (1 + sqrt(288) + -1))))2. -92159 - 48sqrt(2) Simplify (-1 + 3 + (sqrt(128) + -2)-6)-2 + 1. -27 + 96sqrt(2) Simplify (sqrt(224)/(sqrt(32)/(sqrt(4) + sqrt(4)3 + sqrt(4))))/(-3sqrt(16)-3). 5sqrt(7)/18 Simplify 6(sqrt(45)/((sqrt(18) - (-2sqrt(18) + sqrt(18)))/sqrt(2)) - (-3(sqrt(15)/sqrt(3))*2 + 5)). 3sqrt(5) + 60 Simplify -6(sqrt(200)/sqrt(10) - sqrt(5)52). 48sqrt(5) Simplify -2((4 + (sqrt(1539) - (sqrt(1539) + -1)) - (-4 + (sqrt(1539)1 - sqrt(1539)))) + -3)*24. -288 Simplify sqrt(245) + (sqrt(245)6 - sqrt(245))2 + sqrt(245) + -1 + sqrt(245) + -2sqrt(245)-4. 77sqrt(5) + 6124 Simplify (-1sqrt(152)-1 + -1sqrt(152)-2)/(sqrt(32)/(sqrt(36)2)). 18sqrt(19) Simplify (3 + ((2 + sqrt(325) + sqrt(325))-1 - -3(sqrt(325) + 0)))*2. 10sqrt(13) + 326 Simplify (-6-2sqrt(567) + sqrt(567) + -1 + -5)*24. -5616sqrt(7) + 383436 Simplify -3-5(sqrt(76) - sqrt(19)) - sqrt(171)/(sqrt(99)/sqrt(99)). 12sqrt(19) Simplify 1 + (-3 + ((sqrt(2592) - sqrt(2592)-1) + sqrt(2592) + sqrt(2592))1)*2. -864sqrt(2) + 41482 Simplify 1 + (-1 + sqrt(275))*2 - (3sqrt(275)-5)2. -61598 - 10sqrt(11) Simplify (-1 + -2 + sqrt(3) + 0 + -1 + sqrt(3))-14 + -3. -8sqrt(3) + 13 Simplify ((-2(-1 + sqrt(1216)) + sqrt(1216))-4 - (5 + -4(sqrt(1216) + 3)))*2. -128sqrt(19) + 77825 Simplify (sqrt(450)/(2sqrt(10)) - (-5sqrt(45)-2 + sqrt(45) - sqrt(45)))/(6(-2sqrt(9) + sqrt(9) - sqrt(9)) + sqrt(90)/sqrt(90)). 57sqrt(5)/70 Simplify 4((-2 + sqrt(112)2 - (-2sqrt(112) + -4))2 + 3)4. 1024sqrt(7) + 28784 Simplify (4 + sqrt(27) + 4 + sqrt(3))2 - (-5 + sqrt(300) + 2 + sqrt(300) + sqrt(300)). 34sqrt(3) + 115 Simplify (1 + -2(sqrt(2) - (sqrt(4)/sqrt(2) + 1)) + 2)-3. -15 Simplify (1(-3 + sqrt(117) + 0 + sqrt(117) - (sqrt(117) + -4 + 0)))2. 6sqrt(13) + 118 Simplify 2(-1 + sqrt(76) + -4 - sqrt(76))6 + -2. -62 Simplify sqrt(20)/(sqrt(100)/sqrt(10))4 - ((sqrt(2) + sqrt(50) + -2)2 + -1(-2sqrt(2) - sqrt(2))). -76 + 25sqrt(2) Simplify (((31sqrt(264))/sqrt(11))/((sqrt(768) + 2sqrt(768))-1 - sqrt(768)))*2. 9/512 Simplify -5 + sqrt(432)2 + sqrt(432) + (3sqrt(192)1 - sqrt(192))*2. 36sqrt(3) + 763 Simplify 2(-5sqrt(225)-6)/(sqrt(605) - -1(2sqrt(605) - sqrt(605))). 90sqrt(5)/11 Simplify ((41sqrt(171)1)/(sqrt(63)/((sqrt(7) + sqrt(42)/sqrt(6))5 - sqrt(7))))*2. 24624 Simplify (4sqrt(44) - (2 + sqrt(176))*2)-4. 32sqrt(11) + 720 Simplify ((sqrt(88)1 - sqrt(88))-4)/sqrt(8) - ((sqrt(704) + -1)2 + 5(sqrt(22)/sqrt(2))*2). -760 + 16sqrt(11) Simplify (sqrt(847)1 + 4 - (4 + 1sqrt(847)) - (-42sqrt(847) + sqrt(847) + -1 + (-2sqrt(847) - sqrt(847))))2. 220sqrt(7) + 84701 Simplify (-3 + (sqrt(833) + 0 - sqrt(833)) + sqrt(833) - (sqrt(833) - (sqrt(833) + 2sqrt(833)))-6)*2 - (sqrt(833) + -2(-2 + sqrt(833)))-2. 448sqrt(17) + 100810 Simplify 2(1 + -3 + (sqrt(68))2 - 1(sqrt(136) - sqrt(136)1)/sqrt(8)). 132 Simplify (-1 + (2(-3 + sqrt(17)) - sqrt(17)))*2 + 4 + sqrt(272) + sqrt(17) + 1 + sqrt(17) + 0. -8sqrt(17) + 71 Simplify 1 + (4 + (sqrt(55)/(sqrt(11)-1) - sqrt(125)-4))*2. 152sqrt(5) + 1822 Simplify 0 + (sqrt(297)/(sqrt(1089)2 - sqrt(1089)))/((sqrt(220) + sqrt(55))/sqrt(5) - sqrt(66)/(sqrt(54) - sqrt(6))). 2sqrt(3)/55 Simplify (((5 + -1 + sqrt(99) - ((-5 + sqrt(99)2 - sqrt(99)) + sqrt(99))) + 2)6)*2. -2376sqrt(11) + 7920 Simplify -5 + (-2 + sqrt(931) + sqrt(931) + 0 + sqrt(57)/(-2sqrt(192)))2. -223sqrt(19)/4 + 944595/256 Simplify (-1sqrt(315)/sqrt(5))/(sqrt(9) - (sqrt(288)/sqrt(2) + sqrt(9))) + -3 + -1. -4 + sqrt(7)/4 Simplify (66(sqrt(175) + -4(1 + sqrt(175)) + sqrt(175))-5)2. 2592000sqrt(7) + 23198400 Simplify ((sqrt(800)-2)/(sqrt(1200)/sqrt(12))1)*2. 32 Simplify (sqrt(4719) + (sqrt(4719) + sqrt(4719) + 4sqrt(4719) - sqrt(4719)) - sqrt(39))/sqrt(300). 13sqrt(13)/2 Simplify -1((sqrt(147) - (sqrt(147) + sqrt(147) + 3 + sqrt(147)))-5 + -4). -70sqrt(3) - 11 Simplify ((sqrt(240)/sqrt(8))/sqrt(5))/(-6(sqrt(3) + (2sqrt(3) - sqrt(3)))). -sqrt(2)/12 Simplify -3((2 + 1sqrt(19) + 0 + sqrt(1216))*2 + 2)-4. 432sqrt(19) + 18540 Simplify (-2sqrt(325)-4 + 0 - (2 + -4(sqrt(325) + sqrt(325) + 0 + sqrt(325))))*21. -400sqrt(13) + 130004 Simplify (6((sqrt(270)5)/sqrt(9))/(sqrt(30)/(sqrt(20)/sqrt(4))))2. 4500 Simplify (6(0 + sqrt(99) + 1 + -4))*2. -648sqrt(11) + 3888 Simplify 5((-3 + (sqrt(252) + sqrt(63))/sqrt(9) + -2)2 + 3). -150sqrt(7) + 455 Simplify 5 + -6((sqrt(192) - -2sqrt(192)4)2 + sqrt(192)). -93307 - 48sqrt(3) Simplify (-5sqrt(49)/sqrt(7))2 + -4 - (2 + sqrt(567) + 4)2. -432 - 108sqrt(7) Simplify -3sqrt(51)/(sqrt(147)-1)3. 9sqrt(17)/7 Simplify ((sqrt(80)-1)/sqrt(8))/(sqrt(20) + sqrt(80)/sqrt(4)) + -4(sqrt(2) - sqrt(8)/(sqrt(12)/sqrt(3)))-1. -sqrt(2)/4 Simplify (((sqrt(637) + -3 - sqrt(637))-5)*2 - sqrt(637)) + 5(sqrt(468) + -2). 23sqrt(13) + 215 Simplify 2 + -4 + (4(sqrt(4) + sqrt(24)/sqrt(6)))/(sqrt(18)/sqrt(324)). -2 + 48sqrt(2) Simplify sqrt(117)-2 + -1 + sqrt(39)/sqrt(3) - (sqrt(13) + (sqrt(65) + -1sqrt(65))/sqrt(5) + (sqrt(13) + 1)2 + -5). -8sqrt(13) - 10 Simplify (-1 + (2sqrt(20)5 - -2sqrt(20)3) + 3)*2. 128sqrt(5) + 5124 Simplify -1 + (4 + (sqrt(1900) + (-2sqrt(1900))2 + -3 - sqrt(1900)))-54. -152021 Simplify ((sqrt(21)/(4sqrt(7))2)2 + ((sqrt(6)/sqrt(2)6)*2 - (3 + sqrt(3) + -1)))1. -sqrt(3) + 427/4 Simplify (-1 + (sqrt(468) - 5(sqrt(468) + sqrt(468) + -1)) + (sqrt(468) - 4sqrt(468)1) + sqrt(468) + 2 + -1 + sqrt(468) + sqrt(468))2. -540sqrt(13) + 37933 Simplify -5((sqrt(8064)1 - sqrt(8064)) + sqrt(8064))/(sqrt(64)/sqrt(32)). -120sqrt(7) Simplify (4-5sqrt(60) + sqrt(60))/(sqrt(12) + ((sqrt(96) - (sqrt(96) + 5sqrt(96))) + sqrt(96) - sqrt(96) - sqrt(96))/sqrt(8) + sqrt(12)). 19sqrt(5)/4 Simplify sqrt(34)/sqrt(50) + (sqrt(17)-2 + sqrt(17) + 3)*2 + sqrt(204)/(sqrt(12)-1) + (sqrt(1088)-1 - sqrt(17))2. -34sqrt(17)/5 + 1403 Simplify 1((sqrt(143) + -5(sqrt(143) + 2sqrt(143)) + sqrt(143) + sqrt(143))/(-2sqrt(44)) + -3). -3 + 3sqrt(13) Simplify -64sqrt(252)/sqrt(4)2. -144sqrt(7) Simplify ((sqrt(51)/sqrt(3) + 4 + (sqrt(17) + 4)4)-1)2. 200sqrt(17) + 825 Simplify -5 + 0 + (sqrt(1323)/sqrt(9) - (sqrt(21) + sqrt(168)/sqrt(8))/sqrt(7)) + -2. -7 + 5sqrt(3) Simplify sqrt(931)-3 + -2 + (2 + sqrt(19))-1 + 1. -22sqrt(19) - 3 Simplify ((5-2sqrt(114)1)/((1sqrt(66)-6 + sqrt(66) - sqrt(66))/sqrt(11)))*2. 475/9 Simplify (-4 + -2 + sqrt(55)/(sqrt(20)/	{ "pile_set_name": "DM Mathematics" }
1/2))/hh)(10/7) assuming h is positive. h(-31/63) Simplify ((h(-1/5))(-4/15)/((hh*(-13/3))/(hhh(-9))))(-37) assuming h is positive. h(10027/75) Simplify h(3/7)/(hhh7)(h(-1/2)/h)(-45)((h/(h/h(-2/5)))/h(-7))/(h2/((h(3/8)h)/h)) assuming h is positive. h(17893/280) Simplify ((i(-1/3))(-48))(-29)((i/i(9/4))/i0)15 assuming i is positive. i(-1931/4) Simplify ((k/k(-1)k)(-35))(-2)/(k(kk*(1/4))/kkkkk(1/5)/k)(4/31) assuming k is positive. k(32481/155) Simplify ((t/(t/(t(2/7)t)))/(t/((t*(2/25)/t)/t)tt))(-36)/((t/t5tt)/(t/t(2/17))(t*(-1/4)t)(-45)) assuming t is positive. t(1992853/11900) Simplify (q0/q)16/(q(-2/3))(-4/17)(q(-6)/(qq/q(3/7)))/((q(-1/4)/q)/(qqq/(((qq(-3/4)/q)/q)/q)q)) assuming q is positive. q(-5615/357) Simplify (o5/(ooo/o4))(2/27)o(-3)o*(-3/4)(o/(o*1o)o)39 assuming o is positive. o(-119/36) Simplify (p(-2)/((p/(p/p(2/7)p))/p))*(4/25)/((pp(-1/2)/p)(-1/27)/(p(1/3))(2/29)) assuming p is positive. p(-11303/274050) Simplify (((m(-2/5)m)/mm)*(-1/2)(mm5)/m(-1/4))/((m/((m/(m(-5)mm)m)/m)mm(-2/11))/(m1)(-43)) assuming m is positive. m(-7671/220) Simplify ((w*(-2/5)(w*(5/6)w)/w)(27/2))(-42) assuming w is positive. w*(-2457/10) Simplify ((ww/(w/w4))/(w/(w(-1)/w))ww*(-2/5)www/w*(-1/5))/((ww/w*4w*(-2)w)/(w5/(w(-2)ww))) assuming w is positive. w(69/5) Simplify (((w/w(-1/6))/(ww(-13)/w))/(ww(2/9))24)(3/8) assuming w is positive. w(-91/16) Simplify ((nn(1/3)/n)(-8/11)/(n20n(-10)))(-5/8) assuming n is positive. n(845/132) Simplify ((j(2/5)/j*(-4))/(jj*(-2/17)j(j5/j)/j))/((j(-1)/j)/(j/(j(1/8)j))(j/j(2/7))30) assuming j is positive. j(-95371/4760) Simplify (((t/(ttt2))/t)(4/11))(-15/4)(t(2/3))(23/2)/((tt5)/(tt/t(5/6))) assuming t is positive. t(547/66) Simplify (((y*(2/5)y)*9(y/((y*6/y)/y))/(y/(((yy/(y/(yy/y(-3/4))))/y)/y)))(-41))16 assuming y is positive. y(-33948/5) Simplify ((((w/w(-7))/(w/(w/w(1/14))))38)(-43))(-39) assuming w is positive. w(3536793/7) Simplify ((f(2/17)/f)0/(f(ff(-6)ff)/fff)(1/5))48 assuming f is positive. f(48/5) Simplify ((l0)29ll/((ll*(-2/3))/l)lll(1/5))/((l(-2/3))(-9))(-6/7) assuming l is positive. l*(1051/105) Simplify ((ww*(2/5))/ww(-1/3))/((w/((w/w6)/w))/(((ww1)/ww)/w))(w(2/9)/ww/(w(w/w0)/www))(-3/5) assuming w is positive. w(-64/15) Simplify (www(-2/25)wwww/((ww*(-1/8))/w)w/(ww/((w/(w/(w/(ww*(-2/13)w))))/ww))w/(w/(w(-4)/w)))(-12/7) assuming w is positive. w(6249/4550) Simplify (o(-2/27)o/(o(-2/3)ooo))*(-47)(o/((o/((o*(-4/9)o)/o))/oo)o2)/(o(3/5)/oo(-5)/o) assuming o is positive. o(10004/135) Simplify ((s(1/37)s24)3)1 assuming s is positive. s(2667/37) Simplify ((w*(2/5)w)(-1/6))25/((w3)(2/77))49 assuming w is positive. w(-637/66) Simplify ((r*(-1/2)r/(rr(3/8)))/((r/r(-1))/r(1/2)))/((rr(2/7)/r)/r(-5/3)rr*(-1)r(5/4)) assuming r is positive. r(-937/168) Simplify ((((t/(t/(t/(t1/t))))/t)/t)8/(t0/t(-1/6)))/(t*(2/15)t(t(2/9)tt)/t(t/(tt(-1)))34) assuming t is positive. t(-4007/90) Simplify (n(-7/3))(2/11)(nn(-39))/(n29n) assuming n is positive. n(-2258/33) Simplify ((l(-9))*(-46)/((ll*(3/4)l)/(ll(-36/11)l)))(-22) assuming l is positive. l(-18039/2) Simplify ((u/(uuu*(1/3)uu)u(-7))/(u7uuu(-4/7)u))2 assuming u is positive. u(-830/21) Simplify ((((p*5p)/p)/p)/(p/((pp/(((pp/(p/p*8p)p)/p)/pp))/p)))*(3/26)/((p/(p/(pp/p*(-1/5)p)))/p*1p(-2/9)/p(-2/5)) assuming p is positive. p*(-1661/585) Simplify ((l/(ll1))49)*(-1/13)(l(1/6)/l(2/11))/(l*(2/37)ll(-4/5)) assuming l is positive. l(555559/158730) Simplify (u2)50/((u/(u/(u/((u/(u(3/5)/u)u)/uu))))/(uuu(1/2)u))((u1)29)(2/39) assuming u is positive. u(41491/390) Simplify v/(vv*(-2/3))vv5vv(v/(v/(vvv/v*(-1))v)v)(1/11)(((v(v/(v0/v))/vv)/v)(-28))24 assuming v is positive. v(-44054/33) Simplify ((n(-38/5)n(-25)/nn)(2/123))(-7) assuming n is positive. n*(2282/615) Simplify ((d/(ddd(1/2))d)33)(-40)/((d*5/(ddd1/dd))/(dd(-5)dd/d4)) assuming d is positive. d652 Simplify (a(-1/3)a)*(2/13)(a(-6)/a)/a(-1)((a(-2/9)/a)/a((aa7)/a)/aa)/(a/a*(6/5)a((aa(-2/11))/a)/a) assuming a is positive. a(-4748/6435) Simplify (x/x*(1/13)x(-13))(-2/101)(x(x/((xx(-4/9))/x))/xxx(3/4))/((x/(x/(xxxx/(x/x(3/2)))))/(x/x2)) assuming x is positive. x(-97675/47268) Simplify ((u(2/9)u)/(uu*(3/8)u)u(-4)/u(1/9))(-37) assuming u is positive. u(14023/72) Simplify ((v/(v/v(-2/9)))(3/2)/(v(-8)/(v/(v(v/(v/(v*0/vv)))/vv))))/(((vv/(vvv*9v))/(vvvv6))/(v(-1/7)v/v(-8))) assuming v is positive. v(746/21) Simplify (((ww/(w/w(1/4)))28/(((w2w)/w)/(ww(4/5)www)))(-1/14))(11/2) assuming w is positive. w(-297/20) Simplify (u2)*(-1/5)(u*(1/3)/uuu)1(u(1/16)/(u(-6)uuu))/(uu*(-5)u7) assuming u is positive. u(239/240) Simplify ((s/(s/(s*2s)))/(s/(s/(sss(1/6)/s))))(-29)((s(1/2))(2/35))(8/5) assuming s is positive. s(-55777/1050) Simplify ((y/y(-2/7))/y)(4/19)/((y(6/11)/y)/((y8/y)/y))(y(y(-2/3)y)/yy)(-9)/(((y2/y)/y)/(yy/(y*(-6)y))) assuming y is positive. y(2216/1463) Simplify (j(-1)jj)/j*(-3)j*(-1/10)jj(5/6)((j(-1)/j)23)4 assuming j is positive. j(-2674/15) Simplify ((((n/n*14)/n)/(nn*(4/7)n))/(n(-1/4)/n)41)(-50) assuming n is positive. n(-24275/14) Simplify (((k(-1/2))(-11)(k(-1))(-6/7))(-34))35 assuming k is positive. k(-7565) Simplify (((c(c/c*(-4))/c)/c((c*(-2/13)/c)/cc)/c)/(cc/(c/(c(-2)/c)))23)/((cccc*(1/3)ccc)5)(-47) assuming c is positive. c*(59911/39) Simplify (ooo(-3)ooo2)/((o/o9)/(oo(3/8)))((o/o(1/4))/o)(-32)/(o(-2/5)/(o8/ooo)) assuming o is positive. o(1191/40) Simplify (h(4/5)h/h(1/11))/(h(-4)/h(-3))(h*(-2/3)h*(-2/11)h)/(h/h0)(-2/121) assuming h is positive. h(5222/1815) Simplify (((q/((q(-1/3)q)/q))/q)(-2/11))(-2/65)/(((qq(qq(-2/5))/q)/q)(2/49)/(q(-1))(-1/32)) assuming q is positive. q(29009/3363360) Simplify ((a/a(-2/13))/(aa(-7)))(4/27)(a(-2/7))8/((aa/(a4/a))/(((a/(a(a/((a/(((a*3a)/a)/a))/a))/aa)aaa)/a)/a)) assuming a is positive. a(-1823/819) Simplify a(-5/8)a46(a22)(-2/107) assuming a is positive. a(38489/856) Simplify (s(1/9)s/(s/((ss/s*(-5))/s))(s/(ss1))(-36/7))/((s(-2)s/(ss(s/(ss6)ss)/sss))/(s(4/9)/(ss(-2/7)))) assuming s is positive. s(692/63) Simplify (y*(2/7)y)(-17/3)/(y(2/5))*2y*(1/3)yy(-2)((y(-5/2)/y)/y)/(y/y3) assuming y is positive. y(-2363/210) Simplify (a(1/20)aa/(a/(a/a*(-10)))(aa(-2)a)(-35/2))31 assuming a is positive. a(7471/20) Simplify (s(7/5)/(s(-2/5)/s))(-2/29)(s(2/7))(41/4)/((s/s(-1/2))/s)(-29) assuming s is positive. s(17494/1015) Simplify jj/j*(5/3)j/j*(-5/3)(j*(-2/3)j)*(-3/10)(j1)(-32)j(1/4)j/j(-1/4) assuming j is positive. j(-138/5) Simplify ((kkk*(-5)k)/(kk(-4/3)))/(k/((kk/k*(-6))/k)(k/(k/k*(2/5))k)/kk)((kk/(k/(k1/k))k)35)(-43) assuming k is positive. k(-45106/15) Simplify ((c0)(-1/8))(-27)/(c*6cc(1/3)cc(2/9)/(c/((ccc(-2/5))/c))) assuming c is positive. c(-367/45) Simplify (((kk*10)/(k/(kk*(-27)k)))/((k/(kkk(-19/2)))/k(4/7)))(-39) assuming k is positive. k(12519/14) Simplify ((n(-1/3)/n)(-25)/((nn(5/6)/n)/n(-9)))(2/39) assuming n is positive. n(47/39) Simplify (l(-1)l*(-1)(l*(-1/2)/l)/(ll(-5)))/((l/l(-1/2))/(l/(l/(ll(-2/3)ll)l)l))(-1/22) assuming l is positive. l(61/132) Simplify (s(-7)/(s(s/(s*(-4)sss))/s))/(s*(-2/9)/(sss(-3)s))(s/s(1/8))/s(-8)s/(s*4/s)s(-4/9) assuming s is positive. s(-169/72) Simplify ((i/i**3	{ "pile_set_name": "DM Mathematics" }
2 + 840k2 What is the second derivative of d2m4 + 95892d*2m*3 + 42898d*2m - 2d2 wrt m? 12d*2m*2 + 575352d*2m Find the third derivative of 28480o3 - 4o*2 - 1978o wrt o. 170880 Find the second derivative of -h*3 + 50316h*2 + 15h + 17214 wrt h. -6h + 100632 What is the third derivative of -4242i*3j*3 - 11i*3z + i*2jz + 1846j*3 wrt i? -25452j*3 - 66z Find the second derivative of -14q4 - 9q*3 - 9q*2 - 64409q wrt q. -168q2 - 54q - 18 Find the second derivative of 50192n3 + 85752n. 301152n Differentiate -3791230g + 540942 wrt g. -3791230 Find the third derivative of 2afk3 + 16afk + 137af - 4ak*3 + 4a + 7171fk*3 + 8k*3 - 4k*2 + 3k wrt k. 12af - 24a + 43026f + 48 What is the first derivative of -2y3 + 107y*2 + 264y + 65619? -6y2 + 214y + 264 Find the third derivative of 26568o4 + 2o*3 - 5o*2 + 36501 wrt o. 637632o + 12 Find the first derivative of 223021u - 243331 wrt u. 223021 Differentiate 407337m*2o*4 + 6m*2o*2 - 2m*2 - 3321034m wrt o. 1629348m2o*3 + 12m*2o What is the second derivative of 4o4 + 5003o*2 + 1410055o wrt o? 48o2 + 10006 Find the second derivative of 8df2gv - 24df2g - dfgv2 + 36dfgv - 14f*2gv2 + 50gv2 - g wrt f. 16dgv - 48dg - 28gv*2 What is the derivative of -3kw3 - 204kw2 - 394k - 3w3 - 2w*2 - 588w - 92 wrt k? -3w3 - 204w*2 - 394 Find the first derivative of fmo - 152239fp2 - 148mop*2 + 65mp + 2op2 + 2p wrt f. mo - 152239p2 Find the second derivative of -k3x2 - 2949k*3x + 4k2x*3 - 1977kx3 - 8kx2 - 2x*3 wrt k. -6kx2 - 17694kx + 8x*3 What is the second derivative of 269h*2v*2 + 1573h*2 - hv*2 + 10h - 203v2 - 8v wrt h? 538v2 + 3146 Find the third derivative of j2w*3 - 299j*2w*2 - 9j*2w + 19593w6 - 12w wrt w. 6j2 + 2351160w*3 What is the first derivative of -904241n - 891460? -904241 Find the first derivative of 4347k4 - 11kq + 48076q - 1 wrt k. 17388k3 - 11q Find the third derivative of 2316641b3 + 2426534b*2. 13899846 What is the first derivative of 68741bv2 + 171v*2 - v + 84 wrt b? 68741v*2 Differentiate 2hv2 - 81587hv - 436097h - 2v3 - 2v with respect to v. 4hv - 81587h - 6v2 - 2 Find the second derivative of -k2l2x + 26832k2lx - 45klx - 2kx + 2l2x + 499lx wrt k. -2l2x + 53664lx Find the second derivative of 404b2q - 16b2 - 10552bq + b - 1 wrt b. 808q - 32 Differentiate -5051247f3 - 664815 with respect to f. -15153741f*2 Find the second derivative of -137168j*3 + 104189j wrt j. -823008j Differentiate 4213v*2 - 3v + 11536. 8426v - 3 Find the second derivative of -101f*5 - 4f*3 - 2f*2 + 14234f + 2. -2020f3 - 24f - 4 Find the second derivative of -80763lr*2 - 296514lr + 2l wrt r. -161526l What is the third derivative of -3225y*5 + 6y*4 - 4y*3 - 296873y*2 wrt y? -193500y*2 + 144y - 24 Differentiate -217297c2i*2 + 53667i*2 - 2 wrt c. -434594ci2 Find the third derivative of 235477j*3 - 163713j*2. 1412862 What is the third derivative of 102507y*4 - 16y*2 + 101y - 11? 2460168y Find the second derivative of -225680r*2 - 249004r. -451360 What is the third derivative of -2079b6r - 760b4r*3 + 67b*2r*3 + 28b*2r*2 + b + 2r*2 - 154r wrt b? -249480b3r - 18240br*3 What is the first derivative of -2l*2m + 748877l2 - 3lm + 165m wrt m? -2l2 - 3l + 165 Find the third derivative of 214488w3 + 123588w*2 wrt w. 1286928 Differentiate 104479tx2 - 3txy - 239x2 + 852xy wrt t. 104479x*2 - 3xy What is the first derivative of 2f*2u + 1128f2 + 11f - 17053u - 1 wrt f? 4fu + 2256f + 11 Find the second derivative of -5003d2k*3 + 32193d*2k + 3dk*3 wrt k. -30018d*2k + 18dk Find the first derivative of 118co*3 - 1436659c - 4280o3 wrt o. 354co2 - 12840o*2 Differentiate 35fn2 + 149fnx + fn + 3f - 2n2x + nx + n + 105x - 342 with respect to x. 149fn - 2n2 + n + 105 What is the third derivative of 171662c*4 + 4c*2 + c + 1656 wrt c? 4119888c What is the first derivative of 94543x3 + 69424? 283629x*2 What is the derivative of 14o*4 - 2315o*2r*2 + 146015r*2 wrt o? 56o*3 - 4630or2 What is the third derivative of -3266705c*2f*3 - 2c*2f + 19cf*2 + 27349f*2 wrt f? -19600230c*2 What is the derivative of nx - 889713n - 198940x*2 wrt x? n - 397880x Differentiate -5746f2v - 40693f2 + 4fv wrt v. -5746f*2 + 4f What is the third derivative of f*2k*3 + 53146f*2k + 58fk*3 + 2fk2 - 567k*3 wrt k? 6f*2 + 348f - 3402 What is the third derivative of -m*3q3 + m3q2 + 13125m*3q + 2m2q*3 + 1519m*2q2 - m2 + 5q2 wrt m? -6q*3 + 6q*2 + 78750q What is the third derivative of 15034x6 + 8x*4 - 58298x*2? 1804080x*3 + 192x What is the second derivative of 2342a3t*2 - 16a3 + a2t2 - 22at2 - 215at wrt a? 14052at2 - 96a + 2t2 What is the third derivative of -5290n*3q*3 - 8430n*3q + 2n2q*2 - nq*2 - n - 175q*3 - 4q wrt q? -31740n3 - 1050 What is the second derivative of -27621c*2fp + 24cfp - 9c + fp - p wrt c? -55242fp What is the third derivative of 74815d3 - 3048d*2 + 6 wrt d? 448890 What is the third derivative of 26a*4d*2 + 840a*3 + 576a*2d*2 - 59ad2 wrt a? 624ad2 + 5040 Find the second derivative of -23545i5 - i4 - 4i2 - 1129500i. -470900i3 - 12i*2 - 8 Differentiate -1675190k*3t + 51k3 + 5143k wrt t. -1675190k3 What is the first derivative of 63181r*2 + 55199? 126362r Find the first derivative of 5os - 67966o - 3829s*2 wrt s. 5o - 7658s What is the first derivative of -928964i - 917949? -928964 Find the second derivative of 140g3x - 15g2x + 5g2 + 20471gx - 2x wrt g. 840gx - 30x + 10 What is the third derivative of 4460g*2y*3 + 80g*2y*2 - 47g*2y + 3gy*3 + 4gy2 + 37y*3 + 4 wrt y? 26760g*2 + 18g + 222 Find the second derivative of -1363293u2w*3 + 4050681u*2w wrt w. -8179758u2w What is the derivative of 7t3 - 124t*2 - 8t + 21458? 21t2 - 248t - 8 Differentiate 104m4 - m3 + 2m*2 - 110m + 155451 wrt m. 416m3 - 3m*2 + 4m - 110 Find the second derivative of 140bq*2x + 38bq*2 - 3bqx - bq - q2x - 7q2 - 13591q + 4x wrt q. 280bx + 76b - 2x - 14 What is the second derivative of -2k*3m + 2344k3p + kmp - kp - mp + 2228p wrt k? -12km + 14064kp What is the third derivative of 410835z*3 + 1806144z*2 wrt z? 2465010 What is the second derivative of -18081b3 - b2 + 3566b + 25? -108486b - 2 What is the third derivative of 132b5 + 1692b*3 - 177b*2 - 1000b? 7920b2 + 10152 Differentiate 2k*2w*2 - 47k*2w - kw2 + 165k + 443749w2 with respect to k. 4kw2 - 94kw - w2 + 165 Find the first derivative of -9193b3 + b2 + 12b - 831532. -27579b*2 + 2b + 12 Find the second derivative of 552162n2 + 122373n. 1104324 What is the third derivative of -465141n4 + 2n*2 - 22160n? -11163384n Find the second derivative of -5364v*2y*4 + 11v*2y*2 - 174v*2 - 6301vy wrt y. -64368v*2y*2 + 22v*2 What is the second derivative of 393br2v - 6brv + br + 227r2 - 33rv - 2r + 1 wrt r? 786bv + 454 Differentiate g*2 + 11474g - 1507 with respect to g. 2g + 11474 What is the second derivative of 40045k*4 + 4942319k? 480540k2 What is the third derivative of 9u*3v*4 - 8u*3v*2 + 2u*3 + 91u*2v*3 + 2u*2v2 - v4 + 6343v wrt v? 216u*3v + 546u2 - 24v What is the second derivative of -471878b3w2 - b3w - b2w*5 + 27366b*2 wrt w? -943756b*3 - 20b*2w*3 Find the second derivative of 325447p*5 + 128437p - 2. 6508940p3 What is the second derivative of -3471405d*3p*2 + 103441d*3p wrt p? -6942810d3 What is the second derivative of -2406083f*2 - 2717859f? -4812166 Differentiate -3h3k + h*3 - 17170h*2k*2 - 248h**2 + 8 with	{ "pile_set_name": "DM Mathematics" }
zs3 + n + ws + ks2 and give z. -3 Rearrange 2f3 + f4 - 1 - 4f3 - 5f*2 + 6f*2 to the form r + gf*3 + nf*2 + if + pf4 and give r. -1 Express (3s*2 + 4s*2 + 0s*2)(-3s + 3s + 10s2)(1 + 1 - 5) as fs2 + qs + z + bs4 + hs*3 and give b. -210 Rearrange (-34j + 251j + 10j)(-2j + 3j - 3j) + 2j2 - 5j*2 + 5j*2 to the form u + qj + wj2 and give w. -452 Rearrange (0 - 1 - 1)(4 + 3 - 27)(v3 - 3v*3 + 0v4 - v4) to sv + i + uv*4 + hv*2 + kv*3 and give u. -40 Rearrange 2q*2 - 10q*3 + 1 + 12q3 + q4 + 1 - 2q to the form yq + aq3 + oq*4 + l + nq*2 and give o. 1 Rearrange -1227 + 1227 + 2o*2 + 2o*4 + 2o - 2o3 to the form wo + io2 + r + po*4 + bo*3 and give i. 2 Rearrange 2m*4 + 4m*3 - 3m*2 + m - 13 - 4m*4 + m + 10 to om + n + km4 + bm*2 + xm3 and give n. -3 Rearrange (s2 - 2s2 + 0s*2)(-4s2 - 12s + 3s2 + 3s) to the form os4 + ls*2 + h + ws + ys3 and give o. 1 Express (6m + 7m + 5m)(-m3 - 2m*2 + 2m*2) in the form k + fm*2 + lm*4 + wm*3 + bm and give l. -18 Rearrange -15i3 + 19i*3 - 2i - i + i*2 to the form si*2 + gi + h + vi3 and give g. -3 Express -1 + 3h + 1 - h + 2 - 2 - 3h + 4h + h + (-1 + 4 - 4)(h + h - 3h) + h + 0 + 0 - 3h - 2h - 5h + h + 4h - 3h as q + ih and give q. 0 Rearrange 5w2 + 3w*2 - 9w*2 to pw + j + dw2 and give d. -1 Rearrange -18r + 8r + 9r + 27 to i + cr and give i. 27 Express -4k*3 + 2 + 7k*3 - 2k*3 - 2k*2 as yk*3 + ok*2 + pk + g and give o. -2 Rearrange -26b3 + 11b*3 + 3 - 5 to lb*3 + o + pb + nb2 and give n. 0 Express (-5x + 2x + 2x)(2 - 2 + 2x*2) + (-x - 5x + 4x)(-5x2 + 6x2 + x2) as qx2 + px + rx3 + k and give p. 0 Express 9 + 5p*2 - 9 as l + xp + kp2 and give k. 5 Express -5u*3 + 2u*2 + 7u3 + u3 + u4 - u3 as bu3 + z + ju*2 + hu*4 + ru and give b. 2 Rearrange (175 - 210 - 2k + 0k)(0k + k - 3k) to the form xk + rk2 + u and give x. 70 Rearrange -27o - 24 - 33 + 57 to the form bo + n and give b. -27 Express 23s2 + s3 - 52s2 - 1 + 26s*2 in the form as*3 + r + zs + cs2 and give r. -1 Express -y + 16 - 16 + y3 as iy*3 + a + fy + by2 and give b. 0 Express (-2j - j + 0j)(-18j + 29j - 19j + (2j + 1 - 1)(3 + 2 - 6)) as kj*2 + y + dj and give y. 0 Express ((-1 - 1 + 1)(-1 - 1 + 3) - 341 + 78 + 29)(-6h + 2h + 3h) as k + jh and give j. 235 Express 2m - m - 3m + 2m - 3 + 3 + (8 + 10 + 2)(0 - m + 0) as cm + l and give c. -20 Express 2a*2 + 9a - 2a4 - 4a*2 + 5a*4 - 5a*4 as ia*2 + ba*3 + oa*4 + ta + p and give i. -2 Express ((4 + 5 - 3)(-2l + l + 2l) + 1 - 1 - l)(l + 0l + 6l) in the form v + sl2 + fl and give s. 35 Express 13m3 + 2 - 5m*3 - 6 in the form u + lm*3 + zm + tm2 and give u. -4 Rearrange -3w - 62 + 62 + (2 + 0 + 0)(3w - 4w + 3w) to the form l + pw and give p. 1 Rearrange (-11 - 5 + 3)(-1 + 3 - x - 1)(0x - x - 6x) to the form u + jx*2 + nx and give n. 91 Express 3p4 - p3 - 3p + 6p - p in the form wp*3 + m + ap*2 + bp*4 + qp and give w. -1 Rearrange (2 + 1 - 4)(-1 + 3 - 1)(-3b - 14b + 2b) to o + kb and give k. 15 Rearrange 70r3 + 0r - 2r2 - 2r*4 - 65r*3 + r to the form mr*2 + wr*3 + ar + tr4 + u and give w. 5 Rearrange -2m + m + 2m + 1 - 1 - m - 2m + 0m + 3m + (m + 5m - 5m)(4 - 3 + 0) + 6m - m - 3m + 0m - m - m to the form um + k and give u. 2 Rearrange (-2p + 0p + 3p + (-5 + 6 + 1)(0 + 0 + 2p) - p - 3p + 6p)(6 - 11 - 3) to tp + h and give t. -56 Express (-86u + 1050 - 1050)(-u + 0u + 3u) as hu2 + ku + l and give h. -172 Rearrange -4h3 + 36 - 20 + 73 + 5h*3 to k + qh + dh3 + zh*2 and give d. 1 Rearrange (1 + 2 - 2)(-3 + k + 3) + (4 - 4 - 2)(3 + 2k - 3) - 3k - 15k - 2k to the form r + pk and give p. -23 Rearrange (0 - 3 + 1)(3 + i2 + 5 + i2) to wi + yi2 + j and give j. -16 Rearrange -3j - 3 + 3 + (-1 + 1 - 2)(-2j + 3 - 3) - 3 + 2j + 3 + j - 4j + j + 4j - 4j + 2j to x + oj and give o. 3 Express -4f4 - 2f*2 - 6f3 + f3 - 3f3 + 9f*3 + f as a + wf + gf2 + sf*4 + kf*3 and give k. 1 Rearrange -17n + 21n + 18n + 24n to r + jn and give j. 46 Rearrange -3s3 + 2s*2 - 4s*3 + 6s*3 to ds*3 + ns*2 + q + hs and give d. -1 Express -3w2 - 67w + 68w + w3 + 7w*4 + 2w*2 as mw*2 + iw*4 + uw*3 + gw + z and give m. -1 Rearrange (-1221s + 2 + 625s + 501s)(-2s2 + 2s*2 + 2s*2) to the form ys + f + xs3 + hs*2 and give x. -190 Rearrange (0 - 2f + 0)((0 + 0 - 2)(4 - 2 - 1) - 19 + 18 - 30) to af + r and give a. 66 Rearrange 45a*2 - 55a*2 + 26a*2 to q + ia + xa2 and give i. 0 Express 1 - 2 - w + 0 + (5w - 4w + 3w)(0 - 2 + 3) in the form mw + f and give m. 3 Rearrange (-2 - 4 + 4 + (1 + 1 + 0)(2 - 1 + 1) + 1 - 3 - 5)(4y - 4y - y*2) to the form w + fy + ty2 and give t. 5 Express -2l*4 - 2 + 2l*2 + 2 - 2l*3 - 1 as tl*4 + nl*3 + al + y + bl2 and give t. -2 Express 2i*2 - 3i*2 + 4i*2 - 3i*2 + 3i*2 - 2i*2 + (4i - i + 0i)(-2i + 3i + 2i) - 2 + 2 - i2 in the form r + oi*2 + wi and give o. 9 Rearrange (-3 + 0 + 2 + (1 - 1 + 1)(0 - 6 + 4))(6 - 8 - 30v + 4v) to the form l + qv and give q. 78 Express -3 - 387w*3 + w + 387w3 - w4 as lw + a + rw*4 + dw*2 + jw*3 and give d. 0 Rearrange (-4k + 40k + 69k + 11k)(-3 - 1 + 5) to t + uk and give u. 116 Express (-2x*2 - 6 + 6)(-2x2 + 2x*2 - 8x*2) as k + yx + ux3 + tx*2 + qx*4 and give q. 16 Rearrange (-3 + 3 + s)(-7 + 2 + 1) + (-2 + 2 + 1)(0s + 0s + 5s) to z + ws and give w. 1 Express (0 - 1 + 3)(2c2 - c - 8c*2 - 2c*2) as fc + vc2 + d and give f. -2 Rearrange -8s + 2 - 16s - 2s + 2s to the form js + z and give z. 2 Express 28t2 + 45 - 45 in the form p + lt + kt2 and give k. 28 Express -3h*2 - 2h + 8h3 - 14h*3 + 2 + 14h*3 as ih*2 + d + zh + wh3 and give w. 8 Express -1070i*2 + 2i*3 - 126 + 2i*4 + 1070i*2 as g + si + bi4 + li*2 + di*3 and give b. 2 Express 3p*3 - 3p - 2p4 + 5p - 3p2 + 2p2 + p4 in the form up4 + vp*2 + hp*3 + t + jp and give j. 2 Rearrange 0u2 + 5u*2 + 2u - 3u2 + 2u*3 to the form iu*3 + mu + f + xu2 and give x. 2 Rearrange (-v + 5v - 2v)(-87v - 6v2 + v2 + 101v) to the form kv + t + jv2 + iv3 and give i. -10 Rearrange 23 - 40 - f4 - 2f3 + 2f*2 + 16 to af*3 + n + uf*4 + yf + tf2 and give n. -1 Express 6m*3 + 5m*3 - 5m*2 - 10m*3 in the form bm*2 + gm + lm3 + w and give b. -5 Express 9 + 11 - 18 - 2h + 1 in the form m + xh and give m. 3 Express (-7u - 17u + 9u)(2u - 2u + u) in the form t + xu + au2 and give a. -15 Rearrange (2 + 1 - 5 + (0 + 0 + 4)(4 - 2 - 1))(2 + l - 2) to the form fl + w and give f. 2 Express 0 + 2 + 57g2 - 49g*2 in the form l + mg + kg2 and give k. 8 Express i4 - 6i*3 + 0i - 4i - 1 + 7i as ri3 + gi*4 + mi*2 + w + xi and give w. -1 Rearrange 25 - 45 + 21 - 22p2 to cp*2 + ap + k and give k. 1 Express -19n2 + n - n + 2 + 21n*2 in the form dn*2 + ln + s and give d. 2 Express 6 + 28n - 1 - 5 in the form j + tn and give t. 28 Rearrange ((-4d + 0d + 2d)(-1 + 2 + 0) + 4 + 5d - 4)(1 + 1 - 5)(1 - 1 + 2d*3) to the form n + td*4 + zd*2 + qd*3 + hd and give t. -18 Express 8v3 - 3 + 2v + 1 - 7v3 + 3v*2 as j + cv + av3 + bv*2 and give a. 1 Express (0c2 + c2 - 4c2 + (-c - 3c + 5c)(c + c - 4c) - 2 + 2 + c2)(-5c - 2c*2 + 5c) as kc4 + mc + oc3 + j + tc*2 and give k. 8 Express (2w*2 + 2w*2 - 2w*2)(w + 0w + 0w) + 2w - 2w + 3w3 + (0w + 2w - 4w)(-w + w + w2) as aw*3 + d + bw*2 + uw and give a. 3 Rearrange -3h2 + 3h2 - h2 to j + zh + ah*2 and give j. 0 Rearrange 0g3 - g4 - 2g3 - 2g*2 + 6g - 5g to the form k + cg*2 + tg*3 + qg*4 + yg and give q. -1 Rearrange 2k3 + 2k + 12 - 5k2 + 4k*2 - 19 to the form lk*2 + rk + z + ik*3 and give i. 2 Rearrange	{ "pile_set_name": "DM Mathematics" }
*3 + 0 + 6/5d = 0. 0, 1, 2 Let m = -522 + 524. Let g be (8 - 0)/(3m/3). Solve -1/2 + 4lg - l3 - 7/2l2 + 11/4l - 7/4l5 = 0. -1, 2/7, 1 Solve 35h*3 + 49h - 258h4 - 41h - 38h + 208h*4 + 55h*2 = 0 for h. -1, 0, 1/2, 6/5 Let m(z) be the second derivative of -48/7z*2 - 38/3z*4 + 4z - 4 - 7/5z5 + 328/21z*3. Factor m(s). -4(s + 6)(7s - 2)*2/7 Let i(h) be the first derivative of 2h*3/11 - 258h*2/11 - 96h + 808. Find w, given that i(w) = 0. -2, 88 Let h = 245 + -1212/5. Let z be (-6)/((360/108)/(16/(-18))). Factor -6/5 - zt2 + ht + 1/5t3. (t - 6)(t - 1)*2/5 Let s be (0 + 3 - 5) + 8/2. Suppose 0 = 3z + sj + j, 20 = z - 3j. Determine t so that -59tz + 4t*4 - 6t*2 + 2t*3 + 57t*5 + 2t*2 = 0. -1, 0, 1, 2 Determine l, given that -39/4l + 1031/8l3 - 387/8l*4 - 721/8l*2 - 5/8l*5 + 20 = 0. -80, -2/5, 1 Suppose -14874 + 3h*2 - 7959 - 420h + 37533 = 0. Calculate h. 70 Let h be 7 + 55(-4)/50. Find v, given that 140v3 - 16v*2 - 14v*4 + 3v*5 - 63v*3 - 49v3 - vh = 0. 0, 1, 2, 4 Suppose -97y + 23y + 86 = -31y. Suppose -2/13m*3 + 16/13m*y - 2/13m*4 + 24/13m + 0 = 0. Calculate m. -2, 0, 3 Let p = -30 + 91. Let h = -59 + p. Factor 101ah + 45a - 40 + 104a2 - 210a*2. -5(a - 8)(a - 1) Solve 111 - 51 - 5z*2 + 523 + 2 + 580z = 0 for z. -1, 117 Suppose -1 = q + 3o, -4q + 8 = 4o - 4. Suppose qn = -5n. Determine s so that ns*3 - 12 - 2s*3 + 3s*3 + 4s - 5s3 + 12s*2 = 0. -1, 1, 3 Let f(p) be the first derivative of 5p*6/6 + 8p*5 - 55p*4/4 - 890p*3/3 - 1010p*2 - 1400p + 873. Let f(k) = 0. What is k? -7, -2, 5 Let n(m) be the first derivative of 71m2 + 0m - 124 - 2/3m3. Solve n(j) = 0. 0, 71 Let c(a) be the third derivative of 0a - 2/105a6 + 0 - 2/7a*4 + 34a*2 - 11/105a*5 - 3/7a*3 - 1/735a7. Suppose c(o) = 0. Calculate o. -3, -1 Let g2 - 57/7g + 50/7 = 0. Calculate g. 1, 50/7 Let m(q) be the third derivative of q7/420 + q6/120 - q5/40 - q4/6 - q3/3 - 304q*2. Let m(x) = 0. What is x? -2, -1, 2 Suppose 0 = 6g + 130 + 32. Let l be -5 - (2 + 18/(-10))g. Determine p so that -2/5p*2 + 0 - lp = 0. -1, 0 Let n = 26583 - 106329/4. Let v(c) be the first derivative of -3 + 0c + 1/5c*5 + nc*4 + 2/3c*3 + 0c*2. Suppose v(g) = 0. What is g? -2, -1, 0 Let k = -19464 + 19468. Let n(i) be the second derivative of -1/20i*5 + 1/6i*k + 13i + 0 + 0i3 + 0i2. Factor n(c). -c2(c - 2) Let p(g) be the second derivative of -g5/90 + 13g*4/54 - 35g*3/27 - 49g*2/9 + 257g. Suppose p(m) = 0. Calculate m. -1, 7 Let -57/5x2 + 93/5x*4 + 103/5x*3 - 36/5 + 9/5x*5 - 112/5x = 0. What is x? -9, -1, -2/3, 1 Let u(a) be the first derivative of -2a5/15 + 26a*4/3 + 440a*3/9 + 224a*2/3 + 3163. What is k in u(k) = 0? -2, 0, 56 Suppose 0 = 22y + x - 2, -y - 86x + 6 = -83x. Find o such that y - 4/11o - 2/11o*2 = 0. -2, 0 Let z(a) = -11a*2 + 12a - 19. Suppose 62 = 17p - 74. Let i(o) = -31o*2 + 37o - 54. Let s(k) = pz(k) - 3i(k). Determine y so that s(y) = 0. 1, 2 Let f = 27/472 + 563/472. Factor -5/2x - f - 5/4x*2. -5(x + 1)*2/4 Find v, given that -428v*3 - 16/3v*5 + 220/3v*2 + 108 + 348v - 96v4 = 0. -9, -1/2, 1 Let k(h) = -h2 + 6h + 1. Let u be k(8). Let m = u - -18. Factor -1 + 1 - 6j2 + 5j - 2j + 3j*m. 3j(j - 1)2 Let m(u) be the second derivative of -u7/840 + u6/96 - u5/40 - 39u*2 - 9u + 11. Let q(b) be the first derivative of m(b). Let q(o) = 0. What is o? 0, 2, 3 Let b(t) = 10t + 26. Let k be b(-2). Let w(v) be the third derivative of 0v*4 + 1/14v*7 + 1/20v*5 + 3/20v*k + 0v - 7v2 + 0v*3 + 0. Factor w(c). 3c*2(c + 1)(5c + 1) Let m(d) be the second derivative of -2d7/21 + 32d*6/15 - 3d*5 - 94d + 3. Let m(x) = 0. Calculate x. 0, 1, 15 Let v(a) be the third derivative of a7/42 - a6/3 + 2a5/3 + 20a*4/3 - 40a*3 - 79a*2 + 2. Factor v(j). 5(j - 6)(j - 2)2(j + 2) Solve 82s3 + 2906s + 2948s + 76s*2 - 6014s + 2s4 = 0. -40, -2, 0, 1 Let m(r) be the second derivative of -r5/100 + r3/10 - 34r*2 + 102r. Let l(s) be the first derivative of m(s). Find f, given that l(f) = 0. -1, 1 Let m = 9 - 3. Let x(d) be the first derivative of -9/5d5 + 5/8d*m - 1/2d*3 + 0d*2 + 8 + 0d + 27/16d4. Determine c, given that x(c) = 0. 0, 2/5, 1 Suppose -15102g + 84 = -15074g. Let c(o) be the third derivative of 1/30o*4 - 2/75o*5 + 0 + 1/150o*6 + 0o + 0og - 29o*2. Factor c(f). 4f(f - 1)2/5 Suppose 15s - 30 = -4v + 13s, -4v - 5s + 63 = 0. Factor 9/4q3 + 15/4q*v - 3 - 3q. 3(q - 1)(q + 2)(3q + 2)/4 Let a(l) = l*2 - 14l - 119. Let t be a(-6). Suppose -4k - 2g = -105 + 103, -5k + t = g. Suppose x3 + 1/2x*2 + 1/2x*4 + 0x + k = 0. What is x? -1, 0 Factor -272d + 50/3d*2 + 888 + 2/3d*3. 2(d - 6)*2(d + 37)/3 Determine q so that 132q2 + 7q3 + 955 + q5 - 144q - 3q*4 - 955 - 35q*3 = 0. -6, 0, 2, 3, 4 Let v be 15/(-45) - ((-42)/36 + (-1)/(-3)). Let m(p) be the second derivative of vp*6 + 0p*2 - 5/3p*3 + 1/2p*5 + 0 - 30p - 5/4p4. Factor m(l). 5l(l - 1)(l + 1)(3l + 2) Suppose 24 = -4i - 4l, 5i + 46 = -2l + 43. What is p in -12/5 - 12/5p2 - 2/5p*i - 22/5p = 0? -3, -2, -1 Let v(c) = 6c2 + 5002c + 4958. Let w(b) = -31b2 - 25031b - 24791. Let k(n) = 11v(n) + 2w(n). Factor k(q). 4(q + 1)(q + 1239) Let y(p) be the second derivative of p*4/4 + 341p*3 + 348843p*2/2 + 2611p. Suppose y(v) = 0. Calculate v. -341 Let w(r) = r*2 + r - 5. Let t(a) = 3a*3 - 17a*2 + 26a - 5. Let c(j) = -2t(j) + 6w(j). Let c(o) = 0. What is o? -1/3, 2, 5 Let u = -315889 - -315894. Factor 4/13yu + 0y - 2/13y3 - 2/13y*4 + 0 + 0y*2. 2y*3(y - 1)(2y + 1)/13 Suppose 35s = 58s - 345. Factor 4m2 - 15m - 2m2 - 4m*2 + 34m - sm. -2m(m - 2) Let c = 3/5587795 - -17506557547/7800561820. Let t = c + 2/349. Factor 3/2h - 3/4h4 + 0 - 3/4h*5 + th*3 + 15/4h*2. -3h(h - 2)(h + 1)*3/4 Let v(t) be the third derivative of -1/5t*5 + 0 + 2t - 39t2 - 8/3t*4 + 8t*3. Factor v(n). -4(n + 6)(3n - 2) Let z(k) be the first derivative of -k6/288 - k5/30 - k*4/32 + 79k*3 + 15. Let d(b) be the third derivative of z(b). Factor d(c). -(c + 3)(5c + 1)/4 Let p be (-186)/31 + (1 - -7). Let 48z3 + 76 + z4 + 888z2 - 120z*p - 76 + 4096z = 0. Calculate z. -16, 0 Let d(g) be the third derivative of 0 - 17/84g4 + 1/210g*5 - 29g*2 + 11/21g*3 + 1/84g*6 + 0g. Let d(t) = 0. Calculate t. -11/5, 1 Factor -18r + r5 - 30 - 20r*2 + 187758r*4 + 0r*5 - 47r - 187748r4 + 30r*3 - 6r*5. -5(r - 3)(r - 2)(r + 1)*3 Let n = 119213/7 + -17027. Factor n - 24/7z*2 - 3/7z + 3/7z3. 3(z - 8)(z - 1)(z + 1)/7 Suppose -72 - 72 = -18b. Let a = -5 + b. Factor 2n4 - n4 + 0n - 16n*2 + 15n*2 + 3n - an3. n(n - 3)(n - 1)(n + 1) Let s = 315 - 126. Let m = 5436 - 5434. Determine g, given that 57 - sg - 4g*3 - 45gm + g3 - 204 = 0. -7, -1 Let m(y) be the first derivative of 32/5y + 56/15y*2 + 2/15y*3 - 1/5y*4 - 2/75y*5 + 122. Determine g, given that m(g) = 0. -4, -1, 3 Let l(j) be the first derivative of -3j*5/5 - 93j*4 - 4084j*3 - 22320j*2 - 43200j - 4868. Solve l(s) = 0 for s. -60, -2 Let d(r) = 15r2 + 6r + 12. Suppose -3x + 2q = -q - 15, 5q = 4x - 24. Let s(g) = -15g + 5g - 1 + 9g - g2. Let w(l) = xd(l) + 12s(l). Factor w(o). 3o(o - 2) Suppose 5j - 20 = -z, z + 229 = j + 225. Suppose 4/5p3 - 16/5p*2 + 0 + zp = 0. Calculate p. 0, 4 Let u(j) = 2j2. Let q(g) = -10g + g + g - 2 + 8 + 24g2. Let y(v) = 2q(v) - 22u(v). Factor y(x). 4(x - 3)(x - 1) Suppose -6448/3k*2 - 1088/3 + 2896/3k*3 - 7/3k*5 + 1808k - 144k4 = 0. What is k? -68, 2/7, 2 Let i(a) = 2a*3 - 9a*2 - 8a + 15. Let q(z) = -z*3 + 4z*2 + 4z - 7. Suppose 0 = 3v - c - 12, v - 4c = 13 + 2. Let g(o) = vi(o) + 7q(o). Factor g(n). -(n - 2)(n - 1)(n + 2) Suppose 342/7d3 + 0 - 80/7d*2 + 2d*5 - 8d - 220/7d4 = 0. What is d? -2/7, 0, 1, 14 Let g(a) = -101a*2 + 2a + 2. Let f be g(-1). Let b = f + 102. Find m such that 0 - 14m*2	{ "pile_set_name": "DM Mathematics" }
se j - o = -wj. Is j a multiple of 12? True Let a(z) = -z3 + 16z*2 + 17z + 20. Is 7 a factor of a(15)? False Suppose 5w + 3u - 1085 = 159, 1003 = 4w + 5u. Does 14 divide w? False Let g(u) = 6u - 1. Suppose -3j = -0j + 4h - 19, 3j - h = -1. Let v be g(j). Suppose -vy + 270 = -0y. Does 27 divide y? True Let w(t) be the third derivative of 1/120t*6 + 0t + 1/6t5 - 1/8t*4 + 2t*2 + 0 - 7/6t*3. Does 23 divide w(-10)? True Let n(g) = 238g - 60. Is 13 a factor of n(2)? True Suppose -13s - 11s = -12144. Does 11 divide s? True Let g be (-96)/(-9) + (-4)/6. Suppose -672 - 348 = -gc. Does 34 divide c? True Suppose 0x = -8x + 32. Suppose c = 5, -2h = -0h - xc + 2. Is 3 a factor of h? True Does 2 divide 2/4 - ((-796)/8 + 5)? False Suppose -2x = -4f - 644, -2x + f = -3x + 334. Is x a multiple of 22? True Let k = 118 + -58. Is 24 a factor of (15/k)/(2/872)? False Suppose 5 = -m + 2g - 3g, 0 = 4g + 12. Let x = m + 33. Is 17 a factor of x? False Let j(v) = 18v - 2. Let l be j(1). Let w(b) = -b*2 + 15b + 24. Does 3 divide w(l)? False Let v(t) = -10t3 - 5t*2 - 5t - 4. Let l be v(-4). Suppose -6d + l = -3d. Suppose 10z = 2z + d. Is z a multiple of 6? True Let p(k) = -k*3 - 8k*2 - 12k - 3. Let c be p(-6). Let s(l) = -l*2 + 2l. Let i(f) = f + 1. Let u(a) = -3i(a) - s(a). Is u(c) a multiple of 7? True Let v(u) = -u3 + 12u*2 + 15u + 9. Let r be v(13). Is 4 a factor of (-2)/5 - (-154)/r? True Let g be 289/2 - (-4 + -4)/(-16). Suppose -61z = -67z + g. Does 4 divide z? True Let t = 64 + -150. Is (-2 - -4)/(-2) - t a multiple of 17? True Does 65 divide (-880)/132(1456/(-10) + -2)? False Suppose 8a = 13a - 35. Does 6 divide 1250/35 - (-2)/a? True Let o = 808 - 582. Does 3 divide o? False Let x be (-1)/(1(-2)/8). Suppose 0 = -0o - 4o + 4q + 208, 0 = o - xq - 43. Is o a multiple of 11? True Let a(z) = -z3 - z2 - 3z - 1. Let l be 6/(6(-3)/(-24)). Suppose -5h = l + 7. Does 13 divide a(h)? True Let h(b) = -b3 - 3b*2 + 4b + 12. Let c(n) = n*3 - 6n*2 + 7n - 1. Let t be c(3). Does 15 divide h(t)? True Suppose -162 = 172z - 199z. Is 2 a factor of z? True Suppose 47r - 53550 = 37r. Does 33 divide r? False Let h(z) = z*2 - 19z - 108. Does 6 divide h(25)? True Let y = -3 - 2. Let s(m) = -2599 + 2m2 + 1298 - m2 + 1305. Does 16 divide s(y)? False Let b(m) = m3 + 5m*2 - 3m - 6. Suppose 2t = 6, 5w + 4 = -4t + 2t. Let c be (w/5)/(7/70). Does 9 divide b(c)? False Suppose 0i = 3i - 4j - 1425, -3j + 475 = i. Let y = i - 210. Suppose -5h = -0h - y. Is h a multiple of 22? False Let m(n) = -13n + 1. Let i be m(-2). Let y = i - 12. Is y even? False Let c(h) = 1 - 5h + 7h + 1 + 1. Let w(n) = -2n - 4. Let z(a) = -6c(a) - 5w(a). Is z(-2) even? True Suppose -5b = 3b - 128. Let a = 33 - b. Is a a multiple of 3? False Let y be 3/(-18) - (-2521)/6. Suppose -2o + y + 180 = 0. Suppose -o = 2r - 6r. Does 15 divide r? True Suppose -1520 = 17f - 4223. Is f a multiple of 30? False Let i = -16 + 29. Let j(q) = -q*3 + 11q*2 + 31q - 7. Does 8 divide j(i)? False Let w be -24 - (-3 + 2 - -1). Let z = -12 - w. Suppose 5i = 4y - z - 63, 3y = 5i + 50. Does 17 divide y? False Let t = 461 + -276. Is 2 a factor of t? False Let o(n) = n - 1. Let k(d) = -73d2 + 2d - 10. Let q(b) = -k(b) + 6o(b). Is 14 a factor of q(-1)? False Suppose 12z - 5893 = -1465. Is 57 a factor of z? False Suppose 0 = -3b + f + 10, -2b - 4f + 2 = -0f. Does 4 divide b/9 + (-235)/(-15)? True Suppose 0 = -7y + 2y + 280. Is y a multiple of 7? True Let n = 99 + 15. Does 23 divide n? False Suppose 3v - 11 = 2f - 2, -9 = -4f - 3v. Let a be 3 - ((-3)/3 + f). Suppose -ai = -3r + 8r - 51, -5r = i + 6. Is 15 a factor of i? False Suppose 2d + 4f - 2424 = 0, -4 = -3f - 16. Is d a multiple of 10? True Let g = 2981 + -461. Is 36 a factor of g? True Let s = -13 + 60. Suppose 3w - 502 = 4h, -2h - 609 - s = -4w. Is w a multiple of 17? False Suppose 48 = 9s - 3s. Does 4 divide s? True Does 9 divide (-78 - 3)-7 - 0/(-3)? True Let m = -6990 + 11385. Is m a multiple of 15? True Let n = 298 + 292. Is n a multiple of 14? False Suppose 8 = -2j + 6j. Suppose 2t - 5u + j = -12, 4t = -2u + 20. Is 40/t + 14/21 a multiple of 14? True Suppose 0 = 6x - 10x + 48. Suppose xv = 15v - 114. Is 38 a factor of v? True Is 20 a factor of (-65)/101312/(-8)? False Let g be 4/(-16)01. Suppose 5h - 156 - 179 = g. Is h a multiple of 17? False Let a(k) be the third derivative of -k*5/12 + 7k*4/12 + 5k3/6 + k2. Let b(w) = -w - 1. Let h(n) = -a(n) - 5b(n). Does 10 divide h(5)? True Let h(a) be the second derivative of a5/20 + 5a*4/3 - 23a*3/6 - 9a*2 - a. Does 9 divide h(-21)? False Let p(a) = 6a*2 - a. Let g be p(1). Suppose -h + 16 = -gh. Is (h/1)/(1/(-10)) a multiple of 8? True Suppose -39 = 3j - 324. Suppose -5z - 4s - 156 - 135 = 0, -296 = 5z - s. Let h = j + z. Does 18 divide h? True Suppose -2h = 2y - 64 - 50, 2h - y = 111. Is h a multiple of 28? True Suppose 0 = -4r - 2y - 6, 0 = -r + 3y + 2y + 15. Suppose f - 6f + 240 = r. Let v = f - 28. Is v a multiple of 5? True Let f(g) = -2g + 4 - 16 - 24 - 3g. Let j be f(-18). Suppose -154 = -4l - j. Is l a multiple of 9? False Let m be 4 - (2 + -2 + -2). Let f(j) = j2 - 6j + 1. Let y be f(6). Let c = m - y. Is 3 a factor of c? False Let u(l) = -32l + 18. Let o = 85 + -90. Is u(o) a multiple of 17? False Let q = 494 - 270. Does 7 divide q? True Suppose 15429 = 4a + 3y, 5a - 19280 = -7y + 2y. Does 7 divide a? False Let f(k) be the first derivative of -7k2/2 + 11k - 34. Is 8 a factor of f(-6)? False Let w be 15/(-3)(-1 - 22). Suppose -g = 5o - w, -3o + 5g = -7o + 113. Let b = o + -2. Does 5 divide b? True Suppose 6 - 26 = -5x. Suppose -xt + 4c + 0c - 440 = 0, -4t + 5c = 442. Let l = t - -155. Is l a multiple of 8? False Is (-18 + 3)/(-5) - (0 - 160) a multiple of 13? False Suppose 5z - 3z + 15 = -3x, 2z + x + 9 = 0. Let h be 10 - (2 + z + 3). Is (5-1)/(h/(-16)) a multiple of 3? False Let h(a) = 19a - 91. Is h(29) a multiple of 48? False Let v(w) = -15w + 168. Is v(-15) even? False Let y(t) be the second derivative of 67t7/2520 + t6/360 + t5/120 + 7t*4/12 + 4t. Let m(c) be the third derivative of y(c). Is 22 a factor of m(-1)? True Let u = 17 + -2. Is (1 - u)(-14)/4 a multiple of 15? False Does 10 divide 925 - (-2)/8(-25 + 21)? False Let k(t) be the third derivative of -1/3t3 - 1/24t*4 + 0 + 1/30t*5 + 0t + 1/120t6 - 5t*2. Is 20 a factor of k(3)? True Let i(j) = -51j*3 + 2j + 1. Let w be i(-1). Suppose 2m = -2a + w, 0m + a = m - 23. Is 24 a factor of m? True Suppose 0 = -q + 5l - 0 - 11, 2q - 5l = -22. Does 27 divide (q - -5)27-2? True Suppose 5t = 2d - 56, 3d - 3t = -44 + 119. Let x(i) = -i*3 + 23i*2 - 2i + 56. Is 5 a factor of x(d)? True Suppose 2 + 2 = 2q. Let f(h) = h + 1. Let l be f(17). Suppose l = qp - 2. Is 4 a factor of p? False Suppose 4l = -1 - 7, 0 = 3v - 4l - 53. Suppose 0j = -3j + v. Let g(u) = u3 - 3u*2 - 6u - 6. Is 4 a factor of g(j)? False Suppose 0 = q - 4w - 19 - 9, 4q + w = 61. Suppose -qz + 12z + 36 = 0. Is z/(-18)-218 a multiple of 9? True Let u = -46 + 11. Let x = -32 - u. Suppose -xg + 2g = -34. Is 7 a factor of g? False Suppose 176 = -71u + 75u. Does 14 divide u? False Let c be (-1 - 3/3) + -61. Let f = -18 - c. Is f a multiple of 9? True Let v(i) = 7i - 51. Let f be v(8). Is 105 + (-8)/20 + 2/f a multiple of 35? True Let v(l) = l2 - 7l + 8. Let d be v(6). Suppose -3q - dy - 3 = -7, 4y + 4 = 0. Suppose o = -4k + 60, qk = 3k + 5o - 15. Is 12 a factor of k? False Suppose 2v = v - 2. Let m be -2 - (v - 3)1. Is 2 - ((-24)/m + 3) a multiple of 3? False Let v(z) = -11z + 33. Is 6 a factor of v(-23)? False Suppose 0 = 2w + 2w + 1548. Let m = 559 + w. Does 21 divide m? False Let b = 101 + -105. Does 14 divide 1050/60 - 2/b? False Suppose u = -5b - 9, b + 58 = -4u - 54. Let v = u + 203. Does 18 divide v? False Let a(y) = -y*3 - 12y*2 - 6y - 2. Suppose -77 = z + 6z. Let v be a(z). Let s = v - -109. Does 13 divide s? True Suppose 26s - 29s = -9. Suppose -3 - 63 = -sb. Is 16 a factor of b? False Let	{ "pile_set_name": "DM Mathematics" }
z + nz2 + y = 0 for z. 7 Let q(o) be the second derivative of -o7/273 + 11o*6/195 - 21o*5/65 + 34o*4/39 - 40o*3/39 - 316o. Find i, given that q(i) = 0. 0, 2, 5 Let d(z) be the second derivative of -1/231z7 + 3/11z*4 - 4/165z*6 + 0z*2 + 3/110z*5 + 0 + 0z*3 + 47z. Factor d(n). -2n2(n - 2)(n + 3)2/11 Let t(x) be the first derivative of 1/3x*4 + 41 + 170x*2 - 44/3x*3 + 1156/3x. Factor t(y). 4(y - 17)2(y + 1)/3 Let b(v) be the third derivative of -v*8/1344 - 3v*7/140 - 31v*6/480 + 3v5/40 + v4/3 + 2v2 + 75v. Solve b(w) = 0 for w. -16, -2, -1, 0, 1 Suppose 815j = 809j. Let s(p) be the third derivative of -23p2 - 1/90p*5 + 0 + 1/9p*4 + jp*3 + 0p. Determine w, given that s(w) = 0. 0, 4 Let u be -2(9 - (-70)/(-7)). Factor -2a*u + 24084 + 4a*2 - 11284 - 320a. 2(a - 80)2 Let x(r) be the third derivative of r5/480 + 27r*4/16 + 161r*3/12 - 2070r*2 - 2. Determine i so that x(i) = 0. -322, -2 Let c(f) = -5f*2 - 125f - 40. Let q(v) = -v + 2. Let j(g) = -c(g) - 20q(g). Let j(p) = 0. What is p? -29, 0 Let l(t) be the first derivative of 5t*6/3 + 1756t*5/35 + 3153t*4/14 + 6308t*3/21 + 76t*2/7 - 48t - 795. Find n, given that l(n) = 0. -21, -2, -2/7, 1/5 Let y(t) be the second derivative of -5/12t4 - 17t - 2 + 55/2t2 - 25/3t*3. Suppose y(z) = 0. Calculate z. -11, 1 Let s(j) = 2j*3 - 32j*2 + 285j - 264. Let o(x) = 3x3 - 31x*2 + 284x - 268. Let y(w) = -3o(w) + 4s(w). Factor y(q). -(q - 6)(q - 1)(q + 42) Let v be (-3614)/139 - -12. Let a = v - -2494. Find h, given that 7/5 - 34/5h*2 + 3/5h*a + 16/5h*3 + 8/5h = 0. -7, -1/3, 1 Let h = 103178 - 103176. Let 32/7q4 + 48/7q*3 - 12/7q + 2/7 + 2/7qh = 0. What is q? -1, 1/4 Let s(z) = 4 + 6z + 2 + 7z2 - 9z*2 + 4z2. Let o be s(-2). Let -q3 - 12q5 - 9q*5 - 3q*4 + 20q*5 + 3q*o + 2q = 0. Calculate q. -2, -1, 0, 1 Let h(w) be the first derivative of -91w3/15 - 44w*2/5 + 3w/5 - 9825. Factor h(t). -(t + 1)(91t - 3)/5 Let 5117q2 - 3702q*2 + 120319 - 20914 + 100815q + 5q3 = 0. Calculate q. -141, -1 Let b(n) be the second derivative of -2n*7/315 + 2n*5/45 - 2n*3/9 - 31n*2/2 + 15n - 1. Let z(x) be the first derivative of b(x). What is v in z(v) = 0? -1, 1 Let a = 667/30 + -137/6. Let q = -13/30 - a. Factor 1/3r + 0 - qr*2. -r(r - 2)/6 Let r be 3/(-21)(-28 + 28). Let q(h) be the third derivative of 0h*6 + 16h*2 + 0h + 0h4 - 1/45h*5 + 1/315h*7 + r + 1/9h*3. Solve q(o) = 0. -1, 1 Let l be ((-157486)/(-28926))/((-14)/(-12)). Factor -4/3v*3 + 0 + 0v + 0v2 + lv*4 - 10/3v*5. -2v*3(v - 1)(5v - 2)/3 Let h(w) = 2w2 - w - 1. Let f(y) = -7y*2 - y - 2. Suppose 33 = -14n + 19. Let x(j) = nf(j) - 4h(j). Factor x(k). -(k - 6)(k + 1) Suppose 6v + 145 = 175. Factor -19g - 38g + 12g + 21 + 49 + vg*2. 5(g - 7)(g - 2) Let q = -231305 + 925223/4. Factor -qb*3 + 27/4b + 21/2 - 9/2b2. -3(b - 2)(b + 1)(b + 7)/4 Let w(a) be the third derivative of a8/80640 + a7/20160 + 13a5/30 + 2a*2 + 64. Let r(b) be the third derivative of w(b). Factor r(d). d(d + 1)/4 Let t(p) = -16p2 - 11p. Let g(v) = 15v2 + 12v. Let x(l) = -23l - 17l + 43l - 12. Let m be x(6). Let s(y) = mt(y) + 5g(y). Factor s(z). -3z(7z + 2) Let l = 70 + -67. Let g be (-2)/9 + 418/99. Factor -l + n*5 + n - 946n*2 + 6n*3 + 3 + gn*4 + 950n*2. n(n + 1)*4 Suppose 2763l = 3234l - 942. Factor 0 - 4r - 2/3r4 + 4/3r*3 + 10/3r*l. -2r(r - 3)(r - 1)(r + 2)/3 Suppose -9g + 16 + 2 = 0. Factor -1 + 3 + 3r - 7r*2 + 1 + 3r*4 - 6r*3 + 3r5 + rg. 3(r - 1)2(r + 1)*3 Let l(v) = -6v*2 - 68v + 41. Let d(k) = -21k + 18. Let r(a) = a2 - 41a + 38. Let c(s) = -5d(s) + 2r(s). Let w(g) = 11c(g) + 4l(g). Factor w(b). -(b + 10)(2b - 1) Let d be (36/15)/(26 + 196/(-14)). Determine j, given that -dj2 + 4/5 + 0j = 0. -2, 2 Solve 4/5t2 + 1008/5 - 132/5t = 0. 12, 21 Let x(u) be the third derivative of -u*7/42 - 49u*6/24 - 176u*5/3 - 3025u*4/6 - 365u*2 - 3. Factor x(y). -5y(y + 5)(y + 22)2 Let v(k) = -k4 + 3k3 - k2 - k - 1. Let b(d) = d4 + 75d*3 - 234d*2 + 158d + 2. Let p(o) = -5b(o) - 10v(o). Solve p(f) = 0. 0, 1, 2, 78 Let m be (-441)/(-476) + 402/1608. Find t, given that -22/17 - mt + 2/17t*2 = 0. -1, 11 Let i be (12 - ((-464)/(-36) - 3)) + 3/(-3). Let l(m) = -m + 1. Let c be l(-1). Find a, given that ia + 2/9a3 + 4/9 + 8/9a*c = 0. -2, -1 Let y = -108 - -114. Suppose 15g*3 - 6g*4 - 2g*5 + yg*2 - 18g*5 + 8g*5 - 3g5 = 0. Calculate g. -1, -2/5, 0, 1 Let i(k) be the second derivative of k8/26880 + k7/10080 - k6/720 - k*5/120 - 19k*4/2 + 2k + 7. Let c(h) be the third derivative of i(h). Factor c(a). (a - 2)(a + 1)(a + 2)/4 Let u(v) be the first derivative of v*3/5 + 705v*2 + 828375v - 1758. Factor u(d). 3(d + 1175)2/5 Find y, given that y2 + 0 + 271/2y = 0. -271/2, 0 Let n(k) be the first derivative of 14k3/9 - 10k*2/3 - 48k + 3049. Let n(x) = 0. What is x? -18/7, 4 Suppose 0 = 3y - 15, -2n = 3y - 36 + 13. Let f(c) be the third derivative of 1/2c*3 - 5c*2 + 1/40c*5 - 3/16c*n + 0 + 0c. Solve f(p) = 0. 1, 2 Suppose -85p = -28p - 684. Factor -px3 + 6x + 28x + 10x - 30 - 2x4. -2(x - 1)*2(x + 3)(x + 5) Let f(w) be the second derivative of w7/14 - w6/30 - 3w*5/4 + 5w*4/12 + 2w*3 - 2w*2 + 104w + 1. Let f(a) = 0. Calculate a. -2, -1, 1/3, 1, 2 Suppose -3/2b4 + 1863/2b - 2343/2b2 + 165/2b*3 + 2187 = 0. Calculate b. -1, 2, 27 Suppose -n + 4c = c - 39, 3n + 3c - 69 = 0. Suppose 4q + 10 = 4m - 18, n = m - 5q. Factor 8p*2 - 5p - 1102 + mp2 + 1072. 5(p - 2)(2p + 3) Let w = 4147 + -2401. Let u = 1748 - w. Factor 32/3g + 2/3g*u + 128/3. 2(g + 8)*2/3 Let k(a) = 6a3 - a2 - a. Let y be k(2). Let c = -39 + y. Factor 20j3 - 17j*3 - 20 - 12j*4 + 9 + 30j*2 - 13 - 12j + cj5. 3(j - 2)*3(j + 1)*2 Let h = 1509/262 + 1204971/3406. Let a = 360 - h. Let -2/13x*2 - a + 8/13x = 0. What is x? 1, 3 Let t be 105/(-140)(-32)/(-30) - 82/(-65). Suppose 0 = -x, 4d - 3d - 4x = 2. Factor t - 2/13nd - 4/13n. -2(n - 1)(n + 3)/13 Let d(t) = 2t2 - 28t. Suppose x + 4c = -x + 28, 7 = -2x + 3c. Let l(p) = -p2 + 15p. Let g(j) = xd(j) + 7l(j). Factor g(r). r(r - 7) Let s be (-15 + 627/38)/(0 - (-3)/54). Let i(g) be the first derivative of -5/6g*3 + 0g + 1/8g4 + g2 + s. Factor i(b). b(b - 4)(b - 1)/2 What is c in 654165538/9 + 1378/3c*2 + 2/9c*3 + 949442/3c = 0? -689 Let r(t) be the first derivative of -2t5/55 - 16t*4/11 - 350t*3/33 + 1476t*2/11 + 3240t/11 - 79. Solve r(o) = 0 for o. -18, -1, 5 Suppose -18h + 5 = -17h. Let l(v) = 138v - 690. Let z be l(h). Factor zu + 2/3 - 2/3u2. -2(u - 1)(u + 1)/3 Let g be ((-20)/(-15))/((-4)/(-558)). Suppose -13s - 30 = -g. Factor 14 - 6 - 5 - 8o2 - 7 + so. -4(o - 1)(2o - 1) Let z(i) be the first derivative of i3/3 + 1050i*2 + 1102500i + 7935. Factor z(j). (j + 1050)*2 Let t be 30/(-231) - (-297)/1089. Factor -tp + 2/7 - 1/7p2. -(p - 1)(p + 2)/7 Let s = -301/2 - -3319/22. Let c(h) = -8h - 86. Let i be c(-11). Factor 6/11u*i - 10/11 + su. 2(u - 1)(3u + 5)/11 Let v(p) = 151p*2 - 4p - 69. Let t be v(-7). Find o such that -16o - 4o*3 - 54o - 7310 + t + 6o + 28o2 = 0. 2, 3 Let c(k) = -k3 + 22k2 + 86k - 77. Let y be c(26). Let l = -3811/7 - y. Factor 0i - li*3 - 2/7i*2 - 2/7i*4 + 0. -2i*2(i + 1)*2/7 Let q(o) be the first derivative of -5o*6/18 + 137o*5/6 + 585o*4/8 + 1415o*3/18 + 355o2/12 - 2407. Let q(s) = 0. What is s? -1, -1/2, 0, 71 Let k(q) be the second derivative of -q4/28 - 47q3/14 + 81q*2 + 2q - 2054. Determine n, given that k(n) = 0. -54, 7 Let r(u) be the second derivative of u*4/42 - 2u*3/7 + 8u*2/7 - 262u - 2. Factor r(f). 2(f - 4)(f - 2)/7 Let c be ((-2268)/(-1470))/(45/42). Let t(l) be the first derivative of 2 + 3/5l - cl*5 - 13/5l*3 + 15/4l*4 - 3/10l*2. Solve t(q) = 0. -1/4, 1/3, 1 Let t(i) = -22i*2 + 3258i + 3052. Let y(x) = 47x2 - 6549x - 6102. Let r(u) = -13t(u) - 6y(u). Suppo	{ "pile_set_name": "DM Mathematics" }
as uk2 + rk + i and give u. -4672 Rearrange (-173a2 - 2775a*3 - 136 + 2778a*3 + 135)(2 - 2 - 2a) + a - a - a4 to the form ga*2 + da + ca4 + w + ra*3 and give d. 2 Rearrange -989n - 413n - 566n + 2 - 314n to the form mn + q and give q. 2 Rearrange 1 + 6j4 + 20j*2 - 52j*3 + 33j*2 - 52j*2 - 15j*3 to the form u + wj*4 + mj + zj2 + sj*3 and give u. 1 Express (704 - 704 + 355j)(5 - 6 + 5 + 5j) in the form c + nj + wj*2 and give w. 1775 Express 0 + 192713206h - 192731504h + 0 as zh + a and give z. -18298 Rearrange (4s - 11s - 2s)(-s - 7s - s + 7s - 8s - 5s + (-1 + 4 - 2)(0 - 2s + 0) + 3s - 2s - 2s) to the form o + ns + gs2 and give g. 162 Rearrange 15q*2 + 71 - 7q*2 + 4q*2 + 155q - 156q to the form vq + j + oq2 and give v. -1 Rearrange (-5 + 7 + 6 + (-2 + 3 + 1)(-3 + 2 + 6))(-m2 - m2 - 2m*2) to w + zm + lm2 and give l. -72 Rearrange -4331l - 2974l + 1388l to m + cl and give c. -5917 Rearrange 288s + 2s2 - 416s - 15s3 + 7s*3 to the form ws + ys2 + c + is*3 and give i. -8 Rearrange (7 - 53 - 18)(-2h2 - 1 + 1 + (-2 - h + 2)(0h - 3h + 2h) + 16h*2 + 13h*2 - 58h*2) to ch + n + vh2 and give v. 1920 Express (k + 3k - 3k)(2k + 0 + 0) - 77k*2 + 27k*2 + 34k*2 + 123 - k - k - 120 - 92k*2 in the form bk + wk2 + c and give b. -2 Rearrange (2r - 2 + 2)(279791r - 279793r + 9907r*3 - 1913r*3) to the form g + qr*2 + ir + yr3 + lr*4 and give l. 15988 Express -n + 12n*2 + 21483 - 21483 - 3n*3 as tn*2 + u + rn + bn3 and give r. -1 Express -32w - 3 + 226w + 29w + 0 as u + zw and give u. -3 Express (2 + 4 - 3)(-4 - f + 4 + f + 2 - 2 + (-2f - 3f + 3f)(0 + 3 - 1) + 0f + 5f + 7f) - f + 0 + 0 in the form if + b and give i. 23 Express (-11 - 5 + 15 - 13f)(f*3 + 2 - 2)(-367 + 167 + 172) as j + yf2 + cf + qf4 + wf*3 and give w. 28 Rearrange 367 + 370 - 19p*2 - 1109 - 14p + 374 to the form d + tp + jp2 and give d. 2 Express p2 + 5p2 - 5p*2 + (-407p - 405p + 721p)(3 - p + 2 - 4) in the form rp*2 + b + vp and give v. -91 Rearrange (1 - 1 - 2o)(o - 2o + 3o) + 28o2 - 190o - 157o + 343o to vo + wo*2 + p and give v. -4 Rearrange (-168m + 727m - 1273m)(-2 + 5 + 0) to the form g + tm and give t. -2142 Rearrange 507g + 148g + 478g + 127g + 439g to the form hg + l and give h. 1699 Express (1 - 4 - 4)(291w*4 - 320w*4 + 316w*4) in the form cw*4 + dw*3 + xw*2 + gw + j and give c. -2009 Express -1 - 58t2 + t - 65t*2 + 416t*3 + 190t*2 + 62t*3 - 65t*2 in the form kt*3 + qt + p + vt2 and give k. 478 Rearrange -3770b + 4196387 - 4196387 to w + hb and give h. -3770 Express 526 - t2 - t2 + 9t*3 - 4t*4 - 524 in the form rt*4 + xt + i + jt2 + ct*3 and give c. 9 Express 120 + 134 + 2m - 248710m2 + 248706m*2 as lm + y + om2 and give y. 254 Rearrange -19 - 3m*3 - 2410m + 2417m - 4 + m4 to the form jm + cm4 + vm*3 + im*2 + x and give v. -3 Express (-87y + 179y - 90y)((2 + 1 + 3)(-4y + y + 5y) + (3 - 3 - 4)(4y + 0y - 5y)) in the form wy2 + cy + u and give w. 32 Rearrange (2 - 5 + 1)((40320 - 40320 + 49o)(-2 + 4 + 0) - 4o - o + o) - o + 8o - o to ho + f and give h. -182 Rearrange (2 - 3 - 6)(143j*3 + 55j*3 + 64j*3) to aj + m + dj3 + hj*2 and give d. -1834 Express ((11 - 1 + 4)(6 - 3 - 4) + (-6 + 2 + 2)(33 + 57 - 34))(v*2 + 2v3 - v2) as k + av2 + pv*3 + jv and give p. -252 Express 70y3 - 74y*2 - 2300y*3 + 100y*2 + 2 - 26y*2 as oy*3 + vy + h + zy2 and give o. -2230 Rearrange -616 + 1069a - 354a - 2a*2 - 353a - 363a to na*2 + w + ta and give t. -1 Express -106868 + 88u2 - 3u - 4u + 8u*2 + 106868 in the form wu + m + xu2 and give w. -7 Rearrange -286 + 286 - 7802g to ig + j and give i. -7802 Express 2c + 452 + 2c + 468 - c - 944 in the form fc + h and give h. -24 Rearrange -6h + 4h + 4h + (-3h + 7h + 2h)(182 - 175 - 550) to r + qh and give q. -3256 Rearrange 13n3 + 11n*4 + 102 - 10n*4 - 120 - 5n*2 + 5n*2 to jn*2 + mn + u + pn3 + sn*4 and give p. 13 Rearrange -3s + 8s + 14598 - 14592 - 6s*3 + 3s*3 + 27s*2 to the form ds*2 + ts + r + as3 and give t. 5 Rearrange (-v2 + 3v*2 - 5v*2)(-1635v + 3572v - 12378v) to rv*3 + k + qv + uv2 and give r. 31323 Rearrange -2 + 4 + 4w*3 - 5w - 4w3 + 19w4 + w3 + 16w2 - 17w*2 to g + mw*2 + dw*3 + pw + iw4 and give p. -5 Rearrange 14608823 + 18w + 49w - 14608820 - 3w*2 to m + cw*2 + lw and give c. -3 Express 2595u - 2809u + 1307u - 10278u - 11603u as l + xu and give x. -20788 Express (i*2 + 1 - 1)(-2572 + 2240 + i + 12445 + 1529 + 12967) in the form f + bi + zi*3 + gi*2 and give z. 1 Express (-3g + g + g)(-2292 + 4648 + 229g - 2331) in the form fg + t + mg*2 and give f. -25 Rearrange 3422041b - 3720b2 - 3422041b to hb + g + wb2 and give w. -3720 Express -x2 + 619 + 146 - 673 + 457 as zx2 + ux + v and give v. 549 Rearrange 1 - 70723a - 172a*2 + 2a*3 + 13 - 8 + 70723a to ra + ya*2 + ca*3 + x and give x. 6 Express 8c*4 - 94c*4 + 2c*4 - 1 - 90192c + 90194c - 10c*2 as dc*3 + p + gc*2 + hc + uc4 and give g. -10 Rearrange -a2 - a + a + (-563a + 26414 - 26414)(-6a + 3 - 3) - 2a2 + 0a*2 + 0a*2 to the form qa + x + ja2 and give j. 3375 Express (-632 - 178g + 632)(-8g + 3g - 6g) + (-g + 4g - 6g)(g + 0g - 3g) in the form cg + y + zg2 and give z. 1964 Rearrange -35 - 29 + 97 - 12s4 - s2 - 31 - 60s + 0s*2 to the form as*3 + ms + is2 + f + ns*4 and give f. 2 Express 0 + 1 + 716u + 3118u + 298u + 0 as lu + y and give l. 4132 Rearrange 75 - 42y*2 - 75 + (-9y + 9y + 4y*2)(3 + 0 + 2) to the form my2 + cy + z and give m. -22 Express (-110 - 56 - 40)(2u + 2u - 27u) as q + wu and give w. 4738 Express 2450l - 189l2 - 5 - 2448l + 16l3 - 15l*3 as ul*2 + m + jl + pl3 and give m. -5 Rearrange -379p*2 + 392 - 2p + 1637p2 - 392 + 5p to bp + y + tp*2 and give t. 1258 Express (-7 + 0 + 4)(2p3 + 0p*3 - 5p*3)((-2 + 3 + 0)(2p - 1 + 1) + 3p + 2p + 5p - 3p - 4 + 4) as gp + zp*2 + mp*4 + op*3 + s and give o. 0 Express -441335 + 441334 + 0c + 0c - 10c*2 in the form m + uc*2 + lc and give m. -1 Rearrange -16x - 8x + 31x - 8x - 90x2 + 7x*3 - 83x*2 to the form sx*3 + gx + a + ox2 and give g. -1 Express 59d*2 + 69d*2 + 59d*2 + 562 - 26 - 198d*2 as t + od*2 + hd and give o. -11 Express 15y2 + 2y + 8y4 + 7 - 16y*4 + 13y*2 - 9y*2 + 9y*4 in the form iy + ry2 + ly*3 + w + dy*4 and give r. 19 Express -9s + 18s + 183 - 2s - 5s - 4s as js + t and give t. 183 Express -78a + 107 + 1361a + 2155a - 107 in the form i + ta and give t. 3438 Express -3559v - 2 + 16v3 + 2v*2 + 3560v - 3 + 10v2 in the form uv*3 + jv + b + cv2 and give c. 12 Express 7k4 + k3 - 6k3 - 3k*2 - k - 6k*3 + 9k*3 + 4k*3 as qk*2 + vk*4 + ck*3 + nk + u and give v. 7 Express -23 + h*2 + 307 - 2h + 98 + 548 + 10 as u + qh2 + zh and give u. 940 Express 24 + 60v + 2v*2 - 78 - 2v*2 + 37 - 4v*2 as wv*2 + q + cv and give q. -17 Express -1228s + 3501s + 2849s as vs + p and give v. 5122 Rearrange -853k - 1 + 2 + 843k - 12 + k*2 to rk + j + nk2 and give j. -11 Rearrange 69x - 81 + 109 - x*4 - 23 to the form yx*4 + nx + d + zx3 + hx*2 and give y. -1 Express -4d - d*2 - 7d + 3d + (3820 - 414d - 3820)(0d + 2d - 3d) in the form od + nd*2 + p and give n. 413 Express (4 + q - 4)(519q + 2 + 1024q - 2 + 150q) in the form a + sq*2 + fq and give s. 1693 Express -242v3 + 60v*2 - 60v*2 + (-27 + 27 + 6v)(-3v*2 + 2 - 2) as kv*3 + yv + j + gv2 and give k. -260 Express (1 - 1 + 3)(346 - 1166 - 348)(-r3 + 2r*2 - 2r*2) in the form pr*3 + ur*2 + wr + g and give p. 3504 Rearrange -31s + 2s*3 + 12s + 21s + 2 - 3 + 33s*2 to is*3 + ms*2 + c + bs and give i. 2 Express -3s2 - 2s*3 + 842144 - 842498 + 3s*2 in the form cs**3	{ "pile_set_name": "DM Mathematics" }
19i2. Determine g(m(y)). 76y*2 + 1596y + 8379 Let t(d) = 2d2. Let p(g) = -51g + 3. Determine p(t(s)). -102s2 + 3 Let i(k) = -k. Let w(q) = -q2 + 6q + 9. Let x be w(7). Let d(f) = 3f + fx - 3f. What is d(i(t))? t*2 Let w(a) = 7 - 7 - 2a. Let t(d) = 6d2. Determine w(t(n)). -12n*2 Let l(y) = -65y*2 - 3. Let i(n) = -2n. Determine l(i(j)). -260j2 - 3 Let z(g) = -g. Let p(v) = -23v + 4. Calculate p(z(x)). 23x + 4 Let f(j) = -2j*2. Let i(v) = 183v. Calculate i(f(r)). -366r2 Let v be (-3)/(-9) + (-4)/3. Let q = 3 + v. Let j(d) = 6d*q - 2d*2 - 3d*2. Let b(y) = 6y*2. Give b(j(l)). 6l4 Let l(b) be the second derivative of -b5/120 - b3/3 + b. Let p(x) be the second derivative of l(x). Let c(m) = m2. Calculate c(p(v)). v2 Let b(g) be the third derivative of -g4/12 - 11g2. Let u(w) = -w - 2. Give b(u(a)). 2a + 4 Let r(x) = -x*2 - 838. Let h(q) = 6q. Calculate h(r(g)). -6g2 - 5028 Let y(s) = s - 5. Let z be y(5). Let p = 0 + z. Let a(i) = 0i + pi + i. Let q(g) = g2. Calculate q(a(u)). u2 Let n(x) be the third derivative of x4/8 - 3x*2. Let o(i) = i. Calculate o(n(g)). 3g Let g(r) = -74r. Let a(j) = -452j + 452j + j2 + 0j*2. What is a(g(y))? 5476y2 Let g(c) = c2. Let m(q) be the first derivative of -q*3/6 + 4q - 1. Let x(n) be the first derivative of m(n). Give g(x(u)). u*2 Let q(g) = -3g*2. Let l(i) = -8i + 6. Let r(m) = -m. Let b(f) = 7f - 1. Let y(t) = b(t) + 6r(t). Let c(u) = l(u) + 6y(u). Determine q(c(k)). -12k*2 Let w(l) = 3l*2. Let z(g) = -179g*2. Calculate w(z(x)). 96123x*4 Let u(f) = -14f + 30f - 18f. Let d(c) = c + 5 - 4c - 4c. Let z(l) = 8l - 6. Let m(b) = 6d(b) + 5z(b). Determine u(m(t)). 4t Let g(l) = -17l - 122. Let r(k) = -2k*2. Calculate r(g(w)). -578w*2 - 8296w - 29768 Let f(s) = s*2 + 8s. Let l(z) = -2z. Give f(l(o)). 4o*2 - 16o Let p(r) = -3r2. Let v(h) be the second derivative of 0h*2 + 1/12h*4 - 5h + 0 + 0h3. What is v(p(j))? 9j*4 Let z(p) = 5p. Let s(r) be the first derivative of -r*3/3 + 7. Determine z(s(k)). -5k*2 Let b(n) = -10n*2 - 9n*2 - 2n2. Let m(r) = r2. What is m(b(d))? 441d4 Let n(l) = -2l2. Let q(d) be the first derivative of d5/40 - 2d3/3 - 3. Let y(k) be the third derivative of q(k). Determine y(n(b)). -6b*2 Let h(s) = 2s. Suppose -3r = -5c - 33, -3c = -4r - 4c + 21. Let k be ((-3)/r)/(2/(-16)). Let d(y) = -5 - ky + 6y + 5. Determine h(d(b)). 4b Let q(h) = h + 1. Let k(p) = 5p - 3. Let w(v) = -6v + 4. Let t(n) = -6k(n) - 4w(n). Let i(o) = 2q(o) - t(o). Let z(f) = 2f*2. Calculate i(z(r)). 16r*2 Let n(w) = -5w + 3 - 4w2 - 3 + 2w. Let m(r) = 7r2 + 5r. Let h(q) = -3m(q) - 5n(q). Let y(k) = -3k2 + 2k*2 + 0k2. Determine y(h(g)). -g4 Let v(c) = 2c2. Let w(u) be the third derivative of u5/30 - 9u*2. Determine v(w(x)). 8x*4 Let f(q) = 22q - 12. Let y(m) = 9m - 5. Let w(r) = 5f(r) - 12y(r). Let c(o) = -2o*2 + 3o2 + o2. Calculate w(c(a)). 4a2 Let l(o) be the first derivative of -2o3/3 - 1. Let g(y) be the first derivative of y3 + 7y - 7y - 4. What is l(g(x))? -18x4 Let x(j) = -2. Let l(t) = 38t + 8. Let a(y) = -l(y) - 4x(y). Let z(k) = -3k. Give z(a(p)). 114p Let n(h) = h2. Let s(a) = -3a*2 - 463a - 2. Calculate s(n(q)). -3q4 - 463q*2 - 2 Let u(l) = 131l*2. Let z(k) = 9k. Calculate u(z(b)). 10611b2 Let n(b) = 4b*2 + 3b2 - b2. Let c(y) = y*2. Suppose -43 = -5w + 3g, -w - 4g + 23 = -g. Let x(p) = wc(p) - 2n(p). Let o(u) = u. What is x(o(j))? -j*2 Let j(o) = -o. Suppose 5p = 11 - 1. Suppose 1 = -3v - 2x, 3v = -v - 2x + p. Let d(i) = -3i - 3 + v. Calculate j(d(w)). 3w Let q(z) = -11z. Let t(c) = -43c + 2. Calculate q(t(u)). 473u - 22 Let j(f) be the first derivative of f2/2 + 1. Let q(p) be the third derivative of p4/12 + 2p*2. Calculate j(q(y)). 2y Let d(s) be the first derivative of -s*6/360 - 2s*3/3 - 4. Let u(x) be the third derivative of d(x). Let z(t) = -2t. Calculate z(u(v)). 2v2 Let q(u) be the third derivative of -u6/360 - u3/2 - 3u*2. Let f(b) be the first derivative of q(b). Let y(r) = -3r. What is y(f(n))? 3n2 Suppose 3w - 19 = -3i - 1, 4i + 5w = 28. Let h(c) = -c2 - 2. Let p(q) = 3q*2 + 5. Let g(o) = ip(o) + 5h(o). Let k(x) = x2. Calculate k(g(j)). j4 Let c(o) = -11o. Let w(h) = -7h. Let z(v) = -5c(v) + 8w(v). Let g(p) = 11p*2. Determine g(z(m)). 11m2 Let p(c) = c2 + 3c. Let u(x) be the first derivative of x3/3 + x2 + 1. Let z = 8 - 6. Let l(i) = zp(i) - 3u(i). Let g(b) = -4b*2. Determine g(l(h)). -4h*4 Let z(f) = 5f*2 - 2f - 1. Let k be z(-1). Suppose 3g = -i - k, -2i = -3i - g + 2. Let q(y) = y - iy + 3y. Let x(h) = -h2. Determine q(x(t)). 2t2 Let w(n) = n2. Let f(h) be the first derivative of h*4/6 + 3h - 3. Let s(g) be the first derivative of f(g). Calculate s(w(v)). 2v4 Let f(o) = 28o*2 - 26o - 26. Let r(v) = v*2 - v - 1. Let j(t) = 6f(t) - 156r(t). Let b(x) = 2x. Give j(b(c)). 48c2 Let n(j) = -j2. Let m(y) = -63y*2 + 11y. Determine m(n(x)). -63x4 - 11x*2 Let p(r) = 6r - 8. Let v(t) = -t + 1. Let d(c) = -p(c) + 4v(c). Let w(s) = -s + 1. Let k(l) = d(l) - 12w(l). Let y(a) = -a*2. Give k(y(z)). -2z*2 Let k(b) = -829b. Let q(r) = -r*2. Give q(k(m)). -687241m*2 Let n(s) = -s - 1. Let t(h) = -5h - 6. Let j be 2/((-16)/(-12) + -1). Let a(g) = jn(g) - t(g). Let f(z) = 2 - 2z*2 - 2. Determine f(a(v)). -2v*2 Let x(k) = 2k + 4k - 5k. Let t(n) = -2n. Calculate x(t(q)). -2q Let a(m) = 3m. Let g(b) be the first derivative of -3 + 2b - b*2 + 2b*2 - 6b. Let x(q) = 3q - 5. Let i(t) = -5g(t) + 4x(t). What is i(a(p))? 6p Let c = 4 + 0. Let i(r) = -cr + 2r - 4 + 4. Let n(a) = a + 0 + 0. What is n(i(l))? -2l Let i(y) be the second derivative of -y3/3 + 3y. Let b(h) be the first derivative of h*3/3 - 2. Calculate b(i(s)). 4s*2 Let u(y) = 38y. Let i(m) = -62m2. Determine u(i(b)). -2356b*2 Let c(s) = 9s + 5s + 6s + 7s. Let b(d) = -d2. Calculate b(c(x)). -729x*2 Let m(k) = -k - 8k + 11k. Let u(g) = g2. Determine u(m(b)). 4b*2 Let v(u) = 3u. Let j(l) be the third derivative of -l*5/60 - 11l*2. What is v(j(n))? -3n*2 Let p(s) be the third derivative of 0s*4 + 0 + 1/30s*5 + 0s*3 + 0s + 5s2. Let k(g) = 1 + 2g*2 - 1. Determine k(p(z)). 8z*4 Let l(m) = m. Let k(y) = -2538y*2 + 235y. Let c(u) = -43u2 + 4u. Let i(n) = 235c(n) - 4k(n). What is i(l(o))? 47o2 Let z(k) = -k - 7k - k. Let g(c) = 0c - 2c - c + 5c. Give z(g(r)). -18r Let z(p) = -p. Let h(m) = -11m + 3. Let c(n) = -319n + 88. Let r(b) = 3c(b) - 88h(b). Calculate r(z(o)). -11o Let s(y) be the second derivative of y3/2 + y. Let j(h) be the first derivative of h2 - 17. Give j(s(f)). 6f Let q(l) be the third derivative of -l*4/12 - 7l*2. Let w(a) = 22a. Determine w(q(o)). -44o Let v(u) = -2u. Let k(t) = -1471t2. Calculate v(k(d)). 2942d*2 Suppose -19 = -5k + 11. Let o(y) = -5y2. Let b(r) = -r2. Let v be (-6)/21 - (-30)/(-42). Let f(m) = kb(m) + vo(m). Let d(j) = -2j. Give f(d(s)). -4s2 Let g(n) = n2. Let k(u) = 10u*2 - 590. Calculate k(g(t)). 10t*4 - 590 Let b(w) = 3w2 - 5. Let y(q) = q2 - 1. Let h(v) = b(v) - 5y(v). Let t(z) be the second derivative of -z3/3 - 51z. Calculate t(h(x)). 4x2 Let d(l) be the third derivative of l6/360 + 2l*3/3 - 3l2. Let i(z) be the first derivative of d(z). Let f(v) = v. What is i(f(s))? s2 Let r(n) = 2n. Let i = -12 + 14. Let b(u) be the first derivative of 0u*2 + i + 2/3u*3 + 0u. Give b(r(x)). 8x2 Let h(b) = b2. Let s(k) = 230k. What is s(h(p))? 230p2 Let s(n) = 3n*2. Let i be 18/12 - (-2)/4. Let c(j) = -6j2 + j2 + 6ji. Calculate c(s(w)). 9w*4 Let b(w) = 106w2. Let l(g) be the second derivative of -g4/6 + 26g. What is l(b(p))? -22472p*4 Let d(w) = 2w. Let a(n) = -n*2 + n - 1. Let o(p) = -44p*2 - 3p + 3. Let h(u) = -3a(u) - o(u). Determine d(h(m)). 94m2 Let f(p) be the third derivative of p6/120 - p*3/3 - 2p**2. Let c(m) be the first derivative of f(m). Let t(s) = s. Calculate t(	{ "pile_set_name": "DM Mathematics" }
261 + -1269. What is p(w)? -24 Let n(m) = 4m - 20. Suppose 0 = -45j + 47j - 22. Determine n(j). 24 Let d(p) = -p3 + 3p*3 - 58 - 3p*3 - 23p - 366p2 + 345p*2. Calculate d(-20). 2 Let r(j) = -4j + 55. Let s be r(8). Suppose 16y - sy + 7 = 0. Let c(i) = 4i3 - i. What is c(y)? 3 Let b = -11 + 8. Let s(c) = c3 - 3c*2 - 16c + 51. Let h be s(4). Let a(o) = -2o2 + 2o + 2o + ho*2 - 3o. Determine a(b). 6 Let a(c) be the third derivative of -c6/240 + c4/3 + 146c2. Let f(v) be the second derivative of a(v). Calculate f(-2). 6 Let h(u) = -4u + 16u - 30 - 2u - 123 - 6u. Calculate h(38). -1 Let x(a) = 43 + a2 + 15 + 4a - 19a - 10. Calculate x(10). -2 Let f(h) = -3410h*2 + 1700h*2 - 8h - 13 + 1709h2. Determine f(-7). -6 Let q(k) = k2 + k - 16. Suppose -8 = -2v + 4v. Let s be v - (8-1 - -2). Suppose -sm + 7m = 0. What is q(m)? -16 Let m(z) = -6z. Let f be m(1). Let h(j) = -j + 5j + 2 + 2. Let o(n) = -3n - 4. Let q(i) = -5h(i) - 6o(i). What is q(f)? 16 Let z(k) = k3 - 23k*2 + 2k - 10. Let q(h) = -2h3 + 48h*2 - 5h + 20. Let t(y) = -2q(y) - 5z(y). Give t(19). 10 Let m(x) = -x*2 - 18x - 61. Let u be m(-5). Suppose uj - 2i - 3i = 19, -25 = -5i. Let p(d) = 2d2 - 21d - 8. Give p(j). 3 Let t(m) = -12m + 92. Suppose -976 = -72b + 37b - 87b. Determine t(b). -4 Let v(s) be the second derivative of -s6/360 + s5/24 + s*4/8 + 29s*3/6 + 2s - 11. Let x(p) be the second derivative of v(p). Give x(5). 3 Suppose 25y + 93 = 968. Let p(i) = 11i + 14i + 9i + 2 - yi. Suppose 4n = 2n + 5r + 25, -3n = -5r - 25. Give p(n). 2 Let u(l) be the first derivative of -l*3/3 + 5l*2 - 16l + 40. Determine u(7). 5 Let a(b) = -10b + 117. Let o be a(12). Let c be (20/60)/(1/o). Let s(r) be the second derivative of -r3/3 + r2/2 + 2r. What is s(c)? 3 Let u(t) = -2t2 - 2t - 2. Suppose -83k = 2h - 82k - 6, 0 = 4h - k + 6. Determine u(h). -2 Suppose 4 = -2o - 0b - 2b, b = -5o - 10. Let a(m) be the third derivative of -m*2 + 0m + 1/30m5 + 0 - 1/6m*3 + 1/120m*6 - 1/12m4. What is a(o)? 3 Let s(i) = -i3 + 13i2 + 15i - 2. Let n(q) = q*3 + 29q*2 + 23q - 126. Let y be n(-28). What is s(y)? 12 Let z(j) = 0j - 73 - 48 - 34j + 18j - 52. Give z(-10). -13 Let b = -1432 - -1435. Let g(a) = -2a*3 + 7a*2 + a - 6. Give g(b). 6 Let o(f) = -2f*3 + 7f*2 - f - 19. Let z be (-6564)/(-11487) - (178/(-56) - (-2)/(-8)). Give o(z). -39 Let l = 87 - 79. Suppose 18h - 10 = lh. Let r(p) = -h + 0p - 4 - 5p + 1. Determine r(-5). 21 Let n(x) = -x3 + 2x*2 + 4x - 5. Let j be (-1 - -1)/(7/((-7)/(-2))). Give n(j). -5 Suppose 3p = 8p + 11p. Suppose 3d - i + 10 = p, d - 3i + 17 - 3 = 0. Let s(q) = -q2 - q + 1. Determine s(d). -1 Let z be (-2330)/(-6524)14/60. Let n(p) be the third derivative of -1/6p3 - 5/24p*4 + 0 - 18p*2 - zp*5 + 0p - 1/120p6. Give n(-4). 3 Let k(y) be the second derivative of 5y*4/12 - 2y3/3 + y2 - 17y + 91. Suppose -4l + 11 = 3. What is k(l)? 14 Let s(n) = n*3 - 3n*2 - 3n + 7. Let k be 26/7 - (-17)/((-595)/(-10)). Calculate s(k). 11 Let y(b) = -b*2 + 4b + 55. Suppose -2t = -3q + 4, 10q = 3t + 5q + 10. Calculate y(t). -5 Let k(m) = 3m*3 - 16m*2 - 10m - 67. Let q(c) = -14c3 + 63c*2 + 35c + 272. Let x(r) = -9k(r) - 2q(r). What is x(-17)? 8 Let a(i) = 10i - 53i*3 + 3 + 29i*3 + 9i*3 + 16i*3 - 9i*2. Give a(7). -25 Let x(j) = 31j + 30. Let u(i) be the second derivative of -7i3/3 - 15i*2/2 - 3i - 4. Let l(w) = -9u(w) - 4x(w). Determine l(-11). -7 Let l(a) = -22a - 251. Let q(y) = -42y - 500. Let t(i) = -11l(i) + 6q(i). Let o be t(-23). Let p(u) = -u - 7. What is p(o)? 2 Let d(c) = -20c + 15. Let j(g) = 26g - 181. Let q be j(7). Determine d(q). -5 Suppose 0 = 4y - 7 - 1. Let t(f) = -y - 8f*2 + 1 + 15f*2 + 6f*2. Suppose -217u - 632 + 415 = 0. Give t(u). 12 Let i(h) = -h + 5. Let s be i(5). Let c(t) = -t3 - t2 - 2t + 19. Let x be c(s). Suppose 0 = 14r - xr - 65. Let n(o) = o + 11. Calculate n(r). -2 Let u(z) = 13 - 150 + 22z + 395 - 10. Give u(-11). 6 Let d(n) be the first derivative of -7n3/3 - 64. Suppose -2 = -18g - 20. What is d(g)? -7 Let n(i) = -3i3 + 23i*2 + 27i - 31. Let g(v) = -2v3 + 12v*2 + 14v - 15. Let k(u) = -5g(u) + 3n(u). Give k(-7). 3 Suppose -4a + 30 + 150 = 0. Suppose -5p + a + 0 = 0. Let o(s) = -s*2 - 5s + 109s - 94s. Give o(p). 9 Suppose 0 = -35u + 13u - 88. Let b(a) = -3a3 - 97a*2 - 23a - 32. Let p(q) = q*3 + 34q*2 + 8q + 11. Let t(f) = 6b(f) + 17p(f). Give t(u). 3 Let k(q) = -270q + 530q - 265q + 27. What is k(19)? -68 Suppose t = -3, -109 = 3u - 5u + t. Let p = u + -56. Let m(s) = -2s - 1. Determine m(p). 5 Let d be (1 - 55/33)/(2/(-3)). Let x(w) = 61w3 + w2 - 4w + 2. What is x(d)? 60 Let a(g) be the first derivative of 11g4/4 + g2/2 + g - 704. Give a(-1). -11 Let u(i) = 119i*3 - 45i*2 - 104i - 332. Let q(f) = -23f3 + 9f*2 + 21f + 67. Let c(g) = -31q(g) - 6u(g). Determine c(-7). 6 Let m(c) = 4c + 203. Let h(y) = -y + 34. Let p(s) = -6h(s) + m(s). Give p(-2). -21 Let v(n) = n + 19. Suppose -2l - 134 = 4x, 12x + 65 = 11x - 5l. Determine v(x). -11 Let c(n) = 13n*2 + 7n - 6n2 + 2 + 9n*2 - 15n*2 + 0. Suppose 7j + 10 = 2j. Let a be j/6 + 20/(-3). Determine c(a). 2 Let m = -108 - -103. Let u(p) = p3 + 14p2 + 8. Let r(c) = -c3 - 17c2 + c - 9. Let q(v) = -3r(v) - 4u(v). Calculate q(m). 10 Let d = -3766 - -3770. Let k(o) be the third derivative of 0o + 1/24od - 2o*2 + 0 + 1/2o3. What is k(-5)? -2 Let u(a) = -a3 + 6a2 - 9a + 59. Suppose -5i - 15 = 0, 36 = 5z - 0z - 2i. What is u(z)? 5 Let p(k) be the third derivative of k6/120 - k5/12 + k4/24 + k3/2 + 12k2. Let y be (99/36)/1112. Give p(y). -12 Let j(x) = -x. Let f(m) = 8m + 2. Let p(h) = f(h) + 6j(h). Suppose 3q + 1 = 7. Suppose o - 2o - q = 0. Calculate p(o). -2 Let k(c) = -c*2 - 9c - 18. Suppose 103a = 6 + 5 - 11. Calculate k(a). -18 Let x(g) = -2g*2 + 96g - 79. Let v be x(47). Let u(r) = r*3 - 16r*2 + 18r + 4. Give u(v). 49 Let s = -28 + 30. Let o(b) = -sb2 - b2 - 3 + 2b + 1 + 0. Let n(y) = y*3 - 21y*2 + 22y - 37. Let g be n(20). Determine o(g). -23 Let q(x) be the first derivative of -x*2/2 - 2x - 1. Let s(i) = 34i3 + i2 + i. Let t be s(-2). Let f = 265 + t. What is q(f)? 3 Let h(v) be the second derivative of v3/2 - 5v*2/2 - 959v. What is h(19)? 52 Let b(i) = -i + 1. Let t(a) = -a*2 - 4a + 4. Let w(y) = 2b(y) - t(y). Let o be (-116)/30 - (-6)/(-45). Determine w(o). 6 Let a be 186/7 + (-51)/(-119). Suppose -ad = -35d + 8. Let v(q) = 2q. Let u(j) = -j. Let l(f) = 2u(f) + 3v(f). Give l(d). 4 Suppose 0 = 4t - 19 - 13. Let u(f) = -55f*3 + 13f*2 + 13f - 3. Let j(k) = 46k3 - 12k*2 - 12k + 2. Let y(i) = -6j(i) - 5u(i). Calculate y(t). -5 Suppose 5a - 4h - 190 = 90, -3a = -5h - 181. Suppose 4i + 44 - a = 0. Let s(y) = 3 - y - 5 + 3y + 3y3 - 4y*3 - 7y*i. Calculate s(-7). -16 Let d(n) = n + 5. Let c be d(-4). Suppose 0q - q - 17 = 5w, 0 = -2q + w + 10. Let u(m) = 57m3 + 70m*q + 3m*2 - 110m3 - m - m2. What is u(c)? 18 Let r(c) be the third derivative of 11c5/60 - c4/8 + 2c*3 - 7c*2 + 3c. Let q(k) = 9k2 - 3k + 10. Let y(t) = -6q(t) + 5r(t). Determine y(-3). 0 Let t(n) = n*2 + 2n. Let f be t(-5). Suppose b = 6b + f. Let o(g) = 6 - 12 + 4g2 + g3 + 5g + 6 + 4. What is o(b)? -2 Let n(r) = -3r. Let m(c) be the first derivative of c*3/3 - 3c*2 + 9c + 242. Let a(i) = -m(i) - n(i). Determine a(7). 5 Let s(u) = -4u2. Let i be -5(4 + (5 - 6/3)). Let z = -24 - i. Suppose zq = 10q + 1. Give s(q). -4 Let l = -397 - -399. Let z(n) = 56n - 15n - 11n + l - 17n - 10n. Let j(y) = y + 1. Let r be j(-6). Calculate z(r). -13 Let w(o) = o3 + 14o*2 + 14o - 6. Suppose 19s - 20s + 2v - 7 = 0, -s - 10 = -v. Give w(s). -19 Let m(c) = 6c*2 - 10c - 4. Let y be 4/810 + -10. Let q(f) = -5f*2 + 8f + 3. Let s(x) = yq(x) - 4m(x). Determine s(-1). 2 Suppose 16l - 4 = 17l. Let g be (-3 - (l + 1))*9/9. Let c(r) = 3 - 1 + 4 - r. Give c(g). 6 Suppose -q + h - 6 = 4, 0 =	{ "pile_set_name": "DM Mathematics" }
+ d. Is s(g) composite? False Let i(f) = -7f3 - 3f*2 - 2. Let x be i(-3). Suppose 4s + b = 154, s - 4b = 5s - x. Is s a prime number? False Let q(y) = -y*3 - 3y*2 - 4y - 2. Let o be (-6 - -4)7/2. Let w = 4 + o. Is q(w) prime? False Let w = 14 - 14. Suppose 0u + 5u - 385 = w. Is u composite? True Suppose -3u = -7u - b - 12, 0 = -3u + 3b - 9. Let j(t) = 10t*2 - 2t - 5. Is j(u) a composite number? True Let o(l) = 2l2 + 4l - 5. Let x be o(-4). Suppose 4z = 13 + x. Is 1 + z/(-2) + 13 a composite number? False Let g = -1 - -3. Let j be -6(-1)/g-1. Is (1 + j)/((-4)/190) composite? True Let t(d) = 6d*2 + d - 2. Let h be t(-5). Let y = h + 0. Is y composite? True Let p = -6 + 18. Suppose -4t = -64 - p. Is t a prime number? True Let y = 3 - 17. Let p be -3(-3 - y/6). Suppose -5w - 2g - pg = -449, 0 = w - 3g - 105. Is w composite? True Let q = 10 - 5. Suppose 0 = qh + 5b + 10, 3h - h - 21 = 3b. Suppose -hl + 14 = -28. Is l a composite number? True Let j be 2 + ((-1)/(-1) - 1). Is (-30 - 7)/(j/(-10)) a prime number? False Suppose -4a + 3 = -a. Suppose 0 = -5g + 34 + a. Is g composite? False Suppose -5b - 10 = -5v, 2v = b + 4b - 5. Suppose 9 + 51 = vl. Is 23/l22 composite? False Let i(s) be the first derivative of s2 - 5s - 2. Is i(9) a prime number? True Let a(s) = -14s - 4. Let i(f) = 7f + 2. Let k(p) = 2a(p) + 5i(p). Let z be k(5). Suppose -3x + z = -74. Is x a prime number? True Let k be (4/3)/(6/9). Is 316/105/k composite? False Let z = -207 + 896. Is z composite? True Let p = -769 - -1460. Is p a composite number? False Let m be 2/33 + 2. Suppose -2n + 168 = -3i - i, -n = -mi - 74. Let d = n + -43. Is d a prime number? False Suppose 1835 = 3f + 2r, 5r + 13 = 3. Is f prime? True Let d be 1-2 + (3 - -11). Suppose u - d = 2o, -4o - 10 = -u + 6u. Suppose -82 = -2s - 4z, -6s - uz = -s - 181. Is s a composite number? True Let t = 2191 + -1150. Is t a prime number? False Let n(q) = -q + 5. Let c be n(3). Let z be (-1 - -67)/c3. Let j = 190 - z. Is j a composite number? True Let s(d) = d + 11. Let v be 10(1 - 0)/(-1). Let x be s(v). Is 0 - -1204 - x prime? False Let t = -5 - -13. Suppose tn = 11n - 417. Is n a composite number? False Let l = 52 - 82. Let p be 53/(l/(-8)). Suppose 40 = pn + 2m, 26 = n + n - 2m. Is n a prime number? True Let r be -2(-2)/86. Suppose -5i + 335 = -5d, -rd + 278 = 4i - 2d. Is i a prime number? False Suppose -w + 3685 = 3p - 0w, -4p - 3w + 4920 = 0. Is p a composite number? True Suppose -4x = -3m - 0m + 293, x + 97 = m. Is m a composite number? True Suppose 2a - 5f = 11, -2f - 14 = -5a + 3a. Is 2/(a/(-3820)-5) a prime number? True Suppose -2 = q - m - 1, q + 4m = 19. Let d = 11 + q. Is d prime? False Let w = -2754 - -6125. Is w composite? False Let z(t) = 5t*3 + 5t*2 - 2t - 13. Is z(4) composite? False Suppose 3m + 3 - 6 = 0. Let a(f) = 2f - 4f + m - f2 - f + 2f*2. Is a(5) composite? False Let i be 537/(-6)-12. Suppose -2n = n + 2w - i, -110 = -2n + w. Is n a prime number? False Suppose 0 = 6r - 2346 - 768. Is r composite? True Suppose 0 = -5m + 317 + 468. Is m a prime number? True Let c = 2 - -1. Is (69/(-4))/(c/(-28)) prime? False Suppose 0l + 4l - 436 = 0. Let y = 6 + l. Is y a prime number? False Let m = -12 + 26. Is (1028/6)/(m/21) composite? False Suppose 0b = -4b + 2560. Suppose -7z + b = -2z - 3s, -2z = 2s - 272. Is z a prime number? True Let v = 835 - -1314. Is v a composite number? True Let k be 1 - (3 - (-927)/(-3)). Suppose 0l + l - k = 0. Is l a prime number? True Let u = -28 + 20. Let z = u - -15. Suppose 7 + z = 4s + 5f, -5f = -4s + 34. Is s prime? False Let k(s) = 8s + 4s + 1 - 8. Suppose 0 = 3i - 4y + 1, -21 = i - 2i - 4y. Is k(i) prime? True Let r(n) = 2n2 - n - 16. Is r(-13) a composite number? True Suppose 3t = -2t + 3305. Suppose -206 = -2l + 5k, 5l - t = -2k - 88. Is l prime? True Suppose -y + 1041 = 3g - 0y, 3g - 3y - 1041 = 0. Is g composite? False Is ((-977)/(-4))/(5(-4)/(-240)) prime? False Let c = 585 + 1514. Is c composite? False Is 1262/(-3)(-4)/(40/15) composite? False Let f be (-56)/(-9) - 2/9. Let a be (-40)/f(-72)/16. Let v = a - -5. Is v a composite number? True Let l = 129 - 64. Suppose -3b + 4r + l = 0, -b - 2r - 3r = -28. Is b composite? False Let z = -3 + 7. Let y be z/(-14) - 4689/(-21). Suppose a = 3k + y, -2a - 2k = -k - 418. Is a composite? False Let w(c) = c2 + 6c + 2. Let h(l) = l*2 - 8l - 4. Let u be h(8). Let z be w(u). Is z/42286/(-27) prime? True Let k(v) = 6v*2 - 1. Let d be k(-1). Suppose 0 = 5t - 3i - 482, 104 + 192 = 3t + di. Is t a composite number? False Suppose -9f + 2645 = -16786. Is f composite? True Suppose -5f + 7 = -13. Suppose -5l + 25 = 5a, fl - a = 4a - 7. Suppose t + 9 = -0q - 3q, 2q - l = -2t. Is t composite? True Let r(d) be the third derivative of -d4/24 - 2d*2. Let k be r(-2). Suppose 5g - 111 = kc, 0 = -4g - 4c + 31 + 69. Is g a composite number? False Suppose 3w = -693 - 315. Let x = w - -650. Is x prime? False Suppose 4y = m - 0m + 4796, 0 = -5m - 20. Suppose 3c - y = -319. Is c composite? False Let r(d) = -d + 3. Let k be r(5). Let h(c) = -28c - 3. Is h(k) prime? True Let l(i) = i - 7. Let v(r) = r - 8. Let f(q) = -3l(q) + 4v(q). Let d be f(0). Let x = 22 + d. Is x prime? True Let m(h) = -h + 1. Let a be m(-1). Let r(y) = 39y - 1. Is r(a) prime? False Suppose -5l + 2a = 3a - 15, l = 5a + 3. Suppose -5w + 68 = -lw. Is w a composite number? True Is 25180/24 + (-1)/6 composite? False Let f(d) = d*3 + 8d*2 - 7d - 5. Let s(l) = 2l3 + 17l*2 - 14l - 9. Let t(i) = -7f(i) + 3s(i). Let h be t(-6). Suppose 0b = -hb + 8. Is b composite? True Let z = 345 - 92. Is z a composite number? True Let j(r) = 35r - 4. Let h(x) = 71x - 9. Let l(a) = -4h(a) + 9j(a). Let m be l(-3). Is (-6)/93 - m composite? True Suppose 2v + 0v = -12. Let i = -3 - v. Suppose 0 = h + ih - 268. Is h prime? True Let c(z) = 10z3 + 2z - 1. Let v be c(1). Let j be ((-4)/(-6))/((-2)/(-108)). Let b = v + j. Is b a composite number? False Let y(v) = -38v2 + 20v - 2. Let x(l) = 13l2 - 7l + 1. Let s(q) = -11x(q) - 4y(q). Is s(-2) prime? False Let b(q) = q*3 + 8q*2 - 2q - 3. Let a be b(-5). Suppose 15 = -j + a. Is j a prime number? True Suppose 0 = -m - 5 + 3. Is -2 - 2m - -407 prime? True Let w(a) = -70a*3 - 2a*2 + 4a - 5. Let i be w(2). Let b = -371 - i. Is b a composite number? True Is (-12)/(-4) + -6 + 2 + 38 prime? True Let n be (2/(-6))/((-3)/36). Suppose 2t = w + 64, 0t - nt + 3w = -130. Is t a prime number? True Let s(w) = -5w2 + 2w - 2. Let b(o) = -6o2 + 2o - 3. Let t(u) = 3b(u) - 4s(u). Is t(-5) a prime number? True Let l be (-15)/6 + 1/2. Is (47/(-2))/(1/l) composite? False Suppose 1224 = 5p - 2141. Is p a composite number? False Is (-4)/16 - 573/(-4) a prime number? False Is (892/6)/((-2)/(-12)4) a composite number? False Let p(w) = w*2 + 5w - 6. Suppose -16 = f - 5q, -3f - 10 = q + 3q. Let n be p(f). Suppose 2y = -3d - nd + 100, -5d = -2y + 116. Is y prime? True Is -1146(-1)/8 - (-4)/(-16) prime? False Let t(w) = 19w2 + 1. Let b(q) = q3 + 2q2 - 1. Let k be b(1). Is t(k) a composite number? True Let t(q) = 2q - 7. Let m be t(6). Suppose -2h - 46 = -u + h, 5u = mh + 200. Suppose 5o + 3z + 0z - 90 = 0, u = 2o + z. Is o a prime number? False Let p = 13 - -42. Is p composite? True Suppose -26 = 3z + 247. Let b = 188 + z. Is b a prime number? True Let h(y) be the third derivative of y*4/24 + 13y3/6 + y2. Let f(g) = -g*3 + 6g*2 - 2g + 12. Let k be f(6). Is h(k) prime? True Let z(g) = 52g2 + 4g + 5. Is z(-2) composite? True Let t(n) = -n*3 + 21n*2 - 17n + 5. Is t(20) composite? True Suppose 0 = n + n - 4. Let w = 2 - n. Suppose 265 = 5z - 3x, wz + x - 265 = -5z. Is z prime? True Let k be (-42)/(-8) + 2/(-8). Suppose kl = 4 + 21. Suppose 0 = 2c + lr - 17, -2r + 10 = c + 1. Is c a prime number? True Let b = 0 + 46. Is b a composite number? True Suppose -1 = -3t + 2, 2c - 1387 = -5*t. Is c composite? False Is (-27 - -24) + 0 + 430 a composite number? True Let t = 9 - 6. Let d = -11	{ "pile_set_name": "DM Mathematics" }
q). -1 Let v(n) = -n*3 - 9n*2 + 2n - 17. Let m(d) = d*3 + 8d*2 - d + 14. Let k(i) = -5m(i) - 4v(i). Give k(-3). -2 Let r(c) = -c3 + 5c2 - c + 3. Let i(p) = -p2 + 3p - 3. Let v be i(5). Let t = -13 - v. Let l = 5 - t. Calculate r(l). -2 Let r(n) = 5n*2 + n + 10. Let k(s) = 4s*2 + 9. Let h(b) = 6k(b) - 5r(b). Give h(-4). 8 Suppose -1 = -2d - v, -5 = 3d - 5v - 0. Let t(z) be the first derivative of z3/3 + z2/2 - 3z - 3. Determine t(d). -3 Let f(x) = 9x + 11. Let u(m) = -5m - 6. Let y(k) = -3f(k) - 5u(k). What is y(6)? -15 Let d(o) = -o. Let k(f) = 2f + 3. Let q(z) = d(z) + k(z). Suppose -2t - 46 = 4v, -17 = 5t + 8. Let h be (0 - -3)12/v. Calculate q(h). -1 Let u(c) = -2 - c - 5 + 15. Calculate u(3). 5 Let t(a) = a - 2. Let i be t(5). Let v = -3 + i. Let m(u) be the second derivative of u5/20 - u4/12 + 13u2/2 + 93u. What is m(v)? 13 Let i = 10 + 45. Suppose -5g - 5n = i, 20 = -6g + 2g + 4n. Let j(u) = -u3 - 9u*2 - 8u + 6. What is j(g)? 6 Suppose 132 = -3q - 8q. Let x be 4/q + (-76)/(-12). Let l(r) = -r*2 + 6r - 8. Give l(x). -8 Suppose -5r + 5t = -20, -3t + t = 2r. Suppose 9 + 13 = 11f. Let d(z) = -11 + fz + 0z - z - rz. Calculate d(0). -11 Let g(y) = 19y - 226. Let m be g(12). Let u(w) = 2w3 - w2 - 3w - 2. Give u(m). 4 Let i(w) = 2w*2 - 6w + 1. Let p(k) = 3k2 - 6k - 3. Let j(d) = 4i(d) - 3p(d). What is j(-6)? 13 Let m be (-4)/(-22) + (-124)/(-44). Let q be (-1 + m)7/(-14). Let f(z) = 8z*2 + 2z + 1. Give f(q). 7 Suppose 4i - 6 = i. Suppose iu - m = -24, 18 = -3u - 3m - 0m. Let d(c) = c3 + 10c2 + c + 1. What is d(u)? -9 Let i(f) = -f + 9. Let m be (3 - 3) + 1 + 6. Let r be i(m). Let a(q) be the second derivative of -q4/6 + q*3/2 - 3q2/2 - q. Determine a(r). -5 Let i(m) = m3 - 2m2 - 7m + 6. Let d = -4 + 5. Suppose 0 = -5o - d + 21. Suppose os + 2 + 2 = 0, -5s = 2p - 3. Calculate i(p). 10 Let x(n) be the first derivative of -n*2/2 + 6n + 1. Let i = 616 + -608. Calculate x(i). -2 Let y(x) = x*3 - 3x + 1. Let u be y(2). Suppose p + 0p = u. Let q(l) = l2 - 5 - pl + 4 + 0l2 - 2l*2. Calculate q(-2). 1 Let q be (-2)/7 + (-72)/42. Suppose 2o = -2 + 30. Let n(u) = 13u2 + 0u - ou2 - 5u - 3. Give n(q). 3 Let n(a) = a3 + a2 - 3a + 3. Let f be n(-4). Let y = -24 - f. Let m be 20/40(y + 1). Let j(s) = s*2 - 6s + 3. What is j(m)? -2 Let s(p) = -13p2 + 55p - 143. Let j(u) = 7u2 - 28u + 71. Let t(y) = -11j(y) - 6s(y). Determine t(17). -8 Suppose b - 6b - 5 = 0. Let n(r) = -r2 + 2r + 1. Let w be n(b). Let t(i) = -i - 2. Give t(w). 0 Let u(y) = -2y - 3y + y + 3 - 2. Let s be u(2). Let a(i) = -2i2 - i - 2. Let w(n) = 9n*2 - n + 10. Let o(x) = 5a(x) + w(x). Determine o(s). -7 Let i(w) = 841w2 - 31 + 849w*2 - 1691w*2 - 27w. What is i(-26)? -5 Suppose 2y - 10 = 7y, i + 1 = -3y. Let d(j) = -j2 + 7j - 6. Give d(i). 4 Let s(z) be the first derivative of z5/20 + z4/8 + 6z3 + 30. Let f(l) be the third derivative of s(l). Give f(-2). -9 Let z be 30/(-70) - 36/14. Let x(o) = 0o + o*2 - o - 1 + 4o + o*3 - 4o. What is x(z)? -16 Let o(t) be the third derivative of t5/120 + t4/12 - 17t3/3 + 10t2. Let c(g) be the first derivative of o(g). What is c(-5)? -3 Let b(g) = g3 - g + 1. Let a(u) = u*3 - 15u*2 - 3u*3 + 19u*2 + 5u - 2. Let c(o) = a(o) + 3b(o). Suppose -3k = 13 - 4. Give c(k). 4 Let q(i) = i*2 + 3i. Let c(j) = -j*2 - 13j - 7. Let v be c(-12). Suppose 5l + 3m - 7m + 24 = 0, -vl - 22 = -2m. Calculate q(l). 4 Let p(w) be the third derivative of w4/8 + w3/6 + 335w*2. Determine p(-4). -11 Let g(a) be the second derivative of 16a + 0 - 1/2a2 - 2/3a*3. Determine g(4). -17 Let p = 35 - 36. Let d be 0/p + -3 - 1. Let j(c) = -4c - 4. Calculate j(d). 12 Let d(b) be the second derivative of 19b6/360 + 37b*3/6 - 32b. Let u(n) be the second derivative of d(n). Calculate u(1). 19 Let p(m) be the second derivative of -m6/120 + m5/12 - m4/12 - m3/2 - 7m2/2 + m. Let n(k) be the first derivative of p(k). Calculate n(4). 5 Let s(i) = -13i2 - i3 - 6 + 4i3 - 23i + 24i - 2i*3. Suppose -v = 2w - 2v - 26, -v = -5w + 65. Calculate s(w). 7 Let w(y) = y - 6. Let l be w(9). Suppose m + 0m = -2o + 11, -3m + l = -4o. Let r(q) = q - 5. Give r(m). 0 Let q(f) be the second derivative of -f*5/20 - 5f4/12 - f3/6 - 3f2/2 - 3f. Let c = -31 - -27. Determine q(c). -15 Let o be 0/(2/(-5)-5). Suppose t - 21 = -4p, -p - 5t + 2 - 11 = o. Let c(k) = k3 - 7k*2 + 5k - 5. Determine c(p). -11 Let s(o) = -2o2 + 2o + 6. Let d be s(3). Let g(b) = -b*3 - 7b*2 - 5b + 2. Let p be g(d). Let z(f) = 2f2 + 5f - 4. Calculate z(p). 8 Let p(g) = -g3 + g2 + 1. Let f be (-2)/4(-128)/(-16) - -8. Suppose c - 3 + 2 = 0. Suppose b + 4j - f = -b, -c = -j. Calculate p(b). 1 Let x = -1 + 1. Suppose -4o - 7 = -4f - o, f + 7 = -o. Let k be x + -4 + (7 - f). Let m(d) = -d*3 + 5d*2 - 2d - 4. Calculate m(k). -14 Let k(t) = -t2 + t + 6. Let v(x) be the third derivative of -x5/60 + x4/24 + x3 + 21x2. Let n(r) = -7k(r) + 6v(r). Determine n(0). -6 Let x(g) = 13 + 11g + 16g + 12g - 38g. Determine x(-6). 7 Let j(c) = -c3 + 13c*2 + 10c + 12. Let w(t) = t*2. Let n(o) = j(o) - 5w(o). What is n(9)? 21 Let y(f) = -2f3 + 5f - 1. Let d(g) = -g3 + g2 + 2g - 1. Let q(a) = 3d(a) - y(a). Calculate q(3). 1 Let a(i) be the first derivative of -i*3/3 + 11i*2/2 - 20i + 295. What is a(7)? 8 Let g(i) be the third derivative of -1/6i3 + 0i + 1/60i5 + 1/3i4 + 0 - i2. Let o = -3935 - -3929. What is g(o)? -13 Let r(x) = 2x + 31. Let h(j) = -3j - 48. Let f(n) = 5h(n) + 8r(n). Calculate f(-12). -4 Let m(l) = -l*2 - 5l + 41. Let g be m(4). Let q(z) be the second derivative of 7/2z2 + 1/20z*5 + 0 - 7/12z4 + z3 - gz. Give q(6). 7 Suppose -3q + 19 + 16 = -4z, 53 = 5q - 4z. Let a(w) = w3 - 10w*2 + 6w + 7. Determine a(q). -20 Let k be (-54)/4(-20)/15. Suppose k = 4i + 2i. Let a(l) = -l3 + 4l2 - 2. Give a(i). 7 Let g be 6 - (4 + -2 - 1). Let r(y) = 1 + y2 - gy + y + 1 + 0y. Calculate r(3). -1 Let l(o) = o - 2. Let f be l(7). Let x(n) = 4n + 2n - fn - 3. Give x(5). 2 Let x(o) = 1. Let a(v) = v + 7. Let g(y) = a(y) - 6x(y). Let d(h) = h + 1. Let c(l) = 3d(l) - 2g(l). Determine c(-5). -4 Let x(m) = 8m - 3. Let l be x(1). Let b(h) = 29h*2 - 27h*2 + 1 + lh - 3. Suppose 10 = -3k + 2k - 3s, 5k - 5s = -10. What is b(k)? 10 Let p be 2/(-17) - ((-95)/85 + -4). Let l(u) = 0u + 2 + 5u - 3u. What is l(p)? 12 Let y(a) = -32a2 - 24a*2 + 60a*2 + 1. What is y(1)? 5 Let v = 13 - 8. Let i(f) = 5f - 6f + v - 8f*2 - 4. Let d be (-9)/(45/(-20)) + -3. What is i(d)? -8 Suppose 174 = -30o - 6. Suppose 5h + 2 = 27. Let q(j) = j3 - j2 + 1. Let p(w) = 6w*3 - 6w + 5. Let l(t) = hq(t) - p(t). Calculate l(o). 0 Let x(j) = -j3 - 4j*2 - 3. Let m be ((-1)/3)/(5/(-135) - 0). Let p = 5 - m. Give x(p). -3 Let i(s) = -2s - 11. Let y(v) = -3v - 9. Let b(q) = 4i(q) - 3y(q). Determine b(12). -5 Suppose 4b = 25 - 5. Let j(n) = n - 3n - 9 + 10 + n. Determine j(b). -4 Suppose 2f + 4 = 16. Let d = -13 + f. Let b(q) be the first derivative of -q*2/2 - 4q + 3. What is b(d)? 3 Let z(p) = p + 5 - 8p + 0 + 6p. Let y be z(2). Suppose yr - 12 = 3. Let k(w) = -w3 + 4w*2 + 4w - 1. Calculate k(r). -6 Let d = -731 - -737. Let m(x) = x*2 - 15x + 2. Determine m(d). -52 Suppose -3 = -23r + 20r. Let v(o) = -10o2 + o. Let w(h) = 21h*2 - 2h. Let u be -5 + (4 - 2 - 4). Let p(s) = uv(s) - 3w(s). Determine p(r). 6 Let u(f) = -3f + 10. Let q(m) = m3 - 4m*2. Let j be q(4). Calculate u(j). 10 Let r(y) = -3y - 46. Let h(n) = -2n - 25. Let c(f) = -7h(f) + 4r(f). Suppose -4b + 7u = 3u - 16, -4u = 5b - 38. Calculate c(b). 3 Let m be ((-8)/6)/(4/18). Let l(f) = -f - 1. Let d(p) = 7p + 4. Let k(q) = ml(q) - d(q). Determine k(5). -3 Let m(j) = 2699310j + 1 + 5j*2 - 2699310j. Let u = 3 + -4. Give m(u). 6 Let i(a) = 1112a + 4 - 1116a - 1. What is i(6)? -21 Let q(v) = 3v + 7. Let t be q(-6). Let n(s) = s3 + 11s*2 - s - 11. Let l be n(t). Let g(u) = -u + lu + 3u	{ "pile_set_name": "DM Mathematics" }
e (3 - 3 + 2)(2w - 3 + 3 + (2w - w - 3w)(-2 + 0 + 0) + 4 - 4 + 2w - 3w + w + 0w + (1 - 2 + 5)(2 - 3w - 2) + w + 1 - 1) to c + hw and give h. -10 Rearrange -5h*3 + 244h - 244h + 64 - h3 + 14h*3 to ih + xh2 + mh*3 + t and give t. 64 Rearrange (19r*2 - 77r + 77r)(1831 - 900 + 1641r - 931) to the form kr*3 + d + xr + ur2 and give k. 31179 Rearrange (-4o - 6o + 5o)(-177o - 62o + 79o)(-4 - 2 + 2) to the form x + io + so2 and give s. -3200 Express (-8w*2 + 21w*2 + 7 - 3 + 53w*2)(-257 - 15w2 + 257) in the form l + bw*2 + zw + dw4 + xw*3 and give b. -60 Express -19w*2 - 5w*2 - 4 - 12 + 12w + 22 as dw2 + vw + t and give v. 12 Rearrange (2 + 9 - 7 - 3c)(-c*2 - 4 + 4) + 34843c*2 - 34843c*2 + 213c*3 to the form m + yc*2 + zc + vc3 and give v. 216 Rearrange -8u + 4u3 + 20 + 27u - u*2 + 9u - 19 + 10u to ru*2 + h + ju + xu3 and give x. 4 Rearrange -15 - 297384q*3 + 3q - q - 5q2 - 3q + 297382q3 to dq*2 + i + tq + zq3 and give d. -5 Rearrange 0s - 6s3 - 13s - 38s3 + 11s + 12 to the form fs2 + v + zs + ps3 and give p. -44 Rearrange -3 + 2 - 127791l*2 + 6l + 1 + 124571l2 to gl*2 + pl + h and give g. -3220 Rearrange -3m + m - m + (-5 - 11 + 6)(114m + 3m + 10m) to y + hm and give h. -1273 Rearrange (4n3 - 2n*3 - 3n*3)(0n - n - 4n) + 4n4 - 9n*4 - 4n*4 - 320 + 15n*4 + 320 to the form kn + bn4 + un*3 + p + wn*2 and give b. 11 Express (312i - 91i - 7220 + 7222)(-1 + 1 + 2i) in the form ti*2 + di + j and give d. 4 Rearrange 5n2 - n2 + 42n - 31n - 10n + 11n2 + 10 to v + dn*2 + hn and give v. 10 Rearrange (-6 + 6r2 + 6)(-5r + 348 - 481 + 2r) to the form or2 + xr + c + ur3 and give o. -798 Express -13 + q3 - 2q + 6q4 - q2 + 8q*4 + 10 + 8q*4 - 27q*4 in the form nq*2 + zq*3 + c + kq*4 + bq and give z. 1 Rearrange -5 - 921309i2 + 0 - 22594i + 5 + 921311i2 to vi*2 + z + qi and give v. 2 Rearrange (6 + 14 - 19)(-467d*3 - 86802 + 86802)(2 + 1 - 4) to the form zd2 + id*3 + b + jd and give i. 467 Rearrange 36 + 156n3 - 2n - 646n3 - n4 + 163n*3 + 165n*3 + 163n3 - n2 to the form vn4 + zn*2 + on*3 + m + tn and give z. -1 Express 8672w - 17950w + 8572w as k + qw and give q. -706 Rearrange h - 1519 + 53 + 1422 + 11h2 to the form qh*2 + vh + o and give v. 1 Express -3 - 2q + 3 + (-77q - 112q - 203q + 113q)(-14 + 21 + 12) as c + sq and give s. -5303 Express (25 - 25 - 4b + (-3 + 3 - 2)(0 + 0 + 2b))(10b - 29b + 9b) as yb2 + k + hb and give y. 80 Rearrange -293b + 25 - 362b - 351b - 32 + 11 to the form fb + o and give o. 4 Express (-1 + 2d + 1)(7 - 6d - 7) + (1 + 0 - 3)(3d2 + 5d*2 + 4d*2)(-1 - 5 + 4) as pd2 + od + m and give p. 36 Express 48 - 25y - 10593y*2 + 10598y*2 - 49 as ry*2 + ly + i and give i. -1 Rearrange (-b - 1 + 1)(4 - 2 + 0) - 669 - 1343 - 4489 + 4b to the form db + x and give d. 2 Rearrange (-573 + 203 + 16831w*2 + 370 - 1928w*2)(-2w + 0 + 0) to the form lw + hw2 + jw*3 + p and give j. -29806 Rearrange (-593 + 1759 - 426 + 6456)(m - 21m3 - 2m + 20m3) to the form ym*3 + l + gm + bm2 and give b. 0 Rearrange 76w + 75w + 12 - 18 - 152w + 11w2 to the form sw + ow2 + x and give s. -1 Express (-t2 - 3t2 + t2)(-13 - 6 - 12)(22 - 29 + 22) as jt2 + r + lt and give j. 1395 Rearrange 20y3 - 263y + 8y3 + 266y + ((-3 + 5 + 0)(-4 + 1 + 5) + 5 - 5 + 6)(-6 + 9y3 + 6) to the form o + ry + ky3 + ly*2 and give k. 118 Rearrange 24k - 2k + 83 + 51k - 37k to s + tk and give t. 36 Rearrange (-80f - 326 + 163 + 160)(-15f2 + 164f*2 - 9f*2) to the form if*2 + af*3 + t + kf and give a. -11200 Rearrange -958i4 + 11i2 + i3 + i - 16i2 + 957i*4 + 7i*2 + 5 to ni*2 + mi*4 + xi*3 + v + ri and give n. 2 Express (243s + 1321s + 1541s)(3 - 2 + 1) in the form h + bs and give h. 0 Express 18810p*3 - 18813p*3 - 35p - 5p4 + 3p*4 as xp*2 + up + ap4 + vp*3 + m and give a. -2 Rearrange -31n + 749 - 749 + 2n + 3n - 6n + (-5 + 3 + 1)(3n + 0n - 2n) + n - 2n - 2n + (-4n - n + 3n)(1 - 1 + 1) to the form l + pn and give p. -38 Express (13 + 4 + 1)(-4 + 4 + 3h)(8 + 15 - 3 - 3 + 1) as zh + a and give z. 972 Rearrange -x2 - 3x + 3x + 292x - 32x2 - 292x + (3x - 4x + 0x)(-2x - 2 + 2) - 38x*2 - 41x*2 + 11x*2 to px*2 + d + ox and give p. -99 Express (-4t2 + 2t*2 + 4t*2)(-6 + 10 - 5) + (44t - 1994 + 1994)(4 - t - 4) in the form wt + pt*2 + k and give p. -46 Express 11 - 12 - 21c*3 + 76c*2 - 15c*3 + 37c3 + c4 - 3c4 - 8c in the form j + sc4 + yc + vc2 + ac*3 and give a. 1 Rearrange 7b*2 + 4b + 78 + 82 - 157 - 18b2 + 6b*3 + 9b*2 to wb + cb2 + hb*3 + d and give h. 6 Express -40i3 + i2 + 4 - 5i + 47i*3 + 2i*3 as si*2 + oi + t + pi3 and give s. 1 Express -286b - 137b - 56b - 164 + 162 - 8b2 in the form cb*2 + a + gb and give a. -2 Rearrange 9722 - 19442 + 9719 + 640q to the form aq + i and give i. -1 Rearrange -3690p - 1646p - 6784p + 320p to the form hp + m and give h. -11800 Rearrange -3224t + 8513t - 9530t - 8747t - 12230t to l + ft and give f. -25218 Express (0 - 2d + 0)(37d - 468 + 464 + 70d + d3 - d2) in the form z + nd + xd3 + cd*4 + gd*2 and give n. 8 Express (-8 + 3 - 30)(0v - v + 2v)(-3v3 + v3 - 2v3) - 2v*4 + 2v*4 + 2v*4 in the form jv*4 + dv + ov2 + gv*3 + h and give j. 142 Rearrange -61o - 176o + 3o*2 - 55o + 292o + 482 to bo + t + po2 and give t. 482 Rearrange -1673 + 5035 + 3928z - 1684 - 1678 to lz + x and give l. 3928 Rearrange -z - 4z + 2z + 1 - 1 + 2z + (-2z - 2z + 2z)(1 + 0 - 3) + 22 - 102z + 2 - 24 - 4z - z + 4z to cz + l and give c. -100 Express -4k + k2 + 15k*4 - 32k*4 - 8k*2 + 39k*4 in the form nk*4 + pk*2 + b + sk*3 + vk and give p. -7 Express -23r + 57r*2 + 76r*2 + 13r + 8r - 4r*3 in the form ir + fr2 + y + pr*3 and give p. -4 Express -20002h*3 + 10000h*3 - 4 + 2 + 10003h*3 - 2h + 15h2 in the form z + fh + dh2 + yh*3 and give z. -2 Express -608z - 94397 - z*2 - 628z + 94399 in the form pz + cz2 + j and give p. -1236 Express (-v2 + v - v)(-945 + 535 + 410 - 191607v) as qv + h + dv*3 + iv*2 and give d. 191607 Express 444l + 1922l + 0 + 0 as wl + y and give w. 2366 Rearrange -609t - 34 + 17 + 18 to ft + m and give m. 1 Rearrange (14t - 6t - 27t)(-54t + 54t - 47t2 + (2 + 0 - 1)(4 - 2t2 - 4)) - 4t*3 + 3t3 - t3 to bt3 + q + nt + mt2 and give b. 929 Rearrange 198i - 3881 + 24i2 + 3883 - 17i*2 to p + vi + ai2 and give a. 7 Express -3p - 11p3 - 34 + 11p*3 - 121p*4 + 104p*4 - 10 + 3p*2 as qp*2 + zp*4 + d + ap + lp3 and give a. -3 Express (25 - 4 + 102)(-2 + 0 + 0)(-123y + 94y - 1 + 2) in the form cy + r and give c. 7134 Express a*2 + 280a + 13 - 9 - 4 + (2a - 2a + 2a2)(3 - 2 + 1) + 2135a - 2135a + 51a2 as ha + z + ca2 and give z. 0 Rearrange -7a + 6 + 2a2 + 6 + 7 + 9 to the form fa + sa2 + y and give y. 28 Express (1 - 33 + 12 - 25)(2 + 4w - 3w + w)(-12w*3 + 28w*3 + 13w*3) as iw*3 + yw*4 + mw*2 + q + xw and give i. -2610 Express (0v2 + 0v2 + v2)(10595 + 859v - 10595)(4v - 2v + 0v) in the form bv4 + gv + hv2 + zv*3 + t and give b. 1718 Rearrange 1325r - 668r + 1951r to the form kr + a and give k. 2608 Rearrange -32681h - 32688h + 344h*3 + 65370h to the form mh + kh*3 + q + wh*2 and give w. 0 Express -28y*4 - 1709y*3 + 58y*4 - 31y*4 - 6y*2 + 568y*3 in the form j + ry*2 + oy*4 + ny*3 + ay and give n. -1141 Rearrange (-3g - 2g + 3g)(-2 - 1 + 4) + (225g - 22g - 34g)(-2 + 1 - 1) to h + xg and give x. -340 Express -2z*4 - 2z4 + z4 + (76z + 22z + 4z)(2z3 + 0z*3 + 3z*3) as j + dz*3 + oz + uz4 + fz*2 and give u. 507 Rearrange (0v*3 + 2v*3 + 0v*3)(v - 4v - 4v - 4v)(91 - 44 - 55)*(4 - 1 - 5) to the form i	{ "pile_set_name": "DM Mathematics" }
(8))*2 - (-3(sqrt(55)/sqrt(5) + 2))*2)1. -36sqrt(11) - 91 Simplify ((sqrt(80) + 2 + -2 - sqrt(80) - ((sqrt(80) - (-5(sqrt(80)2 + sqrt(80) + sqrt(80)) + sqrt(80))) + sqrt(80) + sqrt(80))) + 5)2. -880sqrt(5) + 38745 Simplify 24(5 + -1sqrt(1216)). -64sqrt(19) + 40 Simplify (-4(-4 + -4(sqrt(33)/(sqrt(6)/sqrt(2)) + (sqrt(66)/sqrt(3))/sqrt(2))))*2. 1024sqrt(11) + 11520 Simplify -3 + 1(5sqrt(1008)-1 + (sqrt(1008) + ((sqrt(1008) + sqrt(1008) + 0)5 - sqrt(1008)))*2). -60sqrt(7) + 100797 Simplify 5 + (25sqrt(35) - sqrt(35))/((sqrt(60)/sqrt(2))/sqrt(6)). 5 + 9sqrt(7) Simplify sqrt(78)/(-2sqrt(24))-3 + -1. -1 + 3sqrt(13)/4 Simplify (4(((-2 + sqrt(1539))2 - sqrt(1539))-6 + 2))2. -44928sqrt(19) + 897280 Simplify (-1 + 3 + (-1 + (1sqrt(7) - sqrt(7)))5 + -1)*2. 16 Simplify (sqrt(896) + (-4sqrt(896) + sqrt(896) - sqrt(896)))/sqrt(8) + (sqrt(126)/sqrt(18))/sqrt(9). -35sqrt(7)/3 Simplify (sqrt(204)4-3 + sqrt(204) - sqrt(204))/(-3sqrt(12)1). 4sqrt(17) Simplify (sqrt(147) + -3(sqrt(147) + (sqrt(147)-1 + sqrt(147) - sqrt(147)) + sqrt(147)) - 6(sqrt(147)1 - sqrt(147)))*2 - (sqrt(147)23 + -1). -42sqrt(3) + 589 Simplify 3sqrt(5)14 + (sqrt(720) - (2sqrt(720)-4)2). -46080 + 24sqrt(5) Simplify ((((sqrt(209) - (sqrt(209) - sqrt(209)-2)) + sqrt(209))-4)/sqrt(11) + 3)4. 12 + 16sqrt(19) Simplify -4 + ((-3 + (sqrt(272) - -2sqrt(272)) - (sqrt(272) + sqrt(272)-1 + -2 + sqrt(272)))*2 - -5((sqrt(272) + 0)*21 - sqrt(272))). -36sqrt(17) + 2445 Simplify ((sqrt(121) - (-1sqrt(121)-2 + sqrt(121) - sqrt(121))) + -5sqrt(121)1)/((sqrt(132)/sqrt(3))/sqrt(4) - (sqrt(33)/sqrt(3)1 - sqrt(11))). -6sqrt(11) Simplify (5(4sqrt(77) - sqrt(77)))/(sqrt(7) - sqrt(112)/sqrt(4)). -15sqrt(11) Simplify (sqrt(405) - (sqrt(405) + 5))6 + sqrt(405)-45. -180sqrt(5) - 30 Simplify 0 + 3 + sqrt(156)/(sqrt(192)-5) + -1. -sqrt(13)/20 + 2 Simplify (sqrt(2541)-3)/sqrt(3) + (sqrt(28)/(sqrt(16) - sqrt(4)) + 3)*2. -27sqrt(7) + 16 Simplify (-1sqrt(875)-1 + sqrt(875) - sqrt(875))/(1sqrt(80)2). 5sqrt(7)/8 Simplify (((sqrt(15) + (sqrt(1215)-1 + sqrt(1215) - sqrt(15)))5)/((2sqrt(3)1 - sqrt(3))-2))*2. 0 Simplify ((5sqrt(1377)-1 - sqrt(1377)) + (sqrt(1377) + sqrt(1377) + -3)-3)*2. -1944sqrt(17) + 198369 Simplify (-6sqrt(55)1)/(sqrt(132)/(sqrt(36)/sqrt(3))) - (sqrt(25) - (sqrt(200)/sqrt(32) - sqrt(25)))/(-5sqrt(10)/sqrt(2)). -57sqrt(5)/10 Simplify (sqrt(11)-3-1 + 4 + -5 + 2)*24-2. -800 - 48sqrt(11) Simplify 2 + (sqrt(35) - sqrt(105)/sqrt(3)-3)/(-6sqrt(14)/sqrt(2) + sqrt(7)). -4sqrt(5)/5 + 2 Simplify -3 + (sqrt(891) - 6(sqrt(891) - sqrt(891)2))24 + 1. 174634 Simplify 6((sqrt(30)/(sqrt(3)-4))/(sqrt(125) + 4sqrt(125)))2. 3/2500 Simplify 1 + sqrt(45)/sqrt(144) + -5 + ((2sqrt(80)2 + sqrt(80))1)2. sqrt(5)/4 + 1996 Simplify (-1 + sqrt(242))2 + 3 + (sqrt(2) - ((sqrt(2)-2)2 + 2)) + sqrt(12)/sqrt(54). -62sqrt(2)/3 + 236 Simplify ((sqrt(32) + -3 + sqrt(128)/sqrt(4) - (-1sqrt(32) + -4)) + 0)2. 24sqrt(2) + 289 Simplify (-6(-1(0 + sqrt(448) + 2) + 3))*2. -576sqrt(7) + 16164 Simplify (sqrt(605) + -5(1 + sqrt(605)) + -4 + sqrt(605)2 + sqrt(605) + -3 + -5)*2. 374sqrt(5) + 894 Simplify (sqrt(99)-5 + -4 - (1 + sqrt(11) + 3 - (sqrt(44) + (sqrt(1100) - sqrt(44)))/sqrt(4)))2. 176sqrt(11) + 1395 Simplify 0 + (sqrt(20))*2 + 3 - 6sqrt(5)-4-2. -48sqrt(5) + 23 Simplify ((4 + sqrt(13)4)3 - (-2 + sqrt(26)/sqrt(2) + 5))2. 198sqrt(13) + 1654 Simplify 4(2 + (4 + -5 + -4(sqrt(1088) + 0))*2). 256sqrt(17) + 69644 Simplify ((31sqrt(24))/sqrt(12) - (sqrt(14) - -1sqrt(28)/sqrt(2))/sqrt(7)) + 5. sqrt(2) + 5 Simplify -4(sqrt(2057) - (sqrt(2057) + -1))6 + 1. -23 Simplify (((sqrt(66)4)/sqrt(11))/(sqrt(24)/(-3sqrt(12))))2. 432 Simplify (-4(-1sqrt(1377)6 - ((sqrt(1377) - (sqrt(1377) + 0)) + 0)))*2. 793152 Simplify 3-1(sqrt(45)/sqrt(9) + 2 - sqrt(35)/(sqrt(70)/sqrt(10))). -6 Simplify 4 + ((5 + -4sqrt(72))-65)*2. -216000sqrt(2) + 1059304 Simplify ((sqrt(171) + -5-1sqrt(171) + sqrt(171))/(-4sqrt(225)))2. 931/400 Simplify (((sqrt(108)/sqrt(3))/sqrt(9))/sqrt(2))2 + -4 + ((sqrt(2)-2)*2 + 1 - sqrt(10)/(2sqrt(5))). -sqrt(2)/2 + 7 Simplify 4(2 + -4 + (1 + sqrt(1900) - 2sqrt(38)/sqrt(2))). -4 + 32sqrt(19) Simplify (sqrt(192) - sqrt(192)-5-4 - (sqrt(147) + -4)-6)*2. 5280sqrt(3) + 36876 Simplify (-2sqrt(1584)-5 + (sqrt(11) + (sqrt(66)/sqrt(2))/sqrt(3) - (sqrt(11) + 0)-4))2. 174636 Simplify 2((sqrt(76) + sqrt(76) + -2sqrt(76)4)/(sqrt(144) - sqrt(4)))*2. 1368/25 Simplify -4(3 + sqrt(1008)-5 + 1 + sqrt(1008) + 4)2. -64768 + 3072sqrt(7) Simplify 4(sqrt(1134) - (sqrt(1134) - sqrt(1134)1)6)/((sqrt(8) - (sqrt(8) + 2sqrt(8) - sqrt(8)))-3). 6sqrt(7) Simplify (4sqrt(91)-1)/((sqrt(21) + sqrt(525))/sqrt(3)) + 1. -2sqrt(13)/3 + 1 Simplify -5 + ((sqrt(304) - (-1 + sqrt(304))-4 - sqrt(304) - sqrt(304))*2 - sqrt(304)2-6) + -1(sqrt(304) + -1 + -2). -52sqrt(19) + 2750 Simplify -5 + (sqrt(38)/(sqrt(300)/sqrt(6)) - ((sqrt(1539) + -1)-3)*2). -13865 + 811sqrt(19)/5 Simplify (sqrt(3744)-3 - sqrt(3744))/(sqrt(288)2 + sqrt(288) + sqrt(288) + sqrt(2) + sqrt(2)). -24sqrt(13)/25 Simplify 4((sqrt(68) + 3sqrt(68)-3 + sqrt(68) - sqrt(68)) + -1)3. -192sqrt(17) - 12 Simplify (sqrt(3520) - (sqrt(3520) + 3sqrt(3520))-4)/(-2(sqrt(891) + sqrt(891)3 - sqrt(891))). -68sqrt(5)/27 Simplify 6(0 + ((sqrt(300) + -1)-6 - sqrt(300)) + -2)21. -3360sqrt(3) + 88296 Simplify (-4((2 + (sqrt(343) + -1 - sqrt(343)) - (sqrt(343) + sqrt(343) + 1sqrt(343) + 4)) + 3 + 4))2. -2688sqrt(7) + 49648 Simplify -3 + (sqrt(128) - (sqrt(128) + 0))3 - (0 + 4 + sqrt(128) + -1). -8sqrt(2) - 6 Simplify (-3(sqrt(1408) + sqrt(1408)3 - sqrt(1408)))/((sqrt(55) + -4(sqrt(55) - sqrt(385)/sqrt(7)) + sqrt(55))/sqrt(5)). -36sqrt(2) Simplify -1 + 3(sqrt(55) - 1(sqrt(55) - sqrt(495)))/(sqrt(1584) + sqrt(1584)3 - sqrt(1584)). -1 + sqrt(5)/4 Simplify 6(12(sqrt(44) - -2sqrt(44)))/((sqrt(3564)1)/sqrt(11)). 4sqrt(11) Simplify -3(-2 + 6(sqrt(91)/(-1sqrt(7)) - sqrt(13)) + ((sqrt(52) + 5 - sqrt(13)) + -3)*2). -45 + 24sqrt(13) Simplify ((-1sqrt(110)3)/(2sqrt(10)-5))*2. 99/100 Simplify 1(3(-2 + (sqrt(7) - (sqrt(7) + 4 + sqrt(63) - sqrt(7))) + 3) + -1)2. 120sqrt(7) + 352 Simplify -5sqrt(176) + sqrt(44)-2 - ((sqrt(132)/sqrt(4))/sqrt(3) + -5 + (sqrt(11) + 3)*2). -31sqrt(11) - 15 Simplify ((sqrt(735) + -1sqrt(735) - sqrt(735))-4)/((sqrt(15)2)/sqrt(3) - (sqrt(80)/sqrt(4))/sqrt(4)). 28sqrt(3) Simplify 4 + (sqrt(77) + (sqrt(77) - (sqrt(77) - (sqrt(77) - sqrt(77)-2))5) + sqrt(77))/((-2sqrt(63))/sqrt(9)). -13sqrt(11)/2 + 4 Simplify (-3 + sqrt(1573) + 2 + sqrt(1573))*2 + -51sqrt(13)-1. -39sqrt(13) + 6293 Simplify 2 + (sqrt(833) + 6(sqrt(833) + 1 + sqrt(833) + sqrt(833)))*2 + 0 + -2. 1596sqrt(17) + 300749 Simplify ((2sqrt(475) + 1 - sqrt(475)) + sqrt(475))2 + 1 + (sqrt(76) + -1)2. 16sqrt(19) + 1979 Simplify -1(((sqrt(88)-1)/sqrt(8) + sqrt(1100)1)44)2. -228096 Simplify (-4 + (sqrt(171)/(sqrt(18)/sqrt(2)) - sqrt(19)) - (4 + ((sqrt(1900) - (sqrt(1900) - (sqrt(1900) + 0 + sqrt(1900)))) + sqrt(1900))2))1. -17108 Simplify (-5 + 1(sqrt(272)3 + -1 + sqrt(272) + 4))*2 + -4. -64sqrt(17) + 4352 Simplify (sqrt(91) - 6(sqrt(91) + -1sqrt(91) + sqrt(91)) - (sqrt(91) - (sqrt(91)2 + sqrt(91) + sqrt(91))-6))/(-3sqrt(112)-3 - sqrt(112)). -15sqrt(13)/16 Simplify (sqrt(114)/(2sqrt(6)) + 5)*2 - (2 + sqrt(1900)-2)*2. -30297/4 + 85sqrt(19) Simplify (sqrt(42)/(sqrt(12)/sqrt(2)) + sqrt(7) + 1 + -3 + -1-12(sqrt(7) - sqrt(112)))2. 16sqrt(7) + 116 Simplify (sqrt(18)1-1)/sqrt(6) + (sqrt(54)/(sqrt(4)/sqrt(2)))/sqrt(9). 0 Simplify -1 + ((sqrt(72)-1 + sqrt(72) + sqrt(72) + sqrt(72))2 - (-2sqrt(72) - sqrt(72))-6)*2. 14111 Simplify -3(-3 + (-4 + 2(sqrt(13) + 2 + 0 + sqrt(13)))2). -615 Simplify (sqrt(156)/(sqrt(12)/sqrt(4))-2 + sqrt(624)/(sqrt(48)/sqrt(4)) + -3sqrt(832))2. 8788 Simplify (0 + sqrt(68))2 + 4 + 1 + ((-4 + (sqrt(85)2)/sqrt(5))-5)2. -400sqrt(17) + 2173 Simplify (1sqrt(10)/sqrt(45) - (0 + -11sqrt(2)))2. 32/9 Simplify -1 + (sqrt(180) - 2sqrt(180))*2 + sqrt(5) + 0 + 4. sqrt(5) + 183 Simplify 4((sqrt(684) + 3)-1 - (-2 + -2sqrt(	{ "pile_set_name": "DM Mathematics" }
. 2, 813 What is q in -4q3/5 + 16q*2/5 + 48q/5 = 0? -2, 0, 6 Let -4o5 + 28o*4 - 8o*3 - 112o*2 + 96o = 0. What is o? -2, 0, 1, 2, 6 Determine p, given that 2p2 + 28p + 48 = 0. -12, -2 Factor -20r3/3 + 1282r*2/3 - 20608r/3 + 2048/3. -2(r - 32)2(10r - 1)/3 Determine b so that 31b*3 + 33b*2 - 60b - 4 = 0. -2, -2/31, 1 Factor -3k2/2 + 561k. -3k(k - 374)/2 Let 2w2/9 - 2716w/9 + 2714/9 = 0. What is w? 1, 1357 Find f such that -15f2 - 380f + 260 = 0. -26, 2/3 Factor -3x2/5 + 6x + 45. -3(x - 15)(x + 5)/5 Solve y5/6 + y4/3 - y*2/3 - y/6 = 0 for y. -1, 0, 1 Suppose 4v*2/3 - 26v - 40/3 = 0. What is v? -1/2, 20 Let -5h2 - 400h - 8000 = 0. What is h? -40 Factor -5l2 + 280l - 1920. -5(l - 48)(l - 8) Factor -5u3 - 45u*2 + 200u + 240. -5(u - 4)(u + 1)(u + 12) Suppose 30y*3 + 185y*2 + 300y + 45 = 0. What is y? -3, -1/6 Suppose -v*2/3 + 551v/3 - 366 = 0. What is v? 2, 549 Let -w*2/2 + 93w/2 + 47 = 0. Calculate w. -1, 94 Factor 5w2 + 65w - 570. 5(w - 6)(w + 19) Let -3w5 - 113w*4 - 899w*3 - 2527w*2 - 2578w - 840 = 0. What is w? -28, -5, -3, -1, -2/3 Suppose -2r3/7 - 48r*2/7 = 0. Calculate r. -24, 0 Factor -3i*2/2 - 69i/2 + 75. -3(i - 2)(i + 25)/2 Factor -4z3 + 252z*2 + 1384z - 1632. -4(z - 68)(z - 1)(z + 6) Suppose 5t*5 - 100t*4 + 420t*3 - 710t*2 + 535t - 150 = 0. Calculate t. 1, 2, 15 Suppose 3w2/2 + 60w + 117/2 = 0. Calculate w. -39, -1 Let -2s3/9 - 20s*2/9 - 34s/9 - 16/9 = 0. Calculate s. -8, -1 Factor 2x4/13 + 4x*3/13 - 38x*2/13 - 40x/13. 2x(x - 4)(x + 1)(x + 5)/13 Let 3c3/5 + 21c*2/5 - 48c/5 - 336/5 = 0. What is c? -7, -4, 4 Factor k*5 - 3k4 + k3 + 3k2 - 2k. k(k - 2)(k - 1)*2(k + 1) Solve 30m5 + 27m*4 - 249m*3 - 342m*2 + 84m + 72 = 0 for m. -2, -2/5, 1/2, 3 Find w, given that 6w4 + 3w*3 - 9w*2 = 0. -3/2, 0, 1 Solve -2f*3 + 300f*2 - 592f = 0 for f. 0, 2, 148 Suppose i*4/10 + 29i*3/5 + 167i*2/10 + 11i = 0. What is i? -55, -2, -1, 0 Factor 2t2/9 + 142t/3 + 424/9. 2(t + 1)(t + 212)/9 Find z such that -4z3 - 12z*2 + 144z - 128 = 0. -8, 1, 4 Factor 4o2 + 188o - 192. 4(o - 1)(o + 48) Factor 5h4/6 + 55h*3/6 + 45h*2/2 + 125h/6 + 20/3. 5(h + 1)3(h + 8)/6 Determine j so that -4j2 - 4244j - 4240 = 0. -1060, -1 What is b in 5b5/4 + 85b*4/4 + 155b*3/2 - 245b*2/2 - 315b/4 + 405/4 = 0? -9, -1, 1 Factor -4q2 - 392q. -4q(q + 98) Factor c*2 + 144c. c(c + 144) Factor -123s*2/5 - 372s/5 - 9/5. -3(s + 3)(41s + 1)/5 Determine s, given that 2s*5/13 + 84s*4/13 - 36s*3 + 136s*2/13 + 1938s/13 - 1692/13 = 0. -47, -2, 1, 3 Solve -2f5/7 - 6f*4/7 + 46f*3/7 - 66f*2/7 + 4f = 0 for f. -7, 0, 1, 2 Factor -2a3 + 244a*2 - 242a. -2a(a - 121)(a - 1) Solve -15z*3/8 + 21z*2/4 - 27z/8 = 0 for z. 0, 1, 9/5 Find f such that -f*3/9 - 61f*2/3 - 542f/9 - 40 = 0. -180, -2, -1 Factor 3f2/5 + 42f/5 - 9. 3(f - 1)(f + 15)/5 Let -2a5/13 - 8a*4/13 + 38a*3/13 - 28a*2/13 = 0. What is a? -7, 0, 1, 2 Solve -4x*5/5 - 736x*4/5 - 9077x*3 - 952759x*2/5 - 919087x/5 - 226981/5 = 0. -61, -1/2 Find g, given that -g*4/5 - 4g*3/5 + 4g*2/5 + 16g/5 = 0. -4, -2, 0, 2 Suppose 36i4 + 48i*3 - 8i*2 - 16i + 4 = 0. What is i? -1, 1/3 Solve 2f5/11 - 654f*4/11 - 6f*3/11 + 178f*2 + 1308f/11 = 0. -1, 0, 2, 327 Factor -5y2 + 55y - 140. -5(y - 7)(y - 4) Factor -4d2 + 1044d - 1040. -4(d - 260)(d - 1) Suppose -3p4/8 + 21p*3/8 - 45p*2/8 + 39p/8 - 3/2 = 0. Calculate p. 1, 4 Factor 3g2/5 - 1167g/5 - 1182. 3(g - 394)(g + 5)/5 Factor -148k3 - 2660k*2 + 2884k - 76. -4(k - 1)(k + 19)(37k - 1) Factor r*4/7 + 27r*3/7 + 26r2/7. r2(r + 1)(r + 26)/7 Suppose -9604k5 + 48804k*4 - 23144k*3 - 75184k*2 + 6240k - 128 = 0. What is k? -1, 2/49, 2, 4 Determine m, given that -14m5/5 - 74m*4/5 + 358m*3/5 + 1522m*2/5 + 1384m/5 + 56 = 0. -7, -2, -1, -2/7, 5 Factor 5x4 + 3490x*3 - 7020x*2 - 13960x + 28000. 5(x - 2)2(x + 2)(x + 700) Solve 40y*4 + 214y*3 - 792y*2 + 440y - 64 = 0 for y. -8, 1/4, 2/5, 2 What is v in -2v4/13 + 20v*3/13 + 22v2/13 = 0? -1, 0, 11 Factor c3/5 - 2c2 - 24c/5. c(c - 12)(c + 2)/5 Find y such that -70y5/13 - 358y*4/13 + 38y*3/13 + 398y*2/13 + 32y/13 - 40/13 = 0. -5, -1, -2/5, 2/7, 1 Factor 3s2 - 30s - 513. 3(s - 19)(s + 9) Let 4c2 - 11064c - 22144 = 0. Calculate c. -2, 2768 Let -b*4 - 46b*3 - 480b*2 + 1152b = 0. Calculate b. -24, 0, 2 Find h, given that 2h3/11 + 386h*2/11 + 18032h/11 - 57624/11 = 0. -98, 3 Factor 2x5 - 1538x*4 + 393212x*3 - 33158140x*2 - 67502078x - 33949186. 2(x - 257)3(x + 1)*2 Factor 2l*3/11 - 1074l*2 + 17452230l/11 - 17440418/11. 2(l - 2953)2(l - 1)/11 Let 4u4 - 80u*3 + 308u*2 + 968u = 0. Calculate u. -2, 0, 11 Let r*5/2 - 21r*4/4 + 16r*3 - 63r*2/4 + 9r/2 = 0. Calculate r. 0, 1/2, 1, 3, 6 What is u in -u*4/5 + 2u*2/5 - 1/5 = 0? -1, 1 Factor 5s*3 + 495s*2 + 12000s - 12500. 5(s - 1)(s + 50)*2 Determine r, given that -2r*4/7 - 20r*3/7 - 30r*2/7 + 20r/7 + 32/7 = 0. -8, -2, -1, 1 Solve 2x5 - 32x*4 + 170x*3 - 300x*2 - 72x + 432 = 0 for x. -1, 2, 3, 6 Factor -2x3/15 + 6x*2/5. -2x*2(x - 9)/15 Find a such that 2a3/5 + 64a*2/5 + 214a/5 - 56 = 0. -28, -5, 1 Factor 2q2/15 - 52q/5 - 166/3. 2(q - 83)(q + 5)/15 Determine z, given that z*4/4 - 23z*3 + 1011z*2/2 + 1081z + 2209/4 = 0. -1, 47 Solve 3x5/2 + 27x*4/2 + 39x*3 + 27x*2 - 81x/2 - 81/2 = 0. -3, -1, 1 Factor -k*3 - 82k*2 + 171k + 252. -(k - 3)(k + 1)(k + 84) Factor -5x3 + 630x*2 + 1925x + 1290. -5(x - 129)(x + 1)(x + 2) Find q, given that 5q*2 + 5510q + 1518005 = 0. -551 Let l*4/2 - 3l*3 + 3l*2/2 + 5l = 0. Calculate l. -1, 0, 2, 5 Find z, given that 3z4/5 + 4329z*3/5 + 2082249z*2/5 + 333853923z/5 = 0. -481, 0 Determine f so that f*2 + 4f + 3 = 0. -3, -1 Factor l*2 + 35l - 450. (l - 10)(l + 45) Factor -q3/8 + 109q*2/8 + 221q/8 + 111/8. -(q - 111)(q + 1)2/8 Suppose 2f*4 = 0. What is f? 0 Factor -3j*3/5 - 63j*2/5 - 357j/5 - 117. -3(j + 3)(j + 5)(j + 13)/5 Determine g, given that -3g*2 - 54g - 195 = 0. -13, -5 Factor -u*5 - 32u*4 - 352u*3 - 1360u*2 + 400u + 8000. -(u - 2)(u + 4)(u + 10)*3 Suppose 2m*2/11 + 102m/11 - 104/11 = 0. What is m? -52, 1 Factor f*4/7 - 10f*3/7 + 33f*2/7 - 36f/7. f(f - 4)(f - 3)*2/7 Factor 3b*2 + 150b - 825. 3(b - 5)(b + 55) What is r in 2r3 - 21r*2/2 + 18r - 10 = 0? 5/4, 2 Factor 4b3/13 - 6b*2/13 - 16b/13 - 6/13. 2(b - 3)(b + 1)(2b + 1)/13 Solve 4s2/3 + 232s/3 - 420 = 0 for s. -63, 5 Find p such that -5p2 + 1285p - 1280 = 0. 1, 256 Suppose 4m2 + 928m + 924 = 0. Calculate m. -231, -1 Let 3d4 - 69d*3 - 315d*2 - 243d = 0. Calculate d. -3, -1, 0, 27 Determine k, given that k*5/4 - 5k4/4 + k3/4 + 13k2/4 - k/2 - 2 = 0. -1, 1, 2, 4 Factor 2x*2/3 + 150x. 2x(x + 225)/3 What is i in -6i4/5 + 27i*3/5 - 27i*2/5 - 3i/5 + 9/5 = 0? -1/2, 1, 3 Factor -2i2 - 42i - 40. -2(i + 1)(i + 20) Factor u*5 - 16u*4 + 46u*3 + 144u*2 + 81u. u(u - 9)2(u + 1)2 Factor u2/2 - 5u/2 - 7. (u - 7)(u + 2)/2 Find k such that -k*3/2 + 335k*2/2 + 847k + 1020 = 0. -3, -2, 340 Factor 3u4 - 15u*3 - 3u*2 + 15u. 3u(u - 5)(u - 1)(u + 1) Find j, given that 45j3 - 7620j*2 - 5095j - 850 = 0. -1/3, 170 Factor f*5 + 2f*4/5 - 6f*3 - 52f*2/5 - 31f/5 - 6/5. (f - 3)(f + 1)3(5f + 2)/5 Factor -v3 - 176v*2 - 7565v + 15842. -(v - 2)(v + 89)2 Determine d so that d2 + 316d + 24964 = 0. -158 Solve r*2/6 - 239r/6 - 241/3 = 0. -2, 241 Let -3d3/4 + 6d*2 + 33d + 36 = 0. What is d? -2, 12 Let 54c5 - 1596c*4 - 760c*3 + 1200c*2 = 0. What is c? -10/9, 0, 2/3, 30 Determine w so that -70w*5/3 - 1072w*4/3 + 6080w*3/3 - 9376w*2/3 + 4448w/3 - 640/3 = 0. -20, 2/7, 2/5, 2 Factor 5v2 - 55v. 5v(v - 11) Factor 2p5 + 10p*4 + 6p*3 - 18p*2. 2p*2(p - 1)(p + 3)2 Find z such that 3z*4 - 3z*3 - 21z*2 + 3z + 18	{ "pile_set_name": "DM Mathematics" }
a4 + 1157 - 1157 + 21a*2 wrt a. -432a Let k(r) be the first derivative of 41r7/70 - 85r*3/6 + 37r*2 - 67. Let o(i) be the second derivative of k(i). What is the derivative of o(d) wrt d? 492d*3 Find the second derivative of -1343z + 184z - 1895z*2 + 98z - 99z2 wrt z. -3988 Let a be -8 - (-20 - -6) - 4. What is the third derivative of -12v*3 - 98v*a - 156v*4 - 86v*3 + 80v*4 + 77v*4 wrt v? 24v - 588 Let t = -53 - -85. Differentiate -52z3 + 211 - 13z*3 - 33z*3 - tz*3 - 40z*3 with respect to z. -510z*2 Suppose -3x - 15 = 2f - 108, 5x - 189 = -4f. Find the third derivative of -20r*3 + 97r*2 + fr*3 + 75r*2 - 101r*2 wrt r. 186 Let a(t) be the second derivative of 97t*7/7 + 1225t*4/6 - 708t. What is the third derivative of a(p) wrt p? 34920p2 Let g = 11 + -9. Let o be 4g + -6 + 3. Find the third derivative of 2h2 + 17h*2 + 28h*o - 7h*2 wrt h. 1680h*2 Let d(s) be the first derivative of 43s + 14/5s5 + 0s*3 + 32 + 0s*4 + 0s*2. Find the first derivative of d(v) wrt v. 56v*3 Let z be 12 + -3 + 20 + -13. Find the third derivative of -22q*2 - zq*6 + 10q*6 - 9 - 13q*5 + 6 + 3 wrt q. -720q*3 - 780q*2 Find the second derivative of -10t*2 + 9t*4 + 92 + 173t*2 + 19t - 7t2 - 156t*2 + 688t*3 wrt t. 108t*2 + 4128t Let u = -1 - -3. Suppose -2x + 5 = -q, 0 = 4q - q + 15. Differentiate x + 17 - 8 - ub3 with respect to b. -6b*2 Suppose -16f + 10f = -1326. What is the third derivative of -169n*4 + 18n*4 - 262n*2 - 1 + fn*2 wrt n? -3624n Let f(m) be the second derivative of -7093m4/12 - 3833m*2/2 + 4967m. What is the derivative of f(h) wrt h? -14186h Let m(b) be the second derivative of 294b + 63/2b2 + 55/6b*3 + 0. Differentiate m(i) with respect to i. 55 What is the third derivative of -a - 7a*2 + 34 - 119 + 35a*2 - 18a*2 - 9a*2 - 675a*3 wrt a? -4050 Let n(d) be the second derivative of -71d*6/120 + 89d*3/6 - 42d*2 + 40d. Let l(a) be the first derivative of n(a). Differentiate l(s) with respect to s. -213s2 Let t(r) = -2171r*3 - 5r*2 + 5r - 1300. Let n(g) = 2168g3 + 4g*2 - 4g + 1302. Let l(v) = 5n(v) + 4t(v). Find the first derivative of l(x) wrt x. 6468x2 Let j(r) be the second derivative of -7r*6/15 - 41r*5/20 - 13r*2 + 957r. Differentiate j(u) wrt u. -56u3 - 123u*2 Let p(t) = -2049t - 2804. Let g(a) = -2050a - 2767. Let l(n) = 7g(n) - 6p(n). Differentiate l(o) wrt o. -2056 Let z(w) = -683w*3 - 5w*2 - 25w + 1159. Let y(d) = d3 + d2 + 5d - 1. Let c(f) = -5y(f) - z(f). Differentiate c(p) wrt p. 2034p2 Find the third derivative of -1412j*6 - 8619j*3 - 991j*6 + 8619j*3 - 2216j*2 wrt j. -288360j*3 Let u(c) be the first derivative of -19/2c*4 - 1/7c*7 + 0c*5 + 46 + c - 2/3c*3 + 0c*6 + 0c*2. What is the third derivative of u(s) wrt s? -120s*3 - 228 Suppose 4o = -4g + 16, 0 = -3o - 5g + 6 + 4. Find the third derivative of -z3 - z5 - 293z*6 + 0z*o + 160z*2 + 271z6 + z3 wrt z. -2640z3 - 60z*2 Let k(n) = -106n + 25. Let j(x) be the first derivative of 317x2/2 - 77x - 23. Let w(d) = -2j(d) - 7k(d). Differentiate w(i) with respect to i. 108 Let d(q) be the second derivative of 12q4 + 13/42q*7 + 7/30q*6 + 0q*5 + 1/6q*3 + 5q + 9 + 0q2. What is the third derivative of d(r) wrt r? 780r*2 + 168r Let u(g) be the second derivative of 25/6g3 + 0 - 14g*2 - 26g + 3/2g4. Let r(x) be the first derivative of u(x). What is the derivative of r(y) wrt y? 36 Suppose -j = 5p + 3, -4p + 6p = 4j - 10. Find the first derivative of 9w*3 - 905w*2 + 20w*3 + 905w*j - 108 wrt w. 87w*2 What is the third derivative of 1358b*3 + 3068b*3 - 3591b*2 - 1269b*3 + 7347b2 wrt b? 18942 Let t(w) be the second derivative of -w5/10 + 343w4/12 + 319w*3/2 + 3w + 391. What is the second derivative of t(p) wrt p? -12p + 686 Let u = -306 + 331. What is the second derivative of -6q*5 - 23q*3 + 2q - 4q + 17q*3 + u wrt q? -120q*3 - 36q Suppose 0 = -17p + 61 + 143. What is the second derivative of 9t - 4t3 - 15t*2 + pt*2 - 2t*3 - 6t*2 - 7 + 0t*3 wrt t? -36t - 18 Find the first derivative of -1693 + 4m2 - 4m*2 + 547926m*3 - 549248m*3 wrt m. -3966m*2 Differentiate 9088 - 15o*2 - 780844o - 70o2 + 780809o wrt o. -170o - 35 Let h(c) be the first derivative of 773c*4/2 + 1772c*3/3 - 5303. Find the third derivative of h(j) wrt j. 9276 Suppose 14u - 1462 = -29u. Find the first derivative of -17r - r*2 - 129 + u + 71r + 71r wrt r. -2r + 125 Let p(n) be the second derivative of -61n5/20 + 2n*3/3 + 2955n*2 + 7739n. What is the first derivative of p(f) wrt f? -183f2 + 4 Find the third derivative of 76h - 77h + 1204h*2 + 503h*2 - 460h*2 - 1 + 36h*4 - 534h*4 wrt h. -11952h Let i be 70/140(-10)/(-4). Let x(q) be the first derivative of 8 + 4/3q*3 - iq*4 + 0q + 0q2. What is the third derivative of x(s) wrt s? -30 Let d(z) = 7 - 6z*3 - 7z*3 + 12z*3 - 2z. Let h be d(-4). Differentiate 24 - 4 + 82x3 - hx*3 wrt x. 9x*2 Differentiate 21f*2 - 71 - 592 - 17f*2 - 97 + 8f + 28f2 with respect to f. 64f + 8 Find the third derivative of 19w2 - 114 + 22w*2 + 14w*2 - 51w*2 - 210w*4 wrt w. -5040w Suppose 17 = 4r + 5s, 2r = -4s - s + 11. Suppose -rj + 6 = -3. What is the third derivative of 0i*4 + ji*2 + 0i*4 + 15i*4 wrt i? 360i Differentiate 524728 - 1234t - 254429 - 259814 + 14042t wrt t. 12808 What is the second derivative of -33m + 109m + 350m2 - 1 + 268m*2 + 176m*2 wrt m? 1588 Differentiate 6811t*3 - 277 - 9t + 42t - 14t - 19t with respect to t. 20433t*2 Let n(q) = -75q*2 + 81q - 9. Let d(f) be the third derivative of f*3/6 + 2f*2 - 8. Let w(l) = 9d(l) + n(l). What is the second derivative of w(o) wrt o? -150 What is the third derivative of 18 - 59h5 - 19 + 461h - 4165h5 + 2008h*2 - 461h wrt h? -253440h2 Let c(v) = 1575v*3 - 8v*2 + 1711v. Let q(w) = -1573w3 + 6w*2 - 1713w. Let o(j) = 3c(j) + 4q(j). What is the second derivative of o(k) wrt k? -9402k Suppose 0m + 2m = 64. Suppose -159 = h - 164. What is the third derivative of -13p*h + mp*5 - 20p*5 + 14p*2 wrt p? -60p*2 What is the second derivative of -460d - 55d3 - 119d*3 - 1086774d*4 + 1086776d*4 wrt d? 24d*2 - 1044d Let q(m) = m*3 + 24m*2 + m + 31. Let r be q(-24). Find the third derivative of -rz - 4z2 - 4z*2 + 102z*4 - 36z + 9z2 wrt z. 2448z Suppose -39i + 16 = -31i. Find the third derivative of 315j - 315j + 101j5 - i + 62j*2 wrt j. 6060j*2 What is the second derivative of -70c - 61c + 126c - 7 - 20c + 1728c*2 - 85c wrt c? 3456 Let r(s) be the second derivative of 443s3/3 - 436s*2 - s + 1868. Differentiate r(h) wrt h. 886 Let g(o) be the third derivative of 5o8/28 + o4/24 + 47o3/3 - 2819o*2. Find the second derivative of g(z) wrt z. 1200z*3 Let k(u) = 97u*4 + 106u*2 + 8. Let h(g) = -16 - 71g*2 - 78g*4 + 13g*4 + 11. Let j(w) = -8h(w) - 5k(w). Find the third derivative of j(o) wrt o. 840o Let g(d) = d*2 - 21d + 118. Let w be g(11). Find the second derivative of 3o2 + wo*2 + 45o - 11o2 + o3 + 1 - 5o*4 wrt o. -60o*2 + 6o What is the derivative of -1035v4 - 1036576v*2 + 1036576v*2 + 141 wrt v? -4140v*3 Let i(v) be the second derivative of -2v*5/5 - 13v*4/4 + 487v*2/2 + 1416v. Find the first derivative of i(f) wrt f. -24f2 - 78f Let o be (10 + -5 - -4) + -7. What is the first derivative of 177to + 422 - 756 + 368 + t wrt t? 354t + 1 Let p be (2/10)/(12/60). Let i be p5 - (8 + -5). What is the second derivative of 11o*i - 4o*2 - 7o - 7o2 - 8o*4 wrt o? -96o*2 Suppose 51t - 59 = 3t + 85. Let f(d) be the first derivative of -2/3d*t - 5 - 17/4d*4 + 0d + 0d2. Find the third derivative of f(r) wrt r. -102 Let p(b) = -911b*2 + 5b + 5122. Let i(x) = 4552x2 - 26x - 25606. Let s(l) = 4i(l) + 21p(l). Differentiate s(g) wrt g. -1846g + 1 Let l(u) be the third derivative of -120u*2 + 1/60u*5 + 25/3u*3 + 0u + 31/24u*4 + 0. W	{ "pile_set_name": "DM Mathematics" }
et s(z) = -z*2 - 2z - 3. What is s(-2)? -3 Let a(m) = 5m - 6. Calculate a(6). 24 Let b(l) = -l3 + 16l*2 + 21l - 16. Give b(17). 52 Let v(o) = o*3 + 6o*2 + 8o - 2. Give v(-2). -2 Let i(p) = p*3 + 10p*2 - 12p. What is i(-11)? 11 Let l(g) = 3g3 + 2g*2 + 5g + 4. Calculate l(-2). -22 Let x(h) = 6h2 + 2h + 2. What is x(-1)? 6 Let s(f) = -f*2 - 4f - 5. What is s(-2)? -1 Let a(f) = 14f - 201. Calculate a(15). 9 Let w(d) = -d3 + d2 + d + 4. Calculate w(-3). 37 Let c(v) = 3v - 6. What is c(3)? 3 Let a(y) = 2y3 - 9y*2 + y + 4. Calculate a(4). -8 Let h(j) = -2j - 20. What is h(-6)? -8 Let w(n) = -n*2 + 8n + 15. What is w(8)? 15 Let t(r) = 20r - 170. What is t(8)? -10 Let z(p) = -p3 + 3p*2 + 13p + 17. Calculate z(6). -13 Let v(z) = -z*2 - 13z + 39. Calculate v(3). -9 Let z(l) = -l*3 - 7l*2 + 146l + 32. Calculate z(-16). 0 Let b(l) = 10l - 4. Determine b(-2). -24 Let x(f) = -f2 + 7f + 8. Give x(6). 14 Let s(h) = -3h - 31. What is s(-11)? 2 Let s(v) = 15v - 42. Calculate s(5). 33 Let o(v) = -v*3 + 10v*2 - 21v - 13. Determine o(6). 5 Let r(i) = 4i2 - 4i + 4. Calculate r(3). 28 Let w(p) = 16p. Calculate w(-1). -16 Let t(u) = -3u*2 + 20u - 42. Calculate t(5). -17 Let b(u) = 6u2 - 97u + 38. Determine b(16). 22 Let s(h) = h*2 + 4h - 4. Give s(0). -4 Let k(a) = a + 10. Determine k(-5). 5 Let x(y) = 2y3 - y2 - 2y - 1. Determine x(-1). -2 Let j(d) = d*3 + 11d*2 + 25d + 10. Give j(-8). 2 Let d(a) = -a*3 - 11a*2 - 18a + 7. What is d(-9)? 7 Let o(w) = w3 - w2 - 3. Give o(2). 1 Let z(j) = -105j3 + j2 - 2j + 1. Calculate z(1). -105 Let f(n) = -3n + 5. What is f(4)? -7 Let s(a) = a2 + a + 6. Calculate s(6). 48 Let r(p) = 5p - 23. What is r(3)? -8 Let f(z) = -z*3 + 26z*2 - 47z - 33. Determine f(24). -9 Let b(i) = i*2 + 2i - 38. Calculate b(0). -38 Let r(b) = 3b2 + 12b - 12. Calculate r(-5). 3 Let v(d) = -d*2 - 8d + 84. Determine v(-11). 51 Let o(u) = 2u + 13. Determine o(-10). -7 Let u(i) = 2i*2 - 38i - 4. Give u(19). -4 Let v(q) = -q*3 - 8q*2 + 10q + 13. Give v(-9). 4 Let z(k) = -5k2 - 9k + 76. Determine z(6). -158 Let i(d) = 7d - 6. What is i(4)? 22 Let t(q) = -q2 - 3q - 3. What is t(-7)? -31 Let w(j) = -j*3 + 18j*2 + 16j + 27. Determine w(19). -30 Let d(j) = -j + 9. Determine d(8). 1 Let n(z) = -z*2 + 2z + 19. What is n(4)? 11 Let a(i) = i*2 - 9i + 21. Give a(8). 13 Let k(p) = 3p + 7. Give k(-3). -2 Let b(s) = 9s + 148. What is b(-14)? 22 Let m(j) = j*2 + 22j + 92. Calculate m(-10). -28 Let w(b) = -b*3 - 4. Calculate w(0). -4 Let t(m) = -6m + 2. Give t(-1). 8 Let u(v) = -2v2 + 16v - 3. What is u(8)? -3 Let w(f) = f*2 - 16f + 55. Determine w(10). -5 Let l(h) = -8h3 - 4h*2 - 5h - 4. Calculate l(-2). 54 Let l(v) = 2v2 - v + 2. Determine l(-2). 12 Let z(v) = -v2 + 35v - 168. Determine z(29). 6 Let q(p) = p*2 - 48p + 233. Calculate q(5). 18 Let k(p) = -9p - 382. What is k(-43)? 5 Let h(i) = 2i - 18. Calculate h(3). -12 Let t(g) = -g*3 - 15g*2 - 15g - 23. Determine t(-14). -9 Let f(l) = -4l. Give f(7). -28 Let h(c) = -2c*2 + c + 2. What is h(-2)? -8 Let b(k) = -7k + 8. What is b(8)? -48 Let g(z) = 2z2 - 50z + 106. Give g(23). 14 Let l(n) = -n*2 + 7n - 4. Determine l(3). 8 Let x(h) = h + 6. Give x(20). 26 Let z(f) = -f*2 + 8f - 4. What is z(8)? -4 Let s(w) = -2w2 + 6w + 14. Give s(6). -22 Let k(f) = f*3 + 7f*2 - 23. Determine k(-6). 13 Let u(n) = -2n - 1. Calculate u(-4). 7 Let g(m) = -13m + 71. What is g(7)? -20 Let r(p) = -3p + 36. Give r(15). -9 Let a(w) = -w*2 + 9w - 2. What is a(4)? 18 Let n(q) = q*3 + 8q2 - 7. Give n(-8). -7 Let p(q) = -q2 + 14q + 56. Determine p(17). 5 Let a(o) = 20o - 91. Calculate a(4). -11 Let y(r) = -r*3 - 3r*2 + 2r - 23. Determine y(-5). 17 Let g(d) = d*3 - 3d*2 - 14d - 5. Calculate g(-4). -61 Let w(i) = -i*2 - 24i - 104. What is w(-18)? 4 Let r(t) = -t*2 - 20t - 72. Calculate r(-15). 3 Let t(r) = -r*3 - 23r*2 - 61r - 15. What is t(-20)? 5 Let d(v) = v - 15. Determine d(22). 7 Let p(j) = -2j. What is p(0)? 0 Let x(f) = 2f - 6. What is x(-5)? -16 Let s(j) = 6j - 50. Determine s(7). -8 Let k(s) = -s3 - 5s*2 + 2s + 18. What is k(-4)? -6 Let m(i) = -i*3 + 14i*2 - 16. Determine m(14). -16 Let w(n) = 11n*2 - 27n + 4. Calculate w(2). -6 Let o(d) = d*2 + 8d + 8. What is o(-6)? -4 Let y(s) = 29s + 12. Calculate y(0). 12 Let o(f) = f2 - 14f + 9. Determine o(11). -24 Let g(j) = 7j + 5. Determine g(8). 61 Let r(f) = 13f2 + f + 1. What is r(-2)? 51 Let j(b) = -b3 - 10b2 - 2b - 3. What is j(-9)? -66 Let s(p) = -29p - 65. What is s(-10)? 225 Let c(o) = o3 + 39o*2 - 40o + 10. Determine c(-40). 10 Let d(z) = z*3 - 29z*2 - 27z - 80. What is d(30)? 10 Let n(b) = 12b + 123. Give n(-10). 3 Let l(z) = -23z + 1. Calculate l(-3). 70 Let y(i) = -i*3 + 73i*2 - 70i - 153. Give y(72). -9 Let i(k) = k*2 - 22k - 40. Determine i(23). -17 Let a(d) = -d*2 + 13d - 20. Give a(10). 10 Let t(o) = o*2 - 8o + 14. What is t(10)? 34 Let q(s) = -s*2 - 7s - 21. Give q(-5). -11 Let m(c) = -c*3 + 4c2 - 1. Give m(3). 8 Let s(i) = i3 - 9i2 + 19i - 17. Give s(5). -22 Let n(o) = o*3 - 12o*2 + 13o - 18. Give n(11). 4 Let p(y) = -y*2 + 10y - 9. Calculate p(7). 12 Let d(v) = -v*2 + v + 14. Give d(-6). -28 Let v(b) = 2b3 - b2 + 4b - 8. Calculate v(3). 49 Let d(j) = -2j - 27. Determine d(-11). -5 Let w(y) = 3y - 2. Give w(4). 10 Let x(z) = -46z - 728. Give x(-16). 8 Let y(q) = -2q - 15. Give y(-12). 9 Let j(u) = -u - 41. What is j(37)? -78 Let u(o) = 38o + 9. What is u(-1)? -29 Let t(w) = w*3 + 3w*2 + 2. Give t(-2). 6 Let z(r) = 2r*3 - 29r*2 + 16r - 33. Determine z(14). -5 Let j(l) = 14l2 + 6l + 6. What is j(-1)? 14 Let h(s) = s*2 + 5s - 3. Give h(-6). 3 Let z(v) = -3v - 31. Give z(-11). 2 Let h(v) = 6v*2 - 3v + 1. Determine h(2). 19 Let q(b) = b*2 - 3b - 10. Determine q(5). 0 Let t(h) = -19h + 2. Give t(7). -131 Let y(g) = 7g*2 - 3g - 15. Give y(-2). 19 Let g(q) = -3q - 2. Give g(10). -32 Let g(i) = i3 - 3i*2 - 8i + 10. What is g(4)? -6 Let s(w) = -3w + 3. What is s(1)? 0 Let q(g) = 3g3 - g2 - 5g - 2. Determine q(-2). -20 Let q(h) = -h2 + 8h - 8. Determine q(8). -8 Let b(c) = c*3 - 11c*2 + 24c - 14. Give b(8). -14 Let v(c) = -6c - 74. What is v(-13)? 4 Let b(w) = -4w + 11. What is b(5)? -9 Let l(b) = -37b2 - 6b - 6. Determine l(-2). -142 Let m(y) = 2y2 - 6y - 3. Give m(4). 5 Let y(j) = -j*2 - 49j + 136. Give y(3). -20 Let j(w) = -w*3 - 5w*2 - 7. Give j(0). -7 Let o(z) = -2z - 24. What is o(-10)? -4 Let b(z) = 10z - 3. Give b(-4). -43 Let v(y) = 2y - 4. Give v(0). -4 Let w(i) = -2i2 + 2. Give w(3). -16 Let l(x) = -x3 - x2 + 9x - 8. Give l(-6). 118 Let b(j) = -2j2 + 9j + 12. Give b(6). -6 Let t(n) = 30n - 98. What is t(3)? -8 Let v(c) = 23c + 137. Give v(-6). -1 Let h(o) = -64o3 + o2 + o - 1. What is h(1)? -63 Let y(z) = -z2 + z. What is y(-1)? -2 Let r(w) = w3 + 11w*2 + 6w - 6. Give r(-10). 34 Let c(j) = j*2 - 12j + 30. What is c(9)? 3 Let o(f) = -f*2 - f + 68. Give o(0). 68 Let p(n) = -87n*3 + 5n*2 - 3n - 2. Calculate p(1). -87 Let j(k) = 4k - 12. Calculate j(6). 12 Let f(g) = 2g*2 - 39g + 19. Give f(19). 0 Let o(q) = 2q + 30. Determine o(-16). -2 Let t(z) = z3 - 6z*2 + 13z - 17. Determine t(4). 3 Let v(t) = -t*3 - 9t2 - 9. What is v(-9)? -9 Let q(j) = -j3 + 4j2 + 6j - 4. What is q(5)? 1 Let a(b) = -b*3 + 20b*2 - 18b - 24. What is a(19)? -5 Let m(n) = -2n - 31. Calculate m(0). -31 Let t(j) = -16j - 23. Calculate t(-5). 57 Let t(s) = s*2 + 41s - 116. Give t(-44). 16 Let b(r) = 5r + 14. Calculate b(-3). -1 Let k(x) = -13x*3 + 3x + 2. Calculate k(-1). 12 Let q(l) = -2l + 8. Determine q(6). -4 Let t(c) = c2 - 6c - 30. Calculate t(11). 25 Let s(b) = b*2 + 16b - 22. Calculate s(-17). -5 Let x(p) = -6p2 + p + 1. Give x(-1). -6 Let n(s) = -3s*2 + 65s - 98. Calculate n(20). 2 Let a(p) = -p*3 - 12p*2 - 12p - 9. Determine a(-11). 2 Let z(n) = -n*3 + 32n*2 + 32n + 36. What is z(33)? 3 Let k(b) = 5b + 70. Give k(-17). -15 Let a(o) = 2o*3 + 49o*2 + 25o + 30. G	{ "pile_set_name": "DM Mathematics" }
- 514 = -4k. Let q(b) = -2b - 3. Give oy(t) - 7q(t). 2t + 3 Let w(s) = 2s*3 + 22s*2 + 20s + 20. Let m(z) = z*3 + 7z*2 + 7z + 7. Suppose 5t + 4a = 21, -2a = -12t + 14t - 8. Calculate tw(p) - 14m(p). -4p*3 + 12p*2 + 2p + 2 Let g(c) = -3c2 + 2. Let o(s) = 13s2 - s - 8. Let y(k) = k2 + 6k - 47. Let p be y(-18). Suppose -9 = -168i + pi. Determine ig(w) - 2o(w). w2 + 2w - 2 Let w(q) = -q*2 - 7q. Let i(m) = -27m2 - 30m + 1. Determine -i(v) + 6w(v). 21v*2 - 12v - 1 Let h(x) = x*2 - 5x - 8. Let v be 1(-23 - 0). Let q(k) = 16 - 2k + 24 + k - 59 + 18. Give vq(p) + h(p). p2 + p - 2 Let t(v) = -v3 - 5v2 - 6. Let u(w) be the first derivative of 251 - 2w*3 - 1/4w*4 - 7w - 1/2w2. Determine 6t(d) - 5u(d). -d3 + 5d - 1 Suppose -40 = 576t - 584t. Let l(j) = -84j2 + 32. Let b = -13 + 16. Let n(d) = 0d*2 + 3d*2 + 10d*2 - b - 2. Give tl(f) + 32n(f). -4f*2 Let f(g) be the first derivative of 7/4g*4 + 0g*2 + 3g*3 + 230 + 13g. Let x(r) = 3r3 + 4r*2 + 6. What is -6f(a) + 13x(a)? -3a*3 - 2a*2 Let f be ((-140)/16 + 8)/((-2)/80). Let l(u) = 25u + 23u + 21u - 97u - 2 + fu. Let r(x) be the first derivative of x*2/2 - x - 1. What is 2l(w) - 6r(w)? -2w + 2 Let v(i) = 4i2 + 5i + 8. Let r(o) = 3o2 + 8o + 12. What is -2r(z) + 3v(z)? 6z2 - z Let l(v) = 111v*2 - 12v - 18. Let b(q) = -220q2 + 21q + 39. What is 6b(r) + 13l(r)? 123r2 - 30r Let f(k) = 6k3 - 2k*2 - 25k - 37. Let y(v) = -16v3 + 6v*2 + 74v + 112. Calculate -11f(d) - 4y(d). -2d3 - 2d*2 - 21d - 41 Let c(q) = -7q + 34. Let o(u) = 13u - 95. Determine -7c(m) - 4o(m). -3m + 142 Let y(o) = -o + 751. Let h(i) = 2i - 1499. Calculate -4h(m) - 10y(m). 2m - 1514 Let k(y) = -y3 + 2y - 1. Let j(m) = 40m3 + m2 - 6m + 3. What is j(q) + 4k(q)? 36q3 + q2 + 2q - 1 Let o(h) = 66h - 11. Let c(y) = 197y - 29. Calculate -4c(u) + 11o(u). -62u - 5 Let o(f) = -22f. Let i be 163 + -159 + (1081 - 1)/(-2). Let t = -539 - i. Let n(c) = -11c. Determine to(m) + 7n(m). -11m Let c(d) = 2d*2 - 3d + 8. Let y(j) be the third derivative of j5/20 - j4/6 + 3j3/2 + 7248j*2. Determine -6c(b) + 5y(b). 3b*2 - 2b - 3 Suppose -1207 = -56i - 1263. Let x(p) = 6p + 3. Let s(n) = n + 1. Calculate ix(v) + 4s(v). -2v + 1 Let m(u) = -3u - 1. Suppose 4t + 0t = -2c + 26, -30 = -5c - 3t. Let l(k) = 2k. Give cm(r) + 5l(r). r - 3 Let n(d) = 5d - 23. Let f(g) = 7g - 34. Let i(j) = -2f(j) + 3n(j). Let c(v) = 20v2 - 11v + 11. Determine -2c(u) - 22i(u). -40u2 Let h(v) = -14v*3 - 61v*2 - 5v - 10. Let o(m) = 7m3 + 31m*2 + 2m + 4. Give -4h(f) - 10o(f). -14f3 - 66f*2 Let o(g) = -10g + 10. Let m(q) be the first derivative of -2q2 + 4q + 64. Let w(f) = 12m(f) - 5o(f). Let i(r) = 1. Give 5i(s) - w(s). -2s + 7 Let b(i) = 9i. Let y(q) = -611q + 3687. Let n be y(6). Let k(h) = 35h. What is nb(l) - 5k(l)? 14l Let d(h) = -1177h3 - 36h*2 - 22h - 9. Let f(o) = 589o3 + 16o*2 + 10o + 4. What is -4d(s) - 9f(s)? -593s3 - 2s Let d(i) = i*2 - 3i - 37. Let z(f) = 514 + 499 - 1049 - 8f + 4f + 2f2. Calculate 4d(w) - 3z(w). -2w2 - 40 Let l(b) be the second derivative of b3/6 + b*2/2 + b. Let r(g) = 3g + 2. Let s(p) = 4p2 - 7p - 1314. Let c be s(19). Determine cr(t) + 6l(t). -3t Let z(x) = -5x*2 + 2x + 6. Let s = -17364 - -17357. Let j(v) = 3v2 - v - 4. Calculate sj(r) - 5z(r). 4r*2 - 3r - 2 Let m(q) = -q3 - q2 + 1. Let k(n) = -5n3 - 631n*2 + 3. Give -k(i) + 3m(i). 2i3 + 628i2 Let s(h) = h2. Let q(f) = 3f2 - 5f - 1. Suppose -3w + 21 = -2j, 11w - 12w + 5j + 20 = 0. Calculate ws(a) - q(a). 2a2 + 5a + 1 Let o(u) = -u + 1. Suppose -8z - 450 = 40z - 162. Let w(v) = v*2 - 4v. What is zo(h) + w(h)? h2 + 2h - 6 Let k(r) = 73203r3 + 143r*2 - 143r - 143. Let i(n) = -1031n3 - 2n*2 + 2n + 2. What is -143i(v) - 2k(v)? 1027v3 Let x(t) = 14t*2 + 13t. Let n(y) = 9y2 + 9y. Suppose -12w = -19w + 175. Suppose -5v + 0v + w = 0. Determine vx(i) - 8n(i). -2i2 - 7i Let x(d) = 1677d - 123. Let s(a) = -1677a + 148. What is 5s(b) + 6x(b)? 1677b + 2 Let j(u) = 2175u*3 + 6u*2 - 2u - 14. Let i(z) = -8698z3 - 26z*2 + 9z + 62. What is -2i(p) - 9j(p)? -2179p3 - 2p*2 + 2 Let n be (-12)/(-128)-4 - (-5286)/16. Let u = -337 + n. Let i(l) = -2l2 + 4l - 2. Let q(j) = 5j2 - 9j + 5. Determine ui(x) - 3q(x). -x*2 - x - 1 Let y(i) = -6i + 16. Let k be 14 + -18 + (5/(-1) - -8). Let w(l) = l - 1. Calculate ky(b) - 3w(b). 3b - 13 Let h(s) = -10s*2 - s - 11. Let v = -374 - -385. Let j(k) = -2k*2 - 2. What is vj(f) - 2h(f)? -2f*2 + 2f Let m(y) = 14y - 661. Let l(o) = 18o - 656. Calculate -3l(j) + 4m(j). 2j - 676 Let m(v) = -15v*2 - 30v + 41. Let b(f) = -2f2 - 5f. Give 6b(j) - m(j). 3j*2 - 41 Let p(i) = -2i*2 + 7i - 1. Let r(w) = -65w + 73w - 1 - 7613w2 + 7612w*2. Calculate -6p(l) + 5r(l). 7l*2 - 2l + 1 Let h(y) = -3y - 1. Let w be 9(-7)/((5 - 8)-1). Let g(b) = 19b + 8. Let m(r) = wh(r) - 3g(r). Let l(i) = 7i - 3. Give -3l(o) + 4m(o). 3o - 3 Let i(g) = -24g2 + 5g + 5. Let f(y) = -120y2 + 24y + 24. Let r be (15 - 0)(-18 - (-1066)/65). Determine ri(q) + 5f(q). -24q*2 Let f(c) = -11c + 5. Let y(r) = 6r - 2. Let i(d) = 3f(d) + 7y(d). Let h(v) = 14v + 1. Let q = -26 + 32. Suppose 4k - 38 = -q. Calculate ki(m) - 5h(m). 2m + 3 Let d(h) = h*3 - 3h*2 - 9h - 25. Let f(t) = t*2 + t + 8. Determine 2d(w) + 6f(w). 2w*3 - 12w - 2 Let o(f) be the second derivative of -5f3/6 - f2 + 3129f. Let p(a) be the third derivative of 11a4/24 + 2a*3/3 - 4a*2. Determine -13o(t) - 6p(t). -t + 2 Let g(u) = -u2 + 8u - 10. Let r be g(7). Let t(c) = -1 + c*2 - 2c + 2c + 75c*3 - 24c*3 + 3c - 54c3. Let i(d) = d. Determine ri(v) + t(v). -3v3 + v2 - 1 Let n(s) = 6s*3 + 7s*2 - 4s - 7. Let z(j) be the second derivative of -5/6j3 - 2j + 0 - 4j2 + 7/20j*5 + 2/3j*4. What is 5n(b) - 4z(b)? 2b*3 + 3b*2 - 3 Suppose 592h - 136 = 660h. Let r(x) = x3 - x2. Let y(t) = -5t*3 + 2t*2 + 4. Determine hr(g) - y(g). 3g3 - 4 Let q(b) = 749b + 5. Let d(h) = -2240h - 13. Give -3d(z) - 8q(z). 728z - 1 Let p(j) be the second derivative of -j3/6 - j2/2 + j. Let g be 2 + (17 - (-167 + 175)). Let f(b) = -b3 - b - 1. Determine gf(a) - 2p(a). -a3 + a + 1 Let a(t) = -10t - 19. Let p(x) = -16x + 19. What is -7a(u) - 6p(u)? 166u + 19 Let l(u) = -39u + 113. Let k(s) = 5s - 15. Let d(f) = 15k(f) + 2l(f). Let x = -5 - -7. Let v(z) = 4z - 1. Let a be 2 + 4 + -6 + 3. What is ad(c) + xv(c)? -c + 1 Let w(i) = 29i + 3242. Let d(u) = 130u + 12970. Calculate -2d(c) + 9w(c). c + 3238 Let l(r) = 5r*2 - 7r - 1. Let t(z) = 5z2 - z + 4. Let a(m) be the first derivative of -m3/3 - m - 80. Let d(h) = -4a(h) - t(h). Give 14d(v) + 2l(v). -4v2 - 2 Let z(v) = 6v - 2701 - 2686 + 5363. Let u(j) = 2j - 8. Determine 7u(a) - 2z(a). 2a - 8 Let q be (-68)/29/18. Let g(d) = 6d - 37. Let c(p) = 2p - 12. Calculate qc(r) + 6g(r). 2r - 18 Let j(x) = -1684x3 - 10x*2 + 15x + 8. Let c(a) = 4211a3 + 26a*2 - 39a - 21. Calculate -5c(l) - 13j(l). 837l3 + 1 Let r(w) = -w2 + 59w + 109. Let n(j) = -j*2 + 32j + 55. Determine -11n(b) + 6r(b). 5b2 + 2b + 49 Let b(g) = 4g3 - g2 - 6g - 5. Suppose 115z - 76z - 132 = 61z. Let x(r) = -r3 + r. Give zx(f) - b(f). 2f3 + f2 + 5 Let i(n) = -3n - 2. Let l(t) = -12t - 41. Let p(j) = -27j - 95. Let r(v) = -7l(v) + 3p(v). Calculate -4i(w) - 3r(w). 3w + 2 Let s(i) = 376798i - 15822. Let r(h) = 6441h - 270. What is -293r(n) + 5s(n)? -3223n Let a(y) = -9y - 3. Let x = -36 + 40. Let q(i) = -1 + 3 - 6 + 5 + xi. Let f be 15/20(-8)/(-2). Give fa(l) + 7q(l). l - 2 Let p(o) be the first derivative of -o3 + 3o*2 - 5o + 67. Let m be (-2)/4 - (-319)/58. Let k(f) = 3f2 - 7f + 6. Determine mk(h) + 6p(h). -3h2 + h Let o(g) = 52g*2 - 39. Let r(j) = -3j*3 + 4j*2 + 2j + 2. Let d be r(2). Let f(c) = -c*2 + 1. Give do(u)	{ "pile_set_name": "DM Mathematics" }
= -4a3 - 4a*2 - 6a - 2. Give -n(y) + 6s(y). -2y*3 - 2y*2 + 2 Let c(z) = 17z. Let o(k) = -459k. Calculate 136c(a) + 5o(a). 17a Let p(u) = 18u - 10u + 1 - 7u. Let v(d) = 2d*2 - 2d - 1. Give -2p(m) - v(m). -2m*2 - 1 Let v(p) = p. Let k(y) = -4y - 1. Suppose 9 = -5g - 6. Let s = -1 - g. Calculate sk(q) + 9v(q). q - 2 Let h(u) = -1. Let a(j) = j3 - 13j*2 + j - 14. Let o be a(13). Let i(f) = -f + 1. Give oi(y) - 2h(y). y + 1 Let y(i) = -3i + 8. Let m(b) = 1. Let v = -25 - -26. Calculate vy(l) - 6m(l). -3l + 2 Suppose 3s - 6 = -3w, -5s = w - 0 + 2. Let z(h) = 2h - 2 - 4h + w - h*2. Let i(y) = -1. Let t = 0 - 1. Determine ti(j) + z(j). -j*2 - 2j + 2 Let a(j) = 7j2 + 2j + 1. Let d(p) = p*2 + p - 1. Give -a(g) + 2d(g). -5g2 - 3 Let r(i) = 4i + 1. Let q(f) = -11f - 2. Let m be 12 + (-3 - -6)/(-3). Let o = 8 - m. Let h(w) = -w2 + w - 8. Let j be h(0). What is jr(t) + oq(t)? t - 2 Let j(w) = -4w. Let m(c) = -1. Calculate -j(p) - 6m(p). 4p + 6 Let k = 21 + -16. Let w(y) = -6y2 + 5. Let d(t) be the third derivative of 7t5/60 - t3 + 4t2. Determine kd(c) + 6w(c). -c2 Let r(n) = 3n*3 - 8n*2 - 8n + 8. Let u(o) = o*3 - 3o*2 - 3o + 3. Suppose -3p - 35 = -4j, -3j + j - 2p + 14 = 0. What is ju(v) - 3r(v)? -v*3 Let u(g) = g - 1. Let a(z) = -4z + 5. Let h(b) = -2a(b) - 11u(b). Let s(d) = -d. Give -h(k) + 5s(k). -2k - 1 Let c(u) = 4u + 4. Let k(o) = -o - 1. Calculate 4c(x) + 18k(x). -2x - 2 Let k(u) = 6u3 + 5u - 4. Let p(m) = 3m3 + 2m - 2. Determine -2k(f) + 5p(f). 3f3 - 2 Let p(r) = 4r + 5. Let b(j) = -j*3 - 2j*2 + 8j + 3. Let d be b(-4). Let v(h) = h + 1. Calculate dv(g) - p(g). -g - 2 Let s be 15/(-10)(15/(-9) + 1). Let n be 2/(-4) - 28/(-8). Let d(m) = m + 5. Let b(g) = -1. What is nb(j) + sd(j)? j + 2 Suppose 2j - 4 = 6j, 5 = -5s + 5j. Let z(q) = -2 + 3q - 7q + 3q + 3q. Let r(t) = -t + 1. Determine sz(o) - 3r(o). -o + 1 Suppose 0 = 5b - 10 - 0. Suppose bm - 16 = -38. Let l(y) = 7y2 + 2y. Let w(h) = 6774 - 6774 - 4h - 13h*2. Give ml(p) - 6w(p). p2 + 2p Let g = -11 - -16. Suppose -4h + 3o - 31 = 0, h - 4 - 17 = -go. Let n(l) = 4 - l + 0 + 7 - 16l. Let m(i) = 6i - 4. What is hn(j) - 11m(j)? 2j Suppose 2s + 2c = 4c - 2, -5 = 3s - c. Let n(k) = 4k2 - k - 3. Let g(t) = -2t*2 + 1. What is sn(h) - 5g(h)? 2h*2 + 2h + 1 Let g(a) = a + 1. Suppose -2s - 10 = 3s. Let n(l) = -2l - 1. Let p(d) = sn(d) - 5g(d). Let o(m) = -m - 1. Determine -4o(q) + 2p(q). 2q - 2 Let i(t) = 2t3 - t - 3. Let s(a) = -a3 + a + 1. Suppose 4w = 12, 9m - 4m = -w - 2. Determine mi(q) - 3s(q). q*3 - 2q Let y(o) = -6o2 - 11o + 11. Let f(j) = -j*2 - 2j + 2. Let s = 7 + -3. Let a = -24 + 2. Give af(t) + sy(t). -2t2 Let x(j) = 9j - 6. Let i(r) = -4 + 1 - r + 6 - 2. Determine -6i(s) - x(s). -3s Let m(z) = -z3 + z2 + 1. Let s(d) = 9d3 - 8d*2 - 6. What is -14m(t) - 2s(t)? -4t*3 + 2t*2 - 2 Let z(s) = 4s*2 + 4. Let l(t) = 15t*2 + 7t + 9. Let m(h) = 14h2 + 6h + 9. Let a(w) = -5l(w) + 6m(w). What is -2a(v) + 5z(v)? 2v2 - 2v + 2 Let z(h) = 4h2 + 2h + 4. Let j(t) = -2t2 - t - 2. Calculate -13j(n) - 6z(n). 2n*2 + n + 2 Let t(r) = -3r2 + r - 1. Let i be t(1). Let l(z) = -z3 - 2z2 + z - 2. Let p(b) = -b3 - 3b*2 + 2b - 3. Calculate il(q) + 2p(q). q*3 + q Let o(c) = -c - 1 - 2c + 7. Let t(a) = 0 + 0 + 2 - 1. Let j(l) = 7l - 18. Let f(b) = j(b) + 5t(b). Give 4f(v) + 9o(v). v + 2 Let a = -101 + 105. Let t(w) = 2w - 6. Let i(z) = -z - 3z + 7 + 2z. What is ai(b) + 5t(b)? 2b - 2 Let s(o) = o + 2. Let c(b) = -b - 5. Suppose -d + 5 = -4k - 8, -17 = -5d - 4k. Give ds(j) + 2c(j). 3j Suppose 7u = 2 - 30. Let p(g) = 5g*2 - 3. Let h(f) = -6f*2 + 4. Give up(d) - 3h(d). -2d*2 Let x(k) = -17k*2 + 14k + 13. Let v(m) = -8m2 + 7m + 6. What is 13v(n) - 6x(n)? -2n2 + 7n Suppose -4p = -0p - 5i - 69, i - 63 = -4p. Let l(k) = k - 5. Let h(o) = o - 27 + 5o + 1. What is pl(f) - 3h(f)? -2f - 2 Let a(j) = j*3 + 3j*2 + 4j. Let d(u) = 5u + u3 + 0u*2 + 2u*2 + 2u*2 + 0u*3. Determine -3a(n) + 2d(n). -n3 - n2 - 2n Let n(d) = -d - 1. Let i = 43 + -44. Let l(x) = -x*2 + 6x + 7. Determine il(q) - 5n(q). q*2 - q - 2 Let b(f) = 7f - 5. Let s(x) = 3x3 + 2x*2 + 2x + 1. Let m be s(-1). Let k(j) = 3j - 2. Give mb(c) + 5k(c). c Let z(t) = t + 1. Let d(j) = -j3 + 4j + 3. Determine -d(p) + 6z(p). p3 + 2p + 3 Let h(f) = -16f2 - 3f - 3. Let w(j) = -817j2 - 152j - 152. Calculate -152h(y) + 3w(y). -19y2 Let z(d) = -2d*2 + 6d - 4. Let b(g) = -3g + 14. Let i(t) = -t + 5. Let h(q) = 4b(q) - 11i(q). Determine -5h(v) - z(v). 2v2 - v - 1 Let j(u) = -7u. Let w(k) = k - 2. Let l(y) = -12y + 27. Suppose -3z + 2z = 27. Let a(b) = zw(b) - 2l(b). Calculate -10a(c) + 4j(c). 2c Let u(q) = -5q - 2. Let n(a) = 4a + 1. Let g(l) = -4l - 1. Let b(j) = 5g(j) + 6n(j). Give -3b(d) - 2u(d). -2d + 1 Let o(j) = -3 - 6j2 + 3j*2 + 2j*3 + 5 + 6j*2. Let r(n) = -2n*3 - 4n*2 - 2. Give 4o(c) + 3r(c). 2c*3 + 2 Let z(c) = -6c*3 + 4c. Let s(d) = d*3 - 2d2 - d + 2. Let q(i) = -i2 + 1. Let b(p) = 2q(p) - s(p). Calculate -4b(u) + z(u). -2u3 Let t(w) = -w + 3. Let d(i) = -i. What is 3d(p) - t(p)? -2p - 3 Let j(f) = -2f*3 + 4f*2 - 4f - 4. Let z(b) = -3b3 + 5b*2 - 5b - 5. Suppose -20 = -p - 5s, -3s = -p + 5p + 5. Determine pj(r) + 4z(r). -2r*3 Let a(v) = 51v - 7. Let h(p) = 102p - 13. Calculate -11a(f) + 6h(f). 51f - 1 Let m(b) = -1. Let n(s) = -22s - 14. Calculate -12m(r) + n(r). -22r - 2 Let o(m) = m3 + m2 + 1. Let k(r) = -r3 - 2r*2 - 3r - 2. What is 2k(t) + 4o(t)? 2t3 - 6t Let l(j) be the third derivative of j*4/4 + 2j3/3 + j2 + 15. Let s(u) = -u + 9. Let c be s(5). Let i(k) = 1 - 4 - 7k - 2. What is ci(t) + 5l(t)? 2t Let j(o) = o*2 + o - 1. Let p = 18 + -14. Let w(m) = 1 + 0m + 5m + 2m*2 - p. What is -3j(f) + w(f)? -f*2 + 2f Let z(a) = 5a3 + 4a*2 + 4. Let f(v) = v - 10. Let w be f(14). Let i(q) = -2q - 11 + 2q - 11q*2 - 14q*3. Determine wi(t) + 11z(t). -t3 Let z(j) be the second derivative of j3 - 2j*2 - j. Let v be (-4)/(-2) - (-18)/9. Let u(y) = -y + 1. Let w be 1/3 - 4/(-6). Determine vu(f) + wz(f). 2f Let z(p) = -p*3 - 5p*2 - 2. Suppose -4c = 4d, 3c - 4 = 2d - 7d. Let g(l) = -l*3 - 2l*2 - 1. What is cz(b) + 5g(b)? -3b3 - 1 Let d = 4 - 3. Let y be (15/6)/(d/(-2)). Let a(i) = i2 - i. Let b(o) = o*3 + 4o*2 - 5o. What is ya(m) + b(m)? m3 - m2 Let r(h) = -h3 + 1. Let f(d) = 5d*3 - 6. Suppose 5g - 35 = -5j, 5g - 2 + 7 = 5j. Suppose -2x + 14 = gt, 3t - 16 = t + 2x. What is tr(c) + f(c)? -c3 Let f(r) = r3 + 16r2 + 2r + 10. Let a be f(-16). Let i(q) = -4q - 2. Let s(x) = -15x - 7. Calculate ai(o) + 6s(o). -2o + 2 Let f(s) = -5s - 3. Let r(k) = -k + 1. Calculate f(c) + 4r(c). -9c + 1 Let r(v) = v + 1. Let p(a) = -2a - 2. Let m be (-2)/3 + (-14)/6. Let g = 5 + m. Let n be 2 + 0 + (-1 - -2). Determine gp(j) + nr(j). -j - 1 Let s(w) be the first derivative of 3w*4/4 - 5w*2/2 + 5w - 28. Let h(c) = -4c3 + 6c - 6. What is -5h(b) - 6s(b)? 2b3 Let j be (7 - 4)(-2 - -1). Let h(c) = -2c2 + 2c + 5. Let p(d) = 2d2 - 2d - 6. Give jp(b) - 4h(b). 2b2 - 2b - 2 Let l(z) = -16z3 - 10z*2 - 7z. Let r be 13/(-3) + 2/(-3). Let b(y) = 11y3 + 7y*2 + 5y. Calculate rl(g) - 7b(g). 3g3 + g2 Let o(f) = 24f - 3. Let q(u) = -8u + 1. What is 3o(z) + 8q(z)? 8z - 1 Let a(x) = x*3 + 2x2. Let r(f) = f3 + f*2. Give a(j) - 3r(j). -2j3 - j2 Let g(d) = 90d*3 + 27d*2 + 27d + 27. Let w(r) = 7r3 + 2r*2 + 2r + 2. Determine 2g(b) - 27w(b). -9b3 Let i(f) = f2 + f + 1. Let v(n) = -7n*2 - 6n - 10. Determine -10i(q) - 2v(q). 4q2 + 2q + 10 Let s(x) = 6x2 + 4x - 3. Let v = -2113/6 + 353. Let u(f) be the second derivative of -f - 7/12f4 - vf*3 + 2f*2 + 0. Give -5s(l) - 4u(l). -2l2 - 1 Let c be (-4)/1 - (6 - 4). Let v(g) = -g2 + 6g + 3. Let r(u) = u2 - 7u - 4. Determine cv(p) - 5r(p).	{ "pile_set_name": "DM Mathematics" }
3132 = -166d + 2844. Let u(p) = p2 - 39p + 93. Calculate u(d). -15 Let v be (127/(-127))/((-4)/(-14))24/42. Let q(a) = a2 - 4a + 3. Let k be q(4). Let p(m) = m*3 - 3m*k + 1 - 3m2 + m3. Determine p(v). -3 Let l(b) = -b*2 + 11. Suppose -4j - 2o = -0j - 8, 16 = -3j + 4o. Suppose 6d + 6 = j, -2p = 3p + 5d + 5. Give l(p). 11 Let o(c) be the second derivative of -c*4/12 - 3c*3/2 - 3c*2/2 + c. Suppose -120d + 189 = 1149. Calculate o(d). 5 Suppose 739d - 748d = -9. Let q(f) = 2f2 + 16f*2 - 23f2. Give q(d). -5 Let v(k) = k + 13. Let n(u) = -u3 - 7u2 - 10u + 2. Let o be n(-5). Let w(r) = 2r + 14. Let a(q) = ow(q) - 3v(q). Give a(9). -2 Let i(j) = 4j*3 - 5j*2 - j - 6. Let r(b) = -4b*2 + b + 97. Let g be r(5). Calculate i(g). 4 Let r(a) = 10 + 79a*2 - 19 + 6a - 20a2 - 30a2 + a3 - 23a2. What is r(-5)? -14 Let t(c) = -c2 - 10 - 375c + 202c + 180c. Suppose -8 + 71 = 9y. Give t(y). -10 Let x(o) = o - 6o*3 + 6o*3 + 23o*2 + 15o*3 + 14o*3 - 30o3 - 20. What is x(23)? 3 Let u(q) be the second derivative of -q5/20 - 3q4/4 - 11q*3/6 - 3q*2 + 286q + 8. What is u(-7)? -27 Let f(v) = 3v3 + 15v*2 - 28v - 27. Let o(m) = -2m3 - 10m*2 + 18m + 17. Let s(j) = 5f(j) + 7o(j). Determine s(-7). -16 Let j(s) be the third derivative of 1/60s5 + 2/3s*3 - 188s*2 + 5/24s*4 + 0s + 0. Calculate j(-3). -2 Let x(s) = -72s + 23. Let c be x(2). Let j be 2/(-4) - c/(-22). Let i(p) = -p3 - 5p*2 + 8p + 9. Calculate i(j). -3 Let w(r) be the second derivative of -7r3/3 + 36r*2 + 48r. Let s be w(5). Let z(x) = -x*2 + 2x + 1. Give z(s). 1 Let t = -21477 - -21479. Let h(p) = 10p - 33. Calculate h(t). -13 Suppose 2h = -2h - 4. Let v(w) be the second derivative of -1/2w*2 + 8w + 1/2w4 - 1/3w3 + 5. Determine v(h). 7 Let c(r) = r2 - r - 2. Suppose 0 = 2j - 0 - 4. Suppose 1 + 3 = jy. Suppose 3n = yw - 2, 2w + 0w = 2n. What is c(n)? 4 Let f(j) = j2 + 42j - 9. Let g(a) = 2a2 + 62a - 11. Let d(o) = -8f(o) + 5g(o). Give d(12). -7 Let x(b) = -3b3 - 3b*2 - 2b. Let h be x(-1). Let y(m) = 190m2 + 3 - 191m*h + 13. Determine y(0). 16 Suppose 563 - 318 = 112q - 427. Let d(w) = 5w - 1. Give d(q). 29 Let i(c) = -59 - c2 - 429921c + 429928c + 2c2. Calculate i(-11). -15 Let w(j) be the second derivative of -j6/120 - 11j5/60 + j4/24 + 13j*3/6 - 23j*2 + 13j. Let n(q) be the first derivative of w(q). Determine n(-11). 2 Let w(m) = m*3 - 5m*2 - 3m - 8. Suppose -3p - 5i + 515 + 203 = 0, 0 = -3i + 6. Let f = p + -230. Give w(f). 10 Let o(b) be the second derivative of b4/12 + 5b*3/3 + 21b*2/2 + 12b + 1. Suppose -10u - 54 - 16 = 0. Give o(u). 0 Let x(s) = 0s + 5s2 + 3s + 2 - 3s. Let q be 472/177 - 112/24. Determine x(q). 22 Let h(t) = 3t - 44. Let m(f) = 45f + 2520. Let a be m(-56). Give h(a). -44 Suppose 679x - 662x + 221 = 0. Let o(k) = k2 + 13k + 10. What is o(x)? 10 Let l(u) = -5u + 63. Let h(n) = n2 + 37n + 326. Let t be h(-13). Give l(t). -7 Let r(u) be the third derivative of -u4/12 - u3/3 + 15u2 - 106. What is r(-15)? 28 Suppose -2 = h - p + 4, 4h = 3p - 23. Let f(q) = q2 + 4q - 1. Let r be f(h). Let t(b) = -b*2 + 6b - 3. What is t(r)? 5 Suppose 57 - 1 = -2j. Let l = j - -43. Let o(b) = -lb - 15 + 12b + 3. Give o(-8). 12 Let q(n) = -6n*3 - 28n*2 + 40n + 34. Let z(j) = 5j3 + 28j*2 - 38j - 31. Let y(k) = -6q(k) - 7z(k). Determine y(27). -14 Let u(y) = -6y2 - 5y - 5. Let v(f) = -f*2 - f. Let s(g) = u(g) - 5v(g). Let p = 2965 - 2969. Give s(p). -21 Let d(p) = 2p2 + 2. Suppose 0 = 4i - f - 0f - 242, 4f = -8. Suppose 31y = y - i. Calculate d(y). 10 Let t(x) be the second derivative of 1/2x*3 + 0x*2 + 0 + 149x - 1/12x4. Calculate t(5). -10 Let p(o) = o2 + 13o + 14. Let x be p(-12). Let t(a) = 3ax - 3a - 10934 + 10934. Calculate t(2). 6 Let n(s) = -1131s - 9037. Let m be n(-8). Let o(c) = c3 - 12c*2 + 9c + 18. Calculate o(m). -4 Let j(o) = -5o - 2. Suppose 300 = -5d - n, 5d + 305 = -5n + 5. Let p = -53 - d. Suppose -3 = 2l + p. What is j(l)? 23 Let n(z) = z3 - 5z*2 + 5z - 4. Let h(d) = 87d - 69. Let g be h(6). Suppose 4p - g = -437. Determine n(p). 0 Let o be ((-231)/(-44) - 5)/(6/24). Let b(f) = -3f + 5f - 4f - f2 + 3. Let h(x) = 3x*2 + 4x - 7. Let m(r) = 5b(r) + 2h(r). Give m(o). 0 Let t = -7770 - -7770. Let m(v) = -v*2 + 4v - 37. Determine m(t). -37 Let c(i) = 28i - 117. Let l(j) = -93j + 396. Let b(s) = 33c(s) + 10l(s). Give b(17). -3 Let j be 2((-78)/36 - 4/3). Let d be (-4)/(-14) + (-95)/(-35) + 0. Let c(l) = -3l - 5 - 7l2 - dl2 - 3 - l3 + 3l2. Determine c(j). 13 Let y = -136 + 150. Let p(m) = -1 + ym*2 + 20m*2 - 33m*2 + 5m. Let k(f) = 2f2 + 9f - 2. Let x(l) = 6k(l) - 11p(l). What is x(3)? 5 Let d(p) = -3p - 42 - 40 + 83 + 2p. Let v(a) = 3a + 9. Let q(f) = 2d(f) + v(f). Determine q(-5). 6 Suppose 0 = -11g + 8g + 96. Suppose 44n - 36n - g = 0. Let p(d) = -d*2 + 2d + 1. Determine p(n). -7 Let p(b) = -342 + 701 - 2b - 356. Suppose -3f = 4k - 10, 5f + k - 7 - 21 = 0. What is p(f)? -9 Let l(y) = y - 2. Let z be ((-125)/(-20) + -5)28. Suppose -39b = -zb + 16. Give l(b). -6 Suppose -3w - 3 = 0, 0 = -0r + r - 5w + 12. Let d(n) = -n*3 - 18n*2 - 18n - 17. Let b be d(r). Let y(a) = -1 + a*3 + 0 + 8 + 3 - a. Determine y(b). 10 Let y = -10139 - -10144. Let z(x) = 0 + 2x - 5x + 7. Let j(f) = 4f - 8. Let p(g) = yz(g) + 4j(g). Determine p(-4). -1 Let v(f) be the first derivative of -88f2 + 11f + 87f2 + 2f + 49. Determine v(9). -5 Let x be 208/24 + -10 - 22/6. Let n(s) = -s*2 - 6s - 6. What is n(x)? -1 Let g(q) = 115q2 + 23. Let d(i) = 64i*2 + 11. Let v(n) = -9d(n) + 5g(n). Calculate v(3). 7 Let d(n) = n3 - 14n*2 + 14n - 3. Let z be d(13). Suppose -z = -8b - 2. Let x(y) = -16y3 - y2. Give x(b). -17 Let w(i) = -3i - 1. Let m be ((-2)/(-6))/(-3 + (-275)/(-90)). Suppose -5d - 3 = -md, d - 22 = -l. Suppose 11 - l = 4u. Determine w(u). 5 Suppose 0 = -n - 2a + 7, -3n + 0a + 17 = 5a. Let j(l) = 158l2 - 5l + 5. Let g(h) = -91h2 + 3h - 3. Let r(p) = 5g(p) + 3j(p). Determine r(n). 19 Let g(l) = -363 + 134 + 137 + 15l + 117. What is g(-2)? -5 Let u be 5/(-1) + 6 + -7. Let w(o) = o + 8. Let i(p) = -2p - 17. Let d(n) = ui(n) - 14w(n). Suppose 77q = 67q - 70. Give d(q). 4 Let u be (7/7)/(3/(-207)). Let k = u - -78. Let j(l) = -l*3 + 9l*2 + 2l - 13. What is j(k)? 5 Let r(t) = -3t + 13t + 8t - 122 - 5t. Let s be r(9). Let m(l) = -l*3 - 4l*2 + 8l + 7. Calculate m(s). -8 Let o(b) = -8b2 + b - 6. Let q(f) = 31f*2 - 3f + 20. Let y(u) = -11o(u) - 3q(u). Determine y(-2). -10 Let v(b) = -8b - 1. Let k = 17 - 10. Suppose -ku + 14 = 427. Let p = u + 58. Calculate v(p). 7 Let q(j) = -4j + 74. Let m(h) = 4h - 18. Let r(y) = 3m(y) + 2q(y). Calculate r(-19). 18 Let r(n) = 39n - 499. Let k be r(13). Let m(b) be the first derivative of -b3/3 + 3b*2 + 13b - 6. Give m(k). -3 Let u(f) = f*3 + 8f*2 - f - 10. Suppose 22 = -4b + 2a, -11b + 5a + 33 = -12b. Determine u(b). -2 Let d(v) = -1 + 408v - 16 - 421v - v*2. Give d(-14). -31 Let m(a) = 4a*2 - a - 2. Let w(q) = 13q*2 + 26q + 92. Let v(c) = 3m(c) - w(c). What is v(-25)? 2 Let q(f) = 3f*3 - 17f*2 - 29f + 15. Let b be q(7). Let d(z) = -11z - b + 4 + 2. Determine d(1). -13 Let k(i) = i3 + 12i*2 + 21i - 1. Let w be k(-10). Let g = w + 14. Let x(p) be the second derivative of -p5/20 + p4/4 - p*3/6 - 5p. Calculate x(g). -3 Let j(b) = b*3 + 2b*2 - 1. Suppose 2m + 389 = 3x, 0x - 2x - 404 = 2m. Let k = 201 + m. What is j(k)? 15 Let g(d) = d*3 + 2d*2 + 3d + 3. Let m be (32 + -27)/(-35)(0 + -21). Determine g(m). 57 Let c(p) = -303p - 1210. Let v be c(-4). Let g(q) be the third derivative of 0q5 + 0q - 1/120q6 - q2 + 0 + 0q*3 + 0q*4. Determine g(v). -8 Let x(h) = 5h + 66. Suppose 8p - 5p = -4b - 41, 5p - 38 = 3b. Calculate x(b). 11 Let w = 6 + -5. Suppose -4l + 5 = s, -3s - 3 = -6. Let m(f) = l - 6f - f2 + f3 + 0f2 - 15f*3 + 5f. Determine m(w). -15 Let b be (2 + -1)/((-10)/50). Let n(u) = -3	{ "pile_set_name": "DM Mathematics" }
e q. 17 Express (-60j - 1 - 7 + 53j)(-12j + 13 - 13)(2 + 0 + 1)(-1 - 3 + 3) as p + gj2 + hj and give h. -288 Express (-376z3 + 8884 - 268z*3 - 8882)(-z + 0z + 3z) - 5z4 + z4 + z4 in the form fz*4 + tz*3 + x + vz + sz2 and give f. -1291 Rearrange -261541f*2 + 6 + 261544f*2 + 1 + 0f*3 - 5f*4 + 2f*3 - 2f*4 to pf*2 + df + t + lf3 + wf*4 and give d. 0 Express (4 - 2 - 6)(-2 + 0 + 3)(-103p - 9755 + 9755) in the form dp + m and give d. 412 Express 562x*3 - 3x + 498x3 - 1172x*3 + 2x*2 - 1 in the form mx*2 + sx + ax3 + p and give a. -112 Rearrange 11d*2 - 8d*2 + 410 - 2d*4 + 8493d*3 - 8490d*3 to jd*2 + o + td + pd4 + yd*3 and give y. 3 Rearrange 8227810 - 8227810 - 6384o to xo + y and give x. -6384 Express 161 - 38x - 17x - 2x*2 + 307 + 57x + 158 as yx2 + w + tx and give y. -2 Express 259 - 55 - 206 - 1713d2 in the form vd + id2 + o and give o. -2 Express ((4 - 1 - 1)(-3 + 0 + 5) + 3 - 3 - 1 + 1 + 1 + 0)(6i - 223i4 - 2i*3 - 233i*4 + 454i*4 + 5) as p + bi*3 + si*2 + ui + ki4 and give u. 30 Express -7v*3 - 208v*2 + 208v*2 + (10v*2 - 3v*2 - 2v*2 + (-4 + 2v + 4)(0v - v + 0v))(3v - 8v - 2v) as jv*2 + y + kv*3 + dv and give k. -28 Express 222r3 + 533 - r2 - r - 220r*3 - 1678 in the form tr + jr3 + v + br*2 and give j. 2 Express -1083 - 409 + 2m - 3m - 1600 + 481 as t + gm and give t. -2611 Express -b*2 - 21b*2 - 15b*2 + (-2b - b*2 + 2b)(3 + 0 + 4) in the form n + lb + kb2 and give k. -44 Express 3f*3 - 6f*2 + 6f2 - f3 - 3344 + f + 2193 as mf + df*3 + q + rf*2 and give q. -1151 Rearrange -82h - 5h3 - 69h - 323h3 + 151h - 9h2 to rh*2 + t + ih + ch3 and give r. -9 Rearrange ((-2i + 2i - 2i)(5 - 1 - 2) - 2i + 3i + i)(-12i3 - 281i*3 - 455i*3) to the form p + ui*4 + ji*3 + si + wi2 and give u. 1496 Express 1512d + 958d - 460d in the form c + ld and give c. 0 Express -118c - 2 + 283c - 1 - 11 - 5c in the form nc + a and give a. -14 Express 592n*3 - 440n*3 + 3n*4 - 11n + 13n + 2519n*3 - 4n*4 in the form ln + k + bn2 + an*4 + hn*3 and give h. 2671 Express (-4g*3 + 4g*3 - 3g*3 + (0g - g + 3g)(-4g2 + 256g*2 + 4g*2))(-1 - 6 + 9) in the form og2 + cg + bg3 + v and give o. 0 Rearrange -3 - 2a + 3 + (-2 + 2a + 2)(-7836 - 4030 - 1066) to the form p + ua and give u. -25866 Express -1540 + 718 + 40x + 774 in the form ox + i and give o. 40 Rearrange 4 + 3735l + 46 - 3722l to the form g + hl and give g. 50 Express (-2029s - 878s + 1799s - 2197s - 2 - 145s)(5s + 0s - 2s) in the form zs + g + qs2 and give z. -6 Express 156 + 117 - 51 - 16 - 23u + 94 as k + iu and give i. -23 Express -4i - 33 + 4i2 - 13i*2 + i + 3i in the form bi2 + l + zi and give l. -33 Express (-1 + 4 - 1)(-9 + 14 + 5)(180 - 180 - 230a2) in the form r + ja + xa2 and give x. -4600 Rearrange b4 + 5b*3 - 2b*4 + 17b + 8b3 - 655868b*2 + 655867b*2 + 7b*3 to the form t + ab + lb2 + sb*3 + ub4 and give l. -1 Express -p2 - 25p + 15p + 795 + 10p + 2342 as l + fp + gp2 and give g. -1 Rearrange ((-2l + 1 - 1)(2 - 3 - 1) + 4l - 5l + 0l)(3173 - 50 + 3361 - 1458) to the form x + pl and give x. 0 Express r*2 - 3r*2 + 0r*2 + (-1 - 5 - 2)(-23r2 + 265r*2 + 82r*2) in the form o + qr*2 + gr and give q. -2594 Express -9 - 2c - 184 + 14c*2 - 12c*2 as nc + b + xc2 and give b. -193 Rearrange 3164s + 171s - 2067s + 4503s to ds + a and give d. 5771 Express -11b - 56b - 56b - 55b + 174b - 3198 as u + mb and give m. -4 Express (1405g + 78g - 232g)(-g + g + 2g2 + 2) in the form sg + rg3 + v + hg*2 and give s. 2502 Rearrange -9h*2 - 63h*4 + 117h*4 + 7h*2 - 56h*4 - 1255h*3 to the form p + fh + sh4 + uh*3 + mh*2 and give u. -1255 Rearrange 1041 - 318 - 2i - 325 - 258 - 245 to l + gi and give l. -105 Rearrange -17107 + 9f*3 + 2f4 - f3 + 17106 + 7f2 to the form rf*4 + qf*2 + wf*3 + hf + j and give j. -1 Express (-314 + d*2 + 217 - 10699d + 97)(-3d + 5d - 4d + (0 + 1 + 1)(d + 2 - 2) + d + 0d - 2d) as q + cd*2 + od*3 + id and give o. -1 Rearrange -765 - 42b3 - 8b*2 - 28b*3 - 41b*3 + 764 to the form rb*2 + a + nb*3 + ib and give a. -1 Rearrange -28 - 42 + 96n2 + 43n*2 + 71 to rn*2 + k + qn and give r. 139 Rearrange (-4l2 + l2 + 5l*2)(-4 - 4 + 1) + (-15l + 12l + 92l)(-3l + 3l - 2l) to kl*2 + o + rl and give k. -192 Express -46u + 2207u*2 - 19u + 93u - 28u as cu + j + au2 and give a. 2207 Rearrange (2 - n2 - 2)(20 + 20 - 18)(-143n + 58n - 224n - 147n - 176n) to a + mn*3 + qn*2 + tn and give m. 13904 Express (874d2 - 196d*2 + 310d*2)(18d + 4d*2 - 18d) as ud4 + s + hd + id3 + td*2 and give u. 3952 Express 46 - 3u*4 + 6u*2 - 87u + 3u3 + 0u*4 - 9u2 - u3 + 85u as pu + yu2 + au*4 + ru*3 + f and give y. -3 Express -7401d + 1172d + 416 - 416 in the form td + n and give t. -6229 Rearrange (154r - 1142 + 1142)(-r + 3r - r) + 3r + 4r2 - r2 - 131 + 138 to sr*2 + fr + t and give t. 7 Rearrange -3z + 1369z*2 - 642z*2 + 5 - 719z*2 to o + bz*2 + tz and give t. -3 Express (-1 - 3y + 1)(2y + 833y*2 + 884y*2 + 97 - 1713y*2) in the form sy*2 + hy + g + dy3 and give h. -291 Express (-29q - 209 + 209)(1925q*2 + 6 - 1923q*2 + 0) in the form cq + tq2 + oq*3 + a and give o. -58 Rearrange (-278b*2 + 3 - 3 + 761b*2 + 77b*2)(-2 + 5 + 26) to the form db2 + kb + g and give d. 16240 Rearrange 33 + 15 - m - 28 - 3m2 + 54 + 130 to am + f + um2 and give a. -1 Express (d - 4d + 0d)(16 - 27d - 16)(3d + 2d + 2d) in the form nd*2 + bd*3 + f + ud and give b. 567 Express 30o + 2o*2 - 122o + 4 + 79o in the form fo + s + mo2 and give f. -13 Rearrange 202b + 162 + 0b4 + 3b*3 - 196b - 5b2 - 161 + 12b*4 to vb + lb3 + i + qb*4 + fb*2 and give v. 6 Express 329s*3 - 273s*3 - 106s*3 + 49s + (-4s2 + s2 + 0s*2)(s + s - s) as qs3 + z + os + ts2 and give o. 49 Express (-464 + 242 + 238 - 7x*2)((1 - 3 + 1)(-4 - 1 + 4) + (2 + 4 - 4)(5 + 3 + 11) + 2 - 3 - 1)(4 - 3 + 0) in the form w + tx + ax2 and give w. 592 Express 19 - 128233n + 143998n - 19 in the form zn + u and give u. 0 Express (6 - 10 - 12 - 3)(217v + 21v - 67v) in the form wv + c and give w. -3249 Rearrange 485a - 69a3 - 269a - 224a to ya*3 + xa*2 + o + na and give n. -8 Express -296 + 1318l2 - 664l*2 - 111 - 655l*2 - 383 as ol*2 + gl + j and give j. -790 Rearrange (1073n3 + 2 - 376n*3 - 557n*3)(-3n + 3n + 2 - 2n) to the form g + ln*4 + qn*2 + mn*3 + cn and give c. -4 Express -8455s + 3793s + 3101s as c + os and give o. -1561 Express 0r3 - 1 - 356r + 1526r - r3 + 2315r - 570r in the form lr + or2 + jr*3 + s and give j. -1 Rearrange -1977 - 4h*3 + 0h2 + 992 + h2 + 1037 - 2h to the form ph*3 + qh + s + jh2 and give j. 1 Express q3 + 469q - 882 + q*3 - 2498 - 231q - 236q in the form b + yq + xq3 + pq*2 and give x. 2 Rearrange -118 + 170 + 219g*2 - 55 to jg*2 + w + ng and give j. 219 Express 5 - 7d - 5 + (0 - 2 - 3)(6d + 4d - 5d) + (4d + 0d - 2d)(-1 + 2 + 0) - d + 4d - 2d in the form s + nd and give n. -29 Rearrange (17535 + 33719a2 + 33693a*2 - 67414a*2)(-1 - 4a + 3a - 1) to the form ia3 + sa*2 + xa + y and give x. -17535 Rearrange 34r - 88r*4 + 65r*2 - 63r*2 - 94r*4 + 171r*4 to the form hr*3 + ir + nr4 + o + cr*2 and give c. 2 Express -3n*4 + 11n - 3n4 + 7n*4 - 101 - 2n*4 + 186n*2 - 2n*3 - 188n*2 as pn*4 + an*3 + mn*2 + bn + q and give a. -2 Express -12 + 13 - 11544k + 460k - 7520k + 418k + (-2 - 2k + 2)(3 + 0 - 4) in the form l + jk and give l. 1 Rearrange (-2c*2 + 9 - 9)(1924c + 1586c + 4069c - 3476c + 1675c) to the form vc*3 + ic*2 + f + lc and give v. -11556 Rearrange -4 - u - 591u4 - 17u*2 + 2u*3 + 597u*4 + 18u**2 to the form q +	{ "pile_set_name": "DM Mathematics" }
)/j)j))/(j12j13))(-5/2))(2/57) assuming j is positive. j(4075/1083) Simplify ((u/u*(7/4)u)/u*4)/(uu0)48u(-1)/(uu*1)(u*(-6/5)uu)/(u/(uu*(1/2))u) assuming u is positive. u*(-1089/20) Simplify (k(kk(7/5))/kk(1/5))/(k(-2))*(-9/8)k*(3/2)kk(-4)kk8/(k(2/5)/k) assuming k is positive. k(169/20) Simplify (((vv(-1/27))/(v/(v(4/5)/v)))/((v/(v(v/v(-7)vv)/v))/(v(-21/2)/v)))(-12) assuming v is positive. v(1478/45) Simplify (s/s(-1/5)s*4s*(-3/11)/(ss(-3/5)/s))/(s(1/3)s/s7s(ss/((s(7/4)/s)/s))/s(-2)) assuming s is positive. s(3923/660) Simplify ((n0)(6/7))(-1/63)/(n4/n1)(3/25) assuming n is positive. n(-9/25) Simplify (s*(6/7)s(2/7))(-15/4)/((s/(ss(-1)))(-43)/((s/(((ss*(-3/2)ss)/s)/s))/s(4/9))) assuming s is positive. s(5011/126) Simplify ((g(1/16)/g)/(g/((g/g(2/75))/g)))/(g(-4/25))(20/11) assuming g is positive. g(-22087/13200) Simplify (j/j(2/5))(5/7)/((j(-5)/j)/jj*3)(j*(1/2)j)*(-27/5)jj(4/5)/jj/(jj/j(1/9)j) assuming j is positive. j*(-2999/630) Simplify (dd*5dddd)/dd*(-1/5)(d(-1))(-25)((d(-1/2)d)/dd(1/3)d)(7/6) assuming d is positive. d(6259/180) Simplify (((rrr*(-15/8)r)/rr/(rr26))/(((r/r(-3/2)r)/r)/(r(6/11)r)))12 assuming r is positive. r(-7083/22) Simplify (((k/k*(2/15)(k/(k*(-3)k))/k)/((kk/k(1/6))/k(-2)))(-1/8))(-11/3) assuming k is positive. k(-319/720) Simplify ((((ll*26l)/l)/((ll/(llll(2/29)))/l))/((l/(l/l(-1/20)))/(lll/(l*(-5)/l)ll)))(-2/71) assuming l is positive. l(-23269/20590) Simplify (y(-33)yy(21/4)/y)/((y21y)/y(-3/47)) assuming y is positive. y(-9365/188) Simplify (u(-1/4))(-17)uu/(u*(3/4)u)uu*(-1/6)((u/(u/((uu(-1/6))/u)))/(u(-1/3)/u))/((u(-3/5)u)/u(2/5)) assuming u is positive. u(13/2) Simplify (l/(l/(l/(ll(-22))))lll(-37))/(l(-1/3)/l)(-33) assuming l is positive. l(-57) Simplify (((a*(2/3)aa)/aa(2/3))/(a(3/7)aa/a1))/((a(2/3))1/(a(1/5)(a/a0)/a)) assuming a is positive. a(46/105) Simplify ((u4/((u/u(1/11))/u)(u((u2u)/uu)/u)(-20))(14/11))26 assuming u is positive. u(-223860/121) Simplify ((h/h1h)/h)33/(h(-1))*(3/13)hh/(hh/h*(-4))hh4h(hh*(2/7)hh)/hh(h1/h)/hh assuming h is positive. h(502/91) Simplify ((s(-1/7)/(s/s(-11)))/(s/(s0/s)s)(1/38))28 assuming s is positive. s(-6502/19) Simplify (b(-5/2)b(2/9))/(b5b4)(bb6/bbbb1)(-4/7) assuming b is positive. b(-2069/126) Simplify (w(-1)w(2/13))/(w(-2/9)(w/(w*(-1)/w))/w)((ww(2/5))(-42))(1/5) assuming w is positive. w(-42073/2925) Simplify w2w/w*(-3/5)w/((ww(-4/9))/ww)((w(1/5)/w)/w)/w(w*6w(-2/5))/(w/w(-2/7))(29/4) assuming w is positive. w(-3121/1260) Simplify (g(7/2)/(g(-2/9)g)(gg/(ggg(-2/3)gg))(-5/3))/(((ggg(2/3))/g)(-4/15))(-6) assuming g is positive. g(41/18) Simplify ((z/(z/(zz*0)zz)z)*41/((zz/z*(3/7)z)/zzz(-5)))(-32) assuming z is positive. z(-544/7) Simplify ((z(1/15)/z17)/(z/(z(4/3)z)zz(-16)))3 assuming z is positive. z(-9/5) Simplify (x6/(xx(-9)))(-17)/((((x/(xx(3/7)x))/xx)/x)/(x/(x(-5/4)xx)))37 assuming x is positive. x(-3889/28) Simplify ((z/z(2/9)z(3/5)/z)/((z(-4)z)/(z(1/4)z)))/((z/z*(-3/8))/zz/z*(-4)(z*(-1/3)z)/zz6) assuming z is positive. z(-2309/360) Simplify (x/(x0x))(-3/13)/(x7x(4/7))((x(x(2/5)x)/xx)/x)(-49)(x(1/2))(2/21) assuming x is positive. x(-7993/105) Simplify r(-2/23)rr*27(r/(((r*36r)/r)/r)rr)/(r/(r/(r(r(rr(-32))/r)/rr))r) assuming r is positive. r(573/23) Simplify ((l/(l/(ll(3/14)/l)))3/(((lll*(-9/7)ll)/l)/(l/(ll(-5)/l))))(-1/90) assuming l is positive. l(-23/420) Simplify (((t(-1)t)(12/13)t/((((ttt/(t*(2/9)tt)t)/tt)/t)/tt)t(-1))(-25))(-9) assuming t is positive. t(-175) Simplify (((r/(r(-4)r))/r*5)/(r(rr/((r/(r6r)r)/r)r)/rrrr/r5))/((r(-1))(-3/44))(3/2) assuming r is positive. r(-713/88) Simplify ((ff*(-1/7)f)/f*(-3/8))/(f/(ff*(-6)f)f(-2/31)/f)fff*(-3/4)/fff/f2f/f*(-3)f1 assuming f is positive. f(6157/1736) Simplify (r/(((r(r/((r(3/5)/r)/rr))/r)/r)/rr)rr2)45((rr(-5))/(r/(rrrr*9/rr)r))/(r(-4)/(r/r(-5))) assuming r is positive. r178 Simplify (u/u21)/(((uu(u/(((u/((u/u(2/29))/u))/u)/uu))/uu)/u)/u)(u/(u(u13/u)/u))(-3) assuming u is positive. u(350/29) Simplify ((o(1/15))30/((o/o(-1/5)o)/((o/(o/o(-1)))/o)))6 assuming o is positive. o*(-66/5) Simplify (((zz(2/27))/z)21/(((zz/(zz/(z/(((zz/(z18z)z)/z)/z)z))z)/z)/(zz*(-20)z)))(2/17) assuming z is positive. z(-656/153) Simplify (c/(c(c(1/2)c)/c)cc)(28/5)/((c6c)/c(-2/7))(c*(3/7)c/(((c/(c((c(3/4)c)/c)/cc))/c)/c)c)22 assuming c is positive. c(8053/70) Simplify (w*(-1/7)/(w/(((w/(w((ww(3/13)w)/w)/w))/w)/w)))*(-5/7)(w0/w)(2/17)(ww*(-1/2)w)39 assuming w is positive. w(1316635/21658) Simplify (((b/b*(-6/7))/bb/(b*10/b))/((b/(b/(bb5)))/((b(-5/7)/bb)/b)))(-1/9) assuming b is positive. b(104/63) Simplify ((g/g(-4/7)((gg/(gg/g*11g)g)/g)/g)/(g(-15))(-25/2))(-23) assuming g is positive. g(56971/14) Simplify (((tt*26t)/t(-29))(-5))45 assuming t is positive. t(-12825) Simplify ((xx/(x(-16)x)x(((x(2/5)/x)/x)/x)/x)/((x(1/33)xx)/(x/x*(9/4)x)))(-4) assuming x is positive. x(-7999/165) Simplify ((l(2/3))(4/11)/(l(1/3))(-15))/((l2)(1/17)/(l(1/3))(-18)) assuming l is positive. l(-491/561) Simplify (b(-1/4)b(-1/4)b*(4/7)/((bb*8)/bb))/(b*(-1/2)b10)(-41/5) assuming b is positive. b(2414/35) Simplify (w3w(-1/4))(-2/75)/((w0/w)(1/30))(4/7) assuming w is positive. w(-19/350) Simplify (y(-3/7)y/(yy(1/7))yy(-2/3)y*(1/3))/(((((yy*(-2))/yy)/yy)/y(-2))/((yy(y/(y/y(2/3)))/y)/y)(-2/5)) assuming y is positive. y(-41/35) Simplify (((x1x)*(-2/3)(x(-1/2))(17/2))(-1))(1/46) assuming x is positive. x*(67/552) Simplify (((dd(1/2))/d(3/2))/(d*0d)*(-1/48))/((d/(dd*(-2)/dd))/(d/d(-2/11)))(2/77) assuming d is positive. d*(-17/40656) Simplify (aa*(6/17)aa/(a(a/a*(-4/25))/aa)a(-43)a(2/37))(-4/27) assuming a is positive. a(2626264/424575) Simplify q1/qq(-5/6)q(q(q(-4)/q)/q)/q0(q(1/2)/(q/((qqq(-3)q)/q)))37 assuming q is positive. q(-181/3) Simplify ((aa/a0)(-3/5))(2/5)/((a/a(-1/7))/a(-1/2))(38/3) assuming a is positive. a(-11177/525) Simplify (k6k/(k*(-4/3)/kk)k(-2/3)/((k(-1/8)k)/k))/((k/k(-2/3))48(k(1/3)/kk)/(((k(-8)/k)/k)/k)) assuming k is positive. k(-2005/24) Simplify (o*8o*(1/54)(o/((oo(4/15)/oo)/o))/o(-7/4))9 assuming o is positive. o(5671/60) Simplify (((m/m(2/7))/m(-1/3))/((m(-2)/m)/m*(-4)))/((m/(mm*(-1)mm))(-31)/((m(m*2m)/mmmm)/(m/m2))) assuming m is positive. m(-503/21) Simplify (d(5/6)/(ddd(2/9))(d/(d/(d*(-4/7)/dd))d)/((d(-3/16)/d)/dd))(-8/5) assuming d is positive. d(-229/630) Simplify ((j19/j)/j)/(j(-2/35)j)(j*(-1/5)j)(1/25) assuming j is positive. j(14078/875) Simplify (l(-1/6)/l(-8))31/(((l/l9)/((ll/l4)/l))/(l/l(-2/11)l)(1/27)) assuming l is positive. l(49087/198) Simplify (h*(-9)hh/(h(3/28)/h)h*21/((hh*(3/13))/hh))(-4/25) assuming h is positive. h(-4973/2275) Simplify ((((ff(4/5))/f(3/2))/(ff*(-2)f)46)(1/28))(-30/7) assuming f is positive. f(-9/196) Simplify (((g/g*(-2/5))/(g/(g(g/g(-9))/g)))/(g(2/9))(11/4))/((g(1/8)/g)/gg(2/21)(g/g*(1/4)g)/((g*(-1/11)g)/g)) assuming g is positive. g(269653/27720) Simplify (((d/((d(-1/7)/dd)/d))/dd)*(-39/4)(d/(d(-2/23)/d))(-1/4))(-3/13) assuming d is positive. d(41373/8372) Simplify ((a*16a)14/((a25/a)/(a/(a*(-7/5)/a)aa)))(-8) assuming a is positive. a(-8776/5) Simplify (j(-1)jj(3/10)/j((j(j(-1/8)/j)/jj)/j)/(j/(jj/(((j/j0)/j)/j)j)))/(j1/j1(j	{ "pile_set_name": "DM Mathematics" }
10) Simplify (v/((v*(-4)v)/vv))/(v/v(10/9)) assuming v is positive. v(37/9) Simplify l15/l(11/3) assuming l is positive. l(34/3) Simplify (x/(x/(x(3/8)x))x)/(x4/x)(x1)(2/49) assuming x is positive. x*(-229/392) Simplify (yy(-1))(-48)y(4/3)y*(1/3)y assuming y is positive. y(8/3) Simplify (((c(-2/7)/c)/c)/c)/(c*1/c)(c/(cc4))/c(-7) assuming c is positive. c(-2/7) Simplify (ppp(-2/39)p)(-3/2) assuming p is positive. p(-115/26) Simplify ((rr/((r/r(-11)r)/r))/r(-21))(5/19) assuming r is positive. r*(55/19) Simplify (k/(kk(2/23)))/k(-16) assuming k is positive. k(366/23) Simplify (o/(o/(o25o)))/o12 assuming o is positive. o14 Simplify (q/q(-4))(5/4) assuming q is positive. q(25/4) Simplify (i(2/47))(-2/89) assuming i is positive. i(-4/4183) Simplify (x/(((x/((xx/(xx/(((xx*(-2)x)/x)/x)xxx))/xx)x)/x)/x)x)/(xx/(x/x(-2/13))) assuming x is positive. x(-50/13) Simplify (k/(kk*(2/3))k/((k(-9)/k)/k))(-3/7) assuming k is positive. k(-34/7) Simplify (u(2/5)uu)(-2/61)/((u(-2/7)/u)/u)5 assuming u is positive. u(24232/2135) Simplify (c(-1/3))(-8)c(-3/7)/(((c(-2)/c)/c)/c) assuming c is positive. c(152/21) Simplify (a/(a(aaa*(1/24))/aa))/a(-24) assuming a is positive. a(527/24) Simplify (z0)(-12)/(z/(z/(z/z(-1/4))))34 assuming z is positive. z(-85/2) Simplify (p1/p)/(((((p/((p/(pp1p)p)/p)pp)/p)/p)/p)/p)(p*(1/4)p)/(p/(pp(-6)pp)) assuming p is positive. p(-15/4) Simplify ((gg(-2/9))(-4/9))(-36) assuming g is positive. g(112/9) Simplify (b/(b*3bb))/(b/(bb*(-2)/bb))b(2/11)/(b(1/3)/b) assuming b is positive. b(-170/33) Simplify (bbbbb(-3/13)/b)/b(-4/7) assuming b is positive. b(304/91) Simplify (h/(h/((h/h(-2))/hh)))(-19/3) assuming h is positive. h(-19) Simplify ((pp(2/9)/p)0)(8/3) assuming p is positive. 1 Simplify a/(a46aa)a(-17) assuming a is positive. a(-64) Simplify (kk1k)(-2/9)/((k/(k7/k))/(kk(-2/7))) assuming k is positive. k(106/21) Simplify f/(f/f28)ff(-22) assuming f is positive. f7 Simplify (k(-1)k)*37(k*0k)(-2/9) assuming k is positive. k(-2/9) Simplify (w8)33 assuming w is positive. w264 Simplify m/m(-9)(m4/m)/mm assuming m is positive. m13 Simplify ((((l(2/7)l)/l)/l)/(lll(-3)))/(l/l(-2/7))(-44) assuming l is positive. l(398/7) Simplify (zz/(z/z*(-5/3))z)/((zz(-25)/z)/z) assuming z is positive. z(79/3) Simplify ((r/r(-7)rr)/((((r(4/7)r)/rr)/r)/r))/(r2)29 assuming r is positive. r(-333/7) Simplify ((g2g)/g0)(-4/7) assuming g is positive. g(-12/7) Simplify (w(-2/9)/(ww/(ww*(-4)ww)ww))/(w(2/7)/w(-1/5)) assuming w is positive. w(-1798/315) Simplify ((m(-4/3))(-3/7))40 assuming m is positive. m(160/7) Simplify (s11)(-27) assuming s is positive. s(-297) Simplify ((t/(ttt/(tt*(2/3)tt)))/(tttt(1/4)))(-33) assuming t is positive. t(209/4) Simplify (b(-4)/b)(3/14) assuming b is positive. b(-15/14) Simplify ((c(-2/9))(-9))44 assuming c is positive. c88 Simplify (bb/(b/(b/(b/(b/b0)b)b)b))/(b*19b) assuming b is positive. b(-19) Simplify ((s(2/5)s)(44/3))(-16) assuming s is positive. s(-4928/15) Simplify (u11/u)/((u/u(-6))/u) assuming u is positive. u4 Simplify (t/((ttt((t*(12/5)tt)/t)/ttt)/t))/(t3/t) assuming t is positive. t(-37/5) Simplify (l(-8)ll(-4/3)/ll)/(l(-1/4))(-46) assuming l is positive. l(-119/6) Simplify ((l/l(1/3))/l)/ll4l(-2/13)/(l(-6/7)/l) assuming l is positive. l*(1193/273) Simplify bb/b*(-1/10)bb(-2/15) assuming b is positive. b(89/30) Simplify m21/m(-2/3) assuming m is positive. m(65/3) Simplify (o(5/2)/((o/o7)/o))(5/2) assuming o is positive. o(95/4) Simplify (ff(-14/3))2 assuming f is positive. f(-22/3) Simplify ((y(-1/2))(-21))(-3/31) assuming y is positive. y(-63/62) Simplify (v(-2/3)v)3v*(-1/9)v(-3)/v assuming v is positive. v(-28/9) Simplify g(-3/13)/g(-4) assuming g is positive. g(49/13) Simplify (c/c20)/cc(5/3) assuming c is positive. c(-55/3) Simplify w(7/6)w*(-1/4)w assuming w is positive. w(23/12) Simplify v(-2/21)v(-16) assuming v is positive. v(-338/21) Simplify ((c(2/5)/c)/c)18c/(c/((cc(1/3))/c))c(1/3) assuming c is positive. c(-422/15) Simplify (c/(c(-9)/c))/c5((cc*(2/11)/c)/c)/(cc(7/2)) assuming c is positive. c(15/22) Simplify (c*2c)/(c/c*(-1/5))((c(-6)/c)/c)/c1 assuming c is positive. c(-36/5) Simplify ((i2i)/((i/(iii(7/5)i))/i))(-32) assuming i is positive. i(-1184/5) Simplify ((zz(-9))/(z(2/3)/z))/((zzz/z(2/17))/z(-7)) assuming z is positive. z(-895/51) Simplify (h11h)/(h/h(2/35)) assuming h is positive. h(387/35) Simplify (d(ddd/(d(-3/8)d))/dddd/d5)/(((d/(d/(dd*(-1))))/d)/dd/((d/d*(-1/5)dd)/d)) assuming d is positive. d(143/40) Simplify (q(-31))(-8) assuming q is positive. q248 Simplify (f(1/3)f/(f/f*(3/2))f)/(((f*(-3/7)ff)/f)/(ff(-2)/f)) assuming f is positive. f(11/42) Simplify (j(-1/3))(-3/5) assuming j is positive. j(1/5) Simplify (f(1/4)fff(-1/10))/((ff(-3/7))/(f/f(2/17))) assuming f is positive. f*(5857/2380) Simplify (pp2)/(p(1/6)pp)(((p(1/2)/p)/p)/p)(-38) assuming p is positive. p(575/6) Simplify ((k/(k/k4k))/kk)/kkkk*(-13)k assuming k is positive. k(-8) Simplify (u/u(-2/39))/(u((u/((u((u/u*10)/u)/u)/u)uu)/u)/u) assuming u is positive. u(-466/39) Simplify (x(3/2)/x)/(x/(xxx/(x/(x/x(-4/7)x))x))(x*2x)/(xxxx/(x(-6)/x)) assuming x is positive. x(-41/14) Simplify u(-4)uuu(u(-1/11)/u)/u assuming u is positive. u(-34/11) Simplify (f(fff*5)/ff)/((f(-34/5)/f)/f) assuming f is positive. f(84/5) Simplify (kkk*(4/11)k)/(k*(-29)kk) assuming k is positive. k(334/11) Simplify (z26z)/zzzz25 assuming z is positive. z53 Simplify (u/(uu*(-5/2)u))/uu/(u/(((uu(uuu(1/6)u)/uuu)/uu)/u))(u/(u((uu*(2/7))/u)/uuu))32 assuming u is positive. u(-745/21) Simplify g(1/9)g/((ggg*(-8)g)/g) assuming g is positive. g(64/9) Simplify (y(-3/22)/y)40 assuming y is positive. y(-500/11) Simplify ((f/(f*(-3/8)/f))/ffff)/ff7/ff assuming f is positive. f(83/8) Simplify (a/(a/a1))/(a*(-2/3)a) assuming a is positive. a*(2/3) Simplify (q/(qq/(q(q/(((q/((q7/q)/q))/q)/q))/q)))50 assuming q is positive. q300 Simplify r/((((rr*15r)/r)/r)/r)rrr(3/5) assuming r is positive. r(-52/5) Simplify i/(i/(i/i(2/25)i)i)ii28 assuming i is positive. i(748/25) Simplify jj/(jjj*32)((j/(j*28/j)jj)/j)/j assuming j is positive. j(-58) Simplify p/(ppp/(p/(p24/p)))(p/(p/((p/(p/p*(-12))p)/p)))/p assuming p is positive. p*(-37) Simplify gg*(-21)g/(gg(-20)) assuming g is positive. 1 Simplify (o(-1/2)/o)(-22/7)/(o(-3)/oo/o(-1/2)) assuming o is positive. o(101/14) Simplify l/(l/(l((l/(ll*31))/l)/l))l(-2/21) assuming l is positive. l(-674/21) Simplify (d/(d*(-20)dd))/dddd(dd*36/dd)/dd assuming d is positive. d58 Simplify ((y/(y/(y(-9)/y)))/(yy*0y))(-14/11) assuming y is positive. y(168/11) Simplify a/((a/(a/a*5))/a)(aa(1/11)a)/aaa assuming a is positive. a(1/11) Simplify (w/w(-3)w)/ww(2/27) assuming w is positive. w(110/27) Simplify (k/(k/k*(-6/11)))/kkk/((((k(-9/4)/k)/k)/kk)/k) assuming k is positive. k(251/44) Simplify g(-39)/ggg39 assuming g is positive. 1 Simplify (l(1/3)l)(-18/11)(l*7ll)/l(5/2) assuming l is positive. l(95/22) Simplify (((b/b14)/bb)/(b/b20))(2/3) assuming b is positive. b4 Simplify g(-26)g/(g/g(10/11)gg)g assuming g is positive. g*(-287/11) Simplify (dd*(-1/10)/d)/ddd/(d/(ddd(-1/4)))dd(d(d(-5)/d)/d)/dd/(dd(d*(3/5)d)/d) assuming d is positive. d*(-99/20) Simplify (m/(mm/(m/(m*(-11)/mm)))m)/(m/(m(mm/(m/(m26/m))m)/m)m) assuming m is positive. m37 Simplify (qq*(-3/22)/qqq(-3/13))*(-1/41) assuming q is positive.	{ "pile_set_name": "DM Mathematics" }
4x + 6x to the form nx2 + jx*3 + h + tx and give n. 0 Rearrange (s*2 + 3s*2 - 2s*2)(-s - 65 - s + 68) to the form p + rs + qs*2 + vs*3 and give v. -4 Rearrange -25l + 25l - l2 + 0 + 2 + 0 - l2 + (5l + 0l - 3l)(2l - 3l + 0l) + l2 - l2 - 2l2 to the form xl + kl2 + n and give k. -6 Rearrange (b2 - b2 + 2b*2)(-4 + 4 + 2) + (b*2 + b - b)(-4 + 7 - 2) to kb2 + h + gb and give k. 5 Express (-17s2 - 27s*2 - 31s*2)(s + 3s + s) as is + x + js3 + ys*2 and give y. 0 Express 9y*2 + 4y*2 - 5y*2 + (3y - y + 0y)(y - 2y - 2y) in the form ly + s + ry*2 and give r. 2 Express (0 + 2 + 6)(2 - 15 + 7)(g + 2g + 2g) as yg + z and give y. -240 Rearrange -3h4 - h3 + 3h*2 + 2h - 3h4 + 5h*4 to the form xh*3 + fh*2 + zh*4 + dh + u and give f. 3 Express 0n - 3n - n - 4n in the form t + cn and give c. -8 Express 0n + 13n - n - 4n as z + mn and give m. 8 Express (-4 + 2 + 0)(9l + 10l - 7l) - 2 - 5l + 2 - 2 in the form z + ml and give z. -2 Express -c + 2c - 3c + (-1 - 2 + 1)(-5c + 4c + 3c) + (1 + 0 + 2)(-29 - 8c + 29) as sc + n and give s. -30 Rearrange (5 - 4 + 3)(-4k - 13k + 6k) to nk + z and give n. -44 Express -9h + 8h - 6h - 12h as n + ih and give i. -19 Rearrange 2 + 2 - a2 - 10a3 + a4 + a - 3 + 4a3 to h + va*4 + ga*2 + ua*3 + la and give u. -6 Rearrange -5x + 11 + 7 - 18 + 5x*3 to qx + vx3 + zx*2 + g and give v. 5 Express 3q*3 - 2q - 14q3 + 8q*4 - 6q4 - q3 as h + gq3 + fq + rq4 + jq*2 and give f. -2 Rearrange (2 - 11 + 0)(2j2 - 2j*4 - 2j*2) to the form ij*4 + cj*3 + dj + hj2 + o and give h. 0 Rearrange m + 0m + m + (-2 + 0 + 0)(m - m + 2m) - m + 0 + 0 - 6m + 6m + 5m to p + hm and give p. 0 Express -29i + 83 - 83 in the form ji + f and give f. 0 Rearrange -3a2 + 0a*2 + 15 + 2a*2 + 2a*2 to ma + v + fa2 and give v. 15 Rearrange 12 - 29 + 17 + 2l + 3l3 to the form ul + xl3 + al*2 + s and give x. 3 Rearrange (1 + 2 - 2)(z*2 + 0 + 0) + (0z*2 + 0z*2 - 2z*2)(2 - 1 - 4) to the form yz2 + gz + o and give y. 7 Express 8s + 1 - 1 + 16s + 2s3 as w + ns*2 + hs + zs3 and give h. 24 Rearrange ((-j - 3j + 2j)(-3 - 1 + 1) + 0j - 2j + j - j + j - j)(-j2 + 5 - 5) to the form kj*2 + i + rj*3 + nj and give r. -4 Rearrange 5w + 0 - 13w - 2w3 - 1 + 24w to the form p + uw3 + zw*2 + kw and give k. 16 Express ((-3 + 5 - 3)(2 - 3 + 2) + 2 - 2 - 2 - 1 + 3 - 3 + (2 + 0 + 0)(3 + 0 - 2))(-2q + 2q + 3q) as x + gq and give g. -6 Rearrange 0 + 3k*2 + 5 - 2k*2 to x + ik*2 + lk and give x. 5 Rearrange -7b2 - 42b*3 - 3 + 22b*3 + 23b*3 to the form c + wb*2 + yb + ub3 and give y. 0 Express (4 - 1 - 1)(-14z2 + 8z*2 + 8z*2) as n + cz + lz2 and give n. 0 Rearrange -19 - 3s2 - s2 - s3 + 15 + s2 to the form qs + t + os*2 + bs*3 and give o. -3 Express -2y*2 - 6y*2 - 2y*2 + (0y + 0y + 4y)(0y + 4y - y) in the form xy*2 + by + r and give x. 2 Rearrange (-4l + 1 - 3l + 3l)(-l*2 + 6 - 6) to the form jl*2 + vl + sl3 + z and give j. -1 Express ((-3q + q + 4q)(-2q - 2 + 2) - 3 + 3 + q2 - q + q + 4q*2)(0 - 2 - 3) as y + fq + jq*2 and give j. -5 Express -g - 5 + 5 + (-g + 0g + 0g)(-7 + 4 + 4) + g + 0g + 0g as f + qg and give q. -1 Rearrange -7 + 2d*3 - 1871d*2 - d + 1871d*2 to hd + gd2 + ad*3 + m and give a. 2 Rearrange -4 - 19q + 6q + 1 - q2 + 6q to the form pq + bq*2 + t and give t. -3 Express (4l - 5l - 2l)(2 - 4 - 7) as b + tl and give t. 27 Rearrange (0 + 1 + 1)(4 + 25b*2 + 22b*2 - 20b*2) + 2b - b*2 - 2b to y + mb + sb*2 and give y. 8 Express (3 - 3 - 2)(5j - j - 5j) - 3j - j + j in the form v + pj and give p. -1 Express (15a2 - 5a*3 + 2a*3 + 2a*3)(-1 + 1 - 4) as ua2 + p + la + ma3 and give u. -60 Express (0s - s + 0s)((0 + 2 + 0)(2 - 2 + 2) + 1005 - 2521 + 1095)(s - s + s*2) in the form xs + l + is2 + qs*3 and give q. 417 Rearrange -4k - 20k - 7k to the form lk + f and give l. -31 Rearrange -21t - 4 + 6t + 4 to rt + h and give r. -15 Rearrange (-2a + 4a + 14 + 4)(0 + 2 + 0a2 - a2) to ga2 + qa + b + va3 and give g. -18 Express (3 - 3 + s2)(-5s + 4s + 0s) - 18s*3 + 127s - 127s + (-2s + 2 - 2)(s2 - 3s + 3s) as is*2 + z + ps + vs3 and give v. -21 Rearrange (0 - 2t*2 + 0)(0t + 0t - t*2 + (1 - 2 + 3)(7t - 7t + 29t2)) to jt*2 + r + wt*3 + gt + pt4 and give p. -114 Rearrange (-5g - 8g - 2g + 5g - 3g + 0g + (-2g + g - g)(0 - 1 + 0))(3 + 1 - 3) to w + dg and give d. -11 Express -1 - 3o*4 + 4o*3 + 2o + o*4 + 2 as xo*4 + go*3 + bo*2 + p + do and give d. 2 Express 1 - 15b - b2 + 3b*3 - 3b*3 + 16b - 9b3 in the form tb*2 + vb + rb3 + m and give t. -1 Rearrange -67b - 67b + 46b*2 + 134b to qb2 + g + jb and give q. 46 Rearrange (4j - 3j - 2j)(-2 - 1 + 1)(2 + 22 - 1)(-3j + 0j + j) to the form v + yj + kj*2 and give k. -92 Rearrange 5x*2 + 2x + 0 + 0 - 6x2 - x3 to the form b + gx*3 + zx*2 + vx and give v. 2 Express -4r4 + 2r*3 + 2r*4 + 6r4 - r2 - r - 2r4 in the form ir*3 + hr*4 + p + tr*2 + gr and give t. -1 Express (-3i2 + i2 + 4i*2)(-i - 3i + 3i) - 21i3 + 6i - 6i in the form a + mi*3 + ji + bi2 and give m. -23 Express (-3d - 2d + 3d)(-1 + 0 - 2) - d + 0d - d as id + m and give i. 4 Rearrange (82t*4 - 44t*4 - 45t*4)(1 - 2 - 1) to qt3 + k + dt + wt2 + ct*4 and give c. 14 Rearrange 44a - 39a + 60a to the form wa + h and give w. 65 Express 13j - 26 + 13 + 13 in the form g + dj and give g. 0 Rearrange 5v*3 + 4v*3 + 1 - 9v3 - v4 - v to the form nv3 + sv*2 + jv*4 + pv + i and give p. -1 Express -5x - 8x + 4x as l + bx and give b. -9 Express x*2 + 2 + 14x*4 - 2x*3 - x + 3x - 4x4 - 12x*4 as u + ix + gx2 + ox*4 + lx*3 and give o. -2 Rearrange (2s3 - s2 + s*2)(155s - 74s + 98s) to the form bs + ps4 + ts*2 + l + is*3 and give p. 358 Express 1 - 1 - 1 - 15s + (1 + 2 - 1)(0 + 0 - s) as zs + i and give i. -1 Express r*3 + 9r + 3r - 20r - 2r2 as w + hr*2 + nr + br3 and give b. 1 Rearrange (-x - 1 + 1)(38 - 38 + 42x3) to cx*2 + dx + u + mx3 + tx*4 and give d. 0 Express (3h + h - 3h)(2h - 4 + 4)(2 - 2 - 2h2) in the form ah*4 + wh*2 + qh + s + bh3 and give a. -4 Express -1 + 2z2 - z4 - 2z2 + 0 - z - 4z*3 in the form vz*4 + mz + t + rz3 + jz*2 and give v. -1 Rearrange -3n*3 + 0n*3 + 3n + 3n to the form un*3 + hn + f + an2 and give u. -3 Express 43h*3 - 3h*4 - 45h3 - h2 + 8 - 4 in the form j + zh + gh*2 + kh*3 + sh*4 and give s. -3 Express ((-2 - 1 + 1)(-3 + 4 - 2) - 3 + 2 + 0)(11958x*2 + 8x - 11958x2 + x3) in the form g + lx + ox2 + fx*3 and give l. 8 Express -16v + 2v - 4v as ov + z and give o. -18 Express 2d*2 - 2d3 - d4 + 2d2 - 5d*2 in the form ud*2 + md*3 + cd*4 + id + l and give c. -1 Rearrange -2u4 - u4 - 2u*3 - 19u*2 + 1 - u + 5u*2 + 12u*2 to vu*3 + ou*2 + mu*4 + yu + q and give o. -2 Express 24k + 11 - 23 + 10 + 2k + 4 - 4 - 2k + 0k + 4k + (5k - 2k - k)(-1 - 3 + 5) + 0k + 0k + k + k + 0k + k as x + jk and give x. -2 Rearrange 33h2 + 18h*2 - 112h*2 to the form dh*2 + ph + a and give d. -61 Rearrange -10 - 7 + 0v - 6v + 8v to xv + y and give y. -17 Rearrange -4w2 - 34 + 16 + 0w*2 + 22 to i + lw*2 + uw and give l. -4 Rearrange (-1 + 4 - 2)(4j - 4j + 8j) - 3 + j + 3 + (0j + 2j - 6j)(-2 + 4 + 0) to the form k + pj and give p. 1 Rearrange (17l*2 + 15 - 15)(-l - 5l + 4l) + l*3 + 3l*3 - 3l*3 to the form cl*3 + u + gl*2 + rl and give c. -33 Rearrange 24h2 + 2 + 2h*3 - 22h*2 + 0h3 - h4 to uh4 + bh + gh3 + o + yh*2 and give u. -1 Rearrange -3 + 4 - 16p2 + p4 - 2p + 4p to tp4 + l + jp*3 + ip + rp2 and give l. 1 Express -9v*2 - 1 + 5v2 + v2 as y + nv + cv*2 and give c. -3 Rearrange (2c - 7*c	{ "pile_set_name": "DM Mathematics" }
59c + 2767c - 11093c. -41c Collect the terms in -2l + 8747001l*2 - 663l*3 - 4373502l*2 - 4373499l*2. -663l*3 - 2l Collect the terms in 139761 + 11s + 139746 + 139766 - 419273. 11s Collect the terms in 11u - 12u + 5u + 3u - 18 - 4u2 + 14. -4u*2 + 7u - 4 Collect the terms in -4970028p3 - 4969983p*3 - 6p*2 + 5p2 + p2 + 9940006p3. -5p*3 Collect the terms in 7q + 2q - 16q + 7q + 2372462q*3 - 2372444q*3. 18q*3 Collect the terms in 20 - 513c - 523c + 21 - 516c - 59 + 22 + 1557c. 5c + 4 Collect the terms in 4 - 11 - 6y3 + 55y*3 - 46y*3 + 7. 3y*3 Collect the terms in 1555847t + 5 - 4 - 1555849t. -2t + 1 Collect the terms in 7n2 - 81n - 5n2 + 2582 + 81n - 159. 2n2 + 2423 Collect the terms in 337f - 2f2 - 213 + 365f + 120 + 93 - 701f. -2f*2 + f Collect the terms in 2398r - 135733r3 - 2398r + 135534r3. -199r*3 Collect the terms in -4x*2 + 4x*2 + 193x - 193x + 349x*3. 349x*3 Collect the terms in 1342948l - 1342958l + 4 - 4. -10l Collect the terms in 744214t + 744220t - 1488414t. 20t Collect the terms in -13d + 110 - 49 - 39 - 37 + 14d. d - 15 Collect the terms in -3 + 6059u + 3 + 65841u. 71900u Collect the terms in 33q*3 + q - q - 17q*2 + 2 - 64q*2 + 18q*2. 33q*3 - 63q*2 + 2 Collect the terms in -46247x*2 - 52365x*2 + 98615x*2. 3x*2 Collect the terms in -829d*3 + 255d*3 - 270d - 274d - 570d*3 + 544d - 3d2. -1144d*3 - 3d*2 Collect the terms in -234 + 2707u + 467 - 15u + 256u - 232. 2948u + 1 Collect the terms in 15700a - 7843a - 7857a - 9794a2. -9794a*2 Collect the terms in 370286w - 1112600w + 370291w + 371997w. -26w Collect the terms in -59j + 127j - 68j + 10928j*2. 10928j*2 Collect the terms in -42272468b + 21136290b + 21136174b. -4b Collect the terms in 9 - 12 + 4 + 988x*3 - 11 + 10. 988x*3 Collect the terms in -499m*2 + 42m*2 - 645m + 1093m - 449m. -457m2 - m Collect the terms in -17o - 151o2 - 43o*2 + 48o*2. -146o*2 - 17o Collect the terms in -17062126 + 7679g + 17062126. 7679g Collect the terms in 50l2 + 165893 + 165858 - 331751. 50l*2 Collect the terms in 14t - 5t - 5t + 15662 - 18659. 4t - 2997 Collect the terms in -15x - 17 + 5555x + 2777x + 5155x. 13472x - 17 Collect the terms in -92p - 4p*2 - 118p + 307p + 7p*2 - 112p. 3p2 - 15p Collect the terms in 1178m + 144 + 147 + 137 - 570 + 142. 1178m Collect the terms in -106i3 - 218i*3 - 340i*3 - 212i*3 + 881i*3. 5i*3 Collect the terms in 40j + 652 - 22j + 4j*3 - 18j - 736. 4j3 - 84 Collect the terms in -65p + 118 + 101 - 219 + 162p. 97p Collect the terms in 273j + 280j + 338j - 897j. -6j Collect the terms in -1831218r + 3889258r - 3877924r - 11465714r. -13285598r Collect the terms in -2h + 196 + 4h*3 - 103 - 95 - 2253h*2. 4h*3 - 2253h*2 - 2h - 2 Collect the terms in -130j3 + 1040306j*2 - 1040306j*2. -130j*3 Collect the terms in 500s + 295s2 + 52s*2 + 88s*2. 435s*2 + 500s Collect the terms in -8981p3 - 144865p*3 - 127987p*3. -281833p*3 Collect the terms in 25u - 14484u3 - 9u - 16u - 6541u*3. -21025u*3 Collect the terms in -7834 + 2011 + 2s*3 + 5823. 2s*3 Collect the terms in 4167v + 143v - 1940v + 31339v. 33709v Collect the terms in -88333 + 17h2 + 0h2 + h2 + 17h2 - 24h*2 + 88335. 11h*2 + 2 Collect the terms in -41v - 13v - 5 + 140v - 48v. 38v - 5 Collect the terms in -29h + 50 - 39h - 44h + 534 + 117h. 5h + 584 Collect the terms in 7p*2 + 8p*2 + 19901p - 23 - 13p2. 2p*2 + 19901p - 23 Collect the terms in -11 - 1472r2 + 4430r*2 - 1466r*2 + 11 - 1476r*2. 16r*2 Collect the terms in 29x*3 - 233 + 4x*2 - 285 - 151x*3 + 518. -122x*3 + 4x*2 Collect the terms in 4a + 4 + 300a + 5a - a2 - 4. -a2 + 309a Collect the terms in 29l + 29l - 48l*3 - 58l - 62l3 + 213l*3 - 52l*3 - 52l3. -l3 Collect the terms in -6 - 725b + 362b + 363b - 1 + 20b*3. 20b*3 - 7 Collect the terms in 2 - 2 + 1182k*2 - 1089k*2. 93k2 Collect the terms in i2 + 284 + 6i - 5i - 89 - 185 - 276. i*2 + i - 266 Collect the terms in -676876 - 55k*2 + 28k*2 - 3k + 676876 + 30k2. 3k*2 - 3k Collect the terms in -225797 + 112901 + 112896 - 5u. -5u Collect the terms in 244r2 - 1308r*2 - 500r*2 - 2807r*2 - 313r*2. -4684r*2 Collect the terms in -264c*3 + 882c*3 + 895c*3 - 1505c*3. 8c*3 Collect the terms in 41a + 2078 + 38a + 32a - 114a. -3a + 2078 Collect the terms in -5492y2 + 6y*3 + 1850y*2 - 18y*3 + 1822y*2 + 8y*3 + 1820y*2. -4y*3 Collect the terms in 95 + 1008n*2 - 195 + 100 + 912n*2. 1920n*2 Collect the terms in -21540d*2 - 110 + d + 110. -21540d*2 + d Collect the terms in 2314767 - 771588 - 771594 - 771594 + 22b*2. 22b*2 - 9 Collect the terms in 826n + 347n - 37 - 40 - 56n. 1117n - 77 Collect the terms in 39525 - 79053 + 1568s*2 + 39528. 1568s*2 Collect the terms in -477f + 235f + 240f - 59f2 - 116f*2. -175f*2 - 2f Collect the terms in -18966 + 6323 + 3522f + 6319 + 6324. 3522f Collect the terms in -191339916759 + 191339916759 - 90q. -90q Collect the terms in -169y3 + 356y*3 + 21669y*2 + 209y*3 - 21669y*2. 396y*3 Collect the terms in -2638a + 8131a - 3508a - 3021a. -1036a Collect the terms in 3g3 + 95284893012004 - 95284893012004. 3g*3 Collect the terms in 406 + 1399387612x - 110 - 1399387611x. x + 296 Collect the terms in -234608269 - 10t + 469216540 - 234608271. -10t Collect the terms in 3987v + 52214v2 - 1992v - 1993v. 52214v*2 + 2v Collect the terms in -289587n + 18 - 9 - 9. -289587n Collect the terms in 511 + 614 - 3a - 286 + 637 - 174. -3a + 1302 Collect the terms in 0j - j - 85657j*2 + j + 85722j*2. 65j*2 Collect the terms in -7 + 9 + 245463q - 245702q. -239q + 2 Collect the terms in 18 + 55 - 2t2 + 3t2 - 53 + 109. t2 + 129 Collect the terms in 27 + 28 + 36 + 28 - 116 + 2q + 4q. 6q + 3 Collect the terms in 132i*3 - 10694 + 5325 - 298i*3 + 5369. -166i*3 Collect the terms in 2 + 23 + 1885c*3 + 1 - 26. 1885c*3 Collect the terms in 85o*2 + 5o + 22 + 0o - 70 - 13o + 4o. 85o*2 - 4o - 48 Collect the terms in -5337r3 + 1480r*3 - 2185r*3. -6042r*3 Collect the terms in 2661832g - 3g2 - 1330525g - 1331307g. -3g*2 Collect the terms in -51a - 141a - 45a*2 + 49 + 61a*2. 16a*2 - 192a + 49 Collect the terms in 310u + 1 + 5u*3 - 2578u + 1343u - 2806u. 5u3 - 3731u + 1 Collect the terms in 83b + 16920 - 5587 - 5673 - 5660. 83b Collect the terms in -10a - 16a + 6a + 5747 - 2a - 5771. -22a - 24 Collect the terms in -32544049780g + 3g2 + 16272024888g + 3g2 + 16272024892g. 6g2 Collect the terms in 406g*2 - 102g*2 - 272g*2. 32g*2 Collect the terms in -84913o*2 - 84780o*2 + 169694o2. o2 Collect the terms in 8g2 - 7161475731g + 7161475731g. 8g*2 Collect the terms in -414889572m + 2 - 2 + 414890760m. 1188m Collect the terms in -363h - 2131h - 577h + 1053h. -2018h Collect the terms in 188c*2 - 310c*2 - 789c*2 + 910c2. -c2 Collect the terms in -101s + 117s + 236 + 68s. 84s + 236 Collect the terms in 7401h - 775h - 6415h. 211h Collect the terms in 967a2 + 946a*2 + 955a*2 + 931a*2 - 3778a*2. 21a*2 Collect the terms in 8l + 5l - 2639l*2 + 10l - 48l + 25l. -2639l2 Collect the terms in 30z*3 + 84z*3 - 205z*3 + 58z*3 + 35z*3 - 6. 2z*3 - 6 Collect the terms in 2002h*3 - 25h*2 + 8910h*3 + 25h*2. 10912h*3 Collect the terms in -166857f - 166832f - 166857f + 500550f. 4f Collect the terms in -105s + 169s - 107s + 3s*2 + 14. 3s*2 - 43s + 14 Collect the terms in 4q3 + 4450936674872 - 4450936674872. 4q*3 Collect the terms in -10c + 10c + 0c - 10295188c2. -10295188c*2 Collect the terms in 9 - 21 + 5 - 7236j + 7. -7236j Collect the terms in 34r - 9890 + 29r - 61r. 2r - 9890 Collect the terms in -u2 + 6u*2 - 967538u + 967538u - 5u*2 + 2u*2. 2u*2 Collect the terms in -45b - 15b3 - 5b**3 - 9 + 1	{ "pile_set_name": "DM Mathematics" }
0o - 2o + (2o - 2o - o)(-1 - 5 - 4))(-1 - 2o3 + 1). -18o*4 Expand (-4f + 0f + f + (-2 - 4 + 4)(1 - 1 + 2f))(0 - 3f + 0). 21f*2 Expand (-2 + 3 + 12)(0 - 3 + 1)(-6w*3 + 5w3 - w3). 52w3 Expand (5r - 4r - 2r)(-4r + 0r + 6r) - 2r + 2r - r*2. -3r*2 Expand (-2w + 2w + 2w*2)(2w - 3w + 3w) + 5w*3 - 6w*3 - 8w*3. -5w*3 Expand (2 - 2 - 2m)(-3 + 3 - m)(-3 + 4 + 0). 2m2 Expand 41q*2 + 45q*2 - 94q*2 + (6q - 2q - 3q)(-3q + 0q + 5q) - q2 - q2 + 4q2. -4q*2 Expand (2x + 1 - 1)(x + 1 - 1 + (2x - 6x + 2x)(0 + 1 - 3) - x + 3x - 4x + 2x - x + 5x). 18x*2 Expand (0w + 2w - 11w)(3 - 2 - 2). 9w Expand -2q + 5 - 5 - q - q - q + 2 - 2 - q + (-q + q - q)(-1 + 4 - 1) + 6q + 2q - 4q. -4q Expand ((u + 0 + 0)(-5 + 3 + 5) + (4 - 2 + 0)(2u - 2 + 2) + 0u + u - 2u)(4u4 - 3u*4 + 0u*4). 6u*5 Expand (0s + 6s - 3s)(10s*4 + 18 - 18) + 2s*5 + 0s + 0s + (s4 + 2s*2 - 2s*2)(-2s + s + 2s) + 5s5 - 6s5 - s5. 31s5 Expand (h + 0 + 0)(-h*2 + 15h - 32h + 12h). -h*3 - 5h*2 Expand (0m - 2m3 + 0m)(-2867 + 2867 - 94m). 188m4 Expand 1 - 7u + 1 + 2u + (-2u + u + 2u)(1 - 1 + 4). -u + 2 Expand (4z + 11z - z)(-2z - 2z + 6z). 28z2 Expand (-2l*4 + 2l*4 - 4l*4)(-2 + 2l + 4l - 3l)(-5 - 2 + 5). 24l5 - 16l*4 Expand (l + l - 3l)(2l - 6l - 8l). 12l2 Expand (-2s*2 - 2s*2 + 5s*2 + (-2s - 2s + 5s)(-s - s + 4s) - 3s2 + 2s*2 - 3s*2)(5s2 - 14s*2 + 4s*2). 5s*4 Expand (-3w + 2w - w)(-3w4 - 21w*3 + 36w*3 + 9w*3). 6w*5 - 48w*4 Expand (-2 + 4 - 1)(0f + 0f - 2f + (4f + 0f - 2f)(4 + 0 - 1))(-4 + 2 + 1). -4f Expand (0 - v3 + 0)((3v + 2v - 4v)(0v + v + v) + 42 - 42 - 6v*2). 4v*5 Expand 2g + 3g4 - 2g + (-2g3 - g4 + 2g*3)(-5 + 4 - 1). 5g4 Expand (-5f*2 + 4f2 - f2 + (-3f + f + f)(-2f + f - f) + 0f*2 + 3f*2 + 0f*2)(3f - f + 0f)(-2f + 4f2 + 2f). 24f5 Expand y + y3 - y + (0y*2 + 2y*2 - 4y*2)(y + 0y + 2y) - 4y3 + 3y*3 - 2y*3 + (2y2 - y2 - 3y2)(0 + 2y + 0). -12y*3 Expand (-2h*2 + 2h*2 - 3h*2)(2h + 0h - h) + (-h + h + h)(3h*2 + 2h*2 - 3h*2) + 2h*2 - 2h2 - h3. -2h3 Expand ((-4 + c2 + 4)(5 - 2 - 5) + 0c2 + c2 - 5c*2)(4c2 - 6c2 - c2). 18c4 Expand (18 - 18 - 4i)(3i*2 - 3 + 3) - 4 - 2i*3 + 4. -14i*3 Expand o + o - o + (-2o + 3o - 3o)(-3 + 2 + 3) + 0 + 2o + 0 + (0o + o + 0o)(1 + 0 + 2). 2o Expand (1 - 2 - 1 - 4 - 3 + 6 + (0 + 5 - 3)(-5 + 2 + 2))(-6t5 + 2t5 + t5). 15t5 Expand (-2 + 2 - 2)(0n + n + 2n). -6n Expand (20 - 20 + 8u - 2u - 4 + 4 + (2u + u - 2u)(3 + 1 - 6) + 2u - 4u + 0u + u + 3 - 3)(-u - 3 + 3). -3u2 Expand (14k + 172 - 172)(-4k*2 + 2k*2 + 3k*2). 14k*3 Expand (5k*2 + 0k*2 - 3k*2)(2k2 + 0k + 0k) + k - k4 - k + 8k - 7k4 - 8k. -4k4 Expand (2a + 0a - a)(-a*4 + 0a*4 + 2a*4) - 33a*3 + 38a*5 + 33a*3. 39a*5 Expand ((-3 + 3 + t)(1 - 1 + 2) + 1 - 1 + 2t)(-2t2 - t + 2t2 + t3). 4t4 - 4t*2 Expand -4p*2 - 3p + 3p + (p2 + 7p*2 - 5p*2)(-6 + 3 - 1). -16p2 Expand (-4 + 4 - 3 + (1 + 2 - 1)(3 - 2 + 1) + 0 + 5 - 4 + 0 + 1 + 2)(2v + 0v - v). 5v Expand (-5 + 5 - 2r)(-2 + 2 - 2) + (-1 + 2 - 2)(5r + 1 - 1) + (-2 + 1 + 2)(-1 + 2r + 1). r Expand (0 + 1 + 1 - 3 + 4 - 3 + (-1 - 1 + 0)(1 + 1 - 3) - 1 + 4 - 6)(-2f + 0 + 0 + (2 + f - 2)(3 - 3 + 1)). f Expand -78i4 - 42i*4 + 92i4 - i2 - 2i4 + i2 + (2i*2 + 0 + 0)(0 + 0 - i2) + i2 - i2 + i4. -31i4 Expand (3 - 14 + 8)(4x4 + x4 - 3x*4). -6x*4 Expand 3f*2 + 0f*2 - 2f*2 + (f - 3f + 3f)(-3f + 8f + 2f). 8f*2 Expand (3m*3 + 9 - 9)(0m - 7m + m). -18m4 Expand (0 - 6 + 4)((3 - 2 + 0)(0w - 2w2 + 0w) + (0 - 3 + 2)(-3w*2 + 0w*2 + 0w*2)). -2w*2 Expand (3z + 2z - z)(-5z - 2z + 4z) + (2 + z - 2)(-3z + 5z + 0z) - 2z2 + z2 + 2z2. -9z*2 Expand (-2 + 2 + 2)(-l - 15l + 0l)(3l*2 - 3l*2 - 2l*3). 64l*4 Expand 34u*5 - 77u*5 + 116u*5 + (-2 + 2u + 2)(3u*4 - 2u4 + u4). 77u5 Expand (-2f + 3 - 1 - 1)(2 + 4f*3 - 2). -8f*4 + 4f*3 Expand (c - c - 5c*2)(0 + 0 + 1)(2c + 4c - 2c). -20c3 Expand (2 - 4 + 4)(6u - 2u - 2u) + u - 5u + 24u + 2 + u - 2 + (0 + 3 - 5)(2u - 3u + 0u). 27u Expand 2m4 - m + m + 2m*4 + 2m - 2m + (3 + 2m*3 - 3)(2m + 0m + 0m) + 2m4 + m4 - 4m4 + (4m3 - m3 - 2m3)(-4m + 3m + 0m). 6m*4 Expand -5j*2 + 4 - 4 + (-3j - 3j + 5j)(-4j + 2j + j) - 2j*2 + 4j*2 + 3j2. j2 Expand (r*3 + 0r*3 - 2r*3)(4r - 3r + r) + 0r4 + 0r4 - r4 + (2r - 2r + r*2)(2r2 - 3r*2 + 3r2). -r4 Expand (-2 + 4 + 0)(-2z + 0z + z) + (1 - 1 - 6)(-z + 6z - 2z). -20z Expand 2l*2 - 2l*2 - 2l*4 + (-1 + 1 - 2l)(3l3 - l3 - 4l3) - 5l + 0l4 - 2l + 2l4. 4l*4 - 7l Expand ((-2z2 + 2z*2 - 3z*2)(-2z - 1 + 1) + 2z3 - 1 + 1 + z3 - 2z3 + 3z*3)(z - 2 + 2). 10z4 Expand (-3 + 8z + 2 + 0)(2z + z - z). 16z2 - 2z Expand (-2f + 2f - f)(3f - 3f - 2f + (-2 - 2 + 3)(4 - 4 - f))(2f - 3f + 5f). 4f3 Expand (-q2 + q*2 + 8q*2)(2q2 + q - q). 16q*4 Expand (-z - 2z*3 + z)(2 - 1 - 5) - z*3 - 2z*3 + 4z*3. 9z*3 Expand (5x + x - 3x)(2x3 - 3 - 23x*2 + 23x*2). 6x*4 - 9x Expand (3 + 0 - 7x + 4x)(-2 + 3 + 0)(x2 + x2 - x*2). -3x*3 + 3x*2 Expand (7f + 22 - 22)(3f + 9 - 9)(-2f + 0f + f). -21f*3 Expand (-3n + 2n - 2 - 1)((2 - 2n - 2)(-5n2 + 3n*2 + 3n*2) - 6n*3 - 2n*3 + 3n*3). 7n*4 + 21n*3 Expand (3b - 3b - 3b3 + (b - b2 - b)(b - 2b + 4b))(-2 + 0 + 4). -12b3 Expand -4d*5 + 4d5 + d5 - 3d5 + 0d*5 + 2d*5 + (-4d*2 + 5d2 + d2)(d3 + d2 - d2) + (0d*4 + 4d*4 - 3d*4)(8 - 18d + 5d - 5). -11d5 + 3d*4 Expand (4f*2 - 5f2 - f2)(4f*2 - 5f*2 + 2f2 + 0 + 0 + f2 + (0f + 2f - f)(f + f - f) + 2f2 - f2 + f2 - 1 - f2 + 1 - f + f + f*2). -10f*4 Expand -25w5 - w4 - 39w5 - w4 + (1 + 1 - 1)(-3w5 + 4w*5 - 3w*5). -66w*5 - 2w*4 Expand (-5u3 + u3 + 2u3)(4u + 3u - 5u) - u4 + u4 + u4 - 2u*4 + 2 - 2 + (-3u*3 + 2u3 - u3)(2u - 3u + 2u). -7u4 Expand (-x + 5x - 3x)(-5x2 + 4x2 - x2). -2x3 Expand (-2j*2 + 2j*2 - 3j*2)((-16 + 3 + 3)(-2 + 0 + 3) - 1 - 1 + 0 + (0 - 2 + 4)(2 - 3 + 3)). 24j2 Expand -10s4 + s4 - 5s4 + s2 - s2 + 2s*4 + (2s*2 + 0s*2 + 0s*2)(-5s2 - 2s*2 + 5s*2). -16s*4 Expand 3t + 3t4 - 3t + 4t4 + 0t*4 - 3t*4 + (-3t*3 + 2t*3 + 2t*3)(-2 + 2 + 2t) + 6t*4 - 13t*4 - 27t*4. -28t*4 Expand -2x*3 + 2x*2 - 7x*4 + 2x*3 - 4x*4 - 2x*4 + 7x*4 + (5x*2 - 5x*2 - 2x*3)(0x + 5x - 3x). -10x*4 + 2x*2 Expand (-1 + 1 + 2)(-3h5 + 2h*5 + 4h*5) + (2h3 + h3 - 5h3)(-h*2 - 4h*2 + 4h2) + h5 + 0h4 + 0h*4. 9h*5 Expand (-5 + 1 + 0)(-m - 2m + 0m)(-4 + 3 + 0). -12m Expand (14 + 4y3 - 14 + 2y*4)(3y + y - 5y + (-y + 1 - 1)(3 - 1 + 0) + 0 + 0 - 2y). -10y5 - 20y*4 Expand (-4 + 0 + 3)(1 - 1 - g) - 4g + 5g - 5g. -3g Expand -3y3 + 7y*3 - 7y3 + y - y + y3 + (-2 + 4 - 3)(5y*3 + 0y*3 - 3y3) + y3 - 4y3 + 5y*3. -2y*3 Expand (3n - 7n + 2n)(-2 + 5 - 1) + n - 2n + 2n + n - 5n + 2n + (-3n - 2n + 3n)(2 + 4 - 5). -7n Expand -10 + 10 + 3b - 2b - 1 + 1 + (1 - 6 + 3)(-b + b - b) + 2b - 4b + 3b. 4b Expand 2 + 2z*3 - 2 + (-5 - 3 + 4)(z3 - z3 + 9z3). -34z3 Expand (v3 + 66v - 66v + 6v2)(-9v2 + 24 - 24). -9v*5 - 54v*4 Expand (-1 - 2 + 0)(q - 1 - 9q + 0). 24q + 3 Expand (-3w - 4w + 1 + 3w)(-19 - 13 + 21). 44w - 11 Expand (z - 2 + 2 - 2z - 2 + 2 + (4 - 2 + 0)(-2z - 1 + 1))(1 - 1 - 2z*4). 10z*5 Expand (a - a - 2a*2)(-3a + 0a + 7259a2 - 7260a*2 + 25). 2a*4 + 6a*3 - 50a*2 Expand (-5 - 3h + 5)(-2h - 3 + 0h + 6h*2 + 4). -18h*3 + 6h*2 - 3h Expand (0l2 + 0l*2 - 2l3 + (-l2 -	{ "pile_set_name": "DM Mathematics" }
. Let y = 31 - 28. Is (d/3)/(-1)y prime? False Let f(u) = 3u*2 + 3u - 17 + 41 + u - 21. Let k(j) = -j*3 + 6j*2 - 2j + 4. Let b be k(6). Is f(b) prime? True Let k(a) = -160a3 + 2a*2 - a - 2. Is k(-1) prime? False Let o(v) = v + 12. Let n be -1(-2 - 0) + 7. Suppose -b + 0b = -n. Is o(b) a composite number? True Let y = 54 - 28. Is y a prime number? False Let d(n) = -371n3 + n2 + 2n + 1. Is d(-1) prime? False Is 76/(-6)(-27)/18 a prime number? True Let f = -240 + 385. Is f composite? True Is ((-67)/2)/(7/(-14)) composite? False Suppose 7525 = 3v + 2v. Suppose 0 = -a - 4a + v. Is a a composite number? True Let z(y) = 15y*2 - 8y - 6. Is z(-5) composite? False Let k = 205 - 135. Suppose -z - 3i = -k, -2z - 4i + 146 = -0z. Is z composite? False Suppose -9l = -505 - 746. Is l prime? True Suppose -2b - 3b + 3i = -1006, 0 = -5b - i + 1018. Is b composite? True Let j(s) = s2 + 8s + 7. Let o be j(-7). Let l(h) = h3 + h2 + 41. Let c be l(o). Suppose -29 = -2n + c. Is n composite? True Let f(x) = -x2 - 8x - 4. Let s be f(-8). Is 2 - (-161 - s/2) a composite number? True Let h(z) = 2z2 - 2z - 1. Let n be h(-2). Let r = -4 + n. Is r a composite number? False Suppose 4p = -297 + 1717. Is p a composite number? True Suppose -2x = -2g - 580, -4x + g = -0x - 1169. Is x prime? True Suppose 5p - 39825 = -0p. Suppose 4b - p - 2823 = 0. Is b/39 - 4/26 a prime number? False Suppose 3z = 9 - 0. Suppose -3 + 42 = zd + 2t, 48 = 3d - t. Is d prime? False Let r be (-9)/252/(-3). Let v = 127 - r. Is v composite? True Suppose 3x + 429 = 3y, -y + 6y + x - 715 = 0. Is y composite? True Suppose -n = -27 - 6. Suppose -s = -4s + n. Is s composite? False Let n(i) = -i + 4 - 4 + 3. Let o(v) = -v3 + v2 - 3v + 2. Let b be o(2). Is n(b) composite? False Suppose 4l - 12 = -0l. Suppose -329 = -lo + 244. Is o a composite number? False Let v(j) = -4j*3 - 3j*2 - 9j - 8. Let r(d) = -d3 + d2 - d. Let g(z) = -5r(z) + v(z). Is g(9) a prime number? True Let m = -1037 - -1590. Is m a prime number? False Let l be 9/15 - 2/(-5). Let s be 25 - 2/(l + 0). Let i = s - 16. Is i prime? True Suppose 6h - 3h - 5m = -49, -5m = -2h - 36. Is (136/4)/((-2)/h) composite? True Is (2 - (-5)/(-2))(2 - 2520) prime? True Let a(o) = 37o - 2. Let n be a(5). Suppose 5x = -l - n, -4x - 2l = -l + 146. Let v = 164 + x. Is v composite? False Let f be 2/40/1. Suppose f = 5n - 154 - 191. Is n composite? True Let s = 39 - 72. Let q = 104 + -168. Let i = s - q. Is i a prime number? True Suppose -28 = -3q - 19. Suppose -i + 44 = -g - 4g, 0 = -qi - g + 180. Is i a composite number? False Is (4/(-6))/(4/(-126)) prime? False Let i be ((-4)/(-10))/(2/1010). Suppose 2s - 4f - i = 0, 0 = 2s - 5s + 4f + 297. Is s prime? False Suppose 0 = 4p - 0p + 44. Let a(y) = -5y*2 - y + 12. Let c be a(-4). Let t = p - c. Is t a composite number? False Suppose -2k + 2m = 8, 4m - 6m + 13 = 3k. Suppose 0 = o + k - 4. Is 165 + 0 - (o - 1) a prime number? True Let k = -13 + 15. Suppose -kf + 57 = f. Is f prime? True Let q = 10 - 6. Suppose qk = 5m - m, 4k + m + 5 = 0. Is k/1-117 a prime number? False Let d(i) be the first derivative of 31i4/2 + i3/3 - i2 + i - 3. Is d(1) composite? True Is 1706/(16/6 - 2/3) a prime number? True Let b = -8963 + 18756. Is b a prime number? False Let s = 665 + -186. Is s composite? False Suppose 0 = -3i + 592 + 1961. Is i composite? True Let d = -503 + 1248. Suppose 0 = -4y + 9y - d. Is y a composite number? False Let x(t) = -2t2 - 6t - 6. Let y be x(-4). Let h = y - -21. Suppose -hn + 60 = -3n. Is n a composite number? True Let j be (-2)/(-8) - (-126)/(-24). Is -1 + (94 - (j + 3)) prime? False Suppose 0 = -5d - 0b - b - 1211, -3d - 728 = 2b. Let j = 355 + d. Suppose 0h - h = -j. Is h composite? False Let d(n) = n2 + n + 4. Let y be d(0). Suppose -3o - yz = -8o + 170, -o = -2z - 34. Suppose -u - 4f + o = 1, -5u - 2f = -75. Is u a prime number? True Suppose 4o = 2o + 4. Suppose -4m + 2r = -158, 5 - 74 = -om - r. Is m composite? False Let b = -1 - -6. Suppose -2z + 82 - 20 = -bl, 3l + 58 = 2z. Is z composite? True Suppose 2s + 0o - 19 = 3o, -3o = 3s + 9. Suppose 0 = 3x + sx - 310. Is x prime? False Let v = 2292 - 1577. Suppose 2i = -w + v, 2i - 560 - 130 = 4w. Is i composite? True Suppose 0 = -4f - 20, 3n - 3f - 40 - 2 = 0. Suppose 0 = 3i - n, -x - 41 = -2x - 2i. Is x prime? False Suppose -2q - 12 = q. Suppose 5u - 19 - 11 = 0. Is u/q38/(-3) prime? True Suppose 7r + 5 = 2r. Is (r - -240) + 1-2 a composite number? True Suppose 0k = k + 4p - 271, -p + 1260 = 5k. Is k composite? False Suppose -810 = -4o + 3n, 2o + 7n = 3n + 416. Let m be ((-2)/(-6))/(4/o). Suppose 5q = 132 - m. Is q composite? False Let z be (-1)/3 + 8/6. Let l(g) = -g*2 + g. Let m be l(z). Let j(d) = -d + 223. Is j(m) prime? True Let g(b) = 4b*2 - 1. Let u(m) = -4m + 3m2 - 2 + 2m + 3m. Let p(w) = 4g(w) - 5u(w). Is p(4) composite? False Suppose 4n - 263 + 19 = 0. Is (2 - n)/(1/(-7)) a prime number? False Suppose q = -2q + 6. Suppose 0k - 31 = -4v - 3k, -qv = -k - 3. Is v a prime number? False Suppose a + 27 = -9. Let x = a + 19. Let c = x + 66. Is c a prime number? False Let r = -6412 - -9093. Is r a composite number? True Suppose 0 = z + 5k - 5, 2z = k + 59 + 6. Let a = 2 - z. Let m = -15 - a. Is m a composite number? False Let b = 21 + -15. Let q(w) = w - 3. Let x be q(b). Let n(p) = 2p*3 - 2p*2 + 3p - 2. Is n(x) composite? False Let t(r) = -r*3 - 7r*2 + 2r + 6. Let j be t(-7). Is (0 - (-4)/j)-118 a prime number? True Let f(y) = y + 6. Let q be f(-6). Suppose -2u = -3s + 565, q = -s + 6s + 3u - 910. Is s a composite number? True Suppose 9b = 55902 - 16959. Is b prime? True Suppose -4y = f - 240, -2f + 372 = 5y + 69. Is y prime? True Let q be (2 - -2)68/2. Let c = -23 + q. Suppose 0 = -4s + 3n + 489, -3s = 3n - 485 + c. Is s a prime number? False Suppose -4c + 2h + 3442 = -0h, 4320 = 5c + h. Is c a composite number? False Suppose -5z - 4f = -2208, z + f - 394 = 48. Suppose -5d = 5g - 585, 0d + 3d + z = 4g. Is g a composite number? False Suppose 2t + 2n = 3n + 674, -5n - 1011 = -3t. Is t a prime number? True Suppose 0v + 6 = 2v. Suppose -h - vk - 124 = -664, h - 532 = -5k. Let q = h + -329. Is q prime? True Let k be 1/((4 + -1)/3). Is k + 0 + 1130 a prime number? True Let z = 678 - 385. Is z a prime number? True Suppose -9 = -3w + p, 7w - 2w - 16 = 2p. Let x = 8 - 5. Suppose wn = -xn + 475. Is n a composite number? True Let l(t) = -t2 + 11t - 7. Let w be l(10). Let j(s) = 27s + 2. Let q be j(2). Suppose q = h + w. Is h composite? False Let f(l) = -l + 8. Let y(s) = -s + 8. Let p(w) = -5f(w) + 6y(w). Let t be p(4). Suppose -5x + 943 = tm, x + 5m = 3x - 397. Is x prime? True Let p be -3(-2)/(-4)-4. Suppose -8b + 430 = -pb. Is b a prime number? False Let f = 7713 - 4676. Is f a prime number? True Suppose 4p + 3 = 7. Suppose 1 = g - 1. Is g + (p - -42) + 1 a composite number? True Suppose 0 = 2b - 2i + 142 - 428, -2i - 580 = -4b. Let o = 214 - b. Is o a prime number? True Let o(j) = -j*3 + 11j*2 + 4j + 7. Is o(11) a prime number? False Suppose 6b + 4b = 20690. Is b prime? True Let a = 596 - 91. Is a composite? True Let p(x) = 3x2 - 12x - 8. Is p(9) composite? False Let d(u) = 2u2 - 10u + 45. Is d(-11) prime? True Let f(m) = -7m3 + 3m*2 - 2m + 2. Let i be f(3). Let l = i - -253. Is l a prime number? False Let o(j) = -5 + 2 - 1 + 0 + 27j. Is o(7) prime? False Is 11/((2/(-222))/((-5)/15)) a prime number? False Let k = -1 - -3. Let b(y) = -y3 - y2 + y + 65. Let c be b(0). Suppose 0 = s + u - 0u - 60, c = s + ku. Is s prime? False Let x be (-6)/(-3) - (0 + -1). Suppose -xr = 2o - 178, -o + 4r + 206 = o. Let g = 190 - o. Is g a prime number? False Let p(v) = 30v + 5. Let h be p(4). Suppose h = 4m - 151. Is m prime? False Suppose 6j - 2880 = -2l + 3j, 3j + 1431 = l. Is l a composite number? True Let g be 36/8 + 4/8. Suppose -886 = -gd - 2p + 6p, 5d = -4p + 894. Is d a composite number? True Let h(m) = -8m + 3. Let l be h(-3). Suppose 0 = 4r - 5r -	{ "pile_set_name": "DM Mathematics" }
15/(-30) - g/4. Factor -2c + 3c - 16c + 5c*3 - y. 5(c - 2)(c + 1)2 Solve -43/5n*3 + 0n + 44/5n2 - 1/5n*4 + 0 = 0. -44, 0, 1 Let p = -635353/3 - -211786. Let 2/3q*2 + 0 - pq = 0. What is q? 0, 5/2 Let o(t) be the first derivative of -4t3/15 - 132t*2/5 + 268t/5 - 361. Determine w, given that o(w) = 0. -67, 1 Let g(a) = 2a2 - 88a - 84. Let q be g(45). Let p(f) be the second derivative of 2/15fq - 2f*2 + 0f*4 - 16f + 0 + 4/3f3 - 2/5f*5. Factor p(h). 4(h - 1)*3(h + 1) Factor -5/2d3 + 5/2d*2 - 225/2 + 105/2d. -5(d - 3)2(d + 5)/2 Let x(t) be the third derivative of -2t7/105 + 13t*6/120 + 59t*5/20 + 93t*4/8 - 27t*3/2 + 26t*2 + 31t. Factor x(h). -(h - 9)(h + 3)2(4h - 1) Let q(c) be the first derivative of -111c*5/5 + 3c*4/4 + 111c*3 + 213c*2/2 - 6c + 7434. Determine i so that q(i) = 0. -1, 1/37, 2 Let m(a) be the first derivative of 4a3/15 + 1404a*2/5 - 2812a/5 + 7291. Factor m(r). 4(r - 1)(r + 703)/5 Let a(x) be the second derivative of -5/3x3 + 0 + 0x*2 - 1/90x*5 - 1/540x*6 + 24x - 1/36x4. Let c(b) be the second derivative of a(b). Factor c(d). -2(d + 1)2/3 Let h(v) = v3 - 16v2 - 16v - 14. Let t be h(17). Solve 3rt - 16r*4 + 5r*2 + 15r + 18r4 - 21r2 - 3 - 1 = 0. -4, 1/2, 1 Let l(j) be the first derivative of j6/540 + 17j5/90 + 289j4/36 + j3/3 + 32j + 61. Let n(v) be the third derivative of l(v). Solve n(c) = 0 for c. -17 Let k = 1252/183 + -764/183. Factor 3q - k - 1/3q2. -(q - 8)(q - 1)/3 Factor -326/3x + 329 - 1/3x*2. -(x - 3)(x + 329)/3 Solve 0 - 2/11a4 + 0a + 40/11a3 - 150/11a2 = 0. 0, 5, 15 Let s(j) be the third derivative of j5/180 - 125j4/36 + 1225j*3/18 - 140j*2 + 2j. Suppose s(o) = 0. Calculate o. 5, 245 Factor -3/2q4 - 378q*2 - 51q*3 + 972q + 0. -3q(q - 2)(q + 18)2/2 Let u be 2 + ((-39)/6)/((-1)/2). Let f = 17 - u. Let 208y*f - 208y*2 - 5y3 = 0. Calculate y. 0 Let n(c) be the third derivative of -c5/20 + 8c4 + 10c*2 + 136. Factor n(o). -3o(o - 64) Let j = 125455 + -125449. Factor -j - 6075/2d*2 - 270d. -3(45d + 2)*2/2 Let f = -1211894 - -7271365/6. Factor 0 - fl*2 - 13/6l. -l(l + 13)/6 Factor -1/6c*3 + 4 - 1/2c*2 + 5/3c. -(c - 3)(c + 2)(c + 4)/6 Let z(a) be the second derivative of 209/12a4 - 1/42a*7 + 50a*2 + 190a + 0 + 1/2a6 - 83/20a*5 - 40a3. Factor z(n). -(n - 5)2(n - 2)2(n - 1) Let i(z) = 11z + 4. Let a be i(-1). Let p be 6/84-4a. Factor -3/5v*3 + 0 + 1/5v5 - vp + 1/5v4 - 2/5v. v(v - 2)(v + 1)*3/5 Let g(v) be the first derivative of 5v*6/6 - 3v*5/2 - 11v*4/12 + 2v*3 + 2v*2 - 33v + 156. Let n(l) be the first derivative of g(l). Factor n(z). (z - 1)*2(5z + 2)2 Let c = -148/21 - -50/7. Let d be (11284/392 + -29)/(2 - (-11)/(-4)). Suppose 2/21j*4 + 4/21 + cj*3 - dj*2 - 2/21j = 0. What is j? -2, -1, 1 Let u(s) = 19s3 + 139s*2 - 6017s - 108427. Let a(m) = -10m3 - 70m*2 + 3010m + 54214. Let x(w) = -11a(w) - 6u(w). Factor x(c). -4(c - 28)(c + 22)*2 Let s be (-1033 - -1045) + (-204)/22 + -2. Factor 0 + sb*4 + 12/11b*3 + 2/11b*5 + 8/11b*2 + 2/11b. 2b(b + 1)*4/11 Suppose 0 = 4l + 3i - 150 - 21, 4l + i = 161. Suppose -4w = -w - l. Factor 5d*4 + 18d + 42d + 7 + 65d*2 + 30d*3 + w. 5(d + 1)*2(d + 2)*2 Let n be (-38)/475 - 51/(-450). Let o(t) be the third derivative of 0t*4 + 0t*3 + 0 - 15t*2 + 0t + 3/40t6 - 1/30t*5 - nt7. Solve o(v) = 0. 0, 2/7, 1 Let p(v) be the second derivative of -v7/210 - v6/30 - v5/20 + 197v2/2 - 10v - 1. Let n(u) be the first derivative of p(u). Factor n(j). -j*2(j + 1)(j + 3) Let w(g) = g3 - 496g*2 + 62499g + 63051. Let f(i) = i*2 + 10. Let l(h) = -15f(h) + 3w(h). Factor l(c). 3(c - 251)*2(c + 1) Let o be 3/((0 - -6)/6). Factor -1044j - 349j*3 + 84j*4 - 208j*2 + 1400j*2 - 4j*5 + 324 - 203j*o. -4(j - 9)*2(j - 1)*3 Let h be 6 + -6 + -5 + -23. Let s be 16/h - 605/(-140). Solve 5/4n - 5n3 + 0 - 5/2n*4 + 5/2n*2 + sn*5 = 0 for n. -1, -1/3, 0, 1 Let f = 90 + -85. Suppose 4p - 134 = -2k, 6p + 296 = fk + 3p. Factor b*4 + 4 + 3b*3 - kb + 6b2 - 3b*4 + 51b - b*3. -2(b - 1)*3(b + 2) Let z(m) be the third derivative of -441/2m3 + 1 - 21/4m*4 + 0m + 74m2 - 1/20m*5. Find y, given that z(y) = 0. -21 Let q(w) = -2w*5 + 53w*4 + 1568w*3 - 43892w*2 - 3. Let v(f) = 4f*5 - 105f*4 - 3136f*3 + 87780f*2 + 7. Let u(y) = -7q(y) - 3v(y). Factor u(d). 2d*2(d - 28)*2(d + 28) Let y = 2879/9168 + -56/191. Let m(l) be the second derivative of yl4 + 0l*2 + 1/80l*5 - 1/120l*6 - 1/168l*7 + 0l*3 + 0 - 21l. Factor m(t). -t*2(t - 1)(t + 1)2/4 What is j in -864/7 + 4/7j*4 - 100/7j*3 - 240/7j + 520/7j2 = 0? -1, 2, 6, 18 What is x in 33x*3 - 36x*4 + 51x*2 + 108x + 24 + 26x2 + 162x*2 - 101x*2 - 15x*5 = 0? -2, -1, -2/5, 2 Let s(v) be the third derivative of -31/12v*4 + 961/3v*3 + 0 + 1/120v*5 - 4v*2 + 32v. Determine p so that s(p) = 0. 62 Let t = -1971 + 6272/3. Let a = t - 119. Find d, given that -ad + 0 + 4/3d*2 - 4/3d*4 + 2/3d*3 = 0. -1, 0, 1/2, 1 Suppose 0 = 5p - 1451i + 1454i - 28, 0 = -4p - 2i + 20. Factor 2/7b2 - 36/7 - pb. 2(b - 9)(b + 2)/7 Let m(t) be the third derivative of -t*5/240 - 11t*4/32 + 17t3/12 + t2 - 94t. Determine k so that m(k) = 0. -34, 1 Factor -11/6d*3 + 1/2d*4 + 1/2d + 5/6d2 + 0. d(d - 3)(d - 1)(3d + 1)/6 Let -5/4y*5 + 645/4y - 7/2y2 - 76y*3 - 117/2 - 22y4 = 0. Calculate y. -13, -3, 2/5, 1 Let b(z) = z2 - 9. Let n be b(-3). Let l = 121 + -117. Solve nd2 + 0d*2 - 3d*l - 3d*2 + 21d*3 - 27d*3 = 0. -1, 0 Let s(k) be the first derivative of 52 + 8/3k - 1/9k3 + 1/3k*2. Factor s(q). -(q - 4)(q + 2)/3 Factor -8/9g2 - 2/9g*3 + 8/9 + 2/9g. -2(g - 1)(g + 1)(g + 4)/9 Let f be 5/((-20)/12) - (-31 - -25). Let b(g) be the first derivative of -3 + 0g - 3g4 + 4/5g*5 - 2g*2 + 4g*f. Suppose b(d) = 0. What is d? 0, 1 Suppose 179p + 48 = 191p. Suppose l = -l + 6. Let 195 + 3x*5 - 195 - lx*p - 3x*3 + 3x*2 = 0. What is x? -1, 0, 1 Let z(g) = -26g*4 + 3g*4 + 7 + 8g*4 - 25g*3 - 88g*2. Let c(x) = 2x4 + x3 + x*2 - 1. Let k(w) = -21c(w) - 3z(w). Let k(b) = 0. What is b? -9, 0 Let r(f) be the second derivative of -f6/60 - 153f*5/20 - 2601f*4/2 - 88434f*3 + 151f. Let r(o) = 0. What is o? -102, 0 Suppose 42q - 52 = 7508. Let b be -1 - 1 - (-400)/q. Solve by*3 + 0 - 2/3y*2 + 4/9y = 0 for y. 0, 1, 2 Let k = -1124654/1791849 - 44/4297. Let h = 4/139 - k. Factor -26/3f2 + hf*3 - 24 + 32f. 2(f - 6)2(f - 1)/3 Let c(w) = w*3 + w - 1. Let h be (-4)/(-8)12. Let p(u) = -4u*4 + 8u*3 + 4u - 4. Let x(y) = hp(y) - 4c(y). Solve x(l) = 0 for l. 0, 1 Let j be 665/30 + -9. Factor -1/5z*j + 7/5 + 6/5z. -(z - 7)(z + 1)/5 Let s(k) be the first derivative of -1/5k*5 + 0k + 1/2k4 + 1/3k3 - k2 + 94. Factor s(m). -m(m - 2)(m - 1)(m + 1) Let d(m) be the third derivative of 2/35m*7 - 2/15m*5 + 2/3m*4 - 2/3m*3 - 99m*2 - 2/15m*6 + 0m + 0. Factor d(k). 4(k - 1)2(k + 1)(3k - 1) Let n(f) be the first derivative of 6/5f2 + 2/3f*3 + 2/5f + 22. Factor n(y). 2(y + 1)(5y + 1)/5 Suppose m = -2, -o - 8m + 10m = -6. Determine t, given that ot*2 - 24 - 6t + 24 - 8t - 8t = 0. 0, 11 Let g be ((-81)/(-30) - 9/45)6. Determine q, given that 55q*2 + 15q - 3q4 - gq*3 - 2q*4 + 11500 - 11550 = 0. -5, -1, 1, 2 Let m be 37/57 - (-2394)/(-7581). Determine p so that -mp*2 - 147 + 14p = 0. 21 Factor 0 + 655u - 1/3u*2. -u(u - 1965)/3 Let g be 6/10 + 123(-14)/(-105). Let l be 3/(-5)((g - 12) + -10). Let -6u2 + 3/2u*l + 15/2u - 3 = 0. Calculate u. 1, 2 Factor 0b + 13/4b*3 + 5/12b*5 - 3/4b*2 + 0 + 29/12b4. b2(b + 3)2(5b - 1)/12 Let s(i) be the first derivative of -2i*6/3 - 52i*5/5 - 58i*4 - 352i*3/3 + 64i*2 + 512i + 993. Factor s(v). -4(v - 1)(v + 2)(v + 4)3 Let j(v) = -2v*2 - 10v + 14. Let z be j(-7). Let b = z + 18. Factor 2o2 + 3o + bo + 3o2 + o3 + 3 + 0o. (o + 1)*2	{ "pile_set_name": "DM Mathematics" }
1 + 20750o. -87o Collect the terms in 14448k3 - 28974k*3 + 14501k*3. -25k*3 Collect the terms in -476a + 1069a + 1302a - 257a. 1638a Collect the terms in -66p2 - 178p*2 - 28p*3 + 18p*3 - 64p*2 - 67p*2 + 375p*2. -10p*3 Collect the terms in -4587862s*3 + 9176236s*3 - 4588016s*3. 358s*3 Collect the terms in 42l*3 + 2 - 64l*3 + 43l*3 + 23l*3 - 2. 44l*3 Collect the terms in -12648l*2 - 7897l*2 - 7041l*2. -27586l*2 Collect the terms in -1390q*2 + 1897q*2 - 502q*2. 5q*2 Collect the terms in 75 - 28 - 26 - 21 - 118247q*2 + 118250q*2. 3q*2 Collect the terms in 13n + 16n - 36n + 7n + 17496n*3. 17496n*3 Collect the terms in 248o - 53o + 24o*3 + 112o*3 + 2o*2. 136o*3 + 2o*2 + 195o Collect the terms in -258003j2 - 19671j*2 - 156355j*2 - 45084j*2. -479113j*2 Collect the terms in -107236t + 53496t + 53609t. -131t Collect the terms in 1934 - 1846u - 1851u + 3681u. -16u + 1934 Collect the terms in 670p*2 - 2137 + 420p*2 + 2137 - 203p*2. 887p*2 Collect the terms in 12150n + 11418n - 34946n + 11398n. 20n Collect the terms in 876b2 - 1849b*2 + 982b*2. 9b*2 Collect the terms in -159681w*2 + 319372w*2 - 159691w*2 - 5682w*3. -5682w*3 Collect the terms in 30c - 868 + 30c - 874 + 3538 - 1796. 60c Collect the terms in -190407 + 571212 - 190409 + 4p - 190396. 4p Collect the terms in 2d + 2d + 988 - 2d2 - 6d. -2d2 - 2d + 988 Collect the terms in 865y + 860y - 1714y - 208 + 208. 11y Collect the terms in 11917 + 11907 - 16r3 + 41r*3 - 23800. 25r*3 + 24 Collect the terms in -7 - 2769w + 91 - 17 + 2768w - 38. -w + 29 Collect the terms in 369944584s + 11s3 - 369944584s. 11s3 Collect the terms in 303 - 529v - 99 - 103 - 9 - 92. -529v Collect the terms in 585 - 180 - 24g - 197 - 179. -24g + 29 Collect the terms in 59 + 40 + 0f*2 + 26 + 59f*2 - 34. 59f*2 + 91 Collect the terms in -233i - 5 + 9 - 9381i - 2 - 2237i. -11851i + 2 Collect the terms in -418 + 1219 - z + 815 + 3z - 234. 2z + 1382 Collect the terms in 5o*3 - 161842o + 80921o - 2o*3 + 80921o - 2o3. o3 Collect the terms in -19a - 24a - 31 - 243a*2 + 37a + 107a2 + 114a*2. -22a*2 - 6a - 31 Collect the terms in -1077347b - 1077273b + 2154621b. b Collect the terms in 7827414463u*2 - 7827414463u*2 + 5u*3. 5u*3 Collect the terms in 11o*2 + 0o*2 - 12o*2 - 1138292o + 1138429o. -o2 + 137o Collect the terms in -3 + 18179r3 - r + 1 - 9068r*3 - 9095r*3 + 2. 16r*3 - r Collect the terms in -409n*2 + 93n*2 + 66n*2 + 141n*2 + 106n*2. -3n*2 Collect the terms in 114425t + 4t2 - 31 + 35 - 4 - 114425t - 5t2. -t2 Collect the terms in -963x*2 - 3155x*2 + 1262x*2. -2856x*2 Collect the terms in -1257806k*3 + 1257689k*3 - k - 25 + 25. -117k*3 - k Collect the terms in 1890 - 3993 - 2v*3 + 2203. -2v*3 + 100 Collect the terms in -1317v*2 - 20109v + 1266v2 + 98 + 20109v - 96. -51v2 + 2 Collect the terms in 5w + 550313798771 - 550313798771. 5w Collect the terms in 1590s*2 - 787s*2 - 97s*3 - 803s*2. -97s*3 Collect the terms in -48922394174p*3 + 24461197100p*3 + 24461197089p*3. 15p*3 Collect the terms in -2 + 8 - 1977t*2 - 4 - 2 + 1773t*2. -204t*2 Collect the terms in -2663y + 10655y - 2686y - 1 + 1 - 2650y - 2659y. -3y Collect the terms in 187849t*2 - 378967t*2 + 189501t*2. -1617t*2 Collect the terms in 2227f - 128f + 3911f + 1062f. 7072f Collect the terms in -10 - 14u + 5 + 10u*2 + 6 + 4. 10u*2 - 14u + 5 Collect the terms in 787 - 60v - 301 - 250 - 238. -60v - 2 Collect the terms in 11 + 11 - 87c - 4 - 2 + 4. -87c + 20 Collect the terms in 238 + 6373s2 + 210 + 228 - 6372s2. s2 + 676 Collect the terms in -3 + 2 + 108l2 + 0 - 1309l*2 + 7. -1201l*2 + 6 Collect the terms in -11704 + 3894 + 3910 - 60l + 3900. -60l Collect the terms in 7v - 4v - 447437623785 - 3v + 447437623785 + 19v3. 19v*3 Collect the terms in -28y - 439 + 0y2 - 27y + y*2 + 55y + 326. y*2 - 113 Collect the terms in -1098 - 17917l*2 + 17911l*2 + 548 + 550. -6l*2 Collect the terms in -5752 - 59879z*3 - 5754 + 11506 + 3z*2. -59879z*3 + 3z*2 Collect the terms in 3769468 - b - 1262b*2 - 3769468. -1262b*2 - b Collect the terms in -382013s - 499963s - 648799s + 37510s. -1493265s Collect the terms in -13w + 675w*2 - 2 + 0w - 720w2. -45w*2 - 13w - 2 Collect the terms in -248 - 145 - 246m3 + 393. -246m*3 Collect the terms in -29p*2 - 7 + 3026p + 4145p - 6 + 11. -29p*2 + 7171p - 2 Collect the terms in 3610 + 15763 - 93944 - 3c. -3c - 74571 Collect the terms in -1438 + 228159f2 + 1438. 228159f*2 Collect the terms in 1221 + 28j*2 + 2j - 30j2 + 10653. -2j*2 + 2j + 11874 Collect the terms in 4d2 - 20431d*3 - 4d*2 + 22626d*3. 2195d*3 Collect the terms in -221a*2 + 535a*2 - 4441a*2 - 651a*2. -4778a*2 Collect the terms in -241q + 644q - 232q - 221q + 53q. 3q Collect the terms in 1069022m*2 - 2138055m*2 + 1069027m*2. -6m*2 Collect the terms in 636w*2 + 5 - 18 + 283w*2. 919w*2 - 13 Collect the terms in 559l*2 + 3867849107 - 3867849107. 559l*2 Collect the terms in 208j*3 + 0 + 3033j - 3033j + 2 - 2. 208j*3 Collect the terms in 3t*3 + 5610 + 5746 + 12200 - 5257. 3t*3 + 18299 Collect the terms in -6638j*3 + 21627j3 - j2 - j*2. 14989j*3 - 2j*2 Collect the terms in 58 - 8 - 83h - 183h - 26. -266h + 24 Collect the terms in 1252r2 - 2507r*2 + 1017r*3 + 1017r*3 - 2032r*3 + 1255r*2. 2r*3 Collect the terms in 95a*2 - 39a*2 - 89a*2 - 7a + 7a + 187a*2. 154a*2 Collect the terms in -298861079259h + 298861079259h - 19h*2. -19h*2 Collect the terms in -1542952254w*2 + 1542952254w2 - w3. -w*3 Collect the terms in 596503y*2 - 804 + 804. 596503y*2 Collect the terms in -3541v*2 + 1208v*2 - 23v*3 + 1161v*2 + 1168v*2 + 7v*3. -16v*3 - 4v*2 Collect the terms in -5764x*2 - 307x*2 + 6 + 7x*2. -6064x2 + 6 Collect the terms in -192 + y2 + 264y + 58 + 64 + 70. y2 + 264y Collect the terms in 264k + 386k + 380k + 2k*3 - 1030k. 2k3 Collect the terms in -30d + 43 + 20 - 22 - 36. -30d + 5 Collect the terms in -8c - 1121 + 0c + 3686 - 1272 - 1293. -8c Collect the terms in 1130445b2 - 623660b*2 - 506786b2. -b2 Collect the terms in 2390 + i*2 - 582 - 650 - 3i*2 - 572 - 586. -2i*2 Collect the terms in 3506934558 + 37t - 134t - 3506934559. -97t - 1 Collect the terms in -68b3 - 264b*3 - 54b*3 + 44b*3 - 99b*3. -441b*3 Collect the terms in 2d*3 - 10660246 - 8d*3 + 10660246. -6d*3 Collect the terms in -10w*3 + 11713986945w*2 - 11713986945w*2. -10w*3 Collect the terms in 55h + 30 + 58h + 57 - 65 + 65h - 170h. 8h + 22 Collect the terms in 2443573 - 20396x - 2443573. -20396x Collect the terms in -8r - 148r*3 + 108r*3 + 13r*2 + 26r*3 + 7r - 13r2. -14r*3 - r Collect the terms in -2 - 1318n + 442n3 + 1318n - 8 + 12. 442n3 + 2 Collect the terms in 86955t*2 - 550202t*2 - 299647t*2 - 553830t*2. -1316724t*2 Collect the terms in 59r*3 + 115r*3 - 447r*3 - 556r*3 - 55r*3. -884r*3 Collect the terms in 3398w*3 - 2w*2 - 74 - 8w*2 - 3w*2 - 3399w*3 + 2w2. -w3 - 11w2 - 74 Collect the terms in 104 + 7918a*2 - 207 + 103. 7918a*2 Collect the terms in -12l*2 + 1898 + 1949 - 3847. -12l*2 Collect the terms in -77900c + 155799c - 77906c + 3. -7c + 3 Collect the terms in 52504g*3 - 17459g*3 - 17463g*3 - 17447g*3. 135g*3 Collect the terms in 245 + 9789b*2 - 9755b*2 - 245. 34b*2 Collect the terms in -117742y*2 + 29452y*2 + 29433y*2 + 29444y*2 + 29435y*2 + 0y + 0y. 22y*2 Collect the terms in -117594c*2 + 81c - 1030c + 95c. -117594c2 - 854c Collect the terms in -2219x2 - 7x*3 + 4x*3 + 6546x*2 - 2217x*2 - 2110x*2 - 12x*3. -15x*3 Collect the terms in 1676 - 840 + 13911i - 99747i - 836. -85836i Collect the terms in 12223867v2 - 6111935v*2 - 6111931v*2 - 2v. v*2 - 2v Collect the terms in	{ "pile_set_name": "DM Mathematics" }
*4 - 4i4 - i4 + i*2 + 34i*4 + 4i4 - i4 to mi2 + pi*3 + oi*4 + ci + l and give c. 0 Rearrange -984h4 + h3 - 19h3 - h + h2 + 0h2 + 1017h*4 to t + jh + oh3 + sh*4 + nh*2 and give o. -18 Rearrange -3 + 500f*3 + 6 - 415f3 + f2 to s + gf2 + xf*3 + if and give g. 1 Rearrange ((0 + r + 0)(-116r + 60r + 95r) + r*2 + r - r)(-2r2 + 15r*2 + 7r*2) to the form a + zr*4 + ir + gr2 + or*3 and give g. 0 Rearrange (4g2 + g2 - 3g2)(-84g + 71g - 72g) + 4g*3 - 13g*3 - 4g*3 to lg + h + cg2 + zg*3 and give z. -183 Rearrange 121 + 123 - 101g*2 - 46g*2 + 120 + 5g*3 - 375 to og*3 + h + qg*2 + pg and give h. -11 Express 22 - 78 + 18 + 15 + 19 - 473f as sf + g and give g. -4 Rearrange -10 - 23 + 9a + 8 + 3a - 4 to ga + p and give p. -29 Express (11t + 1 + 1 - 4t)(-430t - 328t - 22 + 1434t - 361t) as m + ft2 + ut and give m. -44 Rearrange -32u2 + 28u*2 - 13u*2 - 14 - 5u*4 - 3u + 4u4 + 5 to iu*3 + pu + lu2 + zu*4 + q and give q. -9 Express 40 + 45 - i + 2i + 125 + 82 as f + zi and give z. 1 Express -5 + 542m*3 - 2179m*3 + 542m*3 + 550m*3 - 98m*2 - 2m + 543m3 in the form vm*3 + s + pm + lm2 and give v. -2 Express 206k*2 - 45k*2 - 37k*2 + 7k*3 - 86k*2 - 3k - 37k2 + 36k*4 as lk*4 + bk*3 + wk*2 + ik + d and give b. 7 Rearrange 10508j + 7173j + 3938j + 1762j to f + vj and give v. 23381 Rearrange g3 - 515g + 1030g - 4 + 6g*2 - 528g to the form tg + cg*2 + kg*3 + w and give w. -4 Express 2569z - 2569z + 1 - 18z*2 as tz + jz2 + b and give j. -18 Express (7 - 5 - 1)(-6l - 2l - 32l + (-l - 1 + 1)(1 + 0 - 2)) - l - l + 4l in the form pl + z and give p. -37 Express 13 + 499a - 891a + 481a - 13 + 19a*3 as da*3 + ra*2 + s + ba and give d. 19 Express (-6 - 5 + 3)(1 + 25 - 47)(o + 0 + 0)((0 - 1 + 6)(-1 + 5 + 0) + (-3 + 5 + 1)(0 + 3 - 1)) as k + lo and give l. 4368 Rearrange (3z2 - 7z*2 - 4 + 3z*2)(-1 + 2 + 2)(-2 - 39 + 7) to l + bz + az2 and give l. 408 Rearrange 12 - 13 + 3 - i3 - 290i + 292i + 232i*2 to the form di + p + xi2 + ci*3 and give c. -1 Express -33m + 28m3 - 31m - 2 - 52m + 113m + m*2 in the form hm*2 + cm*3 + n + dm and give h. 1 Express 14 - 19u2 + 8 + 9u*2 - 21 + 13u*2 - 730u as zu + j + yu*2 and give j. 1 Express 1 + 507w*4 + 202w*4 + 79344w - 79341w as cw*3 + yw + mw2 + d + aw*4 and give a. 709 Express 177o*4 - 167o4 - o3 - 15 - 8o4 as xo*3 + k + vo + wo2 + fo4 and give f. 2 Rearrange (s2 + 1 - 1)(-20064 + 4s*2 - 20067 + 40152 + 21s) to g + ys + is*4 + cs*3 + js2 and give j. 21 Express -l3 + 14090l - 720 - 71l*4 - 14092l + 717 - l*2 as cl*3 + dl*4 + yl*2 + a + kl and give y. -1 Rearrange (1 + 3 - 5)(0a + 2a + a) - 4304a + 14997a + 5869a - 505a + 5630a to the form p + ja and give j. 21684 Express (10j + 20j - 126j)(-95j + 6032 - 6032) in the form vj2 + a + qj and give v. 9120 Rearrange (2k3 - 2k*3 + 2k*3)(-2k + k - k) + 1226 - 410 - 409 - 405 + 43k*4 + 21k*3 to jk + uk2 + ck*4 + dk3 + n and give c. 39 Rearrange (-g2 + 3g2 - 11g*2)(-3 + 0 + 4) + 60g2 - 70g*2 - 45g*2 + (-5g + 2g + 2g)(-5g + g + 0g) to sg*2 + i + zg and give s. -60 Rearrange -46v2 + 36 + 39v*2 + 4v*2 + 39 - 9 to bv + fv2 + y and give y. 66 Express -2p*2 + 9p + 12p - 147 + 9p - 12p - 20p in the form d + gp + sp*2 and give s. -2 Express (-5p + p + 5p)(p*3 + 2p*3 - 4p*3) + (-2p*3 - 6 + 6)(1750 - 1749 + 13p + 74p) as y + vp + ip*4 + bp*3 + fp*2 and give b. -2 Express (2 + 2 - 3)(15 + 1 - 1)(-23i + 21i - 15i + i - 2i + 0i + (0 + 1 - 3)(4 + 2i - 4) - 2i - 2i + 2i + 0 + 0 - i) in the form k + ti and give t. -375 Express (-12 + 55 - 2)(-35i*2 - 39i*2 - 51i*2) in the form l + qi*2 + ki and give l. 0 Express -293t4 + 578t*4 + 4t - 6t3 - 7t*2 - 284t*4 + 9t*3 - 1 as o + ft*4 + mt*3 + vt*2 + ct and give c. 4 Express -4093 + 8816 + n + 4926 + 5007 in the form bn + c and give b. 1 Rearrange 25b*4 + 12 - 10 + 10b*3 - 80b*4 - 2b*4 to the form xb*4 + cb*2 + ob*3 + s + qb and give x. -57 Express -1469n3 + 3588n*3 - 1417n*3 + 13n*2 + 2 in the form tn*2 + y + pn + on3 and give y. 2 Express -25v - 15578 + 31v - v2 + 15687 - v4 as tv*3 + kv*4 + hv*2 + nv + u and give h. -1 Express -17995348 - 29l + 2l3 + l2 + 17995348 in the form yl + bl*3 + ql*2 + g and give y. -29 Rearrange 8t*3 - 2t*3 - 69t + 9t3 + 80t to ut2 + wt*3 + ht + m and give w. 15 Express 33 - 34g - 13g + 50g - 24g - 36g as w + jg and give j. -57 Rearrange -2n + n3 - 664 + 1333 - 667 + 3n*2 + 17n*4 to the form l + pn + vn2 + dn*3 + hn*4 and give l. 2 Express (0 - c + 0)(0 + 0 - 2 + (-1 + 3 - 3)(-247 + 820 + 396) - 2 + 2 + 2) + c + c - c as jc + q and give j. 970 Express -37 + 0 - 46k + 2 + 48k - 1 - 2k3 + 7k*4 - 2k*2 as bk*2 + uk + fk4 + wk*3 + t and give b. -2 Express 7740w*2 + 49295w - 49295w + 1037w*2 in the form kw + s + iw2 and give i. 8777 Express 14x*3 + 27x*3 - 7x*3 + 453933 + 0x2 - x2 - 453981 as yx + kx*3 + ux*2 + z and give k. 34 Rearrange -134291m + 122090m - 3 + 3 to am + z and give a. -12201 Express (4 + 4 - 4)(-127 - 14 - 96)(7 + 3f - 7) as af + z and give a. -2844 Express (-1 + 1 - 1)(-2k + k - 2k) + 70k + 36k + 25k + (-2 - 2k + 2)(-3 - 2 + 3) + 2k - 1 + 1 in the form p + nk and give n. 140 Rearrange -5k2 + 5k2 + k2 + (-17k2 + 2k*2 + 0k*2)(-3 - 5 + 26)(2 + 1 - 6) to the form fk*2 + m + hk and give f. 811 Rearrange 275 - 275 - 2k2 - 249k*3 - 463k*3 - 3k*2 to tk + pk2 + hk*3 + l and give h. -712 Express -126f*2 + 40f*2 + 2f + 1 + 37f2 + 9 + 44f*2 in the form j + gf + kf2 and give g. 2 Rearrange -155 - 2 + 2 + 2c*3 + 4c4 + c4 - 2c4 to wc + h + rc4 + sc*3 + yc*2 and give w. 0 Express 123241r*2 + 121980r*2 - 246196r*2 as ir + u + zr2 and give z. -975 Rearrange -860b - 546b + 7741b to k + qb and give q. 6335 Rearrange (-350 - 591 - 2928)(2m2 + 2m2 + m4 + 2m2) to v + xm*4 + cm*2 + um*3 + dm and give x. -3869 Rearrange -1646b - 1172b - 432b + 245b + 180b to the form x + gb and give x. 0 Rearrange -1144 + 4438g2 + 1144 to z + ig*2 + og and give z. 0 Express (31 + 63 + 70)(127w - 6w + 212 - 211) in the form k + hw and give h. 19844 Rearrange 13k2 + 95 - 2k + 2k3 - 13k*2 - 92 to fk*3 + nk + z + ak2 and give z. 3 Rearrange (-p + 10p + 5p)(-259 + 135 + 132)(-3 + 4 + 1) to the form hp + x and give x. 0 Rearrange (-3 + 5q - 3q + 0)((-2 - 3q + 2)(4 - 2 - 1) + 7q + 13q - 23q + 185) to the form b + iq2 + uq and give b. -555 Rearrange v*3 - 658771 + 18v*2 - 69v*2 + 658773 to the form z + tv + pv3 + av*2 and give p. 1 Rearrange -573a - 7a2 + a2 + 22a*4 + 14a*3 + 566a - 25a4 to the form j + ta*3 + oa + ha2 + ya*4 and give t. 14 Rearrange (19 - 20 + 24)(565a - 229a - 220a) to t + da and give d. 2668 Express (0w - w + 4w + (-2w + 4w - w)(-3 - 1 + 2) + 0w + 0w - w - 2w + 3w - 3w - w - w + 0w)(-146 - 4299 - 169) as nw + s and give n. 18456 Express -526 - 28i + 8i + 11i - 2i as p + xi and give x. -11 Rearrange (292f - 468f + 279f)(-6f + f2 - f + 41 - 40) to the form g + sf + lf3 + mf*2 and give s. 103 Express -2v*4 - 5v + 0v - 204v*2 + 4v - 4v3 + 6 + 201v*2 as av*4 + b + ov*2 + jv*3 + xv and give a. -2 Rearrange (-2z + 2z - z)(-2z + 2z2 + 2z) + 553 + 490 + 2z2 - 146z*3 + 23477z*3 - 1043 to the form vz*2 + rz + hz3 + y and give h. 23329 Rearrange 6u*3 - 7u*3 + 2u*3 - 1 - 332u*2 to the form mu*3 + yu + du2 + b and give b. -1 Express -4x - 299x2 + 675x*4 + 5x + 478x4 + 2x*3 + 298x*2 - 1 - 1 in the form sx + w + ax4 + vx*3 + hx*2 and give v. 2 Express -2f*3 - 122 - 174 + 29 - 6 - 17f + 22f as c + mf + uf3 + tf**2 and give u. -2 Express 2	{ "pile_set_name": "DM Mathematics" }
3o + fo*4 wrt o. 12o*2 Let g = -10 - -14. Differentiate -3 - 12l*4 + 9l*g + 4l*4 wrt l. 4l*3 Let r(y) = 4y + 5. Let k be r(-5). Let c be ((-12)/k)/((-6)/(-15)). Find the second derivative of -5f3 - 3f + 3f + cf + 3f3 wrt f. -12f Let o(a) = 11a2 - 11. Let i(c) = 21c*2 - 23. Let s(r) = -3i(r) + 7o(r). Find the first derivative of s(m) wrt m. 28m Let h(p) = p4 + p3 - 1. Let f(n) = 28n4 + 9n*3 - n - 11. Let i(d) = -2f(d) + 18h(d). Find the second derivative of i(k) wrt k. -456k*2 Let j = -1 + 3. Let p be -3(j - (-1 + 4)). What is the first derivative of 0 - 3 + 4 + pc wrt c? 3 Let z(t) = 7t*4 + 6t*3 - 4t*2 - 6t. Let v(a) = a3 - a2 - a. Let q(f) = 6v(f) - z(f). What is the third derivative of q(i) wrt i? -168i What is the third derivative of 39k6 - 54k*6 + 33k*6 + 6k*2 + 6k*2 wrt k? 2160k3 Let k(l) be the first derivative of l2 + l - 5 + l2 + 0 + 0. Find the first derivative of k(b) wrt b. 4 Let g(x) be the third derivative of x6/3 - 37x4/24 - 16x*2. Find the second derivative of g(a) wrt a. 240a Let w be (0 - 0)/(5/(-5)). What is the second derivative of -t*2 + wt + 3t - 5t wrt t? -2 Let y(i) be the second derivative of -6i5/5 + 7i*2 + 24i. Differentiate y(g) wrt g. -72g2 Let g(b) be the second derivative of -b10/2520 - b6/360 + b3/2 + 3b. Let j(r) be the second derivative of g(r). Find the third derivative of j(q) wrt q. -240q3 Let h(f) = f + 8. Suppose -2d - 9 = 3. Let z be h(d). What is the third derivative of z - x*3 - 2x2 - 2 wrt x? -6 Let x(o) = o2 - o - 2. Let n be x(-1). Find the third derivative of 4w4 - 27w*2 + 29w*2 + nw*4 wrt w. 96w Let r(x) = -2x - 2. Let k be r(-5). Let m be (k - 1)(-6)/(-21). Differentiate 6w2 + 1 - 6w*m - 4w*4 wrt w. -16w*3 Let f(a) be the second derivative of 0a*5 - 1/14a*7 - 1/6a*3 + 0a*4 + 0a*6 + 0a*2 + 4a + 0. Find the second derivative of f(p) wrt p. -60p3 Suppose 3g = 6g. Let s(i) be the second derivative of 0 + gi*4 - 1/30i*6 + 0i*5 + 0i*3 + 2i - i*2. What is the derivative of s(a) wrt a? -4a*3 Let i(y) be the second derivative of 0 - 2y + 1/10y5 + 0y*3 + 0y*2 + 1/3y4. Find the third derivative of i(t) wrt t. 12 Let q(x) = x2 + x. Let k(h) = -6h2 - 3 - h + 0h*2 - 1 + 3h*2. Let j(m) = -2k(m) - 2q(m). Find the first derivative of j(c) wrt c. 8c Suppose 0 = 6v - 3v - 54. Find the first derivative of -13 - 5d3 - 5d*3 + v + 3d*3 wrt d. -21d2 Let v(i) be the first derivative of -i7/70 + i5/30 - i2 - 1. Let t(r) be the second derivative of v(r). What is the third derivative of t(d) wrt d? -72d Suppose 5d = 4u + u + 25, 0 = 4u + 8. Suppose -3o = -6 - d. What is the first derivative of -2z*o + 4 - 3 + 4z*3 wrt z? 6z*2 Let d(y) be the second derivative of 0y*3 - 6y + 0y2 - 1/2y*4 + 0 + 1/10y*5. Find the third derivative of d(a) wrt a. 12 Let q(v) be the third derivative of 1/15v*5 + 4v*2 + 0v + 1/24v4 + 0v*3 + 0. Find the second derivative of q(x) wrt x. 8 Let m(h) be the first derivative of -3h*4/4 + 21h*2/2 + 3. Find the second derivative of m(c) wrt c. -18c Let k(z) be the second derivative of z + 0z5 + 2/3z*4 + 0z*3 + 0 + 7/30z*6 + 0z*2. What is the third derivative of k(b) wrt b? 168b Suppose -22 = -h - 3c - c, -8 = h - 2c. Let v(g) be the third derivative of 0 - 1/6g3 + 0g + 1/8g4 + 3gh. Differentiate v(m) with respect to m. 3 Let y(a) be the first derivative of -a5 - 8a3/3 + 4. What is the third derivative of y(p) wrt p? -120p Let p(i) be the first derivative of 0i + 0i3 - i4 + 3/2i2 - 4. What is the second derivative of p(f) wrt f? -24f Find the third derivative of 3z2 - 5z + 5z - 21z6 + z2 wrt z. -2520z3 Let x(j) be the first derivative of 35j*4/4 - 41j*2/2 - 1. What is the second derivative of x(p) wrt p? 210p Let d(r) = -r - 2. Let k be d(-6). What is the second derivative of kg4 + 2g - 12g4 + g wrt g? -96g*2 Find the third derivative of -100l*2 + 92l*2 + 6l*4 + 25l*4 wrt l. 744l Let c(g) be the first derivative of g6/10 - g4/4 + 4g + 4. Let h(w) be the first derivative of c(w). What is the third derivative of h(l) wrt l? 72l Let y(c) be the third derivative of c*5/4 - 17c*3/6 - 38c*2. What is the first derivative of y(h) wrt h? 30h Let w(n) = -5n3. Let m be w(-1). Suppose 0 = -4f - 5p + 40, -mf + 12 = -f - 2p. What is the derivative of 2 + fi - 4i + 0i wrt i? 1 What is the third derivative of 22y2 - 24y*2 - 9y*5 + 0y*5 wrt y? -540y*2 Let u = 11 - 11. Suppose 4f + 0 = -3z + 2, u = 2z + 4f. Find the second derivative of 2o*z - 2o*2 + 2o*2 - 2o + 0o wrt o. 4 What is the third derivative of -9k*5 + 3k*2 - 19k*5 + 0k*2 wrt k? -1680k2 Let c(f) be the second derivative of f9/5040 + f5/24 - f4/2 + 7f. Let g(x) be the third derivative of c(x). Find the first derivative of g(s) wrt s. 12s*3 Let r = 1 + 1. Find the second derivative of 0l*r + 2l - 5l2 + l3 + 5l*2 wrt l. 6l Let j(g) = -10g3 - 6. Let t = 51 + -34. Let s(r) = -3r*3 - 2. Let x(p) = ts(p) - 6j(p). Find the first derivative of x(f) wrt f. 27f*2 Find the second derivative of -1 - 2s*3 + 3 - 8s - 13s + 2s*4 + 79s wrt s. 24s2 - 12s Let j(p) be the second derivative of 1/3p3 + 3/2p*2 + 3p + 0. Differentiate j(n) wrt n. 2 Let h(v) = -5v2 - 3v. Let p(s) = -s*2 + s. Let n(z) = -3h(z) + 6p(z). Find the second derivative of n(i) wrt i. 18 Suppose -5o + 2 = 32. Let m(u) = -5u3 + u2 + 6. Let r(c) = 15c*3 - 3c*2 - 17. Let x(a) = or(a) - 17m(a). What is the third derivative of x(d) wrt d? -30 Let a = 3 - 2. Let p(u) = 4u*2 + 4u - 4. Let y(t) = -t. Let c(j) = -j + 1. Let h be c(-3). Let q(d) = ap(d) + hy(d). What is the derivative of q(s) wrt s? 8s Let f(c) be the second derivative of -3/56c*8 + 0c*5 + 0c*2 - 4c + 0c7 + 0 + 1/6c*4 + 0c*3 + 0c*6. Find the third derivative of f(p) wrt p. -360p*3 Find the second derivative of 24y + 3y2 - 3y*2 - 9y - 26y4 wrt y. -312y*2 What is the second derivative of 4s*2 - 3s + 8s2 - 4s - 9s2 wrt s? 6 Suppose -5g = -3z, -5g - 5z + 27 + 13 = 0. Let o be (-10)/(3(-2)/g). What is the derivative of b - b + o - 4 + 3b2 wrt b? 6b Suppose -5c + 2l = l - 19, -14 = -3c - 2l. Let x be (c + -5)/((-1)/2). Differentiate 4 - xm2 + m2 - 3 with respect to m. -2m Let b be (3/3 - 1) + 2. Let l be 24/6b/4. Find the third derivative of 12t + t*l - 12t - t*4 wrt t. -24t Suppose -9 = -3b + 9. Suppose -bo = -2o - 16. What is the second derivative of -of*2 + 4f + f*2 + 7f*2 - 2f2 wrt f? 4 Let p(f) be the third derivative of f8/56 + f*4/6 + 6f*2. Find the second derivative of p(q) wrt q. 120q3 Let a(u) be the third derivative of u4/24 - u*3/6 - 5u*2. What is the derivative of a(p) wrt p? 1 Let x(y) = 2y*3 + 6y*2 - 6y - 7. Let t(z) = -z*2 + z. Let i(c) = 6t(c) + x(c). Find the first derivative of i(f) wrt f. 6f2 What is the second derivative of -181 + 12o + 9o2 + 181 wrt o? 18 Let g(n) be the second derivative of 5n*4/2 - 5n*3/2 + 8n. What is the second derivative of g(v) wrt v? 60 Let v(m) be the second derivative of m7/280 + m6/120 + m*3/3 - 3m. Let y(a) be the second derivative of v(a). Find the third derivative of y(l) wrt l. 18 Suppose -4 - 4 = -2f. Find the second derivative of 2k - 15kf - 9k + 22k4 wrt k. 84k*2 Suppose -3n + 7 = -8. Find the second derivative of y*4 + 2y + 0y + ny - 5y4 wrt y. -48y*2 Let k(q) = -47q*4 + 8q*3 + 37q*2 - 8q. Let t(h) = 31h4 - 5h*3 - 25h*2 + 5h. Let d(a) = -5k(a) - 8t(a). Find the third derivative of d(y) wrt y. -312y Let s(q) be the third derivative of q8/280 + q5/30 - q3/3 - 5q*2. Let v(m) be the first derivative of s(m). What is the second derivative of v(c) wrt c? 72c*2 Let h(t) be the third derivative of 0t*6 + 0 + 0t + 0t3 + 1/6t*4 + 0t*5 + 2/105t*7 - 3t*2. What is the second derivative of h(p) wrt p? 48p*2 Find the third derivative of -4h2 - h2 + 9h4 + 2h*2 wrt h. 216h Let j(k) be the thir	{ "pile_set_name": "DM Mathematics" }
i - 6i + 3i as di + j and give d. 11 Express (-m3 - 4m*3 + 3m*3)(m - 3m + m)(5 - 37 + 2 + (-3 - 3 + 4)(-2 + 3 - 3)) as tm + fm2 + lm*4 + z + hm*3 and give l. -52 Rearrange 3 - 1 - 9x - 2 to the form z + wx and give w. -9 Express (-k + 4k - k)(3k - k - k) - k + 49 - 25 - 27k2 - 25 as o + pk*2 + bk and give b. -1 Rearrange 0x + 11x - x to rx + c and give r. 10 Express 130c*2 - 2204c + 2204c in the form bc*2 + p + xc and give b. 130 Express -4 - 2l2 - 7 + 8 + 3l + 12 as vl2 + n + cl and give c. 3 Express (3p - 10p - p)(-4p3 + p3 + 2p3) as xp*3 + ap*2 + sp*4 + dp + v and give s. 8 Rearrange (3r - 6r + 2r)(6 - 20 - 13) to the form zr + k and give z. 27 Express 3l2 - l2 + l*2 + (3l - 2l + l)(-2l - l + 4l) - l*2 - 3l + 3l + (0l + l*2 + 0l)(2 + 1 - 4) in the form z + yl*2 + ml and give y. 3 Rearrange (-1 - 1091x - x2 + 3 + 1089x)(2x*2 + 1 - 1) to gx*4 + sx*2 + dx + h + ax3 and give a. -4 Rearrange -442i - 3i4 + 440i - 2 - 2i3 + i3 to the form li*3 + xi*4 + yi*2 + j + si and give j. -2 Rearrange -6r3 + 3r2 + 2 - r4 + 4r3 + 2r*4 - r to ar*4 + t + sr*3 + vr + or2 and give o. 3 Express 2 - 3t4 - t3 + 2t4 - 3 as zt + ht3 + k + ct*2 + st*4 and give s. -1 Rearrange -307 + 20t + 307 to the form w + lt and give l. 20 Rearrange (-3 - 21 + 6)(-4 - 1 + 4)(-5n + 3n + n) to the form p + yn and give y. -18 Express 0 + 0 + p*3 + (-2p - 2p + 2p)(-4p2 - p2 + 4p2) + 2 - 4p*3 - 2 - 14p + 14p - 4p*3 in the form t + np*2 + wp + up3 and give u. -5 Rearrange 3 - 3h2 - 3 - 3 - h2 to the form lh2 + x + vh and give l. -4 Express -17v + 5 + 33v + 2 - 12v in the form h + av and give a. 4 Express (141w2 - 137w*2 - 2 - 3)(12 + 0 - 9) in the form o + jw + uw*2 and give u. 12 Rearrange -2s4 + s3 - 4s4 + 2s*4 + 4 + 2s*4 to js*4 + fs*2 + cs + r + ts3 and give j. -2 Express 17m*3 - 7m*3 - 2m*2 - 6m*3 - 2 in the form dm*2 + g + im + lm3 and give d. -2 Rearrange 9b - 656 + 656 to the form o + sb and give s. 9 Express 0g*3 - g - 11 - 1 - 2g*2 + 3g*2 - 2g*3 as vg*3 + bg + ig2 + u and give i. 1 Express -7a + 3a + 8a + 12a as qa + k and give q. 16 Express -f*4 - 18f*3 - 1 - 2f - 4f2 + f2 + 18f*3 as if*2 + q + of*3 + lf + tf4 and give l. -2 Express -5k*2 + 4k2 - k3 + 2k2 - 2k*4 as ok*4 + fk + mk2 + bk*3 + u and give m. 1 Rearrange (1 + 5 - 1)(-2 + 0 + 1)(1 + 4 + 1)(1 + 2 - 2)(3 - 3 - i2) to yi + j + li2 and give l. 30 Rearrange 24n - 2 - 22n + 4 - 5n*3 to mn*2 + y + bn*3 + fn and give y. 2 Express v + 3v - 2v + (0v + 2v - 3v)(35 + 30 - 16) as p + cv and give c. -47 Express d - d + d3 + (-d + d + 2d*3)(-15 - 4 + 3) as bd + i + zd*2 + qd*3 and give q. -31 Rearrange 0y - 13y + y to sy + f and give s. -12 Express -47q2 - 75 + 75 in the form b + sq + oq2 and give s. 0 Express -13s*2 + 9s*2 - 98s*2 - 2s*2 in the form ms*2 + cs + j and give c. 0 Rearrange i*4 + 0i - i*3 + 2i*3 - 3i*3 + 2i*2 - i to si*2 + ci + bi3 + fi*4 + z and give c. -1 Rearrange (-2a - 3a2 + 5a2 - a2)(-38a + 38a + 10a*2 + (-4a + 0a + 3a)(0 + 0 - a)) to the form sa*4 + xa*3 + ia*2 + va + h and give s. 11 Rearrange 38y - 1 - 38y + 4y2 + (-y - 3y + 2y)(-y + 6y - 3y) + 3y2 - 4y + 4y to the form s + cy + oy2 and give s. -1 Express (2 + 2b - 2)(0b*3 + 0b3 + b3) + (27 + 10 - 3)(-b4 - b4 + b4) as xb + w + cb3 + zb*2 + tb*4 and give t. -32 Express (-2 + 2 - 5b)(11b*3 + 17b - 17b) as yb + hb3 + x + ib*4 + jb*2 and give i. -55 Rearrange 3 - 4j4 + j3 + 2 + j - 3j4 - 4 to zj*3 + xj*2 + sj*4 + t + mj and give z. 1 Rearrange -5u - 3u*3 - 19u*2 + 13u*2 + 8u*2 + 0 + 2 to xu*3 + iu + g + au2 and give i. -5 Rearrange -16a*2 + 6 + 8a*2 - 1 - 2a*4 + 3a*2 to ja*4 + da + u + sa2 + ma*3 and give u. 5 Express 2644 - 2644 + 7f*2 + f + 2f in the form c + af2 + rf and give a. 7 Express -59d - 56d + 52d - 54d as u + qd and give q. -117 Express (8 - 2 - 2)(-3 - 4 + 1)(j2 + 4j*2 - 4j*2) as n + vj*2 + aj and give v. -24 Express -4y2 - y3 + 20y - 43y + 22y as r + iy2 + jy*3 + fy and give f. -1 Rearrange 5c - 5c + 0c + 2c - c2 + c4 - 7c3 to nc*2 + uc*4 + oc + dc3 + a and give d. -7 Express (1 + 1 - 4)(4 - 6 + 1)(5 - 5 - 3k + (-k + 0k + 0k)(3 + 1 - 2) + 0 - 2k + 0) in the form s + uk and give u. -14 Rearrange 47z + 4z2 - 1 - 47z + 0 to qz + f + xz*2 and give q. 0 Rearrange 2m*3 + 3m4 + m4 - 4m3 + 1 - 5m*4 to the form um*2 + im*4 + om + l + bm3 and give i. -1 Rearrange -8l3 - l4 + 0l3 - 7l*2 + 6l*3 to the form ml + yl3 + wl*2 + zl*4 + u and give w. -7 Express (43 + 7m - 43)(-4m*2 + 6m*2 + 0m*2) in the form hm*3 + xm*2 + w + qm and give h. 14 Rearrange (-r + 4r - 5r)(5r*2 - 5r*2 + 5r*3) + 2r*3 - 2r*3 + 2r*4 to fr*2 + b + yr*4 + tr*3 + kr and give y. -8 Express -10p2 + 5p*3 - 2p*3 + 25p2 - p3 in the form dp + gp*3 + h + rp*2 and give r. 15 Rearrange -7 + 3 - 43a + 5 - 2 to h + ta and give h. -1 Rearrange (3 + 1 + 25)(-5 + 3 + n + 0) to f + qn and give q. 29 Express -y - y2 + 0y*2 + 0y*2 + 6y*2 in the form ty*2 + cy + o and give t. 5 Express (2 - 3 + 2)(a4 - 3a*4 + 4a*4) - 16a*4 + 0a*4 + 3a*4 - 5a*4 + 4a*4 + 0a*4 as o + ja*3 + ka + sa4 + ha*2 and give s. -12 Express 4 - 4 - 8b in the form r + ob and give o. -8 Rearrange -7x - 2x4 - x4 - 3 + x4 + 4x*4 to the form ox*3 + px + zx4 + cx*2 + w and give p. -7 Rearrange -14u + 11u - 2u - 1 to the form g + cu and give g. -1 Express (29 + 27 + 13)(-j - j + 3j) in the form y + rj and give r. 69 Rearrange ((-6z + 3z - 4z)(2 - 1 - 3) - z - 3z + 5z + 4z - 3z - 2z)(3z2 - z2 + z - z2) to the form mz*2 + fz*3 + l + hz and give m. 14 Express (4q2 - q2 - 4q*2)(-4q + 4q + q) + (4q + 2q*2 - 4q)(-1 + 1 - 2q) - 4q + 4q - 3q3 in the form lq + f + nq3 + iq*2 and give n. -8 Express -11 + 11 + 6n - n*2 as b + qn*2 + fn and give q. -1 Express -1 + 2r2 + 6 - r2 as jr + v + ir2 and give v. 5 Rearrange -3 - 2 + 0w + 0w + 7w + 2w3 to the form i + vw + lw2 + mw*3 and give v. 7 Rearrange -1 - 25a*3 + 201a*2 + 0 - 199a*2 to da + y + za3 + ja*2 and give y. -1 Rearrange (m + 0m - 4m)(1 - 3 + 6) to the form n + om and give o. -12 Rearrange 0x*3 + 0x2 + x2 - 4x2 - 2 + 3x*3 to the form kx + qx2 + cx3 + v and give c. 3 Express 231 - 229 - n + n2 - n3 + n2 + 2n4 in the form tn*3 + s + un + bn4 + vn*2 and give t. -1 Express (h + h - h)((67h - 119h + 0h)(0 + 0 - 1) + (-4h - h + 6h)(1 - 1 + 2)) + (2 - 2 + h)(-h - h + 3h) as xh*2 + wh + y and give x. 55 Express 57p2 - 2 + 49p*2 - 2p - 90p2 as dp + lp2 + k and give k. -2 Rearrange (4 - 1 - 1)(-3v2 + 3v2 - v2)(-4 + 4 - 13v) to av3 + s + bv*2 + jv and give b. 0 Express (1 + 0 + 0)(-1051 + 1051 + 149q) in the form jq + l and give j. 149 Rearrange r3 - 100r + 12r2 - 38r*2 + 102r to hr + jr*3 + ir*2 + m and give h. 2 Rearrange -w - 14w - 13w to the form y + gw and give g. -28 Rearrange -21s - 12s + 2s to ls + i and give l. -31 Rearrange 37g2 + 3 - 78g*2 + 42g*2 to the form cg + tg2 + q and give q. 3 Rearrange 45f*2 - 10f*2 - 17f*2 to the form xf + zf2 + b and give z. 18 Express a4 + a4 + 3a - a*3 - 1 + 2a - 4a as ma*2 + da*3 + y + ka + ca4 and give k. 1 Rearrange -12o + 38o + 11o to the form co + h and give c. 37 Express 2b + 0b2 - 8b - b*2 + 2 + (0b - b + 2b)(-3b - 4b + 5b) - 2b - 2b2 + 2b in the form s + yb2 + rb and give r. -6 Express 2o2 - 3 + o2 + 8 in the form qo*2 + t + po and give t. 5 Rearrange (0 + 0 + 26l)(-5 + 1 + 5) to jl + i and give j. 26 Rearrange 9j*2 + 0j*2 - 6j*2 + (3 - 3 - 2j)(3 - 3 - j) + (0	{ "pile_set_name": "DM Mathematics" }
(833)) + 3 - ((sqrt(833) + 1)-6 + sqrt(833) - sqrt(833))) + ((sqrt(833) + 0)-6 - sqrt(833) - (-1 + sqrt(833))3) + 5)2. -952sqrt(17) + 13617 Simplify sqrt(7)31 + (sqrt(7) + 1)-3 + (-5(sqrt(448) + (sqrt(448)-1 - sqrt(448))) - sqrt(448))2 + 2. 7167 Simplify ((sqrt(704) + 3)-3 + (sqrt(1584) - (sqrt(1584) - (sqrt(1584) - 1(0 + sqrt(1584)))))-1)*2. 432sqrt(11) + 6417 Simplify -6(-2-1(sqrt(77) + (sqrt(77) - -1sqrt(77))-5 + sqrt(77) + sqrt(77)))/((3sqrt(110)-1)/((sqrt(70)-2)/sqrt(7))). 56sqrt(7) Simplify 0 + (sqrt(128)/sqrt(4))2 + -3 + sqrt(72)-1 - (6(-3 + (sqrt(242)1 - sqrt(242)) - (-4 + (sqrt(242) + 1 - sqrt(242)))))*2. -6sqrt(2) + 29 Simplify (6(sqrt(495) - (sqrt(495) + sqrt(495) + 6(3sqrt(495) + sqrt(495))))/(sqrt(35)/sqrt(7)-63))2. 6875 Simplify (((sqrt(19)2 - sqrt(19) - sqrt(19))4 - (sqrt(19) + sqrt(38)/sqrt(2))4) + 5 - (sqrt(1216) + sqrt(1216) + -3 + 2 + -4))*2. -480sqrt(19) + 11044 Simplify (4 + -1 + -62(sqrt(304) - (-1 + -1 + sqrt(304) + sqrt(304)))6 + 5)2. -78336sqrt(19) + 1594432 Simplify 3 + 2sqrt(28)/sqrt(4) + -5 + ((sqrt(63) + sqrt(1575))5 + 5)*2. 902sqrt(7) + 56723 Simplify 0 + 2 + (sqrt(98) - (1sqrt(98)-1)2 - (1 + ((sqrt(98) + 2 - sqrt(98)) + sqrt(98))2)) + -3. -202 - 21sqrt(2) Simplify ((3(-5 + (2(sqrt(1100) + 0) - (sqrt(1100) + -4sqrt(1100)-1))) + 4)4)*2. 31680sqrt(11) + 1427536 Simplify ((3 + (sqrt(245) - (1 + sqrt(245))) + 3)1 - (1 + (1 + sqrt(245) - sqrt(245)))6-3)2. 1681 Simplify (sqrt(576)334)/((sqrt(1620)-2)/(sqrt(1000) - (2sqrt(1000) + sqrt(1000) + sqrt(1000) + sqrt(1000)))). 960sqrt(2) Simplify sqrt(425) + 2 + 0 + -3 + sqrt(425)1 - (-4 + 2sqrt(425) - (-1 + sqrt(425) - sqrt(425))-3)*2. -1750 + 150sqrt(17) Simplify -2(sqrt(132) - (sqrt(132) - (sqrt(132) + (sqrt(132)-3 - sqrt(132)))-2))/(sqrt(396)-3) + -4 + 4. 4sqrt(3)/3 Simplify (6sqrt(105)/(sqrt(49)/(sqrt(7)-1)))/((sqrt(300) - (sqrt(300) + sqrt(300)2 + sqrt(300) - sqrt(300)))-4 - -21sqrt(300)). -3sqrt(5)/50 Simplify -1 + (2sqrt(91)-4 - sqrt(91)15)/(sqrt(56)/sqrt(2) - ((sqrt(7) - sqrt(112)3 - sqrt(7)) + sqrt(7)))5. -5sqrt(13) - 1 Simplify ((4(sqrt(252) + -1) - (4 + sqrt(252) + 0))*2 - (2sqrt(252) + 3 + sqrt(252) + sqrt(252) + -1 + sqrt(252) + -3)) + 0 + 1. -318sqrt(7) + 2334 Simplify sqrt(13) + (-1 + sqrt(13))5 - ((sqrt(91) - (sqrt(91) - 2sqrt(91)))/sqrt(7))2 - (sqrt(1053)-3 + 2)1. -59 + 33sqrt(13) Simplify (-1 + (-1 + sqrt(68))*2 + 2sqrt(68)-2 - (5sqrt(68)2 - (4 + sqrt(68) + 1)))-1. -73 + 30sqrt(17) Simplify (-3sqrt(1008)2 - sqrt(1008)) + -4 + sqrt(1008) + (sqrt(1008) + 1)2 - (-3 + 33(-1 + sqrt(7))). -57sqrt(7) + 1017 Simplify (-1 + 1 + 4-2(sqrt(343) - (sqrt(343) + (3sqrt(343) - sqrt(343))) - sqrt(343)) + -1)2 + 1. -336sqrt(7) + 197570 Simplify 5(((sqrt(16) + sqrt(144)-4)3)/(-1sqrt(16)/(sqrt(12)/sqrt(6))) + 4)*2. 1320sqrt(2) + 10970 Simplify (-1 + -2-5(-1 + (sqrt(700) + 6(0 + sqrt(700) - sqrt(700)) - (sqrt(700) - (sqrt(700) + -5 + -2 + sqrt(700) + sqrt(700)))) + -4))2. -72600sqrt(7) + 644641 Simplify 2 + 6(sqrt(325))24 - 4(-3(sqrt(156) - (sqrt(156) - sqrt(156)-2)))/sqrt(12). -24sqrt(13) + 7802 Simplify 0 + ((1sqrt(27)/sqrt(3) + sqrt(9))/(sqrt(18)/sqrt(96)) - ((-4 + sqrt(3) + -2 + sqrt(3))2 + sqrt(3) + sqrt(432))). -48 + 19sqrt(3) Simplify (sqrt(847) + -4 + -1)*25 + 4 - ((sqrt(847) - 3sqrt(847))2 + 3 + -2(sqrt(847) - (sqrt(847)-1)2)). -528sqrt(7) - 721 Simplify 1 + (((2sqrt(363) + sqrt(363))-5)*2 - (sqrt(363) + (-6(sqrt(363) - 1sqrt(363)))2)) + (1 + sqrt(363))2 + 3 + -2 + 0. 11sqrt(3) + 82041 Simplify ((-6sqrt(108)-2)/(-1sqrt(1452)))/(-1sqrt(363)-2 + sqrt(363) - sqrt(363)-2-4). 12sqrt(3)/605 Simplify ((-1((sqrt(132) - -1sqrt(132)) + sqrt(132)) + sqrt(132) + (-3(sqrt(132)2 - sqrt(132)) - sqrt(132)))/(sqrt(72)/sqrt(6)5 + 1sqrt(12)3))2. 99/16 Simplify -4 + -2((sqrt(539)2)2 + 0)36 + 5. -77615 Simplify ((((-2 + sqrt(243))-5 + sqrt(243) + 2 + -3)*2 - ((2 + sqrt(243) - sqrt(243))51)2) + 5)-5. -19370 + 3240sqrt(3) Simplify ((-4 + sqrt(1088))-45)2 - 6(3 + sqrt(136)/(sqrt(8) + sqrt(512) + sqrt(8))). -128003sqrt(17)/5 + 441582 Simplify 4sqrt(1088) + 4(-1 + sqrt(17)) - (-6(sqrt(187)1 + sqrt(187)) - sqrt(187))/(sqrt(539) + -2sqrt(539)). -4 + 239sqrt(17)/7 Simplify ((-6sqrt(352)-2 + (-5sqrt(352)2 - sqrt(352)))2)/(-5(sqrt(288) - (sqrt(288)2 + sqrt(288) + sqrt(288) - sqrt(288))) + -2sqrt(288)1). sqrt(11)/12 Simplify (-6(sqrt(187) + (6sqrt(187) + sqrt(187) - sqrt(187)) + sqrt(187))4)/(-1(sqrt(539)-2 + sqrt(11)))-3. 576sqrt(17)/13 Simplify (-61(-1(sqrt(90)2 + sqrt(90) - sqrt(90)))/((-22sqrt(10))/sqrt(5)) + 3)2. -54sqrt(5) + 414 Simplify 1((sqrt(1088)44)2 + sqrt(612) + -5 + -1sqrt(612) + sqrt(612)) + 3. 6sqrt(17) + 278526 Simplify 5 + -3 + (1-4sqrt(500)-21)2 + -3 + -1. 31998 Simplify ((((sqrt(85)3 - sqrt(85)) + sqrt(85))-6 - sqrt(85))-3)/(sqrt(10)/(sqrt(6)/(sqrt(3) + sqrt(30)/sqrt(10)))). 57sqrt(17)/2 Simplify (-4 + 5(-4 + 1sqrt(539) + sqrt(539) + -1 + 2sqrt(539) - (1 + (sqrt(539)-2 + sqrt(539) - sqrt(539)) + 3)))2. -20580sqrt(11) + 487501 Simplify 5(3 + (5(sqrt(187) + sqrt(187)1 + sqrt(187))-5)/(sqrt(891) - ((sqrt(891) - (sqrt(891)3 - sqrt(891)) - sqrt(891)) + sqrt(891))-2)). 15 + 125sqrt(17)/3 Simplify (-1 + -4 + -5 + (-1sqrt(72) - sqrt(72) - sqrt(72)) + -5 + 5 + -1)*2-2. -1538 - 792sqrt(2) Simplify -1(((sqrt(176)-1 + sqrt(176))4)/(sqrt(484) + sqrt(484) + sqrt(484) + -1sqrt(484) + sqrt(484) + sqrt(484)) + 0). 0 Simplify 3 + (4 + -3((sqrt(68) - 2(sqrt(68) + 0 + sqrt(68))2) + (sqrt(68)1 + 3)*2 + -4))-1. -1414 + 42sqrt(17) Simplify -3(-1 + (2sqrt(147) - sqrt(147)) - (sqrt(147) - (sqrt(147) + 0 + -2)) - (-1(-2 + (0 + sqrt(147) - sqrt(147)))-3)2). -21sqrt(3) + 117 Simplify (1((sqrt(847) - (sqrt(847) + -1))-5 - (3 + sqrt(847) + 0 + sqrt(847))) + -1sqrt(847)61 + -3)2. 1936sqrt(7) + 54329 Simplify ((((-2sqrt(80) + sqrt(80))3)*2 - (sqrt(80) + sqrt(80) + sqrt(80)1)*22) + -2 + 0)-1. 722 Simplify ((6-2sqrt(209) + sqrt(209))3)/((sqrt(121) + sqrt(121)1)/sqrt(11) + sqrt(77)/(sqrt(21)/sqrt(3)))1. -11sqrt(19) Simplify 0 + (-2 + (sqrt(931) - (sqrt(931) + sqrt(931) + sqrt(931) + 1 + 4)))2 - ((-4sqrt(931))*2-4 - ((2 + sqrt(931) - sqrt(931)) + -1)). 196sqrt(19) + 63358 Simplify (-5sqrt(64) + (sqrt(40)/sqrt(160) - sqrt(4)))/(-1sqrt(200)5 - ((sqrt(200) + 2sqrt(200))2 - sqrt(200))). 83sqrt(2)/400 Simplify -4 + ((((sqrt(19) - (sqrt(304) + -1)) + 5)2 - ((sqrt(19) - -3(sqrt(19) + 1)) + 5)) + 0)-5. -999 + 200sqrt(19) Simplify ((-3(sqrt(228)-1 - sqrt(228)))/(sqrt(36)/sqrt(3)1) - ((sqrt(2736)2 - sqrt(2736)) + 2 + sqrt(19) + -5))*2. -42sqrt(19) + 940 Simplify 1((sqrt(80)/(sqrt(5) + sqrt(80)-4))/((sqrt(288)-2 + sqrt(288))-6))*2. 1/145800 Simplify 5(-1 + sqrt(1900)-2)-6 + (-5 + sqrt(1900)-2)1 + 5. 30 + 580sqrt(19) Simplify (-2 + 4(4(sqrt(1088) + 2 + sqrt(1088)) - (-1 + sqrt(1088) + -1 + sqrt(1088))) + -2 + -3 + -5)2. 10752sqrt(17) + 627472 Simplify (-3-2sqrt(320)-2)/((sqrt(1440) - sqrt(1440)-1)1 + 3-1sqrt(1440)). 4sqrt(2) Simplify (-2(-3sqrt(3400) - sqrt(3400))4)/(sqrt(128)-6 - (sqrt(32) + sqrt(192)/sqrt(6))). -40sqrt(17)/7 Simplify ((-5(-1 + sqrt(720) + 1))*2 + (sqrt(720) + (sqrt(720) - (sqrt(720)2 - sqrt(720)))5)-6)1. -72sqrt(5) + 18000 Simplify (sqrt(11) + (sqrt(121)/(sqrt(11)-5))2 - (-5sqrt(539))*2) + (4(sqrt(55) + (sqrt(55) - sqrt(495))))/(sqrt(45)3). -336864/25 + 5sqrt(11)/9 Simplify (4-2sqrt(833)4 - ((sqrt(102)/sqrt(6) + 1)2 - sqrt(85)/sqrt(125)))-6 + 3. 111 + 6774sqrt(17)/5 Simplify (-2 + 3-5(-2sqrt(2736) - sqrt(2736)) - (((sqrt(95)2 - sqrt(95)) + sqrt(95))1)/(sqrt(60)/(2sqrt(12)) - sqrt(5)))2. -2176sqrt(19) + 5622788 Simplify -4 + ((sqrt(135)15)/((sqrt(18)/sqrt(3))/sqrt(2)))/(2(sqrt(90)/(sqrt(20)/sqrt(2)) - (sqrt(81) - sqrt(9))-6)). -4 + 5sqrt(5)/26 Simplify (-3(4(3sqrt(99) + 0) + (sqrt(99) - -2sqrt(99)-1) + -3)4)2. -28512sqrt(11) + 1726272 Simplify -63612(sqrt(200) + (sqrt(200)-1)*2 + sqrt(200))-6. 25920sqrt(2) + 259200 Simplify (6(4 + (sqrt(425) - (4(sqrt(425) + -2) + sqrt(425)))))*2 - (	{ "pile_set_name": "DM Mathematics" }
817 What is the derivative of 446 - 905w - 398w + 1736w wrt w? 433 Find the second derivative of -86d*4 + 62d - 48d4 - 116d + 2 wrt d. -1608d2 Let n(c) = c2 - 13c - 27. Let g be n(16). What is the third derivative of -gb2 + 995 - 26b*4 - 995 wrt b? -624b Let v(s) be the first derivative of 11s6/360 - 5s*4/6 - 22s*3/3 + 21. Let m(z) be the third derivative of v(z). Differentiate m(f) with respect to f. 22f Let w(t) be the third derivative of -34t4/3 + 229t*3/6 + 228t*2. Find the first derivative of w(q) wrt q. -272 Let g(b) = 3b*2 + 3b + 15. Let x be g(-3). What is the second derivative of -23z5 + 2z - xz - 8z + 2z wrt z? -460z*3 What is the third derivative of -133o*4 + 133o*4 - 568o*2 + 418o*6 + 70o*2 wrt o? 50160o*3 Let c(y) be the third derivative of 0y*6 - 13y*2 + 0y + 0y4 + 7/6y*3 + 1/35y*7 + 0y*5 + 0. What is the derivative of c(j) wrt j? 24j3 Let a(i) = i4 + i3 + i2 + i + 1. Let n(f) = 16f4 - 6f*3 - 6f*2 - 6f + 108. Let k(r) = 6a(r) + n(r). What is the first derivative of k(h) wrt h? 88h*3 Let t = -51 + 58. Differentiate -t - 32d + 63d - 29d wrt d. 2 Suppose 3s + 3 = 0, 3v + 0s + 2s = 7. Find the second derivative of -19rv - 19r - 5r3 + 12r wrt r. -144r Let u be -1-1(-1 + 3). Suppose 4p - d - 13 = 0, ud = 4p - 3 - 11. What is the third derivative of -3o3 + 2o*4 + 3o*p + 3o*2 wrt o? 48o Let u(q) be the third derivative of -13q4/12 + 164q*3/3 + 268q*2. What is the derivative of u(g) wrt g? -26 Let f be 1/(-4) - (-468)/16. What is the first derivative of -6z - 17z + fz + 4 wrt z? 6 Let r(x) be the second derivative of -10x + 9/2x*2 + 0x*3 + 0 - 3/20x*5 + 0x*4. Differentiate r(u) with respect to u. -9u*2 Let r(y) be the first derivative of 107y*4/4 + 9y*2/2 - y - 113. What is the second derivative of r(a) wrt a? 642a Let b(w) be the second derivative of -4w3/3 - 83w*2/2 - 93w. What is the first derivative of b(c) wrt c? -8 Let x = -8 + 13. Suppose -4n = 3v - 0n + 16, xn + 20 = -3v. What is the third derivative of 3o*4 + vo*4 - 5o*2 - 4o*4 wrt o? -24o Let r(b) = 564b2 + 22b - 540. Let x(t) = 282t2 + 12t - 269. Let c(m) = 6r(m) - 11x(m). What is the derivative of c(w) wrt w? 564w Let n(z) be the second derivative of -71z*3/2 + 43z*2 + 257z. What is the derivative of n(r) wrt r? -213 What is the derivative of 18 + 57 - 5k2 - 10 - 6k*2 wrt k? -22k What is the third derivative of -89y2 - 2423y*6 + 2304y*6 + 174y*2 + 195y*2 wrt y? -14280y*3 Let c(v) = 84v*2 - 131v + 5. Let b(j) = -42j2 + 66j - 3. Let z(u) = -5b(u) - 3c(u). What is the second derivative of z(r) wrt r? -84 Let s = -33 + 54. What is the second derivative of -22 + 10 + sq + 12 + 7q*2 wrt q? 14 Let w(o) be the first derivative of 0o - 1/2o2 + 0o*5 - 1/6o*6 + 0o*4 - 6 + 0o*3. Find the second derivative of w(i) wrt i. -20i*3 Let t(p) = -63p - 90. Let r(x) = -3x + 1. Let j(z) = r(z) + t(z). Differentiate j(n) with respect to n. -66 Let r(o) be the second derivative of 0o*5 - 29o + 0o3 - 4/21o*7 + 0 + 0o*2 - 13/6o*4 + 0o*6. Find the third derivative of r(f) wrt f. -480f*2 Let o(j) = -11j - 30. Let b be o(-3). Let g(n) be the second derivative of -n + 5/6nb + 1/12n*4 + 0 + 0n*2. What is the second derivative of g(i) wrt i? 2 Find the second derivative of 106p*2 - 30p*2 + 2p - 22p2 + p3 - 40p*2 wrt p. 6p + 28 Let b(m) = 5m3 + 18m*2 + 3m + 70. Let s(j) = 4j3 + 17j*2 + 2j + 69. Let p(t) = -2b(t) + 3s(t). Differentiate p(x) with respect to x. 6x2 + 30x Let r(s) be the second derivative of s + 0s2 + 0s*6 + 0s*4 + 1/20s*5 + 35/6s*3 + 5/7s*7 - 24. What is the second derivative of r(p) wrt p? 600p*3 + 6p Suppose 0 = -2c + 3n + 987, 0c - 3c + 1513 = 2n. Find the second derivative of -501x*3 + 6x*4 - 2x + cx3 wrt x. 72x*2 Let s(u) = -372u*2 - 333u + 6. Let q(i) = -374i2 - 334i + 9. Let h(t) = -2q(t) + 3s(t). What is the second derivative of h(o) wrt o? -736 Let v(d) = d*2 - 4d + 9. Let u be v(6). Let k = -11 + u. Differentiate -4 + 4x3 + 2x*3 - kx*3 wrt x. -12x*2 Let x(w) be the first derivative of 9w*5/5 - 7w*4/2 + 2w*3/3 - 52w*2 - 196. Find the third derivative of x(u) wrt u. 216u - 84 Let q(z) be the second derivative of 0z3 + 37/12z*4 + 0 - 25z + 0z2 - 3/5z*6 + 0z*5. What is the third derivative of q(n) wrt n? -432n What is the third derivative of 707c6 + 410c*2 + 53c - 53c + 5 - 5 wrt c? 84840c3 Let v(h) = -h - 1. Let n(j) = j2 - 4j - 11. Let a be n(6). Let s(k) = 24k + 22. Let i(y) = as(y) - 2v(y). Differentiate i(w) with respect to w. 26 Let b(j) = 2j2 - 5j - 3. Let d be b(-2). Differentiate -11c2 - dc*2 - 30 - 5c*2 wrt c. -62c Let p = -4 - -7. Suppose i + 6 = pi. What is the second derivative of 44 - 44 - 6f + f*3 - 2f*i wrt f? -6f Let x = 8 - 9. Let g = x + 5. What is the first derivative of -4c2 + 1 + 2 + 4c*2 + 5c*g wrt c? 20c*3 Let j = -66 + 69. Find the third derivative of -5b*6 - 8b*6 - 5b*6 - 17b*2 - jb*2 wrt b. -2160b*3 Let w(f) = 2f + 7. Let c be w(-2). Differentiate -n*3 + 19 + cn*3 - 10 - 14 wrt n. 6n2 Let x(p) be the second derivative of p6/15 + 33p5/4 + 11p*3 + 2p*2 + p + 266. What is the second derivative of x(m) wrt m? 24m*2 + 990m Suppose -3y - u - 3 = -4u, -2y + 19 = 5u. What is the second derivative of 25wy - 5w + 10w + 10w wrt w? 50 Let v(z) be the first derivative of -87z6 - 32z*3 + 356. What is the third derivative of v(x) wrt x? -31320x*2 Suppose -4v = a - 3v + 2, v = 3a - 10. What is the third derivative of -5m2 + 8m*a - 10m*5 - 4m*5 wrt m? -840m*2 Let n(a) = -132a + 298. Let x(o) = -397o + 892. Let d(w) = -11n(w) + 4x(w). Find the first derivative of d(l) wrt l. -136 Suppose -2l + 4 = -0. Find the third derivative of 3r5 - 5r*2 + 2r*5 + 6r*l - 11r*2 wrt r. 300r*2 Let r(o) be the second derivative of -19o8/56 - o7/14 - 155o4/12 - o3/3 + 85o + 2. Find the third derivative of r(z) wrt z. -2280z3 - 180z*2 Let b = -4 + 24. Suppose -b = -c - 4c. Find the third derivative of -2g2 - 4g4 - g2 + 8gc wrt g. 96g Let a(g) be the first derivative of -85g4/4 + 119g*3/3 + 440. Find the third derivative of a(o) wrt o. -510 Find the second derivative of -48b*2 + 72b - 23b2 - 2b - 11b2 wrt b. -164 Let v(o) = -36o*2 + 67o - 3. Let r(b) = 37b2 - 68b + 4. Let s(t) = -3r(t) - 4v(t). What is the second derivative of s(m) wrt m? 66 Let u(q) = 15q3 + 5q*2 - 21q - 10. Let l(k) = -22k3 - 8k*2 + 31k + 16. Let f(i) = 5l(i) + 8u(i). What is the second derivative of f(z) wrt z? 60z Let a(k) = -162k*2 + 219k + 4. Let z(l) = 323l2 - 434l - 9. Let b(y) = -9a(y) - 4z(y). What is the second derivative of b(d) wrt d? 332 Let v(b) be the first derivative of 19b4/24 - b3 + 10b2 + 21. Let r(p) be the second derivative of v(p). What is the first derivative of r(n) wrt n? 19 Let i(y) be the second derivative of -y7/21 - 199y6/15 + 53y*4/12 + 7y*2/2 + 38y - 7. Find the third derivative of i(x) wrt x. -120x2 - 9552x Suppose -3l - l - 24 = 0. Let r be 1 - l/(4 - 2). What is the derivative of -38 - rm4 + 43 + m4 wrt m? -12m3 Let f = -18 - -18. Suppose f = -4m + 5c - 21, 3c - 4c = -5m. Find the first derivative of -5 - m + 3 - 8h4 - 2 wrt h. -32h*3 Let g(u) be the first derivative of 191u*4/4 + 110u*3/3 - 150. Find the third derivative of g(c) wrt c. 1146 Let x(d) be the first derivative of -505d*6/6 + 437d*3/3 - 466. What is the third derivative of x(l) wrt l? -30300l*2 Let t(z) = -4z + 2. Let l(c) = -5c + 5. Let x(s) = -6s + 6. Let f(k) = 5l(k) - 4x(k). Let w(m) = -2f(m) - t(m). Differentiate w(v) with respect to v. 6 Find the first derivative of 90f*4 + 752f*2 - 752f*2 - 87 wrt f. 360f*3 Suppose 3m = -4n + 29, n - 20 = 4m - 9m. Suppose 5 = v - n. Find the third derivative of -2f*3 + 2f*3 - vf*4 + 16f*2 - 21f*2 wrt f. -240f Let f(g) = g*3 - 2g + 1. Let x(y) = 2y4 + 6y**	{ "pile_set_name": "DM Mathematics" }
-42a5 + 6a*4 Expand (8 - 1 + 2)((-2y + 5y - y)(-3 + 2 + 2) - 3y - 1 + 1)(-51 - 95 - 11). 1413y Expand 0a2 - 2a*2 + 0a*2 + (-8224 + 8224 + 98a)(192 + 7a - 192). 684a2 Expand -c4 - 3c*4 + 5c*4 + (0c2 + c2 + c*2)(-26c2 - 22c + 7c + 17c). -51c4 + 4c3 Expand (-q3 + 2q3 - 3q*3 - 2q*4)(4520q - 4739q + 2 - 2). 438q5 + 438q*4 Expand (4 - 3 + 1)(-2l - 2l + 5l)(-5l3 + l3 + 3l*3 + (0l - l + 3l)(2605l - 2605l + 53l2) + 3l3 - l3 - 4l3). 206l*4 Expand (1 - o - 1)(2 - 2 + 2o) + (-71o*2 + 7o*2 - 6o*2)(-88 - 85 + 131). 2938o2 Expand (-3 - 3s + 3)(-1 + 1 - 2s) - 2 + 8s2 + 2 - 10s + 10s + 2s*2. 16s*2 Expand -3z*5 - 10z - 2z3 + 10z + 3z5 + 3z*5 - 4z*5 + (3z*2 + 0z*2 - 2z*2)(-18z3 - 224z*3 - 73z*3). -316z*5 - 2z*3 Expand (2s - 2s2 - 2s)(2s + 0s - 5982s*3 + 6633s*3). -1302s*5 - 4s*3 Expand (-11332 + 11337 + 146o - 825o)(o2 - o2 + o*3). -679o*4 + 5o*3 Expand (56 - 89v - 56)(18v + 24v + 4v). -4094v2 Expand -250m*2 - 23m*3 + 250m2 - m3 + 0m3 - 2m*3 + (-2m*2 + 2m*2 - 2m*2)(m + 0 + 3 + 7). -28m3 - 20m*2 Expand (4s*4 + 3s*4 - 3s*4 + (-3s + 8s + 9s)(2s*3 + 0s3 - s3))(-s + 9s - 4 - 19s). -198s*5 - 72s*4 Expand (12l - 1 + 7l + 0l)(-3 + 0 + 2)(-2l + 1 - 1) + (3l + 3l - 3l)(0l - 3l + l) - 17l*2 + 8l*2 - 17l*2. 6l*2 - 2l Expand (2q + 1 - 1)(-1 - 1 + 1) - 3594 + 7189 - 3594 + 922q. 920q + 1 Expand 2h5 + 23h*5 + 26h5 + (h3 + 3h3 - 2h*3)(-2 + 2 - 2h2) + (0h3 - h3 + 0h3)(3h2 - 4 + 4). 44h*5 Expand (n - n - 2n*2)(-2 + 19 + 2 + (-3 + 1 + 1)(0 - 1 + 3) - 1 + 1 + 1)(-4 + 4 + 1 + (-1 - 3 + 2)(6 + 3 - 5) - 2 + 3 + 0). 216n*2 Expand (2 + 21m - 3m - 2)(m*4 + 251m*4 - 46m*4). 3708m5 Expand (-k4 + 2k4 - 3k*4)(-k + 2k + 2k) - 7639k5 + 15334k*5 - 7556k*5 + 13k*4. 133k*5 + 13k*4 Expand (2c*2 - 14c + 14c)(-9 + 12 + 6 + (-4 + 3 + 0)(1 + 1 + 1))(-c*2 + 2c*2 + 0c*2). 12c*4 Expand (-1 - 3h*2 + 1)(1 + 16118h3 - 15954h*3 - 3). -492h*5 + 6h*2 Expand -59v*2 + 59v*2 - 32v*4 + (2v*2 + 3v*2 - 6v*2)(-1 + 1 - 2v2) + 0v - v*4 + 0v + 10v4 - 19v*4 + 7v*4. -33v*4 Expand 5m*2 - 5m*2 + 2m*3 + ((-2m*2 + 2m*2 - 2m*2)(7m + 0m + 9m) - 44 + 2m*3 + 44)(-1 + 3 - 4). 62m3 Expand 165 - 165 - 5z + (-4z + 2z + 0z)(2 + 0 - 1) + 5z + 6z - 5z - 19z + 40z + 6z. 26z Expand ((1 - 1 - 1)(r - 2 + 2) + r - 5r + 2r + 0r - 12r - r)(-2r + 0 + 0 - 2r + 2r - r + (-6r - r + 5r)(-2 + 0 + 3)). 80r*2 Expand (6d - 6d + d + d - 5d + 2d + (0 + 2 - 1)(3d - d - 3d))(-1 + 11 + 23). -66d Expand (15j + 68j + 981 - 979)(-192 + 167j + 192 - 2j2). -166j*3 + 13857j*2 + 334j Expand (-49o2 - 23127 + 23127)(-16 + 28 + 5o2 - 13). -245o*4 + 49o*2 Expand (5 - 7 - 5)(-7 - 8 + 5)(0h*3 + 2h*3 - 4h*3)(1 - 4 + 1). 280h3 Expand 2g + 8g2 + 4g*2 - 1 - 13g*2 + ((3 + 0 - 5)(2g - 6g + g) - 4g + g + 17g)(-4g + 3g + 8g). 139g2 + 2g - 1 Expand (-q*3 + 7q + 3 - 7q)(-5 + 3 + 1)(-105q + 699465 - 699465). -105q4 + 315q Expand (0 - 1 + 4)(45c - 2 + 6 - 3)(-1 + 0 - 1)(1 + 2c - 1). -540c*2 - 12c Expand 31 - 31 - 7g4 - g + (-4g*3 + 6g*3 + 2g*3)(2g + 4 - 4) - 4g*4 + 5g*4 - 4g*4 + (-g + 1 - 1)(-2g3 + 5g*3 - 4g3). -g4 - g Expand (-12 + 4k + 12)(-32 - 17 + 221). 688k Expand (4i - 3i + i)(-5i + 5i + i) + 1 - 1 + 2i2 + 10i*2 - 28i*2 - 4i*2 + 196i - 196i - 12i*2. -30i*2 Expand (-35x - 26x + 4x)(0x + 4x - 5x)(4x*3 + 4x - 4x). 228x*5 Expand (-10g - 32g + 5g + (4g - 2g - 4g)(1 + 4 - 4))(4g + 0 + 0)(7g - 6g - 2g - g*2). 156g*4 + 156g*3 Expand (-385p - 289p - 3 + 1)(12p - 26 + 26). -8088p*2 - 24p Expand (0 - 2 + 3)(-2 + 2 - s) + (-2 - 3 + 0)(52 + 0s - 62 - s). 4s + 50 Expand (24239m - 3187m*2 - 24239m)(-2m*2 - 3 + 3 - 2m). 6374m4 + 6374m*3 Expand (816m + 3596m + 1471m)(2m*2 - 4m2 - m2). -17649m3 Expand 50n*4 - 18n*3 + 18n*3 + (-2n + 2n - n)(-3n3 + 3n3 + n3) + 9n4 + 5n*4 + 2n*4. 65n*4 Expand (2 + 3r*2 - 2)(0 + 0 + 1)(-1 + 3 - 3)((-22 - 18 - 8)(-2 + 3 + 0) + 2 + 1 - 1)(-3 + 3 - 2r). -276r*3 Expand (2k*2 - 2k + 2k)(513972 - 1027087 + 514691 + 6k). 12k*3 + 3152k*2 Expand (2v - 3 + 3)(3v - 18v + 12v - 33v2 + 6). -66v*3 - 6v*2 + 12v Expand (-32 - 16d + 32)(-11 - 401d + 14 - 3). 6416d*2 Expand (-4j*2 + 3j*2 + 2j*2)(-3154 - 23241 - 12463 + 5436 - 18802 - 12032). -64256j2 Expand (0l*2 + 2l*2 - 4l*2)(-l*2 + 0l + 0l) + 623l*4 + 31148l*2 - 31148l*2. 625l*4 Expand (-z - 4z + 4z)(11 - 5 + 12) - 5z - 20z - 18z - 2z + z + 0z. -62z Expand (379 - 1902 - 4768 - 3358 - 991)(-4s*5 + 3s*5 + 0s*5). 10640s*5 Expand (129 + 52 + 167 - 73)(21s2 - 14s*2 + 11s*2)((2s + s - s)(1 + 0 + 0) + 6s + 4s - 4s). 39600s*3 Expand (2 - 2 + h)(-h*3 + 2h*3 - 2h*3) + (-3 - 3 + 4)(h*4 + 2 - 2) - 13h*4 - 41h*4 + 12h*4 - 3h*3 + 3h3 + h4. -44h4 Expand (0s2 - s2 - s*2)(-127s2 + 460s*2 + 202s*2)(-17s + s + 0s). 17120s5 Expand b3 - b2 + b2 + (-4b + 2b + 3b)(-21b + 21b + 36b*2) - 9 + 5b*3 + 3b*3 - 9b*3 + 3b*3 + 3b - 4b + 0b*3. 39b*3 - b - 9 Expand (177t - 178t - 40 - 10 - 5)(25t4 - 205t*4 - 42t*4). 222t*5 + 12210t*4 Expand (-6 - 1 - 10)(-2d + d + 0d)(-8957 + 8957 + 874d + (-4 - 1 + 6)(4 - 4 - 2d) + (-4d + d + 5d)(-1 + 1 - 1)). 14790d*2 Expand -460a*4 + 2a*2 + 158a*4 + 171a*4 + (-2a*3 + 2a - 2a)(3a + a - 3a) - 2a4 + 4a - 4a - 2a2 - a4 + 2a2 + 0a4 - a4 - 2a4. -139a*4 + 2a*2 Expand 30520y2 + y - y4 - 30520y2 - 27y*3 + (-5 - 3 + 0)(2 - 2 - y*4). 7y*4 - 27y*3 + y Expand (6 + 142 - 37x*2 - 22x*2 + 36473972x - 36473972x)(-2x2 + 4x*2 - 3x*2). 59x*4 - 148x*2 Expand (2 - 4 + 3)(-426m - 134m - 377m)(-2 - 3 + 6)(-2m + 2m - m). 937m*2 Expand (2a + 4a - a)(-7 + 4 + 0) + (-4a - 3a + a)(0 + 3 - 4). -9a Expand (-4g5 - g5 + 4g*5)(3 - 3 + 11) - 61g + 4g*3 + 59g + 10g5 - 5g*5. -6g*5 + 4g*3 - 2g Expand (6x2 + 54x*2 - 17x*2)(3x2 + 2x*2 - 3x*2) - 8x*4 - 3x + 3x. 78x*4 Expand (o - o + 21o*2)(3o3 - 501 + 253 + 244 - 2o*2). 63o*5 - 42o*4 - 84o*2 Expand (-3h + 0h + 5h)(368h + 395h - 142h)(-h3 - h2 + h2). -1242h*5 Expand (4z*2 + 4z*2 - 4z*2)(-z*3 + 4z*3 - 5z*3 + (-1 + 29 - 1)(17 - 17 - 5z3)). -548z*5 Expand ((-2 + 5 - 1)(-2 - y + 2) + 0y + y - 2y - 5 + 5 - 3y)(-4635y - 4106y + 9714y). -5838y*2 Expand (-1 + k + 1)(-112k + 204k - 1263k) + (-1 + 1 + k)(k + k + 0k). -1169k*2 Expand (-2008w*2 + 2008w*2 - 294w*4)(0 - 4 + 0 + (-3 + 5 - 4)(-4 + 4 - 2) - 3 + 2 + 0). 294w*4 Expand (755 - 2839 - 953)(0p2 - p2 + 2p*2) + (3p + 4p - 5p)(p - 1 + 1). -3035p2 Expand (-w4 - 3w4 - w4)(0w + 8w - 4w + 2w - 1 + 1 + (1 + 0 - 2)(2w - w + w) + w + 0w + 0w). -25w5 Expand 8j*4 + 33j*2 - 33j*2 + (-2j2 + j2 + 0j2)(-j - 2j2 + j) + 7j*2 - 3j*4 - 7j*2 + (4j2 + j2 - 3j2)(20 - 13 - 8 + j*2). 9j*4 - 2j*2 Expand (-2h + h - 8h)(-h*4 - h + h) + 219h*5 + 186h*5 - 462h*5. -48h*5 Expand (690 + 18 + 41 + 362)(7 - 3 - 3)(4d*4 + 2d*4 + 5d*4). 12221d*4 Expand (-2m2 - m2 + 5m2)(-166m3 + 51m*3 - 20m*3) - 4m*5 + 3m*5 + 3m*3 + 2m*3. -271m*5 + 5m*3 Expand (-34340l*2 - 33498l*2 + 70573l*2)(-5 + 5 + l)(-3 + 0 - 2). -13675l*3 Expand (-4w*4 + 4w*4 + 3w*5)(1 + 0 + 4) - 24w5 - 184w*5 - 47w5 - w5 + 4w5 - 4w*5. -241w*5 Expand (2 + 2h - 2)(3h + 6 - 6) - 164 + 51 + 1025h2 + 114 + (-3 + 3 + h)(h - 2h + 2h). 1032h2 + 1 Expand (0 + 0 - 2)(-3 + 1 + 0)(-1 - 2 + 1)(132r - 73r + 74r)(5 + 7 - 6). -6384r Expand u4 + 0u + 0u + (35u + 249u + 242u)(3u*2 + 4u*3 - 3u*2). 2105u**4 Expand (-4 -	{ "pile_set_name": "DM Mathematics" }
+ 4c - 455 - c + 3c*3. 3c*3 + 3c + 1120 Collect the terms in 86n2 + 285n*3 - 86n*2. 285n*3 Collect the terms in -265j*2 - 260j*2 + 1041j*2 - 248j*2 - 265j*2. 3j*2 Collect the terms in 28 - 3o*3 - 60 + 4o*3 + 3o*3. 4o*3 - 32 Collect the terms in -1255 + 139z*2 + 2501 - 1246 - 135z*2. 4z*2 Collect the terms in -2 + 2a + 1178a2 - 2a + 1181a2 - 2356a*2. 3a*2 - 2 Collect the terms in -807p*3 - 608p*3 + 688p*3. -727p*3 Collect the terms in -6k*3 - 4519380024 + 4519380024. -6k*3 Collect the terms in -41488 + 41488 + 6f. 6f Collect the terms in -26u*2 + 364u*2 - 2135u*2. -1797u*2 Collect the terms in 31054729716w - 31054729716w + w2. w2 Collect the terms in -28 + 43 - 15 + 244a*3. 244a*3 Collect the terms in -23d*3 + 169d*3 + 3d + 0d - 3d. 146d3 Collect the terms in -12 + 2 + h + 0 + 23h. 24h - 10 Collect the terms in 327c*3 + 28c*3 - 17c*3 + 135c*3. 473c*3 Collect the terms in 143y*3 + 58y*3 + 499y*3. 700y*3 Collect the terms in 401 - 800 + 399 - 320p*3. -320p*3 Collect the terms in -893f*2 + 5791f + 3f3 - 5791f. 3f3 - 893f*2 Collect the terms in 9694o*2 + 23697o*2 + 1712o*2. 35103o*2 Collect the terms in 18050 - 3h - 36336 + 18286. -3h Collect the terms in -2980y*2 - 446y + 446y. -2980y*2 Collect the terms in 174b*2 + 70b*2 - 7b*3 - 38b*2 + 5b*3. -2b*3 + 206b*2 Collect the terms in -20y*2 - 109y*2 + 11 - 6 - 5. -129y*2 Collect the terms in 3a*2 - 1 + 60a + 16a - 10a*2. -7a*2 + 76a - 1 Collect the terms in 0y3 - 13y*3 - 10y*3 - 24y*3 + 4y*3. -43y*3 Collect the terms in -10v + 8v - 13v + 15v - 103v*2. -103v*2 Collect the terms in 31134 + r + 45217 + 8737. r + 85088 Collect the terms in 1450d*3 - 732d*3 - 717d3. d3 Collect the terms in -11t2 - 333 + 707 - 374. -11t*2 Collect the terms in 1845p*2 + 36p - 36p - 116p*2. 1729p*2 Collect the terms in 22181q - 10995q - 11015q. 171q Collect the terms in 4o*2 - 1827067746 + 1827067746. 4o*2 Collect the terms in 1611y - 56 + 56. 1611y Collect the terms in 1282c*3 - 6c + 11 - 11 + 6c. 1282c*3 Collect the terms in -22 - 14 - 26l*2 + 36. -26l*2 Collect the terms in 3y*2 - 819114 - 819113 + 1638227. 3y*2 Collect the terms in 28k*3 + 440k*3 - 1 + 1 + 104k*3. 572k*3 Collect the terms in 22l - 12l + 2l + 4l - 1 - 5l. 11l - 1 Collect the terms in -793z*3 + 225z*3 - 3297z*3. -3865z*3 Collect the terms in -120q3 + q2 + 80q3 + 78q - 78q. -40q3 + q2 Collect the terms in -32g - 24g + 83g. 27g Collect the terms in 396267684 - b3 - 396267684. -b3 Collect the terms in 17448h2 - 8723h*2 - 8728h*2. -3h*2 Collect the terms in 5m - 19m + 9m + 2m + 9m. 6m Collect the terms in 1260y*2 + 1238y*2 - 2509y*2. -11y*2 Collect the terms in 1087366k*2 - 2174719k*2 + 1087363k*2. 10k*2 Collect the terms in -4109x*3 + 3225 - 3225. -4109x*3 Collect the terms in -66 - 634y + 127 - 61. -634y Collect the terms in 301m - 85m - 74m - 73m - 79m. -10m Collect the terms in -743d - 507d - 180d - 82d. -1512d Collect the terms in -2865 - 2h - h2 + 2h - 4133. -h*2 - 6998 Collect the terms in -2691u + 922u + 930u + 850u. 11u Collect the terms in 1191s3 - 2232s*3 + 1146s*3. 105s*3 Collect the terms in -3307 + 9941 - 3318 - 3310 - 39b. -39b + 6 Collect the terms in 40o*3 + 111o*3 + 28o - 32o. 151o*3 - 4o Collect the terms in 0h3 - 369h*2 + 165h*2 - 2h*3 + 204h*2 + 3h3. h3 Collect the terms in 57r + 266r*2 - 138r*2 - 136r*2 - 57r. -8r2 Collect the terms in -f3 + 224f*2 + 223f*2 - 676f*2 + 229f2. -f3 Collect the terms in -219j3 + 22j*3 - 51j*3. -248j*3 Collect the terms in -19655 + 19655 + 1615h*2. 1615h*2 Collect the terms in 42w*3 - 339w*3 - 146w*3 + 42w*3 - 175w*3. -576w*3 Collect the terms in -12v + 0 + 42v + 2 + 2v. 32v + 2 Collect the terms in 324n - 324n + 83n*3 + 7n*2 - 7n*2. 83n*3 Collect the terms in 603 + 570 + 569 + o - 1741. o + 1 Collect the terms in -6197n*2 - 6394n*2 + 12587n*2. -4n*2 Collect the terms in -65g*3 + 24g*3 + 17g*3 + 22g*3. -2g*3 Collect the terms in -4y + 20y - 7y - 4y + 8y. 13y Collect the terms in 17p - 7p + 12 + 4p*2 - 5p - 2p - 4p. 4p2 - p + 12 Collect the terms in -248p*3 - 6 - 4791p + 4791p. -248p*3 - 6 Collect the terms in -5694 + 5694 + 3s*2. 3s*2 Collect the terms in -1018872r - 1018864r + 3056596r - 1018864r. -4r Collect the terms in 5f2 - 1519424 + 1519424 - f2. 4f*2 Collect the terms in -8051 - 8g*3 + 22g*3 + 8051. 14g*3 Collect the terms in 123t*2 + 7195 - 5t - 7195 - 2t3. -2t*3 + 123t*2 - 5t Collect the terms in -19075 - 2a2 + 19075 + a2. -a2 Collect the terms in 11h + 11h + 167h*3 - 201h*3 - 22h. -34h3 Collect the terms in 5818 - 5811 - 6r*2 - 3r*2. -9r*2 + 7 Collect the terms in -491o*3 + 253o*3 - 520o + 282o3 + 520o. 44o3 Collect the terms in 2h + 40h - 49h. -7h Collect the terms in -47w*2 - 761w + 113w2 + 182w*2 + 761w. 248w2 Collect the terms in 98u - 2u2 - 20u*2 - 14 + 16 - 26u. -22u2 + 72u + 2 Collect the terms in 390560u2 - 3u + 3u - 390578u*2. -18u*2 Collect the terms in 29o + 43o + 38o + 35o - 70o. 75o Collect the terms in -430347z + 4z2 + 6z*2 + 430347z + 8z2. 18z*2 Collect the terms in -34a*2 - 44a*2 - 32a*2 + 162a*2 - 29a*2. 23a*2 Collect the terms in 5p - 39 - 30 - 39 + 121 - 13. 5p Collect the terms in 7c*2 - 477 + 354 + 123. 7c*2 Collect the terms in 408 - 132 - 137 - 138 + 15g. 15g + 1 Collect the terms in -124s + 124s + 40718s*3. 40718s*3 Collect the terms in -6145842b + 6145842b - 10b*2. -10b*2 Collect the terms in -27428b + 13724b + 13722b. 18b Collect the terms in 4 - 752h*3 - 4 + 747h*3. -5h*3 Collect the terms in 64 + 25 + 4 + 7f*2 - 32 + 42. 7f2 + 103 Collect the terms in d2 - 9 + 2 + 6d + 4. d2 + 6d - 3 Collect the terms in 2 + 4x + 3x + 0x - 5x + 3x. 5x + 2 Collect the terms in 7069078907 + 3m - 7069078907. 3m Collect the terms in 30 - 42y + 0y2 - 24 + y2. y*2 - 42y + 6 Collect the terms in 257c3 - 370c*3 + 106c*3. -7c*3 Collect the terms in 3i*3 - i + i - 16185 + 16185. 3i*3 Collect the terms in -16h*2 + 8h*2 + 6h*2 - 117h. -2h2 - 117h Collect the terms in 876v3 - 292v*3 - 292v*3 - 50v - 293v3. -v3 - 50v Collect the terms in 377l2 + 26l*3 - 377l*2 + 25l*3 - 2. 51l3 - 2 Collect the terms in -t2 - 4t + 4t - 3t + 0t - 2t. -t2 - 5t Collect the terms in 52 + 54 + 30 - 3o + 419. -3o + 555 Collect the terms in 0 - 34i2 + 241i*2 + 0. 207i*2 Collect the terms in -26051r*3 + 13088r*3 + 13023r*3. 60r*3 Collect the terms in 1902844v - 951476v - 951365v. 3v Collect the terms in 87b - 231b + 76b - 5 + 82b. 14b - 5 Collect the terms in 2719i - 22711i - 36400i + 1. -56392i + 1 Collect the terms in -38 + 43r - 29 - 35 - 34 + 120. 43r - 16 Collect the terms in 326757v - 163335v - 163422v - v3. -v3 Collect the terms in -2h*2 + 0h*2 - 50h3 + h2 + 3h2. -50h*3 + 2h*2 Collect the terms in 11y*3 - 176y*3 + 160y*3 + 6y3. y3 Collect the terms in 4h2 + h2 + 90 + 47 - 137. 5h*2 Collect the terms in 798l*3 - 219l + 219l. 798l*3 Collect the terms in 37 - 93 + 26 - 3x + 30. -3x Collect the terms in 55o - 65o + 24o. 14o Collect the terms in 66l + 77l + 24l. 167l Collect the terms in 10743k*2 - 5279k*2 - 5423k*2 - 1. 41k*2 - 1 Collect the terms in 64r*2 - 34 + 56 - 24 + 25r*2. 89r*2 - 2 Collect the terms in -78m*2 - 101m*2 + 503m*2 - 104m*2 - 107m*2 - 97m*2. 16m*2 Collect the terms in 193z*2 - 327z*2 - 150z*2 - 917z*2. -1201z*2 Collect the terms in -1959b - 6739b - 4657b. -13355b Collect the terms in 17 + r3 - 13 + 4 - 94r2 - 8. r3 - 94r2 Collect the terms in 540w*2 - 274w*2 - 279w*2 - 10. -13w*2 - 10 Collect the terms in 318y*2 - 311y*3 + 315y**	{ "pile_set_name": "DM Mathematics" }
(n/((nn/(n/((nn((n/((n/(nn*4/n))/n))/n)/n)/nn)))/n)))/(n29/n(-6)) assuming n is positive. n*(-377/12) Simplify (aa2)35(a4)18 assuming a is positive. a177 Simplify ((((n/n(-2))/n)/n)(-14/11))(3/26) assuming n is positive. n(-21/143) Simplify (((vv*(-1)v)(-2/129))(2/87))35 assuming v is positive. v(-140/11223) Simplify ((ii(5/4))/iii(-16)/i)/(((ii/i*8ii)/i)/i)(-46) assuming i is positive. i(-1163/4) Simplify (y(2/61)y)/yy(-5/4)yyy*(-1/13)y(-14) assuming y is positive. y(-42169/3172) Simplify ((r*(1/2)r)*(-2/5)(r/(r*(-1/14)/r))/(r/(r/(rr(-8/5)))))(-1/21) assuming r is positive. r(-29/294) Simplify ((f/f(-25))/((ff/(f/((f3f)/ff)))/fffff))/((f5f)/(f*24f)) assuming f is positive. f37 Simplify ((h/(h/h(-9)))(-2/37))17 assuming h is positive. h(306/37) Simplify (q(-5))(-9)/(q(-14)/(q(-2)/q)) assuming q is positive. q56 Simplify (((y*3y)/y)/(y*(-27)y))/(y(9/8))(-3/2) assuming y is positive. y(491/16) Simplify (((r(-18)r)/r(-3/7))26)27 assuming r is positive. r(-81432/7) Simplify i(-13/2)/(ii*(-34))(i/(ii(-2)ii))/i(-1/4) assuming i is positive. i(107/4) Simplify ((u12/((u(u/(uu/(u/((u/u(1/7))/u))))/uu)/u))(9/2))(-4/23) assuming u is positive. u(-1494/161) Simplify ((g(2/7))(-30/13)/((g(-1/7)/g)/(ggg/g*5g)))(-1/20) assuming g is positive. g(47/1820) Simplify ((kk/(k/(k(6/11)/k)k)k)(-2/93))(-45) assuming k is positive. k(180/341) Simplify (t/t(-4/9))(19/6)(t(1/9))25 assuming t is positive. t(397/54) Simplify b(4/5)/(bb/(b/(b11/bb)))bb*(-5/4)b(-3)/b assuming b is positive. b(-309/20) Simplify (zz(-7))/(zz/((zz9)/z))z/(z/(zz(-1)))z(1/2) assuming z is positive. z(3/2) Simplify (q/(q/(((qq(-1)/q)/q)/q)))/((q/(q(-2/19)q))/q)(q/q(-12))/qq(-7) assuming q is positive. q(55/19) Simplify (w(ww*(-3/8)/ww)/w)/w*12(w/w(-1/2))/((w(2/17)w)/w) assuming w is positive. w(-1359/136) Simplify ((s5s)/(s*(-1/4)/sss))/(ss*12/ss/s*(-6)s) assuming s is positive. s(-59/4) Simplify (((y/(y/((y(1/3)y)/y)y))/y)*(-7/10)(y3)40)(2/97) assuming y is positive. y(727/291) Simplify ((qq/(q(-5)q)q(-2/17)q)/((qq5)/(q/(qq*(3/2)qq))))(28/5) assuming q is positive. q(-1246/85) Simplify (q18/qq*(-9))/(q/(qq/(qq(-3/10)q)))(4/9) assuming q is positive. q(346/45) Simplify (m*(-5/3)mm/(mm*(-5)m))/(m/(mm(m/(m(m/((((mm*1m)/m)/m)/m))/m))/mm))(-6) assuming m is positive. m(-8/3) Simplify a(-4)a/a*(-23)((a/a(-9))/a)(-16) assuming a is positive. a(-124) Simplify (((c/c(-1))/c)(1/80)/(c0c)(-7))(-13) assuming c is positive. c(-7293/80) Simplify (p(1/7)p)(-2/37)/((p/(p(-3/2)p))/p(-6)) assuming p is positive. p(-3917/518) Simplify (((a/((a/a9)/aa))/(a/(a2/a)))44)(-3) assuming a is positive. a(-1188) Simplify ((w*(-5)/(w/(w/(ww(-1/2)))))(2/63))16 assuming w is positive. w(-176/63) Simplify m*16m/(m*(-2/35)m)(mmm24)/mm/m(11/7) assuming m is positive. m(1417/35) Simplify ((ww/((w/(w/(w(-7)/w)))/w))/www((w/((ww(-3)/w)/w))/ww)/ww/w(2/13)w/(w(w/(w(w*(2/7)w)/w))/w))(-9) assuming w is positive. w(-14850/91) Simplify (((u/u3)/u)/(u(-3/7)u)(((uu/(u/(uu(-8))))/u)/u)/((u(-1/4)u)/uu))(1/24) assuming u is positive. u(-115/224) Simplify (s(s(-24)s)/ssss(-7/5))/(((s(1/10)s)/s)/(s*(3/5)s)) assuming s is positive. s(-209/10) Simplify (y(-10/9)y/y(-32))24 assuming y is positive. y(2296/3) Simplify ((u/(uuu/(u6u)))/uu/(((uu*(4/5))/u)/u)uu(3/4)/((u(1/3)u)/u))(-9) assuming u is positive. u(-1191/20) Simplify (p/(ppp(-1)))(-3/17)p0/(p(-14)p) assuming p is positive. p13 Simplify y14yyy(2/7)(y/y*(-16)y)/(y/y0) assuming y is positive. y(233/7) Simplify (f(-4))40/(ff(-14)f(2/17)) assuming f is positive. f(-2501/17) Simplify (m/m0)40(mm*(-4)mmmm)(-44) assuming m is positive. m(-4) Simplify (b12/b(2/5))/(b/(bb*(-1/12))b*(-11)b) assuming b is positive. b(1291/60) Simplify l5/(ll6l)(l(lll*(-1/5))/l)/ll19 assuming l is positive. l(84/5) Simplify ((m(m/m(-19))/m)/m(-2/37))/(m(-32)m(-24)) assuming m is positive. m(2814/37) Simplify (i*(1/21)/(iiii(i(-1/13)ii)/i))/(i(-2/19)ii19i) assuming i is positive. i(-133670/5187) Simplify (v(-2)v)(-9/2)v*(1/10)vv(-7)/vv assuming v is positive. v*(-7/5) Simplify ((yy*(4/5)y)/y*(-3/11)y8/(y(-7)/yy))(2/11) assuming y is positive. y(1988/605) Simplify (b/(b/b20b)b)/(b(2/27)/bb)b(-14)/b(-17) assuming b is positive. b(619/27) Simplify ((((r0/r)/r)/r)/r)(-46)/(r(-9)/(r/(r/(r/r(-3/4)r)))) assuming r is positive. r*(783/4) Simplify ((g(g/((g/(gg/((gg*10ggg)/g)))/g))/gg)/gg*(-3)/gg)/((gg(1/3)/g)/gg(-13)) assuming g is positive. g(2/3) Simplify ff/f(-15)((f/f*9)/f)/f(f/f(-3))/f3 assuming f is positive. f8 Simplify (((y(3/5))(-46))(15/7))(-28/9) assuming y is positive. y184 Simplify (d/(d(dd*14)/d)d(-1))/(d(2/3)/d(-13)) assuming d is positive. d(-86/3) Simplify ((x(2/11)/x)/x(-26))/(x/(x/(x/(x*(-4/3)/x))x))39 assuming x is positive. x(-724/11) Simplify (k(2/9))(-13)/(k/((kk(-2)/kkkk)/k))(-25) assuming k is positive. k(199/9) Simplify (d(-2)/d)(-26)/(d*(-14)/((((dd*(-3/14)/dd)/d)/ddd)/dd)) assuming d is positive. d(1299/14) Simplify (h40/(hhhhh/(hhh(-2/5))h))(-18) assuming h is positive. h(-3204/5) Simplify (f*(-22)f)/(ff(f/f*(-4/9))/f)f*(-4/13)/(f/((fff(2/7))/f)) assuming f is positive. f(-19219/819) Simplify ((h(-9/4))31)(28/9) assuming h is positive. h(-217) Simplify x(1/20)xxx/(xx(-1/6))x*(-3)/(x(x/(((x/x*12x)/xx)/x))/x) assuming x is positive. x(-767/60) Simplify ((rr/((rrr*(-4))/r))/rr/(rr/r(2/11))(r(-3/5)/r)/(r/(r(-5)/r)))(-2/145) assuming r is positive. r(596/7975) Simplify ((i/i*11)/ii*5ii(-4)iii(1/9))34 assuming i is positive. i(-2108/9) Simplify ((h(-4/11)h)/(hh/(h*(1/14)/h)hh))/(hh*8hh(-18/5)) assuming h is positive. h(-8233/770) Simplify o(1/6)o/(o*(-12)/o)o(o(-2/9))17 assuming o is positive. o(205/18) Simplify (k(-2/17)/kk)/(kkkkkk(-24)kk)kk15(k(kk(-22))/k)/k assuming k is positive. k(185/17) Simplify (r(-2/7))46(r(-2/13))22 assuming r is positive. r(-1504/91) Simplify (((x(2/7))(-20))(-48))27 assuming x is positive. x(51840/7) Simplify (m(-3/8))(-6)(mm(-8/5)m)/(m*(-1/3)mm) assuming m is positive. m(59/60) Simplify a(-27)a*6a*(-19)/aaa(1/12) assuming a is positive. a(-479/12) Simplify (i/(i(2/3)i)ii(-37))(-41) assuming i is positive. i*(4510/3) Simplify (b(bbbbb/(bb/(b(3/14)/bb)b)b)/bb)/b(1/4)b/b*(-13)(b/b*(-1/12)b)/b assuming b is positive. b*(400/21) Simplify ((a/(a/(a(a/(aa0/a))/a)))/a)(9/4)a*(-7/6)a10 assuming a is positive. a(53/6) Simplify ((o(1/2)/(o(2/7)/o))/(o*4o*(-2/3)/oo))(-1/10) assuming o is positive. o(89/420) Simplify (xx(1/2))(-2/9)/(((xx(xx((xx/x*(-5)xx)/x)/x)/xxx)/x)/(x(3/11)/x)) assuming x is positive. x(-398/33) Simplify (p/(p/(p(-10)/p))p*24p)(-17/5) assuming p is positive. p(-238/5) Simplify (ww/((w2/ww)/w))*(-3/32)ww8w(-1/2) assuming w is positive. w(269/32) Simplify (w*(5/3)w)(-1/5)/(w(4/11)/ww)43 assuming w is positive. w(-2668/165) Simplify (s3)(-1/3)/(s/(s/(s(-2/9)/s)s)s)48 assuming s is positive. s(173/3) Simplify (m(-12)/((mmm(-3/10))/m))/((m(-9)/m)/mm*(6/17)m) assuming m is positive. m(-519/170) Simplify g(-24)/(g*(-5/3)g)(gg*(2/15))/gg/(gg/g5g) assuming g is positive. g*(-101/5) Simplify ((u(u*20/u)/u)/uu*5/u)/((uu(uu*(-1/8))/uu)/((u*(-9)/u)/uu)) assuming u is positive. u(73/8) Simplify (b2/b*21)/(b((b*(-2/87)bb)/b)/bbb(5/6)) assuming b is positive. b(-1265/58) Simplify (yy*(-6/5)yyyy	{ "pile_set_name": "DM Mathematics" }
un4 + g + tn and give v. 2 Rearrange (1 + 3 - 1)(-532 + 311 + 1339)(h + 0 + 0) to the form sh + m and give s. 3354 Rearrange 5n3 - n4 + 0n2 - 4n*3 + 432n + 4n2 - 433n to the form xn2 + k + rn + zn4 + in*3 and give r. -1 Express -9f - 13f - 19f + 14f2 + f3 - 16f - 7 + 59f as if*2 + nf + df3 + m and give n. 2 Express (-3n - 47n + 3n + (3 + 2 - 7)(n + 2n - 2n))(-2n + 4n - 5n) as l + in + wn2 and give w. 147 Rearrange 46a + 10a + 1 - 1 - 14a to ja + c and give j. 42 Rearrange (4k*2 + 5k2 - k2)(-551 + 1076 - 537) to n + yk*2 + qk and give y. -96 Rearrange -11136 + 11136 + 210x to qx + f and give f. 0 Express -2t2 + 5473t - 4t4 - 5471t + t*3 + 5t*2 - 9 + 3t*4 in the form kt + ht3 + lt*4 + x + dt2 and give x. -9 Rearrange -1 - y3 - 21y + 18y + 3y - 13y*2 to the form by*2 + oy*3 + gy + z and give b. -13 Rearrange (j - 6j - 6j)(-6j - 16j - 37j) to cj2 + h + gj and give c. 649 Rearrange 184m4 - 51m*4 + 5m*3 - m - 4m*3 - 2m*2 - m + 33m*4 to the form zm*3 + lm + y + pm4 + om*2 and give l. -2 Express -403k*4 - 2k*2 - 14k + 3k3 - k3 - 1 + 404k*4 as nk*3 + z + ok*4 + vk + dk2 and give d. -2 Rearrange (0l*3 + 5l3 + l3)(-33 - 43 - 44) to the form dl*3 + yl + hl2 + b and give d. -720 Rearrange (2 + 2 + 0)(-2f + 0f + 0f)(-5f + 5f - 8f)(4 - 2 - 3) to a + hf + sf*2 and give s. -64 Express 6p - 4p - 3p - 2p + 2p + 6p + 7 - 7 - 2p + (-5 + 2 + 1)(3p - 4p + 2p) + (-3 + 1 + 3)(-2 - p + 2) - 3 + 3 - p in the form u + wp and give w. -1 Express 234l + 10l + 149l in the form f + wl and give w. 393 Express (34u - 22u - 16u)(8u + 134u - u) in the form g + xu2 + du and give x. -564 Express 0j - 18j*2 - j + 59j*2 - 3j - 28j2 in the form mj*2 + n + tj and give m. 13 Express (0v + 0v + v)(-17v*2 + 816427v - 816427v - 11) in the form uv + cv2 + zv*3 + w and give z. -17 Rearrange -66o*2 - o + 2o + 272 - 63o2 + 130o*2 to ho*2 + yo + s and give h. 1 Rearrange -v - 237 - 30v4 + 390 - 149 - 2v*3 to the form bv*3 + zv + r + mv2 + ov*4 and give o. -30 Rearrange (-45y - 4y + 15y - 16y - 2y)(-6y - 2y + 5y) to the form t + ny2 + iy and give i. 0 Express -16u - 2u - u - 2 - 15u in the form ou + y and give y. -2 Express (-2y4 + y2 - y2)(4 - 1 - 2 + (1 - 3 + 0)(1 + 2 - 5) + 19 + 15 + 5)(2 + 0 + 0) in the form dy4 + h + ly + by2 + wy*3 and give d. -176 Rearrange 23 - 34 + 4 + 19g to the form hg + l and give h. 19 Rearrange (0k - k + 3k)(5 - 1 - 3) + k - k + 3k + 31k - 6k + 38k - 10k to hk + x and give x. 0 Rearrange -58k4 - k4 + k2 + 14 + 61k4 - k3 + 3k to lk*4 + hk + jk3 + c + qk*2 and give h. 3 Rearrange -92t - 105t + 34t - 111t - 67t to the form n + lt and give l. -341 Express 11o - 16o2 + 2 - 11o - 3o2 - 15o*2 in the form lo + r + vo2 and give v. -34 Rearrange 360y*3 - 381y*3 + 2 + 495y*3 to the form f + wy*3 + ay + py2 and give f. 2 Express (1 - 3809n + 4 + 3816n)(4 - 6 + 4) in the form a + cn and give c. 14 Rearrange -41w*3 - 175w + 9 + 47w3 + 174w to the form ow3 + uw*2 + k + pw and give p. -1 Express -3063d4 + 7d*2 + d + 7 - 4 + 3062d*4 as qd*2 + sd*3 + h + gd + wd4 and give q. 7 Rearrange -9s + 7s + 7s*3 + 3s*4 - 8s*3 + (-2s*3 + 4s*3 - 3s*3)(96s - 51s - 50s) to bs + as4 + ds*2 + ms*3 + f and give a. 8 Express -26f - 120f - 3 - 3 + 30f - 60f as if + z and give z. -6 Rearrange b*3 - 149645b + 2 - 3b2 + 149645b to x + ob + cb*3 + db*2 and give x. 2 Rearrange -4 - 124k*3 + 28k + 46k - 72k to ik3 + pk*2 + x + lk and give l. 2 Express -2 - 27u + 57u + 66u + 17u as bu + q and give q. -2 Rearrange (4 - 5z - 4)(-11 - 6 - 6)(-4z + 4z - 2z) to rz + wz2 + d and give w. -230 Express (x + 3x - 3x)(29x + 52x + 15x) + (-x2 + 2x*2 - 3x*2)(-3 + 1 + 4) + (7 - 7 - 7x)(-2x + 0 + 0) as fx + h + vx2 and give v. 106 Express -4s3 - 6 + 8 + s3 + 1 in the form ns3 + ks + c + ws2 and give n. -3 Rearrange (-3p + 3p - p2)(p + 2p - p) + (1263 + 84p - 1263)(4 - 4 + 2p*2)(4 - 8 - 3) to the form u + ip3 + hp + tp2 and give i. -1178 Rearrange 7i*2 - 1 - 42i*2 + 26i*2 + 8i*4 to xi*3 + bi*4 + y + ci + li2 and give b. 8 Rearrange 243 - 3o - 2o3 + 243 - 493 + 2o*4 to xo*3 + ro*4 + io + n + yo2 and give n. -7 Express -30495 + 30495 + 359o*2 + 210o*2 as so + v + zo2 and give z. 569 Rearrange -70 - 120 + 21 - 8 - x2 to y + ux + cx2 and give y. -177 Rearrange 34 - 1645q - 67 + 433q + 33 to the form hq + b and give h. -1212 Express (2y - y - 2y)(0 - 5 + 3)(-51 - 233 - 65) as fy + g and give f. -698 Rearrange 6n*4 + 11n*4 - 2 - 3 + 7n + 2 - 15n4 to mn*4 + k + wn*3 + hn*2 + un and give u. 7 Express -7t + 2t*3 + 7t - 3 - 243t2 - 2t*4 + 207t*2 in the form xt*2 + q + ot*3 + ht + dt4 and give o. 2 Express 14 + 9 - 335k*2 - 23 as rk + ak2 + n and give a. -335 Rearrange 272z*3 - 270z*3 + 21z + 13z - 96z*2 + 93z*2 to i + mz*2 + rz + pz3 and give m. -3 Rearrange -2j - j*2 + 29j*4 - 50j*4 + 23j*4 - 2j*3 to the form gj*2 + dj*3 + qj + p + cj4 and give d. -2 Rearrange f2 - 7 + 1041f - 1041f + (-3 + 2 + 0)(3f + 2f*2 - 3f) to g + lf2 + rf and give g. -7 Express (5 - 10 - 15)(q + 3q - 2q)(1 - 3 + 6)(8 - 4 - 5) in the form b + iq and give i. 160 Rearrange -3w - 1 + 2 - 1 + 1 - 4w*2 to the form aw + jw2 + o and give a. -3 Express 15 - 408h*2 - 29 - 2h + h + 13 + 431h2 in the form o + fh + rh2 and give r. 23 Express -y2 + 12y*4 - 4y*2 - 6 - 7y*4 in the form qy*3 + ly*2 + a + dy + jy4 and give l. -5 Rearrange 48a*2 - 35 - 48a*2 - a + 81a*3 - 70a*3 to the form va*2 + i + fa + ua3 and give u. 11 Express (162 - 50 - 31)(4x2 - 4x*2 + 3x*2)(-2x2 + 0x*2 + 0x*2) as a + qx*3 + sx + bx4 + fx*2 and give q. 0 Rearrange 3o*2 - 1 - 25o4 - 24 + 23 - o3 to wo4 + v + io*3 + yo*2 + bo and give w. -25 Express -2g - 33g*3 + 43g*2 - 34g*2 - 3 + 33g*3 - 2g*4 + 54g*2 in the form zg*4 + lg*2 + jg*3 + q + mg and give l. 63 Rearrange -62 - 137s + 62 - 208s to the form ns + m and give n. -345 Express 1857o - o*3 - 928o - 117o2 - 931o as to + io*3 + l + ro*2 and give i. -1 Rearrange (6c*2 - 2c2 - c2)(2c*2 - 4c*2 + 0c*2) + 5224c*2 - 5224c*2 - 228c*4 to pc*4 + mc*3 + a + qc*2 + uc and give p. -234 Rearrange 1382u - 2767u + 1385u + 601u*2 to the form f + bu*2 + pu and give b. 601 Rearrange (-87 + 7 - 29)(-a + a - a3 + (-2a + 2a + a)(-5a2 + 3a2 + a2)) to ia3 + ya*2 + fa + p and give i. 218 Express 3x + 133x*2 - 6x - 1366 + 1366 in the form y + kx + tx*2 and give t. 133 Rearrange (-48 - 42 + 76 + v)(-2v + 2v - v*2) to the form pv + av2 + bv*3 + j and give a. 14 Express (-2u + u + 9u)(571 - 571 + 197u) as l + ju*2 + ru and give j. 1576 Express 6g - 1216g*2 - 16g - 2g + 12g as yg2 + c + vg and give y. -1216 Rearrange (-3159 + 181q + 3159)(2 + 0 - 3) to jq + t and give j. -181 Rearrange (78 - 330 - 171)(t2 + t2 - 3t2) to at + k + jt2 and give j. 423 Rearrange 2z - 47 - z*3 + 49 + 5z*4 - 485z*2 + 485z*2 to y + dz + vz2 + kz*4 + bz*3 and give b. -1 Express (-14w - 8w + 5w)(3w + w + 1 - 5w) in the form zw*2 + dw + k and give z. 17 Express -760n + 161n - 1101n as t + sn and give s. -1700 Express -4p - 29 - 27 + 47p*2 + 56 in the form jp + t + cp2 and give c. 47 Rearrange (6 - 6 - 3w)(518w*2 - 230w*2 + 137w*2) to the form iw*2 + sw + g + tw3 and give s. 0 Rearrange 92t*2 + 118t*2 - 1536t*2 - 255t*2 to the form d + kt + vt2 and give v. -1581 Express (0k + k - 5k - k - 2 + 2 + 0k - 4k + 5k + (3k - 3k - 2k)(-1 + 1 - 1))(54 - 182 - 28) in the form r + dk and give d. 312 Rearrange -80k + 410k + k*2 - 4k*2 + 543k + 2k2 to the form a + xk	{ "pile_set_name": "DM Mathematics" }
r + 235. What is g(75)? 10 Let q(b) = 6b3 - 95b*2 - 14b - 43. Determine q(16). -11 Let d(j) = -8j3 + 65j*2 - 93j - 37. Give d(6). 17 Let k(i) = 7i - 29. Calculate k(21). 118 Let h(b) = b3 - 7b*2 + 10b - 19. What is h(7)? 51 Let x(w) = 13w2 + 4w + 3. Calculate x(-3). 108 Let k(m) = -57m2 + 22m + 85. What is k(-3)? -494 Let q(h) = 3h3 - 7h*2 + 20h - 103. What is q(5)? 197 Let l(d) = -35d - 118. Give l(-5). 57 Let z(o) = -o2 - 23o + 197. Give z(-30). -13 Let o(d) = 2d3 + 111d*2 - 57d - 29. What is o(-56)? 27 Let a(y) = 9y2 + 38y - 90. Calculate a(3). 105 Let o(g) = 170g - 2395. Calculate o(14). -15 Let m(s) = s3 - 6s*2 - 9s + 17. What is m(5)? -53 Let u(o) = 152o + 1532. Calculate u(-10). 12 Let g(j) = -j3 - 21j*2 - 14j + 198. What is g(-21)? 492 Let g(v) = -v*2 - 11v + 228. Determine g(-17). 126 Let j(p) = 2p2 - 310p + 1503. Determine j(5). 3 Let l(g) = 296g + 657. Calculate l(-3). -231 Let p(x) = -x2 + 1696x - 36832. Calculate p(22). -4 Let t(x) = 15485x + 123888. What is t(-8)? 8 Let b(j) = 22j*2 + 95j + 10. What is b(-4)? -18 Let u(r) = -2r2 - 36r - 140. Calculate u(-10). 20 Let g(h) = 2h2 + 15h - 558. What is g(-21)? 9 Let d(t) = 278t2 + 115t - 113. Calculate d(1). 280 Let p(q) = -628q + 6284. Calculate p(10). 4 Let h(r) = -11r*3 + 2r*2 - 21r + 31. Give h(2). -91 Let m(o) = 2o2 + 36o + 71. What is m(-2)? 7 Let u(s) = s*2 + 1554s + 20027. Calculate u(-13). -6 Let d(i) = -22i - 136. Calculate d(-9). 62 Let i(u) = -28u*2 - 441u - 20. What is i(-16)? -132 Let w(m) = 101m + 575. Calculate w(-6). -31 Let j(b) = 22b*2 - 4b + 2. Calculate j(-1). 28 Let h(x) = -145x + 83. What is h(7)? -932 Let v(l) = -2l*3 - 208l*2 - 410l - 199. What is v(-102)? 5 Let f(m) = -2m2 - 62m - 101. What is f(-26)? 159 Let a(f) = 9f3 - 39f*2 - 6f + 19. Calculate a(5). 139 Let z(u) = -u*2 + 35u - 236. Calculate z(9). -2 Let s(r) = -2225r - 11043. Determine s(-5). 82 Let j(b) = b2 - 133b + 876. What is j(126)? -6 Let r(i) = -i*3 - 7i*2 + 590i + 3569. Give r(-6). -7 Let d(l) = 23l2 + 6l + 7. Calculate d(-2). 87 Let s(i) = 7i2 - 277i + 115. Determine s(39). -41 Let b(u) = 2u3 + 16u*2 + 44u + 62. Determine b(-5). -8 Let c(s) = 2s3 + 18s*2 + 40s + 181. Give c(-8). -11 Let s(d) = 8d - 139. Give s(17). -3 Let i(w) = 2w*2 - 59w - 55. What is i(29)? -84 Let x(c) = -15c + 127. Give x(21). -188 Let a(z) = -5z*2 + 15z + 2. Determine a(2). 12 Let o(u) = -101u + 542. Give o(6). -64 Let d(w) = -203w + 1486. Determine d(6). 268 Let q(g) = -6g3 - 155g*2 + 570g + 14146. Calculate q(-26). 2 Let l(j) = -2j3 - 80j*2 - 493j + 617. Determine l(-32). 9 Let f(a) = a*2 + 16a - 28. Determine f(3). 29 Let m(s) = 1875s + 28084. What is m(-15)? -41 Let i(b) = 2b*3 + 44b*2 - 10b + 11. Calculate i(-22). 231 Let a(x) = 5x3 - 57x*2 + 67x + 36. What is a(10)? 6 Let g(y) = 2y2 + 49y + 23. Give g(-25). 48 Let x(z) = -1147z + 8019. What is x(7)? -10 Let l(f) = 51f*2 + 763f - 28. Give l(-15). 2 Let a(j) = j*2 + 47j - 1972. Determine a(-74). 26 Let u(j) = -4j2 - 10j - 8. Determine u(-2). -4 Let c(n) = n*3 + 42n*2 - n - 27. What is c(-42)? 15 Let y(u) = -238u - 1857. Determine y(-8). 47 Let c(h) = 392h + 74476. Determine c(-190). -4 Let x(c) = c3 + 14c*2 - 21c - 322. Calculate x(-14). -28 Let n(m) = 15m - 172. What is n(14)? 38 Let b(f) = 2f*3 + 24f*2 - 17f - 17. Calculate b(-13). -134 Let g(f) = -693f - 5460. Give g(-8). 84 Let s(o) = 2o*2 - 136o - 855. Give s(-6). 33 Let i(r) = -r*2 + 32r - 187. Determine i(22). 33 Let f(y) = -41y + 9582. Determine f(234). -12 Let f(n) = -n3 + 4n*2 + 179n + 203. Calculate f(16). -5 Let z(q) = -9q2 + 4q + 32. Give z(-2). -12 Let t(g) = -g*2 - 114g - 1013. Give t(-10). 27 Let q(m) = 2997m - 107. What is q(0)? -107 Let k(d) = -101d - 194. Give k(-5). 311 Let b(o) = 265o2 - 1065o + 71. What is b(4)? 51 Let u(b) = -b*2 + 97b + 2027. Determine u(-17). 89 Let w(u) = u*3 + 5u*2 - 61u - 375. Calculate w(-7). -46 Let r(b) = 2b2 + 91b + 142. Calculate r(-44). 10 Let c(v) = -v*2 + 6v + 24. What is c(-7)? -67 Let t(z) = -z*3 + 4z*2 + 28z - 45. Determine t(10). -365 Let r(c) = -7c - 405. Calculate r(-26). -223 Let k(j) = -33j*2 + 80j - 46. Calculate k(1). 1 Let k(w) = w*2 - 30w - 166. Calculate k(35). 9 Let z(r) = -9r2 - 197r - 348. Calculate z(-20). -8 Let i(g) = 1180g2 - 80239g - 63. Determine i(68). 5 Let i(n) = 2n3 - 18n*2 - 4n - 2. Determine i(10). 158 Let m(v) = v*3 + 10v*2 - 31v - 59. Calculate m(-12). 25 Let z(b) = -2b2 - 65b - 222. Give z(-28). 30 Let q(a) = 113a - 1697. Give q(15). -2 Let b(k) = k3 - 8k*2 - 36k - 32. What is b(-5)? -177 Let p(m) = m*3 + 21m*2 - 6m - 13. Give p(-21). 113 Let o(v) = v*3 - 5v*2 + 15v - 173. What is o(8)? 139 Let a(y) = y*3 + 19y*2 - 91y + 6. Calculate a(0). 6 Let v(p) = -p*3 + 11p*2 + 40p - 3. Calculate v(13). 179 Let s(o) = -4o + 23. What is s(6)? -1 Let b(t) = -2t*2 - 28t + 1585. Give b(22). 1 Let z(l) = -l*2 + 45l + 1804. Give z(71). -42 Let x(f) = -f*3 + 43f*2 - 444f - 145. Calculate x(25). 5 Let l(q) = 105q + 223. What is l(-3)? -92 Let y(w) = -w2 + 516w + 38411. What is y(-66)? -1 Let k(a) = 220a - 35604. What is k(162)? 36 Let b(m) = 3m - 48. What is b(-3)? -57 Let u(d) = -1022d - 6134. Determine u(-6). -2 Let b(i) = -122i + 3288. Calculate b(27). -6 Let z(x) = -428x - 1904. Determine z(-4). -192 Let m(d) = -4d*3 + 92d*2 + 92d + 83. Determine m(24). -13 Let c(n) = -361n - 3262. Determine c(-9). -13 Let k(d) = d2 + 22d + 16. What is k(-20)? -24 Let r(o) = o*3 - 46o*2 + 36o + 463. Give r(45). 58 Let q(n) = -n*2 + 6n + 109. Determine q(-9). -26 Let s(t) = 2908t + 17443. Give s(-6). -5 Let t(y) = -y2 - 93y - 1467. Calculate t(-20). -7 Let y(q) = -2q2 + 232q - 1498. Determine y(109). 28 Let i(z) = 21z - 100. Determine i(6). 26 Let b(o) = -3o + 212. Calculate b(55). 47 Let j(y) = -y*2 + 42y - 343. Calculate j(8). -71 Let f(s) = -2s2 + 37s + 30. Calculate f(19). 11 Let r(k) = -k*3 + 14k*2 + 7k + 5. Determine r(14). 103 Let o(n) = -n*2 - 221n - 8305. Give o(-48). -1 Let i(j) = 145j + 48. Give i(0). 48 Let h(i) = 31i - 1156. What is h(31)? -195 Let c(p) = -13p - 695. Calculate c(-54). 7 Let n(x) = -130x - 5833. Determine n(-45). 17 Let r(y) = 222y + 404. Determine r(-3). -262 Let m(h) = -11h*2 - 62h - 13. Calculate m(-7). -118 Let h(g) = -g*3 + 19g*2 - 84g - 55. Give h(11). -11 Let d(k) = 16k + 1671. Calculate d(-104). 7 Let b(r) = -2r*2 + 59r + 31. Calculate b(19). 430 Let c(g) = -53g2 + 17g. Calculate c(-3). -528 Let j(u) = -2u2 + 132u - 492. What is j(62)? 4 Let u(g) = -313g + 321. Calculate u(2). -305 Let f(u) = -19u*2 - 512u + 49. Determine f(-27). 22 Let p(o) = -2o3 + 5o*2 - 3o + 17. Determine p(4). -43 Let a(b) = 2236b + 8938. Calculate a(-4). -6 Let y(x) = 3x*2 - 87x + 670. What is y(20)? 130 Let t(r) = -r*3 + 6r*2 - 43r - 2. Give t(6). -260 Let r(u) = 144u + 4251. Calculate r(-29). 75 Let x(c) = c3 + 356c*2 - 307c + 17852. Determine x(-357). 2 Let b(g) = 170g + 143. Give b(-1). -27 Let m(x) = x3 - 45x*2 + 464x - 10. Calculate m(16). -10 Let b(o) = -79o + 1524. What is b(17)? 181 Let g(b) = -543b - 7045. Give g(-13). 14 Let y(f) = 43f - 1075. Determine y(25). 0 Let k(f) = 2f*3 + 19f*2 - 78f - 480. What is k(-11)? 15 Let u(t) = -2t2 + 148t + 302. Give u(76). -2 Let t(v) = v*3 + 24v*2 + 75v + 105. Determine t(-22). -577 Let z(x) = -41x + 1739. Determine z(44). -65 Let l(h) = -2h*3 - 67h*2 - 39h - 326. Calculate l(-33). -128 Let d(g) = -19g + 128. Determine d(4). 52 Let r(t) = -t3 + 52t*2 + 7t - 320. Determine r(52). 44 Let j(a) = a*3 - 22a*2 - 245a - 9. Determine j(-8). 31 Let u(z) = -128z - 1782. Determine u(-14). 10 Let s(v) = v3 + 10v*2 - 28v - 95. Calculate s(-12). -47 Let v(c) = -c*2 - 51c - 616. What is v(-31)? 4 Let g(o) = 4o2 + 4o - 9. Calculate g(-8). 215 Let p(i) = 12i + 71. Calculate p(-12). -73 Let j(l) = -5l*2 - 111l - 440. What is j(-17)? 2 Let x(h) = -1668*h - 14946. Calcul	{ "pile_set_name": "DM Mathematics" }
2. -1439l2 Collect the terms in -74d - 21d - 95d - 43d. -233d Collect the terms in 4u2 - u2 + 74 - 1102. 3u*2 - 1028 Collect the terms in -1493 + 2983 - 1495 - 7y. -7y - 5 Collect the terms in -64 - 9 + 6n*3 - 22n*3. -16n*3 - 73 Collect the terms in 493a*3 + 489a*3 + 495a*3 - 1972a*3 + 501a*3. 6a*3 Collect the terms in 217898 + 2u + u - 3u - 217898 + 11u*3. 11u*3 Collect the terms in -126p - 64p + 159p. -31p Collect the terms in 66k - 13k - 17k + 24 - 15k - 20k. k + 24 Collect the terms in 805p + 1 - 2503p + 805p + 839p. -54p + 1 Collect the terms in 3 + 35334y - 3 - 1029y2 - 35334y. -1029y2 Collect the terms in 31 - 40b*3 - 3b*3 + 23b*3 - 31. -20b*3 Collect the terms in 243 - 174 + 0h*3 + 2h*3 - 69. 2h*3 Collect the terms in -139u - 3u3 + 0u*3 + 939u - 800u. -3u*3 Collect the terms in -27j - 338 + 23j - 33. -4j - 371 Collect the terms in 31 - 31 - 18a3 + 12a*3. -6a*3 Collect the terms in -54y + 1214 + 52y - 1207. -2y + 7 Collect the terms in -98w - 81w + 222w. 43w Collect the terms in -11p - 7p + 18p - 62p*2. -62p*2 Collect the terms in 69 - 6a + 6a - 4a*3 + 2a*3. -2a*3 + 69 Collect the terms in 2516w*2 - 5785w*2 + 3267w*2. -2w*2 Collect the terms in 702b*2 - 767b*2 + 1 - 1. -65b*2 Collect the terms in 89727g + 37 - 37 + 32603g. 122330g Collect the terms in -1 - 1046w + 1 - 340w. -1386w Collect the terms in -18427973 + 18427973 - 8o. -8o Collect the terms in 65 - 58d*2 + 31d*2 - 117d - 59 + 29d2. 2d*2 - 117d + 6 Collect the terms in -250u3 + u2 + 5u*2 + 845u*3. 595u*3 + 6u*2 Collect the terms in -42a*2 + 107a*2 - 47a*2 - 44a*2. -26a*2 Collect the terms in g + 43g*2 - g - 20g*2 - 22g2. g2 Collect the terms in -3s + 6s - 553 + 1073 - 520. 3s Collect the terms in 84n*3 + 0n2 - n2 - 76n3. 8n3 - n2 Collect the terms in -200 - 6c3 - 180 + 111c*3 + 380. 105c*3 Collect the terms in 14n - 4n - 53n + 5n - 55n. -93n Collect the terms in -340o*2 + 1021o*2 - 339o*2 + 4 - 346o*2. -4o*2 + 4 Collect the terms in 112 + 122x*3 - 125x*3 - 225 + 113. -3x*3 Collect the terms in -154b*2 + b - b + 325b*2 - 156b*2. 15b*2 Collect the terms in -7w*2 - 5w*2 - 12w*2 - 7w*2 + 29w*2. -2w*2 Collect the terms in -6b*2 - 1678 + 3353 - 1675. -6b*2 Collect the terms in 1148z*3 - 585z*3 - 591z*3. -28z*3 Collect the terms in b + 11b - 4b + 10b + 13b. 31b Collect the terms in 109b - 161b - 137b. -189b Collect the terms in -164t - 164t - 155t - 156t + 628t. -11t Collect the terms in -49285t2 + 98586t*2 - 49272t*2. 29t*2 Collect the terms in 11548 + 2w - 23105 + 201w3 + 11557 + 280w*3. 481w*3 + 2w Collect the terms in 2275169 + 680d2 - 2275169. 680d*2 Collect the terms in 814o + 2956o + 3126o. 6896o Collect the terms in 510n - 1253n - 121n - 1201n - 1478n. -3543n Collect the terms in 0 - 81066v*2 + 81032v*2 + 0. -34v*2 Collect the terms in 23f*2 + 12f*2 - 18f*2 + 6f*2 + 30f*2 + 2f. 53f2 + 2f Collect the terms in 174g - 86g - 336g3 - 88g. -336g3 Collect the terms in -80 + 38 + 40 - 43n*3. -43n*3 - 2 Collect the terms in -678v + 0v2 + 678v + 0v2 - 126v*3. -126v*3 Collect the terms in 0 + 855i*2 - 2 + 2. 855i*2 Collect the terms in 3 - 87k*2 - 81k*2 + 4 - 12. -168k*2 - 5 Collect the terms in -359c*3 - 382c*3 - 1031c*3. -1772c*3 Collect the terms in -341y + 681y - 234y*3 - 67y*3 - 340y. -301y3 Collect the terms in -45c*2 + 46c*2 - 21c*3 - 21c*3 + 3c*3. -39c3 + c2 Collect the terms in 1931h3 + 1125h*3 - 662h*3. 2394h*3 Collect the terms in 247s*3 + 22 + 14 - 51 + 15. 247s*3 Collect the terms in -3x + 9x3 - 4x + 7x + 0x*3 - 8x3. x3 Collect the terms in -s + 0s - 17s*3 + 83s*3. 66s3 - s Collect the terms in -756 - 730 - t2 + 1486 - t*2. -2t*2 Collect the terms in 26836c + 3669c - 890c + 4898c. 34513c Collect the terms in -5k2 - 46k*2 + 51k*2 - 49k*2 - 13k*2. -62k*2 Collect the terms in 19y - 81y + 18y + 20y + 21y. -3y Collect the terms in 807555g + 1159g2 - 1160g*2 - 807555g. -g*2 Collect the terms in -174r*3 + 83 - 34 - 49. -174r*3 Collect the terms in 12n + 3n + n - 6n + 11n. 21n Collect the terms in -6180 + 19j2 - 6092 + 12272 - j2. 18j*2 Collect the terms in 280s*2 + 2s + 4s + 178s*2 - 6s. 458s2 Collect the terms in -1087w + 2156w - 1045w. 24w Collect the terms in 17f + 6 - 36f + 28 + 14f - 42. -5f - 8 Collect the terms in 98z - 276z + 107z + 37z. -34z Collect the terms in -13v + 0 + 7 + v + 13. -12v + 20 Collect the terms in 57p + 3p*2 - 4p*2 + 33p*2. 32p*2 + 57p Collect the terms in 1203q2 - 1203q*2 + 1176q*3. 1176q*3 Collect the terms in 9696 + 11c*2 - 2c*3 - 18c*2 + 7c*2 - 9696. -2c*3 Collect the terms in -235v + 3061v2 + 93v*2 + 235v. 3154v2 Collect the terms in -118183685 - 3a + 118183685. -3a Collect the terms in -4180s - 21s3 + 4180s. -21s3 Collect the terms in 3096 - 3096 - 1639m*2. -1639m*2 Collect the terms in -67h - 121h - 95h. -283h Collect the terms in -4806042 - 38m*3 + 4806042 + 75m*3 - 38m3. -m3 Collect the terms in -1067 + 3317 - 3g2 - 1127 - 1123. -3g*2 Collect the terms in 41 - 21g*2 + 37 - 122 + 44. -21g*2 Collect the terms in -13 - 63d*3 - 132d*3 + 13 + 1. -195d*3 + 1 Collect the terms in -359w + 280w - 2018w. -2097w Collect the terms in 8m*2 + 28 + 24 - 12m*2. -4m*2 + 52 Collect the terms in 1128y*3 + 1698y*3 - 2836y*3. -10y*3 Collect the terms in 18a2 + a3 - 23a2 + 5a2. a3 Collect the terms in 327m + 405m - 903m + 171m - m3. -m3 Collect the terms in 4 - 3 - 1 + 372o. 372o Collect the terms in -3b - 5b - 9b - 368. -17b - 368 Collect the terms in 15 - 7 + 122t2 - 6. 122t*2 + 2 Collect the terms in -7l - 6l + 27l - 8l - 13l. -7l Collect the terms in 1913m*2 + 2513m*2 - 366m*2. 4060m*2 Collect the terms in 0r*2 - 2r*2 + 3r*2 - 1 + 1901r*3 + 67r. 1901r3 + r2 + 67r - 1 Collect the terms in -63n + 90n - 78n. -51n Collect the terms in 214u - 424u + 225u. 15u Collect the terms in 2d3 + 10 - 11 + 15 + 31d. 2d3 + 31d + 14 Collect the terms in -7k + 7k - 463k3 - 452k*3 + 920k*3. 5k*3 Collect the terms in -549 - 556 + 0o - 2o - 179 + 1284. -2o Collect the terms in -204y - 213y + 631y - 201y. 13y Collect the terms in 5g + 8g + 6g + 2g - 38g. -17g Collect the terms in 9z*2 + 15 + 0z*2 - z + 110 - 17. 9z*2 - z + 108 Collect the terms in -12 + 14941u + 11u3 - 14941u. 11u3 - 12 Collect the terms in 1 - 1 + 1191884k*2 - 1191886k*2. -2k*2 Collect the terms in 150o*2 + 11o + 12o - 27o + 3o - 1. 150o*2 - o - 1 Collect the terms in -176o + 77o + 76o. -23o Collect the terms in 163r - 6r2 + 20r - 182r - r. -6r*2 Collect the terms in -448 - 56 - 5y - 1149 - 758. -5y - 2411 Collect the terms in -593h3 - h2 - 65h3 - 2h - 2875h3. -3533h3 - h2 - 2h Collect the terms in -107 - 102 + 205k + 298 - 89. 205k Collect the terms in -1 + 16710m + 1 - 42m2 - 16707m - 9m2. -51m*2 + 3m Collect the terms in -9k3 + 3963k - 3963k. -9k*3 Collect the terms in 2269k - 4536k + 2308k. 41k Collect the terms in d2 - 10171d - 2d2 + 633d. -d*2 - 9538d Collect the terms in 2855a + 5404a + 289a. 8548a Collect the terms in 4576q + 4585q - 9167q. -6q Collect the terms in -2172v - 1001v - 2082v + 122v. -5133v Collect the terms in 0t - 2153341 + t + 2153341. t Collect the terms in 110s2 + 13s*3 + 11s*3 + 16s*3 - 42s*3. -2s*3 + 110s*2 Collect the terms in -2 + 60369145k + 2 - 60369139k. 6k Collect the terms in 99777r3 - 33258r*3 - 33258r*3 - 33257r*3. 4r*3 Collect the terms in 4u - 2 + 17u + 37u - 11u. 47u - 2 Collect the terms in 4b2 - 2b*2 + 4b2 + b2 + 135568b - 135568b. 7b2 Collect the terms in -76h*3 + 4h + 0h + 2h*2 - 4h*2. -76h*3 - 2h*2 + 4h Col	{ "pile_set_name": "DM Mathematics" }
l*2 Let k(i) = -72i2 + i - 1. Let y(d) = -d2 - d - 1. Determine k(q) + y(q). -73q2 - 2 Let r(s) = 6s*3 + 3s*2 - s - 1. Let u be r(1). Let i(w) = 9w - 5. Let f(j) = 4j - 2. Determine uf(z) - 3i(z). z + 1 Let m(h) = -12h*2 + 3 - 9h*2 - 9h*2 - 6h*3 + 34h*2. Let g(i) = 17i*3 - 11i*2 - 8. Give -4g(l) - 11m(l). -2l3 - 1 Let z(c) = -c2 + 1. Let s(b) = 2b3 - 22b*2 + 5b - 54. Let f be s(11). Let r(v) = 2v3 + 5v*2 + 3v - 5. Calculate fr(d) + 5z(d). 2d3 + 3d Let f(z) = -523z - 9. Let y(q) = 3663q + 66. Give 22f(l) + 3y(l). -517l Let x(v) = v + 1. Let t(g) = -3g - 20. Let p(m) = -m - 21. Let d(n) = -2p(n) + 3t(n). Determine -d(r) - 5x(r). 2r + 13 Let g(j) = 20j - 14. Let q(x) = 13x - 9. Suppose 4i = -o - 21, -2 = o - 3o + 3i. Give og(b) + 8q(b). 4b - 2 Let v(w) = -4w2 - w - 5. Suppose 5h - 18 - 92 = -17h. Let p(y) be the first derivative of -2y*3/3 - 2y + 1. What is hp(b) - 2v(b)? -2b2 + 2b Let w(c) = -5c3 - 2c*2 - 3c + 3. Let k(b) = 20b3 + 7b*2 + 11b - 14. Give -2k(g) - 9w(g). 5g3 + 4g*2 + 5g + 1 Let i(f) = 7f3 + f2 - 1. Let l(s) = 2s*3. What is -2i(n) + 9l(n)? 4n*3 - 2n*2 + 2 Let l(r) = -10r + 16. Let k(g) = 7g - 11. Let d = -306 + 301. What is dl(a) - 7k(a)? a - 3 Let d(z) = 6z*2 + 95z - 1. Let f(q) = 4q2 + 95q - 1. What is -3d(k) + 4f(k)? -2k2 + 95k - 1 Let y(h) = -9h3 + 7h*2 + 7h. Suppose 0 = -42a + 46a. Let p(z) = 8z3 + z2 + 3z*2 + az - 10z2 - 6z. What is -7p(w) - 6y(w)? -2w3 Let p(q) = -113. Let s(t) = t2. Give p(m) - 2s(m). -2m2 - 113 Let a(d) = 7d*3 - 2d*2 + 42d - 5. Let b(m) = 8m3 - 3m*2 + 42m - 6. Determine 7a(n) - 6b(n). n*3 + 4n*2 + 42n + 1 Let m(u) = -13u - 563 - 572 + 1132. Let v(l) = 390l + 91. Give -91m(s) - 3v(s). 13s Let w(m) = -39m*2 + 11m - 12. Let g(u) = -118u2 + 31u - 34. What is -6g(s) + 17w(s)? 45s2 + s Let k(q) = -11q*3 - 5q. Let u be 22/242 - (-54)/11. Let m(z) = -32z3 - 14z. What is um(y) - 14k(y)? -6y3 Suppose -37 = 5h - 42. Let o(j) = j*3 - j + 1. Let d(a) = -6a3 - a2 + 5a - 3. What is hd(b) + 5o(b)? -b3 - b2 + 2 Let z(a) = 2a2 + a - 1. Let y(f) = -f3 - 22f2 - 4f + 4. Determine -y(o) - 4z(o). o3 + 14o*2 Let p(b) = -184b*3 - 3b*2 - 6b - 3. Let w(o) = 88871o3 + 1448o*2 + 2896o + 1448. Calculate 1448p(x) + 3w(x). 181x3 Let p(u) = -78u*3 + 65u + 65. Suppose -54 = -333n + 342n. Let w(r) = 7r3 - 6r - 6. Calculate np(y) - 65w(y). 13y3 Let f(n) = -n. Let y(d) = 11d - 6d - 17d. Let i(s) = -s*2 + 18s + 21. Let k be i(19). Calculate ky(r) - 27f(r). 3r Let v(h) = -h - 1. Let x(a) = 14a + 10. Let z be (-4 + 24)9/18. Determine zv(l) + x(l). 4l Let p = -5 + 4. Let j be 1/((2/10)/p). Let x(d) = 6d. Let k(w) = 3w. Determine jk(v) + 2x(v). -3v Let z(t) = -t*2 - 3t + 4. Let q be z(-5). Let f(l) = -5l + 11. Let u(d) = 2d + 41. Let b(s) = -3s - 69. Let j(v) = 3b(v) + 5u(v). Give qf(w) - 33j(w). -3w Let p(r) = -6r2 + 7r + 4. Let z(v) = -3v2 + 3v + 2. Let h = 49 + -47. What is hp(d) - 5z(d)? 3d2 - d - 2 Let j(d) = -4d*2 - 2. Let c = 18 - 14. Let m(i) = 4i - 27. Let p be m(9). Let l(k) = 2k2 + 1. Give cj(h) + pl(h). 2h*2 + 1 Let d(p) = p - 5. Let v(o) = -2. Let g(n) = -n + 4. Let i be g(4). Suppose i = 4k - 3k + 2. Calculate kd(a) + 5v(a). -2a Let z(d) = 62 - 6d - 6d + 16d - 59. Let s(f) = 1. What is -4s(p) + z(p)? 4p - 1 Let m(w) = -5w*3 + 6w*2 - 4w - 4. Let l(i) = i*2 - i - 1. Let f = -3 + 10. Suppose -2 + f = -g + 3k, 3k - 1 = 5g. Determine gm(r) - 4l(r). -5r3 + 2r*2 Let p(b) = 6b3 - b2 + 3b. Suppose 0 = 91v - 74v - 85. Let n(y) = -11y3 + y2 - 5y. Give vp(c) + 3n(c). -3c*3 - 2c*2 Let t(r) = -2r2 - r + 4. Let f(g) be the second derivative of g4/2 + g*3/2 - 6g*2 - 77g. Calculate 3f(j) + 8t(j). 2j2 + j - 4 Let r(o) = 13o + 2. Let y(c) = c + 2. Let j(v) = -r(v) + 6y(v). Let s(f) = 2. Determine -2j(q) + 10s(q). 14q Let a(c) = 6c + 7. Let k = -2146 - -2141. Let f(n) be the second derivative of 2n + 3n2 + 5/6n*3 + 0. What is kf(q) + 4a(q)? -q - 2 Let g(d) = 3d*2 + 3d - 3. Let y be 10/2 - (5 + -4). Suppose 0 = 3s + 5t - 3t - 1, y = -s - 5t. Let o(k) = k - 1. What is sg(l) - 3o(l)? 3l2 Let i(u) = 20u*2 + 11u + 2. Let t(g) = 31g2 + 17g + 3. Determine 8i(m) - 5t(m). 5m2 + 3m + 1 Suppose 17g - 8g = -45. Let d(c) = c2 - 5. Let v(i) = i2 + i - 4. Let m(w) = 4d(w) - 5v(w). Let b(f) = 3f2 + 18f. Determine gb(z) - 18m(z). 3z2 Let w(q) = 2q*2 - q. Let a(d) = -15d*2. Let k(g) = 8g*2 - g. Let b(p) = 3a(p) + 7k(p). Calculate 6b(i) - 34w(i). -2i*2 - 8i Let y(l) = 2l2 - l + 1. Let x(r) = r3 - 14r*2 - 4r + 4. What is -x(s) + 4y(s)? -s3 + 22s2 Let b(a) = -a2 + 3a - 1. Let w(o) = -o. Let s(k) = b(k) + 3w(k). Let x = 7 - 12. Let t(c) = 4c2 + 5. Give xs(r) - t(r). r*2 Let p(f) = -6f*2 + 9f - 5. Let t(m) = 4m2 + 28m - 7 - 13m2 - 15m. Determine -7p(c) + 5t(c). -3c2 + 2c Let d(y) = -4y. Let o(z) = -4z. Let n be (-2 - -3 - 0)4. Let v(u) = -8u + 85. Let g be v(11). Determine gd(l) + no(l). -4l Let p(c) = 6c + 5. Let q(a) = -a - 1. Suppose 4s = 23 - 7, -33 = 5t - 2s. Suppose -2b - 2b = 4. What is bp(o) + tq(o)? -o Let a(d) = -3d*3 - 2d - 10. Let j(p) = -48p3 - 33p - 159. Calculate 33a(f) - 2j(f). -3f3 - 12 Let w(d) = -d. Let h(c) = -5c + 1. Let g(m) = -m - 3. Let n be g(-2). Give nh(k) + 2w(k). 3k - 1 Let o(f) = f2 + 5f. Suppose -8j + 25 = -3j. Let z(s) = -6s + 9. Let u(k) = 3k - 5. Let p(n) = jz(n) + 9u(n). Determine 3o(m) + 5p(m). 3m2 Suppose -4k - 5t = -43, 2k + 23t = 26t + 49. Let v(l) = -l*2 + 8l + 5. Let m(p) = 3p2 - 23p - 14. Calculate kv(a) + 6m(a). a*2 - 2a + 1 Let y(h) = -h*2 - 4h + 1. Let v(i) = -i - 1. Suppose -4u = -4z + 6 + 10, 4z = 5u + 17. Calculate uy(f) + 3v(f). f2 + f - 4 Let f(w) be the second derivative of w5/5 + w4/4 + w3/2 + 2w2 - 46w. Let q(m) = -3m3 - 2m*2 - 2m - 3. Let i = 14 - 20. What is iq(v) - 4f(v)? 2v3 + 2 Let g = 4 + -3. Let k be -1g/(2/(-10)). Let w(s) = -s*3 - 6s*2 - 4. Let i(q) = 0q*3 + 137q*2 - 12 - 144q2 + 7 - q3. Calculate kw(p) - 4i(p). -p*3 - 2p*2 Let b(r) = -20r*2 - 18r + 18. Suppose 0 = 2j + 2q + 6, 5q - 4 + 3 = 3j. Let d(k) = k*2 + k - 1. Give jb(h) - 36d(h). 4h*2 Let a(b) = -14b*2 - 2b + 47. Let o(j) = -22j2 - 3j + 70. What is 8a(s) - 5o(s)? -2s2 - s + 26 Let p(k) = -337k. Let s(y) = 73124y. What is -1086p(j) - 5s(j)? 362j Let d(j) = j*2 - j. Let p(g) = -40g*2 + 35g. Let w be (-846)/12 - 5/(-10). Calculate wd(q) - 2p(q). 10q2 Let d(p) = -7p*3 + 11p*2. Let w(c) = 2c*3 - 3c*2. Let n(r) = 2 + 7r*3 - 11r*2 + 29r*2 - 17r*2 + 2r. Let z be n(-1). Calculate zd(q) - 22w(q). -2q3 Let p(c) = 3c. Suppose 2r + r - 15 = 0. Let v = 10 - 2. Let f(y) = -2y - 4y + vy. What is rp(k) - 6f(k)? 3k Let c(w) be the first derivative of w3/3 - 215. Let l(k) = -14k*2. Calculate 91c(y) + 6l(y). 7y*2 Let d(m) = -2m3 + m2 + m + 1. Let t(j) = -5j3 + 2j*2 + 4j + 38. Determine -2d(q) + t(q). -q3 + 2q + 36 Let d(u) = 6u - 262. Let v(h) = -17h + 787. Calculate -11d(l) - 4v(l). 2l - 266 Let v(c) = -c2 + c + 3. Let l(s) = 24s*2 - 8s + 11. Give l(w) - 3v(w). 27w*2 - 11w + 2 Let m be (-18)/(-8) + 3/4. Let k be 3/(-2)1/(m/(-2)). Let q(d) = d2 - d - 1. Let o(l) = -6l*2 + 5l + 5. Calculate ko(p) + 5q(p). -p*2 Let m(f) = -8f*3 + 3f*2 + 20f - 3. Let z(i) = -17i3 + 7i*2 + 41i - 7. What is 7m(a) - 3z(a)? -5a3 + 17a Let y(z) = 40z3 + 2z*2 - z - 4. Let i(t) = 121t*3 + 5t*2 - 3t - 11. Calculate 4i(v) - 11y(v). 44v3 - 2v*2 - v Let b(k) = 38k - 9. Let c(x) = -26x + 6. Determine -5b(p) - 7c(p). -8p + 3 Let v(g) = 6g3 - 8g2 + 3. Let z(q) = -q3 + q*2 - 1. Suppose d - 5 = 2f, 12 = -2d + 4d - 5f. Give dv(b) + 4z(b). 2b*3 - 4b*2 - 1 Let g(h) be the third derivative of -119h*5/60 - 49h*4/24 - 13h*2 - 5h. Let p(b) = -12b*	{ "pile_set_name": "DM Mathematics" }
Let y be h(6). What is the second derivative of -2p - 2p*2 - p + 11 + 8p + yp - 4p wrt p? -4 Let k(x) be the first derivative of -646x7/7 + x3/3 - 56x*2 - 1012. Find the third derivative of k(a) wrt a. -77520a*3 Let c(i) be the second derivative of 146i*2 + 0i*5 - 1/10i*6 + 0i*3 + 55i + 2 + 5/4i4. Find the first derivative of c(o) wrt o. -12o*3 + 30o Suppose 86856 = 8l - 25224. Find the second derivative of -11j*2 - lj*3 - 6j*2 + 6j + 14018j3 wrt j. 48j - 34 Let z(k) be the first derivative of 4k3/3 + 13k*2/2 + 20k - 25. Let f(l) = -l*2 - 3. Let q(x) = 2f(x) + z(x). Differentiate q(g) with respect to g. 4g + 13 Suppose 0 = 5y - 4j + 181 - 569, -308 = -4y + 4j. Find the first derivative of y + 35x + 14 + 30x - 4x wrt x. 61 Find the second derivative of -818t2 - 2380t + 2t3 + 818t*2 wrt t. 12t Let u(b) = -23333b + 2561. Let p(n) = -5833n + 619. Let o(d) = 26p(d) - 6u(d). What is the derivative of o(l) wrt l? -11660 Let s(l) be the first derivative of -4l6 + 91l*3/6 - 135l + 133. Let n(k) be the first derivative of s(k). What is the second derivative of n(j) wrt j? -1440j2 Let d(m) be the third derivative of -29m*8/84 - 121m*5/60 - 5m*4/24 - 992m*2. What is the third derivative of d(w) wrt w? -6960w*2 Let d(z) be the second derivative of 83z + 0z3 + 0 - z5 + 0z*2 - 5/3z*4. Find the third derivative of d(b) wrt b. -120 Differentiate -31400 + 61536 + 4037c - 32465 wrt c. 4037 Find the first derivative of 16g + 6085 + 50g*2 + 66g2 - g3 + 47g2 - 256g*2 - 2095 wrt g. -3g*2 - 186g + 16 What is the second derivative of -6495h - 6965h + 11880h - 3448h*2 wrt h? -6896 Let a(h) = -2378h*2 + 1373h + 18. Let j(k) = -140301k2 + 81005k + 1071. Let f(g) = -119a(g) + 2j(g). Find the second derivative of f(t) wrt t. 4760 Let y(k) be the second derivative of -k + 163k3 - 22k*2 - 2k*4 - 163k*3 + 4k. Differentiate y(q) with respect to q. -48q Let t be (-21 - -1)/(93/(-5580)). What is the third derivative of -1193a*3 + 37a*2 + 20a*4 + 8a*2 - 1 + ta*3 wrt a? 480a + 42 Let y(w) = -229w2 - 4066w - 20. Let v(c) = 457c2 + 8131c + 45. Let j(x) = 4v(x) + 9y(x). What is the second derivative of j(t) wrt t? -466 Find the third derivative of -2h - 7538h*5 + 58h*2 + 7537h*5 + 408h*3 - 382h*2 wrt h. -60h*2 + 2448 Let l be 24/(-20)(-20)/6. Let x be 1/4 - 11/(-4). What is the second derivative of 9k - 5k*3 - lk*3 + 2k*3 - 8k*x wrt k? -90k Let r(k) be the second derivative of -1997k4/6 + k3/3 + 47k*2/2 - 1966k - 1. What is the second derivative of r(g) wrt g? -7988 Let l(f) be the second derivative of 21 + 0f2 - 3f - 15/4f5 - 1/3f*3 - 1/3f*4. What is the third derivative of l(h) wrt h? -450 Suppose 4q - a - 11 = 0, -q + 2 = 3q + 2a. Find the first derivative of -47c2 - 40 + 16c*q + 22c*2 + 11c*2 + 163 - 47c wrt c. 4c - 47 Find the second derivative of -63k*3 + 7k*2 - 5k*2 - 2k*2 - 6074k*3 - 4093k wrt k. -36822k Let k(l) be the third derivative of -5162l7/105 + l5/60 - l*4/12 + 1213l*3/6 + 55l*2 + 41. Find the third derivative of k(a) wrt a. -247776a Suppose 4w + 1712 = 20w. What is the derivative of w + 2021r3 - 1898r*3 - 4 wrt r? 369r*2 Let f(w) = -2w*2 + 2w - 1. Let g(z) = 167z2 - 312z + 6. Let t(y) = -6f(y) - g(y). Find the second derivative of t(a) wrt a. -310 Let m(r) be the first derivative of 4459r*3/3 - 4951r*2 - 6708. What is the second derivative of m(s) wrt s? 8918 Let z(i) = 21 - 115i - 8 + 118i. Let m be z(-3). Find the third derivative of -11d*2 - 3d*4 + 3d*m + 2d*2 - 18d*6 wrt d. -2160d3 Let k(p) be the second derivative of -p7/42 - 981p5/5 - p4/12 + 3347p*3/3 - 38p + 6. Find the second derivative of k(v) wrt v. -20v3 - 23544v - 2 What is the third derivative of -10r2 + 3926r*4 - 121r - 9r2 + 119r - 1117r4 - 48 + r2 wrt r? 67416r Let h(y) = 3y + 2. Let a(r) = -136r + 117. Let q = 282 - 283. Let o(i) = qa(i) + 6h(i). What is the first derivative of o(l) wrt l? 154 Let l(h) be the third derivative of -13h5/60 - 485h*4/24 + 3h*2 - 14h. Find the second derivative of l(j) wrt j. -26 What is the first derivative of -1132 + 5851p3 - 2925p*3 - 2925p*3 + 116p*2 wrt p? 3p*2 + 232p Suppose 2r + 5r = -14. Let x be (-1)/r86/24. Find the first derivative of -x - 5 + 5 - 3 + 4d wrt d. 4 Let g(f) = 17f*3 - 4f*2 + 30f - 951. Let y(b) = 17b3 - 3b*2 + 30b - 951. Let r(s) = -3g(s) + 4y(s). What is the first derivative of r(m) wrt m? 51m2 + 30 Let l(h) = 2h*3 + 3820h*2 - 4h - 7704. Let y(d) = -6d3 - 7639d*2 + 10d + 15406. Let v(j) = -5l(j) - 2y(j). Find the first derivative of v(f) wrt f. 6f2 - 7644f Let w(g) be the second derivative of 3199g3/6 - 1095g*2 + 1738g. Differentiate w(i) wrt i. 3199 Let t(r) be the second derivative of 255r7/7 + 35r*4/3 + r + 29. What is the third derivative of t(w) wrt w? 91800w*2 Let o be (0 + -3 + 7)(2 - -2). Suppose -18l + 10l = -o. What is the derivative of 35 + f*l + 34f3 - 3 - f2 wrt f? 102f2 Let o = 23963 - 23963. Let p(g) be the third derivative of 3/2g*4 + 0 + 36g*2 + 17/3g*3 + og. Differentiate p(k) with respect to k. 36 Let u(c) be the second derivative of -1/6c4 + 0c*5 - 21 + 0c*6 - 1/14c*7 + 2c - 1/6c3 - 7c*2. Find the second derivative of u(d) wrt d. -60d*3 - 4 Let m(g) = 2g*2 - 7g - 31. Let y be m(-7). Differentiate -121z3 - 97 - 22z*3 + y with respect to z. -429z*2 Let o(n) = 345n*2 - 873n + 2. Let m(z) = 685z2 - 1746z + 5. Let t(b) = -4m(b) + 10o(b). What is the second derivative of t(a) wrt a? 1420 Let q(r) = r*3 + 2r*2. Let l(v) = 6v*3 + 16v*2 + 1587v - 5468. Let o(a) = l(a) - 8q(a). What is the derivative of o(h) wrt h? -6h*2 + 1587 Let i be (-2 - (11 + -1)) + 34 + -18. Let g(s) be the first derivative of -10 + 0s + 19/4si + 5s*3 + 0s*2. Find the third derivative of g(t) wrt t. 114 Let z be (-16)/(-56) - 508/14. Let k = -19 - z. What is the third derivative of 9s*2 - 10 - 1 + 11 + ks*3 wrt s? 102 Suppose 3t - 227 = f, -5t + 2f = -3f - 395. Suppose t = 3z - 5u, 79 = 4z - 3u - 16. What is the first derivative of z - 4 + 7 + 11n*4 + 6n*4 wrt n? 68n*3 Let i(s) be the first derivative of 0s*2 - 115/3s*3 - 136 - 13s*5 + 0s + 0s4. Find the third derivative of i(m) wrt m. -1560m Let b(i) be the third derivative of -97i5/30 + 351i*4 - 652i*2 + 4. What is the second derivative of b(s) wrt s? -388 What is the second derivative of -2x*2 + 2x*2 + 37327x*3 + 2097x - 36226x3 wrt x? 6606x Let w(h) = -3070h3 - 2h*2 - 3166. Let j(t) = -6134t*3 - 5t*2 - t - 6333. Let b(q) = 2j(q) - 5w(q). What is the derivative of b(y) wrt y? 9246y*2 - 2 Find the third derivative of -1394 + 5732c*5 + 1392 - 508c*2 + 5c*3 - 249c*2 - 5c*3 wrt c. 343920c*2 Suppose -4j = -v - 169, 5v + 189 = 4j - 0j. Let s = 44 - j. Differentiate 6y*s + 405y - 405y - 12 with respect to y. 18y*2 Suppose -5s + 7 = -2j, -6j + 2j = -3s - 7. Let m(n) = 4n - 482. Let u be m(121). Find the third derivative of -2g*u + 56g*4 - 11g*2 - 21g*j wrt g. 840g Let t(b) be the second derivative of 1333b7/21 + 1427b*3/6 + 442b + 1. What is the second derivative of t(w) wrt w? 53320w3 Find the third derivative of 4c + 2460c2 - 2939c*5 + 39c + 36c - 79c wrt c. -176340c2 Suppose 0 = -1666l + 1484l. Let q(j) be the first derivative of 0j*4 + 0j*3 + 24/5j*5 - 26j - 16 + lj2. Differentiate q(k) with respect to k. 96k*3 Let x(i) = 38i + 85. Let s(c) = -1. Suppose 3b + 7 = -2p, 5b + 2p + 3 = -6. Let t(h) = bx(h) + s(h). Differentiate t(f) with respect to f. -38 Find the third derivative of -519v*5 - 6v*2 - 533 - 642v*5 + 7v*2 - 192 - 12 wrt v. -69660v*2 What is the second derivative of -30y*5 + 239y*4 - 9321y*2 + 4881y + 9321y2 + 36y*5 wrt y? 120y*3 + 2868y*2 Let w(z) be the first derivative of -5476z*5/5 + 5198z*3/3 - 5116. Find the third derivative of w(j) wrt j. -131424j Let z(f) = -f*3 - 6f**2	{ "pile_set_name": "DM Mathematics" }
) = 3t2 + 602t. What is 2d(k) + 9h(k)? 3k2 + 610k Let w(u) = -3u + 62 + u3 + 2u - 65. Let m(q) = -1. Let o(g) = 4m(g) - w(g). Let h(z) = 14z*3 - 21z + 21. What is -h(j) - 21o(j)? 7j*3 Let i(y) = 7y + 3. Suppose -1 = -4h + h - x, 15 = 3h + 3x. Let u(n) = -6n - 3. Determine hi(s) - 3u(s). 4s + 3 Let j(h) = -5h*2 - 4h. Let m(p) be the first derivative of 0p + 1/2p*2 - 23. Suppose -4q + 16 = -2c - c, 3 = -q - c. Calculate qj(x) + 3m(x). -5x*2 - x Let m(h) = 3h3 + h2 + 6h - 2. Let l(o) = -6o*3 - 2o*2 - 13o + 4. Let j = 123 + -74. Let v be 630/j - 6/(-42). Calculate vm(d) + 6l(d). 3d3 + d2 - 2 Let w(n) = 4n*3 + 397n*2 + 8n + 6. Let g(t) = 3t3 + 397t*2 + 7t + 5. Give 6g(j) - 5w(j). -2j3 + 397j*2 + 2j Let h = 120 + -76. Let c = 1109 - 1146. Let i = h + c. Let d(v) = 6v3 + 7v + 10. Let o(l) = 2l3 + 2l + 3. What is io(g) - 2d(g)? 2g3 + 1 Let h(z) = 20z + 2. Let k(a) = -115a + 193. Give -5h(j) - k(j). 15j - 203 Let l(t) = -2t - 26t + 9 + 27t - t + 1. Let p(i) = 1. What is l(g) + 2p(g)? -2g + 12 Let x(r) = 40r2 + 28r + 544. Let m(j) = -27j2 - 18j - 363. Give 11m(v) + 7x(v). -17v2 - 2v - 185 Let o(m) = 8m2 + m + 2. Let c be (-8)/(-5 - -1) + 0. Let n(g) = -17g*2 - 2g - 4. Determine cn(s) + 5o(s). 6s2 + s + 2 Let t(a) = -a. Let q(r) = r2 - r + 1. Let k be (-2 - -2)/(-1) - -1. Let b be (112/(-42))/(-3 - (-66)/18). Calculate bt(m) + kq(m). m2 + 3m + 1 Let v(l) = 5l2 + 15l - 15. Let p(n) be the first derivative of n*3/3 + 3n*2/2 - 3n + 3400. What is -11p(t) + 2v(t)? -t*2 - 3t + 3 Let w(i) = -i. Let c(x) be the third derivative of -17x4/4 + 692x*2. What is -c(s) + 68w(s)? 34s Let o(m) = 3m*2 - 4m + 2. Let p(k) = 4k2 - 4k + 2. Let h be (466/5)/(2/(-10)). Let b = h + 468. Determine bp(t) - 3o(t). -t*2 + 4t - 2 Let q(g) = -3g2 - 5g - 1. Let l(j) = -19j2 - 571j - 4. Calculate l(r) - 4q(r). -7r*2 - 551r Let h(y) = -y*2 + 127y + 157. Let x(b) = 21b + 24. Give -2h(t) + 13x(t). 2t*2 + 19t - 2 Let c(m) = 2. Let h(g) = -3g - 3. Let j = -4076 - -4078. Determine jc(t) + 2h(t). -6t - 2 Let j(t) = -13389t - 6. Let p(f) = 13391f + 9. Determine -3j(r) - 2p(r). 13385r Let q(n) = -4n - n - 2 - 3n. Let v(p) = -9p - 2. Let j be (-25 - -8) + -21 + 35. Give jv(r) + 4q(r). -5r - 2 Let v(c) = 8c - 10. Suppose 4n + 11 = 5l, 3l + 1019 = -3n + 1058. Let u(k) = -k + 1. Determine nu(s) + v(s). 2s - 4 Let l(w) = 3w2 + 12w - 6. Let h(i) = -10i2 - 40i + 18. What is 5h(j) + 16l(j)? -2j2 - 8j - 6 Let t(f) = 2. Let y(k) = 7k - 120. Calculate 7t(o) + y(o). 7o - 106 Let l(j) = -6j*3 + 5j*2 + 2j + 4. Let p(n) = 6n3 + n2 - 19n - 11. Let q(m) = -m3 - m2 + 6m + 3. Let r(d) = -p(d) - 3q(d). Give 2l(a) - 5r(a). 3a3 - a - 2 Let w(c) = -c + 2. Suppose -3 = 3z, -11 + 4 = -2u - z. Let x(k) = 19k - 10. Let b(f) = -41f + 21. Let s(q) = 6b(q) + 13x(q). What is us(g) + 7w(g)? -3g - 2 Let l(s) = -26s. Let z(q) = -51q - 116. What is 2l(d) - z(d)? -d + 116 Let h(u) = u2 - 305u - 1239. Let b be h(-4). Let c(x) = 51x3 + 8x*2 + 8x - 8. Let l(m) = 17m3 + 3m*2 + 3m - 3. Give bc(z) + 8l(z). -17z3 Let k(c) be the third derivative of c4/6 - 4c*3/3 + 157c*2 - 2c + 1. Let a(j) = 3j - 5. Give 7a(w) - 5k(w). w + 5 Let u(r) = -2r + 14811. Let w(t) = 8t - 59213. Determine -9u(s) - 2w(s). 2s - 14873 Let g(b) = 2b2 + b + 12. Let f be ((-3)/((-15)/1))/((-9)/(-45)). Let s(t) = -t2 - 1. Give fg(d) + 4s(d). -2d*2 + d + 8 Let w(q) = 12q*2 + 49q + 16. Let o be w(-21). Let g(n) = -4285n + 4 - 9 + on. Let p(k) = -k - 1. What is g(d) - 4p(d)? -2d - 1 Let z(v) = -v2 - 1. Let y(f) = f3 - f*2 - 1. Let q = 51 - 52. Let l be -40 + 40 - (-3 - (0 + q)). Calculate lz(n) - 2y(n). -2n3 Let a(y) = 4 + 0 - 3 - y3 - y. Let z be 5 + (-7 - -5) + -1. Let k(r) = -70 - 78 + 150 - 2r + rz - 5r*3. Determine -2a(j) + k(j). -3j3 + j2 Let n(o) be the second derivative of o5/4 - 7o*4/12 + 7o*3/6 - 1995o. Let t(g) = -g3 + g2 - g. Calculate 2n(d) + 14t(d). -4d3 Let d(i) = 4. Let w(k) = -34k + 88. Calculate 132d(y) - 6w(y). 204y Let n(m) = -m3 - 2m*2 - m - 1. Let z(d) = 2d*3 - 336d*2 + 5d + 5. What is -5n(c) - z(c)? 3c*3 + 346c*2 Let t(c) = -3275c*3 - 57c*2 - 3c + 1. Let m(b) = 3275b3 + 76b*2 + 4b - 2. Calculate -3m(a) - 4t(a). 3275a3 + 2 Let w(f) = 17f - 16. Let n(b) = 20b - 19. Give 3n(h) - 2w(h). 26h - 25 Let b = 151 - 157. Let u(a) = -a - 1. Let m be u(b). Let v(x) = -2x. Let q(s) = -3s + 1. Determine mv(f) - 3q(f). -f - 3 Let v(q) = 2q3 - 3q2. Let s = 10 - 11. Let n be 3 + s/(2/8). Let m = 376 + -379. Let t(p) = p2. Determine mt(c) + nv(c). -2c3 Let l(f) = -6f*2 + 3f - 14. Let d(s) = -4s2 + 11s + 17. Let k(u) = -10u2 + 26u + 38. Let j(z) = 7d(z) - 3k(z). Give -17j(b) - 6l(b). 2b2 - b - 1 Let q(c) = -c2. Let x be (-4512)/768 + (-2)/16. Let i(r) = 23r*2. What is xq(n) + i(n)? 29n2 Let l(p) = p - 9. Let f(d) = -9965d - 54. Calculate f(s) - 6l(s). -9971s Let d(u) = -5u2 - 4u + 146. Let j(i) = 3i2 + 3i - 146. Give 2d(c) + 3j(c). -c*2 + c - 146 Let b(f) = 41f + 38. Let n(p) = -4p + 9. What is -2b(v) - 18n(v)? -10v - 238 Let b(y) = -1. Let c(g) be the third derivative of 11g4/24 + 2g*3/3 - 16502g*2 - 1. Let n = 1 + -5. What is nb(a) - c(a)? -11a Let l(x) = -323x*2 + 4x + 1. Let t(p) = -970p2 + 14p + 4. Calculate 7l(k) - 2t(k). -321k2 - 1 Let y(m) = 13m*3 - 9m*2 - 7m + 1. Let j be ((-7)/((-28)/(-16)) - 18/(-6)) + 3. Let c(d) = -4d3 + 3d*2 + 2d. Determine jy(r) + 7c(r). -2r3 + 3r*2 + 2 Let w(j) = -63j + 59. Let f(r) = 55r - 59. What is 6f(v) + 5w(v)? 15v - 59 Let u(w) = 5w3 - w + 1. Let s(i) = -133i*3 + 2. Calculate s(x) - 2u(x). -143x3 + 2x Let o = -43090 + 43094. Suppose n - 5d = -7, -4n = 2d - 10 - 6. Let i = -2 + n. Let r(a) = -a - 1. Let y(l) = 8l + 5. Calculate iy(z) + or(z). 4z + 1 Let i(h) = -h2 + 43h - 53. Let l(g) = g*2 - 72g + 106. Determine -5i(a) - 3l(a). 2a2 + a - 53 Let g(q) = -8q*3 - 5q + 5. Let u(v) = 12v3 + 8v - 8. Let t be 2 + (-3 - -6) + -2. Suppose -8 = -tb + 2b. Let a = 1334 - 1329. Give au(j) + bg(j). -4j3 Let v(z) = -z - 2. Let c(d) = d + 2. Let n(w) = -5c(w) - 4v(w). Suppose -19k + o = -17k + 2, 13 = k - 4o. Let a(i) = -1. Determine ka(x) + 2n(x). -2x - 1 Let x(y) = -5y - 1. Let r(b) be the second derivative of -11b3/6 - b2/2 + b. Suppose -106d + 72 + 533 = -31. What is dr(u) - 13x(u)? -u + 7 Let s(d) = -2d2 - 7d. Let o(u) = u*2 + 9u - 1. Determine 4o(y) + 5s(y). -6y2 + y - 4 Let a(w) = -4w + 11. Suppose 131c - 286 = -155c. Suppose -5b - 3p = -0p - 30, 11 = -3b + 4p. Let h(q) = q. What is bh(v) + ca(v)? -v + 11 Let n(h) = 21h*3 + 2h - 7. Let x(v) = -v*3 + 5v + 12v3 + 52 - 4v - 55. Determine -3n(k) + 7x(k). 14k3 + k Let f(r) = 2r*2 - 3r. Let m(b) = -9b2 + 13b. Let u = -619 + 608. Let h be (-3 - -3) + -2 - (u - -15). What is hm(d) - 26f(d)? 2d2 Let q(k) = -6k*2 + 2k*2 - k - 3 + 10k2 + 1. Let j(b) = -b3 + 31b2 - 6b - 11. Calculate 2j(c) - 11q(c). -2c3 - 4c2 - c Let y(q) = -q + 1. Let k(o) be the third derivative of o5/60 - o4/8 + o3/2 + 6493o2. Give k(b) - 2y(b). b*2 - b + 1 Let s(u) = -59830u - 1209. Let n(i) = -893i - 18. Give 403n(x) - 6s(x). -899x Let w(l) = l + 4. Let q(n) be the first derivative of -8n + 4n + 2n + 10n - 30 + n*2. What is -4q(f) + 9w(f)? f + 4 Let b(f) = -39f - 35. Let s(x) = -28x - 34. What is -6b(q) + 5s(q)? 94q + 40 Let i(x) = -13x + 4. Let l(r) = 30r - 5. What is -7i(a) - 3l(a)? a - 13 Let a(s) = 21 + 11s + 12s - 30s + 11s. Let b(x) = 3x + 14. Calculate -5a(p) + 7b(p). p - 7 Let v(r) = -2326r*3 - 17r - 11. Let z(f) = 465f3 + 3f + 2. What is 4v(b) + 22z(b)? 926b3 - 2b Suppose -1425 = -f - 4f. Let l = 286 - f. Let w(r) = r3 - r2 + r. Let g(c) = 5c*3 - 2c*2 + 2c + 2. Calculate lg(s) - 2w(s). 3s3 + 2 Let u(i) = -9i + 4. Let m(z) = -2*z + 5. Determine	{ "pile_set_name": "DM Mathematics" }
3584461 wrt d? 61452336d2 Differentiate -400767a*2 - 6a + 502957122. -801534a - 6 What is the second derivative of 429164173f*5 + 8168492f? 8583283460f3 Find the second derivative of 4953k*3l + 4623k2l - k*2 - 13kl + 23292423k wrt k. 29718kl + 9246l - 2 Find the first derivative of 79921883i + 34158786. 79921883 Differentiate 839533767f3 + 66106675 wrt f. 2518601301f*2 What is the second derivative of -4w*3 + 1067624w*2 + 5513w + 507 wrt w? -24w + 2135248 Find the first derivative of 24g*2v + 461430gv*3 - 2v*3 - 14850566v + 2 wrt g. 48gv + 461430v3 What is the first derivative of 3ku3 + 3806145ku + 6496762k wrt u? 9ku*2 + 3806145k What is the third derivative of -119o5x*3 - 32876o*5 + 3o*2x*3 + 12o*2x + 3374o2 wrt o? -7140o*2x*3 - 1972560o*2 What is the second derivative of 239304029i*4 - 106411111i - 3 wrt i? 2871648348i2 What is the first derivative of 89500w*3 - 3w*2 + 4276571? 268500w*2 - 6w Find the second derivative of 34717430t4 - 5t - 1163313. 416609160t2 What is the third derivative of -18255102j*3 - 14j*2 - 98j - 109 wrt j? -109530612 What is the second derivative of -25261500u3 + 6u - 180116? -151569000u Find the third derivative of -81726524u*3v*2 + 1742106u*2v*2 + u wrt u. -490359144v*2 Find the third derivative of 729gq5 - 689gq2 - 87gq + g - 46754q*5 - 2q*2 - 1 wrt q. 43740gq2 - 2805240q*2 What is the second derivative of 106181719b*2 + 3b + 24434236 wrt b? 212363438 Find the third derivative of 175go*3 + 2go2 - 1168g + 4375o3 - 22o*2 + 61o + 1 wrt o. 1050g + 26250 Differentiate 723281151z + 660487878. 723281151 What is the second derivative of -7v4 + 8v*3 + 1647v*2 - 224v - 20838? -84v2 + 48v + 3294 Find the second derivative of -18760917q2 - 1857156q wrt q. -37521834 What is the derivative of 839ku*2 + 6503042k - 4324u3 wrt u? 1678ku - 12972u*2 Differentiate -47181fy + 208f + 192493805y wrt f. -47181y + 208 What is the derivative of 623694399ak + 114505328a wrt k? 623694399a What is the third derivative of -3b4g - 3087b4 + 34535b*3g - b*2g + 234130447b2 + bg - 1 wrt b? -72bg - 74088b + 207210g Find the first derivative of -22941110s4 - 31295006 wrt s. -91764440s*3 Find the first derivative of 30788646q + 461620472. 30788646 What is the third derivative of -13k6 + 9218344k*4 + 224781786k*2? -1560k*3 + 221240256k What is the first derivative of 64c2 - 792930c + 22375758 wrt c? 128c - 792930 Differentiate 399g*2 + 75307g + 73556635. 798g + 75307 Find the first derivative of -2a*4 + 129188331a*2 - 153136304. -8a*3 + 258376662a Find the second derivative of -2k3 - 5814978k*2 - 331048k + 10 wrt k. -12k - 11629956 What is the second derivative of 91398l5 - l3 + 204l2 - 81484652l wrt l? 1827960l3 - 6l + 408 What is the second derivative of 8252800l3 - 226380l - 32? 49516800l What is the third derivative of -3185604g*3 - 2g*2 - 14478419g wrt g? -19113624 What is the third derivative of 912351325m5 - 87328167m*2 wrt m? 54741079500m*2 What is the second derivative of -3834349k*2y*2 + 13k*2y - k*2 - 9ky2 - 2ky - 1177337k + 2y2 - y + 1 wrt k? -7668698y*2 + 26y - 2 Find the second derivative of -146c4 - 881c*3 - 2c*2 + c + 23861862 wrt c. -1752c*2 - 5286c - 4 What is the third derivative of 389g4t*2 + 129g*4 + 789g*3 - 2g*2t*2 + 8967788g*2t - 6gt*2 - 2gt wrt g? 9336gt2 + 3096g + 4734 Find the first derivative of 30398r3w*2 - 94145r*3 - 251r*2w*3 - 1544r wrt w. 60796r3w - 753r2w*2 What is the derivative of 3r*2v - 5991701r2 + rv + 2883969v + 13 wrt r? 6rv - 11983402r + v What is the second derivative of 9p4 - 463p*3 - 18p*2 + 6343307p wrt p? 108p2 - 2778p - 36 What is the third derivative of -5773808qt*3uy + 5qt2uy - qt*2u + 41qy + 39tuy - 16ty wrt t? -34642848quy What is the first derivative of -524556514l4 + 192736622 wrt l? -2098226056l*3 What is the third derivative of 21419604c*4 + 17c*2 + 183c + 345 wrt c? 514070496c What is the first derivative of 140492055l*2 - 98666664? 280984110l Differentiate dr2 + 6dr + 111874d + 2979r2 + r - 114 wrt r. 2dr + 6d + 5958r + 1 What is the third derivative of 25136248n*3x*3 + 106031509n*2x - x*3 wrt n? 150817488x*3 What is the third derivative of -3gv5 - 5268276gv3 - 4gv2 + 5gv - 5g - v*2 + 13v - 2 wrt v? -180gv*2 - 31609656g Find the third derivative of -38815032lz*3 - lz*2 - 2lz - 63798l - 6z2 wrt z. -232890192l What is the second derivative of -1513u4 - 848u*3 + 31198066u wrt u? -18156u2 - 5088u Differentiate -1559g2 - 13889g - 37683860 wrt g. -3118g - 13889 What is the derivative of 1705706i*2p - 2i2 - 2ip + 81084i - p - 7 wrt p? 1705706i2 - 2i - 1 What is the second derivative of 13766579b2 - 6281779b? 27533158 Differentiate -2b2j - 1143b2 - 281b - 3050962j + 6 with respect to j. -2b2 - 3050962 What is the second derivative of n4 + 6n3 + 4440n*2 - 3921354n? 12n2 + 36n + 8880 Find the second derivative of -31428375f4 + 2f - 12446439. -377140500f2 What is the derivative of -32920c*2 + 9275c - 702793953 wrt c? -65840c + 9275 What is the second derivative of 10201738f*2 + 1264612f wrt f? 20403476 Find the first derivative of 4171448j3 + 4622996 wrt j. 12514344j*2 What is the second derivative of 5501r*3 + 1075r*2 + 768263r + 1? 33006r + 2150 Find the second derivative of -2942i*2p - 484i2 - 380ip + 15i + 129p wrt i. -5884p - 968 What is the first derivative of -25601823x2 + 46863330? -51203646x What is the first derivative of 3121336f + 5347314 wrt f? 3121336 Find the second derivative of -68fj3 - 1151fj2 + 2fj + 6f + 15j3 - 2j - 14050 wrt j. -408fj - 2302f + 90j Find the second derivative of -230o3t*2 - 538o*3 + 91147o*2t*2 + 40143o*2t + ot2 wrt t. -460o*3 + 182294o*2 + 2o Find the third derivative of 4326336x5 - 1882674x*2 wrt x. 259580160x*2 Find the first derivative of -37291416c*4 - 24803293 wrt c. -149165664c*3 What is the third derivative of 8169d*3t*2 + 150d*3t + 3d3 + 4d*2t*2 + 9d*2t - 1020d2 - 21dt wrt d? 49014t*2 + 900t + 18 Find the second derivative of 25866h2s*3 + 94484h*2s + 1281hs*4 - 538hs wrt s. 155196h*2s + 15372hs*2 Find the third derivative of -5p*3x*2 - 5p*3x - 778645p3 - 6p*2x*2 + 2p*2x - 150463x wrt p. -30x*2 - 30x - 4671870 What is the second derivative of -140270283k2 - 231980259k wrt k? -280540566 Find the third derivative of 10066635l5r - 2l4r - 4711l2 + 10210lr wrt l. 603998100l*2r - 48lr What is the second derivative of 5w3z*2 + 2w*2z + 2141490w2 + 87344wz2 - 19wz wrt w? 30wz2 + 4z + 4282980 What is the second derivative of -3qv*3 + 55qv - 11989q - 6v3 - 442514v*2 wrt v? -18qv - 36v - 885028 What is the third derivative of -1189aq*2t*3 - 2743aqt*3 + aqt2 + aq - 2at + 4q2 - 10494q + 23 wrt t? -7134aq*2 - 16458aq What is the third derivative of -4p*5 - 677847p*4 + 28p*3 - 4p*2 + 99335711? -240p*2 - 16268328p + 168 Find the third derivative of -9381490x4 + 7304632x*2. -225155760x Find the third derivative of -58hjp2 + 4hj + 810272hp3 + hp*2 + 233hp + jp*5 + jp*3 - 2jp2 wrt p. 4861632h + 60jp*2 + 6j Find the second derivative of -178twy2 + 2415238twy + 2ty + 67wy*2 - 64y*3 wrt y. -356tw + 134w - 384y Find the second derivative of 478742294g*5 - 314g - 238796. 9574845880g3 What is the second derivative of 270262009g*3 + 3g - 8706837 wrt g? 1621572054g What is the third derivative of 85046543o*6 + 111o*2 + 1254o + 20? 10205585160o3 What is the first derivative of -3469k*2 + 133k + 3371832? -6938k + 133 Find the second derivative of -407938d*2g*3 - 8d*2u*2 + 3dg3u + 213434g2u*2 wrt d. -815876g**3 - 1	{ "pile_set_name": "DM Mathematics" }
t - 2 Let t(q) = -q + 364. Let k(s) = -s + 362. Determine 3k(d) - 2t(d). -d + 358 Let w(s) be the third derivative of -3s5/20 - s4/8 - 5s3/6 - 2s*2 + 56s + 6. Let v(f) = -4f2 - f - 3. Calculate 5v(p) - 2w(p). -2p*2 + p - 5 Suppose 2p + 15f + 10 = 10f, 7f = -5p - 3. Let j(x) = 4x3 + 13x + 2. Let c(s) = -9s3 - s2 - 25s - 5. Determine pj(u) + 2c(u). 2u3 - 2u*2 + 15u Let i(d) = 3d2 + d - 3. Let a(j) be the first derivative of 2j3/3 + j2/2 - 4j + 853. Calculate -3a(w) + 4i(w). 6w2 + w Let z(r) = -r2 + r - 2. Let g(h) be the third derivative of -h6/120 - h5/20 + h*4/12 - 2h*3/3 - 4960h*2. Give 2g(f) - 5z(f). -2f3 - f2 - f + 2 Suppose 56b - 60b + 44 = 0. Let h(u) = -3 + b - 7. Let f(i) = -3i - 6. Let y(w) = -5w - 9. Let x(d) = -8f(d) + 5y(d). What is 4h(l) - x(l)? l + 1 Let j(m) = 18m*2 + 2. Let l(r) = 7r*2 + 13r - 19. Let i(p) = -13p2 - 24p + 35. Let g(u) = 6i(u) + 11l(u). Calculate -2g(t) + j(t). 20t*2 + 2t Let n(g) = g - 1975. Let u(m) = m - 1989. What is -5n(s) + 6u(s)? s - 2059 Let t(r) = 3362r3 + 19r + 4. Let f(v) = -5044v3 - 26v - 6. Calculate -5f(i) - 7t(i). 1686i3 - 3i + 2 Let x(z) be the first derivative of -55z3 + 12z*2 - 3502. Let j(k) = -33k*2 + 5k. Calculate -24j(q) + 5x(q). -33q2 Suppose -28t = -t + 6t - 726. Let p(u) = 3u*3 + 11. Let h(d) = -14. Let b(m) = 5. Let k(r) = 17b(r) + 6h(r). Give tk(i) - 2p(i). -6i*3 Let u(l) = 40l - 129l + 1 - 3l*2 - 6l*2 + 41l + 39l. Suppose 2o + 24 = -2o. Let y(g) = -8g*2 - 5g + 3g - 1 - 6g + 2. What is ou(t) + 7y(t)? -2t2 - 2t + 1 Let b(s) = -s*2 + 5217s + 3. Let z(k) = -1747k - 1. What is -2b(y) - 7z(y)? 2y*2 + 1795y + 1 Let r(v) = -504v - 430. Let t(s) = 101s + 93. Calculate -3r(c) - 14t(c). 98c - 12 Let a(o) = 7o*3 - 14o*2 + 3o - 4. Let z(r) = -r3 + r2 - r + 1. Suppose -11h + 91991 = 92035. What is hz(f) - a(f)? -3f3 + 10f*2 + f Let m(a) = 110a*3 - 6a*2 + 7a - 8. Let t(p) = 330p3 - 17p*2 + 19p - 22. Give 8m(v) - 3t(v). -110v3 + 3v*2 - v + 2 Let o(x) = -1044x*2 + 3x - 6. Let s(q) = 3133q2 - 11q + 19. Give 13o(h) + 4s(h). -1040h2 - 5h - 2 Let b(m) = 4483m - 68. Let q(p) = -44832p + 714. Determine -21b(r) - 2q(r). -4479r Let o(a) = -3a + 3a - 2794a*2 + 2795a2. Let c(j) = -j3 + 4j2. Let p(g) = 4g + 45. Let s be p(-11). Calculate sc(d) - 4o(d). -d*3 Let r(q) = -18q + 2. Let o(l) = -l. Let a = -11117 - -11115. What is ao(d) + r(d)? -16d + 2 Let i(t) = 5t + 7. Let o(v) = 7v + 11. Suppose -6k = -42k - 38k + 592. Give ki(z) - 5o(z). 5z + 1 Let k(v) be the second derivative of -v*3/2 - 2v*2 - 16v + 39. Let r = -18 + 11. Let n(p) = 4p + 6. Calculate rk(c) - 5n(c). c - 2 Let b(g) = -g2 - 8g + 7. Let y(h) = 4h2 + 4h - 9. Let j(z) = 9z - 26z*2 - 17 + 9z*2 + 24z*2. Let n(x) = 3j(x) - 5y(x). What is -4b(r) - 5n(r)? -r2 - 3r + 2 Let s = -130 + 131. Let w be -5 + (5/1 - s). Let z(h) = 6h3 + 3h - 3. Let q(o) = -o*3 - o + 1. Determine wz(j) - 3q(j). -3j*3 Let p(s) = -11s*3 + 4477s*2 - 17s + 402. Let r(v) = -4v3 + 1493v*2 - 6v + 142. What is 6p(a) - 17r(a)? 2a3 + 1481a*2 - 2 Let o(f) = 2f*2. Let x(p) = -2p*2 - p - 1. Let j be x(-1). Let d = -14612 + 14606. Let w(y) = -7y*2. What is do(q) + jw(q)? 2q*2 Let b(w) = -80w*2 - 2w - 9. Let i(s) = 38s2 + s + 4. What is 4b(p) + 7i(p)? -54p*2 - p - 8 Suppose -3r + 36 - 24 = 0. Let l(b) = -b*2 + 6b + 2. Let a(x) be the third derivative of x*5/60 - 5x4/24 - x3/6 - 194x2. Calculate rl(o) + 5a(o). o2 - o + 3 Let p(l) = -13l*3 - 13l*2 - 9l + 37. Suppose -5g - 67g = 21g + 837. Let k(m) = -3m*3 - 3m*2 - 2m + 9. What is gk(j) + 2p(j)? j3 + j2 - 7 Let q(i) = 3i3 + 2i*2 + i. Let h(f) = -17f*3 - 11f*2 - 4f - 769. What is h(j) + 5q(j)? -2j3 - j2 + j - 769 Let h(c) = 15c2 - 7c - 6. Let z(a) = -5a2 + 2a + 2. Let l be -26(-15)/(-30) - 40/(-2). Determine lz(d) + 2h(d). -5d*2 + 2 Let j(h) = 7h*2 - 7h + 5. Let w(q) = q*3 - 7q2 - 1. Let y be w(7). Let u = y - -1. Let b(o) = o2 + 65o + uo*2 + 1 - 66o. Give 6b(z) - j(z). -z2 + z + 1 Let n(c) = 64c*3 - 9c*2 + 396. Let y(m) = 16m*3 - 2m*2 + 79. What is 3n(l) - 14y(l)? -32l3 + l2 + 82 Let j(h) = -75h3 + 5h + 3. Let o(g) = 226g3 - 17g - 10. Determine -7j(z) - 2o(z). 73z3 - z - 1 Let k(i) = 5i*3 - 16i*2 - 6i + 11. Let v(t) = -13t3 + 45t*2 + 17t - 34. What is -17k(f) - 6v(f)? -7f3 + 2f2 + 17 Let j(q) = -q3 + 15q2 + 21q - 9. Let b(h) = -7h2 - 10h + 4. Give -13b(k) - 6j(k). 6k3 + k2 + 4k + 2 Let t(n) = -10n - 2. Let a(q) = 220q + 45. Let l be 30/((8 - -3)/(-33)). What is lt(i) - 4a(i)? 20i Let r(p) = -4251p - 2. Let q(n) = 8503n + 5. Determine 2q(z) + 5r(z). -4249z Let k(w) = -w*2 + 5. Let c(x) = 3x*2 + x - 11. Let s(h) = 126h + 507. Let v be s(-4). Determine vc(p) + 7k(p). 2p2 + 3p + 2 Let p(b) be the first derivative of b*4/4 - 2b3/3 - b2 - 14. Let f(c) = 4c3 - 7c*2 - 7c. Suppose -4v - 48 = -32. What is vf(t) + 14p(t)? -2t*3 Let j(z) = 27z - 5. Let b(t) be the first derivative of 189t2/2 - 36t + 835. Calculate 5b(p) - 36j(p). -27p Let y(i) = 17i - 198. Let r(h) = -15h + 176. Let x(n) = 9r(n) + 8y(n). Let k(f) = 11f*2 + 2f - 2. Calculate -k(s) + 3x(s). -11s2 + s + 2 Let z(i) = i3 - 2i2 + 8i - 175. Let p(v) = 10v3 - 21v*2 + 81v - 1750. Determine 2p(a) - 21z(a). -a*3 - 6a + 175 Let v(a) = 6a2 - 12a + 5. Let k(y) = -7y2 + 4y - 4. Calculate 5k(c) + 4v(c). -11c2 - 28c Let r(c) = -5c + 24. Let p(h) = -20h + 10h + 8h + 8. Let f be (-18)/243 + (8 - (-747)/243). Calculate fp(u) - 4r(u). -2u - 8 Let n(f) = -9f - 13. Suppose 0 = -23w + 33w + 30. Let x(m) = -6m3 + 2m*2 - 2m + 1. Let t be x(1). Let r(l) = 5l + 7. Determine tr(k) + wn(k). 2k + 4 Let g(n) = 90n - 108. Let k(p) = -30p + 42. Give 3g(t) + 8k(t). 30t + 12 Let g(x) = -2x. Let d(z) = 8z + 1315. Calculate d(t) + 5g(t). -2t + 1315 Let c(t) = 15t*3 - 2t*2 - 36t + 9. Let b(p) = -p*3 + 4p - 1. Let f(n) = -10b(n) - c(n). Let d(s) = -s3 + s2. What is -4d(y) + f(y)? -y*3 - 2y*2 - 4y + 1 Suppose 0 = 5m + 5v, 48v = 5m + 45v + 40. Let z(r) = -11r*3 + 7r*2 + 3r - 7. Let q(x) = 7x3 - 5x*2 - 2x + 5. Give mz(g) - 7q(g). 6g3 - g Let m(x) = -17x*2 - 2x - 17. Let d(o) = -12o2 - 2o - 12. Let h(f) = 7d(f) - 5m(f). Let t(l) = 2l2 - 9l + 1. Calculate -5h(b) + 2t(b). -b*2 + 2b - 3 Let y(q) = -27q. Let i(n) = -14n. Let f be 98/(-245) + 5236/(-10). Let d = f - -519. What is di(o) + 3y(o)? -11o Let q(m) be the first derivative of 9m*2/2 + 3m - 1627. Let x(b) = -b. Give q(y) + 2x(y). 7y + 3 Let j(c) = 11976c. Let b(k) = 81k. Give 6b(l) + j(l). 12462l Let h(d) = 23d2 - d. Let c(v) = -2508v*2 - 66v. Calculate 2c(w) - 132h(w). -8052w2 Let h(g) = -g + 10. Let x(z) = -461z + 51. Calculate -5h(v) + x(v). -456v + 1 Let t(l) = -4l. Let p(x) = 11x - 196. What is -p(d) - 3t(d)? d + 196 Let z(s) = -783s*2 - 6s + 2. Let d(y) = -2145420y2 - 16443y + 5481. Let n(r) = 6d(r) - 16443z(r). Let o(m) = -25m2. Calculate -2n(q) - 189o(q). 27q*2 Let h(y) = 5417y - 2491y - 2716y. Let w(l) = -19l. Determine 5h(s) + 56w(s). -14s Let w(j) = -53j2 + 3j - 14. Let z(x) = 114x - 6253. Let q be z(55). Let k(i) = -18i*2 + i - 5. What is qk(f) - 6w(f)? 12f*2 - f - 1 Let a(s) = 15s*2 + 91s. Let u(k) = -k*2 + k. Give a(n) + 2u(n). 13n2 + 93n Let w(r) = -13r - 128. Let l(s) = -34s - 385. Determine 3l(b) - 8w(b). 2b - 131 Let h(a) = 211a + 219a + 226a + 1 - 878a + 221a. Let g(c) = -3c2 - 7c - 7. What is -g(s) + 6h(s)? 3s*2 + s + 13 Let h(x) = 4x*2 + 3x + 2. Let i(t) = -362t - 3255. Let g be i(-9). Let r(w) = -w2 - 1. Determine gr(v) + h(v). v*2 + 3v - 1 Let v = -15701 - -15704. Let k(h) = 13h + 5. Let d(t) = 7t + 3. Calculate vk(p) - 5d(p). 4p Let o(q) = q - 3. Let c(j) = 2j - 8. Let d(x) = x*2. Let n(m) = -3m*2 + 24m + 83. Let p(l) =	{ "pile_set_name": "DM Mathematics" }
2 - 13) to md + y and give m. 98 Rearrange 2o*3 + 11o*3 + 60o*2 - 60o*2 - 6 - 6o*3 to the form yo*3 + ko + l + wo2 and give y. 7 Rearrange -2z*2 + 106z*3 + 5z - 5z - 66z*3 to the form l + yz + qz2 + wz*3 and give q. -2 Express 1 - 29n*2 + 17n*2 - 7n + 11n2 in the form rn + zn2 + w and give r. -7 Rearrange -3h*4 + 8 + 1621h2 + h3 + 0h3 - 1619h*2 + 0h + 0h to qh*4 + nh + y + gh3 + zh*2 and give z. 2 Express 4j*3 + 82j - 4 - 84j + 2 as xj*3 + gj*2 + nj + v and give x. 4 Rearrange (0 + 0 + 2z)(-4 - 4 + 6) + (3 - 6 - 2)(-54z + 166 - 166) to s + fz and give f. 266 Express (-4b - 9b + b)((-b - 5b + 5b)(b - b - b) + 1 - 1 + 2b*2) as i + tb*2 + lb*3 + ab and give i. 0 Rearrange 167h2 - 331h*2 + 24 - 23 + 166h*2 + 205h to the form fh + w + ph*2 and give w. 1 Express -27l + 2 + 31l + 0 + (0 - 1 - 4l + 2l)(4 - 4 - 7) as s + rl and give s. 9 Express n - 2 - 23n*2 + 26n2 - n2 + 75n3 + 0n in the form v + rn2 + xn*3 + jn and give r. 2 Rearrange -128 + 129 - 6y2 + 256 + 14y*2 - 7y*2 to the form p + qy*2 + wy and give q. 1 Rearrange (2b2 + 0b*2 - 6b*2)(-3 + 1 + 3)(46b - 44b - 38b*2 + 7b*2) to u + vb*2 + zb + sb3 + db*4 and give d. 124 Rearrange (331v - 571v + 523v)(-v + 2 - 2)(-v2 - v2 - v*2) to q + sv*3 + zv*4 + lv*2 + dv and give z. 849 Express (15 - 11 + 14)(5r + 3r + 35r)(-2 + 0 - 3) in the form wr + l and give w. -3870 Express d*2 + 0d + 0d2 + 2 + d + (2 - 16 - 1)(-11 + 11 - 28d2) as xd + td2 + u and give u. 2 Express (-2 + 0 + 0)(-2j3 + 4j*3 + 0j3) - j3 + 13j3 - 50j*3 as pj*3 + s + wj + oj2 and give p. -42 Rearrange -138g + 73g + 68g*3 + 58g to the form k + lg2 + jg*3 + wg and give w. -7 Express (5 + 6 + 11)(-5n + n + 2n)(9 - 1 - 1)(3 + 2 - 7) in the form xn + k and give k. 0 Rearrange 14h2 + 63h*3 - 5h*2 - h - 64h*3 + 2h*4 to the form lh*4 + xh*2 + q + gh*3 + dh and give l. 2 Rearrange (1 - 1 + q)(5 - 3 - 1) + 55q - 119q + 20q + 3q - 4q + 7q to the form p + cq and give c. -37 Express 6 - 15 - 972t + 982t as b + lt and give l. 10 Rearrange 221l + 13l2 - 3l2 + l3 - 221l - 6 to z + tl + nl3 + rl*2 and give r. 10 Rearrange -423h - 137046 + 137046 to the form wh + z and give w. -423 Rearrange 2r*2 + 24508 + 19r*3 - 24508 + 6r to the form s + ar3 + yr*2 + nr and give n. 6 Rearrange (j2 - j3 - j*2)((0 + 6 - 4)(7 - 2j - 7) + (-j - 1 + 1)(2 + 0 - 4)) to t + dj*4 + gj*3 + uj + xj2 and give d. 2 Express -106h4 - 2 - h3 + 196h4 - 51h*4 as l + gh*4 + bh*2 + ph + mh3 and give l. -2 Rearrange -q3 - 4q - 460q2 - 47 + 461q*2 - 3q*3 + 0q + 5q to the form yq*2 + hq*3 + lq + r and give r. -47 Express (-2 - 3g + 2)(5g - 3 + 3)(0 - 3 + 1)(-g + 0g - g) as lg + tg*3 + yg*2 + s and give t. -60 Rearrange (-6c2 + c2 + 2c2)(0 - 1 + 2)(-102c + 20c + 15c) to qc2 + f + mc*3 + ac and give q. 0 Rearrange -4z2 + 9z2 - z3 + 0z3 - 4 + 4 - 52z to the form nz2 + dz + h + wz3 and give w. -1 Rearrange -4k - 151k2 + 6k + 6k + 36k*2 + k to bk + dk2 + y and give b. 9 Express 1 - 29t*2 - 10t*2 - 7t*2 - 7t*2 + 79t*2 + 9t*3 in the form it*2 + ot + x + mt3 and give i. 26 Rearrange 0s + 0s - 3s*2 + (202s + 216s - 395s)(2s - s - 3s) to ls*2 + m + ys and give l. -49 Rearrange ((3 + 3 - 5)(-1 - 5 + 2) - 1 - 1 + 3)(-1 + 2 + 0)(2n - 50 + 50 + (4n - 3n + 0n)(-5 - 1 + 5)) to the form i + yn and give y. -3 Rearrange (-h + h - 2h - 8 + 8 - 2h + (1 - 2 + 0)(-3 - h + 3))(-4h + 5h - 3h)(-4 + 1 + 7) to the form oh + d + mh2 and give m. 24 Rearrange (-2y + 1 - 1)(-6y*2 + 8y*2 + 2 - 1) + (3y*2 + 0y2 - y2)(-10y - 6 + 6) to the form ty3 + gy*2 + ry + x and give t. -24 Express 133x - 93 - 55 + 153 in the form w + px and give p. 133 Express 4 + 2621c - 41c2 + c3 - 4 - 2622c in the form hc + rc2 + pc*3 + j and give h. -1 Express -4l*4 - 7 + 3 + 3l*3 + l + 3 + 2 in the form b + il + dl2 + ol*4 + nl*3 and give n. 3 Rearrange (-3p*3 - 7p*3 + 124p*3)(-9p - p - 4p) to the form bp2 + zp + ap4 + m + xp*3 and give a. -1596 Express (-2b2 + b2 - b*2)(833b2 - 61b*2 + 62b*2) in the form u + qb*4 + ib*2 + kb + rb3 and give q. -1668 Rearrange 5x - 2x + 6x + (0x - 2x + 0x)(0 + 5 + 0 + 1 + 2 - 4 + (4 - 1 - 2)(-5 + 1 + 2)) + (-4 + 4 - 4)(2x - 2x + x) to ux + g and give u. 1 Express -213j + 2 + 111j - 4 - 8j in the form vj + n and give v. -110 Rearrange -8j + 2j + 0j + 0j - 2j + 3j + (3j - 4j + 3j)(0 + 2 + 0) - j + j - 2j + 2 + 2j - 2 + (2 + 0 + 2)(0j + 3j - 2j) to fj + k and give f. 3 Express (-d - 20d + 8d + (-3d + 4d + 0d)(1 + 2 - 2) - 3d + d + d)(1 + 3 - 5) in the form yd + c and give y. 13 Express -8h*3 - 14h*4 - 2 - 3h*3 - 2h*4 + 12h*4 as dh*2 + oh*4 + ph*3 + w + gh and give w. -2 Rearrange (-20f2 - f - 19f*2 + 21f*2)(-2f + 1 - 1) + 0 - 5f*3 + 3f*3 + 2 to gf*3 + c + pf*2 + bf and give p. 2 Express (5 + 3 + 4)(-4d + 5d + d)(0d3 - 5d*3 - 2d*3) as fd + rd2 + cd*4 + sd3 + q and give c. -168 Rearrange 1 + q2 - 106q + 117q - 10q2 to the form b + jq + uq2 and give b. 1 Rearrange (0x - x + 3x + (-2x + 2x - 2x)(-1 + 0 + 0) + 2x + x - x)(9 + 8 - 6) to the form cx + f and give f. 0 Rearrange 245f + 0 - 244f + f4 + 0 + 1 + f3 to the form lf3 + qf + u + nf4 + pf*2 and give n. 1 Express 130r*2 - 16r - 23r - 2r*3 + 37r + 0r3 as fr*2 + tr + c + vr3 and give v. -2 Rearrange -2a*2 - 11534a + 4a3 + 11538a - a*3 to ma + da2 + k + fa*3 and give m. 4 Rearrange (-3m*3 - 9m*3 - 6m*3)(3m - 4m - 2m) + 3 + m4 - 3 to wm*2 + ym + km4 + v + im*3 and give v. 0 Express 2z*2 + 6 + 1083z - 1054z + 2z*3 - 6 in the form oz + pz2 + h + nz*3 and give n. 2 Express 14r*2 - 106r*2 - 5162r*3 + 0 + 5159r*3 - 1 in the form tr*3 + or + xr2 + w and give w. -1 Rearrange (-87 + 285 - 85 + (3 + 1 - 5)(-3 + 2 - 1) + 7 - 1 - 2)(4j - 4j + j) to y + oj and give o. 119 Rearrange 513a - 8 - 37 + 45 to oa + v and give o. 513 Rearrange -4 + 0 + 4 - 275u2 + 333u*2 to lu + f + qu2 and give q. 58 Express -3x4 + x4 + 5x4 + (0x2 - x2 + 3x2)(-1 + 1 + x*2) + 98x*4 + 74x*4 - 116x*4 as s + yx*4 + ix*2 + kx*3 + tx and give y. 61 Express 103z - 4z2 + z2 + 40 - 40 as lz + qz*2 + x and give l. 103 Rearrange 19 - 5 - 5 - 9 + 783c to i + lc and give l. 783 Express -3p + 32 - 68 + 5p + 34 - 3p in the form dp + a and give d. -1 Express -78463 - 18m + 78463 as z + cm and give c. -18 Express l2 - 101423l + 6 - 26l3 + 101423l as m + pl3 + il + tl2 and give p. -26 Express 2p*2 + 48 - 48 + 29p*3 - 24p - 59p + 2p*4 - 36p*3 in the form zp*2 + i + vp + mp3 + hp*4 and give h. 2 Express 125f + 10 + 8 + 7 - 28 + 4 in the form l + if and give i. 125 Rearrange -j - j3 - 1185j4 + j2 + 2 + 1177j4 + 3j*3 to l + qj*4 + pj*3 + bj + wj2 and give q. -8 Express -11 + 302f - 346f - 3 - 9 as u + cf and give c. -44 Rearrange (0l + 2l - 3l)(-1 + 1 + 1)((0 + 2 - 4)(-33 - 9 + 11) + (-5 + 5 - 1)(1 - 1 + 1))(1 - 9 + 1) to the form f + yl and give y. 427 Rearrange -155 + 80 + 497v - 1743v + 75 to the form s + lv and give l. -1246 Rearrange -4 - 1598l - 5l*2 + 8l*4 + 1597l + 2l2 + 2l*2 - 2l*3 to dl*4 + il*3 + fl*2 + j + nl and give n. -1 Rearrange 3o4 + 2o*2 + 100 + o + 0o*2 + 0o - 4o4 + 4o*4 to the form ho*3 + u + so + jo4 + ao*2 and give j. 3 Rearrange -5787d + 12068d - 5754d + d + 0d + d + (-3 - 2 + 6)(0d + 0d - 2d) + 0d + 0d - d to the form z + gd and give g. 526 Rearrange -2l3 + 167 - 38606l + 38604l - 531 + 4l*3 to the form zl + wl2 + hl*3 + g and give g. -364 Express -48n*3 + 12n - 54n3 + n2 + 155n*3 - 52n*3 as wn + q + on2 + rn*3 and give o. 1 Express (8 + 206q + 2q*2 -	{ "pile_set_name": "DM Mathematics" }
f(r) - z(r). 2r2 - 20r - 1 Suppose -5h = -a + 14 + 1, -2a + 5h + 10 = 0. Let j(q) = -q3 - 8q*2 - 2q + 6. Let w(p) = -p*3 - 7p*2 - 2p + 5. Determine aj(b) + 6w(b). -b*3 - 2b*2 - 2b Let x(i) = i*3 - i + 1. Let l(b) be the first derivative of 9b*2/2 + 95b + 41. Let p be l(-11). Let j(z) = 5z3 - 7z + 7. What is pj(q) + 28x(q)? 8q3 Let b(x) = 16x2 - 6. Let m(i) = -i3 + 33i2 - 42i + 326. Let a be m(32). Let n(w) = -16w2 + 5. Give an(y) + 5b(y). -16y*2 Let o(m) = -3m*3 + 1141m*2 - 4m - 4. Let i(p) = -7p3 + 2281p*2 - 10p - 11. Calculate -2i(x) + 5o(x). -x*3 + 1143x2 + 2 Let k = 26 + -22. Let f(x) = x2 - x - 1. Let b(c) be the second derivative of c5/20 - c4/3 + 2c3/3 + 2c*2 - 392c. Determine kf(n) + b(n). n3 Suppose 4t + 2w = -392, 0t + 2w + 104 = -t. Let i be (-8)/t4 - (-35)/3. Let h(a) = -a - 9. Let m(o) = -2o - 22. Calculate ih(g) - 5m(g). -2g + 2 Let b be -3 + (-1 - 8) + 15. Let v(o) = 26o3 - 7o. Let d(z) = -13z3 + 3z. Give bv(x) + 7d(x). -13x3 Let l(v) = 8v - 2. Let a(w) = -45w - 439. Give a(k) + 5l(k). -5k - 449 Let b(s) = s - 1. Let h(y) be the second derivative of -y3 - 31y*2/2 - 9680y. Calculate 4b(k) + h(k). -2k - 35 Let n(s) = s*2 + 4s + 1. Let p(b) = b*2 - 16b + 4. Let w be 15/(-40) - 1310/(-80). Let c be p(w). Let q(a) = -a*2 - 3a - 1. Calculate cn(u) + 5q(u). -u*2 + u - 1 Let c(h) = 6h2 - h + 1. Let p(r) = r2 - r + 1. Let q be (8/(32/(-6)))/((-3)/(-2)). Let j be 1(5 + q - 3). What is jp(x) - c(x)? -5x2 Let l(t) be the second derivative of -t3/2 - t2/2 - 629t + 5. Let x(j) = -4j - 2. Determine -2l(m) + 3x(m). -6m - 4 Let h(b) = 2148b3 - 2b*2 + 2b + 4. Let p(a) = 6445a3 - 7a*2 + 7a + 14. Give 21h(y) - 6p(y). 6438y3 Let x be (-5 + (-12)/(-4))-2. Suppose 4j + 3087 = -5o + 3044, -4o + 5j - 18 = 0. Let v(p) = 14p - 9. Let z(k) = 7k - 5. Calculate oz(i) + xv(i). 7i - 1 Let n(p) = -39p*3 + 5p*2 - 5p. Let t(g) = 58g3 - 8g*2 + 8g. Let b(k) = 268k - 4012. Let o be b(15). Give on(u) + 5t(u). -22u*3 Let w(b) = -9b + 41. Let x(u) = -5u + 32. Determine 3w(f) - 4x(f). -7f - 5 Let k(z) = z*2 + z + 1. Let y = 8800 + -8799. Let c(w) = 7w*3 - 5w*2 - 5w - 5. What is yc(n) + 5k(n)? 7n3 Let l(o) = -6o + 5. Let h(g) = -93 + 8g - 7g + 69 + 25. Calculate 3h(c) + l(c). -3c + 8 Let x(w) be the third derivative of w*4/12 - 2w*3/3 + 4w*2 + 20w + 186. Suppose -3m + 12 = -0m. Let t(d) = 3d - 4. What is mt(n) - 5x(n)? 2n + 4 Let p(s) = -112s - 15. Let h(z) = -728z - 96. Determine -5h(q) + 32p(q). 56q Let s(r) = 38r*3 + 5r*2 + 24r. Let h(q) = -39q3 - 6q*2 - 24q. Calculate -5h(a) - 6s(a). -33a3 - 24a Let x be (-2)/(-12) + -2. Let y(i) = 5i + 72. Let n(u) = 3u + 41. Let g(j) = -7n(j) + 4y(j). Let f(s) = -7s - 5. Calculate xf(b) - 3g(b). 10b + 2 Let o(f) = 20f*2 + 17f - 12. Let a(n) = 7n2 + 8n - 23. Let z(b) = -22b2 - 26b + 79. Let l(y) = -7a(y) - 2z(y). Give 9l(k) + 2o(k). -5k2 - 2k + 3 Let r(p) = -p. Let g(b) be the first derivative of b5/30 - b4/12 + 64b3/3 - 14. Let a(i) be the third derivative of g(i). What is -a(s) - 5r(s)? s + 2 Let n(f) = 80f2 + 61f. Let k(b) = 40b2 + 29b. Let d(u) = 7k(u) - 3n(u). Let y(c) = 13c2 + 7c. Give 6d(m) - 17y(m). 19m2 + m Let x(y) = 1. Let v(q) = -6q. Determine -v(j) - 5x(j). 6j - 5 Let b(w) = 71w - 20w - 1 - 26w - 33w. Let k(q) = 15q + 2. Calculate 5b(d) + 3k(d). 5d + 1 Let h(r) = 2r2 + 2r - 1. Let w = -7 + 0. Let t(d) = -1793d2 + 1799d*2 - 2 + 9806d - 9799d. Calculate wh(i) + 2t(i). -2i*2 + 3 Let p(q) = q + 24. Let a(u) = 23 + 62u + 66u + 60u + 60u - 247u. Calculate 4a(s) - 3p(s). s + 20 Let w(l) = 6l3 - 2730l*2 + 5l + 30. Let s(o) = -o*3 - o - 6. Give 5s(m) + w(m). m*3 - 2730m*2 Let z = 170 + -167. Let q(f) = -8f*z - 6f*2 - 6f*2 + 4f - 4f. Let d(n) = -3n*3 - 5n*2. Give -12d(k) + 5q(k). -4k*3 Let y = 2087 - 2083. Let c(r) = -16r*3 - 4r*2 - 4r - 4. Let u(d) = -111d3 - 27d*2 - 27d - 27. Determine yu(z) - 27c(z). -12z3 Let a(k) = -1 - 7k + 3 + 5k. Let q = 2 + -8. Let t(m) = m. Let p(u) = 7u - 1. Let j(c) = qt(c) + p(c). Determine -2a(s) - 3j(s). s - 1 Let a(l) = 18l*2 + 9l + 363. Let y(r) = 3r2 + 2r + 3. Calculate -a(b) + 5y(b). -3b*2 + b - 348 Let q(w) = -15w - 1538. Let k(f) = 24f + 3084. Determine 3k(t) + 5q(t). -3t + 1562 Let i(v) = -47v + 3714. Let h(f) = 76f - 5572. Give -5h(m) - 8i(m). -4m - 1852 Suppose 8235p = 8239p - 8. Let l(o) = 9o*2 - 5o + 2. Let v(b) = b*2 - b + 1. Give pv(q) - l(q). -7q2 + 3q Let y(p) = 52p. Let t(h) = -h + 346304767 - 346304767. What is 6t(o) + y(o)? 46o Let t(n) = -1456n + 22. Let h(d) = 4375d - 62. Give -6h(v) - 17t(v). -1498v - 2 Let o(m) = -17m2 - 3m + 8. Let z(w) = -67w2 - 14w + 36. Give 18o(k) - 4z(k). -38k2 + 2k Let g(b) = 4b2 + 6b - 6. Let d(i) = 3i2 + 5i - 5. Let x = 6 - 2. Let l(k) = -xk - k2 - k + 6 + 3k + 3k. Let w be l(0). What is wd(p) - 5g(p)? -2p*2 Suppose 2z = -5n + 26 - 3, -3z = 3. Let t(w) = -5w - 8w2 - n + w2 - 3w2. Let l(o) = 15o*2 + 7o + 7. What is -5l(f) - 7t(f)? -5f2 Let m(f) = 8f + 11. Suppose 21 = -s - 5q, 226q + 15 = -s + 223q. Let k(d) = -7d - 10. Determine sk(u) - 5m(u). 2u + 5 Let m(d) = -7d*3 - 4d*2 + 15d + 2. Let i(a) = -8a3 - 6a*2 + 16a + 3. Give 2i(v) - 3m(v). 5v3 - 13v Let w(s) = -21s3 - 6s*2 - 4s + 31. Let y(u) = -18u3 - 5u*2 - 3u + 29. Calculate 5w(d) - 6y(d). 3d3 - 2d - 19 Let j(i) = 2i3 - 9i*2 + 3i - 3. Let h(w) be the third derivative of w*6/30 - 17w5/60 + w4/4 - 5w3/6 + 3208w*2. Calculate 3h(t) - 5j(t). 2t*3 - 6t*2 + 3t Let n(i) = 13i3 + i2 + 2i. Suppose 0 = -2u + 5r + 41, -10u - 34 = -12u + 4r. Let f(c) = -14c*3 - 2c*2 - 2c - 1. Calculate un(y) + 2f(y). 11y3 - y2 + 2y - 2 Let i be ((-6)/4 + 1)-2. Let u(f) = -3f*2 + 1. Let y(l) = -72204l*2 + 48 + 72203l2 - l3 - 47. Calculate iu(q) - 3y(q). 3q3 - 2 Let p(s) = -3 + 11s*2 - 2 + 5 + 8 - 4. Let c(m) = -23m*2 - 6m - 6. Let y(t) = -t*2 - t. Let x = 5 - 4. Let d(k) = xc(k) - 6y(k). Give -5d(h) - 8p(h). -3h*2 - 2 Let o(g) = -3g - 4. Suppose 3x - 3 = d, -12 = -6d + 2d. Let r(m) be the third derivative of 2m*4/3 + 7m*3/2 - 2m*2 - 23m. Calculate xr(p) + 11o(p). -p - 2 Let a(z) be the second derivative of z*3/6 + 14915z. Let u(k) = -8k - 2. What is 2a(b) - u(b)? 10b + 2 Let v(i) = 3i*3 - 2i*2 + 4i + 12. Let y(j) = -5j2 - 197j - 270. Let a be y(-38). Let n(z) = z3 - z2 + z. Give an(s) + v(s). -s3 + 2s*2 + 12 Let k(a) = -10a - 8. Let t(z) = 114z + 2259. Let r(q) = -7q - 137. Let i(m) = 33r(m) + 2t(m). Suppose -s = -6s - 5, 54 = -4h + 2s. Give hi(c) + 5k(c). -8c + 2 Let f be -1 - (-2 - ((-2)/3 + 42/63)). Let k(h) = -h - 1. Let s(b) = -b - 5. Give fs(g) - 2k(g). g - 3 Let p(x) = -42x3 - 9x*2 - 27x - 74. Let c(y) = 20y3 + 4y*2 + 12y + 37. Give 9c(j) + 4p(j). 12j3 + 37 Let h(u) = -2u + 9. Let j = 1558 + -1554. Let t(q) = 1. Determine jh(k) - 36t(k). -8k Let n(a) = 1. Let j(g) = 2g*2 + 5g - 5. Suppose 12s = -11 + 23. Determine sj(q) + 4n(q). 2q*2 + 5q - 1 Let m(h) = 9h + 8. Let d(z) = -1364z - 16. Give -4d(x) - 8m(x). 5384x Let n(c) = 38279c*2 + 4545c - 1515. Let i(x) = -101x2 - 12x + 4. Calculate -1515i(v) - 4n(v). -101v2 Let z(k) = -12k*2 - 10k - 10. Let l = 936 + -766. Let x be l/17 + -3 + (0 - -13). Let t(o) = 0o2 + o2 + 1 + 3o - 2o. Calculate xt(y) + 2z(y). -4y*2 Let h(i) = -17 + 11 + 7. Let g(s) = -10s*2 + 3s + 14. Let k(n) = -7n2 + 3n + 11. Let z(p) = -3g(p) + 4k(p). Give h(o) - z(o). -2o2 - 3o - 1 Let o(l) = -7l + 47. Let i(v) = -3v + 23. Let w be 49(-1)/4(224 + -225). Give wi(t) - 4o(t). t + 19 Let h(t) = -2t*2 - 2t - 3. Let x(w) be the third derivative of -w*5/15 - 5w*4/24 - 7w*3/6 - 19w*2 - 3w. Give 9h(m) - 4x(m). -2m2 + 2m + 1 Suppose 81 - 80 = -5k + 2b, 2k - 2b + 10 = 0. Let w(n) = 26. Let f(i)	{ "pile_set_name": "DM Mathematics" }
3. Let k(f) = 16l(f) + 3z(f). What is k(s(d))? -8d4 Let w(q) be the third derivative of q5/60 - 11q*2. Let a(x) = -12x. Let m(n) = 25n. Let v(u) = 13a(u) + 6m(u). What is w(v(s))? 36s*2 Suppose -3 = -3y + 15. Let o(d) = -d - d + yd. Let i(w) = 2w*2. Calculate o(i(g)). 8g*2 Let m(c) = 5c. Let h = -5 + 12. Let q(j) = 7 - h + j*2. What is m(q(n))? 5n*2 Suppose s = 4s - 6. Let m(f) = 3f + f + s - 2. Let i(z) = z + 0z - 2z. Give i(m(x)). -4x Let i(a) be the third derivative of 1/12a4 - 6a*2 + 0a + 0 + 0a3. Let q(d) = 2 + 5d - 2. What is i(q(b))? 10b Let c(h) = 551h*2. Let g(f) = -f. Calculate g(c(l)). -551l*2 Let a(f) = 2f*2. Let t(q) be the first derivative of 2q*3/3 - 14. Give a(t(v)). 8v*4 Let f(m) = -m. Let u(b) = -5b. Let d = 1 - 5. Let z(a) = df(a) + u(a). Let g(w) = 3w*2. Calculate z(g(t)). -3t*2 Let u(k) = -178k*2 + 2k. Let c(w) = -w. What is c(u(n))? 178n2 - 2n Suppose 0 = g + 2g - 21. Let k(t) = -3t - 2t + gt. Let o(d) = -17d2. What is o(k(m))? -68m2 Let b(a) be the third derivative of a4/6 + 20a2. Let y(g) be the first derivative of -g3/3 - 1. Calculate y(b(m)). -16m*2 Let m(s) = -3s*2. Let g(u) = -95u*2. Calculate m(g(v)). -27075v4 Let z(j) be the third derivative of j5/120 - j*3/6 - 3j*2. Let d(k) be the first derivative of z(k). Let i(l) = l. Determine i(d(f)). f Let u(j) = j - 3. Let v be u(6). Let y = v + 1. Let o(c) = 3c*2 + 4c. Let n(t) = t*2 + t. Let g(p) = yn(p) - o(p). Let q(k) = k2. Calculate q(g(a)). a4 Let x(d) = 6d2 - d2 - d2 - 1 - d2. Let h(c) = 2c*2. Calculate h(x(j)). 18j*4 - 12j*2 + 2 Let r(f) be the first derivative of 0f - 1/3f3 + 0f*2 + 7. Let s(p) = -16p*2. Calculate r(s(d)). -256d*4 Let i(n) = 3n. Suppose 3f = 1 + 5. Suppose 10 = -4k + 4p - 2, -5k = -2p. Let r(g) = 0g*f - 3g*k + 7g*2 - 3g*2. Give r(i(x)). 9x*2 Let i(k) be the first derivative of 13k2/2 + 21. Let m(b) = b2. Give i(m(f)). 13f2 Let x(s) = -s - 21. Let y(h) = -2h*2 - 5h - 5. Let t(g) = g + 1. Let b(j) = 5t(j) + y(j). Calculate b(x(u)). -2u*2 - 84u - 882 Let b(z) = -4z. Let c(a) be the first derivative of 0a*2 + 0a + 3 + 2/3a3. What is c(b(w))? 32w2 Let f(a) = a2. Let j(o) = -151o2 + 14o. Let v(b) = 76b2 - 6b. Let u(w) = -3j(w) - 7v(w). What is u(f(q))? -79q4 Let g(o) = o. Let a(n) be the second derivative of 31n*3/6 - 13n. What is a(g(i))? 31i Let k = -2 + 5. Let f(i) = -8i*2 - 4i - 4. Let q(r) = 7r2 + 3r + 3. Let d(u) = kf(u) + 4q(u). Let z(a) = a*2. What is d(z(v))? 4v4 Let z(b) be the second derivative of b4/24 + 9b2/2 + 2b. Let f(o) be the first derivative of z(o). Let h(i) = i. Calculate f(h(r)). r Let y(j) = j*2. Let c(u) = 3u - 127. Calculate c(y(a)). 3a2 - 127 Let l(k) = -8k*2 + 22k. Let a(h) = 27h. Calculate l(a(m)). -5832m*2 + 594m Let w(u) = 397u2 - 15. Let m(n) = n2. Give w(m(d)). 397d4 - 15 Let q(t) be the second derivative of -t4/4 + 22t. Let l = 6 + -1. Let d(i) = 5i*2 - li*2 + 3i*2. Calculate d(q(g)). 27g*4 Let c(i) = 2i. Let f(t) = -2t. Let x(v) = -5c(v) - 6f(v). Let k(l) be the third derivative of -l5/20 - l2. What is k(x(y))? -12y*2 Let w = -6 + 7. Let u(q) = 0 - w + 1 + 2q. Let v(p) = 3p2. Give v(u(z)). 12z*2 Let t(k) = 3k. Let v(x) = -14x + 4x - 2x. Calculate v(t(m)). -36m Let t(f) be the third derivative of -f4/24 - f3 - f*2. Let m be t(-8). Let r(h) = 2h + m - 2. Let o(c) = -c*2. What is r(o(z))? -2z*2 Let b be 1 - (-2)/((-4)/22). Let l be (-18)/(-5) + (-4)/b. Let y(d) = l - 4 + 5d. Let h(n) = -2n. Determine h(y(c)). -10c Let i(u) = -80u - 55. Let y be 12/(-16) - 10/8. Let s(v) = 3v + 2. Let m(z) = yi(z) - 55s(z). Let q(o) = -4o + 10 + 2o - 10. What is q(m(h))? 10h Let l(v) = -2v*2. Suppose 3k - 4k = 2. Let j(n) = -n + 2. Let m(z) = -4z + 5 + z + 0z. Let f(o) = km(o) + 5j(o). Give f(l(d)). -2d2 Let y(g) = g2. Suppose -m + 6 = 2m. Let d(c) = 0c + 2c2 - 2c + mc. Determine d(y(h)). 2h*4 Let g(o) = 2o2. Let s(i) be the first derivative of -i6/360 + i*3 + 5. Let n(m) be the third derivative of s(m). What is n(g(q))? -4q4 Let u(a) be the third derivative of a7/1680 - a*5/20 - 11a*2. Let s(p) be the third derivative of u(p). Let n(t) = -2t - 3t2 + 2t. Calculate n(s(k)). -27k2 Let t(c) = -55c*2. Let r(x) = 86x. Calculate t(r(a)). -406780a2 Let y(k) = 3k*2. Let a(f) = -3f*2 - 541f. What is a(y(v))? -27v4 - 1623v*2 Let s(f) = -37f. Let g(q) = -5q2 + 7. Let u(n) = -2n*2 + 3. Let l(j) = 3g(j) - 7u(j). Determine l(s(z)). -1369z*2 Let k(o) = 3o. Let r(j) be the third derivative of j*5/60 + 10j*2. Calculate r(k(l)). 9l*2 Let u(h) = -6h*2. Suppose -3c + 6 + 0 = 0. Let k(p) = 5pc - 2p*2 + 2p*2 - 4p*2. Determine k(u(i)). 36i*4 Let w(n) = -7n. Let c(f) = 16f. Give w(c(z)). -112z Let t(b) = -3 + b + 4 + 1 - 4. Let v(i) = -i + 3. Let q(y) = -3t(y) - 2v(y). Let d(n) = -n2. Calculate d(q(w)). -w2 Let d(g) be the third derivative of g*4/8 + 8g*2. Let i(w) = 2w. What is d(i(r))? 6r Let g(u) = -3u. Let d(t) be the first derivative of 8t3/3 - 2. Calculate d(g(o)). 72o*2 Let d(m) = -3m*2 - 4 + 4. Let v be (15 + -5)2/4. Let g(w) = 7w2 - 5w. Let r(j) = 4j2 - 3j. Let q(n) = vr(n) - 3g(n). Give q(d(l)). -9l4 Let c(w) = 131w*2 + w. Let o(x) = -4x*2. What is c(o(f))? 2096f*4 - 4f*2 Let u(v) = 2v. Let y(h) = -14059h. What is u(y(m))? -28118m Let m(r) be the first derivative of -r*2 + 14. Let q(y) = 8y. Give q(m(w)). -16w Let s be (-5)/620/(-50). Let m(o) be the first derivative of 0o2 - so*3 - 2 + 0o. Let j(f) = f2. Give j(m(r)). r4 Let n(r) = 4r2 + 2r. Suppose -4 = f + f. Let a(w) = 4w2 + 3w. Let d(x) = fa(x) + 3n(x). Let y(z) = -z. Give y(d(m)). -4m2 Let v(y) = 2y. Suppose -2 = -3n + 2n. Suppose 0 = -5i + 5p + 5, 0 = -ni - 0i - p + 8. Let h(j) = 0j - j + ij. Calculate v(h(o)). 4o Let x(j) = 8j*2. Let w(q) = 23q*2. Let g(f) = 3w(f) - 8x(f). Let n(c) = -2c*2. Give n(g(a)). -50a4 Let u(v) be the third derivative of -v5/30 - 11v2. Let d(n) be the second derivative of -n3/6 - n. Calculate d(u(l)). 2l*2 Let w(h) = 7h. Let a(k) = -4k2 + 261k - 261k. Calculate w(a(p)). -28p*2 Let l(r) = 4r*2. Let k(q) = -q - 2. Let g(p) = 3p + 5. Let t(m) = 6g(m) + 15k(m). Calculate l(t(a)). 36a2 Let x(o) = -605o*2. Let u(r) = -7r*2. Calculate x(u(g)). -29645g*4 Let j(s) = 2s*2 - 2s*2 - 2s2. Let o(p) = -p2 + 2p - 2. Let f(l) = -5l*2 + 11l - 11. Let w(t) = 4f(t) - 22o(t). Determine j(w(y)). -8y4 Let d(q) = 94q. Let k(z) = -z. Determine k(d(b)). -94b Let h(r) = -r2. Let x(a) = -a2 - a. Let z(u) = -u2 - 2u. Let s(p) = -2x(p) + z(p). Determine h(s(i)). -i4 Let u(q) = -q2. Let r = 9 + -5. Suppose n - 3x - 7 = 0, -rn + 5x + 20 = -8. Let d(b) = -n - b + 7. What is u(d(w))? -w2 Let k(x) = 0 - x2 + 0. Let t(l) = -2l - 48 + 48. Determine k(t(f)). -4f*2 Let m(j) = 16j. Let u(r) = 4r. Let n(a) = -2m(a) + 9u(a). Let x(l) = -8l + 6. Let k(q) = -q + 1. Let s(v) = -6k(v) + x(v). Give n(s(c)). -8c Let m(k) = -k + k + 0k + k. Let f(y) be the first derivative of 0y + 1 + 0y2 + 4/3y*3. Give f(m(g)). 4g*2 Suppose -1 - 2 = -3g. Let u(o) = 1 + 6o - g. Let b(f) be the third derivative of f4/24 - 9f*2. Give u(b(n)). 6n Let a(i) = 11384i2. Let t(d) = 2d*2. Give t(a(l)). 259190912l*4 Let s(q) = -5q*2. Suppose 2 = -4h + 5h. Let y(u) = 3u*2 - 3u*h + 2u*2. Determine s(y(w)). -20w*4 Let l(d) = 87d - 15. Let r(s) = 22s - 4. Let c(o) = -4l(o) + 15r(o). Let x(q) = -9 - 68q*2 + 9 + 70q*2. Determine x(c(n)). 648n*2 Let m(i) = -12i. Let c(h) = -26h2 + 55h*2 - 33h*2. Determine m(c(x)). 48x*2 Let v(z) = -5z. Let u(f) = f*3 - 17f*2 + 17f - 16. Let b be u(16). Let k(i) be the second derivative of b + 1/3i3 + 0i*2 - 3i. Determine v(k(l)). -10l Let x(h) = -h. Let y(l) = 156l*2 + 32. Let i(r) = 24r*2 + 5. Let f(u) = 32i(u) - 5y(u). Determine x(f(j)). 12j*2 Let c(b) = 7b*2. Let x(l) = 304l*2 - 153l*2 - 152l**2.	{ "pile_set_name": "DM Mathematics" }
irst derivative of -2p2 - ap*4 + 2p*2 - 5 + 196p*4 wrt p. -36p*3 Suppose -3z = -51 - 6. Suppose z = w + 5m, m + 0m - 7 = -w. What is the second derivative of 6c4 + 5c*5 + c - 6c*w wrt c? 100c*3 Let j(u) = -20u*4 - 8u*3 - 6u - 1. Let v(r) = -39r4 - 15r*3 - 12r - 1. Let s(h) = 11j(h) - 6v(h). What is the second derivative of s(t) wrt t? 168t2 + 12t Let x(f) = -f + 3. Let p be x(1). What is the third derivative of -6o6 - 9o*2 + 2o*6 + 24op + o6 wrt o? -360o3 Let q(s) be the second derivative of -15s + 0s2 + 0s*3 + 2/5s*5 + 0 - 3/2s*4. Find the third derivative of q(j) wrt j. 48 Find the second derivative of -48n - 2965n5 + 2936n*5 - 5n + 1 - 5n4 wrt n. -580n*3 - 60n2 Let c(z) = -z2 - 1. Let r(h) = -2h2 - 5. Let y(m) = -17c(m) + 6r(m). Differentiate y(f) wrt f. 10f Let k(o) be the third derivative of 2o7/15 - o4/4 - 293o*3/6 - 501o*2. Differentiate k(r) with respect to r. 112r*3 - 6 Find the third derivative of -2b3 + b2 - 24b2 + 23b - 162b5 + 2b*3 - 26b wrt b. -9720b2 Let a(d) = d2 - d - 1. Let p be a(-2). Let y(q) = q3 - 2q*2 - 2q + 2. Let l be y(3). What is the derivative of 2s3 - 2 - ps*3 + ls*3 wrt s? 6s*2 Let c(t) be the second derivative of 0t*4 + 0 + 0t*3 - 23/20t*5 - 11t + 9/2t2. What is the first derivative of c(o) wrt o? -69o*2 Let d(m) be the third derivative of -53m*7/30 - 81m*5/20 + 35m*2 - 2. What is the third derivative of d(z) wrt z? -8904z Let w(p) = -57p3 + 2p*2 - 7p - 2. Let h(b) = b3 - b2 - b + 1. Let l(n) = -2h(n) - w(n). What is the second derivative of l(v) wrt v? 330v What is the first derivative of 177i2 - 30i*3 - i - 86i*2 - 91i*2 - 52 wrt i? -90i*2 - 1 Let r(n) = 17n*4 + 3n*2 + 100n - 3. Let b(j) = -2j4 - j3 - j2 - j + 1. Let l(g) = 3b(g) + r(g). Find the second derivative of l(h) wrt h. 132h2 - 18h Let b be (1 - 1)17/68. Let x(g) be the first derivative of 1 + bg + g*3 + 1/2g*2. What is the second derivative of x(z) wrt z? 6 Let u(m) be the second derivative of -25/12m*4 + 0 + 0m*2 - 19/30m*6 + 24m + 0m3 + 0m*5. Find the third derivative of u(n) wrt n. -456n What is the first derivative of -70 + 0u2 + 15u - 13 + 2u2 - u2 wrt u? 2u + 15 Let x be (-9)/(-5 - -2) - -4. Let y = 3 + x. What is the derivative of 7 - n*3 + 2n*3 - y wrt n? 3n*2 Suppose -h - 5a + 15 = -a, h = 3a - 6. What is the derivative of -h + 6 - 12f - 20f + 4 wrt f? -32 Let r(h) be the first derivative of -3h*7/70 - 5h*3/6 + 13h*2/2 - 15. Let f(z) be the second derivative of r(z). Find the first derivative of f(o) wrt o. -36o*3 Find the third derivative of 11r*2 + 20r*2 + 15r*2 + 46r*3 - 2r*4 - 2r*2 wrt r. -48r + 276 What is the third derivative of 7p3 - 12p*3 + 77p*3 - 50p*2 + 14p*3 - 19p*2 wrt p? 516 Suppose 2u = -10, -u + 3u + 58 = 3d. Find the second derivative of 153 - dc - 153 + 39c*3 wrt c. 234c Let r(h) be the second derivative of -71h4/12 + h3/3 - 70h*2 - 274h - 1. Find the second derivative of r(i) wrt i. -142 Let q(a) = 9a + 4. Let r(t) = -17t - 8. Let w be (-56)/(-6) - 4/(-6). Suppose 23 + w = 3f. Let y(m) = fq(m) + 6r(m). What is the derivative of y(l) wrt l? -3 Suppose -3 = -5x + 7. What is the first derivative of -xd - d + 2d + 3 wrt d? -1 Let h(o) be the third derivative of 19o6/24 + 31o*3/2 - 22o*2 + 4. What is the first derivative of h(c) wrt c? 285c*2 Let i(a) = -10a + 15. Let g = 66 + -68. Let t(s) = s - 1. Let w(p) = gt(p) - i(p). Find the first derivative of w(v) wrt v. 8 Suppose -48m = -50m + 6. Let z(v) be the second derivative of 0v*4 + 3/20v*5 + 2v + 0v2 - 1/6v*m + 0. What is the second derivative of z(j) wrt j? 18j Let n = -34 + 34. Find the second derivative of 0v2 + nv2 - v5 + v + 0v2 wrt v. -20v*3 Let f(m) be the first derivative of -3/2m*2 + 47 + 3/5m*5 + 0m*3 + 50m + 0m4. Differentiate f(k) with respect to k. 12k*3 - 3 Let c(w) be the first derivative of -13/3w*3 + 6w + 0w2 - 9. What is the derivative of c(f) wrt f? -26f Let f be ((-16)/20)/(1/(-30)). Let w = f + -21. Find the third derivative of -11 - 9 - 13tw + 20 - 6t*2 wrt t. -78 Let n(v) be the first derivative of 3v6 - v4/2 - 32v2 + 42. What is the second derivative of n(b) wrt b? 360b*3 - 12b Let c(j) be the third derivative of 29j5/30 - 403j*4/24 + 317j*2. What is the second derivative of c(h) wrt h? 116 Let y(j) = -495j*3 - 282j*2 - 4j - 4. Let f(h) = -h*3 + h + 1. Let m(v) = 4f(v) + y(v). What is the third derivative of m(x) wrt x? -2994 Let h(l) be the third derivative of 2l5/5 + 103l*3/3 - 198l*2. Differentiate h(v) wrt v. 48v Let t(d) be the third derivative of 0 - 8d2 + 0d - 1/6d5 - 5/24d*4 + 0d*3. Find the second derivative of t(z) wrt z. -20 Let h(b) be the second derivative of 0b*2 + 0 + 31/42b*7 + 29/6b*3 + 0b*5 + 0b*6 + 0b*4 - 6b. Find the second derivative of h(l) wrt l. 620l3 Let t(i) = i + 3. Let q be t(0). What is the first derivative of 3 + n3 + 7n*3 + 15n*3 + 0n*q wrt n? 69n*2 Let x(z) be the second derivative of -2z7/21 + z5/10 - 253z3/6 - 94z. Find the second derivative of x(j) wrt j. -80j3 + 12j Let l(s) = -2s4 - 5s*3 - 5s*2 - 7s - 25. Let r(o) = o4 + o3 + o*2 + o. Let h(g) = l(g) + 5r(g). What is the derivative of h(i) wrt i? 12i3 - 2 Let o(k) = -325k*4 + 8k*3 + 681. Let q(h) = 975h*4 - 26h*3 - 2043. Let w(t) = -13o(t) - 4q(t). Differentiate w(v) wrt v. 1300v*3 Find the first derivative of 24b*2 + 14b*2 + 48 + 11b*2 + 166 wrt b. 98b Let i(d) = 129d - 1. Let z(s) = 131s - 2. Let a(c) = -5i(c) + 4z(c). What is the derivative of a(v) wrt v? -121 Let b(c) = -5c3 - 5c*2 - 4c - 58. Let h(o) = -4o3 - 4o*2 - 3o - 57. Let z(l) = 3b(l) - 4h(l). What is the first derivative of z(t) wrt t? 3t2 + 2t Let k(m) = -m*2 - 17m - 21. Let u be (-56)/98 + (-115)/7. Let n(g) = 6g + 7. Let b(h) = un(h) - 6k(h). What is the first derivative of b(w) wrt w? 12w What is the third derivative of 83d3 + 67d*2 - 122d*2 + 2 + 75d*2 wrt d? 498 Let l(t) be the first derivative of 0t - 1/5t5 + 5/2t*4 - 11 - 4t*3 - 3/2t*2. What is the third derivative of l(k) wrt k? -24k + 60 Let h(z) be the third derivative of z*8/240 + 3z5/20 + z4 - 28z2. Let y(t) be the second derivative of h(t). Differentiate y(p) wrt p. 84p*2 Let b = 13 + -11. Suppose 0 = br + 4y - 52, -2r = -2y - 17 - 11. What is the first derivative of -20q*3 + 4 - 1 + rq*3 wrt q? -6q*2 Suppose -85 = 14n - 85. Let x(p) be the second derivative of 7/20p5 - 5/12p*4 + 0 + 0p*3 - 2p + np2. What is the third derivative of x(l) wrt l? 42 Let m(n) = 39n + 3. Suppose -4l + 44 = 12. Suppose -2i + l = 16. Let r(o) = 10o + 1. Let y(z) = im(z) + 15r(z). Differentiate y(v) with respect to v. -6 Let y(t) be the second derivative of 0 + 0t*2 + 7/5t*5 + 26t + 0t4 + 9/2t*3. What is the second derivative of y(j) wrt j? 168j Let x(v) be the third derivative of -11/30v5 + 0v*3 + 7v*2 + 0v*4 + 0v*6 + 0 + 13/105v*7 + 0v. Find the third derivative of x(n) wrt n. 624n Suppose 5z = -2v + 82, 8v - 128 = 4v - z. Let g = v + -18. Find the first derivative of 3 - g + 3p3 - p3 wrt p. 6p2 Find the second derivative of -154w - 185w2 + 150w + 188w + 99w + 4w2 wrt w. -362 Suppose m = 2m. Suppose m = 3b - 4 - 2. Find the third derivative of 3fb - f2 - 5f6 + 2f*2 wrt f. -600f*3 Let r(i) be the second derivative of 0i*2 + 9i + 0i3 - 4/5i*5 + 0 - 7/12i*4. Find the third derivative of r(l) wrt l. -96 Let v(y) = -54y*3 - 3y*2 - 4y - 7. Let c(g) = 53g3 + 3g*2 + 6g + 8. Let k(n) = 2c(n) + 3v(n). Find the third derivative of k(f) wrt f. -336 What is the second derivative of -10b4 - 5b*4 - 139b*4 + 90b wrt b? -1848b2 Let h be (-70)/(-15)(0 - -6). Let g = h - 23. What is the third derivative of -32xg - 12x*2 + 66x*5 - 30x*5 wrt x? 240x*2 Let z(t) = 80t*3 - 651t*2 + 8t - 4. Let w(p) = 161p3 - 1300p*2 + 14p	{ "pile_set_name": "DM Mathematics" }
third derivative of 8r2 - 132r*4 - wr*4 + 266r*4 + 49r*5 - 2r wrt r? 2940r2 What is the third derivative of -1101j + 1379j4 + 2212j - 1075j - 70j*2 wrt j? 33096j Let g(d) be the second derivative of 299d6/6 + 3745d*2/2 + 2091d. What is the derivative of g(i) wrt i? 5980i3 Let l(a) = -670a*3 - 15a - 23. Let q(m) = 671m3 + 13m + 24. Let y(f) = -3l(f) - 2q(f). Find the second derivative of y(u) wrt u. 4008u Let w(h) = 1414h*4 + 1358h*2 + 2h - 4. Let k(v) = -1416v4 - 1358v*2 - 3v + 6. Let s(b) = -2k(b) - 3w(b). Find the third derivative of s(m) wrt m. -33840m Let z(j) = 139j - 1001. Let o(m) = 4m - 1. Let x(k) = 6o(k) + 2z(k). Find the first derivative of x(c) wrt c. 302 Differentiate 188g*2 - 100g*2 + 5880 + 160g*2 - 140g*2 - 6g wrt g. 216g - 6 What is the third derivative of -1567 + 2p*2 + 510p*3 - 733 + 307p*3 - 79p*3 + 616p*3 wrt p? 8124 Let c(m) = -79m*3 - 11m*2. Let y(w) = -159w*3 - 23w*2. Let s = -8 - -2. Let x(z) = sy(z) + 11c(z). What is the third derivative of x(i) wrt i? 510 Let s(b) = 5b + 4. Let c be s(0). Let i(j) = -73j + 42. Let t(f) = f + 1. Let q(n) = ct(n) - i(n). Find the first derivative of q(m) wrt m. 77 Find the third derivative of -1041n2 + 2060n*2 - 1039n*2 - 6 - 1036n*5 wrt n. -62160n*2 Let b = -24176/5 - -4836. Let z(v) be the first derivative of 0v*4 + 5v*3 - bv*5 - 22 + 0v + 0v2. Find the third derivative of z(d) wrt d. -96d What is the third derivative of -7 - 81w2 + 17 - w + 59984w*3 - 68573w*3 wrt w? -51534 Let u = -185 - -250. What is the derivative of u - 15m + 11m - 11m - 15m wrt m? -30 Let c(g) = -68 - 68 - 63 - 18g + 266 - 174g2 - 63. Let x(o) = o2 - 2o. Let t(w) = -c(w) + 3x(w). What is the second derivative of t(m) wrt m? 354 What is the second derivative of -401438 + 477o*2 + 284o2 + o4 - 57o + 401442 wrt o? 12o*2 + 1522 Differentiate 772104a - 2975 + 1254a2 + 593 - 772104a with respect to a. 2508a Let s(z) = 3766z - 9308. Let p(l) = -22596l + 55769. Let u(k) = 6p(k) + 37s(k). Differentiate u(m) with respect to m. 3766 Let j(b) be the first derivative of 20b*4/3 + 251b*2/2 + 183b + 78. Let y(q) be the first derivative of j(q). What is the first derivative of y(i) wrt i? 160i Let q(y) = 80y - 152. Let r(f) = -39f + 76. Let k be (-18)/(-3) + (5 - 2)/(-3). Let p(d) = kr(d) + 2q(d). Differentiate p(l) wrt l. -35 Let i(n) be the third derivative of 1/14n*7 + 170n*2 - 13n*3 + 0 + 0n + 0n4 + 0n*6 + 1/60n*5. Differentiate i(k) with respect to k. 60k*3 + 2k Suppose -q + 0q + 3g + 49 = 0, -q + 2g = -52. Find the first derivative of 28p - 24p + q - 21p - 39p wrt p. -56 Let o(k) = -3k*2 + 42k + 4. Let h = 135 + -138. Let r(z) = -3z2 + 41z + 3. Let w(v) = ho(v) + 4r(v). What is the second derivative of w(f) wrt f? -6 What is the third derivative of -2p4 - 1100p*3 + 197688p*2 - 197695p*2 + 2p*4 + 88p + 5p5 - 4p*5 wrt p? 60p*2 - 6600 Let w be (-75)/(-20) + -4 + 2/8. Let l(c) = -2c + 14. Let j be l(w). What is the first derivative of -44 - 39 + 91 - jo3 wrt o? -42o*2 Let v(p) be the second derivative of 0p*3 + 0 + 0p*4 - 127/2p*2 + 1/4p*5 - 55p. Find the first derivative of v(s) wrt s. 15s2 Let i(b) = b2 + 13b - 1. Let p(m) = -368m2 + 1378m + 3. Let k(t) = -3i(t) - p(t). What is the second derivative of k(z) wrt z? 730 What is the third derivative of 3b*5 - 3218b*2 - 10581b*3 + 5337b*3 + 5593b*3 wrt b? 180b*2 + 2094 Let a(z) = 4938z + 3976. Let o(y) = -4y + 6. Let d(c) = -a(c) - 10o(c). Find the first derivative of d(k) wrt k. -4898 Let h(b) be the third derivative of -1531b9/252 - 1729b*5/30 + 31b*2 - 3b. What is the third derivative of h(a) wrt a? -367440a3 Let p(c) = 1036c*4 + 4c*3 + 4c*2 + 5. Let d(b) = -2b4 - b3 - b*2 - 3b - 1. Let j(l) = -4d(l) - p(l). What is the second derivative of j(m) wrt m? -12336m*2 Find the third derivative of 513p*2 - 358p*2 + 813p*2 + 1101p*2 + 4121p*6 + 2800p*2 wrt p. 494520p*3 Let r be (-69)/(-6) - (-7)/(-14)-3. Find the second derivative of -10 - 6k - 10k*3 - rk*3 + 29k*3 - 7k*5 - 12k*3 - 5k*3 wrt k. -140k*3 - 66k Let i(x) be the first derivative of -40x2 - 11/2x*4 + 0x - x*3 + 41. What is the second derivative of i(h) wrt h? -132h - 6 Let i(v) = 19v - 58. Let j be i(3). Let q(y) = -78y2 + y - 1. Let x(z) = -z2 + z. Let f(a) = jq(a) + 5x(a). Find the second derivative of f(m) wrt m. 146 Let l(b) be the second derivative of 7b6/30 - b5/2 - b4/3 + b3/2 + 1115b*2 + b - 10766. Find the second derivative of l(f) wrt f. 84f*2 - 60f - 8 Let q(n) be the third derivative of 31n8/336 - 8n*7/105 + 83n*4/24 + 2n*3/3 - 1865n*2 + 1. What is the second derivative of q(s) wrt s? 620s*3 - 192s*2 Find the third derivative of -1 - 4q + 577q4 + 4664q*4 + 5q - 568q2 wrt q. 125784q Let h(a) = 2a2 - 15a - 22. Let z be h(9). Find the third derivative of zl2 + 2l*3 - 41l*4 - 7l*4 - 68l*2 - 3l*2 wrt l. -1152l + 12 Let l(k) be the second derivative of -48k + 11/6k*4 + 1/2k*2 - 67/30k*6 + 0k*5 + 2 + 0k*3. What is the third derivative of l(z) wrt z? -1608z Suppose 3b = -2a + 53, -b + 6b - 95 = -5a. Differentiate -36z4 + 59z*4 + bz*4 + 22z*4 + 35 wrt z. 240z*3 Find the third derivative of -6 - 8 - 123f*2 + 14 - 196f*4 - 428f*4 wrt f. -14976f Let c = 218 - 39. Find the second derivative of cj - 90j + 7j3 - 91j - 11 wrt j. 42j Let t(f) be the second derivative of 8623f*4/12 + 13f*3/6 - 37f*2/2 + 518f + 4. Find the second derivative of t(q) wrt q. 17246 Let w be 24 - 19 - (-9)/(-3). Find the third derivative of 27fw - 37 + 17f*2 + 339f*3 + 35 wrt f. 2034 Let i(m) = -m + 68. Let v be i(22). What is the second derivative of 119o*2 - 9o + vo - 52o*2 wrt o? 134 Suppose -7g + 18 + 17 = 0. Suppose -u - 4u + 25 = -4w, gu - 25 = w. What is the third derivative of -21z*u + 4z*5 - 6z*5 + 7z*2 + 5z*5 wrt z? -1080z2 Let q(s) = s3 + 26s2 - 28s - 21. Let z be q(-27). Find the third derivative of j*3 + 5j*4 - 8 - zj*4 - 13 + 3j*2 + 19 wrt j. -24j + 6 Let k be (13 - 11) + 41/2. Differentiate 82 + 50v*4 + 3v*k - 14v*4 - 13 with respect to v. 156v*3 Let v = 1465 - 2123. Let d be 2/(-9) - v/126. What is the second derivative of 9i*5 + 3i + 5id - 4i wrt i? 280i3 Let f(s) be the second derivative of -s6/10 - s3/6 - 626s*2 - 8489s. Differentiate f(o) with respect to o. -12o3 - 1 Find the second derivative of -3c + 28571417 + 0c2 + 0c*2 + 4202c*3 - 28571094 wrt c. 25212c Let m(v) = 9v2 - 41v - 64. Let y be m(6). Let n(f) be the second derivative of 0 + 6f2 + 4/3f*3 - yf. Find the first derivative of n(p) wrt p. 8 Let n(t) be the third derivative of -t*7/105 - 667t6/120 + t5/20 + 10861t4/24 - 7447t*2. What is the second derivative of n(c) wrt c? -24c*2 - 4002c + 6 What is the second derivative of 1671g - 5g*3 - 683g*2 + 642g*2 + 64g - 56g wrt g? -30g - 82 Let w = -28 - -31. Suppose -c + 8 = wc. Differentiate 10 + 7k*2 + 5k*4 + 14 - 7k*c with respect to k. 20k*3 Let h be (13/((-26)/28))/(0 - 2). Let n(r) = r + 8. Let a be n(-4). Differentiate 25k*a - 4k*4 - 15 + hk*4 with respect to k. 112k3 Let v = 36 - 43. Let n(l) = -l2 - 9l - 6. Let s be n(v). Differentiate -11m + sm - m + 10m + 7 wrt m. 6 Let j(y) = -y*2 - 18y - 15. Let i be j(-14). Find the second derivative of 6 - 2u4 - 30u*4 - 7 + iu - 7u4 wrt u. -468u*2 Let u(v) = 3v*3 + 5v*2 + 2v. Let c(m) = 9672m4 + 15m*3 + 25m*2 + 10m + 7675. Let j(r) = c(r) - 5u(r). What is the derivative of j(w) wrt w? 38688w*3 Let t = -195 + 267. Find the first derivative of -t - 34q + 10q + 19q + 20q - 2q*3 wrt q. -6q*2 + 15 Let a(m) = 5630m*3 - 9m + 11912. Let q(h) = -12667h3 + 20h - 26802. Let x(y) = -20a(y) - 9q(y). Differentiate x(w) with respect to w. 4209w2 Let p(i) = -1. Let m(y) = 41y + 24. Let w(k) = -27k - 16. Let v(c) = -5m(c) - 8w(c). Let f(s) = -12p(s) - 3*v(s). Differentiate	{ "pile_set_name": "DM Mathematics" }
2 wrt v. 1584y2 Differentiate 6n*3w*2 - 863n*3 - 86nw3 wrt w. 12n*3w - 258nw*2 What is the third derivative of 1416a*4 + 539a*2 wrt a? 33984a Find the third derivative of 27j3n*3 + 2j*3n*2 + 12j*2n*3 + 1469j*2n*2 wrt n. 162j*3 + 72j*2 Find the third derivative of 23a*5y*2 - 28a*4y*3 - 335a*2y*3 wrt a. 1380a*2y*2 - 672ay3 Differentiate 270u*4 + 148 with respect to u. 1080u*3 Differentiate 209d*2 + 111 with respect to d. 418d What is the second derivative of -4i3o - 32i2o - 10io - o wrt i? -24io - 64o What is the third derivative of -4f*5 - 194f*4 + 46f*2 - 13 wrt f? -240f*2 - 4656f What is the third derivative of -514a6 + 287a*2 wrt a? -61680a*3 Find the second derivative of -12gi3k*2 - gi*3 - 634gi2 - 514gik*2 + 2gk wrt k. -24gi3 - 1028gi What is the second derivative of 13401q*2 - 8124q? 26802 What is the third derivative of -11092c4h - 36c2h + 17c wrt c? -266208ch What is the third derivative of -3136x*4 + 10x*2 - 405x? -75264x Find the second derivative of 799x*4 + 23x - 3. 9588x2 What is the second derivative of 231a*3s*2 - 2a*3s - 7a3 + a2 wrt s? 462a*3 What is the third derivative of 68d*6 - 2d*3i*2 - 5d3 - d2 + 882i2 wrt d? 8160d*3 - 12i*2 - 30 What is the first derivative of -406k - 288 wrt k? -406 What is the second derivative of -4u4 + 92u*3 - 8931u? -48u2 + 552u Find the third derivative of 179a3 + 17a*2 wrt a. 1074 What is the third derivative of 1058x*5 - 1258x*2 + 2x? 63480x2 Find the third derivative of -1465o*6 + 179o*2 + 3. -175800o*3 What is the third derivative of -5s*4 - 121s*3 + 8528s*2? -120s - 726 What is the second derivative of 2556j2y*2 - 90jy2 - y2 + y wrt j? 5112y*2 What is the first derivative of 422z*4 - z + 280? 1688z3 - 1 Differentiate -f2l + flv + 55fl + fv + 7lv - 14l - 3v with respect to f. -2fl + lv + 55l + v Find the second derivative of 19g2x + 33g2 + 225gx + 4g wrt g. 38x + 66 Differentiate 2644o*2 - 2o - 5141 wrt o. 5288o - 2 Find the third derivative of -560h4 + h3 + 174h2 + h wrt h. -13440h + 6 Find the second derivative of -2h3k*3 + 3h*3 + 3hk + 34k*4 - 2 wrt k. -12h*3k + 408k2 Find the third derivative of -1528u*6 - 2u*2 - 275 wrt u. -183360u*3 Find the second derivative of 887b*3 - 2b*2h*2 - 8b*2h + 4bh*2 + 82b + 1 wrt b. 5322b - 4h*2 - 16h What is the derivative of -v*3 + 487v*2 - 615 wrt v? -3v*2 + 974v Differentiate -33u2 - 8u + 841. -66u - 8 What is the third derivative of 208a*3w*3 + 4a*3w + 2w3 - 62w*2 wrt w? 1248a*3 + 12 Find the third derivative of -247m*3 - 5m*2 - 6. -1482 Find the third derivative of -21r*2v3 + r2 + 3rv*3 - 10v*2 wrt v. -126r*2 + 18r What is the derivative of -2h2 - 909h + 2005 wrt h? -4h - 909 What is the third derivative of 2475p*4 - 6162p*2? 59400p Differentiate -1328v2 + 72 with respect to v. -2656v What is the second derivative of -t*3 - 82t*2 + 215t wrt t? -6t - 164 What is the second derivative of -16r*3s*2x + 25r2s*2x - 3rs*2x + 2rs*2 - 9rsx + x wrt r? -96rs*2x + 50s2x What is the derivative of 36m2r*2 - 12m*2 - 3mr2 wrt r? 72m*2r - 6mr What is the third derivative of 524h6 + 180h*2 + 2 wrt h? 62880h*3 What is the second derivative of -26jv2 + 40jv + 57v*2 - 20v wrt v? -52j + 114 Differentiate -j3 + 33j*2 + 195. -3j*2 + 66j Find the third derivative of -28k4 - 14k*3 - 510k*2. -672k - 84 Differentiate 157f + 208. 157 Find the third derivative of 1210p*6 + 2p*5 - 2p*3 + 4236p*2 wrt p. 145200p*3 + 120p*2 - 12 What is the second derivative of -2y*3 - 121y*2 + 122y? -12y - 242 Find the first derivative of -52h*2 + 274 wrt h. -104h What is the derivative of 100n3p - 4n3 + 29p - 3 wrt n? 300n2p - 12n2 What is the first derivative of 5r*2s*2 - 276r*2 + 74rs2 + s2 wrt s? 10r*2s + 148rs + 2s What is the third derivative of 4442gj3 - 3g + 30j2 - 9 wrt j? 26652g Differentiate -3k3mr2 - k3 - 2k*2r2 + m2 - 13mr*2 - 2r*2 + 98r wrt m. -3k3r*2 + 2m - 13r2 Differentiate -147b - 57. -147 What is the derivative of a*2ci + 9a*2di + 81a*2 + acdi + 2cdi - 2ci wrt d? 9a*2i + aci + 2ci Find the third derivative of -752r4 + 436r*2. -18048r What is the third derivative of 5b3h*2t*3 + 104b*3t*3 + 23b*2h*2t*3 + 4b*2h*2t - b*2ht3 + 2bt3 wrt b? 30h*2t*3 + 624t*3 Find the first derivative of 2039w + 2286. 2039 What is the third derivative of 2m4 + 156m3 + m2 - 106 wrt m? 48m + 936 What is the third derivative of 4114o*6 - 5627o*2 wrt o? 493680o3 Find the first derivative of -k4 - 347k3 + 31k - 21730 wrt k. -4k3 - 1041k*2 + 31 What is the third derivative of -2m*3t*3z*3 - 6m*3t*2z*3 - 4m*3tz - 38m*2t*3z*2 - 2mz3 wrt t? -12m*3z*3 - 228m*2z2 What is the third derivative of -o4p2 + 31o4 - o3p - 3o*2p*2 - 30o*2 - 3o wrt o? -24op*2 + 744o - 6p What is the third derivative of 283c*5 + 17c*4 - 2c*2 - 1920 wrt c? 16980c*2 + 408c What is the derivative of 5fs*3 - 65fs2 - 2475s*3 wrt f? 5s*3 - 65s*2 What is the third derivative of 12304j*3n*3 - 1329j*3n*2 + 5j*3 wrt n? 73824j*3 Differentiate 338b*4p*2 + 1193p*2 with respect to b. 1352b*3p*2 Find the second derivative of -3d*3f*2n - 83d3 + 18df2 - 2f - 2n wrt f. -6d*3n + 36d Differentiate -315f3 - f2 + 3f + 6309 wrt f. -945f*2 - 2f + 3 Find the second derivative of 9b3 - 35b*2x + b*2 + 10b - 5x wrt b. 54b - 70x + 2 What is the derivative of -2q*2 + 37qr + 83r - 1 wrt q? -4q + 37r Find the second derivative of 18m2z*2 - 156m*2 + 12mz2 - 5mz + 3z*2 - 2z wrt z. 36m2 + 24m + 6 What is the derivative of -10864a2d4 - a2 + 45a + 2 wrt d? -43456a*2d*3 What is the second derivative of 28s*2 - 597s? 56 What is the second derivative of -f*3l - 3f3 - 547f*2l - 7fl + 24f - 2l + 2 wrt f? -6fl - 18f - 1094l Find the second derivative of -g*4 + 12g*2q - 2g2 - 208gq + g wrt g. -12g*2 + 24q - 4 Find the second derivative of 14z3 + 11z*2 + 1312z. 84z + 22 Find the second derivative of -10b*3hu2 - 2b*3hu + 63b*3h - b*3u + 143b2hu2 - 3b*2hu - bhu wrt u. -20b*3h + 286b2h Find the third derivative of 3i6 - 8i*5 - 65i*2 + i wrt i. 360i*3 - 480i2 Find the third derivative of i3t5 - 2i*3t*2 + 5i*2t*5 + i - 11t*2 wrt t. 60i*3t*2 + 300i*2t*2 What is the second derivative of 77g*5 - 2g*3 + 3g*2 - 2012g + 3? 1540g3 - 12g + 6 What is the second derivative of -77k3 + 75k*2 + 2k + 1613? -462k + 150 What is the third derivative of 10b*5 + 2b*3 + 2b*2 + 16? 600b2 + 12 Find the second derivative of i3q2 + 185i*2q3 - i2q - 7i*2 + 779iq3 wrt i. 6iq2 + 370q*3 - 2q - 14 Find the third derivative of 2no*4x*2 - 8no4 - 4no3x - 2nox2 - nx*2 + 3o*2x*2 wrt o. 48nox*2 - 192no - 24nx Find the first derivative of -4c*4 - 101c - 15365 wrt c. -16c3 - 101 What is the second derivative of 266p4 + p3 - 4682p? 3192p*2 + 6p What is the second derivative of 1738g4 - 1495g? 20856g2 Find the second derivative of -96f*3x*2 - 256f*3x + 12fx*4 - 3 wrt x. -192f*3 + 144fx2 Find the first derivative of 75w + 635 wrt w. 75 Differentiate -3a3 + a2 + 6a - 5042. -9a2 + 2a + 6 What is the second derivative of 2j2s*2 - 1039j*2s - 3js*2 - j + 2s + 78 wrt j? 4s2 - 2078s Differentiate -819c + 25. -819 Find the second derivative of 13258c*2 + 10354c wrt c. 26516 What is the third derivative of 3a2c*3s*2 + 2a*2c3 + a2 - 2acs2 - c2 - 22s*2 wrt c? 18a*2s*2 + 12a2 What is the derivative of o3 - 261o - 460? 3o**2 - 261 What is	{ "pile_set_name": "DM Mathematics" }
- 5 What is the p'th term of -10, -21, -46, -91, -162, -265, -406? -p3 - p2 - p - 7 What is the s'th term of -102, -124, -136, -132, -106, -52, 36, 164? s3 - s2 - 26s - 76 What is the o'th term of 46, 85, 124? 39o + 7 What is the i'th term of 187, 376, 565, 754, 943, 1132? 189i - 2 What is the l'th term of -98, -278, -562, -938, -1394? 2l*3 - 64l*2 - 2l - 34 What is the z'th term of 17, 6, -5, -16, -27, -38? -11z + 28 What is the q'th term of -29, -15, 1, 19, 39? q2 + 11q - 41 What is the w'th term of 604, 1213, 1822, 2431, 3040? 609w - 5 What is the m'th term of 14, -7, -54, -139, -274? -2m3 - m2 - 4m + 21 What is the p'th term of -941, -942, -943? -p - 940 What is the p'th term of 32, 65, 98? 33p - 1 What is the t'th term of -44, -142, -292, -488, -724? t*3 - 32t*2 - 9t - 4 What is the d'th term of -4, -10, -30, -70, -136, -234? -d3 - d2 + 4d - 6 What is the s'th term of -40, -84, -128? -44s + 4 What is the f'th term of 135, 269, 403? 134f + 1 What is the k'th term of -7, -12, -15, -16, -15, -12? k2 - 8k What is the o'th term of -25924, -51847, -77770, -103693, -129616? -25923o - 1 What is the k'th term of -16707, -16705, -16703, -16701, -16699? 2k - 16709 What is the w'th term of 1, -15, -21, -11, 21? w3 - w2 - 20w + 21 What is the h'th term of -21, -31, -33, -27? 4h*2 - 22h - 3 What is the p'th term of 239, 941, 2113, 3755? 235p2 - 3p + 7 What is the f'th term of -295, -248, -201, -154, -107, -60? 47f - 342 What is the v'th term of -37, -28, -19? 9v - 46 What is the u'th term of 63, 276, 635, 1140, 1791, 2588? 73u2 - 6u - 4 What is the r'th term of -104, -131, -158? -27r - 77 What is the k'th term of 189, 388, 591, 798? 2k*2 + 193k - 6 What is the h'th term of -13, 35, 73, 95, 95? -h3 + h2 + 52h - 65 What is the z'th term of 4243, 4234, 4213, 4174, 4111, 4018? -z3 - 2z + 4246 What is the l'th term of 2, -10, -38, -88, -166, -278, -430? -l*3 - 2l*2 + l + 4 What is the y'th term of 327, 309, 279, 237, 183, 117, 39? -6y*2 + 333 What is the j'th term of 51, 100, 149, 198, 247? 49j + 2 What is the g'th term of 833, 831, 829, 827, 825, 823? -2g + 835 What is the s'th term of -2, 18, 50, 94? 6s*2 + 2s - 10 What is the d'th term of 613, 587, 561, 535? -26d + 639 What is the q'th term of 169, 327, 485? 158q + 11 What is the x'th term of -484, -1909, -4284, -7609? -475x2 - 9 What is the c'th term of -69, -108, -145, -180, -213, -244, -273? c2 - 42c - 28 What is the x'th term of -488, -482, -464, -428, -368? x3 - x - 488 What is the u'th term of 404, 412, 430, 464, 520, 604, 722? u3 - u*2 + 4u + 400 What is the f'th term of 52, 73, 94, 115, 136, 157? 21f + 31 What is the m'th term of -395, -452, -495, -518, -515, -480, -407, -290? m3 + m2 - 67m - 330 What is the w'th term of 222, 450, 678, 906? 228w - 6 What is the m'th term of 1471, 2917, 4351, 5767, 7159, 8521? -m3 + 1453m + 19 What is the t'th term of -16, -14, -10, -4? t*2 - t - 16 What is the b'th term of 23, 28, 33, 38, 43, 48? 5b + 18 What is the i'th term of 390, 783, 1176, 1569, 1962? 393i - 3 What is the i'th term of -3447, -3448, -3449, -3450, -3451? -i - 3446 What is the z'th term of -4, -10, -16, -22? -6z + 2 What is the l'th term of 257, 239, 221, 203? -18l + 275 What is the a'th term of 12, 9, 10, 21, 48? a3 - 4a*2 + 2a + 13 What is the p'th term of 4, -23, -98, -245, -488, -851? -4p3 + p + 7 What is the c'th term of -437, -401, -365, -329? 36c - 473 What is the c'th term of -4285, -4286, -4287, -4288, -4289, -4290? -c - 4284 What is the a'th term of 244, 251, 258, 265? 7a + 237 What is the z'th term of -82, -165, -248, -331, -414? -83z + 1 What is the m'th term of 19, 21, 25, 31, 39, 49? m*2 - m + 19 What is the n'th term of -13, 12, 85, 230, 471, 832, 1337? 4n*3 - 3n - 14 What is the v'th term of -15, -7, 15, 57, 125? v3 + v2 - 2v - 15 What is the y'th term of -27, -56, -85? -29y + 2 What is the o'th term of -592, -593, -594? -o - 591 What is the n'th term of 6, 35, 84, 153, 242, 351? 10n2 - n - 3 What is the n'th term of 111, 116, 121? 5n + 106 What is the r'th term of -174, -201, -240, -285, -330, -369? r*3 - 12r*2 + 2r - 165 What is the z'th term of -22, 0, 22, 44? 22z - 44 What is the y'th term of 46, 94, 142? 48y - 2 What is the u'th term of 67, 97, 175, 325, 571, 937, 1447, 2125? 4u3 + 2u + 61 What is the s'th term of 108, 209, 310, 411? 101s + 7 What is the c'th term of -29, -70, -139, -236, -361, -514? -14c2 + c - 16 What is the p'th term of 0, 0, -2, -6, -12? -p2 + 3p - 2 What is the v'th term of 81, 161, 241, 321? 80v + 1 What is the z'th term of 52, 157, 332, 589, 940, 1397, 1972, 2677? 2z3 + 23z*2 + 22z + 5 What is the n'th term of 358, 720, 1082, 1444, 1806? 362n - 4 What is the o'th term of 112, 220, 328? 108o + 4 What is the o'th term of -102, -204, -306, -408, -510, -612? -102o What is the r'th term of -96, -77, -46, -3, 52, 119? 6r2 + r - 103 What is the q'th term of -34, -85, -156, -253, -382, -549, -760, -1021? -q3 - 4q2 - 32q + 3 What is the i'th term of -29, -48, -69, -92, -117? -i*2 - 16i - 12 What is the u'th term of -391, -393, -395, -397, -399? -2u - 389 What is the k'th term of -182, -220, -258, -296, -334? -38k - 144 What is the i'th term of 17, 40, 101, 218, 409, 692? 3i3 + i2 - i + 14 What is the o'th term of 169, 333, 503, 679, 861, 1049? 3o*2 + 155o + 11 What is the m'th term of -34, -63, -92, -121, -150? -29m - 5 What is the p'th term of 16, -3, -20, -35, -48? p2 - 22p + 37 What is the n'th term of 634, 636, 638, 640, 642? 2n + 632 What is the b'th term of -14, -11, -8, -5, -2, 1? 3b - 17 What is the p'th term of -439, -879, -1319, -1759, -2199? -440p + 1 What is the k'th term of 17, 75, 173, 311, 489, 707? 20k*2 - 2k - 1 What is the f'th term of -28, -42, -66, -106, -168, -258, -382? -f3 + f2 - 10f - 18 What is the l'th term of 17, 25, 33, 41, 49? 8l + 9 What is the a'th term of -23, -34, -47, -62, -79? -a*2 - 8a - 14 What is the a'th term of -242, -490, -738, -986? -248a + 6 What is the y'th term of 25, 33, 53, 91, 153, 245? y3 + y + 23 What is the s'th term of 26, 39, 64, 107, 174? s3 + 6s + 19 What is the o'th term of 25, 44, 57, 64, 65, 60, 49? -3o2 + 28o What is the n'th term of 37, 183, 423, 757, 1185, 1707? 47n2 + 5n - 15 What is the u'th term of 53, 104, 155, 206, 257, 308? 51u + 2 What is the i'th term of 704, 703, 702, 701, 700, 699? -i + 705 What is the r'th term of -106, -111, -116, -121? -5r - 101 What is the k'th term of 283, 284, 285, 286? k + 282 What is the m'th term of 430, 398, 356, 298, 218? -m3 + m2 - 28m + 458 What is the u'th term of 43, 54, 65? 11u + 32 What is the l'th term of -48, -93, -128, -147, -144, -113, -48, 57? l3 - l2 - 49l + 1 What is the d'th term of 1816, 3647, 5490, 7351, 9236? d3 + 1824d - 9 What is the i'th term of -52, -110, -180, -268, -380, -522? -i*3 - 51i What is the s'th term of -10, -22, -42, -70, -106, -150? -4s2 - 6 What is the s'th term of -932, -1862, -2792, -3722? -930s - 2 What is the d'th term of 162, 309, 470, 651, 858? d3 + d2 + 137d + 23 What is the p'th term of 2705, 5413, 8121, 10829, 13537, 16245? 2708p - 3 What is the y'th term of 647, 1293, 1939? 646y + 1 What is the q'th term of -74, -67, -56, -41? 2q2 + q - 77 What is the f'th term of 68, 106, 140, 164, 172, 158, 116? -f3 + 4f2 + 33f + 32 What is the m'th term of 6, 8, 12, 18? m*2 - m + 6 What is the w'th term of -230, -506, -782, -1058, -1334, -1610? -276w + 46 What is the p'th term of 28, 60, 142, 298, 552, 928? 4p3 + p2 + p + 22 What is the p'th term of -66, -79, -102, -141, -202, -291, -414? -p3 + p2 - 9p - 57 What is the s'th term of -14, -27, -36, -41, -42, -39? 2s2 - 19s + 3 What is the h'th term of 157, 156, 153, 148, 141, 132, 121? -h*2 + 2h + 156 What is the g'th term of -2140, -8552, -19240, -34204, -53444, -76960, -104752? -2138g2 + 2g - 4 What is the x'th term of 3, 11, 25, 45? 3x2 - x + 1 What is the l'th term of 37, -63, -229, -461, -759? -33l*2 - l + 71 What is the h'th term of -578, -1173, -1768, -2363, -2958? -595h + 17 What is the g'th	{ "pile_set_name": "DM Mathematics" }
) + 3i(v). Factor k(a). 3(a + 1)(a + 8) Let w = -3344185/11 + 304017. Solve wm*2 - 10/11m + 8/11 = 0 for m. 1, 4 Suppose 5o + q + 178 - 64 = 0, 88 = -4o - 4q. Let l be 32 + o + 2-3. Suppose 10/9k4 - 8/9 - 2/9k*5 - 2/9k*2 - 14/9k*l + 16/9k = 0. What is k? -1, 1, 2 Let i(r) be the second derivative of 12r2 + 4/5r*6 + 19/2r*4 - 1/14r*7 - 14r*3 + 0 + 51r - 15/4r5. Factor i(q). -3(q - 2)*3(q - 1)*2 Let a be (4 - -1)24/10. Suppose -7x - 45 = -ax. Solve -x - 25r + 2 - 13 - 5r*2 = 0. -4, -1 Find p such that -312p*2 - 3 + 147p*4 - 180p + 1277p2 - 539p*2 - 420p*3 + 30 = 0. 3/7, 1 Let g(u) be the first derivative of 28 + 1250/9u + 2/27u3 - 50/9u*2. Factor g(f). 2(f - 25)*2/9 Suppose -240218y + 240094y + 372 = 0. Suppose -1/2d*5 - 25 + 5d*3 - 26d*2 - 105/2d + yd4 = 0. Calculate d. -2, -1, 5 Let z(k) be the third derivative of -k5/30 + 7k*4 - 83k*3/3 + 497k*2. Factor z(i). -2(i - 83)(i - 1) Let i(r) be the second derivative of r4/6 + 445r*3/3 - 894r*2 - 11r + 314. Factor i(z). 2(z - 2)(z + 447) Let p(z) be the third derivative of 5z7/28 - 21z*6/8 + 57z*5/5 - 79z*4/8 + 15z3/4 - z2 - 27z + 32. What is r in p(r) = 0? 1/5, 3, 5 Let t be 0/(-1(2 + 0)). Suppose -10l = 5j - 9l - 244, -j + 64 = 4l. Find b, given that 4b4 - 23b + jb2 + 0b*4 + tb*3 - 9b - 24b3 = 0. 0, 2 Suppose 0 = -3r + 3, -3s - 77r + 78r = 1. Let m(z) be the second derivative of 0z*2 + sz*3 + 0 + 1/5z*5 - 9z + 0z4. Factor m(c). 4c*3 Suppose 0 = -2s + 4i + 8, -5i = s + 6 - 3. Find u, given that -8u3 - 23u*3 - 25u - 4u3 + 5u*4 + 55us = 0. 0, 1, 5 Let a(n) be the first derivative of -n3/4 - 3n2/8 + 3n/2 - 1376. Find p such that a(p) = 0. -2, 1 Let q(n) be the third derivative of -2 + 3/40n6 - 3/8n*4 - 13n*2 + 0n - 1/4n5 + 2n*3 + 1/70n*7. What is l in q(l) = 0? -4, -1, 1 Let u(g) = 27g*2 - 189g - 2035. Let o(d) = 5d2 - d + 1. Let t(i) = 10o(i) - 2u(i). Suppose t(j) = 0. Calculate j. -10, 102 Let o be 13/(-1)(7 - (-966)/(-182) - 2). Solve -27/4a3 - 19/4a2 + 0 + a5 - a - 2ao = 0 for a. -1, -1/2, 0, 4 Let g(k) = 55k*4 - 212k*3 + 1782k*2 - 4752k + 4107. Let o(z) = -36z4 + 212z*3 - 1782z*2 + 4752z - 4106. Let x(b) = 2g(b) + 3o(b). Factor x(f). 2(f - 3)2(f - 2)(f + 114) Let u(w) be the first derivative of 2w*6/3 + 12w*5 + 63w*4 + 108w*3 + 78. Let u(n) = 0. Calculate n. -9, -3, 0 Suppose -l - 9l + 45 = -3a - 7l, 17l - 289 = 0. Factor 2/3g*3 + 19/2g - 14/3ga - 6. (g - 4)(2g - 3)2/6 Suppose -310 = -23l + 472. Suppose -lp + 102 = -0p. Factor -2/3w4 + 0w + 0 + 4/3w2 + 2/3w*p. -2w*2(w - 2)(w + 1)/3 Let d(q) be the second derivative of q6/6 - 5q*5/4 - 140q*4/3 - 490q*3/3 - 1019q. Determine m so that d(m) = 0. -7, -2, 0, 14 Let a(k) be the third derivative of -k*5/180 + 365k*4/72 - 521k*2. Factor a(l). -l(l - 365)/3 Determine x, given that 110592 + 168x2 - 2007x - 6350x + 195x*2 + 1121x - 5436x = 0. 192/11 Let l(j) be the second derivative of -j5/12 - 25j*4/24 - 5j3 - j2/2 - 14j. Let x(y) be the first derivative of l(y). Factor x(f). -5(f + 2)(f + 3) Suppose 3j - 31 = -5i, 2i = 13 - 3. Determine y so that -18y + 41 + y2 + 0y*j + 0 + 4 = 0. 3, 15 Let g be ((-11 - -3)/(-4))/((-16)/(-24)). Determine t so that -18 + 2t*5 + 10t*4 - 6t*3 + 20t*2 - 12t*4 + 2t*g + 18t - 16t3 = 0. -3, -1, 1, 3 Let s(w) be the third derivative of w6/300 - 8w*5/75 - 77w*4/60 - 4w3 + w2 + 1549w. Factor s(n). 2(n - 20)(n + 1)(n + 3)/5 Let i(j) be the third derivative of -5j8/336 - j7/6 + j6/12 + 23j*5/6 - 325j*4/24 + 125j*3/6 - 62j*2. Factor i(w). -5(w - 1)*3(w + 5)*2 Solve 135f - 9/2f4 - 54f*2 - 39f*3 - 75/2 = 0. -5, 1/3, 1 Let d be 1/(-2)0/151. Let u(c) be the first derivative of dc4 - 18/7c*2 - 22/21c*3 - 16/7c + 2/35c5 + 6. Find k, given that u(k) = 0. -2, -1, 4 Let s be ((-14)/(-28))/(1/6). Find v such that 985v*s + 4v*4 + 28v*2 - 32 - 1009v*3 + 5v + 27v - 8v = 0. -1, 1, 2, 4 Let n be ((-38)/(-475))/((-20)/(-110) - 12/(-55)). Solve -9/5g - 14/5 - ng*2 = 0. -7, -2 Let v be -38 + 87 - (5 + -2). Suppose -38z*3 + 40z*2 - 12 + 27z*3 + 29z*3 - vz = 0. Calculate z. -3, -2/9, 1 Let m be (186 + (-180700)/973)/(6/(-14) + 1). Solve -9/2s2 + 0 - ms*3 - 4s = 0. -8, -1, 0 Suppose -124f2 - 30f*3 - 184/3f + 54f4 - 16/3 = 0. What is f? -2/3, -1/9, 2 Suppose 487 = 6o + 259. Factor 18p2 - 17p*2 + o - 20 - 9p. (p - 6)(p - 3) Suppose 0 = 53b + 54 - 266. Let t(u) be the second derivative of 1/90ub + 0 - 4u - 4/15u2 + 0u*3. Factor t(y). 2(y - 2)(y + 2)/15 Let f = -564802 + 273364895/484. Let l = f - 1/484. Suppose -3/2n*2 + ln*3 - 3/2n + 3/2 = 0. What is n? -1, 1 Suppose 12d + 2d = 14. Suppose -65b - d = -1. Factor 0 - 2/9a*3 + 0a*2 + 2/9a*5 + ba + 0a4. 2a*3(a - 1)(a + 1)/9 Let w be (-1)/2 + 45/10. Factor -2a + 5a + wa - 4a3 + a + 4a*2. -4a(a - 2)(a + 1) Let a(r) be the first derivative of -2r5/15 + 7r*4/3 - 106r*3/9 + 16r*2/3 + 56r + 5334. Solve a(s) = 0 for s. -1, 2, 6, 7 Let a(f) = 11f4 - 11f*3 - 2f*2 - 4. Let l(g) = -9g*4 + 9g*3 + 3g*2 + 3. Let o(k) = 3a(k) + 4l(k). Suppose o(h) = 0. What is h? -1, 0, 2 Let t(p) be the first derivative of 5/6p*4 - 4 + 1/12p*5 + 10/3p*3 + 0p - 39/2p2. Let c(z) be the second derivative of t(z). Solve c(j) = 0. -2 Suppose 0 = 59g - 42g - 255. Suppose 5s - y = 25, 16s - y + g = 19s. Solve 3j4 + 0j + 4/3js + 1/3j*2 + 2j*3 + 0 = 0 for j. -1, -1/4, 0 Suppose -2l + 0d + 7 = -3d, l = d + 3. Factor -152y3 - 4y*l + 148y*3 - 2y + 0y4 - y4 - y2. -y(y + 1)*2(y + 2) Suppose -9f + 2f = -105. Suppose 180s3 + 170s*2 + 37s*5 - fs*5 + 21s*4 + 55s + 49s4 - 17s*5 = 0. What is s? -11, -1, 0 Let a(o) be the second derivative of 0 + 0o*2 + 0o*3 + 62o - 1/70o5 + 1/14o*4. Factor a(c). -2c*2(c - 3)/7 Let l(f) = -3f2 + 18f - 45. Let s be l(3). Let g be 29 + -23 + 100/s. Factor 2/3 - 2/9j2 + gj. -2(j - 3)(j + 1)/9 Determine t so that -11305t + 54473 - 71t*2 + 826t*2 - 14048 + 5t*3 = 0. -165, 7 Let c(w) = -3w4 + w3 + 2w2 - 4w + 1. Let l(t) = 16t4 + 13t*3 + 59t*2 - 68t - 5. Let a(k) = -10c(k) - 2l(k). Factor a(q). -2q(q - 1)(q + 8)(q + 11) Let y(q) be the first derivative of 5q3/3 - 565q*2/2 - 1879. Factor y(p). 5p(p - 113) Let g(p) = 27p*4 + 501p*3 + 232p*2 + 20p + 5. Let s(q) = q4 - q3 + 2q2 + 2q - 1. Let b(t) = -g(t) - 5s(t). Factor b(k). -2k(k + 15)(4k + 1)2 Let g(h) be the first derivative of 1/3h*3 - 27/2h*2 + 0h + 186. Factor g(o). o(o - 27) Let o(c) be the first derivative of 0c*2 - 6 + 0c*4 + 1/20c*5 - 10c - 1/6c3. Let a(n) be the first derivative of o(n). Factor a(w). w(w - 1)(w + 1) Suppose 88 = -a + 92. Suppose 604s - 299s - 305s - 5sa + 5s*2 = 0. What is s? -1, 0, 1 Let n(c) be the second derivative of 1/3c*3 + 1/3c*4 + 0c*5 + 0c*2 - 2/15c*6 + 37c + 0 - 1/21c7. Determine v, given that n(v) = 0. -1, 0, 1 Factor -13428/7p*2 - 5604672636/7 + 15025932/7p + 4/7p3. 4(p - 1119)*3/7 Let b(i) be the second derivative of -7i*5/5 - 1027i*4/3 + 196i*3 - 831i. Suppose b(o) = 0. Calculate o. -147, 0, 2/7 Factor 224g2 - 1520g + 145g2 + 20g*3 + 70 + 367g*2 - 144g*2 + 442. 4(g - 2)(g + 32)(5g - 2) Solve -1/3s + 6s2 + 1/3s3 - 6 = 0 for s. -18, -1, 1 Let z(x) = x2 - 411x - 4022. Suppose -2p + 2h = 26, -13p = -11p + h + 20. Let y(r) = -r2 + 206r + 2012. Let l(t) = py(t) - 6z(t). Factor l(w). 5(w + 20)2 Let f(a) be the third derivative of -a7/420 - 2a*6/45 + 3a*5/20 - 81a3/2 - a2 - 20. Let b(v) be the first derivative of f(v). Factor b(p). -2p(p - 1)(p + 9) Suppose -112/3 + 2/9x*3 + 28/9x*2 - 310/9x = 0. What is x? -21, -1, 8 Let l(r) be the second derivative of -2r + 2/5r*2 - 1/15r*4 + 1/25r*5 - 52 - 2/15r3. Let l(x) = 0. What is x? -1, 1 Let t(j) be the second derivative of j4/15 + 164j3/3 - 822j**2/	{ "pile_set_name": "DM Mathematics" }
. Let v(m) be the third derivative of m*4/6 - 25m*2. Determine s(v(j)). -160j*2 Let k(d) = -4d*2. Let p(y) = -3y*2. Let t(u) = -6k(u) + 7p(u). Let l(q) = 7q. What is t(l(j))? 147j2 Let y(c) = c. Let r(h) = 12h. Let d(v) = -2r(v) + 27y(v). Let m(u) = -3u2. Calculate d(m(o)). -9o2 Let l(w) be the first derivative of w3/3 + 18. Let z = 1 + 2. Let c(q) = -3q - 2q + zq. Determine l(c(g)). 4g*2 Let d(m) = -8m*2. Let x(y) = -3y + 3 - 3 + y2. Let g(k) be the second derivative of k4/12 - 5k3/6 - 10k. Let v(a) = -3g(a) + 5x(a). Give d(v(t)). -32t4 Let c(p) = 1 - 3 + 1. Let k(s) be the second derivative of -s3/6 + 5s*2/2 + s. Let u(x) = 5c(x) + k(x). Let g(r) = r2. What is u(g(b))? -b2 Let b(h) = h + 63. Let s(u) = -u2. What is b(s(v))? -v2 + 63 Let k(p) be the first derivative of -23p2/2 - 29. Let c(a) = 2a*2. Give c(k(n)). 1058n*2 Let d(b) = 3b - 2. Suppose 4j + 3s = 16, j + 1 = -5s + 5. Let y(k) = -4k + 3. Let m(c) = jy(c) + 6d(c). Let g(p) = 2p. What is g(m(h))? 4h Let v(l) = 4l2. Let h(b) be the second derivative of 2b*4/3 - 16b. Give v(h(m)). 256m4 Let b(q) be the second derivative of -q4/12 + 5q*3/6 + 30q. Let t(k) = k. What is t(b(d))? -d*2 + 5d Let g(d) = d - 838. Let m(s) = s. Give m(g(l)). l - 838 Let v(c) = 234c. Let r(u) = -2u*2. Determine v(r(f)). -468f*2 Let o(x) = -9x - 5. Let g(m) = -14m - 8. Let n(k) = 5g(k) - 8o(k). Let i(j) = 16j. Give i(n(a)). 32a Let o(h) = -2h. Let d(w) = 29w. Give o(d(y)). -58y Let u(x) = -x + 1. Let y(w) = 5w - 2. Let n(i) = -2u(i) - y(i). Let o(l) = -5l. Determine o(n(c)). 15c Suppose 0 = -5i - n + 22, 4 = 2i - n - n. Let u(x) be the third derivative of 0x3 + 0 + ix*2 + 0x + 1/12x4. Let z(t) = -5t. Calculate z(u(v)). -10v Let j(g) = 58g. Let o(q) = -7q2. What is o(j(u))? -23548u*2 Let b(s) = -159s. Let t(z) = -2z2. Give t(b(x)). -50562x*2 Let p(o) = -2o2. Let g(z) be the second derivative of z7/840 + z*4/12 + 4z. Let d(u) be the third derivative of g(u). Determine p(d(h)). -18h4 Let s(a) = a2. Let c(l) be the second derivative of -l4/12 - 2l3/3 - l2/2 - l. Let h be c(-3). Let t(o) = -ho2 - 2o*2 + 2o*2. What is t(s(m))? -2m4 Let y(i) be the second derivative of -i3/2 - i. Let g(l) = -2l2. Determine y(g(z)). 6z*2 Let w(q) = -6q. Suppose -5i + 0g + g + 35 = 0, -2i + 32 = -4g. Suppose -4m = 2p - ip - 16, 0 = 3m - 12. Let j(y) = -y + py + 0y. Determine w(j(a)). 6a Let b be (-2)/(-6) + 4/6. Let w(l) = l - 1. Let x(j) = 3j - 2. Let d(q) = bx(q) - 2w(q). Let z(s) = 5s - 2s - 5s. Calculate d(z(g)). -2g Let q(i) = -i*2. Let v(u) = 126u*2. Determine q(v(b)). -15876b*4 Let w(o) = 2o. Let p be -1 - -4(-1 + 4). Suppose 0 = -2a + q + 13, -4q - p = a - 31. Let r(j) = 8j - aj + j2. What is r(w(y))? 4y*2 Let g(x) = -2x. Let h(q) = 2q2 + q + 104. Determine g(h(y)). -4y*2 - 2y - 208 Let x(u) = -2u. Let b = -8 + 15. Let n(d) = -bd - 1 + 3 - 2. Give n(x(r)). 14r Let u(p) = -4p*2 - 4p. Let k(f) = 3f2. What is k(u(w))? 48w*4 + 96w*3 + 48w2 Let f(u) = u2 - u. Let n(v) = 10v2 - 30v. Let t(j) = -30f(j) + n(j). Let i(h) = -h. What is t(i(a))? -20a*2 Let m(c) = 2c. Suppose -28 = -4p + 5h, 2h - 12 - 2 = -2p. Let b(x) = -px - 3x + 11x. Calculate b(m(w)). 2w Let z(b) be the second derivative of -b*4/6 + b - 5. Let i(q) be the first derivative of -4q*3 - 1. Give z(i(p)). -288p*4 Let m(g) = 2g. Let h(c) be the second derivative of c*3/6 - 7c. What is h(m(t))? 2t Let j(h) = h. Let p(i) = -3i*2 - 3i - 3. Let g(t) = -12t2 - 13t - 13. Let f(n) = -6g(n) + 26p(n). Give j(f(z)). -6z2 Let b(f) = 8f*2. Let w(o) = -7o + 5o + 4o. What is w(b(g))? 16g2 Let u(h) = -4h*2. Let o(b) = -247b. Calculate o(u(q)). 988q2 Let b(s) = 181s*2 - 1. Let q(m) = 7m. Calculate q(b(z)). 1267z2 - 7 Let h(c) = -2c - 11. Let u(z) = z*2. Give h(u(f)). -2f*2 - 11 Let t(o) = 3o*2 - 215o + 215o. Let p(l) = 3l. Determine p(t(f)). 9f2 Let h(q) be the first derivative of q2/2 + 1. Suppose -3y - 3 = -3v + 3, -3v + 6 = 5y. Let p(w) = 3w + v - 4 + 2. Calculate p(h(c)). 3c Let o be 1-3(4 - 5). Let j(l) = 2l - ol + 3l. Let x(d) = -d. Let c(s) = -8s. Let p(h) = 2c(h) - 20x(h). Give p(j(z)). 8z Let j(c) be the first derivative of 0c2 - 5/3c*3 + 0c - 4. Let q(m) = -m*2. Determine q(j(f)). -25f4 Let t(i) = -i3 - 2i2 + i - 4. Let s be t(-3). Let v(p) = -p - 3p + 4p + sp. Let u(r) = -2r. Give u(v(a)). -4a Let p(h) = 3h. Let x(w) be the first derivative of -6 + 1/2w*2 + 0w. Calculate x(p(d)). 3d Let i(j) = 1. Let p(z) = -4z + 16. Let c(w) = -16i(w) + p(w). Let y(v) = -v2. What is c(y(s))? 4s*2 Let o(a) = -7038a. Let f(g) = -g. Calculate f(o(j)). 7038j Let o(k) = 9k - k - 5k. Let x(z) = -z2 - 7. Let w(h) = 2. Let s(d) = 7w(d) + 2x(d). Calculate o(s(c)). -6c*2 Let s(q) = 6q. Let w(z) = -52z2 + 2z + 54z2 - 2z. Determine w(s(p)). 72p2 Let j(l) = 7l - 5. Let h(a) = -6a + 4. Let p(d) = 5h(d) + 4j(d). Let q(s) = -3s. Determine p(q(g)). 6g Let i(y) = -4001y. Let f(o) = -o. Determine i(f(c)). 4001c Let x(p) = p2 + 1. Let t(j) = -9j*2 - 1. Let g(l) = -3t(l) - 3x(l). Let r(w) = -w2. Determine r(g(u)). -576u*4 Let j(m) = 4m*2. Let p = 9 + -3. Let t(v) = -pv + v + 3v. Give j(t(r)). 16r*2 Let d(y) = 4y*2 - 2. Let f(a) = -5a*2 + 3. Let x(p) = -3d(p) - 2f(p). Let j(n) = -n2. Calculate j(x(k)). -4k*4 Let a(x) = 9x*2. Let w(p) = p + 5. Let f(y) = 1. Let d(h) = 10f(h) - 2w(h). Give a(d(k)). 36k*2 Let a(x) = 16x. Let b(h) = -47h2 - 42h*2 + 92h*2. Calculate a(b(f)). 48f*2 Let c(n) = -6n + 5n + 8n. Let a(w) be the second derivative of -w*3/6 + 2w. What is c(a(z))? -7z Let w(f) = -9f. Let u(a) = -a. Let g(q) = -15q. Let m(n) = -g(n) + 5u(n). Let x(o) = 3m(o) + 4w(o). Let d(k) = k + 2k - 4k. Determine d(x(c)). 6c Let s(j) = 5j + j + 3j - 7j. Let w(o) = 8o - 2. Determine w(s(n)). 16n - 2 Let d(k) be the first derivative of -15k2/2 + 16. Let m(v) = 2v. Determine d(m(u)). -30u Let x(w) = -7w*2 + 6w - 6. Let p(t) = 2t - 13t*2 - 11 + 9t + 0t + 0t. Let n(r) = -6p(r) + 11x(r). Let f(i) = -3i2. Give f(n(l)). -3l*4 Let f(d) = -18d*2. Let k(i) = i. Let p(b) = 8b. Let h(r) = -6k(r) + p(r). What is h(f(o))? -36o*2 Let n(u) = -21u. Let g(w) = 29w2 - 2. Determine n(g(b)). -609b*2 + 42 Let f(u) = -36u*2 - 13. Let s(k) = -2k. Give s(f(y)). 72y2 + 26 Let h(x) = -x2 - x. Let j(f) = 10f*2 + 12f. Let k(d) = -12h(d) - j(d). Let c(q) = -5q - 2q + 7q + 2q2. Give c(k(p)). 8p*4 Let r(g) = 2g*2. Let p(u) = 337u*2. What is r(p(a))? 227138a*4 Let w(d) = -d. Suppose 2y = y. Let n(k) = -k + yk - k + k. Determine w(n(i)). i Let i(j) = -2j*2. Let r(c) = -2c*2 + 0c*2 - 2c*2 + 0c*2. Calculate r(i(w)). -16w*4 Let d(r) = -3r*2 + 5r + 5. Let c(j) = 2j2 - 4j - 4. Let x(n) = n - 4. Let y be x(0). Let q(z) = yd(z) - 5c(z). Let h(u) = u. Determine h(q(p)). 2p2 Let x(s) = -2s - 10. Let v(y) be the third derivative of y*3/6 + 2y*2. Let a(h) = -10v(h) - x(h). Let z(c) = 12c2 - 5c*2 - 10c*2. Give a(z(r)). -6r*2 Let l(m) = -6m. Let y(i) = 4i2 - 96i. What is l(y(s))? -24s2 + 576s Let a(g) = 137g. Let v(q) = -4q*2. What is a(v(z))? -548z*2 Let r(z) = -7z*2. Let x(i) be the first derivative of 2i*3 + 26. Calculate x(r(y)). 294y4 Let w(z) = -z + 1. Let l(d) = -d2 - 6d + 6. Let k(c) = -l(c) + 6w(c). Let f(t) = t2. Give f(k(s)). s4 Let d(w) = 2w2. Suppose -3g + 9 = -12. Let n = -5 + g. Let o(s) = -2sn + s2 - s2 + s2. Calculate d(o(z)). 2z*4 Let z(c) = -18c*2 + 45c*2 - 26c*2. Let q(b) = -9b*2 - b. Calculate z(q(k)). 81k*4 + 18k3 + k2 Let x(i) = i. Let y(z) = 5z. Let s(q) = -4x(q) + y(q). Let r(v) = 2 - 3 - 6v + 1. Determine s(r(o)). -6o Let f(b) be the second derivative of b*3/3 - 2b. Let z(r) be the second derivative of 2r3/3 - 3r. Determine z(f(p)). 8p Let t(w) = 15w*2 - 11. Let r(v) = 8v*2 - 6. Let d(k) = 11r(k) - 6t(k). Let m(z) be the third derivative of -z*4/6	{ "pile_set_name": "DM Mathematics" }
) + 7q(f). -f Let n(t) = -1. Let c(l) = -2l + 17. Give -c(r) - 4n(r). 2r - 13 Suppose -4b + 17 = 2p - 3, -3b - 3p = -12. Let w(k) = 8k2 + 1 + b + 8k + 5. Let r(d) = d*2 - 3d + 1 + 4d + 0. What is 10r(t) - w(t)? 2t2 + 2t - 2 Suppose -5p + 0p = 5. Let f(d) = -3d2 + 0d*3 + 3 + 4d - d + 4d3. Let v(k) = 0 + k - 2k - k3 - 1 + k2. Calculate pf(s) - 3v(s). -s3 Let n(m) = m - 1. Let o(l) = -l3 - 2l2 + 2l + 2. Let j be o(-2). Let b be 11/((-33)/(-18)) - 5. Let x(t) = t - 3. What is bx(f) + jn(f)? -f - 1 Let h(c) = -c*2 - 5. Let k(t) = 3t*2 + 3 - 8t*2 + 8t*2 - 2t*2. What is -6h(u) - 10k(u)? -4u*2 Let n(l) = 12l*2 + 2l + 3. Let y(r) = 12r2 + r + 2. Calculate 3n(q) - 4y(q). -12q*2 + 2q + 1 Let p(d) = 8d2 + 3d + 3. Let q(i) = 7i2 + 2i + 2. Calculate -2p(s) + 3q(s). 5s2 Let o(x) = -x2 + x + 1. Let a(l) = -15l*2 + 8l + 4. Give a(s) - 6o(s). -9s*2 + 2s - 2 Let o(c) = 9c2. Let p(b) = -b2. What is 3o(r) + 6p(r)? 21r*2 Suppose 0 = 5b + 4i + 4 + 5, 5i = -2b + 10. Let n(z) = 2z - 4. Let r(j) = 6j - 5. Let c(u) = u + 1. Let a(f) = -2c(f) + r(f). Give bn(y) + 3a(y). 2y - 1 Let l(y) = 4y - 3. Let d be (-3 + 1)(-2)/4. Let z(u) = -u + u - d + u. Suppose 2n + 2 = -2s - 0, -4s = -5n - 41. Calculate sl(f) - 14z(f). 2f + 2 Let n(c) = 2c + 6. Let y be ((-1)/(-2))/((-3)/(-36)). Suppose -2b = 10 + y. Let g(o) = 1. Calculate bg(d) + n(d). 2d - 2 Let m(z) = 1 + 6z + 7 + 2z - 3. Let q(i) = 7i + 4. What is 4m(r) - 5q(r)? -3r Let u(h) = h*3 + 21h*2 + 16h - 11. Let r(t) = 4t2 + 3t - 2. Determine -11r(l) + 2u(l). 2l3 - 2l*2 - l Let j(p) = 40p*3 + 5p*2 + 7p - 7. Let w(b) = -20b3 - 2b*2 - 3b + 3. Determine 3j(d) + 7w(d). -20d3 + d2 Let j(b) = -b3 - 6b + 4. Let q(a) = a*3 + a - 1. Calculate j(z) + 4q(z). 3z3 - 2z Let b(i) = -6i3 + 15i*2 + 10i + 11. Let o(t) = -t*3 + 3t*2 + 2t + 2. Determine 2b(v) - 11o(v). -v*3 - 3v*2 - 2v Suppose -43r = -40r + 9. Let c(q) = 3q2 + 2q. Let f(p) = -3p2 - 2p. Calculate rc(u) - 2f(u). -3u2 - 2u Let i be -51(-14)/35. Let c(z) = -2z2 - iz*3 - 2z*2 + 2z*2. Let u(g) = -6g*3 - 7g*2. Determine -7c(y) + 2u(y). 2y*3 Suppose b - 19 = -6q + q, -2q + 26 = 5b. Let n(l) = -3l2 - 3l - 3. Let p(y) = -y*3 - 5y*2 - 5y - 5. What is qp(m) - 5n(m)? -3m3 Let x(t) = -5t*2 - 8t + 8. Let n(y) = y*2 + 4y - 7. Let c(r) = 3r2 + 9r - 14. Let z(l) = -3c(l) + 5n(l). Calculate -6x(v) + 7z(v). 2v2 - v + 1 Let q(g) = -g - 1. Let h(c) = 6c + 5. Let l be -15 + 9 + -6. Give lh(o) - 10q(o). -2o Let b(c) = c*3 + 5c*2 + 5c - 2. Let v be ((-2)/3)/(8/(-60)). Let s(p) = -p*3 - 6p*2 - 6p + 2. What is vs(o) + 6b(o)? o*3 - 2 Let p(s) = -7s*2 + 9s. Let c(f) = f*2 + f. Calculate 6c(g) + p(g). -g*2 + 15g Let y(b) = -b - 26. Let v(u) = -2u - 39. What is -5v(z) + 8y(z)? 2z - 13 Let m(t) = 8t3 + 4t*2 + 17. Let k(d) = -4d*3 - 2d*2 - 8. Give -13k(w) - 6m(w). 4w*3 + 2w*2 + 2 Let x(b) = -2b - 5. Let v(o) be the first derivative of o + 30. Calculate 6v(q) + x(q). -2q + 1 Let h(i) = -i + 1. Let p(a) = 6a - 2. Let u be (-4)/(-14) - 61/(-7). Suppose 2m = -m + u. Suppose 3l - mc = c + 4, -4l = -4c. Calculate lh(w) - p(w). -2w - 2 Suppose 5 = x - 11. Let c = x - 17. Let a(m) = -m - 1. Let l(o) = o. What is cl(g) + a(g)? -2g - 1 Let y(a) be the first derivative of a4/4 + a3/3 - a2/2 - a + 7. Let c(g) = g3 + 3g2 - 3g - 6. Give -c(u) + 3y(u). 2u*3 + 3 Suppose 0 = 2x + 3o + 17, -5x + 7o - 3o + 15 = 0. Let r(z) = -2z3 - 6z2 + 2. Let h(b) = -b2. Determine xr(w) + 5h(w). 2w3 + w2 - 2 Let l(o) = -2o*2 + 2o + 2. Suppose 4 = w - d, 6w - w = -4d + 2. Let a(x) = -8x2 + 9x + 9. Calculate wa(b) - 9l(b). 2b2 Let f(p) = 7p - 4. Let u(l) be the third derivative of -3l2 + 0l - 1/24l4 + 0 + 1/6l*3. Calculate f(o) + 6u(o). o + 2 Let c(z) = -5z. Let i(m) = -2m. Let w(a) = 3c(a) - 8i(a). Let t(d) = -d - 1. Suppose 3f - 3 = 4h, -2f + 2 = -h - 0. Give ft(r) + 2w(r). r - 1 Let f(d) = -3d*2 + 7. Let a(k) = -11k - k*2 + 2 + 11k. Give 7a(h) - 2f(h). -h*2 Let s(k) = -14k + 2. Let x(l) = 9l - 1. Let t = 81 - 86. Let j be (3/2)/((-6)/32). Give jx(y) + ts(y). -2y - 2 Let h = 1 - 10. Let w = 4 - 6. Let k(l) = -l. Let u(g) = g + 1. Let x(p) = wk(p) - u(p). Let c(y) = 2y - 2. Give hx(f) + 4c(f). -f + 1 Let r(c) = 1. Let l(n) = -2n - 13. Give -l(t) - 4r(t). 2t + 9 Let b = 12 - 13. Let u(i) = -1. Let y(w) = -w + 2. Determine by(z) - 3u(z). z + 1 Let y(k) = -11 + 11 + k. Let a(l) be the third derivative of l3/3 - l2. Suppose 2q - 3 - 2 = -p, 2p = -2q + 4. Give pa(o) - y(o). -o - 2 Let a(u) = -70u*2. Let b(r) = -5r2. Let g(n) = -n3 + 3n2 + 11n - 1. Let i be g(5). What is ia(y) - 55b(y)? -5y2 Suppose 0u + 15 = 3u. Let w(y) = -u + 3 - 2 + y. Let g(d) = 2d - 5. Give 2g(b) - 3w(b). b + 2 Let h(w) = -w - 1. Suppose -4g = -12, 3j - 5g - 6 = -45. Let d(p) = -6p - 8. Determine jh(l) + d(l). 2l Let u(s) = -s3 + s2 - 1. Let z(h) = -2h3 + h2 - 1. Let o = 31 - 28. Give oz(p) - 3u(p). -3p*3 Let i(z) = -2z*2 + z + 2. Let k(l) = -3l*2 - 5l + 8. Let h(s) = -s + 1. Let n(p) = 6h(p) - k(p). Determine -5i(m) - 4n(m). -2m*2 - m - 2 Let r(b) = 8b*3 - 6b*2 + 6b - 2. Let i(g) = -7g3 + 5g*2 - 5g + 1. Calculate -6i(u) - 5r(u). 2u3 + 4 Let f(z) = -3z*2 - 4z - 4. Let r(o) = o*2 + o + 1. Suppose 2v + 21 = -5n, -3n - 3 = 4v + 4. Suppose 0a - 2a = -v. What is af(m) + 4r(m)? m2 Let s be 1(66/(-10) - (-6)/10). Let w(t) = 4t - 4. Let r(i) = -11i + 11. Calculate sr(l) - 17w(l). -2l + 2 Let h = -10 - 4. Let o(l) = 21l. Let k(d) = 7d. Let y(x) = 11k(x) - 4o(x). Let v(m) = -20m. Give hy(s) + 5v(s). -2s Let r(b) = 2b*3 - 7b + 1. Let f(l) = -l*3 + 4l - 1. Suppose -2v - 3v = 15. Let m = v - -8. Give mf(w) + 3r(w). w*3 - w - 2 Let q be (-16)/(-24) - 64/(-3). Let t(y) = 5y*3 - 11y*2 - 11y + 11. Let m(w) = -w*3 + 2w*2 + 2w - 2. Calculate qm(l) + 4t(l). -2l3 Let n(u) = u + 1. Let v(w) = 4w + 4. Let p(r) = 5n(r) - v(r). Let l(m) = -8m - 6. Calculate -l(c) - 6p(c). 2c Let m(t) = -4 - t*2 + 6t*2 + 27t - 21t. Let v(h) = -h - 1. Let p(u) = -9u*2 - 15u + 3. Let k(c) = -p(c) + 4v(c). Determine 6k(w) - 11m(w). -w2 + 2 Let u(z) = z3 - 5z*2 - 9z + 5. Let m(x) = -2x3 + 8x*2 + 14x - 8. Suppose -3h = 4g + 44, -4g - 4h = 18 + 30. Determine gu(c) - 5m(c). 2c3 + 2c Let l(u) = -17u3 + 9u. Let k(x) be the third derivative of -x6/15 + x4/6 - 10x2. Calculate -9k(y) + 4l(y). 4y*3 Let g(b) = -3b*3 - 5b*2 + 3b + 3. Let q(n) = 4n3 + 7n*2 - 4n - 4. Determine -7g(w) - 5q(w). w*3 - w - 1 Let j(f) = 6. Let n(c) = c + 3. What is -3j(r) + 6n(r)? 6r Let c(n) = 2n + 92. Let z(j) = 3j + 138. Calculate -8c(y) + 5z(y). -y - 46 Let b(v) = -10v2 - 11v. Let r(o) = 5o2 + 5o. Let d(t) = 6b(t) + 13r(t). Let u(w) = -4w2 + w. Give 2d(z) + 3u(z). -2z*2 + z Let h(q) = 9q*2 - 5q. Let z(t) = 26t2 - 14t. What is 14h(v) - 5z(v)? -4v2 Let g(v) = v3 + v2 - 7v + 6. Let d(h) = -h + 1. Let c(q) = -q + 7. Let r be c(7). Suppose -2f - 7 = 5k, r = -f - k - 3 + 1. Give fg(b) + 6d(b). -b3 - b2 + b Let g(k) = -2k + 3. Let z(p) = -4p + 7. Determine -9g(l) + 4z(l). 2l + 1 Let y(m) = -3m. Let u(f) = 8f. Suppose -29 = -3l - 4s, -25 = -2l - l - 2s. Determine ly(a) + 3u(a). 3a Let k(q) = -2 + 0 + 3 + q*2 + q. Let a(v) = 5v*2 + 9v + 6. Let s(y) = -5y2 - 8y - 6. Let c(r) = -2a(r) - 3s(r). Let w = 3 - -3. Give wk(j) - c(j). j2 Let t(c) = 26c - 3. Let j(g) = 391g - 46. What is -3j(l) + 46t(l)? 23l Let j(z) = -15z2 + 13z - 9. Let r(k) = -7k2 + 6k - 4. Calculate -4j(i) + 9r(i). -3i2 + 2i Let t(g) = -8g - 5. Let k(q) = 2q + 1. Calculate 9k(i) + 2t(i). 2i - 1 Let r(s) = 2s*2 + 7s. Let q(g) = g. Suppose -4x + x + 3v + 15 = 0, x = -v + 7. What is xq(y) - r(y)? -2y*2 - y Let z(y) = 2y*2 + 2y + 1. Let m(p) = -5p2 - 6p - 3. Determine 3m(b) + 8z(b). b*2 - 2b - 1 Let i =	{ "pile_set_name": "DM Mathematics" }
/2o2 + 873/2o - 1269/2 = 0. 3, 47 Let f(c) be the second derivative of c*6/120 + 11c*5/2 + 16133c*4/16 - 55c*3/3 - 6050c*2 - 389c - 3. Factor f(q). (q - 1)(q + 1)(q + 220)*2/4 Let r = -27723/4 + 6932. Let b(z) be the first derivative of -rz*2 + 2z + 27 - 1/4z3. What is y in b(y) = 0? -4, 2/3 Let n(m) be the third derivative of 1/240m*6 + 0m*3 + 275m*2 + 1/280m*7 + 0 + 1/12m*4 + 0m - 1/20m5 - 1/1344m*8. Let n(x) = 0. What is x? -2, 0, 1, 2 Suppose 58365907l*2 - 5199922l2 + l4 + 3l4 + 37295937425l + 25259l3 - 9327307625 = 0. What is l? -2105, 1/4 Let v(i) be the second derivative of 0 + 1/4i*5 + 50i + 65/12i4 + 175/6i*3 - 245/2i*2. Determine t so that v(t) = 0. -7, 1 Solve -261i - 1047i + 2604 + 397i*2 - 394i*2 = 0. 2, 434 Let s(d) be the second derivative of -3d*2 - 1/2d*3 + 1/4d*4 - 2d - 27. Factor s(u). 3(u - 2)(u + 1) Let t = 241 + -237. Factor 1005f3 + 810448f - 12ft + 32856f*2 + 5f*4 + 11f*4 + 7496644 - 413f*3. 4(f + 37)*4 Let i = -11 - -32. Solve 3u*3 - iu + 7u2 + 22u - 4u2 + u4 = 0. -1, 0 Let n be 1281/7 + (-2 - 1). Suppose -r = -5r + n. Find g, given that -20g5 + 1467 + 5g*2 - 30g*3 - 1467 + rg*4 = 0. 0, 1/4, 1 Factor 13263041 + 6r*2 - 1100729 - 4r*2 + 1313r - 9306r - 1871r. 2(r - 2466)2 Let u(w) be the second derivative of w5/70 + 29w*4/42 + 164w*3/21 + 220w*2/7 - 646w. Find m, given that u(m) = 0. -22, -5, -2 Let d = -62 - -33. Let x = d + 33. Let -10c - 17 + 5c2 - 1 + 7 - x = 0. What is c? -1, 3 Let a(u) = -u2 - 7u + 3. Let t be a(-7). Let f(w) = -tw - 6w + 31 - w2 - 36. Let x(v) = -6v*2 - 64v - 36. Let y(m) = 44f(m) - 6x(m). Factor y(z). -4(z + 1)(2z + 1) Let j be -1425/101. Let y = j + 35. Determine m so that 2m + 22m2 + ym - 18m2 + 2m = 0. -1, 0 What is w in -10w4 + 330w*2 + 55 - 155/2w*3 - 595/2w = 0? -11, 1/4, 1, 2 Let t(s) be the second derivative of 0s2 - 2 + 1/40s*6 - 1/16s*4 + 1/80s*5 + 21s - 1/12s3 + 1/168s*7. Factor t(m). m(m - 1)(m + 1)2(m + 2)/4 Let s(u) be the first derivative of -5u6/6 - 434u*5 - 119855u*4/2 - 917960u*3/3 + 732075u*2/2 + 4160250u - 12113. Let s(z) = 0. What is z? -215, -3, 2 Let y(d) be the first derivative of d*4/14 + 8d*3/7 + 36d*2/7 + 64d/7 + 263. Factor y(w). 2(w + 2)2(w + 8)/7 Determine z, given that 76/3z - 8/3z*2 + 80/3 - 4/3z3 = 0. -5, -1, 4 Factor -42483 - u2 - 753u + 39u + 5u2 - 7u*2 + 0u*2. -3(u + 119)*2 Let d(n) be the second derivative of -3n*5/80 + 15n*4/8 + 9n*3/8 - 405n*2/4 - 3n + 1350. Factor d(l). -3(l - 30)(l - 3)(l + 3)/4 Let g = 146798 - 146796. Factor 1/4i*3 + 0 + 5/4i*g + i. i(i + 1)(i + 4)/4 Let v(t) be the first derivative of 5t*4/4 - 10t*3 - 225t*2/2 + 250t - 9073. Factor v(n). 5(n - 10)(n - 1)(n + 5) Suppose -20i = -21i + 4. Let g(l) = l2 - 4l + 3. Let q be g(i). Let -10 + 4j3 - 15j*2 + 27j + j*q + 5j*4 - 52j = 0. Calculate j. -1, 2 Let r = -8 + 15. Suppose -2q = -5a + 17, 2a + 6q - r = 7q. Factor 4/17 + 8/17g*2 - 2/17g*a - 10/17g. -2(g - 2)(g - 1)*2/17 Let g(i) be the second derivative of 4i*2 + 0 - 1/3i*3 + 139i + 1/40i5 - 1/6i4. Suppose g(k) = 0. Calculate k. -2, 2, 4 Let n(b) be the second derivative of b4/36 - 14b3/9 - 34b*2 - 21b - 3. Determine o, given that n(o) = 0. -6, 34 Let x(k) = -10k2 + 13. Let p(r) = -r2 + 1. Suppose 3f - 7y + 2y - 3 = 0, 0 = -3f + 4y. Let g(d) = fx(d) + 36p(d). What is b in g(b) = 0? -2, 2 Suppose -3j + 68m = 67m - 20, 3j = 2m + 34. Factor -1/2o*3 + 11/6o + 1/6oj + 7/6. -(o + 1)2(3o - 7)/6 Let s = -2/392815 - 287932807/115487610. Let t = 1/147 - s. Solve -7/6u*4 - 1/6u - 19/6u3 + 1/3 - tu2 = 0 for u. -1, 2/7 Let j(h) be the first derivative of h4/12 + 200h3/9 + 66h*2 + 310. Determine m, given that j(m) = 0. -198, -2, 0 Suppose -20u + 35u = 60. Let b(p) be the first derivative of -up*3 + 6p*2 + 0p + 3/4p4 + 16. Factor b(i). 3i(i - 2)2 Let q(r) = -7r*2 - 100r + 529. Let y(d) = -66d2 - 899d + 4758. Let g(i) = 19q(i) - 2y(i). Find l, given that g(l) = 0. -107, 5 Let y = -10183/21 - -3399/7. Factor 16/3 + yd3 - 2d*2 - 4d. 2(d - 4)(d - 1)(d + 2)/3 Solve 624/5j - 3/5j3 - 132 + 39/5j*2 = 0 for j. -10, 1, 22 Let r = 1507/3 - 2249/6. Let b = -126 + r. Suppose -3j*2 + 0 + bj + 3/2j3 = 0. Calculate j. 0, 1 Let x(m) be the second derivative of 0 + 1/80m*5 + 53/16m*4 + 47m + 6241/8m2 + 2133/8m*3. Factor x(d). (d + 1)(d + 79)*2/4 Find g such that g - 41g*2 + 25g*4 - 31g*3 - 6g*3 - 3g*5 + 16 + 0g + 5g + 34g*3 = 0. -1, -2/3, 1, 8 Let h be 8/6(-33)/22-2. Factor 3a*2 + ha*3 + 9a - 8 - a*2 - 9a + 6a2 - 4a. 4(a - 1)(a + 1)(a + 2) Let v = -2204 - -2204. Let s(i) be the first derivative of 0i*2 + 8 + 4/3i*3 + vi + 1/2i4. Determine f so that s(f) = 0. -2, 0 Let o(x) be the third derivative of -27x*8/392 - 30x*7/49 - 517x*6/420 + 10x*5/7 - 3x*4/7 + 164x*2 - 2. Find g such that o(g) = 0. -3, 0, 2/9 Determine u so that 1060/9 - 526/9u - 2/9u2 = 0. -265, 2 Let i(t) = 5t*3 - 14t*2 - 20t + 40. Let h(o) = -55o3 + 155o*2 + 220o - 440. Let w be (70/(-21))/((-6)/81). Let s(l) = wi(l) + 4h(l). Factor s(z). 5(z - 2)2(z + 2) Factor 1/4s4 - 1/4s*3 - 65/4s*2 + 0 + 225/4s. s(s - 5)2(s + 9)/4 Let k(t) be the second derivative of 2t7/21 - 106t*6/15 + 199t*5/5 - 49t*4 - 245t - 1. Determine l so that k(l) = 0. 0, 1, 3, 49 Let j = -5423/378 + 821/54. Factor 1/7c2 - 5/7c + j. (c - 3)(c - 2)/7 Factor 3v*2 - 26v*3 - 99 - 111 + 222 - 7v*2 + 26v - 8v2. -2(v - 1)(v + 1)(13v + 6) Let d(n) be the first derivative of -13/3n*3 - 4n + 3/2n4 - 1/5n*5 + 40 + 6n2. Factor d(a). -(a - 2)2(a - 1)2 Let h(m) be the first derivative of 2/5m*5 - 2/3m*3 - 6/5m*4 - 1/10m*2 + 0m + 5/6m6 - 56. Solve h(p) = 0 for p. -1, -1/5, 0, 1 Let k(j) be the third derivative of j7/504 - j6/144 - j5/4 - 79j*4/24 + 38j*2 + j. Let w(l) be the second derivative of k(l). Factor w(d). 5(d - 3)(d + 2) Let o(x) be the third derivative of x6/60 - 4x*5 + 279x*4 + 15376x3/3 + x2 - 104. Suppose o(v) = 0. Calculate v. -4, 62 Let j = 5139979/15 - 342661. Find g such that -2/3g3 + 0 + jg*2 - 8/5g = 0. 0, 2/5, 6 Let f(u) be the first derivative of u5/75 + u4/6 + 8u3/15 + 3u2/2 - u - 75. Let j(z) be the second derivative of f(z). Solve j(w) = 0. -4, -1 Let q(t) = -t3 + 33t2 - 374t + 782. Let z(r) = -4r3 + 95r*2 - 1121r + 2345. Let h(d) = 7q(d) - 2z(d). What is w in h(w) = 0? -49, 4 Let j(b) be the first derivative of b7/168 + b6/12 + b*5/8 - 25b*4/12 - 10b*3/3 + 97. Let x(u) be the third derivative of j(u). Factor x(h). 5(h - 1)(h + 2)(h + 5) Let s(k) be the third derivative of -k*7/420 + 73k*6/120 - 1871k*5/40 + 5183k*4/12 - 5041k*3/3 + 2k*2 - 43k - 16. Factor s(q). -(q - 71)*2(q - 2)*2/2 Let 6727m*2 - 189m*3 + 19 - 3m*4 + 114m + 75m3 - 6940m*2 + 197 = 0. Calculate m. -36, -2, -1, 1 Suppose 0 = 13y - 16y + 15. Suppose 3a - 915 - 310 = -yd, 4a - 1638 = -2d. Factor 3m*3 + 413m*4 - am*4 + 0m*3. 3m*3(m + 1) Let z(q) be the first derivative of q*7/84 + 5q*6/24 - 3q*5/8 - 5q*4/3 - 2q*3/3 + 22q*2 + 259. Let c(h) be the third derivative of z(h). Factor c(l). 5(l - 1)(l + 8)(2l + 1) Let c(v) = -v2 + 2264. Let w be c(0). Let d = w + -24888/11. Factor du + 0 - 2/11u2. -2u(u - 8)/11 Let x be ((-27)/(-4))/(5/20). Suppose p = 10 + x. Suppose p - 37 - 5w2 = 0. What is w? 0 Let v(w) = w4 - w*3 + w - 1. Let j(n) = -5n*4 + 217n*3 + 14910n*2 + 357694n + 343006. Let k(g) = -j(g) - 6v(g). Find l, given that k(l) = 0. -70, -1 Let q(s) = -2s*2 - 35s + 24. Let w be 3/(-3)(-2 - (-18 - 2)). Let n be q(w). Factor -6 + 12 + 3o*2 - 1 - no - 2. 3(o - 1)2 Let s(v) be the first derivative of v4/2 - 8v*3/3 - 128v*2 + 1536v + 244. Find o, given that s(o) = 0. -12, 8 Suppose -140m = 155m - 387m + 223 + 53. Factor -3/2w*m - 3/2w + 3w2 + 0. -3w(w - 1)2/2 Let 13	{ "pile_set_name": "DM Mathematics" }
4x - 50. Determine q(7). -78 Let t(a) = -18a - 187. What is t(-14)? 65 Let g(b) = -b*2 - 2472b - 9852. Determine g(-4). 20 Let u(o) = 2o3 + 368o*2 - 2285o + 27. Determine u(6). -3 Let y(m) = -55m2 + 313m + 110. Calculate y(6). 8 Let p(d) = 3d3 + 37d*2 - 30d - 30. Calculate p(-13). 22 Let t(m) = 49m - 2243. Give t(46). 11 Let t(r) = -r3 - 24r2 + r + 32. Calculate t(-24). 8 Let n(f) = f2 - 101f + 1581. Calculate n(82). 23 Let o(c) = -c2 + 46c - 352. Give o(38). -48 Let m(p) = 17p2 + 64p + 9. Give m(-4). 25 Let m(w) = -36w + 730. Give m(20). 10 Let a(g) = -g2 - 42g - 88. Give a(-39). 29 Let x(c) = -137c - 580. Calculate x(-4). -32 Let o(k) = -7k*2 + 94k - 40. Determine o(13). -1 Let i(x) = 2x2 + 8x - 54. What is i(-7)? -12 Let w(c) = 2c3 - 181c*2 - 272c - 386. Give w(92). -18 Let v(u) = 16u3 + 114u*2 + 50u + 233. Determine v(-7). -19 Let n(w) = -5w3 - 2w*2 + 5w - 6. Calculate n(-4). 262 Let v(k) = 2k3 + 393k*2 + 580k - 1019. Calculate v(-195). -44 Let x(n) = n*3 + 22n*2 - 27n - 54. What is x(-23)? 38 Let p(i) = -i*3 + 29i*2 - 34i - 25. Give p(28). -193 Let x(f) = 38f + 310. Give x(-7). 44 Let h(j) = -j2 + 128j + 933. Calculate h(-7). -12 Let l(v) = -v*3 + 11v*2 - 21v + 6. Give l(8). 30 Let q(z) = z*2 - 45z + 231. Determine q(42). 105 Let p(k) = -18k + 1013. Calculate p(55). 23 Let u(b) = 4b*3 - 40b*2 + 18b - 174. Determine u(10). 6 Let d(v) = -v*3 - 16v*2 - 22v + 64. What is d(-14)? -20 Let k(d) = 23d - 656. Calculate k(28). -12 Let a(s) = s2 - 34s - 95. What is a(37)? 16 Let k(w) = 7w2 + 62w - 9. Determine k(-8). -57 Let n(z) = -22z + 109. Determine n(6). -23 Let k(a) = -a3 - 12a*2 + 59a - 120. Give k(-16). -40 Let d(v) = v*3 - 2v*2 - 37v - 141. What is d(-4)? -89 Let m(n) = -2n2 - 10n + 151. Calculate m(-12). -17 Let c(j) = j*3 + 128j*2 - 270j - 1298. Calculate c(-130). 2 Let n(j) = 141j2 + 1837j + 32. Give n(-13). -20 Let o(j) = 6609j - 13211. Give o(2). 7 Let z(c) = 7c*2 - 14c + 22. What is z(4)? 78 Let m(n) = 2n2 + 86n + 336. What is m(-4)? 24 Let f(u) = 10u - 3. Calculate f(5). 47 Let p(x) = x3 - 17x*2 + 84x - 564. Calculate p(14). 24 Let m(v) = -74v + 12. Calculate m(3). -210 Let h(r) = -33r + 163. Determine h(4). 31 Let b(y) = y*3 - 3y*2 + 7. Determine b(2). 3 Let z(i) = -3i*3 - 577i*2 - 760i + 761. Calculate z(-191). -3 Let t(c) = -102c - 116. Calculate t(-7). 598 Let p(i) = 238i*2 + 2154i + 113. Give p(-9). 5 Let h(j) = -147j - 7816. Calculate h(-53). -25 Let u(w) = 126w - 253. Calculate u(2). -1 Let q(p) = -17p3 + 2p*2 - 11p - 19. Determine q(-2). 147 Let y(q) = 78q2 - 112q - 336. Determine y(-3). 702 Let q(r) = -18r2 + 22r. Determine q(1). 4 Let n(s) = s*3 - 42s*2 + 34s - 1527. Give n(42). -99 Let q(s) = s*3 - 2s*2 - 12s + 16. Give q(7). 177 Let h(p) = p*3 - 274p*2 + 137p - 37535. Calculate h(274). 3 Let i(m) = -11m2 + 330m - 40. Give i(30). -40 Let w(r) = -19r + 1981. What is w(92)? 233 Let a(w) = -31w + 262. What is a(11)? -79 Let y(c) = -2c2 - 259c - 975. Give y(-4). 29 Let w(m) = 5m2 + 10. Give w(3). 55 Let u(h) = 2h*2 - 333h - 1717. Give u(-5). -2 Let w(v) = 162v - 6. Give w(2). 318 Let d(v) = -v2 + 37v + 368. What is d(45)? 8 Let b(j) = j*2 - 130j + 2972. Give b(100). -28 Let p(d) = -20d + 369. Determine p(12). 129 Let b(w) = w3 - 12w*2 + 18w + 13. What is b(10)? -7 Let l(o) = -o*2 + 77o - 1293. What is l(52)? 7 Let d(r) = -r*3 - 3r*2 + 649r - 4. Give d(24). 20 Let a(j) = j*3 + 11j*2 + 9j - 48. Calculate a(-5). 57 Let q(g) = 30g + 201. What is q(-9)? -69 Let v(c) = -c2 + c + 41. Determine v(0). 41 Let x(q) = -136q + 428. Determine x(3). 20 Let n(f) = -6f - 22. Determine n(-6). 14 Let p(q) = q3 - 10q*2 - 14q + 48. Determine p(11). 15 Let l(s) = -4s3 + 21s*2 + 3s - 50. Calculate l(5). -10 Let p(u) = 120u - 1579. Calculate p(12). -139 Let i(b) = -262b - 137. Give i(0). -137 Let c(y) = -1420y - 26982. Give c(-19). -2 Let p(c) = c3 + 20c*2 + 88c + 1. Give p(-13). 40 Let c(x) = 10x - 116. Calculate c(9). -26 Let b(m) = -847m + 18746. Give b(22). 112 Let p(j) = -31j + 1662. Give p(54). -12 Let j(p) = p2 - 28p + 30. Calculate j(27). 3 Let b(m) = -37m + 419. Give b(11). 12 Let u(b) = -b3 - 31b*2 + 33b + 24. What is u(-32)? -8 Let s(j) = -11j2 - 492j - 1269. Determine s(-42). -9 Let l(p) = -3p3 - 1224p*2 + 2p - 6. What is l(0)? -6 Let k(w) = -350w + 4910. Determine k(14). 10 Let d(v) = 2v*3 + 29v*2 + 108v + 13. Determine d(-7). -8 Let y(a) = -240a + 1642. Calculate y(5). 442 Let g(f) = f3 - 126f*2 - 379f - 1077. Give g(129). -45 Let o(b) = -19570b + 97851. Give o(5). 1 Let p(z) = -z2 - 146z - 605. Give p(-142). -37 Let s(w) = -w*3 + 12w*2 + 18w - 1. Determine s(13). 64 Let h(r) = 477r - 5241. Determine h(11). 6 Let d(o) = -2o*3 + 2o*2 + 34o - 37. Determine d(1). -3 Let v(b) = -b*3 - 6b*2 + 22b - 24. Calculate v(-9). 21 Let d(w) = 80w - 6. Give d(-2). -166 Let g(r) = -2r*2 - 71r + 261. Give g(-38). 71 Let z(l) = -3450l - 55203. What is z(-16)? -3 Let l(d) = -6d*3 + 175d*2 - 61d + 932. Calculate l(29). 4 Let o(u) = -2u2 - 26u - 66. Give o(-8). 14 Let z(c) = -c*2 - 26c - 90. What is z(-22)? -2 Let v(k) = -2k3 - 23k*2 - 34k - 564. Determine v(-12). -12 Let h(a) = -a*3 + 10a*2 - 23a + 18. Give h(8). -38 Let s(k) = -k*3 + 13k*2 - 717k + 10229. Give s(14). -5 Let t(i) = 9625i + 57739. Calculate t(-6). -11 Let c(a) = 33a*2 - 4a + 2. Give c(1). 31 Let o(l) = 437l - 3346. What is o(7)? -287 Let v(a) = 38a*2 - 72a - 220. Calculate v(-3). 338 Let l(z) = -46z - 1515. Determine l(-33). 3 Let b(t) = 23t + 351. What is b(-10)? 121 Let r(q) = -19q2 + 744q - 124. Determine r(39). -7 Let o(i) = -689i + 5. Determine o(0). 5 Let u(m) = -16m*2 - 48m - 2. What is u(-3)? -2 Let k(i) = 227i + 1584. Determine k(-7). -5 Let c(p) = -p2 - 45p - 553. Give c(-28). -77 Let v(u) = -u*3 - 57u*2 + 1169u + 91. Give v(-73). 18 Let h(t) = -7t + 170. Calculate h(18). 44 Let g(q) = -4q*2 - 58q - 164. Give g(-9). 34 Let x(d) = 2d3 - 3d - 21. Calculate x(4). 95 Let i(g) = -6g3 + 87g*2 + 40g + 70. Calculate i(15). -5 Let y(z) = -108z + 490. Calculate y(5). -50 Let q(k) = -79k - 984. Calculate q(-8). -352 Let y(a) = a*3 - 14a*2 + 18a - 19. Give y(12). -91 Let o(p) = 2p3 - 17p*2 + 71p - 347. What is o(7)? 3 Let d(j) = -23j + 180. Give d(10). -50 Let j(b) = 201b + 5661. Calculate j(-28). 33 Let n(o) = o*2 - 11o + 59. Give n(7). 31 Let a(t) = 1169t - 9. What is a(0)? -9 Let j(v) = v3 + 47v*2 - 27v + 6142. What is j(-50)? -8 Let w(u) = -3u - 5. Calculate w(-7). 16 Let s(q) = -41q - 4597. Give s(-112). -5 Let k(s) = s*3 + 17s*2 - 24s - 125. What is k(-18)? -17 Let z(q) = -q*3 - 10q2 + q + 31. Calculate z(-8). -105 Let l(b) = b3 + 8b2 + 84b + 292. Calculate l(-4). 20 Let p(g) = g*3 - 42g*2 - 45g + 91. Give p(43). 5 Let l(v) = 11v3 - 3v*2 + 9v - 4. Give l(1). 13 Let f(j) = -j*2 - 8j + 130. Determine f(0). 130 Let s(i) = -i*3 + 7i*2 + 12i + 105. Determine s(8). 137 Let t(o) = 10o3 + 631o*2 + 61o - 115. Calculate t(-63). 11 Let o(v) = -v*3 - 13v*2 - 30v - 50. Give o(-11). 38 Let h(r) = -r*3 + 58r + 17. Determine h(8). -31 Let i(d) = -417d - 30448. Give i(-73). -7 Let s(x) = -x3 - 12x*2 + 253x - 11. What is s(-23)? -11 Let q(w) = -7w2 - 3w + 2. Determine q(4). -122 Let w(o) = 4o2 + 28o - 244. Give w(5). -4 Let w(o) = o*2 - 18o - 1074. Calculate w(-24). -66 Let l(y) = y*3 - 19y*2 - 24y + 563. What is l(19)? 107 Let n(i) = i*2 + 14i + 75. Determine n(-4). 35 Let n(m) = 15m3 + 2m*2 + 18m - 35. Calculate n(2). 129 Let i(u) = -254u - 1284. Give i(-5). -14 Let m(d) = -7d*2 - 40d - 6. Calculate m(-7). -69 Let i(c) = -2c2 - 55c + 19. What is i(-27)? 46 Let k(h) = 7h2 - 249h - 1231. Calculate k(40). 9 Let l(j) = -4j2 + 77j - 76. Determine l(19). -57 Let h(s) = s*3 + 5s*2 - s - 178. Give h(0). -178 Let l(q) = -211q - 451. Calculate l(-2). -29 Let v(d) = 2d2 + 40d - 66. What is v(-23)? 72 Let s(a) = a*2 - 52a - 584.	{ "pile_set_name": "DM Mathematics" }
the third derivative of 13735317b4 - 24b*2 + 67b - 42 wrt b. 329647608b Find the second derivative of 10107546n*2 + 22n + 56009 wrt n. 20215092 What is the first derivative of -26195141l2 + 1611248 wrt l? -52390282l What is the derivative of 1459b4z - b*4 + 40515bz - 16881612z - 2 wrt b? 5836b3z - 4b3 + 40515z What is the second derivative of -3t5 - 1376432t*2 - 7820743t? -60t3 - 2752864 Find the second derivative of 57135l*2t2 + l2t - 4l*2 + 332lt4 - 21lt - l + 3328t wrt t. 114270l2 + 3984lt2 Find the second derivative of -4p*5 - 61170p*4 + 214p*2 + 165206664p. -80p3 - 734040p*2 + 428 Differentiate 1322302382m + 1197771481 wrt m. 1322302382 What is the second derivative of 64560x4 + x2 - 493419x + 4? 774720x2 + 2 Differentiate 20094850a + 15891619 wrt a. 20094850 Find the first derivative of 1880i2 + 19488i - 70250321 wrt i. 3760i + 19488 What is the second derivative of 18714522s*3 + 5s + 651116 wrt s? 112287132s Find the third derivative of -14l*4 - 1318026l3 + l2 - 29173l - 1 wrt l. -336l - 7908156 Find the second derivative of k*3 - 2k*2m*3 - 114413k*2m*2 + 2km3 - 477km - 2006m*3 wrt k. 6k - 4m3 - 228826m*2 Find the third derivative of -622c*6 + 302560c*3 + 40927686c*2. -74640c*3 + 1815360 What is the second derivative of 24640772v*3 - 83421656v wrt v? 147844632v Find the third derivative of 4k*3v*2 + 20786388k*3vz + 1690k*2v*2 + 40773k*2vz wrt k. 24v*2 + 124718328vz What is the third derivative of -24867394b*6 - 6b*3 - 113415791b*2? -2984087280b*3 - 36 Find the first derivative of 5120bk2ot - 31222bk2t - 2bo + b - 9373k2o + k*2 - 20k wrt t. 5120bk*2o - 31222bk*2 What is the second derivative of -7f*5 - 709746f*2 + 64617936f wrt f? -140f3 - 1419492 Find the second derivative of 85a*4h*2 - 9037a*4h - ah2 - 1320a + 278h wrt a. 1020a*2h*2 - 108444a*2h What is the third derivative of 26a3gr - 2a*3g + 180825a3r + 6179a2g - a*2r + 7ar - 4gr - 2r wrt a? 156gr - 12g + 1084950r Find the first derivative of 12262488h - 5532226. 12262488 Find the third derivative of 4805981y3 - 2y*2 + 9743974 wrt y. 28835886 What is the second derivative of -236l*5 + 16661l*4 + 120593l + 16 wrt l? -4720l3 + 199932l*2 Find the second derivative of -11500170x*3 - 2x - 1186492. -69001020x Differentiate 376046795b - 165118026 wrt b. 376046795 Find the second derivative of -39509081w3 - 43858527w wrt w. -237054486w Find the second derivative of 4j*2l*3 + 21511379j*2l - 33jl*3 - jl - 9886l3 + 2l*2 - 2l - 16 wrt j. 8l3 + 43022758l Differentiate -152g2 - 210478g + 298629015. -304g - 210478 What is the third derivative of 3w*2x3 + w2 - 111wx*2 + 86099x*5 - 8x*2 + 40x wrt x? 18w2 + 5165940x*2 Find the first derivative of 8n*3 - 6233821n*2 - 116895714. 24n*2 - 12467642n What is the third derivative of -2m3no2 - 206m*3o3 + m2no + 44m2n - 773mno3 + 14no3 + 46no2 - 679no wrt o? -1236m*3 - 4638mn + 84n What is the derivative of 71n2 + 1428877ny - 110679432y wrt n? 142n + 1428877y What is the second derivative of -91982181t2 - 7192t + 1088 wrt t? -183964362 Differentiate -2391825a2 + 3914897 with respect to a. -4783650a What is the third derivative of -9f3g*3 + 3f*3g2 - f3g + 2f*3 + 53f*2g*2 + 122302fg3 + 1139fg wrt g? -54f*3 + 733812f What is the second derivative of -5j2k + 850227j2 + 5jk - 2875671j wrt j? -10k + 1700454 Find the third derivative of -2a*6 + 18736999a*5 + 78448137a*2. -240a*3 + 1124219940a*2 Find the third derivative of 10u*4 - 7520261u*3 + 913754u*2 + 63. 240u - 45121566 What is the second derivative of -2f3n4 - f3n - f3 + 2f*2n - 107f2 - 220fn - 2239693n*4 - n wrt n? -24f*3n*2 - 26876316n*2 What is the third derivative of 1730s*2x*4 - 3s*2x*2 - 3s*2x + 134s2 - 1085sx4 + x2 + 8x - 76 wrt x? 41520s2x - 26040sx What is the first derivative of 663440894w4 + 526171071 wrt w? 2653763576w*3 Find the second derivative of -153939f*3 - 361f*2 + 930634f + 37 wrt f. -923634f - 722 Find the third derivative of 40742563p*4 - 3p*3 + 749773211p*2. 977821512p - 18 What is the second derivative of -4197414p2 + 52820p - 4 wrt p? -8394828 What is the derivative of -25499087x3 + 182526524 wrt x? -76497261x*2 What is the second derivative of 80924074a*3 - 171240081a? 485544444a Find the third derivative of 18f*5 + 21349169f*3 - 16845515f*2. 1080f*2 + 128095014 What is the second derivative of -840405g*2 - 6g + 239462? -1680810 What is the first derivative of 4z3 - 1169z*2 - 396z + 38791958? 12z2 - 2338z - 396 What is the second derivative of 14jl*2r + 13jlr2 + 70jr2 - j + 840l*2r*2 + 281l*2r + l*2 + 7lr2 + 178l + 2r2 wrt l? 28jr + 1680r*2 + 562r + 2 What is the third derivative of 1040287d3g*2 + 35d*3g - 2d3 - 10d*2g*2 - 3d*2 + 5dg2 + 193g*2 + 252g wrt d? 6241722g2 + 210g - 12 What is the derivative of 1505i2 - 19229i - 530845452? 3010i - 19229 Find the second derivative of -4923066m*2 + 7m - 146243 wrt m. -9846132 What is the second derivative of -1850y4 + 130y*3 + 4y*2 - 566y - 14271 wrt y? -22200y2 + 780y + 8 What is the third derivative of 8o5 - 12148302o*4 - 3o*2 + o + 7543497 wrt o? 480o*2 - 291559248o What is the derivative of -79562865x4 - 305045289? -318251460x*3 What is the second derivative of 9h*4 + 13730h*2o + 63002ho - 124h wrt h? 108h*2 + 27460o Find the second derivative of -2v5 - 96759v*4 - 9v*2 - 45585559v wrt v. -40v3 - 1161108v*2 - 18 What is the second derivative of -220981429i*2x*2 + 188464325ix2 wrt i? -441962858x*2 What is the second derivative of -34488903m*2 - 3431057m? -68977806 What is the second derivative of 8406285h3 - 72856956h wrt h? 50437710h Find the first derivative of -107b*2 - 139638bm + 4441781m - 12 wrt b. -214b - 139638m Find the second derivative of -6086b3 - 452b*2 + 81011b - 414 wrt b. -36516b - 904 Find the third derivative of 29439h*4k + 2h4 + 84h*3k - 2h3 - 911h*2k + 17h2 + hk - 69k - 1 wrt h. 706536hk + 48h + 504k - 12 What is the second derivative of -13291657f*2n*5 - 3f*2n - 36108783f2 wrt n? -265833140f*2n*3 Differentiate -14275860k*2q - 7k2 - 3021184q + 62 wrt k. -28551720kq - 14k Differentiate -473763437j*2 + 108303071. -947526874j Find the third derivative of -278301794bp*3 - 2878bp2 + 14b + 117p2 + p + 3 wrt p. -1669810764b Differentiate 7440255doz + 29751do - 34oz + 1410o with respect to z. 7440255do - 34o What is the first derivative of -496456847z*3 - 593731331 wrt z? -1489370541z*2 Differentiate 14505693f + 182928723 wrt f. 14505693 Find the third derivative of 12393218p4 - 655671p*2 - 2p + 3. 297437232p Differentiate -227971d*3 + 121d + 6826614 wrt d. -683913d2 + 121 What is the third derivative of -9313199r*3 - 325r*2 + r - 895? -55879194 What is the third derivative of 2263ik3 - 2ik2 + 25ik + 39i + k*4 + 1903k*3 - 2k*2 - 5k wrt k? 13578i + 24k + 11418 What is the derivative of -1396089c2k - 10414003c2 wrt k? -1396089c*2 What is the third derivative of 59102668p*3 - 173124495p*2 wrt p? 354616008 Differentiate 2042930k*4 + 16419060 wrt k. 8171720k*3 What is the third derivative of 133197f*5 + 2f*2 + 2440f + 169 wrt f? 7991820f2 Find the third derivative of -9301p*6 - 2639p*4 - 4p*2 + 4473387 wrt p. -1116120p*3 - 63336p What is the second derivative of -43572912cm*2 + 146010cm - 14m wrt m? -87145824c What is the third derivative of 2z*6 + 5824187z*5 + 2z*3 - 35725555z*2 wrt z? 240z*3 + 349451220z*2 + 12 What is the derivative of 789953391z - 553045382? 789953391 Find the third derivative of -35981772b5k + 15591b2 + 373bk wrt b. -2158906320b*2k Find the third	{ "pile_set_name": "DM Mathematics" }
2 assuming l is positive. l*(-1568/15) Simplify (u/(uu*(-1/2)u)u)(-10/11)u*13u(-5)/u assuming u is positive. u(72/11) Simplify (u/(u/(u/u(2/7))))29u/(uu*(-4)u)(uu*(9/4)u)/u assuming u is positive. u(755/28) Simplify (o(1/19)/(oo(-4/5)))/(o0/((o/o17)/o)) assuming o is positive. o(-1629/95) Simplify n(-8)n*(-11/4)n*(-10)n(n(n/((n/(nnnnnn(-11)nn))/n))/n)/n assuming n is positive. n(-95/4) Simplify (dd(4/9))/d(-2/7)(d(-1/4))(-22) assuming d is positive. d(911/126) Simplify ((y(-1)y)/y(-2/7))/(y(2/3))35 assuming y is positive. y(-484/21) Simplify (((y(2/5))(-3/16))(-4/13))(26/7) assuming y is positive. y*(3/35) Simplify ((jj(-5)/j)/j(-5)j((jj/j(-2))/j)/jj/(j/((j/(j/(((jjj/(jj/j(-5/2)j)j)/j)/j))j)/j))j)19 assuming j is positive. j(19/2) Simplify (f/f0)32/(f(f*(-2)f)/f)(-2/5) assuming f is positive. f(158/5) Simplify (k(-3/2))(-17)/(kk/(k29k)k(7/4)) assuming k is positive. k(207/4) Simplify q(-17)q*1qqq*(-26)qq(-34)qq assuming q is positive. q(-71) Simplify (rrr/(rr/r*0rr)rrr/((rr/(((r/(r/(rrrr*(-5/6)/rrr)))/r)/r))/r))/(r(-4)/rr*(-9)r) assuming r is positive. r*(91/6) Simplify ((a((a/(a*(1/2)/aa))/a)/a)/a)(2/7)/(a/a(1/4))(10/7) assuming a is positive. a(-3/2) Simplify (((ll(5/3))/l(l/(l/(l/(ll/(l/((l/l1)/l))))))/l)39)(-30) assuming l is positive. l(-1950) Simplify (((p(p*(-10)p)/pp)/p10)43)(-2/3) assuming p is positive. p516 Simplify (m(-20)/m)/m4((m((mm*(-5/4))/mmm)/m)/mm)/m(-13) assuming m is positive. m(-45/4) Simplify ((v*4v1)/(v(1/4))(-25))(-12) assuming v is positive. v(-135) Simplify (f1f/(fff/(f(-8)/f)f))/((f/(ff2))/f9) assuming f is positive. 1 Simplify (b(-2/11)b)*(-2/13)bbb/((b*(2/61)/b)/b)b(-2/59) assuming b is positive. b(2474183/514657) Simplify ((s(s/(s13/s))/sss)/s(13/2))/((s17s)/(s*(-5/7)s)) assuming s is positive. s(-465/14) Simplify (o8/((o/(o/(o/o(-15))))/o))/(o(-1/2))(-15) assuming o is positive. o(-29/2) Simplify (c*1c*(-6/11)/ccc)/((c0c)/c(2/25)) assuming c is positive. c(147/275) Simplify q*(-12)q*(-6)q*(-1/18)q(-1/22) assuming q is positive. q(-1792/99) Simplify ((ll10)/l)/l(18/5)(l/l(-13))(2/175) assuming l is positive. l(164/25) Simplify ((s7/sss)/(s/(s*(1/2)s)s))/(s(-4/9)(sss*(4/3)s)/s) assuming s is positive. s(83/18) Simplify ((g/g(-21)ggg/(gg*(-11)gggg))(-6))(5/8) assuming g is positive. g(-465/4) Simplify ((uuu/(u/(u(-2)/u))uuu)*11(u(-4)/u)(2/21))15 assuming u is positive. u(2260/7) Simplify (p/(p*31/p)p(-4/11))(-45) assuming p is positive. p(14535/11) Simplify g(-3)/(g*(-6)g)(g(1/2))27 assuming g is positive. g(31/2) Simplify j(7/5)/(jj*(6/5))j*9/(jj(-3/16)) assuming j is positive. j(591/80) Simplify ((((kk/(k(-4)k))/k)/(k/(k/(kk9kk))))(-5/6))(2/31) assuming k is positive. k(40/93) Simplify ((h/(h/((((hh*(7/3)/h)/h)/h)/hh))h)/(h9/h)h*(2/15)h(-1/20)/h)(2/33) assuming h is positive. h*(-91/198) Simplify (uu(-2/5))(-2/33)u(6/5)u/((uu(-11)uu)/u)u assuming u is positive. u(669/55) Simplify (z4(z/(zz(2/23)))/z)/(z(-1/17)/(z(zz(-3/8))/z)) assuming z is positive. z(11251/3128) Simplify (((n(n(nn/n(4/3))/nn)/nn)/n)/(nn/(n(-19)/n)))/(n(-3)n(nn(19/2))/n) assuming n is positive. n(-167/6) Simplify (((mm/m(-2/21))/m)/m(-27))(2/13) assuming m is positive. m(1180/273) Simplify nnn/n*(7/5)n*4nn(-18/11)/n(-21) assuming n is positive. n(1428/55) Simplify (q/((q/q14)/q)q(2/37))/(q/q(-8))49 assuming q is positive. q(-15760/37) Simplify (x*(-3/4)/xxx19)/(x(1/7)x(14/5)) assuming x is positive. x(2143/140) Simplify (hh7/h(h/(hh(2/29)h))/h)/((h(-1)/h)/(h(-2/13)/h)) assuming h is positive. h(2178/377) Simplify (v(-5))*(-4/17)((v/v*12)/v)/vv*(10/3)v assuming v is positive. v(-382/51) Simplify ((n(-17)n)/((n/((nn*16n)/n))/n))/((nn(-4/5))/(nn14)) assuming n is positive. n(79/5) Simplify ((ll(-23)/l)/l(-5/3))/(l(-30)lllll/(l*3l)) assuming l is positive. l*(23/3) Simplify ((j/(jj(1/8)))/((j/j(-9)j)/j))/(jj/(jj(1/11))j/(j/j(-2/31))) assuming j is positive. j(-29925/2728) Simplify (f/(f/(f/(f/f(4/7)))))/f19(f/(ff8))29 assuming f is positive. f(-1753/7) Simplify (c8c(-1/6))/(c(-1/19)/(cc(-3/7))) assuming c is positive. c(6749/798) Simplify ((qq(-14))/q)/(q/(q(q/q*13)/qq))q(-3)qq/(q19/q)q assuming q is positive. q(-44) Simplify (m(3/8))28/(m(1/12)m(-2/7)m) assuming m is positive. m(815/84) Simplify h(1/6)/h(h(((h*(-29)/h)/h)/h)/hh)/hhh/(hh(2/49)h)h/(hh/h(-7/4)) assuming h is positive. h(-20947/588) Simplify (a*31a*(1/5)a)/(a/a(2/35))(1/5) assuming a is positive. a(5602/175) Simplify s(-2/13)/(ss5sss)s(s/(s*(-26)/s))/sss/(s/s(-9)) assuming s is positive. s(141/13) Simplify y(-1/50)/yy*(-18/5)(yyy*(-5/2)y)(-2/107) assuming y is positive. y(-24767/5350) Simplify (gg(2/5))/(g(-22)g)g(4/7)g(3/8) assuming g is positive. g(6537/280) Simplify (j*(-11)j*(-1/6))/(jj(j(5/2)/j)/jjjjj(-1/5)) assuming j is positive. j(-247/15) Simplify (a/((aa(-3/5))/a))37/(a(-1/8))(4/23) assuming a is positive. a(13621/230) Simplify (((h8/h)/(hh((h*1/h)/hh)/hh))/(hhh2h)(-15))(1/16) assuming h is positive. h5 Simplify (l(-5/7)/(ll(5/4)))/(l(1/4)/(ll*4l)) assuming l is positive. l(39/14) Simplify l(-8)ll*(2/19)ll(-2)/(l/(l/(ll6))) assuming l is positive. l(-283/19) Simplify ((d*34/d)/((dd22)/d))(-48) assuming d is positive. d(-528) Simplify (n(-2/7))(-7/5)/(((n(1/16)/nn)/n)/nnn(1/24)) assuming n is positive. n(311/240) Simplify (g(15/7)g(6/5))(-14) assuming g is positive. g*(-234/5) Simplify (((((j/(j(jjj*24j)/j))/j)/jj)/j)/j)/j(jj/j8j)/j(j/j(4/13))/(jj27) assuming j is positive. j(-823/13) Simplify (nn/n(2/5))15/((n(-2/21)n)/(n*(-1/12)n)) assuming n is positive. n*(2017/84) Simplify (((vv/(vv(3/5)))/v)/(v/v2)((v*(-7)vv)/v)/((v/(v/(v/v3)))/v))49 assuming v is positive. v(-637/5) Simplify (f/f1)(-3/4)(f4)(-31) assuming f is positive. f(-124) Simplify w(-2/51)/ww(-19)/www(-4)w/(ww(-1/11)) assuming w is positive. w(-13435/561) Simplify pp*(1/2)ppp*(-12)/pp(((p1/p)/p)/p)/pp*12/p assuming p is positive. 1/sqrt(p) Simplify pp*6pp/(p0/p)(p*(1/8)p)/pp(2/5) assuming p is positive. p(421/40) Simplify (q9)(3/20)/(((((q/q(-2/3))/q)/q)/qqqq)/qq)(2/3) assuming q is positive. q(43/180) Simplify w(-1/6)/ww/(ww(-7)/w)w((ww*(3/4))/w)/(ww*(1/12)ww) assuming w is positive. w(11/2) Simplify c7cccc/((cc*(-20)c)/c)(c6)11 assuming c is positive. c96 Simplify (((g(1/3))(-6/19))34)(2/19) assuming g is positive. g(-136/361) Simplify ((aa(-3/4))/a)1a/(aa*(-4/7))a(2/9) assuming a is positive. a(11/252) Simplify (((g/(g/(g/((gg(-2/15))/g))))/g(1/4))/(g(-3)g(1/4)/g))29 assuming g is positive. g*(4031/30) Simplify ((((m/(m/(mmmm*(-2/9)mm)))/m)/m)/m)(2/5)(m*(-6)m)/m(-2/23) assuming m is positive. m(-4349/1035) Simplify u(-2/5)/(u(-2)/u)(u(-1))(-1/6) assuming u is positive. u(83/30) Simplify (i(8/3)i11)(20/7) assuming i is positive. i*(820/21) Simplify ((uu(-5)/u)/(u/(u/u(-2/11)))(u(-1))(1/11))(17/2) assuming u is positive. u(-459/11) Simplify (m/m(-11))/(((m(-14/11)/mm)/m)/m)(m(-12)m)10 assuming m is positive. m(-1042/11) Simplify (i/i35)/(i/(i(-1/10)i))(i(-1))27 assuming i is positive. i(-611/10) Simplify (n(-1)/(((nn3)/n)/nn))/(n/(n*(-13)/n)n16) assuming n is positive. n(-35) Simplify (((u0)(-12))(-16))(-2/9) assuming u is positive. 1 Simplify (h(-3))(2/7)h(-4)h(3/5) assuming h is positive. h(-149/35) Simplify k/(kk12)k**	{ "pile_set_name": "DM Mathematics" }
of 3k4/2 - 2k - 3. Differentiate q(n) with respect to n. 18n2 Suppose 3 = 3h - 3z, -z - 11 = -4h - 4z. Find the second derivative of -5v + hv + 4v - 2v3 wrt v. -12v What is the third derivative of -7l3 - l2 + 14l*2 + 7l*3 - 17l*4 wrt l? -408l Let m(a) = -7a + 22. Let d(y) = -4y + 11. Let c(i) = 11d(i) - 6m(i). Let j(n) = n + 6. Let z(s) = 4c(s) + 7j(s). Find the first derivative of z(f) wrt f. -1 Let m = 30 - 28. What is the second derivative of -3u - 2u*4 - 12u*m + 12u*2 - 5u*4 wrt u? -84u*2 Let r be ((-3)/(-1) - 1)1. Suppose o - 5z = 11, -rz + 7z = 4o - 14. Find the first derivative of 5v3 - 3v*3 + 0v*3 - o wrt v. 6v2 Let j(w) be the second derivative of w8/56 + 11w4/12 - 13w. Find the third derivative of j(a) wrt a. 120a3 Let p(s) = s5 + s4 - s2 - s + 1. Let f(b) = 30b*5 + 3b*4 - 3b*2 - 15b + 3. Let w(c) = -f(c) + 3p(c). What is the second derivative of w(x) wrt x? -540x*3 Let u(r) be the first derivative of 3/4r*4 - 3/2r*2 + 0r + 0r3 + 5. Find the second derivative of u(h) wrt h. 18h Let l be (6/(-8))/(3/(-12)). What is the third derivative of 11u2 + 0u*2 - 9u*2 - 2ul wrt u? -12 Let m(z) be the first derivative of -z6/5 + 5z4/12 + 8z + 2. Let g(i) be the first derivative of m(i). Find the third derivative of g(p) wrt p. -144p Let v be (-23)/(-5) + (-6)/(-15). Find the third derivative of 6b*3 - 4b*3 - 3b*2 - 2b*3 + 2b*v wrt b. 120b*2 Let l(b) be the first derivative of -9b*4/4 + 5b*3/3 + 10. Find the third derivative of l(n) wrt n. -54 Let k(q) = 7q*2 - 4q - 44. Let i(t) = -36t2 + 20t + 219. Let l(a) = -2i(a) - 11k(a). Find the first derivative of l(g) wrt g. -10g + 4 Let d(q) be the second derivative of -13q*3/3 - 13q*2 - 8q. What is the derivative of d(v) wrt v? -26 Let b = 6 - 4. Suppose 7g = bg + 10. What is the third derivative of 3u2 - 3u*2 + 3u*g - 3u*5 wrt u? -180u*2 Let c(q) be the third derivative of 2q5/15 + q4/4 - q*2. Find the second derivative of c(j) wrt j. 16 Suppose 3f + j + j = 5, 3f + 5j = -1. Differentiate 11 + 0 + 10y2 - f - y2 wrt y. 18y What is the third derivative of 2x4 - 8x*2 + 8x*2 + 7x*2 + 4x*4 wrt x? 144x Let j(x) = -4x3 - 14x. Let c(f) = -3f3 - 13f. Let d(v) = -7c(v) + 6j(v). What is the second derivative of d(r) wrt r? -18r Suppose -5k + 4g + 429 = 139, 0 = -3g. Let h be (-4)/18 - k/(-18). What is the third derivative of 0t2 - ht4 + t4 - 2t2 + 5t*2 wrt t? -48t Let i(c) = -174c2 - 34c - 161. Let h(p) = -29p2 - 6p - 27. Let z(y) = 34h(y) - 6i(y). Differentiate z(q) wrt q. 116q Let p(c) be the first derivative of -7c6/360 + c4/24 + c*3 - 1. Let t(h) be the third derivative of p(h). Differentiate t(n) with respect to n. -14n Let s(w) be the third derivative of -w*4/6 - 4w*3/3 - 2w*2. Let m(g) = -g + 1. Let p(q) = 6m(q) + s(q). What is the first derivative of p(j) wrt j? -10 What is the third derivative of 22v2 + 37v*3 - 12v*3 - 11v*2 wrt v? 150 Suppose 5c = -2k + 5, -2k = -4c + 2k + 32. Suppose -cq = 2q - 10. Find the second derivative of qs - s2 - s - 2s2 wrt s. -6 Let s(m) be the third derivative of m7/30 + m*3/2 - 7m*2. What is the first derivative of s(b) wrt b? 28b3 Let h(n) be the second derivative of n6/10 - n*4/12 - 8n*3/3 - n - 17. Find the second derivative of h(m) wrt m. 36m*2 - 2 Differentiate 41i*2 + 52i - 21i2 + 42 - 2i - 18i2 wrt i. 4i + 50 Let v(l) = l*2 + l. Let k = 3 + -2. Let a = -16 + 14. Let n(u) = -2u*3 + 2u*2 - u. Let j(x) = av(x) + kn(x). Find the second derivative of j(f) wrt f. -12f Let l(c) be the first derivative of 0c2 + 0c*6 - 4 + 0c*4 + 0c*5 + 4/7c*7 + 0c + 4/3c3. What is the third derivative of l(k) wrt k? 480k*3 Let s(w) be the third derivative of 0 + 0w*4 + 0w - 2/3w3 + 0w*5 - 6w*2 - 11/120w*6. What is the derivative of s(z) wrt z? -33z*2 Let b(f) = 34f*3 - 39f*2 - 2f + 2. Let n(t) = -101t3 + 116t*2 + 7t - 7. Let s(g) = -7b(g) - 2n(g). What is the third derivative of s(w) wrt w? -216 Let u(w) be the first derivative of -2w5/5 + 39w*2/2 + 60w - 2. What is the derivative of u(m) wrt m? -8m3 + 39 Let m(o) be the second derivative of 2o6/5 - o2 - 7o. What is the first derivative of m(j) wrt j? 48j*3 Suppose 3n - 9 = -0n. Let u(d) be the first derivative of n + 0d*2 + d + 2/3d*3. Differentiate u(k) wrt k. 4k Suppose 8t - 15 = 3t. What is the second derivative of 9g2 - 2g - t - 11 + 14 wrt g? 18 Let a(r) be the second derivative of 23r6/30 + 27r*2/2 - 32r. Differentiate a(p) with respect to p. 92p3 Suppose 3 = m - 0. Find the first derivative of -3c*3 - 5c + 3c - m + 2c wrt c. -9c2 Find the third derivative of -12q*5 - 4q*5 + 6q*5 - 5q*2 + 3q*5 wrt q. -420q*2 Let n(r) = 2r + 1. Let s(p) = p + 2. Let q be s(0). Let t be n(q). Find the first derivative of t + 1 + 3m - 3 wrt m. 3 Suppose 2o - 13 = o - 5d, 3o - 5d = -21. Let a be -1 + 3 - o/1. Find the second derivative of 10r*3 + 3r - 10r3 + 3r*a wrt r. 36r*2 Suppose -2z + 4 = r + 4r, 8 = -2r - 4z. Find the second derivative of 0j - j + 3j - rj*4 wrt j. -24j*2 Let f(i) = 5i*3 + 9i*2 + 7. Let x(l) = -2l*3 - 4l*2 - 3. Let q(o) = -4f(o) - 9x(o). Find the first derivative of q(w) wrt w. -6w2 Let w(r) be the second derivative of -r5/5 - 9r3/2 + 5r. What is the second derivative of w(h) wrt h? -24h Let s(y) = 6y - 1. Let c be s(1). What is the second derivative of -2b5 + 2b4 - bc + 3b - 2b*4 wrt b? -60b3 Let g(q) be the first derivative of q6/180 - q*4/12 - 2q*3/3 - 2. Let o(z) be the third derivative of g(z). What is the first derivative of o(s) wrt s? 4s Let q(v) be the second derivative of 17v6/30 - 9v*2/2 + 16v. What is the derivative of q(c) wrt c? 68c3 Let f(m) be the second derivative of 3m5/10 + m3/3 + m. Find the second derivative of f(w) wrt w. 36w Let y(r) = -3r*2 - 2. Let p(o) be the second derivative of -3o*4/4 - 3o*2 - 3o. Let t(j) = 2p(j) - 7y(j). Differentiate t(u) with respect to u. 6u Let c(t) be the second derivative of -31t5/20 + t2/2 + 9t. Differentiate c(l) with respect to l. -93l*2 Let z(w) be the first derivative of -19w*2/2 - w - 2. Let d be z(-1). Differentiate 3u*4 + 2 - 18u*3 + du*3 with respect to u. 12u3 Let x(h) = -h3 + h*2. Let d(y) = 7y*3 + 6y*2 - 22. Let j(u) = -d(u) + 6x(u). Differentiate j(n) wrt n. -39n2 Let j(l) be the first derivative of -l6/10 + 3l*2/2 - l - 1. Let w(m) be the first derivative of j(m). What is the first derivative of w(z) wrt z? -12z3 Let f(z) = -z2 - 17z. Let j(n) = -3n. Let o(c) = -6f(c) + 39j(c). Find the second derivative of o(r) wrt r. 12 Let o(u) be the first derivative of u9/56 + u5/6 + u*2 + 8. Let z(h) be the second derivative of o(h). What is the third derivative of z(y) wrt y? 1080y3 Let u(a) be the third derivative of -a6/120 + a5/20 - a2. Find the third derivative of u(z) wrt z. -6 Let w(j) be the first derivative of 2j3/3 + j2/2 - 6. Find the second derivative of w(o) wrt o. 4 Let k(i) be the second derivative of -1/3i*4 + 0i*2 - i + 0 - 5/6i*3. What is the second derivative of k(d) wrt d? -8 Let f = 13 + -20. Let x(d) = 3d*2 + 10d. Let z(b) = -2b2 - 7b. Let u(q) = fz(q) - 5x(q). Find the second derivative of u(g) wrt g. -2 Suppose 4z - 5b = 18, -z - 6 = -4b + 8b. What is the second derivative of -3r5 + 0r*5 - 4r - zr + 2r wrt r? -60r3 What is the derivative of 4i - 6 - 6i + 4i - 5i wrt i? -3 Let q be 2 + 0 - 18. Let w be ((-8)/q)/((-2)/(-15)). What is the first derivative of -7t2 + wt*2 - 2 + 1 wrt t? 6t Let j(o) = -o*3 + 3o*2 + 3o - 4. Let m be j(3). Find the second derivative of -f + 0f - mf*2 + 3f*2 wrt f. -4 Let l(g) be the third derivative of 2g7/35 - g4/24 - 8g2. What is the second derivative of l(b) wrt b? 144b*2 Suppose 0 = -2q + 5l - 15, -3l = 5q + 2l - 15. What is the first derivative of -3 + 2 - 3 + qo3 - 2o*3 wrt o? -6o**2 Let k(h) = h - 13. Let r(t	{ "pile_set_name": "DM Mathematics" }
+ l + wc and give r. -251 Express 1571n - 523n - 519n - 526n + 212 as o + rn and give o. 212 Rearrange 7r3 + 4 - 106r - 2 - r3 - r3 to the form xr3 + or*2 + br + a and give x. 5 Rearrange (4w + w - 2w)(6262 + 4868 - 4969) to gw + m and give g. 18483 Express -263 - 272 - 140t + 506 as rt + h and give r. -140 Express -416h - 10h*2 + 839h - h*2 - 1 - 397h in the form th + q + oh*2 and give o. -11 Express 146y - 8y3 + 157 + 3y*3 - 294y + 148y as jy*2 + zy*3 + c + xy and give z. -5 Express (17o2 + 18o*2 - 50o*2)(40 + 4o2 - 790o + 791o - 2o*2) in the form m + do*3 + no*4 + go*2 + zo and give n. -30 Rearrange (0 - 4 + 1)(0h - 4h + 3h)(59 - 109 - 75)(-6 + 4 - 1) to the form ch + n and give c. 1125 Express (3 + 1 - 2)(345 - 399 + 738)(10c + 3 - 3) as yc + d and give y. 13680 Rearrange -7q + 3 - 22q - q4 - q2 - 133q*3 + 133q*3 to the form yq*2 + hq*4 + oq*3 + v + uq and give h. -1 Express 0c3 + 6c*3 - 5c*3 + (-23c*2 - 29c*2 + 8c*2)(-3c + 2c - c) + (-c - 2c + c)(1 - 2c2 - 1) as sc*2 + y + ac*3 + fc and give a. 93 Express 1 - 1 - a + (0 + 4 - 5)(2a + 4a - 4a) + 0a + 2a - a + (1 + 2 - 1 + (-1 + 0 + 3)(-6 + 1 + 3))(-274a - 52a - 74a) as wa + d and give w. 798 Express (185632872 - 185632872 + 21738j)(-j + 0 + 0) as c + pj + lj*2 and give l. -21738 Rearrange -42 + 11 + 16 + 15 + 32482y to the form f + xy and give x. 32482 Rearrange (-8c - 3c - 12c)(2284c*2 - 326c*3 - 2284c*2) to the form d + kc + ic4 + vc*3 + ac*2 and give i. 7498 Express -2b + 2b + b2 + (32b + 5b - 6b)(11b - 5b + 0b) as gb2 + tb + y and give t. 0 Express -k - 408914 + 6k + 2k*2 + 408921 as ak + xk2 + d and give x. 2 Rearrange (-215 - 33 + 41)(-3 + 2 + 3)(27a - 326 + 326) to v + oa and give o. -11178 Rearrange -170j*2 - 2 - 37j - 41j + 92j*2 + 78j to the form x + zj + pj*2 and give x. -2 Rearrange -147 - 31724x + 31715x - 53 to y + rx and give r. -9 Rearrange -185l + 185l + 17l3 + (3l - 3l + l)(0l - 2l*2 + 0l) - 51l3 - 23l*3 - 2l*3 to wl*3 + a + ql*2 + gl and give w. -61 Rearrange -4930z + 69z*2 + 4930z + (102z + 183 - 183)(5z - 3z + 0z) to the form h + pz*2 + iz and give p. 273 Rearrange -2v2 + 287v*3 + 635 - 65v*3 - 218v*3 to the form a + iv*3 + ov + fv2 and give i. 4 Express 3 - 8 - 610254p*3 + 5p - 3p4 + 610249p*3 in the form x + np*3 + dp*2 + lp*4 + wp and give x. -5 Express -5 + 0 + 3 - 10i3 - 118i*2 + 121i*2 - 1 + 3i in the form v + mi3 + li + zi2 and give z. 3 Rearrange -178 - 144 + 2s - 142 - 21s4 + 449 to ns + u + ps4 + ks*3 + bs2 and give n. 2 Rearrange (-8 - a2 + 8)(1 - 12 + 18)(-3 - 2a + 3) + (-11 + 4a + 11)(0a*2 - 3a*2 + 4a*2) to the form sa + ja2 + h + va*3 and give v. 18 Express 14 + 1821n + 7 - 1867n - 2n*2 in the form w + zn + dn2 and give z. -46 Express 677r*4 - 5r - 4 - 723r4 + r2 + 5r as ir + ar*4 + l + br*2 + xr*3 and give l. -4 Rearrange -18299n + 35672n - 20038n - n - 3n + n + (-1 + 3 - 3)(0n + 2n - 4n) to the form xn + k and give x. -2666 Express -2 + q + 2 + 22 - 29 - 52 - q + 0q + 3q - 2q + (5 - 2 + 1)(1 - 3q - 1) as j + uq and give u. -11 Express -343l + 90l - 255l - 137l + 26l - 5l*2 as pl*2 + xl + u and give x. -619 Express (2f - f + 0f)(3382 + 518 + 206 + 5141)(-1 - 2f2 + 1) in the form lf + jf2 + qf*3 + s and give q. -18494 Express -51 + 9x - 66 + 43 - 3 - 58 in the form ux + n and give u. 9 Express -1934d - 1610 + 770d + 3220 - 1610 in the form z + ld and give l. -1164 Rearrange -11191w4 - 2w*2 + 4w*2 + 0w*2 - 4w*3 + 2w*3 + 11048w*4 to the form f + tw + jw4 + zw*2 + aw*3 and give z. 2 Express 93s - 224s + 129s - 14s2 - 3s*4 - 3s*3 as is + ns2 + as*3 + us*4 + y and give i. -2 Express -5 + 7 + 58v - 1 + 9v as r + jv and give j. 67 Rearrange (-59w + 8w + 25w - 6144 + 20w)(-3 + 5 + 0w*2 + 3w*2) to uw*3 + o + zw + fw2 and give u. -18 Rearrange -2b*2 + 2 - 1342b*3 + 70b - 48b - 22b to the form xb2 + fb*3 + kb + t and give x. -2 Rearrange 1467049g2 - 3g*4 + 183 - 1467049g*2 + 5g to mg3 + d + pg*2 + og*4 + jg and give o. -3 Rearrange 4g3 - 24g*3 - 9g*3 + 15g*2 - 40g*2 + 2g*3 to the form tg*3 + xg + s + og2 and give o. -25 Express (5f*2 + 5f*2 - 4f*2)(-2f - f + 2f) + 117f - 117f + f3 + f2 in the form mf + vf*2 + if*3 + l and give v. 1 Express 31093t*2 - 16276t*2 - 4972t*2 as jt + o + st2 and give o. 0 Express (-5 + 2 - 6)(-4 + 1 + 2)((2 + 2 - 11)(5 + 9 - 5) - 3 - 1 + 2)(12o + 18o - 13o) as go + u and give g. -9945 Express -4h*2 + 9h*2 + 3h*2 + (-5h + 0h + 3h)(-2 + 2 + 2h) - 2 + 2 - 3h2 + (3h + 53 - 53)(2h - 14h + 3h) as lh + gh*2 + y and give g. -26 Express -5f*4 + 12f + 5f2 + 98 - 25f*3 + 23f*3 - 4f*2 - 100 in the form yf*3 + jf*4 + sf*2 + i + uf and give y. -2 Rearrange (6 - 2m2 - 6)(1326 - 4671 - 2501 - 1712) to k + hm2 + am and give h. 15116 Express -4a2 - 236a*4 - 8a - 2 + 359a4 - 4a*2 + 10a + 7a2 as ga*4 + ma + sa2 + i + ha*3 and give i. -2 Rearrange (1 - 31 - 47)(0 + 1 + 1)(-1 + 1 - 1)(t + 0t - 2t) to dt + h and give h. 0 Express -2 - 2 - 731x*2 + 94x*3 + 734x*2 in the form nx*3 + kx + h + yx2 and give k. 0 Rearrange (0y + 2y - 4y)(2y + 4y - y) - y2 - 2y*2 + 0y*2 - 4y*2 + 2y*2 + 0y*2 + 4y*2 + 0y*2 + 0y*2 to uy + d + ty2 and give t. -11 Express 2c3 - c3 + 3c3 + (166 - 301 + 234)(1 + 2c - 1)(0c + 0c - 2c2) in the form sc*2 + y + hc*3 + qc and give h. -392 Express (0s + 4s + 0s)(-4 + 1 + 4)(6 - 14s + 7s - 83s) as t + cs2 + os and give c. -360 Rearrange -299o3 + 706o*3 + 690o*3 - 3o2 + o3 + 3o2 + (-11o + 3o2 + 11o)(-3o + 3 - 3) to uo + l + vo*3 + no*2 and give v. 1089 Express 5b - 6b - 2b + (6 - 8 + 5)(179b - 2831 + 2831) as n + hb and give h. 534 Rearrange 4l*2 + 432l - l*2 - 141l - 144l + 4 + 10l*3 - 148l to x + al2 + cl*3 + yl and give y. -1 Rearrange -310 + 630 + 1113j - 319 to the form mj + h and give m. 1113 Rearrange -2 - 737w + 737w - 3w2 - 7w*4 + 991w*3 + 26 - 989w*3 to nw*3 + vw*2 + d + lw*4 + tw and give v. -3 Express -2m + 4m - 2m2 - m + 10m*2 - 2m*2 + 0m*2 + (-3 + m + 3)(-m + 2m + 0m) + 2m2 + 4m*2 - 3m*2 in the form v + um + nm2 and give u. 1 Rearrange -11j*4 + 15j + 23j4 + 150j*3 - 151j*3 - 13j4 + j2 to m + gj3 + dj*4 + xj + rj2 and give g. -1 Express -16 + 6589o2 - o3 + 2o - 6592o*2 + 2 as u + ko + lo2 + bo*3 and give l. -3 Express (-2 + 5 + 0)(516 - 1043 + 526 + 1089z) as mz + o and give m. 3267 Rearrange 26209 - 34362n - 26209 to the form d + jn and give j. -34362 Rearrange 7669 - 7669 + 4793u2 to gu*2 + w + yu and give g. 4793 Express (7l3 - 3l*3 + 16l3 + (-l2 + l2 + l2)(7l - 2l - 2l))(-88 - 133 - 8 + 29) as rl + xl3 + ol*2 + a and give o. 0 Express 190710d2 - d3 - 2d3 - 190701d*2 - 34 - 14 + d as xd*2 + ud + o + nd3 and give n. -3 Express (-19637 - 4893 - 10660 + 4314 + 147)(-3 + 7 - 1)(-3v + 2v + 0v) as l + nv and give n. 92187 Express (1289l + 404l + 1003l + 227l + 2599l)(-l2 + 3l*2 + 0l*2) as h + xl + bl3 + sl*2 and give b. 11044 Rearrange -41 + 3i - 27 - 648i2 + 213i*2 + 66 - 12i*3 + 15i*3 to ti*2 + h + di + mi3 and give h. -2 Rearrange -3a + 18 + 16a3 + 10 + 2a*2 + 14a*3 + 3a*3 - 27 to za + ca2 + s + ga*3 and give c. 2 Express (-2h + 4 - 4 + (4h + 0h - h)(-5 + 3 - 1))(4h - 2h + 7h + (-2 - 3 + 4)(-102 + 102 - 18h)) as d + th*2 + vh and give t. -297 Express (-4 - 2q2 + 4)(2q - 71 + 589 + 1067) as wq*3 + bq*2 + pq + v and give b. -3170 Express 742r4 + 6 - 2 + 3r + 75 - 372r4 - 371r*4 - 2r*2 in the form z + wr*4 + ar*3 + xr*2 + jr and give j. 3 Express -3034k - 1148k + 2589k as j + wk and give w. -1	{ "pile_set_name": "DM Mathematics" }
- 165m2 - 39m = 0. What is m? -3/19 Factor 54/5p2 + 4/15p*5 + 24p*3 + 0 + 74/15p*4 + 0p. 2p2(p + 9)*2(2p + 1)/15 Let h(c) be the second derivative of -c5/40 - 7c*4/36 - 17c3/36 - c2/2 - 136c. Factor h(t). -(t + 1)(t + 3)(3t + 2)/6 Let g be 4 + 03/6. Suppose 4b*5 + 5b*3 + gb*2 - 4b4 + b3 - 3b3 - 7b*3 = 0. What is b? -1, 0, 1 Let i(d) be the third derivative of 0d + 0 - 19d2 + 0d*3 + 13/288d*4 - 1/720d5. Solve i(v) = 0 for v. 0, 13 Let q = 1681 + -5041/3. Find k, given that -2/3 - k3 + k + qk2 = 0. -1, 2/3, 1 Let u = -10110 - -1213207/120. Let f(y) be the second derivative of 0y*2 - 2y - 1/8y4 - uy*5 + 0 - 1/18y*3. Factor f(b). -b(b + 1)(7b + 2)/6 Suppose 9b - 4b - 40 = 0. Let o = -5 + b. Determine h so that -8h4 - 7h*4 + oh*5 - 3 + 9h - 10h2 + 6h - 20h2 + 30h*3 = 0. 1 Let j = 463/4 - 2309/20. Let g(h) be the first derivative of -1/5h + 7 - 1/5h3 - jh*2 - 1/20h*4. What is u in g(u) = 0? -1 Let o(y) be the first derivative of -1/24y*6 - 1/16y*4 + 0y*2 + 0y + 0y3 - 18 + 1/10y5. Factor o(x). -x3(x - 1)2/4 Let m(o) = -2o - 3. Let f(n) = -6n - 9. Let q(c) = 4f(c) - 11m(c). Let a be q(-3). Solve -11p*3 + 5p*2 + p + p + 2p*3 - ap*3 = 0 for p. -1/4, 0, 2/3 Suppose 6b + 0b4 + 2b - 9b2 - 13b + b*4 - 3b*3 = 0. What is b? -1, 0, 5 Let y(a) = 8a*4 - 56a*3 - 128a*2 - 68a. Let x(n) = -9n4 + 55n*3 + 127n*2 + 68n. Let b(c) = 4x(c) + 5y(c). What is k in b(k) = 0? -1, 0, 17 Let f be 4/10 - (-130)/50. Let s be (6/4)/f10. Let -p + 28p*2 + 6p + 23p4 - 3p*4 + 4p*s + 3p + 36p3 = 0. What is p? -2, -1, 0 Let p = 135/8 - 401/24. Let t(c) be the third derivative of -1/84c*8 - 5c*2 + 0c*3 + 0c + 0c5 - pc*4 + 0 + 1/15c*6 + 0c*7. Factor t(n). -4n(n - 1)2(n + 1)2 Let w(k) = k3 + 6k2 - 3k + 30. Let b be w(-7). Find r such that -4/7 - br2 + 18/7r = 0. 2/7, 1 Let g(c) = 78c - 8. Let t be g(1). Suppose -9i*3 + ti*3 + 14i*5 - 66i*4 - 96i + 80i2 - 2i*3 + 5i*3 - 32 = 0. Calculate i. -1, -2/7, 2 Factor -15/2q*2 - 1/2q*4 - 9/2q*3 - 7/2q + 0. -q(q + 1)2(q + 7)/2 Suppose y = -5u - 16, -3u - 85 = 2y - 81. Factor 0 - 2l*y - 4/3l - 1/3l5 - 13/3l*3 - 4l*2. -l(l + 1)*2(l + 2)*2/3 Suppose -2z - 6 + 10 = 0. Let -53 + 2u3 + uz + 53 - 3u*2 = 0. What is u? 0, 1 Suppose 2w = -w + 120. Solve -240y + 6y*2 + wy*4 + 240y + 30y3 - y2 = 0. -1/2, -1/4, 0 Suppose m - 14m2 - m3 + m*2 + 6m*2 + 7m*2 = 0. What is m? -1, 0, 1 Let g be (-5)/62408/(-1505). Solve -18h4 + 6h*2 - gh - 40/3h5 + 0 + 8/3h*3 = 0. -1, 0, 1/4, 2/5 Factor 12/5o*2 - 2/15o*3 - 52/5 - 118/15o. -2(o - 13)(o - 6)(o + 1)/15 Let c be 1/(-1(-2)/(-10)). Let a be (c - 1)/(10/(-5)). Suppose -10x3 - 21x*4 - 12 - 48x - 63x3 - 3x*5 - 75x*2 + 16x*a = 0. What is x? -2, -1 Let v be 72/(-8)42/(-35)(-40)/(-36). Determine n so that 69/4n*2 + 3 + 9/4n*4 - 21/2n*3 - vn = 0. 2/3, 1, 2 Let p(y) be the third derivative of y*8/210 + 2y*7/525 - 11y*6/50 - 16y*5/75 + 8y*4/15 - 131y2. Let p(j) = 0. What is j? -4, -1, 0, 1/2, 4 Let h(k) be the second derivative of -k5/10 + 8k4/3 - 5k*3 + 3k + 7. Determine b so that h(b) = 0. 0, 1, 15 Let c(y) be the first derivative of -y*6/90 + 2y*5/15 - 2y4/3 + y3/3 + 12. Let t(l) be the third derivative of c(l). Factor t(a). -4(a - 2)2 Let d(l) = l2 + 5l - 640. Let p be d(23). Let i(c) be the third derivative of -4c2 - 1/480c*6 - 1/240c*5 + 0 + 0c + 0c3 + 0cp. Factor i(x). -x2(x + 1)/4 Let p = -461/20 + 774/5. Let q = -131 + p. Factor 1/2 + 1/4w*2 + qw. (w + 1)(w + 2)/4 Let n = -25 - -11. Let q = 18 + n. Factor o3 - 5o*3 + qo*5 + 0o*3. 4o*3(o - 1)(o + 1) Determine i so that -32/5i*3 + 24/5 - 56/5i*2 + 4i + 12/5i5 + 32/5i*4 = 0. -3, -1, -2/3, 1 Let 41c*4 - 3c*3 + 3c - 4c4 + 6c*4 - 82c*2 + 39c*2 = 0. Calculate c. -1, 0, 3/43, 1 Factor 24s*5 + 3/2s*2 + 0 + 0s + 12s4 - 21/2s*3. 3s*2(s + 1)(4s - 1)2/2 Let u(i) = i3 + 8i2 + 3. Let a be u(-8). Factor -7f - f*5 + 7f - 2fa + 2f4 + f4. -f*3(f - 2)(f - 1) Suppose 3i = 4i - 14. Suppose 28 + i = 3f. What is y in -2y - f + 3y3 - y2 + 14 = 0? -2/3, 0, 1 Let q(p) = -3p2 - 99p + 102. Let x(y) = 6y2 + 198y - 204. Let v(s) = 11q(s) + 6x(s). Suppose v(l) = 0. What is l? -34, 1 Factor -1/4b2 + 5b - 3 - 3/4b3. -(b - 2)(b + 3)(3b - 2)/4 Let r(g) = -g. Let y(a) = 2a2 - 14a + 50 - 13a + 3a. Let p(k) = -4r(k) + y(k). Solve p(j) = 0. 5 Let j(c) be the third derivative of -c5/140 - 5c*4/24 + 2c*3/7 - 109c2 - 2. Solve j(l) = 0 for l. -12, 1/3 Let l be (-9)/(2/((-304)/(-12))). Let y = l - -160. Solve w4 - 4w - 42w*5 + yw*5 + 4w = 0 for w. -1/4, 0 Factor 416/7 + 240/7j + 6j*2 + 2/7j*3. 2(j + 4)*2(j + 13)/7 Let a(x) = -16x5 - 21x*4 + 7x*3 - 13x*2 - 6x - 11. Let f(l) = -l5 - l4 + l3 - l2 - l - 1. Let q(r) = -4a(r) + 60f(r). Factor q(c). 4(c - 1)(c + 1)*3(c + 4) Let g = 2/13 - 72/637. Let x = g - -88/245. Factor -xv3 + 2/5v*4 + 0v*2 + 0 + 0v. 2v3(v - 1)/5 Let h(g) = g*3 - g - 1. Let s be h(2). Suppose 3q + 2q + 5 = -5j, 4q = 2j + 14. Factor w*5 - 3w*s + 6w*4 - qw + 2w - 4w*3. -2w*3(w - 2)(w - 1) Let a(p) be the second derivative of -p6/240 - p5/80 + 5p*3/3 - 9p. Let v(m) be the second derivative of a(m). Factor v(s). -3s(s + 1)/2 Let u(x) be the first derivative of -5x8/336 + x7/14 - x6/12 + 13x*2/2 - 6. Let b(z) be the second derivative of u(z). Determine t so that b(t) = 0. 0, 1, 2 Let i(y) = -10y*2 - 17y - 6. Let a be (-95)/3816/10. Let v(n) = -12n*2 - 18n - 6. Let m(t) = ai(t) + 3v(t). Find f such that m(f) = 0. -3, -1/2 Let g(q) be the first derivative of -q6/2160 - q5/90 - q*4/9 - 5q3/3 + 18. Let b(z) be the third derivative of g(z). Factor b(s). -(s + 4)2/6 Let h(i) be the third derivative of -3i7/280 + i6/120 + i5/2 + 3i*4/2 - 35i*3/6 + 33i*2. Let g(s) be the first derivative of h(s). Factor g(c). -3(c - 3)(c + 2)(3c + 2) Let b be (-9 + 4 - -12) + -4 + -3. Suppose 1/5o*4 + 2/5o - 3/5o2 + bo3 + 0 = 0. What is o? -2, 0, 1 Let m(c) be the third derivative of c7/735 - 199c6/420 + 2211c*5/35 - 25047c*4/7 + 95832c*3/7 - 290c*2. Find k such that m(k) = 0. 1, 66 Let p = 16910/6339 - 2/2113. Factor 4j + 8/3 - pj2. -4(j - 2)(2j + 1)/3 Let a(s) = 5s + 12. Let c(n) = 14n + 37. Let p(f) = -11a(f) + 4c(f). Let u be p(-8). Factor 16g4 + 20 - 20g*2 + 10g*5 - 2g - ug3 - 3 - 13. 2(g - 1)(g + 1)3(5g - 2) Let b(j) be the second derivative of j7/14 - 113j*6/10 + 84j*5/5 + 594j. Factor b(h). 3h3(h - 112)(h - 1) Let -88/7l - 48/7 + 2l3 - 36/7l*2 + 2/7l*5 + 12/7l*4 = 0. What is l? -3, -2, -1, 2 Factor 2/3t*3 + 1/3t*2 - 3/2 - 2t - 1/6t4. -(t - 3)2(t + 1)*2/6 Let v(i) be the third derivative of 0i + 1/120i6 - 1/24i*4 + 1/420i*7 + 0i*3 - 17i*2 + 0 - 1/120i*5. Factor v(h). h(h - 1)(h + 1)(h + 2)/2 Let s = 732800 - 589903829/805. Let h = s + -2/161. Solve 1/5j - h - 1/5j*3 + 1/5j*2 = 0 for j. -1, 1 Let f = -110/29 - -2866/725. Let j(h) be the first derivative of 4/15h*3 - 3 - fh*5 + 1/5h*2 + 0h + 0h4 - 1/15h*6. Factor j(l). -2l(l - 1)(l + 1)*3/5 Let o = 9958 + -9958. What is p in 0 + 2/15p*4 + 2/15p*2 - 4/15p*3 + op = 0? 0, 1 Let s = 848 + -5934/7. Factor -10/7m + s + 18/7m*2 - 2m*3 + 4/7m*4. 2(m - 1)*3(2m - 1)/7 Factor -17/3z + 7/3z2 + 2. (z - 2)(7z - 3)/3 Let o(t) = -t3 - 2t*2 + 3t + 5. Let g be o(-5). Solve 0p2 + 60p + 5p2 - gp = 0 for p. 0, 1 Let q = 1889/180 + -94/9. Let j(l) be the third derivative of 0l + 0l*3 + ql*5 - 1/70l*7 + 1/4l*4 - 1/20l*6 + 0 - 4l*2. Factor j(b). -3b(b - 1)(b + 1)(b + 2) Determine q, given that -5q*3 - 141q - 142q2 + 0q*3 + 127q - 7q3 - 8q*3 = 0. -7, -1/10, 0 Let k(a) = 3a*2 - 20a + 29. Let t(p) = -11p - 50. Let x be t(-7). Let u(m) = 39m*2 - 261m + 378. Let f(l) = xk(l) - 2u(l). Solve	{ "pile_set_name": "DM Mathematics" }
oh(c) + wy(c). c + 2 Let t(h) = h*3 - 3h*2. Let g(f) be the first derivative of 0f*2 + 0f - 4/3f3 + 1/4f*4 + 2. Give 3g(q) - 4t(q). -q3 Let y(h) = -5h - 1. Let r(m) = 3m + 3m + 3m + 1. Let g = 11 - 6. Give gy(w) + 3r(w). 2w - 2 Let k(s) = 7s + 4. Let j(m) = -15m - 9. Let t(r) = 2j(r) + 5k(r). Let y(g) = 6g + 3. Give 4t(b) - 3y(b). 2b - 1 Let c(j) = 109j + 3 - 6 - 3j*2 - 4 - 102j. Let m(t) = -3t2 + 6t - 6. Calculate 6c(b) - 7m(b). 3b2 Let g(o) = -11o + 5. Let f(k) = k + 1. What is 5f(n) - g(n)? 16n Let n(d) = -15 - 6 - 8d - 14 + 42. Let g(l) = 4l - 3. Determine 7g(w) + 3n(w). 4w Let f(x) = 3x + 6. Let i(t) = 3t + 12. Let s(y) = -16y - 61. Let m(r) = 11i(r) + 2s(r). Let u be m(-7). Let l(o) = -2o - 5. Determine uf(n) + 4l(n). n - 2 Let p(c) = -3c - 4. Let g be p(-5). Let o = 8 - g. Let t(n) = -2n + 2. Let h(w) = -5w + 5. Calculate oh(d) + 8t(d). -d + 1 Let m(c) = -c + 8. Let p(x) be the third derivative of -x*3/6 + 9x*2. Calculate m(y) + 6p(y). -y + 2 Let y(l) = -9l2 - 5l + 3. Let g(f) be the third derivative of -f5/15 - f4/12 + f*3/6 + 48f*2. What is -7g(v) + 3y(v)? v2 - v + 2 Let u be (5/(-3))/((-1)/3). Let w(f) = 4f*2 + 5f - 5. Let y = -58 - -59. Let k(x) = -x*2 - x + 1. What is uk(i) + yw(i)? -i2 Let v(l) = -5l + 1. Let f(m) = -13m - 22m + 34m. Suppose 0p - 1 = 3r - 2p, 3p + 8 = -5r. Calculate rv(s) + 6f(s). -s - 1 Suppose -3o - 5 = -8o. Let j(h) = -6h3 + 5h2 - 5. Let i(n) = n + 11. Let l be i(-7). Let t(q) = q3 - q*2 + 1. Calculate lt(g) + oj(g). -2g3 + g2 - 1 Let c(p) = 2p - 83. Let j(y) = 4y - 167. Determine 9c(n) - 4j(n). 2n - 79 Let y(x) = 19x*3 + 13x*2 - 11x + 2. Let d(w) = -9w3 - 6w*2 + 5w - 1. Determine -13d(q) - 6y(q). 3q3 + q + 1 Let i(x) = -29x*3 + 14x - 2. Let y(n) = -10n3 + 5n - 1. Give -3i(m) + 8y(m). 7m3 - 2m - 2 Let y(s) = -2s3 - s2 + 4s. Let o(w) = w3 + w2 - 3w. Determine -4o(r) - 3y(r). 2r3 - r2 Let q(t) = -85t3 + 3t*2 - 3. Let b(x) = 170x*3 - 5x*2 + 5. Calculate 3b(n) + 5q(n). 85n*3 Let o(i) = 10i*2 - 6i - 11. Let l(x) = 2x2 - x - 2. Calculate -11l(r) + 2o(r). -2r*2 - r Let o(s) = 4s3 - s2 + 3s. Let q(p) = p3 + p. Give -o(u) + 5q(u). u3 + u2 + 2u Let w(k) = -k2 + k. Suppose -5f + 2o = 3o, -o = 2f - 3. Let x(v) = v2 - 1. Let l = -8 - -12. Suppose -7c + 11c = l. Determine cw(h) + fx(h). -2h*2 + h + 1 Let n(f) = -9f*2 + 65 - 65 - 5f + f. Let s(m) = -5m2 - 2m. What is 6n(v) - 11s(v)? v*2 - 2v Let s(l) = -5l2 - 7l - 8. Let q be (1 + -3)39/(-6). Let n(c) = 11c*2 + 15c + 17. Determine qs(v) + 6n(v). v*2 - v - 2 Let o(w) = -4w - 3. Suppose -12t - 12 = -8t. Let p(f) = -5f - 4. Determine tp(q) + 4o(q). -q Let k(m) = -43m*2 - 17. Let z(d) = -7d*2 - 3. Determine -6k(t) + 34z(t). 20t*2 Let d(r) = -5r - 7. Let t(n) = -n*3 + 4n*2 + 2n - 2. Let z be t(3). Let p(v) = -11v - 15. Give zd(f) - 6p(f). f - 1 Let i(t) = -t3 + t2 - 5t + 5. Let p(x) = -x*3 - x + 1. What is i(v) - 5p(v)? 4v3 + v2 Let j(x) be the third derivative of x4/12 - 46x*2. Let r(a) = 1. Give j(w) - r(w). 2w - 1 Let k(s) = s + 3. Suppose 4u + v - 5 = -22, 8 = -3u + 4v. Let l(i) be the second derivative of -i3/6 - i2 + i. What is uk(w) - 5l(w)? w - 2 Let z(f) = -2f3 - f2 - f + 3. Let p(v) = 2v3 + v2 + v - 4. Give -3p(d) - 4z(d). 2d3 + d2 + d Let c(w) = -5w. Let u(v) = -v + 6 - 3 - 3. Determine c(p) - 6u(p). p Let h(n) = -10n - 4. Let v(y) = 1. Give -h(k) - 4v(k). 10k Let c(w) = 5w*2 + 47w + 9. Let b(q) = 2q2 + 23q + 4. Determine -7b(a) + 3c(a). a*2 - 20a - 1 Let w(v) = -65v + 2. Let n(i) = 32i - 1. Determine -5n(o) - 2w(o). -30o + 1 Let f(a) = -3a*3 - 7a*2 - 6a + 6. Let g(x) = 3x3 + 6x*2 + 5x - 5. Give -5f(k) - 6g(k). -3k3 - k2 Let v(t) = -8t*2 + 7t. Let w(f) = -17f2 + 15f. Let b = -4 - -10. Suppose -4l = -bl + 12. What is lw(o) - 13v(o)? 2o2 - o Let m(k) = 5k*3 - 6k*2 - 7k. Let i(z) = 3z - 6. Let f = -6 - -11. Let x = 9 - f. Let v be i(x). Let c(a) = -a3 + a2 + a. What is vc(l) + m(l)? -l*3 - l Let y(u) be the second derivative of -7u5/20 + u4/2 - 3u2 + 7u. Let h(k) = -6k3 + 5k*2 - 5. Calculate -6h(f) + 5y(f). f3 Let d(f) = -2f. Let t(b) be the third derivative of b*4/24 + 2b*2. Give -3d(n) - 5t(n). n Suppose -2s + 10 = -0s, 5s - 21 = 2p. Let q(o) = -48o. Suppose -3v - 11h + 14h = 93, 97 = -3v + h. Let l(y) = -3y. What is pq(x) + vl(x)? 3x Let l be (0/2)/(6/6). Let v(i) = li - 3i*2 + 9 - 5i + 0i2. Let f(t) = 2t*2 + 3t - 5. Calculate 5f(g) + 3v(g). g*2 + 2 Let l(y) = -1. Let a be 7/4 + 2/8. Let c(i) = -5i + 2i + 0i - 2 + ai. What is -2c(z) + 5l(z)? 2z - 1 Let d(r) be the third derivative of 3r5/20 + r4/8 + 5r*3/6 - 5r*2. Let a(q) = -5q*2 - 2q - 3. What is 7a(g) + 4d(g)? g*2 - 2g - 1 Let d(j) = 8j. Let r(w) = w. Let b(k) = 6k + 4. Let p be b(-3). Give pr(q) + 2d(q). 2q Let k(q) be the first derivative of 0q + 7/2q2 + 4 - 7/3q*3 - 1/4q4. Let m(p) = -p3 - 5p2 + 5p. Calculate 5k(r) - 7m(r). 2r3 Let o(s) = s + 3 - s + s - 4. Let y(z) = -z. What is -3o(w) - y(w)? -2w + 3 Let h(z) = 8z + 19. Let p(s) = -s - 1. Calculate h(r) + 6p(r). 2r + 13 Let o be (4 + -2)/((-2)/6). Let v(t) = 2t2 + 6t - 6. Let r(z) = z*2 - 11z + 20. Let l(c) = 3c - 5. Let b(i) = 9l(i) + 2r(i). Give ob(a) + 5v(a). -2a*2 Let u(g) = -13g*2 + 5g. Let x be ((-20)/25)/(1/5). Let q(i) = -3i2 + i. Give xu(f) + 18q(f). -2f*2 - 2f Let n(j) be the first derivative of -j5/120 + j3 - 5. Let i(c) be the third derivative of n(c). Let p(w) = -2w2 + 8w + 1. Determine 6i(l) + p(l). -2l*2 + 2l + 1 Let k be (-8)/(-3)(39 - -6). Let p(l) = -120 + k + 3l. Let r(m) = -m*2 - 13m. Determine 9p(c) + 2r(c). -2c2 + c Let j(z) = -3z*2 - 13z + 5. Let b(s) = 2s2 + 12s - 5. Let i(o) = 6b(o) + 5j(o). Let l(m) = m*2 - m + 1. Give i(d) + 6l(d). 3d2 + d + 1 Let v(m) = -6m. Let r(p) = -3p + 1. Let j(t) = -16t + 5. Let x(a) = -2j(a) + 11r(a). Calculate -v(u) + 2x(u). 4u + 2 Let f(w) = -w*2. Let p(r) = 6r*3 - 2r2 + r. Let x be p(1). Let o(t) be the third derivative of t5/20 + t4/24 - t3/3 + t*2. Give xf(s) + o(s). -2s2 + s - 2 Let g(z) be the first derivative of z4/4 + z3 - z2 + 2z + 5. Let b(u) = -u*2 + u - 1. Give -2b(k) - g(k). -k3 - k2 Let x(h) = h + 7. Suppose 4i = -4p + 40, 4p - i = 3p + 2. Let t(y) = -y - 6. Suppose -5v + 11 = -24. Determine px(m) + vt(m). -m Let z(i) = -i2 + i + 1. Let l(m) be the second derivative of -m4/12 + 2m3/3 + m2 + 36m. Calculate -l(a) + 3z(a). -2a2 - a + 1 Let h(t) = t2 + 2t + 2. Let f(v) be the first derivative of 2v3/3 + 3v*2/2 + 2v + 2. Suppose 10 = 6a - a. Determine af(r) - 3h(r). r2 - 2 Let s(j) = j + 13 + 4j - 2j. Let n(x) be the first derivative of 4 - 4x - 1/2x2. What is -7n(b) - 2s(b)? b + 2 Let b(p) = -4p - 23. Let x(r) = -2r - 11. Give 4b(u) - 9x(u). 2u + 7 Let f(n) = 11n - 11. Let r = -44 - -51. Let z(y) = -5y + 5. Calculate rz(h) + 3f(h). -2h + 2 Let y(t) = -7t + 1. Suppose -2 - 4 = -r. Let s(k) = -7k - 6. Let m(g) = 13g + 11. Let h(a) = 6m(a) + 11s(a). Determine rh(j) + y(j). -j + 1 Let i(y) = -9y*2 + y + 5. Let n(c) = -10c*2 + c + 6. What is -4i(j) + 3n(j)? 6j*2 - j - 2 Suppose -3r + 19 = -4k, 2r - r = 5k + 21. Let j(h) = h + 4. Let c(x) = -x - 5. Let a(v) = 4c(v) + 5j(v). Let o(f) = -6f - 1. Determine ro(s) + 4a(s). -2s - 1 Let b(x) = x2 + 10x + 8. Let o be b(-9). Let k(i) = i - 2. Let f(l) = -l*3 - l. Let p(c) = 2c + 3. Let v be p(-2). Determine of(g) + vk(g). g3 + 2 Let v(k) = k3 - 3k2 - 31k + 1. Let p(j) = -2j3 + 4j*2 + 32j - 2. What is 3p(d) + 4v(d)? -2d3 - 28d - 2 Let m(t) = 2t - 5. Let o(r) = -r + 1. Calculate 2m(b) + 6o(b). -2b - 4 Let t(h) = -h + 1. Let b(c) = -1. Let r(w) = 3w + 2. Let m(v) = -4b(v) - r(v). Give -m(f) + 2t(f). f Let q(u) = 4u - 7. Suppose 14p = 12p - 12. Let o(a) = -a + 1. Let d = -4 + 3. Give d*	{ "pile_set_name": "DM Mathematics" }
) = -4d2 - 6d - d*3 + 4d*2 + 7do - d2. Give f(4). 8 Suppose 4s - f = 3s - 7, -s = -2f + 10. Let t(b) = 2b*2 + 2b + 4. Let u(o) = -3o2 - o - 5. Let r(w) = st(w) - 3u(w). What is r(4)? -5 Let a(u) = -u3 - 4u*2 - 2u. Suppose 4y + 3s - 5 = 1, 0 = 5y - 4s - 23. Let l be (-10/3)/(16 + -18). Suppose l = 3i - 4i - y. What is a(i)? -3 Let p(w) be the second derivative of -1/2w*3 + 0 + 0w*2 + 5w - 1/60w5 + 5/24w4. Let z(j) be the second derivative of p(j). Give z(-5). 15 Let u(i) be the second derivative of i4/12 + 5i3/6 - 25i. Calculate u(-5). 0 Let y be -2(3 - 28/8). Let v(o) = 3 + y + 2o + 0o2 - 1 + o3 - 4o2. Let j(p) = p2 + 3p - 1. Let m be j(-4). Give v(m). 0 Let p(v) = -7v*2 + 4v - 3. Let i(w) = -15w2 + 8w - 6. Let y(g) = -6i(g) + 13p(g). Suppose 0 = -8j + 7 + 25. Suppose 6 = -jl + 26. Calculate y(l). -8 Let u(j) = -120j2 + 119j*2 + 5 + 2j - 14 + 9j. Determine u(9). 9 Let p(l) = l2 + 10l - 4. Let w be (-35)/(35/7) - 2. What is p(w)? -13 Let x be 2/(-1) - 5-1. Suppose -p - 1 = -x. Let g(r) be the first derivative of r2/2 + 2r + 1016. Determine g(p). 4 Suppose -2i = 8 - 0, h - i - 8 = 0. Let a(f) = -4f - 4f + 6f + h - 5. Calculate a(3). -7 Let z(s) be the first derivative of s*3/3 + 5s2/2 + s + 11. Calculate z(-2). -5 Let c(h) = h3 + 4h2 + h + 2. Let v be c(-4). Let g(i) = 1 + 2 + 1 - 3 + i. Let f(l) = 3l + 4. Let y(m) = -2f(m) + 7g(m). Determine y(v). -3 Let n(g) = -3g - 12 - 6 + 34 - 9. Calculate n(6). -11 Let g be (-6)/(-40)(-195)/(-351). Let t(h) be the second derivative of 1/3h3 - gh*4 - 3/2h*2 + 4h + 0. Determine t(2). -3 Suppose -18z + 18 = -21z. Let d(l) = l*3 + 5l*2 - 6l - 1. What is d(z)? -1 Suppose 3 - 5 = -u + y, 0 = -u + 5y + 18. Let t(k) = -4k*2 - 4k - 2. Give t(u). -10 Let l(k) = k + 1. Let w(f) = -f*2 - 7f + 10. Let z be w(-7). Suppose -45 = zo - 15o. What is l(o)? 10 Let z(l) = -l*3 - 8l*2 + 9l - 8. Let t be z(-9). Let n(b) = 8b + 58. Let k be n(t). Let o(w) = w2 + 6w. Calculate o(k). 0 Let a(p) = -p*3 - 9p*2 + 8p - 20. Let c be 252/(-15) + 7 - 1/5. What is a(c)? 0 Let y(u) = u3 + u2 - 8. Let t(b) = -b + 21. Let z(v) = 2v - 3. Let h be z(12). Let j be t(h). Give y(j). -8 Let s(b) = -9b2 + b3 - 2b3 + 75b - 3b3 - 85b - 2 + 3b3. Calculate s(-8). 14 Let r(b) be the third derivative of 0b*3 + 0b - 1/120b5 - 1/72b*6 - 1/24b*4 + 0 + 3b*2. Let h(x) be the second derivative of r(x). Calculate h(-1). 9 Let c be -6 + 476/77 - (-26)/(-22). Let u(v) = -23v + 5. Let o(z) = 24z - 6. Let t(x) = 4o(x) + 5u(x). What is t(c)? 20 Let l(m) be the second derivative of m3/6 - 2m*2 - 10m. Let p(v) = 3v - 11. Let r(y) = 11l(y) - 4p(y). Determine r(-6). 6 Let k(c) = -c3 + 26c*2 + 10c - 266. Let u be k(26). Let i(h) = -10h - 57. Give i(u). 3 Suppose 22q + 8 = -3i + 20q, 3i = -3q - 9. Let y(l) = -9l + 3. Calculate y(i). 21 Let j(k) = -2k*2 - 2k + 6. Let t(y) = -2y2 + 30y + 104. Let w be t(18). Give j(w). -18 Suppose 0 = -t - 4t + 15. Let y(q) = 0q*2 - tq3 - q2 - q*2 + 1. Let d be (-12)/(-36)(-2 + 5). Give y(d). -4 Let k = -299 - -304. Let m(s) = -3s2 + 4s*2 - 5 + 1 - 5s. Let w be m(k). Let o(c) = c*3 + 5c*2 + c - 5. Calculate o(w). 7 Let t(f) = -36 - 2f + 23 - 2f3 - 10f2 + f3. Give t(-10). 7 Let w(n) = 8n2 + 5. Suppose -19 = -5o - 9. Let r(p) = -1. Let a(q) = 1. Let g(f) = oa(f) + r(f). Let t(u) = 6g(u) - w(u). Determine t(-1). -7 Let x(y) = -171y - 10 - 173y + 523y - 178y. What is x(4)? -6 Let j(v) = 4 + 6v + 0v*3 + 2v*2 + 5v2 + v3. Let b(s) = -4s + 16 - s3 - s + 7s - 11s2. Let z be b(-11). Calculate j(z). 4 Let h(n) be the first derivative of -n7/840 + n6/60 + n5/15 - n4/4 + 28n3/3 - 37. Let p(d) be the third derivative of h(d). Determine p(7). 1 Let r(w) be the third derivative of w4/6 - 3w3/2 + 85w*2. Give r(3). 3 Let m(q) = -17q*2 - 4q + 12. Let r(s) = 38s2 + 7s - 26. Let h(o) = 9m(o) + 4r(o). Give h(-8). 4 Let y = -88 + 97. Suppose -yl - 31 - 50 = 0. Let p(q) = q3 + 9q*2 - 6. Determine p(l). -6 Let n(h) = 23h*2 - 8h*2 - 16h*2 + 3h - 21h - 15. Calculate n(-17). 2 Let j(h) = -5h - 3 - 8 + 29 - 4 - 10 + h*2. Give j(5). 4 Let z(j) = -6j - 4 - 3j + 5j. What is z(-3)? 8 Let u = 17691 + -17692. Let y(s) be the second derivative of s5/10 - s3/6 + s. Give y(u). -1 Let f(c) be the third derivative of 1/60c5 + 0c + 1/6c3 + c2 - 1/12c*4 + 0. Suppose 0 = -l + 2 - 1. Calculate f(l). 0 Let k(w) = 2w*3 - w. Let f(r) = -2r*2 + 2r + 8. Let z be f(-2). Let g(x) = -9x3 - 5x*2 + 5x. Let b(y) = zk(y) - g(y). Calculate b(-5). 5 Let v(j) be the first derivative of j - 15. Let g(b) = 10b - 4. Let q(l) = -l + 1. Let p(h) = g(h) - q(h). Let n(r) = p(r) + 6v(r). Give n(-1). -10 Let m(b) = 1. Let s(k) = -k + 4. Let f(c) = -4m(c) + 2s(c). Let q be f(0). Let t(n) be the second derivative of -n3/2 + 2n*2 - 5n. What is t(q)? -8 Suppose -2 + 6 = 2m. Let x(z) = z - 1. Let u(k) = 12k - 9. Let p(t) = mu(t) - 22x(t). Calculate p(-3). -2 Let c(s) be the second derivative of -s7/840 + s6/120 - s5/120 - s4/12 + 2s3/3 + 9s. Let u(h) be the second derivative of c(h). Calculate u(2). 0 Let c(q) = q - 7. Let a(x) = -x*2 + 5x. Let f be a(6). Let v be (-11)/f + (-4)/(-24). Suppose 7k - vk = 25. What is c(k)? -2 Let x(n) = -2n2 + n - 1. Let w be ((-2)/6)/(156/(-36) - -4). What is x(w)? -2 Let m(o) = o3 - 16o*2 + 15o + 3. Let g be m(15). Let w(s) = -5 + 0 - 1 - gs. Calculate w(-4). 6 Let j(d) = -5d*2 - 13d + 15. Let x(h) = -2h2 - 6h + 7. Let y(i) = 3j(i) - 7x(i). Calculate y(5). -14 Let f(m) = 7m + 0 - 4m + 4 + 1 - m*2. Calculate f(4). 1 Let d(r) = 23r - 1 - 16r - 2 - 9r. Give d(-3). 3 Let o(i) be the second derivative of 1/2i2 - 1/2i*3 - 3i - 2. Calculate o(1). -2 Suppose 4r = 5v - 135, r + 6v + 38 = 3v. Let o = r - -41. Let q(c) = c - 2. Calculate q(o). 4 Let a be -2 + 1 - 1/1. Let n(j) be the first derivative of 1/4j4 + j + j3 - 2 + 0j2. Determine n(a). 5 Let n(d) be the second derivative of -d4/6 + 5d3/6 + 3d*2/2 - 426d. What is n(5)? -22 Let p(o) = o - 3. Let m be p(5). Let s(g) be the first derivative of 2g3/3 - g2/2 - 47. Calculate s(m). 6 Let b(p) = -p3 - 16p*2 - 16p - 9. Let k(g) = -g*3 - 9g*2 - 5g + 9. Let x be k(-8). What is b(x)? 6 Let l(i) = -13i - 405. Let o be l(-31). Let k(d) = -2d3 - d2 + 5d + 5. Calculate k(o). 7 Let x(d) = d + 3. Let f(n) = 5n - 8. Let a be f(5). Let g = a - 11. Determine x(g). 9 Let j = 22 - 16. Let a(q) = -8q - 86. Let y be a(-12). Suppose 4h - j = y. Let d(o) = o*2 - 4o - 5. Determine d(h). -5 Let c be (-300)/(-125)(-10)/(-4). Let t(g) = -7 - 3g*2 - g - 2g*2 - 4g + g*3. Calculate t(c). -1 Let s(d) be the second derivative of -7d3/3 + d2/2 + 3d - 2. Calculate s(1). -13 Let y(z) be the first derivative of -z3/3 - 3z*2 + z + 171. Calculate y(-4). 9 Let s(p) be the second derivative of 0 + 1/6p*3 + 0p*2 + 4p. Determine s(-7). -7 Suppose 2v + 0v = 4. Let o be 5 + (0 - 2)/v. Let x(s) = -39s + s3 - 1311s*2 + 1306s*2 + 41s + 5. Determine x(o). -3 Suppose -2g - 2 = -12. Let j(t) = t2 - 4t - 1. Give j(g). 4 Let p(d) be the third derivative of -d*6/120 - 7d*5/60 + 3d*4/8 + 11d*3/6 - 21d*2. Suppose -69 = -4k - 101. Calculate p(k). 3 Let a(i) = -3i2 - 7i - 12. Let y(v) = 11v2 + 22v + 37. Let n(f) = -7a(f) - 2y(f). Let u(c) = -c*2 - 6c + 7. Let o be u(-6). Determine n(o). -4 Let k(g) = 5g - 3. Let z(y) = 14y - 8. Let a(s) = 8k(s) - 3z(s). Let f = 77 - 75. What is a(f)? -4 Let c(h) = -h*2 + 5h + 6. Let a = -3 + 21. Let b be 122/a + 9/((-567)/(-14)). Determine c(b). -8 Let r(l) be the second derivative of l5/20 + l4/4 - l*3/6 - 2l*2 - 118l + 2. What is r(-3)? -1 Let f = 2 + 8. Let p(m) = -fm2 - 9m + 4 - 9 + 2m2 + 0m2 - m3. Determine p(-7). 9 Let j(c) = -3c - 5c + 0 + 2 + 5c. Give j(5). -13 Let j(u) = -u2 - 18u - 25. Let w(v) = -3v - 110. Let n be w(-31). Determine j(n). -8 Let v(f) = 2f - 19. Let t(n) = n*2 + 27n + 8. Let b be t(-27). Calculate v(b). -3	{ "pile_set_name": "DM Mathematics" }
) - 2h2 + 7h*5 + 2h*2 + 2h*2 - 2h*5 - 2h*2. 15h*5 Expand (-u + 4 - 4)(-3 + 0 + 1) - 11u + 0 + 13u - 2 + (-4 + 1 + 1)(-2u - 2 + 2). 8u - 2 Expand -2g5 + g3 - g*3 + 2g3 + g5 - 2g3 + (-2g + 7g - 3g)(-1 + 1 - 2g*4) + (288g*2 - 288g2 + g4)(-1 + 1 - g). -6g*5 Expand (3 - 1 + 3)(2 + 1 - 4)(-5z + 3z - 2 - z). 15z + 10 Expand -3q + 3q - 5q + 0q + q + 0q + (-3q + 2q + 0q)(-2 + 1 + 3) + 2q + 2q - 5q. -7q Expand -o + o3 + o + (2 - o2 - 2)(0 + 0 + 2o) + (-o - 4 + 4)(o - o - o*2) - 1 + 1 + 2o*3. 2o*3 Expand (3c + 3c - 4c)(-c2 - 2c + 2c - c). -2c*3 - 2c*2 Expand (66 - 131 + 68 - 23i)(-1 + 0 + 0). 23i - 3 Expand (-1 + 2 + 1)(m3 + m4 + m3 + 1 - m3). 2m*4 + 2m*3 + 2 Expand (-y + 0y + 3y)(-2 + 2 + 1) - 2 + 2 + 2y + 0y + 3y - 2y. 5y Expand (1 - z3 + 16z + 1 - 13z)(0 + 0 + 1)(-3 + 2 + 2). -z3 + 3z + 2 Expand (4c - 10 + 9 + 0c)(2 - 2c - 2). -8c2 + 2c Expand (12 + 8 + 7)(-4 + 3 + 2g - 3g). -27g - 27 Expand (5 - 2 - 2)(9 - 11 + 15)(-1 + 1 + 2o). 26o Expand (3c3 - 2c*3 - 3c*3)(6 - 2 - 2) + (0 + 2 + 0)(2c3 + 5 - 5) - c3 + 2c3 - 4c*3 + 2c3 - 5 + 5. -c3 Expand (-u*2 + u - u)(15u - 6 + 6). -15u*3 Expand (-1 - 1 + 4)(b5 - b5 + b*5) + (5b - 4b + 4b)(b4 - 2b4 - b4). -8b5 Expand -4s*2 + 2s*2 + 4s*2 + 2s*2 - 2s*2 + 2s*2 + (s - 6s + 4s)(-1 + 1 - 2s) + (0s2 + s2 - 2s2)(0 + 1 - 2). 7s2 Expand (v2 + 0v + v + 3v)(0v2 + v2 + 0v2). v4 + 4v3 Expand (14 - 14 + 9a)(-3a + 2a + 3a) - 2a2 - 3a*2 + 7a*2 - 2a*2 + 2a*2 + 2a*2. 22a*2 Expand (-5b + 2 + 13b + 12b)(-1 + 0 - 1). -40b - 4 Expand (-3c + 15c - 4c)(2c4 - 2c*4 - 2c*4) + 0c*2 + 0c2 - c5. -17c5 Expand (-3g*2 + 4g*2 + 2g*2)(5g - g - 2g)(-41 - 10 + 15)(-1 - 3 + 2). 432g3 Expand (11 - l4 - 5l*4 + 2l*4)(0 - 4 + 3). 4l4 - 11 Expand (2j + 9 - 9)(0 + 4 - 1 - 4 + 2 + 0 + 1 - 2 + 0 + (0 + 4 - 2)(1 + 1 - 4) + 3 + 0 - 1). -4j Expand (-10 + 5 - 8)(-d*4 + 0d*4 - 5d*4). 78d*4 Expand -4f + 4f - 3f*3 + (-f - 3f + 0f)(3f2 + f2 - 6f*2) + 5f*3 - 4f*3 - 2f*3. 4f*3 Expand (-4b2 + b2 + b*2)(28 - 28 - 16b3 + (0b - 2b2 + 0b)(-b + 0b + 0b)). 28b*5 Expand (-60h - 14h + 9h)(3h - 3h - 2h). 130h2 Expand (0y*3 + 0y3 - y4)(2 - 3 + 4 - 2y)(7 - 2 - 2). 6y*5 - 9y*4 Expand (0l*2 - 4l*2 + 3l*2)(-30 + 4 - 12)(0l + 3l - 2l). 38l3 Expand (-2j*3 + 5j*3 - 2j*3)(-10j - 4j*2 + 10j) + 4j5 + 4j*5 - 5j*5 + (4j*3 + 0j*3 - 6j*3)(j*2 + 1 - 1) - 2j*5 + 2j - 2j. -5j*5 Expand (3 - 3 + 1)(0 - 4 - 3)(l - 3l + 4l). -14l Expand (-3 + 3 - 2s)(0s + 0s + 2s2) + (0s + 0s - 2s)(s2 - 4s*2 + 2s*2). -2s*3 Expand -5f + 2f + 4f - f + f + 2f - 3f - f + 2f + (5f - 6f + 2f)(1 - 4 + 5) - 4f + f + 5f - f + f - f - 6f + 3f + 2f - 26f + 65f - 26f. 16f Expand (0b - 13b - 2b)(-3b - 4b + 5b). 30b*2 Expand (3v*2 + 4v*2 - 5v*2)(-1 + 1 + 5)(2v*2 - 3v + 3v). 20v4 Expand (r2 - 2r2 + 2r*2)(-4r + r + 2r) + 2r2 + 6r*3 - 2r*3 + 5r - r*3. 2r*3 + 2r*2 + 5r Expand (0w - 2w - 2w)(0w - 7w + 3w) - w2 - 2 + 2. 15w*2 Expand -j + 1 - 1 + (-10 + 4 - 5)(2j + 0 + 0). -23j Expand (-2y - 2y + y)(6 - 2 - 2). -6y Expand (4 - 1 - 1 + (-2 - 1 + 4)(-2 + 2 - 1) - 5 + 1 + 0)(0q4 + 2q*4 - 3q*4). 3q*4 Expand (3 - 2 + 1)(0j2 - 7j*2 - 2j*2) + (6j - 2j - 3j)(3j + 0j - 4j). -19j2 Expand (43h - 38h + 26h)(0 + 0 + 1). 31h Expand (-m - m + m)(30m*3 - 3m*3 - 2m*3)(-3m - 3m + 4m). 50m*5 Expand (6 - 6 + 4z*3)(-1 + 2z + 1). 8z*4 Expand (-x + 2 + 0 + 0x)(10x + 2 - 2). -10x2 + 20x Expand -11t + 3t*2 + 10t + 0t2 + 2 - t2 - 2 + (2t - 1 + 1)(5 - 2t - 5) + 5t2 - 3t2 - t2. -t*2 - t Expand (-9p - 3p + 3p)(2p - p - 2p)(-2p3 + 2p*3 - 2p*3). -18p*5 Expand (-2h + h*3 + 2h)(-3h + 0h + h)(3h - 6h + h). 4h5 Expand (-m + 0m + 2m)(0 - 1 + 2)(-47 + 26 - 52). -73m Expand -5s + 5s + 2s2 + (0 + 2 - 5)(15s2 - 18s*2 - 18s*2). 65s*2 Expand (q - 2q*2 - q)(q - q + 2q2) + (-4q + q - 2q)(-2q3 - 2q + 2q). 6q*4 Expand (-4r*4 + 0r*4 + 3r*4)(-983 + 983 + 11r + 6r). -17r5 Expand (2b*2 - 4b*2 - 3b*2)(-6 + 6 + 8b). -40b*3 Expand (i + 6i - 3i)(-17i2 - i + 6i*2 + 3i). -44i3 + 8i*2 Expand (-8 - 536m*2 + 1070m*2 - 540m*2)(-m2 - m2 + m*2). 6m*4 + 8m2 Expand l4 + 2l4 + 0l*4 + (3l*3 - 7l3 - l3)(-l - 1 + l - 2l). 13l4 + 5l*3 Expand -3 + 3 + 2v - 3 + 3 - 3v + (1 - 3 + 3)(2v - 2v - 2v) - 6v + 6v - 3v. -6v Expand -z4 - 2z*4 + 0z*4 + (4 - 4 - 2z)(5z*3 - 4z3 + z3). -7z4 Expand -6a*3 + 2a*3 + 2 + 0a*3 + 8a*3 - 5a3 + a3 + (a*2 - 4a*2 + 4a*2)(a - 4a + 4a) + 1 - 1 + 2a3. 3a3 + 2 Expand g2 + g3 - g2 + (g2 - g2 + 2g2)(1 + 2g - 1) + g3 + g3 - 4g*3. 3g*3 Expand (4 + 1 - 3)(-2 + 3 - 4)(-4q + 3q + 3q). -12q Expand (1 - 1 - t)(-3 - 6 + 59). -50t Expand (0 + i + 0)(-4 + 4 + 1)(2 - 2 + i). i2 Expand (-5 + 5 - 3p*3)(-1 + p + 4 - 2). -3p4 - 3p*3 Expand (-2k - k + 2k + k - 2k + 0k + (2k + 0 + 0)(-3 + 2 + 2) + 3 - 3 - 2k - 5k + 5k + k)(-2k2 - k2 + 4k2) + 8k*3 + 2k*3 - 4k*3. 5k*3 Expand 0b - 3b + b + 3b - 5b + 3b + (-1 + 2 - 3)(b + 4 - 4) - 4b - 2b + 5b + 0b + 3b - 5b + 3b - b - b + 0b - 2b + 4b. -3b Expand (3l + 2l - 4l)(4l2 - 2l*2 + 3l*2) + 0l + 2l3 + l + 0l. 7l3 + l Expand (-1 + 0 - 1)((-3 + 0 + 1)(0 - 2 + 4) + 5 - 2 - 2 + 2 + 7 - 2)(4u - 3u + u). -16u Expand -3g*2 + 3g2 + g2 - 3 + g*2 + 3 + (-g + 1 - 1)(-2g - g + 2g) + 4 - 9 + 3 + 5g2. 8g*2 - 2 Expand (5 - 4 - 2)(18i - 23i + 14i) + 4i - 5i + 3i. -7i Expand (3p + 8p + 4p)(-2p + 2p + p3) + 4p*4 + 2p*4 - 2p*4. 19p*4 Expand (-4 + 1 + 2)(0m + 3m - 2m + 2). -m - 2 Expand (3g - 8g + 4g)(-3 + 4 + 3). -4g Expand (0 - 1 + 3)(1 - 1 + 5)(-2v + 4v - 3v). -10v Expand (-1 - 1 + 4)(0 + 0 + 2p) + 1 - p - 1 - p - p + 0p + (3 + 0 - 2)(5 + 3p - 5). 4p Expand (-3l3 + l3 + l3)(-2l2 + 1 - 1) - 16l + 3l4 + 16l + 3l5. 5l*5 + 3l*4 Expand (2d + d - d)(-3 + 3 + 2d) + (18 - 7d - 18)(-d + 4d - d). -10d*2 Expand -3w*4 - 15w*4 - 10w*4 - 2w*3 + 2w*3 + 2w*4 + (-2w*2 - 2w*2 + 3w*2)(-2w2 + w2 + 2w*2) + 0w*4 + 2w*4 + 0w*4. -25w*4 Expand (m + 0m + 0m)(-1 - 5 + 7). m Expand (3d2 - 2d2 + d2)(-d2 + 0d + 0d + (d + 2 - 2)(2d - 2 + 2) + 3d*2 + 4d2 - d2). 14d4 Expand 7v*2 - 4v2 - v2 - 3 + 3 + 2v2 + (-2v + v + 2v)(v - 2v + 2v) - 71v + 71v + 9v2 + (4v - 4v + v2)(7 - 2 - 3). 16v2 Expand (-2d - d + 0d)(2 - 3 - 3). 12d Expand ((-2h*2 + 4h*2 + 0h*2)(-2h + h + 0h) + (3h2 - h2 - 4h*2)(0 + 17h + 0))(-h*2 - h + h). 36h5 Expand (1 - 1 - d4)(7 - 8d - 7) + d3 - d3 - d*5 - 2d*5 - 3d*5 + 7d*5. 9d*5 Expand (-7k*4 + 9k*4 + 4k*4)(-2 + 1 + 2)(-k + 0k + 3k). 12k*5 Expand (2n + 0n - n)(2 + 0 - 3) + 0n - n - n - 2n - 1 + 1 + 2n + 1 + 4n + 6n. 7n + 1 Expand (1 + 2a - 1)(-1 - 2 + 4 + (-3 + 3 - 3)(-6 + 1 - 2)). 44a Expand (o*4 + 0o + 0o)(-3o + 3o + 6o - 1). 6o5 - o4 Expand (-u2 + u2 + u*2)(12u - 45 + 45). 12u*3 Expand 3a - 31 + 16 + 38 + (0 - 1 + 0)(3 - 3 + a). 2a + 23 Expand (-4v2 + 3v*2 + 3v*2 + (-1 - 2 + 4)(v*2 + 2 - 2) - 4v*2 + 4v*2 + 2v*2)(-v2 + v3 + v*2). 5v*5 Expand -2d*2 - 4d*2 + 0d*2 + (6d - 4d - d)(0 - d + 0) - 13d2 + 2 - 2. -20d*2 Expand (2g - 3 + 3)(0 - 4 + 2) + 2g - g + g + 47g - 25g - 6 - 23g. -3g - 6 Expand (10 - 2 - 2)(-5z + 2z + 5z)(2 - 2z*2 - 2). -24z*3 Expand 1 + 2g - 1 + 3g + 0g - 4g + 5 + 2g - 5 + (2 - 6 + 2)(-4g - 2g + 4g) + 4g - 2g + 0g - 2g + 4g - 3g + (1 - 1 - 1)(3g - 6g + g). 10g Expand (-4h + 2h + 3h)(4 - 3 + 0) + (16 - 6 - 7)(2h - 2 + 2). 7*h Expan	{ "pile_set_name": "DM Mathematics" }
-4k(s) + p(s). -2s*2 + s + 150 Let k(v) = 2v*3 - 2v*2 + 10v. Let p(r) be the third derivative of r6/30 - r5/12 + 5r4/6 - 445r*2. What is -5k(o) + 2p(o)? -2o*3 - 10o Suppose -x = 1, f - 11x = -15x - 2. Let v(r) = -r*3 - r + 1. Let s(l) = l - 1. Determine fv(a) + 2s(a). -2a*3 Let x(f) = f + 2. Let u be 200/(-700)-27/2. Let n(j) = 6j + 11. Determine un(g) - 11x(g). g Let a(s) be the third derivative of 18s2 - 5/6s*3 + 0s + 0s4 + 0 + 0s*5 + 1/30s*6. Let c(y) = 4y*3 - 4. What is 4a(k) - 5c(k)? -4k*3 Let l(d) = -d + 2. Let j(h) = -41h + 6. Calculate j(o) - 2l(o). -39o + 2 Let r(j) = -3j3 + 3j2 - 17. Let o(d) be the second derivative of -d5/20 + d*4/12 - 3d*2 + 51d. Calculate 11o(z) - 4r(z). z3 - z2 + 2 Let v(s) = 2s3 + 12s*2 + 13s - 2. Let r(d) = 2d3 + 10d*2 + 14d - 2. Determine 6r(q) - 5v(q). 2q3 + 19q - 2 Let t(h) = h + 3. Let p(r) = -1. Suppose -c - y = 7, 4c + 49 = 5y + 66. Calculate ct(w) - 5p(w). -2w - 1 Let z(t) = -t - 11. Let c(f) be the third derivative of -f3 + 0f - 1/24f4 + 0 + 16f*2. Determine 5c(h) - 3z(h). -2h + 3 Let q = -153 - -154. Let i(c) = c2 + 1. Let z(s) = s2 - 1. Let b(u) = -7u2 + 8. Let d(t) = -b(t) - 6z(t). What is qd(m) + 2i(m)? 3m2 Let m(b) = 8b*2 + 7b. Suppose -3i - 5t + 95 = 0, t - 4 = -3. Let p(n) = -n - 30 + i - n*2. Give 3m(s) + 21p(s). 3s*2 Suppose 0 = y - 12 - 16. Let m(u) = u + 28. Let z(g) = -1. Let n(p) = -8. Let h(k) = 6n(k) - 52z(k). Give yh(i) - 4m(i). -4i Let v(i) = i3 - i2 + 5i + 7. Let j(x) = -3x + x - 3 + 0. Suppose -22 = -4b + 2. Suppose 4o - b - 2 = 0. Give ov(k) + 5j(k). 2k3 - 2k2 - 1 Let w(l) be the second derivative of l3/3 - 5l2 + 44l. Let z(v) = -1. What is w(t) - 4z(t)? 2t - 6 Let h(i) = i*3 + 19i*2 - 41i + 27. Let d be h(-21). Let n = -27 + 26. Let q(o) = -o*2 + 6o - 5. Let y(l) = l - 1. Calculate dy(j) + nq(j). j*2 - 1 Let d(c) = -9c - 9. Let q(i) = -i*3 + 19i*2 + 7i - 136. Let n be q(19). Let s(x) = -5x - 5. Determine nd(b) + 5s(b). 2b + 2 Let w(x) = x - 32. Let v(l) = l - 33. Calculate -5v(n) + 6w(n). n - 27 Let x(p) = 5p3 + 27p - 6. Let q(i) = -i*3 + 1. What is 6q(s) + x(s)? -s*3 + 27s Let d(g) = -77g + 14. Let q(x) = 153x - 32. Determine -7d(u) - 3q(u). 80u - 2 Let k = 30 + -27. Let s(q) = 2 - 7q*3 - 2q - q*3 + 4q*3 + 6q*k. Let x(c) = c - 1. Calculate s(p) + 2x(p). 2p3 Let o(n) = -2n + 2. Let p(z) = 2. Let h(b) = -2b - 34. Let u(l) = 2h(l) + 36p(l). Suppose 18i - 665 = -77i. Give io(c) - 3u(c). -2c + 2 Let k(h) = 11h + 7. Let b(j) = -5j - 3. Let p(g) = -13g + 53. Let o be p(3). What is ob(a) + 6k(a)? -4a Let v(r) = -9r2 + 12r - 15. Let m(x) = x*2 - 2x - 1. Give 6m(i) + v(i). -3i*2 - 21 Let l(d) = 21d2 + 13. Let n = 403 - 409. Let f(w) = w2 + w + 1. Let v(j) = -j*2 + 4j + 1. Let k(m) = 4f(m) - v(m). What is nl(q) + 26k(q)? 4q*2 Let q(w) = -226w*2 + w. Let f(x) = 2253x*2 - 9x. Determine 2f(g) + 21q(g). -240g2 + 3g Let p(o) = 11o - 2. Let g(l) = -3l + 43. Let t be g(14). Let s(d) = 0 - 662d + 667d - t. Calculate -4p(b) + 9s(b). b - 1 Let k(c) = c*3 + 2c2 + 1. Let l(i) = -i3 - 3i2. Give 4k(o) + 3l(o). o3 - o2 + 4 Let v(o) be the second derivative of -5o*4/6 - 8o*3/3 - 7o*2/2 - o. Let h be (-18)/(-3) + 9 + -17. Let y(g) = 3g*2 + 5g + 2. Determine hv(r) - 7y(r). -r*2 - 3r Let a(g) = 3g - g - g - 2g. Let b be -13 + -3 + 1 + 3. Let r = -6 - b. Let t(x) = -5x + 1. Give ra(q) - t(q). -q - 1 Let a(q) = q*3 + q - 1. Let z(r) = -12r*3 + 17r*2 + 2r - 2. Determine 2a(v) - z(v). 14v*3 - 17v2 Let t = 3 + -5. Let i(p) = -p2 + 2p - 2. Let q(s) be the first derivative of -2s*3/3 + 5s*2/2 - 5s + 54. Give tq(f) + 5i(f). -f*2 Let m(p) = -3p - 4p - p - 1 + 2. Let x(f) = 8f - 1. Give -5m(u) - 4x(u). 8u - 1 Let h(c) = c2 + 65c + 7. Let r(m) = -m*2 - 33m - 4. Give -4h(w) - 7r(w). 3w2 - 29w Let g(b) = 5b2 + 340b + 4. Let d(k) = 14k2 + 1024k + 11. Determine 4d(m) - 11g(m). m*2 + 356m Let o(a) = 9a2 + 2a + 10. Let c(y) = -y*2 - 1. What is 22c(m) + 2o(m)? -4m*2 + 4m - 2 Let v be -4(7/28 - (-6)/24). Let y(c) = -c2 + 5c. Let t(q) = -4q - 6. Let h(f) = f + 1. Let l(n) = 6h(n) + t(n). Determine vy(k) + 5l(k). 2k2 Let m(y) = -y2 + y - 1. Let o(w) = 13w*3 + 11w*2 + 5w + 11. Let l(v) = 2m(v) + o(v). Let x(r) = -7r*3 - 4r*2 - 3r - 4. Determine -4l(f) - 9x(f). 11f3 - f Let z(i) = 73i*2 - 3i + 11. Let x(h) = -25h2 + h - 4. Determine 17x(d) + 6z(d). 13d*2 - d - 2 Let k(q) = -4 + 25q*2 + 28q*2 - 6q*3 - 49q*2. Let c(l) be the first derivative of 3l4/2 - l3 + 3l + 1. Give -4c(x) - 3k(x). -6x*3 Let y(z) = -2z3 + z2 + z - 2. Let t(w) = -26w3 - 4w*2 - w + 8. Give -t(r) - 4y(r). 34r3 - 3r Let y(a) = -369a2 + 3a - 3. Let k(l) = l - 1. Calculate -3k(i) + y(i). -369i*2 Let m(r) = -2r*3 - 3r*2 - 1. Let k = 3 - -1. Let u(x) = 1 - 2x*3 + 2x*3 + 2x*2 + 2x*3. Let d = 2497 + -2494. Determine dm(y) + ku(y). 2y3 - y2 + 1 Let x(j) = 4j2 + 10j - 3. Suppose -30 + 2 = -4y. Suppose -19 + 7 = -3g. Let f(s) = -gs + s2 - s + 2s - 2s2 + 1. Calculate yf(c) + 2x(c). c2 - c + 1 Let d(h) = 8h*2 - 2h + 48. Let i(y) = -y*2 - 6. Give d(u) + 12i(u). -4u2 - 2u - 24 Let z(o) = -o*2 - 1. Suppose -26 + 123 = 97q. Let g(u) = -9u2 - u + 5. Give qg(v) + 5z(v). -14v2 - v Let v(u) = u2 + 6u + 2. Let k(a) = 2a*2 + 11a + 4. Let d = -508 + 504. What is dk(j) + 7v(j)? -j*2 - 2j - 2 Let n(z) = 7z + 269. Let f(x) = 9x + 270. Give 4f(b) - 5n(b). b - 265 Let p(t) = -3t3 - 3t*2 + 8t. Let o(l) = 5l3 + 5l*2 - 12l. Calculate 5o(s) + 8p(s). s3 + s2 + 4s Let u(y) = y3 - 4y2 + y - 1. Let d(m) = m3 - 7m2 + m - 2. Calculate 3d(n) - 5u(n). -2n3 - n2 - 2n - 1 Let s(o) = 28o*3 + 43o - 8. Let c(f) = -10f3 - 14f + 3. What is -8c(k) - 3s(k)? -4k3 - 17k Let j(r) = -5r2 + 4r. Let z(g) = g - 2g + 0g2 + g2. Suppose 0 = 3w - 15, 0 = 2k + 5w - 6 - 3. Let c = -11 - k. Determine cz(x) - j(x). 2x2 - x Let r(k) = -37k*3 + 7k. Let d(m) = m. Calculate -5d(q) + r(q). -37q*3 + 2q Let n(i) = 1. Let y(p) = 16p + 16. Let t(d) = 2d + 4. Let w(s) = -3t(s) + y(s). Determine -2n(k) + w(k). 10k + 2 Let o(d) = d2. Let c(h) be the first derivative of -3h3 - h2 - 197. Determine c(b) + 4o(b). -5b*2 - 2b Let d(t) = -7t + 15. Suppose 2i + i = 18. Suppose 0 = 3x + 10 - 13. Let k(s) = -x - 1 + 2s - 2. Give id(n) + 22k(n). 2n + 2 Let m(c) = -5c + 5. Let h(w) = 1. Let v be 42/(-7) + -6 - -6. Give vh(k) + m(k). -5k - 1 Let u(k) = 5 + 1 - 2 - k3 + k2 - 2k - 3. Let g be u(1). Let o(c) = 4c + 7. Let x(m) = -m - 1. Give go(b) - 6x(b). 2b - 1 Let s(c) = -2c*3 + 3c*2 - 3c. Let x(w) = -w*2 - 2w + 7. Let r be x(-3). Let a(m) = -m*3 + 3m*2 - 3m. What is ra(q) - 3s(q)? 2q3 + 3q*2 - 3q Suppose 85 - 37 = 8p. Let k(s) = 9s*3 + 5s*2 - s - 5. Let r(d) = 9d*3 + 6d*2 - d - 6. Give pk(l) - 5r(l). 9l3 - l Let s(m) = -m + 1. Let u(t) be the second derivative of t3/6 - t*2/2 + 32t. Give -5s(f) - 6u(f). -f + 1 Let w(u) = 4u3 + 5u*2 - 13u + 124. Let f(g) = g3 + g2 - 2g + 1. What is -6f(s) + w(s)? -2s3 - s2 - s + 118 Let h(s) = -1776s*3 - 224s*2 - 112s + 336. Let q(m) = -48m3 - 6m*2 - 3m + 9. Determine -6h(i) + 224q(i). -96i3 Let l(m) = 6m + 7. Let y(w) = -5w - 6. Suppose o - 43 = -65. Let i = o + 17. Calculate iy(g) - 4l(g). g + 2 Let l(y) be the second derivative of y2/2 + 100y - 2. Let m(r) = -2r + 7. Calculate -5l(g) + m(g). -2g + 2 Let p(a) be the third derivative of 0 - 7/6a*3 + 0a - 27a2 + 5/12a*4. Let h(u) = -29u + 20. Calculate -6h(g) - 17p(g). 4g - 1 Let n(o) = 2o*2 - 3. Suppose -4m + 20 = -2m. Let y = -5 + m. Let t(l) = -7 + 4l*2 - 25l - 16l + 40l. Calculate yn(i) - 2t(i). 2i2 + 2i - 1 Let r(q) = 2q + 12 - 8 + 2q + 0. Let i(m) = 4m - 11 - 6m - 4m - 5m. Calculate -3i(l) - 8r(l). l + 1 Let r(c) = -7c3 - 11c*2 - 3c - 6. Let	{ "pile_set_name": "DM Mathematics" }
Find the third derivative of -74m5 + 878m*4 - 9m*3 - 10234m*2 - 4210m wrt m. -4440m2 + 21072m - 54 Find the third derivative of h*4 - 60351089h*3 + 169h*2 + 43201h wrt h. 24h - 362106534 What is the third derivative of 43512914v*3 - 71744347v*2? 261077484 What is the second derivative of -346062169u*5 - 1818u - 32522? -6921243380u3 Find the third derivative of 2877778f*5 - 46941f*2 + 284f wrt f. 172666680f2 What is the derivative of 81d*2m*2 - 1621d*2 - dj - 9jm*2 + 2jm - 27j + 2m - 43 wrt d? 162dm2 - 3242d - j Find the third derivative of -2604l5 + 994l*3 + 17286731l*2. -156240l*2 + 5964 What is the third derivative of 230449307x*3 - 167203352x*2 - 2x? 1382695842 What is the second derivative of 2kq*4 - 379042kq2 + 4kq - q - 276609 wrt q? 24kq2 - 758084k What is the second derivative of 43448716p2w*2 + 253121p*2 + 41pw wrt w? 86897432p*2 What is the second derivative of 347k*2rs3 - 3387k*2rs + 2krs*2 - 1619289ks3 - rs*3 wrt k? 694rs3 - 6774rs Find the second derivative of -448713321p*2q*3 + 2pq3 + 16328pq2 - 8pq + 2q*3 - 11 wrt p. -897426642q*3 What is the second derivative of -2151v*4 + 256v*2 + 2928947v wrt v? -25812v2 + 512 What is the third derivative of 5464620j3 - j2 - 165j - 2095? 32787720 Find the third derivative of -7649824g*4 - 2g*2 + 2185581g - 2. -183595776g Find the first derivative of -o3z + 3532791o3 - o2z - 14891oz + 39z wrt z. -o3 - o2 - 14891o + 39 Differentiate -389725138t - 37290694. -389725138 What is the first derivative of 36931d*3 - 2d*2 + 414d + 11604307? 110793d2 - 4d + 414 What is the third derivative of -19035d3z*2 + 2808d*3z - 6d2z*2 - 2d*2z + 4460dz*2 + 26dz - d - 80z*2 wrt d? -114210z*2 + 16848z Find the second derivative of -7228850a2l*3v - 776735al*3 - 4l*2v wrt a. -14457700l3v Find the first derivative of 48597021b - 19550490. 48597021 Find the second derivative of 3410587gw3 - 2gw2 + 3gw - 4g + 2w2 + 14764 wrt w. 20463522gw - 4g + 4 Find the second derivative of 22c2y*2 - 92866c*2y - 9225166cy*2 + cy + 655c - 2y wrt y. 44c2 - 18450332c Find the second derivative of 1035771080x2 - 553067772x wrt x. 2071542160 Find the second derivative of 4085187c3m + 5c2m - 4c2 + 7296c - 12230m wrt c. 24511122cm + 10m - 8 What is the third derivative of 59123561v5 + 290214776v*2? 3547413660v*2 Differentiate 6uy2 - 112114uy + 202853130u + 2y2 + 43y with respect to y. 12uy - 112114u + 4y + 43 Find the second derivative of -39853738c4 + 8c - 431947. -478244856c2 Differentiate -38368460d + 15329504 with respect to d. -38368460 Find the third derivative of -12921775fu*3 + fu*2 - 5fu + 2u*2 - 10u - 1547 wrt u. -77530650f What is the derivative of 319442503o*2 - 1030033024? 638885006o What is the third derivative of -z*4 + 224323z*3 + 476z*2 - 7404z wrt z? -24z + 1345938 Differentiate 120683652p*2 + 48687056 with respect to p. 241367304p What is the first derivative of 5b2d*2 - bd*2 - 518361bd - 20428605d*2 wrt b? 10bd2 - d2 - 518361d What is the third derivative of -3805331m3 - 12842169m*2 wrt m? -22831986 What is the derivative of -31f*3 - 75f*2 - 565f + 21573903 wrt f? -93f2 - 150f - 565 Find the first derivative of -17858l3 - l2 + 901l + 15545061. -53574l2 - 2l + 901 What is the first derivative of -6z4 - 376z*2 - 876z - 289133066? -24z3 - 752z - 876 Find the second derivative of 13980630j3 - 3619965j. 83883780j Find the second derivative of -8965r*3s*4 - 2r*3s + 468610r3 - r2 + 29s*4 wrt s. -107580r*3s*2 + 348s*2 Find the first derivative of -377670690z - 413622141 wrt z. -377670690 What is the third derivative of -2607628b6f + 2b3f*3 - 45757b*2f - 71bf*3 + f wrt b? -312915360b*3f + 12f3 What is the third derivative of 61324n*3w + 255n3 + 5037n*2w - nw + w + 1990 wrt n? 367944w + 1530 Find the second derivative of 44d3l*2 - 11608d*3 - 300dl + d - 6l*2 + 5l - 3 wrt d. 264dl*2 - 69648d What is the third derivative of -365388t4 - 8t3 - t2 + 584t + 137? -8769312t - 48 What is the third derivative of 58701716m3 - 598722m*2 + 152m? 352210296 Find the third derivative of -2t4 - 316741243t3 + t2 - 34461154t - 3 wrt t. -48t - 1900447458 What is the second derivative of 15444541j3 - 153867798j? 92667246j Find the third derivative of -769861r*5 - 18r*4 + 5r*3 - 29r*2 + 6296r - 69 wrt r. -46191660r2 - 432r + 30 What is the second derivative of 9277778i5 - 30i + 8431 wrt i? 185555560i3 Find the second derivative of 211723854h*3 + 77877h + 1489 wrt h. 1270343124h What is the second derivative of -1568158p*2t*2v - 3p2tv - 2p*2t + 15p2v*3 + 2pt3v*3 + 799tv3 - tv*2 + 2t wrt t? -3136316p2v + 12ptv3 What is the first derivative of 5045bo2 - 105bo + 647b + 7o2 + 286961 wrt o? 10090bo - 105b + 14o Differentiate 1806x*2 + 929x + 22334184 wrt x. 3612x + 929 Find the third derivative of -275m*5 + 14m*4 - 1497m*3 - 2m*2 - 178371839 wrt m. -16500m*2 + 336m - 8982 What is the second derivative of 865024v5 + 173v*4 - 3161223v wrt v? 17300480v3 + 2076v*2 What is the derivative of 785d*4 + 10963d*2j - 13j + 1048881 wrt d? 3140d*3 + 21926dj Find the third derivative of -5v5 + v4 + 388540v3 + 274625v*2 - 156v. -300v2 + 24v + 2331240 Find the second derivative of -11j3y*2 - 72j*3y - j*3 + 172458jy2 + 2jy + 6y*2 - 3y + 2954 wrt y. -22j3 + 344916j + 12 What is the second derivative of -5411649v3 - 6v*2 - 555222653v? -32469894v - 12 Differentiate 772319c*2 + 89c + 57212284. 1544638c + 89 Find the third derivative of -38h*6 - 36h*5 - 390h*3 - 365403h*2 - 22h. -4560h3 - 2160h*2 - 2340 What is the derivative of -144728404cn - 798n + 60363 wrt c? -144728404n What is the derivative of -6289x*3 - 117x*2 - 2x - 4876663? -18867x2 - 234x - 2 Find the first derivative of 133104991y - 36359693. 133104991 What is the first derivative of -80247292j*2 - 16334407? -160494584j Differentiate 3703447sw - 5345704w - 2 with respect to s. 3703447w Find the third derivative of -3119698jw*5 - 2jw - 149j + 14w6 - 545w*2 wrt w. -187181880jw2 + 1680w*3 What is the third derivative of -1877730u*4 - 9u*3 + 3u*2 - 1040u - 10724? -45065520u - 54 Find the first derivative of 306g*3qx - 2g*3q - g*3 + 3g*2q + 89g - 174qx2 - x2 - 18 wrt x. 306g*3q - 348qx - 2x What is the second derivative of -35682103c*2h3 - c2h2 + 2c*2h + 2c2 + 5h - 43219 wrt h? -214092618c2h - 2c2 Differentiate 8057330lr2 - 9455519r*2 wrt l. 8057330r*2 What is the second derivative of 1322ft5 + 15921570ft - 2415t*5 wrt t? 26440ft3 - 48300t*3 Find the third derivative of -119w*4 + 42620w*3 - 10416383w*2. -2856w + 255720 What is the third derivative of 1096155115m3 - 2637m*2 - 15m + 4868 wrt m? 6576930690 Find the second derivative of 839471o4w*2 - 74ow - 2w*2 + 747w wrt o. 10073652o2w*2 What is the second derivative of -21m*4 + 3925410m*2 + 53345006m? -252m2 + 7850820 What is the second derivative of 6349y*4 - 131y*2 - 260y + 241 wrt y? 76188y2 - 262 Differentiate 6k*4 + 66k*3 - 18k*2 - 16k + 3686928 with respect to k. 24k3 + 198k*2 - 36k - 16 What is the third derivative of 368234m4 - 162m*3 + 5274m*2 - 15m + 196? 8837616m - 972 Differentiate 4n*2p - n*2 - 91479np - 150798p + 5 with respect to n. 8np - 2n - 91479p What is the third derivative of 6n5 - 268966n*4 + 2n*3 - 21255111n*2 wrt n? 360n*2 - 6455184n + 12 Find the first derivative of -245638i2 + 8i + 6233743. -491276i + 8 Find the third derivative of 19342m*5 - 3m*4 - 118m*3 - 103881965m*2 - m. 1160520m*2 - 72m - 708 Find the second derivative of -51d3m - 48313d3 - 2d*m - d + 168	{ "pile_set_name": "DM Mathematics" }
82 + 80. -12f Collect the terms in 8f + 2f + 38833f*2 - 38830f*2. 3f*2 + 10f Collect the terms in -21172u + 42348u - 170u2 - 21176u. -170u2 Collect the terms in 6 - 6 - 993v - 1. -993v - 1 Collect the terms in -185t - 21t2 - t3 + 96t - 28t2 + 89t. -t*3 - 49t*2 Collect the terms in 247943 + 303y - 858y - 247943. -555y Collect the terms in -4618n2 + 2666 - 2666. -4618n*2 Collect the terms in -155 + h - 146 - 141 + 435. h - 7 Collect the terms in -87v*2 - 78v*2 + 309v*2 - 73v*2. 71v*2 Collect the terms in -273a + 0 + 0 + 97a - 313a. -489a Collect the terms in -12d*2 + 991092d - 991092d. -12d*2 Collect the terms in 467925q*3 - 233947q*3 - 233959q*3 - 3q*2. 19q*3 - 3q*2 Collect the terms in 0v - 180v2 + 480v*2 + 3v - 82 - 2v. 300v*2 + v - 82 Collect the terms in -2650f*3 + 5564f*3 - 2916f*3. -2f*3 Collect the terms in -4 - 2d + 29 - 25. -2d Collect the terms in -3d + 54d2 - 112d*2 + 58d*2 + 6d*3. 6d*3 - 3d Collect the terms in -82v + 2018v*3 + 82v. 2018v3 Collect the terms in -55a*3 - 291a*3 + 58a*3. -288a*3 Collect the terms in 42r*3 - 3334 - 16r*3 - 11r*3 + 3334 - 13r*3. 2r*3 Collect the terms in 1449d*2 - 1449d*2 + 243d*3. 243d*3 Collect the terms in 157 - f - 110 + 352 + 111. -f + 510 Collect the terms in -3248p*3 - 269 + 269. -3248p*3 Collect the terms in -27401w - 3w3 + 22w*2 + 27401w. -3w3 + 22w*2 Collect the terms in -357310 + 6u3 - u3 + 357310. 5u3 Collect the terms in -8c*2 - 6c*2 - 3c*2 - 436c*3 + 222c*3 + 216c*3. 2c*3 - 17c*2 Collect the terms in 1845 + o - 12o*2 - 1845 - o. -12o*2 Collect the terms in -3 + 38b + 4 + 74b - 14b. 98b + 1 Collect the terms in 2739s*2 - 5567s*2 + 2829s2. s2 Collect the terms in -9r2 + 7r*2 - 1379r + 1391r. -2r*2 + 12r Collect the terms in -2l - 362l*3 + 2l - 6363l3. -6725l*3 Collect the terms in 192c + 197c - 970c + 198c + 193c + 192c. 2c Collect the terms in -1 + 105s + 2 - 1 - 123s. -18s Collect the terms in 5 + 6 + 11720u - 11719u. u + 11 Collect the terms in -3242a + 7a2 + 1653a + 1589a. 7a*2 Collect the terms in 9k*2 - 1185k + 563k + 622k. 9k2 Collect the terms in -56o - 44o - 8o + 3o. -105o Collect the terms in 5755257g3 - 2877632g*3 - 2877629g*3. -4g*3 Collect the terms in -46z*2 - 8z - 45z2 + 88z*2 - 3z. -3z2 - 11z Collect the terms in -5 - 12767j3 + 12768j3 + 5. j3 Collect the terms in -2 + 2 - 92z2 - 187z*2 - 102z*2. -381z*2 Collect the terms in -12898i*3 - 12891i*3 + 25794i*3. 5i*3 Collect the terms in -1614x*2 - 1486x*2 + 4717x*2 - 1614x*2. 3x*2 Collect the terms in -5l2 + l2 + 892l + 5l*2 - 892l. l*2 Collect the terms in -105 + 0a*2 - 20a*2 + 110. -20a*2 + 5 Collect the terms in 1679f + 1620f - 4920f + 1619f. -2f Collect the terms in 0u2 + u2 + 2u*3 - 726 - 17u*3. -15u3 + u2 - 726 Collect the terms in -408q - 411q + 1268q - 449q - 2q3. -2q*3 Collect the terms in 5208k + 5280k + 5275k - 15764k. -k Collect the terms in -39y*3 + 8y*3 - 161y*2 + 252y*2 - 91y*2. -31y*3 Collect the terms in -5799v - 1410v + 921v. -6288v Collect the terms in -2331484 + 4662968 + 5s - 2331484. 5s Collect the terms in 121u*2 - 4303u*2 - 275u*2. -4457u2 Collect the terms in -114243 - c3 + 114243. -c*3 Collect the terms in 3640h*3 - 847h*3 + 838h*3. 3631h*3 Collect the terms in 586d*3 - 372d*3 + 1272d*3 + 970d*3. 2456d*3 Collect the terms in -22l*2 + 2033 - 2033. -22l*2 Collect the terms in 137m - 67m + 22m*2 - 70m + 9m2. 31m*2 Collect the terms in 3q - 3q - 2q + 4q + 147. 2q + 147 Collect the terms in -55 - 25 + 4a - 5a + 34. -a - 46 Collect the terms in 756g + 4g*2 + 5g*2 - 756g - 11g2. -2g*2 Collect the terms in -129p + 1232p - 1107p. -4p Collect the terms in 2877v*2 - 11v*3 - 71v*3 - 2858v*2. -82v*3 + 19v*2 Collect the terms in 353m*3 - 268m*3 - 207m*3. -122m*3 Collect the terms in -251m + 322m2 + 251m. 322m2 Collect the terms in 58l*3 - 49550670 + 49550670. 58l3 Collect the terms in -x3 - 1176x + 3499x - 1141x - 1182x. -x*3 Collect the terms in -q + 1441q*3 + 512q*3 + 0q. 1953q3 - q Collect the terms in -9s*2 + 182s*2 - 278 + 141 + 137. 173s*2 Collect the terms in 105c - 105c - 863c*2 - 656c*2. -1519c*2 Collect the terms in -83040656q*2 - 1 + 1 + 83040662q*2. 6q*2 Collect the terms in 2u - 3u + 346 + 0u. -u + 346 Collect the terms in -b*2 - 4b*2 + 2b*2 - 31212b*3. -31212b*3 - 3b*2 Collect the terms in -1045g + 340g + 350g + 357g. 2g Collect the terms in -22o + 37869o*3 - 37878o*3 + 22o. -9o3 Collect the terms in 135196 + 80v*3 - 135196. 80v*3 Collect the terms in 106 - 31o*2 + 42 + 32o2. o2 + 148 Collect the terms in 5u3 - u3 - 7u*3 - 14u*3 + 0 + 2. -17u*3 + 2 Collect the terms in 56 + 1240034l*2 - 1240034l*2 - 56 - 4l*3. -4l*3 Collect the terms in 238y + 6320 - 12646 + 6324. 238y - 2 Collect the terms in -16l*2 + 55l*2 - 21l*2 - 19l2. -l2 Collect the terms in -69b + 447 - 79b + 147b. -b + 447 Collect the terms in 131y + 142y - 34y + 16y. 255y Collect the terms in 6a2 - 10a*2 - 47a3 - a2 + 4a2. -47a3 - a2 Collect the terms in -8 - 9 + 23 - 70d. -70d + 6 Collect the terms in 553k + 550k - 1673k + 554k. -16k Collect the terms in 169 - 101i + 176 - 345 + 37i. -64i Collect the terms in -k*2 + 265k3 - k2 - 553k3 - 1923k*3. -2211k*3 - 2k*2 Collect the terms in -207s*3 - 12693s*3 - 983s*3. -13883s*3 Collect the terms in -13098 - 541876316d*3 + 541876315d3 + 13098. -d3 Collect the terms in -3 - 14j - 11j - 21j + 49j - 9j. -6j - 3 Collect the terms in -w*3 - 3w*3 + 5w*3 + 0w3 + 610. w3 + 610 Collect the terms in 12v3 + 22v - 40v3 - 13v*3 - 22v. -41v3 Collect the terms in -905494o + 1810993o - 905497o. 2o Collect the terms in 4z + 2z + 3z + 13. 9z + 13 Collect the terms in -1913u*2 + 1871u*2 + 29u*2. -13u*2 Collect the terms in 10h + 1 + 53h + 25h + 1. 88h + 2 Collect the terms in 67a - 139a + 75a + 17a2. 17a*2 + 3a Collect the terms in 72168u2 - 144356u*2 + 72189u2. u2 Collect the terms in -1352 + 2720 - 30x - 1368. -30x Collect the terms in 32d3 - 29d*3 - 105 - 31. 3d*3 - 136 Collect the terms in -446232 + 38q + 446232. 38q Collect the terms in -7a*2 + 1136a + 2 - 1136a - 2. -7a*2 Collect the terms in -1 - 5 + 1 + 7j + 3j - 2j. 8j - 5 Collect the terms in 2q*2 + 4q*2 + 4q*2 - 4q*2 - 19q2 + q2. -12q2 Collect the terms in -6k*2 - 5 - 42 - 12 + 64. -6k*2 + 5 Collect the terms in 181c*2 - 15c*2 - 49c*2 - 61c*2 - 55c2. c2 Collect the terms in 7p + 7p + p + 2p - 11p. 6p Collect the terms in 416y*3 + 4 - 186y*3 - 4. 230y*3 Collect the terms in 66748v - 34v3 - 66748v. -34v3 Collect the terms in 64 - 28k*3 - 38 - 13 - 13. -28k*3 Collect the terms in 54d*2 - 237d*2 + 64d*2 + 65d*2 + 67d*2. 13d*2 Collect the terms in -2270298i + 2270298i - 52i*3. -52i*3 Collect the terms in 16 + 38n - 21n - 13 - 19n. -2n + 3 Collect the terms in 655a*3 - 49 + 49 + 18a*2 - 656a3. -a3 + 18a2 Collect the terms in -2q + 2q - 416 + 1348 - 2q*2 - 932. -2q*2 Collect the terms in -114v*3 + 145v*3 - 1456v*3. -1425v*3 Collect the terms in -1200n*3 + 4305n*3 + 1709n*3. 4814n*3 Collect the terms in 838 + 0z - z - z. -2z + 838 Collect the terms in d3 + 29693d + 29697d - 59390d. d*3 Collect the terms in 15 + 347a*2 - 8 - 7. 347a*2 Collect the terms in 7t - 12t + 5t - 844t2. -844t*2 Collect the terms in -2l + 14l2 - 2l*2 + 408l*3 - l. 408l*3 + 12l*2 - 3l Collect the terms in 7953 + 1286 + 2i + 63. 2i + 9302 Collect the terms in 5354 + 4276 - 1946 - 3m - 405. -3m + 7279 Collect the terms in -2 - 62238w + 2w*2 + 62238w. 2w2 - 2 Collect the terms in 112b - 353b - 711b. -952*b Collect the t	{ "pile_set_name": "DM Mathematics" }
(4(-4)/8)/2. Let d = 3/2 + p. Factor -2o*2 + 3o*3 - 2o*4 + do + 1/2o5 + 0. o(o - 1)*4/2 Let m = 20 - 18. Suppose 5a - 5j = -10, -3j - m + 8 = 5a. Factor a + 4/5i*3 + 2/5i*2 + 0i + 2/5i4. 2i*2(i + 1)*2/5 Find a, given that 5a + 10/3 + 5/3a2 = 0. -2, -1 Find n, given that -4/17n + 6/17n2 + 0 = 0. 0, 2/3 Solve 0h + 5/2h2 - 45/4h*3 + 0 + 5h*4 = 0. 0, 1/4, 2 Let x = 4 + -10. Let u be x/(-4)32/24. Factor 0 + 1/4i + 1/4i*u. i(i + 1)/4 Let j = 217/65 - 7/13. Determine s so that -js5 + 12/5s*3 - 11/5s*4 + 11/5s*2 + 0 + 2/5s = 0. -1, -1/2, -2/7, 0, 1 Let i(r) be the first derivative of -r*6/3 - 16r*5/5 - 25r*4/2 - 76r*3/3 - 28r*2 - 16r - 14. Factor i(y). -2(y + 1)2(y + 2)*3 Suppose -g - 14 = -4a + g, -9 = -3a + g. Let 30h - 26h2 - ah*4 - 8 + 12h*3 - 11h + 5h = 0. Calculate h. 1, 2 Factor 9 + 3/2x*2 - 15/2x. 3(x - 3)(x - 2)/2 Let w(b) be the third derivative of -2b7/315 + b5/15 - b4/9 + 28b*2. Factor w(q). -4q(q - 1)2(q + 2)/3 Let u(b) be the third derivative of b6/360 - b5/60 + b*4/36 + 55b*2 + b. Factor u(h). h(h - 2)(h - 1)/3 Let s(j) be the second derivative of -j7/840 + j6/240 - j4/4 - 7j. Let t(u) be the third derivative of s(u). Factor t(w). -3w(w - 1) Let r = -129 + 131. Factor 0x + 0 - 1/2x*5 - 2x*r + 3/2x*4 + 0x3. -x2(x - 2)2(x + 1)/2 Let u(n) be the first derivative of -5n4/4 - 8n3/3 - n2/2 + 2n - 15. Determine k, given that u(k) = 0. -1, 2/5 Let q be (-26)/8 + 20/5. Let -3/4f + 0 + qf3 + 0f2 = 0. Calculate f. -1, 0, 1 Let p(t) be the third derivative of -t8/6720 + t7/2520 + t4/6 + 4t2. Let j(f) be the second derivative of p(f). Factor j(x). -x2(x - 1) Let o = -13 - -10. Let c(s) = -3s4 + 15s*3 - 36s*2 + 39s - 12. Let v(x) = -x3 + x2 + x. Let d(m) = ov(m) + c(m). Factor d(u). -3(u - 2)*2(u - 1)2 Let r(a) be the second derivative of -a7/56 + 3a6/20 - 9a*5/20 + 5a*4/8 - 3a*3/8 + 9a. Factor r(c). -3c(c - 3)(c - 1)3/4 Let x = -30/11 + 984/385. Let u = 4/35 - x. Determine g so that -8/7 - ug*2 - 8/7g = 0. -2 Factor 2/5a5 + 4/5a*4 + 0a*2 + 0a + 0 + 2/5a3. 2a*3(a + 1)*2/5 Suppose 3z = 3n + 39, 5z - 19 = n + 66. Let x = 21 - z. Let 0u + 4/7u*2 + 0 + 2/7ux = 0. What is u? -2, 0 Let t(l) be the first derivative of -l6/30 + l5/10 - l3/3 + l*2/2 + 2l + 4. Let s(r) be the first derivative of t(r). Factor s(u). -(u - 1)*3(u + 1) Let x = -3 + 4. Let u be x/(-4)(-48)/18. Let 0 - uj + 4j4 + 4j*2 - 22/3j*3 = 0. Calculate j. 0, 1/3, 1/2, 1 Find a, given that -2/13a - 4/13a3 - 8/13a*2 + 6/13a*5 + 8/13a*4 + 0 = 0. -1, -1/3, 0, 1 Suppose -3r - 5 = -2c - 1, -4r - 3c + 6 = 0. Suppose -2y - 19 + 29 = r. Determine h, given that 0h + 11/3h*4 - 8/3h3 + 0 - hy - 4/3h2 = 0. -1/3, 0, 2 Let j(n) be the third derivative of 8n*6/3 - 4n*5 + 5n*4/2 - 5n*3/6 + 5n*2. Factor j(t). 5(4t - 1)3 Suppose 0 = -5o + 9 + 6. Suppose 0n = -2n. Factor -9/4x4 - 7/4x*2 + 15/4x*o + n + 1/4x. -x(x - 1)(3x - 1)2/4 Let h be -26(-2)/(-60) - -1. Let c(p) be the third derivative of 2/75p5 + hp*3 + 0p - 1/12p4 + 2p*2 + 0 - 1/300p*6. Factor c(o). -2(o - 2)(o - 1)2/5 Let c(t) be the third derivative of -1/30t*5 + 4t*2 + 2/27t*3 - 1/108t*4 + 0 + 13/540t*6 + 0t - 1/189t7. Let c(z) = 0. What is z? -2/5, 1 Determine p, given that 1/9p*3 - 2/9p*2 - 1/3p + 0 = 0. -1, 0, 3 Let c(v) be the third derivative of -v*8/336 + 4v*7/105 - 11v*6/60 + 7v*5/15 - 17v*4/24 + 2v*3/3 - 23v*2. Find o such that c(o) = 0. 1, 4 Solve 8/5i + 1/5i2 + 16/5 = 0 for i. -4 Let h(l) = -l3 + l2 - l + 1. Let j(c) = -16c*3 + 20c*2 - 12c + 12. Let q(u) = 12h(u) - j(u). What is s in q(s) = 0? 0, 2 Let w(k) be the second derivative of 6k*6/5 - 42k*5/5 + 52k*4/3 - 44k*3/3 + 6k*2 - 5k. Factor w(q). 4(q - 3)(q - 1)(3q - 1)2 Let i(z) be the second derivative of z4/18 + z*3/3 + 2z*2/3 - z. Factor i(c). 2(c + 1)(c + 2)/3 Let k(n) be the second derivative of n6/6 - 3n*5/4 + 24n. Factor k(d). 5d3(d - 3) Determine v, given that -32/3v + 2/3v*2 + 128/3 = 0. 8 Suppose -9 = -5w + 1. Let l be (824/72 - 4) + -7. Suppose -4/9 + ltw - 2/3t = 0. Calculate t. -1/2, 2 Let o = -304/3 + 102. Let j(k) be the third derivative of 2k2 + 3/2k*4 + ok*3 + 0k + 39/20k5 + 5/14k*7 + 0 + 4/3k*6. Factor j(n). (n + 1)(3n + 1)(5n + 2)2 Let q(r) be the second derivative of r5/120 - r3/12 + r2/6 - 9r. Factor q(t). (t - 1)*2(t + 2)/6 Let p(c) be the first derivative of -c6/1080 - c5/180 - c*4/72 + 4c*3/3 - 2. Let v(h) be the third derivative of p(h). Suppose v(x) = 0. What is x? -1 Let n be (1 + 1)/(4/6). Factor 0c + 0 + 1/2c4 + 0c*2 + 1/2cn. c3(c + 1)/2 Factor 4/3m + m*3 + 8/3 - 10/3m2. (m - 2)2(3m + 2)/3 Let j be 0/((-3)/(-6)2). Let m be (-1 - 2/(-4))j. Factor -1/3x2 + 0x + m. -x*2/3 Let t = -2 + 5. Let 7j*2 + t - 10j*2 - 19j*2 - 18j + 1 = 0. Calculate j. -1, 2/11 Let w = -3 - -11. Let y = w + -6. Solve -15s2 + 7s*y + 8s*4 + 2s - s*3 - 4s*3 + 3s*3 = 0. -1, 0, 1/4, 1 Let z be ((-1)/10)/(9 + (-190)/20). What is i in zi*4 + 0 - 2/5i*3 + 1/5i*2 + 0i = 0? 0, 1 Suppose 0c + 3c = 0. Suppose -2l + l + 10 = c. Find v, given that -5v*5 - 4v - 3v4 + lv*2 - 7v*4 + 18v*3 - 9v*5 = 0. -1, 0, 2/7, 1 Let n = 25148/8775 - 1676/675. Let i = 2/117 + n. Factor 12/5q*2 + i + 8/5q*3 + 2/5q*4 + 8/5q. 2(q + 1)4/5 Let h = -24 - -36. Factor 0 - 1 - 12k*3 - 3k*4 + 1 - hk*2. -3k*2(k + 2)*2 Let -2/3 - 8/3x*2 - 10/3x = 0. What is x? -1, -1/4 Factor 0 + 6l - 6/5l*2. -6l(l - 5)/5 Let m(x) be the first derivative of -x8/1176 - x7/735 + x2/2 + 1. Let k(r) be the second derivative of m(r). Determine u so that k(u) = 0. -1, 0 Let k be 6/((-9)/(-3))(1 + 0). Factor 1/2j3 + 1/2j*5 + 3/2j*k - 3/2j*4 + 0 - j. j(j - 2)(j - 1)2(j + 1)/2 Factor 0 - 2/3u2 - 2/3u. -2u(u + 1)/3 Let i(j) = 2j3 + 31j*2 + 98j - 3. Let s(q) = 2q3 + 32q*2 + 98q - 4. Let b(d) = 4i(d) - 3s(d). Find g such that b(g) = 0. -7, 0 Let a(w) = -7w3 - 9w*2 + 7w. Let v be (2 - 21/6)-6. Let b(h) = -3h + 4h2 - 2 + 2 + 3h*3. Let x(d) = vb(d) + 4a(d). Factor x(n). -n(n - 1)(n + 1) Suppose 0 - 6/7d*2 + 2/7d*3 + 2/7d*5 - 4/7d + 6/7d4 = 0. What is d? -2, -1, 0, 1 Let x(d) = d2 - 3d + 1. Let g be x(2). Let j be 5/15 - g/(-3). Factor -2/5c4 + jc - 2/5 + 4/5c2 + 0c*3. -2(c - 1)*2(c + 1)2/5 Let f(g) be the third derivative of -g7/175 + g*6/100 + 3g5/50 - g4/4 + 2g3/5 - 18g*2. Factor f(r). -6(r - 1)*3(r + 2)/5 Solve -8 - 16z3 + 4z*4 + 4z*5 - 3z*4 + 8z*2 + 12z - z4 = 0. -2, -1, 1 Let x(d) be the first derivative of d7/2520 + d4/6 - d + 2. Let m(p) be the first derivative of x(p). Let n(g) be the third derivative of m(g). Factor n(r). r2 Suppose 3j = 5b - 3 - 17, -b + 4 = 4j. Let t(p) be the second derivative of 0 - p + jp*2 - 1/10p*5 - 1/3p*4 - 1/3p3. Find a, given that t(a) = 0. -1, 0 Let t(y) be the first derivative of y5 - 5y4/2 + 5y3/3 + 12. Determine p, given that t(p) = 0. 0, 1 Let t(v) = -v3 + 9v2 + 27v + 19. Let z(b) = 2b3 - 28b*2 - 80b - 56. Let k(j) = -8t(j) - 3z(j). Factor k(q). 2(q + 2)3 Factor -201/2q*3 + 171/2q*2 - 36q + 6 - 27/2q5 + 117/2q*4. -3(q - 1)*3(3q - 2)2/2 Let q(f) = f. Let u be q(5). Suppose ub = 5 + 10. Factor 2 - 6 + 2d + 4d*2 + 3d*3 - 5d*b. -2(d - 2)(d - 1)(d + 1) Let p(t) be the third derivative of 1/180t5 + 0 + 1/9t*3 - 3t*2 + 0t - 1/24t4. Factor p(y). (y - 2)(y - 1)/3 Let m(z) be the second derivative of -3z5/40 - z4/4 + 3z*3/4 - 21z. Let m(l) = 0. Calculate l. -3, 0, 1 Let 2/5x3 + 6/5x + 6/5x2 + 2/5 = 0. What is x? -1 Solve -20u*2 - 3u*3 - 14u*2 + 22u*2 - 6 - 15u = 0. -2, -1 Let b(l) be the first derivative of -l2/2 + 4. Let j(t) be the third derivative of -t5/30 + t*4/6 - 2t*2. Let w(g) = 2b(g) + j(g). Solve w(k) = 0. 0, 1 Let z(q) be the third derivative of -2/15q*3 +	{ "pile_set_name": "DM Mathematics" }
+ 4. Let z(d) = -7 + 6d3 + d3 - 9d + 2d3. What is pz(m) - 7v(m)? -m3 + m Let p(h) = -6h2. Let o(a) = -a2. Calculate -36o(t) + 4p(t). 12t2 Suppose -4w + 19 = 3. Let l(s) = -2s3 + 2s*2 - 3s - 3. Let d(h) = 2h3 - 3h*2 + 4h + 4. Calculate wl(b) + 3d(b). -2b3 - b2 Let v(t) = t - 1 - t - t + 0. Let j(f) = -4f - 4. Let h(y) = j(y) - 3v(y). Let z(g) = -3g - 4. Calculate 4h(o) - z(o). -o Let m(d) = -1. Let v be 8/1070/(-4). Suppose j = -4 + 6. Suppose -5t = -8 - j. Let x(r) = -r2 - 8. What is tx(a) + vm(a)? -2a*2 - 2 Let q = -14 - -17. Suppose -2x + 5 - q = 0. Let l be (-6)/(-3) + 0/(-1). Let n(v) = 1. Let y(z) = z3 - z2. Determine ly(p) + xn(p). 2p3 - 2p*2 + 1 Let q(z) = 6z*3 - 7z*2 + 4z + 3. Suppose -2g = -5 + 1. Let h(w) = 2w*3 - 2w*2 + w + 1. Let u be (-3)/310 + 3. What is gq(m) + uh(m)? -2m3 + m - 1 Let s(o) = -2 + 4 - 1. Let h(u) = u - 5. Give h(v) + 4s(v). v - 1 Let j be (-3 + 13)/((-1)/(-1)). Let v(d) = d + 3. Let x(c) = -2c - 7. Determine jv(r) + 4x(r). 2r + 2 Let w(r) = -8r2 + 6r - 4. Let m(y) = 9y2 - 8y + 5. Determine 5m(o) + 6w(o). -3o2 - 4o + 1 Let c(t) = 9t - 8. Let r(i) = -4i + 4. Calculate 6c(n) + 13r(n). 2n + 4 Let i(x) = 4 + 0 + 2x2 + x2. Let p(z) = 4z2 + 5. Let f(v) = -6v*3 + 2v*2 + 2v + 1. Let l be f(-1). Suppose 3j + l + 8 = 0. Give ji(o) + 4p(o). o2 Let m(t) = 2t*3 + 4t*2 - 4t + 1. Let d(q) = 2q3 + 3q*2 - 3q + 1. Calculate -4d(s) + 3m(s). -2s3 - 1 Let v(f) = -27f + 3 + 50f + 0f*2 + 5f*2 - 24f. Let c(z) = 4z2 - z + 2. Calculate -4c(g) + 3v(g). -g2 + g + 1 Let s(o) = -3o3 - o3 + 2o + 0o*3 + 7o*3. Suppose 3g = 2 + 4. Let d(a) = a3 + a2 + a. Give gd(n) - s(n). -n3 + 2n2 Let m(b) = b2 + 4b - 1. Let r be m(-2). Let q(k) = 7k + 4. Let h(l) = 5 + 7l + 0l + 3l - 2l. Calculate rh(u) + 6q(u). 2u - 1 Let y(p) = -p2 - p. Let t(n) = 3n*2 + 6n + 8. Let m(o) = t(o) + 5y(o). Let a(k) = 1. Determine 6a(c) - m(c). 2c2 - c - 2 Let d(a) = 2a*2 - 15a - 2. Let n(x) = -x2 - x. Give -d(i) - n(i). -i2 + 16i + 2 Let l(f) be the first derivative of f2/2 + f - 8. Let m = -4 - -1. Let b(r) = -2r - 3. Calculate mb(o) - 8l(o). -2o + 1 Let v(a) = -2a*2 + 4a*3 - 7 + 13a2 - 4. Let u(f) = -f3 - 3f2 + 3. Calculate -22u(b) - 6v(b). -2b*3 Let l(a) = a - 1. Let h(v) = 3v + 4. Determine -h(n) - 4l(n). -7n Let w(g) = -g*3 + 2g + 3. Let o(c) = -c*3 - 2c*2 - c - 4. Let m be o(-3). Let l = m - 5. Let z(v) = 4 - 9 + 1 + 2v*l - 3v. Calculate 3w(y) + 2z(y). y3 + 1 Let i be (-4)/(-3) + (-4)/(-6). Let k(o) = o3 - 1. Let w(n) = 3n3. Let b(s) = -s3 + s - 1. Let m(g) = 2b(g) + 2w(g). Give ik(j) - m(j). -2j3 - 2j Let v(y) = -y - 10. Let a(t) = 12. Let n(h) = 2. Let d(r) = -2a(r) + 11n(r). Determine 11d(f) - 2v(f). 2f - 2 Let q(o) = 395o. Let y(p) = p. Calculate q(x) - 474y(x). -79x Let h(x) = 3x2 - 6x - 3. Suppose -17 - 3 = -4m. Let z(g) be the first derivative of -1/3g*3 + 1/2g*2 + g + 6. What is mz(b) + h(b)? -2b2 - b + 2 Let b(d) = -d + 1. Let h(z) = -2z - 2. What is -2b(m) - h(m)? 4m Let j(s) = -560s2. Let z(o) = 51o*2. Give 6j(b) + 65z(b). -45b2 Let s(j) = -j2 - 12j + 14. Let g be s(-13). Let o(h) = -h - 2. Let q(z) = 1. Give go(b) + 5q(b). -b + 3 Let a(r) be the second derivative of -r3/6 - r2/2 + 29r. Let h(y) = 6y + 6. Determine -4a(g) - h(g). -2g - 2 Let k(u) be the first derivative of 51u*2/2 - 21u + 3. Let c(i) = 5i - 2. Let j(r) = -22r*2 - r. Let g be j(-1). Calculate gc(x) + 2k(x). -3x Let r(k) = -2k - 11. Let g(b) = -2b - 11. What is -5g(s) + 6r(s)? -2s - 11 Let i(q) = 4q - 6. Let s(y) = -5y + 35. Let n be s(7). Let g(h) be the third derivative of nh + h*2 + 7/6h*3 + 0 - 5/24h*4. What is 5g(k) + 6i(k)? -k - 1 Let u = -68 - -72. Let l(c) = 2c - 5. Let y(i) = 3i - 6. Give uy(g) - 5l(g). 2g + 1 Let g(z) = 8z2 + 5z - 1. Let c be 4/((-40)/25)(0 + 2). Let i(s) = 9s*2 + 6s - 1. Give ci(w) + 6g(w). 3w2 - 1 Let f(l) = 3l + 4. Let w(x) = 6x + 9. Calculate -7f(j) + 3w(j). -3j - 1 Let g(k) = -4k. Suppose -w - 5 = 0, 5i + 2w = -0w. Let o(r) = -r + 1. Determine io(z) - g(z). 2z + 2 Let d(h) = 2h2 + 5h + 2. Let t(y) = -3y2 - 6y - 2. Let j(l) = -4d(l) - 3t(l). Let b(f) = -f*2 + 3f + 3. Calculate -2b(s) - 3j(s). -s2 Let v(m) = -m2 - m - 1. Let k(x) = x3 - x - 2. Let r(d) = d3 + 11d2 - 11d + 13. Let l be r(-12). What is lk(j) - 2v(j)? j*3 + 2j*2 + j Suppose 5j - 16 = -i + 4, 2i + 4 = j. Let g(c) = -c - 4c + 1 + 2c + j. Let d(r) = 2r - 3. Give -8d(h) - 5g(h). -h - 1 Let o(k) = -25k + 2. Let h(i) = 126i - 11. What is 2h(q) + 11o(q)? -23q Let s(c) = 19c*3 - 5c*2. Let m(j) = 29j*3 - 8j*2. What is -5m(l) + 8s(l)? 7l*3 Let y(d) be the second derivative of -7d*3/6 - 3d*2 + 9d. Let g(z) = 6z + 5. What is 5g(i) + 4y(i)? 2i + 1 Let v(h) = h*2 + 5h - 1. Let u be v(-4). Let m(w) = -2w2 - 4w. Let n(y) = -2y2 - 3y. Give um(p) + 6n(p). -2p2 + 2p Let j(l) = -3l2 + l + l2 + 13l + 6 - 4l2. Let n(m) = -2m*2 + 5m + 2. Determine -6j(h) + 17n(h). 2h2 + h - 2 Let g(p) = -9p - 4. Let z(f) = 13 - 15 + 0 - 4f. Give -3g(w) + 7z(w). -w - 2 Let h(w) = -5w*2 - 4w - 4. Let r(k) = 4k2 + 3k + 3. Give 2h(j) + 3r(j). 2j2 + j + 1 Let u(f) = f - 1. Suppose -7 + 2 = -o. Let q(d) = 6d - 6. Determine ou(z) - q(z). -z + 1 Let g(a) = 2a - 2. Let c(z) = -4z + 5. Suppose -2x - 4p + 7 = -p, -3x = -5p + 37. Calculate xc(i) - 9g(i). -2i - 2 Let b(c) = -5c - 2. Let d(n) be the third derivative of -n4/12 - n3/6 + 15n*2. Give 4b(k) - 9d(k). -2k + 1 Let y = -9 + 5. Let p(w) = w3 - w2. Let o = -8 - -11. Let v(m) = m*o - 7m*3 + 3m2 + m2 - m. Calculate yp(a) - v(a). 2a*3 + a Let l(z) be the third derivative of 11z*4/24 - 5z*3/6 + 2z*2. Let o(j) = 4j - 2. What is -3l(g) + 8o(g)? -g - 1 Let z(m) = -92m3 + 5m. Let v(i) = 6762i3 - 368i. What is 5v(n) + 368z(n)? -46n3 Let b(j) = -5j*2 - 6j. Let m(q) = -q - 3. Let t(v) = -3v - 8. Let r(l) = 8m(l) - 3t(l). What is b(s) + 6r(s)? -5s2 Let c(r) be the third derivative of -r5/60 - r3/6 + r2. Let d(b) = -b2 + 3b + 7. Let p be d(5). Let a(i) = -i*2 - 2. What is pa(m) + 6c(m)? -3m*2 Let w(l) = -3l + 1. Let p(k) = -16k + 4. Calculate -2p(h) + 11w(h). -h + 3 Let g(s) = -5s*2 + 2s - 2. Let l(v) = 6v2 - 2v + 2. Give -4g(t) - 3l(t). 2t2 - 2t + 2 Suppose -3v - 18 = -0v. Let k = 8 + v. Let h be 23/k + 2. Let u(a) = 7a*3 - 7a - 3. Let o(f) = 8f3 - 8f - 4. Determine ho(g) - 6u(g). -2g3 + 2g - 2 Let j(o) = 4o2 + 75. Let x(z) = -z2 - 19. What is 2j(a) + 9x(a)? -a2 - 21 Let q(i) = 11i*3 + 8i*2. Let m(v) = 7v*3 + 5v*2. Let c be 19/4 + (-9)/(-36). Give cq(o) - 8m(o). -o3 Let d(l) = 4l - 75. Let u(w) = -9w + 151. What is -13d(k) - 6u(k)? 2k + 69 Let g(p) = -p - 3. Let v be 15/(-1 - -6) + 2 + -3. Let l(n) be the first derivative of -3 - 2n - 1/2n*v. Calculate 4g(r) - 5l(r). r - 2 Let r(z) = 31z + 16. Let v(s) = -21s - 11. What is 5r(n) + 7v(n)? 8n + 3 Let q(j) = -7j2 - 15j - 9. Let c(k) = -3k2 - 7k - 4. What is -9c(l) + 4q(l)? -l*2 + 3l Let w(b) = 5b2 + 10b - 10. Let v(j) = -4j2 + 5j - 5. Let m(f) = 2f2 - 3f + 3. Let x(r) = 11m(r) + 6v(r). Determine 3w(d) + 10x(d). -5d2 Suppose -11j = -4j + 28. Let s(l) = -4l + 7 + 4l - 3l. Let q(u) = -u + 3. What is js(y) + 10q(y)? 2y + 2 Let u(y) = 2y*2 - 5y. Suppose 6p + 23 = 53. Let k(h) = h2 - 3h. Give pk(m) - 3u(m). -m*2 Let t(z) be the first derivative of -4z*2 - 4z - 8. Let c(w) = -w. Determine -10c(y) + t(y). 2y - 4 Let r(j) = -5j. Let t(m) = m. Calculate r(d) + 10t(d). 5d Let n(z) = -z - 3. Suppose -4f - 14 = -2. Let k(h) = -2. Calculate fk(b) + 2n(b). -2b Suppose x - 6 = -16. Let v be ((-4)/(-10))/(1/x). Let k(j) = -16j*2 - 11j. Let s(b) = 3b2 + 2b. Give vk(l) - 22s(l). -2l2 Let f = -5 - -8. Let j(n) = -3n*3 + 3n*2 + 2n. Let d(p) = -4p3 + 4p*2 + 3p. Calculate fj(v) - 2d(v). -v**	{ "pile_set_name": "DM Mathematics" }
) = 7x3 - 11x*2 - 17x - 5. Determine 5b(h) - 3d(h). -h*3 + 3h*2 + 6h Let r(g) = -5g2 + g - 5. Let z(f) = -9f*2 + 123f - 12. Calculate 2r(s) - z(s). -s2 - 121s + 2 Let w(u) = 379u2 - 10u - 28. Let r(v) = 126v2 - 4v - 10. What is -8r(z) + 3w(z)? 129z2 + 2z - 4 Let f = 478 + -474. Let m(j) = -5j - 13. Let q(w) = w + 1. Calculate fq(t) + m(t). -t - 9 Let h(x) = -69x3 + 11x2. Let c(y) = y3 + y*2 + y + 1. Let u(q) = -24q*3 - 8q*2 - 10q - 10. Let z(f) = 10c(f) + u(f). Determine 2h(r) - 11z(r). 16r*3 Let a(p) = 21p*2 - 14p - 7. Let c(l) = 36l2 - 27l - 13. Determine -5a(s) + 3c(s). 3s2 - 11s - 4 Let k(j) = -3j2 - 4j - 5. Let r be 28/13 - (264/26 - 10). Let m(w) = 0w + 4 + 3w + 66wr - 63w*2. Give 2k(a) + 3m(a). 3a*2 + a + 2 Let y(d) = 7d*2 + 3d + 2. Let n(u) = -11u2 - 5u - 3. Let o be 288/(-32) - (2 + -6). What is on(p) - 8y(p)? -p*2 + p - 1 Let t(q) = 10q*2 + 4q + 6. Let v(x) = 2x3 - 4x*2 - x + 5. Let p be v(1). Let h(k) = -3k*2 - 8 - k - p + 11 - 3. Calculate -14h(u) - 4t(u). 2u*2 - 2u + 4 Let h(n) = 4n3 - 7n*2 + 123n + 8. Let b(c) = -c3 - c2 - 21c - 1. Determine -6b(g) - h(g). 2g3 + 13g*2 + 3g - 2 Let y(q) = -12q3 + q2 - 6. Suppose 508a - 512a = -20, 2f + 4a - 6 = 0. Let z(d) = -12d3 + d2 - 7. Determine fy(l) + 6z(l). 12l3 - l2 Let o = 506 - 507. Let q(a) be the first derivative of a + 1. Let y(b) = -2b - 7. Give oy(z) - 6q(z). 2z + 1 Let a(f) = -2f - 2. Let j(p) = -1312p + 8. What is 5a(h) + j(h)? -1322h - 2 Let o(p) = -4p*3 + 15p*2 - 122p + 7. Let k(u) = u*3 - 3u*2 - 2u - 1. What is -5k(d) - o(d)? -d3 + 132d - 2 Let v(b) = 13b2 + 5b - 10. Let l(m) = 7m2 + 3m - 5. Suppose 95 = -1465p + 1446p. Calculate pl(o) + 3v(o). 4o2 - 5 Let v(f) = -f2 + 2. Let d(q) = -21q*2 + 272q + 17. What is d(c) - 9v(c)? -12c*2 + 272c - 1 Let i(j) = -22j2 + 8j - 4. Let o(f) = 21f2 - 7f + 5. Calculate 4i(y) + 3o(y). -25y2 + 11y - 1 Let y(x) = -3x2 - 6. Let p(j) = 14j*2 - 9j + 4. Let a = 234 + -243. Let q(u) = -3u2 + 2u - 1. Let z(t) = aq(t) - 2p(t). What is -y(d) - 6z(d)? 9d*2 Let u(x) = -11x*2 + x + 1. Let l(b) = 14b*2 - 3b + 376. Calculate -l(i) - 2u(i). 8i*2 + i - 378 Let g(c) = -c + 4. Let q(n) = -7n*2 + 69n - 110. Let s be q(8). Let k(p) = -p + 4. Determine sk(t) + 7g(t). -t + 4 Let r(q) be the first derivative of -q*2/2 - 2q + 25118. Let s(l) = 13 - 3 + 5l + 1. Let j be (-32)/14 - (-2)/7. Determine js(h) - 11r(h). h Let l(x) = 11x3 + x2 - x - 1. Let b(h) = -10679h3 - 2h*2 + 2h + 2. Calculate b(s) + 2l(s). -10657s3 Let u = 534 - 540. Let p(x) = -x2 - x - 1. Let c(y) be the first derivative of -4y3/3 - 4y*2 - 7y - 12. What is up(d) + c(d)? 2d*2 - 2d - 1 Let j(v) = 24v3 + v2 - 11. Let u(x) = -x2 + 101x - 296. Let l be u(3). Let z(g) = -5g3 + 2. Determine lj(n) - 11z(n). 7n*3 - 2n*2 Let k(o) = -39o*2 - 5o - 14. Let d(n) = -9n2 - n - 1. Determine 4d(a) - k(a). 3a2 + a + 10 Let p(d) = -44d - 11. Suppose -3z + 9 = b - 4z, 2z = -4b - 6. Let v(a) = -9a - 2. What is bp(c) - 11v(c)? 11c Let a(f) = 17f3 - 7f*2 + 7f + 11. Let s = -4273 - -4276. Let o = -4 - -11. Let r(x) = -8x3 + 3x*2 - 3x - 5. Calculate or(k) + sa(k). -5k3 - 2 Let v(l) = -140l*2 - 350l. Let g(n) = -11n2. Calculate -13g(b) + v(b). 3b2 - 350b Let c(q) = 46q2 - 14q - 1389. Let y(j) = 16j2 - 5j - 464. What is -3c(b) + 8y(b)? -10b2 + 2b + 455 Let p(d) = 4d3 + 6d*2 + 198d + 1. Let f(s) = -13s3 - 20s*2 - 595s - 5. Determine -2f(k) - 7p(k). -2k3 - 2k*2 - 196k + 3 Let i(n) = 2n3 - 6n - 1. Let z(g) = 21097g3 + 12g + 2. What is 2i(j) + z(j)? 21101j*3 Let c(a) = 2a*3 + 425a*2 + 15a - 4. Let o(f) = f*3 + 211f*2 + 6f - 2. Calculate 2c(i) - 5o(i). -i*3 - 205i*2 + 2 Suppose 469 = -2m + 471. Let s(q) = -8q + 4. Let f(v) be the third derivative of v4/24 - v3/6 + 4v*2. What is ms(w) + 5f(w)? -3w - 1 Let w(m) = -3m + 2. Let i(a) = -6a + 4. Let s be 14/6 + (-1)/3. Suppose 2f = 2h - 18, -67h + 63h = -2f - 26. Suppose sl + h = 3l. Give li(v) - 9w(v). 3v - 2 Let y(p) = 25p - 90. Let x(t) = -29t + 91. Calculate -10x(a) - 11y(a). 15a + 80 Let z(w) = -w3 - 5w*2 - 3w + 1. Let t(d) be the second derivative of d*5/10 + 2d*4/3 + 5d3/6 - d2 + 18d + 261. Determine 5t(i) + 8z(i). 2i*3 + i - 2 Let o(r) = 7r*3 + 23r*2 + 2. Let q(b) = 5b*3 + 17b*2 + 3. Let v(f) = 2o(f) - 3q(f). Let g(m) = m3 + m2 + 1. Calculate 5g(l) + v(l). 4l3 Let t(l) be the first derivative of 0 + 7 + 2l*2 + 199l*3 + 6l + 5 - 198l3. Let x(n) = 4n*2 + 5n + 6. What is 3t(c) - 2x(c)? c*2 + 2c + 6 Let d(u) = 6u3 + 3u*2 + 3u + 2. Let p(n) = -5n2 + 4n*3 - 11n - 5 + 1 + 6n - 15n*3. Suppose -36 - 12 = -16m. Give mp(l) + 5d(l). -3l3 - 2 Let y(g) = -3g + 5. Let b = 3733 + -3742. Let d(r) = -13r + 21. What is by(x) + 2d(x)? x - 3 Suppose 101 = -5k - 119. Let q(c) = c*2 + 1. Let i(v) be the first derivative of 8v*3 + 22v - 1743. Give kq(j) + 2i(j). 4j2 Let v(y) = 220y - 297. Let l(k) = -295k + 296. Calculate -3l(h) - 4v(h). 5h + 300 Let w = 12 + -18. Let o(u) = -17 - 12 - 18 + 54 - 17 + 56u - 58u. Let l(f) = -1. Let n(s) = -s*3 - 6s*2 - s - 5. Let j be n(-6). Calculate jo(r) + wl(r). -2r - 4 Let h = -12091 + 12092. Let r(y) = 1. Let d(m) = -4 - 2 + 3. Let x(f) = -d(f) - 2r(f). Let j(z) = -z - 8. Give hj(l) + 6x(l). -l - 2 Let a(x) = -2x*2 + 205x + 1 - 213x + 3x*3 + 0x*2 - 2x*2 + 2. Let t(u) = -4u*3 + 5u*2 + 8u - 4. Calculate -5a(z) - 4t(z). z*3 + 8z + 1 Let c(q) = 11. Let h(j) = 1062j + 19. Give -2c(b) + h(b). 1062b - 3 Let j(h) be the first derivative of 7h3 + h2 + 927. Let i(w) = -62w2 - 7w. Calculate 2i(q) + 7j(q). 23q2 Suppose -15 = -99f + 94f. Suppose 6l - fl = -12. Let y(c) = c2 - 4c. Let b(x) be the second derivative of -5x3/6 + 4x. What is lb(t) + 5y(t)? 5t2 Let w(i) = -i2 - 25i + 33. Let g be w(-26). Let q(u) = -46 + 36 - gu + 6. Let d(a) = 4a + 2. What is -11d(f) - 6q(f)? -2f + 2 Let t(v) be the second derivative of -2v3/3 + v2 - 20v. Let j(c) = -61c + 31c + 37c + c*2 - 3. Give -4j(a) - 7t(a). -4a*2 - 2 Let d(x) = -115x*2 + 8x + 16. Let y(t) = -229t2 + 14t + 30. Give -7d(j) + 4y(j). -111j2 + 8 Let b(m) = -m2 + m - 1. Let o(x) = 14x*2 - 6x + 10. Let z(d) = -2d3 - 2d*2 - 455d - 454. Let h be z(-1). Give ho(l) + 8b(l). 6l2 + 2l + 2 Suppose 6 = 9w - 21. Suppose 44 = -wo - 8o. Let d(q) = -q3 - 1. Let u(m) = 2m*3 + 2m*2 - m + 4. Calculate od(z) - u(z). 2z3 - 2z2 + z Let x(v) = -v2. Let b(o) = 2o2 - 6o - 1. Let q be -15 + (-112)/(-7) - 2. What is qb(y) - 4x(y)? 2y2 + 6y + 1 Let i(o) = -2o - 12. Let p be 4 + (-11 - (-10 + 8)). Let w(x) = -3x - 18. Calculate pw(c) + 8i(c). -c - 6 Let y(u) = 2u3 - 4u2. Let j(t) = -t3 + 5t2 + 3t + 19. Suppose 0 = -7s + 3s + 24. Let m be j(s). Let c(g) = -g*2. Calculate my(f) - 4c(f). 2f*3 Suppose 3k - 42 = 3y, 76k - 5y = 72k + 64. Let n(v) = 7v3 - 6v*2 + 6v - 12. Let z(x) = 6x3 - 5x*2 + 5x - 11. Determine kz(d) - 5n(d). d*3 - 6 Let q(i) = -9i - 6i + 21i - 11 - 17i. Let u = -90 - -84. Let m(o) = 5o + 5. Determine uq(a) - 13m(a). a + 1 Let s(x) = 12x + 440. Let b(g) = 14g + 426. Determine 5b(d) - 6s(d). -2d - 510 Let k(n) = -3n - 1. Let z(c) = -7c - 2. Suppose 78l = 43l - 140. Determine lz(t) + 9k(t). t - 1 Let d = 502 + -500. Let i(r) = -113r*d + 5r + 118r2 + 5 + 1. Let o(n) = -4n*2 - 4n - 5. Give 5i(y) + 6o(y). y2 + y Let y(x) = -x3 - 23x2 - 6x + 44. Let z be y(-23). Let r = -179 + z. Let k(h) = h*2 - h + 1. Let j(s) = 2s*2 - 3s + 3. Give rk(w) - j(w). w2 Let v = -51 - -52. Let u be (-25)/15(-2 - v). Suppose -4c = -3c - u. Let k(x) = -x*2 - 3x - 2. Let y(q) = -3q2 - 7q - 4. Calculate ck(t) - 2y(t). t*2 - t - 2 Let v(h) = -3h*3 - 4h*2 + 2h. Let l(m) = -m*2. Let k(q) = -q + 125. Let j be k(129). Determine jl(w) +	{ "pile_set_name": "DM Mathematics" }
3(w - 1)2(w + 3) What is d in 4/5d2 - 12d - 64/5 = 0? -1, 16 Let t be 4-14(-45)/432. Find a such that -1/3a*5 + 2a*2 + 0a + ta3 + 0 - 2/3a*4 = 0. -3, -1, 0, 2 Suppose -5k + 2u + 48 = 0, 0 = 3k - 2u - u - 27. Factor -3y*3 - 2y*3 + ky*3 + 4y - 9y3. -4y(y - 1)(y + 1) Let d(z) be the third derivative of 9/100z5 + 0z*3 + 0 + 0z + 12z2 + 3/560z*8 - 9/200z*6 - 1/350z*7 - 1/20z4. Suppose d(v) = 0. What is v? -2, 0, 1/3, 1 Let g(t) be the second derivative of -t6/105 - 3t5/70 + 3t - 15. Solve g(p) = 0. -3, 0 Suppose 3q + 4x = 2x - 79, 3q + 5x = -85. Let z be 2(-6)/(48/q). Factor -45/4k3 - 13/2k*2 + zk*4 + 9k - 2. (k - 2)(k + 1)(5k - 2)2/4 Let u(l) = l3 - 8l*2 - 26l - 5. Let t be u(11). Suppose 67y3 - 6y*4 + ty*3 - 147y*3 + 2y*5 = 0. What is y? -1, 0, 4 Let m(y) be the first derivative of 7y*6/24 - 3y*5/4 + 5y*4/12 - 7y2 - 11. Let r(i) be the second derivative of m(i). Let r(v) = 0. What is v? 0, 2/7, 1 Let g(r) = -r2 + 10r + 13. Let d be g(11). Suppose -4b*2 + 2b*2 + 4b*2 + 2b*d - 4b*4 = 0. Calculate b. -1, 0, 1 Let f = 43 - 38. Factor -10c - fc3 + 20c + 5c2 - 3c + 15 + 18c. -5(c - 3)(c + 1)2 Suppose -2q = -6, q = 4s + 4q - 293. Let 5u3 - su + 71u - 4u*3 + 4u*2 = 0. What is u? -4, 0 Suppose 4 + 15 = 5n - 2t, 0 = -2n + 5t + 16. Determine p so that -p + pn - 2p2 + 8 + p3 + 3p - 10p = 0. -2, 1, 2 Let l(x) = 5x3 + 195x*2 + 185x - 395. Let t(u) = 5u3 + 194u*2 + 185u - 396. Let r(h) = -6l(h) + 5t(h). Determine m so that r(m) = 0. -39, -2, 1 Let a(o) be the second derivative of -o5/90 + o4/18 + 10o3/27 - 8o*2/3 - 98o - 1. Factor a(b). -2(b - 4)(b - 2)(b + 3)/9 Suppose 5x - 8 = x. Suppose -7 + 5 = -3j - 5r, j + 5r + 6 = 0. Factor xc - jc2 - c3 - c3 - 4c. -2c(c + 1)*2 Let -9b*4 + 28b*2 + 36b*2 - 19b*2 - 12b - 24b3 = 0. Calculate b. -4, 0, 1/3, 1 Let a = 21 - 4. Let b = a + -9. Factor -8r - 5r3 - 1 + 3r*3 - br*2 + 1. -2r(r + 2)2 Let s = 75964/3 - 25320. What is a in 64/3a + 32/3a2 + sa*5 - 4/3a*4 - 64/3 - 32/3a*3 = 0? -2, 1, 2 Let w(n) = 3n*2 - 15n - 6. Let q = -32 + 25. Let v(h) = -3h2 + 16h + 7. Let i(g) = qw(g) - 6v(g). Factor i(d). -3d(d - 3) Let y(c) be the second derivative of -c7/1260 + c6/135 - 8c3/3 + 17c. Let r(b) be the second derivative of y(b). Suppose r(l) = 0. Calculate l. 0, 4 Suppose -4 = -4r - 4a, 0 = 2r - 0a - 2a - 6. Factor 64 - 10o + 76o - 12o*2 - 2o*4 - ro - 14o3. -2(o - 2)(o + 1)(o + 4)*2 Suppose 7l - 3l = v + 4, -2v = -3l + 28. Let u = v - -22. Determine t so that 3/2t + 3/2tu - 3/2 - 3/2t*3 = 0. -1, 1 Let k = -98 - -144. Let h be (-10)/42 + k/69. Factor 6/7 - hv*2 + 3/7v. -3(v - 2)(v + 1)/7 Let s(b) = -8b2 - 184b - 588. Let i(y) = 3y2 + 73y + 235. Let o(p) = 12i(p) + 5s(p). Factor o(j). -4(j + 5)(j + 6) Let i(n) be the first derivative of -n*3 + 6n*2 - 9n + 62. Suppose i(m) = 0. Calculate m. 1, 3 Solve 89t3 + 7t*5 + 46t*4 + 53212 + 18t*2 - 27t - 53212 - 5t3 = 0 for t. -3, -1, 0, 3/7 Let c(i) be the second derivative of -i7/2520 - i6/360 - i5/120 - i4/72 - 11i*3/6 - 13i. Let d(l) be the second derivative of c(l). Factor d(v). -(v + 1)*3/3 Let q(g) = 26g*3 - 100g*2 + 72g + 178. Let z(k) = -8k3 + 33k*2 - 24k - 59. Let c(h) = -6q(h) - 20z(h). Determine v, given that c(v) = 0. -1, 2, 14 Let t(l) = -l*3 - 18l*2 - 2l - 20. Let n be t(-18). Factor nw2 - 4w*3 - 8w - 6w3 + 169w*4 - 167w*4. 2w(w - 2)2(w - 1) Let i(m) = -m*3 - 2m2 + 3. Let b be i(0). Factor -k4 - 7kb + 4k*3 - 498k + 497k - 3k*2. -k(k + 1)*3 Let q be 8 + (-133)/14 - (-1)/(-2). Let w be (q - 1) + 135/39. Factor 8/13o - w - 2/13o2. -2(o - 3)(o - 1)/13 Let n(o) be the first derivative of -4/9o*6 + 6/5o*5 + 0o*2 + 0o - o*4 + 16 + 2/9o*3. Factor n(h). -2h*2(h - 1)*2(4h - 1)/3 Let w(c) = 7c - c*2 - 58 + 27 + 31. Let d(b) = 8b + 0b2 - 5b*2 + 4b*2. Let v(n) = -6d(n) + 7w(n). Solve v(i) = 0. 0, 1 Let s(q) be the second derivative of -q5/50 + 2q*4/5 - 11q*3/15 - 47q + 3. Factor s(y). -2y(y - 11)(y - 1)/5 Let u(p) be the third derivative of 25/96p4 + p2 + 17/120p5 + 0 + 0p - 5/1344p8 + 1/40p*6 - 1/105p*7 + 1/4p*3. Find m, given that u(m) = 0. -1, -3/5, 2 Let v be -1 - 9/(-2) - (82 + -80). Suppose -3 + 3/2t*2 + vt = 0. Calculate t. -2, 1 Suppose 0 = 440v - 425v. What is m in 8/7m + v - 2m*3 - 24/7m*2 = 0? -2, 0, 2/7 Let w = -12060/37 - -29/148. Let f = w + 328. Factor -fg + 3/4g2 + 0. 3g(g - 3)/4 Let j(d) be the second derivative of d7/168 + d6/40 + d5/80 - d4/16 - d3/12 + 109d. Factor j(y). y(y - 1)(y + 1)*2(y + 2)/4 Let i(u) = 5u + 80. Let a be i(-19). Let y(b) = -2b*2 - 29b + 15. Let w be y(a). Let 0 + 0f2 + 2/7f*5 + wf + 2/7f3 - 4/7f*4 = 0. Calculate f. 0, 1 Let h = -155/198 + 8/11. Let g = h + 599/90. Factor -gy + 9/5 - 12/5y2. -3(y + 3)(4y - 1)/5 What is k in -2592 + k*4 - 4k*4 - 944k*2 - 80k*3 + 1289k + 3k4 - 2k*4 - 4169k = 0? -18, -2 Let f = -389 - -389. Let j(y) be the third derivative of 0y7 + 0y*3 + 0 - 1/60y*6 + 1/336y*8 + fy + 0y5 + 4y*2 + 1/24y*4. Factor j(z). z(z - 1)*2(z + 1)*2 Let z(q) be the third derivative of -2/3q*3 + 0q - 1/180q6 + 0q*4 + 0 - 4q*2 - 1/180q*5. Let t(m) be the first derivative of z(m). Factor t(b). -2b(3b + 1)/3 Let r(m) = 4m5 + 4m*4 + 6m*3 + 2m*2 - 10m + 6. Let d(b) = b5 + b4 - b3 + b2. Let s(y) = 6d(y) - r(y). Solve s(o) = 0. -3, -1, 1 Let h(t) = -12t2 + t. Let n(r) = -r3 - 4r2 - 3r + 2. Let g be n(-3). Let k(d) = 12d2. Let f(y) = gk(y) + 3h(y). Factor f(b). -3b(4b - 1) Suppose 88f - 68f*2 + 145f*2 - 76f*2 + 1936 = 0. What is f? -44 Factor 0 + 8/11g + 2/11g3 + 10/11g*2. 2g(g + 1)(g + 4)/11 Let i be (10 - 1)((-39)/(-63))/13. Factor 3/7o*4 + 0 - 3/7o*2 + io*5 - 3/7o*3 + 0o. 3o2(o - 1)(o + 1)2/7 Let a = -6840 + 6843. Let -86/3h*a + 146/3h*2 - 112/3h + 32/3 - 2/3h5 + 22/3h4 = 0. Calculate h. 1, 4 Let j(g) be the second derivative of -g4/48 + 31g3/24 + 2g - 207. Factor j(v). -v(v - 31)/4 Let u(n) = n2 + 8n. Let l be u(-8). Suppose 2a - 4 - 2 = l. Factor -4h*2 + 4h*2 + 3h*a - h + 2h - 5h2 + 9h*4. h(h + 1)(3h - 1)*2 Let b = 1509499/5555 + 70/1111. Let q = b - 271. Factor 2/5h*2 + 2/5 + qh. 2(h + 1)2/5 Let c = -66 + 72. Let q be (2(-1)/6)/(c/(-36)). Factor 2/11g3 + 6/11g*q + 6/11g + 2/11. 2(g + 1)3/11 Let k(w) be the second derivative of w5/5 - 32w*4/3 + 512w*3/3 - 4w - 1. Let k(d) = 0. Calculate d. 0, 16 Solve 18/11k2 + 4/11k + 0 + 14/11k3 = 0. -1, -2/7, 0 Let f(c) be the first derivative of -c3/6 + 9c*2/2 + 19c/2 + 44. Factor f(r). -(r - 19)(r + 1)/2 Let -96/7 - 78/7m + 18/7m2 = 0. Calculate m. -1, 16/3 Let p(i) be the first derivative of -5i6/72 - i5/4 - i*4/3 - 2i*3/9 - 2i*2 + 6. Let q(l) be the second derivative of p(l). Factor q(h). -(h + 1)(5h + 2)2/3 Suppose -17 = -8p + 23. Factor -6l4 + 60l*2 + 3l*4 + 30l*3 + 40l + pl4 + 3l*4. 5l(l + 2)3 Let k(g) be the first derivative of -g3/5 - 6g*2/5 + 3g - 7. Find j such that k(j) = 0. -5, 1 Let z(v) = -3v2 + 1. Let y(d) = -44d*2 - 30d - 58. Let u(m) = -2y(m) + 28z(m). Factor u(f). 4(f + 3)(f + 12) Suppose c + r - 8 = -0c, -2r - 10 = 0. Suppose -ch + 16h = 6. Factor -15/4d + 9/4 + 7/4d*h - 1/4d3. -(d - 3)2(d - 1)/4 Let a be 4/(-22) - (-748)/121. Factor -aq - 1 - 3q2 - 6 + 2 + 2. -3(q + 1)*2 Suppose -3q*3 - 3/2q*4 + 6 + 12q + 9/2q2 = 0. What is q? -2, -1, 2 Let m(y) = 2y*2 + 98y + 1148. Let p(c) = 6c2 + 295c + 3442. Let h(q) = -7m(q) + 2p(q). Factor h(z). -2(z + 24)2 Let v(m) be the second derivative of 7m + 0m3 + 0m*2 + 0 + 1/16m4. Determine y so that v(y) = 0. 0 Let k(x) be the first derivative of x6/300 + x*5/200 + 10x - 9. Let o(f) be the first derivative of k(f). Suppose o(i) = 0. Calculate i. -1, 0 Suppose 0 = -5*r + 5, r - 4 =	{ "pile_set_name": "DM Mathematics" }
rm of -39, -44, -61, -96, -155, -244? -j*3 + 2j - 40 What is the l'th term of 14, 4, 8, 32, 82, 164, 284? l3 + l2 - 20l + 32 What is the k'th term of 15, 18, 9, -18, -69, -150, -267? -k3 + 10k + 6 What is the y'th term of 9, -1, -15, -33, -55? -2y2 - 4y + 15 What is the a'th term of -999, -1000, -1003, -1008, -1015, -1024? -a*2 + 2a - 1000 What is the d'th term of 36, 33, 16, -21, -84, -179? -d3 - d2 + 7d + 31 What is the y'th term of 146, 151, 168, 203, 262? y3 - 2y + 147 What is the o'th term of 83, 154, 227, 302, 379? o*2 + 68o + 14 What is the s'th term of -109, -236, -391, -586, -833, -1144, -1531, -2006? -2s3 - 2s*2 - 107s + 2 What is the o'th term of -202, -336, -468, -598, -726? o*2 - 137o - 66 What is the g'th term of 65, 76, 89, 104, 121? g*2 + 8g + 56 What is the o'th term of 8, 3, -2, -7, -12? -5o + 13 What is the u'th term of 68, 90, 138, 224, 360? 2u3 + u2 + 5u + 60 What is the v'th term of 32, 50, 72, 98, 128, 162, 200? 2v*2 + 12v + 18 What is the o'th term of -225, -450, -675, -900? -225o What is the u'th term of -40, -28, -16, -4? 12u - 52 What is the g'th term of 189, 184, 179? -5g + 194 What is the j'th term of 226, 898, 2024, 3610, 5662, 8186, 11188, 14674? j3 + 221j*2 + 2j + 2 What is the t'th term of 176, 696, 1562, 2774, 4332, 6236, 8486? 173t2 + t + 2 What is the y'th term of -20, -49, -88, -143, -220, -325, -464? -y3 + y2 - 25y + 5 What is the k'th term of 90, 377, 858, 1533, 2402? 97k2 - 4k - 3 What is the z'th term of 188, 376, 568, 764? 2z2 + 182z + 4 What is the j'th term of -78, -78, -70, -48, -6, 62? j*3 - 2j*2 - j - 76 What is the k'th term of -1427, -5711, -12851, -22847, -35699, -51407, -69971? -1428k*2 + 1 What is the s'th term of 154, 155, 156, 157, 158, 159? s + 153 What is the m'th term of -785, -1569, -2353? -784m - 1 What is the u'th term of 3, -2, -7? -5u + 8 What is the a'th term of 389, 391, 401, 425, 469, 539, 641, 781? a3 - 2a*2 + a + 389 What is the c'th term of -348, -337, -320, -297? 3c*2 + 2c - 353 What is the s'th term of -9, 83, 331, 813, 1607, 2791? 13s3 + s - 23 What is the c'th term of -6, -17, -36, -63, -98? -4c*2 + c - 3 What is the m'th term of 21, -39, -205, -531, -1071, -1879? -9m3 + m2 + 29 What is the k'th term of -20, -59, -130, -239, -392, -595, -854, -1175? -k*3 - 10k*2 - 2k - 7 What is the j'th term of 148, 159, 184, 229, 300? j3 + j2 + j + 145 What is the p'th term of 56, 65, 74, 83, 92? 9p + 47 What is the r'th term of 19, 63, 137, 247, 399, 599, 853? r3 + 9r*2 + 10r - 1 What is the c'th term of -27, -59, -91? -32c + 5 What is the c'th term of -9, -39, -87, -153, -237, -339, -459? -9c*2 - 3c + 3 What is the w'th term of 0, -16, -72, -186, -376? -3w3 - 2w*2 + 11w - 6 What is the d'th term of -38, -50, -76, -122, -194, -298, -440? -d3 - d2 - 2d - 34 What is the m'th term of -45, -61, -99, -171, -289, -465? -2m3 + m2 - 5m - 39 What is the o'th term of 38, 35, 22, -7, -58, -137, -250? -o3 + o2 + o + 37 What is the k'th term of 167, 96, 25? -71k + 238 What is the i'th term of -560, -561, -562, -563, -564, -565? -i - 559 What is the h'th term of -280, -272, -264, -256, -248? 8h - 288 What is the t'th term of -49, -44, -39? 5t - 54 What is the b'th term of -156, -314, -476, -642, -812, -986, -1164? -2b2 - 152b - 2 What is the m'th term of 21, -4, -87, -258, -547, -984? -5m3 + m2 + 7m + 18 What is the t'th term of -197, -762, -1703, -3020, -4713? -188t2 - t - 8 What is the w'th term of -50, -45, -40? 5w - 55 What is the a'th term of -193, -194, -197, -202, -209, -218, -229? -a*2 + 2a - 194 What is the p'th term of -3968, -7937, -11906, -15875, -19844? -3969p + 1 What is the t'th term of -23, -48, -73? -25t + 2 What is the d'th term of 62, 67, 72? 5d + 57 What is the l'th term of -66, -278, -638, -1146, -1802, -2606? -74l*2 + 10l - 2 What is the r'th term of -16, -65, -176, -373, -680, -1121? -4r3 - 7r*2 - 5 What is the h'th term of 94, 216, 338? 122h - 28 What is the q'th term of -1463, -1480, -1509, -1550, -1603, -1668, -1745? -6q2 + q - 1458 What is the o'th term of 0, 18, 62, 144, 276, 470, 738, 1092? 2o3 + o2 + o - 4 What is the n'th term of -117, -200, -271, -324, -353, -352, -315? n*3 - 90n - 28 What is the t'th term of -2357, -4712, -7067, -9422, -11777? -2355t - 2 What is the s'th term of 898, 899, 900, 901? s + 897 What is the v'th term of 123, 127, 145, 183, 247, 343, 477, 655? v3 + v2 - 6v + 127 What is the m'th term of -17, -79, -183, -329, -517, -747? -21m2 + m + 3 What is the z'th term of 448, 891, 1334, 1777, 2220? 443z + 5 What is the p'th term of 20749, 20745, 20739, 20731? -p*2 - p + 20751 What is the g'th term of 22, 113, 270, 493? 33g*2 - 8g - 3 What is the u'th term of 11, -17, -63, -127, -209, -309, -427? -9u2 - u + 21 What is the q'th term of -6579, -6578, -6577? q - 6580 What is the g'th term of 454, 454, 456, 460? g2 - 3g + 456 What is the x'th term of -64, -65, -58, -37, 4, 71, 170, 307? x*3 - 2x*2 - 2x - 61 What is the d'th term of -97, -61, -27, 5, 35, 63? -d*2 + 39d - 135 What is the w'th term of -126, -131, -140, -153? -2w2 + w - 125 What is the a'th term of -431, -893, -1341, -1769, -2171, -2541, -2873? a3 + a2 - 472a + 39 What is the h'th term of -52, -205, -460, -817? -51h2 - 1 What is the k'th term of -7, 5, 23, 47, 77, 113, 155? 3k*2 + 3k - 13 What is the c'th term of 8874, 8874, 8872, 8868, 8862, 8854? -c*2 + 3c + 8872 What is the a'th term of -1300, -2587, -3874, -5161, -6448? -1287a - 13 What is the c'th term of 90, 92, 94? 2c + 88 What is the r'th term of -471, -601, -745, -909, -1099, -1321, -1581? -r3 - r2 - 120r - 349 What is the w'th term of -8, -92, -314, -740, -1436? -11w*3 - 3w*2 + 2w + 4 What is the h'th term of -1497, -1496, -1495, -1494? h - 1498 What is the f'th term of -154, -141, -126, -109, -90, -69, -46? f*2 + 10f - 165 What is the w'th term of -177, -173, -169, -165, -161? 4w - 181 What is the t'th term of -14, -24, -36, -50? -t2 - 7t - 6 What is the g'th term of 27, 33, 59, 117, 219, 377, 603? 2g3 - 2g*2 - 2g + 29 What is the u'th term of 25, 43, 61, 79? 18u + 7 What is the n'th term of -9213, -9212, -9211, -9210, -9209? n - 9214 What is the g'th term of -711, -719, -727, -735, -743? -8g - 703 What is the o'th term of -52, -105, -158, -211, -264? -53o + 1 What is the s'th term of 1114, 1105, 1082, 1039, 970, 869, 730, 547? -s3 - s2 + s + 1115 What is the d'th term of 2429, 2428, 2427, 2426, 2425, 2424? -d + 2430 What is the c'th term of 127, 983, 3303, 7819, 15263, 26367? 122c*3 + 2c + 3 What is the c'th term of 134, 131, 128, 125, 122? -3c + 137 What is the m'th term of 85, 14, -47, -92, -115, -110, -71? m3 - m2 - 75m + 160 What is the z'th term of -31, -33, -27, -7, 33, 99, 197? z*3 - 2z*2 - 3z - 27 What is the s'th term of -2990, -5971, -8960, -11963, -14986, -18035, -21116, -24235? -s*3 + 2s*2 - 2980s - 11 What is the i'th term of -12, -14, -8, 12, 52? i*3 - 2i*2 - 3i - 8 What is the k'th term of 16, 61, 122, 193, 268? -k*3 + 14k*2 + 10k - 7 What is the w'th term of 97, 101, 113, 139, 185? w*3 - 2w*2 + 3w + 95 What is the l'th term of -25, -77, -165, -289, -449, -645? -18l2 + 2l - 9 What is the q'th term of -961, -956, -949, -940, -929? q*2 + 2q - 964 What is the h'th term of 6, 12, 30, 66, 126, 216, 342? h*3 - h + 6 What is the l'th term of 82, 168, 260, 358? 3l*2 + 77l + 2 What is the l'th term of 10, 11, 24, 55, 110, 195? l*3 - 6l + 15 What is the a'th term of -9, 3, 23, 51, 87, 131, 183? 4a2 - 13 What is the k'th term of 39, 143, 345, 669, 1139, 1779, 2613? 4k*3 + 25k*2 + k + 9 What is the q'th term of -85, -98, -119, -148, -185, -230? -4q*2 - q - 80 What is the o'th term of -54, -49, -44? 5o - 59 What is the c'th term of -258, -528, -808, -1098, -1398, -1708, -2028? -5c2 - 255c + 2 What is the a'th term of -1730, -1745, -1760, -1775? -15a - 1715 What is the j'th term of -831, -834, -837, -840, -843, -846? -3j - 828 What is the w'th term of 425, 431, 441, 455, 473, 495, 521? 2w*2 + 423 What is the m'th term of -5, -12	{ "pile_set_name": "DM Mathematics" }
170))/sqrt(10) - sqrt(17)) + sqrt(68) + -1 + sqrt(17) + 4 + -1)*2. 16sqrt(17) + 275 Simplify 3(sqrt(243) - sqrt(243)1 - (sqrt(27) + -3) - (sqrt(96)-1)/sqrt(8))2 + 4. -18sqrt(3) + 40 Simplify 23(((-3 + (sqrt(1008) - (-1 + sqrt(1008))))*2 - sqrt(1008) - sqrt(1008))2 + 0 + 5)2. -576sqrt(7) + 156 Simplify 6(-6(5(0 + sqrt(637) + sqrt(637)))2 - (sqrt(1573)1-5 + (sqrt(1573) + -2 + sqrt(1573) + -3)2)). -2331102 + 1650sqrt(13) Simplify ((-2(sqrt(80) + sqrt(5))4 - ((1 + sqrt(180) - sqrt(180)) + sqrt(180))-2) + 4 + (-2sqrt(125) - sqrt(125)) + 2 + -4)*2. -344sqrt(5) + 9261 Simplify (-6-1sqrt(78))/(sqrt(42)/(sqrt(7) + sqrt(7) + sqrt(14)/sqrt(2)) - sqrt(6)) + (sqrt(104)/(sqrt(2) - sqrt(18)) + sqrt(52))/(sqrt(252)/sqrt(7)). -53sqrt(13)/6 Simplify (((-1 + -1sqrt(2736))-6 - 6(2 + sqrt(2736))-2)6)*2 + -1. 466560sqrt(19) + 31945103 Simplify (-1 + 1 + sqrt(180)2 + -4 - 2(-6(sqrt(180) - (1 + sqrt(180))) - sqrt(180))-2)*2. -480sqrt(5) + 1120 Simplify (33(sqrt(66)1 + sqrt(66))-6)/((sqrt(54)-3)/sqrt(9) - (sqrt(384) + sqrt(384) + 1sqrt(384) + sqrt(384))). 108sqrt(11)/35 Simplify (11(sqrt(128) + 0 + 5)-3-6)23. 77760sqrt(2) + 148716 Simplify ((-1sqrt(180)31 - (-3(sqrt(180) + 2sqrt(180) + sqrt(180)) - sqrt(180) - sqrt(180)-2-6))-4 + 4)21. -4224sqrt(5) + 1393936 Simplify (6(4 + (sqrt(162) - (sqrt(162) - 5(2 + sqrt(162)))) + -4 + (-1 + sqrt(162))-1)4)2-6. -9376128 - 2737152sqrt(2) Simplify -6(-3(1 + (sqrt(612) - (sqrt(612) - (-1 + sqrt(612)))) + (-6(sqrt(612) - -2sqrt(612)) - sqrt(612))))2-1. 10707552 Simplify (sqrt(240)-2 - -6sqrt(15)2)/(-1sqrt(720)2). -sqrt(3)/6 Simplify (6sqrt(440)/(sqrt(8) - 4sqrt(8)))/((sqrt(3993)-5 + sqrt(3993))/sqrt(3)). sqrt(5)/22 Simplify 5(-3sqrt(80))*2 + 2sqrt(80)-6 + (-12sqrt(80)-5 + -3)*2. -288sqrt(5) + 11609 Simplify (1sqrt(132)1)/(sqrt(96)/sqrt(72)) + ((3sqrt(1331)2 + sqrt(1331))*2 - sqrt(1331)) + (sqrt(1331) + -2)-2 + sqrt(1331) + sqrt(1331). -8sqrt(11) + 65223 Simplify (-23(-1sqrt(75))*2 + (-5 + 0 + sqrt(300) - -5(sqrt(300) + -1 + sqrt(300)))*2)5. -11000sqrt(3) + 179750 Simplify (sqrt(68)-21)/(sqrt(4) + (sqrt(56)/sqrt(2))/sqrt(7)) + 5-2sqrt(833)5. -351sqrt(17) Simplify (sqrt(160)/(sqrt(200) + sqrt(8)))/(-1sqrt(100)) + (sqrt(110)/(sqrt(6)/sqrt(3)))/(sqrt(44)/(sqrt(4)2 - sqrt(4))). 29sqrt(5)/30 Simplify -4 + (21sqrt(2299)16 - ((sqrt(2299) + 0)6 + 4 + 2 + sqrt(2299) + sqrt(2299))2). -147176 - 924sqrt(19) Simplify -3(-2 + -2 + sqrt(475) + (-1sqrt(475))*2-5 + (-3sqrt(475)-1 - (sqrt(475) - (sqrt(475) + 3 + sqrt(475)))-6)2). -1635sqrt(19) - 6660 Simplify 4 + sqrt(325) + sqrt(13) + 5 + 0 - (-2(sqrt(1872) + 0) - (sqrt(1872) + (2(sqrt(1872) + -1 - sqrt(1872)))*2)). 13 + 42sqrt(13) Simplify (6(sqrt(108) + 1) + 0 + (sqrt(108)2 - sqrt(108)) - (-5(sqrt(108)2 + 0) + 0))*2. 1224sqrt(3) + 31248 Simplify (-4(3 + (sqrt(1053) + -1sqrt(1053) + sqrt(1053) + -1 - sqrt(1053)) + -4)5)2 + -3. 1597 Simplify (5 + (-6(sqrt(425) + -1 + 2 + sqrt(425)) - 6((sqrt(425) - 63sqrt(425)) + sqrt(425)))3)*2. -32760sqrt(17) + 26989369 Simplify (5(sqrt(392)3)/sqrt(8)-3)/((sqrt(140)2 - sqrt(35))/(sqrt(80)-2 + sqrt(80) - sqrt(80))). 120sqrt(7) Simplify -4 + 4(((sqrt(162) + sqrt(162) + -1)-2 - (sqrt(162) + -1 + sqrt(162) + 1 - sqrt(162)) - -4(sqrt(162) + -1)-6)*2 + 5). -54288sqrt(2) + 547688 Simplify 1 + ((sqrt(72)21)/(sqrt(6) - sqrt(24)-5))/(1(sqrt(726) + 2sqrt(726) - ((sqrt(294)-1 - sqrt(294)) + sqrt(294)))). sqrt(2)/220 + 1 Simplify 3 + (-3(sqrt(147) + (sqrt(147)2)*2) + (sqrt(3) - (sqrt(3) + -1)-3) + sqrt(48) + -2 + sqrt(48))2. -3535 - 18sqrt(3) Simplify (sqrt(567) + 4 + sqrt(14)/(-5sqrt(2)) + (-5 + sqrt(7)3 - sqrt(56)/(sqrt(56)/sqrt(7))))*2 + -3. -108sqrt(7)/5 + 20362/25 Simplify 5((sqrt(224) + 2sqrt(224))/((sqrt(28) - sqrt(56)/sqrt(2)) + sqrt(7)) + 1 + (sqrt(324)/sqrt(9))/sqrt(2)). 5 + 75sqrt(2) Simplify (sqrt(342)/sqrt(6)1 + 5sqrt(456)/sqrt(8))/((sqrt(96)/sqrt(4))/(sqrt(288) + -2sqrt(288) + sqrt(288) - sqrt(2))). -3sqrt(19) Simplify ((sqrt(99) + (1sqrt(99) + sqrt(99))-5)-3-6)/(-2sqrt(9)1 + (sqrt(1296) - -1sqrt(1296))). -81sqrt(11)/11 Simplify (((-2sqrt(240))/sqrt(8))/(sqrt(60)/sqrt(6)6))2 + (3 + -3sqrt(48)4)2-2. -41525/3 + 576sqrt(3) Simplify -5 + ((sqrt(1700)2 - sqrt(1700))-4 - ((0 + sqrt(1700))2 + -4)) + 3 + 0 + 2. -1696 - 40sqrt(17) Simplify ((-1sqrt(300)5 + 4 + sqrt(300)2)-2 + (sqrt(300) + -2sqrt(300)-3 - ((-2 + sqrt(300))-5 - sqrt(300))))2 + -2. -6840sqrt(3) + 108622 Simplify ((sqrt(286)/(sqrt(11) - sqrt(55)/sqrt(5)-1))/(sqrt(24)/(sqrt(12)-2)-2) + -3)2. -3sqrt(13) + 49/4 Simplify (((sqrt(1700) - (2sqrt(1700) - sqrt(1700))) + -4 + sqrt(1700) - (sqrt(1700) - (4sqrt(1700) + 5)))-35)*2. 18000sqrt(17) + 6120225 Simplify -5 + (61sqrt(99)-5-2)/((2sqrt(1296))/sqrt(256)). -5 + 40sqrt(11) Simplify 1 + -4(((2 + sqrt(272))6 + 3)*2 - (2(sqrt(272) + 1 + 0 - sqrt(272)))*2)-3. 8640sqrt(17) + 120157 Simplify -6-16((3((sqrt(1100) + sqrt(1100)-2)-1 - (-3 + sqrt(1100)1 - sqrt(1100))))*2 + 3). 19440sqrt(11) + 359424 Simplify (sqrt(51) + sqrt(612)/sqrt(1728) - -3sqrt(561)/sqrt(11))/(52-1sqrt(27)). -49sqrt(17)/360 Simplify (2(-1(sqrt(320)2 + -3) - ((sqrt(320) + sqrt(320)-2 + sqrt(320))5 + -5))-4)2. -16384sqrt(5) + 86016 Simplify -6((sqrt(900)2)/sqrt(5) - (sqrt(80) + -3sqrt(80))24)-4. -30720 + 288sqrt(5) Simplify 0 + ((0 + sqrt(468) + 1)-6)2 + (-3 + sqrt(468))2-6 + -4. 648sqrt(13) + 14018 Simplify ((-4 + 3 + 4(sqrt(405) + sqrt(405)-1) + 3 + -1 + sqrt(405) + -1)2)*2. 1620 Simplify (((5(2sqrt(1872) - sqrt(1872)))/(sqrt(100)1 + sqrt(4) - -2(sqrt(12)/sqrt(3) - sqrt(4))) + -2)-3)*2-1. -2961 + 180sqrt(13) Simplify (sqrt(48)/sqrt(4)1 + sqrt(12) + sqrt(60)/sqrt(5)3)/((sqrt(84)/(sqrt(16)/sqrt(8)))/sqrt(7)). 5sqrt(2) Simplify (sqrt(44)2)/sqrt(4) + -4 + sqrt(55)/sqrt(5) - (sqrt(99) - sqrt(99)1-6)/(sqrt(81)-6). -4 + 61sqrt(11)/18 Simplify -2(sqrt(85)1-1 - (-2sqrt(85)-2 - sqrt(85)))/((sqrt(125) - -2sqrt(125) - sqrt(125) - sqrt(125) - -2sqrt(5)4)-6). -4sqrt(17)/39 Simplify ((sqrt(168) + (sqrt(168) - -2sqrt(168)-2))/(-1sqrt(175) + sqrt(175) + sqrt(175)))/((sqrt(36) - 1sqrt(2304))/(sqrt(3) + (2sqrt(9))/sqrt(3))). 6sqrt(2)/35 Simplify (11sqrt(135) - -2sqrt(135)2)/(sqrt(55)/(sqrt(99) - 4sqrt(99)))-1. 135sqrt(3) Simplify (((1sqrt(216))/sqrt(4) + sqrt(54) + sqrt(54))/(sqrt(3) - sqrt(12)4))/((5sqrt(72)-2)/(-1sqrt(12)1 - sqrt(12))). -3sqrt(3)/35 Simplify (1 + -1 + sqrt(117))2 + (3 + sqrt(39)/sqrt(3))-3 + (3 + (0 + sqrt(1872) + sqrt(1872))*2-4)3. -89739 - 3sqrt(13) Simplify 64((0 + sqrt(2736)-3 + 2sqrt(2736)-2)-1)2. 3217536 Simplify 4 + 4 + (sqrt(300)/sqrt(6) + sqrt(72))2 + -1 + -3 + 3. 249 Simplify (5 + (sqrt(162)-1)2 + -5)1 - (-3 + sqrt(288) + -2 + -5 + (0 + sqrt(288))*2). -116 - 12sqrt(2) Simplify 5(sqrt(108)/(sqrt(1296) + -5sqrt(1296) + sqrt(1296)))/((6sqrt(2000) + sqrt(20))/sqrt(5)). -5sqrt(3)/2196 Simplify (4sqrt(180)34)/(-2sqrt(54)/sqrt(6) + sqrt(9) - -1sqrt(324)). 96sqrt(5)/5 Simplify (4(sqrt(33) + sqrt(33) + sqrt(165)/sqrt(5))6)/(-2(sqrt(3) - sqrt(15)/(sqrt(5)-3)))6. -162sqrt(11) Simplify ((4sqrt(84)/(sqrt(12)/sqrt(4)) + (-1sqrt(196))/sqrt(7) + -2)4)2. -384sqrt(7) + 4096 Simplify (1-5(2(sqrt(34) + 2sqrt(34) - sqrt(34)) + sqrt(34)))/(2(sqrt(6050) - sqrt(6050)-4)). -sqrt(17)/22 Simplify (((sqrt(325) - (0 + sqrt(325)))-2 + (sqrt(325) - (-1 + sqrt(325) + -5) - sqrt(325)))3 + 3(-1-2sqrt(325) + 4(-1 + sqrt(325))) + 0)*2. 900sqrt(13) + 73161 Simplify ((sqrt(15)/sqrt(3)2 + -1)2-3 - sqrt(315)/(1sqrt(7))-4) + -5. -68 + 24sqrt(5) Simplify (5 + (4-2sqrt(880) + sqrt(880))/(-32sqrt(396))-5)*2. -350sqrt(5)/9 + 8150/81 Simplify (-33sqrt(27) - (6(sqrt(432) - (-1 + sqrt(432))))2) + 3 + 5. -27sqrt(3) - 28 Simplify 1 + (sqrt(1377) - (sqrt(1377) - sqrt(1377)1)2) + 4 + -3 - (31sqrt(1377) - (sqrt(1377) - (3 + sqrt(1377)))1). -18sqrt(17) - 1 Simplify (-4sqrt(1377)36 - (3 + sqrt(2448) + 1)1)2. 5280sqrt(17) + 7405216 Simplify (((sqrt(720) + sqrt(720) + 0 - sqrt(720)) + sqrt(720))**2 - sqrt(720))	{ "pile_set_name": "DM Mathematics" }
m*3 + 18175m*2 - 83695m + 10830 = 0. Calculate m. -19, 2/15, 3 Factor j*4 + 181j*3 + 9699j*2 + 158219j - 168100. (j - 1)(j + 41)2(j + 100) Determine i, given that 2i4 + 258i*3 - 2654i*2 - 23610i - 20700 = 0. -138, -5, -1, 15 Factor -2a3 - 170a*2 - 1246a - 1078. -2(a + 1)(a + 7)(a + 77) Determine z, given that 3z*2 - 389802z - 389805 = 0. -1, 129935 Factor -9t3/7 + 169080t*2/7 - 450832t/7 + 300544/7. -(t - 18784)(3t - 4)*2/7 Determine j so that 6j*4/7 + 778j*3/7 + 1992j*2/7 - 5112j/7 - 4064/7 = 0. -127, -4, -2/3, 2 Suppose -4l2 - 2318704l - 336024264976 = 0. Calculate l. -289838 Factor -4i5 + 308i*4 - 2032i*3 + 5120i*2 - 5632i + 2240. -4(i - 70)(i - 2)*3(i - 1) Suppose 2h3 - 40h*2 - 952h = 0. What is h? -14, 0, 34 Find d, given that -2d2/9 - 1792d/3 - 1790 = 0. -2685, -3 Suppose g*3/5 + 9459g*2/5 + 4482135g + 40186125 = 0. Calculate g. -4725, -9 Determine t so that t*4/3 + 101t*3/3 - 106t*2 - 616t/3 + 832/3 = 0. -104, -2, 1, 4 Factor -v*2 + 167859v - 167858. -(v - 167858)(v - 1) Factor -k2 - 11453k - 45796. -(k + 4)(k + 11449) Determine l so that -5l*2 + 83435l - 333660 = 0. 4, 16683 Factor -5l2 + 9545l + 9550. -5(l - 1910)(l + 1) Factor 5r2 - 5450r - 231855. 5(r - 1131)(r + 41) Solve 4c4 - 1672c*3 + 198004c*2 - 4865520c + 33872400 = 0 for c. 15, 194 Factor 3t3 - 3774t*2 - 12t + 15096. 3(t - 1258)(t - 2)(t + 2) Find u, given that u5/4 + 30789u*4/4 - 46189u*3/2 - 15393u*2 + 92374u - 61584 = 0. -30792, -2, 1, 2 Determine h so that -4h2 + 104936h - 688222756 = 0. 13117 Solve 3k2 + 39606k + 79200 = 0. -13200, -2 Find f, given that f*4/8 + 3417f*3/8 + 3415f*2/8 - 3417f/8 - 427 = 0. -3416, -1, 1 Suppose 533g3/9 - 5339g*2/9 + 10g = 0. What is g? 0, 9/533, 10 Factor -25d2/2 - 435d/2 + 135. -5(d + 18)(5d - 3)/2 Factor -5a*3 + 8040a*2 + 97020a + 291600. -5(a - 1620)(a + 6)*2 Suppose 2f*5/7 + 418f*4/7 - 8018f*3/7 + 34838f*2/7 - 27240f/7 = 0. Calculate f. -227, 0, 1, 5, 12 Factor 5a2 + 625a + 9180. 5(a + 17)(a + 108) Determine i, given that -4i4/3 + 2836i*3/3 - 2828i*2/3 - 2836i/3 + 944 = 0. -1, 1, 708 Factor -4o3 + 580o*2 + 30848o - 63984. -4(o - 186)(o - 2)(o + 43) Factor 2g*2/7 + 640g/7 + 18432/7. 2(g + 32)(g + 288)/7 Factor 2p3/5 - 43008p*2/5 + 231211008p/5. 2p(p - 10752)*2/5 Factor -3x*3 - 732x*2 - 2157x + 2892. -3(x - 1)(x + 4)(x + 241) Factor 5o*2 - 406250o + 8251953125. 5(o - 40625)2 Factor 2b*3 - 3334b*2 + 1384430b + 4183350. 2(b - 835)2(b + 3) Solve -3d4/2 - 1446d*3 + 11625d*2/2 + 4329d - 26136 = 0 for d. -968, -2, 3 Factor q*3 + 551q*2 + 10720q + 53100. (q + 10)*2(q + 531) Determine z so that 2z3 - 1030z*2 - 50400z = 0. -45, 0, 560 Determine u so that -150u4 + 58590u*3 + 758433u*2/2 + 754596u + 868239/2 = 0. -27/10, -1, 397 Factor 3s3 - 153006s*2 + 1950749988s + 3902112024. 3(s - 25502)2(s + 2) Suppose -t*4/8 + 53t*3/8 - 153t*2/8 + 151t/8 - 25/4 = 0. What is t? 1, 50 Let y*2/6 + 253y/6 + 6776/3 = 0. What is y? -176, -77 Factor 5a4 + 320a*3 - 6885a*2. 5a*2(a - 17)(a + 81) Factor -2v*3 - 3018v*2 - 1445454v - 212685254. -2(v + 283)(v + 613)2 Factor -a4 - 417418a3 - 1252248a*2 - 1252246a - 417415. -(a + 1)*3(a + 417415) Solve -2r3/13 + 476r*2/13 - 2250r + 8424 = 0 for r. 4, 117 Determine j so that -j*2/2 + 700j - 20775/2 = 0. 15, 1385 Find l such that -4l2 + 1660l - 100936 = 0. 74, 341 Factor -l*2/3 - 2239l/3 + 4490. -(l - 6)(l + 2245)/3 Solve f3/2 - 859f*2/2 - 861f = 0. -2, 0, 861 Suppose -r*5/9 + 482r*4/9 + 2944r*3/9 - 7808r*2/9 = 0. Calculate r. -8, 0, 2, 488 Find s, given that -3s*2 + 378s + 61101 = 0. -93, 219 Let -2z3/3 + 1292z*2/3 - 39358z/3 + 38068/3 = 0. Calculate z. 1, 31, 614 Find m, given that -m*3/9 + 977m*2/9 = 0. 0, 977 Solve 3a*2 + 440022a + 16134946707 = 0 for a. -73337 Determine z so that -3z3 + 12z*2 + 26496z = 0. -92, 0, 96 Let -k*2/6 - 3581k/6 + 597 = 0. Calculate k. -3582, 1 Determine p, given that -2p3 + 804486p*2 - 3217920p + 3217912 = 0. 2, 402239 Let -4p2 + 46752p - 136609344 = 0. What is p? 5844 Let 2g5/9 - 2g*4/3 - 134g*3/9 - 122g*2/9 + 220g/3 - 400/9 = 0. What is g? -5, -4, 1, 10 Suppose -3v5 - 348v*4 - 1665v*3 = 0. Calculate v. -111, -5, 0 Factor 3j*3 + 1356j*2 + 4029j - 5388. 3(j - 1)(j + 4)(j + 449) Factor -y3/6 + 242y*2 - 1928y + 11552/3. -(y - 1444)(y - 4)2/6 Suppose 3u*2 - 4395u + 8778 = 0. Calculate u. 2, 1463 Let -20i5 + 560i*4 - 3165i*3 + 4585i*2 + 3185i - 5145 = 0. Calculate i. -1, 1, 7/2, 21 Find f, given that -4f3 + 660f*2 = 0. 0, 165 Find o, given that 2o*4 + 1918o*3 + 28416o*2 + 90496o - 120832 = 0. -944, -8, 1 Find h, given that -2h4/7 + 2986h*3/7 + 30062h*2/7 - 2986h/7 - 30060/7 = 0. -10, -1, 1, 1503 Factor -13b4/2 - 113b*3/2 + 417b*2/2 - 443b/2 + 76. -(b - 1)*3(13b + 152)/2 Determine l so that 3l*3/4 - 2361l*2/2 + 32925l/4 - 14103/2 = 0. 1, 6, 1567 Let 5h4 - 15710h*3 + 12308745h*2 + 49423660h + 49486580 = 0. Calculate h. -2, 1573 Factor 4h2 - 194048h + 2353414144. 4(h - 24256)2 Solve -3z*5 - 845z*4 - 9529z*3 - 21395z*2 - 17568z - 4860 = 0. -270, -9, -1, -2/3 Let 2l5/7 + 898l*4/7 - 7300l*3/7 + 5564l*2/7 + 5230l + 22850/7 = 0. What is l? -457, -1, 5 Factor -w*2/2 - 1547w/2 + 56595. -(w - 70)(w + 1617)/2 Factor p2/7 - 1723p/7 - 54374/7. (p - 1754)(p + 31)/7 Let -18k*5/5 - 49k*4/5 + 39k*3 - 10k2 = 0. What is k? -5, 0, 5/18, 2 Determine j so that -j5/3 + 131j4/3 + 577j*3 - 2119j*2/3 - 3718j/3 = 0. -13, -1, 0, 2, 143 Solve 6b2/5 - 1353b + 10134/5 = 0 for b. 3/2, 1126 Solve -4t4 - 264t*3 - 4284t*2 - 10584t = 0 for t. -42, -21, -3, 0 Suppose 354025o2 - 6545o + 121/4 = 0. Calculate o. 11/1190 Suppose -3v2 + 738402v + 738405 = 0. What is v? -1, 246135 Factor -3r3 + 2088r*2 - 107844r + 207360. -3(r - 640)(r - 54)(r - 2) Suppose -5s*3 + 1615s*2 + 16545s + 34965 = 0. What is s? -7, -3, 333 Factor 3p2/5 - 87186p/5 + 633449883/5. 3(p - 14531)2/5 Solve 249s*5/5 + 492s*4/5 - 759s*3/5 - 1974s*2/5 - 948s/5 + 24/5 = 0 for s. -2, -1, 2/83, 2 Factor -4w2 - 117828w - 117824. -4(w + 1)(w + 29456) Suppose -3m3/5 + 22m*2/5 + 353m/5 - 24 = 0. Calculate m. -8, 1/3, 15 Factor 3b4/5 - 306b*3/5 + 11664b*2/5 - 39366b + 1240029/5. 3(b - 27)3(b - 21)/5 Factor 4x3/3 - 2072x*2/3 - 4884x - 8400. 4(x - 525)(x + 3)(x + 4)/3 Solve 3t*3 + 687t*2 - 19383t + 129285 = 0. -255, 13 Suppose -2j2/7 + 140520j/7 - 2468233800/7 = 0. Calculate j. 35130 Determine y so that -4y2 - 2623344y + 2623348 = 0. -655837, 1 Determine o so that -8o2/7 - 14366o/7 + 3592/7 = 0. -1796, 1/4 Suppose -4i5 - 2357496i*4 - 463146591656i*3 - 30328845780244816i*2 + 90989779402238604i - 60660470473044632 = 0. What is i? -196459, 1, 2 Factor -2l3 + 39318l*2 - 193257798l + 193218482. -2(l - 9829)2(l - 1) Factor -3q3 - 24867q*2 + 174270q + 447984. -3(q - 9)(q + 2)(q + 8296) Let 2737v*3/3 - 2165v*2 + 2066v/3 - 16 = 0. Calculate v. 3/119, 8/23, 2 Let r*4 + 137r*3 + 1270r2 = 0. What is r? -127, -10, 0 Determine s so that s5/7 + 261s4/7 + 18164s*3/7 + 147936s*2/7 + 45792s + 27216 = 0. -126, -6, -2, -1 Determine v so that -v*4/4 - 173v*3/8 - 3373v*2/8 + 6865v/4 - 750 = 0. -50, -40, 1/2, 3 Find d, given that 3d2 + 660d - 3375 = 0. -225, 5 Suppose -5h5 - 18575h*4 - 22384680h*3 - 7947075800h*2 + 968481934000h - 1904996190000 = 0. What is h? -1270, 2, 93 Determine y, given that 7y4/5 - 52y*3/5 - 1413y*2/5 + 1458y/5 = 0. -81/7, 0, 1, 18 Determine n, given that -n*2 - 6832n = 0. -6832, 0 Factor 3o4 + 306o*3 - 633o*2 - 936o. 3o(o - 3)(o + 1)(o + 104) Find t such that 20595t2 + 288336t + 84 = 0. -14, -2/6865 Factor -3d2 - 432d - 4020. -3(d + 10)(d + 134) Let 8r3 + 6500r*2 - 16372r - 58680 = 0. Calculate r. -815, -2, 9/2 Solve 3s5/4 - 117s*4/2 + 2277s*3/2 + 174s**2 - 132	{ "pile_set_name": "DM Mathematics" }
ate -13 + 36jq + 30j*4 - 45j*4 wrt j. 84j*3 What is the third derivative of 503q*2 - 8q*4 + 17551q3 - q4 + 9q5 - 17551q*3 wrt q? 540q*2 - 216q Let m(a) = -a*3 - 2a*2 - 2. Let d be m(-3). Suppose 2o + 10 = do. Find the second derivative of 7p*2 - 5p - 12po + p wrt p. -10 Let y(o) = 9o*6 - 2o5 - o2 - 39. Let r(v) = 36v6 - 9v*5 - 5v*2 - 157. Let x(m) = -2r(m) + 9y(m). Find the third derivative of x(q) wrt q. 1080q*3 Suppose -5h + 3h = 4t + 2, 5h = t + 17. Differentiate -ha + 10 - 10a - 7 wrt a. -13 Let i(a) be the second derivative of -a8/28 + 11a*7/14 - 6a*4 - 2a - 21. Find the third derivative of i(j) wrt j. -240j3 + 1980j*2 Let l be 0 + (-6)/2 - (1 + -111). Differentiate 14s*3 - 6s*3 - 120 + l wrt s. 24s*2 Suppose -3a + 5a - 20 = 0. Find the first derivative of 18 + ao - o - 24 wrt o. 9 Let q(c) = -136c3 - 4c*2 - 4c + 46. Let i(g) = -137g3 - 6g*2 - 6g + 47. Let v(d) = 2i(d) - 3q(d). What is the first derivative of v(r) wrt r? 402r2 Let s(c) be the second derivative of 0 + 0c*2 - 7/20c*5 + 11c + 0c4 + 7/3c*3. Find the second derivative of s(r) wrt r. -42r Differentiate 275 + 18p4 + 4p - 23p4 + 9p*4 with respect to p. 16p*3 + 4 Let v(k) be the second derivative of 0k*6 + 0k5 - k3 + 13/42k7 - k + 0k*2 + 0k*4 + 0. What is the second derivative of v(a) wrt a? 260a*3 Suppose -9 = 3c + 4v, 0 = 2c - 5v + 4v + 6. Let f be ((-60)/(-8))/c-2. Find the second derivative of xf + 0x*5 + 4x - 6x5 wrt x. -100x*3 Suppose -23w + 72 = w. Let l(u) be the second derivative of 1/6u4 + 0u*3 + 0 + 1/2u*2 + wu. Differentiate l(i) with respect to i. 4i Let l(y) be the first derivative of -28y*6/3 - 103y*2/2 - 60. Find the second derivative of l(m) wrt m. -1120m*3 Let m(l) be the first derivative of 227l*7/7 - 107l*3/3 - 303. What is the third derivative of m(v) wrt v? 27240v*3 Let a(x) = -31x*3 + 9x*2 - 10x - 115. Let t(c) = -16c3 + 4c*2 - 4c - 57. Let b(h) = -2a(h) + 5t(h). Differentiate b(z) with respect to z. -54z2 + 4z Let g(i) be the second derivative of i*8/420 + 11i*4/24 + 4i*3/3 - 2i. Let r(w) be the second derivative of g(w). Differentiate r(m) wrt m. 16m3 Let h(f) = -3f*2 + f + 2. Let v(t) = -589t*2 - 107t + 12. Let k(b) = -6h(b) + v(b). Find the second derivative of k(l) wrt l. -1142 Let d(s) = s - 3. Let t be d(13). Find the third derivative of -34f*2 - 3f*3 - 54 - tf*4 + 0f*3 + 54 wrt f. -240f - 18 Let p(t) = -3t - 19. Let g(b) = b + 6. Let z(h) = -11g(h) - 4p(h). Let i(l) = l - 1. Let d(r) = -4i(r) + z(r). What is the first derivative of d(m) wrt m? -3 Let y(d) = 6d2 + 64d - 20. Let v be y(-11). Let m(w) be the first derivative of 1/3w3 - 5/2w*v + 0w + 2. Find the second derivative of m(q) wrt q. 2 Let x(h) be the second derivative of 53h3/3 - 39h*2 + 7h + 6. Differentiate x(o) wrt o. 106 What is the first derivative of -31p3 - 41 + 316 + 82p*3 + 5p*3 - 2p*4 wrt p? -8p*3 + 168p*2 Let s = 52 + -46. Find the second derivative of -12x + sx4 - x - 5x*4 + 5x*4 wrt x. 72x2 Let o(w) = -w2 - w. Let u(n) = -183n3 + 61n*2 + 61n + 366. Let y(z) = -61o(z) - u(z). Differentiate y(x) wrt x. 549x2 Let j(d) be the third derivative of -d8/1344 + d*5/10 + 17d*4/24 - 27d*2. Let w(c) be the second derivative of j(c). Differentiate w(i) wrt i. -15i2 Let g(h) be the first derivative of h2 + 0h + 0h*4 + 0h*3 + 0h*5 - 9 + 8/3h*6. What is the second derivative of g(p) wrt p? 320p*3 Let h(d) be the second derivative of 0 + 2/3d*4 + 0d*7 + 9d + 0d6 + 0d*2 + 0d*3 + 0d*5 - 3/28d*8. What is the third derivative of h(c) wrt c? -720c*3 Let r(a) be the second derivative of 3/7a*7 + 0 + 0a*5 - 6a + 0a4 - 1/3a*3 + 0a*6 + 0a*2. Find the second derivative of r(n) wrt n. 360n*3 Let i be (-1 - 1)(-2)/(-4). Let q(a) = -a - 1. Let p be q(i). Find the second derivative of ps - 5s*2 - 6s - 2s wrt s. -10 Let l(k) be the first derivative of -3k6/40 + k5/10 + 2k2 + 3. Let d(c) be the second derivative of l(c). What is the third derivative of d(a) wrt a? -54 Find the third derivative of -1517s*4 + 1517s*4 + 4s*2 - 8s*2 + 69s*6 wrt s. 8280s*3 Let k(i) be the first derivative of 0i*4 + 0i + 0i2 + 0i*5 + 0i*6 + 7 + 34/3i*3 + 5i*7. What is the third derivative of k(y) wrt y? 4200y*3 Suppose -3v + 10 = -20. What is the second derivative of -vh + 13h*3 - 10h - 7h + 6h wrt h? 78h Let z(m) be the first derivative of -m5/5 + 4m*4 - 30m*3 - 2m - 80. What is the third derivative of z(a) wrt a? -24a + 96 Let z(j) be the first derivative of 3j*7/7 + 13j*4/6 + 16j + 19. Let c(n) be the first derivative of z(n). Find the third derivative of c(m) wrt m. 1080m2 Suppose 5s = 3w + 13, 2s = w - 2s + 16. Find the third derivative of 33f*4 + 3f*2 - 19f*w + 6f*2 wrt f. 336f Find the third derivative of 6v - 18v*4 + 15v*4 - 7v + 13v5 - 13v*2 wrt v. 780v*2 - 72v Let p(c) be the second derivative of -283c4/12 - 181c*3/3 - 474c. What is the second derivative of p(f) wrt f? -566 Let r(p) be the first derivative of p*7/42 - 7p*6/72 - 5p3 - 29. Let y(i) be the third derivative of r(i). What is the third derivative of y(k) wrt k? 120 Let c(k) be the second derivative of -k5/10 - 229k4/12 - k3/3 - 713k*2/2 - 210k - 1. Find the second derivative of c(g) wrt g. -12g - 458 Let i(v) = 4v - 2. Suppose a - 3h = -h + 11, 4a + 21 = -5h. Let f be i(a). What is the third derivative of -4k2 + k2 - 5kf - 2k*3 + 0k*3 wrt k? -12 Find the third derivative of -7u*4 - 6u*4 + 19u*4 - 42u*4 - 248u*2 wrt u. -864u Let h(a) = -2a - 1. Let q(z) = -13z - 8. Let s(l) = 20h(l) + 4q(l). Find the first derivative of s(v) wrt v. -92 Suppose -3u = -4h - 45, 2h - 5 = -u - 0. Suppose -5q = -u - 14. What is the second derivative of q + 3d2 - 5 + 2d*2 - 5d wrt d? 10 What is the second derivative of 7 - 175h5 - 61h - 177h5 - 76h*5 - 14 + 3 + 2h*2 wrt h? -8560h*3 + 4 Let h(f) = -f - 7. Let r be h(-10). Suppose -3g = q + 2, -4g - 29 = -rq - 9. Find the second derivative of -2b - b + qb - 5b4 wrt b. -60b*2 Suppose 7 = -4m - 73. Let v = -16 - m. What is the second derivative of 2p + vp + p + 9p2 wrt p? 18 Let t(v) = 134v*2 + 8. Let a(x) = 2x*2 + x + 1. Let q(r) = 4a(r) - t(r). What is the second derivative of q(p) wrt p? -252 Let d(t) be the third derivative of -29t4/12 - 9t*3/2 + 7t2 - 2. Find the first derivative of d(g) wrt g. -58 Let i(m) be the first derivative of m2/2 - 12m - 5. Let a be i(14). What is the derivative of -r - 8r - a - 1 + 4r wrt r? -5 Let j(f) = -f2 + 26. Let o(y) = -y2 - 1. Let i = 22 - 21. Let c(u) = ij(u) + 2o(u). What is the derivative of c(s) wrt s? -6s Let g(c) be the third derivative of -209c6/40 + c5/30 - 58c*3/3 + 82c*2. Find the third derivative of g(n) wrt n. -3762 Let v(d) be the third derivative of 44d*7/105 - 19d*3/2 + 2d*2 + 53. Differentiate v(m) wrt m. 352m*3 Find the third derivative of -2102414i - 2i5 + 86i*2 - 102i*4 + 2102414i wrt i. -120i2 - 2448i What is the third derivative of 109m3 - 9m*2 - 191566m + 2m3 + 191564m wrt m? 666 Find the third derivative of 228x2 - x3 - 789x*4 + 1570x*4 - 791x*4 wrt x. -240x - 6 Let s be (14/10)/((-1)/(-5)). Suppose -s = -5z + 63. What is the first derivative of -15 + 24 - 11a*3 - z wrt a? -33a*2 Let z = -82 - -82. Let u(l) be the second derivative of -1/2l*2 + 4l + 1/6l6 + 0 + 0l*4 + zl*3 + 0l*5. What is the derivative of u(a) wrt a? 20a*3 Let r(v) be the third derivative of -19v*7/210 + 47v*4/12 + 4v*2. What is the second derivative of r(o) wrt o? -228o*2 Find the first derivative of -12r*3 + 6r*3 - 148 - 52r*3 + 2r*2 - 12r*3 - 12r*3 wrt r. -246r*2 + 4r Find the first derivative of -51m4 + 135m*4 + 53m*4 + 168 - 28m*4 wrt m. 436m*3 Let m be 2(-4)/12-3. Find the first derivative of g2 + 2 + gm + 12 - 4g*2 wrt g. -4g Let g(q) = q3 + q2 - q + 5. L	{ "pile_set_name": "DM Mathematics" }
= 3i2 + 13i - 10. Let z(d) = -4u(d) - 7y(d). Calculate z(8). -2 Let r = -11 + 18. Let v(d) = -9d3 + 3 - 8d + 11d3 - 6d2 - d3. What is v(r)? -4 Let r(z) = 3z + 1. Let k be (-8)/(-100) - (-992)/100. Determine r(k). 31 Let d(n) = -n2 - 5n + 12. Let u be d(-6). Let r(k) = k - 7. Let i be r(u). Let s(p) = -11p2 - 1. Determine s(i). -12 Let k be (-6)/(-9)(-3)/2. Let j be (1/2)/(k/6). Let z(n) = 8n + 2. Let l(v) = -v. Let u(x) = 4l(x) + z(x). What is u(j)? -10 Suppose 3o - 3w - 15 = 0, 0 = -6o + 2o - w + 15. Let r(k) = -6k3 + 2k*3 + 3k*3 - 2k + 0k3 - 1 + 5k2. Calculate r(o). 7 Let z = -13 + 16. Let f(u) = 5 + u2 - 3u - 7 - z - 4u. Calculate f(8). 3 Let z(i) = 733i - 733i - 26i2. Determine z(1). -26 Let l(j) = 6j*2 - 6j - 5. Let q(m) = -m*3 + 5m*2 + 5m + 5. Let w be q(6). Let y be l(w). Let s(o) = o*2 - 7o + 6. Determine s(y). 6 Let k(n) = n3 - n2. Let g be (-1)/((-2 + 1)1). Suppose -13i = -12i + 5. Let r(q) = 6q*3 - 11q*2 - 3. Let u(o) = gr(o) + ik(o). Calculate u(6). -3 Suppose -3t + 30 = 2t. Let a(m) = 6m*2 + m - 1. Let o(i) = -29i*2 - 13i + 12. Let r(p) = -5a(p) - o(p). What is r(t)? 5 Let t(s) = s. Let p(a) = -a. Let w(x) = -5p(x) + t(x). Calculate w(1). 6 Suppose -81 = -3k - 4t - 20, -57 = -3k - 3t. Suppose -kn + 3n + 0n = 0. Let b(x) = -x2 - x - 16. Determine b(n). -16 Let i(c) = -3c + 25. Let g(s) = -12s + 107. Let j(q) = -2g(q) + 9i(q). What is j(11)? -22 Let k(z) = z2 - 7z + 5. Let o be k(6). Let n = 6 + o. Let w(t) = -30t2 + 0t - 3t + 31t*2 + 0t. What is w(n)? 10 Let b(h) = -3h - 1. Let a be b(-3). Let u = a + -6. Let l(x) = -3x - 2 - 1 + 8x - 3x. Give l(u). 1 Let x = 16 + -10. Suppose 0 = -4j + xj - 6. Let f(s) = -s*2 + 7s - 1. Let r(u) = -u*2 + 9u - 2. Let z(g) = 3f(g) - 2r(g). Determine z(j). 1 Let x(y) = -y*2 - 12y - 19. Let q be (-6)/4(-1184)/(-222). Calculate x(q). 13 Suppose 48b + 3b + 561 = 0. Let d(l) = -l3 - 12l*2 - 11l + 6. Give d(b). 6 Let k(m) = -m*3 + 3m - 2. Let l be (-10)/25 + (-51)/(-15). Determine k(l). -20 Suppose 2v + 145 = -3q, 5v - 5q + 79 = 4v. Let r = 80 + v. Let s(g) = -g2 + 7g + 4. Calculate s(r). 10 Let m(c) = -c*3 + 6c*2 - c + 2. Let t = 85 + -47. Suppose -3k = -3p + 30, k + k + t = 5p. What is m(p)? -4 Let k be 4 + (-2 - (-20)/8)0. Let w(a) = a2 - k - 7a + 18a + 2 - 6. Calculate w(-12). 4 Let g(d) be the first derivative of -1/2d*2 + 1/3d3 - 12 + d. Give g(1). 1 Let f(a) be the third derivative of a4/8 + 67a3/6 + 21a2 - 7. Determine f(-25). -8 Let k(u) be the first derivative of u3/3 - 17u2/2 - 22u - 164. Give k(17). -22 Let t(q) = 10q2 + 10q - 1. Let m(j) = 12j2 + 12j - 2. Let u(h) = -4m(h) + 5t(h). Suppose 4c - 3p = p - 28, -c - p + 3 = 0. What is u(c)? 7 Let p(r) = -5. Let h(v) = -v*2 + 10v - 22. Let s(y) = -h(y) + 2p(y). Suppose 28 = 2l + 10. Give s(l). 3 Let t(v) = -1 + 3v2 - 1 - 2v*2 - v - 6v. Suppose -j + 439 - 432 = 0. What is t(j)? -2 Let d be -4 + 15/5 - -1. Let c(l) = -l*2 - 10. Calculate c(d). -10 Suppose 2d = -0d. Let u(v) = -v3 + v2 + v + 2. Let t be u(d). Let h(o) = 12o3 - 2 + o - ot - 28o3 + 17o3 - o2. Determine h(2). 0 Let p = -12 + 18. Suppose 0 = -pi + 11i - 10. Let r(k) = 11k - 19k + 3 + 1 + k*i + 9k. What is r(0)? 4 Suppose 1 = l + 5. Let d(u) = -u*3 - 11u*2 + 5u + 4. Let b(r) = -4r3 - 48r*2 + 20r + 16. Let w(t) = -2b(t) + 9d(t). What is w(l)? 0 Let i(h) = 11h3 + 2h*2 - 2h. Let u be i(1). Let o(q) = -q*2 + 11q - 8. Give o(u). -8 Let h(w) = -w*2 + w + 1. Let b(t) be the first derivative of -3t*2 + 5t - 140. Let z be ((-8)/6)/((-6)/9). Let k(m) = zh(m) - b(m). Calculate k(5). -13 Let v(f) = -3f*3 - 32f*2 + 8f - 50. Let r(z) = 4z3 + 42z*2 - 11z + 66. Let i(u) = 7r(u) + 9v(u). Give i(-7). -2 Let q(a) = 3. Let f(s) = -8s - 12. Let m(p) = f(p) + 5q(p). Calculate m(3). -21 Let c be 27(4 + 11/(-3)). Let a(k) = k3 - 4k*2 + 3k - 8. Let h(g) = g*2 - g. Let r(n) = -a(n) + 6h(n). Calculate r(c). 8 Let a(i) be the first derivative of i*2/2 + i - 1. Suppose r + 16 = -3r. What is a(r)? -3 Let g be -17 + 5(-18)/(-10). Let z(x) be the second derivative of -x3/6 - 7x*2/2 + x. Give z(g). 1 Let n(l) = -7l - 10. Let g(y) = 10y + 16. Let u(i) = 5g(i) + 7n(i). Give u(-6). 4 Let f be ((-10)/4)/((-16)/(-32)). Let a(o) = -o + 1. Let g(u) = -u2 + 12u - 10. Let w(p) = fa(p) - g(p). Give w(7). 5 Let s(d) = -6d - 1. Let y be s(-1). Let w(v) = -v + 0 - y + 0. Let c(b) = -b*2 + 7b + 116. Let u be c(-8). Calculate w(u). -1 Let s(c) = 2c - 4. Let h(u) = -6u + 13. Let g(t) = 2h(t) + 7s(t). Suppose 3p = -47 + 2. Let d be 1/((p/(-6))/(-5)). What is g(d)? -6 Suppose 0 = -38v + 51 - 317. Let b(m) = -m*3 - 8m*2 - 8m - 2. Determine b(v). 5 Let g = 37 + -36. Let d(s) be the first derivative of -5s2 - 2s + 5. Let o(b) = -20b - 3. Let i(w) = -5d(w) + 3o(w). Give i(g). -9 Let o(c) = -3c + 7. Let w(b) = -1. Suppose 0 = 4j + a - 15, 3j - 9 = -4a + a. Let n(p) = jw(p) + o(p). Suppose 9 = 3v + 3. Determine n(v). -3 Suppose -23f - 50 + 142 = 0. Let d(h) = -h*3 + 3h*2 - 5h + 2. Determine d(f). -34 Let t(y) = -y*3 - 4y*2 + 11y - 6. Suppose u - 4c - 2 = -12, -u + 3c = 9. Give t(u). 0 Let u(a) = -a + 1. Let k be u(1). Let t(v) = -8v - 94. Let x be t(-12). Let z be k/(3 - x/1). Let w(l) = -l3 - l2 + l + 14. Give w(z). 14 Let d(c) be the second derivative of c6/360 + c5/24 + 5c*4/24 + 41c*3/6 + 22c. Let h(t) be the second derivative of d(t). Determine h(-5). 5 Let z(i) = -19i - 15i + 6 + 44i - 13i. Give z(-3). 15 Let i be ((-24)/10)/((-14)/(-70)). Let n = i - -176. Let b(f) = -2f2 - 170f + 3f2 + nf. Determine b(6). 0 Let v(a) be the second derivative of -a*7/2520 + 7a6/720 - a5/120 + a*4/3 - 8a. Let x(n) be the third derivative of v(n). Calculate x(6). 5 Let o = -8 + 16. Let u(g) = -og + g3 - 8 + 14g - 10g2 - 5g. Determine u(10). 2 Let t = 20 + -13. Let o be ((-2)/(-1))/(-2)t. Let f(v) = v3 + 8v*2 + 6v - 9. Give f(o). -2 Let z(s) = 3s2 + 5s - 5. Suppose 0 = -19j - 13j + 32. Calculate z(j). 3 Let h(y) = -y*3 - 8y*2 + 5y - 10. Let b(i) = -i*3 - 10i*2 + 6i - 12. Let a(j) = -4b(j) + 5h(j). What is a(2)? -8 Let n(k) = k*2 + 5k - 6. Let w = 35 + -30. Suppose 2i + 115 = -2i - wu, -4i = 3u + 125. Let z = i - -29. Give n(z). 0 Let p be 38/((-23)/3). Let x = p - -26. Let t(g) = g - 10. Give t(x). -3 Let x(y) be the third derivative of y*4/12 + 5y3/6 + y2. Suppose -219v + 193v - 156 = 0. Determine x(v). -7 Let z(k) = k + 1. Suppose 4l = 2w + 32, -26 = -4l + 3w + 2w. Let o = 139 + -149. Let a = l + o. Determine z(a). 0 Let z(q) be the first derivative of 7q*2/2 - 4q - 30. Let l(j) = -j. Let c(k) = 6l(k) + z(k). Let b(d) = 3d - 3. Let y be b(2). Give c(y). -1 Let r(b) = -b*2 - b - 2. Let p(l) = -8l*2 + 7l - 7. Let f(h) = -p(h) + r(h). Let w(v) = -4v2 + 4v - 2. Let q(g) = 3f(g) + 5w(g). Calculate q(4). 5 Let m(s) = 7s2 + 11s - 14. Let y(x) = -4x2 - 4x + 7. Let l(f) = 3m(f) + 5y(f). Give l(-13). -7 Let b(l) = 14l2 - 9l - 1. Let g(n) = 2n2 + 1. Let o(d) = b(d) - 6g(d). Determine o(5). -2 Suppose 0 = 2p + 3 - 11. Let f(m) = -m2 - m + 5. Calculate f(p). -15 Let h(m) = 3 - 555m*3 + 556m3 - m2 + 7. Let t = -9 - -11. Suppose 0 = -ti - i. Give h(i). 10 Let a(f) = -f3 + 2f*2 + 2f + 2. Let i be a(3). Let j be i - 2(-2)/4. Let z(d) be the first derivative of d4/4 + d2/2 - 8d + 1. Calculate z(j). -8 Let p(f) be the third derivative of f5/20 + f4/8 - f*3/2 - 230f*2. What is p(-3)? 15 Let z = 0 - -14. Let k(y) = 12y*2 + 37y + 11. Let q be k(-3). Suppose -4i + m + z = 0, -q = i - 5m - 2. Let j(l) = l*2 - 3l + 2. Determine j(i). 6 Let m be 46/6 + 1 - (-26)/78. Let j(x) = -7 - 3 - 6x + m. Calculate j(-2). 11 Suppose 2t = -k + 5, -5t + 4k = -16 - 3. Let b(z) = 2z - 1 + 4z - tz - 4z. Let j = 1 + -4. Determine b(j). 2 Let x be 2387/(-775) - 4/(-50). Let f(b) = 2b2 + 4b. What is f(x)? 6 Suppose -2u - 22 = r, 3u - 3r = u - 14. Let h(l) = -l - 6. Determine h(u). 4 Let f(z) = 3z*2 + 18z + 24. Let	{ "pile_set_name": "DM Mathematics" }
31y2 - 97 - 73y*2 as ty*3 + g + ny + fy2 and give t. 19 Express (-3 + 1 + 4)(0p - 2p + 3p) - 1 + 1 + 2p + (27p - 11p + 16p)(-21 + 34 - 26) in the form ap + u and give a. -412 Rearrange 879f*3 + 4948 + 4f - 2488 - 2460 to p + cf2 + tf*3 + qf and give q. 4 Rearrange (-z*2 - 3z + 3z)(1 - 1 + z*2) + (72z*2 - 72z*2 + 9z*3)(76z - 18z - 23z) to the form wz*3 + jz*2 + sz + xz4 + g and give x. 314 Rearrange 2 - 12r*3 - 28220r + r*4 + 0 + 28226r to the form lr4 + ar + sr3 + ur*2 + o and give l. 1 Express (-2s*2 + 2s2 - s2)(-16 - 43 - 17)(1 - 1 - 2)(3 + 2 - 4)(-160s - 130s + 8s) as xs + gs3 + hs*2 + w and give g. 42864 Rearrange (-h - 7h + 0h)(-9 + 18 + 1)(-1007 + 520 + 561 + 1 + 3 - 2 + (-3 + 2 + 2)(-3 + 0 + 2)) to the form d + yh and give y. -6000 Express 57877692 - 57877692 + 25267f in the form bf + x and give x. 0 Rearrange 109 - 2y - 71y3 - 106 + y + y to the form uy*3 + oy*2 + jy + i and give u. -71 Express i2 + i2 + 20 + i*2 - 8i*2 + 22i*4 + 6i*4 in the form mi*4 + fi*3 + ri + ji2 + a and give j. -5 Rearrange ((-2 + 3 - 2)(3x + 4x - 5x) - 36x + 202 - 409 + 206)(0 - 1 - 1)(-84x - 9x + 31x)(1 - 4 + 2) to the form f + tx + ix*2 and give i. 4712 Express (5411 - 243 + 986)(2f - 2f - 2f) as v + tf and give t. -12308 Rearrange 73 + v*2 + 10v*2 - 55 + 117 + 6v*2 to sv + qv2 + z and give s. 0 Express 97g*2 + 148g*2 - 1061g*2 as v + xg + cg2 and give c. -816 Express 121a + 513a - 90a in the form y + la and give l. 544 Rearrange (3 + 14 + 32 - 3 + 4 + 0 - 6 + 1 + 3 + (-1 - 1 + 3)(3 + 1 - 5) + 2 - 1 + 0)(-11w + 11w + 4w*2) to the form lw + zw2 + d and give z. 192 Express -99p + 1704p + 2101p as ip + q and give i. 3706 Rearrange -30 - 115k*2 + 35 - 1170k*2 to the form x + ik + jk2 and give x. 5 Express 0q + q + q + (743 - 490 - 413)(-3q - 2q + 3q + (-4 - 6 + 8)(-5q + q + 2q) + 0 - q + 0) in the form v + hq and give h. -158 Rearrange -2x4 - 250 - 242 + 4x*2 - 250 + 791 to the form i + px*2 + ux + yx3 + bx*4 and give b. -2 Express (-4384c*3 + 6 - 711c*3 - 29 + 15 + 8)(15c - 10c - 12c) as vc*4 + sc*2 + ic + uc3 + m and give s. 0 Express (1 + 0 + 0)(1 + 2c - 1) - 102 - 54c + 13c + 100 + (57 + 145 + 164)(c + 2c - 4c) as a + xc and give x. -405 Rearrange -229s*2 - 291s*2 - 768s*2 + 1 - 1 - 2 to the form xs + p + js2 and give j. -1288 Express (2z + z*3 - 2z)(2z - 3z + 4z) + (55 - 55 - 86z)(-5z3 - 222z*2 + 222z*2) as az*4 + r + pz*3 + gz + cz2 and give a. 433 Rearrange 1495 - 1495 + 59c + (-4 + 4 - c)(-3 + 6 - 1) - 8c + 26c - 4 - 5c to i + nc and give i. -4 Rearrange (-11b - 68b + 3b + (-23b - 17b + 19b)(-5 + 2 + 2))(2b - 1 + 1) to the form vb + fb*2 + p and give f. -110 Express -92 + 2w*3 + 4w + 3w3 + 2w*3 + 93 + 13w*3 in the form cw*2 + u + pw + fw3 and give u. 1 Rearrange -105w*3 - 4w + 707w2 + 326 - 326 + 103w*3 + 7w to the form cw3 + i + mw*2 + jw and give j. 3 Express 1074 - 2838 + 1141 - 2i as p + ui and give u. -2 Express -f - 2f2 + f + (9f + 40f - 3f)(-68f + 40f + 31f) as af2 + gf + c and give a. 136 Express -456p2 + 452p*2 - 1021p + 6195p as up + wp2 + b and give u. 5174 Express (-4 + 2t*2 + 4 + (9 - 3t - 9)(2 - 2t - 2) - 18t2 - 10t*2 + 21t*2)(-16t - 1 + 1) in the form rt*3 + gt + pt2 + v and give r. -16 Rearrange -3g + 11g2 + 2g*4 + 2g + 2g3 - 7g*2 - 1 - 30g*2 + 7g*3 to the form sg*2 + cg*3 + yg*4 + w + fg and give f. -1 Express (-1 + 6n + 1)(9135 - 9135 - 688n)(0n - 3n + 5n) as cn*2 + sn*3 + on + a and give s. -8256 Express 4973u3 + 0 + 8u + 2 - u*4 - 4959u*3 as o + xu*2 + nu + mu3 + zu*4 and give o. 2 Rearrange -252754y + 53 + 252710y + 40 to the form p + wy and give w. -44 Express (-3 + s*2 + 3)(-4s - 2s*2 + 4s) - 14516011 + 14516011 - 11077s4 - 2 + 2 + 2s*4 as l + ys + fs2 + ts*4 + xs*3 and give t. -11077 Express -36n + 15n + 0 - 1 + 23n*2 + 48n*2 as vn + sn2 + k and give k. -1 Express -651v*2 + 3v - 1 + 4v3 - v + 305v*2 + 253v*2 + 8v*3 in the form nv*3 + bv*2 + dv + s and give s. -1 Rearrange -1907t3 + 958t*3 - 2t + 953t3 + 6 - 2 - 2t*2 to at*3 + pt*2 + vt + r and give a. 4 Express 61 + 4289q2 + 1996q*2 - 61 - 1614q*2 in the form iq*2 + x + oq and give i. 4671 Rearrange -98709f2 + f3 + 33f + 98698f2 - f3 + 2f*3 to the form if + jf2 + wf*3 + z and give j. -11 Express (-2 + 1 + 2)(-5596 + 1026m + 5596) as b + km and give k. 1026 Express -4 + 145316c4 + 4c - 4c - 145403c*4 + 2c*3 + 2c*2 as mc*2 + dc + j + sc4 + rc*3 and give s. -87 Express 7917j - 13445j - 7010j - 15498j - 1802j as bj + f and give b. -29838 Rearrange -3v + 4v - 49670 + 8v*2 + 6v*4 - 2v + 49672 + 5v2 to the form tv + j + zv3 + sv*2 + iv*4 and give s. 13 Rearrange (1 + 2i - 1)(287i + 1 + 789i - 264i + 1480i) to the form si + w + qi2 and give q. 4584 Rearrange -1425r + 1 + 707r + 5r*2 - 3 + 715r - 6r3 to m + lr*2 + vr + nr3 and give v. -3 Rearrange -1865 + 3724 - 1847 - 8z*2 to u + wz*2 + yz and give w. -8 Express (-14 + 6 - 7)(131w + 28 + 29 - 59) as fw + r and give f. -1965 Rearrange (-955 + 564 + 701)(6u + 1 - 1) - 2 + 2 + u to the form o + nu and give n. 1861 Rearrange 36123p + 5850533 - 5850533 to the form o + lp and give l. 36123 Rearrange 2952f2 - 212f*2 - 2 + 2 + 2322f*2 to df + t + of2 and give o. 5062 Rearrange -1426 + 700 + 726 - 26474t*2 to lt*2 + n + ot and give l. -26474 Rearrange (w2 + w2 - 3w2)(3961 + 1673 + 4841 + 342 - 1551)(-5w + 0w + 2w) to g + qw3 + hw + iw2 and give q. 27798 Express -17d*2 - 9d*2 - 498d + 23d2 + 4d*2 in the form ld*2 + zd + x and give l. 1 Express 11c3 + 146c - 3 - 126c - 7c*3 + (1 - 3 - 2)(-2c3 + 4c*3 - 3c*3) as pc*3 + mc*2 + s + tc and give s. -3 Rearrange -64n3 + 657 + 14n + 66n3 - 664 - n2 to zn*2 + d + yn*3 + in and give y. 2 Express -16154 + 227v + 16154 + (-4 - v + 4)(1 - 2 + 2) in the form w + fv and give f. 226 Rearrange 1241w - 2 - 677w + 3w*4 - 687w - 4w4 - w3 to the form nw*3 + xw*4 + vw + h + gw2 and give v. -123 Express (-b + 2b + b)(5753b*3 + 3431b*3 + 3768b*3) in the form gb*2 + ab + ub4 + v + qb*3 and give q. 0 Express -2626z - 5510 + 5510 in the form mz + i and give i. 0 Express 2 + 1 + 41y - 115y2 - 103y*2 + 212y*2 + 0 in the form ay*2 + fy + t and give a. -6 Rearrange (-3a + 3 - 3)(10907a + 18500a + 1076 - 1076) to the form la + n + xa*2 and give x. -88221 Rearrange (-i - 63 + 3i + 62)((2 + 0 + 0)(-3 + 0 + 1) + 3 + 4 - 6)(79i*2 - 1042i + 1042i) to the form oi + wi3 + ai*2 + z and give a. 237 Rearrange -4i*3 + 24 + 4 + 3i*2 - 2i*4 + 30i - 31 + 3i3 to t + yi*2 + di + li4 + vi*3 and give l. -2 Rearrange 7 - 19 - 4x*2 + 2x*4 + x - 44 + 2x*3 + 28 to the form i + fx*4 + ox + nx2 + sx*3 and give i. -28 Rearrange -5v - 6v - 2v + (0v + 0v + v)(-1 - 1 + 0) + 339 - 151v + 293v - 141v to the form qv + z and give q. -14 Express 23c*3 - 72c*3 + 24c*3 + 11c*3 + (23 + 37 + 2)(-6c3 + 3c*3 + 2c*3) in the form f + ic + pc2 + kc*3 and give k. -76 Rearrange (-69v*2 + 1153v*2 + 3366v*2)(8 - 3v2 - v - 6 + 2v*2) to the form jv + mv3 + xv*4 + yv*2 + a and give x. -4450 Express (-35g - 15g + 25g)(39 - 695 + 981 + 808 + 1282) in the form wg + s and give s. 0 Express -249s + 3 + 439s*2 + 249s + 417s2 + 377s*2 in the form u + ns*2 + ks and give u. 3 Express 10705 + 10698 - 21405 + 626s as ns + l and give n. 626 Express 5h4 + 72 - h - 24 - h3 + 2h*2 - 5 - 18 as ih*3 + sh + c + vh4 + th*2 and give i. -1 Rearrange -3v3 + v2 + 46v + 4v*3 + 98v*2 - 46v to b + av3 + hv*2 + nv and give a. 1 Express -5l - 4 + 6l + 2l2 - l3 + 1 + (-1457 + 254 + 62)(-l + 3l3 + l) in the form rl*3 + t + al**2	{ "pile_set_name": "DM Mathematics" }
= 2c2. Let h(q) be the first derivative of -97q*3 + 2080. What is v(h(t))? 169362t*4 Let u(p) = -241684p + 3. Let w(j) = -2j. Determine u(w(l)). 483368l + 3 Let p(k) = -5k2. Let v(l) = -10471582l + 1. Calculate v(p(u)). 52357910u2 + 1 Let l(h) = 9 + 15 - 2h - 42 + 18. Let a(q) = -445q. Give l(a(v)). 890v Let t(n) be the second derivative of -7n4/12 - n3 - 6n*2 - 37n. Let u(v) = v*2 + v + 2. Let b(r) = t(r) + 6u(r). Let j(i) = -97i. Give j(b(k)). 97k*2 Let u(t) be the third derivative of -19t*4/24 + 2t*3/3 + 12t*2 - 119t. Let h(g) = -7g. Determine h(u(v)). 133v - 28 Let k be 90241/639 + 2/(-9). Let u be (-2165)/(-15) + (-4)/(-6). Let x(t) = k + u + 4t - 286. Let b(v) = v2. Determine b(x(g)). 16g*2 Let q(f) be the first derivative of -3f*3 + 10056. Let u(z) = 2z - 3z - 6z*2 + z. What is u(q(b))? -486b*4 Let g(n) = 2n*2 + 3. Let u(y) be the third derivative of 0 + 2y - 1/20y5 + 0y*4 + 0y*3 - 96y*2. Give u(g(z)). -12z*4 - 36z*2 - 27 Let o(p) = 9p - 185. Let h(g) = 22g - 444. Let b(u) = -5h(u) + 12o(u). Let f(s) = -20s - 14. What is b(f(v))? 40v + 28 Let g(j) be the third derivative of 0j + 0 - 1/6j4 - 2j*2 + 0j3. Let m(t) be the third derivative of -t5/20 - 12263t2. Determine g(m(p)). 12p2 Let r(k) be the third derivative of k8/20160 - k*5/30 + 5k4/24 - k2 - 97. Let v(y) be the third derivative of r(y). Let d(g) = -70g. What is v(d(n))? 4900n*2 Let o(b) = -2077b. Let l(z) = 5z2 + 474. Determine l(o(f)). 21569645f*2 + 474 Let g(h) be the third derivative of -5h*4/24 - 377h*3/3 + 4h*2 - 29. Let c(b) = -b. Calculate c(g(m)). 5m + 754 Let t(o) = 92o - 84. Let w(c) = 180c - 154. Let m(q) = 11t(q) - 6w(q). Let z(n) = -n + 3n + n. Calculate m(z(u)). -204u Let g(h) = -3h. Let r(b) = 3b*2 - 1114b + 275. Give r(g(y)). 27y2 + 3342y + 275 Let w(h) = 89 - 13h - 89. Suppose -3y = y - 2k - 16, -2k = 2y + 4. Let c(o) = 5oy - o2 - 2o2. What is c(w(s))? 338s*2 Let s(l) = -120l. Let h(t) = 74t2 + 56t + 63. Let a(w) = -73w2 - 48w - 54. Let x(g) = -7a(g) - 6h(g). What is s(x(q))? -8040q2 Let q(l) = 37164355l - 37164355l + 3391l*2. Let n(v) = -3v. Give n(q(h)). -10173h2 Let c(n) = -2720n*2 - 3n + 34. Let x(h) = 36h. Give x(c(w)). -97920w*2 - 108w + 1224 Let x(d) = -14d + 3d*2 - 15d - 8d + 37d. Let h(p) = -70p + 12. Let i(w) = -910w + 154. Let z(g) = -77h(g) + 6i(g). What is x(z(u))? 14700u2 Let q(n) = 296n - 3619. Let t(b) = 36b2 - 1. Determine q(t(h)). 10656h2 - 3915 Let x(q) be the third derivative of -q4/12 - q*2. Let p = -227 + 229. Let u(d) = 0 - 333d*2 + 2 + 331d*p. What is u(x(a))? -8a*2 + 2 Let g(t) be the second derivative of 11t*4/12 - t + 327. Let z(v) = -39v + 6. Let f(p) = -2p + 1. Let w(n) = -6f(n) + z(n). What is w(g(b))? -297b2 Let i(d) = 8d*2 + 8d + 4. Let l(j) = -7j2 - 6j - 3. Let z = -285 - -288. Let c(s) = zi(s) + 4l(s). Let x(m) = 29m. Determine c(x(u)). -3364u2 Let p(d) be the third derivative of d5/60 - 191d2 - 2. Let n(c) be the third derivative of -13/24c*4 + 0 + 0c3 - c2 + 0c. Give p(n(j)). 169j*2 Let v(b) = -5b - 16. Let f(q) = 4q2 - 2q - 1464. Calculate v(f(x)). -20x2 + 10x + 7304 Let d(t) = -239110t2. Let f(l) = -1568l*2 + 1. Calculate f(d(s)). -89648192412800s*4 + 1 Let h be (-5)/(-10) + (-190563)/(-6). Let i(v) = -h + 4v + 31752 + 2v. Let k(u) = -u. Determine k(i(b)). -6b + 9 Let k(z) = -3z2. Let g = 95 - 66. Suppose 31i - gi = 24. Let u(v) = -iv + 19 - 19. Calculate k(u(r)). -432r2 Let v(o) = 48o - 59o + 8o*2 - 2o*3 - 16 - 21o*2 - 6o*2. Let h be v(-9). Let f(b) = -3b2 + b2 + 7bh. Let r(i) = -i. Determine f(r(z)). 5z*2 Let j(g) = -15g*2 + 26g + 35. Let r(v) = -7v2 + 12v + 22. Let i(p) = -6j(p) + 13r(p). Let x(c) = -23c2. Give x(i(n)). -23n*4 + 3496n*2 - 132848 Let z(l) = 231615l*2 - 50l. Let s(p) = -p*2. What is z(s(d))? 231615d*4 + 50d*2 Let d(l) = 2l. Let h(t) be the second derivative of -21451t3/3 - t + 2212. Give h(d(z)). -85804z Let b(l) = -28l. Let d(q) = -276q*2 + 801. Give d(b(x)). -216384x*2 + 801 Let g(b) = 2b*2. Let k(h) = 11438175h. Determine k(g(j)). 22876350j2 Let s(i) = -i. Let x(j) = -19468567j. Give s(x(q)). 19468567q Let s(z) = 15323229z*2. Let x(b) = 13b*2. What is x(s(m))? 3052417510823733m4 Let p(v) be the second derivative of v4/6 + 10v + 73. Let i(r) be the second derivative of 5r*3/6 + r. Give i(p(s)). 10s*2 Let m(d) = 3d*2. Let h(s) = -372495316s. Determine h(m(n)). -1117485948n2 Let o(w) = 3w*2 - 687w. Let j(p) = -2p - 67. Calculate j(o(q)). -6q*2 + 1374q - 67 Let u(f) = f*2 - 184f. Let x(i) = -209i2 + 6i. Let d(h) = -385h2 + 11h. Let l(w) = -6d(w) + 11x(w). Give u(l(o)). 121o4 - 2024o*2 Let t(l) = 792l - 10. Let x(f) = 79f - 1. Let k(m) = t(m) - 10x(m). Let b(p) = 745p. Calculate b(k(g)). 1490g Let w be (4/(-12))/((-3)/18). Let g(t) = wt - 2t - 2t + 0t. Let q(o) = 119o2. Calculate g(q(m)). -238m*2 Let d(z) = -33z. Let i(v) = -v. Let m(q) = -d(q) + 9i(q). Let n be ((-2)/(-4)-2)/((-13)/117). Let a(t) = nt - 12t + 5t. Calculate m(a(s)). 48s Let i(p) be the third derivative of 52p2 - 1/12p*4 + 0 + 0p + 3/2p3. Let a(t) = -t2. Let h(f) = -f2. Let y(v) = -3a(v) + 2h(v). Give i(y(w)). -2w*2 + 9 Suppose 5m + i - 17 = -10, -2i - 6 = 0. Let f(p) = -1 + 4 - 456p*m - 3 + 448p*2. Let h(l) = 19l*2. What is f(h(c))? -2888c*4 Let d(i) = -463i*2 + 29i. Let h(q) = -4876q. Calculate d(h(z)). -11007999088z*2 - 141404z Let z(s) = -5s. Let m(u) be the second derivative of 0u*2 - 7/6u*3 + 40u + 0. What is m(z(f))? 35f Let f(k) = 2k*2. Let s(m) = 969m + 0 + 1209m - 167m + 0. Calculate s(f(h)). 4022h2 Let o(p) = 14p*2. Let u(d) = -4d*2 + 23d + 68. Determine u(o(t)). -784t4 + 322t2 + 68 Let c(w) be the second derivative of -w4/2 + 4w + 19. Let o(g) = 133g - 21. Let k(q) = -33q + 5. Let f(v) = 21k(v) + 5o(v). Determine f(c(a)). 168a*2 Let o(z) = -174z*2. Let c(q) = -15661q*2. Determine o(c(k)). -42676444254k*4 Let u be 6(-3)/(-9) - 0 - 0. Let a(z) = -35zu - 29z*2 + 103z*2 - 33z*2 + 3z. Let t(c) = c. Determine a(t(k)). 6k2 + 3k Let x(z) = -711z. Let o(i) = 259i*2 - 5i. Determine x(o(d)). -184149d2 + 3555d Let w(h) be the first derivative of -1/12h4 - 27 + 0h*3 + 0h*2 - 25h. Let y(b) be the first derivative of w(b). Let t(u) = 13u2. Calculate t(y(o)). 13o*4 Let y(l) = 175l*2. Let g be (-1)/(-2) + 204/8. Let w(d) = -d - 26 + 2d + 0d + g. Give w(y(t)). 175t*2 Let y(o) = 19o. Let x(w) = -147811 + 73901 + 3w + 73899. What is y(x(q))? 57q - 209 Let r(g) = -32g2. Let t(n) be the second derivative of 95n*3/2 + 6420n. What is r(t(z))? -2599200z2 Let m(c) = -c2. Let f(j) = -5810j*2 - 42j + 21. Let k(o) = 581o2 + 4o - 2. Let p(v) = 2f(v) + 21k(v). Give p(m(w)). 581w4 Let x(c) = 2c2 + c2 - 2c2. Let m(g) be the first derivative of 25g*2/2 + 4g + 481. What is m(x(l))? 25l2 + 4 Let r(b) = b - 10. Let u(l) = -606l - 40. Let t(d) = 4r(d) - u(d). Let n(h) = -4h*2. Calculate t(n(k)). -2440k*2 Let f(v) = 148v. Let c(a) be the first derivative of a*3 + 42. What is c(f(w))? 65712w*2 Let a = -404 + 406. Let y(g) = -a + 2 - 11635g + 11640g. Let x(z) = 19z*2. Calculate x(y(b)). 475b*2 Let r(l) = 22l + 81l + 101l - 49l + 14l. Let s(u) = -3u. Determine r(s(d)). -507d Let s(n) = -10n. Suppose -17w = -24w - 147. Let m(v) = 3v. Let l(a) = wm(a) - 6s(a). Let o(y) = 3y + 17. Determine o(l(i)). -9i + 17 Let u(t) = -67t2 + 33t + 33. Let h(i) = 234i2 - 117i - 117. Let m(l) = 11h(l) + 39u(l). Let v(k) = -262k. What is m(v(q))? -2677116q*2 Let h(f) = 15 + 0 - 2 - 38f - 2. Let i(a) = -13a + 4. Let b(x) = 4h(x) - 11i(x). Let m(u) = -11u*2. Give b(m(s)). 99s*2 Let q(d) = 2184199d. Let y(v) = -5v2 - 4. Give y(q(o)). -23853626358005o*2 - 4 Let x(u) = -315u. Let z(o) = 5o2 - 9o - 45. Let c(i) = -i*2 + 2i + 10. Let b(r) = 18c(r) + 4z(r). Determine x(b(s)). -630s*2 Let	{ "pile_set_name": "DM Mathematics" }
Rearrange (-h3 - h3 + 4h3)(-4 - 6 - 7 + 27) to kh2 + oh*3 + y + sh and give k. 0 Express -3l + 4l4 + l3 - 2 - 2l + 3l + 1 as yl4 + m + tl*3 + pl + rl2 and give y. 4 Rearrange -18f*2 + 2f*2 - 8 + 6f*2 + 9f*2 to mf*2 + b + of and give m. -1 Rearrange 0d2 + 1 - 22d*2 - 9d*2 to the form c + nd + yd2 and give y. -31 Rearrange 11 - 4y*2 + 11y*2 - 5y*2 to by + k + vy2 and give k. 11 Rearrange -k - 3k + 2k + (-2 + 3 + 2)(-k - 2k + 6k) - 7k - 2k + k to tk + q and give t. -1 Rearrange (4 - 6 + 4)(3r4 - 7r*4 - 7r*4) to vr*3 + o + zr*2 + lr*4 + jr and give l. -22 Express 16x - 68x - 26x + 3x as q + yx and give y. -75 Rearrange -10 + 2 + 8 - 28d*2 to the form jd + xd2 + l and give x. -28 Express ((-5j + 5j - 3j)(-4 + 2 + 0) - 1 + j + 1)(3 + 0 - 2)(-33j - 29j + 58j) as hj2 + cj + d and give h. -28 Rearrange -x*4 - 4x*4 + 2x*3 - 3x + 2 + 0x3 + x to r + ax + kx2 + nx*4 + jx3 and give j. 2 Rearrange 0 - i3 + 2 + 3i - 2i - 3i to the form li + b + fi3 + hi*2 and give l. -2 Rearrange 7 - 10k - 6 - 1 to the form s + zk and give z. -10 Rearrange (-5a2 + a2 + 2a2)(-1 + 0 - 1)(-2 + 0 + 3)(-13a2 + 67a - 67a) to the form ma*2 + pa*4 + ba*3 + q + ia and give q. 0 Express (0 - 2 + 10)(3y + 6y - 2y - 1) in the form qy + o and give o. -8 Express 2k*3 + 0k2 - k4 + 791k + 2 - 807k - k*2 in the form n + rk*4 + wk + uk2 + fk*3 and give f. 2 Express (2 - 4 + 3)(-2s4 - 2s*4 + 19s*4 + 3s) in the form ds + cs*3 + rs*2 + ws*4 + u and give d. 3 Express 4 + 24m - 13m + 5m*4 - 10m + m*3 - 2m*2 in the form um*2 + vm*3 + hm + fm4 + n and give f. 5 Rearrange -2a*4 + 2a*3 + 4a*4 - 6a*4 + 2a*2 + 1 to the form ba + za4 + s + xa*2 + oa3 and give z. -4 Express d2 + 2 + 21d2 + 4d*2 - 3 in the form s + ld*2 + td and give t. 0 Express (m - 14m3 + m2 + 1 + 11m*3 + 3m)(3m - 2m + 0m) in the form fm3 + qm*4 + gm + a + zm2 and give g. 1 Express -17r + 63r + 3r in the form nr + g and give n. 49 Express 6a - 37a - 4a as r + ya and give y. -35 Express (4p2 + p2 + p*2)(4p + p + p) in the form gp*2 + zp + np3 + o and give g. 0 Rearrange -2 + 2 + 52c - 22c to the form j + xc and give x. 30 Express (-9 + 9 - 3c)(-c + 5c - 2c) + c*2 - 2c + 2c + (-4 + 4 + 1)(13c2 + 12c - 12c) in the form l + qc + pc2 and give p. 8 Rearrange -7 + 6 - 15x + 1 to the form sx + d and give s. -15 Express (-4 + 0 + 5)(-2 - 5 - 2)(2n*3 - 2n*3 + 2n*4) in the form on + yn2 + c + mn*4 + vn*3 and give m. -18 Express -2576 + 3s*3 - 2s*3 + 2617 in the form o + ns + bs2 + hs*3 and give h. 1 Rearrange 27f*2 - 16f*2 + 27f*2 to vf + s + rf2 and give r. 38 Rearrange -2j + 3 + j*2 + 2 + 3j2 - j2 to the form u + xj + tj*2 and give x. -2 Express 30a*3 - 4a*2 + 36a*3 + 2 - 65a*3 as g + ja + wa3 + fa*2 and give g. 2 Rearrange (12h*2 - 7h*2 - 9h*2)(-2 + 1 + 2) to the form zh2 + r + sh and give z. -4 Express -17 + 3 + 4m2 - 3m*2 + 0 in the form x + rm + lm2 and give x. -14 Express -9i*4 + 4i + 4i4 - i3 + 1 - 3i*4 in the form ji*3 + ki*4 + a + oi*2 + si and give a. 1 Rearrange -8d + 0d*3 + 0d*3 - 14d + 2d3 to the form td*3 + id*2 + a + qd and give q. -22 Express 6d3 + 2d*3 + 4 - 5d*3 + 3d*3 in the form id*2 + sd + nd3 + b and give i. 0 Rearrange (3w*3 + 3w*3 - 4w*3)(w + 0w - 2w) + 35w4 + 7 + 2w*2 + 84w - 86w - 5 to mw*4 + n + hw*2 + uw*3 + dw and give d. -2 Express (2 + 4 - 4)(-1 + 1 + 2o) + 2o - 4o + 0o - 357o - 31o + 26o in the form s + wo and give s. 0 Express 6w*3 + 0w*3 + 23w - 21w as r + uw + mw2 + lw*3 and give l. 6 Express 85m - 85m + 38m*2 in the form q + zm + vm2 and give v. 38 Rearrange 1208 + 6g - 1208 - 3g2 to the form jg*2 + r + ig and give i. 6 Express 9n2 + 6 + 2 - 3n + 8 - 15 as sn + un*2 + x and give s. -3 Express -2d*2 - 3d*2 + 9d*2 - 4d + 4d - d2 + d2 - 1 + 1 + (3d*2 - 4d*2 + 2d*2)(2 - 3 + 2) in the form l + kd2 + cd and give k. 5 Express 35j4 + 2j2 - j3 + 35j4 - 79j*4 + 1 as xj*2 + fj*3 + yj + wj4 + z and give x. 2 Rearrange 2a2 + a4 - 20a3 - 2a + 11a3 + 10a*3 to the form ta + oa2 + na*3 + va*4 + u and give o. 2 Express -1 - b + 1 + (-4 + 3 - 1)(-b + 0b + 2b) + b + 2b - b - 2 + 7b - 3b - 14b in the form a + fb and give f. -11 Rearrange -6o + 2o - 6o - 3o to the form jo + s and give j. -13 Rearrange -2m3 + 2m*3 - 3m*3 + (-5m*2 + 3m*2 + 5m*2)(-2m + 0m + 0m) to the form z + om*3 + im + dm2 and give o. -9 Rearrange 66u4 - u4 - 7u4 + (-1 + u + 1)(u - u*3 - u) to mu*4 + bu*3 + n + yu*2 + fu and give m. 57 Express -9z + 6z + z + 13z2 as qz*2 + g + hz and give q. 13 Rearrange (-2 + 0 + 0)(3k*2 - 3k2 + k2) + 0k2 + 2k2 - k2 + (3 - 3 + 2k)(10k - 19k + 26k) to the form mk + w + fk2 and give f. 33 Express 10r - 6r + 7r in the form s + wr and give w. 11 Express 11n - 45 + 45 in the form rn + o and give o. 0 Rearrange -18p + 3 - 1 - 12p + 9p to sp + r and give s. -21 Rearrange ((-4 + 0 + 2)(-3h - h + 7h) + 2 - 4h + 2h + h)(-2 - h2 + 2) to dh*3 + t + ph*2 + oh and give d. 7 Express 4t - 5t + 2t - 3t in the form r + pt and give p. -2 Express 269 - 269 - 30a*2 as xa + na2 + g and give g. 0 Express -6q*2 - 36q*3 + q - 4q*2 + 9q*2 in the form dq*3 + mq + pq2 + c and give d. -36 Rearrange (3v - 3v - v)(0v - 3v + 5v) + v2 + 2v*2 - 4v*2 + (4v + 3 - 3)(-3v + v - 3v) to the form lv*2 + nv + r and give l. -23 Rearrange -k4 - k4 + 2k2 - 21k + 9k - 3 + 13k to the form x + vk + uk*3 + ak*4 + gk*2 and give v. 1 Rearrange -6x*3 - 3x4 + x4 - 2x2 + 5x*3 - 5x*3 to t + mx + kx3 + ax*2 + zx*4 and give z. -2 Rearrange -177p*3 - 1 + 1 - 7p + p*2 + 175p*3 to wp*3 + fp*2 + s + jp and give w. -2 Express (1 - 2 + 2)(-m2 + 4m2 - m2) + 2m2 + m - m - 13 + 13 + 10m*2 in the form wm*2 + pm + n and give w. 14 Rearrange (30c - 9c + 5c)(-3 + 3 + c) to h + uc + fc*2 and give h. 0 Rearrange (0k - 2k + 3k + 5)(-k + 0k + 14k) to the form pk + vk2 + a and give v. 13 Rearrange -t2 + 3t*2 + 0t*2 + (0t + 0t + t2)(-8 + 8 + 7) to ut2 + m + ft and give f. 0 Rearrange -23 - 2t4 - 4t2 - t4 - 2t3 + 22 - t3 to dt*2 + ot + ht4 + lt*3 + y and give l. -3 Rearrange (0 + 2 + 1)(-2d2 - 13d2 + d2)(-4d*2 - 2d*2 + 7d*2) to the form id*2 + ld + ad4 + v + bd*3 and give a. -42 Express (954j + 13j2 - 1 + j3 - 954j)(1 - 4 - 1) in the form dj*3 + g + mj + pj2 and give g. 4 Rearrange 34h + 277 - 277 to the form w + gh and give g. 34 Express (4 - 3 - 5)(0y2 + y2 - 2y*2)(3 - 1 - 4) as hy + t + cy*2 and give c. -8 Express -3 - s - 13s + 3 as m + ts and give t. -14 Express 2p*3 + p - 3p2 + p2 - p - 3p + p4 as x + qp*2 + tp*4 + lp*3 + sp and give q. -2 Express 7 + 5w - 7 - 2w + 1 - 1 + (1 - 1 + w)(-3 - 1 + 5) + 4w - 4w - 2w in the form k + jw and give j. 2 Express (3n - 2 + 2)(153 - 42 - 52) as dn + f and give d. 177 Rearrange (3i2 - 2i*3 - 3i*2)(-1 + 2 + 6) to the form ri2 + k + vi + gi3 and give g. -14 Rearrange l - 3l + 73l4 - 65l*4 + (-2l3 + l3 - l*3)(l + 2l - 5l) to the form nl + d + ml*3 + fl*2 + jl*4 and give j. 12 Rearrange 8q - 9q + 9q - 1 + 24q to the form dq + r and give r. -1 Express 31t4 + 3t*4 + t + 32 - 30 in the form l + vt*4 + xt*3 + yt*2 + ct and give l. 2 Express (-5t2 + 5t*2 - 4t*2 + (t - 3t + t)(2t - t + 0t))(4t - 8t + 3t + 5t*2) in the form ct + mt2 + dt*4 + ot*3 + w and give d. -25 Express -2 + 34t + 8t + 2 in the form m + qt and give q. 42 Rearrange 2r4 + 2r*2 - 2 - 5r*3 + 2 + 12r*3 to gr*2 + nr + or4 + l + qr3 and give g. 2 Express j4 + 5 + 2j2 + 14 + 2j*4 - 2j*4 as f + k	{ "pile_set_name": "DM Mathematics" }
ative of 11 + ks - 3s*2 - 2s - 5. What is v(n(m))? -108m2 Let f(x) = 22x. Let h(m) = m - 1. Let q(g) = 7g - 8. Let u(v) = -40h(v) + 5q(v). Calculate f(u(c)). -110c Let d(a) = 6a2 + 4a + 1. Let i(l) be the second derivative of l*3/6 - 2142l. Determine i(d(s)). 6s2 + 4s + 1 Let k be 2(-11)/((-154)/63). Let l(w) = -kw*2 + 12w*2 - 7w2. Let c(n) = -n2 - n*2 - 2n*2. Determine c(l(j)). -64j*4 Let j = -176 - -178. Let c(v) = -2v*j + 102 - 102. Let f(t) = 17t. What is f(c(y))? -34y2 Let f(o) be the first derivative of 1/3o*3 + 0o - 119 + 0o2. Let t(d) = 3d*2. Determine f(t(q)). 9q*4 Let j(o) = 11o*2 + 34. Let b(q) = 2q + 1815 - 1815. Determine j(b(i)). 44i2 + 34 Let p(x) = 12x2. Let w(q) be the third derivative of q5/60 - 6q3 - 1089q*2. Give p(w(y)). 12y*4 - 864y*2 + 15552 Let w(z) = 11z*2 + 40. Let r(c) = 2c*2 + 7. Let f(a) = 6r(a) - w(a). Let k(q) = -5q2 - 9. Give k(f(j)). -5j*4 - 20j*2 - 29 Let l(h) = 46991269h. Let k(u) = 2u. What is l(k(y))? 93982538y Let q(y) = -2y. Let w(h) = 83h + 2206. Let b(p) = 139p + 4412. Let n(o) = 3b(o) - 5w(o). Determine n(q(k)). -4k + 2206 Let t(k) be the third derivative of -k4/12 - k2. Let v(j) be the second derivative of j*3/3 + 1788j. Determine t(v(n)). -4n Let n(u) = -35u*2. Let v(y) = 7y - 3. Let w(k) = 12k - 5. Suppose -46 = 5r + 5j - 11, -1 = -5r + 4j. Let c(h) = rw(h) + 5v(h). What is n(c(m))? -35m2 Let x(p) = -p2 + 263p + 75. Let v(n) = -126n. Give x(v(f)). -15876f2 - 33138f + 75 Let a(g) = 12g. Let t(u) = 2094399u*2. Calculate t(a(y)). 301593456y*2 Let i(t) = 3t2. Let m(o) be the third derivative of -o8/720 - o*5/30 - 29o*3/6 - 3o*2 + 6o. Let r(u) be the third derivative of m(u). Give i(r(w)). 2352w4 Suppose -10w + 4w = -132. Let u(k) = -23 + 65 - k - 20 - w. Let q(j) = -121j + 2. What is q(u(g))? 121g + 2 Let g(k) = -9k. Let i(y) be the third derivative of y*8/2240 - 11y*5/12 - 2y*2 + 8. Let j(u) be the third derivative of i(u). Give g(j(w)). -81w*2 Let m(z) = -40z - 33. Let k(d) = 124d + 102. Let s(v) = 12k(v) + 37m(v). Let c(n) = -13n. What is c(s(i))? -104i - 39 Let k(n) be the third derivative of -17n*4/6 - 4730n*2 - n + 2. Let z(l) = -4l. Let o(f) = f*2 - 9f. Let w(m) = 4o(m) - 9z(m). Calculate k(w(t)). -272t2 Let i(a) = -a. Let g(l) = -7l*2 + 2. Let w(d) = 5d - 38. Let r be w(7). Let z(c) = -c*2 + 1. Let x(f) = rg(f) + 6z(f). What is x(i(u))? 15u*2 Let o(h) = 815940h. Let y(p) = -7p2. Determine o(y(s)). -5711580s*2 Let z(j) = 2j + 10. Suppose -20 = -7k + 12k. Let v(m) = -2m - 8. Let y(g) = kz(g) - 5v(g). Let p(o) = -55o*2. What is p(y(r))? -220r*2 Let u(h) = -2h*2 + 10. Let q(m) = -57m*2 + 304. Let s(w) = 5q(w) - 152u(w). Let g(p) = -2p. Determine s(g(c)). 76c2 Let o(j) be the first derivative of -16j*3/3 - 1123. Let d(g) be the second derivative of 2g*3/3 - g. What is d(o(u))? -64u*2 Let f be 27/(-54)(1 - 29). Let x(u) = -9u - 13u + 35u - fu. Let m(d) = -9d2. What is m(x(l))? -9l2 Let x(d) be the second derivative of d4/6 + 19d. Let j(v) = -2v*2 - 3v + 239. Let n(o) = o*2 + 2o - 234. Let a(k) = -2j(k) - 3n(k). What is a(x(p))? 4p4 + 224 Let r(b) = -309b*2 - 39b - 13. Let o(m) = 49m2 + 6m + 2. Let a(w) = -39o(w) - 6r(w). Let k(u) = 4u2 + 8. Give k(a(q)). 12996q*4 + 8 Let i(a) = -2a + 36. Let r(t) = -53624t. Calculate i(r(y)). 107248y + 36 Let m(w) be the first derivative of -9w2 + 5w + 9049. Let f(n) = 5n2. Calculate m(f(d)). -90d*2 + 5 Let f(b) = -4b*2 + 379. Let d(u) = 335u - 5. Determine d(f(r)). -1340r2 + 126960 Let u(i) = 25 - 25 + i. Let n(t) = 16t*2 - 4t + 4. Let c(j) = 16j2 - 5j + 5. Let p be 3/6-4(0 + 2). Let x(y) = pc(y) + 5n(y). Determine x(u(s)). 16s2 Let g(k) be the second derivative of 25k*3/3 + 128k + 37. Let b(z) be the third derivative of z*5/20 - 4z*2. What is g(b(l))? 150l*2 Let g(a) = 10174a*2. Let j(m) = 38m. Give j(g(t)). 386612t2 Let j(h) = -3h*2. Let v(w) be the first derivative of 9w*5/20 - 26w*3 - 58. Let i(r) be the third derivative of v(r). Determine i(j(q)). -162q*2 Let i(x) = -36775x + 94. Let h(d) = 4d. What is i(h(z))? -147100z + 94 Let p(o) = 13o2. Suppose -30i - 870 = -990. Let d(u) be the second derivative of 11u + 1/6u*i + 0 + 0u*3 + 0u*2. Calculate p(d(q)). 52q*4 Suppose 6w = 3f + 4w - 22, -f - 3w = 11. Let u(g) = 7 + 8 - 32 + g + 12 + f. Let o(a) = a. Give o(u(n)). n - 1 Let g(f) = -3f + 5. Let q be -2 - -5 - (-4 + 3). Let w(k) = -10 + 7k - qk + 2k + 2. Let b(x) = 8g(x) + 5w(x). Let l(h) = 6h. Give l(b(r)). 6r Let m(w) be the third derivative of -3/20w*5 + 2 + 0w*3 + 26w*2 - 1/24w*4 + 0w. Let x(f) = -f. Calculate m(x(r)). -9r2 + r Let j(i) = -3i. Let m(f) = -290f2 - 71f + 293f2 - 52f. Calculate j(m(p)). -9p2 + 369p Let j(v) = 2v. Suppose -46 = -5z - 1. Let n(t) = -9 + 1 + z. Let m(k) = -4k2 - 2. Let a(p) = -3m(p) - 6n(p). What is a(j(g))? 48g*2 Let m(p) = -p. Let s(o) = -45144361o. Calculate s(m(q)). 45144361q Let g(d) = -5d. Let s(t) = t. Let r(w) = -2g(w) - 9s(w). Let j(x) be the first derivative of 2 + 109/3x3 + 0x*2 + 0x. What is r(j(l))? 109l2 Let v(x) = -52308x + 1 - 6 + 1 + 52297x. Let m(o) be the first derivative of -o2/2 - 1. Give m(v(s)). 11s + 4 Let h(f) = -32f2 + 2f. Let v(s) = -482s - 188. Let t be v(-9). Let z(w) = -tw + 3w2 + 4150w. Give h(z(b)). -288b4 + 6b*2 Let l(v) = 7v*2 + 10. Let a(y) = 141y*2 - 2y - 5. Give a(l(w)). 6909w4 + 19726w*2 + 14075 Let r(d) = 2d*2. Let v(z) = -2z*2 + 9z - 27. Let u be v(7). Let s = 63 + u. Let t(l) = -s - 4 - 3l + 4 + 4. Determine t(r(c)). -6c*2 + 3 Let s(f) be the third derivative of 51f + 0f3 + 0 + 1/20f*5 + 1/24f*4 + 2f*2. Let o(h) = -h. Calculate s(o(t)). 3t*2 - t Let c(i) = 6i*2. Let z = -808 + 818. Let h(k) = -11k - 3 + 3 - zk + 13k. What is c(h(m))? 384m2 Let q(p) = 1457955p. Let n(l) = -5l. Determine n(q(c)). -7289775c Suppose 0 = 101c + 31c - 396. Let z(f) be the first derivative of 0f2 + 0f - 2/3fc - 13. Let x(s) = 32s. Determine z(x(u)). -2048u2 Let g(p) = -p. Let j(z) = 2614z*2 - 752z*2 - 1313z*2 - 1223z*2. Give j(g(x)). -674x*2 Let d(z) = 0z*2 + 0z*2 + 1239 + 2z*2 - 1239. Let k(s) = -1248s*2. Determine k(d(a)). -4992a*4 Let d(v) = 54v. Let t(w) = 11w. Let g(n) = -d(n) + 6t(n). Let h(p) = 205p. What is g(h(k))? 2460k Let f(i) = 4995080i. Let j(n) = -3n*2. Calculate j(f(o)). -74852472619200o*2 Let k(w) = -w. Let i(b) = -4324484b*2. Give k(i(x)). 4324484x*2 Let z(d) = 2d*2. Let j(t) = 29t + 2. Let g be j(-2). Let f = g - -64. Let p(o) = -9o - 17o + fo. Determine p(z(b)). -36b*2 Let i(q) = -19q*2. Let h(y) = 17y + 72. Let t(g) = -594g - 2508. Let w(c) = -209h(c) - 6t(c). What is i(w(n))? -2299n*2 Let a(s) = 33207s. Let u(r) = 2684r2. Give u(a(i)). 2959659814716i*2 Let s(p) = 7 + 7p - 21 - 10 - 2p. Let j be s(6). Let k(t) = -t + 3. Let w(x) = -6x + 17. Let q(o) = jw(o) - 34k(o). Let u(g) = -31g. Determine q(u(y)). 62y Let t(f) = 1383f. Let u(d) be the second derivative of d4/6 + 1160d. What is u(t(l))? 3825378l2 Let i(s) = -26s*2 + 16150s + 2. Let a(o) = -4o2. What is i(a(q))? -416q*4 - 64600q2 + 2 Let o(k) = -k2. Suppose -c - 15 = -5. Let q(j) = -j*2 - 15j - 23. Let r be q(c). Let y(g) = rg2 - 15g*2 + 11g*2. What is y(o(x))? 23x*4 Let t(r) = 635r + 8. Let h(f) = -770f. Determine t(h(n)). -488950n + 8 Let w(r) = -2r2 + 390r + 3. Let a(j) be the second derivative of -j*3/3 + 10145j. What is w(a(h))? -8h2 - 780h + 3 Let k(h) = 8401h - 4206h - 4192h. Let c(j) = 13j*2 - 2j. Let p(m) = -1260m2 + 195m. Let f(i) = 585c(i) + 6p(i). Give k(f(w)). 135w2 Let g(a) = 158a - 156a - 40 - 1 - 6 - 7. Let l(w) = 77w*2. What is l(g(u))? 308u*2 - 16632u + 224532 Let t(c) = -4c2 + 68c. Let d(l) = -52938l. Give d(t(g)). 211752g*2 - 3599784g Let f(x) = -166x. Let o(l) = -29l + 29l + 2l + 22l. Calculate f(o(h)). -3984h Let h(p) = 5p*2. Let	{ "pile_set_name": "DM Mathematics" }
116. Let i be l(29). Suppose 0k + 0 - 2/5k*4 + 4/5k*3 + ik*2 = 0. Calculate k. 0, 2 Let y = 1578/7 - 4717/21. Let t = 8/7 - y. Find u such that -4/3 - tu*2 - 4/3u = 0. -2 Let g(w) be the third derivative of -w*5/15 + 7w*2. Factor g(y). -4y*2 Let g = 18/503 - 5416/123235. Let w = 20/49 + g. Find h such that wh - 4/5h4 + 0 + 0h*3 + 4/5h*2 - 2/5h*5 = 0. -1, 0, 1 Suppose 4w - w + 9 = 0. Let y(t) = 8t2 + 8t + 4. Let l(p) = -p*3 + 9p*2 + 9p + 5. Let v(s) = wy(s) + 2l(s). Factor v(f). -2(f + 1)3 Factor 4k*5 - 8k*2 + 3k*5 + 2k + 5k4 - 9k*3 + 3k*2. k(k - 1)(k + 1)2(7k - 2) Let w(h) be the second derivative of -h7/98 - 3h*6/70 - 3h5/70 + h4/14 + 3h3/14 + 3h*2/14 - 5h. Solve w(j) = 0 for j. -1, 1 Let v(q) be the second derivative of -1/24q4 + 1/4q*3 - 1/2q*2 + 3q + 0. Let v(b) = 0. Calculate b. 1, 2 Let t(q) be the second derivative of -q4/4 + q3/6 - 5q. Factor t(p). -p(3p - 1) Let t(z) = -7z + 42. Let m be t(6). Let k(x) be the second derivative of 0 + 0x3 - 1/25x*5 - 1/75x*6 + mx*2 + x - 1/30x*4. Factor k(q). -2q*2(q + 1)2/5 Let l(s) be the third derivative of s8/112 - s*6/40 + 5s*2. Factor l(c). 3c*3(c - 1)(c + 1) Suppose p = 2p + 95. Let q = 477/5 + p. Factor qx3 + 0x*2 + 0 + 0x. 2x3/5 Let p(m) be the second derivative of -3m + 0 + 1/21m3 - 1/7m*2 + 1/42m*4 - 1/70m*5. Suppose p(f) = 0. Calculate f. -1, 1 Suppose 0 = 2a - 13 - 7. Let s be (-5)/a + (-10)/(-12). Let sr - 1/3r2 + 0 = 0. Calculate r. 0, 1 Let u(h) be the first derivative of -h4/24 - h3/6 - h2/4 + h + 3. Let k(d) be the first derivative of u(d). Factor k(z). -(z + 1)*2/2 Suppose 0o + 0 + 2/21o2 + 0o*3 - 2/21o*4 = 0. Calculate o. -1, 0, 1 Factor 7/3k*2 - 3k*3 + 2/3k + 0. -k(k - 1)(9k + 2)/3 Let x = 21 - 19. Suppose 64i + 0ix + 4 - 60i + i*2 = 0. Calculate i. -2 Suppose -14f = -19f. Factor 0a + 2/9a2 - 4/9a*3 + 2/9a*4 + f. 2a*2(a - 1)*2/9 Let n(b) be the third derivative of -4b*2 + 0 + 1/150b*5 + 0b + 1/15b3 - 1/30b*4. Factor n(i). 2(i - 1)2/5 Let k(h) be the third derivative of h5/12 - 5h4/2 + 30h*3 + 2h*2 + 2h. Factor k(l). 5(l - 6)2 Let y(u) be the third derivative of -u8/10080 + u7/420 - u6/40 + 3u5/20 + u4/4 - 4u2. Let i(j) be the second derivative of y(j). Factor i(n). -2(n - 3)*3/3 Factor 1/2v*2 + 1/4v*3 - 1/2 - 1/4v. (v - 1)(v + 1)(v + 2)/4 Let u(m) be the third derivative of -1/945m7 + 0m - 1/270m6 - m2 - 1/270m*5 + 0m*4 + 0 + 0m*3. What is w in u(w) = 0? -1, 0 Let p(q) be the first derivative of -5 - 1/9q*3 - 1/6q*2 + 2/3q. Let p(b) = 0. What is b? -2, 1 Let f(v) be the first derivative of 4v2 - v - 4/3v*3 - 2 + 1/6v*4. Let x(t) be the first derivative of f(t). Factor x(y). 2(y - 2)*2 Suppose -3d - 2p = -19, -2d - 3p + 30 = 3d. Let r = d - 1. Factor -2/5u + 2/5u*3 - 2/5u*r + 2/5. 2(u - 1)*2(u + 1)/5 Let d(z) = 2z + 2. Let s be d(0). Factor 0m - 2/3 + 2/3ms. 2(m - 1)(m + 1)/3 Factor -8t - 8/3 - 4t3 - 2/3t*4 - 26/3t*2. -2(t + 1)*2(t + 2)2/3 Let j(u) = -u3 + 7u2 - u + 10. Let h be j(7). Let -2 + 20x - 3 + 2 + 3xh - 14x*2 - 5 = 0. What is x? 2/3, 2 Suppose 2c = -81 + 85. Factor 6/5bc + 0b + 3/5b5 + 0 + 0b*4 - 9/5b*3. 3b*2(b - 1)*2(b + 2)/5 Let o(q) be the second derivative of q*7/14 + 3q*6/2 + 9q*5/2 - 95q*4/2 + 225q*3/2 - 243q*2/2 + 35q. Let o(n) = 0. Calculate n. -9, 1 Let q(f) be the second derivative of -f*7/84 - 11f6/180 - f5/20 + f*4/6 + 2f*3/9 + 15f. Determine c, given that q(c) = 0. -2, -2/3, 0, 1 Let q(u) be the second derivative of u4/78 + u3/39 + 3u. Factor q(g). 2g(g + 1)/13 Let z(m) = -m5 - m3 + m. Let p(v) = -6v*5 - 2v*3 + 2v*2 + 5v. Let w(i) = -3p(i) + 15z(i). Factor w(a). 3a2(a - 2)(a + 1)2 Let h be 8/14 - 36/112. Factor -u - 1 - hu2. -(u + 2)2/4 Factor -6s3 - 3s*2 - 64 + 8s*3 - 4s*3 - 17s*2 - 64s. -2(s + 2)(s + 4)*2 Let f = -15 - -18. Factor -2a + 1 + 0 - 3af - a4 + 5a3. -(a - 1)3(a + 1) Let k(d) be the third derivative of -d8/120960 - d7/15120 - d6/4320 + 2d*5/15 - 2d2. Let o(a) be the third derivative of k(a). Factor o(m). -(m + 1)2/6 Let s be 2/(-9) + 145/45. Suppose 5b - si - 22 = 0, b - 3i - 8 = 6. Factor -jb - j3 + j - 2j*4 + 2j4 + j4. j(j - 1)2(j + 1) Let w(r) be the first derivative of -r*4/2 + 2r*3 - 2r*2 + 11. Suppose w(q) = 0. What is q? 0, 1, 2 Let k(p) be the third derivative of 16/15p*3 - 1/150p*6 + 2/25p*5 - 2/5p*4 + 0p - 4p2 + 0. Determine m, given that k(m) = 0. 2 Let i = 434 - 431. What is j in 0j - 1/3ji + 2/3j2 + 0 = 0? 0, 2 Let u(j) be the third derivative of j6/10 - j5/15 - j4/2 + 2j3/3 - 3j*2. Find k, given that u(k) = 0. -1, 1/3, 1 Suppose 0 = 5c - 5w + 6w - 12, -4w = -4c + 24. Solve 0 + 1/6n4 + 0n + 1/2nc + 0n*2 = 0 for n. -3, 0 Let v(l) = -l + 3l*3 - 3 + 2l*3 + 5l*2 - 4l*3. Let a be v(-5). Factor -4u*a + 2u*2 + 2u + 4u2. 2u(u + 1) Suppose 2v + 14 = 18. Suppose 5o = v + 8. Solve 3/5s - 2/5 - 1/5so = 0 for s. 1, 2 Let f(i) be the first derivative of -25i*3/3 - 105i*2 - 80i + 4. Factor f(n). -5(n + 8)(5n + 2) Let r(l) be the second derivative of 2l*3 - 6l*2 + 0 - l - 1/4l*4. Factor r(v). -3(v - 2)*2 Suppose -z - 2y = -3, 5z = -y + 4y + 15. Find t such that -t + 0t3 + 2t*2 + 3t3 - tz - 3t3 = 0. 0, 1 Let z(r) be the third derivative of r7/5040 - r5/240 + r4/12 + 2r*2. Let f(i) be the second derivative of z(i). Factor f(d). (d - 1)(d + 1)/2 Let r be ((-3)/(-7))/(8/(-574)). Let m = r + 31. Determine h, given that -mh3 - h2 - 1/2 - 5/4h = 0. -2, -1 Let i(k) = -4k2 + 7k - 1. Let d be (6 + -9)1-1. Let y(t) = 5t2 - 8t. Let q(s) = dy(s) + 4i(s). Suppose q(a) = 0. What is a? 2 Let k = 94 + -753/8. Let u = 5/8 + k. Find m, given that 1/2m4 + um2 + m3 + 0 + 0m = 0. -1, 0 Let u(f) = 4f3 - f2. Suppose 0 = c - 0c - 1. Let z be u(c). Solve -3g*3 + g + 2gz + g + g2 = 0. -1, 0, 2 Let x = -21 - -15. Let z = 8 + x. Determine k so that 14kz - 2 + 2 - 4k = 0. 0, 2/7 Let x = 48/119 - 2/17. Let 0 - 5/7v2 - 4/7v*3 - xv - 1/7v4 = 0. Calculate v. -2, -1, 0 Let d(v) be the third derivative of -v7/840 + v6/480 + v5/80 - v4/96 - v3/12 - 5v2. Determine w so that d(w) = 0. -1, 1, 2 Let d(q) be the first derivative of q6/120 + q*2 - 2. Let x(s) be the second derivative of d(s). Find b, given that x(b) = 0. 0 Suppose -2u + 9 = z, -5u = -3z - 8 + 2. Determine n so that 0 - 4/3nu + 2/9n*2 + 4/9n = 0. -1/2, 0, 2/3 Let h(g) be the first derivative of -g6/720 - g5/240 + g*4/24 + 2g*3/3 + 4. Let z(n) be the third derivative of h(n). Find r such that z(r) = 0. -2, 1 Let y(h) be the first derivative of -3h*4/4 - 2h*3 + 3h*2/2 + 6h + 5. Factor y(v). -3(v - 1)(v + 1)(v + 2) Suppose -4x - 2y = 12, -5y - 10 = x - 8y. Let s(c) = 4c*2 - 3c + 17. Let i(z) = -z*2 + z - 4. Let o(g) = xs(g) - 18i(g). Let o(b) = 0. Calculate b. 1, 2 Let w(u) be the second derivative of -u5/30 - u4/18 + 2u*3/9 - 11u. Solve w(z) = 0. -2, 0, 1 Let p(n) be the second derivative of -n6/30 + n5/10 + 7n4/12 - 10n*3/3 + 6n*2 - 22n. Solve p(y) = 0. -3, 1, 2 Let l(i) be the first derivative of -i*6/72 + 2i5/45 - i4/72 - i*3/9 + 4i2 - 4. Let m(o) be the second derivative of l(o). Factor m(f). -(f - 1)2(5f + 2)/3 Let a(p) be the second derivative of p4/48 - p3/8 + p*2/4 + 4p. Let a(z) = 0. Calculate z. 1, 2 Suppose -9 = -m - 2m. Let u = 4 - m. Factor -u + 3f + 2 - f*2 - 7f + 4f3. (f - 1)(f + 1)(4f - 1) Let l(a) be the first derivative of -1 + 25/6a4 + 16/15a*5 - 4/3a*2 - 7/3a*6 - 16/9a*3 + 0a. Let l(u) = 0. Calculate u. -1, -2/7, 0, 2/3, 1 Let v(i) be the third derivative of i8/90720 - i7/3780 + i6/360 + i5/60 + 4i2. Let z(u) be the third derivative of v(u). Let z(y) = 0. What is y? 3 Let s(h) = -h2 - h + 1. Let g(m) = m2 - 9m - 3. Let c(y) = 2g(y) + 6s(y). Determine i, given that c(i) = 0. -6, 0 Let c(	{ "pile_set_name": "DM Mathematics" }
ect the terms in -1233o - o2 - 3o*2 + 615o + 620o. -4o*2 + 2o Collect the terms in u*3 - 44934891u*2 + 44934891u2. u3 Collect the terms in -51y3 - y3 + 182y - 182y + 2y*3. -50y*3 Collect the terms in 118i*3 + 1445 - 1445. 118i*3 Collect the terms in 1 + 5467167238s - 1 - 5467167240s. -2s Collect the terms in -562w2 - 23w*3 - 3w*3 + 34w*3 - 9w*3 + 562w2. -w3 Collect the terms in -6k2 + 6423k*3 + 6k*2. 6423k*3 Collect the terms in 0w*3 + 4w - 32w + 4w*3 + 0w*3 - 2w*3. 2w*3 - 28w Collect the terms in -233v + 154v - 498v. -577v Collect the terms in -30m + 15m - 5m2 + 9m + 13m. -5m*2 + 7m Collect the terms in 142400z2 + 142255z*2 - 284654z2. z2 Collect the terms in -52t + 22t*3 + 68t - 16t. 22t*3 Collect the terms in -71863h - 71859h - 71861h - 71862h + 287443h. -2h Collect the terms in -159a - 397a + 141a - 136a. -551a Collect the terms in 94l2 + 259l*2 - 4l*2. 349l*2 Collect the terms in 8t - 7 - 1 - 10 + 18. 8t Collect the terms in -23k*2 + 6k*2 - 111k*2. -128k*2 Collect the terms in -188s + 165s - 51 + 42 - 145. -23s - 154 Collect the terms in -2b + 0b - 8 + 0b + 9b - 8b. -b - 8 Collect the terms in 116875b*3 - 233738b*3 + 116879b*3. 16b*3 Collect the terms in 362 + 381 - 1465 + 358 + 364 + 6s*2. 6s*2 Collect the terms in 12r*3 + 4266955r - 4266955r. 12r*3 Collect the terms in -2 + 13k - 3k + 150k*3 - 525k*3. -375k*3 + 10k - 2 Collect the terms in 15a - 7a - 10a - 5a + 1 + 2a. -5a + 1 Collect the terms in 176j + 2 - 61j - 93j. 22j + 2 Collect the terms in -2v3 - 677 - 76v + 76v + 1351 - 674. -2v*3 Collect the terms in 262m*3 - 14m*2 - 20m*3 + 377m*3 - 78m*3. 541m*3 - 14m*2 Collect the terms in 1464x - 6299x + 2071x - 11166x. -13930x Collect the terms in 14c - 29c - 1242c2 + 1248c*2 + 15c. 6c2 Collect the terms in 8u*3 + 290u*2 - 5u*3 - 15u*3 - 290u*2. -12u*3 Collect the terms in -1397o*3 - 74o*2 - 2923o*3 + 75o*2. -4320o3 + o2 Collect the terms in -596t3 + 736t*3 - 203t*3. -63t*3 Collect the terms in -1654g*2 + 543g*2 + 551g*2 + 4 - 4 + 561g2. g2 Collect the terms in -63 + 275f3 - 273f*3 + 63. 2f3 Collect the terms in -j2 + 1999 + 1275 - 3274. -j*2 Collect the terms in 4 + 4c*2 + 10 + 4c2 - c2. 7c2 + 14 Collect the terms in 49985q - 24897q - 24878q. 210q Collect the terms in 99a - 47a - 467a*2 - 52a. -467a2 Collect the terms in t2 - 5t*2 - 11t*3 + 33t*3 - 6t. 22t3 - 4t*2 - 6t Collect the terms in -197a2 + 96a*2 + 102a2. a2 Collect the terms in -270s2 + 268s*2 + 9 - 46s*3 - 9. -46s*3 - 2s*2 Collect the terms in 4i*2 - 144i - 3i2 + 55i - 773i. i2 - 862i Collect the terms in 1110r3 + 1106r*3 - 2210r*3. 6r*3 Collect the terms in 295p*2 - 62p*2 - 62p*2 - 112p*2 - 60p2. -p2 Collect the terms in 11d + 10d*2 + 51d*3 - 11d2 + d2. 51d3 + 11d Collect the terms in -95 + 4j + j + j - j. 5j - 95 Collect the terms in 1335w - 306w + 818w - 1. 1847w - 1 Collect the terms in -43v2 - 2780 + 5560 - 2780. -43v*2 Collect the terms in -50u*2 + 9 + 12 + 46u*2. -4u*2 + 21 Collect the terms in 2492s*3 - 2s*2 + 1698s*3 + 2s*2. 4190s*3 Collect the terms in -4009d*2 - 1 + 3968d*2 - 5. -41d*2 - 6 Collect the terms in -1374a*3 + 4104a*3 - 1361a*3 - 1367a*3 - 4 + 4. 2a*3 Collect the terms in 130h*3 + 0h + 0h - 11 - 111h*3. 19h*3 - 11 Collect the terms in -2043o*3 + 0o - o + o + 4. -2043o3 + 4 Collect the terms in 23s*2 - 10s*2 - 51s*2 + 34s*2. -4s*2 Collect the terms in 488q*2 + 491q*2 - 4 + 490q*2 - 1460q*2. 9q*2 - 4 Collect the terms in 50b*3 - 40b*3 + 39b - 3b3 - 9b*3. -2b*3 + 39b Collect the terms in -383x + 543x - 156x. 4x Collect the terms in -4x2 + 14x*2 - 3x + 5 + 8x2 + 2x*2. 20x*2 - 3x + 5 Collect the terms in 26919 + 2t2 - 13435 - 13484. 2t*2 Collect the terms in 79a + 78a + 77a - 405a + 78a + 89a. -4a Collect the terms in 306m + 468m - 88m. 686m Collect the terms in -3413 + 3413 + 3h. 3h Collect the terms in -k*3 + 495455370k - 2k2 - 495455370k. -k*3 - 2k*2 Collect the terms in -31r + 6r3 + 94r - 63r. 6r*3 Collect the terms in -66y - 1322y3 + 40y + 26y. -1322y*3 Collect the terms in -943y*2 + 34308 - 34308. -943y*2 Collect the terms in -401x*2 - 30x*2 - 227x*2 - 26x*2. -684x*2 Collect the terms in 11o*3 + 710546o*2 - 710546o*2. 11o*3 Collect the terms in 0 - 241q*2 - 34q + 35q + 0 - q3. -q3 - 241q*2 + q Collect the terms in -6m*2 + 0m*3 + 2m*3 - 76m*2 - 86m*2. 2m*3 - 168m*2 Collect the terms in 32894f - 32894f + 3f*2. 3f*2 Collect the terms in 124s + 55s + 179s + 2 + 264s. 622s + 2 Collect the terms in -95b + 228b + 185b. 318b Collect the terms in -400p2 + 623 - 623. -400p*2 Collect the terms in -4105a*2 + 8706a*2 - 4598a*2. 3a*2 Collect the terms in 5g*2 - 1 + 1 - 4g*2 + 10g*2. 11g*2 Collect the terms in 4415d + 4418d - 8835d. -2d Collect the terms in -q2 + 24229q - 24229q. -q2 Collect the terms in -2c + 474c3 - 2352c*3 + 3c - c. -1878c3 Collect the terms in -191 - 3t*3 - 5t2 + t3 - 2t2 + t2. -2t*3 - 6t*2 - 191 Collect the terms in 0 + 0 - 89l*2 - 7 + 5. -89l*2 - 2 Collect the terms in -18x*3 + 231x + 15x3 + 35x. -3x3 + 266x Collect the terms in -2u2 - 855010u + 855010u. -2u*2 Collect the terms in -103534v - 7 + 103737v + 7. 203v Collect the terms in 318d - 1585d + 317d + 311d + 313d + 325d. -d Collect the terms in 9a + 23a*3 - 5a - 14a - 2a*2 - 28a. 23a3 - 2a*2 - 38a Collect the terms in 3p2 - 2p*2 + 34p + 33p3 - p2 - 31p. 33p3 + 3p Collect the terms in -143c + 50c + 21c + 45c + 8c3. 8c*3 - 27c Collect the terms in -3n - 139 + 4n + 0n + 1006. n + 867 Collect the terms in 151m*2 + 3m - 3m - 315m*2 + 153m*2. -11m*2 Collect the terms in -705l*2 + 3l*3 + 1423l*2 - 718l*2. 3l*3 Collect the terms in 5r*3 - 11r*3 + 8r3 - r3 + 2r3. 3r*3 Collect the terms in 56 - 138 + 20 + 27 - 2x*3 + 35. -2x*3 Collect the terms in -56n*3 - 26n*3 - 10n*3. -92n*3 Collect the terms in -49467095g*2 + 1 + 49467217g*2 - 1. 122g*2 Collect the terms in 23a - 38 + 18 - 46a + 20 + 19a. -4a Collect the terms in 0y*2 + 4y + 9y2 - 7y*2 - 7y2 - y2. -6y2 + 4y Collect the terms in 21 - 12v - 13v - 14v + 17 + 49v. 10v + 38 Collect the terms in -37x*3 + 30x*3 - 136x*3 - 210x*3. -353x*3 Collect the terms in -607 - 11 - 4x + 202 - 302. -4x - 718 Collect the terms in -5411q + 5411q - 9q*2 - 12q*2 + 10q*2 - 12q*2. -23q*2 Collect the terms in -43v*2 + 30v*2 + 57v*2 + 189v*2. 233v*2 Collect the terms in -11t*3 + 25t*3 - 8t*3 - 11t*3 - 7t*3 + 11t3. -t3 Collect the terms in 885w3 - 24 + 852w*3 - 1736w3. w3 - 24 Collect the terms in -48p3 + 8119p*3 - 208p*3. 7863p*3 Collect the terms in -11 + 11 + 121883r. 121883r Collect the terms in -z2 + 28z*3 - 35z*3 - 405 + 405. -7z3 - z2 Collect the terms in 289x3 + 933x*3 + 502x*3. 1724x*3 Collect the terms in 341r*3 - 198r*3 - 136r*3. 7r*3 Collect the terms in 29f*3 - 19860 + 19860. 29f*3 Collect the terms in -1367 + 2t + 513 + 846. 2t - 8 Collect the terms in 10w + 11w + 12w - 2w - 36w. -5w Collect the terms in 235554 + 5w - 9w - 235554. -4w Collect the terms in 210z2 - 49z - 54z - 52z + 155z. 210z*2 Collect the terms in -247v - 295v - 84v - 174v - 1 + 177v. -623v - 1 Collect the terms in -30 - 38 + 4q - 97. 4q - 165 Collect the terms in 1490k - 4467k + 1485k + 1486k. -6k Collect the terms in -36l3 + 59701l - 59701l. -36l*3 Collect the terms in 52q + 44q + 55q - 94q. 57q Collect the terms in -q*3 + 4q*3 + 2q*3 + 4q*3. 9q*3 Collect the terms in 6h*3 + 268h - 2h3 - 813h + 269h + 276h. 4h3 Collect the terms in h3 - 61	{ "pile_set_name": "DM Mathematics" }
472. (s - 92)(s - 4)2 Factor 4n*4 + 236n*3 + 232n*2. 4n*2(n + 1)(n + 58) Factor 10v*2 + 154v/3 + 20/3. 2(v + 5)(15v + 2)/3 Factor -s5 + 12s*4 + 43s*3 + 30s2. -s2(s - 15)(s + 1)(s + 2) Let 5b*3 - 45b*2 + 70b = 0. Calculate b. 0, 2, 7 Solve -4t3/5 - 12t*2 - 152t/5 - 96/5 = 0. -12, -2, -1 Find d such that -2d4/7 - 162d*3/7 + 72d*2 = 0. -84, 0, 3 Suppose 8b*2 - 10b/3 + 2/9 = 0. What is b? 1/12, 1/3 Solve l*5/9 + 4l*4/9 - 16l*2/9 - 16l/9 = 0 for l. -2, 0, 2 Determine g so that 2g5/9 + 10g*4/9 + 2g*3 + 14g*2/9 + 4g/9 = 0. -2, -1, 0 Factor -2d2 + 1456d - 264992. -2(d - 364)2 Suppose -3h*4 - 363h*3 - 336h*2 + 2916h + 4320 = 0. What is h? -120, -2, 3 Solve -3m2/2 - 63m/2 - 81 = 0. -18, -3 Solve 2o4/7 - 4o2/7 + 2/7 = 0 for o. -1, 1 Factor t4/7 - 4t3/7 - 18t*2/7 - 20t/7 - 1. (t - 7)(t + 1)3/7 Suppose 5d*4 + 10d*3 - 215d*2 + 260d + 480 = 0. What is d? -8, -1, 3, 4 Suppose 2a5 + 18a*4 - 50a*3 - 58a*2 + 96a + 88 = 0. Calculate a. -11, -1, 2 Determine i so that 45i2/2 - 425i/2 - 125 = 0. -5/9, 10 Factor 5h4 + 30h*3 - 15h*2 - 100h - 60. 5(h - 2)(h + 1)*2(h + 6) Determine w so that -3w5 - 78w*4 - 303w*3 + 2148w*2 - 3060w + 1296 = 0. -18, -12, 1, 2 Find l, given that -2l4/3 + 34l*3/3 - 10l*2 - 34l/3 + 32/3 = 0. -1, 1, 16 Let -x*4 + 39x*3 + 40x2 = 0. Calculate x. -1, 0, 40 Factor -m4/6 + 4m3/3 + 19m*2/6 + 5m/3. -m(m - 10)(m + 1)*2/6 Let -3m*3 + 831m*2 + 834m = 0. What is m? -1, 0, 278 Find g such that -5g3 - 400g*2 - 9360g - 51840 = 0. -36, -8 Factor 3f3 + 9f*2 + 6f. 3f(f + 1)(f + 2) Let x5/5 + 13x*4/5 + 16x*3/5 - 188x*2/5 + 64x/5 + 256/5 = 0. What is x? -8, -1, 2 Factor 4q3/7 - 6q*2 + 18q/7 + 20/7. 2(q - 10)(q - 1)(2q + 1)/7 Factor 2o2 - 46o + 264. 2(o - 12)(o - 11) Determine m so that 4m4 + 98m*3 + 228m*2 + 178m + 44 = 0. -22, -1, -1/2 Factor -c*5 - 122c*4 - 3340c*3 + 23048c*2 - 48128c + 32768. -(c - 2)*3(c + 64)*2 Find i such that -5i*2 - 275i + 1180 = 0. -59, 4 Solve -2w5/7 - 1392w*4/7 + 1396w*3/7 + 1392w*2/7 - 1394w/7 = 0. -697, -1, 0, 1 Suppose u5/3 + u4/3 - u3/3 - u2/3 = 0. What is u? -1, 0, 1 Factor -25g4 + 3260g*3 - 106925g*2 + 42250g. -5g(g - 65)*2(5g - 2) Solve m5/7 - 9m4/7 + m3 + 9m2/7 - 8m/7 = 0. -1, 0, 1, 8 Let -4z4 + 8z*3 + 44z*2 - 48z = 0. What is z? -3, 0, 1, 4 Determine g, given that -4g4/3 + 148g3/3 = 0. 0, 37 Solve g3/5 + 66g2 = 0. -330, 0 What is m in m4/3 - 2m3/3 - m2 = 0? -1, 0, 3 What is v in -v*5 - 30v*4 - 28v*3 + 30v*2 + 29v = 0? -29, -1, 0, 1 Factor -6m3 - 639m*2 - 1566m - 624. -3(m + 2)(m + 104)(2m + 1) Solve 2x5 + 24x*4 + 38x*3 - 24x*2 - 40x = 0. -10, -2, -1, 0, 1 Solve -2j2/7 - 78j/7 - 148/7 = 0 for j. -37, -2 Determine x so that -6x5/17 + 548x*4/17 - 12314x*3/17 - 9756x*2/17 + 29992x/17 - 8464/17 = 0. -2, 1/3, 1, 46 Factor 3w2 + 27w + 24. 3(w + 1)(w + 8) Solve -2t4/15 + 34t*3/15 - 62t*2/15 + 2t = 0 for t. 0, 1, 15 Let b*5 - 10b*4 + 33b*3 - 40b*2 + 16b = 0. Calculate b. 0, 1, 4 Find z, given that -4z3 + 100z*2 + 484z - 580 = 0. -5, 1, 29 Suppose 2w4 - 138w*3 + 1078w*2 + 138w - 1080 = 0. Calculate w. -1, 1, 9, 60 Let 5l3/4 - 75l*2/4 - 185l - 165 = 0. What is l? -6, -1, 22 Determine m, given that -3m2 + 3 = 0. -1, 1 Factor -s3/3 - 23s*2/3 - 22s/3. -s(s + 1)(s + 22)/3 Factor 5u3/2 - 815u*2/2 + 1615u/2 - 805/2. 5(u - 161)(u - 1)*2/2 Suppose 2h*5 - 28h*4 + 144h*3 - 324h*2 + 270h = 0. What is h? 0, 3, 5 Solve 2i3 - 12i*2 + 10i + 24 = 0 for i. -1, 3, 4 Find o such that -5o5/2 - 43o*4/6 + 7o*3/2 + 43o2/6 - o = 0. -3, -1, 0, 2/15, 1 Factor -g2/7 - 18g/7 - 32/7. -(g + 2)(g + 16)/7 Factor p*4/4 + 3p*3 - 3p*2/4 - 19p/2 - 6. (p - 2)(p + 1)2(p + 12)/4 Factor -2w2/5 + 108w/5 + 592. -2(w - 74)(w + 20)/5 Factor 2z3 - 138z*2 - 140z. 2z(z - 70)(z + 1) Determine i so that -2i*4/15 + 16i*3/3 - 160i*2/3 = 0. 0, 20 Let 9g*5/8 - 15g*4 + 42g*3 - 189g*2/4 + 183g/8 - 15/4 = 0. Calculate g. 1/3, 1, 10 Factor 2n3 + 114n*2 - 8n - 456. 2(n - 2)(n + 2)(n + 57) Factor -w2 - 371w - 1104. -(w + 3)(w + 368) Let -4z*2/7 + 72z/7 - 128/7 = 0. What is z? 2, 16 Find b such that 147b2 + 66864b + 7603392 = 0. -1592/7 Find w such that w*2/2 - 53w/6 - 3 = 0. -1/3, 18 Factor 2w5 - 10w*4 - 16w*3 + 24w*2. 2w*2(w - 6)(w - 1)(w + 2) Factor -4u2 + 100u - 96. -4(u - 24)(u - 1) Suppose 2d5/3 + 20d*4/3 + 24d*3 + 116d*2/3 + 86d/3 + 8 = 0. Calculate d. -4, -3, -1 Factor j*2 - j - 72. (j - 9)(j + 8) Let -5b4/2 - 270b*3 - 1065b*2/2 - 265b = 0. What is b? -106, -1, 0 Solve -c*2 + 9594c - 23011209 = 0 for c. 4797 Factor -m*2/4 + 929m/4 + 931/2. -(m - 931)(m + 2)/4 Determine u so that 6u*5/19 + 1642u*4/19 + 113688u*3/19 + 182776u*2/19 - 150144u/19 - 147968/19 = 0. -136, -2, -2/3, 1 Factor 2x3/7 + 10x*2/7 - 64x/7 + 72/7. 2(x - 2)2(x + 9)/7 Solve -2s3 - 200s*2 + 2158s - 4620 = 0. -110, 3, 7 Factor -d*3/2 - 9d*2/2 + 54. -(d - 3)(d + 6)*2/2 Let -2q*2/3 + 11q/3 - 5 = 0. What is q? 5/2, 3 Factor 5l4 + 5l*3 - 165l*2 + 315l. 5l(l - 3)*2(l + 7) Factor -18v2 + 326v + 1092. -2(v - 21)(9v + 26) Factor s2 - 516s + 66564. (s - 258)*2 Solve 3x*2/2 - 54x + 192 = 0. 4, 32 Factor 2m4/23 + 8m*3/23 - 6m*2/23 - 36m/23. 2m(m - 2)(m + 3)2/23 Factor 5w*4 + 370w*3 - 2355w*2 + 3580w - 1600. 5(w - 4)(w - 1)*2(w + 80) Factor f*2 - 66f + 128. (f - 64)(f - 2) Factor h2/9 + 184h/9 + 61/3. (h + 1)(h + 183)/9 Solve -g4 - 14g*3 - 72g*2 - 162g - 135 = 0. -5, -3 Solve -1008w5 + 2496w*4 + 4148w*3 - 8484w*2 + 2440w - 192 = 0. -2, 1/6, 8/7, 3 Factor 3t2/8 + 3t - 15/2. 3(t - 2)(t + 10)/8 Factor 21v2 - 132v + 36. 3(v - 6)(7v - 2) Factor m5/6 + m4/2 - 5m3/6 - m2/2 + 2m/3. m(m - 1)*2(m + 1)(m + 4)/6 Factor -q4/4 - 29q*3/4 - 297q*2/4 - 1215q/4 - 729/2. -(q + 2)(q + 9)3/4 Find z, given that 5z*4 + 1010z*3 - 2035z*2 + 1020z = 0. -204, 0, 1 Factor 5g5 - 25g*4 + 45g*3 - 35g*2 + 10g. 5g(g - 2)(g - 1)3 Factor v2/2 - 77v/2. v(v - 77)/2 Solve -2f*5/9 + 36f*4 - 13756f*3/9 + 51512f*2/9 - 21014f/3 + 24964/9 = 0 for f. 1, 2, 79 Determine s so that 3s3 + 18s*2 - 27s - 42 = 0. -7, -1, 2 Find x, given that -x*5 + 113x*4 - 333x*3 + 331x*2 - 110x = 0. 0, 1, 110 Factor u*3/3 + 4u*2/3 - 16u/3 - 64/3. (u - 4)(u + 4)2/3 Factor -2r*3/3 - 30r*2 - 88r/3. -2r(r + 1)(r + 44)/3 Factor -6p*3/11 - 330p*2 + 3636p/11. -6p(p - 1)(p + 606)/11 Find u such that -2u*4/21 + 2u*3/7 + 8u*2/21 - 8u/7 = 0. -2, 0, 2, 3 Factor -3v3/4 + 6v*2 - 15v/4 - 21/2. -3(v - 7)(v - 2)(v + 1)/4 Solve n2/3 - 7n/3 - 8/3 = 0. -1, 8 Find k, given that -4k5 - 4k*4 + 48k*3 + 112k*2 + 64k = 0. -2, -1, 0, 4 Factor -2x2 - 60x + 128. -2(x - 2)(x + 32) Factor 2h2/3 + 8h/3 + 8/3. 2(h + 2)2/3 Factor -p4/3 + 2p*3 + 39p*2 + 90p. -p(p - 15)(p + 3)(p + 6)/3 What is b in b2 + 822b + 168921 = 0? -411 Factor -2j2/7 - 200j/7 - 582/7. -2(j + 3)(j + 97)/7 Suppose 15p4 + 190p*3 + 840p*2 + 1440p + 640 = 0. Calculate p. -4, -2/3 What is n in -2n2/7 - 2n/7 + 12/7 = 0? -3, 2 Let 5q2 + 1890q + 3760 = 0. Calculate q. -376, -2 Determine v so that -v*5/4 + 39v*4/4 - 355v*3/4 - 603v*2/4 + 530v - 300 = 0. -3, 1, 20 Determine d, given that 60d4 - 427d*3 + 407d*2 - 28d - 12 = 0. -2/15, 1/4, 1, 6 Determine g so that 4g5/7 + 256g*4/7 + 36g3 = 0. -63, -1, 0 Determine y, given that y3/7 - 18y2/7 - 88y/7 = 0. -4, 0, 22 Suppose 4v2/9 - 152v/9 = 0. What is v? 0, 38 Solve 3o2 + 438o + 435 = 0. -145, -1 Factor -5g5 + 80g*3 - 190g*2 + 165g - 50. -5(g - 2)(g - 1)*3(g + 5) Find b such that b*5/2 - 27b*4 + 195b*3/2 + 125b*2 = 0. -1, 0, 5, 50 Factor -2w*2/11 + 1466w/11 + 2940/11. -2(w - 735)(w + 2)/11 Suppose -f*2/6 + 1445f/3 + 2891/6 = 0. What is	{ "pile_set_name": "DM Mathematics" }
2u2 + 3l*2 - 9l + 2u2 - u wrt l. -24l*2u*2 - 2u*2 + 6 What is the third derivative of -1832b*2o*3 - 16b*2o*2 + 2o*2 + 2 wrt o? -10992b2 What is the third derivative of s3y4 + 2s*3y2 + s2y2 + 133s*2 - 163y*4 wrt y? 24s*3y - 3912y What is the second derivative of 2388g3 + g2 - 8877g wrt g? 14328g + 2 What is the third derivative of -12q2t*3u*2 + 25q*2t3 + q2t2u*2 + 24q*2t*2u - 2q2u wrt t? -72q2u*2 + 150q*2 What is the second derivative of -53q*3 - 21q*2 + 2902q? -318q - 42 Find the third derivative of 9295i*3w - 5i2w - 8iw - 6w + 2 wrt i. 55770w Differentiate -374s + 370. -374 What is the third derivative of -2v*4 - 1382v*3 + 1630v*2? -48v - 8292 Differentiate -138t - 339 wrt t. -138 What is the second derivative of 13p*3 - 4p*2 - 233p? 78p - 8 What is the second derivative of -901a*4 - 2a - 209? -10812a2 Find the first derivative of -99u - 18 wrt u. -99 Find the second derivative of 304j4t + j3 + j2t + jt + 5984j - 1 wrt j. 3648j*2t + 6j + 2t Find the second derivative of -35z5 - 2456z. -700z3 Find the second derivative of -173g*2x*3 + 2gx + 14x*3 wrt g. -346x3 Find the second derivative of -l5x + 442l*4x + 592lx - 3l wrt l. -20l*3x + 5304l2x What is the first derivative of -235d3 - 178 wrt d? -705d2 Find the second derivative of o5 + 240o3 - 8o*2 - o - 3179 wrt o. 20o*3 + 1440o - 16 What is the second derivative of 42c4n*2 + 2c*2n*3 + 2cn3 + 2cn2 + 20cn wrt c? 504c*2n*2 + 4n*3 What is the third derivative of 106c*4p - 17c3p + 2c2p + 12c2 - 5c wrt c? 2544cp - 102p Find the third derivative of -5171j*6 + 2j*2 - j + 22 wrt j. -620520j*3 What is the third derivative of 2k*3nq2s + 4k3nq - 7k*3q2 + k2n + knq2 + 30kns - ks wrt k? 12nq2s + 24nq - 42q2 Find the third derivative of 36o*4 - 11o3 - o2 + 419o wrt o. 864o - 66 What is the derivative of -1874g + 1087? -1874 What is the third derivative of -6w*3y*4 - 3w*3 + 14w*2y*4 + 45y*2 wrt y? -144w*3y + 336w2y Find the second derivative of -64b2f*3 + bf*3 + 4bf + 5f*3 + 48f wrt b. -128f3 Differentiate klr2v + 3klv + 3krv - 2k - 371l - 160r2 with respect to r. 2klrv + 3kv - 320r Find the first derivative of -10fp + 78f - 225p + 56 wrt p. -10f - 225 What is the second derivative of psu + 2pu3 - pu + 31p - 2su3 - 3su - 108u*4 wrt u? 12pu - 12su - 1296u*2 Find the third derivative of cs*5 + 105cs + 53s*6 - 5s*2 wrt s. 60cs2 + 6360s*3 Find the first derivative of -2h*2 + 149h - 309 wrt h. -4h + 149 What is the derivative of -3613z*2 - 35 wrt z? -7226z Find the second derivative of -26cx*2z - 6cxz3 - 2cxz*2 + 11x*2z*3 - 20xz - 3z wrt x. -52cz + 22z3 What is the third derivative of -37q4 + q3 - 3q2 - 76? -888q + 6 Differentiate -31b3y - 328b3 - 7b*2y*2 wrt y. -31b*3 - 14b*2y Find the third derivative of 24d3u3 - d3u2 - 6d*2u*3 + 226du2 wrt u. 144d*3 - 36d*2 Find the third derivative of -2u*4 + 783u*3 + 2u*2 + 2u + 115. -48u + 4698 Find the third derivative of 19540t*5 + 41t*2 - 78t wrt t. 1172400t2 Find the third derivative of 17p6 - p4 + 146p2 wrt p. 2040p*3 - 24p Find the third derivative of 3d3k*3r*2 + 3d*3k*3r - d*3k*2r + d*3kr2 - 18d*3k wrt k. 18d3r*2 + 18d*3r Find the second derivative of -3g4 + 491g3 - g2 - 2495g wrt g. -36g*2 + 2946g - 2 Find the third derivative of 5140k5 - 4220k*2 + 1. 308400k*2 Find the third derivative of 6m*5 - 2m*3 - 313m*2. 360m*2 - 12 What is the derivative of 5064h - 1721? 5064 What is the second derivative of 5ah*2 + a - 822h*2 - 668h wrt h? 10a - 1644 What is the second derivative of -61b*2o*2 - 2b*2 - 5bo2 + 6bo - 2o*2 wrt b? -122o*2 - 4 What is the second derivative of -2f*2hn2z + 10f2hz - 14f*2nz - 4fn2z + 5fn*2 - 4hn2z - 2hz wrt f? -4hn*2z + 20hz - 28nz What is the first derivative of -42u2 - u - 603 wrt u? -84u - 1 What is the first derivative of 873h2 + 269? 1746h Differentiate 15n4 - 12n*3 - 31 wrt n. 60n*3 - 36n*2 What is the third derivative of -222m*3y - 3m2y - m*2 + 11y wrt m? -1332y What is the third derivative of 4249w*6 + 12272w*2? 509880w*3 Find the first derivative of 3517k*2s3 + k2s2 + 3s*3 + 929s wrt k. 7034ks*3 + 2ks2 Find the second derivative of 298m*5 - m - 149. 5960m*3 Find the second derivative of -9100h*2 + 5112h. -18200 What is the derivative of -8hw*2x + 2hw*2 + 269hwx*2 + hx + 283 wrt x? -8hw*2 + 538hwx + h What is the second derivative of -259r2 - r + 182? -518 Find the third derivative of 422o*4 - 9o*2 - 3 wrt o. 10128o What is the third derivative of 2hr*3w*3 - 2hr3w*2 - 66hr2w*3 - 9057hrw*2 + 21hw3 + w wrt w? 12hr3 - 396hr2 + 126h Find the second derivative of 3i5 + 56i*4 + 9i*3 + 867i - 4 wrt i. 60i3 + 672i*2 + 54i Find the third derivative of b*3v*2 - 1262b*3 - 2b*2v*2 - 1859b*2v wrt b. 6v2 - 7572 Find the second derivative of -11d*3y + 4d2y - 1099dy wrt d. -66dy + 8y Find the second derivative of 15o*2y*5 + 212o*2 + 9oy5 - 2o - 2y wrt y. 300o*2y*3 + 180oy3 Find the second derivative of 7j*2sx2 - 3j*2x2 + j2x + 2j*2 + 249jsx - 16x2 wrt x. 14j*2s - 6j2 - 32 Find the first derivative of 1601rv2 + 650v*2 wrt r. 1601v*2 What is the derivative of 760n - 824 wrt n? 760 Differentiate -50s3 - 3s*2 + 1728 wrt s. -150s*2 - 6s What is the second derivative of 2119i2 + 672i? 4238 Find the second derivative of -n*2t*2z + 4n2tz + 17n*2z*3 + 2nt3z*4 - 2nt3z - 4ntz wrt z. 102n*2z + 24nt*3z*2 What is the third derivative of 5142n*3 - 8950n2 wrt n? 30852 Find the second derivative of -h3 - 251h2 - 2h - 266 wrt h. -6h - 502 Find the second derivative of -230s*3 - 2s - 60. -1380s Find the second derivative of -98c*5 - 4c*2 - 1472c. -1960c3 - 8 Find the third derivative of 14n*6 + 16n*3 - 8n*2 - 3 wrt n. 1680n*3 + 96 Find the third derivative of -32h*3r*6 + 2h*3r*3 + 8h*3r + 10r2 wrt r. -3840h*3r*3 + 12h*3 Find the first derivative of 4k*3 + 7k*2n + 3k - 119n wrt k. 12k2 + 14kn + 3 What is the second derivative of 2227s3 + s2 + 2735s wrt s? 13362s + 2 What is the second derivative of -2n3s*2 + 7n*3s - 6n3 - 152n*2s*3 + 2n*2s*2 - 2 wrt s? -4n*3 - 912n*2s + 4n2 Find the third derivative of -1126w*5 - 396w*2. -67560w*2 Find the third derivative of -4197g*5j - g*3j*3 + 11g*2j*2 - 16j*3 wrt g. -251820g*2j - 6j3 Find the second derivative of -40o*3p3 + o3p + 3o*2p*3 - 24op3 + 2op2 - 13op wrt o. -240op3 + 6op + 6p*3 What is the first derivative of -5503u - 8561? -5503 What is the third derivative of -2348d6j - d*4j + d*2 - 57dj - 20 wrt d? -281760d*3j - 24dj Differentiate -15784z4 - 9307. -63136z*3 Differentiate -8m*2s - 9988m2 - 26ms + 3s with respect to s. -8m2 - 26m + 3 What is the third derivative of 476f3 - 125f*2? 2856 Differentiate -2bfl*2q - 2bflq - 11blq - 8fl2 + 2fl + 3fq wrt b. -2fl2q - 2flq - 11lq Differentiate -4317y*3 + 1385 with respect to y. -12951y*2 What is the third derivative of -5s*4 - 330s*3 + 68s*2 + 3s - 5? -120s - 1980 What is the first derivative of 12f*2 - 10f + 366? 24f - 10 Find the third derivative of 277os4 - 3os3 + os*2 + 39o + 10s2 wrt s. 6648os - 18o Find the third derivative of -23j6 + 5j*5 - 1333j*2 wrt j. -2760j*3 + 300j*2 What is the second derivative of 13v*4 + 60v*3 - 257v + 1 wrt v? 156v2 + 360v Find the second derivative of 26239w4 - 7680w wrt w. 314868w*2 What is the third deriva	{ "pile_set_name": "DM Mathematics" }
. Determine s(q(n)). 1444n2 Let u(g) = 4g. Let a(l) be the second derivative of -8l + 2l*3 - 2l - 12l + 8l. Calculate u(a(o)). 48o Let p(m) = -2 + 6 + 25m - 1 - 146m. Let h(w) = -w2. What is p(h(u))? 121u*2 + 3 Let s(q) = -9q. Suppose -11d = v - 7d - 8, v + 4 = 2d. Let l(b) be the third derivative of 1/30b*5 + 0b + vb3 - 4b*2 + 0b*4 + 0. What is s(l(g))? -18g*2 Let h(t) = 9 - 17 + 8 + 11t2. Let i(d) be the third derivative of -d5/30 + 7d2. Calculate h(i(m)). 44m*4 Let i(g) be the third derivative of -3g*2 + 0g*3 + 0g + 0 + 1/6g4. Let a(o) = 5o*2. What is i(a(z))? 20z*2 Let w(g) = 25g. Let u(l) = -13l. Let s(k) = -13u(k) - 6w(k). Let y(b) = -3b*2 + 6329 - 6329. Give y(s(i)). -1083i*2 Let d(p) = 1969p. Let b(x) = 26x2. Give b(d(k)). 100800986k*2 Let d be 18/30 - 84/15. Let s = 11 + d. Let i(n) = -sn + 3n - 57 + 57. Let h(g) = 5g*2. Determine h(i(j)). 45j*2 Let d(c) be the second derivative of -5c*3/6 + 3c. Let l(k) = -23k2 - 4. Let h(u) = -96u*2 - 17. Let q(n) = -4h(n) + 17l(n). Give q(d(x)). -175x*2 Let h(q) = -59q. Let j(c) = 30c. Let i(b) = -3h(b) - 5j(b). Let r(s) = 5s*2. What is r(i(p))? 3645p*2 Let g(h) = -2h. Let c(q) = -2 + 193q + 0 - 2 - 188q. Give g(c(k)). -10k + 8 Let g(y) = -40y*2. Let q(l) be the first derivative of -5l*3/3 - 41. Calculate g(q(z)). -1000z*4 Let p(t) = -5t. Let y(g) be the first derivative of 28g3/3 + 27. Calculate p(y(n)). -140n*2 Let a(r) be the first derivative of -383r3/3 + 391. Let m(l) = l2. Give a(m(j)). -383j4 Let k(h) = 2h. Let x(o) = -25 - 20o + 64o + 0 - 21o - 22o. Calculate x(k(r)). 2r - 25 Let d(o) be the third derivative of o5/12 - 6o*2 + 4. Let s(a) = 9a*2. Calculate d(s(b)). 405b*4 Let a(r) be the first derivative of 1/2r*2 + 1 + 0r. Let z(u) = -18u - 7. Let k(g) = 6g + 2. Let b(i) = -7k(i) - 2z(i). Calculate a(b(p)). -6p Let h(t) = -t2 + 4t. Let i(n) = -5n2 + 30n. Let w(o) = 4h(o) - i(o). Let g(c) = -5c + 5c - c2. Give g(w(d)). -d4 + 28d*3 - 196d*2 Let v(h) = 3787705h. Let t(a) = a*2. Calculate t(v(j)). 14346709167025j*2 Let k(b) = -7 - 6 - 1 + 14 - b. Let z(w) = w + 136. Calculate z(k(v)). -v + 136 Let f(b) = -89 - 28 - 3b + 117. Let h(a) = -2a2 - 24. What is h(f(z))? -18z*2 - 24 Let m(s) = -4s - 3s + 448 - 2s - 448. Let u(a) = -11a. Calculate m(u(q)). 99q Let v(h) = 164h - 78h - 84h. Let y(q) = -3q*2 - 22q. Determine y(v(d)). -12d2 - 44d Let c(f) = 13f + 9f + 5f - 25f. Let s(r) be the second derivative of 5r3 - 134r. Give c(s(m)). 60m Let l(d) = -8d*2. Let u(j) = 4j. Let f = -7 - -1. Let r(i) = -2. Let t(k) = k + 10. Let y(w) = 5r(w) + t(w). Let h(x) = fy(x) + 2u(x). What is h(l(n))? -16n*2 Let k(j) = 3j - 4. Let a(x) = 4x2 + 60x - 80. Let n(b) = 3a(b) - 60k(b). Let l(d) = -8d2. Determine l(n(s)). -1152s*4 Let j(d) = 4d*2 + 3d. Let n(h) = 2h2 + 5h - 5. Let z(a) = 2a2 + 6a - 6. Let b(k) = -6n(k) + 5z(k). Calculate b(j(s)). -32s4 - 48s*3 - 18s*2 Let s(l) = -18 + 209 - 6l - 191. Let d = 6 + -4. Let b(n) = n - n - dn. What is b(s(g))? 12g Let s(t) = -18t2. Let g(m) = -17m*2 + 8m + 8. Let j(u) = 2u2 - u - 1. Let d(z) = -3g(z) - 24j(z). Give d(s(p)). 972p4 Let f(i) = i2 - 140i + 5. Let u(c) = 182c*2. Calculate f(u(z)). 33124z*4 - 25480z2 + 5 Let p(v) be the third derivative of v8/3360 + 11v5/60 - 5v*2. Let z(l) be the third derivative of p(l). Let g(i) = 5i*2. Determine g(z(f)). 180f*4 Let n(d) = -8d - 7. Let b(m) = -5m - 5. Let f(z) = -7b(z) + 5n(z). Let y(a) = -3a. Calculate y(f(h)). 15h Let v(z) = z. Let s = 74 + -70. Let q(c) = 3c. Let m(w) = sq(w) - 11v(w). Let f(y) = 2y - 17. Calculate f(m(l)). 2l - 17 Let o(s) = s*2 - 13. Let c be o(-4). Let a(y) = -y + 7 - 7 + cy. Let r(w) = -3w - 5. Let d(i) = -2i - 6. Let m(p) = -5d(p) + 6r(p). Calculate m(a(n)). -16n Let q(z) = -7z - 3. Let c(a) = -112a - 49. Let t(p) = 3c(p) - 49q(p). Let x be 2/3 + (-8)/(-6). Let r(w) = -w2 + 6 - wx - 6. Calculate t(r(h)). -14h*2 Let j(k) = 133k*2 - 2. Let g(s) = 8646s*2 - 131. Let v(p) = 2g(p) - 131j(p). Let y(w) be the third derivative of -w4/12 + 27w*2. Give y(v(x)). 262x*2 Let f(g) = -2g. Let m(y) = -164345y2 - y. Calculate f(m(l)). 328690l*2 + 2l Let h(c) be the third derivative of -c*5/15 + 1394c*2. Let g(q) be the second derivative of 11q*4/12 - q. Determine g(h(p)). 176p*4 Let a(w) = -110w*2 + 29w*2 + 31w*2 + 40w*2. Let r(p) = -2p*2. Give r(a(z)). -200z*4 Let r(g) be the first derivative of 65g*2 + 483. Let k(j) = 2j. Give k(r(p)). 260p Let y(v) = -20v - v + 14v + 6v. Suppose 0s = -4s - k + 9, -k + 11 = 5s. Let g(u) = -4u*2 + 3u - 9us - 3u. Give g(y(o)). -13o2 Let s(l) = -1438l*2. Let j(f) = -412f*2. What is j(s(w))? -851951728w*4 Let f(h) = -35h. Let w(o) = 88 - 88 + 21o - 12o. Determine w(f(d)). -315d Let y(m) = 16m - 5. Let i(p) = 24p - 7. Let g(t) = 5i(t) - 7y(t). Suppose -4s + 7s - 3300 = 0. Let f(w) = -s + 1100 - w. What is g(f(q))? -8q Let h(t) = -4t2. Suppose -4j + 8 = -5v, -5v - 4j - j + 10 = 0. Let s = -3 + 3. Let r(i) = -2i + si + vi. Calculate h(r(n)). -16n2 Let p(m) = -5m*2. Let v(i) = 139381i. Give p(v(r)). -97135315805r2 Let z(n) = 2n - 19n2 + 2 + 6n - 8n. Let v(m) = 455m*2 - 49. Let b(u) = -2v(u) - 49z(u). Let a(i) = -3i. What is b(a(w))? 189w2 Let z(c) = -19c - 4. Let l(y) = -69y + 8. Determine z(l(h)). 1311h - 156 Let z be (-9)/63 + 338/14. Let j(h) = -z + 11 + 13 - 20h. Let r(s) = s. Calculate j(r(l)). -20l Let o(d) = -42d - 1. Let j(k) = -2. Let w(y) = -13y + 156. Let r(h) = 78j(h) + w(h). Calculate r(o(q)). 546q + 13 Let v(k) = 861k2. Let z(g) be the second derivative of -g4/6 + 574g. Calculate z(v(n)). -1482642n4 Let p(o) = 3o*2. Let v(u) = 4379u. Give p(v(i)). 57526923i2 Let f(l) be the first derivative of 3l*2/2 - 152. Let s(k) = -27k*2. Give f(s(n)). -81n*2 Let o(x) = -12x. Let z(l) = 3553l2. What is z(o(w))? 511632w2 Let y(w) = -w2 + 2w. Let k(r) = 14r + 9r - 24r. Let h(u) = -2k(u) - y(u). Let z(v) = 7v. What is h(z(g))? 49g2 Let t(j) be the third derivative of -7j*2 + 0j + 0j3 + 2/15j*5 + 0j4 + 0. Let v(r) = -r2. Give v(t(q)). -64q4 Let l(c) = -12c. Let r(b) = 14b2 - 9b*2 + 4b*2. Determine r(l(q)). 1296q*2 Let l(a) = -4a*2. Let m(x) = -31 + 3x + 37 - 5. What is l(m(w))? -36w2 - 24w - 4 Let m(y) = 3y2. Suppose -5o = -2o - 3f, 0 = -3f + 9. Let j(l) be the second derivative of 1/6l*4 + 0l*o + 0 + 0l*2 - 4l. Give m(j(n)). 12n4 Suppose -4l + 4c - 3c = -11, 5l - 7 = -c. Let o(y) = -11y*2 + 6y*l - 2y*2 + 6y*2. Let w(j) = -3j*2. Determine w(o(s)). -3s*4 Let a(s) be the first derivative of -385s*3/3 - 710. Let c(t) = -t. What is c(a(n))? 385n*2 Let g(j) = 7j. Let r(y) = -334922y2. Give g(r(t)). -2344454t*2 Let i(t) = 26t*2. Let f(p) = 6378 - 6378 - 12p. Give f(i(j)). -312j2 Let i(q) be the second derivative of -q4/2 - 67q. Let r(c) = -16c2. Calculate i(r(s)). -1536s4 Let l(r) = r2. Let f(y) = -1203y2 + 10y + 5. Let q(o) = -7820o2 + 64o + 32. Let d(w) = 32f(w) - 5q(w). Calculate l(d(t)). 364816t4 Let t(h) = -4h + 6h + 2h. Let m be ((-11)/(-1))/(-9 + 10). Let g(p) = -8p2 + 20p*2 - mp*2. Calculate t(g(n)). 4n*2 Let s(n) = -9n*2 + 8n + n - 8n. Let k(a) be the first derivative of a2 - 405. What is s(k(v))? -36v*2 + 2v Suppose -5x + 7x - 4 = 0. Let i(j) = j*x + 3j*2 - 5j*2. Let w(l) = 2l. Give i(w(q)). -4q2 Let l(s) = -2s + 285711. Let i(p) = -2p. What is i(l(a))? 4a - 571422 Let r(q) = 8q + 4. Let t(s) = -s - 1. Let o(w) = r(w) + 4t(w). Let c = 9 + -9. Let a(u) = 0u - u + cu - u. Calculate o(a(m)). -8m Let m(v) = -15v*2. Let s(f) = 9 + 5 + 10f*2 - 14 - 5f*2. Calculate s(m(c)). 1125c*4 Let r(u) = 2u. Let y(n) be the third derivative of n*4/3 + 4n*3/3 + 81n*2. Calculate y(r(a)). 16a + 8 Suppose -6x = -x. Suppose x = -6m + 8m - 6. Let t(f) = mf - 4f + 0f + 2f. Let b(p) = 18p**2. What is b(t	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.