Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
t*2/7 + 14478t/7 + 10854/7 = 0. -1809, -3, -1, 1 Let -225w5/4 - 1255w*4/2 - 2290w*3 - 6195w*2/2 - 6215w/4 - 175 = 0. Calculate w. -5, -4, -1, -7/45 Find m such that -m*5/7 - 979m*4 - 20553m*3/7 - 20551m*2/7 - 6850m/7 = 0. -6850, -1, 0 Solve -5t4 - 4600t*3 - 63415t*2 + 4600t + 63420 = 0. -906, -14, -1, 1 What is r in 2r3 + 100r*2 - 2774r + 14768 = 0? -71, 8, 13 Factor -3l4/7 - 66l*3/7 - 423l*2/7 - 660l/7 - 300/7. -3(l + 1)2(l + 10)*2/7 Factor 7y*3 + 2948y*2 + 3348y - 5040. (y + 2)(y + 420)(7y - 6) Solve -2j*2/5 + 231872j/5 + 695634/5 = 0 for j. -3, 115939 Factor 6v2 - 12760v + 8504. 2(v - 2126)(3v - 2) Solve -h4/3 + 258794h*3 - 50230750827h*2 = 0. 0, 388191 Determine c so that -4c*4/5 + 22764c*3/5 - 159208c*2/5 + 318336c/5 - 181888/5 = 0. 1, 2, 4, 5684 Factor 3w2 + 48402w - 581256. 3(w - 12)(w + 16146) Factor -m*3/2 + 4149m*2 + 16599m/2 + 4150. -(m - 8300)(m + 1)2/2 Solve -6u*5 - 9045u*4 + 4542u*3 + 27123u*2 - 31662u + 9048 = 0. -1508, -2, 1/2, 1 What is k in -6k2/7 - 364330k/7 + 121444/7 = 0? -60722, 1/3 Determine w so that -3w5 + 210w*4 + 5103w*3 + 26790w*2 - 5100w - 27000 = 0. -10, -1, 1, 90 Let n*4 + 91n*3 + 1807n*2 - 8451n + 6552 = 0. Calculate n. -56, -39, 1, 3 Suppose 3h2 + 1335h/2 - 40392 = 0. What is h? -272, 99/2 Find z such that -2z4/15 + 22z*3/15 + 262z*2/15 + 254z/5 + 228/5 = 0. -3, -2, 19 Suppose 10o3/19 - 1196o*2/19 - 5440o/19 - 1984/19 = 0. What is o? -4, -2/5, 124 Find l such that -3l3 + 82176l*2 + 164361l + 82182 = 0. -1, 27394 Factor 3b3 - 16191b*2 - 64803b - 48609. 3(b - 5401)(b + 1)(b + 3) Let -r3/5 - 939r*2/5 + 3768r/5 - 3772/5 = 0. What is r? -943, 2 Let -1388l5/5 + 6944l*4/5 - 8348l*3/5 + 24l2/5 = 0. What is l? 0, 1/347, 2, 3 Suppose f5/11 + 32f4/11 + 183f*3/11 - 108f*2 + 972f/11 = 0. What is f? -18, 0, 1, 3 Determine q so that 14q2/3 + 3646q/3 - 696 = 0. -261, 4/7 Suppose -2b4/11 + 296b*3/11 + 3334b*2/11 - 27780b/11 + 45504/11 = 0. Calculate b. -16, 3, 158 Factor 2v3 - 142v*2 + 2572v - 4592. 2(v - 41)(v - 28)(v - 2) Factor -2p*2/13 + 36p + 20054/13. -2(p - 271)(p + 37)/13 Find r, given that 242r4/5 - 13398r*3/5 - 52264r*2/5 + 20328r/5 - 1888/5 = 0. -4, 2/11, 59 What is k in 3k5/4 + 109k*4/2 + 2993k*3/4 - 19471k*2/2 - 18440k + 7200 = 0? -40, -2, 1/3, 9 Let -q*3/3 - 188q*2/3 - 1279q - 2310 = 0. What is q? -165, -21, -2 Solve 3p3/4 + 458p*2 + 3047p/4 + 609/2 = 0 for p. -609, -1, -2/3 Determine c so that 3c4/2 + 1323c*3/2 + 14247c*2/2 + 24537c/2 + 5805 = 0. -430, -9, -1 Solve 4o4 - 7384o*3 + 80868o*2 - 234992o + 205520 = 0. 2, 7, 1835 Suppose 2y2/17 - 1656y + 5827464 = 0. What is y? 7038 Solve -5x3/6 - 485x*2/3 - 18055x/6 + 9515/3 = 0. -173, -22, 1 Determine o, given that -o*5/3 + 19o*4/3 - 29o*3/3 - 91o*2/3 + 34o = 0. -2, 0, 1, 3, 17 Factor 4l2 - 780l + 15224. 4(l - 173)(l - 22) Let -r*5 - 207r*4 + 1271r*3 - 1497r*2 - 1270r + 1704 = 0. Calculate r. -213, -1, 1, 2, 4 Suppose -z*3 - 333z*2 + 4104z + 6394032 = 0. Calculate z. -228, 123 Let -2j3/21 - 550j*2/7 + 53276j/21 + 58208/7 = 0. What is j? -856, -3, 34 Suppose m*4 + 1216m*3 + 46913m*2 - 149266m + 101136 = 0. Calculate m. -1176, -43, 1, 2 Suppose -3r4 + 4299r*3 + 60627r*2 + 212709r = 0. What is r? -7, 0, 1447 Find y, given that -y*5 + 19546y*4 - 95570149y*3 + 572893264y*2 - 859154260y + 381811600 = 0. 1, 4, 9770 Let 69f4/7 - 15390f*3/7 - 14925f*2/7 + 31590f/7 - 192 = 0. Calculate f. -2, 1/23, 1, 224 Factor -2f4 + 758f*3 + 155992f*2. -2f*2(f - 527)(f + 148) Solve 4u*4 + 2092u*3 - 6328u*2 - 8416u = 0. -526, -1, 0, 4 What is p in 3p3 + 3432p*2 + 191487p + 2739978 = 0? -1086, -29 Find z, given that -2z4/5 - 1574z*3/5 - 401286z*2/5 - 6564274z - 32421656/5 = 0. -307, -172, -1 Determine f, given that -3f2/4 + 138861f/4 - 902343/2 = 0. 13, 46274 Let 2v3 - 10708v*2 + 14354050v - 57245000 = 0. What is v? 4, 2675 What is t in -5t4 + 60t*3 + 5290t*2 + 27660t - 33005 = 0? -23, -7, 1, 41 Factor 55597s2/3 + 111197s/3 + 2. (s + 2)(55597s + 3)/3 Factor q*3/2 + 10915q*2/2 + 87247q/2 - 98163/2. (q - 1)(q + 9)(q + 10907)/2 Factor 3y4/7 - 1107y*3 + 260865y*2/7 - 2209983y/7. 3y(y - 2549)(y - 17)2/7 Let -4b*2/7 - 219192b/7 - 3002820804/7 = 0. Calculate b. -27399 Let -d*3/3 - 1188d*2 + 10711d/3 + 11890 = 0. What is d? -3567, -2, 5 Let 48a3 + 46a*2 - 962a + 40 = 0. Calculate a. -5, 1/24, 4 Find n, given that 2n4/7 + 724n*3/7 - 28008n*2/7 + 257904n/7 = 0. -398, 0, 18 Find j such that -20j4 + 10928j*3 + 39524j*2 + 41776j + 13200 = 0. -2, -1, -3/5, 550 Let -d*4/3 - 3007d*3/3 + 6019d*2/3 + 3007d/3 - 2006 = 0. What is d? -3009, -1, 1, 2 What is r in 11r3 - 1076r*2 - 13385r - 2398 = 0? -11, -2/11, 109 Factor 19m2 + 2122m - 672. (m + 112)(19m - 6) Factor 25m4 - 17235m*3 - 45009m*2 + 20071m - 2076. (m - 692)(m + 3)(5m - 1)2 Factor -j3/3 - 2435j*2/3 - 2434j/3. -j(j + 1)(j + 2434)/3 Determine k so that k*4/3 - 3241k*3/3 + 853880k*2 + 105025600k/3 - 107584000/3 = 0. -40, 1, 1640 Factor -3l2/7 - 1149l - 24102/7. -3(l + 3)(l + 2678)/7 Solve -2j2/5 - 408j + 2042/5 = 0. -1021, 1 What is s in s*2/10 + 2052s/5 - 78337/10 = 0? -4123, 19 Solve 3w5 - 2850w*4 - 2943w*3 + 85818w*2 - 216996w + 159768 = 0 for w. -7, 2, 951 What is x in -x*2 + 16512x + 16513 = 0? -1, 16513 Solve 2l2 + 6410l - 12828 = 0 for l. -3207, 2 Determine t, given that -3t4/7 + 111t*3/7 + 1731t*2/7 + 231t = 0. -11, -1, 0, 49 What is k in -k*4/7 + 16k*3 - 221k*2/7 + 110k/7 = 0? 0, 1, 110 Solve -9z4/5 + 3120z*3 - 36367z*2/5 + 5540z - 6924/5 = 0. 2/3, 1, 1731 Find u, given that -3u2/5 - 7203u/5 + 5772 = 0. -2405, 4 Let -39a4/4 - 591a*3/2 - 5247a*2/4 - 2013a - 987 = 0. What is a? -329/13, -2, -1 Factor 4v4 + 13796v*3 + 13784v*2 - 27584v. 4v(v - 1)(v + 2)(v + 3448) Factor -574564v3/7 + 3451932v*2/7 - 27297v/7 + 54/7. -(v - 6)(758v - 3)2/7 Find p such that p3/2 - 10981p2/2 = 0. 0, 10981 Factor -3i*2 - 139785i - 698850. -3(i + 5)(i + 46590) Let -4v2 - 1092v - 8480 = 0. Calculate v. -265, -8 What is h in 15h5 + 978h*4 + 7044h*3 + 10296h2 = 0? -286/5, -6, -2, 0 Suppose -t4/8 + 85t3/8 + 1119t*2/8 + 4315t/8 + 2425/4 = 0. Calculate t. -5, -2, 97 Suppose u*4/2 - 61u*3/2 - 468u*2 + 2222u - 2336 = 0. Calculate u. -16, 2, 73 Suppose -y*5/3 + 239y*4/3 - 9130y*3/3 + 49124y*2/3 - 94504y/3 + 61760/3 = 0. Calculate y. 2, 40, 193 Factor -2a3 + 1264a*2 - 130080a + 3686400. -2(a - 512)(a - 60)2 Factor k4/4 + 255k3/4 - 3034k2. k2(k - 41)(k + 296)/4 Find k such that k*5/2 - 33k*4 + 472k*3 - 1911k*2 - 945k/2 + 1944 = 0. -1, 1, 9, 48 Suppose 3d5 + 249d*4 - 801d*3 - 2241d*2 + 6966d = 0. What is d? -86, -3, 0, 3 Solve -i*2/4 + 3439i/4 + 11219 = 0. -13, 3452 Factor -10x3/7 + 13488x*2/7 - 4620114x/7 + 48336588/7. -2(x - 669)2(5x - 54)/7 Find m, given that -136m*4/13 + 36986m*3/13 - 2476424m*2/13 - 5214494m/13 - 225228/13 = 0. -2, -3/68, 137 Factor 2l3 - 3424l*2 - 55296l. 2l(l - 1728)(l + 16) Let 2j*3/3 - 212j*2 - 12906j - 180792 = 0. What is j? -27, 372 Find f such that 5f4 - 1410f*3 + 9695f*2 - 19290f + 11000 = 0. 1, 2, 4, 275 Factor -3x2 - 1959x - 17388. -3(x + 9)(x + 644) Factor 5k2 - 495k - 9860. 5(k - 116)(k + 17) Find l such that -3l5 - 375l*4 - 4059l*3 + 1119l*2 + 11454l - 8136 = 0. -113, -12, -2, 1 What is q in 3q3/7 + 1933170q*2/7 + 311428854075q/7 = 0? -322195, 0 Suppose 3d3 - 264d*2 + 7344d - 62208 = 0. What is d? 16, 36 Factor 4j3 + 55128j*2 + 55124j. 4j(j + 1)(j + 13781) Determine s so that 4s*2 + 1078456s + 1078452 = 0. -269613, -1 Solve 2v4/17 - 52v*3/17 + 270v*2/17 + 4v/17 - 1520/17 = 0. -2, 4, 5, 19 Suppose -52t5 + 2238t*4 + 9430t*3 + 11750t*2 + 4422t - 188 = 0. What is t? -2, -1, 1/26, 47 Let -5r3 - 8205r*2 - 3361995r +	{ "pile_set_name": "DM Mathematics" }
5u + 0u - 3u)(2 + 2u2 - 2) to wu*3 + yu + g + fu2 and give w. 6 Express -2t*2 - 8 + 6 + 141t - t*3 - 141t as nt + c + zt*2 + yt*3 and give z. -2 Rearrange (-1 + 2 + 1)(6 + 2 + 4)(3 - 4 - 1)(1 - 1 - h) to the form i + ch and give c. 48 Rearrange (2m*2 + 0m*2 - 4m*2)(-4 - 2 + 4) - 42m2 + 49m*2 + 65m*2 + 2m2 - m2 - 5m2 to the form hm*2 + wm + x and give h. 72 Express 43j2 + 19j - 2 - 73j2 + 35j*2 + 25j*2 as b + nj*2 + tj and give t. 19 Rearrange -51y2 - 11y + 4y - 2 + 4y to dy2 + f + ny and give d. -51 Rearrange -9844 + 5o2 + 0o*2 - o + 9935 to i + go*2 + ao and give g. 5 Express r - 58r + 2r3 - r3 as vr2 + n + ar*3 + xr and give a. 1 Rearrange (23 - 37 - 22 + (2 - 4 + 3)(-1 + 1 - 2))(-2p2 + p2 + 6p*2) to the form jp*2 + r + dp and give j. -190 Rearrange (10 + 8 - 8)(-3m*2 + 3m*2 + 9m*4) + 2m*4 - 23m + 8m - 2m to the form um4 + rm*3 + tm*2 + n + hm and give u. 92 Rearrange -1501m - 194m - 202m to wm + r and give w. -1897 Rearrange 19k + 13k - 47k - 2k*3 + 16k + 1 - 56k2 to bk*2 + fk + l + mk3 and give m. -2 Express (3 - 3 + m)(15m - 20 + 20) + (2m - 4 + 4)(-2 + 2 + 2m) - 2 + 3 + 12m2 + 1 as g + xm*2 + km and give g. 2 Rearrange u*2 - 47u*2 - 13u*2 + 27 + 21u*2 to the form vu + x + su2 and give x. 27 Express (-4u*2 + 0u*2 + 6u*2)(-20u - 141 + 141) as n + ku + wu3 + ou*2 and give w. -40 Express 32f + 17f + 6f + 64f in the form lf + p and give l. 119 Rearrange -125 + 126d - 122 + 247 to the form r + yd and give r. 0 Express (-4 + 4 + 1)(0b - 3b + 0b)(0b + 4b + b) as xb*2 + c + ib and give x. -15 Rearrange -76s2 + s - 4s + 21s2 + 39s*2 - 3s to bs + y + ks*2 and give k. -16 Express (-4 + 4 + r)(54r + 25r - 22r) + (2 - 2 - r2)(5 - 2 - 2) - 5r2 - 2r*2 - 3r*2 - 2r*2 + 3r - 3r in the form k + ir*2 + or and give i. 44 Express l*3 - 15l*4 + 3 + 7 - 3l - 13 + 13l4 as t + il*2 + nl*3 + zl*4 + kl and give z. -2 Rearrange 7c2 + c2 + 25c*3 + c - 12c*2 + 1 - 2c*4 - 23c*3 to mc*4 + gc + hc2 + vc*3 + p and give v. 2 Rearrange 151 - 141 + 4w*2 + 158 + 78 to the form nw*2 + m + hw and give m. 246 Express -9 + 60 - 2 - 3q in the form x + hq and give h. -3 Rearrange 5q2 + 5q*2 - 13q*2 + q + 5q*2 - 205 to the form b + pq*2 + mq and give b. -205 Rearrange 257j2 + 5 - 10j - 3 - 2 - 228j2 to ij*2 + uj + a and give i. 29 Express 3z2 - 122z - 2z2 - 46z as yz2 + h + uz and give u. -168 Rearrange 2116i2 + i4 + i - 2109i*2 + 14i*3 + 3 - 4 to zi*2 + ri*4 + ti*3 + a + qi and give q. 1 Express (v - 2 - 5 + 6)(4v*2 - 14 + 17 - 3v*2) as mv*2 + xv + f + wv3 and give m. -1 Rearrange (-499257c + 499257c + 638c*2)(c + c - 4c)(6c - 4c - 4c) to the form hc + d + pc3 + yc*4 + ic*2 and give i. 0 Rearrange -463 + 912 - 449 - 415p to o + gp and give g. -415 Express -4 - 2 + 685n*3 - 684n*3 - 5 - 2n - 2n2 - 3 as gn*3 + mn*2 + on + w and give m. -2 Express -8j + 3j + 7j - 2j + 118j2 as gj + l + pj2 and give p. 118 Express -1427d*2 + 31 + 8 - 39 + (-3d - 3d + 4d)(-1 - 2d + 1) in the form s + rd + fd*2 and give f. -1423 Express 5 + 5p + 9p3 + p2 + 0p - 1 - 11p3 as n + dp*2 + ap*3 + qp and give d. 1 Express (0 + 13v2 + 0)(2 - 34v2 - 28v*2 - 2) in the form tv*4 + gv + sv2 + wv3 + i and give t. -806 Express (-c2 + c*2 - 4c*2)(-3c + 2c - 6c)(-16 - 16 + 6) in the form i + fc + mc*3 + bc*2 and give m. -728 Express 238b + 52b - 6b + 26b as rb + y and give r. 310 Rearrange -690 + 4a - 3a*3 + 54a*4 - 2a - 2a + 689 to na*2 + va*4 + t + ja*3 + xa and give j. -3 Express -1 + 2q3 + 1 - 11q*4 + 36q*2 + 10q*4 + 0q*4 - 1 in the form vq*3 + hq*4 + jq + n + tq2 and give h. -1 Express 3 + g3 + 3g*2 + 3g*3 - 11g*3 + 0g*3 in the form o + rg + cg2 + dg*3 and give d. -7 Rearrange 786k + 248k - 378k + 312k to the form lk + p and give l. 968 Rearrange 2w2 + 80 + 0w2 - 77 + w3 + 14w to kw + i + hw3 + vw*2 and give i. 3 Rearrange 4h*3 - 40h*4 + 14 - 2h*2 + 2h*2 - 37h*4 - 11h + 79h4 to the form ah*4 + b + xh + zh3 + yh*2 and give a. 2 Rearrange -16k*2 + 9k - 36k2 + 54k*2 to t + yk + ok2 and give y. 9 Rearrange -111 + 57 - m4 - 27m*4 + m + 56 - 2m*3 to zm*2 + im*4 + cm + x + wm3 and give w. -2 Rearrange (869 - 186 + 397 + 39)(-a + 5a - 2a) to s + ca and give c. 2238 Express -410r*2 + 49r*2 - 377r*2 + (2r - 2r - r2)(-2 + 1 - 1) as x + lr + sr*2 and give s. -736 Express 27 - 2 + 139l - 29 in the form c + vl and give c. -4 Express 482b*2 - 3b*3 - 481b*2 + 5b*3 + 54b in the form jb2 + zb*3 + tb + c and give t. 54 Rearrange 2 - 258i + 0 - 2 to yi + x and give y. -258 Rearrange ((-t + 2t + t)(0t + 2t - 3t) + (9t*2 - 7t*2 - 14t*2)(-1 + 10 + 14))(2t - 3 + 3) to s + vt + yt*2 + ft*3 and give f. -556 Express (-4a - a + 3a)(-4 + 2a + 4) + 2a2 - a2 + a*2 + 2a*2 + 0a*2 - 4a*2 - 4a*2 + 2a*2 - 7a*2 as s + oa + ka2 and give k. -13 Rearrange -2f - 9f4 - 663f*3 + 3f + 661f3 - 3f*2 + 14f*4 to wf*2 + if + hf4 + y + df*3 and give w. -3 Express (-30 + 30 - 195n*2)(-1 - 3 + 1) in the form sn + vn*2 + d and give v. 585 Express 32i2 - i2 - 5i + 116i*3 + 4i - 70i3 - 44i*3 + 2 in the form pi*3 + ni + v + ui2 and give p. 2 Rearrange -13 - 83z - 80z + 154z - 5z - z + 3z + (3 - 5 + 1)(-4z + 4z + 2z) to the form fz + k and give f. -14 Rearrange (3 - 3 - 3r*2)(6 - 1 + 0) + (4 - 2r - 4)(r + r - 3r)(0 + 7 - 1) to the form xr + fr*2 + p and give p. 0 Express -74f*3 + 30f*3 + 6 + 2f*2 + 39f*3 - 5f as mf + if*3 + a + df*2 and give i. -5 Express 27o - 4o - 4o - o + 11o - 6o + (0o + 4o - 2o)(-2 + 5 - 2) - 2o + 3o + 0o - o + o - 2o - 3o + 2o + 2o as go + v and give g. 25 Rearrange 0h + 0h + 19h3 + (-3h*3 - 14h*2 + 13h*2 + 42h*3)(1 + 3 - 2) to the form ch + bh*3 + a + ph*2 and give b. 97 Express 529 + 776q - 1058 + 529 - q*2 in the form tq*2 + sq + v and give t. -1 Rearrange -3r3 - 9588 + r - 2r*3 + 9580 + r - 35r*4 + 2r*3 to the form br + s + lr4 + pr*3 + ar*2 and give b. 2 Express (0y + y + y)(7y*3 + 24y*3 + 2y*3 + (3y2 - y2 + 0y2)(-y + 6y + 0y)) as ry2 + b + ny*4 + oy + ky3 and give n. 86 Rearrange -483 - 484 + 1813y + 1452 - 485 to the form wy + c and give w. 1813 Rearrange (-q - 6q + 4q)(-1638q - 17 + 1697q - 6 + 4) to the form tq2 + h + kq and give t. -177 Express (11 - n - 11)(2n + 3 - 3)(-84 + 107 + 61) as mn + fn2 + y and give f. -168 Rearrange (2m*2 - 5m2 + m2)((-2m - 3 + 3)(58 + 39 - 86) - 4m + 2m + m) to um*2 + d + bm*3 + sm and give b. 46 Rearrange (-2k - 3k + 3k)(-4080k3 - 1464k*3 - 1496k*3 + 111k - 111k) to fk*4 + p + ak*2 + ik*3 + sk and give f. 14080 Rearrange 2w + 11w*2 - 2 + 15w - 11w2 + 3w*2 to zw*2 + h + pw and give z. 3 Rearrange 4q + 2q*3 + 107q2 - 821 - q3 + 819 - 23q2 - 2q to vq + j + mq*2 + nq*3 and give m. 84 Rearrange (-8 + 14 + 14)(17 - 27 + 12 - o) to the form q + no and give n. -20 Rearrange (-5s + 5s - 4s*2)(-36s2 + 2s*2 - 23s*2) to x + ms + ks2 + vs*4 + rs*3 and give r. 0 Rearrange (-u + 2u + 3u)(109 + 68 - 33) to the form bu + v and give b. 576 Express -110t*3 - 79t*2 - 104t*3 + 2t + 212t3 in the form ht + at3 + gt*2 + c and give a. -2 Rearrange -9z + 10z3 + 26z - 17z + 5 + 6z*3 to c + kz*2 + wz*3 + vz and give w. 16 Rearrange -8m3 + 0m*3 - 2m*3 + (3 + 0 - 1)(2m3 - 4m*3 - 2m*3) + 6m*3 + 2m3 + m3 to lm + gm*2 + xm*3 + r and give g. 0 Express (-4 + 1 + 2)(7c - 7 - 18c + 9c) + 0 + 0 + c as v + oc and give o. 3 Express 39g + 2g*2 + 14g - 2g3 - 8g - 8g as lg*3 + a + bg + qg2 and give l. -2 Rearrange 5 + 2c*2 - 534c*3 - 527c*3 + 1054c**3 to the for	{ "pile_set_name": "DM Mathematics" }
/4 (d) -0.07 d What is the closest to 1 in -5/4, -4, -1, -3/2? -1 What is the nearest to 0 in 1/14, -3, -1/2, -0.3? 1/14 What is the closest to 2/7 in 0.4, 1.14, 1/7? 0.4 What is the nearest to -2 in -3, 2, -41? -3 Which is the closest to 2? (a) 16 (b) -1 (c) -3 b What is the closest to -1 in -0.1, 1.6, -4/7, -4? -4/7 Which is the closest to -3? (a) 0.3 (b) -0.14 (c) -14 b Which is the nearest to 1? (a) 0.3 (b) -4 (c) 5 (d) 2 a Which is the nearest to 0.1? (a) 5 (b) -5 (c) -1/2 (d) 1 c What is the closest to 0.2 in -0.16, 3, -5? -0.16 What is the closest to -2 in -207, 3/4, 0.1, -4? -4 What is the closest to 2 in -1/8, -0.3, -1, -4? -1/8 What is the nearest to 2 in 2/11, -2/7, 0, 0.2? 0.2 Which is the closest to -0.1? (a) 5 (b) 3/14 (c) -2/5 (d) 68 c Which is the closest to -1? (a) 2/5 (b) -0.34 (c) -2/15 b What is the closest to -1/2 in -2, -2/5, 2/5, 1/6? -2/5 Which is the nearest to 0.1? (a) -1030 (b) 3/5 (c) -4 b Which is the nearest to 1? (a) -0.03 (b) -3 (c) 18 (d) 2 d What is the closest to 0.2 in -2, -13, -24, -3/10? -3/10 Which is the nearest to -1/4? (a) -2.5 (b) -4 (c) 0.2 c What is the nearest to 2/3 in 0, 22/9, -2/11, -0.4? 0 What is the nearest to -3 in 2.3, -3/5, 2? -3/5 What is the nearest to 12 in -10/9, 1, 1/3, -1/5? 1 Which is the nearest to -1? (a) 2 (b) 2/5 (c) 0.03 (d) 4/3 c Which is the nearest to 24? (a) 4 (b) 11 (c) 0.7 b What is the nearest to -1 in 1.7, 16, -4? 1.7 Which is the nearest to 13? (a) 5 (b) -1 (c) -0.2 a Which is the closest to 1? (a) -2/9 (b) -4 (c) 15 (d) -108 a What is the closest to 32 in 0.3, -3, -1? 0.3 Which is the closest to -2? (a) -2/3 (b) 0 (c) 3/16 a What is the closest to 0 in -10, -3, 0.08, -0.3? 0.08 What is the closest to -1 in -0.039, -1/7, 4? -1/7 What is the nearest to -2/3 in -1.188, -5, -1, -0.3? -1 What is the closest to 1/2 in 2/11, 2/5, -0.4, 1? 2/5 What is the closest to 1 in 8, -0.3, -0.075, -2/9? -0.075 What is the closest to -1/3 in -15, 0.5, 5? 0.5 Which is the closest to -1? (a) 52 (b) 0 (c) -5 b Which is the nearest to -2? (a) 2/113 (b) -4 (c) -0.7 c Which is the closest to -1/4? (a) -0.1 (b) 2 (c) -3 a What is the closest to -1 in 3/8, 25/2, -1/7, -5? -1/7 Which is the closest to 0.1? (a) -2 (b) -5/2 (c) -6/13 c Which is the nearest to 1? (a) -5 (b) 6/7 (c) 1/4 b Which is the nearest to -3? (a) -7 (b) 19/5 (c) 4 a What is the closest to 0 in 0.06, -5, 1, -1/3? 0.06 Which is the closest to -2/9? (a) -37 (b) -5 (c) 0.3 (d) -1/4 d Which is the closest to 0? (a) -0.1 (b) 0.55 (c) 3 a What is the nearest to 1 in -1, -8, 0.6? 0.6 What is the closest to -1 in 1, 1/11, 0.5? 1/11 Which is the closest to 0.2? (a) 0.01 (b) -2/11 (c) 2 a What is the closest to -1/2 in 7, 12, -5, -4? -4 Which is the closest to -0.1? (a) -1.3 (b) -17 (c) 0.4 c Which is the closest to -1/16? (a) -0.05 (b) -4 (c) 0 a Which is the nearest to 3/7? (a) 2 (b) 5 (c) 3 (d) -5 a What is the nearest to 2 in 0, 3, 46? 3 What is the nearest to 7 in 1, -2/7, 4? 4 Which is the nearest to 2/3? (a) 5 (b) -1/4 (c) -1 (d) -3/4 b What is the closest to -2/3 in -5, 1, 0.3, -1.2? -1.2 What is the nearest to -3/2 in 1/3, -0.3, -4? -0.3 Which is the nearest to -1/6? (a) -853 (b) -3 (c) -2/5 c What is the nearest to 0.2 in -0.4, -0.1, 189? -0.1 What is the nearest to 0 in -0.058, -3/2, -0.2? -0.058 What is the closest to -96 in 1, -4/3, 0? -4/3 What is the closest to 0.1 in 27, -5, -297? -5 What is the closest to 0.1 in -4, 0.5, -4/7? 0.5 Which is the nearest to -0.1? (a) 0.5 (b) 0.4 (c) 2 (d) 29 b What is the closest to -2 in 4, -7, -10, 1/11? 1/11 What is the closest to -32 in 2, -4, -2.2? -4 What is the nearest to -2/5 in 0.25, 4, -4, 0.1? 0.1 Which is the closest to -1? (a) 0.2 (b) 17 (c) 5 a Which is the nearest to -0.9? (a) 1/2 (b) -3 (c) -5 (d) -0.04 d Which is the nearest to 1? (a) -2 (b) 17 (c) -0.23 (d) -0.3 c What is the closest to -2/7 in -2, 1/2, -0.5, -3/10? -3/10 What is the nearest to 0.1 in 4, -2/13, 0.14, -1? 0.14 What is the closest to -0.2 in 5, -0.5, 4, 3/2? -0.5 What is the nearest to 0.1 in -4, -2, 0.5, -2/3? 0.5 What is the nearest to 2 in 1, 0.4, 10, 0.2? 1 What is the nearest to -1 in 1/5, -15, -4/7? -4/7 What is the nearest to 6 in -2/3, -1/2, -13? -1/2 Which is the nearest to -16? (a) 0 (b) 2/5 (c) 1 (d) -1 d What is the closest to 2 in -3, 2/17, 0.2, -0.4? 0.2 What is the closest to 1/4 in 0.095, -4/7, -0.2, -1/3? 0.095 What is the closest to 2 in -1/5, -1, 0.2? 0.2 Which is the nearest to 1? (a) -4 (b) 0.1 (c) 0.855 (d) -5/4 c Which is the nearest to -0.1? (a) 65/4 (b) 0 (c) 1.25 b What is the nearest to -1 in 2, 0, -14? 0 What is the closest to -3 in -2, 0.3, -2/9, 8? -2 What is the closest to 3 in -1.4, -6, 3, 0.5? 3 What is the nearest to -1/3 in -7, -3, 0.1? 0.1 What is the nearest to 8 in 2, 164, 1, 2/3? 2 Which is the closest to 2? (a) 2/1511 (b) -3 (c) 1 c What is the nearest to -0.1 in -5.7, 6/5, 5? 6/5 Which is the nearest to 0? (a) -0.4 (b) -2/27 (c) 0 (d) -0.066 c Which is the closest to -0.1? (a) -1 (b) 188/9 (c) 0.1 (d) 0.2 c Which is the nearest to -6? (a) 1 (b) -0.2 (c) -1/2 (d) 0.15 c Which is the closest to -5? (a) -0.04 (b) -0.5 (c) 2/3 b Which is the closest to 0.2? (a) 0.1 (b) -4/9 (c) -4 a What is the closest to -1 in 0.2, -3/14, -1/3, -0.1? -1/3 Which is the nearest to -0.031? (a) 1 (b) -0.4 (c) 5 b Which is the closest to 2/9? (a) 4 (b) 4/7 (c) 0.4 c Which is the nearest to -0.2? (a) -0.12 (b) 4 (c) -0.06 a Which is the nearest to -2/23? (a) 0 (b) 2 (c) -2 (d) -4 a Which is the nearest to -0.1? (a) -0.1 (b) -6 (c) 0.2 (d) -2/9 a Which is the closest to 2/5? (a) -1 (b) -3 (c) 4 (d) -609 a Which is the nearest to 2/7? (a) 2.2 (b) 4 (c) -1/4 (d) 2 c What is the closest to 0.0738 in -1, -0.5, 1/7? 1/7 Which is the nearest to 3? (a) -3 (b) 1/5 (c) -12/23 b What is the nearest to -4 in 1, -2, -0.2, 9? -2 Which is the closest to -33? (a) -0.4 (b) -5 (c) 2/7 b Which is the closest to -2? (a) -0.5 (b) -2 (c) 1/8 b What is the nearest to -1/3 in 3, -0.5, -5/12, 2? -5/12 Which is the closest to 2/3? (a) 12/47 (b) 1 (c) 3 (d) 5 b What is the closest to 4 in 0.3, -3, -1/3? 0.3 Which is the nearest to 0? (a) -6 (b) 2 (c) 2/13 (d) 0 d Which is the closest to 36? (a) 2 (b) 0.1 (c) -4 a What is the nearest to 2 in 2/109, -3/4, 0.14? 0.14 What is the nearest to -0.1 in -5, 5/6, -2, 0.5? 0.5 Which is the closest to -0.012? (a) 0.3 (b) 5/4 (c) -2/3 (d) 9 a Which is the closest to 2/3? (a) -0.14 (b) 3/91 (c) -0.4 b What is the closest to 0.1 in 3, 1/4, -3, 500? 1/4 Which is the closest to 7? (a) 0 (b) -2 (c) -330 a Which is the nearest to -13? (a) 6 (b) -0.1 (c) -0.5 (d) 3 c Which is the closest to 2/7? (a) -8 (b) -2 (c) 0 c What is the nearest to -2 in 1/194, 3, 3/8? 1/194 Which is the closest to 4? (a) 1/8 (b) 0.2 (c) -0.4 (d) 12 b What is the nearest to -59 in -2/7, -4, 0.5, -1/4? -4 What is the closest to -0.1 in 2, 3, 5, 15? 2 Which is the nearest to -0.1? (a) 1 (b) 1/2 (c) -3 (d) 49 b Which is the nearest to 0.055? (a) 12 (b) -4 (c) 4 c What is the closest to -0.1 in -0.8, -4, 4? -0.8 What is the closest to -0.3 in -41, -1, -0.01? -0.01 What is the nearest to 23 in 1/2, 0.1, 3, -3/2? 3 What is the nearest to 1/4 in 2, -0.1, 3, -5? -0.1 Which is the closest to -0.1? (a) -1/5 (b) -1/18 (c) -11 b Which is the nearest to 0.033? (a) -0.4 (b) -0.1 (c) -0.05 c What is the nearest to -19 in 1, 0, 4/3, 0.2? 0 What is the nearest to -2/47 in -5, -0.3, -0.065, -0.1? -0.065 What is the nearest to 0.2 in -3/4, -2/15, 5/7, 0.2? 0.2 Which is the nearest to -1? (a) -3 (b) -4028 (c) 0.2 c Which is the closest to -2? (a) -1 (b) 2 (c) 303 (d) -1/7 a Which is the closest to 0.2? (a) 1/8 (b) -2 (c) -10 a Which is the closest to -18/7? (a) 4 (b) -41 (c) 16 a What is the closest to 2/21 in 2/5, 5, 6? 2/5 Which is the closest to -1/19? (a) -1 (b) 0 (c) 0.01 b What is the nearest to 2 in 1/5, 3, 24? 3 Which is the nearest to 0.1? (a) -0.5 (b) -4 (c) -5 (d) -2 a Which is the nearest to -13? (a) -0.5 (b) 2/65 (c) 4 (d) -3 d What is the closest to 1 in 0.2, 15, 2/3, -3? 2/3	{ "pile_set_name": "DM Mathematics" }
is the nearest to -0.3? (a) -35/2 (b) -3/2 (c) 4 b Which is the closest to -2? (a) -3/8 (b) -2/119 (c) -0.5 (d) 1/4 c Which is the nearest to 0? (a) 0 (b) -5 (c) 0.5 (d) 3/5 a Which is the nearest to 0.2? (a) -1/2 (b) 3 (c) 1.9 (d) 2 a What is the closest to 5/3 in 0.5, 0.4, -5? 0.5 Which is the closest to -0.3? (a) -12 (b) 5 (c) 1/10 c Which is the closest to 1? (a) 3/7 (b) 3/5 (c) 8 (d) -9 b What is the nearest to 21 in -0.1, -5/8, -3? -0.1 Which is the nearest to -1? (a) 23 (b) -3 (c) 3/4 (d) -6 c Which is the nearest to -1/4? (a) -2/157 (b) -1/9 (c) 8 (d) 2 b Which is the closest to 3? (a) 1.06 (b) -2 (c) 1 a Which is the nearest to -2? (a) -10/3 (b) -1/2 (c) 69 (d) -2/7 a Which is the closest to -1/14? (a) 0.01 (b) -5 (c) 3 a Which is the nearest to 1? (a) 4/9 (b) -1 (c) 5 a Which is the closest to -1? (a) 0.1 (b) -5 (c) 0.4 (d) 509 a Which is the closest to -35? (a) -4 (b) -5 (c) 1 b What is the nearest to -2/11 in 0.3, 3, 2? 0.3 What is the nearest to 0.5 in 2/11, 2, -7? 2/11 Which is the closest to 1? (a) 18 (b) 6/7 (c) -2 (d) 0.5 b What is the closest to -1/5 in 5, -235, -0.2, -4? -0.2 Which is the nearest to 1? (a) 7 (b) 5 (c) -2/5 (d) 0 d Which is the nearest to 1? (a) -1/3 (b) -2/17 (c) 25 (d) 0.5 d Which is the closest to 4/17? (a) 2/5 (b) -5 (c) 2 a What is the closest to 0.3 in 0, 0.4, 17, -0.07? 0.4 What is the nearest to -2/5 in -5, 1/4, -6, 3/5? 1/4 Which is the closest to -0.1? (a) 2/5 (b) -27 (c) -1 a Which is the closest to 6.2? (a) 4 (b) -4 (c) 2 a Which is the nearest to 4? (a) 2/5 (b) -3 (c) 2/7 a What is the nearest to -2 in 0, -1/13, -2, 1/5? -2 What is the nearest to -1/5 in -20, -2/9, -5? -2/9 Which is the nearest to 1? (a) -5 (b) -3 (c) -4 (d) -255 b Which is the closest to 1? (a) -0.09 (b) -2/5 (c) 2 (d) 3 c Which is the closest to 0? (a) 0 (b) 492 (c) 0.5 a Which is the closest to 0.01? (a) 2 (b) 1/4 (c) -24 (d) -2 b Which is the closest to 0? (a) 1/13 (b) -1/2 (c) -8 a Which is the nearest to 1? (a) -33 (b) 4 (c) -4 (d) 2/3 d Which is the nearest to 0? (a) -5 (b) -3 (c) 0 c Which is the closest to 0? (a) -5 (b) 203 (c) 0.3 c What is the nearest to 0.48 in -5, 3/4, -2/3, 0.2? 3/4 What is the nearest to 0.5 in 4, 2/5, 2, 0? 2/5 What is the closest to -4/5 in 2/3, 3, 29/2, -4? 2/3 Which is the closest to 11/2? (a) 0.3 (b) -1/4 (c) 0.1 (d) 3/5 d Which is the closest to 4? (a) -0.12 (b) -1/2 (c) -12 (d) 3 d What is the closest to 0.1 in 3/5, 2/13, 8/13? 2/13 Which is the closest to -1? (a) -2/3 (b) 1.39 (c) -3 (d) 2/15 a What is the closest to -2/5 in -0.3, 27, -5/21? -0.3 Which is the closest to 17? (a) 0.2 (b) -1/3 (c) 0 (d) -30 a What is the closest to -0.06 in -0.5, 1, -3? -0.5 Which is the closest to 3? (a) -0.5 (b) -4/5 (c) 2/7 (d) -1/5 c Which is the closest to 2? (a) -3 (b) 1 (c) -5 b Which is the closest to 11? (a) 1/4 (b) 0.1 (c) -7 (d) -1/2 a What is the closest to 0 in 0, -4, -2, -0.4? 0 Which is the closest to -4? (a) 0.4 (b) 0.5 (c) -6/11 (d) 3 c Which is the nearest to 0? (a) -5 (b) 4/3 (c) -3 (d) 1/7 d What is the nearest to -1 in 4, -1/11, 1? -1/11 Which is the closest to 5? (a) -2/7 (b) -1/7 (c) -5 b Which is the nearest to -1? (a) 0.1 (b) -49 (c) -1 (d) -2/11 c Which is the closest to -1? (a) -0.48 (b) -2/7 (c) 3 (d) 12/5 a What is the nearest to 0.3 in -2, -0.051, 2/19, 0.3? 0.3 What is the nearest to -1.86 in -2/17, -2/3, 1/2? -2/3 What is the nearest to 1.3 in -0.1, -1, -4? -0.1 Which is the closest to -2? (a) 17 (b) -1 (c) -1/2 b What is the closest to -8 in 4, -1/5, -1/3? -1/3 What is the closest to -5 in -1/8, 1/5, -5, -1/4? -5 Which is the closest to 0.1? (a) -4 (b) -0.06 (c) -24 (d) -1/8 b What is the nearest to 26 in 3, 2/13, -25? 3 What is the closest to 2/3 in -1, 0.3, 4, -25? 0.3 What is the nearest to 0.1 in 2/13, 3, 2, -1? 2/13 Which is the closest to 0.9? (a) -0.2 (b) -0.7 (c) -2/3 a Which is the nearest to -1/3? (a) 0.1 (b) 3/5 (c) -4 (d) -0.9 a Which is the nearest to -2? (a) 0 (b) 2/3 (c) 1 (d) -2 d What is the closest to 1 in 2, 5, -1/7, -0.2? 2 Which is the nearest to 0? (a) 6 (b) -5 (c) 14 b Which is the nearest to -0.1? (a) 0.4 (b) -266 (c) -1 a Which is the closest to -1? (a) -12 (b) 2 (c) -1/3 (d) 0.11 c Which is the nearest to 0.2? (a) -1/3 (b) 2/15 (c) -4 (d) 9 b What is the closest to -2 in 0.5, 3, -0.5, -3? -3 What is the closest to -15 in 5, -1/4, 3/5? -1/4 Which is the closest to -4? (a) 5/6 (b) 1/2 (c) -2/11 (d) 2/9 c Which is the closest to 0.1? (a) 2/23 (b) 1/85 (c) 1/2 (d) -0.1 a Which is the closest to -2? (a) 0.5 (b) -5 (c) -102 a Which is the closest to 0.19? (a) 0 (b) -3 (c) 0.3 c Which is the closest to 1/4? (a) 3/5 (b) 0 (c) 5 (d) 525 b What is the nearest to 0.2 in -1, 0.06, -26, -4/7? 0.06 What is the nearest to 0.1 in -0.5, 2/45, -0.02? 2/45 Which is the nearest to -1? (a) 1/3 (b) 1/53 (c) -0.5 (d) -2 c What is the nearest to -1 in 2/3, 0.3, 50, -10? 0.3 Which is the nearest to 4? (a) -4 (b) 2 (c) -0.06 b Which is the nearest to 0.178? (a) 0.3 (b) 1 (c) 0.02 a What is the nearest to 1 in 2, -5, -1/2, -0.3? 2 What is the closest to 0 in -0.1, -16, 2/11, 0? 0 What is the closest to -0.1 in -4, 0.003, 0? 0 Which is the closest to -0.1? (a) 1/2 (b) 3 (c) 5 (d) 1/68 d Which is the closest to -0.1? (a) -1 (b) -4 (c) 0.3 (d) 2/19 d What is the closest to -4 in -2, -1.6, -0.1, -4? -4 What is the closest to -44 in -18, 2, 4? -18 Which is the nearest to 5/7? (a) 2 (b) 2/7 (c) 2/5 (d) -5 c What is the closest to 0.1 in 7/4, 5, -2? 7/4 Which is the nearest to 3? (a) -0.4 (b) 15 (c) 3 (d) -0.2 c Which is the closest to -1/3? (a) -3 (b) 1/32 (c) -2/5 c What is the nearest to 1/4 in -3, -33/4, 4/5, -0.1? -0.1 What is the closest to 2/11 in -0.5, -2, 4, -0.4? -0.4 Which is the nearest to 1? (a) -4 (b) -2/11 (c) 2 (d) -7/9 c What is the closest to 18 in 1/2, 5, 0.2, -3? 5 Which is the closest to -0.2? (a) 0.4 (b) 0.5 (c) 1 (d) -2 a Which is the nearest to -1? (a) -1 (b) -0.5 (c) 18 (d) -5 a Which is the nearest to 0? (a) 5 (b) 2/3 (c) -36.6 b What is the nearest to 0.1 in -1/8, -4, -1/72, 6? -1/72 Which is the closest to -12? (a) 0.1 (b) -2/3 (c) 2 b Which is the nearest to 2/17? (a) 5 (b) 8 (c) -3/7 c What is the nearest to 264 in -3, -50, -1/3? -1/3 What is the nearest to 0.1 in 2/5, -0.5, -2/57, -0.1? -2/57 Which is the closest to 1/3? (a) -0.2 (b) 15 (c) 1 (d) 3 a What is the nearest to 3/4 in -0.5, 3, 226? -0.5 What is the nearest to -70 in 2, -0.6, -3? -3 What is the closest to -4 in -4, 2, -2/19? -4 Which is the closest to 1? (a) -5 (b) 0.1 (c) -1/358 (d) 1/2 d Which is the closest to 3? (a) -2/7 (b) 3 (c) 0 (d) -0.1 b What is the closest to 1/3 in 4/11, -4, 5? 4/11 Which is the nearest to -2? (a) 0.17 (b) 4 (c) 1/4 a Which is the nearest to 0.2? (a) -0.3 (b) 157 (c) -5 a What is the nearest to -5.8 in 2/21, -0.5, -2/43? -0.5 What is the nearest to -87 in -3/8, -0.1, -1/4? -3/8 Which is the nearest to -1? (a) -4/5 (b) 5/6 (c) 2/35 a Which is the closest to -1/2? (a) -244 (b) -2/41 (c) 4 b Which is the nearest to -0.09? (a) -3 (b) -11 (c) 2 c What is the nearest to 3/4 in -0.4, -96, 1? 1 Which is the nearest to 1/4? (a) -5 (b) -23 (c) 2/3 (d) -1 c Which is the closest to -2/53? (a) -9/5 (b) 1.2 (c) -0.3 c What is the closest to -414 in -0.3, -2/7, 2, 0.4? -0.3 What is the closest to 10 in 0.3, 2/11, 2/9, -0.5? 0.3 Which is the closest to 1/5? (a) 6 (b) -0.5 (c) 1/6 (d) -1/7 c What is the nearest to -4/3 in 2/5, 4, 1/2? 2/5 What is the closest to 0.4 in -2, 2, -5? 2 Which is the nearest to -3? (a) 7 (b) -7 (c) 2/7 c What is the closest to -0.4 in 4, -0.1, 14/15? -0.1 Which is the closest to 1? (a) -2/7 (b) 0.5 (c) 4 (d) -11 b Which is the nearest to 1? (a) -10 (b) -0.4 (c) 4 (d) 2/3 d Which is the nearest to 2/217? (a) 2 (b) -4 (c) -87 (d) -3/8 d What is the nearest to 1/2 in 0.04, -2/5, -0.6? 0.04 What is the closest to 2 in 3, 4/5, 1/3, 0.2? 3 What is the nearest to -0.4 in -20, 1/2, 1? 1/2 Which is the closest to 1093? (a) -1 (b) -5 (c) 5/3 c Which is the closes	{ "pile_set_name": "DM Mathematics" }
3r2 - 84865a*2br3 - 8ab3r - 2ab3 - b2r3 - 7br2 - 12r*3 wrt a. -4b*3r*2 - 169730br3 Find the first derivative of -858h*4 - 2h3 - h2 - 15h - 391733. -3432h*3 - 6h*2 - 2h - 15 Find the first derivative of -195a2 - 389a + 143610. -390a - 389 What is the third derivative of -184924f*3 - 260527f*2? -1109544 Find the third derivative of -128839w*3 + 65w*2 - 3w + 22. -773034 What is the second derivative of -44689p2 - 2990p - 7 wrt p? -89378 What is the first derivative of 124840f2 - 139483 wrt f? 249680f Find the third derivative of -19381j4 - 7j*3 - 231195j*2. -465144j - 42 What is the third derivative of -2t4 + 266183t*3 - 7t*2 + 40395t? -48t + 1597098 Find the first derivative of -13k*2u - 19ku*2 + ku + 189k - 3490u*2 + u - 64 wrt k. -26ku - 19u*2 + u + 189 What is the first derivative of 14862n + 64092 wrt n? 14862 Find the third derivative of -234180q5 + 6057q*2 - 24. -14050800q*2 What is the second derivative of -3co2v + 2co*2 + 25cov - 2c + 14o*2v - 51o2 + 50ov wrt o? -6cv + 4c + 28v - 102 Differentiate 107771y*2 + 1052252 wrt y. 215542y What is the second derivative of -3c2q*4 - 2c*2 + 2cq3 - 326cq2 + 6cq - 2q - 1 wrt q? -36c2q*2 + 12cq - 652c What is the second derivative of 606241s2 - 5s - 120766? 1212482 What is the derivative of 7868lo - 52170l - 9o + 4 wrt o? 7868l - 9 What is the third derivative of -32931i*6 - 33062i*2 wrt i? -3951720i*3 Differentiate 6932n*4 + n - 8597 wrt n. 27728n*3 + 1 Find the third derivative of 1703882k*5 - 1126k*2 + 157k + 1. 102232920k2 What is the second derivative of k2z*4 - 52k*2z + 2560kz*4 - 117kz wrt z? 12k*2z*2 + 30720kz2 Find the second derivative of 24037t*4 - 39383t wrt t. 288444t2 Find the third derivative of 829l*5 - 2l*4 - 45l*3 + 40203l*2. 49740l*2 - 48l - 270 Differentiate 2hj*2 + 1057hju - 3hj - 1015j2u + j + 3u with respect to h. 2j*2 + 1057ju - 3j What is the second derivative of -110k3 + 501k*2 - 1881488k wrt k? -660k + 1002 Find the third derivative of 357547i*5 + 1658i*2 + 38 wrt i. 21452820i*2 Differentiate -12g*2 + 989g - 76602 with respect to g. -24g + 989 Find the second derivative of -39i*3x - 244i3 + 3i*2 + 1246ix - 10x wrt i. -234ix - 1464i + 6 What is the first derivative of -132904b*2 - 94991? -265808b What is the second derivative of 21645d5 + 2d + 19524? 432900d3 What is the second derivative of 225d*2h - 72d2 + 28dh + 2d + 2h + 3 wrt d? 450h - 144 What is the first derivative of -28g4q + 1941g3q - gq - 439792q wrt g? -112g3q + 5823g2q - q Find the third derivative of -891354m3p*2 - 2342m*2 - 12mp2 - p2 wrt m. -5348124p*2 What is the first derivative of 1184297y + 191131 wrt y? 1184297 What is the third derivative of -347d5 - d4 - 44d*3 - 54d*2 - 1265 wrt d? -20820d*2 - 24d - 264 Differentiate -72250j2 + 2j + 321826 wrt j. -144500j + 2 Differentiate -84063k*3 + 71508 with respect to k. -252189k*2 What is the first derivative of -2kw2 - 5536kw + k - 192w*2 + 17w - 15 wrt k? -2w2 - 5536w + 1 What is the derivative of 2a2f + 105a2 - 313a - 10383f wrt f? 2a*2 - 10383 Differentiate 30bly + 14bl - 4894by + 3b + 2ly - 9l - 22 wrt y. 30bl - 4894b + 2l What is the second derivative of -8i5 + 682i*4 - 152710i? -160i3 + 8184i*2 Differentiate 40050o*4 + 131992 wrt o. 160200o*3 What is the second derivative of 2053261p*2s*2 - 6ps2 + 8p - 11878s2 wrt p? 4106522s*2 What is the first derivative of -119788tz3 + 2t - 616744z3 wrt t? -119788z*3 + 2 Find the second derivative of 6038124r*2 + 12617r - 10 wrt r. 12076248 What is the first derivative of 17731i3r - 2ir*2 - 3r*2 + 37374 wrt i? 53193i*2r - 2r2 Find the second derivative of 1933k*2u*2 + 9509k*2u - 2k2 - ku*2 - 1 wrt u. 3866k*2 - 2k Differentiate -1453096n - 716906. -1453096 Differentiate -4kq2 - 1624058k + 303q3 - 2q with respect to q. -8kq + 909q2 - 2 What is the third derivative of -70964t*6 + 10t*4 - 565567t*2 + t wrt t? -8515680t*3 + 240t Differentiate -1096699pq + 2328p - 119 with respect to q. -1096699p What is the second derivative of 205887z2 - 434343z wrt z? 411774 What is the second derivative of -569b3t*3 - 37758b*3t + 20b2t*4 - 2bt wrt t? -3414b*3t + 240b2t*2 What is the third derivative of -3177q*3 + 46424q*2? -19062 Find the second derivative of 2d*4 + 5775d*2 + 93758d. 24d2 + 11550 What is the third derivative of 27678x4 + x3 - 2592x2 + 11 wrt x? 664272x + 6 Find the second derivative of -73336z5 + 3z*2 + 282z - 1064. -1466720z3 + 6 What is the second derivative of -2b*2g*2 + 11b*2g - bg2 - 2bg + 1688b - 206342g2 + 2g + 3 wrt g? -4b2 - 2b - 412684 What is the second derivative of -d*5 - 34492d*3 + 19963d? -20d3 - 206952d What is the second derivative of -2046771o3 - 40855o - 35 wrt o? -12280626o What is the derivative of -18942a*4y*2 - 49y*2 + 55y - 3 wrt a? -75768a3y*2 Find the third derivative of -142513a*3f*2 + 407653a*2 - af*2 wrt a. -855078f*2 Differentiate 84848f + 50673 wrt f. 84848 Find the third derivative of -133ms*4 + 2ms - 2m - 23s5 - 15s*3 - 4s*2 - 2635s + 2 wrt s. -3192ms - 1380s2 - 90 Find the third derivative of -1567225r*5 - 3787674r*2. -94033500r*2 What is the third derivative of 567x*5 - 172x*3 + 5x*2 + 543x - 7? 34020x2 - 1032 Differentiate -129904m*2 + 647448 with respect to m. -259808m Find the third derivative of 6123k5 + 20k*3 + 998184k*2. 367380k*2 + 120 What is the second derivative of -432b*4z - 11b2z3 + b2z - 56b - 4z3 - 121z wrt b? -5184b2z - 22z3 + 2z Find the second derivative of -2q5 - 60774q*4 - 6q + 650. -40q3 - 729288q*2 Find the third derivative of -1055v*4 - 28v*2 + 836v - 1. -25320v Find the second derivative of 9g*5 + 2177g*2z + 3gz + 103678g wrt g. 180g*3 + 4354z Differentiate 53164j3t + 2j3 - 2j*2t + 4t - 17970 wrt j. 159492j*2t + 6j2 - 4jt Find the first derivative of 18a*2 + 2304a + 140786 wrt a. 36a + 2304 Find the third derivative of -303a*6v - 28a3v + a*2 - 115av + 65a wrt a. -36360a3v - 168v Find the second derivative of -12u*4 + 2228u*3 - 2u*2 + 496070u. -144u2 + 13368u - 4 What is the third derivative of 2670hp*5 + 2hp2 - 517hp - 8h + 2p5 + 2p*3 - 2p*2 wrt p? 160200hp2 + 120p*2 + 12 Differentiate 25042d - 276963. 25042 What is the second derivative of -961q4 + 14q*3 - 1338689q wrt q? -11532q2 + 84q Find the second derivative of -114434s2 - s + 103621. -228868 What is the second derivative of 29r*3 - 377r*2 - 92230r? 174r - 754 What is the third derivative of 195681b4 + b2 + 4b - 6941 wrt b? 4696344b What is the second derivative of -13040v2 - 1114v wrt v? -26080 What is the third derivative of -823o3r*3 + 5o*3r2 - o3 + 936o2r*3 + 27or3 wrt o? -4938r*3 + 30r*2 - 6 Differentiate -17825f - 32090 with respect to f. -17825 What is the second derivative of 19s4 + 1824s*2 - 5s - 37981 wrt s? 228s2 + 3648 What is the third derivative of -11222o*3s*2 + 80513o*2s*2 wrt o? -67332s*2 Find the second derivative of 2742f*4m*3 - 19f*4 - fm*2 - fm + 13f + 202m*3 wrt f. 32904f*2m*3 - 228f*2 Find the first derivative of -65a*3 - 9053a*2 - 2a + 4349034 wrt a. -195a2 - 18106a - 2 Find the third derivative of -d*2j*3 - 9d*2j*2 - 1197d*2 - dj*2 + 155j*3 wrt j. -6d*2 + 930 Find the first derivative of 2531g*2 - 34g + 148269 wrt g. 5062g - 34 Differentiate 29194as2w - 1212s2 - 2sw - 9 with respect to a. 29194s*2w What is the first derivative of -88bf - bm - 2383bp + 2fmp - 2fm - 8f + m wrt p? -2383b + 2fm Differentiate -134048n4 + 161971 with respect to n. -536192n**3 Find the fir	{ "pile_set_name": "DM Mathematics" }
25)). -4sqrt(5) + 1 Simplify (sqrt(7)-2)*25 + (sqrt(98)/sqrt(2) + sqrt(49))/sqrt(7). 2sqrt(7) + 140 Simplify (sqrt(81)/(sqrt(9)1))/(sqrt(18)/sqrt(6)-2). -sqrt(3)/2 Simplify sqrt(72) + 1 + -3 + sqrt(72) + (sqrt(72) - (-1 + sqrt(72)))2 + -4. -5 + 12sqrt(2) Simplify -3 + (5sqrt(1008)2 + 1 + -1sqrt(1008))2. 216sqrt(7) + 81646 Simplify sqrt(56)/(sqrt(8) + -3sqrt(128) + sqrt(8)). -sqrt(7)/10 Simplify ((sqrt(363) - -6(-1 + sqrt(363))) + (sqrt(363) - (0 + sqrt(363))1) + sqrt(363))2. -1056sqrt(3) + 23268 Simplify -5(-3 + -2sqrt(1900)). 15 + 100sqrt(19) Simplify ((sqrt(22) + sqrt(22)-2)5)/sqrt(11) + -4. -5sqrt(2) - 4 Simplify (4 + (sqrt(50))*2)-5. -270 Simplify (-1 + sqrt(200) + -2 + 0)*2 + 1. -60sqrt(2) + 210 Simplify (sqrt(4)/sqrt(2)5)2 + -3 + sqrt(162). 9sqrt(2) + 47 Simplify (-6(sqrt(704) + 2) - sqrt(704))2 + 5. 1344sqrt(11) + 34645 Simplify 0 + (sqrt(2299) - (sqrt(2299)2 - sqrt(2299)))2 - sqrt(2299) - ((-6-2sqrt(2299))2 + sqrt(2299) - sqrt(2299)). -331056 - 11sqrt(19) Simplify (sqrt(119)-24)/sqrt(7). -8sqrt(17) Simplify (sqrt(242) + -1)2 - (sqrt(18) + -1). -25sqrt(2) + 244 Simplify -4 + (sqrt(320) - (sqrt(320)-1)2) + sqrt(320) - (1 + sqrt(320) + sqrt(320)-1). -325 + 16sqrt(5) Simplify (sqrt(152)/sqrt(4))/sqrt(2) + sqrt(209)/(sqrt(22)/sqrt(2)). 2sqrt(19) Simplify 3 + -4(sqrt(475)-1)*2. -1897 Simplify (1 + sqrt(700)-1 - sqrt(700))*2. -40sqrt(7) + 2801 Simplify (sqrt(13) + 3 + 0 + sqrt(13) + -1(sqrt(13) + 0 + sqrt(13) - sqrt(13)) + -2)2. 2sqrt(13) + 14 Simplify 1 + -4((1 + sqrt(11))2 + -1). -43 - 8sqrt(11) Simplify 4(sqrt(1100) + 3 - sqrt(11)) + -5. 7 + 36sqrt(11) Simplify -3(sqrt(612) + sqrt(612)-1 - (-2 + sqrt(51)/sqrt(3)))*2. -63 + 12sqrt(17) Simplify -6sqrt(63)/(-3sqrt(9)). 2sqrt(7) Simplify (3 + sqrt(1539)3)-4. -108sqrt(19) - 12 Simplify (-2(sqrt(11) + sqrt(275))-2)*2. 6336 Simplify ((sqrt(180)/sqrt(5))/sqrt(9))/sqrt(2). sqrt(2) Simplify (sqrt(384)/sqrt(4))/(sqrt(150)/sqrt(3)). 4sqrt(3)/5 Simplify (sqrt(22)/(sqrt(11)2))2 + -5 + -1sqrt(2). -9/2 - sqrt(2) Simplify ((sqrt(216) - sqrt(24))-1)/((sqrt(12) - sqrt(192))-3). -2sqrt(2)/9 Simplify -2 + sqrt(40)/(2sqrt(8))-4. -2sqrt(5) - 2 Simplify 4 + (sqrt(12)/sqrt(6))*2 + sqrt(2) - sqrt(16)/sqrt(2). -sqrt(2) + 6 Simplify (1sqrt(13) + -3 - (sqrt(39)/sqrt(3) + 1)) + 5 + (sqrt(13) - sqrt(65)/(sqrt(10)/sqrt(2))). 1 Simplify (sqrt(18)/(sqrt(18)/sqrt(2)) + sqrt(2) + sqrt(2) - ((sqrt(2) - sqrt(8)/sqrt(4)) + 4)*2) + -3. -19 + 3sqrt(2) Simplify 1sqrt(60)/sqrt(432). sqrt(5)/6 Simplify ((sqrt(2057) + 0 - sqrt(2057)) + 1)2. 1 Simplify (1 + sqrt(242))-1 - (sqrt(242) + -5(sqrt(242) - (sqrt(242) + sqrt(242) + -1)))2. -8738 + 649sqrt(2) Simplify 6(4(-1 + sqrt(13)))*21. -192sqrt(13) + 1344 Simplify (3 + sqrt(448)-2)*2. -96sqrt(7) + 1801 Simplify sqrt(44)/(sqrt(576)1 - sqrt(4))6. 6sqrt(11)/11 Simplify (1sqrt(156)/(sqrt(84)/sqrt(7)))*2. 13 Simplify sqrt(14)/(-4(sqrt(2) + sqrt(2)1)) - sqrt(42)/(sqrt(18)/sqrt(3)5). -13sqrt(7)/40 Simplify (-4 + (sqrt(3) + -1sqrt(3) - sqrt(3)))*2-1. -19 - 8sqrt(3) Simplify (sqrt(3) + (2(0 + sqrt(3)) + sqrt(3))*2 + (-2sqrt(27))*2)1. sqrt(3) + 135 Simplify 3 + (sqrt(1539) - (sqrt(1539) + 1)-6)2. 756sqrt(19) + 75450 Simplify (2sqrt(600))/(sqrt(162)/sqrt(9)). 20sqrt(3)/3 Simplify 5sqrt(76)/sqrt(4) - -2sqrt(76). 9sqrt(19) Simplify (1(1 + sqrt(425)))*2. 10sqrt(17) + 426 Simplify (sqrt(2) - (-4 + sqrt(10)/sqrt(5)))-3. -12 Simplify 0 + 5 + (-1 + sqrt(7))2. -2sqrt(7) + 13 Simplify ((5(sqrt(170)/sqrt(5) + sqrt(34)))/(2sqrt(2)2 + sqrt(2)))2. 68 Simplify (1sqrt(3264))/(sqrt(27)/sqrt(81)). 24sqrt(17) Simplify sqrt(252)-1 + (sqrt(343)-1)2 + sqrt(7). -5sqrt(7) + 343 Simplify ((sqrt(304) + 2 + sqrt(19) - sqrt(19)) + 2)*2. 32sqrt(19) + 320 Simplify 1sqrt(243)1. 9sqrt(3) Simplify (1sqrt(77)4 + sqrt(77))/((sqrt(28) + sqrt(56)/sqrt(2))/sqrt(4)). 5sqrt(11)/2 Simplify ((sqrt(2448) + -1 + sqrt(2448) + 4 + sqrt(2448) - (2sqrt(2448) + 3 - sqrt(2448)))2)*2. 39168 Simplify (-1(sqrt(304) - 1sqrt(304)) + -2 + sqrt(304) + -1)21. -24sqrt(19) + 313 Simplify sqrt(33)/sqrt(12) + sqrt(11) + (0 + sqrt(11))-5 + -1. -7sqrt(11)/2 - 1 Simplify 0 + (sqrt(1152) - ((sqrt(1152)1 - sqrt(1152)) + sqrt(1152)) - sqrt(1152))/(sqrt(81)6). -4sqrt(2)/9 Simplify sqrt(704)/sqrt(4) + -3 - (5 + (sqrt(11)1)2 - (1 + sqrt(11))4). -15 + 8sqrt(11) Simplify sqrt(243) + -4 - 5sqrt(18)/sqrt(6). -4 + 4sqrt(3) Simplify ((0 + sqrt(50) + -3)16)2. -1080sqrt(2) + 2124 Simplify sqrt(34)/(sqrt(2) - sqrt(8)-2). sqrt(17)/5 Simplify sqrt(325) + (-1sqrt(325) + sqrt(325) + 1)*2 + 2. 3 + 5sqrt(13) Simplify (sqrt(17) + sqrt(272) + 0)*26 + (sqrt(187) - (sqrt(187) + 1sqrt(187)1 - sqrt(187) - sqrt(187)))/sqrt(11). sqrt(17) + 2550 Simplify -4(sqrt(176)1 + -4). -16sqrt(11) + 16 Simplify (-1(sqrt(99) - sqrt(99)1) - sqrt(99))/((sqrt(324)1 - sqrt(324)) + sqrt(9)). -sqrt(11) Simplify 2(-2(-1 + sqrt(5)) + (0 + sqrt(605))*2). -4sqrt(5) + 1214 Simplify ((sqrt(20) + (-2sqrt(80))/sqrt(4))/(sqrt(100) - sqrt(100)-2 - sqrt(4)))*2. 5/196 Simplify (-1 + 3 + -4sqrt(1539))*2. -144sqrt(19) + 24628 Simplify (2sqrt(112) + 5)2. 80sqrt(7) + 473 Simplify (2 + 3 + -2sqrt(5))2 + (sqrt(180)1-1 + sqrt(180) + sqrt(180))2. -20sqrt(5) + 225 Simplify -4 + -6(5 + (sqrt(2) - (sqrt(2) - sqrt(8)/sqrt(4)))). -34 - 6sqrt(2) Simplify sqrt(36)/sqrt(300) + 0. sqrt(3)/5 Simplify (sqrt(171)/sqrt(3)1)/(2sqrt(108)). sqrt(19)/12 Simplify (-4 + -2sqrt(2) - sqrt(24)/sqrt(108))2. 56sqrt(2)/3 + 242/9 Simplify 4 + (2sqrt(13) + sqrt(13))2 + 1. 122 Simplify (-5(sqrt(88) - sqrt(88)-1))/(sqrt(968) - (sqrt(968) + sqrt(968) + (sqrt(968) - sqrt(968)2)) - sqrt(8))3. 30sqrt(11) Simplify (sqrt(32) + -2)*2 + sqrt(72)-6. -52sqrt(2) + 36 Simplify sqrt(12)/(1sqrt(12)/sqrt(3)). sqrt(3) Simplify (sqrt(120)/(sqrt(8)1))/(3sqrt(10)/sqrt(2) + sqrt(5) + sqrt(5)). sqrt(3)/5 Simplify (sqrt(95) - 2sqrt(95)-1)/((sqrt(90)/sqrt(3))/sqrt(6)). 3sqrt(19) Simplify (sqrt(242) + -1 - sqrt(242))2 - ((sqrt(32))2 + 0). -31 Simplify sqrt(325) - 6(sqrt(325) - (sqrt(325) + sqrt(325) + -1 + sqrt(325))*2). -205sqrt(13) + 17556 Simplify -3(2 + sqrt(63) - (sqrt(56)1)/sqrt(8))*2. -96 - 24sqrt(7) Simplify ((6sqrt(132)-1 - sqrt(132)) + sqrt(132))/(1sqrt(972)) + 3. -2sqrt(11)/3 + 3 Simplify (-1sqrt(847))2 + -5. 842 Simplify -1sqrt(55)/sqrt(5) - (5 + 2sqrt(11)). -3sqrt(11) - 5 Simplify (sqrt(22) - (sqrt(22) + (sqrt(22) - sqrt(44)/sqrt(2))3 - sqrt(22)))/(sqrt(121)/sqrt(99)). 3sqrt(2) Simplify -1sqrt(50)/(-2sqrt(1440)). sqrt(5)/24 Simplify (0 + sqrt(117))*2 + 4. 121 Simplify 1 + sqrt(343) + sqrt(7) + -1 + -2. -2 + 8sqrt(7) Simplify (sqrt(12) + (sqrt(432)1 - sqrt(12)))/(sqrt(28)/(sqrt(28)/sqrt(4))). 6sqrt(3) Simplify (1sqrt(405) - sqrt(405) - sqrt(405)) + -4 - sqrt(450)/sqrt(90). -10sqrt(5) - 4 Simplify (sqrt(204) + (sqrt(204)-1 - sqrt(204))4)/(sqrt(84)/(sqrt(21)/sqrt(3))). -7sqrt(17) Simplify -2 + -2 + sqrt(2) + 1 + sqrt(8). -3 + 3sqrt(2) Simplify (6sqrt(847))2 - (sqrt(21) + sqrt(168)/sqrt(8))/sqrt(3). -2sqrt(7) + 30492 Simplify 1 + (sqrt(133)/sqrt(7))2 + (sqrt(114)/sqrt(6))2 + -5. 34 Simplify (-2 + (sqrt(180)/sqrt(6))/sqrt(6))*2. -4sqrt(5) + 9 Simplify -1(sqrt(133) - (sqrt(133) + (sqrt(133) + (sqrt(133) + 3sqrt(133) + sqrt(133))6 - sqrt(133))))/sqrt(7). 30sqrt(19) Simplify 3 + sqrt(152)/sqrt(8) + 2. sqrt(19) + 5 Simplify ((sqrt(13) - (1 + sqrt(13)-2))-4)*2. -96sqrt(13) + 1888 Simplify sqrt(13) + ((sqrt(65)2)/sqrt(5))2 + (sqrt(13) - ((sqrt(130)-1)/sqrt(10))*2). 2sqrt(13) + 39 Simplify (4 + 1sqrt(567) + (sqrt(567) - (4 + 1 + sqrt(567))))2. -18sqrt(7) + 568 Simplify (sqrt(720)-2)2-4. -11520 Simplify sqrt(75) - (sqrt(75)1)2 - -2(sqrt(3) - sqrt(75)). -75 - 3sqrt(3) Simplify -2 + (11sqrt(13) - (sqrt(208))2-5). sqrt(13) + 1038 Simplify (((-2sqrt(68))/sqrt(2))/sqrt(2))2. 68 Simplify (-6(1 + sqrt(833)))*2 + sqrt(34)/(sqrt(2)-1 - sqrt(2)) + 4. 1007sqrt(17)/2 + 30028 Simplify sqrt(143)/(sqrt(33)/sqrt(3)4) - ((2sqrt(78))/sqrt(6) - (2sqrt(208) + sqrt(13))). 29sqrt(13)/4 Simplify (sqrt(384) - (-2sqrt(384) - sqrt(384)))/(sqrt(48)/(sqrt(12)	{ "pile_set_name": "DM Mathematics" }
, 3 Suppose -7w + 1 = -825. What are the prime factors of w? 2, 59 Let u(m) be the first derivative of m - 1 + 1/2m2. What are the prime factors of u(2)? 3 Let s = 67 + -25. What are the prime factors of s? 2, 3, 7 Let w(n) = n3 - 16n2 - 8n - 7. What are the prime factors of w(17)? 2, 73 Let d(p) = 2p + 9. Let a be d(-9). What are the prime factors of a/6-21? 3 Let l(u) be the third derivative of u4/24 - u3 + 2u*2. Let v be l(11). Suppose 14 = -vr + 79. What are the prime factors of r? 13 Suppose -2o + h + 18 + 3 = 0, -5h + 16 = o. Let j(l) = l*2 - 9l - 6. What are the prime factors of j(o)? 2 Let m = 10 + -8. What are the prime factors of (-15)/m(-2)/3? 5 Let y(r) = 30r + 3. What are the prime factors of y(7)? 3, 71 Let a(f) = f*3 - 6f*2 - 5f - 4. Suppose -y + 17 = -2k - 0k, -4y = -k - 33. Let w be a(y). Let d = -6 + w. What are the prime factors of d? 2 Let h = -14 + 23. Let u(r) = -r3 + 8r*2 + 11r - 11. What are the prime factors of u(h)? 7 List the prime factors of ((-1)/(-2))/(3/(-1350)-3). 3, 5 Let k = 12 + -10. Suppose 0 = -ka + 5a - 6. What are the prime factors of 20 + (1 - a)1? 19 What are the prime factors of 140/7(-48)/(-15)? 2 Let r = 274 - 131. List the prime factors of r. 11, 13 Suppose -5j + 23 = 13. Suppose -3z + jz = -5b - 54, -2z - 5b + 93 = 0. What are the prime factors of z? 7 Let g(y) = -y2 - 9y + 3. Suppose 2x + 10 = -0. What are the prime factors of g(x)? 23 Let s(j) = -2j*3 - 8j*2 - 5j - 3. Let d be s(-5). Suppose 2v + 2i = 7i + 23, 5v + 2i - d = 0. Suppose 1 - v = -n. What are the prime factors of n? 13 Suppose -2d + 30 = -o - 3o, -5d + 68 = -3o. Let m = 32 - d. What are the prime factors of m? 19 Let j be (-12)/10(-5)/2. Suppose -jh = h - 24. List the prime factors of h. 2, 3 Let r(v) = 14v - 7. List the prime factors of r(8). 3, 5, 7 Suppose -3r = 2q + r - 246, -2q = -5r - 210. Suppose -3v = 2v - q. List the prime factors of v. 23 Let b(a) be the first derivative of -a*4/4 + 5a*3 + 17a*2/2 - 4a - 2. List the prime factors of b(16). 2, 3 Let r(l) = -4l2 + 34l + 5. List the prime factors of r(5). 3, 5 Let g(q) = -q*3 + q - 1. Let d be g(2). Let t = d + 0. What are the prime factors of (t(-1)/(-1))/(-1)? 7 Suppose 0 = -k + 15 + 18. List the prime factors of k. 3, 11 Suppose 3d + d = 256. List the prime factors of d. 2 Let g(l) = 2l + 18. What are the prime factors of g(0)? 2, 3 Let h(b) = -b + 4. Let k be h(5). List the prime factors of 3 + (-1)/(k/7). 2, 5 Let n be 1/(-4) + (-18)/(-8). Suppose -22 = -nw - 4p, -w - 2w + p = -19. What are the prime factors of w? 7 Suppose 4s = -0s - 16. Let y = s + 24. What are the prime factors of y? 2, 5 Let a(x) be the third derivative of x6/120 + x5/12 + x4/12 - x3/2 - x2. Let c be a(-4). List the prime factors of (c + (2 - 2))2. 2, 5 Let i(o) = -20o - 12. What are the prime factors of i(-4)? 2, 17 Let x = 16 - -4. Suppose 0 = -5f + 110 + x. What are the prime factors of f? 2, 13 Suppose -5j = -3j + 2n - 136, -2n - 214 = -3j. What are the prime factors of j? 2, 5, 7 Suppose 25 = -4n - n. Let t = 1 - n. What are the prime factors of t? 2, 3 List the prime factors of (-8)/56 + 422/14. 2, 3, 5 List the prime factors of 20 + (3 - (-4)/4). 2, 3 Let y = -4 + 6. List the prime factors of 26y/4. 2, 3 Let q be (-3)/(-18) - (-3 + 273/18). Suppose -83 = 3n - 5y, 4n = 2y - 123 + 31. Let s = q - n. List the prime factors of s. 3 Suppose 5p - 8 = 4p. Suppose pg = 11g - 60. List the prime factors of g. 2, 5 Let i(w) = -3w + 3. Let q be i(3). Let f be q/(-5)(-120)/18. Let p = f - -15. List the prime factors of p. 7 Let j = 11 - -3. List the prime factors of j. 2, 7 Let j(x) = x3 + x2 + 2. Let i be j(-2). Suppose 5z = 4k - 52, 4z = -0k - 3k + 8. Let b = k - i. List the prime factors of b. 2, 5 Let h = -393 - -640. What are the prime factors of h? 13, 19 Suppose 0 = 9d - 7d. What are the prime factors of 18 - (-1 - (d - -2))? 3, 7 Suppose d + j + 1 - 27 = 0, -5d = -4j - 157. What are the prime factors of d? 29 Suppose 4 = -q - q. List the prime factors of (-1)/(30/16 + q). 2 Suppose 4n = -2t - 3t - 50, 2n = -3t - 28. Let p = t + 53. Suppose p + 13 = 5d. List the prime factors of d. 2, 3 Let h = 47 - 8. List the prime factors of h. 3, 13 Suppose 0b = -2b + 238. List the prime factors of b. 7, 17 Let t be (-1 - 3)(-9)/12. Suppose -2m = -3q + 80, -4m - 74 = -tq + m. What are the prime factors of q? 2, 7 Suppose 2b = 4g - 840, 4g + 0g = -2b + 848. What are the prime factors of g? 211 Let s be (-2 - 0) + 2 + -2. Let o be 0(s + 3 + -2). Let x(j) = -j + 4. List the prime factors of x(o). 2 What are the prime factors of (75/(-9))/((-4)/24)? 2, 5 List the prime factors of 1701 - (9/(-1) - -7). 2, 43 Suppose 3c + 0w - 4w - 17 = 0, -10 = 5w. Let z(u) = 2u*3 - 3u*2 - 5u + 2. List the prime factors of z(c). 2, 7 Let t be (0 + 8)/(6/3). Let b be 1/t + 42/(-8). Let a(z) = z*2 + 2z - 5. What are the prime factors of a(b)? 2, 5 Let o be (-1)/(4/5 + -1). Let r(m) = m*2 + m - 1. Let w(s) = -5s*2 + s - 2. Let n(l) = -4r(l) - w(l). List the prime factors of n(o). 2, 3 Suppose 0 = 5v - 2p - 97, -4v = -9v - 5p + 90. Suppose 2k - v = 47. List the prime factors of k. 3, 11 Suppose 2q = -4c + 166, -4q + 332 = -0c + 2c. List the prime factors of q. 83 Let r(k) = k3 - 15k*2 + 20k + 19. List the prime factors of r(14). 103 Suppose 0w = 4a - 3w - 8, -2w = -a + 2. Suppose -ac + 4 = -2. Suppose 3 = -cz, -i + 2z + 1 = -6. What are the prime factors of i? 5 Let b = 259 + -168. List the prime factors of b. 7, 13 Suppose 0 = -2o - t + 21, -5o - 4t + 19 + 41 = 0. List the prime factors of o. 2 Let n = 12 - 18. Let m = 10 + n. What are the prime factors of (-1)/((8/(-10))/m)? 5 Suppose 12x = 9x + 18. List the prime factors of x. 2, 3 Let g be (-1 - 0)(-4 + 1). Suppose -gr = x - 7, -2x = r + 2x + 16. Suppose l = -r - 1, 2a = l + 33. What are the prime factors of a? 2, 7 Suppose 123 = 4k - 37. What are the prime factors of k? 2, 5 Let f(a) = a*3 - 6a*2 - 4a + 3. Suppose 5n - 14 - 21 = 0. What are the prime factors of f(n)? 2, 3 Suppose 2l - 30 = -b + 3b, 4b - l = -60. Let u be (-6)/b + 16/10. Suppose 0 = 5j - j - 2k - 14, -uk + 1 = -j. What are the prime factors of j? 5 Suppose -2t + 24 = 3h + t, 2h - 46 = 4t. Let d = 19 - h. What are the prime factors of d? 2, 3 List the prime factors of (-12)/(-28) + (-1024)/(-28). 37 Suppose 26 = -3h - 91. Let f = h + 57. What are the prime factors of f? 2, 3 Let s = -1 - -4. Suppose -46 = -4t + sr, -t - 5r + 24 = 1. Let i = t - 2. What are the prime factors of i? 11 List the prime factors of 109 + ((-1 - 1) + -2)-1. 113 Let y = -114 + 193. What are the prime factors of y? 79 Let s(m) = -m*3 - 8m*2 + m - 11. List the prime factors of s(-9). 61 Let k(g) = 2g + 20. What are the prime factors of k(-9)? 2 Let h(l) = -l*3 + 3l*2 + l - 3. Suppose -30 = -4n - n + 5i, 3n - 4i - 21 = 0. Let q be h(n). Let f = 13 - q. List the prime factors of f. 13 Let b(y) = -y3 + y. Let t(m) = -6m*2 - 2m + 6. Let w(d) = -b(d) + t(d). Let o be w(7). Let u = -22 + o. What are the prime factors of u? 2, 3 Let f(h) = -2 + h + 7 - 3 + 6. Let v be f(-6). Suppose 6r - 48 = vr. What are the prime factors of r? 2, 3 Let d = 5 - 2. Suppose dg - 20 = -g. What are the prime factors of g? 5 Let i be 2 + (-6)/3 - 2. Let m be i/(-5) + 26/10. Suppose n + 0n = m. List the prime factors of n. 3 Let u be 0 + 2 + 0 + -2. Suppose 0 = 2z + 4p + 4, 0z - 2z - 2p = u. Suppose 13 = 2a - 5g, 0g + zg + 6 = a. List the prime factors of a. 2 Suppose -1 + 85 = 3c. List the prime factors of c. 2, 7 Let z be 84/10 - (-2)/(-5). Let b = z + -4. Let j(k) = -k*2 + 6k - 1. List the prime factors of j(b). 7 List the prime factors of -9(-4)/12 - -24. 3 Let x = -2 + 1. List the prime factors of (1 - x) + 6/6. 3 Let z(v) = 3v + 1. Suppose -3k = -2k - 5. Let n(a) = -3a - 2. Let u(h) = kz(h) + 4n(h). List the prime factors of u(6). 3, 5 What are the prime factors of ((-2)/2)/(2 + (-2664)/1328)? 2, 83 Let o(h) = 1. Let n(m) = -10m - 6. Let a(k) = -n(k) - 6o(k). Let j be a(2). Suppose 3d = 7*d - j. Wha	{ "pile_set_name": "DM Mathematics" }
. Is m at least -2? False Suppose 4k + 5l - 110 = -25, 2l = 5k - 98. Suppose k = 5v + 5p, -4v - 1 = 3p - 14. Let y = 1 - 1. Which is smaller: v or y? y Let t(o) = o*2 + 5o - 6. Let b be t(-6). Which is bigger: b or -7/6? b Let m = 1889/5525 + 4/221. Is -1 greater than m? False Let n = -235/2 + 120. Let u = -3 + n. Let j be -1 - (1 + (1 - 1)). Is u at most j? False Let s = 1 + 4. Let o = s - 9. Let b = -3 - -2.8. Is o != b? True Suppose 43 = 5g - 17. Let j be (-288)/(-27) - 1/(-3). Is g != j? True Let s = -0.003 - -0.103. Which is smaller: 0.19 or s? s Let o = -19 - -21. Is o at least as big as 2? True Suppose -a - 8 = -6. Which is smaller: a or -12/11? a Let f = -3 - -5. Let u = 0.08 - 0.04. Let v = u + -0.14. Which is smaller: f or v? v Let q(i) = i3 - 3i*2 - 4i + 2. Let w be q(4). Suppose 5k + 26 = 4g, 2g = -wg - k + 14. Which is bigger: g or 3? g Suppose -5r - 3h = h + 22, -4r - 5h - 23 = 0. Let d = -62 - -2789/45. Let v = d - 259/495. Is r <= v? True Let k be (105/(-9))/(5/15). Is -34 <= k? False Suppose 5p - 11 = 3b + p, b + p - 8 = 0. Suppose -5q - 22 = 2r, -q + br + 23 = -6q. Which is bigger: -3 or q? -3 Let o = 27 + -26. Which is greater: -4/17 or o? o Let i be ((-14)/28)/((-3)/2). Is i <= 16? True Let x(m) = 3m - 1. Let u be x(1). Let p = 13 + 3. Let k be u/5(-4)/p. Is k at least -1? True Let w be (1 + -6 + 3)/7. Let p(o) = 4o + 1. Let c be p(1). Suppose 25 = ck, 15 = 3y + 2y + 3k. Is y equal to w? False Let z be 15/(-2) + 2/(-4). Suppose 8t + 39 = -4m + 5t, 2m + 17 = t. Which is smaller: m or z? m Let l be 0 - (100/44 - 1). Let y = l - -53/33. Is y less than or equal to -1/3? False Suppose 5a - 7a = -5s - 20, 5s = -3a + 5. Let r be ((-6)/(-8))/(3/24). Let k(l) = l - 7. Let n be k(r). Is s < n? True Let u be (-90)/(-21) - (-2)/(-7). Suppose 4t = -2k + 146, -uk - 4t = -3t - 299. Let l = k - 451/6. Is l != 0? True Let r(b) = 0b + b + 1 - 1 - 5. Let c be r(5). Let x = -1/125 - 119/750. Is c > x? True Let q(j) = -2j2 - 2j - 5. Let w be q(-4). Let a = 146/5 + w. Which is bigger: a or -2? a Let p(l) = -7l2 - 4l + 2. Let t be p(3). Let u be -1 + t/(-18) + -3. Is -1 at least as big as u? False Let d = -970 - -3019/3. Let a = d - 37. Suppose -v = -5s - 39 + 14, -20 = v + 4s. Is a at most v? True Let i be (0 - -1 - -2) + -5. Which is greater: i or -3/5? -3/5 Let z = -33/238 - 5/34. Which is greater: 3/14 or z? 3/14 Let d be (0 - -1)(-3 + 2). Let v(m) = 2m - 12. Let x be v(6). Which is smaller: d or x? d Let d = -120 + 961/8. Let a = 222 - 224. Is d at least a? True Let t = -29 - -27. Which is greater: -5 or t? t Suppose 0w - 3w - 6 = 3s, 4w - 34 = 2s. Let u = -6 - s. Which is smaller: u or -3/7? -3/7 Let l be ((-588)/10)/((-5)/(-50)). Let k = l + 7638/13. Which is smaller: 0 or k? k Suppose 5r = -38 + 8. Which is greater: r or -11? r Let r(x) = 3x - 5. Let f be r(5). Let z(h) = -h2 + 11h - 12. Let b be z(f). Which is bigger: 1 or b? 1 Let c be -2(-2 + 3)/(-2) - 70. Is -68 greater than or equal to c? True Suppose -9p + 236 = 83. Is 33/2 at least p? False Let p be 2 + -88/30. Is p <= -12? False Let d = 0.05 - 0.25. Let z = 0 - -3. Suppose 0 = -zu - 2a - 3, -4a + 2 = 2u + 12. Which is smaller: d or u? d Let s = 751/36 + -208/9. Let y = s + 3/4. Suppose 0 = 4u + 12, 0 = -2d + 4u - 0 + 6. Are y and d unequal? True Let j = -20 - -25. Suppose 5h + ju = 50, -4h = -2h - 2u. Is 7 != h? True Let d be -15(2 - (-32)/(-12)). Does d = 19/2? False Suppose 3s = 3u + 190 - 532, -3u + 327 = 2s. Let x be u/105 - 1/(-7). Which is bigger: x or 1? x Let r = -0.04 + 0.01. Let c = 0.23 - 0.3. Let v = c + r. Which is bigger: -7 or v? v Suppose 5m = 2m - 2n - 11, 2m - 3n + 29 = 0. Is m < -8? False Let b be 1/(-3) - (-4)/3. Let h = -7/16 + 19/16. Is b >= h? True Suppose 0 = 5a - 19 + 49. Let y = a + 5. Which is bigger: y or 1/4? 1/4 Let l = -3093 + 349507/113. Are l and -1 unequal? True Let u be (-1)/(-4) + 81/(-276). Which is greater: u or -1? u Let h(j) = j - 2. Suppose -2s - d = -0d - 8, -5d = -5s + 20. Let l be h(s). Suppose -2m - m - w - 7 = 0, 0 = 3m + lw + 5. Is m less than -3? False Let k(m) = m + 8. Let s be k(-11). Let b = -1 - s. Suppose v + v + b = 0. Is -1/2 at most as big as v? False Suppose 0 = -3u + 5b + 18, 3b + 8 = u - 2. Suppose -f + 0 - u = 0. Which is smaller: 0.1 or f? f Let p be -3(2 - 1)-69. Suppose 3r + 39 = p. Suppose 4u - r = 5t, -t = -u - 0t + 13. Do u and 10 have different values? True Let g be (-51)/6-1-2. Let y = 21 + g. Which is greater: 0 or y? y Let m = -58 + 59. Is m smaller than 5/14? False Let g = -12 + 11.95. Is g equal to 0? False Suppose -m + 30 = 2n, n - 13 = -4m + 9. Which is bigger: 16 or n? 16 Let c be 4 + -2 + (-1 - -3). Suppose 0 = -w - 3s - 15, -cs - 28 = -2w + 6w. Is w equal to 2/5? False Let y(x) = -4x + 4. Let t be y(6). Let s = t + 22. Let a(n) = -n3 + 3n*2 - 1. Let z be a(1). Is z less than s? True Suppose d + 7 = -3i - 0, -2d - 5i = 17. Is -17 < d? True Suppose -78s = -77s - 17. Is 17 > s? False Let j = -10 - -2. Let n be 18/(-27) + j/(-6). Which is bigger: n or 7? 7 Let c be ((2 - -1 - 4)3)/(-1). Let r be 2/211 - 0. Suppose -cv + r = -4n, n = -4v - 2n - 27. Which is smaller: -2 or v? v Suppose 0 = -2q + 10, 67 = 3m - 0m + 5q. Let f = m - 6. Suppose 2k = -2k - f. Which is greater: 0 or k? 0 Let y = 0.44 + 0.06. Let q = 2.5 - y. Which is greater: q or -3? q Let x = -534/5 - -110. Let o = 23 + -20. Which is smaller: o or x? o Let r be 4/4 - (-10)/(-8). Suppose -3m - 2v - 10 = 0, -3m = -0m - 3v + 15. Let w be m/(-10)10/14. Which is bigger: w or r? w Let j = 26 + -12. Which is smaller: j or 13? 13 Suppose 6w - 2n + 47 = w, 0 = 5w - 3n + 43. Let l be 7/3 + (w - -9). Suppose 2t = -0t + 2. Is l at least as big as t? False Suppose 4c - 3 = 7c. Is 4/9 smaller than c? False Let j be ((-3)/(3/(-2)))/(42/(-12)). Which is smaller: 0 or j? j Let a = -66047/101780 - -155/727. Let f = 3/20 + a. Let n(i) = -i*2 + 8i + 10. Let p be n(9). Does p = f? False Suppose -n - 96 = 2n. Let r = n + 259/8. Which is greater: 0 or r? r Suppose -2d - 2b + 14 = 2b, -5d + 2b = -23. Let g = d + -4. Suppose 4j + 0 = 8. Is j != g? True Suppose 2x + 0x = -10. Let k be (-1)/(-5)x/4. Is k bigger than -1? True Suppose 0 = -0r - r - 6. Is r less than -6? False Let y = -8 + -2. Let g = 12 + y. Suppose -2v + 6v = 0. Is g > v? True Let n = -0.35 - 26.65. Let v = -25.05 - n. Let p = -0.05 - v. Which is smaller: p or 0.1? p Suppose p + 1 + 2 = 0, i + 5p + 14 = 0. Let n be (-3 + i)-1 + 1. Suppose 4a + 0j = -j - n, -5a = -3j + 25. Is a > -2? False Suppose 0w = 2w - 4. Let y = 8 + -6. Suppose yu - 5 + 1 = 0. Is u at least w? True Let g = -52 + 33. Are -19 and g non-equal? False Let f be -2 - (2 - 8) - 2. Is f <= 1? False Let a(c) = -2c + 9. Let x be a(-4). Which is bigger: x or 16? x Let f be 6/3 + (1 - -1). Let y = f - 2. Let h = 1 - 3/2. Which is smaller: y or h? h Let c be ((-2)/(-2))/(11/572). Which is bigger: 53 or c? 53 Suppose 0 = 4d - 16, 2z + 18 = d + 4d. Let f(g) = -g*3 - 4g*2 + 3g - 1. Let m be f(-5). Let t be 12/mz/(-4). Which is smaller: 0 or t? t Let r(k) = -k2 + 12k - 26. Let m be r(9). Suppose 3g - 2g = 4. Suppose -2l = 2l - g. Is m at most l? True Let s(p) = p*2 - 3p - 8. Let u be s(6). Let z be u/(-5)1/(-2). Let n be (-2)/(-3)3/(-11). Which is greater: n or z? z Let n = 82832/55 + -1506. Which is smaller: n or -1? -1 Suppose 2f - 1500 = -3f - 2c, f = -5c + 277. Let a = 896/3 - f. Which is bigger: -3 or a? -3 Suppose -s = -4y + 8, 6s - s - 29 = -3y. Suppose 2b + 10 = -yb. Let r be b - 1(-3 - -2). Is r != 0.2? True Let a be -2 - -1 - (-72)/60. Suppose 2w = w + 3. Suppose -3m + 10 = -4l, 3l + 4m = 2 + w. Does a = l? False Let f = 23 + -8. Let y = 16 - f. Are 2 and y nonequal? True Suppose d = -3r - 7, 2r = -2d + 6d - 14. Which is bigger: r or -4? r Let b = -56 + 396/7. Let o = 6/35 - b. Let g be 3-12/6. Which is bigger: o or g? o Suppose 8 = d + 2v, -2d + 3v - 12 = -0d. Let i(k) = -26k - 12. Let y be i(-12). Let r = y - 5102/17. Is r bigger than d? False Let m = 1 - 6. Is m greater than -3? False Let v = -4 + 2. Let x = -30	{ "pile_set_name": "DM Mathematics" }
32)). -14 Evaluate 91 + (-151 - -66 - -17). 23 Calculate -83 + -9 + (-479 - -557). -14 What is -13 + (22 - 7) - -16? 18 What is the value of 1 + 6 + 13 + -17 + -4 - (2 - 7)? 4 23 + -97 + -3 - -40 -37 What is -47 + 1 - (-53 + 37 + 5) - 3? -38 Calculate (23 - 11) + 11 + -6 - (1 + -4). 20 Calculate -48 + (17 + -32 - -73) + 89 + 1. 100 Calculate (1 - 1 - 76) + -6 + 30 + -10. -62 What is (-11 - (-14 - (86 + -19))) + -31 + 21? 60 What is (2013 - 1997 - ((1 - -22) + 1)) + -33? -41 What is -65 + (-539 + 533 - (0 + (0 - 26)))? -45 -100 + 178 + (-67 - 63) -52 Evaluate (-2 - (3 + 23)) + (35 - (37 - (3 - 8))). -35 ((-5 - 3) + (-7 - (-22 + -7)) - -86) + -14 86 Calculate (0 - 7) + (1 - 31) + (-71 - -113). 5 What is 7 + (13 - 5) + (2 - -16) + -15? 18 17 - (28 - ((-44 - -13) + 14 + 2)) -26 Calculate 18 + (-15 - -13) - (38 - 4) - 8. -26 Calculate 85 + (7 - 0) + (6 - 4 - 16) + -7. 71 Calculate 76 - (1 - 14 - (1949 + -1996)). 42 Calculate (-13 - ((1 - -32) + (143 - 147))) + 8. -34 Calculate 1 + -6 + (18 - (5 - -10)) + -2. -4 25 - (167 - 172 - (-2 - -19)) 47 -34 - -39 - (27 - 19) - 30 -33 What is (1 + -5 - 3) + (24 - (16 - -35))? -34 Evaluate (64 - -1) + (185 - 344). -94 Calculate -4 + 84 - 57 - 18. 5 What is the value of -1 - (-12 - -2 - (-6 - 15 - -29))? 17 Evaluate 28 + -1 - (6 + -15 + -2). 38 Calculate -206 + 249 + 1 + -36. 8 What is the value of (1 - -7 - -9 - 3) + 33? 47 1 + -5 + -3 - (8 + (-70 - -21)) 34 What is the value of ((-19 - 2) + (33 - 5) - (4 - -2)) + 98? 99 Evaluate (-57 - ((-2 + -2 - 0) + (-536 - -547))) + -12. -76 What is the value of -35 - (-21 + 12) - (-259 - -314)? -81 Calculate -136 + 72 - (5 - (0 + -9 - (-9 + 5))). -74 -152 + 82 - -67 - (0 - 4) 1 Evaluate (-238 - -146) + -3 + 36 + 2. -57 24 + (29 - 17 - -28) + -4 60 Evaluate (13 - (96 + -41)) + 44. 2 What is -24 + (0 - -1) + -5 + -15 + 8 + 9? -26 Calculate 3 - (-13 + 23) - 8 - -48. 33 What is the value of -13 - (-1 + -12 + -17) - -18? 35 What is the value of -27 + 68 + -34 + 46? 53 Evaluate (-2 - (-57 + -3)) + -18 + 47 + -28. 59 What is the value of 123 + (-13 - -54) + -123? 41 What is (2 + 36 - 3) + (22 + -46 - -29)? 40 Evaluate -22 - (5 + -8) - (-12 - (-35 - -36)). -6 What is 7 + 9 + 14 + (4 - (7 + 1)) + -70? -44 What is ((9 - 21) + -1 - (12 - 33)) + -120 + -5? -117 What is the value of (-14 + 29 - 46) + 38 + 98? 105 What is -158 + 83 + (-3 + -1 + -2 + 4 - -2)? -75 What is the value of 16 - (143 - (-34 + -2 + 9))? -154 Calculate (-11083 - -10968) + (28 - 0). -87 What is 321 - 324 - (0 + 79)? -82 What is 17 - ((29 - 27) + 21)? -6 What is (30 - 89) + 86 + -73? -46 What is the value of 113 - ((-114 - -36) + 132)? 59 What is 711 + -742 + 0 + 39 + 36? 44 What is the value of 2 - -12 - (-47 + 66 - (-3 + 21)) - 9? 4 Calculate -89 + (12 - (23 - -5)) + 44. -61 Calculate 28 + 69 + 15 + 30 - (5 + -1 + -5). 143 What is (-6 - (-2 + -5)) + (14 - 12) + -70 - -7? -60 What is the value of -42 + -4 + (8 - (49 + -38 + (-4 - -2)))? -47 What is (-1 + (14 - 17) - (2 - 19)) + 61? 74 What is -2 + (12 - (-4 - (4 + -12)) - 10)? -4 14 + -11 + (9 - (15 - 12)) - -47 - -9 65 170 - (83 + -190 + 153) 124 What is -15 + 8 - -12 - (-3 + -4 + 12 + 26)? -26 Evaluate (-1 - (0 + -1) - 73) + (-58551 - -58556). -68 Calculate -221 + 283 + (-54 - -4). 12 34 + 94 + -40 - 26 62 (70 - 59 - ((1 - 2) + 16)) + -2 + 10 4 Evaluate -6 + 4 + (4 - 6) + -58 + 2 + 19. -41 Calculate -2 + 47 - (86 + -128). 87 What is 1 - 20 - (124 - -17 - (104 - 41))? -97 -31 + 14 + (-6 - (8 + -2 + -5)) + -2 -26 What is the value of (-139 - (18 - 64)) + 43? -50 What is (1 - 2) + 78 + (70 - (111 + -54) - -2)? 92 Calculate 14 + 3 + (-10 - 20) - (-10 - 4 - -5). -4 What is the value of 7 + 2 + (-3 - (-4 - 0) - (84 - 108))? 34 Evaluate 9 + (-98 + 118 + (-7 - 2) - (-16 - -1)). 35 51 + (4 - 48) + -39 -32 Evaluate 6 - (-1 + -8) - (19 - (-5 + 14)) - -106. 111 Calculate (144 - -4) + -91 + 15. 72 What is the value of -52 + 4 - (-9 + -3)? -36 27 - (-48 + 76) - (-4 + (-9 + 6 - -24)) -18 What is 7 + -1 + 5 - (17 + (25 - -22))? -53 What is (46 - 13) + -45 - (-4 - (99 + 1) - 1)? 93 -29 - (25 - (6 + 11)) - -25 -12 What is (-13 - 1) + 7 + 2 + (9 - 5) + -36? -37 Calculate -11 - (-39 + ((-11 - (2 - 3)) + -8 - -13)). 33 Evaluate -4 + (20 + (-19 - 19) - -21). -1 Calculate 1 - 0 - (139 - 55) - (3 + 15 - 30). -71 What is 620 + -635 - (0 - -30)? -45 What is the value of -58 + -2 + -73 + 196? 63 Calculate 0 - -31 - (-2631 - -2673). -11 Evaluate -17 - (-43 - 1) - -7. 34 (3 - (29 - 1)) + -10 + 27 -8 Calculate -5 + 82 + 26 + (6 - -5) + 0 + -1. 113 What is (-25 - -48) + 6 - ((-13 - -7) + -15)? 50 Evaluate (9 - -3) + (-2 + 10 - 11) + 84 + 6. 99 Calculate -24 - (-2 - (-488 + 477 - (1 - 14))). -20 What is the value of 3 + -91 + 1 - (8 - (-150 + 137))? -108 What is the value of 10 + (0 + 0 - (113 - 88))? -15 5 + -145 + 105 + 6 -29 What is the value of -11 + (-15 - -12) + (-27 - (2 - -4))? -47 Calculate 20 + -28 + -64 + -16 + 4 + -5. -89 (-45 - (4 - (4 + 7))) + 13 + -1 -26 What is the value of -51 + -12 - (0 + -37 + 20)? -46 9 + -4 + 1 + -9 + 379 + -383 -7 36 + 26 + (-30 - 63) -31 Calculate -2 - (11 - 18) - (-25 + 18 + -9). 21 Evaluate (-22 - -55) + 49 + -191. -109 -29 - ((-20 - (15 + -29 + 5)) + (-2 - -9)) -25 What is -18 - (-17 + 6 + 18 + 12)? -37 What is the value of 16449 + -16406 + (-2 - -1) + -4? 38 What is the value of 3 - 0 - ((-68 - (-12 - 5)) + 7 + 21)? 26 328 + -208 + -130 - (103 + -1 + 0 + -1) -111 Calculate -160 - (-157 - -86) - 5. -94 Calculate -80 - (-69 + 15 - 92). 66 Evaluate (-204 - -51) + (4 - (-35 + 18)). -132 (-366 - -387) + (35 - 3) 53 What is the value of 10 + -9 - (17 + -31) - 19? -4 Calculate (13 - -2) + 2 + -7 + 42 + -1 + -25. 26 (-15 - ((-44 - -1) + -577 + 600)) + -4 1 Evaluate (4 + -38 - -19) + (-17 + 3 - -3). -26 What is (-28 - (20 - 12)) + 30? -6 What is 16 - (-8 - -49) - -53? 28 Calculate -36 + 7 - (17 + -5). -41 What is 7 + (43 - 18 - 8) - (-66 + 1)? 89 4 + -111 + (149 + -156 - (-18 - 0)) + -8 -104 Calculate -39 + 4 - (57 + 100 + -274). 82 What is the value of 6 + (11 - 68) + 10? -41 Calculate 24 + (53 - 8 - (47 + -15)). 37 What is -111 - -93 - (0 - 5) - -2? -11 Evaluate -28 - (2 + 13 - (40 + -17)). -20 Calculate 6 + 50 + -20 + 11. 47 What is the value of (5 - -11) + (-142 - 33) + 25? -134 What is -41 + 81 + (-65 - -20)? -5 (35 - (1 - -38)) + 1 + -12 + 2 + -11 -24 9 + 11 + 21 + -1 + -21 19 Evaluate 5 + 42 + (-72 - -71) + (-11 - -2). 37 Evaluate -9 - (1 + 1 + -11 - (313 - 312)). 1 52 + -14 + 6 + -2 + 3 + 2 47 What is the value of (9 - (7 + -5)) + 3 + 1 + -74? -63 What is -22 + (89 - 57) - -33? 43 Evaluate 5 + 0 - (1 - (18 + (-2 - -4))). 24 Calculate -23 - (-29 - (7 - 5)) - 18. -10 Evaluate 295 + -108 - 86 - 128. -27 What is -10 + -3 + 21 + -60 - (-6 - 2)? -44 Calculate (-801 - -836) + -6 + -1 + -5. 23 What is the value of (3 + 15 - 5 - -6) + (-376 - -378)? 21 What is 23 + 286 + -298 + 10 + (-5 - -4)? 20 What is the value of (-1 + 5 - (-2 + (3 - -8))) + -34? -39 680 + -34 + -655 + -1 + (11 - 0) 1 What is (1 - (1 - 13)) + (66 - -166 - 248)? -3 Calculate (-62 - (-42 - 7)) + -48. -61 What is the value of -16 + -1 + 14 + (17 + -22 - 8)? -16 420 + -384 - (4 + 9) 23 What is -14 - (18 + -27 - (16 - 23))? -12 (-19 - -3) + (287 - 371) + (-1 - 2) -103 What is the value of 12 + (-22 - -12) - (85 + -8 + -8) - -4? -63 What is (-112 + 234 - 246) + 221? 97 Calculate (24 - ((24 - 46) + 56)) + 5 - 101. -106 2 - (1 + 36 - (-17 + 2 + (14 - -3))) -33 Evaluate -2 + -62 + 90 + -10. 16 15 + 34 - (2 + -17) - 22 42 What is the value of 8 - (7 - -8 - 6) - (-4 + -6 - -5)? 4 61 - 98 - (-20 - -1) - -74 56 Calculate 107 - (150 + 74 + -115). -2 -4 + 1 + (-1 - 54) + -43 + 52 + 20 -29 -62 + 28 + 57 + 18 + 0 41 What is 69 + (21 + -49 + 22 - -8)? 71 20 - 111 - (137 - 291) 63 -14 + 40 + -28 - ((5 - 4) + 0) -3 What is the value of (14 - 17) + 4 - 18 - (-5 - -1)? -13 What is the value of 110630 + -110520 - ((34 - 0) + 0)? 76 What is the value of -15 + 6 - (1 + 12 + -16)? -6 What is the value of -380 + 401 - (-2 - -1) - 15? 7 Evaluate 31 + 1 - (-3976 - -4021). -13 What is the value of 2 + -16 - 6 - (15 + -10 - -5)? -30 Calculate (-95 + 20 - -46) + (-7 - 0 - 2). -38 -491 + 500 + (5 - (1 + 2 + (148 - 8))) -129 Evaluate -60 + 110 - (2 + -2 - (29 + -29)). 50 What is -20 + (-1 - -4) + (2 - -3 - -5)? -7 W	{ "pile_set_name": "DM Mathematics" }
hdhdhdhhh. 1/91 What is prob of sequence kzez when four letters picked without replacement from {z: 9, k: 7, e: 1, t: 2}? 7/1292 Two letters picked without replacement from {r: 1, n: 1, b: 1, i: 2}. Give prob of sequence in. 1/10 Calculate prob of sequence hsrh when four letters picked without replacement from vkrsjjkhkjkh. 1/5940 What is prob of sequence xeef when four letters picked without replacement from {h: 1, l: 4, j: 2, e: 2, f: 5, x: 1}? 1/3276 Calculate prob of sequence tx when two letters picked without replacement from {t: 3, x: 4, r: 1, g: 4, s: 1}. 1/13 Two letters picked without replacement from {g: 1, s: 1, w: 2, f: 2, v: 4}. What is prob of sequence sv? 2/45 Calculate prob of sequence okcx when four letters picked without replacement from {r: 4, k: 4, c: 1, x: 2, i: 2, o: 1}. 1/3003 Calculate prob of sequence ggg when three letters picked without replacement from sagargarsrssg. 1/286 What is prob of sequence dtd when three letters picked without replacement from {p: 12, h: 1, t: 1, v: 2, d: 2}? 1/2448 Four letters picked without replacement from {z: 3, x: 3}. Give prob of sequence zxzz. 1/20 What is prob of sequence hgu when three letters picked without replacement from huhegpp? 1/105 Four letters picked without replacement from {p: 1, h: 5, c: 2, y: 3, b: 6}. Give prob of sequence cpch. 1/5712 Two letters picked without replacement from zzzzjnjujnu. What is prob of sequence zz? 6/55 Calculate prob of sequence kkjk when four letters picked without replacement from bbjjbkjbbbjbbjjbjb. 0 What is prob of sequence qsqs when four letters picked without replacement from llsscqqsqsq? 1/55 What is prob of sequence rrrr when four letters picked without replacement from {r: 4, o: 3, t: 6}? 1/715 Four letters picked without replacement from {s: 2, l: 7}. Give prob of sequence llss. 1/36 What is prob of sequence ldl when three letters picked without replacement from {l: 13, d: 5}? 65/408 What is prob of sequence ll when two letters picked without replacement from {e: 2, s: 2, o: 2, l: 2, y: 4, n: 2}? 1/91 Calculate prob of sequence yaha when four letters picked without replacement from aahaahyyaaaaaaaya. 33/2380 Calculate prob of sequence ifj when three letters picked without replacement from {j: 2, f: 9, i: 5}. 3/112 Four letters picked without replacement from {v: 1, b: 1, r: 11, c: 1, j: 1}. Give prob of sequence vrbc. 11/32760 Calculate prob of sequence jmm when three letters picked without replacement from {m: 2, j: 9}. 1/55 Three letters picked without replacement from uggogougvvuu. What is prob of sequence ovu? 2/165 Four letters picked without replacement from qpqqkkkkqqkqqkqpqqq. Give prob of sequence pkpq. 11/7752 What is prob of sequence cf when two letters picked without replacement from ccf? 1/3 What is prob of sequence ttac when four letters picked without replacement from cacctttta? 1/42 Three letters picked without replacement from {v: 2, j: 7}. What is prob of sequence vvj? 1/36 Four letters picked without replacement from xxkkhkkkhxxhk. Give prob of sequence xxkh. 9/715 What is prob of sequence nen when three letters picked without replacement from ennepnpnnnnnn? 12/143 Three letters picked without replacement from xffxxfx. Give prob of sequence xxx. 4/35 Four letters picked without replacement from {u: 5, z: 5}. Give prob of sequence uzzu. 5/63 Three letters picked without replacement from {i: 1, d: 1, e: 2}. What is prob of sequence eed? 1/12 What is prob of sequence kl when two letters picked without replacement from lkkkkkkkkl? 8/45 Three letters picked without replacement from apguupga. What is prob of sequence aga? 1/84 Four letters picked without replacement from {v: 3, x: 3, j: 3, e: 1, c: 2, u: 4}. Give prob of sequence uxvv. 3/1820 Calculate prob of sequence eyr when three letters picked without replacement from yygekkkkggggrggrre. 1/408 What is prob of sequence ozz when three letters picked without replacement from zoozzzooooo? 14/165 Four letters picked without replacement from {z: 2, j: 4, a: 2, q: 1, e: 3, p: 6}. Give prob of sequence aazj. 1/4590 Four letters picked without replacement from wwkkafyawkkagkkgg. Give prob of sequence aywa. 3/9520 Calculate prob of sequence mt when two letters picked without replacement from {q: 2, t: 3, g: 9, n: 1, m: 1, c: 2}. 1/102 Three letters picked without replacement from wwywywww. Give prob of sequence www. 5/14 Two letters picked without replacement from {i: 3, q: 2, g: 1, x: 1, t: 1, e: 4}. What is prob of sequence xt? 1/132 What is prob of sequence ffff when four letters picked without replacement from {f: 4, k: 15}? 1/3876 What is prob of sequence ssbe when four letters picked without replacement from {s: 2, j: 1, p: 1, b: 1, e: 2}? 1/210 Two letters picked without replacement from vttgggttvvvvvvgvv. Give prob of sequence vv. 9/34 Calculate prob of sequence em when two letters picked without replacement from emmmmme. 5/21 Four letters picked without replacement from {u: 2, q: 11, g: 6}. What is prob of sequence guqu? 11/7752 Calculate prob of sequence cej when three letters picked without replacement from {x: 4, i: 3, e: 4, k: 1, c: 1, j: 1}. 1/546 Calculate prob of sequence ddff when four letters picked without replacement from {p: 1, f: 14, d: 5}. 91/2907 Calculate prob of sequence fd when two letters picked without replacement from dfvffvvf. 1/14 What is prob of sequence wg when two letters picked without replacement from {w: 9, n: 1, g: 10}? 9/38 Four letters picked without replacement from glolgliclc. Give prob of sequence occg. 1/1260 What is prob of sequence gggh when four letters picked without replacement from gggghghgggggg? 3/26 Three letters picked without replacement from {x: 1, r: 1, z: 1, q: 6}. Give prob of sequence zxq. 1/84 Two letters picked without replacement from {q: 1, c: 2, a: 2, w: 1, k: 12}. Give prob of sequence kk. 22/51 Four letters picked without replacement from {k: 3, f: 1, j: 4}. Give prob of sequence fjkj. 3/140 Calculate prob of sequence psp when three letters picked without replacement from {b: 3, s: 4, p: 2}. 1/63 What is prob of sequence di when two letters picked without replacement from zdi? 1/6 Two letters picked without replacement from debvhvhhbh. What is prob of sequence vh? 4/45 Three letters picked without replacement from llkkekkleklk. What is prob of sequence lll? 1/55 Four letters picked without replacement from {e: 3, b: 6, m: 2, c: 2, n: 2}. What is prob of sequence cene? 1/1365 Two letters picked without replacement from {m: 2, w: 1, l: 1, s: 2}. What is prob of sequence ss? 1/15 Two letters picked without replacement from {p: 7, e: 1, q: 1}. Give prob of sequence qp. 7/72 Calculate prob of sequence nn when two letters picked without replacement from {i: 7, f: 3, n: 2}. 1/66 Calculate prob of sequence ac when two letters picked without replacement from {a: 17, c: 3}. 51/380 Two letters picked without replacement from {u: 7, k: 5, a: 4}. Give prob of sequence uk. 7/48 Four letters picked without replacement from cxgcewa. Give prob of sequence xcex. 0 Two letters picked without replacement from xnxinxixkpwnxpxip. Give prob of sequence pw. 3/272 Calculate prob of sequence dxgb when four letters picked without replacement from iicddbgxxgci. 1/1485 Three letters picked without replacement from {j: 1, u: 1, t: 1, s: 2, w: 1, e: 1}. Give prob of sequence ssj. 1/105 Three letters picked without replacement from lddlllllllll. What is prob of sequence ldl? 3/22 Three letters picked without replacement from jxjca. Give prob of sequence acj. 1/30 Two letters picked without replacement from {s: 1, p: 1, y: 1, f: 1, d: 1, e: 2}. Give prob of sequence yd. 1/42 Calculate prob of sequence om when two letters picked without replacement from {o: 1, m: 1, r: 1}. 1/6 Calculate prob of sequence yy when two letters picked without replacement from {y: 4, m: 1, u: 3}. 3/14 What is prob of sequence dk when two letters picked without replacement from {k: 12, d: 7}? 14/57 What is prob of sequence rgv when three letters picked without replacement from xgtxrtvd? 1/336 Three letters picked without replacement from {r: 2, b: 6, k: 4, p: 3, v: 4, j: 1}. Give prob of sequence rvk. 4/855 Four letters picked without replacement from {w: 4, m: 4	{ "pile_set_name": "DM Mathematics" }
culate the highest common factor of 70388976 and 48. 48 Calculate the highest common factor of 75 and 4548525. 75 Calculate the highest common divisor of 3115 and 301603645. 3115 Calculate the greatest common factor of 2524926 and 110038. 2974 Calculate the greatest common factor of 19 and 2755747. 1 What is the highest common divisor of 8 and 5082548? 4 What is the highest common factor of 8725 and 1843069? 349 What is the greatest common divisor of 368 and 465474? 46 Calculate the highest common divisor of 31652 and 2849452. 772 What is the highest common divisor of 62695186 and 8194? 482 What is the highest common factor of 21589605 and 1805? 1805 Calculate the highest common divisor of 34998 and 566466. 114 Calculate the highest common divisor of 367158346 and 158. 158 What is the highest common divisor of 16 and 656068784? 16 Calculate the greatest common divisor of 662548 and 400843. 73 What is the greatest common divisor of 132827885 and 255? 85 Calculate the greatest common factor of 4530 and 229230. 30 Calculate the greatest common divisor of 1885 and 3014260. 145 Calculate the highest common factor of 449508 and 558924. 564 Calculate the greatest common factor of 2462516 and 19096. 868 Calculate the greatest common divisor of 6202028 and 4508. 196 Calculate the highest common factor of 164292 and 1868. 4 What is the greatest common divisor of 36 and 464974614? 18 Calculate the highest common factor of 20772 and 1021632. 12 What is the highest common divisor of 304 and 1029698? 2 What is the greatest common divisor of 4926 and 11515346? 1642 Calculate the highest common divisor of 327500 and 208028. 524 Calculate the greatest common factor of 147419285 and 555. 185 What is the greatest common factor of 16238 and 7641391? 353 What is the highest common factor of 49 and 4407893? 49 Calculate the highest common divisor of 74767938 and 2550. 102 What is the greatest common factor of 217649 and 138851? 23 Calculate the greatest common divisor of 110044 and 2966678. 902 What is the greatest common factor of 1875 and 362150625? 1875 What is the highest common factor of 55128 and 186? 6 Calculate the highest common divisor of 5584 and 4096562. 698 What is the greatest common divisor of 48 and 603001428? 12 Calculate the greatest common factor of 8805 and 353515. 5 What is the greatest common divisor of 112942155 and 13491? 4497 Calculate the greatest common divisor of 17757389 and 403. 403 What is the greatest common factor of 255140 and 6400? 20 Calculate the highest common factor of 1279200 and 134004. 156 What is the greatest common factor of 28416 and 3936? 96 What is the highest common divisor of 3049664 and 11968? 1088 What is the greatest common factor of 4088128 and 528? 176 Calculate the greatest common divisor of 2070 and 323317440. 2070 What is the highest common divisor of 4212 and 600860? 52 What is the greatest common divisor of 1140156 and 98739? 1863 Calculate the greatest common divisor of 6647140 and 978. 326 Calculate the highest common divisor of 25318236 and 474. 474 Calculate the highest common factor of 2050 and 6119425. 25 Calculate the highest common divisor of 75 and 139341525. 75 What is the greatest common factor of 766 and 15071816? 766 What is the greatest common factor of 572 and 81438643? 143 What is the highest common divisor of 222604 and 27782? 58 Calculate the highest common divisor of 1849496 and 64. 8 What is the greatest common divisor of 114 and 10509166? 38 What is the highest common divisor of 164 and 36304? 4 Calculate the greatest common factor of 24738334 and 515. 103 What is the highest common divisor of 121 and 13192025? 121 What is the highest common divisor of 83439563 and 214? 107 Calculate the greatest common factor of 17 and 48782061. 17 Calculate the greatest common factor of 171 and 24956136. 9 Calculate the highest common factor of 849648 and 213156. 372 Calculate the highest common factor of 2961 and 968172975. 2961 Calculate the greatest common factor of 468 and 36974340. 468 What is the highest common divisor of 5649545 and 35695? 3245 What is the highest common factor of 46 and 69952522? 46 Calculate the greatest common factor of 277109008 and 11. 11 What is the greatest common divisor of 46676 and 84938? 14 What is the highest common factor of 22794 and 469626? 174 Calculate the greatest common divisor of 90064801 and 193. 193 What is the greatest common factor of 465267 and 1518? 759 Calculate the greatest common factor of 11000 and 1375528. 88 What is the greatest common divisor of 1548 and 3096258? 258 What is the greatest common divisor of 32 and 32104024? 8 Calculate the greatest common divisor of 8085 and 917455. 385 What is the greatest common divisor of 192052847 and 413? 413 What is the greatest common divisor of 766395 and 175? 35 Calculate the greatest common factor of 1206 and 19223037. 603 Calculate the highest common factor of 10000 and 2950. 50 What is the greatest common divisor of 299968137 and 487? 487 Calculate the highest common factor of 486167 and 5000215. 2519 Calculate the greatest common factor of 8701792 and 968. 88 Calculate the greatest common factor of 3866 and 15574181. 1933 Calculate the highest common factor of 96524 and 28433680. 1636 What is the greatest common divisor of 7384 and 2131136? 568 What is the highest common divisor of 746924 and 1019524? 5452 What is the highest common divisor of 250509 and 3318? 1659 Calculate the greatest common factor of 1152 and 121312764. 36 Calculate the greatest common factor of 212 and 58175927. 53 Calculate the highest common divisor of 225 and 451419030. 45 What is the greatest common divisor of 165801197 and 1087? 1087 What is the greatest common divisor of 30843648 and 4608? 2304 What is the greatest common factor of 863949232 and 7088? 7088 What is the highest common divisor of 5675887 and 269339? 2471 Calculate the highest common divisor of 8167800 and 2400. 600 Calculate the highest common divisor of 65900259 and 9. 9 What is the highest common factor of 9 and 9607239? 9 What is the greatest common factor of 24597442 and 2082? 694 Calculate the greatest common divisor of 296036 and 2808. 52 What is the greatest common factor of 8246740 and 820? 820 What is the greatest common divisor of 18493518 and 816? 102 Calculate the greatest common divisor of 9405201 and 2073. 2073 Calculate the greatest common divisor of 64 and 32880472. 8 Calculate the greatest common divisor of 1541 and 6254316. 67 What is the greatest common factor of 92114 and 24062? 106 What is the highest common factor of 124980080 and 111? 37 What is the greatest common divisor of 42 and 34287771? 21 Calculate the greatest common factor of 7777 and 1632463. 707 What is the highest common factor of 4559 and 308557? 97 What is the greatest common divisor of 3912 and 64111812? 1956 Calculate the greatest common factor of 581647 and 1538240. 4807 What is the highest common factor of 4040 and 11681330? 10 Calculate the highest common factor of 640 and 30038880. 160 What is the highest common divisor of 364 and 1301321? 7 Calculate the highest common divisor of 1873924060 and 20. 20 What is the highest common divisor of 194190589 and 67? 67 Calculate the highest common divisor of 7940 and 5016492. 1588 What is the greatest common factor of 5127 and 324? 3 Calculate the highest common divisor of 4059921 and 198843. 2517 What is the greatest common divisor of 27178 and 144780? 254 What is the highest common factor of 698 and 706440914? 698 Calculate the greatest common divisor of 103653888 and 104. 104 What is the highest common factor of 16836 and 46069? 23 What is the greatest common factor of 151148 and 7124804? 5212 Calculate the highest common divisor of 306955195 and 1877. 1877 Calculate the greatest common factor of 5709723 and 957. 87 What is the greatest common divisor of 37284 and 28011756? 2868 What is the highest common factor of 18430 and 48694? 194 Calculate the greatest common divisor of 92393 and 360707. 197 Calculate the greatest common divisor of 64512 and 12306. 42 What is the highest common divisor of 5109012 and 11484? 36 Calculate the greatest common divisor of 112 and 11215288. 56 Calculate the highest common factor of 125	{ "pile_set_name": "DM Mathematics" }
= 4 for o. 5 Let r(v) = 3v - 38. Let o(d) = d - 13. Let w(h) = 11o(h) - 4r(h). Let f be w(4). Let u be ((-5)/3)/(f/(-15)). Solve 7 = -us - 3 for s. -2 Let u be 12/((-20)/4 - 23/(-5)). Let q be 306/63 + u/35. Solve 0 = qr - 6r + 10 for r. 5 Let n = -19315 - -19338. Solve -48j = -nj + 150 for j. -6 Let f be 1/4-1 + (-966)/(-184). Let c be (f/(75/(-6)))/((-4)/60). Solve -n + c = n for n. 3 Let b = 4364 + -4332. Solve -6s + b = 38 for s. -1 Let y(z) = -z*3 + 22z*2 - 89z + 980. Let s be y(20). Solve -22c + 183 - 227 = s for c. -2 Let m = -3164 + 3204. Solve -17s = -7s + m for s. -4 Let s be (-2 + 14)-3(-42)/56. Let h(x) = -2x + 63. Let q be h(s). Solve 0 = 4r - qr for r. 0 Let z = -4913 + 4981. Solve 35y + z = 18y for y. -4 Let x(c) = 8c - 65. Let j be x(25). Suppose -5w - j = -10w. Solve 35 = -4g + w for g. -2 Let w be (10/25)/((9/(-20))/(-9)). Solve 48a = 392 - w for a. 8 Let c = 287 - 280. Suppose -z - 2x - 8 = -22, -c = -3z + x. Solve v - 9 = zv for v. -3 Let i = 6962 - 6925. Solve p + i = 38p for p. 1 Let s = 11948 + -11934. Suppose -5a + 4c + 11 = 0, 0 = 2c - 2. Suppose -2j + x = -2, 2j - 7 = -3x + a. Solve 4l - j + s = 0 for l. -3 Suppose -489q = -481q - 2680. Let x be -4 + (-300)/(-78) - q/(-65). Solve 0p = xp + 25 for p. -5 Let g(h) = 6h2 + 4h + 49. Let u be g(-5). Solve -173 + u = m for m. 6 Suppose -115 = -13z - 11. Let v be -6(4/z)/(18/(-12)). Solve 4m - 4 = vm for m. 2 Let d be ((-77)/(8316/162))/(2(-6)/368). Solve 40c - dc = 30 for c. -5 Suppose 3n + 365 - 54 = v, n - 291 = -v. Solve v - 316 = 4i for i. -5 Let n(i) be the first derivative of 4i3/3 + i2/2 - 7i + 12. Let l be n(-2). Solve 1 - l = -6c for c. 1 Let n be (-2 - -7) + 3-1 + 18. Let t be (364/112)/((1/n)/1). Let g = t + -63. Solve -g - 6 = 4w for w. -2 Let u be 4 - (-2 + 4/4). Suppose 10r + ur = 3r. Suppose k - 3 = 2. Solve r = d - kd for d. 0 Let o(a) = -a*3 + 8a*2 - 33a + 62. Let n be o(0). Solve -397q + n = -366q for q. 2 Suppose 2m = -u - 6, -4u + 3 - 2 = 3m. Let h be 111/(-74)16/(-6). Suppose 0 = -3a - hb + 10, 3a = 3b + 19 + 5. Solve u - a = -q for q. 2 Let t be (-21)/(-14)(0/(-2) - -34). Let a = -77 + t. Let g = -26 - a. Solve g = -4h + 3 + 9 for h. 3 Let a(w) = -17w2 + 299w - 162. Let x be a(17). Solve 179r - 177r + x = 0 for r. -4 Let h(n) be the second derivative of n*5/20 + 5n*4/6 - 11n*3/6 + 3n*2 + 78n. Let i be h(-11). Solve 2t = it - 4 for t. 1 Let k(g) = g*3 + 10g*2 - 10g + 15. Let l be k(-11). Let a be (0 - 21/(-28))l. Solve s = a - 2 for s. 1 Suppose 3132 = -19j + 73j. Solve -15t - 14t = -j for t. 2 Let l = 165 - 16. Solve 4m + l = 145 for m. -1 Suppose 1075q - 2167q + 1083q = -1404. Solve -34m = 5m - q for m. 4 Let y = 4037 + -4037. Solve y = -5n + 5 + 20 for n. 5 Let s = 6220 - 6188. Solve -35 = sl - 163 for l. 4 Let q(l) be the second derivative of -l3/2 - 3l*2/2 - 17l. Let g be q(-3). Suppose 4r - 9 = -t, 5r - gt - 27 = -2t. Solve rw + w + 4 = 0 for w. -1 Suppose 215 = 2y + 2h + 3h, y = -2h + 106. Let w = y - 82. Solve 0 = 4t - 10t - w for t. -3 Suppose 0 = 5f - 10 - 5. Suppose 2i - 2 = 4i, 13 = k - fi. Solve kp = 5p for p. 0 Suppose -4254g = -4265g. Solve g = 4n + 31n + 35 for n. -1 Suppose -2u - 24 + 14 = 0. Let h be ((-12)/(-32)4)/(u/10). Let l(r) = -2r*2 - 8r - 4. Let c be l(h). Solve -n + 0n = -c for n. 2 Let s(o) = -4o - 32. Let i be s(-9). Suppose 3j + 5y = -5, 0 = 2j + 2y - 6y - i. Solve -g = -jg for g. 0 Let x(r) = 7r + 68. Let u be x(-9). Suppose -3g - 2a = -2, ug - 34a + 38a = 4. Solve -2i - 4 = -g for i. -2 Let t(p) = 3p*2 + 13p - 14. Let a be t(-8). Suppose ar = 65r + 126. Solve -13l = -rl - 3 for l. -3 Suppose -24w - 19 = -43w. Let j(b) = 12b - 138. Let f be j(12). Solve 0 = -t - w + f for t. 5 Let h be 7/13(-3 - -16). Solve -h = -x - 7 for x. 0 Let q(y) = 18y3 - 125y*2 - 3y - 10. Let b be q(7). Solve 0 = bs + 9 + 63 for s. -4 Let n be 28 - 4 - (-2 - -1). Suppose 4v + 3g = -64, g = -2v - n - 7. Let j be (-126)/(-24) - (-4)/v. Solve jk = 1 - 6 for k. -1 Let g be -1 + 1 + (17/((-51)/(-27)) - 8). Suppose 2b + 11 = 3b. Solve -4i + g = -b for i. 3 Let c be 0 - 4 - (5 + 0 + -11). Suppose 3y - 5m = c + 11, 2y - 7 = 5m. Solve 0 = n - yn - 10 for n. -2 Suppose 5d - 4n - 30 = 0, 5d = 6d - 5n - 6. Solve do + 60 = 18o for o. 5 Let k(a) = a*2 - 15a + 64. Let m be 0 + 1 + (48)/4. Let u be k(m). Solve 3b + 2b = u for b. 2 Suppose q + 298 - 175 = 0. Let b be 0 + 124 - (4 + -11 - -4). Let t = q + b. Solve t = -5k + 9 for k. 1 Let n(g) = g*2 - 27g - 936. Let f be n(-20). Suppose -4z + 20 = 0, z - 11 = -4q + 2z. Suppose q = 3t + 1. Solve 3 = fw - t for w. 1 Let m be 1796/(-14) - (-4 - (-182)/49). Let p = m + 128. Suppose -10 = 4k + 5z, 7k - 3k + 4z + 8 = p. Solve kf - 16 = 4f for f. -4 Let r = -1 - -1. Let k = 7061 + -7061. Solve -s - 3 + k = r for s. -3 Let o = -2245 + 2304. Solve -88 = -49x + o for x. 3 Let i be (-25)/(-275) + (-13890)/(-33). Let c = i - 419. Solve -c = -3y + 1 for y. 1 Let g(u) be the first derivative of -1/2u2 - 11 - 1/4u*4 + 0u*3 + 6u. Let w be g(0). Solve o + w = -2o for o. -2 Suppose -45j - 2817 = -55j - 937. Solve -196f = -jf + 40 for f. -5 Let m be (9/5)/(-8 + (-3220)/(-400)). Solve 17o + o = m for o. 2 Let s = 4 - 2. Let a = 813 + -792. Suppose 0 = am - 2m + 4m. Solve -sn + 0n + 10 = m for n. 5 Let i(j) = 14j - 6j - 18 - 3j. Let z be i(4). Suppose 2m = zt + 14, 2t + 8 = -2t. Solve 0 = -2d + m + 3 for d. 4 Suppose 40862 = 32l + 2014. Solve lg = 1207g + 35 for g. 5 Let r = 7907 + -7905. Let z be 24/(-8)(-4)/3. Suppose 2c + zq - 38 = 8q, 5c + 4q = 53. Solve cy + r = 14y for y. 2 Suppose 5a = 3y - 2, -4y - 9 = -a + 6a. Let m be (-1 - (-6 - -5))/(y + 2). Suppose -9q + 2 = -8q. Solve mh = qh + 8 for h. -4 Let n = -10871 - -10913. Solve n = -182v + 189v for v. 6 Let t = -50 - -49. Let w(q) = -32q3 + 2q + 2. Let g be w(t). Let a = -29 + g. Solve u - 2u - a = 0 for u. -3 Suppose 3h = 12h. Let z(i) = i2 - 25i + 49. Let u be z(23). Suppose -7s + 2s + 15 = 0. Solve h = uf - 2f + s for f. -3 Let u = 295 + -285. Suppose -5g + 6g - 1 = 0, -2o = -4g - u. Solve 3x + 5 = -o for x. -4 Let o(l) = -l2 + 228l - 9091. Let x be o(176). Solve 177 - x = -29v for v. -4 Let j(m) = 811m + 1416. Let n be j(5). Solve ns = 5473s - 16 for s. 8 Let r be (-4 - -2)/((6 - 514/85)/2). Solve 3i - r = -73 for i. 4 Let c(v) = -v2 - 2v + 4. Let x be c(-3). Suppose -17p = 23 - 6. Let z be (0 + p/x)-1. Solve l - 6 = -z for l. 5 Suppose 3v - 77 + 65 = -2g, 0 = -5g + 4v + 7. Solve 0 = -5f + 13 - g for f. 2 Suppose -8h + 22 = -202. Suppose -32 = -6z + h. Solve 5x - z + 5 = 0 for x. 1 Let w = -1 + 1. Suppose wl = -4l + 16. Suppose -5t + 2y + 18 = 4y, -2t + ly = 12. Solve -6 = v + tv for v. -2 Let m(p) = -p*3 + 15p*2 + 101p - 8. Let b be m(20). Solve -i + 52 = bi for i. 4 Let o = 6980 - 6744. Solve -228j + oj - 40 = 0 for j. 5 Let p = 5756 + -5719. Solve pr - 183 = 39 for r. 6 Let q(j) = -j*3 - 5j*2 - 3j - 6. Let d be q(-4). Let b = -7 - d. Suppose 122x - 24 = 116x. Solve -b + 7 = xk for k. 1 Suppose -s - 39 = 4z, 5z - s = -6s - 60. Let p(b) = 8b + 22. Let n be p(z). Let j = n + 54. Solve 5 + j = -3t for t. -3 Let x be 7 + 10/(-4)14/(-210)-18. Solve 19 = xd + 3 for d. 4 Suppose -l - 21 = -3b, 0 = -2b - 4l - 0l. Solve 5z - 11 = -b for z. 1 Let b(d) = 3d - 79d*2 - 4d + 1 + 81d2. Let h be b(3). Let z be ((h/(-10))/(-2))/(6/15). Solve -3i - 10 = z for i. -4 Let i(z) = 188z2 - 166z + 671. Let a be i(4). Solve ah - 3012h = -9 for h. -3 Suppose 17 = u - 3j, 8u - 2j - 20 = 3u. Solve 0 = -4w - 6 - u for w. -2 Let c(i) = 3i + 3 + i - 9 - 5i. Let k be c(-10). Let g be (-6)/k(-5 + 4/(-12)). Solve 3s - g = s for s. 4 Suppose -22 - 11 = -2y - 5n, 3n = 2y - 25. Let u(k) = 2k*2 - 26k - 26. Let r be u(y). Solve rz = -z for z. 0 Suppose -a + 125 = 2y, 11y = 6y + 4a + 280. Solve 0 = 5x + 15x - y for x. 3 Let c(f) = -96f + 3193. Let x be c(33). Solve -10 - x = 5o for o. -7 Suppose 162 = 340j - 1086 - 2152. Solve -j	{ "pile_set_name": "DM Mathematics" }
x + 3, -x + 1 = 0. Calculate the remainder when k is divided by t. 8 Let x(q) = -q - 2. What is the remainder when x(-9) is divided by 2? 1 Suppose -5y = -10, -3f + 2y = 4y - 91. What is the remainder when f is divided by 16? 13 Suppose 0 = 2b - 41 + 15. Suppose m + h + b = 0, 0 = 2m - 2h - 3 + 13. Let w = 19 + m. Calculate the remainder when 39 is divided by w. 9 Let h = 29 - -75. Calculate the remainder when h is divided by 21. 20 Suppose 0 = 5l + 3o - 40, 4l + 2o - 3o = 32. Calculate the remainder when 36 is divided by l. 4 Suppose -4 = 3p + 2. Let v(c) = 11c - 4. Calculate the remainder when v(3) is divided by 1/p - (-84)/8. 9 Suppose 0 = -a - 9 - 14. Let p = 56 + a. What is the remainder when p is divided by 9? 6 Suppose -f - 3u + 0u + 22 = 0, 5f - 2u = 25. Calculate the remainder when f is divided by 16/6 + 4/(-6). 1 Let k = -5 - -8. Suppose -4y + 18 = -ky. Calculate the remainder when 34 is divided by y. 16 Suppose 353 = 3q + 77. Let d = -52 + q. What is the remainder when d is divided by 14? 12 Let t be (-1 - -2)0/(-4). Suppose -4r - 4 = -3r, 0 = q + 5r + 4. Calculate the remainder when 54 is divided by (-2 + t)1 + q. 12 Let z = 53 + 22. What is the remainder when z is divided by 26? 23 Let w(m) = 69m + 2. What is the remainder when w(1) is divided by 36? 35 Let v(b) = 3b + 3. Let r = -71 + 122. Calculate the remainder when r is divided by v(5). 15 Let b = 5 + -4. Suppose i - 14 - b = 0. What is the remainder when i is divided by 8? 7 Let m(x) = 2x2 - 7x + 5. Calculate the remainder when 26 is divided by m(4). 8 Let z be (-1)/(-4 + (1 - -2)). Let g(c) = 5c2. Let j be g(z). Suppose j = i + 2. What is the remainder when 5 is divided by i? 2 Let m = 29 - 17. Let l(r) be the second derivative of -11r*3/3 + 3r. What is the remainder when l(-1) is divided by m? 10 Let z(m) = m*3 + 10m*2 - 13m. What is the remainder when z(-11) is divided by 5? 2 Suppose 0 = 2b + h + h - 76, 149 = 4b + h. Suppose 8 = m - 3m, 3z = 3m + 9. Calculate the remainder when b is divided by (z/(-3))/((-1)/(-39)). 11 Suppose 4n + 42 = 2f, -23 = -4f + n + 89. Let j(o) = 2o - 4. What is the remainder when f is divided by j(7)? 9 Let n(v) = 2v*3 - 4v*2 + 5v - 5. What is the remainder when 7 is divided by n(2)? 2 Let o be (-1)/(((-6)/(-5))/(-6)). What is the remainder when (-2)/(o/(610/(-4))) is divided by 21? 19 Let v = 30 - 16. What is the remainder when 53 is divided by v? 11 Let g = -7 - -10. Suppose gi - 5i = -32. What is the remainder when 30 is divided by i? 14 Let g be (-4)/22 + (-92)/(-22). Let y be g(0 + 51/12). Let m = y - 5. Calculate the remainder when 22 is divided by m. 10 Let v(h) = 16h*3. Let u(z) = 3z*2 - z. Let g be u(2). Suppose r = -5s + g, 2r - 9 = -0s + s. What is the remainder when 47 is divided by v(s)? 15 Suppose 0 = -2x + 5z + 52, -7x - 4z - 92 = -10x. What is the remainder when 140 is divided by x? 32 Suppose 3n - 68 = -4f - n, 4n = 3f - 86. Calculate the remainder when 83 is divided by f. 17 Let l(j) = j2 + 9j + 2. Calculate the remainder when 2 is divided by l(-9). 0 Suppose -3a + 23 + 7 = 0. Calculate the remainder when 47 is divided by a. 7 Let m = -14 - -47. Let k = 26 - 14. What is the remainder when m is divided by k? 9 Let s(p) = p3 - 15p*2 - p + 17. Let j = 14 - -1. Calculate the remainder when 9 is divided by s(j). 1 Calculate the remainder when 63 + -4 + 6/3-1 is divided by 15. 12 Let h = -6 + 8. Let k be 221/51 - 2/6. Suppose 4v + 76 = kf, 5v + 38 = hf + 9. What is the remainder when f is divided by 12? 10 Let w = -28 + 59. What is the remainder when 121 is divided by w? 28 Suppose 0 = -5h + 6 + 4. Suppose hy + 2y = 0. Let m(k) = -k2 - k + 26. What is the remainder when m(y) is divided by 14? 12 Suppose 0 = 5d - d - 8. Suppose -dw = w + 4c - 122, 4 = -c. Calculate the remainder when w is divided by 24. 22 Suppose -8l + 4l - 3y = -208, 5y = 5l - 225. Suppose -51 = -0v - 3v. What is the remainder when l is divided by v? 15 Suppose 6 = 3b - 39. What is the remainder when 41 is divided by b? 11 Let d = -66 + 114. Calculate the remainder when d is divided by 17(-1 + 3 + -1). 14 Suppose -1756 + 1666 = -3g. What is the remainder when g is divided by -11(2/(-1) - -1)? 8 Let x(d) = -2d*3 - 4d*2 - d + 2. Let s = -8 + 6. Let m = 32 + -22. Calculate the remainder when m is divided by x(s). 2 Let x(f) = -4f3 + f2 - f - 1. Let a be x(-1). Suppose d + 4d + a = 5y, 0 = -3d - 4y + 11. What is the remainder when d is divided by 1? 0 What is the remainder when 276/20 + (-1)/(-5) is divided by 3? 2 Let f be -4(44/(-16) + 2). Suppose 2w - z - 89 = 0, 0 = fw - 4z - 64 - 82. What is the remainder when w is divided by 11? 9 Let j = -33 - -20. Let z = j - -18. Suppose -9 + 135 = 4x - 5u, 2x - zu - 68 = 0. Calculate the remainder when x is divided by 8. 5 What is the remainder when 62 is divided by 639/72 - (-2)/16? 8 Suppose 0 + 20 = 4n. Suppose 37 = 13c - 93. Let g = n + c. What is the remainder when g is divided by 4? 3 Calculate the remainder when 10/(-2) - 56/(-1) is divided by 14. 9 Let c(h) = 7h + 3. Let y(j) = -3j - 2. Let f(b) = 3c(b) + 5y(b). Calculate the remainder when f(5) is divided by ((-24)/16)/((-1)/10). 14 Let i be 3-16(-3 + 2). What is the remainder when 23 is divided by (i/(-9))/((-2)/3)? 7 Let i(l) = -l*3 + 7l*2 + 9l - 1. What is the remainder when i(8) is divided by 4/2 + -1 + 1? 1 Suppose -2v + 39 = 9. Let y = -61 - -97. Suppose y = u - 8. Calculate the remainder when u is divided by v. 14 Let d(r) = -11r3 - r2. Calculate the remainder when 39 is divided by d(-1). 9 Suppose -6l + 5l = -14. Suppose -g + 30 - 5 = 0. What is the remainder when g is divided by l? 11 Let x = -41 - -53. Let s = 7 + 0. What is the remainder when x is divided by s? 5 Suppose 18 = -2f + 4f. What is the remainder when 24 is divided by f? 6 Suppose -31 - 9 = -8o. What is the remainder when o is divided by 3? 2 Let l = 33 + -9. What is the remainder when l is divided by (-1)/(-3) + 38/3? 11 Suppose c = -3, -2q + 3q - 2c = 137. What is the remainder when q is divided by 11? 10 Suppose 2v + a = 36, -5a = -v + 3v - 44. What is the remainder when 29 is divided by v? 12 Suppose -5i + 45 = 2y - 18, 123 = 3y - 2i. Calculate the remainder when 75 is divided by y. 36 Let o(f) = -2f*2 + 16f + 7. What is the remainder when 12 is divided by o(8)? 5 Let t(q) = 2q - 4. Let c be t(-3). Let b be 32/(-6)(-15)/c. Let l = -5 - b. Calculate the remainder when l is divided by 2. 1 Let h(k) = 2k2 - 5k - 3. Let o be h(5). What is the remainder when ((-10)/(-4))/(2/24) is divided by o/(-4 - -61)? 8 Let a(u) = -u2 - 25u - 12. Calculate the remainder when a(-13) is divided by 37. 33 What is the remainder when (-29)/(-9 + 7) is divided by 3? 0 Let c(g) = 7g. Let h = 31 + -7. Let l = -19 + h. Calculate the remainder when c(2) is divided by l. 4 Calculate the remainder when 4 is divided by (0 + (-3)/(-9))9. 1 Let j(m) = -2m*2 + 41m - 5. Calculate the remainder when 95 is divided by j(20). 5 Let r = 7 + -8. What is the remainder when (-1 - 74)/3r is divided by 14? 11 Calculate the remainder when 44 is divided by 7/(-35) - 152/(-10). 14 Suppose -2u = -y + 10, 0y - 2y = -u - 17. Calculate the remainder when 13 is divided by y. 5 Let f be 31/2 - 1/(-2). Suppose -3h - h = -f. Suppose ho = 11 + 5. Calculate the remainder when 5 is divided by o. 1 Suppose -3g - 24 = -3a - 0g, -2a = -3g - 21. Let b = a - -18. Calculate the remainder when b is divided by 6. 3 Suppose -3k + 48 = -0k. Let g = 8 - 6. Suppose 0 = -go + 63 - 1. What is the remainder when o is divided by k? 15 Let m(g) = g*3 - 3g*2 + 5g - 2. What is the remainder when 25 is divided by m(3)? 12 Suppose 0 = 2m - 5r - 3, 4r + 1 = m + r. What is the remainder when m is divided by 3? 1 Let m(n) = -2n*3 - 3n*2 + 2n - 7. What is the remainder when 124 is divided by m(-3)? 12 Let a = 51 + -50. Let d = -8 - -18. Let l = d - a. What is the remainder when 24 is divided by l? 6 Let t(z) = 3z + 4. What is the remainder when 36 is divided by t(3)? 10 Suppose d + 0d = -5. Suppose -s = -6*s - 120. Let p = d - s. What is the remainder when 37 is di	{ "pile_set_name": "DM Mathematics" }
uppose c + 3x + 1 = 0, -3c - 4x = -14 + 2. Let t(b) = 10b + 9. Let o be t(2). Solve -2p + 2n - 2 = 0, -cn + o = p - 3n for p. 4 Let o(q) = -10q - 60. Let p be o(-6). Solve -y + 4i = -0y + 11, p = -3i + 12 for y. 5 Let u(z) = z*2 + z - 1. Let g be u(1). Suppose -q = g, 5q = 3h - 0q - 11. Solve 4f = -4a + 20, -3a + 8 = hf - 3 for f. 4 Let d = 22 + -19. Solve -3k - k = -12, -dk = -4w - 1 for w. 2 Let p be (-14)/49 + 2/7. Let f = 4 - p. Solve -v - 4i - 6 = 0, -12 = -v - v + fi for v. 2 Let d(y) = -y3 + 4y*2 + 2y - 4. Let a be d(4). Solve 3k + au = 3 - 1, 0 = -3k - 5u + 1 for k. 2 Let d(n) = 2n3 - 4n*2 + 3n - 2. Let u be d(2). Solve -12 = -ul - 4z, 2 = z - 1 for l. 0 Suppose 0 = -7b + 6b + 5. Solve 3s = y - 4y - 6, 0 = bs + 4y + 7 for s. 1 Let a = -105 - -109. Solve -d - 20 = ad - 2i, -4d - 16 = -3i for d. -4 Let w be (3/6 - 3)54/(-15). Solve 4a - m + 3 = 0, m + w + 0 = -2a for a. -2 Let m(c) be the first derivative of -c2 + 2 + 2c + 1/3c3. Let s be m(3). Solve 3h = sh + 3q + 19, 4q + 22 = -2h for h. -5 Let q(z) = 2z + 2z - 5z + 5z*2 + 1 - z. Let b be q(1). Suppose 3j - b = 2. Solve 2a - 4 = -jv, 6 = -v + 5a - 10 for v. -1 Let o(y) = -10y. Let l be o(-2). Solve j = -4v - l, 8v = 3v - 20 for j. -4 Let u be (5 + 1)/(3/(-2)). Let w be u/525/(-10). Solve 2a = 3a - 2c - 12, 0 = 5a + wc - 12 for a. 4 Let v be 2 + (-22)/88 + 2/8. Solve vf = -5z - 0f + 5, -2f + 12 = -2z for z. -1 Let q(l) = l*2 + l + 3. Suppose 2v + 2v = 0. Let b be q(v). Suppose i = -3m, 0 = -0i + 2i + 2m - 4. Solve 4p + 27 = 4g + i, 12 = -bp + g for p. -3 Let q be (-3 - -2)/3-9. Let x be 2 - q/(12/(-8)). Solve 0 = xh + 3n + 23, 2n - 9 = -3h + 5n for h. -2 Let u(m) = -m*3 + 6m*2 + m - 2. Let y be u(6). Suppose yd = -d. Let j be d + -410/(-4). Solve -5s - k + j = -0s, -10 = 2k for s. 3 Suppose 6 = -3s + 3l, 4l = 3s + 4 + 6. Solve -4b = p + 11, sb - 6p + p = 11 for b. -2 Let f = -29 + 11. Let s = -13 - f. Solve 3k = -a + s, k - 5 = -a - a for a. 2 Let c = -16 + 16. Suppose -j + c + 5 = 0. Solve 5n = -2k + 14, -n + jk + 3 = 11 for n. 2 Let r be -18(5 - 2)/(-3). Suppose 4q + 2 = r. Solve 3b = qu + 5, 3u + 6b - 2b = -35 for u. -5 Let i(z) = -z*2 + 4z + 1. Let r = -2 - -5. Let p be i(r). Solve -17 = -a - 0a + pq, a + 18 = -3q for a. -3 Let z(p) = -p3 + 3p*2 - 2p + 3. Let x be z(2). Suppose -2 = -xf + 10. Solve -3n + 2g - 4 = 0, n + 20 = fg + 2 for n. 2 Suppose 3 + 15 = 6s. Suppose -2b + 5b - 9 = -sz, 0 = -2b + 5z + 20. Solve -bh = -6h - 4l - 13, 4h - 5 = 3l for h. -1 Suppose 0 = 5c - c + 16. Let a = 12 + c. Solve 3v + a = -r, -2r - v - 9 = -2v for r. -5 Let d = 0 + 4. Suppose -j = 5t - 2j - 19, 0 = 2t - 4j - d. Solve 4h + 4 = tp, -4h = -8 - 0 for p. 3 Suppose -3q = -10 - 2. Suppose -4n + 0g = -5g - 7, -3n + qg + 5 = 0. Suppose -1 = 4t - 17. Solve 4x = -4, x = -nu + tu - 3 for u. 2 Suppose 3 = -b - 2g, -3g + g = 5b - 1. Let n be (b - 0)21. Solve -4m + 2h + n = -0, -4h + 4 = 0 for m. 1 Let x be (-26)/65 - 17/(-5). Solve 3k + 6 = d, 0 = -5k - xd + d + 1 for k. -1 Suppose -13g = -12g - 7. Let o = -1 - -3. Let y be ((-20)/15)/(o/(-15)). Solve -5r - x - y = 0, gr + 2x = 3r - 14 for r. -1 Let y be 18/(-3)(-6)/4. Let r be -4(y/6 + -2). Solve -2x - 13 - 7 = -rs, -s = x for x. -5 Suppose -3l = l - 112. Suppose -4q + l = 8. Solve 0 = -4u + 5x + 31, 0x - 23 = -qu + x for u. 4 Let d(k) = k3 - k2 - k - 2. Let w be d(2). Suppose 2b + 5g - 49 = w, 3g - g - 70 = -5b. Solve -16 = 3z - 4j, 2z + 0j = -3j + b for z. 0 Suppose 4a - 3s = 64, 0 = -2a - a - 4s + 48. Let p = a - 11. Suppose 2u - 5f = 71, f - 59 = -3u + 22. Solve 0 = j - i, 0 = pj + i + u - 4 for j. -4 Let c be (2/3)/(1/6). Let z = -18 + 12. Let o be 72/4 - z/(-2). Solve ct + o = 5k, -2k - 3t = -3 + 20 for k. -1 Let y be (2 - 3) + 70 - 2. Let o = y + -46. Solve 1 + 2 = 4c + 5g, -3c + 4g - o = 0 for c. -3 Suppose -50 = -0w - 5w. Let b = 9 - 9. Suppose 0u - 2u = b. Solve -3g + 2g = -4v - 15, u = -v - g - w for v. -5 Suppose 4 = 3p - 2p. Suppose -y = py. Solve 3w + 3g - 21 = 6, 5w - 4g = y for w. 4 Let s = -66 - -85. Suppose 8 = 2a + 8g - 4g, 0 = -3a + 4g + 2. Solve au - s = -3z, -2u - u = -5z for z. 3 Let c be (-5)/3(19 + -1)/(-6). Solve -2v + 18 = -2h, 2h - cv + 48 = 18 for h. -5 Suppose 4b - 3b = -5w - 2, -4w + 2 = -b. Solve 5x + l = -10, w = -3l + 5 - 20 for x. -1 Suppose 4c + 6 = 26. Solve -3 = 4y + 1, ck + 20 = -5y for k. -3 Let y = -2 - 1. Let m = y - -7. Suppose -k = -mk + 6. Solve 2 = -4t + kd + 12, -3t + 5d + 4 = 0 for t. 3 Suppose 0g = -g - 2, -w + 3 = g. Solve -3p - w = 2n, -5 = 5n - 6n for p. -5 Let h = -6 + 4. Let a be 5/(-3)6/h. Solve 4x = k - 2k + 12, -2k + 18 = ax for k. 4 Suppose 0 = 5l - 2l + 6. Let d = 5 + l. Solve 3z - 15 = -dm, 3m + z + 1 - 10 = 0 for m. 2 Suppose 0 = -24n + 18n + 12. Solve -22 = -5y + 3f, -nf - 8 = -y - y for y. 5 Let x be (-1 + 3)/((-2)/(-4)). Let t be 3/1x/3. Let l = 27 - 22. Solve -3z - z = li - 17, 2i = -tz + 14 for z. 3 Suppose -4n - o + 4 = 3o, 0 = o + 3. Let b(d) = 3d2 + 1. Let w be b(1). Solve 0 = -5h + 3p - 24 + 5, -wh = -np + 20 for h. -2 Let b = -5 + 9. Let p = 4 - 2. Suppose -4a + 6a = -3z + 10, -pz + 4a + 12 = 0. Solve 0 = -q - 0q - 2f - 7, 24 = -bq - zf for q. -5 Let r(i) = i*2 - 5i - 9. Let v = -2 - -1. Let j be (v1)/((-4)/28). Let f be r(j). Solve f = -5c + k, -c = 4k + k + 1 for c. -1 Let r = 6 - 4. Suppose 0 = 3c + 5g + 4, -4c - 3g = 2g + r. Solve -4o + 20 = -cd, 0 = -3d + o - 5o + 10 for d. -2 Let x be 4 - (1 - -63/6). Solve x = -4m - 4r + 8, -3m - 3r - 2r = -16 for m. -3 Let w = -6 + -12. Let l = w + 23. Solve -v + 25 = -lb, 3v = -4b - 14 - 6 for v. 0 Suppose 3v + 1 + 5 = 3h, -3h + 2v = -7. Solve -3p = -7p - ht + 14, p = -5t - 5 for p. 5 Suppose -2 = 2i - i. Let k be 21/(-6)(i + 0). Let h(y) = -y3 + 7y*2 - y + 7. Let g be h(k). Solve -z - 2 - 3 = 4b, g = 2z + 2 for b. -1 Suppose -4y = -6 + 2. Suppose g + y = 6. Solve v - 19 = gt - 0, -2v + 3t + 10 = 0 for v. -1 Let h(b) = -b3 + 6b*2 + 2. Let i(z) = -7z - 1. Let s be i(-1). Let j be h(s). Solve 4q - 2q + 2n = 0, 2q - jn = 0 for q. 0 Let v(w) = 5w*2 - w - 4. Let r be v(2). Solve 5f - r = -a + 13, 4a - 4f = -12 for a. 2 Suppose 3 = v, 21 = -0k + 4k + 3v. Solve -3n + 8 = -kc - 10, -12 = c - 3n for c. -3 Let h(d) = -d*3 - 5d*2 + 4d - 7. Let u be h(-6). Let o = -1 + u. Solve 12 = 4a, c + 5a - 3 = oc for c. 4 Suppose -13f = -16f. Solve f = 3q + 5h + 23, h + 3 = 4q - 3q for q. -1 Let k = -23 + 3. Let g be ((-35)/k)/(2/40). Solve -3q - 3m - 32 = q, 3q + g = -5m for q. -5 Let k = 6 + -8. Let j be -1 + (-1 - k - -3). Solve -2t = -6t, j = 3c - 4t for c. 1 Let s(w) = -w2 + 28w - 37. Let q be s(26). Solve -3d - 17 = -6n + n, q = 3n + 3d for n. 4 Suppose -5q + 30 = 4m, 0q + q + 3m - 17 = 0. Solve -2u + 7u = -5, 4k - qu + 2 = 0 for k. -1 Let n = 4 - -1. Let r be 1 - n/((-10)/68). Let w(i) = -i - 3. Let j be w(-7). Solve -jp + 5b = 0, -3p + 0b - r = 5b for p. -5 Let o(m) = m3 + 3m*2 + m + 5. Let s be o(0). Solve 2p - 10 - 7 = 5f, p + sf = -14 for p. 1 Suppose 3m - 12 = -0m. Suppose 14 = -2g + mg. Solve 3r - 2w - 19 = -gw, 5r = w - 15 for r. -2 Suppose -5h + 4 + 11 = 0. Suppose w + h - 24 = 0. Solve 0y - 18 = -3a - 3y, 2a + 5y - w = 0 for a. 3 Let w(l) = l*2 + 8l + 7. Let d be w(-7). Solve -b - 4x + 15 = d, 0b - 2b + 10 = 4x for b. -5 Suppose -4u = -5u + 6. Solve -3p + 3h = 7h + 15, -3h = -3p + u for p. -1 Suppose 12 = z + 5z. Solve o + z = x, -2o - 2 = 2x + 14 for x. -3 Let h(q) = -3q3 + 2q*3 - 2q + 3q - q2. Let p be h(0). Suppose -5u = -2x + 30, p = -5u + 4 - 24. Solve xg - 3g = 4a - 2, 0 = 4g + 2a + 24 for g. -5 Let r be 10/(-3) + (-1)/(-3). Let p be (3/(-1))/(r - -2). Let k be 3 - p(-1)/(-3). Solve 3l - l = 6, -2t - 12 = -kl for t. -3 Suppose -5u = 5l - l - 21, 11 = 4l - 5u. Let m be (10/l)/(1/2). Solve 0 = 3r + 2o + 3, -2r = 2o - mo - 11 for r. 1 Suppose 0 = g - 2 - 1. Solv	{ "pile_set_name": "DM Mathematics" }
36445, -109295562? -21859117y + 23 What is the r'th term of -87969, -89904, -91839, -93774, -95709? -1935r - 86034 What is the c'th term of -924292, -924327, -924362, -924397, -924432, -924467? -35c - 924257 What is the x'th term of -6597, -14661, -22725, -30789? -8064x + 1467 What is the v'th term of -7267, -7260, -7251, -7240? v*2 + 4v - 7272 What is the m'th term of 895, 3751, 8587, 15403, 24199? 990m2 - 114m + 19 What is the y'th term of -1919, -7521, -16851, -29915, -46719, -67269? -y*3 - 1858y*2 - 21y - 39 What is the q'th term of -16240713, -16240746, -16240801, -16240878? -11q2 - 16240702 What is the s'th term of 316, 620, 1448, 3064, 5732, 9716, 15280? 44s*3 - 2s*2 + 2s + 272 What is the p'th term of 181240, 181151, 181062, 180973, 180884? -89p + 181329 What is the v'th term of -254803, -259115, -263427, -267739, -272051, -276363? -4312v - 250491 What is the i'th term of -58026, -57552, -56754, -55626, -54162, -52356? i*3 + 156i2 - i - 58182 What is the t'th term of -43237, -86706, -130185, -173680, -217197, -260742, -304321, -347940? -t3 + t*2 - 43465t + 228 What is the q'th term of 839, 6686, 22525, 53354, 104171, 179974, 285761, 426530? 833q3 - 2q*2 + 22q - 14 What is the k'th term of 1399223, 1399186, 1399125, 1399040, 1398931, 1398798? -12k2 - k + 1399236 What is the h'th term of 38984, 36657, 34326, 31991, 29652, 27309? -2h*2 - 2321h + 41307 What is the y'th term of 472577, 945149, 1417727, 1890317, 2362925, 2835557? y*3 - 3y*2 + 472574y + 5 What is the o'th term of 8246, 32940, 74078, 131666, 205710? o*3 + 8216o*2 + 39o - 10 What is the t'th term of -827593, -1655140, -2482679, -3310204, -4137709? t*3 - 2t*2 - 827548t - 44 What is the h'th term of -59078108, -59078100, -59078092, -59078084? 8h - 59078116 What is the c'th term of 54452790, 54452787, 54452784, 54452781, 54452778, 54452775? -3c + 54452793 What is the q'th term of -234, 2, 530, 1446, 2846, 4826? 16q3 + 50q*2 - 26q - 274 What is the x'th term of 155281065, 155281064, 155281063, 155281062? -x + 155281066 What is the o'th term of 3157649, 3157653, 3157657, 3157661, 3157665, 3157669? 4o + 3157645 What is the c'th term of -5729042, -5729029, -5729016, -5729003, -5728990? 13c - 5729055 What is the d'th term of 16556, 16571, 16616, 16691, 16796, 16931, 17096? 15d2 - 30d + 16571 What is the w'th term of -23488954, -23488954, -23488952, -23488948, -23488942? w*2 - 3w - 23488952 What is the y'th term of 117054855, 117054851, 117054847? -4y + 117054859 What is the x'th term of 517, 3133, 9855, 22699, 43681? 336x*3 + 37x*2 + 153x - 9 What is the b'th term of 447650, 1791324, 4031020, 7166744, 11198502? b*3 + 448005b*2 - 348b - 8 What is the g'th term of -6226917, -6226930, -6226943, -6226956? -13g - 6226904 What is the k'th term of 92, 204, 358, 578, 888, 1312? 4k*3 - 3k*2 + 93k - 2 What is the h'th term of -809, -1582, -2255, -2828, -3301, -3674, -3947? 50h2 - 923h + 64 What is the b'th term of 926, 805, 610, 341? -37b2 - 10b + 973 What is the s'th term of 37303, 38208, 39113? 905s + 36398 What is the c'th term of -1685, -3878, -6047, -8186, -10289, -12350, -14363, -16322? c3 + 6c*2 - 2218c + 526 What is the v'th term of -190863, -191338, -191811, -192282, -192751, -193218, -193683? v*2 - 478v - 190386 What is the y'th term of -1528, -3459, -5794, -8533, -11676, -15223? -202y2 - 1325y - 1 What is the q'th term of 408375, 819652, 1230917, 1642164, 2053387, 2464580, 2875737, 3286852? -q*3 + 411284q - 2908 What is the j'th term of -80206469, -80206471, -80206471, -80206469, -80206465, -80206459? j*2 - 5j - 80206465 What is the o'th term of 5760, 22495, 50196, 88857, 138472, 199035, 270540? -o*3 + 5489o*2 + 275o - 3 What is the b'th term of 12802106, 25604218, 38406330? 12802112b - 6 What is the m'th term of 301380238, 602760483, 904140730, 1205520979, 1506901230, 1808281483, 2109661738? m2 + 301380242m - 5 What is the y'th term of 150106725, 150106727, 150106729, 150106731? 2y + 150106723 What is the c'th term of -27277, -54952, -82627, -110302? -27675c + 398 What is the l'th term of -481, -4054, -13801, -32824, -64225, -111106, -176569? -517l3 + 15l*2 + l + 20 What is the c'th term of -3626679, -3626680, -3626681, -3626682, -3626683, -3626684? -c - 3626678 What is the a'th term of 132798, 133372, 134332, 135678, 137410, 139528? 193a*2 - 5a + 132610 What is the v'th term of -156, -225, -112, 279, 1044? 16v3 - 5v*2 - 166v - 1 What is the v'th term of 5834847, 5834840, 5834833? -7v + 5834854 What is the k'th term of 6358, 10157, 13956, 17755? 3799k + 2559 What is the s'th term of -55247, -441878, -1491269, -3534800, -6903851, -11929802? -55230s3 - 21s + 4 What is the b'th term of 47774, 47977, 48180, 48383, 48586? 203b + 47571 What is the i'th term of 7586, 29386, 65718, 116582, 181978, 261906? 7266i*2 + 2i + 318 What is the n'th term of -54002, -54017, -54042, -54077? -5n2 - 53997 What is the n'th term of -10157274, -20314544, -30471814, -40629084, -50786354? -10157270n - 4 What is the v'th term of -402317, -804577, -1206837, -1609097? -402260v - 57 What is the m'th term of -1942, -6430, -13450, -22996, -35062, -49642? m3 - 1272m*2 - 679m + 8 What is the c'th term of -13193568, -13193569, -13193570, -13193571, -13193572, -13193573? -c - 13193567 What is the t'th term of -68318311, -68318307, -68318301, -68318293, -68318283, -68318271, -68318257? t2 + t - 68318313 What is the b'th term of -5560820, -22243307, -50047448, -88973237, -139020668, -200189735, -272480432, -355892753? b3 - 5560833b2 + 5b + 7 What is the p'th term of -424445, -1697745, -3819895, -6790883, -10610697, -15279325, -20796755? 2p3 - 424437p*2 - 3p - 7 What is the p'th term of 453079131, 453079128, 453079123, 453079116, 453079107? -p*2 + 453079132 What is the r'th term of 26820, 50905, 74990? 24085r + 2735 What is the n'th term of 12680, 11626, 10572, 9518? -1054n + 13734 What is the x'th term of 564, 334, 108, -114, -332, -546? 2x*2 - 236x + 798 What is the v'th term of 64726006, 64726004, 64726002? -2v + 64726008 What is the d'th term of -936, -13209, -25482, -37755? -12273d + 11337 What is the k'th term of -3011492, -3011614, -3011736, -3011858, -3011980, -3012102? -122k - 3011370 What is the g'th term of 19269, 38456, 57643, 76830, 96017? 19187g + 82 What is the s'th term of -860150, -860679, -861564, -862805? -178s2 + 5s - 859977 What is the t'th term of -164448393, -328896784, -493345175, -657793566, -822241957? -164448391t - 2 What is the i'th term of 1479, 2892, 4333, 5796, 7275, 8764, 10257? -i3 + 20i*2 + 1360i + 100 What is the z'th term of -45605, -91292, -136973, -182648, -228317, -273980? 3z2 - 45696z + 88 What is the l'th term of -194841, -193264, -190637, -186960? 525l2 + 2l - 195368 What is the l'th term of 203780, 203764, 203738, 203702, 203656? -5l2 - l + 203786 What is the s'th term of 169039, 338312, 507585, 676858, 846131, 1015404? 169273s - 234 What is the b'th term of 3300, 3057, 2652, 2085, 1356, 465? -81b2 + 3381 What is the j'th term of -8528435, -8528434, -8528433, -8528432? j - 8528436 What is the k'th term of 1923, 7795, 17629, 31425, 49183, 70903? 1981k*2 - 71k + 13 What is the g'th term of -126008, -251952, -377912, -503894, -629904, -755948, -882032? -g*3 - 2g*2 - 125931g - 74 What is the s'th term of -22, -467, -1790, -4447, -8894, -15587? -76s3 + 17s*2 + 36s + 1 What is the i'th term of 30173, 121104, 272651, 484814, 757593, 1090988? 30308i2 + 7i - 142 What is the x'th term of -9984755, -9984741, -9984727, -9984713? 14x - 9984769 What is the g'th term of -1805, -7022, -15655, -27704, -43169, -62050? -1708g*2 - 93g - 4 What is the w'th term of 9344, 22631, 44770, 75755, 115580? -w*3 + 4432w*2 - 2w + 4915 What is the t'th term of 8444, 22791, 37138, 51485, 65832, 80179? 14347t - 5903 What is the u'th term of 1487200, 2974382, 4461564, 5948746, 7435928? 1487182u + 18 What is the m'th term of 326988, 326978, 326968? -10m + 326998 What is the b'th term of -36263118, -36263109, -36263100, -36263091, -36263082? 9b - 36263127 What is the g'th term of 5	{ "pile_set_name": "DM Mathematics" }
picked without replacement from {b: 1, y: 1, h: 2, s: 1}. 1/10 What is prob of sequence dd when two letters picked without replacement from {j: 2, i: 3, w: 1, p: 5, d: 2, x: 6}? 1/171 Calculate prob of sequence ogoo when four letters picked without replacement from ggoooo. 2/15 Calculate prob of sequence ourg when four letters picked without replacement from {r: 5, g: 1, b: 6, o: 1, u: 1, s: 3}. 1/11424 Three letters picked without replacement from zzyzqzzgbq. Give prob of sequence qbg. 1/360 Three letters picked without replacement from {a: 2, z: 10, t: 4, l: 1}. What is prob of sequence aza? 1/204 What is prob of sequence ng when two letters picked without replacement from angnzagnnnznngna? 1/10 What is prob of sequence mmmk when four letters picked without replacement from {w: 7, m: 5, p: 2, k: 4}? 1/306 Calculate prob of sequence ui when two letters picked without replacement from {m: 3, i: 4, a: 4, u: 3}. 6/91 What is prob of sequence ae when two letters picked without replacement from {w: 7, a: 7, e: 2}? 7/120 Three letters picked without replacement from wwwwwwwiwwwiiww. What is prob of sequence wii? 12/455 Two letters picked without replacement from {f: 3, d: 1, p: 3, t: 8, v: 1, n: 2}. Give prob of sequence fn. 1/51 Two letters picked without replacement from {y: 3, a: 1, e: 1, c: 8, h: 4}. What is prob of sequence ah? 1/68 Calculate prob of sequence xcc when three letters picked without replacement from {c: 11, x: 9}. 11/76 Three letters picked without replacement from {j: 1, h: 2, d: 1, o: 3, l: 4, w: 4}. What is prob of sequence lwh? 16/1365 Four letters picked without replacement from asssssassss. What is prob of sequence aass? 1/55 Two letters picked without replacement from cmqoawqacoomoc. What is prob of sequence qm? 2/91 Four letters picked without replacement from biogobxxxioxgxee. Give prob of sequence gixg. 1/2184 Calculate prob of sequence ymio when four letters picked without replacement from yffitmfmmito. 1/1980 What is prob of sequence gk when two letters picked without replacement from gkk? 1/3 Three letters picked without replacement from {g: 1, m: 1, u: 1, h: 2, x: 2}. What is prob of sequence mmg? 0 Four letters picked without replacement from {y: 2, p: 2, c: 1, j: 1}. Give prob of sequence yjyj. 0 Calculate prob of sequence dege when four letters picked without replacement from eoorceecgeceedcdc. 1/952 What is prob of sequence hz when two letters picked without replacement from hhzzzzhzzhzh? 35/132 What is prob of sequence us when two letters picked without replacement from jjsspsdpduas? 1/33 What is prob of sequence pff when three letters picked without replacement from fffppppfpf? 5/36 Four letters picked without replacement from {a: 8, j: 3, d: 5}. What is prob of sequence jdjj? 1/1456 Two letters picked without replacement from {r: 6}. What is prob of sequence rr? 1 What is prob of sequence ss when two letters picked without replacement from {s: 7, b: 7}? 3/13 Calculate prob of sequence rut when three letters picked without replacement from uuuuutruuttttrtudc. 1/51 Calculate prob of sequence shjs when four letters picked without replacement from {s: 4, m: 2, j: 2, h: 6, q: 2, w: 1}. 3/1190 Four letters picked without replacement from {y: 3, w: 7, t: 2, k: 3, g: 5}. What is prob of sequence gttk? 1/3876 Three letters picked without replacement from uaffuuf. Give prob of sequence fuu. 3/35 What is prob of sequence tk when two letters picked without replacement from {v: 7, t: 3, k: 3}? 3/52 Calculate prob of sequence om when two letters picked without replacement from {l: 4, m: 5, o: 4, h: 2}. 2/21 What is prob of sequence ju when two letters picked without replacement from {x: 5, k: 3, u: 7, j: 3, t: 2}? 21/380 What is prob of sequence oaao when four letters picked without replacement from aaooaaaaaaoa? 2/55 Two letters picked without replacement from ppoopppp. Give prob of sequence po. 3/14 What is prob of sequence gsss when four letters picked without replacement from sssgsssssssggggssss? 455/3876 Four letters picked without replacement from {a: 5, v: 2, z: 4, n: 2}. Give prob of sequence vvnn. 1/4290 Four letters picked without replacement from ppfinninipnn. Give prob of sequence nppf. 1/396 Three letters picked without replacement from {y: 7, s: 9}. Give prob of sequence sss. 3/20 What is prob of sequence ctxv when four letters picked without replacement from {x: 1, p: 1, c: 2, t: 1, f: 1, v: 2}? 1/420 Two letters picked without replacement from pvtptuqttvvvqq. Give prob of sequence qt. 6/91 Calculate prob of sequence wwww when four letters picked without replacement from wwwwwww. 1 Calculate prob of sequence st when two letters picked without replacement from {m: 2, t: 1, b: 1, u: 10, s: 2}. 1/120 What is prob of sequence ww when two letters picked without replacement from awvavvwaaa? 1/45 What is prob of sequence rn when two letters picked without replacement from oarmnfn? 1/21 Calculate prob of sequence yy when two letters picked without replacement from {h: 9, y: 9}. 4/17 Two letters picked without replacement from dddddjdddjdjdddddjdd. Give prob of sequence jj. 3/95 What is prob of sequence zee when three letters picked without replacement from ezezzezzez? 1/10 What is prob of sequence qcg when three letters picked without replacement from {q: 12, g: 4, e: 3, c: 1}? 2/285 Three letters picked without replacement from {i: 2, f: 1, l: 2, p: 1, r: 2, d: 1}. What is prob of sequence rdl? 1/126 Two letters picked without replacement from {u: 2, n: 5, e: 1, f: 3, r: 1}. Give prob of sequence ef. 1/44 Three letters picked without replacement from {l: 2, v: 2, h: 1, b: 2, d: 1}. What is prob of sequence hbv? 1/84 What is prob of sequence cce when three letters picked without replacement from exmmememmmccmxxm? 1/560 Two letters picked without replacement from pprrprdrdrkkrpdriudi. Give prob of sequence ri. 7/190 Three letters picked without replacement from wfafawfafwaaaaaawaa. What is prob of sequence wwf? 8/969 Two letters picked without replacement from {d: 1, a: 1, o: 4, q: 5, j: 9}. What is prob of sequence jj? 18/95 What is prob of sequence zj when two letters picked without replacement from {j: 12, z: 1, m: 1}? 6/91 Four letters picked without replacement from {j: 5, p: 9}. Give prob of sequence jjjj. 5/1001 What is prob of sequence syy when three letters picked without replacement from yssssyssyys? 14/165 Calculate prob of sequence vsv when three letters picked without replacement from sgv. 0 Calculate prob of sequence xss when three letters picked without replacement from {w: 1, n: 1, s: 2, x: 3}. 1/35 Four letters picked without replacement from ccvvvcvvcvvvvvvc. Give prob of sequence cvvc. 55/1092 Four letters picked without replacement from {l: 2, y: 1, q: 4, i: 3, k: 1}. What is prob of sequence llki? 1/1320 Two letters picked without replacement from {e: 3, r: 5}. Give prob of sequence er. 15/56 What is prob of sequence kkwb when four letters picked without replacement from {g: 2, k: 4, b: 2, w: 1}? 1/126 What is prob of sequence kggk when four letters picked without replacement from {k: 3, p: 11, g: 4}? 1/1020 Four letters picked without replacement from {v: 8, t: 5, p: 3}. Give prob of sequence pptv. 1/182 Two letters picked without replacement from {e: 4, o: 7}. What is prob of sequence oe? 14/55 Three letters picked without replacement from jjppvepjjeppecf. What is prob of sequence pcp? 2/273 Two letters picked without replacement from {k: 1, s: 1, v: 1, f: 3, h: 1}. What is prob of sequence sk? 1/42 Calculate prob of sequence dnnn when four letters picked without replacement from nddndndnnn. 2/21 What is prob of sequence uu when two letters picked without replacement from xouuaouuuouodoouoaa? 7/57 Three letters picked without replacement from {z: 3, j: 1, k: 5}. Give prob of sequence kkk. 5/42 What is prob of sequence mo when two letters picked without replacement from omotootmooooomooo? 9/68 Two letters picked without replacement from vzzvvvvvxzvzazzzzzaz. Give prob of sequence xa. 1/190 Calculate prob of sequence nhhh when four letters picked without replacement from {h: 10, n: 4}. 120/1001 What is prob of sequence fbk when three letters picked without replacement from zkzyzkzkbzzkkzzkf	{ "pile_set_name": "DM Mathematics" }
0001 What is -20479400 rounded to the nearest one hundred thousand? -20500000 What is -112235 rounded to the nearest 1000? -112000 Round 0.006823066 to six decimal places. 0.006823 Round -27020.985 to the nearest 1000. -27000 What is -21602.49 rounded to the nearest one hundred? -21600 Round 0.11100938 to 4 decimal places. 0.111 Round -0.1941882 to three decimal places. -0.194 Round 7300300 to the nearest 10000. 7300000 Round -4191200 to the nearest ten thousand. -4190000 What is 0.0002335836 rounded to 7 decimal places? 0.0002336 What is -34441.4 rounded to the nearest one hundred? -34400 What is -18758930 rounded to the nearest 100000? -18800000 Round 19783.425 to the nearest ten. 19780 Round 0.06682058 to five decimal places. 0.06682 Round 234.5555 to zero decimal places. 235 Round -0.0803132 to 2 dps. -0.08 Round 0.00007529913 to 6 dps. 0.000075 Round -632.7785 to 1 decimal place. -632.8 Round -267421.2 to the nearest one hundred. -267400 Round 630358 to the nearest 10000. 630000 Round 1544.494 to the nearest one hundred. 1500 Round -21958550 to the nearest ten thousand. -21960000 What is -0.0001934896 rounded to six decimal places? -0.000193 Round -679695.44 to the nearest 100000. -700000 What is 0.0000960756 rounded to 6 decimal places? 0.000096 Round -1232.4144 to the nearest ten. -1230 Round 2258.0982 to the nearest integer. 2258 Round 1333.818 to 0 decimal places. 1334 What is -0.0000011715619 rounded to six decimal places? -0.000001 What is 94692.33 rounded to the nearest 100? 94700 What is 39.410997 rounded to 2 decimal places? 39.41 What is 33152.38 rounded to the nearest 100? 33200 What is -6797439 rounded to the nearest one million? -7000000 Round -0.000014528688 to seven decimal places. -0.0000145 What is -273.462 rounded to zero decimal places? -273 What is -8.55698 rounded to 0 decimal places? -9 What is 0.42744926 rounded to 2 decimal places? 0.43 What is 0.000684581 rounded to six dps? 0.000685 What is 0.007691101 rounded to five dps? 0.00769 Round 0.0000108987 to seven dps. 0.0000109 What is -0.0000181947 rounded to 7 dps? -0.0000182 Round -185653.49 to the nearest 1000. -186000 Round -4615.677 to the nearest 10. -4620 Round -0.0947789 to two dps. -0.09 What is -8747796.4 rounded to the nearest 10000? -8750000 What is 31369190 rounded to the nearest one million? 31000000 What is 2565.3443 rounded to the nearest one thousand? 3000 Round -0.00000048748 to six decimal places. 0 Round -162332.9 to the nearest 1000. -162000 Round -28347600 to the nearest one hundred thousand. -28300000 What is -3402777 rounded to the nearest one thousand? -3403000 What is -0.00231917 rounded to 5 decimal places? -0.00232 Round -6.7939617 to one decimal place. -6.8 What is 6.67771 rounded to two dps? 6.68 What is 0.000000809355 rounded to six dps? 0.000001 What is -503484 rounded to the nearest one hundred thousand? -500000 Round -0.0012836702 to four decimal places. -0.0013 What is 156186.74 rounded to the nearest 10000? 160000 Round 0.8065106 to two dps. 0.81 Round 2360915 to the nearest one thousand. 2361000 What is -0.0233529 rounded to two decimal places? -0.02 What is -0.00953404 rounded to five decimal places? -0.00953 Round 0.0020885 to 3 dps. 0.002 What is 0.022338891 rounded to 5 decimal places? 0.02234 What is -307555 rounded to the nearest 100000? -300000 What is 0.00001690277 rounded to seven decimal places? 0.0000169 Round -0.0184667 to 2 decimal places. -0.02 Round 26514.063 to the nearest ten. 26510 What is 48246840 rounded to the nearest one million? 48000000 What is 3955.87 rounded to the nearest one hundred? 4000 What is 0.000007457329 rounded to 7 decimal places? 0.0000075 Round -2755468.5 to the nearest 1000. -2755000 What is -0.0000011332115 rounded to seven dps? -0.0000011 Round 17.8986 to zero decimal places. 18 Round -0.00000082566875 to 7 decimal places. -0.0000008 Round 0.0000191792 to 6 dps. 0.000019 Round 6.00715 to the nearest integer. 6 What is -4390510 rounded to the nearest one hundred thousand? -4400000 Round 1954.7 to the nearest 10. 1950 What is 0.0018473 rounded to four decimal places? 0.0018 What is 1034187000 rounded to the nearest 1000000? 1034000000 What is 0.37376395 rounded to four dps? 0.3738 Round 0.000308023 to four dps. 0.0003 What is 3146423 rounded to the nearest ten thousand? 3150000 Round 1253.598 to the nearest one hundred. 1300 Round -13618.146 to the nearest one thousand. -14000 Round -1415.017 to the nearest 10. -1420 Round -4.611714 to 2 decimal places. -4.61 What is -14487400 rounded to the nearest one million? -14000000 Round 386.08391 to 1 dp. 386.1 What is 0.000504592 rounded to 6 decimal places? 0.000505 What is -0.0001549134 rounded to four decimal places? -0.0002 What is -0.012568643 rounded to 4 decimal places? -0.0126 Round -0.000262489 to six dps. -0.000262 Round -0.02039506 to 3 dps. -0.02 Round -667.78 to the nearest 100. -700 What is 0.2873886 rounded to 1 dp? 0.3 What is 6935700 rounded to the nearest one hundred thousand? 6900000 Round -0.00038906 to six decimal places. -0.000389 What is 0.01153315 rounded to 5 dps? 0.01153 What is -0.3084367 rounded to two decimal places? -0.31 Round -0.0019726495 to six decimal places. -0.001973 What is -15.03942 rounded to two dps? -15.04 Round -24594.426 to the nearest 1000. -25000 What is 7666.67 rounded to the nearest one thousand? 8000 What is 4.20579 rounded to one decimal place? 4.2 Round 13679.216 to zero dps. 13679 What is -0.816594 rounded to 3 decimal places? -0.817 Round -27.12364 to two dps. -27.12 Round -736014.91 to the nearest one hundred thousand. -700000 Round -0.01079592 to 3 decimal places. -0.011 Round -5246195 to the nearest one thousand. -5246000 Round -3404.9686 to the nearest one hundred. -3400 Round -2033.925 to the nearest ten. -2030 Round 1243287.3 to the nearest 1000. 1243000 Round 4.535824 to one dp. 4.5 What is 3851.55 rounded to the nearest 100? 3900 What is -0.00006896382 rounded to seven decimal places? -0.000069 Round -0.03184288 to 4 dps. -0.0318 What is -0.00000124978 rounded to 6 decimal places? -0.000001 Round -907079.2 to the nearest 100000. -900000 What is 0.0001067407 rounded to six dps? 0.000107 Round -66898.8 to the nearest one hundred. -66900 What is 3971.75 rounded to the nearest 1000? 4000 What is -0.00006680508 rounded to five dps? -0.00007 Round -31493660 to the nearest one hundred thousand. -31500000 What is 48.4619 rounded to the nearest ten? 50 What is 0.0005892124 rounded to four dps? 0.0006 What is -4583.781 rounded to the nearest one thousand? -5000 What is 0.0032559893 rounded to six dps? 0.003256 What is 68833000 rounded to the nearest 100000? 68800000 Round 2.245907 to one decimal place. 2.2 What is -3080180 rounded to the nearest one million? -3000000 What is 0.0000092245 rounded to 6 dps? 0.000009 Round -77787350 to the nearest 10000. -77790000 What is 0.00009972344 rounded to six dps? 0.0001 Round 275163300 to the nearest one million. 275000000 What is 0.0000011726247 rounded to seven decimal places? 0.0000012 What is 0.1691921 rounded to 2 dps? 0.17 What is 843.778 rounded to the nearest one hundred? 800 What is -8719074800 rounded to the nearest one million? -8719000000 Round -0.00247199 to 3 decimal places. -0.002 What is -174.136 rounded to the nearest integer? -174 Round -2.480471 to 2 dps. -2.48 Round -9762.24 to the nearest 1000. -10000 Round -10.5088 to the nearest 10. -10 What is -0.0000172536 rounded to seven decimal places? -0.0000173 Round -0.003718543 to 6 dps. -0.003719 Round -4530.259 to the nearest 10. -4530 Round 11323580 to the nearest 100000. 11300000 What is -1.6547782 rounded to one dp? -1.7 Round -0.91439 to 1 decimal place. -0.9 What is 1126.924 rounded to the nearest integer? 1127 What is 3111965.6 rounded to the nearest 1000? 3112000 What is -18.121643 rounded to one dp? -18.1 What is -559466.5 rounded to the nearest 100000? -600000 What is -0.0000013788212 rounded to 7 dps? -0.0000014 Round -22705870 to the nearest one hundred thousand. -22700000 Round 46121390 to the nearest one hundred thousand. 46100000 Round -4.14797 to one decimal place. -4.1 What is -0.00005302758 rounded to 6 dps? -0.000053 What is 0.0292891 rounded to three dps? 0.029 Round -7	{ "pile_set_name": "DM Mathematics" }
v. -v3 Collect the terms in 10z*2 + 19z*2 - 26z*2. 3z*2 Collect the terms in 46187h*3 - 46186h3 - 2 + 2. h3 Collect the terms in 691y2 + 34y*2 + 105y*2. 830y*2 Collect the terms in -130 - 4i + 130. -4i Collect the terms in 2 + 1 - 3 + 125c*2. 125c*2 Collect the terms in -3g - 269 + 574 - 305. -3g Collect the terms in 381p*3 - 92p*3 - 97p*3 - 93p*3 - 97p*3. 2p*3 Collect the terms in 573m*3 + 574m*3 - 1150m*3. -3m*3 Collect the terms in 8k - 4k + 2k + 6k. 12k Collect the terms in 1368 - 1368 - 54c2. -54c*2 Collect the terms in 377 - 377 - 4o. -4o Collect the terms in 213s*3 + 379s*3 + 397s*3. 989s*3 Collect the terms in -13o*2 - 13o*2 - 2o*2. -28o*2 Collect the terms in -7 + 1 + 6 - 9z. -9z Collect the terms in 139o + 141o - 407o + 142o. 15o Collect the terms in 1 - 4g2 + 6g*2 - 1 + 603g. 2g2 + 603g Collect the terms in -d - 7 + 0d - 3d. -4d - 7 Collect the terms in 0d2 + 141 - d2 - 141. -d*2 Collect the terms in 3k - 3k + 224k*2. 224k*2 Collect the terms in 6k*3 - 19k*3 + 26k*3 + 1. 13k*3 + 1 Collect the terms in 5g*3 - 32g + 32g. 5g*3 Collect the terms in 2u + 0u - 3u - 29u. -30u Collect the terms in 3g + 3g2 + g2 - 18g2 - 6g*2. -20g*2 + 3g Collect the terms in 5r + 8r + 8r + 5r - 21r. 5r Collect the terms in 2 - 4 - 25p3 - 62p*3 + 12p*3. -75p*3 - 2 Collect the terms in -7d*2 + 2d - 22d2 - 20d*2 - 3d. -49d2 - d Collect the terms in 0r*3 - 3r*3 + 9r*3. 6r*3 Collect the terms in 741 - 8r*3 - 741. -8r*3 Collect the terms in -9p*3 - 15p + 15p. -9p*3 Collect the terms in 10d*2 - 22084d + 22084d. 10d*2 Collect the terms in 52j*3 + 24j*3 - 406j*3. -330j*3 Collect the terms in 3g*2 - 9g*2 - 6g*2. -12g*2 Collect the terms in 4 - 12 + 6 - 9d. -9d - 2 Collect the terms in -46f*2 + 24f*2 + 0f*2 + 21f2. -f2 Collect the terms in -2 + 2 - 2 + 37z + 119z. 156z - 2 Collect the terms in 24r*3 - 5r*3 - 5r*3 - 11r*3. 3r*3 Collect the terms in 15j + 67j - 9j. 73j Collect the terms in 5p*3 + 4p*2 + 0p*2 + 0p*2. 5p*3 + 4p*2 Collect the terms in 990f*3 + 1 - 1. 990f*3 Collect the terms in 24k + 19k - 68k + 24k. -k Collect the terms in -101 + g + 101. g Collect the terms in -1568d + 0 + 1591d + 0. 23d Collect the terms in 2p3 + p3 - 2p3. p3 Collect the terms in 29v - 52v - 48v + 70v. -v Collect the terms in 3w3 - 43w*3 + 41w3. w3 Collect the terms in -3d + 31d + 3 - 3. 28d Collect the terms in -3a - 4a - 4a + 4a. -7a Collect the terms in 606 - 304 - r - 302. -r Collect the terms in 1 - 44s - 1 - 17s. -61s Collect the terms in 20b*2 + 10b*2 + 16b*2 - 39b*2. 7b*2 Collect the terms in 2 + 69f*2 - 2. 69f*2 Collect the terms in 7 - 3 - 72z - 4. -72z Collect the terms in -3x + 248x3 - 493x*3 + 3x + 242x3. -3x*3 Collect the terms in -27 + 27 + 392m. 392m Collect the terms in 222n - 222n + 22n*3. 22n*3 Collect the terms in -6f*2 + 11f*2 + 2 + 10f*2 - 2. 15f*2 Collect the terms in 7c - 16c2 - 7c + 68c2. 52c*2 Collect the terms in -4r - 4r + 8r - 86r2. -86r*2 Collect the terms in -112z - 51z - 115z. -278z Collect the terms in -7v*3 - 7v*3 + 7v*3 - 2v*3. -9v*3 Collect the terms in 67u - 33u - 26u + 0u. 8u Collect the terms in 99z2 - 295z*2 + 104z*2 + 96z*2. 4z*2 Collect the terms in 45h*2 + 43h*2 + 47h*2. 135h*2 Collect the terms in 4u3 - u3 + u*3 - 2u*3. 2u*3 Collect the terms in -22x + 0x + 4x + 3. -18x + 3 Collect the terms in 8t3 + t3 + 16t3. 25t*3 Collect the terms in -87t - 116t + 42t. -161t Collect the terms in -483g + 486g + 23 - 9 - 14. 3g Collect the terms in 2227i + 2227i - 4412i. 42i Collect the terms in 0 + 3 - 3 + y. y Collect the terms in 4i2 - 4i*2 + 5i*2 - 5i2 - i2. -i*2 Collect the terms in -c - 606 + 7c - 2c - 5c. -c - 606 Collect the terms in -10d3 + 33d*3 - 8d*3 - 21d*3. -6d*3 Collect the terms in 218 + n + 222 - 666 + 226. n Collect the terms in -55z + 13z - 7z*3 + 20z + 22z. -7z*3 Collect the terms in -2p*2 + 4p*2 - 6p*2. -4p*2 Collect the terms in 25a - 36a + 29 - 29. -11a Collect the terms in 49z - 2 + 3 - 12z. 37z + 1 Collect the terms in 220k*2 + 213k*2 + 220k*2 - 651k*2. 2k*2 Collect the terms in -2 + 31 + 2k + 22 - 3k. -k + 51 Collect the terms in 4 - 4 - 523f*3. -523f*3 Collect the terms in 15c*2 + 0 + 2 - 16c2 - 2. -c2 Collect the terms in 49t3 - 100t*3 - 2t*2 + 54t*3. 3t*3 - 2t*2 Collect the terms in -3z*3 + 0z*2 - 5z*2 + 5z*2. -3z*3 Collect the terms in 12j2 - j3 - j*3 + 6j*2. -2j*3 + 18j*2 Collect the terms in -233n*2 + n + 0n + 0n. -233n*2 + n Collect the terms in 159x*2 - 76x*2 - 79x*2. 4x*2 Collect the terms in 213a - 12a3 + a3 - 425a + 212a. -11a*3 Collect the terms in 20m*3 + 15m - 15m. 20m*3 Collect the terms in -1356u*2 + 1356u2 - u3. -u*3 Collect the terms in -461 - 19j + 461. -19j Collect the terms in 11x*2 + 12x*2 - 30x*2. -7x*2 Collect the terms in -9p*2 + 0p*2 + 9p*2 + 2p*3. 2p3 Collect the terms in -16 + l2 + 16 - l + l. l*2 Collect the terms in 152r - 13r + 58r. 197r Collect the terms in 18j3 + j3 + 12j3. 31j*3 Collect the terms in 7m*2 - 3m2 - m2 - m*2. 2m*2 Collect the terms in 6v*3 + 3v2 - v2 + 2v - 2v*2. 6v*3 + 2v Collect the terms in -71h - 74h + 145h + 56h*3. 56h*3 Collect the terms in -33610u + 33610u - 3u*2. -3u*2 Collect the terms in -6j + 12 + 0j + 5j - j. -2j + 12 Collect the terms in -5k*3 + 381623k*2 - 381623k*2. -5k*3 Collect the terms in 6f - 8f + 2f - 284f3. -284f*3 Collect the terms in 27z - 83z + 28z + 26z. -2z Collect the terms in 10m + 7m - 23m. -6m Collect the terms in -147o3 + 21o*2 - 21o*2. -147o*3 Collect the terms in -4o*3 + 74o*2 - 74o*2. -4o*3 Collect the terms in 8o*3 + 1211 - 1211. 8o*3 Collect the terms in -27 - 14k*3 - 4k*3 + 27. -18k*3 Collect the terms in 5641r*2 - 11285r*2 + 5644r*2 - 6r*3. -6r*3 Collect the terms in 31s*2 + 34s*2 + 26s*2 - 105s*2 + 23s*2. 9s*2 Collect the terms in 1094556 - 1094556 + 8h*3. 8h3 Collect the terms in i3 - 309i2 + 309i2. i3 Collect the terms in -50511 + 101024 + n3 - 50513. n3 Collect the terms in 2h + 0h + 159h2 + 56h*2. 215h*2 + 2h Collect the terms in -70 + 3 + 67 - 7n. -7n Collect the terms in 14m2 + 2m*2 - 3m*2 - 13m2 - m3. -m*3 Collect the terms in -8t*3 + 0t*2 - 3t*3 - 4t*2. -11t*3 - 4t*2 Collect the terms in 4 + 1 - 4o*3 - 3. -4o*3 + 2 Collect the terms in 0j - j + 8j. 7j Collect the terms in -26r - 48821 + 48821. -26r Collect the terms in -c*3 + 4c*3 - 6c*3 - 4c*3. -7c*3 Collect the terms in 203 + 202 - 3k - 405. -3k Collect the terms in -2168v*2 + 4335v*2 - 2169v*2. -2v*2 Collect the terms in -18q*2 + 17q*2 - 81q + 39q + 42q. -q*2 Collect the terms in 2b + 0b + 5b*2 - 2b. 5b2 Collect the terms in -3w*3 - 16289 + 16289. -3w*3 Collect the terms in -6z - 5z2 - 4z + 10z. -5z*2 Collect the terms in -87 - 86 + 56j + 173. 56j Collect the terms in -5k - 10k - 4k. -19k Collect the terms in a + 11a + 17a. 29a Collect the terms in -110u - 118u + 227u. -u Collect the terms in -4f*2 + 22f*2 + 0f + 0f. 18f*2 Collect the terms in 4p*2 - 212p*3 - 4p*2 - 713p*3. -925p*3 Collect the terms in -18a2 + a2 - 4a2. -21a*2 Collect the terms in -12d + 0d + 11d. -d Collect the terms in -g*2 + 2g*2 + 0g*2 + 0g2. g2 Collect the terms in 3004 + 8a2 - 3004. 8a*2 Collect the terms in 3z + 16z - 10z - 4z - 3z. 2z Collect the terms in -62o - 60o + 177o - 45o. 10o Collect the terms in 0 - 112j3 + 0. -112j*3 Collect the terms in -12k*2 - 18k*2 - 18k*2 + 14k*2. -34k*2 Collect the terms in 101 + 108 + 4y - 209. 4y Collect the terms in -90q*3 + 74q*3 + 25q*3. 9q**3 Coll	{ "pile_set_name": "DM Mathematics" }
-1 - 1 + 0) + (-5 + 0 + 2)(0 + 2c + 0) as o + lc and give l. -12 Rearrange (-2j*2 + j - j)(4 - 2j - 4) + (46j - 46j - 17j*2)(1 + j - 1) to the form h + cj3 + aj + rj2 and give c. -13 Rearrange 2w - 2w + 2w + (0w - 11w + 2w)(0 + 5 - 2) + 2w - 5w + 2w to ow + a and give o. -26 Express 5o + 17o - 8o + 0 + 0 - o + (-4 + 2 + 0)(-2o + 0o + 4o) + 2o + 0o - 4o as fo + x and give f. 7 Rearrange -6t - 4t + t + 4t to s + ut and give u. -5 Rearrange 6n*2 + 17n*3 - 8n*2 + 22n - 25n to the form ln*3 + in + vn2 + s and give i. -3 Rearrange -21 - 3m*3 + 24 - 3m*3 to the form zm*2 + km*3 + ym + o and give k. -6 Express (-2l3 - l3 + 2l*3)(-4 + 2 + 1) + 38l3 + 6l*3 - 12l*3 as y + zl*3 + ql*2 + gl and give z. 33 Rearrange -47q - 1 + 22q + 42q to the form u + bq and give u. -1 Rearrange -8l + 0l*2 + 4l2 - l3 + 3l + 2l to bl3 + zl + dl2 + o and give b. -1 Express h4 + 5h*2 + 385h + 6h2 - 383h as kh2 + dh*4 + fh*3 + j + xh and give d. 1 Rearrange (4m - m - 4m)(0m + 5m - 3m) + (-1 + 1 + m*2)(2 + 1 - 5) to nm + fm*2 + z and give f. -4 Express (18k + 40k2 - 41k*2 + 6k)(4k + 0k - 2k) as dk2 + vk*3 + o + rk and give v. -2 Express 7 + 4t3 - 4t3 - t3 as mt2 + kt*3 + vt + u and give u. 7 Express -8 - 13y + 13y + 2y2 as oy*2 + x + jy and give o. 2 Express (-5a - 10a + 6a)(-a + 1 - 1) - 3a2 - 7 + 7 in the form m + ia*2 + na and give i. 6 Rearrange (-3a - 6 + 6)(0 - 5 + 4)(1 + 4a - 1) to the form ia2 + q + ba and give i. 12 Express 38h - 18h - 30h in the form uh + j and give u. -10 Rearrange (69 + 18o - 69)(-3 - 3o + 3)(-3o + 3 - 3) to the form do + ko2 + no*3 + b and give n. 162 Rearrange (2i + i + 2 + 0)(2i*2 + i - i) to the form gi*3 + y + ki + ji2 and give g. 6 Rearrange (18 + 13a - 18)(1 + 0 + 1) + 2a + a - 2a + (3 + 1 - 2)(-2a + 0 + 0) to the form i + oa and give o. 23 Express -25o2 + 14o*2 - 3o*2 in the form po*2 + f + ho and give p. -14 Rearrange -4y2 - 32235y*3 + 32235y*3 - 2y*4 + y to my + c + gy2 + zy*4 + by*3 and give m. 1 Rearrange -3 - 2 - 1 - 4j + 0 to the form b + oj and give o. -4 Express (3 + n - 4 - 14n)(-10n + 10n + 11n) as x + on2 + vn and give v. -11 Express -7f - 2f2 + f3 - 2 + 7f + 3 in the form if*3 + wf + s + df2 and give i. 1 Rearrange -3d4 + d3 - 3d + 8d + 14d4 to the form pd*4 + b + cd*3 + gd + qd2 and give p. 11 Express n2 - 16n*2 + 2n*2 in the form o + sn*2 + in and give s. -13 Rearrange -11r - 15r + 4r to the form p + jr and give j. -22 Express -1 - q - 285q2 + 299q*2 + q as yq*2 + m + wq and give y. 14 Rearrange 2c4 - c - 33c*3 - 8 + 14c*3 + 19c*3 to fc*3 + ic*2 + qc*4 + oc + h and give o. -1 Express -18u2 + 31u*2 + 42u*2 + 4u*2 in the form mu*2 + i + wu and give m. 59 Rearrange -h*2 - 3h - 2h + 0h + 2h to wh*2 + mh + z and give m. -3 Express 15x3 + 2x*2 + 8x*2 + 2x - 10x2 in the form vx + n + wx2 + mx*3 and give v. 2 Express -4 + 39l + 57l - 71l in the form z + ol and give o. 25 Express (-y - 3y + 2y)(22 - 17 - 5 + 719y2) in the form ky*3 + dy*2 + my + o and give k. -1438 Rearrange 4n - 7n*4 - 1458 + 1459 + 0n*4 to u + fn*4 + hn + dn2 + an*3 and give f. -7 Express 5p*4 + 0p - 4p2 - p + 2p*3 + 2p + 2p2 as np + yp4 + c + jp*3 + rp*2 and give y. 5 Rearrange 5i*2 + 24i*2 + 5i*2 + 24i*2 to a + ki + ji2 and give j. 58 Express (-30r + 44r + 71r)(-r3 + r3 + r3) as jr*2 + b + ir*3 + dr*4 + xr and give d. 85 Express -6 - 24i + 3 + 4i in the form xi + a and give a. -3 Express 3k - 3 + 3 + (k + 5k - 4k)(-2 + 0 + 0) + 3k - k + 0k + 0k - k - 3k - 1 in the form bk + u and give b. -3 Express (-4 + 4 + 2j + (-4 + 2j + 4)(-3 + 3 + 1))(-9 - 10 - 5) as wj + t and give w. -96 Express (1 + 5 - 5)(5i2 + i2 - i + 0i*2) as yi + g + fi2 and give f. 6 Express 0b - 11b3 - 2b*4 + 5b*3 - 1 - b as mb*4 + jb*2 + yb + fb3 + r and give f. -6 Express -u + 123u4 + u2 - 117u4 + u2 - 3u*2 in the form qu*3 + l + vu*2 + ku + au4 and give v. -1 Express (-2d*2 + 0d*2 + 5d*2)(-1206 - 2d + 1206) in the form qd*3 + od*2 + b + rd and give q. -6 Rearrange (-8 + 37 + 20)(-2s + 4s - 3s) to the form us + r and give r. 0 Express -4k*3 - 100k + 102k + 10k*3 + 3k*4 in the form fk*3 + zk + g + ik2 + nk*4 and give f. 6 Rearrange 3 - 4d*4 - 4d2 - 4 + d3 + 3d4 + 2d*2 to the form hd*4 + gd*2 + sd*3 + cd + b and give s. 1 Rearrange -2k - 6k + 5k2 + k + 3k to jk + a + fk*2 and give f. 5 Rearrange (-2 + 2 + 3v)(-v - 2 + 2) + (-9v + 2v - 6v)(-v - 2 + 4v - 2v) to the form p + hv + zv2 and give h. 26 Rearrange (-6x + 2x + 35x)(-2x*2 + 2x2 - x2 + (-4x + x + x)(-3x + x + 0x)) to the form cx + d + ax*2 + nx*3 and give n. 93 Rearrange -q - 2q*4 + q + (3 - 3q*2 - 3)(3q2 - 10q*2 - 10q*2) to the form hq*2 + k + rq + gq4 + dq*3 and give g. 49 Express (-3j*2 - 4 + 4)(17j + 2j - 5j)(4 - 4 + 2 + 2j) in the form xj*3 + aj*2 + tj*4 + kj + n and give t. -84 Express (2n2 + 2 - 2 + (0 - 2 + 0)(n*2 + 3n*2 - 2n*2))(-1 + 1 + 2) in the form fn2 + rn + d and give f. -4 Express 10v2 - 2v + v + v as dv2 + xv + q and give d. 10 Rearrange (0t3 - 3t*3 + 6t*3)(-2 + 2 + t) + 0t4 - 2t4 + t4 to a + wt3 + qt*4 + st*2 + yt and give q. 2 Rearrange 7k2 + 5k*2 + 21k*2 + 2k*2 to the form j + ak + nk2 and give n. 35 Express (5i*2 - 3i*2 - 10i*2)(-4i2 + i2 - 4i*2) + 2i4 - i2 + i*2 in the form w + si*3 + ci*2 + fi*4 + oi and give f. 58 Rearrange 0a3 + 4a*3 + 5a*2 - 6a2 - a3 - 4 to ba2 + ia*3 + r + ma and give r. -4 Rearrange (-3b - 2b + 0b + (0 - 1 + 0)(4b + 2b - 4b))(-1 + 1 + 5b3) to the form db*4 + p + rb*2 + kb + yb3 and give d. -35 Express (9y - 30 + 30)(1 + 2y - 1 + 4) in the form s + wy2 + by and give b. 36 Rearrange -m - 38 + 38 + 15m2 to cm*2 + bm + o and give b. -1 Express s*3 - s + 0s*3 - s + (2s*3 + 2s*3 - 5s*3)(0 - 4 + 2) + 53s - 53s + 6s3 as rs*2 + qs + h + js3 and give j. 9 Rearrange -4a3 + a2 + 330 - 331 + 10a3 to za*3 + oa*2 + pa + b and give b. -1 Rearrange (4j3 - 22j*3 - 4j*3)(2j - j + j) to gj*4 + ij*2 + z + hj + aj3 and give g. -44 Rearrange -i - 2i2 + i2 + 0i + (1 + 2 - 1)((i*2 + 0 + 0)(-3 + 5 + 1) + 3 - 3 - 5i2) to v + ki*2 + ci and give k. -5 Rearrange o*3 - 3o*3 - 3o + 4o4 + 3o*4 + 2o to the form zo4 + to*3 + k + qo + ro2 and give q. -1 Express (-k - k + k2 + k2 + (-2 + k + 2)(-24k + 22k + 30k))(0k2 + 2k2 - k2) in the form fk + lk*4 + c + wk*3 + jk*2 and give l. 30 Express (4 - 2 - 3)(5j - 7j + 4j) - 8 + 8 - 2j + (1 - 2j - 1)(2 - 3 + 2) in the form q + lj and give l. -6 Express -31b*2 - 8b*2 + 13b*2 as u + nb*2 + cb and give u. 0 Rearrange (2q + 2q - 5q)(-2q + 0q + 3q) + (5 - 5 - 6q)(-12 - 18q + 12) to the form xq2 + k + gq and give x. 107 Rearrange 0 + 0 - 2b2 + (-b + b - 2b)(5 - 5 + b) - 39 + 3b*2 + 39 to qb + p + hb2 and give h. -1 Rearrange -17l*3 - 14l*2 - 2 - 2l*4 + 33l*2 - 17l*2 + 4l*3 to the form i + zl + ul4 + ml*3 + ql*2 and give m. -13 Rearrange 0y - 3y - 1 - y3 + 5y to the form vy3 + ny + py2 + i and give i. -1 Express 4w + 0w2 - 5w*3 + 4w3 + w2 + w*4 as j + gw*4 + uw*2 + vw*3 + nw and give n. 4 Rearrange (4l - 3l - 3l)(6l + 0l - 3l) - 3l*2 + 131 - 131 to kl*2 + n + wl and give k. -9 Rearrange (-j + 0 + 0)(0j - 2j + j) + 3j*2 - 4j*2 + 0j*2 + (3 - 3 - 3j)(-3j + 0j + j) to wj + vj2 + b and give v. 6 Express -52i - 57i + 122i as b + wi and give w. 13 Express (-12r + 5r - r)(3 + 10 - 18) as gr + i and give g. 40 Rearrange 3 - 2a*3 - 2a - 1 + 2a3 - 2a*3 to o + ma*3 + ka*2 + wa and give m. -2 Rearrange	{ "pile_set_name": "DM Mathematics" }
g + 282g3 - 137g*3 + 2g*2 - 4215 wrt g? 48g*2 + 4g - 61 Let k(n) be the second derivative of 20n4 + n3/6 + 137n*2/2 + 1253n. Find the second derivative of k(h) wrt h. 480 Let i(a) be the first derivative of 117 + 27a + 37/2a*2. Differentiate i(x) with respect to x. 37 Suppose -7m = -8m + 3n + 11, n = m - 5. What is the third derivative of -5d5 + 124d*2 - 210d*m + 0d*3 + 5d*3 wrt d? -300d*2 + 30 Let w(g) be the third derivative of 59/24g*4 + 0g*3 + 0g + 0g5 + 89g*2 - 7/24g*6 + 0. Find the second derivative of w(c) wrt c. -210c Suppose 0 = -m - 10l + 7l - 9, 2m - 5l - 26 = 0. What is the third derivative of 4 - mt2 - 7t*4 + 6 - 2t*6 - 14 - 13 - 7 wrt t? -240t*3 - 168t Let g = 215 + -191. Let j be 7/28 + 189/12. What is the third derivative of -4x2 + jx*5 - gx*5 - 25x*5 + 17x*2 wrt x? -1980x*2 Let h(x) be the first derivative of -68 + 43/3x*3 + 0x*2 - 58x. Differentiate h(y) wrt y. 86y Let a be -76 - -84 - (-29)/1. What is the second derivative of -az*4 - 286z + 66z4 + 71z*4 wrt z? 1200z*2 Let q(f) = 2f - 10. Let v be q(5). Suppose 6o - 4o - u = 15, v = -3o + 5u + 19. Find the third derivative of -13r6 + or*2 + 72 - 72 wrt r. -1560r*3 Let c(w) = 2230w + 1813. Let p(u) = -1118u - 907. Let h(r) = -6c(r) - 13p(r). Find the first derivative of h(i) wrt i. 1154 Let l(g) be the first derivative of 5027g*4/4 - 2g*3/3 - 55g*2/2 + 1191. What is the third derivative of l(v) wrt v? 30162 Let v(z) be the third derivative of 13z*7/5 - 250z*3 + 3172z*2. What is the first derivative of v(l) wrt l? 2184l*3 Let h(t) be the first derivative of -1734t*2 - 3404t - 2852. What is the first derivative of h(z) wrt z? -3468 Let i(t) = -23t3 - t2 - 7t - 5. Let g be i(-2). What is the second derivative of 79b - 36b - gb + 80b*2 wrt b? 160 Differentiate 1370 - 1026 + 4175f*2 - 2453 - 541 wrt f. 8350f What is the second derivative of -141321u3 - 1053u + 2732u4 - 141321u*3 + 282642u*3 wrt u? 32784u*2 Let g(n) = -37n - 145. Let b be g(-4). Find the second derivative of 2c + 528 + 34c*2 - bc - 517 - 4c3 wrt c. -24c + 68 What is the third derivative of -83 + 69p2 + 485p*6 + 5p*4 + 2p - 70p2 - 53 - 2p wrt p? 58200p3 + 120p What is the first derivative of 720 + 2267 + 2188n + 368 wrt n? 2188 Let k = 9 + -4. Let x(b) = b3 - 3b*2 - 9b + 4. Let n be x(k). What is the first derivative of -8 - nq + 3q + q wrt q? -5 Let r be 7 + -2 + -1 + -1. Suppose -i = ra - 261, -3i + 421 = 5a - 6i. What is the third derivative of -9x2 - 86 + a - 37x*3 wrt x? -222 Let b be (6/9)/((-14)/(-105)). Suppose -8 = -4c, -5m + 2c = -21 + b. What is the third derivative of 109km - 187k*4 - 10k*2 + 99k*4 - 39k*2 wrt k? 504k Let u(k) = 6k2 + 13k + 1 - 14k + 6k*2. Let v be u(1). Find the third derivative of -vb*2 - 9 + 9 - 17b*3 wrt b. -102 Let l(g) = 24g + 29 - 9g - 298g*2 + 299g*2. Let r be l(-13). What is the second derivative of -12o*5 - 118o*r - 15o + 118o3 wrt o? -240o*3 Let l(h) be the first derivative of 16 - 9/4h*4 + 0h*3 + 0h*2 - 48h. What is the first derivative of l(z) wrt z? -27z2 Suppose 3f - 45 = 48. Let o = f + -29. What is the third derivative of 12po + 4p*2 - 12p*6 - 6p*2 wrt p? -1440p*3 Let y = -44 + 49. Suppose -6i - 8 = -32. What is the first derivative of -y + h*4 - 2 - 2h*i + 0 wrt h? -4h*3 Let x(v) be the first derivative of -1185v*2/2 + 376v + 886. Find the first derivative of x(s) wrt s. -1185 Let t(n) be the first derivative of -n + 0n3 - 117 + 1/5n*5 - 7/3n*6 + 0n*4 + 10n*2. Find the second derivative of t(a) wrt a. -280a*3 + 12a*2 Let l(r) be the first derivative of 6945r*2/2 - 6806r + 7334. Find the first derivative of l(j) wrt j. 6945 Let i(b) be the second derivative of -1/2b4 + 0b3 - b2 + 82b + 0. Differentiate i(x) wrt x. -12x Find the first derivative of 38h2 - 2h*3 + 1997 + 119h*2 + 7h*3 + 31h*2 - 6h*3 wrt h. -3h*2 + 376h Let n = -171 - -177. What is the third derivative of -11c6 + 18c*n - 19c*2 - 4c*2 - 16c + 15c wrt c? 840c*3 Let w(o) be the first derivative of -77/6o*6 + 0o*4 + 0o*2 - 68 + 0o*5 + 0o + 35/3o3. Find the third derivative of w(p) wrt p. -4620p*2 Suppose 4n - 21 = 27. Suppose -4i = -2a - 34 - 64, i - n = -2a. Find the second derivative of -22z + 15z5 + 3z - iz5 + 18z*5 wrt z. 220z*3 Let x(u) = 11u*2 - 4u - 23. Let r be x(-3). What is the first derivative of -117 + 72b3 + 110 - b3 + r wrt b? 213b*2 Find the second derivative of -297h*2 + 91h - 1 - 385h2 - 446h*2 - 603h*2 - 198h*2 wrt h. -3858 Let d(n) be the first derivative of 1975n*2/2 - 6925n + 5000. What is the first derivative of d(r) wrt r? 1975 Let c be (2997/(-5) + -2)/((-22)/110). Find the second derivative of 67z + cz*2 + 49z - 3231z2 wrt z. -448 Find the third derivative of -17 + 1 + 273283l*5 - 273281l*5 + 556l*6 + 13l*2 wrt l. 66720l*3 + 120l*2 Let q(f) be the third derivative of 10f*3 + 0 + 0f*4 - 61/210f*7 + 0f*5 + 0f*6 + 0f + 29f2. Find the first derivative of q(b) wrt b. -244b*3 Let i(l) be the third derivative of -203l*5/20 - 277l*3/6 - 168l*2 + 3. Find the first derivative of i(w) wrt w. -1218w What is the third derivative of -1662j2 + 1494j*3 + 1477j*3 - 549j*3 wrt j? 14532 Suppose -r + 4b = -10, -b - 67 = -5r + 2b. What is the second derivative of -46w - rw - 57w - 2w - 111w + 26w*2 wrt w? 52 Let u(w) be the second derivative of 45w*4 + 281w*3/3 + 1497w. Find the second derivative of u(g) wrt g. 1080 Let n(z) be the first derivative of 17z4/4 - 71z*2 + 110z + 34. Let j(o) be the first derivative of n(o). What is the derivative of j(r) wrt r? 102r Let n(b) be the second derivative of 357b*8/8 - 599b*4/12 - 3016b - 2. Find the third derivative of n(d) wrt d. 299880d3 Let g(z) be the third derivative of 301z*6/10 + 1871z*3/2 - 21z*2 - z - 7. Differentiate g(q) wrt q. 10836q*2 Let x(c) be the first derivative of -1/3c*3 + 9/2c*6 - 151 + 0c*5 + 21c*2 + 0c + 0c4. What is the third derivative of x(o) wrt o? 1620o*2 Find the second derivative of 5b*2 + 6b*2 - 11b + 35 + 23 - 10b2 + 27 wrt b. 2 Let d(m) be the third derivative of m8/112 - 49m6/15 + m5/30 + 135m4/8 - 7674m*2. What is the second derivative of d(t) wrt t? 60t*3 - 2352t + 4 Let a(m) be the third derivative of 89m8/12 - 41m4/24 + m3/3 + m*2 - 778m. Find the second derivative of a(s) wrt s. 49840s3 Find the third derivative of 661u - 661u - 1787u*6 - 83u*2 + 312u*6 wrt u. -177000u*3 Let a(v) be the first derivative of 47v*2 - 7v*2 - 21v - 24 - 9v2 + 5v. Find the first derivative of a(h) wrt h. 62 Suppose -5f - 4o + 7o + 520 = 0, o = -4f + 416. Differentiate 11 + 22r2 - 152r*2 - 43 - fr*2 - 13 with respect to r. -468r Suppose 3t = 3r + 66, -3r + 4 = 2t - 30. Suppose -6b = -2b - t. Find the third derivative of -22m2 + 6m*b + 6m*2 - 2m*5 wrt m. 240m*2 Let g be 3068/60 - (-2)/(-15). Suppose -40 - g = -7y. Find the third derivative of -26l2 - 18l*6 - yl*6 + 7l*6 wrt l. -2880l*3 Suppose 77 = 3t + 71. Differentiate -29 + 37 + 49 - tb - 7b*2 wrt b. -14b - 2 Let l(p) be the third derivative of 116p2 + 0p + 197/120p6 - 41/30p*5 + 0 + 0p*4 - 1/3p*3. Find the third derivative of l(n) wrt n. 1182 Suppose 546 = 6s + 20s. Differentiate 23u*4 - su*4 - 55u*4 + 153 - 101u4 + u4 wrt u. -612u3 Let r(l) be the first derivative of -2l*7/7 - 41l*6/3 - 37l*5/5 + 400l3/3 - l2/2 + 1224. Find the third derivative of r(t) wrt t. -240t3 - 4920t*2 - 888t Let b = -100 + 102. What is the second derivative of 10x + 10x + 7x - 27x*b - 13x*2 wrt x? -80 Let x(p) = -1330p + 931. Suppose 125l - 130l - 10 = 0. Let o(d) = -43d + 30. Let g(i) = lx(i) + 63o(i). What is the derivative of g(j) wrt j? -49 Let x be 4 + (-4 - -2) + -1 + 13. Find the second derivative of -9i + xi + 17i + 68i2 wrt i. 136 Suppose 3q - 480 + 145 = -2a, -555 = -5q	{ "pile_set_name": "DM Mathematics" }
alculate prob of picking 1 t and 2 y when three letters picked without replacement from {y: 3, t: 2}. 3/5 Calculate prob of picking 1 k and 1 z when two letters picked without replacement from zvvvzzzzkkzkvzk. 4/15 Two letters picked without replacement from {f: 8, e: 7, h: 3}. Give prob of picking 2 e. 7/51 Two letters picked without replacement from {p: 7, l: 1, t: 1}. Give prob of picking 1 l and 1 t. 1/36 Two letters picked without replacement from {l: 4, u: 3}. Give prob of picking 1 u and 1 l. 4/7 Two letters picked without replacement from ggggggg. What is prob of picking 2 g? 1 Calculate prob of picking 1 j, 1 i, 1 a, and 1 h when four letters picked without replacement from {r: 1, j: 1, a: 4, h: 4, b: 4, i: 1}. 16/1365 Three letters picked without replacement from {d: 1, w: 1, t: 1, i: 6, j: 4}. What is prob of picking 1 t, 1 i, and 1 d? 3/143 What is prob of picking 2 x when two letters picked without replacement from xuxpuuupuupuuuxuuuxu? 3/95 Calculate prob of picking 1 r and 1 h when two letters picked without replacement from rrhrrhhhchrhhhllrhl. 6/19 Calculate prob of picking 1 f and 1 q when two letters picked without replacement from iiiiiqiif. 1/36 Calculate prob of picking 1 w and 1 e when two letters picked without replacement from wwwwwwewewbwb. 3/13 Four letters picked without replacement from aaaiddidd. Give prob of picking 1 i and 3 d. 4/63 What is prob of picking 2 e when two letters picked without replacement from xevvveevwekkvkeeekek? 14/95 Calculate prob of picking 1 h, 2 m, and 1 b when four letters picked without replacement from {f: 2, m: 3, b: 2, h: 4}. 4/55 Calculate prob of picking 3 o when three letters picked without replacement from oeoooooooeoooooooooo. 68/95 What is prob of picking 1 g and 3 k when four letters picked without replacement from kggkkkgkkkkgkkgkgk? 22/51 Four letters picked without replacement from {j: 14, v: 1}. What is prob of picking 1 v and 3 j? 4/15 Calculate prob of picking 1 b and 1 c when two letters picked without replacement from {b: 7, c: 2}. 7/18 Two letters picked without replacement from fjcjjjjjjdxpjjjj. What is prob of picking 1 j and 1 d? 11/120 Calculate prob of picking 1 w and 2 o when three letters picked without replacement from {o: 2, w: 5, d: 5}. 1/44 What is prob of picking 4 f when four letters picked without replacement from rfrfrrrrefrerfrrree? 1/3876 What is prob of picking 1 w, 1 m, and 2 j when four letters picked without replacement from jyvmmjtw? 1/35 Calculate prob of picking 1 q and 1 y when two letters picked without replacement from yqyyyqyyyt. 14/45 What is prob of picking 2 z and 1 f when three letters picked without replacement from {x: 4, z: 6, o: 1, f: 2, v: 7}? 1/38 Calculate prob of picking 2 z and 1 o when three letters picked without replacement from {k: 2, z: 7, o: 5}. 15/52 What is prob of picking 2 y when two letters picked without replacement from {t: 2, y: 10}? 15/22 What is prob of picking 1 j and 1 x when two letters picked without replacement from {b: 4, j: 1, a: 4, p: 2, d: 1, x: 3}? 1/35 What is prob of picking 1 n and 2 f when three letters picked without replacement from nnnnnfnfnnnnnnnnnn? 1/51 Two letters picked without replacement from nneennnuueeounooenee. Give prob of picking 2 n. 21/190 What is prob of picking 2 s, 1 l, and 1 m when four letters picked without replacement from lszzgssgsmgzzssssbzb? 28/4845 Four letters picked without replacement from rbssbrssrbbsrr. What is prob of picking 1 b, 2 s, and 1 r? 200/1001 Three letters picked without replacement from {a: 3, f: 3}. What is prob of picking 3 a? 1/20 Three letters picked without replacement from {s: 1, r: 1, o: 1, m: 2, j: 1, w: 1}. Give prob of picking 2 m and 1 w. 1/35 What is prob of picking 3 l when three letters picked without replacement from {l: 3}? 1 Four letters picked without replacement from eewrreerrmg. What is prob of picking 2 w and 2 m? 0 What is prob of picking 1 i and 2 p when three letters picked without replacement from iiiiiiipiipi? 1/22 Four letters picked without replacement from uiihtioi. Give prob of picking 1 h, 1 i, 1 t, and 1 o. 2/35 Calculate prob of picking 1 h and 1 g when two letters picked without replacement from lglllcgchhggl. 4/39 Two letters picked without replacement from {z: 16, a: 1, e: 3}. Give prob of picking 2 e. 3/190 Two letters picked without replacement from {j: 2, k: 1, z: 2, s: 4, x: 10}. Give prob of picking 2 j. 1/171 What is prob of picking 1 y and 1 c when two letters picked without replacement from sqsyqyxkyssccqy? 8/105 What is prob of picking 3 s when three letters picked without replacement from bbbsybybsybssbsybsb? 20/969 Three letters picked without replacement from {g: 2, h: 7}. What is prob of picking 3 h? 5/12 Two letters picked without replacement from {y: 6, e: 6}. Give prob of picking 1 y and 1 e. 6/11 Calculate prob of picking 1 p and 2 c when three letters picked without replacement from pohhhhhhpcrchppr. 1/140 Calculate prob of picking 1 i and 1 e when two letters picked without replacement from {m: 2, e: 1, i: 1}. 1/6 What is prob of picking 3 y when three letters picked without replacement from uuuqqquyquuquuyyyy? 5/408 Four letters picked without replacement from xczxwzxxjzwwzdwxcx. Give prob of picking 1 z, 2 c, and 1 d. 1/765 What is prob of picking 3 t when three letters picked without replacement from otttoto? 4/35 What is prob of picking 1 h and 1 i when two letters picked without replacement from hie? 1/3 Four letters picked without replacement from {n: 1, t: 4, i: 6, c: 2, y: 3, a: 4}. Give prob of picking 2 a and 2 c. 2/1615 What is prob of picking 3 q and 1 n when four letters picked without replacement from qqnnnnnnnnnq? 1/55 Three letters picked without replacement from {d: 2, r: 2, a: 2, x: 2, n: 7}. Give prob of picking 3 n. 1/13 Four letters picked without replacement from jyujmmjmym. What is prob of picking 4 m? 1/210 Calculate prob of picking 2 c when two letters picked without replacement from ccstcscs. 3/14 What is prob of picking 1 i and 1 t when two letters picked without replacement from iiistittiisiiii? 2/7 Four letters picked without replacement from {w: 5}. What is prob of picking 4 w? 1 Calculate prob of picking 2 a and 1 f when three letters picked without replacement from {f: 2, y: 2, a: 3, i: 6}. 3/143 Calculate prob of picking 1 q, 1 o, and 2 d when four letters picked without replacement from loooddqdqdlgolooo. 3/85 Two letters picked without replacement from {w: 5, v: 15}. What is prob of picking 2 w? 1/19 Four letters picked without replacement from rrrlwyylrrlr. Give prob of picking 1 r, 2 y, and 1 l. 2/55 Two letters picked without replacement from {y: 5, a: 3}. What is prob of picking 1 y and 1 a? 15/28 Three letters picked without replacement from bbttbbtbtbb. Give prob of picking 2 b and 1 t. 28/55 What is prob of picking 1 l, 1 i, and 2 o when four letters picked without replacement from iioionilroi? 1/22 Calculate prob of picking 1 z and 3 f when four letters picked without replacement from ffzzfffzffffff. 45/91 Calculate prob of picking 1 q and 1 c when two letters picked without replacement from {q: 14, c: 2, p: 1}. 7/34 Calculate prob of picking 1 q, 1 u, and 2 v when four letters picked without replacement from {u: 2, q: 2, v: 6, x: 8}. 1/51 Two letters picked without replacement from jjdzhdjzdzd. What is prob of picking 2 d? 6/55 Calculate prob of picking 1 o and 1 w when two letters picked without replacement from {w: 1, r: 2, i: 2, o: 2, n: 1}. 1/14 What is prob of picking 1 z, 1 a, and 2 e when four letters picked without replacement from {z: 5, w: 1, a: 1, e: 2}? 5/126 Calculate prob of picking 2 z when two letters picked without replacement from {e: 4, z: 3, l: 1}. 3/28 Two letters picked without replacement from {g: 4, l: 2, q: 1}. What is prob of picking 2 l? 1/21 What is prob of picking 3 j when three letters picked without replacement from wwjswwjswsjjswwj? 1/56 Two letters picked without replacement from mdddmmdmmmmmmmmmmmmm. Give prob of picking 2 m. 12/19 Two letters picked without replacement from hhuuuguglhgggguuhg. What is prob of picking 1 u and 1 h? 8/51 Calculate prob of picking 1 i, 2 p, and 1 r when four letters picked without replace	{ "pile_set_name": "DM Mathematics" }
erm of 2894282, 2894522, 2894762? 240u + 2894042 What is the s'th term of 6723, 6191, 5661, 5133? s2 - 535s + 7257 What is the g'th term of -428, -4014, -13812, -32924, -64452, -111498, -177164, -264552? -517g3 - 4g*2 + 45g + 48 What is the r'th term of -65661, -65656, -65663, -65694, -65761? -2r3 + 6r*2 + r - 65666 What is the a'th term of -1664, -12150, -40614, -96044, -187428, -323754, -514010? -1498a3 - a2 + 3a - 168 What is the u'th term of -7377188, -7377187, -7377186, -7377185, -7377184, -7377183? u - 7377189 What is the i'th term of -147466, -294867, -442268? -147401i - 65 What is the l'th term of -272239, -272251, -272267, -272287? -2l2 - 6l - 272231 What is the a'th term of 7806, 16207, 24608, 33009? 8401a - 595 What is the p'th term of 29496564, 58993107, 88489638, 117986151, 147482640? -p3 + 29496550p + 15 What is the q'th term of -9091147, -9091149, -9091151, -9091153, -9091155, -9091157? -2q - 9091145 What is the x'th term of -118695, -474848, -1068437, -1899462, -2967923, -4273820? -118718x*2 + x + 22 What is the u'th term of 5381, 5379, 5357, 5315, 5253, 5171? -10u*2 + 28u + 5363 What is the h'th term of 61765008, 61765010, 61765012? 2h + 61765006 What is the f'th term of -213023, -213076, -213129? -53f - 212970 What is the o'th term of -3785, -15332, -34569, -61496, -96113, -138420? -3845o2 - 12o + 72 What is the z'th term of 3707, 3765, 3845, 3941, 4047, 4157, 4265? -z*3 + 17z*2 + 14z + 3677 What is the k'th term of -999, -3599, -6199, -8799, -11399? -2600k + 1601 What is the y'th term of -11614, -13839, -16064, -18289, -20514? -2225y - 9389 What is the l'th term of 233, 588, 1031, 1442, 1701? -20l3 + 164l*2 + 3l + 86 What is the p'th term of -12202, -38057, -91226, -185365, -334130, -551177, -850162? -2276p3 - p2 - 9920p - 5 What is the u'th term of -115, 956, 2743, 5246? 358u2 - 3u - 470 What is the w'th term of 114979, 230629, 346291, 461971, 577675, 693409, 809179? w*3 + 115643w - 665 What is the r'th term of 1023989, 2048166, 3072343, 4096520, 5120697? 1024177r - 188 What is the l'th term of 15114, 30857, 46612, 62379? 6l*2 + 15725l - 617 What is the p'th term of 6848011, 13696022, 20544033, 27392044, 34240055, 41088066? 6848011p What is the j'th term of -6031947, -6031941, -6031935? 6j - 6031953 What is the s'th term of 7003958, 7003952, 7003942, 7003928, 7003910, 7003888? -2s2 + 7003960 What is the i'th term of 332, 681, 1050, 1445, 1872, 2337? i3 + 4i*2 + 330i - 3 What is the p'th term of 549638, 549607, 549576, 549545, 549514, 549483? -31p + 549669 What is the t'th term of -361, -463, -577, -703, -841, -991? -6t*2 - 84t - 271 What is the x'th term of 1575774, 6303058, 14181850, 25212150? 1575754x2 + 22x - 2 What is the k'th term of -383050, -383099, -383178, -383287, -383426, -383595? -15k2 - 4k - 383031 What is the z'th term of -856527, -856056, -855585? 471z - 856998 What is the c'th term of -7789, -6924, -6059, -5194? 865c - 8654 What is the c'th term of -8876, -17745, -26602, -35441, -44256, -53041? c*3 - 8876c - 1 What is the c'th term of 19809, 19073, 17077, 13191, 6785, -2771? -105c3 - c + 19915 What is the d'th term of 502236, 502475, 502714, 502953? 239d + 501997 What is the k'th term of 11461, 91940, 310391, 735802, 1437161, 2483456? 11498k3 - 2k*2 - k - 34 What is the k'th term of -5186, -10207, -15112, -19901? 58k*2 - 5195k - 49 What is the b'th term of -240199932, -480399869, -720599804, -960799737, -1200999668? b*2 - 240199940b + 7 What is the y'th term of -450386, -900777, -1351168, -1801559? -450391y + 5 What is the u'th term of -40861, -39738, -38615, -37492, -36369, -35246? 1123u - 41984 What is the o'th term of -165, -170, 127, 876, 2227, 4330, 7335? 25o3 + o2 - 183o - 8 What is the k'th term of 2533862, 2533852, 2533842, 2533832, 2533822? -10k + 2533872 What is the w'th term of -19, -153, -523, -1243, -2427, -4189, -6643, -9903? -19w*3 - 4w*2 + 11w - 7 What is the o'th term of 182546, 365089, 547632, 730175, 912718, 1095261? 182543o + 3 What is the j'th term of 14204, 28634, 43062, 57488, 71912, 86334, 100754? -j2 + 14433j - 228 What is the x'th term of -2691, -4752, -6185, -6990, -7167, -6716? 314x2 - 3003x - 2 What is the h'th term of 5547, 4951, 4407, 3939, 3571, 3327, 3231, 3307? 4h3 + 2h*2 - 630h + 6171 What is the c'th term of -115913, -231787, -347619, -463409, -579157, -694863, -810527? 21c2 - 115937c + 3 What is the s'th term of 9181, 26055, 42923, 59785, 76641, 93491? -3s2 + 16883s - 7699 What is the a'th term of 261, -32, -725, -2010, -4079, -7124? -32a3 - 8a*2 - 45a + 346 What is the l'th term of 14156, 28112, 42042, 55940, 69800? -l*3 - 7l*2 + 13984l + 180 What is the t'th term of 24837, 25614, 26391? 777t + 24060 What is the k'th term of 803548, 803562, 803586, 803620, 803664, 803718? 5k*2 - k + 803544 What is the k'th term of 58535, 58364, 58083, 57692, 57191, 56580? -55k*2 - 6k + 58596 What is the t'th term of -34860, -35363, -35866, -36369, -36872, -37375? -503t - 34357 What is the v'th term of 17587, 28711, 39831, 50947, 62059? -2v*2 + 11130v + 6459 What is the x'th term of -1679, -12967, -43313, -102245, -199291? -1588x3 - x2 - 169x + 79 What is the r'th term of 847127, 847094, 847061, 847028, 846995? -33r + 847160 What is the o'th term of -16127640, -16127649, -16127658, -16127667, -16127676? -9o - 16127631 What is the m'th term of -2267, -8191, -18065, -31889, -49663, -71387? -1975m2 + m - 293 What is the a'th term of 14184, 31789, 61138, 102237, 155092, 219709, 296094? a3 + 5866a*2 + 8317 What is the v'th term of -28428, -113046, -253856, -450858, -704052, -1013438, -1379016? -28096v*2 - 330v - 2 What is the p'th term of 109145, 109026, 108907, 108788, 108669? -119p + 109264 What is the m'th term of 54038, 52226, 50428, 48650, 46898? m3 + m2 - 1822m + 55858 What is the n'th term of 22002, 22035, 22060, 22071, 22062, 22027? -n*3 + 2n*2 + 34n + 21967 What is the i'th term of -4202, -4225, -4290, -4421, -4642, -4977, -5450, -6085? -4i3 + 3i*2 - 4i - 4197 What is the l'th term of -152619, -305094, -457575, -610062, -762555, -915054, -1067559? -3l2 - 152466l - 150 What is the r'th term of 5432, 6003, 6574, 7145, 7716, 8287? 571r + 4861 What is the t'th term of 106007, 105211, 104415, 103619, 102823? -796t + 106803 What is the b'th term of -53452705, -53452706, -53452707, -53452708? -b - 53452704 What is the o'th term of 197177, 394424, 591697, 789008, 986369? 2o3 + o2 + 197230o - 56 What is the a'th term of -9224627, -9224611, -9224595? 16a - 9224643 What is the a'th term of 1790, 12486, 23182, 33878, 44574, 55270? 10696a - 8906 What is the p'th term of -51366, -102452, -153538, -204624, -255710? -51086p - 280 What is the j'th term of -17237, -34353, -51451, -68525, -85569? j3 + 3j*2 - 17132j - 109 What is the x'th term of 8874, 73264, 248664, 590580, 1154518, 1995984, 3170484, 4733524? 9251x3 - x2 - 364x - 12 What is the r'th term of 2072, 3343, 5528, 8633, 12664, 17627, 23528, 30373? r*3 + 451r*2 - 89r + 1709 What is the x'th term of -17, -746, -2729, -6584, -12929? -103x3 - 9x*2 + 19x + 76 What is the s'th term of -8579, -35206, -79583, -141710? -8875s2 - 2s + 298 What is the r'th term of 4226, 5819, 7412, 9005, 10598, 12191? 1593r + 2633 What is the i'th term of 3337, 13226, 29691, 52744, 82397, 118662, 161551? 2i*3 + 3276i*2 + 47i + 12 What is the v'th term of -1877215, -1877194, -1877151, -1877080, -1876975, -1876830? v*3 + 5v*2 - v - 1877220 What is the b'th term of -6087835, -6087833, -6087831, -6087829, -6087827, -6087825? 2b - 6087837 What is the y'th term of -1452, -6073, -13866, -24837, -38992, -56337, -76878? -y*3 - 1580y*2 + 126y + 3 What is the t'th term of 288870, 288947, 289076, 289257, 289490? 26t2 - t + 288845 What is the c'th term of -510, -454, -408, -408, -490, -690? -6c*3 + 31c*2 + 5c - 540 What is the p'th term of -84198, -336623, -757334, -1346331? -84143p2 + 4p - 59 What is the k'th term of 1116035, 4464034, 10044025, 17856008, 27899983? 1115996k2 + 11k + 28 What is the i'th term of -1	{ "pile_set_name": "DM Mathematics" }
f -j*5/60 + 7j4/24 - j3/6 + 13j2. Calculate l(q). 5 Suppose 0 = -2o + 4o - 4. Suppose ol = 7l - 10. Let h(u) be the third derivative of u5/60 - u4/12 + u3/3 + 376u*2 + 3u. What is h(l)? 2 Let w(p) = p*2 - 6p + 10. Suppose -2c + 30 = 30h - 25h, 30 = 5h - 4c. Determine w(h). 10 Let m(a) = -44a - 2421. Let x be m(-55). Let j(i) = -13i - 10. Give j(x). 3 Let d(h) be the first derivative of 2h*3/3 - 13h*2/2 - 38h + 50. What is d(9)? 7 Let t = -7 - -3. Let r(n) be the second derivative of -n3/2 + n2 - 3153n. What is r(t)? 14 Let q be 19482/(-24) + 3/(-12) + 5. Let j = 799 + q. Let l(i) = -2i*2 - 16i - 4. Calculate l(j). -4 Let d(w) be the first derivative of w*2/2 - 5w + 8. Suppose -4z = -3l - 16 - 22, 0 = 2l - 2z + 24. Let b(i) = 6i + 63. Let j be b(l). What is d(j)? -2 Let s(g) = 17g*3 - 10g*2 - 32g + 2. Let p(u) = 37u3 - 19u*2 - 65u + 1. Let h(n) = -6p(n) + 13s(n). Calculate h(-14). -8 Let g(d) be the second derivative of -4/3d3 + 5d*2 + 0 - 31d + 1/12d4. Let v be g(6). Let i(r) = -4r - 3. Determine i(v). 5 Let t(o) = o*3 - o + 1. Suppose -7x = 2x + 17x. Suppose -71i - m + 8 = -68i, x = -i + 4m + 7. What is t(i)? 25 Let k(a) = a2 - 254a - 6968. Let r be k(-25). Let j(m) = -3m2 + 25m - 12. What is j(r)? 16 Let q = 349/588 + -1/98. Let i(t) be the second derivative of 1/2t2 + 0t*3 + qt*4 - 16t + 0. Calculate i(1). 8 Suppose -18l + 764 + 208 = 0. Suppose -119b - l = -110b. Let a(p) = p3 + 6p*2 - 6p - 7. Calculate a(b). 29 Let v(i) = 3i2 - 11i - 5. Let t be v(6). Suppose -tu = -29u - 8. Let b(g) = -5 - u - g*3 - 9g - 6g2 + 8g. Give b(-6). 0 Let t(z) = 3z2 - 117z - 113. Let k be t(40). Let j(v) = -v*3 + 6v*2 + v + 35. Calculate j(k). -7 Let f(p) = -2p + 2. Let w = -72 - -114. Suppose 2r - w = -2j, r + 3r = 4. Suppose c = -14 + j. Give f(c). -10 Let b(q) = -q2 + 3q - 1. Let a(j) be the second derivative of 3j3/2 + 2j*2 + 13j. Let w be a(-1). Let f be (4/(-3))/(w/15). What is b(f)? -5 Let p(w) = w*2 + 10w + 22. Let g be p(-8). Let y(f) = 9 - 18 + g - 2f. Let n = -23 + 18. Calculate y(n). 7 Let u(d) be the third derivative of d4/8 + 3d*3/2 + 17d*2 - 38. What is u(-6)? -9 Let h = 15065 - 15047. Let x(f) = 2f*2 - 33f - 3. Determine x(h). 51 Let p(g) = -g*2 + 8g + 10. Let n(i) = -i*3 + 13i*2 - 28i - 12. Let f be (-152)/(-8) + (-8 - 1). Let l be n(f). What is p(l)? 10 Let d be 45/(-60) + 94/8. Suppose 30 = -dt + 8. Let z(k) be the third derivative of -k5/15 - k3/6 - k2. Calculate z(t). -17 Let h = 5971 + -5949. Let y(g) be the first derivative of 2g2 + g3 - h - 1/4g4 + g. Calculate y(3). 13 Let i(g) = 16g + 4. Let d be ((-28)/631)/(26/117). Give i(d). -28 Let o be 2/(2 - (-5)/(-2)). Let t be -10(18/(-4) - o). Suppose 3p = -k - 2 + 18, tk + 3p = 20. Let q(s) = s3 - s2 + s - 1. Give q(k). 0 Let w(t) = 24t*3 + 74t*2 - 13t - 110. Let j(r) = -11r3 - 34r*2 + 7r + 55. Let v(s) = 11j(s) + 5w(s). Give v(-4). 7 Let s(p) = -58p2 + 63p + 5. Let y(q) = -151q2 + 158q + 13. Let u(j) = 13s(j) - 5y(j). What is u(-2)? -54 Let u be 115 - (0 - 0 - -6)/2. Let j(q) = 6q*2 - 70q - 22. Determine j(u). 2 Let x(q) be the third derivative of -q5/60 + q4/4 - 2q3/3 + q2 + 6q. Let a be 2 - 4/(-2)2. What is x(a)? -4 Let h(x) be the first derivative of 5/2x*2 + 0x + 22. Calculate h(-3). -15 Let n(y) = 5y + 102. Let x(j) = 2j*2 + 68j + 394. Let t be x(-26). Calculate n(t). -8 Let n = 41 - 37. Suppose -4v + 32 = -4o, -5v - 1 = 4o + n. Suppose 4s - 15 = -t, 0 = 3s - 5t - v - 14. Let x(k) = -k3 + 4k*2 - 3k - 1. Give x(s). -13 Let m(k) = 8k - 2. Let r(o) be the second derivative of 17o*3/6 - 3o*2/2 + 3o - 14. Let c(v) = -13m(v) + 6r(v). What is c(5)? -2 Suppose 3k = -3s - 66 + 252, 5s - k - 304 = 0. Let h = s - 59. Let l(c) = -4c*h + 12c*2 + 247c - 247c. Calculate l(1). 8 Let q(p) = -85655p + 171584p + 2 - 85928p. Suppose -4y - 10 = y + 2j, 20 = -y - 4j. Suppose 0a - a - 6 = y. What is q(a)? -4 Let f(g) be the third derivative of g*5/60 - 5g*4/12 - 61g*3/2 - 4g*2 - 749g. What is f(-9)? -12 Let g(d) = d*2 + d - 4. Suppose -3b - 2c = 1133, -4b + 216 = 4c + 1724. Let j = b + 381. Give g(j). 2 Let h(t) = -t3 - 5t*2 + 2t + 5. Let p be h(-6). Let w(z) = 5z2 - 1 + pz*3 - 5z - 30z3 - 1 - 1. Give w(4). -7 Let q(h) = 34h*3 - 4h*2 - 3h - 1. Suppose 0 = 134r + 64 + 70. What is q(r)? -36 Let l(p) = 101p*2 + 32p + 26. Let m(w) = 63w2 + 21w + 17. Let r(d) = 5l(d) - 8m(d). Determine r(8). -6 Let f(i) = -2i - 36. Let r(t) = 4t + 72. Let y(d) = -5f(d) - 2r(d). Let o be y(-17). Let m(x) = 4 - 12x2 + 4x + 0 + 13xo. What is m(-5)? 9 Let p(t) = -5t + 74. Suppose -8 = -4d + 26 + 22. Calculate p(d). 4 Let g = -8613 - -8602. Let r(a) = -6a + 23. What is r(g)? 89 Suppose 0y - 12 = -4n - 4y, -3 = -n - 4y. Suppose -3j - nh = -21, -2j + 0h = -5h + 7. Let c(t) = t + 3. Give c(j). 7 Let i(q) = q3 - 8q*2 - q + 7. Let o(n) = 10n - 80. Let j be o(6). Let k = -12 - j. What is i(k)? -1 Suppose 5s - 5u + 6u - 813 = 0, -s + 161 = u. Let t = s + -253. Let g = t - -90. Let c(r) = -r3 - r. Give c(g). 0 Let j(z) = z3 - 4z*2 - 25z - 53. Let y be j(8). Let p(o) = 12o - 43. Determine p(y). -7 Let z(y) = 2y*2 + 6y + 2. Suppose -57 = -17x + 113. Suppose 7 - x = f. Calculate z(f). 2 Let n(w) = w2 + 11w - 13. Let i(g) = -g*2 - 10g + 29. Let b(s) = 2i(s) + 3n(s). What is b(-13)? 19 Let f = -95 + 97. Suppose -22 = -fv - 30. Let t(j) be the third derivative of j5/30 + 5j4/24 - j3/6 - j*2. Determine t(v). 11 Suppose 0 = -2116d + 2122d - 378. Suppose -dz + 54z + 18 = 0. Let r(q) be the second derivative of q4/6 + q3/6 + q2/2 - q. Determine r(z). 11 Suppose 3374g - 246 = 3333g. Let h(x) = x + 1. Let m(w) = -2w + 23. Let t(a) = 2h(a) - m(a). What is t(g)? 3 Let t be (-8 + 385/44)/(3/(-16)). Let h(i) = -25i - 91. Give h(t). 9 Suppose 3 - 43 = 4t. Let i = -6 + t. Let v be i/4 - (0 + 0). Let b(h) = h3 + 5h*2 + 4h - 2. Calculate b(v). -2 Suppose 4k - 21 = -4z + 3k, -6 = 2k. Let q(x) = 0x - 12x - 2x2 + x2 + x + z - x. Give q(-11). 17 Let i(j) = j2 + 4j + 4. Let f(x) = -x*3 - 13x*2 - 14x - 22. Let t be f(-12). Let u(a) = -ta + 5a - 315 + 292. Let h be u(6). Give i(h). 9 Let x be 0 - 4 - (0 + (4 - 120/12)). Let a = 69 + -30. Let s(j) = a - 39 + j2 - j. Determine s(x). 2 Let i(w) be the second derivative of w4/6 - 49w3/6 - 75w*2 - 3309w. What is i(-3)? 15 Let w(j) = 56 + 5j - 104 + 32 - 127 - j. Determine w(36). 1 Let g = 27 + -29. Let u(r) = -10r*2 - 4r + 4. Let l(k) = 9k2 + 4k - 3. Let v(w) = 7l(w) + 6u(w). Calculate v(g). 7 Let w(k) = k*3 + 13k*2 + 16k + 2. Let d be w(-2). Let g(c) = -c*2 + 12c - 11. What is g(d)? -39 Let u(b) = b*3 - 5b*2 - 9b - 40. Let w be u(7). Let p = -33 - -35. Let g(j) = 3 - 3j - j3 - 6j*p - j + 2. Calculate g(w). 0 Suppose -k + 1 = 0, -4k = -m - 0m. Let u(i) = 8i2 + i3 - mi + 10i*2 - 35i*2 + 17i*2. Suppose -2q - 2 = -4o, 0 = 3o - q - 5 + 1. Give u(o). 15 Let j(v) = 7v - 10. Let i(b) = -b + 2. Let n(l) = -6l + 13. Let u(w) = 40i(w) - 5n(w). Let m(x) = 7j(x) + 5u(x). Determine m(9). -4 Let w = 10 - 25. Let r be 3/(-5) + (-39)/w. Let o(k) be the second derivative of k*4/12 - 2k3/3 + k2 + 668k - 3. Give o(r). -2 Let n(y) = -222y*2 + 9y + 9. Let f be n(-2). Let c = f + 896. Let j(q) = 22q2 + 2q + 1. What is j(c)? 21 Suppose 0 = 2p + 2s - 10, 3p + 0p + 1 = 5s. Let c(d) = -p - 9 + 0 + 0d + d. Let q be c(5). Let l(k) = -k*2 - 4k + 10. Determine l(q). -11 Let q(h) = -2h2 + 110h + 91. Let g(n) = n*2 - 36n - 32. Let s(l) = 8g(l) + 3q(l). Determine s(-21). 17 Let l(n) = 141. Let f(v) = -v - 196. Let q(r) = 5f(r) + 7l(r). Calculate q(-2). 17 Let n(j) = -5j + 9. Let t(f) = 3f - 4. Let x(l) = 6n(l) + 13t(l). Suppose 10r - 40 - 20 = 0. Let m be r/3 - (-16)/(-4). Calculate x(m). -16 Let j(q) be the third derivative of -q4/24 - 4q*3/3 - 14q*2 - 88. Suppose 0 = -5d + 1 + 14. Suppose c = -0x - dx - 15, 0 = 2x + 4c. What is j(x)? -2 Let x(r) = 3*r	{ "pile_set_name": "DM Mathematics" }
r be (-10)/(-3) - 0 - 3/9. Let o = -1 + r. Find the second derivative of -1100do - 9d*4 + 1100d*2 - 3d wrt d. -108d2 Find the second derivative of -478n*4 + 1080n*4 + 1431n - 485n4 + 1769n*4 wrt n. 22632n*2 Let f(s) be the third derivative of 0s + 282s2 + 35/2s*3 - 11/12s*5 + 0 - 1/12s*4. Differentiate f(l) with respect to l. -110l - 2 Let k(i) be the first derivative of -1259i3/3 + 1841i - 6340. What is the first derivative of k(g) wrt g? -2518g Let m(s) be the first derivative of s6/8 + 50s3/3 - s2 - 11s + 6. Let i(d) be the second derivative of m(d). What is the first derivative of i(c) wrt c? 45c2 Let l(s) be the third derivative of s7/70 + 1081s6/120 - 11s*5/20 - 167s*3/6 + 2638s*2 + s. Find the third derivative of l(t) wrt t. 72t + 6486 Let j(v) = v*2 - 6v + 2. Suppose -4i = -3i - 6. Let u be j(i). Find the second derivative of -up4 + 6p*4 + 3p*4 + 8p wrt p. 84p2 Let n(r) be the second derivative of 664r6/15 - r3/3 - 67r2 - 284r. Find the second derivative of n(k) wrt k. 15936k2 Let x(p) be the third derivative of 73p7/5040 - p6/15 + 31p5/60 + 62p*2. Let v(z) be the third derivative of x(z). Differentiate v(b) wrt b. 73 Let i(w) = 7w*3 - 85w + 3. Let u = -84 - -87. Let d(l) = -l4 + l3 + 1. Let o(x) = ud(x) - i(x). Find the second derivative of o(b) wrt b. -36b*2 - 24b Let q(u) be the first derivative of 4561u7/7 - 59u*3/3 - 2u - 2788. Find the third derivative of q(p) wrt p. 547320p3 Let x(u) be the third derivative of 10u - 193/24u4 + 0u*3 + 0u*5 + 0 + 101/120u*6 - 1/210u*7 + 10u*2. What is the second derivative of x(d) wrt d? -12d*2 + 606d Let b(d) be the first derivative of 63d5/20 + 34d*2 + 24d + 26. Let s(j) be the first derivative of b(j). What is the first derivative of s(g) wrt g? 189g2 Find the third derivative of 47077919 - 3932i*3 + 3462i*2 - 47077919 wrt i. -23592 Let a(d) = 10d*2 - 2d + 1. Let t be a(-2). Find the first derivative of -t + 74n - 5 - 8 - 5 wrt n. 74 Let r(l) be the first derivative of -168/5l*5 + 0l*3 - 135l + 174 + 0l2 + 0l*4. Find the first derivative of r(u) wrt u. -672u*3 Let g(c) = 5526c*2 + 4871c + 2. Let f(k) = -5519k2 - 4867k - 2. Let a(x) = 3f(x) + 2g(x). Find the second derivative of a(s) wrt s. -11010 Let y(q) be the first derivative of 5 + 128/3q3 + 0q + 0q2 - 97/4q4. Find the third derivative of y(l) wrt l. -582 Let x(n) be the second derivative of -n6/10 - 319n5/20 - 283n4/12 - n3/6 - 23n + 1. What is the third derivative of x(h) wrt h? -72h - 1914 Let y(s) be the second derivative of -211s7/14 - 709s*4/12 - 812s. Find the third derivative of y(t) wrt t. -37980t2 Let p(x) = 24x*3 - 15x - 45. Let v(u) = u*3 - 2u + 1. Let m(q) = 2p(q) - 14v(q). What is the derivative of m(b) wrt b? 102b2 - 2 Let k(w) be the first derivative of -1799w*6/6 + 2w*3/3 - 525w*2 - 703. Find the second derivative of k(j) wrt j. -35980j*3 + 4 Suppose 29 - 3 = 2s. What is the second derivative of -2l4 + 4 - 2 + sl - 15l + 5l4 - l3 wrt l? 36l2 - 6l Let c(d) be the first derivative of -77/4d4 + 65 - 1/2d*2 + 97d + 0d3. Find the second derivative of c(r) wrt r. -462r Let l(c) = 11c - 63. Let b be l(6). What is the second derivative of -bk - 15k - 6k*2 + 4k - 26k - 2 wrt k? -12 Let a(s) be the first derivative of 31/5s*5 + 0s*2 + 72 + 1/4s*4 + 0s - 158/3s3. Find the third derivative of a(d) wrt d. 744d + 6 Let u(p) = 3p2 - 3p - 7 + 1496p3 - 1523p3 - 20. Let s(t) = t3 - 2t2 + t + 1. Let j(o) = 2s(o) + u(o). Find the second derivative of j(i) wrt i. -150i - 2 Let m(h) be the first derivative of 4568h*3/3 - 769h - 4239. Differentiate m(z) wrt z. 9136z Let x(p) be the second derivative of 69p5/10 + p4/3 - 1013p3/6 - 475p. Find the second derivative of x(k) wrt k. 828k + 8 Let y(l) = 2l*2 - 17l. Let z(c) = 1102c2 + 2888c. Let r(b) = -6y(b) - z(b). What is the second derivative of r(u) wrt u? -2228 Let n(u) = 340u*2 - 2827u + 6. Let l(g) = 681g2 - 5658g + 10. Let b(j) = 3l(j) - 5n(j). Find the second derivative of b(m) wrt m. 686 Suppose -10y = 977 - 2777. Find the first derivative of -56i*2 + 5 + 0 + 9 + yi*2 wrt i. 248i Let r = 218 - 217. Let j(d) = d*5 - 2d*2 + 1. Let k(w) = 22w*5 - 3w*3 - 45w*2 - 3. Let b(q) = rk(q) + 3j(q). Find the third derivative of b(h) wrt h. 1500h*2 - 18 Suppose -2z - 40 = 2n + 74, 111 = -2n + z. Let p be (-192)/n + (-3)/7. What is the third derivative of -8v6 + 11v*6 + pv*2 + 2v*2 - 14v*6 wrt v? -1320v*3 Differentiate 11459 - 4457 - 5788 - 427q*3 wrt q. -1281q*2 Let z be (-91)/(-7) - (-12)/(-2). Find the second derivative of -zl*5 + 4l*3 + 24l - 2 + 23l - 49l wrt l. -140l3 + 24l Let y(s) be the third derivative of 0s3 + 0 + 11s*2 + 1/30s*5 - 1/35s*7 + 0s*6 - 1/3s*4 + 3s. Find the third derivative of y(q) wrt q. -144q Let a(d) = -212 - 228d*3 - 73 - 34d*3 - 27. Let y(r) = 260r*3 + 314. Let l(s) = -5a(s) - 6y(s). Find the first derivative of l(u) wrt u. -750u*2 Find the third derivative of -162d*4 + 29d*4 - 1871d*2 + 199d2 + d5 + d*5 - 152d*4 wrt d. 120d*2 - 6840d Let h(i) be the second derivative of -57i4/2 + 305i*3/3 - 20i. What is the second derivative of h(a) wrt a? -684 Let g = 395 - 289. Find the third derivative of 2 - 13o2 - 68o*3 - go*3 + 7o*2 - 65o*3 wrt o. -1434 Let f(b) = -733b*4 - 6b*3 + 6b + 185. Let s(d) = -1466d4 - 11d*3 + 11d + 370. Let u(t) = 11f(t) - 6s(t). Differentiate u(c) with respect to c. 2932c3 Find the third derivative of 1024y*2 - 60y*4 - 1208y*2 - 79y*3 - 2401y*2 + 43y*4 wrt y. -408y - 474 Suppose 4c + 2c - 18 = 0. Suppose cj = 2j - 0j. Find the third derivative of 15p*2 + jp4 - p4 + p*4 + 19p*6 wrt p. 2280p*3 Find the first derivative of 17h + 108 - 59h - 1398h*4 + 28 + 42h wrt h. -5592h3 What is the derivative of -983p*3 - 158 - 46 + 36 - 1181p*3 - 164 wrt p? -6492p*2 Let x(j) = -15j*3 - 4j*2 - 12j + 29. Let g(s) = s*3 - 2s - 2. Let q(b) = 3g(b) - x(b). What is the second derivative of q(d) wrt d? 108d + 8 Let o(u) be the third derivative of 221u7/42 - 103u*3 - 346u*2. Differentiate o(r) with respect to r. 4420r*3 Let o(a) be the first derivative of 42a - 63 - 49/2a2. Differentiate o(s) with respect to s. -49 Suppose 0 = 43s + 146 + 26. Let b(d) = -23d + 126. Let f(t) = -t2 - 24t + 125. Let g(r) = sb(r) + 3f(r). Find the first derivative of g(z) wrt z. -6z + 20 What is the third derivative of 3x*6 - 4x*6 + 161x + 2x5 + 2x*2 - 131x - 164x4 - 2x*5 wrt x? -120x*3 - 3936x Let g(p) be the second derivative of -38p7/3 - 3p4 - p3/6 + 14p - 22. Find the third derivative of g(k) wrt k. -31920k*2 Find the first derivative of 259 + 330 + 38s - 941s3 + 947s*3 wrt s. 18s*2 + 38 Let q be 2(-2)/6-24. What is the derivative of q + 25 + w2 - 6w*2 + 55w*2 wrt w? 100w Let f = 45 - 43. Suppose fb = 4y - 18, 7 = 2y + 5b + 28. What is the third derivative of -2p4 + 30p*2 + 13p*y + 40p*6 + 2p*4 wrt p? 4800p*3 Let o(d) be the first derivative of 1028d7/7 + d6/6 - 95d3/3 + 2d*2 - 3579. What is the third derivative of o(g) wrt g? 123360g*3 + 60g*2 What is the third derivative of -549l*3 + 117 + 420 - 1517l + 755l + 765l + 2l2 - 4503l*3 wrt l? -30312 Let u(q) be the first derivative of 86q*4 + 10q3/3 - q2/2 + 4237q - 9964. Find the second derivative of u(n) wrt n. 2064n + 20 Let j(y) = -66y2 + 20y + 343. Let m(z) = 32z2 - 10z - 171. Let i(v) = 4j(v) + 9m(v). What is the first derivative of i(r) wrt r? 48r - 10 Let y(v) be the first derivative of -322v*3 + 831v*2 + 1139. Find the second derivative of y(x) wrt x. -1932 Let w = -24452 + 24452. Let u(x) be the third derivative of w + 4x*3 - 1/12x*6 + 0x + 0x4 + 0x*5 - 23x*2. What is the derivative of u(h) wrt h? -30h*2 Let x(l) = -24l*3 - 23l - 18. Let n(p) be the second derivative of p*2 - 54p. Let b(g) = -18n(g) - 2x	{ "pile_set_name": "DM Mathematics" }
v (c) -0.1 b Let d = -23755 - -23756. What is the closest to d in -244, -1/3, -4, 2? 2 Let b = 1.74 + 5.16. Let g = b - 6.5. Let d be ((-13 - -7) + 6)/(-1 + 0). What is the nearest to 0.1 in -3, d, g? d Let n = -2.8 + 3. Let m = 20.12 - 233.32. Let x = 215.2 + m. What is the closest to n in 0.4, x, -1/3? 0.4 Let l = 94.1102 + -0.2102. Let o = -94 + l. Let k = 0.09 + 0.01. Which is the closest to o? (a) -0.2 (b) -1 (c) k a Let h = -35 + 59.5. Let w = -25 + h. Let i = -31 + 34. Which is the nearest to 7? (a) i (b) w (c) 1 a Suppose -24o = -138o + 71o + 43. What is the nearest to o in 6, 3/4, -11? 3/4 Let y = 58 - 58. Let r = -1032 - -1033. Let u = -2/331 + -508/25487. Which is the nearest to u? (a) -0.5 (b) y (c) r b Let n be -6 + 0 + 6732/1089. What is the nearest to -263 in n, -2, 2/7, 0.4? -2 Suppose 5o - 33 + 28 = -5i, -2i - 4o + 4 = 0. Which is the closest to 2? (a) -0.13 (b) -2 (c) i (d) -2/5 c Let v(d) = d3 - 10d*2 + 6d + 28. Let w be v(9). Let t = 549 + -579. Which is the nearest to 1? (a) t (b) w (c) 0.4 b Let r be 38/(-18) - 88/33. Let h = -17/56 + 1231/4424. Which is the nearest to h? (a) 0.5 (b) r (c) -2 a Let w = -0.8932 - 2.1068. What is the closest to -1 in 191, w, 2/7, -0.1? -0.1 Let v = -258 - -433. Let g = v - 171. Suppose 0 = 3s - s + 6. What is the nearest to -1 in g, s, 1/2? 1/2 Suppose 2g + 7t - 6t = -10, 5g - 3t + 25 = 0. Which is the nearest to 0.1? (a) g (b) 3 (c) -1 c Let f = -0.0468 + -0.2532. What is the nearest to 1 in -2, f, -3.19? f Let u = -187744/13 + 14442. What is the closest to -3 in u, 1.2, -16? u Let m be (-12)/(-64)-4 - -7(-4)/16. Which is the closest to 1/87? (a) -0.5 (b) 1/5 (c) 2 (d) m b Let a(x) = -x3 + 18x*2 - 19x + 40. Let h be a(17). Let l be (2/h)/((-20)/45). What is the closest to 1 in 0, 5, l? 0 Let j = 0.0807 - -0.0193. What is the nearest to j in -0.05, -0.4, 0.2, -2? 0.2 Let n = 20892 + -20893.9. Which is the nearest to 6? (a) -1 (b) -25 (c) n a Let k = -2.1453 + 2.4453. Which is the closest to k? (a) -1/80 (b) 4 (c) -1/4 a Suppose 0 = 5i - 14i - 522. Let t = 63 + i. What is the nearest to 0.1 in 1/8, t, -1? 1/8 Let y = 7425 + -7424.1. What is the nearest to -1/4 in y, 2/11, -2? 2/11 Let w = -0.593 - 278.407. Let x = -282 - w. Which is the closest to 1? (a) -0.1 (b) -4/5 (c) x a Suppose -6i + 10 = 22. Let w be ((-2 - i) + 2)-7. Let j be w/3 - (-1 - 3). What is the nearest to j in -1, 2, 0? -1 Let d = 0 + 0.4. Suppose -1956h = -1886h - 2730. What is the closest to -1/2 in 5, d, h? d Let b = 0.05495 + -0.05495. What is the closest to b in 5, -4, -9, 0? 0 Let f = -1.09729 - -0.09729. Which is the nearest to f? (a) -2 (b) 5 (c) 0.4 (d) 1 a Let q = 17.8 - 17.6. Let z = -226 - -226.1. Which is the nearest to q? (a) -2 (b) z (c) 2 (d) -5/2 b Suppose -3 = 3i - 6i. Let y = -122.14 - -118. Let p = y - -4.14. Which is the closest to 0.4? (a) p (b) i (c) -1 a Let m = 233 + -234. Let x be (-7)/(-21)m27/6. What is the closest to -3 in x, -0.2, -5, 2? x Let o be (-126)/8156/117. Let q be (-5 - -1) + 6 + o/3. Let k = 0.2 - 0.3. Which is the closest to -6? (a) k (b) 0.1 (c) q c Let g = 453 - 452.8. Which is the closest to -0.1? (a) g (b) 4 (c) -0.025 c Suppose 0 = 4u - 2z + 58, 3z - 4 = -3u - 7. Which is the closest to 0.1? (a) u (b) 1/15 (c) -0.01 (d) -5 b Let f(n) = -8n + 20. Let w be f(2). Let k = w + -32/7. Which is the closest to 0? (a) 0.5 (b) k (c) 2/3 a Let w = 3680/11039 + -1/33117. What is the closest to 6 in w, 6, 25? 6 Let u = 5843.5 - 5844. Which is the closest to 7/2? (a) 3 (b) u (c) 0.5 a Let b = 129/56 - 757/280. What is the closest to b in 14, -0.2, -0.4? -0.4 Let v = -2/283 + -1122/1415. Let t = 1.1 + -6.1. Let r be 45/(-6)(560/(-42))/20. What is the nearest to -4 in r, v, t? t Let n = 243 + -254. Which is the closest to -1/3? (a) 0.1 (b) n (c) -4 (d) -2 a Let w = -94.3 + 94.2382. Let l = w - -0.0518. What is the nearest to 0.2 in l, -5, -1/4? l Let j = 4193 - 4193.3. Which is the nearest to 4/25? (a) -3 (b) -4 (c) j c Let g(o) = 2o - 10. Let z be g(10). Let k(l) = 11l + 40. Let n be k(-4). Which is the nearest to 1/2? (a) -0.2 (b) z (c) n a Let g = -895/91 + 126/13. Which is the nearest to -3? (a) g (b) 4 (c) -0.06 (d) 3 a Let g = -252 + -75. Let u = g + 332. Which is the closest to 1/2? (a) 0.4 (b) u (c) -0.5 (d) -1 a Let i = 392.907 + -393.907. Let h = 3 - 2.5. What is the closest to 2/5 in h, 0.1, -0.1, i? h Let z = 98.95 + -98.35. Which is the nearest to 2? (a) -2/11 (b) -2/7 (c) z c Let s be 68/20 - (-12)/20. Suppose 0 = -sh - 143 + 207. Let n be -1-4(-4)/h. What is the nearest to n in 0, -12, 0.2? 0 Let g(v) = v*3 - 19v*2 + 38v - 58. Let s be g(17). Let x be 10/(-28)(-18)/225s. What is the closest to -2 in 0, 2/23, 0.1, x? 0 Let k be 163/42 + 80/96. Let o = k - 5. Let v be (((-12)/(-9))/2)/(-3). Which is the nearest to 3? (a) o (b) v (c) 0.3 c Let u = 172 - 67. Let k = 105 - u. Which is the closest to k? (a) -0.5 (b) -4 (c) 1 a Let c = 463.3 + -450.9. What is the nearest to 3/2 in c, 3, -1, -5? 3 Let r(w) = w*3 + 10w*2 + 6w - 16. Let h be r(-9). Let d = -0.342 - -0.842. Which is the nearest to h? (a) -4 (b) d (c) 0 b Let z = 187/5 + -37. Let l = -20 + 19. Let r be (2 - 1)2/l-1. What is the closest to z in r, 5, -3/5? -3/5 Let y = -3/16 + 7/16. Let m = -1227/1604 + 6/401. What is the closest to y in -1/3, -37, -0.3, m? -0.3 Suppose 6u = 102 + 36. Let n = u - 21. Suppose -4x + 8 = -w, 3x = 4w - nw + 11. Which is the closest to 3? (a) w (b) 5 (c) 0.3 b Let y = 4 - 1. Suppose -p + 14 = 8g - yg, -3p + 3 = 2g. Let o = -843011/5 + 168602. Which is the closest to p? (a) o (b) 0.3 (c) -2/37 a Let o = -14975 - -14974.92. What is the nearest to 231 in o, 4, 5? 5 Let w = -10520 + 10521. Which is the closest to 2/5? (a) -4 (b) 1/3 (c) 28/9 (d) w b Let m = 0.319 + -183.319. Let t = m - -182.8. Which is the closest to 2? (a) 5 (b) t (c) 10 b Let i = 6989 - 6990. What is the closest to -1/3 in i, -5, -1/3, -67? -1/3 Let q be (32/360)/((-14)/(-21)). What is the closest to -0.8 in q, -4, 4, -0.3? -0.3 Suppose 21k = 8k. Suppose k = -3g - 5 + 2, 5o - 3g - 23 = 0. What is the nearest to -0.6 in o, 3, -9? 3 Let i = -0.06 - -0.26. Let y be 12/16(-4)/(-12). Let z = 5 + -29/6. What is the nearest to y in i, 0, z? i Let z(j) = -j3 - 2j*2 + 21j + 7. Let f be z(0). Which is the closest to f? (a) 3/4 (b) -1 (c) -26 (d) 5 d Let z = 0.5 - -4.5. Let t = 701.9743 - 702. Let a = -0.1743 + t. What is the closest to -1 in a, 0, z? a Let o = 1951 + -1952.1. Suppose 3t = 2m - m + 11, 2m + 5t = 22. What is the nearest to m in -0.5, -2/5, o, 5? -2/5 Suppose 29z + 1914 = 7z. Let i be ((-10)/(-18))/((-145)/z). Which is the closest to -3/5? (a) -1/7 (b) i (c) -4/7 c Let y = 127.05 + -127.13. Let w = 0 - 0. What is the closest to w in 3, y, -5? y Let x = -0.0649 + -0.3351. What is the closest to 14.7 in x, 2/7, 4, 3? 4 Let m = 242.61 + -269.61. What is the closest to -4 in -1, -0.01, -4, m? -4 Let p be (-14)/(-161) - 20/230. Let w = 695.9 - 696. What is the closest to w in -2, -0.3, p, 1/3? p Let s = 3144 + -3141. Which is the nearest to -0.2? (a) -2 (b) s (c) 1/27 c Let p = -243.639 - -0.639. Let b = 242 + p. What is the closest to b in 0.8, 1, 4? 0.8 Let j = 16 + -17. Suppose -b = 0, -4q + 4b + 1 = -7. Suppose qu + 4p - 12 = 0, -4p + 3 = -u - 3. What is the closest to j in -2, 1, u? -2 Let q = 66 + -67. Let p(r) = r3 + 10r + 1. Let j be p(0). What is the nearest to 1/8 in -5, -2/19, q, j? -2/19 Let h = 477 - 270. Let z = 207.2 - h. Which is the closest to -1? (a) -3 (b) -0.5 (c) z b Let j = 115.166 - 115. Let k = j - 0.366. What is the nearest to k in 0.01, 4, -0.4? -0.4 Let x = -420 + 424. Let d = -41 - -39. Let o = -1 + 0. What is the nearest to o in x, d, -5? d Let p be (4/40)/(2/(-4)). Let w = 178412.5 - 178412. What is the closest to 0.1 in 2, w, p, 3? p Let s = -1.06 - -0.06. Which is the closest to -4/5? (a) 1/5 (b) s (c) 0.053 (d) 2/11 b Let n = -22102/3 + 7368. What is the nearest to n in -4, -3, -17, 2/5? 2/5 Let w = 18.677 - 23.677. What is the closest to 0.1 in 4/3, -1/16, w? -1/16 Let o be 10/(-38	{ "pile_set_name": "DM Mathematics" }
1/93 Let m = -4252.8 + 4253. What is the nearest to 4 in -84, 0.3, 0, m? 0.3 Let r be 2/1 - (-26)/(-10). Let x = 246.7 + -246.72. What is the nearest to x in r, -3/4, 3/5? r Let x = -45121/77 + 586. Let u = -34/77 + x. Let z = u + 45/56. What is the closest to 0 in z, 3/4, -5? z Let r be 154/(-49) - (-6 + (-3)/(-1)). Let d = 9/35 - r. Let w = -4 - -6. Which is the closest to d? (a) 2/21 (b) w (c) -1/6 a Let n be (2244/(-16))/(-17) + -8. Let i be (2650/135)/(1/6). Let h = 118 - i. What is the nearest to h in n, -5/2, -1? n Let j(r) = -r*3 + 13r*2 + 18r - 18. Let h be j(14). Suppose 3n = 8 - h. Let p be (-2)/n + 8(-3)/45. Which is the closest to -7? (a) 4 (b) -2 (c) p b Let j be 7/(-1 + (-9)/(-6)). Let t = 0.24 - 0.74. Let u = 693 + -693. What is the nearest to u in 1/5, t, j? 1/5 Let t be (26 - 412/16) + 34/(-72). What is the closest to 0 in -4, 21, -16, t? t Let g = -2.148 - -2.648. Which is the closest to 1/8? (a) 3 (b) -253 (c) g c Suppose -5i = -r + 15, -2i - i - 3r - 9 = 0. Let t be (0 - i/(-2))154/(-231). Which is the nearest to -145? (a) t (b) -1 (c) 0.3 b Let n = 4.457 - 4.657. Let d = -10 + 10. Which is the nearest to n? (a) 0.3 (b) 0.8 (c) d c Let m = 757/3861 - 5/351. What is the nearest to -2 in -2.5, 0, m, -2/5? -2.5 Let x = -0.9945 + 1.4945. What is the nearest to 2 in -0.5, 5, x, 0.4? x Let x = 0.4 + -0.4. Let d = 1 - x. Let t(y) = -y*3 + 6y*2 + 2y - 39. Let q be t(4). What is the closest to d in 0.3, q, 3? q Let u = 2439/13 - 187. Let o = -2/39 - u. Suppose 0 = 298y - 332y + 68. What is the closest to o in 0.1, 3/2, y? 0.1 Suppose -102m + 199m - 88 - 106 = 0. Which is the nearest to m? (a) 25/2 (b) 4/7 (c) 9/4 c Let g = 1324/385 + -114/35. Which is the nearest to -49? (a) g (b) -1 (c) -0.4 (d) -0.5 b Let u = -23.31 + 23.51. What is the nearest to 2/253 in 2, u, 2/7? u Let w = -1.3 - 0.7. Let j = 2.3 + w. Let s = 273 + -269. Which is the closest to s? (a) j (b) 1/10 (c) -5 a Let x be 6 - (-20)/8(-104)/50. Let z = 3.8 + -4. Which is the nearest to -1? (a) z (b) 4 (c) x a Let s = 0.051 - -0.949. Suppose -257i = -260i. What is the closest to 0 in i, 2/3, -5, s? i Suppose 4f = -0f. Let p = -40.76 + 42.76. Which is the nearest to 2? (a) 0.2 (b) p (c) f b Suppose -3 = 3u - 30. Let s(q) = -q*3 + 8q*2 + 7q + 21. Let z be s(u). Suppose zd = -d + 8. What is the closest to d in 13, -3, -0.5? -0.5 Let w = -4.89 - 0.11. Let j = -117 - -305. Let t = j + -751/4. Which is the nearest to t? (a) -0.3 (b) -0.4 (c) w a Let r = 1564.4 + -1563.4. What is the nearest to -409 in 1/11, -0.5, r, 0.1? -0.5 Let r = -1291 + 1855. Let m = 564.4 - r. Which is the closest to -4/7? (a) -0.5 (b) 2/23 (c) -2 (d) m a Let k = 0.227 + -0.427. Which is the nearest to -1? (a) 1/5 (b) k (c) 15 (d) 5 b Let j = 8 + -8.1. Let z be (-2)/11(5 + -6). Let v be (-4 + -3 - -6)6. What is the closest to v in -2/19, z, j? -2/19 Let p = 1637 - 1636.5. What is the nearest to 4 in -11, -2, 0.2, p? p Let g be 73/(-18)8/(-14). Let z = -2598/13 + 200. What is the nearest to -2 in g, -0.01, z? -0.01 Let w = -0.25 + -0.05. Let v = -0.1 + w. Let l = -120935 + 120938. What is the nearest to 0.2 in l, 4, v? v Let i = -3.86 - -4.36. What is the nearest to i in -1/9, 7, 4, -1? -1/9 Let q = -18/1139 + 3507/5695. What is the nearest to 0.1 in q, 3, -0.05? -0.05 Let v = 32.6 - 32.5. Which is the closest to 0? (a) -1 (b) v (c) -3/4 (d) 6 b Suppose -170 = 2k + 118. Let q = k + 155. Which is the closest to -1/2? (a) q (b) 2/5 (c) 0.1 c Let s = 12714 + -12713. Let f = -9/32 + 141/160. Which is the nearest to 7/5? (a) -2 (b) s (c) f b Let j = -2.948 + -0.052. Let a be ((-24)/(-80))/((-30)/(-25)). What is the nearest to 1 in j, a, 2/21? a Let k = -20.3 + 21.3. Let i = 10.5 + -9.2. What is the closest to k in i, 3, -3/7? i Let t(d) = d3 - d2 - 2d + 1. Let f be t(0). Let j = 0.19 + -1.79. Let a = j - -1.4. What is the closest to -2/3 in 0.2, f, a? a Let v be 64/(-160) + 2/(-5) - (-484)/330. Which is the closest to v? (a) -6/5 (b) -0.4 (c) 0.3 (d) -19 c Let t = -0.07 + 1.07. Let s(n) = 4n - 72. Let u be s(22). Let m be 0 - 86/u - -5. Which is the closest to t? (a) -4 (b) -2/11 (c) m b Let x be 4 - 0 - (14 + -14). Suppose -d - 2i + 5i + x = 0, 4 = d + 2i. Suppose -7f + d = 11. Which is the closest to -1? (a) 1.6 (b) -2 (c) f c Let m be 2/9 - (-92)/72. Let p = 19.012 + -19.612. What is the closest to 0 in 1, m, p? p Let f = -0.124 + -40.876. Let r = 41.4 + f. Let h = 3.1 - 0.1. Which is the nearest to -1.5? (a) h (b) r (c) 0.2 c Let h = 6.442 + -3.442. Which is the nearest to -0.15? (a) h (b) 0 (c) 5 (d) 11 b Let l = -94 - -94. Let x = -0.567 - -0.967. Let r be 4/(-14) + 26/42. Which is the closest to r? (a) -4 (b) x (c) l b Let h = -1.302 - -71.002. Let s = h - 70. Let q = 1 + -3. Which is the nearest to 2? (a) q (b) s (c) -0.1 c Let q = -62 - 46. Let t = -110 - q. What is the nearest to t in -7, -2, -0.2, -3? -2 Let f be 1/3 - (-376)/141. Let g = 55 + -51. Let x be (-2)/(-4) - (-21)/(-6). Which is the closest to x? (a) -3 (b) g (c) f a Let h = -14 - -12. Let u = 89 + -89. Suppose 4j - 2 - 4 = 2f, u = -2j. Which is the closest to -1? (a) h (b) f (c) -0.03 c Let q = 1/6399 - -3641024/44793. Let s be -5 - 228/((-3)/(-1)). Let f = q + s. Which is the closest to -2/7? (a) -2 (b) f (c) -2/5 c Let w = -23 - -38. Let p be (-27)/w + 2 + 0. Let i = 99.8 + -100. Which is the nearest to p? (a) i (b) 4/5 (c) 0 c Let f be 3 + 2185/(-627) - (-6)/(-33). What is the closest to f in 337, 2/7, 3? 2/7 Let d = 0.044 + -3.044. Let s = d - 45. Let q = s - -44. Which is the closest to 0.3? (a) 0 (b) -0.2 (c) q a Suppose 11g = 2010 + 4975. Let t = g - 631. Which is the nearest to -2? (a) 0 (b) -2/11 (c) t (d) 17 b Let v = 309542 + -309542. Let w = 4.04 + -0.04. Suppose 8 = 4f + 5l, 5l = l + 16. What is the closest to w in -1, v, f? v Let y be (12/14)/(75/35). Which is the closest to y? (a) -1/4 (b) 1/9 (c) -15/2 b Let h = -10135/1743 + 36/83. Let n = h + 17/3. Let i = -4 + 4.2. Which is the nearest to n? (a) 0.5 (b) i (c) -0.1 b Let w be 24/(-63)(-81)/(-108). What is the nearest to -3 in 2/3, -8/5, w? -8/5 Let s be 4/(-6) - 140/(-30). Let j = -2.59 - -3.29. Which is the closest to 2? (a) s (b) -0.5 (c) j c Suppose -4k + 19 = q, k = -3q + 19 - 6. Let l be (5 - (-26)/(-6))60/(-160). What is the nearest to 0 in l, 0.3, q? l Suppose -1824h = -1831h - 161. What is the nearest to 0 in -3, 0.3, h? 0.3 Let p = 0.12 - 0.22. Let t be -5614/(-224) + -5. What is the nearest to -0.1 in p, t, 0.5? p Let q be (-7)/20 - (-7)/(-28). Which is the nearest to q? (a) -2 (b) -920 (c) -2/9 c Let h = 1300 - 1299. Let j be (-2)/(-8)8/17. Which is the nearest to h? (a) j (b) 0.3 (c) -4/3 b Suppose -7w = 11w - 18. Let g be ((-2)/(-133))/(5/((-105)/9)). Which is the nearest to 1? (a) -0.1 (b) w (c) g b Let g(h) = 2h*3 - 25h*2 + 6h + 74. Let l be g(12). What is the closest to l in -2/9, 2, 1/8, 5? 2 Let x = -7/20 - -1/10. Let f = 5506.2 - 5506. Which is the closest to 1? (a) f (b) x (c) 2/23 a Let y be 212/44 + 6/33 + (-342)/63. What is the nearest to 5/2 in 6/7, y, -1, -4? 6/7 Suppose w + 43 = 3k - 4w, 3k - 4w = 44. Suppose -2x - 12 = x + 2c, 4x = -4c - k. Let m = -20.684 - -24.684. What is the closest to -0.1 in x, 1/6, m? 1/6 Let i = -144 - -244. Let y = 2215.3 + -2215. What is the closest to 0.1 in 0, i, y? 0 Let x be -2 + (-1)/((-3)/(-2)). Let o = 49352 + -49351.8. Which is the nearest to -5? (a) o (b) x (c) -0.1 b Let f = 0.9111 - -0.0889. Which is the nearest to -0.1? (a) -0.2 (b) 6 (c) 2/81 (d) f a Suppose -4w - 30 = -5h, 0 = 71w - 70w + 5. Which is the nearest to h? (a) 4 (b) -4 (c) 1/13 c Let u be 8/63/18. Let d = 2 - 0. Let y = -9188.6 - -9188. What is the closest to -1 in y, d, u? y Let j = 26 - 16. Suppose -27 = -jr + 23. Which is the closest to 0? (a) -4 (b) r (c) -0.1 c Let i(v) = v*3 - 29v + 138. Let p be i(-7). Which is the nearest to -85/6? (a) 3 (b) p (c) -29 b Let i = -471 - -57. Let b = i - -415. What is the closest to b in -4, -0.3, 0.4? 0.4 Let n be (-102)/(-25) - 220/2750. Which is the closest to 9/101? (a) n (b) -1 (c	{ "pile_set_name": "DM Mathematics" }
+ 7193 Simplify ((sqrt(98)-1-5)/sqrt(2))/((-1sqrt(567) + sqrt(567) - sqrt(567))6 + sqrt(567) - sqrt(567)). -5sqrt(7)/54 Simplify (-4(sqrt(200) - (sqrt(200) + (-1 + sqrt(200) - sqrt(200)))) + 4)*2 + sqrt(200)-2-4 + sqrt(200) + -1 + -5. -6 + 90sqrt(2) Simplify (-1sqrt(130)/((-1sqrt(90) - sqrt(90))/sqrt(9)))*2-5. -65/4 Simplify 3 + (sqrt(4032)-3)/sqrt(9) + sqrt(49)/(6sqrt(252)). -863sqrt(7)/36 + 3 Simplify ((-1 + 0 + sqrt(208) - sqrt(208) - sqrt(208))-3)*2 - ((sqrt(208)1 - sqrt(208))*2 + 2 + 2). 72sqrt(13) + 1877 Simplify (sqrt(260)/(sqrt(5) - sqrt(80) - sqrt(5)) - -2sqrt(4212))/(sqrt(196) + ((sqrt(196) + sqrt(196)1 + sqrt(196))-6 - sqrt(196)) - sqrt(196)). -71sqrt(13)/532 Simplify (-6sqrt(300)/sqrt(10))/(sqrt(1000) + (sqrt(1000) + sqrt(1000)2 + sqrt(1000) - sqrt(1000)) + sqrt(1000) - sqrt(1000)). -3sqrt(3)/20 Simplify (4 + sqrt(192) + -1 + 4 - 1((sqrt(192) - (-4 + sqrt(192)1)) + sqrt(192)))2. 9 Simplify ((sqrt(405)2 - sqrt(405)) + sqrt(45) + sqrt(45)-21)/(4(4sqrt(81) + sqrt(81) + sqrt(81) - sqrt(81))). sqrt(5)/30 Simplify (-5 + (0 + sqrt(2448) - -6(sqrt(17) - sqrt(153))))-2 + 3. 13 Simplify (3(sqrt(65) + (sqrt(65) - -4sqrt(65)-2 - sqrt(65))))/(-1sqrt(20)4). 21sqrt(13)/8 Simplify (5((sqrt(1584) - (sqrt(1584)-3 - sqrt(1584))) + sqrt(11) + 4 + 2sqrt(176)-2))*2. 9000sqrt(11) + 557275 Simplify (((-1sqrt(605) - sqrt(605)) + sqrt(605) + 1)2 - sqrt(605) - ((sqrt(605)1 - sqrt(605)) + sqrt(605))*25) + ((sqrt(605) - -6sqrt(605)2) + 0)*2. -33sqrt(5) + 99826 Simplify (sqrt(2268) - (sqrt(2268) - (-1 + sqrt(2268)))6 - (sqrt(2268) - (-1 + sqrt(2268))-2))*23. 864sqrt(7) + 27264 Simplify 41(sqrt(49)/sqrt(7) + 3)-65. -360 - 120sqrt(7) Simplify sqrt(78)/(sqrt(36)/sqrt(96)) + (sqrt(91)2-5)/sqrt(7). -6sqrt(13) Simplify -4((sqrt(242) - (sqrt(242) + sqrt(242)-1)) + 3 - sqrt(242))2 + 0. -36 Simplify ((sqrt(133) - (sqrt(133) + 2sqrt(133)-2)) + -3sqrt(133)-1)/(2(3sqrt(847) + sqrt(847))). 7sqrt(19)/88 Simplify (-4 + (sqrt(17)1 + sqrt(17))2)3 - (-1 + (sqrt(2057) + 0 - sqrt(2057))*2). 193 Simplify (((-2sqrt(110) - sqrt(110)) + sqrt(110))5)/(sqrt(640)/sqrt(4)) + 0. -5sqrt(11)/2 Simplify ((sqrt(396) - (sqrt(396)4 + sqrt(396)))/sqrt(9))/((sqrt(64)/sqrt(4))/sqrt(4)). -4sqrt(11) Simplify (-1(sqrt(504)/sqrt(9) - sqrt(56)))/(sqrt(8) + sqrt(8) + sqrt(80)/sqrt(40) + sqrt(8)). 0 Simplify ((sqrt(240)1 - sqrt(240) - sqrt(240))/sqrt(10))/sqrt(12) + (1 + sqrt(2)-2 - (sqrt(200) + 1))2. -sqrt(2) + 288 Simplify (-1sqrt(99)-33)/(sqrt(72)/(sqrt(8) - (sqrt(8) - 2sqrt(200)))). 90sqrt(11) Simplify ((sqrt(204) - (-33sqrt(204) + sqrt(204)))/(sqrt(60)/sqrt(5)-6) + 5)2. -15sqrt(17) + 253/4 Simplify 3(-3 + sqrt(1053)) + (-5 + -1sqrt(13))*2-4. -161 - 13sqrt(13) Simplify -1(-1sqrt(484))/(sqrt(10)/(sqrt(15)/sqrt(3))). 11sqrt(2) Simplify ((-1(sqrt(6) - sqrt(150)))/(sqrt(2) - (sqrt(22)6)/sqrt(11)) + 1)*2. -8sqrt(3)/5 + 73/25 Simplify 5 + (3 + sqrt(108) - sqrt(3) - ((sqrt(3) + 1 - sqrt(3)) + -5))*2-1-6. 420sqrt(3) + 749 Simplify ((sqrt(75) + -3)*2 - sqrt(30)/(sqrt(10)1)) + 4sqrt(30)/(-2sqrt(10)). -33sqrt(3) + 84 Simplify ((sqrt(1216) + (sqrt(1216) + sqrt(1216)4 + sqrt(1216))-4)-3 + (-42sqrt(1216) - -5(sqrt(1216) + -1sqrt(1216) + sqrt(1216))))*2. 5296896 Simplify -1 + (-3 + (2sqrt(1088))*2 + (-5 + 0 + sqrt(1088) - sqrt(1088)))-1. -4345 Simplify 2 + ((sqrt(126) + 6sqrt(126))/sqrt(6))/(sqrt(3) - (1sqrt(432) + sqrt(3)) - sqrt(3)). -7sqrt(7)/13 + 2 Simplify (43(sqrt(385)/(sqrt(7) + -2sqrt(7)))/(sqrt(60)/(sqrt(12)2)))2. 6336 Simplify ((sqrt(462)2)/sqrt(11) + sqrt(42))/(-3sqrt(6)1) + 2. -sqrt(7) + 2 Simplify -4 + -4(sqrt(11) + sqrt(132)/sqrt(300) + ((sqrt(891) - (-2 + sqrt(891))) + sqrt(891))2). -3584 - 744sqrt(11)/5 Simplify 3-2sqrt(19)5 + 4 + (0 + sqrt(76))2 + 0. -30sqrt(19) + 80 Simplify (sqrt(108)/sqrt(4) - sqrt(27)) + -2 + 6(sqrt(36)1)/sqrt(12). -2 + 6sqrt(3) Simplify 3(sqrt(98) + -2 + 3)2 - ((sqrt(98) + 2 + 2)2 + sqrt(98) - (0 + sqrt(98) + 0)). -14sqrt(2) + 183 Simplify sqrt(242) + sqrt(242) + ((sqrt(242) - (sqrt(242) + 0))2 - sqrt(242)) + 0 - (1 + sqrt(242))-6 - ((-4 + sqrt(162) + -1 + sqrt(162))*2 + 1). -668 + 257sqrt(2) Simplify (sqrt(448) - (sqrt(448) + -5 + sqrt(448))-5 - (2 + 1sqrt(448)))*2. -4320sqrt(7) + 45529 Simplify (sqrt(48)/sqrt(400))/(sqrt(256) - (sqrt(256) + 3sqrt(256)-6)). sqrt(3)/1440 Simplify (sqrt(13) + -1)6 + (1sqrt(130) + sqrt(130))/sqrt(10) + sqrt(26)/(sqrt(24)/(sqrt(12) + (sqrt(12) - sqrt(24)/sqrt(2)))). -6 + 9sqrt(13) Simplify (2sqrt(27)5)/((sqrt(360)/sqrt(8))/sqrt(5)). 10sqrt(3) Simplify 2sqrt(117)4 + (sqrt(26)/sqrt(32) + sqrt(39)/sqrt(3)2)2. 1053/16 + 24sqrt(13) Simplify 2((sqrt(208) + 2sqrt(208) + sqrt(208) + sqrt(208) + sqrt(208) - sqrt(208) - sqrt(208))/sqrt(4))/(1(sqrt(4) - -1sqrt(4))). 4sqrt(13) Simplify (sqrt(616)/sqrt(11))/sqrt(8)-2 + sqrt(21)/(sqrt(18)/sqrt(6)) + (sqrt(175) + sqrt(175)-1)2. -sqrt(7) Simplify (6-3sqrt(176)-5-3)2. 12830400 Simplify ((-2sqrt(112))*2-4 - sqrt(112)) + 1 + -5. -1796 - 4sqrt(7) Simplify ((sqrt(12) + -1)-6 + (sqrt(3) + 1 + sqrt(3) + sqrt(3) + -4 - sqrt(192)-2))2. 42sqrt(3) + 156 Simplify (-2 + 3 + -2 + -3sqrt(72) + sqrt(72))2. 24sqrt(2) + 289 Simplify ((0 + sqrt(672)/sqrt(6) - sqrt(42)/(sqrt(600)-2)) + -2)2. -81sqrt(7)/5 + 47527/400 Simplify ((sqrt(11) + 2 + sqrt(11) + -3 + sqrt(11) + 1sqrt(99))36)2. -3888sqrt(11) + 128628 Simplify (-1 + 3 + (sqrt(891)-3 - sqrt(891)) + 4 + sqrt(891)-1 + -4)*2. -180sqrt(11) + 22279 Simplify sqrt(27)2 + (-1sqrt(432) + sqrt(432))*2 + (((sqrt(45)-1)/sqrt(3))/sqrt(5))*2. 3 + 6sqrt(3) Simplify (4sqrt(1280))/(sqrt(4)-25)-2. 32sqrt(5)/5 Simplify ((0 + sqrt(363) - 4(sqrt(3) + sqrt(15)/sqrt(5) - sqrt(3) - sqrt(3))) + -4)*2. -88sqrt(3) + 379 Simplify (sqrt(5) - (sqrt(80) - (sqrt(80) + sqrt(80)-3))2) + 0 - (sqrt(5) + sqrt(60)/(4sqrt(12)) + -5)*2. -12045/16 + 27sqrt(5)/2 Simplify ((-1sqrt(68) - sqrt(68) - (-1 + sqrt(2448))) + (sqrt(170) - sqrt(170)2)/sqrt(10)-5)2. -22sqrt(17) + 2058 Simplify (6sqrt(108)2 + 6(1 + sqrt(108)))212. 2592sqrt(3) + 70056 Simplify -5 + (5 + (sqrt(32) + sqrt(512) + -2)*2)-1. -814 + 80sqrt(2) Simplify 6(-2sqrt(28)/sqrt(4) + 5 + (sqrt(448)22)2). -12sqrt(7) + 43038 Simplify (-2sqrt(2160))/(sqrt(9)/sqrt(3)4). -6sqrt(5) Simplify 1(-1 + (sqrt(252) - -2sqrt(252)) + (sqrt(252) + (sqrt(252) + -1)-4)*2 - (sqrt(252)-1 + 4 + 0)). -120sqrt(7) + 2279 Simplify ((sqrt(132) + -61sqrt(132) - sqrt(132)) + sqrt(132) + sqrt(132)-1-3)/(32sqrt(1452)). -sqrt(11)/33 Simplify ((sqrt(200) + 2 - sqrt(200))2 + 0 - (sqrt(200) + sqrt(200) + 2)26) + 2. -4818 - 480sqrt(2) Simplify ((sqrt(77) + -2sqrt(77)3 + sqrt(77) + 6sqrt(77)2)/(sqrt(110)/(sqrt(20)/sqrt(2)) - sqrt(99)1) + -5)*2. 40sqrt(7) + 137 Simplify (-6(sqrt(209)35 + sqrt(209) + sqrt(209)))/(sqrt(275)22). -51sqrt(19)/10 Simplify ((sqrt(25) - 2sqrt(2500) - -31sqrt(25))/(-1sqrt(80)))*2. 80 Simplify (-15sqrt(540))/(sqrt(300)3). -sqrt(5) Simplify ((1 + -1(sqrt(3) + -3) + sqrt(3) + sqrt(3))5)*21. 200sqrt(3) + 475 Simplify (5 + 5(((((sqrt(847) - (sqrt(847) + sqrt(847) + sqrt(847)-2 + sqrt(847))) + sqrt(847))2 - sqrt(847)) + sqrt(847) - sqrt(847)) + sqrt(847)) + 4)*2. 1980sqrt(7) + 84781 Simplify (-5 + sqrt(1584) + 2)*2 + 0 + sqrt(66)/sqrt(6) + -2. -71sqrt(11) + 1591 Simplify (3(((sqrt(68) - (2sqrt(68)-3 + sqrt(68) - sqrt(68) - sqrt(68))) + sqrt(68))/(sqrt(40)/(-2sqrt(10))) + 3))*2. -972sqrt(17) + 49653 Simplify (62sqrt(10)-3)/(sqrt(12)/sqrt(24) + 2sqrt(32)). -72sqrt(5)/17 Simplify (sqrt(36) - 1sqrt(900) - sqrt(36))/((sqrt(300) - sqrt(300)3)-3). -sqrt(3)/6 Simplify (-2-2(6-3sqrt(80) + sqrt(80)))*2. 369920 Simplify (sqrt(1296) - (sqrt(1296) + sqrt(1296)-2) - ((sqrt(1936) + sqrt(1936)-2 - sqrt(1936)) + sqrt(1936)))/((sqrt(40)-2)/sqrt(5) - sqrt(8)21). -29sqrt(2)/4 Simplify ((sqrt(637) + (sqrt(637) - (sqrt(637) - ((0 + sqrt(637))-3 + sqrt(637)) - sqrt(637))))*2 - sqrt(637)) + -1(sqrt(52)/sqrt(4)-4 - sqrt(13)) + -5. -2sqrt(13) - 5 Simplify -2(sqrt(1575)1-2 + (0 + sqrt(1575))-6)*2. -201600 Simplify ((-3sqrt(325))**2 + 4 +	{ "pile_set_name": "DM Mathematics" }
. 3 Let t be (-3 + (-135)/(-12))/((-2)/(-32)). Suppose 128o = to. Solve o = 2f + 2s + 2, 0 = -2f + 3f + 4s + 16 for f. 4 Let m(s) = 4s*2 - 35s + 75. Let c be m(3). Solve c = 2q, -3k - 5q + 6q = 0 for k. 1 Let m be (16/(-12))/(2/(-21)). Suppose 0 = u + 206 - 373. Suppose -ul - 40 = -175l. Solve 3s - lk = -22, 2s - 2k + m = k for s. -4 Suppose 0h + 5h - 30 = 0. Let v be (2 - h) + 1 + 3 + 3. Suppose -9 = -3q - vp, -q + 4p + 13 = -0p. Solve 3o + 16 = qg, 0 = -5o + 5g - 2g for o. 3 Let u = -4259 - -4260. Solve 0 = l + u, 0 = 5s - 0s + 2l + 27 for s. -5 Suppose 0 = -l + 3k + 12, 0 = 4l + k - 3k - 18. Suppose -652x + 61x = 197x. Solve u = -0u - l, x = -4t - 3u + 7 for t. 4 Let a be 785/195 - (-76)/(-2964). Solve 36c + av + 29 = 31c, c = 5v for c. -5 Let t(u) = 10u + 73. Suppose 5o + 40 = -0h - 5h, -4h - 18 = 2o. Let j be t(o). Let q = 4 + 1. Solve -jf + g - q = -3g, -3g + 5 = -f for f. 1 Let d be 3(3 + (-20)/15) - 0. Let k(o) = o3 + 37o*2 + 39o + 112. Let w be k(-36). Solve ds = -3c + 1, 3s + 0c + 6 = -wc for s. 2 Let b be ((-150)/(-15)1)/2. Solve -g - 3g = 4z - 20, g = -4z + b for z. 0 Suppose 3y + 3o - 15 = 0, -2o = -4y - 33 + 41. Solve -yg = -5i + 17, 28g - 26g - i = -9 for g. -4 Let o(m) = m + 12. Let r be o(-6). Suppose -ry - 2 = -7y. Let v = 355 + -350. Solve -yg + 2 = -4i, -vi + 0 - 1 = -4g for g. -1 Suppose 3d - 3f - 15 = 0, -421 + 411 = -2d - 5f. Solve db + 15 = -5y, -3b + y - 3y - 6 = 0 for b. 0 Suppose 5j - 7w + 10w = 1274, 3j - 5w = 744. Let n = -250 + j. Solve nq = -g + 7q + 23, -2q = -4g + 22 for g. 3 Suppose -63r - 114r + 1520 = -25r. Solve 2h - r + 18 = -k, -17 = 5h + 4k for h. -5 Suppose -36y + 25y = -44. Suppose 11z = 9z + y. Suppose -5h + 4f = -10, -2h - 4f = -8 + 4. Solve h - 8 = zb + 4l, -12 = 4b - l for b. -3 Let o = 18332 - 18332. Solve o = 5w - 43h + 40h + 17, 5h + 21 = -4w for w. -4 Suppose -c - 268 = -4a, -c = -0a - 3a + 264. Let v = c + 252. Solve n + 3 = v, -2g - 2g = 4n + 28 for g. -4 Let p(w) = -w*2 + 47w + 931. Let q be p(62). Solve -4a + 4 = 2z, -3a - 2z + 3 = q for a. 2 Let x be 6/8 + (-26256)/192. Let t = 140 + x. Solve 2i = 3o - 5, -4i + to - 2 = 2 for i. 2 Let x(v) = 12v2 + 31v + 28. Let q be x(-11). Suppose 6y - 1151 = -q. Solve -25 = -4c + 3h, -h - h + 2 = yc for c. 4 Let g = -586 - -606. Let y be 2190/g + -8. Solve 3r - d + 2d = y, 5d - 22 = -4r for r. 3 Let j = 25 + -45. Let v be (j/8)/(2/(-8)). Let l be 3 + (-7)/(0 - -7). Solve -3y - c = 3c - v, 0 = -5y - lc - 2 for y. -2 Let u(a) = a2 + a - 138. Let p be u(-13). Solve -o - 4w = -11, 8w - 3w - p = 3o for o. -1 Suppose 14 = 61o - 3158. Solve 0 = -4t - 2q + 4, ot - 54t - 14 = 5q for t. 3 Let q(w) = -3w*2 + 4. Let h(k) = -2k*2 + k + 4. Let l(z) = 4h(z) - 3q(z). Let d be l(-2). Solve 4c - 16 = d, -5i + 5c - 22 = 2c for i. -2 Let m(h) = -h3 - 31h*2 - 19h - 13. Let d be m(-30). Let u = -334 - d. Solve n = -2g + u, 0 = 4n + 2g - 4g - 16 for n. 5 Let d = 30916 - 30916. Solve -2l - h - 7 = d, -3 = 8h - 7h for l. -2 Suppose -5c + 3d = 933, 3d - 2d + 760 = -4c. Let j = -96 - c. Suppose -j = q - 97. Solve 15 = 2f + f + 5w, 0 = qf + 4w - 20 for f. 5 Let o(h) = 2h2 + 843h - 1687. Let d be o(2). Solve 4c + n = -10, 8c - dc = n - 5 for c. -3 Let g(y) = -121y + 3996. Let q be g(33). Solve 6a - 2a + 40 = 5c, -a + qc - 17 = 0 for a. -5 Let f(c) = 4c2 - 2c. Let r be f(1). Let o be 231/(-1)-1r/6. Let w = o + -73. Solve 4j - w = -3y - y, 5j - 17 = -2y for j. 5 Suppose -15 = -5j + k, 4k = 4j + 3k - 13. Let u be 135/(2 - 1/j). Let p = -86 + u. Solve -o + 3y + p = -1, 4y = 4o - 4 for o. -1 Let a(d) = 472d - 3301. Let l be a(7). Solve 0 = -5i + 5, 9g + i - l = 8g for g. 2 Let f = 272 + -216. Suppose fv - 51v - 10 = 0. Suppose -2 = -s + 3. Solve z - sm - 16 = 0, -4z + 0m = vm + 24 for z. -4 Let n = -4512 - -4516. Solve -8j - 4y = -nj + 12, 5j = -2y - 9 for j. -1 Let o(w) be the second derivative of 2w4/3 - 22w3/3 - w2 - 2w + 29. Let s be o(6). Solve -3t + 3g = -6, 2t - g = -5g + s for t. 5 Let b = 59 + -55. Suppose -2n - 18 = -5j, 0 = j - 0j - 2n - 2. Solve 4q = a + b, -ja - a - 20 = -4q for q. 0 Let d(h) = -h*3 + 13h*2 - 3h + 41. Let c be d(13). Solve -cp = 3i + 2, -43i - 6 = -40i for p. 2 Suppose -m + 3 - 1 = 0. Suppose mn - 35 = -5n. Suppose -5g - 2b + 74 = 0, -4g + 5b - 3b = -70. Solve 4 = 4i - g, 20 = nv + i for v. 3 Let r(f) = 964f - 5779. Let y be r(6). Solve -11h - 2m + y = -14h, m - 4 = 2h for h. -3 Let d(i) = -i3 - i2 - i. Let g be d(0). Suppose -3k = -gk - 42. Suppose -4 = 2q - 14. Solve z = 3s - qs + 13, 2z = -s + k for z. 5 Let c be (-1 + 2/(-6))-3. Let k(x) = -x2 - 4x - 2. Let h be k(-2). Suppose v + 1 - 21 = -f, -46 = -hf - 4v. Solve 4q + z = 17, -2z - f = -3q + c for q. 5 Let l = -34 - -4. Let p = -99 - l. Let u = p + 71. Solve 4s + 12 = uw - 18, 0 = s + w for s. -5 Let u = -35606 - -35611. Solve -11s - 2x - 15 = -10s, x = -u for s. -5 Suppose -2c + 15 = 4n - 13, 0 = -c + 4. Suppose -1169h - 12 = -12. Solve nd + 4m - m - 3 = h, -26 = -2d + 5m for d. 3 Let j = 16 + -11. Suppose -3w = -8 + 2, -70 = -jh - 5w. Suppose -6u + 5u = -5. Solve 2z + 5x + 2 = -4, -h = -uz + x for z. 2 Let a be 6/1 + 0 + -2. Let l(f) = -6 + 3 - 9 + 10f - 11f. Let c be l(-12). Solve -2o + 10 = -aj, j + 3o + c = 15 for j. 0 Suppose 2t - 181 = 3j + 214, 4t - 805 = j. Let n = t - 199. Solve 4i = 3s + n + 3, 5s - i - 7 = 0 for s. 2 Let o = -3647 - -3653. Solve ob = 10b + v - 15, 0 = -5b + 2v + 9 for b. 3 Let j = -14027 - -14029. Solve -3 = -5u + 4a, 4u - 4 = ja + 2 for u. 3 Let h(b) = b*3 - 17b*2 + b - 6. Let g be h(17). Let v be 36/1520/8. Let y be 10/v + 8/(-12). Solve t = 4j + g, -2t - y = 4j - 5t for j. -4 Let j = 26864 + -26861. Solve 0 = -5c + b + j, -244c + b = -242c - 3 for c. 0 Suppose -y + 18 = 5y. Let z be (y + -4)(1 - 84). Let p = z - 73. Solve -i + 6i - 16 = -3h, -2i - 3h + p = 0 for i. 2 Suppose k = 6k - 20. Suppose 2h - 1 = 6c - 3c, 0 = -3h + kc + 3. Solve -5i = -hb, 4i + 40 = -2b - 2b for i. -5 Suppose -16l - 448 = -20l. Suppose 17u - 9u + l = 0. Let x = u + 16. Solve -5d - xw = 28, 2d - 5d = -4w - 4 for d. -4 Let v = -378 - -354. Let x be 8/6(-36)/v + 2. Solve 5s + 3j - x = 4, 2s + 1 = 3j for s. 1 Let c(m) = -2m - 19. Let i be c(-23). Let q = i - 28. Let b(x) = -6x - 3. Let n be b(q). Solve -na + 3s + 5 = -4a, -13 = -3a + 5s for a. 1 Let p be (8/(-2))/(-4 - (-2 + -1)). Let n = -6 - -10. Let j(r) = 48r - 24. Let u be j(1). Solve f - u = ni + 5f, -2i = pf + 18 for i. -3 Let b(a) = -a*3 - 6a*2 - 2a - 9. Let w be b(-6). Suppose -s - 5 = -46. Let n = s + -32. Solve -3k + 0v + wv - n = 0, 5k + 13 = 4v for k. -1 Suppose 106 = -8h + 6h. Suppose -11q - 724 = -119. Let l = h - q. Solve t - 13 = lt + 5f, 0 = 2f + 6 for t. 2 Let h be (2/(-3))/(118/(-708))(-25)/(-5). Solve -3w - 4 = 5v - h, 4v = 3w + 29 for v. 5 Let r be 1370/(-8)(-3 - (-2 + 3)). Let c = -685 + r. Solve cl - 5b = 3l - 6, -2 = -l - 3b for l. 2 Let y = -67 + 70. Suppose 25p - 471 = 204. Solve 4o = -yx + p, 0 = -3o - 0x - 2x + 19 for o. 3 Let i be -1 + 3 + -3 + 3. Let h be 4/(-10)240/8 - 0. Let v = h + 15. Solve 7 = ia - vd, -3a = 2d + 30 - 8 for a. -4 Suppose -4n = 15n + 13n. Suppose 7s - 131 + 110 = n. Solve 3c + 15 = sr, -4r + 3r - 25 = 5c for r. 0 Let c = -919 - -480. Let x = c + 442. Solve 5u = 2n - 1, 2u + 5 = xn - 2 for u. 1 Let n be (-2)/(-12) + 500/24. Suppose -68z + 16 = -120. Solve 0 = 4r - o + n, 5r - z = 5o - 32 for r. -5 Suppose 0 = 10n - 25 - 25. Suppose -4s + 16 + 0 = no, 8 = 2s + 4o. Solve w - sc - c + 10 = 0, 4c + 21 = -5w for w. -5 Suppose 3a = 5p - 22, 18p - 3a - 16 = 16p. Suppose pq + 3b = -3, -b = -5q + 26 + 9. Solve 0 = 3y - 4s + 1 - 22, -y + q = -s for y. 3 Let m = 7168 + -7163. Solve 0 = -mz + 4p - 33, 0z - 2z + 3p = 16 for z. -5 Let w(x) = -3x2 + 15x + 3. Let f be w(5). Suppose -3t + 49 = -3u + 4u, -2t + 51 = -fu. Solve -3g + t = 2	{ "pile_set_name": "DM Mathematics" }
))/o)/o)/(oo(12/7)o)(o(1/7))(1/3) assuming o is positive. o(1/3) Simplify n/n(-19)nnnn(-17)nn13n*(1/18)n assuming n is positive. n(379/18) Simplify (d18)*(-29/2)d31/(((d/d29)/dd)/d) assuming d is positive. d(-201) Simplify c(-8/5)c/(((cc19)/c)/cc)(cc/(c/(cc/c(-4))))/c(-3) assuming c is positive. c(-48/5) Simplify ((m3/((m6/m)/m))/(m8m*4m))(3/16) assuming m is positive. m(-21/8) Simplify (k*(1/2)k)(-22)/((k5/k)/(k/(k*(-8)kk))) assuming k is positive. k(-30) Simplify (((kk(14/5))/k)/k(-7))/((k*(5/4)/kk)/k)25 assuming k is positive. k(71/20) Simplify (i(2/21))(-5/19)(i(-24)/i)(-48) assuming i is positive. i(478790/399) Simplify (p(-2/5))(-10/11)/((p/(p/p(-2/35))p)/(p*9/pp)) assuming p is positive. p*(3242/385) Simplify (uu*(-2/69)(uu22/u)/u)(1/78) assuming u is positive. u(758/2691) Simplify ((uu(1/5))/u0uu*(-2)uu(-4/5)/uu)(-16) assuming u is positive. u(-32/5) Simplify (q(-7/2))14/(q*(1/13)q(-7/3)) assuming q is positive. q(-1823/39) Simplify (d*(7/3)d*4/dddd*(-1/4)ddd(dd/d*(5/3)d)/d)(4/5) assuming d is positive. d(25/3) Simplify (pp2)(-46)((p/p*(2/21))/pp)/p5 assuming p is positive. p(-2984/21) Simplify (bb(3/7))/(b4/b)(((b/((bbb*14)/b))/b)/b)/(bb0) assuming b is positive. b(-130/7) Simplify ((y*(-4/7)y)/y)*43yy(2/17)/yyy/y4 assuming y is positive. y(-3148/119) Simplify (((f/(f/f0))/f(-3))(-8/5))49 assuming f is positive. f(-1176/5) Simplify (r(-7/4))17/(r(1/4)(r*11r)/rr) assuming r is positive. r(-42) Simplify a(3/4)/aaa11aa(2/7)/aa(2/11) assuming a is positive. a(3763/308) Simplify ((oo/o(-33)o)/o(-10))29 assuming o is positive. o1334 Simplify z(-10/9)zz*(4/5)((z/(zz(3/8)))/z)3 assuming z is positive. z(-1237/360) Simplify (q(-2/9)q(-1))/(q(4/3)q)(-1/2) assuming q is positive. q(-1/18) Simplify (q(-2/17)q(-14/9))(-8/3) assuming q is positive. q(2048/459) Simplify ((h0/h)*(-9)(h(-2)/h)/h(1/4))(-48) assuming h is positive. h(-276) Simplify ii/i(-2)ii/(((i/i(-14/5))/i)/i)(i/i*(5/8))/(i(i/i(9/4))/i) assuming i is positive. i(233/40) Simplify (z/z5)/z(-2/25)(zzzz*(1/13)z)/z(-6/11) assuming z is positive. z(2511/3575) Simplify ((ttt*(-5)/t)/(ttt7)(tt(6/7))/(((t/t(-6/5))/t)/t))(-1/3) assuming t is positive. t(397/105) Simplify (((x(4/13)/xx)/(xx/x(8/3)))25)(-33) assuming x is positive. x(-10450/13) Simplify (((h(-11)/h)/(hh/h(6/5)))47)(-18) assuming h is positive. h(54144/5) Simplify ((g*3g)/gg(1/4)((gg7)/g)/ggg/(g/g(1/6))g)(2/13) assuming g is positive. g(137/78) Simplify u*(3/7)uu(1/13)(uuu*15u)/u(1/2) assuming u is positive. u(3459/182) Simplify (((n/(n(-2)/n))(-2/47))(-1/46))(-2/55) assuming n is positive. n(-8/59455) Simplify (x/((x(3/7)x)/x))/x(22/5)(x*(5/6)x)(-14) assuming x is positive. x(-3097/105) Simplify w3/((w/w(2/55))/w)(w(-1/4))50 assuming w is positive. w(-1041/110) Simplify (h/(h/(hh*(-2/7)h))h(2/11)(hhh*3h)/(h/(hhh/h(2/9))))(2/3) assuming h is positive. h(13408/2079) Simplify (c/c18)/((c*15c)/c)(c/c(11/2))/c(-1/3) assuming c is positive. c(-217/6) Simplify ((ff2)(-6))14 assuming f is positive. f(-252) Simplify ((o*5o(6/7))(7/4))(-42) assuming o is positive. o(-861/2) Simplify ((iii/((i*0/i)/i)i)*(-1/11)i/(i*(5/6)i)iii1ii)(2/17) assuming i is positive. i(239/561) Simplify ((q0)(-10)/((q(-1/4)qq)/q(-1/4)))(-21) assuming q is positive. q42 Simplify (y(-1/30)y(y/(y/((yy/y*(-4/5))/y)))/yy)/(yy/y(-8)yy(-3/10)) assuming y is positive. y(-119/15) Simplify (k(-2)kk(kk(-9))/kkk(-4)(k/(k*(-3)/k)k)/k)(7/3) assuming k is positive. k(-49/3) Simplify (((h*10h)/(hh(-20)/h))(-1/2))(-16) assuming h is positive. h248 Simplify (((hh*(-3/7)h)/h)*(-24)/((hh6)/(h(-9)h)))(4/11) assuming h is positive. h(-804/77) Simplify ((x(-5)/xx/x(-3/5))40)1 assuming x is positive. x(-176) Simplify ((jj(-1)j)*(-44)j/((j/((j/(jj/(jj*(1/3)/j)))/j))/jj)j(1/3))(1/14) assuming j is positive. j(-68/21) Simplify ss*(-8)s*11(s(-1))(19/2) assuming s is positive. s*(-11/2) Simplify (rr*3r/(r*(-1/46)r))/((r(-13)/r)/r)(-49) assuming r is positive. r(-33625/46) Simplify j(6/7)/jj(-10)(j/j11)/(j(-2/31)/j) assuming j is positive. j*(-4140/217) Simplify ((qq*(-2)q)/((q/q*(-2/11))/q))/(q/(((q/(qq*0qq))/q)/q)qq)(2/71) assuming q is positive. q(-296/781) Simplify c3ccc*(1/5)(c/c(1/9))(20/9) assuming c is positive. c(2906/405) Simplify (q/(q/((q/(q/(q(-1/5)q)q))/q)q)qq/(qqq/(qqq(5/4))q))/(q16)43 assuming q is positive. q(-13779/20) Simplify (((k/k(-1))/kk)/k)(-1/28)/(k(-1/3))(5/7) assuming k is positive. k(17/84) Simplify ((ww*(2/11)ww(1/4))/(w(-10/9)/ww(-2/5)))(-9) assuming w is positive. w(-9787/220) Simplify ((j/j(-6/13))(-28))40 assuming j is positive. j*(-21280/13) Simplify (nn(-4))(7/2)/((nnnnn*(-12)/n)/nn)(1/29) assuming n is positive. n(-591/58) Simplify (g/(g*(7/3)g)g)(3/7)g/(gg(-9/4)g)gg(-2/7) assuming g is positive. g(39/28) Simplify ((oo(-5)/oooo(o/(o(-5)o))/o)/(o*2o(-2)))(11/9) assuming o is positive. o(22/9) Simplify (j/(j(-2/57)/j)(j/(((j/(j/j(-9/4))j)/j)/j))/j)50 assuming j is positive. j(30125/114) Simplify ((u/u*(3/5)u3)/(u4uu4))(1/12) assuming u is positive. u(-7/15) Simplify (y(-3/7)/y)*(-17/5)(y/y6)/(y/y(-12)) assuming y is positive. y(-92/7) Simplify (((w(1/8)w)/(w6/w))/(w(-3/4)w*(-5)w))(5/8) assuming w is positive. w(35/64) Simplify (a*(-29)a(2/17))/(a24aaa/(a/(a(5/9)/aa))a) assuming a is positive. a(-8635/153) Simplify (u(5/13)/(uu*(-22)uu))(-44) assuming u is positive. u(-11088/13) Simplify ((yy/(y*12/y)y)/y)5/(y(-9/4)/(y/y18)) assuming y is positive. y(-239/4) Simplify l*4/ll/((((lll*(-6/7))/l)/l)/l)(l/l*(-3))/(ll(-11)) assuming l is positive. l(139/7) Simplify (g*(-11)g/g*(-12))/(g/(gg(1/2)))(2/59) assuming g is positive. g(119/59) Simplify (h(-3/8))(7/6)/(h/(h/h18hh)h(2/129)) assuming h is positive. h(-33959/2064) Simplify (m(-11)m)34/(m2)(2/61) assuming m is positive. m(-20744/61) Simplify (f/(fff/f*2)f/(f*16f))/(f/((ff(-21)f)/f)((f/f(2/3))/f)/f) assuming f is positive. f(-106/3) Simplify ((k/(k/k2))17/(k/(k/(kk/(k*(-3/2)/kkk))))(-3/4))(1/25) assuming k is positive. k(287/200) Simplify ((w/((w13/w)/w))/w)/(ww*(-10))((w*23/ww)/w)33 assuming w is positive. w724 Simplify ((s(1/21))(-5/8))(-16/3) assuming s is positive. s(10/63) Simplify (jj23/jjj(-1/8)jj)/(j(-1/2)j/j(-2/15)) assuming j is positive. j(3029/120) Simplify ((gg(-2)gg(-3))(-44))(-7) assuming g is positive. g(-924) Simplify (z/((z/(zz/(z*(-3)z)))/z))*35z(-2/9)/z2 assuming z is positive. z(1555/9) Simplify ((n/(n(2/5)/n)n/n(-1))/(n(2/3))(-28))(-2/83) assuming n is positive. n(-668/1245) Simplify (vv/v2)49((vv(-1/4))/v)17 assuming v is positive. v(-17/4) Simplify ((l(2/3))*(-4/5)((l/((lll*3)/l))/l)/ll(-3))(-2/3) assuming l is positive. l(256/45) Simplify (c8c(-2/3)/cc)/(cc(-2/3)c(c/((c/c(-23))/c))/c) assuming c is positive. c29 Simplify ((((ww(2/9)/w)/w)/w)(-5/2))(-43) assuming w is positive. w(-1720/9) Simplify (((p/(p/(p*(1/6)/p)p))/pp(-2/9)pp)/((p(2/11)/p)/((pp(-2/3))/p)))38 assuming p is positive. p(-3401/99) Simplify (l18ll*(-1/6))/(l/(l(l/((l/(ll(4/5)l))/l)l)/l)l(-2/23)) assuming l is positive. l(15677/690) Simplify ((s/(sss(1/8)))/s)(-4/43)/(s(2/13)/s)(3/16) assuming s is positive. s(3187/8944) Simplify (r(-2))*(5/7)/((r(((rr(-16))/r)/r)/r)/rrrrr(6/25)r) assuming r is positive. r*(2158/175) Simplify (((o(o/((o	{ "pile_set_name": "DM Mathematics" }
be r(i). What is the units digit of 0 + (-2)/(-3) - t/6? 4 Suppose 8j = 6 + 2. What is the thousands digit of (1 + j)9149/14? 1 Let d = 26036 + -17919. What is the hundreds digit of d? 1 Let h(d) = 2d2 + 9d - 9. Let o be ((-8)/(-5)-1)/(2/10). Let u be h(o). Suppose u - 209 = -2w. What is the units digit of w? 1 Suppose -3l - 5d + 30 = 0, d + 15 = -2l + 42. Let r = 198 - l. What is the tens digit of r? 8 Suppose 2138 = 4l + 4p - 438, -1944 = -3l + p. Let f = 1471 - l. What is the units digit of f? 4 Suppose -n - 5g + 21450 = -2g, 2n - 42909 = 3g. What is the ten thousands digit of n? 2 Let q = 317 + -312. Suppose -4v - qv + 6642 = 0. What is the tens digit of v? 3 Let o(n) = n*3 + 23n*2 - 22n - 39. Let k be o(-21). Let c = k + -877. Suppose 0 = -2l + c + 150. What is the tens digit of l? 8 Let b be (-48)/(-18) - (-1)/3. Suppose 3 + 3 = -2p, 0 = 2m + 3p + 5. Suppose mj + 0j = 3a + 136, -5j + 361 = ba. What is the units digit of j? 1 Suppose -6v + 39 - 3 = 0. Suppose -4440 = vh + 6h. Let w = h - -520. What is the tens digit of w? 5 Let t be 2/81 + (-486)/(-72). Suppose -tj + 1326 = 6j. What is the tens digit of j? 0 Suppose x = -2n + 7, -7n - 5x - 4 = -10n. Suppose -ni + 4q + 69 = 7q, 0 = -5i + q + 127. What is the units digit of i? 5 Let n(i) = -i3 + 25i*2 + 22i + 8. Let r = 83 + -57. Let w be n(r). Let f = -86 - w. What is the tens digit of f? 1 Let w(x) = -7x - 18 + 146x*2 - 147x*2 - 2x. Let h be w(-5). Suppose -c = 2m - 96, -c + 472 = 4c + hm. What is the tens digit of c? 9 Let t(n) = n2 - 7n + 3. Let c be t(6). Let d(a) = a*2 + 42a + 94. Let q be d(-32). What is the tens digit of q/c + (-18)/(-27)? 7 Suppose 1336r - 1338r = -34224. What is the ten thousands digit of r? 1 Suppose -2u + 983 + 1947 = 0. Suppose -13c = -8c - u. Suppose -4j + 2b + c = -b, 3b = -j + 92. What is the tens digit of j? 7 Suppose -10 = 5j - 10. What is the hundreds digit of 1540/4 - (j + 3)? 3 Suppose 147k - 64369 = 144k + 4z, 3k - 64374 = 3z. What is the tens digit of k? 6 Let b be 3 - (228/(-108) + 2/18). Suppose 725 = 9c - bc + 3u, 5c - 889 = 2u. What is the tens digit of c? 7 Let f be (-3)/(-2)(-136)/(-6). Let m(q) = -58q - 723. Let h be m(-13). Suppose 357 = fv - hv. What is the units digit of v? 9 Let p(i) = i2 - i. Let x(v) = -5v*2 - 8v + 25. Let u(o) = -6p(o) - x(o). Let d be u(11). What is the units digit of 407/2 - ((-52)/d - -5)? 5 Suppose 5m - 306 = 2m. Let q = -29 + m. Let h = 138 - q. What is the units digit of h? 5 Suppose -2h = -3s, 0h + 3s = -3h. Suppose hc = -18c + 3564. What is the tens digit of c? 9 Suppose 78220 = 5n - 3t - 18429, 2n + 4t = 38618. What is the hundreds digit of n? 3 Let k = 332 - 323. What is the units digit of 2/k - (-712)/36? 0 Suppose -14u = -8u - 126. Suppose 3i + 906 = 3c, uc - 18c + 5i = 938. What is the tens digit of c? 0 Let g = 1081 + -726. Suppose -2u + 6u = 3i - 615, 5u = 4i - 768. Let c = g + u. What is the tens digit of c? 9 Let c = -50 - -45. Let b(o) = -o*3 - 3o*2 + 13o + 21. Let x be b(c). Suppose xz = 8z - 458. What is the units digit of z? 9 Let u = 390 + -344. What is the units digit of (-35)/(-2) - 23/u? 7 Suppose 160 = 17p - 231. Suppose s + s = 2q + 6, 4q = 5s - 20. Let r = s + p. What is the units digit of r? 1 What is the units digit of 4769425/426 + (-2)/(-12)? 6 Suppose -10x = 5v - 18x - 99363, -2v = 4x - 39774. What is the hundreds digit of v? 8 Let l = -25 - -37. Let x be (12 - l)((-1)/2)/1. Suppose x = -6o + 3o + 219. What is the tens digit of o? 7 Let y(x) = -3x2 + x + 8. Let m be ((20/3)/(-2))/(58/(-87)). Let u(b) = -4b*2 + 8. Let r(v) = my(v) - 4u(v). What is the units digit of r(0)? 8 Let x(k) = -k3 + 2k*2 + k + 1. Let n(t) = 5t*3 + 11t*2 + 7t - 5. Let d(v) = -n(v) - 4x(v). What is the tens digit of d(-19)? 1 What is the hundreds digit of (-11 - (-24 + 14)) + (-114420)/(-3)? 1 Let y = 43 + -46. Let f(a) = -47a - 9. Let w be f(y). Let m = -79 + w. What is the units digit of m? 3 Let n = 35 - 28. Suppose -3v - o = -13, -v = 3o - 0 - 7. Suppose -r + v = -n. What is the tens digit of r? 1 Suppose -4 = -2b, 8 = -z - 5b - 3. What is the hundreds digit of (-3)/(z/308)16? 7 Suppose 3b + 4b - 35 = 0. Suppose bm = -8m + 5096. What is the hundreds digit of m? 3 Let t be (-339)/(-15) + 7/5. Suppose 4s - 2d - 176 = 0, -t = -3s + 2d + 108. What is the tens digit of s? 4 Suppose -29s + 39s = 44s - 111350. What is the tens digit of s? 7 Let n(z) = -25 + 16z2 + 10z*2 + 28 - 101z. What is the units digit of n(4)? 5 Let u be 3/((-3)/4)6/(-12). Suppose -3b + u = -13. Suppose -s - 164 = -bs. What is the units digit of s? 1 Let j(s) = -s3 - 14s*2 - 12s + 12. Let k be j(-13). Let h = k - 5. Let o(z) = 2z3 + 13z*2 - 4z - 2. What is the units digit of o(h)? 8 Let s = 645 + -1089. Let y = s + 982. What is the tens digit of y? 3 Suppose 0 = -23m + 56m - 10m - 662607. What is the ten thousands digit of m? 2 Suppose 17 - 9 = 2r. Suppose 7a - ra - 45 = 0. Let v(x) = -2x2 + 36x - 16. What is the tens digit of v(a)? 7 Let j(o) = o*3 + 27o*2 - 30o - 59. Let z be j(-28). What is the tens digit of ((-4)/(-6)z)/((-8)/1728)? 3 Suppose 0 = u + 3x - 76909, 61104 = u - 2x - 15795. What is the units digit of u? 3 Let y(a) be the third derivative of a4/6 + 42a*2 + a. What is the units digit of y(6)? 4 Suppose 154w + 3008411 = 250w - 1224613. What is the tens digit of w? 9 What is the hundreds digit of 69882/8(-9)/(108/(-16))? 6 Let n(x) = 2x3 + 30x*2 - 154x + 11. What is the thousands digit of n(10)? 3 Let x(a) = 9a + 510. Let c(o) = 7o + 509. Let y(j) = 4c(j) - 3x(j). What is the hundreds digit of y(0)? 5 Suppose -2t = 1929 - 7157. Suppose -12g + 1598 = -t. What is the units digit of g? 1 Let s = -36 + 6. Let y = s + 33. Suppose 164 = -2b + 3b - yi, 830 = 5b - 5i. What is the hundreds digit of b? 1 Suppose 3k - 8k + 50 = 0. Let a be k/(1 + (-2 - -3)). Suppose 2n = u - 6u + 300, n + 285 = au. What is the units digit of u? 8 Suppose 4d = 232f - 236f + 25492, 6367 = f - d. What is the hundreds digit of f? 3 Suppose -2024640 = 445s - 482s. What is the ten thousands digit of s? 5 Suppose -6s + 8s - 48618 = -7s. What is the tens digit of s? 0 What is the hundreds digit of 123195/108/12? 2 Suppose -52 = -8y - 36, 0 = -4r - y + 9674. What is the hundreds digit of r? 4 Let i = 21717 - -29813. What is the tens digit of i? 3 Let q(r) = 63r - 5. Let l be (-6)/((-36)/21)12/21. Suppose 0 = a + 3d + 2d - 28, -3a + ld = 1. What is the units digit of q(a)? 4 What is the units digit of (-17 + 16)/(26382/5277 - 5)? 9 What is the hundreds digit of (48/15)/((-6)/10(-32)/26256)? 3 Suppose -3427 = 16k - 12931. What is the tens digit of k? 9 Let u(i) = 59i + 3. Suppose -5y = -0y + 35. Let z(l) = 2l2 + 12l - 13. Let k be z(y). What is the units digit of u(k)? 2 Let w = -19472 + 33313. What is the ten thousands digit of w? 1 Suppose m = 4m - 3. Let s(p) = -30p*2 - 4p - 3. Let n be s(3). What is the hundreds digit of (-1 - 8/m)/(19/n)? 1 Let a(b) = 6b2 - 27b - 295. What is the units digit of a(-10)? 5 Let r(f) = -65f + 203. Let x be r(-13). Suppose 5z - x = -3n, -18z = 5n - 19z - 1756. What is the hundreds digit of n? 3 Suppose 3c - 42 = -3g, -5g + 4c = 8c - 75. What is the tens digit of (-238)/(-3)(22 - g)? 3 Let y = 218 + -222. What is the units digit of (-66)/(-33)(-922)/y? 1 Let d be (0 + -1)-4(-2748)/(-8). Suppose -d - 99 = -3j. What is the tens digit of j? 9 Suppose -39315 = -20k - 8075. What is the hundreds digit of k? 5 Let s be 9932/(-5) + 26/65. Let p = -1249 - s. What is the tens digit of p? 3 Suppose -13j - 58j + 477555 = 22j. What is the tens digit of j? 3 Suppose -846 = 9v + 144. Let y be 7/(-1)(3 + -2). Let x = y - v. What is the units digit of x? 3 Let r(p) = -p*2 - 16p + 25. Let w be r(-17). Let s(u) = -4u3 + 5u*3 + u + u - 3u*2 - 5u*2 + 13. What is the units digit of s(w)? 9 Let y(r) = 4r*3 + 3r*2 + 2r - 4. Let b be y(1). Let v(p) = 279p - 6. What is the hundreds digit of v(b)? 3 Let t(d) = -106d + 28. Let i be -7 + -2 + (-2 - -5). What	{ "pile_set_name": "DM Mathematics" }
rs of b? 3, 23 Let n be 112/10(-180)/(-9). Suppose 2t - n = 2x - 46, -3t + 266 = -2x. What are the prime factors of t? 2, 11 Let k(u) = -1. Let a(d) = -3d + 2. Let s(q) = a(q) + 6k(q). Let j be s(-3). Suppose -2t - g - 3g - 12 = 0, 0 = -jg - 20. What are the prime factors of t? 2 Suppose 4c = p - 1175, 0 = -2c - 0 - 10. What are the prime factors of p? 3, 5, 7, 11 What are the prime factors of -8 + ((-34524)/(-168))/(3/8)? 2, 3, 5 Let h(b) = -b + 15. Let s be h(11). Let c be s/30 - 928/(-15). Suppose 3m - c - 19 = 0. What are the prime factors of m? 3 Suppose 0 = 6r - 2r + 16. Let c be r/(-28) - (-26)/14. What are the prime factors of (c - -1)/((-5)/(-45))? 3 Suppose 3z - 1 = -2g + 3g, 2g - 2z = 2. Let a(m) = -19 + 44 - 14 + m*g + 0m*2. List the prime factors of a(0). 11 Suppose 13k = -4936 + 31092. List the prime factors of k. 2, 503 What are the prime factors of (-1 - -3)/(6/2445)? 5, 163 Suppose -8a - 222 = -2a. Let r = 15 - a. List the prime factors of r. 2, 13 Let m(o) = -o*3 - 5o*2 - 3o + 4. Let i be m(-4). Let y = 92 - 64. Let v = i + y. List the prime factors of v. 2, 7 Let q(d) = -d*3 + 21d*2 - 39d + 12. List the prime factors of q(17). 5, 101 List the prime factors of 30/35 - (-38246)/182. 211 Suppose -2l + n = 5n - 1172, -2l = -4n - 1140. What are the prime factors of l? 2, 17 Let j = 78 + -76. Suppose -jw - 2c = -360, -4c + 544 = 3w - 2c. What are the prime factors of w? 2, 23 List the prime factors of (-44361)/(-53) - 11/1. 2, 7, 59 Suppose 75064 - 1936 = 33x. List the prime factors of x. 2, 277 Let x(j) = j3 - j2 + 5j + 6. Let m be x(6). Let d = m - 135. What are the prime factors of d? 3 Suppose -3f = -4o - 1668, 1117 = -0f + 2f - o. Suppose -7t + 903 + f = 0. What are the prime factors of t? 11, 19 Suppose 0 = -3g - 13 + 88. Let h(j) = j2 + 21j + 24. Let u be h(-20). Suppose g + 3 = uv. What are the prime factors of v? 7 List the prime factors of 8/(-6)927/(-6). 2, 103 Suppose 0 = -0k + k + 2r + 10, 3r - 11 = 5k. What are the prime factors of 2/k + (-462)/(-28)? 2 Suppose 6 = -6b + 3b. Let x be -7 + (-2)/(-4)b. Let a(p) = -p2 - 9p + 4. What are the prime factors of a(x)? 2, 3 Suppose v + 16 = 5v. Let w be ((-8)/3)/(v/(-6)). Suppose -wj + 8 + 0 = 0. List the prime factors of j. 2 Let k = -1736 + 2007. What are the prime factors of k? 271 Suppose -x = -s - 2s + 44, 0 = -2x + 2. Suppose s = 2u - 5u. What are the prime factors of 1200/28 + u/(-35)? 43 Suppose 5j - 5d = -10, -5d + 2 + 2 = -4j. Let g = 63 + j. What are the prime factors of g? 3, 19 Suppose 0b = -5b + 5. Let y = 8 + b. Suppose 3j + y = 6j. What are the prime factors of j? 3 Let r(y) be the first derivative of 28y3/3 + 7y*2/2 - y + 23. What are the prime factors of r(2)? 5 Suppose -15 = 5h, -932 = -3z - 2h + 1336. List the prime factors of z. 2, 379 Suppose -3j - 50 = -5y - 21, 3j + 1 = -2y. List the prime factors of 149 + (2 - 4 - j). 2, 3, 5 Let x(k) = -4k3 + 13k*2 - 2k - 12. Let m(h) = 7h3 - 25h*2 + 4h + 25. Let t(d) = 6m(d) + 11x(d). What are the prime factors of t(-6)? 2, 3, 31 Suppose 5d + 66 = -0d + 3t, -3d - 34 = t. Let x be d2/(-4) - 0. Suppose -3c + 3g + 111 = 0, c - 5g + x = 31. What are the prime factors of c? 2, 5 Let k be 3/((-4)/(-4)) + -3. Suppose -5j = -5s - 41 - 104, 2s + 4j + 28 = k. Let v = s - -52. What are the prime factors of v? 2, 7 Suppose j - 119 = -4k, -3k + 2j + 94 = -2j. Suppose 9 + k = b. What are the prime factors of b? 3, 13 Suppose 1149 + 4541 = 2i. What are the prime factors of i? 5, 569 List the prime factors of (20 + -222)/(-1 + -1). 101 Let y(g) = 2g*3 - 5g2 - g + 4. Let l(u) = -u3 - 23u2 + 24u + 5. Let f be l(-24). List the prime factors of y(f). 2, 31 Suppose 4z - 1801 + 387 = -2c, 5z - 695 = -c. What are the prime factors of c? 5, 11, 13 List the prime factors of (-64)/203955/(-14). 2, 113 Let g(c) = -c*2 - 7c - 6. Let h be g(-5). Let d(k) = 3 - k*2 + 0 - 2k + 3k + hk. What are the prime factors of d(4)? 7 Suppose x = 2w + 22, w = -w + 3x - 30. Let f = 57 + w. List the prime factors of f. 2, 3 Let p be ((-8)/10)/((-5)/(-25)). Let i = p - -8. Suppose 5d + 0n + 3n = 6, in = -4d. List the prime factors of d. 3 Let h = -3 + 4. Suppose 1579 + 21 = 4u. What are the prime factors of -3u/(-15)h? 2, 5 Suppose 3769 - 509 = 10n. Let c = -218 + n. List the prime factors of c. 2, 3 Let x(t) = -8t*2 - 182t + 20. What are the prime factors of x(-20)? 2, 5, 23 Suppose 5z + 2 = 22. Suppose zy - 6 - 2 = 0, -5j + 2y + 276 = 0. What are the prime factors of j? 2, 7 Suppose 112 = 35p - 27p. Suppose v + 0v = -3m + 126, -511 = -4v - 5m. Suppose -pa + 11a = -v. List the prime factors of a. 43 Suppose -3x = -3j + 1812, j + 5x + 37 = 641. List the prime factors of j. 2, 151 Let k(y) = 4y - 34. Let f(n) = -n*2 + 5n + 34. Let o be f(7). What are the prime factors of k(o)? 2, 23 Let h(x) = -17x + 193. What are the prime factors of h(-25)? 2, 3, 103 Let a(z) = -z3 - 12z*2 + 13z + 4. Let c be a(-13). Suppose h + m - 3m = 31, -5h + 167 = -cm. List the prime factors of h. 5, 7 Let g = -1 - -1. Suppose t + 3t - 16 = g. Suppose 19 + 1 = tz. List the prime factors of z. 5 Let i(d) = 2d - 5. Let s be i(3). Let h be (-1 - s) + 2 - -2. Suppose hq = -3q + 45. List the prime factors of q. 3 Let f(v) = 37v2 - 22v - 99. List the prime factors of f(-10). 3821 Suppose -y = 3z - 8z - 148, -3z + 12 = 0. What are the prime factors of y? 2, 3, 7 Suppose 4q = -4m + 1574 - 422, -3m - 5q + 864 = 0. What are the prime factors of m? 2, 3 Let q(t) = t3 + 35t*2 + 55t - 85. List the prime factors of q(-33). 2, 139 Suppose 30 = 4j - 78. Suppose -4v + 19 = 4w - 9, -v + j = 5w. Suppose -wb - b + 156 = 0. List the prime factors of b. 2, 13 Let x = 23 + -6. Let q be 8/(-68) + (-678)/x. What are the prime factors of 4/(0 - 4/q)? 2, 5 Let h = 432 + -413. What are the prime factors of h? 19 Let d(f) = -2f - 3. Let h be d(-2). Suppose p = 1 + h. Suppose a = -2o + o + 11, 0 = pa + 8. List the prime factors of o. 3, 5 Suppose 2b - 2t - 18 = 6, -2b + 3t = -24. Let w be 2/(-4) + (-114)/b. Let h(p) = p + 13. List the prime factors of h(w). 3 Let w = -64 - -40. Let l = 75 + w. List the prime factors of l. 3, 17 Let y(w) = 3w2 + 5w - 4. Let v(h) = -7h2 - 10h + 9. Let f(x) = -6v(x) - 13y(x). List the prime factors of f(-5). 2, 7 Let s = 1092 - -337. List the prime factors of s. 1429 Let g = 1660 - 960. List the prime factors of g. 2, 5, 7 Let z = -2500 - -3361. What are the prime factors of z? 3, 7, 41 Let y(m) = -m*2 + 24m - 31. Let v be y(22). What are the prime factors of (2 + v)(-40)/(-6)? 2, 5 Let p = -386 - -1174. What are the prime factors of p? 2, 197 Suppose 0v = -3v - w - 80, 0 = 3v + 2w + 82. Let n = 21 - v. List the prime factors of n. 47 Let d(g) = 2g*3 + 34g*2 + 19g - 12. Let j = -31 - -15. What are the prime factors of d(j)? 2, 7 Let i = -3 + 5. Let h(t) = -2t3 - 13t*2 + 5t - 12. Let b be h(-7). Suppose -j = 0, -ir + 3j = b - 16. List the prime factors of r. 7 Let c(d) = -d*3 + 8d*2 + d - 14. List the prime factors of c(7). 2, 3, 7 Suppose u - 5a = 5u - 27, 0 = 3u + a - 23. Suppose 2s - 2 - u = 0. Let c(q) = 7q - 12. List the prime factors of c(s). 23 Let g(y) = -y*3 + 47y*2 - 57y - 197. List the prime factors of g(44). 29, 107 What are the prime factors of (-15160)/(-8)(0 + 3 + -2)? 5, 379 Let s be ((-7)/3 - -2)/(3/(-387)). Suppose s = 9l - 974. List the prime factors of l. 113 Let t(g) be the second derivative of 0 - 5g + 1/2g*2 + 3/2g*3. List the prime factors of t(3). 2, 7 Let y be ((-5)/(-4))/((-4)/(-192)). Suppose yf = 56f + 496. What are the prime factors of f? 2, 31 Let w = 317 - 220. What are the prime factors of w? 97 Let g = 422 - 205. Suppose x - g = -3c, -63 = -4c + 2x + 233. What are the prime factors of c? 73 Let l(b) = -2b. Let h be l(-2). Let r = 53 - 48. Suppose i - h = -3m, 5i + 50 = rm + 170. List the prime factors of i. 19 Let y = -1322 - -2495. List the prime factors of y. 3, 17, 23 Let u be -94*7/(15 - 1). Let d be ((-79)/2)/((-2)/4). Let b = d + u. List the prime factors of b. 2 Let v	{ "pile_set_name": "DM Mathematics" }
. Let g(d) be the second derivative of d*4/12 + 5d*3/6 - 2d + 58. Calculate g(a). 6 Let i = -19 + 39. Let w(h) = 13 + i - 35 + h. Determine w(6). 4 Let i(t) = 11t2 - t. Let l(q) = -44q*2 + 5q. Let v(b) = -9i(b) - 2l(b). Suppose 15m - 7 = 22m. Calculate v(m). -10 Let u(a) = 5a - 2. Let q be (-6)/8-28/6. Determine u(q). 8 Let v(u) = -u2 - 13u - 1. Let m(c) = 4c2 + 40c + 4. Let k(n) = -2m(n) - 7v(n). What is k(10)? 9 Let t(r) be the second derivative of -3r5/20 - r4/12 + r2/2 - 8r. What is t(-1)? 3 Suppose -4h - 2k = 4, 2h - 3k + 2 = -0. Suppose -5n = 5d - 10, -d + 1 = -3d + 3n. Let v be (-16 - h)d/(-3). Let b(r) = -r2 + 5r - 2. Calculate b(v). -2 Let v(r) = r*2 + 4r - 7. Let c be v(-5). Let i(d) = -d*3 + 2d*2 + 3d. Calculate i(c). 10 Let s(w) = w + 1. Let l be s(-5). Let m(n) = 2n + 5. What is m(l)? -3 Let c be 8/(-5) - 21/(-35). Let x(g) = -2g*3 - 2g*2 - 2g - 1. Determine x(c). 1 Let u(i) = i*2 + 6i - 4. Let j(r) = 3r2 + 12r - 8. Let k(x) = -2j(x) + 5u(x). Give k(4). 4 Let t be -3 + 1 - 8/(-2). Let o(n) = 2n3 + 4 + 2n + 5nt - n3 + 0n. Give o(-5). -6 Let y(d) be the second derivative of -d5/20 - d4/3 + 7d3/6 + 3d*2/2 - 11d. Determine y(-5). -7 Suppose -12r - 12 = -9r. Let z(m) = 6m - 3. Give z(r). -27 Suppose -20 = 5u - u. Let y(x) be the first derivative of -7x + 5/3x*3 + 1/4x4 - 3 - x2. Give y(u). 3 Let h(a) = a*2 + 6a + 5. Let g(u) = -3u2 - 13u - 11. Let i(n) = -2g(n) - 5h(n). Let j(b) = -b + 2. Let m be j(6). Let y = 1 - m. Calculate i(y). 2 Let p(k) be the second derivative of -k5/20 + k4/2 - k*3/3 - 5k*2/2 + k - 27. Calculate p(5). 10 Let t(f) = -4 - 4f - f2 + 7 - 7 + 0. Give t(-3). -1 Let v = 6 + -1. Let y(d) = -d3 - 7d2 + 9d + 11. Let j be y(-8). Let t(s) = j - 4s - 4 - s2 + 2s*2. Give t(v). 4 Suppose 3v = d + 9, 5v - 14 = -2d + 1. Let k = 8 - 4. Suppose -19 + 3 = 4w + vt, 0 = kw - 2t + 16. Let p(b) = -b*2 - 4b + 4. What is p(w)? 4 Suppose 17l - 6l = 88. Let b(s) = s*2 - 8s + 8. Determine b(l). 8 Let z = 11 - 7. Suppose k = -zk. Suppose 10 = -4c - 2b, -2b - 2 = -kc + 2c. Let s(n) = -n + 4. Determine s(c). 8 Let o(m) = 3m - 4m - 2m2 + m2 + 5m + 7. Determine o(6). -5 Let d = 0 + 2. Let z(v) = 2v3 - v + 0v + 3 - 3v. Calculate z(d). 11 Suppose -2q + 4q - h - 2 = 0, -5h - 25 = 5q. Let w(v) = -5v + 3. Let n(z) = -15z + 8. Let j(k) = 4n(k) - 11w(k). Calculate j(q). 4 Let j = 13 + -10. Let p(i) = i3 - 5i*2 + 3i - 4. Determine p(j). -13 Let s(r) = 3r - 1. Let t(d) = -6d + 2. Let a(n) = -11s(n) - 6t(n). What is a(3)? 8 Let q(l) be the first derivative of l4/4 + l3/3 - l2 + l + 3. Let v = 1 + 8. Let r be 6/v - 2/(-6). Determine q(r). 1 Let k(a) = -a3 + 7a2 - 6a + 2. Let s be k(6). Let m(d) = 3d + 63d*2 - 5 + d - 62d*s. Determine m(-4). -5 Let t(c) = 2c*2 + 3c + 2. Suppose -5j = -0j - 10. Suppose 2l + 1 = -3k + j, 0 = l + 2k. Suppose -3v = lv + 10. Calculate t(v). 4 Let u be -1 - (-3)/(6/8). Suppose 0 = -5r + 3t + 16, 4 = -3t - 2. Let y(n) = n - 4n + 3 - 2 + rn. Determine y(u). -2 Suppose -1 = -5j + 4. Let m = 3 - j. Let p be (1 - 6/m) + 7. Let x(a) = -a2 + 5a + 3. Calculate x(p). 3 Let r(w) = w - 2 + 2. Let k(s) = 4s2 + 6s + 3. Let p(z) = -z*2 - z - 1. Let l(u) = -k(u) - 3p(u). Let g be l(-4). What is r(g)? -4 Suppose 0 = -d + 5d - 8. Let f(x) = -3x - x + 3x + 4 + d. Calculate f(3). 3 Let f(q) be the second derivative of 1/2q*2 + q + 0 - 1/6q*3. Calculate f(0). 1 Let z(y) = -2y*3 - 2y + 2 + 521y2 - 524y2 + y3. Calculate z(-2). 2 Suppose w + 3n + 19 = 2w, 4w - 36 = 2n. Let d(v) = v*2 - 4v - 6. Determine d(w). 15 Suppose 1 = j - 0j. Let m be (3/(-6))/(j/(-2)). Let u(q) = 4q3 - q2 + 1. Determine u(m). 4 Let k(b) = 9b3 - b2 - 12b + 14. Let c(m) = 5m3 - 6m + 7. Let v(s) = -7c(s) + 4k(s). Let q be (25/10)/(1/2). Give v(q). 2 Let i(f) be the third derivative of -f*5/60 - 7f4/24 - f3 - 3f2. Let h be i(-6). Suppose l + 2l + 6 = h. Let p(b) = b2 - 1. Determine p(l). 3 Let h = 6 - 1. Let q(s) be the third derivative of s6/120 - s*5/15 - 5s*4/24 - 5s*3/6 + 40s*2. What is q(h)? -5 Let b(u) = 11u*3 + 18u*2 + 15u - 9. Let a(m) = 4m3 + 6m*2 + 5m - 3. Let s(v) = 8a(v) - 3b(v). Determine s(-5). 3 Let l be 39/12 + 2/(-8). Suppose 0 = 4a + 3s + 4, -la - 2 - 1 = -4s. Let v(n) = -n*2 - 2n - 1. Calculate v(a). 0 Suppose 0y - 5o = 2y - 9, -4o - 4 = -4y. Let p(q) = q3 - 4q2 - q + 2. What is p(y)? -8 Let o(c) = 1. Let y(w) = w2 - 6w + 1. Let i(g) = -5o(g) - y(g). Determine i(6). -6 Let a(h) = -h*2 - 2h + 4. Suppose -r + 5f - 1 = -4r, 5 = -5r - 5f. Determine a(r). 1 Let t(o) = -o*3 + 3o*2 + o - 3. Let p be (3 + 0)2/(-6). Let a = p - -4. Determine t(a). 0 Let k be (-35)/(-20) + (-1)/(-4). Suppose kq - 3 = 2z + 9, 4z - q + 15 = 0. Let a(m) = 3m + 4. What is a(z)? -5 Suppose -5i - 3c + 13 = -i, -3i + 4c = 9. Suppose p = 1, 5p + 6 = 4u - i. Let y(s) = -s*3 + 0s*u + 0s3. What is y(0)? 0 Let x(a) = -a2 - 8a - 7. Let b be (-96)/(-10) + 2/5. Suppose -k - 11 = 2k - 5q, 5q + b = 0. Determine x(k). 0 Let a(l) = -l - 6. Let z(j) = j + 5. Let m(t) = 5a(t) + 6z(t). Suppose -3q - u = -0q - 9, 0 = 5q + 2u - 15. Calculate m(q). 3 Let u = -4 + 3. Let j(p) = 7p3 - p2 + p + 1. What is j(u)? -8 Let t(w) be the second derivative of w5/24 - w4/24 - w3/6 + 10w. Let i(u) be the second derivative of t(u). Calculate i(-2). -11 Let x(j) = -j*3 + 3j*2 + 2j - 3. Let k(u) = -2u + 10. Let q be k(3). Give x(q). -11 Let n(y) = 3y + 1. Let p be 5 - (2 + -2 - -1). Let k(u) = -4 - 11u - 2u + pu. Let q(i) = 2k(i) + 7n(i). Calculate q(-1). -4 Let k(z) = 2z*2 + z + 2. Suppose 4d + 16 = 2a, 5a - 2 - 11 = d. Calculate k(d). 17 Suppose 0 = 4t - 4f + 4, 1 = 5t - f - 2. Let n = 3 - t. Suppose -nm + 1 + 1 = 0. Let v(a) = -5a2 + a. Determine v(m). -4 Let i(o) = -o2 - o - 11. Let n be 61(-5)/(-10). Suppose 2c + nc = 0. Give i(c). -11 Let b(a) be the first derivative of -1 - a2 + 6 - 3a + 0a + 2. What is b(-4)? 5 Let y(j) be the second derivative of -1/20j*5 - 3/2j*2 + 3j + 0 - 1/4j4 - 5/6j*3. Calculate y(-3). 12 Let c be 1/(-2)24/(-2). Let g(u) = 3u2 + 2u + 1. Let x be g(-1). Let z(f) = 9f - 3f - f + 4 - f*x. Give z(c). -2 Let p be 2/(-8) - (-26)/8. Suppose -3j + 3 = s, -pj + 8s = 3s - 3. Let u(h) = 27h + 7. Let v(q) = 13q + 3. Let o(c) = -2u(c) + 5v(c). Calculate o(j). 12 Let m(k) be the first derivative of k5/60 + k4/4 + k3/3 + k2 - 1. Let q(s) be the second derivative of m(s). Let h = 6 + -11. What is q(h)? -3 Let p = -3 - -2. Let t(o) = 4o*2 - 3o*2 + 4o - o + 4o3 - 2o. What is t(p)? -4 Let b = 0 - -2. Suppose -4x - 2f + 3f - 9 = 0, 4x + 18 = -bf. Let k(y) = -y2 - 3y + 1. Determine k(x). 1 Suppose -3g = -8g - 2r + 11, -5g + 7 = 4r. Let w(d) = -gd + 1 + d*3 + 5d + 3d2 - 2d*2. Let n = 8 - 9. What is w(n)? -1 Let o be ((-24)/(-18))/((-1)/(-3)). Let y(a) = 4a + o - 4a + 2a - a. Determine y(-5). -1 Let d(n) = 2n3 - 3n*2 + 3n - 1. Suppose -10 = -5h + 2g + g, 2 = h - 4g. Determine d(h). 9 Let c(z) = z2 + 12z + 15. Let s be c(-10). Let y(f) = f*2 + 5f - 2. What is y(s)? -2 Suppose 14 = -9x + 2x. Let u be 6/8 - (-2)/8. Let j(n) = u - 5 + 3 + n. Give j(x). -3 Let z(l) = -1 + 12l - 7l + 5l. Suppose -4f - 5 + 20 = -v, 5v = -2f + 13. Calculate z(v). 9 Let n = -1 - -5. Suppose -3l = -5l - n. Let g(i) be the second derivative of -i4/6 - i3/6 + 3i. Calculate g(l). -6 Let x = -2 + 2. Let d(k) = 4 + x - 1 + k. Let p be (-150)/9013. Calculate d(p). -2 Let z = 5 - 2. Let j(y) = -y - 1. Let g(i) = -4i - 6. Let r(q) = 3g(q) - 16j(q). What is r(z)? 10 Let a(r) = -2r. Let t be a(0). Let o(p) be the third derivative of 4p*2 + tp - 1/6p3 + 0 - 1/4p4. Give o(-1). 5 Let l(t) = t2 + 4t - 3. Suppose 3u - 3h = -0u - 18, 4u - 8 = -4h. Let n(k) = -k*2 + 2k + 3. Let o be n(u). Calculate l(o). 2 Suppose 5j = 10, 5f + 4 + 8 = -4j. Let z(v) = -v. Give z(f). 4 Let x(t) = 6t. Let z(i) = 5i. Let o(d) = 3x(d) - 4*z(d). Let a = -2 + 0. Let g	{ "pile_set_name": "DM Mathematics" }
= 5069/2 - 2534. Let z be 1 - 0/(3/(-1)). What is the third smallest value in 0, 3, z, p? z Suppose 15 = -4t - u + 1, -5t + 4u = 7. Let n = 4.057 + -0.057. Which is the second biggest value? (a) t (b) n (c) 2/43 c Let l = -8 + 8. Let f = 94 + -94.4. Which is the second biggest value? (a) f (b) l (c) 0.02 b Let s = 595 + -600. What is the second smallest value in -4, s, 1/2? -4 Let l be (2 + 0)1/(-5). Let v = -0.613 - -0.65. Let h = -0.237 + v. What is the third biggest value in h, -2/7, l? l Suppose 2s - 8s + 30 = 0. What is the second biggest value in -81, s, -3? -3 Let t = 1/2704 - -1351/2704. What is the smallest value in 2/21, t, -4/3, -0.4? -4/3 Let s = 0.7 + 2.3. Let c(u) = -u3 - u2 - u + 2. Let v be c(0). Let a be v/(-3)15/(-30). What is the third biggest value in s, -1, a? -1 Let u = -586.5 + 587. Let t = -0.3 + 0.5. Which is the second biggest value? (a) u (b) t (c) 2 a Let z = 951 + -11401/12. What is the third smallest value in -1/3, z, 1? 1 Suppose 17 = 5n - 2m, -2m - 12 = -3n - 1. Let k be (1 - 2)/(2/(-30)). Let t be (k/6)/(-1) + n. Which is the second smallest value? (a) 1/4 (b) -1 (c) t a Let b = 486 + -481. What is the second smallest value in -4, -3, b? -3 Let w = 149 + -210. Let y = w + 66. Which is the biggest value? (a) -5 (b) 2.6 (c) y c Suppose -3q + 0m + 2m = -54, -q - 3m = -18. Suppose 0 = -4z + z + q. Let j = 817 + -816.8. What is the third smallest value in 0, z, j? z Let l = -12.12 + 12.1. Which is the third smallest value? (a) 0.3 (b) -2 (c) 12 (d) l a Suppose j - 3d + 8 = 0, -9 + 1 = -5j - d. Let z = -2 - -1. Let w = 0 + z. What is the smallest value in -1/4, w, j? w Suppose -s + 5m = -7, 10m + 1 = 3s + 5m. Which is the third biggest value? (a) -1/6 (b) 0.3 (c) 1.3 (d) s a Let s be (-2)/24 + (-3)/((-3960)/638). What is the third biggest value in -0.4, -3/2, s, 0.57? -0.4 Let g = -0.8 - -0.5. Let h be (-228)/(-44) + (-7)/((-63)/(-45)). Which is the fourth biggest value? (a) -3 (b) 0 (c) h (d) g a Let q = 0.6 - 8.6. Let g = q + 8. What is the smallest value in g, -2/13, 1/2? -2/13 Let x = -740 - -744. What is the third biggest value in 2, 0, x, -5? 0 Let n = -97 - -67. Let w = 30.1 + n. Suppose 2z - 35 = -31. Which is the second biggest value? (a) z (b) -3 (c) w c Suppose 436 = -48s - 140. Let x = 0.09 + -2.09. Which is the fourth biggest value? (a) x (b) s (c) -4 (d) -4/5 b Let m = -61 + 67. Let o = -8 + 10. Let u = o + 2. Which is the second biggest value? (a) 0 (b) m (c) u c Let m = -1.63 - 1.37. Which is the third smallest value? (a) m (b) -16 (c) 0.3 c Let p = -1/159 + -103/477. What is the fourth smallest value in 5, p, 1/4, 1/3? 5 Suppose -3i - 840 = -51. Let a be ((-1)/3)/(2/i). Let v = a + -44. What is the biggest value in -0.4, v, -0.3? v Suppose -4x + 3j = 1, 13x + 3 = 16x - 3j. Which is the smallest value? (a) 1 (b) -0.1 (c) x (d) -1 c Let w = -1447.6 - -1448. Let k = 0 + 0. Let z = k + -1. Which is the second smallest value? (a) w (b) z (c) -2/3 c Let t = -90 + 89.8. What is the second smallest value in -2, t, -0.5, -0.1? -0.5 Let h(l) = l*2 - 14l - 9. Let s be h(15). Suppose 0 = sd - 0d + 30. Which is the third smallest value? (a) d (b) 4 (c) -6 b Let k = -0.2 - 0. Let b(u) = -u*2 - 9u + 5. Let r be b(-10). What is the second smallest value in 0.1, k, r? k Let t = -38/65 - 8/13. What is the third biggest value in -17, -0.5, t? -17 Let w = -168 - -187. What is the third biggest value in -0.03, w, -5, 5? -0.03 Suppose 52 = -4o + 5r, 0 = o - 5o - 4r - 16. Let j be (-5)/(-15)o9/6. Which is the third smallest value? (a) -1 (b) -4/3 (c) j a Let d be -7 + 2 - 555/(-105). Let n be ((-4)/(-10))/(60/50). What is the second smallest value in n, 5, d? n Let l = -3.3 + 4. Let f = 107.7 - 162.4. Let x = 55 + f. Which is the biggest value? (a) 0 (b) l (c) x b Let x = -305 - -303. What is the second smallest value in 2/7, x, 5, 0? 0 Let j be 6/24 - (-3)/(-7). Let i = j - 4/7. What is the third smallest value in -0.04, 1, i? 1 Let p = -2.4 + 0.6. Let q = p + 2. Let j = 308 + -307.5. Which is the biggest value? (a) 1/6 (b) q (c) j c Let y = -2.25 - -0.25. Let b = 14 + -10. Let f = 2 - 1. What is the third biggest value in b, f, y? y Let w(c) = 3c - 68. Let f be w(22). What is the third smallest value in f, 3/4, 17.9? 17.9 Let v = 2.3 + -1.7. Let m = v - -0.1. Let q = m + -0.2. Which is the third smallest value? (a) -1/6 (b) q (c) -1/2 b Suppose 560 = -12k + 4k. Let t = 279/4 + k. What is the second smallest value in t, 2, 2/3, -0.1? -0.1 Let d = 0.192 - -77.808. Let q = d + -80. Let j = 316/165 - 26/15. Which is the third biggest value? (a) -1 (b) q (c) j b Let n = -0.11 + -0.49. Let g = 216/133 + -20/19. Let y = 171/106 - 6/53. What is the biggest value in g, n, y? y Suppose -1 = -4i + 7. Suppose -ic - c = -k, 2c - 2k + 4 = 0. Let m be -1 - ((-1 - 6) + 2). What is the second smallest value in m, -0.01, c? c Let f = -0.1408 - -2.1408. What is the third biggest value in -14, f, 1/2? -14 Let p = 1.2 + -48.2. Let z = p - -48. Let r = 1 + -1. What is the third smallest value in 0.1, r, z? z Let t = 0.009 + -0.029. Let a = t - -0.12. Let v(s) = 4s. Let d be v(1). What is the third smallest value in 2/19, a, d? d Let i = 7 + -3. Let q be ((17 - 2)-2)/(-1). Let j be (3/q)/((-3)/(-6)). Which is the second smallest value? (a) i (b) -0.3 (c) j c Let l = 895/44 - 210/11. Let i = -85 + 85.4. What is the smallest value in i, l, 1? i Let p be (-1)/(-3) - ((-1191)/261 - -5). Let y = -35/58 - p. What is the second biggest value in y, 3/5, 21? 3/5 Let y = -1075 + 1074.7. Which is the second biggest value? (a) 2/1087 (b) -1/11 (c) y (d) -0.5 b Let y = -0.2531 + -0.1469. Which is the second smallest value? (a) y (b) 1/2 (c) -1/5 (d) 0.1 c Let a = 691 - 694. Let d be (4/(-6))/(1/(-6)). Let v(k) = -k2 + 6k - 4. Let u be v(d). What is the second biggest value in a, u, -6? a Let h = -0.2 + -0.2. Let k be ((-8)/(-7))/2(2646/(-140))/(-27). What is the second smallest value in h, k, -0.6? h Let k be 0/1 - (-4)/10. Let p = 10 + -5. Let z = 3.9714 - -0.0286. What is the second smallest value in k, p, z? z Let f be (2/3)/(2/6). Let q = -89.66 - -90.36. Which is the second smallest value? (a) f (b) q (c) 0.1 b Let j = -104.7 - -109.69. Let w = -0.01 - j. Let i = w - -5.1. Which is the third smallest value? (a) 3 (b) -2 (c) i a Let m be (-53)/(-106)(-172)/14 + 6. Which is the second smallest value? (a) m (b) -0.1 (c) -0.85 (d) -0.3 d Suppose 1 = -i - 2a + 7, -2i + 4a = 4. Suppose 3 = -3v - 3. Let o be (v/1)/(1/i). What is the third smallest value in -2, -3, o? -2 Let o = -241 + 242. What is the third biggest value in -2, -1/2, 1/3, o? -1/2 Let r be (-2)/(-4) + (0 - 1). What is the third smallest value in r, 0.4, -35? 0.4 Let r = 3 + -11. Let m = -17 + 8.8. Let q = r - m. What is the smallest value in q, 2, -0.2? -0.2 Let j = -618 + 618.028. Which is the biggest value? (a) j (b) -3/5 (c) 2/13 (d) -3 c Suppose 2m = 2f + 14, -m - 5f = 2 + 9. Suppose 5d - 3k - 3 = 0, -md = -0d + 4k + 4. Which is the biggest value? (a) d (b) 1/3 (c) -2 b Let t = 2474 - 2471. Let l = -1 + 4. Let r = l - 6. Which is the third biggest value? (a) 2/13 (b) t (c) r c Let h = -2/283 - 1411/566. What is the fourth smallest value in -12, h, 0, -5? 0 Let i = 0.31 - 0.3. Let j = i - -0.05. Let f = j - 0.36. Which is the biggest value? (a) f (b) -3/2 (c) 5 c Let p = -11.6 - -20.8. Let f = p + -4. What is the biggest value in 1, 0.5, f? f Suppose -42 = -36o - 222. Which is the second biggest value? (a) o (b) 2/5 (c) -16 a Let f = -34 - -19. Let r be ((-2)/6)/((-50)/f). Let c = -11.8 - -12. What is the third smallest value in r, c, -0.9? c Let r(z) = z3 - 8z*2 + 2z - 9. Let q be r(8). Suppose qj - 16 = 11j. Which is the third biggest value? (a) 0.03 (b) j (c) 3/7 (d) 0 d Let m = 0.13 + 0.07. Let f = 991/7 - 142. What is the third biggest value in m, f, -5? -5 Let r = 1027 + -1088. Which is the second smallest value? (a) -0.2 (b) r (c) -2 c Let v = -818/77 + 120/11. Which is the third biggest value? (a) -0.01 (b) 2/5 (c) -4 (d) v a Let s be (-121)/6 + (-1 - -1)*-1. Let g be 2 + -3 - (-907)/42.	{ "pile_set_name": "DM Mathematics" }
302816 to the nearest integer? 12 What is the fourth root of 1073135 to the nearest integer? 32 What is 273580 to the power of 1/2, to the nearest integer? 523 What is the tenth root of 4038579 to the nearest integer? 5 What is the fifth root of 37642433 to the nearest integer? 33 What is the cube root of 733894 to the nearest integer? 90 What is 3780655 to the power of 1/3, to the nearest integer? 156 What is 1301008 to the power of 1/9, to the nearest integer? 5 What is 75023 to the power of 1/4, to the nearest integer? 17 What is the square root of 309681 to the nearest integer? 556 What is the third root of 242556 to the nearest integer? 62 What is 12045774 to the power of 1/2, to the nearest integer? 3471 What is the fifth root of 11500718 to the nearest integer? 26 What is 6507366 to the power of 1/2, to the nearest integer? 2551 What is 360973 to the power of 1/4, to the nearest integer? 25 What is 770936 to the power of 1/2, to the nearest integer? 878 What is the square root of 4271824 to the nearest integer? 2067 What is the square root of 2857686 to the nearest integer? 1690 What is 74943 to the power of 1/8, to the nearest integer? 4 What is 784554 to the power of 1/3, to the nearest integer? 92 What is the cube root of 208294 to the nearest integer? 59 What is the third root of 335043 to the nearest integer? 69 What is the cube root of 2335107 to the nearest integer? 133 What is 21305 to the power of 1/2, to the nearest integer? 146 What is 2027426 to the power of 1/2, to the nearest integer? 1424 What is the cube root of 56895 to the nearest integer? 38 What is the square root of 26787973 to the nearest integer? 5176 What is the third root of 296041 to the nearest integer? 67 What is 34342795 to the power of 1/2, to the nearest integer? 5860 What is the fourth root of 6396833 to the nearest integer? 50 What is 80743 to the power of 1/2, to the nearest integer? 284 What is 868206 to the power of 1/10, to the nearest integer? 4 What is the square root of 13104829 to the nearest integer? 3620 What is the third root of 763449 to the nearest integer? 91 What is the square root of 13776046 to the nearest integer? 3712 What is 5070225 to the power of 1/3, to the nearest integer? 172 What is the cube root of 11102154 to the nearest integer? 223 What is the square root of 12412992 to the nearest integer? 3523 What is the square root of 141305 to the nearest integer? 376 What is the third root of 372092 to the nearest integer? 72 What is 798379 to the power of 1/10, to the nearest integer? 4 What is 608655 to the power of 1/2, to the nearest integer? 780 What is 29547252 to the power of 1/5, to the nearest integer? 31 What is 3226071 to the power of 1/2, to the nearest integer? 1796 What is 7553096 to the power of 1/2, to the nearest integer? 2748 What is 334775 to the power of 1/3, to the nearest integer? 69 What is the square root of 451776 to the nearest integer? 672 What is the square root of 8466699 to the nearest integer? 2910 What is the square root of 5916811 to the nearest integer? 2432 What is the fourth root of 16516158 to the nearest integer? 64 What is 429318 to the power of 1/2, to the nearest integer? 655 What is 664522 to the power of 1/2, to the nearest integer? 815 What is the third root of 68215 to the nearest integer? 41 What is the square root of 6950469 to the nearest integer? 2636 What is 936204 to the power of 1/5, to the nearest integer? 16 What is the tenth root of 2537121 to the nearest integer? 4 What is the fourth root of 944791 to the nearest integer? 31 What is 1887886 to the power of 1/2, to the nearest integer? 1374 What is 1828881 to the power of 1/6, to the nearest integer? 11 What is 101678 to the power of 1/9, to the nearest integer? 4 What is the cube root of 90496 to the nearest integer? 45 What is 4779102 to the power of 1/4, to the nearest integer? 47 What is the square root of 14414092 to the nearest integer? 3797 What is the eighth root of 2216678 to the nearest integer? 6 What is 9925202 to the power of 1/3, to the nearest integer? 215 What is the square root of 11430714 to the nearest integer? 3381 What is 15943775 to the power of 1/7, to the nearest integer? 11 What is 340978 to the power of 1/7, to the nearest integer? 6 What is the square root of 2319437 to the nearest integer? 1523 What is 152765 to the power of 1/6, to the nearest integer? 7 What is the third root of 1600918 to the nearest integer? 117 What is the square root of 266150 to the nearest integer? 516 What is the square root of 4612906 to the nearest integer? 2148 What is 3336844 to the power of 1/3, to the nearest integer? 149 What is 1924341 to the power of 1/10, to the nearest integer? 4 What is the square root of 2088860 to the nearest integer? 1445 What is 522931 to the power of 1/3, to the nearest integer? 81 What is the third root of 5367329 to the nearest integer? 175 What is 12802679 to the power of 1/6, to the nearest integer? 15 What is the cube root of 21116 to the nearest integer? 28 What is the fifth root of 199970 to the nearest integer? 11 What is the cube root of 9223036 to the nearest integer? 210 What is 79820 to the power of 1/2, to the nearest integer? 283 What is the ninth root of 834802 to the nearest integer? 5 What is the square root of 1386910 to the nearest integer? 1178 What is 178594 to the power of 1/6, to the nearest integer? 8 What is the eighth root of 216018 to the nearest integer? 5 What is 1997631 to the power of 1/3, to the nearest integer? 126 What is 995297 to the power of 1/6, to the nearest integer? 10 What is 255565 to the power of 1/2, to the nearest integer? 506 What is the square root of 620586 to the nearest integer? 788 What is 1015052 to the power of 1/10, to the nearest integer? 4 What is the tenth root of 4705 to the nearest integer? 2 What is 9493322 to the power of 1/2, to the nearest integer? 3081 What is the square root of 1342715 to the nearest integer? 1159 What is 531892 to the power of 1/2, to the nearest integer? 729 What is 235269 to the power of 1/3, to the nearest integer? 62 What is 13710472 to the power of 1/2, to the nearest integer? 3703 What is the square root of 623894 to the nearest integer? 790 What is 1296366 to the power of 1/2, to the nearest integer? 1139 What is the square root of 758317 to the nearest integer? 871 What is 298283 to the power of 1/9, to the nearest integer? 4 What is the square root of 839054 to the nearest integer? 916 What is 460622 to the power of 1/3, to the nearest integer? 77 What is the third root of 1644017 to the nearest integer? 118 What is 24070639 to the power of 1/3, to the nearest integer? 289 What is the sixth root of 134325 to the nearest integer? 7 What is the square root of 11850095 to the nearest integer? 3442 What is 524904 to the power of 1/3, to the nearest integer? 81 What is the fourth root of 136975 to the nearest integer? 19 What is 2056858 to the power of 1/3, to the nearest integer? 127 What is 46822 to the power of 1/2, to the nearest integer? 216 What is the square root of 703735 to the nearest integer? 839 What is 4119362 to the power of 1/3, to the nearest integer? 160 What is the cube root of 2649193 to the nearest integer? 138 What is 362765 to the power of 1/2, to the nearest integer? 602 What is 9522970 to the power of 1/4, to the nearest integer? 56 What is 236019 to the power of 1/4, to the nearest integer? 22 What is the square root of 1649730 to the nearest integer? 1284 What is the square root of 587184 to the nearest integer? 766 What is the cube root of 3221825 to the nearest integer? 148 What is 8877319 to the power of 1/4, to the nearest integer? 55 What is the tenth root of 671483 to the nearest integer? 4 What is 784799 to the power of 1/5, to the nearest integer? 15 What is the fourth root of 103861 to the nearest integer? 18 What is 1368755 to the power of 1/5, to the nearest integer? 17 What is the square root of 503687 to the nearest integer? 710 What is 3080109 to the power of 1/2, to the nearest integer? 1755 What is 305231 to the power of 1/5, to the nearest integer? 13 What is the square root of 50457 to the nearest integer? 225 What is 2148905 to the power of 1/2, to the nearest	{ "pile_set_name": "DM Mathematics" }
(d) -3 d Which is the third smallest value? (a) 5/6 (b) -5/2 (c) 0.474 (d) 4 (e) -1/5 c Which is the third smallest value? (a) -2/24815 (b) 0 (c) 5 (d) 2 (e) -3 (f) -2 a What is the sixth biggest value in 1, -2, 0.3, -2568, -1/8, -3? -2568 Which is the third biggest value? (a) -1/3820 (b) -4 (c) 2/5 (d) 4 (e) -2/25 a What is the second biggest value in -30, -12, 0.0088? -12 What is the second smallest value in -17, 407, -0.5, 0.125, 3? -0.5 Which is the biggest value? (a) 3 (b) -4.89 (c) 2.54 a What is the biggest value in -5, 0, 4922, 25? 4922 What is the third biggest value in -1/2, -3/5, 1, 57, 0.08, -2/7? 0.08 Which is the second biggest value? (a) 2/7 (b) 12 (c) -3431 a Which is the third smallest value? (a) -4/9 (b) 23/6 (c) -30411/2 b What is the second smallest value in -4, 18, -1, 0? -1 What is the third biggest value in -7, 1, 18.81? -7 Which is the smallest value? (a) -325/8 (b) 2 (c) 7/4 (d) 0.2 (e) 0 a What is the biggest value in -17, -4, 0.032564? 0.032564 What is the fifth smallest value in 7, -1, -6, -46, -2/19? 7 Which is the fifth biggest value? (a) 4 (b) 0.5 (c) -2 (d) 0.06 (e) -9 (f) -127 e What is the fourth smallest value in -10, 6, -0.6, -5, -7, 32? -0.6 Which is the smallest value? (a) -18 (b) -3 (c) -141 c What is the fourth smallest value in 0.2, 0.4, -2/190483, -0.2? 0.4 Which is the fifth smallest value? (a) 0 (b) -114 (c) 2/3 (d) 2/7 (e) -4 (f) -2 d What is the third smallest value in 89/5, -1, -53? 89/5 Which is the biggest value? (a) 121 (b) 3 (c) 2/13 (d) -153 a What is the third biggest value in 0.29, 5, 0.04, -0.7? 0.04 What is the smallest value in 2603, 5, 0.4, 2, -1.5, -5? -5 Which is the smallest value? (a) 0.361 (b) -0.2 (c) 1/8 (d) -4/5 (e) 3 (f) -1/2 d Which is the second biggest value? (a) 102 (b) -13667 (c) -0.3 c Which is the second biggest value? (a) -1/2 (b) 0.044464 (c) -3 (d) 0 d Which is the fourth smallest value? (a) 3/11 (b) 1 (c) 2 (d) -82 (e) -3/2 b Which is the second biggest value? (a) 14/13 (b) 1/2 (c) 1 (d) -0.5 c Which is the fourth biggest value? (a) -2.5 (b) 0.4 (c) 5 (d) 2/11 (e) 2236 (f) 4/9 b Which is the second biggest value? (a) 3 (b) 41 (c) -2 (d) 2/19 (e) -74 (f) 0.06 a Which is the smallest value? (a) 1/4 (b) -7 (c) 3 (d) 2.09 b Which is the smallest value? (a) -5 (b) 0.2 (c) -13/36 (d) -1 (e) 0.02 a What is the third smallest value in 1/4, -5, 15, -2.5, 7/4? 1/4 Which is the second smallest value? (a) 0.11 (b) 0.4 (c) -3/2 (d) -0.1 d What is the fifth smallest value in 1, 5, 0.1, 483, 8/17? 483 What is the third biggest value in 158327, -5, -1? -5 What is the fifth biggest value in 0.1, -1200/19, -1/2, 0.2, 2? -1200/19 Which is the third biggest value? (a) 2/5 (b) 0 (c) 2 (d) -549 b Which is the second smallest value? (a) 52 (b) 2938 (c) -3 a Which is the second biggest value? (a) 1 (b) 0.1 (c) -363 (d) -0.119 (e) 1/6 e What is the third smallest value in -169, 1/5, 1.8? 1.8 What is the biggest value in -2, 2/41, 1/2, 70, 1/3? 70 What is the third smallest value in -18, 9/61, -26? 9/61 What is the smallest value in -44645, 2, -9? -44645 Which is the third biggest value? (a) 0.2 (b) 13 (c) -5 (d) 2 (e) 5 (f) 2/17 d Which is the sixth biggest value? (a) 7 (b) 2/9 (c) 0.13 (d) -1 (e) 0.1 (f) -3 f Which is the biggest value? (a) 7/5 (b) 78 (c) -2.1 b Which is the third smallest value? (a) -0.5 (b) 0.7 (c) -2 (d) 5 (e) 35 (f) -0.4 f Which is the second biggest value? (a) 6/11 (b) 0.2 (c) 38/35519 b Which is the third smallest value? (a) -2.771 (b) -2/11 (c) 36 c What is the smallest value in 0.03465, -3, -7, 0.4? -7 Which is the sixth biggest value? (a) 4 (b) -7 (c) 1 (d) -0.038 (e) -26 (f) 2/11 e Which is the third biggest value? (a) -0.01 (b) 430 (c) 5 (d) -17 a Which is the fourth smallest value? (a) 2/15 (b) 6 (c) 0 (d) -1 (e) -1/1162 a Which is the smallest value? (a) 2 (b) 23 (c) -1 (d) -5 (e) 0.3 (f) 14 d What is the third smallest value in 0.5, 3, -2/159, 0.05, 16? 0.5 What is the fourth smallest value in -2/11, -51/4, 13, 3/5, -3/8, -1/2? -2/11 What is the third biggest value in 54/7, -1/4, 50? -1/4 What is the biggest value in -1, 1.34, -0.006? 1.34 Which is the smallest value? (a) 2/9 (b) -5 (c) -209 (d) 2 (e) 9 c What is the third biggest value in 0.539, 2, 1/6, 0.2, -2, -0.2? 0.2 What is the fourth biggest value in -5, -2/3, 0.953, 2, 3? -2/3 Which is the third smallest value? (a) -2/9 (b) 1606 (c) 2/313 b Which is the fourth biggest value? (a) 1 (b) -14/5 (c) -2/3 (d) 0.1 (e) -5 b What is the biggest value in -17, 16, -4? 16 What is the second smallest value in -2, -14/41, -0.4? -0.4 What is the second biggest value in -1/5, 0, 4/7, 2/5675, -2/11, 1/4? 1/4 What is the smallest value in -4, 6, 5276, 1/4, -0.4? -4 What is the fourth biggest value in 5, -0.1, 28, 75, -62, 1? 1 Which is the smallest value? (a) -0.1 (b) 3 (c) 70/31 (d) -1/175 (e) -2/5 (f) -1 f Which is the fourth smallest value? (a) 3 (b) 8/7 (c) -581 (d) 4 d Which is the third biggest value? (a) 0.38 (b) -5 (c) 3/5 (d) 494 a Which is the fifth biggest value? (a) 21 (b) -1 (c) -3 (d) 3 (e) 16 c Which is the third biggest value? (a) -17523 (b) -2 (c) -0.4 a Which is the third biggest value? (a) -5.5 (b) 1/2 (c) -3728 c What is the smallest value in -43, 61, -1.5, 18? -43 Which is the fourth biggest value? (a) 3/4 (b) 1 (c) 0.4 (d) 0 (e) -13.3 d What is the fifth biggest value in 1/22, -2, -110, -1.1, 1? -110 Which is the sixth biggest value? (a) 0.06 (b) -1/171 (c) -3 (d) 1 (e) 3 (f) -4 f What is the second biggest value in -112.27, -2, 0? -2 What is the second smallest value in -0.03, 1/10, -0.1, 1/6? -0.03 Which is the biggest value? (a) -368 (b) 12/101 (c) 0.4 c Which is the second biggest value? (a) 1/6 (b) -1930 (c) 0.0919 c What is the second biggest value in 7, -1/3, -4384? -1/3 What is the sixth smallest value in 0.02057, 0.3, -1, -0.2, 2, -0.5? 2 What is the biggest value in 3/8080, 0.07, 5? 5 What is the smallest value in 21, -2/2463, 5? -2/2463 Which is the fourth smallest value? (a) 4 (b) 5 (c) -19 (d) -6 (e) -0.5 (f) 0.1025 f Which is the third biggest value? (a) -5 (b) 10 (c) 1/5 (d) 42 c Which is the second biggest value? (a) 1 (b) -140 (c) 0.05 (d) 48 a Which is the sixth biggest value? (a) -3 (b) -0.37 (c) 4 (d) -0.5 (e) -1 (f) 0.2 a Which is the third smallest value? (a) 4 (b) 2/3 (c) 1512 (d) 0.4 (e) -6 b What is the fifth biggest value in 0, 1, -2, -5, -259? -259 Which is the smallest value? (a) -4/5 (b) -801 (c) -2 b What is the fourth smallest value in -4, 2, 0.02, 30, 2/9? 2 Which is the sixth smallest value? (a) 14/9 (b) 0.1 (c) -0.2 (d) -2.5 (e) 2 (f) -2 e Which is the second smallest value? (a) -0.2 (b) 1.54 (c) 2/709 (d) -1/2 (e) -2/9 e What is the biggest value in 263.8, -2/5, 129? 263.8 Which is the fifth biggest value? (a) -5/2 (b) 10 (c) 1/2 (d) 0.145 (e) 2.7 a Which is the third smallest value? (a) -2/19 (b) -1419 (c) -2 (d) 253 a What is the biggest value in 2, 1/4, 13, 1, 5, 3970? 3970 Which is the second biggest value? (a) 1 (b) 0 (c) -0.6 (d) -5 (e) 0.3 (f) 1/2 f What is the third smallest value in 2/21, -101, -339? 2/21 Which is the fourth biggest value? (a) -4 (b) 2/3 (c) 2 (d) -19 (e) 5 (f) -22 a Which is the third smallest value? (a) -0.1 (b) 65/2 (c) -1 b Which is the biggest value? (a) 5 (b) 3/2 (c) -149/16 a What is the third biggest value in -0.2, -790, 57? -790 Which is the third biggest value? (a) -4/11 (b) -2 (c) 7 (d) 2 (e) 38.3 (f) -0.1 d What is the third smallest value in 0.4, 0, 4, 1, -37/4, 2/11? 2/11 What is the fourth biggest value in -3/2, 2/19, -0.4, 0.04, 29/4, 0? 0 Which is the second smallest value? (a) -432 (b) -14 (c) -4 b What is the third smallest value in -10, -3, 25/38? 25/38 What is the third smallest value in -2/21, 0.77, 4? 4 What is the second biggest value in 2375, 3, 8.8, -3? 8.8 What is the biggest value in -3, -2.24, 3/38, -4? 3/38 What is the smallest value in -13, 6, 3, 0.1, 0.07? -13 What is the biggest value in -1/2, -5/2, -163/3, 0.1? 0.1 W	{ "pile_set_name": "DM Mathematics" }
28a - 4. Let z be i(5). Let m = -436 - z. What are the prime factors of m? 11, 23 List the prime factors of 7858 - 363 - 42/4. 59, 127 Suppose 7i + 10 = 5i. Let d(n) = n*3 + 7n*2 + 10n - 2. Let t be d(i). List the prime factors of (-5 - -9 - t)(-16)/(-6). 2 Suppose -28178x + 537510 = -28163x. List the prime factors of x. 2, 19, 23, 41 Let s = 3638 - 863. List the prime factors of s. 3, 5, 37 Suppose 5x - 20 = -10. Suppose 0o - 18 = -4o - xv, 4v = -3o + 16. What are the prime factors of -4 + (8 - o) + 117? 3, 13 Suppose 5s - 323421 = 3i, 5s - 323453 = -88i + 87i. List the prime factors of s. 3, 21563 Let w be 32150/8 - 90/120. Suppose -5n = -d - 4022, 0 = 5n + 6d - 5d - w. List the prime factors of n. 2, 3, 67 Suppose -247k - 26k = -2634512 + 1081688. List the prime factors of k. 2, 3, 79 Suppose -y - 9 = -48. Let o be (-104)/y - ((-1)/(-3) - 1). Let g(h) = -h3 - h2 - 6h - 5. List the prime factors of g(o). 11 Let g = 24953 - 14270. What are the prime factors of g? 3, 1187 Let v be (20/24524)/((-3)/(-9)). Suppose -11r - v = -21r. What are the prime factors of r? 131 Let k = -73 + 91. Suppose 0 = 8w + k + 6. What are the prime factors of w(-3)/9 - -32? 3, 11 Suppose -5d + 72 + 211 = 2r, -d + 55 = 2r. Let p be (1 + 0)/(-1) - (-6 + d). Let u = p + 74. List the prime factors of u. 2, 11 Let r be 44/3((-6)/12 - -5). List the prime factors of (-109)/((24/(-4))/r). 11, 109 Let g(n) be the third derivative of 0n - 1/8n*4 + 2n*2 - 7/3n*3 + 0. List the prime factors of g(-7). 7 Let u be (4 - -13)/(0 + -2 + 1). List the prime factors of (-1942)/(-4) + 6/(u - -29). 2, 3 Let z be ((-10)/(2/2))/(6 + -8). Let u be (5 - z/(-1))(-4)/10. Let y = u - -20. List the prime factors of y. 2 Suppose -6880 = -2g - 4k, 4g - 7k - 13790 = -5k. What are the prime factors of g? 2, 1723 Let r(k) = -74 - 30k + 82 + 32k2 + 23k. List the prime factors of r(-3). 317 Let v(m) = -6m2 - 6m + 12. Let a be v(6). Let y = a - -514. What are the prime factors of y? 2, 137 Let r = 1273 + 29897. List the prime factors of r. 2, 3, 5, 1039 Let i be (6/(-2))/(2/((-64)/12)). Suppose -i + 6 = -f. Let b(w) = 20w2 + 2w. List the prime factors of b(f). 2, 3, 7 Let a be (-36)/8 + 5/10 + 0. List the prime factors of a/9 + 12508/36. 347 Suppose -3o + 9 = 0, 0 = -2r + 4o - 5o - 3. Let t(v) = 34v2 - 5v + 2. List the prime factors of t(r). 17, 19 Let f = -158 + 1333. Suppose 5j - 2939 = -4r, f = 2j + 3r - 2r. What are the prime factors of j? 587 Suppose -112 = 7z - 3z. Let s be -46/(216/51)-15. Let w = z + s. List the prime factors of w. 3, 19 Let d = -2451 + 24957. What are the prime factors of d? 2, 3, 11, 31 Let f(y) = y3 - y2 - y + 5. Let o be f(0). Suppose -ol + 22 = -h, 0 = -h + 4l - 9 - 8. List the prime factors of 82/h - (-3 + 20/6). 3 Let o(c) = 97c*2 + 215c - 846. List the prime factors of o(4). 2, 3, 29 List the prime factors of 730/(-1168) + (-508346)/(-16). 31771 Suppose 4i + 96 = p, -148 = 3p - 2i - 466. Let w be ((-6831)/p)/(1/4). Let r = w + 386. What are the prime factors of r? 7, 19 Let j(g) = 14g + 124. Let c be j(-7). Suppose ca - 1010 = 25a. List the prime factors of a. 2, 5, 101 Let g(t) = -50 - 53 - 39 + 176 + 6t - 49. Let h(z) = z3 + 6z*2 + 7z + 5. Let n be h(-4). List the prime factors of g(n). 3, 13 What are the prime factors of ((-460)/(-110) - 4) + (-3406)/(-22)? 5, 31 What are the prime factors of (11 + 0)1/(77/143857)? 20551 Let f(q) = 75q*2 + 168q + 45. What are the prime factors of f(6)? 3, 139 Suppose 5i = -0i + 3a + 2061, a + 413 = i. Let o = i + -148. What are the prime factors of o? 263 Let f(y) = 93y*2 - 3y - 18. Let x be f(-5). Suppose -7i + x = -191. What are the prime factors of i? 359 Let c(z) = -133z + 1012. List the prime factors of c(-66). 2, 5, 11, 89 Let x = 639 - -3872. Let o = -2722 + x. List the prime factors of o. 1789 Let z(y) be the second derivative of y4/6 - y3/2 + 8y2 - 189y. List the prime factors of z(4). 2, 3 Suppose 17u = 19u - 1010. Let q = u - 398. List the prime factors of q. 107 Let j = -4468 + 4618. Suppose -4l - 254 = -1342. Let y = l - j. List the prime factors of y. 2, 61 Let q(x) = 1682x*2 - 32x + 68. List the prime factors of q(2). 2, 3, 11, 17 Suppose -392 = 32y - 39y. Suppose -yl + 552 = -54l. List the prime factors of l. 2, 3, 23 Let w(d) = d*3 - 9d*2 + 9d - 6. Let k be w(8). Suppose -y + 806 = -5t + y, 0 = -4t - ky - 652. What are the prime factors of (t/(-4))/(7/14)? 3 Let f(w) = w + 13. Let a = -48 + 35. Let g be f(a). What are the prime factors of 58/2 - g/3? 29 Suppose 2r + 13 = -q + 2q, 2q = -4r - 14. Suppose 4l = 5d - 5125, ql = 2l. List the prime factors of d. 5, 41 Let y be ((-5)/(-15))/(1/81). Let p be -215/18-3. Suppose -268 = -pr + y. List the prime factors of r. 59 Suppose 12 = -2i - 2. Let s(j) = 4j*2 - 7j - 11. Let z(o) = 5o2 - 8o - 12. Let p(c) = 4s(c) - 3z(c). What are the prime factors of p(i)? 3, 23 Let o = -1042 - -1042. Suppose 2 = -4f + 2f, -2w - 2f + 138 = 0. Suppose o = 12z + w - 850. What are the prime factors of z? 5, 13 Let g(z) = 20z*2 - 5z + 2. Suppose -i - 7 = -2t, t + 0i + 1 = -i. Let c be g(t). What are the prime factors of (6 - 8)/(c/74 + -1)? 2, 37 Let b(i) = 5i3 - 10i*2 - 10i - 1. Let x be b(-5). Let s = x + 1393. List the prime factors of s. 3, 7 Let j be ((-12)/24)/(1/(-26)). Suppose -jk + 336 = -12k. What are the prime factors of k? 2, 3, 7 Let m(j) = 12j2 - 21j + 642. List the prime factors of m(18). 2, 3, 173 Let o(j) = 6j3 - 5j*2 + 10j - 26. Let y(b) = -8b2 + 81b - 4. Let w be y(10). What are the prime factors of o(w)? 2, 5, 23 Suppose -26x = -125x + 764181. What are the prime factors of x? 3, 31, 83 Let t = 24231 - 7008. What are the prime factors of t? 3, 5741 Let m(r) = 2r2 + 2r - 8. Let x be m(-3). Suppose -111 = -xj + 121. What are the prime factors of j? 2, 29 Let o(b) = 160b + 20. Let l = 246 - 245. What are the prime factors of o(l)? 2, 3, 5 Suppose -3v + 19 = 5j - 4v, j - 11 = 2v. Suppose -25 = -5s, -10q + js = -11q + 435. List the prime factors of q. 2, 3, 5, 7 Let f(n) = -n*3 + 11n*2 + 12n - 21. Let j be f(12). Let h be 1 + j/15 + 26/(-10). Let o = h - -34. What are the prime factors of o? 31 What are the prime factors of -2 + (-16)/4 + 9871 - -9? 2, 4937 Let c be (-14)/(-4)(-124)/217. Let y(z) = -197z3 - z2 + z + 5. List the prime factors of y(c). 3, 5, 7 Suppose 54j - 391851 - 980127 = 0. List the prime factors of j. 3, 941 Suppose -207n - 69750 = -212n - b, 0 = 5n + 2b - 69755. List the prime factors of n. 13, 29, 37 Let p(m) = 1 - 4m*2 - 8m + 6m + 7m*3 + 4m*2. Let x be p(1). List the prime factors of 78/(-65)(-220)/x. 2, 11 Let d = 1611 - 1661. Let s(h) = h*2 - 3. Let c be s(-6). Let v = c - d. What are the prime factors of v? 83 Let q be ((-3)/9)/(-6 - (-2541)/423). Let o = q - -131. What are the prime factors of o? 2, 3, 7 Suppose -65y + 75y = 5030. Let b = y - 316. What are the prime factors of b? 11, 17 Suppose -9v + 60728 = -4v + a, -3a - 36444 = -3v. List the prime factors of v. 2, 6073 Let n = 980 - 1723. Let k = -4 - -6. What are the prime factors of k/(-13) - n/13? 3, 19 Let a(u) be the second derivative of -u3/3 + 131u2 + u - 97. List the prime factors of a(-41). 2, 43 Let a(c) = c2 + 6c + 11. Let t be a(-3). Suppose 4q = 3m - 8, -4 = 3q + 2m + t. List the prime factors of (141 - 5)q/(-4). 2, 17 Let z = 5 - 8. What are the prime factors of (-6)/(-18) + ((-1984)/(-6) - z)? 2, 167 Suppose 47 = -k + 51, g = -3k + 2523. List the prime factors of g. 3, 31 Suppose 18i - 69483 - 1573827 = 0. List the prime factors of i. 5, 19, 31 Let t(i) = 79i2 + 79i + 1005. What are the prime factors of t(-22)? 3, 463 Let s = 1046 + 1246. Suppose 134t - 130t = s. What are the prime factors of t? 3, 191 Let o(n) = n*2 + 10n + 12. Let c be o(-9). Suppose 5v - cs = 977, -4v + 592 = -v + 4s. What are the prime factors of v? 2, 7 Let d(o) = -o*3 + 114o*2 - 256o - 792. List the prime factors of d(111). 3, 5, 11, 47 Suppose 2v = 2, -5v = 86q - 87q - 1. Suppose o - 5734 = -qh - 1956, 2h - 2*o = 1884. What are the prim	{ "pile_set_name": "DM Mathematics" }
s the highest common divisor of 14078999 and 1602? 89 Calculate the greatest common factor of 2208 and 4916784. 48 What is the greatest common factor of 5 and 2248420? 5 What is the highest common factor of 4401568 and 10460? 2092 Calculate the greatest common divisor of 77490329 and 133. 7 Calculate the greatest common divisor of 175910 and 88375. 35 What is the greatest common factor of 3324 and 23933908? 1108 What is the highest common factor of 3743 and 19526509? 19 What is the highest common divisor of 81 and 252399402? 81 Calculate the greatest common divisor of 35927873 and 59. 59 Calculate the highest common divisor of 9005670 and 50. 10 Calculate the greatest common divisor of 1726252 and 2068. 44 Calculate the highest common divisor of 467129411 and 3605. 721 What is the highest common divisor of 4814 and 3955282? 166 Calculate the greatest common factor of 38 and 292125570. 38 Calculate the highest common divisor of 25132 and 194829547. 6283 What is the highest common divisor of 11093546 and 2247? 107 What is the highest common factor of 24136 and 48772? 4 What is the highest common divisor of 1358 and 74256798? 1358 What is the highest common factor of 6 and 3111258? 6 What is the greatest common factor of 3821670 and 2430? 90 Calculate the highest common factor of 558920 and 1449895. 785 What is the greatest common factor of 54 and 66466926? 54 What is the greatest common factor of 195 and 150747? 3 What is the greatest common factor of 102 and 5534367? 51 What is the greatest common divisor of 2333392285 and 35? 35 Calculate the greatest common factor of 47465 and 70023820. 4315 Calculate the greatest common divisor of 513 and 321366. 57 What is the greatest common factor of 10020 and 975? 15 What is the highest common factor of 5 and 27017? 1 What is the highest common divisor of 319196 and 3658724? 1604 Calculate the greatest common divisor of 4820 and 58174990. 2410 What is the highest common divisor of 1075040 and 3520? 160 Calculate the greatest common divisor of 616 and 193032. 56 Calculate the highest common divisor of 10800 and 6098800. 400 What is the highest common divisor of 4785 and 72232620? 435 Calculate the greatest common divisor of 58005233 and 42328. 5291 Calculate the greatest common factor of 376 and 758336. 8 What is the greatest common factor of 660 and 1744800? 60 What is the greatest common factor of 114 and 240233169? 57 What is the highest common factor of 1497213 and 189? 9 What is the highest common factor of 416 and 4234919? 13 Calculate the highest common divisor of 3914 and 57429710. 206 What is the highest common factor of 3830045 and 388? 97 Calculate the highest common factor of 3400930 and 1560. 130 What is the greatest common factor of 57942686 and 6339? 2113 Calculate the highest common divisor of 1117250 and 58. 2 Calculate the greatest common factor of 48 and 67862016. 48 What is the highest common divisor of 3415417 and 87? 29 Calculate the greatest common factor of 63 and 981301104. 63 What is the highest common factor of 65 and 1051621740? 65 What is the greatest common divisor of 920 and 993416? 184 Calculate the greatest common factor of 22926577 and 7688. 961 What is the greatest common factor of 208814541 and 159? 159 What is the highest common factor of 105906 and 355281? 57 Calculate the highest common divisor of 81344 and 2214. 82 What is the highest common divisor of 742182 and 1043? 7 What is the greatest common factor of 8 and 79215? 1 Calculate the highest common divisor of 8736145 and 2337320. 4115 What is the greatest common factor of 141 and 1129749? 3 What is the highest common factor of 792 and 14816472? 264 Calculate the highest common factor of 583 and 1906509. 11 Calculate the highest common divisor of 1212 and 1490154. 606 What is the greatest common divisor of 1768 and 9312124? 68 Calculate the greatest common divisor of 1956 and 92376338. 326 What is the greatest common divisor of 59228 and 15881060? 884 Calculate the greatest common factor of 25602830 and 110. 110 What is the greatest common factor of 107293 and 5719? 19 Calculate the highest common factor of 2100 and 1096295200. 700 Calculate the greatest common divisor of 20148048 and 432. 432 What is the highest common factor of 9336 and 61539411? 1167 What is the highest common divisor of 303 and 8836591? 101 Calculate the highest common divisor of 570766 and 34071828. 9674 What is the greatest common divisor of 637830 and 126? 18 What is the highest common divisor of 3475875 and 18975? 1725 What is the greatest common factor of 62899 and 1974217? 2029 Calculate the highest common divisor of 19733012 and 976. 244 Calculate the greatest common factor of 2378270 and 128750. 1030 What is the greatest common factor of 91874871 and 8613? 8613 What is the highest common divisor of 11 and 105337177? 11 What is the greatest common factor of 1078 and 108661322? 1078 Calculate the highest common divisor of 9693 and 60362619. 1077 What is the greatest common divisor of 11031 and 5711? 1 Calculate the highest common factor of 44948 and 74392. 68 What is the greatest common factor of 9264 and 1833? 3 Calculate the greatest common divisor of 12110945 and 28160. 55 Calculate the greatest common divisor of 170791 and 81350450. 8989 What is the highest common divisor of 117975 and 858? 429 What is the highest common factor of 134 and 10876? 2 Calculate the greatest common divisor of 27392 and 1440. 32 Calculate the greatest common factor of 3131303 and 559. 43 Calculate the greatest common divisor of 64009495 and 577. 577 What is the highest common divisor of 37732600 and 675? 25 Calculate the greatest common divisor of 16774356 and 4887. 543 What is the greatest common factor of 1012698 and 612? 18 Calculate the highest common divisor of 5 and 63183655. 5 What is the greatest common factor of 37348122 and 6606? 2202 Calculate the highest common divisor of 379537927 and 23. 23 What is the greatest common factor of 1195442 and 814511? 3097 Calculate the highest common divisor of 31599906 and 2652. 1326 What is the greatest common divisor of 29892681 and 1243? 113 Calculate the greatest common divisor of 579 and 202836824. 193 Calculate the greatest common divisor of 45593 and 21082. 127 What is the highest common divisor of 11401 and 24713? 13 What is the greatest common divisor of 68 and 162883069? 17 Calculate the highest common factor of 304756 and 244. 244 What is the greatest common divisor of 38813753 and 11? 11 What is the greatest common divisor of 81 and 559161? 9 Calculate the greatest common factor of 65726 and 633778. 118 Calculate the highest common factor of 1140 and 8821605. 285 Calculate the greatest common divisor of 63 and 5490597. 21 Calculate the highest common divisor of 1031681 and 192983. 133 What is the greatest common divisor of 381 and 39949374? 381 Calculate the highest common divisor of 8274 and 2055892. 394 What is the highest common divisor of 11833460 and 540? 20 What is the highest common factor of 7795 and 1080207715? 7795 Calculate the greatest common divisor of 129515456 and 1344. 448 Calculate the greatest common factor of 8283 and 51249. 33 What is the greatest common divisor of 1196976 and 13728? 528 Calculate the highest common divisor of 70 and 279037255. 35 What is the highest common divisor of 9022660 and 3582? 398 What is the highest common divisor of 6239 and 25075? 17 Calculate the highest common divisor of 2771 and 937669. 17 What is the greatest common divisor of 45 and 18674793? 9 Calculate the greatest common factor of 2607389 and 76627. 2071 What is the highest common divisor of 119 and 51571625? 119 What is the greatest common divisor of 4927 and 3614819? 13 Calculate the highest common divisor of 1703024 and 304. 16 Calculate the greatest common factor of 1 and 3017447. 1 Calculate the greatest common divisor of 97800 and 159414. 978 What is the greatest common factor of 4781573 and 749564? 1241 Calculate the greatest common divisor of 115376 and 34000. 16 Calculate the greatest common factor of 5493419149 and 13597. 13597 Calculate the highest common factor of 3000 and 115400. 200 What is the greatest common divisor of 653940 and 27270? 270 What is the greatest common fact	{ "pile_set_name": "DM Mathematics" }
r and 1 f. 1/969 Calculate prob of picking 2 z, 1 n, and 1 m when four letters picked without replacement from {z: 3, a: 3, j: 6, m: 3, n: 2}. 9/1190 Calculate prob of picking 1 v and 1 g when two letters picked without replacement from {b: 1, u: 1, g: 1, f: 1, v: 1}. 1/10 Four letters picked without replacement from sssmssssssssssssss. What is prob of picking 1 s and 3 m? 0 Four letters picked without replacement from kkks. What is prob of picking 1 s and 3 k? 1 Four letters picked without replacement from mddmmmxkhhkdmhxmhn. Give prob of picking 1 m, 1 d, 1 n, and 1 h. 2/85 Calculate prob of picking 1 n and 1 t when two letters picked without replacement from tyyonn. 2/15 Two letters picked without replacement from {y: 2, a: 3, n: 12}. Give prob of picking 2 y. 1/136 Three letters picked without replacement from bjmbwbbbbwmw. Give prob of picking 1 j, 1 b, and 1 w. 9/110 Four letters picked without replacement from tssststsssttstst. What is prob of picking 4 t? 1/52 Two letters picked without replacement from njittjhtjnthaanjjhj. What is prob of picking 1 i and 1 j? 2/57 Two letters picked without replacement from jczzjjjrjjr. Give prob of picking 1 c and 1 j. 6/55 Calculate prob of picking 2 c and 2 p when four letters picked without replacement from {p: 2, c: 8}. 2/15 Calculate prob of picking 3 m when three letters picked without replacement from mwmmmmwwmm. 7/24 Three letters picked without replacement from {f: 2, d: 3}. Give prob of picking 1 d and 2 f. 3/10 Three letters picked without replacement from exje. Give prob of picking 1 e, 1 x, and 1 j. 1/2 What is prob of picking 1 c and 1 r when two letters picked without replacement from kwwkkkwcrkwwcic? 1/35 Three letters picked without replacement from {m: 1, l: 1, d: 2, p: 2, b: 1}. Give prob of picking 1 d, 1 m, and 1 l. 2/35 Two letters picked without replacement from {h: 3, x: 7}. Give prob of picking 2 h. 1/15 Two letters picked without replacement from {w: 1, v: 1, q: 1, m: 5, i: 1}. Give prob of picking 1 v and 1 w. 1/36 What is prob of picking 2 t and 1 d when three letters picked without replacement from {i: 3, d: 1, s: 3, r: 2, t: 6}? 3/91 Three letters picked without replacement from {j: 1, f: 3, u: 1, c: 6, e: 2, q: 2}. Give prob of picking 1 j and 2 e. 1/455 Three letters picked without replacement from dddffdddfdd. What is prob of picking 2 d and 1 f? 28/55 Four letters picked without replacement from {t: 6, n: 2, d: 1, k: 5, g: 2}. Give prob of picking 1 d, 2 k, and 1 t. 3/91 What is prob of picking 1 t, 2 e, and 1 r when four letters picked without replacement from ftrfefeueu? 1/70 What is prob of picking 2 o and 1 d when three letters picked without replacement from {o: 3, g: 1, d: 3}? 9/35 Four letters picked without replacement from axaaxxxaxaxax. Give prob of picking 2 x and 2 a. 63/143 What is prob of picking 2 d and 1 h when three letters picked without replacement from {b: 1, o: 3, k: 1, d: 2, h: 3}? 1/40 Three letters picked without replacement from lcdjldcllll. Give prob of picking 3 l. 4/33 Four letters picked without replacement from iigkuec. Give prob of picking 1 e, 1 k, 1 c, and 1 i. 2/35 Calculate prob of picking 3 n and 1 f when four letters picked without replacement from {k: 5, n: 4, f: 2}. 4/165 What is prob of picking 1 h and 1 s when two letters picked without replacement from shasvxlshlxaxs? 8/91 What is prob of picking 1 v and 3 d when four letters picked without replacement from dduddddyydvvdd? 24/143 What is prob of picking 1 g and 1 r when two letters picked without replacement from {r: 9, g: 3}? 9/22 What is prob of picking 2 a when two letters picked without replacement from laaaaaaajaa? 36/55 What is prob of picking 1 v and 2 u when three letters picked without replacement from uvu? 1 Two letters picked without replacement from oogooooooooooooooooo. What is prob of picking 1 g and 1 o? 1/10 Three letters picked without replacement from {k: 3, j: 9}. What is prob of picking 3 j? 21/55 Four letters picked without replacement from gtohhohjhhojohog. Give prob of picking 1 t and 3 h. 1/91 Two letters picked without replacement from qpwwwwqpwqppwwwwww. What is prob of picking 1 q and 1 p? 4/51 Three letters picked without replacement from bbbskstktkbbksbkbbk. What is prob of picking 2 t and 1 s? 1/323 What is prob of picking 1 w and 2 x when three letters picked without replacement from {x: 3, m: 6, w: 2, q: 1}? 3/110 What is prob of picking 1 m and 1 g when two letters picked without replacement from cccomccccccg? 1/66 Three letters picked without replacement from {y: 2, z: 1, c: 2, x: 9}. Give prob of picking 1 c, 1 x, and 1 y. 9/91 Two letters picked without replacement from {g: 4}. Give prob of picking 2 g. 1 What is prob of picking 1 j, 1 x, and 1 z when three letters picked without replacement from {v: 1, k: 2, z: 3, j: 1, x: 3}? 3/40 Calculate prob of picking 3 d and 1 q when four letters picked without replacement from zdzddqdzzdzoddqzz. 1/34 Four letters picked without replacement from {b: 2, i: 16}. Give prob of picking 1 b and 3 i. 56/153 Calculate prob of picking 1 v and 2 h when three letters picked without replacement from ehevchhhh. 5/42 Two letters picked without replacement from {d: 5, w: 8, p: 1, v: 2, l: 3}. Give prob of picking 2 w. 28/171 Two letters picked without replacement from ccizdzcwdziz. Give prob of picking 1 d and 1 z. 4/33 Calculate prob of picking 2 a when two letters picked without replacement from pmppppppmmpppaa. 1/105 What is prob of picking 1 c and 1 h when two letters picked without replacement from shcss? 1/10 Two letters picked without replacement from {k: 2, x: 1, l: 1, g: 1, p: 1, s: 1}. Give prob of picking 2 k. 1/21 Three letters picked without replacement from {x: 4, c: 6, e: 3, i: 1, g: 1}. Give prob of picking 2 x and 1 g. 6/455 Calculate prob of picking 1 p and 1 t when two letters picked without replacement from {f: 5, y: 1, p: 2, t: 5, e: 3}. 1/12 Two letters picked without replacement from ijjijvjqmbvjjjmji. Give prob of picking 2 v. 1/136 Four letters picked without replacement from {e: 2, p: 5, g: 2, v: 7, s: 2}. Give prob of picking 1 s, 1 e, and 2 v. 7/255 Four letters picked without replacement from {n: 3, d: 13}. Give prob of picking 1 d and 3 n. 1/140 Four letters picked without replacement from {n: 12, p: 1}. Give prob of picking 4 n. 9/13 Calculate prob of picking 1 y and 1 a when two letters picked without replacement from {a: 2, y: 5}. 10/21 Calculate prob of picking 2 l, 1 y, and 1 s when four letters picked without replacement from {l: 8, s: 1, y: 8}. 8/85 Two letters picked without replacement from {i: 3, j: 9}. What is prob of picking 2 i? 1/22 What is prob of picking 1 a and 1 m when two letters picked without replacement from wmmomomnaaaxaoaam? 15/68 Two letters picked without replacement from httttthttttthttththt. What is prob of picking 2 t? 21/38 Calculate prob of picking 2 d when two letters picked without replacement from dssswwwsdwswdwwwd. 3/68 Calculate prob of picking 1 p and 3 x when four letters picked without replacement from pbppxxpxppx. 4/55 Calculate prob of picking 2 d and 1 z when three letters picked without replacement from {s: 1, z: 1, d: 2}. 1/4 Two letters picked without replacement from sfffs. Give prob of picking 1 f and 1 s. 3/5 Two letters picked without replacement from {q: 1, m: 1, g: 1, o: 1, l: 1}. Give prob of picking 1 l and 1 o. 1/10 Four letters picked without replacement from {b: 5, v: 7}. What is prob of picking 4 v? 7/99 Two letters picked without replacement from dvvvvvdddd. What is prob of picking 2 v? 2/9 What is prob of picking 1 t and 2 h when three letters picked without replacement from {f: 1, t: 2, h: 4}? 12/35 Four letters picked without replacement from {p: 4, b: 2, s: 1, r: 1}. Give prob of picking 1 r, 1 s, and 2 p. 3/35 What is prob of picking 1 q and 3 m when four letters picked without replacement from mmmmommokcqmmmmwkmo? 55/1292 What is prob of picking 1 z and 1 c when two letters picked without replacement from ggzzzvvgggzgggggcgc? 8/171 What is prob of picking 1 n, 1 q, and 1 x when three letters picked without replacement from {c: 2, n: 1, q: 1, j: 2, x: 1}? 1/35 What is prob of picking 2 p when two letters picked witho	{ "pile_set_name": "DM Mathematics" }
base 14 -b -77 (base 10) to base 16 -4d 8 (base 11) to base 10 8 -5 (base 15) to base 10 -5 Convert -20 (base 4) to base 2. -1000 Convert 35 (base 16) to base 2. 110101 What is -a9 (base 11) in base 2? -1110111 What is -2110 (base 3) in base 11? -60 What is 111 (base 3) in base 13? 10 10 (base 6) to base 12 6 32 (base 13) to base 15 2b -1 (base 10) to base 6 -1 What is 1 (base 9) in base 14? 1 101 (base 2) to base 13 5 Convert -20 (base 5) to base 12. -a 311 (base 6) to base 16 73 49 (base 12) to base 2 111001 Convert 2c (base 16) to base 14. 32 -c (base 14) to base 7 -15 1 (base 12) to base 16 1 -2 (base 3) to base 9 -2 Convert -2 (base 10) to base 4. -2 What is -1111 (base 3) in base 6? -104 Convert -262 (base 10) to base 7. -523 What is 433 (base 5) in base 10? 118 Convert 7 (base 14) to base 10. 7 5 (base 14) to base 13 5 -1202 (base 3) to base 14 -35 1 (base 3) to base 2 1 Convert 16 (base 14) to base 10. 20 30 (base 12) to base 13 2a 18 (base 9) to base 5 32 -62 (base 7) to base 4 -230 Convert 6 (base 14) to base 13. 6 -2 (base 5) to base 4 -2 Convert -6 (base 16) to base 12. -6 103 (base 5) to base 7 40 What is 50 (base 7) in base 8? 43 -10 (base 15) to base 5 -30 Convert 2 (base 4) to base 2. 10 Convert -1000011 (base 2) to base 6. -151 132 (base 6) to base 10 56 Convert 2 (base 15) to base 5. 2 What is b9 (base 16) in base 2? 10111001 What is -81 (base 10) in base 4? -1101 What is 48 (base 9) in base 2? 101100 -4 (base 12) to base 11 -4 Convert 6 (base 8) to base 13. 6 -1001001 (base 2) to base 15 -4d 3 (base 6) to base 7 3 Convert -2 (base 9) to base 16. -2 Convert 1 (base 5) to base 3. 1 What is -15 (base 13) in base 12? -16 What is 3 (base 7) in base 10? 3 What is -1a (base 15) in base 8? -31 0 (base 6) to base 10 0 Convert 20 (base 6) to base 14. c What is 0 (base 14) in base 16? 0 What is -9 (base 11) in base 15? -9 3 (base 11) to base 12 3 Convert 10 (base 7) to base 5. 12 What is 98 (base 10) in base 15? 68 What is -32 (base 11) in base 2? -100011 What is -32 (base 7) in base 12? -1b -21 (base 9) to base 13 -16 Convert 58 (base 15) to base 5. 313 What is 241 (base 6) in base 15? 67 Convert 30 (base 9) to base 3. 1000 161 (base 9) to base 3 12001 What is -82 (base 9) in base 16? -4a Convert -2 (base 7) to base 10. -2 What is 10 (base 12) in base 8? 14 -3 (base 13) to base 12 -3 Convert -10 (base 3) to base 6. -3 6 (base 14) to base 12 6 What is -1 (base 2) in base 16? -1 -22 (base 4) to base 2 -1010 What is -31 (base 7) in base 16? -16 -361 (base 7) to base 2 -10111110 What is -278 (base 10) in base 16? -116 10 (base 8) to base 15 8 What is -11 (base 4) in base 13? -5 2322 (base 4) to base 11 15a Convert -11 (base 4) to base 13. -5 Convert 0 (base 15) to base 9. 0 What is 5 (base 8) in base 15? 5 Convert 2020 (base 3) to base 16. 3c Convert 3 (base 9) to base 13. 3 21102 (base 3) to base 15 d5 Convert b (base 14) to base 15. b 0 (base 8) to base 14 0 Convert 84 (base 10) to base 3. 10010 173 (base 9) to base 10 147 What is -9 (base 12) in base 6? -13 Convert -2 (base 11) to base 14. -2 94 (base 10) to base 9 114 Convert -2 (base 16) to base 3. -2 Convert 3 (base 8) to base 13. 3 Convert 2 (base 15) to base 6. 2 What is 13 (base 7) in base 5? 20 Convert 11110010 (base 2) to base 4. 3302 536 (base 7) to base 10 272 1242 (base 5) to base 15 d2 What is 8 (base 14) in base 8? 10 What is -100 (base 6) in base 3? -1100 Convert -6 (base 10) to base 6. -10 76 (base 12) to base 11 82 8 (base 9) to base 7 11 153 (base 7) to base 4 1113 What is 10 (base 3) in base 10? 3 What is 3 (base 14) in base 11? 3 What is -15 (base 10) in base 15? -10 What is -38 (base 9) in base 15? -25 Convert 41 (base 13) to base 3. 1222 What is -432 (base 5) in base 2? -1110101 Convert 1 (base 16) to base 9. 1 What is -2c (base 16) in base 6? -112 -3 (base 15) to base 6 -3 What is -515 (base 6) in base 2? -10111111 Convert -1 (base 2) to base 8. -1 24 (base 5) to base 16 e Convert 1000110 (base 2) to base 16. 46 What is 0 (base 12) in base 7? 0 Convert 1 (base 5) to base 4. 1 1010 (base 2) to base 13 a What is -2 (base 11) in base 15? -2 0 (base 2) to base 15 0 Convert 6 (base 7) to base 10. 6 Convert 14 (base 5) to base 16. 9 What is -9 (base 11) in base 9? -10 What is -a6 (base 16) in base 5? -1131 1 (base 3) to base 10 1 What is 101 (base 5) in base 8? 32 Convert 251 (base 7) to base 11. 112 -3 (base 4) to base 11 -3 Convert -77 (base 15) to base 3. -11011 -10 (base 14) to base 3 -112 What is 0 (base 2) in base 3? 0 -2 (base 15) to base 10 -2 What is 14 (base 10) in base 6? 22 What is -146 (base 9) in base 4? -1323 What is -140 (base 5) in base 15? -30 What is -9 (base 15) in base 6? -13 24 (base 5) to base 10 14 4 (base 14) to base 10 4 3 (base 12) to base 9 3 -120 (base 3) to base 14 -11 What is -71 (base 16) in base 4? -1301 -11 (base 14) to base 6 -23 Convert 33 (base 6) to base 16. 15 Convert -50 (base 10) to base 15. -35 What is 0 (base 7) in base 6? 0 Convert -110212 (base 3) to base 2. -101011011 What is 300 (base 6) in base 13? 84 -99 (base 10) to base 16 -63 a (base 16) to base 5 20 -28 (base 10) to base 8 -34 16 (base 10) to base 5 31 Convert -bd (base 15) to base 9. -217 What is 441 (base 7) in base 10? 225 Convert 1 (base 7) to base 3. 1 10001 (base 3) to base 16 52 What is -2 (base 7) in base 9? -2 40 (base 7) to base 6 44 Convert 4 (base 11) to base 9. 4 What is 47 (base 14) in base 10? 63 What is 1 (base 13) in base 2? 1 -5 (base 16) to base 3 -12 Convert -1a (base 12) to base 11. -20 What is 131 (base 13) in base 16? d1 What is 14 (base 6) in base 12? a Convert 5d (base 14) to base 12. 6b Convert -67 (base 16) to base 15. -6d What is 6 (base 9) in base 16? 6 -553 (base 6) to base 14 -113 -102 (base 3) to base 14 -b Convert 3 (base 9) to base 14. 3 What is 432 (base 7) in base 8? 333 2421 (base 5) to base 15 191 What is -1 (base 11) in base 4? -1 18 (base 14) to base 10 22 -205 (base 8) to base 13 -a3 What is -11 (base 14) in base 15? -10 -14 (base 7) to base 8 -13 -142 (base 5) to base 15 -32 What is -39 (base 15) in base 4? -312 What is -22 (base 14) in base 8? -36 10 (base 2) to base 8 2 What is -20 (base 3) in base 12? -6 -4 (base 11) to base 3 -11 What is -3 (base 8) in base 6? -3 Convert -1210 (base 3) to base 10. -48 What is 103 (base 12) in base 2? 10010011 6 (base 14) to base 2 110 Convert -3 (base 15) to base 7. -3 Convert -12222 (base 3) to base 8. -241 What is 23 (base 4) in base 11? 10 -120 (base 4) to base 9 -26 0 (base 8) to base 2 0 Convert 51 (base 10) to base 15. 36 -11 (base 16) to base 10 -17 What is 136 (base 12) in base 16? ba Convert 100 (base 2) to base 5. 4 Convert 48 (base 10) to base 8. 60 Convert -2 (base 15) to base 10. -2 -4 (base 11) to base 6 -4 Convert 111011 (base 2) to base 14. 43 221 (base 3) to base 4 121 -105 (base 6) to base 13 -32 What is -143 (base 7) in base 14? -5a -9 (base 14) to base 6 -13 What is -4 (base 8) in base 13? -4 What is 112 (base 3) in base 10? 14 28 (base 13) to base 11 31 Convert 204 (base 6) to base 7. 136 What is -2e (base 16) in base 4? -232 2 (base 10) to base 12 2 Convert -10 (base 11) to base 9. -12 Convert 13 (base 5) to base 3. 22 Convert 28 (base 15) to base 5. 123 1c (base 16) to base 11 26 Convert 2 (base 16) to base 3. 2 Convert 2 (base 15) to base 7. 2 Convert -1 (base 3) to base 15. -1 20 (base 9) to base 15 13 11111 (base 3) to base 6 321 Convert 10012 (base 4) to base 16. 106 What is -103 (base 8) in base 12? -57 What is -156 (base 7) in base 8? -132 What is -303 (base 6) in base 5? -421 Convert 11 (base 11) to base 7. 15 Convert -243 (base 9) to base 2. -11001001 Convert -1111 (base 2) to base 13. -12 What is -306 (base 10) in base 6? -1230 Convert 5 (base 15) to base 13. 5 What is -1001 (base 2) in base 8? -11 What is 12 (base 11) in base 2? 1101 What is 30 (base 7) in base 3? 210 1 (base 6) to base 12 1 Convert 117 (base 15) to base 3. 100011 Convert 25 (base 11) to base 4. 123 What is 10 (base 8) in base 12? 8 Convert -2 (base 8) to base 13. -2 -46 (base 8) to base 6 -102 b4 (base 12) to base 7 253 Convert 1 (base 10) to base 16. 1 -3 (base 12) to base 7 -3 What is 1 (base 7) in base 11? 1 10 (base 2) to base 13 2 2 (base 7) to base 10 2 What is 0 (base 7) in ba	{ "pile_set_name": "DM Mathematics" }
389a4 + 0). 135a*5 Expand (-14 - 2 - 1)(4p2 - p2 - p2). -34p*2 Expand (-484 + 8v*2 + 484)(v + 2v - v). 16v*3 Expand 18u*5 - 4u5 + u5 + (4u3 - 3u*3 - 2u*3)(2u2 + u2 - 4u*2) - 5u5 + u5 + 2u5 + 14u - 14u + 4u*5. 18u*5 Expand (3q + 2q - 4q)(-4 - 3 + 2 + (0 + 2 - 3)(0 - 3 + 1) + 0 - 2 + 1 + 1 + 3 - 3) + 0 + q + 0. -2q Expand (13w + 11w2 - 25w + 15w)(-2w2 + 0w*2 + 0w*2). -22w*4 - 6w*3 Expand (a + a + 3a)(-2 + 2 + 1) + 2 - 2 - a - 2 - 2a + 2. 2a Expand (-h2 - 2h*2 + 5h*2)(-h + 3h + 17 + 2). 4h*3 + 38h*2 Expand (-4v*2 - 6 + 6)(-7 - 6 - 1)(3 - 5 + 4). 112v*2 Expand (0 - 1 - 1)(-3w + 2w - w) + (-2 + 2 + 4)(5 - 5 + 3w). 16w Expand (-2i2 + i2 - i*2)(-16 - 4 - 4)(-i + 1 - 1). -48i*3 Expand (10f - 11 + 11)(4f + f - 3f)(2 - 5 - 1). -80f2 Expand (-2q*2 + 2q*2 - 2q*5)(2 - 4 + 3). -2q5 Expand (14y*2 - 25 + 25)(0y2 + y2 - 2y*2 - 2y*2 + 7y*2 - 4y*2 + (-2y + 0y + 4y)(y + 0y + y) + y*2 - 4y*2 + 4y*2). 70y*4 Expand (-4 + 6g + 4)(3 + 8 - 5). 36g Expand 2t3 - 7t3 - t4 + t*3 + (1 + t - 1)(t*3 + 4t*3 - 3t3). t4 - 4t3 Expand 0h*4 - 2h4 + h4 + (0 - 2 + 1)(-h4 + h4 + h4) + h4 - 4h4 + h4 + h4 - h4 + 2h4 + 0h*4 - 6h*4 + 3h*4 - 2 + 3 - 8h*4 + 0. -13h*4 + 1 Expand (0u + 0u - 3u)(3u*4 + 0u*2 - 3u2 - u4). -6u5 + 9u3 Expand (-b2 + 3b2 - b2)(-42b2 + 21b*2 - 4b + 3b). -21b4 - b3 Expand -11p2 - 2p*3 + 8 + 11p*2 + (-p - 1 + 1)(p2 + p2 - p*2). -3p*3 + 8 Expand (1 - 1 - 2k)(14k*4 + 7k*3 - 7k*3). -28k*5 Expand (1 - 5 - 2)(-w + w - 2w). 12w Expand (-1 + 3 - 4)(-l5 + l5 + 2l4 + l5). -2l5 - 4l*4 Expand (-3q + 2q + 2q + (2q - q + q)(0 + 2 + 1) - 3q + q + 0q)(4 + 3q*2 - 4). 15q*3 Expand (2 - 1 + 0)((-2 + 2 - 2)(3s + 2s - 3s) + 0s - s + 2s + 2s - 2s - s). -4s Expand 5k*3 - 3k3 - k3 + (0k2 - 4k*2 + 3k*2)(2k + 0 + 0) + 7k*3 - 12k*2 - 6k*3 - 3k*3. -3k*3 - 12k*2 Expand (1 - 4 + 5)(3 - 3 - v)(0v - 3v + 6v). -6v2 Expand (0x + 2x - 3x)(2x - 20x2 - 3x - 1 - 1). 20x3 + x2 + 2x Expand (2t3 - 3t*2 + 3t*2)(-3t2 + 2t*2 + 3t2) - t5 - 2t + 2t + 3t5 + 3t*5 - 4t*5 + (4t*3 - 6t3 - t3)(-2t - t*2 + 2t). 8t5 Expand (-1 + 2 + y - 3y)(y - 4 + 4). -2y*2 + y Expand (-1 + 1 - 2)(-4 + 2t2 + 4) + 4 - 4 + 30t*2. 26t2 Expand (b2 - 4b2 + b2)(20 + 11 - 20)(-3 + 4 + 0). -22b*2 Expand (2 - 2 + x)(-1 - x + 1). -x*2 Expand -5 - m + 5 + (3m - 4m - m)(0 + 1 - 3) + 2m - 2m - 2m + (2 + 2 - 3)(0m - 3m + m) + 0m - m + 2m + 5m + 0m - m - 25 + 25 - 7m. -3m Expand (4 + 2 - 3)(4n - 3n2 - 4n) - 2n2 + 3 - 3 + (-n + n + n)(2n - 2n - n). -12n2 Expand (-26x - 15x + 6x)(3x - 2x2 - 3x). 70x3 Expand (z - 6z + 0z)(-4 + 2z + 4) + (-2z + 2z - 2z)(-2z + 3z + z) + 2z*2 - 4z + 4z. -12z2 Expand -q4 - q*4 + 0q4 + (0 + 0 + q2)(q + q2 - q) + 0q*3 + 0q*3 - 2q*4 + (-4q*4 - 2q*4 + 0q*4)(0 + 3 - 4). 3q4 Expand (-j2 + 4j*2 - 4j*2)(9j - 13j + 32j)(-2 + 2 - 2j). 56j*4 Expand (2 - 2 - 4)(2 + 10s - 7 - 7s). -12s + 20 Expand (-10 - 17 + 18)(-w*5 - 2w*5 + 5w*5). -18w*5 Expand (2u*3 + 34u - 34u)(u + 5u - u). 10u*4 Expand (6l - 4l - 3l)(l4 - 3l*4 + 0l*4) + (3l*2 - 3l*2 - 2l*5)(6 - 4 - 4). 6l5 Expand -2l*4 + 3 - 3 + (0l + 2l - 4l - 3l - l + 5l + (-1 + 0 - 1)(-l + 2l + 0l) - 2l - 3 + 3 - 3l - l - 3l)(4l*3 + 0l*3 - 5l*3). 10l*4 Expand (-2l*2 + 3l*2 - 2l*2)(15l3 + 5l*3 - 6l*3). -14l5 Expand (q3 - q*3 - 2q*4)(-2q + 3q - 2q) + q3 + 2q5 - q3 + 2q5 + 9q*5 - 3q*5. 12q5 Expand s2 - 2s2 + 2s*2 + (3s + s - 2s)(2 - 2 - s) - 7s2 - 15s*2 + 2s*2. -21s*2 Expand (-3 + 0 + 2)(-1 + 1 - 2)(-17x - 32x + 16x)(0 + 0 + 1). -66x Expand (-2q3 + q3 + 3q*3)(1 + 2 - 2)(6 - 5 + 5). 12q*3 Expand (-34 + 138v - 4 - 137v)(2 - 6 + 3). -v + 38 Expand (-6 + 1 + 4 - 2n2)(-4 - 8 + 7). 10n2 + 5 Expand (3i*2 + 0i*3 - 4i*3 - 1 + 2i*3)(0 + 8 - 1). -14i3 + 21i*2 - 7 Expand (3o - o - 4o)(-2 - o + 2) - 3o2 + 4o*2 + 6o*2. 9o*2 Expand (-1141 - 64j*2 + 1141)(4j - j - j)(-5 - 1 + 5)(0j - 3j + 2j). -128j4 Expand (-17 - 4 + 7)(-i3 - i3 + 3i3 + (3 - 2i*2 - 3)(0 + 0 + 2i) - 6i*3 + 2i*3 + 2i*3 - 1 + 2i*3 + 1). 42i3 Expand (2 - u2 + 2u2 + 2u*2)(9u2 + 2u*3 - 9u*2). 6u*5 + 4u*3 Expand ((z + 4 - 4)(5z - 2z - 2z) - 2z*2 - 3z2 - z2)(0 - 5 + 2). 15z*2 Expand (4 + 0 - 2)(-n + 6n - 2n)(-3 + 1 - 1)(-1 - 2 + 5). -36n Expand (0u*2 - 3u*2 + 4u*2)(-5u3 - 1 + 1 - 2). -5u*5 - 2u*2 Expand -2s*4 + 2s4 + s4 + (-s3 + s3 - s*3)(-5s + 5s - s) + 2s - 1 + 1 + s4. 3s*4 + 2s Expand 3y - y + 0y + 5 + 0y - 4 + 4y + y + 0y + y + y - y - y + (-3 + 2 - 1)(-1 + 1 + y). 5y + 1 Expand (f + f + 0f)(4f - f - 4f)(f + f - 3f). 2f*3 Expand 4y*2 + 3y*2 + 2y*2 + (1 + 3 - 2)(2y - 3y*2 - 2y). 3y2 Expand (-2 - 3 + 4)(5w2 - 2w*2 - 5w*2). 2w*2 Expand 2l*4 + 2l*4 - 3l*4 + (9l + l + 6l)(0l3 - 2l3 + l3). -15l4 Expand (-5b + 2b + 2b)(8b*2 + 2b*2 + 5b*2 + (0b - 3b + b)(2b + 1 - 1)). -11b*3 Expand (318 - 13d*2 - 318)(0 + 0 - 2). 26d2 Expand (-1 + 0 - 1)(0 + 1 + 1)(2 + 15d2 + d2 - 8d2). -32d*2 - 8 Expand (2l*2 - l + l - 3l + 3l + 2l2 + (-l2 + 0 + 0)(-3 - 1 + 2))(3l3 + 12l*3 + 3l*3). 108l*5 Expand (-6 + 4 + 4)(-f - 46 + 46)(0f*2 - 4f*2 + 2f*2). 4f*3 Expand (3w*2 - 2w*2 - w + 3w)(3w - 4w + 7w). 6w3 + 12w*2 Expand (8k*3 - 17k + 17k)(0k2 - 3k*2 + 4k2) - k4 + k*4 + 2k*5. 10k*5 Expand (-6i + 2i - 7i + 2)(i - i2 - i). 11i*3 - 2i*2 Expand (2q - 5q + 2q)(0 + 0 + q) - 3 - 8q*2 + 3. -9q*2 Expand (-9p + 10 - 10)(2 - 7 + 3)(-3p - 3p + 4p) + (-3p - 3p + 5p)(-4p + 0p + 3p). -35p2 Expand -c5 - 3 - 2c*5 + 2 + (-c + 2c + 0c)(c3 - c3 - 5c4 + 2c*4 - 4c*4 + 4c4 + (c2 - c*2 + 2c*3)(-3 - c + 3) - c*3 - 2c4 + c3). -10c5 - 1 Expand -f4 + f4 - 2f*5 + (2 + f - 2)(34f - 2f*4 - 34f) + 0f2 + 2f + f*2 + 0f*2 - 2f*5. -6f5 + f2 + 2f Expand (g + 3g - 2g)(1 + 0 + 5)(4 + 0 - 3)(-2 + 3 + 0). 12g Expand (-2u*3 + 2u3 + u3 + 4 - 2u3 - 4 + 2u*3 - 3u*3 + 3u*3 + (5 - 2 - 4)(-u*3 - 3u*3 + 2u*3))(2u2 + 11 - 11). 6u*5 Expand 27l*4 - 17l*4 - 25l*4 + (3l + 0l - 2l)(-3l3 + l3 + l3) + (-l3 - 2 + 2)(-2l + 5l - l). -18l*4 Expand ((-y + y + 2y)(0 + 2 - 5) + 3y - 6y + y)((-3 + 1 - 1)(0y - y*3 + 0y) - 6y3 + 3y*3 + 2y*3). -16y*4 Expand (5 - 3 - 4)(-5b3 - 3b*3 + 4b*3) + 33b - 33b + 3b*3. 11b*3 Expand 1 - 1 - 2j*3 + (3j - 2j2 - 3j)(-2j + 3j - 6j). 8j3 Expand 0 + y + 0 - 2y + 2y - y + (5 - 4 - 3)(2 + y - 2) + y + 0y - 3y - 4y - y + 4y - 2 + 2 + y + 13y - 5y + 4y + 2. 8y + 2 Expand (-2r + 5r - 4r)(530r2 + 19r*3 - 530r*2). -19r4 Expand -k2 + 0k2 + 2k*2 + (-6k + 2k + 2k)(0k + 3k - 2k) + k*2 - 4k2 - k2. -5k2 Expand (2a - a + 2a)(3 - 3 - 3a)(-3 + 3 + 1)(-1 + 0 - 2). 27a*2 Expand 13r*4 - 7r*4 + 11r*4 + 0r*4 + 2r4 - r4 + (-3 + 3 - 2r4)(4 - 5 + 0). 20r4 Expand (17h + 5h2 - 17h)(3 - 4 + 0). -5h*2 Expand (1 + 2a - 1)(-2a2 + a3 + 3a3 + a2). 8a*4 - 2a*3 Expand (-2 + 9 + 0)(2y + 0y - y)(0 - 1 + 2). 7y Expand (2 - 2 + 8z)(-2z + 2z - z) + 0z2 + 0z*2 + 2z*2. -6z*2 Expand (-3 + 6 - 5)(2b3 + 2b*3 - 5b3) + (-1 - b2 + 1)(b + 0b - 2b) + (1 - 1 - 2)(0b3 + 0b3 - b3) + 4b3 - 4b*3 + 2b*3. 7b*3 Expand (3z2 + z2 - 3z2)(-z*2 - 3z*2 + 5z*2) + (-4z*3 + 4z3 - z3)(-z - 2z + 0z). 4z*4 Expand (-3s*2 - s + s)(-22s2 - 84 + 41 + 45). 66s*4 - 6s*2 Expand (-4d3 - d3 + 6d3)(3 - 1 - 1)(-2 - 3 + 3)(3 - 2 +	{ "pile_set_name": "DM Mathematics" }
e thousands digit of 5485? 5 What is the tens digit of 71088? 8 What is the hundreds digit of 3266? 2 What is the hundreds digit of 13428? 4 What is the tens digit of 44615? 1 What is the units digit of 39719? 9 What is the hundreds digit of 280? 2 What is the thousands digit of 7534? 7 What is the thousands digit of 11518? 1 What is the hundreds digit of 8043? 0 What is the units digit of 12095? 5 What is the tens digit of 2349? 4 What is the ten thousands digit of 18166? 1 What is the units digit of 5240? 0 What is the tens digit of 88525? 2 What is the units digit of 3341? 1 What is the units digit of 4327? 7 What is the units digit of 1452? 2 What is the thousands digit of 5772? 5 What is the hundreds digit of 3622? 6 What is the units digit of 1595? 5 What is the units digit of 27553? 3 What is the hundreds digit of 403? 4 What is the thousands digit of 1990? 1 What is the thousands digit of 21535? 1 What is the hundreds digit of 46310? 3 What is the thousands digit of 2681? 2 What is the tens digit of 20044? 4 What is the tens digit of 5874? 7 What is the tens digit of 1143? 4 What is the hundreds digit of 105239? 2 What is the tens digit of 19277? 7 What is the thousands digit of 58910? 8 What is the hundreds digit of 390? 3 What is the units digit of 10712? 2 What is the hundreds digit of 6310? 3 What is the tens digit of 782? 8 What is the units digit of 1016? 6 What is the ten thousands digit of 29234? 2 What is the tens digit of 3044? 4 What is the hundreds digit of 1591? 5 What is the tens digit of 6723? 2 What is the tens digit of 171? 7 What is the thousands digit of 46864? 6 What is the tens digit of 546? 4 What is the tens digit of 81845? 4 What is the hundreds digit of 11208? 2 What is the thousands digit of 2031? 2 What is the tens digit of 1057? 5 What is the hundreds digit of 1603? 6 What is the tens digit of 2703? 0 What is the thousands digit of 2541? 2 What is the tens digit of 480? 8 What is the units digit of 1013? 3 What is the hundreds digit of 1459? 4 What is the tens digit of 564? 6 What is the units digit of 9120? 0 What is the units digit of 2446? 6 What is the thousands digit of 12207? 2 What is the units digit of 3055? 5 What is the thousands digit of 15876? 5 What is the tens digit of 70121? 2 What is the tens digit of 71027? 2 What is the units digit of 1606? 6 What is the tens digit of 1302? 0 What is the hundreds digit of 301? 3 What is the hundreds digit of 3603? 6 What is the hundreds digit of 29006? 0 What is the thousands digit of 8954? 8 What is the thousands digit of 4694? 4 What is the thousands digit of 120604? 0 What is the thousands digit of 1388? 1 What is the tens digit of 10122? 2 What is the ten thousands digit of 24138? 2 What is the ten thousands digit of 137054? 3 What is the tens digit of 3612? 1 What is the tens digit of 5046? 4 What is the tens digit of 891? 9 What is the tens digit of 9266? 6 What is the tens digit of 1106? 0 What is the thousands digit of 21239? 1 What is the units digit of 9805? 5 What is the tens digit of 15995? 9 What is the tens digit of 35134? 3 What is the hundreds digit of 967? 9 What is the hundreds digit of 8665? 6 What is the hundreds digit of 1635? 6 What is the thousands digit of 35143? 5 What is the tens digit of 9402? 0 What is the thousands digit of 36854? 6 What is the tens digit of 10243? 4 What is the ten thousands digit of 192519? 9 What is the hundreds digit of 2068? 0 What is the hundred thousands digit of 158705? 1 What is the units digit of 1820? 0 What is the hundreds digit of 5947? 9 What is the tens digit of 1062? 6 What is the units digit of 2533? 3 What is the units digit of 2173? 3 What is the thousands digit of 21462? 1 What is the thousands digit of 78928? 8 What is the tens digit of 468? 6 What is the tens digit of 928? 2 What is the hundreds digit of 110273? 2 What is the tens digit of 1073? 7 What is the units digit of 5056? 6 What is the units digit of 102? 2 What is the ten thousands digit of 74451? 7 What is the hundreds digit of 3145? 1 What is the tens digit of 197? 9 What is the units digit of 494? 4 What is the units digit of 29687? 7 What is the hundreds digit of 207? 2 What is the thousands digit of 5099? 5 What is the hundreds digit of 15744? 7 What is the tens digit of 93613? 1 What is the tens digit of 24456? 5 What is the ten thousands digit of 34622? 3 What is the thousands digit of 3972? 3 What is the tens digit of 4393? 9 What is the hundreds digit of 3370? 3 What is the hundreds digit of 9505? 5 What is the units digit of 35? 5 What is the thousands digit of 104321? 4 What is the thousands digit of 1208? 1 What is the thousands digit of 38240? 8 What is the units digit of 4460? 0 What is the units digit of 22375? 5 What is the tens digit of 29430? 3 What is the thousands digit of 1211? 1 What is the hundreds digit of 1028? 0 What is the tens digit of 1511? 1 What is the hundreds digit of 8157? 1 What is the hundreds digit of 21339? 3 What is the tens digit of 487? 8 What is the tens digit of 3953? 5 What is the thousands digit of 6065? 6 What is the units digit of 98931? 1 What is the tens digit of 2491? 9 What is the units digit of 4559? 9 What is the ten thousands digit of 106152? 0 What is the tens digit of 538? 3 What is the hundreds digit of 1838? 8 What is the hundreds digit of 280? 2 What is the hundreds digit of 4002? 0 What is the thousands digit of 23328? 3 What is the thousands digit of 6686? 6 What is the ten thousands digit of 14684? 1 What is the tens digit of 62489? 8 What is the tens digit of 750? 5 What is the units digit of 842? 2 What is the ten thousands digit of 34201? 3 What is the tens digit of 1901? 0 What is the units digit of 1161? 1 What is the units digit of 31020? 0 What is the tens digit of 8857? 5 What is the tens digit of 2550? 5 What is the hundreds digit of 1874? 8 What is the thousands digit of 9032? 9 What is the units digit of 2441? 1 What is the ten thousands digit of 29483? 2 What is the hundreds digit of 51653? 6 What is the thousands digit of 4638? 4 What is the hundreds digit of 4874? 8 What is the thousands digit of 1846? 1 What is the tens digit of 1539? 3 What is the hundred thousands digit of 176971? 1 What is the units digit of 129152? 2 What is the hundreds digit of 341? 3 What is the tens digit of 727? 2 What is the units digit of 381? 1 What is the units digit of 39846? 6 What is the hundreds digit of 813? 8 What is the thousands digit of 30720? 0 What is the thousands digit of 117387? 7 What is the thousands digit of 3878? 3 What is the units digit of 11883? 3 What is the tens digit of 588? 8 What is the tens digit of 3612? 1 What is the units digit of 1535? 5 What is the thousands digit of 1685? 1 What is the thousands digit of 138109? 8 What is the thousands digit of 6655? 6 What is the hundreds digit of 22375? 3 What is the units digit of 271? 1 What is the thousands digit of 122989? 2 What is the units digit of 6839? 9 What is the units digit of 66448? 8 What is the units digit of 29428? 8 What is the units digit of 363? 3 What is the hundreds digit of 4793? 7 What is the tens digit of 430? 3 What is the tens digit of 102570? 7 What is the tens digit of 5170? 7 What is the tens digit of 7837? 3 What is the units digit of 3871? 1 What is the tens digit of 905? 0 What is the ten thousands digit of 14139? 1 What is the units digit of 3023? 3 What is the units digit of 129? 9 What is the hundreds digit of 1047? 0 What is the hundreds digit of 4309? 3 What is the hundreds digit of 3657? 6 What is the hundreds digit of 152? 1 What is the hundreds digit of 2085? 0 What is the hundreds digit of 53462? 4 What is the units digit of 10203? 3 What is the hundreds digit of 8643? 6 What is the tens digit of 965? 6 What is the thousands digit of 1363? 1 What is the ten thousands digit of 31279? 3 What is the units digit of 24? 4 What is the thousands digit of 4846? 4 What is the hundreds digit of 495? 4 What is the thousands digit of 17586? 7 What is the ten thousands digit of 18170? 1 What is the units digit of 14351? 1 What is the thousands digit of 5756? 5 What is the tens digit of 56496? 9 What is the units digit of 114? 4 What is the tens digit of 7605? 0 What is the hu	{ "pile_set_name": "DM Mathematics" }
'th term of 3027, 3025, 3023, 3021? -2z + 3029 What is the n'th term of 194, 203, 212, 221, 230, 239? 9n + 185 What is the z'th term of -41239, -41241, -41245, -41251? -z*2 + z - 41239 What is the j'th term of -21, -41, -61, -81? -20j - 1 What is the s'th term of -31, -141, -325, -583, -915? -37s2 + s + 5 What is the j'th term of 24, 50, 80, 114, 152? 2j*2 + 20j + 2 What is the m'th term of 27, 48, 81, 132, 207, 312? m*3 + 14m + 12 What is the x'th term of -1, -21, -53, -97? -6x2 - 2x + 7 What is the d'th term of -41, -75, -97, -101, -81, -31, 55? d*3 - 41d - 1 What is the v'th term of -2350, -2340, -2330, -2320? 10v - 2360 What is the y'th term of -82, -111, -140? -29y - 53 What is the p'th term of 47, 182, 401, 698, 1067? -p*3 + 48p*2 - 2p + 2 What is the t'th term of -58, -115, -172? -57t - 1 What is the l'th term of 145, 135, 111, 67, -3, -105? -l3 - l2 + 147 What is the w'th term of 30, 58, 90, 126? 2w*2 + 22w + 6 What is the c'th term of 8, -7, -40, -97, -184, -307, -472? -c*3 - 3c2 + c + 11 What is the p'th term of 1843, 1842, 1843, 1846? p2 - 4p + 1846 What is the b'th term of 28, 55, 100, 169, 268, 403? b3 + 3b*2 + 11b + 13 What is the a'th term of -388, -773, -1158, -1543? -385a - 3 What is the f'th term of -19, -44, -69, -94, -119? -25f + 6 What is the s'th term of -22, -28, -24, 2, 62, 168? 2s3 - 7s*2 + s - 18 What is the n'th term of 232, 239, 246, 253, 260? 7n + 225 What is the x'th term of 24, 152, 506, 1200, 2348, 4064? 19x3 - x2 - 2x + 8 What is the q'th term of 328, 330, 340, 364, 408? q*3 - 2q*2 + q + 328 What is the h'th term of -71, -148, -231, -320, -415, -516, -623? -3h*2 - 68h What is the d'th term of 57, 47, 37, 27, 17? -10d + 67 What is the m'th term of 3, 10, 25, 54, 103? m3 - 2m*2 + 6m - 2 What is the l'th term of -102, -211, -320? -109l + 7 What is the n'th term of -62, -123, -184, -245? -61n - 1 What is the f'th term of -18, -63, -132, -219, -318, -423, -528? f*3 - 18f*2 + 2f - 3 What is the k'th term of -169, -367, -579, -811, -1069, -1359, -1687, -2059? -k3 - k2 - 188k + 21 What is the h'th term of 3, 2, 1, 0, -1, -2? -h + 4 What is the c'th term of 3, 2, -1, 0, 11, 38, 87, 164? c3 - 7c*2 + 13c - 4 What is the q'th term of -4, -21, -52, -97, -156, -229? -7q2 + 4q - 1 What is the l'th term of -23490, -46981, -70472, -93963? -23491l + 1 What is the n'th term of 3, -13, -43, -93, -169, -277? -n3 - n2 - 6n + 11 What is the b'th term of -159, -325, -503, -699, -919? -b*3 - 159b + 1 What is the b'th term of 24, 6, -30, -90, -180? -b*3 - 3b*2 - 2b + 30 What is the z'th term of -204, -200, -196? 4z - 208 What is the p'th term of -20, -15, 48, 199, 468? 5p3 - p2 - 27p + 3 What is the w'th term of -22, -6, 32, 98, 198, 338, 524? w3 + 5w*2 - 6w - 22 What is the f'th term of -3775, -3773, -3769, -3763, -3755, -3745? f*2 - f - 3775 What is the p'th term of -195, -180, -165? 15p - 210 What is the j'th term of -987, -963, -923, -861, -771, -647, -483? j*3 + 2j*2 + 11j - 1001 What is the h'th term of -42, -169, -382, -681, -1066, -1537? -43h2 + 2h - 1 What is the z'th term of -56, -71, -96, -137, -200, -291, -416, -581? -z3 + z2 - 11z - 45 What is the t'th term of 2, 15, 60, 155, 318, 567? 3t*3 - 2t*2 - 2t + 3 What is the d'th term of 1192, 2391, 3590? 1199d - 7 What is the g'th term of 62, 66, 72, 80, 90, 102, 116? g2 + g + 60 What is the n'th term of -991, -987, -981, -973, -963, -951, -937? n2 + n - 993 What is the w'th term of 3502, 3503, 3504, 3505, 3506? w + 3501 What is the g'th term of 168, 674, 1520, 2706? 170g*2 - 4g + 2 What is the h'th term of -682, -680, -678, -676, -674, -672? 2h - 684 What is the b'th term of 798, 3177, 7138, 12681, 19806, 28513, 38802? 791b*2 + 6b + 1 What is the f'th term of 115, 99, 73, 37, -9, -65, -131? -5f2 - f + 121 What is the d'th term of 69, 145, 225, 309, 397? 2d*2 + 70d - 3 What is the u'th term of 560, 1115, 1670, 2225, 2780? 555u + 5 What is the h'th term of -6349, -6342, -6333, -6322, -6309? h2 + 4h - 6354 What is the r'th term of -56, -52, -46, -38? r*2 + r - 58 What is the t'th term of -1710, -3436, -5162, -6888? -1726t + 16 What is the p'th term of 8, -22, -98, -244, -484, -842? -4p3 + p2 - 5p + 16 What is the l'th term of 5, 13, 33, 71, 133, 225, 353? l3 + l + 3 What is the n'th term of -9149, -9152, -9157, -9164, -9173, -9184? -n2 - 9148 What is the b'th term of -1780, -3566, -5350, -7132, -8912, -10690, -12466? b*2 - 1789b + 8 What is the m'th term of 18, 113, 374, 885, 1730, 2993, 4758, 7109? 14m3 - m2 + 5 What is the l'th term of -11, -8, -3, 4, 13, 24? l2 - 12 What is the v'th term of -119, -117, -115, -113, -111, -109? 2v - 121 What is the w'th term of -22, -44, -90, -172, -302, -492, -754? -2w3 - 8w - 12 What is the h'th term of 1186, 1313, 1426, 1519, 1586? -h3 - h2 + 137h + 1051 What is the a'th term of -1559, -1570, -1585, -1604, -1627, -1654, -1685? -2a*2 - 5a - 1552 What is the g'th term of 992, 1986, 2980, 3974, 4968, 5962? 994g - 2 What is the n'th term of 594, 1187, 1780, 2373, 2966? 593n + 1 What is the m'th term of -30, -77, -138, -213, -302, -405, -522? -7m2 - 26m + 3 What is the m'th term of -69, -124, -179? -55m - 14 What is the r'th term of -13, -24, -35, -46, -57? -11r - 2 What is the z'th term of 1605, 1604, 1603, 1602, 1601? -z + 1606 What is the y'th term of -37, -76, -115, -154, -193, -232? -39y + 2 What is the r'th term of -120, -149, -188, -243, -320? -r3 + r2 - 25r - 95 What is the s'th term of -10, 56, 172, 344, 578, 880, 1256, 1712? s*3 + 19s*2 + 2s - 32 What is the r'th term of 5420, 5418, 5428, 5456, 5508, 5590? r*3 - 9r + 5428 What is the k'th term of -4394, -8784, -13162, -17522, -21858? k*3 - 4397k + 2 What is the s'th term of 51, 58, 65, 72? 7s + 44 What is the h'th term of 4, 26, 46, 52, 32, -26, -134, -304? -2h*3 + 11h*2 + 3h - 8 What is the j'th term of -9, -6, -3? 3j - 12 What is the f'th term of -25, -39, -53, -67, -81, -95? -14f - 11 What is the n'th term of 27, 48, 59, 60, 51, 32, 3? -5n2 + 36n - 4 What is the i'th term of 32, 45, 74, 125, 204, 317? i*3 + 2i2 + 29 What is the u'th term of -16, -19, -24, -31, -40, -51? -u2 - 15 What is the n'th term of -187, -720, -1595, -2806, -4347, -6212, -8395, -10890? n*3 - 177n*2 - 9n - 2 What is the u'th term of 3164, 3158, 3140, 3104, 3044, 2954, 2828, 2660? -u*3 + u + 3164 What is the b'th term of -333, -667, -1001, -1335, -1669, -2003? -334b + 1 What is the x'th term of 101, 100, 99, 98, 97? -x + 102 What is the v'th term of -2, 42, 116, 220, 354, 518, 712? 15v2 - v - 16 What is the m'th term of 20, 38, 54, 68, 80, 90? -m2 + 21m What is the n'th term of 35, 67, 101, 137, 175, 215? n*2 + 29n + 5 What is the i'th term of -423, -425, -427, -429, -431, -433? -2i - 421 What is the t'th term of 135, 126, 117, 108? -9t + 144 What is the y'th term of 1292, 1295, 1300, 1307, 1316? y2 + 1291 What is the j'th term of 1690, 6793, 15290, 27175, 42442? -j3 + 1703j2 + j - 13 What is the r'th term of 8470, 8469, 8468, 8467? -r + 8471 What is the c'th term of 180, 368, 556, 744, 932? 188c - 8 What is the i'th term of -108, -94, -76, -54, -28? 2i2 + 8i - 118 What is the n'th term of 35, 37, 39? 2n + 33 What is the o'th term of 2446, 2446, 2456, 2482, 2530? o3 - o2 - 4o + 2450 What is the h'th term of 338, 299, 242, 173, 98, 23, -46? h*3 - 15h2 - h + 353 What is the a'th term of 792, 791, 790, 789, 788? -a + 793 What is the c'th term of 858, 854, 848, 840, 830, 818? -c2 - c + 860 What is the v'th term of -34, -135, -298, -517, -786? v*3 - 37v*2 + 3v - 1 What is the f'th term of 181, 361, 543, 727? f*2 + 177f + 3 What is the n'th term of 1985, 1992, 2011, 2048, 2109? n*3 + 1984 What is the b'th term of -20, -24, -32, -44, -60, -80? -2b*2 + 2b - 20 What is the b'th term of 1164, 2332, 3500, 4668, 5836? 1168b - 4 What is the x'th term of -64, -81, -98, -115? -17x - 47 What is the t'th term of -3, -19, -53, -111, -199, -323, -489? -t*3 - 3t*2 + 1 What is the c'th term of 77, 78, 83, 92, 105, 122, 143? 2c*2 - 5c + 80 What is the	{ "pile_set_name": "DM Mathematics" }
2688397207? 77.1688397207 What is -1881.56 + 123793.05? 121911.49 Calculate 0.07715232 - -0.07648. 0.15363232 Put together -13852483668313 and 0.4. -13852483668312.6 What is -0.121 - -61924990869? 61924990868.879 What is -0.1131695 plus 78963.596? 78963.4828305 Sum -49 and -4936806267. -4936806316 Calculate 1819507 - 58878911. -57059404 What is -29129972306 plus -0.8637? -29129972306.8637 What is -0.05 - -10413.98889? 10413.93889 What is 8242182.93 less than -1628? -8243810.93 -337+145271504.6 145271167.6 Add together -0.2436 and 327246899. 327246898.7564 What is 1665936.702 minus -97681? 1763617.702 Add 10101206 and 1165.37. 10102371.37 What is -159 take away 258088.73722? -258247.73722 Add together 850.6470264 and 0.1. 850.7470264 Calculate 29.8 + 2259838961. 2259838990.8 What is the difference between 0.994151778 and -1959? 1959.994151778 Subtract -332770136 from -35369. 332734767 What is the difference between -3959.3 and 4468281.2? 4472240.5 40226.71 + -19.725 40206.985 What is the distance between 5178 and 10806.339? 5628.339 What is -10.89944 minus 0.05320318? -10.95264318 Work out -0.851 + -66768.5735. -66769.4245 Subtract -735160577 from -302. 735160275 What is -0.163 plus -37523496660? -37523496660.163 What is 0 - 44924913.2? -44924913.2 Work out -2172414534178 + 0.2. -2172414534177.8 Work out 554201658850 + -0.8. 554201658849.2 What is -3.286 + 52.05517? 48.76917 What is the distance between -7.396556 and -0.08089? 7.315666 What is 3.68 take away -233584819658.4? 233584819662.08 Calculate 2 - 25768.123066292. -25766.123066292 What is the distance between -93.16866674 and -0.0353? 93.13336674 What is -0.01 minus 644.520347254? -644.530347254 What is -19299737.5 minus -0.1017? -19299737.3983 Work out 11.42 + -1118231559. -1118231547.58 Put together 0.09423907 and 0.39706. 0.49129907 Subtract 4813681 from -16800276. -21613957 What is 1072900172941 minus -4? 1072900172945 What is 1.2 take away -3.2192499964? 4.4192499964 Sum 24 and -4.2162117651218. 19.7837882348782 What is -1.8 plus 141129706590? 141129706588.2 What is -2.9381 plus -22145917? -22145919.9381 Work out -300 + 1737565067. 1737564767 2.79 - -0.62622355192 3.41622355192 Subtract 2.9656 from -1296729. -1296731.9656 19125268.41+-44190 19081078.41 8722634.834 - -0.287 8722635.121 Sum -2 and 8347330271369. 8347330271367 Add together 82604505 and -3541. 82600964 Put together -43524521 and -13703.8. -43538224.8 What is -12035.6 less than -20345406? -20333370.4 Add together -89662504 and 464.42. -89662039.58 Calculate -0.4 + -66838.533008. -66838.933008 What is 9.713 take away 93.76378? -84.05078 Work out 1034.887 + -31036. -30001.113 Work out 2.353679989 + 100.9. 103.253679989 Add together -0.02 and 15436713997. 15436713996.98 Add together -1014886 and -1349259. -2364145 Put together -379752746161 and 0. -379752746161 Put together 21587.3 and -1828442949. -1828421361.7 3152161540+62 3152161602 -44786350712974 - 2.4 -44786350712976.4 Subtract -63635 from -8490079. -8426444 What is 6131791 minus -12940? 6144731 Calculate 951.11 - 15726992.1. -15726040.99 Add together 0.0348 and -104094.64994. -104094.61514 Subtract -1 from -348496062609315. -348496062609314 What is the difference between -1626 and -13.6167431132? 1612.3832568868 0.0806764953 - 76289 -76288.9193235047 What is the distance between 350.400027 and -76120? 76470.400027 What is -24 plus 280954497509? 280954497485 Calculate -663.738136 + 53.8467. -609.891436 What is the distance between 1711139222.743 and 78? 1711139144.743 What is the distance between 314556267408 and 4? 314556267404 737 + -13.340982 723.659018 Calculate -25 + 1509834170433. 1509834170408 Calculate -25562 + -342531487. -342557049 Calculate -1504432083 + 170. -1504431913 6 - -1838382790 1838382796 Add -3.87 and 0.3882752428. -3.4817247572 What is the distance between 247196140 and 0.920097? 247196139.079903 What is -1972022 - -712548.2? -1259473.8 Sum 5 and -3720981639536. -3720981639531 Total of 3.077 and -2064.303636. -2061.226636 Calculate -26.923 - 2388437429. -2388437455.923 Calculate 10981969 + -101670554. -90688585 Calculate 2 + 0.371315005923. 2.371315005923 What is 12020346589 + -3.4? 12020346585.6 What is -0.0822 plus -0.04311455032? -0.12531455032 What is the difference between -33.2589484 and -2401? 2367.7410516 Work out -2 - -18121529182705. 18121529182703 What is -9942578 minus -0.2896681? -9942577.7103319 Work out -520217 - -115839. -404378 Put together -0.4 and -11489613487904. -11489613487904.4 What is -25 take away 72924796447? -72924796472 Add -979.2539 and -5.869. -985.1229 What is -38.68505 less than 2606? 2644.68505 What is -198 - -489.8676987125? 291.8676987125 What is the distance between -0.0370372 and -56.3502726? 56.3132354 What is 0.21412335 minus 9107.9? -9107.68587665 Calculate 23244448 - -34.27. 23244482.27 Calculate 1103 - 5167.6186. -4064.6186 -1.16 + -15.663014031 -16.823014031 Work out 0.2 + -2758596954846. -2758596954845.8 Add together 371377175.359 and 136. 371377311.359 Put together -737821892 and 1743. -737820149 What is the difference between -0.309 and 30900130? 30900130.309 -15336.137828697 - 15 -15351.137828697 What is the difference between -1755803828 and -361? 1755803467 Subtract 298.763 from 2805612.06. 2805313.297 Add 384242883 and 0.2201. 384242883.2201 What is 4189616 - 16239? 4173377 What is the distance between -390188783 and -165.1? 390188617.9 Add 26020588910 and -38.93. 26020588871.07 -0.06 - 4193744.959306 -4193745.019306 What is the difference between 1447643778 and -145? 1447643923 What is -6405638 less than -237526? 6168112 What is -12.5194744427 minus -0.02? -12.4994744427 What is 2759.444844415 take away -0.4? 2759.844844415 What is -2290941 minus -5769463? 3478522 -2114.138426 + -0.4 -2114.538426 What is -3595077810 less than 14347? 3595092157 What is -1 take away -474460.097326? 474459.097326 0.3456+-155.76 -155.4144 What is 739534194.907 plus 0.8? 739534195.707 What is -11059373269482 plus 1? -11059373269481 What is 572484 take away -238.4674? 572722.4674 Add 1288457.24 and 193948. 1482405.24 -588284 + 0.30495 -588283.69505 Calculate 0.1 - 20688928614183. -20688928614182.9 Work out 29 - -533824573341. 533824573370 514624628+-4.012 514624623.988 206.852166067 - -3 209.852166067 What is the difference between -0.4 and 10818142628.543? 10818142628.943 Calculate 494 - 16.047966803. 477.952033197 Calculate -29937916552 + -24.7. -29937916576.7 Calculate -1.2 + -63760702.556. -63760703.756 Sum 6 and -27735607717. -27735607711 Add -0.204 and -270742.33213. -270742.53613 -89.6 + -18227539037 -18227539126.6 Work out -5968.32139 + 1927376. 1921407.67861 Sum 3 and 4146048582992. 4146048582995 What is 0.356406677 plus 0.0668? 0.423206677 Work out -41073683284.44 - -0.3. -41073683284.14 What is the difference between -193287 and 1216826? 1410113 What is 4.339401408875 plus -2.2? 2.139401408875 Sum -5 and 523213285.551. 523213280.551 What is 0.3 - 194351639024722? -194351639024721.7 Total of 21 and 3727517.76164. 3727538.76164 What is -2538179409048 minus 0.009? -2538179409048.009 29.9+-13676585.9023 -13676556.0023 Sum -1.248 and 26802711348. 26802711346.752 0.1 - -103240.860579995 103240.960579995 What is -73964423699 less than -2.7? 73964423696.3 What is 13 plus 15311278.203? 15311291.203 What is the distance between 34225.522392 and -32.7? 34258.222392 What is 94513283 less than 76? -94513207 Put together 127136.5 and 462271721. 462398857.5 -23928939 - 399714 -24328653 Calculate -0.2 - -658635.423182. 658635.223182 What is the distance between -4790 and 41201.04181? 45991.04181 581419 - -21918.646 603337.646 Work out 47316960552 + -0.4. 47316960551.6 Add together -5608 and 4092270968. 4092265360 5818.0057823757 + 2.3 5820.3057823757 What is 0.2 - -4005085313776? 4005085313776.2 Work out 941 - 0.0470355139. 940.9529644861 Add 1 and 129.498997626198. 130.498997626198 What is -0.064 minus -33.0724568867? 33.0084568867 What is the distance between -254148971185 and 2.02? 254148971187.02 Total of -0.11 and -25495364923.5. -25495364923.61 What is 0.068864854 less than 1.4482? 1.379335146 Work out -1610.86 - -0.05043052. -1610.80956948 What is the difference between -1860.37 and 217332385.5? 217334245.87 Pu	{ "pile_set_name": "DM Mathematics" }
digit of v? 7 Let c = -179 - -249. What is the units digit of c? 0 Let m = 21979 - 11880. What is the units digit of m? 9 Suppose 0 = -27p + 26p. Suppose p = -4b - 2o + 1146 + 3160, -b + 5o + 1082 = 0. What is the hundreds digit of b? 0 What is the units digit of 100/30(-3)/2-1694? 0 Let h be ((-4376)/(-3))/43. Let n = h - 771. What is the hundreds digit of n? 3 Suppose -45a - 318516 + 1206411 = 0. What is the thousands digit of a? 9 Let p = -1241 + 3597. Suppose 10b = 14b - p. What is the tens digit of b? 8 What is the hundreds digit of ((-2560)/25 - -6)(-220)/8? 6 Suppose 474702 = -196z + 106406 + 1988824. What is the thousands digit of z? 8 Let a(r) be the first derivative of r2/2 + 23r - 66. What is the units digit of a(-17)? 6 Suppose v + 6 = -0b - 4b, 0 = -3v + 5b + 33. Let d be ((-24)/9)/427/v. What is the tens digit of (-1)/d + 264/18? 1 Let o(c) = -10c*3 - 2c*2 + 2c + 57. Let i be o(-8). Suppose -i = -2l - 1267. What is the hundreds digit of l? 8 Suppose 3 + 3 = 3h. Suppose -34c = -99c - 29c + 658. Suppose cx = hx + 555. What is the units digit of x? 1 Let p be (-2)/(-2 - (-9)/6). Suppose 2 = -s + 2l + 5, s - 3 = -pl. Suppose sr = r + 5w + 195, -w = 4r - 335. What is the units digit of r? 5 Let x = -7834 + 15491. What is the thousands digit of x? 7 Let d(n) = 12n2 - 425n + 11. What is the thousands digit of d(-21)? 4 Suppose 8o = -0o + 168. Let z = o + -17. Suppose q - 4l = 257, -zq = -6q + 5l + 526. What is the units digit of q? 3 Let s = 21 - 19. Suppose sf = -28 + 620. What is the units digit of f? 6 Let s(w) = w2 + 3w + 5. Let p be s(-3). Suppose 3o + 2t = 820, po - 1364 = -0o - 4t. What is the units digit of o? 6 Let n = -38 - -18. Let y be 2067/(-15) + (0 - (-4)/n). Let b = 308 + y. What is the units digit of b? 0 Let k = 21211 + -15695. What is the thousands digit of k? 5 Let b = -109 - -65. Let m be b/7 - (-2)/7. Let l(u) = -u3 - 4u*2 + 5u - 9. What is the tens digit of l(m)? 3 Suppose -37 = -5d - b, -20 = -2d + b - 8. Suppose 9z = dz + 108. What is the tens digit of (-3)/(81/6) + 8112/z? 5 Suppose -c + 3y = 0, 5c + 5y - 21 + 1 = 0. What is the tens digit of (-177)/(-11/(c/3))? 7 Let d = 15156 - 4632. What is the tens digit of d? 2 Suppose -2u - 51023 + 6421 = -r, -178408 = -4r + 3u. What is the ten thousands digit of r? 4 Suppose -4i + 3j - 4j = -20, -3i + 32 = 5j. Suppose -iv = 4z + 13 - 1369, 2v - 687 = -5z. What is the tens digit of v? 3 Let t = 1880 + 5366. What is the units digit of t? 6 Let d(h) = h + 16. Let j be d(-18). What is the hundreds digit of (2 + 43)8 + (-4)/j? 3 What is the thousands digit of (13 - (29 - 12)) + 8793? 8 Suppose 320 = 7b + 285. Suppose -bw + 2944 = o + 1069, 0 = 2o - 4w - 3750. What is the thousands digit of o? 1 What is the hundreds digit of (-67)/(1340/360)(2 - 1216)? 8 Let b = -93 - -96. Suppose 2l - 1106 = 2c, 2l + 2l - 2213 = bc. What is the hundreds digit of l? 5 Let r(m) = 8m + 1171. What is the units digit of r(37)? 7 Let o(y) = y*2 + 12y + 26. Let v be o(-11). Suppose i = 4m - 12, 5m + 0m - v = i. Suppose -z - 34 = -d, mz + 0z = -6. What is the units digit of d? 2 Suppose -3b - 5d + 6d = 50, 0 = 5d - 25. What is the thousands digit of ((-1187)/5)/(836/(-55) - b)? 1 What is the hundreds digit of 17850/(-510)1047/(-1)? 6 Suppose -k + 400 = -5g, 7g = 12g + k + 400. What is the hundreds digit of 232/((g/(-56))/5)? 8 Suppose -17423 + 93345 = 22h. What is the hundreds digit of h? 4 Let x = -274 - -50. Let v = x + 975. What is the hundreds digit of v? 7 Suppose 2g + 2n + 443 - 15267 = 0, -3n = 3. What is the tens digit of g? 1 Suppose 260 = 30z + 20. What is the tens digit of 6096/z + -4 - -4? 6 Suppose h - 10574 = -k, -2k - k + 4h = -31764. What is the tens digit of k? 8 Let m = -224 + 1018. Let t = m + -13. What is the tens digit of t? 8 Let t = 7366 - 3680. What is the thousands digit of t? 3 Let u(y) = -11y + 8. Let v be u(5). Let r = v - -55. Suppose -3j - r = -293. What is the tens digit of j? 9 Let n(w) = w*3 - 15w*2 + 18w - 48. Suppose 55 = 5f + 7v - 4v, 2f = 5v + 53. What is the units digit of n(f)? 8 Let f(r) = r3 + r2 - r + 1. Let d(t) = 4t*3 - 4t*2 - 13t - 7. Let i(q) = -d(q) + 3f(q). Let o be i(9). Let h = o - -123. What is the units digit of h? 1 Let a(l) = l3 - 6l*2 - 3l + 8. Let u be a(6). Suppose 10q - 45 = -3n + 5q, 3n = 5q + 15. What is the tens digit of (-174)/u + -2 - n/25? 1 Suppose 18s - 2 = 20s + y, 0 = -4y + 16. What is the units digit of ((-2748)/8)/(s/6)? 7 Let x = 2334 + 7733. What is the ten thousands digit of x? 1 Suppose 9s - 8s - 4h - 63 = 0, -5s + 3h = -264. What is the tens digit of (s/102)/((-2)/(-1292))? 2 Let p = 20734 + -16566. What is the hundreds digit of p? 1 Let f(u) = 27u - 159. Let j(c) = -109c + 636. Let m(k) = -9f(k) - 2j(k). What is the tens digit of m(-12)? 5 Suppose 2y = 12y - 220. Let n = -28 + y. What is the tens digit of (-8)/(16/(-6))(-94)/n? 4 Let r = 20366 - 12800. What is the units digit of r? 6 Let l(y) = 59y - 1184. Let r(i) = 30i - 593. Let n(w) = -4l(w) + 7r(w). What is the hundreds digit of n(0)? 5 Suppose 0 = 7d + 63 - 119. What is the hundreds digit of d + (-450)/55 - 11288/(-11)? 0 Suppose -22g = 4g - 25714. Suppose -2 = u, -3a - u - g = -6a. What is the units digit of a? 9 Let g = 187 + -99. Let b = 507 - g. What is the tens digit of b? 1 Suppose -18f + 18234 = -19944. What is the hundreds digit of f? 1 Let k be -4 + -1 - (-12)/(-6). Let m(s) be the third derivative of -11s4/12 + 3s*3 - 2s*2. What is the units digit of m(k)? 2 Suppose 6o + 603 = -3o. Let j = 67 + o. Suppose 5b + i - 66 = j, 4i + 48 = -2b + 6b. What is the units digit of b? 3 Suppose 2u = 2s - 23398, 44825 = 5s + 2u - 13614. What is the units digit of s? 1 Suppose -3i + a = -2i + 2275, 2i + 4532 = -4a. What is the units digit of -3 + i/(-5) + 42/70? 2 Suppose -2v = -7v - 2j - 3, 5j - 1 = -4v. Let i be 1 + v/((-4)/(-1020)). Let w = i + 432. What is the units digit of w? 8 Suppose -2k = -9k - 952. Let b = k + 484. Let d = -112 + b. What is the tens digit of d? 3 Let l = -44 + 47. What is the tens digit of l/(-5) - 32112/(-120)? 6 Let j(u) = 3905u3 - 3u*2 - 3904u*3 - u + 19u*2 + 15u - 32. What is the hundreds digit of j(-10)? 4 Suppose 7 = 4y + 3, -3k - 3y + 8274 = 0. What is the thousands digit of k? 2 Let h = 20 + 6. What is the hundreds digit of 512/12429/h? 7 What is the ten thousands digit of ((-52)/(-12)-17)/((-10)/9510)? 7 Suppose -34 - 26 = -10s. Let t(f) = 7f + 19. Let i(r) = -6r - 18. Let b(n) = -5i(n) - 4t(n). What is the units digit of b(s)? 6 Let h be (-2)/(-6) + (-776)/24. Let g = h - -35. Suppose 0 = -5q + 4i - 0i + 453, -5q - gi = -474. What is the tens digit of q? 9 Let l(r) = 2r3 + r2 - 4r + 15. Let i be l(8). Let f = 1518 - i. What is the tens digit of f? 4 Let j = -45 + 40. Let v = j + 21. Suppose 2y + 4l = 18, l - v = -2y - 4l. What is the tens digit of y? 1 Let y be (-13 - -11)/(2/(-32)). Let c = 37 - y. Suppose 0 = -cp + 2z + 420 - 54, -5z = 2p - 129. What is the units digit of p? 2 Suppose 21 = 4d + 9. Suppose -h + 2z + 289 = 0, -dz - 2z + 911 = 3h. Let b = h - 177. What is the hundreds digit of b? 1 Suppose -91l - 74 = -89l. Let h = l - -661. What is the units digit of h? 4 Let s(y) = y*3 - 7y - 2. Let w be s(3). Suppose -3v + 1435 = wn, -6n = -n + 3v - 1796. What is the units digit of n? 1 Suppose 14m + 301034 - 967658 = 0. What is the thousands digit of m? 7 Let b(m) = m2 + 1. Let a(n) = 3n*2 + 2n - 10. Let h be (-4)/(-2) - (0 - 2/1). Let r(g) = hb(g) + a(g). What is the tens digit of r(2)? 2 Let d be 2/((-1603)/(-534) + 16 + -19). Suppose 2n + 3j = d + 65, -n - 2j + 566 = 0. What is the hundreds digit of n? 5 Let p(r) = -27r + 346. Let i(g) = g3 - g2 + 6g - 6. Let d be i(1). What is the units digit of p(d)? 6 Let c(k) = 216k2 + 23k - 94. What is the tens digit of c(5)? 2 Let s be ((-4)/2 - -1)/(4/4). What is the hundreds digit of (-10428)/(-33) + s(-1 + 2)? 3 Let z(l) = 2l*3 + 108l*2 - 300l + 17. What is the tens digit of z(-35)? 6 Suppose -3d + 6 = 0, -14d	{ "pile_set_name": "DM Mathematics" }
d the second derivative of -3 + 2n5 + 2n*5 + 18n*c - 3n*5 + 25n - 7n5 + 5n*5 wrt n. -20n*3 + 108n Let i(h) be the third derivative of -31h + 0 - 13h3 + h2 + 91/12h4. What is the first derivative of i(p) wrt p? 182 Let r(b) be the first derivative of 1023b*4/2 + 71b*3 + 3b*2/2 - 1291. What is the third derivative of r(c) wrt c? 12276 Let j(z) be the third derivative of 1057z*5/30 + 2z*4/3 - 10z3/3 - z2 + 756z. Find the second derivative of j(d) wrt d. 4228 Let t = 53 - 50. What is the first derivative of 33l + 28l + 35 + 29l - tl wrt l? 87 Let f(n) = n3 + 4n*2 - 124n - 699. Let p be f(-7). Suppose 2u = -u + 66. Differentiate 330 - 317 - pc*3 - uc*3 with respect to c. -132c*2 Let c(w) be the second derivative of 269w*8/28 - 363w*4/4 + 3w - 74. What is the third derivative of c(f) wrt f? 64560f3 Let t(b) = 2b*2 + 2b - 3. Let m(n) = 340n2 + 13n + 1451. Let y(c) = -m(c) + 6t(c). Differentiate y(p) with respect to p. -656p - 1 Suppose -33c - 8 = -37c. What is the derivative of 1031z2 - 55 + 1030z*c + 21z - 2058z2 wrt z? 6z + 21 Suppose -4p - u + 14 - 2 = 0, 0 = -2p - u + 8. Let y(h) be the first derivative of 0h - 21/2h*p + 5/3h*3 + 16. Find the second derivative of y(l) wrt l. 10 Let b(z) be the third derivative of 2z*2 + 3z + 0 + 0z3 - 1/15z*5 + 1/40z*6 + 11/12z*4. Find the second derivative of b(m) wrt m. 18m - 8 Let v(k) be the first derivative of -1444k5/5 - 2k*3/3 - 33k - 158. What is the third derivative of v(g) wrt g? -34656g Let k(h) be the third derivative of -289h*4/12 + 2173h*3/6 + 3607h*2. What is the first derivative of k(r) wrt r? -578 What is the third derivative of -500n*3 - 2071n + 45n3 + 3n*2 - 4n*2 - 316n*3 wrt n? -4626 Let u(p) = 1154p*2 + 8p + 220. Let z(k) = -2k - 5. Let o(m) = -u(m) - 4z(m). Find the first derivative of o(q) wrt q. -2308q Let f(v) be the first derivative of 0v + 69/4v4 + 0v*3 - 67 - 23v*2. Find the second derivative of f(z) wrt z. 414z Let y = 14 - 10. What is the second derivative of 54h4 - 8h - 6h - yh - 2h wrt h? 648h*2 Suppose -2t - 2 + 2 = 0. Suppose 0 = 2a + 2o - 10, t = 6a - a + 3o - 27. What is the derivative of 9r3 - a - 4r*3 + 21 + 1 wrt r? 15r*2 Suppose 62 = 8s - 2. Suppose -5j + sj = 0. What is the first derivative of -2i4 + ji*4 - 5 + 5 - 8 wrt i? -8i*3 Suppose 0 = 5w - 3i - 1049, 5w = 11i - 9i + 1051. Find the second derivative of 425h - wh + 8h2 - 92h*2 - 190h wrt h. -168 Let a(x) be the first derivative of 5 - 5/6x4 + 0x*3 - 7/2x*2 + 26x. Let w(q) be the first derivative of a(q). Differentiate w(u) wrt u. -20u Suppose -x = -0x + 3t - 14, 80 = 4x + 4t. What is the second derivative of xg*3 + 22g*3 + 46g + 76g - 15g*3 wrt g? 180g Let v(o) be the second derivative of 352o4/3 - 1213o*3/6 + 1113o. What is the second derivative of v(t) wrt t? 2816 Let s(w) = w - 1. Let h(k) = -8k - 7k + 18k3 + 6 + 23k - 5 - 10k. Let x = -8 - -6. Let n(u) = xs(u) - h(u). What is the derivative of n(o) wrt o? -54o2 Let d(i) = i2 - 17i - 14. Let x be d(18). Suppose xs + 2 = 5s. Find the third derivative of -3j3 - 35j*2 + 46j*s - 22j*2 wrt j. -18 Let a = 93 + -27. Let m = a + 9. Differentiate -12d*2 + md - 16 - 75d + 2 with respect to d. -24d Let d(q) = 2q2 - 11q - 61. Let l be d(9). What is the third derivative of 2 - 44m + 6m*2 + 50m + 11m2 - l - 118m*3 wrt m? -708 Let b(m) = -58m3 + m2 - 4m - 4. Let o be b(-1). What is the third derivative of -2 - 21u*6 - 2u*5 + 0u5 + u4 - ou2 - 5u*4 + 2u*5 wrt u? -2520u*3 - 96u Let t be (-15)/(5 - 2) - -7. What is the derivative of 341n - 127n*t - 341n + 8 wrt n? -254n Let v(u) be the first derivative of -1/3u*6 + 0u*4 + 0u*2 + 0u*5 + 0u + 18 - 32/3u3 + 33/7u*7. What is the third derivative of v(c) wrt c? 3960c*3 - 120c*2 Let u(p) be the third derivative of 0p*4 - 11/40p*6 + 0p + 8p2 + 0p*3 + 1/30p*5 + 0. Find the third derivative of u(r) wrt r. -198 What is the first derivative of 627 - 2468179k*2 + 9k*3 - 11k + 2468179k2 wrt k? 27k*2 - 11 Find the third derivative of -2031h*6 - 77h*2 + 3211h*6 - 209h*2 wrt h. 141600h*3 Suppose 4l = -5k - 26, -2l + 6l - 2k + 12 = 0. Let n be 14/l-2 + -2. What is the third derivative of 24p*2 - np*6 - 3p*2 + 4p*2 wrt p? -600p*3 Let t(h) = -912h3 + h2 - 245h - 4. Let s(i) = -2737i*3 + 2i*2 - 739i - 12. Let j(n) = -3s(n) + 8t(n). What is the second derivative of j(x) wrt x? 5490x + 4 Let h(i) = -5i + 90. Let l be h(14). Find the third derivative of 8k5 + 12k*4 - 22k + lk - 13k*4 + 84k*2 wrt k. 480k*2 - 24k Let h(r) be the second derivative of -479r5/4 - 4r*4/3 - 29r*3/6 - 4r + 74. Find the third derivative of h(n) wrt n. -14370 Find the third derivative of -26 - 59c2 - 202c - 7c5 + 56c*2 - 114c*3 + 26 wrt c. -420c*2 - 684 Let n(a) = -103a - 51. Let k(b) be the first derivative of -104b2 - 101b + 88. Let s(h) = -3k(h) + 7n(h). Find the first derivative of s(l) wrt l. -97 Let r(m) = 1944m3 + 4m*2 - 4m - 839. Let t(z) = -1945z3 - 5z*2 + 5z + 844. Let p(c) = -5r(c) - 4t(c). Find the first derivative of p(q) wrt q. -5820q2 Let y(n) be the first derivative of 1149n*2/2 + 478n - 574. Find the first derivative of y(s) wrt s. 1149 Let p = 623 - 619. Find the third derivative of 901ip - 1141i*4 + 3i*2 + 14i - 2i2 wrt i. -5760i Find the second derivative of 1275m + 104m*2 - 456m*2 - 441m - 303m2 + 487m wrt m. -1310 Let d(j) = 194j + 90. Let s(g) = -582g - 268. Let x(v) = 6v - 23. Let l be x(3). Let r(o) = ls(o) - 16d(o). What is the first derivative of r(y) wrt y? -194 Let y(i) be the second derivative of -550i7/21 + i3/3 - 353i2/2 - 1153i. What is the second derivative of y(w) wrt w? -22000w3 Let j(z) = -5z*3 - 2z*2 + z + 1. Let u(f) = -5377f*3 - 6f*2 + 3f + 4106. Let c(l) = 3j(l) - u(l). What is the first derivative of c(h) wrt h? 16086h*2 Let l(u) be the second derivative of 5/6u*3 + 0u*4 - 139/42u*7 + 0u*5 + 0u*6 - 19/2u*2 - 114 - 2u. What is the second derivative of l(d) wrt d? -2780d3 Suppose 8l = 7l + 129. Let c be 0 + -4 + 128 + -1. Find the third derivative of 2j*5 + cj*2 + 3j*5 - lj*2 wrt j. 300j*2 Let t(i) = 383i*3 - 19i*2 + 2i + 4168. Let x(a) = 191a3 - 10a*2 + a + 2076. Let u(v) = 3t(v) - 5x(v). What is the second derivative of u(y) wrt y? 1164y - 14 Suppose -11v + 5v = 0. Suppose v = 3c + 3d - 3, -c - 2d + 1 = 5. What is the first derivative of -10 + c - 3 - 15x*3 wrt x? -45x*2 Let v = -88 + 33. Let f = v + 82. What is the derivative of 2i*4 + f - 5 + 0 wrt i? 8i*3 What is the second derivative of 329n - 2435n2 - 335n - 1 + 480n wrt n? -4870 Let x be ((-153)/102)/(4 + 9/(-2)). Let c(a) be the second derivative of 13a + 5/2a2 + 0 + 19/6a*x. Find the first derivative of c(y) wrt y. 19 What is the first derivative of -8 + 94 - 22 + 106 - 1363s*2 wrt s? -2726s Let y(h) be the first derivative of 0h3 + 0h*2 + 114 - 1/4h*4 - 17/5h*5 + 118h. Differentiate y(c) with respect to c. -68c3 - 3c*2 Suppose -4k - 20 = 0, 2j = j + 2k + 14. Differentiate -55cj - 49 + 4054c - 4054c with respect to c. -220c*3 Let w(a) be the second derivative of -19a*7/210 + 8a*3 - 11a*2 - 2a. Let j(n) be the first derivative of w(n). Differentiate j(v) with respect to v. -76v3 Let w = -174 + 176. Find the third derivative of -204y*2 + 163y*2 - 16y*4 + 2y*3 - 5y*3 + wy*3 wrt y. -384y - 6 Suppose -l + 2y + 9 = 0, -5y - 28 + 9 = l. Let n be -1(3 + l) + (21 - 13). What is the third derivative of 17c*4 + 7c*n - 31 + 31 - 5c*2 wrt c? 576c Suppose -2h + 6h + 3m - 13 = 0, -2 = 2m. What is the third derivative of -27o2 + 104o*h + 32 + 70o*2 - 32 wrt o? 2496o What is the third derivative of 951065i + 3i*2 - 16i*3 + 1643i4 + i5 + 18i3 - 949290i wrt i? 60i2 + 39432i + 12 Suppose -32v + 1922 + 1662 = 0. What is the first derivative of 0 - 111 - v + 200p wrt	{ "pile_set_name": "DM Mathematics" }
e j(-148). -10 Let n(o) = 23o - 981. Calculate n(-23). -1510 Let o(h) = -27h*3 + 45h*2 - 39h + 34. Calculate o(1). 13 Let h(k) = k*2 - 19525k - 7077650. Determine h(-356). -14 Let n(f) = 853f - 164648. Calculate n(193). -19 Let g(b) = b3 + 31b*2 - 4574b - 152043. Calculate g(-34). 5 Let u(t) = -2t3 + t2 - 155t - 569. Determine u(-4). 195 Let b(o) = -927o - 197447. Give b(-213). 4 Let d(h) = -697h + 46637. Determine d(67). -62 Let i(f) = 134f + 103. Give i(-7). -835 Let o(x) = 40x*2 + 306x - 61. Give o(-10). 879 Let g(d) = -71d2 + 26211d - 4202. Give g(369). 226 Let l(k) = 2444k + 12578. Give l(-6). -2086 Let l(n) = 23n*2 + 6387n + 12684. Give l(-2). 2 Let f(d) = 823d + 6099. What is f(-7)? 338 Let i(b) = -193b - 4235. Give i(-27). 976 Let y(g) = -6g2 + 1827g - 133033. Calculate y(184). -1 Let z(q) = 3q2 + 1314q + 23848. What is z(-419)? -35 Let y(n) = -51n3 + 170n*2 + 278n - 992. Determine y(3). -5 Let v(y) = 607y - 71012. Determine v(117). 7 Let s(g) = 266g + 3124. Calculate s(-10). 464 Let m(w) = -3w3 + 146w - 893. What is m(0)? -893 Let y(d) = 1557d + 53611. Calculate y(-32). 3787 Let h(n) = 15n*2 - 566n + 2480. What is h(5)? 25 Let j(o) = 5o3 - 3237o*2 + 1185o + 70521. Give j(647). -2 Let d(h) = -228h + 18783. Determine d(77). 1227 Let b(x) = 53x*2 - 3709x - 3709. Calculate b(-1). 53 Let y(j) = -45911j - 1193671. Give y(-26). 15 Let n(q) = -416q - 28327. Give n(-68). -39 Let f(y) = -y*3 + 58y*2 + 34y - 2129. What is f(58)? -157 Let o(q) = -4q3 - 16q*2 + 633q + 1275. Determine o(-2). -23 Let a(c) = c*3 + 106c*2 - 221c - 614. What is a(-108)? -74 Let s(f) = -7f2 - 5172f + 5173. What is s(1)? -6 Let z(y) = -10y3 + 1049y*2 + 58y + 4950. Give z(105). 15 Let h(v) = 5v2 + 3148v - 27191. Determine h(-638). -395 Let i(a) = 24a2 - 1054a - 11505. What is i(53)? 49 Let b(h) = -160305h - 258. Calculate b(0). -258 Let s(n) = 2n*2 + 58n + 480. Give s(-26). 324 Let y(x) = -x*3 - 50x*2 + 687x + 857. Determine y(-61). -119 Let f(h) = -380803h + 761610. Give f(2). 4 Let g(r) = -543r - 118839. What is g(-219)? 78 Let g(b) = b*2 + 3b - 75. Calculate g(16). 229 Let d(f) = -8f2 - 9170f + 82433. Give d(9). -745 Let g(m) = -95617m + 1051782. Calculate g(11). -5 Let v(y) = 18310y + 567137. What is v(-31)? -473 Let u(c) = -2612c - 57472. What is u(-22)? -8 Let q(j) = 35j*2 + 1448j + 11329. What is q(-31)? 76 Let q(t) = 15t3 + 554t*2 - 69t - 1173. Determine q(-37). 11 Let f(x) = -41x3 + 27x*2 - 103x + 13. What is f(4)? -2591 Let m(t) = 4t2 - 789t + 8952. Give m(12). 60 Let o(u) = -2u3 - 8u*2 + 273u + 3147. Calculate o(-11). 1838 Let h(w) = 108w + 594. Determine h(-10). -486 Let v(d) = 17570d - 87627. Give v(5). 223 Let k(a) = 372a - 9052. Determine k(23). -496 Let t(j) = 92j*2 - 1044j + 4154. Calculate t(4). 1450 Let j(f) = -64f3 - 2109f*2 + 96f - 110. Give j(-33). -11 Let q(x) = 11947x + 53461. Calculate q(-4). 5673 Let x(n) = 7813n + 789099. Give x(-101). -14 Let g(k) = 61k3 + 547k*2 + 2k + 12. What is g(-9)? -168 Let o(u) = 7589u - 3589592. Determine o(473). 5 Let a(h) = 1635h + 67005. Give a(-41). -30 Let a(z) = -2z3 - 268z*2 + 547z + 571. Calculate a(-136). 163 Let i(n) = 43n2 - 11743n + 1168. What is i(273)? 76 Let u(n) = -47n3 - 1086n*2 - 37n + 34. Calculate u(-23). -1760 Let r(m) = -635m + 9689. Give r(19). -2376 Let p(j) = -8j*2 - 159j + 2213. Calculate p(11). -504 Let z(l) = 961l + 14580. Calculate z(-15). 165 Let g(c) = 2c*3 + 62c*2 - 88c + 1376. What is g(-33)? -76 Let o(t) = -298t2 - 9t + 47. What is o(0)? 47 Let k(m) = 4m3 + 27m*2 - 5m + 253. Determine k(-8). -27 Let d(r) = r*3 - 65r*2 - 84r + 1165. What is d(66)? -23 Let c(j) = 4j2 + 701j - 5822. Calculate c(8). 42 Let j(d) = d*2 - 7035d + 28112. Give j(4). -12 Let i(b) = -2629b + 891230. What is i(339)? -1 Let y(s) = 40s*2 - 84369s - 234431. Calculate y(2112). 1 Let k(x) = 2x3 - 859x*2 + 3103x - 51571. What is k(426)? -25 Let b(y) = 3y2 - 1074y - 6442. Calculate b(-6). 110 Let o(q) = 270q + 2126. Calculate o(-8). -34 Let r(w) = -33w*2 - 431w + 1548. Determine r(-16). -4 Let n(s) = s*3 + 29s*2 - 246s - 723. Calculate n(-33). 3039 Let z(w) = -33w3 + 893w*2 - 53w - 16. What is z(27)? 11 Let l(o) = -50o2 - 9146o + 620. What is l(-183)? -112 Let o(g) = -2g2 - 273g - 4392. Determine o(-19). 73 Let p(h) = -19h3 + 16h*2 - 36h + 37. What is p(1)? -2 Let k(l) = -131l3 - 130l*2 - 117l - 120. Give k(-1). -2 Let m(y) = 26y3 - 8y*2 + 66y + 154. Calculate m(-2). -218 Let z(p) = 17p - 4015. What is z(234)? -37 Let g(q) = q2 - 2914q + 229470. Calculate g(81). -3 Let s(l) = 5l3 - 907l*2 - 547l + 159. Calculate s(182). -23 Let v(x) = -3062x + 132164. Calculate v(43). 498 Let o(c) = -c3 + 11c*2 + 1032c - 7454. Give o(7). -34 Let q(u) = -5u2 - 804u + 11725. What is q(15)? -1460 Let f(p) = 31p3 + 9p*2 - 81p - 78. Calculate f(-1). -19 Let t(i) = -i*2 - 465i + 11725. What is t(24)? -11 Let a(y) = -1112508y + 10012568. What is a(9)? -4 Let p(g) = 2g*2 - 63g - 14100. Determine p(101). -61 Let w(n) = -469n - 17731. Calculate w(-38). 91 Let f(s) = 2s*3 - 327s*2 - 2220s + 554. What is f(170)? -1146 Let i(r) = -501r - 2435. Determine i(-5). 70 Let t(w) = -7w*3 - 2w*2 - 18w + 58. Calculate t(6). -1634 Let g(m) = 4m2 - 1231m + 4885. Calculate g(4). 25 Let h(u) = -18u - 169. What is h(93)? -1843 Let m(r) = -2r*3 + 202r*2 - 205r + 566. Calculate m(100). 66 Let n(r) = -3r3 - 78r*2 + 7r - 94. Give n(-26). -276 Let i(h) = -2h2 - 4495h + 377223. What is i(81)? 6 Let z(o) = -20o2 - 288o - 339. What is z(-15)? -519 Let x(m) = -2644m2 + 182433m + 221. Calculate x(69). 14 Let x(q) = -5q2 + 1556q + 14039. What is x(-9)? -370 Let o(k) = -6k3 - 2k*2 + 68k + 356. Give o(-5). 716 Let s(b) = -13222b + 766557. What is s(58)? -319 Let c(s) = -40s - 1066. What is c(-21)? -226 Let k(a) = 950a2 + 58a - 151. What is k(2)? 3765 Let m(j) = -j*3 - 6j*2 + 37j + 406. Calculate m(-8). 238 Let r(k) = -10k2 - 633k + 4363. Give r(7). -558 Let j(w) = -5690w - 1951621. What is j(-343)? 49 Let w(s) = 77s*2 + 17s - 9. Determine w(-3). 633 Let r(i) = -121i - 3486. Determine r(-18). -1308 Let t(o) = 3o*3 + 29o*2 - 289o + 188. Determine t(6). 146 Let l(q) = q*3 + 110q*2 + 28q - 8908. Give l(-109). -79 Let v(w) = -7219w + 2764948. What is v(383)? 71 Let d(m) = -189m - 22491. What is d(-122)? 567 Let j(c) = -2c2 - 68c - 146. Give j(-27). 232 Let g(m) = m*3 - 11m*2 - 4080m + 40925. Give g(10). 25 Let b(i) = 467i + 5404. Determine b(-13). -667 Let n(x) = -45x + 2707. Determine n(58). 97 Let j(n) = -274n + 4675. What is j(17)? 17 Let z(p) = -933p - 21448. Calculate z(-23). 11 Let d(h) = h*2 + 113h - 2308. Give d(17). -98 Let l(y) = 2y3 + 577y*2 - 9102y - 58. Give l(15). -13 Let i(n) = 46452n - 92767. What is i(2)? 137 Let x(m) = 35m*3 + 767m*2 - 56m + 8. Give x(-22). -212 Let z(k) = 7k2 - 15781k - 110794. Give z(-7). 16 Let q(k) = -22k2 - 23k + 31. What is q(-6)? -623 Let o(w) = 2088w - 286129. Determine o(137). -73 Let o(y) = -y3 + 38y*2 + 21636y - 698502. Give o(32). -6 Let z(c) = -6c2 + 318c - 2798. Give z(11). -26 Let j(x) = 16694x + 383970. Determine j(-23). 8 Let a(t) = 10640t + 84266. Give a(-8). -854 Let w(b) = -16073b - 3680721. Determine w(-229). -4 Let d(n) = -210n*2 + 1058n + 4. Determine d(5). 44 Let n(z) = -22z3 + 161z*2 - 588z + 8. Give n(4). -1176 Let a(k) = -3k3 + 16k*2 - 86k + 663. Determine a(7). -184 Let a(i) = -87i - 2279. Give a(-21). -452 Let v(z) = 51z + 484. What is v(-9)? 25 Let d(q) = -9115q - 2005322. Give d(-220). -22 Let f(x) = -84x*3 - 87x*2 - 173x + 18. Determine f(-2). 688 Let y(n) = -n*3 - 181n*2 - 533n + 108. What is y(-178)? -70 Let o(l) = -16l2 - 810l - 5993. Calculate o(-9). 1 Let w(q) = -q*3 - 10q*2 + 131q + 677. Give w(-17). 473 Let s(h) = -8430h + 118027. What is s(14)? 7 Let t(n) = n2 + 69551n - 834752. What is t(12)? 4 Let g(i) = -i*2 + 1504146i - 22561962. What is g	{ "pile_set_name": "DM Mathematics" }
rest ten? 0 Let d = 7.5 - 7.49776. What is d rounded to 4 dps? 0.0022 Let i = 5.9 + -5.8999985. What is i rounded to six decimal places? 0.000002 Let u = 6479.1 - 6481.9049. Let m = u - -2.8. What is m rounded to three decimal places? -0.005 Let g = 61.87 + -104.04. Let m = g + 42. Let o = 0.1699945 + m. Round o to 6 decimal places. -0.000006 Suppose 2b - b + 40000 = 0. What is b rounded to the nearest one hundred thousand? 0 Let k = 63.06773 + -63. Let o = -0.068 + k. Round o to 4 decimal places. -0.0003 Let k(w) = 8w*2 - 13w - 24. Let n(i) = -3i2 + 4i + 8. Let u(v) = 4k(v) + 11n(v). Let y be u(-6). Suppose yc - 150 = 2c. Round c to the nearest 10. 80 Let k = 0.027 - 0.257. Let l = 0.07 - k. Round l to 1 decimal place. 0.3 Let j be (-9)/(36/(-116800))250. Round j to the nearest one million. 7000000 Let m(p) = 2p + p*2 - 29 + 22 + 14 + 6p. Let s be m(-7). What is s rounded to 7 dps? 0 Let t = 3.4 - 3.351. Round t to two dps. 0.05 Let l = -1 + 1.011. Let r = -73 + 72.9844. Let p = l + r. What is p rounded to three decimal places? -0.005 Let z be 3 + -3(-1)/(-3). Let k be -2250((-640)/(-3))/z. What is k rounded to the nearest 100000? -200000 Let k be 1/(-2) + 3767/(-2). Let l be -3072(k/9 - -1). Round l to the nearest 100000. 600000 Let o(g) = -5 + 5 + g - 18 - 8. Let z be o(0). Round z to the nearest 10. -30 Let y be 1100008 + -12 + 41. What is y rounded to the nearest 100000? 1100000 Let d = 248.113 + -248. What is d rounded to 2 dps? 0.11 Let t = -0.8 + 1.19. Round t to one dp. 0.4 Let a = 83937 + -117577. Let l = 33593.937 + a. Let r = 46 + l. Round r to 2 decimal places. -0.06 Let w = -286.9821 - -287. Round w to three dps. 0.018 Let o = -1209897589.2 - -1209897589.09720896122. Let b = -54.10279060878 - o. Let m = b + 54. What is m rounded to seven dps? 0.0000004 Suppose -4y = -2r + 12, -5r = 4y - 8y - 12. Let m be (-3 - -4)/(y/(-339)). Round m to the nearest ten. 110 Suppose 89627 = -4i + 815147. Let d be (222/8)/(3/90960). Let b = i - d. What is b rounded to the nearest 100000? -700000 Let m = -3624.54 + 3624.839999. Let b = -2 - -2.3. Let g = m - b. What is g rounded to 7 dps? -0.000001 Let v = 814332.5 - 528444. Let c = v + -285885.299942. Let m = 3.2 - c. Round m to 5 decimal places. -0.00006 Let a = 49.9938 - 50. What is a rounded to 3 decimal places? -0.006 Let d = -0.98232 - -0.98. What is d rounded to 4 dps? -0.0023 Let r be 1943997/12 - 7/(-28). What is r rounded to the nearest ten thousand? 160000 Let a = 16165 + -58278. Let l = a - -42147.858. Let f = -35 + l. Round f to 2 decimal places. -0.14 Let m = 1275 - 485. What is m rounded to the nearest 100? 800 Let l = 817783 + -817782.6700046. Let c = 6.63 - 6.3. Let r = c - l. What is r rounded to 6 decimal places? 0.000005 Let x = 2.35 + -2. Let g = 1891.54947 + -1891.2. Let v = x - g. What is v rounded to four decimal places? 0.0005 Let a = -13860.6600056 - -13859.96. Let o = -0.7 - a. What is o rounded to 6 decimal places? 0.000006 Let i(t) = -9t3 - 3t*2 + t - 6. Let q be i(-3). What is q rounded to the nearest ten? 210 Let r = 2 + -3. Let d = r - 0. Let w(c) = -1061c - 1. Let x be w(d). What is x rounded to the nearest one hundred? 1100 Let r = 0 + 2. Suppose 2b - 4 = -rl, -2b + 3l - 2 + 6 = 0. Suppose -5z + bz - 90 = 0. Round z to the nearest ten. -30 Let p = -0.7 - -42.7. Let g = p + -96. Let k = g - -59.3. What is k rounded to the nearest integer? 5 Let a = -1.45 - -0.7. Round a to one dp. -0.8 Let v = -14908660 + 14908654.2000062. Let r = v - -5.8. Round r to 6 decimal places. 0.000006 Let q = 243 - 204.4. Let k = q - 0.6. Let t = 37.9958 - k. Round t to three dps. -0.004 Let n(g) = g + 6044555. Let s be n(0). Let j(f) = 2128911f. Let q be j(5). Let d = s - q. Round d to the nearest one million. -5000000 Suppose -x - 2 = 1. Let i(y) = 5y*3 + 2y*2 + 3y - 3. Let j be i(x). What is j rounded to the nearest ten? -130 Let q = 4035 - 135. What is q rounded to the nearest 1000? 4000 Let h be -2 - 1 - (0 + -215). Suppose 0 = -4c - 5s + h, -2c + 78 = -c - 5s. Round c to the nearest 10. 60 Let k(h) = 86899h + 15. Let o be k(-6). Let d = -258621 + o. Round d to the nearest one hundred thousand. -800000 Suppose -20 = -5g, -2u - 3g = -11 - 5. Let v be -2(7/2 - u). What is v rounded to the nearest 10? 0 Let a be (-36)/(-16) + (-1)/4. Suppose -as = 2s + 131180. Let u = s + 99795. Round u to the nearest 10000. 70000 Let b = -0.032 + -0.02. Round b to 2 dps. -0.05 Let n be 42/8 + -4331. Let c = n + -45670. What is c rounded to the nearest one hundred thousand? -100000 Let o = -340 + 340.0597. Let m = -0.057 + 0.126. Let i = o - m. What is i rounded to three decimal places? -0.009 Let s = -0.5 - 0.3. Let p = s - -0.21. What is p rounded to one dp? -0.6 Let k = 29016.24966 + -29016. Let g = k + -0.25. What is g rounded to 4 decimal places? -0.0003 Suppose -37 = -4v - 5r, -r - 16 = 5v - 6v. Suppose -8 = 11l - vl. Let n(x) = 2655x3 + 6x*2 - 3x - 4. Let m be n(l). Round m to the nearest 100000. 200000 Let k = 29365470987142 + -29365460069792.0000056. Let u = 10917345 - k. Let r = 5 + u. What is r rounded to 6 decimal places? 0.000006 Let i = 110.99859 + -111. What is i rounded to four dps? -0.0014 Let t = 50.8000257 + -50.8. Round t to 5 decimal places. 0.00003 Let x = -9.9332 + 0.0192. Let t = -0.114 - x. Round t to 0 dps. 10 Let b = 6 + -6. Suppose b = -2o - 0o - 4k - 1939996, -3o - 2910001 = -k. Round o to the nearest one hundred thousand. -1000000 Suppose -375010 = -v - 2m, 0 = 5v - 5m - 863308 - 1011667. Round v to the nearest ten thousand. 380000 Let i = 16702.00042 - 16674. Let q = i - 28. Round q to four decimal places. 0.0004 Let d = 760 - 400. What is d rounded to the nearest one hundred? 400 Let o(v) = v3 + 12v*2 + 12v + 5. Let l be o(-5). What is l rounded to the nearest 100? 100 Let l = 1262 - 662. Round l to the nearest one hundred. 600 Let d = 1.11765 + 9.88855. Let y = 18 + -7. Let n = d - y. Round n to 3 decimal places. 0.006 Let d = -80.725372 + 65.0253887. Let z = -15.7 - d. Round z to 6 dps. -0.000017 Let n = -921156 - -1791156. What is n rounded to the nearest 100000? 900000 Let f = -13.678 - -13.8. What is f rounded to 2 dps? 0.12 Let n = -0.06 - 1.02. Let v = -10.2 - -11. Let y = n + v. Round y to one decimal place. -0.3 Let t = 10 + -6. Let h be -1 - 0 - t6. Let f be (-2)/5 + 107490/h. Round f to the nearest one thousand. -4000 Let n = 8 - 0. Let k = -1 - n. Let u = k - -8.9999993. What is u rounded to 6 dps? -0.000001 Let g = 37 + -127. Round g to the nearest ten. -90 Let a(u) be the first derivative of -2504u*2 - 1. Let h be a(-1). Let f = h - 2508. Round f to the nearest 1000. 3000 Let c = -1 + 0.4. Let h = 7.4 - c. Let o = 8.0022 - h. What is o rounded to 3 dps? 0.002 Suppose -6 = -5m + 69. Let h be 1/(-3) + 239510/m. Let i = h - 10067. What is i rounded to the nearest one thousand? 6000 Suppose 0 = -5j + 26 - 1, -4o = -3j - 1083985. What is o rounded to the nearest one hundred thousand? 300000 Let u = -1549811 + 609811. What is u rounded to the nearest 100000? -900000 Let p = -307 + 1277. Suppose -6308 = w + 2s, -s - p = 4w + 24234. Round w to the nearest 1000. -6000 Suppose 3o - 3 = 6. Suppose -os - 390258 = 209742. Round s to the nearest 1000000. 0 Let n = -143294.654 - -143483. Let c = 188 - n. Let x = c - -0.056. Round x to one dp. -0.3 Let n = -7.986 + 8. Round n to two decimal places. 0.01 Let y = -5.1 + 5.1216. What is y rounded to three decimal places? 0.022 Let u = -2671.661 - -2673. Let p = u + -0.019. Round p to 1 dp. 1.3 Let n = 261 - 146. Let q = 12402698.699909 + -12402813.7. Let a = n + q. What is a rounded to 5 dps? -0.00009 Let m = -34.657 + 34.5. What is m rounded to 2 decimal places? -0.16 Suppose 4w - 1517774 = 7482226. Round w to the nearest one hundred thousand. 2300000 Let z = 2049.175 + -2048.6749943. Let b = -0.5 + z. Round b to six dps. 0.000006 Let z = 94 + -93.99999923. Round z to 7 decimal places. 0.0000008 Let j(z) = 2036z3 + 7z*2 - 8z + 20. Let h be j(6). Round h to the nearest 100000. 400000 Let r(x) be the first derivative of 17x3 - x2/2 - 12x + 4. Let k be r(-6). What is k rounded to the nearest one hundred? 1800 Let b = 5.3298	{ "pile_set_name": "DM Mathematics" }
-4v. Suppose -v = l + l. What is c(l)? -5 Let f(p) be the third derivative of -p4/24 + 7p*3/6 + 5p*2. Let d be f(5). Let n(k) = 3 + k - 3k + 2k - k - kd. What is n(-3)? -3 Let n be (99/(-18))/((-2)/(-4)) + 5. Let f(l) be the second derivative of l5/20 + l4/2 - l3/6 + l. Give f(n). 6 Let m(b) = -b3 - 6b*2 - 7b - 5. Suppose 2z + 0 = 20. Let g be 52/(-10) + 2/z. What is m(g)? 5 Let p(d) = -d2 - 4d - 2. Let g be p(-2). Let l(f) = 1 - f - 1 - gf. Give l(-1). 3 Let l(o) = 5o - 1. Let v(n) = 4n. Let s(q) = 3l(q) - 4v(q). What is s(-4)? 1 Let k(m) = 3m*2 - m. Let a be k(-1). Let v(h) = 2 - ah2 + h3 - 1 - 2h3 - h + 2. Calculate v(-4). 7 Let k(i) = 4i + 13. Let c be k(-5). Let f(t) = t*2 + 10t + 3. Determine f(c). -18 Let n(a) = 2a2 - 10a + 12. Let z(h) = h*2 - 5h + 6. Let d(s) = 3n(s) - 5z(s). Suppose 4g - 3 = 9. Let v be g/12 + 19/4. Give d(v). 6 Let v(g) = 9g*2 + 10g - 8g + 3 - 4g - 2. Determine v(1). 8 Suppose -2 = z + 3. Let d(k) = k*3 + 5k2 - k - 6. What is d(z)? -1 Let c(w) = -w3 - w + 13. Let h(y) = y3 + y2 - 14. Let v(n) = -7c(n) - 6h(n). Suppose a - 5 = -0a. Calculate v(a). 3 Let g(p) be the second derivative of 7p*3/6 + 3p*2/2 + 11p. What is g(-2)? -11 Let m = -3 + 5. Suppose -2x - mx + 52 = 0. Let v(k) = -6 - 2k + 3k + x. Calculate v(-4). 3 Let r(k) = -k*3 + 9k*2 - k + 11. Let z be (-4)/8 + 38/4. Let v be r(z). Let p(s) = 0 + v - s - 2. Determine p(0). 0 Let c = -6 - -12. Suppose ch = 5h. Let p(a) = a + 2. What is p(h)? 2 Let l = 29 + -41. Let q = l - -12. Let c(b) = -b - 3. Calculate c(q). -3 Suppose -x + 0x = -3. Let p(n) = n2 - x + 5 + n3 + 2n - 5n. Give p(-3). -7 Let p = -3 - -5. Let q be (-5 + p)(-4)/(-6). Let i(d) = d3 + d2 - 4d - 3. Give i(q). 1 Let o(k) = -35k - 34k - 33k + 103k. Determine o(3). 3 Let i(s) = -s*2 - 3s + 4. Suppose -3o - 29 - 28 = 0. Let f = -10 - o. Let q be ((-4)/2)/(6/f). Calculate i(q). 4 Let b(x) be the third derivative of 0x - 1/6x3 - 8x*2 + 0 - 1/20x*5 - 1/12x*4. Calculate b(-1). -2 Let k(y) = -4y + y*3 - 3 + 1 + 6y + 4y2. Let t(q) = 2q*2 - 3q + 1. Let w be t(2). Suppose wr - 7r = 12. Determine k(r). 1 Let z = 56 - 51. Let d(t) = -t*3 + 6t*2 - 8t + 3. Calculate d(z). -12 Let y(q) = 16q - 6. Suppose 0 = -3n - 2 - 4. Let t(r) = -3r + 1. Let s(x) = ny(x) - 11t(x). Calculate s(-6). -5 Let l = -16 - -22. Let q(j) be the third derivative of -j5/60 + 5j4/24 + j3/6 + 3j2. Give q(l). -5 Let f(n) = -n3 + 5n*2 - 3n. Let i = -4 - -2. Let s = 0 + i. Let o be s/9 + 29/9. Give f(o). 9 Let k(v) = 5v + v3 + 4 + 4v*2 - 3v - 6 - 2. Suppose 0 = -2b - 5 - 1. Calculate k(b). -1 Let a = 12 + -10. Let j(f) = f2 + 1. Determine j(a). 5 Let k(q) = q2 + q. Let y be k(-1). Let b(c) = -c2 + c + 6. Give b(y). 6 Let c(s) be the third derivative of -s6/360 + s5/40 + s4/12 - 3s*2. Let y(a) be the second derivative of c(a). Suppose -10 - 2 = -3l. What is y(l)? -5 Let p(d) = 2d3 + 3d + 2 - 3d - 3 - 3d. Give p(-2). -11 Let m(t) = -97 - 2t + 100 - 2t. Let s be 3 + 0/1 - 0. Determine m(s). -9 Let l(w) = w - 7. Let c be l(7). Suppose c = 5r - 9 - 11. Let v(y) = -y2 + 4y - 2. Give v(r). -2 Let t = -5 - -7. Suppose a - 15 = -3f + 2, -2a - f + 9 = 0. Let j(g) = -2g3 + 2 + g3 + 3g*a - 2g*2. Give j(t). -2 Let j = 2 - -2. Let f(s) = 0 + 6 - 1 - js. Give f(4). -11 Suppose 0 = -6c + 2c. Suppose ct = -t. Let s(b) = b + 2b*3 - 3b*3 - 2b*3 + 2b3 + 5. Give s(t). 5 Let h(v) be the first derivative of -v2/2 - 6v - 8. Calculate h(-7). 1 Let o(k) = -k2 - 4k + 5. Let l(a) = a - 5. Let d be l(8). Suppose -2p + 12 = -dp. Let t be -3 - p/(-3) - -3. Give o(t). 5 Let m(k) = k*2 + 11k + 2. Let q be m(-11). Let l(i) = -i3 + i2 + 1. Determine l(q). -3 Let m(a) = 7a2 + 7a - 7. Let g(k) = 3k2 + 3k - 3. Let q(f) = 9g(f) - 4m(f). Let o(t) = t + 19. Let j be o(-18). Calculate q(j). -1 Let x(d) = d*3 + 5d*2 - 4d + 6. Let y = 35 - 41. What is x(y)? -6 Let o(w) = -w*2 - 5w + 5. Let r(q) = q*2 + 4q - 4. Let a(p) = -5o(p) - 6r(p). Suppose 12g - g - 11 = 0. What is a(g)? -1 Let t(z) = -8z*2. Let l = 27 + -28. What is t(l)? -8 Let k(y) = 7y*3 + 4y*2 - 9y - 8. Let c(w) = -w3 - w2 + w + 1. Let q(j) = -6c(j) - k(j). Suppose -22 = 6x - 40. Determine q(x). 2 Let r(q) = -q*3 + 2q*2 + 2q - 2. Let i(p) = 9p - 9. Let o(d) = -5d + 5. Let f(g) = -6i(g) - 11o(g). Let y be f(4). Determine r(y). -5 Let d = 12 + -18. Let i(x) = -2x2 - 14x - 7. Let m(h) = -h*2 - 7h - 4. Let b(t) = -3i(t) + 5m(t). Calculate b(d). -5 Let v(f) = -f2 + f - 4 + 4 + 1 - f3 + 2f2. Let i(p) = -7p*3 + 9p*2 + 7p + 7. Let c(x) = -i(x) + 6v(x). Give c(2). -7 Let h(v) be the first derivative of -v4/4 - 7v*3/3 - 3v*2/2 - 5v + 4. Determine h(-7). 16 Let h(z) = z*3 + 3z*2 - 2z - 2. Let o be h(-3). Let v be 1-3 + (-12)/o. Let i(b) = -b2 - 6b + 1. Determine i(v). 1 Let v(x) be the third derivative of 0 + 4x2 + 0x - 5/6x3 - 1/24x*4. Give v(-4). -1 Let j(i) = 7i*3 + 9i*2 - 3i + 4. Let z(s) = -20s3 - 26s*2 + 8s - 12. Let x(g) = 17j(g) + 6z(g). Determine x(-3). 5 Let x(k) be the first derivative of -k6/360 - k5/20 - k4/4 - k3 - 1. Let v(p) be the third derivative of x(p). Calculate v(-6). -6 Let t(r) = r*2 - 3r - 2. Suppose 0 = 4b + b - 70. Let k = -10 + b. Determine t(k). 2 Suppose 3q - 3 = 0, -4a + 5q - 1 = -0. Let u(s) = -1 - a - s + 5. Calculate u(2). 1 Let a(l) = -l*2 - 8l - 4. Let m be (2/5 - 57/5) + 3. Calculate a(m). -4 Let d(i) be the first derivative of -i2/2 - i + 2. Give d(-10). 9 Let r(t) be the first derivative of t3/3 - t*2/2 - 2. Let q be r(1). Suppose -4u = -q + 12. Let k(y) = -y*2 - 2y + 4. Calculate k(u). 1 Suppose 5 = 3r - 1. Let q(a) = a2 + 5 + 0a - 3 + ra + a2. Determine q(-2). 6 Let p(c) = c - 3. Let f be p(8). Let w be (-2 + f)/3 + -2. Let h(s) = 7s*3 + 1. What is h(w)? -6 Let c(n) = 17n*3 - 2n*2 + 11n - 11. Let h(t) = -9t3 + t2 - 6t + 6. Suppose 2s + 12 = -0. Let v(b) = sc(b) - 11h(b). Give v(1). -2 Suppose -s = 4s - 25. Let f(m) = -m*3 + 5m*2 + 2m - 2. Give f(s). 8 Suppose 0 = -3l + 9 - 3. Let d(z) = -l - 4 + 10 - z. What is d(5)? -1 Suppose -5y - 2m + 17 = 0, 2m = 5y - m - 12. Suppose -yj - 6 = -j. Let k(z) = 1 + 1 + 2 + 4z + z2. Determine k(j). 1 Let k(o) be the first derivative of -o4/12 + 9o*2/2 + 4o - 4. Let i(r) be the first derivative of k(r). Determine i(0). 9 Suppose -3j = -4j + 6. Let l(w) = w + 1. Determine l(j). 7 Let v(h) = h*3 - 8h2. Let t(s) = s3 - 9s2. Let k(g) = 3t(g) - 4v(g). What is k(5)? 0 Let l = -69 - -72. Let f(p) = -p2. Let q(j) = 3j*2 + 3j + 2. Let b(t) = 4f(t) + q(t). Calculate b(l). 2 Suppose 0 = 3g + 6, 0j + 3g = -j - 3. Let i(a) = -17a2 + 12a + 21. Let c(b) = 4b2 - 3b - 5. Let v(m) = 9c(m) + 2i(m). What is v(j)? 6 Let m(f) = -8f - 3. Let s(x) = 17x + 7. Let j(i) = 13m(i) + 6s(i). Suppose -4y = -119 + 23. Suppose o = 5p + y, p + 5 = 2o - 7. Determine j(o). -5 Let y(h) = -h3 - 7h*2 + h + 7. Let k be y(-7). Suppose -5u + 2u + 9 = 3j, 0 = j - 4u - 18. Let b(q) = -3q + kq + jq + 3. Calculate b(-3). -6 Let n(t) = -t*3 + 4t*2 + 2t. Suppose 8 = -21r + 23r. Determine n(r). 8 Let z(w) = w*3 - 7w*2 + 6w + 4. Let p = 58 + -52. What is z(p)? 4 Let b(u) = 11u3 - 16u*2 + 26u + 38. Let r(s) = 7s3 - 11s*2 + 17s + 25. Let w(n) = -5b(n) + 8r(n). Give w(7). 3 Let k = -64 - -59. Let q(w) = -w - 1. Calculate q(k). 4 Let c(r) = -2r2 - r - 1. Suppose j + 6 = 4j. Suppose -ji = -13 - 9. Suppose 0l = 3l + 5k + i, 4l + 2k + 10 = 0. Determine c(l). -7 Let q be (-4 - -2)(-3)/2. Let x(l) = -2 + 3l + l*q + 1 + 3l*2 + 3. Let c be (4 - 2) + (-8)/2. Give x(c). 0 Let q(g) = -7g*3 + 3g2 + g. Let w(a) = a3 - a*2. Let j(r) = -q(r) - 6w(r). Calculate j(-3). 3 Let f(g) = -g*2 - 4g + 7. Let h be f(-5). Let z(w) = 2w + 1. Determine z(h). 5 Let c(s) be the second derivative of s4/12 - 2s*3/3 + 3s*2/2 + 3s. Calculate c(3). 0 Suppose 0 = d - 3d + l, 4d - 20 = -3l. Suppose -8 + d = -3w. Let k(t) = wt2 + t + 1 + t2 - t*2. Give k(-1	{ "pile_set_name": "DM Mathematics" }
ppose 11x - 60 = 6x + 5c, 3c = -5x + 52. Suppose xa = ia - 5u - 38, -4a + 3u + 237 = 0. What is the tens digit of a? 6 Let s(j) = -25j - 46. Let q be s(-2). Suppose 3r - 11 = 19. Suppose -r - q = -2t. What is the units digit of t? 7 Let t(u) = 2u + 26. Suppose 3k + 12 = 0, -k + 42 = 5b + 6. Let r = b - 13. What is the units digit of t(r)? 6 Let x(j) = -4j - 13j*3 - 5j + 8j2 + 14j*3. Let q be x(-9). Suppose q = 11g - 7g - 392. What is the units digit of g? 8 Let h = 1574 + -1594. Let v be (73/(-2))/(2/(-20)). What is the hundreds digit of (8/h)/(-1)v - 3? 1 Let j(i) = -3i3 - 2i - 1. Let y(u) = -503u3 + u2 + 11u + 5. Let d(x) = 5j(x) + y(x). What is the units digit of d(-1)? 8 Suppose -4q - 4f = -8f - 6612, -3q = 3f - 4941. What is the units digit of q/4 - 6/4? 1 Let k(t) = 27 + 30 - 79 + 21 - 21t. Suppose -5o + 5i - 24 = 1, o - 4i = -14. What is the units digit of k(o)? 1 Let j(h) = 2h2 + 34h - 66. Let t be j(-24). Let c = -96 + t. What is the hundreds digit of c? 1 Let b(z) be the third derivative of 109z5/60 + z4/12 - 5z*3/2 + 210z*2. What is the units digit of b(3)? 2 Suppose -f = -2t - 149, 0 = 3t - 3 + 6. Suppose -2y = 3m - 219, -2y = -2m - f - 57. What is the hundreds digit of y? 1 Let d = -44621 + 65259. What is the tens digit of d? 3 Suppose 5f = -3d + 5261, 19f = -4d + 23f + 7036. What is the tens digit of d? 5 Let w be (-2)/4 - (-190862)/28. Suppose 9i = w + 1599. What is the hundreds digit of i? 9 What is the units digit of ((-20)/12)/(205/(-1556934))? 8 Suppose 4k - 210243 = -3n, -10253k + n = -10256k + 157676. What is the thousands digit of k? 2 Suppose 4n = -n + 10. Suppose -t = nt - 204. Suppose -i = -0i - t. What is the units digit of i? 8 What is the tens digit of (-5 - (-1896)/(-60))/((44/40)/(-11))? 6 Let y(q) = -254q + 104. Let u be y(-3). Let w = u + -218. What is the units digit of w? 8 Suppose 50h - 43h - 43722 = 0. What is the thousands digit of h? 6 Let v = -14 - -17. Let t(n) = -n2 - n + 6. Let c be t(v). What is the tens digit of ((-39767)/(-42))/19 + (-1)/c? 5 Suppose 0 = 3l + 4q - 36770, 12q + 20 = 7q. What is the thousands digit of l? 2 Let p = -619 - -623. Suppose 2v + 10 = 0, 7v = -w + pv + 463. What is the units digit of w? 8 What is the hundreds digit of 489 - ((-30)/(-35))/((-5)/(-175)-5)? 4 Let g be 11/5 + (-8)/(-10). Let v be -10 - -1(g - 6). Let w(f) = -5f + 5. What is the tens digit of w(v)? 7 Let z(b) = -7b - 39. Let d(o) = -o*3 - 6o*2 + o + 18. Let g be d(-6). Let p be ((-22)/(-12) - 2)4g. What is the tens digit of z(p)? 1 Suppose 3m - 544 = -154. Let h = -340 + 603. Suppose 2l - 3o - h = 0, 3o = -l + 6o + m. What is the units digit of l? 3 Suppose 0 = -30b + 433289 + 915121. What is the ten thousands digit of b? 4 Suppose 2b - 5a = 22, -26 + 2 = -3b + 3a. Suppose -br + 609 = -261. What is the tens digit of r? 4 What is the units digit of 513/(-6)(-4)/(-8)(4 - 260)? 4 Suppose -657 = 2t - 3t. Let q = t + -382. Suppose q + 30 = 5f + 3v, -2f = -3v - 122. What is the tens digit of f? 6 Let r be (-10)/((2 - 1) + -3). Suppose -13h = rh. Suppose -7p + 502 = 2a - 5p, h = 2p. What is the units digit of a? 1 Let k(y) = -y*3 - 2y. Let j(h) = -207h3 + 2h*2 - 12h - 4. Let c(p) = j(p) - 4k(p). What is the tens digit of c(-2)? 3 Suppose -72 = -77b + 74b. Let k = 31 - b. Let t(j) = -j3 + 10j*2 - 2j - 15. What is the hundreds digit of t(k)? 1 Let y be 5 - (-86)/(-18) - (-70)/9. Suppose 3z - 19 = y. Suppose 946 = zi + 127. What is the tens digit of i? 9 Suppose 70h - 186h = 127h - 1532844. What is the units digit of h? 8 Suppose 60q = 55q + 97280. Suppose q = -3p + 19p. What is the hundreds digit of p? 2 Let b(u) = -u3 + 11u*2 - 11u + 22. Let z be b(8). Suppose -133s + 8799 = -zs. What is the tens digit of s? 5 Let b(t) = 280t3 - 3t*2 - 19t + 61. What is the tens digit of b(3)? 3 Suppose -2o + 16 = -5v, 6o - o - 2v = 61. Let a(k) = -6k2 + 25k - 3k2 + 2k*2 + 6k*2 + 4 - 3. What is the hundreds digit of a(o)? 1 What is the units digit of (-35399)/(-3) - ((-88)/264)/((-2)/4)? 9 Suppose 0 = -4o + 5z + 20252, 20248 = -71o + 75o - 4z. What is the tens digit of o? 5 What is the ten thousands digit of ((-14659)/(-411))/(1277/(-1278) - -1)? 4 Let h(w) = 34266w3 + 13w*2 - 5w + 6. What is the tens digit of h(1)? 8 What is the units digit of (843/182)/(19/2679)? 7 What is the units digit of 16266 + 1 + -47 + 34? 4 Let n be (-2)/(-2) - (8 + -10)1. Suppose 3j - 930 = -5i, ni - 6i + 552 = 3j. What is the tens digit of i? 8 Let y(s) = 13s*2 + 7s + 22. Let k be y(8). Suppose 3i = -11i + k. What is the units digit of i? 5 What is the units digit of ((-76)/190)/(4/(-40)1/2308)? 2 Let n = 1022 - 528. Suppose -5s + i + i = -2482, s + 2i = n. What is the units digit of s? 6 Let j be (13 - 5) + (-2 - 2). Suppose -1606 = -jv - 394. What is the tens digit of v? 0 Let y = 897 - -5061. What is the tens digit of y? 5 Suppose -88l - 10057 = -201950 - 326867. What is the thousands digit of l? 5 Let p = -14117 - -34616. What is the thousands digit of p? 0 Suppose -2p + 4p + 438 = z, 2z = p + 870. Suppose 9s - 3359 + z = 0. What is the units digit of s? 5 Suppose 6x - 3x - 52 = -5k, 0 = x - k - 4. Let i = 15 - 12. Suppose -t - 15 = -iv, v + 4t - x = 3t. What is the units digit of v? 6 Let c(l) = 0 - 13l + 8 + 9l + 3l. Let i be c(6). Suppose ip + 2u - 57 = -u, 4p = 3u + 159. What is the tens digit of p? 3 Suppose -138 + 2 = -8o. Suppose 4y = 5b - 27, -2b + oy = 22y - 24. What is the units digit of b? 7 Let v be 429 + 2 + (-1 - 2). Let f = -715 + v. Let a = -187 - f. What is the tens digit of a? 0 Let k = 195 + -193. Suppose -m + 5q = -1401, 5q + k = -18. What is the tens digit of m? 8 Let y(q) = 21q2 + 3q + 8. Let n(t) = -2t2 + 6t + 6. Suppose 5 = 3w - 7. Let d be n(w). What is the tens digit of y(d)? 8 Let z = 375 - 618. Let d = z + 482. Suppose d + 115 = 6p. What is the tens digit of p? 5 Let d be 2/2 - 1 - 3. Let r(b) = -124b + 1. Let q be r(d). Suppose 2p - 4p + 142 = -2s, 5p + s - q = 0. What is the units digit of p? 4 Let w(a) = 2 - 8 + 342a - 11 - 4. What is the tens digit of w(1)? 2 Let q = 221 - 206. Suppose qm - 25037 + 7637 = 0. What is the thousands digit of m? 1 Let y = 264 + -264. Suppose 232v - 228v - 5100 = y. What is the hundreds digit of v? 2 Let j be 4((-1)/(-2) + 2) + -2. Suppose 4m = jm - 644. What is the tens digit of m? 6 Let g be 4 - (54 - 0) - -1. What is the tens digit of (2 + -5)(g - (2 + -2))? 4 Suppose 5z - w = 3w - 274, -2w = 3z + 182. Let x = z - -44. What is the units digit of 77/x-1(-18)/(-1)? 9 Let i be (-146372)/814 + (24/(-11) - -2). Let x = i + 250. What is the units digit of x? 0 Suppose -4y + 96 = -5y. Suppose z - 5v = 154, 4z - 4v - 113 = 439. Let o = z + y. What is the units digit of o? 8 What is the ten thousands digit of (-161125)/(-5) - ((-108)/6)/6? 3 Let j be ((-160)/(-25) - 6) + 11464/(-10). What is the units digit of j/2(-11 - -10)? 3 Let t(y) = 13 - 25y - 11y - 4y. Let w be t(-5). Suppose -3h - w = -2c, -3c - h = 2h - 297. What is the units digit of c? 2 What is the units digit of (18 + 15280/(-100))-10? 8 Let d(q) = -q2 - 14q + 82. Let x = 96 - 113. What is the units digit of d(x)? 1 Let w = -7 - -7. What is the hundreds digit of (10 + w - (9 - 12))25? 3 Let a(j) = 8j + 340 - 5j + 52 - 109 - 96j. What is the hundreds digit of a(-8)? 0 Suppose 0 = 2f - a + 14, -3f = 2a + 14 - 7. Let m(o) = 5o + 3 + 4o2 + 2o*2 - 4o*2. What is the units digit of m(f)? 8 Let t be (-210)/4(154/(-21) + 6). Let b = t - 70. Let k(z) = -z*2 + z + 6. What is the units digit of k(b)? 6 Suppose -4b = -3h - 34, -h + 5b - 8 = 7. What is the units digit of ((-65)/(-26))/(h/(-8))18? 6 Suppose 3c - 7c + 9377 = -3v, 4 = 4v. Suppose 7g = 2g + c. What is the hundreds digit of g? 4 Let w(d) = 4d*2 - 90d - 11. What is the units digit of w(52)? 5 Let m(z) = 255z + 65. Let u be m(-9). Let r = u + 3434. What is the tens digit of r? 0 Let q be 6/(-2)-10 + 0 - -1. Let l = q - 20. Suppose s = 3c - l, -3s + 0c - 4c + 32 = 0. What is the u	{ "pile_set_name": "DM Mathematics" }
16). Solve z - 3q = -f, 19z - q + 4 = 18z for z. -1 Let y = 3248 - 3246. Solve 2r = -5s - 8, yr + 5 = -3s - 3 for r. -4 Let l(n) = -n2 + 20n + 1930. Let a be l(55). Solve -4v + 16 = -4o, 9 - 5 = -av + o for v. -2 Let p(t) = t2 - 341t + 1360. Let c be p(4). Solve 2q + l + 4 = 0, -cl + 13l - 20 = 4q for q. -4 Suppose 4n - 3u = -n + 16, 3u = -6. Suppose -4j = -nj + 6j. Suppose -8g + 38 + 2 = 0. Solve 3v - 15 = -d, j = -5v + 5d + g for v. 4 Suppose 78 = -137h + 147 + 479. Solve p = -hk + 2k - 9, 3p + 24 = -5k for k. -3 Suppose -306l + 214 = -1316. Solve 5o + 78h - 76h - 35 = 0, -10 = 3o - lh for o. 5 Let k = 77 - 32. Let t = -45 + k. Suppose -o + 3 + 1 = t. Solve 3f - 2 = 5v, -5f - 5 + 17 = -ov for f. 4 Suppose 25 = 5q + 5w, q - 5w = -23 + 10. Let y(b) = -b + 4. Let c be y(5). Let v be -6(c/q - 0). Solve -vg - 3p = -6, -2 = -4g - p + 3 for g. 1 Let q = 289214 - 289212. Let c(g) = 2g2 - 3g + 3. Let p be c(2). Solve -u + pl = -12 - 3, 3l + 16 = qu for u. 5 Suppose -14y + 15y + 2n - 30 = 0, y = 4n + 6. Solve -4t + 11v - 4 = 15v, -4v - y = -2t for t. 3 Let t(d) = 9d2 - 289d + 51. Let f be t(32). Solve 11 = -10z + 9z + 4u, -5z + 2u - f = 0 for z. -3 Suppose -2f - 6 = 3w, -2w - 2f - 6 = 2w. Let s(m) = -13m + 185. Let c be s(14). Solve 0 = -2a + x - 11, 3a + wa + 3 = -cx for a. -4 Let d be (-49 - -50)(1 + 4). Let g be (-2)/8-4 - -2. Suppose 3w = -gu - 9, 0u = du + 15. Solve w = -5h + 4m - 3m + 17, -3h - m + 15 = 0 for h. 4 Suppose 4x = -2h, 15 + 30 = 5h + x. Suppose 0 = -4l - p - 457, -3l - 414 + 75 = -3p. Let w = 116 + l. Solve 2z = ws - 4, 2s + 3 = 3z + h for s. -1 Let k(f) = -f3 - 20f*2 - 20f - 19. Let n be k(-19). Suppose x + 3s - 4s - 14 = n, 4s = -8. Solve z + x = -5m - 1, m = -2 for z. -3 Suppose 1985m = 1981m + 52. Solve w - 4 = -a, 0 = -4w + 2a + 9 + m for w. 5 Let q = -2742 + 2744. Solve 6 = z - 4y + 2y, -qy = 3z + 6 for z. 0 Suppose 4j = 5n + j + 507, -3n + 3j = 303. Let l = -97 - n. Solve 25 = -lc + 2f, -2c - 25 = -2f - 9 for c. -3 Suppose 2x - 4s - 8 = 0, -2s - 34 = 2x + 2x. Let v be ((-9)/2)/(x/8). Let b = -444 + 447. Solve 0 = -2g - bm + 5, -vg - 7 = -g + m for g. -2 Let u(s) = s*3 + 10s*2 - 5s - 29. Let i be u(-10). Suppose 6o - 33 = -i. Solve 2v - 3v = 1, -5v + 3 = od for d. 4 Let y be (4 - (-6)/(-18)12)/2. Suppose 15w + 26 - 26 = y. Solve -j + 2u = -wj + 8, 3j = -2u for j. -2 Suppose i + 2 + 29 = 0. Suppose 114 = -3c + 3h, 0c + 4h - 47 = c. Let f = i - c. Solve 28 = fv - 5n - 7, 0 = v - 4n - 17 for v. 5 Let y = 2206 + -2203. Solve -5c + 0c + 2x = 25, 2x + 15 = -yc for c. -5 Let p = -355 - -372. Solve -l + 4h + 3 + p = 0, 2l + 5 = -h for l. 0 Let u = -368 - -340. Let n(a) = -a2 - 29a - 28. Let f be n(u). Solve fd - 20 = 4d, 2d + 2 = 4r for r. -2 Let y = -205 + 189. Let f be -8(5 - (-94)/y). Suppose -4x = -3x - 12. Solve 3v = x, q - 1 = -2v + f for q. 0 Suppose -3s + 3 = -2s. Let b(p) = -11 + 4p - 11 - 14 + 27. Let k be b(s). Solve -ky = -5d - 37, -3y + 11 = d + y for d. -5 Suppose 2h = -4f + 12, -22h = -19h + 8f - 24. Let c be (-60)/(-8)(-4)/(-6). Solve -2r - 20 = -2g + 7g, h = -2r + cg for r. -5 Suppose 6c + 35 = 11c. Let y(h) = 2h + 32. Let o be y(c). Let i = o + -26. Solve p = 5f + 4p + 21, -4p = 4f + i for f. -3 Let c = 4 - -15. Suppose 0 = 351y - 481y + 260. Solve g + 5s = -c, 0s - 7 = -yg + 5s for g. -4 Suppose -14p - 10 = w - 12p, 0 = w + 4p + 20. Solve -2c - 3i = 19, w = -2c + 6i - 10i - 24 for c. -2 Suppose 8 = 4f, -7f - 10 = -5t - 2f. Let r be (21 - 7 - 13)-215/(-6). Solve -12 = -tn, -5g = -4n + 7 + r for g. 0 Let b(j) = -j - 22. Let n be b(12). Let o be (-76)/(-646) + (-30)/n. Solve -2c - 14 = 4d, 0c - d = -c - o for c. -3 Let h be (-1005 - -1002)(-2)/3(-3)/(-2). Let s(b) = b2 + 7b + 9. Let p be s(-6). Solve 2d + hy + 7 = 0, -y + 2 = -4d - py for d. 1 Suppose -4y = -129 + 1. Let l = y - 26. Suppose 55 + 83 = lq. Solve 3w + 5o + 0 = -9, 5o = 4w - q for w. 2 Let s(g) = -24g - 18. Let o be s(0). Let y be 27/o(-14)/3. Solve -3a = 2v - y, -11 = -v - 5a + 3 for v. -1 Let l(s) = s + 23. Let u(t) = -5t + 36. Let a be u(8). Let q be l(a). Solve 2m + 2 = 2y, -5y + q = 5m - 6 for m. 2 Suppose -960 = -15f + 7f. Let l = f - 100. Solve 6p - m + l = p, 0 = 5p - 3m + 20 for p. -4 Let j be (-10)/2 - 2/2(16 - 23). Solve -2f - 5d = j, -62d = -5f - 58d + 28 for f. 4 Suppose -14r - 12 = -18r + 4s, -9 = -3s. Let y = 11 + r. Solve -u - y = -3u + 3j, -5u = 2j + 5 for u. 1 Let u = -202 + 211. Let s = 34 + -9. Suppose -ur = -14r + s. Solve 2g + 2m = rg - 6, g - 4m = 12 for g. 0 Suppose 13m - 17 = 22. Let h be -3 + 4 + 11 - -2. Solve -35 + h = 2c + 5d, -mc - 3 = -2d for c. -3 Suppose 27 + 1 = 3u - 20. Solve -7 + u = -j + 4y, -5y + 20 = -3j for j. -5 Let y(j) = -83 + 0j + 3j*3 - 83 - 2j*3 - 6j - j*2 + 168. Let m be y(3). Solve i + 5 = 9, 0 = -ml - 4i + 12 for l. -2 Let r be ((-2828)/21)/((-3)/9). Let y = r + -401. Solve -4c = -2i - 6, -4i - y + 5 = -c for c. 2 Suppose l - 16 = -3l. Suppose -5j + t = 22 - 12, 3j - 5t = -28. Let b(c) = 18c + 30. Let u be b(j). Solve -5s = 2k - 12, 5s - ls + u = -4k for s. 4 Suppose -3u = 3u - 198. Suppose -11 + u = 11v. Let l be (-3)/((2 - -1) + -4). Solve -4 = 2f - k, -8 = 4f - lk - v for f. -3 Let b = -5 - -4. Let u be b/((-4)/3 + 1). Suppose 4j - 4a = -10 - 6, 22 = 2j + 3a. Solve o - u = -2y + jo, -2o - 7 = -5y for y. 1 Let l(p) = -135p - 673. Let t be l(-5). Solve q = -h - t, 0q = -q + 2h + 7 for q. 1 Let h(q) = 3q*2 + 166q + 88. Let b be h(-55). Solve 0r + b = 5i - 4r, -4i + 3r + 26 = 0 for i. 5 Let u be (24/28)/((-4)/(-14)) + 2. Solve -k - 2d = 11, -2d + ud + 3 = 3k for k. -3 Suppose -27s + 30 = -12s. Suppose j + sh = 10, h - 2h + 20 = 2j. Solve -d = -5f + 2, -d + j = 5f - 6d for f. 0 Let x = -4110 + 4118. Solve 3g = 2l - x, -5g - 18 = -28l + 27l for g. -4 Suppose -138k = -39k - 495. Solve -21 = 5u + 2w, 13 + 14 = -ku + w for u. -5 Let g be (-20)/55(-451)/82. Solve 12 = -2t + 2f, 16t - 15t + gf = 6 for t. -2 Let k(o) = -o2 + 42o - 336. Let n be k(11). Solve nz = 2p + 13, -4p = -5z + 39 - 28 for z. 3 Suppose 5 + 3 = -2l, 5m - 18 = 2l. Suppose 56x = 438 - 158. Solve -z - 3b = 13, -xz = b - 7 + m for z. 2 Let f be -3 + -9 - (-364)/30 - 58/(-15). Solve 5z = 2b + 3b + 40, -4b - fz = 0 for b. -4 Let a(s) = 149s - 1017. Let o be a(7). Solve -5i - 2 = ou - 28u, -i = 3u - 3 for u. 1 Suppose -5z + 0o - 2o + 708 = 0, 2z + 4o - 280 = 0. Suppose 2 = -20s + z. Solve 4x = -d - 20, s = -2x - 3 for d. 0 Let n be (436/18 - (-10)/(-45)) + -4. Suppose -4c + n = 3f, 0c + 2f = -c + 5. Suppose 0 = -cr + 4 + 16. Solve 0 = 4x - 4d + 16, 16 = 4d + r for x. -1 Let i = 297 + -165. Suppose -63 + i = 23n. Solve -3y + ng - g - 7 = 0, -3g = -y for y. -3 Suppose -14r = 152 - 54. Let g be (-6)/(19 + r)-8. Solve -3a + gq = q + 9, -4a = -2q + 14 for a. -4 Let z be -18 + 1 - 4/(-2). Let h be 3 + (-2)/((-6)/z-1). Suppose 4k = -5q + 36, -3q - q + h = -2k. Solve qv + 10 = 4t - 7t, 12 = -2t - 4v for t. 2 Suppose -3k = -4h + 124, 0 = 2h - 4k - 17 - 55. Let a be 8/28 + (-177)/7. Let i = a + h. Solve 0n + 18 = is - n, 0 = -4s - 4n + 8 for s. 5 Suppose -4p + 239 = q, -47q = -45q - 4p - 502. Suppose -q = -31i - 92. Solve 2y + 5a = i, y - 5 - 2 = 2a for y. 5 Let q be 05/25(-2)/(-4). Suppose 3k - 41 = -r, 3k + 2r - 3r - 31 = q. Solve 3b = k, 0 = 2t - 0b + 4b - 8 for t. -4 Suppose -l + 5m - 5 = 0, 5l + m - 27 = -0l. Suppose u - 5t = 31, lt = 4u + 6t - 19. Solve d + 12 = -3j - u, -2d = -5j - 19 for d. -3 Let v be 713/310 - 27/90. Solve 9 = -o + 3x, vo = -2x + 3 + 3 for o. 0 Suppose -10 = -2y + 2t, 0y - 3y - 4t + 1 = 0. Suppose -2x = -4l + 2, -139l + 136l + 2x = -2. Solve -14 = -k + 3c, -3k + 2c + 4 + y = l for k. -1 Suppose 0 = -5c + 4y + 25, -5c = -2c - y - 15. Let d(i) = -ci + 1 + 1 - 2i*2 - 8i + i. Let t be d(-6). Solve -10 = -v + 3x, -x = -v - tv + 14 for v. 4 Let t = -11951 + 119	{ "pile_set_name": "DM Mathematics" }
- 85p - 583. Give c(-18). -25 Let g(i) = -404i*2 - 1651i - 6. What is g(-4)? 134 Let c(s) = 1151s2 - 188s + 158. Calculate c(1). 1121 Let n(g) = g*2 + 919g - 89798. Determine n(89). -86 Let p(o) = -3o2 + 144455o - 288906. Determine p(2). -8 Let m(o) = -7o3 + 3881o*2 - 1788o + 69798. Determine m(554). -6 Let y(b) = 1705b + 56387. What is y(-33)? 122 Let f(c) = c3 - 271c*2 + 9990c - 454. Calculate f(227). 0 Let p(t) = 2t3 - 36t*2 - 1855t + 34550. What is p(19)? 27 Let l(a) = -8a2 + 35a + 296. What is l(-9)? -667 Let f(t) = t*3 - 34t*2 + 135t - 287. Determine f(29). -577 Let i(u) = u*2 + 84u + 422. Give i(-8). -186 Let m(u) = -44u - 2686. Give m(-40). -926 Let o(k) = 2k*3 + 112k*2 - 665k - 31413. Calculate o(-57). -6 Let w(m) = -1305m + 18160. What is w(14)? -110 Let j(k) = 2k*3 - 207k*2 + 1967k - 1309. Determine j(93). -7 Let m(d) = 8d3 + 60d*2 + 100d + 503. What is m(-7)? -1 Let h(p) = 23p2 - 9263p + 6843. Give h(402). 9 Let r(j) = 5j2 + 15j + 106. Give r(20). 2406 Let v(r) = -8r2 - 104r + 1513. Give v(9). -71 Let a(t) = 117t3 + 30t*2 - 14t - 213. Calculate a(3). 3174 Let v(i) = -i*3 + 12i*2 - 118i - 23. Calculate v(7). -604 Let g(y) = -y*3 - 146y*2 - 801y - 912. Calculate g(-4). 20 Let i(z) = 18693z + 18684. Determine i(-1). -9 Let g(w) = -19w*2 - 331w - 329. What is g(-1)? -17 Let j(c) = -3c2 + 283c - 1200. Calculate j(91). -290 Let y(q) = -q*2 - 154q - 9310. Calculate y(-60). -3670 Let c(b) = 355b + 7163. Calculate c(-20). 63 Let v(y) = -y3 + 17y*2 - 61y - 929. What is v(-5)? -74 Let x(d) = 72d3 - 26497d*2 + 366d + 689. What is x(368)? -47 Let c(o) = 39o3 - o2 - o + 881. Calculate c(0). 881 Let r(o) = -4o*3 + 256o*2 - 1303o + 66220. What is r(63)? 7 Let h(x) = -375x - 157877. Calculate h(-421). -2 Let m(j) = 1998j - 12045. What is m(6)? -57 Let l(w) = -w*2 + 29897w + 209330. Give l(-7). 2 Let o(i) = -228i3 - i2 - 64i - 64. What is o(-1)? 227 Let j(f) = 66199f - 290. Calculate j(0). -290 Let k(s) = -1384835s - 5539412. Give k(-4). -72 Let m(r) = -r*3 - 220r*2 - 2133r - 6919. What is m(-210)? 11 Let h(r) = -r*2 + 431r + 4381. What is h(-10)? -29 Let i(l) = -7368l - 346300. Give i(-47). -4 Let h(b) = -2b*2 + 219b + 1316. Give h(-6). -70 Let m(k) = 15k3 - 7k*2 - 4k + 6. Give m(2). 90 Let a(p) = -6p3 - 483p*2 - 232p - 112. Determine a(-80). -752 Let c(k) = -791k + 2275. Give c(5). -1680 Let f(s) = -4758s*2 + 107s + 7. Calculate f(0). 7 Let k(r) = 9407r - 234663. Determine k(25). 512 Let i(u) = -u2 + 5353u - 64100. Determine i(12). -8 Let x(o) = -o*3 - 536o*2 - 37228o - 2. Calculate x(-82). -2 Let a(v) = -26v2 + 9676v - 1512. Calculate a(372). -24 Let c(u) = -u*2 - 298u - 16156. Calculate c(-227). -39 Let m(w) = -466w2 - 14w - 3. Calculate m(2). -1895 Let h(p) = -2p2 + 31598p + 63203. Calculate h(-2). -1 Let o(t) = -19458t + 972884. What is o(50)? -16 Let p(a) = -21a*3 - 2624a*2 + 74a - 6366. Calculate p(-125). 9 Let i(k) = -35k2 + 71150k - 284620. What is i(4)? -580 Let z(c) = 2c3 - 449c*2 + 2490c - 17735. Determine z(219). 4 Let t(b) = -1872b2 - 13109b - 29. What is t(-7)? 6 Let a(l) = -14l3 + 991l*2 + 198l + 1007. Give a(71). -58 Let m(u) = -3578u - 218270. Determine m(-61). -12 Let g(w) = 54w*2 - 173w - 220. Give g(-1). 7 Let w(g) = -22g2 - 9089g + 17005. Calculate w(-415). -10 Let j(u) = -27956u - 44533896. What is j(-1593)? 12 Let x(y) = -y2 - 162y + 159063. Give x(326). -25 Let m(o) = 14983o - 92322. Calculate m(6). -2424 Let l(t) = -106058t + 2121164. Determine l(20). 4 Let o(g) = -g*3 + 882g*2 + 3514g + 26575. Calculate o(886). -5 Let u(c) = -2c3 - 183c*2 - 134c - 3888. Calculate u(-91). 25 Let l(v) = 255v2 - 37741v + 189. What is l(148)? 41 Let g(n) = 430640n - 4306564. Determine g(10). -164 Let r(c) = 1531c - 10675. Determine r(7). 42 Let m(o) = -o*3 - 402o*2 - 386o + 6818. What is m(-401)? 803 Let l(r) = -75r2 + 1053r + 1067. Calculate l(15). -13 Let i(x) = -1023x - 6403. Give i(-6). -265 Let i(c) = -c2 - 340c - 24402. What is i(-103)? 9 Let y(k) = -k*2 + 44k + 1402. Give y(70). -418 Let o(y) = -y*3 + 5y*2 + 12210y - 85314. Determine o(7). 58 Let w(y) = 4y3 - 29y*2 + 3y - 21. Give w(10). 1109 Let m(p) = -43p2 + 378p + 140. Give m(9). 59 Let a(g) = -59g - 7664. Determine a(-139). 537 Let w(f) = 1937f - 65277. Determine w(34). 581 Let d(y) = 8y3 + 295y*2 + 275y + 873. Give d(-36). 45 Let p(j) = -159j - 3924. Determine p(-25). 51 Let l(y) = -2y*2 + 22187y - 155294. Determine l(7). -83 Let g(i) = 2223i + 106671. Give g(-48). -33 Let o(j) = -138197j + 18242003. Calculate o(132). -1 Let l(a) = 4088a - 8176. What is l(2)? 0 Let s(p) = -p3 + 42p*2 - 426p - 521. Give s(24). -377 Let s(t) = 158t2 - 2147t + 4476. Calculate s(11). -23 Let w(c) = 4c3 - 566c*2 - 361c + 10942. Give w(142). 8 Let n(t) = 6t3 - 11t*2 - 143t + 153. What is n(1)? 5 Let f(m) = -60620m - 1091148. Give f(-18). 12 Let g(f) = -20551f - 2712715. Calculate g(-132). 17 Let g(z) = 64z2 - 189z - 3476. Give g(9). 7 Let n(z) = 34792z - 382704. Calculate n(11). 8 Let w(p) = 107p - 41007. Calculate w(342). -4413 Let d(z) = z*3 - 17z*2 - 63z + 115. Calculate d(22). 1149 Let u(l) = -31l2 + 19l + 505. Calculate u(-7). -1147 Let j(g) = -144g - 4854. What is j(-33)? -102 Let w(k) = 5k*2 + 635k + 3055. Determine w(-122). 5 Let w(i) = -i*3 + 7i*2 + 160i - 221. What is w(16)? 35 Let k(g) = -g*3 - 18g*2 + 314g - 11. Determine k(9). 628 Let n(x) = -x*3 + 39x*2 + 321x + 497. Give n(46). 451 Let v(d) = 253d2 - 615d + 218. Calculate v(2). 0 Let a(b) = 52b + 3387. Calculate a(-70). -253 Let y(z) = -14z*2 + 5715z - 1303. What is y(408)? -79 Let z(x) = -x*2 - 376x - 26626. Give z(-96). 254 Let w(d) = 6d3 - 10d*2 + 32d - 108. Calculate w(6). 1020 Let y(b) = 8340b + 75050. Determine y(-9). -10 Let h(t) = 3t*2 + 1269t - 40743. Give h(31). 1479 Let j(h) = -4h2 - 389h - 528. Give j(-101). -2043 Let y(i) = 5i2 - 97i + 282. Give y(3). 36 Let t(g) = g*3 - 33g*2 + 69g + 2490. What is t(27)? -21 Let b(r) = 13r3 - 8023r*2 + 1220r + 8738. What is b(617)? 100 Let w(c) = -c*3 - 220c*2 + 38073c + 343. Determine w(114). 1 Let t(w) = -w*3 - 228w*2 - 7445w + 2994. Give t(-40). -6 Let y(g) = g*2 - 240g - 15230. Calculate y(-52). -46 Let t(l) = 3l2 - 464l + 1029. What is t(154)? 721 Let g(c) = c*2 - 21114c + 1074182. Determine g(51). -31 Let v(f) = -2f2 + 13261f + 132530. Calculate v(-10). -280 Let j(i) = 36400i - 291211. Calculate j(8). -11 Let f(s) = -136s*2 - 41208s - 133. Determine f(-303). -133 Let c(z) = 25z3 + 400z*2 - 42z + 13. Give c(-16). 685 Let k(b) = -583b + 176. What is k(1)? -407 Let s(h) = -8h*3 - 50h*2 + 9h - 58. Give s(-7). 173 Let g(u) = 11u2 + 667u - 6306. Determine g(-69). 42 Let b(h) = h*3 - 26h*2 - 45h - 655. What is b(29)? 563 Let q(m) = 52992m + 476696. Give q(-9). -232 Let n(p) = -1000p - 118995. Determine n(-119). 5 Let g(c) = 94079c - 1599306. What is g(17)? 37 Let c(j) = 8j*2 - 5j + 2. Determine c(2). 24 Let i(x) = x*2 + 6734x + 492906. What is i(-74)? 66 Let o(j) = 2j3 - 29j*2 - 15707j + 204708. What is o(13)? 10 Let t(k) = 1282469k - 1282443. Calculate t(1). 26 Let n(f) = 12f*2 + 1183f + 3070. Give n(-96). 94 Let c(t) = 4t2 + 1704t - 22853. Calculate c(13). -25 Let v(b) = b*2 - 525b - 49076. Give v(606). 10 Let b(m) = -190m + 6609. Calculate b(35). -41 Let g(c) = -c2 + 2004c - 975109. Give g(832). -5 Let t(x) = -3x3 + 103x*2 + 64x - 1808. Determine t(33). 4660 Let i(b) = -4b3 + 227b*2 - 198b - 15. Calculate i(1). 10 Let m(f) = 2f3 - 19f*2 - 40f + 96. Calculate m(-3). -9 Let g(c) = -c*3 + 701c*2 - 27059c + 51. Give g(41). 92 Let u(f) = -286f + 123003. Calculate u(430). 23 Let c(n) = -30059n + 60123. Give c(2). 5 Let x(m) = -5m2 - 1333m - 11138. Determine x(-258). -44 Let i(q) = 5q3 - 15q*2 - 14498q + 28995. Calculate i(2). -21 Let j(t) = -25t2 - 55t + 219. Determine j(0). 219 Let b(j) = -2457*j + 8101. Calculate b(4)	{ "pile_set_name": "DM Mathematics" }
.3 (b) 80 (c) 1/4 (d) 5 (e) -19/5 (f) 58/7 (g) -3 a Which is the third biggest value? (a) -0.2 (b) -25656.7 (c) 32 b What is the fifth biggest value in 6/5, 8, 7190, -0.3, 2, -0.5, 9? 6/5 What is the third smallest value in 4, 12, -3, -2/5, 1, 3.0364? 1 Which is the third smallest value? (a) 4 (b) -4 (c) -2074939 (d) 8.2 a Which is the second biggest value? (a) 3 (b) 0 (c) -4/57 (d) -170.1 (e) 2/3 (f) -2/23 e What is the third biggest value in 160383, 1/2, -3? -3 Which is the third smallest value? (a) 5 (b) -311 (c) -300/19 (d) -2 (e) 50 d Which is the second smallest value? (a) -0.6 (b) 5/7 (c) -342 a What is the fourth smallest value in -751, 9, 6, 0.1, 4, 0.4, -3? 0.4 What is the third biggest value in 0.5, 2/5, -0.142, -28, 0.6? 2/5 What is the third biggest value in -27280/23, 0.5, -3, 0.1, -0.3? -0.3 Which is the second smallest value? (a) 6/7 (b) 3211087 (c) -6 a Which is the second smallest value? (a) -360 (b) 0.18 (c) -2/437 c Which is the fifth smallest value? (a) 1/10 (b) 0 (c) -0.1 (d) -0.2 (e) 65 (f) -2 (g) 0.023 g Which is the sixth smallest value? (a) 17 (b) 0.2593 (c) 3/5 (d) 0.4 (e) 0.3 (f) -0.2 a What is the third smallest value in -42, 1.66939, 0.1? 1.66939 Which is the fourth smallest value? (a) -0.1 (b) -3 (c) 1.84345 (d) -66 c What is the biggest value in -13/21, -2/13, 0.01517, -1? 0.01517 Which is the seventh smallest value? (a) 11 (b) -35.7 (c) 2/7 (d) -2 (e) -12 (f) 5 (g) 3 a What is the third smallest value in -28/3, 0.3, -34, 0.017, 0? 0 What is the smallest value in 1.3, -54, 1.9? -54 Which is the fifth biggest value? (a) 0.5 (b) -5 (c) 2/7 (d) 0.1 (e) -33 (f) 0.273 b What is the fifth biggest value in -3/5, 4, 6/415, -1/5, 23/2? -3/5 What is the biggest value in -3, -946202/19, -0.07? -0.07 Which is the third smallest value? (a) -4 (b) -0.1329 (c) 0 (d) 0.15 (e) 26 c Which is the fifth smallest value? (a) -874 (b) -3 (c) 1/15 (d) -2/11 (e) -3/2 (f) -5 d What is the seventh smallest value in 1/5, -4, 43.842, 1, -3/5, -3/7, -2/11? 43.842 Which is the fourth biggest value? (a) 4/289 (b) -4 (c) 0.3 (d) 0.43 (e) -0.1 e What is the fourth smallest value in 2/9, -1/101, -0.4, 5, -200, 3, 7? 2/9 Which is the fourth biggest value? (a) -17.13 (b) 4/7 (c) 0.079 (d) 3 a Which is the biggest value? (a) 15/11 (b) -0.09 (c) -8 (d) -7.61 a Which is the biggest value? (a) -2 (b) -170/47 (c) 545 c Which is the third smallest value? (a) -9/7 (b) 154 (c) 7/4 (d) 0 (e) -0.061 (f) -1 e What is the second biggest value in -0.3, 568, -2, 1? 1 Which is the biggest value? (a) -4 (b) 0 (c) 776 (d) 2/63 (e) 9 c Which is the second biggest value? (a) -6327 (b) 1 (c) -1 (d) -2208 c What is the smallest value in -45/22, -4, 10, -1/4, 4, 683? -4 Which is the second smallest value? (a) -0.2824 (b) 16 (c) -17.5 a What is the fourth smallest value in 25, 2, -2/15, -44, -0.4, 0.514, -5? -2/15 Which is the second smallest value? (a) -7/31 (b) -44 (c) -77.01 b Which is the third smallest value? (a) -1/17 (b) 18 (c) -0.5 (d) -3/8 (e) 20 (f) -3/5 (g) 2 d Which is the biggest value? (a) 0.37 (b) -109 (c) 3 (d) 1.538 (e) 4/9 c Which is the second biggest value? (a) 14/9 (b) -1 (c) 3.252547 a Which is the biggest value? (a) 1 (b) -11066 (c) 90 c Which is the fourth smallest value? (a) 17 (b) -0.4 (c) 0 (d) -47 (e) 120/11 (f) -11 c Which is the third smallest value? (a) -1/8 (b) 74.5005 (c) 1 (d) 1/2 c Which is the second biggest value? (a) -0.028 (b) 0.027 (c) -1 (d) 71 (e) -0.1 b Which is the fifth smallest value? (a) 13/11 (b) -1/5 (c) -3/10 (d) 2 (e) -0.05 d Which is the third smallest value? (a) 6/19 (b) 3/12754 (c) 4 c What is the smallest value in 3.88, 174839, 7? 3.88 Which is the fifth biggest value? (a) -1/3 (b) -1/13 (c) 44 (d) 25 (e) -3 (f) -0.033 (g) 5 b What is the biggest value in 1/1406, -12.3, 5, -1/4? 5 Which is the third smallest value? (a) -3 (b) 61 (c) 19/5 (d) 4 (e) 0.069 c What is the third smallest value in -14, -8/9, -1/9, -0.1, -291, 6/7? -8/9 What is the fourth smallest value in -5.2, -2, -3, -46, 288? -2 What is the second smallest value in -1/6, -2, -6/6311, 2/3, 2/21? -1/6 What is the biggest value in -0.4, -2, 53595.6, 3/14? 53595.6 Which is the smallest value? (a) 195 (b) 6/829 (c) 1/4 (d) -2/5 (e) 5/2 (f) -5 f What is the third smallest value in 2, -0.1, -1, -2/23583, 2/9? -2/23583 What is the second biggest value in 0.5, 17, 4, -587432/3? 4 What is the fourth biggest value in 0, 1/3, 535/4, 3345? 0 Which is the fifth biggest value? (a) -5 (b) 3 (c) 0.4 (d) 1/3 (e) -189 (f) 2/141 (g) -0.1 g What is the fourth smallest value in 3, 2/9, -19, 0.01, 5545/2? 3 Which is the biggest value? (a) 2/13 (b) -6 (c) -3/16 (d) -2/287 (e) -165 (f) 5 (g) -2 f What is the sixth biggest value in -2, 3, -1200, 5, 6/29, 0.4? -1200 What is the second biggest value in 1, 0.4, 0.13, 3659? 1 What is the second biggest value in 8, -1941373, -6? -6 What is the smallest value in -1/5, -0.03, -68/9? -68/9 Which is the fifth smallest value? (a) -14 (b) 11 (c) 46579 (d) 0.01 (e) -3 (f) -5 b What is the fifth biggest value in -45, 3, 20, 5, 7/5? -45 What is the third biggest value in 8, -5, -142.4? -142.4 What is the sixth biggest value in -0.1, -82.4, -10, -414, -2/13, -4? -414 Which is the fourth smallest value? (a) 8580 (b) 1 (c) 0.03 (d) 2/7 (e) 2/11 (f) 0 (g) -0.3 e What is the third smallest value in -2/125, -0.5, 0.3219, 4? 0.3219 What is the second biggest value in 2/15, -1770092, -1/2, -27? -1/2 Which is the fifth smallest value? (a) 2/7 (b) 53 (c) 1/4 (d) -1/2 (e) -0.1 (f) 1119 b What is the second smallest value in -1/3, 27, 950/4607? 950/4607 What is the third biggest value in 1, 2/7, 5, 7.191, -3, 6/7? 1 Which is the fourth smallest value? (a) -23.462 (b) -2/7 (c) 4 (d) 0.3 (e) 2 (f) -2 d What is the sixth smallest value in 0.2, -4/7397, 0.1, -1/2, 1/2, 88/3? 88/3 What is the fourth smallest value in 2/3, 15069, 102, 27/2? 15069 What is the fourth biggest value in 0.2, 989/7, 5, -1/10, 2, -2/7, 2/5? 2/5 Which is the third smallest value? (a) -5 (b) -1 (c) 54 (d) 3/8 (e) -20 b What is the third biggest value in 35, 305, 0.1, -0.1, 0, -1065? 0.1 What is the smallest value in -1/5, 153, 0.1, -2, 5/27? -2 Which is the third smallest value? (a) 0.92033 (b) -1/5 (c) -4/7 (d) 7 a Which is the biggest value? (a) 0.2 (b) -33823 (c) 3231 c Which is the biggest value? (a) -2/3 (b) -0.69 (c) 0 (d) -3/2 (e) -214 (f) 2/35 f Which is the third smallest value? (a) 96 (b) -2/9 (c) 0.064 (d) 1/7 (e) 3 (f) -138 c What is the biggest value in -2/1093, 6/17, 20.38? 20.38 Which is the third smallest value? (a) 182 (b) -1431 (c) 99 (d) 0.3 c What is the fourth smallest value in 128, 143, -0.1429, -2/3? 143 What is the third smallest value in 5, -13, -432539? 5 What is the fifth smallest value in -1, -2/9, 101, -10, -3872/7? 101 What is the second biggest value in 2, -4, 4/31, -2, -1/6, -1/4, -2.461? 4/31 What is the second biggest value in -3, 53, -2, 1, -0.3, 0.2, 1/2? 1 What is the smallest value in -1.90595, -0.057, 4? -1.90595 What is the second smallest value in -1, -2/9, -3, -4, 1/5, 0.819? -3 Which is the smallest value? (a) 5978/19 (b) -2 (c) -0.24 (d) 3 (e) -0.4 b Which is the third smallest value? (a) 4208 (b) 0.3 (c) -26 (d) 1/3 (e) 2 d Which is the smallest value? (a) 722 (b) 8 (c) -4/5 (d) -833 (e) 1/5 d Which is the biggest value? (a) -5 (b) 0.5 (c) 190.8 (d) 1 (e) -2 (f) 143 c What is the smallest value in 5885, -1/8, -1/2, -7, -1? -7 Which is the fourth biggest value? (a) 0.41 (b) 2 (c) 1271.51 (d) 3/7 a What is the fifth smallest value in 2, -3/2, -2101, 1, -0.5, -0.4, -0.547? -0.4 What is the fourth smallest value in -0.095, 1, -451, -0.04? 1 Which is the third biggest value? (a) -39 (b) 5/2 (c) 1/2 (d) 35462 c What is the third smallest value in -117, 0.7, 3/2, -0.3, 8? 0.7 What is the fourth smallest value in -2, -5, -1/7, -4067/9, -3, 15? -2 Which is the fifth smallest value? (a) -7 (b) 23539 (c) -2/3 (d) -3 (e) -0.2 b Which is the second biggest value? (a) -15 (b) -201 (	{ "pile_set_name": "DM Mathematics" }
+ 44? 38 In base 2, what is -110 - -100001001? 100000011 In base 2, what is -11011111010 - 100? -11011111110 In base 12, what is 2 + -502? -500 In base 5, what is 13022 - 2? 13020 In base 6, what is -1153 - -2? -1151 In base 8, what is 0 - -1201? 1201 In base 7, what is 52 - 4? 45 In base 12, what is -1 + 2b9? 2b8 In base 7, what is 0 - 124? -124 In base 3, what is 20 + 1122? 1212 In base 8, what is 4643 + -4? 4637 In base 12, what is 22 + 6a? 90 In base 9, what is -1480 - 0? -1480 In base 2, what is 10001 - -110010100? 110100101 In base 14, what is 81 - 4? 7b In base 3, what is -10 + -1121? -1201 In base 10, what is -168 - 64? -232 In base 11, what is -389 - -2? -387 In base 3, what is -2002121 + -12? -2002210 In base 4, what is 13303 - 132? 13111 In base 5, what is 14224 - -4? 14233 In base 3, what is -1 - -2122? 2121 In base 7, what is -12 + 1266? 1254 In base 3, what is -21 + -22202? -100000 In base 15, what is 18 + -a0? -87 In base 10, what is 0 + 21? 21 In base 2, what is 1010111 + -10100? 1000011 In base 12, what is -4 + -894? -898 In base 10, what is -13 + 13? 0 In base 15, what is -17e + 9? -175 In base 10, what is -77 + 8? -69 In base 7, what is -3 - 164? -200 In base 2, what is 0 - -10000010011? 10000010011 In base 8, what is 0 + 115? 115 In base 7, what is 40 - -141? 211 In base 13, what is 974 + 1? 975 In base 2, what is -111011110 + 100011? -110111011 In base 2, what is -11 + -1100111110011? -1100111110110 In base 16, what is -5 + -2e? -33 In base 4, what is 30 - -1100? 1130 In base 3, what is -10 - 10211? -10221 In base 11, what is -6 + -5353? -5359 In base 7, what is -4 + 11006? 11002 In base 2, what is 100001100111111 + -11? 100001100111100 In base 5, what is -2 + 2432? 2430 In base 4, what is 3 - 101? -32 In base 4, what is -202 - 1020? -1222 In base 12, what is 1 - 203? -202 In base 5, what is 2010 - -1? 2011 In base 12, what is 592 - -1? 593 In base 11, what is 1 - 158a? -1589 In base 10, what is 678 - 1? 677 In base 6, what is -334 + 5? -325 In base 12, what is -10 + 91? 81 In base 4, what is 1032033 + 2? 1032101 In base 16, what is 100 - b? f5 In base 5, what is 113 + -13? 100 In base 16, what is -5 + 605? 600 In base 3, what is 110 - -102021? 102201 In base 4, what is -11 - -212? 201 In base 9, what is -14 - -3? -11 In base 11, what is 37 - -18? 54 In base 7, what is 63 - 106? -13 In base 8, what is 174 + 2? 176 In base 12, what is -1 + a7? a6 In base 16, what is 4 + -25? -21 In base 8, what is 15 - 5? 10 In base 16, what is 435 - 5? 430 In base 12, what is 5 + 2440? 2445 In base 11, what is 1 - 127? -126 In base 10, what is 249 - 8? 241 In base 5, what is -40130 + 1? -40124 In base 5, what is -300221 - 2? -300223 In base 8, what is 3 - -1? 4 In base 12, what is 2b7 - 4? 2b3 In base 15, what is -3 + -e9c? -ea0 In base 15, what is -c6 + 4? -c2 In base 8, what is 4 + 16? 22 In base 5, what is -11 + 4? -2 In base 7, what is 0 - -42? 42 In base 14, what is -7d - 0? -7d In base 10, what is -465 - -3? -462 In base 2, what is -10 + -1000? -1010 In base 14, what is 34 + -22? 12 In base 11, what is a9 + 6? 104 In base 14, what is -bb - 7? -c4 In base 5, what is 30 - 2? 23 In base 2, what is 100 - -11? 111 In base 7, what is 25 + -253? -225 In base 15, what is 177 + -18? 15e In base 16, what is fc + 6? 102 In base 9, what is -5168 + -2? -5171 In base 16, what is 8 + 1? 9 In base 2, what is -10 + -11111010? -11111100 In base 6, what is 1 - -245? 250 In base 14, what is -11c3 - -3? -11c0 In base 9, what is -4 - -88? 84 In base 14, what is c5dc + -1? c5db In base 5, what is -321 + 0? -321 In base 2, what is 101111 + 0? 101111 In base 11, what is 196 + 5? 1a0 In base 5, what is -4 - 10? -14 In base 2, what is 110000 - 101? 101011 In base 14, what is -a + 1835? 1829 In base 4, what is -11210 + 11? -11133 In base 7, what is -113 - 2? -115 In base 8, what is 2 - 42? -40 In base 7, what is -1112 + 3? -1106 In base 6, what is 432 + -3? 425 In base 16, what is 2 - -1? 3 In base 6, what is -11 - 143? -154 In base 11, what is 490 - -3? 493 In base 14, what is -16c + 3? -169 In base 3, what is 1011021 + -10? 1011011 In base 12, what is -5 - 32? -37 In base 4, what is -3 + -302? -311 In base 8, what is -2261 - 1? -2262 In base 6, what is 0 + 123? 123 In base 12, what is -82 + -4? -86 In base 5, what is 24 + 40? 114 In base 12, what is -3b + 3? -38 In base 2, what is -10 + 101000011? 101000001 In base 9, what is -833 - -15? -817 In base 13, what is 3 + -258? -255 In base 9, what is -2 - -3856? 3854 In base 9, what is -5 + -17? -23 In base 3, what is 11121 - 0? 11121 In base 12, what is -11 + -108? -119 In base 5, what is -44 + 244? 200 In base 2, what is 101010100000 + -10? 101010011110 In base 8, what is 257 - 5? 252 In base 13, what is 1 - 66? -65 In base 3, what is -210 - 2? -212 In base 7, what is -2 - -403? 401 In base 5, what is -242 - -143? -44 In base 3, what is 1011 - -12? 1100 In base 5, what is 1012 + 4? 1021 In base 14, what is 26b - -b? 278 In base 6, what is -121 - -111? -10 In base 3, what is -12102020 - -12? -12102001 In base 8, what is -10343 - 3? -10346 In base 2, what is 11 + -11010? -10111 In base 3, what is 21 + 100? 121 In base 3, what is 1100002 - -1? 1100010 In base 12, what is 149 - -9? 156 In base 7, what is 3 - -645? 651 In base 6, what is -1 + -214? -215 In base 4, what is -1321 + -2? -1323 In base 14, what is -4 - 1031? -1035 In base 12, what is -4 - -20? 18 In base 3, what is 0 + 11100? 11100 In base 2, what is -11110 - -10? -11100 In base 4, what is 2 + -1333? -1331 In base 6, what is 1342 + 4? 1350 In base 2, what is 1010000101 + 1011? 1010010000 In base 6, what is -30 - -1? -25 In base 15, what is -311 + -4? -315 In base 16, what is 24 - 28? -4 In base 16, what is 4 + 11? 15 In base 10, what is 58 - 5? 53 In base 12, what is 19 - -20? 39 In base 10, what is -52 - 3? -55 In base 4, what is -1 - -30? 23 In base 10, what is 11 - 6? 5 In base 12, what is -345 + 7? -33a In base 13, what is -4668 + 1? -4667 In base 5, what is -10 + 441? 431 In base 5, what is -3 - -12013? 12010 In base 7, what is 2 - 425? -423 In base 5, what is 14 + -342? -323 In base 11, what is 4 + 274? 278 In base 16, what is -4 + f? b In base 12, what is 5 + -1764? -175b In base 15, what is 4 - 6e? -6a In base 8, what is 1 - -1203? 1204 In base 5, what is -4 - -1232? 1223 In base 16, what is 68b + 4? 68f In base 14, what is 89dc - -4? 8a02 In base 11, what is 35 - -8? 42 In base 11, what is 1 - -10? 11 In base 7, what is 2324 + 4? 2331 In base 2, what is -1000 + 1001010001? 1001001001 In base 4, what is -3 + -12113? -12122 In base 15, what is -2d + 8? -25 In base 4, what is -1001 + 10213? 3212 In base 11, what is 1 + -126? -125 In base 14, what is -497 - 3? -49a In base 9, what is 653 - 0? 653 In base 13, what is 1c - -9? 28 In base 13, what is 89 - -7? 93 In base 12, what is 1 - 65? -64 In base 5, what is -230 + 141? -34 In base 14, what is d + 4? 13 In base 3, what is -1 - 101? -102 In base 15, what is -13a + -1? -13b In base 5, what is -2102 - 4? -2111 In base 9, what is -5 + -82? -87 In base 11, what is 609 + -5? 604 In base 14, what is -10 - -25? 15 In base 8, what is 42 - -5? 47 In base 11, what is -8 - 54? -61 In base 8, what is -46 + -21? -67 In base 9, what is 5 - -6? 12 In base 3, what is -2021 - 11? -2102 In base 3, what is -122112 + 22? -122020 In base 11, what is 3 + -2a7? -2a4 In base 7, what is -1 + -3154? -3155 In base 14, what is -26 - -7? -1d In base 5, what is 13 - -311? 324 In base 9, what is 20 - 3? 16 In base 12, what is -5b5 - 4? -5b9 In base 6, what is 3 + -21353? -21350 In base 7, what is -225 + 22? -203 In base 2, what is -1111 - -1? -1110 In base 7, what is -4 - -40? 33 In base 15, what is -be - 4? -c3 In base 6, what is 255 + -12? 243 In base 14, what is -5 + 136d? 1368 In base 2, what is -110 - 111000111? -111001101 In base 14, what is -6 + -8? -10 In base 12, what is 13 - 19? -6 In base 8, what is -4 + 61? 55 In base 7, what is 4123 + 1? 4124 In base 7, what is 5 - -4153? 4161 In base 15, what is -2 + 549? 547 In base 8, what is -16 - 24? -42 In base 3, what is 12 - -201021? 201110 In base 7, what is -42 - -34? -5 In base 8, what is -134 - -46? -66 In base 7, what is -136 + 4? -132 In base 10, what is 150 + -21?	{ "pile_set_name": "DM Mathematics" }
e factors of 3711236569. 103, 739, 48757 What are the prime factors of 8110522? 2, 7, 167, 3469 What are the prime factors of 190847634? 2, 3, 31807939 List the prime factors of 2890632082. 2, 13, 111178157 List the prime factors of 2539063440. 2, 3, 5, 109, 32353 List the prime factors of 477576502. 2, 13, 1051, 17477 What are the prime factors of 60840710? 2, 5, 7, 869153 List the prime factors of 3735342846. 2, 3, 691, 300317 List the prime factors of 92222191. 101, 139, 6569 List the prime factors of 2872395. 3, 5, 21277 What are the prime factors of 143307920? 2, 5, 7, 255907 List the prime factors of 1607360521. 13, 53, 179453 What are the prime factors of 10481452? 2, 17, 9067 List the prime factors of 63743957. 63743957 List the prime factors of 1054625952. 2, 3, 31, 354377 What are the prime factors of 2418353234? 2, 11, 109925147 What are the prime factors of 166713869? 7, 1061, 22447 What are the prime factors of 1341665299? 13, 89, 823, 1409 List the prime factors of 57907497. 3, 19, 59, 67, 257 What are the prime factors of 577046260? 2, 5, 7, 47, 87697 What are the prime factors of 79100880? 2, 3, 5, 329587 What are the prime factors of 698963562? 2, 3, 11, 103, 34273 List the prime factors of 69881690. 2, 5, 6988169 List the prime factors of 105290388. 2, 3, 7, 139273 What are the prime factors of 245198954? 2, 7, 11, 13, 122477 What are the prime factors of 22168035? 3, 5, 29, 16987 List the prime factors of 795653211. 3, 265217737 What are the prime factors of 366574681? 11, 61, 659, 829 List the prime factors of 41972620. 2, 5, 233, 9007 List the prime factors of 855834619. 53, 16147823 List the prime factors of 61792149. 3, 20597383 What are the prime factors of 26852214? 2, 3, 17, 263257 List the prime factors of 104693348. 2, 431, 60727 List the prime factors of 71754564. 2, 3, 7, 19, 44959 List the prime factors of 1922979925. 5, 107, 718871 What are the prime factors of 10129421? 227, 44623 List the prime factors of 4416681213. 3, 7, 137, 511723 List the prime factors of 3127216065. 3, 5, 43, 383, 12659 List the prime factors of 5312078383. 17, 1613, 193723 List the prime factors of 24399286. 2, 12199643 What are the prime factors of 691422892? 2, 691, 250153 List the prime factors of 57630787. 59, 61, 67, 239 List the prime factors of 1193073710. 2, 5, 23, 5187277 List the prime factors of 1101695. 5, 7, 31477 List the prime factors of 40450285. 5, 8090057 What are the prime factors of 2566317450? 2, 3, 5, 17, 223, 4513 What are the prime factors of 365396444? 2, 7, 151, 86423 List the prime factors of 1575545131. 1575545131 List the prime factors of 4680575. 5, 187223 What are the prime factors of 4832285499? 3, 178973537 What are the prime factors of 2530155192? 2, 3, 4591, 22963 List the prime factors of 1981455325. 5, 503, 157571 What are the prime factors of 214439883? 3, 7, 733, 13931 What are the prime factors of 345308101? 31, 197, 56543 What are the prime factors of 3619139? 19, 67, 2843 What are the prime factors of 29722459? 13, 31, 131, 563 What are the prime factors of 30439793? 61, 569, 877 What are the prime factors of 60358849? 60358849 What are the prime factors of 543544863? 3, 13331, 13591 What are the prime factors of 130275289? 23, 73, 77591 List the prime factors of 680198103. 3, 13, 29, 307, 653 List the prime factors of 767391209. 13, 19, 3106847 List the prime factors of 365549298. 2, 3, 1031, 59093 List the prime factors of 266742053. 17, 181, 86689 List the prime factors of 43056993. 3, 7, 2050333 List the prime factors of 704206263. 3, 1523, 154127 What are the prime factors of 116525435? 5, 13, 31, 57829 List the prime factors of 491055157. 37, 13271761 What are the prime factors of 128757944? 2, 7, 2299249 What are the prime factors of 1455466524? 2, 3, 121288877 What are the prime factors of 85604098? 2, 42802049 List the prime factors of 37186108. 2, 71, 127, 1031 List the prime factors of 86282640. 2, 3, 5, 293, 409 What are the prime factors of 12931058? 2, 7, 19, 173, 281 What are the prime factors of 6013080392? 2, 11, 68330459 What are the prime factors of 582763509? 3, 64751501 What are the prime factors of 220729215? 3, 5, 7, 2102183 List the prime factors of 1920321072. 2, 3, 29, 459847 List the prime factors of 233214543. 3, 25912727 List the prime factors of 361744728. 2, 3, 631, 23887 What are the prime factors of 30498785? 5, 2393, 2549 What are the prime factors of 1990316669? 11, 41, 4413119 List the prime factors of 1870426808. 2, 233803351 What are the prime factors of 553730877? 3, 7, 2929793 What are the prime factors of 388542235? 5, 77708447 List the prime factors of 18758515. 5, 3751703 What are the prime factors of 18355998? 2, 3, 61, 50153 List the prime factors of 135639966. 2, 3, 7, 11, 61, 4813 What are the prime factors of 3566437? 7, 577, 883 List the prime factors of 370537266. 2, 3, 11, 5614201 List the prime factors of 1344221345. 5, 71, 3786539 List the prime factors of 2717567789. 59, 4931, 9341 What are the prime factors of 4145708468? 2, 11, 17, 326023 List the prime factors of 9013350098. 2, 233, 19341953 List the prime factors of 20282646. 2, 3, 3380441 What are the prime factors of 1103388366? 2, 3, 17, 1699, 6367 What are the prime factors of 391552094? 2, 195776047 What are the prime factors of 110093750? 2, 5, 13, 271 List the prime factors of 502373934. 2, 3, 83, 112087 List the prime factors of 8495051703. 3, 41, 69065461 List the prime factors of 28914135. 3, 5, 233, 8273 What are the prime factors of 26470248? 2, 3, 7, 157561 What are the prime factors of 292240513? 43, 79, 86029 List the prime factors of 15721244. 2, 7, 11, 51043 What are the prime factors of 3549045? 3, 5, 223, 1061 What are the prime factors of 2223428332? 2, 71, 1237, 6329 What are the prime factors of 4324773000? 2, 3, 5, 1441591 What are the prime factors of 4480717155? 3, 5, 439, 680443 What are the prime factors of 4367209001? 607, 1291, 5573 List the prime factors of 2470913300. 2, 5, 43, 574631 List the prime factors of 804651998. 2, 613, 656323 List the prime factors of 101067399. 3, 3743237 What are the prime factors of 21182299? 21182299 What are the prime factors of 1910644948? 2, 31, 1231, 12517 List the prime factors of 9135769545. 3, 5, 7, 2017, 4793 List the prime factors of 5971027. 5971027 What are the prime factors of 94340313? 3, 1783, 5879 List the prime factors of 2828175132. 2, 3, 235681261 What are the prime factors of 778251174? 2, 3, 127, 1021327 List the prime factors of 4237058659. 29, 53, 2756707 List the prime factors of 21207824. 2, 11, 41, 2939 What are the prime factors of 43820922? 2, 3, 911, 8017 List the prime factors of 21031634. 2, 13, 101, 8009 What are the prime factors of 1086654976? 2, 11, 61, 3163 What are the prime factors of 384935177? 11, 34994107 What are the prime factors of 629297730? 2, 3, 5, 193, 36229 List the prime factors of 85242386. 2, 17, 439, 5711 What are the prime factors of 356070441? 3, 509, 233183 What are the prime factors of 219814122? 2, 3, 11, 373, 8929 List the prime factors of 515276187. 3, 171758729 What are the prime factors of 3353342589? 3, 1367, 272563 What are the prime factors of 284747001? 3, 7, 11, 112061 List the prime factors of 189395186. 2, 94697593 What are the prime factors of 3065093? 757, 4049 What are the prime factors of 63104339? 19, 73, 45497 List the prime factors of 99877378. 2, 1709, 29221 What are the prime factors of 4263783551? 29, 43, 61, 56053 What are the prime factors of 120789359? 120789359 List the prime factors of 6522091927. 13, 223, 2249773 What are the prime factors of 73365851? 13, 41, 59, 2333 What are the prime factors of 3842866003? 67, 149, 384941 List the prime factors of 694677249. 3, 7, 47, 78203 List the prime factors of 16148354. 2, 37, 47, 4643 What are the prime factors of 1092488836? 2, 273122209 List the prime factors of 768880559. 197, 751, 5197 What are the prime factors of 33344809? 29, 31, 1279 List the prime factors of 131605305. 3, 5, 13, 19, 35521 List the prime factors of 1713042196. 2, 17, 2011, 12527 List the prime factors of 49759172. 2, 277, 44909 What are the prime factors of 353819616? 2, 3, 31, 118891 List the prime factors of 122921261.	{ "pile_set_name": "DM Mathematics" }
3b + 891. Give z(21). -12 Let w(n) = 4n*2 + 543n + 905. Determine w(-134). -33 Let x(b) = 8b2 - 10b + 26. What is x(6)? 254 Let d(v) = 431v + 3495. Determine d(-8). 47 Let i(o) = 7o*2 + 24o - 55. Determine i(2). 21 Let r(o) = 2o3 + 13o*2 + 65o + 356. Give r(-6). 2 Let d(o) = -4o2 + 247o + 6219. Determine d(81). -18 Let f(u) = u*3 + 14u*2 + 8u + 21. Determine f(-6). 261 Let r(m) = -m*2 - 35m - 651. Determine r(-25). -401 Let a(l) = 3l2 + 826l + 5671. What is a(-7)? 36 Let s(m) = 9m + 32. Calculate s(2). 50 Let z(l) = -3l*3 - 4l*2 - 18l - 113. Calculate z(-5). 252 Let v(y) = -287y - 12918. Give v(-45). -3 Let i(b) = -6b*3 - 2b*2 + 84b - 81. What is i(1)? -5 Let x(f) = -f3 - f2 + 24f + 48. Calculate x(-4). 0 Let l(z) = 2z*2 + 22z - 819. Give l(18). 225 Let b(f) = 3f2 + 1002f + 2008. Calculate b(-2). 16 Let w(t) = 3t2 + 45t - 2. Give w(-17). 100 Let z(m) = m*2 + 189m + 1098. Calculate z(-183). 0 Let a(q) = -1585q - 9581. Give a(-6). -71 Let j(m) = 32m + 77. Give j(-5). -83 Let v(g) = -170g + 1537. What is v(9)? 7 Let x(a) = -9a*2 + 40a + 40. What is x(-1)? -9 Let c(z) = -43z + 1986. What is c(52)? -250 Let q(i) = i2 - 11i + 113. Determine q(17). 215 Let v(c) = -361c - 751. Give v(-2). -29 Let h(n) = -25n - 2212. Give h(-88). -12 Let c(d) = 993d2 - 6948d - 22. Determine c(7). -1 Let w(u) = 78u + 1172. What is w(-15)? 2 Let q(f) = -f2 + 119f - 1325. Calculate q(15). 235 Let b(x) = x*2 + 13x - 154. Give b(8). 14 Let r(t) = -t*3 + 31t*2 - 122t + 2746. What is r(30)? -14 Let a(s) = -s*2 + 30s + 74. Determine a(30). 74 Let q(c) = 483c - 4352. Calculate q(9). -5 Let l(h) = h3 - 8h*2 + h - 29. Give l(8). -21 Let k(h) = -6h*2 + 27h + 347. Calculate k(-7). -136 Let w(m) = -29m2 + 176m - 20. Give w(6). -8 Let z(d) = 14946d + 89657. Calculate z(-6). -19 Let r(m) = 6389m - 140553. Determine r(22). 5 Let r(a) = 9a - 1055. Determine r(-7). -1118 Let o(b) = -3b*2 - 80b + 250. What is o(3)? -17 Let u(b) = 5b2 - 3b - 109. What is u(6)? 53 Let w(p) = -4p3 + 130p*2 - 64p - 1. Determine w(32). -1 Let d(a) = -37a - 1018. Calculate d(-27). -19 Let g(n) = 103n - 962. Determine g(9). -35 Let c(b) = -9216b + 55274. Determine c(6). -22 Let g(t) = t2 + 326t + 1909. Determine g(-6). -11 Let n(h) = -46h2 + 552h - 8. Calculate n(12). -8 Let f(m) = 419m3 + 2m*2 + m - 1. Determine f(-1). -419 Let g(t) = -20t*2 + 231t + 73. What is g(12)? -35 Let d(r) = -2r3 + 16r*2 - 13r + 75. Determine d(7). 82 Let p(b) = 1010b - 1000. Give p(1). 10 Let f(c) = 2c*3 - 50c*2 + 259c - 99. Determine f(18). 27 Let q(x) = 64x3 + 7x*2 - 8x + 1. What is q(1)? 64 Let x(d) = 285d + 292. Give x(-1). 7 Let d(z) = -71z*2 - 32021z - 2. Give d(-451). -2 Let u(w) = -2w3 + 44w*2 - 117w + 66. Calculate u(19). 9 Let g(t) = -2t2 + 30t + 2. Give g(15). 2 Let k(w) = 2w2 - 27w - 94. Determine k(-5). 91 Let h(q) = -236q - 3. What is h(-1)? 233 Let l(a) = -a3 - 2a + 10. Calculate l(0). 10 Let t(a) = 601a + 32416. Determine t(-54). -38 Let s(a) = -9a*2 + 300a - 1712. Determine s(26). 4 Let h(k) = k*3 + 34k*2 + 23k - 237. Calculate h(-33). 93 Let f(y) = y*2 + 11234y + 134662. What is f(-12)? -2 Let m(i) = 2i2 - 874i + 44604. What is m(378)? 0 Let b(a) = 167a - 474. What is b(3)? 27 Let y(z) = -3z*2 + 2z + 17. Give y(-9). -244 Let t(s) = -s3 + s2 + 6s + 11. Calculate t(5). -59 Let o(h) = h3 + 57h*2 - 2848h - 14. Determine o(-89). -14 Let f(q) = q*3 + 21q*2 - 135q - 124. What is f(-26)? 6 Let x(a) = -386a + 8855. What is x(23)? -23 Let z(a) = 42a - 652. Calculate z(19). 146 Let g(x) = 147x + 2058. Give g(-15). -147 Let m(a) = a3 - 5a*2 - 13a - 16. Determine m(7). -9 Let s(n) = -2n3 - 5n*2 - 6n - 6. What is s(2)? -54 Let f(x) = -9x3 + 1143x*2 + 2x - 255. Calculate f(127). -1 Let p(a) = -75a + 4. Give p(3). -221 Let a(f) = 11f + 488. Determine a(-39). 59 Let j(s) = -s*2 + 101s - 1487. Calculate j(18). 7 Let d(j) = -3j3 + 589j*2 + 395j - 195. Determine d(197). 2 Let j(o) = o*2 - 973o + 5781. Give j(6). -21 Let a(f) = 16f2 + 39f + 6. Give a(-8). 718 Let z(h) = 2152h + 12911. Calculate z(-6). -1 Let y(f) = -18f*3 + 2f*2 - 10f - 12. What is y(-2)? 160 Let y(w) = 3w3 + 26w*2 + 17w + 35. What is y(-8)? 27 Let w(d) = d*2 + 15d - 326. What is w(15)? 124 Let x(c) = 36c - 1195. Give x(33). -7 Let u(n) = -n3 + 28n*2 - 169n + 173. What is u(20)? -7 Let w(j) = j*3 + 13j*2 + 24j - 16. Calculate w(-11). -38 Let l(y) = -3y2 + 43y - 48. Calculate l(13). 4 Let l(b) = -b*3 - 13b*2 - 35b - 20. What is l(-4)? -24 Let s(y) = -2y2 + 166y - 3267. Give s(32). -3 Let b(s) = -s*2 + 42s - 199. What is b(5)? -14 Let m(o) = -o*3 - 45o*2 - 12o - 543. Determine m(-45). -3 Let r(d) = d*3 - 71d*2 + 169d - 2139. Calculate r(69). 0 Let k(s) = s*2 + 29s + 12. What is k(-8)? -156 Let p(z) = 2z3 - z2 + z - 149. Calculate p(0). -149 Let v(h) = 2788h + 8309. Give v(-3). -55 Let z(d) = -8d + 515. Calculate z(45). 155 Let y(s) = -276s - 69294. Give y(-251). -18 Let x(q) = q3 - q2 - q + 7. What is x(2)? 9 Let l(w) = w*3 + 10w*2 + 13w + 98. Determine l(-9). 62 Let s(l) = l*3 + 14l*2 - 22l + 37. Determine s(-16). -123 Let d(o) = -2o + 20. Calculate d(22). -24 Let z(m) = -1101m + 6611. Determine z(6). 5 Let y(v) = -v*3 + 6v*2 - 2v - 17. Calculate y(5). -2 Let c(p) = -p*3 + 6p*2 - 5710p + 22801. What is c(4)? -7 Let v(g) = -46g + 87. Calculate v(4). -97 Let q(n) = -56n + 6775. Calculate q(121). -1 Let l(c) = 23c2 - 435c - 38. What is l(19)? 0 Let r(c) = 2c2 + 123c + 108. Determine r(-60). -72 Let t(p) = -28p + 12. Calculate t(-3). 96 Let r(m) = -35m + 21. Determine r(4). -119 Let a(l) = 24l - 733. Calculate a(30). -13 Let v(c) = c3 - 15c*2 + 5c - 4. Determine v(15). 71 Let t(i) = -i*3 - 9i*2 + 13i + 31. Determine t(-11). 130 Let t(z) = -50z2 + 526z + 27. Determine t(11). -237 Let o(q) = -54q - 764. Give o(-14). -8 Let x(n) = -n3 + 4n*2 + 9n - 23. What is x(4)? 13 Let v(w) = -30w2 - 37w + 44. Give v(1). -23 Let y(m) = 9m2 - 37m + 28. Calculate y(4). 24 Let b(n) = -44n - 252. What is b(-6)? 12 Let n(h) = 3h*2 + 55h + 136. What is n(-17)? 68 Let m(w) = 1095w - 20816. What is m(19)? -11 Let r(f) = -f2 - 168f - 940. Determine r(-6). 32 Let z(u) = -39815u - 119435. Give z(-3). 10 Let k(r) = -r3 - 9r*2 + r + 297. What is k(0)? 297 Let l(g) = 27g*2 - 834g - 85. Give l(31). 8 Let g(w) = w*2 + w - 201. Calculate g(15). 39 Let v(o) = -15o*3 + 510o*2 + 17o - 576. Calculate v(34). 2 Let f(h) = -83h - 1008. Give f(-11). -95 Let w(c) = 93c - 1967. Determine w(15). -572 Let a(i) = i*2 - 105i - 552. Calculate a(-5). -2 Let u(l) = 2l3 + 26l*2 - 18l - 240. Determine u(-13). -6 Let k(r) = -r*2 + 31r + 207. What is k(-6)? -15 Let d(g) = -g*3 + 78g*2 - 81g + 315. Give d(77). 7 Let w(c) = 903c + 4517. Determine w(-5). 2 Let r(o) = -3o*2 + 87o - 4. Determine r(29). -4 Let h(l) = 2l3 + 82l*2 + 5l + 190. Give h(-41). -15 Let l(f) = 3f2 - 62f + 98. Calculate l(16). -126 Let r(n) = 8n + 190. Give r(-21). 22 Let n(b) = 2b*2 + 54b - 502. What is n(-34)? -26 Let j(h) = 277h - 20792. Determine j(75). -17 Let g(m) = -13m + 168. Determine g(-33). 597 Let u(p) = 69p + 2280. What is u(-33)? 3 Let r(p) = -2p*2 + 338p - 3743. Give r(157). 25 Let h(f) = -3f2 + 126f - 91. Calculate h(41). 32 Let z(y) = 3y3 + 15y*2 + 5y + 11. Calculate z(-5). -14 Let j(n) = n*3 + 40n*2 - 42n - 10. Determine j(-41). 31 Let a(b) = 2b2 - 52b - 218. What is a(-4)? 22 Let a(f) = -5f3 - 22f*2 - 2f - 17. Give a(-4). -41 Let z(q) = -q*3 - 10q*2 + 23q + 36. What is z(-10)? -194 Let l(k) = 1963k - 17666. Give l(9). 1 Let i(u) = -15u - 353. Give i(-27). 52 Let g(b) = 17b3 - 2921b*2 - 517b + 179. Determine g(172). 7 Let v(l) = 63l - 1571. Determine v(24). -59 Let s(v) = v3 + v2 + 4v - 143. Calculate s(0). -143 Let q(t) = 3t2 - 39t - 1370. Give q(28). -110 Let y(g) = -g*3 - 49g*2 - 586g - 203. Determine y(-29). -29 Let h(b) = b3 + b2 + 2*b - 92. Calculate h(0). -92 Let	{ "pile_set_name": "DM Mathematics" }
92/9. Which is the second biggest value? (a) 1/11 (b) -7 (c) q a Let d = -232 + 467/2. Let j = 3 + -4. What is the smallest value in -0.03, j, d? j Let v = 388 - 3500/9. Which is the second smallest value? (a) 6 (b) v (c) -2 (d) 5 b Let z = 226.67 + -227. Let v = -0.4 + 0.74. Let j = v + z. Which is the smallest value? (a) j (b) -2/3 (c) -3/5 b Let k = 1744 - 1739. What is the smallest value in -3, -12/5, k? -3 Let y be 46 - ((-24)/(-40))/(2/10). Let m = 47 - y. What is the second smallest value in m, 0.1, -2, -0.1? -0.1 Let i = -2725 + 2735. Which is the second smallest value? (a) -2/5 (b) 5 (c) i (d) -1 a Let j = -15.68 - -15. Let o = -0.13 - j. Let z = o - 0.15. Which is the third biggest value? (a) z (b) 1/7 (c) 0 c Let l = 568.89 - 569. Let i = -7.5 - -7.11. Let q = l + i. What is the third biggest value in 0.09, q, 0? q Let c = 376.3 - 376. What is the second smallest value in 7/3, 5, 0.1, c? c Let j = -0.3 - -0.5. Let l = 22.9 - 31.9. What is the biggest value in j, 3, l? 3 Suppose 0 = -r + 3r - 10. Suppose 0 = -8x + 13x. Suppose x = -3q - rm - 1 + 2, 0 = -5q - 5m - 5. What is the second biggest value in q, -3/7, -1? -1 Let n = -498 - -494. What is the biggest value in n, -5, 1/300, 3? 3 Let c = 6.94 - 7. Let g = c + 0.46. Let j = 2503/4 - 626. What is the smallest value in j, -4, g? -4 Let u = -33 - -33.44. Let a = u - 0.54. What is the biggest value in -4, -2, a? a Let i = 23 + -20. Let x(g) = 12g + 3 + 5g2 - 6g + 0g - 2g*i + 3g*3. Let m be x(-4). Which is the third biggest value? (a) 0.2 (b) m (c) 0.1 b Let g be (-7)/(1260/(-296)) + 0. Let i = g - 28/15. Which is the third biggest value? (a) -0.1 (b) i (c) -0.3 (d) 0.4 b Let s be (-7)/(-6)68/(-357). Which is the fourth biggest value? (a) -12 (b) 2 (c) -1/4 (d) s a Let r = -0.21 + 1.51. Let n = r + -4.3. What is the third biggest value in -1/3, 0.2, n? n Let z be (-2)/(0/(-3) - 1). Suppose -zg + g = -2r - 16, 0 = g - 4. Let y be ((-9)/90)/((-1)/r). Which is the biggest value? (a) y (b) -2 (c) -3 a Let z be 24/(-20)18/(-36). Which is the second smallest value? (a) z (b) 2 (c) -3.9 (d) 0.3 d Let k = -164 + 80. Let b = k + 83.8. What is the fourth biggest value in 19, 1/9, b, 1? b Let f = -405 - -7697/19. Which is the third smallest value? (a) f (b) -0.3 (c) 3/4 (d) 0.4 d Let v = -4/46417 + -4906936/46417. Let j = -153 + 47. Let r = j - v. Which is the second smallest value? (a) r (b) -0.04 (c) -1/5 c Let w(s) = -s3 - s2 + s - 4. Let m be w(0). Let t = -178/217 - -21/31. Let j = 3 - 5. What is the third biggest value in m, t, j? m Let t(m) = -13m - 6. Let h be t(7). Let z = h + 385/4. What is the second biggest value in -0.4, 0, z? -0.4 Let y be (22/(-6) + 5)6/(-14). Which is the second biggest value? (a) -0.4 (b) y (c) -0.048 a Let q = -83.1 - -9.1. Let c = -52 - q. Let j = c - 24. What is the third biggest value in 5, j, 0.3? j Let s be 1 + 4/(-3) - 1. Let j = 23 - 25. Let v be (1/(-7))/(j/8). Which is the biggest value? (a) -1/4 (b) v (c) s b Let s = 0.5 + -0.4. Let w = -0.375 + 0.175. Which is the third smallest value? (a) 3 (b) w (c) s a Let s = 347.18 + -347. Which is the second biggest value? (a) -2 (b) -0.3 (c) s (d) 1 c Let k be 16/12 - 2/(-3). Let n be 16/((-1)/(-1)) + k. Let s = -17 + n. What is the second biggest value in 3/4, -5/2, s? 3/4 Let u be 651/(-186)(2/(-28) - 0). Let f = -26 - -20.1. Let c = -0.9 - f. What is the second biggest value in u, c, -2/3? u Let z = 41 - 68. Let x be (z/(-6))/((-1)/2). Let y = x + 4. Which is the biggest value? (a) -2 (b) 2/9 (c) y b Let h = -92.6 - -105. Let y = h + -12. Let x = -8 + 7.97. Which is the third biggest value? (a) x (b) y (c) -5 c Let m = 791 - 791.5. Which is the second smallest value? (a) 1 (b) -0.3 (c) m (d) 3 b Let p(i) = i*3 - 4i*3 + 5 - 6i + i3 + i3 + 9i2. Let w be p(8). Let o = w + -21. Which is the second smallest value? (a) -0.1 (b) -2 (c) o a Let x be (-30)/(-495)(2 - -1). What is the second biggest value in 0, 4/5, 1/5, x? 1/5 Let d = -148/7 - -289/14. What is the third biggest value in d, 2/19, -0.2? d Let p be -6 - (-91)/14 - (-14)/4. Which is the third smallest value? (a) -0.2 (b) 5/7 (c) p (d) 1 d Let r be 2/5 - (-1422)/(-405). Let d = 382/117 + r. What is the biggest value in 0.14, d, -3? d Suppose -3q = -5k + 10k + 1, -3k + 4q - 18 = 0. Let w = 0.1 + 0.3. Let b = -0.2 + -0.1. What is the third biggest value in b, k, w? k Let r be -4(-4 + 105/28). What is the third biggest value in r, -25/13, 1/2? -25/13 Let m = -609 - -625. What is the biggest value in m, -1/2, -0.3? m Let j = -10.361 - -10.3. Let w = 1.101 + j. Let q = 0.04 - w. What is the third smallest value in q, -2, -5? q Let j = 89/370 - 3/74. Which is the third biggest value? (a) -2/13 (b) 3/11 (c) j a Suppose 2l - 5x = l - 208, l + 176 = -3x. Let u = l - -184. Let y = 8 - 13. Which is the second smallest value? (a) y (b) 0.07 (c) u c Let y be (-1 + 2)(3 - (-3 + 1)). What is the biggest value in -3/4, 1/23, y? y Let f = 0.99 + 15.61. Let h = f + -17. Which is the second biggest value? (a) 2/7 (b) h (c) -2/9 c Let q be (7 + 220/(-28))(-2)/(-4). Which is the smallest value? (a) 5 (b) q (c) -5 c Let i = -717 - -717.4. What is the second smallest value in -0.6, 0, i? 0 Suppose -3t + 15 = 2t. Let z = -78 + t. Let j = -227/3 - z. What is the biggest value in 3, j, -8? 3 Let l = 177284/43 - 4124. What is the third smallest value in l, 1, -0.2? 1 Let l = -0.0746 - 3.9254. Let t be (10/(-25))/(1/5). What is the biggest value in l, t, 0? 0 Suppose -43x = 132 + 83. Let i be (2/(-5))/((-3)/(-15)). Which is the smallest value? (a) x (b) 0.03 (c) i a Let t = -8 - -6. Let q = 38 + -43. Which is the fourth biggest value? (a) t (b) 0.3 (c) -0.2 (d) q d Let x = -27.95 + 28.1. What is the biggest value in -5, 2, -0.01, x? 2 Let o = -14.1 + 14.159. Let i = o + -3.159. Let m = i - 0.9. Which is the second smallest value? (a) -0.3 (b) m (c) -2/5 c Let i = -6 + 6.05. Let y = i + -0.01. Let m = 228 + -226. What is the third biggest value in -0.5, y, m? -0.5 Let m be 4/8 - 140/(-8). Let w = m + -16. Which is the second biggest value? (a) 3/4 (b) w (c) -0.23 a Let o = 436 + -435. Which is the fourth biggest value? (a) -1/5 (b) o (c) -4 (d) -0.3 c Let h = 48.9 + -49.1. Let j = 0.4 - 0.3. Suppose 5 = -2w + 15. Which is the third smallest value? (a) h (b) j (c) w c Let u = -14.7 + 15.2. Let h = -1549/4850 + 17/50. Let m = 188/291 + h. Which is the biggest value? (a) -3 (b) m (c) u b Let y = -6 + -9. Let h = -10 - y. Let r = 0.39 + -0.09. What is the third biggest value in r, -0.1, h? -0.1 Let v = 0.18 + 14.82. Let f = -14.4 - -4.4. Let w = v + f. Which is the third smallest value? (a) 0.1 (b) w (c) 2/7 b Let w = 1.394 + -0.394. What is the biggest value in 15, w, 4? 15 Let q = 0.298 - -0.702. What is the smallest value in 0.1, q, -0.7? -0.7 Let w = -113 + 163. Let k be (w/15)/((-1)/(-12)). Let m be (16/k)/(1/10). What is the third biggest value in m, 5, -1/5? -1/5 Suppose -4z - 133 = 3r, 3z + 5r = -2z - 165. Which is the biggest value? (a) z (b) -3/2 (c) 1/6 c Let g = -3.03 + 6.03. Let z = -6.1 - -0.1. What is the third smallest value in z, g, 4? 4 Let y = -247 - -743/3. Let l = -0.1 + 0.4. Which is the third smallest value? (a) 2 (b) l (c) y a Let z(y) = -y + 2. Let k be z(5). Let h = 21 - -21. Let c be 4/(-16) - h/(-8). What is the second biggest value in k, 0, c? 0 Let m = -67 - -78.8. Let o = -12.4 + m. Which is the second biggest value? (a) 3 (b) 0 (c) o (d) -4 b Let y = -2.1 + 0.6. Let q = -2 - y. Let w = 14.57 + -12.57. Which is the third smallest value? (a) q (b) w (c) 0.2 b Let g = 4.9 + -4. Let r = g - 1. Let i = 0.8 - 1.3. What is the biggest value in r, -1/8, i? r Let f = 3701/4 + -925. Which is the smallest value? (a) 4 (b) 0.21 (c) 0 (d) f c Let k = 1280.5 + -1280. Which is the second smallest value? (a) k (b) -0.4 (c) 4 (d) -2/9 d Let k = 77.05 - 0.55. Let n = -77 + k. Which is the fourth biggest value? (a) -1.2 (b) 0.3 (c) 3 (d) n a Let z = 0.84 + 8.56. Let t = -9.39 + z. Let p = -1 + 4. Which is the biggest value? (a) t (b) p (c) 1 b Let n = -0.15 + 1.55. Let f = 0	{ "pile_set_name": "DM Mathematics" }
48))/(x/(-9)). Which is the second biggest value? (a) y (b) -4/5 (c) p b Let a be 10/(-8) + 1 + 0. What is the smallest value in -4, -0.3, a? -4 Let l = 4 + -3.7. Suppose -w - 3w = 0. Which is the third biggest value? (a) -2 (b) l (c) w a Let h = -30 + 43. Let x = 12.91 - h. Let c = x - 0.01. What is the second smallest value in 4, c, -4? c Let f = -23 - -49/2. Let p = 0 + 0.2. Which is the third smallest value? (a) -2 (b) f (c) p b Let a be (3 - 1) + (-96)/51. Let o = 223.3 + -223. What is the third smallest value in -0.5, a, o? o Let w be (-1)/3 - (-42)/(-9). Let n be (-23/(-8))/((-90)/(-16)). Which is the biggest value? (a) 1/9 (b) n (c) w b Let d = 5 - 10. Which is the smallest value? (a) 4 (b) d (c) -0.2 b Let n = -0.2 + 2.6. Let h = n + -2.9. Which is the third biggest value? (a) -0.3 (b) 4 (c) h c Let s = 0.568 + -0.028. Let i = s + -0.04. Let v = 0 + -0.4. What is the second biggest value in i, v, 5? i Let n = 0.07 + 5.93. Which is the second smallest value? (a) 3 (b) -2/15 (c) -4 (d) n b Let x = 3.9 + -4. Let l = -7 + 4. Which is the smallest value? (a) 0.4 (b) x (c) l c Let n(u) = u*2 + 3u + 1. Let y be n(-2). Let o be (14/(280/(-15)))/(6/(-16)). Suppose -4i - 1 = -5i. What is the smallest value in i, o, y? y Let x = 16 - 13. What is the biggest value in -0.4, 2/5, x? x Let o(c) = c - 3. Let b be o(6). Let p = 4 + -10. Let f be ((-5)/(-15))/((-1)/p). What is the second smallest value in -1/6, b, f? f Let n(u) = -3u3 + 31u*2 - 9u - 8. Let o be n(10). Let y = 11 + -7. Let d = -0.3 - 0.2. Which is the second biggest value? (a) o (b) d (c) y a Suppose 1 + 7 = -2l. Which is the smallest value? (a) -2/17 (b) -5 (c) l b Let h be (-4)/(-3)(-294)/(-28). Let q be -3 + (-7)/(h/(-4)). Which is the smallest value? (a) -5 (b) 1/5 (c) q a Let x = 527/5 - 105. Let d = -157 + 781/5. What is the third biggest value in x, 1, d? d Let r = 1.02 - 1.52. Which is the second biggest value? (a) 4 (b) r (c) -2 b Let a = -12 + 12. What is the smallest value in 4, -5, a? -5 Let f = 418/5 + -84. Let g = -2.06 + 2. Let b = -1.94 + g. What is the second smallest value in b, f, -3? b Let n = -0.06 - -0.06. Let h = 0.5 - n. Which is the second biggest value? (a) -0.4 (b) h (c) 1 b Let u = 719 + -10771/15. Let j = u + -11/10. Let t = 0.02 - 0.42. Which is the second smallest value? (a) t (b) j (c) -2 a Let d(g) = -2g2 + 11g + 17. Let y be d(7). Which is the third biggest value? (a) -2/7 (b) -0.068 (c) y c Let y(d) = 4d3 - 2d*2 - 4d - 3. Let m be y(-1). Which is the biggest value? (a) 4 (b) -0.2 (c) m a Let s = 0.57 - -3.43. What is the third smallest value in -2/3, 1/2, s? s Let b be (0 + (-3)/(-16))-4. Let f = 11 - 11. What is the third biggest value in f, -2/5, b? b Let u = 2.4 - 0.4. Let r = u + -3. Let x(t) = -t - 1. Let y be x(4). Which is the third biggest value? (a) y (b) 5 (c) r a Let t = 0.247 - 0.047. Which is the third biggest value? (a) 3/4 (b) t (c) -4 (d) -0.4 d Let f = -21 + 16. Which is the second biggest value? (a) -0.2 (b) -4 (c) f b Let c = -11 - -14. Let h(n) = n2 - 5n - 6. Let z be h(6). Let f = 4.01 + -0.01. What is the smallest value in z, c, f? z Let m = 136 + -132. Let p = -0.6 - -0.2. Let q = 1 - 1. Which is the third smallest value? (a) m (b) p (c) q a Let m = -5.3 + 1.3. What is the smallest value in -2, 3, m? m Let n = 11.5 + -11.5. Let o = -0.6 - -1. What is the third biggest value in 0.1, n, o? n Let y = 5 + -4.7. Let o = y + -0.4. Let p be (-2)/6 + (-11)/(-33). Which is the smallest value? (a) o (b) p (c) 4 a Let l = 0 - 0.2. Let r = l - -0.4. Let s = 55/144 - 1/144. What is the second biggest value in 0.3, s, r? 0.3 Let t be 32/30 + 14/(-21). Suppose -3d = -3m - 12, -2m + 5 = d + 16. What is the biggest value in m, 0.1, t? t Suppose 0 = -12f + 18 + 30. Let u = -12 + 11.93. What is the third biggest value in u, f, 5? u Let v = 0.27 - 0.27. Which is the third smallest value? (a) -5 (b) v (c) 0.3 c Let u(o) = -o*3 + 6o*2 - 3o - 5. Let h be u(5). Let r = 3.7 + -3. Let p = 0.7 - r. Which is the third smallest value? (a) p (b) 0.5 (c) h c Let d be 46/(-36) + 4/(-18). Let v = -0.4 - 0.1. Which is the third biggest value? (a) d (b) v (c) -1/6 a Let y = 1.3 + 3.7. Let v(m) = -m + 7. Let f be v(7). Let k be 3 + -1 + f - 1. Which is the biggest value? (a) k (b) -0.4 (c) y c Let t = -3 - -4. Suppose -13 = -4h - t. Which is the third biggest value? (a) h (b) 5 (c) -0.4 c Let j = 8.9 - 9. What is the second smallest value in 0.2, 3/2, -0.03, j? -0.03 Let l be 6/7(-1 - (-15)/8). What is the third smallest value in 3, -1/4, l, 4/5? 4/5 Let h = -1.66 + -0.34. Which is the smallest value? (a) 2/11 (b) h (c) 0.4 (d) -4 d Let i(p) = -p + 11. Let o be i(9). Let s be (5/(-1085))/(o/(-4)). Let y = s - 233/1736. Which is the biggest value? (a) 0.4 (b) y (c) -1 a Let f = -17.6 - -18. Which is the smallest value? (a) 2 (b) f (c) -1/10 c Suppose 56 = -4y + 4p - 2p, -50 = 4y - 5p. Let b be (-12)/y + (-108)/110. What is the biggest value in 2/9, b, 3/5? 3/5 Let o = 2 - -3. Let m = -5.4 + o. Let z = 5.4 + m. What is the biggest value in 4, 0.4, z? z Suppose -3s - 40 = -8s. Let u be ((-3)/s)/((-18)/(-12)). Which is the third smallest value? (a) -1 (b) u (c) 0.1 c Let f be ((-27)/(-15) - 3) + 1. Let t = -9 + 6. Let u = t - -6. Which is the second smallest value? (a) u (b) f (c) 1/8 c Let t = 0.211 - 0.011. Which is the second biggest value? (a) t (b) -0.4 (c) 2/5 (d) -0.1 a Let w = -17 + 13. Let d = 77 - 387/5. Which is the biggest value? (a) d (b) w (c) -3/7 a Let b = 0.1 - -0.9. Let d = b - 2. Let y = d + -3. What is the third smallest value in y, 0.4, -0.1? 0.4 Let v be (-1)/(-2) + (-110)/20. Which is the third biggest value? (a) -17 (b) 5 (c) v a Let l = -1.97 + 2. Let g be (-1)/(4 - (-21)/(-9)). Which is the smallest value? (a) g (b) -1/11 (c) l a Let q = 71 - 351/5. Which is the smallest value? (a) 3 (b) q (c) 0.9 b Let t = 7 - 7.3. Which is the biggest value? (a) t (b) -1 (c) 3 c Let v = 10 + -7. What is the third biggest value in 6, 2, v, -2/7? 2 Let i be (1 + (-26)/28)288. Let p = i + -20. Suppose 4h - 16 = 0, -4s = -0h + 5h - 24. Which is the smallest value? (a) s (b) -3/2 (c) p b Let l(i) = -4i2 + 12i*2 - 1 + 0i - i*3 + 5 - 7i. Let j be l(7). Suppose 0 = jv - f + 7, 2v - f = 2f + 9. What is the smallest value in -5, -0.1, v? -5 Let f = -40 + 43.2. Let v = -3 + f. Let j = -0.2 + 0.1. What is the third biggest value in -2/9, v, j? -2/9 Let q = -43 - -43.5. Which is the third smallest value? (a) 5/4 (b) 4/7 (c) q a Let w = 18 + -11. Let z = 6.5 - w. What is the third smallest value in -0.1, -4/3, z? -0.1 Let g = -151 - -457/3. What is the fourth biggest value in 4, -0.3, g, 0.5? -0.3 Let k = -4.746 - -0.046. Let a = k - -5. Let h = a + 0.2. What is the third biggest value in -4, 3, h? -4 Suppose -5 = 2j - 1. Let y(d) = d*2 + 3d + 2. Let t be y(j). Let u = 3 + -4. Which is the biggest value? (a) u (b) t (c) -2/7 b Let m = 2/439 + -1774/3951. Which is the biggest value? (a) 3/5 (b) 0.5 (c) m (d) -5 a Let v = -1 - 2. Which is the third biggest value? (a) 2 (b) 0.05 (c) v c Let j(v) = -8v - 29. Let o be j(-3). Which is the third biggest value? (a) -0.3 (b) -2/7 (c) 2 (d) o a Let h = 22 - 40. Let l = h - -17. Suppose v + 20 = -3v. Which is the second biggest value? (a) l (b) -2/5 (c) v a Suppose 18 - 3 = 3s. Suppose -m = s, -19 = 3v + m + m. Which is the third biggest value? (a) -4 (b) v (c) -0.2 a Let n be (-3)/2(-22)/(-120). Let g = 1/8 - n. Which is the second biggest value? (a) -1/3 (b) -1/2 (c) g a Let z = 44 + -40. Let t = -0.3 - -0.4. Which is the smallest value? (a) -5 (b) t (c) z a Let f = 0.484 + 0.016. What is the second smallest value in 0.1, f, 5? f Let f = -5.04 + 0.04. Let d be 2/(-16)(-1 + 3). Which is the third biggest value? (a) d (b) f (c) -1/3 b Let o = 47 - 49. Which is the second biggest value? (a) 3 (b) o (c) 13 a Let n(x) = -x*3 + 2x*2 + 2x + 1. Let s be n(-1). Let h = 2 + -2.3. Which is the second smallest value? (a) h (b) s (c) 1/5 c Let t = -3.046 - -0.046. Which is the third biggest value? (a) t (b) -2/	{ "pile_set_name": "DM Mathematics" }
. Let k = i - w. Calculate the greatest common divisor of 70 and k. 14 Let r(i) = -i*3 - 9i*2 - 12i - 8. Let d be ((-3)/4)/(7/84). Let b be r(d). Suppose 0n + b = 2n. Calculate the highest common factor of 10 and n. 10 Suppose -2n + 7n + 1285 = 0. Let q = n - -154. Let d = -67 - q. What is the highest common divisor of d and 4? 4 Suppose 46 = z - v, 3z - 128 = v + 8. Suppose -d - z = -6d. What is the greatest common divisor of d and 1? 1 Suppose -2s + 10 = -0s + 4w, -5w + 17 = 4s. What is the highest common factor of 21 and s? 3 Let s be 174/8 - 1/(-4). Suppose -3g + m + 103 = 0, -g + 41 = -2m - 0m. Calculate the highest common divisor of g and s. 11 Let f be (-1)/(-3) + (-222)/(-9). Let m be 3 + -1 + f + 0. What is the highest common divisor of 18 and m? 9 Let a(x) = -x*2 - 22x + 21. Let w be a(-22). Suppose -3 = -3v - 0v - 2n, -3n = -5v + 24. Calculate the highest common factor of v and w. 3 Let c = -32 - -35. Suppose 0 = 3z - 31 - 62. Let l = -22 + z. Calculate the greatest common divisor of l and c. 3 Let v(w) = w*3 - 6w*2 - 2w + 5. Let j be v(7). Let t = -9 - -15. Let a = t + 4. Calculate the greatest common factor of a and j. 10 Suppose 0 = 4j - 2j - 12. Suppose -j = c + 2p, -10 = -0c + 2c + 3p. Let m be (-3)/6 + (-61)/c. What is the highest common factor of m and 10? 10 Suppose -2v - 4d + 368 = 0, 4v - 3d = -2d + 700. Let h be (-3 + 119/35)/((-2)/(-110)). Calculate the highest common factor of h and v. 22 Let i(a) = -a2 - 6a. Let d be i(-5). Let u be (8 - 58)2/(-5). What is the highest common factor of u and d? 5 Let c(k) = 9k2 - k - 1. Suppose -y - 6 = -5. Let v be c(y). Let x(n) = n2 - 4n + 15. Let j be x(6). Calculate the highest common divisor of j and v. 9 Suppose 4k = 2n + 4, -k = 2n - 5n - 11. Let a be (3 - 0)/(k/(-3)). Suppose -297 = -2p - p. Calculate the greatest common factor of p and a. 9 Let v(t) = 3t - 6. Let d(l) = l3 - 2l*2 - 2l - 2. Let w be d(5). Let y be (w/(-3))/(-3) - 1. Let z be v(y). What is the highest common factor of 12 and z? 12 Let i be ((-8)/10)/(4/(-50)). Let o = -267 + 272. Calculate the greatest common factor of i and o. 5 Suppose a = 6a + 100. Let i = -6 - -7. Let s be ((-72)/a)/(i/55). Calculate the highest common divisor of 18 and s. 18 Suppose 0 = -2l + 5 + 7. Suppose -i + li = 10. Suppose 0 = 3p + ik - 7k - 49, -69 = -5p + 2k. Calculate the greatest common divisor of p and 91. 13 Let a = -117 + 143. What is the greatest common divisor of 65 and a? 13 Suppose w = 5q - 13, 5w - 49 = 5q - 14. Suppose 5j = 4j - 13. Let v(p) = p2 + 10p + 9. Let r be v(j). What is the greatest common divisor of r and w? 12 Suppose -k + j + 10 = -6, -2k = -3j - 37. Let f = 121 + k. Calculate the highest common factor of 12 and f. 12 Let q(w) be the third derivative of 89w5/60 + w3/6 + w2. Let s be q(-1). Let r = s - 27. What is the highest common divisor of 7 and r? 7 Suppose -3s + 104 = -2s. Let q(n) = 5n - 1. Let b be q(-3). Let a = 29 + b. Calculate the highest common divisor of s and a. 13 Let c be -3(0 + -3 - 5/3). What is the greatest common factor of 14 and c? 14 Let q = -48 - -51. Calculate the greatest common divisor of 39 and q. 3 Let r be 428/3 - (-12)/(-18). Suppose 3x = 4f + 94, 5f + r - 53 = 3x. Calculate the highest common factor of 95 and x. 19 Let m be (-1)/(-2 - (-21)/12). Suppose -3l + m = -11. Calculate the greatest common divisor of 20 and l. 5 Let x be (-2)/5 - 37/(-5). Let r be 6/(-21) - (-428)/28. Let m = 13 + r. What is the greatest common divisor of x and m? 7 Suppose -3l - 37 = -127. Calculate the highest common factor of 15 and l. 15 Let v(o) = o3 - 6o*2 - 10o - 9. Let h be v(8). Let b(c) = -c*3 + 4c*2 + 3c + 1. Let j be b(4). What is the highest common divisor of h and j? 13 Suppose 2h - 30 = -5p, -p + 9 = -h - 4. Let t = p + 9. What is the highest common factor of t and 17? 17 Let x = 92 + 12. Let f = -13 - -53. Let d = f - 27. Calculate the highest common divisor of x and d. 13 Let q(v) = 0 - 2v + 3 + 4 + 7v - v*2. Let g be q(5). What is the highest common divisor of 14 and g? 7 Let r be 21/2(-12)/(-9). Suppose 5n = 3n + r. Suppose -5g = -102 - 213. What is the greatest common divisor of n and g? 7 Suppose 7p = 5p + 418. What is the greatest common factor of p and 19? 19 Suppose 4m - 15 = 3p + 37, -12 = -2m - 2p. What is the highest common divisor of 5 and m? 5 Let h be (1 - (-1 + -1)) + -83. Let x = -48 - h. What is the greatest common divisor of 48 and x? 16 Let l(g) = g + 6. Let f be l(6). Calculate the highest common divisor of f and 132. 12 Let v(j) = -2j*2 + 60j + 28. Let g be v(30). What is the highest common factor of g and 42? 14 Let u(i) = i*2 + 8i + 12. Let l be u(-8). What is the highest common divisor of l and 96? 12 Suppose d = 5f - 219, 0 = -2f - 2d - d + 91. Calculate the greatest common divisor of f and 11. 11 Let h(x) be the third derivative of 3x4/8 + x3 - 2x2. Let o = 20 - 12. Let d be h(o). Calculate the highest common divisor of d and 13. 13 Suppose 18r - 11r = 35. Suppose -f + 3o + 3 = -4f, -2f + 2o = -10. Calculate the greatest common factor of r and f. 1 Suppose -11q + 8q + 189 = 0. What is the highest common factor of 18 and q? 9 Let y(a) = 2a*2 + 6a. Let q be y(-5). Let b be 6(-1)/(-2)5. Suppose -5i - b = -f - 0i, 3i = f - 13. Calculate the highest common factor of q and f. 10 Let l(x) = -x3 + 6x*2 + 16. Let s be l(6). What is the highest common divisor of s and 12? 4 Let i(r) = -299r. Let m be i(-2). Let n = -388 + m. What is the greatest common divisor of 30 and n? 30 Suppose 3s - 16 = 14. Let i = -8 + s. Suppose -ik + k = -24. What is the greatest common divisor of k and 3? 3 Let y = -12 - -5. Let v(w) = w*2 + w - 2. Let j be v(y). Suppose -5 = 2u - 3n, -3u - 4n + 9n = 10. What is the highest common divisor of u and j? 5 Let s be -2 + -1 + (5 - -1). Suppose 4o + 51 = 3x, -8o - 67 = -4x - so. Calculate the highest common divisor of x and 78. 13 Suppose -5d + 4p + 15 = 0, 2d - 3 = d + 4p. Let y = 6 - d. Calculate the highest common divisor of 21 and y. 3 Suppose 506 = 12t + 11t. Calculate the highest common factor of t and 2. 2 Suppose 0 = -5f - 3p + 21, -2p - 4 = -4p. Suppose 0 = -3j + f + 3. Let o = 6 - 4. Calculate the highest common factor of j and o. 2 Suppose 5n + 660 = -0o + 5o, -2o + 252 = -5n. What is the greatest common factor of 17 and o? 17 Suppose -12x + 5 = -127. What is the highest common factor of 55 and x? 11 Suppose t - 3 = 5j, 5j = -t - 4 - 3. Let c be 1 - (1 + (-1 - t)). Let r be (105 + c)4/8. Calculate the highest common factor of r and 13. 13 Suppose 0 = h + 4h - 20. Suppose -3n - 4w + 18 = -7w, -5w = -hn + 19. What is the highest common divisor of 55 and n? 11 Suppose -u + 5k = -68, 0 = 5u - 0k + 2k - 205. Calculate the highest common factor of 387 and u. 43 Suppose -g = -3d - 7, -2d = -4g + 2d + 4. Let r be g(-1)/21. Suppose -r + 7 = 2p. Calculate the highest common factor of p and 15. 3 Let i(n) = 2n - n + n + 1. Let u be i(1). Let v = 8 + -6. What is the greatest common divisor of v and u? 1 Let w = 156 - 146. What is the greatest common divisor of w and 290? 10 Suppose 0 = 2q + v - 53, 4q + 0q + 3v = 111. Calculate the greatest common divisor of q and 36. 12 Let v = 24 + 88. What is the greatest common divisor of v and 16? 16 Let y(a) = -6a*3 - 4a*2 - 3a - 2. Let g be y(-2). Let j = 30 + g. Let z = j - 12. What is the highest common divisor of z and 6? 6 Let u be 8(-2 - (-14)/4). Suppose 0s + 5q = s - 24, 4q = -u. Calculate the highest common divisor of 72 and s. 9 Let t be (-8)/(-28) - (-150)/14. Calculate the greatest common divisor of 11 and t. 11 Let i(o) = 4o2 + 7o*2 + 3 + 2o2 - o3 - 4o2 - 7o. Let y be i(6). Calculate the greatest common divisor of y and 46. 23 Suppose 0u = -5u + 45. Let f(z) = z + 7. Let m be f(2). What is the greatest common factor of m and u? 9 Let i be -18(4 - (-16)/(-3)). What is the greatest common divisor of i and 8? 8 Suppose 5t = -4z + 17, 7z - 4z - 9 = -3t. Suppose 2b - ts - 21 = b, -9 = 3*s. Calculate the highest common factor of b and 30. 6 Let u be ((-5)/(-2)	{ "pile_set_name": "DM Mathematics" }
/84k4 - 1/84k*6 + 0k + 0 - 2/105k5 + 0k*3. Factor j(x). -2x(x + 1)(5x - 1)/7 Suppose -4t - 21 = 3. Let b be 1/(2/4) + (t - -44). Solve -2n3 - 3n*5 + 46n2 + n5 - bn2 - 6n*4 + 4n = 0. -2, -1, 0, 1 Factor -10/11c3 - 86/11c*2 + 202/11c - 106/11. -2(c - 1)2(5c + 53)/11 Let i = -697/597 + 7367/4776. Let o = 18 + -71/4. Factor -o - ig - 1/8g2. -(g + 1)(g + 2)/8 Let w(a) be the third derivative of -a*6/280 - 3a*5/28 + 25a*4/14 + 2a*2 + 27a - 20. Factor w(j). -3j(j - 5)(j + 20)/7 Let k(s) = -s3 - 22s*2 + 41s - 168. Let t be k(-24). Let y be t/(-2) - 24/(-6). What is d in -6/13dy + 20/13d*3 - 8/13d*2 + 0 - 16/13d = 0? -2/3, 0, 2 Let v(x) = 11x2 + 83x + 930. Let y(z) = 8z2 + 84z + 920. Let a(j) = 2v(j) - 3y(j). Solve a(b) = 0 for b. -25, -18 Suppose -4h = 32, -96x + 91x - 4h = 12. Factor -4/7i2 + 0i + 2/7 + 0i3 + 2/7i*x. 2(i - 1)*2(i + 1)2/7 Let r(z) be the third derivative of z7/70 + 3z6/40 - 9z*5/4 + 77z*4/8 - 18z*3 + 4042z*2. Solve r(h) = 0. -9, 1, 4 Let z(o) be the second derivative of -19o10/6048 - o9/144 - o*8/672 + 239o*4/12 + 10o - 2. Let p(l) be the third derivative of z(l). Factor p(v). -5v3(v + 1)(19v + 2) What is a in 4a - 1/2a*4 - 15/2a*2 + 8 - 4a*3 = 0? -4, -1, 1 Let l = 16 - 0. Let a be (l/10)/(-2)-5. Find k, given that -k*3 + 0k*5 - 4k*5 + 9k*3 - ak = 0. -1, 0, 1 Let t(w) = 3w + 401. Let n(d) = -11d - 399. Let a(l) = 2n(l) + 3t(l). Let h be a(31). Factor 6bh + 48/5b + 24/5 + 6/5b3. 6(b + 1)(b + 2)2/5 Let w(l) be the second derivative of -2/11l*2 - 1/165l*6 - 3/22l*4 - 4l - 7/33l3 - 1/22l*5 + 1. Factor w(d). -2(d + 1)*3(d + 2)/11 Let b(o) = 74o + 150. Let v be b(-2). Solve -17h*2 - 8h*2 + 40h + 33hv - 4h2 = 0 for h. -10, 0 Determine w, given that w4 - 1053w2 + 22953w + 31695w3 - 87880 - 4870w - 31694w3 = 0. -40, 13 Let g(t) be the first derivative of 0t - 2/35t5 + 35 + 1/14t*4 + 0t*2 - 1/21t*6 + 2/21t*3. Factor g(m). -2m*2(m - 1)(m + 1)2/7 Let z be -19 - (-4 - -6) - 169747/(-7677). Find f, given that 0f - 4/9f2 - 2/9f*5 - zf*3 - 8/9f*4 + 0 = 0. -2, -1, 0 Let p(r) be the first derivative of 3r*2 - 12r - 1/4r3 - 66. Solve p(a) = 0 for a. 4 Let r(f) be the first derivative of -f8/168 - f7/105 + f6/60 + f5/30 - f2 - 10f + 13. Let i(d) be the second derivative of r(d). Factor i(n). -2n2(n - 1)(n + 1)2 Let h(m) be the third derivative of -m5/60 + 167m*4/24 - 83m*3/3 - 1950m*2. Let h(u) = 0. What is u? 1, 166 Let d be (-2 - (12/30 + -2))-60. Let w be 1 - (8/d + -1 + 1). Solve 4/3b + wb*2 - 2 = 0 for b. -3, 1 Let g = -644525/6 - -107421. Factor -gz*4 - 1/6z*3 - 10/3z + 0 + 8/3z2. -z(z - 2)*2(z + 5)/6 Let 105t2 + t3 + 5t*3 - 216 + 954t - 840t - 9t*3 = 0. Calculate t. -2, 1, 36 Solve 83/4a*2 - 169/4a + 1/4a3 + 85/4 = 0 for a. -85, 1 Let r be (-10)/(-85) + (-542)/(-17). Suppose 36 = -29g + rg. Factor 6p*2 + 3p*5 + gp*4 - 75p*3 + 0p + 90p3 + 0p. 3p2(p + 1)*2(p + 2) Solve -4040/3 + 3370v - 25/3v*2 = 0 for v. 2/5, 404 Let d(t) be the second derivative of -1/3t3 + t2 - 1/24t4 - 32t + 0 + 1/40t5. Factor d(n). (n - 2)(n - 1)(n + 2)/2 Let c be -1 + (-2)/6-57. Suppose -4m - f = -c - 3, 4f = 4. Factor -6r3 - r5 + 3r5 + rm + 3r. 3r(r - 1)2(r + 1)*2 Let d be 28264/24 + 51/(-3). Let k be 553/d - (-10)/(-105). What is p in k - 21/4p + 147/8p*2 = 0? 1/7 Let p be ((-50)/6 + 8)/(2/(-146)). Let l(x) be the first derivative of -px3 - 30 + x4 - 81x + 171x2. Factor l(o). (o - 9)2(4o - 1) Solve -204/7f + 3/7f*2 - 60 = 0. -2, 70 Let a = 2622267/10 - 1581031/6. Let j = 1279 + a. Let -6/5v*5 - jv*3 - 8/3v*4 + 12/5v*2 + 4/15 + 26/15v = 0. What is v? -1, -2/9, 1 Let n be 807/538 - (2 + -1 + -2). Let v(a) be the second derivative of 0a2 + 1/4a*5 + na*4 + a + 15/2a*3 + 0. Factor v(x). 5x(x + 3)2 Determine o, given that -18o*5 + 108716 + 56o*4 - 148o*3 + 124o*4 - 91o*2 - 108752 - 53o*2 + 166o = 0. -1, 1/3, 2/3, 1, 9 Let a(r) = -r*3 - 45r*2 - 434r + 2. Let f be a(-31). Factor 0 - 3/5jf + 3/5j. -3j(j - 1)/5 Let f = 17087/3666 - -7/1222. Suppose fb3 + 56b + 40/3 + 34b2 = 0. What is b? -5, -2, -2/7 Let p(c) be the first derivative of -c3 - 1098c*2 - 401868c + 193. Factor p(u). -3(u + 366)2 Let i be (-12)/27 - 5/(-126)-6206. Let z = i - -247. Suppose zs2 + 162/7 + 36/7s = 0. Calculate s. -9 Factor -86r - 2r + 1015 + 37r - 58r - 89r - r2. -(r - 5)(r + 203) Let w be 80605/(-1645) - 51/(-1). Factor 75/2 + 9/2lw + 114l. 3(l + 25)(3l + 1)/2 Let h(w) be the second derivative of -w6/540 + 11w*5/180 - 2w*4/3 - 149w*3/6 + 77w. Let i(l) be the second derivative of h(l). Factor i(z). -2(z - 8)(z - 3)/3 Let q(g) = g*2 - 17. Let y(z) = 7z*2 - 160z + 214. Let n(j) = 6q(j) - y(j). Determine k so that n(k) = 0. 2, 158 Let j(m) = 2m*2 - 72m - m*2 - 7 + 37m + 3 + 34m. Let z(v) = -20v*2 - 25v + 225. Let x(l) = 25j(l) + z(l). Suppose x(q) = 0. Calculate q. 5 Let d(c) be the first derivative of -c3/3 + 39c*2 - 1521c + 2812. Factor d(f). -(f - 39)2 Let j(g) = g3 + 90g2 - 96g - 455. Let i be j(-91). Let m(a) be the first derivative of 9 - 2/27a3 + ia*2 + 8/9a. Factor m(o). -2(o - 2)(o + 2)/9 Let r = 10792/68965 + -14/5305. Let -3034/13m + 6724/13 - 160/13m*2 - rm3 = 0. What is m? -41, 2 Let x(i) be the first derivative of -i5/25 - 7i4/10 - 44i*3/15 - 4i2 - 1278. Let x(g) = 0. What is g? -10, -2, 0 Let g(h) = h4 - 3h3 - 2h*2 + h + 1. Let i(u) = 4u*4 + 23u*3 - 83u*2 + 41u + 5. Let k(j) = 10g(j) - 2i(j). Let k(q) = 0. Calculate q. 0, 1, 36 Let y be ((-172)/(-12))/((-2)/5988-2). Factor 3g*2 - 21460g*4 - 18g + 18g2 + yg*4. -3g(g - 2)(g - 1)(g + 3) Let i(b) be the second derivative of 17/3b*3 - 7/6b*4 - 2 - 130b - 9b2 - 1/10b*5. Determine f, given that i(f) = 0. -9, 1 Let s be (-8)/(-14) - 3850/1078 - (-34)/162. Let -sj3 + 0j - 1/4j5 - j4 + 0 - 1/2j*2 = 0. What is j? -2, -1, 0 Let t(d) = -3d*3 + 948d*2 + 1867d + 930. Let v(h) = 23h3 - 6642h*2 - 13068h - 6508. Let p(r) = 30t(r) + 4v(r). Let p(y) = 0. What is y? -934, -1 Find x such that -940/13x + 118/13x*2 - 32/13 = 0. -2/59, 8 Let f(w) be the second derivative of 0 + 1/10w*6 + 3/20w*5 + 0w*2 - 200w - 9/2w3 - 9/4w*4. Let f(q) = 0. What is q? -3, -1, 0, 3 Solve 8 + 2z*5 - 10z*2 - 2z*3 - 8z*3 - 81146z*4 + 8z + 81148z4 = 0 for z. -2, -1, 1, 2 Suppose -2o - 4f + 4 = 0, -o - 3f = -0f - 4. Let h be 1 + o - 11/(-11). Let h - 5/2l2 + l = 0. What is l? 0, 2/5 What is x in -215 - x2 + 2x2 - 579x + 2x2 + 215 = 0? 0, 193 Let s(j) be the first derivative of -3j*5/5 + 33j*4/2 - 140j*3 + 327j*2 - 297j - 1335. Let s(u) = 0. Calculate u. 1, 9, 11 Suppose 4v + 5z + 5 = -12, -3v = z - 1. Let a = 33 - 31. Factor -47ga - g3 + 10g - 10g - g*4 + 53gv. -g2(g - 2)(g + 3) Let y = -7/162 - -527/4698. Let z = y - -222/145. Factor -6a2 + 9/5a*3 + 28/5a - z. (a - 2)(3a - 2)*2/5 Factor 22179461m*3 + 3m2 + m2 - 22179457m3 - 48m. 4m(m - 3)(m + 4) Let o be ((-1)/1)/(3/(-12) - 0/23). Let f(k) be the second derivative of -1/24k*6 - 1/4k*5 - 37k - 25/48ko - 5/12k*3 + 0k*2 + 0. Factor f(u). -5u(u + 1)2(u + 2)/4 Let v(g) be the first derivative of g7/210 + g6/6 - 7g5/20 + 5g*2 + 12g - 210. Let o(s) be the second derivative of v(s). Find y such that o(y) = 0. -21, 0, 1 Let q be -5 + 8 - (0 - 1)/1. Determine p, given that 144p + 24p*3 + 28p*3 + qp*4 + 1609p*2 - 1417p*2 = 0. -6, -1, 0 Let k(h) be the third derivative of 3h*7/385 - 19h*6/330 + 14h5/165 + h4/6 - 7h3/11 + 2h*2 + h + 2. Solve k(q) = 0 for q. -7/9, 1, 3 Let t(q) = 4q*3 + 26q*2 - 340q - 2109. Let y be t(-6). Let 281216/7 - 2/7gy - 16224/7g + 312/7g2 = 0. Calculate g. 52 Let 115 + 34 - 200g - 31 + 8g3 + 10g2 - g4 + 96 + 161 = 0. What is g? -5, 3, 5 Let d(u) = -6u2 + 247u + 273. Let a(n) = -3n2 + 124	{ "pile_set_name": "DM Mathematics" }
4 = 5v. Let q(r) = r - 2. Determine sp(m) + vq(m). m Let k(x) = -299x*3 - 6x2 + 6. Let r(a) = -a3 + a*2 - 1. Determine -k(p) - 6r(p). 305p3 Let i be (2 + 1)/(15/10). Suppose -4 = 6t + i. Let w(h) = 2h - 4. Let m(r) = 1. Determine tw(u) - 4m(u). -2u Let w(r) be the third derivative of 1/6r3 - 9r*2 + 0r + 0. Let j(h) be the second derivative of h5/20 - h2 + h. What is 2j(v) + 4w(v)? 2v3 Let n = -179 - -180. Let d(o) = 5o*2 - 3o + 4. Suppose -t = 2t - 9. Let b(r) = -r2 + r - 1. Determine nd(v) + tb(v). 2v*2 + 1 Let g(o) = -2o - 5. Suppose -3m - 2b = 0, -5b = -2m - 0b + 19. Suppose -ml - 10 + 0 = 0. Let s(f) = 2f + 4. Give lg(h) - 6s(h). -2h + 1 Let k(p) = -1. Let l(n) = -2. Let f(q) = -5k(q) + 3l(q). Let i(t) = 2t - 3. Let j(o) = -o - 2. Let y be j(-3). Give yf(h) - i(h). -2h + 2 Let x(p) = -3p3 + p2 + 5p - 13. Let a(q) = -6q*3 + 2q*2 + 9q - 24. What is -3a(u) + 5x(u)? 3u3 - u2 - 2u + 7 Let h be 3(-10)/(-15) + 0. Let u(d) = -3d*2 + 2d - 3. Let k(y) = -12y2 + 9y - 13. Give hk(x) - 9u(x). 3x2 + 1 Let k(a) = 3a*2 - 69a - 4. Let l(r) = -8r2 + 208r + 10. Calculate -11k(h) - 4l(h). -h*2 - 73h + 4 Let p(s) = -6s + 178. Let b(i) = -i + 4. What is 10b(a) - 2p(a)? 2a - 316 Suppose 5a - 39 = -44. Let x(l) = l2 + l. Let u(k) = 5k*2 + 5k*2 + 6k + 0k. Determine au(z) + 6x(z). -4z*2 Suppose 20 = 2l + 3l. Let v(j) = 3. Let o(d) = -d + 17. Let p(z) = -o(z) + 6v(z). Let n(a) = -a - 4. Let s be (-1)/(2/(-1 - 1)). Calculate lp(h) + sn(h). 3h Let i(s) = -22s*3 - 14s*2 + 71s - 8. Let h(u) = 8u3 + 5u*2 - 24u + 3. Calculate 8h(v) + 3i(v). -2v3 - 2v*2 + 21v Let a(c) = -5c + 6. Let k(l) = -6l + 7. Let z(o) = -o*2 - 14o - 7. Suppose -d + 2d + 27 = -2q, -4d = -4. Let m be z(q). Determine ma(j) + 6k(j). -j Let x(p) = -p2 + 2. Let g(a) = 3a2 - 4. Let r(c) = -c2 + 9c - 21. Let m be r(6). Calculate mg(f) - 7x(f). -2f*2 - 2 Let i(b) = -15b + 15. Let h(n) = 2n - 2. Let d(f) = -25h(f) - 3i(f). Suppose 3p - 2p + 7 = 4a, a - 13 = 4p. Let x(t) = -2t + 2. Give pd(m) + 7x(m). m - 1 Let o(y) = y3 + y2. Suppose 4q = -2a - a + 14, 3q - 21 = 3a. Let b(z) = -3 + 2 - 3z2 - 3z*3 - 1. What is ao(k) - b(k)? k3 + k2 + 2 Let o(l) = 1. Let v(h) = -8h - 4. Let n = 178 + -177. What is nv(q) + 4o(q)? -8q Let v(j) = j*2 + 4j - 4. Suppose 4q - 32 = -48. Let b(h) be the first derivative of h3/3 + 3h*2/2 - 3h + 9. Calculate qb(k) + 3v(k). -k*2 Let o(w) = 2w - 3. Let p(d) = 2d - 4. Let j be 30/2560/9. Let s be (j/6)/(22/(-33)). Give sp(x) + 3o(x). 2x - 1 Let l(j) = -2j*2 + 26j + 6. Let w(x) = x*2 - 13x - 3. Give 4l(k) + 9w(k). k*2 - 13k - 3 Let q(b) = 3b2 + 3b + 64. Let t(c) = -14c2 - 13c - 255. Give -18q(d) - 4t(d). 2d2 - 2d - 132 Let v(u) = u*3 + 11u*2 + 4u + 2. Let a(j) = 5j3 + 44j*2 + 18j + 9. What is 4a(l) - 18v(l)? 2l3 - 22l*2 Let q(r) = -2r - 6. Suppose -3u = 2 + 1. Let g = 2 - u. Let v(t) be the third derivative of -t4/24 - 5t*3/6 + 2t*2 - 17t. Give gq(c) - 4v(c). -2c + 2 Let s = -29 + -9. Let p = s + 27. Let z(f) = 5f*2 + 10f + 11. Let j(w) = -w*2 - 2w - 2. Give pj(x) - 2z(x). x*2 + 2x Let h(n) = -n. Let p(t) = -t*2 - 4t. Let g = 479 + -493. Determine gh(v) + 2p(v). -2v2 + 6v Let k(x) = x. Let w = 282 - 276. Let j(s) = 4s. Give wj(b) - 21k(b). 3b Let h(d) = d + 3. Let q(g) = -3g + 20. Determine -4h(r) + q(r). -7r + 8 Let i(z) = -z2 - z. Let q(s) = 3s - 32. Let r be q(-7). Let g = r + 47. Let c(a) = 5a2 + 7a - 2. What is gi(v) - c(v)? v2 - v + 2 Let h(m) = -8215m*2. Let a(b) = 4b*2. Calculate 6360a(f) + 3h(f). 795f*2 Let o(f) = -2f. Let w(s) = -7s + 127. Determine 3o(h) - w(h). h - 127 Let r(v) = -7v - 8. Let h(t) = 12t + 15. Give -4h(y) - 7r(y). y - 4 Let q(w) = w*3 - 17w*2 + 2w + 2. Let r(d) = -2d3 + 18d*2 - 2d - 3. Calculate 6q(f) + 4r(f). -2f3 - 30f*2 + 4f Let m(r) = 249r - 496r + 244r + 3. Let c(d) = -4d + 3. Calculate -4c(t) + 5m(t). t + 3 Let c(q) = 4q + 334. Let x(r) = 5r + 336. Determine -7c(t) + 6x(t). 2t - 322 Suppose 0 = -r - 2r + 15. Let u(z) be the third derivative of -z6/60 - z5/10 + z*4/12 + 121z*2. Let p(y) = 2y*3 + 5y*2 - 2y. Give ru(f) + 6p(f). 2f3 - 2f Suppose 9n = 13 + 68. Let x(g) = 5g*2 - 2g. Let r(o) = -21o2 + 8o - 1. Determine nx(m) + 2r(m). 3m2 - 2m - 2 Let t be 3 + (1 - 1 - -1). Suppose 5 = -24g + 29g. Let c(h) = 6h3 - 2h - 4. Let z(u) = -u*3 + u + 1. Determine gc(j) + tz(j). 2j*3 + 2j Let n(o) be the third derivative of o4/12 + o3/2 + 27o2. Let x(f) = -13f - 17. Calculate 34n(k) + 6x(k). -10k Let c(v) = -v + 1. Let n(m) = -11m + 2. Suppose -583t + 573t - 10 = 0. What is tn(z) + 2c(z)? 9z Let m(c) be the first derivative of -5c*4 + 22c*3/3 - 22c - 220. Let k(g) = g3 - g2 + 1. Give 88k(t) + 4m(t). 8t3 Let u(q) = -q + 868. Let w(v) = 217. Give -2u(t) + 9w(t). 2t + 217 Let g(j) = 3j - 5. Let t(i) = 4i - 29. Let m be (30/(-12))/((-1)/(-2)). Let d(q) = -2 - 12 - 5 + 3q. Let v(w) = mt(w) + 8d(w). Give 7g(p) - 5v(p). p Let y(z) = -4z*3 - 3z*2 + 2z - 1. Let s(h) = -17h3 - 13h*2 + 9h - 5. Let m(d) = 2d2 - 75d - 40. Let j be m(38). What is js(w) + 9y(w)? -2w3 - w2 + 1 Let t(d) = d2 + d + 1. Let w = 100 - 90. Suppose 11s + 1 = ws. Let i(x) = -x2 - x - 2. What is si(p) - 2t(p)? -p2 - p Let h(t) = -82t*3 + 5t - 2. Let w(n) = 41n3 - 3n + 1. Calculate 3h(z) + 5w(z). -41z3 - 1 Let f(j) = -1. Let m(h) = 131h + 6. Determine 6f(n) + m(n). 131n Let d(g) = -3g3 - 4g2 + g + 3. Suppose 0 = v + 48 - 50. Let n(y) = yv + 4y3 - 4y3 + y3 - 1. Determine -d(i) - 4n(i). -i3 - i + 1 Let o(s) = 28s - 79s - 2 + 27s + 23s. Let h(g) = g. Let d(t) = -t2 + 5t + 1. Let w be d(5). What is wo(j) + 4h(j)? 3j - 2 Let d(l) = -16l*2 + 11l + 2. Let j(f) = -24f2 + 18f + 3. What is -8d(a) + 5j(a)? 8a2 + 2a - 1 Let c(q) = -3q2 + 29q + 14. Let r(p) = -6p2 - 3p - 5. Let n(y) = -5y2 - 4y - 5. Let u(h) = 7n(h) - 6r(h). Determine -6c(f) - 17u(f). f*2 - 4f + 1 Let f(s) = -s*2 - s + 1. Let w = 40 - 22. Suppose 3a + 3a - w = 0. Let h(l) = -2 - 2 - 4l*2 + 8 + 0 - al. What is -5f(v) + h(v)? v2 + 2v - 1 Let q(v) = 15v2 + 3. Let i(c) = 14c*2 + c + 4. Give 3i(n) - 4q(n). -18n*2 + 3n Let m(a) = 5a2 - 32a + 2. Let i(r) = 2r2 - 11r + 1. Give -8i(w) + 3m(w). -w*2 - 8w - 2 Let c(j) = -j*3 - 5j*2 + 26j + 12. Let u be c(-8). Let m(z) = z*2 - z + 1. Let t(y) = 8y*2 - 4y + 3. Determine um(b) + t(b). 4b*2 - 1 Let w(r) = 8r*2 + 12r - 4. Let y(p) = p*2 + p + 1. Determine -w(x) + 12y(x). 4x2 + 16 Suppose 3u + u = -20. Let o(j) = -4j - 37j*2 + 56j*2 + 2j*3 + 9j - j*3 - 22j2. Let k(n) = -n3 + 2n2 - 3n. Give uk(w) - 3o(w). 2w3 - w2 Let v(z) = -z3 - 3z*2 - 4z - 3. Let d be v(-2). Let m(q) = -13q - 1. Let f(c) = -c. Let r(j) = 8f(j) - m(j). Let g(o) = -o. Give dr(s) + 6g(s). -s + 1 Let n(u) = -u - 2. Let g(j) = -3 - 9j + 17j + 2 - 10j - 2. Determine -4g(i) + 5n(i). 3i + 2 Let s(l) = 3l + 27. Let g(t) = -4t - 26. Determine 5g(y) + 6s(y). -2y + 32 Let u(h) = -119h*2 + 33h - 25. Let c(m) = 24m2 - 6m + 5. Calculate -11c(a) - 2u(a). -26a2 - 5 Let j(r) = 8r + 3. Suppose -28h - 292 - 16 = 0. Let l(z) = -23z - 9. Calculate hj(w) - 4l(w). 4w + 3 Let v(t) = 2t - 6. Let y(u) = -1. Suppose 1 - 21 = -5q. Let j = 97 + -95. Let d = j - 3. Calculate dv(h) + qy(h). -2h + 2 Let u(c) = -16c - 5. Let w(y) = -3y - 1. Let r(m) = 2u(m) - 11w(m). Let x(a) = 2a2 - 6a + 2. Determine 6r(t) + x(t). 2t*2 + 8 Suppose 5 = 3w - 8w. Let v(r) = r - 2. Let c(z) be the third derivative of -z3/6 + 6z*2 + 2. What is wv(a) + 5c(a)? -a - 3 Let k(u) = -237u + 7. Let b(y) = -238y + 8. Determine -6b(m) + 7k(m). -231m + 1 Let t(l) = -390l - 2. Let n(q) = 1562q + 9. Give 2n(w) + 9t(w). -386w Let x be -4 + (3/(-12))/((-11)/88). Let l(s) = 10s - 26. Let u(p) = 2p - 5. What is xl(g) + 11u(g)? 2g - 3 Let s be -	{ "pile_set_name": "DM Mathematics" }
+ 1 - 4z2 - 2z*2 - 3z*2 as d + pz*2 + yz and give d. 1 Express (1 - 3 + 3 + (2 - 9 + 2)(-2 + 1 + 3))(61m - 2 - 101m + 64m) as r + im and give i. -216 Express 62r - 49 + 27 + 22 in the form mr + p and give m. 62 Rearrange 318q3 - 316q*3 + 6q - 4q + 16q*2 + 24q*2 to the form jq + c + vq2 + kq*3 and give v. 40 Express 4v*2 - 8v*2 + 3v*2 - 2v*2 + 3v*2 - 2v*2 + (-v - 1 + 1)(-3v - 3v + 4v) + (-1 + v + 1)(-6v - v + 2v) as nv2 + ov + p and give n. -5 Rearrange -5n - 3n*4 + 5n + 14n4 - 8n*2 + 8n*2 + (-3n2 - n4 + 3n2)(-1 + 5 - 5) to l + gn + un*2 + wn*4 + qn*3 and give w. 12 Rearrange -145f*2 - 32f*2 + 1207f*2 to the form af + j + of2 and give o. 1030 Express 14m + 13m - 36m + 14m + 14 - 4 as rm + g and give g. 10 Rearrange 64z - 130z*2 - 137z*2 + 266z*2 to tz + bz2 + l and give t. 64 Rearrange -15169h*3 + 15195h*3 + 5h*2 - 4h + 4h to xh + q + dh3 + oh*2 and give o. 5 Express 440n*4 - 430n*4 + n + 2n*2 + 0n + n*3 + 0n*3 + 2n as on2 + vn*3 + an*4 + b + kn and give v. 1 Rearrange 0y2 + y2 - 17y + 23y - 33y to the form iy + g + py*2 and give p. 1 Express -5u*2 - 31u*4 + 2 - 42u*4 + 72u*4 - u in the form a + vu*4 + hu*2 + xu*3 + zu and give z. -1 Express 2f4 + 13f*3 - 11f - 2f2 + 18 - 14 - 15f*3 in the form rf + yf3 + tf*2 + of*4 + l and give y. -2 Express 2l*4 + 48l*2 + 114 - 119 - 48l*2 - l in the form cl*4 + j + sl*3 + yl + kl2 and give c. 2 Express (-418 + 925 - 239)(-4p2 + 4p2 - p2) + p*2 - 2 - 2 + 3 in the form sp + o + qp2 and give q. -267 Express (o2 - o2 + 4o*3)(2o - 3o - 3o)(-7 - 1 - 6) as g + jo3 + fo*2 + vo + co4 and give c. 224 Rearrange -399 + 7q*2 - 401 + 796 - 4q*2 to the form nq*2 + d + tq and give n. 3 Rearrange 93c2 - 46c*2 + 52c*2 to gc + f + kc2 and give k. 99 Rearrange 52j + 108j - 3 - 55j to qj + b and give b. -3 Rearrange (65 + 51 - 111 + 46)(-12b + 89 - 89) to the form pb + t and give p. -612 Express (-3w + 6w - w)(0 - 3 + 2)(-154 + 27 + 6) as n + aw and give a. 242 Rearrange 1829n + 560n - 555n + (-n + 0n + 2n)(3 - 1 - 3) to u + yn and give y. 1833 Rearrange -r*4 - 81 + 2r*4 + 2r*3 - 2r*2 + 164 - 90 to the form nr*4 + c + fr*3 + ur + kr2 and give c. -7 Rearrange (0w*4 + 3w*4 - 2w*4)(15 - 6 - 5 + (4 - 4 + 1)(5 - 4 - 3) + 0 + 0 + 1 - 6 - 6 + 2) to the form qw*4 + iw*2 + lw + mw3 + f and give i. 0 Rearrange (-3l*2 - 4l + 4l)(-20l + 12l + 25l) + (-4 - 5l + 4)(-3l*2 + 10l*2 - 3l*2) to the form xl*3 + tl + ul2 + a and give x. -71 Rearrange q + 5q*3 + 20 - 17 - 3q*3 - 4q*3 - 31q*4 to the form pq + vq3 + f + bq*4 + mq*2 and give v. -2 Express 8 + 13t + 6 - 3t3 - 20t in the form yt3 + ft + z + bt2 and give y. -3 Rearrange (-1 + 0 - 1)((0 - 4 + 3)(-25 + 25 - h) - 3h - 8 + 8 + 2h - 3h - h) to the form ih + v and give i. 8 Rearrange (74 - 136 - 302 - 342)(a*2 - 1 + 1) to ya*2 + xa + m and give y. -706 Express (-d + 2d + 0d - 7d + 2d + 2d + (0 + d + 0)(3 + 0 - 2))(-68d - 1170 + 1170) in the form ud + n + kd*2 and give k. 68 Rearrange 5i + 5 - 12i + 4i + 9i - 27 to the form h + yi and give y. 6 Rearrange 2k4 - 5k + 3k - 144k*3 - 9k*2 - 2 + 141k*3 to uk + qk4 + g + ak*3 + xk*2 and give g. -2 Express -2a*2 + 2a*3 - 441a*4 + 887a*4 - 1 - 467a*4 in the form oa*2 + da*3 + ra*4 + z + sa and give z. -1 Express 88 - 88 + 41l2 + 3l*2 - 2l*2 + 3l2 + l2 + 1 - 1 + (-2 + 2 + l)(-3l - l + 2l) - 4l*2 + 6l - 6l as zl*2 + gl + n and give z. 40 Rearrange 10z + 31z - 1 - 13z to the form vz + q and give q. -1 Rearrange 319l + 3 + 610l + 257l - 3 to the form pl + q and give p. 1186 Rearrange -92n3 - 66n*3 - 15n*3 + (-2n - 2n + 2n)(0n2 + n2 + n2) + n3 + n3 - n3 to un + dn*3 + pn*2 + m and give d. -176 Rearrange (-15423f - 56f3 + 15423f)(7f + 12 - 3 - 8) to z + if + hf*4 + df*2 + yf*3 and give h. -392 Rearrange -1 - 2b*3 - 2b - 3b3 - 218b*4 + 2b + b*2 + 8b*3 to the form tb*3 + r + nb + yb4 + ab*2 and give r. -1 Rearrange -298l*2 + 2308l*2 - 136l*2 to the form v + nl + dl2 and give d. 1874 Express (136w + 158w - 147w + 104w)(0w - w + 4 - 5) as cw*2 + z + kw and give k. -251 Rearrange 3923t2 + 56 + t3 - 5t*3 - 3921t*2 to st*2 + yt*3 + kt + b and give b. 56 Rearrange -150j + 67780 - 67780 to the form i + nj and give n. -150 Rearrange u*2 - 2 - 51u + 24u + u3 + 24u to y + au2 + mu + du3 and give a. 1 Rearrange 297v - 234v + 286v + 1 + 159v + 261v to the form hv + a and give a. 1 Rearrange (-9567r*2 + 34750r - 34750r - 4449r*2)(-2r2 + 0r*2 + 3r*2) to the form vr*4 + tr*3 + f + or*2 + yr and give v. -14016 Rearrange -5 + 6u3 + 2u*3 - 11389u*2 + 11390u*2 to the form du*2 + tu*3 + p + gu and give t. 8 Express (17 - 19 + 30)(1 + 1 - 4 - j + j + 4 - 4 + j - 2j + 0j - 2 - 2j + 2 + (-4j + 4j + 2j)(1 + 3 - 2) + 1 + 2j - 1) in the form uj + v and give u. 84 Rearrange -5b + 19b + 5b3 - 4b*3 - 1 + 0 to the form vb + p + yb2 + gb*3 and give p. -1 Rearrange 2f*3 - 10911f + 10908f + 42f*2 + 89f*2 to uf*2 + pf*3 + g + yf and give u. 131 Express 2v3 - 10v*4 + 15v*2 + 2v + 2 - 33v2 + 20v*2 in the form iv*4 + m + wv + tv3 + av*2 and give m. 2 Express -528q*2 - 1 + 513q*2 - 7 as d + jq*2 + nq and give d. -8 Express 15l2 + 79l*2 + 96l*2 + 75l*2 - 52l*2 as ol*2 + w + tl and give o. 213 Express (19 - 50 + 4j + 20 + (-5 - 1 + 4)(1 - 1 - 2j) + 4j + 0j - 3j)(3j - 5j - j) in the form l + vj + wj2 and give v. 33 Rearrange (-3h + 4h + 0h)(7 + 8 - 4) + 2334 - 58h - 2334 to the form x + fh and give f. -47 Rearrange (-1473 - 1356 + 2996)(v - 1 + 1) to the form s + zv and give z. 167 Rearrange 2 - 1 + 116n + 6 - 5 to m + yn and give m. 2 Express 4n - 88 + 46 - 168n4 + 39 - 4n + n*3 in the form xn*2 + qn + hn3 + tn4 + b and give t. -168 Express -a2 - 1 - a + 21a3 + 38a*3 + 76a*3 + 28a*3 + 2a*2 in the form l + va + ma2 + da*3 and give v. -1 Express 2d*2 - 6d - 3d3 - 117 + 60 + 2d + 56 as id + zd*2 + u + wd*3 and give z. 2 Express -2x2 + x2 + 3x2 + (-2x + 0 + 0)(2x - 4x + 4x) + 1414x - 18x*2 - 1414x as lx2 + px + u and give l. -20 Express (1 - 3 + 4 + (3 + 2 - 3)(-1 - 1 + 0))(2c2 - c2 - 8c*2) in the form kc + vc2 + y and give v. 14 Express 402w*2 + 120w2 + w2 in the form sw + jw2 + p and give j. 523 Express y2 - 2y2 + y + 3y*2 - 6y*2 + 6 + 0 as wy*2 + iy + x and give x. 6 Express (3 - 1 - 9g + 12g)(5g*3 - 2g*3 - 2g3) - g2 - 3g4 + 5g*4 + 5g*4 in the form wg*4 + qg*2 + yg*3 + v + jg and give y. 2 Express (-2 + 2 - 1)(9u - 5344 + 5344)(0u2 - u2 - 2u2) in the form vu*3 + x + pu + qu2 and give v. 27 Express (-3d - 1 + 3d + 9d)(-2 + 25 - 2)(-2d + 2 - d + 4d) as gd2 + r + kd and give g. 189 Rearrange (17m - 16m + 8 + 0)(0m*3 - 9m*3 + 2m*3) to the form ym*2 + nm + um3 + gm*4 + s and give g. -7 Express -7z2 + z2 + 2z2 + (-3 - 2z + 3)(-4 + z + 4) + 1 - 1 + 3z2 + 0 + 0 - z2 in the form iz2 + oz + y and give i. -4 Express 5 + 7n4 + n - 2n*3 + 2n*3 - 9n*4 as dn*2 + an + cn3 + f + sn*4 and give f. 5 Rearrange 0 - 82d - 5d3 + 169d - 3 - 85d to the form zd + gd2 + c + md*3 and give z. 2 Express -13v*3 - 8v*3 - 3v - 24v2 + 25v*2 as tv*2 + bv*3 + ov + c and give t. 1 Rearrange (0d2 - 2d*2 + 4d*2)(-2 + d + 2) + (5 - 5d - 5)(-d2 - d2 + d*2) to the form w + cd*3 + od*2 + zd and give c. 7 Express 2m - 7 - 2m + m - 65m3 - 3m + 5 - m*2 as qm*2 + im*3 + l + jm and give l. -2 Express 13356 + 6u - 13356 in the form pu + x and give p. 6 Express -279w + 550w + 14w2 - 267w - 2w3 in the form zw*3 + fw*2 + ow + p and give o. 4 Rearrange 2w2 + 2w*3 + 29w - 5w*	{ "pile_set_name": "DM Mathematics" }
is 1115 to the power of 1/3, to the nearest integer? 10 What is the third root of 7309 to the nearest integer? 19 What is 411 to the power of 1/2, to the nearest integer? 20 What is the seventh root of 744 to the nearest integer? 3 What is 20728 to the power of 1/3, to the nearest integer? 27 What is the seventh root of 2494 to the nearest integer? 3 What is 9940 to the power of 1/2, to the nearest integer? 100 What is 4621 to the power of 1/2, to the nearest integer? 68 What is the third root of 406 to the nearest integer? 7 What is the cube root of 121885 to the nearest integer? 50 What is the square root of 4914 to the nearest integer? 70 What is the fourth root of 23755 to the nearest integer? 12 What is 4030 to the power of 1/3, to the nearest integer? 16 What is 1531 to the power of 1/9, to the nearest integer? 2 What is 32506 to the power of 1/3, to the nearest integer? 32 What is the cube root of 98384 to the nearest integer? 46 What is 35649 to the power of 1/3, to the nearest integer? 33 What is 7850 to the power of 1/7, to the nearest integer? 4 What is 6489 to the power of 1/2, to the nearest integer? 81 What is the third root of 7822 to the nearest integer? 20 What is the fifth root of 355 to the nearest integer? 3 What is the cube root of 57897 to the nearest integer? 39 What is 82455 to the power of 1/3, to the nearest integer? 44 What is the fourth root of 37491 to the nearest integer? 14 What is the fourth root of 2240 to the nearest integer? 7 What is 4196 to the power of 1/2, to the nearest integer? 65 What is 71650 to the power of 1/2, to the nearest integer? 268 What is the seventh root of 30376 to the nearest integer? 4 What is the fourth root of 2854 to the nearest integer? 7 What is 592 to the power of 1/2, to the nearest integer? 24 What is 1167 to the power of 1/6, to the nearest integer? 3 What is 3278 to the power of 1/7, to the nearest integer? 3 What is the fourth root of 5861 to the nearest integer? 9 What is the cube root of 27018 to the nearest integer? 30 What is 1372 to the power of 1/2, to the nearest integer? 37 What is the square root of 41 to the nearest integer? 6 What is 53529 to the power of 1/10, to the nearest integer? 3 What is 19191 to the power of 1/3, to the nearest integer? 27 What is 2673 to the power of 1/8, to the nearest integer? 3 What is 642 to the power of 1/2, to the nearest integer? 25 What is 7818 to the power of 1/2, to the nearest integer? 88 What is the square root of 10955 to the nearest integer? 105 What is the cube root of 622 to the nearest integer? 9 What is 1516 to the power of 1/6, to the nearest integer? 3 What is the seventh root of 3886 to the nearest integer? 3 What is the square root of 6379 to the nearest integer? 80 What is the third root of 1607 to the nearest integer? 12 What is the fourth root of 26358 to the nearest integer? 13 What is 65274 to the power of 1/6, to the nearest integer? 6 What is the fourth root of 151196 to the nearest integer? 20 What is 19808 to the power of 1/2, to the nearest integer? 141 What is 1286 to the power of 1/4, to the nearest integer? 6 What is 2606 to the power of 1/7, to the nearest integer? 3 What is the square root of 1275 to the nearest integer? 36 What is 364 to the power of 1/2, to the nearest integer? 19 What is the third root of 4499 to the nearest integer? 17 What is the square root of 3429 to the nearest integer? 59 What is 2404 to the power of 1/3, to the nearest integer? 13 What is 566 to the power of 1/2, to the nearest integer? 24 What is 10050 to the power of 1/3, to the nearest integer? 22 What is the square root of 54 to the nearest integer? 7 What is 414 to the power of 1/2, to the nearest integer? 20 What is the cube root of 27894 to the nearest integer? 30 What is the eighth root of 284 to the nearest integer? 2 What is 839 to the power of 1/3, to the nearest integer? 9 What is the ninth root of 2015 to the nearest integer? 2 What is 706 to the power of 1/6, to the nearest integer? 3 What is 11971 to the power of 1/3, to the nearest integer? 23 What is the third root of 15391 to the nearest integer? 25 What is the cube root of 2986 to the nearest integer? 14 What is the seventh root of 10694 to the nearest integer? 4 What is 6733 to the power of 1/6, to the nearest integer? 4 What is the square root of 1627 to the nearest integer? 40 What is the third root of 16702 to the nearest integer? 26 What is the third root of 4486 to the nearest integer? 16 What is the square root of 195 to the nearest integer? 14 What is the cube root of 3694 to the nearest integer? 15 What is 144 to the power of 1/4, to the nearest integer? 3 What is 3066 to the power of 1/8, to the nearest integer? 3 What is the cube root of 16563 to the nearest integer? 25 What is the cube root of 7220 to the nearest integer? 19 What is the cube root of 1170 to the nearest integer? 11 What is the sixth root of 1593 to the nearest integer? 3 What is 3357 to the power of 1/2, to the nearest integer? 58 What is the eighth root of 11062 to the nearest integer? 3 What is the cube root of 1169 to the nearest integer? 11 What is 5659 to the power of 1/9, to the nearest integer? 3 What is the third root of 815 to the nearest integer? 9 What is the ninth root of 1226 to the nearest integer? 2 What is the eighth root of 23554 to the nearest integer? 4 What is 591 to the power of 1/3, to the nearest integer? 8 What is the third root of 7597 to the nearest integer? 20 What is the square root of 78 to the nearest integer? 9 What is the square root of 84606 to the nearest integer? 291 What is 5806 to the power of 1/6, to the nearest integer? 4 What is 61572 to the power of 1/3, to the nearest integer? 39 What is 18218 to the power of 1/5, to the nearest integer? 7 What is 1120 to the power of 1/7, to the nearest integer? 3 What is the square root of 20630 to the nearest integer? 144 What is 982 to the power of 1/2, to the nearest integer? 31 What is the eighth root of 30142 to the nearest integer? 4 What is the square root of 2946 to the nearest integer? 54 What is the square root of 651 to the nearest integer? 26 What is 7846 to the power of 1/2, to the nearest integer? 89 What is the sixth root of 1553 to the nearest integer? 3 What is 19647 to the power of 1/8, to the nearest integer? 3 What is the square root of 24028 to the nearest integer? 155 What is 6703 to the power of 1/7, to the nearest integer? 4 What is the ninth root of 63 to the nearest integer? 2 What is the fifth root of 7811 to the nearest integer? 6 What is the cube root of 7625 to the nearest integer? 20 What is the fifth root of 26216 to the nearest integer? 8 What is the fourth root of 4835 to the nearest integer? 8 What is the cube root of 33831 to the nearest integer? 32 What is the ninth root of 8753 to the nearest integer? 3 What is the third root of 2204 to the nearest integer? 13 What is the square root of 13708 to the nearest integer? 117 What is 1186 to the power of 1/3, to the nearest integer? 11 What is the sixth root of 2554 to the nearest integer? 4 What is the tenth root of 7024 to the nearest integer? 2 What is the third root of 98160 to the nearest integer? 46 What is 2063 to the power of 1/6, to the nearest integer? 4 What is the sixth root of 8203 to the nearest integer? 4 What is 24946 to the power of 1/2, to the nearest integer? 158 What is the third root of 2366 to the nearest integer? 13 What is the ninth root of 64428 to the nearest integer? 3 What is 12363 to the power of 1/3, to the nearest integer? 23 What is the sixth root of 85651 to the nearest integer? 7 What is the cube root of 375 to the nearest integer? 7 What is 1843 to the power of 1/3, to the nearest integer? 12 What is 38343 to the power of 1/10, to the nearest integer? 3 What is the third root of 24837 to the nearest integer? 29 What is the cube root of 3360 to the nearest integer? 15 What is the third root of 1414 to the nearest integer? 11 What is the sixth root of 5337 to the nearest integer? 4 What is 110518 to the power of 1/3, to the nearest integer? 48 What is the square root of 25856 to the nearest integer? 161 What is the cube root of 7918 to the nearest integer? 20 What is the cube root of 15	{ "pile_set_name": "DM Mathematics" }
et n(m) = 8k(m) + 8t(m). Let b(h) = -4h2. Determine n(b(z)). -736z*2 Let y(w) = -2w. Let o(v) = -8v - 3827. Let l(h) = 7h + 3818. Let c(z) = 6l(z) + 5o(z). Determine c(y(m)). -4m + 3773 Let g(p) = 80p + 25. Let r(m) = 13m + 4. Let s(t) = 4g(t) - 25r(t). Let u(n) = 4n + 1. Let c(f) = 18f + 6. Let h(b) = 2c(b) - 12u(b). What is h(s(v))? 60v Let v(u) = 3u2. Let x(m) = -353m + 5. Let g(p) = 28583p - 404. Let y(i) = 5g(i) + 404x(i). What is y(v(n))? 909n*2 Let w(n) = 119 - 12 + 8987n - 107. Let a(o) = -2o. What is w(a(f))? -17974f Let j(u) = -18u2 - 490u. Let c(g) = -674g. Give c(j(y)). 12132y*2 + 330260y Let k(r) = 209r + 66. Let j(x) = -47x - 15. Let c(b) = 22j(b) + 5k(b). Let f(h) = h*2 - 6h2 + h2. Determine f(c(o)). -484o2 Let i(q) be the third derivative of 61q5/20 - q3/3 + 6q2 + 101q + 2. Let j(l) = -l. Calculate j(i(z)). -183z2 + 2 Let p(w) = -19w - 4. Let z(y) = -201y - 59. Calculate z(p(s)). 3819s + 745 Let i(y) = -76542y. Let m(z) = -127z*2. Give m(i(s)). -744052076028s*2 Let x(i) = -36i*2 - 16i + 4. Let n(d) = d*2 + 4d - 1. Let o(l) = -20n(l) - 5x(l). Let b(w) = 3w. Calculate o(b(s)). 1440s*2 Let u(p) = -4p*2 - 2p. Let o(b) be the first derivative of -61b2/2 + 5527. Give o(u(q)). 244q*2 + 122q Let i(j) = 12j2. Suppose 26 = b + 9. Let l(s) = 3s*2 - 15s + 32s - bs. Give l(i(c)). 432c4 Let f(w) = -17w*2. Let m(h) be the first derivative of 11 + 1 + 2h*2 + 2 - 30. What is f(m(t))? -272t*2 Let r(u) be the first derivative of 3u*2/2 + 323. Let p(c) = 2c*2 + 48. Calculate r(p(y)). 6y2 + 144 Let v(u) be the second derivative of -u4/6 - 43u2/2 + 2u + 16. Let a(f) = 2f. Determine a(v(d)). -4d*2 - 86 Let z(h) = -3h*2. Let u(r) = 107r + 1. Let q(g) = 311883g + 2908. Let y(x) = -q(x) + 2908u(x). Calculate z(y(w)). -1585587w2 Let i(b) = -6b - 51. Let m(v) = v + 9. Let t(x) = -6i(x) - 34m(x). Let c(o) = -o*2 + 1017o. Give t(c(a)). -2a2 + 2034a Suppose 2q + 1 = -3a + 102, 0 = 3q - 3a - 129. Let t(y) = -37y + 51 - 51 - qy. Let j(i) = -i. What is j(t(u))? 83u Let m(h) = 20739h. Let z(n) = 21184n2. Calculate z(m(g)). 9111368067264g*2 Let f(n) = 292n. Let s(h) be the first derivative of 0h2 + 0h - 2/3h3 - 190. What is f(s(j))? -584j*2 Let j(u) = -30u*2 - 10u*2 + 32u*2. Let p(c) be the first derivative of -2c*3/3 + 5c - 2. Let f(b) be the first derivative of p(b). Determine j(f(g)). -128g2 Let o(f) = -2 - 7f + 2. Let s(r) = 6r2 + 10. Let i(g) = -7g*2 - 12. Let a be (6 - 9)/(2/4). Let x(w) = as(w) - 5i(w). Give x(o(j)). -49j*2 Let m(s) = -13s + 2. Let u(x) be the first derivative of -x*3/2 + 35x + 97. Let a(j) be the first derivative of u(j). Calculate a(m(f)). 39f - 6 Let f(r) = 4852146r. Let y(b) = 16b2. What is f(y(g))? 77634336g*2 Let i(j) = 13j. Suppose -164k + 161k + 6 = 0. Let g(d) = -44d2 + 28d*2 + 12d*k. Calculate i(g(s)). -52s*2 Let n(q) = -q. Let t(r) = 17r + 3292. Let w(u) = -6u - 1096. Let a(g) = -3t(g) - 8w(g). Calculate n(a(x)). 3x + 1108 Let j(z) = z*2. Let v(p) be the third derivative of 0p - 17 + 1/6p3 + p2 + 5/24p*4. What is j(v(r))? 25r*2 + 10r + 1 Suppose 5y + y - 30 = 0. Let r(j) = -7j - yj + 3j + 8j. Let o(s) = 1. Let b(z) = 19z - 57. Let x(g) = b(g) + 57o(g). Calculate x(r(h)). -19h Let p(j) = -36j - 46j - 27j + 108j. Let h(k) = 135k - 6. Give h(p(s)). -135s - 6 Let r(f) = -5481 - 4f + 5481. Let p(u) = -3u - 11u + u. Let i(t) = 2p(t) - 7r(t). Let g(n) = 5n. Give g(i(l)). 10l Let s = 2 + 18. Let u be (1 + s/(-8))/((-1)/6). Let l(w) = -7w - 6w - uw + 3w. Let f(o) = -2o. What is f(l(d))? 38d Let r(y) = 244y*2 - 30y. Let c(a) = 245a2. Determine r(c(w)). 14646100w*4 - 7350w*2 Let v(h) = -65h*2 - 9h. Let q(j) = -152j2 - 21j. Let b(w) = -3q(w) + 7v(w). Let k(l) = 5992l2. Calculate k(b(n)). 5992n*4 Let g(i) = 38i - 1. Let v(h) = -368087h + 2. Calculate v(g(p)). -13987306p + 368089 Let s(a) = 24a2 - 12. Let g(l) be the third derivative of l5/20 - 654l*2. What is s(g(i))? 216i*4 - 12 Let r(z) = 0z + 1 - z - 5 + 6. Let d(q) = 27q - 9q - 5 - 15q. Let c(n) = -2d(n) - 5r(n). Let f(u) = -8u. Give c(f(p)). 8p Let s(r) = 38r*2. Let d(p) = -2016p + 242. Let g be d(-9). Let z(f) = 18388f2 + 0 - gf*2 + 0. Give z(s(j)). 2888j*4 Let y = 7 + 1. Let n(l) = -4l + 7l + yl. Let a(k) = 5 - 33 + 65 - 2k - 37. Give a(n(g)). -22g Let t(u) = 31u - 8. Let j(w) = 54w - 14. Let b(x) = -4j(x) + 7t(x). Let a(h) = 776h2. Let n(o) = -o2. Let p(v) = -a(v) - 388n(v). Give p(b(g)). -388g2 Let r(v) = 2v*2. Let g(l) = -1002l*2 - 295l - 2. Calculate g(r(a)). -4008a4 - 590a*2 - 2 Let o(a) = -a. Let g(r) = 456r*2 - 6r - 5. Let z(w) = w*2 - w - 1. Let f(t) = -g(t) + 6z(t). What is f(o(x))? -450x2 - 1 Let s(n) = 34n. Let u(i) = -62i - 34. Let f(d) = 30d + 15. Let z(c) = 9f(c) + 4u(c). What is s(z(k))? 748k - 34 Let j(a) = 19a + 119. Let l(x) = 2x2 + 327x. Calculate j(l(c)). 38c2 + 6213c + 119 Let c(s) = -s*2. Let v(b) = 114b + 629b - 273b - 40b + 572b. Determine v(c(r)). -1002r2 Let t(d) = -14d - 1. Let g(c) be the third derivative of 0 + 0c3 + 206c*2 + 0c - 1/6c4. Determine g(t(h)). 56h + 4 Let m(k) = 29k2. Let a = 818 + -816. Let x(z) = -az*2 - 5 + 2 + 8 - 5. Calculate x(m(g)). -1682g*4 Let m(n) = -13n*2. Let r = -30 + 32. Suppose 5y - 130 = -w, 7y - ry - 5w - 100 = 0. Let p(o) = o2 + yo - 14o - 11o. Determine p(m(t)). 169t4 Let j(y) = 9y + 5. Let s(m) = -4m - 2. Suppose -7 = 5t - 17. Let b(w) = tj(w) + 5s(w). Let d(q) be the second derivative of q*3 - 18q. Calculate b(d(v)). -12v Let t(c) = 103c*2 - 28. Let w(z) = -243z*2 + 66. Let n(b) = 33t(b) + 14w(b). Let u(o) = -17o*2 - 6. What is u(n(m))? -153m4 - 6 Let x(h) be the second derivative of -h3/6 - 3h. Let o(q) be the first derivative of 5q3 - q2/2 + 146. Calculate x(o(y)). -15y2 + y Let c(x) = -x. Let o(f) be the second derivative of 0f*2 - 1/3f*4 + 0 - 21f - 4/3f3. What is o(c(v))? -4v*2 + 8v Let o(v) = -5 + 15v2 + 5. Let u(x) be the third derivative of -x5/5 + 60x*2 - 33. What is o(u(q))? 2160q*4 Let s(m) = -3m*2 + 198. Suppose -79k + 82k = -z + 1747, -k - 4z + 575 = 0. Let g(n) = kn + 583n - 1167n. Determine s(g(w)). -3w*2 + 198 Let w(y) = 1782y + 53. Let v(m) = 2m2 + 6. What is w(v(d))? 3564d*2 + 10745 Let n(v) = -49893v. Let m(c) = 789c. Give m(n(r)). -39365577r Let d(t) = 3t. Let v(x) = 29x + 8. Let q(u) = 29u + 10. Let s = 315 + -319. Let w(p) = sq(p) + 5v(p). Determine w(d(y)). 87y Let w(s) = 83s. Let i(q) be the first derivative of 2q*2 + 1714. Calculate i(w(j)). 332j Let y(n) = 8597874n2. Let l(d) = 35d*2. Give y(l(g)). 10532395650g*4 Let m(t) = -287t*2 + 424t*2 - 142t*2. Let x(n) = 2n - 8. What is x(m(p))? -10p2 - 8 Let s(t) = 4t. Let p(z) be the first derivative of -18z2 - 371. Determine s(p(v)). -144v Let v(m) be the first derivative of -m*2 + 2. Let r(a) = -17a - 322. Let p(x) = 50x + 943. Let u(h) = -14p(h) - 41r(h). What is u(v(j))? 6j Let g(b) = 161b + 1991. Let c(i) = -5i. Calculate g(c(a)). -805a + 1991 Let d(a) = -18a. Let r be 12/(81/4). Let o(u) = 14 - 14 + ru. What is o(d(g))? -108g Let w(r) = 3696306r + 1. Let a(o) = 4o. Give w(a(n)). 14785224n + 1 Let w(a) = -21a2 - 42. Let c(y) be the second derivative of -y4/4 + 3688y. Give w(c(l)). -189l4 - 42 Let n(i) = -904i*2. Let c(h) = 17h*2 - 11h - 55. Let o(w) = 3w2 - 2w - 10. Let u(f) = 2c(f) - 11o(f). Give n(u(z)). -904z4 Let b(n) = -9 + 174n - 84n - 87n. Let c(l) = 1. Let r(k) = 2b(k) + 18c(k). Let z(a) = 4a2. What is r(z(t))? 24t*2 Let n(j) = -12j*2 - 236j + 4. Let a(v) = -13v2 - 295v + 5. Let c(d) = -4a(d) + 5n(d). Let f(b) = 9b + 2. What is c(f(m))? -648m*2 - 288m - 32 Let b(p) = 40p + 1. Let r(h) = h2 - 19217h. Determine b(r(t)). 40t2 - 768680t + 1 Let o(r) = -2r + 2r + r*2. Let a be (4 + 2)/(-2) + 229. Let v(c) = ac - 97c - 104c. Calculate v(o(i)). 25i2 Let j(q) = 0q**2 - q + 6	{ "pile_set_name": "DM Mathematics" }
y is divided by q(7)? 18 Let d(o) = -o*2 + 4o + 4. Let w = 4 + 4. Suppose j - 4y = -w, 5j - y - 5 = 4y. Calculate the remainder when d(3) is divided by j. 3 Let a(v) be the first derivative of -v3/3 + 4v*2 + v - 5. Calculate the remainder when a(5) is divided by 10. 6 Let c = 9 + -6. Let s be (-34)/4 + c/6. Let f(y) = -5y + 1. What is the remainder when f(s) is divided by 11? 8 What is the remainder when 201 is divided by 4 + (-189)/(-7) + -1? 21 Let a be (22/87)/(10/(-40)). Let n = a + 159. Calculate the remainder when n is divided by 17. 14 Let l(u) = u + 3. Let c(a) = a3 - 3a*2 - a - 3. Let d be c(4). What is the remainder when (-188)/(-14) - d/21 is divided by l(4)? 6 Suppose -40 = 16o - 88. What is the remainder when 46 is divided by o? 1 Suppose 60 = -2t + 5t. Calculate the remainder when (-44)/8(-13 + -1) is divided by t. 17 Calculate the remainder when 109 is divided by 536/(-30) + 35. 22 Let g = -6 + 10. Calculate the remainder when 11 is divided by (g/6)/(3/18). 3 Let b(g) = g*2 - 2g - 10. Let u be b(5). Let r be -1 + 0/(-1) + u. Suppose -18 = -rh + 14. What is the remainder when 28 is divided by h? 4 Suppose 0 = 3u - 2x - 342, 3u - 4u + 4x = -104. What is the remainder when u is divided by 41? 34 Let p(z) = z*3 + 2z*2 - 4. Let a be p(-3). Let t(y) = -10y + 15. Let v be t(a). Let h = 207 - v. Calculate the remainder when h is divided by 16. 14 Suppose -l = -3l + 4u + 62, 5l + u = 188. Suppose t = 5x - 75, 4x + 3t - 25 = 16. Calculate the remainder when l is divided by x. 9 Suppose 0 = d + 167 - 200. What is the remainder when 113 is divided by d? 14 Suppose -86 - 399 = -5l - 2x, 5l - 460 = 3x. Let w = -3 - -8. Suppose -3r = -0n - wn + l, 5n = -3r + 65. What is the remainder when 62 is divided by n? 14 Suppose -5a + 15 = 0, 3a = 4c + 12 - 51. Calculate the remainder when 34 is divided by (-18/c)/((-2)/54). 16 Suppose -2b - b + 5z = -89, b - 2z = 31. Let r(s) = -9s3 - s2 + s + 1. Let d be r(-1). Calculate the remainder when -4 - (d/2 + -53) is divided by b. 22 Let l = 104 - 110. Calculate the remainder when 18 is divided by ((-8)/l)/((-14)/(-105)). 8 Suppose g - 16 = 3d + d, -64 = -4g + d. Let i = g + 35. What is the remainder when i is divided by 28? 23 Let z(i) = 28i + 5. Let u(l) = 55l + 10. Let k(c) = 3u(c) - 7z(c). Let g be k(-8). Let q = g - 171. What is the remainder when q is divided by 15? 12 Suppose -2f = -4f - 3u + 19, 63 = 4f + u. Let j(z) = -4z + 2z2 - 3 + 0z + z - 1. What is the remainder when f is divided by j(3)? 2 Suppose -2a + 80 = 2a. Suppose -59 = -5f - 4. Calculate the remainder when a is divided by f. 9 Let o(h) = 17h + 1. Suppose 0 = -3w + 75 + 15. What is the remainder when w is divided by o(1)? 12 Let v(m) = 2m - 17. Let n be v(21). Suppose -nx = -23x - 22. Suppose -2p + l = -13, -4l + 34 = 5p - 8l. What is the remainder when x is divided by p? 5 Suppose 15 = m + 2m + 3c, -2m + 2c = -10. Let b = 4 - -1. Suppose 0 = -bf - p + 9, mf + 2p + 3p - 5 = 0. What is the remainder when 5 is divided by f? 1 Let k(h) = -h + 40. Let j be k(25). Calculate the remainder when 1146/j - 3/(-5) is divided by 13. 12 Let f be (-4 - 0)/8-10. Suppose 2q + 2m = 46, -124 = -fq + 6m - 2m. Calculate the remainder when q is divided by 9. 6 Let u = 60 - 60. Suppose -o + 5 = u, -f - 12 = -5o + 2. Calculate the remainder when f is divided by 6. 5 Let h = -1343 - -1519. What is the remainder when h is divided by 27? 14 Suppose 0 = 4u + 4m - 31 - 161, -3m = 5u - 246. Calculate the remainder when 454 is divided by u. 46 Let k = 10 + -3. Let r(c) be the first derivative of c4/4 - 2c*3 - 3c*2 + 3c - 8. Calculate the remainder when r(k) is divided by 3. 1 Suppose -13 = -2f - 9. Suppose -2h + 5s = fh - 113, -2h + 4s = -64. What is the remainder when h is divided by 8? 6 Let z = -598 + 1087. What is the remainder when z is divided by 70? 69 Let z(b) = -2b + 2. Let v(w) = -2w + 5. Let f be v(2). Calculate the remainder when 48/9 + f/(-3) is divided by z(-1). 1 Suppose 3j = -2m + 282, -m = -3j - 56 - 85. Let k(n) = -2n*3 + 14n*2 - 7n - 6. What is the remainder when m is divided by k(6)? 21 Let l(g) = g*3 - 2g*2 - 2g + 32. Let a be l(0). Suppose am - 110 = 27m. Calculate the remainder when 63 is divided by m. 19 Let l = 10 - 13. Calculate the remainder when 1/3 + (-293)/l is divided by 20. 18 Let f(k) = -6k - 98. Calculate the remainder when 28 is divided by f(-20). 6 Suppose 2t - 16 = -18. Calculate the remainder when (12/(-10))/((-3 + t)/20) is divided by 4. 2 Let s(n) = -2n - 1. Let f(y) = y3 - 9y*2 + 23y + 7. Calculate the remainder when f(6) is divided by s(-3). 2 Suppose -2x + 3k + 22 = 0, -12 = -0k - 3k. What is the remainder when x is divided by 15? 2 Let n(u) = u*2 - 3u + 2. Let x be n(-5). Let b = -74 - 6. Let v = x - b. Calculate the remainder when v is divided by 31. 29 Suppose -3c + 1 + 29 = 0. What is the remainder when 35 is divided by c? 5 What is the remainder when 48 - (35/5 - 5) is divided by 8? 6 Let k(m) be the first derivative of m3/3 + 3m*2/2 + 3m - 3. Let j be k(-3). Suppose 0 = -jx + 16 + 2. Calculate the remainder when 17 is divided by x. 5 Let u = -1777 - -1783. What is the remainder when 328 is divided by u? 4 Let u = -14 - -13. Let f be (4 - 0) + (-2 - u). What is the remainder when (f - -1)37/4 is divided by 20? 17 Suppose 3b - 66 = -0b. Calculate the remainder when 65 is divided by b. 21 Let q = -12 + 16. Suppose qt + 90 = 5b, -3t + 36 = 4b + t. Calculate the remainder when 53 is divided by b. 11 Let u(q) = -3 - q*2 + 7 + 2q*2 - 3q. Calculate the remainder when 8/18 - (244/(-18) + 0) is divided by u(4). 6 Let u(b) = -12b. Let d be u(-3). Suppose -5s = -85 - 65. Let l = d - s. What is the remainder when 47 is divided by l? 5 Let l be 22/(12/9). Suppose -lm + 48 = m - 4j, -5j = -2m + 18. What is the remainder when m is divided by 8? 6 Suppose 0 = -3v - b + 781, -3v + 2b + 778 = -0v. Calculate the remainder when v is divided by 29. 28 Let x = 205 - 167. Calculate the remainder when x is divided by 11. 5 Let h be 233/7 - (4 - (-52)/(-14)). Let x = 53 - h. Calculate the remainder when 79 is divided by x. 19 Suppose -l = -c + 8, -4l - 17 - 9 = -3c. Suppose -5w = -cw - 24. Let o = 26 + w. Calculate the remainder when 4 is divided by o. 0 Calculate the remainder when 7 + 15/9339 is divided by 16. 12 Let m(t) = -26t3 + 13t + 25. Calculate the remainder when m(-2) is divided by 11. 9 Suppose -817 = -6g - 277. Suppose -30r + 36r = g. What is the remainder when 41 is divided by r? 11 Let v(d) = 29d - 218. What is the remainder when v(11) is divided by 13? 10 Let s(a) = 83a2 + 9a - 13. What is the remainder when s(2) is divided by 26? 25 Let a = 173 + 144. What is the remainder when a is divided by 106? 105 Let s = 335 - 316. Let x be ((-54)/(-8))/((-9)/(-24)). Suppose 4j - 2 - x = 0. What is the remainder when s is divided by j? 4 Let n = 637 + -600. What is the remainder when 57 is divided by n? 20 Suppose -164 = -3f - f. Let o = -18 + f. Let a(v) = v + 12. Calculate the remainder when o is divided by a(-6). 5 Suppose 200 = 3q - 4x, -q + 3x + 2x + 52 = 0. Calculate the remainder when q is divided by 38. 34 Let g(k) = -k*3 - 3k*2 + 4k + 8. Let x be g(-5). Let z = x - 54. Let c = 21 + z. Calculate the remainder when 19 is divided by c. 4 Suppose -3r = 2r + 825. Let m = -93 - r. What is the remainder when m is divided by 25? 22 Let f(z) = -z*3 - 3z*2 - 2z - 1. Let y be f(-3). Let k be 30/186/y. Suppose -kw = -4w + 48. Calculate the remainder when 46 is divided by w. 22 Calculate the remainder when (-4)/(-12) + 4717/159 is divided by 20. 10 Suppose -n + 5 - 1 = 0. Calculate the remainder when ((-6)/n)/(42/(-2492)) is divided by 13. 11 Calculate the remainder when 115 is divided by (-156)/(-273) - (-24)/7. 3 Let l = 74 + -34. Suppose 0y - l = -2y. Calculate the remainder when 5/(y/8) - -42 is divided by 15. 14 Suppose -164g - 147 = -185g. What is the remainder when 527 is divided by g? 2 Let r(l) = -l3 - 11l*2 - 12l + 12. Let q(n) = 6n - 1 - 8n - 2n + 9n**2. What is the remainder when q(4) is divided by r(-10)	{ "pile_set_name": "DM Mathematics" }
nator of 83(-6)/(-18)6/(-208) and 37/5? 520 Suppose 45y - 1251 = 48y. Calculate the common denominator of -2 + (-2)/228y and 51/8. 152 Suppose 6o - 84 = 3o + 3d, 4o - 152 = -4d. Calculate the least common multiple of o and 22. 66 Suppose m - 4i - 11 = 0, -2i = 2m - 5i - 22. Suppose z + 0 - 2 = 0. What is the least common multiple of m and ((z - 3) + 6)/1? 55 Calculate the smallest common multiple of (-96)/224 + (-2 - 5466/(-14)) and 14. 2716 Let b(i) = -100i3. Calculate the lowest common multiple of b(-1) and 10. 100 Let s = 12095879/60 + -810481/4. Let w = 1019 + s. Find the common denominator of -151/30 and w. 30 Let a(q) = -q2 + 14q - 19. Let b be a(8). Suppose 7j - b - 13 = 0. Calculate the smallest common multiple of j and 10. 30 Let z = 34 - 13. Suppose z = 7s - 6s. Calculate the least common multiple of s and 18. 126 Suppose 6v + 3k - 18 = v, -4v + 3k = -36. Let w = v - 2. Calculate the least common multiple of w and 5. 20 Let b = -2109 - -2124. Let n = -22055/6 + 3688. What is the common denominator of n and b? 6 Suppose -4m + 0w + w = -159, 5m + 2w = 189. Let p = 57 - m. What is the least common multiple of (-9)/(27/12) - -24 and p? 180 Let f = 27/4 + -449/60. What is the common denominator of f and 22/51? 255 Let k be ((-78)/1989)/((-1)/(762/20)). Let i = -10617/1360 + k. Find the common denominator of -73/24 and i. 48 Let m be (-4)/6 - (-5702)/(-1104). Let y = 25/46 - m. Find the common denominator of y and 12/10(-20)/22. 88 Let m = -21338 - -2496605/117. Calculate the common denominator of m and -13/18. 234 Let o be (2/8)/(-1) + 1314/(-24). Let r = -60 - o. What is the common denominator of r and (-2)/(-8) + 114/(-16)? 8 Suppose 2l - 92 = 5s, 3s - 4l + 48 = -l. Suppose -4x = -3n - 142, -158 = 7n - 4n + 4x. Find the common denominator of (-158)/(-16)s/n and 71/12. 60 Let n(g) = -g*2 + 15g + 55. Let d be n(18). Suppose 4z - 4p - 92 = 0, -2z - 3p + 20 = -d. What is the lowest common multiple of (36/14)/(1/7) and z? 18 Find the common denominator of -93/4 and (268/8)/(12069/54). 1788 Let u(s) = -s*3 + 16s*2 + 6s + 3. Calculate the least common multiple of 27 and u(16). 297 Suppose -l = -5y - 37, 4l = l - y + 47. Suppose -k + 3 + l = 0. Calculate the least common multiple of 8 and k. 40 Let z = 107785/4 - 25525. Let a = z + -1431. Find the common denominator of a and 5/2. 4 Let t = 21607 - 5790665/268. Let a = 231096833 + -309669772379/1340. Let o = t - a. What is the common denominator of -37/10 and o? 10 Let s be (1894/(-20))/(3 - (-51)/(-15)). Let a = s - 238. Calculate the common denominator of a and -43/10. 20 Let f(q) = 2q3 - 9q*2 - 11q + 37. Let w be f(10). Let o = w + -63721/62. Calculate the common denominator of 51/14 and o. 434 Find the common denominator of 59/90 and 0 - 1/(-1) - (-415)/(-300). 180 What is the common denominator of 32/5 and 15/((-75)/20) + 194/45? 45 Let t be 1 + 381/2. Suppose o + 3 - 1 = 0, 5o + t = j. Let y = 10 + 2. Calculate the lowest common multiple of y and j. 60 Let l(c) be the third derivative of c6/120 - c5/15 + c*4/24 + 2c*3/3 + 2c*2. Let q = 38 + -26. What is the lowest common multiple of q and l(4)? 24 Let c be -1(4 + 20/(-4)). Suppose c = 5l - 4. What is the common denominator of 89/4 and 38/8 - 3/l? 4 Let r = 37 - 35. Suppose rx - 3x - s = -5, -3x + 18 = 4s. What is the lowest common multiple of x and (-56)/(-6) - 6/(-9)? 10 Let f = -9 + 9. Suppose -4k = -fk. Suppose k = -2m + 4x + 20, -6m + 5x = -m - 35. Calculate the least common multiple of m and 4. 4 Suppose -5b - 4h = 5, 3b - 2b + 15 = 2h. Let l = 215/2 + -130. What is the common denominator of 2/b + 1404/(-440) and l? 22 Let f(n) = 13n2 - n. Let y be ((-2)/(-6))/(2/6). Let d be f(y). Calculate the common denominator of 9/8 and 1/(-36)(-14 + d). 72 Suppose -3j - 2j = -3p + 23, -2p + 4j + 14 = 0. Let d(o) = -o3 - o2 + 7o + 9. Calculate the least common multiple of d(-3) and p. 66 Let r(o) = -12o3 + 4o*2 - o - 2. Let k be r(2). What is the common denominator of k/(-63)(-2)/(14/33) and -20/3? 21 Let g = 2 - -7. Let x be (-1)/3(5 - 11). Suppose 14 = xz + 2q + 6, -4z = -3q - 9. Calculate the lowest common multiple of z and g. 9 Let f = 1/1689 - -81065/11823. Find the common denominator of f and -77/4. 28 Let f = 188 - 134. Calculate the least common multiple of f and 63. 378 Let s = -1300662883121/796300005570 - 584/42145655. Let z = s + 1/15745. Find the common denominator of 46/15 and z. 30 Let n(c) = -2c*3 - c + 2. Let t = 1446 + -982. What is the smallest common multiple of n(-2) and ((-2)/(-4))/(2/t)? 580 Suppose -4v + 264 = 5x, 179 = 3v + 3x - 4x. Suppose -4l + 134 = -2g, 2l - v = -0g - 5g. Calculate the least common multiple of 9 and l. 99 Let j(t) = t + 0t + 14 + 0t. Let q = -20 - -11. What is the least common multiple of j(q) and 5? 5 Suppose 11 + 1 = 3w. Let c be (w - -1) + (-3 - -6). Calculate the common denominator of 47/14 and -11((-35)/c)/7. 56 Suppose 2y = -5u + 15406, y - 5u - 3127 - 4591 = 0. Let i be (117/(-182))/((-3)/(-35939)). Let f = i + y. What is the common denominator of 11/2 and f? 14 Let b = -2 + 5. Suppose 0 = -2x + 4i - 4, -bx + 35 = 2x + 5i. Calculate the smallest common multiple of 5 and 9/6x/6. 5 Calculate the lowest common multiple of 74/6 - (-6)/(-18) and 0 - -1 - (-1 + -3). 60 Let j = 738 + -686. Let h = 27 - 7. Calculate the lowest common multiple of h and j. 260 Calculate the lowest common multiple of (-4 - -9) + 7 - 1 and 83. 913 Let r = 401931/28 - 14357. Find the common denominator of r and (-21 + 23)(3 - 459/120). 140 What is the common denominator of ((-113)/6)/((-140)/(-84)) and ((-2)/12)/(3/122)? 90 Let x be (-59208)/(-165) + 2/4. Let s = x - 1806/5. Calculate the common denominator of s and -5 + (-148)/(-56) - (3 + -3). 154 Let d = 613 + -1203/2. Find the common denominator of d and (-4)/48(38 + -1). 12 Suppose 2n = n + 3, -4q + 4n = 0. Let m = 8 - q. Suppose 0 = 4l - 28 - 16. What is the lowest common multiple of m and l? 55 Let m(v) = 2v2 + 2v - 4. Let h(t) = 7t - 12. Let l be h(2). Suppose 40 = 5g - 10. Calculate the lowest common multiple of g and m(l). 40 Suppose 3 = 17d - 16d. Calculate the least common multiple of 14 and ((-7)/d)/(12/(-72)). 14 Let p = -16 - -30. Let i = 23 - p. Calculate the least common multiple of (-3)/(-2) - (-1)/(-2) and i. 9 Suppose -d = 22 - 146. What is the least common multiple of 10 and d/3633? 310 Suppose -12 = -3w - 0w. What is the lowest common multiple of (-112/4)/(3/(-6)) and w? 44 Let r = -285/22 + -409/44. Find the common denominator of r and (-1 - (-82)/84)/((-39)/(-3471)). 84 Let z = 1444007/36 + -40114. What is the common denominator of -43/4 and z? 36 Let r = -34/19739 + -21172331/4421536. Let f = -89/32 + r. Let p = 14468/3795 + 2/345. What is the common denominator of p and f? 77 Let k be 346/26 + -2 + 2. Let z = -1219/117 + k. Find the common denominator of 138/(-16) + 6/12 and z. 72 Let g = -305524314/211561 + 1/30223. Let r be -1438 - (4 + -4) - 3. Let i = g - r. Find the common denominator of i and 53/6. 42 What is the common denominator of -35/8 and ((-3782)/155)/((-2072)/10)? 2072 Calculate the common denominator of (206/(-4))/((-98)/(-7)) and -101/8. 56 Suppose -13 = h - 2s + 5, -4h - 3s - 94 = 0. Let l = h + 20. Calculate the least common multiple of (4 + -12)/l - 1 and 10. 30 Let b be 14/21 - (-56)/(-3). Let z = b - -30. Suppose -3i + 17 = u, 3u - i - 69 = -2u. What is the smallest common multiple of z and u? 84 Find the common denominator of 195/(-21)(122/(-108) + 1) and 137/36. 108 Suppose 18 = 4k + 2. Let b be 0/(-4 + k - -2). Suppose b = -2o - 0o - 2p + 14, -2o - 3p + 15 = 0. What is the lowest common multiple of 22 and o? 66 Suppose 3l + 108 = 6l. Let x = 50 - l. What is the least common multiple of x and 4? 28 Let k(o) = -o*2 + 17o - 10. Let n be k(14). Suppose -5t - n = -3m, 8 + 31 = -5t - 4m. Find the common denominator of -107/22 and 18/4 + t + 7. 22 Let o be 4/(-14) + (-3900)/952. Let v = 929/51 + o. Calculate the common denominator of 97/10 and v. 30 Let z(m) = 11m2 + 25m + 17. Let h(o) = -3o2 - 6o - 4. Let r(u) = -9h(u) - 2z(u). Calculate the	{ "pile_set_name": "DM Mathematics" }
04 Round 32.9444 to two decimal places. 32.94 What is 410883 rounded to the nearest 1000? 411000 What is -0.003211874 rounded to 5 dps? -0.00321 What is 0.0000158192 rounded to 7 decimal places? 0.0000158 What is -60.648 rounded to the nearest ten? -60 What is 0.005012595 rounded to six decimal places? 0.005013 Round 28161.4 to the nearest 1000. 28000 What is -0.002862429 rounded to 6 dps? -0.002862 Round 0.0001265876 to 7 decimal places. 0.0001266 Round 885.7696 to zero dps. 886 Round 0.000068023383 to 5 decimal places. 0.00007 What is 0.0001377282 rounded to seven dps? 0.0001377 Round -79.1253 to zero decimal places. -79 Round 881399 to the nearest ten thousand. 880000 What is -1295275.8 rounded to the nearest ten thousand? -1300000 What is -0.00128232 rounded to six decimal places? -0.001282 Round 183.421 to the nearest 100. 200 Round 0.00000126699 to 6 decimal places. 0.000001 Round 0.0000471049 to five decimal places. 0.00005 Round -44581.48 to the nearest one hundred. -44600 What is 0.000578229 rounded to six dps? 0.000578 Round 247.628 to the nearest 10. 250 What is 169.8343 rounded to the nearest ten? 170 Round 115.17561 to 1 dp. 115.2 Round -0.000104412 to six decimal places. -0.000104 What is 0.00000016161 rounded to 7 decimal places? 0.0000002 Round 0.00420663 to 3 decimal places. 0.004 What is 15.385196 rounded to 2 dps? 15.39 What is -0.665977 rounded to two decimal places? -0.67 What is 0.0851314 rounded to 3 dps? 0.085 What is 0.0000011754113 rounded to seven dps? 0.0000012 What is 10530.1 rounded to the nearest 100? 10500 Round -0.0151244 to 5 decimal places. -0.01512 What is 0.0001865748 rounded to seven decimal places? 0.0001866 What is 0.001610263 rounded to four dps? 0.0016 Round -164852.5 to the nearest 1000. -165000 Round -26.0195 to 1 dp. -26 What is -20.52803 rounded to 0 decimal places? -21 What is -0.00000528673 rounded to seven dps? -0.0000053 What is -0.0000099650015 rounded to 6 decimal places? -0.00001 Round -0.00575228 to 3 dps. -0.006 What is 24.8778 rounded to the nearest integer? 25 Round 0.3810491 to two dps. 0.38 What is 311.9986 rounded to the nearest integer? 312 What is 0.009883361 rounded to 6 dps? 0.009883 What is -6278.1 rounded to the nearest one hundred? -6300 What is 7428.664 rounded to the nearest one hundred? 7400 What is 0.000329445 rounded to 4 dps? 0.0003 Round -0.000018281216 to 7 decimal places. -0.0000183 Round -0.00001401032 to 5 dps. -0.00001 What is 14048951 rounded to the nearest one million? 14000000 What is 25741.035 rounded to the nearest 10? 25740 Round -3.24126 to one dp. -3.2 What is -1.7196327 rounded to three decimal places? -1.72 What is -1280390 rounded to the nearest 10000? -1280000 Round -0.00000035232 to 7 decimal places. -0.0000004 What is 105499000 rounded to the nearest 1000000? 105000000 Round -127113.767 to the nearest 100. -127100 What is -0.7835101 rounded to 1 dp? -0.8 What is 15246.042 rounded to the nearest 1000? 15000 What is 0.0000007898855 rounded to seven dps? 0.0000008 What is 0.00026388 rounded to 6 dps? 0.000264 Round -0.006569537 to 4 decimal places. -0.0066 Round -0.00123861577 to four dps. -0.0012 What is -0.004775902 rounded to four decimal places? -0.0048 What is 619475 rounded to the nearest one thousand? 619000 What is -3032443.1 rounded to the nearest one thousand? -3032000 What is -259107.6 rounded to the nearest 1000? -259000 Round 0.0986778 to three decimal places. 0.099 What is 0.000006874753 rounded to 7 dps? 0.0000069 What is -6180513 rounded to the nearest one thousand? -6181000 Round 0.2375727 to two dps. 0.24 What is -419.14 rounded to the nearest one thousand? 0 What is -589500 rounded to the nearest one hundred thousand? -600000 What is -589286 rounded to the nearest 1000? -589000 Round 179.21476 to 1 decimal place. 179.2 Round -3439.346 to the nearest 10. -3440 What is -280.93291 rounded to the nearest integer? -281 What is -255.612 rounded to the nearest ten? -260 Round -0.000000947177 to seven dps. -0.0000009 What is 1080.6168 rounded to the nearest one hundred? 1100 Round 0.0007978771 to five decimal places. 0.0008 What is 25558 rounded to the nearest 1000? 26000 Round 0.00125545 to 5 decimal places. 0.00126 What is 0.00015442785 rounded to six decimal places? 0.000154 What is 0.002265154 rounded to 5 dps? 0.00227 What is -0.6141547 rounded to 2 dps? -0.61 What is -0.14101902 rounded to 4 dps? -0.141 What is -4361100 rounded to the nearest 100000? -4400000 What is -42178.39 rounded to the nearest 10? -42180 Round 531.26121 to the nearest one hundred. 500 Round -231344 to the nearest one hundred thousand. -200000 What is -0.523572 rounded to two dps? -0.52 What is -0.0003341388 rounded to 7 dps? -0.0003341 Round -0.00021868455 to five dps. -0.00022 Round -102744.49 to the nearest 1000. -103000 What is -350.0596 rounded to 0 dps? -350 Round -5.64385 to two decimal places. -5.64 Round -0.016702524 to 4 decimal places. -0.0167 What is -1.0917305 rounded to one dp? -1.1 What is -0.0491152 rounded to three dps? -0.049 Round -0.00004418893 to 5 dps. -0.00004 Round 26131.374 to the nearest one thousand. 26000 What is -27.010787 rounded to 0 decimal places? -27 What is -0.1569168 rounded to 4 dps? -0.1569 Round -0.0000012903248 to seven dps. -0.0000013 What is 5.886854 rounded to zero dps? 6 Round -0.0002220959 to seven dps. -0.0002221 What is -0.00029963518 rounded to 5 decimal places? -0.0003 What is 5682.37 rounded to the nearest ten? 5680 Round 3090860 to the nearest 10000. 3090000 Round 0.2683861 to three decimal places. 0.268 Round 19.22742 to one dp. 19.2 Round 319.417 to 0 decimal places. 319 Round -0.000096738631 to seven dps. -0.0000967 Round 370.63128 to the nearest 10. 370 Round -506.1219 to the nearest 100. -500 What is 35847020 rounded to the nearest 10000? 35850000 Round -1.133697 to 3 decimal places. -1.134 What is -1258.39 rounded to the nearest one hundred? -1300 What is 110197.7 rounded to the nearest ten thousand? 110000 What is -1745.7273 rounded to the nearest integer? -1746 Round -280701990 to the nearest 100000. -280700000 Round -0.00155536 to four decimal places. -0.0016 What is 2802606.8 rounded to the nearest 10000? 2800000 What is 734073000 rounded to the nearest 1000000? 734000000 What is -0.0375602 rounded to two decimal places? -0.04 Round -21.012452 to two decimal places. -21.01 What is 0.00000337265 rounded to seven decimal places? 0.0000034 What is 99485130 rounded to the nearest one million? 99000000 What is 1345.02 rounded to the nearest ten? 1350 Round 1975834 to the nearest 100000. 2000000 What is -8.0817 rounded to two dps? -8.08 Round 517896400 to the nearest one hundred thousand. 517900000 What is 0.00001346466 rounded to five decimal places? 0.00001 What is -906062.7 rounded to the nearest 10000? -910000 What is 387042.52 rounded to the nearest ten thousand? 390000 What is 6849.612 rounded to the nearest 100? 6800 Round 1.75945 to 1 decimal place. 1.8 Round -753.25 to the nearest 100. -800 What is -0.01198869 rounded to four dps? -0.012 Round -0.0037824974 to 5 dps. -0.00378 What is -137709.4 rounded to the nearest one thousand? -138000 What is -3023.433 rounded to zero dps? -3023 What is -0.0000778278 rounded to 7 dps? -0.0000778 Round -0.1019304 to 4 decimal places. -0.1019 Round -524.033 to the nearest integer. -524 What is -0.0297861 rounded to one decimal place? 0 What is 4583.124 rounded to the nearest one hundred? 4600 Round -0.007996462 to four decimal places. -0.008 What is -201559.2 rounded to the nearest one thousand? -202000 Round -0.000054752 to 6 decimal places. -0.000055 What is 35.91 rounded to the nearest ten? 40 Round 1.398471 to two dps. 1.4 What is -2.673001 rounded to two dps? -2.67 What is 7.290671 rounded to the nearest ten? 10 Round -40.113 to one dp. -40.1 Round 68.8777 to the nearest integer. 69 What is 0.0078637 rounded to five decimal places? 0.00786 Round 2508.19 to the nearest 100. 2500 Round 0.3689 to one dp. 0.4 What is 2649.97 rounded to the nearest ten? 2650 Round 0.0927751 to 4 dps. 0.0928 What is 3651.94 rounded to the nearest 100? 3700 Round 0.2412988 to four dps. 0.2413 Round -10264681 to the nearest one hundred thousand. -10300000 Round 940241 to the nearest 1	{ "pile_set_name": "DM Mathematics" }
9 Suppose 22 - 94 = -2s. Let r be 25 - 1(1 - 0). What is the greatest common factor of s and r? 12 Let u = 19 + 3. What is the highest common divisor of 176 and u? 22 Suppose 7z - 2z = 0. Suppose z = -2g + 6g - 136. Calculate the highest common divisor of 17 and g. 17 Let i = 78 + -66. Suppose x + 5r = -3x + 28, -2x + 2r = 4. Suppose -2v + 96 = xv. What is the highest common divisor of i and v? 12 Let v be ((-2)/4)/(1/(-6)). Let o = 12 - v. Calculate the highest common factor of o and 36. 9 Suppose 2s + 12 = -4x + 7s, -4s = -4x - 8. What is the highest common divisor of 1 and x? 1 Suppose -495 + 93 = -4h - 2l, 0 = -l + 3. What is the greatest common divisor of h and 9? 9 Suppose -2 - 4 = 3w. Let s be ((-7)/((-14)/(-20)))/w. Calculate the highest common factor of 10 and s. 5 Let u be (-4 - -4)/(-4) - 4. Let a be u/((-64)/(-12))-36. What is the highest common divisor of a and 9? 9 Let p(q) = 36q + 5. Let v be p(2). Calculate the greatest common factor of v and 7. 7 Let h(t) = -2t - 7. Let g = 9 - 14. Let p be h(g). Suppose 4o = 4i - 64, 2i = -pi - 4o + 71. Calculate the highest common divisor of i and 10. 5 Let o = 43 + -34. Calculate the highest common factor of o and 72. 9 Let p(k) = -k - 10. Let a be p(-7). Let s = 8 + a. Suppose sb = -2q + 19, -2q + b - 3b = -34. What is the greatest common divisor of 11 and q? 11 Let h = 5 + -2. Suppose 0s = hs - 690. Suppose 0 = 2k - 4 - s. Calculate the greatest common divisor of 13 and k. 13 Let i be (-5 + -17)/((-6)/9). What is the highest common divisor of i and 231? 33 Let k be 0 - 1 - (-10)/1. Let r be (-27)/216/(-12). Calculate the greatest common divisor of k and r. 9 Suppose -h + 3h + 50 = 2o, -100 = -4o - h. Calculate the greatest common factor of 25 and o. 25 Suppose 3a - 61 = -0a + 5y, 51 = 3a - 3y. Suppose -5m + a = -m. Suppose -u = 3p - p - 15, -27 = -u + 2p. What is the greatest common divisor of u and m? 3 Suppose -3p = -154 + 19. Let v be (3/6)/(3/(-18)). Let i = v + 8. Calculate the highest common divisor of p and i. 5 Let w = -98 + 104. Calculate the highest common divisor of 3 and w. 3 Suppose -3f - 27 = -6f. Let p = 6 - 0. Calculate the greatest common divisor of f and p. 3 Let t = 24 - 22. Calculate the highest common divisor of t and 2. 2 Let d(w) = w3 - w2 - w - 5. Let v be d(5). Suppose -2g - 16 = -6g. Let a = g - -6. What is the greatest common factor of a and v? 10 Let b be 5 - (-1)/(3 - 2). What is the highest common divisor of b and 48? 6 Let f = 16 - 12. Suppose 0 = -5n - t + 837, -ft - 14 + 2 = 0. Calculate the greatest common factor of n and 21. 21 Let v = -104 - -266. Calculate the highest common factor of v and 6. 6 Let v be ((-27)/(-18))/((-1)/(-2)). Suppose -3j + 8j - 75 = 5i, -vj + 2i + 40 = 0. What is the greatest common factor of 110 and j? 10 Let w(b) = -b2 + 6b + 2. Let f be w(6). Suppose -d = -1, fp - 86 = -p - 2d. Calculate the greatest common factor of p and 14. 14 Let m = -1 + 0. Let k be (2m)/((-3)/6). Suppose -3j = -r - kr + 36, j + 6 = r. Calculate the highest common divisor of r and 36. 9 Suppose -b + 120 = 5q, -3b - 320 = -6b + 5q. What is the greatest common factor of b and 10? 10 Let x(f) = -f + 5. Let b be x(0). What is the greatest common divisor of 5 and b? 5 Let i = 387 + -211. Calculate the greatest common divisor of i and 22. 22 Suppose 0 = o - 4o + 45. Suppose 113 = 3c - 112. Calculate the highest common divisor of o and c. 15 Let f = -161 - -315. What is the highest common factor of 14 and f? 14 Let m = -4 + -5. Let l be 14/(-63) + (-38)/m. Let u be 40/(-6)(-36)/15. Calculate the greatest common divisor of l and u. 4 Suppose -7l - 4g + 18 = -5l, 2l - 2g = -6. Calculate the highest common divisor of l and 3. 1 Suppose -9k + 294 = 5k. Calculate the greatest common factor of 84 and k. 21 Let f be (-70)/8 - (-3)/(-12). Let w = f - -44. Let n be 7/(-2)(-2)/1. What is the highest common divisor of n and w? 7 Suppose 3s + 2 = 2f, -f - s + 7 = 1. What is the greatest common divisor of f and 2? 2 Let i = -5 + 3. Let g be 4(21/4 + i). What is the highest common divisor of 52 and g? 13 Suppose -2 + 14 = 3h. Suppose 2k + k = 0. Suppose 3x + v - 30 = -2, k = -4x - 2v + 36. Calculate the highest common factor of h and x. 2 Suppose -21 = -d - 2d. Calculate the greatest common factor of 14 and d. 7 Let j = 24 + -16. Suppose g = 4g - 48. What is the highest common divisor of g and j? 8 Suppose l = 3v + 18, 12 = -l - 3v - 0. Suppose u - 2 = 3w + 9, -2u = -lw - 13. Let g = u - -2. What is the greatest common factor of g and 10? 2 Let z(n) = 9n*2 + n - 1. Let b(f) = -2f - 2. Let r be b(-2). Suppose 5l - r - 3 = 0. Let j be z(l). What is the greatest common divisor of j and 81? 9 Suppose 0 = -0u - u + 2. Suppose -6 = ua + 3q - 2, -5a + 5q + 40 = 0. What is the greatest common divisor of a and 1? 1 Let q be 90/(-2 + (2 - -1)). Let i = q + 42. What is the greatest common factor of i and 12? 12 Suppose z + 2 = -2a + 4a, 3a - 3z = 0. What is the highest common factor of a and 3? 1 Suppose -3o + 4m = 3 - 5, -4o + 44 = 5m. Calculate the greatest common divisor of 54 and o. 6 Let a(r) = r*3 - 9r*2 - 10r + 2. Let x be a(10). Suppose 0 = b - 2q, -xq + 55 = 3b + 3q. What is the greatest common factor of b and 30? 10 Suppose -5h + 1000 = -260. What is the highest common factor of 36 and h? 36 Suppose 4 = 3q + 4p - 80, -2q + 4p + 76 = 0. Calculate the highest common factor of 16 and q. 16 Let h = -5 + 17. Let a(s) = 9s*2 - 2s - 4. Let o be a(4). What is the highest common factor of o and h? 12 Suppose l - 2z = 3z + 105, z = 5. What is the greatest common factor of 10 and l? 10 Suppose -4p = 4d - 0 - 4, 3d = -5p + 7. Suppose pr + 2 = r. Let y be 41 - 0 - (1 + r). What is the greatest common divisor of 28 and y? 14 Suppose -2l + 9 = -25. Let n be 2 + -2 + 0 + l. Suppose 3z - 4 = n. What is the highest common factor of 77 and z? 7 Suppose -3i - 23 - 14 = -2y, -21 = -y + i. Let x = -585 + 871. Calculate the highest common factor of x and y. 26 Suppose -y + 39 = -5j, 4y - j - 34 = 27. Let v be 4/((-24)/(-10))21. What is the greatest common divisor of v and y? 7 Let t = 13 + 11. What is the highest common factor of t and 6? 6 Let c = -108 - -163. What is the greatest common divisor of 10 and c? 5 Let c(b) = 2b3 - 6b*2 + 3b + 1. Let a be c(4). Suppose -s = 2s - a. Calculate the highest common factor of s and 10. 5 Let t(r) = -2r*2 - 4r + 3. Let v be t(-5). Suppose -4q + 3i + 221 = 0, -i = -3q + q + 113. Let s = v + q. Calculate the highest common factor of s and 16. 16 Let m(l) = -l2 + 4l + 6. Let s be m(6). Let u = s + 30. Let v(q) = -7q - 6. Let x be v(-6). What is the highest common factor of u and x? 12 Suppose 4b - 65 - 31 = 0. Let p = b + -9. Let h = -3 - -6. What is the greatest common divisor of p and h? 3 Let t = 79 - 67. What is the greatest common divisor of 96 and t? 12 Let k be 1/210-2. Let w be k/(-6) + (-2)/3. Let r = 12 - 11. What is the greatest common factor of r and w? 1 Let j = 126 + 45. What is the highest common factor of 19 and j? 19 Let q = 62 - 61. What is the highest common factor of q and 17? 1 Let s = -57 - -75. Calculate the greatest common divisor of s and 27. 9 Suppose -51 = 2k - 5k. Let q be 2/(-1) - (-1 - k). What is the highest common factor of q and 160? 16 Suppose 2s - 14 = 84. What is the greatest common factor of s and 7? 7 Let v be (-7 + 4)(-56)/6. Let k be 2/(-16)-10v. What is the highest common divisor of 7 and k? 7 Let w(m) = m*2 + 14m - 3. Let b be w(-15). What is the highest common factor of b and 8? 4 Let g = -144 + 260. Let t be g/8 + (-1)/(-2). Calculate the highest common divisor of 6 and t. 3 Suppose 0 = 2a + 3a - 30. Let b(h) = h*2 - 5h - 8. Let r be b(a). Let y be 7 - -2(-3 - r). What is the highest common factor of 15 and y? 5 Let m = 49 - 82. Let n be (m + 3)/(4/(-2)). Calculate the greatest common divisor of n and 75. 15 Let p be (4 + -12)(-3)/4. What is the highest common divisor of 24 and p? 6 Suppose -4o + 9o - 180 = 0. Let g(b) be the third derivative of b5/30 - b4/12 - b**2. Let t be g(3). What is the highest common divisor of t and o? 12	{ "pile_set_name": "DM Mathematics" }
2a + 3a = -3a. Let i = -0.07 - 0.23. Let y = -0.35 - i. Is y equal to a? False Suppose 12u + z + 63 = 16u, -19 = -2u + 3z. Which is bigger: u or 32? 32 Let g = -106 - -1583/15. Is -2/13 at most g? False Let x = 10 + 12. Suppose 0m - 8 = 2m, 0 = k - 2m - 29. Is x bigger than k? True Suppose -4t + 3h = 200, -2t = 2h + 71 + 29. Let g be (4 - (-147)/(-30))t/12. Which is bigger: -0.1 or g? g Let f be 2/(-5) + 18/(-5). Let t be ((-328)/18 + 2/9)1. Let l be (t/f)/1 - 0. Does 6 = l? False Let s = 0.62 - 27.62. Let n = 25 + s. Which is smaller: 7 or n? n Let u be (15547/1110)/1 + (-15)/75. Let q = 83/6 - u. Is -1 greater than q? False Let c = -2 - -9. Suppose -r = -cr - 156. Let n = 41 + r. Is n bigger than 15? False Suppose -2r + 4t = -4, -4r + 3t = -t - 8. Suppose -4y - 2 = -2c, 3c + rc = -5y + 35. Let z(b) = 2b - 41. Let w be z(21). Which is greater: y or w? y Let g = 1808/11 - 19610/143. Which is greater: g or 28? 28 Let x(k) = k3 + 9k*2 + 12k + 21. Let n be x(-7). Suppose 0 = -m + n - 35. Do -24/17 and m have the same value? False Let j be 4 + -3381/(-45). Let d = 51 - 21. Let a = d - j. Which is smaller: a or 0? 0 Let n be 0 + (2 - 1)/1. Let h be (12/(-20))/(n/5). Let f = -41.3 + 41. Is h >= f? False Let n(w) = -6w - 47. Let o be n(8). Is -95 equal to o? True Let b = -33 + 12. Let y be -2 + (1 - b) + -3. Let x = -16 + y. Is 3/4 greater than or equal to x? False Suppose 0 = 111m - 13m - 5194. Is 670/13 greater than or equal to m? False Let i(z) = -14z3 + 0z + 12z3 + z - 4. Let u be i(2). Which is smaller: u or -52/3? u Let a = 0.06 + 0.06. Let h = -0.1 + a. Let l = 8362 - 8361. Which is greater: l or h? l Let r = 45 + -46. Which is smaller: r or -0.4? r Let t = -190 - -574/3. Is t equal to -8/3? False Let w = 23/10 - 14/5. Let s = -47.19 + 47. Let i = s - -0.17. Is i not equal to w? True Let o be 2 - 6/3 - -2. Suppose 36 + 74 = op + 2y, -5p + 263 = -y. Is -1 >= p? False Let j(v) = -v3 - v2 + 3v + 7. Let t be j(-3). Let d be 2/(-5)(-30)/t. Which is smaller: 1 or d? d Let c = -219.545 + 220. Which is greater: 0.1 or c? c Let v = 75747/4355 + 6/871. Is v less than 16? False Let q = -257/445 - 2/89. Let z be (-7 + 4)/(-4 - 66/(-12)). Are q and z nonequal? True Suppose 0 = -2f - 2d + 4, 4f - 4 = -d + 4. Let a(i) = -i - 1. Let c(y) = 3y - 8. Let q(n) = fa(n) + c(n). Let b be q(9). Which is greater: b or -2/19? -2/19 Let o(d) = d3 - 29d*2 + 29d + 20. Let n be o(28). Which is smaller: n or 53? n Let c(a) = a*2 + 40a - 335. Let o be c(-47). Which is greater: -75/13 or o? -75/13 Let o = 233498/17 - 13740. Which is smaller: -5 or o? -5 Let v be (-7 - -1)(-1)/((-3)/5). Let j = 148 + -152. Are v and j equal? False Suppose -2n - n = -3. Let f be (-2)/(-19) - 6(-1105)/(-44574). Is f >= n? False Let y(h) = h + 1. Let k be y(-4). Let s be (-2)/k + (-28)/(-12). Suppose -sr = 2r. Which is smaller: r or -2? -2 Let o = -374 + 380. Is 12 > o? True Let v = -7 - -9. Suppose -vu = s + 3s - 12, -4u + 4s = 0. Let c be u/(-8) - (-29)/4. Is c at least 6? True Suppose -6f + 372 = 3z, -9f - 5z + 44 = -8f. Is 46 at least f? False Let m = 26 + -11. Let w = -27 + 25. Let o(n) = 3n2 - 2n - 1. Let g be o(w). Is g at most m? True Suppose 5v - 4y = 19, 5v - 11 = -2y - 2y. Suppose 2n = 4a + 16, n = -2a + va + 8. Let z = -15 + n. Is -7 greater than z? False Let m = 4.5 - 0.7. Let y = m - 4. Which is bigger: y or -10? y Suppose -6w = -2m - w - 30, 0 = -5m - w - 102. Let t be m/45 + (-4)/18. Are t and -13 nonequal? True Let n = -1.2 - -56.2. Let q = 58 - n. Which is bigger: q or -0.02? q Let u = 206 - 204. Is 38 less than or equal to u? False Let d be (-4 + -2 - -2)/(-4). Is d less than 1? False Suppose -2i = 2n - 14, 0i + 2 = i + 2n. Suppose 0 = 13h - 513 - 59. Let f be (-33)/h - (-51)/4. Is i <= f? True Let f be (-254)/42 + 1. Let b be ((-2)/6)/((-70)/f). Do 0.3 and b have the same value? False Let u = 0.12 - -0.68. Let b = 1.1 - u. Let c = 13 + -13. Which is smaller: b or c? c Let x be 1/((-1)/102). Let h(p) = -p3 + 17p*2 + 18p - 1. Let g be h(18). Is x > g? False Let d(l) = -2l2 + 13l + 9. Let o be d(6). Suppose 2c = 12 + 20. Are c and o non-equal? True Let w = 3415/2 + -1571. Does w = 138? False Suppose r = -2r + 4u + 76, -20 = -r - 4u. Let c be (1/(-2))/(2/r). Let f(p) = -p*2 - 4p - 2. Let o be f(-5). Which is bigger: o or c? c Let w = -1681 - -1666. Which is bigger: w or -0.28? -0.28 Let d = -16865 - -9444397/560. Which is smaller: d or -1? -1 Let d = -215 - -214. Are d and -82 equal? False Suppose -268l = -271l + 315. Is l >= 104? True Suppose -136 = -14p - 696. Is -40 less than p? False Let r(g) = -g2 - 21g + 125. Let f be r(-32). Is -225 greater than or equal to f? True Let g be (1743492/(-1002))/((-2)/(-1)). Let j = -870 - g. Let v = j + -341/1169. Is -0.2 equal to v? False Let v = 1678 - 1721. Let u be (-6 - -9)(-14 - 0). Which is bigger: u or v? u Let o = 9.05 - 9.05. Which is smaller: o or -1.1? -1.1 Let h = -20 + 20. Which is greater: -94 or h? h Let d = 919 + -856. Is d bigger than 1/3? True Let g = 734 - 3664/5. Suppose -t = -3t - 4. Which is bigger: t or g? g Let a = -26 - -23.7. Let z = a + 0.3. Is z equal to -2.5? False Let k be (14 - 6) + (-249)/31. Let i = 0 + 1. Let b be (0(2 - 1))/i. Which is smaller: k or b? k Let x = 1.2 + -1.55. Let p = x + 2.45. Let l = p + -0.1. Which is smaller: l or 0.2? 0.2 Let a be 02/4 + (-984)/86756. Is 1 < a? False Let f = 83 - 83. Let m(o) = 2o - 10. Let h be m(f). Which is smaller: h or -46/5? h Suppose 4c = 5c + 22. Let o = -15 - c. Suppose -4x - 4v + 16 = 0, 0x = 4x - 5v - 43. Do x and o have different values? False Let m = -1.55 - -2.98. Let x = m + -0.83. Which is smaller: 5 or x? x Suppose 4z - 2 = 2b - 0b, z + 1 = 2b. Suppose 5a = 2k - 4k + 18, 0 = -5a - k + 19. Let w = -5 + a. Is w < z? True Let c = 203819/2630 + 3/1315. Is c < 77? False Suppose 5a - 5f = -225 - 545, 4a + 3f = -644. Which is greater: a or 1/2? 1/2 Suppose 0k + 3 = 3k. Suppose 3x + 9u - 46 = 13u, 0 = 3x + 2u - 40. Is x at least k? True Suppose 5i - 4c - 1799 = 0, -11i = -10i + 3c - 375. Do 362 and i have the same value? False Suppose 82 = 4z - 4m + 2m, 5m - 2 = z. Let j be z/((-7)/(14/40)). Let d = j - -3/4. Which is bigger: 0 or d? 0 Let f = 14.09 + -14.09. Let s = 2 - 1.8. Do f and s have the same value? False Suppose 12t - 8t = -24. Let y be 2/(((-24)/(-198))/((-4)/t)). Which is smaller: y or 8? 8 Let q = 3576/5 + -722. Suppose 0 = -5b - 47 + 7. Which is smaller: b or q? b Let w = 23 - 43. Let a = -71 - -50. Let n = w - a. Is n < -0.1? False Let d(i) = -51i*3 + 4i*2 - 2i - 1. Let c be d(1). Which is smaller: -49 or c? c Let a be (3 - -188) + 31 + -23. Is a at least 200? False Let r(w) = -11w3 + w2 - 1. Let n be r(1). Let g = 1.5 + 9.5. Let t = 10 - g. Do t and n have the same value? False Let w be ((-2)/(-10))/(((-27)/(-5))/(-3)). Suppose -3r - 6 = -6r. Let u be 4/r - (-6 + 7). Which is bigger: w or u? u Let a = 4.4 + -4. Let x be 32/4(-162)/8. Let v be (4/(-6))/1x/378. Is v at most a? True Suppose -2k = 3p - 1, 0 = p + 5k + 2 + 2. Let r be p/7 + (-44)/14. Let o(c) = c + 7. Let j be o(r). Which is greater: j or 5? 5 Let l = 638 - 892. Is -255 smaller than l? True Let t(h) = h + 2. Let o be t(2). Suppose -14 + 2 = -of. Which is smaller: 5 or f? f Let t(c) = -c3 - 9c*2 - 8c + 2. Let u be t(-8). Let l be (-3 - -3) + 87/2. Let z = -42 + l. Which is bigger: u or z? u Let g be (5/(-21))/((-105)/126). Which is bigger: g or -0.21? g Let n be (-37)/5 - 16/(-40). Let f be ((-1)/n)/((-10)/(-35)). Let k be 8/(-14)(-70)/20. Which is smaller: k or f? f Let z be 6/(-14) - (-28677)/(-462). Which is bigger: -62 or z? -62 Let s = 159641/12 - 13094. Let p = -209 + s. Which is greater: p or -1? p Let v = -67.26 - 0.74. Let b = v - -69. Is -42 < b? True Let u be 3(-3)/((-36)/(-4)). Is u >= 5/38? False Let v(q) = -q - 3. Suppose 0 = -5h + h - 4. Let j be v(h). Let c(z) = z3 + 4z*2 - 3z + 7. Let y be c(-5). Is j equal to y? False Let h(x) = x*2 - 11x + 39. Let d be h(20). Is d less than or equal to 219? True Let w be (-7 + 1)(-2)/4. Suppose -2d - wd + 10 = 0. Let l(p) = -2p + 2.	{ "pile_set_name": "DM Mathematics" }
) Let m*2/4 - 173m/4 - 1615/2 = 0. What is m? -17, 190 Factor t*2 - 1300321t/2 + 325080. (t - 650160)(2t - 1)/2 Factor -q*2/3 - 3136q/3 - 1045. -(q + 1)(q + 3135)/3 Determine t so that 2t*2/3 - 82t + 5320/3 = 0. 28, 95 Factor 36h3 - 43000h*2 - 110172h + 57456. 4(h - 1197)(h + 3)(9h - 4) Factor -2h2 + 100h - 282. -2(h - 47)(h - 3) Suppose -3x2 + 85659x - 1284210 = 0. Calculate x. 15, 28538 Find u such that -3u2/2 - 14070u - 32994150 = 0. -4690 Factor 5s3/3 + 7256s*2 + 7895979s - 9478658/3. (s + 2177)*2(5s - 2)/3 Factor -3z*4/2 - 573z*3 - 123327z*2/2 - 1325922z - 8031894. -3(z + 13)2(z + 178)2/2 Factor p4 - 9p3 - 21p*2 - 11p. p(p - 11)(p + 1)*2 Suppose 2f*5/15 + 81994f*4/15 + 81992f*3/15 = 0. Calculate f. -40996, -1, 0 Let -3x*4 + 9108x*3 + 63903x*2 = 0. What is x? -7, 0, 3043 Factor -4l*2 + 20112l - 60300. -4(l - 5025)(l - 3) Find j such that -2j3 - 580j*2 - 1726j - 1148 = 0. -287, -2, -1 Let -3f4/8 - 33f*3/2 + 207f*2/4 - 105f/2 + 141/8 = 0. What is f? -47, 1 Factor -2w3/13 - 8646w*2/13 - 8644w/13. -2w(w + 1)(w + 4322)/13 Let -g3/2 + 1829g*2/2 + 11005g/2 + 9175/2 = 0. Calculate g. -5, -1, 1835 Let -20a2 - 18168a - 43488 = 0. Calculate a. -906, -12/5 Suppose -4m3 - 15324m*2 + 572320m - 556992 = 0. What is m? -3868, 1, 36 Factor 5y2 - 476640y + 11359284480. 5(y - 47664)2 Suppose 405s*3 + 3195s*2 - 110350s + 24360 = 0. Calculate s. -21, 2/9, 116/9 Let -j*5/7 + 1842j*4/7 - 1095888j*3/7 + 187729280j*2/7 + 13631542272j/7 = 0. What is j? -54, 0, 632 Let 5n2 - 20n - 585 = 0. What is n? -9, 13 Determine k so that -2k4/5 - 474k*3/5 + 100k*2 + 5712k/5 = 0. -238, -3, 0, 4 Factor 5c3 + 435c*2 - 10890c + 48600. 5(c - 15)(c - 6)(c + 108) Determine v, given that -16v*3 + 2020v*2 - 13858v + 6426 = 0. 1/2, 27/4, 119 Factor -2s4/3 + 2000s*3/3 - 591850s*2/3 + 43565500s/3. -2s(s - 445)*2(s - 110)/3 Let 219i2 + 417i - 720 = 0. Calculate i. -3, 80/73 Suppose 162y4 + 645660y*3 + 358586y*2 - 255032y + 31880 = 0. What is y? -3985, -1, 2/9 Factor 2q3 + 692q*2 + 60770q + 176136. 2(q + 3)(q + 164)(q + 179) Find v such that -3v*2 - 963v + 3900 = 0. -325, 4 Factor b*3/2 - 151b*2 + 4017b/2 + 2160. (b - 288)(b - 15)(b + 1)/2 Factor -5f2 + 47855f - 143520. -5(f - 9568)(f - 3) Factor 3v2/5 + 591v/5 + 27306/5. 3(v + 74)(v + 123)/5 What is p in -4p3 - 41796p*2 - 83580p - 41788 = 0? -10447, -1 Solve -4b5 + 100b*4 + 24b*3 - 2880b*2 = 0 for b. -5, 0, 6, 24 Solve -4l*5 - 188l*4/5 + 128l*3/5 + 2384l*2/5 - 3456l/5 = 0. -8, -27/5, 0, 2 Find c such that -2c4 + 5702c*3 - 4015164c*2 - 70019352c + 74028816 = 0. -18, 1, 1434 Determine h, given that 2h4/13 + 6h*3/13 - 354h*2/13 + 1082h/13 + 1440/13 = 0. -16, -1, 5, 9 Find q, given that -4q4 - 1040q*3 - 27996q*2 + 91328q - 62288 = 0. -229, -34, 1, 2 Factor s*3/5 - 8s*2 + 391s/5 - 216. (s - 27)(s - 8)(s - 5)/5 Find g such that -g*2/4 + 8581g/4 - 25725/2 = 0. 6, 8575 Solve -p*3/3 + 1734p*2 - 2193152p - 486394720/3 = 0. -70, 2636 Factor -2y2 - 9786y - 675220. -2(y + 70)(y + 4823) Factor v*3 + 155v*2 - 3521v - 3675. (v - 21)(v + 1)(v + 175) What is k in -k*4/3 + 298k*3 + 3k*2 - 2682k = 0? -3, 0, 3, 894 Determine t, given that t*2/6 - 195209t/6 + 97604/3 = 0. 1, 195208 Factor -m*2 - 7511m. -m(m + 7511) Find x, given that -5x*4/3 + 2060x*3 - 628220x*2 - 15475360x/3 = 0. -8, 0, 622 Factor 2c3 - 18760c*2 + 149934c + 168696. 2(c - 9372)(c - 9)(c + 1) Solve -168a*3 + 1989a*2 + 330a - 72 = 0. -2/7, 1/8, 12 Solve -4y3/13 + 7990y*2/13 + 3696y + 72126/13 = 0 for y. -3, 4007/2 Suppose a*5 - 74a*4 + 933a*3 + 16884a*2 + 15876a = 0. Calculate a. -9, -1, 0, 42 Suppose -n*3/3 + 564n*2 - 61271n/3 + 19860 = 0. What is n? 1, 36, 1655 Factor -3v2/4 - 3015v/4 - 3003. -3(v + 4)(v + 1001)/4 Factor -i*3/3 + 794i*2/3 + 3991i/3 + 3196/3. -(i - 799)(i + 1)(i + 4)/3 Factor -w*5 - 444w*4 - 68160w*3 - 3952144w*2 - 51539184w. -w(w + 18)(w + 142)*3 Factor 12z*2 + 2832020z - 944008. 4(z + 236002)(3z - 1) Factor j4/3 - 47j*3/3 - 97j*2/3 - 49j/3. j(j - 49)(j + 1)*2/3 Let 3y*2 - 558960y + 26036356800 = 0. Calculate y. 93160 Solve -4n3 + 40n*2 - 36n = 0 for n. 0, 1, 9 Find j, given that -3j4 - 54j*3 + 216j*2 + 582j + 315 = 0. -21, -1, 5 Find m such that 3m3 - 282m*2 + 3315m + 3600 = 0. -1, 15, 80 Determine i, given that 5i4 - 3855i*3 - 192230i*2 = 0. -47, 0, 818 Suppose -2q*4 - 8q*3 + 184q*2 - 192q - 1152 = 0. What is q? -12, -2, 4, 6 Suppose 3q2 - 75q - 9798 = 0. What is q? -46, 71 Factor j*2 + 2552j - 7665. (j - 3)(j + 2555) Factor -5l*4 + 140l*3 - 975l*2 - 140l + 980. -5(l - 14)2(l - 1)(l + 1) Let -2w*3/7 - 228w*2 + 1602w/7 + 3196/7 = 0. Calculate w. -799, -1, 2 Suppose -53792x3/13 - 154160x*2/13 + 512750x/13 - 306250/13 = 0. Calculate x. -5, 175/164 What is a in -a*2 + 344a - 4303 = 0? 13, 331 Determine s so that -4s5 - 20s*4 + 2208s*3 - 16704s*2 = 0. -29, 0, 12 Solve 3v*3 - 83322v*2 + 166635v - 83316 = 0. 1, 27772 Let 2x3/3 - 3052x*2/3 + 389128x - 774192 = 0. What is x? 2, 762 What is c in -24c4 - 940c*3 - 3792c*2 - 1664c = 0? -104/3, -4, -1/2, 0 What is m in -7m3 + 6292m*2 + 7199m + 900 = 0? -1, -1/7, 900 Find m such that 11602m3 - 23198m*2 + 11590m + 6 = 0. -3/5801, 1 Solve 3d4/2 + 5412d*3 + 5392824d*2 + 922204800d + 43554240000 = 0. -1704, -100 Factor 5u2 + 2520u + 39040. 5(u + 16)(u + 488) Factor 3p2 - 2793p + 27630. 3(p - 921)(p - 10) Find w such that 5w4/2 - 50w*3 - 5w*2/2 + 50w = 0. -1, 0, 1, 20 Solve 22w2 - 6626w/7 + 172/7 = 0 for w. 2/77, 43 Let -5k5/3 + 5910k*4 - 15646550k*3/3 - 42026060k*2 - 205145765k/3 - 31577290 = 0. What is k? -6, -1, 1777 Factor -3r4/7 - 24r*3 - 324r*2/7. -3r*2(r + 2)(r + 54)/7 Solve 5v*3/3 + 11570v*2 - 69440v/3 = 0. -6944, 0, 2 Factor -z*2/4 + 2597z/4 - 649. -(z - 2596)(z - 1)/4 Let -b4/5 - 7699b*3/5 + 7706b*2/5 + 9240b = 0. Calculate b. -7700, -2, 0, 3 Factor m*5 + 53m*4 + 970m*3 + 6698m*2 + 10693m + 4913. (m + 1)*2(m + 17)3 Factor o3/4 + 1975o2/2 + 4075977o/4 + 85583943. (o + 92)(o + 1929)2/4 Factor -3s*3 + 55989s*2. -3s*2(s - 18663) Factor -3a2/2 - 147a/2 + 9309. -3(a - 58)(a + 107)/2 Factor 4q3 - 724q*2 + 8156q - 7436. 4(q - 169)(q - 11)(q - 1) What is o in 46o*5/3 + 1330o*4/3 - 150904o*3/3 + 2402168o*2/3 - 1464704o + 121344 = 0? -79, 2/23, 2, 24 Factor 5f4 - 3215f*3 + 28650f*2 - 76160f + 50720. 5(f - 634)(f - 4)*2(f - 1) Factor 3i2 - 22854i + 43525443. 3(i - 3809)2 Factor -4r*3 - 415220r*2. -4r*2(r + 103805) Solve 4d4 + 56d*3 - 7764d*2 + 7576d + 15392 = 0 for d. -52, -1, 2, 37 Let 2l4/5 + 198l*3/5 + 1478l*2/5 + 1962l/5 - 728 = 0. What is l? -91, -5, -4, 1 Determine g, given that -3g4 + 45g*3 - 141g*2 + 99g = 0. 0, 1, 3, 11 Find v, given that -3v3 + 720v*2 + 39204v + 75504 = 0. -44, -2, 286 Factor -2j2/3 - 53699j/3 + 26851. -(j + 26851)(2j - 3)/3 Determine n so that -2n5/5 + 4818n*4/5 + 5802n*3 - 72362n*2/5 - 212688n/5 + 81144 = 0. -7, -3, 2, 2415 Solve -691321849i5/4 - 691952881i*4/4 - 157794i*3 - 36i2 = 0. -1, -12/26293, 0 Let -u4/4 - 309u3/4 + 783u*2/2 - 314u = 0. Calculate u. -314, 0, 1, 4 Let 5k5 - 180k*4 + 535k*3 + 3880k*2 - 17040k + 12800 = 0. What is k? -5, 1, 4, 32 Solve -1830p3 - 12805p*2 + 32975p - 90 = 0 for p. -9, 1/366, 2 Find k, given that 6k5/11 - 552k*4/11 + 3138k*3/11 - 3576k*2/11 - 3144k/11 + 4128/11 = 0. -1, 1, 2, 4, 86 Suppose d*3/3 - 1649d*2 + 2063101d - 175353749/3 = 0. Calculate d. 29, 2459 Let y*3/3 + 239y*2/3 + 1212y - 10212 = 0. Calculate y. -222, -23, 6 Determine g, given that -73441g3/4 + 8401g*2 - 961g = 0. 0, 62/271 Suppose -3s4/7 + 681s*3/7 - 1638s*2 + 37788s/7 - 5016 = 0. Calculate s. 2, 14, 209 Determine n, given that -3n4 - 54n*3 + 3639n*2 - 10350n = 0. -46,	{ "pile_set_name": "DM Mathematics" }
. 40p4 Let v(m) = m. Let j(q) be the first derivative of 29/2q*2 - 21 + 0q. Give j(v(o)). 29o Suppose -4b = 4k - 368, 5b + 0k = k + 442. Let c(z) = 89z + z*2 - bz. Let x(u) = 4u2. Calculate x(c(v)). 4v*4 Let b(x) be the third derivative of -7x*4/12 - 117x*2 - 18x. Let n = 5 + -3. Let j(a) = na - 3a + 0a. What is j(b(q))? 14q Let j(v) = v. Let d(b) = -6b2 + b2 - 11b*2 + 28b + 6b2 + 21b. Calculate d(j(c)). -10c2 + 49c Let x(z) = 17z. Let v(r) = -154r*2. Determine x(v(h)). -2618h2 Let w(v) = v2 - 6v. Let y(t) = 2t*2 - 7t. Let j(h) = -7w(h) + 6y(h). Let f(k) be the first derivative of k*3 - 853. Determine j(f(x)). 45x*4 Let l(n) = -n. Let j(i) = 791i + 33. Give l(j(p)). -791p - 33 Let u(h) = 3h. Suppose -3w + 808 = 5w. Let n(q) = w - 13q - 101. Determine u(n(a)). -39a Let x(n) be the first derivative of 485n2/2 - 623. Let i(l) = -3l. What is x(i(r))? -1455r Let f(p) = -274p*2 + 8145. Let w(x) = 2x. Determine w(f(b)). -548b2 + 16290 Let s(o) = -2o*2 - 29o. Let t(y) = -2209y. Give s(t(u)). -9759362u*2 + 64061u Let t(j) = j. Let l(m) = -3m. Let s(n) = -2l(n) - 7t(n). Let h(f) = -130f + 45. Let u(c) = -3c + 1. Let b(d) = -5h(d) + 225u(d). What is s(b(a))? 25a Let m(v) = 17v2 + 8. Let x(a) = 52a*2 + 26. Let s(q) = 13m(q) - 4x(q). Let h(w) = 8w*2. What is s(h(n))? 832n*4 Let o(m) be the first derivative of -11m*2/2 - 150. Let g(p) = -9p. Give o(g(h)). 99h Let x(y) = 5y + 7. Let r(j) = -4j - 6. Let o(v) = 7r(v) + 6x(v). Let l(z) be the first derivative of -87z*2/2 + 67. Give l(o(f)). -174f Let b(a) = -41a. Let u(d) = 12d - 560. Give u(b(q)). -492q - 560 Let k(l) = l. Let r(g) = -2030g + 67. Determine r(k(o)). -2030o + 67 Let t(g) = 3g + 3g - 4g - g. Let w(r) = 1. Let b(h) = h*2 - 9. Let y(m) = b(m) - 2w(m). Let a(j) be the first derivative of y(j). Give a(t(x)). 2x Let x(b) = 2b*2. Let w(h) = -3h - 4244. Calculate x(w(q)). 18q2 + 50928q + 36023072 Let d(y) = 29y2. Let p(w) = 30w - 44w + 24w. What is d(p(q))? 2900q2 Let k(a) = a. Let m(w) = 26w - 19w - 30w - 16w. What is k(m(i))? -39i Let b(v) = -208v. Let r(m) be the second derivative of -m3/3 + 131m. Determine b(r(s)). 416s Let j(f) = -3f + 10. Let i(l) = l - 5. Let u(h) = 2i(h) + j(h). Let p = 1 - 1. Let q(d) = p - 13d + 0. Determine u(q(y)). 13y Let l(w) be the first derivative of -3w3 + 2. Let s(v) = v3 + 12v2 + 31v + 5. Let h be s(-7). Let j(f) = 33 - f - h. Determine j(l(o)). 9o2 Let j(l) = -2l - 89. Let q(m) = -21. Let v(x) = j(x) - 3q(x). Let b(h) = 13h. Determine b(v(k)). -26k - 338 Let z(j) = -j + 17. Let h(f) = 96f*2. Give h(z(p)). 96p*2 - 3264p + 27744 Let b(h) = -8h2. Let z(l) = -10l*2 + 4l - 2. Let f(m) = -39m2 + 18m - 9. Let u(x) = -2f(x) + 9z(x). Calculate u(b(n)). -768n4 Let b(a) = 6a*2. Let p(d) = -5d + 7. Let w(g) = -g + 15. Let c be w(8). Let q(n) = 2n - 3. Let o(u) = cq(u) + 3p(u). Calculate o(b(f)). -6f*2 Let l(q) = 3q*2. Let m(h) = -3h2 - 5. Let s(n) = n. Let y be s(-6). Let f(i) = i2 + 2. Let r(v) = ym(v) - 15f(v). Determine l(r(b)). 27b4 Let d(j) = 108j2. Let a(u) be the first derivative of u3/3 + 192. Give a(d(v)). 11664v4 Let q(l) = 2l. Let n(w) be the third derivative of -11/24w4 - 5w*2 + 0w + 0 + 0w3. Calculate q(n(g)). -22g Let o(s) be the second derivative of s*3/2 - 46s. Let q(i) = i + 3. Give q(o(k)). 3k + 3 Let j(h) = -22113h + 22113h - 2h*2. Let g(m) = 15m*2 - 3m. Give g(j(y)). 60y4 + 6y*2 Let s(p) = -419p. Let k(n) = 187n + 203n - 390n + 2n2 + n2. Determine k(s(i)). 526683i2 Suppose 0 = q - 0q - 2. Let n(x) = -120 - 124 - 12xq + 244. Let a(i) = -3i. Calculate n(a(g)). -108g2 Let c(j) = -1948j*2 - 12. Let r(d) = 2d. Calculate r(c(g)). -3896g2 - 24 Let s(u) = -u2. Let m(z) be the second derivative of -5z*4/3 + 10z. Let j(k) = 4m(k) - 72s(k). Let w(r) = 2r2. Determine w(j(h)). 128h*4 Let m(l) be the third derivative of 0 - 7/60l*5 - 37l*2 + 0l*4 + 0l*3 + 0l. Let w(q) = 5q2. What is w(m(z))? 245z*4 Let b(u) = -8u2 - 1. Let w(l) be the third derivative of l5/60 + 20l2 + l. What is w(b(k))? 64k*4 + 16k*2 + 1 Let g(c) = 7c. Let q(r) be the third derivative of r4/8 - r2 - 2r. Calculate q(g(l)). 21l Let o(h) = 9h. Let r(q) be the first derivative of q2/2 + 38. Calculate o(r(w)). 9w Let h(t) = -2t - 34. Let j(o) = -2o*2 + 38o - 8. Determine h(j(n)). 4n2 - 76n - 18 Let h(q) = q*2. Let d(g) = 96021g. Give h(d(y)). 9220032441y2 Let x(c) be the first derivative of -c3 + 5c*2/2 - 9. Let t(j) = 2j*2 - 3j. Let o(a) = 5t(a) + 3x(a). Let g(p) = 4 - 4 - p. Determine o(g(z)). z*2 Let l(d) = d + 0 + 0. Let h(y) = -3y. Let a(z) = 5h(z) + 12l(z). Let w(u) = u + 5u - 5u. Give a(w(n)). -3n Let o(z) = -15872z - 12. Let v(c) = -13c2. What is o(v(m))? 206336m*2 - 12 Let u(h) be the third derivative of 0 + 0h*4 + 2/15h*5 + 0h + 27h2 + 0h*3. Let t(x) = 8x. Give t(u(l)). 64l2 Let c(m) = -4m. Let q(g) = 4g2 - 20g*2 + 288 - 288. What is q(c(d))? -256d*2 Let l(c) be the first derivative of -59c*3/3 + 254. Let a(n) = 4n. Calculate l(a(v)). -944v2 Let u(p) = -4p + 0p + 3p - 2p. Let i(n) be the second derivative of -7n*3/6 + n - 10. Give i(u(l)). 21l Let t(o) = -3o. Let l(j) be the third derivative of 0j*3 + 15j*2 - 11/12j*4 + 0j + 0. Give t(l(v)). 66v Let j(d) = -458d. Let q(y) = -6y2 + 4y - 4. Let s(r) = -r*2 + r - 1. Let g(l) = q(l) - 4s(l). Determine j(g(k)). 916k2 Let w(y) = 2y. Suppose -7x - 17x = 0. Let t(i) be the second derivative of 1/6i4 + 0i*3 + 0i*2 - 4i + x. What is w(t(m))? 4m2 Let w(f) = -13631f. Let h(t) = -6t2. Calculate h(w(l)). -1114824966l*2 Let s(n) = -19 + 33 + n - 14. Let l(f) = -3f + 13. Calculate s(l(u)). -3u + 13 Let q(b) = 9b. Let d(t) = -t. Let j be (-76)/(-18) + 6/(-27). Let p(s) = -4s. Let i(y) = jp(y) - 14d(y). Give i(q(l)). -18l Let n(t) = 11t2 - 15t. Let z(k) = -2k - 4. Let m(y) = 2. Let l(c) = -2m(c) - z(c). Give l(n(j)). 22j2 - 30j Let p(d) be the third derivative of -d*5/60 + 2d*2. Let z(x) = -x + 7. Let m be z(5). Let r(o) = 5o - mo + 0o - 4o. Calculate p(r(j)). -j2 Let z(m) = 1. Let a(w) = 5w*2 - 6. Let x(j) = -a(j) - 6z(j). Let p(b) = 15b - 43b + 21b. Calculate p(x(g)). 35g*2 Let y(f) = 3f2. Let q(b) be the third derivative of b8/4032 + b*5/12 - 13b*2. Let a(d) be the third derivative of q(d). Give y(a(t)). 75t*4 Let t(m) = -m + 80. Let h(g) = -272g. Calculate h(t(y)). 272y - 21760 Let x(r) = 3r*2 - 2323. Let n(z) = 2z*2. What is x(n(y))? 12y*4 - 2323 Let t(n) = -2n*2 - 24n. Let c(l) = l - 36. Calculate c(t(p)). -2p2 - 24p - 36 Let z(n) = -36n. Let f = -84 - -79. Let c(v) = -2v + 2. Let o(a) = -6a + 5. Let t(r) = fc(r) + 2o(r). Give t(z(p)). 72p Let i(x) be the third derivative of 11x5/20 + 2x*2. Let y(m) = -5m - 4. Let f(j) = 6j + 5. Let z(k) = -4f(k) - 5y(k). Calculate i(z(a)). 33a*2 Let a(b) = 2b*2. Let f(u) = -35347u. Calculate f(a(p)). -70694p2 Let q(w) be the third derivative of -13w*6/360 - 2w3/3 - w2. Let l(o) be the first derivative of q(o). Let s(y) = y. What is s(l(v))? -13v2 Let i(r) = -r + 2. Let n(f) = 27f - 42. Let l(k) = -63i(k) - 3n(k). Let v(t) = -7t2. Give v(l(h)). -2268h*2 Let u(a) = -10a*2. Suppose -20x = -10 - 50. Let c(j) be the first derivative of -2 + 1/3jx + 0j + 0j2. Give c(u(y)). 100y4 Let k(o) = o2. Let f(m) = 73m + 25 - 26 - 213m. Give k(f(l)). 19600l2 + 280l + 1 Let p(o) = 8814o2. Let r(y) = 13y. What is p(r(v))? 1489566v2 Let o(m) be the third derivative of -m8/10080 + m5/60 - 21m*2. Let b(z) be the third derivative of o(z). Let v(w) = -3w. Give v(b(q)). 6q2 Let r(l) = 2l*2. Suppose -6q = -4q - o + 16, 0 = -5q + 3o - 39. Let c be q/(-36) - (-59)/4. Let z(a) = 33 - c - a - 18. Determine z(r(j)). -2j*2 Let p(a) = 72a. Let w be (-30)/(-40) + 2/8. Let m(h) = h. Let s(y) = wp(y) - 15m(y). Let x(k) = 2k2. Calculate x(s(i)). 6498i*2 Let w(h) = 76 + 2h**2 + 60 - 1	{ "pile_set_name": "DM Mathematics" }
8. Let c(a) = -204l(a) + 3q(a). Determine c(m(i)). -24480i Let m be 1/(-2) - (-3 - 2/4). Let y(f) = -mf - 7f + 25f. Let j(d) = -d + 2. Let v(r) = -3r + 7. Let o(n) = 7j(n) - 2v(n). Give y(o(l)). -15l Let s(o) = -21o - 7746. Let m(p) = 100p - 2. What is m(s(g))? -2100g - 774602 Let x(l) = -5l. Let c = -139 - -146. Suppose cn - 397 + 26 = 0. Let y(v) = 53 - 4v - 106 + n. Calculate x(y(j)). 20j Let m(n) = -38n*2. Let v(g) = -187g*2 + 253 + 20g*2 - 512 + 259. Calculate m(v(q)). -1059782q*4 Suppose -8y - 125 + 141 = 0. Let g(u) = -1095 + 1095 - 34uy. Let r(i) = -2i*2. Calculate r(g(k)). -2312k4 Let g(c) = c3 + 33c2 + 89c - 27. Let a be g(-30). Let y(n) = -46n + 93n - 2n2 - 47n - an2. Let u(o) = -35o - 1. Calculate y(u(v)). -6125v2 - 350v - 5 Let y(g) be the second derivative of 1/6g3 - 6g + 2 + 0g2. Let t(q) = -q2 - 2q*2 + 7q*2. Determine y(t(a)). 4a*2 Let x(v) = -2v. Let m(f) = -f*2 - 26f - 125. Let j be m(-7). Let b(p) = -1. Let w(l) = 8l - 8. Let d(g) = jb(g) - w(g). Calculate d(x(u)). 16u Let r(k) = 1122k + 1112k - 2233k. Let x(w) = 420w2 - w. Determine x(r(b)). 420b2 - b Let m(k) = -1 + k2 + 0 + 1. Let i(p) be the first derivative of -p*3 + 9/2p*2 + 27 + 0p. Give i(m(w)). -3w4 + 9w2 Let o(f) be the third derivative of -f5/20 + 5f2 + 10f. Let d(k) be the third derivative of -k*5/3 + 10k*2. Determine o(d(n)). -1200n*4 Let q(f) = -2f. Let z(n) = -285255 + 3811n + 142625 + 142630. Give q(z(v)). -7622v Let q(b) = -2. Let j(a) = -a - 7. Suppose 2k - 5 = 2t - k, 0 = -3t + 4k - 6. Let c(g) = tj(g) - 7q(g). Let p(v) = 3v + 16. Calculate c(p(u)). -6u - 32 Let v(o) = o - 7. Let q(y) = -1589y2 - 7y + 49. Let t(u) = -q(u) - 7v(u). Let d(c) = -c2. Determine t(d(s)). 1589s*4 Let j(d) = -17d*2. Let a(h) = 261h*2 - 4358h - 1. Give a(j(q)). 75429q4 + 74086q2 - 1 Let r(t) be the third derivative of -t4/12 - 149t2. Let i(z) = -58z*2 + 5z. What is i(r(h))? -232h2 - 10h Let s(p) = 4p - 5. Let z(l) = -144l + 192. Let w(q) = -192s(q) - 5z(q). Let h(o) = 91o2. Calculate w(h(t)). -4368t*2 Let u(p) = -5p. Let c = -3207 + 3207. Let s(b) be the third derivative of 5/24b4 + 0b*3 + c - 12b*2 + 0b. Determine s(u(l)). -25l Let r(x) be the third derivative of x4/8 - x2. Let a(q) = 3309q - 3 - 1641q - 1671q. What is r(a(s))? -9s - 9 Let g(a) = -7972425a. Let f(j) = 3j2. Calculate g(f(b)). -23917275b*2 Let g(h) = 1234622h. Let a(w) = -2w. Give g(a(c)). -2469244c Let m(j) = -17j + 0j + j*2 - 4j*2 + 8j + 1108 + 10j. Let w(l) = 2l. What is w(m(c))? -6c2 + 2c + 2216 Suppose -3217 = -179r + 1974. Let o(t) be the second derivative of 0t*2 - 3/2t*3 - rt + 0. Let g(a) = -a. What is o(g(h))? 9h Let b(f) = 441f - 1252f - 980f - 472f. Let z(n) = -4n. Calculate z(b(t)). 9052t Let o(c) = -7c*2. Let a(d) = -18d + 55d + 13d + 81d - 11d. Give a(o(h)). -840h2 Let q(r) = -r2 + 2. Let h(c) = -2c*2 + 5. Let n(w) = 2h(w) - 5q(w). Suppose 8t = 7t + 2. Let s(d) = td + 227d2 - 230d*2 - 2d. Calculate s(n(a)). -3a4 Let c(h) be the first derivative of -49h*2/2 - 15h + 1. Let n(g) = -73g - 24. Let a(t) = -8c(t) + 5n(t). Let o(x) = 2x. What is a(o(w))? 54w Let a(w) = -31801 - 31807 + 2w + 63608. Let g(c) = 4c - 7. Determine g(a(r)). 8r - 7 Let q(f) = 164362f + 1. Let x(v) = 19v. Calculate q(x(p)). 3122878p + 1 Let v(f) = 2f*2 + 16 - 17 - 31 - 33. Let q(u) = 3u*2. Calculate q(v(a)). 12a*4 - 780a*2 + 12675 Let z(t) = -4t + 3. Let x(w) = -253w + 5 - 7 + 256w. Let o be (1 + 2)(-4)/6. Let g(u) = oz(u) - 3x(u). Let b(q) = -8q. Calculate g(b(c)). 8c Let i(l) = -9l*2 - 4l + 4. Let w(t) = -7t2 - 3t + 3. Let f(j) = -3i(j) + 4w(j). Let h(k) = -15950k2. Give f(h(p)). -254402500p*4 Let r(d) = 29d - 36. Let m(z) = z - 1. Let k(x) = 6m(x) + r(x). Let h(s) = -8s + 10. Let n(j) = -21h(j) - 5k(j). Let t(w) = -11w. Calculate t(n(f)). 77f Let o(r) = -136r + 795. Let j(h) = 3h*2 + 3h. Calculate o(j(f)). -408f2 - 408f + 795 Let l(v) = -21v. Let f(w) be the first derivative of -w4/12 + 15w*2/2 - w + 65. Let c(b) be the second derivative of f(b). Give l(c(d)). 42d Let d(c) = 2c2. Let y be (-7)/(-21) - (-2824)/6. Let o = y - 327. Let x(w) = -144 - 3w + o. Determine d(x(i)). 18i2 Let m(r) = -52r - 39r + 190r - 52r - 49r. Let c(b) be the third derivative of 13b4/12 - b2. Determine m(c(a)). -52a Let b(k) = 188k. Let f(s) = 4860750s. Calculate f(b(d)). 913821000d Let b(d) = 61d*2 + 6d + 6. Let w(z) = -117z2 - 11z - 11. Let s(k) = -11b(k) - 6w(k). Let r(f) = 25f. Determine r(s(u)). 775u*2 Let j(z) = z - 3 - 4 + 7. Let k(s) = -4469s - 9 + 2234s + 2221s. Determine j(k(l)). -14l - 9 Let b(a) = -35a*2. Suppose -d + 4t = -16, 6d - 11d = 7t + 28. Let v(m) be the second derivative of 1/6m*3 + dm*2 + 0 + 21m. What is v(b(q))? -35q2 Let v(w) = -307w2 + 8. Let p(t) be the third derivative of -t4/24 + 2885t2. Give v(p(l)). -307l*2 + 8 Let m(p) = -10p*2. Let x(q) = -557q + 2. Determine m(x(r)). -3102490r2 + 22280r - 40 Let c(m) = -11m2. Let y(l) be the second derivative of -89l*3 + 57l - 1. What is y(c(t))? 5874t2 Let m(w) = 2083w. Let q(x) = 2x2 + 2x + 947. Calculate m(q(f)). 4166f2 + 4166f + 1972601 Let y(u) be the first derivative of 2/3u3 - 241 + 0u + 0u2. Let f(v) = 278v. Give f(y(o)). 556o2 Let n(t) = t. Let w(d) = 36d*2 + 4565d - 6. Determine n(w(j)). 36j2 + 4565j - 6 Let j(y) = -214y - 402. Let u(t) = -38t*2 - 2t. Determine j(u(f)). 8132f2 + 428f - 402 Let j = -30 - -27. Let v be -1 - -2 - (-2)/(-6)j. Let l(n) = -22n*v - 27n*2 + 35n*2. Let w(k) = -2k*2. Determine l(w(f)). -56f4 Let i(u) = u2. Suppose -3s - 2s = -90. Let z be (4/12)/((-3)/s-1). Let f(m) = -7m - 2 + 5m + z. Calculate f(i(n)). -2n*2 Let k(q) = 10803q + 5. Let d(h) = -12h2 - 3h. Calculate k(d(o)). -129636o2 - 32409o + 5 Let y(b) = 2b + 2808. Let j(d) = -51231d*2. What is y(j(g))? -102462g*2 + 2808 Let k(c) = 6342c. Let h(a) = 46036a2. What is h(k(x))? 1851612298704x*2 Let j = -159 + 52. Let g = j - -51. Let x(o) = -4o*2 + 14. Let m(y) = -1. Let s(f) = gm(f) - 4x(f). Let a(c) = -c2. What is a(s(z))? -256z*4 Let a(b) = -2b. Let n(f) = 4019f2 + 1085f + 20. Determine a(n(m)). -8038m2 - 2170m - 40 Let f(k) be the third derivative of 1 - 166k2 + 0k*4 + 0k*3 + 3/10k*5 + 0k. Let w(c) be the third derivative of -c*4/8 + 2c*2. What is f(w(r))? 162r2 Let z(n) be the first derivative of n2 - 2239. Let d(j) be the second derivative of -j*3/6 + j. Give z(d(p)). -2p Let l(g) be the second derivative of -g*3/6 - 21g. Let k(o) = 10o2 + 5o. Let v(p) = 10p2 + 4p. Let d(n) = 4k(n) - 5v(n). Calculate l(d(f)). 10f2 Let z(f) = 2f - 1. Let i(n) = 377n - 59n - 123n - 142n. Give z(i(d)). 106d - 1 Let k(n) = -5n - 106 + 45 + 61 + 102n. Let j(q) = 13q. What is j(k(r))? 1261r Let g(t) = -6t*2 + 6t - 19. Let k(i) = 1742i2 - 4i + 4i - 1743i*2. Calculate g(k(p)). -6p*4 - 6p*2 - 19 Let k = -25 - -27. Let a(o) = -13o*2 - 15o*2 + 32o*k. Let z(r) = 2r*2. Determine z(a(y)). 32y*4 Let o(n) = n - 579. Let x(b) = 251b*2 + b. Give x(o(m)). 251m*2 - 290657m + 84144912 Let a(p) = -136p2. Let h(f) = 1884091f + 37 - 1884093f - 1. What is a(h(s))? -544s*2 + 19584s - 176256 Let p(j) = j. Let o(s) = -2s. Let i(b) = -3o(b) - 4p(b). Let d(y) = -345y. Calculate i(d(v)). -690v Let s(h) = -5h. Suppose -269o + 1004 = 81 + 116. Let f(b) be the third derivative of -2b + 0 - 17b2 + 0b*o + 1/30b*5 + 0b*4. Give s(f(w)). -10w*2 Let f(w) = -1143w + 10. Let u(m) = 5m2 - 24. Calculate u(f(x)). 6532245x*2 - 114300x + 476 Let t(b) = -42 + 42 + 26604b2 - 27142b2. Let x(q) = -q2. What is t(x(y))? -538y4 Let z(j) = -7j*2. Let i = -185 + 187. Let m(q) = -12q*2 + 0 + 0 + 8q*i. Determine m(z(v)). -196v*4 Let p(g) = 13g*2 - 2651g + 32. Let m(y) = 19y2. What is p(m(d))? 4693d*4 - 50369d*2 + 32 Let v(z) = -2035624z. Let q(k) = -k + 52. What is q	{ "pile_set_name": "DM Mathematics" }
+ 174. Suppose 5j + 4056 = vb, 4b = 4j + 1940 + 2112. Is b a prime number? True Let o be (10 + -2)(7/(-2) - -4). Is 199236/(-9)((-55)/10 + o) a prime number? False Suppose -3u - 22 + 34 = 0. Suppose ug - 5a = 2725, 3a = 3g - 740 - 1300. Suppose 2m = -x + g, -2424 = -5m - 4x - 735. Is m composite? False Suppose -1008x + 1016x + 15381 = 97229. Is x a composite number? True Suppose 572 - 50 = 9q. Let g = 52 - q. Is 3((-8)/(-4))/g - -1362 a prime number? True Suppose 3l = -63721 + 6985. Let c = 33925 + l. Is c a prime number? True Let p(w) = w3 + 10w*2 - 3w - 10. Let x be p(-10). Suppose -3b + 32 = x. Suppose 3f - 5138 = -5c, -5c - f + 1028 = -bc. Is c a prime number? False Let a(h) = 171h - 59. Let k(c) = c + 2. Let r(u) = a(u) - 3k(u). Is r(24) prime? True Suppose -541c + 227810950 = -247970959. Is c prime? True Let h(o) = -178o - 9. Let q = -48 + 44. Let u be h(q). Let g = u - 230. Is g prime? False Let g = -12209 + 12473. Let n = 264 - 83. Suppose 0 = -b - f + n + 87, 5f = -b + g. Is b prime? True Suppose -4 = u, -15868 = -x - 2u + 4u. Suppose 4j = -g - 3g + x, 2g - 2j - 7938 = 0. Is g composite? False Suppose 3r = -11798 + 22292. Suppose -h = -0h. Suppose -2n - 4n + r = h. Is n a composite number? True Let s be (-10)/(-10) + -2 + 3. Let v be 5578/9 - 26/(-117). Suppose -5l + v = 3h, -sh + 257 = 3l - 114. Is l prime? True Suppose -4z + 7z + 4j - 5215 = 0, -5z + 3j = -8740. Suppose 7c = 6c + z. Is c a prime number? False Suppose 3w = 4g + 5w - 42, -7 = g + 4w. Is (23703/(-6))/(g/(-26)) a prime number? True Let b(l) = -106704l3 + l2 - l - 3. Is b(-1) prime? True Let i(s) = -9s3 - 2s*2 + 2s + 2. Suppose j + 5u = 14 + 15, -j + 4u + 2 = 0. Suppose -jd - 21 - 21 = 0. Is i(d) a composite number? True Suppose 28n - 519277 = 17n + 446710. Is n a prime number? False Suppose -32b = -5b. Suppose 3u - 4050 = -y + 4u, 3y + 2u - 12145 = b. Is y a prime number? True Suppose -4l + 50 = 5p, 4p + 1 - 37 = -4l. Suppose q = 3y - 2855, py - 10y - 3802 = -q. Is y composite? True Suppose 0 = -51w + 135w + 99w - 5876679. Is w composite? True Let g(q) = -2q*2 + 12q + 25. Let l be g(-2). Is (7/14)/(l/(-230986)) a composite number? True Let t(x) = 2x3 + 36x*2 + 25x + 41. Let v(u) = -5u3 - 107u*2 - 75u - 123. Let l(s) = -8t(s) - 3v(s). Is l(-14) prime? False Suppose 2h + 0h - 1766 = 0. Let a = h - 564. Is a a prime number? False Let j(i) = 31041i - 1027. Is j(20) prime? True Let t(d) be the second derivative of -13d*3/6 + 27d*2/2 - 38d. Is t(-10) prime? True Let b = -8150 + 18492. Is b prime? False Suppose -4t = 3s - 87921, s + 4t - 34204 = -4889. Is s prime? True Let z(s) = 5s - 73. Let v be z(15). Is v/((-4)/6) + (-6 - -16342) prime? True Let a(z) be the first derivative of -129z2/2 + 143z + 229. Is a(-14) a composite number? False Let c(w) = -w*3 - 16w*2 - 17w + 13. Let o be c(-16). Let m be o/25 + (-3)/(-5). Is (586/m)/(2 + (-55)/30) composite? False Let v(u) = 22u2 - 22u + 128 + 124 - 275. Is v(-15) a prime number? False Let c(g) = 43g2 + 2g + 23. Let b(y) be the third derivative of y6/120 + y5/12 + y4/12 + y3/3 + 4y2. Let v be b(-5). Is c(v) composite? True Let f(i) be the second derivative of -i4/3 + i3/3 + 8371i*2/2 - 43i + 2. Is f(0) composite? True Let f = -41 + 36. Is f/((-5)/1851) - 4 composite? False Let l(i) = 3608i - 1185. Is l(23) a composite number? False Suppose -3003528 = -82b + 3738266. Is b composite? False Suppose 4s = 4c - 93076, -4c = s + 3353 + 19901. Let t = s + 34817. Is t prime? True Let w(h) = 13h - 7. Let q(r) = r*3 + 8r*2 + 8. Let g be q(-6). Let c be (2/123)/(8/g). Is w(c) prime? False Let x(f) = 230f2 + 12f + 17. Let b be 5 + 77/(-14) + 14/(-4). Is x(b) composite? True Let b be 49902/(-21) - (-4 + (-52)/(-14)). Is (0 - 2 - b) + -3 composite? False Suppose 45x - 23x - 88 = 0. Suppose 1370 = 2w - xj, -4w - 1080 = -2j - 3838. Is w a composite number? False Suppose -2160 = p + 3s, -1063 = p - 5s + 1097. Let j = p + 4678. Is j prime? False Let c = 74 - 75. Is c/4-1 + (-48870)/(-72) a prime number? False Let o(a) = 339a*2 - 24a - 9. Let k be o(-7). Let f = k + -8956. Is f a prime number? False Suppose -44q = -4q - 1040. Is (4/(-2))/(q/(-10673)) a composite number? False Let k = 11056 - 7651. Let v = -2402 + k. Is v a composite number? True Suppose 3h + h + 2o = 7276, 3h - o - 5457 = 0. Let a = h - -4130. Suppose 7k = a + 4418. Is k prime? True Let i = 1858 + 1112. Is i/4 + (-11)/(-22) a composite number? False Suppose 1990 = -70m + 69m. Let i = m + 3072. Is i a composite number? True Let n = -605 - -611. Is (-10 + 12)/(n/13179) a composite number? True Let z be -3 - -6 - (2 + 6/(-2)). Suppose 6h + zh = 5h. Suppose h = m + 4, 4m - 1576 = -3a + 2137. Is a a composite number? True Let q = 294 + -184. Let x be q/25 - (13/(-5) + 3). Suppose 2558 = xp - 3b + 643, 2 = -2b. Is p a prime number? False Let m(v) = -9v. Let b be m(-1). Suppose -5l + 305 = -3a, 8l - 159 = 5l - 3a. Suppose -2d = -2y + l, -by + 4y = -2d - 133. Is y a prime number? False Is (655/(-15))/(-4 + 7615/1905) a composite number? True Suppose -16151 + 233543 = -16h. Let t = h + 20090. Is t a prime number? False Let w = 60277 + -16616. Is w composite? False Let m(u) be the third derivative of 7u6/8 + 7u*5/60 - 3u*4/2 - 5u*3/2 - 156u*2. Is m(8) composite? True Let c(j) be the third derivative of -77j*4/4 - 37j3/6 + j2 + 5j. Is c(-11) composite? True Suppose 76235 = -8v + 463891. Is 4/6 - v/(-3) a prime number? False Let n = 296 - 293. Suppose nj - 2472 - 3297 = 0. Is j composite? True Suppose -r - 3x + 12177 = 3r, 15223 = 5r + 2x. Suppose 0 = -n + 1228 - 3386. Let d = n + r. Is d prime? True Suppose 0 = 5r - 4t - 30, 0r - 4t - 18 = r. Suppose -o + 2o - 3s - 344 = 0, -4s = -ro + 696. Let h = o + -215. Is h composite? True Let d = 311 - 582. Suppose 0 = -31c - 69c - 11000. Let v = c - d. Is v composite? True Suppose -411c = -402c - 530163. Is c a prime number? True Let m(z) = 5547z + 19. Let q be m(4). Suppose -5p - s = q, 3534 = -p - 5s - 893. Is (-6)/(-14) + p/(-7) prime? False Suppose -5z - 5v = 105 - 345, 57 = z + 4v. Suppose -12a = -15a - 9, 5a = -m - 11. Is m/18 - (-103805)/z a composite number? True Suppose -2l = -2o - 276416, -4o - 71 + 75 = 0. Is l prime? True Let y(d) = 144541d - 810. Is y(5) a composite number? True Let h(b) = -18b3 - 54b*2 - 32b + 95. Is h(-22) a prime number? False Let b(t) = -13t + 90. Let f be b(6). Let k(j) = 77j + 17. Is k(f) a composite number? False Let h be (-20)/(-25)(-5)/(-2). Suppose 3w - hq - 277 = 2q, 2w - 5q = 187. Suppose 3f - 1004 = 2n - w, -4n = -5f + 1523. Is f prime? False Let k(h) = 4970h2 + 38h - 29. Is k(8) a composite number? True Let s be (-6)/27 + (-14)/18. Let a(t) = -160t3 - 2t*2 - 4t - 3. Let z be a(s). Let i = z - 112. Is i a composite number? False Let m be 2354 + (3 - 8 - -4). Let q = m + -930. Is q composite? False Let v(u) = -1836u - 2. Let n(h) = 1835h + 2. Let m(d) = -6n(d) - 5v(d). Let x(y) = 2745y + 3. Let i(a) = -7m(a) - 5x(a). Is i(-4) prime? True Suppose 0 = 77r - 65r - 1403436. Is r composite? False Let j(y) be the third derivative of 7/24y*4 - 11y*2 + 0y + 3/2y3 + 0 + 13/60y*5. Is j(-5) a prime number? False Suppose -i - 1 = 1, -5j + 2i = -5374. Suppose 5s - j + 34 = 0. Suppose 3o - s = 173. Is o a composite number? False Let y = 41 - 36. Suppose -f + 9 + 2 = 2n, -25 = -2f - yn. Suppose -4u + 1056 + 2527 = i, -u = -fi - 880. Is u a prime number? False Let y(j) = -102j3 - 38j*2 - 18j - 37. Is y(-15) a composite number? True Suppose 2b + c - 3c - 32 = 0, 3b - 48 = 5c. Suppose -a = 3a - b, 3m = 2a + 250. Suppose -2o + q + 49 = 0, 4o - 3q = -5q + m. Is o a composite number? False Let o be 1(-674)/(-10) + 4/(-10). Let i = 130 - 70. Let f = o + i. Is f a composite number? False Suppose 5k - 3472617 = o, -5k - 1613o = -1616o - 3472621. Is k composite? False Let y be ((-6)/4)/((-12)/56). Suppose -5b = yb + 1596. Let m = b - -386. Is m prime? False Let k be (-3)/(1*2/(4 - 2)). Is ((-5048 - k)	{ "pile_set_name": "DM Mathematics" }
ence mxxm when four letters picked without replacement from {x: 13, m: 5}. 13/306 Two letters picked without replacement from hhhxhhhhxhhh. What is prob of sequence xx? 1/66 Calculate prob of sequence ccc when three letters picked without replacement from {c: 7}. 1 Calculate prob of sequence rcc when three letters picked without replacement from {d: 2, c: 3, r: 7}. 7/220 Calculate prob of sequence ea when two letters picked without replacement from {e: 7, a: 9, d: 1, u: 2}. 7/38 Three letters picked without replacement from illllii. Give prob of sequence lll. 4/35 Two letters picked without replacement from {r: 2, n: 1, m: 1, x: 1, o: 1, k: 1}. Give prob of sequence rx. 1/21 Calculate prob of sequence njf when three letters picked without replacement from fjjnj. 1/20 Three letters picked without replacement from rrrmhmrmhhmhrmrmm. Give prob of sequence rhr. 1/34 What is prob of sequence fm when two letters picked without replacement from {f: 2, q: 7, m: 2, z: 1}? 1/33 Three letters picked without replacement from puxxxwtwxbxtt. What is prob of sequence uxb? 5/1716 Four letters picked without replacement from jjjjjjj. Give prob of sequence jjjj. 1 Two letters picked without replacement from fgpfpgfffffppgff. Give prob of sequence pf. 3/20 What is prob of sequence geg when three letters picked without replacement from {g: 9, e: 9}? 9/68 Calculate prob of sequence wh when two letters picked without replacement from {d: 2, w: 1, h: 4, r: 1, u: 1}. 1/18 Three letters picked without replacement from {a: 3, x: 1, z: 13, g: 2}. Give prob of sequence xaz. 13/1938 Three letters picked without replacement from {d: 8, n: 1, b: 4}. What is prob of sequence bdb? 8/143 Four letters picked without replacement from xxexxxddvpdxxpxexxve. Give prob of sequence eexe. 1/1938 Calculate prob of sequence zec when three letters picked without replacement from eeicccecczzzz. 5/143 Two letters picked without replacement from kivkckvkkkik. What is prob of sequence ic? 1/66 Calculate prob of sequence wzxw when four letters picked without replacement from {f: 1, r: 6, z: 1, w: 2, x: 2}. 1/2970 Calculate prob of sequence uuum when four letters picked without replacement from {u: 4, m: 10}. 10/1001 Calculate prob of sequence bn when two letters picked without replacement from begebbgbennbknbeb. 21/272 Three letters picked without replacement from {s: 6, r: 4, n: 5, b: 5}. Give prob of sequence nrr. 1/114 Calculate prob of sequence li when two letters picked without replacement from villiiiqlvqivlqviii. 16/171 Calculate prob of sequence ppg when three letters picked without replacement from ppgpgppgpppgpppppp. 91/612 What is prob of sequence anrn when four letters picked without replacement from {a: 1, r: 11, n: 7}? 77/15504 Four letters picked without replacement from hwmwwwwhwwwwwwm. Give prob of sequence mhhm. 1/8190 What is prob of sequence uuu when three letters picked without replacement from {u: 6, a: 2}? 5/14 Three letters picked without replacement from vvvvccswcvvvcvv. What is prob of sequence wcs? 2/1365 Three letters picked without replacement from mqqmypwpmpwqqqqpy. What is prob of sequence yyp? 1/510 Four letters picked without replacement from npnpnnnpnnunnupnnnp. What is prob of sequence pnuu? 5/3876 Calculate prob of sequence jsjc when four letters picked without replacement from scjcccsjjssccc. 1/143 What is prob of sequence tul when three letters picked without replacement from {u: 3, t: 3, l: 2}? 3/56 Two letters picked without replacement from {a: 1, l: 3, r: 1, e: 6, d: 1}. What is prob of sequence al? 1/44 What is prob of sequence ujrf when four letters picked without replacement from {r: 2, k: 1, u: 3, f: 2, a: 3, j: 4}? 2/1365 Four letters picked without replacement from {s: 1, y: 9, p: 2, l: 2}. What is prob of sequence splp? 1/6006 What is prob of sequence cu when two letters picked without replacement from {x: 2, u: 2, w: 1, c: 4}? 1/9 Calculate prob of sequence jd when two letters picked without replacement from odjujujjj. 5/72 What is prob of sequence jpf when three letters picked without replacement from ppjkkkpkkkpfk? 1/429 Two letters picked without replacement from {t: 1, u: 1, k: 1, l: 1, c: 1}. Give prob of sequence lu. 1/20 What is prob of sequence cqqc when four letters picked without replacement from uccuuqaaaqaa? 1/2970 Two letters picked without replacement from {q: 1, v: 2, k: 1, m: 1, y: 1, i: 2}. What is prob of sequence qm? 1/56 What is prob of sequence lr when two letters picked without replacement from {a: 2, r: 1, s: 1, g: 1, l: 2, j: 1}? 1/28 Three letters picked without replacement from cxhjconhxjjcjjjncnon. Give prob of sequence xnc. 4/855 What is prob of sequence jxjj when four letters picked without replacement from {j: 3, x: 4}? 1/35 Calculate prob of sequence ttj when three letters picked without replacement from {t: 3, j: 9}. 9/220 Calculate prob of sequence xcp when three letters picked without replacement from {x: 1, w: 5, c: 2, d: 1, p: 6}. 2/455 Four letters picked without replacement from irrri. Give prob of sequence iiri. 0 Four letters picked without replacement from {c: 4, b: 2, w: 1, z: 1, u: 2, f: 2}. Give prob of sequence ffcu. 2/1485 What is prob of sequence neoe when four letters picked without replacement from {e: 2, n: 1, o: 1}? 1/12 Calculate prob of sequence rrq when three letters picked without replacement from {q: 2, r: 1}. 0 What is prob of sequence bb when two letters picked without replacement from lllllbllbllllllllll? 1/171 Three letters picked without replacement from {z: 2, y: 1, i: 1}. Give prob of sequence yiz. 1/12 Calculate prob of sequence uy when two letters picked without replacement from uyuy. 1/3 What is prob of sequence vvmm when four letters picked without replacement from mmvmmmmmmvmvmmvv? 55/1092 Three letters picked without replacement from {t: 1, g: 2, y: 1, z: 1}. Give prob of sequence yzg. 1/30 Calculate prob of sequence lfsf when four letters picked without replacement from {l: 6, r: 2, e: 4, d: 1, f: 2, s: 4}. 1/1938 Three letters picked without replacement from mufmdvuuuhdumuf. What is prob of sequence uvf? 2/455 Four letters picked without replacement from {b: 13, w: 5}. Give prob of sequence bbww. 13/306 What is prob of sequence hkkt when four letters picked without replacement from {t: 9, h: 6, k: 4}? 9/1292 Two letters picked without replacement from doodhdodododh. Give prob of sequence hd. 1/13 Calculate prob of sequence bgbg when four letters picked without replacement from bbgggbgbbbbbggggbbgg. 45/646 What is prob of sequence zdf when three letters picked without replacement from yqfpddzyfyqqzy? 1/273 What is prob of sequence xxx when three letters picked without replacement from {x: 9, h: 7}? 3/20 Three letters picked without replacement from {y: 3, m: 3, i: 1}. Give prob of sequence miy. 3/70 Calculate prob of sequence zjz when three letters picked without replacement from {d: 2, g: 1, z: 2, j: 1, k: 1}. 1/105 Calculate prob of sequence zgg when three letters picked without replacement from {i: 1, g: 2, e: 4, j: 1, z: 2}. 1/180 Calculate prob of sequence wwx when three letters picked without replacement from xwx. 0 Two letters picked without replacement from bblbbbblbbb. What is prob of sequence ll? 1/55 Three letters picked without replacement from ngggngb. Give prob of sequence ggg. 4/35 What is prob of sequence eed when three letters picked without replacement from {e: 4, d: 15}? 10/323 Four letters picked without replacement from pbsbpbpsbsbs. What is prob of sequence bpsp? 1/99 Four letters picked without replacement from vdvokkvwowzozw. Give prob of sequence dzvo. 3/4004 Three letters picked without replacement from zzuupcwuwzzcucuuu. What is prob of sequence uzc? 7/340 What is prob of sequence yayy when four letters picked without replacement from uauyuyujuayauju? 1/1820 Two letters picked without replacement from jjjjjjjhjjjj. Give prob of sequence jj. 5/6 Three letters picked without replacement from jjjjjjjjnjn. What is prob of sequence jjj? 28/55 Two letters picked without replacement from osdduss. What is prob of sequence ss? 1/7 Three letters picked without replacement from {t: 2, b: 2, r: 1, h: 1}. What is prob of sequence rtt? 1/60 Three letters pi	{ "pile_set_name": "DM Mathematics" }
+ o + dk and give o. 2 Rearrange 158a + 4a3 + 2a*3 - 1 - 1 - 157a to q + sa + wa*3 + ua*2 and give q. -2 Express 2w3 - w3 + w*4 - 2w - 2w2 - 2w*4 as lw*3 + a + gw*4 + xw + yw2 and give y. -2 Rearrange -3u + 2u2 + 3u + 0u to the form ju + p + xu2 and give p. 0 Rearrange -2l*3 - 1 + 3l*2 + 5l*3 + 10l*4 - 6 - 9l*4 to ol*4 + r + yl*2 + vl + fl3 and give o. 1 Express 0s - 2s + s4 + 2s*4 + (-2 + 2 - 2s*2)(-6s + 6s + 9s2) in the form rs*2 + fs*3 + ps*4 + b + ms and give p. -15 Express -1 - 8q2 - 11q*2 + 7q*2 in the form rq*2 + j + tq and give r. -12 Express (-4 + 2s + 4)(-3s - s + 3s) - 1 - 5s2 + 1 as y + ts*2 + hs and give t. -7 Rearrange 2n + 7 + n2 - 4 - 6 + 0n2 - n2 + 0n2 + (5n - 3n + 0n)(0n + n + 2n) to the form jn*2 + dn + b and give b. -3 Rearrange -4k + 6k - 7 + k to the form ck + z and give z. -7 Express 2 - 5j - 2 + (2 - 1 + 0)(23 - 4j - 23) + 2j + 2j - 2j in the form wj + f and give w. -7 Express 2u2 + 1 - 5u*3 + 3 + 3u - u + 3u3 in the form qu*3 + vu + s + zu2 and give q. -2 Express -2v + 2v - 5v - v in the form ov + q and give o. -6 Express (1 + 1 + 3)(-d - d + 0d) as n + cd and give c. -10 Rearrange (3 + 2l - 3)(261 - 261 + 25l2) + 0l*2 - 2l*3 + 0l2 - 3 - l3 + 3 to i + ul2 + tl + dl3 and give d. 47 Express t2 + 2t - 2t - 20t*2 + 21t*2 + 26t*2 - 5t*2 + 2t*2 + 2t*2 + (1 - 5t - 1)(-4t + 3t + 0t) in the form gt + bt*2 + j and give b. 32 Rearrange (-3c + c + c)(-5 + 5 - 5c) to the form n + uc + vc*2 and give v. 5 Rearrange (4a - 6a + 4a)(3a - 5 + 5)(1 + 6 + 9) to the form ka*2 + ba + q and give q. 0 Express -165j2 + 1 + 2j*3 + 0j*3 + 153j*2 as pj*3 + q + aj*2 + cj and give q. 1 Rearrange (-5a2 + 4a2 - a2)((-2a + 4a - 3a)(1 + a - 1) - 5a*2 + 2a2 + a2) to ca2 + f + qa*3 + ma + ga4 and give m. 0 Express (-16 + 7 + 12)(-c + 3c - 5c) as t + xc and give x. -9 Express 6i*4 - 12i*4 - 2i*3 + 2i*2 + 8i + 7i4 as wi + oi3 + fi*2 + ui*4 + p and give u. 1 Express 5c*3 - 7c + 9c3 - 15c*3 as wc + u + qc3 + rc*2 and give q. -1 Express -3u*2 - 4 + 1 + 1 + 5 in the form qu*2 + yu + k and give k. 3 Express -3l - 3l + 0l + (2 - 3 + 0)(2l - 3l + 2l) + (1 + 0 + 1)(l + 2l - l) as t + pl and give p. -3 Express (-7h + 2h + 4h)(5h3 + h3 - 4h*3) + 120 + 3h*4 - 120 + 2h*4 + 2h*4 - 2h*4 in the form f + zh*4 + ah + ph2 + gh*3 and give f. 0 Rearrange -18 + 116i - 230i + 112i to yi + m and give m. -18 Rearrange 39a - 2a2 - 39a + 12 to the form ma2 + c + ka and give k. 0 Express 7f2 - 20f*2 + 4 + 12f2 - f3 as sf3 + tf*2 + zf + y and give s. -1 Express -9q + 2q2 - 27 - q3 + 4q + 30 in the form aq*2 + yq*3 + pq + o and give a. 2 Express -9f2 + 16f2 - f4 - 6f2 - 4f*3 in the form pf*2 + hf + s + yf3 + qf*4 and give y. -4 Rearrange -13k*2 - 24k*2 - 81k*2 - 70k*2 to the form u + ck*2 + sk and give c. -188 Rearrange 0d2 + 7d - 2d2 - 3d to g + vd + md*2 and give v. 4 Rearrange (5 - 5 - l)(-3 + 4 + 1)(-2l - 3 + 0l + 1 + (3 + 0 - 1)(-4l + 3l + 3l)) to the form p + dl*2 + hl and give p. 0 Express 73r2 + r + 1 - 135r*2 + 1 in the form wr*2 + br + y and give b. 1 Rearrange -27g - 4 - 33g + 4 to the form u + jg and give j. -60 Rearrange -3 + 5s*4 - 43s*3 + 0s*4 + 41s*3 to the form cs*2 + i + ps*3 + qs*4 + rs and give i. -3 Express -v2 - v2 - 3v - 10v in the form r + bv + xv*2 and give r. 0 Rearrange (-3 + 5 - 1)(0x3 - x3 - x3) + 0x*2 - 5x*2 - 2x*3 + 3x*2 - 9x*3 + 5x*3 + 5x*3 to the form r + gx*3 + zx*2 + sx and give z. -2 Rearrange -4x3 + x3 + 0x*2 + 187x - 185x - 2 - x2 to the form bx*2 + px*3 + u + gx and give u. -2 Rearrange (-6 - 4 + 12 + 2a3)(1 - 4 + 0)(1 + 1 + 0)(-2a + a - 2a) to the form s + za3 + da + ga4 + na*2 and give d. 36 Express (52g*2 + 6 - 1 - 68g*2)(0g2 - 4g*2 + 3g*2) as kg + wg2 + pg*3 + vg*4 + q and give v. 16 Rearrange -19x*2 - 11x*2 + 80x*2 + x to sx*2 + r + dx and give r. 0 Rearrange 1 - 1 + 72j - 31j to hj + k and give h. 41 Rearrange h4 - h3 + 10h*3 + 3h + 7h3 + 0h*4 to the form ah + th2 + x + fh*3 + ph*4 and give x. 0 Rearrange (-a + 3a - 3a)(100a2 - 137a + 137a) - 4a*3 - 1 + 1 to the form fa + ra2 + y + za*3 and give f. 0 Express -4y*3 + 12y*3 - 2y - 2y2 - 4 - 1 - 9y*3 as hy + l + ny2 + dy*3 and give n. -2 Express 5 + 3 - 2 + 13n*2 - 2 in the form in*2 + fn + y and give y. 4 Express (5a - 4 - 7 + 9)(-4 + 0 + 6)(3a + a - 2a) in the form x + va + ka2 and give v. -8 Rearrange -q - q + q + (4 - 1 - 4)(0 + 0 - q) + 1 - 33q - 19q - 3q - 4 + q + 4 to the form v + sq and give v. 1 Rearrange -58j4 - 3j + 5j3 + 2j + 60j4 to the form wj + aj4 + qj*2 + z + vj3 and give a. 2 Rearrange -b2 - 4b4 + 0b*2 + b + 9b*4 - 2b to the form tb2 + zb*3 + v + mb*4 + ub and give m. 5 Express -y + 4y - 3y + 3y in the form x + jy and give j. 3 Express 5z3 - 35 + 5z*2 + 34 - 3z*3 as wz*3 + v + gz + hz2 and give v. -1 Express o - 2o4 + o4 + 2o + 2 + 2o*3 - 2o2 + o2 in the form lo2 + xo*3 + v + no + po4 and give p. -1 Express (-3q - 4q2 + 3q)(0 + 6 - 2) as kq*2 + r + nq and give n. 0 Rearrange 1 + 1 + l*2 + 37l*3 - 43l*3 to the form y + bl*2 + cl + tl3 and give y. 2 Rearrange x + x + x - 14 to b + wx and give w. 3 Rearrange -7d + 2 - 2 - 8d to xd + h and give x. -15 Express (-2f*2 - 1 + 1)(-2 - 1 + 2) + 3f2 + 3f*2 - 5f*2 - 2f - 3f2 + 2f + (-4 - 1 + 4)(-1 + f2 + 1) in the form v + pf + gf2 and give g. -1 Rearrange -6m*3 - 6m*4 + 4m4 - 2 + m2 + 5m4 to the form um*3 + km*4 + a + sm*2 + bm and give k. 3 Rearrange 1 - 2 + 2 + 1 + 41s to bs + o and give b. 41 Rearrange -4j + 11j*4 - 3j2 + j3 - 10j4 + 0j*2 to b + rj*2 + yj*3 + nj*4 + dj and give d. -4 Express (-2n - n + 0n)(n3 + 0n*3 - 3n*3) + (0n*4 - 3n*4 + 7n*4)(0 + 1 + 0) as gn3 + mn*4 + kn + b + hn2 and give m. 10 Express (-1 + 4 - 2)(y + 28 + 80 - 7) in the form oy + b and give o. 1 Express -15m + 4m - 9m + 0m in the form n + wm and give w. -20 Express -1 - 115z - 40z + 1 in the form a + xz and give x. -155 Express (-80w + 80w + 10w*2)(-3 + 3 - 2) + (-3 + 3 + 1)(4w2 - w2 - w2) - w2 - 3w2 + 3w*2 in the form yw*2 + aw + o and give y. -19 Express -505 - 105r + 505 as wr + s and give w. -105 Express (115p - 43p*2 - 115p)(4 + 1 - 6) in the form t + bp*2 + vp and give b. 43 Express -k2 + 5 - 5 + k2 - 1 + 1 + (k + 4k - 4k)(3k + 0k - k) + 0k*2 + 2k*2 - 3k2 + (-k2 - 5 + 5)(6 - 3 + 1) as a + lk + rk2 and give r. -3 Rearrange -24x*2 - 7x*2 + 13x*2 to cx*2 + v + lx and give c. -18 Express (3 + 3y2 - 3)(2 + 1 - 1)(-3y - 1 + 1)(3y + 25 - 8 - 18) as ay + h + ry*2 + uy*4 + cy*3 and give u. -54 Rearrange 0s*3 + 16s*3 + 4s*3 + (-3s*2 + 4s*2 - 2s*2)(-3s + 4s + 0s) to the form xs*3 + us*2 + ds + b and give x. 19 Express ((i*2 - 2i*2 + 3i*2)(-6i - 2i + 4i) - i + i + 2i*3)(0i - i - i) as li*2 + xi + ri4 + t + vi*3 and give r. 12 Rearrange -286k*2 + 147k*2 + 142k*2 + 20k to the form qk + hk*2 + x and give h. 3 Rearrange -44 + 2d - 2d - 3080d*2 + 3077d*2 to yd*2 + td + s and give s. -44 Express y*4 - 6y - 2 + 5y + y3 + 2 - 3 as p + ly*3 + ay + ny2 + dy*4 and give l. 1 Rearrange 6 + 27p*2 - 9p*2 - 12p*2 - 7p*2 + 2p to the form m + dp + zp*2 and give m. 6 Rearrange (q - 5q + 2q)(-102q3 - 2q + 99q3 + 1 - 2) to iq + nq2 + tq*4 + k + vq*3 and give i. 2 Rearrange (0s + 4s - 2s)(1 - 3 + 4) + 2s - s + 0s + (0 + 2 + 4)(s + s - s) to qs + k and give k. 0 Express (3b2 + b2 - 5b2 + (6b - 3b - 4b)(b + 2b + 0b))(5b2 - 2b2 - b2) as nb3 + qb*4 + xb + g	{ "pile_set_name": "DM Mathematics" }
= -s + 1. Suppose -15 + 16 = -c. Let l be (24/9)/(3/(-9) - c). Determine v(l). -3 Let y(z) = -17z + 7z + 23 + 9 + 3z + 6z. Determine y(16). 16 Let h(c) = 2c2 + 4c + 4. Suppose f = 5b - 25, b - 4f + 25 = 6b. Suppose -3x = -k - 36, -x + k - 55 = -bx. Let s = 9 - x. Give h(s). 20 Let w be (-1)/(1/2) - -2. Let s = -123 + 126. Let a = w - s. Let o(k) = k3 + 4k*2 + k + 2. What is o(a)? 8 Let o(j) = -j + 1. Let u(p) = 3 + 7p*2 + 2p*2 - 3p*2 - 4p. Let v(l) = -4o(l) + u(l). Let x(h) = -2h - 7. Let s be x(-3). What is v(s)? 5 Let x(d) = -33 + 53 + 13d - 31. Let y(s) = -20s + 17. Let o(w) = 8x(w) + 5y(w). Calculate o(2). 5 Suppose f - 29 = 4o, 0 = -0o - 2o - 4f + 8. Let i(j) = 11j + 13. Let y(v) = 13v + 14. Let s(n) = -6i(n) + 5y(n). What is s(o)? -2 Let i(n) = 16n3 - 5n*3 - n + 11 - 10n*3. Let b be (-14)/77 - (-2)/11. Suppose -2t = -bt. Calculate i(t). 11 Let t(m) = 0m*3 + 2m*2 - 5m3 - m2. Let w(f) = -21f - 463. Let p be w(-22). Determine t(p). 6 Let o(h) = -h2 - 4h + 10. Suppose -3z + 15 = 5g, 32g + 3z = 31g + 3. Determine o(g). -11 Let d(a) = 6a - 7. Let i(h) = -13h + 14. Let o(b) = 9d(b) + 4i(b). Let j be ((-94)/(-376))/((-2)/(-56)). Calculate o(j). 7 Let x be (-483)/(-12) - 6/24. Let u = x - 36. Let y(q) be the second derivative of q4/12 - 2q*3/3 - 2q2 - q. What is y(u)? -4 Let y(r) = -r2 - 4r + 2. Let g be y(-5). Let s(h) = -5h - 6847 + 2286 + 2276 + 2283. Calculate s(g). 13 Let t(h) be the third derivative of 0 + 1/10h5 + 1/120h*6 - 1/2h*3 + 1/6h*4 + 0h - 3h2. Determine t(-5). 2 Let y(z) = -z3 + 6z*2 - 6z + 7. Let v be y(5). Let x(p) = 74 - 11p - pv - 71 + 4p. Suppose -4r - 3r = 49. Determine x(r). 3 Let j = 40 + -123. Let t = j - -87. Let q(b) = b*3 - 5b*2 + 4b + 4. Give q(t). 4 Let q be 18/6(-5)/(-45)6. Let u(o) = -5o3 - 3o2 + o + 1. Determine u(q). -49 Let c(t) = -t3 - 7t2 - 6t - 1. Let n(y) = -y. Let w be n(-5). Suppose -4s + 6s + w = -5x, -5s = 2x - 40. Let h be 8/(-20) + (-56)/s. Calculate c(h). -1 Let d be (12/(-21))/(2/(-7)). Suppose -dk - 12 = -6k. Let i(j) = -4j - 4. Give i(k). -16 Let p(g) = -g*3 + 7g*2 - 2g - 6. Suppose -4i = -6 - 18. What is p(i)? 18 Suppose 0 = 5a + 3w - 28, -a + 0a - 2w + 7 = 0. Suppose 5u + 20 + a = 0. Let j(m) = -m*2 - 3m + 7. What is j(u)? -3 Let x(v) = -v*3 + 12v*2 - 11v + 4. Let s be x(11). Let d(u) = 0u - u + 214 - 209. Calculate d(s). 1 Let g be (-1)/(-5) - (-330)/(-25). Let h = g + 18. Let x(f) = -h + 5f2 - f2 + 13f3 - 12f*3. What is x(-4)? -5 Suppose -5m = 6c - 11c, -3m + 8 = 5c. Let n = 3 - c. Let k(x) = 1 + nx2 + 0 - 11x*2 + 2x2. What is k(1)? -6 Let h(x) be the third derivative of -x8/6720 + x6/360 - x5/120 - 37x4/24 - 11x*2. Let y(f) be the second derivative of h(f). What is y(-2)? 3 Suppose 0 = 234v - 242v - 32. Let s(a) = -8a*2 - 5 - 2a*2 + 2a + 11a2. Calculate s(v). 3 Let i(v) = -v2 - 3v + 3. Suppose 8t - 14 = 26. Give i(t). -37 Let o(f) = f2 + 2f + 1. Suppose 28 = -2a + 4i - 0i, -i = 4a + 74. Let u = a - -9. Let v be (6/(-27))/(1/u). Give o(v). 9 Suppose 5 = -2q - 9. Let t(f) = 3f*3 - 5f + 3f + 8f*2 - 4 + 4f + 3f - 2f*3. Determine t(q). 10 Let r(g) = 1. Let l(u) = -3u - 43. Let k(w) = l(w) - 4r(w). What is k(-19)? 10 Let a(o) = 25 + 6o + 5o - 2o - o*2 - 31. Calculate a(7). 8 Let t = -75 - -79. Let l(f) = 3f - 7. What is l(t)? 5 Let h(o) be the second derivative of o5/10 - o4/3 + o3/3 + o2/2 - 3o - 44. Determine h(2). 5 Let z(y) be the third derivative of y6/120 - 2y5/15 + y4/4 + 7y3/6 - 72y*2. Give z(6). -29 Let h = -51 - -44. Let q(j) = j + 5. Let d be q(h). Let p(z) = 4z + 1. Determine p(d). -7 Let o(j) = -j3 - j2 - 74j + 1. Let a be o(0). Let u(b) = 5b*3 - 2b2 + b. Calculate u(a). 4 Let g(n) be the second derivative of n4/12 - 2n3/3 + 5n*2/2 + 5n. Let z(f) = -11f + 38. Let v be z(3). Determine g(v). 10 Let o(q) = -2q + 1. Let d = 59 - 53. Let w be (-4)/d(-36)/(-8). Give o(w). 7 Suppose 15c = -22 + 127. Let p(y) = y*2 - y - 6. Determine p(c). 36 Let c(u) = 6 + 4u + 2u - 7u. Let v be c(5). Let z(i) = 3 + 0 - 3 + v - 2i. Calculate z(4). -7 Let a = 98 - 98. Suppose k + a = 4b - 4, -3k - b + 1 = 0. Let w(m) = m - 12. Calculate w(k). -12 Let d(o) = -18o*3 - 2o - 1. Let s(w) = w*2 + 7w + 9. Let j be ((-45)/25)/((-3)/15). Suppose -jc + 12c = -15. Let p be s(c). Calculate d(p). 19 Let d = 61 + -54. Let c(h) = 1 - h + 8h3 - dh*3 - 4 - 6. Determine c(0). -9 Suppose 5n - 5a = 0, -3a = -n - 3n - 3. Let u = n + 7. Let z(h) = 3h + 4 - 3 - uh + 1. Determine z(4). -2 Let z(m) = -1 + 0m + 2m2 + 0m*2 - 2m. Let t = 19 - 13. Let b = t - 4. Give z(b). 3 Let y(v) = -v + 5. Let m(r) = -r*2 + 15r - 44. Let i be m(7). Calculate y(i). -7 Let y = -34 + 35. Let w(z) = -z. Let r(o) = -2o - 3. Let b(x) = yr(x) - 3w(x). Suppose 3n - 4 = 17. What is b(n)? 4 Let p(q) = 5q2 - 3q - 2. Let r(j) be the second derivative of -j4/12 + j3/6 + 25j. Let i(z) = p(z) + 6r(z). Give i(4). -6 Let w(g) = -5g - 76 + 26 + g + 25 + 23. What is w(-2)? 6 Let v(u) = u - 2. Let i(f) = -f + 1. Let k = 12 + -18. Let b(c) = kv(c) - 5i(c). Determine b(0). 7 Suppose j - 5a - 11 = 0, 2 - 25 = -3j + 5a. Let u(i) = -i*3 + 5i*2 + 4i - 4. Calculate u(j). -16 Let l(n) = -n*3 - n. Let v(u) be the first derivative of -7/4u*4 - 8 + 4/3u*3 - 7/2u*2 - 2u. Let x(d) = -6l(d) + v(d). Determine x(4). -6 Let i be 9 - (-12)/(-8)-21. Suppose 0 = 2b - b - 3y + i, -2b - 14 = -y. Let c(w) = -2w - 9. Give c(b). 3 Let u(y) = -y + 1. Suppose 0 = -4g + l - 18, 27g - 28g - 9 = 2l. What is u(g)? 6 Let z(t) = -t - 10. Let y(i) = i2 + 14i + 20. Let h be y(-11). Let n be z(h). Let b(j) = 3j2 - 3j + 2. Give b(n). 20 Suppose -5x + 3 + 2 = 0, 3x = i - 2. Suppose ir = -31 - 4. Let h(g) = -3g*2 + 2g*2 - 207g + 200g. What is h(r)? 0 Let v(o) = o2 + o - 12. Let p = -219 - -219. Calculate v(p). -12 Let k be (-775)/(-279) - (-4)/18. Let c(l) = l3 - 3l - 3. What is c(k)? 15 Let t(a) be the second derivative of -5/12a4 - 1/20a*5 + 0 - 26a - 3/2a2 - 1/2a*3. Calculate t(-4). -7 Suppose -16 = 4a + 2c, 5c - 5 = 5a - 0. Let g(i) = i2 - 12i - 40. What is g(a)? 5 Let l(q) be the third derivative of -1/24q4 + 0 + 0q + 1/6q3 + 5q*2 + 1/30q*5. Let y be (-4)/20 - (-6)/5. Determine l(y). 2 Let p(u) = u + 7. Let w(f) = 2f + 13. Let m be -8(-2)/4 - 10. Let r(h) = mw(h) + 11p(h). Determine r(0). -1 Suppose 10l = 9l + 2. Let k(f) = l - 9f - 6 - 3 + 2f - f2. Calculate k(-6). -1 Let x(v) be the second derivative of v2 - 11v + 0 - 2/3v3. Let s(z) = 2z - 6. Let i be s(4). What is x(i)? -6 Let k(d) be the third derivative of -d*5/60 + 5d4/24 + d3/3 + 19d2. Let r = -5 - -3. Let m = 8 + r. Determine k(m). -4 Let t = 67 - 75. Let x(u) = -2u - 3. Determine x(t). 13 Let p(o) be the second derivative of 11o3/2 - o2/2 + 4o + 25. Calculate p(1). 32 Let c(q) = -q*2 + 24q + 24. Let f be c(25). Let h(z) = -10z2 + 2z + 6. Let b(k) = 11k2 - 2k - 7. Let w(g) = 5b(g) + 6h(g). Determine w(f). -6 Let u = -1103 + 1104. Let x(k) = 9k2 - k + 2. What is x(u)? 10 Suppose -35h - 130 = -48h. Let o(v) be the first derivative of -v2/2 + 2v + 2. Calculate o(h). -8 Let k be 0 + -2 + 3 + -2. Let r = -5 + k. Let s(f) = -2 - 22f - 19f + 69f - 29f. Give s(r). 4 Suppose 5g + 0g - 20 = 0. Suppose -gv = -v. Suppose vf = 3f + 9. Let q(c) = c - 3. Calculate q(f). -6 Let w(u) = -u2 + 3u + 6. Suppose 0 = -4y + 113 - 17. Let g = 30 - y. Calculate w(g). -12 Let v(o) = -5o - 6 - 265o2 + 130o*2 + 134o2. What is v(-3)? 0 Let j(o) be the first derivative of -o5/20 - 5o4/12 + o3/3 - 2o*2 + 26o + 9. Let u(v) be the first derivative of j(v). Determine u(-5). -14 Let t(n) = 2n - 6. Let k(j) = -j + 1. Let m(v) = -6k(v) - t(v). Let c(h) = -8 - 3h - 8h + 3h - h2. Let l be c(-7). Calculate m(l). -4 Let n = 7 - 13. Let p(q) = 39q + 44q + 39q - 123q + 2 - 7. What is p(n)? 1 Suppose -3 = b + 2. Let i(a) = 6a + 10a - 31a + 8a + 5a. Give i(b). 10 Let k(j) = 3j + 806. Let y(b) = 2b + 60	{ "pile_set_name": "DM Mathematics" }
n 0.2, r, -0.3? -0.3 Let o be (1 + 66/(-60))(-1 + -3). What is the third smallest value in -11, 4/9, o? 4/9 Let z be (-105)/(-54) - (42/(-12) + 5). What is the fourth biggest value in z, 0.4, 2/3, -0.04? -0.04 Let h be 1 + (-3)/((-30)/(-16)). Suppose -46o + 84 = -25o. Which is the third smallest value? (a) -5 (b) h (c) o c Let n = 110 + -109.33. Let j = -3.67 + n. Which is the biggest value? (a) j (b) 0.5 (c) 3 c Suppose 0 = -4y - 20, -j + 36 = -4y + 13. Suppose r + 1 = j. Let h be 1/1r/(-8). Which is the second smallest value? (a) -2 (b) h (c) 3 b Let t = 206.5 + -206. What is the fourth biggest value in t, 1/5, 4, -5/2? -5/2 Let w = -0.03 + 0.03. Let p(k) = -19k - 1. Let q be p(1). Let s = q + 16. Which is the third biggest value? (a) s (b) w (c) -0.5 a Let b = 78.6 + -77. What is the third smallest value in 0.4, b, -5? b Suppose -3w - 4 = w. Let p = -509 + 4075/8. What is the fourth smallest value in 1/7, p, w, 2/15? p Let s be 4 + 817/136. Let q be ((-2)/5)/((-18)/(-10)). Which is the third biggest value? (a) s (b) -40 (c) q b Let c = 251/287 + -30/41. What is the third biggest value in -2, -1/28, c? -2 Let h be ((-3)/32)/(2/8). Let y = -1/40 + h. Let k = -0.264 - -0.764. Which is the third biggest value? (a) k (b) 1/9 (c) y c Suppose -10h = -6h - 36. Let j be (-3)/(h/(-2)) - 1. Which is the third biggest value? (a) 2/7 (b) -0.7 (c) j (d) 3 c Let j = -0.039 + -0.021. What is the biggest value in 0.1, -3/2, j? 0.1 Let m = -34/11 - -305/88. Let o = -171.9 + 179.9. Which is the second smallest value? (a) m (b) o (c) 5 c Let n = -53.9 + 54. Let s be 2/(-4) + (-19)/(-30). Which is the second smallest value? (a) n (b) 0 (c) -3/5 (d) s b Let q = 0.1 - 0. Let i = 1018.6 - 1018.3. What is the smallest value in q, -1/6, i? -1/6 Let u = 0.27 + -0.27. What is the third biggest value in u, 2/3, 2, -0.3? u Let x = -94 + 169/2. Let t = 22 + -12. Let p = x + t. What is the second biggest value in p, 0.3, -2/5? 0.3 Let w = -74 + 90.8. Which is the third biggest value? (a) w (b) -4/9 (c) 4 b Let n = 57.517 - -0.083. Let m = -58 + n. Which is the third biggest value? (a) m (b) 1 (c) -4/3 c Let i = -3 - 2. Let m be (1/(-7))/(132/(-154)). What is the smallest value in i, m, 3/5? i Suppose 2 = 4p - 3p - m, 0 = 3p - 5m. Suppose -3k - py + 11 = -5k, 0 = 5k - y + 16. Which is the smallest value? (a) -3/2 (b) 0.1 (c) k (d) -4 d Let n = 7.1 - 8. Let w = n - 0.1. Which is the second biggest value? (a) 2 (b) -2/11 (c) w b Let y = -297 - -297.3. Which is the second smallest value? (a) y (b) -0.2 (c) 1 a Suppose -259u - 5400 = -57u + 256. Suppose -3i + o + 24 = i, i + 3o + 7 = 0. What is the smallest value in u, 2/15, i? u Let l = 6/109 + -428/3815. Which is the second biggest value? (a) -0.3 (b) 0.4 (c) l c Let k(l) = 18l*2 - 127l. Let q be k(7). Which is the third smallest value? (a) q (b) 0 (c) 3 (d) 1/5 d Let i = -1.084 + 1.044. What is the third biggest value in -24, 4/7, i, 0.3? i Let o be (30/75)/(6/(-5)). What is the smallest value in -0.6, o, 0? -0.6 Let u = 6 - 8. Let a = -285 - -332.1. Let g = 47 - a. What is the smallest value in g, 1/5, u? u Let w = -231 - -157. Let u = 73 + w. What is the third biggest value in u, 6, 0? u Let o = -992/2607 + 4/237. What is the second biggest value in 5, -4, o? o Let n be 2/(-11) - (-44335)/242935. Let k = n - -16002740/75089. Let x = -213 + k. What is the third smallest value in -0.1, 5, x? 5 Let j = 2498 + -2494. Which is the third smallest value? (a) 1 (b) j (c) -28 b Let q be 30(-1)/(-6)3. Let k be ((-1)/q)/((-4)/5). Let x = 92 + -1382/15. Which is the third biggest value? (a) k (b) 0.2 (c) x c Let j be 2 - 192/104 - 32/39. Let z(s) = s*3 + 2s*2 + 4s + 3. Let x be z(-2). Which is the biggest value? (a) x (b) j (c) 2 (d) 1 c Let p = 298/15 + -111/5. Let f(o) = 3o + 54. Let g be f(-17). Which is the biggest value? (a) p (b) -3/5 (c) g c Let y = -6.4 + 6. Let g = 99.44 + -100. Let i = g + 0.46. What is the third smallest value in 0, y, i? 0 Let s = 0.365 + -0.165. What is the second smallest value in 5, -5, s, 48? s Let r be 7/28 + (-49)/260. What is the smallest value in 4, r, 2? r Let f = -26 - -46. Let i be ((-10)/f)/((-10)/(-24)). Let u = -4/5 - i. Which is the smallest value? (a) u (b) 8 (c) -0.5 c Suppose 0 = -4x + 4j + 20, -4x + 5j + 7 + 18 = 0. Let u = 91 + -89. Let q be 20/(-40)(-1)/(u/20). What is the second smallest value in q, x, 2/7? 2/7 Suppose 5c - 4z = 1, -3 = -c + 5z + 14. What is the fourth smallest value in -1/8, c, 6/11, -15? 6/11 Suppose -2 = -v + 2. Suppose n + 9 = vn - 5x, x = -n - 5. Let o = -216 - -221. Which is the smallest value? (a) -3 (b) n (c) o a Let g = -0.34 + -0.06. Let s be 4/18((15 - 15) + 6). Which is the second smallest value? (a) -6/11 (b) g (c) s (d) 3/2 b Let d = -1.47 - 2.53. What is the smallest value in 1/5, -0.5, 1, d? d Let o = -2 - -1.6. Let j be ((-6)/4)/(-93/90) - 2. What is the third smallest value in j, o, -0.1? j Let d = -24.9 - -3.9. What is the second smallest value in -4/3, d, 0.4? -4/3 Let f = -166 - -165. Which is the biggest value? (a) 0.4 (b) -0.1 (c) f (d) 9/4 d Let t = 2041 - 2040.7. Let n = 1 - 1.5. Which is the third biggest value? (a) 2/19 (b) t (c) -0.1 (d) n c Let c(g) = 16g - 124. Let f be c(8). What is the fourth biggest value in -1/3, f, -4, 0.01? -4 Let c = 40.56 + -40. Let r = 0.86 - c. What is the third smallest value in r, -0.3, 4, -5? r Let g be (30/(-36))/(510/(-30)). Let f(t) = -3t - 4. Let r be f(-3). Which is the third biggest value? (a) 11 (b) r (c) 2 (d) g c Let r = -82.8 + 157.4. Which is the third biggest value? (a) 1 (b) r (c) 2 a Let c = 517.2 - 517. What is the third smallest value in c, -6, 11? 11 Let g = 0.0003 - -0.0127. Which is the third biggest value? (a) g (b) -3 (c) -0.03 (d) 2/7 c Let s = -823/2 + 413. Let z = -4 + 6. What is the smallest value in 2/17, z, s? 2/17 Let p = 0.3 + 54.7. Let k = -54.8 + p. Let h = -2/59 - 226/295. What is the third smallest value in 2, h, k? 2 Suppose -3f - 3t = -0f + 492, -5t = -2f - 314. Let k be (12/f)/(4/(-6)). Which is the smallest value? (a) k (b) -2/7 (c) -0.2 b Let v be 2/510/(-26). Let t = -38.7 - -39. Let d(o) = -3o2 + o. Let r be d(-1). What is the second smallest value in t, v, r? v Let f = -1.59 + -0.01. Let k = f - -6.6. Let b = -0.4 + 4.4. What is the biggest value in 2/5, b, k? k Let m = -0.03 - 0.01. Let k = m - -0.24. Let f = k - -0.3. Which is the third biggest value? (a) 1/5 (b) f (c) -1/2 c Let j = -8 + 6. Suppose -2w = 3w - 300. Let o be w/50(-2)/(-6). Which is the second smallest value? (a) -3 (b) j (c) o b Suppose s + 4i - 36 = -4s, -i = -4. Suppose 0 = -c + s - 6. What is the second biggest value in 2/5, c, 5? 2/5 Let h be -411/222/(-14). What is the second biggest value in 3, 7/2, h? 3 Let w = 800 - 799. Which is the fourth biggest value? (a) 0.4 (b) w (c) 114 (d) 2/15 d Let t = -0.15 + 0.45. Let g = 203/6 + -34. Which is the fourth biggest value? (a) -0.5 (b) 2 (c) t (d) g a Let r = 17.32 + -19.3. Let o = -0.02 + r. What is the second biggest value in o, -2/11, -3, 3/8? -2/11 Let u = 155 - 154. What is the second smallest value in -2.9, u, 0.2? 0.2 Suppose 4t - 5l = 21, 3t - 4l + 1 - 16 = 0. Let q be (-12)/t3/18. What is the second biggest value in q, -4, 4? q Let l = 0.562 + -4.452. Let i = 0.11 - l. Let v = -3/19 - 7/76. Which is the second smallest value? (a) i (b) v (c) 5/6 c Suppose -10m + 11m - 5 = 2c, 3c + 11 = -2m. What is the second biggest value in -0.1, c, -6.6? c Let r = -2 + 2.048. Let x = 13.752 + r. Let f = 14 - x. Which is the smallest value? (a) 1/4 (b) -2/7 (c) f b Let h = 0.7 - -0.3. Let f = -2.742 - -3.042. Let r = 2.5 + -2. What is the second smallest value in r, f, h? r Let t = -992 + 1005.26. Let f = 0.26 - t. Let o = -12 - f. What is the third smallest value in 3, 0, o? 3 Let j = 17448/7 + -2493. Let v = 703/20 - 182/5. Let s = 4.8 - 5. Which is the third smallest value? (a) s (b) v (c) j a Let v = 4.79 - 0.89. Let k = v + -5.9. What is the second smallest value in k, -0.06, -0.4? -0.4 Let s = -267 + 298. Which is the biggest value? (a) -4 (b) 3 (c) -1/	{ "pile_set_name": "DM Mathematics" }
irst derivative of -16004o3 - o2 + 41916. -48012o*2 - 2o Find the first derivative of 55glr3 - 174glr*2 + 2glr - 266gr*2 + 15gr + r3 wrt l. 55gr3 - 174gr2 + 2gr What is the third derivative of -10976g*5 + 6g*3h - 3g2 + 8995gh wrt g? -658560g*2 + 36h What is the third derivative of qz6 - 24070qz3 - 2qz2 + 79qz + 3z*2 + 14 wrt z? 120qz3 - 144420q What is the third derivative of 14m6 - 28m*5 + 7m*4 + 46m*2 - 476m - 21? 1680m3 - 1680m*2 + 168m Find the second derivative of 335594f4 + 244377f. 4027128f2 What is the first derivative of 5207k*2m*3 - 36k*2 + 25351m*3 - 3m*2 wrt k? 10414km3 - 72k What is the second derivative of -2h3 + 2h*2o - 554h2 + 114ho - 8h - o + 2 wrt h? -12h + 4o - 1108 What is the third derivative of 45c5 - 113c*4 + 3c*3 - 2c*2 - 4685c - 4? 2700c2 - 2712c + 18 What is the first derivative of 3132161h + 722376? 3132161 Find the third derivative of 3n*4 - 8792n*3 + 3283n*2 - 11. 72n - 52752 Find the second derivative of 75676g2nr - 2g*2r - g*2 - 3g + 28n + 279r wrt g. 151352nr - 4r - 2 What is the third derivative of -1356k*5 - 2k*3z + 1314k2 + z wrt k? -81360k*2 - 12z Find the third derivative of 104962g3 + g2 + 96104. 629772 Differentiate 2a*2k*2p + 2a2p3 + a2p2 - 2a*2 + 39485akp*3 + 2329ap3 wrt k. 4a*2kp + 39485ap3 Find the third derivative of 371734m*3x*2 + 1790m*2 - 206x*2 wrt m. 2230404x*2 What is the derivative of -115044x*2 - 183784? -230088x What is the second derivative of 33558o5 - o - 50250 wrt o? 671160o*3 What is the third derivative of 311894h*5 - 2h*4 - 3h*3 - 2h*2 - 8323h - 10? 18713640h2 - 48h - 18 Find the second derivative of -dl2m + 5dl*2 + 3dlm - dl - 2dm + 12176l*2 - 5583lm + 2 wrt l. -2dm + 10d + 24352 What is the second derivative of -124779x4 + 53570x? -1497348x2 What is the first derivative of -74362mt - m - 4918 wrt t? -74362m Find the third derivative of -3576230i5 + 1410i*2 + 380. -214573800i*2 Differentiate -2o*4 + 2o*3 - 318257o*2 - 1164592 wrt o. -8o*3 + 6o*2 - 636514o Differentiate 4z4 + 88578z*2 + 249581 wrt z. 16z*3 + 177156z What is the first derivative of -335675o - 172972 wrt o? -335675 Differentiate -6s*4v*2 + 106758s*4v - 418346v2 - 1 wrt s. -24s*3v*2 + 427032s*3v Differentiate 17453b + 38662 with respect to b. 17453 Find the second derivative of -6442s*4z*3 + 50s*2z*3 + 17s - 146z3 - 136 wrt s. -77304s*2z*3 + 100z*3 Differentiate -322383n4 - n3 + 3n2 + 205145 with respect to n. -1289532n*3 - 3n*2 + 6n What is the third derivative of -58g6 + 245g*3q*3 - 101g*2q*3 - 27g*2 + gq wrt g? -6960g3 + 1470q*3 Find the third derivative of -4728s6 - s5 - 2s3 + 4s*2 + 2542. -567360s*3 - 60s*2 - 12 Find the second derivative of -75110b*2 + 1922b. -150220 What is the third derivative of 147co*3 + 2co2 + 378co + 221c - 775o3 wrt o? 882c - 4650 Find the second derivative of -14u4 - 1674u*2 - 8u - 291. -168u2 - 3348 Find the first derivative of -32405lo + 3l + 6531o + 41 wrt l. -32405o + 3 Differentiate 3j2 - 90533j + 321598. 6j - 90533 What is the third derivative of -62053n*3 + 12117n*2 - n? -372318 What is the third derivative of 18403c*4j - 24c4 + 654c*2j - 2c2 + 3cj + 2j + 1 wrt c? 441672cj - 576c What is the third derivative of 2j*3lw2 + 37424j*3w*2 + 157j*2w - 8jlw2 - 27lw2 wrt j? 12lw2 + 224544w*2 Find the first derivative of 16000d*2 + 5d - 1426482 wrt d. 32000d + 5 Find the second derivative of 4dp2 - 3410d - 78853p2 + 4p wrt p. 8d - 157706 What is the second derivative of 2w*4 + 4w*3 - 4029w*2 - 17w + 1147 wrt w? 24w2 + 24w - 8058 What is the third derivative of -3056j6 + 288j*5 - 1479952j*2 wrt j? -366720j*3 + 17280j*2 What is the third derivative of -4g*3m*3 - 352g*3m*2 + 81g*3m - g*2m*4 + 16289gm3 - 3m wrt m? -24g3 - 24g*2m + 97734g Find the second derivative of 64942h*5 + 14352h + 32. 1298840h3 Find the second derivative of -8j*5 - 54j*4z - 128jz - 6j + 2 wrt j. -160j*3 - 648j*2z What is the derivative of 486a2o - 2a2 + 177ao - 30a + 7020 wrt o? 486a2 + 177a What is the derivative of -21n2p - 2n2 - 438np - 2n - 243794p wrt n? -42np - 4n - 438p - 2 What is the second derivative of -22q4 - q3 - 36q2 - 1650603q wrt q? -264q2 - 6q - 72 Differentiate 19fu + 5525fv*3x + fvx + 1365uvx - v3 - 3vx - 16v wrt f. 19u + 5525v*3x + vx What is the third derivative of -11407r*6 - 2r*5y - 17r2y - 27r2 + 21r wrt r? -1368840r3 - 120r*2y Find the third derivative of -3640574l3 + 4589044l*2. -21843444 What is the derivative of 875388u*2 + 39148? 1750776u What is the second derivative of 6p3 + 717p*2 - 120p + 178 wrt p? 36p + 1434 Find the third derivative of 11q*4 - 3012q*3 + 32709q*2 wrt q. 264q - 18072 Find the third derivative of -67n5 - 2606n*3 - 10n*2 - 38n + 1. -4020n2 - 15636 What is the third derivative of -435099f*4 + 2f*3 - 272806f*2? -10442376f + 12 Differentiate -13jr*2y - 2jry + 20jy + 2j - 392r - 23y + 1 with respect to r. -26jry - 2jy - 392 Find the third derivative of -43479st3 + st - 14064t2 wrt t. -260874s Find the first derivative of 3269n2x*2 + 2n*2 - 6nx2 + 21n - 314 wrt x. 6538n2x - 12nx What is the derivative of -2gm*2 - 587145g - 11771m2 + 4m wrt m? -4gm - 23542m + 4 What is the second derivative of -2l*3 + 14342l*2 + 34398l wrt l? -12l + 28684 What is the first derivative of -1031ad2x - 3adx + 1524ad - 9d*2 wrt x? -1031ad2 - 3ad What is the third derivative of -159246q*3z*3 + 902q*3z + 192z2 wrt z? -955476q*3 What is the third derivative of -9564z*5 + 12z*2 - 221z wrt z? -573840z2 What is the third derivative of -41309x*3 - 208x*2 - 32x wrt x? -247854 What is the second derivative of -151615n3 + 19n + 4178 wrt n? -909690n Find the second derivative of 6j*3 + 807j*2 + 31616j wrt j. 36j + 1614 Find the third derivative of -41ctz*3 - 265ct + 5t*2z*3 + 3t*2z2 + t2z + 20t*2 + 257tz3 + t wrt z. -246ct + 30t*2 + 1542t Differentiate -28bh*2 + 2bh + 40387b + 17678h2 - 25h - 2 with respect to b. -28h2 + 2h + 40387 What is the first derivative of -3a2h*2 - 2297a*2p - 3a2 + 2036ah + 4h*2p*2 wrt p? -2297a*2 + 8h*2p Find the third derivative of -407136k3 - 185643k*2 wrt k. -2442816 Find the second derivative of -2c*3m*2 - 3c*3m - 297c2m*2 + 2cm2 - 147cm - 44 wrt c. -12cm2 - 18cm - 594m2 What is the second derivative of l5 + 603l4 + 7l*2 - 47070l? 20l3 + 7236l*2 + 14 Find the third derivative of 58205g*3w*4 - 3g*3w*2 - 49478g*2w*2 + 2w*6 wrt w. 1396920g*3w + 240w3 What is the first derivative of -5835h*4u - 56h3u*3 + 4u*3 - 32344u*2 wrt h? -23340h*3u - 168h2u*3 What is the derivative of 310i*3 - 2i*2p*2 - 6ip2 + 15435p*2 wrt i? 930i*2 - 4ip2 - 6p*2 Find the third derivative of 6bg4 - 20bg2 - bg - 231b - g5 - 19833g*3 - 18 wrt g. 144bg - 60g*2 - 118998 What is the first derivative of 67q*3x + 201767q3 + 22q*2x2 - q2x - x wrt x? 67q*3 + 44q*2x - q*2 - 1 What is the third derivative of 17j*5 - 803j*4 - 121243j*2 wrt j? 1020j*2 - 19272j What is the derivative of -83946y + 1447 wrt y? -83946 What is the first derivative of 11965c*2s + 19cs - 2s - 613787 wrt c? 23930cs + 19s What is the third derivative of -6536b4 + 6b*3 - 24184b*2 + 2b wrt b? -156864b + 36 Find the third derivative of -12q*5 + 4358q*4 - 813525q*2. -720q*2 + 104592q Find the second derivative of -148io*3v + 2iov - 104649io + 3o*3 - 24o*2v wrt o. -888iov + 18o - 48v Find the third derivative of -526b*6c**3 -	{ "pile_set_name": "DM Mathematics" }
*2/4 - 964001k/4. k(k - 964001)/4 Factor 4h*2 + 4148232h + 145183220. 4(h + 35)(h + 1037023) Suppose -a*2/4 - 1651233a/2 - 2726570420289/4 = 0. Calculate a. -1651233 Factor -x*3/6 - 3220x*2/3 - 443450x/3 - 5145000. -(x + 70)*2(x + 6300)/6 Factor -b*3 - 32114b*2 + 674857b + 706970. -(b - 22)(b + 1)(b + 32135) Suppose -2j3 + 41508j*2 + 1788378j + 3410708 = 0. Calculate j. -41, -2, 20797 Determine q so that q*3/9 + 9478q*2/9 + 292825q/9 - 100768/3 = 0. -9447, -32, 1 Find p such that -12076p2 - 3828108p - 5072 = 0. -317, -4/3019 Let f*3/4 - 4495f*2/2 + 4452f + 377496 = 0. What is f? -12, 14, 8988 Factor -3w2 - 17739w + 26106780. -3(w - 1220)(w + 7133) Let -2z4 + 566154z*3 - 40103351310z*2 + 5243827748998z = 0. What is z? 0, 131, 141473 Solve -3k4/5 - 3462k*3/5 + 6960204k*2/5 - 3138625626k/5 + 88037077611 = 0 for k. -2345, 397 Let 2g3 - 56168g*2 - 1349696g + 14391296 = 0. Calculate g. -32, 8, 28108 Solve -g*4/4 + 1234g*3 + 2901657g*2/4 + 100612936g - 101339584 = 0. -272, 1, 5479 Factor -2b2 + 90003372b - 1012575871421298. -2(b - 22500843)2 Factor 2b*2 + 57244824b + 409621234348872. 2(b + 14311206)2 Find o, given that -25o*2 - 49280o - 4819440 = 0. -1868, -516/5 Factor 1669k2 - 17981800k - 64644. (k - 10774)(1669k + 6) Determine q so that 2q5/7 + 808q*4/7 - 211332q*3/7 - 638824q*2/7 - 91490q - 213744/7 = 0. -584, -1, 183 Let -2p2 - 52112p + 37623154 = 0. What is p? -26759, 703 Determine v, given that 4v5 + 1501196v*4 + 31523508v*3 + 58543444v*2 + 28521128v = 0. -375278, -19, -1, 0 Factor -312510000080o3 - 625027500280o*2 - 15000285o - 90. -5(o + 2)(250004o + 3)2 Factor 2558o*3/3 + 767393o*2/6 + 4796075o - 13125/2. (o + 75)*2(5116o - 7)/6 Factor -2b*2/7 + 267950b/7 + 1607772/7. -2(b - 133981)(b + 6)/7 Find h, given that -h*3/4 - 19827h*2/4 - 28209384h - 49569690015 = 0. -11535, -4146 Solve 4w3 - 415788w*2 - 142550388w - 12198058596 = 0 for w. -171, 104289 Find m, given that 3m5 - 43885536m*4 + 160495110271611m*3 - 641979256177446m*2 - 1765444018711884m - 962969608377288 = 0. -1, 6, 7314254 Factor 4j2 - 2580208j + 33542028. 4(j - 645039)(j - 13) Factor i*2 + 1646089i + 13168648. (i + 8)(i + 1646081) Factor 2n*2 - 92136n - 645050. 2(n - 46075)(n + 7) Factor -2g3 - 740g*2 - 65696g + 274752. -2(g - 4)(g + 162)(g + 212) Suppose y4/2 - 97y*3/2 + 1313y*2 - 1806y - 202860 = 0. Calculate y. -10, 23, 42 Factor -b*2 - 35057b + 280520. -(b - 8)(b + 35065) Factor 3d*2/5 - 10816728d/5 - 10816731/5. 3(d - 3605577)(d + 1)/5 Find j such that 2j2/5 + 40706j - 5700408/5 = 0. -101793, 28 Determine h, given that 24h5 + 700h*4 + 212h*3 - 75728h*2 + 132528h + 24192 = 0. -21, -18, -1/6, 2, 8 Let 3g5 - 5788815g*4/4 + 349068257943g*3/2 - 218151651618g*2 - 1658048356800g - 1047193920000 = 0. What is g? -2, -3/4, 4, 241200 Suppose -21m5 - 4290m*4 - 21825m*3 + 52620m*2 + 16716m = 0. What is m? -199, -7, -2/7, 0, 2 Determine i, given that -i*5/8 + 5783i*4/8 - 4250461i*3/4 + 202148063i*2/4 - 2196876021i/8 + 3181019643/8 = 0. 3, 43, 2867 Suppose i*3/2 - 25153i*2/2 + 160395515i/2 - 27910605251/2 = 0. Calculate i. 179, 12487 Solve 6f2/7 + 97249674f/7 - 291749076/7 = 0 for f. -16208282, 3 Determine t, given that 21t3/4 + 385893t*2 + 551259t - 441012 = 0. -73502, -2, 4/7 Factor -2w2/17 - 3090986w/17 + 3090988/17. -2(w - 1)(w + 1545494)/17 Solve -2t3 - 50890t*2 - 3603384t - 7003224 = 0. -25374, -69, -2 Solve 4m4 - 4220652m*3 + 1113379508140m*2 - 5566808907348m + 4453433619856 = 0. 1, 4, 527579 Solve 5z3 - 10555z*2 + 1520040z + 9501300 = 0. -6, 162, 1955 Find s, given that -33s5 + 1008507s*4 - 6874971s*3 + 9807933s*2 - 3024816s - 916620 = 0. -2/11, 1, 5, 30554 Determine i so that i*4/4 - 4209i*3/2 - 592935i*2/4 - 2599450i = 0. -35, 0, 8488 Factor -4i3 - 1825i*2 + 142072i + 35632. -(i - 68)(i + 524)(4i + 1) Determine w, given that -w5 + 242w*4 + 10753w*3 - 119294w*2 - 191364w + 770040 = 0. -46, -3, 2, 10, 279 Suppose -4f4 + 11160f*3 - 7938736f*2 + 215668008f - 1426556428 = 0. What is f? 11, 17, 1381 Factor -2k2/13 - 1513432208k/13 - 286309631026469408/13. -2(k + 378358052)2/13 Factor -j3 + 1204j*2 - 12503j - 739660. -(j - 1193)(j - 31)(j + 20) Find x, given that -3x2 - 53649x + 10740114 = 0. -18081, 198 Let 75z5 - 17985z*4 + 299652z*3 - 730608z*2 + 445248z - 79920 = 0. What is z? 2/5, 2, 15, 222 Determine g so that -266450g3 - 147436640g*2 + 394042968g - 262649952 = 0. -556, 486/365 Determine n, given that 2n4/9 - 67946n*3/9 + 192394750n*2/3 - 1730261950n/9 - 5769804500/9 = 0. -2, 5, 16985 What is r in 4r5/9 + 50266r*4/9 - 13627054r*3/9 + 6800960r*2/9 = 0? -12832, 0, 1/2, 265 Let 152a*4/9 - 13076a*3/3 - 26256a*2 - 38028a + 3168 = 0. Calculate a. -3, 3/38, 264 Factor 2l2/7 - 7773884l/7 + 7554159055682/7. 2(l - 1943471)2/7 Find w such that -2w*5/5 - 329448w*4/5 - 13545897282w*3/5 + 1737883977148w*2/5 - 11470542943608w + 107862265976976/5 = 0. -82426, 2, 63 Solve -2t3 + 2018t*2 - 106622t - 108642 = 0. -1, 57, 953 Let 3k5 - 315k*4 + 6345k*3 + 30255k*2 + 9612k - 45900 = 0. Calculate k. -3, -2, 1, 34, 75 Factor 3b3/4 - 84339b*2/4 + 21084b. 3b(b - 28112)(b - 1)/4 Suppose -53926s*3 + 107862s*2 - 20s = 0. Calculate s. 0, 5/26963, 2 Solve -16u4/9 - 1060u*3/9 + 6760u*2/9 + 97180u/9 + 7952/3 = 0. -71, -7, -1/4, 12 Suppose -m*2/2 + 10306850m - 53115578461250 = 0. Calculate m. 10306850 Determine k, given that -2k3/7 + 738294k*2/7 - 68136599502k/7 + 340664540410/7 = 0. 5, 184571 Determine m so that 5m2 - 52866510m + 139743393979005 = 0. 5286651 Solve -a*2 - 120812a - 2295067 = 0 for a. -120793, -19 Let 3v4/7 - 61533v*3/7 + 315925461v*2/7 - 4097375967v/7 + 3781512036/7 = 0. Calculate v. 1, 12, 10249 Let -k*4/5 - 16828k*3/5 + 50491k*2/5 - 33662k/5 = 0. What is k? -16831, 0, 1, 2 Determine l, given that l*3 - 78893l*2/2 + 59168l - 39445/2 = 0. 1/2, 1, 39445 Solve x*2 + 287217x + 287216 = 0. -287216, -1 Factor 2g2/3 + 142772g. 2g(g + 214158)/3 Find o such that 5o5 + 1381040o*4 - 23478915o*3 + 58007270o*2 + 5524220o - 77343000 = 0. -276225, -1, 2, 14 Find t, given that 2t3/5 - 41954t*2/5 - 251828t/5 + 671456/5 = 0. -8, 2, 20983 Factor -3n4 + 4872792n*3 - 2638142576640n*2 + 476033471388057600n + 26666148468621312000. -3(n - 541440)3(n + 56) What is k in 2k3 - 2169674k*2 + 588484472912k - 26477407873440 = 0? 45, 542396 What is c in 3c4/2 + 175173c*3/2 + 2627145c*2/2 + 13134975c/2 + 10945500 = 0? -58376, -5 Factor 4u2/3 + 520328u/3 + 520324/3. 4(u + 1)(u + 130081)/3 Factor -3f3/2 + 1350741f*2/2 - 152039744625f/2 - 456131390625/2. -3(f - 225125)2(f + 3)/2 Factor -99r2 - 5345004r + 323940. -3(r + 53990)(33r - 2) Factor 4c*2/9 + 87280c/9 + 299807116/9. 4(c + 4271)(c + 17549)/9 Factor 9s3 + 589386s*2 - 16901279s + 121139084. (s + 65516)(3s - 43)*2 Let -4j*2/3 + 5331640j/3 - 10663264/3 = 0. What is j? 2, 1332908 Suppose -p*4/7 + 16322p*3/7 - 65272p*2/7 = 0. What is p? 0, 4, 16318 Factor 3t*3 - 8541t*2 + 3361725t + 4233688125. 3(t - 1675)2(t + 503) Solve -5l2 + 2924065l - 140343600 = 0. 48, 584765 Factor -2w3 + 676w*2 - 48550w - 259900. -2(w - 230)(w - 113)(w + 5) Factor -w3 - 23911397w*2 + 95645600w - 95645604. -(w - 2)*2(w + 23911401) Solve -2m3/3 + 1095560m*2/3 - 116112506m/3 + 1025610844 = 0 for m. 53, 547674 Factor -5y2 - 119045y + 2859960. -5(y - 24)(y + 23833) Solve -3j5 - 72j*4 + 147432j*3 + 288j*2 - 589680j = 0 for j. -234, -2, 0, 2, 210 Suppose u*3 + 7546u*2 + 1124764u + 6477144 = 0. Calculate u. -7394, -146, -6 Let 5s3/4 + 114665s*2/2 - 2064305s/4 + 1605625/2 = 0. Calculate s. -45875, 2, 7 Let -2t4 + 1710t*3 - 342478t*2 - 3976830t = 0. Calculate t. -11, 0, 351, 515 Solve -2p2/7 - 4906p/7 + 1780908/7 = 0 for p. -2774, 321 Let 3l2 + 18733656l - 18733659 = 0. Calculate l. -6	{ "pile_set_name": "DM Mathematics" }
25 - -24) + -133 + -147. -131 47 - ((-10 - (-5 - (7 - 3))) + 7) - 2 39 What is (11 + 12 - 17) + (-136 - 34) - -17? -147 Evaluate 0 + 35 + 36 + (1 - 51). 21 Evaluate -53 - (17 + (56 - 118)). -8 0 + -1 + -3 + -13 + 0 - 12 -29 What is (0 - -48) + -309 + 306? 45 -1 + -35 + (-20 - (34 - 64)) - 9 -35 (4 - 14) + (60 - 43) 7 31 + (2 - -6 - (22 + 66)) -49 What is -110 - (21 - ((-18 - 2) + (9 - -13)))? -129 Evaluate (-3 + 1 + 0 - 42) + (-74 - -68) - -10. -40 What is -18 + (9 - 82) + (-3 - -28)? -66 Calculate 41 + (13 - (49 - (-12 + 28))). 21 What is (15 - (25 + -6)) + -24 + -1 + -4? -33 What is (-2 + 2 - (17 + 0)) + -99203 + 99180? -40 What is the value of -19 + (-121 - -126) + (3 - -4)? -7 4 + (-86 - (2 - -26 - 9 - 8)) -93 What is the value of (1 + -5 - (-62 - -49)) + (-5 - (-4 - -3))? 5 What is 9 + (-18 - -8) + 4 + -7 + 78? 74 What is the value of -10 - (-54 + 12 + -2) - (-17 - -31)? 20 What is the value of 11 - (-10 - (10 - 7)) - (-6 + 10 - -6)? 14 Evaluate 4 - (-8 + 3 + -3 + (-117 - -175)). -46 Calculate 24 - (32 + (41 - 23)) - 6. -32 What is the value of -23 - (87 + -46 + 27)? -91 What is (-5 - -39) + (16 + -20 - 10)? 20 Evaluate (2 - 1 - 29) + 0 + -49 + 40. -37 Evaluate -22 + -2 + 1 - (-5 + 5 + -11). -12 Evaluate -49 + (31 - 20 - (57 - 52 - (-4 - -1))). -46 What is -45 + 89 - (125 + 28)? -109 What is -35 - (11 - (9 + -20)) - -16? -41 What is 42 + 34 + -58 + -4? 14 What is -20 + (65 - 72 - 51)? -78 Calculate 101 + (55 - -1) + -230. -73 What is 1 - (-5 + 152 - 77)? -69 Evaluate 64 + -41 + 2 + -8 + (-24 - -35). 28 -39 - (112 - (10 + 154)) 13 Calculate -1 + 59 - (-33141 - -33310). -111 -116 - -111 - (-4 - 2) - -33 34 What is -26292 + 26282 - (-1 + -84 + -1)? 76 What is (-12 - (14 + -54)) + -54 + 4 + -3 + -9? -34 Calculate (-260 + 256 - (1 - -14)) + 0 + 6. -13 What is (-37 - -22 - (3 + -11 + -11)) + 16? 20 (-54 - -203) + -149 - ((1 - -49) + 1) -51 Calculate (23 + -17 - (-37 + 9)) + -102. -68 95 + -128 + 49 - (2 + 2 + 81) -69 What is the value of (6 - (16 + -25)) + -43 + (11 - 24)? -41 -37 + -14 + 15 + (16 - -72) 52 Calculate (-25 - (-3 + -1)) + (37 - (20 - -17)). -21 Calculate -25 - -1 - (-16 + 27 + -7) - 3. -31 Evaluate 55 + -29 + (14 - (-10 - (-6 + -6))). 38 What is 13 + (-50 - -91) + -43? 11 What is the value of 11 - (-3 + 57) - -58? 15 Evaluate -103 - (-89 - -81 - 110). 15 7 - -30 - -20 - (-5 + -4 + -3 + 11) 58 Evaluate -27 - (31 - -3 - -3 - 25). -39 What is -37 - (-53 + 109 + -52)? -41 23 - (42 + 35) - -31 -23 What is 58 + -40 + -29 + 53? 42 What is 50 + (-61 - 90) + 43? -58 Calculate 14 + (-500 + 497 - (21 + -1)) - 104. -113 What is the value of (27 - 47) + (-6 - (-1 - (2 - 5))) + 4? -24 Evaluate (-4 + 12 - -1) + (-6 - -21 - 17) + 22. 29 What is the value of (7012 - 7124) + 19 + -1? -94 Calculate (-109 - -150 - 39) + 20 + -1. 21 -7 - (-63 + 74 + 38 + -3) - -8 -45 What is the value of -36 + -24 + 42 + 47? 29 What is the value of -25 + -18 + 21 + 12 - (0 + -47)? 37 What is the value of 105 + (-150 - (-44 + 70))? -71 Calculate -15 - (6 + (-11 - 40)). 30 Evaluate -6 + 25 + -27 + 17 + (-3 - -45). 51 Calculate 0 + 19 - ((112 - -74) + -186). 19 Evaluate (-90 - -6 - -4) + 8 + -23 + -2. -97 What is -8 - (-88 + 11 + -26 + 24)? 71 What is (-1 - 2) + -4 + -26 + -27 + 0 + 1? -59 What is 5 + (-25 - -15) - (16 - 18) - 44? -47 67 + (-65 - (-80 + 35)) 47 Evaluate -22 - (8 + (20 - 24 - 8)). -18 Evaluate (-25 - 30) + 46 - ((-11 - -7) + 3 + -14). 6 Calculate -9651 - -9654 - (18 - (-2 + 1)). -16 Evaluate 9 - (-8 + 10 + 3 + (-3 - 8)). 15 Evaluate -26 - (1 + (16 + -2 - (20 - -9 - 20))). -32 What is the value of 45 - (12 + (35 + -25 - 24))? 47 What is 56 - (-54 - -80) - (0 - 1 - 2)? 33 What is the value of (18 - -1) + (317 - 330) - (-2 - (46 + 1))? 55 What is (33 - (1 + 5)) + -11? 16 What is -25125 + 25224 + (1 - 157)? -57 (-93 - (32 - 45 - 9)) + -21 -92 Calculate 51 + -25 - 17 - 22 - -70. 57 Evaluate 200 + -131 + -18 + -21. 30 What is 13 + (4 - 16) + 0 + (2 - 8) + 12? 7 Evaluate 41 + 1 - (7403 + -7314). -47 What is the value of 4 + (5 + (-3 - -1) - 66)? -59 What is the value of 505 + -513 - (-120 - ((4 - 1) + -8 + 0))? 107 Calculate -59 + 0 - (6 + (18 - 15 - 8)). -60 0 + 3 + -36 - (-44 - (-57 + 26)) -20 What is the value of 46 + 34 + -102 + (-2 - -62)? 38 Evaluate 76 - (2 - ((11 - (7 - 8)) + -10)) - 9. 67 Calculate 10 + 18 + (-21 - -15) + -3. 19 What is the value of -70 - (108 + 5 + -62)? -121 Calculate 93 - (130 + -129) - (0 + 2 + -18). 108 What is the value of 8 + 1 + 1 + (51 - 10) + (62 - 111)? 2 What is the value of -89 + 14 + (6 - 30) + 19 + -9? -89 Calculate -42 + -144 + -55 + 115. -126 Calculate -40192 + 40184 + 83 + -2 + 1. 74 -4 + -7 + 3 + -6 + 20 6 What is -5 + -10 - 6 - (-151 + 6)? 124 What is -3 + 1 + 3 + 268 + -266? 3 What is 184 - 8 - (5 + 99)? 72 What is the value of -38 - 0 - (4081 + -4065)? -54 Calculate 6 + (49 - -3 - 49). 9 Calculate 58 - (-8 - -38) - 34. -6 What is 75 + (73 - 79 - 68)? 1 What is the value of (-64 - (108 + -156)) + 48? 32 Calculate -11 - (-94 - -42 - -47). -6 Calculate -8 - 37 - (-8 + -14) - 17. -40 -197 + 210 - (113 + -29 + 15) -86 What is -26 - (-206 - -233 - (1 + 47))? -5 Calculate 18 + -25 + 20 - (-35 - -6). 42 What is 43 + -148 + 118 + -41? -28 -2 + 12 - (5 - (-7 - (-33 + 36))) -5 Evaluate 26 + (-7 - ((1 - -4) + 1)) - 61. -48 Calculate 21 - (-12 + 52 - -25). -44 What is 81 - 101 - (5 - 18)? -7 What is the value of 47 - 52 - (-86 - -43 - (1 + -8 + -1))? 30 -33 + -116 + 165 + -102 -86 Evaluate -62 + 27 + -78 + 204. 91 -461 + 298 + 112 - (-3 + -2 + (-2 - -2)) -46 Calculate -23 - (3 - 19) - (-8 - 35). 36 Evaluate -186 + -116 + 78 + 71. -153 What is the value of 49 - (59 + 65 - 2)? -73 What is the value of -69 - (-48 - -37 - 21 - (4 + -15))? -48 Calculate 279 - 217 - (8 + 60). -6 Calculate 33 + (4 - (-10 - (-9 + 0))) + -18. 20 Evaluate 2 + (6 + 11 + 5 - 45). -21 What is -21 + (33 - 9) + -4 + 51 + -2? 48 What is the value of 21 - (-16 - -33) - (-3 - -4)? 3 What is the value of 42 - (-8 - -47) - -10? 13 Calculate (15 - ((24 - 8) + -15)) + -13 - -75. 76 Evaluate -73 - (-5 - -2) - (1973 - 2005) - (-1 + 12). -49 What is -4 + -19 + -66 - 11? -100 What is (31 - 31) + (11 - (-8 - -13)) + -9? -3 Calculate (-3 - (-26 + 103 + -29)) + 17. -34 What is the value of (34 - -88) + -129 + 76? 69 What is the value of -6036 + 6002 - (0 - 1 - -4 - -2)? -39 Calculate (10 - 35) + 28 - (-4 + 28). -21 Calculate (62 - 7) + -70 - 46. -61 What is the value of (-10 + 78 + -22 - (1 - -1)) + 5? 49 What is the value of 22 + (-5 - -1) + -3 + 9 - -12? 36 What is the value of 9 + -4 - (-11 - 5 - (-1 + -3 + -4))? 13 What is 41 + (-2 - 8 - -3 - -11 - (-19 + 13))? 51 Calculate 119 + -46 + 25 - (-1 - -40). 59 (-6 - -3 - 27) + 545 + -533 -18 Calculate 155 + (76 - 156) - 55. 20 Evaluate 9 - 2 - -6 - (-10 - 5 - (-13 + -20)). -5 What is 5 + 0 + 1 - (33 + (-79 - (57 - 21)))? 88 Evaluate 54 + 45 + -23 + -27. 49 What is the value of -15 + -1 - (-79 + (-95 - -169))? -11 Calculate 27 - (-18 + 54) - -25. 16 Evaluate -4 + 9 - 28 - -28. 5 781 + -793 + (0 - ((-6 - -78) + 5 + -1)) -88 Evaluate -27 - (-55 + 56) - (-57 - 3). 32 Calculate -21 + -41 + (24 - 0). -38 Calculate (-8 - (-16 + -3 - -12)) + 24. 23 0 - -37 - (33 - (-56 - -2)) -50 What is 13 + (-15 - 64) + 117? 51 Calculate -210 - -241 - (-1 + 46). -14 What is the value of -6 + (1 - -3) + -9 - (-126 - -122)? -7 Calculate -55 + -65 + 47 - -16. -57 Evaluate 4 + 11 + (4 - 5) - (-404 - -390). 28 (-20 - (-6 + 3 + -30)) + -11 2 Calculate 44 + (35 - 31) + -39. 9 Evaluate (-2 + 34 - 25) + -10 - -33. 30 What is 9 - (0 + 9 - (16 + (5 - 22)))? -1 What is the value of (-36 - 0) + (6 - 56 - -51)? -35 What is the value of 32 - ((-11 + 46 - 20 - 10) + -8 + 0)? 35 What is 32 - (42 + -34) - 27? -3 Calculate -1487 - -1437 - (6 + -177). 121 Calculate 21 + (-2 - -3) + -112 + 133. 43 Calculate -19 - (-23 + -25 + 4). 25 What is -7 - (-41 - ((-34 - -40) + 20))? 60 (-6 + -11 - -8) + (-32 - -49) - 59 -51 Evaluate 12 + (-15 + -8 - -58) + 19. 66 What is the value of ((-5 - (10 - 10)) + 1 - (2 - 13)) + 25? 32 What is the value of 25 + (16 + -18 - -11) + -7 + 1? 28 Evaluate -6 + 25 + (-34 - -17) + 0 + 49 + 8. 59 Evaluate -15 - ((35 - 23) + (-17 - -9) + -106). 87 What is -3 - 2 - (-847 + 883 + (-1 - 18))? -22 What is -19 + -1 + 136 + (-85 - 118)? -87 -322	{ "pile_set_name": "DM Mathematics" }
that 5k5 - 495k*4 + 11595k*3 + 24695k*2 + 12600k = 0. -1, 0, 45, 56 Factor 3p3 - 117996p*2 - 472020p - 472032. 3(p - 39336)(p + 2)2 Solve j3 + 3513j2 + 3087048j + 3083536 = 0. -1756, -1 Factor a*3/12 + 157a*2/12 + 5399a/12 + 5243/12. (a + 1)(a + 49)(a + 107)/12 Factor 2w2 - 14732w - 103222. 2(w - 7373)(w + 7) Let 18l5/11 + 1038l*4/11 - 1034l*3 - 7926l*2/11 - 1340l/11 = 0. Calculate l. -67, -1/3, 0, 10 Let 15c3 + 1811c*2 + 33326c - 9016 = 0. Calculate c. -98, -23, 4/15 Factor -4k3 + 30908k*2 - 59721980k + 59691076. -4(k - 3863)2(k - 1) Let -3z4 + 630z*3 - 39951z*2 + 662844z + 1490580 = 0. Calculate z. -2, 30, 91 Suppose 14400q5 + 661920q*4 + 2440324q*3 + 1732504q*2 - 59796q + 504 = 0. What is q? -42, -3, -1, 1/60 Factor 2v2 - 106832v + 320478. 2(v - 53413)(v - 3) Let 3k5 + 672k*4 + 3816k*3 - 23424k*2 + 26160k = 0. Calculate k. -218, -10, 0, 2 Let s*3/2 - 7141s*2/8 + 16049s/8 - 1783/4 = 0. What is s? 1/4, 2, 1783 Find g, given that 2g5/9 - 40g*4/3 + 406g*3/9 + 2560g*2/9 - 1312g + 8960/9 = 0. -5, 1, 4, 56 Solve 3h4/4 + 303h*3/2 - 87759h*2 - 58569879h/2 - 9338509815/4 = 0. -199, 395 Find d, given that 3d4/5 + 741d*3/5 + 48963d*2/5 + 395199d/5 + 764694/5 = 0. -119, -6, -3 Solve -5l4 - 20900l*3 + 801420l2 = 0 for l. -4218, 0, 38 Factor -a2/4 + 57a/4 + 41789/2. -(a - 319)(a + 262)/4 Solve -5l4/3 + 80l*3/3 - 190l*2/3 - 80l/3 + 65 = 0 for l. -1, 1, 3, 13 Factor -3b3 - 63561b*2 - 190644b + 254208. -3(b - 1)(b + 4)(b + 21184) Let 2r*5/13 + 120r*4/13 + 2216r*3/13 + 960r*2 + 1664r = 0. Calculate r. -26, -4, 0 Factor 2m3/11 - 31172m*2/11 + 121430520m/11 + 242985744/11. 2(m - 7794)2(m + 2)/11 Suppose 4z5 - 376z*4 + 1428z*3 + 1152z*2 - 6480z = 0. Calculate z. -2, 0, 3, 90 Let -r*5/3 - 24968r*4/3 - 155900185r*3/3 - 623326118r*2/3 - 779051548r/3 - 311600648/3 = 0. What is r? -12482, -2, -1 Solve b*5/4 - 47b*4/4 - 99b*3/2 + 17425b*2/2 - 386875b/4 - 421875/4 = 0 for b. -27, -1, 25 Solve 15v3 - 23845v*2 - 613960v + 419900 = 0 for v. -26, 2/3, 1615 Let 5v3 - 40v*2 - 10020v + 164160 = 0. What is v? -48, 18, 38 Factor -x*5 - 15x*4 + 23x*3 + 627x*2 - 1210x. -x(x - 5)(x - 2)(x + 11)2 Find r, given that 5r*4 + 5915r*3 - 23845r*2 - 124635r = 0. -1187, -3, 0, 7 Factor -o*3/3 + 3551o*2 + 10654o/3. -o(o - 10654)(o + 1)/3 Let d*5/10 + 1481d*4/10 - 5222d*3/5 - 20842d*2/5 - 2976d = 0. What is d? -1488, -2, -1, 0, 10 Factor 4x2/7 - 5640x/7 - 16956/7. 4(x - 1413)(x + 3)/7 Find f such that 3f2 - 4083f + 8154 = 0. 2, 1359 Solve 4c2 - 3508c - 21192 = 0 for c. -6, 883 Determine z so that 2z3/5 - 4452z*2/5 - 167322z/5 - 63364 = 0. -35, -2, 2263 Find p such that 3p3 - 1629p*2 + 9693p - 14499 = 0. 3, 537 Factor -2u2/5 - 5952u - 22141440. -2(u + 7440)2/5 Determine h so that 2h*5/9 + 608h*4/9 + 196h*3/3 - 5432h*2/9 + 6658h/9 - 808/3 = 0. -303, -4, 1 Suppose h*5/6 + 184h*4/3 - 312h*3 - 1303h*2/3 + 1871h/6 + 373 = 0. What is h? -373, -1, 1, 6 Factor -2g2 + 690g - 1372. -2(g - 343)(g - 2) Let -y*2 - 4705y - 9406 = 0. Calculate y. -4703, -2 What is x in -x*5/6 - 7x*4/6 + 3x*3/2 + 67x*2/6 + 8x/3 - 14 = 0? -7, -2, 1, 3 Factor 2j2/7 - 191916j/7 + 4603968882/7. 2(j - 47979)2/7 Factor -3h*2/5 + 28812h - 345888060. -3(h - 24010)2/5 Factor 3g*3 + 15570g*2 + 20217636g + 40373016. 3(g + 2)(g + 2594)*2 Suppose -4n*3/5 - 5499n*2/5 - 9611n/5 = 0. Calculate n. -1373, -7/4, 0 Find r such that r*3/9 + 322r*2/3 + 6719r/9 + 1918/3 = 0. -959, -6, -1 Suppose -546852789v5 + 11489695371v*4 - 20901949236v*3 + 220327152v*2 - 776160v + 912 = 0. What is v? 2/567, 2, 19 Factor -k*2/4 - 239201k/2 - 239200. -(k + 2)(k + 478400)/4 Determine j, given that -3j*5/4 + 4467j*4/4 + 8970j*3 + 17964j*2 = 0. -4, 0, 1497 Factor 6s*3 + 10960s*2 - 6s - 10960. 2(s - 1)(s + 1)(3s + 5480) Find q, given that 2q5/5 + 1407q*4/5 - 20687q*3/5 + 96714q*2/5 - 30996q + 77544/5 = 0. -718, 1, 3/2, 6 Factor -2s2/3 + 4938s + 14816/3. -2(s - 7408)(s + 1)/3 Let 5z4 - 385590z*3 + 9911976540z*2 - 84932422979080z = 0. Calculate z. 0, 25706 Suppose -2r5/5 + 66r*4/5 + 844r*3/5 + 708r*2/5 - 842r/5 - 774/5 = 0. What is r? -9, -1, 1, 43 Let -o*3/3 - 40o*2/3 + 4o/3 + 160/3 = 0. What is o? -40, -2, 2 Factor 3u2 + 101370u - 202752. 3(u - 2)(u + 33792) Suppose -315a4 + 5667a*3 - 5301a*2 - 51a = 0. What is a? -1/105, 0, 1, 17 Determine k so that -10k4 + 1255k*3 + 3195k*2 + 650k - 1280 = 0. -2, -1, 1/2, 128 Solve 4i2 + 528500i = 0. -132125, 0 Factor -m*4 - 36m*3 + 80m*2 + 144m - 304. -(m - 2)*2(m + 2)(m + 38) Let 4t*3 - 10628t*2 + 10600t + 63744 = 0. Calculate t. -2, 3, 2656 Determine z so that 4z4 - 284z*3 + 3712z*2 + 18384z + 19584 = 0. -2, 24, 51 Factor 3h3/7 - 8724h*2/7 + 95601h/7. 3h(h - 2897)(h - 11)/7 Factor m2 - 821m + 161704. (m - 493)(m - 328) What is q in 28q*4/3 + 156806q*3/3 + 11200q*2 = 0? -5600, -3/14, 0 Let 3h*2 + 661632h + 36479741952 = 0. Calculate h. -110272 Determine v so that -6v4/13 - 1292v*3/13 - 7984v*2/13 - 676v - 2090/13 = 0. -209, -5, -1, -1/3 Factor 4i3 - 23620i*2 + 141612i - 212364. 4(i - 5899)(i - 3)2 What is g in g3/2 - 39g2 + 797g/2 + 1560 = 0? -3, 16, 65 Suppose 2m5 - 1452m*4 + 330628m*3 - 18060120m*2 - 1264476150m - 2454043500 = 0. What is m? -37, -2, 255 Find l such that -3l3/7 + 6166l*2/7 - 2053l/7 - 4110/7 = 0. -2/3, 1, 2055 Factor -4y2/7 + 10576y/7 + 927860/7. -4(y - 2729)(y + 85)/7 Factor -2n3/5 - 48156n*2/5 + 192744n - 963920. -2(n - 10)2(n + 24098)/5 Suppose 2j4 + 102j*3 - 556j*2 + 240j + 896 = 0. What is j? -56, -1, 2, 4 Determine p, given that -p*5 - 395p*4 + 11343p*3 - 21497p*2 + 10550p = 0. -422, 0, 1, 25 Factor -w*5/4 - 119w*4/2 - 473w*3/4 - 59w2. -w2(w + 1)2(w + 236)/4 Factor -15r2 + 4505r - 1500. -5(r - 300)(3r - 1) Find r such that -38310r*2 + 38314r - 4 = 0. 2/19155, 1 Suppose -t*5 - 839t*4 - 3341t*3 - 829t*2 + 5010t = 0. Calculate t. -835, -3, -2, 0, 1 Solve -3u4 + 246u*3 - 2187u*2 + 1944u = 0 for u. 0, 1, 9, 72 Factor 48w2/7 - 762w + 9324. 6(w - 14)(8w - 777)/7 Determine c, given that -2c*2/9 + 209872c/3 - 5505782048 = 0. 157404 Factor 2u3/15 + 22u*2/15 - 844u/15 - 240. 2(u - 18)(u + 4)(u + 25)/15 Find c, given that -2c*4 - 443452c*3 - 24582983282c*2 - 196642581072c - 393270972192 = 0. -110859, -4 Solve f*3/5 + 2986f*2/5 - f/5 - 2986/5 = 0. -2986, -1, 1 Solve -32t*2 - 8892t - 8860 = 0. -2215/8, -1 Factor -m*4 - 61m*3 + 2852m2. -m2(m - 31)(m + 92) Solve -n*2/2 - 12039n/2 - 66154 = 0 for n. -12028, -11 Factor -2s2/17 - 9966s/17 - 29880/17. -2(s + 3)(s + 4980)/17 Solve 3t4 - 465t*3 + 15768t*2 + 177612t + 161376 = 0. -8, -1, 82 Determine n, given that -2n5/13 + 388n*4/13 + 3684n*3/13 - 5984n*2/13 - 21458n/13 - 12180/13 = 0. -10, -1, 3, 203 What is j in 2j5 - 20948j*4 + 73122464j*3 - 85016846592j*2 - 170912001024j + 681306743808 = 0? -4, 2, 3492 Find u, given that -u*4/5 + 866u*3/5 - 38013u*2 + 222740u - 184900 = 0. 1, 5, 430 Determine w so that -3w3 + 35871w*2 - 71733w + 35865 = 0. 1, 11955 Factor -3p3/5 + 21p*2 + 618p/5 - 144. -3(p - 40)(p - 1)(p + 6)/5 What is g in -1844g*2/5 - 7382g/5 - 24/5 = 0? -4, -3/922 Suppose -t*4/4 + 184t3 + t2/4 - 184t = 0. Calculate t. -1, 0, 1, 736 Suppose 1682s*4/7 + 150684s*3/7 - 62568s*2/7 + 6480s/7 = 0. Calculate s. -90, 0, 6/29 Suppose -2l2/3 - 7090l - 42532/3 = 0. Calculate l. -10633, -2 Determine h so that 3h2/5 - 156h/5 - 8064/5 = 0. -32, 84 Determine u so that -u*2/3 + 191524u - 27511081932 = 0. 287286 Suppose -169d5/5 - 2756d*4/5 + 53751d*3/5 + 27074d*2 + 37796d/5 + 2808/5 = 0. What is d? -27, -2, -2/13, 13 Solve -3d5/5 + 10992d*4/5 - 13294098d*3/5 + 5144258484d*2/5 + 197316789021d/5 - 202447764396/5 = 0. -36, 1, 1233 Factor 2j2/11 + 134j/11	{ "pile_set_name": "DM Mathematics" }
5. 43 What is the remainder when 3663 is divided by 1212? 27 Calculate the remainder when 139 is divided by 127. 12 Calculate the remainder when 5218 is divided by 45. 43 Calculate the remainder when 3581 is divided by 143. 6 What is the remainder when 1144 is divided by 160? 24 Calculate the remainder when 34069 is divided by 36. 13 Calculate the remainder when 416929 is divided by 865. 864 What is the remainder when 122289 is divided by 621? 573 Calculate the remainder when 2197 is divided by 2195. 2 Calculate the remainder when 13138 is divided by 692. 682 Calculate the remainder when 5862 is divided by 217. 3 Calculate the remainder when 19400 is divided by 73. 55 What is the remainder when 51081 is divided by 12764? 25 What is the remainder when 763774 is divided by 1872? 1870 Calculate the remainder when 3356 is divided by 55. 1 Calculate the remainder when 756 is divided by 194. 174 What is the remainder when 518 is divided by 6? 2 Calculate the remainder when 5060 is divided by 1111. 616 Calculate the remainder when 243936 is divided by 135. 126 Calculate the remainder when 2295 is divided by 169. 98 What is the remainder when 17634 is divided by 120? 114 Calculate the remainder when 22269 is divided by 11127. 15 What is the remainder when 585709 is divided by 24? 13 Calculate the remainder when 604 is divided by 174. 82 What is the remainder when 30610 is divided by 253? 250 Calculate the remainder when 8684 is divided by 1243. 1226 Calculate the remainder when 77822 is divided by 42. 38 Calculate the remainder when 1027647 is divided by 796. 11 Calculate the remainder when 16509 is divided by 192. 189 What is the remainder when 922 is divided by 130? 12 Calculate the remainder when 21520 is divided by 1183. 226 Calculate the remainder when 7012 is divided by 100. 12 Calculate the remainder when 10807 is divided by 4822. 1163 What is the remainder when 12317756 is divided by 520? 516 Calculate the remainder when 8707 is divided by 167. 23 What is the remainder when 7323 is divided by 334? 309 What is the remainder when 66243 is divided by 26? 21 Calculate the remainder when 98862 is divided by 14109. 99 What is the remainder when 484 is divided by 160? 4 What is the remainder when 935 is divided by 87? 65 Calculate the remainder when 142348 is divided by 20334. 10 Calculate the remainder when 21408 is divided by 1125. 33 What is the remainder when 1876 is divided by 833? 210 What is the remainder when 7060 is divided by 588? 4 What is the remainder when 4344 is divided by 272? 264 What is the remainder when 145893 is divided by 1131? 1125 Calculate the remainder when 42126 is divided by 7011. 60 Calculate the remainder when 604834 is divided by 466. 432 Calculate the remainder when 2259 is divided by 1101. 57 What is the remainder when 371402 is divided by 777? 773 What is the remainder when 1845 is divided by 1397? 448 What is the remainder when 5722 is divided by 1902? 16 What is the remainder when 377795 is divided by 52? 15 What is the remainder when 6056 is divided by 334? 44 Calculate the remainder when 151516 is divided by 179. 82 What is the remainder when 28219 is divided by 84? 79 Calculate the remainder when 283285 is divided by 30. 25 Calculate the remainder when 364590 is divided by 60765. 0 What is the remainder when 1758 is divided by 404? 142 What is the remainder when 2536 is divided by 701? 433 What is the remainder when 2769 is divided by 891? 96 Calculate the remainder when 28744 is divided by 130. 14 Calculate the remainder when 82662 is divided by 2755. 12 What is the remainder when 2625 is divided by 867? 24 Calculate the remainder when 34918 is divided by 1451. 94 Calculate the remainder when 3394 is divided by 189. 181 What is the remainder when 11705 is divided by 616? 1 Calculate the remainder when 92207 is divided by 2305. 7 Calculate the remainder when 30328 is divided by 24. 16 What is the remainder when 7463 is divided by 7455? 8 Calculate the remainder when 4009 is divided by 17. 14 Calculate the remainder when 401409 is divided by 274. 273 What is the remainder when 5097 is divided by 838? 69 What is the remainder when 72975 is divided by 17? 11 Calculate the remainder when 21142 is divided by 5283. 10 Calculate the remainder when 63386 is divided by 14. 8 Calculate the remainder when 47409 is divided by 431. 430 Calculate the remainder when 2771 is divided by 23. 11 What is the remainder when 37106 is divided by 312? 290 What is the remainder when 148331 is divided by 49428? 47 What is the remainder when 103218 is divided by 18? 6 Calculate the remainder when 10364 is divided by 24. 20 What is the remainder when 18913 is divided by 945? 13 What is the remainder when 123957 is divided by 59? 57 Calculate the remainder when 1150 is divided by 193. 185 Calculate the remainder when 1436 is divided by 38. 30 Calculate the remainder when 1170478 is divided by 20. 18 What is the remainder when 14040 is divided by 2227? 678 Calculate the remainder when 1557219 is divided by 25. 19 What is the remainder when 91099 is divided by 60? 19 Calculate the remainder when 5709 is divided by 1003. 694 What is the remainder when 7656 is divided by 984? 768 What is the remainder when 2633 is divided by 33? 26 What is the remainder when 32036 is divided by 10611? 203 What is the remainder when 44384 is divided by 44369? 15 Calculate the remainder when 787283 is divided by 112467. 14 Calculate the remainder when 23736 is divided by 3954. 12 Calculate the remainder when 251 is divided by 232. 19 What is the remainder when 28148 is divided by 2344? 20 What is the remainder when 1223 is divided by 55? 13 Calculate the remainder when 1020 is divided by 84. 12 What is the remainder when 8864 is divided by 190? 124 What is the remainder when 299662 is divided by 639? 610 Calculate the remainder when 15066 is divided by 28. 2 What is the remainder when 412525 is divided by 304? 301 Calculate the remainder when 1471 is divided by 845. 626 What is the remainder when 2231 is divided by 388? 291 What is the remainder when 32898 is divided by 555? 153 What is the remainder when 87718 is divided by 10? 8 What is the remainder when 2011 is divided by 242? 75 What is the remainder when 3872 is divided by 932? 144 Calculate the remainder when 21143 is divided by 8. 7 What is the remainder when 193323 is divided by 25? 23 Calculate the remainder when 129036 is divided by 230. 6 Calculate the remainder when 237324 is divided by 993. 990 Calculate the remainder when 310914 is divided by 20727. 9 Calculate the remainder when 7035 is divided by 1329. 390 Calculate the remainder when 5542 is divided by 1106. 12 What is the remainder when 437 is divided by 89? 81 What is the remainder when 193432 is divided by 686? 666 Calculate the remainder when 4375 is divided by 73. 68 Calculate the remainder when 1133 is divided by 741. 392 What is the remainder when 99076 is divided by 24767? 8 What is the remainder when 346949 is divided by 1285? 1284 Calculate the remainder when 11041 is divided by 746. 597 Calculate the remainder when 5383 is divided by 58. 47 Calculate the remainder when 10534 is divided by 62. 56 What is the remainder when 4798 is divided by 373? 322 Calculate the remainder when 1675 is divided by 338. 323 What is the remainder when 18150 is divided by 1393? 41 What is the remainder when 4349 is divided by 2279? 2070 What is the remainder when 752223 is divided by 88? 87 Calculate the remainder when 2248 is divided by 54. 34 What is the remainder when 560949 is divided by 49? 46 Calculate the remainder when 78729 is divided by 212. 77 Calculate the remainder when 15138 is divided by 15128. 10 What is the remainder when 25774 is divided by 173? 170 What is the remainder when 38312 is divided by 12759? 35 Calculate the remainder when 27980 is divided by 65. 30 What is the remainder when 37770 is divided by 36? 6 Calculate the remainder when 163642 is divided by 27. 22 Calculate the remainder when 49299 is divided by 54. 51 What is the remainder when 9930 is divided by 52? 50 What is the remainder when 46016 is divided by 133? 131 Calculate the remainder when 196 is divided by 32. 4 What is the remainder when 326981 is divided by 163	{ "pile_set_name": "DM Mathematics" }
94 to 7 decimal places. -0.0000455 What is -0.000466512 rounded to 4 decimal places? -0.0005 What is 19571.74 rounded to the nearest 100? 19600 What is 967760 rounded to the nearest one hundred thousand? 1000000 What is -2.021844 rounded to one decimal place? -2 What is -35.62688 rounded to one dp? -35.6 What is -1576.068 rounded to the nearest 100? -1600 Round -0.000000312004 to six dps. 0 What is 48812.7 rounded to the nearest one hundred? 48800 Round -0.0005675888 to 7 dps. -0.0005676 What is -2.54568 rounded to 2 decimal places? -2.55 Round -0.21753133 to four dps. -0.2175 What is -0.00000814765 rounded to 6 decimal places? -0.000008 What is 0.0000394221 rounded to seven decimal places? 0.0000394 What is 0.0085271 rounded to three dps? 0.009 What is -55944078 rounded to the nearest 10000? -55940000 What is -0.2461043 rounded to two decimal places? -0.25 Round -51.01881 to 1 decimal place. -51 What is -0.2049595 rounded to two dps? -0.2 Round 18.860529 to the nearest integer. 19 Round -804.4678 to the nearest 100. -800 Round 8501.3 to the nearest one hundred. 8500 What is 420150 rounded to the nearest 100000? 400000 What is 0.00043826 rounded to 6 decimal places? 0.000438 What is 4684 rounded to the nearest 100? 4700 Round -90899.81 to the nearest ten thousand. -90000 What is 0.1553068 rounded to 2 dps? 0.16 What is 24536100 rounded to the nearest 100000? 24500000 What is 500.2 rounded to the nearest ten? 500 Round 0.008443831 to 3 decimal places. 0.008 Round 45.126829 to 2 dps. 45.13 Round 0.15534541 to one decimal place. 0.2 Round -74896.5 to the nearest one thousand. -75000 What is -49991800 rounded to the nearest 1000000? -50000000 What is -0.00150455 rounded to three dps? -0.002 What is -0.000259 rounded to 4 decimal places? -0.0003 What is -0.0000003880415 rounded to 7 decimal places? -0.0000004 Round -2389153 to the nearest 10000. -2390000 What is 62.0072 rounded to the nearest ten? 60 Round 5381.6596 to the nearest integer. 5382 What is -6.71363 rounded to 1 decimal place? -6.7 Round -13.35223 to the nearest integer. -13 Round 828984100 to the nearest 100000. 829000000 What is -31280.99 rounded to the nearest one thousand? -31000 What is -0.0078278 rounded to 4 decimal places? -0.0078 What is 0.00000523212 rounded to 7 dps? 0.0000052 Round 8.947233 to two dps. 8.95 Round 9080.15 to the nearest one thousand. 9000 Round -0.000000100257 to seven decimal places. -0.0000001 Round -0.0000944766 to 6 dps. -0.000094 Round 20834200 to the nearest 1000000. 21000000 What is -0.766215 rounded to 1 decimal place? -0.8 Round -420.29 to the nearest one hundred. -400 Round 1.89385 to 1 dp. 1.9 Round -455.428 to the nearest 100. -500 What is -0.000028176833 rounded to six decimal places? -0.000028 Round -0.00008152681 to six dps. -0.000082 Round -0.00136964 to five decimal places. -0.00137 What is -219015.7 rounded to the nearest one hundred? -219000 What is 754.1668 rounded to 1 decimal place? 754.2 What is -0.0000026175607 rounded to 7 dps? -0.0000026 Round -12320030 to the nearest 1000000. -12000000 Round -0.0000582153 to five decimal places. -0.00006 What is -49639462 rounded to the nearest one hundred thousand? -49600000 What is -204193.5 rounded to the nearest one hundred? -204200 What is -2094.082 rounded to 0 decimal places? -2094 Round 3546853 to the nearest ten thousand. 3550000 Round 0.0014983632 to four dps. 0.0015 Round 0.00451166 to 4 decimal places. 0.0045 What is -0.0000866202 rounded to five decimal places? -0.00009 Round -1679250 to the nearest one hundred thousand. -1700000 What is -3504610000 rounded to the nearest 1000000? -3505000000 What is 0.0000481843 rounded to seven decimal places? 0.0000482 What is -45421450 rounded to the nearest 100000? -45400000 Round 0.00006157 to six decimal places. 0.000062 What is 186.7567 rounded to 2 dps? 186.76 Round 57.60167 to the nearest 10. 60 What is 6883109 rounded to the nearest one hundred thousand? 6900000 Round -650.1143 to the nearest 100. -700 What is 0.00010258919 rounded to seven dps? 0.0001026 Round -0.004403917 to three decimal places. -0.004 Round -120.146 to the nearest ten. -120 Round 2496.548 to the nearest 100. 2500 What is 310275 rounded to the nearest ten thousand? 310000 Round 1.63912 to 1 dp. 1.6 What is 0.0002868002 rounded to six decimal places? 0.000287 Round 0.000290794 to 5 decimal places. 0.00029 What is 71709.31 rounded to the nearest 10? 71710 Round 0.001309762 to 6 dps. 0.00131 What is -178 rounded to the nearest integer? -178 Round -0.00000890241 to 6 dps. -0.000009 Round 10792180 to the nearest one million. 11000000 What is -789.3197 rounded to the nearest 10? -790 Round -210.1611 to the nearest integer. -210 Round -83976400 to the nearest one hundred thousand. -84000000 Round 2747920 to the nearest one hundred thousand. 2700000 Round -0.0001861528 to 6 dps. -0.000186 What is -6459.376 rounded to the nearest 100? -6500 Round 1553844 to the nearest one hundred thousand. 1600000 Round 0.0030298347 to four decimal places. 0.003 Round 0.000364906 to six decimal places. 0.000365 What is -0.0020050112 rounded to four dps? -0.002 Round -120738900 to the nearest one million. -121000000 What is 76650680 rounded to the nearest 100000? 76700000 Round -176.9663 to one dp. -177 What is -0.000000840485 rounded to 7 decimal places? -0.0000008 Round -0.00002265915 to 6 dps. -0.000023 What is 852175.7 rounded to the nearest ten thousand? 850000 Round 0.002037085 to four decimal places. 0.002 Round -0.02864955 to 2 dps. -0.03 What is 2.5339562 rounded to 3 decimal places? 2.534 What is 0.001110388 rounded to five decimal places? 0.00111 What is -2599.35 rounded to the nearest ten? -2600 Round -0.000006340627 to 7 decimal places. -0.0000063 What is 0.00000019809 rounded to seven decimal places? 0.0000002 Round -3.6026042 to the nearest integer. -4 Round 412157 to the nearest 100000. 400000 What is 4.5742 rounded to 0 dps? 5 Round -1.785855 to 2 dps. -1.79 Round 0.0070110995 to three dps. 0.007 What is -81910300 rounded to the nearest one million? -82000000 What is -8460745000 rounded to the nearest one million? -8461000000 Round -0.0000287189 to 5 dps. -0.00003 Round -0.0285347 to 2 dps. -0.03 What is 226.2114 rounded to one dp? 226.2 What is 26.7604 rounded to 2 decimal places? 26.76 Round -0.00000107392 to 6 decimal places. -0.000001 Round 565520.9 to the nearest one hundred thousand. 600000 Round 0.00132354 to 6 decimal places. 0.001324 What is -0.8176 rounded to 1 dp? -0.8 What is -99729100 rounded to the nearest one hundred thousand? -99700000 Round -11061.86 to the nearest 1000. -11000 What is 1714880000 rounded to the nearest 1000000? 1715000000 Round 424127 to the nearest one thousand. 424000 What is -52.5836 rounded to 0 decimal places? -53 What is -0.0272296 rounded to 2 dps? -0.03 What is -502971 rounded to the nearest one hundred thousand? -500000 What is 2.399886 rounded to 1 dp? 2.4 What is 0.0000155814 rounded to five dps? 0.00002 What is 5349697.9 rounded to the nearest 1000000? 5000000 What is -437606 rounded to the nearest 1000? -438000 Round -0.01072896 to 5 decimal places. -0.01073 What is -9924000 rounded to the nearest 1000000? -10000000 Round 7.825696 to 3 dps. 7.826 What is -0.000137688364 rounded to 6 decimal places? -0.000138 What is -494.373 rounded to the nearest one hundred? -500 What is 0.0003747911 rounded to 6 dps? 0.000375 What is 44101 rounded to the nearest ten thousand? 40000 Round 0.000270876 to 6 decimal places. 0.000271 Round -3.121161 to 1 decimal place. -3.1 What is -0.00779822 rounded to three decimal places? -0.008 Round 0.991971 to 2 decimal places. 0.99 Round -0.000007645865 to 6 decimal places. -0.000008 Round 0.00004352389 to 5 dps. 0.00004 Round 0.000049098 to 6 decimal places. 0.000049 What is 189.0889 rounded to the nearest ten? 190 Round -1033.6913 to the nearest one hundred. -1000 Round 1266680 to the nearest 100000. 1300000 What is 0.000003626544 rounded to 6 decimal places? 0.000004 What is 83722600 rounded to the nearest 1000000? 84000000 What is -35930550 rounded to the nearest one hundred thousand? -35900000 Round -38242.96 to the nearest one hundred. -38200 What is -19.25548 rounded to one decimal place? -19.3 What i	{ "pile_set_name": "DM Mathematics" }
e the third derivative of z*4/12 - 2z*2. Let r(o) be the third derivative of 0o + 4o2 + 0o*3 + 1/6o*4 + 0. Give r(l(h)). 8h Let n(r) = 23r - 22r - 15r. Let z(a) = a2. Calculate n(z(g)). -14g*2 Let u(p) = 4p*2 - 4p*2 - 3p*2. Let q(d) = 7d*2 + 5d. Let k(s) = 3s2 + 2s. Suppose -6n = -2n + 20. Let z(w) = nk(w) + 2q(w). Give u(z(b)). -3b4 Let l(q) = 3q2. Let u(a) = -a2 - 3a + 3. Let b(j) = 2j*2 + 5j - 5. Let i(v) = -6b(v) - 10u(v). Calculate i(l(o)). -18o4 Let c(o) = -413o*2 - 415o*2 + 843o*2. Let u(t) = -7t*2. What is c(u(v))? 735v*4 Let l(k) = -2k. Let j be l(4). Let n(r) = -5r2 + 3r - 3. Let x(w) = 14w2 - 8w + 8. Let b(p) = jn(p) - 3x(p). Let z(v) = 2v. Determine z(b(m)). -4m*2 Suppose 4y - 4z + 8 = 0, -5y + 10 = -3z + 2z. Let n(i) = 0 - yi + 5i + 0. Let v(p) = 9p2. Determine v(n(f)). 36f*2 Let d(x) = -2x*2. Let m(k) = 760k. Calculate m(d(l)). -1520l2 Let l(a) = -a2 + 2a. Let s(u) = 110u2. Give l(s(p)). -12100p*4 + 220p*2 Let d(k) = -40k. Let t(x) = -6x. Give d(t(m)). 240m Let c(k) = -174k2. Let z(w) = -7w - 1. Determine z(c(o)). 1218o2 - 1 Let d(u) = -14u*2 - 8. Let f(w) = 9w*2 + 5. Let x(o) = -5d(o) - 8f(o). Let m(b) be the third derivative of b5/60 + 3b*2. Give x(m(z)). -2z*4 Let w(x) = 3x*2. Let k(m) be the first derivative of 0m*2 + 0m - 3 - 2/3m3. What is k(w(v))? -18v*4 Let p(f) = f + 1. Let t(r) = 4r + 3. Let o = 16 + -13. Let x(y) = op(y) - t(y). Let c(j) be the second derivative of -j3/2 - j. Calculate x(c(m)). 3m Let o(q) = -7 - 8 - 5q + 6. Let d(w) = -w - 2. Let b = 11 + -7. Let g(t) = bo(t) - 18d(t). Let p(x) = -2x. Calculate p(g(l)). 4l Let k(p) = -27448p. Let i(q) = -2q2. Calculate i(k(s)). -1506785408s*2 Let u(i) = 2i. Let z(h) = 827h. Give u(z(p)). 1654p Let v(q) = -q. Let c(s) = s - 1. Let g be ((-24)/(-4))/(0 - -2). Let k = -1 - g. Let u(m) = -m*2 + 4m - 4. Let y(b) = kc(b) + u(b). Determine y(v(d)). -d2 Let s(w) = w2. Let t(d) = -7d*2. Calculate s(t(j)). 49j*4 Let d(j) = 3j. Let o = 8 - 4. Let f(z) = 6z2 + 4. Let s(a) = 5a*2 + 3. Let k(r) = os(r) - 3f(r). Give k(d(x)). 18x*2 Let w(t) = -10t*2. Let l(n) = -14n + 6n + 9n. Determine w(l(m)). -10m2 Suppose 0 = 4d - v - 13, -4v + 3v + 3 = 4d. Let p(b) = b + 1. Let h(a) = 2a + 1. Let m(k) = dh(k) - 2p(k). Let o(s) = -3s2. What is m(o(x))? -6x*2 Let r(t) = 2t. Let d = 29/10 - 12/5. Let g(u) be the first derivative of 0u - 2 - du*2. What is g(r(i))? -2i Let h(b) be the second derivative of -b*3/3 - 2b - 63. Let f(y) = -2y2 + 2y - 2y. Calculate h(f(q)). 4q*2 Let l(x) be the first derivative of -2/3x*3 + 0x - 1 + 0x2. Let u(i) be the third derivative of -i5/60 - i2. Calculate l(u(n)). -2n*4 Let x(u) = -3u. Let w(g) be the first derivative of 22g3/3 - 24. Give w(x(o)). 198o2 Let g(w) = -w2 + 12w. Let n(f) = 11f. Determine n(g(y)). -11y2 + 132y Let o(h) = -6h2 + 10h + 10. Let a(j) = -2j2 + 3j + 3. Let n(q) = 10a(q) - 3o(q). Let k(c) = -9c. Calculate k(n(w)). 18w2 Let w(z) be the third derivative of -z5/10 + 2z2 - 24. Let p(n) = -2n. Give w(p(y)). -24y2 Let u(h) be the first derivative of -37h*3/3 - 3. Let p(z) = 2z*2. Give u(p(o)). -148o*4 Let y(o) = -o + 3o + o. Let x(i) = -3i2. Determine y(x(v)). -9v*2 Let g(w) be the first derivative of -2w*2 - 65. Let c(t) = t - 1. Let v(d) = 4d - 3. Let m(f) = 6c(f) - 2v(f). What is g(m(p))? 8p Let c(w) = -w. Let z(s) be the first derivative of 4s*3 + 7. Determine z(c(b)). 12b*2 Let d(r) be the third derivative of -4r*5/15 + 32r*2. Let i(x) = -2x*2. Determine i(d(s)). -512s*4 Let a(n) = n. Let v(x) = 4x + 5. Let y(t) = 12t + 14. Let l(m) = -14v(m) + 5y(m). Determine a(l(w)). 4w Let n(h) = -23h + 23h - 7h2. Let o(w) = 48w*2. Let s(p) = 27n(p) + 4o(p). Let a(d) = 2d*2. Give a(s(y)). 18y*4 Let n(d) be the first derivative of -3d*2/2 - 14. Let a(s) = 10s. Give a(n(x)). -30x Let c = 2 - -1. Let g(r) = -c - 2r*2 + 3. Let h(t) = 15t. Let q(p) = 3p. Let k(u) = -2h(u) + 11q(u). What is g(k(o))? -18o2 Let a(f) = -f2 - 8 + 8. Let l(z) = -2z. Let r(c) = c. Let s(i) = 2l(i) + 5r(i). Calculate s(a(g)). -g2 Let p(d) = -2d + 89. Let u(a) = 3a2. Give p(u(n)). -6n*2 + 89 Let a(m) = -4m*2 - 269m. Let q(s) = -s. What is q(a(x))? 4x2 + 269x Let r(h) = h*2. Let q(w) = w. Let f(m) = -5m. Let g(d) = -f(d) - 2q(d). Determine r(g(b)). 9b*2 Let s(z) be the first derivative of 3z + 1/6z4 + 0z*3 + 0z*2 + 3. Let i(b) be the first derivative of s(b). Let j(m) = 3m*2. Determine i(j(q)). 18q*4 Let h(i) = 2i*2. Let g(a) = -5a - 35 + 35. What is g(h(v))? -10v2 Let d(u) = 67u*2. Let p(q) = -21q. Determine p(d(m)). -1407m2 Let v(y) = 2y*2. Let s(k) = 22k + 22k - 48k. Determine s(v(w)). -8w2 Let o = -2 - -4. Let p(f) = -3f*2 + 5f*2 - 10f*o + 5f*2. Let h(j) = -2j. Determine p(h(b)). -12b2 Let q(t) be the first derivative of 1 + 1/2t*2 + 0t. Let o(m) be the first derivative of -2m2 - 1. What is q(o(r))? -4r Let q(f) be the second derivative of f*3/2 + 6f. Let s(a) = 5a2. Determine q(s(b)). 15b*2 Let z(w) = 2w*2 - 128w. Let o(n) = 3n2. What is z(o(h))? 18h*4 - 384h*2 Let k(a) = -6a + 6. Let p(m) = -2m2 + 7m. Give p(k(f)). -72f2 + 102f - 30 Let f(s) = 2s2. Let t(c) be the third derivative of 19c*4/24 + 2c*2. Determine f(t(x)). 722x2 Let y(q) be the third derivative of q7/2520 + 7q4/24 + 8q*2. Let g(s) be the second derivative of y(s). Let v(w) = 2w. Determine g(v(m)). 4m2 Let n(s) = 2523s. Let v(l) = 2l2. What is n(v(x))? 5046x*2 Let l(i) = 7i*2. Let t(w) = -5w*2 + 2w. Determine l(t(c)). 175c4 - 140c*3 + 28c2 Let o(b) = -b2. Let v(x) = 3x - 28. Give o(v(m)). -9m*2 + 168m - 784 Let t(m) be the first derivative of -5/3m3 + 4 + 0m*2 + 0m. Let d(q) = -2q. Give t(d(w)). -20w*2 Let q(z) = 2z*2. Let i(l) = 247l. Determine i(q(a)). 494a2 Let y(l) = -50l*2. Let m(v) = -68v*2. What is y(m(f))? -231200f*4 Let v(m) = 3m. Suppose 2s + 6 = 0, -93 = -5y - 3s + 13. Let x(a) = ya*2 - 11a*2 - 9a*2. Determine v(x(r)). 9r*2 Let i(s) = -18s - 7s - 11s + 40s. Let a(c) = 9c - 7. Let h(z) = -8z + 6. Let n(m) = 6a(m) + 7h(m). Determine i(n(v)). -8v Let q(d) = -d. Let w(z) = z*2 + 1. Let h(y) be the first derivative of -4y*3/3 - 6y + 1. Let l(i) = -h(i) - 6w(i). Determine l(q(j)). -2j*2 Let x(f) = -3f*2. Let u(q) = -4q - 92. What is x(u(k))? -48k2 - 2208k - 25392 Let o(h) be the third derivative of 5h4/12 + 11h*2. Let c(l) = -l. Determine o(c(p)). -10p Let m(s) = -4s. Let v(t) = 30t + 1. Calculate m(v(j)). -120j - 4 Let x(d) be the third derivative of d7/2520 - d4/24 - d2. Let g(l) be the second derivative of x(l). Let o(y) = 2y + 12 - 12. Give g(o(w)). 4w2 Let d(g) = 110g*2 - 3. Let y(q) = 10q*2. What is d(y(a))? 11000a*4 - 3 Let b(z) = -9z*2. Let s(c) = 32c*2. Give s(b(f)). 2592f*4 Let b(y) = y. Let u(g) = 3g*2 + 5g + 5. Let a(k) = -k*2 - 2k - 2. Let j be (4 + -1)(-8)/(-4). Let w = 0 + 15. Let l(s) = ju(s) + wa(s). What is b(l(p))? 3p2 Let o(g) be the third derivative of g4/12 - 5g2. Let u(i) = 2i + 3. Let r(b) = 8b + 13. Let z(m) = -6r(m) + 26u(m). Calculate z(o(f)). 8f Let f(q) = 0 + 0 - 2q. Let s(l) be the third derivative of -l6/720 + l4/24 - l2. Let o(t) be the second derivative of s(t). Determine f(o(w)). 2w Let q(x) be the second derivative of x*4/6 + 10x. Let o(k) = -6k2. Calculate o(q(m)). -24m4 Let m(h) be the second derivative of -h6/360 - h*3/3 + 2h. Let z(u) be the second derivative of m(u). Let o(w) = -2w. Determine z(o(q)). -4q2 Let c(t) = -t2 + t + 1. Let p(u) = -5u2 + 2u + 2. Let x(b) = 2c(b) - p(b). Let q(k) = -k + k - k + 4k. Give x(q(s)). 27s2 Let h(m) = -31m. Let c(q) = -9 + 9 - 6q. Let u(d) = 11c(d) - 2h(d). Let k(p) = p. Determine u(k(y)). -4y Let g(d) = -d*2. Let k(q) be the first derivative of -8q*3 + 14. Determine k(g(u)). -24u*4 Suppose 0 = 2t + t. Let k(g) be the second	{ "pile_set_name": "DM Mathematics" }
ivide 2 by -32. -1/16 Calculate 4 divided by -47. -4/47 Calculate -2 divided by 5. -2/5 What is 385 divided by 1? 385 Calculate 5 divided by -85. -1/17 Divide -1144 by 4. -286 Calculate -37 divided by 81. -37/81 Divide 29 by -31. -29/31 Divide -1854 by -3. 618 Calculate 1060 divided by 530. 2 What is -164 divided by -6? 82/3 Divide 1885 by 1885. 1 Calculate -3 divided by 4698. -1/1566 Calculate -492 divided by -4. 123 Divide -3633 by -1. 3633 What is 27 divided by -13? -27/13 Calculate -1692 divided by 423. -4 What is 9078 divided by -34? -267 Calculate 8061 divided by 3. 2687 Divide 1190 by 5. 238 What is -874 divided by -437? 2 What is -694 divided by 4? -347/2 Calculate -8 divided by 626. -4/313 Divide 2124 by 3. 708 Calculate -819 divided by 819. -1 -2196 divided by -6 366 Divide -4940 by -5. 988 2 divided by 34 1/17 Calculate 1320 divided by -264. -5 -636 divided by -3 212 What is 165 divided by 33? 5 Divide 5876 by -2938. -2 What is 120 divided by 5? 24 Divide 1584 by 132. 12 Divide 4 by 275. 4/275 -127 divided by -1 127 What is 0 divided by 29? 0 What is -650 divided by -65? 10 Calculate -5495 divided by -5. 1099 Divide -14724 by -1. 14724 Calculate 2820 divided by 60. 47 What is -14 divided by -1139? 14/1139 39 divided by -19 -39/19 Calculate 5395 divided by -13. -415 What is 9 divided by 19? 9/19 Divide 173 by -15. -173/15 What is 2 divided by 130? 1/65 11 divided by -78 -11/78 601 divided by -4 -601/4 What is 276 divided by -3? -92 What is -4 divided by -31? 4/31 Divide 37 by 2. 37/2 2 divided by -144 -1/72 Calculate -37057 divided by -3. 37057/3 What is 327 divided by 4? 327/4 -361 divided by 19 -19 What is -336 divided by -2? 168 Calculate -4 divided by 126. -2/63 96 divided by 4 24 Calculate 2185 divided by 115. 19 What is 97 divided by 7? 97/7 4 divided by -8 -1/2 4 divided by 510 2/255 Calculate -21820 divided by -5. 4364 Calculate -34060 divided by -52. 655 What is -3 divided by -15? 1/5 -9 divided by -71 9/71 Calculate -18 divided by 6. -3 Calculate 4 divided by 105. 4/105 What is 752 divided by -4? -188 Calculate -5 divided by -17. 5/17 Calculate -6323 divided by -2. 6323/2 2892 divided by 4 723 Divide -1436 by -359. 4 1 divided by 25 1/25 Calculate 1264 divided by 8. 158 Calculate -576 divided by -8. 72 Divide -83 by -83. 1 What is 1 divided by -1973? -1/1973 What is 3200 divided by 5? 640 Divide 910 by 2. 455 What is -48 divided by 3? -16 Calculate 75 divided by 25. 3 What is 0 divided by 58? 0 Calculate -25 divided by -25. 1 Calculate -19 divided by -1. 19 Divide 1255 by -251. -5 93 divided by -6 -31/2 -1008 divided by -72 14 What is 1048 divided by 262? 4 Divide -241 by 1. -241 5436 divided by -36 -151 Divide 12651 by -3. -4217 Calculate 2 divided by -153. -2/153 Divide 2 by 1678. 1/839 Divide -2478 by 3. -826 Divide -28 by 14. -2 What is -14 divided by -1? 14 Calculate 153 divided by -51. -3 What is 6 divided by 157? 6/157 Calculate -5 divided by -5. 1 Calculate 0 divided by -55. 0 What is 385 divided by -11? -35 Calculate 4 divided by -5161. -4/5161 Divide 1061 by 4. 1061/4 Divide 8970 by -6. -1495 Calculate 39 divided by -3. -13 Divide 2 by -278. -1/139 354 divided by -6 -59 Divide -2 by -582. 1/291 Calculate 470 divided by -235. -2 Calculate 0 divided by 22. 0 What is -4 divided by 23? -4/23 What is 0 divided by -317? 0 Divide 37 by -4. -37/4 5229 divided by -1 -5229 Calculate -23 divided by 81. -23/81 Divide 868 by -1. -868 Calculate 6200 divided by -248. -25 What is 28 divided by 16? 7/4 Calculate -264 divided by -33. 8 Divide 3482 by -8. -1741/4 3 divided by -610 -3/610 What is 414 divided by -138? -3 -277 divided by 1 -277 Calculate -27120 divided by 120. -226 Divide -33930 by 3. -11310 Calculate -956 divided by 3. -956/3 Calculate 3 divided by 220. 3/220 What is 31 divided by -34? -31/34 Calculate 5556 divided by 12. 463 Divide 834 by -6. -139 21130 divided by -4226 -5 Calculate 0 divided by -243. 0 4 divided by -72 -1/18 Calculate -2163 divided by 721. -3 Calculate 110 divided by 4. 55/2 -172 divided by 74 -86/37 What is 88572 divided by -3? -29524 Calculate -1459 divided by 6. -1459/6 Divide 225 by 1. 225 What is -1522 divided by -2? 761 Calculate 1206 divided by -402. -3 Calculate 316 divided by 79. 4 -6290 divided by 1258 -5 Divide 5 by 618. 5/618 Calculate 4026 divided by 6. 671 What is 2024 divided by -1? -2024 Divide 204 by -68. -3 Calculate 26 divided by 27. 26/27 Calculate 45 divided by 3. 15 Divide 1400 by 2. 700 What is 0 divided by 335? 0 Calculate 20 divided by -42. -10/21 Calculate 2498 divided by 2498. 1 Calculate 3904 divided by -488. -8 What is -215 divided by -6? 215/6 Divide 1 by -216. -1/216 -7072 divided by 416 -17 What is 2 divided by -1? -2 Calculate -1 divided by -227. 1/227 Calculate 8378 divided by 118. 71 Calculate -14 divided by 566. -7/283 What is -3 divided by -2260? 3/2260 What is -7 divided by -29? 7/29 Calculate -18 divided by -2. 9 Divide -10206 by 18. -567 Calculate 1 divided by 95. 1/95 What is 17682 divided by 42? 421 Divide 0 by -120. 0 -185 divided by -5 37 Calculate -4 divided by 513. -4/513 944 divided by 118 8 What is -301 divided by 1? -301 207 divided by 3 69 Divide 290 by -58. -5 Divide -1336 by -1. 1336 Calculate -1504 divided by -376. 4 What is 1623 divided by -3? -541 464 divided by -16 -29 What is 13488 divided by -3? -4496 Calculate -780 divided by 13. -60 Calculate 0 divided by -3561. 0 Calculate 9680 divided by 880. 11 Calculate -315 divided by 105. -3 Calculate -1134 divided by -3. 378 Calculate -1718 divided by 1. -1718 Calculate -182 divided by 5. -182/5 What is 71 divided by 69? 71/69 Calculate 348 divided by 3. 116 -3 divided by -135 1/45 Calculate -14 divided by 31. -14/31 Divide 6765 by 33. 205 Calculate 0 divided by -9. 0 Divide -11388 by 12. -949 Calculate -1884 divided by -471. 4 Divide -1 by -178. 1/178 What is 151 divided by 12? 151/12 Calculate -2627 divided by -37. 71 Calculate 103180 divided by 5. 20636 Calculate 488 divided by -244. -2 Divide -3 by 709. -3/709 Divide -117 by 6. -39/2 What is -14926 divided by -878? 17 -2479 divided by -6 2479/6 Divide 15168 by -316. -48 -978 divided by -6 163 What is 675 divided by 5? 135 What is -342 divided by -6? 57 -19818 divided by -2 9909 What is -2 divided by 832? -1/416 Calculate 38 divided by 227. 38/227 What is -12 divided by -6? 2 -420 divided by -6 70 Divide 23 by -23. -1 What is 5 divided by -324? -5/324 -272 divided by -2 136 Calculate -4 divided by 1026. -2/513 7 divided by -26 -7/26 225 divided by -25 -9 What is -375 divided by -5? 75 Calculate 2763 divided by -5. -2763/5 What is 497 divided by -5? -497/5 Calculate 33 divided by -3. -11 -90 divided by 97 -90/97 What is -6112 divided by -8? 764 -3 divided by -873 1/291 Divide 232 by 116. 2 149 divided by 14 149/14 Calculate -168 divided by -28. 6 Calculate -594 divided by -6. 99 Divide -100 by -20. 5 Calculate 3 divided by 34. 3/34 What is 345 divided by 69? 5 Divide -363 by 121. -3 4 divided by -52 -1/13 Divide -11 by 13. -11/13 Calculate -1729 divided by 13. -133 Calculate 5796 divided by -69. -84 Calculate -179 divided by 2. -179/2 Divide -74 by -37. 2 Divide 318 by -106. -3 What is -4 divided by 51? -4/51 What is 182 divided by 13? 14 What is 50 divided by -65? -10/13 Calculate 240 divided by 57. 80/19 What is 12001 divided by 11? 1091 -69 divided by 3 -23 -3 divided by 3627 -1/1209 What is 32 divided by -8? -4 Calculate 75 divided by 25. 3 Calculate 576 divided by -32. -18 -268 divided by 30 -134/15 Divide -8 by -29. 8/29 What is -3 divided by 27? -1/9 Divide -1 by -326. 1/326 Calculate -5810 divided by -2. 2905 9756 divided by 4 2439 172 divided by -2 -86 Calculate -58 divided by -58. 1 -90 divided by 90 -1 28 divided by 14 2 Calculate -10 divided by -10. 1 Divide -2 by 249. -2/249 -2482 divided by -146 17 What is 21 divided by -155? -21/155 Divide -60 by -5. 12 Calculate 513 divided by 1. 513 Divide 120 by 24. 5 Calculate 2652 divided by 78. 34 Divide 0 by 1422. 0 Divide -20 by 12. -5/3 What is 0 divided by 39? 0 Calculate -7 divided by 749. -1/107 Divide -9 by 3. -3 Divide -554 by 2. -277 Calculate 6612 divided by 6. 1102 What is -4 divided by -154? 2/77 Calculate 1216 divided by 3. 1216/3 What is 18 divided by -8? -9/4 20 divided by -	{ "pile_set_name": "DM Mathematics" }
= -83f3 - 1486f*2 + 200f + 1021. Give i(-18). 13 Let d(y) = 7y3 - 238y*2 - 748y - 8. Calculate d(-3). -95 Let h(m) = 1170m + 7487. Calculate h(-7). -703 Let w(k) = k3 + 52k*2 + 301k + 15653. Give w(-52). 1 Let k(n) = n*3 + 99n*2 + 1750n + 177. Calculate k(-76). 25 Let o(w) = 199w2 - 159w - 25. Calculate o(2). 453 Let y(w) = -2392w + 2298. What is y(1)? -94 Let s(d) = -3024d - 59. Determine s(0). -59 Let o(s) = 1882s - 239026. Give o(127). -12 Let d(q) = -27q*2 + 2180q + 570. Determine d(81). 3 Let a(f) = -735f - 5305. Determine a(-13). 4250 Let z(v) = v2 - 1019v + 203180. What is z(272)? -4 Let p(b) = -b*3 + 47b*2 - 33b + 1115. Calculate p(47). -436 Let z(v) = 225v + 27792. Determine z(-115). 1917 Let d(z) = z3 + 157z*2 + 5892z - 2824. Determine d(-94). -4 Let u(a) = -352a2 - 1356a - 1002. Determine u(-1). 2 Let s(k) = 3k2 + 5k - 319. What is s(-22)? 1023 Let s(c) = 1091c - 8079. Determine s(7). -442 Let c(q) = 45794q - 45804. Calculate c(1). -10 Let w(h) = -62h2 + 6026h - 1128. Calculate w(97). 36 Let n(b) = 35b2 - 26b + 7. Determine n(4). 463 Let y(l) = -l*2 + 369l + 156341. Determine y(-252). -151 Let y(p) = -2p3 + 451p*2 - 892p - 18. Calculate y(2). -14 Let f(z) = 2z3 - 138z*2 - 164z + 11647. Determine f(69). 331 Let u(w) = w*3 + 35w*2 - 107w - 1326. Determine u(-5). -41 Let t(k) = 64k + 6268. Calculate t(-87). 700 Let z(a) = 25a*2 + 1198a + 10873. What is z(-9)? 2116 Let h(b) = -b*3 - 3b*2 + 120b + 7. What is h(9)? 115 Let p(d) = -4d2 + 89d + 3505. Calculate p(42). 187 Let t(l) = -86701l - 1213823. Calculate t(-14). -9 Let g(u) = -18u*2 - 269u + 12478. Calculate g(20). -102 Let l(h) = 3136h + 191611. Determine l(-61). 315 Let t(s) = 2s*2 + 820s - 15444. Calculate t(19). 858 Let l(o) = 2o3 + 17o*2 - 1205o + 8523. Calculate l(11). -13 Let b(z) = 52z2 - 365z + 20. What is b(5)? -505 Let t(o) = o*2 - 38o + 962. Give t(33). 797 Let t(k) = -3288k - 34715. Give t(-10). -1835 Let a(w) = -710w*2 - 1221w + 2445. Give a(2). -2837 Let n(q) = 380q - 179. What is n(3)? 961 Let l(n) = n3 - 202n*2 + 15n + 37464. What is l(201)? 78 Let o(c) = 15c3 + c2 - 32c - 107. Give o(-3). -407 Let s(y) = -3y2 + 41y + 1714. Determine s(-21). -470 Let m(s) = -4s3 + 69s*2 - 261s + 33. Give m(8). 313 Let g(b) = 11232127b + 11232115. Determine g(-1). -12 Let v(l) = l3 + 80l*2 + 128l - 2145. Determine v(-78). 39 Let x(r) = r*3 - 18r*2 + 116r - 290. What is x(8)? -2 Let f(p) = 374p - 1955. Calculate f(6). 289 Let n(f) = -3f*3 + 18f*2 - 12f - 19. Give n(8). -499 Let v(r) = r*3 + 8r*2 - 123r - 897. Determine v(-10). 133 Let m(a) = -a*3 - 3a*2 + 27a + 52. What is m(-3)? -29 Let n(j) = -j*3 + 919j*2 - 6357j - 24650. Determine n(912). -26 Let t(x) = -22x3 - 43x*2 + 131x + 8. Calculate t(3). -580 Let u(l) = -13l2 + 1023l - 14204. Determine u(18). -2 Let d(v) = 55652v + 1892165. Determine d(-34). -3 Let n(d) = -d3 + 1390d*2 + 3d - 4173. What is n(1390)? -3 Let i(p) = 3p3 + 60p*2 + 40p - 722. Give i(3). 19 Let c(w) = 466w + 49128. Calculate c(-97). 3926 Let s(v) = 196v + 4986. Calculate s(-28). -502 Let f(n) = -2n3 + 10n*2 - 152n + 428. Give f(3). 8 Let x(q) = -59q3 - 11q*2 - 30q - 16. What is x(-3)? 1568 Let i(c) = -6c3 - 906c*2 - 1767c + 3135. Calculate i(-149). 6 Let z(o) = 52o + 239. Give z(10). 759 Let t(x) = 3277x - 16292. What is t(5)? 93 Let o(l) = -503l - 79971. Give o(-159). 6 Let r(f) = -16f*3 + 152f*2 - 2f + 68. What is r(10)? -752 Let j(o) = 6o3 - 11o*2 - 720o + 3122. Determine j(5). -3 Let u(g) = -g*3 - 326g*2 + 1596g + 307. Determine u(5). 12 Let a(v) = -10v3 + 16v*2 - 14v + 70. Determine a(2). 26 Let t(f) = 164f - 3619. Determine t(17). -831 Let l(j) = -2j*3 - 83j*2 + 427j + 574. Calculate l(-46). -24 Let l(s) = -s*3 + 32s*2 - 123s + 335. Give l(28). 27 Let m(d) = -24d3 - 40d*2 - 106d - 37. Determine m(-3). 569 Let a(h) = h*2 - 12484h + 62352. Determine a(5). -43 Let c(o) = o*3 - 11o*2 - 182o - 307. What is c(-7)? 85 Let y(g) = 2g3 + 49g*2 + 162g + 311. Give y(-21). -4 Let h(r) = -5r2 - 4170r - 33084. Calculate h(-8). -44 Let w(t) = t*2 + 2228t + 328979. Give w(-159). 8 Let p(a) = 72355a - 72363. Give p(1). -8 Let m(y) = -55619y + 6006845. What is m(108)? -7 Let m(o) = -2o3 + 128o*2 + 2964o - 103. What is m(82)? 881 Let o(j) = -3j2 + 2202j - 210525. What is o(113)? -6 Let t(a) = -5a3 + 84a*2 - 50a - 1820. Determine t(14). 224 Let b(t) = -t*3 - 10t*2 + 19t - 6. Determine b(-15). 834 Let x(j) = j*2 + 127898j - 2174594. Calculate x(17). -39 Let n(v) = -4231v - 81237. Calculate n(-19). -848 Let q(x) = -398x + 961. Calculate q(3). -233 Let y(d) = -124d2 - 3744d - 842. Give y(-30). -122 Let q(l) = -238260l - 16201682. Determine q(-68). -2 Let n(j) = 4j*2 + 31j - 268. Calculate n(7). 145 Let w(t) = 1556t - 51339. Calculate w(33). 9 Let m(y) = -59y - 17. Calculate m(0). -17 Let f(z) = -2z3 - 11z*2 + 149444z + 1045956. Determine f(-7). -5 Let q(x) = 26x2 - 159x - 4550. Give q(-11). 345 Let d(c) = 8c2 - 1122c - 1117. Determine d(-1). 13 Let w(g) = g*2 - 114g - 16075. Give w(-82). -3 Let q(h) = -3h3 + 11h*2 + 29h - 25. Determine q(-9). 2792 Let n(r) = -3r3 - 109r*2 - 834r - 1615. Give n(-4). 169 Let x(l) = 2l3 - 17l*2 + 332l - 78. Give x(13). 5759 Let l(q) = 13834q - 179850. What is l(13)? -8 Let j(c) = c3 + 59c*2 + 589c - 2140. Determine j(-45). -295 Let v(a) = 4966a2 - 193672a - 52. What is v(39)? 26 Let m(k) = k*3 + 49k*2 - 431k - 309. What is m(8)? -109 Let q(a) = 4a3 - 150a*2 - 599a - 13. Give q(-4). -273 Let l(g) = 2g3 + 45g*2 - 139g - 631. What is l(-25)? -281 Let w(h) = 55h - 1160. What is w(46)? 1370 Let h(u) = u2 - 249393u + 1496332. What is h(6)? 10 Let q(s) = -17s3 - 52s*2 + 93s + 182. What is q(3)? -466 Let h(j) = 57j2 - 1322j - 8. What is h(25)? 2567 Let s(f) = -3326f2 - 914676f - 7151. What is s(-275)? -1 Let a(u) = 15u3 - 845u*2 + 758u - 26767. What is a(56)? 1 Let d(p) = -970p2 + 30067p + 187. Calculate d(31). 94 Let q(k) = -97189k - 97309. Give q(-1). -120 Let h(v) = 236v - 195. Calculate h(-1). -431 Let n(c) = 568c + 26433. Determine n(-46). 305 Let x(o) = -24397o + 146380. What is x(6)? -2 Let r(z) = 29z2 + 597z + 1192. Calculate r(-2). 114 Let x(g) = g*3 - 26g*2 - 72g + 155. Determine x(28). -293 Let c(b) = 2b2 + 1405b - 68808. Calculate c(46). 54 Let c(u) = -233u - 12143. Give c(-51). -260 Let z(f) = -4f*2 - 731f + 5501. Give z(-190). -9 Let f(w) = -1644w + 9499. What is f(5)? 1279 Let w(d) = 6d*3 - 135d*2 - 157d + 1586. Determine w(23). -438 Let a(g) = 643g - 26990. What is a(42)? 16 Let l(v) = 12v*3 + 3v*2 + 24v + 49. Calculate l(-2). -83 Let m(l) = 24l2 + 278l + 61. Determine m(-10). -319 Let t(b) = -18944b - 170518. Calculate t(-9). -22 Let z(d) = -d3 - 106d*2 - 1367d - 329. Determine z(-91). -147 Let j(u) = 14u3 + 248u*2 + 719u - 155. Calculate j(-14). -29 Let v(x) = -28x3 + 147x*2 + 1161x - 5984. Determine v(5). -4 Let f(w) = 588663w - 588678. Calculate f(1). -15 Let x(z) = -z3 - 194z*2 - 2z - 832. Calculate x(-194). -444 Let m(q) = -q*3 + 333q*2 + 10143q - 12638. Give m(361). -3 Let u(x) = 4111x + 970186. Determine u(-236). -10 Let r(f) = -7f*3 + 15f*2 - 1375f + 2741. Determine r(2). -5 Let f(r) = -2001r + 14500. What is f(7)? 493 Let c(b) = 16523b - 512205. Calculate c(31). 8 Let u(o) = -2o3 + 946o*2 - 393o + 635639. Calculate u(474). 5 Let g(b) = 42b2 + 329b + 1999. Give g(-6). 1537 Let o(q) = -12q2 - 303q + 2270. Determine o(6). 20 Let p(a) = -a*3 + 143a*2 + 1390a + 23. Calculate p(-9). -175 Let f(b) = -1547451b + 10832180. What is f(7)? 23 Let n(y) = y3 + 11y*2 + 33y - 65. What is n(-11)? -428 Let b(l) = -56462l + 790458. Give b(14). -10 Let v(u) = -u3 - 18u*2 + 51u + 44. Give v(-19). -564 Let n(k) = 5k3 + 2316k*2 + 458k - 2269. Determine n(-463). 46 Let r(b) = 985b2 + 2895b + 61. What is r(-3)? 241 Let p(v) = -3v3 - 63v*2 + 193v + 13. Wh	{ "pile_set_name": "DM Mathematics" }
xpress 0s + 8s + 2s3 - 2 - 6s + 4s2 in the form bs + ys2 + hs*3 + m and give m. -2 Rearrange (6s - 2s - 2s)(34s + 57s + 52s) + (2s + 0 + 0)(-s + 2s - 2s) to z + ns + os*2 and give o. 284 Rearrange 17 - 25 - 8q + 0q + 4q to z + dq and give d. -4 Rearrange (-1 - 2 + 2)(2i + 0 + 0) - 4i + 9i - 3i + (-1 - 4 + 4)(-2i + 2 - 2) to the form n + ui and give u. 2 Rearrange -2a*3 + 3a - a*2 - 4a - 6a2 to the form u + oa*3 + qa + ca2 and give c. -7 Express (4 - 4 - 3j*3)(1 + 3 + 0) as c + gj3 + yj + vj2 and give g. -12 Express -504 + 5k - 2k3 + 504 + 2k*4 as tk*2 + fk + qk4 + a + mk*3 and give m. -2 Rearrange 10r*2 - 2 - 8r2 + r3 + r*3 to hr*3 + sr*2 + qr + u and give h. 2 Rearrange -88i - 2 - 87i + 177i to the form o + ti and give t. 2 Rearrange 0 + 0 + v*2 + (-2 + 4 - 3)(v*2 - 4v*2 + 2v*2) + 0v + v + 14v2 - 10v*2 to ov + m + xv2 and give x. 6 Rearrange (-14 - r + 6 + 10)(-2 - 3 + 4) to d + cr and give d. -2 Rearrange 5d*3 + 2d*3 - 8d*3 - 7 + 5d - 3d to w + kd*3 + ad + ld2 and give l. 0 Rearrange s - 3s + 3s + 62 to us + h and give u. 1 Rearrange 8z - 8z - 5z4 + (-4z + 4z - z3)(0 + 0 - 3z) to wz*3 + sz*4 + tz + p + hz2 and give s. -2 Express (199v*2 + 177v*2 - 448v*2)(0 - 1 - 2)(3 - 1 - 1) as tv + q + uv2 and give u. 216 Express 7 - 2 - 18 - 45 - 2g as a + jg and give a. -58 Express 4o*2 - 6o2 + o2 + (-7o - 2 + 5o + 6o)(-o + 0o + 3o) - 4o2 - 5o2 - o2 in the form go2 + fo + u and give g. -3 Express -16 + 5b2 - 3b*4 + 0b3 + b3 + 4b4 + 17 as cb*2 + n + qb*4 + fb + wb3 and give q. 1 Express -10j + 14 + 12j - 3 as lj + t and give l. 2 Rearrange -159n + 96n + 2 + 2n4 + 0 to kn*2 + cn*3 + x + mn + sn4 and give x. 2 Rearrange -214o + 3o3 + 214o + 6o2 - 1 to d + ko*2 + io + so3 and give k. 6 Express 2q3 + q2 - q*2 + 19q - 19q + 5q*3 - 3q + 3q - 4q*3 + (2 - 2 - 1)(2q3 + 3q - 3q) in the form u + jq*3 + wq + rq2 and give u. 0 Express ((3t + 0t - 4t)(1 - 1 + 2) - t + t + t + (-3t + t + t)(-1 - 1 + 4))(3t + 2t + t) in the form rt + p + lt*2 and give l. -18 Rearrange -3 + 3m*2 + 5 + 3m*3 - 2m*3 + 2m*3 to rm*2 + w + hm + om3 and give r. 3 Rearrange -2s*2 + 0 + 2 + 8s4 + s4 to the form ps3 + v + us*4 + as + ys2 and give y. -2 Rearrange -7 - k2 - 13 - 16 - 2k - 5 to jk + q + ck2 and give j. -2 Express (-k3 + 0k3 - k3)(-2k - 6k - 2k) in the form lk*4 + ok*2 + sk*3 + ak + n and give s. 0 Rearrange (-2h3 - 2h*3 + 5h*3)((2h + h + 0h)(-1 + 3 - 4) + 4 - 2h - 4 + 2 - 3h - 2) to ih + sh3 + c + kh*2 + lh4 and give l. -11 Rearrange -2 + 13 - 7 + h4 + 1 + 4h3 + h to the form zh*4 + v + mh*3 + nh + bh2 and give z. 1 Rearrange (10n + 107n - 58n)(0 + 0 + 2) to the form cn + t and give t. 0 Rearrange 3y2 + 10 + 0y*3 - 10 - 2y*3 to the form gy*3 + wy + iy2 + j and give g. -2 Express (2u + u + 10u)(-1 - 2 + 1 - 3 + 5 - 1 + (2 - 2 + 2)(4 - 3 + 1)) in the form cu + d and give c. 39 Rearrange -5q3 + 4 - 4 + (4q - 2q2 - 4q)(-2 - q + 2) + 64q*2 + 2q*3 - 64q*2 to the form pq*2 + aq*3 + r + lq and give a. -1 Express -4 + 4 + 8a + 0a in the form y + ra and give r. 8 Express (-4g + 3g - g - 2)(2g - 2g + g*3 + (4 - 4 - 2g*2)(-3g + g + 4g) + g*3 - 5g*2 + 5g*2) as jg*2 + rg*3 + ig*4 + qg + h and give i. 4 Express (-3u + u + 0u)(-u - 6u + 6u)(1 - 1 + u*2) in the form hu*2 + nu + qu4 + l + xu*3 and give q. 2 Rearrange 1791r - 9r2 - 1791r to the form tr2 + ar + v and give t. -9 Express -7d + 20d + 6d in the form g + td and give t. 19 Rearrange 2a + 7a + 9a + (-a + 0a - a)(-1 + 1 + 1) + (2 - 5 + 1)(2a + 3a - 7a) to the form x + sa and give s. 20 Rearrange 3 - 2 - 1 - 22d to the form z + ad and give a. -22 Rearrange (3x - 3x - 2x)(-1 - 1 + 0) + x - 4x - 7x to gx + o and give g. -6 Rearrange -3r + r - 3r + 6r to the form f + ar and give a. 1 Express 2u2 - u2 + u*2 - 2u*4 - 2u*3 - 2 in the form su*3 + mu*4 + ju + t + ku2 and give k. 2 Express -2 + 2 - 4c2 + c2 - 3c2 + 0c*2 + (1 - 5 + 3)(3c2 - c2 - c2) - 11 - 23c*2 + 11 in the form z + vc + jc2 and give j. -30 Express (6 - 1 + 1)(t2 + 1 + t2 - t*2) in the form s + it*2 + dt and give i. 6 Rearrange -7r4 - 138r*3 + 138r*3 + 2 - 2r to the form kr + ar*3 + dr*2 + b + sr*4 and give k. -2 Express (-5h*2 - 30263h + 30263h)(-5 + 0 + 3) in the form xh + l + yh*2 and give x. 0 Rearrange 2u3 - 18 - u3 - 3 - 3 to y + su + ju*2 + au*3 and give a. 1 Rearrange -34v*3 + 15v - 15v + 0v + 0v - 3v*3 + (1 - 1 - v)(2v - 2v - 2v2) to n + rv*2 + gv + xv3 and give g. 0 Rearrange 187j - 32j3 - 187j + 2j2 to zj*2 + cj + t + kj3 and give z. 2 Rearrange (-3 - 1 + 2)(-c + 4c - 5c) + 5c - c - 1 - c to sc + d and give d. -1 Rearrange -5c + 4c - c + (1 + 1 - 1)(3c + 2 - 2) to pc + q and give p. 1 Express 3d - 3d - 2d + (-3 + 4 + 1)(-3 + 3 - 2d) + 0 + 0 + 2d + 4d - 2d - 5d in the form md + i and give m. -7 Express -5j + 3j + 13j + (6j - j - 4j)(-5 + 3 + 1 + 1 + 3 - 5 + (1 - 5 + 2)(3 - 4 - 1) + 0 - 2 + 0 - 2 + 5 - 2)(-2 - 1 - 1) as pj + h and give h. 0 Express -c*2 - 3c*3 - 4c*4 + 2c*3 + 4c*4 + 3c - c*4 as hc*2 + a + rc + lc4 + oc*3 and give l. -1 Rearrange (3 - 4t - 3)(-2t + 0t - t) - 2t*2 + 2t*2 + 3t2 + t2 + t*2 + 0t*2 to the form it*2 + ht + c and give c. 0 Rearrange -3m + 155 + 21m - 157 to am + y and give y. -2 Rearrange -2v2 - v3 - 18v + 0v*2 + 19v - 7 to the form u + ov2 + mv + nv3 and give o. -2 Express -5l3 - l3 + 4l3 + (-l - 2 + 2)(10l - 10l + 14l2) + 2 - 2 - 2l*3 as dl*2 + q + ul + bl3 and give b. -18 Rearrange -37o - 33o - 2o*3 + 60o to po + yo*3 + no*2 + s and give y. -2 Rearrange -2v*2 - 1 + 4 + 20v*2 - 2 to cv + uv2 + o and give o. 1 Express (-1 + 3 - 1)(-81 + 2o + 31 + o) in the form a + io and give i. 3 Express (0 - 4 + 2)(0m + m + 0m + m - 3m + 0m + (0 + 2 + 0)(0m + 2m + 0m) + (4 - 2 + 0)(2m - 6m + 3m)) in the form i + bm and give b. -2 Express -307 - 2r + 307 - 3r*2 as gr*2 + sr + c and give g. -3 Express -9p3 + p2 - 6p*2 + 8p*3 in the form hp + ip2 + f + jp*3 and give i. -5 Rearrange -4x - 4x + 2x + 0x to a + nx and give n. -6 Rearrange 6 - q*3 - 31q + 31q + 3q*3 to zq*2 + u + mq + wq3 and give w. 2 Rearrange -28v + 0v + 2v - v to the form fv + y and give f. -27 Express -s - 232s*3 + 195s*3 + 2s + s*2 as h + js*3 + gs + qs2 and give j. -37 Rearrange -158 + 0r + 75 + 107 - r to gr + z and give g. -1 Express (-4 - h - 12h*2 + 2h + 10h2)(-2h2 - h2 - 5h*2) as sh*4 + gh + jh3 + uh*2 + w and give g. 0 Express (w + 4w - w)((-2w - w - 4w)(-1 + w + 1) - w*2 - 4w*2 + 4w*2) in the form vw + hw3 + rw*2 + g and give h. -32 Express (2 + 6 - 3)(0k4 - 4k*4 - 2k*4) as gk + hk3 + j + sk*4 + wk*2 and give j. 0 Express (-5h + 3h + 3h)(2 - h - 2) + (-2 + 1 - 3)(2h2 - 2h2 - h2)(3 + 0 - 4) in the form uh + w + xh2 and give x. -5 Rearrange -46m + 106m + 78m to y + um and give u. 138 Rearrange -4l + 3l - 3l + 6l to cl + d and give c. 2 Express -62v3 - 1 + 2v*2 + 1 - 1 + 2v*4 + 64v*3 as bv + yv4 + tv*2 + nv*3 + m and give t. 2 Express (g + 3g + 0g)(-3g2 + 3g2 + g3)(-4 - 2 + 7) + 0g*4 - 2g*4 - 4g*4 in the form bg*3 + l + jg + tg4 + og*2 and give t. -2 Rearrange (x - x + 2x*2)(-11x + x + 5x) to kx3 + gx*2 + ix + j and give k. -10 Rearrange 102g - g2 - 79g - 3g2 to the form og + hg2 + w and give o. 23 Express 5 - 35z + 3z3 + 33z - 4 - z*3 in the form vz + bz2 + s + iz*3 and give v. -2 Rearrange (-2u - 15 + 11 + 5)(0u - 3u + 5u) + (2u + u - 5u)(-4u - 5 + 5) to su2 + qu + g and give q. 2 Rearrange 2n + 2n*3 - 14n*2 + 13n*2 + n - 2n	{ "pile_set_name": "DM Mathematics" }
153 What is 5 divided by 227475? 1/45495 What is -785213 divided by 143? -5491 4 divided by 1582 2/791 Divide -65793 by -5061. 13 Divide 0 by -441. 0 Divide -787 by -787. 1 What is -205635 divided by -41127? 5 -4 divided by 280662 -2/140331 1877900 divided by -75116 -25 -2 divided by -52029 2/52029 Divide 903856 by -8. -112982 -676944 divided by 4 -169236 -369 divided by 749 -369/749 What is 561990 divided by 1703? 330 Calculate 11097189 divided by -3. -3699063 Calculate -1 divided by -22552. 1/22552 Calculate -90588 divided by 12. -7549 Divide -22545 by -5. 4509 2052 divided by -2 -1026 Divide -26 by -8991. 26/8991 What is -163770 divided by 6? -27295 -9314 divided by 90 -4657/45 -2 divided by 266685 -2/266685 Divide -1489048 by -1. 1489048 Calculate 23632 divided by -1688. -14 202300 divided by -289 -700 What is -49478 divided by 49478? -1 What is 125877 divided by 125877? 1 2957 divided by 1 2957 -1417695 divided by -15 94513 What is -34710 divided by -3? 11570 Divide -144447 by -33. 48149/11 What is 323082 divided by 5983? 54 4746 divided by -67 -4746/67 What is -32 divided by 778? -16/389 Calculate 2 divided by -27595. -2/27595 Calculate 285 divided by -3617. -285/3617 What is 8563870 divided by 1712774? 5 What is 5 divided by -92417? -5/92417 What is -57645 divided by 5? -11529 Calculate -5 divided by 300970. -1/60194 What is 5 divided by -235660? -1/47132 -23470 divided by 4694 -5 102 divided by 5794 51/2897 -385539 divided by -3 128513 Calculate -974200 divided by -194840. 5 Divide -26335 by -5. 5267 Divide 129465 by 45. 2877 What is 135520 divided by 560? 242 -13175 divided by 31 -425 Calculate 141056 divided by 1216. 116 -296684 divided by 17452 -17 What is -149125 divided by -125? 1193 0 divided by -45928 0 What is -379 divided by 275? -379/275 Calculate -12107 divided by -3. 12107/3 Divide -7436 by 207. -7436/207 Calculate -412470 divided by -2. 206235 Divide 238260 by 30. 7942 What is -208005 divided by 245? -849 Calculate -313 divided by -292. 313/292 2702688 divided by 4 675672 10 divided by -440509 -10/440509 Calculate -423488 divided by 509. -832 Calculate -1245620 divided by -10210. 122 447269 divided by 5 447269/5 1194258 divided by -3263 -366 Divide 54036 by -36. -1501 2815026 divided by 2 1407513 Calculate 12 divided by 71717. 12/71717 Divide -227664 by -248. 918 Calculate -3 divided by -960. 1/320 What is -113994 divided by 18? -6333 Calculate -283123 divided by 4. -283123/4 Divide 1219932 by -7. -174276 Divide -1219023 by 45149. -27 Divide 621411 by 127. 4893 Divide -70 by -616. 5/44 Divide -63026 by -1. 63026 Calculate 8 divided by 622496. 1/77812 Divide 7991 by 16. 7991/16 Divide 12880 by 184. 70 What is 4 divided by -8370? -2/4185 204904 divided by 56 3659 Calculate 12774 divided by -7. -12774/7 -93138 divided by -3 31046 -6153 divided by -3 2051 -5599636 divided by 1 -5599636 Calculate 158959 divided by -4. -158959/4 What is 288044 divided by 1? 288044 Calculate 358224 divided by 22389. 16 -112 divided by -12468 28/3117 What is -13 divided by 756? -13/756 Calculate 282 divided by -138. -47/23 -1467 divided by 409 -1467/409 What is -1196944 divided by -112? 10687 What is 176601 divided by 7? 176601/7 Calculate -33425 divided by -191. 175 What is 0 divided by 20688? 0 -103968 divided by 171 -608 Divide -30609 by 2. -30609/2 12346410 divided by -6 -2057735 What is -80729 divided by -179? 451 58665 divided by -3911 -15 -9 divided by 191476 -9/191476 What is 3610 divided by 55? 722/11 828698 divided by 26 31873 Divide 56030 by 5. 11206 What is -4102 divided by -29? 4102/29 What is -497 divided by 129? -497/129 What is 107 divided by -319? -107/319 -1 divided by -468985 1/468985 What is -1498980 divided by 14276? -105 485888 divided by -2336 -208 -5 divided by -17533 5/17533 Calculate -1 divided by 5610. -1/5610 Calculate -5 divided by -16594. 5/16594 Divide -168 by 56. -3 1608968 divided by 4 402242 -269 divided by 220 -269/220 Divide -3 by 446091. -1/148697 Calculate 96099 divided by 3. 32033 Divide -265 by -614. 265/614 What is 67443 divided by 7? 67443/7 Divide -31508 by 4. -7877 -2089450 divided by -3799 550 -42708 divided by -3559 12 Calculate 572606 divided by 286303. 2 Divide -1 by 41479. -1/41479 Calculate 21982 divided by -758. -29 -833625 divided by 513 -1625 34789 divided by -6 -34789/6 5 divided by -21212 -5/21212 0 divided by -530990 0 Divide 455160 by -3. -151720 0 divided by 4852 0 Divide -50130 by -5013. 10 Divide -23 by -245824. 1/10688 1490830 divided by -10 -149083 Calculate 2341170 divided by -3915. -598 Divide 57400 by 410. 140 -2 divided by -488034 1/244017 What is -50292 divided by 11? -4572 Calculate 59545 divided by -6. -59545/6 Calculate 6862 divided by -5. -6862/5 Divide -60367 by 13. -60367/13 What is 30765 divided by -3? -10255 Divide -82 by 8272. -41/4136 1793 divided by 164 1793/164 Divide -49938 by -4. 24969/2 Divide -1229 by -142. 1229/142 290 divided by 1322 145/661 What is 69930 divided by -333? -210 47766 divided by 419 114 What is 86562 divided by 1? 86562 -10948 divided by -2737 4 -1 divided by 14549 -1/14549 What is -46 divided by 5909? -46/5909 Calculate 125604 divided by 41868. 3 What is -2046 divided by -93? 22 Calculate -10695 divided by 465. -23 46889 divided by -3 -46889/3 What is -54 divided by 57? -18/19 -654608 divided by 251 -2608 Divide -3560130 by 254295. -14 Divide -41064 by 8. -5133 Divide -34 by 3235. -34/3235 Calculate -2 divided by 77818. -1/38909 Calculate -1784500 divided by -500. 3569 Calculate -1568175 divided by -104545. 15 -5 divided by 820158 -5/820158 9 divided by 229167 1/25463 What is 231 divided by 42? 11/2 What is -2 divided by -71159? 2/71159 Divide -419794 by 9. -419794/9 -5685 divided by 95 -1137/19 -607100 divided by 5 -121420 120344 divided by -4 -30086 -75150 divided by 90 -835 254124 divided by 12 21177 Divide -5 by -7751. 5/7751 Calculate 5200 divided by -6. -2600/3 What is -185461 divided by 185461? -1 -44465 divided by -8893 5 What is -9393408 divided by -2416? 3888 Divide 1169 by 1. 1169 Divide 4099 by 5. 4099/5 Calculate 5149692 divided by -286094. -18 35078 divided by -6 -17539/3 Divide -69144 by -201. 344 Calculate -57507 divided by 3. -19169 -75606 divided by 6 -12601 Calculate 4 divided by -82516. -1/20629 23272 divided by 2 11636 Calculate -407142 divided by -135714. 3 83 divided by -1925 -83/1925 What is -1746 divided by -17? 1746/17 Calculate 1152 divided by 96. 12 Calculate -1049570 divided by -5095. 206 -3055270 divided by -10 305527 256110 divided by -25611 -10 What is -35849 divided by -5? 35849/5 -238068 divided by -59517 4 What is 13 divided by 37721? 13/37721 Calculate -2615 divided by -93. 2615/93 Calculate -203196 divided by -101598. 2 346 divided by 4234 173/2117 26087 divided by -19 -1373 -26 divided by -196 13/98 What is 2 divided by -17120? -1/8560 What is 134120 divided by -7? -19160 What is -39904 divided by -2? 19952 Calculate 800 divided by 192. 25/6 Calculate 0 divided by -22050. 0 Calculate 13437 divided by 3. 4479 Divide -80214 by -3. 26738 37392 divided by -123 -304 Calculate -289316 divided by -479. 604 What is -3763 divided by 107? -3763/107 Divide 25755 by 51. 505 What is 2054550 divided by -3? -684850 What is 19110 divided by 245? 78 Divide 6 by -33493. -6/33493 Calculate 122 divided by -17547. -122/17547 Divide 0 by 383365. 0 Calculate -2914 divided by -71. 2914/71 Divide -298915 by 955. -313 2240 divided by -2 -1120 Calculate 0 divided by -1826. 0 Divide 1324631 by 77. 17203 Calculate -185638 divided by 1. -185638 2670096 divided by 3 890032 Divide -24352 by 3044. -8 What is -26 divided by 1491? -26/1491 What is -27785 divided by -4? 27785/4 What is -37575 divided by -7515? 5 What is 2099520 divided by 2592? 810 1359255 divided by 1 1359255 Calculate -1 divided by -11546. 1/11546 Calculate -579468 divided by 12. -48289 What is -28986 divided by -6? 4831 Divide 467 by 86. 467/86 150348 divided by 67 2244 What is 190656 divided by 7944? 24 Divide 66533 by -15. -66533/15 What is 1 divided by 95188? 1/95188 Divide 1022288 by 2. 511144 What is 3312624 divided by 168? 19718 Divide -18 by -40. 9/20 What is 3036355 divided by -3? -3036355/3 Divide 8472 by 706. 12 Calculate -336222 divided by -9. 37358 Calculate -	{ "pile_set_name": "DM Mathematics" }
jh, -3h + 4s = -12. Suppose -42 + 710 = hw. Is w a prime number? True Suppose -971g + 932g + 8625201 = 0. Is g a prime number? True Let l(q) = 5q3 - 26q*2 + 14q - 186. Is l(37) composite? False Let o = 25145 - -31562. Is o a composite number? True Let s be (2/(-6))/((-14)/84). Suppose -5n = -4u - 2n - 9, n + 7 = -su. Let z(h) = -19h3 + 6h*2 - 3h - 3. Is z(u) a prime number? False Let w = 104738 + -73969. Is w a prime number? False Let d(s) = 794s + 5. Let h be d(-2). Let c = h - -834. Let v = -490 - c. Is v prime? False Let n(b) = -b3 + 4b*2 - 2b - 4. Let t be n(3). Let v = 385 - 316. Is (2 + v/(-3))/t prime? False Is 33457/(-4)(-223 - -219) a composite number? False Is 36/(-24)(4951888/24)/(-1) prime? True Let v be (-6)/18 + (-5)/3 + 2. Suppose 7c + 75 = 4o + 2c, v = -2o + 4c + 36. Let x(t) = t3 - 18t*2 - 19t - 23. Is x(o) a prime number? True Let k = 46 + -26. Let d be (-1)/(-2)k/2. Suppose -3j + dc = -12136, 4027 = j + 2c - 0c. Is j prime? False Suppose 4o - 5o = -42. Let a = 42 - o. Suppose 2l = -al + 674. Is l composite? False Let p(d) = -2d + 34. Let j be (1 + (-85)/10)-2. Let k be p(j). Suppose 0 = -t - 4l + 71, t + kl + l - 66 = 0. Is t a composite number? True Suppose -2r + 5n = -2002, -2r - 8n + 2050 = -5n. Suppose -3 = -3f - z, z = f + 4z + 7. Suppose 210 = fs - r. Is s a prime number? True Let a be (((-13)/8)/(-13))/(1/16). Suppose -3y + 4v = -v - 9, -y + 3v = -3. Suppose ap - 886 = -2h - h, -5h - 1367 = -yp. Is p a composite number? False Let c(k) be the first derivative of -k*3/3 + 6k*2 - 5k + 10. Let i be c(13). Is (368/48)/((-2)/i) a composite number? True Let t be (12/15)/(32/560). Suppose 16s - 20630 = ts. Is s a prime number? False Suppose -4s = h - 3405008, -53s - h = -54s + 851247. Is s a prime number? True Let u be 3/((-3)/1) + 2. Suppose -3z - 3x - 11 = -2z, 22 = -5z - 4x. Is (u/2)/((-3509)/(-1754) + z) a composite number? False Suppose -6f + 4f = 20. Let q be (-2)/f + (-16588)/65. Let n = q + 922. Is n prime? False Let b = -36 + 39. Suppose -bf - 2f = -15475. Suppose 5s = -5c + s + f, 0 = c - 3s - 638. Is c prime? False Suppose f - 4 = 4h, -f + 3 = 2f - 3h. Suppose 0 = -2b - 4 + 18. Suppose f = -2m + bm - 2675. Is m a composite number? True Suppose 2g + 17778 = -g + 2h, -5g - h = 29617. Let k = 8529 + g. Is k a prime number? False Suppose -20u - 7133243 = -22u - 21u. Is u a prime number? False Is (-110845156)/(-1865) - (-3)/5 a composite number? True Is (-375)/(-1625)1255931 composite? True Let i(a) = -12934a*3 + 3a*2 + 2a + 2. Let o be i(-2). Suppose o = 19h - h. Is h prime? True Suppose -3350c = -3326c - 2338584. Is c a prime number? True Suppose 6k + 186133 - 283446 = 495493. Is k composite? False Let w(n) = 481n3 - 4n*2 - 3n. Let o(v) = 1444v3 - 11v*2 - 9v. Let k(x) = 6o(x) - 17w(x). Is k(2) prime? False Let y = -121425 - -218572. Is y prime? False Suppose -4 = 3r - 13. Suppose 7a - 2a = 25. Suppose -rq = -4 - a, 5q = -f + 430. Is f prime? False Suppose 29k = 34k + 425. Let c = k + 392. Is c composite? False Let u = 64078 - 16005. Is u composite? False Let z(v) = -3871v*3 + 3v*2 + 43v + 139. Is z(-4) a prime number? True Suppose 3y = -q + 14864, 0 = 5q - 4y - 1245 - 72999. Suppose 0 = -15z + 1063 + q. Is z composite? False Suppose -8r + 62r - 45900 = 0. Is (-1715646)/(-50) - (-68)/r prime? True Suppose 0n - 28 = -4n. Let o(x) = -2x2 - 8x*2 + nx + 2x3 - 2x - 12 - 2x. Is o(11) composite? True Let l(p) = 19054p*2 + 101p + 4. Is l(3) a composite number? False Suppose -198 = -11p + 110p. Suppose -r + 3r = -16. Is p/(r/(-12)) + 214 a prime number? True Let k(w) = -85w - 147. Let r(x) = 85x + 147. Let y(i) = 4k(i) + 3r(i). Is y(-10) composite? True Suppose -4u - 3p - 14 = 0, 2u + 3 + 5 = -2p. Let q be (u/(-5))/(1/5). Suppose -c - 11 = -qc. Is c composite? False Let d(f) = 60f2 - 12f - 99. Let s be d(-6). Suppose -15564 = -3u + s. Is u prime? False Is -5 + (-13 - -19)135186 a composite number? True Suppose 7i + 18 = 3i - 2n, -11 = -2i + 3n. Let k(d) = 60d*2 + 8d + 3. Let o be k(i). Suppose 5l + 0a + a = 572, -a + o = 2l. Is l a prime number? False Let q = 532664 - 289495. Is q a composite number? True Suppose -19m + 17898 = -21m. Let a = m - -14206. Is a a prime number? False Let m be (-3)/2(-12)/9. Suppose 9x - 10 = 7x. Suppose p = mp - 1, x = a - 5p. Is a a composite number? True Suppose -2m = -4u + 92, 3m + 12 = u - 21. Let l be -2-46100/24-18. Is 3/7 - l/u a prime number? False Suppose -3l - 22 = -4l. Suppose 33 = 5g + 4h, 3g - l = -g - h. Suppose 5j - 3520 = 5b, -gj + 3502 = 5b - 4b. Is j composite? False Suppose 0 = -3w + 4u + 42325, w - 3u - 6167 - 7943 = 0. Is w a composite number? False Suppose -7m + 3167 = 2b - 10m, 2m - 14 = 0. Is b a composite number? True Suppose -2q + 576z - 580z = -281722, -2q + 4z + 281650 = 0. Is q a prime number? False Suppose -3y - 1624 = -280. Let k = 69 - 962. Let s = y - k. Is s a composite number? True Let z(g) = -533g - 19. Let o be z(-19). Let q = -2549 + o. Is q composite? False Suppose -34082 - 6320 = -2k. Let y = k - 5780. Suppose -3916 + y = 5c. Is c a composite number? True Let h(n) = -243n2 - 11n - 27. Let k(b) = -241b2 - 10b - 28. Let t(j) = -5h(j) + 4k(j). Is t(-9) composite? False Let x(a) = a*3 - 7a*2 + 9a - 13. Let v be x(8). Is (-344)/4v/(-6) a composite number? True Suppose -3x = -4s - 128, 2s - 5x + 79 = 15. Let z(f) = -103f - 210. Is z(s) prime? False Let r be (-8)/12 - (3270/(-18) - -2). Suppose r - 2940 = -11y. Is y a composite number? False Suppose -147q + 4b - 220675 - 39463 = -149q, 0 = -4b. Is q prime? True Let a(b) = 120 - 176b - 44b + 55 + 2. Is a(-13) a composite number? False Suppose 0 = -5q + 2o + 18611 + 35802, 4o - 10887 = -q. Is q a prime number? True Suppose -7b + 2b + 25 = 0. Suppose 0 = -4z + b - 13. Is 885 + 6 + z - 0 composite? True Let n(z) = -z3 + 9z + 3. Let r be n(-4). Suppose -5f - r - 14 = 2g, 2g = -2f - 54. Is 8/((-120)/(-70187)) + 4/g prime? True Let v = 2 + 42. Let f = -56 + v. Is (-234)/(-10) + (f/(-20) - 1) a composite number? False Let a = -3062 - -4938. Suppose a = 7d - 5d - q, -5q - 10 = 0. Is d a composite number? False Let y(a) = 130a - 32. Let n(c) be the first derivative of 43c2/2 - 11c + 12. Let v(m) = -7n(m) + 2y(m). Is v(-8) prime? False Is ((-4860506)/84)/((-6)/36) a prime number? False Let v = -111250 - -164164. Suppose -v = -32j + 30j. Is j composite? True Let m be 2/(3 + -4)(-26)/(-4). Let x(y) = -305y - 8. Is x(m) composite? True Suppose 4y + z = -y + 234530, 0 = -2y + 5z + 93839. Is y composite? True Suppose 2y = -4i + 39010, -i + 10y + 9750 = 11y. Let r = -2976 + i. Is r composite? False Suppose 1379 = -h + 12m - 7m, 3h + 3m = -4047. Let x = h - -2531. Is x composite? True Let k(c) = 248c + 57. Let r(v) = -384v + 219v - 5 + 4 - 37. Let b(g) = -5k(g) - 8r(g). Is b(9) a composite number? False Let v = -129 + 141. Suppose -vs + 122778 = 21198. Is s prime? False Suppose -3r = -2r - 5. Let o(z) = -7z + 45. Let p be o(6). Suppose rg - 5 = 0, -u - 538 = -2u + pg. Is u a prime number? True Let n be (-4)/(-15)-5-3. Suppose -2f + 17216 = 8g - 6g, 0 = -ng - 5f + 34431. Is g a prime number? True Suppose w - 4u - 2 = u, w = 4u + 2. Let n be (-6)/((w/(-328))/((-6)/(-8))). Suppose -7h + 3h + n = 2o, 4o - 1520 = 3h. Is o composite? True Suppose 5i - 13w - 316220 = -2w, 0 = w + 5. Is i a composite number? True Suppose 0 = 5y - 4u - 7633, -5u + 5225 = 5y - 2390. Suppose 4r = -3f + y, 0 + 4 = r. Is f composite? False Is 366573 - (28 - 9) prime? True Let b(m) = -m3 + 22m*2 + 4. Let x be b(22). Suppose -64192 = -2n + xk - 8662, -5n + 5k = -138830. Is n a prime number? True Let l = -57142 + 112269. Is l composite? False Let j = 3917 - 1509. Let t = j - 91. Is t prime? False Let n be (0 - (-3)/3)/((-5960251)/331126 + 18). Let v be -10(2391/2 + 1). Let x = n + v. Is x a composite number? True Suppose 6d = -0d + 12. Suppose -da = 5u - a - 104, 4u - 76 = a. Suppose 21m - u*m = 19. Is m composite? False L	{ "pile_set_name": "DM Mathematics" }
Express ((4i + 0i - 5i)(2 - 2 - 2) - 1 - i - 2 + 5)(-20i - 12i + 6i) as ui2 + g + fi and give f. -52 Rearrange 17k + 2 - 38k*4 + 27k + 44k4 + 8k - k*2 to bk + zk3 + xk*4 + r + dk*2 and give d. -1 Express -4321 - 4318 + 1493j + 8639 as aj + s and give a. 1493 Express -5d + 6 + 9 - d + 7d as s + md and give m. 1 Express -48 - 4r + 9r*2 + 2r + r*3 + 49 as x + cr + mr3 + wr*2 and give m. 1 Express (-3 - 3 + 5)(185 - 112i2 + 110i*2 - 128) as fi + k + vi2 and give v. 2 Rearrange 3 - 1150i - 28 + 25 to k + pi and give p. -1150 Express 0g*3 - 20g*3 + 3 + 6g*3 - 3g - 3g3 as qg*3 + d + pg*2 + lg and give l. -3 Rearrange 2b3 - b + b + (-b + b3 + b)(2 - 5 + 2) + (-3b2 + 4b*2 - 2b*2)(6b + 4b - 4b) to the form ub*2 + t + jb*3 + zb and give j. -5 Rearrange (0y + 0y + 2y)(-3707 + 153y + 3707) to the form ty + fy2 + a and give f. 306 Rearrange (-t + 2t - 6t)(-1 + 0 + 2) + 41 - 2t + 9t - 9t to s + ft and give f. -7 Express (3b2 - 2b*2 - 2b*2 - 2b)(-6 + 86b*2 - 52b*2 + 5) as mb*2 + hb*4 + xb + kb3 + r and give h. -34 Rearrange -646 + 244 - 5b + 147 + 43 to l + qb and give q. -5 Express (0 - 1 + 2)(0 + 0 - 3l) + 47 - 47 - 154l in the form vl + z and give v. -157 Express (1434u + 1116u - 1947u)(u3 + u3 - 3u*3) as cu*2 + tu*4 + pu + qu3 + n and give t. -603 Rearrange 48 + 70 - s2 - 36 to the form f + ps*2 + gs and give f. 82 Rearrange (0q + 2q - 6q)(1 - 1 - 2) + (-2 + 2 - 2)(3 + 7 - 17)(2q + 3q - 3q) to the form b + jq and give j. 36 Rearrange (-a + 0 + 0)(-3a + a + 0a) + 94280 - 94280 - 444a*2 to the form ya*2 + ka + p and give y. -442 Rearrange ((-13 - 16 - 59)(-2j + 2 - 2) + 3 - j - 3)(0j + 0j - 2j)(0 + 1 + 0) to lj*2 + bj + y and give b. 0 Express 1 - 34g2 + 1 + 5 - 518g*2 - 6 in the form m + jg + og2 and give m. 1 Rearrange (-2 + 0 + 0)(5 + 8 + 4)((3t - 4t + 2t)(4 - 6 + 4) + 4t + 2t - 4t) to the form gt + j and give g. -136 Rearrange -2c*3 + 84 + 2c - 63 + 36 + 2c2 to d + zc*2 + mc + oc3 and give m. 2 Express -z2 + 24z + 2 + 3 - 1 - 3z3 - 5 as rz + f + uz2 + iz*3 and give i. -3 Rearrange 0w*2 + 19w*2 + 8w*2 + (-2 + 2w + 2)(1 - 1 + 2w) + 3w2 + 3w*2 - 4w*2 + (2 - 2w - 2)(0 + 0 + 3w) to g + xw2 + ow and give x. 27 Express ((-3 - 2a + 3)(1 - 9 - 4) - 7a + 3a + 2a + a - a - a + (-3 + 2 + 2)(-1 + 1 - a) + 3a - a + a)(a - 7a + 4a) as o + ja2 + ca and give j. -46 Express k*4 + 2879k - 13k2 + 3 - 2879k in the form fk + sk*3 + nk*2 + tk*4 + j and give j. 3 Express 0y*3 - 73y - 3y3 + 4y*3 + 4y*3 - 6y*3 as dy*3 + uy + f + ay2 and give d. -1 Express -206p*2 - 13p*2 - 129p*2 - 182p*2 in the form kp + b + qp2 and give q. -530 Rearrange 11z + 1 + 1529z2 - 1526z*2 + 13z3 + z4 - 10z to the form bz*4 + kz*3 + jz + sz2 + d and give s. 3 Express -27u*2 + 125u*2 + 130u*2 as j + zu + wu2 and give z. 0 Rearrange (z2 - 3z*2 + 3z*2)(-3z + 3z - z) + (2 + z + 0 - 2z)(7z2 - 3z*2 - 9z*2) to the form w + rz*2 + jz + uz3 and give u. 4 Express (0u - u - u)(-394u + 951u - 367u - 2 + 2 + u + (3u - u - u)(-3 - 2 + 3) + u - 2u - 3u) in the form yu2 + au + b and give a. 0 Express -q*3 + 3 - 34q*2 - 6q + 70q2 - 2q*4 + 6q in the form r + dq + iq*3 + sq*2 + hq*4 and give r. 3 Express 8o - 66o + 3o*2 - 5o2 + o2 in the form wo + a + jo*2 and give w. -58 Rearrange -18v2 + v4 - v + 26v2 - 8v*2 - 4v*3 + 7v to cv3 + n + mv*2 + yv + uv4 and give y. 6 Rearrange -1306l*2 - 1338l*2 + 2602l*2 to nl*2 + d + fl and give n. -42 Express -61c3 + 5c + 0c - c + 111 - 113 as a + qc*2 + oc*3 + gc and give a. -2 Rearrange ((2 - 2 + 3v)(-1 - 2 + 0) + 77 + 14v - 77)(2v2 + 2v*2 - 3v*2) to the form rv*2 + cv*3 + tv + f and give c. 5 Express (2 + 3 - 4)(-6t*3 + 5t*3 - 3t3) + t3 + 8 - 8 + (-2t3 - 2t*2 + 2t*2)(-4 + 0 + 3) in the form qt2 + m + gt + yt3 and give m. 0 Express 12w*4 - 397w2 + w3 + w + 373w2 - 3w*3 as qw*2 + bw + uw4 + g + vw*3 and give u. 12 Express 5i*4 + 19 - 2i*4 - 4i*4 - 7 - 27i*2 + 28i*2 as si*2 + mi*3 + y + fi*4 + pi and give f. -1 Rearrange 3k2 - 3k2 - k2 + (-k*2 + 2 - 2)(2 + 3 - 4) + (-2795k - 2798k + 880k2 + 5593k)(1 + 0 - 2) to the form nk + h + fk2 and give f. -882 Express (-7n*3 + 3 + 1 - 1)(13n + n - 4n)(-4 + 1 + 6) in the form d + an*3 + mn*2 + hn + qn4 and give q. -210 Rearrange 3h3 + h2 - 2h - 20h*3 + 8h - h*3 to ah*2 + x + sh*3 + lh and give s. -18 Express 517v - 1705v + 497v in the form t + zv and give z. -691 Express -3 - 25z2 + 13z*2 - 2z*4 + 21z*3 - 19z*3 - 1 + 2 as oz*3 + vz + wz4 + x + gz*2 and give o. 2 Rearrange 30f - 15f - 15f - 4 - 10f - 13 to df + k and give k. -17 Rearrange 191j - 385j + 19j2 + 195j to hj + zj*2 + p and give h. 1 Express -8u + 360 - 123 - u*2 - 125 - 120 in the form x + ru + tu2 and give r. -8 Express (2 - 6 + 3)(0r + 6r + 3r)(-5 + 4 - 1)(-12 - 36 - 36) + (-2r + 4 - 4)(0 + 4 - 3) - 2r + r - r + 0r + r + 0r as i + gr and give g. -1515 Express 3278 + 1459t - 3278 as k + ut and give u. 1459 Express -391z*3 - 458z*3 + 223z*3 + 5 - 3 as cz*2 + jz + m + bz3 and give b. -626 Rearrange (20 + 32 + 3)(z - 6z + z + (-2z - 3z + 3z)(1 + 2 - 2)) to the form tz + i and give t. -330 Rearrange -879l3 + 1 - l + 442l*3 + 13l*2 + 436l*3 to the form m + rl*3 + gl*2 + zl and give m. 1 Rearrange 39t + 0t + 32t3 - 33t to xt2 + r + it*3 + ft and give f. 6 Rearrange 23f2 - 6f - 1 + 5f - 2f + 2f3 + 3f to the form n + jf3 + wf + af2 and give j. 2 Express 20m*2 - 25 - 167m + 28 + 166m as wm + s + nm2 and give s. 3 Express (-1 + 3 - 1)(2 + 3 - 3)(41m + 206m + 462m) as am + x and give x. 0 Rearrange (-5z*2 + 3z*3 + 5z*2 + (2 + 0 - 1)(z - z + 2z3))(18 + 14 - 2) to the form cz + bz*2 + rz*3 + i and give c. 0 Rearrange -65f*4 + 117f - 117f + (2f*2 - f + f)(-2f2 + f2 - f2) to qf*3 + yf*4 + sf*2 + t + kf and give y. -69 Express (-44 - 20 + 28 - 21 - 70)(-14r - 7r + 18r) in the form b + yr and give y. 381 Rearrange -y2 - 30 - 111y - 39 + 2y3 + 69 to the form dy*3 + c + ky + by2 and give d. 2 Rearrange (-1 + 4 - 4)(-h + 5h - 2450h*2 + 37 + 2452h*2) to nh + lh2 + o and give o. -37 Express -8a - 4a - 53a*2 + a + 14a + 0a in the form ra + y + pa2 and give r. 3 Express -10f*2 + 11f + 30f2 - 9f in the form b + kf2 + nf and give n. 2 Rearrange -3m + 0m - 43 + 86 to hm + p and give p. 43 Express 2n - 2n + 53n*2 + 313n*2 in the form cn*2 + jn + p and give c. 366 Rearrange -o*3 + 15606o*2 + 3o3 + o4 - 15605o2 + 6o - 2 to lo + do*2 + j + ao*3 + xo*4 and give j. -2 Express q + 11q*2 - 5q - 659 + 661 as k + jq2 + lq and give l. -4 Express -5x + 3x + 3 - 10 - 12 - 2x2 as tx*2 + a + ix and give t. -2 Rearrange (-47 + 74 + 85)(2 - 1 - 2)(5g - g - 3g) to the form x + ig and give i. -112 Rearrange (-2 + 3 + 1)(-16 + 3 - 23)(2 - 4 - 2h + h + (4 - 2h - 4)(1 - 3 + 1)) to ph + z and give p. -72 Express (-713 + 257 + 233)(-3x2 - 3x*4 + 3x*2) in the form w + dx + ox2 + nx*4 + ax*3 and give n. 669 Rearrange (-76564 + 597m + 76564)(m - 2m + 2m)(-1 + 2 - 3) to the form cm + im*2 + o and give i. -1194 Express 120p - 2p3 + p3 - 43p*2 - 119p in the form jp + lp*2 + f + ap*3 and give l. -43 Express (0 + 4 + 2)(c - 3c + 0c)(-17c*3 - 2c*3 - 4c*3) as p + zc*4 + uc + rc3 + mc*2 and give z. 276 Rearrange (8 - 4l - 8)(7 + 4l - 7) + (0 + 0 - l)(-5 - 2l + 5) - 7l + 7l + 5l2 + 146 - 37l*2 - 146 to the form k + wl*2 + al and give k. 0 Rearrange (2f2 - 3f2 - f2)(-3f*2 + 2f*2 - 18 + 22) + 4f4 - f4 - f*4 to the form mf + v + xf2 + bf*4 + rf*3 and give r. 0 Express 770 - 1537 - 18b*2 + 766 + 25b in the form v*b	{ "pile_set_name": "DM Mathematics" }
base 8, what is 0 + -30? -30 In base 16, what is -8 - -1d? 15 In base 16, what is -4 + -33? -37 In base 10, what is -18 - 7? -25 In base 10, what is 2 - 386? -384 In base 4, what is 1 - 203? -202 In base 11, what is -52 + -2? -54 In base 2, what is -10 - 110100011001? -110100011011 In base 8, what is 225 + -15? 210 In base 4, what is 3031 + 13? 3110 In base 9, what is 78 + -5? 73 In base 12, what is -1 - -196? 195 In base 10, what is -2 + -80? -82 In base 4, what is -112 - 131? -303 In base 10, what is 5 + 627? 632 In base 9, what is 63 - 24? 38 In base 16, what is -1d + 5? -18 In base 11, what is -a - 304? -313 In base 11, what is -1a5 - -1? -1a4 In base 9, what is 353 - 5? 347 In base 5, what is -412 - -3? -404 In base 6, what is -2142 - -4? -2134 In base 6, what is 4 + -1252? -1244 In base 7, what is 116 - 43? 43 In base 10, what is 0 - 543? -543 In base 3, what is -21 + -1020100? -1020121 In base 8, what is -1667 + 1? -1666 In base 10, what is -42 - 42? -84 In base 7, what is 1366 + 5? 1404 In base 15, what is 1 + -1? 0 In base 5, what is -2100 + 3? -2042 In base 16, what is b - -6? 11 In base 13, what is 5 - 198? -193 In base 14, what is -37 - 156? -18d In base 11, what is -90 - -4? -87 In base 5, what is 2 - 20203? -20201 In base 5, what is 1 - 131? -130 In base 8, what is 6 + -5627? -5621 In base 9, what is 2 - 102? -100 In base 2, what is 110 + 1000111? 1001101 In base 14, what is 40 - -8? 48 In base 8, what is -10 + -262? -272 In base 4, what is 2 + 303103? 303111 In base 15, what is -7 + -12d? -135 In base 15, what is 0 + 18d? 18d In base 4, what is 113103 + 10? 113113 In base 9, what is 121 + -2? 118 In base 13, what is -3 + -3? -6 In base 10, what is -401 - -4? -397 In base 9, what is 78 - 8? 70 In base 2, what is 10 + 1000010? 1000100 In base 3, what is 1 + -10? -2 In base 15, what is -145 + -1? -146 In base 4, what is -132 + 32? -100 In base 3, what is -10 - 2200? -2210 In base 13, what is -1 - -1025? 1024 In base 14, what is 8 - 7? 1 In base 10, what is 99 + 4? 103 In base 2, what is -100 - -110111101000? 110111100100 In base 5, what is 2440 + -3? 2432 In base 13, what is 8a0 + 4? 8a4 In base 3, what is 10 + 1210? 1220 In base 4, what is 21222 - -10? 21232 In base 6, what is 33535 - 4? 33531 In base 3, what is -120 - 0? -120 In base 11, what is 9 - 359? -350 In base 10, what is 3 + -7? -4 In base 8, what is -3072 - -1? -3071 In base 9, what is 1 - 1165? -1164 In base 12, what is 0 + 5? 5 In base 15, what is -1 + 2c8? 2c7 In base 2, what is 10 - -1001111? 1010001 In base 10, what is -25 + -136? -161 In base 8, what is 132 - -1? 133 In base 2, what is 1 + 1101100010? 1101100011 In base 15, what is -6b - 1? -6c In base 8, what is -4 - -427? 423 In base 9, what is -2686 - 3? -2700 In base 5, what is -341 - -4? -332 In base 9, what is -444 - 5? -450 In base 3, what is -1 - 1021010? -1021011 In base 15, what is bc + 1? bd In base 12, what is -3 + 56? 53 In base 6, what is 35151 - 3? 35144 In base 16, what is d4f - 2? d4d In base 16, what is 331 - 27? 30a In base 7, what is -215 + -2? -220 In base 6, what is 22 - 4? 14 In base 11, what is 5 + 45? 4a In base 13, what is 15 - 8c? -77 In base 2, what is 100100 + -10111011? -10010111 In base 9, what is -58 - 65? -134 In base 3, what is -2 + -20002? -20011 In base 5, what is -4 - 2022? -2031 In base 10, what is 9 - 422? -413 In base 8, what is 3 + 110? 113 In base 9, what is 1 - -282? 283 In base 7, what is 2661 - 0? 2661 In base 14, what is -a - -53? 47 In base 13, what is -2c + -1c? -4b In base 11, what is 4 - -112a? 1133 In base 12, what is 5 + 1350? 1355 In base 13, what is 0 + -88? -88 In base 6, what is -34 - 3? -41 In base 10, what is -10 + 55? 45 In base 9, what is 27 - -102? 130 In base 14, what is 4 - 5? -1 In base 13, what is 16 + 2? 18 In base 14, what is -5da - -b? -5cd In base 3, what is 1200 + -20101? -11201 In base 14, what is 361 - 5? 35a In base 11, what is -24 - 4? -28 In base 11, what is -3 - 251? -254 In base 11, what is 6 - 8? -2 In base 2, what is 1100111 + 10? 1101001 In base 3, what is 102100 + 200? 110000 In base 4, what is -3110232 - 11? -3110303 In base 6, what is 3 - -102? 105 In base 4, what is -10 - 212? -222 In base 4, what is -1020310 + 3? -1020301 In base 16, what is 341 + -3? 33e In base 2, what is 10 - 10100001111? -10100001101 In base 3, what is 10222 + 1? 11000 In base 4, what is -3120 - 1? -3121 In base 10, what is 5 - -9? 14 In base 4, what is 10 + 201200? 201210 In base 13, what is 3 - 26? -23 In base 9, what is -5 + -58? -64 In base 11, what is 320 - -3? 323 In base 2, what is -111110100 - 1101? -1000000001 In base 13, what is 5 + 533? 538 In base 9, what is -515 + 2? -513 In base 7, what is -1046 - 3? -1052 In base 6, what is -104 + 5? -55 In base 5, what is -30 + -103? -133 In base 4, what is 20131 + 10? 20201 In base 6, what is -2 + 41225? 41223 In base 14, what is -10d + 3? -10a In base 16, what is 3 + 1c? 1f In base 2, what is -101 - 1111010100100? -1111010101001 In base 14, what is b + 9d? aa In base 6, what is 1543 - 0? 1543 In base 9, what is -65 + -15? -81 In base 5, what is -42 + -32? -124 In base 8, what is -2 - -57? 55 In base 9, what is 508 - 1? 507 In base 14, what is -19 - 18d? -1a8 In base 6, what is 34 - 124? -50 In base 2, what is 1110010 - -110101? 10100111 In base 9, what is 78 + -4? 74 In base 14, what is 264 - 5? 25d In base 10, what is -4 - 206? -210 In base 4, what is -11 - 1132? -1203 In base 13, what is -1a7 + -3? -1aa In base 5, what is 4 + -41011? -41002 In base 8, what is 1370 + 5? 1375 In base 7, what is 2 + 53? 55 In base 10, what is -462 + -3? -465 In base 16, what is -a + -2ff? -309 In base 10, what is -6 - -124? 118 In base 14, what is -21 + 6? -19 In base 15, what is 172 + -4? 16d In base 10, what is 169 + -8? 161 In base 9, what is 363 - -16? 380 In base 16, what is 2 - -83? 85 In base 14, what is -5 + 254? 24d In base 11, what is -9 + -1? -a In base 9, what is -1010 + -11? -1021 In base 11, what is 6524 + 3? 6527 In base 12, what is -4 - 13? -17 In base 3, what is -1102022 + -12? -1102111 In base 4, what is 220131 + -3? 220122 In base 12, what is -329 + 10? -319 In base 9, what is 5 + 65? 71 In base 15, what is 1 + c3? c4 In base 5, what is 12 + 20? 32 In base 9, what is 6 + 58? 65 In base 8, what is -14 - -10? -4 In base 14, what is -19 + -1b? -36 In base 4, what is -11 + -22232? -22303 In base 15, what is 3d57 + 2? 3d59 In base 7, what is 51 - 225? -144 In base 9, what is 0 - -31? 31 In base 13, what is -18 + 18? 0 In base 4, what is -10111 + 11? -10100 In base 14, what is 4 + -118? -114 In base 12, what is 9 + -1b7? -1aa In base 3, what is 2 - -10111? 10120 In base 3, what is -12201222 - 1? -12202000 In base 13, what is 2 + -92? -90 In base 14, what is -17 + -5c? -75 In base 4, what is -22 - 1011? -1033 In base 12, what is -12 - 14? -26 In base 7, what is 5 + -415? -410 In base 8, what is -1 - -11? 10 In base 16, what is 1 - 123? -122 In base 6, what is 10 + 125? 135 In base 12, what is -7a94 + 2? -7a92 In base 14, what is 5 + 1a? 21 In base 3, what is -2000 - 10? -2010 In base 6, what is 4 - -1030? 1034 In base 8, what is -22 - 35? -57 In base 8, what is -24 - -4? -20 In base 16, what is -121 - -2? -11f In base 6, what is 4 + 54? 102 In base 16, what is -89 - -2? -87 In base 9, what is -5 - 2016? -2022 In base 10, what is -189 + -4? -193 In base 14, what is 13 + 0? 13 In base 6, what is -2 - -145? 143 In base 13, what is -9 + -12? -1b In base 2, what is -1 + -11001110? -11001111 In base 15, what is c2a - 5? c25 In base 12, what is 966 + -2? 964 In base 13, what is 3b66 + 0? 3b66 In base 6, what is -405 + -12? -421 In base 10, what is 25 - -71? 96 In base 8, what is -4 - 1551? -1555 In base 12, what is -8b + 0? -8b In base 15, what is 21 + -1? 20 In base 2, what is 110100 - -10010001? 11000101 In base 2, what is -11010 - 101001? -1000011 In base 8, what is 0 - -12? 12 In base 14, what is 3 - 4b? -48 In base 5, what is 412 - -10? 422 In base 6, what is -1 - -113? 112 In base 7, what is 134446 - -1? 134450 In base 6, what is -3214 - 5? -3223 In base 6, what is 53 + 44? 141 In base 16, what is -2 - -1f? 1d In base 10, what is -594 + -21? -615 In base 11, what is 4 - -238? 241 In base 10, what is 578 - 13? 5	{ "pile_set_name": "DM Mathematics" }
+ 349hq - 15h + 3. What is f(y(u))? -5u2 - 15u Let p(m) = 10m2. Let j(g) = -2411837g. Give j(p(b)). -24118370b2 Let w(v) be the second derivative of 1/6v*3 + 0 - 20v + 0v2. Let g(y) = -y - 5y + y. Calculate w(g(q)). -5q Let d(t) = -1807t2. Let h(y) be the second derivative of -y3/2 - 313y + 2. Give d(h(o)). -16263o*2 Let r(d) = 19d - 7. Let c(z) = 225170z. Determine r(c(m)). 4278230m - 7 Let z(c) = -19c2 - 61c + 21. Let j(h) = 135h. Calculate z(j(n)). -346275n*2 - 8235n + 21 Let y(b) be the second derivative of -b*4/6 + 17b. Let q(n) be the first derivative of -5 + 13/2n2 + 0n. What is q(y(d))? -26d2 Let t(g) be the first derivative of 13g*4/24 - 7g*2/2 + 66. Let r(w) be the second derivative of t(w). Let f(q) = 4q*2. Give f(r(k)). 676k2 Let c(q) be the second derivative of -q5/30 + 82q2 + 8q + 7. Let i(m) be the first derivative of c(m). Let z(a) = -2a + 2. Give i(z(o)). -8o*2 + 16o - 8 Let j(i) = 5i2. Let o(x) be the first derivative of x5/40 + x4/8 + x3 - 8x*2 + 28. Let m(k) be the third derivative of o(k). Give j(m(u)). 45u*2 + 90u + 45 Let l(s) = -28s2. Let i be (17/4)/1 + (-3)/12. Let b(t) = 2t - 2t + it*2. What is l(b(x))? -448x*4 Let a(d) = -d - 8. Let p(g) = -7g*2 + 5g + 5. Let l(y) = -22y2 + 222 - 206 + 15y + y. Let x(q) = 5l(q) - 16p(q). Determine a(x(b)). -2b2 - 8 Let b(r) = r2. Let g be 24/(-16) + 2/4. Let i(d) = -2d. Let f(v) = 7v. Let s(h) = gf(h) - 4i(h). What is s(b(c))? c2 Let n(m) = m2 + 9m - 12. Let x be n(-8). Let r be 5/2-82/x. Let w(d) = -rd + 5d - 2d. Let c(i) = -13i - 1. Calculate c(w(p)). -13p - 1 Let c(x) = -8x - 19509. Let p(i) = 15i. Calculate p(c(d)). -120d - 292635 Let n(z) = -34727z. Let t(l) = -5l*2 + 256. What is n(t(c))? 173635c*2 - 8890112 Suppose -q - 2q + 2z = -256, -z = 3q - 259. Let s(j) = -81j2 + 164j*2 - qj*2. Let o(h) = -2h*2 + 2h. What is o(s(g))? -18g4 - 6g*2 Let p(k) = -13k*2 - 625k + 15. Let d(i) = 6i2 + 250i - 6. Let l(a) = 5d(a) + 2p(a). Let u(j) = 5j - 8j - 6j. What is u(l(w))? -36w*2 Let p(w) = -79w + 234w - 82w - 63w. Let g(k) = 2k*2 - 7k. What is p(g(j))? 20j2 - 70j Let k(l) = -2l2 - 178. Let h(n) = -4n*2 - 6n + 2. Let u(o) = -5o2 - 9o + 3. Let w(t) = 3h(t) - 2u(t). What is w(k(b))? -8b4 - 1424b*2 - 63368 Let z(u) = 57u*2 - 22u*2 + 12u*2 + 7u*2 + 67u*2. Let n(p) = -29p. Give z(n(x)). 101761x2 Let a(n) = 7n. Let w(x) be the first derivative of x*3 + 3x - 4x - 28159 + 28276 + x. Determine a(w(j)). 21j*2 Let v(k) be the third derivative of -39k*4/8 + 1034k*2. Let c(j) = -4j. What is c(v(m))? 468m Let s(i) = -293338i. Let r(g) = -g*2. Give s(r(v)). 293338v*2 Suppose -2u + q = 5q - 44, -4q + 80 = 5u. Suppose 4 - u = -z. Let o(c) = zc - 4c - 4c - 5c. Let l(h) = -5h*2. Determine l(o(g)). -125g*2 Let s(l) = -67 + 28 - 7l + 38. Let k(x) = -3x + 1. Let y(v) = -2k(v) + s(v). Let p(j) = 5j. Give p(y(c)). -5c - 15 Let i(p) be the first derivative of -p*5/60 - 5p*3/3 - 3. Let j(t) be the third derivative of i(t). Let y(g) = 0 + 560g + 0 - 557g. Calculate y(j(s)). -6s Let a(k) = -15k - 53. Let p(m) = -53638m. What is p(a(x))? 804570x + 2842814 Let n(v) = -81v - 3v - 31v - 101v - 16v. Let j(i) = i. Determine j(n(k)). -232k Let x(j) be the third derivative of 37j*5/60 + 1162j*2. Let o(p) = -2p - 4. Calculate x(o(v)). 148v2 + 592v + 592 Let z(a) = 5a2. Let b(m) = -121m + 51. Let i(j) = 3j - 24. Let f(r) = -b(r) - 2i(r). Calculate z(f(y)). 66125y2 - 3450y + 45 Let m(s) = 2 - 4s2 - 24 + 2s*2. Let x(f) = -1596769f + 1596769f + 3f*2. Determine x(m(g)). 12g*4 + 264g*2 + 1452 Let g(k) = -5k. Let x(f) be the third derivative of 13f4/24 + f3 - 89f*2 + f. Let v(w) = 3. Let m(h) = 2v(h) - x(h). What is m(g(n))? 65n Suppose 4i + 32 = -0i. Let m(a) = 14a - 16. Let h(w) = 41w - 1016 + 509 - 46w + 513. Let v(f) = ih(f) - 3m(f). Let d(n) = 7n. Give v(d(q)). -14q Let x(g) = 68g2 - 71g2 - 11 + 11 + 18. Let i(l) be the first derivative of l3 - 5. Calculate i(x(o)). 27o4 - 324o*2 + 972 Let b(y) = -9y. Let u be (-4)/(-22) + -48(-4)/33. Let a(c) = u + 10c - 15 + 9. Determine b(a(w)). -90w Let z(q) = 12589848q. Let g(k) = -8k2. Determine g(z(d)). -1268034181304832d*2 Let b(a) = 408a*2. Let w(h) = 274h. Let l(k) = 83k. Let x(y) = 20l(y) - 6w(y). What is x(b(z))? 6528z2 Let i(z) be the third derivative of -z5/30 - 832z3/3 + z2 + 762z. Let q(f) = 2f2. Calculate i(q(d)). -8d*4 - 1664 Let a(d) = 4d. Let k(h) = 7064245h. Give a(k(l)). 28256980l Let z(n) = 3n3 - 4n*2 - n + 2. Let k be z(3). Let c(x) be the first derivative of 0x2 - 39 - x2 + k + 27. Let w(m) = 43m. Give w(c(f)). -86f Let p(u) be the second derivative of 23u5/30 + 14u*2 - 64u. Let s(d) be the first derivative of p(d). Let j(c) = 2c2. Calculate s(j(a)). 184a*4 Let y(p) = 5p - 30. Let s(c) = -3c + 20. Let m(n) = -3s(n) - 2y(n). Let b(q) = 2q*2 - 195q. Determine b(m(a)). 2a2 + 195a Let b(n) be the first derivative of 2n3/3 - 20307. Let g(m) = 5m2 + m. Let y(j) = j2. Let s(p) = g(p) - 4y(p). What is b(s(t))? 2t*4 + 4t*3 + 2t*2 Let s(r) = 14r - 28. Let t(o) = -7o + 12. Let m(g) = -3s(g) - 7t(g). Let b(l) = 70l + 17. Let z be b(6). Let k(x) = -2x - 437 + z. Determine m(k(q)). -14q Let m(s) = 90s - 31s - 33s - 25s. Let j(i) = -1769i. Calculate m(j(n)). -1769n Let o(n) be the first derivative of -n*5/60 - 53n3/3 + 127. Let r(f) be the third derivative of o(f). Let a(c) = -c2 + 2. Calculate a(r(p)). -4p2 + 2 Let u(f) be the first derivative of 29f*3/3 - 2065. Let c(q) = 73q*2. Give c(u(o)). 61393o*4 Let y(h) = -3h - 90989. Let p(k) = 12k2. What is y(p(q))? -36q*2 - 90989 Let i(y) = 3y*2. Let a be -2(-5)/(20/18). Suppose 3x = 3v + 5x - 63, -5x - 63 = -3v. Let b(g) = 38 + ag - v - 17. What is i(b(f))? 243f2 Let a(i) = 31i*2 + 5i + 5. Let b(h) = -75h2 - 12h - 12. Let y(z) = -12a(z) - 5b(z). Let j(u) = -u - 55. Determine y(j(w)). 3w2 + 330w + 9075 Let x(l) = -11086l. Let j(f) = 12074f*2. What is x(j(u))? -133852364u*2 Let h = -7817 - -7827. Let s(f) be the first derivative of -8/3f*3 + 0f - h + 0f2. Let d(c) = -3c. Give d(s(m)). 24m2 Suppose 1197 = 6z - 2037. Let n = -285 + z. Let y(o) = -30o2 + n - 254. Let i(u) = 2u. Calculate i(y(p)). -60p2 Let w(o) = -2o. Let u(y) = -y - 432979. Give u(w(c)). 2c - 432979 Let t(j) = 38j*2. Let v be ((-79)/6 - -14)(-4)/(-100). Let p(b) be the third derivative of 0b3 + 0b + 0b4 - vb*5 + 0 - 6b*2. Determine p(t(f)). -2888f*4 Let h(f) be the second derivative of -1075f*3/2 + 8664f. Let a(i) = -2i. Calculate h(a(g)). 6450g Let u(s) = -2s2 - 31172s. Let o(m) = 767m. Determine o(u(h)). -1534h*2 - 23908924h Let n(u) = 0 + 7u + 0. Let o be 1569/(-2)(-14)/21. Let m(g) = og - 2 - 524g + 2. Give m(n(f)). -7f Let j(k) be the second derivative of 49k4/12 - k3/3 + 2k + 75. Let q(c) = 6c. Determine j(q(x)). 1764x2 - 12x Let c(s) = -2s2 + 34s + 20. Let r(d) = -788d2 - 797d*2 - 797d*2 + 2381d*2. Calculate c(r(j)). -2j*4 - 34j*2 + 20 Let f(u) = -6u. Let t(b) be the first derivative of -5b2 + 25b - 4403. What is f(t(p))? 60p - 150 Let j(y) = 3y*2 + 2y - 12. Let a(h) = -13h2 - 9h + 52. Let d(r) = -2a(r) - 9j(r). Let f(u) = 29u2. What is d(f(g))? -841g*4 + 4 Let t(q) = -13q*2 - 12. Let u(o) = -4o + 8. Let z(x) = x - 1. Let l(w) = -u(w) - 8z(w). Determine t(l(i)). -208i*2 - 12 Let a(x) = -1986693x. Let y(i) = 6i2 + 9i. Give a(y(v)). -11920158v2 - 17880237v Let z(x) = 301x - 596x + 301x. Let w(c) = 11c + 11. Calculate z(w(b)). 66b + 66 Let s(n) = 22n + 10. Let a(h) = -41h + 34h + 17 + 12h + 36h + 4h. Let r(d) = 3a(d) - 5s(d). Let z(p) = p2. Give z(r(b)). 625b*2 + 50b + 1 Let o(d) = -5d + 18. Let t(x) = -96x*2 + 294x - 42. Let y(j) = 2j2 - 7j + 1. Let w(h) = -2t(h) - 84y(h). What is o(w(g))? -120g2 + 18 Let v(u) = 14u*2. Let h(d) = 35d - 5. Let q(l) = 36*l - 6. Le	{ "pile_set_name": "DM Mathematics" }
y) = -6y4 - 175y*3 - 2y*2 + 358. Let r(n) = -5n*4 - 177n*3 - 2n*2 + 358. Let a(b) = 4k(b) - 5r(b). Find the third derivative of a(l) wrt l. 24l + 1110 Differentiate -17o2 - 14o - 62o2 + 79o*2 - 328 - 36o*3 with respect to o. -108o*2 - 14 Let a(v) = 2v - 31. Let d be a(15). Let i(l) = l + 4. Let y be i(d). Differentiate -76ny - 5 + 1 + 98n*3 with respect to n. 66n*2 Let z(n) = 2n*3 - 6n*2 + 3n + 6. Let y be z(4). Suppose c + y = 64. Find the second derivative of -ci2 + 3i - 13i - 7i - 3i wrt i. -28 Let q(o) be the first derivative of -2731o*6/3 - 252o*3 + 3108. Find the third derivative of q(v) wrt v. -327720v*2 Let o = 51 + -33. Let d be ((-204)/o)/((-4)/18). What is the second derivative of 3w*4 - 51w*2 + dw*2 + 12w wrt w? 36w2 Suppose 2o = 2u + 8, 6u = -3o + 4u + 12. Let n be (-30)/o2/(-3). What is the third derivative of 0r*4 + 0r*4 + 2r*4 - nr*2 wrt r? 48r Let k(h) = 1509h2 - h + 122. Let n(o) = -1510o*2 + o - 124. Let g(j) = 6k(j) + 5n(j). Find the second derivative of g(w) wrt w. 3008 Let b(o) be the third derivative of -191/120o*6 + 0o*5 + 0 - 191o*2 + 0o*4 + 0o - 55/2o3. What is the derivative of b(r) wrt r? -573r*2 Find the second derivative of 845c + 6c3 - 35c*3 + 2c*2 - 8c*2 - 16c*3 + 4c*3 wrt c. -246c - 12 Let m = 54 + -77. Let r = 25 + m. What is the third derivative of -4j + 4j + 13jr - 100j*5 + 90j*5 wrt j? -600j*2 Let a(o) be the second derivative of -3o*6/10 - 33o*5/20 - 119o*4/3 + 1867o. Find the third derivative of a(g) wrt g. -216g - 198 Suppose -5r + 5q + 226 = 46, 173 = 5r + 2q. What is the third derivative of -d + rd*2 + 2260d*6 - 2311d*6 + 0d wrt d? -6120d3 Let s(q) = 2q*3 - 16q*2 + 11q + 24. Let h be s(7). What is the second derivative of 9x3 - 112x*2 - 2x*h + 102x*2 - 9x - 9x wrt x? 42x - 20 Let z(o) = -253o2 + 8o + 11478. Let y(i) = -127i2 + 4i + 5735. Let p(t) = 26y(t) - 12z(t). Find the first derivative of p(q) wrt q. -532q + 8 Differentiate 12y*2 - 21y*2 - 9y*2 - 87y*3 + 5370 - 24y*2 wrt y. -261y*2 - 84y Let u = 18024 + -9545. Find the second derivative of -124r + ur*2 - 8479r*2 + 38r*5 wrt r. 760r*3 Let a(g) be the first derivative of -7652g*5/5 + 29g*3/3 + 3g*2/2 - 7g - 5471. What is the third derivative of a(l) wrt l? -183648l Let l(r) be the first derivative of 173r*7/7 - 229r*3/3 + 2r - 579. What is the third derivative of l(o) wrt o? 20760o3 Let x be 42/105(-175)/(-60). Let b(y) be the second derivative of 0y3 + 0 + 12y*2 - xy*4 + 34y. What is the first derivative of b(g) wrt g? -28g Let o(u) = 3389u*3 - 5u*2 - 484u + 4. Let d(t) = t*2 + t. Let a(k) = -5d(k) - o(k). What is the second derivative of a(y) wrt y? -20334y Let n(z) be the first derivative of 209z + 0z2 - 116/3z*3 - 138. Differentiate n(a) with respect to a. -232a Let l(i) be the second derivative of 0i2 - 7i + 2 - 61/2i3 - 47/12i*4. What is the second derivative of l(q) wrt q? -94 What is the second derivative of 15674 - 31484 + 15622 + 33n*4 + 2n wrt n? 396n2 Let o = -20 - 0. Let w = -18 - o. What is the second derivative of 3n*w + 24n - 20n + 9n wrt n? 6 Let m(w) be the third derivative of -1347w8/112 - w5/20 + 19w4/12 - w3/3 + 2w2 - 2206. Find the third derivative of m(v) wrt v. -242460v*2 Let s(q) = 21q - 143. Let l be s(7). What is the third derivative of -43v2 - 2v*5 + 16v*l + 1798v - 1798v wrt v? -120v*2 + 384v Find the second derivative of -26586x2 + 9 + 3 + 14 + 30282x*2 - 7 - 46x wrt x. 7392 Let j(b) = -596b2 + 10b - 4262. Let f(k) = k*2 + 2k + 3. Let v(d) = -5f(d) + j(d). Find the first derivative of v(g) wrt g. -1202g Let c(a) be the second derivative of 88a5/5 - a3/6 - 294a*2 - 23a - 1. Find the first derivative of c(z) wrt z. 1056z2 - 1 Let r(h) be the second derivative of 4451h*4/4 - 8h*3/3 - 29h*2/2 + 2507h. Find the second derivative of r(z) wrt z. 26706 Let r(q) = -q*2 + 17q + 7. Let c be r(16). Let z = c + -10. Differentiate 4b3 + z + 1 - 13b*3 with respect to b. -27b2 Let r(m) be the third derivative of m8/168 + 85m6/8 - m5/12 + 4597m*4/24 - 15594m*2. What is the second derivative of r(s) wrt s? 40s*3 + 7650s - 10 Let r(c) = -60c - 99. Suppose -4m + i = -64, 2 = -m - 4i + 1. Let v(f) = 3f - 1. Let a(w) = mv(w) - r(w). What is the derivative of a(o) wrt o? 105 Let g be -42/4-5. Find the third derivative of 2v*5 - 24v*2 + 5v*3 - 57v*2 + gv*5 - 5v*5 wrt v. 420v*2 + 30 Let w(d) be the second derivative of -170d*5 + 2807d*2 + 10d + 248. What is the derivative of w(o) wrt o? -10200o2 Suppose 4g - 5k = -28, 72 = -5g - 2k - k. Let d = g + 20. What is the second derivative of db + 3b - 2b - 10b4 wrt b? -120b*2 What is the second derivative of -2843 + 5558y - 101y3 + 1417 + 1426 - 68y*2 wrt y? -606y - 136 Let x(c) be the first derivative of -1040c4 - 127c*2/2 + 6c + 4590. What is the second derivative of x(t) wrt t? -24960t Let i(f) be the third derivative of -f8/336 + 46f*7/105 - 197f5/60 + f4/24 - 451f2. What is the third derivative of i(z) wrt z? -60z*2 + 2208z Let m = 149 + -144. What is the derivative of -m - 55y - y2 + 60y - 8 + 52 wrt y? -2y + 5 Let c = -87 + 95. Let w(k) = -51k*3 - 16k + 153. Let o(j) = -17j3 - 6j + 51. Let z(u) = co(u) - 3w(u). Differentiate z(h) wrt h. 51h2 Let k(q) be the third derivative of -2869q*5/30 - 29q*4/12 - 7q*3/6 - 2q2 - q + 3436. What is the second derivative of k(x) wrt x? -11476 Let c(f) = -f2 + 17f - 6. Let h be c(14). What is the second derivative of hd + 7d + 2 - 24d*3 + 30d - 2d2 - 39d wrt d? -144d - 4 Suppose 5x + 2n - 51 = 29, 32 = 2x - 2n. Find the first derivative of -9 + 7 + 45a*2 + x - a + 34a*2 + 14 wrt a. 158a - 1 Let z(u) = u*3 - 3u*2 - 2u - 3. Let m be z(4). Suppose 2y = 4n - 22, 6 + 2 = -n + my. Find the third derivative of 19o2 - o6 - 7 + n - o*6 wrt o. -240o*3 Let i(x) = 31x*3 - 10x*2 - 86x + 8078. Let k(m) = 63m3 - 25m*2 - 177m + 16156. Let a(c) = -5i(c) + 2k(c). Differentiate a(t) with respect to t. -87t2 + 76 Suppose -70 = -35g - 0. What is the third derivative of -65r2 - 62r*3 - 33r*2 - 30r*g + 20r*2 + 152r*3 wrt r? 540 Suppose -3p + 8 = 5x, -4x - 2 - 6 = 0. Let j = 3769 - 3767. Find the second derivative of jq2 + 62q*4 - 58q*4 + pq - 2q2 wrt q. 48q*2 What is the third derivative of -263s*6 + 124s*6 - 70s*3 + 162s*6 + 6s + 40s2 + 37s*2 wrt s? 2760s*3 - 420 Let s(o) = -4039o*3 + 2127o*2 + 5o. Let f(h) = 2690h3 - 1418h*2 - 3h. Let m(l) = -8f(l) - 5s(l). Find the third derivative of m(j) wrt j. -7950 Let k(f) be the first derivative of 1085f4/4 - 609f - 567. Find the first derivative of k(x) wrt x. 3255x2 Suppose -4o = -4o + 3o. Suppose ob - b + 61 = 2j, -2b + 4j + 82 = 0. Differentiate 43 - 110 + b + 19y3 with respect to y. 57y*2 Let r be 322084/84 + (-4)/(-6). Suppose -r = -2p - 0o + 5o, 3p - 5769 = 2o. What is the third derivative of -pk - 10k*6 + 28k*2 + 1925k wrt k? -1200k3 Suppose 3l = -0d - d - 4, 2d = l + 13. Let a be ((-25)/(-10) + l)/(2/(-20)). Find the first derivative of -3u + 5u - 9u + au + 10 wrt u. -2 Let i = -21 + -2. Let c = -21 - i. Find the third derivative of 2d2 + 15d*2 + 7d*4 - 2d*2 + 0d*c wrt d. 168d Let h(g) = -8385g2 - 91g - 107. Let n(p) = -2795p2 - 31p - 35. Let k(j) = 2h(j) - 7n(j). What is the second derivative of k(q) wrt q? 5590 Suppose -f + 3w = -9, -4w = 2f - 3w - 18. Suppose 4b + 1 = f. Differentiate 4g*2 - 5 - 3g*b + 7g*2 + 3g*2 wrt g. 22g Let r(h) = 4h2 + 17h + 56. Let z be r(-6). What is the second derivative of -6c4 + 4c*4 - zc + 29c2 - 50c*2 wrt c? -24c*2 - 42 Let i(t) be the first derivative of 121/3t*3 - 2t - 3/2t2 + 168. What is the second derivative of i(g) wrt g? 242 Let g = 61 - 56. What is the second derivative of 1 - 5d*2 + 13d*4 + d + 6 + gd*2 wrt d? 156d2 Let j(s) = -s3 - 6s	{ "pile_set_name": "DM Mathematics" }
earest to -1/2 in -8, -2, 3.4, 5? -2 Which is the closest to 1/566? (a) -4 (b) 3/4 (c) 4 b What is the closest to 4 in -0.12, 4/9, -1/2, 0? 4/9 What is the closest to 31 in -3/8, -4/9, 5, 4? 5 Which is the nearest to -1238? (a) 1.8 (b) -4 (c) -0.2 b What is the nearest to 0.2 in 2/37, 66, 24? 2/37 What is the closest to 218 in 2/7, -7, 3/2? 3/2 What is the nearest to 50 in -0.1, -0.5, -9/4, -32? -0.1 Which is the closest to 380? (a) -5 (b) -0.11 (c) -0.3 (d) -0.01 d Which is the nearest to 1? (a) -2 (b) 5 (c) -0.02 (d) 26958 c Which is the closest to 1? (a) -4685 (b) 0.4 (c) -3/2 b Which is the nearest to -1? (a) -1 (b) 0.4 (c) 124 (d) 2/9 (e) 23 a Which is the nearest to 1/8? (a) -29 (b) 3 (c) -0.052 c Which is the closest to 4? (a) 2/7 (b) -4 (c) 0 (d) -0.1 a Which is the nearest to -0.7? (a) -3 (b) 18 (c) 1/4 (d) -32 c Which is the closest to 2? (a) 4 (b) -1 (c) -15/8 (d) -3/2 (e) 41 a Which is the nearest to 0? (a) -1/3 (b) 2 (c) -4 (d) 0.1162 d What is the nearest to 0.1 in 16, 781, 0.5? 0.5 What is the nearest to 3 in -116879, -4, -1, 3? 3 What is the closest to -13376 in 0, 0.3, 0.4, -5, -4? -5 What is the nearest to 2/9 in -5, 16.6, -4, -0.2, -106? -0.2 What is the nearest to 0 in 1/4, -198, -0.12, 0? 0 Which is the closest to -3? (a) 4705 (b) 0.1 (c) -0.4 (d) 1/2 (e) 2 c What is the closest to 2 in 26/7, 3, 16.8, -2/9? 3 Which is the nearest to 0.04? (a) 10 (b) 0.1 (c) 1383 b What is the nearest to -3 in -7/3, -3/5, -0.319? -7/3 Which is the closest to -1? (a) -116 (b) -2/5 (c) 31 b What is the closest to -0.2 in -2/9, 3/2, -15863? -2/9 What is the closest to -10 in 3/7, -6, 8/13, 0.1, -1/4? -6 What is the closest to -14 in -1/5, -11, -2/21, 0.4? -11 What is the closest to 4 in 2, -0.04, 1/9, -87, -6? 2 Which is the nearest to -5/4? (a) -0.1 (b) 0.4 (c) -16 a What is the nearest to -0.894 in 1/4, 4, 0, 0.06, 0.1? 0 Which is the nearest to -2/5? (a) 0.11 (b) -2/7 (c) 0 (d) -2/11 b What is the closest to 4 in 0.3, -0.1, -10138, -1? 0.3 What is the nearest to -20 in 12/25, 0.3, 0.5, -1/17? -1/17 Which is the nearest to -99? (a) -1 (b) -3/2 (c) 1/4 b What is the nearest to -0.1 in 0, 4, -108, -5, -1/6? -1/6 Which is the closest to -0.03? (a) -1/6 (b) -0.13 (c) 0.2 (d) 9 b What is the closest to -2 in 7, 0.2, -1017? 0.2 What is the nearest to 4.1 in -3/8, 10, -3? -3/8 Which is the nearest to -1? (a) -3.2 (b) 0.2 (c) 8870 b What is the nearest to 4 in -30, -3, -0.071, 4? 4 What is the nearest to 1 in 1, 0.5, 52, -5? 1 Which is the closest to 3/11? (a) -0.3 (b) 5 (c) 0.6 (d) 2 (e) 571 c Which is the nearest to 3? (a) -8 (b) -36.51 (c) 0.1 c Which is the nearest to -2? (a) -0.6 (b) 2/21 (c) -6/7 (d) 215.3 (e) 2 c Which is the nearest to -121.59? (a) 4/3 (b) -91 (c) 0.2 b Which is the nearest to -21/8? (a) -5 (b) 1/3 (c) -2/3 (d) 1 (e) 7 c What is the nearest to 13 in -0.5, -1/4, 5, 4/177? 5 Which is the closest to 1? (a) -0.068 (b) -5/3 (c) 0.086 (d) 5 c Which is the closest to -0.3? (a) 1 (b) -83 (c) 1/3 (d) 67 (e) -0.2 e What is the nearest to -1 in -2/5, 24, -5, 0.5, -0.3? -2/5 What is the closest to -63/5 in 0.1, -2, -7? -7 Which is the closest to -5/2? (a) 18 (b) -0.5 (c) -2/5 (d) -2/11 b Which is the nearest to -1? (a) -1 (b) -4 (c) -0.214 (d) 28 (e) 0.2 a What is the closest to 0 in -31, 149, 2/9? 2/9 What is the closest to 26 in 1/11, -3, -17? 1/11 What is the closest to 61/5 in -0.1, 0.3, 0.5, -0.0079? 0.5 What is the closest to -0.8 in -2, 75, -0.053? -0.053 What is the closest to -3 in 1.9, 5, 3.14, 3/2? 3/2 What is the nearest to 1686 in 0, 0.4, -6/5, -4? 0.4 Which is the nearest to -3? (a) 5 (b) 1/2 (c) 143/10 (d) -4 (e) 3 d Which is the closest to 2/5? (a) -1/7 (b) -2/123 (c) 878 b Which is the closest to -0.1? (a) -6 (b) 5/4 (c) -0.1 (d) 5 c What is the nearest to 1 in 4/5, 0.23, 0.4, -1/10, -3? 4/5 What is the nearest to 1 in -0.1, 0, 28/19, -2? 28/19 Which is the nearest to 1106? (a) -0.5 (b) -0.2 (c) -0.3 (d) 4 d What is the closest to 1/2 in 5, -3, 4.078, 1/11? 1/11 What is the nearest to -2 in -2/35, -8, 2/55, -2, -0.3? -2 What is the closest to 0.92 in 0.1, -1.5, -0.4, -2/9? 0.1 What is the nearest to -4 in -0.08, 2/7, -1287, -4? -4 What is the closest to -1 in -137, -4, 10, -2? -2 Which is the closest to 6/5? (a) -4 (b) -1/2 (c) 1886 b What is the closest to 1/371 in 0, 3, -5? 0 What is the closest to 0.1 in -0.2, -2/5, -4, -0.1? -0.1 Which is the nearest to -1/4? (a) 1 (b) 88 (c) 0.2 (d) -18/5 c Which is the nearest to 0.1? (a) 53/18 (b) 0.08 (c) -5 b What is the nearest to 306 in 0.1, 16, -4, -2/23? 16 What is the closest to 0.2 in -0.04402, -0.5, -1? -0.04402 What is the nearest to -0.435 in -0.4, -0.5, 31, -3, -0.28? -0.4 What is the nearest to 1 in 1694, 0, 3, -2/5? 0 What is the closest to -3 in -12, -82, 0.1, 0? 0 What is the closest to -26 in 13, -2, -52.9, -2/3? -2 What is the nearest to 2.5 in 0.04, 3/5, -0.3, 5, 55? 3/5 What is the nearest to -181.43 in -2, -2/5, 3, 0? -2 What is the nearest to 62/3 in 1/6, -14, 0.4, -5? 0.4 What is the nearest to -3/4 in 0.06, -4, 0.2, 19, -0.2? -0.2 Which is the nearest to -1? (a) 3 (b) 15 (c) 5 (d) -1 (e) -0.3 d Which is the nearest to -8? (a) 0 (b) -4 (c) -55/171 (d) 2/3 b What is the nearest to -2 in -0.19, -12, -4? -0.19 What is the nearest to 2/7 in -0.36, -2/13, -1, 121.2, -2/7? -2/13 Which is the closest to 0.2? (a) -1.495 (b) 2 (c) 11 a What is the closest to 1 in -0.5, 5, 7, -4/177, 0? 0 Which is the closest to -1? (a) 0.99 (b) 2 (c) 2/9 c Which is the closest to 2? (a) 7/93 (b) 5/6 (c) -4 (d) 2/7 b Which is the closest to 0.06509? (a) 0.2 (b) 1 (c) -2 (d) 2 (e) 1/3 a What is the closest to 2/3 in -5, 5/27, -34, -2? 5/27 What is the closest to -2/11 in -30, 15, -5? -5 What is the nearest to -1612 in -1/2, -2/9, 0? -1/2 What is the closest to 0 in 5/12, -1/17, -2, -1/9? -1/17 What is the nearest to 0.05 in -3, 2, -4/19, 0.1? 0.1 What is the closest to 1.5 in 3/4, 3, -2/83, 0.2? 3/4 Which is the nearest to 0.2? (a) 2/9 (b) -43 (c) -39 (d) -4 a What is the closest to 2/3 in 6, 2, 4, -1/62? -1/62 Which is the closest to 10790? (a) -1 (b) 3 (c) 2/11 (d) -4 (e) -1.1 b Which is the closest to -2/11? (a) 7801 (b) -0.1 (c) -13 b Which is the nearest to -6? (a) 3 (b) -11392 (c) -0.2 c What is the closest to 0.2 in 0.3468, 1, -50? 0.3468 What is the nearest to -98953 in -1/6, 1, 0.4? -1/6 Which is the nearest to 0? (a) 4 (b) -12 (c) -1 (d) 0.5 (e) 10/53 e Which is the closest to -4? (a) -0.3 (b) 282 (c) -2 (d) 7 c What is the closest to 1/2 in -5778, -0.2, -0.06? -0.06 What is the closest to -42 in -0.01, 1.4, 0.5, 1/4, 6? -0.01 What is the closest to 18/49 in -5, 3, -3, 0.3? 0.3 Which is the closest to -37/35? (a) 5 (b) 1/8 (c) -8 b What is the closest to 0.1 in 216, 0.8, -0.4, -1, -2? -0.4 What is the nearest to 4 in -0.3, -2/19, -73, -0.5? -2/19 Which is the closest to -0.1? (a) 4 (b) -567 (c) 5/4 (d) 0.4 d Which is the closest to 2/11? (a) -2/5 (b) -0.2 (c) -275 (d) 1 (e) -0.1 e What is the closest to -1 in 0.6, -1/3, -0.3, -2/259? -1/3 Which is the closest to -0.1? (a) 40/3 (b) 2/21 (c) 1/5 b What is the nearest to -332 in 4, -1, 0.2, -3, 253? -3 Which is the closest to 5? (a) 23 (b) 0.4 (c) 2 (d) 4 d Which is the nearest to 0.3? (a) 0.11 (b) -0.3 (c) 0 (d) -57 (e) -0.1 a Which is the nearest to 11? (a) 0.4 (b) 1/21 (c) -6 (d) 4/7 (e) -2/9 d Which is the nearest to -5/3? (a) 8 (b) -0.2 (c) -1 (d) 0.5 (e) -2 e What is the nearest to 0.1 in 1/4, 46, -0.1, 0.08? 0.08 What is the closest to 1 in -31, -2/9, 0.24, -0.5, -30/7? 0.24 What is the closest to 0.1 in -3, 3/5, -3505? 3/5 Which is the closest to 1/4? (a) 46 (b) 11 (c) 2 c What is the nearest to -1 in -0.2, -3, -5, -81, -23? -0.2 What is the closest to -0.1 in 5/2, 9, 0.2, -115? 0.2 What is the nearest to 2 in -1/2, -5/3, -117? -1/2 Which is the nearest to 0.05? (a) 0.0444 (b) 1/3 (c) 1/6 a What is the nearest to -1/4 in 0.3, 0.1, -4, -2/5671, 0.6? -2/5671 What is the closest to -7 in 2, 8/5, 9? 8/5 What is the closest to 3/5 in 10681, 5, -0.5? -0.5 What is the nearest to 1 in -4/9, -107, 167, 2/	{ "pile_set_name": "DM Mathematics" }
9 = -55d. What is the biggest value in -1, 4, 5, d? 5 Suppose -4x + 4 = -0. Suppose 2p = 4h - 2, h = 5p + 4 + x. Let f be -7 - -5 - (-10)/8. What is the third biggest value in -0.4, p, f? p Let x = -9.8 - -10.9. Let h = 247/276 - 10/69. Which is the second smallest value? (a) h (b) x (c) -5 a Let w = -146 - -122. Let i be (w/40)/((-24)/10). Which is the fourth biggest value? (a) -3/8 (b) -4 (c) 2/3 (d) i b Suppose -62 = 5k - 6k. Let h = 66 - k. What is the third biggest value in -0.4, 3/7, h? -0.4 Let z = -26.3 - -26.389. Let c = -0.189 + z. What is the smallest value in c, 4/9, -0.3? -0.3 Let w be 7/(-20) - (-3)/6. Suppose -4u = 0, -g - u - 141 = -0u. Let i = -281/2 - g. What is the third smallest value in i, w, -1/6? i Let b = -0.346135 - -0.046135. Let f = -17 + -1. Let t = 0.1 - -0.4. What is the biggest value in f, t, 1, b? 1 Let u = 7 + -9. Let y = 659.4 + -765. Let g = -108 - y. Which is the second smallest value? (a) 3 (b) u (c) g b Let g be ((-10)/(-20))/((-5)/418). Let j = 42 + g. Let k = -693/80 - -43/5. What is the biggest value in k, j, 0.4? 0.4 Let k be (-4)/58 - 321/(-29). What is the smallest value in 1, -2, -4, -0.3, k? -4 Let i = -18.94 + 19. Let x = -0.1624 + -1.8376. Which is the second smallest value? (a) i (b) x (c) 3/2 a Let j be -12 - (-1 + (-1566)/144). Which is the second biggest value? (a) 2/21 (b) 38 (c) -0.6 (d) 2/7 (e) j d Let w be ((-4)/2)/((-2)/(-2)). Let p = 174 - 161. Let v = -14 - -14.4. Which is the third smallest value? (a) 3 (b) w (c) p (d) v a Let m = 102 - 106. Let h = -8 - -16. Which is the second biggest value? (a) h (b) -2 (c) 1 (d) m c Let m = -9.02 - -613.02. Let t = 601 - m. What is the third smallest value in 2/11, t, -20.3? 2/11 Let t = -39 + 537. Let h = 997/2 - t. Which is the third biggest value? (a) 8 (b) -2 (c) h (d) -1 d Let n be ((-4)/(-180))/(6/(-15)). Which is the third smallest value? (a) -2/5 (b) 0.2 (c) 15 (d) n b Let y = -189 - -188.145. Let u = y - -0.255. Which is the third biggest value? (a) -2/5 (b) 0.4 (c) -0.2 (d) u a Let v be 5 - (3 + (-11)/((-176)/28)). Let g = -58 + 57.95. What is the third smallest value in -2, g, v, 0.4? v Let k be 6/(-27) - (-1)/(-9). Let c be -1 + 150/39 - 3. Let z = 0.209 + -1.209. What is the third biggest value in c, 0.3, z, k? k Let c = 572.9 - 548. Let y = c + -24.6. Let m be (0 + 1/(-6))-4. What is the second smallest value in 3, m, y? m Let h = -27 - -26.6. Let q = -60.23 - -60. Let m = q + 0.23. Which is the biggest value? (a) 1/7 (b) m (c) 0.3 (d) h c Let l = -778/63 + 106/9. Let q(y) = 46y + 187. Let d be q(-4). What is the biggest value in 18, d, l? 18 Let b = -1121 + 1112. Let f = 8.78 - 9. Let s = f + 0.02. What is the smallest value in b, -1, s? b Let t = 10 + -11. Let d(r) = -r3 - 6r*2 - 9r. Let z be d(-4). Suppose -4w - z = -6w. What is the smallest value in 5, w, t? t Let r = 1164 + -1158. Which is the third biggest value? (a) r (b) -4/9 (c) -2/3 (d) 2 b Let a = 1479 + -1479. What is the fourth biggest value in 7.8, 3, 0.4, a? a Let o = 213 - 415. Let x = o - -200. Let a = 626/465 + -2/155. What is the fourth smallest value in x, 1, a, 0.1? a Let p be -9 + (9 - ((-6 - 1) + 74)). Suppose 107 = 3b - 103. Let c = b + p. What is the fourth smallest value in 4, -1/6, c, 2/5? 4 Suppose -15 = -5s - 0s. Let z = 6516.039 + -6521. Let q = z - 0.039. What is the biggest value in q, 1/6, s? s Let w = -17936 + 17960. Let z be 0 + (-6)/(-39) + 180/(-325). Let k be (1/(-5))/((-6)/10). Which is the second smallest value? (a) k (b) w (c) z a Let d = 7439 - 7440. What is the third smallest value in d, -0.5, -0.134, 5/2? -0.134 Suppose 27v = 13v - 80v - 376. Which is the smallest value? (a) 5 (b) v (c) -3/8 (d) -1/12 b Let d = -0.067 + 0.117. Let p = 548/21 + 81/7. Let t = -1475/39 + p. Which is the smallest value? (a) 2 (b) d (c) t c Let l = -18.997 - -18.497. What is the third smallest value in -2/3, l, 158, -4? l Let b = -11863 + 11866. What is the fourth biggest value in b, -5/33, -5, 4? -5 Let o = 15/101 - -71/202. Suppose -2k = -4k + 6. Suppose 17 = 2f - kf. Which is the biggest value? (a) f (b) 2 (c) o b Let m = 4172 - 4182. Let j(l) = l*3 - 6l*2 - 8l + 9. Let p be j(7). Which is the third biggest value? (a) m (b) -3/2 (c) p a Let x = -241 + 244. Let f = -2/125 - 23/125. What is the third biggest value in -4, x, f, 2? f Let z = -1/3620 - -7243/10860. Which is the third biggest value? (a) 0.04 (b) 50 (c) z (d) 1 c Let u = -68214/7 + 9746. What is the fourth biggest value in -5, 2, -3, u? -5 Let n = 576 + -571. Which is the third smallest value? (a) -4 (b) 1 (c) 13 (d) n d Let i = 507 + -504.21. Let m = i + -2.79. What is the fourth biggest value in -5, 0.1, -0.4, m? -5 Suppose 0 = -8d + 2d + 18. Suppose 2o = do - 3. Suppose ox = 11 - 2. What is the smallest value in 12, 1/7, x? 1/7 Let y(a) = -6a + 81. Let h be y(14). What is the third biggest value in 3, h, -5, -2.1? h Let w = -908/27 + 3767/108. What is the third biggest value in 4, 2/9, w, -0.5, -3/2? 2/9 Let m be 1/1 + 3 - (-20)/(-8). Let x = -2.43 + -0.57. Which is the smallest value? (a) m (b) 1 (c) x c Let g = -0.0241 - -0.1241. Let d be (-4)/(-21)(2 - (-3 + 8)). What is the smallest value in -5, g, 99, d? -5 Suppose 3y - 1 - 17 = -5a, -3a = -5y - 38. Suppose 8 = 2t - 5w, -at + 15 = -11t - 5w. What is the third smallest value in -33, t, -0.3, -3? t Let k be (55/(-15) + 4)(-1 - -2). Suppose 0 = 6c - 24. Suppose 0 = 3y - 4x + 6, -3x + c = y - 7. What is the third smallest value in y, k, 1? y Let q be 694/124 + -615/(-54). Which is the third smallest value? (a) q (b) 4 (c) -5 a Let t = 10 + -9.88. Let r = t - -4.88. Let o be ((-640)/512)/(1/8). Which is the third biggest value? (a) o (b) -2 (c) r a Let u = -36744 - -36747. Which is the third biggest value? (a) -4 (b) u (c) -2/51 (d) 2/5 (e) 2/3 d Let k = 3/1429 + 4281/2858. What is the fourth smallest value in -0.1, 24, 18/5, k? 24 Let p = -1.596 - -0.596. Suppose -12 = -7j + 3j. Which is the second smallest value? (a) -1/2 (b) p (c) j a Let i be 671/1415229 - (-2)/(-16). What is the third smallest value in 5, i, -0.56? 5 Let p = -327.2 + 256. Let g = 68 + p. Let v be (-5 + 85/15)(-3)/(-19). Which is the third biggest value? (a) g (b) v (c) 3 a Suppose 0 = 2a + 3a + 10. Let j be 15/(-75) + (66/5)/1. Suppose -4o = -y + 2, j = -5o - 3y + 2. What is the second biggest value in 0.08, 4/5, o, a? 0.08 Let h = 1105 - 2207/2. Which is the third biggest value? (a) 0 (b) h (c) -40 (d) -4 d Suppose 0a + 2k - 5 = -5a, -2a - 4k = 14. Let i = -6264 - -6263. What is the smallest value in i, 0.5, -13, a? -13 Let n = -967 + 1332. Let u = -364.6 + n. Which is the fourth biggest value? (a) u (b) -0.5 (c) -2/19 (d) -1.4 d Let v = 10 - 9.5. Let h = -174/83 - -1962/1411. What is the biggest value in v, h, -3? v Let v = 1378 - 1378.5. What is the second biggest value in v, -3/5, 0, -0.4? -0.4 Let r be 1/(-2) - 1/4. Let m = 168803 + -168792. Which is the smallest value? (a) r (b) -1 (c) m b Let g be (91/(-104)4)/((-147)/12). What is the fifth biggest value in -0.5, 3, 1/2, 114, g? -0.5 Let t = -0.83 + 0.53. Let w = -0.02 - 1.98. Let g = 314 - 1573/5. Which is the fourth biggest value? (a) g (b) t (c) 5 (d) w d Let n = 87 + -87.288. Let h = -0.088 - n. Which is the biggest value? (a) 4/7 (b) -33 (c) h a Let i = 8 + -7.2. Let g = i - 0.6. Let u = 1992 - 1989. Which is the third biggest value? (a) 0.3 (b) u (c) g (d) -0.3 c Let f = 12 - 7. Let w = -34.41 - -6.11. Let r = 28.4 + w. Which is the biggest value? (a) f (b) 2/7 (c) r a Let y be (-5)/95 + (-2890)/323 - (-4)/6. Which is the fourth smallest value? (a) 4/5 (b) 4 (c) 0.3 (d) y (e) -1/6 a Let n = 83.5 - 83.4587. Let h = -0.0587 - n. Which is the fourth smallest value? (a) -0.4 (b) -0.5 (c) h (d) -4 c Let c = 1386 + -1386.08. What is the second biggest value in c, 4, 0.4, 1? 1 Let t = -194/2805 + 64/255. What is the third smallest value in 9, 3.4, 1, t? 3.4 Let d = 12.37 + -7.37. Let s = -0.7 + 0.5. What is the fourth biggest value in d, -8/3, 1/6, s? -8/3 Let z = -87248.3 + 87249. Let q be (-1)/2*(-8 - -3). What is the sec	{ "pile_set_name": "DM Mathematics" }
z - 2. Calculate the highest common factor of o and z. 6 Let w be 3 - ((-20)/(-1) - 1). Let j be ((-7)/28)/(2/w). Let n be (12 + -8)j/2. What is the highest common factor of 16 and n? 4 Let i be (1/(-3))/(5/(-30)). Suppose 14 + i = 4r. Suppose -4 = rs, 0 = -p - 0p + s + 4. Calculate the greatest common divisor of 12 and p. 3 Let q = -17 + 94. Let a be 407/q - 4/14. What is the highest common divisor of 45 and a? 5 Suppose 3c + 11 = -4h + 398, 0 = -3h + 2c + 303. Let i be (-12)/(-2)h/27. Calculate the greatest common divisor of i and 154. 22 Let h be 70 + (16 - (1 - -7)). What is the highest common divisor of 754 and h? 26 Let o(w) = 43w*2 - 2. Let z(q) = -44q*2 - q + 1. Let b(x) = -3o(x) - 4z(x). Let g be b(-1). Calculate the greatest common divisor of g and 45. 45 Suppose 0 = -2c + 5c - 27. Suppose -3b - 1 = -2d, -c = 4b + 11. Let o be (-1)/3d33. Calculate the greatest common factor of o and 11. 11 Let f(p) = p*3 - 4p*2 + 6p - 6. Let b be f(3). Let t = -15 - -27. Calculate the greatest common divisor of t and b. 3 Let v = 226 - 222. Let b be (-46)/44-1. Suppose -b = -vk - 2. What is the greatest common divisor of 11 and k? 11 Let t be (3/(-4))/((-15)/100 + 0). Calculate the greatest common factor of 40 and t. 5 Let p(i) = -i2 - 2i + 8. Let s(m) = 6m3 - m - 1. Let u be s(-1). Let w be p(u). Let x = 18 + w. What is the greatest common divisor of 8 and x? 2 Suppose -4a + 241 = 3r, a - 4r - 105 + 21 = 0. What is the greatest common divisor of a and 16? 16 Let o be 2/(-12) + 5474/84. Suppose -75 = -4j + o. What is the greatest common factor of j and 14? 7 Suppose 33 = 2o + o - 3d, 5o + d - 37 = 0. Calculate the highest common factor of o and 24. 8 Suppose -8d + 14 = -34. Calculate the greatest common divisor of 2280 and d. 6 Let m be (1254/18 + -3)3. What is the highest common divisor of m and 8? 8 Let n(b) = -b*2 - b + 156. Suppose -6p - 5p = -9p. Let o be n(p). What is the greatest common divisor of 12 and o? 12 Suppose 26 = 21x - 436. Calculate the greatest common divisor of 4 and x. 2 Let g = 4 - 2. Suppose 5y + g - 92 = 0. Let r = -54 - -81. Calculate the greatest common divisor of r and y. 9 Suppose 5b + 34 = 74. Suppose 7s - 2s - 320 = 0. What is the greatest common divisor of s and b? 8 Let l = 315 + -147. Let v(c) = 5c + 1. Let k be v(4). Calculate the greatest common divisor of k and l. 21 Let m be 66 - -2 - (-1 + 11 + -5). Suppose -3q - t = -11, 4q - 11 - 3 = -t. Let o be (-6)/q + 11 + 0. Calculate the greatest common divisor of m and o. 9 Suppose -5k - 140 = -19k. Calculate the greatest common divisor of 130 and k. 10 Suppose -20 = -3u + 2u. Suppose 7o - 769 = -209. What is the greatest common factor of o and u? 20 Suppose 3m + 513 = 3u, -844 = -5u - 3m + 35. Suppose -25 = -287c + 1697. Calculate the greatest common factor of c and u. 6 Let h(q) = 10q2 + q. Let c be h(1). Let x(f) = 82f - 43. Let m be x(2). Calculate the greatest common divisor of m and c. 11 Let l(r) = 4r2 + 22r - 422. Let f be l(16). What is the greatest common factor of 18 and f? 18 Suppose 0 = 14b - 1070 - 442. Calculate the highest common factor of b and 24. 12 Let v be 11 - ((-2)/5 - (-308)/70). Let b(q) = 5q - 25. Let f be b(v). What is the highest common factor of 15 and f? 5 Suppose 27d + 15 = 32d. What is the highest common divisor of d and 24? 3 Let p = 205 - 139. Calculate the highest common divisor of p and 66. 66 Suppose -551 = 3w + 190. Let c = 387 + w. Calculate the greatest common factor of 56 and c. 28 Let g(y) = -y3 - 5y*2 - 2y + 2. Let q be g(-5). What is the highest common divisor of q and 60? 12 Suppose -15 = -2q + 33. Suppose -3a = -y - 12, 5a = y - 0y + 22. What is the greatest common factor of q and y? 3 Suppose 0 = -6c - 229 + 535. Suppose 3b + 185 - 1856 = 3d, 3b + 2d - 1691 = 0. What is the highest common factor of b and c? 51 Let z(y) = -y + 9. Let a be z(-7). Suppose -4x - j = -a, -2x + j + j = -8. What is the highest common factor of x and 1? 1 Suppose 5f + 4i = 122, -2f + 8i + 59 = 13i. Calculate the greatest common divisor of f and 88. 22 Suppose 22u - 288 = 240. What is the greatest common factor of u and 8? 8 Let n be (-184)/(-18) + -2 + 12/(-54). Let y be (2 - 2) + (3 - 0). Let z be (y + 1)(-4 + n). What is the highest common factor of z and 32? 16 Suppose -2o + 4i = 8i - 2, 3o + 2i - 11 = 0. Suppose -2r + 0a + 88 = oa, -3r = -2a - 94. Calculate the highest common factor of 204 and r. 34 Let x be (-6339)/(-12) - 10/8. Calculate the greatest common factor of 17 and x. 17 Let x = 178 - 136. What is the highest common factor of x and 84? 42 Let c be (2/(-4))/(29/(-6) + 5). Let m be (-5)/(112/(-36) - c). What is the greatest common divisor of m and 18? 9 Let q = 13 + -9. Suppose 7 - 1 = 2g, -3h - 231 = -2g. Let p = -43 - h. What is the greatest common divisor of p and q? 4 Let g(q) = -q3 + 13q*2 - 14q + 29. Let o be g(12). Suppose v - 154 = -or + 2v, -v = -2r + 64. Calculate the greatest common divisor of r and 5. 5 Let k be -3 - (1 - -1)/(-2)129. What is the greatest common divisor of 315 and k? 63 Suppose 502a = 481a + 210. Calculate the highest common divisor of 1010 and a. 10 Let p(t) = t + 7. Let w be p(5). Suppose z + 7 - w = 0. Let i be 90/(-2)2/(-2). What is the greatest common divisor of i and z? 5 Let p be -4 - (-15 + 5) - 1. Calculate the highest common divisor of p and 105. 5 Let z(h) = -6h + 64. Let x be z(6). Let a = -6 - -5. Let m(v) = 13v2 - v. Let c be m(a). Calculate the highest common factor of c and x. 14 Suppose 5h - 3 = -m, 2m - 9 = -m + 5h. Suppose 4l = -11 + 23. What is the greatest common divisor of m and l? 3 Suppose -3w + 34 = -q, 5 = w - q - 7. Let l be (w - (-2 - -1))/2. Suppose i - li = -55. What is the greatest common factor of 44 and i? 11 Let h be (-2)/(12/(-450)) + 6. What is the greatest common factor of 18 and h? 9 Let n be (10/244)/(2/6). Suppose -np + 40 = 5p. What is the greatest common factor of p and 4? 4 Let l(i) = 5i + 60. Let j be l(23). Calculate the greatest common factor of 35 and j. 35 Suppose 632 = 5x + 92. Let i = 172 - 148. Calculate the highest common factor of x and i. 12 Let n = 1 + 1. Suppose n + 4 = 2a, -2i - 4a = -18. Suppose 2z - 3r = 45 - 12, -ir - 57 = -3z. Calculate the highest common divisor of 72 and z. 24 Let o = 77 + -17. Let d be (246/30 - 7)/((-4)/(-50)). Calculate the greatest common factor of o and d. 15 Let j be 2/6 + 22/6. Suppose -j = -5o + 36. Let f(x) = x*3 - 6x*2 - 2x + 9. Let u be f(o). What is the highest common divisor of 11 and u? 11 Let y(n) be the second derivative of -25n3/3 - n2/2 - 7n. Suppose 0 = 3k - k + 2. Let v be y(k). What is the highest common divisor of v and 7? 7 Let d = -148 + 204. What is the greatest common divisor of d and 24? 8 Let i(n) = -12n + 61. Let s be i(-5). What is the highest common divisor of 22 and s? 11 Suppose 4f = 7f - 30. Calculate the greatest common factor of f and 16. 2 Let v = -154 + 162. Calculate the greatest common factor of 1096 and v. 8 Let f = 825 - 678. What is the greatest common factor of f and 21? 21 Let g be 2(-30)/(-12) + 0 + 0. Let f be g + 17 - 1-2. Calculate the greatest common divisor of f and 72. 24 Suppose -s + 43 = -32. Let j = -83 - -133. Calculate the greatest common divisor of s and j. 25 Let p be (-210)/(-8) + 12/16. Let z(t) = -21t. Let b be z(-9). Calculate the greatest common factor of b and p. 27 Suppose 6q + w + 260 - 856 = 0, -5w = -q + 120. What is the highest common divisor of q and 90? 10 Suppose -3y + 4y - 70 = -c, 0 = 3c - 9. Let j = y + -27. Suppose -12a + 298 = 17 + 41. What is the highest common divisor of a and j? 20 Let r be (-6)/(-2)244(-28)/(-48). Calculate the highest common factor of 7 and r. 7 Suppose -d = 6u - 3u + 21, 0 = -2u + 8. Let c be ((-8)/(-2) - 7)d. Calculate the highest common factor of 9 and c. 9 Let p = -86 + 150. Let m be 0 - -4(-2)/(-12)6. Suppose -mw + 40 = w. Calculate the highest common divisor of p and w. 8 Let g be 2/142(120 - 113). Suppose 0v = -4v - 20. Let r(d) = -d*3 - 6d*2 - 7d - 6. Let w be r(v). What is the highest common factor of g and w? 2 Suppose 0 = 3*w + 1	{ "pile_set_name": "DM Mathematics" }
*3 + 4n*2 - 2n - 2. What is the lowest common multiple of 26 and i(-4)? 78 Let d = 129 + -102. Calculate the smallest common multiple of 12 and d. 108 Let k = 54667/16 + -3415. Let r = k + -23/80. Calculate the common denominator of 41/6 and r. 30 Suppose -9l = -45 - 18. Calculate the lowest common multiple of l and 7. 7 Let k(s) = 3s + 3. Let n be k(6). Suppose n = 3l - 12. What is the least common multiple of l and (-15)/(-12) + (-2)/8? 11 Let w = 14 + -5. Let k = w - 4. Calculate the common denominator of -77/12 and -1(605/18)/k. 36 Let p be (-8)/(-6)912258/240. Let h = 5076 - p. Find the common denominator of -49/4 and h. 20 What is the common denominator of 5/((-100)/8) + -2 and (-460)/(-42) - 2/7? 15 Let f = 41956181 - 18964204797/452. Let v = f + 6/113. Calculate the common denominator of v and 105/(-4) - (-3)/(-12). 4 Let w = 19 - 17. What is the smallest common multiple of 5 and 2 + w + 7 + 0? 55 Let x(p) = p2 + 1. Let o be x(2). Suppose 2s - s - 27 = -oz, -28 = -4s - 4z. What is the least common multiple of s and 10? 10 Let y(j) = -j3 + 6j*2 + j + 6. Let m be y(6). Suppose 0p + m = 2p. What is the least common multiple of p and (-1 + 22/(-14))-7? 18 Let y = 2019/4 + -439. Let q(d) = -3d2 + 3d - 2. Let c be q(-4). Let x = y + c. Calculate the common denominator of -51/11 and x. 44 Let w be -5 + 6 + (-14189)/6. Let x = -2358 - w. What is the common denominator of x and -3/20? 60 Let c be ((-12)/5)/((-2)/(-20)). What is the common denominator of 2/(0 + c/58) and (1/4)/((-3)/(-102))? 6 Let b(y) be the first derivative of y*2/2 + 5y + 5. Let j be (1 + 13)/(2 + 0). What is the lowest common multiple of b(j) and 6? 12 Suppose -28 = -2p + 4t, -p - t + 19 = -4t. Suppose -pz + 2 = -6z. What is the smallest common multiple of 7 and 0/3 + (0 - z)? 7 Suppose -2n = -n - 7. Let q be -2 + (-20)/(-2) + 2. Suppose -4h - h = -q. Calculate the lowest common multiple of h and n. 14 Suppose 6 = 4j - 154. Suppose 3u - j = -u. What is the least common multiple of u and 20? 20 Let d = 14 + -4. Let v(p) = -4p - 2. Let x be v(-8). Suppose -10 = -5l - 3n + x, -5l = -5n. Calculate the lowest common multiple of d and l. 10 Let j = 50/13 - 1371/299. Calculate the common denominator of j and -25/9. 207 Find the common denominator of -22/7 and 3 + (34/(-50))/((-4)/30). 70 Let n(z) = -z + 5. Let y(u) = u*3 + 10u*2 - 10u + 5. Let t be y(-11). What is the smallest common multiple of n(t) and 3? 33 Suppose -h = -0h - 4. Calculate the common denominator of 109/6 and h/16(-70)/(-8). 48 Suppose -u + 1 + 6 = 0. Calculate the smallest common multiple of u and (4/6)/(-2 - (-224)/108). 63 Let n = 105113/38 + -16841597/6042. Let b = -7/159 + n. Calculate the common denominator of b and ((-332)/18)/(16/(-12)). 6 Suppose 0 = -6y + 3y + 5z + 65, -4y + 79 = z. Calculate the smallest common multiple of y and 2. 20 Suppose -4d + 9 = -d. Suppose 2l + 6 + 0 = -4u, 2l + 2u = 0. What is the smallest common multiple of d and l? 3 Let s be 2/(-7) + (-18500493)/106806. Let b = 4/2543 + s. Let p = -184 - b. Calculate the common denominator of p and 33/2. 2 Calculate the common denominator of (-2)/6315/110 and -107/18. 198 Calculate the common denominator of ((-3)/21)/((-12)/(-553)) and 93/4. 12 Let g = 40 + -31. Calculate the lowest common multiple of 9 and g. 9 Let c(m) = 3m - 4. Let l be c(8). Suppose -j - 5n = -2n - 12, -n = -5j - l. What is the common denominator of 2 + j - (-51)/(-42) and -89/18? 126 Let l be 1 - (-2 - (0 - 0)). Suppose 0 = lz + z - 68. Suppose -2v - z = -53. What is the least common multiple of 14 and v? 126 Let o(a) = -8a + 3. Let w be o(-3). Suppose -l - 7 = -w. Calculate the smallest common multiple of l and 2. 20 Let x(i) = i - 3. What is the smallest common multiple of x(10) and 8? 56 Suppose 0 = f + 5t - 17, -5f + 41 = 4t - t. Suppose -3u = u - 8. Calculate the smallest common multiple of u and f. 14 Suppose 3z + 14 = 68. Suppose -4m - z = -l, 0l + 3m = l - 15. Calculate the common denominator of l and 37/5. 5 Find the common denominator of 81/16 and 404/8(-1)/9. 144 Let a(w) = w*2 - 5w + 4. Suppose 5r = 20 + 10. What is the lowest common multiple of 8 and a(r)? 40 Suppose 2j + 5a = 42, -5a = -4j + 74 - 20. Suppose 3z - 53 = -17. What is the smallest common multiple of z and j? 48 Let n = -265554791/8707 + 30499. Let x = 339533/174140 + n. Calculate the common denominator of -25/12 and x. 60 Let b = 4823 - 96349/20. What is the common denominator of (-2)/7 + 442/224 and b? 80 Suppose -152 = -4c + 2a, -2c - 3a + 92 = -0a. Let b = c + -30. Let q = 3 + -2. What is the smallest common multiple of b and q? 10 Let v = -10 - -18. Calculate the lowest common multiple of 11 and v. 88 Suppose -v - 3 = -r - 1, -4r + 8 = v. Suppose ry = -y + 24. Calculate the lowest common multiple of 4 and y. 8 Suppose -4p = -32 - 0. Calculate the least common multiple of 3 and p. 24 Let q = 31141/4383 - -3/487. What is the common denominator of 145/66 and q? 198 Suppose -g + 57 = 18g. What is the smallest common multiple of g and 9? 9 Suppose -9 = 4s - 29. Let b be (-1 - s)/(-3)-2841. Let y = -56931/10 - b. Calculate the common denominator of y and 37/16. 80 Let m = 61835559/16 - 3859753. Let g = 4971 - m. Let s = g - -109/16. What is the common denominator of -131/18 and s? 72 Suppose 0 = -4g - 2c + 28, -5g + 2c + 2 = -33. Suppose 4x + 20 = 4b + 5x, -3b = -2x - 4. What is the lowest common multiple of b and g? 28 Let x(l) = 3l2 - 3. Let k be x(5). Let c = -70 - k. Find the common denominator of 19/4 and (c/42)/((-4)/6). 28 Let h = -47/14 - 11/14. What is the common denominator of (-30)/(-7) + 0/(-2) and h? 7 Suppose -2q = 12 - 172. Let n = 31 - -29. Suppose 0 = -3a - 5h + q, -a - 5h = a - n. What is the lowest common multiple of a and 10? 20 Find the common denominator of (-28)/(-27)1024/64 and 43. 18 Suppose 12 = 2j + 2u - 3u, 4u + 12 = -j. Calculate the least common multiple of j and (36/14)/(2/14). 36 Suppose 7 = w - 5f - 10, -5w - 5f - 5 = 0. What is the smallest common multiple of 8 and w? 8 Suppose -3a - 116 = -2r - 2r, 5r = 5a + 200. Calculate the common denominator of ((-3)/a)/((-1)/6) and -31/22. 22 Find the common denominator of (-542)/(-24) + (-2)/(-12) and -61/9. 36 Let s(a) = a3 + 7a*2 + 6a + 6. Let t be s(-6). Calculate the common denominator of -103/10 and ((-4)/48)/(t/(-356)). 90 Suppose 3a - 101 = u, 42 = 2a - 5u - 8. Suppose 0 = 4c - 9c + a. Let f = 12 - c. Calculate the least common multiple of f and 2. 10 Suppose -4a - 4 = -6a. Suppose 6u - 2u - 120 = -2p, 5u - ap - 168 = 0. Calculate the smallest common multiple of (7/(-14))/((-1)/u) and 14. 112 Let r(s) = s*3 - 9s*2 + 11s - 12. Let g be r(8). Let x(n) = n*2 - 3. What is the smallest common multiple of (6/(-4))/(g/(-80)) and x(3)? 30 Let z = 16 + -2. Suppose -3b + 2b + z = 0. Calculate the least common multiple of 2 and b. 14 Let x be 295(0 - (-16)/20). Find the common denominator of (-1)/3 - (-106)/12 and (x/(-8))/((-3)/2). 6 Let t = 43 - 31. Suppose -4u + 4r = r - 39, -3u + 51 = 5r. What is the least common multiple of u and t? 12 Let f = 1270103/72 - 17639. Find the common denominator of f and -47/18. 72 Let q = 3303251/4274757 + 16626/4439. Let a = q + 4/107. Let b = -178/9 - a. What is the common denominator of b and -17/3? 3 Suppose -2l - 6 = 2j, -2l - 5 = -l. Suppose 2h - 4 = 0, -jy + 2h + 0 = -4. Suppose -6 = -3i + 12. What is the smallest common multiple of y and i? 12 Let t = -3835/516 - -58/43. Calculate the common denominator of t and -13/12. 12 Suppose f + f = -4r + 138, -51 = -r + 5f. What is the smallest common multiple of 28 and r? 252 Let t(l) = -6l - 2. Let y be t(-4). Find the common denominator of ((-1)/4)/(y/60) and 3/8874-2. 22 Suppose -w = 3q - 5q - 48, 0 = w - 5q - 57. Let h = 1939 - 5765/3. Calculate the common denominator of w and h. 3 Let i be (-200)/14 - (-4)/14. Let p = i + 25. Let o = 2 - -1. Calculate the least common multiple of p and o. 33 Suppose -35 = -3g + 8l - 3l, -4g + 2l + 70 = 0. Let w be (-68)/(-5) - 2/(-5). Calculate the lowest common multiple of g and 228/w - 4/14. 80 Suppose -4u + 34 + 30 = 4z, -2*u	{ "pile_set_name": "DM Mathematics" }
at is 33200 rounded to the nearest ten thousand? 30000 Round -0.0040907 to four decimal places. -0.0041 Round -0.00000673 to six dps. -0.000007 Round -11276.8 to the nearest one thousand. -11000 Round -15127100 to the nearest 10000. -15130000 What is -0.05679 rounded to two dps? -0.06 Round -26.48 to zero decimal places. -26 What is -140430 rounded to the nearest 1000? -140000 Round -0.023311 to 3 decimal places. -0.023 Round 393100 to the nearest ten thousand. 390000 What is 507.1 rounded to the nearest 10? 510 Round 5460 to the nearest one thousand. 5000 Round 0.1516 to 2 decimal places. 0.15 What is -4.112 rounded to 1 dp? -4.1 What is -0.0035719 rounded to five dps? -0.00357 What is -0.000009042 rounded to six dps? -0.000009 What is 47.52 rounded to the nearest ten? 50 What is -91.72 rounded to 0 dps? -92 What is -15.05 rounded to zero dps? -15 What is 40493 rounded to the nearest one hundred? 40500 What is -114.62 rounded to the nearest 10? -110 What is 862 rounded to the nearest 100? 900 What is -1201.4 rounded to the nearest ten? -1200 What is 85600 rounded to the nearest 1000? 86000 Round 0.034435 to four dps. 0.0344 What is -3294400 rounded to the nearest 1000000? -3000000 Round -978.3 to the nearest 100. -1000 Round 748.1 to the nearest 100. 700 What is -1283650 rounded to the nearest 100000? -1300000 What is -1750000 rounded to the nearest 100000? -1800000 What is -7.2478 rounded to 0 decimal places? -7 What is 0.000014125 rounded to six dps? 0.000014 Round 0.40691 to two decimal places. 0.41 Round -16.3 to the nearest ten. -20 What is 437.09 rounded to the nearest ten? 440 Round -0.000049335 to 6 decimal places. -0.000049 Round 0.00002065 to five decimal places. 0.00002 What is 0.0736 rounded to two dps? 0.07 Round 1040 to the nearest 100. 1000 Round 14.28 to the nearest 10. 10 Round 632000 to the nearest one hundred thousand. 600000 Round -0.000020177 to 7 dps. -0.0000202 Round -0.007605 to four dps. -0.0076 Round -9981 to the nearest 1000. -10000 What is -0.000021 rounded to four dps? 0 What is -131400 rounded to the nearest one thousand? -131000 Round 74.57 to the nearest ten. 70 What is -9177 rounded to the nearest one thousand? -9000 What is 0.0001103 rounded to 4 dps? 0.0001 Round 0.02229 to 3 dps. 0.022 Round 205000 to the nearest 100000. 200000 Round -511.43 to the nearest one hundred. -500 Round -0.00054475 to four decimal places. -0.0005 Round 0.00000494 to 6 dps. 0.000005 What is -3685 rounded to the nearest one hundred? -3700 Round -1955 to the nearest one hundred. -2000 Round 96.31 to the nearest 10. 100 What is -9096 rounded to the nearest one hundred? -9100 What is -2219300 rounded to the nearest ten thousand? -2220000 What is -0.00069829 rounded to 4 dps? -0.0007 Round 0.000002014 to 7 dps. 0.000002 What is 0.02406 rounded to 3 dps? 0.024 Round 32.947 to the nearest integer. 33 Round -446.4 to the nearest one hundred. -400 What is -0.0000202906 rounded to 7 decimal places? -0.0000203 Round 5970 to the nearest one hundred. 6000 Round -252000 to the nearest 100000. -300000 What is 0.1872 rounded to two dps? 0.19 What is 2293900 rounded to the nearest one million? 2000000 What is -6863100 rounded to the nearest one hundred thousand? -6900000 Round 10.6961 to 2 dps. 10.7 Round 1.3204 to 1 dp. 1.3 Round -2285630 to the nearest 10000. -2290000 Round 0.00001967 to five dps. 0.00002 Round 0.6131 to 1 decimal place. 0.6 What is 83820 rounded to the nearest 10000? 80000 Round -0.027269 to four dps. -0.0273 What is -52900 rounded to the nearest 10000? -50000 Round -1685000 to the nearest 100000. -1700000 Round -4.66396 to 2 dps. -4.66 What is -10570 rounded to the nearest one hundred? -10600 Round 681.2 to the nearest 10. 680 What is -0.000010751 rounded to seven dps? -0.0000108 Round -0.04854 to three decimal places. -0.049 Round -427.49 to 0 dps. -427 Round 0.000253597 to 5 decimal places. 0.00025 Round 14.27 to one dp. 14.3 Round 0.006992 to 4 decimal places. 0.007 What is -0.0005289 rounded to 5 decimal places? -0.00053 What is -0.0053896 rounded to five decimal places? -0.00539 What is -3920 rounded to the nearest 1000? -4000 What is -306700 rounded to the nearest 100000? -300000 What is 50110000 rounded to the nearest 1000000? 50000000 Round -169.13 to the nearest ten. -170 What is 30230 rounded to the nearest 1000? 30000 What is 337400 rounded to the nearest 10000? 340000 What is -1.2334 rounded to two decimal places? -1.23 Round -0.006667 to 3 dps. -0.007 Round -0.04558 to three dps. -0.046 What is 0.0003244 rounded to five dps? 0.00032 Round 0.00019725 to five dps. 0.0002 Round 10235 to the nearest one thousand. 10000 What is 6.1016 rounded to 2 dps? 6.1 Round 76.2 to the nearest 10. 80 Round -108880 to the nearest one thousand. -109000 Round 0.00011032 to 6 dps. 0.00011 Round -0.0001315 to 6 dps. -0.000132 What is -0.0000465737 rounded to seven dps? -0.0000466 Round -466490 to the nearest 1000. -466000 Round -25150000 to the nearest 1000000. -25000000 What is -0.000013 rounded to 5 dps? -0.00001 What is -127.7 rounded to the nearest integer? -128 What is -7665 rounded to the nearest one hundred? -7700 Round 0.41104 to 3 decimal places. 0.411 What is 0.1641 rounded to one decimal place? 0.2 What is 1.356 rounded to one dp? 1.4 Round -0.00000767 to 6 dps. -0.000008 What is -18451 rounded to the nearest 100? -18500 What is -302.1 rounded to the nearest 10? -300 Round -115.47 to 0 dps. -115 What is 0.1446 rounded to two decimal places? 0.14 What is -537000 rounded to the nearest 10000? -540000 What is -0.0000015102 rounded to 6 decimal places? -0.000002 What is -5.3481 rounded to two dps? -5.35 Round 93700 to the nearest 1000. 94000 What is 574.4 rounded to the nearest 100? 600 Round -571.7 to the nearest 100. -600 What is 2689000 rounded to the nearest 100000? 2700000 Round 0.00000066435 to seven dps. 0.0000007 What is -0.0002591 rounded to 5 decimal places? -0.00026 Round -2178.6 to the nearest 100. -2200 What is 75860000 rounded to the nearest 1000000? 76000000 Round -77960 to the nearest 1000. -78000 Round -0.0006283 to five decimal places. -0.00063 What is -2075000 rounded to the nearest 100000? -2100000 What is -41900 rounded to the nearest one thousand? -42000 What is -0.26 rounded to 2 decimal places? -0.26 Round 129.3 to the nearest ten. 130 What is -0.06393 rounded to two dps? -0.06 Round 0.0538 to one dp. 0.1 What is -0.0000481 rounded to six dps? -0.000048 Round 12325000 to the nearest one hundred thousand. 12300000 Round 31000000 to the nearest 1000000. 31000000 Round 2.12612 to 1 dp. 2.1 Round -7016 to the nearest ten thousand. -10000 Round 0.1917 to 0 dps. 0 What is -21.18 rounded to the nearest integer? -21 What is 0.0006005 rounded to 4 dps? 0.0006 What is 11968.2 rounded to the nearest 1000? 12000 Round -8.3312 to 0 dps. -8 Round 0.06306 to three dps. 0.063 Round 1.73826 to one decimal place. 1.7 What is 0.00170729 rounded to four decimal places? 0.0017 What is 0.0004342 rounded to 5 decimal places? 0.00043 What is 0.00076 rounded to four decimal places? 0.0008 Round -0.00753 to 3 decimal places. -0.008 What is -0.000009665 rounded to 6 dps? -0.00001 Round -2627200 to the nearest 10000. -2630000 Round 0.12001 to 3 dps. 0.12 Round 0.0076908 to 3 dps. 0.008 What is 10338.4 rounded to the nearest 10? 10340 What is 447.35 rounded to the nearest one hundred? 400 Round -12.438 to zero decimal places. -12 What is -13.56 rounded to 0 decimal places? -14 Round 0.7051 to one dp. 0.7 Round 2.023 to one decimal place. 2 Round 0.4083 to two decimal places. 0.41 Round 0.0000005405 to seven dps. 0.0000005 Round 2409000 to the nearest 1000000. 2000000 What is -0.01393 rounded to three dps? -0.014 What is 2.539 rounded to 1 dp? 2.5 What is 9511 rounded to the nearest one hundred? 9500 Round -350000 to the nearest 10000. -350000 What is -11.359 rounded to one dp? -11.4 Round -16170000 to the nearest 100000. -16200000 Round -0.00059422 to five decimal places. -0.00059 Round 705000 to the nearest ten thousand. 710000 What is 74806.4 rounded to the nearest 10000? 70000 What is -0.06722 rounded to three decimal places? -0.067 What is -317720 rounded to the nearest 100000? -300000 Round -0.00049529 to 5 decimal places. -	{ "pile_set_name": "DM Mathematics" }
common factor of 7 and 4627. 7 Calculate the greatest common divisor of 234 and 546. 78 What is the highest common factor of 6 and 74? 2 Calculate the greatest common divisor of 44 and 1460. 4 What is the greatest common divisor of 22 and 2486? 22 What is the highest common factor of 133 and 2489? 19 Calculate the highest common factor of 20 and 388. 4 Calculate the highest common divisor of 220 and 99. 11 Calculate the highest common factor of 760 and 1160. 40 Calculate the highest common factor of 222 and 54. 6 What is the greatest common factor of 560 and 20? 20 What is the greatest common factor of 3 and 96? 3 Calculate the highest common factor of 770 and 42. 14 Calculate the highest common divisor of 553 and 7. 7 Calculate the highest common divisor of 28 and 8. 4 Calculate the greatest common divisor of 938 and 536. 134 What is the highest common divisor of 36 and 348? 12 Calculate the highest common factor of 86 and 301. 43 What is the greatest common divisor of 798 and 912? 114 What is the highest common divisor of 46 and 920? 46 Calculate the highest common divisor of 5 and 23. 1 What is the greatest common divisor of 346 and 14013? 173 What is the highest common divisor of 13 and 191? 1 What is the greatest common divisor of 24 and 3? 3 What is the greatest common factor of 250 and 35? 5 Calculate the greatest common factor of 22 and 12760. 22 What is the greatest common factor of 21 and 12341? 7 Calculate the highest common divisor of 29 and 783. 29 What is the highest common factor of 6496 and 1568? 224 What is the highest common factor of 110 and 430? 10 Calculate the greatest common divisor of 236 and 4. 4 Calculate the highest common divisor of 290 and 58. 58 What is the greatest common divisor of 14 and 5726? 14 Calculate the highest common factor of 3 and 277. 1 Calculate the greatest common divisor of 93 and 372. 93 Calculate the highest common divisor of 11750 and 30. 10 Calculate the highest common factor of 48 and 3408. 48 Calculate the greatest common factor of 57 and 2907. 57 What is the highest common factor of 174 and 3? 3 What is the highest common divisor of 42 and 15? 3 Calculate the greatest common divisor of 82 and 1312. 82 Calculate the highest common factor of 1628 and 66. 22 Calculate the highest common divisor of 48 and 138. 6 Calculate the greatest common divisor of 279 and 1125. 9 What is the greatest common factor of 215 and 989? 43 Calculate the greatest common factor of 4 and 996. 4 What is the greatest common divisor of 424 and 318? 106 What is the highest common divisor of 1092 and 168? 84 What is the highest common divisor of 36 and 27? 9 What is the highest common divisor of 56 and 128? 8 Calculate the highest common divisor of 764 and 20. 4 Calculate the greatest common divisor of 276 and 92. 92 What is the highest common factor of 1395 and 15? 15 Calculate the highest common divisor of 1250 and 1. 1 What is the highest common factor of 1482 and 52? 26 Calculate the greatest common divisor of 1058 and 506. 46 Calculate the greatest common divisor of 99 and 418. 11 Calculate the greatest common factor of 560 and 336. 112 Calculate the highest common factor of 114 and 8512. 38 Calculate the greatest common divisor of 1236 and 48. 12 Calculate the greatest common factor of 68 and 646. 34 Calculate the greatest common divisor of 42 and 1554. 42 Calculate the highest common divisor of 8 and 776. 8 Calculate the highest common divisor of 14 and 280. 14 Calculate the greatest common factor of 18 and 32. 2 Calculate the highest common factor of 2108 and 272. 68 What is the highest common divisor of 20 and 12230? 10 What is the highest common factor of 1147 and 851? 37 Calculate the greatest common divisor of 29 and 202. 1 Calculate the greatest common divisor of 47 and 2491. 47 What is the greatest common factor of 65 and 377? 13 Calculate the highest common divisor of 396 and 2868. 12 Calculate the highest common factor of 4176 and 87. 87 Calculate the greatest common divisor of 18882 and 18. 18 What is the highest common divisor of 2405 and 26? 13 What is the highest common factor of 26 and 91? 13 What is the highest common factor of 12 and 222? 6 What is the greatest common factor of 2373 and 168? 21 What is the highest common divisor of 688 and 1333? 43 What is the greatest common divisor of 63 and 49? 7 What is the highest common factor of 60 and 29370? 30 Calculate the greatest common factor of 300 and 4950. 150 What is the highest common factor of 208 and 12? 4 What is the greatest common factor of 479 and 20? 1 What is the highest common factor of 36 and 306? 18 What is the greatest common divisor of 123 and 28659? 123 Calculate the greatest common factor of 12 and 10236. 12 Calculate the highest common factor of 2209 and 47. 47 What is the greatest common divisor of 140 and 310? 10 What is the greatest common factor of 5 and 395? 5 Calculate the greatest common factor of 16 and 1744. 16 Calculate the greatest common factor of 1267 and 7. 7 What is the highest common divisor of 24 and 456? 24 What is the highest common divisor of 1406 and 114? 38 Calculate the highest common divisor of 247 and 209. 19 What is the highest common divisor of 1591 and 74? 37 Calculate the highest common factor of 1323 and 27. 27 Calculate the highest common divisor of 132 and 18084. 132 What is the greatest common divisor of 19 and 551? 19 What is the highest common divisor of 2407 and 83? 83 Calculate the highest common factor of 763 and 7. 7 What is the highest common factor of 35322 and 63? 21 What is the greatest common factor of 8550 and 270? 90 What is the greatest common divisor of 6105 and 45? 15 Calculate the highest common factor of 5 and 835. 5 What is the greatest common divisor of 12883 and 13? 13 What is the highest common factor of 22 and 5324? 22 Calculate the greatest common divisor of 55 and 5. 5 What is the greatest common divisor of 261 and 3683? 29 What is the highest common factor of 270 and 35? 5 Calculate the greatest common factor of 11275 and 82. 41 Calculate the greatest common factor of 70 and 70. 70 What is the greatest common factor of 237 and 79? 79 What is the greatest common factor of 23 and 368? 23 Calculate the highest common divisor of 852 and 12. 12 Calculate the greatest common factor of 475 and 25. 25 What is the greatest common factor of 923 and 13? 13 Calculate the highest common factor of 455 and 1855. 35 Calculate the greatest common factor of 1110 and 60. 30 Calculate the highest common divisor of 143 and 187. 11 Calculate the highest common factor of 299 and 637. 13 What is the highest common divisor of 9 and 219? 3 Calculate the greatest common factor of 7387 and 83. 83 Calculate the greatest common divisor of 927 and 824. 103 Calculate the greatest common divisor of 63 and 14. 7 What is the highest common factor of 32 and 968? 8 What is the highest common divisor of 64 and 928? 32 Calculate the greatest common divisor of 41402 and 489. 163 Calculate the highest common divisor of 15 and 15. 15 What is the greatest common factor of 58 and 3741? 29 Calculate the highest common factor of 4 and 26. 2 What is the highest common factor of 16686 and 162? 162 What is the greatest common divisor of 5 and 155? 5 Calculate the greatest common factor of 9 and 45. 9 Calculate the greatest common factor of 183 and 15. 3 Calculate the highest common factor of 7655 and 5. 5 Calculate the greatest common divisor of 13 and 1287. 13 What is the highest common factor of 20 and 100? 20 What is the greatest common divisor of 2 and 10? 2 What is the greatest common divisor of 1479 and 34? 17 What is the greatest common factor of 1521 and 234? 117 Calculate the greatest common factor of 28542 and 201. 201 What is the greatest common divisor of 36 and 153? 9 Calculate the greatest common divisor of 250 and 30. 10 Calculate the greatest common divisor of 416 and 160. 32 Calculate the highest common divisor of 24 and 984. 24 Calculate the highest common divisor of 520 and 390. 130 Calculate the highest common factor of 13440 and 210. 210 What is the highest common divisor of 10 and 810? 10 What is the greatest common factor of 40 and 3320? 40 Calculate the greatest common divisor of 392 and 8. 8	{ "pile_set_name": "DM Mathematics" }
git of v(-5)? 4 Let o(y) = 2y2 - 8y - 7. What is the tens digit of o(9)? 8 Suppose 0 = g - 3s - 69, s = g - 4s - 73. What is the units digit of g? 3 Let l(x) = -5x3 + 2x2 - 1. Let a = -3 - -2. What is the units digit of l(a)? 6 Let q = -1123 - -343. Let v(b) = b3 - b*2 + b - 11. Let t be v(0). What is the units digit of q/(-55) + 2/t? 4 Suppose 10a = 5a + 25. Let r(q) = -q + 10. Let n be r(a). Suppose -21 = 2g - ng. What is the units digit of g? 7 Suppose -3s - 21 = 2a, a + 5s + 21 = -0s. Let f be (-6 - 1)/(-5 - a). Let h = 20 + f. What is the units digit of h? 3 Suppose 1342 = 7o - 93. What is the units digit of o? 5 Let p be 18/4(-2)/(-3). Suppose -2v + p = -13. What is the units digit of v? 8 Let p(h) = -5h - h + h2 + h - 11. Let u = 34 - 26. What is the tens digit of p(u)? 1 Let i = -3 + 3. Suppose 3j - 33 - 15 = i. What is the units digit of j? 6 Let y be (2/(-3))/((-4)/30). Suppose -2j + 5 + y = 0. What is the units digit of j? 5 Suppose -12 - 8 = -5l. Suppose lx - 15 = x. What is the units digit of x? 5 Let k(g) = 5g*3 + 23g*2 - 27g + 4. Let d(w) = -w*3 - 6w*2 + 7w - 1. Let r(j) = 9d(j) + 2k(j). What is the units digit of r(7)? 3 Suppose 0 = -4s + 310 + 218. What is the hundreds digit of s? 1 Suppose -2v + 20 = 3v. Let n(z) = -2z + 4. Let o be n(v). Let g = 0 - o. What is the units digit of g? 4 Suppose -4r + 6r - 4m = 388, 615 = 3r + 5m. What is the hundreds digit of r? 2 Let n = 307 - 201. What is the tens digit of n? 0 Let k(s) = s3 + 5s*2 - s - 3. Let n be k(-5). Let v(c) = 2c*2 - 2. Let u be v(n). Let m = u + -2. What is the units digit of m? 4 Suppose 3r - 8r + 28 = f, -35 = -5f - 4r. Let c be (0 - (-6)/(-3)) + f. Suppose 3m - c - 5 = 0. What is the units digit of m? 2 Let q(r) = 5r - 3 + r2 + 5 + 7. What is the units digit of q(-8)? 3 Let r(u) = -7u + 1. Let j be r(-6). Suppose j = 3g - 5s, 11 + 22 = 3g - 3s. Let o = g + -2. What is the units digit of o? 4 Suppose 0 = -0v - 2v + 22. Let p be (-15)/1024/4. Let x = p + v. What is the units digit of x? 2 Suppose -2c + 17 = -w, -1 = 3c - 2w - 28. What is the units digit of c? 7 Suppose 5l - 210 - 70 = 0. Let y = l + -5. What is the tens digit of y? 5 Let u = -2 + 8. Suppose ud - 100 = d. What is the units digit of d? 0 Let f(k) = 2 + 10k - 1 - 1 + 1. What is the tens digit of f(3)? 3 Let u(o) = -10o - 1. What is the units digit of u(-1)? 9 Let g(a) = a*3 - 6a*2 + 7a - 3. Suppose 0 - 1 = y. Let z be ((-4)/(-4))/(y/(-5)). What is the units digit of g(z)? 7 Let p(n) = -10n - 56. What is the tens digit of p(-10)? 4 Let y = -11 + -3. What is the tens digit of 2/3-3 - y? 1 Let g be (8/3)/((-6)/(-9)). Suppose 0 = 2f + 4k - 18 - 22, 3f - gk - 40 = 0. What is the units digit of f? 6 Let m = -323 - -590. What is the tens digit of m? 6 Let q = 16 - 10. Suppose -15 = 3t - 6. What is the units digit of 45((-16)/q - t)? 5 Let f(u) = 4u2 + 1. Let j be f(1). Suppose jw - 2 = 63. What is the units digit of w? 3 Let c(i) = -i*2 - 6i - 3. Let j be c(-3). Let z = j - -11. What is the tens digit of z? 1 Let c(a) = a*3 - 7a*2 - 4a + 3. Let p be c(8). Let q = -23 + p. What is the tens digit of q? 1 Let a(s) = -s*2 - 4s + 5. Let d be a(-4). Suppose -x = -dj - 14 + 49, 5x = 0. What is the units digit of j? 7 Let q = 405 + -284. What is the hundreds digit of q? 1 Let p(f) be the first derivative of f*4/4 + 8f3/3 - f2/2 - 6f - 3. Let y(m) = m2 + 8m + 7. Let q be y(-5). What is the units digit of p(q)? 2 Let d(m) = -3m + 1. Suppose -4j - a = 31, j + a - 6a - 8 = 0. What is the units digit of d(j)? 2 Let u be (3 + -8 + 2)-1. Suppose -11 = -3m - b, -ub = -8m + 3m - 5. What is the units digit of m? 2 Let l(d) = -7d3 + 3d*2 + 9d - 13. Let q(s) = 13s3 - 6s*2 - 17s + 25. Let r(y) = 11l(y) + 6q(y). What is the tens digit of r(5)? 4 Let w(d) = 2d - 1. Suppose -5 - 2 = -m + g, -4m + 2g + 20 = 0. Let x = -1 + m. What is the units digit of w(x)? 3 Suppose 3l + 2r + 3r = 27, 3l - 18 = -2r. Suppose 0 = -2h + l + 2. What is the units digit of h? 3 Suppose -2u - 3u + 15 = 0. Let c(x) = 2x - 2 + 0x + 4 + ux*2 - 3x. What is the units digit of c(-2)? 6 Suppose -4a - 2j + 742 = 0, 2j - 381 = -2a - j. What is the units digit of a? 3 Suppose -4v + 46 = s, -3v + v = -4. What is the units digit of s? 8 Let b(l) = -l*2 + 7l + 10. What is the units digit of b(7)? 0 Let x(u) = 5u2 - 4u*3 + 5u*3 + 15u - 5u2 + 18u*2 + 11. What is the tens digit of x(-17)? 4 Let m(h) = -2h - 1. Let u be m(-7). Let x = 21 - u. Let r = x - 4. What is the units digit of r? 4 Suppose 4z = -18 - 22. Let u = z + 40. What is the units digit of u? 0 Suppose -4o + 256 = 4u, 0 = -3o + 3u - 128 + 314. What is the tens digit of o? 6 Suppose 4z - 4o = -11 - 1, -2z = 5o + 13. Suppose 0 = 5k - 0k + 30. Let n = z - k. What is the units digit of n? 2 Suppose -22w + 21w = -16. What is the tens digit of w? 1 Suppose -3f - o = 2f - 19, 3o + 7 = f. What is the units digit of f? 4 Let f(u) = -u*2 - u + 2. Let b be f(-2). Let m = b + 1. What is the units digit of 7 + m + 0/(-2)? 8 Let t = 68 + -33. Let z be 655/t - (-4)/14. Let p = z - 13. What is the units digit of p? 6 Let w be ((-3)/2)/(1/(-2)). Suppose 3o + 15 = -wm, -o - 4m = 11 + 9. Suppose oq = -5q + 25. What is the units digit of q? 5 Let n = -167 - -290. What is the tens digit of n? 2 Suppose 3h - 7h = -336. What is the units digit of h? 4 Let u be 1 + 12/(-15)-5. Suppose 3l = 4l + 11. Let v = u - l. What is the units digit of v? 6 What is the hundreds digit of 42/4(-3 - -17)? 1 Let r(v) = 3v3 - 7v*2 + 5v + 7. What is the units digit of r(4)? 7 Suppose 4s - 95 = 3s + 4v, 0 = s - 5v - 94. What is the units digit of s? 9 Let a(x) = 46x2 - x. What is the units digit of a(1)? 5 Let u = -2 - -5. Let a(g) = 2g - 4. Let p be a(u). What is the tens digit of ((-85)/10)/((-1)/p)? 1 Let a = 8 - 6. Suppose 2z - 16 = -3o, -6 = -5o + 3z + 46. Suppose j + o = aj. What is the units digit of j? 8 Suppose -3j + 20 = -q, -j - 17 + 2 = 4q. Suppose -jy + 2 = -3. What is the units digit of y? 1 Let l be ((-12)/(-16))/(6/16). Suppose -46 = -4i + li. What is the tens digit of i? 2 Let b(s) = s*2 - 6s + 1. Let w be b(6). What is the units digit of ((-1)/w)/(6/(-72))? 2 Suppose 0 = c + 5p - 38, -30 = -8c + 7c - p. What is the units digit of c? 8 Let n(x) = -4x - 13. Let c = -7 + 0. What is the units digit of n(c)? 5 Let a = 17 + -12. Suppose -g - 1 = 3u - u, 21 = ag - 3u. Suppose 2k = 5k - g. What is the units digit of k? 1 Suppose 0 = 2l + 4q - 16, 0q - 21 = -3l - 3q. Let g(z) = -z*3 + 7z*2 - 4z - 7. What is the units digit of g(l)? 5 Let n be (-4)/(-10) + (-128)/20. Suppose -6 = m - 2x, -5m - x - 45 = 4x. What is the units digit of n(2 + m/3)? 4 Suppose -3q + 136 = g, -2q - 3q = -g - 232. What is the units digit of q? 6 Suppose -2a + 90 = z, -3z + 75 = 3a - 207. Suppose 13 = -5p + z. What is the units digit of p? 7 Let a(z) = z3 - 11z*2 + 10z - 1. Let d be a(10). Let m be (1/1)/(2/(-6)). What is the units digit of -13(2 - m/d)? 3 What is the tens digit of ((-1)/(-3))/((-4)/(-540))? 4 Let b(x) = x3 - 8x*2 + 11x - 5. Let o be b(7). Suppose -17 = -4j + o. What is the tens digit of j? 1 Let b(c) = 23c*2 + 6c - 6. What is the hundreds digit of b(-3)? 1 Let v = -29 - -62. What is the units digit of v? 3 Let j(u) = -u*2 + 19u - 5. What is the tens digit of j(15)? 5 Let s(d) = -6d2 - 9d + 19. Let q(a) = a*2 + 2a - 4. Let y(f) = -11q(f) - 2s(f). Suppose 20 = 6k - k. What is the units digit of y(k)? 6 What is the units digit of (-24)/6 - (-12 - -1)? 7 Suppose -2 = -u - 8. Let q(g) = -g2 - 6g + 1. What is the units digit of q(u)? 1 Let f(i) = -i*3 - 5i*2 + 2i - 7. Suppose 2m = -6 - 6. What is the tens digit of f(m)? 1 Suppose -2c = -0c. Let y(m) = 3 - 1 + 5m - 4m. What is the units digit of y(c)? 2 Suppose -2c = -0c + 20. Let k be 4 - 5 - (17 + 1). Let h = c - k. What is the units digit of h? 9 Let d = 8 + -4. Suppose -dt - 5 = -5k + 51, k = 5t + 7. What is the tens digit of k? 1 Suppose 3*t = t + 4. What is the units digit of t? 2 Let f be 1 + 1 - -2	{ "pile_set_name": "DM Mathematics" }
replacement from acacffcccapgcccca. 9/68 Three letters picked without replacement from {b: 2, h: 11}. Give prob of picking 1 b and 2 h. 5/13 Two letters picked without replacement from {s: 1, r: 1, m: 14}. What is prob of picking 2 m? 91/120 Four letters picked without replacement from rriiizrr. Give prob of picking 1 i and 3 r. 6/35 Two letters picked without replacement from {y: 3, f: 7}. What is prob of picking 2 f? 7/15 What is prob of picking 3 z when three letters picked without replacement from qbbzzzzzwzzbzzzwwbw? 40/323 Three letters picked without replacement from fzffftzp. What is prob of picking 1 t and 2 z? 1/56 What is prob of picking 1 t and 2 g when three letters picked without replacement from gggtggggggggt? 5/13 Three letters picked without replacement from {r: 2, b: 2}. Give prob of picking 1 b and 2 r. 1/2 Two letters picked without replacement from ozcoccocczcco. What is prob of picking 1 z and 1 c? 7/39 Two letters picked without replacement from iittttccttii. Give prob of picking 2 i. 1/11 What is prob of picking 1 c and 2 d when three letters picked without replacement from ddccd? 3/5 Two letters picked without replacement from kvvvkkfkkkkkkkkkfvkv. What is prob of picking 2 k? 39/95 Two letters picked without replacement from {c: 6, l: 2, m: 2, d: 3, t: 3}. Give prob of picking 1 l and 1 t. 1/20 What is prob of picking 1 e and 1 c when two letters picked without replacement from ceiry? 1/10 Calculate prob of picking 1 e and 1 a when two letters picked without replacement from eaee. 1/2 What is prob of picking 3 o when three letters picked without replacement from oooub? 1/10 Three letters picked without replacement from kmkumuukugggkmgu. What is prob of picking 2 m and 1 u? 3/112 Calculate prob of picking 1 x, 1 e, and 1 i when three letters picked without replacement from {i: 1, x: 3, k: 1, e: 3, b: 2}. 3/40 Three letters picked without replacement from lalal. What is prob of picking 2 l and 1 a? 3/5 What is prob of picking 1 l and 1 f when two letters picked without replacement from {l: 1, f: 7, a: 6}? 1/13 Three letters picked without replacement from kemcctdt. What is prob of picking 1 e and 2 c? 1/56 Calculate prob of picking 3 g when three letters picked without replacement from {k: 1, g: 6, s: 8}. 4/91 Four letters picked without replacement from ddsszczshds. What is prob of picking 1 c and 3 d? 1/330 Calculate prob of picking 2 n when two letters picked without replacement from wwnvnjmwvhmmwm. 1/91 Two letters picked without replacement from {o: 2, k: 5}. What is prob of picking 2 o? 1/21 Three letters picked without replacement from {s: 1, o: 10, m: 4, n: 2}. What is prob of picking 2 o and 1 n? 9/68 Two letters picked without replacement from {n: 1, m: 1, h: 1, t: 1, o: 1}. What is prob of picking 1 t and 1 n? 1/10 Calculate prob of picking 1 k and 2 u when three letters picked without replacement from skukkuu. 9/35 Two letters picked without replacement from {s: 2, a: 10, z: 4}. Give prob of picking 2 z. 1/20 What is prob of picking 1 h and 1 z when two letters picked without replacement from uugguuzuuuwghwgg? 1/120 Two letters picked without replacement from xxxsessxssses. What is prob of picking 1 s and 1 x? 14/39 Calculate prob of picking 2 n when two letters picked without replacement from {n: 5, p: 2}. 10/21 Calculate prob of picking 2 p and 2 t when four letters picked without replacement from ptttp. 3/5 Three letters picked without replacement from qqqqqqqqq. What is prob of picking 3 q? 1 Four letters picked without replacement from {w: 1, m: 1, y: 1, l: 1, r: 3}. Give prob of picking 2 r, 1 w, and 1 l. 3/35 What is prob of picking 1 g and 1 n when two letters picked without replacement from {g: 2, e: 2, n: 6, m: 9}? 4/57 Four letters picked without replacement from {u: 1, r: 2, b: 4, o: 4}. Give prob of picking 3 o and 1 r. 4/165 What is prob of picking 3 a when three letters picked without replacement from {r: 11, a: 9}? 7/95 What is prob of picking 1 f and 3 y when four letters picked without replacement from {y: 10, f: 9}? 90/323 Calculate prob of picking 1 c and 2 o when three letters picked without replacement from ccocooucoccocococcc. 77/323 What is prob of picking 1 x and 1 d when two letters picked without replacement from {f: 1, x: 1, m: 1, h: 3, d: 1}? 1/21 Three letters picked without replacement from huuuihihiihuui. What is prob of picking 3 h? 1/91 Two letters picked without replacement from awararawrrdwadrawa. Give prob of picking 2 d. 1/153 Calculate prob of picking 2 m, 1 y, and 1 c when four letters picked without replacement from ycymm. 2/5 Four letters picked without replacement from nwwgngwggnwgnn. What is prob of picking 1 w and 3 g? 40/1001 Calculate prob of picking 1 i, 1 j, 1 l, and 1 q when four letters picked without replacement from {l: 2, j: 9, q: 3, i: 2, u: 3}. 9/323 What is prob of picking 1 s, 1 i, and 1 o when three letters picked without replacement from {i: 1, g: 4, s: 3, o: 3}? 3/55 Two letters picked without replacement from {u: 2, v: 6, q: 1, n: 2, t: 3}. Give prob of picking 2 q. 0 Four letters picked without replacement from cwqcwdcqwcqwqqcccd. Give prob of picking 2 q and 2 c. 7/102 Two letters picked without replacement from {u: 2, m: 1, k: 2, f: 1, l: 2}. What is prob of picking 1 u and 1 l? 1/7 Calculate prob of picking 1 r and 2 d when three letters picked without replacement from {g: 5, x: 1, r: 4, d: 3, q: 5}. 1/68 Calculate prob of picking 1 i and 1 v when two letters picked without replacement from {c: 2, i: 8, v: 9}. 8/19 What is prob of picking 1 d, 1 g, and 1 k when three letters picked without replacement from kdlgdvgq? 1/14 What is prob of picking 2 g, 1 q, and 1 z when four letters picked without replacement from lzzpzzqzzgqlpgzqlp? 7/1020 What is prob of picking 4 a when four letters picked without replacement from {a: 4}? 1 What is prob of picking 1 d, 1 j, and 1 i when three letters picked without replacement from qjmidllmmjqlmd? 1/91 What is prob of picking 2 o and 1 m when three letters picked without replacement from {o: 2, m: 17}? 1/57 What is prob of picking 2 l when two letters picked without replacement from {l: 9, i: 2}? 36/55 Two letters picked without replacement from ccwufwyflfculf. What is prob of picking 1 y and 1 u? 2/91 Calculate prob of picking 1 a and 3 i when four letters picked without replacement from {a: 4, i: 7}. 14/33 Three letters picked without replacement from owgns. Give prob of picking 1 n, 1 o, and 1 w. 1/10 Two letters picked without replacement from {q: 2, b: 4, u: 4}. Give prob of picking 1 b and 1 u. 16/45 Four letters picked without replacement from ggpgkgssgkjpjgsp. What is prob of picking 2 k and 2 s? 3/1820 Calculate prob of picking 1 f and 1 m when two letters picked without replacement from {t: 1, m: 5, n: 2, f: 2, b: 4}. 10/91 Three letters picked without replacement from {r: 7}. Give prob of picking 3 r. 1 Three letters picked without replacement from {g: 4, w: 10}. What is prob of picking 2 g and 1 w? 15/91 What is prob of picking 1 a and 2 m when three letters picked without replacement from {c: 2, a: 4, m: 8}? 4/13 Three letters picked without replacement from {d: 6, c: 6}. Give prob of picking 3 d. 1/11 What is prob of picking 1 v and 1 x when two letters picked without replacement from {u: 1, i: 5, v: 1, x: 2, r: 3, h: 1}? 1/39 Three letters picked without replacement from jbnjnw. What is prob of picking 2 w and 1 n? 0 Two letters picked without replacement from oeeeenhwonheeeohh. Give prob of picking 1 o and 1 h. 3/34 Two letters picked without replacement from jhsjjsshsssssggs. What is prob of picking 1 j and 1 s? 9/40 What is prob of picking 1 l, 1 r, and 1 v when three letters picked without replacement from {r: 1, n: 3, j: 1, l: 6, w: 3, v: 4}? 1/34 Two letters picked without replacement from {c: 1, l: 1, g: 9, y: 1, p: 4, k: 1}. Give prob of picking 1 p and 1 l. 1/34 Calculate prob of picking 4 p when four letters picked without replacement from ppppp. 1 What is prob of picking 2 b when two letters picked without replacement from qbbq? 1/6 Calculate prob of picking 1 q and 2 a when three letters picked without replacement from pupakapaqpap. 3/110 Four letters picked without replacement	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.