Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
3 Sort 0, -2, -239, 252, -3, 1 in ascending order. -239, -3, -2, 0, 1, 252 Sort 391473, 4, 5 in increasing order. 4, 5, 391473 Sort -4, -11, 0.8, 1, -5.7 in decreasing order. 1, 0.8, -4, -5.7, -11 Sort 92, 3, 1374, 27 in ascending order. 3, 27, 92, 1374 Put 4, -8, -548, 0, -5, 140 in decreasing order. 140, 4, 0, -5, -8, -548 Sort 5, 41, 7641, 0.3, 0.4, -4 in descending order. 7641, 41, 5, 0.4, 0.3, -4 Put 18, -24, 13, 0, 4, -1/4 in increasing order. -24, -1/4, 0, 4, 13, 18 Sort -1/2, 11, -7, 0.2, 2/9, -0.4. -7, -1/2, -0.4, 0.2, 2/9, 11 Put -105, 22, -1, 24 in decreasing order. 24, 22, -1, -105 Put -2, 3406, 2, 6, -9, 3, 1 in descending order. 3406, 6, 3, 2, 1, -2, -9 Sort 13/16, -2/335, -13/4, 0 in ascending order. -13/4, -2/335, 0, 13/16 Sort 0.8, 0, 10, -6626, -3, 5 in ascending order. -6626, -3, 0, 0.8, 5, 10 Sort -2, -22, 8, 21, -1, -32, -4 in ascending order. -32, -22, -4, -2, -1, 8, 21 Put 3, -3, 1, -21, 214, 26 in decreasing order. 214, 26, 3, 1, -3, -21 Put -3, -8, 2, 0, 106, 1, 20 in increasing order. -8, -3, 0, 1, 2, 20, 106 Put 1026047, 8, 5 in increasing order. 5, 8, 1026047 Sort 77, 7, -16, -4, 4 in decreasing order. 77, 7, 4, -4, -16 Put -246, 1, -19, -5, 3, 8 in decreasing order. 8, 3, 1, -5, -19, -246 Put 4, 1122, -18828 in increasing order. -18828, 4, 1122 Put 1/2, -0.2, -2/13, -587, 1573 in descending order. 1573, 1/2, -2/13, -0.2, -587 Sort -67/6, 8.526, 0.3 in descending order. 8.526, 0.3, -67/6 Sort 0.2, 5/3, -5, -41, -5/7, 2/7. -41, -5, -5/7, 0.2, 2/7, 5/3 Sort -126, -9, -63, -11, -1, 2 in decreasing order. 2, -1, -9, -11, -63, -126 Put 0, -3/7, -0.1223621 in ascending order. -3/7, -0.1223621, 0 Put -129058, 496, 2 in increasing order. -129058, 2, 496 Put 0.05, -10.14, 2/3, -47/2, -3/7 in decreasing order. 2/3, 0.05, -3/7, -10.14, -47/2 Put -1034763, 0.4, -7, 5, 2/13 in increasing order. -1034763, -7, 2/13, 0.4, 5 Put 3/5, 19, -7/512 in descending order. 19, 3/5, -7/512 Put -4, -117, 3, -45, 75, -3 in descending order. 75, 3, -3, -4, -45, -117 Put 1175, 4, 28927 in decreasing order. 28927, 1175, 4 Sort -5, 1, -47, 22, -10, 0 in increasing order. -47, -10, -5, 0, 1, 22 Sort 1, 0, 2, -2, -1, 9, 220. -2, -1, 0, 1, 2, 9, 220 Put -5655, 1706, -3/32, 0 in descending order. 1706, 0, -3/32, -5655 Sort -1267453, -1, 86. -1267453, -1, 86 Put -0.4, -9, 1/22, -5/2, 5, 275.2 in descending order. 275.2, 5, 1/22, -0.4, -5/2, -9 Sort -1165, 15, 5, 10, -3 in descending order. 15, 10, 5, -3, -1165 Put -3/2773, -0.836, 2/3 in decreasing order. 2/3, -3/2773, -0.836 Sort -0.4, -5, -77268, -0.2, -3 in decreasing order. -0.2, -0.4, -3, -5, -77268 Sort -88, 2, 1, 0, 2423, -6 in increasing order. -88, -6, 0, 1, 2, 2423 Sort 1006.2, 2, -1.686 in ascending order. -1.686, 2, 1006.2 Put -5, 1, -8773, -4, 26, -2 in decreasing order. 26, 1, -2, -4, -5, -8773 Sort -2, -1, -462, 4, -6, 3, -8 in increasing order. -462, -8, -6, -2, -1, 3, 4 Put -202, -4, 7952 in decreasing order. 7952, -4, -202 Sort 1/7, -4190140, -2. -4190140, -2, 1/7 Put 81, 21, 3/2, 3, 5 in ascending order. 3/2, 3, 5, 21, 81 Put -12, -2, 83, 4, -5, -1, 38 in descending order. 83, 38, 4, -1, -2, -5, -12 Put 1, -2, 95209 in ascending order. -2, 1, 95209 Put -0.1, 0.06, 688, -71 in decreasing order. 688, 0.06, -0.1, -71 Sort -3, -65, -1, -4, -5, -89, 5 in descending order. 5, -1, -3, -4, -5, -65, -89 Put 7, -469, -3, -107, 3 in ascending order. -469, -107, -3, 3, 7 Put 5, -18, -4, 65785 in descending order. 65785, 5, -4, -18 Put 0, -34, 128, -1, -45, 6 in decreasing order. 128, 6, 0, -1, -34, -45 Sort -4, 102, 2, 999 in increasing order. -4, 2, 102, 999 Put -36, -1, -5, 0, -4, 1, 43 in ascending order. -36, -5, -4, -1, 0, 1, 43 Sort 1/2, -0.3, 1072, 5/8, -0.4 in decreasing order. 1072, 5/8, 1/2, -0.3, -0.4 Sort 2/5, 120, -6.86, -2, 1/4 in descending order. 120, 2/5, 1/4, -2, -6.86 Put 6558, 0.4, 129 in ascending order. 0.4, 129, 6558 Sort -13, 691, -89, 1, 5, -1. -89, -13, -1, 1, 5, 691 Put 1, -114710, -8 in ascending order. -114710, -8, 1 Put 3, 14, 11.796 in decreasing order. 14, 11.796, 3 Put 5/4, -1, -5.9, 5, -7288, 0.5 in ascending order. -7288, -5.9, -1, 0.5, 5/4, 5 Sort 1, 5, -1, 389, -49, 3 in descending order. 389, 5, 3, 1, -1, -49 Sort -30, -9, -41, 1307 in descending order. 1307, -9, -30, -41 Put 3, -496591, 9, -11 in decreasing order. 9, 3, -11, -496591 Sort 113, -12, 6, 9, -19, 4 in decreasing order. 113, 9, 6, 4, -12, -19 Put -2, 3, -60, 10, 1599 in ascending order. -60, -2, 3, 10, 1599 Put -0.3, -1, 18, 5, 32/3, -4 in ascending order. -4, -1, -0.3, 5, 32/3, 18 Put -1/2, 1457, 5/4, 40, 6 in descending order. 1457, 40, 6, 5/4, -1/2 Put -2, 7, -5, -316, 0, -4, 34 in increasing order. -316, -5, -4, -2, 0, 7, 34 Sort 382, -509, 1, 14 in ascending order. -509, 1, 14, 382 Sort 33, -2, -3, -47, 4, -7, -11 in increasing order. -47, -11, -7, -3, -2, 4, 33 Sort -3, -1, 1, 450926, 3, 4 in decreasing order. 450926, 4, 3, 1, -1, -3 Sort -3/5, 729, 0.5, -32, -2, 0 in increasing order. -32, -2, -3/5, 0, 0.5, 729 Put -4, -2, -121, 4, -4789, 3 in decreasing order. 4, 3, -2, -4, -121, -4789 Sort -7301, 0.1, -67 in descending order. 0.1, -67, -7301 Put -5, 4/3, 3, -42, 0.63 in descending order. 3, 4/3, 0.63, -5, -42 Put -3, 7/12855, -180 in decreasing order. 7/12855, -3, -180 Sort -2, 5, -7, -145, 172, 1, -4 in increasing order. -145, -7, -4, -2, 1, 5, 172 Sort 4, -5, 3237, 57277. -5, 4, 3237, 57277 Put 294, -2, -4, 41, -5, 5, 1 in descending order. 294, 41, 5, 1, -2, -4, -5 Sort -5, 0, -3, 71, -9831, -8 in ascending order. -9831, -8, -5, -3, 0, 71 Sort 0, -18, -2830602. -2830602, -18, 0 Put 5/4, -0.141, 17, 1/7, -4, 0.2 in decreasing order. 17, 5/4, 0.2, 1/7, -0.141, -4 Sort -1, -33, -45, 8, 417 in increasing order. -45, -33, -1, 8, 417 Put -4, 416895, -38 in ascending order. -38, -4, 416895 Sort 2, -16, 14, -1, -2, 95 in descending order. 95, 14, 2, -1, -2, -16 Put -1, 57, -4, 1, -8, -15 in ascending order. -15, -8, -4, -1, 1, 57 Sort 0, 78, -626, 102 in descending order. 102, 78, 0, -626 Put -3, 41, 23, -2, 3, 10, -11 in descending order. 41, 23, 10, 3, -2, -3, -11 Sort -145075, 2, 129. -145075, 2, 129 Put -3, 2, 648, -286, -11, -5 in increasing order. -286, -11, -5, -3, 2, 648 Sort -0.2, 2/11, 482/67, 11 in decreasing order. 11, 482/67, 2/11, -0.2 Sort 59220, -12, 3, -18, 5. -18, -12, 3, 5, 59220 Put -644, -19, 31 in decreasing order. 31, -19, -644 Sort 5, -32, 1, 195, 2, -1, 0 in ascending order. -32, -1, 0, 1, 2, 5, 195 Sort 1/6, -10348, 2/7, -3/4, -1/9 in descending order. 2/7, 1/6, -1/9, -3/4, -10348 Sort -3, 2408, -5, -7, 4, 5 in ascending order. -7, -5, -3, 4, 5, 2408 Sort 99, -480, 7, -15 in decreasing order. 99, 7, -15, -480 Put -4, -47, 11, -68 in descending order. 11, -4, -47, -68 Sort -5, 0.63, 0.02, -4, 528 in descending order. 528, 0.63, 0.02, -4, -5 Put 63, -18218, 5, -4, 8, -1, 3 in increasing order. -18218, -4, -1, 3, 5, 8, 63 Sort -1952, 6, -74 in ascending order. -1952, -74, 6 Put -10/11, 1/7, 1950.63 in increasing order. -10/11, 1/7, 1950.63 Sort 46438, 3, 6, -20, -5. -20, -5, 3, 6, 46438 Put -2, 80, 31, 2, 261, -7 in increasing order. -7, -2, 2, 31, 80, 261 Sort -4, -609, -7, -2, 3, -434. -609, -434, -7, -4, -2, 3 Sort 276, -1, 3, 165, -43, 2. -43, -1, 2, 3, 165, 276 Put 16, 9, -1, 4, -21, -73 in descending order. 16, 9, 4, -1, -21, -73 Sort -10, -1, -6, 2, -4 in increasing order. -10, -6, -4, -1, 2 Sort 5516, 1/47411, -2/3 in increasing order. -2/3, 1/47411, 5516 Sort -4, -0.5, 1/4, 0.4, -0.19, 19 in descending order. 19, 0.4, 1/4, -0.19, -0.5, -4 Sort -1/4, -363, -2/8005 in ascending order. -363, -1/4, -2/8005 Put 2, -2, -28, 3409, -4, 0 in descending order. 3409, 2, 0, -2, -4, -28 Sort 5, 14, 4, -3514, 1, 0 in ascending order. -3514, 0, 1, 4, 5, 14 Put -57, -3, -5, 388, -147 in decreasing order. 388, -3, -5, -57, -147 Sort 1, 0.63, 6138, 5, 2/5 in ascending order. 2/5, 0.63, 1, 5, 6138 Sort -4, 5, 934646 in increasing order. -4, 5, 934646 Sort 152439200, 0.2, -0.4 in descending order. 152439200, 0.2, -0.4 Put -4, -17, -40, 8, -235, 0, -5 in descending order. 8, 0, -4, -5, -17, -40, -235 Put -5, -1, 187, 17717 in increasing order. -5, -1, 187, 17717 Put 589151352, 4, 3 in descending order. 589151352, 4, 3 Sort 6, 1, 13, 12317, 2. 1, 2, 6, 13, 12317 Put 29, -1221,	{ "pile_set_name": "DM Mathematics" }
2 - 4o4 + 2 + (o3 - o3 - o3)(-3o + 2o - o) - 3o4 + o4 + o4. -4o*4 Expand (-5 + 2g + 5)(6g - g - 2g) + 8g2 + 58 - 58 + 1 + g2 - 1 + (3 - 3 + g)(5g - 2g - g). 17g2 Expand (g3 - g2 + g2)(-115g - 176g + 98g) - 2g4 + 2g4 + g4. -192g4 Expand (-1 - 91o + 112o - 120o)(o + 1 - 3o + 1). 198o2 - 196o - 2 Expand -9r2 - 116r + 116r - 2r*2 - 20 + 20 + (r + 5r - 4r)(2r + 3 - 3). -7r*2 Expand (-3 + 2 + 2)(s*2 - 2s*2 - 3s*2) + (4s2 - s2 - s*2)(5 + 2 - 4) - s2 - s2 + 4s2. 4s*2 Expand 4o - 13o + 6o + 3o - o + 0o + (0 + 0 + 4o)(4 - 3 + 0). 3o Expand (4u*3 + 10 - 10)(-1 + 4 - 1)(3 - 50u - 12u - 1). -496u*4 + 16u3 Expand (q - q3 - q)(2q + q - 5q) - 46q*4 - 35q*4 + 50q*4 - 2q*2. -29q*4 - 2q*2 Expand (2q - 3q + 2q)(171950q*2 - 188q*3 + 2 - 171950q*2). -188q*4 + 2q Expand -2 + 7m2 + 2 + (3m - 3m + m)(-185 + 185 - 4m). 3m*2 Expand (-5r + 5r + 4r)(1 + 0 + 0) + 107 - 48 - 55 - r. 3r + 4 Expand (4 - 2 - 1)(-f + 2f - 3f) + (0 - 3 + 0)(21 - 21 - 28f - 2f + 4f - 4f + 5f - 3f - 3f + (0 + 5 - 3)(-3f + f + 3f)). 85f Expand (14 - 54 - 46)(-4q4 + 0q*4 + 6q4) - q4 - 3q4 + 2q*4. -174q*4 Expand ((-1 + r + 1)(-1 + 2 + 0) + 2r + 3r + 0r - r + r - 2r)(-2r + 1 - 1 - 2 + 2r + 2 + (-2r - r + 5r)(4 - 5 + 2) + r + 1 - 1). 12r2 Expand (13o + 11 - 11)(4 - 4 - 1)(5 - 6 - 8)(-o + 0o + 3o + (-2 + 5 - 5)(1 - 1 - 2o) + 0 + 0 + 2o + 3o - o + 0o). 1170o2 Expand -5n*3 + 1 + 2n*3 + 0n*3 + (-n - 3n + 2n)(1 - 1 + 2n2) - 28n + 28n - 10n*3. -17n*3 + 1 Expand (w - 5w - 3w)(-1 + 1 + 2)(1 + 0 + 1 + (5 - 4 - 4)(-1 - 3 + 2)) - 46w + 49w + 4 + 2. -109w + 6 Expand (1 + 1 - 1)(4x - x + x) + 14x - 11x - 6x. x Expand (2i2 + 3i*2 - 6i2 - i4)(6 - 9 - i + 5). i5 - 2i4 + i3 - 2i2 Expand (a2 - 3a2 + a2)(16a*2 - 2a*2 - 10a2) - a4 - 2a + 2a + (0a + 0a - a*3)(-2a - 3 + 3) - 3a4 - a4 + 3a4. -4a*4 Expand (3c + c - 2c)(-2c - 2c + c) + 74 - 47 + 2c2 + c - 44. -4c*2 + c - 17 Expand (10b + 5b - 37 + 40)(4b2 - 2b*2 + 0b*2). 30b*3 + 6b*2 Expand -5 + 4 + 0 + 2l3 + (-1 + l2 + 1)(-5 + 2l + 5) + 141l3 - 9l*3 + 49l*3. 185l*3 - 1 Expand -4 + 2v*5 + 5 - 4v*5 + (0v + 6v + 9v)(-1 - 3v*4 + 1). -47v*5 + 1 Expand -6886z + 6886z - 48z*3 + (3z*2 + 0z2 - z2)(-z + z - z). -50z*3 Expand (f - 5 + 5)(-1 + 4 - 4)(6f - 268 - f*2 - 14f + 272). f*3 + 8f*2 - 4f Expand (-o2 + o2 - o*3)(10o2 - 78o + 78o) + 2o*5 - 4o*2 + 4o*2. -8o*5 Expand -2s + 29s + 14s + (-3 + 2 + 2)(2s + 4 - 4) + 6 - 3 - s - 1. 42s + 2 Expand 0c*4 + 4c*4 - 3c4 + (-c2 + c3 + c2)(-3c + 6c + 0c) + (-c + c - 2c)(c - c - 2c3). 8c*4 Expand (2b*3 - 15b*3 - 5b + 3b)(-6b + 3b + b). 26b4 + 4b*2 Expand (-35 + 12u + 35)(-4 + 5 + 2)(2u + u - u). 72u*2 Expand (-3t - t*2 + 3t)(3t*2 - 4t*2 + 0t2) + t4 + t2 - t2 - 46 + 46 - 27t4 + 4t*4 + 2t*4 - 2t4 + t4 - t*4 - 3t*4. -24t*4 Expand (2v3 - v3 + 0v3)(36 - 8 + 68v2 - 25 - v). 68v5 - v4 + 3v3 Expand (2g*2 + 4g*2 - 4g*2)(5g - 6g*3 - 9g - 5 + 7g). -12g*5 + 6g*3 - 10g*2 Expand (-116 - 95 - 178)(4v + 4v - 6v). -778v Expand (j + 4j - 4j)(-44 - 4 + 16)(-j + 2j - 2j). 32j2 Expand (-4v - 30 + 30)(-4v + 20v + 13v). -116v2 Expand (-3d + d - 67 + d)(-4d + 2d - d). 3d*2 + 201d Expand (3 - 2 + 0)(-3 + 3 + 2)(15i + 125 - 125). 30i Expand (-3h + 7h - 2h)(h*3 + 4h*3 - 3h*3) + 2h - 2h - 2h*4 - 4h*2 - 2513h*4 + 4h*2 + 2447h*4. -64h*4 Expand (-7p - 5p + 3p + (2 + 1 - 2)(-2p + 4p - p) + 0p - p + 3p)(11 + 1 - 21)(2 - 12 + 1). -486p Expand (3i5 + 5i*5 + 3i*5)(12 - 11 - 35) + 0i2 + 0i2 + i5. -373i5 Expand (r2 + 2r2 - r2)(r - 4r + r) + 1 + 5 + 2r3 + 10r - 5. -2r3 + 10r + 1 Expand 0i + 30i*4 - 27i*5 + 5i - 30i4 + 2i*5 + 3i*5 - 4i*5 + (-2i*4 + 3i*4 - 3i*4)(-4i + i + i) - 2i*5 + 3i*3 - 3i*3. -24i*5 + 5i Expand (3t2 - 2t*2 - 3t*2)((5 - 2 - 1)(-7t + t*3 + 7t) - 3t3 + 4t*3 - 2t*3 - 4t - 4t3 + 4t). 6t5 Expand 1 - 2g - 1 + (-42 - 30 - 39)(-4 + 4 + g). -113g Expand 8j4 + 0j*4 - 3j*4 - 2j2 - j4 + 2j2 - j4 + 0 + 0 + (j3 - j3 + j3)(5j - j - 5j) - j*4 + 9j*4 + 3 - 5j*4. 5j*4 + 3 Expand 32n*2 - 2n - 65n2 + 88n*2 + (0 + 0 + 2n)(2n + 0n + 0n) - 4n2 - 3n2 - n2 + 0 - n*2 + 0. 50n*2 - 2n Expand (4 + 0 - 3)(116q + 79q + 21q)(1 + 3 - 2). 432q Expand (-64 - 51 + 127)(-1 - 8 + 2)(w + 2w - 2w)(3 + 5 - 6). -168w Expand 366b - 802b + 235b + (2b - b + b)(-3 + 1 + 4). -197b Expand (-2w4 + w4 - w4)(40 + 33 + 5w - 62). -10w*5 - 22w*4 Expand (2x*2 - 2x*2 - 2x*2)(-1 + 1 + 2) + 2x2 + 4x*2 - 5x*2 + 80x + 40x2 - 59x - 33x. 37x*2 - 12x Expand ((n + 0 + 0)(2n - 4n + n) + 2n - 2n - n2)(0 + 0 - 2)(-42n - 52n + 22n)(n2 + n2 + 0n*2). -576n*5 Expand (d - 11 + 11 + (6d - 5d + 8d)(1 + 0 + 0))(0 + 2 - 3). -10d Expand (-3q*3 + 4q*3 - 2q*3)(-4q + q - q)(6 - 2 + 26) - q4 + q4 - q*4. 119q4 Expand -l3 - 3l3 - 2l*3 + 6l*3 - 9l*3 - 4l*3 + (2l*2 + 0l + 0l)(-3l - l + 2l) + 0l3 + 3l*3 - 2l*3. -16l*3 Expand (2o*4 + 0o4 - o4)(-1179 + 1780 - 1131)(3o - 6o + o). 1060o5 Expand ((-2c - 3c + 3c)(11c + c - 31c) - 2 + 3c*2 + 2 + (2c - 2c2 - 2c)(-2 - 1 + 5))(c - 2c - c). -74c*3 Expand (-j - 5 + 4j + 31 + 3j)(2 + 1 + 0). 18j + 78 Expand (3 + 2 - 6)(3 - 3 - 2)(-5i - 1 + 1). -10i Expand (q2 + q2 - q2)(3q - q + 0q)(-2 - 7 - 17). -52q*3 Expand (-6 + 1 + 2)(-4p + 2p + p + (3 - 6 + 2)(p - 2p - p))(-428 - 298 - 11). 2211p Expand -5s5 + 2s*5 + 2s*5 + (-4s*2 + 4s*2 + 2s*4)(3s - 4s + 3s) + 0 + 0 + 2s*5 + (-4s*2 - 2s*2 + 2s*2)(-7s3 - 10s*2 + 10s*2). 33s*5 Expand (39v - 38v + 37v)(2v3 + v3 - 4v3) + 0v*4 + 2v*4 + 0v*4. -36v*4 Expand 34v - v - 2v + 5v + v - 3v + (1 + 2 - 6)(2v + 2v - 5v). 37v Expand ((-3y + y2 + 3y)(y + 2 - 2) - y3 + 2y*3 + 0y*3 - 14114 + 14114 - 178y*3)(2 + 12 - 6). -1408y3 Expand (-s - 2s + 2s)(-s + s - 2s) - 6s*2 + 2s*2 - 4s*2 + (0s + 2s - 4s)(-4s + 3s + 2s) + s*2 - 1 + 1. -7s*2 Expand (-b - b + 0b)(-1 + 0 + 0)(2b + 860 - 860)(-2b2 + b - b). -8b*4 Expand 5l*4 - 4l*4 - 4l*4 + (6l*4 + 23l*4 - 2l*4)(3 + 3 - 3). 78l4 Expand -1 + 1 + 3g*4 + (-4347g + 4347g - 150g*3)(2 - 4 + 0)(g + 0g + 0g). 303g*4 Expand (-80b - 72b + 34b)(-b2 - b3 + b2)(-1 - 3b + 1) + 2b5 + b4 - b*4. -352b5 Expand (-l2 + 0l2 - 25l*2)(4l3 - 4l*3 - 2l*3) - 2l*2 + 2l*2 + 2l*5. 54l*5 Expand (2d*2 + 2d*2 - 2d*2)(-3 - 1 + 6) - 4d2 - 4d*2 + 3d*2 - 9d*2 - 5d2 + d2 + (0d + 4d - 3d)(-2d - 3d + 3d). -16d*2 Expand (0 + 3 - 5)(0 + o + 0) + ((-5o - 2o + 6o)(1 + 1 + 0) - 2o + 12o + 10o)(-1 - 7 + 3). -92o Expand (0j - j + 3j)(-3j - j + 2j)(-16j - 16 + 16). 64j3 Expand (-u2 + 82u*3 - 10u*2 - 4u*2 + 7u*2)(3u2 - u2 + u2). 246u*5 - 24u*4 Expand (-v - v + 0v)((-4 - 2 + 2)(-2 + 0 + 4) + (-4 - 3 + 5)(-1 + 3 - 1)). 20v Expand (-33 - 4a3 + 33)(a + 0a - 2a)(1 + 1 - 1). 4a*4 Expand (-7 + 3 + 2)(-2a + 3a + 2a)(6a - 15a - 68a). 462a*2 Expand (793 + 19q - 793)(4q*4 + 2q4 - q4). 95q5 Expand (5 - 67 - 17 + (-2 - 1 - 1)(2 + 3 - 2))(0a + 3a - 4a). 91a Expand -l4 - 3l*4 + 3l*4 + (-7l*2 + 7l*2 - 5l*3)(4l - 11l + 27l). -101l*4 Expand (0 + 0 - 2p)(-2p*3 + 0p*3 + 0p*3) + 2p3 + p4 - 2p3 + (-27p + 60 - 60)(2p*3 + 0p*3 - 6p*3). 113p*4 Expand ((3 + 4 - 5)(-1 - 4 + 3) + 4 - 1 + 15)(-13r + 14r - 29r). -392r Expand (0s - 4s + 5s)(131s*2 + 534s - 534s)(s2 - s2 - 2s2). -262s5 Expand (-v4 - 4v3 + 4v*3)(-8 + 4 - 3) + 202v2 + 10v**4	{ "pile_set_name": "DM Mathematics" }
39557 What is 68055.8 millilitres in litres? 68.0558 What is twenty-six fifths of a millennium in years? 5200 How many months are there in 516811.8 centuries? 620174160 How many millennia are there in 96.2152 decades? 0.962152 What is 0.830224m in nanometers? 830224000 Convert 95.70114 days to microseconds. 8268578496000 How many millilitres are there in 0.7519446l? 751.9446 How many meters are there in 3/25 of a kilometer? 120 What is one tenth of a minute in milliseconds? 6000 What is 6/5 of a meter in millimeters? 1200 Convert 270480.8 weeks to microseconds. 163586787840000000 How many millilitres are there in 59/5 of a litre? 11800 How many meters are there in 795.0922 kilometers? 795092.2 How many millilitres are there in 4.227587 litres? 4227.587 What is 17/2 of a kilogram in grams? 8500 How many millilitres are there in 1/5 of a litre? 200 How many hours are there in 36.55511 days? 877.32264 How many millilitres are there in 90.87675l? 90876.75 How many tonnes are there in 1.343766kg? 0.001343766 What is 31/5 of a centimeter in millimeters? 62 What is 4261465.8 seconds in hours? 1183.7405 How many decades are there in thirteen fifths of a century? 26 How many millilitres are there in 3/5 of a litre? 600 What is five quarters of a micrometer in nanometers? 1250 How many nanometers are there in 8034.962km? 8034962000000000 Convert 5.869634 kilograms to nanograms. 5869634000000 What is 0.7142622 micrograms in milligrams? 0.0007142622 How many milligrams are there in 308018.1 kilograms? 308018100000 What is fifteen quarters of a week in minutes? 37800 Convert 0.0119628s to nanoseconds. 11962800 Convert 1.408066ng to tonnes. 0.000000000000001408066 What is 18/5 of a litre in millilitres? 3600 What is fifteen quarters of a litre in millilitres? 3750 How many months are there in 17/6 of a century? 3400 What is 3/8 of a litre in millilitres? 375 How many milligrams are there in 21773.74ug? 21.77374 Convert 581.695 litres to millilitres. 581695 How many litres are there in 0.739879 millilitres? 0.000739879 What is one twentieth of a milligram in nanograms? 50000 How many milligrams are there in seventeen quarters of a gram? 4250 How many millilitres are there in one quarter of a litre? 250 Convert 762.69627ms to weeks. 0.000001261071875 What is 853.9503 centuries in decades? 8539.503 Convert 0.8713134 minutes to days. 0.00060507875 How many decades are there in twenty-one quarters of a millennium? 525 How many nanometers are there in one sixteenth of a millimeter? 62500 Convert 795.8116 decades to years. 7958.116 What is three tenths of a meter in millimeters? 300 How many millilitres are there in 9/10 of a litre? 900 What is 26.10017 millennia in centuries? 261.0017 How many litres are there in 9.13972ml? 0.00913972 How many months are there in 0.7082577 years? 8.4990924 What is 138951.42 months in centuries? 115.79285 Convert 571843.5kg to micrograms. 571843500000000 What is 26/5 of a day in minutes? 7488 Convert 90945.51 meters to millimeters. 90945510 What is two fifteenths of a millennium in months? 1600 How many millilitres are there in 223909.8 litres? 223909800 How many millennia are there in 299923.1 centuries? 29992.31 What is three tenths of a millennium in years? 300 What is 0.5562995 millimeters in centimeters? 0.05562995 What is 27924.12 centimeters in kilometers? 0.2792412 How many minutes are there in 42.01956 hours? 2521.1736 Convert 7.579755 micrometers to nanometers. 7579.755 What is 6.477349 litres in millilitres? 6477.349 What is 10.34296ml in litres? 0.01034296 What is four thirds of a minute in seconds? 80 How many kilograms are there in 8907.852g? 8.907852 What is 76/5 of a millimeter in micrometers? 15200 How many millilitres are there in fifty-seven halves of a litre? 28500 Convert 39.63702 weeks to days. 277.45914 What is 15/4 of a millennium in decades? 375 What is 57228.56 decades in months? 6867427.2 How many millilitres are there in 44/5 of a litre? 8800 How many years are there in three fifths of a century? 60 What is twenty-one quarters of a day in minutes? 7560 What is 6989.919 milliseconds in microseconds? 6989919 How many millilitres are there in 5428.795 litres? 5428795 What is 6/5 of a minute in seconds? 72 What is 13/5 of a litre in millilitres? 2600 What is thirteen quarters of a litre in millilitres? 3250 What is 1/16 of a tonne in grams? 62500 How many nanograms are there in 462555.1ug? 462555100 How many millilitres are there in 0.5085273 litres? 508.5273 What is twenty-one halves of a milligram in micrograms? 10500 How many millimeters are there in 3.454139 kilometers? 3454139 How many years are there in 53.62309 decades? 536.2309 How many nanograms are there in 3/8 of a microgram? 375 How many milligrams are there in eleven halves of a gram? 5500 Convert 80865.63mg to kilograms. 0.08086563 How many micrograms are there in 87/4 of a milligram? 21750 Convert 0.186069 minutes to nanoseconds. 11164140000 Convert 4886.741 micrometers to meters. 0.004886741 How many meters are there in six fifths of a kilometer? 1200 How many nanometers are there in twenty-one fifths of a micrometer? 4200 How many micrograms are there in 1/10 of a milligram? 100 What is 6.412809 years in months? 76.953708 What is 87971.84l in millilitres? 87971840 How many litres are there in 7993.74 millilitres? 7.99374 How many milliseconds are there in 2170.831 microseconds? 2.170831 What is one quarter of a milligram in micrograms? 250 What is thirteen quarters of a millennium in years? 3250 How many micrograms are there in 7440.582 grams? 7440582000 How many weeks are there in 19664.4294 nanoseconds? 0.0000000000325139375 What is 75.17013 tonnes in nanograms? 75170130000000000 How many seconds are there in 3/40 of a week? 45360 What is fourty-seven quarters of a second in milliseconds? 11750 How many millilitres are there in 3/10 of a litre? 300 How many milligrams are there in 29/2 of a gram? 14500 What is 112.261 millennia in centuries? 1122.61 What is 49309.64ml in litres? 49.30964 How many micrometers are there in three fifths of a millimeter? 600 What is 3/25 of a meter in centimeters? 12 How many decades are there in seven halves of a century? 35 What is 468787.5ns in days? 0.00000000542578125 How many hours are there in 544.08375 seconds? 0.151134375 Convert 0.348951 millennia to months. 4187.412 What is 28/15 of a minute in seconds? 112 How many months are there in 0.5441607 centuries? 652.99284 How many minutes are there in 1621875.3ms? 27.031255 What is seventy-one quarters of a litre in millilitres? 17750 What is 13/4 of a litre in millilitres? 3250 What is 1/5 of a century in years? 20 What is twenty-five quarters of a millennium in decades? 625 What is 5/4 of a litre in millilitres? 1250 What is 27883.68kg in nanograms? 27883680000000000 Convert 36.59749 millilitres to litres. 0.03659749 What is seven quarters of a millimeter in micrometers? 1750 How many centimeters are there in 9.33823mm? 0.933823 Convert 29793.48 months to centuries. 24.8279 How many seconds are there in 210.7459 weeks? 127459120.32 How many grams are there in one fifth of a kilogram? 200 Convert 17713.59 years to decades. 1771.359 What is 27/2 of a litre in millilitres? 13500 What is 2676814.83us in days? 0.000030981653125 What is one sixteenth of a day in seconds? 5400 How many millilitres are there in 53774.23 litres? 53774230 How many months are there in 3789.557 centuries? 4547468.4 How many tonnes are there in 326.8999 micrograms? 0.0000000003268999 Convert 67210.55 decades to years. 672105.5 How many micrograms are there in 7/4 of a milligram? 1750 How many millimeters are there in 828.3894 nanometers? 0.0008283894 How many litres are there in 8.405806ml? 0.008405806 How many seconds are there in twenty-one halves of a hour? 37800 Convert 1.965037 centuries to months. 2358.0444 What is 3/25 of a centimeter in micrometers? 1200 What is 99.54826 litres in millilitres? 99548.26 How many seconds are there in four fifteenths of a hour? 960 Convert 6.77429 millennia to years. 6774.29 How many millimeters are there in 592642.5 micrometers? 592.6425 How many micrometers are there in 87102.9 nanometers? 87.1029 Convert 3.600075 seconds to nanoseconds	{ "pile_set_name": "DM Mathematics" }
and give u. 0 Express 3 - 491c2 - 3 + 486c*2 - 3c - 2c3 + c4 as oc*4 + dc*3 + hc*2 + w + zc and give h. -5 Express -4a2 - 2 - 2a*4 + 3a*2 + 0 + 4a*3 as s + za + ja3 + qa*4 + xa*2 and give q. -2 Express 3k*2 - 2k*3 + 5k*2 + 3k - 5k2 + 2k*4 in the form tk*3 + dk*4 + qk*2 + w + nk and give d. 2 Express -255u + 228u + 173u as cu + v and give c. 146 Express 2d3 + d2 + 1 - 174d + 174d in the form i + qd*3 + kd*2 + ld and give q. 2 Rearrange -624 - 19a2 + 624 + 46a*2 + a to g + wa + ia2 and give i. 27 Express (g - 3g - g)(0 + 2g + 0) + (0 + 0 - 7g)(-2g + g + 0g) in the form dg + xg*2 + v and give x. 1 Rearrange 1 + 2 + 5l - l + l to z + yl and give z. 3 Express 6 + 4n*2 - 2n*2 - 14 as vn*2 + y + in and give y. -8 Express -4 + 7u3 + 7u*3 + 2u*3 + 3 in the form d + mu*2 + ou + qu3 and give q. 16 Express 8p - 8 + 4 + 4 as mp + j and give j. 0 Express -14a - 5a - 8a + 23a + 1 as h + fa and give f. -4 Rearrange 1124o + 1 - o2 - o3 - 1124o to ko2 + m + ao*3 + qo and give k. -1 Rearrange 2g4 - 3g*4 + 2g*4 + (-5 + 1 + 2)(8g4 - 12g*4 + 9g*4) to the form jg*2 + m + hg + tg4 + wg*3 and give w. 0 Rearrange 2p*4 - 3p*2 + 3p*2 + (56p + 14p - 13p)(5p*3 - 3p3 - p3) to lp4 + op*3 + jp*2 + i + gp and give l. 59 Express 3a3 + 2a*3 - 3a*3 + (-3a*2 + 2a2 - a2)(19a - 9a + 9a) + 0a3 + 3a*3 - 2a*3 as ia + da2 + k + ma*3 and give i. 0 Express -42 + 42 - 14m*2 + (2 + m - 2)(-m - m + 4m) as im*2 + pm + c and give i. -12 Express (8y + 13y - 16y + 5y + 2y - 2y - 6y + y + 3y + (3 - 4 + 0)(-y + 5y - 3y) - 2y - 2y + 5y)(-3 - 2 + 3) in the form z + oy and give o. -16 Express -4q3 - 2q*3 - 2 + 4q*3 + 4q*3 + 2q in the form gq + i + lq*3 + mq*2 and give g. 2 Rearrange 2 - 2 + 6d*2 + 2d*2 to the form h + bd + od2 and give h. 0 Express t4 - 4t4 + t4 + (1 - 1 - 4t)(-21t3 + t3 - 48t*3) in the form gt*2 + it*3 + b + ft + ct4 and give i. 0 Rearrange -2r*4 - 3r3 + r2 + 3r2 - 5r*2 + 2r to zr2 + hr*3 + t + pr*4 + mr and give z. -1 Express q*3 + 4q + 3q - 2q - q as u + oq3 + lq*2 + fq and give o. 1 Express 13s - 7s + 8s + 7s as cs + o and give c. 21 Express (55 - 55 - 6i)(3 - 3 + 2i*2)(2i + 4 - 1 - 2) as gi*4 + b + wi + ki2 + ai3 and give a. -12 Express ((-2 + u3 + 2)(0 - 1 - 1) - 2u*2 - 3u*3 + 2u*2)(-6 + 21 + 40) in the form w + zu + au*3 + tu2 and give a. -275 Express v4 + 0 + 1 + 0v - 3v*4 + v in the form zv*2 + c + iv*3 + sv + wv4 and give w. -2 Express 2 + 5o - 11o3 - 2o + 5o2 - 3 + 10o3 - o4 in the form co4 + yo + jo3 + n + xo2 and give n. -1 Rearrange -w2 + 3 - 16w - 6w*3 + 7w + 9w to the form pw + yw3 + s + qw2 and give y. -6 Express i2 - 4i2 + 6i*2 as m + oi + pi2 and give p. 3 Rearrange 6l*2 - 7 + 1 + 4 to al + i + hl2 and give h. 6 Rearrange (14 - 14 + 8)(2x - 3x + 0x + (0 - 1 + 2)(-4 - 2x + 4) - 2x + x + 0x) to hx + t and give h. -32 Rearrange (2 - 1 + 1)(0u + u - 3u)(2 - 3 + 4)((1 + 2 - 4)(1 + 2 - 1) - 5 - 5 + 2) to xu + p and give x. 120 Express -14l*2 + 5l*2 + 5l*2 + (0l + 3l - l)(3 - l - 3) + 2 - 2l2 - 2 as kl*2 + i + ul and give k. -8 Express -b + 7 - b - b*4 - 6 in the form p + fb + jb2 + rb*4 + ub*3 and give f. -2 Express 8x + 2x - 5x as gx + w and give g. 5 Rearrange -3z*3 - 9z*3 + 14z*3 + 6z*2 to b + tz + cz3 + qz*2 and give c. 2 Rearrange 29 - 29 - 11a to the form ca + w and give c. -11 Express (185 + 18d - 185)(2d + d - 2d) + 30d - 30d - 5d*2 as xd*2 + c + jd and give x. 13 Express 22i + 155 - 155 as ni + z and give n. 22 Express 16n3 - 31 + 58 - 2n - 3n2 - 29 in the form fn*2 + x + rn*3 + zn and give x. -2 Express (-19 + 19 - 17o)(-o*2 - 5o*2 + 4o*2) in the form u + mo*2 + zo + jo3 and give j. 34 Express 28h + 0h + 7h + 9h as j + gh and give g. 44 Express 49 - 98 + 51 + 9g3 as vg + w + yg2 + og*3 and give w. 2 Express 188f - 228f - 1 + 1 in the form nf + w and give n. -40 Rearrange -9q2 + 4q*2 - 16q*2 to the form v + lq + mq2 and give m. -21 Express 4q - 2q + 4q + (6 + 0 - 1)(2q + 1 - 1) in the form d + vq and give v. 16 Rearrange (-2 - 3 - 4)(-9 + 8z2 + 9) - z2 - 2z2 + z2 to the form w + rz + az*2 and give a. -74 Rearrange -105h*2 + 131h*2 + 6h - 1 - 4h to fh + dh2 + k and give k. -1 Rearrange 4h*2 - 4h - 3h3 + h + 2h*3 - 3h*2 to l + wh + zh2 + kh*3 and give w. -3 Express -3 - 160b - 163b + 325b as z + xb and give z. -3 Rearrange -d + 10 - d3 + 4d*2 + 2d*3 - 10 to the form q + vd*3 + sd*2 + yd and give s. 4 Rearrange (-50 - 3y2 + 89 - 46)(5 - 2y - 5) to the form z + hy + ry2 + gy*3 and give h. 14 Express (-2p*4 + 3p4 + p2 + 0p4)(0 - 1 - 6)(3 - 5 + 0)(-2 + 4 - 3) in the form np4 + sp*3 + x + jp*2 + lp and give n. -14 Express -2l3 + 5l3 - 2 - l3 - 4l4 as jl*3 + pl + ul4 + a + vl*2 and give j. 2 Express -g - 4g*3 + 5g*3 + 2 + 1 as i + sg + yg3 + qg*2 and give i. 3 Rearrange (-2l*2 + 2l2 - l2)(0l2 + l2 + 2l2) + l4 - 2l*4 - 4l*2 - 2l*2 to the form kl*4 + h + rl + gl3 + pl*2 and give r. 0 Express (2i - 4i + 0i)(37 + 53 - 58) as li + t and give l. -64 Express (0 + 1 + 0)(0 - 6 + 4)(1 + 4f - 1)(-4f + 4f + f*3) in the form y + bf*3 + if + sf2 + xf*4 and give x. -8 Rearrange (3 - 5i - 2i2 + 2i + 3i2)(-6i - 2i + 0i) to yi*2 + li + oi3 + z and give l. -24 Rearrange -5g*2 - 1 + 21g2 + g2 to the form c + zg2 + rg and give z. 17 Express (6g + 10 - 10)(g*2 - 4g*2 + 2g*2) in the form z + ng + og2 + rg*3 and give r. -6 Rearrange (l - 2l + 2l)(10 - 6 - 8l - 7) to the form ml*2 + dl + q and give m. -8 Express (-6u + 9u + 5u)(5 - 5 + u) in the form q + bu + yu*2 and give y. 8 Rearrange m + 4m - 6m + 3m + m*2 to the form s + pm + am2 and give a. 1 Express -6v*2 - 9v*2 + 9v*2 in the form a + hv*2 + ov and give h. -6 Rearrange 11f2 + f3 - f + 258 + f - 259 to the form q + tf + kf2 + gf*3 and give g. 1 Express (-1 + 6k - 4k - 1)(4k2 + 8k*2 - 16k*2) in the form hk*2 + rk*3 + qk + f and give r. -8 Rearrange (w + w - 4w + (-3 + 1 + 1)(w + 0 + 0))(-2w + 2w + w2) to the form kw*2 + dw + p + lw3 and give k. 0 Rearrange 3m*3 + 2m + 6m - 10m - 5m4 to the form dm*2 + vm + xm4 + jm*3 + k and give d. 0 Express -2h - 5h - 22h + (1 - 5 + 3)(-10h + 9 - 9) in the form i + rh and give r. -19 Rearrange (-10 - 2v*2 + 10)(0v - v + 0v) + 9v3 - 2v*3 + 0v*3 + (-2 + 2 - 2v*2)(0v + 0v - 2v) to the form k + wv + nv2 + pv*3 and give p. 13 Express 20 - 22 - 2p + 2p4 + 0p + 2p3 as ap + qp4 + fp*3 + s + kp*2 and give s. -2 Express -149z - 60z + 24z + 17z as d + rz and give r. -168 Rearrange (r - 3r + 3r)(3r*3 + 0r3 - r3) to the form wr2 + nr + zr3 + kr*4 + o and give k. 2 Express 4 + 1 - 4 - 3h*2 + 9 as sh*2 + z + wh and give s. -3 Rearrange f*3 - 15 + 15 - 2f*3 + 16f to the form rf2 + cf + nf3 + a and give n. -1 Rearrange -30 + 2s2 + s2 + 30 to the form ds2 + rs + x and give d. 3 Express -2q + 13 - 1 - 5 + 3q*2 as tq*2 + gq + x and give x. 7 Rearrange (4q + 3q - 3q)(-2 - q*2 + 220q - 220q) to u + vq*2 + lq*3 + aq and give l. -4 Rearrange -3h + h3 + 3h + (-4h3 + 5h*3 + 0h*3)(1 + 5 - 17) to s + ah3 + xh*2 + ch and give x. 0 Rearrange (-1 - 9 - 54n + 9)(3n - n - 3n) to the form pn2 + gn + f and give g. 1 Express -189w + 2w*2 + 0w*2 + 191w as n + pw2 + dw and give n. 0 Express -34k4 + 2k*2 + 9k*3 - 24 + 32k*4 + 21 as g + ik + pk4 + zk*2 + ok*3 and give p. -2 Express (3 - 3 - 2y)((y + 0y - 3y)(-8y - 6y + 8y) - 4 + y2 + 4) in the form fy*2 + iy*3 + ay + p and give i. -26 Express (14d + 7d - 5d)(2d - 3d - d)*(0 + 4 -	{ "pile_set_name": "DM Mathematics" }
e the greatest common divisor of v and 261. 29 Let r be (-15)/(-9)54/15. Suppose -2 = -4w + 6. What is the greatest common factor of r and w? 2 Suppose 4g - 22 = 5u, 6g + 3u = 10g - 18. Suppose -3w + 99 = -4j, -5w + 46 = j - 119. Calculate the greatest common divisor of g and w. 3 Suppose 0c = -c - p + 28, -4p = -2c + 68. Let r(s) = 6s*2 - 2s - 3. Let n be r(3). What is the highest common divisor of n and c? 15 Let g = -199 + 545. Suppose -3o = -2w - g, -5o - 2w + 565 = -3w. Calculate the greatest common divisor of 16 and o. 16 Let b = -632 + 633. What is the greatest common factor of 31 and b? 1 Suppose -g + 5d + 522 + 63 = 0, 0 = g + d - 615. Calculate the greatest common divisor of 10 and g. 10 Suppose 32u = 25u + 2170. Calculate the greatest common factor of u and 31. 31 Let v(l) = -l*2 + 28l - 52. Let r be v(12). Suppose -4t + 89 - 9 = 0. Calculate the greatest common factor of t and r. 20 Let x be (-3)/((12/9)/(-4)). Let h(y) = 4y*2 - 31y + 5. Let r be h(x). What is the greatest common factor of 20 and r? 10 Let w = -1066 + 1250. Calculate the greatest common divisor of w and 1196. 92 Let b(w) = 8w2 + w + 2. Let d be b(-1). What is the highest common divisor of 9 and d? 9 Suppose 2m - 15 = 7m. Let q be (5/m1)/((-1)/6). Calculate the highest common divisor of 130 and q. 10 Suppose -2p = -2h + 576, -2h + 309 + 264 = p. What is the greatest common factor of 41 and h? 41 Let j(u) = u2 - 26u + 148. Let v be j(7). Let d(n) = -10n2 - 3n - 2. Let l be d(3). Let z = 221 + l. Calculate the highest common divisor of v and z. 15 Let x be (16/(-20))/((3/30)/(-1)). Let q = 53 + 19. Calculate the greatest common factor of q and x. 8 Suppose -5x + 88 + 32 = 0. Suppose -7 = 3k - 10. Let y be (k - 0/(-5)) + 5. What is the greatest common factor of y and x? 6 Let o(i) = i*3 + 11i*2 + 9i - 4. Let q be o(-10). Suppose t - 16 = -4u, -14u = -3t - 19u + 41. What is the highest common divisor of q and t? 6 Suppose 2c = -6, 6c = 3k + 7c - 30. Calculate the highest common divisor of k and 209. 11 Suppose 26j = 4657 + 179. What is the highest common factor of 6 and j? 6 Let b(l) = l3 + 11l*2 - l + 9. Let s be b(-10). What is the greatest common divisor of s and 7? 7 Suppose -5a = -2l + 25, -l - 2l - 2a + 9 = 0. Suppose 0 = lq - 17q + 24. Calculate the greatest common factor of 5 and q. 1 Let q = -2813 - -4731. Calculate the highest common divisor of 14 and q. 14 Let w be 50/6 + 2/(-6). Suppose 0 = -3u + 5u - 10. Suppose 5g - 3g - 26 = ub, -2g = -4b - 24. What is the highest common divisor of g and w? 8 Let j(l) = 88l3 - l2 + 8l - 7. Let z be j(1). What is the highest common factor of 40 and z? 8 Suppose 367 = k - 13f + 18f, 351 = k - 3f. What is the greatest common factor of k and 2023? 119 Let j = -21 - -41. Let g be 10/15 - (-308)/6. Suppose -2f = 2l + 2l - 40, g = 5l + 3f. Calculate the greatest common factor of l and j. 4 Suppose -3n = -4m + 2n - 149, -3n = -3. Let w = m + 108. Suppose -3t - 21 + 9 = 0, 2y = 4t + 34. What is the highest common divisor of y and w? 9 Let h(i) = -i - 1. Let s be h(-1). Suppose -5t + 217 + 3 = s. What is the greatest common divisor of 11 and t? 11 Let v(x) be the first derivative of -x + 5 - 61/2x2. Let d be v(-2). Calculate the greatest common factor of 11 and d. 11 Let i(b) = b2 - 17b - 94. Let t be i(31). What is the highest common divisor of t and 100? 20 Let x be 4(-1 - 145/(-20)). Calculate the greatest common divisor of x and 75. 25 Suppose 4k = 71 + 37. Let i(w) = 4w2 + 373w - 744. Let c be i(2). Calculate the highest common factor of k and c. 9 Suppose -4i = t - 69, 9i + t - 33 = 7i. What is the greatest common factor of 738 and i? 18 Let l(x) be the third derivative of -x6/120 + x5/12 + x4/8 + x3/3 - x2. Let g be l(5). Let u = g - -5. What is the highest common divisor of u and 11? 11 Suppose 0 = 3q - q. Suppose -4r - 142 = -2n, qn - 70 = -n + r. Calculate the highest common divisor of n and 23. 23 Suppose -26 = -b + 3t, -2 = 5b - 3t - 108. Calculate the highest common factor of b and 590. 10 Suppose 3w = -2w + 10, 2w = 4q + 4. Suppose 2p + 4j - 32 = -2p, -j + 3 = q. Let m be 852/30 - 2/p. What is the highest common factor of m and 4? 4 Suppose 5g - 27 = -2v + 37, 4v = 3g - 28. Let r be 10/(-4)g14/(-42). Calculate the greatest common factor of r and 25. 5 Suppose -1031 = -21q + 1699. Calculate the highest common factor of q and 10. 10 Let l be (2 - 4 - -3)207. Let v be 24/20(-20)/(-6). Suppose 0 = -3d - vc + 89, 26 = 2d - 4c - 0c. What is the highest common factor of d and l? 23 Let t be (60/(-50)5)/((-15)/30). Suppose 0 = 4q + 3h - 192 - 183, 0 = 3q - 2h - 294. Calculate the highest common divisor of t and q. 12 Let m = 335 - 326. What is the greatest common divisor of 621 and m? 9 Let f = 11 + -5. Let l be 3/f - 6/(-4). Let j be (l1)/(15/675). Calculate the greatest common factor of j and 10. 10 Let h = -47 + 72. Let c(i) = 2i. Let y be c(2). Suppose yk = -k + 125. What is the greatest common divisor of k and h? 25 Let i be -68 + (-6 - -1) - (5 + -2). Let k(d) = -d3 - 4d*2 + 8d - 4. Let z be k(-8). Let f = z + i. Calculate the highest common divisor of 14 and f. 14 Suppose 3h - 107 = 85. Let j = 56 - 61. Let u be 2/j(-22 - -2). What is the highest common factor of u and h? 8 Let y = 47 - 113. Let i = -24 - y. Calculate the greatest common divisor of i and 28. 14 Let y = -340 - -359. Calculate the greatest common divisor of 19 and y. 19 Suppose -17z + 1205 = -2348. What is the highest common factor of 19 and z? 19 Let n(u) = 126u*2. Let p be n(1). Suppose 3693 = -46w + 256w - 87. What is the highest common factor of w and p? 18 Suppose 16p - 189 = 259. Let r(j) = 23j3 - j2 - j. Let d be r(1). What is the highest common divisor of p and d? 7 Suppose o = -2 + 5, z + 3o - 11 = 0. Suppose 4 = zd, -3r + 320 = -d - d. What is the greatest common factor of r and 270? 54 Let b(p) = -p*2 + 11p + 38. Let v be b(12). Calculate the highest common divisor of v and 442. 26 Let m(f) = 2f2 + 4f + 2. Let x be m(-2). Let o be 50/30 - (-3)/9. What is the greatest common divisor of o and x? 2 Suppose 0 = x + t + 74 - 627, 3t + 1635 = 3x. Calculate the greatest common divisor of 9 and x. 9 Let s be ((-120)/75)/((8/(-30))/(-2)). Let m be ((-15)/35)/((-4)/(-21))s. Calculate the greatest common factor of m and 9. 9 Suppose 33k - 34k = 124. Let n = 223 + k. Calculate the highest common divisor of 9 and n. 9 Suppose -4i + 2i = 358. Let b = 316 - i. Suppose c = -4c + b. What is the highest common factor of c and 9? 9 Let m = 222 - 245. Suppose q + 2q + 30 = -3n, 5q = n - 20. Let k = n - m. Calculate the greatest common divisor of k and 12. 6 Let c(w) = 12 - 5 - 177w + 3w2 + 178w. Let v be c(8). Calculate the greatest common factor of v and 23. 23 Suppose 6b - 14 - 4 = 0. Suppose s + 13 = x, -s - 3s = -bx + 41. Let i = 39 - -16. What is the highest common divisor of x and i? 11 Let o = 72 + -76. Let i(j) = -j3 + 5j*2 + 5j. Let d be i(o). What is the greatest common divisor of 31 and d? 31 Suppose 10 = 4y - l, -8l + 2 = -2y - 11l. Let c(i) = i*2 + 1. Let k be c(-2). What is the greatest common divisor of y and k? 1 Suppose -2d - d + 4a + 233 = 0, -3a = 5d - 340. Calculate the highest common divisor of d and 497. 71 Let s = 29 - 29. Suppose s = 2f - 5f + c + 35, 4c = -5f + 47. What is the highest common divisor of f and 11? 11 Suppose 0y = 2y - 20. Suppose 98 = -13b + 488. What is the highest common factor of y and b? 10 Let x be 3/3 - 7/((-21)/6). What is the greatest common factor of x and 543? 3 Suppose 36 + 62 = 2i + 4b, 4i - 3b - 196 = 0. Suppose iu = 52u - 90. What is the highest common divisor of u and 30? 30 Suppose -22 = 5w - 382. Suppose -14 = 5p - 44. Suppose 4y + py = 80. Calculate the greatest common divisor of w and y. 8 Suppose -o + 1 = -9. Suppose 13b - 60 = ob. Let z be 181 - ((-4 - -3) + 2). What is the greatest common factor of z and b? 20 Suppose 9g - 41 + 32 = 0. Suppose 23 - 1 = 2q. Calculate the greatest common factor of g and q. 1 Let i be 7*1 + -14 + 99. What is the greatest common d	{ "pile_set_name": "DM Mathematics" }
value in -1/2, -5, 0.2, w? 0.2 Let i = 0.05 + -0.069. Let f = -2.24 + 2.021. Let r = f - i. Which is the smallest value? (a) 5 (b) r (c) -2/9 c Let q = 44 - 48. Let l(i) = 6i2 - 21i + 10. Let n be l(3). Which is the biggest value? (a) -1/8 (b) n (c) -1/7 (d) q b Let v = -0.285 - -0.085. Which is the third biggest value? (a) v (b) 1.2 (c) 19 a Let r = 15540.7 - 15535. Which is the biggest value? (a) 5 (b) r (c) 1 (d) -0.4 b Let o be (-72)/(-900)4/((-4)/5). What is the third smallest value in o, -2/13, 5, -3/53? -3/53 Let g(h) = 6h*2 - 4h + 14. Let t be g(3). Suppose -t = 11r + 3r. Let z = -212/35 + 31/5. What is the second biggest value in 1/5, z, r? z Let m(r) = 2r3 + 84r*2 + r + 40. Let n be m(-42). Let b be (-66)/189 - 6/27. What is the second smallest value in -2/9, n, b? b Suppose h = -h + 8. Suppose -3v - 4z - h = 0, 7v + z = 2v + 16. Let q = 11700 + -11700.4. What is the third smallest value in v, q, 0? v Let y = 0.18637 - -0.11363. What is the fourth biggest value in 49, y, 2, -0.5? -0.5 Suppose 2g = -g + 12. Let x = -6.94 + 7.94. What is the third smallest value in g, 2/7, x, 37? g Let z = 14453.93 + -14530. Let i = z + 73. Let u = i + 1.07. What is the biggest value in -25, 2, u? 2 Let u = -727/140 + 151/28. What is the biggest value in u, 7, 0.9, 6? 7 Let w = -2 + 2.4. Let q = 10385 - 10387. What is the smallest value in q, 2, -0.4, w? q Let u = -122 - -11. Let k = u - -110. Let g = 0.32 - 0.02. Which is the fourth smallest value? (a) g (b) -2 (c) 2/5 (d) k c Let g = 346.2 + -180.1. Let r = g + -166. Which is the smallest value? (a) -31 (b) r (c) 2 a Suppose 161q - 296q = -148q - 52. What is the third smallest value in -0.1, -2/11, q? -0.1 Suppose -117b - 7000 = -131b. Let x = -505 + b. What is the smallest value in 5, x, -0.1, 4? x Let y = 31.5 + -31. Let c = 17.676 - 17.586. What is the third biggest value in c, y, 0.3, 2/9? 2/9 Let s = -8307 - -8314. Let j = 9 + -9. Suppose j = -h + 4h. Which is the second biggest value? (a) s (b) -2 (c) h c Let n = 66.2 - 357.2. What is the fourth biggest value in 4, -4, n, 0.5, -2? -4 Suppose 2g - 5m = -193, 5g - m + 713 - 219 = 0. Let d = g - -695/7. Let s = 4267 + -4262. Which is the third biggest value? (a) s (b) d (c) -1 c Let x = -3 - -2. Let a = 1.5962 - 13.5962. What is the biggest value in x, a, 1/5? 1/5 Let a = 1/20 + -153/3860. What is the biggest value in -3, -0.2, a? a Let v(j) = 3j*2 - 36j + 35. Let a be v(11). What is the biggest value in 0.4, 0, 0.2, a? a Let h = -2.5262 + 2.4262. Which is the smallest value? (a) 5 (b) -1 (c) -240 (d) h c Let p = 1 - 1.2. Suppose 3r - 10 = -2r. Let s = 18607 + -18602. Which is the fourth smallest value? (a) p (b) r (c) s (d) -4 c Let d(c) = -41c3 - 5c*2 + 5c. Let z be d(2). Let m = z - -337. What is the fourth biggest value in -6, 2.6, 0.3, m? -6 Let g = 4.09 + -0.09. Let m = -46087 - -46087.1. Which is the third biggest value? (a) 0.5 (b) m (c) 3 (d) g a Let h = -1264 + 7583/6. Suppose 6m - 12 = -0. Which is the biggest value? (a) -0.8 (b) -4 (c) h (d) m d Suppose 4f - 19j = -21j + 18, -2j - 22 = -4f. Suppose -2i - 10 = 0, 0h + 3i - 25 = -2h. Suppose 6l = l + h. What is the biggest value in l, f, -0.4? f Let k = 74 - 43. Let u(r) = r3 - 21r*2 - 3r + 94. Let l be u(21). Let j = l - k. Which is the third smallest value? (a) -0.1 (b) 3 (c) j (d) 1/11 d Let v = -299807 + 299809. Let i be 12/16(-4)/13. What is the third biggest value in 0.3, i, v, 3? 0.3 Let h(p) = 2p*2 - 50p + 11. Let o be h(25). Suppose 4n + o = 2w - 1, -3w + n = -8. Which is the second smallest value? (a) -3 (b) w (c) -40 a Suppose -z + 4j - 16 = 0, 175j = 4z + 177j + 10. What is the fifth biggest value in -1, z, 94, 1/3, 0.4? z Let n = 0.99 - -21.31. Let w = -22.2 + n. Which is the third smallest value? (a) 2 (b) w (c) 5 (d) -6/23 a Let y = 8210 + -8208. Let k = -2 - -1.8. What is the fourth smallest value in -11/4, k, y, 0.5? y Let a = 23 - 1. Suppose -y + 4t = -4y + 4, 5y - t - a = 0. Let n = 2195 + -2195. What is the third biggest value in y, n, 3/2? n Let p be (50/(-1375))/(23/253). What is the second biggest value in -1, -3.6, p, 0.3, -10? p Let k = 18.5 - 18. Let i = -0.013 - -6.013. Let g = -3 - 2. Which is the third biggest value? (a) g (b) i (c) k a Let f = -1/18717 - 37427/131019. Which is the smallest value? (a) f (b) 5/9 (c) 2 (d) -0.28 a Let z = -2462 + 2661. Which is the second smallest value? (a) 5 (b) z (c) 0.05 a Let r = 36.24 - 35.94. Which is the smallest value? (a) 5/4 (b) 0.2 (c) r (d) -5 (e) 3/7 d Let y(l) = -12l2 + 93l + 571. Let z be y(-4). Let v be ((-9)/(-12))/(3/(-2)). Which is the biggest value? (a) v (b) 0.18 (c) z c Let u = -75.09 - -110.09. Which is the fourth smallest value? (a) 2/19 (b) -1/7 (c) -0.3 (d) u d Let h = -20172 - -20172.5. What is the fifth biggest value in h, -1, 10, -0.4, 12? -1 Suppose -4t + 4 = -16. Let m = -17178 + 17192. Let a = -1.1 - -0.1. What is the third smallest value in m, t, a? m Let c = -271 + 1354/5. Let m = -11/30 - c. What is the smallest value in -3, 2/9, m? -3 Let g = 4 + -8. Let q be (88/(-33))/(4/(-192)). Suppose 0 = -6l + 38l - q. Which is the smallest value? (a) 0 (b) g (c) l b Let y = 8087 - 8088. Which is the third smallest value? (a) -2/7 (b) y (c) 1.8 (d) -6 (e) 0 a Let u = 10210 + -10194. What is the biggest value in u, 66, -3? 66 Let s = 7888 + -7877. Which is the third smallest value? (a) 13 (b) 2/19 (c) s a Suppose 2w = -18s + 13s + 13, 2w - 10 = -4s. What is the second smallest value in 32, w, -0.05? -0.05 Let i = 2390.5 + -2391. What is the second biggest value in -1/4, -5/4, 90, i? -1/4 Let p = -84 - -83.7. Suppose -2t = -7 - 21. Let u be (t/(-35))/((-4)/5). Which is the third smallest value? (a) u (b) -2 (c) p (d) 0.4 d Let k be 0 + 0 + -1 + -3. Let u = 9801 - 9796. What is the second biggest value in k, u, -0.5, 3/2? 3/2 Let u = 96 + -64. Let f = -32.2 + u. Let k be (-1)/(1/31). Which is the second biggest value? (a) k (b) f (c) -2/9 c Let h = 0.6 - 7.6. Let j = h - -7.3. Let p be 30/255 + 624/(-1547). What is the second biggest value in p, j, 5/3, 4? 5/3 Suppose 8z - 5z - 9o + 36 = 0, -2o = -2z - 4. Which is the fourth smallest value? (a) -17 (b) 1 (c) -1 (d) z d Suppose -3u - 2g = -0g - 9, 5g + 12 = 4u. Let r = 0.192 - 0.192. Which is the third biggest value? (a) u (b) r (c) -0.1 c Let q = 1719 + -1718.76. Let b = 0.5 - -0.5. What is the second smallest value in b, -0.4, q, 2? q Suppose 0 = -4z + 2s + 6, 2z - 5s - 5 = -14. Let f(d) = d + d*z - 7d - 2d2 + 11d - 4d. Let x be f(2). What is the smallest value in -2, 5/6, x, 1? -2 Let g = 0.1672 + 0.0328. Let d = 1909/5 + -5212/15. Let o = 35 - d. What is the third smallest value in 2, o, g? 2 Let o = -27 - -29. Suppose 0q = -oq + 8. Let d be ((60/(-16))/(-5))/((-99)/(-24)). Which is the second smallest value? (a) q (b) d (c) -0.5 b Let k = 14014 - 14014.33. Which is the biggest value? (a) 1/3 (b) k (c) 21 c Let w = 1141.7 + -1141.73. Let x = 1148/9 - 128. Which is the third biggest value? (a) w (b) -0.4 (c) x c Let y = -72.96 + 73. Let o = 36.96 + y. Let t = o - 35. Which is the third smallest value? (a) -1 (b) t (c) -3 (d) -4 a Let b(i) = 13i + i + i*2 - 3i2 - 35 + i2. Let n be b(11). What is the second smallest value in n, 0.03, 1? 0.03 Let m = -31.6 - -31.5558. Let n = 2.0442 + m. Which is the biggest value? (a) 1 (b) -20 (c) n c Let n = 0.405 - 0.185. Let o = n - 0.42. What is the fourth smallest value in -0.5, -0.4, 0, o? 0 Let t = 23560.01 - 23561. What is the biggest value in -0.3, t, -0.83? -0.3 Let m = 108750 - 17508840/161. Let j = m - -3/23. Which is the third smallest value? (a) j (b) 1 (c) 4 (d) 0.3 b Let d be 3(-2 - (-16)/9). Let w = 11009 + -11008.96. Which is the smallest value? (a) d (b) 0.6 (c) w a Let g(v) = 2v - 9. Let h be g(4). Let y = 18/41 + -77/82. Which is the smallest value? (a) h (b) 2 (c) y (d) -4 d Let t = -8182.3 - -8183. What is the biggest value in 1/4, 6, -4, t, 1? 6 Let p = -53 + -29. Let i be (-2)/4*p/123. What is the third smallest value in -39, 0.4, i? 0.4 Let l be (-2)/	{ "pile_set_name": "DM Mathematics" }
tors of 2488. 2, 311 What are the prime factors of 733? 733 What are the prime factors of 5727? 3, 23, 83 List the prime factors of 78201. 3, 8689 List the prime factors of 71824. 2, 67 What are the prime factors of 322? 2, 7, 23 List the prime factors of 770. 2, 5, 7, 11 What are the prime factors of 806? 2, 13, 31 List the prime factors of 6354. 2, 3, 353 What are the prime factors of 61366? 2, 61, 503 What are the prime factors of 1335? 3, 5, 89 List the prime factors of 90375. 3, 5, 241 List the prime factors of 505. 5, 101 What are the prime factors of 12681? 3, 1409 List the prime factors of 22634. 2, 11317 List the prime factors of 15289. 15289 List the prime factors of 1087. 1087 What are the prime factors of 608? 2, 19 What are the prime factors of 127135? 5, 47, 541 List the prime factors of 7242. 2, 3, 17, 71 What are the prime factors of 126? 2, 3, 7 What are the prime factors of 6836? 2, 1709 List the prime factors of 4810. 2, 5, 13, 37 What are the prime factors of 33624? 2, 3, 467 What are the prime factors of 1261? 13, 97 List the prime factors of 1914. 2, 3, 11, 29 What are the prime factors of 658? 2, 7, 47 List the prime factors of 1090. 2, 5, 109 List the prime factors of 143242. 2, 11, 17, 383 List the prime factors of 41034. 2, 3, 7, 977 List the prime factors of 2448. 2, 3, 17 List the prime factors of 29366. 2, 14683 What are the prime factors of 41190? 2, 3, 5, 1373 What are the prime factors of 69571? 29, 2399 List the prime factors of 19740. 2, 3, 5, 7, 47 What are the prime factors of 1859? 11, 13 What are the prime factors of 7096? 2, 887 What are the prime factors of 759? 3, 11, 23 What are the prime factors of 105? 3, 5, 7 What are the prime factors of 24535? 5, 7, 701 List the prime factors of 5086. 2, 2543 What are the prime factors of 49169? 49169 List the prime factors of 2236. 2, 13, 43 List the prime factors of 6608. 2, 7, 59 What are the prime factors of 110? 2, 5, 11 What are the prime factors of 34677? 3, 3853 List the prime factors of 87451. 7, 13, 31 List the prime factors of 14801. 19, 41 List the prime factors of 5627. 17, 331 List the prime factors of 7078. 2, 3539 What are the prime factors of 8896? 2, 139 What are the prime factors of 87169? 61, 1429 What are the prime factors of 5444? 2, 1361 List the prime factors of 268. 2, 67 What are the prime factors of 3744? 2, 3, 13 What are the prime factors of 10757? 31, 347 What are the prime factors of 1037? 17, 61 What are the prime factors of 9722? 2, 4861 List the prime factors of 22845. 3, 5, 1523 List the prime factors of 153209. 7, 43, 509 What are the prime factors of 704? 2, 11 List the prime factors of 1604. 2, 401 What are the prime factors of 1122? 2, 3, 11, 17 List the prime factors of 49115. 5, 11, 19, 47 List the prime factors of 727. 727 List the prime factors of 28353. 3, 13, 727 List the prime factors of 2229. 3, 743 What are the prime factors of 7955? 5, 37, 43 List the prime factors of 2469. 3, 823 List the prime factors of 1877. 1877 List the prime factors of 88340. 2, 5, 7, 631 List the prime factors of 99124. 2, 24781 List the prime factors of 1408. 2, 11 What are the prime factors of 1970? 2, 5, 197 What are the prime factors of 10246? 2, 47, 109 List the prime factors of 600. 2, 3, 5 List the prime factors of 1844. 2, 461 What are the prime factors of 542? 2, 271 What are the prime factors of 5700? 2, 3, 5, 19 List the prime factors of 5147. 5147 What are the prime factors of 6158? 2, 3079 List the prime factors of 19320. 2, 3, 5, 7, 23 What are the prime factors of 3239? 41, 79 What are the prime factors of 1470? 2, 3, 5, 7 List the prime factors of 33740. 2, 5, 7, 241 List the prime factors of 5709. 3, 11, 173 List the prime factors of 1993. 1993 What are the prime factors of 5500? 2, 5, 11 List the prime factors of 18171. 3, 673 List the prime factors of 21292. 2, 5323 What are the prime factors of 9569? 7, 1367 What are the prime factors of 3411? 3, 379 What are the prime factors of 722? 2, 19 What are the prime factors of 192227? 7, 3923 List the prime factors of 713. 23, 31 What are the prime factors of 3703? 7, 23 List the prime factors of 729. 3 What are the prime factors of 21480? 2, 3, 5, 179 List the prime factors of 126570. 2, 3, 5, 4219 List the prime factors of 115353. 3, 7, 1831 List the prime factors of 5560. 2, 5, 139 What are the prime factors of 35470? 2, 5, 3547 List the prime factors of 224. 2, 7 List the prime factors of 10408. 2, 1301 List the prime factors of 851. 23, 37 List the prime factors of 845. 5, 13 What are the prime factors of 19184? 2, 11, 109 List the prime factors of 539. 7, 11 What are the prime factors of 15187? 15187 List the prime factors of 2920. 2, 5, 73 What are the prime factors of 7541? 7541 List the prime factors of 27537. 3, 67, 137 List the prime factors of 1029. 3, 7 What are the prime factors of 37786? 2, 7, 2699 List the prime factors of 8904. 2, 3, 7, 53 What are the prime factors of 33803? 7, 11, 439 What are the prime factors of 261? 3, 29 List the prime factors of 1300. 2, 5, 13 What are the prime factors of 33305? 5, 6661 What are the prime factors of 2332? 2, 11, 53 What are the prime factors of 3511? 3511 What are the prime factors of 29279? 19, 23, 67 What are the prime factors of 22838? 2, 19, 601 List the prime factors of 72926. 2, 7, 5209 What are the prime factors of 13150? 2, 5, 263 What are the prime factors of 3128? 2, 17, 23 List the prime factors of 3647. 7, 521 List the prime factors of 13946. 2, 19, 367 List the prime factors of 8135. 5, 1627 List the prime factors of 609. 3, 7, 29 What are the prime factors of 12397? 7, 11, 23 List the prime factors of 7303. 67, 109 What are the prime factors of 14905? 5, 11, 271 List the prime factors of 855. 3, 5, 19 List the prime factors of 885. 3, 5, 59 What are the prime factors of 98313? 3, 32771 What are the prime factors of 1149? 3, 383 List the prime factors of 1425. 3, 5, 19 What are the prime factors of 1157? 13, 89 What are the prime factors of 10435? 5, 2087 What are the prime factors of 8271? 3, 919 List the prime factors of 9102. 2, 3, 37, 41 List the prime factors of 2787. 3, 929 List the prime factors of 6. 2, 3 What are the prime factors of 20249? 20249 What are the prime factors of 6097? 7, 13, 67 List the prime factors of 85321. 41, 2081 What are the prime factors of 45026? 2, 47, 479 What are the prime factors of 4350? 2, 3, 5, 29 What are the prime factors of 2809? 53 List the prime factors of 12953. 12953 What are the prime factors of 106316? 2, 7, 3797 List the prime factors of 88578. 2, 3, 7, 19, 37 What are the prime factors of 513? 3, 19 List the prime factors of 72030. 2, 3, 5, 7 List the prime factors of 1122. 2, 3, 11, 17 List the prime factors of 49639. 49639 List the prime factors of 5922. 2, 3, 7, 47 What are the prime factors of 402? 2, 3, 67 What are the prime factors of 8? 2 What are the prime factors of 17902? 2, 8951 List the prime factors of 8697. 3, 13, 223 What are the prime factors of 9142? 2, 7, 653 What are the prime factors of 377? 13, 29 What are the prime factors of 8460? 2, 3, 5, 47 List the prime factors of 149. 149 What are the prime factors of 10402? 2, 7, 743 List the prime factors of 71107. 211, 337 List the prime factors of 2720. 2, 5, 17 List the prime factors of 40488. 2, 3, 7, 241 List the prime factors of 2278. 2, 17, 67 List the prime factors of 2223. 3, 13, 19 What are the prime factors of 1024? 2 What are the prime factors of 624? 2, 3, 13 List the prime factors of 39. 3, 13 List the prime factors of 56860. 2, 5, 2843 What are the prime factors of 4043? 13, 311 What are the prime factors of 134545? 5, 71, 379 List the prime factors of 3006. 2, 3, 167 List the prime factors of 1896. 2, 3, 79 List the prime factors of 669. 3, 223 List the prime factors of 2860. 2, 5, 11, 13 List the prime factors of 1713. 3, 571 What are the prime factors of 614? 2, 307 List the prime factors of 43065. 3, 5, 11, 29 What are the prime factors of 1517? 37, 41 What are the prime factors of 8674? 2, 4337 List the prime factors of 23273. 17, 37 List the prime factors of 1671. 3, 557 What are the prime factors of 21661? 21661 List the prime factors of 5853. 3, 1951 List the prime fac	{ "pile_set_name": "DM Mathematics" }
+ 11o. Suppose -212 = 18h - oh. What are the prime factors of h? 53 Suppose -12o + 17o - 8330 = 0. Let n = -958 + o. Suppose -n = -3v - 3v. List the prime factors of v. 2, 59 Suppose 4i + 86v - 40408 = 85v, 8 = -2v. List the prime factors of i. 10103 Let g = -29 + 3825. Suppose -81c = -94c + g. What are the prime factors of c? 2, 73 Let n(d) = -d3 - 5d*2 - 8d - 10. Let h be n(-4). Suppose 4c - 306 = -y, -h = -5y + 2y. Suppose -3z + 331 - c = 0. What are the prime factors of z? 5, 17 Let q(a) be the third derivative of -7a5/20 - 10a*2. Let i be q(-1). Let m = i - -36. What are the prime factors of m? 3, 5 Let l(n) = -2n*2 - 27n + 91. Let c(m) = -m*2 - 14m + 45. Let r(h) = 5c(h) - 2l(h). Let g be r(-18). List the prime factors of g-5(-4 - 16/56). 2, 3, 5 Let b(z) = 3z - 26. Let u(t) = 5t + t + t - 8t. Let v(s) = -b(s) - 2u(s). What are the prime factors of v(10)? 2 What are the prime factors of (0 + 14 + -21)-1360? 2, 5, 7, 17 Let n = -36 + -280. Let b = 226 + n. Let c = 191 + b. What are the prime factors of c? 101 Suppose 0 = -11c - 9758 + 60083. Suppose -596g + 601g - c = 0. List the prime factors of g. 3, 5, 61 Suppose 21f = m + 22f - 8855, -44219 = -5m + 3f. List the prime factors of m. 2, 7, 79 Suppose 0 = -33t - 76t + 14t + 689035. List the prime factors of t. 7253 Suppose -5888 = -3w - 58y + 56y, -9825 = -5w - y. What are the prime factors of w? 2, 983 Let t be 2/(-1) - (-1049 - 1). Suppose -3x - x = -t. Let f = x + -172. What are the prime factors of f? 2, 3, 5 Let q(f) be the second derivative of 13f - 5f*2 - 1/2f*4 + 1/20f*5 + 0 + 7/6f*3. What are the prime factors of q(7)? 2, 11 Let l = 196 + -49. Suppose -d = -l + 4. What are the prime factors of d? 11, 13 Suppose 3a = -9 - 3, -5q - a - 79 = 0. List the prime factors of (-43)/(-1) + (-5)/((-25)/q). 2, 5 Let w be 30/(-8) + 3 - (-93)/(-4). Let g be w/120 + ((-196)/10)/2. List the prime factors of 6(2/g)/((-16)/1320). 3, 11 Let j = 29052 - 19913. What are the prime factors of j? 13, 19, 37 Let m(k) = 24k2 + 10k - 60. What are the prime factors of m(26)? 2, 2053 Suppose -4o + 3o + 5v = 20, 5o = -5v - 250. Let l = o + 50. List the prime factors of (84 - 1) + l + -8. 2, 5 Suppose 308u + 22u - 532220 = 31u. What are the prime factors of u? 2, 5, 89 Suppose 219346 = 31l - 2614. What are the prime factors of l? 2, 5, 179 Suppose -23423 = -14k + 37916 + 42863. List the prime factors of k. 3, 827 Let o = 542 - 781. Let k = 165 + o. Let f = k - -157. What are the prime factors of f? 83 Suppose 6 = 14w - 12w. Suppose wq = -4m + 3682, 0 = -q - 0q - m + 1229. What are the prime factors of q? 2, 617 Let m(v) = -89v*2 + 20 + 13v + 191v2 + 3 - 85v2. What are the prime factors of m(8)? 3, 5 Let g(u) = u2 + 9u - 93. Let t be g(17). Let i = 631 - t. What are the prime factors of i? 2, 3, 47 What are the prime factors of 6/(-93) + 12 + (-15722720)/(-248)? 2, 5, 17, 373 Suppose 0 = 8m - 18m + 29430. Suppose -a + m = 4x, -2a = 5 - 3. What are the prime factors of x? 2, 23 Suppose 0 = -15s + 11s + 196. Let r = -47 + s. Suppose -ra - 4o = -6, a + o - 7 = -0. List the prime factors of a. 11 Let w = -14 - -16. Suppose 2c = m - 20, -wm + 3 + 5 = 0. Let k(t) = -t3 - 9t*2 - 16t - 9. What are the prime factors of k(c)? 5, 11 Let a = 43998 + -25806. What are the prime factors of a? 2, 3, 379 Suppose 0b + 2b - 12 = 0. Suppose 8q = 10q - b. Suppose 5z = -3d + 3 + 15, 3z + qd - 12 = 0. List the prime factors of z. 3 Let y = 111503 + -75841. What are the prime factors of y? 2, 11, 1621 Let k(v) be the second derivative of 40v3/3 - 9v*2 - 136v. What are the prime factors of k(2)? 2, 71 Let s = -4892 - -11303. List the prime factors of s. 3, 2137 Let n(h) = h*3 - 33h*2 - 68h - 40. What are the prime factors of n(36)? 2, 5, 7 What are the prime factors of (-3 + 150/35)(17 - -2664)? 3, 383 Suppose 804 = 24r - 23r - 505. What are the prime factors of r? 7, 11, 17 Suppose -2q + 916 + 372 = 0. Let w = 1629 - q. What are the prime factors of w? 5, 197 What are the prime factors of (-5)/(-40) + (5 - (-92895)/8)? 11617 Let x(g) = -g*3 - 12g*2 - 2g - 20. Let h be x(-12). Suppose -hu + z + 164 + 2250 = 0, -2u = 3z - 1200. List the prime factors of u. 3, 67 List the prime factors of (-438 - -435) + (1 + -3)/((-2)/38737). 2, 107, 181 Let w = -2350 - -13129. What are the prime factors of w? 3, 3593 What are the prime factors of (104503/3 - 13) + (-30)/(-18)? 97, 359 Let o(f) = 73f*3 - 3f + 7. Let b be o(-4). List the prime factors of 4 + 21/(-5) + b/(-15). 2, 5, 31 Let x be (298 - 15)/((-1)/1). Let j = -259 - x. What are the prime factors of j? 2, 3 Let u(n) = 2n2 + 6n - 31. Suppose -18 = -2q - 2h, 6q + 4h + 24 = 8q. List the prime factors of u(q). 229 List the prime factors of (-1(2 + -1))/(-15 + (-508764)/(-33918)). 5653 Let j(k) = 170k + 1. Let c(u) = u + 2. Let n(m) = -6c(m) - j(m). List the prime factors of n(-1). 163 List the prime factors of (-13)/39 - (-41672)/24. 2, 7, 31 Let l be (-12)/(-66) - (-31)/11. Suppose 2p + 4 = 2k, -lp = 3k + 20 + 4. What are the prime factors of (k - 1)1-13? 2, 13 Let l = 110589 - 62715. What are the prime factors of l? 2, 3, 79, 101 Let m be 18/(4/20 - 14/(-80)). Suppose -5x = -x + b + m, -3b - 1 = x. List the prime factors of -18/52 - 2004/x. 2, 7, 11 Let h(x) = 20x*2 + 17x + 8. Let i be h(-6). Suppose -9k = -427 - i. What are the prime factors of k? 3, 13 List the prime factors of (19 + -4 - -20384)1. 20399 Let w(d) = 2848d2 - 17d + 54. What are the prime factors of w(4)? 2, 22777 Let a be (110/2 - -3) + 4. Let l = 989 + a. List the prime factors of l. 1051 Let s = -623 - -1155. Let a = s + -286. What are the prime factors of a? 2, 3, 41 Let t(q) = -6q + 83. Let v be t(13). Let y(f) = 5f*3 + 12f*2 - 7f + 17. What are the prime factors of y(v)? 907 What are the prime factors of 08/(-40) - (740-27)/3? 2, 3, 5, 37 Suppose 4x - 5x - 3j + 2347 = 0, 0 = 2x - 3j - 4694. Let i = -1025 + x. What are the prime factors of i? 2, 661 Suppose 0 = 5v + 4z - 76, -4z - 49 = -4v - 17. Let x be 4 + -1 - -12(-4)/v. List the prime factors of 76 + 2 + x/1. 7, 11 Let p be 0 + (0 - 2/2). Let s = 33 + p. List the prime factors of s. 2 Suppose 40u = -93u + 562723. List the prime factors of u. 4231 Suppose 4p + 2b = 1303 + 2055, -2p + b = -1689. List the prime factors of p. 2, 421 Let t be 291/(7/((-14)/3)). Let m = 446 + t. List the prime factors of m. 2, 3, 7 Suppose -m - 76 + 78 = 0. Suppose -2q - mu = -7u - 1419, 0 = -3q + u + 2122. What are the prime factors of q? 7, 101 Let x(d) be the first derivative of 787d*3/3 - 2d + 174. List the prime factors of x(1). 5, 157 List the prime factors of ((-12)/10)/(120/(-891800)). 2, 7, 13 Let l be 8 - (2 + -2 - -3). Suppose -lx = -217 - 53. Let o = -33 + x. List the prime factors of o. 3, 7 Let m be 64/(-480) + (-2)/(-15). Suppose m = -4i + 540 + 276. List the prime factors of i. 2, 3, 17 Let g(h) = 136h - 84. Let s be g(18). Suppose b - s = -5b. What are the prime factors of b? 2, 197 Suppose -3 = -2j + 1. Let p be j/((-22)/(-20) - 21/35). Suppose 0 = pt - 601 - 191. List the prime factors of t. 2, 3, 11 Let k(n) = -140n + 4. Let b(d) = -209d + 5. Let r(v) = 5b(v) - 7k(v). What are the prime factors of r(-5)? 2, 7, 23 Let z = -17782 + 32946. List the prime factors of z. 2, 17, 223 Let j(x) = -x*3 - 83x*2 - 164x + 92. What are the prime factors of j(-83)? 2, 3, 571 Suppose 9d - 4y = 4d + 45871, -2d = -4y - 18358. What are the prime factors of d? 3, 1019 Let o(x) = -x3 + 9x*2 + 11x - 10. Let q be o(10). Suppose -2c - c + 54 = q. Let n = c + 5. What are the prime factors of n? 23 Suppose 3h - 8 = p - 584, 1119 = 2p + 5h. Suppose 14u - p = 7u. What are the prime factors of (-18)/u - (-398)/9? 2, 11 Suppose 2p - 34354 = -v, 0 = -187p + 184p - v + 51529. What are the prime factors of p? 3, 5, 229 Suppose -j - 224 = -3r - 5j, 4 = -j. List the prime factors of (r/(-15) - -2)/(4/(-246)). 5, 41 Suppose 27c - 49c + 88 = 0. Suppose -4444 = -ca + 4x, 3x - 1504 + 385 = -a. What are the prime factors of a? 3, 7, 53 Suppose 17405625 = 71s + 76	{ "pile_set_name": "DM Mathematics" }
1292l = -2200 for l. 55 Solve -131d = -804d - 673 for d. -1 Solve 77v - 4440 = 49v - 24v - 8v for v. 74 Solve -35c = -402c - 96c - 60190 for c. -130 Solve 325877 - 327137 = -35l for l. 36 Solve 284h + 1925 - 26065 = 0 for h. 85 Solve 2420100g = 2420215g + 1725 for g. -15 Solve -243h + 3043h = 29h + 25002 + 66441 for h. 33 Solve -4411p - 68746 = -3482p for p. -74 Solve -192r = 210r + 17286 for r. -43 Solve 0 = -1110i + 1207i - 2522 for i. 26 Solve -236s - 7984 = -7276 for s. -3 Solve -265w - 492 = 673 - 230 + 920 for w. -7 Solve -24243 + 168365 = 3188y - 6822 - 30772 for y. 57 Solve 0 = 1113z - 3650824 + 3713152 for z. -56 Solve -47o - 32 = -30 + 656 for o. -14 Solve 8y + 506328 = -3086y - 3246y - 3588y for y. -51 Solve 3165y = 12074y + 605812 for y. -68 Solve 341l = 22568 - 26319 for l. -11 Solve -205m + 9169 = -8430 - 4507 + 581 for m. 105 Solve -241w - 13534 + 4200 = -19602 - 20580 for w. 128 Solve -476l + 21 - 53 + 17 = -15 for l. 0 Solve 1212x - 29640 = -270x for x. 20 Solve 81k + 4467 + 1747 - 2569 = 0 for k. -45 Solve -31k + 79373 = 80024 for k. -21 Solve 31 = -4o - 27o - 22 - 9 for o. -2 Solve -12491h + 43950 = -11612h for h. 50 Solve -2488i = 1704i + 222176 for i. -53 Solve -132 - 340 = -176b - 60b for b. 2 Solve -2087t + 29363 - 7998 = -97594 for t. 57 Solve 1214x + 33383 = -754x - 57145 for x. -46 Solve 1262d + 1229d - 30640 - 66320 = -3569d for d. 16 Solve 14809g = 39610 - 57301 + 521197 for g. 34 Solve 1641y + 1732y - 81961 = 186y + 144316 for y. 71 Solve 2621i + 1110i = 59i - 117504 for i. -32 Solve -79c - 638 = 1492 - 285 + 604 for c. -31 Solve 1585g - 1210g + 36750 = 0 for g. -98 Solve -382597l - 34983 = -382298l for l. -117 Solve 274o = 682 + 2299 + 2545 + 1598 for o. 26 Solve -14r - 579 + 2211 = -62r for r. -34 Solve 415303 = 405t + 369133 for t. 114 Solve -27504 = -2192s + 3550s + 109654 for s. -101 Solve 341j + 85j - 12933 = -34j - 19j for j. 27 Solve -2518796u - 470 = -2518806u for u. 47 Solve 0 = 33c - 73c - 62c - 63c + 165 for c. 1 Solve 30q + 445 + 1384 = 812 - 183 for q. -40 Solve -438t = 153t + 415t + 3378 - 14444 for t. 11 Solve -750w = -21391 + 13141 for w. 11 Solve 0 = 66r - 632 + 1292 for r. -10 Solve -34c - 69c - 2000 - 472 = 0 for c. -24 Solve 0 = -5688n - 189215 + 843335 for n. 115 Solve 14679 = 1927n + 89832 for n. -39 Solve -4321 = 96i - 1075 + 2706 for i. -62 Solve -412648o = -412669o + 273 for o. 13 Solve -9f - 633f - 650f = -385f + 27210 for f. -30 Solve 821420 = 233t + 794625 for t. 115 Solve -3812 - 2194 = -369d + 3724 + 3185 for d. 35 Solve 157022l - 156927l + 1520 = 0 for l. -16 Solve -62q - 1049 = 3324 + 277 for q. -75 Solve -1549c = -327c + 53c + 109650 for c. -86 Solve 0 = -1632p - 32697 - 60327 for p. -57 Solve 13869 + 10991 = -477s - 16658 + 4312 for s. -78 Solve -23554 - 70569 + 1369 = -657d - 14571 for d. 119 Solve 0 = 1272t - 924t + 829 + 215 for t. -3 Solve 0 = 2280k - 2138k + 5901 + 347 for k. -44 Solve 1418p + 75149 + 171109 = -1195p + 45057 for p. -77 Solve 350q = 151q + 245q + 2300 for q. -50 Solve 27581g + 1134 = 27659g + 350 - 2882 for g. 47 Solve 0 = 264m + 327 - 10095 for m. 37 Solve -3627 - 6891 = -383d + 93d + 4852 for d. 53 Solve 1295 = 70a + 41a - 3367 for a. 42 Solve -373k - 2524 = -364k - 1948 for k. -64 Solve 847681o - 14398 + 4963 = 847766o for o. -111 Solve -113b + 15515 = -459b - 1093 for b. -48 Solve 41482 - 77538 = -732t - 2984t + 131164 for t. 45 Solve 0 = 3275c - 3607c + 1992 for c. 6 Solve 2024t + 31497 = 805t - 89184 for t. -99 Solve -10712 = 733g - 249g + 13972 for g. -51 Solve -21r = -3r + 55r + 3413 - 566 for r. -39 Solve -90z - 2843 = -4935 + 2452 for z. -4 Solve 2t + 47t = 780 - 32 + 1653 for t. 49 Solve -9o - 7o = 7o - 60o + 4477 for o. 121 Solve 449765 = -31u + 448525 for u. -40 Solve 48w - 135w + 1077 = 207 for w. 10 Solve -397x = 6678 - 2073 + 4755 + 2947 for x. -31 Solve 179u - 21430346 = -21416205 for u. 79 Solve 23t - 7882 + 1506 = 472t + 1706 for t. -18 Solve 187k - 8835 + 4079 - 14436 = -1614 for k. 94 Solve -40781 = -1591o + 73416 + 8310 for o. 77 Solve -352q + 1783q - 7820 - 23662 = 0 for q. 22 Solve -174i - 111142 + 124192 = 0 for i. 75 Solve 133q + 14q + 4433 = 4q for q. -31 Solve 123b + 21b = 29b + 1955 for b. 17 Solve 861i - 46576 - 61049 = 0 for i. 125 Solve 126104 - 131894 = -579w for w. 10 Solve -1582793 + 1607639 = 303r for r. 82 Solve -339f = 11060 - 853 + 15774 - 556 for f. -75 Solve -94 - 293 + 111 = -138q for q. 2 Solve 2494v - 248812 = -49292 for v. 80 Solve -1773410p + 1773450p + 1680 = 0 for p. -42 Solve -676n + 11990 = 144n + 379n for n. 10 Solve 784r - 150r - 6386 + 49498 = 0 for r. -68 Solve 4445f - 7218f = -16638 for f. 6 Solve 7a + 7296 = 183a - 2502 + 2054 for a. 44 Solve 10050 - 16306 = -678j + 7328 + 14214 for j. 41 Solve -569p = -912p + 18522 for p. 54 Solve -5615 - 19473 = -512n for n. 49 Solve 4582 - 83289 = -1552a - 26a - 2963 for a. 48 Solve 827 = -1883l - 423l + 67701 for l. 29 Solve 256 = -50b + 16b - 458 for b. -21 Solve 0 = 420z + 1354z + 1672z + 17721 - 169345 for z. 44 Solve -1359s - 344s = -9387 - 17861 for s. 16 Solve 38n - 40n + 373 = 41n - 5045 for n. 126 Solve 115h + 1481 = 3781 for h. 20 Solve 13656 + 149392 = 1832c for c. 89 Solve -28u - 941 = -2201 for u. 45 Solve 2045 = -82i - 93i - 55 for i. -12 Solve -979c = 89c + 198c + 65c + 3993 for c. -3 Solve 61p + 40p = -2p - 18p + 3509 for p. 29 Solve -4988 + 2231 - 45678 - 64843 = -5149a for a. 22 Solve 32o + 13o + 5122 = 242o for o. 26 Solve 2911x - 3 - 1401 = 3028x for x. -12 Solve 185922 - 567910 = 7755m + 5417m for m. -29 Solve 25j + 219 = 975 + 2253 + 416 for j. 137 Solve 10h - 917 = -757 for h. 16 Solve 323g = 266g + 829g + 1071g - 93993 for g. 51 Solve 27f - 1502 + 3166 = -18f - 46 for f. -38 Solve 458p - 214p = -977p + 74481 for p. 61 Solve 93990 + 296281 = 6746l - 33326 - 176797 for l. 89 Solve 0 = 3228k - 3294k - 792 for k. -12 Solve -72k + 17003 = 12611 for k. 61 Solve -82v = 50v - 14v - 3304 for v. 28 Solve 2355i - 2011i + 344 = 0 for i. -1 Solve 904k - 12509 - 9511 = 170k for k. 30 Solve -2314t - 84015 - 64081 = 0 for t. -64 Solve 0 = 128o + 1458717 - 1447709 for o. -86 Solve 1343 = 777r + 3684 + 7760 for r. -13 Solve 0 = -191i + 35i - 2402 - 2085 - 1909 for i. -41 Solve 159v = 36v + 1182 - 444 for v. 6 Solve -1937o = 22327 + 90019 for o. -58 Solve 37g + 171 - 619 = 23g for g. 32 Solve -953s + 1648 = 379s - 1016 for s. 2 Solve -97b + 69043 = 59537 for b. 98 Solve -53b + 3b - 7398 = 3b - 190b for b. 54 Solve 868o = -295o - 1542o - 232630 for o. -86 Solve 70p - 744p + 321 = -391p + 14188 for p. -49 Solve -84362 + 43267 = -2635q + 80115 for q. 46 Solve -114i + 41769 + 69 = -134i - 347i for i. -114 Solve 2230i - 26026 = -168746 for i. -64 Solve 411t = -1085 + 8483 for t. 18 Solve 57c + 47c + 8715 = 38c - 39c for c. -83 Solve 32m - 5775 = 130m + 497 for m. -64 Solve 89 = 125x - 50x - 96 - 715 for x. 12 Solve 3689 - 280 + 2587 = -192f + 1388 for f. -24 Solve -1893 - 639 = -488l + 2854 + 958 for l. 13 Solve 2072271 - 2070908 = 47k for k. 29 Solve 37x + 64x - 85x + 240 = 0 for x. -15 Solve 175d = -175d - 162d + 463d + 1960 for d. 40 Solve 441o = -170o - 914o + 263o - 45432 for o. -36 Solve -16s - 96 + 2573 = 32s - 1123 for s. 75 Solve 8354f - 431636 - 298613 = -64320 + 19099 for f. 82 Solve 1155574 = 24204y - 2596046 for y. 155 Solve -1901780 = 147a - 1912658 for a. 74 Solve 77c + 463c - 3543 + 11278 = 85c for c. -17 Solve 0 = 4531n - 14771n for n. 0 Solve 270s + 15196 = 532s for s. 58 Solve -2357h - 137207 - 72931 = -47505 for h. -69 Solve 549913s = 549742s - 12825 for s. -75 Solve -10827n - 84326 - 6316 = 4280n for n. -6 Solve -1856465 = -9510h + 38071h for h. -65 Solve -107796q + 107917q = 2541 for q. 21 Solve -124q + 167q = 120q + 2695 for q. -35 Solve 29 = -96x - 252x + 725 for x. 2 Solve -44n - 30n = 43n - 32n + 6035 for n. -71 Solve -377541 = -20c - 378881 for c. -67 Solve 3672 = 9517f - 9449f for f. 54 Solve 2506n - 5264n +	{ "pile_set_name": "DM Mathematics" }
actor t(m). -2(m + 1)2(m + 4)(m + 40) Let l = -149449/21 - -7117. Let g(i) be the third derivative of li*3 + 0 + 2/21i*4 + 1/105i*5 + 0i - 7i2. Factor g(j). 4(j + 2)*2/7 Suppose -182q - 1318 = -841q. Solve -2/9a*q + 152/9a - 2888/9 = 0 for a. 38 Let x(s) = 14468s + 28940. Let m be x(-2). Solve 8/15w + 56/15w2 - 2/5w*m - 32/15 + 2/3w3 = 0 for w. -2, -1, 2/3, 4 Let h(r) be the third derivative of r5/60 + 7r4/12 - 369r3/2 + r2 + 3r + 107. Solve h(w) = 0 for w. -41, 27 Let l = -459895/3 + 154029. Determine j, given that -196j*5 - 268j*3 - 5432/3j*4 + lj + 96 + 1448j2 = 0. -9, -2/3, -2/7, 1 Let m be 322/42 - ((-609)/(-126) + (-1)/(-6)). Factor 2r*2 + 0r - m - 2/3r3. -2(r - 2)*2(r + 1)/3 Let o = 11 - 4. Suppose 3d + 52 = od. Factor -c*4 - 14c*3 + dc*3 + 0c*2 + 0c2. -c3(c + 1) Let r(q) be the first derivative of -q6/90 - q5/6 + 131q + 165. Let h(o) be the first derivative of r(o). Factor h(j). -j*3(j + 10)/3 Suppose 3v - 45v + 9v = 29v. Let f(a) be the second derivative of -15/2a3 - 4a + 10a2 + 5/2a*4 - 1/4a*5 + v. Solve f(o) = 0. 1, 4 Suppose 13 = 5f + 2r + 2, 2f - 2r + 4 = 0. Let u be 2025/(-360)(f - -1 - 14). Suppose up + 25/2p*3 + 135/4 + 45p*2 + 5/4p*4 = 0. What is p? -3, -1 Let 6x*3 - 388x + 827x2 - 276 + 109x - 278x2 = 0. What is x? -92, -1/2, 1 Let w(g) = -10g*3 - 36g*2 - 16g. Let d(s) = -4s + 52. Let b be d(17). Let o(u) = 3u*3 + 12u*2 + 5u. Let t(i) = bo(i) - 5w(i). Factor t(m). 2m2(m - 6) Let w(t) be the third derivative of t*5/220 - 173t*4/132 - 116t*3/33 - 1420t*2. Determine i, given that w(i) = 0. -2/3, 116 Find q, given that 311q - 282 + 29 - 40 + q*2 - 374 + 41 = 0. -313, 2 Let r be 4(-1 + 112/64). Let s(i) be the third derivative of 0ir + 0i + 1/165i5 + 1/660i*6 + 1/132i*4 + 25i*2 + 0. Let s(t) = 0. What is t? -1, 0 Let k = 247041/7 + -36057. Let n = -764 - k. What is o in no + 2o2 - 4/7 = 0? -1, 2/7 Suppose 0 = 2z + 8, -4j + 9j - 100 = -5z. Let p(n) be the first derivative of 69/2n*2 + 31 + 3n*3 - jn. Determine r, given that p(r) = 0. -8, 1/3 Let z be 0/((1 - 4)/((-3)/2)). Suppose 2d + 2o + 10 - 6 = 0, z = -d - 4o - 14. Factor 2/3h - 2/3h3 - 1/3 + 1/3h*4 + 0hd. (h - 1)3(h + 1)/3 Let v(u) be the first derivative of -u7/63 + 2u*6/45 + 2u*5/15 - 4u*4/9 + 79u + 39. Let x(o) be the first derivative of v(o). Factor x(i). -2i2(i - 2)*2(i + 2)/3 Let c(f) be the third derivative of -236f2 + 0f + 1/210f5 - 5/42f*4 + 0 + 3/7f3. Suppose c(o) = 0. Calculate o. 1, 9 Let x(l) = l3 + 27l2 - 91l - 28. Let v(f) = f*2 + 13f - 8. Let z be v(-11). Let q be x(z). Factor 3/2 + 7/8b2 + 1/8b*3 + qb. (b + 2)*2(b + 3)/8 Let j(r) be the second derivative of -3r + 0r*3 - 1/21r*7 - 1/2r*5 + 0r*2 + 1/3r*4 + 9 + 4/15r*6. Factor j(x). -2x*2(x - 2)(x - 1)2 Let p(j) be the first derivative of 6j*5/7 - 74j*4/7 - 1150j*3/21 - 464j*2/7 - 104j/7 - 2672. Determine a so that p(a) = 0. -2, -1, -2/15, 13 Let s be 3/((-38)/(-4) + -8). Suppose 291j + 4036 + 163j - 314j - 1586 + 2j*s = 0. Calculate j. -35 Let i(k) be the second derivative of 1/40k*5 + 14k*3 + 4 - 25/24k*4 - 7k - 36k2. Let i(a) = 0. Calculate a. 1, 12 Suppose 37 = -3l + 2l - 5p, 2p = l + 30. Let q = l + 34. Factor -20f*3 + 10f*2 - 3f*4 - 8f - 8f - f4 - 42f*q. -4f(f + 1)(f + 2)*2 Let k(n) = -371n*2 - 385n + 16. Let b(a) = -370a2 - 380a + 15. Let s(u) = -6b(u) + 5k(u). Suppose s(r) = 0. Calculate r. -1, 2/73 Let s(t) = -14t4 + 28t*3 + 21t*2 - 112t. Let o(i) = 34i4 - 70i*3 - 52i*2 + 280i. Let j(p) = 5o(p) + 12s(p). Find w such that j(w) = 0. -2, 0, 2, 7 Let f(u) be the first derivative of 2u5/25 - 25u*4/2 - 344u*3/5 + 4096. Let f(k) = 0. What is k? -4, 0, 129 Let l(h) = -8h*3 - 772h*2 + 3188h - 3236. Let y(z) = 9z3 + 769z*2 - 3189z + 3245. Let b(v) = -5l(v) - 4y(v). Let b(m) = 0. Calculate m. -200, 2 Let d be 34((1 - 6) + (-5137)/(-1023)). Let z = d - 2/31. Factor 8/3 + zk*2 + 8/3k. 2(k + 2)2/3 Let w be (-12)/(-40)((-4354)/336 + 14). Let j(x) be the second derivative of 11x + 0x*2 + 3/80x*5 + 0 + wx*4 + 0x*3. Suppose j(p) = 0. What is p? -5, 0 Factor -413m + 1561m + m2 + 314 + 224m + 3m2 + 1054. 4(m + 1)(m + 342) Let m(k) = k4 + 3k*3 + k - 1. Let l(b) = -7b*4 - 3b*3 + 252b*2 + 812b + 580. Let c(t) = l(t) + 4m(t). Find h, given that c(h) = 0. -4, -1, 12 Let f(s) be the third derivative of -s7/525 + s6/75 - s5/25 + s4/15 - s3/15 + 1114s*2. Factor f(n). -2(n - 1)*4/5 Let z = 118695 + -118692. Find d such that 6/7 + 2/7d*z + 10/7d*2 + 2d = 0. -3, -1 Let p(i) be the first derivative of i*6/6 + 652i*5/5 - 3i*4/4 - 1958i*3/3 - 652i2 + 9951. Determine l, given that p(l) = 0. -652, -1, 0, 2 Let i(k) be the third derivative of k6/960 + 37k5/96 + 6691k2. Factor i(a). a2(a + 185)/8 Let o(k) be the second derivative of -k5/120 + 83k*4/72 - 1015k*3/36 + 1127k*2/4 + 2k + 1860. Let o(g) = 0. Calculate g. 7, 69 Factor 147y2 + 1444/3y - 1/3y4 + 8y*3 + 444. -(y - 37)(y + 2)*2(y + 9)/3 Determine k so that 0 - 1/7k4 + 15/7k*3 + 0k - 2k2 = 0. 0, 1, 14 Let d(m) = 22m*2 + 6m - 1. Let v be d(-1). Let s be (72/495)/(2/v). Factor 4/11l5 + sl*4 + 6/11l*2 + 1/11l + 0 + 13/11l3. l(l + 1)*2(2l + 1)2/11 Let m be ((-168)/(-16))/(5 + (-36)/8). Suppose mv - 120 = 11v. Factor 1/3p*2 + v + 4p. (p + 6)*2/3 Let r(u) = 11u*2 + 264u - 752. Let s(c) = -2c2 - 52c + 150. Let f(h) = -3r(h) - 16s(h). Factor f(p). -(p - 36)(p - 4) Let x = 2229/2 - 44579/40. Let u(l) be the third derivative of -3l*3 + 0 - 7/8l*4 + 18l*2 + 0l*5 + xl*6 + 0l. Determine v so that u(v) = 0. -2, -1, 3 Let t(m) be the third derivative of m*6/240 + 17m*5/120 + 11m*4/8 + 69m*2 + 6m - 2. Determine a, given that t(a) = 0. -11, -6, 0 Factor 130m + 50 + 2053m*3 + 62m*2 + 15 - 2055m*3 + 1. -2(m - 33)(m + 1)2 Let y be 5(-156)/(-90)24. Solve -108o*5 - 110o*5 + 148o*3 + yo*5 - 366o4 = 0 for o. -37, 0, 2/5 Let w(n) be the third derivative of n5/15 - 103n4/6 + 264n*3 - 8232n*2. Determine h so that w(h) = 0. 4, 99 Let m(b) be the third derivative of 1/315b*7 + 0 + 0b + 0b3 + 1/90b*6 + 33b*2 + 0b*4 + 0b*5. Let m(v) = 0. What is v? -2, 0 Let y be (-1)/2(105/56 + 11070/(-1296)). Determine r so that -10/3r2 + yr*4 - 8/3r*3 - 1/3r*5 + 0 + 3r = 0. -1, 0, 1, 9 Let p = 40 + -31. Suppose -1 - 9 = -5m. Solve c2 + 16c + 32 + pc2 - 8cm = 0 for c. -4 Let n(t) = t2 + 98t - 622. Let a be n(6). Let k(p) be the second derivative of 1/4p*3 - 1/2p*a - 1/24p*4 + 0 - 17p. Let k(x) = 0. What is x? 1, 2 Let k(c) be the second derivative of -1 + 3/2c2 + 5/4c*4 - 3/10c*5 - 2c*3 - 84c. Solve k(z) = 0. 1/2, 1 Find x, given that -1267 - x*4 + 669 - 8x*3 - 100x + 650 + 57x2 = 0. -13, 1, 2 Factor 0u + 0 - 35u3 + 190/3u*2 + 5/3u*4. 5u*2(u - 19)(u - 2)/3 Factor 0 - 3/5c*2 - 36c. -3c(c + 60)/5 Let x(o) be the second derivative of 0o5 + 1/135o*6 + 1/9o*2 + 0o*3 - 2o - 1/27o4 - 6. Find f, given that x(f) = 0. -1, 1 Let v(u) be the third derivative of -u7/630 + u6/360 + 4u5/45 - u4/18 - 8u3/3 + 2u*2 - 8u + 6. Let v(d) = 0. What is d? -3, -2, 2, 4 Let u = -2707224/5 - -541445. Determine z so that 0z - uz*5 + 0z*2 + 0 + 0z*3 + 0z*4 = 0. 0 Find p such that -2/3p*2 + 24p + 74/3 = 0. -1, 37 Let t(b) be the second derivative of -b5/45 - b4/3 - 16b3/9 - 32b*2/9 - 1187b. Find d, given that t(d) = 0. -4, -1 Let x be (300 - 293) + (95/3 - -1) + -9. Factor 2/3b2 + 1058/3 + xb. 2(b + 23)2/3 Suppose 4h - 38 = r, -2r - 5h + 16 + 38 = 0. Factor -6/5 + 1/5m + 1/5m*r. (m - 2)(m + 3)/5 Let d(u) be the first derivative of 12u + 6u*2 + 6u*3 - 7u*3 + 35 - 11 + 2u*3. Factor d(c). 3(c + 2)*2 Let l(c) be the first derivative of 3c*4 - 14c*3/3 - 4c*2 + 52c - 46. Let q(s) be the first derivative of l(s). Factor q(r). 4(r - 1)(9r + 2) Suppose 0 = -2f - 1 + 5. Let u	{ "pile_set_name": "DM Mathematics" }
2 - 2/13hw + 0 - 2/13h. -2h(h + 1)2/13 Let j(u) = -u2 - 12u - 14. Let m be j(-7). Let v be (-2)/(-21)(m + (-12)/4). Factor -vn + 3/7n*2 + 12/7. 3(n - 2)*2/7 Let v = -2498/3 - -834. Factor 0 + 4/3k - 2/3k4 - vk*3 + 2/3k*2. -2k(k - 1)(k + 1)(k + 2)/3 Suppose -6i + 15i - 36 = 0. Suppose -6t - i = -16. Suppose -4/9 - 2/9v3 + 4/9v*t + 2/9v = 0. What is v? -1, 1, 2 Let a = -1072/3 + 11816/33. Solve 6/11k - 2/11 + ak*2 = 0. -1, 1/4 Suppose -4d = 4l, 3 = -4l - 5d - 1. Suppose -g + l = -5. Let u2 + 18u3 + u2 - 8u - 4 + 3u*2 + gu*4 = 0. Calculate u. -1, -2/3, 2/3 Suppose -317r = -285r - 128. Factor 288/5x + 72x3 - 15x*r - 552/5x*2 - 48/5. -3(x - 2)*2(5x - 2)2/5 Let d(m) be the third derivative of m6/120 - m5/20 - 5m*4/12 + 2m*2 + 45m. Solve d(o) = 0 for o. -2, 0, 5 Let x(j) be the second derivative of -j4/48 + j3/8 - 86j + 1. Find f such that x(f) = 0. 0, 3 Let n(u) be the first derivative of 64u + 16 + 1/3u3 + 8u2. Factor n(v). (v + 8)2 Let v(m) be the second derivative of -m*4/8 + 36m*3 - 3888m*2 - 195m. Factor v(b). -3(b - 72)2/2 Suppose -2h - 28h + 180 = 0. Let k(s) be the second derivative of -1/24s*3 + 0 - 3/80s*5 - 4s + 0s2 - 1/120s*h - 1/16s*4. Factor k(z). -z(z + 1)*3/4 Suppose -231x + 36 - 39/2x2 = 0. What is x? -12, 2/13 Suppose 5 = 5c + 5n - 5, -4c + 2n = 4. Let s(u) be the second derivative of 0u*2 + 1/3u*4 + 9u + 4/3u3 + c. Let s(x) = 0. What is x? -2, 0 Let l(b) = 5b*2 + 11b - 3. Let q(v) = -6v2 - 12v + 3. Let t(j) = -5l(j) - 4q(j). Let u be t(-7). Factor 0c - 2c*2 + 0c + 5c3 - uc*3. 2c*2(c - 1) Let z(a) be the first derivative of a*5 - 55a*4/2 + 235a*3 - 550a*2 + 500a + 145. Factor z(d). 5(d - 10)2(d - 1)*2 Suppose -796 = -5f + 9. Let n be (-2)/7 + f/49. Let 10r - 12r*3 - 4r + 3r5 - 3r*4 + 3r*5 + 6r2 - n = 0. What is r? -1, 1/2, 1 Let c(q) be the third derivative of q6/80 + q*5/20 - 13q*4/16 + 5q*3/2 + 33q*2. Factor c(d). 3(d - 2)(d - 1)(d + 5)/2 Let s(j) be the third derivative of 0 + 0j3 - 13j*2 + 1/660j*6 - 1/330j*5 + 0j*4 + 0j. Let s(y) = 0. What is y? 0, 1 Let x(i) = 2i - 15. Let h be x(11). Suppose -5b = -8 - h. Solve 1 + 13w4 - bw*2 + 6 + 6w*3 + 6w*5 - 7 - 2w = 0. -1, -2/3, 0, 1/2 Let c(x) = 18x3 + 10x*2 - 22x + 12. Let j(a) = -a3 + a2 + a - 2. Let q(w) = c(w) + 6j(w). Determine k so that q(k) = 0. -2, 0, 2/3 Suppose 261/8f + 15/4f3 + 24f*2 - 3/2f*4 - 3/8f5 + 27/2 = 0. Calculate f. -3, -1, 4 Let b(k) be the second derivative of -k6/120 - k*5/16 + 64k. Factor b(s). -s*3(s + 5)/4 Let k be (-1)/4 + 198/24 + -4. Factor -4/21c + 0c*3 - 2/21c*k + 2/7c*2 + 0. -2c(c - 1)2(c + 2)/21 Let u be 13 - 18/128/(-6). Suppose -16g + ug = -3. Suppose 10/3c*2 + 2c*g - 2/3 + 2/3c = 0. Calculate c. -1, 1/3 Factor -1/4p4 + 9/4 - 3/2p + 3/2p3 - 2p2. -(p - 3)2(p - 1)(p + 1)/4 Factor -2/9j2 + 2/9j + 40/9. -2(j - 5)(j + 4)/9 Let f be 178/14 - ((-24)/21)/4. Let b = -11 + f. Factor -3i + 3/2i*b + 0. 3i(i - 2)/2 Let s be ((-2)/(-3))/(10/30). Suppose -2g - 3a = -2a - 2, 0 = 3g + 4a + s. Solve -2t3 - t + 3t + 0t2 + 4t*2 - 2 - 2t*g = 0. -1, 1 Solve 8/5r*2 + 0 - 12/5r*3 + 8/5r*4 - 2/5r - 2/5r5 = 0. 0, 1 Let z be (-6)/(-5 - -2)2. Suppose -2v = -zv. Factor 0l2 + 3l + vl2 + 3l*2. 3l(l + 1) Let g = -13876 + 13880. Factor -16/7 + 16/7t - 16/7t3 + 4/7t*g + 12/7t*2. 4(t - 2)*2(t - 1)(t + 1)/7 Factor -144b - 308b2 + 144b*3 + 28 - 74 + 324b*4 + 30. 4(b - 1)(b + 1)(9b + 2)2 Let y be ((-4)/(-10))/((-8)/(-20)) + 3. Let m(a) be the first derivative of -ya + 0a2 + 1/3a*3 + 1. Solve m(k) = 0. -2, 2 Let y(w) be the second derivative of 7/27w*3 + 15w + 1/9w2 + 5/18w*4 + 4/135w*6 + 0 + 13/90w*5. Suppose y(g) = 0. What is g? -1, -1/4 Suppose -33d + 31d + 20 = -4s, 4d + 4s = -8. Let q(b) be the first derivative of 0b + 1/2b*4 + 2/3b*3 - 8 - db*2. Determine i, given that q(i) = 0. -2, 0, 1 Factor 5j*4 + 296 + 725j*2 + 266 - 1060j - 115j3 - 192 - 155j*2 + 310. 5(j - 17)(j - 2)3 Factor 29g*2 + 18g*2 - 18 - 49g*2 - 12g. -2(g + 3)2 Let j(o) = 104o*3 + 156o*2 - 528o - 160. Let z(m) = 21m3 + 31m*2 - 105m - 32. Let c(a) = 5j(a) - 24z(a). Factor c(p). 4(p - 2)(p + 4)(4p + 1) Let b(a) = -a*2 - 22a - 15. Let u(f) = 20f + 16. Let g(p) = 4b(p) + 6u(p). Factor g(s). -4(s - 9)(s + 1) Let y(r) be the second derivative of -2r + 1/15r4 + 0 + 0r*2 + 1/15r*3 + 1/50r*5. Factor y(u). 2u(u + 1)2/5 Let s(l) = -3l + 4. Let c be s(2). Let i be c + 112/60 + (-88)/(-210). Factor iw2 - 16/7w + 32/7. 2(w - 4)2/7 Let w(f) be the second derivative of -5f8/336 + f7/14 - f*6/12 + 20f*2 + 48f. Let o(h) be the first derivative of w(h). Let o(p) = 0. Calculate p. 0, 1, 2 Let y be 0/(1 - -3)(-4)/12. Suppose 1/7h*3 + y - 1/7h*4 - 1/7h + 1/7h2 = 0. What is h? -1, 0, 1 Let b = 739/80 + -135/16. Factor -bl + 2/5l2 - 6/5. 2(l - 3)(l + 1)/5 Let k(n) be the first derivative of 2n*3 - 8/5n*2 + 4/5n*4 + 2/5n - 32/25n5 + 14. Determine z so that k(z) = 0. -1, 1/4, 1 Let x(f) be the third derivative of -1/32f*4 + 0 - 3/80f*6 + 0f - 1/16f5 + 0f*3 + 9f*2. Find q such that x(q) = 0. -1/2, -1/3, 0 Let r be 80 - (-16 - 496/(-32)). Determine f, given that -343/2f*5 - 67f*2 + 196f*4 - 34f + rf3 - 4 = 0. -2/7, 1 Let t(z) = 27z*2 + 69z. Let d(s) = 5s2 + 14s. Let j(u) = -33d(u) + 6t(u). Solve j(q) = 0 for q. -16, 0 Let i(j) be the second derivative of j*4/54 + 26j*3/27 - 3j*2 + 71j - 1. Factor i(n). 2(n - 1)(n + 27)/9 Suppose -2b = 23 - 31. Suppose 6n + b = 22. Factor 3/7sn + 0 + 0s + 3/7s2. 3s*2(s + 1)/7 Let u be 4/(-1 - (-2 + -2 + 1)). Let c(r) = -21r + 42. Let k be c(u). Determine i so that 4/7i*3 + 8/7i*4 - 16/7i - 32/7i2 + k = 0. -2, -1/2, 0, 2 Let f(q) be the second derivative of 6q*2 - 17q - 6/5q5 - 20/3q*3 + 2/15q*6 + 0 + 4q*4. Factor f(k). 4(k - 3)(k - 1)3 Let y(a) = a3 + a2. Let o(r) = 4r*3 + 4r*2 + 8r + 12. Suppose -5 = -s + 2s. Let f(w) = sy(w) + o(w). Factor f(t). -(t - 3)(t + 2)2 Factor -62/15y + 4/15 - 32/15y2. -2(y + 2)(16y - 1)/15 Suppose 4l + 20 = -2n, 4l + 17 = 3n - 3. Let v(i) = -i*2 + 3. Let j be v(n). What is w in -jw*2 + 2w3 + w2 + 0w3 + 2w*4 - 2w = 0? -1, 0, 1 Let b be 2 - (0 + -4 + 3). Suppose -2o = -z - 6, o + z - 3 = -z. Let 4 - 5f2 + f4 - 3f4 - 6f + 6fb + of*2 = 0. What is f? -1, 1, 2 Find q, given that -440q + 5/3q4 - 40q*3 + 830/3q2 + 605/3 = 0. 1, 11 Let j(h) be the third derivative of h7/840 + h6/96 + h5/40 + 12h2 + 4h. Suppose j(c) = 0. What is c? -3, -2, 0 Suppose -3x = -2k - 1, -5x = -0k - 3k - 3. Factor -7n + 3n + 4n + 5nx. 5n*3 Let l = -99 - -104. Factor 2m - lm3 - 7m*2 + 14m*2 - 5m + m*4. m(m - 3)(m - 1)2 Let t be -5 + 10 - (3 + -3)/1. Let w(m) be the third derivative of 1/60m*t - 4m*2 + 1/12m*3 - 1/16m*4 + 0m + 0. Determine b, given that w(b) = 0. 1/2, 1 Let j be 0/(-1) + 4 - (16 + -17). Suppose 4m - 1 - 1 = -2l, -m + j = -l. Factor -1/2i + 0 - 1/2i*m. -i(i + 1)/2 Let 5t3 - 5t + 2t - 29t*2 + 61t*2 - 28t*2 - 2t4 = 0. Calculate t. -1, 0, 1/2, 3 Let g(f) = f3 + 2f2 + 12f + 24. Let t be g(-2). Factor 0u + 4/3u*3 + 4/3u*2 + t. 4u*2(u + 1)/3 Suppose -5z + 29 = 2x - 4, 5x = 5z - 5. Let c be (280/225)/7 + x/18. What is h in -4/5h4 + 0h - ch5 + 0h*2 + 0 - 2/5h*3 = 0? -1, 0 Let c(u) be the first derivative of -1/24u*3 - 6u + 1/4u2 + 5 - 1/16u*4. Let l(j) be the first derivative of c(j). Suppose l(d) = 0. Calculate d. -1, 2/3 Suppose -n - 210 = -3i, -3i + 0n + 4n + 219 = 0. Let t = -21 + i. Factor -4c*4 + 36c*4 - tc*3 + 3c - 5c + 18c*2. 2c(c - 1)(4c - 1)2 What is x in -34 + 2x*2 - 8x + 17 - 7 = 0? -2, 6 Let v = -446 + 449. Let m(n) be the second derivative of -vn + 0 - 1/5n*2 + 1/30n*4 + 0n*3. Factor m(i). 2(i - 1)*(i + 1)/5 Let a(b) be the third derivative	{ "pile_set_name": "DM Mathematics" }
icked without replacement from swbbshssswshfbbfh? 1/136 What is prob of picking 1 b and 1 v when two letters picked without replacement from {b: 1, v: 2}? 2/3 What is prob of picking 1 l and 1 e when two letters picked without replacement from {l: 3, s: 4, g: 1, e: 2}? 2/15 Three letters picked without replacement from {x: 11, d: 6, u: 1}. What is prob of picking 3 d? 5/204 Three letters picked without replacement from ottmmgtojlo. What is prob of picking 1 t and 2 g? 0 Three letters picked without replacement from kqqokqiqjqjqiviqi. What is prob of picking 1 q and 2 i? 21/340 Two letters picked without replacement from {d: 2, j: 1, c: 1, i: 2, y: 1, e: 1}. Give prob of picking 1 j and 1 c. 1/28 What is prob of picking 2 h and 2 q when four letters picked without replacement from {y: 2, q: 3, h: 5}? 1/7 Three letters picked without replacement from {j: 9, i: 2}. Give prob of picking 3 j. 28/55 Calculate prob of picking 4 a when four letters picked without replacement from {j: 4, p: 1, a: 4, m: 2}. 1/330 Calculate prob of picking 1 i and 1 j when two letters picked without replacement from djwjizjzzdzjdi. 8/91 Two letters picked without replacement from {y: 2, j: 1, w: 1, h: 1, s: 1, l: 1}. Give prob of picking 1 w and 1 s. 1/21 Two letters picked without replacement from {x: 3, v: 1, l: 2, r: 1, k: 8, n: 2}. Give prob of picking 1 v and 1 r. 1/136 Calculate prob of picking 1 s and 1 u when two letters picked without replacement from {o: 2, u: 9, s: 5}. 3/8 Four letters picked without replacement from imizizezemzeid. Give prob of picking 1 d, 1 e, and 2 z. 18/1001 Two letters picked without replacement from {r: 2, m: 2}. Give prob of picking 2 r. 1/6 Three letters picked without replacement from {m: 9, y: 1, x: 1}. What is prob of picking 1 y and 2 m? 12/55 Three letters picked without replacement from uussxuspuxuuz. What is prob of picking 1 p, 1 x, and 1 z? 1/143 Two letters picked without replacement from {u: 4, x: 3, q: 2}. What is prob of picking 2 x? 1/12 Calculate prob of picking 1 y and 1 z when two letters picked without replacement from zhzyhztzz. 5/36 Two letters picked without replacement from uzmmmmuukmzuzmzbm. What is prob of picking 2 m? 21/136 What is prob of picking 1 c and 2 k when three letters picked without replacement from {k: 3, c: 4}? 12/35 Calculate prob of picking 1 m and 2 q when three letters picked without replacement from mdbdpsqq. 1/56 Calculate prob of picking 1 z and 2 v when three letters picked without replacement from {v: 4, b: 1, z: 2}. 12/35 Two letters picked without replacement from {a: 4, l: 1, f: 2, e: 3}. Give prob of picking 1 e and 1 f. 2/15 Four letters picked without replacement from bbbbbvvvbvvbbbbvbb. Give prob of picking 4 b. 11/68 What is prob of picking 1 v, 1 e, and 1 r when three letters picked without replacement from {w: 4, r: 1, v: 8, e: 2}? 16/455 Calculate prob of picking 1 s and 1 p when two letters picked without replacement from {n: 2, q: 1, u: 2, s: 1, p: 14}. 7/95 Two letters picked without replacement from {p: 2, c: 2, h: 10}. Give prob of picking 2 p. 1/91 Two letters picked without replacement from gzgzz. What is prob of picking 2 z? 3/10 What is prob of picking 2 q and 1 h when three letters picked without replacement from {h: 3, u: 2, w: 2, z: 8, q: 2}? 3/680 Four letters picked without replacement from pppp. What is prob of picking 4 p? 1 What is prob of picking 1 g, 1 x, and 1 z when three letters picked without replacement from qqgqxqqgzqqqwqqqqqzw? 1/285 Calculate prob of picking 2 o when two letters picked without replacement from {g: 6, o: 2}. 1/28 Two letters picked without replacement from cuejcwnn. What is prob of picking 1 u and 1 j? 1/28 Four letters picked without replacement from {j: 8, d: 2, x: 2, y: 4, z: 3}. Give prob of picking 2 z and 2 j. 7/323 Three letters picked without replacement from pccgppcddggdcp. Give prob of picking 1 d and 2 c. 9/182 Calculate prob of picking 2 l when two letters picked without replacement from vvnlvvlvvulnlvvlvuvv. 1/19 Calculate prob of picking 1 i and 1 h when two letters picked without replacement from ixbxhxk. 1/21 Two letters picked without replacement from peme. Give prob of picking 1 p and 1 e. 1/3 Two letters picked without replacement from {x: 5, o: 8}. Give prob of picking 2 o. 14/39 Calculate prob of picking 2 o and 2 p when four letters picked without replacement from {o: 4, i: 4, c: 1, p: 6, e: 1}. 9/182 Two letters picked without replacement from fmfhhhemmhfymffm. Give prob of picking 1 y and 1 e. 1/120 Calculate prob of picking 1 o and 2 g when three letters picked without replacement from {l: 1, g: 2, o: 2}. 1/5 Two letters picked without replacement from {v: 2, j: 5, t: 5}. Give prob of picking 2 j. 5/33 Calculate prob of picking 2 u and 2 b when four letters picked without replacement from ubbunbnnbbnbn. 3/143 Two letters picked without replacement from ydddydyxczxdyx. What is prob of picking 1 c and 1 y? 4/91 Calculate prob of picking 2 b, 1 t, and 1 w when four letters picked without replacement from tetewebbjet. 1/110 Calculate prob of picking 3 e and 1 x when four letters picked without replacement from teeextxteteteet. 2/39 What is prob of picking 3 g and 1 j when four letters picked without replacement from {g: 10, j: 4}? 480/1001 Calculate prob of picking 1 h and 3 m when four letters picked without replacement from {s: 4, m: 7, l: 1, h: 2, r: 2, w: 1}. 1/34 Calculate prob of picking 1 k, 1 p, and 2 r when four letters picked without replacement from {r: 2, k: 8, p: 2}. 16/495 Two letters picked without replacement from eoryoaeoeereraaewwr. What is prob of picking 2 a? 1/57 Three letters picked without replacement from {o: 4, u: 4, p: 6}. What is prob of picking 2 u and 1 p? 9/91 What is prob of picking 3 z when three letters picked without replacement from zzzzxxzzxzzxzz? 30/91 Calculate prob of picking 1 n, 2 z, and 1 y when four letters picked without replacement from {z: 5, d: 9, y: 2, n: 3}. 5/323 Four letters picked without replacement from {p: 1, h: 2, t: 1, f: 2, x: 4}. Give prob of picking 1 f, 1 h, 1 p, and 1 x. 8/105 What is prob of picking 1 x and 2 g when three letters picked without replacement from {g: 2, x: 1, j: 3, w: 2, b: 1, n: 6}? 1/455 Three letters picked without replacement from {m: 8, j: 5, f: 4}. What is prob of picking 1 m and 2 f? 6/85 Three letters picked without replacement from {q: 3, t: 3, w: 2}. Give prob of picking 3 t. 1/56 Three letters picked without replacement from klglq. What is prob of picking 2 l and 1 g? 1/10 Three letters picked without replacement from zdrzxvxrrr. What is prob of picking 1 d and 2 z? 1/120 Two letters picked without replacement from cjzxxxzjjzl. Give prob of picking 1 c and 1 j. 3/55 Three letters picked without replacement from dpnnppnppppnnnppdp. Give prob of picking 3 p. 5/34 Calculate prob of picking 2 n when two letters picked without replacement from {y: 4, n: 3}. 1/7 What is prob of picking 2 h when two letters picked without replacement from {l: 4, h: 2}? 1/15 Two letters picked without replacement from sylymuw. What is prob of picking 1 l and 1 u? 1/21 Four letters picked without replacement from {y: 1, g: 6, f: 5, j: 1, c: 2}. Give prob of picking 1 j, 1 c, 1 f, and 1 y. 2/273 Two letters picked without replacement from {f: 2, z: 2, s: 2}. Give prob of picking 2 f. 1/15 Four letters picked without replacement from {d: 2, g: 1, s: 1, f: 6, o: 7, z: 2}. Give prob of picking 1 d, 1 z, 1 f, and 1 g. 2/323 Three letters picked without replacement from frzzhffszmmh. Give prob of picking 1 r and 2 z. 3/220 Two letters picked without replacement from sbbjz. Give prob of picking 1 s and 1 b. 1/5 Two letters picked without replacement from lduddbbdoudbz. What is prob of picking 1 b and 1 o? 1/26 Four letters picked without replacement from iiciiiviiiwkiiccwkv. What is prob of picking 2 i and 2 v? 15/1292 Two letters picked without replacement from nppippnni. Give prob of picking 2 i. 1/36 Two letters picked without replacement from {p: 6, k: 1, q: 2, n: 3}. Give prob of picking 1 k and 1 q. 1/33 Calculate prob of picking 2 x when two letters picked without replacement from {u: 4, b: 5, x: 4, n: 2, h: 1}. 1/20 Two letters picked without repl	{ "pile_set_name": "DM Mathematics" }
6 - 7k2 + 0 + 1/210k*5. What is w in q(w) = 0? -1, 0 Factor -12/7j*2 - 1/7j*5 + 4/7j*4 - 9/7j + 0 + 2/7j3. -j(j - 3)*2(j + 1)*2/7 Factor -144l*2 + 1058 + 48l*2 - 280l - 157l - l3 + 38l*2 + 14l*2. -(l - 2)(l + 23)*2 Solve -342h*3 - 133h*2 + 337h*3 + 43h*2 = 0 for h. -18, 0 Let p(c) be the first derivative of -1/2c*3 + 17 + 0c + 0c2. Factor p(k). -3k*2/2 Let d(m) be the third derivative of 0 - 1/80m*6 + 1/16m*4 - 8m*2 + 0m*3 + 0m + 1/420m7 - 1/120m*5. Let d(j) = 0. What is j? -1, 0, 1, 3 Factor 14 + 93k + 18k2 - 23k*2 - 288k - 384. -5(k + 2)(k + 37) Factor 4/7a3 - 8/7 - 4/7a + 8/7a2. 4(a - 1)(a + 1)(a + 2)/7 Suppose -2a - 5x - 21 = 0, -30 = -5a - 0x + 4x. Find f such that 2f*3 + 2 - af*3 + 4f*2 - 76f + f*3 + 81f = 0. -2, -1 Let -2g2 - 5g*4 - 8910g*3 + 8901g*3 - 2g*4 = 0. What is g? -1, -2/7, 0 Let k(n) be the first derivative of 2/3n*3 + 2/3n - 1/6n4 - 12 - n2. What is y in k(y) = 0? 1 Suppose -2g = -v, g + 2v = -v + 14. Factor -2/7b*g + 4/7b - 2/7. -2(b - 1)2/7 Let t be (1 + 1)/((-4)/(-6)). Let b be -105/((-50)/(-4)) + 6. Find f, given that -10ft + 2f + 3f2 + 13f*3 - 9fb + f = 0. 0, 1 Let d(w) be the second derivative of w5/30 - 5w4/9 + 16w*3/9 - 122w. Factor d(f). 2f(f - 8)(f - 2)/3 Let s(f) be the third derivative of -1/24f*4 + 0f + 1/30f5 + 3f*2 + 0f*3 + 0f*6 + 1/336f*8 + 0 - 1/105f*7. Find w such that s(w) = 0. -1, 0, 1 Suppose -36 = 12n - 12. Let w = 1 - n. Suppose -7/5g2 - 2/5g*w - 8/5g - 3/5 = 0. What is g? -3/2, -1 Suppose u = 2y + 2y + 10, -4u + 4 = -4y. Let r be (1 + (-10)/4)u. Factor -4o - 4o3 - 10o*2 - 7o*r + 3o*3 - 2o*4. -2o(o + 1)2(o + 2) Let y(l) = -l*2 + 101l - 110. Let s(u) = -u*2 + 51u - 56. Let c(g) = 10s(g) - 6y(g). Find x, given that c(x) = 0. -25, 1 Let o(p) be the first derivative of 5p3/12 - 7p*2/4 + 2p + 42. Factor o(b). (b - 2)(5b - 4)/4 Let o = -154 + 2928/19. Let w = o - -28/95. Solve 2/15q3 - 8/15q*2 + 0 + wq = 0 for q. 0, 1, 3 Let g(k) = 9k4 - 50k*3 + 116k*2 + 46k - 129. Let s(j) = j4 - j2 - j - 1. Let l(b) = g(b) - 4s(b). Factor l(i). 5(i - 5)*2(i - 1)(i + 1) Let d(r) = -5r*2 + 12r + 40. Let w(u) = 2u2 - 1. Let b(c) = d(c) + 3w(c). Let h be b(-5). Factor 2/5p5 + 0p - 2/5p4 + 2/5p*h - 2/5p*3 + 0. 2p*2(p - 1)*2(p + 1)/5 Factor 112d2 - 44d*2 + 1221d + 1860 + 318 + d*3. (d + 2)(d + 33)*2 Let f(u) be the first derivative of 1/22u*4 + 8 + 5/11u*2 - 8/33u*3 - 4/11u. Factor f(b). 2(b - 2)(b - 1)*2/11 Let a(z) be the first derivative of -5z*4/4 - 50z*3 + 160z2 - 486. Suppose a(r) = 0. Calculate r. -32, 0, 2 Let d(i) be the second derivative of -i7/168 - i6/72 + i5/12 - 25i3/6 + 17i. Let g(u) be the second derivative of d(u). Factor g(a). -5a(a - 1)(a + 2) Let z(g) be the second derivative of -g4/42 - 2g3/7 + g2 + 137g + 2. Let z(h) = 0. What is h? -7, 1 Let g(c) be the third derivative of c7/70 - 27c*6/40 - 87c*5/20 - 89c*4/8 - 15c*3 - 39c2 + 2. Find b such that g(b) = 0. -1, 30 Let n(o) be the second derivative of -o4/6 - 94o3 - 19881o*2 + 942o. Let n(l) = 0. Calculate l. -141 Let j(l) be the second derivative of -l7/1260 - l6/108 + 2l5/45 + l4/3 + 37l*3/6 + 37l. Let g(z) be the second derivative of j(z). Factor g(k). -2(k - 2)(k + 1)(k + 6)/3 Suppose 2/17f*4 + 84/17f - 84/17f3 - 88/17f*2 + 86/17 = 0. What is f? -1, 1, 43 Let w be (-2)/4 - 45/(-6). Suppose -3 = -wb + 6b. Solve -4t + 6tb + 3t*4 - 12t + 10t - 3t*2 = 0. -2, -1, 0, 1 Let g = 1109/7 - 149714/945. Let u(d) be the third derivative of 0 + 1/270d*5 + 2d*2 - 1/540d*6 + 0d + 0d3 - gd*7 + 1/108d*4. Factor u(i). -2i(i - 1)(i + 1)*2/9 Let k(w) = 31w*2 + 30w + 9. Let n(c) = -c*2 + 1. Let a(i) = -k(i) - 6n(i). Let p(l) = l*3 - 26l*2 - 31l - 16. Let q(j) = 6a(j) - 5p(j). Factor q(g). -5(g + 1)2(g + 2) Let v(l) be the second derivative of -l*6/10 + 3l5/5 - l4/2 - 2l3 + 9l*2/2 + l + 76. Determine g, given that v(g) = 0. -1, 1, 3 Let i(w) be the first derivative of 33/5w*2 - 4 - 24/5w*3 + 3/2w*4 - 21/5w - 3/25w5. Determine z, given that i(z) = 0. 1, 7 Let i = 3653/756 - -79/189. Find n such that -1/2 - in*3 + 21/4n + 1/2n2 = 0. -1, 2/21, 1 Let 200 + 151 + 5t*4 - 900t + 198 + 590t2 - 68 - 76 - 100t*3 = 0. What is t? 1, 9 Suppose 6063h3 - h4 - h*5 - 6071h*3 + 12h*2 + 2h*5 = 0. What is h? -3, 0, 2 Solve 4/5s*3 - 16/3s*2 + 0 + 2/15s*5 + 10/3s + 16/15s4 = 0 for s. -5, 0, 1 Let g(k) be the second derivative of 27k*5/70 + 3k*4/7 + 4k*3/21 - 7k*2/2 - 21k. Let b(i) be the first derivative of g(i). Factor b(y). 2(9y + 2)2/7 Let w(f) = f3 - f*2 - f - 4. Let o be w(3). Suppose -2k = -3v - k + 5, -k = 5v - o. What is u in 11u2 - 14u*v + 14u - 6 - 5u = 0? 1, 2 Let a(j) be the first derivative of -j5/4 - 25j*4/12 - 35j*3/6 - 15j*2/2 - 8j - 41. Let g(o) be the first derivative of a(o). Factor g(c). -5(c + 1)2(c + 3) Suppose 2 = -4l + 2l. Let b = l + 14. Factor -8q - b - 3q*2 + 20q + 6 - 5. -3(q - 2)2 Let z(p) be the third derivative of -p8/336 + p7/105 + p6/40 - p5/15 - p4/6 + 314p*2. Factor z(o). -o(o - 2)*2(o + 1)*2 Let n(f) be the third derivative of 0 - 35f*2 - 1/150f*5 + 3/100f*6 + 0f*3 - 11/525f*7 + 1/210f*8 - 1/60f*4 + 0f. Factor n(l). 2l(l - 1)*3(4l + 1)/5 Factor 1/3o - 1/3o2 + 10. -(o - 6)(o + 5)/3 Let z(r) be the first derivative of r*4 - 268r*3 + 19998r*2 + 40804r - 347. Factor z(m). 4(m - 101)2(m + 1) Suppose 3b - 4g = -2, -8b - g = -7b - 4. Let -8/3r - 8/3r*b - 2/3r*3 + 0 = 0. What is r? -2, 0 Let n = 252 + -291. Let x = 43 + n. Determine z, given that 4/3z*x + 16/3z*3 - 8/3z*2 + 12 - 16z = 0. -3, 1 Let u = 32 + 2. Let r = u - 32. Determine w so that -w*3 + 3w*2 + 4 + 5w*2 - rw - w*3 - 8w = 0. 1, 2 Let l(z) = -4z - 8. Let i be l(-2). Let p(v) be the first derivative of 6 - 1/3v*3 + iv*2 + v. Let p(t) = 0. What is t? -1, 1 Let j(p) be the third derivative of 1/6p*6 + 0 - 19p*2 + 0p - 5/12p5 + 5/24p*4 + 0p*3. Factor j(k). 5k(k - 1)(4k - 1) Let m(l) be the first derivative of l8/560 - l7/280 - l6/20 - 7l*3/3 - 2. Let f(q) be the third derivative of m(q). Find i, given that f(i) = 0. -2, 0, 3 Let w(k) = 8k*3 + 45k*2 + 123k + 83. Suppose 79 - 71 = c. Let h(s) = 23s3 + 135s*2 + 368s + 248. Let b(p) = cw(p) - 3h(p). Factor b(n). -5(n + 1)(n + 4)*2 Let h(d) be the third derivative of -3/20d*6 + 7/30d*5 + 0d + 1/21d7 - 1/6d*4 + 0d*3 - 1/168d*8 - 5d*2 + 0. Determine j so that h(j) = 0. 0, 1, 2 Suppose -c = -5o + 68, 0o - 5o + 2c + 71 = 0. Factor 3z*2 - 7z + 2z2 - oz*2 + 7z*2. -z(z + 7) Let d = 36 - 29. Suppose -3f + 6 = -3c, dc - 2c = 0. Suppose 1/2 - 1/4nf - 1/4n = 0. Calculate n. -2, 1 Factor -5245t2 + 0 - 18t - 4 + 5247t2 - 16. 2(t - 10)(t + 1) Let n(f) = 16f - 16. Let l(u) be the second derivative of -u*4/12 + 49u*3/6 - 24u*2 + 10u. Let h(q) = 4l(q) - 11n(q). Factor h(m). -4(m - 4)(m - 1) Let s(y) be the third derivative of -1/150y5 + 0y + 0 + 1/6y4 - 3/5y*3 + 26y*2. Factor s(g). -2(g - 9)(g - 1)/5 Let v = 3096/5 + -3092/5. Factor 2/5g*3 + 0g*2 - v - 6/5g. 2(g - 2)(g + 1)*2/5 Let j(k) = 19k*2 + 13k. Let r(a) = a*2 - a + 1. Let q(c) = 15c*2 + c + 5. Let f(n) = q(n) - 5r(n). Let d(g) = 11f(g) - 6j(g). Factor d(u). -4u(u + 3) Suppose -133q = -152q + 38. Factor 3/4v5 + 6v - 15/4v3 - 3/4v*4 + 3 + 3/4v*q. 3(v - 2)*2(v + 1)*3/4 Let j(o) = -5o - 21. Let w be j(-6). Suppose -w = 11z - 14z. Find h, given that 0 + 0h + 2/3h*z + 1/3h*2 + 1/3h*4 = 0. -1, 0 Let k = -50551 + 50556. Let p be 2/(-3) - (-22)/6. Factor 8/11b*4 + 2/11b*k + 4/11b*2 + 0b + 10/11bp + 0. 2b*2(b + 1)*2(b + 2)/11 Let 47/2h + 1/2h*2 - 49 = 0. Calculate h. -49, 2 Let q be (-4)/16 - (-150)/24. Let j(m) be the third derivative of 0m + 1/75m5 + 0 + 3m*2 + 0m*3 - 1/120m*4 - 1/200m*	{ "pile_set_name": "DM Mathematics" }
0)/8)/a - (1 - 567)? 5 What is the hundreds digit of ((-1988965)/957)/(1/(-3))? 2 Let a = 4337 + -4159. What is the hundreds digit of a? 1 Let d be 5559/1 + (3 - 10). Suppose 6r - d + 1616 = 0. What is the units digit of r? 6 Suppose -227 - 109 = 2d. Let r = d + 304. What is the hundreds digit of r? 1 Let m(z) = 418z2 - 26z - 72. What is the tens digit of m(-3)? 6 Suppose -16 = -n + 51. Let d = -61 + n. What is the units digit of (-410)/(-35) + (d/(-21))/(-1)? 2 Suppose -i = -580 - 167. Let s = i + -303. Suppose -34w + s = -28w. What is the units digit of w? 4 Suppose -11v + 2011 + 1465 = 0. Suppose -5j + 4g + 318 = 0, 4g = -5j + 7g + v. What is the tens digit of j? 6 Let w = 9312 - 6658. What is the thousands digit of w? 2 Let m(j) = 3j2 + 13j. Suppose 10 = -w + 15. Suppose wh - 2 = -47. What is the tens digit of m(h)? 2 Suppose 0 = -4p + g + 47673, 4p - 3g - 45783 = 1892. Suppose -p = -53l - 6l. What is the units digit of l? 2 Let l = 27 + -145. Let u = l + 220. What is the units digit of u? 2 Let z(u) = u*3 - 2u*2 + 3u - 12. Let m be z(3). Let v(f) = 62f + 36. What is the hundreds digit of v(m)? 4 Let r(v) = 6 + 5 - 11v + 39v. What is the units digit of r(10)? 1 Let i = 2722 - 2557. Suppose -4y + 19 = 7, -2y - 405 = -3v. Suppose -k + i = v. What is the units digit of k? 8 Let j = 9524 - 3703. What is the thousands digit of j? 5 Let d = -19 - -89. Let v be d/30 - (-1)/(-3). Suppose 2o + 2o = -vi + 392, 3i - o = 567. What is the hundreds digit of i? 1 Suppose 14q = 18q - 528. Let s = -84 + q. What is the units digit of s? 8 Let v = 24260 - 14534. What is the tens digit of v? 2 Suppose -u + 46 = -b, -2u - 4b + 64 + 16 = 0. Let y = u - -78. What is the tens digit of y? 2 Let n(b) = -149b3 - 13b*2 + 36. What is the ten thousands digit of n(-5)? 1 Let f(h) = -6h*3 - 36h*2 - 32h + 32. What is the units digit of f(-17)? 0 Let s(f) = 651f + 71. Let v be s(20). Suppose -20c = -c - v. What is the units digit of c? 9 Let z(y) = 30y2 + 9y - 8. Let i be z(6). Suppose 5w = a - 0a + i, -4a = 5w - 1146. What is the units digit of w? 6 Let q = 958 + -680. Suppose -q = 5l - 73. Let r = 54 + l. What is the tens digit of r? 1 Let n(h) = h2 - 15h + 18. Let o be n(14). Let q be 184o/32. Suppose -qk = -593 - 442. What is the hundreds digit of k? 1 Let m = 12151 - 4980. What is the thousands digit of m? 7 Let z(u) = 1824u + 80. What is the thousands digit of z(3)? 5 Let i(j) = j3 + j2 + 4j + 7. Let p be i(-5). Let x be (9729/(-2162))/(0 - 6/(-56)). Let a = x - p. What is the units digit of a? 1 Suppose -222k - l = -229k + 21379, -6104 = -2k + l. What is the thousands digit of k? 3 Suppose 3h - 2f = 22314, 7h = -11f + 8f + 52020. What is the thousands digit of h? 7 Suppose -19b = -8b - 33. Suppose -212 = -t - t - 4l, -bl = -t + 81. Suppose -65x + 66x = t. What is the units digit of x? 6 Suppose 4h - 5730 = 2k, -3225 + 356 = -2h - 3k. Let b = h + -888. What is the hundreds digit of b? 5 Let f = -5 - -10. Suppose -fd + 1146 - 281 = 0. Suppose 2g = 2m + d - 43, 5g = m + 309. What is the tens digit of g? 6 What is the tens digit of (2 - 16860/(-75))/(2/580)? 7 Suppose -4s = -30 + 18, 5m + 4s = 28277. What is the units digit of m? 3 What is the ten thousands digit of ((-192)/60)/((-21102)/63270 - 1/(-3))? 1 Let s(x) = 5x2 - 757x + 774x - 9 + 59. Suppose -1 - 3 = c. What is the units digit of s(c)? 2 Let s = 375 + -368. Suppose 0 = -sm + 766 - 66. What is the units digit of m? 0 Let x(a) = 432a + 101. Let u be x(22). Suppose -3h = -5f + 6f - 1921, -5f + u = -3h. What is the tens digit of f? 2 Let c = -60 - -59. What is the units digit of ((-64)/10)/((-52)/50 - c)? 0 Suppose -2v + 59 = 53. Suppose 2b + 2r = 20, 0b + r = vb - 34. Suppose -by + 192 = -930. What is the tens digit of y? 0 Let x(y) = -2y3 - 17y*2 - 3y - 2. Let m be x(-12). Let i = m - 483. Suppose -5l + 2b = -2b - i, -5l + 553 = 2b. What is the tens digit of l? 1 Let x = -19 - -115. Let c = x - 92. Suppose cq + 0q = 488. What is the units digit of q? 2 Suppose -5n = -10n + 10, 0 = -2q + 3n + 14. Let h(r) = 27r + 46. What is the units digit of h(q)? 6 Let t = 3596 - 944. What is the hundreds digit of t? 6 Let b = 387 - 890. Let y = b + 859. What is the hundreds digit of y? 3 Suppose 0 = -34k + 28 + 40. Let c(b) = 6b*2 - 4b + 1. What is the tens digit of c(k)? 1 Let x(u) = 87u2 - 23u + 197. What is the tens digit of x(10)? 6 Let c be (-2)/(-3)(-16)/(192/(-90)). What is the units digit of 3382/4 - c/10? 5 Let n(d) = -11d + 117. Suppose 2f + 2c - 8 = 0, 4c - 10 - 6 = 0. Let x be n(f). Let v = -113 + x. What is the units digit of v? 4 Let a = 4077 + 202. What is the units digit of a? 9 Let q(r) = r3 + 52r*2 - 23r - 94. Let v be q(-53). Let h = -884 - v. What is the hundreds digit of h? 8 Let u(y) = -y*3 - 9y*2 + 11y + 30. Let d be u(-10). Let v = 45 - d. What is the units digit of (v/(-2))/5-4? 0 Suppose 3x + 5h - 501 = 0, 2490h - 201 = -x + 2494h. What is the units digit of x? 7 Let w(l) = 536l*3 - 5l*2 + 9l - 23. Let q be w(4). Suppose 0 = 37f + 8300 - q. What is the tens digit of f? 0 Suppose -2 = 2l, 6c + l - 69340 = 5l. What is the ten thousands digit of c? 1 Let j(k) = 2k2 + 5k + 17. Let d be (-111)/(-9) + (-2)/6. Let r be j(d). What is the tens digit of ((-5)/((-25)/r))/1? 7 Let v(u) = 67u + 35 + 32u + 18u. What is the thousands digit of v(9)? 1 What is the thousands digit of 1963509/217 - (-3)/(-7)? 9 Suppose 7795341 = 352d - 17816883. What is the ten thousands digit of d? 7 Let o = 53 - 55. Let y(n) = 76n2 - 2n - 4. Let z be y(o). Suppose 6t - 10t = -z. What is the tens digit of t? 7 Let i(u) = -2u3 - 12u*2 + 15u + 7. Let c = 54 - 61. Let a be i(c). Suppose -4t + 896 = -2q, t + 0t - 3q - 224 = a. What is the units digit of t? 4 Let w(j) = -2j + 68. Let g be w(28). Let y be (-2 + g/9)/(3/(-3735)). Suppose 0 = -12z - y + 3254. What is the units digit of z? 2 Let n = 41310 + -20780. What is the hundreds digit of n? 5 Let p be -13 - 1 - (-6 - (5 - 7)). Let h be 1 + (-130)/(-50) + (-4)/p. Suppose 313 = 5x + hq - 821, -5q + 683 = 3x. What is the tens digit of x? 2 Suppose 3f = 4r - 95, -2f + 23 + 67 = 5r. Suppose -9n + rn - 12386 = 0. What is the units digit of n? 6 Let z(r) = 20r3 + r2 + 21r - 9. Let d be z(5). Suppose f - c - 644 = -3c, 4f - c - d = 0. What is the hundreds digit of f? 6 Suppose -3k = 2m - 143970, m - 72006 = -19k + 21k. What is the tens digit of m? 9 Let z(j) = j*3 - 2j*2 - 8j - 5. Let p be z(4). What is the hundreds digit of (-115 - 0 - (0 + 1))p? 5 Let i = -854 + 1618. Suppose -95b = -91b - i. Suppose z = -5s + b, -3z + 3s - 525 = -6z. What is the tens digit of z? 7 Let z = -27 + 31. Suppose -1288 = -zc - s, -4c + 2s + 644 = -2c. Suppose -2x = 4y - c, 4y - 362 + 35 = 3x. What is the tens digit of y? 8 Let h(j) = -j3 - 5j*2 + 2j + 34. Let c be h(-10). Suppose -4u = -3g + g + c, -2g - 3u + 507 = 0. What is the units digit of g? 5 Suppose 5x = -g + 4363, 2g = 2x + 11134 - 2360. Suppose 9o + 4u - 873 = 8o, -5o - 2u = -g. What is the tens digit of o? 7 Let l be 2 - ((-66)/77)/((-2)/14). Let z(a) be the second derivative of -35a3/6 - 6a*2 - 2a. What is the units digit of z(l)? 8 Suppose -8c - 12 = -12c. Let w(f) = -13f. Let u be w(c). What is the units digit of 1/(-3) - 2938/u? 5 What is the units digit of 11275/50 - (-18)/4? 0 Suppose -19a - 3088 = -134944 - 31259. What is the hundreds digit of a? 5 Let r = -238 + 113. Let b = r - -388. What is the units digit of b? 3 Suppose 33c - 573581 = -426688 + 670253. What is the thousands digit of c? 4 Let h = 3842 + -1209. What is the thousands digit of h? 2 Let w be 12-12(-4 + (-102)/(-27)). Suppose -12956 = -wn + 8228. What is the tens digit of n? 6 Suppose 124z - 126z - 1200 = 0. What is the tens digit of (-111550)/z - 1/(-12)? 8 Suppose 1378236 = -59w - 45w + 5331900. What is the units digit of w? 6 Suppose -169468 = -4o + c, -12o + 9o - 4c = -127101. What is the hundreds digit of 15/18 - o/(-78)? 5 Suppose 168*w = 483933 + 445779. What is the hundreds digit of w? 5 Suppose	{ "pile_set_name": "DM Mathematics" }
-0.1. -5931523585.9 Work out -203.019 - -161570. 161366.981 Calculate -1533961.5 + 678. -1533283.5 What is the distance between -33839338 and 0.4? 33839338.4 What is the distance between 0.2 and 38881568? 38881567.8 What is the difference between -7685453450 and 4? 7685453454 What is -326350 take away -48.23? -326301.77 What is -6764577 plus 190? -6764387 -0.150915+8 7.849085 Total of -2301287 and 97. -2301190 Subtract -0.22 from -112360118. -112360117.78 Total of -231 and -3742670. -3742901 What is 3 take away 34802967541? -34802967538 Work out 0.05 + -917275.4. -917275.35 Total of 547996 and -6.2812. 547989.7188 Subtract 0.068851 from -35.899. -35.967851 -3 - 719266914 -719266917 Subtract 0.03818678 from -0.3. -0.33818678 Work out -44060007107 - 0.2. -44060007107.2 What is -0.27 plus 9438101? 9438100.73 Put together -0.495111 and -0.233. -0.728111 Calculate 0.0389 + 0.00129603. 0.04019603 What is 380.464 + -0.45? 380.014 Calculate 0.009 + -2263880.8. -2263880.791 Sum 0.1 and -18352.315. -18352.215 Calculate 0.5 + 13614.1. 13614.6 What is 0.7 less than -2640888? -2640888.7 Put together -436879.1 and -95. -436974.1 Add together -2425405 and -2.7. -2425407.7 Add 793627317 and -0.05. 793627316.95 What is the difference between -5.1 and -632058691? 632058685.9 Calculate -836.6 + 3.606864. -832.993136 Add -3448.2 and 3.722. -3444.478 Work out -0.01 + 3613187. 3613186.99 What is 3287999 - 1312? 3286687 Work out -213423.1 + 3.8. -213419.3 What is -12 take away -144.5494? 132.5494 What is -347 take away 62527.2? -62874.2 Total of -4 and -2851221091. -2851221095 -9901 - 224606 -234507 What is the distance between -4584 and -8421886? 8417302 -0.03+-299771123 -299771123.03 What is 20319661068 less than 6? -20319661062 -4.07384+-1 -5.07384 What is 0.5 - 24062.1579? -24061.6579 What is -0.5 take away -765773787? 765773786.5 What is 675 minus 6498073? -6497398 What is 1158 less than 213994? 212836 931.4 - -3129 4060.4 200.6 + 0.43057438 201.03057438 What is -25302 plus 82.32? -25219.68 Work out -76366 + 16489. -59877 Work out -0.0462607 - 22. -22.0462607 Work out -3.059 + -52125.2. -52128.259 What is -6820975 - 52? -6821027 What is 84039 plus -14232? 69807 What is 18849.8545 less than 0.5? -18849.3545 Put together 5890407 and -3.8. 5890403.2 Add 400425759 and 40. 400425799 What is 7242815309 plus 0.6? 7242815309.6 What is -284.1 - 0.75479? -284.85479 Calculate -1.7 + -985874.3. -985876 Work out -0.2 + -609505617. -609505617.2 -14401427 + 9 -14401418 Sum -6 and 356826.78. 356820.78 -4 + 0.093718476 -3.906281524 Work out -0.69 - 14543.05. -14543.74 458+-1826985 -1826527 Work out -0.108129 - -3.9. 3.791871 Work out 51.530112 + -0.01. 51.520112 91899+-454 91445 What is 1.2 - 59.07871? -57.87871 1.45 + 13.2448 14.6948 Add 1491720774 and 2. 1491720776 Calculate -100773419 - 0.4. -100773419.4 Subtract 6588248 from -9. -6588257 Subtract 25.8 from -376502. -376527.8 What is -0.3415 minus -399? 398.6585 Work out 29 - 5.9003. 23.0997 Put together 1607 and -0.7345748. 1606.2654252 What is the difference between 86575.32 and 0.11? 86575.21 Work out 4 - -2314.061896. 2318.061896 What is 4865980 less than 6.7? -4865973.3 Work out 129549.8 - -61. 129610.8 What is -1.398 take away 0.276988? -1.674988 What is the distance between 0.0205783194 and 8.7? 8.6794216806 What is 2027 take away 119052? -117025 Subtract -0.2245 from 0.09662. 0.32112 Sum -0.7093 and -3089. -3089.7093 What is 18 take away 3461500? -3461482 What is the distance between -0.06258838328 and 0.1? 0.16258838328 What is -1334 minus -5261526? 5260192 -3 - 354058790 -354058793 -3.8 + 190946 190942.2 Calculate -233653496 - 19. -233653515 What is 43068623 less than -57? -43068680 What is the distance between -73537480 and 0.1? 73537480.1 -192 - 2.592685 -194.592685 What is 0.581681 less than -19172? -19172.581681 -69209.3 - 33 -69242.3 Work out 10 + 60.1069. 70.1069 Calculate 1098472 + -516. 1097956 Add -13445761 and 241. -13445520 -10165856 + 0.0932 -10165855.9068 1572577.31 - 0.7 1572576.61 What is -80741757 + -4? -80741761 Subtract 1.483183 from 1792. 1790.516817 What is 4 less than -15.672535228? -19.672535228 Work out -1082 - -0.01436601. -1081.98563399 Work out -37.135329 + -46. -83.135329 Total of 2 and -144450391.4. -144450389.4 Calculate -1477.342 - 613. -2090.342 What is the distance between -458.977 and -8? 450.977 Calculate 4.2 + 0.38397. 4.58397 3 - 84420.923 -84417.923 -169 + 20356 20187 Work out 1.038 + 4866. 4867.038 Subtract -0.1846053 from 15.5. 15.6846053 Sum 6012.8 and 4.64. 6017.44 -26675+86009 59334 Put together -9196757330 and -1. -9196757331 What is -0.021 minus -39166693? 39166692.979 What is the difference between 22137242 and -0.16? 22137242.16 What is the difference between 15653502 and 55? 15653447 What is the difference between 8105 and -259.3? 8364.3 Add together 155831.1 and 1.6. 155832.7 61801+-1.73 61799.27 -5805226572+-2 -5805226574 What is 333064412 less than -3? -333064415 Total of 58165228.4 and 11. 58165239.4 Put together 9.7 and -1783626.5. -1783616.8 What is 1541555 minus 829? 1540726 -9+0.099797377 -8.900202623 Add -41304065 and 9.69. -41304055.31 Total of -192.9 and -3059. -3251.9 What is -3402 - -0.33147? -3401.66853 Put together 40.29827 and 7. 47.29827 -157 - -0.16503054 -156.83496946 What is 0.92 plus 2438993? 2438993.92 Add together 149.95 and 382. 531.95 What is -0.3 + -1419606776? -1419606776.3 Calculate 1.1847626 + -67. -65.8152374 0.5637 + -2.02 -1.4563 Work out -0.3 + -4.08018948. -4.38018948 Put together -2.84 and 364053. 364050.16 Sum -50 and -15135.2. -15185.2 15 + 518393.2 518408.2 Subtract -2 from 35965.76. 35967.76 Subtract 1508889.4 from 90. -1508799.4 What is -728376 minus 260? -728636 Calculate 129743.7 + -5. 129738.7 What is -2.337 - 55309? -55311.337 Work out 27138910 + 1.53. 27138911.53 Total of -0.7 and -321440198. -321440198.7 What is the distance between 52 and 7.1339? 44.8661 Work out -1112396035 + -0.1. -1112396035.1 Subtract 66605146.2 from 4. -66605142.2 -12.4 - 102797.44 -102809.84 Subtract 1422569.1 from 689. -1421880.1 Put together 27664618 and 0.1. 27664618.1 What is the difference between 0.007 and -0.003463? 0.010463 Subtract -0.3 from -21.5290698. -21.2290698 What is -0.2 minus -245.7344529? 245.5344529 Sum -0.0721021 and -0.00375. -0.0758521 -437.9328 - 0.4 -438.3328 Work out 2202284643 + 3. 2202284646 Add -11.37 and -0.04873025. -11.41873025 What is 0.2 take away -0.6425268? 0.8425268 What is 259624.9 + 3? 259627.9 What is the difference between 15.75 and -61.4006? 77.1506 Calculate -5648 - 0.1033051. -5648.1033051 What is 169895375 - -0.1? 169895375.1 What is 5.17210458 plus 8? 13.17210458 What is 2506 plus 0.88934? 2506.88934 Calculate 10506.1997 + 0.8. 10506.9997 What is 474.50662 + 1.06? 475.56662 4+-638801629 -638801625 Calculate -6256305 - -0.2. -6256304.8 Subtract 1.3 from -61248778. -61248779.3 1.7 + 600.7094 602.4094 0.2621 + -6.5068 -6.2447 What is the distance between 2606 and 10682? 8076 What is -39046278 less than 5.1? 39046283.1 -3.22410075 + 62 58.77589925 What is the distance between 31.461766 and 96? 64.538234 Work out -0.5 + 895646934.7. 895646934.2 What is the distance between -1 and -3851634? 3851633 Calculate -13019 - 137746. -150765 Calculate -0.26 - 2633168197. -2633168197.26 Calculate 64 - 298.82319. -234.82319 What is 25.08 - -6580? 6605.08 What is 0.236 plus 39789380? 39789380.236 What is 537 minus -184878? 185415 Add -16.7 and -7202550. -7202566.7 Total of 46050 and 1.3828. 46051.3828 0.023654+0.203153 0.226807 What is -2835 plus 30785? 27950 What is -0.1249722903 take away 0.3? -0.4249722903 What is 0.638 + 5929.9? 5930.538 0.3 - 31003593 -31003592.7 Calculate -80382 + 1165. -79217 Add together 905 and 11295172. 11296077 What is 2816 take away 217577? -214761 Total of 0 and 1207672. 1207672 Subtract -52938461 from -0.0474. 52938460.9526 Work out 2 - -114204.2. 114206.2 What is 11795 take away -238.8? 12033.8 What is the difference between 8 and -2.514597? 10.514597 Work out -0.2346 - 190581. -190581.2346 What is the distance between 0.1094578 and 0.0426? 0.0668578 1.3+2.54791 3.84791 -160 + 350.9675 190.9675 What is the difference between -2419456 and -61? 2419395 Work out -106465 + 2559. -103906 Wha	{ "pile_set_name": "DM Mathematics" }
7f - 203726617. -221820607 Find the third derivative of -23762117s*3 - 3820s*2 - 370s + 4. -142572702 What is the second derivative of 2442763s5 + s2 - 116s - 263220? 48855260s3 + 2 Differentiate 34299iv - 401i + 13714632v wrt i. 34299v - 401 Find the second derivative of 120230hi*3 + 9hi - 254069h - 14i4 wrt i. 721380hi - 168i*2 What is the third derivative of 2372825z*4 - 163z*2 + z - 73? 56947800z What is the second derivative of 26974r4 + 500r*2 - 26837330r? 323688r2 + 1000 What is the first derivative of -1544a*2i + 117a2k*3 - 12a*2 - 5ik2 + 7642i - k*3 - 158 wrt a? -3088ai + 234ak3 - 24a Find the first derivative of -22672121w4 + 5w - 293449018 wrt w. -90688484w3 + 5 What is the third derivative of 1262934a*3y3 - a3y + ay + 2y6 + 2173712y*2 wrt y? 7577604a*3 + 240y*3 Find the first derivative of 461249br2 - 2b - 4247623r2 + 2 wrt b. 461249r*2 - 2 Find the third derivative of -82084928p*3s*3 + 3852p*2s*3 - 1043p*2s - 2p wrt p. -492509568s*3 Find the third derivative of 362b*3q*2w*2 - 7388b*3q*2w - b*2q*2w*2 - 11b*2qw + 15bq2w*2 + 14bqw*2 - bw*2 wrt b. 2172q*2w*2 - 44328q*2w Differentiate 24n4 + 1080n*3 - 20n*2 - 2n - 10837051. 96n3 + 3240n*2 - 40n - 2 What is the derivative of 657691qz*3 - 4qz - 102706099z*3 wrt q? 657691z*3 - 4z Find the second derivative of -14857562v4 - 125v + 28810. -178290744v2 What is the first derivative of -612835592j*2 + 777984516? -1225671184j Differentiate -193760244a3 - 80411599 with respect to a. -581280732a*2 What is the first derivative of 73631h*3 - 321h - 43324290 wrt h? 220893h2 - 321 What is the second derivative of -241l*3t*2 + 237570l*3t - l*3 + 435l*2t3 + l2t + 7t*3 wrt t? -482l*3 + 2610l*2t + 42t What is the second derivative of 160k*2o + 8470k2 - 26623ko + 23o wrt k? 320o + 16940 What is the first derivative of -jq*3 - 4695160j + 37007067q3 wrt q? -3jq2 + 111021201q*2 Find the second derivative of 22940929i*2m*2 + 3i*2m - 6i2 + 90269im + 2m wrt m. 45881858i2 What is the second derivative of 1321291c*3w*2 - 528c*3 + 5724w wrt w? 2642582c3 What is the third derivative of 3703034m*4 + 6870624m*2 wrt m? 88872816m What is the second derivative of 107807l3o - l3 + l2o + 3l*2 + 205lo - 3432 wrt l? 646842lo - 6l + 2o + 6 Find the third derivative of 16162797h*3 - 18544506h*2 wrt h. 96976782 What is the third derivative of 5359437a*4 + 4a*2 - 131643? 128626488a What is the second derivative of -6359645d5 - 10972124d wrt d? -127192900d3 Find the first derivative of 2m*3ot - 878m*3 + 31m*2o + 2709mt - 25866o2 wrt o. 2m*3t + 31m2 - 51732o What is the first derivative of 261124066d - 186356631 wrt d? 261124066 Differentiate -4811o*3 + 182o*2 + 15267182. -14433o*2 + 364o What is the second derivative of 1251072410w3 + 1438528w - 16? 7506434460w What is the third derivative of -2c*4 + 37543411c*3 + 34169275c*2 - 3c wrt c? -48c + 225260466 What is the third derivative of -1683v*4 - 14704v*3 - 60715679v*2? -40392v - 88224 Find the third derivative of 47r4u - 1219r4 - 5r*3u - r*3 - 59r*2u + 239r2 - 4ru + r + u wrt r. 1128ru - 29256r - 30u - 6 Find the first derivative of 537024c*3r + 1213c3 + 3c*2r + 94535c2 + 20cr wrt r. 537024c*3 + 3c*2 + 20c What is the third derivative of -3982028t6 - 1556441t*2 - 1? -477843360t3 What is the second derivative of n4 + 24n3 + 1031254n*2 - 510163682n wrt n? 12n2 + 144n + 2062508 What is the first derivative of -176fo - 307f - 1630h*2o + 6h2 + 20h wrt o? -176f - 1630h*2 What is the third derivative of 684687p*4 + 29p*3 + 16p*2 + 3p - 60922? 16432488p + 174 What is the third derivative of 68408j*3r*3 + 500j*3 - 4574j*2r*3 - 7jr2 + 10j + 2r3 wrt j? 410448r3 + 3000 Differentiate a4s + 441a*2 + 449as + 936s - 5152 with respect to a. 4a3s + 882a + 449s Differentiate -4882243k - 8150218 with respect to k. -4882243 What is the derivative of 3wy3 + 8235wy + 9w + 1107y2 + 4467826 wrt y? 9wy2 + 8235w + 2214y Find the second derivative of -62005p*4 - 4p*2 + 4968423p wrt p. -744060p2 - 8 What is the second derivative of 43f*3i*2 - 323f*3i - 265823f2i*2 - 2fi - 5f + 5i2 - 1658i wrt i? 86f3 - 531646f*2 + 10 What is the second derivative of -141849b*2fx + 2b*2f - 74b2x - 5bfx - bf - 55486fx - 3x - 3 wrt b? -283698fx + 4f - 148x What is the third derivative of 33011l5 - l4 + 4882l3 - 316090970l*2? 1980660l*2 - 24l + 29292 Find the second derivative of -15x4 + 1059564x*3 - 711x + 55405. -180x2 + 6357384x Differentiate 453315422o3u*4 + 2o*3 + 11o*2 - 15o + 3781 with respect to u. 1813261688o3u*3 What is the first derivative of 6666441o*3 + 18o + 222957238 wrt o? 19999323o2 + 18 What is the second derivative of -174480256n*3 - 88071035n wrt n? -1046881536n What is the third derivative of -20773648d*4u2 + d2u - 351du2 - 4du - 41u*2 wrt d? -498567552du2 Find the third derivative of 244380z*4 + 2z*3 + 8097512z*2 wrt z. 5865120z + 12 What is the second derivative of -17745582u4 - 2739398u - 3 wrt u? -212946984u2 Find the first derivative of -3gk2y + 20gk*2 - 1539gk + 2592002gy2 + 5g wrt y. -3gk*2 + 5184004gy Find the first derivative of 679104a*4 + 2630015. 2716416a*3 Find the third derivative of -214386289t*4 - 82t*2 - 1753t + 6 wrt t. -5145270936t What is the second derivative of -p5 + 2181601p*4 - 5912p + 4006? -20p3 + 26179212p*2 Find the second derivative of -2259173l*3m*2 - 3l*3m + l*2 - 90lm - 3m*5 + 47m + 21 wrt m. -4518346l3 - 60m*3 Find the second derivative of -4236648t*2 - 55122t + 8 wrt t. -8473296 Find the second derivative of -141844958z5 + 130302368z wrt z. -2836899160z3 Find the second derivative of 181531317h*2j*2 + hj*2 - 4hj + 3h - 4j2 - j + 346 wrt h. 363062634j*2 Find the second derivative of 8476441l*4 - 64306l + 19. 101717292l2 Differentiate 17w*3 + 368228w*2 - 64922103. 51w*2 + 736456w Find the first derivative of -ijw - iw - 519491i + 1061jw - 114j + 2w wrt i. -jw - w - 519491 What is the derivative of 11cy - 96066c - 3251000y + 527 wrt y? 11c - 3251000 Find the second derivative of 7547b5 + 2b*4 + 62b*3 - 164677b - 16 wrt b. 150940b3 + 24b*2 + 372b What is the second derivative of 103462949c2j + 1846cj - 644c + 2j - 2 wrt c? 206925898j Differentiate 1199096iv4 + 4i + 2v4 + 252209 wrt v. 4796384iv3 + 8v*3 What is the first derivative of -2922244g*2 + 10g - 85110003 wrt g? -5844488g + 10 What is the second derivative of 34370660a*4 + 33161510a wrt a? 412447920a2 Find the third derivative of 2j*4y + 52j4 + 300941j*3y + 2j2y - 7229jy + 3244y wrt j. 48jy + 1248j + 1805646y What is the second derivative of -118i*2ky2 - 10i*2ky + 3i*2y + 5iky + iy*2 - 3ky2 + 15ky + 70k + 454y2 wrt y? -236i*2k + 2i - 6k + 908 Find the first derivative of -5674353b2p - 27133b2 - 763b + 10p - 2 wrt p. -5674353b*2 + 10 What is the derivative of -11515411j - 7986739? -11515411 Find the first derivative of 282h2jt + 25h*2j - 1328h2t - 144h2 - 699h + 5t wrt t. 282h*2j - 1328h2 + 5 Find the first derivative of -2a*3 + 3478039a*2 + 3a - 91809318. -6a2 + 6956078a + 3 Find the second derivative of -198d2q*2 + 2d*2q - 18853d2 - 17dq2 - 6dq - d - 4301q*2 - 2q wrt d. -396q2 + 4q - 37706 Find the third derivative of 301221653r3 + 2118r*2 + 78r - 11. 1807329918 What is the second derivative of -4833372g2s*2 - 13g*2s - 6gs + 2236g wrt s? -9666744g*2 What is the second derivative of 958162671w*2x*2 + 246176wx + 4x*2 wrt w? 1916325342x*2 What is the third derivative of 6413278b6 + b2 - 4915	{ "pile_set_name": "DM Mathematics" }
g) = -4g2 - 6g - 1. Let t(a) = -3l(a) + 2q(a). Calculate t(-5). -1 Suppose 5g + 3u - u = 20, 5u = 4g - 49. Let f be (5/(-2))/((-3)/g). Let z(s) be the first derivative of -s*4/4 + 5s3/3 + s2 - 3s + 1. What is z(f)? 7 Let y(g) = -3g + 52. Let p be y(6). Suppose -18 + p = -4m. Let r(a) = -a3 - 3a*2 + 2a + 2. What is r(m)? 10 Let q(t) = 7107 - 7109 - 2t + 0t. What is q(-1)? 0 Let t(m) = 4m + 23. Let g(d) = 9d + 49. Let f(x) = -3g(x) + 7t(x). Determine f(-14). 0 Let h(q) be the second derivative of q*3/6 - 3q. Let c(w) = -w*3 - 7w + 7. Let m be (-1)/4612/18. Let k(g) = mc(g) - 6h(g). Give k(0). -7 Let q(p) be the first derivative of p6/40 - p5/30 + p*3/6 + 2p*2 - 1. Let a(t) be the second derivative of q(t). Let o be 2 + -3 + 2 + 0. Give a(o). 2 Let u(y) = -12y + 2y - 4y - 5y. Give u(2). -38 Let m be (-32)/(-18) + (-4)/(-18). Let k = 5 - m. Let w(v) = 27 + 27 + v2 + v - 53 - kv*3. Calculate w(-1). 4 Let r = 25 + -26. Let p(u) = -5u3 - u2 - 3u - 3. Let v be p(r). Let o(i) = -i2 + 5i + 4. What is o(v)? 8 Let n(f) = -2f + 3. Suppose 5r = -d - 0r, 2r = -5d + 69. Suppose -15h = -12h - d. What is n(h)? -7 Let o(r) be the second derivative of -r5/20 + 5r*4/12 + 5r*3/6 + 7r*2 - 28r + 7. Give o(6). 8 Let w(s) = 2s - 17. Let h be w(-4). Let b = -25 - h. Let x(r) be the first derivative of -r3/3 + r2/2 + 6r - 1. Determine x(b). 6 Let o = -137 + 77. Let q = o - -69. Let j(z) = z - 7. Calculate j(q). 2 Let v(h) = 7h + h2 + 239 - 698 + 208 + 240. Suppose -3i + 28 + 13 = -4r, 4r = i - 35. Determine v(r). -3 Let b(c) = 3c + 3. Let q be b(-2). Let h(d) = -9d*2 + 3d + 3. Let w(f) = 11f2 - 3f - 3. Let i(s) = -6h(s) - 5w(s). What is i(q)? -3 Let q(i) = 3i2 - i. Let a = 189 + -187. Give q(a). 10 Let x = 119 - 106. Suppose 4i = -q + 7, -2q - i + x = -4q. Let h(s) = 0s2 - 3 - 5s + 8 - s*2. Give h(q). 5 Suppose -1 = 5v + f, 3v - 7f = -12f - 5. Let o be 3/(-2)(-3 + 1). Suppose v = p - 0p - o. Let s(x) = 4x - 1. Give s(p). 11 Let z(r) = -28 + 10 + 11 + 10r + 8. Calculate z(2). 21 Let g(c) = 6c + 19. Let n = 940 + -944. What is g(n)? -5 Let k = -776 + 781. Let u(y) = y*2 - 8y + 15. Calculate u(k). 0 Suppose -v = 2v - 21. Let h(i) = i - 10. Suppose 5z - 1 - 6 = k, -4z - 7 = -5k. Let b(o) = o - 9. Let y(a) = kb(a) - 2h(a). What is y(v)? 0 Let h(m) be the second derivative of -m6/120 + m5/5 - 5m4/12 - 13m*3/6 - 7m*2/2 + 22m. Let p(z) be the first derivative of h(z). Determine p(11). -2 Let l(h) = 2h + 3. Let g be l(-4). Let s(a) = -1. Suppose -5b + 11 = -4f + 41, -4f + 24 = -2b. Let q(n) = -n + 11. Let k(i) = fs(i) + q(i). What is k(g)? 11 Let o(w) = -w*3 - 11w*2 - 8w + 14. Let v be o(-10). Let r(l) = l*2 + 3l - 10. Let g(p) = -1. Let j(u) = 6g(u) - r(u). What is j(v)? -14 Let y(l) = -3l*2 + 18l + 36. Let n(k) = -k*2 + 9k + 17. Let z(a) = 5n(a) - 2y(a). Give z(-8). 5 Suppose -6p + 3p = -72. Let h = p - 18. Let c(m) = -h + m + 5 - 13. Calculate c(0). -14 Let d(t) = -t. Let c be d(-1). Let i(o) = -o - 1. Let k(g) = -g*2 - 6g - 1. Let b(l) = ck(l) - 4i(l). What is b(2)? -5 Let o(c) = 276 + 0c2 - c2 - 283 + 6c. Suppose -3p + 12 = p. Let i be o(p). Let b(r) = r2 - r + 1. Give b(i). 3 Let k(h) = -13h - 5. Let p be 4/(-22) + (-36)/44. Let w be k(p). Let t(s) = s*3 - 8s*2 + s - 3. Determine t(w). 5 Let o(h) = 3h*2 + 2h + 2. Let c(l) = -2 - 5l - l3 - 2l*3 + 4l*3 + 5l*2. Let p be c(-6). Let t be 1/(-2) + 12/p. What is o(t)? 10 Let g(b) = 4 - 3b*2 + b + 0b - b2 - 5. Give g(1). -4 Let f(m) be the first derivative of m4/4 - 5m3 + 7m*2 + 5m + 196. What is f(14)? 5 Let j(b) be the third derivative of b6/120 - b5/15 - 7b4/24 + b3/2 - 2b*2. Let x = 18 + -18. Suppose x = -5f + 31 - 6. Give j(f). -7 Let s(x) be the third derivative of -x5/30 + x4/6 - x*3/6 + 2x*2 + 16x. Let w(c) = -c*3 - 10c*2 + 11c + 3. Let u be w(-11). Give s(u). -7 Let x(n) = 8n - 2. Let c = -112 - -114. Calculate x(c). 14 Suppose 8u - 4u = 112. Let f = 47 - u. Let c = f - 21. Let s(d) = -2d*3 - 4d*2 - 2d + 2. Determine s(c). 6 Let k(w) = -4w3 - w - 1. Suppose 3v + 12 = 3z, -5z + 4 + 16 = -3v. Let i(s) = s2 + 4 - zs - 1 - 1. Let y be i(3). Calculate k(y). 4 Let b(y) be the third derivative of -y6/120 + y5/10 - y*4/24 + 3y*3/2 + 330y*2. Determine b(6). 3 Suppose -16k = -2k - 56. Let c(z) = z + 1. Let i(w) = -2w. Let h = -7 - -4. Let b(t) = hc(t) - 2i(t). Determine b(k). 1 Let u(p) be the first derivative of 2p - 1/2p*2 - 12 - 1/3p*3. Give u(-3). -4 Let g(r) = 2r + 2r2 + 6 + r - 3r*2. Suppose 14i = 9i - 5n + 30, -4i + 22 = 2n. Give g(i). -4 Let g(a) be the first derivative of -30 + 3a3 + 7/2a*2 - 10a + 1/4a4. Determine g(-8). -2 Suppose -33 = 2i + 2i + 5j, 0 = -i - 5j - 27. Let t = i + 4. Let z(g) = -t + 5 + 1 - 2g. What is z(4)? -4 Let p(z) be the first derivative of -z7/420 - z6/180 + z5/30 - z4/12 + 16z3/3 - 9. Let b(l) be the third derivative of p(l). Give b(2). -18 Let f(k) = k3 - 8k*3 + 3k*3. Determine f(1). -4 Let y(z) = 11z*2 + 8z - 7. Let d(j) = 5j2 + 3j - 4. Let s(o) = -4o + 5. Let c be s(-1). Let h(u) = cd(u) - 4y(u). Determine h(7). 6 Let g(q) = -q. Let y(f) = -5f. Let d be (5 + 1)3/6. Suppose -r + 3a = -8 + 19, -dr + 5a - 33 = 0. Let n(t) = rg(t) + 2y(t). Give n(2). 2 Let s(n) = n*3 - 16n*2 - 17n + 5. Suppose -m - 6m = 14. Let o be m + 15 + (-4)/(-1). Let d be s(o). Let t(y) = -y + 2. What is t(d)? -3 Let g(z) = -2z*2 + 15z - 4. Let p(l) = -l*2 + 8l - 2. Let w(m) = 3g(m) - 5p(m). Give w(2). 4 Suppose -5y + 32 = 2s - 3s, 5 = 2y - 3s. Let w = 1 + y. Suppose wh + 15 = 3h. Let a(f) = f3 + 5f*2 + 3f - 3. What is a(h)? 6 Let u(l) = 2l - 3l*2 - 5l*3 + 2l*3 + 1 + 4l3. Let r(c) = -c2 - 8c + 10. Let n be r(-8). Suppose -nf - 1 = -21. What is u(f)? 1 Let q(i) = i*2 - 2i - 4. Suppose -3l - 2 = -8. Let v be l/2(2 + 3). Suppose 5p - 2p - 27 = -vf, 3p = -3f + 21. What is q(f)? -1 Let h be (-50)/(-4)6/5. Let c be 528/30 - (-6)/h. Suppose c - 13 = -g. Let l(a) = a*3 + 4a*2 - 5a - 5. Calculate l(g). -5 Let w(z) = -z*3 + 3z*2 - z + 1. Suppose -19 = -2x - 15. Suppose xh - 3 = h. Determine w(h). -2 Let w(b) = -4b*3 - 5b*2 - 8. Let q(p) = 4p*3 + 4p*2 + 7. Let m be (-4)/(-6) - ((-38)/6 + 1). Let j(z) = mw(z) + 7q(z). What is j(-1)? -5 Let l(k) = -k3 - k2 - k - 2. Let x(c) = c2 - c - 4. Let h be x(3). Suppose -3 = s + 3q, h = -3s + s - 2q. Let u be 0/(s + 0 + -2). Calculate l(u). -2 Let u(q) = -q*3 + 3q*2 + 4q - 3. Let k = 12 - -37. Let o = 52 - k. Determine u(o). 9 Let g(i) = -i - 9. Let c be g(-8). Let n(k) be the third derivative of -2/15k6 - 1/60k*5 - 2k*2 + 0k + 1/24k4 + 1/6k3 + 0. Give n(c). 15 Let m(p) = p3 + 10p2 + 8p - 11. Let f(c) = c - 17. Let g be f(15). Let h be (-1)/(2/(-4))9/g. Calculate m(h). -2 Let g(f) = 6f*2 + 2f - 12. Let d(z) = -z*2 - 1. Let n(i) = -5d(i) - g(i). Let u(r) be the first derivative of n(r). Give u(-4). 6 Suppose 0f + 2b = 4f, -3f + b = -1. Let z be ((-10)/(-4))/(f/(-2)). Let d(u) = u - 3. Calculate d(z). -8 Suppose -2h - 4d - 11 = 3, h - 5d = 28. Let b(p) = p + 2. What is b(h)? 5 Let d(g) = -3g. Let o(m) = m. Let p(r) = -d(r) + o(r). Calculate p(1). 4 Let p(z) = -z*3 - 13z*2 - 13. Let i = 389 + -402. Give p(i). -13 Let v(s) = -s - 2. Let d be -74/8-2. Let q = -7 + d. Determine v(q). -2 Let k(o) = -o + 5 - 20 + 18. Calculate k(-6). 9 Let w(c) = 3c*2 - 2c*2 - 2c*2 + 4 + 4c. Suppose 0 = 5g + 2k - 45, 3g = -0k + 2k + 11. What is w(g)? -17 Let o = 1615 + -1613. Let r(b) be the first derivative of -15/4b*4 + 1/3b3 + b + 3 - bo. Calculate r(1). -15 Suppose 8y + 3y + 55 = 0. Let w(o) = 2o3 + 10o*2 - 3. Determine w(y). -3 Let o(j) = 2j*2 - 2j + 6. Let g(h) = -3h2 + h - 7. Let u(i) = -3g(i) - 4o(i). What is u(3)? 21 Let f(r) = 4r + 0r2 + 0r*2 - 5r - 1 + r*2. What is f(-4)? 19 Let d(g) = 9g - 5g2 - 10g + 4 + 4g2. Let n = -37 + 41. Suppose nx + 3 = 3t + x, 4t - 5x - 8 = 0. Give d(t). -2 Suppose p + 3c + 33 = 0, 3*c + 25 =	{ "pile_set_name": "DM Mathematics" }
? False Is 45691776363 a composite number? True Is 10935942203 a prime number? False Is 4066333 a composite number? False Is 763663489 a prime number? True Is 616248511 a composite number? False Is 66658827113 a composite number? False Is 1914226567 a composite number? True Is 1677745217 prime? False Is 6672821039 a composite number? False Is 47037905 prime? False Is 23432347567 prime? False Is 2774139077 composite? False Is 1468212037 a composite number? False Is 747470453 a prime number? True Is 17627519751 a composite number? True Is 380028851 prime? False Is 2463346753 a prime number? False Is 1764680361 prime? False Is 1430361937 a composite number? False Is 58136429717 a prime number? False Is 49142489119 a composite number? True Is 52996537 a prime number? False Is 201196153 a prime number? False Is 1813667593 prime? False Is 66676759249 a composite number? True Is 346657733 composite? False Is 1721564987 composite? True Is 116664437 a composite number? False Is 128095346139 composite? True Is 14006588567 a composite number? False Is 86866668149 a composite number? False Is 1427870773 prime? False Is 706341173 composite? False Is 36977074247 a composite number? True Is 82240351 prime? True Is 441076637 composite? True Is 21413118317 composite? False Is 113699252011 prime? True Is 285015346519 composite? False Is 10786078277 prime? False Is 5197072319 prime? False Is 5697236607 a composite number? True Is 7812221419 prime? False Is 13280090483 prime? False Is 123639529 a prime number? False Is 355138170197 prime? True Is 37453815709 prime? True Is 1235702201 a prime number? True Is 1537891687 a prime number? False Is 3779301973 a prime number? False Is 217155337 prime? False Is 127245851 a composite number? True Is 63535007 a composite number? False Is 2554700587 a prime number? False Is 341133739 a prime number? False Is 2001797887 prime? False Is 3664004027 a composite number? False Is 24153037607 prime? False Is 3959373541 prime? False Is 11373821065 composite? True Is 417884759 a prime number? False Is 207356945 composite? True Is 966862381 a composite number? False Is 5174870459 prime? False Is 163076311283 prime? False Is 13996254457 a prime number? False Is 2730317399 a composite number? False Is 2402391127 a prime number? False Is 25360973519 a prime number? False Is 237067189 a prime number? False Is 91614893549 prime? False Is 386532103 composite? False Is 145996577089 a prime number? False Is 165242299 a prime number? True Is 2071147379 prime? False Is 5520585943 a prime number? False Is 6332916361 prime? False Is 16715669693 prime? False Is 812227571 composite? True Is 245497531 a prime number? True Is 761460853 prime? False Is 195147137 composite? False Is 62731351013 a prime number? False Is 5497451153 a prime number? False Is 19965079 composite? True Is 1341821731 composite? False Is 1701187717 prime? True Is 2923519 a composite number? True Is 5666979823 composite? True Is 6503265011 prime? False Is 114808489 composite? False Is 2834019247 a prime number? False Is 4793408619 a prime number? False Is 6718397843 a prime number? False Is 61634406881 composite? False Is 28708425643 a composite number? True Is 1869330239 a prime number? False Is 47779319561 prime? True Is 3337453783 a prime number? True Is 21136139819 prime? False Is 173739611 prime? True Is 473037178 a prime number? False Is 19703810822 composite? True Is 3676140779 composite? False Is 6929121449 prime? False Is 346419559 a composite number? False Is 1085987117 composite? True Is 1255859249 a composite number? True Is 41331300079 a prime number? True Is 21036852467 composite? False Is 921963061 composite? False Is 1420837123 a composite number? False Is 76008971293 a composite number? False Is 10055797783 composite? False Is 65471688026 a composite number? True Is 73781699723 prime? False Is 159140380327 a composite number? True Is 2699914237 a prime number? False Is 1669331141 prime? True Is 3182459887 a composite number? False Is 256345447 a prime number? True Is 7413443 prime? True Is 1294273649 prime? False Is 9815291011 a composite number? False Is 11422363021 prime? True Is 89028313 composite? True Is 3661549973 a prime number? True Is 612442093 prime? False Is 24579499621 a prime number? True Is 124659203 composite? False Is 20526240499 a composite number? False Is 80508969911 a composite number? False Is 666674231 prime? False Is 1030284413 prime? True Is 23714536379 prime? False Is 440631491 a prime number? False Is 8344093937 composite? False Is 2006559959 prime? True Is 6242005703 a prime number? True Is 55710249709 prime? True Is 9313870771 a composite number? False Is 315611627 a composite number? True Is 67857191 composite? True Is 454839443 a prime number? False Is 8391878507 a composite number? False Is 8138489959 composite? True Is 8960320909 a composite number? False Is 192484357 a prime number? False Is 234576173 composite? True Is 4426396027 a prime number? False Is 3371330761 a prime number? True Is 2693656279 a prime number? True Is 2735367959 composite? True Is 110681540666 prime? False Is 1835992193 prime? False Is 3086651837 prime? False Is 387396497 composite? False Is 135077213369 composite? True Is 8741999513 prime? False Is 438574529 a composite number? False Is 1574526719 composite? False Is 3023335267 a composite number? True Is 65424271711 composite? False Is 491045699 prime? False Is 2287561349 a prime number? True Is 2913624209 a prime number? False Is 155369587081 prime? False Is 249070499 a prime number? True Is 7223704867 prime? False Is 757212497 a composite number? False Is 32974721053 composite? False Is 3720925013 prime? False Is 74575101473 a prime number? True Is 73809917 composite? False Is 215070123467 a prime number? True Is 3142891723 prime? True Is 12618790165 composite? True Is 9485035519 composite? True Is 14443904597 a composite number? False Is 65191697587 a composite number? False Is 15424517 a composite number? True Is 75762418877 a prime number? True Is 1207169611 a prime number? False Is 238312493 prime? False Is 80912959 a composite number? False Is 1481851633 a prime number? True Is 62741880923 prime? False Is 6265589767 a composite number? False Is 3104262514 a composite number? True Is 6435727087 a composite number? True Is 12463733819 a prime number? True Is 1448512643 prime? False Is 141181247 composite? True Is 31873476469 a prime number? False Is 28790208173 composite? False Is 713827913 prime? True Is 1476673897 composite? False Is 115612897 prime? True Is 63110460991 a composite number? False Is 262383109 a composite number? False Is 1463939821 a prime number? True Is 9096427033 a composite number? False Is 71221738129 prime? True Is 1187280581 composite? False Is 2342029639 prime? False Is 78307617757 a prime number? False Is 133433487167 prime? False Is 73739852201 a prime number? True Is 11129717 prime? False Is 52796941 prime? False Is 486911273 a composite number? True Is 1845723349 a composite number? False Is 10750600183 a composite number? True Is 19421247529 a prime number? True Is 11417484079 a composite number? False Is 7413996799 a composite number? True Is 25387974163 a prime number? True Is 1782615553 prime? False Is 11003883477 a composite number? True Is 60157179219 a composite number? True Is 847459009 a composite number? False Is 4814553691 a prime number? False Is 10902677503 composite? False Is 468546311 a composite number? False Is 99860518711 composite? False Is 9744763553 a composite number? True Is 1137213383 a composite number? True Is 23784639161 prime? False Is 1526571367 prime? True Is 427498681 a composite number? False Is 490545569 a prime number? True Is 3053850637 a prime number? True Is 242737591 composite? False Is 1597866893 a prime number? False Is 11884718399 a composite number? False Is 81877690483 a prime number? True Is 2984910553 prime? True Is 652612477 prime? False Is 4132228873 a prime number? True Is 5654107 a composite number? True Is 669651127 a composite number? False Is 413342927 composite? True Is 1468341395 a composite number? True Is 329067630313 a composite number? False Is 36131705405 composite? True Is 9172162499 prime? True Is 3149034	{ "pile_set_name": "DM Mathematics" }
ten thousands digit of 11224? 1 What is the thousands digit of 1414? 1 What is the tens digit of 5974? 7 What is the units digit of 1418? 8 What is the units digit of 941? 1 What is the units digit of 6044? 4 What is the hundreds digit of 164? 1 What is the units digit of 122? 2 What is the units digit of 40916? 6 What is the units digit of 31633? 3 What is the hundreds digit of 19116? 1 What is the thousands digit of 21482? 1 What is the hundred thousands digit of 212622? 2 What is the thousands digit of 4196? 4 What is the thousands digit of 1121? 1 What is the units digit of 5889? 9 What is the units digit of 904? 4 What is the hundreds digit of 391? 3 What is the units digit of 1097? 7 What is the ten thousands digit of 25160? 2 What is the thousands digit of 1737? 1 What is the hundreds digit of 2003? 0 What is the units digit of 92626? 6 What is the hundreds digit of 2935? 9 What is the tens digit of 54159? 5 What is the tens digit of 2175? 7 What is the hundreds digit of 2209? 2 What is the hundreds digit of 471? 4 What is the thousands digit of 1245? 1 What is the tens digit of 887? 8 What is the units digit of 7933? 3 What is the hundreds digit of 215? 2 What is the tens digit of 1698? 9 What is the units digit of 56231? 1 What is the units digit of 1036? 6 What is the thousands digit of 73910? 3 What is the units digit of 1995? 5 What is the units digit of 4315? 5 What is the thousands digit of 7776? 7 What is the hundreds digit of 15277? 2 What is the hundreds digit of 1574? 5 What is the units digit of 98? 8 What is the tens digit of 1121? 2 What is the tens digit of 3758? 5 What is the thousands digit of 6970? 6 What is the tens digit of 571? 7 What is the units digit of 151065? 5 What is the thousands digit of 1323? 1 What is the tens digit of 717? 1 What is the hundreds digit of 836? 8 What is the tens digit of 3602? 0 What is the tens digit of 13373? 7 What is the units digit of 11635? 5 What is the units digit of 1433? 3 What is the units digit of 6880? 0 What is the tens digit of 1727? 2 What is the ten thousands digit of 102436? 0 What is the hundreds digit of 292? 2 What is the hundreds digit of 2070? 0 What is the tens digit of 516? 1 What is the hundreds digit of 12740? 7 What is the hundreds digit of 7446? 4 What is the tens digit of 853? 5 What is the tens digit of 534? 3 What is the ten thousands digit of 21513? 2 What is the tens digit of 3755? 5 What is the units digit of 2084? 4 What is the thousands digit of 2594? 2 What is the ten thousands digit of 11474? 1 What is the units digit of 5139? 9 What is the units digit of 523? 3 What is the ten thousands digit of 17849? 1 What is the hundreds digit of 494? 4 What is the thousands digit of 15108? 5 What is the hundreds digit of 298? 2 What is the units digit of 558? 8 What is the tens digit of 8909? 0 What is the tens digit of 43? 4 What is the tens digit of 25096? 9 What is the thousands digit of 2009? 2 What is the units digit of 1191? 1 What is the units digit of 18? 8 What is the thousands digit of 5676? 5 What is the tens digit of 3393? 9 What is the ten thousands digit of 95279? 9 What is the tens digit of 42654? 5 What is the units digit of 12733? 3 What is the hundreds digit of 3622? 6 What is the hundreds digit of 377? 3 What is the ten thousands digit of 106532? 0 What is the units digit of 936? 6 What is the ten thousands digit of 35103? 3 What is the tens digit of 3353? 5 What is the hundreds digit of 3396? 3 What is the units digit of 518? 8 What is the units digit of 4314? 4 What is the units digit of 23900? 0 What is the ten thousands digit of 50340? 5 What is the tens digit of 1777? 7 What is the thousands digit of 1704? 1 What is the tens digit of 836? 3 What is the hundreds digit of 639? 6 What is the tens digit of 4363? 6 What is the tens digit of 236? 3 What is the units digit of 71? 1 What is the tens digit of 54145? 4 What is the thousands digit of 95546? 5 What is the units digit of 14614? 4 What is the ten thousands digit of 24371? 2 What is the thousands digit of 13287? 3 What is the hundreds digit of 1729? 7 What is the tens digit of 493? 9 What is the thousands digit of 1143? 1 What is the tens digit of 12082? 8 What is the tens digit of 1443? 4 What is the thousands digit of 2059? 2 What is the units digit of 932? 2 What is the thousands digit of 1206? 1 What is the tens digit of 1030? 3 What is the units digit of 1169? 9 What is the units digit of 694? 4 What is the hundreds digit of 6515? 5 What is the tens digit of 944? 4 What is the hundreds digit of 1093? 0 What is the units digit of 91120? 0 What is the units digit of 5562? 2 What is the ten thousands digit of 139613? 3 What is the hundreds digit of 10391? 3 What is the tens digit of 810? 1 What is the tens digit of 4832? 3 What is the hundreds digit of 1566? 5 What is the thousands digit of 7383? 7 What is the thousands digit of 4508? 4 What is the units digit of 5100? 0 What is the hundreds digit of 219? 2 What is the tens digit of 247? 4 What is the hundreds digit of 2162? 1 What is the units digit of 45? 5 What is the thousands digit of 4980? 4 What is the tens digit of 14005? 0 What is the hundreds digit of 776? 7 What is the ten thousands digit of 48819? 4 What is the tens digit of 4367? 6 What is the tens digit of 589? 8 What is the hundreds digit of 17582? 5 What is the tens digit of 765? 6 What is the tens digit of 1298? 9 What is the units digit of 11980? 0 What is the tens digit of 244? 4 What is the hundreds digit of 49054? 0 What is the tens digit of 22980? 8 What is the tens digit of 25? 2 What is the hundreds digit of 9807? 8 What is the hundreds digit of 5947? 9 What is the hundreds digit of 7003? 0 What is the thousands digit of 4279? 4 What is the hundreds digit of 1304? 3 What is the tens digit of 5733? 3 What is the hundreds digit of 295? 2 What is the tens digit of 183? 8 What is the units digit of 111344? 4 What is the thousands digit of 9135? 9 What is the tens digit of 922? 2 What is the tens digit of 794? 9 What is the ten thousands digit of 51547? 5 What is the units digit of 95? 5 What is the units digit of 6309? 9 What is the units digit of 30558? 8 What is the tens digit of 42832? 3 What is the units digit of 444? 4 What is the units digit of 39? 9 What is the tens digit of 68? 6 What is the units digit of 58293? 3 What is the tens digit of 139427? 2 What is the ten thousands digit of 53202? 5 What is the hundreds digit of 379? 3 What is the units digit of 462? 2 What is the units digit of 9721? 1 What is the hundreds digit of 55778? 7 What is the units digit of 1050? 0 What is the tens digit of 234? 3 What is the hundreds digit of 3231? 2 What is the thousands digit of 1078? 1 What is the thousands digit of 54426? 4 What is the units digit of 1568? 8 What is the tens digit of 883? 8 What is the hundreds digit of 4842? 8 What is the thousands digit of 1425? 1 What is the hundreds digit of 9873? 8 What is the tens digit of 2488? 8 What is the ten thousands digit of 29480? 2 What is the tens digit of 33727? 2 What is the ten thousands digit of 33534? 3 What is the units digit of 73625? 5 What is the tens digit of 680? 8 What is the tens digit of 6036? 3 What is the thousands digit of 27220? 7 What is the units digit of 45735? 5 What is the thousands digit of 6225? 6 What is the thousands digit of 25670? 5 What is the tens digit of 1041? 4 What is the hundreds digit of 1011? 0 What is the hundreds digit of 2580? 5 What is the hundreds digit of 3617? 6 What is the ten thousands digit of 49461? 4 What is the tens digit of 137316? 1 What is the hundreds digit of 4046? 0 What is the tens digit of 111? 1 What is the thousands digit of 10609? 0 What is the thousands digit of 42140? 2 What is the thousands digit of 6861? 6 What is the tens digit of 1373? 7 What is the thousands digit of 87746? 7 What is the thousands digit of 3494? 3 What is the tens digit of 3782? 8 What is the units digit of 3348? 8 What is the thousands digit of 53341? 3 What is the units digit of 9419? 9 What is the tens digit of 1748? 4 What is the thousands digit of 59804? 9 What is the hundreds digit of 28374? 3 What is the thousands digit of 12486? 2 What is the thousands digit of 3496?	{ "pile_set_name": "DM Mathematics" }
+ 3j = 65. What is the remainder when 30 is divided by r? 0 Let u(r) be the first derivative of 7r*2/2 - 2r - 2. Let w = -84 + 132. Calculate the remainder when w is divided by u(3). 10 Suppose 0 = 3r + 5n - 11, 5r - n - 15 = -6n. Suppose -rg - 4s = -94, -3g + 3s + 68 = -100. Calculate the remainder when g is divided by 18. 17 Suppose 12l - 9l + 3o - 72 = 0, o - 105 = -4l. Calculate the remainder when 2382 is divided by l. 6 Suppose -76v + 184v = 68v + 1160. Let f(r) = -5r + 4. Let u be f(-6). Suppose -u - v = -m. Calculate the remainder when m is divided by 16. 15 Calculate the remainder when 4/7 - 78705/(-385) is divided by 68. 1 Let w(f) = 3f + 16. Let d be w(8). Let h = 118 - d. Calculate the remainder when h is divided by 9. 6 Let b(u) = -50u3 - u2 - u + 1. Let y be b(-2). Suppose 8d - y - 1825 = 0. What is the remainder when d is divided by 70? 68 Let v = -297 - -279. Calculate the remainder when 84 is divided by (v/(-15))/(2/5). 0 Let i(k) = 188 - 3k - 188 + 5k2. Let p(s) = -s3 - 2s*2 + 8s + 4. What is the remainder when p(-6) is divided by i(-2)? 22 Let o = 37 + -42. Let n(b) be the third derivative of -b5/60 - b4/8 + 7b3/3 - 12b*2. What is the remainder when 15 is divided by n(o)? 3 Let t(c) = c + 50. Suppose -5p + 50 = -2o, 3o - 5p + 58 = -7. What is the remainder when 110 is divided by t(o)? 5 Suppose -3o - 6 = -3m, 4o + 0o = -3m + 13. Let f = 11 - -34. Let g = f - 44. Calculate the remainder when o is divided by g. 0 Let p(w) = 4w + 53. Let t = -117 + 119. Calculate the remainder when p(-9) is divided by t. 1 Let k = 7348 + -7340. Suppose 0 = 2f - 4 - 4, -5f = 5c - 85. What is the remainder when c is divided by k? 5 Suppose -6t + 117 + 9 = 0. Suppose t = s + 15. Suppose -14r + 8 = -sr. What is the remainder when r is divided by 1? 0 Let g = 82 + -58. Suppose l - 57 + 8 = 0. Suppose l = -r + 143. Calculate the remainder when r is divided by g. 22 Let p(k) = 6k*2 - 8k - 12. Let c be p(-5). Suppose y - 137 = -2q, 5q - 4y - c = 2q. Let d = 79 - q. Calculate the remainder when 32 is divided by d. 6 Let h be ((-220)/50)/(8/(-340)). Suppose -5d + h = 2a, 0 = 5a - 8a - 4d + 284. Suppose -3q + 0q + 42 = 0. What is the remainder when a is divided by q? 12 Let m(c) = 2c3 + c2 + 1. Let o be -1 + (-5 - -5 - 1). Calculate the remainder when m(2) is divided by o/((-15)/10 - -1). 1 Let l be (-4)/(-42) + 1184/(-84). Suppose 3v + 12 = 3b, 13 - 1 = 3b - 2v. Calculate the remainder when (720/(-84))/(b/l) is divided by 11. 8 Suppose -64 = -2n - 50, 158 = 3p + 2n. Suppose 2o + o = 3594. What is the remainder when o is divided by p? 46 Suppose -23q + 3330 = 81q - 830. Calculate the remainder when 635 is divided by q. 35 Suppose 592k - 12917 = 57531. Suppose 59 = o - 2l - 66, 3o - 3l = 381. What is the remainder when o is divided by k? 10 Suppose 26f - 18f - 2272 = -24f. What is the remainder when 419 is divided by f? 64 Let y = 533 - 524. What is the remainder when 6 + (1 + 39)/2 is divided by y? 8 Let v = -244 - -162. Let d = -35 - v. Let a = -535 - -547. Calculate the remainder when d is divided by a. 11 Let u(f) = -6f*3 + 396f2 - f + 122. Let h = -1 - -1. Let x(j) = j + 17. Calculate the remainder when u(66) is divided by x(h). 5 Let o(t) = t2 - 8t - 15. Let n = 1194 - 1145. Calculate the remainder when o(15) is divided by n. 41 Suppose 0 = 4g + 3b + 1, 0 = -g + b - 2. What is the remainder when 80 - (4 - g/(-1)) is divided by (2 - -4)(-50)/(-15)? 17 Let j = -1567 - -1609. What is the remainder when 154 is divided by j? 28 Suppose 0 = -11f - 15 + 70. Let n(x) = 17x - 77. Calculate the remainder when 11 is divided by n(f). 3 Let w = 138 + -43. Let g be (3/2)/((-10)/240). Let r = g - -42. Calculate the remainder when w is divided by r. 5 What is the remainder when 428(-7)/(-84)24 is divided by 42? 16 Suppose 11j = -93 + 148. Suppose -5t = 3g - 148, jg - 30t - 195 = -28t. What is the remainder when 613 is divided by g? 39 Suppose -15 = -8t + 17. Suppose 5a - 452 = 6d - 8d, d = -ta + 361. What is the remainder when a is divided by 27? 9 Suppose 0 = 5z + 40, -3w + z = 5z - 184. Calculate the remainder when 23829 is divided by w. 69 Let k(a) = -2a3 - 24a*2 - 2a - 19. Let y be k(-12). Suppose -9 = -yh + 1. What is the remainder when 67 is divided by h? 1 Let h(j) = 10j - 9. Let x be 11/((-220)/(-8))30. Let g(s) = -3s + 5. Calculate the remainder when h(x) is divided by g(-6). 19 Suppose -161b = -147b - 21882. What is the remainder when b is divided by 779? 5 Suppose b - 2f = 613, -3b - 4f + 2529 - 730 = 0. Suppose 0v + v + b = 2d, -1512 = -5d + 3v. Calculate the remainder when d is divided by 16. 15 Let t = -3955 - -3975. What is the remainder when 35 is divided by t? 15 Suppose -1422 = -3a + 4g, -455 = 4a - 4g - 2355. What is the remainder when a is divided by 15? 13 Suppose -3n - l = -846 - 457, 3n = -3l + 1311. What is the remainder when 26410 is divided by n? 430 Let p(d) = 31d + 158. Calculate the remainder when 5843 is divided by p(-5). 2 Suppose 3r + 5s - 795 = 1988, -3r = -4s - 2801. What is the remainder when r is divided by 28? 7 Let t(q) = -q2 + 4q + 2. Let r be t(4). Let c(n) = -171n - 5111. What is the remainder when (339/(-6))/(r/(-4)) is divided by c(-30)? 18 Let y(a) = -a2 + 7a + 20. Let d be y(9). Suppose j - d = 2. Suppose h - jp = 14, -5h - p - 85 = -239. Calculate the remainder when 59 is divided by h. 29 Suppose 4n - 2566 = 6y - 9y, -y - 3217 = -5n. Calculate the remainder when n is divided by 49. 6 Let c = 944 + -805. What is the remainder when 4307 is divided by c? 137 Let q(c) = -2c3 + 44c*2 - 114c + 25. What is the remainder when 144 is divided by q(19)? 19 Let h be ((-24)/(-9))/43. Suppose -hm + 14 = 2j, -3j + 7 = -2. Suppose -5p = q - 26, 0 = q - mq - 2p + 78. What is the remainder when q is divided by 9? 8 Let r(h) = 6h*2 + 6h + 19. Let m(u) = -9u + 7. Calculate the remainder when r(-7) is divided by m(-3). 33 Let z(q) = -17q - 41. Suppose h = 5 - 0. Suppose hj = -3l + 101, -3j = -2l - l + 69. What is the remainder when z(-7) is divided by l? 24 Suppose 12 = 4s - 0s. Let z = -17834 - -17856. What is the remainder when z is divided by s? 1 What is the remainder when 6719 is divided by (1007/38 - 27)(-2 + -20)? 9 Suppose -f + 213 = 2f. Suppose -2b = 4m - 226, 5m + 2b = 45 + 236. Suppose f = 9l - m. What is the remainder when 41 is divided by l? 13 Let n = -4444 + 4683. Calculate the remainder when 725 is divided by n. 8 Let f(a) = a2 + 10a - 19. Let z = 1845 - 1858. Suppose -5h - u + 32 = 0, -h + 3u + 22 = -2u. What is the remainder when f(z) is divided by h? 6 What is the remainder when ((-76)/16)/(6/(-96)) is divided by 26? 24 Let n = 12 + 4. Suppose 0 = -30z + 23z + 126. Suppose 0 = za - 37a + 2356. Calculate the remainder when a is divided by n. 12 Let s = 45 + -47. Let n(q) = 13q*2 - 2q - 4. Let w be n(s). Let v = w - 33. Calculate the remainder when 54 is divided by v. 16 Let f = 1627 - 1599. Calculate the remainder when 581 is divided by f. 21 Suppose -3o - 2 = -44. Suppose 0 = 6h - 18 - 36. Calculate the remainder when o is divided by (h/(-6) - -1)/(12/(-120)). 4 Let q(j) = 78j + 1389. Calculate the remainder when 5480 is divided by q(-17). 62 Let s = 2484 + -2381. What is the remainder when 444 is divided by s? 32 Suppose 96 = -3k + 201. Let h = 233 - 164. What is the remainder when h is divided by k? 34 Suppose -2g - 3g = -k - 597, 3g - 354 = 2k. What is the remainder when g is divided by (-8 + -1)/3 + 57? 12 Let j(t) = 20 + 2t - 20. Let l(d) = -3d + 1. Let x(c) = -13j(c) - 6l(c). Calculate the remainder when x(-6) is divided by 9. 6 Let m = 113 + -110. Suppose -mk - 42 = -5t, 15t - 17t - 8 = 5k. Calculate the remainder when 34 is divided by t. 4 Suppose -518 = -3g + 19. Suppose -178s - 72s = -11500. What is the remainder when g is divided by s? 41 Let x(i) = -10i - 2. Suppose 59p + 1856 = 3137 + 3085. What is the remainder when p is divided by x(-4)? 36 Let n = 2561 + -2398. What is the remainder when n is divided by 53? 4 Let f(x) = 2x - 9. Let o(h) = 5h + 19. Let c be o(-3). Let p	{ "pile_set_name": "DM Mathematics" }
ty + 25 for y. -5 Suppose -4k + 5d + 3 = -0d, 3k - 4d = 2. Solve kw + 5 = 15 for w. 5 Let r(w) = 81w + 1056. Let b be r(-13). Solve -t - 10 = -bt for t. 5 Let s be 3/7 + (-22)/(-14). Suppose -4i + 12 = -st - 14, -5i = 4t - 13. Solve -17 + 7 = ib for b. -2 Suppose 5u + 4w = u + 20, -4w = -8. Let i be (21/15)/((-1)/(-5)). Solve 5 = -up - i for p. -4 Suppose -j = -3m - 308, 3m + 4j - 107 = -435. Let w be (m/(-65))/(1/5). Solve -w = 6s - 4s for s. -4 Let p(b) = -b3 + b2 + b + 15. Let d be p(0). Let i = 19 - d. Let k = 2 - 2. Solve 5v - iv = k for v. 0 Suppose -3w - 14 = -v, -3v - 3w = -2v + 4. Let d be 22/7 + (-5)/35. Solve -vh + 17 = -d for h. 4 Let v(j) = 2j3 + 19j*2 + 31j - 19. Let z be v(-7). Solve 7k - z = -2 for k. 1 Let m be (-3 + 7)(-4 + 5) + 4. Let c be (-8 + m)(-2)/(-4). Solve 0 = -2y - c + 4 for y. 2 Let w(f) = f*3 - 10f*2 - 11f + 8. Let z be w(11). Suppose 0 = 10y - 8y - z. Solve yq = -q - 10 for q. -2 Let n(t) be the third derivative of t5/60 + t4/12 - 19t*3/6 - 25t*2. Let k be n(-6). Solve -kv = -0v - 15 for v. 3 Suppose 5p + 12 = -4h, p = 3p - 5h - 15. Let q = -1898 + 1904. Solve -4s - 26 + q = p for s. -5 Let u be (-2)/(-10) - 9/(-5). Suppose 4m - 33 = -13. Suppose -5v - 5t + 15 = 0, mv = -4t + 17 - 2. Solve 1 = un - v for n. 2 Let g = 156 + -88. Suppose -l - g = -5l. Suppose q - 4 = -3a, 2 = 3a - 2q - l. Solve 1 = aw - 2 for w. 1 Let c(m) = -12m - 2. Let h be c(-1). Suppose -5a - 20 = -ha. Let b be 6/444/6. Solve b = au - 1 for u. 3 Let l(z) = -5z - 25. Let j be l(-7). Solve ju - 9 = 13u for u. -3 Suppose -98n - 65 = -103n. Solve -3t = -25 + n for t. 4 Let i = 8 - 17. Let s(d) = -d - 4. Let u be s(i). Suppose 0 = -b + ub. Solve bg + 5 = -g for g. -5 Suppose 15p - 11p = 5v - 62, 3v - 18 = -4p. Solve -15 = -15o + vo for o. 3 Let y be (-2)/(-9) + 125/45. Let f = 53 + -38. Let c(i) = i3 - 21i*2 + 82i - 30. Let s be c(16). Solve -so = yo + f for o. -3 Let h be 2/(3 + 1 - (22 - 19)). Suppose -2c + h + 6 = 0. Solve -9 = 7j - cj for j. -3 Suppose -4 = -5s + 6. Suppose -3x + 8 = s. Solve 3 = xu + u for u. 1 Suppose -6y + 7 = -11y + 4s, y = -2s + 7. Solve 4h + 17 - y = 0 for h. -4 Suppose -r - 29 = -2y, -y - 74 = -6y + r. Let t = y - 7. Suppose 0 - 5 = -p. Solve -t = h - ph for h. 2 Let c = -19 - -13. Let a be 8/12 + (222/(-9) - -4). Let h be c/15 + (-68)/a. Solve k - h = -0 for k. 3 Suppose -2j + 12 = 2s, 0j = s + 5j - 14. Suppose -5a - 2 = 38. Let c = s - a. Solve -o - c = -4o for o. 4 Let q = 144 + -103. Let p = q - 36. Solve f = -0f - p for f. -5 Let j = -716 + 730. Solve -10n - jn = 0 for n. 0 Suppose 0 = 9z + 23 + 4. Let k(q) = -5q - 5. Let s be k(z). Solve -4 = 2b - s for b. 3 Let x = -44 - -49. Suppose -96 + 66 = -xd. Solve -2v + dv = 0 for v. 0 Suppose 0m - 80 = -5m. Let q(r) = 4r*2 - 3r + 4. Let g be q(2). Let l = m - g. Solve 0 = -lc - c + 9 for c. 3 Let i be 1/2 + 36/(-8). Let c be (4-4)/i - 2. Let h = 0 + c. Solve hb - 2 = 3b for b. -2 Suppose 7 = -j + 3. Let c be ((-7 - j) + 4)/1 - 1. Solve 0r + r - 2 = c for r. 2 Let m = 1 + -1. Suppose -2k + 4 = -mk. Suppose 0o + k = o. Solve -q = -oq - 1 for q. -1 Suppose 13p = -38p + 1836. Solve 0 = -5b + p - 21 for b. 3 Let w = 20 + -14. Suppose -w = -2r - r. Suppose -d = -rd + 4. Solve 0 = -0g - dg - 20 for g. -5 Suppose 0 = 3z - 6z + 60. Let o be 4/(-5)(-150)/z. Let i be 1/((-1)/o-2). Solve -5r - i = 12 for r. -3 Let s(z) = 7z*3 - z + 1. Let b be s(1). Let x = 6 - b. Let m = 2 + x. Solve m + 9 = 2y for y. 5 Suppose -4k - 81 = -5j, 71 = 4j + 20k - 17k. Solve j = 11d - 5 for d. 2 Let j(g) = 4g + 14. Let n be j(7). Let i = -39 + n. Solve 0p - ip = 0 for p. 0 Let i be 2/(4/(-6)-1). Let d(p) = -p - 1. Let c be d(-5). Suppose n = -0n + cr - 11, n + 3r = 17. Solve -ig = -2g + n for g. -5 Suppose 18 = 17i - 84. Solve 3a = -15 + i for a. -3 Suppose 31t + 21t = 1612. Solve 2l + t = 35 for l. 2 Let r(l) = l*2 + 8l + 3. Let b be r(-8). Suppose 0 = 3q - b - 6. Let z be (-10)/q(-24)/5. Solve 4t - z = -0t for t. 4 Let q be 1(-15)/(-10)4. Solve -qm + 15 = -11m for m. -3 Let z(f) be the second derivative of f*3/6 - 7f*2/2 - 3f. Let p be z(10). Suppose pl = 12 - 3. Solve -5x = -l + 28 for x. -5 Let d = 125 + -116. Solve -2a = 5 - d for a. 2 Let t(i) = -i2 - 46i + 270. Let v be t(-51). Solve f = -11 + v for f. 4 Let i = -52 - -37. Let d be (5 + -1)/((-3)/15). Let c = i - d. Solve 0 = cl - 4l - 4 for l. 4 Let h be (-8)/6 + 140/(-30). Let r = 16 + h. Let c be (8/6)/(-2)-3. Solve 0k = -ck + r for k. 5 Suppose -4i = -2i - 3m - 27, 0 = 4i - m - 59. Suppose 0 = -r + 2r - 5n, 2r - i = -5n. Suppose -6t + rt = -2. Solve -6x + tx = 20 for x. -5 Let l = 1372 + -1361. Solve -l = 39y - 28y for y. -1 Let l(r) = -r + 16. Let p be l(11). Suppose -2w + 28 = 8b - 4b, -4b + 20 = 0. Solve 0 = wc - p - 7 for c. 3 Let m(d) = 10d - 77. Let i be m(8). Let c be -15(4 - 64/12). Solve -x - c = ix for x. -5 Let f be (-6)/(-4)10/15. Let y be (-1 + 1)/(f + 0). Solve y = p + p for p. 0 Let c = 5 - 0. Suppose a + 6 - 9 = 0. Suppose 0 = k - 4k + 4w - 1, 0 = -3k + 3w + a. Solve c - 30 = ks for s. -5 Suppose 7m + 986 = 1000. Solve -h + 7h = mh for h. 0 Let i = 1893 + -1891. Suppose 0k + 5k - 15 = -3q, 5k + q - 15 = 0. Solve i + k = 5z for z. 1 Let v = 11 + -6. Suppose -8a + 3a = -25a. Solve -v + a = -k for k. 5 Suppose 5y + 0z - 8 = -2z, -5z + 20 = 3y. Solve -5m - 9 - 11 = y for m. -4 Let z = -665 - -665. Solve z = -98m + 103m for m. 0 Let l be 7/((-28)/(-75)) - 8/(-32). Solve -ln = -17n for n. 0 Suppose 54 - 46 = 2n. Suppose 5z = -4v + 30, 2z - 6z = -nv + 12. Solve za = -5 - 1 for a. -3 Suppose 0 = 4o - 53 + 17. Let j be (-28)/(-3) - (30/o)/(-5). Solve 8h - 3h + j = 0 for h. -2 Suppose -2z = 5l + 14, -2l = 7z - 4z - 1. Solve 12 = -zd - d for d. -3 Let o be (-1)/1(-4 - 0). Suppose -15 = -p + 3f - 1, -3p + of + 22 = 0. Suppose -2b - 4l = -7 - 13, 0 = 5b + 2l - 50. Solve -b = -0w + pw for w. -5 Suppose 46 = 5j - 5m + 6, 25 = -5m. Suppose -r + 2k = 6k - 13, -3r = -jk + 6. Solve -1 = -h + r for h. 2 Let d = 2 + 3. Let h be 68/(-48)0. Solve h = dl - 0l for l. 0 Let u(t) = -t2 + 10t + 28. Let f be u(12). Solve -3n - 28 = fn for n. -4 Suppose 0 = 2r - 10, -2j + j - 5r + 21 = 0. Let i be 1j/41 + 3. Solve -w - iw - 12 = 0 for w. -4 Suppose -r + 2s + 5 = -4r, -4s - 3 = -r. Let a be (r9 + -1)/1. Let l = -2 - a. Solve -4i = -li for i. 0 Let f(x) be the third derivative of 0x + x2 - 5/6x*3 - 1/4x*4 - 1/60x*5 + 0. Let q be f(-3). Solve -qk + 9 = -k for k. 3 Suppose 0 = 5k + 2a - 150, -2a + 33 = k - a. Solve -32u + ku = 16 for u. -4 Let d be (5 - 2) + 1 + 2. Let o(b) = -b2 + 10b - 5. Let z(p) = 3p2 - 29p + 15. Let f(s) = dz(s) + 17o(s). Let m be f(4). Solve mv = -2 - 18 for v. -4 Suppose -18 = -4p + 2p. Let f be -3 + 1p/3. Suppose f = -5h + h. Solve -2 = -2q - h for q. 1 Let k(x) = 5x - 2. Suppose 0 = -9o + 8 + 1. Let s be k(o). Let z = -4 + 6. Solve zy - s = y for y. 3 Let b = 9 + -20. Let r = 16 + b. Let l = -41 - -61. Solve -q = -rq + l for q. 5 Let o be (-1 + 2)(-2 - -4). Let x be (-21)/(9 - 2) - (-5)/1. Solve -od + 8 = xd for d. 2 Let u be 7 + 1 + -5 + 1. Let r = 44 - 64. Let w be r/(-6)3/2. Solve -wp + p = u for p. -1 Let m be (140/24)/76. Suppose mr - 4r = 4. Suppose 0 = 3k + k + ru - 20, 0 = 5k - u - 13. Solve -g + kg = 0 for g. 0 Let w(v) = 2v2 + v - 4. Let c be w(-2). Suppose 2u - 4 = h, -2h - 5u = ch - 36. Solve -hk = 2 - 6 for k. 1 Let m = 553 + -539. Let z be (-11 + 1)5/(-10). Solve zc - 11 - m = 0 for c. 5 Let y(b) = 8b - 3. Let v(a) = a3 - 8a*2 + 8a - 9. Let c be v(7). Let l be y(c). Let d = -17 - l. Solve -o + 2o - d = 0 for o. 2 Let z(h) = h3 + 5h*2 + 5h + 7. Let p be z(-4). Solve 0 = -6j - p + 27 for j. 4 Let p(k) = 2k*3 + 15k*2 + 8k + 4. Let t(v) = -7v2. Let h be t(1). Let l be p(h). Let z(i) = i2 - i. Let w be z(l). Solve -4b = -4 - w for b. 4 Let x(r) = r*3 - 7r*2 + 6r + 3. Let k be x(6). Let c be (52 - -2) + (-6)/2. Let z = 53 - c. Solve -5	{ "pile_set_name": "DM Mathematics" }
, 379 What are the prime factors of 67821? 3, 13, 37, 47 What are the prime factors of 7352? 2, 919 List the prime factors of 2865. 3, 5, 191 What are the prime factors of 995? 5, 199 What are the prime factors of 1684? 2, 421 What are the prime factors of 1853? 17, 109 What are the prime factors of 1440? 2, 3, 5 List the prime factors of 964. 2, 241 List the prime factors of 266. 2, 7, 19 List the prime factors of 47468. 2, 11867 What are the prime factors of 20329? 29, 701 List the prime factors of 27061. 27061 List the prime factors of 2735. 5, 547 What are the prime factors of 23274? 2, 3, 431 List the prime factors of 19367. 107, 181 List the prime factors of 272. 2, 17 List the prime factors of 2169. 3, 241 List the prime factors of 1204. 2, 7, 43 What are the prime factors of 2051? 7, 293 List the prime factors of 37401. 3, 7, 13, 137 List the prime factors of 1301. 1301 List the prime factors of 4416. 2, 3, 23 List the prime factors of 1508. 2, 13, 29 List the prime factors of 1800. 2, 3, 5 What are the prime factors of 115939? 269, 431 List the prime factors of 47621. 7, 6803 What are the prime factors of 11438? 2, 7, 19, 43 List the prime factors of 43779. 3, 14593 List the prime factors of 754. 2, 13, 29 What are the prime factors of 807? 3, 269 What are the prime factors of 1406? 2, 19, 37 What are the prime factors of 2409? 3, 11, 73 List the prime factors of 16612. 2, 4153 What are the prime factors of 21641? 17, 19, 67 What are the prime factors of 18965? 5, 3793 List the prime factors of 12666. 2, 3, 2111 What are the prime factors of 19600? 2, 5, 7 What are the prime factors of 26? 2, 13 What are the prime factors of 2695? 5, 7, 11 What are the prime factors of 530? 2, 5, 53 List the prime factors of 5351. 5351 List the prime factors of 104237. 7, 14891 List the prime factors of 9609. 3, 3203 What are the prime factors of 717? 3, 239 What are the prime factors of 13049? 13049 What are the prime factors of 70077? 3, 7, 47, 71 List the prime factors of 9137. 9137 What are the prime factors of 70511? 7, 1439 What are the prime factors of 2037? 3, 7, 97 What are the prime factors of 2422? 2, 7, 173 What are the prime factors of 40307? 17, 2371 What are the prime factors of 1583? 1583 What are the prime factors of 22996? 2, 5749 List the prime factors of 166150. 2, 5, 3323 List the prime factors of 1078. 2, 7, 11 List the prime factors of 15936. 2, 3, 83 List the prime factors of 2671. 2671 What are the prime factors of 7178? 2, 37, 97 List the prime factors of 38447. 38447 List the prime factors of 827. 827 What are the prime factors of 1490? 2, 5, 149 What are the prime factors of 3998? 2, 1999 What are the prime factors of 41477? 19, 37, 59 What are the prime factors of 152680? 2, 5, 11, 347 List the prime factors of 36646. 2, 73, 251 What are the prime factors of 35525? 5, 7, 29 List the prime factors of 8549. 83, 103 List the prime factors of 15790. 2, 5, 1579 What are the prime factors of 761? 761 List the prime factors of 18655. 5, 7, 13, 41 What are the prime factors of 14863? 89, 167 List the prime factors of 1160. 2, 5, 29 What are the prime factors of 2338? 2, 7, 167 List the prime factors of 26213. 11, 2383 What are the prime factors of 116799? 3, 38933 List the prime factors of 16143. 3, 5381 What are the prime factors of 4876? 2, 23, 53 What are the prime factors of 35797? 35797 List the prime factors of 6197. 6197 List the prime factors of 6731. 53, 127 List the prime factors of 1189. 29, 41 What are the prime factors of 1898? 2, 13, 73 List the prime factors of 149412. 2, 3, 12451 What are the prime factors of 32424? 2, 3, 7, 193 What are the prime factors of 61309? 37, 1657 List the prime factors of 38444. 2, 7, 1373 List the prime factors of 72398. 2, 53, 683 List the prime factors of 1743. 3, 7, 83 List the prime factors of 972. 2, 3 List the prime factors of 17276. 2, 7, 617 List the prime factors of 6766. 2, 17, 199 List the prime factors of 497. 7, 71 What are the prime factors of 7391? 19, 389 List the prime factors of 975. 3, 5, 13 List the prime factors of 5216. 2, 163 List the prime factors of 499. 499 What are the prime factors of 3195? 3, 5, 71 What are the prime factors of 27? 3 List the prime factors of 48121. 48121 List the prime factors of 745. 5, 149 List the prime factors of 2669. 17, 157 What are the prime factors of 88? 2, 11 What are the prime factors of 49316? 2, 12329 List the prime factors of 778. 2, 389 List the prime factors of 63210. 2, 3, 5, 7, 43 What are the prime factors of 3002? 2, 19, 79 List the prime factors of 21042. 2, 3, 7, 167 What are the prime factors of 127955? 5, 157, 163 List the prime factors of 515. 5, 103 What are the prime factors of 27821? 43, 647 List the prime factors of 23196. 2, 3, 1933 What are the prime factors of 64962? 2, 3, 401 List the prime factors of 8696. 2, 1087 What are the prime factors of 1047? 3, 349 What are the prime factors of 2780? 2, 5, 139 List the prime factors of 1447. 1447 What are the prime factors of 31969? 7, 4567 What are the prime factors of 1440? 2, 3, 5 List the prime factors of 1611. 3, 179 List the prime factors of 79079. 7, 11, 13, 79 What are the prime factors of 95772? 2, 3, 23, 347 List the prime factors of 15367. 11, 127 List the prime factors of 35923. 35923 What are the prime factors of 19613? 11, 1783 What are the prime factors of 3225? 3, 5, 43 List the prime factors of 8531. 19, 449 What are the prime factors of 506? 2, 11, 23 List the prime factors of 2944. 2, 23 List the prime factors of 47. 47 What are the prime factors of 12240? 2, 3, 5, 17 What are the prime factors of 2256? 2, 3, 47 What are the prime factors of 3792? 2, 3, 79 What are the prime factors of 4325? 5, 173 List the prime factors of 127. 127 List the prime factors of 105261. 3, 13, 2699 List the prime factors of 582. 2, 3, 97 List the prime factors of 42997. 19, 31, 73 List the prime factors of 163. 163 List the prime factors of 2810. 2, 5, 281 List the prime factors of 5832. 2, 3 List the prime factors of 504. 2, 3, 7 List the prime factors of 17918. 2, 17, 31 List the prime factors of 2332. 2, 11, 53 List the prime factors of 221. 13, 17 What are the prime factors of 1965? 3, 5, 131 List the prime factors of 11661. 3, 13, 23 What are the prime factors of 2951? 13, 227 What are the prime factors of 1457? 31, 47 List the prime factors of 4473. 3, 7, 71 List the prime factors of 1275. 3, 5, 17 List the prime factors of 532. 2, 7, 19 What are the prime factors of 30202? 2, 15101 List the prime factors of 4281. 3, 1427 List the prime factors of 1118. 2, 13, 43 What are the prime factors of 15478? 2, 71, 109 What are the prime factors of 11844? 2, 3, 7, 47 What are the prime factors of 1078? 2, 7, 11 What are the prime factors of 65276? 2, 16319 List the prime factors of 2663. 2663 What are the prime factors of 15029? 7, 19, 113 What are the prime factors of 62956? 2, 15739 What are the prime factors of 42973? 7, 877 List the prime factors of 16435. 5, 19, 173 List the prime factors of 21187. 21187 List the prime factors of 6576. 2, 3, 137 What are the prime factors of 62? 2, 31 What are the prime factors of 9553? 41, 233 What are the prime factors of 1831? 1831 List the prime factors of 14689. 37, 397 List the prime factors of 12049. 12049 List the prime factors of 33426. 2, 3, 619 List the prime factors of 744. 2, 3, 31 What are the prime factors of 79955? 5, 15991 List the prime factors of 2078. 2, 1039 What are the prime factors of 2941? 17, 173 List the prime factors of 6258. 2, 3, 7, 149 What are the prime factors of 263? 263 What are the prime factors of 4389? 3, 7, 11, 19 What are the prime factors of 5? 5 What are the prime factors of 3524? 2, 881 List the prime factors of 140773. 140773 List the prime factors of 40270. 2, 5, 4027 List the prime factors of 9488. 2, 593 What are the prime factors of 9548? 2, 7, 11, 31 List the prime factors of 35088. 2, 3, 17, 43 List the prime factors of 673. 673 What are the prime factors of 1202? 2, 601 List the prime factors of 6961. 6961 What are the prime factors of 23783? 17, 1399 What are the prime factors of 32419? 17, 1907 List the prime factors of 93001. 93001 What are the prime factors of 47829? 3, 10	{ "pile_set_name": "DM Mathematics" }
eennxxeened. Give prob of sequence edx. 1/132 Four letters picked without replacement from aaaaaaaaa. Give prob of sequence aaaa. 1 Two letters picked without replacement from gjggjgjggjjjgggggg. What is prob of sequence gg? 22/51 Three letters picked without replacement from dmtndmu. Give prob of sequence tmm. 1/105 Calculate prob of sequence xe when two letters picked without replacement from eeexeexexeeeexexxee. 13/57 Calculate prob of sequence jh when two letters picked without replacement from jzhtjjjjjttj. 7/132 Calculate prob of sequence an when two letters picked without replacement from yajnnnvvn. 1/18 Three letters picked without replacement from nbjcbjjbjkkbbjbbkkjn. Give prob of sequence jkn. 2/285 Calculate prob of sequence lkl when three letters picked without replacement from {b: 1, l: 10, n: 3, f: 2, k: 1, c: 1}. 5/272 Calculate prob of sequence oq when two letters picked without replacement from {a: 1, k: 1, o: 1, v: 1, q: 1}. 1/20 Calculate prob of sequence ii when two letters picked without replacement from xjixx. 0 Calculate prob of sequence eoh when three letters picked without replacement from {h: 3, o: 3, e: 2}. 3/56 Calculate prob of sequence flq when three letters picked without replacement from {q: 1, f: 1, l: 1, z: 1, w: 2, m: 1}. 1/210 Calculate prob of sequence zwzw when four letters picked without replacement from wwwwwzzwwzwzwwwwwz. 13/306 What is prob of sequence bff when three letters picked without replacement from wwfbllfwffffl? 5/286 Three letters picked without replacement from viiiivv. Give prob of sequence vvi. 4/35 Two letters picked without replacement from {l: 7, f: 1, o: 2, x: 2, q: 1, c: 2}. What is prob of sequence cq? 1/105 Three letters picked without replacement from {j: 2, h: 1, v: 2, i: 1, w: 1, t: 2}. What is prob of sequence vhi? 1/252 Calculate prob of sequence qqff when four letters picked without replacement from {t: 1, g: 3, q: 3, f: 5, d: 3}. 1/273 Two letters picked without replacement from rffrrrfcrcf. What is prob of sequence fc? 4/55 What is prob of sequence qivv when four letters picked without replacement from qvvqqiqiiiivvv? 50/3003 Two letters picked without replacement from {u: 6, g: 6}. Give prob of sequence ug. 3/11 What is prob of sequence nwfg when four letters picked without replacement from nnfnwnnngnfwnnfwnggn? 33/12920 Two letters picked without replacement from {q: 2, x: 3, e: 1, v: 1}. Give prob of sequence qv. 1/21 What is prob of sequence vp when two letters picked without replacement from vbpbxvbbvvbbbv? 5/182 Calculate prob of sequence ei when two letters picked without replacement from {f: 3, i: 1, v: 1, u: 2, e: 3}. 1/30 Three letters picked without replacement from {m: 1, r: 1, p: 1}. What is prob of sequence mrp? 1/6 Four letters picked without replacement from {r: 1, v: 1, k: 4, n: 1, e: 3, h: 5}. Give prob of sequence evrh. 1/2184 Two letters picked without replacement from peeebpedje. What is prob of sequence ee? 2/9 What is prob of sequence ilg when three letters picked without replacement from kkgkggkgkggklgik? 1/480 Four letters picked without replacement from {c: 10, w: 2, m: 1, h: 1, b: 2, u: 2}. Give prob of sequence umhc. 1/3672 Calculate prob of sequence kvv when three letters picked without replacement from {w: 1, k: 1, v: 2, q: 1, g: 2}. 1/105 Four letters picked without replacement from ukeuupuekueeuu. What is prob of sequence pkek? 1/3003 Calculate prob of sequence dc when two letters picked without replacement from {c: 5, q: 3, p: 1, d: 4}. 5/39 Three letters picked without replacement from vvdkvvdkrrrvvdvddj. Give prob of sequence vvj. 7/816 Four letters picked without replacement from {c: 1, j: 4, u: 3, z: 12}. Give prob of sequence ucuu. 1/19380 Four letters picked without replacement from wanwawapwiagiiwwiwgw. Give prob of sequence wipw. 28/14535 Calculate prob of sequence iu when two letters picked without replacement from owuuiuwiiuuouiiuuu. 5/34 What is prob of sequence urnr when four letters picked without replacement from {n: 1, r: 2, u: 1}? 1/12 Calculate prob of sequence yy when two letters picked without replacement from yrryrhhrppgrrp. 1/91 Calculate prob of sequence iv when two letters picked without replacement from {i: 2, h: 4, v: 3}. 1/12 What is prob of sequence lx when two letters picked without replacement from dlxyxxxa? 1/14 Two letters picked without replacement from {l: 5}. Give prob of sequence ll. 1 What is prob of sequence cc when two letters picked without replacement from ckc? 1/3 Calculate prob of sequence sss when three letters picked without replacement from {f: 2, s: 1}. 0 Two letters picked without replacement from {d: 16, i: 4}. Give prob of sequence dd. 12/19 Three letters picked without replacement from pwjjljppxpppx. Give prob of sequence ppl. 5/286 Four letters picked without replacement from kdknllaldldwlwlwdl. Give prob of sequence klln. 7/6120 Four letters picked without replacement from {y: 1, p: 2, r: 2, k: 1, t: 4}. What is prob of sequence rprk? 1/1260 Four letters picked without replacement from vnnvnvvnnvnvv. Give prob of sequence vvvn. 21/286 Calculate prob of sequence an when two letters picked without replacement from annaanaannnnnnnnnan. 13/57 What is prob of sequence gk when two letters picked without replacement from eooegiekog? 1/45 Four letters picked without replacement from {j: 3, n: 4, q: 1, i: 3}. Give prob of sequence jiin. 1/110 Two letters picked without replacement from tltottiz. What is prob of sequence lt? 1/14 Two letters picked without replacement from {z: 6, h: 4, o: 3}. Give prob of sequence oh. 1/13 Two letters picked without replacement from {t: 2, q: 1, e: 10, v: 2, x: 1}. What is prob of sequence ev? 1/12 What is prob of sequence oom when three letters picked without replacement from fmofo? 1/30 Calculate prob of sequence vv when two letters picked without replacement from ggvggggvgg. 1/45 What is prob of sequence rm when two letters picked without replacement from {m: 3, r: 13}? 13/80 Two letters picked without replacement from uts. Give prob of sequence us. 1/6 Four letters picked without replacement from {h: 4, v: 8, u: 1}. What is prob of sequence vuhv? 28/2145 Four letters picked without replacement from {n: 1, r: 1, w: 2, f: 2, s: 1}. Give prob of sequence wfsf. 1/210 Three letters picked without replacement from zzzkkzzkzz. What is prob of sequence kkz? 7/120 Four letters picked without replacement from {p: 7, t: 4, x: 5}. What is prob of sequence tppt? 3/260 What is prob of sequence jx when two letters picked without replacement from jxxjxxxxxxxxxjxx? 13/80 Two letters picked without replacement from {j: 1, o: 4, n: 5}. What is prob of sequence oo? 2/15 Three letters picked without replacement from sdsdsdjsdessesjdj. What is prob of sequence jed? 1/136 Three letters picked without replacement from {a: 5, r: 3}. What is prob of sequence rar? 5/56 What is prob of sequence fjaf when four letters picked without replacement from {c: 1, j: 1, l: 3, s: 1, a: 2, f: 8}? 1/390 Three letters picked without replacement from xwxwwwwww. Give prob of sequence xww. 1/6 Calculate prob of sequence syy when three letters picked without replacement from yyssyyssyyyyyysyyyy. 455/2907 What is prob of sequence hy when two letters picked without replacement from aitahtythaahlhyay? 3/68 What is prob of sequence lzo when three letters picked without replacement from {z: 2, o: 1, u: 1, l: 1, b: 1, a: 1}? 1/105 Calculate prob of sequence ii when two letters picked without replacement from {z: 1, i: 2}. 1/3 Calculate prob of sequence ege when three letters picked without replacement from egeegekkeekeeee. 6/91 Two letters picked without replacement from qwmmwvvaqawvaavq. Give prob of sequence av. 1/15 Calculate prob of sequence lily when four letters picked without replacement from liyyyyiriyriyylylccl. 16/4845 Calculate prob of sequence gp when two letters picked without replacement from ggphghphhvhgpgphphp. 5/57 Two letters picked without replacement from {l: 2, b: 1, s: 3, t: 4}. Give prob of sequence bs. 1/30 Calculate prob of sequence kw when two letters picked without replacement from wkkwk. 3/10 Calculate prob of sequence ul when two letters picked without replacement from {m: 2, c:	{ "pile_set_name": "DM Mathematics" }
d the third derivative of 19f3km - 102386f*3k - 2f2k - 2f2m + 2fk - f - 5km + 155329 wrt f. 114km - 614316k Find the first derivative of 16748d*2 - 479d + 528397540 wrt d. 33496d - 479 What is the derivative of -9339512n*3q - 1157n3 + 3n*2 + 1238n - 1 wrt q? -9339512n3 Find the third derivative of 1399h*3i*4 - 14h*3i*2 + 6131h*2i*4 + 11h*2i*2 + 10802h - 4i2 wrt i. 33576h*3i + 147144h2i Find the second derivative of 11514120w2 - 2161489w. 23028240 What is the third derivative of 8872i6 + 27i*5 + 9i*3 - 8675080i*2 wrt i? 1064640i*3 + 1620i*2 + 54 Find the second derivative of 412as5 - 5as2 - 62a + 88s5 - 95s - 2 wrt s. 8240as*3 - 10a + 1760s3 Find the first derivative of 779gj - 281485g - 223161282j wrt g. 779j - 281485 Find the second derivative of -9237371m2x*3 + 8mx + 2m - 5x3 + 161 wrt m. -18474742x*3 What is the first derivative of -54203827cd3 - 2729d*3 + 2d*2 - 245d - 5 wrt c? -54203827d3 What is the second derivative of -20483469d*5 - 3d*4 - 401448454d? -409669380d3 - 36d*2 What is the second derivative of 124554200w*2 + 452397237w? 249108400 Find the third derivative of 1855g5 + 3058g*4 - 4g*3 - 2g*2 + 49636935 wrt g. 111300g*2 + 73392g - 24 What is the third derivative of -124532565l3 - 4l*2 + 38171l + 312 wrt l? -747195390 Find the third derivative of -5213w5 + 205w*4 + 71w*3 + 843408272w*2 wrt w. -312780w*2 + 4920w + 426 What is the second derivative of 2m4 + 967874m*3 + 18594597m wrt m? 24m2 + 5807244m What is the third derivative of 1354055u6 + 41u*2 - 88952u wrt u? 162486600u3 What is the first derivative of -518fh3 + 7fh2 + 3310f - 3h3 + 76290860h*2 wrt f? -518h*3 + 7h*2 + 3310 Differentiate -1660128560m*4 + 32147103 with respect to m. -6640514240m*3 What is the second derivative of -82a*2u2 - a2uy*2 + 3a*2uy - 315a*2u - 2a2y - 11331758au*2y*2 - au*2y - au wrt y? -2a*2u - 22663516au*2 Find the second derivative of -1727815c*2z*2 - 20c*2z - 2cz*3 + 192cz + 14c + 4z3 - 1 wrt z. -3455630c*2 - 12cz + 24z Find the second derivative of 43388v3 + 89v*2 + 7504570v wrt v. 260328v + 178 Find the second derivative of 28071511w*3 + 19485w + 2536. 168429066w Find the second derivative of -26u*5 + 21555u*4 + 3967589u wrt u. -520u3 + 258660u*2 Find the first derivative of -10i*2 - 46365i - 6011795 wrt i. -20i - 46365 What is the second derivative of 1072751g*3 - 2g*2 - 29184g + 49? 6436506g - 4 What is the second derivative of -15707jr4 + jr*3t + 2463jrt - 2jr + 45jt + 5j - r*2t wrt r? -188484jr*2 + 6jrt - 2t Find the second derivative of 480d*3 + 1026d*2 + 19986848d wrt d. 2880d + 2052 Find the second derivative of 129924565g*4 + 4174074g + 2. 1559094780g2 What is the first derivative of 5805176l - 3789555? 5805176 What is the second derivative of -18q5 + 50861q*4 + 23q*2 - 217363225q wrt q? -360q3 + 610332q*2 + 46 What is the second derivative of 44279395p*3s*2 + 3563p*3s - 37p3 + 11p*2 - 5ps4 + 3p - 3 wrt s? 88558790p3 - 60ps2 Find the third derivative of 13746379o*4 - 23937380o*2. 329913096o Find the second derivative of 21449907h2 - 556149h - 4. 42899814 Find the first derivative of 100r4 + 36r*3 + 12370r + 1272175917. 400r3 + 108r*2 + 12370 Find the third derivative of 4040893m*3s - m*2s - 2m2 + 522ms - 2s - 1 wrt m. 24245358s Differentiate 582m*3o + 444288m3 - 57m*2o + 64mo + 2o - 10 wrt o. 582m*3 - 57m*2 + 64m + 2 Find the second derivative of 331177143x5 - 82x - 4032002. 6623542860x3 What is the derivative of -68l3 - l2 - 75393l - 1173987856 wrt l? -204l*2 - 2l - 75393 Find the second derivative of -19449026h2 - 39634h + 62. -38898052 Find the third derivative of -1789s4 + 914s*3 - 421936s*2. -42936s + 5484 Find the second derivative of -98776w4 + w3 + 3w*2 + 15631335w. -1185312w2 + 6w + 6 Find the second derivative of 38190f5 + 6f*4 + 2f*3 + 10830124f. 763800f3 + 72f*2 + 12f What is the second derivative of -2578m3 - 20406m*2 + 299991907m? -15468m - 40812 Differentiate -102292p*2 + 225p - 5085091. -204584p + 225 Find the first derivative of 124m*3 + 2m*2 - 3635m - 11674597. 372m2 + 4m - 3635 What is the derivative of -36133086d - 64388069 wrt d? -36133086 What is the second derivative of -7381187f*2 + 120608995f? -14762374 Find the third derivative of 501971072i6x*3 - 46i*2x*2 - 32i*2x + 5ix*3 - 10ix2 - 11i wrt i. 60236528640i3x*3 Differentiate -6044234b*3 - 4052233 with respect to b. -18132702b*2 What is the second derivative of -9632263v*4 + 3578569v wrt v? -115587156v2 Find the third derivative of 82286842p*3 - 13282462p*2 wrt p. 493721052 Find the first derivative of -41008457v - 204114686 wrt v. -41008457 Find the second derivative of 58a5 + 32531a*2c - 61ac - 24a + 33c + 2 wrt a. 1160a3 + 65062c Find the second derivative of 2r2u*2 + 141167r*2u - 48r2 + 3ru2 + 9ru + 13r + 38u2 - 7 wrt r. 4u*2 + 282334u - 96 Differentiate 38hi*3n - 2hi*3 + hi*2 + 156hi + 261hn2 - 43h + 649i3n - i*3 + 30 with respect to n. 38hi3 + 522hn + 649i*3 What is the derivative of 19734480k - 5772407? 19734480 Find the second derivative of -32654927u4 - 2u*2 - 69470219u. -391859124u2 - 4 Find the third derivative of -921093153g*3 - 13g*2 - 4240917g - 1 wrt g. -5526558918 Find the third derivative of 166v5 - 946710v*3 + 2v*2 + 23554v - 813. 9960v2 - 5680260 Find the second derivative of 328t*4 - 66t*3 + 13t*2 - 99t + 11405. 3936t2 - 396t + 26 Find the third derivative of -11fm*4 - 5689820fm3 - 316fm + 2m*2 - 42540m wrt m. -264fm - 34138920f What is the derivative of -7733479pu3 - 334206u*3 - u wrt p? -7733479u*3 Find the third derivative of 13629139y*3 + 2y*2 + 25148212y wrt y. 81774834 What is the third derivative of -6105310u3 - 190896u*2 - 12u wrt u? -36631860 What is the second derivative of -168747ijl2r - 307ijl2 + 62969ijl - ij + 2il2 - il - 2jlr - 699j wrt l? -337494ijr - 614ij + 4i Differentiate -3953610m3 + 42m*2 - 811933546 with respect to m. -11860830m*2 + 84m What is the second derivative of j*3 + 197557655j*2 + 4666680j - 1 wrt j? 6j + 395115310 Differentiate 192506p*4 + 89p3 - p2 - 859419170 with respect to p. 770024p3 + 267p*2 - 2p What is the third derivative of -4l6 - 29182l*4 - 7l*3 + 249601l*2 + l - 94? -480l*3 - 700368l - 42 What is the second derivative of -2502236f4 - 14f*2 - 224027397f wrt f? -30026832f2 - 28 Find the first derivative of -7b*4g + 564824b2g*3 + 350644g*3 wrt b. -28b*3g + 1129648bg*3 What is the second derivative of 47265oz3 + 2oz2 + 1821oz - 62548o - 19z3 + 6z*2 wrt z? 283590oz + 4o - 114z + 12 Find the second derivative of -4889644g*5 - 3188245g wrt g. -97792880g3 What is the derivative of 1915129x*3 + 4x*2 + x - 634674564 wrt x? 5745387x*2 + 8x + 1 What is the first derivative of 142817r + 20921269 wrt r? 142817 Differentiate -28994622q*2 - 50204610. -57989244q Find the first derivative of 204798hty2 - 29hty + 10ty*2 - 13ty - t - 6y*2 + 66y - 4 wrt h. 204798ty*2 - 29ty What is the second derivative of 2s*4 - 189s*3 - 21823s*2 - 8703429s - 1 wrt s? 24s2 - 1134s - 43646 Find the third derivative of 124332820b4 - 269876297b*2. 2983987680b What is the first derivative of -2364a4 + 18599a*3 - 246898235 wrt a? -9456a*3 + 55797a*2 Differentiate -27079998q*4 - 17150965 with respect to q. -108319992q3 Find the second derivative of -h3n + 7681756h*2n - 756844hn + 21h wrt h. -6hn + 15363512n Find the second derivative of -770g5 - 2071g*3 + 3g*2 - 20594g - 1264 wrt g. -15400g3 - 12426g + 6 Find the second derivative of 3544931b2 - 20993057b wrt b.	{ "pile_set_name": "DM Mathematics" }
(-36)/(-54) + 16/3. Let r be 5/((-15)/(-2))a. Suppose i - 15 = -ri. Solve -b - ib = 20 for b. -5 Suppose 5d - 5i - 20 = 0, 4d - i = 8 + 8. Suppose -m - 4m - 17 = 4l, 0 = 4m + 2l + 10. Let p be ((-1)/(-1) + m)-1. Solve -dq + p - 16 = 0 for q. -4 Suppose 4 = n + 1. Let k be n/1 + 2 + 3 + -3. Solve -4 = -kz - 19 for z. -3 Suppose -i = 4i - 30. Let g be i(-5)/(-9)24/20. Solve 0 = -gk - k for k. 0 Let v(m) = -m3 + 3m*2 - 2m + 10. Let l be v(3). Solve 1 + 3 = -ls for s. -1 Suppose -28 = -4j - 4d, 0j + 4d - 7 = 3j. Suppose 0 = -jz + 7z. Let s be 1 + (75/30 - (-6)/(-4)). Solve z = h + sh for h. 0 Suppose 2g - 13 + 17 = 0. Let l be 86/6 - g/(-6). Solve 5w = l + 11 for w. 5 Let v = 8 + -6. Let s = 20 - 18. Suppose 0 = 5n - sn + 5y - 15, 3y - 9 = -2n. Solve -m = -nm + v for m. -2 Let a = 13 - 1. Let b(r) = -r2 + 13r + 13. Let i be b(a). Let f(d) = -d*3 - 3d*2 - d - 1. Let y be f(-3). Solve -yt = 3t - i for t. 5 Let a = 1568 + -1552. Solve -11i + a = -17 for i. 3 Suppose 0 = 3r - 2i - 56, 2r - 26 = -2i + 8. Solve r + 2 = -4o for o. -5 Suppose 59 + 1 = 12i. Solve -id = 98 - 123 for d. 5 Let x = 161 + -159. Solve -18 = -xr - 10 for r. 4 Let n be 1/(3/6) - -1. Suppose u + 4d = 25, -3d = 5u + 12 - 52. Solve 0 = uj - n - 2 for j. 1 Let r(t) = -10t - 240. Let d be r(-26). Solve dy - 18 = 14y for y. 3 Let r(w) be the second derivative of w3/6 + 3w*2/2 - 3w. Let m be r(5). Solve -m = -o - 3o for o. 2 Let p be (-18)/3(-3)/6. Suppose 2t + p = 13. Let d be ((-19)/(-3) + 2)3. Solve -t + d = -4k for k. -5 Suppose -4d + 8 + 6 = 3a, -4a = -d + 13. Suppose 0 = -2v + z - dz, 5v - 14 = -3z. Solve -5 + 21 = -vb for b. -4 Let l(w) = -w3 + 4w*2 + 7w - 4. Let m be l(5). Let i = -363 + 365. Solve mg + 12 = ig for g. -3 Suppose 0 = -2o - 0o + 14. Let z = o + -3. Suppose 4y = -2g + 12, -g - 4g + 21 = y. Solve -z - y = -5w for w. 1 Let l(r) = r*2 - 59r + 278. Let z be l(5). Solve 9v + z = v for v. -1 Let j = 3 - -1. Suppose x = -jx + 25. Solve xi - 2i = 12 for i. 4 Let v be 4/(-6) + (-55)/(-15). Suppose y = 2d - 8, 0y = vd + 3y + 6. Solve -u = 2 + d for u. -4 Let t = 44 + -145. Let r = t - -101. Solve r = -s + 5 for s. 5 Let h(d) = -d*3 + 22d*2 + 23d + 2. Suppose -5f + 130 = 5u, 3u + 37 = 2f - 0u. Let s be h(f). Solve s + 6 = -4a for a. -2 Suppose 0 = -2t - 0t + j + 2, -5j = 10. Let v(m) = -m3 - 26m*2 - 23m + 55. Let u be v(-25). Solve t = 7p - 2p + u for p. -1 Let t be (75/20)/((-3)/8). Let k = t - -14. Solve -kq + 7 + 9 = 0 for q. 4 Let l = 7 + -3. Solve lh + 5 = 13 for h. 2 Suppose -108 = 5h + 3c + 64, -5h = c + 164. Let u = h - -37. Solve 0t = ut - 25 for t. 5 Let s(m) = 2m + 2. Let j(r) = 7 + 1 - r - 1. Let l be j(7). Let c be s(l). Solve -4g - c - 10 = 0 for g. -3 Let z = -13 + 34. Let i be z/1410/3. Solve ig - 2g = 12 for g. 4 Let v = -1 - -1. Let d = 85 + -76. Suppose q = -f + 5, -2f - 3q + d = -f. Solve -fb + b = v for b. 0 Let r be (11 - (-384)/(-36))57. Solve 0 = -13w + rw - 30 for w. 5 Let k(z) = -z*3 + 2z*2 + 3z - 3. Let g be k(2). Suppose 0 = -6h + 4h. Let n be h/(-2 - 0/g). Solve b + b = n for b. 0 Suppose -4v - v + 5f + 60 = 0, -2v = -3f - 22. Let j be -3 + 6 - 7/(v/(-4)). Solve -jh + 10 = -0 for h. 2 Let b(n) = 20n*2 - 37n - 38. Let o be b(-1). Solve 12q + 41 + o = 0 for q. -5 Let o = -28 - 17. Let k be 8/10 + (-9)/o. Solve k = -4y + 5 for y. 1 Let t(d) = -5d2 + 32d - 4. Let r be t(6). Suppose -6n + rn = 10. Solve -4u - 1 + n = 0 for u. 1 Let w(o) = 3o*3 - 33o*2 + 3. Let j be w(11). Solve jx = -23 + 17 for x. -2 Suppose 49z - 1320 = 5z. Solve 0 = -10s + 16s - z for s. 5 Let m = -224 - -234. Solve 12x + 4 = mx for x. -2 Let d be 2/12 - (-138)/36. Suppose -2k - k + dt = -80, -90 = -4k + 2t. Solve -k = -5s - 5 for s. 3 Let g = 10 + -7. Let b(o) = -o + 7. Let u be b(g). Suppose r - ur = 0. Solve r = -2k - 0k for k. 0 Let r(o) = o*3 - 4o*2 - 6o - 2. Let w be r(-3). Let f = w + 49. Solve 3a = -fa + 20 for a. 4 Let u be 8/12 + (-14)/(-6). Suppose ur + r = 5s - 94, -5s + 3r + 93 = 0. Let w be 399/27 + 4/s. Solve w = 4t + 3 for t. 3 Let w(v) = -5v - 9. Let p(a) = -9a - 18. Let c(h) = 3p(h) - 5w(h). Let n be c(-5). Solve -u + 5 = n for u. 4 Suppose -370q = -374q + 48. Solve -17f + q = -11f for f. 2 Let t be (-3)/(-2 + -1 + 2). Suppose -m + t = 7. Let x be (0 + 0)m/(-8). Solve x = r - 4r + 15 for r. 5 Let n be 12 + (3 - (8 + -7)). Solve 15x + n = 14x for x. -4 Let o be 42/(-6) + 10 + 0. Suppose -l + 5s = 1 + 4, 0 = -3l + s - 1. Solve l = -a + oa for a. 0 Let q(n) = -6n*2 - 31n + 34. Let r be q(-6). Suppose 3m - 4 = -1. Solve 5x + r = -m for x. -1 Suppose -5v - y - 15 = 4y, -3v + 2y + 11 = 0. Let l be (-1)/v - (-6 - -1). Let k(r) = r*3 + 9r*2 + 6r - 16. Let n be k(-8). Solve 4 = -np - lp for p. -1 Let x(q) = -22 - 17q - q2 + 6q + 2. Let t be x(-8). Let r be ((27 + -3)/4)/1. Solve r = -6j + tj for j. -3 Let c(n) = n + 5. Let r be c(0). Solve 0 = -rd - 0d - 20 for d. -4 Suppose -2d = 5k - 0k - 58, 0 = 4k + 2d - 48. Let a be -12((-35)/k - -3). Solve 4n = -6 - a for n. -3 Let h = -179 - -182. Solve 0 = -7w - hw - 10 for w. -1 Let n(t) be the third derivative of t4/24 - t3 - 3t2. Let g be n(9). Let v(p) = -p2 + 1. Let x be v(1). Solve 0 = -gs - 9 - x for s. -3 Suppose p + 5 = -2c - 5, -3p - 2c - 10 = 0. Let m be (-3 - (-2 - p)) + 4. Suppose -31 = -3o - 5j + 12, 0 = -o - mj + 21. Solve os = 4s for s. 0 Suppose 0b + 2 = b + 5n, 0 = -3n. Suppose 5t - 5s = -10, -bt + 5t + 4s - 22 = 0. Solve -tk = 4 - 2 for k. -1 Suppose 0 = 4j - 3y, -7 = j + 2j - 4y. Suppose -5b = 3h - 9, -8b + jb - 2h + 6 = 0. Solve b = -k - k for k. 0 Let t = -27 + 29. Suppose 180 + 2 = 14k. Solve ty - k + 5 = 0 for y. 4 Let k(h) = -14h*2 + 3h - 1. Let t be k(1). Let n = t - -12. Suppose w - 4w = n. Solve -2 + w = 2r for r. -1 Let x be (-7)/(84/9) - (-135)/20. Solve 0 - x = 6y for y. -1 Suppose 4u = -2f + 2 - 0, f = 3u + 1. Suppose u = -3p + 3l - l + 11, 1 = p + 2l. Suppose -4x = 12, pw + 6 = -x - 4x. Solve -wd = -d for d. 0 Suppose m - 15 = -0m. Suppose 4h - m = -h. Solve -11 = -hj - 2 for j. 3 Let h be -1 + (0 - -5) + -5. Let l(n) = 3n2 + 1 + 2n*2 - 3n*2. Let w be l(h). Solve z = 6 - w for z. 3 Suppose -66h + 65h - 3 = 0, -2o - h = -39. Solve oy = 25y - 8 for y. 2 Suppose 0 = -8h - 8h + 48. Suppose -3x = 5w + 10, -x - 4w + 0 + 6 = 0. Let m be (0 - 2)(x + 2). Solve hg - 7g + m = 0 for g. 4 Let m be (72/54)/((-1)/(-3)). Suppose -5n - 13 - 4 = mq, -q - 2n = 5. Let s = 9 - q. Solve -s = -0x - 4x for x. 3 Suppose -6h + 5x - 2 = -3h, -3h = -2x - 10. Suppose hi - 9i = -3. Solve 2 - i = -z for z. -1 Let a = -3 + 7. Suppose ad - 210 = -0d + y, 3d = -2y + 152. Suppose 2q - 34 = 4j, -j + 5j + d = 4q. Solve 2v - q = -v for v. 3 Let u be (-3)/(-6)(-2 - -2). Let d = 5 + u. Solve -d = 4t - 5t for t. 5 Suppose -3u + 2r + 28 = 0, -u - 3r - 13 + 4 = 0. Solve -b + ub - 10 = 0 for b. 2 Let z be (-6 - -2) + (-18)/(-1 + -2). Suppose -4v - 3 = -3v + zf, -4v = 4f - 8. Solve 0 = -2h + v + 3 for h. 5 Suppose r - 20 = 5r + 4w, -13 = 2r + 3w. Let b = 22 + r. Solve b = -u - 3u for u. -5 Suppose -2x + 3l = 5l - 4, 0 = 3x + 5l - 2. Solve -4a + x = -4 for a. 2 Let v = 24 - 27. Let f be 3 - (v - -4) - -4. Solve 5y - f = -1 for y. 1 Let k(q) = q + 8. Let j be k(-6). Suppose 2y + 6 = -2g, 0y + 14 = jg - 2y. Let r = 7 - 2. Solve -gx + r = -1 for x. 3 Let n(x) = -2x3 + 5x2 + x - 1. Let o(f) = -f3 + 3f2 + f. Let l(t) = 3n(t) - 5o(t). Let k be l(-2). Solve -2j + 5j + k = 0 for j. -3 Let a = 384 + -374. Solve -5z = -az + 15 for z. 3 Suppose -4a + 3u = -26, -u = -a - 3u + 1. Suppose -12 = -4w - 3z, z + 1 - a = -5w. Let y = -1 - -5. Solve wm + 16 = ym for m. 4 Suppose 88 - 8 = 5q. Solve q = -2m + 24 for m. 4 Suppose -41k + 288 = 7k. Solve 7r = kr - 1 for r. -1 Suppose 0 = 3r - 12, 5r + 0 = -s + 32. Let f be (-4)/s(-2 + -13). Solve 3 = -fq - 2 for q. -1 Let n = 791 - 773. Solve -n = 2z - 11z for z. 2 Let z be 5/1004 + 152/(-10). Let g(k) = k**2 + 1	{ "pile_set_name": "DM Mathematics" }
98 less than or equal to 1? True Is 144.1 != 308/129? True Which is bigger: 6 or 34361/4941? 34361/4941 Is -1 less than or equal to 27/4103828? True Are 4526 and 7967 equal? False Is -519/4000 at least 8? False Which is smaller: -3842037 or -3842077? -3842077 Is -18926 at most 1046? True Which is bigger: 2337798 or 2337802? 2337802 Are 15643 and -0.0161 non-equal? True Which is smaller: 4543028 or 22715138/5? 22715138/5 Which is greater: 50250/173 or 289? 50250/173 Is 0 at least -2/183384575? True Which is smaller: 36.67 or -0.0174? -0.0174 Are -491 and 881726 unequal? True Which is greater: 326658 or 326652? 326658 Which is greater: 1277 or -23248? 1277 Are -1/17690891 and 0 unequal? True Is -3/4468136 less than -1? False Are -9207088/87 and -1/3 non-equal? True Which is smaller: -10238783 or -6? -10238783 Are -1 and -6092/351 nonequal? True Which is greater: 2/8992811 or -1? 2/8992811 Which is bigger: 4 or -1470997/18? 4 Does 336841 = 336821? False Which is smaller: -35896 or -35860? -35896 Is 9 equal to 3341268? False Which is greater: 222 or 24084/109? 222 Is 832612 at least as big as 832606? True Which is smaller: 8131 or 600? 600 Is -118500 bigger than -4.65? False Is -6/1404375935 bigger than -1? True Which is smaller: -102629 or -102772? -102772 Is -0.73 equal to 0.621179? False Which is smaller: -5786985 or -6? -5786985 Which is bigger: 5795/987 or 44? 44 Which is bigger: -110566111 or -110566110? -110566110 Which is greater: 19550575/47 or 415970? 415970 Is -995 > -9.1925? False Is -3 less than or equal to -3119470? False Which is smaller: 545578/3 or 181860? 545578/3 Which is smaller: -0.2 or 1100564? -0.2 Is -1/1550535580 equal to 0? False Is -59.408 equal to -129/40? False Which is greater: -128083110 or -128083113? -128083110 Are 0 and 99/5843836 nonequal? True Which is bigger: -6647938/7 or -949706? -6647938/7 Which is bigger: -20.68428 or -5/2? -5/2 Which is smaller: -1 or -27/2537210? -1 Are 16283/95740 and 0 unequal? True Is 129444811 not equal to 129444799? True Which is greater: 12733 or -19647? 12733 Are 0.1 and 4325224 equal? False Which is bigger: -201632 or 1.1? 1.1 Is -1 != -15/155057? True Is -66/295 equal to -9/35? False Which is smaller: 1 or -132426248? -132426248 Is 2/5 smaller than 43264.9? True Which is bigger: -26 or -277930? -26 Is 1677952 at most 1677952? True Which is greater: -2/609401 or -2/31? -2/609401 Is -9127950 less than 2? True Which is smaller: 125 or 2/66627? 2/66627 Which is greater: 4/9451 or -4628? 4/9451 Which is bigger: 1957/285199 or 1? 1 Is 162795744 < 162795744? False Which is bigger: 0.673 or 36.2? 36.2 Is -1 >= 6/1016450759? False Is 1313/78812 < -1? False Which is smaller: 11143.97 or 345? 345 Is -213457 smaller than -6190220/29? True Is 5105561.4 <= -2? False Is -4007029/45 > -89044? False Which is smaller: -423151 or -5500968/13? -5500968/13 Are -24582757 and -24582749 non-equal? True Which is greater: 8/9925719 or -19? 8/9925719 Which is smaller: -3561/5 or 4/15? -3561/5 Is -1051108 greater than or equal to -1051067? False Which is smaller: 1984 or -30987? -30987 Is 1/1267148229 > 1? False Is -7554147/122 greater than or equal to -61918? False Which is smaller: -1238682 or -1238687? -1238687 Which is bigger: -2008 or 842? 842 Is -2 at least as big as -28292/50345? False Do -15461 and -15078 have the same value? False Is -5 > 14321/670? False Is 248243324 greater than or equal to 248243324? True Is -70122/1945 not equal to -35? True Which is smaller: -70916673 or 0? -70916673 Which is smaller: 78365 or -257? -257 Is -1 at least -3/21339014? False Is 15889699 bigger than 15889699? False Which is bigger: 15423 or -15? 15423 Which is smaller: 1/99528 or -0.65? -0.65 Which is greater: 0.0548577 or -492? 0.0548577 Is 49165270/51 bigger than 964026? False Is -1673782/375 greater than -4463? False Which is bigger: -11/53770391 or 1? 1 Do -23/917 and -1133 have the same value? False Which is smaller: 0 or -1/750287045? -1/750287045 Which is smaller: 0 or 153582184? 0 Which is smaller: -1 or -5/42682? -1 Which is smaller: -2272 or 5432? -2272 Which is smaller: 2.69 or -2/1511967? -2/1511967 Which is bigger: 20817979 or 20817980? 20817980 Are 11224845 and 11224843 equal? False Is 37318/6525 smaller than 7? True Which is smaller: 78738 or 79001? 78738 Are -6/1217489 and 1 non-equal? True Is 0.03 != -3487.18? True Is -1 at most -167/1288773? True Is -11066 > -6462? False Which is smaller: -2/11 or -362849? -362849 Which is bigger: 119/65116 or 0? 119/65116 Which is smaller: -7866488/15 or -524433? -524433 Is 316251 at least as big as 316231? True Which is bigger: 1 or -3/218104979? 1 Which is smaller: 39790587/25 or 1591624? 39790587/25 Which is smaller: 44910 or 1478.8? 1478.8 Is 3/432567521 not equal to -1? True Which is greater: 10183 or -630? 10183 Which is smaller: 2522 or 539599/214? 539599/214 Are 4612076 and 27672449/6 unequal? True Which is bigger: 54816336 or 54816334? 54816336 Which is smaller: 188/440475 or -1? -1 Which is smaller: 19802059/18 or 1100114? 1100114 Which is smaller: -1 or 1345/15266? -1 Which is smaller: -2515854 or -2515886? -2515886 Is 2.21 != -54.6921? True Are 6221 and -9359 nonequal? True Which is smaller: 1297558 or -2.8? -2.8 Which is smaller: -1266 or -25537? -25537 Is 66602 greater than or equal to 66668? False Which is bigger: 285 or -42899/11? 285 Do -112781550 and -3 have the same value? False Which is smaller: 14977961/5 or 2995591? 2995591 Are -1528267/5 and -13 equal? False Is 342899 at least 7543797/22? False Which is greater: -8481 or -5825? -5825 Is 1 less than or equal to 403/36321? False Is 722577 at most -3/95? False Which is greater: -1 or 32/415365? 32/415365 Which is bigger: -465 or -544/39? -544/39 Which is greater: -2/3 or -0.711422? -2/3 Which is smaller: -91208933 or 0.1? -91208933 Which is smaller: -1 or -1/326903440? -1 Which is bigger: -1093/257145 or -1? -1093/257145 Is -137730 equal to -60? False Which is smaller: -9 or -16113/2051? -9 Which is smaller: -2464440 or -2464082? -2464440 Is 10041459 less than 10041456? False Which is smaller: -9967158 or -9967161? -9967161 Does 12447932 = 12447927? False Is 932748/299 greater than 3121? False Which is smaller: -3 or 38694466? -3 Are -1/3101493 and -1/4 unequal? True Is 2088 greater than 461424/221? True Are 42709429 and 42709429 unequal? False Which is bigger: 1296895 or 1296853? 1296895 Are -1 and -3/84584224 equal? False Is -8338 bigger than -9469? True Is 80734 at least 81998? False Which is smaller: 10095301/3 or 3365100? 3365100 Is -1535476 >= -1535539? True Which is bigger: -1/123471462 or 0? 0 Which is smaller: 1796433 or 64671629/36? 1796433 Do 0.1722 and -281349 have the same value? False Is 17189 at least 15798? True Is 2312/2209 less than or equal to 0? False Which is smaller: -2279489/64 or -35618? -35618 Is 504436 less than 504436? False Does 142534 = -6055? False Which is bigger: -2/5 or -6/50357? -6/50357 Which is bigger: -1 or 6366/116453? 6366/116453 Is 0 greater than 5455/865019? False Which is smaller: -2492/142797 or 1? -2492/142797 Is -22752675 at least -22752674? False Which is bigger: 18722 or 5672656/303? 18722 Is -2 at least -10423915? True Which is greater: 0 or -1601/6714? 0 Which is greater: -7303 or 17.35? 17.35 Which is smaller: 2/17 or -941871? -941871 Which is bigger: -154874 or -154845? -154845 Which is smaller: -2807330484 or -1? -2807330484 Is 23 <= 1168/49? True Is -1/4 not equal to -35589642? True Is -118752032 at most -118752030? True Is -158 greater than or equal to -136089/857? True Are -455270 and -455265 unequal? True Which is smaller: 32811798 or 32811799? 32811798 Which is smaller: -1 or -1/14181939? -1 Are 2203/7909 and 1 equal? False Is 137 > 1531701? False Which is greater: 27 or 7100514? 7100514 Which is smaller: -2262612 or -2262627? -2262627 Which is bigger: -1698927 or -1698934? -1698927 Which is greater: -1373 or -2018? -1373 Are 0.287483 and -1/4 unequal? True Which is greater: 6005235/98 or 61278? 61278 Which is smaller: -421/1700208 or 1? -421/1700208 Is 234414 > 234436? False Which is smaller: -159641 or -159534? -159641 Are 17616223 and 17616224 unequal? True Which is bigger: -2866331 or -22930641/8? -22930641/8 Do -3049667 and 0.7	{ "pile_set_name": "DM Mathematics" }
556 1 Divide 2293728 by 1146864. 2 What is 1 divided by -50688? -1/50688 What is -47611 divided by 5? -47611/5 12557 divided by -29 -433 Divide -2115 by -12. 705/4 56 divided by -2049 -56/2049 Calculate -598 divided by -25. 598/25 Calculate -499452 divided by -3. 166484 Calculate 9 divided by -277994. -9/277994 Calculate 1 divided by 392. 1/392 What is 4015 divided by -306? -4015/306 Calculate -944592 divided by -236148. 4 What is -1541 divided by -58? 1541/58 What is 180336 divided by -204? -884 What is 45 divided by -17194? -45/17194 Divide -1 by -6077. 1/6077 -829252 divided by 207313 -4 38482 divided by 1 38482 Calculate -887 divided by -45. 887/45 -3 divided by 152902 -3/152902 Calculate 1 divided by -70329. -1/70329 What is -698592 divided by 36768? -19 What is 7 divided by 9508? 7/9508 240318 divided by 234 1027 Calculate -924528 divided by -374. 2472 Divide -15234 by 2. -7617 -38 divided by 327 -38/327 Divide 9016 by 322. 28 Calculate 2 divided by 653972. 1/326986 Divide 4 by 264165. 4/264165 Calculate -79192 divided by -4168. 19 -43 divided by -16056 43/16056 147189 divided by -147189 -1 311 divided by 732 311/732 Divide 95000 by 19. 5000 What is 1375664 divided by 171958? 8 Calculate 17371 divided by -4. -17371/4 Calculate 94228 divided by 4. 23557 909969 divided by 3 303323 -85680 divided by -1260 68 Calculate -2704 divided by -676. 4 Calculate -5134489 divided by 1. -5134489 Calculate 11197 divided by -4. -11197/4 What is -95832 divided by -8? 11979 What is -558096 divided by 3? -186032 Calculate 1587180 divided by 226740. 7 What is -25 divided by 5997? -25/5997 What is 45 divided by -14590? -9/2918 -1627128 divided by 648 -2511 Calculate -17261 divided by 1. -17261 2029 divided by -74 -2029/74 Calculate 646327 divided by -11. -58757 -536900 divided by 134225 -4 What is -2 divided by 59598? -1/29799 390 divided by -317 -390/317 What is -76 divided by -2804? 19/701 Calculate 1442 divided by 1512. 103/108 Divide 10206 by -378. -27 4 divided by -1385432 -1/346358 Divide -1 by 1256334. -1/1256334 Divide -74016 by -6. 12336 27318 divided by 471 58 What is -1768 divided by 17? -104 231384 divided by -311 -744 3 divided by -5464 -3/5464 55114 divided by -1 -55114 Calculate 539910 divided by 2. 269955 -10 divided by 782 -5/391 5192 divided by -70 -2596/35 Divide -10348 by -10348. 1 What is -1446 divided by -117? 482/39 -4838148 divided by -18396 263 Divide 93958 by -431. -218 Calculate 142467 divided by 3653. 39 750078 divided by 1 750078 What is -933705 divided by 311235? -3 Calculate 25674 divided by -11. -2334 37468 divided by -986 -38 Calculate -1346002 divided by 673001. -2 What is -167594 divided by 83797? -2 5 divided by 4222 5/4222 What is 4 divided by -88834? -2/44417 -324 divided by -159 108/53 Calculate -60623 divided by 4. -60623/4 Calculate 6197 divided by -4. -6197/4 Calculate 292131 divided by -63. -4637 Divide 212352 by 3792. 56 -127808 divided by 31952 -4 What is -18309 divided by -1077? 17 Calculate -144 divided by 45. -16/5 Calculate -3320 divided by -116. 830/29 Divide 147906 by -81. -1826 What is 519840 divided by 48? 10830 Divide -6933 by -6933. 1 -2245 divided by -196 2245/196 Calculate -269424 divided by -3. 89808 What is 335426 divided by 7? 47918 Calculate 3668 divided by 6. 1834/3 What is 36198 divided by -6? -6033 Divide -10054140 by -1020. 9857 What is 13 divided by -5915? -1/455 What is -398910 divided by 5? -79782 Divide -87176 by 17. -5128 Divide -1293 by -145. 1293/145 -87 divided by 673 -87/673 5386245 divided by -6 -1795415/2 1478424 divided by 369606 4 What is -229106 divided by 114553? -2 Calculate -5 divided by 57296. -5/57296 What is -251 divided by -638? 251/638 Divide 15859 by 28. 15859/28 What is -75047 divided by 4? -75047/4 -105270 divided by -1210 87 34788 divided by -26 -1338 Divide 213500 by 28. 7625 What is 178398 divided by -2? -89199 Divide -805 by -1. 805 What is 161 divided by -1162? -23/166 Divide 190894 by 95447. 2 Divide 29575 by -17. -29575/17 What is 935168 divided by -832? -1124 Divide 91596 by 22899. 4 Divide 297770 by -110. -2707 -9 divided by 104355 -1/11595 61125 divided by 2445 25 What is 260 divided by -4? -65 1 divided by 91018 1/91018 Calculate -12 divided by -345594. 2/57599 What is 0 divided by -48232? 0 Calculate -27824 divided by 4. -6956 Divide -83 by -158. 83/158 Divide -2011378 by 105862. -19 What is -686880 divided by -16? 42930 What is -3 divided by 51598? -3/51598 Calculate -32202 divided by -2. 16101 What is 215470 divided by -290? -743 Divide -10 by 901. -10/901 -250034 divided by 3 -250034/3 Calculate -4 divided by -16083. 4/16083 What is -25 divided by -45335? 5/9067 Calculate -40290 divided by -6715. 6 Calculate 15748 divided by -31. -508 144892 divided by -178 -814 Calculate -47324 divided by 11831. -4 What is 6185798 divided by -25882? -239 -619650 divided by -123930 5 Divide -129876 by 3. -43292 What is 1058986 divided by 283? 3742 What is -1 divided by -33200? 1/33200 50 divided by 282 25/141 Divide 869736 by 2004. 434 Divide 546 by -8. -273/4 368601 divided by 3 122867 What is 1354248 divided by 677124? 2 Divide -35202 by -2. 17601 Calculate 11810 divided by -5905. -2 Calculate -3 divided by 109159. -3/109159 What is 12 divided by -272? -3/68 What is -49270 divided by 3790? -13 What is -2466250 divided by 1233125? -2 Calculate 1134 divided by 569. 1134/569 Divide -3520706 by -18242. 193 Calculate -16428 divided by 12. -1369 What is 44836 divided by 31? 44836/31 Calculate -3 divided by -47994. 1/15998 What is -9033600 divided by -4? 2258400 Divide -134223 by 1. -134223 Calculate -220032 divided by -4584. 48 -17610 divided by 3522 -5 What is -12442 divided by 12442? -1 -4877 divided by 200 -4877/200 What is -5 divided by -1131919? 5/1131919 -3 divided by 131659 -3/131659 1313 divided by -8 -1313/8 Calculate 478240 divided by -49. -9760 What is 9 divided by -9356? -9/9356 324 divided by -13 -324/13 1466262 divided by -7758 -189 What is -316058 divided by -1? 316058 -280191 divided by -1 280191 Divide 34079 by 1. 34079 7187 divided by 1 7187 -3 divided by -349133 3/349133 Divide -325745 by -1135. 287 What is -190 divided by -405? 38/81 105105 divided by -7 -15015 Calculate 413034 divided by 17958. 23 -16 divided by -22391 16/22391 Divide 1228514 by -3. -1228514/3 What is -136 divided by 317? -136/317 Divide -489900 by 10650. -46 -4446 divided by -4 2223/2 31856 divided by -28 -7964/7 What is -898950 divided by -2766? 325 Divide -26883 by 309. -87 Calculate -50705 divided by -5. 10141 Divide 113458 by -8. -56729/4 Divide 202 by 141. 202/141 Calculate -159 divided by 24. -53/8 -81408 divided by -6 13568 -29632 divided by 926 -32 Divide -1 by 65636. -1/65636 Divide -3814 by -17. 3814/17 What is 13 divided by 3733? 13/3733 What is -2 divided by -1005902? 1/502951 Calculate 2609823 divided by 2103. 1241 2508 divided by -12 -209 Calculate 175597 divided by -175597. -1 Calculate 5 divided by -270387. -5/270387 Calculate 19 divided by 320. 19/320 Calculate 22022 divided by -121. -182 What is 3 divided by -944582? -3/944582 Calculate 6497 divided by -1438. -6497/1438 Divide 363275 by -6605. -55 What is 12563 divided by -79? -12563/79 Divide 43 by -17548. -43/17548 What is 158616 divided by -158616? -1 Calculate 757869 divided by 252623. 3 Divide 191880 by -60. -3198 What is 28 divided by 120878? 14/60439 -5 divided by -84978 5/84978 Divide 31 by 833. 31/833 Calculate -1812 divided by 507. -604/169 Divide 3148794 by -209. -15066 Calculate 1 divided by -39822. -1/39822 Calculate -3089775 divided by -4. 3089775/4 What is -12779 divided by -13? 983 Calculate -33145 divided by -5. 6629 Calculate 11860 divided by -19. -11860/19 Divide 14688 by -4. -3672 Calculate -243008 divided by -15188. 16 -4 divided by -622 2/311 3363 divided by -3 -1121 118771 divided by 1627 73 Calculate 305250 divided by -61050. -5 What is 5 divided by -8456? -5/8456 Calculate 8 divided by -2727. -8/2727 Calculate -1660 divided by 1660. -1 Divide -46072 by 13. -3544 22876 divided by -1204 -19 What is -45402 divided by 2? -22701 Calculate -878493 divided by 26621. -33 Divide -4 by 8035. -4/8035 Calculate -1249200 divided by -6. 208200 What is 2 divided by 6274? 1/3137 What is -64040 divided by 20	{ "pile_set_name": "DM Mathematics" }
4 Round -3.9036439 to the nearest ten. 0 Round 3171174360 to the nearest 1000000. 3171000000 What is -0.00223677577 rounded to 5 decimal places? -0.00224 Round 0.000082292287 to 6 decimal places. 0.000082 Round -495536577 to the nearest 100000. -495500000 Round 2.08555064 to three dps. 2.086 Round -16701.46388 to the nearest ten thousand. -20000 Round 32.589378 to zero decimal places. 33 Round 23.1328362 to the nearest integer. 23 Round -22.5385609 to one dp. -22.5 What is 0.0004672064097 rounded to 4 dps? 0.0005 Round 0.00025114372 to seven dps. 0.0002511 Round -0.00000235128676 to seven decimal places. -0.0000024 Round 1782763230.1 to the nearest one hundred thousand. 1782800000 What is 0.00000118649343 rounded to 7 decimal places? 0.0000012 Round 508.802912 to the nearest ten. 510 What is 0.003662399547 rounded to 5 dps? 0.00366 Round -0.0037591114 to five decimal places. -0.00376 What is 0.404166221 rounded to 1 decimal place? 0.4 What is 2117.44408 rounded to zero decimal places? 2117 What is -8.4384069 rounded to three decimal places? -8.438 What is -16965060.5 rounded to the nearest 1000? -16965000 Round -579846.46 to the nearest 100. -579800 Round -0.095997274 to 4 decimal places. -0.096 What is -6.0233309 rounded to one decimal place? -6 What is -1182.54201 rounded to 2 dps? -1182.54 Round -0.000002683511 to 7 decimal places. -0.0000027 Round 7.4184863 to 2 decimal places. 7.42 Round 1.506587473 to three decimal places. 1.507 Round 4.76804073 to 0 dps. 5 What is -0.0001298946128 rounded to five decimal places? -0.00013 Round 1733486.7036 to the nearest 100000. 1700000 Round -0.461027439 to five decimal places. -0.46103 Round -0.000005212691904 to six decimal places. -0.000005 What is -0.5017952465 rounded to 1 decimal place? -0.5 What is 23.50313112 rounded to the nearest integer? 24 What is -776.6173346 rounded to 1 decimal place? -776.6 Round -1432.744262 to the nearest integer. -1433 Round 5.78484831 to the nearest integer. 6 Round -301.41256 to zero dps. -301 What is -0.000753256778 rounded to 7 decimal places? -0.0007533 Round -326395.69 to the nearest 1000. -326000 What is -0.08268571 rounded to 4 decimal places? -0.0827 Round -5463.92154 to the nearest one hundred. -5500 What is 0.00000078768219 rounded to six decimal places? 0.000001 What is 0.00044355699 rounded to six decimal places? 0.000444 Round -556.7186 to the nearest one thousand. -1000 What is -2.0708356 rounded to 3 dps? -2.071 Round 259612136.4 to the nearest 100000. 259600000 What is -8829044659 rounded to the nearest 100000? -8829000000 What is -5894140.603 rounded to the nearest 1000? -5894000 What is -127119044 rounded to the nearest 1000000? -127000000 Round 0.001348216 to six decimal places. 0.001348 Round 274.731267 to two dps. 274.73 What is 18689.73581 rounded to the nearest 100? 18700 Round -3316836340 to the nearest one million. -3317000000 Round -135.4107058 to the nearest ten. -140 Round 4.0947532 to 3 dps. 4.095 What is 0.00338514127 rounded to six dps? 0.003385 Round 0.271078108 to three dps. 0.271 What is -0.0000009795228 rounded to 7 dps? -0.000001 What is 1.77017178 rounded to 4 dps? 1.7702 What is 5872.994 rounded to the nearest 1000? 6000 What is -30248997800 rounded to the nearest 1000000? -30249000000 Round 248370280 to the nearest one hundred thousand. 248400000 Round -36611.912 to the nearest 1000. -37000 Round 81624.862 to the nearest ten. 81620 Round 32837342.6 to the nearest 100000. 32800000 Round 0.068414685 to 5 dps. 0.06841 Round 3015367.5 to the nearest 100000. 3000000 What is -0.00778559796 rounded to two decimal places? -0.01 Round 1046.56009 to the nearest integer. 1047 Round -0.05050667455 to five dps. -0.05051 Round -0.0141179976 to six decimal places. -0.014118 What is 11071151400 rounded to the nearest 1000000? 11071000000 What is 831384.42 rounded to the nearest one thousand? 831000 Round -31.95520006 to 3 dps. -31.955 What is -281.595395 rounded to the nearest one hundred? -300 What is 0.0004700528119 rounded to 4 decimal places? 0.0005 Round 4.790938933 to three decimal places. 4.791 Round 44125.141 to the nearest 10. 44130 What is -4698.89892 rounded to 0 decimal places? -4699 What is -0.0004435979728 rounded to seven decimal places? -0.0004436 What is 1097783618 rounded to the nearest one hundred thousand? 1097800000 What is -0.0287745135 rounded to six dps? -0.028775 Round 117097.158 to the nearest one hundred. 117100 Round -1107872.01 to the nearest 1000. -1108000 What is -25.623458 rounded to the nearest ten? -30 Round 1124377190 to the nearest 100000. 1124400000 Round 0.000465293608 to 6 dps. 0.000465 What is 7955446.066 rounded to the nearest 10000? 7960000 Round -0.000061978471 to five decimal places. -0.00006 What is -0.0454006936 rounded to six decimal places? -0.045401 What is -0.17634973 rounded to two dps? -0.18 What is -58756.6984 rounded to the nearest 100? -58800 What is -0.612300458 rounded to 5 decimal places? -0.6123 What is 73074.65349 rounded to the nearest 1000? 73000 What is 728716.9108 rounded to the nearest ten thousand? 730000 What is -323295.0202 rounded to the nearest 100000? -300000 What is -0.0000436885571 rounded to 5 dps? -0.00004 Round 9512898 to the nearest 1000000. 10000000 What is -27.71381349 rounded to zero decimal places? -28 Round -48777.9239 to the nearest 100. -48800 Round -99447.418 to the nearest one hundred thousand. -100000 Round -0.0861986954 to three decimal places. -0.086 What is -55.34964502 rounded to 0 dps? -55 What is -40073068000 rounded to the nearest one million? -40073000000 What is -0.0000224072529 rounded to seven decimal places? -0.0000224 What is -29641191.71 rounded to the nearest ten thousand? -29640000 What is 5025.306672 rounded to 0 dps? 5025 What is -81.277445 rounded to zero dps? -81 What is -3784547.172 rounded to the nearest 1000? -3785000 Round 277128166.4 to the nearest one hundred thousand. 277100000 What is -0.004961494763 rounded to 6 dps? -0.004961 Round -58.1291457 to two dps. -58.13 Round -0.05890631057 to two dps. -0.06 What is -2514.99718 rounded to the nearest one hundred? -2500 What is -5034.95978 rounded to the nearest 100? -5000 Round -66317.64 to the nearest one hundred thousand. -100000 What is 341.4317323 rounded to one decimal place? 341.4 What is 0.00006967531162 rounded to six dps? 0.00007 Round -19.794039 to 2 dps. -19.79 Round 265813.2 to the nearest one thousand. 266000 Round -7792445.84 to the nearest one million. -8000000 Round 1.44537245 to one decimal place. 1.4 Round 2176170.372 to the nearest one thousand. 2176000 Round -5.0414078 to the nearest 10. -10 Round -5325.684 to the nearest one hundred. -5300 Round -9.55584314 to one decimal place. -9.6 Round -0.0000968403316 to five dps. -0.0001 Round 6748.171152 to the nearest 1000. 7000 What is -0.490627507 rounded to 5 decimal places? -0.49063 Round -70318.444 to the nearest 1000. -70000 What is -674.727148 rounded to the nearest ten? -670 What is -680.424387 rounded to 2 decimal places? -680.42 What is -836730.42 rounded to the nearest one thousand? -837000 Round -2.603591898 to 4 decimal places. -2.6036 What is -267246.687 rounded to the nearest one thousand? -267000 Round 0.00080982264 to 7 dps. 0.0008098 Round 0.054734898 to four dps. 0.0547 Round -2.98130627 to two dps. -2.98 What is 6737.7762 rounded to the nearest 100? 6700 What is 0.0000086712412 rounded to 6 decimal places? 0.000009 Round -0.10021936 to five dps. -0.10022 Round 0.0000279451016 to six decimal places. 0.000028 Round 159947240 to the nearest 100000. 159900000 What is -2596449.43 rounded to the nearest ten thousand? -2600000 What is 0.010164130312 rounded to 6 decimal places? 0.010164 What is 1.051321501 rounded to 3 dps? 1.051 What is -0.000080133208 rounded to six decimal places? -0.00008 Round 6620747.7 to the nearest 1000000. 7000000 Round -289.74893 to the nearest integer. -290 Round 502981.02 to the nearest one hundred thousand. 500000 What is -0.0000016163515 rounded to six dps? -0.000002 What is -0.259685708 rounded to three dps? -0.26 What is 14606065.2 rounded to the nearest 1000000? 15000000 What is -37121.175 rounded to the nearest 1000? -37000 What is -946.76358 rounded to 1 decimal place? -9	{ "pile_set_name": "DM Mathematics" }
(i) = -i*2. Let w(x) = -12285667x. What is w(r(h))? 12285667h2 Let d(r) = r2 - 2r. Let b(f) = f - 1. Let a(m) = 3m - 2. Let z(h) = a(h) - 2b(h). Let s(q) = d(q) + 2z(q). Let n(o) = 4o*2. What is n(s(t))? 4t4 Let q(b) = b2. Let l(c) be the third derivative of 0c3 + 43c*2 - 17/24c*4 + 0 + 0c. What is q(l(j))? 289j2 Let q(d) be the first derivative of 7d*2/2 + 5d + 110. Let h(t) = 5t2. What is h(q(a))? 245a*2 + 350a + 125 Let k(s) = -2s. Let i(r) be the first derivative of 792r*3 + 213. What is k(i(a))? -4752a*2 Let p(w) = -38w. Let f(b) = -123200b + 2 + 61552b + 61587b. Give f(p(h)). 2318h + 2 Let f(c) = 11c - 7. Let t(v) = 5v - 4. Let r(q) = -4f(q) + 9t(q). Let n(d) = d*2. Let i(b) = -4b*2. Let w(g) = 2i(g) + 9n(g). Calculate r(w(p)). p2 - 8 Let o(p) = -18p. Let t(i) = i - 2. Let z(r) = 3r - 10. Let w(j) = 3j - 9. Let v(k) = -4w(k) + 5z(k). Let y(m) = 28t(m) - 4v(m). Calculate y(o(n)). -288n Let c be -1(12/(-3))/2. Let i(y) = -10y. Let s(k) = -10k. Let v(t) = ci(t) - 3s(t). Let d(f) = -27f. Calculate d(v(r)). -270r Let q(w) be the first derivative of 0w2 - 4/3w*3 + 305 + 0w. Let n(i) = 113i2. Determine q(n(h)). -51076h4 Let c(j) = -j2. Let k = 473 - 296. Let w(h) = -178h - kh + 400h. Determine w(c(z)). -45z*2 Let p(i) = 39i*2 + 1082i. Let b(d) = -22d2. What is p(b(t))? 18876t*4 - 23804t2 Let a(g) be the second derivative of -g3/6 + 214g. Let z(k) = 44k - 15k + 18k. Determine a(z(s)). -47s Let q(r) = -r. Let i(g) be the first derivative of -5g4/12 - g3/2 + 31g2/2 - 27. Let a(y) be the second derivative of i(y). Give q(a(s)). 10s + 3 Let x(o) = 3132 + 7o - 6263 + 3131. Let s(n) = 52 - 52 + 8n. Determine s(x(i)). 56i Let i(y) = 221y - 164. Let d(k) = -156k. Give d(i(j)). -34476j + 25584 Suppose 0 = -23p + 21p. Let b(u) = pu - 7u + u. Let m(h) = 0h + 3h - 2h. Determine m(b(r)). -6r Suppose 104 = -2h + 15h. Let k(o) = 460o - 460o - ho2 + 4o2. Let z(v) = -v2 + v - 1. Let f(m) = -m + 1. Let b(j) = -f(j) - z(j). Give b(k(g)). 16g4 Let l(i) = -i2. Let f(g) = 6475 - 1500 - 9627g*2 + 9629g*2. Calculate f(l(o)). 2o*4 + 4975 Let x(w) be the third derivative of 0w - 1/60w5 + 0w*3 + 0 + 156w*2 + 0w*4. Let t(u) = -3u*2 + 25u. Give t(x(h)). -3h4 - 25h*2 Let t(q) = -32q + 14. Suppose a + 6 = -8. Let f = a + 9. Let y(r) = -11r + 5. Let v(m) = ft(m) + 14y(m). Let w(j) = -5j*2. Determine w(v(z)). -180z*2 Let j(s) be the second derivative of 0 - 8/3s*3 - s + 0s2. Let u(o) be the second derivative of o4/6 - 3o + 860. Calculate u(j(a)). 512a*2 Let j(q) = 4q - 89. Let b(c) be the first derivative of -c*2 + 6162. Give b(j(x)). -8x + 178 Let h(u) = 31u2. Let m(a) = 7a*2 - 9a - 25. Let s be m(-3). Let b(q) = -66 + 131 - s + 4q. Determine b(h(o)). 124o*2 Let c(z) = -2z. Let m = 2474 - -600. Let b(p) = -3074 - 3p + m. Calculate c(b(o)). 6o Let l(i) be the third derivative of -i*5/10 - 2i*2. Let u(p) = 132 + 115 - 247 + 2p*2. Give l(u(y)). -24y*4 Let s(l) = 8l*2 + 24. Let g(k) = -7k*2 - 32. Let o(n) = 3g(n) + 4s(n). Let u(m) = 222m. Determine o(u(p)). 542124p2 Let o(b) = -2b + 143. Let c(y) = 349y + 10. Let h(i) = 57i + 2. Let v(g) = c(g) - 6h(g). Give o(v(s)). -14s + 147 Let f(g) = -2g2. Let r(i) = 2i*2 + 3i - 2. Let u(v) = 311v2 + 6v - 7. Let o(q) = 2r(q) - u(q). What is o(f(z))? -1228z*4 + 3 Let s(q) = 4258q - 1. Let k(b) = b*2 - 68b + 4. Let w(a) = -17a + 1. Let l(h) = k(h) - 4w(h). Give s(l(v)). 4258v2 - 1 Let q(o) be the first derivative of 4o*2 + 5o + 3717. Let a(t) = -9t. Give a(q(h)). -72h - 45 Let o(v) = -1957v + 80. Let w(g) = 1954g - 100. Let x(y) = 5o(y) + 4w(y). Let k(n) = -3n2. Give x(k(l)). 5907l*2 Let f(v) = 1 - 2 + 1 - 10444v + 11468v. Let l(g) = -3g*2. Calculate f(l(p)). -3072p*2 Let b(m) = 57m. Suppose 3r + 3h = 24, -16 = 14r - 17r - h. Let c(a) = -4a2 + 13a - 5a - ra - 4a. Determine c(b(s)). -12996s*2 Let o(p) = 36p*2 + 16p*2 + 16p*2. Let j(u) = -209947u*2 + 3u - 5u + 2u + 209950u2. What is o(j(l))? 612l*4 Let x = 48 - 35. Let p(q) be the first derivative of -x - 7q*2 + 2 + 10q*2. Let k(y) = -y. Calculate p(k(h)). -6h Let a be 15/(((-27)/(-30))/3). Suppose 6 + a = 7h. Let b(v) = -hv - 4v + 26v. Let z(r) = -2r2. Determine z(b(i)). -392i*2 Let a(k) = -18k*2. Let w(b) = b - 2. Let u(s) = -2s + 12. Suppose -70 = 7m - 28. Let y(d) = mw(d) - u(d). Give y(a(i)). 72i2 Let a(n) = 64n*2. Let j(c) be the first derivative of -11c*3/3 + 1490. Give a(j(t)). 7744t*4 Let h = -1 - -7. Let j(c) = hc - 9c + 17c. Let x(v) be the third derivative of -v*4/12 - 211v*2. Determine x(j(b)). -28b Let w(k) = 1175k - 30. Let x(t) = -287t + 7. Let f(d) = 4w(d) + 17x(d). Let n(c) = 44c2. What is f(n(q))? -7876q*2 - 1 Let g(o) = 2o*2. Let c = -107 - -236. Let a(p) = -129p + cp - 2p*2. What is g(a(m))? 8m*4 Let w(h) = -21h - 19. Let o be w(-1). Let g(i) = oi2 + 2i*2 - 3i*2. Let v(m) = 14m. Let y(q) = 56q. Let t(u) = 9v(u) - 2y(u). Give t(g(n)). 14n*2 Let u(t) = 43t*2 - 151t*2 + 41t*2 + 51t*2 + 37t*2. Let z(h) = -59h. Calculate z(u(m)). -1239m2 Let o(x) = -x2. Let k(v) be the second derivative of -40v*3/3 + 4v*2 - 1295v + 1. What is o(k(w))? -6400w2 + 1280w - 64 Let z(o) = o*2. Let h(b) be the second derivative of 1295b*3/2 + 249b - 3. Determine h(z(m)). 3885m2 Let z(x) be the second derivative of x3/3 + 251x - 2. Let c(q) = 2q2 - 10q + 7. Let j be c(6). Let o(f) = -1 - jf2 + 1. Give z(o(s)). -38s*2 Let x(l) = -943l. Let y(p) = -p*2 + 107503p. Determine y(x(w)). -889249w2 - 101375329w Let q(k) = -k*2 - 5. Let g(v) = -230v - 153. Let a(s) = -81s - 54. Let u(x) = 17a(x) - 6g(x). What is q(u(r))? -9r*2 - 5 Suppose -q = -2q. Let f(m) = -m*2 + qm*2 - 2m*2. Let h(w) = -152w + 248w - 2 + 4 - 73w - 2. What is f(h(t))? -1587t2 Let x(c) = -c3 + 4c + 3. Let t be x(-1). Let f(m) be the second derivative of 10m + tm*3 + 0m*2 + 0 + 13/12m*4. Let y(j) = -j. Determine f(y(b)). 13b*2 Let i(j) = 79j*2 + 73j*2 - 234j*2 + 74j*2. Let u(v) = -5v*2 - 7v2 - v2. What is i(u(c))? -1352c4 Let w(o) = 7o*2. Let b = -612 - -619. Let a(u) = -5u - 7. Let t(s) = -3s - 4. Let z = -11 + 7. Let q(r) = bt(r) + za(r). Calculate q(w(x)). -7x*2 Let b(i) be the third derivative of 42i*2 + 0i*3 + 0 + 1/6i*4 + 0i. Let m(o) = 10o. Give m(b(k)). 40k Let n(h) = 7h2. Let k(p) = -p2 - 33p - 42. Let u(i) = -2i2 - 44i - 42. Let z(r) = -4k(r) + 3u(r). Give z(n(x)). -98x4 + 42 Let z(m) = 8817 - 17628 + 4m*2 + 8811. Let i(a) = -264a. Determine i(z(x)). -1056x2 Let d(k) = -41722k. Let u(n) = 479n2. What is d(u(s))? -19984838s*2 Let p(l) = 5675677l*2 - 1532l - 1532. Let o(n) = -11107n2 + 3n + 3. Let k(i) = 1532o(i) + 3p(i). Let g(h) = -h*2. Calculate g(k(b)). -123365449b*4 Let o be (-1 + 1)/(-7 + 192/24). Let x(h) be the third derivative of 0h*3 + 1/15h*5 + 0h + 0h4 + o + 10h*2. Let r(m) = -5m*2. Determine x(r(q)). 100q*4 Let i(r) = -2r*2. Let l(d) = -10d - 13. Suppose s = -5o, -3o - 4 = -4o - s. Let m(j) = 2j - 1. Let g(t) = ol(t) - 2m(t). Give g(i(f)). -12f2 + 15 Let f(j) = -j2. Let v(s) = -123781846s*2. Calculate v(f(p)). -123781846p4 Let s(j) be the third derivative of j5/120 - 5j4/4 + 133j*3/6 + 5j2. Let k(x) be the first derivative of s(x). Let f(w) = w2. Calculate f(k(l)). l*2 - 60l + 900 Let u(g) = -446g. Let f(x) = 217907x. Give u(f(o)). -97186522o Let v(z) = -716z*2. Let t(i) = -418i. What is t(v(o))? 299288o2 Let w(f) = 4f. Let c = -68 + 80. Suppose 0 = -0p - cp. Let j(x) = 4x2 + px*2 + 4x*2. What is w(j(i))? 32i*2 Let d(i) = -4i*2. Let n(o) = 23 - 14 + 11 + 11o - 11o - 3o. Determine d(n(j)). -36j2 + 480j - 1600 Let z(d) = -5d2. Let s(f) be the first derivative of -3f*2/2 - 67f - 194. Give s(z(b)). 15b2 - 67 Let v(n) = -706571n - 1. Let r(k) = -89k2 - 2. Give v(r(q)). 62884819q*2 + 1413141 Let x(y) = -74y*2 - 6y + 42. L	{ "pile_set_name": "DM Mathematics" }
4 (b) l (c) 0 c Let g be 109/(18/4). Let a = -17 + g. Suppose 0 = -am + v - 0v - 16, v + 12 = -4m. What is the smallest value in m, -1, 0.03? m Let q = -1499/8 - -188. Let r = 1/4 - q. Let g be 1/((-3 - -1)/(-6)). Which is the third smallest value? (a) r (b) g (c) -0.5 b Let b = 1.09 - 0.59. What is the third biggest value in 9, b, -2? -2 Let s = -1.092 - -0.092. Let k = 10 - 10.1. Which is the third smallest value? (a) k (b) s (c) 2 c Let w = -2978 - -8933/3. Let s = 7.1 - 0.1. What is the third smallest value in -0.1, w, s? s Let i = -122 - -128.9. Let j = 7 - i. What is the third biggest value in -2/11, j, 4? -2/11 Let d = 49/94 - 1/47. What is the biggest value in -0.06, -0.4, 1, d? 1 Suppose 6t - 16 = 4t. Suppose -3q - 10 = t. Let p be (-2)/(-3) - (-10)/q. Which is the smallest value? (a) -0.4 (b) p (c) 1 b Let p = -8 + 11. Let z = 239 + -237. What is the third biggest value in p, z, 2/5, -2? 2/5 Let t(g) = g3 + 5g*2 + g + 2. Let s be t(-5). Let z be ((6 - 2) + s)/7. What is the second biggest value in z, -1/5, 3/7? z Let g = 196.004 + -196. What is the biggest value in 2/5, g, -0.4? 2/5 Let j = -9951.6 - -9952. Let b be 5/(-52) - 1/(-4). What is the smallest value in j, 0.2, b? b Let m be (-10)/(-10) - (-27)/(-15). What is the second smallest value in m, -12, 1.6? m Let k = -54 - -28. Let q = k + 26. Which is the second smallest value? (a) -2/7 (b) q (c) 2/9 b Suppose -3310l = -3300l - 10. Which is the smallest value? (a) -1.03 (b) -0.2 (c) l a Let w be (8/24)/(-1)-2. What is the third smallest value in -0.2, w, 119? 119 Let d = 10 + -6. Let p be 3/(-6)d/6. What is the second biggest value in -5, 2, p? p Let q = -0.05 + -1.95. Let r(j) = -3j - 7. Let v be r(-3). Suppose va = 2 - 0. What is the third biggest value in a, 0.02, q? q Let r = 203/9 - 67/3. Let h = 7 - 7.5. What is the fourth biggest value in -3, r, h, 1/4? -3 Let d = -9.4 - -8.4. Let l = 8 - 12. Which is the third biggest value? (a) -14 (b) l (c) d a Let o be (-4)/5 + (1 - 1). Let k be (24/(-150))/(-4 + 110/25). What is the second biggest value in k, 3, -0.01, o? -0.01 Suppose -3 = -2f + 5l, -4l + l + 27 = 2f. Let u(n) = 2n - 16. Let z be u(f). Which is the second biggest value? (a) z (b) -2 (c) 3/4 c Let n be 4/(-8) - (-22)/20. Let p = 1109 + -1110. What is the third smallest value in -2/15, -0.1, p, n? -0.1 Let i = 0.4 - 0.7. Let y = 0.713 + -0.743. Which is the third biggest value? (a) -4 (b) i (c) y a Let w = 21.9 - -6.1. Let y = 28.5 - w. Let v = -16 + 18. Which is the second biggest value? (a) v (b) y (c) -0.3 b Let p = -511/2 + 254. Which is the fourth smallest value? (a) p (b) -1 (c) 4 (d) -2.2 c Let d = 0.819 + 1.181. Let j = -1 - -3. Let g = j - 1.6. Which is the biggest value? (a) -2 (b) d (c) g b Let n(j) = -j*3 + 5j*2 - 10. Let w be n(5). Let s = -27 + 26.5. Which is the second biggest value? (a) w (b) s (c) 0.2 (d) 2 c Suppose 0 = -3j - 4m + 7m + 6, -2m = j - 5. What is the third biggest value in 1, 2, j, 0.3? 1 Let t = -0.202 - -0.702. Which is the biggest value? (a) 7 (b) -10/7 (c) t (d) -0.1 a Let r = -0.026 + -44.974. Let w = r - -54. Which is the third smallest value? (a) -0.5 (b) w (c) 4 b Let p = -2 + -1. Let y(g) = g2 + 9g + 3. Let z be (-7 - 4) + 3 + 0. Let f be y(z). Which is the smallest value? (a) p (b) f (c) 0.2 b Let x = -8.11 + 8.01. What is the second smallest value in -95, 2, x? x Let u = 35652/25 - 1426. What is the biggest value in 0.2, u, -4? 0.2 Let p = -1554 - -1551. What is the fourth biggest value in -13, p, 4, -1/12? -13 Let s = 18 + -24. Let k = -0.95 + -0.05. Let z = s - k. Which is the biggest value? (a) -4 (b) z (c) 0.3 c Let b = -8 + 4. Let y = 0.855 - 0.755. What is the second biggest value in y, b, 0.7? y Let p = -3.2235 + 0.2235. Let x = 2.05 + -0.05. Which is the second biggest value? (a) p (b) 0 (c) x b Let i = 14.8 + -17. Let p = 13 - 10.3. Let o = i + p. Which is the biggest value? (a) o (b) 0 (c) -1/5 a Let p = -2 - -8. Let w = p - 2. Let h = 163/4 + -41. What is the biggest value in h, w, 1? w Let h = -0.16 - -0.56. Let t = 0.436 + 0.064. Which is the second smallest value? (a) t (b) -5 (c) h c Let g = -0.9 - -0.743. Let o = -0.197 - g. Let u be 26/(-44)-2 - 1. Which is the second smallest value? (a) o (b) -3 (c) u a Let w = 397 + -392. What is the second biggest value in 2, -1, 4, w? 4 Let s = 113/5 + -23. What is the third smallest value in -7, 2, s, 0.5? 0.5 Let l = 29 - 28. Let z = -188 + 184. Which is the smallest value? (a) l (b) z (c) 0.06 b Let t = -427 - -424. Suppose -3j + 0j = -12. Which is the third biggest value? (a) j (b) t (c) -2/7 b Let x = -0.9105 + -0.0895. Which is the biggest value? (a) 4 (b) -9 (c) x a Let w = 3958/13 - 304. Let r = 0.2 + -0.2. Which is the third biggest value? (a) w (b) 1 (c) r c Let d = -5.5762 - -0.0062. Let p = 0.57 + d. Which is the biggest value? (a) -0.7 (b) p (c) 4 c Let b = 5.845 + -0.045. Let m = b + -0.8. What is the biggest value in -0.5, 4, m, -0.4? m Let n = 61 + -57. Suppose -3i + 4 = -5z - 9, -21 = ni + z. Which is the biggest value? (a) i (b) -17 (c) 0.4 (d) 0.3 c Suppose 0 = -3q + 9, 3q + 3295 = 5y - 71. Let h be ((-2)/(-3))/(18/y). Suppose 11g - 6g = -h. Which is the second smallest value? (a) 0 (b) g (c) 1 a Let f be 1/4 - 2/(-56). Let t = 65 - 389/6. Let q = -0.07433 + -3.92567. Which is the third smallest value? (a) q (b) f (c) t b Let d = 30 - 59/2. Suppose -2q = z + 6, 0 = -2q - q - 2z - 10. Let j be 3/(-4)16/4. Which is the biggest value? (a) q (b) j (c) d c Let n = -18 + 14. Let j = -30 + 21. Let i = j - -9.4. Which is the third smallest value? (a) -0.1 (b) i (c) n b Let n be (-2 - -2) + (-42)/(-189). What is the fourth biggest value in 0, 4, -0.3, n? -0.3 Let z = 352/5 - 71. Let t(v) = -v3 + 6v*2 - 4v + 4. Let i be t(5). Let n be (i/12-1)/(-5 - -2). Which is the third smallest value? (a) n (b) z (c) 4 c Let r(w) = w3 + w + 4 - w - w. Let y be r(0). Let h be ((-1 - 0) + 4)/(-5). Which is the biggest value? (a) y (b) h (c) 0.1 a Let i = 12 - 5. Suppose 3w - 4o = 8, 0 = -io + 2o - 10. Let t = -11.595 - -9.595. What is the smallest value in w, -0.3, t? t Let g = 35.3 + -35.2. What is the smallest value in g, -0.2, 0.01? -0.2 Suppose 0 = -4j + 3s + 25, -5j + s + 28 = 5. Let k = j - 3. Let w be (k/33)/(1/(-3)). Which is the second smallest value? (a) w (b) 2 (c) 0 c Let d be 1 + 28 - (4 + -3 + 0). Let h be (-4 - d/(-8))14. What is the third biggest value in h, 0.2, 1? h Let r be (-1)/(-5) + 4/((-780)/69). Let l = 0.05 - -2.95. Let m = l - 2.5. Which is the biggest value? (a) 2 (b) m (c) r a Let r be 7 + 1 + (21 - 14) + -4. What is the second biggest value in 0.1, r, -0.5? 0.1 Let z = -28 - -6. Let q = 22.8 + z. Let y = q + 0.2. What is the second smallest value in -0.5, y, -0.3? -0.3 Let q be (-565)/420 + (-72)/96. What is the third biggest value in 1, 5, q? q Let s = 0.52 - 0.02. Let f = 21078/17 - 1240. Which is the biggest value? (a) f (b) s (c) 4/7 c Let f = 1.1 - 1. Let v(j) = -j2 + 4j + 13. Let t be v(6). Let m be (t-3)/(4 - 3). Which is the third smallest value? (a) f (b) m (c) -1/4 a Let o be (15 + -11)6/(-8) + 2. What is the smallest value in 0, 0.06, -5/4, o? -5/4 Let o = 17 + -3. Suppose -u + 6 = -3g, 2g = 3u - 3g - o. Let v be ((-44)/11)/((-4)/6). Which is the third biggest value? (a) v (b) u (c) -1 c Let l = -3 - 0. Let k = 854.5 - 855. Which is the smallest value? (a) k (b) -2 (c) l (d) -0.2 c Let n = -33.6 + 31. Let j = 46 + -48.4. Let q = n + j. Which is the third smallest value? (a) -1/4 (b) 4 (c) q b Let j = -80.8 - -81. Let h = 1 + 2. What is the second biggest value in j, h, 0.05? j Let s = -4.04 + 3.84. Which is the second biggest value? (a) s (b) -30 (c) 5 (d) -5/3 a Let n = 0.1087 + 0.1913. Let u = 14/19 + -429/608. Let z = -35/96 + u. What is the second biggest value in 0, n, z? 0 Let j = -0.089 + 0.002. What is the fourth biggest value in -1/4, 0.2, -0.2, j? -1/4 Let d = -66 + 12. Let o = d - -57. What is the fourth biggest value in 5, o, -0.2, 0.06? -0.2 Let l = 117 + -86. Let q = l - 29. Which is the fourth biggest value? (a) q (b) 5/4	{ "pile_set_name": "DM Mathematics" }
- -3.5. Put 3, 4, y, u in descending order. u, 4, 3, y Let l be 2/(-3) + (-2)/(-30). Let v = -0.13 - -3.13. Let i = -53.07 - -49.07. Put i, l, v in increasing order. i, l, v Suppose -5d - 4g + 42 - 13 = 0, -2g + 12 = 2d. Let z = 175.48 + -2.48. Let a = 187 - z. Sort -0.1, d, a in ascending order. -0.1, d, a Let q(j) = j*3 + 31j*2 - 34j - 44. Let l be q(-32). Suppose 0 = 2r + 2g + 26, g + l = 5g. Sort 1, r, 4 in decreasing order. 4, 1, r Let r = -0.44 - -0.04. Let o = 0.4 + r. Let i = -18254.5 + 18255. Sort -0.2, o, i, -1/7 in increasing order. -0.2, -1/7, o, i Let n be (-5 - -1) + (-608)/(-368). Let l = n + -7/46. Sort l, -11, 0.1 in ascending order. -11, l, 0.1 Let o be -4 + (-48)/21 + -102/(-70). Sort 14, o, 9. o, 9, 14 Let u = 521 - 520.37. Let f = u - 1.03. Put 16, f, 0 in ascending order. f, 0, 16 Let j = -0.163 + 218.163. Let n = -216 + j. Sort n, 5, 19. n, 5, 19 Let y = -16139 - -16140. Put 661, y, 3, -2 in descending order. 661, 3, y, -2 Let t = 9581 - 9580. Sort 2, -1, 9, t in ascending order. -1, t, 2, 9 Let l = 9 + -11. Let c = -5710.4 + 5710. Sort l, -1/5, 0.5, c in ascending order. l, c, -1/5, 0.5 Let s be -2 - (-7)/6 - (-3 - 147/(-63)). Put s, 0.5, 4/89 in descending order. 0.5, 4/89, s Let x = 66 + -90. Let z = x - -13. Sort z, -4, 1 in ascending order. z, -4, 1 Let p(x) = -x*2 - 2x + 359. Let y be p(-20). Suppose o + 0o - 3 = 0. Let m = -3 + o. Sort m, y, 1, 2. y, m, 1, 2 Suppose 4j + 8 = 2m, -7j + 8j = 3m - 2. Suppose 2s - 2t = 4s, -2s + 3t = m. Put s, -1, 2, -2 in decreasing order. 2, s, -1, -2 Let u = 66 - 104. Let t = u - -53. Let x = t + 6. Sort 1, 3, x. 1, 3, x Let j = -41.02 - -41.62. Sort j, 0.3, -4 in decreasing order. j, 0.3, -4 Suppose -170 = 154m - 730 - 364. Sort 2, 3, m, 1, 20 in increasing order. 1, 2, 3, m, 20 Let y = 467 + -207. Let s = -260 + y. Put 5, s, 15 in ascending order. s, 5, 15 Suppose -168 + 33 = 15w. Let n be (2/2)/((-3)/w). Let h(o) = -o3 + 3o*2 + 2o - 7. Let s be h(n). Put -2, 0, s, -20 in ascending order. -20, -2, s, 0 Suppose 0 = 6h - 62 - 28. Suppose 0 = 12f - 17f - h. Let u = -116 - -115. Put f, u, -2 in ascending order. f, -2, u Suppose 36x + 10 = 2g + 38x, 5x = -2g + 1. Put 4, -2, g, 0.2 in decreasing order. g, 4, 0.2, -2 Suppose 66c = 44c - 330. Sort c, -280, -2 in descending order. -2, c, -280 Let s be 3/(-10 - -16)(-1 - -1). Suppose -3o + 5n - 3 = 6n, s = 2n - 6. Let v(h) = -h2 + 5h + 1. Let y be v(4). Put o, y, 4, -4 in increasing order. -4, o, 4, y Let o = 4552771/5427070 + -103/10538. Let y = 3/103 - o. Let z be 0 - 1 - 6/(-10). Sort z, -0.11, y in ascending order. y, z, -0.11 Let k = 146 + -246. Let r = -0.18 + -100.32. Let l = k - r. Sort l, -1/7, 2/21, 0.2. -1/7, 2/21, 0.2, l Suppose -4g = 4n - 24, -2g + 3g - 5n = 0. Let r = -17.9 + 20.82. Let f = -3 + r. Put f, g, 2/3 in increasing order. f, 2/3, g Suppose 0 = -298y + 301y + 5j - 40, -5j = 5y - 50. Put 1, -3, 17, y, -5 in descending order. 17, y, 1, -3, -5 Let w be 10/2 + (-1800)/9 + 2. Let t = 190 + w. Sort -1, t, 16 in ascending order. t, -1, 16 Let z = 47 - 47. Let f = -9 + 8.99. Let d = 10/29 + -228/493. Sort f, d, z, -5. -5, d, f, z Let p(h) = -704h + 6343. Let a be p(9). Suppose -5s - 3u + 0u - 35 = 0, 3s + 2u + 21 = 0. Put a, -1, s in decreasing order. a, -1, s Let b(n) = -n - 3. Let j be b(-2). Sort j, -42, 2, 4 in decreasing order. 4, 2, j, -42 Let p = -1.5 - -2.8. Let n = 1.3 - p. Let w = 2/16085 - -9649/16085. Sort -0.3, w, n, 4. -0.3, n, w, 4 Suppose 15p - 11p = -4h + 44, -5p + 5h = -5. Sort p, 43, 4 in descending order. 43, p, 4 Let v(f) = -5f + 3. Let y be v(2). Let t = 11 - 10.974. Let k = t + 0.274. Put 2, k, y in increasing order. y, k, 2 Let s = -0.03619 - -41.03619. Put 2/13, 2, s in decreasing order. s, 2, 2/13 Let h = 9671/4 - 2417. Put 2/183, -3, -2/13, h in ascending order. -3, -2/13, 2/183, h Let n(b) = -2b2 - 17b + 37. Let r be n(-10). Suppose -13 = -4i + r, -4x = -2i + 14. Let f be (4 + -5)(-3)/15x. Sort 0, -11/3, f in descending order. 0, f, -11/3 Suppose 7f - 382 = 73. Let v = -62 + f. Sort -8, -1, v, -3 in ascending order. -8, -3, -1, v Let j = 0.08004 + -194.08004. Sort j, 0.4, 1. j, 0.4, 1 Let r be (13 - -6) + (2 - 2 - -3). Suppose -3o = -4w + 65 - 40, -3o = -w + r. Put -0.3, 4, 0, o in increasing order. o, -0.3, 0, 4 Let j be 1/(-2)(12 + (-13 - -3)). Put -0.5, j, 0.16, 0.05 in descending order. 0.16, 0.05, -0.5, j Let c = 138512/9 + -15390. Sort 2/5, 0.1099, c in ascending order. 0.1099, c, 2/5 Let s = -20 + 30. Let h(g) = 2g3 - 17g*2 + 16g - 62. Let b be h(8). Suppose -bu + 8 = s. Sort 5, u, 4 in decreasing order. 5, 4, u Suppose 5m - 3 = o + 27, -2o = -4m + 36. Let p be (4/10)/(-164o/(-200)). Let t = -1 + 0. Sort t, -2, 0.5, p. -2, t, p, 0.5 Suppose 4b - y = 6 + 8, 0 = b + y - 1. Suppose 0g + 4g - 5t = -4, bt = -5g - 5. Sort g, 0.3, 3/5, 4. g, 0.3, 3/5, 4 Let x be 6/(-4)214/(-9). Suppose -14h = -28h - 71 - 433. Let k = x + h. Sort 0.1, -4, -0.5, k in increasing order. -4, -0.5, k, 0.1 Let w(n) = -79n + 82. Let b be w(1). Sort -5, b, 1, -69. -69, -5, 1, b Let q = 242 + -249.6. Let y = 5.6 + q. Sort -5, 4/7, y. -5, y, 4/7 Let c be 1/((-3)/(-3))(-46)/(-20). Let n = c + -9/5. Sort 2/5, 11, n in ascending order. 2/5, n, 11 Suppose -221 = 5s - 21. Let q = s - -35. Let o be (q/(-20))/((-38)/16). Put 0.41, -0.4, o in descending order. 0.41, o, -0.4 Let x(c) = c3 - c2 - 3c + 2. Let t be x(2). Let v(l) = -l*2 - 5l + 4. Let z be v(-6). Suppose -18839q = -18663q + 176. Put t, z, q in decreasing order. t, q, z Suppose 143 = 3h + 2x, 2x - 3 + 1 = 0. Let u = 46 - h. Sort -4, 0, 5, u in ascending order. -4, u, 0, 5 Let k = 32 + -21. Let c = -5.093 - -4.993. Sort -1, c, k in increasing order. -1, c, k Let c = 46.8 - 315.8. Let l = 305 + c. Sort -3, 2, l in descending order. l, 2, -3 Suppose -r - 5r + 12 = 0. Let c(g) = g*3 - 3g*2 + 3. Let k be c(r). Let o be (25/(-20))/(k/(-4)). Sort o, 2, -3 in decreasing order. 2, -3, o Let o be ((-140)/(-40))/((12)/4). Suppose -z = -oz - 6. Put z, -16, 4 in ascending order. -16, z, 4 Let u(x) be the first derivative of -15x*2/2 + 90x + 26. Let h be u(6). Sort -2/13, 47, 1, h. -2/13, h, 1, 47 Let c = 89 + 19. Suppose -c = -4q - 40. Sort 1, q, 5 in ascending order. 1, 5, q Let b = 7292.5 - 7293. Sort b, 7/4, 14 in ascending order. b, 7/4, 14 Suppose 10l - 252l - 726 - 242 = 0. Sort 4, 1122, -2, l. l, -2, 4, 1122 Let o = 154 - 154.118. Let x = o - 1.082. Let y = 3 - 5. Sort x, 2/21, y. y, x, 2/21 Let s(z) = z - 4. Let j be s(0). Let n be (6/(-30))/((-46)/1150). Sort n, -5, j, -14 in increasing order. -14, -5, j, n Let z = -9.55 + 606.55. Let o = z + -600. Put 4, -0.2, 2, o in descending order. 4, 2, -0.2, o Suppose -4z - 4o = 25 - 5, 3 = -z - 2o. Suppose -5y + 0y + 15 = -i, 10 = 5y - 2i. Let s be 19/(-7) - 4/14. Put z, y, -5, s in descending order. y, s, -5, z Let f = -1762 + 1680. Let g = -16 - 61. Let h = f - g. Sort h, -5/4, -7 in decreasing order. -5/4, h, -7 Let o = -1870.4 - -1870.9. Sort 4, -0.5, o, -0.056, -1/5 in increasing order. -0.5, -1/5, -0.056, o, 4 Suppose 0 = -3r + r + 3m - 1293, m + 634 = -r. Let w = r - -643. Suppose 3v - 2 = 7. Sort v, 0, w in decreasing order. w, v, 0 Suppose 20g - 240 = -10g. Suppose 0 = 4o - 4a - 5 + 9, -2o - a - g = 0. Put 2, o, 38 in decreasing order. 38, 2, o Suppose -120s - 26s = 266742. Sort s, 1, -4 in ascending order. s, -4, 1 Let i(u) = -811u - 8930. Let c be i(-11). Suppose -2w + 2o - 38 = 0, 6o - 2o = w + 16. Put c, -5, w in increasing order. w, c, -5 Let t = 2479 - 2516. Put t, -7, -5/3, -1/3 in descending order. -1/3, -5/3, -7, t Suppose -4h + h - 126609 = 0. Let n = 381571/9 + h. Let v = n - 194. Put -0.3, -1, v in decreasing order. v, -0.3, -1 Let r(d) = 23d - 85. Let g be r(7). Suppose 3x = g - 82. Sort x, 25, -5 in decreasing order. 25, x, -5 Let k = 379 - 228. Let c = k - 149. Sort 3, c, 0, -2 in decreasing order. 3, c, 0, -2 Let l be (-182)/116 - 62/(-899). Put 23, l, 0.9, -2/7 in descending order. 23, 0.9, -2/7, l Let g = 10 - 10.55. Let w = -0.53 - g. Let k = 215 - 427/2. Sort k, w, 1/7 in descending order. k, 1/7, w Let w = 47 + -43.3. Let c be (-3)/66(222/(-1	{ "pile_set_name": "DM Mathematics" }
2, s: 1, b: 2}. 1/120 What is prob of sequence ok when two letters picked without replacement from mokmbis? 1/42 Four letters picked without replacement from {m: 1, g: 5, p: 7}. Give prob of sequence ggmg. 1/286 What is prob of sequence uucc when four letters picked without replacement from {u: 9, c: 3}? 2/55 Four letters picked without replacement from {s: 6, o: 7}. Give prob of sequence oooo. 7/143 Two letters picked without replacement from {c: 4, l: 3}. What is prob of sequence ll? 1/7 Calculate prob of sequence gg when two letters picked without replacement from eggfe. 1/10 Calculate prob of sequence tmb when three letters picked without replacement from bmbt. 1/12 Two letters picked without replacement from oydufiu. Give prob of sequence dy. 1/42 Calculate prob of sequence uzr when three letters picked without replacement from uqoruqzoqfoouo. 1/728 Three letters picked without replacement from cxwdl. What is prob of sequence ldx? 1/60 Three letters picked without replacement from mulumulummmummmulmu. What is prob of sequence mmm? 28/323 Two letters picked without replacement from {p: 10, a: 4, s: 2}. Give prob of sequence pa. 1/6 Three letters picked without replacement from dndnpnomdm. What is prob of sequence mnm? 1/120 Calculate prob of sequence ynr when three letters picked without replacement from {w: 1, y: 6, n: 11, a: 1, r: 1}. 11/1140 Calculate prob of sequence mt when two letters picked without replacement from btmmt. 1/5 What is prob of sequence ukt when three letters picked without replacement from utakkuuajma? 1/165 What is prob of sequence rfj when three letters picked without replacement from {i: 1, j: 2, r: 4, f: 1, q: 2, v: 2}? 1/165 Two letters picked without replacement from gvvemgevgtitmmmtv. What is prob of sequence ee? 1/136 Three letters picked without replacement from hmehktei. Give prob of sequence hme. 1/84 Two letters picked without replacement from {d: 1, r: 1, s: 3, t: 2}. What is prob of sequence st? 1/7 Four letters picked without replacement from {t: 13, k: 6}. Give prob of sequence ttkt. 143/1292 What is prob of sequence rgg when three letters picked without replacement from {e: 1, r: 5, g: 4}? 1/12 Two letters picked without replacement from rrbrbrwbrbr. What is prob of sequence bw? 2/55 Two letters picked without replacement from {v: 1, s: 2, n: 1, q: 3, p: 2, z: 3}. What is prob of sequence zn? 1/44 Calculate prob of sequence ev when two letters picked without replacement from {e: 3, v: 1}. 1/4 Two letters picked without replacement from {r: 7, w: 4}. Give prob of sequence rw. 14/55 Two letters picked without replacement from {t: 3, h: 6, u: 2, n: 1, z: 2, r: 5}. Give prob of sequence zh. 2/57 What is prob of sequence vv when two letters picked without replacement from vmvvvmmvvmvvmvvvvvvv? 21/38 Three letters picked without replacement from {x: 2, n: 5, d: 3, h: 6, j: 2, l: 1}. What is prob of sequence lhn? 5/969 Calculate prob of sequence ypp when three letters picked without replacement from {i: 2, y: 1, j: 1, p: 4, o: 1}. 1/42 Calculate prob of sequence llh when three letters picked without replacement from {h: 2, l: 15, g: 3}. 7/114 Four letters picked without replacement from {x: 1, n: 3, y: 5, c: 3}. Give prob of sequence xycc. 1/396 What is prob of sequence owbb when four letters picked without replacement from sstttswoowtfbsowb? 3/9520 Three letters picked without replacement from cqcqqqccqc. What is prob of sequence qqq? 1/12 Three letters picked without replacement from rxdxgrgxgxg. What is prob of sequence ggr? 4/165 Calculate prob of sequence oo when two letters picked without replacement from rbrkrrlrokbbrrbrbool. 3/190 Calculate prob of sequence tnn when three letters picked without replacement from {t: 1, n: 2, w: 2, q: 1}. 1/60 What is prob of sequence nnce when four letters picked without replacement from {n: 10, e: 1, b: 5, c: 4}? 1/323 Two letters picked without replacement from gttttgbbgttthhgttgtt. Give prob of sequence tg. 11/76 Two letters picked without replacement from {p: 1, b: 11}. Give prob of sequence bb. 5/6 Three letters picked without replacement from sksesxkescfsfc. Give prob of sequence cse. 5/546 Calculate prob of sequence lhl when three letters picked without replacement from phlxpl. 1/60 Calculate prob of sequence jhhm when four letters picked without replacement from ujajhuhheuuumj. 3/4004 Four letters picked without replacement from dgdmmammdmadddrmmg. What is prob of sequence rddd? 1/612 Four letters picked without replacement from hxhdhcdtdghctd. Give prob of sequence ddxh. 2/1001 Four letters picked without replacement from {b: 4, f: 10}. What is prob of sequence bbff? 45/1001 What is prob of sequence iiii when four letters picked without replacement from iiifiifiif? 1/6 Two letters picked without replacement from lwlllvlddddddldl. Give prob of sequence lw. 7/240 Three letters picked without replacement from {i: 7, d: 9}. Give prob of sequence iid. 9/80 What is prob of sequence kv when two letters picked without replacement from {k: 2, v: 3, s: 3}? 3/28 Three letters picked without replacement from {m: 3, x: 13, o: 2}. Give prob of sequence mxx. 13/136 Calculate prob of sequence uu when two letters picked without replacement from bbbcuub. 1/21 Two letters picked without replacement from {c: 4, z: 2, n: 1}. What is prob of sequence nz? 1/21 Four letters picked without replacement from ijjjijjjiiiiiki. What is prob of sequence kijj? 2/273 Three letters picked without replacement from pheep. Give prob of sequence hep. 1/15 Four letters picked without replacement from laggllggaalllapggala. Give prob of sequence aapg. 1/646 Calculate prob of sequence sss when three letters picked without replacement from {m: 7, s: 3}. 1/120 Three letters picked without replacement from {e: 2, q: 3}. What is prob of sequence qeq? 1/5 Four letters picked without replacement from auuuuuaauu. What is prob of sequence auau? 1/20 What is prob of sequence py when two letters picked without replacement from ppppyppypppppypppypy? 15/76 Calculate prob of sequence aa when two letters picked without replacement from aaavvaaaa. 7/12 Four letters picked without replacement from uuhhwrhhowu. Give prob of sequence whoh. 1/330 Three letters picked without replacement from {o: 3, f: 2, v: 7, g: 3, t: 3}. What is prob of sequence oog? 1/272 What is prob of sequence tqq when three letters picked without replacement from ttqttqtttqqtqttttttt? 5/114 Calculate prob of sequence utxt when four letters picked without replacement from {k: 2, x: 1, u: 2, g: 1, t: 8, f: 3}. 1/510 Four letters picked without replacement from {f: 3, k: 5}. What is prob of sequence ffkk? 1/14 Calculate prob of sequence ummm when four letters picked without replacement from {u: 2, m: 5, b: 4}. 1/66 Three letters picked without replacement from tutetpttlqt. Give prob of sequence uet. 1/165 Two letters picked without replacement from uwqpuwdupwu. Give prob of sequence pu. 4/55 Three letters picked without replacement from {o: 2, h: 8, l: 2, b: 4}. What is prob of sequence lhl? 1/210 What is prob of sequence vmmx when four letters picked without replacement from mmvvmmmmmxvvxvv? 1/65 Four letters picked without replacement from {b: 2, e: 1, j: 4, u: 1, k: 1}. What is prob of sequence jjeu? 1/252 Calculate prob of sequence vdo when three letters picked without replacement from {v: 2, o: 1, m: 1, k: 1, d: 2}. 2/105 Four letters picked without replacement from {f: 4, o: 3, z: 10, u: 3}. What is prob of sequence fzof? 1/323 Calculate prob of sequence llv when three letters picked without replacement from lrrlrrlllzrlrllrzvll. 1/76 Calculate prob of sequence qffx when four letters picked without replacement from xfffqqqfxfffq. 14/715 Calculate prob of sequence mmdd when four letters picked without replacement from mqqddm. 1/90 Three letters picked without replacement from ogggogooogggg. Give prob of sequence ooo. 5/143 What is prob of sequence szfh when four letters picked without replacement from {z: 4, h: 1, v: 3, f: 1, s: 2, g: 1}? 1/1485 What is prob of sequence ppp when three letters picked without replacement from pppp? 1 Two letters picked without replacement from zgthht. Give prob of sequence gh. 1/15 Calculate prob of sequen	{ "pile_set_name": "DM Mathematics" }
the greatest common factor of 16 and m. 8 Suppose 0i = -i + 187. Let c be (18/6)/((-1)/(17/(-3))). Calculate the highest common factor of c and i. 17 Suppose 0t + t = -9. Let u = 11 + t. Suppose -us + 2 = -2. What is the highest common factor of 3 and s? 1 Suppose 3k - k - 168 = 0. Let z = k + -39. What is the greatest common divisor of z and 5? 5 Suppose 2o + 80 = 7o. Suppose -5p - 1 = -26. Suppose pm = -u + 22, -u - 8 = -5m + 10. Calculate the highest common factor of m and o. 4 Suppose -20i + 408 = -3i. Calculate the greatest common factor of i and 168. 24 Let s(u) = -u - 4. Let n be s(7). Let d be (n/(-2))/((-5)/(-70)). Suppose 13h = 12h + d. What is the highest common factor of h and 7? 7 Let p(y) = -3y - 11. Let j be p(-13). Calculate the highest common divisor of 266 and j. 14 Let b be (14 - 12)/(0 - -1). Suppose 0t - 12 = -bl + t, l - 3 = -t. Suppose 384 = -o + lo. Calculate the greatest common factor of o and 12. 12 Let j(f) = 2f - 10. Let w be j(7). Suppose wc - 51 = 89. Calculate the greatest common factor of c and 385. 35 Let h be (-975)/(-12) + (-2)/8. Let k be -16 + (-4)/(-16)0. Let q = k + h. What is the greatest common factor of 26 and q? 13 Let x = -723 + 1018. Suppose x + 2015 = 10k. Calculate the highest common divisor of k and 21. 21 Let w = 6 + 7. Let t = 11 - -22. Let j = -7 + t. What is the highest common factor of j and w? 13 Let v(z) = z + 3. Let m be v(0). Suppose 2d - 2x - 3x - 15 = 0, 5d - 4x = 63. Calculate the highest common factor of d and m. 3 Let s be -21(-139)/(-2). Let g = s + 267. What is the greatest common factor of g and 16? 16 Suppose 26l = -16 + 68. Calculate the greatest common divisor of l and 57. 1 Let y = 25 - 73. Let u = 2 - y. Calculate the greatest common divisor of u and 20. 10 Let n be 1206/(-54) - (-1)/3. Let x = n + 31. Calculate the highest common divisor of 27 and x. 9 Suppose -268 - 842 = -74p. What is the highest common divisor of 15 and p? 15 Let c(w) = -12w + 330. Let u be c(20). Calculate the highest common divisor of 5 and u. 5 Suppose 17v - 1125 = -8v. Calculate the greatest common divisor of v and 36. 9 Suppose -9b = 298 - 964. Calculate the highest common factor of b and 259. 37 Let d = -10 - -12. Let g = 24 - d. Calculate the highest common divisor of 110 and g. 22 Let f(d) be the second derivative of -d5/20 - d4/3 + d*3/2 + 4d*2 + 6d. Let b be f(-5). Calculate the greatest common divisor of b and 6. 6 Suppose -5 - 12 = -r + 4q, -r - q = -22. Suppose r = 3s + 3. What is the highest common divisor of s and 33? 3 Suppose -7q + 14q = 161. What is the greatest common divisor of q and 368? 23 Let a = 219 - 95. Calculate the greatest common factor of a and 434. 62 Let t be (-3)/7 - (-62)/14. Suppose -4h + tr = 60, 29 = -4h + 5r - 27. Let l = 32 + h. What is the greatest common divisor of 143 and l? 13 Let h(r) = r*3 - 6r*2 + 5r + 4. Let n be h(5). Suppose -nj = -88 - 8. Let q be (6/30-2)/(2/(-300)). Calculate the highest common divisor of q and j. 12 Let o(a) = a*2 - 4 + 4a*2 + 3 - 5a. Suppose -10n + 12 = -12n. Let g be o(n). Calculate the highest common factor of g and 19. 19 Let y(z) = -z*3 - 8z*2 - 2z + 56. Let q be y(-11). Calculate the greatest common factor of q and 84. 21 Suppose 0 = 23z - 22z - 35. Suppose 4r = -20, -2r - 1 - 4 = v. Calculate the highest common divisor of v and z. 5 Let d be -10 - -17 - (5 - 15). Let v(p) = -18p - 5. Let s be v(-5). Calculate the greatest common divisor of d and s. 17 Let t = -160 - -198. Calculate the highest common divisor of 722 and t. 38 Let b = -2663 - -2723. Let n(k) = 7k - 4. Let y be n(4). What is the greatest common divisor of y and b? 12 Let p = 42 - -14. Let a(v) = v*3 + 3v*2 - v + 4. Let k be a(-3). Calculate the greatest common divisor of k and p. 7 Suppose 4m = 0, -3j = -5j + 4m + 10. Suppose 16 = -4d, -jw + 3 = -3d + 6d. What is the greatest common factor of w and 6? 3 Suppose -2j - 5j = j - 3696. Suppose -2w - 4i + 92 = 0, 5w - 2w + 3i = 132. Calculate the highest common divisor of w and j. 42 Let f be (-7 - 15)((-465)/10 + 3). What is the highest common factor of 33 and f? 33 Suppose -3g = -0g + 6. Let f be (-1)/g2 + 3. Let l be 1 - ((-212)/f + -2). What is the greatest common factor of l and 7? 7 Suppose -47 = 3g + 3a - 8a, -3a + 33 = -2g. Let v be (g/10)/((-14)/175). Let s = 86 - v. Calculate the greatest common factor of 8 and s. 8 Let h = -869 - -1694. What is the greatest common factor of 75 and h? 75 Suppose 61 = 5c - 2z - 495, 2c - 5z = 214. What is the highest common factor of c and 280? 56 Suppose 5v = 15v. Suppose -4a + 1 + 9 = -d, v = a - 4. What is the highest common divisor of 6 and d? 6 Suppose 6q = q, -95 = -5o + 3q. Suppose d = 2d - 152. What is the greatest common divisor of o and d? 19 Let h be 2/(4/(-46))-1. Let p be 4/(-272)-8 - 2342/(-34). What is the highest common divisor of h and p? 23 Let i be 1 - (1 + (-3)/1). Let z(l) = -l + 13. Suppose -6n - 20 = -2n. Let k be z(n). Calculate the highest common divisor of k and i. 3 Let k(q) = -21q - 2. Let b be k(-5). Let v = b + -17. Suppose 0 = -2t - 3d + 70, -d - v = 5t - 235. What is the greatest common factor of 58 and t? 29 Let z = 4 + 7. Let m = z + -5. Suppose 0 = -2q + 14q - 144. Calculate the highest common factor of m and q. 6 Suppose -3o = 30 + 12. Let p be (-7)/((-1)/1) - (-18 - o). What is the highest common divisor of p and 55? 11 Let o(p) = 2p + 10. Let g be o(10). Suppose g = 4t - 70. What is the greatest common factor of t and 10? 5 Let p(b) = -8b3 + b2 - 2b - 2. Let o be p(-2). Suppose 4i - 55 = 61. Suppose -il - 98 = -36l. Calculate the greatest common divisor of l and o. 14 Let l(s) = s*3 + 9s*2 - 10s + 7. Let q be l(-10). Let t be -1 - (-6)/(6/q). What is the highest common factor of t and 6? 6 Let h(n) = -10n. Let q be h(-1). Let y(f) = 8f - 74. Let t be y(23). Calculate the highest common factor of t and q. 10 Suppose -3080 = -5b + 405. Calculate the greatest common factor of b and 17. 17 Suppose 24 = -4t + 4d, 3t - d = d - 18. Let h be (7 - 3)(-9)/t. Suppose -w - 20 = -hw. Calculate the greatest common divisor of 10 and w. 2 Let a be (-18 + 0)(1 + -2). Let w = 1127 + -1100. Calculate the greatest common divisor of w and a. 9 Let m = 586 + -526. Calculate the greatest common divisor of 45 and m. 15 Let n be -24(-6)/(-16)2. Let k be ((-31)/(-31) + (-424)/3)-6. Let q be k/4 - (-9)/n. Calculate the greatest common factor of q and 30. 30 Let g = -154 - -264. Calculate the greatest common factor of g and 55. 55 Let x be 1 + -2 + 424/4. Suppose -3b = 2g + 209, 0 = -5g + b - 314 - 217. Let p = -64 - g. What is the greatest common factor of p and x? 21 Let j(q) = -q3 - 2q*2 + 11q - 3. Let t be j(-7). Let o = t - 87. Calculate the greatest common factor of 26 and o. 26 Let z = -77 - -493. Calculate the highest common divisor of z and 26. 26 Let d be (108 + 37)44/10. What is the greatest common divisor of 22 and d? 22 Let m be (-327)/(-12) + (-2)/8. Let s = m + 6. Suppose -228 = -27r + 69. Calculate the greatest common divisor of s and r. 11 Let u be ((-648)/126)/(2/(-14)). Calculate the greatest common divisor of u and 450. 18 Let b be (0 - (-24)/18)108. Suppose -3s + 264 + b = 0. What is the greatest common divisor of 17 and s? 17 Let a(n) = n*2 + 11n + 11. Let v be a(-14). Let x = v - 37. Calculate the highest common divisor of x and 112. 16 Let o(n) = 31n - 10. Suppose x + 4d - 2 = 5, 11 = -2x - 3d. Let a = x + 20. Let k be o(a). Calculate the highest common divisor of k and 23. 23 Suppose 19t + 440 = 23t. What is the highest common factor of 275 and t? 55 Let a(x) be the first derivative of x*4/4 + 14x3/3 - x2/2 + x + 3. Let n be a(-14). Calculate the greatest common factor of n and 105. 15 Suppose 2j + 6y = 20 + 32, 5y = 10. What is the greatest common factor of 75 and j? 5 Let y(o) = -o2 + 7o - 4. Let q be y(5). Let p = q + -1. Suppose -a - 48 = -pn - 5a, 0 = 3n + 5a - 34. What is the greatest common factor of 40 and n? 8 Suppose 5p = -4b + 311, 3p - 2b = 126 + 65. Let c be 4/(-6) - (-69)/9. What is the greatest common factor of p and c? 7 Suppose -151 = -	{ "pile_set_name": "DM Mathematics" }
539 What is the c'th term of 96, -160, -834, -1926, -3436, -5364, -7710? -209c2 + 371c - 66 What is the f'th term of -32510745, -32510772, -32510799? -27f - 32510718 What is the h'th term of 880, 1515, 1922, 2095, 2028, 1715, 1150, 327? -h3 - 108h*2 + 966h + 23 What is the x'th term of -1084, -1089, -1050, -943, -744, -429, 26, 645? 4x3 - 2x*2 - 27x - 1059 What is the p'th term of -1125196, -1125178, -1125170, -1125178, -1125208, -1125266? -p3 + p2 + 22p - 1125218 What is the p'th term of -14703, -12563, -6749, 4575, 23245? 306p3 + p2 - 5p - 15005 What is the p'th term of -562125, -562126, -562125, -562122, -562117, -562110, -562101? p2 - 4p - 562122 What is the i'th term of -59868, -123923, -187978, -252033, -316088, -380143? -64055i + 4187 What is the q'th term of 29737, 59353, 88973, 118597, 148225? 2q*2 + 29610q + 125 What is the w'th term of -34221, -70294, -106367, -142440, -178513? -36073w + 1852 What is the x'th term of -12154177, -12154178, -12154179, -12154180, -12154181? -x - 12154176 What is the h'th term of 6731540, 13463086, 20194634, 26926184, 33657736? h2 + 6731543h - 4 What is the w'th term of 5042241, 10084465, 15126663, 20168823, 25210933, 30252981? -2w3 - w2 + 5042241w + 3 What is the m'th term of 3363202, 3363195, 3363188? -7m + 3363209 What is the r'th term of -1855336, -3710662, -5565988, -7421314, -9276640? -1855326r - 10 What is the g'th term of 18569, 18577, 18601, 18641, 18697, 18769, 18857? 8g2 - 16g + 18577 What is the m'th term of 93238, 743403, 2508140, 5944735, 11610474, 20062643, 31858528? 92881m3 - 2m + 359 What is the f'th term of 539, 1678, 3421, 5768, 8719? 302f2 + 233f + 4 What is the a'th term of 1174, 3902, 8176, 13996, 21362, 30274? 773a2 + 409a - 8 What is the a'th term of -131, -474, -953, -1562, -2295, -3146? a*3 - 74a*2 - 128a + 70 What is the t'th term of 1029860, 2059675, 3089490, 4119305, 5149120, 6178935? 1029815t + 45 What is the o'th term of -19, -13, -17, -31, -55? -5o*2 + 21o - 35 What is the s'th term of 165144, 660593, 1486344, 2642397? 165151s2 - 4s - 3 What is the n'th term of 81182, 81184, 81196, 81224, 81274? n3 - n2 - 2n + 81184 What is the l'th term of -16930, -135599, -457618, -1084663, -2118410, -3660535, -5812714, -8676623? -16946l3 + l2 - 50l + 65 What is the c'th term of 108038, 216087, 324150, 432227, 540318, 648423? 7c*2 + 108028c + 3 What is the f'th term of -24671, -24699, -24749, -24821, -24915? -11f2 + 5f - 24665 What is the f'th term of 1161, 227, -715, -1659, -2599, -3529? f*3 - 10f*2 - 911f + 2081 What is the u'th term of -2133636, -4267320, -6401004? -2133684u + 48 What is the q'th term of 23244, 46498, 69714, 92886, 116008, 139074, 162078? -q3 - 13q*2 + 23300q - 42 What is the x'th term of 355, -387, -1165, -1997, -2901, -3895, -4997, -6225? -3x3 - 721x + 1079 What is the f'th term of 452, 3114, 9972, 23006, 44196, 75522? 330f3 + 118f*2 - 2f + 6 What is the z'th term of -5126578, -5126603, -5126642, -5126695, -5126762, -5126843, -5126938? -7z2 - 4z - 5126567 What is the i'th term of -12159, -11801, -11443? 358i - 12517 What is the q'th term of -95794, -95802, -95822, -95860, -95922, -96014? -q3 - q - 95792 What is the f'th term of -1045, -1033, -1019, -1003? f2 + 9f - 1055 What is the t'th term of -69430260, -138860523, -208290784, -277721043, -347151300? t*2 - 69430266t + 5 What is the r'th term of 349, -280, -1369, -2906, -4879, -7276, -10085? 2r3 - 242r*2 + 83r + 506 What is the o'th term of -15801, -60845, -135919, -241023, -376157? -15015o2 + o - 787 What is the j'th term of -3615098, -3615092, -3615086, -3615080? 6j - 3615104 What is the i'th term of 11788255, 23576511, 35364767, 47153023? 11788256i - 1 What is the v'th term of -89510, -357765, -804784, -1430567, -2235114? -89382v*2 - 109v - 19 What is the y'th term of -1827, -4258, -6683, -9102? 3y2 - 2440y + 610 What is the n'th term of 228596, 457175, 685752, 914327? -n*2 + 228582n + 15 What is the l'th term of -1092, -2273, -3660, -5355, -7460, -10077, -13308, -17255? -17l3 - l2 - 1059l - 15 What is the y'th term of 88177668, 176355332, 264532996? 88177664y + 4 What is the i'th term of -701, -1075, -1429, -1763, -2077? 10i*2 - 404i - 307 What is the j'th term of 1694, 1651, 1620, 1601? 6j2 - 61j + 1749 What is the r'th term of -1932049, -3864131, -5796213, -7728295, -9660377? -1932082r + 33 What is the n'th term of 1472, 3183, 5034, 7025, 9156, 11427, 13838? 70n*2 + 1501n - 99 What is the h'th term of 47132, 47196, 47290, 47420, 47592? h*3 + 9h*2 + 30h + 47092 What is the k'th term of 25336, 53026, 83064, 115450, 150184, 187266, 226696? 1174k2 + 24168k - 6 What is the u'th term of 9330939, 18661888, 27992843, 37323804? 3u2 + 9330940u - 4 What is the i'th term of 19696, 36189, 52682, 69175, 85668, 102161? 16493i + 3203 What is the z'th term of -10283, -21364, -33239, -45908, -59371? -397z*2 - 9890z + 4 What is the g'th term of 4504865, 4504888, 4504913, 4504940, 4504969? g*2 + 20g + 4504844 What is the u'th term of -19583, -39176, -58837, -78572, -98387? -u*3 - 28u*2 - 19502u - 52 What is the b'th term of 26635, 52321, 78007, 103693? 25686b + 949 What is the k'th term of 146322, 141917, 137512, 133107? -4405k + 150727 What is the x'th term of -173011, -692063, -1557151, -2768275, -4325435, -6228631? -173018x2 + 2x + 5 What is the k'th term of 6126, 14051, 21964, 29859, 37730, 45571? -k*3 + 7932k - 1805 What is the d'th term of -135693, -271352, -407011? -135659d - 34 What is the t'th term of -102752, -823880, -2781226, -6592898, -12877004? -103018t3 - t2 + t + 266 What is the k'th term of 3226763, 6453522, 9680279, 12907034, 16133787, 19360538, 22587287? -k*2 + 3226762k + 2 What is the x'th term of 5754, 22745, 50970, 90435, 141146? x*3 + 5611x*2 + 151x - 9 What is the l'th term of 3804551, 3804578, 3804653, 3804800, 3805043? 4l3 - l + 3804548 What is the n'th term of -1794452, -3588896, -5383340, -7177784? -1794444n - 8 What is the l'th term of -3011, -4179, -5351, -6533, -7731? -l*3 + 4l*2 - 1173l - 1841 What is the f'th term of 90, 609, 2054, 4911, 9666? 81f3 - 23f*2 + 21f + 11 What is the r'th term of 1206, 2342, 3496, 4668, 5858, 7066? 9r2 + 1109r + 88 What is the l'th term of 3486, 28105, 95026, 225399, 440374, 761101, 1208730, 1804411? 3525l3 + l2 - 59l + 19 What is the m'th term of -475, -775, -707, -85, 1277, 3565? 31m3 - 2m*2 - 511m + 7 What is the u'th term of -129102, -516443, -1162018, -2065833, -3227894, -4648207, -6326778? -u*3 - 129111u*2 - u + 11 What is the a'th term of -2280, -6113, -12526, -21519, -33092? -1290a*2 + 37a - 1027 What is the d'th term of 69899, 69696, 69353, 68864, 68223, 67424? -d*3 - 64d*2 - 4d + 69968 What is the c'th term of 154428, 308801, 463172, 617541, 771908, 926273, 1080636? -c*2 + 154376c + 53 What is the m'th term of 217935, 218018, 218101? 83m + 217852 What is the w'th term of 3634, 3845, 4198, 4693, 5330, 6109, 7030? 71w*2 - 2w + 3565 What is the d'th term of -8542679, -17085359, -25628039? -8542680d + 1 What is the i'th term of -19991, -20066, -20111, -20120, -20087, -20006, -19871, -19676? i3 + 9i*2 - 109i - 19892 What is the z'th term of 18845738, 18845737, 18845736, 18845735, 18845734? -z + 18845739 What is the j'th term of 12526, 21849, 31172, 40495? 9323j + 3203 What is the s'th term of 1118307, 1118411, 1118515, 1118619, 1118723? 104s + 1118203 What is the p'th term of -59506, -59975, -60444, -60913, -61382, -61851? -469p - 59037 What is the r'th term of 1816, -11366, -24560, -37772, -51008, -64274, -77576, -90920? -r3 - 13175r + 14992 What is the w'th term of -20246929, -20246939, -20246949, -20246959, -20246969, -20246979? -10w - 20246919 What is the y'th term of -55823, -55623, -55423, -55223, -55023? 200y - 56023 What is the b'th term of 43337, 173238, 389695, 692702, 1082253, 1558342? -b*3 + 43284b*2 + 56b - 2 What is the g'th term of -1994666, -1994637, -1994550, -1994375, -1994082? 5g3 - g2 - 3g - 1994667 What is the a'th term of 253, 2006, 6699, 15796, 30761, 53058, 84151,	{ "pile_set_name": "DM Mathematics" }
458 - 4454.9952. Let f = 0.0048 - q. Let p = -6 + 5.7. Which is the biggest value? (a) f (b) 2/5 (c) p b Let l = 86 - 83. Suppose 2q - lq = 3q. Let n be -4 + (q - (-48)/20). Which is the fourth biggest value? (a) 1 (b) 0.5 (c) n (d) 0.4 c Let w = -37.65 - -38.05. Which is the third biggest value? (a) -0.89 (b) 0.3 (c) w a Let p = 1.173 - 0.173. What is the third smallest value in 4/3, -0.2, -2, p, -0.5? -0.2 Let h = -9.99961 + -0.00039. What is the biggest value in h, -21, -7? -7 Let w = -9.879 - 0.121. Let q = 3.955 + 0.045. Which is the third biggest value? (a) w (b) q (c) 3 (d) 2/7 d Let y = -3453.33 + 3456.33. Let o = 18 + -13. Which is the third biggest value? (a) 0 (b) o (c) y (d) 0.08 d Let g(u) = u3 - 5u*2 - 6u - 2. Let l be g(6). Let j = -9501 - -9493. Which is the second smallest value? (a) 1/2 (b) j (c) l c Let v = -1037 - -5183/5. Let y = 3.6 + -8.6. Which is the third smallest value? (a) -0.5 (b) y (c) -13 (d) v a Let p = 9123 - 9137.3. What is the third biggest value in -7, p, -1/3? p Let y = 37 - 43. Let o be 5/y - (-7)/(-42). Let m be (-6)/18 + (-11)/3 + -1. Which is the second smallest value? (a) 4/7 (b) m (c) o (d) 2/9 c Let w = 32159/9 - 3573. Which is the fourth smallest value? (a) -2/9 (b) w (c) 11 (d) -2 (e) -1/5 b Let d = 1667 + -1584. Which is the third biggest value? (a) d (b) -0.2 (c) -3 c Let u = -2445.6 - -2446. What is the biggest value in u, 3, 7, -6, -1/3? 7 Let o = -800 - -699. Let l be 682/930 - 1/31. What is the third biggest value in l, 1/9, o? o Let n = 2 - 4. Let y = 8.9107 + 0.0093. Let c = y + -8.52. What is the second smallest value in -3, n, c, 9? n Let n = 18 + -21. Let h = 0.15 - -41.85. Let o = h - 40. Which is the third biggest value? (a) 9/4 (b) n (c) o b Let f = -4374 + 4373.89. Which is the second smallest value? (a) -5 (b) -19 (c) f a Let g = 1782.3 - 1632. Let y = g + -139. Let l = y + -7.3. Which is the biggest value? (a) l (b) -2/9 (c) -1.1 a Let b = 5.975 + -0.975. What is the fourth biggest value in 1, b, 1/8, -4, -1? -1 Let j = -30 - -53. Let k = 13 + j. Let s = 48 - k. Which is the smallest value? (a) 2/5 (b) s (c) 2/9 c Let w = -348 - -344. Let u be 16/10(w/(-2))/8. Which is the smallest value? (a) -36 (b) u (c) -1/5 a Let p = 4181 - 4169. Let y = 41 + -124/3. Which is the third biggest value? (a) y (b) p (c) 5 a Let z = -21959 + 21962. What is the fourth smallest value in z, -1, -2, -2/9, -2/5? -2/9 Let c = 3.252 - 3.652. What is the third smallest value in -2, -6, c, 0.11? c Let x be (-18)/27(-28)/(-14). Which is the third smallest value? (a) -1 (b) x (c) -4 a Let g = -5576 - -16727/3. What is the smallest value in -2/5, -0.025, -1, g, -3? -3 Let b = -4 + 4.5. Let a = b - 0.7. Let q = -18620 + 18619.7. What is the second smallest value in 0.5, -0.07, q, a? a Let l(g) = -13g - 44g + 12 - 40 + 15g. Let z be l(6). Let h be (-3)/(-4) + 2/(z/133). What is the biggest value in h, -0.1, 3? 3 Let v be (24/1040)/(74/(-648)). Let g = -1/481 - v. Which is the smallest value? (a) -12/13 (b) g (c) -1 c Let h = 0.4 - 0.3. Let l be (21 + -21)(2 + (-3)/2). Let y be 22/121 - (l + 0). What is the second biggest value in y, 1/4, h, -0.5? y Let n be (-3)/(-21) - 36660/(-140). Let f = 264 - n. Which is the second smallest value? (a) f (b) -0.3 (c) 0 (d) -0.2 d Let j be -4 + (-14)/(364/(-39)). Let p = 62 + -681/11. Which is the fourth smallest value? (a) j (b) 2 (c) -0.1 (d) p b Let r = 18991.9 - 18770. What is the smallest value in 0.3, 1/4, r? 1/4 Let k = -0.084 + -2.536. Let v = k - -2.22. What is the third biggest value in -3/8, 0, v? v Let i = -8.04 - -3.04. What is the third biggest value in 2, -2/7, 2/5, i, 4? 2/5 Let z = 171.5 + -192. Let y = z + 20.7. What is the second smallest value in -14, 1/6, y? 1/6 Suppose -2x = 4o - 6 + 2, -5o + 20 = -5x. Suppose on = 2h + 12, 2h + 0n + 27 = -3n. Let w = -6 - -9. What is the third smallest value in h, 0.1, w? w Suppose 0 = 2v - 2p + 6756, 3v + p = -12370 + 2256. What is the second biggest value in -0.1, -1/9, v? -1/9 Suppose -3q - 5o - 7 + 32 = 0, 4q + 4o - 28 = 0. What is the second biggest value in 0.04, -2, q, 25? q Let k be (2/27)/(1/3). Let t = -3.54 + 26.49. Let p = -22.9 + t. What is the second biggest value in k, p, 2/5? k Let i = 0.196 - 0.16. Let q = -738.926 + 738.7. Let v = q + i. Which is the biggest value? (a) 0 (b) -0.1 (c) v a Let j = -12 - -7. Let p = 108.931 - 109. Let n = p + -0.331. Which is the third smallest value? (a) 0.2 (b) j (c) -0.2 (d) n c Let w be -12 + -1 + (4 - 2). Let o = 129/2 - 1681/26. Let i = 22109 - 22105. Which is the fourth smallest value? (a) w (b) i (c) o (d) -0.5 b Let h = 1978 + -1977.8. What is the second biggest value in -0.0611, 5, h, -5? h Suppose -5c + 8 = 5x - 72, -72 = -4c - 2x. Suppose -138 = ci - 38. What is the third biggest value in 0.2, i, 1? i Let w = 3290.9 - 3290. Which is the smallest value? (a) w (b) 1 (c) 18 a Let h = -3 - -1. Let z = 0.05 - -0.95. Let y = -176416 - -176415.95. What is the smallest value in z, y, -0.3, h? h Let g = 0.27166 - 926.27166. Which is the smallest value? (a) -2 (b) g (c) -5 b Let h = -12.497 + 12.757. What is the biggest value in -12, h, 0.05? h Let q be ((-9)/(-30))/(2/4). Let g = -11/302 + 12739/1510. Which is the second biggest value? (a) g (b) -2 (c) q c Let j = -182 - -181.974. Let w = j + 0.076. What is the third smallest value in w, -0.3, 2? 2 Let s = 7.943 - 8.543. What is the third smallest value in -0.2, 0.5, s, -2, 124? -0.2 Let h(a) = a*2 - 17a - 42. Let f be h(19). Let u = f + 6. Suppose -ux = 4x + 6. What is the second smallest value in 2, x, -13? x Let k = -0.1509 + -384.8491. What is the biggest value in k, 1, 0.03? 1 Let o = -0.36 - -0.06. Let d be (3 - (-49)/(-15))/(48/760). Let y = -16/3 - d. Which is the biggest value? (a) o (b) 4 (c) y b Let d = -388.89 - -391. Let q = d + -1.71. What is the smallest value in 8, 5, q? q Let n = 853 + -857. Let d be 3/n(-61)/366. What is the third biggest value in 0.4, 5, d, 1.1? 0.4 Let f = -445 + 999. Let n = -553.8 + f. What is the third smallest value in 0, n, 4, -0.6? n Suppose 148 = -j - 3. Let f = -91 - j. Suppose -10 = -10h - f. What is the smallest value in -0.9, h, 5? h Let l = -76.5 + -315.5. Let z = -380 - l. Which is the smallest value? (a) z (b) -0.1 (c) 1/4 b Let v = 0.0909 + -0.0909. Let x be (2/(-195)-5)/((-1)/3). Which is the smallest value? (a) -2 (b) x (c) v a Let w be (-4)/(-7) + (-196)/343 - 13. Which is the third biggest value? (a) 0.1 (b) w (c) -0.5 (d) 2/3 c Let i = -27347 + 27346.8. Which is the second smallest value? (a) 1/51 (b) i (c) 0.2 a Let f be (-34)/40 - (-3)/12. Suppose -4 = -10t - 44. Which is the smallest value? (a) 1 (b) f (c) t c Let h = 0 - -0.4. Let q(c) = 15c + 27c*3 - 26c*3 - 18c*2 + 32 - 4. Let o be q(17). What is the biggest value in h, o, 5, 0.3? 5 Let h(k) = 2k*2 - 4k - 7. Let n be h(4). Suppose -nl + 25 = -4l. Let g = 0.221 - 0.421. What is the third biggest value in 4, l, g? g Let i(w) = w*3 - 39w*2 + 52w - 110. Let r be i(37). Let q be (-9)/(-6)112/r. Which is the biggest value? (a) -0.5 (b) -4 (c) q (d) 0.3 d Let h be 12/(-63)(-60)/(-40). Suppose 2r = 4r + 2. What is the smallest value in r, 3, h, -2/5? r Let w be (1 + 1)/((-1965)/285 - -7). Which is the second biggest value? (a) 9/8 (b) w (c) 0.5 a Suppose 3390k - 3366k = 24. What is the fourth biggest value in k, -0.4, -1, 142/5? -1 Suppose -5p + 8 + 7 = 0. Let o = 2286 + -2291. What is the fourth smallest value in -12, p, -3, o? p Let z = -72/187 + 274/1683. Suppose -34 = -5q + p, q = 6q + p - 26. Which is the second smallest value? (a) q (b) -1/5 (c) z b Let f = 9422/15 - 628. Let c = 0.16 - -0.94. Let v = c + -0.7. What is the fourth biggest value in -4, v, 2/19, f? -4 Let i = -30344 + 30348. What is the second biggest value in i, 0.3, -2/147, -1/7? 0.3 Let n = 503362/3 - 167786. Let y(v) = 18v. Let u be y(5). Which is the biggest value? (a) u (b) -0.4 (c) n a Suppose -3v + 52 = k, -k + v = -3v - 17. Let s = k + -39. Let l = 4 - 2. Which is the third biggest value? (a) l (b) s (c) 1/7 b Let z = -2.6 - -1.6. Let h = 2	{ "pile_set_name": "DM Mathematics" }
t is the third derivative of 109558149m3 + 2m*2 + 35791164 wrt m? 657348894 What is the first derivative of -1276016121n*3p*4 - 222022807n*3 wrt p? -5104064484n*3p*3 Find the first derivative of 210005aj2 - 156a - 715j2 - 235483 wrt a. 210005j*2 - 156 Differentiate 3279b*3r - 21291b3 - 3b*2 + 3b + 578r3 - 3 with respect to r. 3279b*3 + 1734r*2 What is the second derivative of -2319181km5 + 24km2 + 294987km + 25m wrt m? -46383620km*3 + 48k What is the first derivative of -2v3 + 14420v*2 - 836v - 18759675 wrt v? -6v2 + 28840v - 836 What is the derivative of -2p2y + 10p2 + 3136py - 4p + 351y + 100806 wrt y? -2p*2 + 3136p + 351 Find the first derivative of 7898vz*2 - 310vz + 1160320866v wrt z. 15796vz - 310v What is the second derivative of -112430723m*4 + 142731550m? -1349168676m2 Find the second derivative of -28938498v*3 + 34447160v wrt v. -173630988v Find the second derivative of 283i*2j*2 + 27i*2j + i*2 + 6ij + 35728i - 328874j3 wrt j. 566i*2 - 1973244j Find the third derivative of 220691515u4 - 11u*2 + 1430355 wrt u. 5296596360u What is the second derivative of 764720d4 - 106d*3 + 343003664d? 9176640d2 - 636d What is the second derivative of -10717911i5x*3 - 2ix3 + 6162i + 2x3 + 84 wrt i? -214358220i*3x*3 What is the second derivative of 2i*3 + 21802165i*2 - 177455917i wrt i? 12i + 43604330 What is the second derivative of 24a*4 - 1068383a*3 - 152908a + 637 wrt a? 288a2 - 6410298a Differentiate 1316545035v2 - 691947735 with respect to v. 2633090070v What is the second derivative of -44c3 + 29169c*2t - 8400052ct wrt c? -264c + 58338t Find the third derivative of -33b4k - 122b4 - 65b*3k - 5799b2k - 827bk wrt b. -792bk - 2928b - 390k What is the second derivative of -15070528h2w + 1435hw + 91h + 7 wrt h? -30141056w Find the second derivative of -2an*2r*2 - 3an2r - 3an - 784323ar2 + n2r2 - 2n*2r + 27932n2 - 2nr wrt r. -4an2 - 1568646a + 2n2 What is the second derivative of 2g*4 + 776g*3 - 15g*2 - 5468339g wrt g? 24g2 + 4656g - 30 What is the third derivative of 3n4 + 2776878n*3 - 10318479n*2? 72n + 16661268 What is the second derivative of -1480c2v*2w + c*2vw2 + 8c*2vw + 329c*2w - 60429cv*2w*2 + 2cvw*2 + 556vw + 3w*2 wrt v? -2960c*2w - 120858cw*2 What is the second derivative of -27557m*4 + 3m3 + m2 + 154m - 4586 wrt m? -330684m*2 + 18m + 2 Differentiate 73262352i3 - 45911803. 219787056i*2 What is the second derivative of 2000uv2 - 10uv + 6u + 14751v2 + 4209v - 5 wrt v? 4000u + 29502 What is the second derivative of -2431s*3y + 259s3 - 2s*2 - 21s - 170934y wrt s? -14586sy + 1554s - 4 Differentiate 3dow2 - 3do - 2dw + 37d - 71574ow*2 + 77o + 1125 wrt w. 6dow - 2d - 143148ow Find the third derivative of 265722946d4 - 298122094d*2 wrt d. 6377350704d Differentiate 1321009j3z + 21326227j3 - 4j*2z wrt z. 1321009j3 - 4j*2 What is the second derivative of 1035514aq2 + 3aq - 10a - 17q3 - 41256 wrt q? 2071028a - 102q Find the second derivative of 142096318m*2 - 48152897m - 5. 284192636 Differentiate km3 - 158618194km2 + 169m*3 + 22363m + 2 wrt k. m*3 - 158618194m*2 What is the third derivative of -2111663h*5 - 10h*4 + 9h*2 + 1754h + 26? -126699780h2 - 240h What is the first derivative of 3774053w - 12833681? 3774053 Find the third derivative of -15808x*6 - 2x*4 - 113x*3 - 46748156x*2 wrt x. -1896960x*3 - 48x - 678 Find the third derivative of 32381223v3 + 120410574v*2 wrt v. 194287338 Differentiate -4k*3o*3 + 4057320k*3o*2z - 6k3 - 44529k*2o - 42o3z with respect to z. 4057320k3o*2 - 42o*3 What is the second derivative of -3g*4 - 572629g*3 - 2g + 5444574? -36g2 - 3435774g Find the first derivative of -308b3 + b2 + 5019b - 5247374 wrt b. -924b2 + 2b + 5019 Find the second derivative of 125087242f3 - 577886252f wrt f. 750523452f What is the third derivative of -540p*5 + 10p*4 - 118p*3 + 2p*2 + 1483p - 957? -32400p2 + 240p - 708 Find the third derivative of 62868122bu*3 - 184bu2 + 67bu + 32b + 2u wrt u. 377208732b What is the third derivative of 4828f2m*6 - 3f*2m2 + f2 + 709m6 + m + 577829 wrt m? 579360f*2m*3 + 85080m*3 Differentiate 2855g*2 + 627g - 38490550. 5710g + 627 What is the third derivative of 60214i*3k*3z - 26i3kz2 + 1427i*3z*2 - 27i*2k*2z + 59ik*3z*2 + ik*2z*2 - ik*2 wrt k? 361284i*3z + 354iz*2 Find the second derivative of -8427318c*3 - 13c*2 - 273202916c wrt c. -50563908c - 26 Find the first derivative of -124090415w*3 - 301302893 wrt w. -372271245w*2 What is the derivative of 40340077dl2s*2 - 44794l*2s + l*2 + 35ls2 wrt d? 40340077l*2s*2 What is the second derivative of -47601iw4 + 64iw2 + 73iw - 2w*3 - 77743 wrt w? -571212iw2 + 128i - 12w Find the third derivative of 14493g*3h*3 - 29g*3h + 4g3 - 169g*2h3 + h2 - 30h - 325 wrt g. 86958h*3 - 174h + 24 Find the second derivative of -86090666k3 + 86245133k. -516543996k Find the second derivative of -23j*5y - 52748j3y*2 - 6jy2 + 1195j + 36 wrt j. -460j3y - 316488jy*2 What is the derivative of 57786049t*2 + 6824861? 115572098t What is the second derivative of -8024nv*3 - 2206nv - 1980n - 550v3 wrt v? -48144nv - 3300v Find the third derivative of 700761771r3 + 669784182r*2 wrt r. 4204570626 Find the third derivative of 1268g*2i*2n3 + g2in*2 + 391g*2n3 + g2n2 - 1256gi2n*2 + 24gn2 wrt n. 7608g*2i*2 + 2346g*2 What is the second derivative of -95938q*2x*2 - 23q*2x - 101092q2 - 368x*3 - x wrt x? -191876q*2 - 2208x What is the third derivative of -46047338k4 - 3k*2 + 1338304k + 3? -1105136112k Find the third derivative of 345294419g4 - g2 + 54g + 1062323. 8287066056g What is the first derivative of 11i2m - 9i2 + 86729im - i - 6193870m - 38 wrt i? 22im - 18i + 86729m - 1 Find the first derivative of -15952166b2 + 40633122. -31904332b What is the derivative of 580900t2 + 8483334 wrt t? 1161800t What is the first derivative of -7343011k + 9375651 wrt k? -7343011 What is the derivative of -3918939h*3m - 34h3 - 250747h wrt m? -3918939h3 What is the derivative of -127762022q*3 - 128314237 wrt q? -383286066q*2 Find the third derivative of -1580877m*3t*3w + m*3t*2 - 2m*2t*2 - 33mt3 - 1514mt2w - 13mw - 285tw wrt t. -9485262m3w - 198m What is the second derivative of -fi*3 + 6fi2 - 1631003fi + 18f - 1940i3 + 201i*2 wrt i? -6fi + 12f - 11640i + 402 What is the second derivative of 5p*3z + 338715p3 - 16p*2z - 5pz - 185p - 394z - 100 wrt p? 30pz + 2032290p - 32z What is the third derivative of 41699495p3 + 4p*2 + 2p - 203743? 250196970 Differentiate -14iy + 1112046i + 183865y - 906 wrt i. -14y + 1112046 What is the first derivative of 8291093o*3 + 5853808 wrt o? 24873279o*2 Find the first derivative of 471x*4 - 1625x - 2894910 wrt x. 1884x3 - 1625 What is the second derivative of 528294875b*3 + 13392b + 2616? 3169769250b What is the third derivative of 137060702p*3 - 20901840p*2 - 1 wrt p? 822364212 Find the first derivative of -105i*2q*3 - 116i*2 + 11i - 281068q3 - 9 wrt i. -210iq3 - 232i + 11 What is the third derivative of -2424803jw*3 + 2jw2 + jw + 3j + 105w*2 - 1241w wrt w? -14548818j What is the third derivative of 1190n*6 + 1550n5 + n3 - 3757n2 - 13n + 1 wrt n? 142800n3 + 93000n*2 + 6 Differentiate 185405104s*2 - 174470677 with respect to s. 370810208s What is the third derivative of 300526477b3p*3 + 17b*3p*2 - 2633475bp - 4p*2 wrt p? 1803158862b*3 Differentiate -8421422j*2 + 14337306 wrt j. -16842844j Find the first derivative of -193kox3 + 2kx - 218409k + 9412ot*x	{ "pile_set_name": "DM Mathematics" }
ut replacement from yyvyyvyyy. What is prob of sequence yvv? 1/36 Two letters picked without replacement from {a: 3, t: 5}. Give prob of sequence aa. 3/28 What is prob of sequence jjnn when four letters picked without replacement from {n: 2, v: 1, t: 5, j: 8}? 1/390 What is prob of sequence id when two letters picked without replacement from {m: 1, i: 2, f: 3, d: 3, n: 2, j: 1}? 1/22 Three letters picked without replacement from {p: 4, r: 14}. What is prob of sequence rrp? 91/612 Four letters picked without replacement from fffvfvvvfvffv. Give prob of sequence vfvv. 7/143 Calculate prob of sequence usp when three letters picked without replacement from {w: 1, p: 1, u: 2, s: 1, c: 1, t: 1}. 1/105 Four letters picked without replacement from ooooo. Give prob of sequence oooo. 1 Three letters picked without replacement from {i: 3, o: 5, l: 1, f: 1}. What is prob of sequence lff? 0 Three letters picked without replacement from eaofohhxxofx. What is prob of sequence oeo? 1/220 Two letters picked without replacement from hqehw. Give prob of sequence eq. 1/20 Three letters picked without replacement from iiiiiiiii. Give prob of sequence iii. 1 What is prob of sequence jqjq when four letters picked without replacement from {p: 1, q: 4, j: 9}? 36/1001 Calculate prob of sequence jmfm when four letters picked without replacement from mjfmxtm. 1/140 Three letters picked without replacement from ddpppdpdddd. Give prob of sequence ddd. 7/33 Calculate prob of sequence tzzj when four letters picked without replacement from {t: 2, z: 4, j: 5}. 1/66 Three letters picked without replacement from thtthttthth. Give prob of sequence thh. 14/165 Four letters picked without replacement from {z: 1, j: 2, q: 3, c: 1, x: 3, e: 1}. What is prob of sequence ecqq? 1/1320 Calculate prob of sequence oxoz when four letters picked without replacement from {z: 5, j: 11, o: 2, x: 1}. 5/46512 Three letters picked without replacement from lloooololloolonon. What is prob of sequence lnn? 1/340 Calculate prob of sequence gsk when three letters picked without replacement from {z: 1, g: 2, s: 2, k: 9}. 3/182 What is prob of sequence ev when two letters picked without replacement from evdtztyz? 1/56 Two letters picked without replacement from ppppzppppbppjb. Give prob of sequence zb. 1/91 Two letters picked without replacement from {u: 1, e: 12, n: 3, j: 2, d: 1}. Give prob of sequence de. 2/57 What is prob of sequence wjh when three letters picked without replacement from gwghwsssjswgg? 1/572 Four letters picked without replacement from ijjv. What is prob of sequence jijv? 1/12 Calculate prob of sequence ad when two letters picked without replacement from {d: 7, v: 3, c: 4, a: 1, j: 1, k: 4}. 7/380 Two letters picked without replacement from {d: 1, j: 1, y: 2, r: 2, p: 10, f: 3}. Give prob of sequence yf. 1/57 Two letters picked without replacement from {b: 2, n: 1, m: 1}. Give prob of sequence nb. 1/6 Three letters picked without replacement from jjojjjjjo. What is prob of sequence jjo? 1/6 Calculate prob of sequence hn when two letters picked without replacement from hmfnchbcb. 1/36 Two letters picked without replacement from {z: 2, i: 5}. Give prob of sequence ii. 10/21 Calculate prob of sequence zuz when three letters picked without replacement from {u: 1, z: 7}. 1/8 What is prob of sequence yey when three letters picked without replacement from byebyyyj? 1/28 Two letters picked without replacement from rxsqqmqrrsxsxqwrqmrq. Give prob of sequence rs. 3/76 Four letters picked without replacement from {r: 4, b: 3}. What is prob of sequence bbbr? 1/35 Calculate prob of sequence kws when three letters picked without replacement from {s: 1, w: 4, u: 3, g: 4, k: 4}. 1/210 Two letters picked without replacement from brgjzgy. Give prob of sequence jb. 1/42 Calculate prob of sequence ere when three letters picked without replacement from eerrrrereerere. 7/52 Three letters picked without replacement from eeooeoeoeoeaoeoa. Give prob of sequence oea. 7/240 Two letters picked without replacement from nomojjmjmj. What is prob of sequence jj? 2/15 Two letters picked without replacement from {p: 1, z: 1, a: 2, l: 1, i: 2}. What is prob of sequence aa? 1/21 Two letters picked without replacement from {o: 2, s: 1, b: 2, u: 2, y: 1, x: 4}. Give prob of sequence xs. 1/33 Two letters picked without replacement from {d: 1, c: 7}. What is prob of sequence cd? 1/8 Two letters picked without replacement from zzoozzzzzz. Give prob of sequence zo. 8/45 Four letters picked without replacement from {u: 1, o: 2, n: 1, j: 1}. Give prob of sequence ooun. 1/60 Calculate prob of sequence xx when two letters picked without replacement from xxxxxxxxx. 1 What is prob of sequence qq when two letters picked without replacement from {d: 3, t: 5, q: 2}? 1/45 What is prob of sequence hww when three letters picked without replacement from wwwwwhwwhwwww? 5/39 Calculate prob of sequence ee when two letters picked without replacement from ueuuweeueuu. 6/55 Calculate prob of sequence rr when two letters picked without replacement from hrhhhhrhhhhrhr. 6/91 Two letters picked without replacement from {g: 2, r: 7, f: 2, y: 6, v: 1, u: 1}. Give prob of sequence uv. 1/342 Two letters picked without replacement from oom. What is prob of sequence oo? 1/3 Two letters picked without replacement from rqyyqqy. What is prob of sequence rq? 1/14 Three letters picked without replacement from {r: 3, k: 4, m: 1, a: 2}. What is prob of sequence rar? 1/60 What is prob of sequence utq when three letters picked without replacement from tqquvupqtptpvvpppq? 1/204 Four letters picked without replacement from oooooooloooo. What is prob of sequence oolo? 1/12 Three letters picked without replacement from {f: 3, m: 8}. Give prob of sequence fff. 1/165 Three letters picked without replacement from zoz. Give prob of sequence zzo. 1/3 What is prob of sequence pzz when three letters picked without replacement from zuzzuppzzzzb? 7/110 Two letters picked without replacement from ooyycjfjjjjob. What is prob of sequence cf? 1/156 Calculate prob of sequence uii when three letters picked without replacement from {u: 5, i: 11}. 55/336 Three letters picked without replacement from fcfca. Give prob of sequence fca. 1/15 Two letters picked without replacement from bhbehnbbeabbeh. What is prob of sequence ne? 3/182 Three letters picked without replacement from {i: 2, r: 3, b: 4}. Give prob of sequence rbr. 1/21 Four letters picked without replacement from iivi. Give prob of sequence viii. 1/4 Three letters picked without replacement from {h: 1, c: 3}. Give prob of sequence hcc. 1/4 Four letters picked without replacement from ppzdpzzdppzpndpppp. What is prob of sequence zdzn? 1/2040 Two letters picked without replacement from iplxy. What is prob of sequence yi? 1/20 Calculate prob of sequence jwt when three letters picked without replacement from {x: 4, j: 2, w: 6, t: 1}. 1/143 What is prob of sequence mh when two letters picked without replacement from {m: 1, h: 1, d: 1}? 1/6 Calculate prob of sequence fsf when three letters picked without replacement from ssssfsssfo. 7/360 Four letters picked without replacement from ttttbtbymtymtmb. What is prob of sequence mbmb? 1/910 Two letters picked without replacement from gxpgxgpgh. Give prob of sequence px. 1/18 Two letters picked without replacement from {o: 1, p: 2, t: 2}. What is prob of sequence op? 1/10 Calculate prob of sequence zzz when three letters picked without replacement from zzzzjzzzzjz. 28/55 What is prob of sequence tptl when four letters picked without replacement from lrlttprlrmllrlrl? 1/3120 What is prob of sequence mb when two letters picked without replacement from dbbmxxll? 1/28 Four letters picked without replacement from {b: 2, p: 5, q: 2}. Give prob of sequence bbqp. 5/756 What is prob of sequence ite when three letters picked without replacement from {i: 2, l: 4, e: 1, j: 2, t: 5, r: 1}? 1/273 Calculate prob of sequence rz when two letters picked without replacement from zrzzzzzzzzzzz. 1/13 Four letters picked without replacement from oolodrfofloddodl. Give prob of sequence ldrl. 1/1820 Two letters picked without replacement from {s: 7}. Give prob of sequence ss. 1 Calculate prob of sequence	{ "pile_set_name": "DM Mathematics" }
t = -21 - -29. Suppose 3c = 5c - 4. Suppose 0 = ci + 2i - t. Solve -a = 5o - 19, -1 = -io + 3o + 5a for o. 4 Suppose -3q = -0q - 2l - 39, 4l + 48 = 4q. Suppose -38g = -41g + q. Solve -u + g = 4c - 6c, -c = 1 for u. 3 Let q = -375 - -381. Solve -p + 5s = -12, 4p - 5s = 12 + q for p. 2 Let a be (-85)/(-25) - (-2)/(-5). Let y = a - -2. Suppose -4c + 2o + 10 = 0, -yc + 5o + 15 - 5 = 0. Solve 3s + 17 = -2j, -cs + 2s = 5j + 10 for j. -1 Suppose -4 = -5d + 6. Let x(j) = 7 + 0 - 3 + 3j + j2 + 0j*d. Let w be x(-3). Solve -15 = -3g, -f - 1 - w = -g for f. 0 Let s(o) = -o*3 - 9o*2 - 10o. Let k be s(-8). Suppose w + 0y = -3y + 4, y + k = 4w. Solve wf + 8 = 0, 2a + 0f = 5f for a. -5 Let k(v) = -2v - 2. Let i be k(4). Let r(q) = q + 6. Let o be r(i). Let g be (8 + -2)/(-2) - o. Solve 2u - 4w = -2, w + 0w - g = u for u. -1 Suppose 0 = -p + 5p - 8. Solve 3n = -h - 1, ph - 2 = -4n + 4h for n. 0 Let w(u) = -u*3 + 5u + 4. Let b be w(-2). Solve 8 = -4i, 0 = m - bm + 5i + 7 for m. -3 Suppose 0 = s + l + 38, 170 = -3s - 2s + 5l. Let o = -4 - s. Solve 0 = 4d + 5y + o - 12, 0 = 2d + 3y + 12 for d. 0 Let u be 13/4 + (-5)/20. Suppose -6 = -0k - 2k. Let b be (9 - 2)1 - 15/(-5). Solve -ky - 4s - b = -3s, -3s + u = -2y for y. -3 Suppose -134c = -133c - 8. Suppose -5k - 4 - 4 = y, -y + 3k + c = 0. Solve -3h + 5 = -3d + y, 4d - 1 = -h for d. 0 Let j(r) = r - 19. Let u be j(18). Let h = u + 4. Solve -i = hm + 8, -2i + 2m - 13 = 5m for i. -5 Let c = -27 - -31. Suppose cu = -u. Solve 4f + 2s - 8 = u, 0 = -4f + 2s + 2s + 8 for f. 2 Let o = -11 + -1. Let z = o + 9. Let t = z + 16. Solve -3v - 3g = t - 4, g = -4v - 3 for v. 0 Let q(s) = -s - 26. Let r be q(-8). Let k = 23 + r. Solve 0 = 4i - 4l + 2l + 10, -ki = -3l + 10 for i. -5 Let u(l) = -l2 - 6l - 2. Let k be u(-7). Let o be ((-2)/(-4))/(k/(-36)). Let d = -3 - -3. Solve d = y - 6y - 4f - o, -3f - 15 = -3y for y. 2 Let c = 1236 - 1234. Solve 3f - f = -2d + 8, -2d = -cf - 4 for f. 1 Suppose -20 = -5y, -4m = 5y + 10 - 38. Solve 5u = 4u + 3f - 4, mu + 8 = 5f for u. -4 Let o(b) = -5b. Let u(k) = -14k + 1. Let j(w) = 17o(w) - 6u(w). Let g be j(-10). Solve -q = 5y + 9, -2q + 3y + g = 9 for q. -4 Let g(r) = -r2 - 12r + 3. Let b be g(-6). Let i = b - 23. Suppose 2m + 2 - i = 0. Solve 0 = 2u - 5a - 25, 0 = 5u + a - 2 + m for u. 0 Let g(a) = a*2 + 27a - 26. Let m be g(-28). Solve 1 = -5w - y, -3w - 1 + m = y for w. -1 Suppose 4s + 6f - 3f = 17, -4s - f + 19 = 0. Solve 0 = 5l - 2c + sc - 9, l + 15 = 5c for l. 0 Suppose 5n - 1 = 19. Suppose -d + 5 = y, 0d + 3d = ny + 1. Let t(s) = 4s - 2. Let h be t(d). Solve -w - h = -5i, -4i + 6 = -2w - 2 for i. 2 Let h(i) = -i + 5. Let t be h(3). Suppose c - 3v + 20 = -tv, 38 = -2c + v. Let q = c - -38. Solve -3s = 2o + o + 12, 3o + q = 5s for s. 1 Let z(j) = j3 - 6j*2 - 49. Let i be z(7). Suppose -5 + 3 = -q. Solve 0 = -w - 3t - q, 2w + 5t = -i - 3 for w. 1 Suppose 4n - 15 = 1. Let y(b) be the third derivative of -b4/24 - 5b3/6 - b2. Let r be y(-8). Solve -n - 14 = -5j + rk, -k = -2j + 7 for j. 3 Suppose 4v - 4 - 4 = 0. Let h = -305 + 314. Solve -h - 1 = -vt + 4x, 4t + 25 = -x for t. -5 Let j = -6 + -1. Let k = j + 33. Solve 5u - h = 27, -2h + 7 = -3u + k for u. 5 Let q(k) = -k*2 - 3k - 2. Let a be q(-2). Suppose 4l = 17l - 1404. Let z = -103 + l. Solve a = 5i + 4h + h, -2i = -zh - 14 for i. 2 Let p be -11 - (20/2 - 12). Let c(o) = 3o*2 - 1. Let n be c(-1). Solve -2b + b - k = p, n = -4b - 3k for b. 1 Suppose 5g - 10 = 2s - 41, -3g = 2s + 9. Suppose 5h - 206 = 3m - 0h, 0 = -3m - 4h - 170. Let o = 66 + m. Solve sr = x + 3, 0r + r - ox = 1 for r. 1 Suppose -7t + 9t = -6. Let q be (-1)/t(14 + -5). Solve -4c - 27 = -qo, -2o + 3c + 22 = -c for o. 5 Let h = 271 + -283. Suppose -46 = -3x - 4i - 6, 3x - 3i - 54 = 0. Let k = h + x. Solve n = 2b + 2b - 20, -kn - 4b = -20 for n. 0 Let r = 1 - 1. Suppose -174 = -5m + 51. Let b = -45 + m. Solve 2j = -2o - 14, b = o - 2j + 1 - r for o. -5 Let j be 2/3(-18)/(-1). Suppose 4o + 35 = 11o. Suppose -2d + 3u - 4 = -4d, 2d - 2 = -4u. Solve 5 = -5f + oc, df + 4c + j = 2c for f. -2 Let p be (-1)/(-10) - (-1716)/440. Solve 2n = pu + u, 2n = u + 8 for u. 2 Let a(s) = -s2 - 23s - 42. Let i be a(-21). Let u be (i + 9)/(-3) + 3 - -2. Solve 2f + u - 10 = 2w, 3f - 12 = -w for w. 0 Let n = 72 + 43. Let o be n/5 + 1 + 0. Solve -4b - p + o = 0, 0b + 5p = -4b + 40 for b. 5 Suppose 0 = 14a - 16a - 24. Let n be (-3)/4 - 129/a. Solve -b = 5, 4o + 11 + n = -b for o. -4 Let m be (4/(-12) + -3)3. Let v = 13 + m. Let u be 2 - 3 - (2 + -3). Solve 5a = -ud + d + 6, 3d - va = 6 for d. 4 Let a = 430 + -427. Solve -ar + 11 = 5p - 0r, 5 = 3p + r for p. 1 Let d be (9/10820)/(2/6). Let p(m) = -m*2 + 6m - 3. Let v be p(5). Let o be (-2)/(v/(-3) + 0). Solve 0 = oh + 2k + 16, 4h - 1 = -dk - 27 for h. -4 Suppose 356 + 16 = 4p. Suppose -p = -5q + 27. Suppose 4f = 3r + 1 + 4, -4r = -3f + 2. Solve v = -4d + q, -fv + v + 4 = 0 for d. 5 Let o = 6 - -4. Let g = -16 + o. Let b(h) = h*3 + 7h*2 + 5h - 2. Let z be b(g). Solve p = zx + 7 + 18, -5x = 25 for p. 5 Let g = 61 + -56. Let u be (-50)/25 - ((0 - 1) + -5). Solve -gy - 3w - 2 = 0, y - 2w + 7w = u for y. -1 Let u = 2159 - 2125. Solve 5t + c + u = 11, 3t = -5c - 5 for t. -5 Suppose 3 = t + h - 2, -4t = -h - 30. Solve 3l - 4l + 2o = 1, 0 = -2l + o + t for l. 5 Let s = -689 - -692. Solve 0 = 5f + sm + 2, -1 = -4f - 0f - 5m for f. -1 Let r(m) be the second derivative of -m5/20 + 11m*4/12 + 13m*3/6 + 11m*2/2 + 20m. Let w be r(12). Solve 3v + 5i + w = 0, 2v - i - 6 = i for v. -1 Let l = -878 + 882. Solve -x - 10 = -0o - o, x = -lo + 15 for x. -5 Let u(j) = 5j*2 + 5j + 5 - 2 - 2 - j*3 + 5. Let z be u(5). Suppose 2b - z = 5i, -4i = 3b - b + 14. Solve -6 = 5l + 2n, 2l - 9 = -0n + bn for l. 0 Suppose -k = -11k + 120. Solve 0 = -8p + 3p + 4a - 16, -5p + k = 3a for p. 0 Suppose -t + 3 + 6 = 0. Let x = 11 - t. Let c be (5 - 2) + x - 1. Solve 3m + 2h + 0 = -c, -11 = -3m + h for m. 2 Let y(x) = x + 1 - 6x + 4 + 4x. Let q be y(3). Solve 4g = -4u, -2u + qg = -g + 10 for u. -2 Let i(c) = 7c - 283. Let s be i(41). Let q be 3/(-1) + (3 - 0). Solve q = -j - 2, 0u + 4u - sj - 8 = 0 for u. 0 Suppose -3s + 15 = x + 2s, 5x + 4s = 159. Suppose 0 = -k + 5k + 5z + 5, -5 = z. Suppose 0 = -kt + 75 + x. Solve 0q - q = 2, 4d = -q - t for d. -5 Suppose 0j + 14 = 5j - 4m, -j + 5m = -7. Suppose 0d + 1 = 2d - 3t, -2 = 2t. Let y be (d + 10/j)1. Solve 3w - 3 = 0, 3w - 3 = -ya + 12 for a. 3 Suppose -10y + 72 = -6y. Suppose 2d + d = y. Solve -f + 3 = -df + 2g, 3f + 5g - 23 = 0 for f. 1 Let x(m) = -m2 - 7m + 8. Let o be x(-7). Suppose 28 = 5w + o. Solve -4s = -2c - 18, 25 = s + ws - 3c for s. 2 Let i be (-4)/315/10. Let d be i/(-7) - ((-68)/7 - 2). Solve a - 2a = 4c - 7, -4c = -4a - d for c. 2 Let l = -1881 + 1886. Solve 0n + 2n = g - 11, 23 = -2g - ln for g. 1 Let i = 780 - 777. Let d = -25 - -46. Suppose -5x - z = -5 - 26, 3z = -3x + d. Solve -3u - 11 = 4r, -xr = -ir - 2u + 21 for r. -5 Let v be (-21)/42(-5 - -1). Suppose 0 = -u + vu - 4. Solve 3r = h - 12, 5h = -r + 2r + u for r. -4 Let f = -4 - -14. Let g = f - 6. Suppose gc = -c + 20. Solve -cl = 0, 2k + k = -5l for k. 0 Suppose 4n - 148 = -112. Let z = 4 - 0. Let r = n - z. Solve 17 = -3q - c, 0c - rc + 10 = -4q for q. -5 Suppose -37 + 3 = -4j - 5g, -5g = -10. Suppose -4 = 4l, 3l - jl = 2p - 1. Suppose 3h - 8 = h. Solve -f = -k + p, 0k = -hk + 4 for f. -1 Suppose -1167 = 12s - 1203. Solve 5n = -5d + 10, 3d + n + s = 1 for d. -2 Suppose -2n = 5v + 8 - 17, -5v + 13 = 4n. Solve 3t - 15 = -4w, 4w + v = 4t + 3w for t. 1 Let h be (12 - 8)/((4/(-2))/(-8)). Let n = 39 - h. Solve 2r - 3m = n, -4r + 7 = -m - 14 for r. 4 Let o(r) be the first derivative of -r*2 - 8r + 13. Let d be o(-6). Solve 1 = 3p - 3b - 2, 0 = -dp - 2b + 28 for p. 5 Suppose -15h = -13h - 4. Suppose -c = d - 8, 2c - 19 = -5d + h*d.	{ "pile_set_name": "DM Mathematics" }
ss than -11397? -11401 What is the difference between -43984 and -0.2? 43983.8 Work out 131169 + -2. 131167 What is -2 + -2.534? -4.534 Work out 0.1 - 2.767. -2.667 What is -9242.26 less than 0.5? 9242.76 What is the difference between 2317.1 and 16? 2301.1 Sum -1 and 2.417. 1.417 Total of -37944 and 0.09. -37943.91 What is -14065.2 + -89? -14154.2 Work out 191 - 0.8. 190.2 Work out -0.7864 + -8. -8.7864 Calculate 1.2926 + 0.69. 1.9826 What is -0.1 + 9087.39? 9087.29 Work out -0.43 - 1.5. -1.93 What is 2.1 less than -8.065? -10.165 What is 109631 plus -4? 109627 What is -1 less than -534? -533 Calculate 34.165 - -0.1. 34.265 Subtract 26 from 2. -24 What is 282 + 760? 1042 Total of -2 and -2647. -2649 34 - -0.041 34.041 Sum 0.92 and 11. 11.92 What is 1 plus 0.026? 1.026 What is 0.0506 plus -0.4? -0.3494 -2714 - -2 -2712 What is 22241 take away 65? 22176 Work out -1 - 9.287. -10.287 Add together -0.2 and -487. -487.2 -0.249 - -0.6 0.351 Work out 0.4 - -1851071. 1851071.4 Work out -1.8 + -1.98. -3.78 What is -2 plus -7609? -7611 Calculate 3682 + 0.0487. 3682.0487 What is -1.4 minus 823910? -823911.4 Add 19 and -63.8201. -44.8201 Sum 989 and 14.92. 1003.92 5 - -2.7764 7.7764 Work out -3.5 + -35.07. -38.57 What is the difference between 5 and -128.29? 133.29 What is -0.68 minus 1094? -1094.68 What is the distance between -0.3 and -20? 19.7 What is 60 less than -7.98? -67.98 What is 64 - 0.1266? 63.8734 0.1+-1598 -1597.9 What is the distance between 0.4 and 83012.5? 83012.1 Subtract -31 from -50375. -50344 -642.88 - 1 -643.88 What is 0.824 less than 4? 3.176 Calculate 0.047363 + -0.5. -0.452637 Work out -4 + -185136. -185140 Sum -0.28 and -0.144. -0.424 What is the difference between 10.53 and -454? 464.53 What is -791 - 0.221? -791.221 What is the distance between 614 and 1833? 1219 Work out -65.25 + -0.03. -65.28 What is the distance between 1.9 and 4809? 4807.1 What is 5 minus 7032? -7027 0.76 - -0.52 1.28 -0.3+-44.1 -44.4 Calculate -0.3 - 379. -379.3 What is -0.2 take away 0.0369? -0.2369 Add together 381 and -2. 379 46 + -0.15 45.85 What is 0.5 + -0.04639? 0.45361 Work out 10114 - 2. 10112 What is 61.3 plus 26? 87.3 What is -83 minus -52.9? -30.1 What is -3 + -2757.5? -2760.5 -376.9 - 0.1 -377 What is -44 - 0.01588? -44.01588 Work out -44 + -17115. -17159 Calculate -2.78 + 593. 590.22 Add together 29.8 and -3. 26.8 What is the difference between 13.7 and -323? 336.7 What is -39717 - -2? -39715 Add together -176.49 and -4. -180.49 -3 + -2698 -2701 What is 0.5 plus -24147? -24146.5 What is 2 + -229.77? -227.77 What is -10412259 take away 1? -10412260 Add together -9.50183 and -4. -13.50183 Calculate 0.6 + -90.71. -90.11 Total of -8.36 and 742. 733.64 Put together 34 and -593. -559 What is 40560 less than -2.1? -40562.1 Calculate 18.94 + 42. 60.94 Calculate -1.8 - -25. 23.2 Work out -5 - -686.687. 681.687 What is 0.2 - 308? -307.8 -103 - -0.51 -102.49 Total of -2 and -23.65. -25.65 Put together -4 and 245.5. 241.5 Add together -731229 and 0.1. -731228.9 Calculate -65 - 0.03181. -65.03181 What is 3 - 2? 1 What is the distance between -934 and -0.4? 933.6 What is -1422.9 minus -0.2? -1422.7 What is -2.397 plus 11? 8.603 What is the difference between -8 and 2.31058? 10.31058 Work out -4.3 - 19.7. -24 Add together -4526 and 57. -4469 -3.68 + -2 -5.68 Total of 0.0404022 and 2. 2.0404022 Calculate 0.267 - 1938. -1937.733 What is the distance between -0.2 and -312091? 312090.8 What is -452.4 plus 1? -451.4 What is -0.797 plus 0.48? -0.317 Add -174329 and -1.2. -174330.2 What is -13 less than 0.12562? 13.12562 What is 460140 plus -0.2? 460139.8 0.0954 - -0.02 0.1154 What is -5423.355 minus 2? -5425.355 43 - 0.42 42.58 Sum -132 and 1015. 883 Put together 38 and 0.0441. 38.0441 Add together -2.509 and 22. 19.491 What is 0.0405 minus -6? 6.0405 -15.15 + 14 -1.15 What is -768 less than -3? 765 What is -78346 - 4? -78350 What is -0.2 plus 86493? 86492.8 What is 9.039 less than 0.05? -8.989 Total of 18.18 and 0.2. 18.38 Calculate 0.3 - 15.1. -14.8 Total of -5 and -2891. -2896 What is -1 less than -1.49497? -0.49497 What is -2.95 minus 34? -36.95 What is the difference between -175 and 0.066? 175.066 Put together 42.3 and -141. -98.7 Calculate 300 + 1.3. 301.3 What is the difference between -0.07 and 307? 307.07 What is -0.3 less than 602576? 602576.3 Add -139214 and 5. -139209 Calculate -204930 - 48. -204978 What is -6.07 - 0.102? -6.172 -280884+4 -280880 What is 141089 plus -3? 141086 Subtract 1.3 from 3681. 3679.7 What is -107263 take away -0.4? -107262.6 -0.4 - -3005 3004.6 Total of -3 and 0.586. -2.414 Put together 1.367691 and -0.5. 0.867691 Put together 59.532 and 13. 72.532 Put together 0.26 and 66. 66.26 -0.3 + -734 -734.3 What is -0.0863 less than 44? 44.0863 Put together -2 and -770. -772 Put together -0.0731 and -0.154. -0.2271 Sum 36 and -2.88. 33.12 What is -331026.2 minus 0.2? -331026.4 Sum -1 and 164414. 164413 Sum 1.281843 and 0.2. 1.481843 Calculate 0.3 - -186.49. 186.79 Calculate -0.02 + 1402. 1401.98 Put together -27 and -30986. -31013 What is -949 + 0.2? -948.8 What is 366 - 16? 350 What is -0.1 - -347.7? 347.6 What is -106 - 11? -117 Put together -7.41 and -0.04. -7.45 -0.3+93.802 93.502 Add together -0.3 and 2342. 2341.7 Calculate -81168 + -7.6. -81175.6 What is 0.1856 + -1? -0.8144 What is -95 take away -137? 42 Total of -102 and -2.5. -104.5 Add together -0.13 and 0.1. -0.03 What is the difference between 106 and -17930? 18036 Put together -0.24 and -160. -160.24 Calculate 1261 + 54.8. 1315.8 What is -12 take away -8316? 8304 What is 933483 take away -4? 933487 What is -0.17 minus 41986? -41986.17 What is 2565005 - -4? 2565009 Sum -50 and 71. 21 What is -604.39 + -0.07? -604.46 What is -0.389 - -0.1? -0.289 What is -24 less than -13931? -13907 What is 0.3 plus -315? -314.7 Calculate -1759 - -3. -1756 Work out 3470.5 - -0.5. 3471 What is -1 - 1295? -1296 What is -4 take away 33365.2? -33369.2 Work out 0.38 - -0.16. 0.54 Work out -0.03229 - 0.014. -0.04629 What is 1 + -1084182? -1084181 What is 0.2492 + 0.1? 0.3492 Work out 42.2 - 0. 42.2 What is 0.4 take away -89.61? 90.01 What is 0.536 take away 8? -7.464 What is -516.224 minus -0.3? -515.924 Calculate 0.051 - -0.228. 0.279 Add together -0.0317 and 0.52. 0.4883 Total of -1 and -0.5. -1.5 -26 + -2863 -2889 What is 0.4 plus -5.5044? -5.1044 What is the distance between 0.01 and 13260? 13259.99 -207.26 + 1.1 -206.16 What is the difference between 7418.3 and 0.3? 7418 Calculate -50 - 24.028. -74.028 What is 4 less than 1.2755? -2.7245 675+312 987 Calculate -2.96 + 3.1. 0.14 Total of 14 and -816.1. -802.1 Subtract -9440 from -0.19. 9439.81 -1005 - -1.91 -1003.09 What is 0.9 plus -1.299? -0.399 What is -66.9 take away -107? 40.1 Put together 9.65 and 4. 13.65 Sum 2.22723 and 3. 5.22723 Add 2 and 18293. 18295 Add -3 and -70. -73 Calculate 4 - -9699. 9703 -5+1.5896 -3.4104 What is 0.1 plus 531? 531.1 Add 3963211 and -0.5. 3963210.5 What is 1 plus -570? -569 Work out -9 + -62409. -62418 Subtract 0.149 from -151. -151.149 What is 336 less than -5? -341 Add together 3 and -814.39. -811.39 What is the distance between 103811 and 4? 103807 What is -145.52 minus 0.4? -145.92 Total of -34 and 1711. 1677 Calculate 0.2 + 0.279. 0.479 Work out 18490 - 4. 18486 Subtract 2 from -71.68. -73.68 Add together -4938 and 0.49. -4937.51 Total of -3 and -2388.2. -2391.2 What is -0.2 minus 773.2? -773.4 Work out -6 - -0.74619. -5.25381 What is -345 - 187? -532 What is 68 less than -0.05? -68.05 Total of -138 and 0.36. -137.64 Work out 4 - -0.429. 4.429 What is -16.766 - 0.4? -17.166 -2100.6 + -0.12 -2100.72 What is 4 + 74972? 74976 Add together -9 and 279. 270 Calculate -0.193 + 35. 34.807 Work out -50 - 2807.6. -2857.6 What is 0.2 - 0.11? 0.09 Put together 1320 and 7201. 8521 What is -33 - 45.86? -78.86 What is -8.3 plus 11? 2.7 What is -773.873 plus -2? -775.873 What is -19 - 1591? -1610 Add -22080 and 3. -22077 Add together -2440 and 2652. 212 What is -0.7 plus 136943? 136942.3 Calculate 0.023 + -28641. -28640.977 Add 25.4 and -0.254. 25.146 Work out -5 - -0.7. -4.3 -43 + -0.255 -43.255 -2 + 21067 21065 Work out 387 + 0.091. 387.091 Add together -3.1248 and -0.048. -3.1728 What is 118.2667 plus 0.1? 118.366	{ "pile_set_name": "DM Mathematics" }
4? 4 Which is the nearest to -10? (a) -2/3 (b) 0.9 (c) 45/4 (d) 5 a Which is the closest to 48.28? (a) 5 (b) 1/4 (c) -0.4 (d) -4 a What is the closest to 2/19 in 3.2, -2, -0.08? -0.08 Which is the nearest to 13? (a) -13.3 (b) 1/3 (c) -3 b What is the closest to -2/35 in -8, -2/9, 1/47, -3? 1/47 What is the nearest to 0.4 in 196, 1/9, 5, 0, -2/29? 1/9 What is the nearest to 0 in -1, -1/9, 19.1, -3.6? -1/9 Which is the nearest to 1/2? (a) -2 (b) -4 (c) -79 (d) 8 a What is the nearest to 0.1 in -4, 17/9, -6, 18? 17/9 Which is the nearest to 2/9? (a) 29 (b) 0.2 (c) -6 b Which is the closest to 0.02? (a) 5364 (b) 2/7 (c) 0.1 c Which is the closest to 0.2? (a) 1.03 (b) 15 (c) 0.8 (d) 2/7 d What is the closest to 3219 in -4, 3, -0.1, -2/3, -1/3? 3 Which is the nearest to 0.8? (a) -1 (b) 0.3 (c) 0.17 b Which is the nearest to -53/2? (a) -0.3 (b) -27 (c) 5 (d) 1/4 (e) 2/5 b What is the nearest to -63 in 2/3, 8, 0.2? 0.2 What is the nearest to -0.2 in 2441, -2, -15? -2 What is the closest to -0.2 in 3, -65/12, 2/9, -0.06, 0? -0.06 What is the closest to -0.1 in -3.4, 0.1, 48539? 0.1 What is the nearest to -120 in -4, 16.5, 0? -4 Which is the nearest to 0? (a) 4 (b) -61/3 (c) -0.05 c What is the closest to 3/5 in -0.2, 23, -79? -0.2 What is the closest to -975 in 0.05, 0.5, 0, 1? 0 Which is the closest to -3? (a) 0.9 (b) 0.2 (c) -0.03 (d) -1/3 d What is the nearest to 115 in 0.5, 4, -1.6? 4 What is the closest to -1/539 in -2, 33/13, 1? 1 Which is the closest to 9? (a) 2/13 (b) 4/5 (c) 818 (d) 1/3 b Which is the closest to -9? (a) -11/8 (b) 0.3 (c) -4 (d) -27 c What is the closest to 19.8 in 0.3, 1/2, 11, -2, 3? 11 What is the nearest to -1/60 in 3, -1/2, 7? -1/2 Which is the closest to 10? (a) -1 (b) 2/27 (c) 3 (d) 23 c What is the nearest to 0.08 in 0.2, -0.3, 0.01? 0.01 Which is the closest to -0.2? (a) -222 (b) -0.5 (c) -4 (d) 0.5 (e) 6 b What is the nearest to 0.06 in -4806, 1/3, 0? 0 Which is the nearest to -0.1? (a) -1/7 (b) 0 (c) -2/567 (d) 0.3 a What is the closest to 0.1 in 3, -5, 12.5445? 3 What is the nearest to 13 in -1, 1/6, -6, 18? 18 What is the nearest to -2 in -1.12, 2, 27? -1.12 Which is the closest to 8/59? (a) -54 (b) -1 (c) -19 b Which is the closest to 0.2? (a) -1.9 (b) -3 (c) -5/3 (d) -431 (e) -2/19 e Which is the nearest to -2/5? (a) -6 (b) -36.2 (c) -16 a Which is the nearest to 0.2? (a) 31674 (b) -2 (c) -1/7 (d) -1/3 c What is the closest to -128.7 in -7, 2, 0.5, 4? -7 What is the closest to -1 in -5, -4, 1943, 4, 6? -4 Which is the closest to 0.75? (a) 1/5 (b) -2685 (c) -0.1 (d) -0.5 a Which is the closest to 1/9? (a) 5 (b) -0.01 (c) -0.8 (d) -3/4 b What is the closest to 2 in 5, -15514, -5? 5 What is the closest to -0.1 in -9, -2/7, 13, 5? -2/7 Which is the nearest to 1/2? (a) 0.094 (b) -1/2 (c) 10 a What is the closest to -2 in 465, -5, -1/2? -1/2 What is the closest to -5 in -4256, 1, 0? 0 Which is the nearest to -6? (a) -0.1 (b) 0 (c) 5 (d) -311 (e) -2 e What is the closest to -1 in 1, 1/294, 2, -1.8, 3? -1.8 Which is the nearest to -44? (a) -4 (b) 3/13 (c) 2/3 a What is the closest to 1 in 3, -11, 5/9, -9/5, -1/6? 5/9 Which is the nearest to 1? (a) 0.2 (b) -1.7097 (c) 3 (d) 4 a What is the nearest to -0.2 in -2/9, 194, -4, -3? -2/9 Which is the closest to 0? (a) 0.2 (b) 19 (c) -1697 (d) 2 a What is the nearest to 12 in -0.2, -17, 5, 0? 5 What is the nearest to 2/9 in 3, -0.2, -2.4, 0.16? 0.16 Which is the nearest to -2? (a) -0.06 (b) 70.4 (c) 0 a What is the nearest to -10.2 in 3, 12, 4? 3 Which is the nearest to 61759? (a) -0.1 (b) -2 (c) 0.5 c What is the closest to 3 in 1, -1, -0.09, 86? 1 Which is the closest to -0.6? (a) -2 (b) -1/2 (c) 1.52 (d) 1/3 b What is the closest to 9 in 3/5, 5, -3, 1/3, -5? 5 Which is the nearest to 2.8? (a) -10 (b) 9/5 (c) -0.5 b Which is the nearest to -843? (a) 13 (b) 0.3 (c) 0.05 c Which is the closest to -2/19? (a) 2/15 (b) -1/35 (c) -3 b Which is the closest to 0.1? (a) -58 (b) -5 (c) 2 (d) 0.05 d What is the nearest to 0.1 in 0.1, -2, 12880? 0.1 What is the closest to 0.03 in -1478, 1/7, 1/5, 0.1? 0.1 What is the nearest to 0 in 328/3, 0.4, 2/17? 2/17 Which is the nearest to -6? (a) 1/3 (b) 526 (c) -5 (d) 3 c Which is the nearest to -2? (a) -9/25 (b) 0.14 (c) 1/4 (d) 1/2 (e) 3 a Which is the closest to 2/9? (a) 0.5 (b) -1 (c) -3.4 (d) 4 a Which is the nearest to 0.1? (a) -1.2 (b) 10 (c) -6 (d) -4 a What is the closest to 8 in -1, -10/3, -5, -3, 1/12? 1/12 Which is the nearest to -1? (a) 0.2 (b) -5 (c) 256 (d) 0.3 (e) -1/54 e What is the nearest to -2 in 0.7, 4, -2, 0.1? -2 Which is the nearest to 1.76? (a) 1/5 (b) -3.38 (c) -2/7 a What is the nearest to 1 in 1.7, -2, -15? 1.7 What is the nearest to -2 in 27.4, -5, 2, -3/8? -3/8 Which is the closest to -1? (a) -59 (b) 0 (c) -0.11 (d) -4 (e) 4/3 c What is the closest to 0 in 1/5, -101, 0, 2, 1/2? 0 Which is the nearest to 1? (a) -7 (b) 303.7 (c) 2/11 (d) 0 c Which is the nearest to 1? (a) 41 (b) -20 (c) -1/2 (d) 5 c Which is the closest to 0? (a) 394 (b) -4/5 (c) 108 (d) -0.3 d Which is the closest to 795? (a) 0.3 (b) -418 (c) -0.4 (d) -0.1 (e) 4 e What is the nearest to -1/3 in -0.3, 4, -0.06, -480? -0.3 What is the closest to 0.6 in 0.1, -58, -3/4, -4? 0.1 Which is the closest to 0.3? (a) 11 (b) -2 (c) 1301 b What is the nearest to -1/4 in -5, -97, -3269? -5 What is the closest to 1 in 0.6, 0.5, 0.4, 1/6, 64? 0.6 Which is the closest to -1/110? (a) 3 (b) -1/3 (c) 0.3 (d) 2 (e) 1 c What is the nearest to 2/7 in 69, 0.1, 4, -1? 0.1 Which is the closest to -1? (a) 70 (b) 1/41 (c) -7/6 (d) -3 (e) -0.3 c Which is the closest to -0.2? (a) 0.3 (b) 1574 (c) 2/11 (d) 3 (e) 2 c Which is the closest to 0.3? (a) -6 (b) -0.2 (c) -0.021 (d) 4/27 d Which is the nearest to 2889/4? (a) 5 (b) -2/9 (c) 3/17 a Which is the closest to 11? (a) 2 (b) -15 (c) 2/85 (d) 0 (e) 3 e What is the nearest to 1.5 in -4, -5/3, 4? 4 What is the closest to -0.1 in 4, 1/4, 11, 8/5, -0.78? 1/4 Which is the closest to 6103? (a) -0.1 (b) 3 (c) -0.2 (d) 2 (e) -3 b What is the nearest to 0 in -1, 90/77, -15, 0? 0 What is the closest to -3 in 2/19, 2/3, 11/2, 5/14, -0.2? -0.2 Which is the closest to -163? (a) 0.5 (b) -3 (c) 3 (d) -0.3 b Which is the closest to 1/2? (a) -2/3 (b) -1/4 (c) -0.1 (d) 12 (e) 7.42 c What is the closest to -5/4 in -1/3, 1, -0.5, -13.7, 8? -0.5 What is the nearest to 0.1 in -2/5, 1.9, -0.1, -2/3, 3? -0.1 What is the closest to -0.1 in 139, 24, 1/7? 1/7 Which is the nearest to 68? (a) 5/2 (b) -0.1 (c) 428 a What is the closest to -136 in 0.6, 0.02, 0, 2/5? 0 Which is the closest to 1? (a) -55 (b) -1/7 (c) -0.337 b What is the nearest to 0 in 1.5, 4, 16, -2/7, 1/3? -2/7 What is the nearest to 1/2 in 4/251, -3/5, 1/4? 1/4 What is the closest to 15/2 in 1, -3/14, 45? 1 What is the nearest to 17.67 in -0.05, 1, 5, -5? 5 Which is the closest to 0.9? (a) -4 (b) 14.6 (c) 5/2 (d) 4/7 d Which is the nearest to -1/5? (a) 339 (b) -4 (c) -5 (d) 0.35 (e) -0.2 e Which is the nearest to -1? (a) 17 (b) 4/5 (c) 5/2 (d) 1/2291 d Which is the closest to 0.1? (a) 2 (b) 0.0244 (c) -0.1 (d) 1/13 d Which is the nearest to -0.2? (a) -0.5 (b) -116 (c) -3 (d) 2 a Which is the nearest to -0.1? (a) -2/3 (b) -893 (c) 10 a What is the closest to -5/6 in 24, 0.04, -3/4, 0.2, -83? -3/4 What is the nearest to -21 in 16, 3, 2, 5? 2 What is the nearest to -0.2 in 0.16, 14, -1, -2/13? -2/13 What is the closest to -8 in -71, -6, -9/4? -6 Which is the nearest to -5? (a) -1/6 (b) 0.5 (c) 0.815 (d) 3 (e) -2 e What is the closest to -4 in -57, 0.4, 2/165? 2/165 What is the nearest to -0.1 in 0, -0.03, 2/57, -0.099, 2/7? -0.099 Which is the nearest to -0.1? (a) 2/5 (b) 0.1 (c) 178 (d) -1/23 d What is the closest to 0.3 in -0.5, -0.4, 0.3, -8, 5/3? 0.3 Which is the closest to -1/4? (a) -4 (b) -3 (c) -1/27 (d) -36 (e) -0.08 e Which is the nearest to -0.7? (a) -1 (b) 0 (c) -5 (d) 148 a Which is the closest to 0.2? (a) -0.1 (b) -7 (c) -2.04 a What is the closest to -341 in -23, 0.3, -1/4, 4? -23 Which is the closest to -2? (a) 0	{ "pile_set_name": "DM Mathematics" }
6/5) Simplify x*(4/5)xxx/(xx(2/15))xx(-2/23)x/(x*11/x)xx assuming x is positive. x(-236/69) Simplify ((nn(n/n(1/5))/nnnn)/(n*(-1)n))(4/5) assuming n is positive. n(96/25) Simplify q2/q(3/7) assuming q is positive. q(11/7) Simplify (h/(h/h(-4)))41 assuming h is positive. h(-164) Simplify s/(ss(s/s*(8/3))/s)s(13/2) assuming s is positive. s(49/6) Simplify (r(2/5))(6/31)r(-4/9)rrr/(r*(1/10)r)rrrr assuming r is positive. r(15437/2790) Simplify (y0y)/(y(-1/6)/y)(y*(-2/11)y)/y2 assuming y is positive. y(65/66) Simplify m*(2/7)mm13m assuming m is positive. m*(107/7) Simplify (hh*4h*(2/9)h)/((h/h*3h)/(h*5h)) assuming h is positive. h(119/9) Simplify o25o(1/9) assuming o is positive. o(226/9) Simplify (d/(dd*(-2/15))ddd)/d(-5/2) assuming d is positive. d(169/30) Simplify (u/(u(u/(u/(u14u)))/uuu))(-13/4) assuming u is positive. u52 Simplify n(-5/4)/n(-2/3)nn*(3/4)nnn(-2) assuming n is positive. n(7/6) Simplify (((z*23z)/z)/z)/(zz(-5)z) assuming z is positive. z25 Simplify (l(-4/5))(-3/2) assuming l is positive. l(6/5) Simplify (i/(i((ii*(-7)/i)/ii)/i)ii/((i*(-4/5)i)/i))10 assuming i is positive. i108 Simplify (p*8p(-1))/(p(1/3))(4/43) assuming p is positive. p(899/129) Simplify l*(4/11)lll*(2/23)l assuming l is positive. l(873/253) Simplify ((f/(f(2/7)f))(-32))(-33) assuming f is positive. f(-2112/7) Simplify g(-7/2)/g(-3/13) assuming g is positive. g(-85/26) Simplify g(-3/2)/g(-2/7)(g(-1))(-8/9) assuming g is positive. g*(-41/126) Simplify m/(((mm*(3/8)m)/mm)/m)m/((((mm(-1)m)/m)/m)/m)(m/(mm*4m))/(m(-1/4)/m) assuming m is positive. m(-9/8) Simplify (p*(-1/4)p)/p*(2/11)p*(-1/9)pp(-1/4) assuming p is positive. p(239/198) Simplify (q(-1/4)q(2/3)/q)/(q0q(-4/7)q) assuming q is positive. q(-85/84) Simplify (c/c(-1/4))(-3) assuming c is positive. c(-15/4) Simplify (j2/j)45 assuming j is positive. j45 Simplify l(1/25)l(-2/43)/l assuming l is positive. l(-1082/1075) Simplify ((wwwww/(w(ww(-5)w)/ww)w)/(w(1/8)/w))/(w(4/5)/(w*(-6)www)) assuming w is positive. w*(203/40) Simplify y/(yy*(-1)/y)y(-18) assuming y is positive. y(-16) Simplify (f/f*(-3)ff/f(-6))(-45) assuming f is positive. f(-540) Simplify (zz*(2/5))/(zz/((z/z12)/z)) assuming z is positive. z(-63/5) Simplify q*(-15)q(-5/3) assuming q is positive. q(-50/3) Simplify g(-5/14)/g(-1/14) assuming g is positive. g(-2/7) Simplify m2m(5/4)m(m/m(-2/15))/mm(-2) assuming m is positive. m(143/60) Simplify r(-6)/((r/r(-1))/r)(r/r(-4/5))/r(-4) assuming r is positive. r(-6/5) Simplify i(-8)/(i/i(-2/17))(i(-1))(-2) assuming i is positive. i(-121/17) Simplify w(-3)/ww/(ww/w*4)w(-2/7)/(w/w(-5)) assuming w is positive. w*(-51/7) Simplify ((k/(kkk(2/9))k)/kkk(2/13)/k)(-6) assuming k is positive. k*(250/39) Simplify zz/z*(-5)z*(2/15)z(z/(z(z*(-4/9)/z)/zz))/((zz/(z(-4)/z))/zz) assuming z is positive. z(116/45) Simplify (p/p1)*(-7)(p/p0)/p(-1) assuming p is positive. p*2 Simplify (ll/l1)(-2/19)l/(l(3/5)/ll)ll/(l/l(-1/9)) assuming l is positive. l(1012/855) Simplify b*(1/8)bb/(b/(b/(b/(bbb38)b)))b assuming b is positive. b(329/8) Simplify (((((oo(-12))/o)/o)/o)/o10)(-3/41) assuming o is positive. o(72/41) Simplify (l(2/19))(5/4) assuming l is positive. l(5/38) Simplify (b(-14))(-19) assuming b is positive. b266 Simplify ((z*(-2/5)z)/z)/z(11/3) assuming z is positive. z(-61/15) Simplify ((i*(-3/2)/i)/ii(2/5))(3/8) assuming i is positive. i*(-93/80) Simplify (pp/(p(p(-5/9)p)/p)pp)/pp(3/4) assuming p is positive. p(119/36) Simplify (m11mm)48 assuming m is positive. m624 Simplify (((a/(((a/(a(aa(-1/2))/aaa)a)/a)/a))/a)(-2/45))(24/5) assuming a is positive. a*(-8/15) Simplify (p/(p(p(p(-15/8)p)/p)/p))/(p/p(-18)) assuming p is positive. p(-137/8) Simplify h/h*(3/2)h0/h assuming h is positive. h(-3/2) Simplify r/(r/(rrr*(3/8)/rr))r(1/23) assuming r is positive. r(445/184) Simplify (u(u*(-14)uu)/uu)21 assuming u is positive. u(-231) Simplify (((uuu*(-18)u)/u)/uu/(u(-1/11)/uu))(-33) assuming u is positive. u525 Simplify (ss(s/s*(1/2))/ss)*14ss(-1/5)ss4ss assuming s is positive. s(214/5) Simplify (r/(rrr1rrr))*(-29)/((rr*4/r)/(rr/(r/(r*(-1/3)r))r)) assuming r is positive. r(431/3) Simplify (y7/(y(-7)/y))/(y((y/(y/y*(2/7)))/y)/yy)23 assuming y is positive. y(59/7) Simplify (c/c*6(c(cc/(c/(c*(-2)c))c)/cc)/c)/(c*(-2/5)/(c/(c(cc(5/4)/c)/c)c)) assuming c is positive. c(-57/20) Simplify (f0)*(33/7)((f*(-2/7)/f)/ff)(-38) assuming f is positive. f(342/7) Simplify (kk33)/kkk(-10) assuming k is positive. k24 Simplify ((l/((ll*(-2/33))/ll))(-33))2 assuming l is positive. l(-4) Simplify (s1)(16/3) assuming s is positive. s(16/3) Simplify (((zzz(2/9))/z)/z(-3/5))/(z/(z0/z))(-33) assuming z is positive. z(3052/45) Simplify (s(-1/3)/sss*(-1/7)s)(11/3) assuming s is positive. s(121/63) Simplify (yy/y(-14)y)/(yyy6) assuming y is positive. y9 Simplify (d(-2/9))4(d/((d/d7)/dd))/dd(-1)dd assuming d is positive. d(55/9) Simplify (q/(q/(q/(qq/(q/(q(q/(q/(q/(q/(qq*(-2)q)q)))q)/q)))q)))(-1/63)(q*(1/2)qq)(-47) assuming q is positive. q(-14807/126) Simplify mm*(-14)/mm19 assuming m is positive. m5 Simplify ((b/(b/b*(-1)))/(b/(bb*(-2/5)b)))/((b*(4/9)b)/b7) assuming b is positive. b(232/45) Simplify (((h/(h*(-7)/h))/h)/hh)/hh(2/11)h*(-2/19)(h/(h(2/21)/h))/h assuming h is positive. h(35030/4389) Simplify z*(-28)z/(zz(-29)z) assuming z is positive. 1 Simplify (rr(-30)rrrr)/((r/r(4/15))/r) assuming r is positive. r(-371/15) Simplify (m/((m/(mm/m(3/8)))/m))(3/20) assuming m is positive. m(63/160) Simplify (a/a(-4))/(aa(-2/5)) assuming a is positive. a(22/5) Simplify (b/b(-1/2)b(-3))(-47) assuming b is positive. b(141/2) Simplify ((l16/l)/l)/(ll/((l/((ll*(3/14))/l))/ll)l) assuming l is positive. l(165/14) Simplify j(6/5)jj(-1/2)j*(-6)j(j(3/7)j)/j assuming j is positive. j(-201/70) Simplify (n49)(2/17) assuming n is positive. n(98/17) Simplify ((www/w*1w)/(((w/(((ww(-2/9)/w)/w)/w))/w)/w))/(w1/(ww*6w)) assuming w is positive. w(79/9) Simplify y(-1/20)/(yy/((((y/(yy(-28/9)))/y)/y)/y)) assuming y is positive. y(-349/180) Simplify g/(g/g*(-2/5))g*6(g/(gg/(gg(1/2)/g)))/g(-2/5) assuming g is positive. g*(11/2) Simplify ((((k/(kk*4))/k)/k)/kk/(k/(kk/k4)k))(-33) assuming k is positive. k330 Simplify ((q/q*(-5/4)q)/q(1/5))/((q/q(4/3))/q(-2/23)) assuming q is positive. q(4549/1380) Simplify ((u/(uu1/u)u)(-14))(-49) assuming u is positive. u*686 Simplify ((dd*(-2/3)d)/d)*(-10/3)d*4/dd(d/(((d/((d/d(1/15))/d))/d)/d))/d assuming d is positive. d(172/45) Simplify x/x35x(24/7) assuming x is positive. x(-214/7) Simplify (y(1/3)/y)(2/5)(y(-1/2))47 assuming y is positive. y(-713/30) Simplify uu*(1/7)(uu0)/uu(uuu7)/uu(-4) assuming u is positive. u(43/7) Simplify (xx/(x2x))(1/21) assuming x is positive. x(-1/21) Simplify (((a/a*(-5))/aa)/((a/(a/((a*5/a)/a)))/aa))(-2/23) assuming a is positive. a(-6/23) Simplify yy/(y/(y29/y))yy18/y assuming y is positive. y47 Simplify (ww*(-5)ww(-2)w)/(w*(-3)ww/(w/w(1/6))) assuming w is positive. w(-13/6) Simplify rr*(4/9)/rrr2r/(rr3)rrrr(-7) assuming r is positive. r(-32/9) Simplify (y1)(2/7) assuming y is positive. y(2/7) Simplify (nn*(-5/2)n)(5/2) assuming n is positive. n(-5/4) Simplify (qq(-1/2)/qq)(-3)/(q(-2/7)q)23 assuming q is positive. q(-251/14) Simplify u/(u(-2/35)/u)u(-2/7) assuming u is positive. u(62/35) Simplify r/(r/(rrr*(-19)r)r)rr*(-24) assuming r	{ "pile_set_name": "DM Mathematics" }
vative of -h5/30 + h4/4 + 19h3 + 112h*2 - 11. Determine t(9). 6 Let j(z) = -2z*3 + 6z*2 - 2z - 20. Let d(s) = s*3 - 3s*2 + s + 9. Let y(k) = -9d(k) - 4j(k). Let a be 2 + 0 + -2 + 3. Determine y(a). -4 Let q(b) = -b3 - 6b*2 - b + 5. Suppose -556g + 552g + 352 = 0. Suppose -12h = -28 + g. Determine q(h). -15 Let c(i) = 52i + 555. Let d(a) = -49a - 523. Let u(n) = 17c(n) + 18d(n). Let b = 6 - 14. What is u(b)? 5 Let m(t) = -7t + 25. Let q = -14194 + 14198. Calculate m(q). -3 Let f(v) = 42 + 3v*2 + 201v + 76 - 4v2 - 199v. Calculate f(0). 118 Let s(q) = -49q - 8. Let z(r) = 8r + 1. Let d(k) = s(k) + 6z(k). Suppose 6b + 11 = -1. What is d(b)? 0 Let m = 341 + -335. Let n(r) = 8r2 + 3r - 8. Let d(z) = -7z2 - 4z + 7. Let t(q) = mn(q) + 7d(q). What is t(-9)? 10 Let v(q) = -q*3 + 10q*2 - 23q - 14. Let n be v(6). Let s(d) = -d*2 - 5d + 40. Determine s(n). 16 Let g(l) = l3 + l2 + l - 2. Let d be g(0). Let u = -46 - -50. Let t(q) = -2 + 2q2 - uq - 5 + 0 + 5 - 4q2. What is t(d)? -2 Let w be 76/(-16) - (-21)/28. Let x(m) = 17m + 3. Determine x(w). -65 Let f(h) = -9h - 8. Suppose -573x = -597x + 72. What is f(x)? -35 Let q(x) be the third derivative of 1/3x*3 + 49x + 0 - 1/4x4 + 1/60x5 + x2. Let h be (-47)/(-9) + (-2)/9. What is q(h)? -3 Let v(a) = 0 + 0a - 2a + 3 + 1 - 3. Give v(-1). 3 Let t(r) = -r*3 - 23r*2 + 53r + 68. Let c be t(-25). Let h be c + 10 + -7 - -10. Let g(y) = y*3 - 6y*2 + 3y. Determine g(h). 18 Let n(j) = 2j + 2. Let i(r) = -r + 13. Suppose 2v - 28 = -3p, 3p - 2v + 5v = 24. Let k be i(p). Let g(q) = 1. Let f(w) = kn(w) + 2g(w). Give f(-4). -4 Let q(b) be the first derivative of -b*3/3 + 3b*2 - 8b - 8985. What is q(2)? 0 Suppose 3g + 2j = 0, 19 = 2g + 3g - 3j. Suppose 0 = 2h - h - g. Suppose -p = hz + 3, 4p + z - 16 = p. Let r(u) = -u + 1. Calculate r(p). -6 Let m(k) = -k + 1. Let l(c) = 15c + 4. Let z(b) = l(b) - 4m(b). Let n(f) = -4f - 12. Let p be n(-2). Let g be (-18)/27(-6)/p. Determine z(g). -19 Let g(b) be the first derivative of -11b2 - 289b + 6532. What is g(-13)? -3 Suppose -1 = -12u + 11u. Let i(x) = 9x - 3x - u - 8x + 8x + x*2 + 0x. Suppose 32 = -3w + 11. Give i(w). 6 Let g(w) = -4w*2 - 13w + 9. Let b = 235 - 240. Let o(c) = -7c2 - 25c + 18. Let l(m) = bg(m) + 3o(m). What is l(-11)? -2 Let z(a) = -2a + 3. Let t be z(2). Let q(g) = -g + 19g*2 - 18g*2 - 9 + 5g*3 + 30g*3 - 4g*3 + 8. Give q(t). -30 Let a(v) be the third derivative of 0 + 216v*2 - 1/60v*5 + 0v - 1/12v4 + 5/6v*3. What is a(-3)? 2 Let o = -52 + 88. Let l(x) = -4 + 39x*2 - 4x + ox2 - 77x*2. What is l(-3)? -10 Let f(a) = -10a*2 - 3a - 2. Let w = -4014 + 4011. What is f(w)? -83 Suppose 0 = -4n + 3s - 94, 438n + 26 = 436n - 2s. Let x(c) = 8c + 149. Give x(n). -3 Let j = -4091 - -4091. Let c be 9/(-27) - 10/(-3). Let n(t) = 0 + 0t + t + c. Determine n(j). 3 Let m(k) = k3 - 28k*2 - 27k - 49. Let r be m(29). Let w(a) = -a*3 + 8a*2 + 10a - 5. Give w(r). 4 Let f(y) = -y*3 - 2y*2 + 3y. Let c be 3/6(0 - -4). Calculate f(c). -10 Let u = -2/25867 - -51740/77601. Let f(k) be the first derivative of 0k*2 - 17 + k - uk*3. What is f(-2)? -7 Let b(o) = -1586o - 1 + 0o2 + o2 + 1587o. Suppose 2j = -j. Determine b(j). -1 Let z(p) = 2p*2 + 135355p + 135353p + 135355p - 406061p + 0 - 1. Let g be 02/(-4) - -2. Determine z(g). 11 Let c(r) = r*2 + 2r - 5. Let m(n) = -n*3 + 13n*2 + n - 31. Let h(k) = -5c(k) + m(k). Calculate h(6). 12 Let v(m) be the third derivative of -m*5/60 + 4m*4/3 - 15m*3 - 1088m2. Calculate v(29). -3 Let j(n) = -n3 - 6n2 - 6n - 4. Suppose 19 = -6k - 13k. Let i be k + 7/((-35)/25). Determine j(i). 32 Let z(f) = 70f3 + 2f*2 - 2689f - f*2 + 1347f + 1344f. Determine z(-1). -71 Let n(j) = -60j*2 + 66j*2 + 9 + 547j*3 + 6 - 548j3. Calculate n(6). 15 Let n(h) = -h2 - 38h - 280. Let j be n(-28). Let y(l) = -3l + 19. What is y(j)? 19 Let l = -2 + 3. Let d be (-44)/550 - 104/(-50). Let v(m) = -dm3 - 80m - 79m + 1 + 0m*3 - 2m*2 + 159m. Calculate v(l). -3 Let v = 48718 + -48716. Let a(x) be the third derivative of x6/120 + x4/24 - x*3/6 + 2x2. What is a(v)? 9 Let z be ((-10)/20)/((-1)/2). Let h(q) = q2 - 8q + 10. Let r be h(7). Let p(x) = 237x*r + 4x - 2x2 - 234x*3 - 3x. What is p(z)? 2 Let b(g) = g*3 - 12g*2 + 14g - 37. Let a be b(11). Let k be a/(-8)(-2 + (1 - 5)). Let s(n) = n + 4. Give s(k). 1 Suppose 9 = -8m - 31. Let v(y) be the third derivative of y6/120 + y5/20 - 5y4/24 + 2y*3/3 + 34y*2 - 5. Calculate v(m). -21 Suppose 0 = 2a + 5k + 28, 2k = a + 1142 - 1155. Let v(t) be the second derivative of -a + 19t + t2 + 1/6t*3. Give v(-6). -4 Suppose 3a + a = 28. Let n(x) be the first derivative of x*5/20 - 7x4/12 + x3/6 + 4x + 22. Let r(g) be the first derivative of n(g). Determine r(a). 7 Let j(z) = -3z + 30. Let k(v) = -v + 10. Let y(i) = -6j(i) + 17k(i). Suppose 0 = -2c + 2t + 16, 0c + 3c - 9 = -2t. Determine y(c). -5 Let f(t) = -t3 - 2 - 31t + 10 + 4858t2 - 4826t*2. Let u be f(31). Let v(j) = -2j - 4. Give v(u). -20 Let d(h) = h*2 + 6h - 11. Suppose s + 21s + 36 = -294. Give d(s). 124 Suppose 25k = 8 + 67. Suppose 4g + g = 15. Let q(w) = -2 + 4 - 3 + w2 - gw. Give q(k). -1 Let o be 16/44 + (-684)/66. Let n be 252/(-140)o/(-3). Let x(k) = 4k - 3 - k - 4k. What is x(n)? 3 Suppose 0 = 5o - 4g - 30, 0o + 29 = 2o - 5g. Let f(x) = 0 + 2x3 - 3x*3 - 6x*o + x - 14 + 13x2. Calculate f(7). -7 Let x = -195 + 191. Let n(k) = k2 + 3k - 6. Let t(h) = -h2 - h + 5. Let f(i) = xn(i) - 5t(i). Suppose 2u - 5 = 1. Calculate f(u). -13 Let r be 6 + 4(-21)/28. Let t(z) be the third derivative of 0z + 3z2 - 1/3z*3 + 1/8z4 + 0. Determine t(r). 7 Let h(x) be the first derivative of x5/15 - x*4/6 + 5x*3/6 - 83x*2/2 - 226. Let a(l) be the second derivative of h(l). Calculate a(2). 13 Let y(v) = -2v + 13. Suppose h + 13 = 2p, 1372h = 1374h + p + 1. What is y(h)? 19 Let f(v) = 2v2 - 1852 - v + 1855 + v2 - 606v3 + 607v*3. Let k(z) = z - 4. Suppose -6 = -c + 3c + 3s, -2 = s. Let d be k(c). Determine f(d). -9 Let y(s) = -s3 + 3s*2 - s + 3s*2 + 583 - 579 - 4s - 2s2. Calculate y(3). -2 Let l(h) = 6h - 1. Let a be l(1). Suppose -4c = -ac + 4. Let z(m) = cm + 5 - 5 - 2. Determine z(-4). -18 Let l(t) = -t3 - 28t*2 - 31t - 107. Let x be l(-27). Let b(j) = 25j3 + 2j*2 - j. Determine b(x). 26 Let b(o) = 2o*2 - o - 138. Suppose -144q - 24 = -142q - 3r, -5q + 5r = 40. What is b(q)? -138 Let p(h) be the second derivative of h*5/20 + 7h*4/2 + 77h*3/6 - 57h*2 - 154h + 3. Determine p(-40). 6 Let y = -4500 + 4506. Let b(r) be the third derivative of r*6/120 - 7r5/60 + r4/4 - 3r3/2 - 2r*2. Calculate b(y). -9 Let p(j) = 6 - 17j + 1 + 8 + 37j - 18j. What is p(-7)? 1 Let l = 64 + -67. Let b(o) = 5o2 + 3o. Calculate b(l). 36 Let k(b) be the second derivative of 0 + 0b3 + 5/24b*4 - 3/2b*2 - 8b + 1/60b5. Let o(h) be the first derivative of k(h). Calculate o(-6). 6 Let y(s) be the second derivative of -s4/3 - s3 + s2/2 + 892s. Give y(-3). -17 Let n(w) = 2w3 - w2 - 2w - 1. Let a(z) = -z*2 - 12z - 5. Let t be a(-12). Let j be (-20)/50 + (-37)/t. Suppose jm + 7 + 0 = 0. What is n(m)? -2 Let b(j) = -7j - 427. Let o(d) = -5d - 287. Let a(k) = 5b(k) - 8o(k). Give a(-33). -4 Let z(s) = -s3 + 8s*2 + 10s - 8. Let b = -34 - -58. Suppose 10 = -bd + 19d. Let v(u) = u*3 - u + 1. Let i(p) = dv(p) - z(p). Determine i(-6). -18 Let b(w) = w + 15. Let k be b(-5). Suppose k = -3o + 28. Let z(p) = -op*2 - 5 + 32p*3 + 30p*3 + 6p - 63p3. Give z(-7). 2 Let m(y) = -y3 - 10y*2 - 5y + 46. Let n be m(-6). Let x = n - -72. Let b(s) = s*3 - 4s*2 + 3s + 2. What is b(x)? 14 Let x(o) = 3o - 12. Let w be x(6). Let s(r) = 10r - 4r + r + 7 - wr. Let p(n) = n*2 + 6n + 5. Let y be p(-4). Give s(y). 4 Suppose k - 16 = 2x - 53, 2x + k = 23. Let y(o) = -2o2 + 25o + 70. Determine y(x). -5 Let m(f) = -22*f - 104. Let p be (4/(-4) + 7 - 20) + 9. What is m(p	{ "pile_set_name": "DM Mathematics" }
23 = -5, 5h - 3z = 34. Let f(s) be the first derivative of -6s2 - 3/5s*h - 3s + 2s3 + 6s*4 + 31 - 2s*6. Solve f(y) = 0 for y. -1, -1/4, 1 Let u(o) = 7o*2 + 45o + 144. Let j(d) be the second derivative of 0 - 22/3d3 - 72d*2 - 9d - 2/3d4. Let a(s) = -3j(s) - 4u(s). Factor a(y). -4(y + 6)*2 Let k be 24 - (-5)/(-10)6. Let v = 24 - k. Solve -8i5 - 15i*2 + 7i*5 - 2i*5 + 13i*v + 14i*3 - 9i*4 = 0. -5, 0, 1 Let z(s) be the second derivative of -9s*2 - 1/4s*4 - 37s - 5/2s3 + 0. Factor z(c). -3(c + 2)(c + 3) Let r = -103 - -105. Let d = 7235 - 36171/5. Factor -dz*r - 16/5z*4 + 0 - 6/5z*5 + 0z - 14/5z3. -2z*2(z + 1)*2(3z + 2)/5 Let b be ((-140)/(-10) + 12)(-4)/(-26). Let -14/9a + b - 2/9a*2 = 0. What is a? -9, 2 Let k(q) = 2q*2 - 21970q - 30184141. Let w(o) = 20o2 - 241672o - 332025516. Let l(g) = 32k(g) - 3w(g). Factor l(d). 4(d + 2747)2 Let m = -4987303/4 - -1246828. Find r, given that -9/4r + mr3 - 5/4 + 7/4r*2 - 1/2r*4 = 0. -1, -1/2, 1, 5 Let t(k) = -2k + 28. Let c be t(17). Let h(p) = p*2 + 4p + 6. Let x be h(c). Suppose 17m4 + 5m*3 - 2m*3 - 3m*2 + m - xm*4 = 0. Calculate m. 0, 1 Let n(l) be the third derivative of 0l*3 + 0 + 1/2100l*7 - 1/300l*6 - 1/120l*4 + 0l + 1/120l5 + 140l*2. Factor n(o). o(o - 2)(o - 1)2/10 Let s = 687 + -671. Let l be (2 + s/(-12))/((-16)/(-6)). Factor 1/4h - lh3 + 1/4h2 - 1/4. -(h - 1)2(h + 1)/4 Suppose -60c + 30c = -1530. Factor -64 + 5h + 108h + ch*2 + 36h*3 - 4h*4 - 163h*2 + 31h. -4(h - 4)(h - 2)*2(h - 1) Let y be (-1 - 9/(-5)) + 822/91105-57. Factor yz*2 + 288/7 - 48/7z. 2(z - 12)2/7 Let t(d) = 14d*3 + 83d*2 + 6d - 93. Let g(q) = 8q3 + 41q*2 + 3q - 48. Let b(c) = -5g(c) + 2t(c). Factor b(p). -3(p - 1)(p + 2)(4p + 9) Factor 14771883/5 + 13314/5l + 3/5l*2. 3(l + 2219)2/5 Let z(h) be the second derivative of -h6/30 + 2h5/5 + 7h*4/6 + 49h*2/2 + 47h. Let m(f) be the first derivative of z(f). Factor m(u). -4u(u - 7)(u + 1) Let f(z) be the third derivative of -9/8z*4 - 4 + 0z - 11/20z5 + z3 - 4z*2. Determine q, given that f(q) = 0. -1, 2/11 Suppose 8y + 11761 = 36057. Factor 5d2 + 4760 - y - 280d + 2197. 5(d - 28)2 Let p(j) = 9j*3 - 485j*2 - 852j + 356. Let f(n) = 65n3 - 3395n*2 - 5965n + 2500. Let l(v) = -8f(v) + 55p(v). Factor l(k). -5(k - 21)(k + 2)(5k - 2) Let w(b) = 2b3 - 2b*2 - 266b + 26. Let x be w(12). Determine d so that -2/11dx + 0 + 2/11d = 0. 0, 1 Let f(d) = 4d2 - 108d + 208. Let h(w) = 12w2 - 326w + 626. Let g(n) = -11f(n) + 4h(n). Find q, given that g(q) = 0. 2, 27 Suppose -13y - 693 = -46y. Suppose 9w3 + 105 - yw*3 - 6w*2 - 3w*2 - 99w + 15w3 = 0. What is w? -5, 1, 7 Let x(a) be the first derivative of a3/4 - 30a*2 + 117a - 1064. What is p in x(p) = 0? 2, 78 Let x(c) be the third derivative of 0c - 115c*2 - 1/60c*6 - 19/24c*4 + 4/3c*3 + 9/40c*5 - 1/420c*7 + 0. Factor x(o). -(o - 2)(o - 1)*2(o + 8)/2 Let n be -1(26/(-91) - 26/7). Suppose 0 = -4m + 6m - j - 8, nj + 24 = 4m. Factor 14/11c*4 + 4c*m + 26/11c + 2/11c5 + 36/11c*3 + 6/11. 2(c + 1)*4(c + 3)/11 Let m = 18349/18 + -9134/9. Let f(k) = 2k + 31. Let j be f(-13). Find d such that -1/2 + md + jd2 = 0. -1, 1/10 Suppose -2884/3 - 440/3u - 4/3u2 = 0. Calculate u. -103, -7 Suppose -5g + 5o = -695, -583 = -4g - 0g - 5o. Let q = 142 - g. Factor qr3 - 1/2r*4 + 0r + r2 - 1/2. -(r - 1)2(r + 1)2/2 Solve 296/5j*3 - 8/5j*2 + 0 + 0j - 146/5j4 = 0. 0, 2/73, 2 Suppose 15b - 523b + 1845 = -9b + 116b. Let -1/2p*4 + 77/2p - 13/2pb + 49 - 33/2p*2 = 0. What is p? -7, -1, 2 Let l(c) be the first derivative of 1/6c*4 + 0c - c*2 + 0c*3 - 1/6c*5 - 2. Let z(b) be the second derivative of l(b). Factor z(g). -2g(5g - 2) Let m(z) be the second derivative of -95/6z3 + 55/12z*4 - 1/4z*5 - 91z + 45/2z2 + 0. Determine t so that m(t) = 0. 1, 9 Let q(s) = 71s - 548. Let j be q(8). Suppose -5o + 14a = 9a - j, 2o - a - 7 = 0. Factor 0 - 2/15wo - 8/15w - 8/15w2. -2w(w + 2)2/15 Suppose -u = 85 - 87. Solve 4i*3 - 3i + 4i4 - 28i*5 - 2i*3 + 29i*5 - 4i*u = 0 for i. -3, -1, 0, 1 Let k = 3674218/5 + -734843. Find o, given that 9/5o + 0 - ko2 = 0. 0, 3 Let u(q) be the third derivative of q7/1890 - 7q*6/270 + 91q*5/540 + 5q*4/9 - 3389q*2. Let u(t) = 0. What is t? -1, 0, 5, 24 Let i = -81 - -76. Let d be (-5216)/(-160) - 2/i. Factor 2r*2 + 4r*2 + 38r*3 + 14r*2 - 5r - dr3 - 20. 5(r - 1)(r + 1)(r + 4) Let v be (712/840 - 1) + 63/49 + -1. Let t(s) be the first derivative of -vs3 - s2 - 12 + 1/2s*4 + 2/25s*5 + 0s. Suppose t(o) = 0. Calculate o. -5, -1, 0, 1 Let q(m) = 11m2 - 56m - 1272. Let l(c) = -10c2 + 50c + 1270. Let y(n) = 6l(n) + 5q(n). Factor y(v). -5(v - 18)(v + 14) Let z(q) be the third derivative of -q*5/28 - 13q*4 + 146q*3/7 - 112q*2 + 5q - 1. Determine v, given that z(v) = 0. -146, 2/5 Let u(z) = 11z4 + 62z*3 + 93z*2 - 56z - 100. Let r(j) = -80j4 - 435j*3 - 650j*2 + 390j + 700. Let c(n) = 2r(n) + 15u(n). Solve c(s) = 0. -10, -2, -1, 1 Let t(k) be the second derivative of k*4/6 - 107k*3/3 + 106k*2 - 5624k. Factor t(f). 2(f - 106)(f - 1) Factor 5o2 - 20o*2 - 36o*2 + 260o + 4o3 - 168 - 45o*2. 4(o - 21)(o - 2)(o - 1) Suppose -2o + 2n + 1525 = 1503, n + 17 = 2o. Solve -9/5d*2 - 39/5d + o = 0 for d. -5, 2/3 Let p be (-2 - 0) + (2 - 1 - -2). Suppose -2f - 4w + 7 = -w, -f = -3w + p. Factor -v2 + 275v + 6 - 272v - 2v*f. -3(v - 2)(v + 1) Let u(k) be the third derivative of k5/60 + 4k*4 - 2k*2 + 211. Factor u(s). s(s + 96) Factor 4/9v2 + 50/9v + 28/3. 2(v + 2)(2v + 21)/9 Let l(s) = s3 + 11s*2 - 13s - 10. Let r be l(-12). Let 7407v3 - 7387v*3 - 4v*5 - 16v - 2v2 + rv2 = 0. What is v? -2, -1, 0, 1, 2 Let t(f) be the second derivative of -f6/120 - f*5/80 + 291f + 4. Let t(l) = 0. Calculate l. -1, 0 Let c = -5 + 0. Let y be c/(-2)16/4. Factor -8 + 8 + x3 - 5x - 6x3 + yx*2. -5x(x - 1)2 Let -3/2g*5 - 117g*3 + 675/2 + 45/2g - 45/2g4 - 219g*2 = 0. Calculate g. -5, -3, 1 What is i in -41/2i + 83/4 - 1/4i2 = 0? -83, 1 Let u(q) be the second derivative of 27/8q*4 + 75/4q*2 + 12 - 51/4q*3 - 2q - 3/40q5. Factor u(x). -3(x - 25)(x - 1)2/2 Let t(q) be the second derivative of -q7/98 - 7q*6/5 - 144q*5/35 + 7q - 10. Find m such that t(m) = 0. -96, -2, 0 Suppose -2t - 80 = -5y, 0y + 3t = 4y - 71. Suppose -w - 5 = -f, y = 4f - 2w + w. Factor 121n*2 + 7n*3 - 113n*2 - 15n*f + 4n*4 - 2n*4. 2n*2(n - 2)*2 Suppose -3r + 3k + 7 = 2k, 5r = 5k + 15. Let -v - 22v2 + 35v*2 - 14v*2 + r = 0. Calculate v. -2, 1 Factor -60200k - 200k3 + 181202 + 6854k*2 - 920k*4 - 650k*2 + 922k*4. 2(k - 43)*2(k - 7)*2 Let c = -319/85 - -4317/1105. Find w such that -4/13w + 30/13 - cw2 = 0. -5, 3 Suppose -26 - 25 + 3 - 30y*2 - 9y*3 + 76y + 34y3 - 23y*3 = 0. What is y? 1, 2, 12 Let o be (3 + 3/(-9))/((-24)/(-108)). Let r be (6/18o)/2. Factor 4/17u - 2/17u*r + 0. -2u(u - 2)/17 Let b(m) be the second derivative of m4/32 + 11m*3/16 - 15m*2 + 5597m. Suppose b(h) = 0. Calculate h. -16, 5 Suppose -927 = 12p - 987. Solve -1/5y + 0y3 + 1/5y*p + 0 + 2/5y*4 - 2/5y2 = 0 for y. -1, 0, 1 Let f(q) be the second derivative of -q6/135 + 7q5/15 - 157q*4/54 + 64q*3/9 - 76q*2/9 - 571q - 1. Suppose f(h) = 0. What is h? 1, 2, 38 Let p(d) = -3d3 - d2 + 7d + 1. Let i(u) = 15u3 + 150u*2 - 687u - 6. Let z(k) = -i(k) - 6p(k). Factor z(y). 3y(y - 43)(y - 5) Let g(d) be the first derivative of 85d4/4 + 335d*3/2 + 190d*2 - 75d/2 - 11731. Let g(w) = 0. Calculate w. -5, -1, 3/34 Let t(h) be the first derivative of -3h4/4 - 702h*3 - 369603h*2/2 - 10461. Factor t(s). -3s(s + 351)2 Suppose -5 + 9 = a. Suppose -at = -8t + 4. Determine m, given that 6 + t - 3 + 16m + 12m2 = 0. -1, -1/3 Let h(a) be the first derivative of 39/8a*2 + 1/8a*3 - 129 + 0a. S	{ "pile_set_name": "DM Mathematics" }
. Which is greater: r or t? r Let z be 44/154 + (-7114)/56 + 1. Which is bigger: z or -126? z Suppose -2o + 55 = 3o. Suppose 3y - oy + 88 = 0. Suppose 4r = r + 36. Is y less than or equal to r? True Let h = 298 - 297. Let m(w) = -w2 - 34w - 141. Let s be m(-29). Which is smaller: s or h? h Let q(c) = 101c2 + 314c + 1242. Let a be q(-4). Which is bigger: 1600 or a? a Let n = -121.2 - -130. Let w = 14.8 - n. Let l = -53 + w. Is 1 less than l? False Let x = 29/18243 - -1221423463/72972. Let m = -16651 + x. Which is smaller: 88 or m? m Let j(x) = x*2 - 23x + 1816. Let c be j(-46). Is 4988 <= c? True Let y(l) = 2l2 - 21l - 117. Let o be y(15). Suppose -121 = 4q + 7. Let u = -13 - q. Which is smaller: u or o? o Suppose -1053921 - 51868 = -579m + 518306. Which is smaller: m or 2812? m Let y = 1342 + -1342. Are y and -0.4333 non-equal? True Let z(h) = -h3 - h2 + 2h + 1. Let c be z(-2). Let s = 20171948523/88872314 - 1/2066798. Let w = 227 - s. Does c = w? False Suppose -3m + x + 14 = 4, 2m + 3x - 14 = 0. Suppose 0 = q - 2q + d - 2, -mq = -d + 5. Let s be (q - -2)-19 - (2 + -2). Which is greater: s or -20? s Let f be (-184)/(-32) + (-3)/(-12). Suppose 0 = -11p + 284 - 339. Which is smaller: f or p? p Let z = -296 + 301. Suppose zn - 4h + 3 = -2, 5h - 1 = n. Let j be 147/(-492) + 2/8. Which is smaller: n or j? n Let w be ((-70)/40 - -2) + (-659)/(-4). Let x = -173 + w. Let z be (25/35 - 4)2. Is z bigger than x? True Suppose 19 = -10y - 18 - 13. Which is greater: -127/25 or y? y Suppose -5j - 5u = -2u + 6, -3j - 5u = 10. Let f = 14448/1431481 - -2/7417. Which is smaller: f or j? j Let v be (6/(-60)2)/1. Let g = -12.2 + 1.2. Let h = g + 15. Is v at most as big as h? True Let t(r) = -9r*2 - 26r - 31. Let o be t(14). Is -2161 >= o? False Suppose 4o + 4 + 4 = 4m, o = -m - 2. Let x(k) = -11k + 6. Let n be x(o). Let u(c) = 4c*2 + c - 6. Let w be u(-3). Which is bigger: n or w? n Suppose -13g - 12g + 19g = 3g. Are -47 and g equal? False Suppose -h = -6h - u - 3, -6 = 5h + 2u. Suppose 9n - 5n + 3c - 9 = 0, -n + 3c - 9 = h. Is n less than -1/295? False Suppose 18r + 9r - 597 = -2109. Is r > -73? True Suppose -4h = 5n - 49, 2n - 2h - 7 = n. Suppose 15 - n = 6z. Let f be 4/180(1 - (z + -1)). Which is bigger: f or 0? f Let o be -9 + 12 - (2 + -1). Let p be o-1(-3236)/7824. Let q = p - -1/163. Which is smaller: 1 or q? q Let y(r) = 4r - 20. Let m be y(8). Let p be 344/(-1488) + 2/m. Let w = 3.0041 + -0.0041. Is p <= w? True Let c be ((-2)/3)/213. Let n = -18073 - -18069. Which is smaller: c or n? c Let r = 0.3782 - 0.3702. Are r and -3 unequal? True Suppose -4r = -5u - 134, -4u + u - 78 = -3r. Let k be ((-155)/(-30) - 2)/(1/(-9)). Which is greater: k or u? k Let w = 1.93387 + 0.06613. Is -203 >= w? False Let r = 0 + -2. Let f = 166 + -391. Let x = f - -219. Is r < x? False Let v = 247 + -312. Let c = 64 + v. Which is greater: -3/161 or c? -3/161 Suppose -21m = 10m - 9m + 8778. Do m and -3592/9 have different values? True Let s = -134 - -158. Let g be (33/(-43))/((-2)/((-32)/s)). Is 0 at most g? False Suppose 3x - 4 = 4f, 0 = -3f - 2f - 4x + 26. Let j be (-15)/(-18)(-87)/(-10) + -6. Which is smaller: f or j? j Suppose -4 - 2 = -3a. Let o be 3(-7)/378-29. Is o smaller than a? True Let x = -563/150 - 2/25. Let b = -2602 + 2601. Which is smaller: x or b? x Let r be (-378)/248(-52)/(-30). Let u = -54/31 - r. Let x be 3 - 28/(-35)(-25)/10. Is x >= u? True Let v(h) = -h3 - 2h*2 + 4h - 3. Let u be v(2). Let p = -14 + 14. Suppose -37f + 34f - 24 = p. Which is bigger: f or u? f Let q be 1/(1/(-4 + 9)). Let b be ((-20)/q - -7) + -3. Let d be -1 - (38 + -5 + b). Is d greater than -34? False Let t(m) = 2m2 - 36m - 34. Let j be t(18). Let o(k) = 3k3 - k + 1. Let x be o(2). Let v = x + j. Is -11 less than or equal to v? True Let s be 4/6 - (-206)/6. Let o be (-9 - (-4608)/105) + (-21)/(-6)2/5. Is s > o? False Let b(i) = 4i2 + 10i - 6. Let t be b(-6). Suppose -69h - 108 = -th. Is 2/15 < h? True Let t = 13/86 - 211/258. Is t < 0.4745? True Let a = 19414 - 19382. Which is smaller: 0.07 or a? 0.07 Let a be 4/(-20)-3 - (-426)/15. Let j = -31 + a. Let z be ((-7)/(-3))/(j/(0 + 8)). Is z less than or equal to -8? True Let v = 7.76 - 39.66. Let x = -32 - v. Let m = 57/2 - 103/4. Which is smaller: m or x? x Suppose 39558 = 26s - 83s. Is -2 at most s? False Let c = -878 - -1258. Suppose 4w - 4m = c, 2w + 3m + 101 = 3w. Let v = 462/5 - w. Is v less than 16? True Suppose -60r + 38r + 9372 = 0. Do 423 and r have the same value? False Suppose -12a = 4d - 13a - 8341, 0 = 3a - 9. Which is smaller: d or 2087? d Suppose 93664 = -35a - 199111. Which is bigger: -33455/4 or a? -33455/4 Let i be 4/2 - (-1000)/(-480). Suppose -39r + 35r = 0. Is r != i? True Suppose 7 = -3l - 2c, 0l - 3l - 5c - 13 = 0. Let q = -166 + 162. Let g be (1/q)/(555/20). Which is greater: g or l? g Let z = 2 + -2. Suppose 2c - 6 = 5f - 0c, z = 4f - 2c + 4. Let b = 4431 - 8863/2. Is b smaller than f? False Suppose -76p + 65p = 4818. Let x = p + 437. Which is smaller: -10/13 or x? x Let n(y) = y3 + 3y*2 - 3y + 1. Let v be n(1). Let b be ((-1 + v)-1)/(-1). Let z be ((-324)/111)/(-1) + -3. Is b greater than z? True Let p(n) = n2 + 13n + 44. Let s be p(-7). Let z(t) = t3 - t2 - 4. Let c be z(s). Which is smaller: c or 2/147? c Let u = 251/2 + -125. Let h = -449/22 - -28528/1397. Are h and u equal? False Let r = -2782 + 2784. Does 207 = r? False Suppose 5t + 4u + 1093 = 0, 5u + 887 = -8t + 4t. Which is greater: t or -216? t Suppose 147 = -7s + 294. Suppose -sj + 602 = -511. Which is greater: 54 or j? 54 Suppose 4f - 72 - 276 = 0. Let c = f - 137. Let w = c - -41. Which is smaller: -11 or w? -11 Let v be 3/(-6)(-1 - 1). Let l be ((3510/4)/9)/((-14)/21). Let u = l + 20463/140. Is u > v? False Let a be (0/1)/(0 + (-4)/2). Suppose 6k + 0k + 150 = a. Let s = 12 + -13. Which is bigger: k or s? s Let v = -411.38 - -409. Let a = v - -4.48. Is 1 not equal to a? True Let l = 347 - 340. Let f be ((-6)/l)/((-1)/(-28)). Let n(a) = -8a - 1. Let g be n(3). Which is smaller: f or g? g Let p be 1/(((-8)/(0 - -32))/2). Which is smaller: -69/10 or p? p Let i = -235.98 + 238.9051. Let j = 0.0749 + i. Which is greater: -65 or j? j Suppose 10390 = 2l + 77l + 752. Let u be 126 + 0 - 4/2. Which is bigger: l or u? u Let b be 6726/42 + 4/(-28). Suppose -32x = -28x - b. Is 4 not equal to x? True Let l(i) = -2i2 - 15i + 26. Let z be l(-10). Let b be z/(159/30 - 5). Is b not equal to -80? False Let t = 7604.9 + -7270. Let a = -335 + t. Is -462 greater than a? False Suppose 4o - 17 = -13v, v = 5o - 0 - 4. Is 4/323 greater than v? False Let h = 186.231 - 186. Let k = 0.318 - h. Is 0.1 greater than k? True Let s = -32 - -37. Let d(c) = 0 - 2 + s - 13 + c. Let h be d(9). Is h equal to -2/13? False Suppose 0 = -3o - 3g + 12, 9 = 3o + 4g - 8. Suppose -3s - 189 = -0s. Let a be 6/s(-112)/12. Is a < o? False Let x(h) = -4h + 36. Let z be x(8). Let c be -13 + 2 + -1 - z. Let a be (8/3)/(c/120) + -3. Is -24 equal to a? False Let f = -256.96 - -252. Let l = -6.3 - f. Let v = l + -4.66. Which is smaller: v or 6? v Let d(g) be the third derivative of -11g6/20 + g5/15 - 5g4/24 + g3/3 - 2g*2 + 69g. Let m be d(1). Which is greater: m or -64? -64 Let b = -9.799 - -6.799. Which is smaller: -226 or b? -226 Let v(n) = -n*3 - 13n*2 - 13n + 42. Let l be v(-7). Which is greater: l or -178? l Let f = 254 - 425. Let g = 174 + f. Is g bigger than 27? False Let h = 42.28 - 1318.28. Is h at least -1? False Let h(m) = -408m + 680. Let w be h(4). Is w != -950? True Suppose -3d + 8 = -2g - 4, -2d - 2g + 18 = 0. Suppose -d = 4l - 18. Suppose -12 = m - lm. Is m < 10? True Let p be 54/(-351) - (-54368)/(-494). Let d = -110 - p. Which is smaller: -1 or d? -1 Let m be (-93)/((-3)/264-12). Are -683 and m nonequal? True Let g = -30470 + 30471. Which is greater: g or -18/605? g Let i be 23/(-7) - (-512)/1792. Let p = 15.91 + -16. Which is smaller: i or p? i Let j(y) = y*3 - 32y*2 + 70y - 56. Let b be j(30). Is 487/2 at least as big as b? False Suppose 288*z + 4328 - 3197 = -4053. Is z at	{ "pile_set_name": "DM Mathematics" }
se 4j - 104 = -2t, -77 = -j - 2j - 2t. Let f = 94071 - 94066. Solve fo = -j + 12 for o. -3 Suppose -2d - 10 + 4 = 0. Let w be ((4 - d)/21)/(1/(-309)). Let v = w + 103. Solve -b - 4b + 15 = v for b. 3 Let k(r) = r3 + 6r*2 - 2. Let i = -366 + 363. Let h be k(i). Solve -5d = -0d + h for d. -5 Suppose -12h + 29 = -103. Suppose -13w = -hw - 4. Solve -ws - 3 = -s for s. -3 Let j = -17034 + 17247. Solve 49z - j - 81 = 0 for z. 6 Let b = 95 + -92. Suppose -bw - 78 = -87. Solve -wz = z for z. 0 Let x(k) = 4k2 + 38k + 95. Let r be x(-5). Let n(g) = 2g2 - 3g. Let q be n(-3). Solve rs + q = -4s for s. -3 Let z(x) be the third derivative of x*4/6 + 4x*3/3 - 85x*2. Let v be z(3). Solve 16j = 11j - v for j. -4 Let m(z) = -2z*2 + 15z - 23. Let i(l) = 4l2 - 29l + 46. Let q(d) = 3i(d) + 5m(d). Let a be q(6). Let w = 23 - a. Solve -1 + w = x for x. -1 Suppose -4y - 12 = 0, 23m - 3y = 19m + 29. Suppose -mo + 0g + 3 = -3g, -3o = g - 13. Suppose 1 + 5 = 2r. Solve 0 - o = -ri for i. 1 Let h(p) be the third derivative of p*4/12 - 31p*3/6 + 7p*2. Let m be h(17). Suppose -ma + 32 = 3c + 2, 0 = -5c + 4a + 68. Solve -l - c = 3l for l. -3 Suppose 5r - 5k = 145, -3k = 2r + k - 28. Solve 39a - 51a - r = 0 for a. -2 Let g = -74 - -94. Suppose 6 = 2o - 2. Let f be 3 + 2 - o/2. Solve -fu + g = -8u for u. -4 Let z = 425 - 418. Suppose 0 = r + z - 8. Solve -6a = r + 11 for a. -2 Let u(z) = -4z2 + 76z + 4. Let s be u(19). Suppose 13c = 11c + s. Solve -5t = -c - 23 for t. 5 Let x = -2819 - -2871. Solve -64n = -xn - 48 for n. 4 Let r = 135 + -105. Let d be 130/r - -22/6. Solve dg - 10 = 7g for g. -5 Suppose -u + 3s + 71 = 0, 190 = u + 3s + 65. Solve -21w = -uw - 462 for w. -6 Let w(c) = 51c + 962. Let q be w(-18). Solve -40u - 8 = -qu for u. 2 Let v be 72/15 + -2 + (-3)/(-15). Suppose 2x = 6x + 3d - 12, 5d - v = -x. Solve xy = 2y for y. 0 Suppose p - 5r = -27, 3r + 2 = -8p + 6p. Let x be 0/(3 + 2 + -4) - p. Solve -xd - 8 = -3d for d. -2 Let p = 9613 + -9432. Solve pf = 189f + 32 for f. -4 Let k = -31169 - -31172. Solve -662w = -665w + k for w. 1 Let p(y) = 7y - 91. Let d be (28/(-10))/((-4)/20). Let x be p(d). Solve -6 + x = -r for r. -1 Let r be 4/24 + (-110)/(-60) + 35. Solve -ro = -33o - 12 for o. 3 Let u be 104/(9 - -4) - 1. Solve ut - 28 = 3t for t. 7 Suppose -i = -a + 6, -10a = 2i - 8a - 4. Let b be i/(-18) + -9 + 1672/99. Solve 2x = -2x + b for x. 2 Let g be ((-242)/(-99))/11 + 2 + (-20)/9. Solve 37m - 34m - 3 = g for m. 1 Suppose 3w + 5m - m = 22, -12 = -2w - 2m. Suppose 0 = s - 3 - 0. Suppose -5r - su = -u - 143, -3r + 101 = 5u. Solve 0 = -5c - w + r for c. 5 Let h = 4133 + -4128. Let k(m) = -m*3 - 8m*2 - 11m - 12. Let s be k(-7). Solve i = hi + s for i. -4 Let w be (9/6 - 3)(-20)/15. Let d(t) = t*3 - 1. Let b be d(w). Solve -3 = -4f + bf for f. -1 Let f be (2/7)/((-1)/(-7)). Suppose fd + 2d = 4. Let g = -12595 + 12599. Solve -l - d = -g for l. 3 Let f(u) = -2u*2 - 3u + 2721. Let z be f(36). Solve -4s + 9 = z for s. -3 Let q(f) = -f2 - 12f - 7. Let l(x) = 2x2 + 0 + 9 + 0x - 2x3 + x3 + 3x. Let p be l(4). Let v be q(p). Solve -vn = -0n for n. 0 Let f be 250/(-2125) - 4/(-34). Let x(t) = t*2 - t - 4. Suppose 4i - 4p = -7p - 3, p + 9 = -4i. Let l be x(i). Solve 9s - ls + 2 = f for s. -2 Let o = 11 - 8. Let f = -48 + 13. Let r = -34 - f. Solve -8 = -og + r for g. 3 Let i be 33/1 + 26 + -27. Solve 57z + i = 65z for z. 4 Let q be (-3)/(-1) + 33/11. Suppose c - qc = -10. Suppose s - 32 = -cd, 0 = 2d - s - 28. Solve 0 = 4b - b + d for b. -5 Let r = -15296 - -15315. Solve -rl - 39l - 174 = 0 for l. -3 Suppose 220i + 5490 = 458i - 229i. Solve -i = -15p - 685 for p. -5 Let p(h) = 10h2 + 487h + 9. Let m be p(-49). Solve -m = -55x + 29x for x. 6 Suppose -b + 3w - 6 = -w, -5b = -3w + 47. Let i = b - -15. Let c(q) = -q3 - 6q*2 + q + 8. Let m be c(-6). Solve mz = iz + 6 for z. -2 Let f = 24 - 19. Suppose 2c + u - 3 = -22, fc + 5u = -55. Let n be 48/4(c/(-6) - 1). Solve 4o = -0o + n for o. 1 Let c(f) = 4f*2 - 15f - 4. Let m(j) = -j*2 + 8j - 12. Let r be m(4). Let b be c(r). Solve 4t + 4 + 8 = b for t. -3 Let j be (-33)/(8/1392-9). Let y = j + -636. Solve 4r + yr = -18 for r. -3 Let s = -10919 - -10968. Solve sq = 13q + 216 for q. 6 Suppose -5u = 4p + 135, -3u + 28 = -4p + 77. Let t = u - -71. Let o = 54 - t. Solve -oi = -3i + 12 for i. -4 Let s be 63/(16 - 15) + 12/(0 + 2). Solve -s = 4i - 65 for i. -1 Let y(i) = -i3 + 7i*2 + 12i - 25. Let a be y(8). Suppose -6b + ab = 0. Solve b = h - 1 - 2 for h. 3 Let o(f) = 15f2 + 314f + 16. Let x be o(-21). Solve -50l - 65 = -xl for l. -5 Let c(q) = 420q + 3367. Let s be c(-8). Solve -3327 + 3376 = -sg for g. -7 Let x be 22/4 + (-11)/(-22). Suppose 2l = 4z + 11 + 1, 2z + x = 5l. Let d be -5 - 13/((-13)/30). Solve 5f + 0f + d = l for f. -5 Let q(l) = -3l - 13. Let s be q(-6). Suppose -2m + s = -m. Suppose i - 6 = -2h, 12 = -0i + 3i + 4h. Solve it = -mt for t. 0 Let z(v) = v*3 - 15v*2 - 4v + 62. Suppose -5h + 4l - 83 = -10h, -4l - 67 = -5h. Let n be z(h). Solve -na - 40 = -10a for a. 5 Let m(n) = 2n*2. Let y be m(1). Let h be -3 - (-19 + 12 + 2)/1. Solve y = 4z - h for z. 1 Let y(a) = -48a - 3557. Let x be y(-78). Solve 2b - 195 = -x for b. 4 Suppose 10 = 5h + 2k, 6h = 10h - 5k + 25. Let m(g) = 40g - 226. Let a be m(6). Solve -2d - ad - 48 = h for d. -3 Let c(u) = -u*3 + 8u*2 + 83u + 11. Let y be c(14). Let t be (-12y/12 - 1)8. Solve -15n + tn - 1 = 0 for n. 1 Let i = 73 - 78. Let p be i/25 + (-392)/(-10). Suppose -40n + pn = -12. Solve 0h + 3h = -n for h. -4 Let f(n) = n*3 - 2n*2 - 35n + 16. Let o be f(7). Suppose -v + o = -2v - 5z, 4z = -4v. Solve 25 = -vb - b for b. -5 Suppose -53k + 709 + 1040 = 0. Solve 0 = -ka + 74 + 25 for a. 3 Let g be 163/(3/1). Suppose t - 9t = -g. Suppose -3l - 2h = -2l - 2, -2h = -l + t. Solve -7 = -f - l for f. 5 Let l = -15942 - -15972. Solve -17 = -lf + 13f for f. 1 Let u be (-46)/(-14) + (-2)/7. Let s(o) = o3 - 5o*2 - 3o - 22. Let f be s(7). Suppose f - 10 = 5d. Solve d + 0 = -uv for v. -3 Suppose 9x - 1936 = -5x - 30x. Solve x = 24b + 164 for b. -5 Let t = -66 + 246. Let s be 4/(-14) + t/140. Solve p - 6 + s = 0 for p. 5 Let p be 20 - (-4 - (-6)/2). Suppose 457 = 33d + 61. Suppose -s - d = -16. Solve su = 5 - p for u. -4 Let i = -98 - -99. Solve -26x = 79 - i for x. -3 Let t(l) = 28l + 13. Let m be t(8). Solve m - 225 = 3v for v. 4 Let s(z) = z3 + 9z*2 - 83z - 34. Let v be s(6). Solve 0 = vf + 1 - 25 for f. 3 Suppose 3c = 5b - 0b - 15, -5b - 20 = 4c. Let g(o) = -o*3 + 40o*2 - 81o + 194. Let y be g(38). Solve b = -5n + yn for n. 0 Let r be (-4)/16-4 - -4. Suppose 8f - 13f = r. Let a(j) = -3j3 - j2 - j. Let v be a(f). Solve -1 = -vh - 4 for h. -1 Let x(u) = 2u*2 + 6u. Let n be (28/(-3))/(1/3). Let s = n + 25. Let c be x(s). Solve -h + 3 - 8 = c for h. -5 Let n be ((-63)/(-6))/((-3)/16). Let w = 59 + n. Suppose -x = wx - 0x. Solve 0 = -xu - 5u + 25 for u. 5 Let h(n) = n*2 + 14n - 40. Let v be h(-17). Let a(r) = -r + 15. Let z be a(v). Suppose zc + 5m - 20 = 0, 3m = -4c - m + 20. Solve 0 = -3b - c + 14 for b. 3 Suppose -5f + 30 = 5b, 0f - 2b = 3f - 22. Suppose 168 = 90m + 31m - 79m. Solve mr = -f - 10 for r. -5 Let i(l) = l. Let p(z) = 54z - 36. Let c(t) = 72i(t) - p(t). Let w be c(-2). Solve 2d = -wd for d. 0 Suppose -9 = 4q + 5j, 4q - 3j - 26 = 5. Solve -7x + q = 11 for x. -1 Let f = 20513 - 18398. Solve 2150 = -7y + f for y. -5 Suppose -375 = 24w - 375. Let s = 78 + -52. Solve w = 4m - s + 6 for m. 5 Let b = -6836 - -6885. Solve -13 + b = 9w for w. 4 Suppose o + a = 2, 0o - 10 = -2o + a. Suppose ok + 2 - 18 = 0. Solve 0r + 2r - k = 0 for r. 2 Suppose -146b + 145b + 2i + 39 = 0, 4b - 5i = 180. Solve 30 = -17x - b for x. -5 Suppose 19u - 55 = 8u. Suppose -5p - 19 = 4d - d, -ud = p + 17. Let n be (1 + p - -1)/(-6 + 9). Solve n = 4h - 8 for h. 2 Suppose 18 = 5t - 2s, -5t = -6s + s - 30. Let i be t*(-1 + -2)/(-6) - -3. Suppos	{ "pile_set_name": "DM Mathematics" }
e 9) in base 12? -1245a 18183 (base 9) to base 5 400144 What is -4212 (base 5) in base 7? -1424 -2405 (base 6) to base 10 -581 10833 (base 9) to base 8 16107 -7263 (base 9) to base 15 -189c Convert -113621 (base 7) to base 9. -31158 Convert -7219 (base 13) to base 14. -5a43 What is -24157 (base 8) in base 5? -312401 What is -101100000 (base 2) in base 9? -431 What is -46d (base 15) in base 5? -13003 Convert 996 (base 10) to base 15. 466 Convert -3431 (base 5) to base 2. -111101011 Convert -211212 (base 4) to base 13. -1131 Convert 65887 (base 9) to base 7. 241342 What is -54c1 (base 14) in base 13? -68a9 10201201 (base 3) to base 15 c14 What is 1432 (base 15) in base 14? 180a 2c8 (base 13) to base 11 417 -1000011100100011 (base 2) to base 10 -34595 Convert -ecde (base 15) to base 10. -50159 da5 (base 15) to base 3 11020002 What is -1012 (base 14) in base 2? -101011001000 Convert 73a (base 14) to base 2. 10110010000 What is 232e (base 15) in base 11? 5680 11011 (base 2) to base 8 33 -588 (base 9) to base 6 -2125 3012 (base 9) to base 6 14102 What is -443003 (base 6) in base 4? -21001023 -1312 (base 12) to base 11 -16a7 -31121 (base 5) to base 4 -133310 What is -190 (base 15) in base 6? -1400 Convert -1b3 (base 12) to base 16. -117 Convert -6255 (base 11) to base 15. -26c8 Convert -22441 (base 5) to base 9. -2201 Convert -100111111100 (base 2) to base 14. -d08 1a56 (base 11) to base 14 d3c Convert 100011110 (base 2) to base 8. 436 -1432 (base 15) to base 6 -32002 Convert -1042 (base 6) to base 3. -22222 What is -5 (base 7) in base 14? -5 Convert -19da (base 14) to base 7. -16463 What is -531 (base 12) in base 11? -629 2111121010 (base 3) to base 16 c07e 1010342 (base 5) to base 9 24373 What is 8b71 (base 13) in base 15? 5bbc Convert -42520 (base 6) to base 16. -16b0 Convert 540 (base 11) to base 12. 461 -10545 (base 6) to base 15 -6a5 What is -554 (base 10) in base 6? -2322 13db (base 14) to base 10 3525 -2a93 (base 13) to base 6 -44420 Convert 9c (base 14) to base 12. b6 What is -1031 (base 6) in base 11? -1a4 Convert b312 (base 13) to base 9. 36772 -5011 (base 9) to base 4 -321013 Convert -3112120 (base 4) to base 16. -3598 What is 1d76 (base 16) in base 12? 4446 1289 (base 12) to base 10 2121 211012 (base 4) to base 5 33444 -bc94 (base 14) to base 3 -1122210212 What is -486 (base 15) in base 12? -716 Convert -4397 (base 10) to base 11. -3338 -177 (base 13) to base 11 -223 What is -35416 (base 7) in base 5? -243002 Convert -4010 (base 6) to base 12. -606 What is 1065 (base 8) in base 13? 346 What is -5053 (base 7) in base 15? -7bd -33013111 (base 4) to base 3 -10010220221 -46824 (base 10) to base 4 -23123220 What is -10210 (base 5) in base 6? -3052 -1410 (base 6) to base 7 -1032 Convert 4640 (base 14) to base 4. 2332300 Convert -9c6 (base 13) to base 8. -3223 Convert -20541 (base 6) to base 15. -c67 What is -2db (base 15) in base 3? -220022 Convert 1101101000011 (base 2) to base 12. 4057 What is -100221001 (base 3) in base 4? -1301011 What is -33223 (base 4) in base 12? -6b7 -304 (base 13) to base 2 -111111111 What is 210010221 (base 3) in base 15? 487a What is -4232 (base 7) in base 2? -10111010101 Convert -171 (base 8) to base 7. -232 Convert -52875 (base 9) to base 4. -20202203 Convert -593 (base 11) to base 14. -387 2140 (base 5) to base 3 101221 What is 8580 (base 10) in base 14? 31ac Convert 103550 (base 9) to base 11. 42389 Convert 25884 (base 10) to base 9. 38450 Convert -19191 (base 12) to base 6. -441101 -352 (base 16) to base 14 -44a What is 2288 (base 10) in base 9? 3122 736 (base 8) to base 10 478 a940 (base 11) to base 15 442d 1140 (base 12) to base 9 2563 6114 (base 13) to base 16 3438 Convert -3421 (base 6) to base 12. -571 105203 (base 6) to base 8 21343 1104 (base 5) to base 9 181 Convert -551 (base 7) to base 13. -188 What is -1012000 (base 4) in base 16? -1180 144014 (base 5) to base 4 1133312 Convert -1123200 (base 4) to base 13. -2886 What is -13c2 (base 14) in base 6? -24114 -95 (base 16) to base 15 -9e Convert 20001201 (base 3) to base 13. 2020 Convert 11111100000010 (base 2) to base 13. 745a 731 (base 10) to base 7 2063 What is -411 (base 10) in base 16? -19b Convert 28 (base 12) to base 10. 32 What is f1a (base 16) in base 13? 19b5 Convert -111111000001 (base 2) to base 5. -112113 -105645 (base 7) to base 13 -876c 102001 (base 3) to base 9 361 1201 (base 8) to base 5 10031 Convert -8124 (base 9) to base 8. -13457 -25c4 (base 16) to base 9 -14232 What is -101110111101001 (base 2) in base 10? -24041 -100010100000000 (base 2) to base 10 -17664 What is -11202020 (base 3) in base 6? -24010 Convert 444 (base 7) to base 10. 228 What is 938 (base 13) in base 6? 11132 121102 (base 3) to base 6 2015 What is 2583 (base 12) in base 11? 3237 Convert -1b (base 13) to base 14. -1a Convert -11136 (base 8) to base 5. -122302 572 (base 9) to base 7 1241 What is -100010001011 (base 2) in base 16? -88b What is -42420 (base 5) in base 7? -11224 -20 (base 15) to base 3 -1010 What is -432505 (base 6) in base 9? -53755 What is 301 (base 6) in base 14? 7b 111000000111111 (base 2) to base 11 1a653 What is 1232 (base 5) in base 11? 165 -204550 (base 7) to base 12 -184aa Convert -10121221020 (base 3) to base 16. -116e2 -1a5 (base 11) to base 13 -152 What is -1000101110011101 (base 2) in base 13? -13364 Convert -420113 (base 5) to base 7. -55120 What is -13041 (base 5) in base 7? -2656 -747 (base 8) to base 9 -601 What is 1717 (base 11) in base 3? 10000100 What is b80 (base 14) in base 3? 10010000 Convert 100d (base 14) to base 16. ac5 What is 706 (base 12) in base 14? 526 31 (base 5) to base 15 11 What is 31252 (base 9) in base 12? bb25 1e (base 15) to base 9 32 -23211 (base 6) to base 14 -12d1 Convert 1099 (base 14) to base 2. 101100111111 Convert -10342 (base 6) to base 10. -1430 Convert 1300433 (base 5) to base 9. 37408 Convert 334253 (base 6) to base 3. 1102122220 1925 (base 12) to base 11 2326 Convert 53045 (base 6) to base 11. 5417 Convert -100031 (base 5) to base 7. -12105 Convert -1a58 (base 11) to base 5. -40404 What is -3311 (base 7) in base 9? -1555 Convert 10301 (base 4) to base 9. 368 55d (base 16) to base 12 965 -792 (base 16) to base 9 -2583 -4b16 (base 12) to base 7 -33552 Convert 1044025 (base 6) to base 2. 1100110111110001 What is -60602 (base 7) in base 9? -22145 -1060 (base 9) to base 4 -30033 -55a3 (base 11) to base 7 -30332 32412 (base 5) to base 15 9dc 340 (base 13) to base 10 559 What is -350 (base 14) in base 10? -658 -560 (base 16) to base 7 -4004 What is 37b (base 14) in base 6? 3121 Convert 23443 (base 8) to base 14. 3919 Convert c4 (base 14) to base 5. 1142 What is 1669 (base 13) in base 2? 110011100010 4055 (base 6) to base 11 748 Convert 70c (base 16) to base 5. 24204 Convert -10011000100 (base 2) to base 3. -1200012 What is -344 (base 15) in base 11? -612 1000101101 (base 2) to base 13 33b -20310 (base 8) to base 15 -2747 -2e9a (base 15) to base 4 -2130331 Convert 1061 (base 10) to base 12. 745 What is -1ca (base 15) in base 6? -1531 30 (base 6) to base 9 20 Convert 130023 (base 4) to base 12. 1063 What is -27117 (base 8) in base 4? -2321033 What is 141204 (base 5) in base 14? 2188 What is -371 (base 12) in base 13? -30a Convert -20123 (base 6) to base 16. -a53 What is 120211 (base 4) in base 7? 4405 What is 252 (base 11) in base 7? 605 Convert -19aca (base 14) to base 3. -10022111200 -1333032 (base 5) to base 12 -13943 What is -3377 (base 10) in base 12? -1b55 What is -34595 (base 10) in base 2? -1000011100100011 Convert 100100111101 (base 2) to base 7. 6616 829 (base 11) to base 16 3e7 214400 (base 6) to base 4 10113000 What is -11b07 (base 12) in base 16? -5df7 What is 1010111101100011 (base 2) in base 12? 21b97 What is -5036 (base 14) in base 12? -7b74 61 (base 12) to base 2 1001001 Convert 7ac (base 13) to base 3. 1211002 What is 186a (base 11) in base 16? 947 What is -2618 (base 13) in base 11? -4096 -7b18 (base 12) to base 7 -54641 What is 10101000011 (base 2) in base 16? 543 Convert -1011110101010100 (base 2) to base 5. -3022333 What is 22114 (base 5) in base 2? 10111111110 Convert 44 (base 14) to base 12. 50 -20086 (base 9) to base 10 -13200 Convert -42110 (base 10) to base 2. -1010010001111110 What	{ "pile_set_name": "DM Mathematics" }
t the terms in 7w3 + 6w*3 - 8w*3. 5w*3 Collect the terms in 4c*3 + 28c*3 - 8c*3. 24c*3 Collect the terms in 23 + 116w*2 - 23. 116w*2 Collect the terms in -309q + 167q + 144q. 2q Collect the terms in 36y + 8y + 2y. 46y Collect the terms in 1 - 42f*2 + 48f*2 - 1. 6f*2 Collect the terms in 6y*2 - 3y*2 + 25y - 4y2. -y2 + 25y Collect the terms in -22f2 + 2f2 - f2. -21f2 Collect the terms in -14b*3 - 2b*3 + 2b*3. -14b*3 Collect the terms in 124d2 - d3 + 98d2 - 8d*2 + 2d3. d3 + 214d2 Collect the terms in -13p*2 + 12p*2 + 2p2. p2 Collect the terms in -7a3 - 10a*2 + 16a*3 + 10a*2. 9a3 Collect the terms in i2 + 4i2 - 4i*2 + 3i*2. 4i*2 Collect the terms in -8y*3 - 4y*3 + 6y*3 - 9y*3. -15y*3 Collect the terms in 15n - 16n + 12n + 7n. 18n Collect the terms in 53x2 - 24x*2 - 25x*2. 4x*2 Collect the terms in -30s*2 + 7s2 - s2. -24s2 Collect the terms in -16w*3 - 30 - 32 + 14w*3. -2w*3 - 62 Collect the terms in -62n*3 + 20n*3 - 62n*3. -104n*3 Collect the terms in 18b - 31b + 19b. 6b Collect the terms in 5 + a - 5 + 4a. 5a Collect the terms in 1724r*2 + 324r*2 + 125r*2. 2173r*2 Collect the terms in 2u - 44u + 9u*3 + 42u. 9u3 Collect the terms in -14b*2 - 9b*2 + 0b*2 + 2b*2. -21b2 Collect the terms in 4 + r2 + 2r2 - 6r2 - r2. -4r2 + 4 Collect the terms in 2u*2 - 5u*2 + 7u*2 + 4 + 6. 4u*2 + 10 Collect the terms in -2g*3 - 96308g*2 + 96308g*2. -2g*3 Collect the terms in 1903288 - 1903288 + 3w. 3w Collect the terms in -810774 - 2i*2 + 810774. -2i*2 Collect the terms in -r + 15r + 15r - 5r. 24r Collect the terms in 246 - 246 - 8w. -8w Collect the terms in 15v - 8v2 + 0v*2 - 15v - 3v2. -11v*2 Collect the terms in 0p*2 - 211 + 0p*2 + 211 + 2p*2. 2p*2 Collect the terms in -292x - 271x - 41x - 2. -604x - 2 Collect the terms in 0p - 8p2 + 5p*2 + 0p. -3p2 Collect the terms in 16i + 21i + 21i - 59i. -i Collect the terms in -1300 - 16f + 1300 + 6f. -10f Collect the terms in 3 + 2 - 13 + 8 + 3a. 3a Collect the terms in -5u - 5u*3 + 0u + 25u. -5u*3 + 20u Collect the terms in m2 - 22 + 10 + 12. m2 Collect the terms in -48t - 2t*3 + 4 - 4. -2t*3 - 48t Collect the terms in -7 - 74h3 + 7. -74h*3 Collect the terms in 69i*3 + 2i*2 - 2i*2 - 3i*3. 66i*3 Collect the terms in 2y - y - 98 - 92 + 60. y - 130 Collect the terms in 118u - 58u - 51u2 - 60u. -51u2 Collect the terms in 6a*3 - 8a*3 + 4a*3. 2a*3 Collect the terms in -5184 + 5184 + 2k. 2k Collect the terms in -5u*2 + 2u*2 + 6u*2 + 15u*2. 18u*2 Collect the terms in -49 - 46 - 49 + 144 + 3x. 3x Collect the terms in -s2 + 112 - 3s*3 + 0s2 + s2. -3s3 + 112 Collect the terms in 76 + 1231m*3 - 76 - 1230m3. m3 Collect the terms in 57a - 7 + 8 - 1. 57a Collect the terms in 3d + 2712d*2 + d - 4d. 2712d2 Collect the terms in -13t*3 - 9t*3 - 28t*3 + 40t*3. -10t3 Collect the terms in v2 - 13v2 + 5v*2 + 12v*2. 5v*2 Collect the terms in 2 - 2j*2 + 0j*2 - 23j*2 - 7j*2. -32j*2 + 2 Collect the terms in 664 - 664 - 3w*3 + 6w*3. 3w*3 Collect the terms in -20a - 7a2 + 20a. -7a2 Collect the terms in -9b2 + b2 - 6b2 - 8b*2. -22b2 Collect the terms in -u3 + 33711u - 33711u. -u*3 Collect the terms in 515s*3 + 7s + 514s3 - 7s - 1038s3. -9s3 Collect the terms in v3 + 12v3 - 10v*3. 3v*3 Collect the terms in s - 3 + 1557s*2 - s - 1564s*2. -7s*2 - 3 Collect the terms in -4 + 43l*2 + 6 - 2 - 5l*3. -5l*3 + 43l*2 Collect the terms in -443 + 443 - 96h. -96h Collect the terms in 142634 - 142634 + c. c Collect the terms in 9s*3 + 9 + 10s - 10s. 9s*3 + 9 Collect the terms in 20a*2 - 30a*2 + 10a2 + a3. a*3 Collect the terms in -19w - 155w + 185w - 4w3 - 11w. -4w3 Collect the terms in 6t - 9t + 2t. -t Collect the terms in 580b + 2b*2 - 580b. 2b2 Collect the terms in 18h*2 - 2h*2 - 3h*2 - 4h*2. 9h*2 Collect the terms in 317k - 639k + 319k. -3k Collect the terms in 4p*3 + 0p*3 + p + 7p - 5p3. -p3 + 8p Collect the terms in -2419 + 3p + 2419. 3p Collect the terms in 35z + 31z + 42z - 112z. -4z Collect the terms in -4t*2 + 12t*2 - 10t*2 - 2t*2 - 7t*2. -11t*2 Collect the terms in 67d + 56d - 122d. d Collect the terms in -625i + 0 + 617i + 0. -8i Collect the terms in 5b - 22b + 10b + 13b. 6b Collect the terms in 15 - 13t - 15. -13t Collect the terms in 104v3 - 54v*3 - 63v*3. -13v*3 Collect the terms in 349d*2 - 13 - 336d*2 + 13. 13d*2 Collect the terms in -2 + 2 - 2885l*3 + 2886l3. l3 Collect the terms in -48987w + 48987w + 4w3. 4w*3 Collect the terms in -13b*2 - 32b2 + b2 - 64b2. -108b*2 Collect the terms in -42149 + 42149 - 2d*2. -2d*2 Collect the terms in 180z*3 + 2552z - 2552z. 180z*3 Collect the terms in -2r + 3r - 26 + 31 - 5r. -4r + 5 Collect the terms in -6v*2 + 2v*2 - 18v*2. -22v*2 Collect the terms in -18o - o2 + 1 - 1. -o2 - 18o Collect the terms in 7a - 2a2 - 2a + 2a2 - 2a*2. -2a*2 + 5a Collect the terms in 7g2 - g2 - 30g*2 - 27g*2. -51g*2 Collect the terms in -48o*3 + 8 - 6 - 2o*2 - 2. -48o*3 - 2o*2 Collect the terms in -53x3 - 1 + 1 - x2. -53x3 - x2 Collect the terms in 20i - 13i - 9i. -2i Collect the terms in 10y + 0 + 0 - 9y. y Collect the terms in -24l*3 - 7l + 4 - 4 + 3l3. -21l*3 - 7l Collect the terms in 17 - 27a - 15 - 5. -27a - 3 Collect the terms in 3 + 2b2 + 6 + 6. 2b*2 + 15 Collect the terms in 2q - 4q + 0q*2 + 0q*2 - 164q*3. -164q*3 - 2q Collect the terms in 13776j + 8j*2 - 13776j. 8j2 Collect the terms in 5o*3 + 3o*3 - 59o*3. -51o*3 Collect the terms in 0z*2 + 13z*3 + 0z*2 + 28z*3. 41z*3 Collect the terms in -129 + 3f + 129. 3f Collect the terms in -421q*3 + 715q*3 + 1194q*3. 1488q*3 Collect the terms in 8k + 5k - 20k + 8k. k Collect the terms in 24o*2 - 12o*2 + 2o*2 + 7o*2. 21o*2 Collect the terms in 11o*2 - 37o + 37o. 11o*2 Collect the terms in 28x*3 - 10x*3 - 6x*3. 12x*3 Collect the terms in -52w - 3 + 2 - 39w. -91w - 1 Collect the terms in -42x + 5x + 29x. -8x Collect the terms in -3s2 + s2 + 20 + s2 - 2s*2. -3s*2 + 20 Collect the terms in 1 + 2 - 6 + 52q + 2. 52q - 1 Collect the terms in -1484k + 47k2 + 1484k. 47k2 Collect the terms in -3o - 9o2 + 3o - 4o2. -13o*2 Collect the terms in 393r*2 - 393r2 + r3. r*3 Collect the terms in 8n + 14 - 14. 8n Collect the terms in 23k*2 + 30k*2 - 68k*2 + 16k2. k2 Collect the terms in 0a + 0a + 3a + 0a - 4a. -a Collect the terms in 27q*3 + 11q + 3q - 14q. 27q3 Collect the terms in -7q*2 + 4q*2 - 4q*2 - 5q*2. -12q*2 Collect the terms in -7y*3 + 2y*3 + 2y3 + y3 + 0y3. -2y*3 Collect the terms in -1979z*2 - 1 + 1. -1979z*2 Collect the terms in -11 + 0n2 + n2 + 16. n*2 + 5 Collect the terms in -1752166j - 2j3 - 2j*3 + 1752166j. -4j3 Collect the terms in 51w + 49w - 198w + 48w + 47w. -3w Collect the terms in -42d + 4 - 53d + 0. -95d + 4 Collect the terms in -48080 + l + 48080. l Collect the terms in -1283p2 + 1283p2 + p3. p*3 Collect the terms in 5c - 5c + 26c*3 + 6c*2. 26c*3 + 6c*2 Collect the terms in 463o*3 + 0o - 472o3 + 0o. -9o3 Collect the terms in -11f*2 + 2f*2 + 10f2. f2 Collect the terms in -9n2 - 6n2 + n2 + n*2. -13n*2 Collect the terms in -712f*2 + 2122f*2 - 708f*2 - 705f*2. -3f*2 Collect the terms in 19s - 47s + 28s + 4s2 - 10s*2. -6s*2 Collect the terms in -54g*3 - 33g*3 + 74g*3 - 4g*2 + 7g*2. -13g*3 + 3g*2 Collect the terms in -21b + 21b - 268b*2. -268b*2 Collect the terms in 557l*3 - 29l*2 - 27l*2 + 56l*2. 557l*3 Collect the terms in 10t*3 + 4 + 13t*3 - 4. 23t3 Collect the terms in -14 + s3 + 14. s**3 Col	{ "pile_set_name": "DM Mathematics" }
factors of v? 2, 3, 19 Let n(t) = -27t3 + 6t*2 + t + 2. Let m be n(-2). Suppose -p = c - 87, 3c = 3p + p + m. What are the prime factors of c? 2, 3, 7 Suppose 5 = -w + 9. Suppose 4v = -2i + 8, 5i - wv = -v + 72. What are the prime factors of (-3)/(-12) + 273/i? 23 List the prime factors of 0 - ((-8 - -4) + 2 + -442). 2, 3, 37 What are the prime factors of 8((-133)/(-6) + (-9)/54)? 2, 11 Suppose 3v = 2p - 71 - 530, 0 = -3p - v + 874. List the prime factors of p. 293 Suppose -2p + 3p = -1, 0 = 3t - 4p + 239. Let d = t + 221. Suppose -4s = -0s - d. What are the prime factors of s? 5, 7 Let w be 0 + ((-1)/(-2))/((-2)/12). What are the prime factors of ((-44)/(-12) + w)93? 2, 31 Suppose x = 5p - 3p - 966, -3x = -p + 483. Suppose -2h - 5h + p = 0. What are the prime factors of h? 3, 23 Suppose -11t - 782 = -2146. What are the prime factors of t? 2, 31 Let q = 1 + 6. Suppose 0 = -m + 3r - q, -3m = -2m + 3r - 17. Suppose -72 = mt - 9t. List the prime factors of t. 2, 3 Suppose 0 = -8i + 5i. Suppose 3u + 4d + 1 - 10 = i, 15 = 5u + 4d. Suppose 5o + z = -4z + 145, -uz + 9 = 0. List the prime factors of o. 2, 13 Suppose -410 - 285 = -5h. Suppose -11 = -a + h. Suppose 0 = 4z - 9z + a. What are the prime factors of z? 2, 3, 5 Let m = -599 - -1844. List the prime factors of m. 3, 5, 83 Let z(g) = 37g + 11. Let c be z(5). What are the prime factors of 3/(3 - 576/c)? 7 Let m(q) = 2q - 6 - q*2 + 4q + 20 + q*3 + 6q*2. What are the prime factors of m(-4)? 2, 3 Suppose 4f = 3z - 2443, 2z - 2442 = f + 3f. Let j = -344 - f. What are the prime factors of j? 2, 7, 19 Let n = -2505 - -4473. List the prime factors of n. 2, 3, 41 Let g(t) be the third derivative of t7/1260 + t6/144 + t5/10 + 5t*2. Let l(z) be the third derivative of g(z). List the prime factors of l(6). 29 Let f(c) = -181c - 117. List the prime factors of f(-8). 11 Let t(n) = -n*3 - 4n*2 - 7n - 7. Let s be t(-5). Suppose -79 - s = -2w. Let m = -47 + w. What are the prime factors of m? 19 Let b = 4780 + -2575. List the prime factors of b. 3, 5, 7 Let o = 115 + 385. What are the prime factors of o? 2, 5 Let p(l) = -l2 + 10l + 7. Let u(w) = 6w3 + w2 - 1. Let i be u(1). Suppose 20 = -2v + iv. List the prime factors of p(v). 2 Let o(y) be the third derivative of -y5/60 - y4/3 + 5y*3/6 + 3y*2. Let q be o(-6). What are the prime factors of 6/(-51) - (-563)/q? 3, 11 Let s(m) = 447m*2 + 2m + 2. List the prime factors of s(-2). 2, 19, 47 Let b(s) = 162s + 3s*2 - 3 - 13 - 82s - 97s. What are the prime factors of b(-8)? 2, 3, 13 Let v(y) = 64y - 52. List the prime factors of v(9). 2, 131 Suppose 0 = -13f + 61f - 98016. What are the prime factors of f? 2, 1021 Let k = 38 - -4. Let q = -20 + k. What are the prime factors of q? 2, 11 Suppose -371d + 368d = -5088. List the prime factors of d. 2, 53 Let z be (-32)/(-14) - 4/14. What are the prime factors of (z/4)/((-15)/(-2610))? 3, 29 Let g(u) = u*3 + 13u*2 - 15u - 12. Let b(v) = -11v2 - 3v + 4. Let z be b(2). Let k = z - -32. List the prime factors of g(k). 2 Let z(k) be the first derivative of k*3/3 - 11k*2/2 + 12k - 4. Let h be z(10). Suppose 3j + 2j - 3m = 165, m = hj - 65. List the prime factors of j. 2, 3, 5 Suppose 5l + y + 3y - 15 = 0, -9 = -3l - 2y. Suppose 7c - 122 = -l. List the prime factors of c. 17 Suppose -2628 - 452 = -11i. What are the prime factors of i? 2, 5, 7 Let b(h) = h*2 - 6h + 8. Let r be b(5). Suppose 2w = 5y - 0y + 77, 0 = -rw + 3y + 93. List the prime factors of w. 2, 13 Let p = 15146 - 8651. What are the prime factors of p? 3, 5, 433 Let b(i) = i3 + 9i*2 + 7. Let x be b(-9). Suppose -5h = -2p - 42, -x = -3h + 5p + 22. List the prime factors of h. 2 Let j = -25 - -14. Let b = 6 + j. List the prime factors of (-88)/b + (-8)/(-20). 2, 3 Let x(y) = -222y - 423. List the prime factors of x(-9). 3, 5, 7 Let l(q) = 16q - 5. Let g be l(3). Suppose -145 = -2n + 2f + g, 379 = 4n - 3f. What are the prime factors of n? 97 Let y be (5 - 11)(-4)/6. Suppose 0x + w + 82 = yx, -3x + 58 = w. Suppose 2o = -2j + j + x, 25 = 3o - j. List the prime factors of o. 3 List the prime factors of 0/2 - (0 - 10/5). 2 Suppose -34o + 35400 = 26o. List the prime factors of o. 2, 5, 59 Let i be (-2)/(68/(-20) + 3). Suppose -2a + 63 = -ix, 5a + 2x = -2x + 174. Let y = a - 12. List the prime factors of y. 2, 11 Let f(p) = -p3 - p2 - 4p + 1. Let v be f(-4). What are the prime factors of v(-1 - (-4)/2) + 1? 2, 3, 11 Suppose s + 2773 = 2x, 0s = -3x + 5s + 4163. What are the prime factors of x? 2, 3, 7, 11 Suppose -r + 3f - 5f = 172, 0 = r + f + 167. List the prime factors of 12/(-15) + (-36)/40r. 5, 29 Let z = 246 + 704. What are the prime factors of z? 2, 5, 19 Let i(x) = -x*3 + 10x*2 - 24. Let k be i(9). Let n = k + -40. List the prime factors of n. 17 Let i be (-77)/4 - 3/4. List the prime factors of (2/1)/((-5)/i). 2 What are the prime factors of 3/(-24) + (-1631672)/(-448)? 2, 3, 607 Suppose -6 = 2q, 2u = -5q + 1 - 4. Suppose 0 = -ur + 3r + 72. What are the prime factors of r? 2, 3 Let x be -4(-4 + 75/20). Let c = x - -93. List the prime factors of c. 2, 47 Let m(t) = -t - 1 + 2t + t. Let o be (-18)/84/(-3). What are the prime factors of m(o)? 5 Suppose -5b + 4 = 2p, 0p - 5p = 5b - 10. Suppose -72 = -t - 5l, -3t - t = -pl - 244. What are the prime factors of t? 2, 31 Let n(b) = -59b + 30. Let z be n(8). Let p = z - -732. List the prime factors of p. 2, 5, 29 Suppose -4q + 2 = -2. Suppose o + 3y - q = 17, 0 = y - 5. Suppose 3b - 2z + 1 = 42, -oz - 68 = -5b. List the prime factors of b. 13 Let p be ((-6)/5)/(12/(-30)). Suppose -pq - q = 0. Suppose -z + 14 = -4o - q, 3o = 3z - 51. List the prime factors of z. 2, 3 Suppose -5487 + 1029 = -2t + 3l, 2l + 8 = 0. List the prime factors of t. 3, 13, 19 Let b(a) = 3a - 3. Let v be b(4). Suppose 0 = vi - 7i + 102. Let u = i + 72. List the prime factors of u. 3, 7 What are the prime factors of 598 - 9/((-36)/(-16))? 2, 3, 11 Let b be (-2)/14 - 66/(-21). Let k be b + 14/(6/3). Suppose 0 + k = 5q, 24 = w + q. What are the prime factors of w? 2, 11 Let z = -788 - -1651. What are the prime factors of z? 863 List the prime factors of (12/(-14))/(39/(-132223)). 2, 1453 Let x(m) = m2 + 16m - 15. Let d be x(-17). Let i(o) = 265o - o2 + 6o*d - 267o. What are the prime factors of i(2)? 2 Suppose 0a - 4 = -2a. Suppose -aw = -6w. Suppose w = 5g - 3g - 56. What are the prime factors of g? 2, 7 Let r(j) = 421j - 256. What are the prime factors of r(8)? 2, 389 Suppose 9u = 6u + 2g + 711, -3g = -9. What are the prime factors of u? 239 Let b be (-327)/(-5) + 6/(-15). Let i(a) = -a + 4. Let p be i(4). Let u = b - p. List the prime factors of u. 5, 13 Let r(z) = 37z + 11. Let u be r(-8). Let v = -203 - u. Suppose 0 = -3g + 3t + 2t + v, -5g + 142 = -3t. What are the prime factors of g? 29 Let o(n) = -12n*2 - 6n - 4. Let w be o(-3). Let l = w + 214. List the prime factors of l. 2, 3, 5 Let q(d) = 7d2 + 17d - 7. What are the prime factors of q(13)? 11, 127 Suppose 4v - 3i - 1841 + 104 = 0, -4v - 5i + 1713 = 0. What are the prime factors of v? 2, 3 Let h(k) = k*3 + 7. Let z be h(0). Suppose zt - 2t = 180. List the prime factors of t. 2, 3 Suppose 3p - 7p = -560. Let b = 78 + p. What are the prime factors of b? 2, 109 Suppose 5r = -5d - 25, -4 = -2r + 5d - 14. Let u(n) = n3 + 4n*2 + n + 33. What are the prime factors of u(r)? 3 Let p(o) = 20o - 2o2 - 12 - 7o*2 + 8o*2. What are the prime factors of p(11)? 3, 29 Suppose 44u = 45u - 3. Suppose 3g - 3s - 665 = -122, -564 = -ug - 4s. What are the prime factors of g? 2, 23 Suppose 5f - 2f = -531. Let a = 150 - f. List the prime factors of a. 3, 109 Let c = 787 - 277. What are the prime factors of c? 2, 3, 5, 17 List the prime factors of 2669/(-51)2/((-4)/6). 157 Let m(c) = -c + 8. Let n be m(6). Let l = -129 + 143. Suppose nz - l = z. What are the prime factors of z? 2, 7 Let i(d) = 3d + 4. Let c(f) = -f - 9. Let m be c(-15). What are the prime factors of i(m)? 2, 11 Let c = 343 + -219. Let l = -64 + c. List the prime factors of l. 2, 3,	{ "pile_set_name": "DM Mathematics" }
w) = 0 - 3 + 0 + 3w. Let m be h(j). Solve 3k - 7 + 18 = -4l, -ml = 4k + 10 for k. -1 Suppose 0 = 2g - 9 + 3. Suppose -5s = -c - 22, 0c + 14 = gs - c. Solve f - 6 = sk, 4k = -0k - 2f - 12 for k. -2 Suppose 0 = f + 5l - 29, -9 - 20 = -f - l. Solve 0 = 5m - 4n - n - 5, -m - f = 5n for m. -4 Let p(w) = -w + 7. Let z be p(3). Suppose 2f = 2s + s - 9, -5f - 4s + 35 = 0. Let r be ((-6)/z)/f-2. Solve 2i = -0i - 4c - 26, -3i = -2c - r for i. -3 Let g = 22 - 36. Let f = g + 19. Solve -3l - 16 = 4t, l + l + ft = -13 for l. -4 Let w be (2/3)/((-2)/(-12)). Suppose -3d = g - 4d, -g - 15 = -wd. Solve -4u = p + 10, p + gu + 18 = -3p for p. -2 Let m(s) = -s*2 - 6s + 3. Let b be m(-6). Let j = -8 - -21. Suppose 2v = j - b. Solve -vz + w = -11, 3z + w = 4w - 3 for z. 3 Suppose 12 = 5z - z. Let c(p) = -2p - 3. Let j(l) = -l - 13. Let d be j(-9). Let o be c(d). Solve 3g + ob - 20 = 0, -2g = zg - b - 24 for g. 5 Let n = -31 + 33. Solve -ns + 3 = -3u, -5s = -u + 2u - 16 for u. 1 Let a = -24 - -29. Solve 4l = -b - 4, 0b = -ab + 2l + 2 for b. 0 Let a = 21 - 17. Solve b = af + 14 + 5, 4b = -4f - 24 for f. -5 Let s be 2/(-11) - (-90)/11. Suppose 2n - 2d - s = 0, 2n + 4d = -0d - 10. Solve 2l + n + 1 = -2i, l - 4i + 21 = 0 for l. -5 Let m be 78/13 + -1 + (-3 - -2). Let i(k) = -k3 - 7k*2 - 6k. Let v be i(-6). Solve -5h + 26 = -4n, -3n + vh = 4h + m for n. -4 Let p(k) = -k3 + k2 + 3k + 3. Let l be p(-2). Solve 9 = -4v + 5x, -lx + 4x + 25 = 0 for v. 4 Suppose -w = -2q + 3, 4w = -4q - 6 - 6. Suppose -12 = z - qz. Let u be ((-9)/(-12))/((-3)/z). Solve 0 = 3r + uc - c - 5, -1 = -c for r. 1 Let w = 7 + -3. Solve 3p = -d - w, d + 2d = -p + 12 for d. 5 Let f be 0(-5 + 2 + 2). Suppose 3q + t - 13 = -t, q - 2t - 15 = f. Solve 5d + 10 = -4l, 3l - ql - 30 = -5d for l. -5 Let t = -7 + 11. Solve 0 = -0z + 4z + tk, z + 20 = -5k for z. 5 Let p be 18/4 + 8/(-16). Solve -py + 3r = 4r + 5, -y + 1 = r for y. -2 Let k = -66 + 68. Solve 2f = -3m + 5m + 10, f + km = -1 for f. 3 Suppose -5v + 19 = -1. Suppose -2n - 80 = -vn. Solve 3y + f + 20 = 0, 4f = -7y + 3y - n for y. -5 Suppose 3u + 2u - 95 = 0. Let c = u + -11. Solve -t + 4m = 8 + 2, -c = -t - 2m for t. 2 Suppose 0 = -5l - 2x + 5 + 12, -5l + 2x + 13 = 0. Let q be -3 + l + (2 - -1). Solve 5v = 2z - 7z + 10, 0 = -2v + qz - 21 for v. -3 Let z = -1 + 1. Suppose -3k + 9 = -3. Suppose 2q + 34 = kq. Solve -5p = 2g - q, -g + zp - 5p = -21 for g. -4 Let f = 350 - 341. Let b be (-4)/6 - 15/(-9). Let j = b - -1. Solve -jp - 7 = -k + 6, 0 = 5k + 4p - f for k. 5 Let j be ((-1)/1)/((-3)/15). Suppose y - 2 = 3. Suppose 0 = jp + u - 19, 0 = -p - 4p - yu + 15. Solve -3h + 20 = pn - 7h, 0 = -3n - h + 11 for n. 4 Suppose -68 = 3g - g. Let b = g - -53. Solve 5u - 4c = -3c - 1, -4c = 3u + b for u. -1 Let f be (-2 - 4)/(0 - -2). Let y(s) = -s*3 - 3s*2 - s. Let x be y(f). Let r(a) = 7a - 1. Let k be r(3). Solve -xp + k = p - 5q, 0 = -4p - q - 4 for p. 0 Let b be 4(2 + 2/4). Let f be 41b/(-8). Let d = 8 + f. Solve 0 = 2v - di - 11, 2v = 2i - 0i + 8 for v. 1 Let t = 6 + -3. Solve -4k + 5j + 26 = 0, -4j = tk - 7k + 24 for k. 4 Let g be (3/6)/(1/6). Suppose 3 = -4f + 3b, g = 2b - 7. Solve -d - 4r - 1 = 0, r - 4r + 6 = fd for d. 3 Let t = 0 - -4. Suppose 5h = 5 + 10. Let k be 10/6 - h/(-9). Solve 4f - 2q + 10 = t, kf = -5q - 33 for f. -4 Let l be 0 - (0 + -3) - 10. Let f be 30/8 + l/(-28). Solve -fv - 10 = m, 0 = -2v + 3m - m for v. -2 Suppose -42 = 3j - 2j + 4i, 0 = 3j - i + 74. Let x be j + -3 + (-2)/(-2). Let b be 2/(-7) + (-8)/x. Solve b = 2f + 2k + 14, -2f + 0f - 29 = 5k for f. -2 Let b = -3 - -6. Suppose -i = -2 + 3. Let y = b - i. Solve -n + y = 0, 5j - 8 = 5n - 33 for j. -1 Let v be (-100)/(-55) + (-2)/(-11). Solve 7q - 2q - vc = -20, -c + 4 = -q for q. -4 Suppose -30 = -3t - 0t. Solve -4a - 3r + t = 0, -4a - 5r = -7a + 22 for a. 4 Let d be (-7 + 1)(-8)/12. Let w be (-42)/(-11) - d/(-22). Solve 2i + wj = 5j, -5j = 0 for i. 0 Suppose 2f - 12 = -4. Suppose -3l + l = -d - 9, l = -fd + 9. Solve -lo + 2 = 4r, 2 = -r - 0r for o. 2 Let t(k) = -15 + 5 + 2k + 3k - 3k. Let q be t(7). Suppose -qs - 7 = -23. Solve 3n = sn - 1, -5u + 3n - 18 = 0 for u. -3 Suppose -15 = -5q - 2r, 3q - 4r + 12 + 5 = 0. Solve 4z + 1 = -3x - q, -4 = 3z + x for z. -2 Let r(h) = 9h - h2 - 26 + 40 - h3 - 10h2 + 4h. Let m be r(-12). Solve 0 = 5c - 5g - 50, -5g - 15 = mc - 0c for c. 5 Let a(m) = -3m*2 + 8m - 8. Let r be a(6). Let i be r/(-18) + 4/18. Solve b + b = -3c - i, -3b - 17 = -c for b. -5 Let x(f) = f*2 + 9f + 20. Let k be x(-7). Solve -5g = -5l + 40, kl = 3l - 2g - 1 for l. 3 Let a be 3 + (-2)/2 + 6. Let h = -4 + a. Solve -2y + 3p - 2 - 2 = 0, 0 = -5y + 4p + h for y. 4 Let o = 42 - 22. Suppose 3c = -c + o. Suppose -26 = -5h - u, -4u - 2 = -ch + 19. Solve -2m - 20 = d - 5, -hd - m - 30 = 0 for d. -5 Suppose -u = -0u + d - 10, d + 38 = 5u. Suppose -u = m - 5m. Solve -w - 12 = -4k, w - 2w = mk for w. -4 Suppose -4 = 31t - 33t. Solve 3u + v = -t, 0 = u + v + v + 9 for u. 1 Let t(i) = -2i2 - 10i - 6. Let n be t(-6). Let o = n - -38. Suppose 4q - 6 = 3u + 2u, -5q + o = 0. Solve 3w = -um + 2, -2m - 2 - 8 = 0 for w. 4 Let i = 7 + -6. Let h = i + 1. Suppose 4f = -2m + 12, -3m - 3f + 16 = hf. Solve -mb + 37 = 3b + 4j, -4j + 27 = 3b for b. 5 Let s be 0 - ((-3)/1-1 - 3). Solve 1 + s = -z, 4o = -3z - 23 for o. -5 Suppose -k - 2 = -5, -3k = -3b + 6. Solve -bu + 4h = 45, 6h - 25 = h for u. -5 Suppose 2g = 2g - 3g. Solve 4v - 9v + 3n - 2 = g, -2v + n = 0 for v. 2 Let h = 17 + -14. Solve -y + hq = y, 3q = -6 for y. -3 Suppose 3g = -14 - 1. Let u be (-21)/(-4) + 2/(-8). Let q be 2/g - (-17)/u. Solve -2x + d = q, -4x - 3d = -2d - 9 for x. 1 Suppose -3v + 165 + 39 = 0. Let j be v/18 + 2/9. Let k(z) = z*3 + 12z*2 + 10z + 15. Let a be k(-11). Solve y - c = -y - 1, jc = -2y - a for y. -3 Let w(o) = -o*2 + 3o + 5. Let l be w(4). Solve -4f + l = -2b - 5, 3b = 3f for b. 3 Let q(k) = -k*2 - 9k - 8. Let o be q(-8). Let h(b) = -b3 - b2 - b + 3. Let g be h(0). Let f = -3 - -6. Solve -2z = -fz - s, o = -5z + gs - 8 for z. -1 Let n(p) = -p*3 - 7p*2 - 2p - 9. Let b be n(-7). Suppose 5w + 19 = -2i, 0 = i - w - 3 - b. Solve 0 = 3z - ia - 6, -4z + 6a + 12 = a for z. -2 Let f be (-3 - -13)(-3)/(-2). Let p be ((-4)/3)/((-6)/9). Suppose a + 12 = 4g + 3a, 3g - pa - 9 = 0. Solve -f = -5t + 2k, 4t - gk - 5 = -0k for t. 5 Let n(i) = i*2 + i - 2. Let y be n(-3). Solve 0q - yd = 4q + 20, -2q - d = 5 for q. 0 Let d = 32 - 30. Solve -do = -5k + 26, -4k + 22 = -0o - 2o for o. -3 Let w be 3/(-2)(-4)/3. Suppose w + 14 = 2m. Suppose 5c + 2k = 14, 0 + m = 2c + 2k. Solve -cj - 2 = -4p, 4p = j - 2j + 17 for p. 3 Suppose 2z + 9 = 5g, -z + 2z + g - 13 = 0. Suppose j = -2d + 4, 4j + 5d = zd + 16. Solve -ja = 0, 4v + 3a + 0a = 20 for v. 5 Suppose -v - 5v = 0. Let y(n) = n*2 + 5n - 4. Let h be y(-6). Suppose 5l - hl - 6 = 0. Solve lj = -3a + 5j, v = -3a - 3j - 30 for a. -5 Suppose w - 13 + 4 = -2a, -a + 3 = -w. Suppose -w = -3x + 8. Suppose -3y + 14 = 2f, 0 = 2y - 5f + 2f + 8. Solve -t = yd + 1, 0t = -t - 4d - x for t. 1 Let k be 2(-3 + (-1 - 2)). Let y be 40/12k/(-10). Solve -3g = -3o + 24, 3g + yo = -g + 8 for g. -3 Suppose -1 = -2a + 1. Let x = a - -4. Solve -x = -5w, -2w = 3q - 0w - 11 for q. 3 Suppose -17f = -16f - 2. Solve -4w = -4z - w + 32, fz + 2w = 2 for z. 5 Suppose 8p = 3p + 15. Suppose 1 = n + s, ps - 3 = -4n + 1. Let l be n/2 + (-7)/(-2). Solve -3x = -2h - 12 - 4, -lh - 28 = -4x for h. -5 Let t be (-1)/2(-2 - -6). Let y be (3 - t) + -3 - 2. Suppose -b + 4b - 9 = y. Solve 0 = bn + 4h - 19, h - 21 = -n - 3n for n. 5 Suppose 40p - 41p + 4 = 0. Solve -z + 4z + 5o = -1, -pz + 2o = 10 for z. -2 Let c(g) = g2 - 5g - 8. Let w be c(6). Let a be (0 - w)1 - -1. Solve 0 = p - 3i - 1, ai + 9 = -3p + 6p for p. 4 Suppose -5h + 12 = -13. Solve 4l - 5g + 10 = 0, 5l + hg = 2 + 8 for l. 0	{ "pile_set_name": "DM Mathematics" }
s5. What is the second derivative of u(q) wrt q? 4 Let t(x) be the first derivative of 211x*5/5 + 29x*3/3 + 112. Find the third derivative of t(q) wrt q. 5064q Let f(w) be the first derivative of -w*6/6 - 2w*4 - 62w*3/3 + 106. What is the third derivative of f(s) wrt s? -60s*2 - 48 Let l = 29 - 31. Let x = l + 7. Let t(r) = -3r + 14. Let c(f) = f*2 - 5f + 27. Let j(k) = xt(k) - 3c(k). Differentiate j(z) with respect to z. -6z Suppose 2h = 3h - 2, -4h - 4 = 4q. Let x(u) = -u2 - 5u - 3. Let a be x(q). What is the second derivative of -8z3 + 0z*a + 7z - 18z wrt z? -48z Let g(y) be the third derivative of -2/3y4 - 13/210y*7 + 0y + 0 + 0y6 + 0y*5 + 0y*3 - 12y*2. What is the second derivative of g(i) wrt i? -156i*2 Suppose -7s - h = -2s - 20, 2s - 4h = 30. Suppose 9 + 10 = 3f - 2b, 2b = -sf + 5. What is the second derivative of 10v3 - vf + 12v - v3 wrt v? 48v Let b(z) be the second derivative of -171z8/56 - 63z*4/4 + 9z - 3. What is the third derivative of b(g) wrt g? -20520g3 Let t(x) be the second derivative of 68x6/15 + x4/12 + 47x2/2 + 296x. Find the first derivative of t(r) wrt r. 544r3 + 2r Let l(t) be the second derivative of -7t6/120 + 49t*3/6 - 5t*2/2 - 47t. Let o(u) be the first derivative of l(u). What is the derivative of o(g) wrt g? -21g2 Find the second derivative of -267c + 2661c4 - 566c - 86c2 - 2664c*4 wrt c. -36c*2 - 172 Suppose -6v - 45 = -v. Let j be (-81)/v - 21. Find the second derivative of 3g*3 + 3 - g + j - 10 wrt g. 18g Let q(t) = t*3 + 10t*2 - 11t + 5. Let l be q(-11). Find the second derivative of 8s - 13s*5 - s + ls*5 - 48s wrt s. -160s3 Let o be (30/(-2))/((-27)/18). Let x be (-4)/o(-1 - 9). Differentiate -1 + 7 - 5 - w*x wrt w. -4w*3 Let j(p) be the first derivative of -11 + 0p + 4p2 + 0p*3 + 9/5p*5 + 0p*4. Find the second derivative of j(k) wrt k. 108k*2 Let t(g) = g + 2. Let a be (4/(-5))/((-2)/25). Let j be t(a). What is the third derivative of -12f + 5f4 + jf + 5f2 wrt f? 120f Find the third derivative of 131n4 - 133n*4 + 10n*2 + 148n*5 - 352n*5 - 28n wrt n. -12240n2 - 48n Let c = -13 + 10. Let f(k) = -16k + 1. Let j be f(c). What is the third derivative of 5b*4 + 3b*2 + j - 49 wrt b? 120b Let t(j) be the second derivative of j*7/210 - 7j*4/24 + 13j*3/3 + 19j. Let h(l) be the second derivative of t(l). Differentiate h(d) wrt d. 12d2 Find the second derivative of -52v*4 - 5v + 67v3 + 79v - 67v3 wrt v. -624v*2 Let i(v) be the first derivative of 31v*2 + 100v + 29. What is the derivative of i(o) wrt o? 62 Let s(d) = d*4 + 4d*3 + 168d*2 - 2d. Let t(b) = -b*4 - 12b*3 - 503b*2 + 7b. Let v(n) = 7s(n) + 2t(n). Find the third derivative of v(r) wrt r. 120r + 24 Let x(f) = -2f + 11. Let n be x(4). Find the second derivative of -20c + 25c*n - 13c + 15c wrt c. 150c Let u = -38 - -12. Let q = u - -28. Find the third derivative of 20y4 - 33y*4 + 17y*4 + 8y*4 - 5y*q wrt y. 288y Let o(g) be the first derivative of -g*7/42 + 19g*4/24 - 14g*3/3 - 5. Let f(t) be the third derivative of o(t). What is the first derivative of f(r) wrt r? -60r*2 Let n be (-88)/(-33)2/((-8)/(-6)). Differentiate 4c - 6 + 7 - n - 25c wrt c. -21 What is the third derivative of -7d2 - 4d*2 + 2d*5 + 1296 - 1296 + 3d - 113d6 + 2d wrt d? -13560d3 + 120d2 Let d(c) be the third derivative of c5/60 - c*4/24 + 55c*3/6 + 2c*2 + 65c. Differentiate d(h) with respect to h. 2h - 1 Suppose 17 = 2v + 7. Suppose 52 = vu + m, -3m + 10 + 6 = u. What is the second derivative of 4z3 + z + 0z - uz + 0z wrt z? 24z Let v(j) = -3j*3 - 2j*2. Let f(s) = 548s*3 + 10s*2 - 54s. Let w(c) = f(c) + 5v(c). Find the second derivative of w(r) wrt r. 3198r Let o(u) be the second derivative of -u*6/30 + 53u*3/6 - 253u*2/2 + 270u. Differentiate o(v) wrt v. -4v3 + 53 Find the third derivative of 127z*2 + 44z*6 - 13z6 + z5 + 54z2 - 43z*2 wrt z. 3720z*3 + 60z2 Let q(n) be the third derivative of n8/112 + 8n7/35 - n5/30 - n4/24 + 2n*2 - 60. Find the third derivative of q(t) wrt t. 180t*2 + 1152t Let r(m) = -20m2 - 4m - 7. Let y(c) = 40c2 + 7c + 13. Suppose 0 = -3q - 6, 3w + 2q - 7q = -2. Let a(j) = wy(j) - 7r(j). Differentiate a(l) wrt l. -40l Let n(t) be the first derivative of -7t3 + t2/2 + 105t + 169. Differentiate n(x) with respect to x. -42x + 1 Suppose 2g = -0g + 4. What is the third derivative of -61 + 61 - 15n4 + 11n*g - 29n*2 wrt n? -360n Find the third derivative of y*3 + 8y*6 + 48y*6 + 8 - 29782y*5 - 109 + 29782y*5 - 3y*2 wrt y. 6720y*3 + 6 Let a = 47 - 44. Differentiate 22 - 15s*a + 10 - 23 with respect to s. -45s*2 What is the first derivative of 22 + 131p - 117 + 7 wrt p? 131 Let g(h) be the first derivative of -379h4/2 - 1070h*3/3 + 315. What is the third derivative of g(o) wrt o? -4548 Let a be (4/2)/(2/6). Suppose -4q + 20 = -5b, -q - 25 = b - aq. What is the third derivative of -5y2 + 3y*6 - 5y*6 - 3y*6 + by*2 wrt y? -600y*3 Suppose 2x - 9 = -1. Let c(h) = -h*3 + 4h*2 + 4h + 7. Let u be c(5). Find the third derivative of -5du + d4 - 5dx - d2 wrt d. -96d Let u(i) be the second derivative of 0 + 0i*3 - 13/2i*2 + 5/12i*4 + 15i. What is the first derivative of u(d) wrt d? 10d Let k(t) be the first derivative of t10/5040 - t6/90 + 20t*3/3 - 15. Let q(b) be the third derivative of k(b). What is the third derivative of q(c) wrt c? 120c*3 Let m(i) = 619i*2 - 14i - 740. Let s(g) = 413g2 - 10g - 495. Let h(j) = 5m(j) - 7s(j). What is the first derivative of h(l) wrt l? 408l Let q(a) = -a - 4. Let l be q(-7). What is the first derivative of -lm*3 + 12 - 19 + 8 wrt m? -9m*2 Find the second derivative of 404s*4 - 33s - 1 + 135s + 1 + 254s wrt s. 4848s2 Let b(d) = 519d + 645. Let l(c) = 65c + 81. Let v(q) = -4b(q) + 33l(q). What is the first derivative of v(f) wrt f? 69 Let n(v) = v2 - 7v - 4. Let u be n(8). Suppose -4f = 3x - 15 - 11, -5x + 38 = 4f. Find the first derivative of -j*4 + 5j*4 + 9 + xj*u wrt j. 40j*3 Let i(l) be the third derivative of 19/3l*3 + 0 + 0l + 13l2 + 3/2l*4. Find the first derivative of i(f) wrt f. 36 Suppose -q + 3 = -0. Let o be 2(54/4 + q). Differentiate 13h4 + oh*3 - 6 - 18h*3 - 15h*3 with respect to h. 52h3 Let p(a) = a3 - 19a2 + 18a + 5. Let n be p(18). What is the second derivative of 42l + 30l - 41ln - 121l wrt l? -820l3 Let b(h) be the second derivative of 23h7/42 - h4/12 + 46h3 - 15h + 1. What is the second derivative of b(y) wrt y? 460y3 - 2 Let f be (-6)/(4 + (3 - 5)). Let m be 0/f(-3 - -4). Differentiate 3d4 + d4 - 3 - 6d*4 + m wrt d. -8d3 What is the third derivative of -x4 - 14x2 + x4 + 2225x*6 - 2104x*6 - 3 wrt x? 14520x*3 Let f(u) be the third derivative of 11/60u*5 + 0u*4 + 0u + 0 - 14u2 - u3. What is the first derivative of f(t) wrt t? 22t Let r(x) be the second derivative of 33x5/5 - 21x*4/2 + 54x. Find the third derivative of r(p) wrt p. 792 Let k(p) = -p*2 + 2p - 6. Let i be k(0). Let s(j) = -j - 3. Let m be s(i). What is the derivative of 6om + 11 + 13 - 8 - 3 wrt o? 18o*2 What is the third derivative of 3o + 96o2 + 89o*2 - 161o*2 + 2o*6 + 47o*4 wrt o? 240o*3 + 1128o Let i(q) be the first derivative of -106q6/3 - 617q*2/2 + 348. What is the second derivative of i(p) wrt p? -4240p*3 Suppose q = -g + 20, 78 = 3g - 5q + 2q. Let y = g - 19. What is the third derivative of 6fy + f3 - f3 + 6f*2 - 11f*2 wrt f? 144f Let d(w) = 203w2 - 24w - 4. Let m(b) = 101b2 - 13b - 1. Let o(k) = 3d(k) - 5m(k). What is the second derivative of o(y) wrt y? 208 Let m(z) = -8z - 1. Let i be m(-1). Find the second derivative of 0d*3 - id3 + d3 + 11d3 + 12d wrt d. 30d What is the second derivative of -4 + 26s - 41s4 + 24 + 41s*4 - 14 - 367s*5 wrt s? -7340s3 Let y(i) be the second derivative of i3/2 + 19i2/2 - 5i. Let r(k) = k + 5	{ "pile_set_name": "DM Mathematics" }
hat is prob of picking 3 p? 1/4 What is prob of picking 2 y when two letters picked without replacement from yycycwycyycyyywcyyc? 55/171 What is prob of picking 1 v and 1 e when two letters picked without replacement from eevvvveevveveevevevv? 99/190 Three letters picked without replacement from czffccffzfzfffzz. Give prob of picking 3 f. 1/10 Calculate prob of picking 1 k and 1 d when two letters picked without replacement from {k: 1, d: 2, y: 1, e: 1}. 1/5 Calculate prob of picking 3 b when three letters picked without replacement from zbbbzzbbzzbzzbzbzbzb. 2/19 What is prob of picking 2 x and 1 h when three letters picked without replacement from {x: 5, h: 9}? 45/182 What is prob of picking 2 s when two letters picked without replacement from esssssseeesesese? 3/10 Two letters picked without replacement from vuivxvivgvivvvvvvvxu. Give prob of picking 2 x. 1/190 Two letters picked without replacement from hhhhhhhhhhhrrhrh. What is prob of picking 2 h? 13/20 Three letters picked without replacement from {i: 2, q: 3, w: 2, e: 2}. Give prob of picking 2 q and 1 e. 1/14 What is prob of picking 1 u, 2 m, and 1 b when four letters picked without replacement from mbjbbxobujbojjmoomb? 3/646 Two letters picked without replacement from {c: 3, i: 2, r: 1, b: 2, m: 1, p: 6}. Give prob of picking 1 i and 1 c. 2/35 Three letters picked without replacement from {b: 2, k: 2}. Give prob of picking 1 k and 2 b. 1/2 Calculate prob of picking 2 i when two letters picked without replacement from {z: 1, v: 1, g: 1, i: 4, o: 8, l: 1}. 1/20 Three letters picked without replacement from {w: 4, z: 3}. Give prob of picking 3 z. 1/35 Four letters picked without replacement from {p: 3, d: 3}. Give prob of picking 2 d and 2 p. 3/5 What is prob of picking 1 m and 1 o when two letters picked without replacement from omommo? 3/5 Three letters picked without replacement from {e: 3, v: 12}. Give prob of picking 3 e. 1/455 Four letters picked without replacement from mimmmim. Give prob of picking 2 i and 2 m. 2/7 What is prob of picking 1 l and 1 t when two letters picked without replacement from lpplllltppptlllpppp? 16/171 Three letters picked without replacement from mlrolrk. What is prob of picking 1 k, 1 r, and 1 l? 4/35 Two letters picked without replacement from ftxxsxssfessxfxxtssx. Give prob of picking 2 t. 1/190 Calculate prob of picking 3 q and 1 h when four letters picked without replacement from qhhhhhhqqh. 1/30 Three letters picked without replacement from {i: 2, o: 1, m: 8, g: 6, r: 1}. Give prob of picking 2 g and 1 i. 5/136 Four letters picked without replacement from kkiikikkkkiikikikiki. What is prob of picking 4 i? 42/1615 Four letters picked without replacement from {s: 2, b: 2, a: 7}. Give prob of picking 2 b and 2 a. 7/110 Three letters picked without replacement from {g: 7, q: 2}. What is prob of picking 3 g? 5/12 Three letters picked without replacement from bbbybbyybby. What is prob of picking 2 b and 1 y? 28/55 What is prob of picking 1 g and 1 f when two letters picked without replacement from fgytgfftygfj? 2/11 Calculate prob of picking 1 i, 1 s, and 1 z when three letters picked without replacement from gsggszggggii. 1/55 Calculate prob of picking 1 z, 1 e, and 1 s when three letters picked without replacement from lelelzs. 2/35 Calculate prob of picking 3 m and 1 b when four letters picked without replacement from {e: 7, b: 3, m: 3, g: 6}. 1/1292 Two letters picked without replacement from {o: 1, u: 1, g: 2}. What is prob of picking 2 g? 1/6 Three letters picked without replacement from {o: 16, m: 2}. What is prob of picking 2 m and 1 o? 1/51 Four letters picked without replacement from {w: 5, s: 7}. Give prob of picking 3 w and 1 s. 14/99 Calculate prob of picking 2 b and 1 z when three letters picked without replacement from {z: 2, b: 3, g: 4, d: 2}. 2/55 What is prob of picking 2 x when two letters picked without replacement from {x: 7, i: 6}? 7/26 What is prob of picking 4 e when four letters picked without replacement from {w: 1, e: 10, b: 6}? 3/34 Two letters picked without replacement from vtvtvvtvtvvvvvvvtvvv. What is prob of picking 1 v and 1 t? 15/38 Calculate prob of picking 3 c when three letters picked without replacement from {h: 6, c: 4}. 1/30 Two letters picked without replacement from cichphqp. What is prob of picking 1 h and 1 c? 1/7 What is prob of picking 2 m and 1 i when three letters picked without replacement from mmmiim? 3/5 Two letters picked without replacement from kttt. Give prob of picking 1 k and 1 t. 1/2 Calculate prob of picking 2 d when two letters picked without replacement from {s: 2, n: 7, d: 2}. 1/55 Calculate prob of picking 1 o and 1 e when two letters picked without replacement from oyoyoyhqzoooyyze. 1/20 Two letters picked without replacement from ggdgddggdgggggdg. What is prob of picking 1 d and 1 g? 11/24 Calculate prob of picking 1 m and 1 o when two letters picked without replacement from {y: 1, c: 9, m: 1, o: 2}. 1/39 Calculate prob of picking 1 j and 1 g when two letters picked without replacement from zjpzzzggkzzzzk. 2/91 Three letters picked without replacement from {c: 1, f: 1, d: 7, k: 10}. Give prob of picking 3 d. 35/969 What is prob of picking 2 t and 1 e when three letters picked without replacement from {s: 2, t: 2, e: 1, c: 1}? 1/20 Calculate prob of picking 1 v and 3 s when four letters picked without replacement from {l: 3, z: 3, u: 8, v: 2, s: 3}. 1/1938 Four letters picked without replacement from {h: 10, c: 2, x: 3}. What is prob of picking 1 x and 3 h? 24/91 Four letters picked without replacement from {q: 9, c: 3}. What is prob of picking 1 c and 3 q? 28/55 What is prob of picking 1 m, 1 r, and 1 h when three letters picked without replacement from lmrrzhli? 1/28 Three letters picked without replacement from cssccscscccsssscsscc. Give prob of picking 2 c and 1 s. 15/38 What is prob of picking 1 k and 1 g when two letters picked without replacement from {z: 1, k: 3, g: 2, u: 6}? 1/11 Two letters picked without replacement from uibchkb. Give prob of picking 2 b. 1/21 Calculate prob of picking 4 s when four letters picked without replacement from {s: 9}. 1 What is prob of picking 3 a when three letters picked without replacement from natnnaaaataaanaa? 3/14 What is prob of picking 2 k when two letters picked without replacement from kskos? 1/10 Calculate prob of picking 1 l and 1 n when two letters picked without replacement from nnlcl. 2/5 Calculate prob of picking 1 p and 1 t when two letters picked without replacement from qpqppqtptqppq. 2/13 Calculate prob of picking 1 b, 1 x, 1 e, and 1 d when four letters picked without replacement from {x: 3, s: 3, n: 2, b: 7, d: 1, e: 1}. 3/340 Two letters picked without replacement from nnnnnhnnhhnn. What is prob of picking 2 n? 6/11 Calculate prob of picking 3 y and 1 z when four letters picked without replacement from {y: 12, z: 3}. 44/91 Two letters picked without replacement from twgtpnwvwntwwnpvptpw. What is prob of picking 2 v? 1/190 Two letters picked without replacement from {l: 3, z: 3, b: 2, p: 1, e: 1}. What is prob of picking 1 l and 1 p? 1/15 Two letters picked without replacement from ginzgibl. What is prob of picking 1 l and 1 z? 1/28 What is prob of picking 2 u and 1 f when three letters picked without replacement from fqqyuqufqqqqfqy? 3/455 Three letters picked without replacement from {s: 1, r: 2, n: 1, u: 3, f: 4}. What is prob of picking 1 r and 2 u? 2/55 Two letters picked without replacement from {v: 3, l: 1, s: 1, e: 1, a: 2, r: 4}. Give prob of picking 2 v. 1/22 Three letters picked without replacement from {f: 2, e: 3}. What is prob of picking 1 e and 2 f? 3/10 Calculate prob of picking 1 h and 1 n when two letters picked without replacement from {h: 10, x: 1, v: 1, g: 2, n: 3, q: 1}. 10/51 What is prob of picking 1 g and 1 l when two letters picked without replacement from hllkkge? 2/21 Four letters picked without replacement from vbpdvvbvbv. What is prob of picking 2 p, 1 d, and 1 b? 0 What is prob of picking 4 h when four letters picked without replacement from {h: 4, c: 3, f: 2, u: 2}? 1/330 Two letters picked without replacement from rseezla. Give prob of picking 1 z and 1 r. 1/21 What is prob of picking 2 j and	{ "pile_set_name": "DM Mathematics" }
5)) + (1 - -8). 4 What is the value of (9408/(-816))/286/(-14)? 3/17 (-6)/(-12)(-24 - 2) -13 What is 4/8-1(-40)/(-28)? -5/7 What is the value of 48/(-10)1965/(-1572)? 6 Calculate (6 - (-112)/(-21))287/(-82). -7/3 Evaluate (400/1680)/(5/(-2)). -2/21 Evaluate ((-4512)/(-1880))/((9/10)/(-3 - 0)). -8 What is 73 - 76 - (2/(-4))/((-2)/(-28))? 4 (0 + (-2)/102)/(834/695) -1/3 Evaluate 15/(-20)(5/2 + (-86)/36). -1/12 What is (8/(-10))/(2/(-10)) + (16 - 7)? 13 What is (-35 + 497/14)-14? -7 Evaluate ((-15)/(-10))/(11/(-10 - -32)). 3 -8 + (-1485)/63 + 32 3/7 (2898/(-2093))/(5/65) -18 Evaluate ((5/10)/(3/(-21)))/(3/12). -14 (9/(-27)3/(-2))/((-16)/416) -13 ((-24)/(-60))/((-12)/225)2/(-10) 3/2 What is -8(5300/(-1378) - (-4)/(-26))? 32 Evaluate (-4)/488 + 3. 7/3 What is the value of (70/(-25))/1 - (-12)/3? 6/5 Calculate 15(2(-7)/77 - 13/(-11)). 15 Evaluate (-9 - (-73 - -58))/((-1)/(12/9)). -8 Calculate ((-8 + 9)-6)/(1 - 2). 6 (-3)/(-10)90 + 6 + 0 + -11 22 Evaluate 3100/(-180) + 39/(1404/8). -17 What is (-8)/16 + 70/112? 1/8 What is (-15)/(-2)1932/31395? 6/13 ((-15)/5)/(-117 - -118) -3 Calculate (1224/(-210) + 6)/((-1071)/135 - -8). 18/7 Calculate 2/7 - -9400/140. 26 Calculate (4/(-12))/(14/(-420)) + 3 + -21. -8 What is 90/(-20)(51/(-9) + 5)? 3 Calculate (18/(-225))/((-54)/90) - 484/30. -16 Evaluate ((-342)/(-133))/((-204)/(-42) + -3 + -2). -18 What is 4/36 + 5/((-1980)/68)? -2/33 What is (-240)/90(-18)/(-20)350/(-60)? 14 What is the value of 21/735105/10? 3/10 Evaluate 4/10(-575)/(-345). 2/3 Evaluate ((-415)/(-581))/((-55)/70). -10/11 Calculate (-20)/(-25) + (-78)/(-65). 2 Calculate 43 + 33356/(-930) + (-1)/(-5). 22/3 What is (2 + 6 + -2)/(16/32)? 12 What is the value of 12 - 10734/912 - (10/95 + 0)? 1/8 What is -5 - (-12)/(-7 - (-55)/10)? -13 (19 - 13)/(6/12) 12 What is (10/3)/((-1205)/(-5061))? 14 What is 153/170((-4)/6 - 16/(-12))? 3/5 Evaluate ((-33)/(-55))/(9/105) - -2. 9 (60/(-140))/(-3 - 0) 1/7 (21 + 1521/(-72))(-102 + -2) 13 Evaluate (-6 + -6 + 10)/(-16). 1/8 What is (-297)/(-495) + 62/5? 13 Evaluate (-36)/(-4 + 10) - ((-8)/2 - 4). 2 What is the value of 2(-9)/((-153)/68)? 8 Calculate -13 + 164/54(-3114)/(-692). 2/3 What is the value of (7 + 512/(-80))/(-1)? -3/5 Calculate -9112/(-148 - 20). 13/2 Evaluate 126(-6)/60 - (-4)/(20/3). -12 What is the value of (16/(-24))/(11/((-1617)/(-14)))? -7 Evaluate (25/230)/((-4)/(-42) + (-4656)/(-4032)). 2/23 (-26920)/3800 - 703/(-95) 6/19 Evaluate (-129)/(-516)(-204)/3. -17 Calculate (6 + 189/(-35))/(11 + -8). 1/5 What is the value of 2/(((-46)/(-10))/((-9)/63014))? -2/23 Calculate 0(-13)/(-182) - (-1)/(-12)-2. 1/6 (418 - 414)69/(-12) -23 Calculate (-10 - ((-92)/28 + -7))/((-1)/(-21)). 6 Evaluate (59 + -58)73/(-6). -7/2 What is (-1)/((41/2214)/(1 - 1/2))? -27 What is the value of (2/(-5) - (-91)/140)/((-432)/(-25920))? 15 4/98 - -81157/(-101920) -1/20 226/((-52780)/105) -3/29 What is 16(-13)/(-624)(0 - -6)? 2 What is ((-1)/(-42))/(-69 - (-81242)/1176)? 2/7 What is 371/(-42) - (-150)/180? -8 What is the value of 7(2-2 + 3) - (-90 - -86)? -3 What is the value of 16(19 - 9)/(-20) + -3 - -4? -7 What is the value of 690/(-276)((-96)/(-10))/(-3)? 8 (-24)/1 + (-170660)/(-7155) -4/27 What is ((441/(-14))/7 + 5)/(189/(-42))? -1/9 Calculate (-12)/(-14)(-3066)/(-1314). 2 Evaluate 66/10 + (-132)/220. 6 Calculate 20 + 21182/(-156). -9/2 What is the value of 1 + 5 + ((-460)/138 - 1/(-3))? 3 (-18135)/78(-28)/210 31 Evaluate (136/5)/8 - 10/251. 3 Calculate (-29391)/23634 - 1/(-13). -7/6 What is the value of (-3)/24 - (-61608)/(-3264)? -19 What is the value of 14(3/(-6) - (-6 + 5))? 2 What is (-2)/3 - 23/(345/(-30))? 4/3 Calculate ((-567)/4158)/(1/((-28)/3)). 14/11 What is the value of -10 + (2418/18)/13? 1/3 (-28)/(-4) - (-6 - 267/(-21)) 2/7 (-14586)/4914 + (3 + -24)/(-7) 2/63 What is 1/((-1)/7(0 - 49/56))? 8 (18 - 22)/(52/247) -19 Evaluate -17(3/9)/(7 - (-160)/(-24)). -17 What is the value of (-7)/2(-64)/88 + (36 - 38)? 6/11 What is the value of 6/207 + 79086/71001 + -21? -6/7 What is the value of ((12 + 430/(-35))/(2/(-28)))/(-2)? -2 What is the value of (-162)/495(44 + -54)? 36/11 -1(-5)/(-10) - -11(-27)/(-522) 2/29 Calculate (1(-6)/(-50))/(((-27)/(-45))/3). 3/5 Calculate 11 + ((-3390)/190 + 0 - -7). 3/19 3/(-2)(3 + 155/(-15)) + -31 -20 What is (-437)/(-57) + -8 + (250/(-12))/5? -9/2 What is the value of (-1)/6 - 290/(-44)(-3)/(-45)? 3/11 What is the value of (-13)/(-12(-10)/(-120))? 13 What is 2/9 + (-474)/(-54)? 9 Calculate 3(67/804)/(1-11). -1/4 What is 2/(2 + -42)784/588? -1/15 Evaluate (-1691)/445(-6 - -11). -19 What is the value of (-31)/(4340/(-56)) + 164/(-160)? -5/8 ((-2)/(-3))/((-12)/765110/44) -17 Calculate 202/16 + ((-966)/46 - -8). -3/8 Evaluate (-5)/2(-28)/10 + 32 + -31. 8 (-8 - 3/(-3))(14 + -11) -21 What is the value of (1311/46)/19(-20)/165? -2/11 Evaluate 30/(-55) + (-286)/363. -4/3 What is (-12)/(-54)-3 - ((-552)/(-18))/(-4)? 7 What is 244/22 - (-153 + 164)? 1/11 Evaluate ((-255)/135(-6)/(-4) + 3)-4. -2/3 What is 1/(-6) + (56 - (-1859)/(-33))? -1/2 Calculate (5/(-35))/((221/(-153))/(-13)). -9/7 Calculate (-339)/210 - (28/(-5))/4. -3/14 -6 - ((32/54)/2)/((-62)/1209) -2/9 What is -11 - (-28)/(-84)(4 - 31)? -2 (-91)/(-38038)95(-4 + (1 - 1)) -10/11 What is the value of (840/100 - (8 - 0)) + (-231)/15? -15 What is the value of 100/(-200) + 54/4? 13 Evaluate ((-3)/(-57))/((-59)/118). -2/19 Calculate (24/(-18))/(32/54033/22). -15 What is 10 + 549/54 + -10 - (0 + 9)? 7/6 Evaluate ((-108)/(-66))/(-34 + 999/27). 6/11 Calculate 6 + (-30)/18 + 8/(-24). 4 What is the value of (-2276)/60314 + 168/(-1166)? -2/11 Calculate ((-18)/(-408))/(189/(-168)). -2/51 What is -2(-48)/(-44) + (-18)/(-99)? -2 What is the value of (1 - -9)/(-578 - -562)? -5/8 What is (-160)/198 + 200/330(-15)/(-25)? -4/9 Calculate (14/(-35) + 32/30)(-30)/(-10). 2 What is 378/(-84)8/(-9)? 4 -203832/(-10528) + -16 2/47 What is 2/13(-4693)/(-38)? 19 (6 - 6)100/2500 0 Evaluate 20/14 + (-27825)/(-3675). 9 50/275 + 203/(-693) -1/9 What is the value of (4 + 30)((-357)/34 - -10)? -17 (31 - 2691/81)(3 - 48/15) 4/9 Evaluate (-10 + -42)(-48)/208. 12 Calculate (-178)/356 + (-38)/(-4). 9 What is (-748)/62 + 106/1643 - -31? 19 What is ((-152)/1900)/(2/(-5) - 0)? 1/5 What is 78/(-182) + (-9)/21? -6/7 Evaluate (-189)/532 - (-13)/52. -2/19 Evaluate 7 + 257/(-37) - 796(-2)/(-2072). -5/7 Calculate (-32)/(-48) + 156/36. 5 Calculate (5/((-375)/12))/((-12)/30). 2/5 Calculate 7/(-3)(-160)/140(-4)/16. -2/3 648/(-1188) - 588/(-594) 4/9 37/(333/126) - 22 - (-366)/46 -1/23 ((-15)/27)/((-1955)/(-204) - 10) 4/3 Calculate 5 - (26/39)/(-3 - (-32)/12). 7 Evaluate (-72)/(-324) + (0 + 1 - 1). 2/9 ((-356)/180 - (-76)/38)(-15)/(-12) 1/36 Evaluate ((-4)/6)/(180/216). -4/5 What is the value of 963/(-214)-2(-2)/84? -3/14 (45/25/15)/(3/6) 15 Evaluate -11 + (-266)/28-2. 8 What is the value of (-14)/16 + 32/(768/18)? -1/8 What is (-2 + 1)/((9 + -7)/34)? -17 What is the value of (-8667)/(-1498) - (-18 - 0)/(-3)? -3/14 Calculate (-41)/((-861)/(-462)) + 11. -11 (42/28 - -10 - 4)-2 -15 ((-2)/12(-9)/6)/(108/576) 4/3 12(-17 - 1740/(-90)) 28 What is the value of (0 - (-108)/48)/(12/8)? 3/2 What is the value of (7/(-30)-5)/(-8 - -15)? 1/6 (-16)/112 + (-679)/49 -14 Evaluate (1 + 1)/(((-266)/(-28))/(-19)). -4 Calculate 4/(-18) - (6354/(-162) - -32). 7 What is the value of (12 + -10)/(310/(-93))? -3/5 What is -4 + (-15)/((-70)/(-14))? -7 (21/(-2))/(-1) - -14(-12)/336 10 What is (65/(-156))/(-5) + (4 - 537/(-36))? 19 Evaluate (-66)/(-220) - 567/90. -6 Evaluate (1162/(-664)(-3)/(-14))/((-3)/(-5)). -5/8 What is (7 + 2)(-6 - 0)(-715)/2574? 15 What is -5 + (1/30-9)/((-18)/310)? 1/6 What is -12 + 3 + 259/28? 1/4 Evaluate -24 - (-9 + 1540/(-98)). 5/7 1/(-20)488 - -24 -2/5 Evaluate (117/(-9))/(-13)2/6. 1/3 What is (-6)/((-5)/10 + 36/(-24))? 3 What is ((-171989)/102)/(-67) - 25? 1/6 (((-54)/4)/3)/((-410)/(-20) + -31) 3/7 What is the value of 411/(-81) + 5 - (-6206)/(-783)? -8 Calculate 29 + -10 - (-3)/((-27)/9). 18 402/(-34) - (-2763)/(-15657) -12 Calculate -2 - 11 - (-140 + 137). -10 Evaluate -1 + -17 + -1 + 26. 7 Evaluate 44/(-40)300/(-96)-8. -10 108/10 + -611/(-330) 11 Evaluate (227/(-48))/(-16 + 6	{ "pile_set_name": "DM Mathematics" }
k'th term of -72821, -145661, -218487, -291293, -364073? k3 + k2 - 72850k + 27 What is the w'th term of -870693, -1741387, -2612081, -3482775, -4353469, -5224163? -870694w + 1 What is the h'th term of -8049, -16101, -24153, -32205, -40257, -48309? -8052h + 3 What is the t'th term of -151291, -151289, -151287? 2t - 151293 What is the l'th term of 192, 165, 132, 93? -3l2 - 18l + 213 What is the i'th term of -119607, -239219, -358827, -478431, -598031, -717627? 2i2 - 119618i + 9 What is the i'th term of 294, 348, 378, 372, 318, 204, 18, -252? -2i3 + 68i + 228 What is the q'th term of 10658, 10645, 10632, 10619? -13q + 10671 What is the y'th term of -9954, -9900, -9856, -9828, -9822, -9844, -9900, -9996? -y3 + y2 + 58y - 10012 What is the u'th term of 23, 17, -25, -115, -265, -487? -2u3 - 6u*2 + 26u + 5 What is the m'th term of 478, 961, 1444, 1927, 2410, 2893? 483m - 5 What is the g'th term of -178, -392, -698, -1096, -1586, -2168? -46g*2 - 76g - 56 What is the i'th term of 61935, 61939, 61945, 61953? i2 + i + 61933 What is the l'th term of -17, -24, -43, -80, -141, -232, -359, -528? -l3 - 16 What is the n'th term of 4175, 8562, 12949? 4387n - 212 What is the i'th term of -63552, -63555, -63558, -63561, -63564? -3i - 63549 What is the v'th term of 6119, 12236, 18353? 6117v + 2 What is the l'th term of 210589, 210600, 210617, 210640? 3l*2 + 2l + 210584 What is the a'th term of -5144, -5117, -5090, -5063? 27a - 5171 What is the o'th term of -20469, -40950, -61431, -81912, -102393? -20481o + 12 What is the z'th term of 17625, 35252, 52879, 70506, 88133? 17627z - 2 What is the p'th term of -297, -610, -953, -1338, -1777, -2282, -2865? -2p*3 - 3p*2 - 290p - 2 What is the u'th term of 20, -42, -124, -220, -324, -430? u*3 - 16u*2 - 21u + 56 What is the g'th term of 442, 872, 1328, 1822, 2366, 2972? 2g3 + g2 + 413g + 26 What is the v'th term of -151, -106, -65, -28? -2v2 + 51v - 200 What is the r'th term of 5209, 5116, 5023? -93r + 5302 What is the m'th term of 76656, 76659, 76664, 76671? m2 + 76655 What is the o'th term of 1824, 2340, 2856, 3372, 3888? 516o + 1308 What is the y'th term of -4800, -9487, -14188, -18909, -23656? -y3 - y2 - 4677y - 121 What is the o'th term of -90962, -90950, -90936, -90920, -90902, -90882? o2 + 9o - 90972 What is the s'th term of 15841, 63387, 142637, 253597, 396273, 570671, 776797, 1014657? s*3 + 15846s*2 + s - 7 What is the x'th term of 1916, 1900, 1872, 1832, 1780? -6x*2 + 2x + 1920 What is the y'th term of -244, -459, -650, -817, -960, -1079? 12y2 - 251y - 5 What is the t'th term of -4551, -4548, -4545? 3t - 4554 What is the u'th term of 379, 454, 529? 75u + 304 What is the q'th term of -4342539, -4342540, -4342541? -q - 4342538 What is the h'th term of -1525, -3052, -4595, -6154, -7729, -9320? -8h2 - 1503h - 14 What is the f'th term of -920, -781, -642, -503, -364? 139f - 1059 What is the z'th term of 364, 379, 392, 397, 388, 359, 304? -z3 + 5z*2 + 7z + 353 What is the o'th term of 840, 926, 1066, 1254, 1484, 1750, 2046, 2366? -o*3 + 33o*2 - 6o + 814 What is the v'th term of 9484, 9481, 9478, 9475, 9472? -3v + 9487 What is the k'th term of -98495, -98415, -98335, -98255, -98175? 80k - 98575 What is the z'th term of 47331, 94636, 141941, 189246, 236551, 283856? 47305z + 26 What is the i'th term of -372, -740, -1110, -1482, -1856, -2232, -2610? -i2 - 365i - 6 What is the r'th term of -17626, -17648, -17686, -17740? -8r2 + 2r - 17620 What is the o'th term of -12037, -11849, -11661, -11473, -11285, -11097? 188o - 12225 What is the p'th term of -2004, -8002, -17986, -31956, -49912, -71854? -1993p*2 - 19p + 8 What is the w'th term of 60513, 242069, 544665, 968301? 60520w2 - 4w - 3 What is the z'th term of -15733, -15742, -15757, -15778, -15805, -15838? -3z2 - 15730 What is the l'th term of 380, 756, 1132, 1508? 376l + 4 What is the x'th term of -24701, -49415, -74129, -98843, -123557, -148271? -24714x + 13 What is the k'th term of -36656, -36658, -36662, -36668, -36676? -k2 + k - 36656 What is the y'th term of -1940, -3863, -5784, -7703, -9620, -11535? y2 - 1926y - 15 What is the p'th term of -6470, -12920, -19372, -25826, -32282, -38740, -45200? -p*2 - 6447p - 22 What is the n'th term of 9253, 9309, 9399, 9523, 9681, 9873, 10099? 17n2 + 5n + 9231 What is the v'th term of -89, -326, -741, -1352, -2177, -3234, -4541, -6116? -3v3 - 71v*2 - 3v - 12 What is the f'th term of 3354, 13093, 29326, 52053, 81274, 116989, 159198? 3247f2 - 2f + 109 What is the m'th term of 1314, 2615, 3918, 5223, 6530? m*2 + 1298m + 15 What is the d'th term of 3580, 3568, 3558, 3550, 3544, 3540, 3538? d*2 - 15d + 3594 What is the y'th term of 4280, 8574, 12866, 17156, 21444? -y*2 + 4297y - 16 What is the s'th term of -746, -1415, -2084, -2753, -3422? -669s - 77 What is the s'th term of -4465, -4435, -4385, -4315? 10s*2 - 4475 What is the x'th term of 87, 143, 233, 357, 515? 17x*2 + 5x + 65 What is the x'th term of -10044, -10037, -10030? 7x - 10051 What is the m'th term of 12230, 12224, 12218? -6m + 12236 What is the l'th term of -417, -544, -671? -127l - 290 What is the b'th term of 113, 240, 387, 554? 10b*2 + 97b + 6 What is the w'th term of -92636, -92621, -92596, -92561, -92516? 5w2 - 92641 What is the v'th term of -122231, -488962, -1100187, -1955912, -3056143, -4400886? -v3 - 122241v*2 - v + 12 What is the u'th term of 841, 955, 1145, 1411? 38u*2 + 803 What is the m'th term of -172930, -172919, -172908, -172897? 11m - 172941 What is the r'th term of 2373, 2260, 2161, 2082, 2029, 2008, 2025, 2086? r3 + r2 - 123r + 2494 What is the z'th term of -6454, -6405, -6356, -6307, -6258? 49z - 6503 What is the q'th term of 23119, 23115, 23111, 23107, 23103? -4q + 23123 What is the s'th term of 451659, 451661, 451663? 2s + 451657 What is the o'th term of 877, 1699, 2521, 3343? 822o + 55 What is the r'th term of -436, -1770, -3994, -7108, -11112? -445r*2 + r + 8 What is the b'th term of 1284, 2531, 3774, 5013, 6248? -2b*2 + 1253b + 33 What is the g'th term of -21, -175, -529, -1155, -2125, -3511, -5385, -7819? -12g3 - 28g*2 + 14g + 5 What is the f'th term of 469, 1272, 2409, 3880, 5685, 7824? 167f2 + 302f What is the s'th term of -13434, -13447, -13460, -13473? -13s - 13421 What is the x'th term of -50, -116, -176, -230, -278, -320, -356? 3x*2 - 75x + 22 What is the s'th term of -198981, -198983, -198985? -2s - 198979 What is the s'th term of -5404, -5425, -5446, -5467? -21s - 5383 What is the i'th term of -121, 29, 173, 305, 419, 509, 569? -i*3 + 3i*2 + 148i - 271 What is the o'th term of -4820, -19272, -43360, -77084, -120444? -4818o2 + 2o - 4 What is the z'th term of 13359, 13361, 13363? 2z + 13357 What is the w'th term of 1130, 594, 48, -514, -1098, -1710, -2356? -w3 + w2 - 532w + 1662 What is the b'th term of 1192, 1185, 1180, 1177, 1176? b*2 - 10b + 1201 What is the h'th term of 15746, 31491, 47236, 62981, 78726? 15745h + 1 What is the g'th term of -331, -740, -1137, -1510, -1847? 2g*3 - 6g*2 - 405g + 78 What is the o'th term of 11379, 11375, 11369, 11361, 11351, 11339? -o2 - o + 11381 What is the m'th term of 55095, 55081, 55055, 55011, 54943, 54845, 54711, 54535? -m3 - 7m + 55103 What is the g'th term of -8492, -8517, -8542, -8567, -8592, -8617? -25g - 8467 What is the k'th term of -23204, -23335, -23562, -23891, -24328, -24879? -k*3 - 42k*2 + 2k - 23163 What is the w'th term of -3440, -3454, -3476, -3506, -3544, -3590? -4w2 - 2w - 3434 What is the u'th term of -185968, -185970, -185972, -185974, -185976, -185978? -2u - 185966 What is the f'th term of 24582, 49160, 73738, 98316, 122894? 24578f + 4 What is the d'th term of 391, 642, 893, 1144, 1395? 251d + 140 What is the t'th term of 302, 631, 986, 1367? 13t*2 + 290t - 1 What is the g'th term of -519, -624, -731, -840, -951? -g*2 - 102g - 416 What is the o'th term of 5907, 11780, 17579, 23268, 28811? -6o3 - o2 + 5918o - 4 What is the b'th term of -385, -505, -627, -751, -877, -1005? -b*2 - 117b - 267 What is the u'th term of -2270, -3060, -	{ "pile_set_name": "DM Mathematics" }
s f a multiple of 76? True Suppose 0 = -26m + 31m - 10. Suppose -mt + 516 = t. Suppose -2a + t = 58. Does 8 divide a? False Let n(i) = i*2 + 13i + 11. Let b = 22 - 34. Let u be n(b). Is -4 - (-86 - (-1 - u)) a multiple of 11? False Suppose -10 = -2b + 288. Let g = b + -130. Suppose 0 = 21n - gn - 448. Is 9 a factor of n? False Let r = 1019 - 64. Does 2 divide r? False Let k be (-2)/(-19) + (-1044)/(-551). Suppose 10 = 2w, -kr + 436 = -w - 3w. Is 35 a factor of r? False Let f(j) = 276j3 + 424j - 2168. Is f(5) a multiple of 87? True Let u = -162 + 275. Let o be ((-22)/(-77) - 1263/84)4. Let g = u + o. Does 11 divide g? False Suppose -7q + 171 = 2m - 4q, q = m - 93. Let i be ((-8)/(-10))/(36/m). Does 11 divide (5 - (-47)/(-4))(-2 - i)? False Suppose 35 + 127 = -p + 3c, 634 = -4p - 2c. Let v = -333 - p. Is 34 a factor of 5/2v/(-5)? False Let n = 7 + 17. Let x(a) = -a2 + 23a + 58. Let t be x(25). Does 7 divide ((-546)/n)/((-2)/t)? True Suppose -8608j = -8592j - 840192. Is 96 a factor of j? True Suppose 0 = 2f - 1318 - 1298. Suppose 35h = 30h + 4m + 1635, -3m + f = 4h. Is h a multiple of 31? False Let p(v) = v - 1. Let m(w) = 2w2 - 9w - 10. Let g(z) = m(z) + 6p(z). Let j be g(8). Does 36 divide 6(-4 + j/4)? True Suppose 266 = k + 3c + c, -2k + 548 = 4c. Suppose 68b + k = 70b. Suppose -11v = -68 - b. Is v a multiple of 7? False Suppose 4f + 5h = 100400, -47f + 48f = 3h + 25134. Is f a multiple of 27? True Let p(t) = -3t - 4. Let x be p(-1). Let o(d) = 283d2 + 2d + 4. Does 15 divide o(x)? True Let c = -43 + 42. Let a(o) = 8o2 - 2o - 1. Is 2 a factor of a(c)? False Suppose -9991 = -94s + 27717 + 38714. Is 5 a factor of s? False Let k = -43 - -43. Suppose 15o = 11o + 48. Suppose k = -n - 0n + o. Does 3 divide n? True Let s be 13/91 - 9743/(-7). Suppose -652n + 654n = s. Is 63 a factor of n? False Let b = -8 - -13. Suppose -4v + bv + 125 = 0. Is (v/10 + 2)-2 a multiple of 7? True Let g(q) = -1031q - 2183. Is 10 a factor of g(-13)? True Let r(p) be the first derivative of 11p3/3 - 4p*2 - 29p + 8. Let x be r(13). Is (-5)/(-15) - 1 - x/(-6) a multiple of 33? False Let v(d) = 7d2 - 5d - 10. Let c be v(3). Suppose n + 21090 = cn. Does 38 divide n? True Let q(n) = -4n + 10. Suppose -2y + 5 - 25 = 0. Does 3 divide q(y)? False Let r be 7455/5 + -2 + (2 - 3). Let l = 2366 - r. Is 63 a factor of l? False Let f = -54 - -58. Let g(c) = c3 - c2 + 12c - 6. Does 15 divide g(f)? True Suppose 0 = -4f - 5y + 7332, 0 = -5f + 2y + 3y + 9120. Suppose f = 3d + 373. Suppose 10g - 15g = -d. Does 17 divide g? False Let n(r) = -2r2 - 35r - 20. Let s be n(-14). Let t be ((-2)/3)/((-13)/s). Suppose 4v = 4l + 5v - 456, tl - 480 = 5v. Is 23 a factor of l? True Suppose -60d - 57494 = -295274. Is d a multiple of 7? False Suppose -4d - 4r = -28, 0 = -2d + d - 4r + 13. Suppose df - 2f = -2s + 19, 3f + 5s - 34 = 0. Suppose -891 = -fq - 156. Is 31 a factor of q? False Let q(n) = 2n2 - 7n - 6. Let x be q(9). Suppose 77 = 2b - x. Does 7 divide b? False Suppose 4v + 4484 = 4q, -2v - 1896 + 6392 = 4q. Suppose -2h = 4i - 1138, 2h - 12i = -13i + q. Does 71 divide h? False Let r = -257 + 135. Let j = -221 - -35. Let p = r - j. Is p a multiple of 4? True Let n = -38576 - -49946. Is 30 a factor of n? True Suppose 5g - r - 1201 = 0, 0 = -3g - 32r + 34r + 722. Does 12 divide g? True Let v(x) = -6x + 57. Let l be v(9). Suppose lt - 1295 = -5c, -4c - 1027 = -5t + 1156. Let y = t + -197. Is y a multiple of 14? True Suppose 81s = 5r + 80s - 62470, 4s = -r + 12473. Is r a multiple of 31? True Let h = -73 - -75. Suppose hz + 3b = 22, -2z - 5b + 9 + 21 = 0. Suppose 5d = -5j + 1170, 4d - 938 = -zj + 3j. Is d a multiple of 47? True Suppose 4j - 64230 = -7z, -13461 = 3z + 5j - 40998. Does 22 divide z? True Suppose -5b + 2b = -5283. Does 9 divide b? False Suppose 0r - 5r = 2q - 1892, -3r + 1129 = -5q. Suppose -19o + 7887 = -r. Does 20 divide o? False Suppose -3w + 5i + 1631 = -1815, -4w + 4608 = -4i. Let h = -437 + w. Does 12 divide h? True Let g be ((-2)/(-5))/185. Suppose gf = 11426 - 1260. Is f a multiple of 16? False Let u = -6504 + 7350. Is 9 a factor of u? True Suppose 0 = 7s + s - 9840 + 1680. Is 6 a factor of s? True Suppose -2q + 2l = -3q - 6, 2l = -10. Suppose -qm + 166 = 2o, -2o + 3m - m + 136 = 0. Suppose -f = f - i - 126, o = f + 2i. Is f a multiple of 3? False Suppose 2u - 6u + 1939 = 5w, -5u = -5w - 2480. Suppose -3z - 737 = 3h + h, -1205 = 5z + 2h. Let q = z + u. Is q a multiple of 12? True Let w(l) = 7l*2 - 21l + 3. Let z(g) = -4g2 + 11g - 1. Let t(h) = -6w(h) - 11z(h). Is t(-5) a multiple of 4? False Let h(x) = 6x + 17. Let v be h(3). Let z be (1/(v/(-14)))/(2/(-90)). Suppose -12w - 840 = -zw. Does 27 divide w? False Let q = -18 - -30. Let i(p) = -13p - 13. Let o(l) = -11l - 11. Let s(n) = 5i(n) - 6o(n). Does 3 divide s(q)? False Let d = -87 + 91. Suppose -19h - dh = -5152. Is 7 a factor of h? True Let a be -1(6 - 4 - (4 - -1)). Suppose -3w - 1 = -5t + 29, -30 = aw + 3t. Does 10 divide w((-11)/(-1))/(-1)? True Let s be ((-4)/3)/(12/(-18) - 0). Is 7 a factor of (-27)/(-36) - (3050/(-8) + s)? False Let k(h) = -2620h - 1636. Does 28 divide k(-6)? True Let y = -139 + 143. Suppose -2n = 3s - 346, 4s = -yn + 36 + 660. Is 16 a factor of n? True Let o be 1/(-3) + 2252/6. Suppose -2q = 43h - 41h - 10, -4q = -3h - 41. Suppose -o = -qp + 169. Is 11 a factor of p? False Is (31/(620/(-2288)))/(10/(-225)) a multiple of 45? False Suppose 0 = 23y - d - 1891750, -4y + 3d = -29883 - 299117. Does 53 divide y? False Suppose 69i + 7821 = 60i. Is 8/(-24)15-1 - i a multiple of 46? True Suppose 0 = 4r + 63 + 225. Is 66 a factor of ((-5480)/18)/(-4) + 8/r? False Let m(n) = -203n3 - 15n*2 - 20n + 1. Let s(w) = 40w3 + 3w*2 + 4w. Let z(h) = -2m(h) - 11s(h). Does 19 divide z(-2)? True Suppose 0 = -5b + 2m + 37168, 2b = 2m + 13533 + 1327. Is b a multiple of 22? True Let n(a) = 643a + 904. Is n(5) a multiple of 32? False Suppose -j + 16j + 45 = 0. Let w(i) = -85i + 69. Is w(j) a multiple of 27? True Let v be (-8 + -4)/2(-10)/15. Does 31 divide (-3 - (-32)/v) + 415? False Suppose 5i = -4k - 132 + 903, -3i + 4k + 437 = 0. Suppose 3x = -3c + 429, c = -0c + 3x + i. Is c a multiple of 14? False Suppose 4789q + 340704 = 4797q. Does 39 divide q? True Let q = -3601 - -4556. Is q a multiple of 69? False Suppose 334u - 339u = 2g + 190 - 18210, g = 0. Is 3 a factor of u? False Suppose 125200 = 4z - 2t, -141z = -145z + t + 125200. Is 20 a factor of z? True Suppose 2u + 532 = 4u. Suppose m + 5x = -2m - u, -m - 66 = -4x. Let a = -77 - m. Is a even? False Let n(k) = 23 + 1 + 10k - 8k + k. Let b be n(-6). Suppose 3t = -3, bq - 3q - 5t - 518 = 0. Does 32 divide q? False Suppose a - 5 = 0, 4a - 30 = c - a. Let x be ((-8)/c - 2) + 2/5. Is x - (2 + 316/(-8)2) a multiple of 13? False Let k(q) = -q*3 - 38q*2 + 72q - 964. Is 35 a factor of k(-48)? True Suppose 0 = 12h - 25418 - 49882. Is 207 a factor of h? False Let z(s) = 78s - 231. Let t be z(-9). Does 36 divide 102/153t/(-2) + -5? False Let d(x) = 38x*2 + 33x*2 + 42x*2 - 20 - 112x*2 + x. Does 7 divide d(-9)? False Let g(j) = 177j*2 + 164j + 22. Does 10 divide g(4)? True Let g = 53 - 80. Let t be -1(6 + g)34/6. Let y = -78 + t. Is y a multiple of 9? False Suppose -5j + 760 = -b, 4j - 597 = 5b - 10. Is j a multiple of 17? True Let y = -218 - -239. Suppose 0 = -yh + 6304 - 2272. Is h a multiple of 9? False Let q = 243 + -239. Suppose qi + 0i - 436 = 0. Is i a multiple of 8? False Let l(g) = 15g2 - 200g - 3028. Is l(-19) a multiple of 16? False Let w(j) = -2j - 326 + 3j - 2j + 330. Let o be w(1). Suppose -od = -2y + 342 - 58, 0 = 4y - 3d - 562. Is 32 a factor of y? False Suppose 3j - 114 = -3v, -3v + 6v - 128 = 4j. Suppose 2 = 3h - v. Is 21 a factor of h/3144/14? False Suppose -2x = -3x + 18. Let f(o) = 6o + 6o + xo. Is f(1) a multiple of 30? True Suppose -50h + 22 = -39h. Suppose -ho - 3k = 2o - 1384, 1730 = 5o + k. Is o a multiple of 5? False Suppose -42m	{ "pile_set_name": "DM Mathematics" }
the value of 9/39((-520)/(-30))/(-13)(-63)/6? 42/13 What is the value of ((-1)/325)/((-5939)/(-59390))? -2/65 Evaluate (623/(-7120)-8)/7. 1/10 Evaluate 7/(207/(-621)12/(-1)). 7/4 Calculate (33/(-22))/((588/10)/((416/65)/8)). -1/49 (-140)/(-336)3/5-56 -14 What is (-10)/1260-60(-21)/6639/(-15)? 71 Calculate (4/(-8)12)/((-570)/722). 38/5 Evaluate 112/(-12)(45/(-4))/((-1056)/(-704)). 70 What is the value of (((-6)/3)/((-36)/(261/(-29))))/19? -1/38 What is the value of (7/((-46550)/(-76)))/((-20)/(-28))? 2/125 What is ((-14784)/(-80))/33-430/(-576)? 7/6 Calculate ((-60852)/7376(-100)/(-22))/(6/20). -125 Evaluate (6/(-150))/(101/(4040/100)). -2/125 What is the value of (-44)/4841067-1? 97 (((-658)/(-77))/47)/(-2) -1/11 What is -185/5(423/(-94))/(-9)? -17/2 Calculate (1/(25/100))/((-16)/28). -7 What is 10(-27)/(-1575)10(-378)/(252/(-14))? 36 Evaluate (-1862)/627(-6490)/2065. 28/3 Calculate -3530/4409664. -30/13 Calculate ((-4)/8)/((-182)/(-28))1052/(-263). 4/13 What is the value of ((-4)/183)/(((-69090)/35721)/(-235))-1? 81 Calculate (-1)/(2/16(-56)/350). 50 ((-332)/5146)/((-6)/93)(-2)/((-8)/(-52)) -13 Evaluate (-6)/(66/(-19074)-102). -17 What is the value of (15016054/26175)/((-8)/2-1)? 23 (-3(-29)/(-348))/(((-10)/(-235)-1)/8) 47 ((3/(-20))/((-793)/39650))/(1(-1)/10) -75 What is the value of (-154292)/6807(-27)/12? 51 Calculate (116/145)/((-93)/((-299925)/30)). 86 Evaluate (-308)/(-56)(-2)/((-88)/14)486/21. 81/2 What is the value of (((-7860)/(-18))/(-5))/(((-638)/(-174))/((-66)/(-12)))? -131 What is the value of (475/300)/(20/(-12))4? -19/5 What is (1613/(-52))/((18/3)/36)? -24 ((-1297)/2594)/(((-1)/(-54))/(-1)) 27 Evaluate 4932/(-3699)8/((-96)/(-693)). -77 Calculate 12/((-18000)/70)26(-8)/(-364). -2/75 Calculate (2(-2)/34)/(851080/5425635). -3/4 Calculate ((-85)/990)/((-14603)/1718). 1/99 Calculate -2((-311640)/(-60))/98. -106 What is the value of 44/((-5984)/(-510))(-7)/((-105)/72)? 18 Calculate (10/5)/((-2)/4)1/(-210)-5. -2/21 Evaluate ((-7)/21)/((((-672)/1498)/24)/(-3)). -107/2 Calculate 19448/(-442)45/(-24420). 3/37 Evaluate (-28)/(((-8)/21)/(-31(-228)/12369)). 42 Evaluate (15/12)/((-472)/5664). -15 12413/(-4248)(-4)/6 7/9 What is the value of ((-24871)/88179)/((-33)/9)? 1/13 What is the value of ((-840)/13444/3)/(5(-11)/(-99))? -3/2 Evaluate (36/2331)/(12/(-2016)-24). 4/37 Calculate -2(-1165)/2330(-14)/(-6). 7/3 What is the value of ((4/6)/(-2))/((8062/(-2871))/((-20)/165))? -2/139 (2844/(-34760))/((-117)/(-52)) -2/55 ((-5)/3)/(17/((-48960)/(-150))) -32 What is the value of (12/98)/(1068/2380)? 3/7 Calculate ((405/(-405))/(-19))/((-1)/(-9)). 1 What is (188048/(-876)(-2)/7)/(-85/(-30))? 46 What is the value of ((-8)/116)/(498/(-2407))(-12)/62? -2/31 Calculate 2160/4455(-315)/(-14)-43/(-120). 12/11 (6/10)/((-104)/(291200/5544)) -10/33 Calculate (-3)/(-322)4204/(-3153). -2/161 What is ((3/(-14))/((-259)/777))/((-1)/((-77)/(-6)))? -33/4 Evaluate (5/2)/((-3)/(-2))12294/(-27320). -3/4 What is (12/1596)/((-8)/280-10)? 1/38 (51360/(-5350))/(2/(-5)) 24 4-3(-5)/1801(-27)/(-738) 1/82 What is 403/(-372)2594/(-33)? 39 (-33)/(((-700)/(-15))/(-10)459/(-102)) -11/7 What is (-160)/1200630/189? -4/9 What is (-20920)/1464421/27? -10/9 Evaluate (22/36)/(8/(-768)8). -22/3 What is the value of (385/10)/11((-38)/(-95))/(-2)? -7/10 Calculate (1/(2/(-1)))/(((-30972)/(-178))/21924). -63 Evaluate (4/(-552))/(2/4)(-126)/(336/24). 3/23 What is the value of ((300/(-81))/(6/(-9)))/(((-34)/51)/(-1))? 25/3 What is the value of 3/147104/1404-27? -2/49 What is the value of (((-1716)/935)/26)/(1219/(-760))? 4/17 What is the value of ((-2)/1)/(178/(16732/846))? -2/9 Evaluate ((36299760/(-328))/210)/((-34)/2). 31 What is 15204/(-2172)7/(147/120)? -40 Calculate ((-73)/3)/((-2)/(-66))((-38383)/(-3223))/(-131). 73 Evaluate ((-720)/110)/(39(-57)/16302). 48 Evaluate (1745/92485)/((-26)/1176/4). -3/53 Calculate ((-1)/24)/((-19)/(-26448)-2). 29 Evaluate 50(-140)/7448076. -50/7 Evaluate 135/66/(14/(336/108)). 30 What is the value of ((16/(-256))/(3/(-6)))/((-19981)/(-5512))? 1/29 Calculate (14720/(-96))/(-46)-185/(-50). 6 Evaluate ((-14)/1197)/(-25/((-1080)/(-3))). 8/19 What is ((3/1)/(-6))/((-72)/(-576))? -4 Evaluate (1/(-6))/(2/6)42/91. -3/13 (-1(-16)/(-3))/1-15(-44)/(-110) 32 What is the value of (55180/(-289695))/(-14)? 1/21 Calculate 2/212/36-15143/55. -13 What is the value of -5((-182248)/4905)/(-76)? -22/9 (-2(-2)/(-56)38)/((-6)/(-546)13) -19 Calculate (-12)/(264/(-11))1260/1365. 6/13 Evaluate (-10(-9312)/(-640))/(5/((-70)/(-42))). -97/2 What is 34/382512/268273/672? 1/75 What is 283/32184/(-391)-102? 126 Calculate (-159418)/154444/77. -59 What is ((-36)/(-1287))/(480/(-528))? -2/65 (-9884)/353(-22)/7 88 What is the value of (((-1)/18)/((-1584)/(-10692)))/15? -1/40 Calculate (2387/3933776)/(3/(-96)). -2/103 Evaluate 12/(-2)(-42)/9(-121)/((-245630)/348). 24/5 511/(-2)297/((-58212)/(-56)) -73 Calculate (-8(15/(-50))/(6909/(-35)))/((-7)/(-49)). -4/47 Evaluate (-108)/44((-10)/12)/5530/(-265). -9/11 Evaluate 444/66600171/38. 3/100 Calculate (112/(-273))/((36/(-15))/((-252)/(-120))). 1/26 Evaluate 92/69(-3)/(-26)299. 46 Evaluate (84/(-1568)-252)/(3/(-8)). -36 (29/((-5220)/168))/((-18)/135) 7 What is the value of (11/(968/320))/(31/341)? 40 50/((-60)/(-6))(10/(-1))/(-10) 5 Evaluate 3((-13)/((-117)/28))/((-21)/((-819)/26)). 14 Evaluate (-10)/498/154962/5789. -14 Calculate ((-14)/119)/(97/85748). -104 -12217/(-155)(-7)/(378/(-45)) 14 What is ((-412)/(-309))/((12/4)/(-54))? -24 (((-63)/(-6))/(-1))/(((-1185)/5688)/((-10)/18)) -28 What is the value of ((-2912)/936)/(32/72)? -7 Evaluate (-144)/(-513)27/(-21)175/(-150). 8/19 Evaluate (1584/27)/22300/(-80). -10 What is the value of ((-21)/(-875))/((432/30)/12)? 1/50 Evaluate (18/(-16))/((-17)/(1496/132)). 3/4 Evaluate (-50)/1066/660212/((-6)/3). 53 What is (63/218452)/(((-2)/(-1))/(-52))? -39 Calculate (1230/((-1599)/(-39)))/2. 15 What is (2344/208)/(780/10140)? 43 What is (104(-6)/(-56))/(((-123)/(-14))/(-41))? -52 What is the value of (((-190)/(-100))/19)/(((-7)/14)/(-1))-15? -3 Evaluate (-10)/115(-621)/(-1755). -2/65 Evaluate ((-6)/696720/(-72))/(-10). -1/116 Calculate -44(-100)/12836/99. 25/2 What is the value of 32305/14916/10? 13 8/(75/((-1575)/56))1/(-369) 1/123 What is (15/(-5))/(3/204270/45)? -34 Calculate 539/(-3)-81(-82)/(-24354). 49 Calculate 1(-18)/(-15)(35945/(-21))/79. -26 Calculate 22117802/(-3956)(-2)/90. 11/5 Evaluate (-8)/406(-42)/(-1302)217. -4/29 What is the value of 180/(-1950)(400/12)/((-108)/(-81))? -30/13 Calculate (240/(-312))/((-5)/13)1/(-14). -1/7 -13(-12)/(-702)-5198/(-4)-1 55 What is the value of (-19)/(1976/48)(-104)/(-208)? -3/13 Evaluate ((-104)/(-416))/(2/(-104)). -13 Calculate (3322/363)/((-1240)/324/(-10)). 4/31 What is 29460/31424(-144)/30? -9/2 (68(-100)/(-14280))/(10/875) 125/3 (-123)/(28167/(-10763))(1/3)/1 47/3 What is the value of ((-492)/6888)/(6/322)? -23/6 Evaluate (((-2)/(-49)-4)/(26/(273/21)))/6. -2/147 What is the value of (-24)/42(-378)/(-396)? -6/11 Calculate 645/(-43)(-80)/(-24). -50 Evaluate (-3)/(-20)(-19)/576/1208. -1/50 What is the value of ((90/2295)/((-44)/(-18)))/(27/((-315)/35))? -1/187 Calculate (1/(110/(-5)))/((24/(-2))/(-1032)). -43 What is (5/10(-2)/(-3)15)/((-8525)/(-5115))? 3 Evaluate (-468)/(-16)((-15400)/(-450))/77. 13 Calculate 12/((-258)/(-13760)40). 16 Calculate 376/(-1)(-9483)/75864. 47 Calculate (((-10)/(-50))/(3/15))/(9417/(-146)). -2/129 What is ((-1149)/272696)/(21/(-24))42/(-27)? -2/267 (-102)/(-48)(10/(-5))/(27/54) -17/2 Calculate 117/((-43290)/148)180. -72 Evaluate (2(-2875)/(-276))/(365/(-876)). -50 Calculate (-4)/(-4)-167116/(-176). 61 Evaluate 5((36/6)/(((-21)/(-6))/(-7)))/34. -30/17 Evaluate (1/(-75))/((-208)/520)-1(-4)/7. 2/105 Evaluate (-1(-20)/(-12))/((1/(-20))/(39/208)). 25/4 Calculate ((-3009)/45135)/(1/(-24)). 8/5 Calculate 64/(-48)(-460)/1104. 5/9 What is the value of ((-546)/(-585))/(728/56160)? 72 (-15((-9)/36)/((-6)/8))/(910/25116) -138 ((-13)/13-477)/9 53 Evaluate (160/(-2700))/(40/16016/10). -4/27 Calculate ((-1)/((-18)/(-152)))/(1922/8649)1/(-2). 19 -28	{ "pile_set_name": "DM Mathematics" }
10 (base 5) to base 6 -5 Convert 1 (base 11) to base 2. 1 What is 11 (base 16) in base 4? 101 What is 72 (base 10) in base 7? 132 Convert -6 (base 9) to base 10. -6 10 (base 10) to base 12 a 21 (base 7) to base 4 33 What is -1110 (base 2) in base 5? -24 What is -5 (base 10) in base 5? -10 Convert 2 (base 4) to base 11. 2 What is -3 (base 12) in base 9? -3 -44 (base 11) to base 4 -300 What is 7 (base 13) in base 8? 7 Convert -1 (base 15) to base 9. -1 What is -3 (base 4) in base 9? -3 What is 2 (base 12) in base 13? 2 What is 3 (base 6) in base 9? 3 -1021 (base 4) to base 16 -49 What is 11 (base 15) in base 11? 15 3 (base 13) to base 11 3 What is 3 (base 15) in base 16? 3 -4 (base 13) to base 6 -4 54 (base 8) to base 15 2e What is -1010 (base 3) in base 13? -24 Convert 2 (base 14) to base 12. 2 84 (base 13) to base 5 413 Convert 100 (base 7) to base 16. 31 What is 28 (base 11) in base 12? 26 -6 (base 13) to base 6 -10 Convert 221 (base 5) to base 4. 331 7 (base 14) to base 11 7 10 (base 2) to base 6 2 What is 58 (base 11) in base 13? 4b Convert d (base 14) to base 13. 10 What is -12 (base 3) in base 10? -5 19 (base 15) to base 4 120 Convert -3 (base 8) to base 10. -3 What is -42 (base 7) in base 16? -1e -16 (base 10) to base 7 -22 Convert -114 (base 15) to base 14. -136 What is 1 (base 16) in base 9? 1 -13 (base 9) to base 13 -c Convert -32 (base 5) to base 4. -101 44 (base 8) to base 15 26 112 (base 4) to base 8 26 4 (base 8) to base 9 4 Convert 24 (base 13) to base 3. 1010 Convert -4 (base 11) to base 5. -4 Convert a8 (base 12) to base 4. 2000 -11 (base 9) to base 4 -22 What is 2 (base 15) in base 5? 2 Convert 2021 (base 4) to base 2. 10001001 What is -25 (base 15) in base 2? -100011 2 (base 13) to base 5 2 What is -80 (base 10) in base 6? -212 -1 (base 16) to base 9 -1 What is 0 (base 3) in base 9? 0 What is -33 (base 16) in base 2? -110011 -31 (base 9) to base 12 -24 Convert -4 (base 8) to base 12. -4 -6 (base 10) to base 14 -6 Convert 102 (base 4) to base 10. 18 Convert -7 (base 10) to base 8. -7 0 (base 12) to base 6 0 Convert -15 (base 10) to base 13. -12 -9 (base 14) to base 6 -13 70 (base 10) to base 5 240 1101 (base 6) to base 2 11111101 3 (base 4) to base 6 3 230 (base 6) to base 3 10100 -2c (base 16) to base 6 -112 141 (base 7) to base 13 60 What is -10 (base 5) in base 16? -5 Convert 100010 (base 2) to base 16. 22 1 (base 4) to base 8 1 -128 (base 11) to base 3 -12121 -202 (base 3) to base 4 -110 Convert -28 (base 12) to base 14. -24 -26 (base 7) to base 13 -17 -1 (base 12) to base 15 -1 What is -4 (base 14) in base 9? -4 Convert 34 (base 5) to base 12. 17 Convert 3 (base 11) to base 8. 3 What is -cb (base 14) in base 12? -12b What is -1012 (base 3) in base 10? -32 Convert 1 (base 8) to base 16. 1 c2 (base 15) to base 2 10110110 Convert -111 (base 2) to base 10. -7 4 (base 5) to base 9 4 What is -21 (base 7) in base 15? -10 What is 350 (base 7) in base 10? 182 3 (base 9) to base 14 3 Convert 2 (base 8) to base 16. 2 What is 2 (base 6) in base 13? 2 Convert -1010 (base 5) to base 10. -130 Convert -1011 (base 2) to base 15. -b Convert 2 (base 16) to base 6. 2 Convert 16 (base 7) to base 15. d Convert -120 (base 6) to base 9. -53 -13 (base 5) to base 6 -12 -211 (base 3) to base 11 -20 -22112 (base 3) to base 16 -e6 6a (base 13) to base 7 154 What is 0 (base 3) in base 10? 0 What is 12 (base 16) in base 14? 14 202 (base 4) to base 2 100010 What is 2 (base 11) in base 14? 2 What is -14 (base 6) in base 7? -13 Convert 1a (base 15) to base 16. 19 What is -7 (base 15) in base 2? -111 3c (base 15) to base 14 41 Convert 11220 (base 3) to base 13. a2 Convert -3c (base 16) to base 3. -2020 Convert 2 (base 4) to base 14. 2 Convert 0 (base 2) to base 16. 0 Convert 1 (base 3) to base 13. 1 -8 (base 15) to base 3 -22 Convert -217 (base 9) to base 10. -178 103 (base 11) to base 14 8c 1012 (base 3) to base 2 100000 Convert 101 (base 2) to base 7. 5 Convert -1 (base 9) to base 12. -1 Convert -301 (base 7) to base 2. -10010100 10 (base 8) to base 9 8 Convert 12 (base 3) to base 9. 5 What is -210 (base 3) in base 12? -19 What is -3 (base 16) in base 7? -3 What is -2 (base 10) in base 15? -2 -304 (base 6) to base 16 -70 Convert 10 (base 8) to base 12. 8 Convert 32 (base 8) to base 15. 1b What is -7 (base 13) in base 3? -21 What is -44 (base 10) in base 4? -230 -6 (base 14) to base 10 -6 -2 (base 6) to base 11 -2 Convert -1124 (base 5) to base 9. -202 What is -4 (base 14) in base 4? -10 -11100 (base 2) to base 16 -1c -10 (base 4) to base 7 -4 Convert 2 (base 3) to base 15. 2 Convert -102 (base 3) to base 2. -1011 What is -4 (base 16) in base 7? -4 1 (base 2) to base 15 1 What is 4 (base 10) in base 3? 11 Convert -1 (base 15) to base 5. -1 22201 (base 3) to base 15 10a Convert -22 (base 8) to base 6. -30 Convert -230 (base 4) to base 2. -101100 32 (base 4) to base 15 e Convert -2 (base 12) to base 8. -2 31 (base 13) to base 14 2c -5c (base 13) to base 12 -65 What is 1011 (base 2) in base 11? 10 -59 (base 14) to base 3 -2221 What is 3 (base 15) in base 7? 3 Convert 20010 (base 3) to base 13. c9 Convert -110100 (base 3) to base 4. -11031 Convert 4 (base 14) to base 13. 4 What is -56 (base 10) in base 2? -111000 -2 (base 3) to base 15 -2 What is 6a (base 11) in base 3? 2211 16 (base 11) to base 2 10001 What is -18 (base 11) in base 14? -15 Convert -1 (base 12) to base 4. -1 Convert -46 (base 7) to base 3. -1021 Convert -30 (base 5) to base 13. -12 -25 (base 10) to base 3 -221 103 (base 5) to base 13 22 What is -4 (base 10) in base 3? -11 Convert 210 (base 3) to base 10. 21 -29 (base 15) to base 14 -2b -11 (base 6) to base 16 -7 -11100111 (base 2) to base 16 -e7 What is 77 (base 13) in base 10? 98 Convert -33 (base 5) to base 10. -18 Convert 4 (base 9) to base 10. 4 -5 (base 11) to base 9 -5 What is -39 (base 11) in base 10? -42 Convert 2100 (base 3) to base 16. 3f -247 (base 12) to base 9 -421 What is -10 (base 2) in base 13? -2 Convert -14 (base 12) to base 6. -24 Convert -106 (base 7) to base 10. -55 Convert 5 (base 7) to base 12. 5 11 (base 3) to base 5 4 What is -11012 (base 3) in base 5? -423 What is -142 (base 5) in base 6? -115 2 (base 9) to base 11 2 -1 (base 13) to base 3 -1 What is -1c (base 15) in base 5? -102 What is -2 (base 15) in base 10? -2 What is -555 (base 6) in base 12? -15b Convert -1 (base 11) to base 3. -1 Convert -1110001 (base 2) to base 14. -81 -3 (base 7) to base 8 -3 2 (base 6) to base 7 2 -186 (base 13) to base 3 -101100 What is -8 (base 14) in base 2? -1000 What is 0 (base 7) in base 14? 0 90 (base 13) to base 16 75 What is -2 (base 8) in base 12? -2 What is 322 (base 5) in base 11? 7a 0 (base 8) to base 13 0 Convert 113 (base 5) to base 10. 33 What is -191 (base 13) in base 4? -10133 What is 4 (base 10) in base 2? 100 What is 8b (base 15) in base 7? 245 What is 13 (base 10) in base 4? 31 Convert 100 (base 3) to base 12. 9 What is -2 (base 5) in base 12? -2 Convert 74 (base 9) to base 14. 4b Convert -22 (base 3) to base 16. -8 Convert 1 (base 12) to base 4. 1 Convert -23 (base 10) to base 2. -10111 Convert 2 (base 5) to base 11. 2 What is 36 (base 15) in base 9? 56 What is 3 (base 12) in base 11? 3 Convert -3 (base 15) to base 16. -3 What is 87 (base 11) in base 9? 115 Convert 301 (base 5) to base 8. 114 What is 120 (base 9) in base 16? 63 10111 (base 3) to base 13 73 -14 (base 9) to base 15 -d What is -11 (base 15) in base 4? -100 Convert -5 (base 10) to base 14. -5 0 (base 16) to base 5 0 -474 (base 8) to base 12 -224 What is -40 (base 5) in base 16? -14 60 (base 13) to base 10 78 What is 2 (base 9) in base 6? 2 Convert -1010 (base 2) to base 14. -a What is -1 (base 11) in base 6? -1 Convert -10 (base 5) to base 8. -5 Convert 1001000 (base 2) to base 13. 57 4 (base 8) to base 16 4 What is 22 (base 8) in base 2? 10010 What is 10 (base 7) in base 2? 111 What is -10 (base 2) in base 16? -2 -2 (base 8) to base 9 -2 What is -311 (base 4) in base 8? -65 What is -156 (base 9) in base 8? -204 -23 (base 7) to base 3 -122 5 (base 15) to base 5 10 49 (base 11) to base 4 311 30 (base 10) to base 6 50 Convert 55 (base 11) to base 16. 3c Convert -2 (base 16) to base 10. -2 Convert 107 (base 9) to base 16. 58 32 (base 16) to base 8 62 C	{ "pile_set_name": "DM Mathematics" }
17 What comes next: 1134, 4458, 9998, 17754, 27726, 39914, 54318? 70938 What is next in -136831, -136820, -136811, -136804, -136799, -136796, -136795? -136796 What is next in 14267, 14272, 14277, 14282, 14287, 14292? 14297 What is the next term in 2831, 2503, 2175, 1847, 1519? 1191 What is the next term in -3652, -3650, -3648, -3646? -3644 What is the next term in 660, 1342, 2002, 2634, 3232? 3790 What comes next: 444, 3513, 11848, 28083, 54852, 94789, 150528, 224703? 319948 What is next in -28, 47, 172, 347, 572? 847 What is next in -1191, -1194, -1199, -1206, -1215, -1226, -1239? -1254 What comes next: 518, 503, 488? 473 What comes next: -28809, -57622, -86439, -115254, -144061, -172854? -201627 What comes next: -69359, -554897, -1872789, -4439213, -8670347, -14982369, -23791457? -35513789 What comes next: 1408, 2831, 4252, 5671? 7088 What is next in -264, -424, -580, -732, -880, -1024? -1164 What comes next: 1081, 8268, 27789, 65812, 128505? 222036 What is the next term in 11645, 11660, 11701, 11780, 11909? 12100 What is the next term in 451, 783, 1115, 1447, 1779, 2111? 2443 What comes next: -40508, -40506, -40504, -40502, -40500? -40498 What comes next: 268014, 536030, 804046? 1072062 What comes next: 843, 864, 885, 906, 927? 948 What is next in 24, -36, -162, -366, -660, -1056? -1566 What is the next term in -6250, -12255, -18274, -24313, -30378? -36475 What is the next term in -27265, -27267, -27269, -27271, -27273, -27275? -27277 What comes next: -5806, -23221, -52244, -92875, -145114? -208961 What is next in 41194, 82386, 123578, 164770? 205962 What comes next: -789, -3520, -8197, -14820, -23389, -33904, -46365? -60772 What is the next term in -39, 162, 721, 1818, 3633? 6346 What is next in -8614, -8642, -8670, -8698, -8726? -8754 What comes next: -9277, -9278, -9279, -9280, -9281, -9282? -9283 What is next in -56028, -224117, -504264, -896469, -1400732, -2017053, -2745432? -3585869 What is the next term in 139, 277, 407, 523, 619? 689 What comes next: 37863, 37859, 37851, 37839, 37823, 37803? 37779 What is the next term in -91180, -364829, -820910, -1459423, -2280368, -3283745? -4469554 What is next in 77, 489, 903, 1319? 1737 What comes next: 172, 146, 110, 58, -16? -118 What is next in -1261737, -2523475, -3785213, -5046951, -6308689? -7570427 What is the next term in 13847, 13846, 13843, 13838? 13831 What is next in 346, 132, -232, -752, -1434? -2284 What is next in -265, -998, -2221, -3934, -6137, -8830, -12013? -15686 What is next in -139, -302, -753, -1636, -3095, -5274, -8317? -12368 What is next in 7585201, 7585200, 7585199, 7585198? 7585197 What is the next term in 42620, 42621, 42622, 42623, 42624, 42625? 42626 What comes next: 120, 301, 558, 855, 1156, 1425? 1626 What comes next: -963, -4517, -10433, -18705, -29327, -42293? -57597 What is the next term in -45, -117, -229, -387, -597, -865? -1197 What is the next term in -1044, -4201, -9460, -16815, -26260, -37789? -51396 What comes next: -954, -3830, -8636, -15372, -24038, -34634, -47160? -61616 What is next in 794, 829, 882, 953, 1042, 1149? 1274 What is next in 10677, 10673, 10667, 10659, 10649, 10637? 10623 What is next in 71476, 285896, 643262, 1143574, 1786832? 2573036 What is next in -4359, -8813, -13267? -17721 What is next in 110, 423, 942, 1667? 2598 What comes next: 35, 532, 1941, 4718, 9319, 16200? 25817 What is the next term in -43, -281, -687, -1237, -1907, -2673, -3511? -4397 What comes next: 160777, 160781, 160787, 160795, 160805, 160817? 160831 What is the next term in 1962, 1906, 1850? 1794 What is the next term in -499, -1025, -1575, -2149, -2747? -3369 What comes next: 64813, 64784, 64735, 64666, 64577, 64468? 64339 What is the next term in -98284, -98288, -98294, -98302, -98312, -98324? -98338 What is the next term in -3866, -15477, -34828, -61919? -96750 What is next in -126, -357, -588, -819, -1050, -1281? -1512 What comes next: 887, 1726, 2541, 3332? 4099 What is the next term in 3, -30, -143, -384, -801, -1442? -2355 What is next in -2947, -5953, -8959, -11965, -14971, -17977? -20983 What is the next term in 3011, 2996, 2925, 2768, 2495, 2076, 1481, 680? -357 What comes next: -10911, -43664, -98253, -174678, -272939, -393036, -534969? -698738 What comes next: -368, 6, 380, 754? 1128 What comes next: 21, 801, 2097, 3909, 6237, 9081, 12441? 16317 What is next in 62, 47, 0, -97, -262, -513, -868, -1345? -1962 What is next in 2352, 2355, 2358, 2361, 2364, 2367? 2370 What is the next term in -423, -494, -601, -732, -875, -1018, -1149? -1256 What is the next term in -234, -280, -358, -480, -658, -904, -1230? -1648 What is next in -17336, -17338, -17340, -17342, -17344? -17346 What is next in 2731, 5218, 7705, 10192? 12679 What is next in -64802, -129584, -194366, -259148? -323930 What is the next term in -3999, -3956, -3909, -3858, -3803, -3744, -3681? -3614 What is the next term in 5781, 5787, 5807, 5847, 5913, 6011, 6147? 6327 What comes next: -134, -150, -146, -110, -30, 106, 310, 594? 970 What comes next: -67, -132, -225, -346? -495 What is the next term in -3822, -15286, -34392, -61140, -95530, -137562? -187236 What is the next term in 249, 308, 401, 528, 689? 884 What is the next term in 110, -2, -180, -418, -710? -1050 What is the next term in 86099, 86096, 86081, 86048, 85991, 85904, 85781, 85616? 85403 What is next in 189, 189, 215, 273, 369, 509? 699 What is the next term in -35904, -35867, -35830, -35793, -35756? -35719 What is next in 24095, 48188, 72281, 96374? 120467 What is the next term in 24956, 49902, 74822, 99704, 124536, 149306, 174002, 198612? 223124 What comes next: 403, 1516, 3369, 5956, 9271, 13308? 18061 What is the next term in -3253, -6528, -9787, -13024, -16233, -19408, -22543? -25632 What is next in -83, -700, -1317, -1934, -2551? -3168 What is next in -8, -123, -348, -683, -1128? -1683 What is next in -320837, -641675, -962513? -1283351 What is the next term in 23, -57, -185, -367, -609, -917, -1297, -1755? -2297 What is the next term in 548715, 1097430, 1646145, 2194860? 2743575 What is next in 216, 1600, 5240, 12228, 23656, 40616? 64200 What is next in -490, -860, -1236, -1618? -2006 What is next in 1411697, 1411701, 1411707, 1411715, 1411725? 1411737 What is the next term in 268, 460, 646, 820, 976, 1108, 1210? 1276 What is next in 7682, 15372, 23062, 30752, 38442? 46132 What is next in 253, 59, -273, -749, -1375, -2157, -3101, -4213? -5499 What is next in -610295, -1220588, -1830881, -2441174, -3051467, -3661760? -4272053 What is the next term in -20947, -41898, -62849, -83800, -104751? -125702 What comes next: 42, -22, -288, -858, -1834? -3318 What is next in -839, -699, -567, -449, -351? -279 What comes next: 9890, 10065, 10266, 10505, 10794? 11145 What is the next term in -19208, -19193, -19178? -19163 What is next in -1204, -1213, -1222, -1231? -1240 What is the next term in 154378, 154379, 154380? 154381 What is the next term in 2967, 2975, 2985, 2991, 2987? 2967 What comes next: -8248, -16511, -24774, -33037, -41300, -49563? -57826 What is next in -116, -459, -800, -1139? -1476 What comes next: -20, 16, 76, 160, 268? 400 What comes next: 58, 201, 422, 721? 1098 What comes next: -624411, -624412, -624413, -624414, -624415, -624416? -624417 What is next in 1330196, 2660393, 3990590? 5320787 What comes next: -501, -1414, -2933, -5058, -7789, -11126? -15069 What is next in 85, 112, 79, -14, -167, -380? -653 What is next in 175136, 175134, 175130, 175124, 175116, 175106, 175094? 175080 What comes next: 3348, 4963, 6576, 8187, 9796, 11403? 13008 What comes next: 6862, 14027, 21194, 28363? 35534 What comes next: 129, 275, 435, 615, 821? 1059 What comes next: 27810, 55600, 83392, 111186? 138982 What comes next: -429, -1729, -3883, -6879, -10705, -15349? -20799 What comes next: -239326, -239328, -239330, -239332, -239334? -239336 What is next in -266, -472, -800, -1244, -1798, -2456? -3212 What is next in 4984, 4982, 4980, 4978? 4976 What is the next term in 12592, 12599, 12608, 12619, 12632? 12647 What comes next: -470741, -470745, -470751, -470759? -470769 What comes next: 2852, 2879, 2922, 2981, 3056? 3147 What is next in -35201, -35203, -35205? -35207 What is next in -1227, -2423, -3619, -4815, -6011? -7207 What is	{ "pile_set_name": "DM Mathematics" }
lse Is 1205 + (-3 - 10/(-2)) a prime number? False Let q(t) = -t*3 + 6t*2 + 2t - 9. Let n be q(6). Suppose 0 = -7o + no - 4v + 8612, -4o + 5v = -8612. Is o composite? False Let w be 1/(-4 + 2481/621). Let y = w + 848. Is y prime? True Suppose 5d = 2j - 6010, 6j - 3j - 8997 = 3d. Is j composite? True Let a = -174 - 133. Let o = 512 + a. Is o a prime number? False Suppose 3p - 8413 = -4d + 9233, p = d - 4408. Suppose 0 = 2g - 4i - d, -5i = -i + 20. Is g prime? False Let t(i) = i3 + i + 31. Let p be t(0). Suppose q - 5k - 88 = -p, -5k = 3q - 251. Let z = 108 - q. Is z composite? False Let d(s) = 199s2 + 7s + 1. Let b(r) = -198r2 - 4r - 8 + r - 5r + 7. Let h(f) = 5b(f) + 6d(f). Is h(-1) composite? True Let m(s) = 4s*2 - 40s - 17. Is m(13) prime? True Let a(p) = -3995p - 425. Let g(k) = -85k - 9. Let r(j) = 4a(j) - 187g(j). Is r(-6) composite? True Suppose -87054 = -3w - 14997. Is w a composite number? False Let a(q) = 2155q + 1. Let d be a(-1). Let x = d + 4608. Suppose -y = 5y - x. Is y a prime number? True Let g = 7 + -2. Suppose gb + k - 2610 = 0, 5b - 2620 = -k - 2k. Is b a prime number? True Suppose 0 = -3z + 3u - 600, -2u + 6u = -3z - 635. Let h(v) = 136v + 96. Let q be h(-5). Let p = z - q. Is p a composite number? False Let a be 2 + 0 - (-3 + -2). Let n be -15(a - (3 - 6)). Let q = 221 + n. Is q a prime number? True Let l = -2293 + 8511. Is l prime? False Let l be 10/(-4)2-1. Suppose 339 = -lf + 8f. Is f composite? False Let m = -4 - -2. Let d be ((-5)/2)/(1/(-6)). Is m - 30/(-2)d a prime number? True Suppose 6g = 7g - 3219. Suppose 0 = 3a - 4a - t + 1072, g = 3a + 4t. Is a a composite number? False Let j(x) = 148x2 - 4x + 71. Is j(15) prime? True Is (-92362)/(-18) + 50/(-225) a prime number? False Let t(c) = c*3 + 6c*2 + 5c + 2. Let i be t(-5). Suppose if = 7f - 3215. Suppose -4r = -3a - 5r + 631, -5r = -3a + f. Is a a composite number? False Suppose 0 = 18r - 110698 - 90848. Is r prime? True Suppose 0 = 5w + 2j - 6, 3w - j + 4 = -6j. Suppose -11b + 6111 = -wb. Is b a prime number? False Let a be (-1)/4 + (-57665)/76. Is a/9-3 - 0 a prime number? False Suppose -12l + 5 = -17l. Let a be l/(63/66 - 1). Suppose -7c + 3c + 3y + a = 0, 4c - 5y = 18. Is c prime? True Let d(m) = -m*3 + 6m*2 - 3m - 5. Let f be d(5). Suppose 4a + 0a - 4 = 4r, 4r = a + f. Suppose -rn + i - 6i + 187 = 0, i + 535 = 5n. Is n prime? False Let t be ((-8)/(-10))/(12/30). Suppose 0 = tj - 5v - 1 - 351, -j + v = -170. Is j composite? True Let s be (-4)/2 - (-32)/1. Suppose 6p - s = -0p. Suppose 955 = 5j + g, -2j + pj = 2g + 573. Is j a composite number? False Suppose -5q = 5b, -2b - q - 3q + 4 = 0. Let t be (72/(-90))/(b/5). Suppose tp + 3365 = 7p. Is p prime? True Let b(m) = -m2 + 13m - 21. Let q be b(11). Let g = q + 1542. Is g a composite number? False Let a(f) = -f*2 + 8f - 12. Let c be -1(3 + (-24)/3). Let x be a(c). Suppose 0 = xr - 2r - 106. Is r a prime number? False Suppose 2n = 5n - 72. Let j(p) = 6p - 5. Let x be j(6). Suppose x + n = 5s. Is s prime? True Suppose -5x - 8 - 12 = 0. Let v(f) = 5 + 4778f2 - 2f - 1 - 4742f2 - 1. Is v(x) a composite number? False Let i(d) = -d3 - 2d*2 + 1. Let m be i(-1). Suppose m = 5b + 5754 - 14989. Is b composite? False Is (-1 + 5757)(185/20 + -9) composite? False Suppose -2v - 3d = -6d - 29, -4v + 55 = -3d. Let i = -12 + v. Is 291 + 6 + -5 + i composite? False Let b(w) = 49w2 - 4w + 8. Let n be b(5). Let t = 1800 - n. Is t composite? False Suppose 5b - 399 = 3n - 4n, 0 = -2b - 8. Is n a prime number? True Let h be (-19)/5 + 1/(-5). Let m be h/(1 - (-2 - -2)). Let f(o) = o*3 + 8o*2 - 5o + 2. Is f(m) a composite number? True Let l = -1187 - -4540. Is l prime? False Let d = 3225 - -217. Is d a composite number? True Suppose 0 = 17r - 21r + 4108. Is r prime? False Suppose -6u = -2929 - 6539. Let j = 2617 - u. Is j prime? True Let m(b) = 4b*2 - b + 14. Suppose -6p = -2p - 28. Is m(p) prime? False Let l(q) = -q3 + q2 + 10q + 19. Let h be l(-6). Let j = 2 + h. Is j a prime number? False Let m(o) = -4o3 + 10o*2 - 2o + 23. Is m(-6) composite? False Suppose -13j = -1278 - 2999. Is j prime? False Suppose y + 1 = -2. Let o be (y/(-9))/(1/9). Suppose -2r + 495 = od, 0 = 3d - 5r + 149 - 623. Is d prime? True Suppose -d + 2l = 0, l = -4l + 10. Suppose 5v + 3p - p - 18 = 0, dp = 16. Suppose 2r + vu = 23 + 1, -5u = 5. Is r prime? True Let b(s) be the first derivative of 2s*3/3 + 3s*2/2 - 11s + 4. Let y be ((-10)/((-100)/(-15)))/(2/8). Is b(y) composite? False Suppose 0 = 7u + u - 2336. Suppose 0 = -4m + 6l - l + 1167, l + u = m. Is m composite? False Let o = 2321 - 835. Is 1 + o/8 + (-14)/(-56) prime? False Let f = -3522 + 6227. Let v = 14 + f. Is v composite? False Let s = -7 + 11. Suppose 2r = -2j + 730, -s - 2 = 3r. Is j composite? False Let i = 2030 + 1475. Is i composite? True Suppose -29507 = -5g - 2c + 233822, -4g = 5c - 210653. Is g a prime number? True Let l(q) = q*2 - 13q - 12. Let v be l(14). Suppose -2o - 3x = -3023, -vo - 873 + 3902 = 5x. Is o prime? False Let p(k) = -86k + 14. Let z be p(-8). Suppose 0 = h + 5y - 220, h - z = -2h - y. Is h prime? False Let y = 20109 - -12550. Is y prime? False Let u(s) = -s3 + 3s*2 - 30s - 13. Is u(-16) a prime number? False Suppose 3t - 26 = -5z, 0 = -2t - 4z + 18 + 2. Suppose -tj + 248 = -j. Let l = j + 9. Is l prime? True Let p = 17 - 29. Let m = -23 - p. Is m + 74 - (-1 - 1) a composite number? True Is 2762 + 1 - (-10 + 12) composite? True Suppose 4f = 8f - n - 19658, 5f + 2n - 24566 = 0. Suppose 330 = -8p + f. Is p a composite number? True Let y(c) = c - 3. Let d be 1/(0 + 1/3). Let v be y(d). Suppose 6i - 7i + 51 = v. Is i a composite number? True Suppose z - 4127 = 11874. Is z a composite number? False Let s(f) = f*2 + 16f - 2. Let b be s(-13). Let y = -328 - b. Let w = y - -418. Is w a prime number? True Let o(u) = u*2 - 1 + 57u3 + u2 + 39u3. Let s be -4 + (-19 - -34)(-1)/(-3). Is o(s) composite? False Let n(r) = -92r + 401. Is n(-19) a prime number? False Let i(h) = -h3 + 3h*2 + 2h - 1. Let z be 6 + (1 - 4)1. Let d be i(z). Suppose 4v = 7v - 3k - 570, -951 = -dv + 4k. Is v prime? True Suppose 0 = 2f - 3l - 5617 - 7906, -4f + 27101 = 5l. Is f composite? True Let g = -30 + 20. Let p = -5 - g. Suppose -j + 14 = -pn, 2j - 4n + 0n = 34. Is j prime? True Let n = 37 + 24489. Is n composite? True Let w = 26 + 25. Let k = w - 79. Is 2/(-8) + (-4963)/k composite? True Suppose -c = -3n + 3c, -n - 5c = 0. Let m be (1 - -61) + n + 0. Suppose s + m = 3s. Is s prime? True Let v be (5/4)/(3/12). Let g(w) = -w*2 + 14w - 21. Let y be g(12). Suppose -3i + 46 = -0t - vt, 5i = -yt + 122. Is i prime? False Let s = 27070 - 17381. Is s composite? False Let m(b) = 4b*2 - 6b + 3. Let a(p) = p + 19. Let l be a(-12). Let g be m(l). Let z = g + -99. Is z prime? False Let m = -130 - -419. Suppose -3p = -k - m, -4p - 34 = 2k - 426. Is p composite? False Let w(q) = -2q - 6. Suppose 0 = -0r + 5r + 25. Let c be w(r). Is c/((-12)/9) - -130 prime? True Let w = -70 - -11133. Suppose 3d + i = 2d + 2768, -4d + 5i + w = 0. Is d a composite number? False Suppose 211832 = -15j + 23j. Is j a composite number? False Let n(h) be the second derivative of h5/10 + h4/12 + h*3/2 - 7h*2/2 - 11h. Is n(6) a prime number? True Let s(u) = u*3 - 10u*2 + 23u - 25. Suppose -q - 2q = 3z - 15, 35 = 2q - 3z. Is s(q) prime? False Suppose -2r + 6 = -0, 2u - 4r = 41696. Is u prime? False Let b be 1390/(-27). Let o(d) = -2d - 14. Let k be o(b). Suppose -2f = 4m - 26, -5f + 4m = km - 73. Is f composite? True Suppose 4a - 3v = 5a - 5147, a - v = 5155. Is a composite? False Let l = -38 - -25. Let z be 1-5(l + 12). Suppose 0 = -5u + zt + 775, -2u - 4t = 2u - 636. Is u a prime number? True Suppose -5030 = 15f - 45515. Is f a prime number? True Let n be -1 - -4 - -1 - (3 - 4). Suppose nr = 4r + 149. Is r a prime number? True Is 96894 - -1((4 - 7) + 2) composite? False Suppose 11k - 15 = 8k. Suppose kh - 94 = 276. Suppose	{ "pile_set_name": "DM Mathematics" }
at is -10 - -1? -d In base 16, what is -175 - -5? -170 In base 13, what is 2 - -a? c In base 14, what is -1 - 6a? -6b In base 6, what is 12 + 320? 332 In base 12, what is 3 + 107? 10a In base 8, what is -13 + 20? 5 In base 15, what is -8 + -da? -e3 In base 6, what is 20 + 14? 34 In base 9, what is 5 + 347? 353 In base 9, what is -2 + -14? -16 In base 15, what is -b4 - 5? -b9 In base 11, what is 35 - -97? 121 In base 10, what is -5 + -836? -841 In base 15, what is 0 + a9? a9 In base 8, what is -525 - -4? -521 In base 8, what is 12 + -1364? -1352 In base 8, what is -10655 - 0? -10655 In base 3, what is -200 - -1001222? 1001022 In base 4, what is 2213302 + 1? 2213303 In base 16, what is -4 + 32? 2e In base 10, what is 53 + -86? -33 In base 15, what is -41 + -b6? -107 In base 11, what is -1474 - -1? -1473 In base 2, what is 11000111 - -10? 11001001 In base 2, what is 110 + -11111100? -11110110 In base 2, what is -101 + 1100? 111 In base 13, what is -4 + -10bc? -10c3 In base 14, what is -3 - -a3? a0 In base 14, what is -a2 + -4d? -111 In base 14, what is 1 + 84? 85 In base 15, what is 15 + 45? 5a In base 5, what is -2243 + 0? -2243 In base 8, what is -550 + 6? -542 In base 5, what is 0 - 3? -3 In base 5, what is 22 + 10444? 11021 In base 2, what is 10000111 + 11? 10001010 In base 5, what is -2 + -10121? -10123 In base 11, what is -17 + -314? -330 In base 16, what is 19 - 202? -1e9 In base 12, what is 1a04a + -3? 1a047 In base 8, what is 0 - -33? 33 In base 11, what is 2 + -44? -42 In base 4, what is -3 - 12031? -12100 In base 9, what is -1 - -66? 65 In base 15, what is -2a6 + 0? -2a6 In base 2, what is -1 - -101000? 100111 In base 5, what is 10 + -14? -4 In base 14, what is 37a - 8? 372 In base 10, what is -4 - 246? -250 In base 15, what is -1b + 5? -16 In base 10, what is -137 + 2? -135 In base 16, what is -2aa + -d? -2b7 In base 8, what is -141 - -3? -136 In base 6, what is 113 - 21? 52 In base 11, what is -248 + 9? -23a In base 12, what is 3 + -a7a? -a77 In base 9, what is 33 + -1? 32 In base 5, what is 1032113 + -3? 1032110 In base 11, what is -4 + -31? -35 In base 5, what is 2010 - -2? 2012 In base 15, what is -255 - 0? -255 In base 12, what is 1 + 17? 18 In base 4, what is -101103 - -10? -101033 In base 9, what is -83 + 3? -80 In base 8, what is 4 + -325? -321 In base 4, what is -3120 + -2? -3122 In base 15, what is -95 + 22? -73 In base 10, what is -28 - -4? -24 In base 5, what is -400 + -31? -431 In base 13, what is -34 - 56? -8a In base 10, what is 14 - 590? -576 In base 16, what is -2 - 26d? -26f In base 10, what is 43 - 0? 43 In base 15, what is -1 - -1a4? 1a3 In base 13, what is -2 - 19? -1b In base 6, what is 53 + -22? 31 In base 9, what is -2 + 4177? 4175 In base 6, what is -130 - 41? -211 In base 7, what is 1 - -26002? 26003 In base 3, what is 0 - 220001? -220001 In base 6, what is 5 + -33? -24 In base 11, what is 3 - -1029? 1031 In base 9, what is -1155 + -5? -1161 In base 4, what is -213 - 21? -300 In base 4, what is -2131 - 11? -2202 In base 8, what is -20 + 41? 21 In base 15, what is 2 + -1dd? -1db In base 10, what is 3 + 87? 90 In base 6, what is -2 + -40? -42 In base 10, what is 10 + -3? 7 In base 6, what is -134 + 10? -124 In base 16, what is 13 - -138? 14b In base 8, what is 670 - -5? 675 In base 15, what is -23 - -43? 20 In base 12, what is 81 - -3? 84 In base 12, what is 72 - -b? 81 In base 2, what is 10011011 - 1? 10011010 In base 2, what is -11 - -1001011? 1001000 In base 9, what is 10 + -47? -37 In base 11, what is 1331 - -4? 1335 In base 2, what is 1101001 - 111? 1100010 In base 4, what is 330 - -301? 1231 In base 13, what is -3 - -295? 292 In base 3, what is 100022220 + -2? 100022211 In base 7, what is 35 - 10? 25 In base 9, what is 4 + -260? -255 In base 15, what is -3bd + 3? -3ba In base 10, what is 21 + 11? 32 In base 7, what is 1 + -3434? -3433 In base 9, what is 0 - -34? 34 In base 11, what is 2 + 1303? 1305 In base 13, what is 3 - -73? 76 In base 8, what is 3 - 3110? -3105 In base 16, what is dd - 7? d6 In base 7, what is -22 - 11? -33 In base 4, what is 13 - 31? -12 In base 16, what is 4 + 84? 88 In base 9, what is 235 - 7? 227 In base 8, what is -2 + -3500? -3502 In base 10, what is 1787 - 3? 1784 In base 10, what is -347 + -4? -351 In base 13, what is -21 + -1? -22 In base 2, what is 1100000 - -10? 1100010 In base 10, what is 2 + -272? -270 In base 4, what is -10 + 1122? 1112 In base 10, what is -5 + 58? 53 In base 12, what is 4 - 32? -2a In base 8, what is -7 - 212? -221 In base 13, what is 2 + -1498? -1496 In base 8, what is -577 - -1? -576 In base 5, what is -141 + 314? 123 In base 10, what is 12 + 17? 29 In base 10, what is 16 + 33? 49 In base 2, what is 1111011100 + -1000? 1111010100 In base 15, what is 7 + -6b? -64 In base 6, what is -5354 - 5? -5403 In base 4, what is -10 - 320? -330 In base 5, what is 1 + 22? 23 In base 12, what is -a92 - -1? -a91 In base 14, what is -87 + -9c? -145 In base 13, what is 25 + -15? 10 In base 9, what is -1 - -64? 63 In base 13, what is -4 - 3c? -43 In base 3, what is -1002 + -11201? -12210 In base 5, what is -4 + -3332? -3341 In base 10, what is 32 - 51? -19 In base 11, what is 2a2 - 0? 2a2 In base 13, what is 1 + 124? 125 In base 11, what is 705a + 1? 7060 In base 12, what is 0 + -202? -202 In base 13, what is -6 + 7? 1 In base 3, what is -12 + 2211? 2122 In base 2, what is 11000001 + -1? 11000000 In base 6, what is -1342 - 41? -1423 In base 12, what is 17 + 1? 18 In base 2, what is -100110 - -100? -100010 In base 4, what is 1 + -103111? -103110 In base 3, what is -100 - -1222? 1122 In base 4, what is 22 + 2211? 2233 In base 14, what is 7 + ad? b6 In base 9, what is -27 - -154? 126 In base 3, what is 120020 + 2? 120022 In base 15, what is 74 + 0? 74 In base 8, what is 2 - -212? 214 In base 7, what is 5541 - -1? 5542 In base 5, what is 224 - 322? -43 In base 14, what is -d + 12? 3 In base 16, what is -4d - 1? -4e In base 13, what is 18 + -18? 0 In base 15, what is -1 + a? 9 In base 16, what is 4a + -15? 35 In base 11, what is 5 + 67? 71 In base 16, what is -d + -707? -714 In base 3, what is -200 + 2? -121 In base 11, what is 6712 - -4? 6716 In base 5, what is 4 + -4? 0 In base 7, what is 3 - 4130? -4124 In base 12, what is -42 + -3? -45 In base 9, what is 842 - -2? 844 In base 14, what is -11 - 6? -17 In base 5, what is 2304 - 4? 2300 In base 9, what is -45 - 1? -46 In base 6, what is 1 + -115? -114 In base 7, what is -343 - -3? -340 In base 3, what is 0 + -2112? -2112 In base 3, what is -201211 + 111? -201100 In base 11, what is -21 - -320? 2aa In base 5, what is 14 - -3202? 3221 In base 13, what is -3 + -112? -115 In base 14, what is 2b8 + -12? 2a6 In base 14, what is -58 - -1? -57 In base 9, what is -3 + -3227? -3231 In base 15, what is -2 - -48a? 488 In base 13, what is -11b + -12? -130 In base 13, what is -5 - -56? 51 In base 5, what is 21 + -43? -22 In base 16, what is 12 + 24? 36 In base 5, what is 10 - 1110? -1100 In base 3, what is 10 - 111221? -111211 In base 5, what is -1203 - -4? -1144 In base 14, what is 0 - 4d? -4d In base 12, what is -1441 - 4? -1445 In base 5, what is 3 + -2014? -2011 In base 7, what is 1465 + 40? 1535 In base 15, what is 5 - e6? -e1 In base 2, what is 101 - 100010011100? -100010010111 In base 6, what is -40 + 13? -23 In base 6, what is 1211 - -2? 1213 In base 2, what is -100000 - 11? -100011 In base 12, what is 122 - 120? 2 In base 15, what is -5 - 2d0? -2d5 In base 2, what is 10011001 + -10101000? -1111 In base 10, what is 177 + 6? 183 In base 13, what is -6 - -139? 133 In base 7, what is -3 + -2123? -2126 In base 6, what is -4 + -14224? -14232 In base 5, what is 1041 + -2? 1034 In base 16, what is 1af + d? 1bc In base 2, what is -1001 + -111010110? -111011111 In base 11, what is 1366 - 3? 1363 In base 14, what is -8a - -1a? -70 In base 14, what is 3 + -3? 0 In base 10, what is -10 - 40? -50 In base 16, what is 2d - 1d? 10 In base 9, what is -1 + 35? 34 In base 15, what is 17 + -a0? -88 In base 5, what is 111023 + 4? 111032 In base 15, what is -33 - e? -42 In base 6, what is -2 + -241? -243 In base 3, what is -2 + -1121101? -1121110 In base 10, what is -10 + -56? -66 In base 9, what is -11217 - 2? -11220 In base 15, what is -a - 31?	{ "pile_set_name": "DM Mathematics" }
403 with respect to n. 572 What is the derivative of -j*2 - 35j - 493? -2j - 35 Differentiate 41a*3g*3 - 2a*2g*3 - 5g*3 + 12 wrt a. 123a*2g*3 - 4ag3 What is the second derivative of -1174a*4 - 380a wrt a? -14088a2 What is the first derivative of 1219gi2s*3 - 2i*2s*2 + 26is3 - 18 wrt g? 1219i*2s*3 What is the second derivative of 12f*5 + 8f*3 + 6f - 6? 240f3 + 48f What is the derivative of -2u2x*2 + 118ux2 - 48x*2 wrt u? -4ux2 + 118x*2 What is the second derivative of 2r*5 + 77r*4 + 153r + 2? 40r3 + 924r*2 What is the second derivative of -601d*4 - 5d*2 - 3232d wrt d? -7212d2 - 10 What is the third derivative of f4h + 4f4 - f2 + 10fh wrt f? 24fh + 96f Find the second derivative of -96l2 + 35l wrt l. -192 What is the third derivative of -117j4w*2 + 8j*3w*2 - 6j*2w*2 + 2j*2 + 50jw2 + 9 wrt j? -2808jw2 + 48w*2 What is the third derivative of -641abl*3 + 2abl*2 + 6abl + 14a wrt l? -3846ab Differentiate -845c*2 - 593 with respect to c. -1690c Find the second derivative of b*3u*2 + 2742b*3u + 14940u2 - 2u wrt u. 2b3 + 29880 What is the second derivative of -hw*4 + 8hw3 + 2hw - 5w*2 - 5w - 16 wrt w? -12hw*2 + 48hw - 10 Find the third derivative of -415g*3z*3 + 82g*3z*2 - 5g*3z - 3z3 wrt z. -2490g*3 - 18 Find the first derivative of -245o*2 + 80. -490o What is the second derivative of 114s3 - 62s wrt s? 684s Differentiate 4fhs*3 - fhs - 9fs3 + 4hs3 - 2hs - 113s wrt f. 4hs*3 - hs - 9s3 Find the second derivative of -2x*4 + 145x*3 - 253x - 1 wrt x. -24x2 + 870x What is the second derivative of 302c3x - 2c3 - cx + 102c - 6 wrt c? 1812cx - 12c Find the third derivative of 841n3 - 707n*2. 5046 Find the first derivative of 181y*2 + 2y + 1801 wrt y. 362y + 2 Find the third derivative of -211t*5u + t*3u3 + t3u + 6t*2u*3 + 246t*2 wrt t. -12660t*2u + 6u3 + 6u Find the third derivative of -24375w6 - 72w*2 - w + 25 wrt w. -2925000w*3 What is the derivative of 9225j + 1527? 9225 What is the third derivative of -19671b2j*3 + 19b*2 + 3bj2 wrt j? -118026b*2 What is the derivative of 13hi2 - 44h + 1 wrt i? 26hi What is the third derivative of 64aj*4 + 14aj - 10j*4 - 87j*2 + j wrt j? 1536aj - 240j What is the second derivative of -6t4 + t3 + 225t? -72t2 + 6t Find the third derivative of -17513g6 - 9298g*2 wrt g. -2101560g3 Differentiate -i3ku2 - i3u2 + 12i*2ku2 - 73i - u2 with respect to k. -i3u2 + 12i*2u*2 Differentiate 147d*2m*3 - 9d*2 - 3m3 - m2 + 192m wrt d. 294dm3 - 18d Find the second derivative of -4h2np + h2p - 4h2 - 7hnp - np - 9n wrt h. -8np + 2p - 8 What is the third derivative of -173n*5 - 72n*2 wrt n? -10380n*2 Find the third derivative of -15n*4 + 49n*2 wrt n. -360n Differentiate -4fp*2 + 12fp - 6f - 14p2 - 3p + 44 with respect to f. -4p2 + 12p - 6 Find the third derivative of -2f3p3 + f3p2 - 2f*2p*2 + 16fp3 - 11p wrt p. -12f3 + 96f Find the third derivative of 4b2k6 - b2k5 - 510b*2k*2 + 2k*2 wrt k. 480b*2k*3 - 60b*2k*2 What is the third derivative of -10h*6 - 23h*4j - h*2j - 106j wrt h? -1200h*3 - 552hj What is the second derivative of -m3 + 4m*2u*3 + 20m*2u + 2mu*3 - 50mu + 2u*3 wrt m? -6m + 8u3 + 40u What is the third derivative of -54t6 - 2t*2 - 116 wrt t? -6480t*3 Find the second derivative of 18g*2p*2r*2 + 11g*2pr - 7gp + 94p*2r*3 - 7r*3 wrt p. 36g*2r*2 + 188r*3 What is the third derivative of -361t*3 - 10t*2 + 10 wrt t? -2166 Find the second derivative of 72d*2g*2 + 92d - 2g2 wrt d. 144g*2 Find the second derivative of -342i*4 + 6055i wrt i. -4104i2 What is the third derivative of 5686mt3 + mt*2 + 810mt wrt t? 34116m What is the derivative of -78f2 + 1851? -156f Find the second derivative of -128n3 + 220n. -768n Find the first derivative of -2836t*2 + t - 5293. -5672t + 1 What is the second derivative of -8o3 - 1020o*2 + 28513o? -48o - 2040 Find the third derivative of -6d*5g*2 - 183d*3g*3 + 2d*2 - 2dg3 - 27g wrt d. -360d2g*2 - 1098g*3 What is the derivative of -46d*2fr3 + d2fr2 - 2d*2r*3 - 9d*2 - 2r*3 wrt f? -46d*2r3 + d2r2 What is the second derivative of -2do3 + 17do2 - do + 3o3 + 127 wrt o? -12do + 34d + 18o What is the derivative of -4c*3l - 40c3 + 7c*2l*4t*2 - 3t*2 wrt l? -4c*3 + 28c*2l*3t*2 What is the third derivative of -72m*3 - 81m*2 + 2m wrt m? -432 What is the second derivative of -n*3 - 5n*2 - 2575n? -6n - 10 Find the second derivative of -86c*5f*2 + 5cf2 - 22f*2 wrt c. -1720c*3f*2 Find the third derivative of 32x*3 + 34x*2. 192 What is the third derivative of 15a*2v*3 - 132a*2v*2 - 8a*2v - av + 11v*4 wrt v? 90a*2 + 264v What is the second derivative of -3611n3 - 2567n + 1 wrt n? -21666n Differentiate -1004w*3 - 832 wrt w. -3012w*2 Find the first derivative of -135w*3 + 480. -405w*2 What is the third derivative of 2r*4 - 2200r*3 + 103r*2 - 13r? 48r - 13200 What is the second derivative of 6n*2q*2y + 2n2qy2 + 3n*2q - 4nq*2y*2 - 2nqy - q*2y*2 + 2qy wrt q? 12n*2y - 8ny*2 - 2y*2 Find the second derivative of -107ir4t + 8ir*3t - 9ir - 93rt wrt r. -1284ir*2t + 48irt Find the first derivative of 58m*2qt2 - mq*2t*3 - 2q*2t*3 + 9qt3 + 7qt2 wrt m. 116mqt2 - q2t3 Find the second derivative of -981z*2 + 7600z wrt z. -1962 What is the third derivative of -12284t3 + 8874t*2 + t? -73704 Find the second derivative of 2202j*4 + 407j wrt j. 26424j2 Differentiate 2k*3z - 52kz*2 + 701z*2 wrt k. 6k*2z - 52z2 What is the second derivative of 14l*4 - 17l*2n*2 - 51ln2 - 2l - 3n2 wrt l? 168l*2 - 34n*2 What is the third derivative of 166u*6 - 2u*5 - 13u*2 + 10u wrt u? 19920u3 - 120u*2 Differentiate 357fq2 - 61fv - 4f - 3q3v2 - q3 + 2v2 wrt q. 714fq - 9q*2v*2 - 3q*2 What is the third derivative of -380m*5 - 97m*2? -22800m*2 What is the first derivative of cvy - 262cv + 5cy - 15c + 4vy + 4y - 3 wrt v? cy - 262c + 4y Find the second derivative of -79v5 + 4v*4 + 4v - 4. -1580v3 + 48v*2 Find the second derivative of 1191l*2v5 - l2v4 - 3l*2v - 4lv - 85l wrt v. 23820l*2v*3 - 12l*2v*2 Find the first derivative of 2509f*3 - 2392. 7527f*2 What is the first derivative of 3d*2q*3 + 74d*2 - 7dq4 - 2q wrt q? 9d2q*2 - 28dq3 - 2 Find the third derivative of 5b6 - b5t + 7b*4t - 2b2 + 20t wrt b. 600b3 - 60b*2t + 168bt Differentiate 360p2uw + 14pu3 - 2pw - 2u*3 + 41u*2 + 20uw with respect to p. 720puw + 14u3 - 2w What is the second derivative of a*4 - 561a*2 - 1318a wrt a? 12a2 - 1122 What is the second derivative of 388w*5 + w - 18? 7760w*3 Find the second derivative of -5140cv2 - 2cv - 2c + v*2 - 2369v wrt v. -10280c + 2 Find the first derivative of -3a*3 + 30a*2y - 24a2 + 10126y wrt a. -9a2 + 60ay - 48a Differentiate 25n2 + 22n + 507 with respect to n. 50n + 22 What is the first derivative of -50a + 7556 wrt a? -50 What is the third derivative of -70g5 - 6g*3 - 766g*2 + 1? -4200g2 - 36 What is the first derivative of c2x + 6c*2 - 152cx4 + 20 wrt x? c2 - 608cx3 What is the third derivative of -198x5 - x4 + 627x2 - 3 wrt x? -11880x*2 - 24x What is the derivative of 379qwy3 + 2qw + 2qy3 - 466q + 3y3 wrt w? 379qy3 + 2q Find the third derivative of -9c3i*3 - 3c*3i*2 - 11ci5 + ci*4 - 79i*2 wrt i. -54c*3 - 660ci2 + 24ci What is the third derivative of 3gq3v*3 + 4gq3 + 56gq2v*4 - 21gq + 2q*2v*2 wrt v? 18gq3 + 1344g	{ "pile_set_name": "DM Mathematics" }
term in 6479, 25932, 58355, 103748, 162111, 233444, 317747? 415020 What comes next: 597994, 597993, 597992, 597991, 597990? 597989 What comes next: -124, -182, -240, -298? -356 What is the next term in 16, -1414, -5284, -12812, -25216, -43714, -69524, -103864? -147952 What comes next: 13304, 13299, 13282, 13247, 13188, 13099, 12974? 12807 What is next in 194, 276, 412, 602? 846 What is next in 109569, 109565, 109559, 109551, 109541, 109529? 109515 What comes next: 14111, 14114, 14117, 14120, 14123? 14126 What comes next: 2566989, 2567002, 2567029, 2567076, 2567149? 2567254 What comes next: 2790, 5696, 8636, 11628, 14690, 17840, 21096? 24476 What is the next term in 10, 5, -6, -17, -22, -15? 10 What is next in 19, 16, -87, -296, -617, -1056? -1619 What is next in 209, 366, 507, 626, 717, 774, 791, 762? 681 What is next in -153, -203, -287, -405, -557, -743? -963 What is next in -122, -1146, -4122, -10088, -20082? -35142 What comes next: 22032, 22015, 21994, 21969, 21940? 21907 What is the next term in 2919, 5938, 8957, 11976, 14995, 18014? 21033 What comes next: -79, -105, -101, -31, 141, 451, 935? 1629 What comes next: 105, 395, 867, 1521, 2357, 3375, 4575? 5957 What is next in 741, 1902, 3077, 4272, 5493, 6746, 8037? 9372 What comes next: 284, 674, 1062, 1448? 1832 What is next in 611590, 611582, 611574, 611566, 611558? 611550 What is the next term in -76, -46, -6, 44, 104, 174, 254? 344 What is next in -2556, -2609, -2670, -2739? -2816 What comes next: -1735, -3496, -5293, -7138, -9043? -11020 What comes next: 192, 381, 572, 771, 984, 1217? 1476 What is next in 7344, 14530, 21716, 28902? 36088 What is next in -19, -24, -17, 8, 57, 136, 251, 408? 613 What comes next: -2553, -2864, -3175, -3486? -3797 What is the next term in -36, -76, -128, -192? -268 What is next in -11956, -95638, -322778, -765106, -1494352, -2582246, -4100518, -6120898? -8715116 What comes next: 1325, 1597, 2327, 3743, 6073, 9545? 14387 What is the next term in 2387, 2388, 2389? 2390 What comes next: 612, 574, 444, 168, -308, -1038, -2076, -3476? -5292 What is next in -464402, -928804, -1393206, -1857608? -2322010 What is the next term in -332, -531, -730? -929 What is next in -21378, -21384, -21390, -21396, -21402? -21408 What is the next term in 275, 932, 1971, 3392, 5195? 7380 What comes next: -54305, -108610, -162915, -217220, -271525? -325830 What is the next term in 96, 286, 476, 666, 856? 1046 What is the next term in 483747, 483752, 483759, 483768, 483779, 483792? 483807 What comes next: 19468, 38934, 58400, 77866, 97332? 116798 What is next in -242634, -485277, -727924, -970575, -1213230, -1455889? -1698552 What is next in -54588, -109187, -163786, -218385, -272984? -327583 What is the next term in -58, -69, -72, -55, -6, 87, 236, 453? 750 What comes next: -2527, -3236, -4419, -6076? -8207 What is the next term in 52236, 52235, 52238, 52245, 52256? 52271 What is the next term in -62945, -125871, -188793, -251717, -314649? -377595 What is the next term in -1808, -3739, -5670, -7601, -9532? -11463 What comes next: 11712, 11694, 11676, 11658, 11640, 11622? 11604 What comes next: -284, -742, -1376, -2186? -3172 What comes next: 249, 532, 1297, 2784, 5233, 8884? 13977 What is next in -957, -739, -377, 129, 779, 1573, 2511? 3593 What comes next: 405, 773, 1129, 1467, 1781? 2065 What is next in 768, 1516, 2274, 3042? 3820 What comes next: 589, 551, 497, 427, 341, 239, 121? -13 What comes next: -177, -595, -1285, -2253, -3505, -5047, -6885? -9025 What comes next: 2884, 2998, 3112, 3226, 3340, 3454? 3568 What comes next: 79, 409, 1299, 3031, 5887? 10149 What comes next: -1082, -2116, -3150, -4184, -5218? -6252 What is the next term in -216, -140, -28, 108, 256, 404, 540, 652? 728 What is the next term in -8649, -17307, -25973, -34647, -43329? -52019 What comes next: 544, 1061, 1556, 2035, 2504, 2969? 3436 What is the next term in -113, -116, -105, -74, -17, 72? 199 What is next in 159, 615, 1373, 2433, 3795, 5459, 7425? 9693 What is next in -2019, -3908, -5679, -7338, -8891, -10344, -11703? -12974 What comes next: 13495, 54077, 121723, 216439, 338231, 487105, 663067, 866123? 1096279 What is the next term in -7453, -7445, -7435, -7423, -7409, -7393, -7375? -7355 What is next in 179, 124, -87, -532, -1289, -2436, -4051? -6212 What comes next: -316, 1448, 3212, 4976, 6740, 8504? 10268 What is the next term in 1043, 1029, 1015, 1001? 987 What is the next term in -113, -106, -107, -128, -181, -278? -431 What is next in -267, -573, -935, -1383, -1947, -2657, -3543, -4635? -5963 What comes next: 9177458, 18354915, 27532374, 36709835, 45887298, 55064763, 64242230? 73419699 What is next in -199, -206, -227, -268, -335, -434, -571? -752 What comes next: 25, 439, 1607, 3907, 7717, 13415, 21379, 31987? 45617 What is the next term in -148, -201, -284, -397, -540? -713 What is the next term in 177, 1901, 4775, 8799, 13973? 20297 What is next in -269, -523, -799, -1109, -1465, -1879? -2363 What comes next: 97621, 97617, 97613, 97609, 97605? 97601 What comes next: 459, 937, 1429, 1935? 2455 What is next in 509, 2113, 4787, 8531, 13345? 19229 What is the next term in 11058, 11061, 11066, 11073? 11082 What comes next: -1851, -7392, -16617, -29526? -46119 What is the next term in -103, -225, -347, -475, -615, -773, -955? -1167 What is the next term in 20, -71, -330, -847, -1712, -3015, -4846, -7295? -10452 What comes next: 100397, 200796, 301195, 401594, 501993? 602392 What is next in -789, -112, 1017, 2598, 4631? 7116 What is next in -9726, -9727, -9728, -9729, -9730? -9731 What is next in -9234, -18474, -27712, -36948, -46182? -55414 What is next in -111, -275, -713, -1563, -2963, -5051? -7965 What comes next: -152, -629, -1106, -1583, -2060, -2537? -3014 What is next in 104523, 209083, 313655, 418245, 522859, 627503, 732183, 836905? 941675 What is the next term in -9072, -9078, -9084, -9090, -9096, -9102? -9108 What is the next term in 983, 1947, 2897, 3833, 4755? 5663 What comes next: 2070, 4144, 6232, 8340, 10474, 12640, 14844? 17092 What is the next term in -4289, -8629, -12969? -17309 What comes next: 124, 132, 104, 40? -60 What is the next term in 176, 622, 1346, 2354, 3652? 5246 What is next in -2042, -8155, -18338, -32591, -50914, -73307? -99770 What is the next term in 1005, 2013, 3027, 4047, 5073, 6105, 7143? 8187 What is the next term in 91373, 91355, 91337, 91319, 91301, 91283? 91265 What comes next: 2395, 2374, 2367, 2380, 2419? 2490 What comes next: -7654, -7717, -7780, -7843, -7906, -7969? -8032 What is the next term in -463056, -463055, -463054, -463053, -463052, -463051? -463050 What is next in -9743, -19473, -29203, -38933? -48663 What is the next term in -27, -240, -639, -1224? -1995 What is the next term in 91085, 364349, 819791, 1457411? 2277209 What is next in -641, -460, 61, 1102, 2843, 5464? 9145 What comes next: 232, 455, 688, 931, 1184? 1447 What comes next: -133141, -133147, -133157, -133171, -133189, -133211? -133237 What is next in 77, 410, 1079, 2174, 3785, 6002, 8915? 12614 What comes next: -29228, -29218, -29206, -29192, -29176, -29158, -29138? -29116 What is the next term in 29793, 29788, 29769, 29730, 29665, 29568? 29433 What comes next: -399, -699, -999, -1299, -1599, -1899? -2199 What comes next: -16298, -16308, -16318, -16328, -16338? -16348 What is the next term in -2826, -2894, -2962, -3030? -3098 What comes next: -202, -1234, -3706, -8236, -15442? -25942 What is next in -14098, -28196, -42292, -56386, -70478? -84568 What is the next term in 129071, 258140, 387209, 516278? 645347 What comes next: 25130, 50273, 75426, 100589? 125762 What is the next term in 3721, 3745, 3785, 3841, 3913? 4001 What is next in 4466, 17897, 40292, 71651, 111974? 161261 What is next in 63945, 63938, 63921, 63888, 63833, 63750, 63633, 63476? 63273 What is the next term in -8323, -7618, -6915, -6214, -5515, -4818? -4123 What comes next: -361471, -361470, -361469, -361468, -361467, -361466? -361465 What comes next: -326665, -653335, -980005? -1306675 What comes next: -178574, -357147, -535720, -714293? -892866 What comes next: -465, -430, -407, -402, -421, -470, -555? -682 What is the next term in 3955, 3951, 3937, 3907, 3855? 3775 What is next in -2289361, -2289364, -228	{ "pile_set_name": "DM Mathematics" }
Two letters picked without replacement from hhvhieqhnvhiv. What is prob of sequence qv? 1/52 Calculate prob of sequence tat when three letters picked without replacement from zztttazztzaazztza. 1/51 What is prob of sequence ccjz when four letters picked without replacement from {p: 3, v: 3, w: 2, c: 2, j: 1, z: 4}? 1/4095 Calculate prob of sequence zppp when four letters picked without replacement from pzppzpppppzzz. 14/143 Four letters picked without replacement from {d: 9, n: 7, s: 3}. What is prob of sequence sdds? 3/646 Calculate prob of sequence fpj when three letters picked without replacement from bfjjpffjjfpffp. 3/91 Three letters picked without replacement from bfffbfbffbbf. Give prob of sequence bbf. 7/66 Three letters picked without replacement from vvkvxkvvkvknkkvvk. What is prob of sequence vxv? 7/510 Three letters picked without replacement from spehrsjjjjjjjeeee. Give prob of sequence hee. 1/204 Four letters picked without replacement from zzogzgzzzozggggzzzzg. What is prob of sequence zzgo? 77/5814 Four letters picked without replacement from ejjjejjjjeejeeej. Give prob of sequence jjje. 21/260 Two letters picked without replacement from {p: 1, k: 1, t: 1, w: 1, m: 1, a: 11}. What is prob of sequence mt? 1/240 Four letters picked without replacement from cgtnmnl. Give prob of sequence mgnl. 1/420 Calculate prob of sequence jma when three letters picked without replacement from {m: 8, j: 2, w: 2, a: 3}. 8/455 Calculate prob of sequence pp when two letters picked without replacement from snpssnsstptsststntt. 1/171 Calculate prob of sequence ud when two letters picked without replacement from uuzjmzrrd. 1/36 Calculate prob of sequence dl when two letters picked without replacement from {o: 3, d: 4, l: 1, h: 3}. 2/55 Three letters picked without replacement from kfmmf. What is prob of sequence fkf? 1/30 Two letters picked without replacement from {z: 6, d: 2, q: 3, a: 2, e: 2}. What is prob of sequence ze? 2/35 What is prob of sequence ncz when three letters picked without replacement from {n: 2, d: 1, k: 2, c: 3, z: 12}? 1/95 Calculate prob of sequence xs when two letters picked without replacement from {w: 2, x: 1, s: 3, m: 1}. 1/14 Two letters picked without replacement from {l: 7, p: 1}. What is prob of sequence ll? 3/4 Calculate prob of sequence wwq when three letters picked without replacement from qqqqwwwqqqqqqqqq. 13/560 What is prob of sequence ynkr when four letters picked without replacement from {n: 1, r: 1, k: 12, y: 1}? 1/2730 Two letters picked without replacement from {d: 13, z: 3}. What is prob of sequence dz? 13/80 What is prob of sequence lkll when four letters picked without replacement from {k: 6, l: 4}? 1/35 What is prob of sequence jjww when four letters picked without replacement from jjjjwwjw? 1/14 Two letters picked without replacement from vxrdrrmmddm. Give prob of sequence md. 9/110 Three letters picked without replacement from {p: 9, o: 2}. What is prob of sequence oop? 1/55 Two letters picked without replacement from {q: 4, k: 1, c: 2}. Give prob of sequence kc. 1/21 What is prob of sequence rar when three letters picked without replacement from {a: 11, r: 2}? 1/78 Four letters picked without replacement from kkakaakakakaakakakkk. Give prob of sequence kkkk. 22/323 What is prob of sequence yy when two letters picked without replacement from yeyyywe? 2/7 Calculate prob of sequence qo when two letters picked without replacement from ecexoxqecceee. 1/156 Three letters picked without replacement from {p: 2, l: 3, d: 2, q: 1, t: 6, z: 6}. What is prob of sequence dqt? 1/570 Three letters picked without replacement from {k: 1, d: 4, g: 2, i: 9}. What is prob of sequence gik? 3/560 Calculate prob of sequence vv when two letters picked without replacement from ntvtvtetuvtw. 1/22 Calculate prob of sequence nys when three letters picked without replacement from wysnsw. 1/60 Three letters picked without replacement from {r: 6, q: 2}. What is prob of sequence rqq? 1/28 Two letters picked without replacement from {g: 1, l: 4, a: 2, d: 4, i: 1, n: 2}. What is prob of sequence dg? 2/91 Four letters picked without replacement from jvjjjjvvvo. Give prob of sequence vjvv. 1/42 Calculate prob of sequence mmmm when four letters picked without replacement from {m: 5, h: 8}. 1/143 Calculate prob of sequence soyy when four letters picked without replacement from {s: 1, f: 1, y: 2, o: 12, l: 2}. 1/3060 Two letters picked without replacement from {e: 1, h: 1, a: 1, v: 1, i: 1}. What is prob of sequence ah? 1/20 What is prob of sequence jlj when three letters picked without replacement from {j: 6, y: 5, l: 2}? 5/143 Three letters picked without replacement from kkdkdd. What is prob of sequence kkk? 1/20 Two letters picked without replacement from ojrjojrorrsojrrj. Give prob of sequence rr. 1/8 Calculate prob of sequence btj when three letters picked without replacement from ststbbjbtjbjbjb. 12/455 Four letters picked without replacement from vkbwvwvkccbbk. Give prob of sequence wwcb. 1/1430 Three letters picked without replacement from czccccccaccczac. Give prob of sequence azc. 22/1365 Three letters picked without replacement from uxxxuxzuuuzuuxxuxx. What is prob of sequence xuu? 14/153 Calculate prob of sequence zmx when three letters picked without replacement from {z: 5, m: 13, x: 2}. 13/684 Calculate prob of sequence vvt when three letters picked without replacement from vtttvsstas. 1/90 Three letters picked without replacement from {f: 1, h: 1, g: 1, m: 2, k: 5}. What is prob of sequence mfh? 1/360 Calculate prob of sequence ihh when three letters picked without replacement from {h: 3, i: 3, t: 10, v: 4}. 1/380 What is prob of sequence mzzm when four letters picked without replacement from mzmzczmmzcccmzzmczmz? 98/4845 Three letters picked without replacement from {x: 1, s: 5, b: 2, o: 6, g: 1}. Give prob of sequence bgs. 1/273 Four letters picked without replacement from {e: 6, s: 3, f: 1, g: 1, c: 1}. What is prob of sequence scef? 1/660 Calculate prob of sequence kit when three letters picked without replacement from {i: 3, x: 1, r: 7, k: 4, t: 3}. 1/136 What is prob of sequence ip when two letters picked without replacement from bbplbpkpiipxp? 5/78 What is prob of sequence iii when three letters picked without replacement from {y: 13, i: 5}? 5/408 What is prob of sequence xtx when three letters picked without replacement from ttytsytxtxstyxttxxxx? 14/285 Three letters picked without replacement from edlhghhh. What is prob of sequence hle? 1/84 What is prob of sequence mnw when three letters picked without replacement from {l: 6, n: 6, k: 1, w: 1, m: 1}? 1/455 What is prob of sequence upm when three letters picked without replacement from {m: 1, a: 1, p: 7, u: 5}? 5/312 Two letters picked without replacement from {v: 1, m: 2, x: 3, t: 5, j: 1, p: 3}. What is prob of sequence tx? 1/14 What is prob of sequence gj when two letters picked without replacement from kwgwkgwjkwggjwgwiw? 5/153 Three letters picked without replacement from {g: 4, c: 6}. What is prob of sequence cgc? 1/6 Four letters picked without replacement from {z: 2, m: 2, p: 1, j: 2, k: 1}. Give prob of sequence jzmm. 1/210 Calculate prob of sequence mg when two letters picked without replacement from babgbgmabammb. 1/26 Calculate prob of sequence in when two letters picked without replacement from nixixnxxxinxcx. 9/182 Two letters picked without replacement from zqqcbiy. What is prob of sequence zy? 1/42 Four letters picked without replacement from pllppplllppll. What is prob of sequence plpp? 7/143 What is prob of sequence vv when two letters picked without replacement from {v: 10, e: 4}? 45/91 What is prob of sequence raar when four letters picked without replacement from {p: 5, a: 9, d: 1, q: 1, r: 4}? 12/1615 Calculate prob of sequence qtr when three letters picked without replacement from ccqrtrttqtqfrq. 2/91 What is prob of sequence wg when two letters picked without replacement from dgwgzdou? 1/28 Two letters picked without replacement from {y: 2, g: 1, s: 1, e: 4, a: 8}. What is prob of sequence as? 1/30 Four letters picked without replacement from psssxxsxsssssss. Give prob of sequence ssss. 22/91 Two letters picked without replacement from	{ "pile_set_name": "DM Mathematics" }
s be i(b). Suppose 4d = j + 3d - 39, -4j + sd + 152 = 0. List the prime factors of j. 43 Let d be ((-9)/15)/((-2)/10). Suppose 6m = dm + 15. Let a = m + 14. What are the prime factors of a? 19 Let j = 289 - -602. What are the prime factors of j? 3, 11 Suppose 0 = -p - a - 1, -4p - p + 40 = -4a. Let y be ((-3)/(-4))/(p/(-64)). Let x = 23 + y. List the prime factors of x. 11 Suppose -5c + 2c - 546 = 0. Let f = c - -325. What are the prime factors of f? 11, 13 Let u(s) = s3 - s2 - s + 31. Let j = -17 + 17. List the prime factors of u(j). 31 Let y(q) = 11q2 + 9q - 5. Let z be y(-7). Suppose 3j = -3b + z, -b = -j + b + 151. What are the prime factors of j? 5, 31 Suppose 3l - 30 = 5g, 2l + 3g + 4 = 5. Let m be 1 + (0/1 - -35). Suppose 4v = 2s - m, 0 = -3s - 2s - lv + 90. What are the prime factors of s? 2, 3 Suppose -4x = 0, -p + 2p - 3x = 218. List the prime factors of p. 2, 109 Let n = 6427 - 2717. What are the prime factors of n? 2, 5, 7, 53 Suppose -f - 3 = 0, a - 515 = -2f + 42. List the prime factors of a. 563 Let w = -97 + 158. Suppose -j + s - 2s + w = 0, 4s = -j + 76. What are the prime factors of j? 2, 7 Let v = 6205 - 3344. What are the prime factors of v? 2861 Let z be (-4)/6(-36)/6. Let k be -3 - (-4 + (0 - z)). Suppose -47 = -kr + 3i + 130, -4i - 176 = -5r. What are the prime factors of r? 2, 3 Suppose 3k + 6 = k - 2w, -w = -2k + 3. Let h(n) = n + 15. What are the prime factors of h(k)? 3, 5 Let o(b) = b3 + b + 2. Let h be o(0). Let m = -113 + 116. Suppose -hz + 2s = -80, 2z - ms = -0s + 85. What are the prime factors of z? 5, 7 Suppose 299 = c - 86. What are the prime factors of c? 5, 7, 11 Suppose 3b - 4800 + 1863 = 0. List the prime factors of b. 11, 89 Suppose -38 = -5z - 3n - 6, 5n = -4z + 36. Suppose 0 = -zo - 2j + 66, -o + 12 = j - 7. Let l = 18 + o. List the prime factors of l. 2 Suppose -18b + 23b = 0. Let m(a) = -a2 - a. Let s be m(b). Suppose 3q - 92 = -2y, s = 6q - 2q - 5y - 115. What are the prime factors of q? 2, 3, 5 Suppose -4j = -o - 1136, -5j + 1437 = -8o + 11o. What are the prime factors of j? 3, 5, 19 Suppose 5q = 3j - 11341, j - 3757 = 16q - 19q. What are the prime factors of j? 2, 23, 41 Let b(z) = 18z + 3. Let n be (-4)/((6 - 2)/(-2)). Let y be b(n). Let i = y - 24. What are the prime factors of i? 3, 5 Let s = -17 + 29. Let v(p) = -p + 14. Let q be v(s). List the prime factors of 241(q - 1). 2, 3 Let m = -1203 + 2565. List the prime factors of m. 2, 3, 227 Let c be (-1742)/22 + (-4)/(-22). Suppose 2n = 5r + 233, 0r + 4r - 338 = -3n. Let m = n + c. What are the prime factors of m? 5, 7 Suppose o + 5u - 19 = 0, u + 10 = 5o - 7. Suppose -m = 4s - 207, -4s = -m - 3m - 232. Suppose -oy = s - 137. What are the prime factors of y? 3, 7 Let s be (-9)/2(-1 - (-5)/9). Suppose -5u = si - 1263, 3i = u - 182 - 74. What are the prime factors of u? 11, 23 Let d(c) = -9c - 13. Let r = 22 - 26. Let u be 1/(r + (-92)/(-24)). What are the prime factors of d(u)? 41 Let i(d) = 19d. Let m(r) = r*2 - 8r - 8. Suppose 0 = -3p + 10 + 17. Let v be m(p). What are the prime factors of i(v)? 19 Let v = 58 - 101. Let q = v - -55. What are the prime factors of q? 2, 3 Suppose 22c + 15985 = 4g + 27c, 3g - 2c = 11960. What are the prime factors of g? 2, 3, 5, 7, 19 Let l = 29 + -30. What are the prime factors of ((-2)/(-4))/(l/(-80))? 2, 5 Let j = 288 + -139. Let o = j - 87. What are the prime factors of o? 2, 31 Let l = -6 + 8. Let n(w) = -5 + 2w + 4w*2 - 6w*2 + 4wl - w2. What are the prime factors of n(5)? 2, 3, 5 Let a(v) be the third derivative of -v*6/120 - 7v5/60 - v4/8 - v3/2 - v2. Suppose q + 2q + 21 = 0. What are the prime factors of a(q)? 2, 3 Let a = -44 - -5. Let z = a + 80. What are the prime factors of z? 41 Let x = -55 + 105. Suppose 20 = 2c - 4i, -i = -5c - 3i + x. List the prime factors of c. 2, 5 Suppose 19o - 7328 = 5592. List the prime factors of o. 2, 5, 17 Suppose 0 = -3s - 108 + 351. Suppose -z - s = -4z. What are the prime factors of z? 3 Let k = -1155 - -3913. What are the prime factors of k? 2, 7, 197 Let a(y) = 350y + 202. What are the prime factors of a(6)? 2, 1151 Let h be (-48)/(-9)(0 - -6). Let j = -20 + h. Let m = j + 19. What are the prime factors of m? 31 Suppose -39 = -5q - 14. Suppose 3d - 255 = 3p, -p = 3d - qp - 259. What are the prime factors of d? 3 Let b(t) = -22t - 12. Suppose 6i + 22 + 2 = 0. What are the prime factors of b(i)? 2, 19 Let q = -22 + 55. Let j = q + 12. What are the prime factors of j? 3, 5 List the prime factors of (8334/36-1)/(1/(-6)). 3, 463 Let v = 167 + 66. What are the prime factors of v? 233 List the prime factors of (-2)/((-4)/3 + (-2562)/(-1923)). 3, 641 Suppose -285b = -280b - 14905. List the prime factors of b. 11, 271 Let k = 193 + -315. Let s = -59 - k. What are the prime factors of s? 3, 7 Let t(s) = 5s2 - 4s - 112. List the prime factors of t(13). 3, 227 Suppose 9d - 2d = 448. Let k = -39 + d. List the prime factors of k. 5 Let m(w) = -2w + 13. Let g be m(4). Suppose gb - 2c = 413, b + 3c - 231 = -2b. What are the prime factors of b? 3 Let h = 1617 - 1064. List the prime factors of h. 7, 79 Suppose -5z = -10 - 20. List the prime factors of 308/z36/24. 7, 11 Let h be (-5)/(-2) + 47/(-94). Suppose -2y - 6 = -4y. Suppose yi - 3u = -4u + 18, hi - 16 = -2u. List the prime factors of i. 5 Suppose 10s = 4s + 480. Let x = 125 - s. What are the prime factors of x? 3, 5 Let m = -153 - -14. Let x = m - -345. List the prime factors of x. 2, 103 Let x(o) = 200o + 406. List the prime factors of x(7). 2, 3, 7, 43 Let n = -32 + 39. Let u(a) = -a2 - 2a - 1. Let w be u(-3). What are the prime factors of (n + w + 3)6? 2, 3 Let u(w) = -w2 - 14w - 20. Let b be u(-11). Suppose -4i + 12 = -2j, 0 = i + 3j - j - b. What are the prime factors of i? 5 Let s(u) = u3 - 5u*2 + 4u - 5. Let h be s(5). Suppose 5c - 5z = h, -c + z = -4z + 9. List the prime factors of c. 2, 3 Let f = -14 - -15. Let x be (1 - -1)(-1 - f). List the prime factors of x/(-8) + (-54)/(-4). 2, 7 Let w be 64 + (1 - 0/(-2)). Suppose -3b = -419 + w. List the prime factors of b. 2, 59 Let r = 0 - -4. Let k be -4(-2)/r2. Suppose -6 = -kt + 26. What are the prime factors of t? 2 Let h be 80/36 - (1 + 28/(-36)). Suppose -2t - hw + 550 = 36, 3t + 2w - 769 = 0. What are the prime factors of t? 3, 5, 17 Let u = -41 - -77. Let v be (-9)/6u/(-3). Suppose m - v = -m. What are the prime factors of m? 3 Suppose -4y = -4l + 35 - 199, -82 = -2y + l. Let i = 84 - y. List the prime factors of i. 43 Let t = -1113 + 1559. List the prime factors of t. 2, 223 Let i = 39 - 8. Suppose i = 6f - 137. What are the prime factors of f? 2, 7 Let m = 57 - 60. Let h(s) = 27s*2 + 9s - 3. List the prime factors of h(m). 3, 71 Let a(d) = -d*3 + 29d*2 - 55d + 76. List the prime factors of a(27). 7 Let t = 805 + -541. List the prime factors of t. 2, 3, 11 Let w(q) = -76q + 259. List the prime factors of w(-11). 3, 5, 73 Let c = -342 + 687. Suppose -3l = -0l - c. Suppose 5r - 135 = -5q - 0q, -4r = -3q - l. What are the prime factors of r? 2, 7 List the prime factors of 1 - 12/14 - (-158592)/1176. 3, 5 Let u be (-8)/10 - 110/50. Let h(t) be the first derivative of t*4/4 + 5t3/3 + t2 + 3t - 10. List the prime factors of h(u). 3, 5 Let c = 1039 - 406. List the prime factors of c. 3, 211 What are the prime factors of (-16)/44 + 30400/110? 2, 3, 23 Let q(l) = -4l - 9. Suppose -7u = -8u - 6. What are the prime factors of q(u)? 3, 5 Suppose 3u = 2p + 40, -p = 4u - 4 - 31. Suppose 3r = -r + h + 13, r = -3h. Let t = u + r. List the prime factors of t. 13 Let x(c) = 2c + 29. Let r be x(-12). Suppose r = 4v - 3v. List the prime factors of v. 5 Let w(r) = -r*3 - 14r*2 + 13r - 26. Let b be w(-15). Suppose bh - 157 = 2j + 283, -3j + 103 = h. What are the prime factors of h? 109 Let j = -22 - -23. What are the prime factors of -4 + (21 - 2)j? 3, 5 Suppose 0 = q - 3g - 868, -7g + 6g = 0. List the prime factors of q. 2, 7, 31 Let g(h) = -89h*2 + 3h - 1. Let y be g(1). Let f = -30 - y. List the prime factors of f. 3, 19 Suppose -3*f = 5 - 14.	{ "pile_set_name": "DM Mathematics" }
lculate the highest common factor of 1263984 and 3. 3 Calculate the greatest common divisor of 3796 and 12116. 52 What is the highest common divisor of 17629 and 17? 17 What is the highest common factor of 11275 and 656? 41 Calculate the highest common divisor of 4045712 and 132. 44 What is the greatest common divisor of 87563 and 7? 7 Calculate the greatest common factor of 5568620 and 820. 820 What is the highest common factor of 3032 and 22361? 379 Calculate the greatest common factor of 8 and 6068. 4 Calculate the greatest common factor of 3456 and 2880. 576 What is the greatest common factor of 8938 and 1845? 41 Calculate the highest common divisor of 5035 and 6935. 95 What is the greatest common factor of 215 and 62737? 43 Calculate the highest common divisor of 2046 and 17484. 186 What is the highest common divisor of 10392712 and 44? 44 Calculate the highest common factor of 3255 and 840. 105 What is the highest common divisor of 420 and 8022? 42 Calculate the greatest common factor of 85403 and 123. 41 What is the greatest common divisor of 613465 and 20? 5 What is the greatest common factor of 1034 and 17766? 94 Calculate the greatest common factor of 14 and 15113. 7 What is the highest common divisor of 304 and 151808? 16 What is the greatest common divisor of 138 and 100326? 138 Calculate the greatest common divisor of 123 and 57441. 123 Calculate the highest common divisor of 231033 and 66. 33 What is the greatest common divisor of 88842 and 3? 3 Calculate the highest common factor of 38515 and 80. 5 Calculate the greatest common divisor of 2009588 and 1960. 196 Calculate the greatest common factor of 492 and 525948. 492 Calculate the greatest common divisor of 148 and 20. 4 Calculate the highest common divisor of 2718 and 28188. 18 Calculate the greatest common divisor of 4681 and 28841. 151 Calculate the highest common factor of 2650 and 8425. 25 Calculate the highest common factor of 13380 and 6540. 60 What is the greatest common divisor of 1248 and 84? 12 What is the highest common divisor of 871 and 104453? 67 Calculate the greatest common factor of 60900 and 1875. 75 What is the greatest common factor of 2 and 14302? 2 What is the greatest common factor of 49100 and 300? 100 What is the highest common divisor of 174 and 37758? 174 Calculate the greatest common divisor of 1860 and 164238. 186 What is the highest common divisor of 73 and 3480713? 73 Calculate the highest common divisor of 26796 and 94743. 957 What is the highest common factor of 216 and 117396? 108 What is the greatest common factor of 897 and 1564? 23 What is the greatest common divisor of 2037397 and 573? 191 Calculate the highest common factor of 44 and 349877. 11 Calculate the highest common divisor of 6860 and 1320. 20 Calculate the highest common divisor of 28 and 57449. 7 What is the highest common divisor of 348 and 242? 2 What is the highest common divisor of 2950 and 17150? 50 What is the highest common factor of 57 and 3479603? 19 Calculate the highest common factor of 392 and 45766. 98 What is the highest common factor of 170 and 729453? 17 Calculate the greatest common factor of 1278 and 9656. 142 What is the highest common divisor of 28 and 65982? 14 Calculate the highest common divisor of 11228959 and 238. 119 What is the greatest common divisor of 55740 and 840? 60 Calculate the highest common divisor of 201924 and 83070. 1278 Calculate the highest common factor of 2657616 and 52. 52 Calculate the greatest common factor of 9 and 8361. 9 What is the greatest common divisor of 1642641 and 42? 21 What is the highest common divisor of 1207 and 1006141? 71 What is the greatest common factor of 7224 and 7620? 12 Calculate the greatest common factor of 8541 and 62853. 219 What is the greatest common divisor of 112504 and 49? 49 What is the greatest common divisor of 80 and 546370? 10 Calculate the highest common divisor of 155447 and 8975. 359 Calculate the greatest common factor of 678873 and 309. 309 Calculate the highest common divisor of 856 and 26750. 214 Calculate the greatest common factor of 5852 and 247874. 418 Calculate the greatest common factor of 6006 and 10582. 286 Calculate the highest common factor of 704 and 16654. 22 What is the highest common divisor of 13 and 275522? 13 Calculate the greatest common divisor of 1064601 and 666. 333 Calculate the greatest common divisor of 3876 and 6120. 204 Calculate the highest common factor of 47 and 1035457. 47 What is the highest common divisor of 14225 and 40825? 25 What is the highest common divisor of 131 and 11029021? 131 Calculate the greatest common factor of 10817 and 1. 1 Calculate the greatest common factor of 32 and 33008. 16 What is the highest common divisor of 4354266 and 129? 129 What is the greatest common divisor of 180 and 6580? 20 What is the greatest common divisor of 121 and 55011? 11 Calculate the highest common factor of 36 and 74673. 9 What is the greatest common divisor of 7641 and 54? 27 What is the highest common factor of 2700 and 48492? 108 What is the highest common factor of 11 and 895081? 11 Calculate the highest common factor of 68 and 2039932. 68 Calculate the greatest common divisor of 56 and 2468. 4 What is the greatest common factor of 30360 and 360? 120 What is the greatest common divisor of 2241 and 1162? 83 What is the highest common divisor of 279 and 33387? 93 Calculate the highest common divisor of 2315056 and 5140. 1028 What is the greatest common divisor of 396 and 14796? 36 What is the greatest common factor of 14 and 131782? 14 Calculate the highest common divisor of 38 and 1594423. 19 What is the greatest common divisor of 703 and 2736? 19 What is the highest common factor of 1984 and 99634? 62 Calculate the greatest common divisor of 123 and 154447. 41 What is the highest common divisor of 2640 and 22720? 80 Calculate the greatest common divisor of 3990 and 275709. 399 What is the greatest common divisor of 279 and 62793? 9 What is the highest common factor of 602 and 4011? 7 What is the highest common divisor of 1028348 and 811? 811 Calculate the highest common factor of 31992 and 4929. 93 What is the highest common divisor of 1968 and 138498? 246 What is the greatest common factor of 1502267 and 13286? 949 What is the highest common factor of 18234 and 126? 18 What is the greatest common factor of 428 and 397612? 428 Calculate the greatest common divisor of 18784 and 7. 1 What is the highest common divisor of 26779 and 13609? 439 Calculate the greatest common factor of 3933 and 4761. 207 What is the highest common divisor of 90257 and 2064? 43 What is the greatest common factor of 3615 and 825? 15 Calculate the greatest common factor of 68864 and 3497. 269 What is the greatest common factor of 771205 and 731? 731 Calculate the highest common divisor of 10 and 101440. 10 Calculate the greatest common factor of 18156 and 255252. 1068 Calculate the highest common factor of 52650 and 14976. 234 What is the greatest common factor of 38 and 21698? 38 What is the greatest common divisor of 1296 and 5448? 24 Calculate the greatest common divisor of 817524 and 828. 36 What is the highest common factor of 1965 and 5097865? 655 What is the greatest common factor of 2456168 and 4407? 1469 What is the greatest common factor of 74 and 1365596? 74 What is the greatest common factor of 16967 and 1504? 47 What is the highest common factor of 124 and 157666? 62 Calculate the greatest common divisor of 36762 and 30. 6 Calculate the greatest common divisor of 8433 and 1737. 9 What is the greatest common factor of 22 and 840004? 22 What is the greatest common factor of 2120 and 138330? 530 What is the highest common factor of 163488 and 32? 32 What is the greatest common factor of 23 and 41101? 23 What is the greatest common factor of 10397 and 22761? 281 Calculate the greatest common divisor of 91 and 8983. 13 What is the greatest common divisor of 538 and 894694? 538 What is the greatest common divisor of 688 and 9824? 16 Calculate the highest common divisor of 1394813 and 203. 203 What is the greatest common divisor of 420 and 706440? 420 Calculate the greatest common factor of 7 and 164647. 7 Calculate the greatest common factor of 1430 and 2002715. 715 Calc	{ "pile_set_name": "DM Mathematics" }
79824o3 wrt o. 1416h*3 - 6h + 4678944 Differentiate -42854335qz + 34448q - 63 wrt z. -42854335q Differentiate -g*4 + 12683691g*2 - 8g + 533713552 wrt g. -4g3 + 25367382g - 8 Differentiate 2rz*2 + 11224rz - 1141r + 63z2 + 25z + 2892 wrt r. 2z2 + 11224z - 1141 Find the second derivative of 46699228m3 + 3m*2 - 874m - 27958 wrt m. 280195368m + 6 Differentiate 2w*3 + 17305w*2 + 28w + 19794016 with respect to w. 6w2 + 34610w + 28 Find the third derivative of -1755850m6 + 48m*5 - 477543275m*2. -210702000m*3 + 2880m*2 What is the first derivative of 6k*3s + 90k3tw + 3k*3t - 10k2stw + 40k2tw - 16kw - 28stw + 4w wrt s? 6k*3 - 10k*2tw - 28tw What is the second derivative of 57034i*5 + 24i3 - i2 + 1521i - 8335 wrt i? 1140680i*3 + 144i - 2 What is the first derivative of -294f2 - 540127f - 637969138 wrt f? -588f - 540127 What is the third derivative of 6b*3n*3 - 1139730b*3n*2 + 140957bn3 + 34bn2 - n6 wrt n? 36b*3 + 845742b - 120n3 What is the first derivative of -rt*3 - 20197rt2 + 3213rt + 40t*3 + 18t2 + 4603 wrt r? -t3 - 20197t2 + 3213t Find the first derivative of -16348588bm*2 - 29m*2 - 55m + 2459 wrt b. -16348588m2 What is the derivative of -1968d3 + d2 + 2448d + 105937527? -5904d*2 + 2d + 2448 What is the derivative of -9598b3 + 119bh - 31801593h wrt b? -28794b2 + 119h What is the third derivative of 3325002v3 - 33578006v*2 - 2v wrt v? 19950012 Find the third derivative of 31293284m3t*2 + 2m*2t - 84mt*2 + 14800 wrt m. 187759704t*2 Find the second derivative of 103505944n*5 - 98792176n. 2070118880n3 Find the third derivative of -t4w + t*4 + 1155t*3w + 1105t3 - 13t*2 + 10tw + 18t - 25w - 3 wrt t. -24tw + 24t + 6930w + 6630 Find the second derivative of 19677t*3 + 439t*2 + 239t + 210732 wrt t. 118062t + 878 What is the second derivative of -2760fku*2 + fku - 2fk + 5ku2 + 63280ku + 24u*2 - u - 2 wrt u? -5520fk + 10k + 48 What is the second derivative of 722400g3 + 2g*2 + 10220g - 32 wrt g? 4334400g + 4 Differentiate 20085626h*3o*3 + 1050h*3 + 9h*2 + 3h - 2o3 + 37 with respect to o. 60256878h*3o*2 - 6o*2 Find the second derivative of -1953i*5 - 1538i*3 + 3i*2 + 176907437i. -39060i3 - 9228i + 6 Find the first derivative of 20n4 - 3352245n - 289070159 wrt n. 80n3 - 3352245 Differentiate 151982945ov + o + 76905431 with respect to v. 151982945o Differentiate -95589483y2 - 64161480. -191178966y What is the first derivative of -105o4 + 5870o - 37468831? -420o3 + 5870 Differentiate 264541k*3u*2 - 15ku2 - ku + 160508728u2 wrt k. 793623k*2u*2 - 15u*2 - u Find the second derivative of -872280497k*5 + 706601547k wrt k. -17445609940k3 What is the first derivative of -16086716a*3 - 28578181 wrt a? -48260148a2 What is the second derivative of b3m2 + 143185b*2m*3 - 30825869bm3 wrt b? 6bm2 + 286370m*3 What is the first derivative of 398152788q + 11196499? 398152788 What is the second derivative of 77356085h4 + 11h - 2371089 wrt h? 928273020h2 What is the third derivative of -2v*5 - 516310v*3 - 245v*2 - 7256v wrt v? -120v2 - 3097860 Differentiate -2709801m*4 - 10995304 with respect to m. -10839204m*3 Differentiate 115686849y*3 + 140648535 wrt y. 347060547y*2 Differentiate 6279592u*4 + 9704809 with respect to u. 25118368u*3 What is the third derivative of 1090733u*5 - 2u*3 - 3405818u*2? 65443980u*2 - 12 What is the second derivative of 5827406j*2 - 11j - 194018? 11654812 What is the third derivative of 201jz*4 + 417jz3 - 5jz2 + 44781j + 23z4 wrt z? 4824jz + 2502j + 552z What is the second derivative of -hy*3 + 74846hy2 + 415hy + 5h + 4y3 - 8y*2 - 81y wrt y? -6hy + 149692h + 24y - 16 What is the first derivative of -38509t3 + 30t*2 + 13t - 44792157 wrt t? -115527t2 + 60t + 13 Find the third derivative of 337039o4y - 3o4 + o3y - 2o3 - 94o*2 + 1425oy wrt o. 8088936oy - 72o + 6y - 12 What is the second derivative of 2b*4 + 12b*3 + 2b*2i - 101572b2 - bi - 33b - 3i - 1600 wrt b? 24b2 + 72b + 4i - 203144 What is the first derivative of -14z*3 + 1930047z + 95876990? -42z2 + 1930047 Differentiate -gj*3 + 2619519gj - 8795685g with respect to j. -3gj*2 + 2619519g Differentiate 218733p3 + 61p*2t*2 + 58786661t*2 wrt p. 656199p*2 + 122pt2 What is the third derivative of -h3x3 + h3x - 868451h*3 - 12823h*2x*3 - 591h*2x*2 wrt h? -6x*3 + 6x - 5210706 Differentiate 138djl2 + 7dl3 - 219343dl2 + 1413j*4l*3 with respect to j. 138dl2 + 5652j*3l*3 What is the third derivative of -362045453q*6 - 117324000q*2? -43445454360q*3 What is the third derivative of -7256264m*6 - 292m*2 + 41917m? -870751680m3 What is the third derivative of 2c*6j + 14639256c5j + 2c2j - 2c2 - cj + 8c + 3079j - 2 wrt c? 240c3j + 878355360c2j Find the second derivative of -2gi*3v - 124gi*2v*2 + giv + 967gi - 6363i*3v*2 - 2i*3 + 4iv2 - 2462i wrt v. -248gi*2 - 12726i*3 + 8i What is the third derivative of 61752t5 - 17t*3 + 12144646t*2? 3705120t*2 - 102 What is the first derivative of 3s*3 + 16270s*2 - 4s + 8119424 wrt s? 9s2 + 32540s - 4 What is the third derivative of 606905y4 + 27y*3 - 24319y*2 + 356y wrt y? 14565720y + 162 What is the third derivative of -8409767t*3 - 2642351t*2 wrt t? -50458602 What is the second derivative of -67183191u*2 - 86695351u wrt u? -134366382 What is the second derivative of 37107589v2 - 22628311v wrt v? 74215178 Find the third derivative of 16550614n4 + 60975n*2 + 13n. 397214736n What is the third derivative of 467737502f*3 + 182f*2 - 753595f wrt f? 2806425012 What is the third derivative of -904032303d5 - 637347540d*2 wrt d? -54241938180d*2 Find the second derivative of 50z*4 - 2503z*3 + 753z*2 - 7449z - 37661. 600z2 - 15018z + 1506 What is the first derivative of -84078h2 - 15h + 15433931 wrt h? -168156h - 15 Find the third derivative of -623i*3w*3 + 32843i*3w*2 + 187i*2w*3 - 2i*2 + 124iw3 - 4iw2 + 7i wrt i. -3738w3 + 197058w*2 Find the third derivative of -12899264h*3 - 4462h*2 - 2743. -77395584 Find the second derivative of -7518005c*2 - 10950209c. -15036010 What is the third derivative of 36746540p5 - p2 + 137497p - 53? 2204792400p2 Differentiate 233r*4 - 292r*2 - 104r - 134097892. 932r3 - 584r - 104 Find the second derivative of 109053g2w + 27g2 - 8903598gw wrt g. 218106w + 54 What is the second derivative of -161n4 - n3 - 3903n*2 + 15875n - 319? -1932n2 - 6n - 7806 What is the third derivative of -960l6 - 9915l*3 + 9047l*2 - 923l wrt l? -115200l3 - 59490 Find the third derivative of 14782446v*4 - 7757051v*2. 354778704v What is the derivative of -6lq*2 - 159lq + 642537210l - 5405q3 - 2 wrt q? -12lq - 159l - 16215q2 Find the second derivative of -197704839a*3 + 33a - 98581 wrt a. -1186229034a Find the third derivative of 144rz3 - 84rz2 - 43343rz - 293878z*4 wrt z. 864r - 7053072z Find the third derivative of 6654846f*3 - 1096383f*2 - 7f. 39929076 Find the third derivative of 19555715g4 - 1078675g*2 wrt g. 469337160g What is the third derivative of 2n5v - 11n4 - 785092n*3v - 2n2v - 4n2 + 329nv + 199n + v - 6 wrt n? 120n2v - 264n - 4710552v Find the first derivative of 10024635z - 431367. 10024635 What is the second derivative of -4bm5 + 139167bm4 + bm + 252184b wrt m? -80bm3 + 1670004bm2 What is the second derivative of 71177h*2r*2 + 162h*2 + 11046hr2 - 44hr + 2h - 4r2 + 3r wrt h? 142354r2 + 324 Find the third derivative of -324130115m*3 - 129m*2 + 22m + 1788. -1944780690 What is the second derivative of 2357r4s + 702r3s + 2rs - 2r - 30126s - 144 wrt r? 28284r2s + 4212rs Find the t	{ "pile_set_name": "DM Mathematics" }
t q be 2/(2 + 6/(-4)). Suppose -qv + 51 = -7v. Let x = v - -22. Solve 0 = -xd + 43 - 18 for d. 5 Suppose 0 = s + 1, 3w + s + 65 = -212. Let x be w/(-22) + 10/(-55). Solve -xg + 9 - 1 = 0 for g. 2 Let s(m) = 57m + 134. Let v be s(-2). Solve -14k = -9k + v for k. -4 Let l(u) = u*2 - 11u - 28. Let p be l(13). Let v be -1 - -1 - ((p - -2) + 0). Solve 0 = -vk + 5k - 15 for k. 3 Let d be ((-48)/(-18))/(12/18). Solve 9 + 7 = dq for q. 4 Let w(u) = -u2 - 24u - 17. Let p be w(-23). Solve pr - 9 = -3 for r. 1 Let f be 292/(-18) - (-4)/18. Let c = -14 - f. Solve 0 = l - 4 + c for l. 2 Let g be (76/190)/(2/10). Suppose 12 = 4s - 0s. Suppose 0 = -5z - sv + 8, 20 = 5z - 4v - 16. Solve -z = -2m - g for m. 1 Suppose -197 = -8q - 5. Solve 26j - 8 = qj for j. 4 Suppose 4y = -2u + 6, -3y - 4 = -3u + 5. Solve -w + 2 = -uw for w. -1 Suppose 2w - 11 = 1. Let o be (-16(-8)/576)/(3/27). Solve g - w = -og for g. 2 Let b(h) = -5h + 8 - 8h - 7. Let x be b(1). Let c(k) = k3 + 12k*2 - 2k - 4. Let a be c(x). Solve 4g = -g + a for g. 4 Let c(w) = -w2 + 8w - 12. Suppose 5 = -x + 10. Let l be c(x). Solve 3 - 15 = -lv for v. 4 Let j = 2 - -4. Suppose -d = -jd + 10. Let w be 558/27 + d/(-3). Solve i = 6i + w for i. -4 Suppose 5f + 5r + 141 - 21 = 0, -3f - 4r - 72 = 0. Suppose 0 = -66z + 82z + 256. Let a = z - f. Solve 0 = -3l + l - a for l. -4 Suppose 0s = -s + 2. Let w = -21 - -21. Suppose q - 2y - 2 = -wy, -sq = -3y - 4. Solve 0h + qh = 0 for h. 0 Suppose -6 = 4k - 7k. Let s = 7 + k. Suppose 4c - 10 = 6. Solve -cf = -sf - 5 for f. -1 Let m = -25 - -28. Suppose 8s - 60 = ms. Let n be 121/66 + 2/s. Solve -y = -ny + 2 for y. 2 Let n(r) be the second derivative of 1/3r*3 + 3/2r*2 - r + 1/6r*4 + 0. Let b be n(-3). Solve i + b = 4i for i. 5 Suppose -6u - 14 = 520. Let a = u - -93. Solve x + a = -x for x. -2 Suppose 4s - 4w - 12 = 0, -s - w + 8 = 7. Solve -3t - 25 = st for t. -5 Let d = 63 - 63. Solve -23q + 18q = d for q. 0 Suppose -5i = -0i. Suppose -29z - 80 = -39z. Solve i = -3n + 23 - z for n. 5 Suppose -14y = -23y - 16y. Solve -4x - 4x - 8 = y for x. -1 Let b(a) = -a2 + a + 9. Let o be b(3). Suppose -2l = -j + ol - 19, 3j + 3l - 15 = 0. Solve k - 4 = j for k. 5 Suppose -4k - 80 = -9k. Let i be (-49)/(-17) + k/136. Solve -3s = -0 + i for s. -1 Suppose 5b - 12 = 3. Suppose 3k - 21 = -3n - 0n, -5n - 4k + 34 = 0. Solve -bd = -0d + n for d. -2 Suppose -6l = -0l - 276. Solve 50f - lf - 4 = 0 for f. 1 Let m = -140 - -144. Suppose -6 = -3l + 3. Suppose 0 = -mu - 16, -lf + 0u - 5u - 14 = 0. Solve z = -z - f for z. -1 Let m be ((-3)/6 + 0)-8. Suppose -4z - z + 36 = mg, -g - 4z + 20 = 0. Suppose -gh + j = -10, 0 = -h - 4h - 5j + 25. Solve 0 = -l - 5 + h for l. -2 Suppose -47x + 24 = -41x. Solve x - 8 = 2n for n. -2 Let a be (-2)/(3 + (-85)/25). Suppose t + 2t - ap - 8 = 0, p = 5t - 6. Solve 2h - 3 - t = 0 for h. 2 Let s be 74/12 + (-5 - 87/(-18)). Solve si + 24 = -0 for i. -4 Let q(r) = -2r3 - 9r*2 + 4r - 1. Let c be q(-5). Suppose -4t + 0t = -32. Let l = -1 - -1. Solve co + t + 0 = l for o. -2 Let o be (-6)/4(-3 + (-892)/12). Let m = o - 91. Solve -5p + 0p + m = 0 for p. 5 Let a(x) = 4x2 - 2x + 1. Let g be a(2). Let z(o) = o*2 - 17o + 53. Let m be z(g). Solve 5 = -2l + m for l. -2 Suppose -3b + 15 = 3z, b = 3z - z - 7. Solve -zd - 73 + 65 = 0 for d. -2 Let x be (25/3)/((-4)/(-12)). Suppose 5w = -3s + x, w - 2s - 8 = -3w. Solve 0 = wp - 0p for p. 0 Let f = -325 - -329. Solve 7 = fv - 1 for v. 2 Suppose 3g = -h + 12, -5h + 3g = -33 + 9. Suppose hb - 26 - 28 = 0. Solve b = -5w + 34 for w. 5 Let g = 39 + -28. Let x = 15 - g. Let p be (x/4 - 3) + 4. Solve o = 2o - p for o. 2 Suppose -7b - 51 - 68 = 0. Let l = b + 21. Solve -5i + 9 = l for i. 1 Suppose 10 = -7w + 24. Solve w = -2y + 4 for y. 1 Suppose -4h + 2h = 3c - 13, 0 = -4c + 12. Solve -14 + 24 = -ha for a. -5 Let y(l) be the first derivative of 5l3 - 1/2l*2 - l - 6. Let d be y(-1). Solve -d = -4z - z for z. 3 Let t(h) = -2h2 + 33h - 11. Let a be t(16). Solve v - av = 4 for v. -1 Let q be 0 + 4/18 + 29716/414. Solve -12 + q = 12r for r. 5 Suppose -24 = -77h + 71h. Solve ha = 9a - 25 for a. 5 Let h be (-376)/(-32) - (-2)/8. Suppose 3d = 5t + 54, -d = -t - 14 + 4. Let v = h + t. Solve 0 = -vm + m - 5 for m. 5 Let z = -58 + 62. Solve zy - 5 = -y for y. 1 Let o(x) = -4x - 2. Let z be o(-11). Suppose 3m + 33 = -z. Let b = -25 - m. Solve 0t - t - 2 = b for t. -2 Let c(w) = -6w + 56. Let y be c(8). Solve yl + 16 = 4l for l. -4 Let h = 986 + -983. Suppose -19 = -3l - 4. Solve -hz - 2 = -lz for z. 1 Suppose -10i = -3i + 35. Let z be 0 + 1 + (1 - i) + -4. Solve 8 = -k - zk for k. -2 Suppose 0 = 21w - 14 - 49. Solve 6s + w = -3 for s. -1 Let n(v) = v*3 + 16v*2 + 2v - 13. Let q be n(-16). Let k = -42 - q. Solve t = -kt + 8 for t. 2 Let o = 6 + -27. Let t = o - -9. Let r be 4/(-24) + (-2)/t. Solve -4x = -r + 4 for x. -1 Let b(a) = a*3 + 4a*2 - 7a - 6. Let q be b(-5). Suppose 11 - 71 = qz. Let v = z + 19. Solve -vl + 7l = 15 for l. 5 Suppose 10r + 110 = 5r. Let n = 3 - r. Solve 0 = -5f - 0f - n for f. -5 Suppose -2o = 1 + 1. Let t(i) = -3i - 1. Let q be t(o). Solve b - 3 = -qb for b. 1 Let k(p) be the first derivative of p*4/4 + 7p*3/3 + 3p*2/2 - 3p - 54. Let j be k(-6). Solve 16f = jf for f. 0 Suppose 4y = i + i - 14, -4i + 3 = -3y. Let f be (0 - (2 + -1))y. Let t = 11 - 5. Solve -21 = fh - t for h. -3 Let c(s) = -s3 - 10s*2 + 9s - 13. Let p be c(-11). Suppose -23 = -pg + 31. Solve g = -0a + 3a for a. 2 Let o be (4/(-26))/(-1) - (-11300)/2938. Solve 0 = 8q - 4q + oq for q. 0 Let l(w) = -w + 16. Let g be l(16). Solve 2j + 23 - 17 = g for j. -3 Let d(j) = j3 + 19j*2 + 34j + 10. Let c be d(-17). Solve -2k = 3k - c for k. 2 Suppose -4v + 2v + 29 = q, 5q = -2v + 49. Suppose -3h + 5m + 0m = -24, 4m = -v. Let l = 1 + 1. Solve hj = -5 + l for j. -1 Let y = 50 - 23. Suppose -4l - 26 + 11 = -u, 3l = 3u - y. Solve -2a = -ua for a. 0 Suppose -4h + 17 = 2z - 1, z + 5h = -3. Solve 53 = 12t + z for t. 3 Let f(j) = 11j2 - 27j + 6. Let z(p) = 9p2 - 26p + 6. Let n(k) = 5f(k) - 6z(k). Let s be n(-22). Solve -l - s = 3l for l. -4 Let a(v) = 13v*3 + 2v*2 - 12v*3 - 12 - 9v + 0v2 + 3v*2. Let g be a(-6). Solve j + j = g for j. 3 Suppose 3b = 12 - 36. Let i = b - -8. Solve 0 = -t - 4 - i for t. -4 Let l be (-8 + 5 + 2)(1 + -2). Let f be (-9 + 0)/(0 - -1). Let j = l - f. Solve 2n = 7n - j for n. 2 Suppose -131 - 84 = -5t. Suppose t = 3c + 4. Let w = -4 + 4. Solve -3n - 1 + c = w for n. 4 Let l(v) = -v*2 + 7v - 1. Let d be l(5). Suppose -4r + 7 + d = 0. Suppose -4g = -rs + 12, -3g + 2 = s - 5. Solve -z - z + s = 0 for z. 2 Let s be (-8 + -2)/((-4)/(-8)). Let w = s + 28. Suppose 5b - wb + 12 = 0. Solve -4o = -4 - b for o. 2 Suppose -u = -y - 6, -6u - 5y = -2u - 6. Solve 0 = -9i + ui + 5 for i. 1 Let i = -22 + 39. Let g(u) = -u*2 - 8u - 9. Let z be g(-6). Suppose -4k + 2v - 7v - i = 0, zk + 4 = -2v. Solve t = -kt for t. 0 Suppose 6z - 15 = 15. Let y = -3 - -4. Let c = y + z. Solve cg - 20 = 2g for g. 5 Let m be -2 + 1 + 3 + 1. Suppose -2n + 39 = -mc, -4 + 43 = n + 5c. Suppose 2w - n - 8 = 0. Solve 0q - w = 4q for q. -4 Let m be (30/25)/((-4)/10). Let j = m - -3. Suppose -4a + a = j. Solve -5b + 16 - 1 = a for b. 3 Let v be 3 + 25/(-5) + 5. Solve 7 = -4n + v for n. -1 Let r(t) = -t*2 + 3t. Let h be r(2). Suppose hu = u. Solve 2g - g = u for g. 0 Let p(c) be the third derivative of -c*5/60 + 3c4/8 + c3/3 + 10c2. Let n be p(9). Solve n - 5 = t for t. -3 Suppose -182q = -150q - 704. Solve 0 = qj - 17j - 20 for j. 4 Suppose i + 9 = -3j, i - 18j - 12 = -14j. Solve 14o - 18o + 8 = i for o. 2 Suppose -k + 4k = 3z + 141, 5z - 65 = -k. Let s be (-36)/(-30)k/3. Suppose -13o = -8o - s. Solve -og + 14 + 6 = 0 for g. 5 Let l = -811 + 822. Solve 2b = lb - 18 for b. 2 Let v(a) = 7a*3 - 3a - 7a3 + 3a2 + 5 + a3. Let n be v(-4). Solve n = 4z + 5 for z. -1 Suppose 41b - 6 = 158. Solve -4 = -bd + 6d for d.	{ "pile_set_name": "DM Mathematics" }
and give h. 1 Express 875 - 1751 - 34t + 876 + 2t - 2 + 2 + (1 + 0 - 2)(t + 0 + 0) in the form ot + w and give o. -33 Rearrange 24s2 - 16s*2 - 16s*2 + (-2s*2 - 58s + 58s)(4 - 2 - 1) to bs2 + u + cs and give b. -10 Rearrange 2w + 2 - 2 + (0 + 1 + 0)(-2w - 2w + 3w) + 0w + w + w + 1 + 2w - 1 - 6w - 11w + 35w to n + xw and give x. 23 Express 14t*2 - 7t*2 - 67 - 9t*2 as m + xt + yt2 and give m. -67 Express (-2t*3 + 1 + 9t + 1130t2 - 1130t*2)(5t - 3t - 6t) as vt*3 + zt + g + qt4 + ft*2 and give z. -4 Rearrange (-4n - 50n - 26n)(0n*2 + 3n*2 - 2n2) + (-1 + 1 + n2)(2n - 3n + 2n) to fn + qn*3 + o + cn*2 and give q. -79 Rearrange -230p - 3 - 227p + 458p + 58p2 to the form up*2 + c + ip and give c. -3 Rearrange -44m2 - 66m*2 - 81m*2 to s + om + um2 and give u. -191 Rearrange (4 - 5 + 2 + 3 + 4 - 5 + (0 + 3 - 1)(-1 - 2 + 2) - 4 - 1 + 3)(34k*3 + 16k*3 + 126k*3) to r + fk*2 + mk + ak3 and give a. -176 Express 1 - 154q + 24q + 38q - 158q - 2 as i + tq and give t. -250 Express (8u + 11 - 31u + 19u)(6 - 2 + 8) in the form x + ku and give x. 132 Express m3 - 7m + 6m - 111 + 113 + 3m*4 - 23m*2 in the form km + tm2 + ym*3 + qm*4 + w and give y. 1 Rearrange (2 - 2 - 2k)((3 + 0 - 4)(2 - 2k - 2) - k + 19k - k - 3k - 6 + 6) to the form mk*2 + bk + u and give u. 0 Express (-3z2 - z2 + 5z*2)(-16z - 41z - 63 + 51z) as uz*2 + o + iz*3 + vz and give i. -6 Rearrange -115s4 + 19 + 59s*4 - 2s*3 - 70 - 4s2 + s3 + 58s4 to ys*3 + xs + ps2 + as*4 + q and give a. 2 Express 193b*2 - 4089b + 4089b + 2 in the form hb*2 + f + ab and give f. 2 Rearrange 54v + 83 - 31v - 24v to i + ov and give o. -1 Rearrange (0x + 0x + 2x)(-6x3 - 4x*3 + 5x*3) + 20x*4 - 1617 - 5x*4 + 1613 to the form fx*4 + sx + o + nx2 + lx*3 and give f. 5 Express (6 - 6 + 2v)(4 - 3 + 0)(3v - 4v + 0v)(10v + 23 + 18 - 39) as n + dv*3 + gv + xv2 and give d. -20 Express 8o + o*4 - 8o - 2o2 + (-o - 15o - 40o)(-o*3 + 4o3 - o3) in the form ho + jo*3 + d + lo*4 + fo*2 and give j. 0 Rearrange -b + 169b3 - b2 + b*2 - 52b*3 to the form yb*2 + kb*3 + p + gb and give k. 117 Rearrange 25c2 + 2c*4 - 2 + 0 - 24c*2 + (-5c*3 + 0c*3 + 3c*3)(28c - 82 + 82) to the form wc + n + pc2 + uc*3 + mc*4 and give m. -54 Express 2 + 20p + 20p + 2p*3 - 41p as qp + r + hp*2 + kp*3 and give k. 2 Rearrange (-5b*3 + 139b - 139b)(6b - 101 + 101) to jb*2 + c + tb*4 + ab*3 + sb and give j. 0 Express (0x - x + 2x)(139x - 71x - 485x)(-48 + 48 + 2x) as ax2 + rx*3 + p + hx and give p. 0 Express -3 + 3 - 181s2 + 47148s - 47141s in the form ys + ws2 + t and give y. 7 Rearrange (-1 - 2 + 2)(n*2 + 0n + 0n) + (-n + n - 2n)(3 - 3 + 2n) - 3n2 - 3 + 3 - 37382n - 34n2 + 37382n to the form mn2 + hn + q and give m. -42 Rearrange -142r + 21 + 143r + 11 + 54 to the form qr + x and give x. 86 Rearrange 72 - 34x + 11x + 17x + 5x to the form rx + k and give r. -1 Rearrange (-5f + 3f + f)(-5 + 5 + f2)(2564 + 2223 - 5130) to the form vf3 + pf + x + sf2 and give v. 343 Express (-142p + 142p - 33p*2)(-8p2 + 77p - 77p) as qp*3 + mp + vp2 + j + tp*4 and give t. 264 Rearrange -1 - 13v*4 - 11v*2 - 48v*3 + 50v*3 + 16v*2 to the form hv*3 + t + wv*2 + jv*4 + iv and give t. -1 Express (0f + 3f - f)(1 + f - 1) - 31008 + 1442f*2 + 31009 + 2f*2 as b + nf + kf2 and give k. 1446 Rearrange (-2x3 + x3 - x*3)(1 + 1 + 0) - 48x3 - 41x*3 - 142x*3 to the form tx*2 + z + ax*3 + sx and give a. -235 Express (2y3 + y3 - y3)(2y - 2y - y) + (-2 + 0 + 3)(-4 + 2 + 1)(y*3 + 0y*4 + 13y3 + y4) as j + iy3 + fy*4 + ky + oy2 and give f. -3 Express -134 - 8o*4 + 2o*2 + 9o*4 - 4o*2 + 2o*4 in the form h + lo + fo3 + jo*4 + ko*2 and give k. -2 Rearrange -5s - 120 - 116 + s to g + rs and give g. -236 Express -5i*2 - 2i*4 + 5i2 + i2 + 0i - 40i*3 + i in the form ti*2 + bi*3 + gi + di4 + o and give g. 1 Rearrange 8v - 9v + 132v*2 + 219v*2 + 20v*2 to the form bv + u + sv2 and give s. 371 Express 20 - 40 + 20 + 63n*2 as zn*2 + sn + u and give z. 63 Rearrange 2r2 - r3 + r + 5023 - 5r*2 - 5029 to qr*2 + mr*3 + jr + u and give u. -6 Express -25k + 19k - 20k3 + 5k in the form hk3 + rk + u + tk2 and give h. -20 Express -25h*3 + 27h*3 + 2h*2 - 9 + 10h - 12h + h4 as t + sh*3 + oh + bh2 + jh*4 and give b. 2 Express -90o*3 + 23o*3 - 6o - o*2 + 6o as to3 + wo + h + bo2 and give t. -67 Express -83j - 6 - 1 + 8 - 5j as v + kj and give v. 1 Express -27 + 7 + 12 + 223q3 + 9 in the form vq*2 + fq*3 + i + wq and give i. 1 Rearrange -2n2 - 113 - 41n + 113 to the form jn2 + f + dn and give d. -41 Rearrange -44b3 - 75b*3 - 96b*3 + (4b*2 - 2b*2 + 0b*2)(4 - 4 + b) to ob3 + q + tb + hb2 and give o. -213 Rearrange -60c + 158c - 96c + 472c3 to the form pc*3 + qc + f + hc2 and give p. 472 Express 0 + 276z + 0 + 333z + 141z in the form s + kz and give k. 750 Express -9 + 11 - 4b*3 - 73741b + 73745b - b2 + (-2b*2 + 3b2 + b2)(-b + 0 + 0) as i + kb*3 + cb + ub2 and give k. -6 Express (-28920 + 440j + 28920)(-j - j + 3 + 4j) in the form l + gj + vj*2 and give v. 880 Rearrange -37 + 26 - 2c*3 + 10 - 15c*2 - 4c*2 + 2c to kc + sc*3 + yc*2 + n and give y. -19 Rearrange ((-4 + 1 + 1)(3 - 3 + 2w) + 0w + 2w - 4w)(-62 - 54 + 26)(-3 + 1 + 3)(-3w + w - w) to the form uw + xw*2 + t and give u. 0 Express (19 - 16 + 27 + (-3 + 0 + 1)(1 + 2 - 4))(-v2 - 14v*2 + 31v*2) as z + av*2 + qv and give a. 512 Rearrange (0 - 2 + 4)(2x*3 + 1 - 1)(0x + 0x - 14x + (-6x + 2x + 2x)(-2 - 2 + 5)) to the form bx + wx2 + p + jx*4 + tx*3 and give b. 0 Express -1 - 65 - 8 + i in the form v + ni and give v. -74 Express (-5414 - 488 - 3477 + 1984)(u - 1 + 1) in the form vu + f and give v. -7395 Rearrange -8 - 8 - 62s + 73s to b + gs and give g. 11 Rearrange 81r*3 - 398r*3 - 151r*3 + (2 - 5 + 1)(r*2 - 2r2 - r2)(0r - 3r - 2r) to the form xr + ar*2 + b + yr*3 and give y. -488 Rearrange 105 - 87 + 278b3 - b2 + 7b - 278b*3 + 5b*4 to ib*3 + pb*2 + xb + ob4 + y and give x. 7 Express -2g + 104g2 - 6 + 1 - 102g2 + g3 as zg2 + qg*3 + ag + j and give z. 2 Express (-5z + 2z + z)(4 + 2 - 4) - 3z - 4z + 5z + (3 - 6 + 0)(-z + 1 - 1) as g + yz and give y. -3 Rearrange 31q3 - 109q*2 + 109q*2 + (-2q + 0q + 4q)(q2 + q2 - q2) + 4q3 + q3 - 9q2 - 6q*3 to nq + p + dq2 + uq*3 and give u. 32 Express 0s*3 - 2s*3 + 0s + 33438s2 - 33441s2 - s4 - 3 - s as ns3 + js*4 + is*2 + ws + d and give j. -1 Express 4195h - 2105h + 9 - 2137h in the form s + ph and give p. -47 Rearrange 166z - 3 - 6 - 4 + 14 to the form nz + o and give o. 1 Express (3i2 + 0i*2 + 0i*2)(-1 - 3 + 1)(29i - 80i + 40i) in the form pi + ci*3 + ki*2 + b and give b. 0 Rearrange -3t3 + t3 + 40t2 + 0 + 0t*3 + 3t*2 - 2 + 2t to ut + at*2 + s + bt*3 and give a. 43 Rearrange 61d + 62d - 59 - 119d to b + sd and give s. 4 Rearrange -2 - q2 - 130q - 87q + 3q*2 to the form oq*2 + y + rq and give y. -2 Express (-q + 0 + 0 + 6)(2q - 2q - 3q)(0 - 5 - 3) as gq*2 + m + hq and give g. -24 Rearrange -l3 - 12 + 23 - 9 - 16 - 6 - l2 to tl2 + wl*3 + d + cl and give d. -20 Express -2 + 62t2 - 15t*3 - 132t*2 + 59t*2 in the form wt*2 + xt + g + it3 and give x. 0 Rearrange (-584t*3 - 4t*4 + 584t*3)(-3 + 2 + 3) + 0t4 + 4t*4 - 7t*4 to the form ct*4 + nt*2 + rt*3 + j + yt and give c. -11 Rearrange 82t - 20t - 24t - 18t - 23t - 257 to the form bt + s and give s. -257 Express (-8u + 9u + 2u)(0 + 2 - 1)(0u + 2u + 0u) + (51 - 51 - 15u)(-7u + 0u + 2u) in the form r + fu*2 + qu and give f. 81 Express 7p - 1 - 4766p**3 -	{ "pile_set_name": "DM Mathematics" }
2s2 + s + 3. Let h be q(2). Let t be j(h). Let b(a) = -a2 + 2. Calculate b(t). -2 Suppose -23p - 11 = -44 - 36. Let t(d) = -d + 32. Determine t(p). 29 Let d(r) = -3r - 27. Let x be ((-2)/(-6))/(19/(-2052)2). Calculate d(x). 27 Let v = -20 - -23. Let h(b) = -2b - 4b*2 - 4 + 5b + v. Suppose 8g = 4g + 8. Determine h(g). -11 Suppose t - 14 = 2v, 0 = -4t + v + v + 50. Let s = -7 + t. Let w(f) = f*2 + 4 - 3f - 2 - f. What is w(s)? 7 Let x = -777 - -801. Let n(b) = 5b - 120. Give n(x). 0 Let d(k) = 17k*3 - 7. Let u(q) = -34q*3 + 13. Let x(v) = 11d(v) + 6u(v). Suppose -h + 28 = -3h - 4g, -3h = 3g + 42. Let z = -13 - h. Calculate x(z). -16 Let t(k) be the third derivative of k5/60 - 5k*4/12 + 2k*3/3 + 768k2. Let h(q) = -q2 - 3q + 4. Let j be h(-3). Determine t(j). -20 Let h(f) = 2f*2. Let j(y) = 69y + 211. Let l be j(-3). Let o be (13/(-2))/(2/(-4)). Suppose 9u = ou + l. What is h(u)? 2 Let w(v) = -v - 7. Suppose q - 2g - 2 = 3, 5g - 10 = -5q. Suppose 0 = -qx - 14 + 2. Let b be 2/x(4 + -4). Determine w(b). -7 Let p(t) = -2t*3 - 8t*2 + 12t + 15. Let u be p(-5). Let d(l) = -427l - 432l + u + 863l. Calculate d(-3). -7 Let l = 15 + 21. Suppose -l + 40 = h. Let f(w) = w + 2 - hw + 2w2 - w - w. Determine f(3). 5 Let b(p) = 41p - 8p2 + 232 - 9p*2 - 10p*2 + 31p*2 - 3p2. Determine b(-34). -6 Let q(u) = -u3 + 30u2 + 6u - 160. Let d be q(30). Let z(a) = -15a + 297. Calculate z(d). -3 Let f(t) = t3 - 5t*2 + 5t - 5. Let u(h) = -17h2 + 38h - 5. Let p(r) = 3r2 + 2r. Let d(a) = 4p(a) + u(a). Let x be d(9). Determine f(x). -1 Suppose 0 = 80m - 81m + 109. Suppose -5z + 3p + m = 16, -p = -4. Suppose -14u + zu - 14 = 0. Let f(l) = 3l*2 + 2. Determine f(u). 14 Let c(r) = 10r*2 - 18r - 13. Let w(j) = -7j2 + 12j + 9. Let b(s) = -5c(s) - 7w(s). Suppose -67 - 10 = -128t + 563. Determine b(t). 7 Let p(h) = 2h + 11. Let g(m) = 4m + 21. Let k(q) = -6g(q) + 13p(q). Let a be (-17)/(-51) - ((-38)/(-3))/2. Determine k(a). 5 Let t(y) = -y2 + 3y - 4. Let d = 125 - 119. Suppose -2l + 23 = -h, -4h = -4l + 3l - d. Suppose 4r - n = l, 0r + 16 = 2r - 5n. Determine t(r). -4 Let r(m) = -2 - 19 - m - m - 14 - 2m. What is r(-5)? -15 Let f(z) = 18z - 73. Let b be f(4). Let l(j) = 1. Let g(a) = 7a2 + a - 4. Suppose 2h - 3h - 1 = 0. Let w(q) = hg(q) - 4l(q). Give w(b). -6 Let l(n) be the first derivative of -n4/4 + 2n*3 + 7n*2/2 + 5n - 168. Let s = 7 - 11. Let x be ((-3)/s - -1)4. Calculate l(x). 5 Let r(u) = u3 + 8u*2 + 13u + 19. Let v(p) = -3p3 - 23p*2 - 38p - 72. Let d(w) = -8r(w) - 3v(w). What is d(-5)? 14 Let j = -773 + 821. Let t be 16/(-88) + (j/22 - 5). Let n(z) = z + 9. What is n(t)? 6 Suppose -14p = 2s - 11p - 19, -4s + p = -3. Let c(j) = 4j2 + j2 - 199 + 203 - j - 3j*s. Give c(2). 10 Let d be (-12)/48 + (-322)/(-8). Let y(z) = 5 + 88z - 36z - z3 - dz + 12z2. Give y(13). -8 Suppose 11u = 7u + 8. Let k be 3/(u - 9/3). Let w(x) = -x2 + 6x - 41. Let l(a) = -a + 6. Let h(y) = -14l(y) - 2w(y). Determine h(k). 10 Let g(r) be the third derivative of -r6/120 - r5/15 + 2r3/3 - 3r*2. Suppose 4n + 11 = -9. Let m be 17/n - 20/(-50). Calculate g(m). -5 Suppose 0 = -4p + 20. Let i(q) be the third derivative of -1/8q*4 + 0q + 0 + q*3 - 50q2. What is i(p)? -9 Let a(k) be the second derivative of k4/4 - k3/2 + k2/2 - 1592k. Suppose 0 = 2g + 4u - 24, -2g - 5u + 14 = -3u. Determine a(g). 7 Let w(s) = s*3 - 10s*2 + 13s - 5. Suppose -n - m - 8 = 0, 2m - 4m - 8 = 0. Let p be (2 + 7)(-3 - n). Determine w(p). 31 Let d(r) = -14 + 16 + 4r*2 + 13 + 14 + 26r + 63r. Determine d(-22). 7 Let a(u) = -14u - 6 - 4 - 842u3 + 844u*3 - 8 - 3u2 + 5. What is a(-2)? -13 Let l(m) = m2 + 9m + 4. Suppose 27 = -4d + 39. Suppose -dq - z + 47 = 3z, 4z = -q + 13. Suppose -4n = q + 3. Calculate l(n). -16 Let a = -242 - -244. Let z(k) = k*2 - 9k*3 + 10k*3 - 2k*2 + 2ka. Give z(-3). -18 Let z(g) = g2 + 11g + 18. Let p be z(-9). Suppose 2l = q + 2 + 3, -q + 3 = p. Let y(a) = -la - 7a*2 + 6a*2 + 5 + 2a2. What is y(4)? 5 Let w(l) = -l2 + 5l + 3. Suppose 661i - 29 = 3p + 657i, -p = 5i - 41. Let y be 110/8 - (-1)/4. Suppose -83 = -ya + p. Give w(a). -3 Let t(r) = -r*2 - 4r + 7. Suppose 0 = -3o - 4u + 8, 3u - u + 2 = 0. Suppose 9 = od + 37. Give t(d). -14 Let n(z) = -7z2 + 51 - 50 - z2. Let m(l) = 2l + 21. Let v be m(-8). Suppose 9s - 14s = v. Calculate n(s). -7 Let p = -884 - -920. Let h(z) = 2z3 - 71z*2 - 37z + 27. Let d be h(p). Let c(q) = -q*3 - 9q*2 - q - 4. What is c(d)? 5 Let o be (6/4)/(5 + (-258)/48). Let y = o - -6. Let p(n) = yn - 50 + 14 + 22 + 16. What is p(-4)? -6 Let q(g) = -g*3 - 8g*2 + 33g - 21. Let u be 12/(-15) + (2499/35)/(-7). Determine q(u). -21 Suppose 8v - 30 - 66 = 0. Suppose 5i = -13 - v, -4u = 4i - 4. Let l(q) = q*3 - 6q2 + q - 3. Determine l(u). 3 Let c(f) be the first derivative of f3/3 + 6f2 + 9f + 7236. Determine c(0). 9 Suppose -x + 11 = -4f, 11 = -3x - 2f - 12. Suppose 14 = g + g + 3h, 4g + 8 = 3h. Let q(p) = -1 - 6p2 - 1 - 2 - p3 + g - 7p. Calculate q(x). 7 Suppose -56 - 22 = -11i + 54. Let z(h) = h - 7. Calculate z(i). 5 Let l(o) = o2 - o + 2. Suppose 30 = 3w - 9a + 13a, 2w + 5a - 27 = 0. Suppose -h - 9 = 2t, h - wh = 5t + 30. Determine l(h). 14 Let u(z) be the first derivative of -z4 - 2z3/3 + z2/2 - 2453. Give u(1). -5 Let k(a) be the second derivative of -5a3/2 + 95a*2 - 289a. Let q be k(12). Let l(p) = -p*3 + 11p*2 - 14p - 4. Determine l(q). -44 Let u(w) = -318 - 21w + 154w*2 - 153w*2 + 276. Determine u(-2). 4 Let v(d) = -295d + 1785. Let k be v(6). Let a(j) = j*3 - 17j*2 + 30j - 9. What is a(k)? -9 Let j(w) = -3w2 - 17w - 4. Let v(d) = 3d2 + 16d + 4. Let c(r) = 2j(r) + 3v(r). Let p be c(-4). Let t(q) = 2q + 5. Calculate t(p). -3 Let k(j) = 20j + 24. Let u be 9 - (3 - 99/(-16 + 5)). What is k(u)? -36 Let u be 4 - (40/(-1))/(-5). Let w = 12 + -6. Let b(d) = 3 - w - 3d - 2 + 0. What is b(u)? 7 Let z = -9360 - -9360. Let i(y) = 10y*2 - y - 3. Determine i(z). -3 Suppose 5q - 5h - 47 = 108, 3h = -5q + 115. Let i be 1530/q + (-2)/(-26)2. Let z(p) = 0p2 + p2 + i - 114 - 3p + 59. Determine z(6). 22 Let l(w) be the third derivative of w5/60 - w4/8 + 11w3/6 + 22w*2 - 2w + 11. Give l(7). 39 Let q(u) = -u + 19. Suppose -40 - 8 = -12x. Suppose -41 = -3f + 2h, -3h = xf + h - 68. What is q(f)? 4 Let x(u) = 9u*2 + 3u + 2. Let w be 13 - (10 + -6) - 10. Give x(w). 8 Let t(q) be the third derivative of -q*5/60 + 11q*4/24 - 11q*3/3 + 1588q*2 + 3. Calculate t(6). 8 Let t(a) be the second derivative of -3/2a*2 + 1/6a*3 - 38a + 0. Give t(-8). -11 Suppose 0 = 3f + 3f. Let a(t) be the second derivative of -t*4/24 + 3t*3/2 + 2t*2 - 13t - 1. Let d(s) be the first derivative of a(s). What is d(f)? 9 Let s(p) = -3p - 1. Let w be 8(-7)/(-14) - (-1 + 16). Let f(i) = -12i - 4. Let r(j) = ws(j) + 2f(j). Determine r(-5). -42 Let d(q) = q2 + 2q + 3. Let h = -147 + 152. Let p(g) = g*2 - 3g - 13. Let o be p(h). Determine d(o). 6 Let o(u) = 6u + 62. Let x be (-3)/(-5 + (-580)/(-110)). Give o(x). -4 Let l(y) = y3 - 3y*2 + y - 2. Let s be (-6)/9 - (-502)/6. Let n = 34 - s. Let m = n - -51. Determine l(m). -4 Let z(k) = 5k + 595. Let i(b) = -10b - 1091. Let v(t) = -6i(t) - 11z(t). Give v(-7). -34 Let m(k) = 9k*3 - 16k*2 + 26k - 63. Let h(q) = 2q3 - q2 + q - 13. Let a(v) = 4h(v) - m(v). What is a(8)? 91 Let p(j) = -5j + 1. Suppose 0 = -2q + 36 - 268. Let c = q + 111. Give p(c). 26 Suppose -10k + 1 = -11k. Let q be 2/k - 50/(-10). Let c = 0 - q. Let a(x) = -x2 + 2. Determine a(c). -7 Let b(l) = l3 - 7l2 - 8l - 5. Let c(x) = -41x + 29 - 7x*2 + 41x*2 - 15x2 + x3. Let z be c(-21). Give b(z). -5 Let l(g) = -11g2 + 15 + 12g + 204g3 - 19 + 200g*3 - 403g*3. Determine l(8). -100 Let d be (-2)/30 + 434/210. Let q(c) be the third derivative of 1/3c*3 - 4c*2 - 1/30c*5 + 0c + 1/24c4 + 0. Determine q(d). -4 Let b(l) = 8 + l3 + 14l*2 + 0 + 9 - 14l. Let u be	{ "pile_set_name": "DM Mathematics" }
6, 1, 0.03, -0.1? 1/6 Which is the nearest to 1? (a) -3 (b) -5 (c) 3/7 c Which is the closest to -1/4? (a) -2 (b) -2/9 (c) 12 (d) -4 b What is the closest to -0.04 in 2, 1/3, 0.06? 0.06 Which is the nearest to 0? (a) 4 (b) -1 (c) -0.5 (d) -990 c What is the closest to 0 in 3, 1, 9? 1 What is the nearest to -0.2 in -4.287, -3, 1? 1 Which is the closest to 0? (a) 0.5 (b) 0 (c) 5 (d) -25 b Which is the closest to 1? (a) 0.1 (b) -1 (c) 6 a Which is the closest to 5? (a) 0.5 (b) -2 (c) 0.03 a What is the nearest to -1/2 in 0, -2, 0.1, -9? 0 Which is the closest to 0.03? (a) -1 (b) 5 (c) 2/9 c Which is the closest to -0.2? (a) 4/9 (b) -1 (c) -3 (d) 0.3 d What is the closest to -0.1 in -0.4, 2/7, -1/8? -1/8 What is the closest to 2/3 in 2, -55.1, -1/4, -1/3? -1/4 Which is the nearest to -17? (a) 5 (b) -0.3 (c) -3 (d) -11/7 c Which is the nearest to -2/13? (a) -5 (b) -15 (c) 2 c Which is the nearest to 53? (a) -2 (b) -5 (c) -1/4 c Which is the closest to -4? (a) -2/21 (b) -1 (c) 0.3 b What is the closest to -64 in 1/5, -1/4, 1/4? -1/4 Which is the nearest to -1? (a) -5 (b) -2/3 (c) 669 b What is the closest to 16 in -6/7, 0.4, -12? 0.4 Which is the nearest to 1? (a) -6/35 (b) -1 (c) -4 a What is the closest to -5 in 2/5, -6, 0, -1/3? -6 Which is the nearest to 2? (a) -5 (b) 0 (c) 0.5 c Which is the closest to -4/7? (a) 0 (b) 2 (c) 1 a Which is the closest to 0.1? (a) -1/2 (b) 1/389 (c) -2/17 b What is the closest to -2/5 in -2/7, 2/3, 0.3, 0.4? -2/7 What is the nearest to 0.2 in 3, 0.03, -2/15? 0.03 What is the closest to 0 in -7/4, 0.3, -2? 0.3 What is the nearest to -2 in 0, 2, -3? -3 Which is the closest to 0.1? (a) -3 (b) -0.06 (c) 0.4 b Which is the closest to 2/177? (a) -0.3 (b) 5 (c) -0.4 a What is the nearest to 4 in -1/2, 21, -1? -1/2 What is the nearest to -4 in -1, 0.4, 2/57? -1 What is the closest to 0 in -0.4, -2, -42/11? -0.4 What is the nearest to 1 in 1/4, 0, 3667? 1/4 Which is the nearest to 1? (a) 5 (b) -1 (c) -24 b What is the closest to 0 in 4, 1/4, -147? 1/4 Which is the nearest to 2? (a) 5 (b) -2 (c) 2/133 (d) -3 c What is the closest to 2/3 in 2, -15, -2, -4? 2 Which is the nearest to -2? (a) -2/15 (b) -2 (c) -5 b Which is the nearest to 0? (a) 0 (b) -4 (c) -3/7 (d) 25 a What is the nearest to -1/4 in 3, -0.1, -1? -0.1 Which is the nearest to -2/3? (a) 33 (b) -1/4 (c) -0.3 c Which is the closest to 1? (a) -2/7 (b) -3 (c) 0.3 (d) -1/11 c Which is the nearest to 2? (a) -0.1 (b) -1/4 (c) -3.2 (d) -0.2 a What is the nearest to 1/64 in 2, -0.2, -2/5, 5? -0.2 What is the nearest to -5 in 3/7, 3, 11, -0.5? -0.5 Which is the closest to 50/13? (a) -0.3 (b) 5 (c) 0.2 b What is the nearest to 0.05 in -0.07, 5, 6? -0.07 Which is the closest to -0.1? (a) -0.5 (b) -3 (c) 0 (d) -0.6 c Which is the closest to 0? (a) 4 (b) -2 (c) -2/5 (d) 5 c What is the closest to -0.9 in 2, -14, 2/7, 0.4? 2/7 What is the closest to 14 in 3/5, -1, 0? 3/5 What is the nearest to 3 in 1/14, -2/17, 0.03, 4? 4 Which is the closest to 1? (a) 2/39 (b) 0.5 (c) 26 (d) -0.3 b What is the nearest to -7.6 in -1, -5, -4? -5 Which is the closest to -6/19? (a) -1 (b) 6 (c) 0.04 c What is the nearest to -2/7 in 2, -0.5, 3/4? -0.5 Which is the nearest to -1? (a) -46 (b) 5 (c) -1/6 c Which is the closest to 0.4? (a) -11 (b) 0.1 (c) 5 (d) -1/12 b What is the closest to 3 in -2/265, 0.4, 1? 1 What is the nearest to -2/11 in 2/9, -4/7, -3? -4/7 Which is the nearest to 1? (a) 4 (b) 0.2 (c) -5 b What is the closest to -3 in -0.03, -0.7, -0.5, -0.3? -0.7 What is the nearest to 0.7 in 4/5, 0.5, -2, -1? 4/5 Which is the closest to -10? (a) -2 (b) 4 (c) -3/5 a What is the nearest to 0.1 in -1.2, -1/3, -1, -4/9? -1/3 What is the nearest to -16 in -1/10, 0.2, -3/2, 3/2? -3/2 Which is the nearest to -2? (a) -0.1 (b) -5 (c) 4 (d) -2/5 d Which is the closest to -1? (a) 47 (b) 3 (c) 0.3 c Which is the closest to 1? (a) -0.5 (b) -3 (c) 0.5 (d) -61 c Which is the nearest to -42? (a) 4/3 (b) 0.4 (c) 13 (d) 5 b Which is the closest to 1? (a) 620 (b) -2/3 (c) 2/11 c What is the nearest to 1 in -2, 10, -14, 1/5? 1/5 Which is the closest to -1? (a) 4 (b) -1 (c) 5 (d) -0.2 b Which is the closest to -5/4? (a) 0.3 (b) 0.1 (c) 6 b What is the closest to 1 in 2, -11, 1/2, 3? 1/2 Which is the closest to -2? (a) 0.4 (b) -2/9 (c) 1 (d) 8/39 b What is the nearest to 5 in 0.5, 0.1, -8? 0.5 Which is the closest to 18? (a) -0.2 (b) -0.4 (c) 0.1 (d) 4 d What is the nearest to -1/4 in -51, 0.3, 4? 0.3 Which is the closest to 163/6? (a) -2 (b) 2/29 (c) 0 b What is the nearest to -0.1 in 95, 0, 2, 2.1? 0 What is the nearest to -2 in 9, 0.8, 1/4, -1? -1 What is the nearest to 80 in -4, 4, 1/4, 1? 4 Which is the closest to -3/2? (a) 0.3 (b) -2 (c) 1 b Which is the closest to -0.2? (a) -10 (b) 5 (c) 0.5 (d) -18.4 c Which is the nearest to -1/2? (a) 5 (b) -5 (c) -0.1 (d) -37 c What is the nearest to 4 in -0.8, -0.3, -4? -0.3 Which is the nearest to -5? (a) -10 (b) 2 (c) -3/2 (d) -4 d Which is the closest to 0? (a) 7 (b) -0.1 (c) 24 b What is the nearest to 0 in 5, 2.7, 2/15? 2/15 Which is the closest to 2/7? (a) -2/11 (b) 2/15 (c) 11 (d) -1/3 b What is the nearest to 1 in 2, -5.3, -0.1, -1? 2 What is the nearest to -2/15 in 0, -1.2, -3? 0 Which is the closest to -1/3? (a) -2/3 (b) -1/2 (c) 2 (d) 3 b What is the closest to 1/4 in 38, 4, 2/9, -3/5? 2/9 Which is the nearest to 0? (a) 0 (b) -2 (c) -11/17 a What is the closest to 1/4 in 0.4, 95, -19? 0.4 Which is the nearest to 2/7? (a) 0.05 (b) 2/3 (c) 2/5 (d) -5 c What is the closest to 0.3 in -5, 4, -3/2? -3/2 What is the nearest to -7 in 0.4, 0, -4, -2? -4 Which is the nearest to 2/9? (a) 29 (b) 1 (c) -2/3 b Which is the nearest to -5? (a) 5 (b) 4 (c) 51 b Which is the closest to -0.1? (a) 4 (b) -0.1 (c) 14 (d) -0.3 b What is the closest to 0 in 3, 0.08, 0.4? 0.08 What is the nearest to -123 in -0.4, 2/17, 13? -0.4 What is the nearest to 12 in 0.3, 1.2, 5? 5 Which is the nearest to -1? (a) 1 (b) -2/9 (c) 0.2 (d) -374 b Which is the nearest to 20? (a) -4/5 (b) -21 (c) -2/7 c Which is the closest to -2? (a) 5 (b) -0.5 (c) 1 b Which is the closest to 1159? (a) 8 (b) 3 (c) -1/4 a What is the nearest to 8 in -1/2, -0.1, -5/4, -24? -0.1 What is the closest to 26 in 3, -11, 1? 3 What is the closest to 888 in 2/13, -3, 3/8? 3/8 What is the closest to 0.02 in -0.17, -4, -3/5? -0.17 Which is the nearest to 0.169? (a) -0.3 (b) 3 (c) 0.4 c What is the nearest to -1/2 in 1/3, 2, -1/9, -0.2? -0.2 Which is the nearest to -1/5? (a) -5/4 (b) -0.4 (c) -0.3 (d) 1 c Which is the nearest to 0? (a) -5 (b) -5.42 (c) 1/4 (d) 1 c Which is the nearest to -1? (a) 6 (b) 0.1 (c) -31 (d) -2/7 d Which is the closest to -1/4? (a) -5 (b) -2 (c) -10 (d) 2/15 d Which is the closest to -1/2? (a) 1 (b) 20 (c) 2/5 (d) -1/4 d What is the closest to -4 in -1/25, -8, -2? -2 What is the nearest to 0.5 in 18, 3, -4, -0.3? -0.3 Which is the closest to 2/7? (a) -1 (b) 1 (c) -3/2 (d) -4 b Which is the closest to -20? (a) -5 (b) 5 (c) 3 (d) 1 a Which is the closest to -25? (a) 1/2 (b) -0.3 (c) 0.1 (d) -9/2 d What is the closest to 2 in 2/11, 0.5, 2/7, -2/9? 0.5 Which is the nearest to -1? (a) -0.05 (b) -3 (c) -0.02 (d) 5 a What is the nearest to -0.06 in -5, 8, -0.1? -0.1 What is the nearest to 1 in -80, 0.2, 4? 0.2 Which is the closest to -91? (a) -6 (b) -0.2 (c) 5 a Which is the closest to 2? (a) -3 (b) -3/5 (c) 365 (d) -0.4 d Which is the closest to 29? (a) -0.5 (b) 81 (c) -2 a Which is the closest to -5? (a) -2/31 (b) 1/5 (c) -5/2 c Which is the nearest to -1/2? (a) 989 (b) -1/4 (c) -3/2 (d) -5 b What is the nearest to -1 in -4, 1.5, 4, -2/5? -2/5 Which is the closest to 2? (a) -14 (b) 0.1 (c) 0.4 (d) -26/7 c Which is the nearest to 0? (a) -0.2 (b) -5 (c) -1/3 (d) -210 a What is the nearest to -1 in -3, -2/151, -1/6, -0.1? -1/6 Which is the nearest to 0.04? (a) 1 (b) -2/9 (c) 2 b What is the nearest to 0.1 in -3, 3, 1/5, 887? 1/5 What is the closest to 5 in -5, 0.3, 4? 4 Which is the nearest to -2? (a) 3.1 (b) -5 (c) 0.2 (d) -1/4 d	{ "pile_set_name": "DM Mathematics" }
me factors of r(3). 2, 5, 7 Suppose -74318 - 36166 = -11k. What are the prime factors of k? 2, 3, 31 Suppose 1004 = 24a - 20a. Suppose -24t = -15131 + a. What are the prime factors of t? 2, 5, 31 Let n = 65 + -68. Let z be (-61)/(4/(-24)3) - n. Let f = z - 96. List the prime factors of f. 29 Let z = 33 - -45. Let x = -66 + z. Suppose xr = 13r - 49. List the prime factors of r. 7 Let r be (120/25)/(-24) + (-16)/(-5). Let f(n) = 29n*2 + 2n + 2. Let b be f(3). Suppose -rw + 559 = -b. List the prime factors of w. 2, 3, 23 Let y(u) = -7u + 4. Let o(d) = 21d - 12. Let q(x) = -6o(x) - 21y(x). What are the prime factors of q(15)? 3, 101 List the prime factors of 8282/5(-13 - 155/(-10)). 41, 101 Let l = -1357 + 4407. What are the prime factors of l? 2, 5, 61 Let m(d) be the second derivative of d*4/6 + 77d*2 + 222d. Let p be (-2)/(-10) + (-1)/5. List the prime factors of m(p). 2, 7, 11 Let o(g) = -2g + 14. Let b(y) = -y + 26. Let u(r) = 3b(r) - 7o(r). List the prime factors of u(7). 3, 19 Let z = 298 + -370. Let a = z + 375. List the prime factors of a. 3, 101 Suppose -11r = -1644 + 104. Suppose -2f = -3p - r, -3f = -10p + 5p - 208. Let c = -28 + f. List the prime factors of c. 2, 3 Let z(h) = -h2 - 2h + 3. Let j be z(-2). Suppose x - 416 = -jx. Suppose n = 4n + 3u - 252, n - x = -5u. What are the prime factors of n? 79 Let b(x) = 74x - 11x - 122 + 63x - 339. What are the prime factors of b(18)? 13, 139 Suppose 7w - 6w - 221648 = -27w. List the prime factors of w. 2, 1979 Suppose n = -4u + 3, -5n + 3u - 1 = -39. Suppose -2 + n = h. Suppose v = 3k + 3v - 371, hv + 222 = 2k. List the prime factors of k. 11 Let c be 1/((-6)/(-20) - 3/(-15)). What are the prime factors of -5 - (-3 - 1351)/(4/c)? 2, 3, 7 Let n(v) = 9v*2 + 4. Let p = -17 + 23. Suppose -p = 3i - i, -5q + 5i = -25. List the prime factors of n(q). 2, 5 Let p(k) = -3723k - 3347. What are the prime factors of p(-7)? 2, 41, 277 Let o = 21 + -23. Let k be (-47)/o - (5 - -1)/(-12). Let j = -20 + k. List the prime factors of j. 2 Suppose j + 3 = -2j. Let b(v) = -16v3 - v2 - 5v + 6v + 0v + v*2. What are the prime factors of b(j)? 3, 5 What are the prime factors of (3348 + 7)7/7? 5, 11, 61 Let c be 138/(1 + ((-180)/(-35))/(-6)). Suppose 0 = 2y + 5y - c. List the prime factors of y. 2, 3, 23 Let n(i) = i*2 + 9i + 14. Let h be n(-6). Let t = h - -153. List the prime factors of t. 149 Let y be 19/6 - -21/(-12). Suppose -5j = -3u + 84, 3u - yj - 18 = 66. Let p = u + 42. List the prime factors of p. 2, 5, 7 Let c be ((-50)/(-30))/((4/2)/6). Suppose -cs = 4s - 675. List the prime factors of s. 3, 5 Let h be (144/20 + -2)/(1/70). Let a = h + -67. List the prime factors of a. 3, 11 Suppose -220h + 56h + 7293244 = 0. List the prime factors of h. 7, 6353 Suppose 8l + 3244 = 3n + 13l, -l = -5n + 5360. Let v = n + -617. List the prime factors of v. 2, 3, 19 Suppose 0 = -183c + 3038187 + 4196169. List the prime factors of c. 2, 9883 Let t = 12020 - 6531. List the prime factors of t. 11, 499 Suppose 4u - 1047 = -5q, -2u + 9 = -5q + 1068. What are the prime factors of q? 211 Suppose -1182518 = -54o + 491342 + 527666. What are the prime factors of o? 59, 691 Suppose 0 = -3k + s - 68, k + 0k + 8 = 4s. List the prime factors of 2240/12 - (-16)/k. 2, 3, 31 Let t = -68271 - -117830. List the prime factors of t. 49559 Suppose 0 = 4s, -3x = 5s - 12 - 39. Let c(k) = k3 - 18k*2 + 20k + 46. What are the prime factors of c(x)? 97 Let j be (16 + -15)1433/1. Suppose -14q - j + 9021 = 0. List the prime factors of q. 2, 271 Let j(i) = -2i + 2i*2 + 2i + i - 6i3 + 5i3. Let b be j(3). Let s(o) = o3 + 14o2 + 10o - 2. What are the prime factors of s(b)? 2, 113 Suppose 4m - m = -180. Let l = m - -109. Suppose l = -3d + 217. What are the prime factors of d? 2, 7 Let c be (-3376)/20 - -6 - (-3)/(-15). Let s = c - -215. What are the prime factors of s? 2, 13 What are the prime factors of (-15)/(-2)99116/710? 3, 349 Suppose 4j + 13 + 159 = 2l, 0 = l - 4j - 94. List the prime factors of 405 - ((-28)/(-13) - 12/l). 13, 31 Let m(h) = 4h2 - 6h + 1. Let x(y) = 4y2 - 7y. Let l(g) = -6m(g) + 5x(g). Let d be l(-3). Let v = d + 88. What are the prime factors of v? 43 Suppose -48x + 52x = 36, -5x + 294260 = 5d. List the prime factors of d. 19, 163 Suppose -s = 5o - 0 - 20, -4s = -4o - 8. Let c = 3481 - 3136. Suppose 0 = 5f - sm - c, -2m - 3 = -1. List the prime factors of f. 2, 17 Let x(f) = 94426f - 1891. What are the prime factors of x(1)? 3, 5, 31, 199 Suppose 9h - 80 = 6625. Suppose -g = -h - 440. List the prime factors of g. 3, 5, 79 Suppose -2z + 2 = 5h - 0z, -5z - 22 = -h. Suppose -1312 = -hc + g, 4c - 4g - 663 = 3c. What are the prime factors of c? 5, 131 Let r = -90 - -414. What are the prime factors of (5 + r)/(-55/(-75))? 3, 7, 47 Let x be 4/10 + (-85)/25-14. Let a = -44 + x. Suppose -d - 373 = -av, -5v - 4d = -221 - 219. List the prime factors of v. 2, 23 Suppose 0 = 2z + 7v - 3v + 1048, -2114 = 4z - v. Let o be z/(-7) + (-1)/73. Suppose -j = -o + 24. What are the prime factors of j? 3, 17 Let k(z) = -z - 8. Let v be k(-13). Suppose 0 = -vy - 3y + 4y. Suppose -w = 5s - 64, 5w + ys - 266 = 2s. List the prime factors of w. 2, 3 Suppose 104 = 4h - 516. Suppose -215z + 103z = -107z - 445. Let v = h - z. What are the prime factors of v? 2, 3, 11 Let b(c) = -2c - 2c + 2c + c*2 + 56. Let n(w) = 6w + 306. Let p be n(-51). What are the prime factors of b(p)? 2, 7 Suppose 0 = -2i - 3m + 12386, -1887i + 1882i - m = -30926. List the prime factors of i. 2, 773 Let x be (4/3212)/(6/16). Let t(p) = p3 + 14p*2 + 13p + 1. Let h be t(-13). Suppose -xf = -5f - h, -2w + 4f = -240. What are the prime factors of w? 2, 59 Let z(w) = 7w2 - 10w + 17. Let d be z(5). Suppose -166 - d = 4y. Let k = y - -165. What are the prime factors of k? 2, 11 Suppose -46299 + 114475 = 2i - 4k, 4k - 24 = 0. What are the prime factors of i? 2, 5, 11, 31 Let j(x) = 15x - 23. Let b(y) = -y - 1. Let z(i) = -2b(i) + j(i). List the prime factors of z(17). 2, 67 Suppose z = 2w - 5422, 5w - 2w - 5z - 8126 = 0. What are the prime factors of w? 2, 3, 113 Let m(r) = 331r + 52. What are the prime factors of m(9)? 7, 433 Let a(n) = -2n*2 + 11n - 9. Let t be a(4). Suppose td - 1430 = -137. Suppose 5z - d = -r - 0r, 5r = 3z - 281. What are the prime factors of z? 3, 29 Let u(t) = -t2 + 27t + 61. Suppose 0 = -3y - 3d - 46 + 109, -3y + 5d + 95 = 0. List the prime factors of u(y). 3, 37 Let h = 322 + -318. Suppose -4t = -hm - 3660, t - 3628 = -3t - 4m. What are the prime factors of t? 911 Suppose -236954 - 630286 = -55r. What are the prime factors of r? 2, 3, 73 Suppose 2g - 9390 = -3188. Suppose 0 = 5z - k - g - 1615, 0 = 3k - 12. List the prime factors of z. 2, 59 Suppose 34388 - 12220 = 4i + 2o, 3i + o = 16625. What are the prime factors of i? 3, 1847 Let k = 175 + -152. Suppose 11486 = kt - 3418. List the prime factors of t. 2, 3 Suppose 0 = 3g + 128 - 125, 4q - 2g - 15650 = 0. What are the prime factors of q? 2, 3, 163 Let r be 28/(-182) - 15/(-13). Let x(w) = -2 + r + w - 217w*3 + 399w*3. What are the prime factors of x(1)? 2, 7, 13 List the prime factors of 2/((-6018)/8069934(-2682)/2 + -1). 61, 1297 Suppose -2a + 9q - 10q + 20372 = 0, 2q = 4a - 40752. What are the prime factors of a? 61, 167 Suppose -14f = -5f + 774. Let c = -67 - f. List the prime factors of c. 19 Let x(n) = -n3 - 20n*2 - 21n - 37. Let t be x(-19). Let l be (-3)/t5/(45/6). List the prime factors of (-1(7 - l))/((-4)/92). 3, 23 Let w = -190 - -194. Suppose -o - 1 - w = 0, -3y + 612 = 3o. List the prime factors of y. 11, 19 Suppose -2o - 6o = 2o. Suppose -v + 239 + 65 = o. List the prime factors of v. 2, 19 Let k(p) = -3p + 11. Let q be k(5). List the prime factors of q + 437 - (-70)/10. 2, 5, 11 Let f = 108 + -106. Suppose -fm + 597 = 3i, 0m + 299 = m + 2i. What are the prime factors of m? 3, 11 Let j = 8353 - -18503. What are the prime factors of j? 2, 3, 373 Let m(z) = -z*2. Suppose -4 + 14 = 2r. Let g(s) = -9s2 + 4s - 7. Let i(x) = r*m(x) - g(x).	{ "pile_set_name": "DM Mathematics" }
-4 - h4 + hn + 11h4 wrt h. 44h*3 Let g(q) be the second derivative of -253q*4/12 - 91q*3/6 - 2q + 179. Find the second derivative of g(s) wrt s. -506 What is the second derivative of -10l4 + 1041l - 704l + 45l*2 - 45l*2 wrt l? -120l*2 Let f(i) = -1 - 14i + 19i2 + 7i + 8i. Let k be f(1). Differentiate -11b*4 + 8 + 4 - k wrt b. -44b*3 Let b be (-4 - (-3 + -3)) + 0. What is the third derivative of -2wb - w4 + 3w2 - 3w*2 wrt w? -24w Let a = -542 - -921. What is the third derivative of -37d2 + 414d*6 - 2d*2 - ad*6 - 11d*2 wrt d? 4200d3 Let q(t) = t2 - 12t + 3. Let r be q(12). Find the second derivative of 19y + 3yr - 16y - y*3 wrt y. 12y Suppose -2g = -6g. Let j be (0 + g + 1)2. Find the third derivative of -13d - 3dj - d2 + d4 + 13d wrt d. 24d Let f = -76 + 80. What is the second derivative of -12m + 11m - f + 4 - 20m*5 wrt m? -400m*3 Let f(x) be the second derivative of -137x*3/6 + 153x*2/2 + 30x - 3. Differentiate f(c) with respect to c. -137 Let i(a) = -86a5 - 5a*4 + 5a*3 + 142a + 5. Let u(y) = y5 + y4 - y*3 + y - 1. Let c(x) = i(x) + 5u(x). Find the second derivative of c(m) wrt m. -1620m3 Let z(v) be the third derivative of 0v + 0v3 - 5/8v*4 + 0 + 6v*2 + 1/5v*5. Find the second derivative of z(n) wrt n. 24 Let d(j) = 2j*2 + 14j. Let r be d(-6). Let l(v) = -102v2 + 78. Let c(o) = -41o*2 + 31. Let x(y) = rc(y) + 5l(y). What is the derivative of x(i) wrt i? -36i Let f(s) be the second derivative of 0 + 0s2 + 13/6s*3 - 5s - 3/10s6 + 0s*5 + 0s*4. Find the second derivative of f(h) wrt h. -108h*2 Find the third derivative of -36n*3 - 130n*2 + 900 - 900 - 143n*3 wrt n. -1074 Let x(i) be the first derivative of -119i*3/3 + 5i*2/2 + 12i + 39. What is the second derivative of x(w) wrt w? -238 Let d(w) = -7w2 - w + 67. Let a(v) = -5v*2 - v + 66. Let f(k) = -6a(k) + 5d(k). What is the derivative of f(n) wrt n? -10n + 1 Let x(m) be the first derivative of 2m3 + 0m6 - m3 - 2m6 + 52 - 63. What is the third derivative of x(u) wrt u? -720u*2 Let b(l) = 3. Let j(n) = -49n - 2. Let q(h) = 12b(h) - 3j(h). What is the derivative of q(u) wrt u? 147 Let z(h) be the third derivative of -31h9/126 - h5/30 + 20h*3/3 + 201h*2. Find the third derivative of z(o) wrt o. -14880o*3 Let x(y) = 121y*3 - 8y*2 + 10y - 4. Let a(v) = -121v3 + 7v*2 - 13v + 3. Let w(k) = -4a(k) - 3x(k). What is the third derivative of w(c) wrt c? 726 Let w(t) be the third derivative of -83t7/105 + t5/30 + 97t*3/6 + 2t*2 - 67t. What is the third derivative of w(z) wrt z? -3984z What is the first derivative of -1640 - 135u + 3319 - 1602 wrt u? -135 Let a(y) be the second derivative of 47y5/20 - 19y*4/12 + 3y*2 + 60y. Find the third derivative of a(m) wrt m. 282 Let i(l) = l*3 - 5l*2 - 5l - 3. Suppose 0 = -4b + 5b - 6. Let n be i(b). Differentiate 3 - 6u + 3u - n - 2 wrt u. -3 Let f(o) be the third derivative of -22o7/35 + o5/60 + 5o*3/3 + 244o*2. What is the third derivative of f(t) wrt t? -3168t What is the second derivative of 230z2 - 484z - 89 + 242z + 243z wrt z? 460 Let j(o) be the first derivative of 27o4 - o3/3 - 37o*2 - 2o - 137. What is the second derivative of j(r) wrt r? 648r - 2 Let o = -10 + 5. Let n be (o + -1)/((-36)/24). What is the second derivative of -3d*4 + 0d - 4dn - 3d + 2d4 wrt d? -60d*2 Differentiate 23l*4 - 81 + 13l*3 + 13l*3 - 24l*3 wrt l. 92l*3 + 6l*2 Let p = -11 + 24. What is the first derivative of pa + 11a + 114 - 111 wrt a? 24 Let p(v) = -v2 - 14v - 22. Let x be p(-12). Find the third derivative of -11yx - 3 + 5y*3 + 2 + 1 wrt y. 30 Let x(i) be the second derivative of -57i8/56 - i6/15 - 45i4/4 + 4i - 9. What is the third derivative of x(h) wrt h? -6840h3 - 48h Let r(i) = -i*3 + 4i*2 - 3i. Let y be r(2). Suppose 2 = -t - s + 3s, 0 = yt - 5s + 6. Find the first derivative of 0o*2 - 2o*2 - 3 - 2o*t wrt o. -8o Let o(p) be the second derivative of -209p5/20 + 243p*2/2 + 252p. Differentiate o(h) wrt h. -627h2 Let y(s) = 136s*2 + 12s + 43. Let i(q) = -135q2 - 10q - 41. Let w(t) = 6i(t) + 5y(t). What is the derivative of w(b) wrt b? -260b Let t(m) be the third derivative of m5/12 + 7m*4/12 - 457m*3/6 - 162m*2. Differentiate t(b) wrt b. 10b + 14 Let h(f) be the second derivative of 343f4/12 - 155f*2 - 494f. What is the derivative of h(q) wrt q? 686q Let j(v) be the first derivative of 10v6/3 - v5/5 - 127v3/3 - 92. What is the third derivative of j(u) wrt u? 1200u*2 - 24u Let b(l) = 39l - 169. Let m(p) = -74p + 340. Let d(s) = 14b(s) + 6m(s). Find the first derivative of d(n) wrt n. 102 What is the third derivative of -6u2 + 108u*6 - 6u - 3u2 + 7u - 7u2 + 6u*6 wrt u? 13680u*3 Suppose 103 = 4d + 3. Suppose 4n = -n + d. Differentiate 3c*3 + n - 5c*2 + 5c*2 wrt c. 9c*2 Let o(s) be the first derivative of 23s*5/10 - 25s*3/6 - 51s - 47. Let t(c) be the first derivative of o(c). Find the second derivative of t(m) wrt m. 276m Differentiate 44w + 18 + 14w + 19w wrt w. 77 Let n(t) = -22t5 + 5t*4 - 5t*3 + 4t*2 - 19t. Let r(k) = k5 - k4 + k3 - k2. Let c(i) = n(i) + 5r(i). Find the third derivative of c(x) wrt x. -1020x2 Let q be 33/(-22) + 9/2. Find the second derivative of -w3 + 7wq - 5w + 14w wrt w. 36w Let c(r) be the second derivative of -57r8/56 - 7r4 + r3/6 - 7r. Find the third derivative of c(l) wrt l. -6840l*3 What is the derivative of -172x + 80 + 207 - 170 wrt x? -172 Let w = 54 - 50. Differentiate 19 + 6p4 + 1 + 0pw + p4 wrt p. 28p3 Let g(v) be the second derivative of 112v*3/3 - 277v*2 + 477v. Find the first derivative of g(b) wrt b. 224 Let j(x) be the third derivative of -59x5/10 + 77x*3/3 - 26x*2 + 9. What is the derivative of j(r) wrt r? -708r Let j(f) be the first derivative of -28f6 - 14f*3 - 297. What is the third derivative of j(c) wrt c? -10080c*2 Let y(a) be the second derivative of -757a*5/20 + 223a*3/3 + 7a - 21. Find the second derivative of y(s) wrt s. -4542s Let s(p) be the second derivative of 0p*5 + 0p*2 + 0p*6 - 4/3p*3 + 0 - 9p - 1/7p7 + 0p*4. Find the second derivative of s(v) wrt v. -120v*3 Let l(k) = 1236k*4 - 16k*2 + 18k + 37. Let j(n) = -824n4 + 10n*2 - 12n - 25. Let a(m) = -8j(m) - 5l(m). Find the second derivative of a(w) wrt w. 4944w2 What is the third derivative of -909o*2 - 622o*5 + 153o*2 + 264o*5 wrt o? -21480o*2 Let h(n) be the second derivative of 0n*2 + 26n + 0n5 + 0 + 0n*3 - 4/5n*6 + 2/3n*4. Find the third derivative of h(l) wrt l. -576l Suppose 5u = 2f + 3 + 8, -5f - 2 = -4u. Suppose -u = v - 4v, 4v - 10 = -3d. Differentiate -40z + 40z - 2 - 4z*d with respect to z. -8z Let c = -7 + 0. Let u(n) = 2n2 + 9n + 10. Let y be u(c). Find the third derivative of ys5 - 2s*2 - 47s*5 + 8s*2 wrt s. -120s*2 Let z(n) be the third derivative of 0 + 0n*3 - 3/4n*4 + 0n + 0n5 + 4n*2 - 1/10n*6. What is the second derivative of z(j) wrt j? -72j Suppose 3k - 5k + 2 = 0. What is the derivative of -33j4 + 32j*4 - k + 14j*4 wrt j? 52j*3 Let u(f) be the second derivative of 123f5/10 - f4/6 - 101f2 - 80f. Find the third derivative of u(m) wrt m. 1476 Let b be 1314/45 - (-2)/(-10). What is the third derivative of -31t2 - 29t*3 - 26t*3 + bt*3 + 6t*2 wrt t? -156 What is the third derivative of -33t - 165t4 + 6t + 303t2 + 27t wrt t? -3960t Let f(h) = -109h + 29. Let d(m) = 110m - 30. Let j(y) = -4d(y) - 5f(y). Differentiate j(n) wrt n. 105 Let q(x) be the third derivative of -23x*6/8 + 29x*5/60 - 7x4/24 - x2 + 35x. What is the third derivative of q(g) wrt g? -2070 Let q(x) be the third derivative of 0x*5 + 0 + 0x*4 - 2x*2 + 0x + 0x6 - 4/105x*7 + 5/6x*3. What is the first derivative of q(b) wrt b? -32b*3 Let l be 35/(-24)(-80)/280. Let a(o) be the third derivative of 10o2 + 0o + 0 + 7/6o3 + lo**4. Find the first derivative	{ "pile_set_name": "DM Mathematics" }
Simplify -23sqrt(125)2. -60sqrt(5) Simplify -1(4(sqrt(2) + 1) - ((sqrt(8)/sqrt(4)-6)2 - sqrt(2))). -5sqrt(2) + 68 Simplify (-1(-2sqrt(700) + 4 + -2))*2. -80sqrt(7) + 2804 Simplify (sqrt(975)-1)/((sqrt(90)/sqrt(5))/sqrt(6)). -5sqrt(13) Simplify (1(sqrt(153) + 1sqrt(153) - sqrt(153)))/(sqrt(81)2). sqrt(17)/6 Simplify (2sqrt(28)-6)2. 4032 Simplify 3 + (0 + (1sqrt(99)1)/sqrt(9))2. 14 Simplify (3(-1sqrt(1862) - sqrt(1862))/((sqrt(22)1)/sqrt(11)))*2. 33516 Simplify (sqrt(832) + sqrt(832) + 1)-3. -48sqrt(13) - 3 Simplify -6(sqrt(5)-1)2 - (-1 + sqrt(5) + 4 + sqrt(5))2. -59 - 12sqrt(5) Simplify ((sqrt(75) + 1 + sqrt(75) - sqrt(75))*2 + sqrt(75))6 + 0. 90sqrt(3) + 456 Simplify 5 + 5 + (sqrt(125) + -5 + (sqrt(125) + 0 - sqrt(125)) + sqrt(125))2 + sqrt(125). -95sqrt(5) + 535 Simplify (2(0 + sqrt(425)1)6)2. 61200 Simplify (sqrt(2106)2)/(sqrt(36)/sqrt(2) + sqrt(18) + sqrt(2)). 18sqrt(13)/7 Simplify (-4 + (sqrt(684) + 0)2 + sqrt(684))-6-1. 36sqrt(19) + 4080 Simplify sqrt(65)/sqrt(5) + -1 + sqrt(13) + sqrt(104)/(-1sqrt(8)). -1 + sqrt(13) Simplify (((sqrt(100)2 + sqrt(100) - sqrt(100) - sqrt(100))/sqrt(10))/(sqrt(2)23 - sqrt(2)))*2. 1/5 Simplify (4sqrt(40)/(sqrt(72)/(sqrt(9)2)))2. 320 Simplify (sqrt(99)/(sqrt(45)/sqrt(5)) - sqrt(88)/(sqrt(24)/sqrt(3))) + -3. -3 Simplify (-3sqrt(19)3)2-2. -3078 Simplify ((sqrt(209) - (sqrt(209) - sqrt(209)1))2 + sqrt(209) + sqrt(209) - sqrt(209))/(1-2sqrt(11)). -3sqrt(19)/2 Simplify (-4 + 6sqrt(102)/((2sqrt(72))/sqrt(12)))2. -24sqrt(17) + 169 Simplify (-6(sqrt(500) + sqrt(20) + sqrt(20)))/sqrt(4). -42sqrt(5) Simplify 3 + (sqrt(19) + 0)*22. 41 Simplify (((sqrt(306) + 3sqrt(306))/sqrt(6))/(sqrt(3) - -5sqrt(18)/sqrt(6)))*2. 68/9 Simplify (sqrt(864)/sqrt(9))/(6sqrt(48)). sqrt(2)/6 Simplify 6(sqrt(5) - sqrt(45))5. -60sqrt(5) Simplify (-5 + sqrt(17) + -3)2 - -3sqrt(425). -sqrt(17) + 81 Simplify -5 + sqrt(15)/sqrt(3) + sqrt(45) + 4. -1 + 4sqrt(5) Simplify (-4 + (1 + sqrt(19))2 - sqrt(19)) + -1sqrt(2299). -10sqrt(19) + 16 Simplify (3 + (sqrt(825) - sqrt(825)2)/sqrt(11))*2. -30sqrt(3) + 84 Simplify (sqrt(550)/(sqrt(10)-1) + sqrt(55))/(sqrt(66)/(sqrt(24)/sqrt(4))). 0 Simplify (sqrt(13) - (2 + sqrt(13)))-4 + 4. 12 Simplify (sqrt(11) - (0 + sqrt(1100))) + 3 + -2. -9sqrt(11) + 1 Simplify (sqrt(539)-3 - sqrt(539)) + (1sqrt(539))2. -28sqrt(11) + 539 Simplify 2-2sqrt(11) + -5. -4sqrt(11) - 5 Simplify 2(sqrt(16)/sqrt(4))/sqrt(2)4. 8sqrt(2) Simplify -4-2sqrt(405) + -1. -1 + 72sqrt(5) Simplify (sqrt(60)/(sqrt(24)/sqrt(2)) + -5sqrt(20)/sqrt(4) + 4)*2. -32sqrt(5) + 96 Simplify (5sqrt(77)1 + sqrt(77) - sqrt(77))/sqrt(11). 5sqrt(7) Simplify ((sqrt(2736) - (-2(sqrt(2736) + sqrt(2736) + sqrt(2736) + (sqrt(2736) - (-1 + sqrt(2736)))) + sqrt(2736))) + 2 + -3)*2. 144sqrt(19) + 98497 Simplify sqrt(136)/(sqrt(72)1). sqrt(17)/3 Simplify (sqrt(2736) + (sqrt(2736) + 0)2 + sqrt(2736) + 2 + ((1 + sqrt(2736))-4 - sqrt(2736)) + sqrt(2736))2. -48sqrt(19) + 5468 Simplify ((sqrt(110) - (sqrt(110) + (sqrt(110) - -2sqrt(110)-1) + sqrt(110)))/(sqrt(40)/(sqrt(28)/sqrt(7))))*2. 0 Simplify 2 + sqrt(76)/sqrt(4)-5. -5sqrt(19) + 2 Simplify sqrt(85)/(sqrt(25)/sqrt(5)) - (sqrt(2448) + -2)2. -2452 + 49sqrt(17) Simplify (3 + 1 + sqrt(320) + sqrt(320) + -1 + -4 + -2)*2. -96sqrt(5) + 1289 Simplify 3 + ((5 + sqrt(1573))*2 + sqrt(13))-3. -4791 - 333sqrt(13) Simplify 5 + sqrt(280)/(1sqrt(10)) + -5-2sqrt(28). 5 + 22sqrt(7) Simplify ((sqrt(288) + -2)23 + sqrt(288))1. -132sqrt(2) + 876 Simplify -11sqrt(5) + 5. -sqrt(5) + 5 Simplify sqrt(33)/(sqrt(1584) + -2sqrt(1584)). -sqrt(3)/12 Simplify -2 + (sqrt(68)/sqrt(2))/sqrt(2). -2 + sqrt(17) Simplify ((sqrt(30)3 - sqrt(30))/sqrt(10) + 2sqrt(3)-2)*2. 12 Simplify 2sqrt(605) + sqrt(50)/(sqrt(10)-1). 21sqrt(5) Simplify (-4(sqrt(245) + 2) + sqrt(245)25 + sqrt(245))2. -784sqrt(5) + 12069 Simplify (sqrt(1600) + (sqrt(1600) - (sqrt(1600) + (sqrt(1600)2 - sqrt(1600)))))/(sqrt(200) - sqrt(200)-2). 0 Simplify (sqrt(1539) + -4 + 4 + sqrt(1539) - sqrt(1539)) + 3. 3 + 9sqrt(19) Simplify ((-2sqrt(847) + sqrt(7) + sqrt(7))-2)2 + 5. 11205 Simplify (1sqrt(65))/sqrt(5) + 1. 1 + sqrt(13) Simplify (sqrt(13) + sqrt(13)1 + 0)2 - sqrt(637)1. -7sqrt(13) + 52 Simplify -2(sqrt(160)/sqrt(4)5)/(sqrt(72)6). -5sqrt(5)/9 Simplify (sqrt(133) + 2-1sqrt(133) + sqrt(133))/((sqrt(70) + sqrt(70)2)/sqrt(10)). 0 Simplify -1 + 2(sqrt(50) + (sqrt(250)/sqrt(5))2). 10sqrt(2) + 99 Simplify -2((3 + sqrt(637))2 + -4). -1284 - 84sqrt(13) Simplify (sqrt(19) + -2 + 5)*2 - (sqrt(684) + 0). 28 Simplify (-5(sqrt(2299) + 3(sqrt(2299) - (sqrt(2299) + -1sqrt(2299)) - sqrt(2299)) - sqrt(2299) - sqrt(2299)))*2 + -3. 57472 Simplify ((-1sqrt(77))/sqrt(7) - sqrt(66)/sqrt(54)) + -2. -4sqrt(11)/3 - 2 Simplify sqrt(128) + (-4(0 + sqrt(128)))*2. 8sqrt(2) + 2048 Simplify -3(sqrt(17)-1)2 + ((0 + sqrt(272))2 - sqrt(17)) + -5. -sqrt(17) + 216 Simplify (sqrt(637) + -1)2 + -4(sqrt(156)/sqrt(48) - sqrt(13))*2. -15 + 14sqrt(13) Simplify ((sqrt(266)/sqrt(7) + sqrt(38))5)/((sqrt(16) + sqrt(16) + sqrt(144))/sqrt(8)). 2sqrt(19) Simplify -3(sqrt(76)/sqrt(4) + 2)-6. 36 + 18sqrt(19) Simplify -2 + sqrt(125) + 3. 1 + 5sqrt(5) Simplify 1sqrt(5)-5-2. 10sqrt(5) Simplify (sqrt(3) - sqrt(27)3)6. -48sqrt(3) Simplify (-2 + sqrt(147) - sqrt(147)) + 5 + 0. 3 Simplify (-2 + sqrt(162) + 4)2 + 2. 36sqrt(2) + 168 Simplify (sqrt(119) + (sqrt(119) - sqrt(119)33))/(sqrt(14)/sqrt(2)3). -7sqrt(17)/3 Simplify ((-3-5sqrt(35))/sqrt(7))*2. 1125 Simplify -4((sqrt(39)-2)/sqrt(3) - (sqrt(13) + (sqrt(65) + -1sqrt(65))/sqrt(5)))*2. -468 Simplify (sqrt(36)1)/sqrt(12) - (sqrt(3) - sqrt(12)-4). -8sqrt(3) Simplify -5 + sqrt(33)/(sqrt(27)/(sqrt(36)/sqrt(4))) + 3. -2 + sqrt(11) Simplify (sqrt(180) + 2(sqrt(180) + 1 - sqrt(180)) + sqrt(180) + -1)2. 24sqrt(5) + 721 Simplify sqrt(20)/(sqrt(16)2). sqrt(5)/4 Simplify sqrt(156)/(-3sqrt(1200)). -sqrt(13)/30 Simplify ((sqrt(243) + sqrt(243)1)2)*2. 3888 Simplify -1(sqrt(242) - (-3sqrt(242))2). -11sqrt(2) + 2178 Simplify 1 + (2sqrt(7))2 + 4 - (4 + (sqrt(847) - (-1 + sqrt(847)))). 28 Simplify (-5 + ((-1sqrt(130))/sqrt(10) - (sqrt(13) - -4sqrt(26)/sqrt(2))))2. 60sqrt(13) + 493 Simplify (sqrt(54)/sqrt(3) - sqrt(2) - sqrt(2))*2 - 61sqrt(2). -6sqrt(2) + 2 Simplify sqrt(28)/sqrt(4)1 - sqrt(7) - sqrt(84)/(sqrt(36)/sqrt(3) + sqrt(12)) - (4sqrt(63) + -1sqrt(700)). -5sqrt(7)/2 Simplify (sqrt(27)/sqrt(81) - (sqrt(48) + sqrt(48) + sqrt(2352)))*2. 11449/3 Simplify (sqrt(117) + (-3sqrt(117) - sqrt(117)))-3. 27sqrt(13) Simplify (sqrt(19) - (sqrt(19) + (2 + (-3 + sqrt(19) + sqrt(19) - sqrt(19)))*2)) + -6(sqrt(19) + 2). -32 - 4sqrt(19) Simplify (sqrt(68) + 1)2 - ((sqrt(85) + sqrt(85)-3)/sqrt(5) - sqrt(17)). 7sqrt(17) + 69 Simplify (sqrt(12)/(sqrt(4)-1) + (sqrt(3) - sqrt(3)2)1)-5. 10sqrt(3) Simplify (sqrt(20)-2)2-4-6. 1920 Simplify 5 + (sqrt(68) + -1 + -4)-5. -10sqrt(17) + 30 Simplify ((sqrt(17) - (sqrt(68)/sqrt(4) + 4)) + sqrt(68) + -3)2. -28sqrt(17) + 117 Simplify (3 + 4 + (sqrt(133)1)/sqrt(7)-1)*2. -14sqrt(19) + 68 Simplify -2 + sqrt(18) - (sqrt(36)/sqrt(6))/sqrt(3). -2 + 2sqrt(2) Simplify -1 + -2sqrt(1331) + 5. -22sqrt(11) + 4 Simplify (-5 + (sqrt(11) + -1 + sqrt(11))2 - (sqrt(396)1)*2)5. -1780 - 20sqrt(11) Simplify sqrt(24)/(sqrt(288) + -2sqrt(288) - sqrt(8)). -sqrt(3)/7 Simplify ((sqrt(1300) + -6(1 + sqrt(1300) - sqrt(1300)))4 + 5)*2. -1520sqrt(13) + 21161 Simplify (-4sqrt(500)-3)*2. 72000 Simplify (sqrt(11)13 - sqrt(55)/sqrt(5)2)*2. 11 Simplify ((1 + sqrt(2) + -2)-46)2. -1152sqrt(2) + 1728 Simplify (sqrt(99) + sqrt(99) + -3 + -5)5. -40 + 30sqrt(11) Simplify (sqrt(24)/sqrt(768) + -3sqrt(2)3)*2. 5041/32 Simplify sqrt(121)/sqrt(176)2. sqrt(11)/2 Simplify (-3((5 + sqrt(17) + sqrt(17))-6 - sqrt(17)))*2 + 4. 7020sqrt(17) + 33961 Simplify 3 + (sqrt(15) - sqrt(15)2)/sqrt(5). -sqrt(3) + 3 Simplify ((((sqrt(110) + sqrt(110)2 - sqrt(110))-1 - sqrt(110)) + sqrt(110))/sqrt(10))2. 44 Simplify (sqrt(11) - (sqrt(11) + -62sqrt(11)))5. 60sqrt(11) Simplify sqrt(209)/((sqrt(132)4)/sqrt(12))	{ "pile_set_name": "DM Mathematics" }
ut replacement from nmncvnvccffcncvc. Give prob of picking 3 v. 1/560 What is prob of picking 2 n when two letters picked without replacement from {r: 11, n: 5}? 1/12 Four letters picked without replacement from {u: 2, q: 8, c: 2}. What is prob of picking 1 u, 1 c, and 2 q? 112/495 What is prob of picking 1 g and 2 q when three letters picked without replacement from {g: 7, i: 2, q: 3}? 21/220 Four letters picked without replacement from {m: 2, f: 7}. Give prob of picking 2 f and 2 m. 1/6 Three letters picked without replacement from xnnnndnnnndnx. What is prob of picking 2 n and 1 d? 36/143 Calculate prob of picking 2 s when two letters picked without replacement from {s: 3, p: 5}. 3/28 Four letters picked without replacement from aaaaijaavavjjv. Give prob of picking 3 a and 1 v. 15/143 Calculate prob of picking 3 c when three letters picked without replacement from {c: 10}. 1 What is prob of picking 2 g and 1 l when three letters picked without replacement from glggmggggggggggmgggm? 2/19 Calculate prob of picking 1 v, 2 m, and 1 q when four letters picked without replacement from lqvmbvxqqqqmmvvq. 18/455 What is prob of picking 2 i when two letters picked without replacement from jvjjiijqj? 1/36 What is prob of picking 4 g when four letters picked without replacement from ggggggg? 1 Calculate prob of picking 1 t, 1 d, and 2 p when four letters picked without replacement from spdcdpst. 1/35 Calculate prob of picking 1 q, 1 j, and 1 b when three letters picked without replacement from bnnqnnbj. 1/28 Four letters picked without replacement from jegxgggjggjxgj. What is prob of picking 3 g and 1 j? 20/143 What is prob of picking 1 r, 2 g, and 1 u when four letters picked without replacement from {j: 1, b: 4, r: 1, u: 3, g: 4}? 18/715 What is prob of picking 1 a and 1 n when two letters picked without replacement from apnpapaaaaapppppa? 1/17 What is prob of picking 1 h, 1 s, and 2 p when four letters picked without replacement from spmuhpspuzzz? 2/165 Four letters picked without replacement from {w: 10}. What is prob of picking 4 w? 1 Four letters picked without replacement from qhhnhnqhrv. What is prob of picking 1 n, 1 q, and 2 r? 0 Two letters picked without replacement from ooslsssoxooslll. Give prob of picking 1 x and 1 l. 4/105 Calculate prob of picking 1 q and 3 l when four letters picked without replacement from {q: 4, x: 1, v: 3, h: 4, l: 7}. 35/969 Calculate prob of picking 1 d, 2 g, and 1 k when four letters picked without replacement from dgkgwd. 2/15 Two letters picked without replacement from oszovzvvkzzzzos. Give prob of picking 1 k and 1 o. 1/35 Two letters picked without replacement from hieiedderhrei. Give prob of picking 1 i and 1 r. 1/13 Two letters picked without replacement from {j: 2, n: 1, i: 3, p: 1}. What is prob of picking 2 i? 1/7 Four letters picked without replacement from {e: 7, f: 6}. What is prob of picking 4 e? 7/143 Calculate prob of picking 3 c and 1 e when four letters picked without replacement from {w: 1, c: 3, a: 1, e: 1, q: 1}. 1/35 Three letters picked without replacement from kasbh. What is prob of picking 1 h, 1 a, and 1 b? 1/10 Calculate prob of picking 1 r and 1 o when two letters picked without replacement from {q: 6, o: 4, r: 2}. 4/33 Calculate prob of picking 3 j when three letters picked without replacement from tutujtjjtjjjjjtj. 3/20 What is prob of picking 1 n and 1 a when two letters picked without replacement from nag? 1/3 Calculate prob of picking 2 c and 1 r when three letters picked without replacement from rrrccrcr. 15/56 Calculate prob of picking 1 d and 1 a when two letters picked without replacement from {a: 6, f: 1, d: 7}. 6/13 What is prob of picking 1 i, 1 d, and 1 t when three letters picked without replacement from {p: 2, i: 2, d: 3, t: 4}? 8/55 What is prob of picking 2 g and 1 j when three letters picked without replacement from gggjggggjgjgggggjgj? 455/969 Two letters picked without replacement from {k: 1, n: 1, u: 1, h: 3, a: 1}. What is prob of picking 1 u and 1 a? 1/21 Three letters picked without replacement from oooozozzoooo. What is prob of picking 1 z and 2 o? 27/55 Three letters picked without replacement from {t: 2, g: 8}. Give prob of picking 1 t and 2 g. 7/15 What is prob of picking 2 p and 1 s when three letters picked without replacement from {p: 7, s: 4}? 28/55 Three letters picked without replacement from nhbnnnnhbbmvhbn. What is prob of picking 2 h and 1 m? 3/455 Calculate prob of picking 1 z and 1 a when two letters picked without replacement from aaaz. 1/2 Three letters picked without replacement from {w: 3, l: 1, i: 4, h: 11}. Give prob of picking 3 h. 55/323 What is prob of picking 1 a and 2 y when three letters picked without replacement from ayyyaqaayayaa? 35/143 Calculate prob of picking 2 e when two letters picked without replacement from {e: 11, s: 9}. 11/38 Calculate prob of picking 2 e when two letters picked without replacement from {t: 1, i: 1, e: 3}. 3/10 What is prob of picking 1 q, 1 d, and 1 z when three letters picked without replacement from znzdnnyhnnzqznzd? 1/56 Calculate prob of picking 1 t and 1 z when two letters picked without replacement from kyyyztzzyk. 1/15 Three letters picked without replacement from tktkkkk. Give prob of picking 1 t and 2 k. 4/7 What is prob of picking 1 j and 1 u when two letters picked without replacement from {j: 2, f: 3, u: 5}? 2/9 Four letters picked without replacement from {z: 1, n: 2, m: 5, l: 2, t: 1, b: 2}. Give prob of picking 1 t, 2 b, and 1 l. 2/715 Two letters picked without replacement from {x: 2, i: 7, m: 3}. What is prob of picking 1 x and 1 m? 1/11 Calculate prob of picking 1 t, 1 n, and 2 k when four letters picked without replacement from {n: 5, t: 1, k: 2, d: 1}. 5/126 Two letters picked without replacement from meqqmgmqgegzqgkqmq. What is prob of picking 1 z and 1 k? 1/153 Four letters picked without replacement from bbcnkbncnb. Give prob of picking 1 n and 3 b. 2/35 Calculate prob of picking 2 p and 2 g when four letters picked without replacement from {y: 1, p: 5, d: 3, w: 1, g: 5}. 20/273 Three letters picked without replacement from vavcwvtv. What is prob of picking 1 v, 1 c, and 1 t? 1/14 Calculate prob of picking 1 w and 1 l when two letters picked without replacement from wkwkl. 1/5 Four letters picked without replacement from {j: 1, t: 12}. Give prob of picking 1 j and 3 t. 4/13 Four letters picked without replacement from {f: 2, v: 2, c: 3, r: 1, m: 12}. What is prob of picking 1 v, 1 c, and 2 f? 2/1615 Three letters picked without replacement from tbbtbbububbbttbtbbtt. What is prob of picking 3 b? 11/76 What is prob of picking 2 z when two letters picked without replacement from xxzxzzz? 2/7 Four letters picked without replacement from {a: 3, k: 4, c: 1, w: 5}. What is prob of picking 2 a, 1 k, and 1 w? 12/143 What is prob of picking 1 b and 1 g when two letters picked without replacement from {g: 6, c: 2, b: 2, n: 2, s: 3}? 4/35 Four letters picked without replacement from bjsbccccbtjsss. Give prob of picking 2 b, 1 c, and 1 s. 48/1001 Two letters picked without replacement from ryfrfffffffffffff. What is prob of picking 1 f and 1 r? 7/34 What is prob of picking 1 h and 1 t when two letters picked without replacement from hhhhhhhhhhth? 1/6 Calculate prob of picking 1 i and 1 n when two letters picked without replacement from jijjjijijnjjjnej. 1/20 Calculate prob of picking 2 e, 1 c, and 1 m when four letters picked without replacement from {u: 2, m: 2, e: 3, c: 2}. 2/21 Calculate prob of picking 2 y and 1 c when three letters picked without replacement from yfyyyccyffc. 2/11 Three letters picked without replacement from {s: 8, w: 6, h: 1, q: 1}. What is prob of picking 1 w and 2 s? 3/10 What is prob of picking 2 l when two letters picked without replacement from lllllll? 1 What is prob of picking 1 m and 1 e when two letters picked without replacement from {b: 5, m: 1, v: 1, t: 2, e: 7}? 7/120 What is prob of picking 1 v and 2 g when three letters picked without replacement from {v: 7, p: 1, g: 10}? 105/272 What is prob of picking 2 w when two letters picked without replacement from cccwwrrcrtr? 1/55 Two letters picked without replacement from cbccfbcfdbb. Give prob of picking 1	{ "pile_set_name": "DM Mathematics" }
- -5. What is the common denominator of -63/2 and (2 - q/(-18))-1? 6 What is the common denominator of (-7)/((-84)/(-81)) - 0 and -7/6? 12 Suppose 0 = 2t - 11t + 63. Calculate the least common multiple of t and 3. 21 Let q = -4 - -6. Calculate the smallest common multiple of q and 2/(-2)1 + 10. 18 Suppose 0v + 5c + 15 = 5v, -3c = 0. Calculate the smallest common multiple of 5/v + 3/9 and 22. 22 Suppose 2 = m - 0. Let z(y) = -2y3 + y + 1. Let s be z(-1). Suppose 79 = 4f - 5h, 3h + sh = 5f - 95. What is the smallest common multiple of f and m? 16 Let a = -2 + 2. Suppose 4g + 11523 - 4459 = a. Let s = g + 21211/12. Find the common denominator of s and 53/22. 132 Let h(p) = -11p + 28. Let b(w) = -5w + 14. Let y(o) = -13b(o) + 6h(o). Let g be y(-8). Let n = 12 + g. What is the lowest common multiple of n and 18? 18 Let i = 183461/66 - 8351/3. Find the common denominator of 53/4 and i. 44 Suppose 3j = -w + 46 - 12, 2j - 74 = -3w. Let u = 10 + 5. Suppose ui = 14i + 4. Calculate the lowest common multiple of w and i. 44 Suppose 2 = s - 2. Calculate the least common multiple of s and 6. 12 Suppose -4c + 8c = 8. Suppose -cl + 8 + 24 = a, -20 = -2l - 4a. What is the least common multiple of l and 1/(-1) - 27/(-3)? 72 Let c be (-6)/39 - 47638/1144. Let q = c - -622/11. What is the common denominator of q and (-30)/(-8)10/(-3)? 4 Suppose 45 = 4p - 35. Calculate the smallest common multiple of p and 22. 220 Let d be (-2)/(-4) + (-1)/(-2). Calculate the smallest common multiple of 1/d + 6/2 and 8. 8 Let o = 2003 + -1178. Let i be ((-8284)/30)/(2/6). Let r = o + i. What is the common denominator of -11/8 and r? 40 Suppose 0 = 2j + 3j - 50. Suppose 3o - 18 - 6 = 0. What is the lowest common multiple of o and j? 40 Let g = -55 - -1589/29. Let r = g + -1345/87. Find the common denominator of -21/4 and r. 12 Let s = 63245/16 - 3955. Calculate the common denominator of 47/10 and s. 80 Suppose -4q + 9 = y - 6y, q - 4y = -6. Let r = -122545/22 - -5572. What is the common denominator of r and q/(-4) + (-20)/110? 22 Let c = -232 + 244. What is the least common multiple of c and ((-4)/(-3))/(1/12)? 48 Let d = -4/339 - -17333/3729. Find the common denominator of 44/9 and d. 99 Let h = 165 + -83. Suppose -3n + y = n - 65, 5n - y - h = 0. What is the smallest common multiple of 1 and n? 17 Let w be 0 + 2 + (0 - -34). Let k = w + -16. Calculate the lowest common multiple of k and 284/14 - (-2)/(-7). 20 Let x = 202 + -196. Let g(i) = i2 + 7i + 8. Let f be g(-7). What is the least common multiple of x and (f/(-2))/((-2)/6)? 12 Suppose 3m - 2i = 68, -3m + 65 = -3i + 4i. Calculate the least common multiple of m and 14. 154 Suppose -6u + 4u + 42 = 0. What is the smallest common multiple of 3 and u? 21 Suppose -4k + 2g = 4 - 2, 0 = -5k + g + 5. Suppose 8 = kl - 12. Calculate the least common multiple of 20 and l. 20 Let u = 8429/56 + -1155/8. Calculate the common denominator of 46(2 + 19/(-8)) and u. 28 Suppose 3o + 5b = 119, 0b + 3b = 5o - 153. Calculate the least common multiple of o and 9. 99 Suppose 13 = 5j - 27. Calculate the common denominator of (-5)/120114/j and 11/20. 160 Suppose 2p - 2z = 8, -3z = -5p - 2z + 24. Suppose -o = 3q - 45, -2q - 5o + 2 = -15. What is the lowest common multiple of q and p? 80 Let j(b) = -2b - 6. Let y be j(-4). What is the smallest common multiple of (3/y)/((-7)/(-84)) and 10? 90 Suppose -268 = -5a - 103. Suppose 3y = a - 12. Suppose 0k + 12 = 3k. Calculate the smallest common multiple of y and k. 28 Let c(z) = -z*3 + 2z2 - z. What is the lowest common multiple of 2 and c(-2)? 18 Let j = -7 + 11. Let c = j + 6. Calculate the smallest common multiple of c and 11. 110 Let r(l) be the second derivative of l4/12 + 5l3/6 - 2l. Let p be r(-5). Let x = 14 - p. Calculate the lowest common multiple of 6 and x. 42 Let x be -1 + 16/2 + -2. Suppose -3w = -m - 26, -xw + 34 = -0w - 4m. What is the least common multiple of w and 7? 70 Calculate the least common multiple of 6 and 2((-45)/(-6) - 4). 42 Let s = 430595867269951/3059691780 - 1156915260/8221. Let f = 2/18609 - s. Calculate the common denominator of f and -131/12. 60 Let m be 3/(264/(-2974))114. Let w = m + 3851. Find the common denominator of -25/8 and w. 88 Let m(p) = -p*2 + 8p + 2. Let l(b) = b2 + b. Calculate the least common multiple of l(3) and m(6). 84 Calculate the common denominator of 78/(-16) - 3/(-6) and (127/9)/(4/(-6)). 24 Let g(j) = j2 - 10j + 17. Calculate the smallest common multiple of g(9) and 58. 232 Let v be 4792024980/(-2396012515) - (-1 + -1). Let z = v - -20187363748481/4571591878620. Let l = -64/477 - z. What is the common denominator of l and -41/4? 20 Suppose 3 = -3d - 3, -2l + 40 = -5d. Let m = -11 + l. What is the smallest common multiple of 8 and m? 8 What is the smallest common multiple of 5 and (-396)/(-48) - (-2)/(-8)? 40 What is the common denominator of (-6)/21666/16 and 45/2? 14 Calculate the common denominator of -46/5 and (1/(-36))/((-2)/(-356)). 90 Suppose 0 = -s - 2w + 30, 0 = -4s - 0s + 3w + 164. What is the lowest common multiple of s and 10? 190 What is the common denominator of (-14)/(-42) - (-295)/6 and 55/6? 6 Suppose -3u - u + 4i = -28, i = -2u + 8. What is the least common multiple of 72/10 - (-1)/(-5) and u? 35 Suppose 0 = 5b - 4y + 161, 3b + 139 - 36 = -4y. Calculate the common denominator of ((-1)/5)/((-1)/b) and 41/11. 55 Let i(r) = -r3 - 5r*2 + 12r + 4. What is the least common multiple of 38 and i(-7)? 342 Suppose 1 = 4l - 3l. Suppose -4d + l = -3. What is the lowest common multiple of 11 and d? 11 Let a be -1 + (-844)/(-90) + -1. Let j = 20/9 + a. Calculate the common denominator of j and 1/2 + 2/(-12). 15 Let j = 43 + -41. What is the least common multiple of 4 and j? 4 Let a = 1/163 + 2769/326. What is the common denominator of -93/22 and a? 22 Let t = 80 - 72. Calculate the lowest common multiple of t and 29. 232 Suppose 5 = 2o - 3. Suppose 0 = d + 2g - 0g + 6, -od - 4 = 4g. Calculate the common denominator of (-60)/2d/18 and 62/3. 3 Find the common denominator of (-42)/(-20) - (1 + (-4 - 0)) and -79/10. 10 Suppose 2j - 3j = -8. Let h be 21((-4)/3 + 1). Let c = h + 8. Calculate the lowest common multiple of j and c. 8 Calculate the lowest common multiple of 0 - ((-3 - -3) + 2 - 30) and 8. 56 Let t be (-3)/6 - (-355)/18. Let i = 296/9 - t. Let o = 32969/2760 - 25/552. Calculate the common denominator of i and o. 30 What is the common denominator of 1/7 + (-711)/(-315) and -33/2? 10 Let p be (-4 - -2) + (0 - -394). Find the common denominator of 57/4 and p/(-105) - 2/(-5). 12 Suppose 0 = -2n - 5c + 24 - 8, -2c = -5n + 40. What is the lowest common multiple of 14 and n? 56 Let k be ((-10)/4)/(1/(-2)). Suppose 31 = -5c + 3z + 111, kc - 80 = 2z. Calculate the lowest common multiple of 2 and c. 16 Calculate the common denominator of (1/3)/(2/(-291)) and (-9)/(-12)(-202)/(-24). 16 Let l = 25 + -13. Let y(m) = -m2 + 14m - 18. What is the least common multiple of y(l) and 6? 6 Let o = 1/642 + -17497/1605. Calculate the common denominator of (1/543)/(-1) and o. 10 Let x = -7 - -5. Let i(k) = k2 - 2k - 1. Suppose -3g = -5g + 6. What is the lowest common multiple of g and i(x)? 21 Let w be 2/6 + 190/6. Calculate the common denominator of (w/(-6))/(44/(-30)) and (-83)/(-6) - (-2)/(-12). 33 Let r = 4 + 2. Let y(g) = -g*3 + 7g*2 - g - 8. Calculate the smallest common multiple of 12 and y(r). 132 What is the lowest common multiple of 5 + (-4)/8-70 and 8? 40 Suppose -3b - 425 = -4d, -2b + 3d + 306 = -4b. What is the lowest common multiple of (-4)/12 + b/(-9) and 10? 80 Find the common denominator of ((-34)/4)/((-20)/(-14)) and 21/22. 220 Let p(i) = -28i*2 + 5i - 5. Let g(s) = -83s2 + 14s - 14. Let l(m) = -6g(m) + 17p(m). What is the least common multiple of 32 and l(1)? 352 Suppose -34 - 50 = -4s. Calculate the smallest common multiple of 33 and s. 231 Calculate the common denominator of 89/38 and (-214)/(-12) + (-5 - -5)/(-2). 114 Let k = 8 - 4. Let o = 2 + 13. What is the common denominator of 39/8 and ((-366)/k)/(1o)? 40 Let z(c) = -2c*3 + 1. Let x be (-3)/12 - (-5)/4. Suppose -x	{ "pile_set_name": "DM Mathematics" }
Calculate the greatest common divisor of 2 and p. 2 Let p(f) = 4f + 7f*2 - 8f*2 + 3 + 2f + 1. Let q be p(6). Calculate the greatest common factor of 28 and q. 4 Let x be 4/(-4)2 + 5. Suppose -5h - 2w = w - 57, 0 = xh - 5w - 41. Let q = 16 - 10. What is the highest common divisor of q and h? 6 Let f(l) = l3 + 7l*2 - 9l - 4. Suppose 0 = -4i - i - 40. Let t be f(i). Suppose tb + 3 = 27. What is the greatest common factor of 6 and b? 6 Let i(d) = -d*3 - 6d*2 + 6d - 3. Let b = 12 - 19. Let q be i(b). Calculate the greatest common factor of q and 20. 4 Let z be (-2)/13 + (396/39)/1. What is the highest common divisor of 530 and z? 10 Let p be (0 + (-1)/(-3))/(2/24). Let j be (143/2)/(2/p). Calculate the greatest common divisor of j and 13. 13 Let p = 362 - -503. Calculate the greatest common divisor of p and 5. 5 Suppose -26 = 14k - 96. What is the highest common divisor of k and 160? 5 Let q(m) = 8m + 7m - 5 - 16m - 4. Let g be q(-12). Suppose -5z + 629 = -r - 198, -gr = 6. Calculate the greatest common factor of 15 and z. 15 Let c be -6(-85)/(-20)(-184)/69. Let q(m) = -m*3 + 4m*2 + 2m + 2. Let u be q(3). What is the greatest common divisor of u and c? 17 Let u = -573 - -590. Calculate the greatest common divisor of u and 323. 17 Let v(w) = w*3 - 17w*2 + 49w - 2. Let h be v(14). What is the greatest common factor of h and 480? 96 Let u(k) = -k*3 - 64k*2 + 4k + 286. Let g be u(-64). Calculate the highest common divisor of 610 and g. 10 Let y be (-14)/(-8) + 3/12. Let x(z) = -4z3 - 4 - 3z + 3z3 + 7z*y + z - 3z. Let q be x(4). Calculate the greatest common factor of q and 96. 24 Let m(n) = 0 - n*3 - n + 2n3 + n2 + 17. Let g be m(0). Let t(y) = 30y2 - 2y + 3. Let c be t(2). What is the highest common divisor of c and g? 17 Let u = 42 + -33. Suppose -5 = -5x + 5. Let j(p) = 8p + 2. Let r be j(x). Calculate the highest common divisor of r and u. 9 Let n(o) = -17o - 19o + 10o - 3. Let j be n(-9). Calculate the highest common divisor of j and 21. 21 Suppose -2 - 14 = -t. Let v = t - 8. Let z be 39 + 12/(v - 4). What is the highest common factor of z and 63? 21 Suppose f - 2f + 5s + 117 = 0, -226 = -2f + 2s. Let h be (0 - -1)/(3 - 235/80). What is the greatest common factor of h and f? 16 Suppose -4j + 6j = 6. Suppose -ju - 3 = 0, -5u + 2u = 2o - 17. What is the highest common divisor of o and 15? 5 Let w be (44/(-6))/(-116/696). Calculate the highest common divisor of w and 22. 11 Let r be (-3)/(-27) - (-64)/(-9). Let w(v) = 3v + 22. Let l be w(r). What is the greatest common divisor of 1 and l? 1 Let k = -1228 - -1635. Calculate the highest common factor of 111 and k. 37 Let x be (-32)/(-24) + (-3)/9. Calculate the highest common factor of 23 and x. 1 Suppose 4l - 185 = -l. Suppose -3f + 3985 = -2a, -2a = -0a - 8. Let r = f + -924. Calculate the greatest common factor of r and l. 37 Let n(p) = -p - 9. Let t be n(2). Let r be t/(-8 - -11 - (-1 - -5)). What is the highest common factor of 33 and r? 11 Let r = 0 - 3. Let m(v) be the second derivative of -v5/20 - v4/6 - v3/3 + v2/2 + 3v. Let b be m(r). What is the highest common factor of 32 and b? 16 Let r(c) = c2 - 11c + 1. Let q be r(7). Let w = q - -48. Let s = 21 - 7. Calculate the highest common divisor of w and s. 7 Let i be 4312/24 - (-2 - (-5)/3). Calculate the highest common divisor of i and 48. 12 Suppose 20 + 40 = -2f. Let q = -14 - f. What is the greatest common factor of 40 and q? 8 Let t = -1 - 3. Let h = 3 + t. Let u be (4 + h - 4) + 67. Calculate the greatest common factor of u and 6. 6 Let y = -439 + 490. What is the greatest common divisor of 1275 and y? 51 Let q(p) = 130p*2 + 897p + 7. Let y be q(-7). Let c = 23 + 124. Calculate the greatest common divisor of c and y. 49 Let t(z) = -12z + 3. Let o be t(2). Let g = -14 - o. Let j(v) = v3 - 6v*2 - 7v + 7. Let i be j(g). What is the greatest common factor of 7 and i? 7 Suppose 4i - 228 = -0i. Suppose -4v + i = 1. Let t(p) = -p3 - 5p*2 + 4p + 9. Let y be t(-6). What is the highest common factor of y and v? 7 Suppose 5s + 192 = x, -13 = s - 4x + 33. Let k = -22 - s. Calculate the greatest common divisor of 80 and k. 16 Let m = -124 - -156. What is the highest common factor of m and 32? 32 Let m = 0 - -12. Let n(y) = -2y3. Let o be n(-1). Suppose -od - m = -26. Calculate the highest common divisor of 28 and d. 7 Let v(t) = t*2 + 5t + 4. Let i be v(4). Suppose z - i = -3z. Calculate the greatest common factor of z and 25. 5 Let r(k) = 8k*2 - 4k. Let y be r(-3). Suppose 0 = 4b + 5u - 3u - 28, 5u - 21 = -3b. Calculate the highest common factor of y and b. 7 Let y = 1200 - 826. Suppose -3t + 166 + y = 0. What is the highest common factor of t and 10? 10 Suppose -127 = q + 14. Let x = 197 + q. Let g be (-16)/x + (-72)/(-7). What is the highest common divisor of 30 and g? 10 Suppose -89 - 19 = -d. Let v = -80 - -152. What is the greatest common divisor of v and d? 36 Let z be 0/1 + (81 - 0). Let t be 42(5 + -3)/4. Suppose 4n - 2s = 46, 4n + 0s + 3s - t = 0. What is the greatest common divisor of n and z? 9 Let z(w) = w*3 + 15w*2 + 8w + 4. Let o be z(-6). What is the greatest common divisor of 80 and o? 40 Suppose -25 - 29 = -3a. Suppose -89w - 9 = -90w. Calculate the highest common divisor of w and a. 9 Suppose 8 = o - 2. Suppose -2s = y - o + 3, s - 2 = -2y. Suppose -2u + 7 = w - su, -11 = -w + 4u. What is the greatest common factor of 12 and w? 3 Let t be 0 + (8/20 - (-133)/5). Suppose -4h - 11 = -47. What is the greatest common divisor of t and h? 9 Let m(f) = f3 - 4f*2 + 5f - 3. Let p be m(3). Suppose -po + 14 + 4 = 0. Let a be (-10 - 1)(-7 + o). What is the highest common factor of a and 11? 11 Suppose 10 = 6u - 8. Let x be (6 - u) + (1 - 1). What is the greatest common divisor of x and 1? 1 Suppose -4x + 273 = 97. Let z = 17 - x. Let h = -24 - z. Calculate the highest common divisor of h and 6. 3 Suppose -11n + 10n + 25 = 0. Suppose 7u = 80 + n. What is the greatest common divisor of 5 and u? 5 Let y = -12 + 13. Let z be 6/(-2)(y - 0). Let s be (1/z)/(2/(-120)). What is the highest common factor of 30 and s? 10 Let t be -6(-4)/(-3)-21. What is the greatest common factor of 24 and t? 24 Let i(a) = -a*3 + 4a*2 + 29a + 15. Let k be i(-4). What is the highest common divisor of k and 621? 27 Let g(y) = -30y + 48. Let r be g(-14). Calculate the highest common factor of 72 and r. 36 Let v be (-14)/(1665/(-549) + 3). What is the highest common divisor of v and 2? 2 Suppose 3 + 0 = z. Let s be -2 - (z - (326 + 3)). What is the greatest common factor of s and 36? 36 Let m(o) = 4o3 + 30o*2 - 59o - 14. Let a be m(-9). What is the greatest common factor of 3503 and a? 31 Let o = 1450 - 1390. What is the greatest common divisor of 12 and o? 12 Suppose 0 = -43h + 47h - 3328. Calculate the highest common divisor of h and 64. 64 Suppose 358 = 2v + 54. Suppose 4 = 4j - 4. Let y be 152/123/j. Calculate the greatest common divisor of y and v. 19 Suppose -3p = r - 16, 5r + 5p + 0p = 40. What is the greatest common divisor of 124 and r? 4 Let q = 288 + -231. Calculate the highest common factor of q and 399. 57 Suppose -c - 5c = 4c. Let p be 23 - (3 - c)/3. What is the highest common divisor of p and 44? 22 Suppose 18l - 22l = -12. Suppose 0 = 4z + y - 79 - 29, -ly = 12. Calculate the highest common divisor of 252 and z. 28 Let h be 3(4 - 5/(-15)). Let s(u) = 10u + 10. Let g be s(h). What is the highest common divisor of g and 20? 20 Suppose 2d + 2c + 1 = 5c, -5c = 2d - 23. Suppose dq - 63 = q. Calculate the greatest common divisor of q and 84. 21 Let o(q) = q + 103. Let j be o(-19). What is the greatest common divisor of j and 21? 21 Let d be (-165)/(-30) - (-3)/6. Calculate the greatest common factor of 27 and d. 3 Let a = 49 + -27. Let v = -4 + 4. Suppose v = 3w + 16 - 148. What is the greatest common divisor of w and a? 22 Let a = 26 + 0. Let x be 4/10 - 18/45. Suppose c + 4s - 47 = x, 6s - s - 166 = -4c. Calculate the greatest common factor of c and a. 13 Let a(z) = -z3 - 7z*2 + 8z + 2. Let v be a(-8). Suppose -vw + 334 = -4o, -7w + 2w + 4*o + 841	{ "pile_set_name": "DM Mathematics" }
5240296? 2, 3, 7, 11, 73, 433 List the prime factors of 161303526. 2, 3, 137, 149, 439 List the prime factors of 2236651476. 2, 3, 79, 337, 7001 What are the prime factors of 815146833? 3, 127, 2139493 What are the prime factors of 444339099? 3, 41, 1204171 What are the prime factors of 433919073? 3, 7, 1987, 10399 List the prime factors of 361922459. 10973, 32983 What are the prime factors of 115600044? 2, 3, 7, 1376191 What are the prime factors of 206457777? 3, 22939753 What are the prime factors of 23694812? 2, 1049, 5647 What are the prime factors of 1108954529? 1108954529 What are the prime factors of 1756826638? 2, 7, 83, 353, 4283 What are the prime factors of 553706765? 5, 47, 2356199 List the prime factors of 31430443. 11, 23, 124231 What are the prime factors of 277350787? 7, 39621541 List the prime factors of 210492105. 3, 5, 14032807 What are the prime factors of 776460810? 2, 3, 5, 239, 108293 What are the prime factors of 202709952? 2, 3, 39103 What are the prime factors of 3013839538? 2, 1506919769 List the prime factors of 2216434369. 139, 15945571 What are the prime factors of 950552147? 21937, 43331 What are the prime factors of 12864620? 2, 5, 643231 What are the prime factors of 100929470? 2, 5, 67, 97, 1553 What are the prime factors of 512766838? 2, 53, 4837423 What are the prime factors of 4570733816? 2, 11, 73, 711509 List the prime factors of 544379237. 544379237 List the prime factors of 2716891352. 2, 7, 37, 1311241 List the prime factors of 249988688. 2, 15624293 What are the prime factors of 56198439? 3, 11, 567661 What are the prime factors of 332846435? 5, 59, 1128293 What are the prime factors of 230144631? 3, 227, 331, 1021 List the prime factors of 304267870. 2, 5, 17, 127, 829 What are the prime factors of 28802596? 2, 31, 109, 2131 List the prime factors of 907987057. 10657, 85201 What are the prime factors of 47794722? 2, 3, 7965787 What are the prime factors of 4460030772? 2, 3, 53, 7012627 What are the prime factors of 3799749? 3, 1266583 What are the prime factors of 127179743? 9479, 13417 What are the prime factors of 253496706? 2, 3, 4877, 8663 List the prime factors of 389170529. 11, 35379139 List the prime factors of 3652332. 2, 3, 19, 83, 193 List the prime factors of 7727213. 13, 594401 What are the prime factors of 544889385? 3, 5, 41, 295333 List the prime factors of 2493048389. 13, 3049, 62897 What are the prime factors of 910092289? 67, 613, 22159 What are the prime factors of 1376395568? 2, 19, 757, 5981 What are the prime factors of 2227232080? 2, 5, 541, 51461 List the prime factors of 67290212. 2, 11, 31, 49333 List the prime factors of 119832251. 7, 11, 1556263 What are the prime factors of 18690148? 2, 19, 31, 7933 What are the prime factors of 332595948? 2, 3, 599, 46271 What are the prime factors of 727829232? 2, 3, 13, 1166393 List the prime factors of 122858423. 47, 563, 4643 What are the prime factors of 3518359026? 2, 3, 7, 13, 431, 14951 List the prime factors of 149446299. 3, 49815433 List the prime factors of 72524250. 2, 3, 5, 32233 List the prime factors of 19035643. 11, 31, 55823 List the prime factors of 143911222. 2, 7, 13, 17, 193, 241 What are the prime factors of 9925574? 2, 4962787 List the prime factors of 4389199268. 2, 71, 15454927 What are the prime factors of 114265789? 11, 17, 47, 13001 What are the prime factors of 3197370914? 2, 17, 431, 218191 What are the prime factors of 211229254? 2, 149, 708823 List the prime factors of 104306339. 17, 6135667 List the prime factors of 691629607. 173, 3997859 List the prime factors of 216227493. 3, 61, 393857 List the prime factors of 64749862. 2, 3511, 9221 What are the prime factors of 1712063264? 2, 53501977 List the prime factors of 165332709. 3, 18370301 List the prime factors of 43068075. 3, 5, 23, 24967 What are the prime factors of 9184080? 2, 3, 5, 17, 2251 List the prime factors of 5672697521. 257, 22072753 What are the prime factors of 146330074? 2, 11, 6651367 What are the prime factors of 1638775831? 7, 11, 21282803 List the prime factors of 6823479367. 19, 359130493 List the prime factors of 540226041. 3, 180075347 List the prime factors of 157527108. 2, 3, 653, 6701 List the prime factors of 45507839. 13, 1297, 2699 What are the prime factors of 122110709? 7, 1171, 14897 What are the prime factors of 365791839? 3, 7, 17, 23, 44549 What are the prime factors of 137688489? 3, 1093, 13997 What are the prime factors of 17770660? 2, 5, 888533 List the prime factors of 288006282. 2, 3, 17, 127, 7411 What are the prime factors of 1365390943? 7, 195055849 What are the prime factors of 173789524? 2, 151, 287731 List the prime factors of 135057655. 5, 27011531 What are the prime factors of 32803219? 491, 66809 What are the prime factors of 1143987497? 37, 30918581 List the prime factors of 4962357539. 907, 5471177 List the prime factors of 31685581. 103, 307627 What are the prime factors of 38032147? 173, 219839 What are the prime factors of 7850242926? 2, 3, 331, 439199 What are the prime factors of 164773471? 1303, 126457 What are the prime factors of 2076958? 2, 13, 17, 37, 127 What are the prime factors of 9562930? 2, 5, 13, 73561 List the prime factors of 124177399. 227, 547037 What are the prime factors of 495857395? 5, 11, 74509 List the prime factors of 1203904300. 2, 5, 17, 708179 What are the prime factors of 736918437? 3, 59, 4163381 What are the prime factors of 859067889? 3, 43, 6659441 List the prime factors of 2718782554. 2, 1359391277 What are the prime factors of 3190102950? 2, 3, 5, 29, 79, 9283 What are the prime factors of 1504734020? 2, 5, 29, 137, 653 What are the prime factors of 104486307? 3, 3181, 10949 What are the prime factors of 1812430536? 2, 3, 7, 61, 176857 What are the prime factors of 57409334? 2, 23, 31, 127, 317 List the prime factors of 85410953. 101, 845653 What are the prime factors of 1222438721? 7, 24947729 List the prime factors of 3670956774. 2, 3, 971, 2593 What are the prime factors of 22230672? 2, 3, 271, 1709 List the prime factors of 1159635796. 2, 11, 37, 59, 12073 What are the prime factors of 144057795? 3, 5, 7, 195997 What are the prime factors of 13211547? 3, 4403849 List the prime factors of 1266391349. 1266391349 List the prime factors of 44066553. 3, 14688851 List the prime factors of 1889262327. 3, 53, 79, 150407 What are the prime factors of 74200913? 74200913 What are the prime factors of 85245521? 23, 37, 109, 919 What are the prime factors of 131089427? 7, 61, 523, 587 List the prime factors of 22761858. 2, 3, 7, 23, 23563 List the prime factors of 130655250. 2, 3, 5, 11, 5279 What are the prime factors of 3655936542? 2, 3, 609322757 What are the prime factors of 489480829? 683, 716663 List the prime factors of 21680617. 7, 1303, 2377 What are the prime factors of 1110053850? 2, 3, 5, 151, 49009 What are the prime factors of 386907393? 3, 19, 6787849 What are the prime factors of 40088750? 2, 5, 13, 2467 What are the prime factors of 189527707? 31, 41, 3637 What are the prime factors of 348029199? 3, 7, 5524273 List the prime factors of 4172818. 2, 13, 19, 8447 What are the prime factors of 428354236? 2, 17, 127, 193, 257 What are the prime factors of 10927198? 2, 5463599 What are the prime factors of 514281657? 3, 171427219 List the prime factors of 14150219. 809, 17491 List the prime factors of 616083429. 3, 13, 31, 509581 What are the prime factors of 132709962? 2, 3, 7, 11, 287251 What are the prime factors of 34903535? 5, 23, 367, 827 List the prime factors of 240320364. 2, 3, 17, 1178041 List the prime factors of 1551789002. 2, 17, 45640853 What are the prime factors of 1414484073? 3, 52388299 List the prime factors of 34180969. 277, 123397 List the prime factors of 47858282. 2, 61, 392281 What are the prime factors of 623864584? 2, 7, 31, 59, 6091 List the prime factors of 2434165382. 2, 11, 110643881 What are the prime factors of 704375701? 704375701 List the prime factors of 4327998211. 719, 6019469 List the prime factors of 61253688. 2, 3, 71, 103, 349 What are the prime factors of 133804657? 7, 2549, 7499 What are the prime factors of 99709052? 2, 24927263 List the prime factors of 364214604. 2, 3, 13, 179593 List the prime factors of 13816213.	{ "pile_set_name": "DM Mathematics" }
derivative of -841do*3s + 296do*3 + 14do2s + do2 + 3dos + 95ds + 3d + 33o*4 - 19s + 9 wrt o? -5046ds + 1776d + 792o Find the third derivative of 222768778a3 - 147964246a*2. 1336612668 Find the third derivative of 87327066q*2t5 - q2t + 1278947qt2 + 8qt wrt t. 5239623960q*2t*2 What is the second derivative of 6303573k*2 + k - 1334809 wrt k? 12607146 Find the third derivative of 3v*4 - 106615393v*3 + 2443712v*2 + 1 wrt v. 72v - 639692358 Find the first derivative of 337086193m - 185458509. 337086193 What is the derivative of 103c*3p + 4c3 + 31493c*2p*3 + 5c - 12003 wrt p? 103c3 + 94479c*2p*2 Find the first derivative of 134g*2r*2 + 14353g*2 - gr + 8814r2 + 8r - 1 wrt g. 268gr*2 + 28706g - r What is the second derivative of 2264861g3 - 2150917g? 13589166g What is the first derivative of 100316500u*2 + 324592113? 200633000u Find the second derivative of 8621084i2 - 3089288i wrt i. 17242168 Find the third derivative of -30939l3y*4 + 1012l*3 + 12l*2y*5 + 3ly2 - 1811l wrt y. -742536l3y + 720l2y*2 What is the third derivative of -5964895n*3 - 12448398n*2? -35789370 Find the first derivative of 53alm + 7al + 70586am + 262a + 2lm + 3408l wrt l. 53am + 7a + 2m + 3408 What is the second derivative of 3g4 - 27g*3 + 1516g*2 + 139g + 34480 wrt g? 36g2 - 162g + 3032 What is the derivative of -3w3 + 1494006w*2 + 15792387? -9w*2 + 2988012w Find the third derivative of 41m3w3 + m3w + 4513m*2w*3 + 414363m*2w + 46mw*3 - 87w*2 wrt w. 246m*3 + 27078m*2 + 276m Find the first derivative of 57974667d4 - 133912068. 231898668d*3 What is the first derivative of -2710674n*4 - 4n*3 + 1172490433 wrt n? -10842696n*3 - 12n*2 What is the first derivative of -7k*3o - 616027k3 - 2k*2o + 3ko - 81113o wrt o? -7k*3 - 2k*2 + 3k - 81113 What is the first derivative of -3h2 - 28242236h - 272205728? -6h - 28242236 What is the third derivative of 160934p*5 + 3p4 + p3 - 105344p2 + 4 wrt p? 9656040p*2 + 72p + 6 What is the third derivative of 175685f6u - 69f6 - 375675f*2 - fu - u + 2 wrt f? 21082200f3u - 8280f3 What is the first derivative of 58ajp - 7592412aj + 8ap - 233030jp + 5j wrt p? 58aj + 8a - 233030j Find the first derivative of 89852c*2s - 27c2 + 4148374s + 1 wrt c. 179704cs - 54c Differentiate 156t*4 + 1270t*2 - 48t + 8966767 wrt t. 624t3 + 2540t - 48 Differentiate -39719352ow + 324493040o - w wrt w. -39719352o - 1 What is the third derivative of 11549381p2t*3 + 34p*2t*2 - 138477pt2 wrt t? 69296286p*2 Find the third derivative of -332460288p*3 + 166230p*2 - 96p. -1994761728 What is the second derivative of 2220k2s2 + k2s + 131k*2 - 4ks2 - 2ks + 2k + 5756s2 + 158s + 2 wrt s? 4440k2 - 8k + 11512 What is the second derivative of 1133731q5 + 2q*3x*3 + qx*3 + 78qx2 - 12q + 73x2 wrt q? 22674620q*3 + 12qx3 What is the first derivative of 5687889m*2 + 6m - 82041843? 11375778m + 6 Find the third derivative of -6758594s*3 + 13846513s*2. -40551564 What is the first derivative of 3065596a*2o*2 + 31443a*2 - 1 wrt o? 6131192a*2o Find the third derivative of 5361b4m - 168b4 + 11b*3m - 2b2m + 15b2 + 2bm + 2m + 576 wrt b. 128664bm - 4032b + 66m What is the second derivative of -2019659q2y*2 + 25242017q*2y - 2y2 wrt y? -4039318q*2 - 4 What is the derivative of 101419127t*2 - 139882126 wrt t? 202838254t Find the second derivative of 71760234b2 - 82504b - 245. 143520468 Find the first derivative of 79364399i2 + 795127064 wrt i. 158728798i Find the second derivative of -36996445d4 + 1119315d + 3 wrt d. -443957340d2 Differentiate 11487519k*2 + 2k - 56028720 wrt k. 22975038k + 2 What is the second derivative of -3332347o*2w*2 + 656o*2w + 3728o2 + w2 wrt w? -6664694o*2 + 2 Find the second derivative of 17205r*2t*2 - 3875r*2 - 3rt2 + 216rt - 18t*2 wrt t. 34410r*2 - 6r - 36 What is the third derivative of 79759404j6 - 2j*4 - 3018j*2 - 601 wrt j? 9571128480j*3 - 48j What is the second derivative of -1119040b2 - 5860380b? -2238080 Differentiate 99661288fr*2 - 40034625r*2 - 5 with respect to f. 99661288r*2 What is the second derivative of -182918j*5 + 11j*3l*3 + 4958672jl3 wrt j? -3658360j*3 + 66jl3 What is the second derivative of -128703629t*3 + 14482t - 1912 wrt t? -772221774t Find the second derivative of v5 - 5495346v*3 + 34338170v. 20v3 - 32972076v What is the third derivative of 5v5 + 18658417v*3 + 700v*2 + 66046 wrt v? 300v*2 + 111950502 Differentiate -9ad2 + 319ad - 1754a - 75725796d2 wrt a. -9d*2 + 319d - 1754 Find the second derivative of 4bdh2l*3 - bdl3 - 165353bh2 - 25bhl + 1277bl*3 - 2dh2l + 2dh - 2l2 wrt h. 8bdl*3 - 330706b - 4dl What is the first derivative of -183518900lo - 2083l + 41005 wrt o? -183518900l What is the second derivative of -659y4 - 4y*3 - 22014y*2 - 533922818y? -7908y2 - 24y - 44028 Find the second derivative of -681119794y2 - 815316y - 165. -1362239588 Find the third derivative of -486883516f3u*3 + 7f*3u - 26400974f2u*2 wrt u. -2921301096f*3 What is the third derivative of 1373lp3 + 595550144lp2 - 22224p*3 wrt p? 8238l - 133344 What is the derivative of -13h4 - 514652h + 31345626 wrt h? -52h3 - 514652 Find the first derivative of -103116u*2 - 54u - 30188672 wrt u. -206232u - 54 What is the second derivative of 14843336g*2 + 32401992g wrt g? 29686672 Differentiate -297q3 + 2183q*2 + 6q - 101146594 wrt q. -891q2 + 4366q + 6 What is the third derivative of 65b6 - 1647b5 - b3 - b*2 + 56b + 579? 7800b3 - 98820b*2 - 6 What is the second derivative of -26015km2 + kmo - 78ko + 29632k + 311m2o wrt m? -52030k + 622o What is the second derivative of -234066329g2h*2 - 193gh - 775050h*2 wrt g? -468132658h*2 Find the first derivative of 31o*3 + 1254120o + 15407926 wrt o. 93o2 + 1254120 What is the second derivative of 1730168l*5 - 1809516l wrt l? 34603360l3 Find the third derivative of 953379r*5 - 285r*3 + 5488r*2 - 14365r. 57202740r2 - 1710 What is the second derivative of 498451855w*2 - 185907907w? 996903710 Find the second derivative of -164n4 - 234200n*3 - 406n + 66105 wrt n. -1968n2 - 1405200n Differentiate 1656d4 - 2d3 + d2 + 80d - 3595777. 6624d*3 - 6d*2 + 2d + 80 Differentiate -1545786591c - 370128339. -1545786591 Find the first derivative of -2288l*3p*3 - 17000398l*3 + 2315p*3 wrt p. -6864l*3p*2 + 6945p*2 What is the derivative of -3897f*2 - 18986f + 20352071 wrt f? -7794f - 18986 What is the derivative of 9b*3 + 45782b*2 - 1436294? 27b*2 + 91564b What is the third derivative of -t*6 - 5705593t*4 - 16t*2 + 5801t + 11? -120t3 - 136934232t What is the first derivative of 3dw*3 + 39242596d + 229181135w3 wrt d? 3w*3 + 39242596 Find the first derivative of 467389627x - 826528154. 467389627 What is the third derivative of -104922607l4 - 2l*2 + 29193282 wrt l? -2518142568l What is the derivative of -81954119c3 + 109185666? -245862357c*2 What is the second derivative of 819253159g*3l*2 + 56145g*3 + 46g*2l - 15gl wrt l? 1638506318g3 What is the second derivative of 963733ho3y*2 - 34ho3y - 3ho - o*3y - 54867oy + 10y3 wrt y? 1927466ho3 + 60y Differentiate -5k2nz - 3004k*2 - 9816958knz + 2743kn + k wrt z. -5k2n - 9816958kn What is the third derivative of -jz3 - 201124jz2 - 2j + 214271023z3 - 2z*2 + 62z wrt z? -6j + 1285626138 What is the second derivative of -12043w*2y*3 + 5w*2y - w*2 + 207wy + 16w + 292y3 - 156 wrt y? -72258w*2y + 1752y Differentiate -8g*2n - 1027669gn - 2g - 8346163n + 20 wrt g. -16gn - 1027669n - 2 Differentiate 226t*3 + 1579934tu2 + 1033006u*2 + 36u with respect to t. 678t	{ "pile_set_name": "DM Mathematics" }
third derivative of -536j3 - 2749j*2. -3216 What is the third derivative of -10i*3uv3 + i3uv - 4i*3v3 - i2v3 - 4iuv*2 - 2iuv + iv2 wrt v? -60i*3u - 24i3 - 6i*2 Find the second derivative of 296q*2v*2 - 3q*2v - q*2 - 38 wrt v. 592q*2 What is the second derivative of 115z*5 - 2z + 5? 2300z3 What is the third derivative of 230n*5 - 98n*2 wrt n? 13800n*2 Find the third derivative of 9h*4n*2 - 3h*3nt3 - 5h*2nt3 + 2h*2t - 2n2t*3 wrt h. 216hn2 - 18nt3 What is the third derivative of lqr + 4lr3 + 18qr3 + 10q + 2r2 wrt r? 24l + 108q What is the second derivative of -26i*3w*2 - 2i*3w + i*3 + 2iw2 - 13iw - w2 wrt i? -156iw2 - 12iw + 6i Find the third derivative of 2952y5 - 2102y*2 wrt y. 177120y*2 Find the first derivative of 5453w*4 - 8836. 21812w*3 Find the third derivative of -165g*2h*4 - 2g*2h*2 - 2g*2 - 53gh2 - h6 wrt h. -3960g*2h - 120h3 What is the derivative of 45l*3 - 149lu3 + 4335u*3 - 2 wrt l? 135l*2 - 149u*3 Find the third derivative of -11a*6 + 11a*3 - 423a*2 + 6. -1320a*3 + 66 Find the first derivative of -3kt2 + ktv + 3kv + 315k + lt2v + l + 29t2v wrt v. kt + 3k + lt2 + 29t*2 Find the third derivative of 201j*6 + 96j*2 wrt j. 24120j*3 What is the third derivative of 161c*3q - 20c3z*3 - 11c*2qz3 + 3c*2qz - 20z wrt c? 966q - 120z*3 Differentiate -1079y*4z + y*4 + 233z + 6 wrt y. -4316y3z + 4y3 What is the first derivative of -k4 - 43k*2p + 43p wrt k? -4k*3 - 86kp Find the second derivative of -3335r*3 + 2917r. -20010r What is the second derivative of 2662jq2 - 28jq - 10q wrt q? 5324j Differentiate -373c*2 - c - 325. -746c - 1 Find the third derivative of 588c3 - 18c*2 + 19c wrt c. 3528 What is the third derivative of 4304a2k*3 + 2a*2 + 2023ak2 - 2k - 1 wrt k? 25824a2 Find the second derivative of 2g*3 - 176g*2 - 256g. 12g - 352 What is the third derivative of -11px3 - 1192px2 - 2x*3 wrt x? -66p - 12 What is the first derivative of 273q2 - 8q - 2853? 546q - 8 Find the first derivative of -12113l*4 - 3891. -48452l*3 Find the second derivative of -182v*5 + v - 30 wrt v. -3640v*3 What is the first derivative of -23700y*4 - 23156? -94800y*3 What is the second derivative of 2f*3 + 4040f*2 + 24426f wrt f? 12f + 8080 What is the second derivative of 92k*2x*5 - 2k*2x - 23k2 + 22kx5 - 2kx + k wrt x? 1840k*2x*3 + 440kx3 What is the third derivative of o2u*5 - 10o*2u*2 - 2o*2 wrt u? 60o*2u*2 Find the third derivative of 327g*5n + g*4n + 12g2n - 61gn wrt g. 19620g2n + 24gn What is the second derivative of -829m2 + 3m + 137? -1658 What is the first derivative of 5cr*2s + 6cr + 2cs - 31r2s - 19s - 21 wrt r? 10crs + 6c - 62rs What is the third derivative of 3a*2y*3 - 338a*2y*2 + ay*6 wrt y? 18a*2 + 120ay3 What is the third derivative of 2212o*6 + 11o*2 + 8o? 265440o3 Find the third derivative of 1147bt5 + 2bt2 - 54bt + 4t*2 wrt t. 68820bt2 What is the third derivative of 31g*5 - 3g*4 - 450g*2? 1860g*2 - 72g What is the derivative of 30n3 - n2 + 170 wrt n? 90n*2 - 2n Find the second derivative of -4dr*2s*2 - 68dr2 + 2ds2 - 2ds - 2rs2 - 3r wrt r. -8ds*2 - 136d Find the third derivative of -5158go*4 + 2g - 343o2 + 3 wrt o. -123792go Find the third derivative of -19045n*3 + 197n*2 - 14n wrt n. -114270 Find the third derivative of 14330h3y*2 - 3h*2 + 3hy2 + 2h + 33 wrt h. 85980y2 Find the second derivative of -6808d*2 + 8483d. -13616 What is the third derivative of 102cm*3 - 18cm2 + 160c - 20m4 + 2m*3 wrt m? 612c - 480m + 12 What is the first derivative of -2j*2z + 43j2 + 28jz4 + 2z*4 wrt z? -2j*2 + 112jz3 + 8z*3 What is the second derivative of -431i*2o*3 - 2i - 2o3 - 4 wrt i? -862o*3 Find the second derivative of -17i*3l*2 - 66i*3l + 2il + 8l3 wrt l. -34i*3 + 48l Find the second derivative of -43z2 + z - 105. -86 What is the second derivative of 338g*3 + 2g - 138 wrt g? 2028g What is the second derivative of -6hq2y*2 + 14hq2 - 181hqy*2 - hqy - 2q*2y2 + q2y + 12q*2 wrt y? -12hq2 - 362hq - 4q*2 Find the first derivative of 7do2 - 216dos - 294do + 5o2s + os wrt s. -216do + 5o*2 + o What is the derivative of -5445p*3 + 3996 wrt p? -16335p*2 Find the first derivative of 2ay3 - 9848ay - 355y*3 + 4y*2 wrt a. 2y*3 - 9848y Find the second derivative of -82ko + 11kw*2 - 2kw - 3k - ow2 + 5w*2 + w wrt w. 22k - 2o + 10 Differentiate 1112d*2 - 1533 with respect to d. 2224d What is the second derivative of 264q2t*3 + 2qt3 - 3qt - 2t*3 wrt q? 528t*3 Find the second derivative of 790w*5 - 1266w. 15800w3 Find the first derivative of 52r*2 - 19r - 3575. 104r - 19 What is the derivative of 688n*2 + 2n + 2631 wrt n? 1376n + 2 Differentiate 2df3p - 5df*3 - 2dfp*2 + 12f*3p + 3f2p*2 wrt d. 2f*3p - 5f3 - 2fp2 Find the third derivative of -758s*6 - 229s*2 - s. -90960s*3 What is the derivative of -61w*3 - 59w + 7542? -183w2 - 59 Find the second derivative of -m2y*3z - 1435m2yz3 + 4myz*3 - 17myz*2 - 5y3 + y2z wrt m. -2y*3z - 2870yz*3 Find the third derivative of -3n*5 + 237n*3 + 19n*2 + 43. -180n*2 + 1422 Differentiate 2857p - 2317 wrt p. 2857 What is the third derivative of -2k5 + 24k*3 - 835k*2 - 2 wrt k? -120k*2 + 144 Differentiate -3154dk + 7dz - 3d - 28kz with respect to z. 7d - 28k Find the third derivative of 105a3 + 342a*2. 630 What is the third derivative of 87al3 + 10al2 + al + l*3 wrt l? 522a + 6 Find the third derivative of -56q6 + 2q*3 - 6q*2 - 32 wrt q. -6720q*3 + 12 Find the third derivative of 6703i*3 + 2254i*2 wrt i. 40218 What is the second derivative of 27x*3 + 189x + 1? 162x What is the derivative of -153x*3 - x - 282 wrt x? -459x*2 - 1 What is the second derivative of 1457q*4 + 1795q wrt q? 17484q2 Find the first derivative of -10v*2 - 11v - 4230 wrt v. -20v - 11 Find the third derivative of 8l*2w4 + l2w3 - l2w*2 + 5lw2 + 32w*4 - 82w wrt w. 192l2w + 6l2 + 768w Find the second derivative of 6p5 + 11p*3z*2 + 2pz + 22z*2 wrt p. 120p*3 + 66pz2 What is the third derivative of -2f*2m*6 + 7514f*2m*3 - 27f*2 - 5fm2 - 2f - 3m wrt m? -240f*2m*3 + 45084f*2 Find the second derivative of -279c*2 - c + 152 wrt c. -558 Differentiate -58q*3 + 2q + 58 wrt q. -174q2 + 2 What is the second derivative of -198i*2t*2 + 4i*2t - 2it*4 + 4t*2 - 63t wrt t? -396i2 - 24it2 + 8 What is the first derivative of -244o*3 - 2217? -732o*2 What is the second derivative of 35j*3r*2 - 3j*3r + 538j2r - 17r3 wrt r? 70j*3 - 102r What is the third derivative of -6o5 - 7o*3 - 212o*2 + 2 wrt o? -360o*2 - 42 What is the third derivative of -1431j*6 - 7138j*2? -171720j*3 Find the third derivative of -af*3s + 6af*3 - 3af2s - 2afs + 265f3 - f2s - fs - s wrt f. -6as + 36a + 1590 What is the first derivative of 2acq*3 - 40acqw + 8aq3w + 2aq*3 - cq*3w + 2cq*3 - 32c + 2q wrt w? -40acq + 8aq*3 - cq*3 Find the second derivative of 812m*2 - 683m wrt m. 1624 Find the first derivative of -17m2 + 73 wrt m. -34m Find the second derivative of 5a2g*2 - 70a*2gm2 - a2g - am + g3m*2 - 14g*3 - gm*2 wrt g. 10a*2 + 6gm2 - 84g Find the third derivative of 4x5 - 55x4 + x3 - x*2 - 701. 240x*2 - 1320x + 6 What is the third derivative of -8t3z*4 + 54t*3z2 + z2 wrt z? -192t3z Differentiate i*2p*2 + 8385i*2 + 6164ip2 with respect to p. 2i*2p + 12328ip Find the third derivative of -25s5 + 4s*3 - 377s*2 wrt s. -1500s**2 +	{ "pile_set_name": "DM Mathematics" }
36. What is j(-12)? 96 Let p(k) = k*2 + 13k - 14721. What is p(-128)? -1 Let y(x) = -1195x + 4448. Give y(4). -332 Let j(q) = -8q*2 - 112q - 218. Give j(-2). -26 Let b(j) = -599j - 599. What is b(-1)? 0 Let k(v) = -v2 - 24v - 43. Calculate k(-3). 20 Let m(g) = 37g + 4703. Give m(-127). 4 Let c(t) = t3 - 54t*2 + 58t - 126. Calculate c(53). 139 Let q(c) = 12c - 555. Determine q(47). 9 Let c(w) = -1872w - 33668. What is c(-18)? 28 Let y(r) = -196r + 61. What is y(0)? 61 Let l(g) = -4g*2 - 4g - 7. Calculate l(-5). -87 Let b(t) = -9t3 + 5t*2 + 5t - 3. Calculate b(2). -45 Let x(v) = -19v + 292. Calculate x(24). -164 Let f(k) = -24k*3 + 3k*2 + 6k - 7. What is f(1)? -22 Let q(k) = -535k2 - 16k + 18. What is q(1)? -533 Let x(k) = -17k + 102. Give x(-30). 612 Let r(u) = -5u*3 - 79u*2 - 308u - 5. Calculate r(-8). -37 Let y(k) = 6k3 + k2 - 2k - 1. What is y(3)? 164 Let w(y) = y*3 - 114y*2 + 1132y + 9. What is w(11)? -2 Let q(d) = -d*2 - 37d - 155. Determine q(-29). 77 Let n(l) = 3l2 - 123l + 4. Calculate n(41). 4 Let d(x) = 9x2 - 9x - 2. Give d(2). 16 Let k(l) = 215l - 2787. What is k(13)? 8 Let c(y) = y3 - 20y*2 + 53y + 101. What is c(5)? -9 Let t(g) = g*2 + 31g + 88. Calculate t(-18). -146 Let h(z) = -z3 + z2 + 10z - 7. What is h(0)? -7 Let x(d) = -17d + 12. Give x(0). 12 Let c(u) = 4u2 + 7u + 9. Calculate c(6). 195 Let d(j) = j*3 + 10j*2 - 34j + 52. Calculate d(-13). -13 Let b(u) = 2u2 - 1166u + 5787. Determine b(5). 7 Let q(m) = 510m - 35688. What is q(70)? 12 Let f(g) = -86798g - 433985. What is f(-5)? 5 Let b(g) = 4182g - 16830. Calculate b(4). -102 Let d(b) = 6b - 256. Determine d(56). 80 Let f(a) = -a*3 - 8a*2 - 368a - 2531. Give f(-7). -4 Let k(s) = 79s2 - 4911s + 811. What is k(62)? 5 Let x(v) = 33v2 + 331v + 2. Determine x(-10). -8 Let t(r) = 2r2 + 183r - 5408. Determine t(-115). -3 Let n(s) = -12s3 - 30s*2 + 31s. Give n(1). -11 Let k(q) = -2q2 + 103q + 7701. Calculate k(93). -18 Let i(f) = -f*3 + 59f*2 - 365f + 4. Calculate i(52). -48 Let k(y) = 8y2 + 86y - 87. What is k(-12)? 33 Let t(j) = -826j + 10747. What is t(13)? 9 Let z(t) = t3 - 6t*2 + 9t - 5. Calculate z(4). -1 Let t(j) = 85j + 203. What is t(-2)? 33 Let i(v) = v3 + 16v*2 - 60v + 28. Calculate i(-19). 85 Let t(o) = -o*2 + 54o + 1254. Calculate t(-18). -42 Let w(u) = -14u2 + 10u - 36. Calculate w(7). -652 Let o(b) = b*2 - 66b - 194. Determine o(69). 13 Let r(q) = 11561q + 92507. Calculate r(-8). 19 Let n(c) = 2c*2 + 91c + 748. What is n(-35)? 13 Let h(g) = g*3 - 19g*2 + 62g - 7. What is h(4)? 1 Let s(i) = 5648i + 11. Determine s(0). 11 Let l(b) = -6b*2 + 139b - 793. Determine l(14). -23 Let b(g) = -6g2 + 63g + 18. What is b(11)? -15 Let p(o) = -o*3 + 126o*2 - 243o - 624. Determine p(124). -4 Let c(n) = -3n3 - 28n*2 + 119n - 31. What is c(5)? -511 Let d(q) = -q*2 - 212q + 213. Determine d(1). 0 Let z(i) = -37i3 + 294i*2 + 3i + 27. Give z(8). -77 Let f(n) = 2n - 52. Calculate f(-5). -62 Let u(c) = -c3 + 102c*2 - 397c + 525. Calculate u(98). 35 Let h(n) = -68n - 3928. What is h(-58)? 16 Let f(g) = g3 - 213g*2 - 196g - 3850. Give f(214). 2 Let w(y) = y*3 + 11y*2 + 10y - 94. Calculate w(-9). -22 Let i(w) = -w*2 + 17w + 230. Give i(-8). 30 Let t(v) = v*3 - 13v*2 - 7v + 4. Determine t(9). -383 Let z(p) = -p*3 + 9p*2 - 4p - 8. Calculate z(11). -294 Let c(q) = -q*2 - 198q - 8356. Calculate c(-137). 1 Let l(r) = -170r + 17. Calculate l(2). -323 Let t(o) = 48o + 9. Determine t(-5). -231 Let a(p) = 10p2 - 8p + 23. What is a(3)? 89 Let d(z) = -517z + 561. Determine d(1). 44 Let a(w) = w2 - 126w - 2282. Determine a(-16). -10 Let g(z) = 112z3 - 8z - 9. Determine g(-1). -113 Let n(b) = b*3 + 7b*2 + 4b + 581. Give n(0). 581 Let x(q) = -364q - 4807. Determine x(-13). -75 Let f(y) = y3 + 8y*2 - 51y - 200. Determine f(-4). 68 Let z(r) = r*3 + 8r*2 - 55r - 401. What is z(-7)? 33 Let t(n) = n*3 + 35n*2 - 197n + 125. What is t(-40)? 5 Let y(x) = -134x - 11010. What is y(-82)? -22 Let t(j) = 5j*2 + 119j + 375. What is t(-20)? -5 Let u(b) = -13b2 + 271b - 22. What is u(21)? -64 Let z(h) = -h*2 + 34h + 2854. Give z(-39). 7 Let l(w) = 93w - 67. What is l(-6)? -625 Let s(v) = v2 + 107v + 966. Calculate s(-10). -4 Let r(a) = a*3 - 173a*2 - 1642a + 727. Determine r(182). -1 Let d(u) = -53u + 578. Determine d(11). -5 Let s(n) = -n3 + 10n*2 - 32n + 29. Calculate s(11). -444 Let b(v) = -v*3 + 80v*2 + 801v + 1. Determine b(-9). 1 Let o(i) = -10i - 13. Give o(-13). 117 Let p(r) = 3r*3 + 78r2 + r + 19. Determine p(-26). -7 Let m(z) = z3 + 4z2 - 12z - 73. Give m(-4). -25 Let x(b) = 32b2 - 25b + 52. What is x(2)? 130 Let b(v) = -2v3 - 48v*2 - 115v - 595. Give b(-22). -1 Let h(u) = -145u + 1288. Give h(9). -17 Let y(n) = 2n*2 + 53n + 573. What is y(0)? 573 Let q(k) = -7k2 - 68k - 27. Determine q(-9). 18 Let l(h) = -h*2 - 192h - 4785. Calculate l(-30). 75 Let i(x) = -487x + 20938. What is i(43)? -3 Let n(w) = w2 - 48w + 133. Calculate n(4). -43 Let x(t) = -5t2 - 708t - 3158. Give x(-137). -7 Let w(f) = 2f2 - 15f + 37. Determine w(-8). 285 Let x(l) = l*3 - 121l*2 - 500l - 208. Give x(125). -208 Let w(a) = 2a2 - 36a + 195. Give w(12). 51 Let s(i) = -3i2 - 290i - 1885. Calculate s(-7). -2 Let n(u) = -5u3 - 2u*2 - 2u - 9. Give n(-3). 114 Let n(r) = 5r2 + 48r - 162. Determine n(3). 27 Let p(m) = -561m + 100414. Determine p(179). -5 Let s(p) = 36p - 254. What is s(8)? 34 Let b(q) = -q*2 + 493q - 9857. What is b(21)? 55 Let r(d) = d*3 + 9d*2 + 14d - 37. Determine r(-5). -7 Let b(a) = -a*3 + 3a*2 + 341a + 3. Determine b(20). 23 Let p(f) = 25f + 655. Calculate p(23). 1230 Let g(r) = -r2 + 13r + 5. Determine g(13). 5 Let a(p) = 14p - 41. Determine a(5). 29 Let k(x) = -6x + 154. What is k(-24)? 298 Let z(g) = g*2 + 15g + 16. What is z(-10)? -34 Let o(g) = -g*3 + 44g*2 + 181g + 539. Determine o(48). 11 Let s(g) = 133g + 1458. What is s(-12)? -138 Let y(i) = -17i*2 + 80i + 60. Give y(5). 35 Let f(x) = -4x2 + 271x + 50. Calculate f(68). -18 Let a(y) = -y*2 + 85y - 1001. Determine a(14). -7 Let k(t) = -t*2 - 52t + 217. Calculate k(4). -7 Let g(c) = 8c + 14. Give g(-3). -10 Let d(c) = c2 - 4c - 129. Calculate d(14). 11 Let v(h) = h*3 - 9h*2 - 361h - 14. Give v(-15). 1 Let a(y) = 57y - 1540. Calculate a(27). -1 Let p(c) = c3 + 28c*2 + 96c - 50. Give p(-24). -50 Let r(q) = 2q - 24. Give r(-2). -28 Let j(o) = -10o*2 + 181o + 38. What is j(9)? 857 Let o(h) = 2h3 + 152h*2 + 2h + 78. What is o(-76)? -74 Let d(x) = 47x2 + 12x + 13. Calculate d(-1). 48 Let j(m) = 16m + 2085. Give j(-129). 21 Let x(b) = -378b - 19266. Calculate x(-51). 12 Let a(m) = -14m3 + 2m2 - 6. What is a(2)? -110 Let x(t) = -t3 - 5t2 + 70t - 14. What is x(6)? 10 Let o(a) = -a*3 + 3a*2 - 2a - 61. Calculate o(0). -61 Let i(d) = -d*3 + 11d*2 - 5d + 65. Determine i(11). 10 Let o(n) = -n*3 + 7n*2 + 13n - 10. Calculate o(8). 30 Let h(d) = -3d3 - 2d*2 + 141d + 143. Determine h(-1). 3 Let l(p) = p*2 - 32p + 44. Give l(33). 77 Let w(l) = -105l2 + 40l - 40. Determine w(1). -105 Let i(h) = 10h2 - 3h + 31. What is i(3)? 112 Let p(r) = 13r2 - 48r - 5. Give p(-5). 560 Let v(w) = -6w - 17. Calculate v(32). -209 Let g(t) = t3 - t - 394. Determine g(0). -394 Let u(x) = -2665x - 2672. Calculate u(-1). -7 Let j(n) = 3n - 1. Calculate j(-17). -52 Let v(g) = -4g*2 - 170g + 69. Calculate v(-43). -17 Let r(u) = 4u2 + 9u + 10. Calculate r(-7). 143 Let c(l) = -2l2 - 21l + 21. Calculate c(1). -2 Let a(r) = -111r + 3422. Determine a(33). -241 Let s(p) = 78p*2 - 247p + 5. Give s(3). -34 Let r(c) = 28c + 1532. What is r(-64)? -260 Let q(y) = 109y - 1279. Determine q(12). 29 Let b(q) = q*2 - 98q + 1370. Calculate b(17). -7 Let a(q) = 8q2 + 128q + 7. Give a(-14). -217 Let m(g) = 3g3 - 56g*2 - 19g - 2. Determine m(19). -2 Let t(z) = -z*3 + 27z*2 - 192z + 4337. What is t(26)? 21 Let o(f) = 2f2 + 16f + 38. Determine o(-20). 51	{ "pile_set_name": "DM Mathematics" }
4 - -5 - (-20 - -31) -4 Calculate (4 - ((-2 - -5) + -8)) + -5. 4 What is (4 - -1) + 20 + -19 + 7 + -11? 2 -6 + (7 - (-1 - 0)) + 0 2 (0 - (6 + (-1 - (2 - 1)))) + 1 -3 Calculate (29 - 9) + (-2 - 8) + 2. 12 Evaluate 3 + (-12 - (-1 + (-34 - -1))). 25 What is 44 + (-6 - (-49 + 77))? 10 What is the value of 1 + 21 - (-34 - -46)? 10 Evaluate -3 + -9 + 9 - 2 - 16. -21 What is (-8 - 1) + (-34 + -10 - -47)? -6 What is the value of 3 + (47 - 52) + (11 - 0)? 9 Evaluate 2 + 13 + -7 - 5 - 2 - -3. 4 What is -8 + -11 + 6 + (-1 - -21)? 7 3 - (-7 + -3 + 5) 8 What is 13 - (7 - -2) - (-3 - -2)? 5 Calculate -49 + (15 + -9 - -20). -23 What is the value of 3 - ((-1 + -4 - -10) + (-10 - 0))? 8 What is 4 - (7 - (8 - 10))? -5 Calculate -31 - -60 - (48 + -6). -13 Calculate (3 - 18) + -7 + (-1 - 5 - -14). -14 What is the value of -6 + (0 - 5) + 17? 6 What is the value of (3 - 21) + (24 - -16)? 22 -9 - 0 - (8 - (-5 + 0 + 21)) -1 0 + -3 - 9 - (-30 + 32) -14 Calculate (-12 + 3 - (18 - 26)) + 4. 3 What is the value of (0 - -23) + (111 - 136)? -2 Calculate 6 + (-1 - (-5 - -2)). 8 Evaluate 30 + 5 + 34 + -62 - (-12 + 1). 18 3 + 3 - 0 - -1 7 What is 3 + 27 + 335 + -372? -7 What is the value of 34 + -13 + 6 + -1 + -3? 23 Evaluate -7 + (26 - (17 - 3)). 5 What is the value of (29 - 35) + (12 - 0) + -4 + 4? 6 Evaluate -8 + 1 + 3 + (6 - 3). -1 Evaluate -12 - (-1 - (7 + -1)). -5 Calculate -36 + -3 + 6 + 3. -30 Calculate -12 - (22 - 29 - -14 - (-1 - -20)). 0 6 + (-11 - -7 - 24) + 0 + -6 -28 -8 + 5 + -34 + 24 -13 What is the value of ((-3 - -11) + -4 - (-2 + 2)) + -1? 3 Calculate 11 + -19 + 19 + (-2 - -6). 15 Evaluate -7 + 6 + 5 + (-10 + 8 - 0). 2 Evaluate (-1 - 38 - -14) + 17 + 30. 22 Evaluate 11 + 5 - (11 + 10). -5 Calculate -6 + 3 + 2 + 1 + 24. 24 Calculate 9 - (-4 - (4 - 13)). 4 2 + -4 + (-19 + 12 - -4) -5 What is the value of 7 + -1 + 3 + 1 + -9 + 2? 3 What is the value of 31 + (-7 - -12 - 60)? -24 Calculate -6 + (-4 + 4 - (-6 - -8 - -4)). -12 What is the value of (-15 - -21) + (-2 - -11)? 15 What is (-4 - (-23 - -11) - -14) + -12? 10 -14 + 83 + -34 + -39 -4 What is the value of (-11 - -24) + -5 + (1 - 19)? -10 Evaluate 2 + (-13 - (7 + -7) - (-8 - -3)). -6 Evaluate 3 - (12 - -1) - (-28 + 23). -5 What is the value of -18 + 69 + (-29 - 5)? 17 -20 + (0 - (-1 - (-6 + 14))) -11 -4 + 4 - (-9 + 20 + -3 + 6) -14 (-105 - -123) + (2 + (-4 - -2) - 3) 15 -8 + -15 + 5 + -5 + 8 + 15 0 Calculate 2 + 0 - -11 - (9 - -1). 3 Evaluate (-28 - -24 - -8) + 1 + -10. -5 -55 + 50 + (0 - -13) + -1 7 What is -3 - 1 - (3 - (-14 + 16))? -5 (2 - 26) + 45 + 10 + -61 -30 -4 + (6 + (-13 - -14) - 4) -1 Calculate (1 - -14) + 1452 + -1438. 29 Evaluate (31 - (-2 - -3 - (1 - 5))) + -8. 18 What is the value of (-1 - -2) + (0 - -3 - 4) + -17? -17 Calculate (-13 - (15 + -8)) + 34. 14 Calculate -11 + 6 - -3 - 4 - (8 - 16). 2 11 + (11 - 9) + -4 + 4 - 1 12 What is the value of (0 - -5) + 0 + (4 - (3 - 4))? 10 What is the value of -7 + (42 - 53) - 14? -32 18 + 7 + (19 - 39) 5 -1 + (-2 + 3 - (-3 + 15)) -12 What is (103 - 84 - (0 - 2)) + (-1 - 2)? 18 Evaluate 16 - 26 - (-8 + -37 - -9). 26 Calculate (217 - 193) + (-4 - -12). 32 Calculate (20 - 13) + (4 - 7 - -2). 6 266 + -247 - (33 + 0) -14 Calculate 11 + -5 + (2 - (12 + 2 - 3)). -3 Calculate 4 - ((-13 + 3 - -9) + 29 - 8). -16 Calculate (11 - (7 - 2)) + (1 - (1 - 1)). 7 Calculate -21 - (37 - 81) - 18. 5 What is -11 + 6 + (4 - 2 - (-7 + 11))? -7 Evaluate 2 - 29 - (-54 - -16). 11 What is (-9 - -2) + 7 + 3 + (16 - -1)? 20 What is 2 + 4 - (-2 + 3 + (-11 - -4))? 12 What is the value of -20 - (-10 - 1) - -25 - 17? -1 (-2 - 9) + -4 + 10 + -8 + 5 -8 What is (-1 - -6) + (-22 - ((4 - 13) + 2))? -10 -4 + -4 + 4 + -6 -10 Calculate (26 - 5) + (-9 - 2) + -18. -8 Calculate -6 + -8 + 10 + 4. 0 -2 + (-2 + -6 - (23 + -51) - 8) 10 -1 - (2 - -10) - (3250 - 3266) 3 Calculate 1 - (1 - (12 - (17 - 8))). 3 -40 - ((19 - 11) + -14) -34 What is -7 - ((16 - 1) + (-46 - -44))? -20 (-3 - 0) + 20 + -17 + 6 6 What is (-20 - (32 + -60) - (0 - 0)) + -38? -30 What is the value of 4 - (6 - (-4 - (-6 + 5 - 2)))? -3 What is the value of -34 + 28 + 5 - (0 - 1 - 4)? 4 What is the value of 1 + 28 + 1865 + -1870? 24 What is the value of -12 - (-46 + -2 - -2)? 34 Calculate (-5 - -1) + -81 + 69 - -44. 28 8 - (-6 + 21 - 11) - -14 18 Calculate -19 + 1 - ((2 - 1) + -4). -15 -7 - (5 + -4) - -10 - (1 - -23) -22 (25 - (22 + 9)) + (-2 - -22 - 0) 14 What is -14 + 47 + -16 + 17 - 9? 25 Evaluate -13 - (-36 - (-25 - (-2 - 11))). 11 What is the value of (4 - 2) + (7 - (-2 + -2 + 3))? 10 Evaluate -3 + (9 - -1) + (-8 + 4 - -3). 6 What is -18 - (-14 + (-10 - -1))? 5 What is 8 - -3 - (-8 + 5 - 11)? 25 Calculate -9 - (-8 + (-8 - -10) + -8). 5 What is (1 + -26 - -3 - -3) + 7? -12 (-10 - -13) + -14 + 3 -8 What is -13 - -1 - (-25 + 28 + -4)? -11 What is (3 - (1 + -2)) + 14 + 27 + -54? -9 Calculate 46 - 2 - -2 - (23 - -35 - 49). 37 Calculate (2 - -1) + -43 + 25 + -3 + -3. -21 1 - (-10 - -5) - 13 -7 What is the value of 33 - 20 - (16 + 0 - 20)? 17 Calculate 44 + (4 - -3 - 40). 11 What is the value of -32 - (-21 - 4) - (-40 - (-2 - 0))? 31 Calculate (-20 - -16 - (-14 - -17)) + -10. -17 What is the value of 8 + -2 - ((17 - 10) + 2 + 4)? -7 Evaluate 10 - (0 - (0 - (11 - -1) - -2)). 0 What is 7 + (18 - 22) - 25? -22 Evaluate (5 - 11) + 8 + 1 + (-32 - -5). -24 What is 8 - 4 - (3 + (-12 - -3 - -5))? 5 Calculate -3 - (-13 + (12 - (-5 - -7 - -4))). 4 Evaluate 1 + (-10 - -20) + -19. -8 -10 - ((3 - (-5 - -9)) + -13) 4 -29 + 12 + 11 + (2 - -12) 8 What is the value of 18 - -1 - (-17 - (6 + -15)) - 8? 19 (-6 - (-5 + 4) - -1) + (3 - 3) -4 Evaluate (5 - 9) + (-17 - -25) + 0. 4 Calculate 16 + 0 + -6 + 9 + -4. 15 What is 14 + 1 + (7 - 41)? -19 Evaluate 42 + -19 + 21 + -20. 24 What is 27 + -52 + (14 - 5)? -16 Evaluate 9 - (-4 + -6 + 15) - -4. 8 Evaluate -15 - -31 - 45 - -2. -27 What is (1 - 3) + (-42 - -33 - (1 + -10))? -2 Evaluate 8 + (-16 - -4) + 18. 14 What is the value of 44 + -23 - 21 - (-12 - -1)? 11 (7 - 19) + -2 + 4 -10 0 - (3 + -6 - -12) - -3 - -32 26 Calculate (-5 - -8) + (3 - (35 + 5)) - -4. -30 Evaluate -12 - (2 - (0 + 13)) - (-2 + -16). 17 (29 + -45 - (0 - 5)) + 3 -8 What is the value of -6 + (8 - -7) - (0 - (8 + -48))? -31 What is -8 + (-4 - (-6 + (-5 + 1 - -4)))? -6 Evaluate 6 + -4 + 10 + -1 - (-1 - -2). 10 What is 9 + (9 - (1 + 6 + 46)) - -4? -31 What is (29 - 11) + (10 - 1) + 2? 29 Calculate (-2 + -7 - (-55 + 46)) + 2. 2 Evaluate -1 - (-17 - (-7 - 0) - -18). -9 Calculate (-4 + 7 - 19) + (-13 - 2) + 22. -9 Evaluate -1 - -1 - 19 - (36 - (6 - -39)). -10 Calculate 10 + -11 - (-26 + 0 - (-1 + 1)). 25 What is the value of 14 - ((5 - 0) + -4 + (-1 - -4))? 10 What is (-1 - -26) + -7 + (10 - (-3 - -3))? 28 Evaluate 4 + (51 - 53 - (0 - -5)). -3 -1 + 6 - (16 - (21 + -6 + 3)) 7 What is (2 - (-1 + -3)) + 11 + 0 + -28? -11 -42 + 108 + -32 - 51 -17 21 + 7 + (19 - 62) -15 Calculate (67 + -20 - 36) + 16. 27 Evaluate -16 - (-4 - 5 - (-15 + 4 - -2)). -16 6 + -3 - 7 - -3 - (9 + 5) -15 (6 - 1) + 19 + -5 + (-48 - -14) -15 Calculate (24 - 24) + -1 + 10. 9 Calculate (1 - -5) + 1 + -18 + 15 + 0. 4 Evaluate 4 - ((-16 - -21) + (2 - 13)). 10 What is the value of 6 - (-5 + (7 - 7) + -6 + 3)? 14 Evaluate (-14 + 20 - (-6 - -4 - 13)) + -4. 17 What is the value of -5 - (6 + (0 - 1) + 0 + -16)? 6 What is 0 + 26 + 1 + -36 + 28? 19 42 + (-40 - 43 - -32) -9 What is the value of -2 - 4 - ((1 - 13) + 3)? 3 -27 - -23 - (-2 - 0 - 3 - -4) -3 What is the value of -18 + (-4 + 24 - 10)? -8 What is the value of -9 + 25 + (1 - 17)? 0 -14 - (0 + 6 + 3 + -2 + -8) -13 Evaluate (6 - (3 - 1)) + -31 + -3. -30 Evaluate 9 - (11 + 1 - -3). -6 Calculate 18 - (-6 + (-2 - (-11 + 6)) + 7). 14 What is the value of 0 - 8 - (-5 + 14 - -7 - 10)? -14 Evaluate 6 + 6 + 3 + -4 + -1. 10 Evaluate -27 - (-4 + -20 + -13). 10 Evaluate -18 + 2 - -22 - (13 + 2). -9 -21 + 20 + (-4 - 21) -26 What is the value of -2 - 2 - ((-17 - -7 - -10) + -12)? 8 Calculate -3 + (19 - 0) - (29 + -19). 6 Evaluate 4 - -7 - (-17 + 10) - -4. 22 What is -17 - (1 - (28 - 12))? -2 Evaluate (3 - (4 + (-1 - -3))) + -4 - 27. -34 Evaluate 22 - (-5 + -20 + 79). -32 Evaluate (5 - 32) + 30 + (4 - 0). 7 What is -2 + (-6 - -7) + 8? 7 Calculate (-24 - -44) + -31 - (-1 + -2). -8 -566 + 586 - (1 - -34) -15 Calculate 5 - (-10 - -3 - (29 - 26)). 15 Eva	{ "pile_set_name": "DM Mathematics" }
. 319 Calculate the greatest common factor of 22 and 5018904. 22 Calculate the highest common factor of 45 and 1200663. 9 Calculate the highest common divisor of 2973584 and 144. 16 What is the highest common factor of 87882 and 38958? 906 Calculate the highest common divisor of 3275 and 6419. 131 What is the highest common divisor of 12935 and 221? 13 Calculate the greatest common factor of 81 and 2398572. 81 Calculate the highest common divisor of 313294 and 36768. 766 Calculate the greatest common factor of 61 and 90707. 61 Calculate the greatest common factor of 45 and 1611720. 45 What is the greatest common factor of 364 and 301028? 364 What is the highest common divisor of 2257 and 13847? 61 Calculate the highest common divisor of 1957 and 1007. 19 What is the greatest common divisor of 3 and 13785? 3 What is the highest common factor of 37806 and 24? 6 What is the highest common divisor of 289 and 170? 17 What is the greatest common factor of 33 and 2556? 3 Calculate the greatest common factor of 2597 and 2401. 49 Calculate the greatest common divisor of 1088 and 2414. 34 Calculate the greatest common factor of 542729 and 11. 11 What is the highest common divisor of 94188 and 169338? 1002 What is the greatest common factor of 1147 and 118733? 37 What is the greatest common factor of 1 and 2267? 1 What is the highest common factor of 130996 and 20? 4 What is the highest common divisor of 159764 and 154? 22 What is the greatest common divisor of 1349 and 152? 19 What is the highest common factor of 2631888 and 147? 147 Calculate the greatest common factor of 186 and 1501826. 62 What is the greatest common factor of 33 and 11968? 11 What is the highest common divisor of 508 and 715010? 254 Calculate the greatest common factor of 9503 and 663. 221 Calculate the highest common divisor of 378 and 402444. 126 What is the greatest common divisor of 221 and 2539069? 221 Calculate the highest common factor of 13 and 98657. 13 Calculate the greatest common factor of 499149 and 3325. 133 Calculate the highest common divisor of 666 and 94202. 74 Calculate the greatest common divisor of 177062 and 1784. 446 Calculate the greatest common divisor of 1325029 and 1004. 251 What is the highest common factor of 64 and 56128? 64 Calculate the greatest common factor of 5292 and 56. 28 What is the greatest common factor of 3175 and 1850? 25 Calculate the highest common factor of 391 and 98821. 17 Calculate the greatest common divisor of 756042 and 84. 42 What is the highest common divisor of 572039 and 2449? 79 What is the greatest common factor of 24 and 5700? 12 Calculate the highest common divisor of 16089 and 279. 93 Calculate the greatest common factor of 23045 and 385. 55 What is the greatest common factor of 60326 and 31? 31 What is the highest common divisor of 2686 and 5846? 158 What is the greatest common divisor of 790 and 13225390? 790 Calculate the highest common factor of 107818 and 71393. 1457 What is the greatest common factor of 122303 and 665? 19 What is the greatest common factor of 11 and 3593491? 11 What is the highest common divisor of 4669664 and 32? 32 What is the highest common factor of 127078 and 56? 14 Calculate the greatest common divisor of 25 and 15385. 5 What is the highest common factor of 285563 and 559? 43 What is the highest common divisor of 263 and 699317? 263 What is the highest common factor of 20 and 16370? 10 What is the greatest common divisor of 5 and 128165? 5 What is the highest common factor of 114678 and 276? 138 What is the highest common divisor of 2581763 and 129? 43 What is the highest common divisor of 168 and 288428? 28 Calculate the greatest common divisor of 1989 and 126360. 117 What is the greatest common divisor of 424 and 6254? 106 What is the highest common factor of 2786 and 24066? 14 Calculate the highest common factor of 1716 and 417612. 156 Calculate the greatest common factor of 2782 and 3146. 26 What is the highest common factor of 762 and 11938? 254 Calculate the highest common divisor of 424 and 1643. 53 Calculate the highest common divisor of 33 and 4213. 11 Calculate the greatest common divisor of 36577 and 2054. 79 What is the highest common factor of 3808006 and 978? 326 What is the highest common factor of 156 and 1014234? 78 Calculate the highest common factor of 84 and 1500. 12 What is the greatest common divisor of 260 and 401780? 20 Calculate the highest common divisor of 3410 and 80. 10 Calculate the highest common divisor of 1032 and 563988. 516 Calculate the highest common divisor of 2436 and 420. 84 What is the highest common divisor of 168 and 2604? 84 Calculate the greatest common factor of 8 and 446536. 8 What is the highest common divisor of 390 and 96980? 130 What is the highest common factor of 1252227 and 142? 71 Calculate the greatest common divisor of 72110 and 40. 10 What is the highest common factor of 1256 and 67510? 314 What is the greatest common divisor of 7852 and 52? 52 What is the highest common divisor of 210 and 1268736? 42 Calculate the greatest common divisor of 56883 and 603. 201 What is the highest common divisor of 1612013 and 39? 13 What is the highest common divisor of 2271 and 5865? 3 Calculate the highest common factor of 791 and 22897. 7 What is the greatest common factor of 450 and 2536470? 90 What is the highest common divisor of 84064 and 481? 37 What is the greatest common divisor of 508 and 21872? 4 Calculate the greatest common factor of 210 and 134470. 70 Calculate the highest common factor of 140 and 5740. 140 What is the highest common divisor of 123 and 2419? 41 Calculate the highest common factor of 1908 and 16006. 106 Calculate the highest common divisor of 201672 and 144. 72 What is the greatest common factor of 118116 and 442? 34 Calculate the highest common divisor of 26388 and 1308. 12 Calculate the highest common factor of 1284 and 2364. 12 Calculate the highest common divisor of 1160250 and 3500. 1750 What is the greatest common divisor of 15276 and 31155? 201 What is the greatest common divisor of 378 and 2116800? 378 What is the highest common factor of 7550 and 24? 2 Calculate the greatest common divisor of 56764 and 184. 92 Calculate the highest common factor of 902 and 198. 22 What is the greatest common divisor of 1311 and 828? 69 What is the highest common factor of 129 and 307407? 129 Calculate the highest common divisor of 941838 and 474. 474 What is the highest common divisor of 69065 and 36670? 95 What is the greatest common factor of 440657 and 1666? 833 What is the greatest common divisor of 169156 and 494? 26 Calculate the greatest common divisor of 48830 and 87970. 190 What is the highest common factor of 103 and 48719? 103 What is the highest common divisor of 7153 and 23? 23 What is the greatest common divisor of 2639331 and 67? 67 Calculate the highest common divisor of 276 and 178779. 69 What is the greatest common divisor of 24 and 1857912? 24 What is the greatest common divisor of 13048 and 224? 56 Calculate the greatest common factor of 31 and 102641. 31 Calculate the highest common factor of 4037 and 23488. 367 Calculate the highest common divisor of 1520 and 3120. 80 Calculate the highest common divisor of 626652 and 2704. 676 What is the greatest common divisor of 57 and 43377? 57 Calculate the highest common divisor of 2268 and 15228. 324 What is the highest common divisor of 496 and 22? 2 Calculate the highest common divisor of 1788 and 991744. 596 What is the highest common factor of 182 and 12649? 91 What is the greatest common factor of 327303 and 1107? 369 What is the greatest common divisor of 596501 and 1535? 307 What is the highest common divisor of 172 and 121948? 172 Calculate the highest common divisor of 976 and 4578416. 976 Calculate the greatest common factor of 430 and 8858. 86 Calculate the highest common divisor of 41384 and 154. 14 Calculate the highest common factor of 59624 and 58. 58 Calculate the greatest common divisor of 4206 and 894. 6 What is the highest common factor of 12532 and 629492? 964 Calculate the highest common divisor of 273 and 31577. 91 What is the greatest common factor of 168 and 1038688? 56 What is the highest common divisor of 36 and 4743? 9 Calculate the grea	{ "pile_set_name": "DM Mathematics" }
(-2/25) Simplify p26p/((p/((((p(p(-9)/p)/p)/pp)/p)/p))/p)p assuming p is positive. p16 Simplify x21/xxx(xx(-15))/x assuming x is positive. x7 Simplify (d(-9)/((dd/d(3/7))/d))/(d(-1)(d(dd4d)/dddd)/d) assuming d is positive. d(-116/7) Simplify ((a(-34)/a)/aa)(8/5) assuming a is positive. a(-56) Simplify (nnn(-1))10/(n*(-1/9)/nn/(((n*(-2/9)nn)/nn)/n)) assuming n is positive. n(98/9) Simplify (s(-1/2)/s)7 assuming s is positive. s(-21/2) Simplify ii(-8)iii/i*(-21)i assuming i is positive. i18 Simplify h(-7)h(-2/5)h(h2)(-42) assuming h is positive. h(-452/5) Simplify (s((s*(-1)ss)/ss)/s)23/(s(-1/6)s(2/5)) assuming s is positive. s(683/30) Simplify c28ccc*0c assuming c is positive. c*31 Simplify ((aaa((a/(a/(aa2)))/a)/aaa)/a(1/6))/(a/(((a/((aaa(-2/3)/a)/a))/a)/aa)aaa3) assuming a is positive. sqrt(a) Simplify ((s/(s/((sss15s)/s))s)/s)/(s(sss(1/10))/s) assuming s is positive. s(149/10) Simplify s*31s(s/(ss/(s/(ss/s(-32)s)s)))/s assuming s is positive. s(-3) Simplify ((x(-2/9)x)/(xx6))(-6/11) assuming x is positive. x(112/33) Simplify b8/((bb*(1/12))/b)(bb(-1))(-12/13) assuming b is positive. b(95/12) Simplify (w(-8/11))(-16) assuming w is positive. w(128/11) Simplify ((p(-1/7)/p)/ppp(-5))/(p0)(-17/6) assuming p is positive. p(-43/7) Simplify ((oo(-4))/o(1/4))(1/21) assuming o is positive. o(-13/84) Simplify (tt5/t)/(tt(-14)) assuming t is positive. t18 Simplify (x/(xx6))/xxx/(xx/(x/(x/((xx/(x/(xx*(-4))))/x)))xx)xxx/(xx(-3/7))x(-6/13)/x assuming x is positive. x(-1004/91) Simplify f*(7/4)f(f1/f)/f(f*(-2/5)f)(-4/9) assuming f is positive. f(89/60) Simplify (v*(-2/7)vv8vv)/(vv*(-1/3)/v(v*(-6)v)/v) assuming v is positive. v(358/21) Simplify r(-1/9)r(-2/13)rr/(r(-1/5)rr)r/(r*(1/2)r)rr assuming r is positive. r(1679/1170) Simplify (c(2/3)cc(1/4))/(c(-2/11)c(-1)) assuming c is positive. c(409/132) Simplify (i/(i/(i/(iii/(ii(-1/5))))))/((i/i0)/i)i4(iii/i(2/17))/i assuming i is positive. i(398/85) Simplify ((q(q6q)/qq)/qq)/(q/((q/(q/(q/(qqq*(-11)))))/qq)) assuming q is positive. q*17 Simplify ((hh29)/h)/(h/h(5/7)) assuming h is positive. h(201/7) Simplify (l2/l)*15(l6/l)/l(-9/5) assuming l is positive. l(109/5) Simplify (p(2/9)p5)/((pp/(p/(p/(p/(ppp*(-1)p))))p)/(p/p(-2/9))) assuming p is positive. p(22/9) Simplify (yy(-6))(2/17) assuming y is positive. y*(-10/17) Simplify (ttt21)/(t/(t/t24)) assuming t is positive. 1/t Simplify ((z/z(2/5))/zz6)20 assuming z is positive. z112 Simplify t(-2/21)/t*(-7)((tt(-2/21)/tt)/tt)/(tt(1/3)) assuming t is positive. t(136/21) Simplify ((i/(i/i(19/4)))/i)(3/14) assuming i is positive. i(45/56) Simplify (x(-1/6)x3)/(((((x(x/(x*(1/6)x)x)/x)/xx)/x)/x)/(xx(-2/33))) assuming x is positive. x(163/33) Simplify ((pp/(p/(p(((pp/((pp16)/pp)p)/p)/p)/ppp))p)/pp)23 assuming p is positive. p(-276) Simplify d(-3)dd(-3/8)ddd*2d*(2/5)/dd assuming d is positive. d(81/40) Simplify (b/(b(1/2)bb))*(3/16)((bb(-5/4))/b)/(b/b(2/21)b) assuming b is positive. b*(-2309/672) Simplify (((gg*1)/gg)/g)*(3/5)(g/(gg(2/3)))46 assuming g is positive. g(-451/15) Simplify ((f4f)/f(-3))(-39) assuming f is positive. f(-312) Simplify (h(2/13)/(h*(-4/3)h))/(h(-1))(21/2) assuming h is positive. h(857/78) Simplify f(-2/27)/f7 assuming f is positive. f(-191/27) Simplify (nn(-8))/n(10/7) assuming n is positive. n(-59/7) Simplify (z(-3)z(1/8))/(z(3/2)zz(2/17)) assuming z is positive. z(-747/136) Simplify a*(2/9)/(aa*1a)(a(2/5))(-4/15) assuming a is positive. a(-649/225) Simplify (((q/(qqq/(q(-1/2)/q)qq)q)/q)(22/3))(-9) assuming q is positive. q363 Simplify (x0)*(-1/6)(x(2/5))(2/47) assuming x is positive. x(4/235) Simplify m(2/5)m(2/21)/mm(-2)/m(-1) assuming m is positive. m(-158/105) Simplify (t/t6tt10)(2/27) assuming t is positive. t(4/9) Simplify (x/x(-7))(-2/95) assuming x is positive. x(-16/95) Simplify (i/i(-1/4))7/(ii/i(-1/3)(i/i(-4))/i) assuming i is positive. i(29/12) Simplify (f*17f(-3/4))10 assuming f is positive. f*(325/2) Simplify (((bb/b*(-2/9))/b)/bb)/((bb(-10))/bbb) assuming b is positive. b(83/9) Simplify (((g/(gg/(g(gg*11)/g)))/g)/gg)(-18/7) assuming g is positive. g(-180/7) Simplify (v(-1/40))(-39) assuming v is positive. v(39/40) Simplify (t/t(-41))50 assuming t is positive. t2100 Simplify (l(2/9))(8/7)/((l*(-2/9)/ll)/l(-1)) assuming l is positive. l(-11/21) Simplify (p(pp/((p/p*(23/5))/pp))/p)(-41) assuming p is positive. p(-1148/5) Simplify r8/(r(-6/11)r) assuming r is positive. r(83/11) Simplify (a/(aaaa*(-6)))/(a/((a/(a/(a/(aaa(-2/5)/aa)a)a))/a)a)(a/(a/(aaa/a*(-5))))/(aa*0/aa) assuming a is positive. a*(37/5) Simplify (jj/j*33)/(j/(((jj/j*34j)/j)/jj)) assuming j is positive. j(-64) Simplify (m(5/4)m*0m)(2/15) assuming m is positive. m(3/10) Simplify (h/(((hhhhh*(7/5))/h)/h)h)(11/2) assuming h is positive. h(-77/10) Simplify ((z*(1/5)zz)/((zz3)/z))(-3/10) assuming z is positive. z*(6/25) Simplify b/(bb/b*(11/8)bb)b18 assuming b is positive. b(131/8) Simplify (ss7s/(s8/s))/(s(1/6)s)(-1/10) assuming s is positive. s(127/60) Simplify (w/(wwww*(-10)www))/(w/w(-16)) assuming w is positive. w(-12) Simplify f*7/(fff(16/3)f) assuming f is positive. f*(-4/3) Simplify (u/((uu/((uu/(u/u(4/15)))/u)uu)/u)u3)(-2/61) assuming u is positive. u(-38/915) Simplify h(-10)h/(hhh/h11hh)h assuming h is positive. h*(-2) Simplify (ggg22)/(g/g16) assuming g is positive. g39 Simplify (cc/c13)(18/7) assuming c is positive. c(-198/7) Simplify (x/x(1/2))*11x*(-4)xxx/(x/(x/x*(-5))xx) assuming x is positive. x(15/2) Simplify (g5g/(g(-1/8)/g))13 assuming g is positive. g(741/8) Simplify (f6)(-44) assuming f is positive. f(-264) Simplify (gg/(g/(gg/(g/(gg/(gg/((g/(gg/g(-8)))/g)g))))gg))12 assuming g is positive. g(-132) Simplify (p*(2/3)/p)/pp(-2)/p assuming p is positive. p(-13/3) Simplify j(13/3)/((j/j(-19))/j) assuming j is positive. j(-44/3) Simplify (o(3/13)o)/oo18 assuming o is positive. o(237/13) Simplify (a*(4/7)a1)/(a5(a/(a/(a/a5))a)/aa) assuming a is positive. a(-3/7) Simplify d(1/4)/(((dddd*(-2/7)d)/d)/d)((d(-1)d)/d)(2/41) assuming d is positive. d(-1737/1148) Simplify t*(-1/30)t(-12) assuming t is positive. t(-361/30) Simplify ((y*(-1)y)(-39))(-22/9) assuming y is positive. 1 Simplify r(-16)/r34 assuming r is positive. r*(-50) Simplify (nn*(-4/7)n)/((n/(n/n*4n))/nn)(n/(nnn*(-1)n))(-42) assuming n is positive. n(283/7) Simplify ((bb(b*(-31)/b)/bbb)/b)/(b/(b/(b/(b/(bb(b(3/13)/bb)/b)b)bb))) assuming b is positive. b(-419/13) Simplify (x(1/4))(1/83)(x/(((xx(-1)/x)/x)/x))(-5/9) assuming x is positive. x(-6631/2988) Simplify ((u/u(-1/18)u)/(u*(-3/5)/uuu))/(uuu/((u(uu(-1/3)/u)/u)/u))(-36) assuming u is positive. u(14189/90) Simplify g/g(2/11)g/(gg(-4/9))g(g/(g(g/((gg4)/gg))/g))/(gg(-7)) assuming g is positive. g(1313/99) Simplify (n9)(27/7) assuming n is positive. n(243/7) Simplify (h(-14)/((((h/h(2/13))/h)/h)/h))(-42) assuming h is positive. h(6468/13) Simplify (ww(6/5))(-18) assuming w is positive. w(-198/5) Simplify (o/o9oo*(1/4)o)46 assuming o is positive. o(-529/2) Simplify (v/(v(-1)/v))(1/8)/(vv/(v/(v/(vv/v*(2/7)v))))(7/5) assuming v is positive. v(11/8) Simplify (r/r*(7/2)r(10/3)/r)48 assuming r is positive. r(-8) Simplify (j16j(-10))(-9) assuming j is positive. j(-54) Simplify (t(2/19)/tt*(-1/2))/(t/(tt*(2/11)tt)tt5/t) assuming t is positive. t*(-	{ "pile_set_name": "DM Mathematics" }
Let a be -29 - (-6 - -4)-2 - 1. Let l(j) = -3 - 28j*2 - j + 29j*2 + 3j. Let x(g) = 6g2 + 11g - 17. What is al(d) + 6x(d)? 2d2 - 2d Let t(a) = 5a - 62. Let u(d) = 2d - 21. What is -3t(c) + 8u(c)? c + 18 Let o(j) = -139j3 + 4j*2 + 2. Let g(x) = 140x*3 - 5x*2 - 2. What is 4g(y) + 5o(y)? -135y*3 + 2 Let s(w) be the second derivative of 5/6w*3 - 11/12w*4 + 2w + 0w2 + 1/20w*5 + 0. Let x(z) = 5z*2 - 2z. Determine -2s(d) - 5x(d). -2d3 - 3d*2 Let t(m) = -2m*2 + m - 1. Let r(c) = -4c + 7. Give r(d) + 4t(d). -8d2 + 3 Let t be (-12)/(-4) + (-2)/(-2). Let b(g) = g2 - g + 6. Let a = 6 + -1. Let h(v) = -v*2 + v - 5. Calculate ah(n) + tb(n). -n2 + n - 1 Let f(t) = -t + 1. Let m(h) = -h2 - 2h + 1. Let y = 165 - 168. What is ym(o) + 3f(o)? 3o2 + 3o Let s(d) = 9d3 + 2. Let o(x) = 1. Let t(g) = -g2 + 17g - 32. Let r be t(15). Give ro(c) + s(c). 9c*3 Suppose 0p = p - 31. Suppose 0 = 4r - 2q + 16, -3r + 6 = 5q + p. Let k(a) = 9a + 7. Let l(d) = d + 4 + 3d + d. Calculate rl(u) + 3k(u). 2u + 1 Let r(g) = g3 - g2 + 1. Suppose 80 = 12o - 2o. Let q be o/28 - -118/(-14). Let a(h) = 4h3 - 6h*2 + 6. Determine qa(z) + 6r(z). 2z*3 Let j(k) = 38k*2 - 7. Let r(l) = -117l*2 + 19. Determine -8j(t) - 3r(t). 47t2 - 1 Let p(q) = -q3 - 3q2 + 14q - 3. Suppose 65s + 28s = -93. Let c(w) = -w3 - w2 + w - 1. What is sp(y) + 3c(y)? -2y3 - 11y Let o be ((-10)/3)/(2/(-6)). Suppose o - 28 = 2g. Let c be (-26)/(-7) - 2/(-7). Let x(y) = 2y*2 + 4y + 4. Let t(a) = 5a2 + 9a + 9. Give ct(z) + gx(z). 2z2 Let i(b) = -9b*2 + 7b + 6. Let g(a) be the second derivative of 5a4/12 - 2a*3/3 - 3a*2/2 - 88a. Calculate 7g(q) + 4i(q). -q*2 + 3 Let t(n) = -2n*3 - 5n*2 - 8n. Let r(a) = -2a3 - 5a*2 - 10a. Let w(u) = -4r(u) + 5t(u). Let y(c) = 5c3 + 14c*2. What is -11w(s) - 4y(s)? 2s3 - s2 Let z(n) = 15n2 - 7. Let s(b) = 6b*2 + 5b - 18. Let v(u) = -4u2 - 2u + 8. Let k(f) = -2s(f) - 5v(f). Calculate -7k(h) + 4z(h). 4h2 Let o = 2 + -2. Let f(d) = o - d + 2d + 1. Suppose 258y - 259y = 3, -5c + 4y = -42. Let r(h) = 3h + 6. Calculate cf(t) - r(t). 3t Let i(b) = -10b + 4 + 0b + 4b + 2b + 5b*2. Let a(z) = -81z*2 + 63z - 63. Determine 4a(h) + 63i(h). -9h2 Let u(o) = -2o*3 + 5. Let p(j) = 1. Suppose i - 2t = -7, -3t - 61 = 2i + 2i. Let y = i + 13. Suppose -z = 1 - y. What is zu(v) + 6p(v)? 2v*3 + 1 Let w be (-216/(-45))/(2/5). Suppose -4x - 3x + w = 0. Let i(f) = -f3 + f2 + 1. Let l(y) = -10y3 + 6y*2 + 5. Determine xl(v) - 6i(v). -4v*3 - 1 Suppose 16 = -5f + 46. Suppose 0 = fd - 2d - 20. Let r(v) = v3 + v2 - 2v + 1. Let u(n) = -3n*3 - 3n*2 + 5n - 3. What is dr(y) + 2u(y)? -y3 - y2 - 1 Let v(w) = -w*2 - 2w - 11. Let y(s) be the second derivative of s4/12 + s3/6 + 3s2 + s - 16. Suppose 4c = 5c + 4. What is cv(m) - 7y(m)? -3m2 + m + 2 Let x be (4/(-8))/(3/(-12)). Let g(w) = -w2 + w + 1. Let m(t) = -t - 5. What is xg(f) + m(f)? -2f*2 + f - 3 Let d(a) = 224612a + 3262. Let k(n) = -689n - 10. Determine -5d(c) - 1631k(c). 699c Suppose 8 = -61r + 57r. Let g(f) = -2f2 + f + 2. Let y(u) = 8u*2 - 5u - 9. Calculate ry(b) - 9g(b). 2b2 + b Let b(i) = -9i - 64. Let y(g) = -14g - 97. Give -8b(o) + 5y(o). 2o + 27 Let s(f) = 6f3 - 5f*2 - f. Let a(q) = -9q*3 + 7q*2 + q. Let b be ((-2)/(-4))/((2/1)/12). Suppose g - 8 = -b. Determine ga(t) + 7s(t). -3t*3 - 2t Let w(z) = -1. Suppose 0 = -b - 4o - 2 + 4, 4b - 22 = -2o. Let u(c) be the second derivative of c3/6 + 9c*2/2 + 5c. Determine bw(f) + u(f). f + 3 Let i(n) = -11n*2 + 5n - 5. Let p(t) = 12t2 - 6t + 6. Let h be 105/(-15)6/(-7). What is hi(d) + 5p(d)? -6d2 Let z(i) be the third derivative of i6/144 + i5/40 + i4/3 + 15i2. Let r(x) be the second derivative of z(x). Let c(v) = 5v + 4. Give 2c(w) - 3r(w). -5w - 1 Let w(h) = -5h. Let d(j) = -j*3 + 5j*2 - 2j - 2. Let u be d(2). Let o(v) = -9 + v*2 + 6 - 5v - 6. Let x be o(u). Let a(l) = 2l. What is xw(b) - 7a(b)? b Let a(w) = -12w + 9. Let r(u) = 35u - 26. Let o(l) = 11a(l) + 4r(l). Let g(c) = 4c - 2. Let q be ((-2250)/(-1500))/((-2)/12). Determine qg(k) + 4o(k). -4k - 2 Let g(w) = -4326w*2. Let f(s) = -173s*2. Calculate 126f(y) - 5g(y). -168y*2 Let n(t) = 3 - 16 - 1 + 8 + 7. Let i(q) = -2q - 1. Determine i(v) + 2n(v). -2v + 1 Let k(s) = -9s2 + 2s + 25. Let r(f) = -16f2 + 3f + 48. Determine -5k(v) + 3r(v). -3v2 - v + 19 Let z(j) = j3 + j2 - j - 1. Let g(w) = -5w*3 - 4w*2 + 6w + 6. Suppose 3a - 7a = -4v - 28, 5v - 4a + 34 = 0. Give vz(f) - g(f). -f*3 - 2f*2 Let y(x) = -337x*3 - 7. Let u(k) = 112k*3 + 2. What is -14u(c) - 4y(c)? -220c*3 Let w(t) = -601t*2 - 5t - 5. Let j(o) = -301o2 - 3o - 3. Give 5j(q) - 3w(q). 298q2 Let z(a) = -15a*3 - 8a + 14. Let q(g) = g - 27 - 21 - 20 + 10g3 + 4g + 59. Give 8q(w) + 5z(w). 5w3 - 2 Let j(y) = 2y + 2. Let w(k) = -4k - 6. Calculate -5j(o) - 2w(o). -2o + 2 Let p = 300 - 289. Let b(w) = -7w2 + 8w + 2. Let f(n) = -13n2 + 15n + 3. Give pb(m) - 6f(m). m*2 - 2m + 4 Let l(d) = -204d3 + 16d*2 - 32d. Let f(a) = -41a3 + 3a*2 - 6a. Calculate 16f(r) - 3l(r). -44r3 Let l(s) = 36s - 66. Let w be l(2). Let z(c) = -4c - 9. Let p(m) = 3m + 8. Give wz(h) + 7p(h). -3h + 2 Let m(k) = -7k + 1. Let d(n) = 4n - 16. What is -d(f) - 6m(f)? 38f + 10 Let w(b) = 502b - 18. Let z(l) = 335l - 13. Calculate -5w(d) + 7z(d). -165d - 1 Let b(f) = 2 - 1 + f + f*2 + 3f - 3f. Let p(r) = -8r2 - 2 + r2 + 3 - 6 - 4r. Let w(l) = l2 + l - 1. Let g be w(-3). Give gb(o) + p(o). -2o2 + o Let i be (3/2)/(90/660). Let h(y) = -5y*3 + 2y*2 - 2y + 2. Let d(k) = -24k3 + 11k*2 - 10k + 11. Give ih(a) - 2d(a). -7a3 - 2a Let h(d) = 131d3 + 5d*2 + 3d - 5. Let y(k) = -65k3 - 3k*2 - 2k + 3. What is 3h(p) + 5y(p)? 68p3 - p Let k(n) = 36n*2 + 7n + 9. Let j(l) = 18l2 + 4l + 5. What is 7j(p) - 4k(p)? -18p2 - 1 Let m(h) = 78h + 76. Let z be m(-1). Let r = -24 + 15. Let x(b) = -b*3 - 13b*2 - 13b. Let f(d) = 3d2 + 3d. Calculate rf(s) + zx(s). 2s3 - s2 - s Let q(d) = -9d - 103. Let o be q(-11). Let m(f) = -11f - 6. Let r(k) = -12k - 5. What is or(c) + 3m(c)? 15c + 2 Suppose 3b + 37 = 4c + 31, -2c = 0. Let i(j) = j2 + j. Let n(f) be the second derivative of f4/6 + f3/2 + f2/2 + f. Give bn(q) + 6i(q). 2q2 - 2 Let p(w) = w - 3. Let a(q) = 58q - 11. What is -2a(n) + 6p(n)? -110n + 4 Let z(b) = -7b*3 - 4b*2 - 6b - 6. Let s(j) = -6j3 - 3j*2 - 5j - 5. Let w be 1014/(-245)-7 - 10. Determine ws(r) + 5z(r). r*3 - 2r*2 Suppose -8 = 13s - 47. Let u(x) = -x - 4. Let n(t) = -4. Calculate su(c) - 4n(c). -3c + 4 Let s(q) be the third derivative of q4/12 + 3q*2. Let t(x) = -4x + 6x - x. Determine -s(d) - t(d). -3d Let o(a) = 16a2 + 11. Let q(r) = -10r - 10. Let y be q(-3). Let k be ((-16)/y)/(6/(-165)). Let s(x) = -3x2 - 2. Give ks(b) + 4o(b). -2b2 Let u(k) = k + 1. Let o(b) = -b2 + 2b + 4. Let v = -229 - -228. Calculate vo(i) + 4u(i). i2 + 2i Suppose 0 = 5w - 4d - 41, 3 + 2 = -3w - 5d. Let f(i) = 11i2 - 3i - 3. Let a(l) = 7l2 - 2l - 2. Determine wf(v) - 8a(v). -v*2 + v + 1 Let c(j) = 4j + 4. Let q(h) = 3h + 5. Let m = -52 - -59. Let a(x) = mc(x) - 6q(x). Let l(n) = 9n - 2. Give -5a(b) + 6l(b). 4b - 2 Let r(l) = 25l. Let f(u) = 12u. Suppose 3q = -0 + 9, -27 = -3k - 5q. Calculate kr(o) - 9f(o). -8o Let h(y) = 31y*2 + 7y - 37. Let w(r) = 15r2 + 3r - 15. Calculate 2h(o) - 5w(o). -13o2 - o + 1 Let u(q) = -3q*2 + q - 1. Let r(t) = 345t*2 - t + 2. Give r(h) + u(h). 342h*2 + 1 Let n(v) = 39v + 2v2 - 74v + 40v + 5. Suppose 2a + 3 = a - 3u, 0 = 5a - 4u + 34. Let t(j) = 3j*2 + 6j + 6. What is an(f) + 5t(f)? 3f2 Let a(b) = -8b - 6. Let h(i) = 7i + 6. Suppose 2f - 2d = 6 - 4, -3f + 33 = 3d. What is fh(z) + 5a(z)? 2z + 6 Let o(g) = 18*g - 8. Let l be ((-2)/(-4))/(1 + 25/(-30)). Le	{ "pile_set_name": "DM Mathematics" }
f + 10 = -f. Let l be (3 + f)/((-1)/(-5)). What is the greatest common factor of l and 35? 5 Suppose a = -2a. Suppose -l = -al - 17. Calculate the highest common factor of l and 85. 17 Suppose -3w + 3i = -24, 2w - 4i = 3w - 3. Calculate the greatest common divisor of w and 7. 7 Let x(g) = -g + 8. Let v be x(7). What is the greatest common divisor of 1 and v? 1 Suppose -3c = 3y - 402, 3c - 2y - 2y - 388 = 0. Calculate the highest common divisor of 33 and c. 33 Suppose -5c - 7 + 62 = 0. Suppose 4v = -2l + 484, 4v - 3v = -l + 121. What is the highest common factor of v and c? 11 Suppose 9 = 6s - 9. Calculate the greatest common divisor of 48 and s. 3 Let x(a) = a3 + a2 + 16. Let v be x(0). Calculate the greatest common factor of v and 8. 8 Let v be 12/2 + -58/(-20). What is the highest common factor of 64 and v? 8 Let u = 88 - 74. What is the greatest common divisor of u and 112? 14 Suppose 28 = 2q - 4n, -4q = -9q + 4n + 76. Suppose -a + q + 6 = 0. Calculate the greatest common divisor of 2 and a. 2 Let j(y) = -13y + 7. Let t be j(-7). Let x be 0 + -2(-4 - 3). Calculate the highest common factor of t and x. 14 Suppose -10 - 2 = -a. Calculate the highest common factor of a and 84. 12 Let f(b) = b - 3. Suppose 0x = -2x. Let c be f(x). Let k be 42/4(-4)/c. What is the greatest common divisor of 70 and k? 14 Let w(p) = -p. Let q be w(1). Let a = 5 - q. Let z be 3(-1)/4-88. What is the highest common factor of z and a? 6 Let y = 26 - 2. Suppose -476 = -14b + 532. What is the greatest common divisor of y and b? 24 Let a = 58 + 72. Suppose -b + q + 26 = -2, -5q + a = 4b. Let n = -12 + 24. What is the greatest common divisor of n and b? 6 Suppose -40 = -5t - 0. Suppose 9 - 3 = 3y. What is the greatest common divisor of t and y? 2 Let q(s) = -12s*3 - 1. Let k be q(-1). Let n = 3 - k. Let c be (n/3)/(3/(-9)). What is the highest common divisor of c and 12? 4 Let a be 64/(-10) + 14/35. Let k be 42/(a/(-2))1. What is the greatest common divisor of 56 and k? 14 Let o(k) = -67k - 14. Let c be o(-2). Calculate the greatest common factor of 6 and c. 6 Let i be 17/2 + (-1)/2. Suppose 4o = 3y - 7, 2o = 4o - 2y + 4. Let w be 0 - (-3 - o)i. What is the highest common factor of w and 24? 8 Let r be (-4)/18 - (-228)/54. Suppose rw + g = -1 + 6, 5w = g + 13. Calculate the greatest common factor of 22 and w. 2 Let o be (-7)/1426/(-2). What is the highest common factor of 1 and o? 1 Let t(m) = m2 + 5m - 10. Let p be t(-11). What is the greatest common divisor of 7 and p? 7 Let s(z) = -5z. Let b(w) = -4w. Let f(j) = 6b(j) - 5s(j). Let u be f(5). What is the greatest common divisor of u and 25? 5 Let d(a) = -a*2 + 2a - 2. Let t be d(3). Let f = 26 + t. What is the highest common divisor of f and 3? 3 Let u(z) = 2z + 44. Let i be u(18). Calculate the greatest common factor of 32 and i. 16 Suppose 7b + 15 - 204 = 0. What is the greatest common divisor of 81 and b? 27 Let f be (7/14)/((-1)/(-24)). Let u = -1 + f. Suppose -5k = -k - 308. What is the highest common factor of k and u? 11 Suppose 4k - 14 = 114. Calculate the greatest common factor of k and 8. 8 Suppose -3d + 3 = -4y, d = 4d - 3y - 6. Let x(m) = -m*3 + 4m*2 + 6m - 4. Let s be x(d). What is the greatest common divisor of 2 and s? 1 Suppose 0 = -21t + 23t - 60. Suppose 5y - 40 = y. Calculate the highest common factor of t and y. 10 Suppose 4s = -8 - 0. Let g be 4/s + 18 - 0. Calculate the greatest common factor of g and 16. 16 Let x be (-2 + 2 + -2)-32. What is the greatest common divisor of 8 and x? 8 Suppose -11m = -8m - 75. What is the greatest common divisor of m and 100? 25 Suppose -2v + 5 = 4b - 57, -3b - 194 = -5v. What is the highest common divisor of 37 and v? 37 Suppose -2f = -4f + 30. Let p = 47 - f. What is the highest common divisor of p and 80? 16 Suppose 5k - 7 = r + 10, -k + 1 = r. Let w(s) = -s*2 - 6s + 1. Let v be w(-7). Let o = v + 15. Calculate the highest common factor of k and o. 3 Let b(y) = 2y + 7. Let m be b(0). Calculate the highest common divisor of 56 and m. 7 Let y be (3 - 18/8)8. Suppose y = -s - 12. Let i = s + 32. Calculate the highest common factor of 154 and i. 14 Let i be (-2)/1(-14)/4. Calculate the greatest common divisor of 7 and i. 7 Let c be 3580/150 + 2/15. What is the greatest common factor of 84 and c? 12 Let g = 2 - -1. Suppose -gu + 103 = 5b, -u - 15 = -b + 4u. What is the highest common factor of b and 8? 4 Let n = 48 - -33. What is the highest common divisor of n and 9? 9 Suppose 3v - 130 = -2y, 0 = 2y - 3v - 69 - 73. Let m = -3 + y. Calculate the highest common divisor of m and 13. 13 Let r(a) = -5a + 4 + 4 + 4a. Let t be r(6). Suppose 0 = ti + 2k - 6k - 14, 2i + k = 19. What is the highest common factor of 6 and i? 3 Let m(a) = -a - 10. Let b be m(-10). Let f be (1 + 0)(b - -3). Suppose 42 = 2u - fw - 123, 4w + 395 = 5u. Calculate the highest common factor of 25 and u. 25 Let u be (1 + 74/(-10))-10. Let y be 28/(-98) + 58/7. Calculate the greatest common factor of y and u. 8 Let r(q) = 8q - 6. Let g = 18 + -15. Let u be r(g). What is the greatest common factor of 2 and u? 2 Let l(o) = o3 - 4o*2 - o - 2. Let z be (-1)/2-25. Let h be l(z). Suppose -31 = -5r + 14. What is the greatest common divisor of h and r? 9 Let w(q) = q*2 + 3q + 2. Let o be w(6). Let z be (121/(-3))/(-1). Calculate the highest common divisor of o and z. 7 Let h(y) = 0y + y + 2y2 + 5y + y. Let g be h(-6). What is the highest common factor of 75 and g? 15 Let u be (-1 - (-15)/(-2))2. Let s = -9 - u. Let j(h) = -3h + 29. Let t be j(9). Calculate the greatest common divisor of t and s. 2 Suppose -q + 10 - 6 = 0. What is the greatest common divisor of 14 and q? 2 Suppose -3c = -0c - 6. Let s be c6(-3)/(-2). What is the highest common divisor of s and 9? 9 Suppose 17 = 4h - u, -3h + 5u = h - 21. Suppose -hr - 8 = -4g, g + 2r - r = -8. Let k be g2/4-2. What is the highest common factor of 9 and k? 3 Suppose 3y - 7y - 5v = 13, -3y = -3v - 24. Let o(w) = -6w - w*2 - y - 3w + w. Let p be o(-5). What is the greatest common divisor of p and 12? 12 Suppose 0m + 3m + 1 = -2z, 3m = -4z + 1. Let h(f) = 5f*2. Let g be h(m). Suppose -t + gt = 180. Calculate the highest common divisor of t and 18. 9 Suppose -8u - 30 = -3u - 4z, 2u + 19 = 3z. Let h = u - -3. What is the highest common divisor of h and 8? 1 Suppose -9v + 4v = -40. What is the highest common divisor of v and 2? 2 Suppose -7u + 2u = -45. Let y be -1 + 3 - 1-217. Suppose 2i + i = -d + 213, 0 = 3i - d - y. Calculate the highest common divisor of i and u. 9 Let m be 3 + 2 + 32 + -2. Let a be 158/14 - 10/m. Let x = 109 + -21. What is the greatest common factor of a and x? 11 Suppose -3x - 5l + 3l = -9, 3x - 9 = -3l. Let a = 16 + -13. What is the highest common divisor of a and x? 3 Suppose 3l + 7j = 2j + 210, -j - 140 = -2l. What is the greatest common factor of l and 28? 14 Let s = 11 - 7. Suppose -2k + 74 = 2h, -sh - k + 67 = -90. Let b be 10(-4 + 4/(16/20)). Calculate the highest common factor of b and h. 10 Let c(p) = p2 - 10p + 6. Let j be c(4). Let a = j + 26. Suppose -4o + 9o - 4l = 308, 0 = -4o + 2l + 250. What is the highest common factor of a and o? 8 Let n = 8 + -13. Let i be 12 + n/(10/(-4)). Calculate the highest common divisor of i and 42. 14 Let f = -336 + 205. Let a = f + 203. Let p(z) = -2z - 3. Let k be p(-6). What is the highest common factor of k and a? 9 Let d(f) = f*3 + 8f*2 + 6f - 6. Let t be d(-6). Calculate the highest common factor of t and 15. 15 Let t = 85 - 29. Let l = -13 + 20. What is the highest common factor of l and t? 7 Suppose -11 = -3g + 3w - 5, 4w = -g - 8. Suppose -2z + 0d + 3d + 13 = g, 4z + 4d + 4 = 0. Let j = 3 + 5. What is the highest common factor of z and j? 2 Let w be (-135)/(-61/4). Let d be w/21 + 2/(-7). Calculate the greatest common factor of 2 and d. 2 Let z(k) = -3k*3 - 1. Let f be z(-1). Let m(t) = -3t - f + 15t2 - 7t*2 + 2t. Let a be m(2). What is the greatest common factor of 4 and a? 4 Let a be 54/4*(-4)/(-3). Suppose d = 60 - a. What is the highest common factor of d and 21? 21 Suppose	{ "pile_set_name": "DM Mathematics" }
ulate ((-11 - -9) + -15 - -2) + 3 - 4. -16 Calculate 12 + -24 + 4 + 5 + -1 + 6. 2 Calculate -7 + (-2 - (2 + 2 - 9)) + 5. 1 What is 1 + -8 + -2 + -1 + 0? -10 What is the value of (-9 + -14 - -5) + 9? -9 Evaluate -5 + ((-2 - 5) + 5 - (0 + -15)). 8 Evaluate 2 + -1 + 9 + (7 - (11 - -16)). -10 What is the value of 32 + (6 - 26) - 35? -23 Evaluate -5 + -11 + 10 + 0 + 11 + 2. 7 Evaluate (8 - 3) + (-2 + -22 - (-111 + 110)). -18 Calculate 9 - 11 - (-10 - (-1 - 4) - -4). -1 -8 + -5 + 54 - 27 14 Calculate 300 + -297 + -2 + -30. -29 What is (-26 - -1) + 181 + -168? -12 What is the value of -1 + 30 + -7 + -14? 8 What is the value of -4 + -1 + (-5 - (-28 + 14))? 4 Calculate (4 - 2) + -3 - (-4 + (-9 - -13)). -1 What is -1 + 1 - ((-37 - -42) + (1 - 6))? 0 Calculate -1 + 1 + -2 - (0 - (-10 - -23)). 11 Evaluate 2 + -54 + (-16 - -30) + 17. -21 What is the value of (7 - (13 - 13)) + -3 - (-5 + -2)? 11 What is the value of -9 + (26 - 11 - -6)? 12 Evaluate (8 + 5 + -7 - -5) + 0. 11 Calculate 7 - (11 - (9 + -1 + -9)) - 7. -12 10 - (-6 + 0 + 4 - -5) 7 12 + (-2 - -2) + -4 + 0 8 What is (-1 - -2) + -2 + 1727 + -1723? 3 Calculate -20 - -24 - (-2 + 1 + 29 + -38). 14 22 + (-8 - (-5 + -4) - 11) 12 Calculate 1 + (7 - (-9 + -3)). 20 What is (-18 + 27 - 2) + 7 + -2? 12 14 - 1 - (1 + 2 + (10 - 8)) 8 Calculate 1 + (-1 - (9 - (0 - -4))) - 9. -14 What is 25 + (-13 - (11 - 15)) + 9? 25 Evaluate (5 - (-2 + (2 - 2))) + (83 - 82). 8 What is 1 + (14 - (21 + -2))? -4 Calculate (-3 - 1) + 24 + 30 + -50. 0 Calculate (-16 + 23 - -2) + -7. 2 Calculate 7 - (-11 + 12 + -6 - (-2 - 1)). 9 Calculate 22 + -15 + 1 - (5 - -1). 2 Calculate (2 - 16) + (15 + -13 - (-2 - -2)). -12 What is (-12 - -3 - (-5 + 1)) + 24? 19 What is 11 + (-14 + 21 + -19 - -23)? 22 What is the value of 0 + 16 + -20 + -5? -9 What is 24 + -5 + 15 + -15 - 5? 14 What is the value of -246 + 260 + (-22 - -1)? -7 What is -11 + 17 + 15 + -31? -10 (33 - -21) + -47 + (0 - -6) 13 What is 0 - ((0 - -11) + (-37 - -55))? -29 Evaluate -6 + (9 - 15) - (-14 + 19). -17 What is 1 - -7 - (31 + -27)? 4 24 + (-3 - (-4 + 3)) + (9 - 4) 27 What is the value of -9 - (-1 + -17 + 7 - 0)? 2 Evaluate 9 - 1 - -8 - 7. 9 5 - (20 + -1 - (-78 - -77)) -15 (15 - (31 - 12)) + (-5 - (3 + -17)) 5 Calculate -8 + 15 - (2 - -8) - (-1 - -3). -5 41 + -1 + (-169 - -157) 28 10 - 8 - -2 - 3 1 What is the value of -455 + 428 + 2 + 1 + 0? -24 -1 + (-6 + -18 - -7 - -24) 6 What is (-11 - (0 - -2)) + (-22 - -41 - 11)? -5 Calculate 4 - 5 - 0 - (-52 + 41). 10 -1 + (0 - 2 - (-1 - 9 - -15)) -8 What is -38 - ((-36 - -23) + -35)? 10 Calculate 11 + -29 + 15 + -20. -23 Calculate 2 - ((-9 - -1) + (-2 - -9)). 3 Evaluate (64 - 70) + -3 + 2 + 1 + 7. 1 Calculate (-9 - -39) + -15 - 5. 10 What is -2 - (3 - (0 + 5) - (28 - 6))? 22 What is -30 + -31 + 30 - -40? 9 Calculate 3 + -4 + -2 + -4. -7 Calculate -19 - (34 - 49) - (-23 - 2). 21 Calculate -20 - (6 - (20 - 7)) - -4. -9 What is the value of 28 - (0 - -8) - 10 - (-17 + -4)? 31 Calculate 29 + (-26 - (-15 + -16)). 34 What is 6 - (27 - 23) - 5? -3 Calculate 3 + (3 - -7) + -2 + -7. 4 What is the value of -6 + (-7 - -3 - (-5 + (1 - -21)))? -27 What is (18 - -12 - 2) + -5 + 0? 23 -12 + 0 + -25 + 6 + 51 20 (-45 - -18) + 19 + (2 - -5) -1 Calculate 36 - 60 - (1 - (5 - -2)). -18 What is the value of 57 + (45 - 86) - (1 - 5)? 20 37 - (-15 - -26) - (14 - 0) 12 Evaluate (-14 - 0 - (-15 + 16)) + 7. -8 What is -3 - (-22 + (10 - (-1 - -2)))? 10 What is the value of 2 + (1 + -19 - (47 - 41))? -22 What is the value of 4 + 0 - (-9 + 9) - 15? -11 What is (-1 + 4 - 19) + 58 + -50? -8 Calculate -14 + 18 + 9 + -1 - 20. -8 Calculate 3 + (-6 + 11 - (0 - (0 + -1))). 7 0 - (13 + -13 + 5) -5 What is the value of 4 - (-6 + 0 + (1 - 6))? 15 Evaluate 23 - (-12 - 10 - -11). 34 What is the value of -19 + 6 + 2 - (-11 + 6)? -6 -5 + 17 + (-11 - (-2 - -18)) -15 Calculate (-24 - -13) + 13 + 0 - 11. -9 (16 - 32) + -5 + (13 - 1) -9 Evaluate 0 + 44 + -36 + 10. 18 What is 29 - (-4 - -9) - (4 + 10 - 8)? 18 Evaluate -66 + 74 - (-21 - 2 - (-2 - 2)). 27 What is (-1 - (1 - 5)) + (-1 + 6 - -2)? 10 0 - 8 - (-2 - (-13 + 8)) -11 79 + -91 + (-1 - 1) -14 What is 5 - (-1 + 0 + 13 + -8)? 1 What is -15 - (-18 + 4 + 1)? -2 Calculate (18 - (-3 - -16)) + -14. -9 What is the value of -14 + (-5 - (-29 + 33))? -23 Calculate 11 - (11 - 8) - (-3 + -1). 12 4 + 3 + 9 + (-4 - 4) + -24 -16 Evaluate 1 + -1 + -16 + 65 + -36. 13 Evaluate (-4 - 13) + 21 - (-3 - -24). -17 Evaluate 4 + -2 + (0 - 3) + (3 - 5). -3 What is -55 + 12 + 4 + 18 - -18? -3 Evaluate 4 + (-12 + 5 - -3) + -4 - -8. 4 Calculate (11 + (9 - 19) - 1) + 8. 8 Evaluate 9 + 71 + -46 + -6. 28 -1 + -4 + (56 + -16 - 32) 3 What is (-10 - 40 - -20) + 16? -14 Calculate (-470 - -473) + (0 + -1 + 0 - -1). 3 Calculate -12 + 3 - (-79 - -34) - 10. 26 What is 11 - (-2 + 1 - (-40 + 28))? 0 Calculate (-4 - ((-16 - 1) + 2 + -5)) + -2. 14 Evaluate (2 - -12) + 1 + 447 + -445. 17 Evaluate 49 + -27 + -5 + -1. 16 Evaluate -12 + 8 + (-13 - -3) + 10. -4 What is (2 - (-12 - -7)) + (-25 - -1)? -17 Calculate -2 - -57 - (-16 - -47). 24 Evaluate 26 + -13 + -22 + 17. 8 What is the value of 11 - (1 + 3 - (-11 + 8 - -8))? 12 Evaluate 20 + -214 + 207 + -7 + 0. 6 What is the value of (-4 - (11 + (-11 - -5))) + 21? 12 -39 - (27 + 12 - 58) -20 Evaluate 1 - -1 - (1 + 0) - (316 - 315). 0 Evaluate (21 - 7) + (-6 - -1) + -15. -6 What is -8 - ((16 - 36) + -2 + 0)? 14 What is the value of 11 + 1 + -11 + 8 - 7? 2 What is 6 + (3 - (-5 + -4)) + -1? 17 Calculate 43 - -9 - (4 - -23). 25 What is the value of 179 + -187 + 8 + -1? -1 What is the value of 7 - (-5 + (-8 - -8)) - (-12 + 16)? 8 What is the value of 5 + (10 - 0) + -25 + 25? 15 Calculate 131 - 95 - 70 - (-1 + -1 + 0). -32 Evaluate 20 + -38 - (14 + -67). 35 (-13 - (8 - 18)) + 8 + 7 12 Calculate (-2 - (-1 - -2)) + (-7 - -12). 2 -9 - ((-28 - -29) + -7) -3 What is the value of 15 - -15 - 15 - 36? -21 What is the value of -23 - (28 - 37 - (4 - 10 - 1))? -21 What is the value of (0 - 10) + (-81 - -84)? -7 Calculate 19 - (-42 + 78 + -19). 2 What is -4 + 25 + -7 + 0? 14 What is the value of 17 + (16 + -25 - ((2 - 0) + -3))? 9 What is -11 + -13 + 3 + 17? -4 What is the value of 12 - (-6 - (-4 - 8)) - 11? -5 What is the value of 0 + (10 + -4 - 11) + 0? -5 Calculate (-18 - (8 - 8 - (1 + 1))) + -4. -20 What is the value of -6 - (-7 + 13 + -16 + 6)? -2 Calculate (-9 - -37) + -18 - (20 + -2). -8 What is the value of 3 + 2 + -5 - (31 + (-41 - -43))? -33 Evaluate 7 - -1 - ((-11 - 3) + 12 - 7). 17 Evaluate 3 + (15 - (18 - -7)). -7 What is 46 + -21 + 3 - 49? -21 Evaluate (9 - 12) + -2 + -3 - -8. 0 What is 6 + (6 - (1 + 2)) - (-8 + 5)? 12 What is 3 - ((12 - (-1 - -8)) + 17)? -19 What is the value of 0 + 4 + (-13 - (1 - 4))? -6 What is (11 - (8 + -24)) + -20? 7 What is the value of (0 + 22 - ((-9 - -12) + 4)) + 4? 19 Evaluate -4 + -2 - ((0 - 1) + (-15 - 2)). 12 10 + (11 - (-9 - -1 - -15)) 14 Calculate 240 + -229 - ((-4 - -14) + -1). 2 What is 2 + (-11 + 13 - 8 - -10)? 6 What is the value of -6 + -1 + (29 - -39) + -81? -20 Calculate (2 - 3) + (-9 - (16 - 15)) - 21. -32 Calculate -379 + 402 + (-10 - -1). 14 What is the value of (87 - 98) + 4 + -2 + -6 + 10? -5 What is the value of 6 + -15 + (-8 - (2 + -8))? -11 What is -33 + 29 - (-3 + -22)? 21 What is 1 + (-4 - -1) - ((10 - 4) + -7)? -1 What is (13 - 16 - 8 - -20) + -5? 4 What is -7 - (0 + -3 + -2) - -2? 0 What is the value of 89 - (-61 - -131) - (1 + -3 - 1)? 22 What is the value of -42 + 54 + 1 - (1 - 16)? 28 (-8 - -12) + (0 - 2) 2 What is the value of -5 + 7 - ((10 - (-26 + 2)) + -2)? -30 -5 + -9 + 46 + -16 16 What is the value of 0 + 4 - 7 - -7 - -2? 6 Calculate (13 - (37 + (-9 - -10))) + 4 + 0. -21 Evaluate 8 + ((-3 - 4) + -7 - -6). 0 28 + (-1 - (7 - -10)) 10 What is the value of (-151 - -162) + -1 + 10? 20 39 - (-10 + 51 + -18 + -15) 31 -10 + (6 + -7 + 7 - (0 + 4)) -8 What is 0 + -19 + 4 + -12 + (9 - -2)? -16 What is 16 + -15 - (4 + 7) - (-1 - 3)? -6 What is 75 + -61 - (-2 + 23)? -7 Calculate -39 + 4 + -277 + 312. 0 What is the value of -6 + -8 + 12 + -11? -13 Evaluate 21 + (-1 - (5 - 3)). 18 2 - (0 + -61 + 35) 28 Calculate (-28 - (-3 - 1)) + (47 - 35). -12 Calculate (1 - 1) + -6 + -5 + 11. 0 Calculate 27 - 9 - 5 - (-4 + 2 + 3). 12 What is 7 + (-25 + 13 - (-4 - 4)) + 3? 6 Calculate 11 - 5 - -10	{ "pile_set_name": "DM Mathematics" }
t of 1884074 to the nearest integer? 5 What is the square root of 3721188 to the nearest integer? 1929 What is the square root of 2665454 to the nearest integer? 1633 What is 12695911 to the power of 1/3, to the nearest integer? 233 What is the tenth root of 19378300 to the nearest integer? 5 What is 4031859 to the power of 1/3, to the nearest integer? 159 What is the cube root of 1956313 to the nearest integer? 125 What is the cube root of 3519108 to the nearest integer? 152 What is the cube root of 9604318 to the nearest integer? 213 What is 8537737 to the power of 1/4, to the nearest integer? 54 What is the cube root of 137049 to the nearest integer? 52 What is 142815 to the power of 1/5, to the nearest integer? 11 What is 870182 to the power of 1/5, to the nearest integer? 15 What is the cube root of 44130745 to the nearest integer? 353 What is 714449 to the power of 1/3, to the nearest integer? 89 What is 1694447 to the power of 1/6, to the nearest integer? 11 What is the tenth root of 19119 to the nearest integer? 3 What is 1070526 to the power of 1/3, to the nearest integer? 102 What is the tenth root of 37128 to the nearest integer? 3 What is 158401 to the power of 1/2, to the nearest integer? 398 What is the square root of 9037314 to the nearest integer? 3006 What is the third root of 15309539 to the nearest integer? 248 What is 4330931 to the power of 1/3, to the nearest integer? 163 What is 535393 to the power of 1/9, to the nearest integer? 4 What is the ninth root of 35293 to the nearest integer? 3 What is the sixth root of 23131767 to the nearest integer? 17 What is the third root of 554466 to the nearest integer? 82 What is the tenth root of 721720 to the nearest integer? 4 What is the square root of 3620646 to the nearest integer? 1903 What is the cube root of 20657 to the nearest integer? 27 What is the third root of 5851726 to the nearest integer? 180 What is the square root of 734959 to the nearest integer? 857 What is 497211 to the power of 1/6, to the nearest integer? 9 What is the third root of 175129 to the nearest integer? 56 What is the square root of 320826 to the nearest integer? 566 What is 5539513 to the power of 1/3, to the nearest integer? 177 What is 627753 to the power of 1/2, to the nearest integer? 792 What is the third root of 346621 to the nearest integer? 70 What is 3291156 to the power of 1/4, to the nearest integer? 43 What is 172976 to the power of 1/3, to the nearest integer? 56 What is the square root of 176975 to the nearest integer? 421 What is the cube root of 8498687 to the nearest integer? 204 What is the square root of 7240297 to the nearest integer? 2691 What is 205276 to the power of 1/3, to the nearest integer? 59 What is 812481 to the power of 1/2, to the nearest integer? 901 What is the ninth root of 473042 to the nearest integer? 4 What is 430165 to the power of 1/3, to the nearest integer? 75 What is 2244673 to the power of 1/2, to the nearest integer? 1498 What is 4217147 to the power of 1/2, to the nearest integer? 2054 What is the square root of 24829 to the nearest integer? 158 What is the square root of 296879 to the nearest integer? 545 What is 18183281 to the power of 1/10, to the nearest integer? 5 What is the cube root of 17296645 to the nearest integer? 259 What is 404110 to the power of 1/7, to the nearest integer? 6 What is 39015 to the power of 1/2, to the nearest integer? 198 What is 1150902 to the power of 1/4, to the nearest integer? 33 What is the square root of 1617363 to the nearest integer? 1272 What is the fifth root of 777 to the nearest integer? 4 What is the third root of 2747441 to the nearest integer? 140 What is 286729 to the power of 1/4, to the nearest integer? 23 What is the cube root of 109078 to the nearest integer? 48 What is 13228972 to the power of 1/3, to the nearest integer? 237 What is the cube root of 3963845 to the nearest integer? 158 What is 4682036 to the power of 1/2, to the nearest integer? 2164 What is 806333 to the power of 1/6, to the nearest integer? 10 What is 9954961 to the power of 1/2, to the nearest integer? 3155 What is the square root of 426641 to the nearest integer? 653 What is the fifth root of 6175114 to the nearest integer? 23 What is 1406998 to the power of 1/6, to the nearest integer? 11 What is 4009300 to the power of 1/4, to the nearest integer? 45 What is 1118106 to the power of 1/3, to the nearest integer? 104 What is 89398 to the power of 1/10, to the nearest integer? 3 What is 5681472 to the power of 1/8, to the nearest integer? 7 What is the tenth root of 675579 to the nearest integer? 4 What is the cube root of 11555373 to the nearest integer? 226 What is 101665 to the power of 1/2, to the nearest integer? 319 What is the square root of 96440 to the nearest integer? 311 What is the cube root of 302851 to the nearest integer? 67 What is the cube root of 673750 to the nearest integer? 88 What is the square root of 146259 to the nearest integer? 382 What is 6672956 to the power of 1/3, to the nearest integer? 188 What is the fourth root of 226467 to the nearest integer? 22 What is the cube root of 694520 to the nearest integer? 89 What is 18753913 to the power of 1/3, to the nearest integer? 266 What is the square root of 311881 to the nearest integer? 558 What is the seventh root of 934037 to the nearest integer? 7 What is the tenth root of 167485 to the nearest integer? 3 What is 67309 to the power of 1/7, to the nearest integer? 5 What is the eighth root of 5366302 to the nearest integer? 7 What is the seventh root of 22534270 to the nearest integer? 11 What is the square root of 154088 to the nearest integer? 393 What is 3208706 to the power of 1/2, to the nearest integer? 1791 What is 1198223 to the power of 1/7, to the nearest integer? 7 What is 1728624 to the power of 1/2, to the nearest integer? 1315 What is the third root of 1625163 to the nearest integer? 118 What is the cube root of 49612 to the nearest integer? 37 What is the third root of 2926215 to the nearest integer? 143 What is 2708868 to the power of 1/2, to the nearest integer? 1646 What is the ninth root of 187015 to the nearest integer? 4 What is 13711234 to the power of 1/3, to the nearest integer? 239 What is the third root of 383014 to the nearest integer? 73 What is 192857 to the power of 1/5, to the nearest integer? 11 What is 6164117 to the power of 1/3, to the nearest integer? 183 What is the square root of 190402 to the nearest integer? 436 What is 1026715 to the power of 1/2, to the nearest integer? 1013 What is 849713 to the power of 1/3, to the nearest integer? 95 What is the square root of 1394815 to the nearest integer? 1181 What is 2482228 to the power of 1/3, to the nearest integer? 135 What is the square root of 224721 to the nearest integer? 474 What is the cube root of 18711443 to the nearest integer? 265 What is 11133836 to the power of 1/2, to the nearest integer? 3337 What is 6015388 to the power of 1/2, to the nearest integer? 2453 What is 644733 to the power of 1/7, to the nearest integer? 7 What is the square root of 451672 to the nearest integer? 672 What is 150386 to the power of 1/2, to the nearest integer? 388 What is the third root of 339957 to the nearest integer? 70 What is 12799312 to the power of 1/3, to the nearest integer? 234 What is 1137101 to the power of 1/10, to the nearest integer? 4 What is the square root of 32858 to the nearest integer? 181 What is the square root of 1940292 to the nearest integer? 1393 What is 17216459 to the power of 1/9, to the nearest integer? 6 What is 137961 to the power of 1/9, to the nearest integer? 4 What is 9186253 to the power of 1/3, to the nearest integer? 209 What is the square root of 2661091 to the nearest integer? 1631 What is the ninth root of 1818708 to the nearest integer? 5 What is the sixth root of 24343307 to the nearest integer? 17 What is the cube root of 1752147 to the nearest integer? 121 What is 7721295 to the power of 1/3, to the nearest integer? 198 What is the cube root of 145287 to the nearest integer? 53 What is the square root of 6989382 to the nearest integer? 2644 What is the sixth root of 1535440 to the nearest integer? 11 What is 651724 to the powe	{ "pile_set_name": "DM Mathematics" }
e of -8w - v - 5 - 2w + g wrt w. -10 Let j(h) be the third derivative of 26/3h3 + 49h*2 + 0h + 19/6h4 - 1. Differentiate j(y) with respect to y. 76 Let o = 207 - 203. Find the second derivative of 7y*3 - 3y*2 - 12y*3 - oy*3 - 51y - 2y3 wrt y. -66y - 6 Differentiate -18223l + 9110l + 2528 - 4419l3 + 9113l with respect to l. -13257l2 What is the second derivative of -18 - 50h + 5 + 4682h3 + 285937h*2 - 285935h*2 wrt h? 28092h + 4 Suppose -4z = g - 9z + 4, -4g + z + 22 = 0. Let b be -4g/(-4)2/4. Differentiate 8v*2 - 2087v + b + 2087v wrt v. 16v Suppose 0 = 13i - 419 - 153. What is the derivative of 77 + 137z - 17z + i wrt z? 120 Suppose -5n + 9317 = 6n. Differentiate -nb + 354b + 327b - 108 + 277b wrt b. 111 Let h(x) be the third derivative of -59x*6/6 + 139x*4/24 + 1638x*2. Find the second derivative of h(k) wrt k. -7080k Let u = -98 - -108. Suppose 5h + uh = 405. What is the third derivative of hb2 - 4b*6 - 24b*6 - 16b*6 wrt b? -5280b*3 Let t(g) be the third derivative of 2/7g*7 - 142g*2 + 0g*6 - 2/3g*3 + 0g + 0g5 + 1/2g*4 + 0. What is the second derivative of t(r) wrt r? 720r*2 Let c(n) = 9n - 124. Let i be c(14). What is the third derivative of 7r4 + ir*4 - 2r*6 + 53r*2 + 95r*2 - 179r*2 wrt r? -240r*3 + 216r Suppose 14y = 113 + 129 + 276. Let i(b) = b2 + 4b + 2. Let k be i(-4). Find the third derivative of 47x2 - yx*6 - 63x*2 + 40x*k wrt x. -4440x*3 Let l(s) be the first derivative of 1635s*4/4 + 2362s + 1678. What is the first derivative of l(d) wrt d? 4905d2 Let d(i) = -i3 + 14i*2 - 26i + 27. Let c be d(12). Suppose -4b = -6 - 6. What is the first derivative of -2 - qc + 3q*b + 3q*3 + 2q*3 wrt q? 21q*2 Find the second derivative of 152531r - 152441r + 63r*2 + 123r*2 - 2651r*2 wrt r. -4930 Let o(r) be the third derivative of 1169r*5/20 - 401r*4/2 + 1545r*2. Find the second derivative of o(d) wrt d. 7014 Let m = -198 + 230. What is the second derivative of 44 - 74c*2 + 35c*2 + 10c - 8c + mc*2 wrt c? -14 Suppose 3a = 8a - 70. Let h be (-28)/(-6) + (-2 - a/(-6)). Find the third derivative of -5p*5 + hp*2 - 13p*5 - 7p*2 - 8p*2 wrt p. -1080p*2 Suppose 2a - 221 + 211 = 0. Suppose 0c + 23 = 5c - l, 3c = 4l + 7. What is the third derivative of -v*c + 77v*2 - 67v2 - v5 - av5 wrt v? -420v*2 What is the third derivative of 2145105x*2 + 25x - 3425x6 + 321x*6 - 2145147x*2 wrt x? -372480x*3 Let t(s) be the third derivative of 109s7/35 - s5/60 - 5s4/24 - 367s*3/6 + 2292s*2 + s. What is the second derivative of t(v) wrt v? 7848v*2 - 2 Let l = -3803 - -3803. Let u(h) be the first derivative of -11/4h*4 + 7/2h*2 + 0h*3 + 9 + lh. Find the second derivative of u(z) wrt z. -66z Find the second derivative of -21u5 + u4 - 542u - 62u*5 + 70u*5 wrt u. -260u*3 + 12u*2 Suppose 0 = -39a + 1684 + 890. What is the second derivative of -62 - 5 - a - 45 - d + 48 - 168d4 wrt d? -2016d*2 Let d be ((0/(-3))/1)/(-2 + 5). Suppose d = 5t + 3i - 30, 4t - 4i + 13 = 5. Differentiate -33w*2 + 74w*2 + t - 40w*2 - 41 with respect to w. 2w Find the first derivative of -5o4 - 5o*4 + 8o*4 - 42o*2 + 481 - 265 + 264 wrt o. -8o*3 - 84o Let a(n) be the first derivative of 1204n5/5 + 35n*3 + 4n - 1936. Find the third derivative of a(x) wrt x. 28896x Let s(c) = 3409c - 2363. Let r(u) = -17044u + 11854. Let o(j) = 3r(j) + 16s(j). Find the first derivative of o(b) wrt b. 3412 Let r(l) be the second derivative of -l5/5 + 38l*3/3 - 3431l*2 - 90l - 3. Find the first derivative of r(x) wrt x. -12x2 + 76 Let r(f) = 31f*2 + 7f - 198. Let x(w) = -15w2 - 4w + 98. Let k(b) = -4r(b) - 7x(b). What is the derivative of k(p) wrt p? -38p Let n(a) = 3a*3 + 61a*2 + 17a + 61. Let p be n(-20). Find the second derivative of 25g5 - 28g + 128g + 21g + pg5 + 116g*5 wrt g. 5240g*3 Let o(l) = -5137l*3 - 5l*2 - 3141. Let c(n) = -2n*3 - 4n*2 + 1. Let b(s) = c(s) - o(s). Differentiate b(m) with respect to m. 15405m*2 + 2m Let p(q) = -6q3 - 5q*2 + 7q + 7. Let x be p(-2). What is the derivative of -46j + 87 - 2j*2 + xj + 11 + 22j wrt j? -4j - 3 Let j(z) = -4080z + 1270. Let y(s) = 4076s - 1259. Let o(h) = -5j(h) - 4y(h). What is the first derivative of o(a) wrt a? 4096 Let z be (-1)/(-1) - (-1 + 2 + -3). Suppose 80 = 4n - 0m + zm, 3n - 49 = -5m. Find the first derivative of n + 22i - 9 + 8 wrt i. 22 Suppose 152 = l + 148. What is the derivative of 14g2 + 6 - 24 - l + 41g*2 wrt g? 110g Let k(r) be the third derivative of 1/60r5 + 0r + 0 + 90r2 - 1/24r*4 + 5r*3. What is the first derivative of k(u) wrt u? 2u - 1 Let j = 117 - 113. Differentiate -18s2 + 24 + 18s*2 - 13 - 28s*j wrt s. -112s*3 Let g(o) be the first derivative of 1/3o*3 + 49/4o*4 - 2/5o*5 + 3o*2 + 0o + 67. Find the third derivative of g(r) wrt r. -48r + 294 Let r(a) = -42a*2 - 55a + 7974. Let k(u) = 44u2 + 55u - 7968. Let l(z) = 2k(z) + 3r(z). Differentiate l(c) wrt c. -76c - 55 Suppose -11w = -8w + 3t - 9, 0 = -5w + 5t + 5. Find the third derivative of 14s4 + 5s - 12s5 + 2s + 10s5 + 5s*5 - 4s*5 - 10s*w wrt s. -60s*2 + 336s Let k be -19(2 + 0 + -3). Differentiate -23d - 7d - k + 6 + 2 wrt d. -30 Let r(n) be the third derivative of 37n6/12 - n5/30 - 563n4/12 - 327n*2. Find the second derivative of r(k) wrt k. 2220k - 4 Let f(b) be the first derivative of 333b4/4 - 218b*2 - 778. What is the second derivative of f(o) wrt o? 1998o What is the third derivative of 20v2 - 3 + 3 + 12 + 8198v*6 - 8396v*6 wrt v? -23760v*3 Let x(q) be the first derivative of -65q*4 + 101q*3/3 - 9q + 3747. Find the third derivative of x(h) wrt h. -1560 Let w(s) = -1525s3 - 178s*2 + 5s - 19. Let p(d) = 1523d3 + 179d*2 - 4d + 16. Let f(h) = 5p(h) + 4w(h). Find the third derivative of f(x) wrt x. 9090 Suppose -3 = -m - w, 5m + 2w - 30 = -6. Find the third derivative of -1117i3 - 13i*2 - 2 + m + 1172i3 wrt i. 330 Let h(u) be the third derivative of -u6/60 + 1613u5/15 - 353u*4/12 + 5u*3/6 - 5455u*2. What is the second derivative of h(x) wrt x? -12x + 12904 Let w(b) be the second derivative of 0 + 0b3 + 43/6b*4 - 133/2b*2 - 25b. What is the derivative of w(c) wrt c? 172c Let w(b) = b3 - 6b - 1. Let u(d) = 11d3 - 15d*2 - 638d - 3. Let i(t) = u(t) + w(t). Find the second derivative of i(z) wrt z. 72z - 30 Let h(m) be the third derivative of 577m*7/105 - 387m*5/20 + 2m*2 - 232m. Find the third derivative of h(a) wrt a. 27696a Let d = 52 - 44. Find the second derivative of -22o - do2 + 56o - 167o - 110o*2 - 37o wrt o. -236 Let u(c) = 1294c4 - 6c*3 - 2c2 - 16. Let z(d) = d4 + 3d3 + d2 - d - 1. Let w(g) = u(g) + 2z(g). What is the second derivative of w(q) wrt q? 15552q2 Let h(x) be the second derivative of 1789x6/30 + x3/3 + 1165x2/2 - x - 742. What is the second derivative of h(r) wrt r? 21468r*2 Let x(c) be the first derivative of -2c*5/5 - 2c*4 + 826c*3/3 - 763. What is the third derivative of x(a) wrt a? -48a - 48 Let v be (24/(-16))/((-1)/2). Let h be 2/((2/v)/1). Find the third derivative of 10q3 + 11q*3 - 2q*h + 8q*2 wrt q. 114 Let c(r) be the third derivative of 0r - 23/2r3 + 0 - 71/24r*4 + 45r*2. Differentiate c(k) wrt k. -71 Let h(o) be the first derivative of 1363o*4/4 + 934o - 242. What is the derivative of h(v) wrt v? 4089v2 Let g(b) = 1. Let s(m) = -5m + 3. Let j(k) = -3g(k) - s(k). Let r be j(2). What is the first derivative of -4h4 - hr + 0 + 3 - 2 wrt h? -20h3 Let h(l) be the first derivative of -69l7/7 + l6/6 + 5l4 + l3 - 366l*2 + 6788. What is the third derivative of h(a) wrt a? -8280a*3 + 60a*2 + 120 Let m(a) = -87a3 + a2 + 6a + 4. Let c be m(-1). What is the second derivative of -37p - cp3 - 142p*3 + 54p*3 + 90p - 68p3 wrt p? -1452p Find the third derivative of -133r - 1197r*5 - 2153r*5 + 919r - 3r2 wrt r. -201000r**2 Let o(k) = 3524	{ "pile_set_name": "DM Mathematics" }
ect the terms in -27b - 3299 + 3299. -27b Collect the terms in -2u2 + 2857 - 2857. -2u*2 Collect the terms in -12s - 4s + 9s*2 - 6s + 22s. 9s*2 Collect the terms in 2j - 2j - 642j*2 + 649j*2. 7j*2 Collect the terms in 874 - 874 + 16f + 17f. 33f Collect the terms in 22a + 2a*2 - 51a + 29a. 2a*2 Collect the terms in -16s - 21 + 14 + 7. -16s Collect the terms in 5371z*3 + 9z*2 - 5363z*3 - 9z*2. 8z*3 Collect the terms in 6124 - 4b*2 - 6124. -4b*2 Collect the terms in 40i - 80i + 42i. 2i Collect the terms in -5 + 0 + 5 - 104s. -104s Collect the terms in 33 - 125g*2 - 33. -125g*2 Collect the terms in 5p - 2p2 + 2p - 7p. -2p*2 Collect the terms in -9f*2 + f - 14f*2 + 2f*2. -21f*2 + f Collect the terms in -14p*3 + 0p*3 + 1 - 1. -14p*3 Collect the terms in 5a + 2a + 3a - 7a. 3a Collect the terms in -9c2 - 4c*2 - 22c*2. -35c*2 Collect the terms in -2g*2 - 3246 + 3246. -2g*2 Collect the terms in 5856t - t*3 - 5856t. -t*3 Collect the terms in -1526 + 1526 - 24a. -24a Collect the terms in 13214 - q2 - 6608 - 6606. -q2 Collect the terms in 5h + 41 - 41. 5h Collect the terms in 2s*2 + 2s2 + s2 + 27s3 - 6s*2. 27s3 - s2 Collect the terms in -40r3 + 30r*3 + 11r3. r3 Collect the terms in 23p - 79p - 112p + 36p. -132p Collect the terms in 46l*2 + 265l*2 + 42l*2. 353l*2 Collect the terms in 14n - 32n + 28n. 10n Collect the terms in 12b*2 - 21b*2 + 6b*2. -3b*2 Collect the terms in -5h + 10h + 1 + 17h. 22h + 1 Collect the terms in -28i + 28i - 22i*2. -22i2 Collect the terms in -x2 + 4x2 - 5x2 + x2. -x*2 Collect the terms in -17v*2 + 15v*2 + 85v*2 + 42v*2. 125v*2 Collect the terms in -9 + 3b*2 + 0b*2 + 9. 3b*2 Collect the terms in -2 - 10r + 2r + 2. -8r Collect the terms in 28m3 + 75m*3 - 25m*3 + 73m*3. 151m3 Collect the terms in -x2 - 7x2 + 2x*2. -6x*2 Collect the terms in 528x - 47x3 + 50x*3 - 528x. 3x3 Collect the terms in 333b*2 - 3b + 3b - 335b*2. -2b*2 Collect the terms in -206a*2 + 404a*2 - 204a*2. -6a*2 Collect the terms in 3t*3 + 22t*2 + 3t*3 - 22t*2. 6t*3 Collect the terms in -8d*3 - 165d*2 + 165d*2. -8d*3 Collect the terms in 6o*2 + 7o*2 + 16o*2 - 28o2. o2 Collect the terms in 2l3 - 3l*2 + 6l*3 - 6l*3. 2l*3 - 3l*2 Collect the terms in 2o3 + o3 - 3o3 - 3o*3. -3o*3 Collect the terms in -1 - 130127m*2 + 130137m*2 + 1. 10m*2 Collect the terms in 3x - 33 - 3x + 2x. 2x - 33 Collect the terms in -1 - 173m*2 + 4 + 56m*2. -117m*2 + 3 Collect the terms in 22a - 29a + 5a. -2a Collect the terms in -6 + 14 - 5 - 9u + 15. -9u + 18 Collect the terms in 50k*2 + 197k - 197k. 50k*2 Collect the terms in j - 123117910 + 123117910. j Collect the terms in 13t + 9t + 16t + 4t. 42t Collect the terms in -69226 - 3b + 69226 + b. -2b Collect the terms in 58d3 + 65d*3 - 37d*3. 86d*3 Collect the terms in 20q*2 - 154q*2 - 10q*2 - 70q*2. -214q*2 Collect the terms in 10 - 9 - 1 + 14p*2. 14p*2 Collect the terms in -16y*2 + 25y*2 - 11y*2. -2y*2 Collect the terms in 8n3 - n3 + n*3. 8n*3 Collect the terms in -444 + 2l + 444. 2l Collect the terms in -15u2 + u2 - 2u2 + 18u*2. 2u*2 Collect the terms in -7o*2 - 13o*2 - 11o*2. -31o*2 Collect the terms in 613y*3 - 1232y*3 + 615y*3. -4y3 Collect the terms in j2 - 47 - 3j2 - 89 + 4j*2. 2j2 - 136 Collect the terms in 3 + 15 - q2 - 15 - 3. -q*2 Collect the terms in 15c*2 + 7c*2 + 7c*2 - 35c*2. -6c*2 Collect the terms in -141 - 5i*3 + 141 - 21i*3. -26i*3 Collect the terms in 6u - 3u - u + u. 3u Collect the terms in 1 + 206f3 - 209f*3 - 1. -3f*3 Collect the terms in -26p*2 + 8p*2 - 30p*2. -48p*2 Collect the terms in -65w + 31w + 32w. -2w Collect the terms in 7i*2 + 3i*2 + 2i*2 - 6i*2 + 0i*2. 6i*2 Collect the terms in 35s*2 - 49s*2 - 76s*2 - 2 - 10s*2. -100s*2 - 2 Collect the terms in -103v*2 - v + 100v*2 + v + 0v. -3v2 Collect the terms in -4 + 4 + 0 - 50m*3. -50m*3 Collect the terms in 14g*3 + 45g*3 - 15g*3 + 28g*3. 72g*3 Collect the terms in -4 + 6 - 2 + 64o. 64o Collect the terms in 4 - 10a + 11a - 4. a Collect the terms in -z2 + 148z3 + z2 - 127z3. 21z*3 Collect the terms in 19m + 7m - 14m. 12m Collect the terms in 11928 - 11928 + 3j. 3j Collect the terms in 1464 + 1442 - 4353 - 2k*2 + 1447. -2k*2 Collect the terms in -9r*2 + 7r*2 - 11r*2. -13r*2 Collect the terms in 6152 - 6152 + 9a. 9a Collect the terms in 0o*3 + 0o*3 - o - o + 4o*3. 4o*3 - 2o Collect the terms in -3t2 - 1147t + 1147t. -3t*2 Collect the terms in 4h*2 - 13h*2 + 5h*2 + 6h*2. 2h*2 Collect the terms in 42m*2 - 3m + 28m2 + 3m. 70m2 Collect the terms in 7d - 6d - 8d. -7d Collect the terms in s3 - 8s*3 - 5s3 + s3. -11s3 Collect the terms in -14n*3 + 1208n*2 - 1208n*2. -14n*3 Collect the terms in 154 - 70 - 2z - 84. -2z Collect the terms in -18o + 38o - 23o. -3o Collect the terms in -5i + 9i - 4i - 5i2. -5i*2 Collect the terms in 28x + 22x + 24x - 94x + 21x. x Collect the terms in 3z3 - 1072 + 1072. 3z*3 Collect the terms in -25 + 26 - 7 + 8k*2. 8k*2 - 6 Collect the terms in 9o + 1 - 1 + 14o. 23o Collect the terms in 2w3 - 3743w + 3743w. 2w*3 Collect the terms in -2 + 2m*3 + 126m*2 - 10 + 12. 2m*3 + 126m*2 Collect the terms in -18c - 27c + 47c. 2c Collect the terms in 11p*2 - 13p2 - p2. -3p2 Collect the terms in 4u - 4u - 6u + u. -5u Collect the terms in 0s - 16s + 9s. -7s Collect the terms in -110w*3 - 2 + 2 + 72w*3 + 53w*3. 15w*3 Collect the terms in -303d - 308d + 606d. -5d Collect the terms in 818j*2 - 9j*3 - 818j*2. -9j*3 Collect the terms in 11z - 22z + 2z. -9z Collect the terms in 10k*2 + 0k*2 + 2k*2. 12k2 Collect the terms in -230 - o2 + 0o2 + 227. -o2 - 3 Collect the terms in -6b*3 + 9b3 - b2 + b*2. 3b*3 Collect the terms in 774k - 4k2 - 774k - 11k2 - 3k*2. -18k*2 Collect the terms in -189045 + 189045 - 5q*3. -5q*3 Collect the terms in 36p - 9p + 13p. 40p Collect the terms in 5203j*2 - 32 - 5201j*2 + 32. 2j*2 Collect the terms in 3 - 3 - 1583c + 1586c. 3c Collect the terms in 619i2 - 1247i*2 + 628i*2 - 5i*3. -5i*3 Collect the terms in 39c*2 - 1 + 15c*2 - 17c*2. 37c*2 - 1 Collect the terms in -86 + 86 + 16x*2. 16x*2 Collect the terms in 2186r*3 + 4r - 2182r3 - 4r. 4r3 Collect the terms in 65193 + z2 - 65193. z2 Collect the terms in 531 - 2z - 1053 + 522. -2z Collect the terms in -6g*3 - 30g*3 + 31g*3. -5g*3 Collect the terms in 4 - 5 - 8u*3 + 1 + 9u3. u3 Collect the terms in 88w3 + 99w*3 - 85w*2 + 85w*2. 187w*3 Collect the terms in 29u - 11u - 7u - 5u - 7u. -u Collect the terms in -25l + 37l - 21l. -9l Collect the terms in -10f + 10f - 7f2. -7f*2 Collect the terms in -31c*3 + 3c - 3c + 35c*3. 4c*3 Collect the terms in 308x + 187x + 734x. 1229x Collect the terms in -2 + 18 - 5j*3 - 11 - 5. -5j*3 Collect the terms in -5 - 10b*3 - 1 + 7b*3 + 6. -3b*3 Collect the terms in 2d + 9d - 6d + 3d. 8d Collect the terms in -v*2 + 2v*2 + 3v*2 - 7v*2. -3v*2 Collect the terms in 5 + 1 - 2 - 3 + 77r. 77r + 1 Collect the terms in -22p2 - p2 - 3p2 + 2p*2. -24p2 Collect the terms in r2 - 2r + 2r + 10r2. 11r*2 Collect the terms in -8h*3 - 3h*3 + 8h*3. -3h*3 Collect the terms in 65 + 98 + 4d*2 - 163. 4d*2 Collect the terms in -13m - 18m + 48m - 11m. 6m Collect the terms in 1 - 1 + 3088y - 3099y. -11y Collect the terms in 104y*3 + 104y*3 - 206y*3. 2y*3 Collect the terms in 3339d*2 - 1106d*2 - 1114d*2 - 1116d*2. 3d*2 Collect the terms in -28g*3 + 2g*3 - 5g*3 - 3g*3. -34g*3 Collect the terms in 5r2 + 5 + 2 + r2 + 0r2. 6r*2 + 7 Collect the terms in -109y + 109y - y*2. -	{ "pile_set_name": "DM Mathematics" }
t(q) + oy(q)? -3q*2 Let n(u) = 380u*2 + 13u - 6. Let k(y) = -574y2 - 20y + 10. Give 5k(v) + 8n(v). 170v2 + 4v + 2 Let m(b) = 38b2 - 40b + 19. Let v(y) = -108y2 + 119y - 57. Give -17m(h) - 6v(h). 2h2 - 34h + 19 Let k(x) = 20x + 105. Let a(f) = -5. Calculate -a(r) - k(r). -20r - 100 Let o(j) = -j*3 + 2j*2 + 1. Let t(c) = -8c*2 - 31c - 3. Determine -4o(x) - t(x). 4x*3 + 31x - 1 Let b(w) = -1757 + 0w2 + w2 + 1757. Let p(a) = 3a*2 - a + 1. Determine -2b(g) - p(g). -5g2 + g - 1 Let q(t) = 982t - 2 - 333t - 327t - 331t. Let m(g) = -8g - 1. Let h(o) = 7o + 1. Let z(w) = -3h(w) - 2m(w). Calculate 4q(k) - 7z(k). -k - 1 Let k(b) = -2b + 7. Suppose n - c = -11, -3n - 5c - 13 = 36. Let a(h) = -h*2 + 4h - 15. Give nk(u) - 6a(u). 6u2 + 2u - 1 Let l(q) = 2q2 + 4q + 45. Let h be l(-9). Let i(s) be the first derivative of -98 + 3s - 90 + h + s2. Let j(r) = -6r - 8. Determine -8i(o) - 3j(o). 2o Let l(o) = o. Let x(t) = -2t*2 - 7. Suppose 3v + 21 = -3h, -4 = -2h - 22v + 23v. Calculate hx(a) + 2l(a). 2a2 + 2a + 7 Let d(k) = 3032k - 3032. Let x(g) = g - 4. Determine 3d(n) - 2274x(n). 6822n Let s(o) = 5o - 2o - 4o - 1. Suppose 55 = -7b + 62. Let m(y) = -19y - 36y - b + 56y. Give 2m(r) - 2s(r). 4r Let w(p) = -17p - 3. Let h(x) = -11x - 2. Let f be 24/(-48)(60/(-4) + 1). Determine fh(k) - 5w(k). 8k + 1 Let r(q) = q + 17. Let h(w) = -16 - 16 + 79 - 38 - 18. What is -7h(s) - 4r(s)? -4s - 5 Let f(x) = 7 - 25x*2 + 32x*2 - 17x*2 + x + 5x. Let g(a) = -9a2 + 5a + 6. Calculate 6f(w) - 7g(w). 3w2 + w Let i(r) = -6r. Let q(p) = 4p - 3. Let m(g) = 55g - 44. Let z(k) = -3m(k) + 44q(k). What is 5i(b) + 3z(b)? 3b Let c(m) = 1516m*3 - 40m*2 - 17m + 17. Let b(u) = -506u3 + 14u*2 + 6u - 6. Determine -17b(t) - 6c(t). -494t3 + 2t*2 Let g(d) = -4. Suppose 39c - 118 = -40. Let k(h) = h + 12. Give ck(y) + 7g(y). 2y - 4 Let o(s) = -84s*2 + 5s - 17. Let g(n) = 28n2 - 2n + 6. Suppose -49f + 47f = 3q + 24, 0 = 14q + 4f + 80. What is qo(j) - 11g(j)? 28j*2 + 2j + 2 Let k(o) = -2o3 + 13o*2 + 41o + 1. Let i(u) = u*3 - 7u*2 - 20u. Calculate -11i(x) - 6k(x). x3 - x2 - 26x - 6 Let h(k) = -4k*2 + 7k. Let g(l) = -105l2 + 323l*2 + 6l - 109l2 - 114l*2. Calculate -5g(p) + 6h(p). p2 + 12p Let x(a) = -5a3 - 5a*2 - 20a - 15. Let s(k) = -4k3 - 3k*2 - 19k - 14. Give 4s(d) - 3x(d). -d*3 + 3d*2 - 16d - 11 Let c(x) = x - 44. Let n(u) = -338. Determine -3c(o) + n(o). -3o - 206 Let l(t) be the second derivative of -t*5/20 - 2t*3/3 - 3t*2/2 - 18t. Let x(m) = -899m3 + 451m*3 + 3 + 5m + 449m3. Determine -5l(w) - 4x(w). w3 + 3 Let c be 29 - 3 - (-4 + 3). Let v(x) = -21 - 3754x + cx2 - 6x*2 + 3754x - 3x3. Let p(i) = -i3 + 5i*2 - 5. Give 21p(l) - 5v(l). -6l*3 Let u(b) = -145b + 7998. Let h(t) = -62t + 3998. Give 7h(q) - 3u(q). q + 3992 Suppose 0 = -p - 2 - 2. Let i(k) = k - 11. Let q(h) be the third derivative of -h4/24 + h3 - 110292h*2. Let z = -16 + 9. Give pi(t) + zq(t). 3t + 2 Let l be (-180 - -168) + 10 + 1. Let w(y) = y + 1. Let v(z) = 2z + 1. Give lv(s) + 3w(s). s + 2 Let m(i) = 1242i - 8. Let w(v) = -621v + 3. What is 2m(q) + 5w(q)? -621q - 1 Let f(z) = 7z - 5. Let w(x) = 18x + 14 - 6 - 6 - 10 - 4. Let o(t) = 2t2 + 37t - 31. Let r be o(-19). Determine rf(g) + 5w(g). 6g Let h(s) = -7. Let i(w) = 1632w + 5712. Determine 816h(m) + i(m). 1632m Let u(o) = -351o2 + 5o + 8. Let g(f) = -89f2 + f + 2. Calculate -9g(k) + 2u(k). 99k*2 + k - 2 Let h(q) = 567q*2 - 4. Let u(m) = -1129m*2 + 8. Calculate 7h(y) + 4u(y). -547y2 + 4 Let m(z) = z3 + z*2 + z. Let t(d) = 5d*3 + 6d*2 + 6d + 4. Suppose 108 - 91 = 3b - 2l, -5b = 2l + 9. What is bt(o) - 6m(o)? -o3 + 4 Let v(r) be the second derivative of -r4/6 - 3r2 - 1467r. Let b(z) = -z*2 + 1. Determine -5b(n) + v(n). 3n2 - 11 Let o(p) = 9p*2 - 8p - 5. Let y(i) = 2i2 - 20i - 1. Calculate -o(l) + 4y(l). -l2 - 72l + 1 Let v(u) = 2u2 + u - 56. Let y(j) = 51j*2 + 6j - 449. What is 6v(t) - y(t)? -39t*2 + 113 Let c(d) = 5d*3 - 5d*2 + 10d - 4. Let f(k) = -246297k + 246298k - k*2 + 3k*3 - 2k*3. Determine c(a) - 6f(a). -a3 + a2 + 4a - 4 Let t(f) = -41 + 30 + 12 - 24f + 14 + 9f. Let k(x) = -1. Calculate -15k(d) - t(d). 15d Let x(m) be the third derivative of -5m4/8 - m3/6 - 1346m2. Let r(p) = 8p + 1. Determine 5r(t) + 3x(t). -5t + 2 Let q(u) = 2. Let c(a) = -a + 14. Suppose 2m = -3p + 20, 3p + 0p = -m + 4. Let h be c(m). Let w(d) = d3 - d2 - 1. Calculate hw(j) - q(j). -2j3 + 2j*2 Let a(q) = 1841q + 5. Let j(l) = 3667l + 11. Give 13a(p) - 6j(p). 1931p - 1 Let p(x) = -144x - 726. Let v be p(-5). Let f(i) = 5. Let w(c) = -c - 4. What is vf(d) - 7w(d)? 7d - 2 Let x(p) = -4p3 - 6p*2 + 3p + 6. Let g(o) = -3o3 - 5o*2 + 3o + 5. Suppose 9 = 4q - 4m - 27, m = -3. Determine qg(y) - 5x(y). 2y3 + 3y Let k(y) = 34y2 + 2y - 2. Let j(p) = -237p2 - 15p + 15. Let r(g) = -2j(g) - 15k(g). Let d = -4 + 15. Let l(a) = -7a2. Calculate dl(i) - 2r(i). -5i*2 Suppose -4h + 3x + 33 = 0, 0 = -2h - 3x - 5 + 8. Let r(q) = 14q*2 + 8q - 29. Let f(s) = -5s2 - 3s + 10. Give hr(b) + 17f(b). -b*2 - 3b - 4 Let h(p) = -170p3 + 12p + 12. Suppose -3v + 33 = -3o, 5o + 0 = -4v - 10. Let c(x) = 68x3 - 5x - 5. Determine vh(z) + 12c(z). -34z3 Let t(k) = -4k*3 + k - 1. Let c(d) = 4d*3 - d + 1. Suppose 0 = -5z + y - 19, -19z + 16z + 4y - 25 = 0. What is zt(s) - 2c(s)? 4s*3 - s + 1 Let k(s) = 0 + 16s + 12s - 2 - 42s + 15s. Suppose z + 6 = 9. Suppose t - 3n - 1 = 4, -zt + 4n = 0. Let d(c) = -c + 1. Determine td(u) - k(u). 3u - 2 Let k(s) = -14s + 2743. Let x(n) = 15n - 2738. Calculate 13k(z) + 12x(z). -2z + 2803 Let t(x) = -x3 - 7x*2 - 6x + 1. Let k be t(-6). Let z(r) be the third derivative of r*4/24 - 24r*2 + 5r. Let l(o) = 3o - 2. Determine kl(m) + 4z(m). 7m - 2 Let m(q) = 2q2 - 1326. Let n(l) = -l2 + 663. Determine -6m(f) - 13n(f). f2 - 663 Let v(l) = -l2 + l + 1. Let w(n) = 3n*2 - 2n + 4. Suppose 0 = 1696f - 1736f - 80. Give fw(r) - 4v(r). -2r2 - 12 Let i(g) = -6g*2 + 15g + 76. Let k(p) = 4p2 - 10p - 53. Let a(n) = 5i(n) + 7k(n). Let r(d) = 2d2 - 6d - 9. What is 7a(v) + 6r(v)? -2v2 - v + 9 Let n(t) = 169t + 72. Let f(j) = 159j + 72. Determine 5f(o) - 4n(o). 119o + 72 Let o(d) = -5d3 + 3d2 - 1. Let m(a) be the first derivative of -a4 + 4a3/3 - a - 2506. Calculate -3m(n) + 4o(n). -8n*3 - 1 Let s(l) = -7l*2 - 3l + 3. Let a(t) = t2 + t. Let q(h) = -h3 - h*2 + 16h + 12. Let o be q(4). What is oa(n) - s(n)? 3n*2 - n - 3 Let t(j) = 54j*3 + 3j*2 + 3j - 3. Let x(a) = a3 - a2 - a + 1. Suppose -11 = 140f - 137f + h, -4f + 2h - 8 = 0. Give fx(y) - t(y). -57y*3 Let q(b) = -2. Let t be (-5)/(-1 - (-3)/(-2)). Let a(h) = h + 0h + 4 + 0h + 1. Suppose -19f = 27 - 122. Determine fq(v) + ta(v). 2v Let o(m) = m2 + 6m. Let p = -5789 + 5793. Let x(k) = -k. Let g(f) = f*2 + 4f + 4. Let t be g(-3). Determine px(d) + to(d). d*2 + 2d Let h(g) = 3g2 - 7g + 7. Let m(u) = -3u + 7u - 4 - u*2 + 0u*2. Suppose 0 = 5q - 2s + 53 - 41, 20 = -2q - 3s. Determine qh(f) - 7m(f). -5f*2 Let f(d) = -d. Let g(o) = -192 + 34 + 132 + 27 + 0o - 9o. Let q = -12 - -8. Give qf(l) + g(l). -5l + 1 Let q(b) = b + b + 146 - 74 + 4b - 73. Let z(s) = -s + 1. What is -q(m) - 2z(m)? -4m - 1 Let k(x) = 6x - 4 - 4x + x - 4x. Let v(d) = 3d + 8. Let f(g) = 2g + 5. Let t(a) = -7f(a) + 5v(a). Give -7k(p) - 6t(p). p - 2 Let d(v) be the third derivative of 4v*5/15 + 31v*4/24 + 11v*3/6 - 1184v*2. Let k(j) = -3j*2 - 6j - 2. What is 2d(x) + 11k(x)? -x*2 - 4x Let r(i) = i + 1. Let l be 3/(4-3) - 13/(-52). Suppose 4x + 24 = -lx. Let s(c) = -3c*2 - 3c - 3. What is xr(j) - 2s(j)? 6j2 Let l(t) = 14t*2 + 267t - 8. Let a(f) = -30f2 - 535f + 18. What is -6a(g) - 13l(g)? -2g2 - 261g - 4 Let x(g) = -4*g + 2. Let	{ "pile_set_name": "DM Mathematics" }
- 210/55) + 4. Solve g = 7s + 9s - 64 for s. 4 Suppose 0 = -7b + 60b - 4187. Solve -14f - b + 9 = 0 for f. -5 Let d = 4508 - 4500. Solve -4c + d = -6c for c. -4 Suppose 0i = 4i + 24. Suppose -45q - 16 = -40q - r, 4r - 24 = 0. Let n be (-15)/i + q + 39/2. Solve 0t - 5t = -n for t. 4 Suppose -1021u = -1036u + 30. Solve -u + 2 = 19o for o. 0 Suppose 7l = 8l + 88. Let i = l + 86. Let w be 506/66 + (2/(-3))/i. Solve 0 = -2u - w - 2 for u. -5 Let y = -35 - -94. Suppose -7i - y + 101 = 0. Solve -v - 10 + i = 0 for v. -4 Let d(b) = -76b - 5237. Let i be d(-69). Solve -61c = -62c + i for c. 7 Let g = -15091 - -15194. Solve 296 = -gu + 140u for u. 8 Let h be 17/(-1 + -50) - (-1516)/12. Solve 275s + h = 257s for s. -7 Let n be (1 - 3 - -7)(-1)/(-1). Suppose 14 - n = 2i + 3l, l = i - 7. Suppose -3r + i = 0, 3r + 20 = 5t - 2r. Solve m = -t + 1 for m. -5 Let n(y) = y3 - 6y*2 + 5y + 2. Let r be n(5). Let q = -18 + 29. Suppose 2f = v + 3, -4v = -7v + f + q. Solve j = rj - v for j. 5 Let h(m) = m*3 - 97m + 25. Let v be h(10). Solve -3d = vd + 464 for d. -8 Let h = -6943 + 7138. Solve 0 = 25w + 14w - h for w. 5 Suppose 5 = 4p - 5q, 13p - 9p - q - 1 = 0. Solve p = 33k - 0k + 198 for k. -6 Suppose -3f = -6 + 3. Suppose 0 = 5p - 2h - 7 + 4, -5h + 10 = 5p. Solve f = k - p for k. 2 Let k be (12/5)/(2/10). Suppose -d = -5y + 8, -3d + 18 = d + 5y. Let l be (-6 - 0) + 9 - d/(-1). Solve -lu = -u + k for u. -3 Let f be (-20)/6(-21750)/625. Solve 0 = 17y - 46y + f for y. 4 Suppose -22d + 789 + 483 = -1016. Solve d = 186u - 173u for u. 8 Let n(a) = a2 - 4a - 5. Suppose -3r + 3c = -12, -c = -2r - 0c + 11. Let x be n(r). Let g be 60/x - (5/(-4) - -1). Solve gw = -w + 10 for w. 2 Let w(z) = 2z*2 - 22 - 4z*2 - 4z + 23 + 0z. Let d be w(1). Let s be (-1)/4 + (-189)/(-36) + d. Solve -m - 3 + 5 = s for m. 2 Suppose 0 = -5y - 3b + 57 + 94, -64 = -2y - 3b. Suppose 0 = -3v - 2g - 20, -6 = v - 5g + y. Let q = v + 12. Solve -qu = -6 + 16 for u. -5 Let b = 39 + -31. Suppose -3f - b = -20. Solve -fg + 4 = -2g for g. 2 Let r = 142 - 144. Let m be 435/60 - r/(-8). Solve 2g = m - 9 for g. -1 Let f be ((-686)/(-12) - 2/12) + (-11 - -13). Solve 46q - fq - 91 = 0 for q. -7 Let h(b) = -2b - 5b + b2 - b - b - 2. Let c be h(-4). Solve 54j = cj for j. 0 Let q(o) = o2 - 32o - 64. Let z be q(34). Let m be -1 - z - (-36 - -31). Solve h + 0 - 3 = m for h. 3 Let t = 9173 - 8795. Solve 0 = 7r + 385 - t for r. -1 Let u(k) be the first derivative of -7k*3/3 - 25k*2 - 4k + 35. Let c be u(-7). Solve 1 = ca + 4 for a. -1 Let b(w) = 21w - 40. Suppose 4c = -2m, 5c + 0c + 2m = 2. Let j be b(c). Solve 0 = t + jt for t. 0 Suppose -12 = -3o - 0. Let a(j) = -1 + o - j - 8. Let m be a(-8). Solve mp + 5 = 2 for p. -1 Let o(l) = 4l2 - l + 4. Let c(z) = -2z + 52. Let d be c(26). Let u be o(d). Suppose -b = 2s - 13, -7s = -us - 5b - 39. Solve s = -x - 3x for x. -2 Let h(c) be the third derivative of -9c*4/8 - 8c*3/3 - 10c*2. Let k be h(-1). Solve 7u - ku - 4 = 0 for u. -1 Let x = 114 - 83. Suppose 2g - 17 = -5z - x, -4g - 3z = 0. Solve -gq + 16 - 4 = 0 for q. 4 Suppose 5q + 306 + 159 = 0. Suppose 0 = 2j + 3x + 211, -13j - 6x = -10j + 324. Let i = q - j. Solve 3f + 6 = if for f. 3 Let m be -2(1 + -3)/((-2)/12). Let t be -211/(-3) - 16/m. Suppose -b + tb = 35. Solve bn - 11 = 4 for n. 3 Let i = 668 - 645. Solve 14k - ik + 54 = 0 for k. 6 Let s = 649 - 649. Let j = 0 + 0. Suppose 0 = 50c - 14c - 144. Solve s = -n - c - j for n. -4 Let r be (83/166)/(1/38). Solve rd + 292 = 330 for d. 2 Let c(d) = 56d*2 + 4d. Let s be c(-1). Solve s = 12j + 4 for j. 4 Let o(q) = -q - 22. Let n be o(-27). Let s = -2 + n. Solve -sv + 1 = 7 for v. -2 Let f(v) = -v*3 + 21v*2 - 82v + 1726. Let u be f(21). Solve 0 = -ul - 168 + 196 for l. 7 Suppose 943 = 4i + 3y, 7i - 363 - 1281 = y. Solve i - 67 = -24f for f. -7 Let w be 1 + -1 + 0 + 0. Let d(q) = 6q - 104. Let b be d(27). Suppose 43u = -b + 230. Solve -x - 1 + u = w for x. 3 Let y = -55 + 51. Let t(f) = -f3 - f2 + 10f + 1. Let c be t(y). Solve -c = -13k + 56 for k. 5 Suppose 0 = -24819f + 24852f - 1122. Solve 0 = -2r + 26 - f for r. -4 Suppose 5j = 5d - 130, -8j - 3d - 154 = -3j. Let i = 29 + j. Solve 3o - o + 2 = i for o. -1 Suppose 0g - g = -3. Let m(y) = 9y - 176. Let j be m(21). Solve jl = 10l + g for l. 1 Let n = -3 + 5. Let g(p) = -4p + 66. Let c be g(16). Suppose -4b + 37 = -3i, 3b - 4i = cb + 19. Solve by = ny + 25 for y. 5 Let q(f) = -f*2 - 73f - 667. Let d be q(-62). Solve -dz = 29z + 132 for z. -3 Let o(x) = x*2 + 156x + 2531. Let t be o(-138). Solve -53v + 6 = -tv for v. 1 Let n be 42/(-8)(1 - -11). Let u(x) = 6x*3 + 32x*2 + 11x + 23. Let j be u(-5). Let q be ((-24)/21)/(j/n). Solve h = 2h + q for h. -4 Suppose 0 = 10f + 6 + 14. Let n be ((-2)/(-3)3)/(f/(-20)). Solve -4t - 4 = -n for t. 4 Let n(h) = -h*2 + 66h - 104. Let u be n(64). Solve -ub + 15b + 36 = 0 for b. 4 Let u = 299 - 297. Suppose -2p = up - i - 24, -p = 2i - 15. Solve 8k = 15 - p for k. 1 Suppose -603 = 5c + 34c - 2163. Solve 349z - 357z = -c for z. 5 Let z = 292 - 289. Suppose zs - 5t - 3 = -0, 4t = -5s + 42. Solve -2 = sg - 8 for g. 1 Let x be (-4)/6 + (-2 - 132/(-9)). Suppose -4u = -a - x, 0a = -2u + 4a + 20. Solve 6k - uk - 8 = 0 for k. 2 Let k be (-84)/(-7)(-3)/(-12). Suppose 31d = 34d - 4u - 19, 0 = 2d - ku - 13. Solve -20 = -dw - 0w for w. 4 Suppose 2 = 2w - 4. Suppose w = g + 1. Solve 4m + gm = 6 for m. 1 Let v = -2473 + 2558. Solve -17h + 0 = v for h. -5 Let d(y) = -5y - 41y + 80y + y*2 - 27. Let z be d(-35). Solve zk = -29 - 11 for k. -5 Suppose -84 = 21p - 35p. Let y(f) = -f*3 + 7f*2 - 13f + 46. Let u be y(p). Let k be ((-27)/(-6))/(3/8). Solve -k = ui - i for i. -4 Let t be (-2)/2 - (-60 + -35)3. Solve -19n = t - 208 for n. -4 Let o = 167 - 177. Let h(t) = t2 + 16t + 65. Let p be h(o). Suppose 35 + 42 = 5i + 4b, 0 = 4i - 2b - 72. Solve i = 3f + p for f. 4 Let i(p) = -2p*2 + 23p - 46. Let n be i(7). Suppose 3c - n = -8. Solve co + 6 = -9 for o. -5 Let f(z) = -2z3 - 12z*2 + 4z + 20. Let j be f(-7). Solve j = 24s + 18 for s. 3 Suppose -5t + 3t + 4o = -62, -5o = 2t - 98. Suppose 4c - 3 = q, -3q = q + c - t. Let a be 4/(-18)117/(-13). Solve q = -ad - d for d. -3 Suppose -3r = b + 2r + 6, 0 = 4b + 3r - 10. Let w = -22 + 26. Suppose 0 = -3o - ws + 40, 5s - 55 + 19 = -2o. Solve -bc + 0 = o for c. -2 Suppose 0 = 3p + 25u - 26u - 16, 5u - 16 = -p. Suppose 2d = 5g - 16, 4d = 4g - 0g - 8. Solve 2h - d = -p for h. -2 Suppose 165l - 93l - 4248 = 0. Solve lc = 29c - 60 for c. -2 Let j(w) = 3w + 48. Let r be j(-16). Let p be (r/(-4) + 9)/(6/2). Suppose -2d = 2d - 3u - 32, pd - 3u = 27. Solve -3 + 8 = -dc for c. -1 Suppose 2m + 5q = 31, -8m + 4m + 53 = q. Suppose 0 = -9f + mf - 24. Suppose 5j + f - 21 = 0. Solve 0 = 2k - jk + 3 for k. 3 Let r = 5234 - 5234. Solve r = 15q + 35 + 25 for q. -4 Let y(f) = 4f3 + 4f*2 - 4f*2 + 6f*2 + 2 + 11f*2 - 3f*3. Let i be y(-17). Solve 5l = -i + 7 for l. 1 Suppose 3y + 41 - 20 = 0. Let l be 58/y + 2/7. Let w be l/36 + (-56)/(-9). Solve 3d + 0d = -w for d. -2 Let a(k) = -36k + 89. Let u be a(6). Let n = 130 + u. Solve -2 = -b - n for b. -1 Suppose 137v - 5451 = 29. Solve vi - 66 = 62i for i. -3 Suppose -5y + 52 = 12, 5b - 91 = -4y + 21. Suppose 2i = i. Solve i = 2u + b - 26 for u. 5 Let n = -44 - -46. Suppose -nh = 2h. Let v = 9 - -3. Solve -4c + hc - v = 0 for c. -3 Let b = 629 - 618. Suppose -10l + 10 = -5c - 6l, b = -2c + 3l. Solve co + 2 + 2 = 0 for o. -2 Let g be 4 + 126/(-8) + 15/(-12). Let s(x) = 6x + 81. Let r be s(g). Solve 2p = rp - 2 for p. 2 Let o = 49 + -45. Suppose 4v - 13 = on - 3n, -3n + 4v = 15. Let r be -3 + (12 - -2) - (n - -2). Solve c - r = -c for c. 5 Suppose 0 = -3i - 2h - 28, 2h + 2h + 2 = 3i. Let w be (25 + -22)/(i/(-4)). Solve -wd + d = -2 for d. 2 Suppose 5c - 8 = -3o, -14 - 12 = -4o + c. Suppose 5f - 14 = 6. Suppose fs = os - 36. Solve -5l + s = -7 for l. 5 Suppose -4	{ "pile_set_name": "DM Mathematics" }
of (1/88-4)/((-26)/(-52))? -1/11 -313/((-234)/(-24)) -4 (44/(-33))/(16/48) -4 What is the value of ((-2)/42)/((-72)/504)15? 5 What is the value of 4/(-9)3/(-11)444/(-296)? -2/11 Evaluate -2((-15)/1353)/(2/66). 22 Evaluate 2/8706(-130)/52. -1/29 Calculate ((-170)/(-2125))/((-17)/(408/16)). -3/25 2/((-6)/35(-308)/(220/(-5))) -5/3 What is (1440/(-9660))/(6/9)? -2/23 Evaluate (-8)/(-26)((-9867)/(-92))/(-143). -3/13 What is the value of (11(-13)/(-39))/(1/(-15))? -5 Evaluate ((-8)/(-28))/((-222)/(-2849))3. 11 -26/((-192)/176)-12 -22 Evaluate (8/(-88))/((-5)/(-100)-10). 2/11 Calculate ((-65)/39)/(190/(-399)). 7/2 Evaluate 74/56160/(-1640). -2/41 (-3)/4(256/(-54))/(-8) -4/9 What is the value of 117/12140/105? 13 (21)/((-25)/(1350/72)) -3/2 What is the value of (-1412)/(408/(-68))? 14/3 Evaluate (-121)/(595441/(-222))(-21)/(-9). 2/19 -9(-1)/(-21)-66/(-27) -4/7 What is the value of ((-27)/36)/((-192)/(-2560))? -10 (-2(-2)/(-8))/(711/15642) -11 Evaluate ((-59)/(-118))/(21/181). 3/7 Evaluate ((-9)/6)/(44/(-88))88/12. 22 (19/(209/(-11)))/(-69/(-4)) -2/27 2264/12735(-10)/8 -2/9 Evaluate -3(-7)/(-21)-14/16. 1/4 Calculate ((-10700)/5136)/(1/((-18)/20)). 15/8 What is (-306)/(-510)10/4924? 2/41 What is the value of ((-40)/(-140))/(2/7)3/(-6)? -1/2 Calculate (((-24)/(-54))/(46/2691))/2. 13 What is the value of (-4)/((7/(21/(-45)))/(24/(-16)))? -2/5 Calculate (-7)/(30/((-90)/(-15))). -7/5 What is (-5470)/1641(-6)/(-110)? -2/11 Calculate (4/10)/(69/1380). 8 What is the value of ((-56)/(-80))/(39/(-78))? -7/5 What is ((6/(-21))/2)/(95/(-532))? 4/5 Evaluate 279/(-62)8/(-54). 2/3 What is (9/18)/((-26)/156)? -3 What is (40(-8)/8)/(-4)? 10 What is the value of (-36)/117(-78)/2? 12 Calculate 15/(26(-102)/(-1768)). 10 3/(-27)-215850/2275 6 (1/2)/((-969)/(-56202)) 29 (22/99)/(64/(-160)) -5/9 Evaluate ((-12)/(-3))/(312/(-18)12/8). -2/13 ((-3600)/2880)/(10/144) -18 ((-496)/(-186))/((8/(-4))/(-6)) 8 What is (-47)/((-658)/66)-7? -33 What is ((1/6)/(255/(-408)))/(42/15)? -2/21 Evaluate 12/2((-114)/6)/19. -6 What is (15/9)/136/(-48)? -5/4 Evaluate (-8)/(-10)(-30)/(-48)(-8)/(-2). 2 What is ((-7)/(-42)16)/((2/(-9))/1)? -12 Calculate (((-15)/18)/(5/27))/(36/192). -24 ((-2)/(-2))/((-28)/(-98)(-27)/18) -7/3 Evaluate (-64)/8(-8)/(-16). -4 What is (1815/484)/(3/(-8))? -10 Calculate ((-1204)/(-215))/(14/(-35)). -14 What is 6/(-165)(-30)/24-2? -1/11 (-91)/(-130)(-50)/420 -1/12 Evaluate 6/14(-8155)/139800. -1/40 What is (-39)/((-1755)/(-90))-1(-3)/(-177)? 2/59 Evaluate (-8)/(-10)(-125)/(-750)15/(-1). -2 (250/15)/(((-384)/(-72))/(-8)) -25 What is ((-1)/(5/6))/(336/(-56))? 1/5 Evaluate ((-35)/65)/(7/(-6)). 6/13 What is the value of (14/161711)/(2/(-42)-15)? 2/15 11/((-110)/60)16/(-2160) 2/45 What is the value of (-8)/650/144018? -5/6 What is the value of (-1539)/855(-6)/(-27)? -2/5 3/12(166/1079)/(5/26) 1/5 What is ((-56)/(-980))/(2/14)? 2/5 Evaluate ((-230)/(-161))/((-5)/35). -10 Evaluate (33/15428/12)/(-12). -1/24 What is (-12)/(-20)(-12)/16825/(-5)? 3/14 Evaluate ((-54)/29711)/((-1)/13). 26 What is the value of ((-26720)/4008)/(10/(-24))? 16 Calculate (99/(-6))/((-3)/2). 11 Calculate ((-210)/15)/(-70)1/((-7)/(-21)). 3/5 Evaluate ((-88)/8)/(-22)30. 15 Calculate (-380)/(-475)(-15)/2. -6 What is the value of (15/12)/(((-45)/(-216))/1)? 6 Evaluate -142/(-36)6. 7 What is the value of ((-3)/(-2))/((-50451)/1004)? -2/67 Calculate ((-110)/(-561))/(246/1394). 10/9 Evaluate 141(-2)/10(-100)/(-40). -7 ((-24)/7)/((-980)/1715) 6 What is the value of ((-18)/(-21))/(237/2212)? 8 (55/75)/(1111/(-606)) -2/5 Calculate ((-33)/11)/(7/(-14)). 6 Evaluate 63/((-9)/(-3))50/(-75). -14 Calculate (0/(-2))/(8/12(-126)/(-84)). 0 What is the value of (-20)/10(-51)/306? 1/3 (-8)/(-100)(-30)/(-8) 3/10 (4/2232/290)/(17/(-255)) -24 Calculate 1134/126(-2)/6. -3 What is the value of ((-10)/10)/84/(-17)? 1/34 (-630)/1890(-1)/((-1)/21) -7 What is (1204/1505)/((11/(-15))/1)? -12 Evaluate (-1)/((-14)/(-4))(-616)/(-440). -2/5 ((-23)/(-207))/(329/441)(-12)/42 -2/47 (31(-7)/7)/(5760/(-256)) 2/15 Calculate 2/5(-114)/76. -3/5 Evaluate ((-5)/30)/((-24)/8208-19). -3 What is (-12)/(-513)5/(-3)27/(-10)? 2/19 What is the value of (-174)/261(-24)/(-10)(-20)/(-8)? -4 Evaluate 2/5(-7315)/(-266). 11 What is the value of ((-30)/20)/(160/64)? -3/5 What is 3-8(-5)/(-280)? -3/7 What is the value of (((-30)/(-56))/(-5))/(167/(-668))? 3/7 What is the value of (-208)/260070/(-12)(-45)/(-3)? 7 (4/(-26))/((2/(-3))/(416/48)) 2 What is the value of (-30)/1374/748? -15 What is the value of (-3)/(63/28)(-7)/(245/(-15))? -4/7 32/(12/3)14/(616/(-3)) -6/11 Evaluate 6/(-112)(-3388)/847. 3/14 Evaluate 810/(-486)((-1)/5)/1. 1/3 What is (((-3)/(-3))/(9/(-117)))/((-22)/(-44))? -26 Evaluate ((-4)/5)/((-742)/14840). 16 What is the value of (-34)/((-3672)/198)(-30)/(-132)? 5/12 Calculate ((-220)/(-60))/((-6)/(-18)). 11 What is 3/(26/728-4)? -21 357/(-36)(-300)/(-75) -19 -125(-1110/(-220))/(10/4) -25 (3/4)/((-234)/52) -1/6 Evaluate (2550/(-3570))/(((-180)/(-14))/(-3)). 1/6 (-20)/(-3)2/(15/((-135)/12)) -10 Calculate (-6)/892/69. -1 Calculate (-264)/1968(-8)/22. 2/41 Evaluate (212/(-15))/(8/(280/7)). -8 (20/24)/(24/(-576)) -20 ((-3)/(-3))/((-42)/231) -11/2 What is the value of (6/3)/(-4)2(-102)/17? 6 What is (((-7)/(-196))/((-3)/4))/(635/(-381))? 1/35 ((24/10)/2)/(133/1330) 12 (1078/88)/49(-3)/(-24)6 3/16 Evaluate -5(5(-12)/(-100))/((-138)/(-4)). -2/23 (((-14)/7)/(6/21))/(1/1) -7 What is the value of ((-28)/(-90))/((-8610)/(-3690))? 2/15 Evaluate 70/45(-1152)/256. -7 Calculate (1-9)/(((-8)/12)/((-28)/42)). -9 What is ((-1)/((-5)/(-4)))/((16/(-40))/(-1))? -2 What is ((-10)/(-4))/(10361/3188)? 10/13 What is the value of (-33)/611/((-22)/4)? 11 What is the value of 40/(-12)48/128? -5/4 What is the value of (((-36)/27)/(5/3))/(10/5)? -2/5 What is the value of (-3)/(-24)21/((-168)/32)? -1/2 Evaluate (-124)/(-186)6/22. 2/11 Calculate (-83)/166(-4)/(-2)8. -8 Calculate (-2)/8-58(-128)/(-35264). 1/19 What is the value of (2/(144/10))/(345/207)? 1/12 Evaluate (-168)/(-60)(-10)/(-24). 7/6 Evaluate (-1)/(15/(240/(-56))). 2/7 What is the value of (458/1145)/((-1)/(-30))? 12 Evaluate (1/5)/(1280/3200). 1/2 What is (12/(-18))/(1/15)? -10 Calculate ((-54)/72)/(35/28). -3/5 Evaluate (4/((-4)/3))/((-1)/((-4)/12)). -1 What is (6/(-3)1)/((-21)/((-2520)/(-15)))? 16 (-4)/(((-580)/1015)/((12/7)/2)) 6 What is 7/(-6)(-80)/(-140)565/(-452)? 5/6 Calculate 1/202(-5549)/(-5549). 1/10 What is the value of 2/(18/(-1485)-11)? 15 What is ((-8)/(-14))/(18018/(-616)(-8)/21)? 2/39 Evaluate (23/((-92)/(-40)))/((-21)/(-21)). 10 Evaluate (4/18)/((-3)/(-54)). 4 28/(-8)(144/(-6))/(-6) -14 What is the value of (8/(-3))/((-7)/(84/(-8)))? -4 Calculate 22/16540-6. -32 What is (-3(-4)/18-2)/((-6)/1)? 2/9 Calculate (1062/(-590))/(2/(40/(-12))). 3 Calculate 20/(-195)316/(-256)12. 3/13 Evaluate ((-1)/2)/((-75)/(-600)). -4 What is the value of (7/(-196)6)/(95/60)? -2/7 Evaluate (15/50)/(7/(70/(-4))). -3/4 What is 25/(-30)(-9)/60? 1/8 (-1)/(3/(-6))(-154)/84-3 11 What is the value of (-49)/(-98)-7(-6)/12-4? -7 (((-2)/12)/((-74)/(-999)))/(9/6) -3/2 What is (-30)/(-20)32/(-168)191? -26 Calculate (33/18(-72)/198)/((-4)/(-18)). -3 Calculate ((-2484)/1449)/(22/42). -18 What is ((-15)/(-5580)-3)/((-7)/(-56))? -2/31 ((-3)/4)/((-13)/(1248/1080)) 1/15 Evaluate 47/(-611)13(-21)/(-3). -7 Evaluate (891/(-162))/((1/(-2))/(-1)). -11 Evaluate ((-4)/2)/((-4)/(-42)(-2303)/188). 12/7 Calculate (66/(-120)-10)/(3/6). 11 (9(-9)/162)/(8/((-192)/402)) 2/67 What is the value of 19/(-38)3/(-6)0? 0 What is the value of (-1)/((-2)/(-4)(-9)/(36/(-8)))? -1 Calculate (7/((-84)/8))/(8918/(-3087)). 3/13 What is 40/(-75)-320/(-4)? -8 4/(-5)42/140-25 6 -2(-39)/(-26)322/(-42) 23 ((-4424)/108388)/((-2)/(-7)) -1/7 145/(-58)(-240)/(-50) -12 Calculate 462/(-154)(-4)/(-30)(-250)/(-5). -20 What is the value of ((-680)/(-21250))/((-2)/(-5))? 2/25 Calculate (-4((-88)/144)/11)/(40/(-90)). -1/2 What is the value of ((-6(-10)/8)/(-3))/((-27)/(-12))? -10/9 Calculate 9/(-99)-11(2/(-2))/1. -1 Evaluate 6/9330/(-20). -11 What is (73/(-219))/(13/(-3))? 1/13 Evaluate (-5(-12	{ "pile_set_name": "DM Mathematics" }
he smallest common multiple of 3 + -1 + (-1 - -15) and y. 16 Let r be (-2)/(33/9 + -3). Let x(o) = -o*2 - o + 4. Let f be x(r). What is the common denominator of 83/16 and (-2)/(-6)11/f? 48 Suppose -5t + 3 = -72. Suppose 0 = -4m - t - 9. Calculate the common denominator of ((-82)/6)/((-28)/m) and -55/12. 84 Suppose -2d - 52 = -4j, d + j + j + 34 = 0. Find the common denominator of ((-36)/(-210))/(8/d) and -149/6. 42 Let b = -125 - -129. Calculate the smallest common multiple of 26 and b. 52 Let m be (-2)/(-6)45/222. Let g = 3867/814 + m. What is the common denominator of g and ((-9)/(-40))/(12/368)? 110 Let s = -54877/22 - -2492. Calculate the common denominator of s and 25/8. 88 Suppose 3w = 4g + 80, -4w + 2w + 15 = -g. Let v = 43 + g. Calculate the least common multiple of v and 14. 140 Let h = -22/199 + 10723/1592. Find the common denominator of h and -133/6. 24 Suppose 0 = -10t + 5t - o + 10, -8 = -4t + 2o. Let i(c) = 2c - 6. Let j be i(4). What is the least common multiple of j/((2/8)/1) and t? 8 Suppose -65 = -6f - 7f. What is the least common multiple of 5 and f? 5 Let y be (9/(-27))/(2/6). What is the common denominator of (y/6)/((-4)/400) and 35/13? 39 Let x(q) = -q*3 - 3q*2 + 3. Let b = 4 - 7. Let t be x(b). Calculate the common denominator of 55/2 and t/(36/(-51)) - 1. 4 Suppose -4 = 2l - 5n + 2n, l = n. What is the lowest common multiple of l and 28? 28 Let n(u) = u*3 + 6 + 8u*2 - 9u - 2u3 - 4u + 4u. Let f be n(7). Calculate the smallest common multiple of (-46)/f + (-4)/(-16) and 16. 48 Let c = -1817/3 - -19876/33. Find the common denominator of c and -39/10. 110 Let u(o) = o3 + 9o*2 + 6o - 8. Let r = -5 - -8. Suppose c + 4x - 19 = -7, 0 = c - rx + 23. Calculate the smallest common multiple of 5 and u(c). 40 Suppose -v + 6v - 40 = 0. Let u be ((-342)/v)/((-1)/(-6)). Let l = 244 + u. Calculate the common denominator of -125/18 and l. 18 Let n(h) = 13h*2 - 1. Let g be (-6)/(-4) + (-50)/20. Calculate the lowest common multiple of n(g) and 8. 24 Let o(k) = 11k*2 + 2k + 1. Suppose s - 4s - 3 = 0. Calculate the least common multiple of o(s) and 4. 20 Calculate the common denominator of -67/21 and -3 - ((-30)/(-45) + (-10)/(-8)). 84 Let t = 255 + -155. What is the lowest common multiple of t and 12? 300 Calculate the common denominator of 2 - (781/12)/11 and 47/22. 132 Let m = 143/590 + -1/5. Let u = -969/590 + m. Calculate the common denominator of 37/3 and u. 15 What is the common denominator of 279/24 + 6/(-4) and -31/7? 56 Let p = -64 + 94. What is the smallest common multiple of p and 8? 120 Let d = -10081/2870 - 56/205. Find the common denominator of 97/4 and d. 28 Let b be (20/8 + -3)0. Suppose b = 3w - 2w - 22. What is the least common multiple of w and 14? 154 Let m be ((-83)/2)/((-6)/(-21)). Let r = 4171/28 + m. Let x = 655/111 + 16/37. Find the common denominator of x and r. 21 Let s = 67 - 53. What is the smallest common multiple of 8 and s? 56 Find the common denominator of (-4)/(-30)160/(-6) and -39/10. 90 Suppose 5j + 119 = 169. Suppose -3l = -3w + 6, 0 = -2w - 3w - 3l + 2. Calculate the lowest common multiple of w and j. 10 Let k = -4 + 8. Calculate the common denominator of (-81)/12 - 2/k and 101/3(-3)/(-12). 12 Let i be (-8)/3(-90)/4. Let f = i - 359/6. Calculate the common denominator of 0 + 48/14 + -1 and f. 42 Let s(b) = -b - 82. Let z be s(0). Let j = -6/35 + -17/7. Calculate the common denominator of j and (z/(-8))/((-11)/(-4)). 55 Let r = 2553/19 - 223825/1406. Let z = -3143/3 - -116366/111. Let h = z - r. Calculate the common denominator of h and 37. 2 Let n = -258127/20 + 12911. Suppose -r + 2h = 4, 0 = -5r - 0h - 5h + 25. Find the common denominator of 1 - (r + (-37)/(-20)) and n. 20 Let j = 6991/390 - 217/13. Find the common denominator of -11/18 and j. 90 Find the common denominator of -1/36 and ((-110)/12)/((-10)/(-15)). 36 What is the least common multiple of 26 + 2/(-3)(7 + -10) and 14? 28 Let l = 141/2 - 110. Calculate the common denominator of l and 97/24. 24 Let i = -3 - -4. Let l(x) = 6x - 1. Calculate the smallest common multiple of l(i) and 2. 10 Let h = -161663/67078 - -3/3049. What is the common denominator of -79/16 and h? 176 Suppose -g = -2t - 3 - 3, 2t = 2. Suppose -ga = -7a - 20. Let l(j) = -j2 - 5j + 8. What is the lowest common multiple of l(-6) and a? 20 Calculate the common denominator of 38/7 and (-215)/(-24) + 26/39. 56 Suppose 0 = -3u + 15 + 9. Let b = -24 - -47. Suppose 4q - b = -0q - 5j, -3q + 20 = j. Calculate the lowest common multiple of u and q. 56 What is the lowest common multiple of 9 and -4(-32)/8(-1)/(-2)? 72 Let v = -10478 - -62731/6. Let o(t) = 3t. Let k be o(-1). Find the common denominator of k + 10/(-16)3 and v. 24 Let n = 0 + 1. Let o(u) = u + 1. Let j be o(n). Suppose -4p + jl = -32, 3p + 2l - 42 = -l. What is the smallest common multiple of 2 and p? 10 Find the common denominator of 6/14(-104)/(-16) and 17/8. 56 Suppose 0 = -5r + 7 + 13. Let o(s) = 8s + 1. Let c be o(r). What is the common denominator of -125/18 and 21/(-6)c/(-56)? 144 Let v = 0 - -3. Calculate the lowest common multiple of v and 17. 51 Let u = -2/52877 - 169757/158631. What is the common denominator of u and 70/27? 513 Let s = -9 - -27. Calculate the smallest common multiple of s and 12. 36 Let m(s) = s2 + 3. Let z be m(0). Suppose -4i = -0i - zd - 9, 3d + 9 = 2i. Let u = 2 + i. What is the smallest common multiple of 4 and u? 4 Let g = 35 - -4762. Let r = 48/278459 - 18708825505/3898426. Let f = r + g. Calculate the common denominator of -41/22 and f. 154 Let m(s) = s*3 + 7 + 3s + 8s - s2 - 10s. Let d = 20 - 14. What is the lowest common multiple of d and m(0)? 42 Suppose -11k = -17 - 423. Calculate the least common multiple of k and 15. 120 Suppose t + 4t - 20 = 0. Calculate the common denominator of 1110/24 + 1/t and 31/12. 12 Let r be (4 - -4)1/2. Suppose -5d + rm + 84 = 0, -2d - 2d - 4m + 60 = 0. What is the lowest common multiple of 18 and d? 144 Let v be (-1566)/(-10) - 6/10. Let t = -26/57 - 65/38. Calculate the common denominator of (v/(-40))/((-8)/10) and t. 24 Let k = 1 + 2. Let u be 0/(k + -1)-1. Suppose b - 6 - 10 = u. What is the lowest common multiple of b and 18? 144 What is the smallest common multiple of (264/40 - (-6)/(-10))/1 and 13? 78 Let l = 748017989/18 + -41545657. Let f = 10901 - l. What is the common denominator of (38/108 - 1)3 and f? 18 Let i = -3226/7 - -103785/224. Find the common denominator of i and 75/2. 32 Suppose -2d + c - 2 + 22 = 0, -5c - 55 = -5d. Let k be (-14)/(-12)2d. What is the smallest common multiple of 22 and 90/k - 2/7? 44 Suppose -16 = 4p - 2q - 2q, -p - 5q - 4 = 0. Suppose -3a + 8 = -2a. What is the common denominator of 2/p + 26/a and 59/6? 12 Suppose -w = 2w - 4a, -3a = 4w. Suppose 2h = -w + 8. Calculate the lowest common multiple of h and 4. 4 Let w = 311819/154 + -6626/7. Let g = w - 1078. What is the common denominator of g and 31/16? 176 Let v be (-508)/(-410) - 6/(-4). Let c = -18/41 + v. What is the common denominator of -63/2 and c? 10 Let z = -40297/6 + 6741. What is the common denominator of z and (23/15)/(1/6)? 30 Let q = -1996/3 - -649. What is the common denominator of q and -62/5? 15 Suppose -3z + 5w = -6z + 25515289, -5w = -5z + 42525495. Let g = z - 101979955/12. Let i = 6763 - g. What is the common denominator of i and 57/20? 60 Find the common denominator of 5 + -10 + 7 + 53/(-21) and 23/10. 210 Let a = 551 + -341. Calculate the common denominator of ((-7)/(-15))/((-18)/a) and 27/10. 90 Let y(w) = -7362w*2 - 3w - 3. Let x be y(-1). Let v be (-3)/66(0 + -162039). Let f = v + x. Find the common denominator of f and 47/4. 44 Let z = 9 - 4. Let n(c) = c3 - 2c*2 + 2c. Let s be n(2). Suppose 5h + 3a - 4 = sh, 5a = 3h - 26. Calculate the least common multiple of z and h. 35 Suppose -2i + 9 + 17 = 4v, 0 = 2i + v - 17. Suppose 3f + i = -11. What is the common denominator of -58/5 and (f/(-10))/(6/(-76))? 5 Suppose 3 + 0 = -3s. Calculate the smallest common multiple of 1 and s/3 - 38/(-6). 6 Let x = 605/12 - 178/3. Calculate the common denominator of 3/4 and x. 12 Let y(z) = 1 + z - 2*z +	{ "pile_set_name": "DM Mathematics" }
. Let d be n/10(-75)/(-3). Calculate the highest common factor of d and 150. 30 Let f = 92 - 12. Suppose -42 = 5y + 28. Let p = y - -30. Calculate the highest common divisor of f and p. 16 Let s(i) = -134i3 + i2 + i - 1. Let p be s(-1). Let l = 39 - 20. Calculate the highest common divisor of p and l. 19 Suppose -9 = 9v - 6v. Let y be (0 - -1)v - -87. Calculate the highest common divisor of y and 12. 12 Let i(p) = -15p - 79. Let u be i(-9). Calculate the greatest common factor of 42 and u. 14 Suppose 13b = 4b - 90. Let y(h) = -8h - 64. Let o be y(b). Calculate the highest common divisor of 96 and o. 16 Let t be (-7)/(-2) - 80/32. Let g be -4 + t + (0 - -7). What is the highest common divisor of g and 44? 4 Let h be 3 + -1 - (5 + -35). Let t = -31 + h. Calculate the greatest common divisor of t and 1. 1 Let v(t) = -t*3 - 6t*2 + 6t + 8. Let w be v(-8). What is the greatest common factor of 22 and w? 22 Let w = 177 + 83. Suppose -v = 2r - 52, 7v - 4r = 2v + w. Calculate the greatest common factor of 13 and v. 13 Suppose -2y + 92 = -m - m, -y = 5m + 242. Let a be (-800)/m + (-4)/6. Let j be 1581/12 + 4/a. Calculate the greatest common divisor of 12 and j. 12 Suppose -4k - 848 = 2x - 6x, 856 = 4x - 2k. What is the greatest common divisor of x and 56? 8 Let g = 91 + -97. Let u be (-22)/g - 0 - 6/9. What is the greatest common divisor of 27 and u? 3 Suppose 4r - 20 = -7o + 3o, 2r - 12 = -3o. Calculate the greatest common factor of r and 5. 1 Let k be 2/(-2)(2 - (6 + -3)). What is the highest common factor of 71 and k? 1 Let c = -473 - -766. Let n = -181 + c. Calculate the highest common divisor of 28 and n. 28 Suppose -3s = 4s. Suppose -2d + 0d = 0, s = -a - 3d + 13. Calculate the greatest common factor of a and 221. 13 Let p be ((-8)/(-12))/(4/42). What is the highest common factor of 217 and p? 7 Let v(a) = -a*3 - 3a*2 - 3a + 2. Let t(d) = -d*2 + 4d - 6. Let s be t(4). Let c be v(s). Let r = -44 + 60. What is the greatest common divisor of c and r? 16 Let i be (9 - 4) + 184/46. Calculate the greatest common divisor of i and 621. 9 Let b = 610 - 595. Calculate the highest common factor of 30 and b. 15 Let s be ((-288)/(-5))/(1/5). Let t(c) = -175c + 561. Let x be t(3). Calculate the highest common factor of x and s. 36 Suppose 21d = 1609 + 1037. Let c = -25 - -43. What is the highest common divisor of c and d? 18 Suppose -5w + 175 = -3s + 1, 0 = -2w + s + 70. Calculate the greatest common divisor of 1332 and w. 36 Let s = -75 + 50. Let r be ((-1340)/s - 4) + 6/(-10). What is the highest common factor of r and 7? 7 Let c(o) = -2o + 4. Let d(t) = -4t + 9. Let h(k) = -7c(k) + 3d(k). Let m be h(2). Suppose 173 = mz + 47. What is the highest common divisor of 63 and z? 21 Let j be 2 - 2 - 2 - -4. Let u = 42 - 35. Suppose 72 = 5l - 4c, -4l = -ul - jc + 52. What is the highest common divisor of l and 96? 16 Let d = 60 + -33. Suppose -20c + 1584 = -9c. Suppose 13i - c = -3i. What is the highest common factor of i and d? 9 Let n = -62 + 66. Suppose 3p + 2p - 244 = nb, -160 = -3p - b. What is the highest common divisor of 130 and p? 26 Suppose -5v + b + 832 = -2b, 0 = -4v - 2b + 648. Suppose -15 = -5c, c + 733 = 4w - v. Calculate the highest common factor of 45 and w. 45 Let u = -1024 + 1134. Calculate the highest common divisor of u and 814. 22 Let b = -27 + 56. Suppose 406 = m + m. What is the highest common factor of b and m? 29 Let c be (0 - 3)/((-2)/34). Let t be 167 + 1 + (-16 - -18). Suppose -3b = 2b - t. What is the greatest common divisor of b and c? 17 Let d be (-144)/(-3)(4 + (-21)/6). Let z(u) = u*2 - u. Let o be (16/(-10))/(-2)5. Let h be z(o). What is the highest common factor of h and d? 12 Let q(k) be the second derivative of -4k3/3 - 5k*2 + 34k. Let l be q(-5). Calculate the greatest common divisor of 12 and l. 6 Let l = 2877 - 2851. Suppose -104 = -2r + 40. Suppose -4a + 188 + r = 5o, -5o + a = -260. What is the highest common divisor of l and o? 26 Let h be -1 + 10 - (-294)/42. What is the greatest common divisor of 2 and h? 2 Suppose 7a = -58 + 2. Let b(j) = -13j - 27. Let c be b(a). Suppose 21 + 0 = 3s. Calculate the greatest common factor of c and s. 7 Suppose -4k - 30 = 4m - 114, 3k + 4m - 65 = 0. Suppose -16s + ks - 168 = 0. What is the greatest common divisor of 28 and s? 28 Let p(g) = 7g*2 - 16g - 78. Let z be p(-4). Calculate the highest common factor of 42 and z. 14 Let j(o) = -104o - 162. Let h be j(-2). What is the greatest common divisor of 1173 and h? 23 Let f be 2985/40 + 4 + (-29)/8. Suppose 2j + j + g = f, 75 = 3j + 2g. What is the greatest common factor of j and 25? 25 Let a be (-5)/((-6 - -10) + -5). Let p = 8 - 28. Let h be (-6)/(-4)p/(-6). Calculate the greatest common divisor of h and a. 5 Suppose x = -4x + 400. Suppose 2b - 20 = -f, -f - f + 40 = b. What is the highest common factor of f and x? 20 Let v be (-25)/4 - (-4)/16. Let m(d) = d + 7. Let r be m(v). Let z be -1(64/(-4) + r). Calculate the greatest common factor of z and 30. 15 Let r be (-36)/3010/(-3). Let v be (3/r)/(1/4). Let i = 5 - v. Calculate the highest common factor of i and 4. 2 Suppose 0h = 2h, 4y + h = -20. Let c be (6/y)/(7/(-245)). What is the greatest common factor of c and 42? 42 Suppose -4a = -z + 3z + 6, 0 = -a + 5z + 4. Let b be (-2002)/(-21) + a/3. Calculate the highest common factor of 38 and b. 19 Let a(r) = r3 - 3r*2 - 9r + 7. Let c be a(6). Let m = c + -50. What is the highest common factor of m and 99? 11 Suppose 4f - 84 = -2h - 3h, 3f - 36 = 3h. Suppose -27i = -14i - 416. What is the highest common divisor of f and i? 16 Let n(m) = -4 + 3m*2 - 2m - 4m - 10m*2 + 6m*2. Let v be n(-5). Calculate the highest common factor of v and 7. 1 Suppose -3q = -3z + q + 2, -4q = -5z + 14. Suppose -g + 3k + 60 = 6, 0 = -5g - k + 206. What is the greatest common divisor of z and g? 6 Let o = 67 - 63. Suppose 2f - f - 5 = ok, 4k + 15 = 3f. Calculate the highest common divisor of f and 25. 5 Suppose -19o + 18o + 24 = 0. Calculate the highest common divisor of o and 24. 24 Let k be 14 + -6 - (-8)/2. What is the greatest common divisor of k and 18? 6 Suppose 79c - 114c = -1120. What is the greatest common factor of 216 and c? 8 Suppose 4h = 122 - 30. Let i(l) = -25l + 3l + 4l - 14 + 3l + 3l2. Let p be i(11). Calculate the highest common factor of h and p. 23 Suppose -4d + 70 = d. Suppose w + 18 = -5b, -w + 5b - d = 4. Let x be w/27 + (-69)/(-9). Calculate the greatest common divisor of 63 and x. 7 Let q(o) = 4o3 + 27o*2 - 7o + 8. Let y be q(-7). What is the greatest common factor of 856 and y? 8 Let h(x) = 5x2 - 2x + 8. Let s be (-4)/(22/(-6)). Let z be h(s). Let k be (6 + -28)3/(-3). What is the highest common divisor of k and z? 22 Suppose 6j - 3j + 472 = 5c, -440 = -5c - 5j. Suppose 27 = -5s + c. What is the highest common factor of 143 and s? 13 Let r be (-4 - -13 - 11)(-130)/4. Calculate the greatest common divisor of r and 78. 13 Let h = -3459 + 5277. What is the highest common divisor of h and 36? 18 Suppose 3x - 90 = -2x. Suppose -4s = 12, 0 = -5g + 3s - s + 36. What is the highest common factor of x and g? 6 Suppose -7r = -6r - 2. Suppose 5g - rg - 75 = 0. Let j = 36 - 26. What is the highest common divisor of g and j? 5 Let g be (-126)/(-28) - (-2)/(-4). Suppose 5l + 100 = gd, -l - 104 + 18 = -3d. What is the highest common factor of 330 and d? 30 Suppose 640 = -8d + 13d. Let b(r) = -4r + 4. Let z be b(-3). Calculate the greatest common divisor of z and d. 16 Let y(w) = 3w2 + 9w + 2. Let r be y(-2). Let b be (r + 1)/(15/(-70)). Calculate the highest common divisor of 154 and b. 14 Suppose 4w - 184 = -2o, w + 4w + 20 = 0. Suppose 5b - 243 = 3l, -2b - 4l - o = -4b. What is the highest common divisor of b and 192? 48 Suppose 195 = -4a - a. Let f = a - -53. What is the highest common factor of f and 84? 14 Let k = 22 - 7. Let s = 55 - k. What is the highest common divisor of s and 20? 20 Suppose 17j - 24 = 44. What is the highest common factor of j and 50? 2 Let p(x) = 3x3 + 176x*2 - 65x - 94. Let l be p(-59). What is the greatest com	{ "pile_set_name": "DM Mathematics" }
j - 7. Let x(u) = 7u*3 + 16u*2 + 9u - 4. Let d(g) = -4k(g) + 7x(g). Factor d(r). -3r(r + 1)(r + 3) Let g(s) = -2s*2 - 12s - 8. Let w be g(-5). Factor -11r2 + rw + 2r + 8r2. -2r(r - 1) Let r(w) be the second derivative of -w5/5 + 22w*4/3 - 2w + 2. Find f such that r(f) = 0. 0, 22 Let i(m) be the third derivative of -m10/378000 + m8/16800 + m*7/6300 - 3m*5/10 + 14m*2. Let h(n) be the third derivative of i(n). Factor h(x). -2x(x - 2)(x + 1)2/5 Let h(t) be the third derivative of -t7/42 + 5t6/12 + 4t*5/3 - 145t*4/12 + 55t*3/2 - 310t*2. Factor h(n). -5(n - 11)(n - 1)2(n + 3) Let a(k) be the first derivative of 0k - 1/48k*6 + 0k*5 - 1/16k*2 - 5 + 0k*3 + 1/16k*4. Factor a(u). -u(u - 1)*2(u + 1)*2/8 Factor -6/5l + 6/5l3 + 9/5 - 1/5l*4 - 8/5l2. -(l - 3)2(l - 1)(l + 1)/5 Let x = -5103/2 + 9569/4. Let r = -158 - x. Factor -1/2l + 0 + rl*2. l(5l - 2)/4 Suppose -3 = -3v - 27. Let f(s) = 14s3 - 30s*2 + 40s - 16. Let c(y) = 9y3 - 20y*2 + 27y - 11. Let m(q) = vc(q) + 5f(q). Factor m(d). -2(d - 2)2(d - 1) Solve 2v + 605v*3 + 25 - 625v*3 + 18v - 30v2 + 0v + 5v4 = 0 for v. -1, 1, 5 Let v(j) be the first derivative of 0j + 2/39j3 - 1/13j*2 - 4 + 1/26j*4 - 2/65j*5. Let v(h) = 0. What is h? -1, 0, 1 Suppose -16 = -l - 4s, -2s + 22 = 4l - 0s. Find v such that -174v*4 - 51v*l + 101v*5 + 24v*5 + 120v*3 - 20v2 = 0. 0, 2/5, 1 Let l(o) be the second derivative of -o6/180 - o*5/10 - 68o + 2. Solve l(j) = 0. -12, 0 Let j(u) be the third derivative of u5/105 + u4/2 - 44u3/21 + 81u*2. Solve j(a) = 0 for a. -22, 1 Factor 1/5p*2 - 12/5p + 0. p(p - 12)/5 Let t(h) be the third derivative of h5/15 + h4/3 - 18h*2 + 6. Find f, given that t(f) = 0. -2, 0 Let p(z) = 2z*2 - 2z - 10. Let v be p(3). Suppose 2l = 7l + s + 2, 0 = vl + 3s + 6. Factor -1/4d2 + 0 + ld. -d*2/4 Factor -1/4v*5 - 45/4v*2 + 5/4v*3 + 5/4v*4 + 27 + 0v. -(v - 3)*3(v + 2)*2/4 Let a(t) be the first derivative of -21/10t*4 + 0t - 12/25t5 + 0t*2 - 8/5t*3 + 1/5t*6 - 25. Factor a(z). 6z*2(z - 4)(z + 1)2/5 Let j(i) be the second derivative of -i5/4 + 25i*4/12 - 5i*3/3 - 20i*2 + 15i. Suppose j(k) = 0. Calculate k. -1, 2, 4 Let h be 90/351/((-16)/(-14)). Let 15/8u - h - 3/8u2 = 0. Calculate u. 2, 3 Let h = -275 - -263. Let d be 24/6 - 1/(h/(-44)). Solve 0u*2 - du*5 + 0 + 2/3u*4 - 1/3u*3 + 0u = 0 for u. 0, 1 Suppose 0t + 5/4t*3 + 0 + 5t2 = 0. Calculate t. -4, 0 Let k(j) = -j2 - 42j - 80. Let s be k(-40). Let g be -3 - 12/(-15) - -3. Solve -2/5u*5 + 0u + s + 8/5u4 - 2u*3 + gu2 = 0 for u. 0, 1, 2 Let h(n) be the first derivative of n6/18 + n5/5 - n4/12 - 11n3/9 - 2n*2 - 4n/3 + 51. Factor h(u). (u - 2)(u + 1)3(u + 2)/3 Let i(j) = 3j3 - 33j*2 - 33j + 3. Let f(q) = -3q3 + 33q*2 + 34q - 2. Let s(n) = -3f(n) - 2i(n). Determine r, given that s(r) = 0. -1, 0, 12 Let v = -60 - -62. Find w, given that -80w2 + 10w*4 + 20w*3 + 78 - 5w*5 + 5w4 + v = 0. -2, -1, 2 Let n(p) be the second derivative of -p6/105 - 3p5/70 + 8p*4/21 - 4p*3/7 + 166p. Determine b so that n(b) = 0. -6, 0, 1, 2 Let z(c) = -3c3 - 25c*2 - 35c - 171. Let p be z(-8). Factor 81/2q3 - 4 - 27/2q*4 - pq*2 + 22q. -(q - 1)(3q - 2)*3/2 Let i = -120 + 127. Suppose 0 = ix - 4x. Determine v, given that -3/5v*2 + 2/5v + 1/5v4 + xv*3 + 0 = 0. -2, 0, 1 Find r such that 957 + 753 - 1838 + 32r + r*3 + 8r*2 + 6r*2 = 0. -8, 2 Suppose 74 = 9s + 20. Let z(k) be the first derivative of -1/18k4 - 16/9k + 4/27k3 - s + 4/9k*2. Factor z(j). -2(j - 2)*2(j + 2)/9 Let d(v) = v + 3. Let s = 16 + -14. Let z be d(s). Suppose -4n2 + 5n*2 + 10n*4 - 20n*3 + 2 + 19n*2 - 10n - 2nz = 0. Calculate n. 1 What is x in 27/2 + 150x*2 + 90x = 0? -3/10 Factor -8/3u3 + 12 - 76/3u*2 - 32/3u. -4(u + 1)(u + 9)(2u - 1)/3 Let x(v) be the first derivative of -2v5/65 + v4/2 - 2v*3 + 27v*2/13 + 33. Let x(t) = 0. Calculate t. 0, 1, 3, 9 Let x(s) be the first derivative of 0s + 10/21s3 - 4 - 4/7s*2 - 1/14s*4. Let x(q) = 0. What is q? 0, 1, 4 Let u be 21720/(-40). Let b = -15 - u. What is f in -3f + 8f2 - 12f*3 + bf*2 + 5f*2 = 0? 0, 1/4, 1 Let b(n) = -6n*3 + 22n*2 + 22n - 22. Let v = 30 + -46. Let k(x) = -2x3 + 7x*2 + 7x - 7. Let o(t) = vk(t) + 5b(t). Factor o(l). 2(l - 1)2(l + 1) Factor -f*4 + 5/2f*2 - 3/4f + 0 + 9/4f3. -f(f - 3)(f + 1)(4f - 1)/4 Suppose -3q = -475 + 28. Solve 153w - 307w - 5w2 + qw = 0. -1, 0 Let o(u) = 5u2 - 4. Let h be o(5). Let t be (-22)/h - 602/(-44). Factor 2/3 - 20/3f - tf3 + 39/2f*2. -(f - 1)(9f - 2)2/6 Let l(c) be the third derivative of -c5/25 + 97c*4/30 + 44c*3/5 + 628c*2. Factor l(o). -4(o - 33)(3o + 2)/5 Let g = 3/70 - 5/182. Let n = 127/195 + g. Solve 4/3a3 - 2/3a*4 + 0a - na2 + 0 = 0 for a. 0, 1 Let j(v) = 6v + 10. Let o be j(-4). Let y be (-116)/o + (-8)/28. Let -4a2 + 2a - 4a4 - 13a - a + y + 12a3 = 0. What is a? -1, 1, 2 Let h(u) = 119u + 1666. Let r be h(-14). Factor r - 3x - 15/2x*4 - 21/2x*2 - 27/2x*3 - 3/2x*5. -3x(x + 1)3(x + 2)/2 Let u be (-858)/(-182) + (-1 - 18/(-14)). Factor 2t2 + 6 - ut*2 + 0 + 3t. -3(t - 2)(t + 1) Determine c so that -16/9c2 + 14c*4 + 44/9c*3 + 0 + 0c = 0. -4/7, 0, 2/9 Determine r so that 2r4 + 1 + 11/2r*3 + 1/4r*5 + 17/4r + 7r2 = 0. -4, -1 Determine d, given that -11d*3 - 148d + 8d3 + 153d*2 - 53d + 51d = 0. 0, 1, 50 Suppose -4p + 5 = -3. Let y be 5 - 18/36(-28)/(-3). Factor 0 + yo - 1/3op. -o(o - 1)/3 Let d(u) be the first derivative of -u6/1980 + u5/220 - u*4/66 - 23u*3/3 - 22. Let g(y) be the third derivative of d(y). Factor g(o). -2(o - 2)(o - 1)/11 Let c be (5 - 1782/300) + 1. Let m(l) be the second derivative of 0l*2 + 0 - 1/10l*4 - 1/75l*6 - 1/15l*3 + 6l - cl5. Factor m(g). -2g(g + 1)3/5 Let q(v) = 92v*3 - 1. Let h(p) = -2p*4 + 4p*3 + 1. Let z(l) = -h(l) - q(l). Factor z(w). 2w*3(w - 48) Determine g, given that 132g2 - 116g*4 + 53g*3 - 81g*3 - 16 + 35g*4 + 112g + 49g4 = 0. -2, -1, 1/8, 2 Suppose 4u + 13 = 33. Let a(v) be the second derivative of 0 + 0v2 + 0v*3 + 1/110v*5 - 1/231v*7 - 1/66v*4 - uv + 1/165v6. Factor a(g). -2g*2(g - 1)*2(g + 1)/11 Let o(y) be the first derivative of y*3 - 15y*2 + 27y - 124. Let o(i) = 0. What is i? 1, 9 Suppose r*4 - 1/2r*2 - 1/4r5 - 1/2 - r3 + 5/4r = 0. Calculate r. -1, 1, 2 Let y(s) be the first derivative of -s8/112 + 3s6/40 - s5/10 - s*2 + 17. Let g(j) be the second derivative of y(j). Find b, given that g(b) = 0. -2, 0, 1 Suppose 5i = -10, -4i + 1 + 21 = -5o. Let d be (-1)/(-5) + (o - (-1248)/210). Let -1/7w4 + 2/7w*3 + 0 - dw*2 + 0w = 0. Calculate w. 0, 1 Factor 2q2 - 8/7q*5 - 30/7q*3 + 26/7q*4 - 2/7q + 0. -2q(q - 1)*3(4q - 1)/7 Find y, given that 21y*3 - 324y + 543y2 - 84 - 1151y*2 + 509y*2 = 0. -2, -2/7, 7 Factor 2/3d*3 - 8/3 + 16/3d - 10/3d2. 2(d - 2)*2(d - 1)/3 Suppose -2k + 8p = 36, -3k + 20 = 4p - 6. Factor 36/11n + 0 - 42/11n*k - 2/11n*4 + 16/11n*3. -2n(n - 3)2(n - 2)/11 Let s(b) = -b*2 - 59b - 316. Let x be s(-6). Factor 2/3q + 10/9q*x - 4/9. 2(q + 1)(5q - 2)/9 Suppose -175 = -57g + 22g. Let j(o) be the third derivative of 0 + 0o + 0o3 + o2 - 1/66o4 - 1/110og. Suppose j(u) = 0. Calculate u. -2/3, 0 Let n(a) = -a3 + 3a2 - 2a + 4. Let d be n(3). Let j be 1/d(-2)/1. Solve -15q*2 + 0q - q + j + 19q3 - 11q*2 + 1 + 42q*4 = 0 for q. -1, -2/7, 1/3, 1/2 Let t = 377/333 + -9/37. Let b(u) be the third derivative of tu*3 + 0u - 1/9u4 + 0 - 6u*2 + 1/180u*5. Solve b(z) = 0 for z. 4 Suppose 29h = 31h. Suppose -5l - 282 + 292 = h. Let -2/5 - 2zl - 12/5z = 0. Calculate z. -1, -1/5 Let r(d) be the first derivative of -1/6d5 + 5/6d*3 - 5/12d*4 + 5/3d*2 + 5 - 10/3d. Solve r(w) = 0 for w. -2, 1 Factor 98/9j2 - 2/9 + 32/3j. 2(j + 1)(49j - 1)/9 Let j(c) = -c*2 +	{ "pile_set_name": "DM Mathematics" }
/30 + l*4/6 + 97l*2. Determine u so that d(u) = 0. -1, 0, 1, 2 Let u(q) = q + 3. Let w be u(-13). Let f = w - -13. Factor 58 - 58 + 2o*f - 6o*2. 2o*2(o - 3) Let z be (-14)/(-4) - 2/(-4). Factor -2x2 + 0x*3 + 2x3 + x3 - zx3. -x2(x + 2) Let y(v) be the first derivative of -v6/120 + v5/20 - v*4/8 - 2v*3 + 3. Let z(h) be the third derivative of y(h). Factor z(p). -3(p - 1)*2 Let d(i) be the first derivative of 20/39i*3 - 4/13i + 13 + 1/13i2. Let d(h) = 0. What is h? -1/2, 2/5 Find b such that 360b + 3b3 + 2448b*2 - 432 + 0b*3 - 2379b*2 = 0. -12, 1 Suppose 24 = 3c - 24. Suppose -cq = -14q - 4. Factor 0 - 3/7o + 3/7o*q. 3o(o - 1)/7 Suppose 5j + 4 = 9. Let v be ((-2)/1)/(j/(-2)). Solve 1 - 2 - 6k2 + 3k - k*v - 7k - 4k3 = 0. -1 Let q(u) be the second derivative of u5/120 - u4/24 - u3/36 + u2/4 + 7u - 15. Factor q(r). (r - 3)(r - 1)(r + 1)/6 Let b(r) = -5r2 - 6r. Let p(l) be the third derivative of 3l5/20 + 11l*4/24 - 124l*2. Let i = -17 + 6. Let u(j) = ib(j) - 6p(j). Factor u(y). y2 Let x(h) be the first derivative of h3/12 - 3h*2/8 + h/2 - 32. Factor x(n). (n - 2)(n - 1)/4 Let k(p) be the second derivative of 0 - 3/4p4 + 0p2 - p3 - 18p. Solve k(o) = 0 for o. -2/3, 0 Suppose -162 = -8u + 678. Let c = u + -103. Determine a, given that 0a + 3/4a*c + 0 - 3/4a*3 = 0. 0, 1 Factor 44/9q + 4/9q2 + 0. 4q(q + 11)/9 Solve 22m*2 + 3m*3 - 2m4 + 283 + m3 - 283 - 24m = 0 for m. -3, 0, 1, 4 Let -4/3w*2 - 4/3w - 5/3w4 + 0 + 13/3w*3 = 0. What is w? -2/5, 0, 1, 2 Suppose 4 = 4p - 4. Find n, given that pn4 - 22n*3 + 28n*3 - 5n*4 = 0. 0, 2 Let a(y) be the third derivative of 0y + 0 - 16y2 - 1/320y*6 + 1/16y*4 + 0y*3 + 0y*5. Let a(v) = 0. Calculate v. -2, 0, 2 Let a(v) = -2v + 7. Let k = -10 + 10. Let f be a(k). Solve 4c3 + 12c - fc3 - 2c*3 - 4c*3 - 3c*4 = 0. -2, 0, 1 Suppose 5c + 4g = 4c + 6, -3 = -3g. Factor 2 + 2y3 - y2 - 2 + 2y - 3y*c. 2y(y - 1)2 Let k(l) be the third derivative of -l6/840 + l5/60 - l4/28 + 46l*2. Solve k(q) = 0. 0, 1, 6 Let b = 50186 + -401473/8. Factor -3/2o + 3/8o2 - b. 3(o - 5)(o + 1)/8 Let w(z) be the second derivative of z7/84 - 11z*6/60 + 43z*5/40 - 73z*4/24 + 14z*3/3 - 4z*2 + 54z - 1. Factor w(h). (h - 4)*2(h - 1)*3/2 Suppose 8j = j + 35. Factor -30 - 4q3 + jq + 2 + 2q + 28q*2 - 3q. -4(q - 7)(q - 1)(q + 1) Let o = -8096 + 40488/5. Suppose -2/5b*3 - 2b - 4/5 - ob2 = 0. What is b? -2, -1 Factor -7019r*3 + 7035r*3 + 18r*2 - 4r*5 + 14r*2 - 8r*4. -4r*2(r - 2)(r + 2)2 Let d(o) = -o3 - o2 + o + 4. Suppose 0 = -n + 2p - 6, -5n + n - p = -3. Let m be d(n). Factor 234/19z*3 - 80/19z*2 - 162/19z*m + 0 + 8/19z. -2z(z - 1)(9z - 2)*2/19 Let t(c) be the second derivative of 0c*2 - 1/6c*6 + 4c - 5/6c3 + 1/4c*5 + 0 + 5/12c*4. Factor t(i). -5i(i - 1)2(i + 1) Let r be ((-11)/10 - (-40)/100)36/(-63). Factor 0 + 4/5p - rp2. -2p(p - 2)/5 Let t be (((-63)/(-70))/(-9))/((-24)/(-255)). Let h = 149/80 + t. Find w, given that 26/5w*3 + 0w + 8w4 + hw*2 + 0 + 18/5w5 = 0. -1, -2/9, 0 Let y = -13 + 21. Factor -l4 + yl2 - 3l*3 - 2l2 - l4 + 3l5 - 4l*4. 3l*2(l - 2)(l - 1)(l + 1) Let v(l) be the second derivative of -l*5/45 - 62l*4/27 - 1922l*3/27 - 846l. Factor v(o). -4o(o + 31)*2/9 Factor 68i - 23i4 - 40i + 19i4 - 60i*2 + 36i*3. -4i(i - 7)(i - 1)2 Let z(t) be the second derivative of t5/30 - 5t4/9 + 25t*3/9 + 19t + 2. Find g, given that z(g) = 0. 0, 5 Let p(m) = -14m2 - 8m + 6. Let o(t) = 14t2 + 7t - 7. Let s = -17 + 23. Let h(d) = sp(d) + 4o(d). Factor h(k). -4(k + 1)(7k - 2) Solve 1/8b*2 + 0 - 1/8b*3 + 1/4b = 0. -1, 0, 2 Factor -40k2 + 19990k*3 + 190k + 642 - 19988k3 - 158 - 36k. 2(k - 11)2(k + 2) Let l(g) be the second derivative of -g*5/120 - 2g*2 + 15g. Let t(b) be the first derivative of l(b). Factor t(y). -y*2/2 Suppose 0 = 2r - 5u + 9, 0r + r + 2u = 9. Factor -rs*3 + 0s*3 + 13s*4 + 4s*2 - 15s4 + s3. -2s2(s - 1)(s + 2) Let n(m) be the first derivative of m6/27 - 2m*5/45 - 2m*4/3 + 32m*3/27 + 32m*2/9 - 32m/3 + 52. Factor n(r). 2(r - 2)3(r + 2)(r + 3)/9 Let n(r) be the third derivative of r6/480 + 29r*5/240 + 247r*4/96 + 169r*3/8 + 27r*2 + 4. Let n(o) = 0. What is o? -13, -3 Let v(p) be the third derivative of -8p*2 - 1/60p*6 + 0p*3 + 0p + 0 - 1/3p4 + 2/15p*5. Determine u so that v(u) = 0. 0, 2 Let z(d) = 11d2 - d - 2. Let p = 39 - 37. Let m be z(p). Determine g so that -40 - g5 + g4 + m = 0. 0, 1 Let z(o) be the second derivative of -o6/240 - o5/80 - o4/96 - 28o. Factor z(l). -l2(l + 1)*2/8 Solve -4/7z*2 + 0z + 26/7z3 + 0 - 22/7z*4 = 0. 0, 2/11, 1 Let -178/13j*2 + 164/13 + 14/13j*4 - 570/13j + 570/13j3 = 0. What is j? -41, -1, 2/7, 1 Let z(l) = 29l*4 + 9l*3 + 24l*2 - 40l - 83. Let q(n) = 25n4 + 9n*3 + 23n*2 - 39n - 84. Let t(d) = -7q(d) + 6z(d). Let t(w) = 0. Calculate w. -5, -3, 2 Let t be ((-3)/(-14))/(12/(-1680)-10). What is a in 0 + 1/2a*2 + 1/5a + 3/10at = 0? -1, -2/3, 0 Let q(n) be the third derivative of 0n - 1/6n5 + 20n*2 - 1/24n*6 + 5/3n*3 + 0 + 5/24n*4. Factor q(m). -5(m - 1)(m + 1)(m + 2) Let w(p) = 156p + 3432. Let t be w(-22). Let 4/9u - 2/9u2 + t = 0. What is u? 0, 2 Let g = -4 - -14. Let f = g + -5. Factor -4m - 14 - 4m2 + f + 4m*3 + 13. 4(m - 1)*2(m + 1) Let y(b) = -6b5 + 2b*4 + 2b3 - b2 + 5b. Let k(m) = -5m5 + m4 + m3 - m2 + 4m. Let o(c) = -5k(c) + 4y(c). Let o(r) = 0. Calculate r. -1, 0 Let a = 117 + -117. Let w(s) be the third derivative of 1/240s*5 + 0s - 1/24s3 + as*4 + 0 - 4s*2. Suppose w(m) = 0. What is m? -1, 1 Let a = 229/2 + -1141/10. Factor 0t - 2/5t2 + a. -2(t - 1)(t + 1)/5 Let m(k) be the first derivative of -3k*4/4 - 21k*3 - 108k*2 + 1296k + 536. Factor m(r). -3(r - 3)(r + 12)2 Let f(l) = l2 - 6l + 24. Let y be f(10). Find c, given that 22c*4 - yc + 5c3 + 10c*4 - 128c*2 + 11c*5 - 37c3 + c5 = 0. -2, -2/3, 0, 2 Let m(h) be the second derivative of h5/80 - h4/32 - h*3/4 - 5h*2 + 7h. Let j(b) be the first derivative of m(b). Determine t so that j(t) = 0. -1, 2 Factor 2/3v3 + 0 - 4v*2 + 0v. 2v2(v - 6)/3 Let j(v) be the first derivative of -7v6/2 - 48v*5/5 - 3v*4 + 14v*3 + 33v*2/2 + 6v - 229. Let j(u) = 0. Calculate u. -1, -2/7, 1 Suppose -4f = -2f - 38. Let p = f + -16. What is g in 6g3 - 3g - 3g5 + 0g5 + gp - g3 = 0? -1, 0, 1 Let j(v) = v3 - 27v2 + 30v - 44. Let h be j(26). Let u = h - 479/8. Find c, given that -uc3 + 0 + 1/8c*2 + 0c = 0. 0, 1 Factor -4/3u4 - 97/3u*2 - 16/3 - 24u - 12u3. -(u + 4)2(2u + 1)2/3 Let x(m) be the first derivative of -23 - 24m + 4/3m3 + 2m*2. Factor x(g). 4(g - 2)(g + 3) Let r(h) = 7h - 12. Let t be r(2). Find g such that -510g4 - 29g*3 + 86g*t - 147g*3 + 26g*4 + 176g + 382g2 + 16 = 0. -1, -2/11, 1 Let w(s) be the third derivative of 277/24s*6 + 0 + 19/3s*7 + 35/48s*8 + 0s + 15/2s4 - 20s*2 + 0s*3 - 19s*5. Factor w(r). 5r(r + 3)2(7r - 2)2 Suppose 42b = 34b + 24. Let t(u) be the second derivative of 0 + 10u + 1/10u6 - 1/4u*5 + 5/6u*b - 1/12u4 - u2. Determine h, given that t(h) = 0. -1, 2/3, 1 Suppose 4/3j2 + 2/3j*3 - 8/3j - 16/3 = 0. Calculate j. -2, 2 Let h(c) be the third derivative of 0 + 1/280c6 - 3/70c*5 - 2/7c*3 + 9/56c*4 + 0c - 6c2. Find k, given that h(k) = 0. 1, 4 Let t = 540 + -537. Let o(d) be the first derivative of -6 + 1/6d*4 + 0d*t - 1/3d*2 + 0d. What is s in o(s) = 0? -1, 0, 1 Let z(y) = y*4 - 7y*3 + 7y*2 + 7y. Let v(o) = 3o3 - 3o*2 - 3o. Suppose -6f = -9f - 21. Let i(n) = fv(n) - 3z(n). Factor i(s). -3s4 Solve 156/7i*3 + 272/7i - 40/7i4 + 4/7i*5 - 296/7i2 - 96/7 = 0 for i. 1, 2, 3 Let r(u) be the first derivative of -u5/12 - 11u4/18 - 4u*3/9 + 16u - 1. Let x(v) be the first derivative of r(v).	{ "pile_set_name": "DM Mathematics" }
4647 + -15.95353. What is the third biggest value in 30/11, 0, z? z Let t = 142 + -1419/10. Let d = -17 - -22. Suppose 3i + 8 = -dw, -8w = -4i - 4w. What is the third biggest value in i, t, -3/7? i Let m = 166 - 168. Let r be ((-12)/21)/(2/(-7)). Let y be (-2)/81/r. Which is the second biggest value? (a) 8 (b) m (c) y c Let u = -73/9 - -119/18. Which is the biggest value? (a) -0.72 (b) u (c) -2/3 c Let x = -485.6 + 487.6. Let r = -38 + 43. Suppose 2h = -3h - 25. What is the fourth smallest value in r, h, x, -0.2? r Let y = 1.2379 - 0.2379. What is the biggest value in 0, y, -490? y Let c = 1.2 - 1.3. Let j = -6.221 - -1.221. What is the third smallest value in c, j, 3/2, -16? c Let r be (-1)/(-10)8/(-6). Let o be (-3)/(-66)-62 + 3. Let j = -42.5 + 43. Which is the second biggest value? (a) 3 (b) o (c) r (d) j d Let n = 36.9 + -33. Let y = 0.1 + n. Suppose -5k + 16 = -3s, -s - 2 = 4k - 5k. Which is the second biggest value? (a) 2/3 (b) y (c) k (d) 2 b Suppose 0 = 233x - 227x + 60. What is the second smallest value in 1/8, -1/4, 2/11, x? -1/4 Let h(q) = q*3 - 12q*2 + 12q - 8. Let a be h(11). Let t = -55.9 - -55.9. What is the biggest value in 0.4, a, t? a Let g be (-1 + 9/4)278/6255-4. Which is the second smallest value? (a) 2/17 (b) -1/3 (c) g (d) -9 b Let f = 16.49 + -16.79. Let d(k) = -k*3 - 8k*2 + 5. Let m be d(-8). Suppose 0 = -2v - m + 15. Which is the third smallest value? (a) v (b) -0.18 (c) f a Let u = -0.2 + 1.2. Let s be (-60)/45 - (37 - 39). Which is the fourth smallest value? (a) s (b) 1/7 (c) u (d) 1/5 c Let z = -79 + -2. Let f = z + 88.4. Let t = f + -9.4. Which is the third biggest value? (a) -2/5 (b) -2.2 (c) t (d) 4 c Let d = -28 + 3. Let s = d - -20. Let u(h) = -8h + 53. Let r be u(6). What is the smallest value in r, s, -3? s Let f = -693 + 648. Let p = 36 + f. Which is the second biggest value? (a) p (b) 0.6 (c) -1 c Let m be (5/(-9))/(90/(-54)). Let q = 1/23 - 71/46. Let l = 5 + -4.6. Which is the smallest value? (a) m (b) -0.1 (c) l (d) q d Let f(u) = -186u - 36. Let p be f(-4). Let z = -2126/3 + p. Let l = 2 - 2.5. What is the third biggest value in -2/5, 19, l, z? l Let a = 2915/17 - 107837/663. Let k = 106/13 - a. What is the second biggest value in k, -2/7, 0.02? -2/7 Let n = -177.29 + 177.33. What is the fourth biggest value in 1/8, 200, 4, n? n Let t = -4667 + 4664. Which is the third smallest value? (a) t (b) -2/49 (c) 7 c Let c = -30.86 + 30.76. What is the smallest value in c, -2, 6/335? -2 Let q be (-414 + (-1 - -2))(-14)/14. Let f = q + -2063/5. What is the third smallest value in 4, 1, f, -4? 1 Let c be -2 + (-4)/(-6)(-36)/(-8). Suppose -5g - 85 = 12g. What is the third biggest value in g, 1.2, c? g Let p = -5748.88 + 5749. Which is the biggest value? (a) 0 (b) 0.1 (c) -180 (d) p d Let t be (-4)/1 + 399/(-171) - -7. What is the second smallest value in -0.01, 11, t, 2? t Let o = 51.96 - 54. Let v = o - -0.04. Let f = -3.523 + -0.477. What is the third biggest value in v, f, -1/2, 2/13? v Let s = -1.422 - -1.722. What is the third smallest value in -0.3, -172, s, 2/5, 5? s Let b = 13184 - 13192. What is the third biggest value in 1.3, 1/6, -0.5, b, 0? 0 Let p = 2 + 3. Let q = -41.005 - -3.005. What is the fourth smallest value in p, -0.2, -1/3, q? p Let t be 1/((-2)/8 + 0). Suppose -31i - 180 - 161 = 0. Which is the third biggest value? (a) t (b) -0.03 (c) i c Let h = -364722.6 + 364723. Let t be 54/(-16)(-4)/(-6). Which is the third biggest value? (a) h (b) -3/5 (c) t c Suppose 0 = 3r - 15, 5a - 2r - 8 = 2. Let c be -1a/(-18) + 960/(-1890). What is the third smallest value in 11, c, -4? 11 Let u = 9343 + -9340. What is the fifth smallest value in -3, 2/3, u, 7, 1/10? 7 Let u be 26/(-234) + 228/(-216). What is the second smallest value in 1/5, -59, 0, 1/2, u? u Let g be (12/6)/4(1 - (-5)/(-1)). What is the biggest value in g, -5, -6/5, 2, 3? 3 Let q = 0 + 3. Let p be 2/q(-84)/(-70). Which is the smallest value? (a) 1 (b) p (c) 0 c Let m = -3038 + 3033.9. What is the third biggest value in m, -2, -4? m Let q be (1/4)/(4/(-24)). Let c = -134.169 - -0.169. Let w = 134 + c. What is the fourth biggest value in 0.06, w, q, -3? -3 Let u = 6111 - 6125. What is the third biggest value in 5, -1, 2, u, 4? 2 Let h = 0.251 - -8.149. Which is the second biggest value? (a) 0.015 (b) 2/11 (c) h b Let g = 62.226 - 112.249. Let s = g + 50. Let q = -0.377 + s. Which is the fourth biggest value? (a) -3 (b) 2/11 (c) -0.3 (d) q a Let t = 2148 - 2148.3. Which is the third biggest value? (a) 3/13 (b) -2/23 (c) t c Let v = -0.0682 + 1.8682. Let c(b) = b*3 + 10b*2 + b + 12. Let t be c(-10). What is the smallest value in v, -0.4, t? -0.4 Let j = -3 - 7. Let m = 10.5 + j. Suppose 26g = 37g + 55. Which is the fourth biggest value? (a) -3/2 (b) 2/17 (c) m (d) g d Suppose 2r = -5j + 33, -2j = -3j - r + 9. Let l = -0.055 - 17.945. Let n = l - -18.5. Which is the third smallest value? (a) n (b) -2/5 (c) j c Let p = -0.0776 + 0.1176. Let h = -2.4 - 0.6. Which is the third biggest value? (a) h (b) p (c) -0.09 a Let l be -4(-3)/12 + 1. Let z be (l/(-148))/(110/(-1180)). Let t = -2/37 + z. Which is the third biggest value? (a) -4 (b) 4 (c) t a Let j = 0.3 + -0.1. Let q = 8/3 + -2. Let c(t) = t*2 + 26t - 42. Let m be c(-28). What is the third biggest value in q, m, j? j Let x = 1930 + -1937. Let r = -51.3 - -51. What is the second biggest value in -6, 5, r, x? r Let m be ((-3 - -3)/(-7 - -1 - -4))/1. Which is the smallest value? (a) 0.5 (b) m (c) 5 (d) -2/15 d Let m(k) = 2k3 + k2 - 4k + 2. Let x be m(1). Suppose -4i + 48 = 4c, -4 = i - 2c - x. What is the second smallest value in -2/11, 1.2, i? 1.2 Suppose 52z - 25z = 44z. Let y = -350 + 6648/19. Let q be (-10)/(-4)(-2 - (-12)/5). What is the smallest value in z, y, -4, q? -4 Suppose 5t + 10r - 659 = 6r, -2t + 263 = r. Let d = 131 - t. Let s be (-3)/((-7)/(-1) + -2). Which is the third biggest value? (a) d (b) s (c) -2/15 b Let q = -21963 - -21962. Let u = 6 - 2. What is the fourth biggest value in 2, 1, q, u? q Suppose 5v + 5f = 0, 2v - 10f = -6f. Suppose v = -2m - 219 + 209. Let l = 4.1 + -0.1. What is the fourth biggest value in l, m, 0, -3? m Let m = -3.7 - -4. Let y = 1537 + -59953/39. Let r = y - -4/39. What is the fourth biggest value in 2/7, r, m, 1? r Let m = 32483 - 32400. Let b = 2 - 1.5. What is the second biggest value in 4, m, b? 4 Let i = -2310 + 2314. Let m be (0 - 1)(6 + -5). What is the second biggest value in -0.1, i, m? -0.1 Let m(w) = 37w - 341. Let g be m(10). Which is the biggest value? (a) 3 (b) -15 (c) g c Suppose 44q - 42q - 8 = 0. Suppose -4r - 20 = -3o + 7o, qo + 20 = 4r. Which is the second smallest value? (a) -3 (b) o (c) -0.3 (d) -1 a Let c = 46 - 46.29. Let n = 55 - 48. Suppose -9 = 5m + q + 5, 0 = -2m + q - n. What is the smallest value in m, c, -5? -5 Let s = 50/249 + -748/1245. Let f be (4/(-3))/((-6)/(-18)). What is the third biggest value in -2/19, f, -2, s? -2 Let h = -158 - -98. Let o = h - -60.55. Let f = o + 1.45. Which is the third smallest value? (a) 0.3 (b) 2/13 (c) f c Suppose -4w + 3w + 8 = -2q, 7 = q + 5w. Let y be (-18)/(-21)(-34)/(-6). Let o = -191/35 + y. What is the second smallest value in o, 8, q? o Let l = -43.888 + -0.112. Let y = l - -55. Let t = y - 10.89. What is the biggest value in -3, t, 0.3? 0.3 Let p = 364 + -121. Let u = -265 + p. What is the third biggest value in u, 3, 1/8? u Let l be 6/(-4)(-64)/24. Let u be ((-6)/44)/((-3)/l). Let r = -0.005 + -0.195. Which is the second biggest value? (a) u (b) r (c) 0.3 a Let f = 3 + -2.98. Let m be 940/376 - 22/8. Which is the smallest value? (a) f (b) 1 (c) -3 (d) m c Let n = -36 - -69. Let o = n + -5. Let l = 28.08 - o. Which is the third biggest value? (a) 2/5 (b) -1 (c) l b Let v be 2 + 72/(-39) + 4156/26. Let u be (-92)/v - 24/(-64). Let g = 34/3 - 167/15. Which is the second smallest value? (a) u (b) 1/2 (c) g c Let m = -198 - -200. Suppose 4l + y + 0y = 10, 0 = -l - 5y - 7. Let u = l + m. Which is the smallest value? (a) 1.3 (b) u (c) -1/6 c Let p = 0 - 0.1. Let y be (-3)/36 - 14/493/	{ "pile_set_name": "DM Mathematics" }
ng q is positive. q(3/3115) Simplify x(7/4)x/(xxxx*(-24)/xxx) assuming x is positive. x(91/4) Simplify (q(-12)q)12 assuming q is positive. q(-132) Simplify (s(-2/5))(-3)/(ss(-1/2))(-1/44) assuming s is positive. s(533/440) Simplify (j24j)/jjj*(5/4)j assuming j is positive. j(109/4) Simplify p1ppp(4/7)/pp*(-5/6)p*3pp assuming p is positive. p(283/42) Simplify (f(11/3)f)/f((f/(f5/f))/f)/f assuming f is positive. f(-4/3) Simplify ((mm((m/(mm*4))/m)/m)/m)/mm(m/m(2/25))/mmmmm(m/(m/m*(-4/7)m))/mmmm(2/11)m assuming m is positive. m(-904/1925) Simplify (z/z(-2/11))/z*(1/6)(z*5z)/z(2/9) assuming z is positive. z(1345/198) Simplify (w(-1/5))26 assuming w is positive. w*(-26/5) Simplify j/(jj*(-22)j)(jj/j*(1/2))/jj assuming j is positive. j*(45/2) Simplify (n/(n/(n/(nn/(n/n*(-3/7)))))nn(4/7))/(n(1/3)/n0) assuming n is positive. n(5/3) Simplify l/l(-1/7)l/(l*(-1/7)/ll)l(2/5)l(-3) assuming l is positive. l(-11/35) Simplify (((rrr/r*1r)/rr)(7/9))(-27) assuming r is positive. r(-63) Simplify tt/(tt/(t/t(-4)tt))tt/t(3/5)(t(-1))0 assuming t is positive. t*(42/5) Simplify (ll/(l*0l)l(-3))/((ll(2/3)/l)/l)(-6) assuming l is positive. l(-4) Simplify (d(-8)/d)(-3/20) assuming d is positive. d(27/20) Simplify q(-3/7)/q(4/3) assuming q is positive. q(-37/21) Simplify l(-6)l(1/6)l*(-6)ll/(ll6) assuming l is positive. l(-101/6) Simplify ((l0)(4/17))*(-15) assuming l is positive. 1 Simplify (((kk/(k/(kk(1/8))kk))/k)/k)/(kk/k*(-9)k) assuming k is positive. k(-111/8) Simplify c/(c/(c/c(-35)))c(cc/((c/c(3/32))/c)cc)/c assuming c is positive. c(1283/32) Simplify xx*(2/123)xx(-24/5) assuming x is positive. x(-1712/615) Simplify (((q/((q0q)/q)q)/q)/q)(2/17)(q(2/19)/q)/(q/q4) assuming q is positive. q(40/19) Simplify (h/((h(-9)h)/h))/(h/(h/(hh20))) assuming h is positive. h(-11) Simplify h/h*(-10)h11 assuming h is positive. h22 Simplify (x*5(x*(-4/9)x)/x)/(x/x*(-5)xx/x6) assuming x is positive. x(23/9) Simplify (a/(a2a))/aa/(a/(a(-1/2)/a))aa/(aa*(-1/12))aa/a6aa assuming a is positive. a(-65/12) Simplify (((n((nn5)/n)/n)/nn)(-13))(-3/2) assuming n is positive. n(195/2) Simplify (d(-1))(-9/7)/((d/d(-4)d)/(dd8)) assuming d is positive. d(30/7) Simplify (bb/((bb*(2/11))/b)(b*(4/3)/b)/bbb)(-3) assuming b is positive. b(-104/11) Simplify (gg/((((g/(g/g*(-1)))/g)/g)/g))/g(gg1)/g(g/(g(-2)/g))/g0 assuming g is positive. g10 Simplify q1q/((qq*(-28))/q)q assuming q is positive. q31 Simplify (q/(q1/q))*(2/89)(q/q*(-7/6))/(((q/(q/(qqq5))qqq)/q)/q) assuming q is positive. q(-3103/534) Simplify (b(-3/7)/b)/b(3/31) assuming b is positive. b(-331/217) Simplify ((a(1/4)/a)/(a/(a(1/4)a)))/(a(2/7)/a(2/3)) assuming a is positive. a(-5/42) Simplify ((w/((w/(w5/w))/ww))/((w/(w/(w/w(-7))))/w))(11/2) assuming w is positive. w*(-33/2) Simplify ((zz(z/(zz/(((z/(z*(-1)zz))/z)/z))zz)/z)/z(-1))46 assuming z is positive. z46 Simplify (g(2/7)g)/(g(-6)/g) assuming g is positive. g(58/7) Simplify (b/(b*(-1/22)bbb))/b(6/5) assuming b is positive. b(-347/110) Simplify (c(2/5))(8/9) assuming c is positive. c(16/45) Simplify ((w/(w5/w))/((w/(w/w*(2/3)ww))/w))/(w3/(w(1/2)w)) assuming w is positive. w(-13/6) Simplify (o7/o(2/15))(8/7) assuming o is positive. o*(824/105) Simplify ((zzz(-2/9))/z)/(zz*(-2))(z(1/4))(1/53) assuming z is positive. z(3401/1908) Simplify (w(-2/7)w(4/9))/(((w(-3/2)/w)/w)/w(-4)) assuming w is positive. w(-43/126) Simplify (ii*(-12/7)i)27 assuming i is positive. i(54/7) Simplify ll(-10/7)l(-41) assuming l is positive. l(-290/7) Simplify (n*(-4)/(nn*(-2)n))/(n/(n(1/2)/n))26 assuming n is positive. n*(-43) Simplify uuu/(u/(u(-30/11)u))u(3/22) assuming u is positive. u(9/22) Simplify jj/(j/(jj/(j(2/3)j)))(j2/j)/jj assuming j is positive. j*(7/3) Simplify uuu35/uu(16/3) assuming u is positive. u(124/3) Simplify (bb6)/bbb/((b9b)/b) assuming b is positive. 1/b Simplify c/c*(-23)c20 assuming c is positive. c44 Simplify y*(1/14)y8 assuming y is positive. y(113/14) Simplify ((h*(10/17)hh)/h)/(h/(hh/(hh/(hh/(hhh*(-32/3)))h))) assuming h is positive. h(523/51) Simplify (((((v(2/5)/v)/v)/v)/v)/((vv(-6))/v))/((v(vv(2/5)v)/vvv)/v)(-25) assuming v is positive. v(437/5) Simplify ((k(((k12/k)/k)/k)/kk)/k)/kkk7 assuming k is positive. k16 Simplify ((i/i*(14/11)i)/ii)/(ii*(-18)i) assuming i is positive. i*(184/11) Simplify (m/(m/(mm*0m)))*(-31)/(mmm/(m(1/5)m))(-4) assuming m is positive. m(-274/5) Simplify (qq(-2/5))/q(-16) assuming q is positive. q(83/5) Simplify (l(-1/5)/ll)*(1/4)/(ll2)(-1/19) assuming l is positive. l(41/380) Simplify m(1/10)mm(-3/14) assuming m is positive. m(31/35) Simplify (b(1/2))18(b0)(-11/4) assuming b is positive. b9 Simplify (ss(16/5))/s18 assuming s is positive. s(-69/5) Simplify ((u1)(-2/147))(-2/87) assuming u is positive. u(4/12789) Simplify (j/j2)*(-41)((j/(j/j(-2/3)))/j)/((j5jj)/j) assuming j is positive. j*(100/3) Simplify (z/(zz/z(-1/3)))(-38) assuming z is positive. z(152/3) Simplify (z(-2/7))*(-31/3)(z(2/3)/z)(2/37) assuming z is positive. z(760/259) Simplify ((((n(-11)/nn)/n)/n)/n(-9/8))41 assuming n is positive. n(-3895/8) Simplify q(1/56)/q48 assuming q is positive. q(-2687/56) Simplify n/((n(-2/17)n)/n)n(5/4) assuming n is positive. n(161/68) Simplify (h/((h(1/2)/h)/h))(-2/39)(h/(hhh*(-1/3)h)h)/h(2/3) assuming h is positive. h(-19/13) Simplify (n/(n/(nn*2nn)))(-7) assuming n is positive. n(-35) Simplify s(-6/17)/(((ss/s*(6/5)s)/s)/s) assuming s is positive. s(-13/85) Simplify (s/(((s(1/15)/s)/s)/s))(9/13) assuming s is positive. s(177/65) Simplify y/(y/y*(4/11))y*(-2)((y*(-1/2)y)/y)/y((yy9)/y)/y assuming y is positive. y(107/22) Simplify (c/(c*(1/3)/c)c)/c*0c1/(c(3/5)c) assuming c is positive. c(31/15) Simplify l/(l/(l/(l(1/14)ll)))l/(l(-20)/l) assuming l is positive. l(293/14) Simplify (i*(-1/6)i)/((i*(-1/11)i)/ii) assuming i is positive. i(-5/66) Simplify v(-2)v*(2/21)(v/(v1/v))27 assuming v is positive. v(527/21) Simplify a(-2/21)/(a(-2)/a) assuming a is positive. a(61/21) Simplify ((dd(-3/10)d)(-29))(-1) assuming d is positive. d(493/10) Simplify o19/(o/(o*23o)) assuming o is positive. o*42 Simplify (mmm(2/7))19/(mm/(m*0m)m)(11/6) assuming m is positive. m(835/21) Simplify (j(-3)j*(-4))/(jj*0j(j(-3)j)/j) assuming j is positive. j*(-6) Simplify (((uu*(-1)u)/u)/u*(-7))/(uu/u1)(-13/6) assuming u is positive. u(55/6) Simplify (v/v(2/11))(-8/5) assuming v is positive. v(-72/55) Simplify h*(3/4)h*(-1)(h*(-4)/h)/hhhhh/h(3/8) assuming h is positive. h(-21/8) Simplify (c12/(c/c(-5)))27 assuming c is positive. c162 Simplify (rr/r*7r)(-7) assuming r is positive. r28 Simplify j(-2/9)/j(-1/7) assuming j is positive. j(-5/63) Simplify (d(-1))*(-36)(d*(2/5)d)(-3/7) assuming d is positive. d(177/5) Simplify v2/(v1/vv)v*(-6/5)vv(vvv/((vv(-3)v)/v)v)/vv assuming v is positive. v*(39/5) Simplify ((rr*(-1/8))/rr(-2))39 assuming r is positive. r(-663/8) Simplify (x1)*(-3/7)x0/(x(-5)/xx) assuming x is positive. x(32/7) Simplify (m8/m(-2/13))/((mm*(-1/3)/m)/((mm/(mmm*5m))/m)) assuming m is positive. m*(58/39) Simplify gg/(g*40g)g/(g/(g(-13)g))ggg assuming g is positive. g(-48) Simplify (y/y(2/131))/((y(-2/49)yy)/y) assuming y is positive. y(164/6419) Simplify (g(-1/5)/g(2/3))/(g(-1))(-16) assuming g is positive. g(-253/15) Simplify ((w(w/(w*(3/2)w)ww)/w)/www(-2)/w)/(w(1/4))14 assuming w is positive. w(-6) Simplify (i**	{ "pile_set_name": "DM Mathematics" }
ime factors of y. 2, 3, 5 Let n(i) = 3963i2 - 64i + 177. What are the prime factors of n(3)? 2, 3, 2971 Let c be 1 + 0 - -2 - 126/(-6). Suppose 2s + 3g - 22 = c, -4s - g + 72 = 0. Suppose -21f + 24 = -sf. List the prime factors of f. 2, 3 Let f be 1 + (1 - 208)8/12. Let v = 404 - f. List the prime factors of v. 541 Suppose 0 = 4c + 5a - 214 + 1118, 5a = c + 251. Suppose 3k - 2m = -91 + 1189, -2k - m + 732 = 0. Let s = k + c. What are the prime factors of s? 3, 5 Suppose 50u + 17u = 7u + 1485900. List the prime factors of u. 3, 5, 13, 127 Let c(w) = -225w + 10552. What are the prime factors of c(-151)? 7, 6361 Let z(w) = w*3 - 2w*2 - 4w + 1. Let i be z(-3). Let u be i/(-12) + -3 - 28/(-12). Suppose -t = ut - 261. What are the prime factors of t? 3, 29 Let y(u) = -u3 - 21u*2 - u - 18. Suppose -51 = 4h + 33. Let w be y(h). Suppose 92 + 58 = wa. What are the prime factors of a? 2, 5 Let h(o) = -o3 + 7o*2 - 5o - 11. Let f be h(6). Let p(m) = -m3 + m2 - 4. Let v be p(f). Suppose 3x + 14 = v. List the prime factors of x. 2, 11 Suppose 72 = -29p + 30p. Suppose -53m + 54m - p = 0. Let o = m + -6. What are the prime factors of o? 2, 3, 11 Let l = -2734 - -7241. Suppose -31 + 6 = -5x, -3f + l = -x. List the prime factors of f. 2, 47 Suppose a = -621 - 36. Let q = -308 - a. List the prime factors of q. 349 Let z(b) = b2 - 2b + 56. Let x be z(10). Let n = x - 78. List the prime factors of n. 2, 29 Let m(k) = -2415k + 1665. List the prime factors of m(-17). 2, 3, 5, 89 Let b(c) = -1580c - 251. List the prime factors of b(-4). 3, 7, 17 Let g(f) = -59f - 10. Let d be g(-14). Suppose -2c = 6c - d. Let h = c - 51. What are the prime factors of h? 3, 17 Let t(z) be the second derivative of 1/20z*5 - 4/3z*3 - 3/2z*2 + 2/3z*4 - 14z + 0. List the prime factors of t(-7). 2, 3, 17 Let l = 12277 + -1980. List the prime factors of l. 7, 1471 Let d(z) = 43z + 45. Let s be d(-1). List the prime factors of ((-27243)/(-243))/(s/18). 1009 Let b = -4813 + 6733. What are the prime factors of b? 2, 3, 5 Let b(m) = -5m + m + 9m2 + 19m - 4m. List the prime factors of b(-9). 2, 3, 5, 7 Let j(d) = 3d*2 + 4d - 11. Let n(k) = k*2 - 1. Let v(a) = -j(a) + 2n(a). Let g be v(6). List the prime factors of (g/2)/(5/(-30)). 3, 17 Suppose a + 16117 = 2p, -2p - 7481 = -4a - 23607. What are the prime factors of p? 7, 1151 Suppose -5b + 45030 = -0b + b. What are the prime factors of b? 5, 19, 79 Let f(j) = 2j*2 + 23j - 6. Let a be f(-12). Suppose -ad = -d - 15. What are the prime factors of d/(-12) + (-99)/(-12)? 2 Let d(c) be the second derivative of -187c*3/6 - 67c*2/2 - 99c. What are the prime factors of d(-3)? 2, 13, 19 Suppose 0 = 17k - 260 + 923. Let i = 126 - k. What are the prime factors of i? 3, 5, 11 Let n be ((-2)/(8/(-218)))/(18/36). Suppose 115s - 810 = ns. What are the prime factors of s? 3, 5 Let n = -1239 - -2246. Let m = n - 513. What are the prime factors of m? 2, 13, 19 Let n(k) = 27k*2 - 15k + 89. What are the prime factors of n(-10)? 2939 Suppose -14 = -2a - 0a - b, -33 = -5a - 2b. Suppose -2y + 8344 = ay. What are the prime factors of y? 2, 149 Suppose 1461 = 7v - 14380. What are the prime factors of v? 31, 73 Suppose -2p + 3z = -4834, 3p + 5z - 5795 = 1475. List the prime factors of p. 2, 5, 11 Suppose -22 = 5o - 7. Let a(b) = 11b2 - 2b - 3. Let c be a(o). Let z = 175 - c. List the prime factors of z. 73 Suppose 0p = 2p + 18. Let b(t) = 4t2 - t + 1. List the prime factors of b(p). 2, 167 Let c = 81544 + -23145. List the prime factors of c. 11, 5309 Let k = 154 + 188. Suppose 0 = 3r + 135 - k. Let j = r - 16. What are the prime factors of j? 53 What are the prime factors of 24009(17 + -11)/6? 3, 53, 151 Let c(q) = 6q*2 + 7q - 11. Suppose -2w - 14 = -3s, 0s + 2w - 10 = -3s. Suppose 2i = -sx + 10, -4i + 15x - 15 = 16x. List the prime factors of c(i). 2, 13 What are the prime factors of ((-4)/6 + 2)(7 + 89)? 2 Let f(d) = 21d + 12d2 + 8 + 14d - 5d - 2 - 38. List the prime factors of f(-7). 2, 173 Suppose 5f - 63 = 3d, -4d - 30 = 4f - 106. Suppose -fc - 19278 = -33c. List the prime factors of c. 3, 7, 17 Let b(z) = -z2 + 22z - 23. Let w be b(21). Let k be w/((2/(-3))/(5/(-3))). What are the prime factors of (-360)/k + (-1 - (-1 + 1))? 71 Suppose -13n - 821 = -4658 - 6485. List the prime factors of n. 2, 397 Suppose 0 = -38g - 20g - 31g + 1527329. List the prime factors of g. 131 Let c(r) = -2r + 4. Let b be c(2). Let d(g) = -g3 - 8g*2 - 8g - 7. Let u be d(-7). List the prime factors of (u - (b - 2)) + 100. 2, 3, 17 Suppose -34654 + 5371 = -5q + 66122. What are the prime factors of q? 19081 Let m = -153 - -48. Let w = m - -109. Suppose 0 = 4a + 3h - 33, -5 = -3h + wh. List the prime factors of a. 2, 3 Suppose l + 1 = -5f, 26 = 2l + 7f - 11f. Suppose -8w + lw - 203 = 0. List the prime factors of w. 7, 29 Suppose -17584 - 47243 + 14857 = -190u. What are the prime factors of u? 263 Suppose -3728 = -5i + 5832. Suppose -4r + 2d + 488 = -i, 2d = 5r - 3000. List the prime factors of r. 2, 3, 5 Let o(p) = 15p*2 - 38p + 367. What are the prime factors of o(23)? 2, 3, 619 Let a = -69 + 67. Let m be (-1505)/(-2) - a6/24. Suppose m + 66 = 7f. What are the prime factors of f? 3, 13 Let o(l) = 17l2 - l - 44. Let b be o(-6). Let r = -274 + b. What are the prime factors of r? 2, 3, 5 Let q(p) = -8p - 15. Let w be q(-9). Let c = w - 51. Suppose 3v - cv + 102 = 0. What are the prime factors of v? 2, 17 Let v be (390/(-75))/(2/10). Let b be (v/6 + 4)-12. Suppose 75 = t + 4m, -118 = 3t + bm - 327. List the prime factors of t. 67 Let k(n) = 217n + 674. List the prime factors of k(19). 3, 13, 41 Let i(n) = 21n*2 - 356n + 21. List the prime factors of i(36). 3, 11, 19, 23 Let d(a) = 37a - 184. Let n be d(5). List the prime factors of 215 + n/(6/42). 2, 3, 37 List the prime factors of -11 + 91237 - (-19 - (-19 - -8)). 2, 11, 13, 29 Suppose 5x = -f + 3840, 2x - 612f - 1548 = -610f. List the prime factors of x. 769 Let g = 45 - 43. Suppose -2s = gs - 352. Suppose -s = -p - p. List the prime factors of p. 2, 11 Let p be 16 - 10 - (1 + 1). Suppose 4h = pc - 915 - 3105, 0 = h. List the prime factors of c. 3, 5, 67 Suppose -150972 = 10t - 18t - 4t. What are the prime factors of t? 23, 547 What are the prime factors of (558/(-4))/(-33 + (-44979)/(-1364))? 2, 3, 31 Suppose -636l + 634l = -15388. List the prime factors of l. 2, 3847 Suppose 27h = 21h + 306. Suppose -hq + 49q = -1870. What are the prime factors of q? 5, 11, 17 Let o = -19 - -9. Let l(x) = -4x2 - 8x + 45. Let d be l(3). What are the prime factors of (-135)/(d/o - 3)? 2, 3, 5 Let w be (-99)/5510405/(-3). What are the prime factors of w/18 - (-2)/12? 347 Suppose -2k - k + 5p - 134 = 0, 237 = -4k - 5p. Let w = -53 - k. Suppose 0 = -5o - 0f - 5f + 200, 5o + 2f - 188 = w. List the prime factors of o. 2, 3 Let t(v) = -v3 + v2 + v + 94. Let n be t(0). Suppose -6w + 2 + 10 = 0. Suppose -wh + n = -0h - 2m, -2m = -6. List the prime factors of h. 2, 5 Let h(q) be the third derivative of -q5/30 - 5q4/24 + q3 - 15q2. Let n be h(-3). Suppose -6w = -nw - 240. List the prime factors of w. 2, 5 Let x = -484 + 290. What are the prime factors of (x/(-12) - (-2)/(-3))2? 31 Suppose -25j - 1743 = -21j + 2g - 20723, -5g = 0. What are the prime factors of j? 5, 13, 73 Let b be (-16)/(-12)5-3. Let h = -17 - b. Suppose 16 = 4k, -7d - hk = -3d - 264. List the prime factors of d. 3, 7 Let u(o) = o*3 - 26o*2 + 32o + 28. Let d be u(28). Suppose 0 = -8p + 948 + d. What are the prime factors of p? 2, 5, 43 Suppose 0 = -3o + 5y + 18, -2o - y = -2 + 3. Suppose -66 = -534g + 556g. What are the prime factors of o/(((-3)/61)/g)5? 5, 61 Suppose 5p = -b + 242316, -1661p + 4b + 145408 = -1658p. What are the prime factors of p? 2, 13, 233 Let t = -366 - -694. Suppose -4c + 1508 = -3u, 2c - 3u - 1082 = -t. List the prime factors of c. 13, 29 Let m(o) = -o3 + 7o*2 + 9o + 3. Let q be m(7). Let w be (q/77)/(2/14). Let l(g) = 2g + 19. List the prime factors of l(w). 31 Let q(k) = 303k - 15. Let w be q(5). S	{ "pile_set_name": "DM Mathematics" }
). Suppose 10z - 12z = -t. Let m be (-892)/5 + 10/z. Round m to the nearest ten. -180 Let v be (-62 - -117536062)5/(-6)-3. Round v to the nearest 1000000. 294000000 Let r = -5051 - -8045. Let s = 2994.0009972 - r. Let x = s + -0.001. Round x to six dps. -0.000003 Let q = -4211 + 4168.97. Let d = q + 42. Let f = 7.47 - d. Round f to zero decimal places. 8 Let x = -8296.022754 + 8296. Round x to 2 decimal places. -0.02 Let o = -3768.994172 + 3769. What is o rounded to four dps? 0.0058 Let i = 196.899993677 - 196.9. What is i rounded to six decimal places? -0.000006 Let m be (-4)/(-14) + (-585)/(-35). Let u(a) = 3019a - 123. Let q be u(m). Round q to the nearest 1000. 51000 Let o = 0.012 - -0.074. Let u = o + -0.338. Let z = u - -0.2679. Round z to two decimal places. 0.02 Let i = -131138 + 131200.3992. Let v = i + 0.0008. Let f = 62.3999307 - v. What is f rounded to five decimal places? -0.00007 Let j = -3198464900.9999218 - -3198464486. Let m = 415 + j. Round m to five decimal places. 0.00008 Let x = -241.2 - -241.2000000375. What is x rounded to 7 dps? 0 Let i = -5508 - -5779.64. What is i rounded to 0 decimal places? 272 Suppose 4z + 2g = 70, -4z + 90 = -0z - 2g. Let v be 0/(z/(-10) + 4/1). Suppose v = 16u - 15u + 40. Round u to the nearest 100. 0 Let g(f) = -15835f + 20. Let u = 47 + -165. Let l = u - -130. Let t be g(l). Round t to the nearest 100000. -200000 Let j = -18.71 + 2.31. Let m = j - -16.3999122. What is m rounded to 6 decimal places? -0.000088 Let q = -9352737 + 20596737. Round q to the nearest one hundred thousand. 11200000 Let d = 2.294 + 0.714. Let z = d - 3.008002957. Round z to 7 dps. -0.000003 Let v be (-5)/(-15) - (-15)/1838. Suppose -4m - 4m + v = 0. Suppose 5k + mu = 2u - 2, u = 2k - 1. What is k rounded to the nearest 1000? 0 Let c = 728 + -729.612. Let g = 0.316 + c. What is g rounded to one decimal place? -1.3 Let y be (-154)/(-3) - 9/27. Let g = 50 - y. Let s be (1035)/(g/4) - 0. Round s to the nearest 1000. -1000 Let w = -102 - -81. Let z = 20.858 + w. Round z to two decimal places. -0.14 Let i = -158.0881 - 0.2119. Let f = 158.1203 + i. Round f to two dps. -0.18 Let o = 33 + -42. Let t be (2973/o)/(1/(-12)). Suppose 3176 + t = -6k. What is k rounded to the nearest 100? -1200 Let a = -1377 - -2777. Let j be (1130/5)/(7/a). What is j rounded to the nearest 10000? 50000 Let d = 450.6885 - 72.515. Let h = -378 + d. What is h rounded to one decimal place? 0.2 Suppose 4w + r + 10 = 0, 4r = 4w + 9r + 2. Let m be -20579w/(36/20). What is m rounded to the nearest 1000? 19000 Let k = 14573 + -7630. Let p = -88043 + k. What is p rounded to the nearest 10000? -80000 Let w be (-2)/(-1) - (3 - 3). Suppose -3u + 5 = -wu. Suppose 0 = ui + c - 16303, -4i + c = 4c - 13049. What is i rounded to the nearest one hundred? 3300 Let n = 11.03 + -324.03. Let r = 5505751.39400772 - 5505438.394. Let d = n + r. What is d rounded to 6 dps? 0.000008 Suppose 42m - 30 = 36m. Let t be m/((-9325)/3110 - -3). Round t to the nearest 1000. 3000 Let d = -48 - -53. Suppose 6k - 4k - 86596 = -2x, -x - 216502 = -dk. Round k to the nearest 1000. 43000 Let b = 77 - 108. Let l = b + 37.8. Let z = l + -6.8000052. What is z rounded to 6 decimal places? -0.000005 Let r = -4443 - -3875.2. What is r rounded to the nearest 10? -570 Let d = 2 - 1.74. Let f = d - 0.2600558. What is f rounded to six decimal places? -0.000056 Let d = 3.287 + -18.408. Let h = 115.811 + d. Let c = h - 100. Round c to 1 dp. 0.7 Let f = -25.8378 - -0.1378. Let m = 158387 + -158412.7532. Let x = m - f. Round x to two decimal places. -0.05 Suppose -2n - 404490 = 17n - 4n. What is n rounded to the nearest 100? -27000 Let f(k) = 2k + 11. Let v(g) = -4g - 21. Let j(x) = 7f(x) + 3v(x). Let p be j(-7). Suppose 5c + 13649 + 15351 = p. Round c to the nearest one thousand. -6000 Let s = -15369773193817 - -15369773258839.52699973. Let j = s - 65021.927. Let t = -0.6 + j. What is t rounded to 7 dps? -0.0000003 Let w = -0.060785 + 129.091185. Let s = -129 + w. Round s to three dps. 0.03 Let u = 0.730294 - 0.7204. Round u to 3 dps. 0.01 Let p = -113.14 - 3.2. Let d = 115 + p. Let q = d + 1.3400077. Round q to six dps. 0.000008 Suppose -14w = -9w - 19500050. Suppose 0n + 2n - w = 0. Suppose 0 = -5c + j + n, 3c = 5j + 182942 + 987083. What is c rounded to the nearest 100000? 400000 Let a be (-5)/(-15) + 290/(-6) + 2. Let g = a + 46. Suppose -2l + 5k = -0l + 73980, g = -3l - 2k - 111008. Round l to the nearest ten thousand. -40000 Let c = -0.009828 + 121.047828. What is c rounded to zero dps? 121 Let h(f) be the second derivative of -1869f*3/2 - 163f*2/2 - 29f. Let u be h(-9). What is u rounded to the nearest one thousand? 50000 Suppose 0 = -9x + 22399 - 857806. Let q = x + 146391. Suppose -139935 - q = 5j - 3h, 0 = j + 5h + 38695. Round j to the nearest one thousand. -39000 Let k = -103.7 - -90.92. Let r = 12.8459 + k. What is r rounded to 3 dps? 0.066 Let g = -135 - -427. Suppose 3j + 0a + g = -4a, -5j - 530 = -2a. Round j to the nearest ten. -100 Let q = 0.1087862 - -0.0912296. Let p = 0.2 - q. Round p to six dps. -0.000016 Let s = 5996 - 6050. Let z = 18643896.999985 + -18643843. Let a = z + s. Round a to five dps. -0.00002 Let k = -140.7 + 129.12. Let d = k + 5.1. Let o = d - 0.02. Round o to the nearest integer. -7 Let h = -267 - -270.65. Let n = -1.04 - h. Round n to one dp. -4.7 Suppose 18b + 1009575 = 9b. Let c = b - -55075. Round c to the nearest one thousand. -57000 Let y = 2359928 - 2359927.81599568. Let j = y + -0.184. What is j rounded to six dps? 0.000004 Let u = 4 - 71. Let j = u + 28. Let c = 38.929 + j. Round c to two dps. -0.07 Let d = -20940.8831942 - -20902.8832. Let k = -1058 - -1096. Let b = k + d. Round b to six decimal places. 0.000006 Let m = 323 + 11. Let k = m + -348.3. What is k rounded to the nearest integer? -14 Let a = 223.299999536 - 223.3. Round a to seven dps. -0.0000005 Suppose 573383 = 2u - h, -u + 160707 + 125980 = h. What is u rounded to the nearest 1000? 287000 Suppose 19r + 376 = 23r. Suppose 0i = 3s - 2i - 268, 0 = s + 4i - r. Round s to the nearest 100. 100 Let x = -232.390009637 + 232.39. Round x to 7 dps. -0.0000096 Let r = -432 + 360. Let m = r + 10.4. Round m to the nearest integer. -62 Let n be (8/(-4) - -1792)22. Suppose -7v + n = -18v. What is v rounded to the nearest one hundred? -3600 Let h = 1939 + -1506.8. Let z = -396 + h. Round z to the nearest integer. 36 Suppose -5o + 7 = 4i, -18 + 8 = 5i. Suppose -oa + 4w = 169351, 4a + 4w + 129477 = -96371. Let k = a + 176457. Round k to the nearest 100000. 100000 Let o = -3650.69686 - -0.29686. Round o to the nearest 1000. -4000 Let c = -3.627 + 3911.127. What is c rounded to the nearest 100? 3900 Let o(v) be the first derivative of 3827v3/3 - 7v*2/2 + 6v + 3. Suppose 14 = -16p + 17p. Let k be o(p). What is k rounded to the nearest 100000? 800000 Let d = -410.9744 + 411. Let n = d - -44.3744. What is n rounded to the nearest 10? 40 Let k(q) = q*2 + 7q - 22. Let s be k(-8). Let i be 12/s(4 + 3). Let g be ((-48)/3)/(i/15150). What is g rounded to the nearest 10000? 40000 Let p = -0.0383 + -15.9737. What is p rounded to one decimal place? -16 Let j = 6730861342 + -4493879682. Let s = j + -2236980925.0000687. Let r = -735 + s. What is r rounded to five dps? -0.00007 Let y = -9930 + 8519.8. Let t = y + 1638. Let h = 251 - t. Round h to the nearest integer. 23 Let k = -27.1 + 27.4995. Let c = k + -0.4. What is c rounded to 5 dps? -0.0005 Let h = -486.932 + 486.931775951. Round h to six dps. -0.000224 Let h = -3115.886 + 3094. Let b = -21.7 - h. What is b rounded to 2 dps? 0.19 Let t = 0.0763 + 1.4287. Let f = t - 2.236. What is f rounded to 2 decimal places? -0.73 Let k = -28974.999974134 + 28975. Round k to 6 dps. 0.000026 Suppose 5h = -n + 293 + 675, -n - 3h = -958. Suppose 0 = y - 3d + 1308, 4y + 5271 = -0y - d. Let z = n - y. Round z to the nearest one hundred. 2300 Let v = 121 - 435. Let l = v - -314.04. Round l to 1 dp. 0 Suppose -1017908 = 3*r + 857242. Let c = -483277 - -844327. Let z = r + c. Round z to the nearest one hundred thousand. -300000 Let m = -0.27175 - -0.27185971. Round m to 6 decimal p	{ "pile_set_name": "DM Mathematics" }
5o - 6/5o*4 = 0. -1, 1/2, 1 Let g(y) = -3y*3 + 10y*2 + 133y + 234. Let d(j) = -j3 + j2 - 3j - 2. Let b(k) = 4d(k) - 2g(k). Factor b(l). 2(l - 17)(l + 2)(l + 7) Let l(g) = -5g2 - 5. Let q(t) = 3t*3 + 2327t*2 - 4683t + 2333. Let z(u) = 2l(u) - q(u). Factor z(d). -3(d - 1)*2(d + 781) Let g(v) = 25v2 + 491v - 178. Let a be g(-20). Solve 14/11p3 + 4p*a + 9/11 + 36/11p - 2/11p5 - 5/11p*4 = 0 for p. -3, -1, -1/2, 3 Let f(i) = 9i*2 + 7i + 8. Let g(z) = -8z2 - 5z - 7. Let w(q) = -5f(q) - 6g(q). Let m(o) = o*2 - o. Let k(v) = m(v) - w(v). Find a such that k(a) = 0. 1 Let o = 5978 - 5972. Let f(w) be the first derivative of 1/3w*5 - 28 + 1/9w*3 - 1/9w*o - 1/3w*4 + 0w + 0w2. Find z such that f(z) = 0. 0, 1/2, 1 Let u(r) = -9r4 + r2 - 7 + 276r3 - 278r3 + r4 + 9r. Let b(a) = 5a4 + a3 - a*2 - 5a + 4. Let n(c) = -7b(c) - 4u(c). Factor n(y). -y(y - 1)(y + 1)(3y - 1) Suppose 123 + 5g2 - 1 - 602 + 15g - 420 = 0. What is g? -15, 12 Let w = 52299 - 314587/6. Let n = -10297/78 - w. Factor -14/13m3 + 0 + nm*4 + 28/13m*2 - 16/13m. 2m(m - 4)(m - 2)(m - 1)/13 Let h(g) = -27g - 317. Let q be h(-12). Let l(x) be the third derivative of 2/7x*3 + 0 - 1/30x*5 + qx*2 + 0x - 19/84x4. Factor l(o). -2(o + 3)(7o - 2)/7 Find c such that -2c2 + 26/3c*3 - 12c + 0 + 14/3c4 + 2/3c*5 = 0. -3, -2, 0, 1 Let g be -6 - (-3 + (-2 - -5 - 9)). Solve 102x*2 + 45 - 4x*4 + 45x - 54 + 10x4 + 45x*g - 45 = 0. -3, -2, 1/2 Let t(d) = 28d*2 - 28d - 24. Let s = 202 + -137. Suppose 0 = -6u - 79 - s. Let w(k) = -k2 + 1. Let c(o) = uw(o) - t(o). Suppose c(j) = 0. Calculate j. 0, 7 Let u(g) = -3g4 + 8g*2 - 20g - 27. Let b = 5 + 6. Let o(n) = -16n4 - n3 + 38n*2 - 101n - 135. Let c(q) = bu(q) - 2o(q). What is v in c(v) = 0? -3, -1, 3 Suppose 3d - 142i + 147i - 78 = 0, 48 = 4i. Solve -1/7g2 + 17/7g - d = 0 for g. 3, 14 Let 2/21y4 + 4664/7y*2 + 146068/21y - 893262/7 + 100/7y3 = 0. Calculate y. -53, 9 Let l(t) = 864t*3 - 870t*2 + 20t - 28. Let y(b) = 173b3 - 174b*2 + 4b - 6. Let z(o) = -3l(o) + 14y(o). Factor z(x). -2x(x - 1)(85x - 2) Let d = -12307503/7 - -1758215. Factor -16/7 + 10/7a2 + da*3 + 4/7a. 2(a - 1)(a + 2)(a + 4)/7 Suppose -72 = 3q + 6b, -b + 18 = -q + 33. Let o be 3/4 + (-3)/(-12). Factor -o + g - 1/4gq. -(g - 2)2/4 Let r(l) = -11l2 - 13l - 22. Let w(h) = 1. Let v(o) = 2o2 - o + 3. Let g(c) = v(c) - 2w(c). Let y(f) = -20g(f) - 4r(f). Determine q so that y(q) = 0. -17, -1 Let u(i) be the first derivative of -i*4/32 - 5i*3/8 - 3i*2 + 160i + 183. Let w(g) be the first derivative of u(g). Factor w(m). -3(m + 2)(m + 8)/8 Let r(o) = -153o3 + 405o*2 - 1659o + 1249. Let c(u) = -231u3 + 405u*2 - 1659u + 1248. Let t(p) = -2c(p) + 3r(p). Factor t(x). 3(x - 3)(x - 1)(x + 139) Let f(p) be the third derivative of p3 - 49/120p*6 - 2 + 0p - 35/24p4 + 1/21p*7 + 17/15p*5 - 23p2. Determine c so that f(c) = 0. 2/5, 1/2, 1, 3 Let m(v) be the first derivative of v4/48 + 17v3/36 - 7v*2 - 9171. Suppose m(o) = 0. Calculate o. -24, 0, 7 Let k = -3454 + 3460. Let l(s) be the first derivative of 8/9s*3 - 1/3s*4 - 1/9s*k + 23 - 8/15s*5 + 0s + s*2. Find m, given that l(m) = 0. -3, -1, 0, 1 Let z be -8 + 10 + 9 + (-35 - -27). Suppose 50t*2 + 115/4t*4 - 235/4t*z - 15t + 0 - 5t5 = 0. Calculate t. 0, 3/4, 1, 2 Let c(n) = 26n*2 - 14n + 27. Let y be c(3). Factor -207 - 3j2 - j2 + y - 8j + 0j. -4(j - 1)(j + 3) Let l(f) be the first derivative of f5/40 - f3/12 - 3f - 142. Let a(k) be the first derivative of l(k). Find s, given that a(s) = 0. -1, 0, 1 Let f be (11856/7410)/((-12)/(-10)). What is c in fc2 - 16/3 + 4c = 0? -4, 1 Let k(d) be the first derivative of -135 + 1/5d3 + 12/5d - 3/2d2. Factor k(c). 3(c - 4)(c - 1)/5 Suppose -o + r + 16 = 0, o = -815r + 810r - 56. Solve -20/7q*3 + 48/7q*2 - 4/7q*5 + 0 - 24/7q*o + 0q = 0 for q. -4, -3, 0, 1 Suppose -s + 10 = 5i, -i - 2s + 18 = -5s. Let k be (-78)/(-91) - (-1 + (-74)/28). Factor -3/2f*i - 21/2f + k + 15/2f2. -3(f - 3)(f - 1)2/2 Let n(r) = 3r3 + r2 - 165r - 273. Let g(d) = 15d*3 + 6d*2 - 825d - 1344. Let m(f) = -5g(f) + 24n(f). Factor m(t). -3(t - 7)(t + 1)(t + 8) Let n(g) = 19g + 757. Let o be n(-28). Suppose 0 = -19x - o + 263. Suppose 2/7u - 2/21ux - 4/21 = 0. Calculate u. 1, 2 Let i = 364 - 354. Determine u so that -42u*2 + i + 9 - 23u*2 + 11 - 127u - 58u = 0. -3, 2/13 Suppose -2o + 73 = -0f + 5f, -81 = -4o + 3f. Let y = o - 20. Factor p*2 + 2p*5 - 12p*5 + 4p*2 - 15p*y. -5p*2(p + 1)*2(2p - 1) Let m(l) be the first derivative of -l7/70 + l6/40 + 3l*5/4 + 23l*4/8 + 5l*3 - 57l*2/2 - 5. Let t(s) be the second derivative of m(s). Factor t(k). -3(k - 5)(k + 1)2(k + 2) Let q(l) be the first derivative of 157 - 44/3l3 + 2l*5 - 4l*4 + 18l + 0l2. Suppose q(a) = 0. What is a? -1, 3/5, 3 Let l(g) = -7g*2 - 365g + 3302. Let j be l(-60). Factor 25/8f + 1/8f*3 + 0 + 5/4f*j. f(f + 5)2/8 Let n(p) be the third derivative of p6/600 - 49p5/150 + 19p*4/24 + 97p*3/15 + 1016p*2. Factor n(r). (r - 97)(r - 2)(r + 1)/5 Suppose -15j + 70 + 50 = 0. Suppose -4v = -4k + j, -2v + 7 = 3k + 1. Suppose v + 0m3 + 2/17m*4 + 0m - 2/17m2 = 0. Calculate m. -1, 0, 1 Factor 0 + 260/9k*3 + 514/9k*2 + 256/9k + 2/9k4. 2k(k + 1)2(k + 128)/9 Let o(b) be the third derivative of 0b + 1/24b*6 + 1/210b*7 + 1/15b*5 + 0b*3 + 5 + 18b*2 + 0b*4. Determine w so that o(w) = 0. -4, -1, 0 Let g(z) be the first derivative of 114z2 + 113 + z4 - 288z - 56/3z*3. Determine w so that g(w) = 0. 3, 8 Factor -80/3 - 44/3u*3 + 1/3u*5 + 32/3u + 5/3u4 + 64/3u2. (u - 2)3(u + 1)(u + 10)/3 Let n(p) be the third derivative of p*7/70 + 41p*6/40 - 11p*5/5 - 21p*4/2 + 742p*2. Suppose n(v) = 0. Calculate v. -42, -1, 0, 2 Let v(j) be the second derivative of -2j*7/105 + 3j*6/10 - 8j*5/5 + 10j*4/3 - 9j*2/2 - 198j. Let u(b) be the first derivative of v(b). Factor u(q). -4q(q - 5)(q - 2)2 Suppose -5f + 80 = 5n, -2f - n = -3n - 36. Suppose f - 2 = 5j. Let 3x4 - 3x*2 - 17x - 16x - 10x + 3xj + 40x = 0. What is x? -1, 0, 1 Let r(x) = 22x4 + 62x*3 + 382x*2 + 588x + 6. Let b(y) = 3y4 - y3 + 3y*2 + 1. Let c(h) = 6b(h) - r(h). Let c(l) = 0. Calculate l. -7, -3, 0 Let f(o) be the second derivative of -5/12o4 - 15o*2 + 0 - 9o - 25/6o3. Factor f(d). -5(d + 2)(d + 3) Let f(o) = -7o*2 - 4o - 1. Let s(u) be the first derivative of 19u3 + 33u*2/2 + 9u + 167. Let x(b) = -33f(b) - 4s(b). Determine r so that x(r) = 0. -1, 1 Suppose 3h = l + 4, 3h - 15l = -18l + 24. Let g(z) be the second derivative of 8/3zh + 2/15z*6 + 0z2 + z5 + 8/3z4 - 21z + 0. Factor g(p). 4p(p + 1)(p + 2)2 Let g(s) be the third derivative of s5/450 - 31s*4/180 + 26s*3/5 - 12372s*2. Determine q so that g(q) = 0. 13, 18 Let d = 124 - 122. Let -6v*3 + 11v*d + 17v*3 - 13v*2 - 10v*3 = 0. Calculate v. 0, 2 Let u be (-198)/(-108) - ((-38)/3 - (-143)/11). Factor uv*3 - 9/2v*2 + 3 + 3/2v*4 - 3/2v. 3(v - 1)2(v + 1)(v + 2)/2 Factor -2/3l*4 + 2/3l*5 + 2/3l*2 + 8/3 - 10/3l*3 + 16/3l. 2(l - 2)2(l + 1)3/3 Let h(w) = -w2 - 36w + 135. Let a be h(-37). Suppose -4t - a = o - 83, 3t + 30 = 3o. Factor 24c + 6 + 21/2c*4 + 57/2c*3 + 75/2c*2 + 3/2c*o. 3(c + 1)*3(c + 2)*2/2 Suppose -4t - 9 = b, -t - 1 = 2. Suppose 4s4 - 15415s*b - 6 + 15415s*3 - 17s - 14s2 + s5 = 0. What is s? -3, -1, 2 Let a be 24/(-9) - -2 - (-9321)/9. Let b = a + -1031. Determine g so that -1/2g*3 - 3g*2 - 6g - b = 0. -2 Let h be ((-3)/(12/(-8)))/((-1)/2). Let f be 16/h(-36)/336. Factor -fq*2 + 0 + 6/7q. -3q(q - 2)/7 Let v be ((-2037)/(-71295))/(1/10). Factor 18/7h + 6/7h*4 + 4/7h*2 - 10/7 - 20/7h*3 + vh*5. 2(h - 1)*3(h + 1)(h + 5)/7 Let c(b) be the third derivative of -b7/630 - 7b*6/18 - 245b*5/6 - 19b*4/6 + 48b**2. Let k(r) be the second deriva	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.