Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
False Is 41161 composite? False Is 10279 a composite number? True Is 161 composite? True Is 142599 prime? False Is 1492369 a composite number? True Is 21557 a prime number? True Is 37357 a composite number? False Is 144787 composite? True Is 1961 composite? True Is 1119 composite? True Is 12889 a prime number? True Is 3452123 a prime number? False Is 3935 prime? False Is 70039 prime? True Is 144563 composite? False Is 279203 a prime number? True Is 2317 prime? False Is 2101 a composite number? True Is 378733 prime? True Is 6382 a prime number? False Is 97979 composite? True Is 193081 a prime number? False Is 1543 a prime number? True Is 244907 a prime number? False Is 45763 prime? True Is 2879 a prime number? True Is 873173 composite? True Is 630371 composite? True Is 15967 a composite number? True Is 215 a composite number? True Is 523097 composite? False Is 110938 composite? True Is 14741 prime? True Is 10807 composite? True Is 265 a prime number? False Is 1966 a prime number? False Is 510407 a composite number? True Is 99707 a composite number? False Is 30809 composite? False Is 71966 composite? True Is 636527 prime? False Is 108299 composite? True Is 4831 a prime number? True Is 33599 composite? False Is 98317 prime? True Is 12689 a prime number? True Is 4583 composite? False Is 333539 prime? True Is 1399 composite? False Is 247759 prime? True Is 18743 a composite number? False Is 31918 a composite number? True Is 196379 a prime number? True Is 533777 a prime number? True Is 94567 prime? False Is 3227 a composite number? True Is 77 prime? False Is 99079 a prime number? True Is 233113 composite? False Is 32927 composite? True Is 40323 a prime number? False Is 166633 composite? True Is 83935 prime? False Is 1130737 prime? True Is 2274443 a composite number? True Is 147617 a prime number? True Is 812137 a prime number? True Is 171929 composite? False Is 3017 prime? False Is 36251 a composite number? False Is 53349 a composite number? True Is 16241 prime? False Is 57347 composite? False Is 176153 a composite number? False Is 882823 a composite number? False Is 13229 a prime number? True Is 232501 a composite number? True Is 92111 composite? False Is 1973 prime? True Is 38039 prime? True Is 45233 composite? False Is 19553 composite? False Is 2457563 a prime number? True Is 5923 prime? True Is 17191 composite? False Is 15527 a composite number? False Is 38501 prime? True Is 44953 prime? True Is 7717 prime? True Is 74393 prime? False Is 25969 a composite number? False Is 20789 prime? True Is 100733 a prime number? True Is 884881 a composite number? False Is 1639 a composite number? True Is 263843 a prime number? True Is 481793 a composite number? True Is 3847 composite? False Is 369273 a composite number? True Is 1330319 a composite number? True Is 1271 a prime number? False Is 873781 prime? True Is 155813 a composite number? True Is 1500473 composite? True Is 26149 a composite number? True Is 144289 a prime number? True Is 1523 a composite number? False Is 1090681 composite? False Is 45827 composite? False Is 35201 composite? False Is 5513 a composite number? True Is 197209 prime? False Is 1973 composite? False Is 18493 composite? False Is 163 prime? True Is 700301 composite? True Is 254839 a composite number? True Is 89041 a composite number? False Is 216097 a prime number? False Is 1961 composite? True Is 115567 prime? False Is 48149 a composite number? True Is 631 composite? False Is 21001 prime? True Is 12283 prime? False Is 100733 prime? True Is 27427 a composite number? False Is 770741 a prime number? True Is 4327 composite? False Is 4955 a composite number? True Is 245807 a composite number? True Is 6541 prime? False Is 193345 composite? True Is 6883 a prime number? True Is 33961 a prime number? True Is 21709 a composite number? True Is 27629 a prime number? False Is 50923 composite? False Is 5137 prime? False Is 3109 a composite number? False Is 339023 prime? True Is 67601 prime? True Is 207709 composite? False Is 16057 a composite number? False Is 26119 prime? True Is 254699 composite? False Is 714673 a composite number? False Is 19961 prime? True Is 358181 composite? False Is 594977 a composite number? False Is 187009 prime? True Is 22691 composite? False Is 171443 prime? False Is 806159 a composite number? False Is 61647 a composite number? True Is 215561 a prime number? False Is 21911 a prime number? True Is 16141 a prime number? True Is 299603 a composite number? False Is 438467 a composite number? False Is 579407 composite? False Is 48769 a composite number? True Is 157397 prime? False Is 328961 a composite number? False Is 371023 prime? False Is 927427 prime? False Is 452441 composite? True Is 1901 prime? True Is 355 a composite number? True Is 39341 a composite number? False Is 1107989 a composite number? False Is 19793 a prime number? True Is 1097 a prime number? True Is 28807 a prime number? True Is 15689 prime? False Is 2939 composite? False Is 369283 prime? True Is 422146 a prime number? False Is 21667 a composite number? True Is 40471 a prime number? True Is 21247 a prime number? True Is 13649 composite? False Is 1073 a composite number? True Is 10369 composite? False Is 170615 composite? True Is 58309 a prime number? True Is 756749 composite? True Is 413657 a composite number? True Is 23497 a prime number? True Is 1418813 prime? False Is 40537 a composite number? True Is 55021 a composite number? False Is 282559 a composite number? False Is 209093 a prime number? False Is 146209 prime? False Is 24749 a composite number? False Is 19937 composite? False Is 1847 a prime number? True Is 13507 prime? False Is 59834 prime? False Is 150763 a composite number? True Is 81811 prime? False Is 230611 a composite number? False Is 606997 a prime number? True Is 502919 a composite number? False Is 5639 prime? True Is 501447 a composite number? True Is 44729 prime? True Is 35359 a composite number? True Is 2425073 a composite number? True Is 14243 prime? True Is 18899 prime? True Is 25439 a composite number? False Is 181819 prime? False Is 655 a composite number? True Is 53477 a prime number? False Is 43294 a composite number? True Is 798053 prime? False Is 39731 composite? True Is 643129 prime? True Is 15787 a composite number? False Is 79481 composite? False Is 656023 a composite number? False Is 4411 composite? True Is 44483 a composite number? False Is 78609 a composite number? True Is 4104709 a composite number? True Is 821 a prime number? True Is 835 composite? True Is 2067187 a composite number? False Is 47001 prime? False Is 13645 a composite number? True Is 8579 composite? True Is 10487 a prime number? True Is 251789 prime? True Is 699823 composite? False Is 16619 composite? False Is 17431 a composite number? False Is 1589083 prime? True Is 357917 composite? True Is 2767 a prime number? True Is 10061 composite? False Is 8573 composite? False Is 377681 prime? True Is 253987 prime? True Is 85721 composite? True Is 1223 a prime number? True Is 41803 composite? True Is 7829 a composite number? False Is 1067 a composite number? True Is 647789 prime? True Is 271393 prime? True Is 1897823 a prime number? True Is 16871 prime? True Is 31643 a prime number? True Is 30787 prime? False Is 3953 prime? False Is 26791 prime? False Is 32903 composite? True Is 1507937 prime? False Is 1397 composite? True Is 65629 prime? True Is 20849 a composite number? False Is 10037 composite? False Is 7621 a composite number? False Is 90845 a prime number? False Is 16253 a composite number? False Is 237991 a prime number? False Is 258389 prime? True Is 1710923 a prime number? True Is 6707 prime? False Is 7417 a prime number? True Is 3649 a prime number? False Is 10599 a composite number? True Is 123167 composite? True Is 6833 a composite number? False Is 1909 composite? True Is 38113 prime? True Is 20533 a composite number? False Is 3109 a prime number? True Is 1029247 a composite number? False Is 53353 composite? False Is 3176695 a prime number? False Is 548591 prime? True Is 4181 a composite number? True Is 1067 a composite number? True Is 14395 composite? True Is 114313 a composite number? True Is 32537 a prime number? True Is 32579 a composite number?	{ "pile_set_name": "DM Mathematics" }
3. Factor o(m). -2(m - 3)2(m - 2)(m - 1) Let b(r) be the third derivative of r6/315 + r5/70 + r4/42 + r3/63 - 6r*2 + 1. Factor b(j). 2(j + 1)*2(4j + 1)/21 Suppose 4f = 4k + 24, f = 3f + 4k + 6. Let b(l) be the second derivative of 0 - fl - 1/2l2 + 1/12l*4 + 0l*3. Factor b(p). (p - 1)(p + 1) Let k(u) be the first derivative of -4 + 2/3u3 - 1/2u*2 + 0u - 1/4u4. Determine v so that k(v) = 0. 0, 1 Let o be 1 + (3 - -1) + 0. Let a(l) = 3l - 25. Let p be a(10). Factor of3 - f3 - 5f*5 - 2f4 - fp. -2f3(f + 1)(3f - 2) Let h be (-52)/(-30) - 44/33. Suppose 0x = 3x - 9. Determine f so that -8/5f - 12/5f*2 - 2/5f*4 - h - 8/5f*x = 0. -1 Solve 1/8r*2 + 1/8r*3 + 0 - 3/4r = 0 for r. -3, 0, 2 Suppose -5u + 97 = 3d, u + u - 3d = 22. Let y = -15 + u. What is f in 6/5 + 3/5f - 3/5fy = 0? -1, 2 Let o(b) = -55b + 13 + 20b2 - 12b + 137b2. Let d(x) = 79x*2 - 34x + 7. Let z(u) = -7d(u) + 4o(u). What is y in z(y) = 0? 1/5 Let r be (-7 + 2)(0 - 1). Let l(k) be the first derivative of 2/21k*3 + 1/21k*6 + 0k - 2 - 2/35kr + 0k*2 - 1/14k*4. Factor l(n). 2n*2(n - 1)*2(n + 1)/7 Factor -3s2 - 1 + 2 + 4s*2 - 5. (s - 2)(s + 2) Factor 5r2 + 10r*5 - 5r*5 + 20 - 5r*4 + 7r - 25r3 + 33r. 5(r - 2)2(r + 1)*3 Let f(k) be the second derivative of 1/180k*6 + 0 + k + 1/6k*3 + 0k*4 - 1/30k*5 + 0k*2. Let h(n) be the second derivative of f(n). Factor h(j). 2j(j - 2) Let d(n) be the second derivative of 0n*3 + 1/16n*4 + 0 + 1/40n*5 + 2n - 1/8n2. Find b, given that d(b) = 0. -1, 1/2 Let v(y) = -y2 - 7y - 4. Let t be v(-6). Let z(s) be the third derivative of -2/9s3 + 0 + 2/15s*5 - 7/180s*6 + 0s - 1/12s4 + ts*2. Factor z(o). -2(o - 1)*2(7o + 2)/3 Suppose 9u + 0u = 27. Let w(x) be the first derivative of 1/10x*5 + 0x + 1/2xu - 3 + 1/4x*2 + 3/8x4. Find j, given that w(j) = 0. -1, 0 Let z(k) be the second derivative of -k4/28 - k*3/7 + 10k. Suppose z(o) = 0. What is o? -2, 0 Let x(l) be the first derivative of -l*4/2 + 2l*3 - 3l*2 + 2l - 9. Factor x(k). -2(k - 1)3 Let -88d*4 - 590d*2 - 451 + 83d*4 + 900d + 46 + 100d3 = 0. Calculate d. 1, 9 Suppose -3/2w - 3/8w2 + 9/2 = 0. Calculate w. -6, 2 Let x(l) = -3l*3 - 3. Let o(h) = 3h3 + h2 + 4. Let r(m) = -3o(m) - 4x(m). Find p such that r(p) = 0. 0, 1 Let q(o) be the first derivative of o7/1400 - o6/1800 - o5/200 + o4/120 - 3o3 - 4. Let g(p) be the third derivative of q(p). Factor g(n). (n - 1)(n + 1)(3n - 1)/5 Let k = -5 + 8. Let q(c) be the first derivative of 0c2 - 1/6c*6 - 2 + 3/4c*4 - 2/3c*k + 0c*5 + 0c. Let q(j) = 0. Calculate j. -2, 0, 1 Let u(x) be the first derivative of -x6/45 - x5/6 - x*4/2 - 7x*3/9 - 2x*2/3 - 6x - 2. Let n(w) be the first derivative of u(w). Solve n(m) = 0. -2, -1 Let p be 40/22 + 2/11. What is q in -q - p + 2q + 2q*2 - q = 0? -1, 1 Let t(y) = y - 2. Let m(u) = 3u*2 - 22u + 32. Let n(q) = -m(q) - 4t(q). Determine g, given that n(g) = 0. 2, 4 Let a(n) = n3 - 3n*2 - 3n - 1. Let s(b) = 6b3 - 15b*2 - 15b - 5. Let d be (-4)/(12/33) + 3. Let l = 3 - d. Let y(r) = la(r) - 2s(r). Factor y(v). -(v + 1)3 Let r(c) be the first derivative of -c7/84 + c*6/60 + 4c - 5. Let d(f) be the first derivative of r(f). Determine v, given that d(v) = 0. 0, 1 Let x(t) be the second derivative of t*5/4 + 5t*4/12 - 25t*3/6 + 15t*2/2 + 10t. Suppose x(r) = 0. Calculate r. -3, 1 Let q(l) = l + 15. Let j be q(-11). Suppose -v = jv - 10. Solve 6r*3 + 2r*v + 0r*2 - 3r*4 + 5r*4 + 2r + 4r2 = 0 for r. -1, 0 Let d(b) = 2b2 + b + 1. Let u be d(-1). Determine h so that h4 - 2h - hu - h3 - h3 + 5h - h = 0. -1, 0, 1, 2 Determine c so that -17c5 + 4 + 30c*5 - 4c + 8c3 + 4c*4 - 8c*2 - 17c5 = 0. -1, 1 Let s(p) be the third derivative of p8/10080 - p7/1890 + p6/1080 + p*4/8 + 2p*2. Let g(r) be the second derivative of s(r). Factor g(m). 2m(m - 1)2/3 Let n(j) be the first derivative of j5/20 - j4/12 + 3j - 4. Let y(r) be the first derivative of n(r). Let y(g) = 0. Calculate g. 0, 1 Factor 3k3 - k3 - 239k*2 + 237k*2. 2k*2(k - 1) Suppose 4u + a - 20 = 0, 0 = 2u + 2a - 1 - 3. Solve 0t*4 + 2t3 + t3 - 3t5 + 6t*4 - ut*2 = 0 for t. -1, 0, 1, 2 Let l = 570 - 45599/80. Let z(w) be the second derivative of 0w*3 + 0w*4 + lw*5 - 3w + 0w2 + 0. Find s such that z(s) = 0. 0 Let v(q) be the first derivative of -q4/18 - 8q3/27 - q2/9 + 4q/3 + 48. Let v(s) = 0. Calculate s. -3, -2, 1 Let m = 8 + -8. Factor -3 + 3h*2 + 2h - 2h3 - h2 + 1 + m. -2(h - 1)*2(h + 1) Let j = -148 - -89. Let l = j - -239/4. What is z in 0 + 0z - 3/4z*4 + lz*2 + 3/4z*3 - 3/4z*5 = 0? -1, 0, 1 Let q be (-22)/(-33) - (-4 - (-3 + 1)). Factor qc - 4/3c4 + 8/3c*2 + 0 - 2c*3 + 2/3c*5. 2c(c - 2)2(c + 1)*2/3 Let a(c) be the third derivative of 0c - 1/60c4 + 0 + 1/50c*5 - 1/150c*6 + 0c*3 - 2c*2. Factor a(s). -2s(s - 1)(2s - 1)/5 Let r(m) = -13m*5 + 73m*4 - 85m*3 + 19m2 + 5. Let p(g) = g5 - g4 - g3 - g*2 + 1. Let l(k) = 5p(k) - r(k). Factor l(v). 2v2(v - 3)(3v - 2)*2 Suppose 4/13c*4 + 2/13c*2 + 0 + 0c - 6/13c3 = 0. Calculate c. 0, 1/2, 1 Let i(j) = 36j - 286. Let l be i(8). Let 0ol + 9/5o - 3/5o3 + 6/5 = 0. Calculate o. -1, 2 Suppose 0 = -3i - 6i + 18. Let r(d) be the second derivative of 2/7d*i + 4d + 1/42d4 - 1/7d*3 + 0. Factor r(a). 2(a - 2)(a - 1)/7 Let q be (-70)/(-90) + 4/18. Let r(c) be the first derivative of -1/6c*3 - q + 1/4c + 1/8c2. Suppose r(m) = 0. What is m? -1/2, 1 Let t be 32/12 - 2/3. Factor -2r*3 - 4r*5 - 2r*4 - tr + 2r + 8r*4. -2r*3(r - 1)(2r - 1) Let m(i) = 4i + 4i*2 + 14i*2 - 10i - 17i2 + 2. Let s be m(6). Find l such that -2/7l*3 + 4/7l*s + 2/7l - 4/7 = 0. -1, 1, 2 Let g(l) = 7l2 - 13l - 4. Let c(s) = 15s2 - 27s - 9. Let r(k) = 4c(k) - 9g(k). Factor r(d). -3d(d - 3) Let n(m) = m. Let d be n(5). Suppose 7a = 3a - 3o + d, -3a = 2o - 4. Suppose -ar*4 - 2r*2 + r - 6r*3 - 4r*2 - 3r = 0. Calculate r. -1, 0 Let h(u) = -6u2 + 73u - 54. Let v(m) = 3m2 - 36m + 27. Let w(l) = -6h(l) - 13v(l). Solve w(y) = 0 for y. 1, 9 Let g(v) = -6v2 - 8v. Let r(a) = -4a2 - 4a + 5. Let h(b) = 5b2 + 5b - 6. Let m(s) = -5h(s) - 6r(s). Let t(n) = -g(n) + 8m(n). Factor t(q). -2q*2 Let r = -20 + 24. Factor -4d*3 - r + 4d*3 - 4d + 5d3 - d3 + 4d*2. 4(d - 1)(d + 1)2 Let f(g) be the second derivative of 0g*3 - 4g + 0g6 - 1/42g*7 + 0g*4 + 0g*2 + 0 + 1/20g*5. What is t in f(t) = 0? -1, 0, 1 Suppose 11 = -y - 5t, -2t = -6t - 12. Let -2u + 2u*5 + 3u*4 - 3u*4 + yu*4 - 4u*2 = 0. Calculate u. -1, 0, 1 Factor 2/7c*3 + 24/7 - 16/7c - 2/7c2. 2(c - 2)*2(c + 3)/7 Let v(z) be the first derivative of 4z + 5/4z*4 + 3 - 2z*3 - 3/2z*2. Suppose v(j) = 0. What is j? -4/5, 1 Determine t so that -2t*3 + 0t*2 + 8/7t - 6/7t4 + 0 = 0. -2, -1, 0, 2/3 Let t = -16 + 19. Let o be (t - 0 - 4) + 1. Let 0g*4 + 3/2g*3 + 0g + og2 + 0 - 3/2g*5 = 0. What is g? -1, 0, 1 Factor -23g - 8 - 67g3 - 44g*2 - 4g*5 - 24g*4 - 20g*2 - 13g + 11g3. -4(g + 1)*4(g + 2) Let l(d) be the second derivative of -3d8/2240 - d7/168 + d6/120 + d4/3 - 7d. Let j(y) be the third derivative of l(y). Solve j(n) = 0 for n. -2, 0, 1/3 Let m(w) = -2w3 + 2w*2 - 1. Let y be m(-1). Factor -r - 1 - 8r2 + r3 + 9r2 + 0r*y. (r - 1)(r + 1)*2 Factor 31 - 17 - 4n*2 - 4n + 4n3 - 10. 4(n - 1)*2(n + 1) Let r be (10/(-1) - 0) + -1. Let l = r - -11. Determine d, given that 1/3d4 - 1/3d*2 + 0d + ld3 + 0 = 0. -1, 0, 1 Factor 2 - l2 + 6l*2 + 0l*2 - 7l*2. -2(l - 1)(l + 1) Let x(p) be the third derivative of -p8/1008 + p7/105 - 11p6/360 + p5/30 - 9p2. Find z, given that x(z) = 0. 0, 1, 2, 3 Let a(w) = -w3 + 2. Let o be a(0). Let 16 + 54s*3 + 45s*2 + 88s - 4s3 + 54s*o + 41s*2 = 0. What is s? -2, -2/5 Let d(k) be the second derivative of -2k*7/147 - 2k**6/3	{ "pile_set_name": "DM Mathematics" }
11. Let r = 0 - g. Let i be 5/210164 - 4. What is the closest to -1 in i, r, -0.4? -0.4 Let m be -4 - (2 + 705/(-112)). Let h = m + -1/112. Which is the closest to -1? (a) 1/7 (b) h (c) 4 a Let d be 56/90 - 4/18. Let v = -0.76 - -2.87. Let y = v + -0.11. What is the closest to 0 in d, 1/3, y? 1/3 Let v = -6.1 - -8.1. Which is the nearest to -2/3? (a) 3 (b) v (c) 5 b Let y(w) = -2w - 5. Let v be y(-4). Suppose -4f + 4 = 0, vf + 1 = -2z + 2f. Let t = -29 + 31. What is the closest to t in 2, z, -3/2? 2 Let c = 1.4 + -1.2. Let p = 0.1 - c. Let h = 4.02 - 0.02. What is the nearest to p in 0.1, h, -2? 0.1 Let j = 109/44 - 30/11. Let z = 0.2 - 1.2. Let d be -5 + (-14)/(-4) - (-3)/2. What is the closest to 0 in j, d, z? d Let x = 1.4 - 0.4. Let z = x + 2. Let q = 18.2 - 18. What is the nearest to 0.4 in -5, z, q? q Let u = -25/12 - -7/3. Suppose 4p = 4j - 0j - 8, 4p = -j + 12. Let s be (6/j)/(63/(-24)). What is the nearest to u in s, -5, 1/11? 1/11 Let v = -0.81 - 0.19. Let w = 0.4 - 0.5. Which is the closest to v? (a) 1 (b) w (c) 2 b Let v be (-24)/(-32)2/6. Which is the nearest to v? (a) -1 (b) 1 (c) 2 b Let g = -12 + 17. Suppose -20 = 5v, 5y - 2v = 3y + 28. Let h = y - 12. Which is the closest to h? (a) -0.5 (b) g (c) -0.3 a Let r = -4 - -3. Let i = -7 + 4. Let n = 3.1 + i. What is the closest to r in n, -4, -5? n Let w be (-417)/(-645) + (-12)/20. Let c = 39/86 + w. Let x = 0 + 0.1. What is the nearest to x in c, 0.2, 3? 0.2 Let y = -10 - -13. Let p be 5 + 1 + 2 + -3. Which is the nearest to y? (a) 2/7 (b) -2 (c) p c Let j = 0.11 + -1.11. What is the nearest to -0.2 in 2/3, -0.4, j? -0.4 Suppose -j + 0j - 29 = -2b, 4b - 3j - 55 = 0. Suppose -5u = -u + b. What is the nearest to -1 in 0.1, u, -0.4? -0.4 Let p = 99 + -99.1. Which is the nearest to p? (a) -5 (b) -0.05 (c) 1 b Let o = 9 + -9.4. Let i = o - -0.1. Let t be (-3)/((-90)/4)-10. What is the closest to -2/3 in t, 2, i? i Let h = 0.86 - -0.14. Let x = 31.3 - 30. Let a = 0.3 - x. What is the closest to h in a, 2, 1? 1 Let l be (-21)/((-4)/2). Let o = 8 + -17/2. What is the nearest to l in 2/3, o, 0.4? 2/3 Let o = 2.4 + -2.6. Which is the nearest to 6? (a) o (b) 3 (c) -2 b Let p = 199/3 + -66. Which is the nearest to p? (a) -2/15 (b) 24 (c) -2 a Let y = -99 - -98. Which is the closest to -2? (a) -5 (b) -1/3 (c) y c Let c = 1.06 + -0.06. What is the closest to c in 0, 5, 1/7? 1/7 Let s(t) = -t*2 + 1. Let z be s(2). Which is the closest to 1? (a) z (b) 3 (c) 0.1 c Let k = -12.8 + 14. Let l = 0.7 - k. Which is the closest to 2/7? (a) -2/5 (b) 3 (c) l a Suppose 3v - 2v = 3. Which is the closest to 2? (a) -3 (b) 5 (c) v c Let d = 2 - 2. Let i = -53.5 + 54. Which is the closest to d? (a) 1 (b) i (c) 0.2 c Let o = -0.47 + -0.03. Let y = 0.02 + 0.08. What is the nearest to 3 in -0.3, y, o? y Let w = 4.33 + -0.33. Which is the nearest to -1? (a) w (b) 2/13 (c) 0 c Let d(u) = -u3 - 3u*2 - 2u. Let i be d(-2). Which is the closest to i? (a) 2 (b) 0.3 (c) -3 b Suppose -1 = -4x + 3. What is the nearest to x in -0.3, -5, 5? -0.3 Let x = 51.1 - 51. Let j = -0.87 - -0.9. Which is the nearest to x? (a) 0.2 (b) j (c) 1 b Let d = 33.9 + -34. Which is the closest to d? (a) -1/3 (b) -2 (c) -0.1 c Let h = 1.5 + 0.5. Let m = -0.4 - 0.6. Let z = 0 + -0.5. Which is the closest to m? (a) h (b) z (c) -0.2 b Let l(s) = -s2 + s + 2. Let w be l(0). Suppose -5p - 48 = 2u, u = 3p + 10 + 10. Let k = -5 - p. Which is the closest to 0? (a) w (b) k (c) 0.4 c Suppose 10q - 22 = 8. Let v = -22 + 112/5. Let j = -0.3 + 0.4. Which is the nearest to v? (a) j (b) q (c) 2 a Let z = -23/45 + -4/45. Let g = 5819/100 + 139/25. Let j = g - 64. What is the nearest to j in -0.5, z, 1? -0.5 Let r = 364 + -367.99. Let y = r + 3.8. Let v = 0.01 - y. What is the nearest to 1 in -1, -0.1, v? v Let r = -7 + -4. Let o = -10.6 - r. Which is the closest to -2? (a) o (b) 3/4 (c) 2 a Let k = -2.942 + -0.058. Which is the nearest to 1? (a) 1/2 (b) -5 (c) k a Let x = 4 + -4.1. Let d = 5 - 8. Let j = -0.1 - 0. Which is the nearest to j? (a) d (b) x (c) -5 b Suppose -2o + 3o = -3o. What is the nearest to 2/7 in o, -1, -0.3? o Suppose -3m - 18 = -3p, 0m - m - 4 = 0. What is the closest to p in -0.4, 1, 0.3? 1 Let m = 28 - 23. What is the nearest to -2/3 in 1, m, -0.5? -0.5 Suppose -4c = -0c. Let o be (0 - 0) + -2 + 7. What is the closest to c in o, 2, 4? 2 Let u = 0.3 - -1.7. Let r = u - 2.1. What is the closest to 1 in 5, r, 0.2? 0.2 Suppose -2h + 4 + 0 = 2t, 4h = 2t - 22. Let k = -3 + 1. Let z = k - -2. What is the closest to -2 in t, z, 1? z Let c = 1.3 + 2.7. Let g = c + -2. What is the nearest to g in 2/3, -5, 0.4? 2/3 Let q = -6 + 6. What is the closest to -4 in q, 2, 4? q Let x = 19 - 21. Let l(a) = -3a + 9a2 - 10 + 4a*3 - 3a*3 + 2a. Let t be l(-9). What is the nearest to t in x, -0.3, -3? -0.3 Let h = 0.14 - -1.46. Let t = h - -0.4. What is the nearest to 2/3 in 4, t, -0.3? -0.3 Suppose 0 = -2w - 7u + 2u - 25, -20 = -w + 4u. Let j = -0.9 - -1. Which is the closest to w? (a) 0.4 (b) 1 (c) j c Let y = -16 + 16. What is the closest to y in -1/5, 0.1, 2? 0.1 Let d be (-4)/((-16)/7) + -1. What is the nearest to 1 in -0.3, 4, d? d Let o = -0.23 + 0.13. Which is the closest to 3/4? (a) -3 (b) o (c) -2/7 b Let z = -14 + 16. What is the nearest to -0.2 in 4, z, -4? z Let s = -16.26 + 16. Let n = -16.06 - -16. Let j = s - n. What is the closest to 0.2 in 3, j, 5? j Suppose 0 = -5n + 6 - 1. Let x be 1 - n - (-3)/(-4). Let m = -0.2 + 0.3. What is the nearest to m in -2/5, x, 5? -2/5 Let w = -2.85 + -0.15. Which is the nearest to -2/5? (a) -0.5 (b) -1/3 (c) w b Let i = -72 + 647/9. Suppose s + 76 = 2s. Let f = s - 226/3. Which is the closest to f? (a) 2 (b) 2/7 (c) i b Let u = 4 - 9. Let f = 0.8 + -0.74. Let v = f + -4.06. What is the nearest to 1 in u, -1/5, v? -1/5 Let y = -8 - -8.5. Let x = -0.7 + y. Let v = x + -0.3. Which is the closest to 0.1? (a) -1 (b) v (c) -1/5 c Let n = 13 + -9. Let b be -4 - (1 - -1)/2. Let w = 0.03 + -0.23. What is the nearest to -1 in b, w, n? w Let v(w) = -4w + 2. Let p be v(0). What is the nearest to 1/3 in -2, p, -1? -1 Let l = -4.8 - -0.8. Let k = l - -3.5. Let t = 2 + -1.9. What is the nearest to t in 0.1, k, -2/9? 0.1 Let s = -21 + 20.8. Which is the closest to 0? (a) -3 (b) s (c) 1/4 b Suppose r = -2r + 72. Let i be r/(-5) + (-1)/5. Let x be 7/i + (-10)/(-25). Which is the nearest to -0.1? (a) -0.5 (b) x (c) 0.1 c Let d = -11.1 - -11. Let j = 6 + -10. Let y = -2 + 5. What is the nearest to d in -0.2, y, j? -0.2 Let z be 4(2 - (-25)/(-10)). Let x = 1.94 + 0.06. Which is the nearest to z? (a) x (b) -2/11 (c) 0.2 b Let o = -0.3 - -0.3. Suppose v = f - 1, 2f + 3v - 16 = -2v. Suppose -k + f = h + 7, 0 = -3h + k + 4. Which is the closest to o? (a) h (b) 2/3 (c) 1 a Let s be (-3)/(-10)12/(-18). Let m = 0.1 + -0.2. Which is the nearest to m? (a) -1 (b) s (c) 4/9 b Let a = -22 + 21. What is the nearest to 0 in a, -6/5, 0.01? 0.01 Let j be (-28)/24 - 34/(-24). What is the nearest to j in 1/4, -0.3, -2? -0.3 Let j be -1 + ((-16)/(-14) - (-7)/49). Let z = 1 - 0. Let h = 160 - 1442/9. Which is the closest to j? (a) -0.2 (b) h (c) z a Suppose -3o + 15 = 2v, 0o + 9 = -3o. Let s = v - 10. Suppose -3z - 7 = 2m - m, -sm = -5z - 8. What is the nearest to m in -2/7, -0.4, -2? -0.4 Let y = -13 - -12.7. Let z = 0.1 - y. What is the nearest to 0 in z, -2, 4? z Let j be 128/(-462) - (-18)/99. Which is the closest to j? (a) 2 (b) -3/4 (c) 0.4 c Let u be (6/20)/((-6)/(-8)). Let q = -8/9 + 58/45. Let h be 30/4(-5)/25. Which is the nearest to q? (a) u (b) h (c) -2 a Let c = -26 - -27. Let b = 0.38 + -0.08. What is the closest to -2/7 in 5, b, c? b Let f = -0.6 + 1.1. Let w = -0.9 + f. Which is the nearest to 0? (a) w (b) -0.2 (c) -2 b Let l(m) = -m*3 + 4m*2 - 2m - 7. Let i be l(3). Which is the nearest to 0.1? (a) 1/4 (b) i (c) -1 a Let i be 12/1428/16. Let q be (1 + -7)(-1)/(-4). Suppose 12 = 5j + 2. What is the nearest to 1 in q, j, i? i Let t(v) = 6v**3 - v. Let n be t(1). Let h be (-32)/180 - 2/9. Let f = 0 - -1. Which is the nearest to h? (a)	{ "pile_set_name": "DM Mathematics" }
-11o3 - 106o*3 + 18o3 + o2. -99o3 + o2 Collect the terms in 161c - 197c - 2253c - 478c. -2767c Collect the terms in -410q + 1339q - 4 + 445q. 1374q - 4 Collect the terms in -223968m + 223968m + 5m3. 5m*3 Collect the terms in 8 - 65a - 4 - 2 - 9a. -74a + 2 Collect the terms in -7t2 + 7t*2 - 212t*3 + 1102t*3. 890t*3 Collect the terms in -4p*3 - 5923965057 + 5923965057. -4p*3 Collect the terms in -64q - 58q + 122q + 15q2. 15q*2 Collect the terms in -1 + 68 + 5u - 2 - 65. 5u Collect the terms in 18f - 8f - 26f - 29f. -45f Collect the terms in 3c2 - 41c*2 + 14c*2 + 38c*2 + 39c*2. 53c*2 Collect the terms in -137 - 13v - 18v + 134. -31v - 3 Collect the terms in -54b2 + 59b*2 - 3b*2. 2b*2 Collect the terms in 15 + 14 + 14q*3 + 14 - 43. 14q*3 Collect the terms in 28 - 4x + 4x - 53x*3 + 40x*3 + 2x*2. -13x*3 + 2x*2 + 28 Collect the terms in -363u*2 + 281u - 659u2 - 281u. -1022u2 Collect the terms in 4692q + 464q + 3108q. 8264q Collect the terms in 6r*3 + 5r*3 - 31r*3 + 8r*3. -12r*3 Collect the terms in -732p*2 + 104p*2 - 158p*2. -786p*2 Collect the terms in 101c*3 + 0c - 3c + 2c + 0c. 101c*3 - c Collect the terms in 1111i*3 - 520i*3 - 542i*3. 49i*3 Collect the terms in 115688o*2 - 176o*3 + 115695o*2 - 231383o*2. -176o*3 Collect the terms in -56c - 36c - 45c + 140c. 3c Collect the terms in -15l - 100 + 30l - 16l. -l - 100 Collect the terms in -24t - 21t - 26t + 128t - 25t - 22t. 10t Collect the terms in -163k - 158k + 310k. -11k Collect the terms in -12 - u*2 + 3u*2 - 7u*2 - 249. -5u*2 - 261 Collect the terms in -262m*2 - 47m*2 - 34m*2 - 63m*2. -406m2 Collect the terms in -51 + i2 + 10343077i - 10343077i. i*2 - 51 Collect the terms in 16884015 - 16884015 + 11r*2 - 2r*2. 9r*2 Collect the terms in -467y*2 - 169y*2 + 635y2. -y2 Collect the terms in 85g - 113817 + 113817. 85g Collect the terms in 5v + 3v - 11 - 3 - 4 + 19. 8v + 1 Collect the terms in -p3 + 525 - 263 + 398p2 - 262. -p3 + 398p2 Collect the terms in 4q*3 + 7q - 226 + 226. 4q3 + 7q Collect the terms in 25n2 - 5n2 - n2 + 131670n - 131670n. 19n2 Collect the terms in 195j + 48 - 27 + 21j. 216j + 21 Collect the terms in -837v2 + 1 - 1109v*2 - 1 - 187v*2. -2133v*2 Collect the terms in 12h*3 - 19983h + 39955h - 19972h + 1 - 1. 12h3 Collect the terms in 0f + 4f + 21f + 3f - 6f - 13f. 9f Collect the terms in 24b - 24b - 41b2 + 46b*2. 5b*2 Collect the terms in 689h*2 + 10 + 6 - 5 + 4. 689h*2 + 15 Collect the terms in 109w - 292w + 183w - 5w3. -5w3 Collect the terms in k2 - 144k3 + 53k*3 + 5k - 113k3 - 5k. -204k3 + k2 Collect the terms in 2505h - 3013 - 2507h - 7h*2 + 9h*2. 2h*2 - 2h - 3013 Collect the terms in -69u2 + 216u*2 - 79u*2 - 79u*2. -11u*2 Collect the terms in 10m*3 + 8m*3 - 16m*3 + 2162. 2m*3 + 2162 Collect the terms in -1920h - 1227h + 2313h. -834h Collect the terms in 2847z*2 + 5146z*2 + 802z2 + z3. z*3 + 8795z*2 Collect the terms in 6w + 19752789 + 2w2 + w2 - 19752789. 3w*2 + 6w Collect the terms in 3233y - 3229y + 8y. 12y Collect the terms in 51g + g3 - 5 + 5 + g3. 2g*3 + 51g Collect the terms in 0w2 + 124w*2 + 82 - 40w*2 - 82. 84w*2 Collect the terms in 1501r - 377r - 379r - 380r - 383r. -18r Collect the terms in 5r*2 - 3 - 37 + 6r*3 - 6r*2 + 6r*3. 12r3 - r2 - 40 Collect the terms in -6q2 + 59621672 - 59621672. -6q*2 Collect the terms in -33j + 2j + 28j + 3j2. 3j*2 - 3j Collect the terms in 7 - 12l3 + 19l*3 - 2 - 5. 7l*3 Collect the terms in -1327p - 1475p + 4061p - 1562p - 1403p. -1706p Collect the terms in -524o + 53 + 47 - 100. -524o Collect the terms in -261k - 3k2 - 6k*2 + 7k2 + k2. -k*2 - 261k Collect the terms in 355k3 - 116k*3 - 112k*3 - 114k*3. 13k*3 Collect the terms in 41o*3 - 140o*2 - 110o*2 + 250o*2. 41o*3 Collect the terms in 79 - 148 + 69 + 8q*2. 8q*2 Collect the terms in 2u*2 - 50648 + 2u - 2u + 50648. 2u2 Collect the terms in k3 + 1767369k - 1767369k. k*3 Collect the terms in -90 + 140 - 47 + 23d. 23d + 3 Collect the terms in -11 + 3 + 9l - 17l + 9. -8l + 1 Collect the terms in -119i2 + 312i*2 - 105i*2 - 111i*2 + 11. -23i*2 + 11 Collect the terms in -190k*3 + 8 + 45k*3 - 3. -145k*3 + 5 Collect the terms in 295a*3 + 837a - 837a. 295a*3 Collect the terms in 3p + 70 + 69 - 136. 3p + 3 Collect the terms in -457d + 960d - 508d - 3d3. -3d*3 - 5d Collect the terms in -831p + 2530p - 838p - 866p. -5p Collect the terms in 29y + 2609004 - 2609004. 29y Collect the terms in -834z*2 + 1223 - 609 - 614. -834z*2 Collect the terms in -846c*2 + 234c*2 + 200c*2 + 263c*2 + 229c*2. 80c2 Collect the terms in -h3 + 9824h - 4935h - 4877h. -h3 + 12h Collect the terms in -9986u2 + 29200u*2 + 19123u*2. 38337u*2 Collect the terms in 102 - 203 + 5m + 105 - 4. 5m Collect the terms in -424d*2 - 425d*2 - 33 + 850d2. d2 - 33 Collect the terms in 234 - 689 + 33r3 + 231 - 41r*2 + 224. 33r*3 - 41r*2 Collect the terms in -71c*3 - 5 - 2 + 149c*3 + 2 - 92c*3. -14c*3 - 5 Collect the terms in 4504 - 41a*2 - 4504. -41a*2 Collect the terms in -10c - 26434 + 26434. -10c Collect the terms in -6b - 71b2 + 53b*2 + 114b. -18b2 + 108b Collect the terms in -324r + 324r + 354r2. 354r*2 Collect the terms in 290o*3 + 8575o*2 - 8575o*2. 290o*3 Collect the terms in 854i - 880i + 0 - 4 + 4 + 1. -26i + 1 Collect the terms in 4531t2 - 1514t*2 - 1512t*2 - 1503t*2. 2t*2 Collect the terms in 332x*2 - 59x*2 + 610x*2. 883x*2 Collect the terms in 35f - 8f3 + 9f*3 + 3f + 3f + 5f*3. 6f*3 + 41f Collect the terms in 11v + 28v - 83v. -44v Collect the terms in 733r3 + 731r*3 - 2936r*3 + 737r*3 + 734r3. -r3 Collect the terms in 234s - 234s + 2463s2. 2463s*2 Collect the terms in 5u + 783 - 2u - 43u - 395 - 386. -40u + 2 Collect the terms in -47b - 194b2 + 141b*2 + 47b. -53b2 Collect the terms in 1850b*2 - 4b - 1809b2 + 5b. 41b2 + b Collect the terms in -9w - 3w + 1656 + w. -11w + 1656 Collect the terms in 35v - 10v - 7v + 23v + v*2 - 2v2. -v2 + 41v Collect the terms in -198g + 611g - 215g - 196g. 2g Collect the terms in -g*2 + 760 - 760 - 120g. -g*2 - 120g Collect the terms in -738i3 + 2241i*3 - 788i*3 - 796i*3. -81i*3 Collect the terms in -47r*2 + 130r*2 - 7 - 38r*2 - 46r2 + 2. -r2 - 5 Collect the terms in -2v2 + 12101087v - 12101087v. -2v2 Collect the terms in -y3 - 122699960 + 122699960. -y3 Collect the terms in -w3 + 341 - 33 - 278 - 30. -w*3 Collect the terms in -10l*2 - 3l*3 + 108710l - 108710l. -3l*3 - 10l*2 Collect the terms in 525q - 87 + 87. 525q Collect the terms in -588n*3 + 590n*3 + 5n - 2n + 4n + 7. 2n3 + 7n + 7 Collect the terms in -4u2 + u2 + 0u*2 - 273u + 269u + 2u2. -u2 - 4u Collect the terms in -18047d*3 + 687d*2 - 687d*2. -18047d*3 Collect the terms in 15g + 4 - 22g - 9. -7g - 5 Collect the terms in 3569y2 + 1975y*2 - 726y*2. 4818y*2 Collect the terms in -36l + 114l - 19l*2 - 67l*2 - 78l. -86l2 Collect the terms in -521n*2 + 215 - 215 + 6n*2. -515n*2 Collect the terms in -12 + 9 - 620z + 11 + 619z - 8. -z Collect the terms in 213134 - 213134 + 5w*3. 5w*3 Collect the terms in -64g*2 + 8g*2 - 39g*2. -95g*2 Collect the terms in -11v - 152v3 + 3 - 70v*3 + 38v*3 - 5v*3. -189v*3 - 11v + 3 Collect the terms in -14c - 134c + 51c - c3 + 52c + 45c. -c3 Collect the terms in 789 - 5146 - 3n + 3n - n2. -n2 - 4357 Collect the terms in 176k*2 + 109k*2 + 269k*2 + 131k*2. 685k*2 Collect the terms in -11785c*2 + 159c - 171c + 11786c2. c2 - 12c Collect the terms in 3 + d - 8 + 9 - 9 + 5. d Collect the terms in -1665q*2 - 503q*2 + 16898q	{ "pile_set_name": "DM Mathematics" }
0p2 + 0p. Find the second derivative of c(w) wrt w. -36w Let d(h) be the third derivative of -h6/72 - 5h*4/12 - 17h*3/6 + 31h*2. Let z(m) be the first derivative of d(m). Differentiate z(b) wrt b. -10b Let d(m) be the third derivative of 143m7/210 + 101m*3/3 - 28m*2 + 2. What is the derivative of d(c) wrt c? 572c*3 Let u be ((-18)/36)/((-1)/6). Find the third derivative of 54gu + g2 - 52g3 - 11g*2 wrt g. 12 Let m(k) be the first derivative of -269k6/6 - k4/2 - 214k3/3 - 192. What is the third derivative of m(r) wrt r? -16140r*2 - 12 Let f(s) be the second derivative of -43s*6/30 + 65s*3/2 - s - 31. Find the second derivative of f(u) wrt u. -516u*2 Suppose -2c = -4c + 12. Let f = 2 - -1. What is the derivative of -ck + fk + 8 + 2k wrt k? -1 Let p(b) = -3b2 + 3b*2 + 7 + 3b*3 - 8 + b. Let f be p(1). Find the second derivative of 27d*f - 3d*4 + 8d + 0d - 27d*3 wrt d. -36d2 Let o(d) = d2 - d. Let v be o(2). Suppose -3p + 2t + 100 = 0, p - vp + 28 = 2t. Differentiate 14y3 + 4 + 28y*3 - py*3 with respect to y. 30y*2 Let g(t) = 80t*3 + 5t - 35. Let q(l) = 82l3 + 6l - 36. Let y(z) = -6g(z) + 5q(z). Differentiate y(d) wrt d. -210d2 Let l(a) be the second derivative of -229a*8/56 + 49a*4/6 - 139a. What is the third derivative of l(r) wrt r? -27480r3 Suppose w + 143 = 5m, w + 151 = 5m + 4w. Let u = m + -21. Differentiate -3b4 + 0 + 4 + ub*4 with respect to b. 20b*3 Let b(i) be the first derivative of -343i*4/2 + 71i3/3 - i2 + 75. What is the third derivative of b(q) wrt q? -4116 Let o(c) = -148c5 - 6c*3 + 12c*2 - 8c - 5. Let u(w) = w*3 - 2w*2 + w. Let b(v) = -o(v) - 6u(v). Find the second derivative of b(i) wrt i. 2960i3 Suppose -2w + w = -2. Suppose 2n + d = -wd + 10, 3n = d + 4. Find the second derivative of -4m*3 - 5m3 + mn - m*2 + 3m wrt m. -54m Let x(c) = 5c + 32. Let k be x(-6). Find the second derivative of 10 - k - 11a + 21a*2 - 8 wrt a. 42 Let l(c) be the second derivative of 7c*6/5 + 22c*3/3 + 20c. What is the second derivative of l(d) wrt d? 504d2 What is the second derivative of -51l*4 + 7368l*3 + 3l - 7368l3 wrt l? -612l*2 Let t(l) be the second derivative of 2l6/3 - l4/6 - 129l2/2 - 279l. What is the derivative of t(h) wrt h? 80h3 - 4h Let q = -7 + 11. Find the second derivative of 378h3 - 11h - 378h3 + 19h*q wrt h. 228h*2 Let b = 6 + -27. Let u = b - -23. What is the second derivative of 0i - 5i + 19i*u - 13i*2 wrt i? 12 Let w(p) = -p. Let s(l) = -2l*2 + 2l + 1. Let k(t) = -s(t) - 6w(t). Let x be k(-3). What is the second derivative of 7c*4 + xc + 0c - 3c*4 + c wrt c? 48c*2 Let i(c) be the second derivative of 353c*4/4 + 23c*3/3 + 2c + 209. Find the second derivative of i(u) wrt u. 2118 What is the second derivative of -133u3 + 627u - 774u - 15u*3 + 28u*3 wrt u? -720u Suppose -5j + 72 = -8. What is the second derivative of -13z*3 + 0z*3 + jz*5 + 13z*3 + 44z wrt z? 320z3 Let f be (2/(-2) - 1)51/(-6). Differentiate fc4 + c + 110 - c - 79 wrt c. 68c*3 Let h = 25 - 15. Suppose -w - 2i + i = -2, 0 = 2i + h. Find the second derivative of 67 + 5a*2 - 67 - wa + 2a2 wrt a. 14 Let z(v) be the second derivative of 5/2v*3 + 0v*2 + 1/2v*4 + 0 - 21v. Find the second derivative of z(g) wrt g. 12 Let s(t) be the third derivative of -181t5/12 + 581t*4/24 + 924t*2. Find the second derivative of s(v) wrt v. -1810 Let r = -6 + 10. Differentiate -3 + 11 + 10w*2 + rw*3 - 10w*2 wrt w. 12w2 Let o(l) = -l2 - l + 1. Let a(k) = -46k3 - 35k*2 - 4k + 4. Let y(v) = a(v) - 4o(v). Find the third derivative of y(b) wrt b. -276 Let d be 136/22 + (-46)/253. Let x = 10 + -7. Differentiate -2o*x + 5o3 - o2 + o*2 + d with respect to o. 9o*2 Let o be 2/3 - (-1)/3. What is the first derivative of -o - 10m*3 + 9m*3 + 4 wrt m? -3m*2 What is the second derivative of -127n*3 - 527n*4 + 526n*4 + 11n*3 + 422n wrt n? -12n2 - 696n What is the first derivative of -19p2 - 21p*2 - 4 + 3 - 16 wrt p? -80p Let j(x) = -x*3 + 13x*2 - 13x + 16. Let h be j(12). What is the second derivative of -6v - 2v + 3v3 + 2v - hv wrt v? 18v Let p = -8 - -10. Suppose -5q - 2f + 6f = -15, 0 = pq - f - 6. Find the third derivative of 5u5 + 4u*4 - qu4 - u4 + 5u2 wrt u. 300u2 Let a(q) = -q4 - q*3 - 2q - 1. Let x(g) = 4g4 + 3g*3 + 124g*2 + 6g + 3. Let z(d) = 3a(d) + x(d). What is the third derivative of z(c) wrt c? 24c Find the first derivative of -30o - 17 + 3 - 19 + 215o + 16o wrt o. 201 Let w(z) = -311z*3 - 167z*2 - 3. Let b(f) = 622f*3 + 335f*2 + 5. Let r(h) = -3b(h) - 5w(h). Find the third derivative of r(v) wrt v. -1866 Let l(i) = 113i*3 - 33i*2 - 3i + 3. Let x(s) = 339s3 - 99s*2 - 8s + 9. Let w(r) = -8l(r) + 3x(r). Find the third derivative of w(t) wrt t. 678 Let v(k) = -9k4 - 2k*2 - 4k - 160. Let s(p) = 36p4 + 9p*2 + 15p + 641. Let i(w) = -2s(w) - 9v(w). What is the derivative of i(o) wrt o? 36o3 + 6 Let i be (24/60)/((-4)/(-10)2). Let o(t) be the second derivative of -6t + it*3 + 0 + 1/2t*4 + 0t*2. Find the second derivative of o(c) wrt c. 12 Let n(l) = -81l*2 + 88l + 2. Let q(h) = 81h2 - 87h - 3. Let p(x) = -4n(x) - 3q(x). What is the second derivative of p(f) wrt f? 162 Let k(t) be the third derivative of -7t5/20 + 15t4/8 - t3/3 - 81t2 + 2. Find the second derivative of k(l) wrt l. -42 Let w(y) be the second derivative of -221y*4/6 - 475y*2/2 + 419y. Differentiate w(j) with respect to j. -884j What is the first derivative of -3f*3 - 482740f*2 + 113f + 482740f2 + 692 wrt f? -9f*2 + 113 Let k = -49 - -70. Differentiate -ko*2 + 6o*2 - 27 + 36o*2 wrt o. 42o Let t(u) be the second derivative of 719u8/56 - 269u4/12 + u3/6 + 440u. Find the third derivative of t(l) wrt l. 86280l*3 Find the third derivative of 16p*2 + 5p*3 - 6p*2 - 6p*2 - 94p*4 - 78 - 3p*3 - 6p*2 wrt p. -2256p + 12 Let x be (4/6)/(2/24). Differentiate p*4 - 6 + x + 5 + 11p*4 with respect to p. 48p*3 Let x = -44 + 46. Differentiate 14r - 4 - 5 + x - 11 with respect to r. 14 Let g = -6 + 11. Suppose -5t - 3z - g = 0, -2t + z + 11 = t. What is the second derivative of -9x - 18x2 + 6x*t + 13x*2 wrt x? 2 Let w(m) = -2m - 28. Let n be w(-15). Find the third derivative of -g*5 + 5g*2 + 10g*n - 26g5 + g5 wrt g. -1560g2 Let r(k) = -k3 - 5k*2 - 9k - 7. Let y be r(-3). Find the third derivative of -37j - 9j*y - 1 - 28j*6 - 4j*6 + 37j wrt j. -3840j3 Let b(t) = 3t*2 + 10t - 15. Let j be b(-7). What is the second derivative of -jo2 - 32o - 5o2 + 29o2 wrt o? -76 Let f(l) = -l2 + 5l - 2. Let c be f(3). Suppose k - 5 - c = 0. Find the second derivative of 3u*3 - 10u*3 - 2u - 3u + ku wrt u. -42u Let b(v) = v - 1. Let y(w) = -w + 5. Suppose -3d - 3 = -0. Suppose 2r + 12 = 4. Let x(i) = dy(i) + rb(i). Find the first derivative of x(a) wrt a. -3 Let n(v) be the first derivative of v6/3 + 22v*3/3 + 89v*2/2 - 63. Find the second derivative of n(h) wrt h. 40h*3 + 44 Find the third derivative of 357n*2 - 295n*2 - 2n*5 - 76n4 + n5 - 2n4 wrt n. -60n*2 - 1872n Let p be (3 + -2)/((-1)/(-31)). Find the first derivative of 0c + p - 8c - 22 wrt c. -8 Let v(z) = z - 21z2 - 4z + 9z2 + 2 + 8z2. Let y(d) = d2 - d + 1. Let w(i) = v(i) - 2y(i). Find the second derivative of w(m) wrt m. -12 Let d(c) = -45c*3 - 7c*2 - 7c + 39. Let z(l) = 8 - 22l3 + 109l - 3l2 + 12 - 112l. Let n(v) = 3d(v) - 7z(v). Differentiate n(r) with respect to r. 57r2 Let b(w) = -2709w*3 + 489w*2 + 18. Let z(k) = -774k*3 + 140k*2 + 5. Let d(a) = -5b(a) + 18z(a). What is the third derivative of d(l) wrt l? -2322 Find the first derivative of -638j + 177 - 46 + 189 + 568 wrt j. -638 Let l(m) = 15m3 + 19m*2 - 2044m + 11. Let b(i) = -6i3 - 7i*2 + 681i - 4. Let f(p) = -11b(p) - 4l(p). What is the second derivative of f(a) wrt a? 36*a + 2 Let t = -4 + 8. Find the first derivativ	{ "pile_set_name": "DM Mathematics" }
t c be y(u). What is c rounded to the nearest integer? 6 Let r = -12424 - -13491.9. Let v = r + -1025. What is v rounded to the nearest integer? 43 Let u = -8158 - -8157.992567. Round u to 3 decimal places. -0.007 Let g = -27.3 - -20.56. What is g rounded to one dp? -6.7 Let g = -38036887635.00000091 + 38036887464. Let k = g + 171. Round k to seven dps. -0.0000009 Let p = -80557.9963 - -80553. Let r = -5 - p. What is r rounded to three decimal places? -0.004 Let o = -9 + 76. Suppose -10 = -4p + 22. Suppose -p - o = -3g. Round g to the nearest ten. 30 Let b(c) = -1974c - 456. Let l be b(-9). What is l rounded to the nearest 10000? 20000 Let r = 30.997 + 0.003. Let w = r + 310. Let z = w + -340.99823. Round z to four decimal places. 0.0018 Suppose 4n + 2k = -1952, -n - 3n - 1940 = 5k. Let o = 316 + n. Let r = 307 + o. Round r to the nearest ten. 130 Let h = 15868163 - 15868316.99094. Let z = h + 154. Round z to 3 decimal places. 0.009 Let a = 74.00000071 + -74. Round a to 7 dps. 0.0000007 Let q = 12.352 - 0.272. Let n = q + -12.2. What is n rounded to two dps? -0.12 Let b = -74100833 - -37530833. What is b rounded to the nearest 1000000? -37000000 Let s = 0.277 - 0.0897. What is s rounded to 2 dps? 0.19 Let a = 81694900 - 81694900.46999979. Let i = a + 0.47. Round i to seven dps. 0.0000002 Let x = 420.3 + -388. Let f = x + -32.30000531. Round f to 7 decimal places. -0.0000053 Let i = -125082 - 737918. Round i to the nearest 100000. -900000 Let o = -52.49 + 52. Let h = 35.51 - o. Let x = 35.9999997 - h. Round x to six dps. 0 Let v = -0.3000021 + 0.3. Round v to 6 dps. -0.000002 Let s = -1458 + 1429.94. Let c = s - -16. Let o = c + 12. What is o rounded to 1 decimal place? -0.1 Let p = -5.345 - -5.341389. What is p rounded to four decimal places? -0.0036 Let y = 7207 + -3187. Round y to the nearest one thousand. 4000 Let y be -36(2 + 26/(-3)). Suppose -4d + y = -0d. Suppose -d = f + 24. What is f rounded to the nearest 10? -80 Let z = 0.2315 + 0.0095. Let v = -0.241187 + z. Round v to 5 dps. -0.00019 Let m = -1729.874 - -1736. Let b = -7.04 + m. Round b to 1 dp. -0.9 Let p = -72.68 + -0.32. Let j = 72.815 + p. Round j to two decimal places. -0.19 Let a = -113.00000296 - -113. Round a to six dps. -0.000003 Let u(f) = 973f3 - 4f*2 - 3f - 6. Let p = 20 + -9. Let l = -5 + p. Let o be u(l). What is o rounded to the nearest 100000? 200000 Let n = 4802.719 - 4824.1. Let p = n + 0.181. Let f = p + 32.1. What is f rounded to zero dps? 11 Let r = 337.821 + -0.821. Let j = 336.9859 - r. Round j to 3 decimal places. -0.014 Let h = -52.5 - -47. Let v = -0.7 + h. Round v to the nearest integer. -6 Let u = -96994 - -96993.9630042. Let p = 0.008 + -0.045. Let a = u - p. What is a rounded to 6 dps? 0.000004 Suppose 17y - 3330 = 16y. Suppose -9p - y = -18p. What is p rounded to the nearest 100? 400 Let b = -465.66692592206 + -60377395.33319207794. Let r = 60377764 + b. Let o = r - -97. What is o rounded to five decimal places? -0.00012 Let o = -53 + 51. Let m(j) be the first derivative of 1925000j3/3 - j2/2 - 2j - 1. Let w be m(o). Round w to the nearest 1000000. 8000000 Suppose 3p + 60687088 = 2o, 3o - 2o = -4p - 80916132. Let u be 12021/(-2)21192. Let v = p - u. Round v to the nearest 1000000. -6000000 Let o = -3.98 - 7.96. Let r = o - -12. Let t = r + -0.05977. Round t to 4 dps. 0.0002 Let m = 0.647 - 0.647826. What is m rounded to four dps? -0.0008 Let u = -206361471.6981684 - -206361427. Let w = -48.3018275 + u. Let o = w + 93. What is o rounded to six dps? 0.000004 Suppose 60 = 3x + 2x. Let t be 4/(x/(-9)) - 419. What is t rounded to the nearest 10? -420 Let o = -9188 - -9187.88129. Let i = -55.882 + 56. Let q = o + i. What is q rounded to four decimal places? -0.0007 Let h = -625 + 443. Let i = h - -182.000000428. Round i to 7 dps. 0.0000004 Let n = 716168543 - 716168530.99999998. Let y = n - 12. Round y to seven decimal places. 0 Suppose -n + 5 = 0, 2w + 1820005 = n - 0n. What is w rounded to the nearest 100000? -900000 Let a = 3.7 - 25.7. Let p = a + 22.00001. Round p to six decimal places. 0.00001 Suppose 3f + 3k = 7860012, -4k = -2f - 0f + 5239984. What is f rounded to the nearest 100000? 2600000 Let q = 12 - -1. Let u = -10 + q. Let f(g) = 58g3 - 4g*2 + 5g - 5. Let s be f(u). What is s rounded to the nearest 100? 1500 Let k(f) = 44f2 - 22f - 19. Let o be k(-10). Suppose -o = -b - 1551. Round b to the nearest 100. 3100 Let y = -1.12243 + 0.02363. Let r = -1.1 - y. What is r rounded to 3 dps? -0.001 Let w = 48 + -53.8. Let u = w + 5.800015. Round u to five dps. 0.00002 Let h be 0 - (2 + -4 + 6). Let s be (-8)/h4154/4. Let q be -41 - (s + -1). Round q to the nearest one hundred. -2100 Suppose s + i = -0i - 8361, 16 = -4i. Let w = -3169 - s. Let h = w - 3338. What is h rounded to the nearest one hundred? 1900 Let j = -154.29 - 3.71. Let c = j - -158.231. Let v = c - 0.23099754. Round v to 7 dps. 0.0000025 Let f = 6957.999978322 + -6958. What is f rounded to 6 decimal places? -0.000022 Let w(y) = 26y2 - 7y + 7. Let p = 60 + -51. Let g be w(p). What is g rounded to the nearest 100? 2100 Let b = 112 - 115. Let i(j) = 808j2 + 8. Let x be i(-7). Let k be x(-2 - (-244)/b). Round k to the nearest one million. -3000000 Let o = 1265 - -33442. Let k be 9/12 + o/12. Let y be 8 + -11 + 0 + k. Round y to the nearest one hundred. 2900 Let r = -10359 + 15269. Round r to the nearest 10000. 0 Let b = -278 + 315.6. What is b rounded to zero dps? 38 Let a = -37.42 + 37. Let v = -18.66 - -19. Let w = v + a. What is w rounded to 1 decimal place? -0.1 Let d = 84.498033 + -84.5. Let j = -59 + 58.998. Let n = j - d. What is n rounded to five decimal places? -0.00003 Let w be 6/(12/(-4))6/(-4). Suppose wp + 2c + 743 = 4049, -3p = -4c - 3288. Round p to the nearest 1000. 1000 Let k = -0.6 + 0.4. Let j = k - -0.5. Let v = 0.302 - j. What is v rounded to three dps? 0.002 Let z = -15 + 19. Suppose -6r + zr = 45000000. Round r to the nearest 1000000. -23000000 Let k = -7.52 + 7.2. Let b = k - -0.319999735. Round b to 7 decimal places. -0.0000003 Let x be (-2695303)/(-15) + 2/15. Let j(v) = 0v - 4v + 0v*2 - 2v*2 - xv3 + v2. Let d be j(4). What is d rounded to the nearest 1000000? -12000000 Let w = 7 + -13.1. Let q = -2.1 - w. Let y = 18.6 + q. What is y rounded to the nearest integer? 23 Let r be (164000/24)/((14/(-180))/(-7)). Round r to the nearest 10000. 620000 Let y = 308.685 - 309. What is y rounded to one decimal place? -0.3 Let y = -0.043 + 0.043031. Round y to five decimal places. 0.00003 Let k(j) = -347j2 - 17. Let t be k(-6). Let u = -627491 + t. What is u rounded to the nearest 100000? -600000 Suppose -5p - 1292286 + 7242051 = 0. Suppose 2o - 973314 = -2l, -2l - 5o = -p + 216624. Suppose 1296652 = 5b + l. What is b rounded to the nearest 10000? 160000 Let h = 901.999998811 - 902. What is h rounded to 7 dps? -0.0000012 Let c = 32.3019246 + -0.3018971. Let r = -32 + c. What is r rounded to 6 dps? 0.000028 Let t = 0.1629 - 812.1629. Let l = t + 812.159984. Let y = l + -0.16. Round y to 6 decimal places. -0.000016 Suppose -2w + 965 = -5k, -250 = k + w - 57. What is k rounded to the nearest 100? -200 Let a = 605.99999771 + -606. What is a rounded to 6 dps? -0.000002 Let o(g) = -2500630g + 2. Let w be o(1). Suppose -5k + 3k - 32402502 = -4q, -q + 8100603 = -5k. Let h = q + w. Round h to the nearest one million. 6000000 Let y be (-12)/(-15) - (-1)/(10/22). Suppose 3a = y, 6a - a + 61999995 = 5o. What is o rounded to the nearest one million? 12000000 Let q = -1.4 - -7. Let g = 33.6 - q. Let i = -28.00088 + g. Round i to four decimal places. -0.0009 Let l = 2344 - 2341.186. What is l rounded to one decimal place? 2.8 Let l = -91607 + 91604.00008. Let v = -4 + 7. Let n = v + l. Round n to four decimal places. 0.0001 Let v(i) = 6338i - 48. Let y be v(-4). Round y to the nearest ten thousand. -30000 Let q = 0.143 - -141.857. Let i = -142.000077 + q. Round i to 5 decimal places. -0.00008 Let d = 40.4 + -91.7. Let r = 58 + d. What is r rounded to the nearest integer? 7 Let i = -299.19996758 - -299.2. What is i rounded to five dps? 0.00003 Let q = 70.22 + -71. Round q to the nearest int	{ "pile_set_name": "DM Mathematics" }
-63/4612. 50732 What is the smallest common multiple of 108 and 1308? 11772 Find the common denominator of -7/10 and -29/535. 1070 What is the common denominator of -63/74 and -47/13? 962 Find the common denominator of -59/212 and -17/76. 4028 Calculate the smallest common multiple of 1340 and 804. 4020 Calculate the common denominator of -127/120 and 139/5160. 5160 Calculate the common denominator of -125/24 and -31/30. 120 Calculate the smallest common multiple of 180 and 32. 1440 What is the common denominator of 121/42 and -9/98? 294 What is the smallest common multiple of 2870 and 902? 31570 Calculate the lowest common multiple of 202 and 909. 1818 Calculate the lowest common multiple of 35 and 25. 175 Calculate the smallest common multiple of 77 and 33. 231 What is the common denominator of 37/48 and 17/120? 240 Calculate the lowest common multiple of 9 and 633. 1899 Find the common denominator of 81/1108 and 109/6. 3324 Calculate the common denominator of -52/121 and 21/44. 484 Calculate the lowest common multiple of 222 and 33. 2442 Calculate the common denominator of 125/24 and -79/1960. 5880 What is the least common multiple of 531 and 295? 2655 Calculate the least common multiple of 126 and 344. 21672 What is the common denominator of 103/40 and 50/9? 360 Calculate the least common multiple of 132 and 132. 132 What is the common denominator of 76/21 and 43/588? 588 Calculate the least common multiple of 64 and 1536. 1536 Find the common denominator of 62/9 and 93/532. 4788 Calculate the common denominator of 45/128 and 117/160. 640 Calculate the least common multiple of 8 and 153. 1224 Calculate the least common multiple of 387 and 430. 3870 What is the common denominator of 49/96 and 107/72? 288 Calculate the least common multiple of 171 and 228. 684 Calculate the lowest common multiple of 5 and 36. 180 What is the common denominator of 83/120 and -47/96? 480 Calculate the lowest common multiple of 90 and 10. 90 Calculate the common denominator of 167/2160 and -53/177. 127440 Calculate the lowest common multiple of 49 and 77. 539 Find the common denominator of -17/52 and 113/56. 728 Find the common denominator of 113/1960 and -37/20. 1960 What is the lowest common multiple of 50 and 210? 1050 Calculate the common denominator of 55/8 and 24/5. 40 What is the common denominator of 121/432 and 1/108? 432 What is the common denominator of 23/105 and 16/3? 105 Find the common denominator of 77/648 and 145/792. 7128 Calculate the common denominator of -113/150 and -93/10. 150 What is the least common multiple of 100 and 52? 1300 What is the lowest common multiple of 810 and 8? 3240 Find the common denominator of 24/767 and -37/104. 6136 Calculate the common denominator of 83/2690 and 89/3766. 18830 Calculate the lowest common multiple of 56 and 3. 168 What is the lowest common multiple of 250 and 520? 13000 What is the common denominator of -17/32 and 47/144? 288 What is the least common multiple of 300 and 1368? 34200 What is the least common multiple of 436 and 62? 13516 What is the lowest common multiple of 2964 and 6? 2964 Calculate the common denominator of -8/635 and -3/127. 635 Find the common denominator of 37/16 and -115/28. 112 Calculate the lowest common multiple of 16 and 38. 304 What is the lowest common multiple of 32 and 224? 224 Find the common denominator of -103/98 and 10/343. 686 Calculate the common denominator of 21/34 and -115/14. 238 What is the smallest common multiple of 113 and 12? 1356 Calculate the least common multiple of 2672 and 3006. 24048 What is the common denominator of -43/13473 and 76/7485? 67365 Calculate the common denominator of 121/60 and -76/111. 2220 What is the lowest common multiple of 48 and 54? 432 Calculate the common denominator of -23/10 and -38/835. 1670 What is the lowest common multiple of 2763 and 2456? 22104 What is the least common multiple of 55 and 5875? 64625 What is the common denominator of -59/28 and -31/228? 1596 Calculate the least common multiple of 20 and 50. 100 What is the smallest common multiple of 8 and 2040? 2040 What is the least common multiple of 322 and 1794? 12558 Calculate the lowest common multiple of 388 and 776. 776 Calculate the least common multiple of 150 and 20. 300 What is the lowest common multiple of 3 and 159? 159 Calculate the least common multiple of 3 and 75. 75 What is the common denominator of 89/32 and -145/24? 96 What is the common denominator of -82/405 and -35/27? 405 Find the common denominator of -151/1302 and -127/3906. 3906 Calculate the common denominator of 57/2 and 187/3810. 3810 Find the common denominator of -9/13 and -39/7. 91 Calculate the common denominator of 43/2 and 33/152. 152 Calculate the least common multiple of 36 and 230. 4140 What is the common denominator of -19/14 and -63/872? 6104 What is the lowest common multiple of 7 and 1828? 12796 What is the common denominator of 73/390 and 71/585? 1170 What is the common denominator of 79/8 and 97/614? 2456 Calculate the common denominator of -20/3 and 89/5760. 5760 What is the smallest common multiple of 58 and 580? 580 Calculate the least common multiple of 220 and 242. 2420 Calculate the common denominator of -95/1448 and 47/724. 1448 Find the common denominator of -5/91 and -125/4862. 34034 Calculate the common denominator of 31/468 and 113/1764. 22932 Find the common denominator of -93/128 and 113/10. 640 What is the least common multiple of 153 and 85? 765 What is the smallest common multiple of 9765 and 15? 9765 What is the common denominator of 99/26 and -85/1262? 16406 What is the smallest common multiple of 10 and 2306? 11530 Calculate the common denominator of 37/22 and -45/74. 814 What is the common denominator of 37/1827 and 125/522? 3654 What is the common denominator of -3/98 and 139/6? 294 What is the lowest common multiple of 4 and 1380? 1380 Find the common denominator of 35/157 and -71/16. 2512 Calculate the least common multiple of 14946 and 3. 14946 Calculate the smallest common multiple of 80 and 40. 80 Calculate the least common multiple of 2924 and 12. 8772 What is the common denominator of -101/80 and -27/310? 2480 Calculate the lowest common multiple of 8 and 356. 712 What is the common denominator of -113/160 and -99/928? 4640 Find the common denominator of -17/24 and 35/12. 24 Calculate the common denominator of 109/36 and -7/138. 828 Find the common denominator of 37/4010 and 3/2. 4010 Calculate the least common multiple of 10 and 7. 70 Calculate the common denominator of -97/12 and 31/7172. 21516 Find the common denominator of -77/120 and -41/22. 1320 Find the common denominator of -33 and -93/2794. 2794 What is the least common multiple of 22 and 30? 330 Calculate the least common multiple of 316 and 300. 23700 What is the common denominator of -53/104 and -41/8? 104 What is the common denominator of 55/4 and 7/73? 292 What is the common denominator of 87/50 and 64/515? 5150 Find the common denominator of -54/115 and -133/138. 690 Find the common denominator of 63/1168 and 67/1460. 5840 What is the common denominator of -59/510 and 35/33? 5610 Calculate the common denominator of 9/11 and 53/88. 88 What is the least common multiple of 176 and 16? 176 Calculate the lowest common multiple of 304 and 104. 3952 Find the common denominator of 7/459 and -83/663. 5967 Find the common denominator of -33/4 and -101/108. 108 Find the common denominator of 38/11295 and -21/2008. 90360 What is the least common multiple of 9 and 36? 36 Calculate the least common multiple of 768 and 320. 3840 Calculate the least common multiple of 496 and 403. 6448 What is the smallest common multiple of 1726 and 11? 18986 What is the common denominator of 53/35724 and -1/15? 178620 Find the common denominator of 85/1344 and 145/1176. 9408 Find the common denominator of -46/25 and 107/20. 100 Calculate the lowest common multiple of 76 and 456. 456 What is the least common multiple of 518 and 740? 5180 Calculate the least common multiple of 500 and 9. 4500 Find the common denominator of -38/159 and -1/106. 318 What is the least common multiple of 33 and 6? 66 Calculate the smallest common multiple of 4700 and 4. 4700 What is the least common multiple of 40 and 340? 680 Calc	{ "pile_set_name": "DM Mathematics" }
ms to micrograms. 18348810000 What is 3/50 of a meter in centimeters? 6 How many millilitres are there in 8.419987l? 8419.987 How many millimeters are there in 33/5 of a meter? 6600 What is 5151.3228 nanoseconds in hours? 0.000000001430923 How many milligrams are there in 82.91326 kilograms? 82913260 Convert 0.2265676 years to millennia. 0.0002265676 How many nanograms are there in 1/16 of a milligram? 62500 What is six fifths of a milligram in micrograms? 1200 What is fourty-one halves of a meter in millimeters? 20500 How many weeks are there in 14055.7788 nanoseconds? 0.000000000023240375 What is 0.9084731 micrograms in kilograms? 0.0000000009084731 What is 11/2 of a week in minutes? 55440 How many kilograms are there in eighty-one quarters of a tonne? 20250 How many millilitres are there in three tenths of a litre? 300 What is 3.061127 millilitres in litres? 0.003061127 How many litres are there in 0.5237584ml? 0.0005237584 What is three eighths of a kilogram in grams? 375 How many meters are there in 7/2 of a kilometer? 3500 What is 789.9163 milliseconds in nanoseconds? 789916300 What is 8.67689 microseconds in seconds? 0.00000867689 How many micrometers are there in one quarter of a millimeter? 250 What is seventeen halves of a millimeter in micrometers? 8500 Convert 297847.935 seconds to weeks. 0.4924734375 What is one fifth of a microgram in nanograms? 200 How many nanograms are there in 13/5 of a microgram? 2600 What is 61/2 of a litre in millilitres? 30500 Convert 172.8435 months to centuries. 0.14403625 Convert 1.10023 grams to kilograms. 0.00110023 What is 1/4 of a day in minutes? 360 How many minutes are there in 802.077 milliseconds? 0.01336795 What is 3/32 of a kilometer in millimeters? 93750 Convert 154722.96 months to years. 12893.58 What is 9234.124 litres in millilitres? 9234124 What is 0.2349395ml in litres? 0.0002349395 What is 3/32 of a kilometer in centimeters? 9375 How many years are there in 9.824717 millennia? 9824.717 Convert 720.9768 nanoseconds to milliseconds. 0.0007209768 What is sixty-four thirds of a year in months? 256 What is 43/4 of a millisecond in microseconds? 10750 Convert 0.8022064kg to tonnes. 0.0008022064 How many microseconds are there in three eighths of a millisecond? 375 How many nanoseconds are there in 0.484017 days? 41819068800000 How many millilitres are there in 24674.51l? 24674510 How many millilitres are there in seven halves of a litre? 3500 How many kilograms are there in 55820.06 grams? 55.82006 Convert 2333.8527s to minutes. 38.897545 What is 165712.1 milligrams in grams? 165.7121 How many litres are there in 179.9304ml? 0.1799304 Convert 6982.858 millennia to centuries. 69828.58 What is 21/2 of a centimeter in millimeters? 105 Convert 88.84395 milligrams to grams. 0.08884395 What is 57/2 of a litre in millilitres? 28500 How many nanograms are there in one twentieth of a milligram? 50000 Convert 46105.67 litres to millilitres. 46105670 What is 296337.5l in millilitres? 296337500 What is 3/32 of a week in seconds? 56700 What is 9898.563g in nanograms? 9898563000000 How many months are there in four fifteenths of a millennium? 3200 Convert 160.634 weeks to microseconds. 97151443200000 What is 6/5 of a minute in seconds? 72 Convert 26.168892 minutes to hours. 0.4361482 What is 0.3240766 decades in years? 3.240766 Convert 0.2569307ml to litres. 0.0002569307 How many months are there in 21/4 of a millennium? 63000 What is 25/2 of a litre in millilitres? 12500 What is 187342.3 nanometers in kilometers? 0.0000001873423 How many decades are there in 10643.53 millennia? 1064353 What is 2.617855ml in litres? 0.002617855 How many millilitres are there in 170700.1 litres? 170700100 Convert 28.44409ug to milligrams. 0.02844409 How many millilitres are there in five quarters of a litre? 1250 What is 423.8659 centuries in years? 42386.59 How many millimeters are there in 3/10 of a meter? 300 How many nanometers are there in 5/8 of a micrometer? 625 How many millilitres are there in 6/5 of a litre? 1200 How many kilograms are there in three eighths of a tonne? 375 What is 0.1403048 centuries in years? 14.03048 Convert 0.5996645 litres to millilitres. 599.6645 What is three fifths of a gram in milligrams? 600 How many millilitres are there in 11/4 of a litre? 2750 Convert 66611.48 centuries to millennia. 6661.148 What is 6.16427ng in kilograms? 0.00000000000616427 How many years are there in one quarter of a century? 25 What is 0.938176 litres in millilitres? 938.176 How many nanometers are there in 17/2 of a micrometer? 8500 Convert 682626.8 millennia to centuries. 6826268 How many nanoseconds are there in 0.1103912 weeks? 66764597760000 How many micrograms are there in 11/8 of a milligram? 1375 Convert 4.842837 millimeters to meters. 0.004842837 What is fifteen quarters of a kilogram in grams? 3750 How many micrometers are there in 7/2 of a centimeter? 35000 What is 13205.45km in centimeters? 1320545000 How many nanograms are there in 985.549g? 985549000000 What is 55/7 of a week in days? 55 How many years are there in 2398.095 months? 199.84125 What is 31/2 of a litre in millilitres? 15500 How many millimeters are there in 0.3582032cm? 3.582032 Convert 44.41716 millilitres to litres. 0.04441716 What is 0.3871692 months in millennia? 0.0000322641 What is thirty-three fifths of a century in years? 660 How many minutes are there in four sevenths of a week? 5760 How many millilitres are there in 52788.74 litres? 52788740 What is 54990.61 decades in years? 549906.1 What is nine tenths of a decade in years? 9 Convert 12756.65 kilograms to micrograms. 12756650000000 What is 1/16 of a milligram in nanograms? 62500 How many millennia are there in 0.2054328 centuries? 0.02054328 What is 520.4619 decades in months? 62455.428 What is 81978.82mm in kilometers? 0.08197882 What is 65.888667 minutes in days? 0.04575601875 How many litres are there in 629.504 millilitres? 0.629504 How many millennia are there in 22259.91 centuries? 2225.991 What is 27/5 of a millimeter in micrometers? 5400 How many milligrams are there in twenty-five halves of a gram? 12500 Convert 81.455175 nanoseconds to hours. 0.0000000000226264375 Convert 15.72688ml to litres. 0.01572688 How many years are there in 2066.885 millennia? 2066885 What is 1/10 of a meter in centimeters? 10 How many micrograms are there in 4495.188kg? 4495188000000 What is 19/4 of a gram in milligrams? 4750 How many millennia are there in 26.88246 months? 0.002240205 How many millilitres are there in 31/2 of a litre? 15500 What is 39847.93ml in litres? 39.84793 What is three fifths of a millennium in centuries? 6 How many micrometers are there in thirteen fifths of a millimeter? 2600 What is 26261.97 centimeters in kilometers? 0.2626197 What is four fifteenths of a century in months? 320 What is 3/40 of a week in seconds? 45360 How many millimeters are there in 99648.93 nanometers? 0.09964893 Convert 0.34061 millennia to months. 4087.32 How many micrometers are there in 6/5 of a millimeter? 1200 Convert 303571.7 days to milliseconds. 26228594880000 What is fifty-five halves of a decade in months? 3300 What is 1.00661ml in litres? 0.00100661 What is thirty-two fifths of a minute in seconds? 384 How many milligrams are there in 2/125 of a gram? 16 What is eleven quarters of a litre in millilitres? 2750 Convert 82.52209 millilitres to litres. 0.08252209 What is thirty-one fifths of a meter in millimeters? 6200 What is 11/4 of a litre in millilitres? 2750 What is one quarter of a millennium in years? 250 What is 1/5 of a gram in milligrams? 200 What is 21/5 of a meter in centimeters? 420 What is 8.326614ml in litres? 0.008326614 How many minutes are there in 9481.217 hours? 568873.02 How many years are there in 723.5083 decades? 7235.083 How many months are there in one quarter of a year? 3 What is 166.7696l in millilitres? 166769.6 What is 3/8 of a week in minutes? 3780 How many grams are there in one tenth of a kilogram? 100 What is 2915.125 micrograms in grams? 0.002915125 What is 1/10 of a gram in milligrams? 100 What is 847217.4km in nanometers? 847217400000000000 Convert 0.8846041 micrograms to tonnes. 0.0000000000008846041 What is 18/5 of a meter in centimeters?	{ "pile_set_name": "DM Mathematics" }
Suppose -2x = -34 + 42. Let j = -132 - -129. Sort p, j, x, 0 in descending order. p, 0, j, x Let a be 2/310/(220/363) - 7. Sort a, -1, 3, 5, -242 in decreasing order. 5, a, 3, -1, -242 Let s = 6021 + -6021. Put s, 0.1, -54 in descending order. 0.1, s, -54 Let p = 161/1032 + -4/129. Let a = 100/7 - 14. Sort p, a, 12 in ascending order. p, a, 12 Let s(v) = -8v - 42. Let j be s(-4). Let g be (26/j)/(6/30). Put -2, g, 3 in descending order. 3, -2, g Let j = -427 - -21. Let r = 401 + j. Sort r, -212, -4. -212, r, -4 Let h(s) = 226s - 1133. Let v be h(5). Put 73, 0, 4, -2, v in descending order. 73, 4, 0, -2, v Let a = 0.32 - 0.02. Let o = 19590 + -176308/9. Put a, o, 197 in ascending order. o, a, 197 Let i = -1 - 1. Let r = i - -2.2. Let y = -794 + 790. Sort r, -2, y in ascending order. y, -2, r Let o = 0 + 2. Suppose -22c + 7p + 56 = -19c, 0 = 2c - p - 19. Sort c, o, -9 in increasing order. -9, o, c Suppose -47w + 4h = -49w - 44, 4w = 4h + 20. Suppose g + 30 = 5t, 5t = -3g + 5 + 5. Sort 21/5, w, t in ascending order. w, 21/5, t Let m = 17.58 + -15.5. Let k = 1.08 - m. Put 1, k, 24 in decreasing order. 24, 1, k Let j(u) = 251u + 491. Let s be j(-2). Sort 2, s, -31 in ascending order. -31, s, 2 Suppose 2434n - 2429n + 14 = u, -2 = 2u. Let f = -558/5 + 111. Put f, 1/13, n, -1 in increasing order. n, -1, f, 1/13 Suppose -24 = 4a - 2j, 2j + 2j - 20 = a. Let k = 0.48 + -0.815. Let l = k - -0.035. Put l, a, -4/7 in descending order. l, -4/7, a Let j = -1/2760 - 3449/2760. Let h = -0.6 - -0.7. Let q = -0.5 + h. Put j, 2/3, 2, q in decreasing order. 2, 2/3, q, j Let l = 10030 - 10029. Sort l, 5, 262 in decreasing order. 262, 5, l Let r be (-42)/(-28)8/3. Suppose -rf = -3 + 27. Let a = 73 - 68. Put f, a, 4 in decreasing order. a, 4, f Let q = 51.4 - 58.88. Let y = -6.98 - q. Let m = -71/30 + -2/15. Sort -10, y, -4, m in increasing order. -10, -4, m, y Let t(q) = -q - 1. Let d be t(-1). Suppose 0 = -5y - dy - 20. Let l = 20 - 15. Sort -2, 2, l, y. y, -2, 2, l Let b = -0.385 - -0.885. Sort -44/9, b, 4 in increasing order. -44/9, b, 4 Let z = -2 + 0. Let j be 4/(-13)(-91)/14. Suppose n + 12 = 4n. Sort n, z, j, 0 in increasing order. z, 0, j, n Let l(c) be the third derivative of -c*5/30 - 2c*4/3 - 5c*3 + 26c*2. Let t be l(-5). Let j be (28/5)/(4/10). Sort t, j, -1 in decreasing order. j, t, -1 Suppose -x = 2h - 21, 0h + 5h + 4x - 54 = 0. Let f be (-1 - 5) + h + -10. Let i be f/81/((-45)/10). Sort i, -4, -2/5. -4, -2/5, i Let j(n) = n*3 + 52n*2 + 193n + 43. Let t be j(-48). Sort t, -72, -0.3 in increasing order. -72, t, -0.3 Let p = -51 - -47. Let w be (2 + (-56)/21)/(p/126). Suppose 18k = wk + 6. Sort k, -13, -4 in decreasing order. k, -4, -13 Suppose 61 = i + 54, -3i + 12 = 3k. Sort k, -4, 2677. -4, k, 2677 Suppose -25z - 217 = 18z - 2. Sort z, 797, 3, 0 in descending order. 797, 3, 0, z Suppose -124 + 194 = -10c. Let r = -61 - -59. Sort r, 3, c. c, r, 3 Let h = -768 - -114. Let b = -653 - h. Sort b, 0.1, 0.24, -0.1 in decreasing order. b, 0.24, 0.1, -0.1 Suppose -d - 1387 = 3t - 1419, 5d = -3t + 28. Let k = -2496/7 + 356. Put -1/2, k, -1/4, d in descending order. -1/4, -1/2, k, d Let n be -4(-5 - 5636/(-1128)). Let p = -17/94 + n. Sort -1/5, p, 3/8, 1/2. -1/5, p, 3/8, 1/2 Let i be 480/(-8)(-36)/15. Suppose 0 = -10q + 8q - i. Sort q, -5, -4 in decreasing order. -4, -5, q Let w(q) = -2q + 1. Suppose -38 = 3d - 95. Suppose dy - 14 = 12y. Let n be w(y). Sort n, 0, 4, -4 in ascending order. -4, n, 0, 4 Let h be (24/(-14))/((-672)/36064). Sort h, 2, 1, -4/5 in increasing order. -4/5, 1, 2, h Let z(x) = -70x + 90. Let o be z(4). Let t be o/(-152) + (2/1 - 4). Sort 1/6, -1/4, t in ascending order. t, -1/4, 1/6 Let x be (40/(-16))/((-36)/72). Put x, 68, 3, -18 in descending order. 68, x, 3, -18 Suppose -332l + 204l + 196l = -272. Sort l, 2, 4, 29, 0 in increasing order. l, 0, 2, 4, 29 Suppose h - 5 = 5n, -6n + 2n = 2h + 4. Suppose 0 = -4j - hj + 148. Let w(g) = 29g - 314. Let p be w(11). Put 3, p, -1, j in ascending order. -1, 3, p, j Let q be (-6)/(-9) + (-28)/6. Let h = 160 + -163. Let g be 11/q - h/(-12). Sort g, 13, 0 in descending order. 13, 0, g Let o = -13 - -12.3. Let p be (-141)/(-15) - (3 - (-13)/(-5)). Let t(v) = v2 - 8v - 13. Let j be t(p). Sort -0.2, o, j in descending order. -0.2, o, j Let j(h) = -h*2 + 36h + 463. Let a be j(-10). Sort -4, 8, a, 1, -14 in ascending order. -14, -4, 1, a, 8 Suppose -n = 1 - 5. Suppose nv - 16 = -56. Let h = -1.6421 - 1.3579. Sort v, 2, h in ascending order. v, h, 2 Suppose -u + 1081 = 3y + 2y, -4y + 884 = -4u. Let q = -4559/21 + y. Sort -5/3, 6, q. -5/3, q, 6 Let v(x) = 33 + 0x + 13x - 3x - 3 + 145. Let t be v(-18). Put t, -6, -5/3, 2/3 in increasing order. -6, t, -5/3, 2/3 Let q(n) = 2n - 4. Let i be q(3). Let y(g) = 31 + 11g - 7226g3 + 3614g*3 + 3613g*3 + 7g*2. Let m be y(-6). Sort 3, 4, i, m in increasing order. m, i, 3, 4 Let d be 3/8 + 205470/(-255696). Let t = -0.1 + 0. Sort 1/6, d, 0.3, t in decreasing order. 0.3, 1/6, t, d Suppose -54m - 25 = -52m - q, 3m + 10 = -4q. Sort -2, m, -4, 17 in decreasing order. 17, -2, -4, m Let f be (4/6)/((-5)/(-150))1. Suppose 50 = 30q - fq. Sort -5, q, -0.02 in ascending order. -5, -0.02, q Let t be ((-20)/105)/(6/(-7)). Let y = -0.22 + 0.02. Sort t, y, -1/8. y, -1/8, t Let j = 11159 + -11155. Let i be (-1)/(8/10 - 1). Let v = 0 - -3. Sort i, v, -4, j in decreasing order. i, j, v, -4 Suppose -5a = 3 - 3. Let f be -6 + 4/(-2) - (-108)/27. Sort -6, 1, f, a in increasing order. -6, f, a, 1 Let q be 16/(-8) - (4 + 2 + -32)1. Put q, -2, -33 in descending order. q, -2, -33 Let x(k) = k*2 - 6k + 3. Let l be x(6). Suppose -3v = -2j + 11, -8j + 3j + 19 = v. Put 0, 4, v, l in descending order. 4, l, 0, v Let y be (10/30 - 2/(-12)) + (-364)/504. Let p(m) = -m3 + 2. Let f be p(0). Sort -14, f, y in decreasing order. f, y, -14 Let h be (-13 - -14)/(1 - 3/6). Suppose -5 = z + 2. Let l = z + 4. Put h, 1, 3, l in descending order. 3, h, 1, l Let m(q) = q2 - q + 1. Let i be m(3). Suppose -2t + 2a + 13 = -5, 0 = -t - 3a - i. Suppose 2r = f, 5r - 5f - t = -0f. Sort r, -5, -2, 1. -5, -2, r, 1 Suppose -41 = 10a - 71. Let f = -43 - -58. Sort f, 0.2, 1, a. 0.2, 1, a, f Let t = -39/2 + 22. Let l = -9.869 - -9.9. Let b = l - -0.169. Sort b, 5, t in descending order. 5, t, b Let u be (4/8)/(1/4). Let h(i) = i*3 + 12i*2 - 3i - 38. Suppose -3c = -10c - 84. Let d be h(c). Sort 0, -8, u, d in descending order. u, 0, d, -8 Let d = 5528.1 + -5528. Sort d, 0.03, -3/5 in decreasing order. d, 0.03, -3/5 Let l = -38.068 - -38. Let o = 61.114 + -61. Let b = l + o. Put 0.2, -1/3, b in increasing order. -1/3, b, 0.2 Let f(s) = s*2 - 4s - 225. Let n be f(-13). Let o be 96/(-816) - (-1)/(-17)n. Let z = -3.2 - -3. Sort -4, o, -1/2, z in descending order. o, z, -1/2, -4 Let z = 4805 + -4804.91. Put 2, z, 0, -4/7 in descending order. 2, z, 0, -4/7 Suppose 0 = 4c + 4k + 31 + 1, -24 = 5c + k. Let a(m) = m*3 - 10m*2 + 17m - 3. Let l be a(8). Sort l, 0, c in descending order. l, 0, c Suppose -2k + 5k = -3h + 57, 5h - 4k - 140 = 0. Let w be (-10)/(5h/20 - 4). Sort w, 0, 4 in ascending order. w, 0, 4 Let t(b) = -b*3 + 4b*2 - 3b - 4. Let p be t(3). Let f = 65.095 + -66.095. Let i be 13/68. Sort f, p, i. p, f, i Let i = 4051 - 4049. Sort 0, -2, i, -26, -1 in descending order. i, 0, -1, -2, -26 Let s(l) = l*3 + 15l*2 - 19l - 25. Let g be s(-17). Let v = -282 - g. Put v, 13, 2 in descending order. 13, 2, v Let v be ((-501)/(-9) + -57)/(8/(-39)). Let c be ((-1)/(-2))/((-4)/(-2)). Put -0.2, v, c in descending order. v, c, -0.2 Let v = 19.928 - -16.072. Sort -3/40, -4, -0.5, v, 2/11. -4, -0.5, -3/40, 2/11, v Suppose -64p + 71p - 35 = 0. Let a be 10/45 + 392/18. Sort a, 4, p in decreasing order. a, p, 4 Let s = 0.192 - 4.192. Sort 22, s, 1/4 in decreasing order. 22, 1/4, s Let y be 25 + -29 + (-27)/(-6). Put -1/4, 4/7, 2, -1049, y in increasing order. -1049, -1/4, y, 4/7, 2 Let j be 558/(-30) - (-3)/51. Suppose -1 = p - 0. Sort p, j, 5 in ascending order. j, p, 5 Suppose -133 = -26v + 595. Suppose -230 = -18m - vm. Sort 1, 9, m in descending order. 9, m, 1 Let w be (-2 -	{ "pile_set_name": "DM Mathematics" }
t t = -19257 - -19272. Solve 2c - 8 = 0, -4c = -48h + 47h - t for h. 1 Suppose 1687g + 276 = 1779g. Solve gf = -24 + 18, f - 22 = -4l for l. 6 Suppose 7i - 11 - 17 = 0. Suppose -5w + ik - 21 = 0, 2w + 0k - 10 = -3k. Let q be (-1 - -1)/(-1)w. Solve q = 2y + 5p + 7, 2y + 2p = 4y for y. -1 Suppose 0 = -3s - 2 - 16. Let m be (1/(-2))/(s/516). Let g = -41 + m. Solve -4x - 3k - 8 = k, -x = -gk + 11 for x. -5 Let x = -125 + 168. Let s = x - 41. Solve m + 1 = -3u, -sm = 4u - u + 5 for u. 1 Let g = -5538 - -5541. Solve 5y = h + 13, -gh + 9 - 8 = -5y for y. 4 Suppose 0u + 2 = u. Let k(l) = l + 6l - 4 - 15l - 2l*u. Let g be k(-3). Solve gm = 6m - 5q - 2, -4q = -4m + 4 for m. 3 Suppose 5t + 0t = -5. Let u(b) = 30 + 3b2 - 30 + 306b - 308b. Let w be u(t). Solve -wf - 3 = -5k + 2, -9 = -3k + f for k. 4 Let w = -504 + 1154. Let t = w + -628. Solve 3k = 2o + t, 3k - k - 33 = 5o for k. 4 Let h(g) = -21 - 9 - 12 - 6g + 2. Let p be h(-7). Solve w = -1, s - pw + 1 = -3w for s. 0 Suppose 228v - 406 = 25v. Solve vj - 1 = -5r - 6, 3 = -3r - j for r. -1 Let t be (-36)/(-4) + (-63)/(3 + 4). Solve 5r + 8v - 3v - 35 = t, 5v = r + 29 for r. 1 Suppose -88c + 205c - 60 = 102c. Solve -2p = -c, 4y + 22 = -0p + p for y. -5 Let y = -7 + 9. Let r = -9 + 29. Let u = r + -20. Solve yc + 10 = 2f, 3f + c = -uc - 5 for f. 0 Suppose -4y = -520 + 144. Suppose 0 = -89x + yx - 40. Solve 2w = -2s - 8, -w + 6w + x = -s for w. -1 Let a = 17570 - 17568. Solve -206o + 207o + 2t = -a, -3t - 6 = 0 for o. 2 Suppose 2w = -3a + 36, -7w + 2a = -5w - 66. Solve -5n = s + 4, 22n - wn = -3s - 12 for s. -4 Let j = -13356 - -13532. Solve -5h = 3z + 184 - j, 2z + 3h + 4 = 0 for z. 4 Let w = 279 - 275. Suppose -2 + 50 = wd. Solve -2m - 3f = f - 8, 4m = -4f + d for m. 2 Let s(v) = 0 - 24 - 17v - 15v + 6v. Let m be s(-1). Solve 4y + 5q - 7 = 0, -mq - 8 = -3y - 3q for y. 3 Let o(d) = d*3 + 28d*2 + 15d + 423. Let c be o(-28). Solve -3r - cj = -3, -11 - 1 = -2r - 4j for r. -4 Let x = 32 - 25. Suppose xw - 4w - 24 = -5b, 3w - 36 = -b. Suppose 6 = wm - 11m. Solve -mf - 9 = 4k, -4f + f - 9 = 2k for f. -3 Let j = 1214 + -1209. Solve -2b + 11 = 3v, 5v + jb - 27 = 6b for v. 5 Let a(y) = 10y - 54. Let v be a(5). Let b be 6((-16)/(-7) + v/14). Solve b = -o + 2f + 2, -20 = -5f for o. -2 Suppose 0 = 5s - 12s + 63. Let l(j) = -j2 + 3j + 58. Let p be l(s). Solve 2i - 5i = 3n - 18, pi + n - 15 = 0 for i. 3 Let n = 393 + -167. Let v = n - 222. Solve -12 = 3l + 3b, -5l = vb - 3b + 24 for l. -5 Suppose -o = 4z - 28, -53z + 58z = -2o + 47. Solve 4a - w = -o, 0 = -6a + 7a + 4w + 4 for a. -4 Let z be 54 + -13 - (-3 - 4). Suppose -zt = -g - 45t - 4, 18 = 4g + 5t. Solve 0 = -ga - u + 10 - 8, -a + 2 = u for a. 0 Let u(z) = -z*3 + 4z*2 + 3z - 8. Let h be u(4). Suppose -2a = -ha. Suppose -2 = 5g - 27. Solve c + 3k + 17 = a, 3k = gc + k for c. -2 Let x(n) = -n*2 + 19n - 22. Let z be x(17). Let o be 9/(z + -12 - (1 - 4)). Solve j = -a + 3, 3a = -5j + 2 + o for j. -2 Let q be (-18 + 150/10)(-20)/6. Solve -6o = -3o + 3z - 15, -q = -3o + 2z for o. 4 Suppose 5t + 61 - 456 = 0. Solve -3w - 5o + 108 - t = 0, 2o = 8 for w. 3 Suppose -2l + 26 + 28 = -4w, -46 = -2l + 2w. Let y = -4 - l. Let m = y + 28. Solve -g + 10 = -mq - 11, 0 = -5q - 4g - 41 for q. -5 Suppose -370b - 6 = -371b. Let a be (12/(-16))/(36/(-40))b. Solve 4c - 3t = -a, 4c + 4t = -t - 45 for c. -5 Suppose 3o - v = -237 + 266, -2v = 10. Solve -16 = -r + 4f, r - of = -12f - 8 for r. 4 Let c be -23(-2)/4. Let z = 1681 - 1679. Suppose -53 = zl + k - 51, -2l + 10 = -2k. Solve 2q + 3h + 11 = 0, -2h - l = 4q - ch for q. -1 Suppose -t + 6 + 7 = 3i, -5i + 17 = -3t. Suppose -7p + 60 = i. Let s = -85 - -89. Solve -m + 4a = -p, sa + 8 = -m + 5m for m. 0 Suppose 3s - 4s - 445 = -5w, w + 4s - 110 = 0. Suppose -wv + 4 = -89v. Suppose -2i = i - 48. Solve 0 = -vo + 5d - 21 - i, 0 = -o + d - 8 for o. -3 Suppose -5b - 4g = -g + 216, 2g = b + 38. Let d be (-6)/(-7)(-147)/b. Let n be ((-25)/20)/((-1)/4). Solve 4q + n - 16 = ds, -4s = 2q + 22 for s. -5 Let p = 3 + 443. Suppose -py + 443y = -27. Solve -t + 11 + y = -5c, 5t + c - 22 = 0 for t. 5 Suppose 2n + 228 = 6n. Suppose 1885u - 1479 = 1856u. Suppose -u = 2j - n. Solve -p + jl = 8, 3p - 2p - l = 0 for p. 4 Let b = -338 - -238. Let u = 101 + b. Solve 0 = -a - 5j - 5, -j - u = 3a - 0j for a. 0 Let p = -465 - -269. Let v = p - -211. Solve j - 14 = -4r, 4r - v = -r for j. 2 Suppose 44 - 53 = -3x. Suppose 0l + 36 = -4l + 4k, l + x = 4k. Let b = 9 - l. Solve -i = -2p + i + 12, -5p + 3i = -b for p. 1 Suppose 2 + 97 = 33w. Suppose -wm + 6l = 2l - 35, -25 = 5l. Solve 5t + 5q = 15, 13 + 8 = mt - q for t. 4 Let s = 191 + -188. Suppose 3j - 6 = 2w, 10w - sj = 5w + 3. Solve -1 = wi - 5q, 5 = -i - 4q + q for i. -2 Suppose 0 = 4u - 4i - 24, 4u + i - 3 = 2u. Suppose 27o - 9 = 26o, 0 = 5m + 3o - 42. Solve 0 = -h - mh + 5b + 3, -ub = -3h for h. -3 Let p = -920 - -575. Let w = p + 208. Let i = 141 + w. Solve -2c + 4m = -2, im + 17 = 4c - 5c for c. -5 Suppose 5o - 66 = 2i, 250o = 245o - 3i + 51. Solve 2u + ob - 8b = -14, -2u + b + 11 = 0 for u. 3 Suppose -p + 14 = n - 2, 3p + 2n - 52 = 0. Suppose -17y - 60 = -py. Solve -5f + y = -0f - 4z, 5f + 2z = 20 for f. 4 Let f = -5 + 10. Let i be 172/12 - (-30)/18. Suppose -i = 2t + 5c, c + 0 = -4. Solve 0 = -td + 4k - 2, d + 25 = -2d - fk for d. -5 Suppose 4g = -220 - 76. Let m = g + 80. Suppose -3o = -9o + m. Solve 3s = r - 7, -r + o + 0 = -s for s. -3 Let s be 60/(-4)46/6. Let r = s - -115. Suppose r = -7y + 16y - 45. Solve 4k + yo = -41, -3k - 5o = 55 - 18 for k. -4 Let g(s) = -s*2 + 15s - 50. Let r be g(11). Let d be 44/(-55)(171/r + 1). Solve 0 = 5l + 4q - 8 - d, -3l + 2q = 4 for l. 2 Suppose 4j - 2t - 110 = -5t, 0 = -4j + 2t + 120. Let w be (-2 - -2 - j)/(-1). Solve w = -2y - 5i, 5y + 2i + 20 = -0y for y. -2 Suppose 0 = -4a + 6a - 560. Let v = -280 + a. Solve 2j = -2m, -3j + 4m - m - 18 = v for j. -3 Let d = 32203 - 32192. Solve -5w - d + 6 = g, -4g - 20 = -5w for g. -5 Let g = 648 - 645. Solve 14v - 17v + 1 = d, v + g = 3d for v. 0 Let q = 14 + -60. Let h = q + 46. Solve 2v + ha - a = -11, -26 = 5v - a for v. -5 Suppose -20r = -25r - 115. Let u = 29 + r. Suppose -p + u = p. Solve 0 = -3m + px + 8 + 10, m - 5x = 10 for m. 5 Let g = -511 - -160. Let s = g - -356. Solve -5 = -3k + 4i - 17, -i = -sk - 20 for k. -4 Let q(t) = -4t2 + 65t - 123. Let o be q(14). Solve 5x + 30 = x - 5v, ov + 6 = 0 for x. -5 Let r be (-2)/(-2) + (-4 - -4) + 3. Suppose -11 = -rg + 1. Let n be ((-45)/(-21))/(26/182). Solve 0 = 3u - 4i + 20, 2u = -u + gi - n for u. 0 Let k(w) = 12w + 54. Let d be k(9). Let p be (4/6)/(27/d). Solve -2c - a = 3a + p, 5c - a = -21 for c. -4 Suppose -2w - 8 = 0, 0l + 2w = -5l + 37. Suppose -3o = 3u - 24, 2o - o - 5 = 0. Suppose uk - l = -6. Solve -5 - k = -3v + c, -2v - c = -9 for v. 3 Let n(c) = 189c2 - 4c - 2. Let w be n(-1). Let y = w - 170. Solve 3v = -v + 16, -5t + y = -v for t. 5 Let p = -7472 + 7492. Solve -18t + 2z - 12 = -19t, 3t - p = -2z for t. 4 Let o = 672 + -669. Solve v - 1 = 0, -3v + o = -5d - 0 for d. 0 Suppose -5d + 2d = -9. Suppose 15 = 2s - p, 0 = 17s + 2p - 26 - 49. Solve 2 = -sb - 3, dk = b + 7 for k. 2 Let b(j) = -j*2 - j + 25. Suppose 0 = -5t + 23 + 2. Suppose tz - 15 = 8z. Let m be b(z). Solve k = -5f + 2k - m, -3f + 2k - 3 = 0 for f. -1 Suppose 0 = -3w + 56 - 59. Let y be (-3)/(-18)w + (-2)/(-12). Solve -2x + yx = 4r - 6, 0 = x + r - 4 for x. 5 Let h be 5/(-25)0 - -1 - (0 + -9). Solve j = -4r + 18, -hj - 10 = -4r - 7j for r. 4 Let d be (-19)/(-2) + 4 + 33/(-6). Let w be 2(-461)/d + 12/48. Let c = 117 + w. Solve g - 4x = 5, -2g - x - 3x = c for g. 1 Let r(w) = w + 2w - 3w - 19 - 6w + 0w. Let v be r(-4). Solve -3k = 4t - 29, -vt + 3k + 40 = 8k for t. 5 Suppose 0 = -m - 1, -15g + 12g - 4m - 4 = 0. Let r = 8 + -5. Suppose -r = -v - 0v. Solve g = 5	{ "pile_set_name": "DM Mathematics" }
Calculate -10592 divided by 5. -10592/5 55 divided by 5 11 -23 divided by 5 -23/5 Divide -42 by 2. -21 What is -48 divided by -3? 16 -4 divided by 80 -1/20 Calculate -34 divided by 14. -17/7 -182 divided by -7 26 -187 divided by 10 -187/10 Calculate 11534 divided by -146. -79 Divide 5 by 112. 5/112 9 divided by -21 -3/7 What is -2943 divided by -981? 3 Divide 9180 by 2295. 4 What is 114 divided by 3? 38 Divide -216 by 72. -3 Calculate 0 divided by 48. 0 What is -248 divided by 48? -31/6 Divide -3 by 80. -3/80 -1894 divided by -4 947/2 Calculate -74 divided by 45. -74/45 What is -1478 divided by -739? 2 Calculate -25 divided by 28. -25/28 Calculate 3 divided by -663. -1/221 What is -42 divided by 42? -1 Divide 620 by -1. -620 Calculate 53 divided by 53. 1 What is -10 divided by 150? -1/15 What is 9 divided by 15? 3/5 12 divided by 22 6/11 Divide 1283 by 1283. 1 Divide -12210 by 5. -2442 What is -4374 divided by 6? -729 Calculate 79 divided by -4. -79/4 What is 4 divided by -110? -2/55 What is 31 divided by -1? -31 -8442 divided by -126 67 Divide 243 by 243. 1 5 divided by 45 1/9 4730 divided by -43 -110 Divide 3 by 9918. 1/3306 Divide -4 by -2184. 1/546 What is 592 divided by -8? -74 Calculate 38 divided by -243. -38/243 What is 2 divided by 41? 2/41 Calculate 8 divided by -71. -8/71 -1 divided by 14 -1/14 Calculate 46856 divided by 2. 23428 4480 divided by -5 -896 Divide 14525 by -415. -35 What is 1128 divided by -94? -12 What is -33668 divided by -4? 8417 -656 divided by -4 164 Divide 0 by -2492. 0 1776 divided by 6 296 Divide -672 by 224. -3 Divide -32 by -11. 32/11 Calculate 632 divided by -158. -4 -3 divided by 131 -3/131 -4 divided by -9 4/9 Divide -5752 by -2876. 2 Calculate 4 divided by 114. 2/57 -1645 divided by 5 -329 What is -412 divided by -3? 412/3 Divide 3 by 99. 1/33 Calculate -1 divided by -6. 1/6 Calculate 2 divided by 3060. 1/1530 Calculate -63 divided by 63. -1 What is -327 divided by 84? -109/28 -3440 divided by 688 -5 Calculate 77 divided by 5. 77/5 Calculate 3 divided by 197. 3/197 Divide -142 by 4. -71/2 What is 16 divided by 3? 16/3 41040 divided by 6 6840 What is -736 divided by -46? 16 Divide 390 by -78. -5 Calculate 1 divided by -1175. -1/1175 Divide -47 by 6. -47/6 What is 102 divided by 3? 34 What is -57854 divided by -2? 28927 What is -9295 divided by -143? 65 What is 7 divided by -26? -7/26 What is -16 divided by 16? -1 Divide 8217 by 8217. 1 Calculate 2 divided by 1375. 2/1375 What is 2192 divided by -16? -137 Calculate -5 divided by 149. -5/149 Divide -588 by 98. -6 -36 divided by -9 4 What is -635 divided by 6? -635/6 -94 divided by -1 94 Divide -2840 by 4. -710 Divide -5 by -487. 5/487 13 divided by 7 13/7 Divide -576 by -2. 288 What is -417 divided by -139? 3 Calculate 3550 divided by -142. -25 Divide -4070 by 110. -37 Calculate 11440 divided by -16. -715 Divide 52 by -50. -26/25 Divide 43027 by 1. 43027 Calculate -412 divided by -4. 103 Divide 0 by 55. 0 What is -52 divided by 13? -4 Divide 3 by -54. -1/18 Calculate 840 divided by 6. 140 4 divided by 383 4/383 What is -12 divided by 5? -12/5 Divide 700 by -7. -100 Calculate 215 divided by 6. 215/6 -163 divided by -53 163/53 4 divided by 689 4/689 What is 29377 divided by -1013? -29 60 divided by 15 4 Calculate 5 divided by 349. 5/349 Calculate -875 divided by -1. 875 Calculate 2420 divided by -605. -4 -21 divided by -15 7/5 What is 0 divided by -25? 0 Divide 17 by -5. -17/5 1 divided by 90 1/90 50 divided by -2 -25 Divide 78 by 1. 78 0 divided by -454 0 -2 divided by 13 -2/13 Divide -784 by -112. 7 What is -3 divided by 201? -1/67 Divide -376 by -4. 94 Calculate 221 divided by -13. -17 What is 3652 divided by -2? -1826 98 divided by 1 98 What is -11 divided by 41? -11/41 -4 divided by -51 4/51 Calculate 24 divided by 8. 3 What is 1118 divided by -11? -1118/11 Divide -15 by -43. 15/43 What is 3 divided by -665? -3/665 -25969 divided by -1 25969 Calculate 2196 divided by 183. 12 What is -6 divided by 87? -2/29 What is 884 divided by 1? 884 Divide 30 by -6. -5 What is 1 divided by 225? 1/225 Divide 5049 by 1683. 3 Calculate 3672 divided by 3672. 1 -126 divided by 3 -42 Divide -276 by 138. -2 Calculate -36625 divided by -2. 36625/2 Calculate -588 divided by 2. -294 Divide -2 by -52. 1/26 12727 divided by 143 89 Divide 333 by 9. 37 Divide 4210 by 1. 4210 What is -1 divided by -71? 1/71 82 divided by 82 1 2664 divided by -4 -666 1 divided by -45 -1/45 -6 divided by -1113 2/371 -4 divided by 100 -1/25 13 divided by -17 -13/17 Divide 10315 by 2063. 5 Divide 71 by -71. -1 Calculate -8 divided by 139. -8/139 Calculate -63 divided by -9. 7 -39 divided by 31 -39/31 3 divided by -16 -3/16 47904 divided by 3 15968 3599 divided by -3 -3599/3 -12 divided by 296 -3/74 -3 divided by -691 3/691 What is -237 divided by -79? 3 -169 divided by 13 -13 -280 divided by 70 -4 Calculate 627 divided by -1. -627 -5313 divided by 7 -759 -120 divided by -3 40 What is 9 divided by -7? -9/7 What is 2520 divided by 6? 420 0 divided by -592 0 What is 4 divided by 143? 4/143 What is -3 divided by -55? 3/55 Divide -672 by -2. 336 -259 divided by 4 -259/4 Calculate -190 divided by 10. -19 What is -189 divided by 63? -3 Calculate 4 divided by 51. 4/51 Divide 5850 by -5850. -1 What is 145 divided by 1? 145 Calculate 4842 divided by 9. 538 Calculate 535 divided by -5. -107 What is 1320 divided by -6? -220 Divide -4 by 487. -4/487 403 divided by 403 1 Divide 4446 by -9. -494 Divide 70 by 11. 70/11 Calculate -4968 divided by -621. 8 Divide 138 by 6. 23 Divide 4 by 232. 1/58 Divide 3069 by 1023. 3 Divide 2 by -100. -1/50 Calculate -1639 divided by 1. -1639 Divide -1153 by 6. -1153/6 5 divided by -114 -5/114 Calculate 4 divided by 60. 1/15 What is 48 divided by -24? -2 Calculate -10798 divided by 5399. -2 Calculate 8 divided by 154. 4/77 Calculate -1344 divided by -672. 2 Divide 13745 by -5. -2749 Calculate 1519 divided by 1519. 1 -740 divided by -185 4 What is 1870 divided by -11? -170 Calculate -1230 divided by 3. -410 -681 divided by -5 681/5 Calculate 276 divided by 46. 6 What is 3 divided by 1094? 3/1094 What is -101 divided by 14? -101/14 -242 divided by 22 -11 Divide -80 by 2. -40 Divide 10 by -7. -10/7 57 divided by -52 -57/52 Calculate -2536 divided by -2. 1268 Divide 0 by 891. 0 1 divided by 20 1/20 What is 1160 divided by 2? 580 Calculate -482 divided by 2. -241 Calculate 37 divided by 3. 37/3 -6 divided by 10 -3/5 Divide 0 by 558. 0 What is -1490 divided by 149? -10 -402 divided by 4 -201/2 Calculate 17556 divided by -3. -5852 Calculate 50 divided by -50. -1 -498 divided by 83 -6 Divide -6519 by -1. 6519 Divide 821 by 5. 821/5 Calculate 2 divided by 5. 2/5 Divide 1044 by -36. -29 Calculate -1209 divided by -403. 3 8 divided by 2023 8/2023 573 divided by 13 573/13 Divide 440 by 2. 220 What is 357 divided by 8? 357/8 Calculate -156 divided by 52. -3 What is -426 divided by 6? -71 4 divided by 76 1/19 Calculate 39150 divided by -5. -7830 -10608 divided by 3 -3536 Calculate -6020 divided by 860. -7 What is -1638 divided by 273? -6 -349 divided by 20 -349/20 Calculate 72 divided by 9. 8 675 divided by 5 135 9 divided by -3 -3 What is -7952 divided by -4? 1988 What is 2360 divided by -5? -472 Divide 480 by 240. 2 What is -861 divided by -4? 861/4 Divide 0 by 1041. 0 Divide 210 by -3. -70 454 divided by -6 -227/3 Calculate 1 divided by 90. 1/90 Divide -9978 by -6. 1663 What is 172 divided by 48? 43/12 26 divided by -2 -13 What is 3067 divided by 4? 3067/4 Calculate -4350 divided by 6. -725 4 divided by -127 -4/127 What is 1504 divided by 752? 2 What is -2 divided by 82? -1/41 Divide -26 by -65. 2/5 Calculate 0 divided by -40. 0 Divide -109 by -5. 109/5 Calculate 6 divided by -10. -3/5 Calculate -158 divided by 54. -79/27 What is -1260 divided by 21? -60 396 divided by -132 -3 What is -422 divided by -2? 211 19 divided by -16 -19/16 -410 divided by 6 -205/3 1820 divided by -182 -10 -1387 divided by -6 1387/6 -24 divided by -69 8/23 What is -45 divided by 3? -15 What is 1524 divided by 508? 3 What is -11 divided by -44? 1/4 36 divided by 1 36 -35 divided by -2 35/2 -1268 divided by -5 1268/5 Calculate 254 divided by 12. 127/6 -12 divided by -7 12/7 Divide -17248 by -49. 352 Calculate 363 divid	{ "pile_set_name": "DM Mathematics" }
a litre? 11800 What is seven quarters of a litre in millilitres? 1750 What is 0.605843 years in months? 7.270116 What is twenty-five quarters of a litre in millilitres? 6250 How many millilitres are there in 60.48297l? 60482.97 How many months are there in 25/2 of a decade? 1500 What is 2.988132 nanoseconds in seconds? 0.000000002988132 What is 15/4 of a microgram in nanograms? 3750 How many millimeters are there in 7/2 of a centimeter? 35 Convert 363.1413 grams to milligrams. 363141.3 How many milliseconds are there in 7/6 of a minute? 70000 Convert 2052.96 years to decades. 205.296 How many minutes are there in nineteen quarters of a hour? 285 What is 3/25 of a millennium in months? 1440 How many micrometers are there in eighty-one quarters of a millimeter? 20250 How many months are there in twenty-five quarters of a century? 7500 What is 54/5 of a second in milliseconds? 10800 What is 45771.37mg in tonnes? 0.00004577137 How many centimeters are there in one tenth of a meter? 10 What is 2.8013 litres in millilitres? 2801.3 Convert 7.520597l to millilitres. 7520.597 Convert 639035.6 millimeters to meters. 639.0356 How many millilitres are there in 18/5 of a litre? 3600 Convert 730.9537 millennia to centuries. 7309.537 Convert 1656.0354us to minutes. 0.00002760059 What is 3/40 of a litre in millilitres? 75 What is 17398.78ml in litres? 17.39878 What is 39681.49 milligrams in kilograms? 0.03968149 Convert 0.773603 decades to millennia. 0.00773603 What is 27/2 of a century in decades? 135 What is 38/7 of a week in days? 38 How many millilitres are there in thirty-four fifths of a litre? 6800 How many millilitres are there in 34/5 of a litre? 6800 How many minutes are there in 630.2864 hours? 37817.184 Convert 905089.9s to milliseconds. 905089900 What is 3.375022 micrometers in centimeters? 0.0003375022 Convert 35.55069ml to litres. 0.03555069 How many milligrams are there in 18/5 of a gram? 3600 How many micrometers are there in seventeen halves of a millimeter? 8500 Convert 270690.6 microseconds to minutes. 0.00451151 What is 6/25 of a litre in millilitres? 240 How many tonnes are there in 0.1707958 micrograms? 0.0000000000001707958 What is 10454.55 months in millennia? 0.8712125 How many millilitres are there in 27/5 of a litre? 5400 Convert 9234.016ml to litres. 9.234016 What is 5/8 of a gram in milligrams? 625 How many minutes are there in 336.684ns? 0.0000000056114 Convert 0.256571 decades to centuries. 0.0256571 What is 3/40 of a milligram in micrograms? 75 What is 12.349593 months in decades? 0.102913275 What is 25/2 of a microgram in nanograms? 12500 How many minutes are there in 3/10 of a hour? 18 How many months are there in 1/15 of a century? 80 How many days are there in 1667023.8 hours? 69459.325 How many kilometers are there in 9.670688nm? 0.000000000009670688 How many millilitres are there in 31867.44 litres? 31867440 Convert 1964.045ng to tonnes. 0.000000000001964045 How many nanograms are there in 48.24039 micrograms? 48240.39 What is three fifths of a gram in milligrams? 600 What is 13/4 of a millennium in decades? 325 Convert 73394.02 minutes to seconds. 4403641.2 How many milligrams are there in one tenth of a kilogram? 100000 What is 3/5 of a micrometer in nanometers? 600 How many millilitres are there in 9/10 of a litre? 900 What is 565.45356 hours in weeks? 3.365795 How many milligrams are there in thirty-one halves of a gram? 15500 What is 32/5 of a tonne in kilograms? 6400 What is 9/16 of a centimeter in micrometers? 5625 How many centuries are there in 896737.9 millennia? 8967379 What is 79.52384 centimeters in meters? 0.7952384 How many nanometers are there in 42/5 of a micrometer? 8400 What is seven halves of a gram in milligrams? 3500 Convert 55239.16 days to milliseconds. 4772663424000 What is 19/4 of a tonne in kilograms? 4750 What is seventy-three quarters of a kilogram in grams? 18250 How many millimeters are there in 9/10 of a meter? 900 How many millilitres are there in 3/25 of a litre? 120 What is 11/8 of a litre in millilitres? 1375 What is 20.86131 millilitres in litres? 0.02086131 What is 3/50 of a litre in millilitres? 60 Convert 400930.2 nanometers to meters. 0.0004009302 What is 4/3 of a hour in seconds? 4800 What is 84330.53l in millilitres? 84330530 How many centuries are there in 10706.54 decades? 1070.654 What is 3/25 of a litre in millilitres? 120 How many years are there in 27/5 of a century? 540 How many millilitres are there in 9673.39l? 9673390 What is five eighths of a tonne in kilograms? 625 What is 204.4743 months in centuries? 0.17039525 How many millilitres are there in 94038.57l? 94038570 Convert 1.41069 millennia to years. 1410.69 What is 7044.291 milligrams in micrograms? 7044291 How many centimeters are there in 1/4 of a kilometer? 25000 What is twenty-seven quarters of a litre in millilitres? 6750 What is one quarter of a litre in millilitres? 250 How many meters are there in 239390.2nm? 0.0002393902 What is 4854.91ns in microseconds? 4.85491 Convert 68.53965 tonnes to micrograms. 68539650000000 How many millilitres are there in 22328.46 litres? 22328460 Convert 3.653146ng to tonnes. 0.000000000000003653146 Convert 7.740674 micrometers to meters. 0.000007740674 Convert 6.556357 milligrams to tonnes. 0.000000006556357 What is 306.2427 centuries in decades? 3062.427 Convert 0.8792352 kilograms to tonnes. 0.0008792352 What is 21/5 of a tonne in kilograms? 4200 What is thirty-one halves of a litre in millilitres? 15500 What is 897888.7 milliseconds in seconds? 897.8887 How many nanometers are there in 3/25 of a micrometer? 120 How many months are there in 7/4 of a century? 2100 What is eighteen fifths of a decade in months? 432 Convert 825.9405um to millimeters. 0.8259405 What is six fifths of a litre in millilitres? 1200 What is one quarter of a kilometer in meters? 250 How many millimeters are there in 6076.05 kilometers? 6076050000 What is 42/5 of a litre in millilitres? 8400 What is 111.9899 millilitres in litres? 0.1119899 Convert 51769.4688 minutes to weeks. 5.13586 What is 497.7944 micrometers in meters? 0.0004977944 What is three tenths of a millennium in decades? 30 What is 3/10 of a milligram in micrograms? 300 Convert 901218.9 litres to millilitres. 901218900 What is fourty-five quarters of a century in months? 13500 How many nanoseconds are there in 3/10 of a microsecond? 300 How many micrometers are there in 6.753199 millimeters? 6753.199 Convert 5.511971ug to milligrams. 0.005511971 Convert 22.07965 decades to centuries. 2.207965 What is 52.63312ml in litres? 0.05263312 What is 9/10 of a minute in milliseconds? 54000 What is eleven halves of a litre in millilitres? 5500 How many millilitres are there in 55/4 of a litre? 13750 How many months are there in twenty-three thirds of a year? 92 What is 12/25 of a kilometer in meters? 480 Convert 4910.313 hours to days. 204.596375 How many milliseconds are there in 92817.79 days? 8019457056000 How many minutes are there in 9/10 of a week? 9072 Convert 0.2087726km to nanometers. 208772600000 What is 3/10 of a centimeter in millimeters? 3 How many years are there in 1/5 of a century? 20 Convert 158383.1 millennia to centuries. 1583831 Convert 36540.16 centuries to months. 43848192 What is three tenths of a microgram in nanograms? 300 What is 57.31533 months in centuries? 0.047762775 What is six fifths of a centimeter in micrometers? 12000 What is 63.40739 years in decades? 6.340739 Convert 50.3767026 seconds to weeks. 0.0000832948125 How many millilitres are there in 41/2 of a litre? 20500 How many minutes are there in 11/2 of a week? 55440 How many kilometers are there in 0.5013329m? 0.0005013329 Convert 63.46485 micrograms to kilograms. 0.00000006346485 How many litres are there in 8.858323ml? 0.008858323 How many years are there in fourty-three halves of a decade? 215 How many months are there in twenty-one halves of a year? 126 What is 1/4 of a litre in millilitres? 250 How many grams are there in 7/2 of a kilogram? 3500 How many micrograms are there in 67/4 of a milligram? 16750 What is 45/4 of a millennium in years? 11250 What is 3/8 of a century in months? 450 How many nanograms are there in 0.4747546 kilograms? 4747546000	{ "pile_set_name": "DM Mathematics" }
t n = 7983 + -7983. What is the closest to n in 2/3, 0.3, j? 0.3 Let g = -4352 + 4049.1. Let v = g + 302. What is the closest to -2 in 1, v, -4/3? -4/3 Let g(h) = h*2 - 5h - 5. Let t be g(5). Let j = 14129 - 14127. What is the nearest to j in 0.06, t, 2/13? 2/13 Suppose -46 = -7o + 6o. Suppose -5x + 64 = -o. Suppose 0 = 5c + 7 - x. What is the nearest to 2 in 0.3, c, -0.1? c Let i be (-5)/5 - 3 - 0/(-2). Let k = -164 - -164.1. What is the nearest to k in 9, i, 6? i Let h(d) = d*3 - 20d*2 + 78d - 43. Let y be h(15). Which is the closest to 118? (a) -2 (b) y (c) -1/4 b Suppose -10 = 5m - 5z, 3m - 2m + 18 = 5z. Let f be (-300)/12 - m2. Let g = f - -28. Which is the nearest to g? (a) -2 (b) 2/3 (c) -5 a Let i(n) = -n - 7. Let v be i(8). Let k be (-6)/v + 28/(-45). Let p = -0.1 - -2.1. What is the closest to 5 in k, -3/4, p? p Let p be (-6)/(-45) + 871/21840. Let y = -9/80 - p. Suppose -5 = 2o - 7o. Which is the closest to o? (a) y (b) -10 (c) -1 a Let r = -3917/15 + 784/3. What is the closest to r in 0.07, -0.2, -0.3? 0.07 Let l = 338 - 338. Let g = -77 - -2. Let r = g - -72. Which is the closest to -1? (a) l (b) r (c) -0.4 c Let m = 71/3 - 24. Let n = -2.042 - -0.042. Let q = 0.6 - -0.4. What is the closest to m in q, n, -0.2? -0.2 Let u = 6383 - 6383.02. Which is the nearest to 0.1? (a) -3/8 (b) u (c) 0.1 (d) 2/65 c Let l = 181/3 + -61. Suppose 3n = -3u - 9, -u - 2u - 15 = 0. Which is the nearest to l? (a) 4/5 (b) n (c) -1 c Let u = -1087 + 1819. Let y = -730 + u. What is the nearest to y in 47, 2, 0.3? 2 Let d = 0.3 - 0.3. Let r = -0.26 + -121.74. Let n = r + 120. What is the closest to d in 26, n, 0? 0 Let u be 3((-16)/(-45))/(-8). Let p = -14167/4 - -3543. Which is the closest to 0.1? (a) p (b) u (c) 2/3 b Let t = -11 + 13. Let i(r) = 7r + 47. Let p be i(-6). Which is the nearest to 26? (a) -2/9 (b) p (c) t b Let w = -1.95 - -2.16. Let t = -6.5 + 4.29. Let k = w + t. Which is the nearest to 0.1? (a) k (b) 2 (c) -2/9 c Let m = 0 + -1. Let t = 3.99 + -4.09. Let n = -1 - -0.7. What is the nearest to t in -3, n, m? n Let a(k) = 12 - 6 + 1 + 20 + k. Let b be a(-30). What is the closest to 0.07 in 3/4, 0.4, b? 0.4 Let a be (-2)/((14/(-315)-3)/((-46)/(-230))). Let u = 2.06 - 0.06. Let r = 1.5 - u. What is the nearest to -21 in r, a, 0? a Let n = -162 - -274. Let h = n + -113. Which is the closest to h? (a) 10 (b) 0.4 (c) -0.3 c Let d = 6475 - 6471. What is the nearest to -159 in -0.2, -1, d, -5? -5 Let d = 309.9 - 310. What is the closest to d in -2/5, -0.5, 310? -2/5 Let j = -3440392/87 - -39544. Let l = j - -2/29. Which is the closest to 0.1? (a) -0.04 (b) l (c) 0.1 c Let u(b) = b*2 - 12b + 37. Suppose 0 = -4y + 79 - 115. Let h be (6 - 12/y) + 2/(-6). Let c be u(h). What is the nearest to 2 in 0.1, c, 1/3? c Let l = -24358 - -24367. Which is the nearest to 0.01? (a) l (b) 2/23 (c) 2/15 (d) 4 b Let q = 0.03 + -1.23. Let m(b) = 672b + 55107. Let p be m(-82). What is the closest to -0.1 in q, -0.3, p? -0.3 Suppose 0 = 24c - 16c. Let k(g) = 2g2 - 7g - 1. Let i be k(5). Let q be 38/i - (8 - 5). What is the nearest to q in 5, c, 1/2? c Let g be (24/288)/((-13)/104). What is the closest to g in -2, 2, 0.2, -116? 0.2 Let o = -483 - -482.729. Let h = -0.471 - o. What is the closest to -1.1 in 1/7, -1, h? -1 Let f = 1974.9 - 1975. What is the closest to 11 in -4, 8, f, -0.5? 8 Suppose 0 = -2k + 98 - 92. What is the closest to 0 in 2, k, 0.2, -0.08? -0.08 Let l = 12 + -10. Let i = 8.53 - 9.53. Which is the nearest to i? (a) -5 (b) -1/4 (c) l b Let f be ((-21)/819)/1(-5 + -1). Let k = -0.06 - -0.36. What is the closest to 1 in -2/29, f, k? k Let i = 298 + -302. Which is the closest to 136? (a) -3 (b) -0.5 (c) i b Let y = -44 + 41. Suppose -7u + 3u = 4w - 20, -19 = -5u - 3w. Which is the closest to u? (a) 0 (b) y (c) 0.11 c Suppose -4c - 45 = 5r, 0 = 3r + 2c - 0c + 25. Let y = -48.12 - -105.12. What is the closest to y in -0.1, r, 3? 3 Let t = -3 + 2.61. Let p = -0.61 + t. Which is the nearest to 0.09? (a) 0.1 (b) -0.3 (c) p a Let j = 124.12 - 181.12. Suppose 2y - 2 = -4. What is the closest to j in -4, 1, y? -4 Let t = 8471/12 - 706. Let k be -6 - (-275)/44 - (-10)/(-72). Which is the closest to 2/3? (a) 3 (b) k (c) t (d) 2/9 d Let r(k) = -k2 + 19k - 19. Let o be r(1). Let d be ((8/(-6))/o)/((-28)/(-6)). What is the nearest to 2 in 3, d, 5? 3 Let p = -186 - -185.993. Let t = -1.007 - p. Let n = 3.3 + 6.7. Which is the closest to t? (a) n (b) 4 (c) -0.1 c Let z be (4/(-70))/((-279)/(-651)). Let a = 135 + -135.5. What is the nearest to 1/4 in a, -3, z, 2/9? 2/9 Let z be ((-6)/18)/((-4)/24). Suppose -4j = -5f - 47, -zj + j = 3f + 18. Let x be f/4 - -1 - -1. What is the closest to -3 in -3, x, 1/2? -3 Let g = 66 - 81. Let o be (1/g)/((-9)/(-15)). Let d = -0.1 + -0.1. What is the nearest to -2 in 0.1, d, o? d Suppose -5l + 47 = 6x, -x - l + 27 = -4l. Let w = 0.06 + 0.94. Let f = w - -2. Which is the closest to -1/4? (a) f (b) 0.1 (c) x b Let k = -675 + 674.8. Which is the nearest to k? (a) -3 (b) 1/4 (c) 12 (d) -0.3 d Let y = 4066 + -4069. Let d = -17 + 18. Suppose 0 = -2f - 2f - 4. What is the closest to y in -1/7, d, f? f Let d = 324 - 324. Let s be ((-16)/(-20) - (d + 1))1. Let b = -1 + 5. What is the closest to -1 in s, -0.1, b? s Let h = -5.249 + 5.049. What is the nearest to h in -110, 0.4, -0.4? -0.4 Suppose 0 = t + 4 - 1. Let o = -0.109 - 66.891. Let z = 68 + o. What is the nearest to 2/11 in z, -4, t? z Let r = -0.1 - -0.14. Let o be 12 + ((-315)/(-36))/(150/(-120)). What is the closest to -6 in 3, 2/3, o, r? r Let h = -204.9 + 201.464. Let w = -0.436 - h. Which is the nearest to -0.02? (a) 2/7 (b) -1/2 (c) -1 (d) w a Let i = -0.5184 + 2.8184. What is the nearest to 1 in 2, -2, i? 2 Suppose 25t - 86 = 164. Suppose -4l + t = -10. Let c = 0 + 0.2. What is the closest to c in 0.5, l, 0.05? 0.05 Let o be 3 + (-1125)/459 + 4/(-6). Which is the nearest to -0.07? (a) -1/4 (b) o (c) -4 (d) -1/6 b Let u = 649/10 - 131/2. Which is the nearest to -1? (a) -0.2 (b) 26 (c) 5 (d) u d Let s = 0.038 - -0.462. Let h(z) = -z*2 + 19z - 89. Let b be h(9). Let n = 5 - 5. What is the closest to n in s, 4, b? s Suppose -2861y + 2802y + 177 = 0. Which is the closest to -5? (a) 1/14 (b) -5 (c) y (d) 5 b Let m = -30312 - -30312.1. Let j = -0.1 - 0.2. Let a = 0.2 + j. What is the closest to m in a, 1, -4? a Let o = -770 + 768. Let l(j) = 14 + 4j - 3j + 0j. Let q be l(-9). What is the closest to o in -0.5, 0.5, q? -0.5 Let v be -1 - (2/21 - (-221)/(-238)). Which is the nearest to 1/2? (a) 84 (b) v (c) 10/7 b Let b be 2 - 1/(-3)(2 - -1). Let l be (b - 177/(-57)) + -6. What is the closest to 4 in 1, l, -2? 1 Let m = -4264 - -4269. What is the nearest to -1 in -22, 31, m? m Suppose 918 = 4i - 10i. Let y = -766/5 - i. Let u = -5 - -5.1. Which is the closest to u? (a) y (b) -1.4 (c) -0.3 a Let w = -0.1 + -0.1. Let l be (-2)/(-14) - (-324)/(-756). Which is the nearest to w? (a) l (b) -2/3 (c) -0.1 a Let j be 264/385 - ((-14)/(-6) + (-1595)/825). Which is the nearest to 1? (a) 927 (b) -1 (c) j (d) -0.4 c Let a(u) = -u*2 - 18u + 54. Let p be a(-21). Let q be 6/(-18) + -2 + (-15)/p. What is the nearest to q in -1, 2/9, -3? -1 Let b = -3068 - -3064. What is the closest to -4 in 5, b, -7? b Suppose -37v - 48v + 106v + 21 = 0. Which is the closest to 1/2? (a) v (b) 29 (c) -6/7 c Let w be (2/(-6))/(148/24 + -6). Let r be w(-12 + 3)/3 - 4. What is the closest to -0.1 in 2/9, r, -3/7, -1? 2/9 Let f = 1.1463 - 0.1463. Let y = 57.9 - 58. Suppose -3x + 1 + 9 = -5a, -23 = 2a - 5x. What is the nearest to a in f, y, -1/6? f Let q be ((-1124)/(-6182))/((-7)/11). What is the nearest to 1 in 433, 3/5, 2, q? 3/5 Let t = -0.56 + -7.44. Let o = -0.6374 + 1.0374. What is the closest to -2/3 in o, -4, -1/3, t? -1/3 Let f = 4 - 3. Let x = -1.73 - -622.93. Let u = 621 - x. Which is the nearest to u? (a) f (b) 5 (c) 0.5 c Let l = -824 - -858.9. Let i = 33 - l. Let s = 0.9 + i. Which is the closest to s? (a) 1/4 (b) 0.4 (c) 4 a Let s = 12579 + -12579. What is the closest to 0.1 in 6, -345, 1/4, s? s Let r = -0.02911 + -0.67089. Wh	{ "pile_set_name": "DM Mathematics" }
3 List the prime factors of 157880267. 157880267 List the prime factors of 541779904. 2, 23, 41, 47, 191 List the prime factors of 6119849987. 37, 3793, 43607 What are the prime factors of 83651718? 2, 3, 19, 29, 25303 What are the prime factors of 784129214? 2, 11, 109, 326993 What are the prime factors of 32489581? 31, 1048051 What are the prime factors of 1559986395? 3, 5, 11, 9454463 List the prime factors of 1613041786. 2, 31, 47, 553549 What are the prime factors of 39628656? 2, 3, 91733 What are the prime factors of 32759112? 2, 3, 1364963 What are the prime factors of 2745837358? 2, 11, 9521, 13109 List the prime factors of 3229416869. 7, 37, 12468791 What are the prime factors of 401612661? 3, 550909 What are the prime factors of 106245166? 2, 53122583 What are the prime factors of 398800237? 11, 233, 155599 List the prime factors of 4404261257. 11, 53, 443, 17053 What are the prime factors of 2319427933? 41, 101, 560113 What are the prime factors of 39222729? 3, 7, 13, 83, 577 What are the prime factors of 1605540691? 23, 69806117 List the prime factors of 255090289. 31, 79, 104161 What are the prime factors of 7189267348? 2, 19, 137, 36341 What are the prime factors of 796410807? 3, 53, 5008873 List the prime factors of 61830816. 2, 3, 67, 9613 List the prime factors of 7005104123. 439, 15956957 What are the prime factors of 203414759? 203414759 What are the prime factors of 2170504076? 2, 13, 41740463 List the prime factors of 27269360. 2, 5, 17, 20051 List the prime factors of 346760658. 2, 3, 73, 163, 1619 List the prime factors of 590517880. 2, 5, 14762947 What are the prime factors of 42578978? 2, 13, 271, 6043 What are the prime factors of 151356112? 2, 571, 16567 What are the prime factors of 2488900219? 13, 23, 89, 93529 What are the prime factors of 26840211? 3, 8946737 What are the prime factors of 110164405? 5, 13, 1694837 What are the prime factors of 45958639? 3541, 12979 What are the prime factors of 918803187? 3, 102089243 What are the prime factors of 332186488? 2, 1753, 23687 What are the prime factors of 1798410369? 3, 7, 733, 116833 What are the prime factors of 377151854? 2, 313, 602479 What are the prime factors of 31817669? 13, 29, 37, 2281 What are the prime factors of 276344125? 5, 227, 9739 What are the prime factors of 25765361? 2713, 9497 What are the prime factors of 3428814637? 907, 3780391 List the prime factors of 2394076597. 11, 269, 73553 What are the prime factors of 66266163? 3, 7362907 List the prime factors of 6614487337. 43151, 153287 What are the prime factors of 1394905177? 1394905177 List the prime factors of 137390613. 3, 45796871 List the prime factors of 1343295444. 2, 3, 139, 805333 What are the prime factors of 118566984? 2, 3, 4940291 What are the prime factors of 6793608? 2, 3, 17, 16651 List the prime factors of 125681729. 23, 5464423 List the prime factors of 2310205301. 2310205301 What are the prime factors of 38981799? 3, 17, 254783 List the prime factors of 722178311. 23, 31399057 List the prime factors of 174154332. 2, 3, 11, 277, 433 What are the prime factors of 771996103? 47, 16425449 List the prime factors of 21607098. 2, 3, 59, 67, 911 What are the prime factors of 63653758? 2, 7, 4546697 List the prime factors of 34313989. 29, 1183241 What are the prime factors of 36521868? 2, 3, 3043489 List the prime factors of 366169945. 5, 37, 101, 19597 What are the prime factors of 130646667? 3, 37, 283, 4159 What are the prime factors of 876382621? 876382621 What are the prime factors of 499912879? 499912879 List the prime factors of 396610083. 3, 4283, 10289 List the prime factors of 46849471. 29, 1615499 List the prime factors of 337602754. 2, 19, 8884283 List the prime factors of 39710051. 39710051 What are the prime factors of 4082776077? 3, 1360925359 List the prime factors of 110434453. 199, 269, 2063 What are the prime factors of 840422499? 3, 7, 40020119 List the prime factors of 76979796. 2, 3, 41, 47, 3329 What are the prime factors of 159945100? 2, 5, 7, 41, 5573 List the prime factors of 14831716. 2, 677, 5477 What are the prime factors of 65474744? 2, 23, 355841 What are the prime factors of 574506693? 3, 63834077 List the prime factors of 137216026. 2, 1697, 40429 List the prime factors of 635767078. 2, 37, 151, 56897 List the prime factors of 76319782. 2, 7, 11, 45053 List the prime factors of 448078545. 3, 5, 41, 211, 1151 What are the prime factors of 240430829? 61, 73, 53993 List the prime factors of 1175743905. 3, 5, 7, 11197561 What are the prime factors of 12316468? 2, 257, 11981 List the prime factors of 79111427. 41, 1277, 1511 What are the prime factors of 698094506? 2, 349047253 What are the prime factors of 728644710? 2, 3, 5, 3539, 6863 What are the prime factors of 1129331674? 2, 31, 61, 298607 What are the prime factors of 71531464? 2, 1951, 4583 What are the prime factors of 400647305? 5, 101, 311, 2551 What are the prime factors of 9043913? 89, 307, 331 List the prime factors of 254007905. 5, 139, 365479 What are the prime factors of 280543595? 5, 1451, 38669 What are the prime factors of 736338092? 2, 7, 3756827 List the prime factors of 256219972. 2, 43, 71, 20981 What are the prime factors of 44516236? 2, 419, 26561 List the prime factors of 45080566. 2, 17, 41, 73, 443 What are the prime factors of 5884274321? 5884274321 What are the prime factors of 44459078? 2, 22229539 What are the prime factors of 95405133? 3, 31801711 List the prime factors of 36490171. 36490171 List the prime factors of 695351700. 2, 3, 5, 31, 24923 What are the prime factors of 608837245? 5, 121767449 List the prime factors of 27231120. 2, 3, 5, 7, 1801 What are the prime factors of 4256876521? 61, 73, 955957 List the prime factors of 180588060. 2, 3, 5, 61, 16447 What are the prime factors of 988972305? 3, 5, 101, 652787 What are the prime factors of 77240975? 5, 7, 47, 9391 What are the prime factors of 61852568? 2, 7731571 List the prime factors of 2264588612. 2, 11, 13, 383, 10337 List the prime factors of 56683852. 2, 37, 382999 What are the prime factors of 1707020265? 3, 5, 4787, 23773 List the prime factors of 143082867. 3, 163, 227, 1289 What are the prime factors of 2277467604? 2, 3, 19, 369959 What are the prime factors of 2016639501? 3, 17, 1471, 26881 What are the prime factors of 222914103? 3, 439, 169259 List the prime factors of 166799477. 13, 12830729 List the prime factors of 229504773. 3, 73, 619, 1693 What are the prime factors of 20044067? 20044067 What are the prime factors of 4023220644? 2, 3, 2969, 12547 List the prime factors of 2765177423. 2765177423 What are the prime factors of 3425136489? 3, 17, 71, 227, 463 What are the prime factors of 3727551078? 2, 3, 5531, 37441 List the prime factors of 880284390. 2, 3, 5, 37, 43, 18443 List the prime factors of 230669855. 5, 13, 17, 199, 1049 List the prime factors of 1119679859. 23, 3163, 15391 What are the prime factors of 91469606? 2, 41, 67, 16649 List the prime factors of 244949102. 2, 19, 37, 83, 2099 List the prime factors of 922281797. 922281797 What are the prime factors of 25457346? 2, 3, 1414297 What are the prime factors of 709020613? 7, 433, 233923 What are the prime factors of 165339196? 2, 11, 3757709 What are the prime factors of 170652405? 3, 5, 7, 11, 71, 2081 What are the prime factors of 645659661? 3, 31, 6942577 What are the prime factors of 6942941362? 2, 7, 495924383 List the prime factors of 1417344088. 2, 23, 41, 187877 What are the prime factors of 39678852? 2, 3, 43, 131, 587 List the prime factors of 390031529. 390031529 What are the prime factors of 545223471? 3, 13, 2713, 5153 What are the prime factors of 528629674? 2, 419, 630823 What are the prime factors of 330879811? 1187, 278753 List the prime factors of 1435387140. 2, 3, 5, 11, 821, 883 List the prime factors of 78431702. 2, 23, 601, 2837 What are the prime factors of 28106849? 109, 257861 List the prime factors of 5024896382. 2, 11, 257, 653, 1361 List the prime factors of 826841452. 2, 206710363 List the prime factors of 711304265. 5, 7, 20322979 What are the prime factors of 1240926507? 3, 45960241 What are the prime factors of 28351322? 2, 491, 28871 What are the prime factors of 134838864? 2, 3, 29, 47, 229 Wha	{ "pile_set_name": "DM Mathematics" }
7484, -7486? -7488 What is the next term in -1197, -1200, -1201, -1200, -1197? -1192 What is the next term in -40, -60, -106, -190, -324, -520, -790? -1146 What is the next term in -477, -966, -1465, -1980, -2517? -3082 What comes next: -16, -36, -88, -190, -360, -616, -976? -1458 What comes next: -211, -455, -853, -1399, -2087, -2911? -3865 What is next in 93, 255, 417, 579, 741? 903 What comes next: 14, -10, -52, -118, -214, -346? -520 What is next in 2, 4, 2, -4? -14 What comes next: -513, -984, -1453, -1920? -2385 What comes next: -476, -462, -444, -422, -396, -366, -332? -294 What is next in 402, 802, 1200, 1596? 1990 What is the next term in -19, -53, -123, -247, -443, -729, -1123? -1643 What is next in 9, 36, 111, 258, 501, 864, 1371, 2046? 2913 What is next in -250, -247, -242, -235, -226? -215 What comes next: -25, -94, -217, -400, -649, -970, -1369? -1852 What comes next: 1084, 2167, 3250, 4333, 5416? 6499 What comes next: -246, -309, -372, -435, -498? -561 What comes next: -219, -256, -299, -342, -379, -404, -411? -394 What is the next term in 63, 97, 153, 231? 331 What is the next term in -897, -904, -913, -924, -937, -952? -969 What is the next term in -111, -82, -45, -6, 29, 54, 63, 50? 9 What is the next term in 78, 112, 168, 246? 346 What comes next: -113, -113, -121, -143, -185, -253? -353 What is the next term in -354, -1436, -3246, -5790, -9074? -13104 What is next in -142, -284, -426, -568, -710, -852? -994 What is next in -139, -175, -211, -247, -283, -319? -355 What is the next term in -22, -34, -46, -58, -70? -82 What is next in -2, 5, 8, 7, 2, -7? -20 What comes next: 193, 736, 1631, 2872, 4453? 6368 What comes next: 78, 298, 658, 1152, 1774? 2518 What comes next: -8, -15, -22, -29, -36, -43? -50 What is next in -12, 13, 52, 111, 196, 313? 468 What is the next term in -12, -75, -234, -537, -1032, -1767? -2790 What is the next term in 2201, 2208, 2215, 2222? 2229 What is the next term in -6, 7, 20, 33, 46, 59? 72 What comes next: 171, 169, 167, 165, 163, 161? 159 What is the next term in -3254, -3250, -3250, -3260, -3286, -3334? -3410 What is next in -75, -105, -135, -165, -195, -225? -255 What is next in 437, 462, 501, 560, 645, 762? 917 What is next in -117, -116, -113, -108, -101, -92? -81 What is next in -483, -461, -427, -375, -299, -193, -51, 133? 365 What comes next: 360, 358, 356, 354, 352? 350 What comes next: -129, -148, -203, -312, -493? -764 What comes next: 1288, 1313, 1338? 1363 What is the next term in 3, -4, -23, -60, -121, -212, -339, -508? -725 What is the next term in 432, 862, 1292, 1722, 2152, 2582? 3012 What is next in -1013, -4019, -9021, -16013, -24989, -35943, -48869? -63761 What is the next term in 11855, 11856, 11857, 11858, 11859, 11860? 11861 What is next in 3679, 7367, 11053, 14737, 18419, 22099? 25777 What comes next: 130, 521, 1174, 2089, 3266, 4705, 6406? 8369 What is next in 0, -19, -50, -93, -148, -215, -294? -385 What is the next term in 64, 69, 76, 85, 96, 109, 124? 141 What is the next term in -2707, -2701, -2705, -2725, -2767, -2837? -2941 What comes next: -17, -31, -45? -59 What is next in -530, -531, -532, -533, -534, -535? -536 What is next in -70, -70, -72, -76, -82, -90, -100? -112 What is next in -15, -18, -13, 6, 45, 110, 207? 342 What comes next: -11, -13, -7, 13, 53? 119 What is next in -22, -27, -32? -37 What is the next term in 2959, 2955, 2963, 2989, 3039? 3119 What comes next: -813, -812, -811, -810, -809, -808? -807 What is next in -152, -145, -124, -83, -16, 83, 220? 401 What is next in -17, -28, -35, -38, -37? -32 What is next in 14528, 14525, 14520, 14513, 14504, 14493, 14480? 14465 What is the next term in 11, 17, 13, -7, -49? -119 What comes next: -35, -244, -789, -1832, -3535? -6060 What is the next term in -222, -232, -232, -216, -178? -112 What is the next term in 20, 70, 160, 296, 484? 730 What is next in -39, -52, -75, -108, -151? -204 What is the next term in 961, 1929, 2897, 3865, 4833, 5801? 6769 What is the next term in 877, 858, 839, 820, 801? 782 What is next in 49, 89, 119, 133, 125, 89, 19, -91? -247 What comes next: -591, -590, -589, -588, -587? -586 What is the next term in 390, 392, 394, 396, 398? 400 What comes next: 1718, 1721, 1726, 1733, 1742, 1753? 1766 What is next in -8, -76, -264, -632, -1240? -2148 What is the next term in -263, -260, -257, -254, -251? -248 What comes next: -21, -4, 27, 78, 155? 264 What is next in -13874, -27750, -41626, -55502? -69378 What is the next term in -429, -431, -433? -435 What comes next: 39, 100, 161? 222 What is next in -25, -55, -89, -127? -169 What comes next: 5, 8, 11, 14? 17 What is next in 32, 12, -6, -22, -36, -48? -58 What comes next: -28, -79, -166, -307, -520, -823, -1234? -1771 What is the next term in -26, -52, -80, -110? -142 What is next in 2346, 4687, 7028? 9369 What comes next: -23, -53, -103, -173? -263 What is next in 2173, 2172, 2171, 2170? 2169 What comes next: 30, 62, 96, 132, 170, 210, 252? 296 What is the next term in -25, -27, -29, -31, -33? -35 What is the next term in -502, -1004, -1506? -2008 What is the next term in -680, -679, -678, -677, -676, -675? -674 What is the next term in 14, 63, 136, 227, 330, 439, 548, 651? 742 What comes next: 531, 518, 481, 408, 287, 106, -147? -484 What comes next: -4305, -4306, -4307? -4308 What is the next term in 1265, 1258, 1241, 1208, 1153, 1070, 953? 796 What comes next: -15, 105, 305, 585, 945, 1385, 1905? 2505 What comes next: 235, 229, 223, 217, 211? 205 What is next in -20, -15, -6, 7? 24 What comes next: -410, -422, -442, -470? -506 What is next in -77, -159, -241, -323, -405, -487? -569 What is next in -19, -41, -91, -181, -323, -529, -811, -1181? -1651 What is the next term in 12136, 24272, 36408, 48544, 60680? 72816 What comes next: -5, -46, -149, -344, -661, -1130, -1781? -2644 What is the next term in 68, 270, 606, 1076, 1680? 2418 What comes next: 575, 569, 561, 551, 539, 525, 509? 491 What comes next: -686, -1372, -2058, -2744, -3430, -4116? -4802 What is the next term in 98, 133, 178, 227, 274, 313? 338 What is the next term in 171, 163, 143, 105, 43, -49, -177? -347 What is the next term in -150, -316, -518, -774, -1102, -1520, -2046? -2698 What is the next term in 72, 136, 200, 264? 328 What comes next: 177, 172, 163, 150? 133 What is next in -4196, -8387, -12576, -16763? -20948 What comes next: -51, -29, -7, 15, 37? 59 What is the next term in 207, 206, 205, 204, 203, 202? 201 What is the next term in 66, 133, 206, 291, 394? 521 What is next in -20, -25, -34, -47, -64, -85, -110? -139 What comes next: -46, -112, -252, -502, -898? -1476 What is the next term in 329, 331, 333, 335? 337 What comes next: -56, -24, 8, 40, 72, 104? 136 What comes next: -110, -224, -350, -494, -662? -860 What is next in -784, -767, -738, -697, -644, -579, -502? -413 What is the next term in 566, 581, 614, 671, 758, 881, 1046, 1259? 1526 What comes next: -369, -735, -1101, -1467? -1833 What comes next: -34, -24, -4, 32, 90, 176? 296 What is next in 712, 716, 720, 724, 728? 732 What is the next term in -30, -74, -116, -156, -194? -230 What comes next: 52, 56, 70, 100, 152, 232? 346 What is next in 39047, 39046, 39045, 39044? 39043 What is the next term in -302, -304, -306, -308, -310, -312? -314 What is the next term in 22, 34, 58, 100, 166, 262? 394 What is next in 18, 8, 0, 0, 14, 48, 108, 200? 330 What comes next: -48, -52, -66, -96, -148, -228? -342 What is the next term in -12, -29, -52, -81, -116? -157 What is the next term in -3395, -13574, -30533, -54266, -84767, -122030, -166049? -216818 What is next in -5, -13, -25, -41? -61 What is the next term in -81, -164, -245, -324, -401? -476 What is next in 359, 360, 361? 362 What is next in -28, -54, -78, -100, -120, -138? -154 What is the next term in 284, 270, 230, 152, 24? -166 What is the next term in -15, -31, -75, -159, -295, -495, -771, -1135? -1599 What comes next: 613, 1226, 1839, 2452, 3065, 3678? 4291 What is the next term in -11, 11, 49, 103, 173? 259 What is next in 611, 1220, 1829? 2438 What comes next: -160, -178, -222, -304, -436? -630 What comes next: 86, 143, 202, 263, 326, 391, 458? 527 What comes next: 411, 418, 429, 444, 463, 486, 513? 544 What is the next term in -333, -330, -3	{ "pile_set_name": "DM Mathematics" }
hich is the closest to 0.2? (a) 3/2 (b) 2/15 (c) r b Suppose 7k - 3k + s = 14, 5k - 26 = 3s. What is the closest to 2/9 in k, -2, -0.1? -0.1 Let p = -3.8 - -4.3. What is the closest to -1 in 1/4, p, -4? 1/4 Let d = -1.6 + -19.4. Let k = -20.9 - d. What is the nearest to 1 in -4, k, 1/3? 1/3 Let s be 5/15 + 6/9. Let f = 0.59 - -0.41. What is the closest to s in 0, -2/15, f? f Let l be 2 + ((-12)/3 - -2). Suppose lo + 4u = -5o - 20, -25 = o + 5u. Which is the nearest to 2/7? (a) -0.2 (b) o (c) 0.1 c Let z = -3 - -2.5. Which is the nearest to 1? (a) z (b) 0.5 (c) 3 b Let g = -6.98 + 1.98. What is the closest to -1/4 in -4, g, -0.3? -0.3 Let v be 3(-7)/421/4. What is the closest to -1/4 in v, 3, 2? v Let v = -31/4 + 7. Let t(f) = f*3 - 3f*2 + 2f - 3. Let m be t(3). Which is the nearest to m? (a) v (b) -4 (c) -5 a Let g = -1 + 4. Suppose -5w + 4d - 3 = 0, -w + 4d - 4 = gw. Which is the closest to w? (a) 0.4 (b) 4 (c) 5 a Let l = 27 + -31. Which is the nearest to 1/3? (a) l (b) 2/19 (c) 0 b Let g = 3 + 1. Let t = -54 - -50. What is the closest to -0.1 in t, 2/7, g? 2/7 Let k = -5.93 + 6. Let z = k + 0.43. What is the nearest to 0.2 in -4, -1/4, z? z Let m = -1.02 + 0.02. Let n = -1.4 - -0.5. Let j = n + 0.5. Which is the nearest to m? (a) 0 (b) -5 (c) j c Let i = 11.1 + -7. Let s = 4 - i. What is the nearest to -1 in -4, s, -0.5? -0.5 Let a = -15.07 - -15. Let h = 0.01 + a. Let j = h + -1.94. What is the nearest to 0 in 4/5, j, 1/2? 1/2 Suppose -o - 5 = 6a - a, 2o = -2a - 2. What is the closest to o in -0.5, -0.1, 3? -0.1 Let i = -3 - -2. Let h be (i/3)/(5/3). Which is the closest to -0.1? (a) -5 (b) h (c) -1 b Let c = -0.55 + 0.5. Let s = -0.02 - c. Let m = -0.37 - s. What is the nearest to -1/2 in 0.3, 1/9, m? m Let d = 0.5 + -0.3. What is the closest to -2 in -2, 2, d? -2 Let u = -0.1 + 0.1. Let o = 0.02 + -0.02. Let w = u - o. Which is the nearest to -2? (a) -0.4 (b) w (c) -0.5 c Suppose 0 = 5o + 32 - 57. Let b = 0.2 - -0.8. What is the closest to -1 in o, 0, b? 0 Let l be (-1)/(-2) - (-7)/(-2). Which is the nearest to 1/4? (a) -4 (b) l (c) 0 c Let n = -166 + 163. What is the closest to n in 6/5, 7, 1? 1 Let q = -42 + 211/5. Which is the nearest to 0? (a) q (b) 0.1 (c) 4 b Let u = -10 + 14.7. Let r = u + -5. Let v = r + 0.4. Which is the closest to v? (a) 2/7 (b) 2 (c) 0.2 c Let g = -6 - -8. Let p = g - 2. Let x = 0.039 + -0.439. Which is the nearest to p? (a) x (b) -0.1 (c) 4 b Suppose 6o - 11o - 80 = 0. Let x be (-4)/o - 18/40. Let m = -0.2 - -0.1. What is the nearest to m in x, -4/3, 2/3? x Let f = 1.64 - -0.36. What is the closest to -1 in -5, -0.1, f? -0.1 Let r = -16339 + 82062/5. Let w = r - 74. What is the nearest to 0 in -1, -4, w? w Let l = 0.1 + 0.4. Let d(h) = -3h + 1. Let p be d(2). Let q = 2.4 + -1.4. What is the nearest to 0.1 in l, q, p? l Let z be -1 + -4 + (-8)/(-4). Which is the nearest to 1? (a) z (b) 2/35 (c) -0.3 b Let u = 2 + -1.8. Let g = -5.1 - -5. What is the closest to g in -2/15, 0.5, u? -2/15 Let s = 1 + 3. Which is the closest to 0? (a) 2/3 (b) s (c) -2 a Suppose 33k - 38k = 20. Which is the closest to 2/7? (a) -1 (b) 0.1 (c) k b Let t be (4/10 + 0)(-50)/80. Which is the nearest to -1/2? (a) -5 (b) t (c) -0.5 c Suppose -3s - 9 + 4 = -4g, -4s - 15 = 3g. What is the nearest to s in 4, 0, -2/3? -2/3 Let o(w) = -w - 3. Let y be o(7). Let c be (-12)/y(-20)/6. Let r be 48/27 - (1 + 1). What is the closest to -0.3 in c, -3, r? r Let r be 19/(-5) + 1/(-5). Let w be (-3)/(-4)r/(-14). Let d = 2/7 + w. What is the nearest to 0 in 2/9, -0.2, d? -0.2 Let q = 1.6 - 0.6. Let j = q - 2. Which is the closest to -1? (a) 1 (b) j (c) -4 b Let m = -7.4 + 5.4. Which is the nearest to 3/4? (a) 3 (b) m (c) -3/4 c Let w = -37 - -36.9. Which is the nearest to 0.1? (a) -0.09 (b) -2 (c) w a Let a = 0 + -4. Let l = 1.3 + -9.3. Let u = 7 + l. What is the closest to -1 in a, -5, u? u Let h = -1.8 - 0.2. Let f = -16 - -14. Which is the closest to h? (a) -1 (b) 2 (c) f c Let r = -0.55 + 0.25. What is the nearest to r in 0.4, -0.3, 3? -0.3 Let b = 7.5 + -7.4. What is the closest to 1 in -5, 2/5, b? 2/5 Let b = -4 + 3. What is the nearest to -0.2 in -3, 0.4, b? 0.4 Suppose -3m - 1 = 2. Which is the closest to -1? (a) m (b) -1/4 (c) -2 a Let t = 215 + -215. Suppose 0 = 4s + 2n - 22, n - 17 = -2s - 2s. Let i = 3243/11 - 295. Which is the nearest to t? (a) s (b) i (c) -4 b Let a = -3 - -2.6. Let l = 6 + -5.97. Let j = l - 0.33. What is the closest to -1 in j, -1, a? -1 Let p = 2.5 - 0.5. Let k = p - 5. Let w = 17.1 + -17. What is the nearest to -1 in -2/9, k, w? -2/9 Let w = 4 - 9. Let x = 10.97 + -11. Let g = -0.07 + x. What is the nearest to g in -1/5, -1/3, w? -1/5 Let z = -0.105 - -0.005. What is the nearest to z in -0.4, -4, -2? -0.4 Let k = -2 - -2.1. Let l be (-10)/(-6)(-18)/(-135). Which is the closest to 1/3? (a) l (b) k (c) -4 a Let k be 1/(-4)(-16)/(-10). Let i be 0 + 2 + (-1)/3. Let v = 0.09 + 0.01. What is the nearest to v in k, i, 1/4? 1/4 Let x = 1.1 + -1. Let a = -0.8 + 5.9. Let k = a - 5. What is the nearest to k in x, 2/7, -3/2? x Let r = 5 + -2. Let v be ((-2)/3)/(r/9). What is the nearest to 0 in v, 2/5, -4/3? 2/5 Suppose -z + 8 = -5z. Let i be 3/z(-6)/36. What is the nearest to i in -2/7, 1, 4? -2/7 Let o = -1 + 3. Let d be o(-1)/(5 + -2). Let r be (-16)/(-44)(-2)/4. Which is the closest to d? (a) 1/5 (b) r (c) -6/11 c Let w = -21 - -20.8. What is the nearest to 0 in -2/7, w, -3/4? w Let d = 1.948 + 0.052. Which is the nearest to d? (a) 3/5 (b) 5 (c) 3 c Let q be 1/(-6) - ((-64)/12 + 5). Let y = -7 + 12. Let k = 2 - y. What is the closest to 0 in 0.3, k, q? q Let l = 312/5 - 62. What is the closest to 2/7 in l, 1, 4? l Let g = 0.11 - 0.01. Let v be 1/91 + 12/(-78). What is the closest to 7 in 0.2, g, v? 0.2 Let t = 18 + -16. Let h = -0.01 - -1.01. Which is the nearest to 1/2? (a) t (b) h (c) 1/7 c Suppose 2k - k = 4n - 1, 3 = -3n - 3k. What is the closest to 0.1 in n, -1/9, -7? n Let c = 1 - 1. Let r be (-1)/2 - (4 + 34/(-8)). What is the closest to 0 in r, c, -0.3? c Let o = -4 + 3. Suppose -7 = -4j + 5. Suppose jh - 3 = 3. What is the nearest to o in h, -0.1, -1/4? -1/4 Let z = -15 - -13. What is the closest to 0 in -3, z, 5? z Let v = -3.8 - -0.8. Which is the closest to 1? (a) 4/9 (b) v (c) -0.3 a Suppose -2g + 3 = -m - 4m, g - 1 = 3m. Which is the nearest to m? (a) -5/4 (b) -4/7 (c) 3/5 c Suppose -o + 6 = -3o. What is the nearest to 1/6 in 0.1, o, 1/5? 1/5 Let h = -1.4 - -0.4. Let w = -6 - -4. Let l = 0 - -0.2. Which is the nearest to w? (a) h (b) l (c) 4 a Let v = -33.3 + 33. Which is the closest to -9? (a) 4 (b) v (c) -2/3 c Let f be (((-45)/4)/(-3))/(-3). Let h be 2 + -1 + 2 + -2. Let j be (-5)/(-3)h - 1. What is the closest to -0.1 in f, j, 2? j Let k = 2 - 3. Let b = 2 - 1.8. Let t = -2.1 + 2.3. What is the closest to b in k, 5, t? t Let x = -1.6 + 1.3. Which is the nearest to -1/4? (a) -4 (b) -2 (c) x c Let x = 55 - 221/4. Let s = 3 + -2.9. Which is the nearest to 2/7? (a) x (b) -5 (c) s c Let x be 78/27-1 + 16/4. What is the nearest to x in 3, 5/4, 4? 5/4 Let s = 8 + -9. What is the nearest to 0 in s, -5, -0.4? -0.4 Let a = -0.2 - 0.3. Suppose -5i = -y - 27, 2y - 2i + 24 = 2i. What is the closest to 0 in -1/3, y, a? -1/3 Let o be -2 + (-4)/(-5)2. Which is the nearest to 0? (a) 1 (b) o (c) 0.3 c Let i be (0 - 0)/(6/6). Let d = i + -2. Let u = 8 + -11. What is the closest to 2 in d, 1, u? 1 Let t = -4847/19 - -255. Suppose -6 + 2 = -4w. Which is the nearest to w? (a) -5 (b) t (c) 4 b Let d = 14.9 + -14. Let t = -3.1 - d. Let i = 9 - 4. Which is the closest to -1? (a) i (b) t (c) 4/3 c Let h = -184 + 195.1. Let j = 11 - h. Let r be 1 - (1 + 6/(-2)). What is the closest to j in -1, r, -0.2? -0.2 Let v = -1.61 - -8.31. Let m = -7 + v. Which is the closest to -1? (a) -2/3 (b) 0 (c) m a Suppose -3 = -5h - n, h - 4n + 8 = -4. Let v = -3 + h. Let u be (-1)/v + 32/(-60). What is the nearest to -0.2 in 1, u, 4? u Let p(k) = -k3 - 5k2 + 1. Let c be p(-5). Let o(u) = -u3 + u*2 - 1. Suppose 0d = -d. Let n be o(d). What is the closest to c in -2/7,	{ "pile_set_name": "DM Mathematics" }
/2164322. 10821610 Calculate the common denominator of 29/1353216 and -101/133912. 25711104 What is the smallest common multiple of 848 and 266260? 56447120 Find the common denominator of -71/83227682 and -19/13222. 915504502 What is the common denominator of -67/39582 and 79/94854? 625751838 Find the common denominator of 115/65052 and -62/43875. 24394500 Calculate the common denominator of -97/72 and -63/364960. 3284640 What is the least common multiple of 11008 and 1190880? 409662720 What is the common denominator of 29/66 and 95/939348? 10332828 Find the common denominator of -53/880 and 125/19614408. 196144080 Find the common denominator of 69/97364 and -34/4747. 4576108 What is the least common multiple of 14196 and 2430896? 51048816 What is the smallest common multiple of 8053002 and 1921141? 587869146 Calculate the least common multiple of 1482 and 7162389. 272170782 What is the common denominator of -17/78 and 93/35457760? 106373280 Calculate the common denominator of 179/60 and -109/9973344. 49866720 Calculate the least common multiple of 4125600 and 6. 4125600 What is the least common multiple of 17948809 and 5? 89744045 Find the common denominator of 29/1224993 and 125/44099748. 44099748 What is the least common multiple of 413974 and 14? 2897818 What is the lowest common multiple of 20010572 and 912? 240126864 Calculate the common denominator of 3/751160 and 167/120. 2253480 What is the least common multiple of 8280 and 657800? 5920200 Find the common denominator of 10/21254919 and 67/3036417. 21254919 Calculate the lowest common multiple of 153000 and 1254600. 6273000 Calculate the least common multiple of 9049720 and 18. 81447480 What is the common denominator of 51/161 and -81/52057510? 364402570 What is the common denominator of 52/257789 and -87/73654? 515578 Find the common denominator of -149/35066640 and -103/5510472. 385733040 Calculate the common denominator of -29/276 and 11/9028696. 27086088 What is the lowest common multiple of 2302780 and 340? 39147260 Calculate the lowest common multiple of 29209432 and 84204. 262884888 What is the least common multiple of 5187 and 95966682? 1247566866 Calculate the smallest common multiple of 18230520 and 3480. 528685080 What is the smallest common multiple of 242 and 5110688? 56217568 Calculate the least common multiple of 22011 and 11121. 7417707 Calculate the smallest common multiple of 14933250 and 139377. 104532750 What is the smallest common multiple of 2662506 and 36771? 274238118 What is the smallest common multiple of 32540 and 200121? 4002420 Calculate the least common multiple of 73118 and 6215030. 6215030 Calculate the common denominator of -25/52550069 and 143/246. 315300414 Find the common denominator of -115/1008 and 115/8044246. 579185712 What is the common denominator of -139/38412 and -1/9927368? 89346312 Find the common denominator of -59/19386 and -35/308381. 16652574 Calculate the common denominator of 169/1176 and -73/943988. 277532472 Find the common denominator of 4/23903 and 17/1883. 45009349 What is the common denominator of 63/970 and -25/12114? 5875290 Find the common denominator of 113/239340 and 20/3801. 303243780 Find the common denominator of -69/67489760 and 41/356460. 202469280 What is the lowest common multiple of 64 and 7767200? 15534400 Calculate the common denominator of 43/7432060 and -34/45. 66888540 What is the common denominator of 59/68 and -57/11923208? 202694536 What is the smallest common multiple of 187200 and 1920? 374400 What is the least common multiple of 86986 and 168360? 5219160 Find the common denominator of 51/2266070 and -47/1812856. 9064280 Calculate the smallest common multiple of 31419 and 44395047. 44395047 What is the common denominator of 67/992844 and 187/2006610? 1047450420 Find the common denominator of 14/292857 and 73/25190073. 1687734891 Calculate the common denominator of 27/952 and 83/55252. 13149976 Find the common denominator of -151/777708 and 85/4061364. 36552276 What is the lowest common multiple of 3823254 and 138798? 42055794 Find the common denominator of 101/4572 and -139/23598. 5993892 Calculate the smallest common multiple of 87475168 and 96. 262425504 Find the common denominator of 73/3098 and -139/375678. 581925222 Calculate the least common multiple of 54344246 and 2. 54344246 What is the common denominator of 35/6179058 and -25/12954? 6179058 What is the common denominator of 75/4663418 and -43/91216? 37307344 Calculate the least common multiple of 4283004 and 29820. 149905140 Find the common denominator of -23/3058416 and 101/60864. 12233664 Calculate the smallest common multiple of 53100 and 204966. 10248300 What is the common denominator of 15/100031 and 44/10451? 700217 What is the common denominator of 31/118459712 and 65/33845632? 236919424 Calculate the smallest common multiple of 28 and 75067200. 525470400 Calculate the least common multiple of 1505025 and 990. 33110550 What is the least common multiple of 5487 and 318153? 18771027 Calculate the lowest common multiple of 368 and 265834. 2126672 Find the common denominator of 149/1840734 and -31/70. 9203670 Calculate the common denominator of -48/1886551 and 34/1477. 13205857 Find the common denominator of -75/17055926 and 14/3095. 85279630 Calculate the common denominator of 73/313572 and 71/32490. 1697992380 What is the common denominator of 79/1054 and 119/2127490? 1121187230 Find the common denominator of -3/166 and -13/2240646. 185973618 What is the lowest common multiple of 12 and 5382266? 32293596 What is the common denominator of -32/3553 and -49/17996591? 197962501 Calculate the lowest common multiple of 1191684 and 14101594. 84609564 What is the lowest common multiple of 36767318 and 190? 183836590 Calculate the smallest common multiple of 987450 and 1044. 5924700 Calculate the least common multiple of 236882680 and 8. 236882680 What is the common denominator of 101/93114580 and -31/14? 651802060 Find the common denominator of 11/832 and 121/19011096. 152088768 Find the common denominator of -37/17437134 and 55/1097442. 156934206 Calculate the common denominator of 71/199515 and -179/54990. 15562170 What is the common denominator of 73/5331 and 8/29451? 52334427 Calculate the common denominator of -49/14288 and -115/5761448. 218935024 Calculate the least common multiple of 198 and 779094. 8570034 Calculate the common denominator of -1/10602 and 137/205542. 6371802 Find the common denominator of 64/1347 and -5/2502726. 2502726 What is the smallest common multiple of 1356 and 8019? 3624588 What is the lowest common multiple of 4312 and 33247676? 66495352 Calculate the lowest common multiple of 3708 and 990963. 3963852 What is the least common multiple of 329670 and 56703240? 56703240 Find the common denominator of -47/15081648 and 37/5. 75408240 What is the least common multiple of 2266 and 1264428? 1264428 Calculate the common denominator of 17/214 and -11/4626225. 990012150 Find the common denominator of 85/18186 and 44/185157. 160345962 Calculate the common denominator of -37/47980373 and -49/5. 239901865 Find the common denominator of 61/27188 and 91/599880. 4077384360 What is the common denominator of 77/200 and -57/8946700? 17893400 What is the common denominator of 101/317044 and -19/227136? 15218112 Calculate the lowest common multiple of 381617511 and 69385002. 763235022 Calculate the smallest common multiple of 21680022 and 17034303. 238480242 What is the smallest common multiple of 25872538 and 1333? 1112519134 What is the lowest common multiple of 86443 and 2407790? 561015070 Find the common denominator of 49/108 and -97/8713278. 17426556 What is the smallest common multiple of 221949 and 11956791? 466314849 Calculate the common denominator of 53/1032488 and -13/224. 28909664 Find the common denominator of 41/759787 and -13/2. 1519574 Calculate the lowest common multiple of 481048 and 4. 481048 Calculate the lowest common multiple of 10633194 and 208494. 10633194 Calculate the least common multiple of 30918 and 53282020. 159846060 What is the smallest common multiple of 9890265 and 4615457? 69231855 What is the smallest common multiple of 4522385 and 350? 45223850 What is the common denominator of -103/343200 and 109	{ "pile_set_name": "DM Mathematics" }
t + 3. Let f(u) = -3. Calculate -3f(m) - 2v(m). -2m + 3 Let n(h) = -h + 1. Let v(m) = 2m + 3. Calculate -6n(b) - 2v(b). 2b - 12 Let z(i) = 2i*3 + 2i*2 + 5i - 3. Let j(a) = -2a3 - a2 - 6a + 2. Determine -3j(y) - 2z(y). 2y3 - y2 + 8y Let i(k) = 0k3 + k2 - 14 + k3 + 13 - 4k + 3k. Let d(z) = -3z*3 - 2z*2 + 4z + 4. Let t = 1 + 0. Give td(l) + 4i(l). l*3 + 2l*2 Let g(b) = -2b + b + b + b - 1. Let n(f) = 1 - 8f - 3 + 5 + 1. What is 6g(q) + n(q)? -2q - 2 Let y(g) = g3 - 4g*2 + 3g - 1. Let l be y(4). Let o(s) = s*3 - 6s + 6. Let w(d) = -2d3 + 11d - 11. Calculate lo(f) + 6w(f). -f*3 Let s(r) be the third derivative of 0r + 2/3r3 + 0 - 1/6r*4 - 2r*2. Let c(q) = -7q + 7. Let m be 480/90 - 4/(-6). Determine mc(w) - 11s(w). 2w - 2 Let u(x) = -4x - 40. Let h(f) = -10f - 100. Give -5h(s) + 12u(s). 2s + 20 Let j(z) = -2z2 + z2 + 1 - 5 - 7z. Let t be j(-7). Let q be (-39)/(-9) - 4 - 10/3. Let g(r) = 2r - 4. Let h(u) = -2u + 3. Determine qg(k) + th(k). 2k Suppose 0b - 13b = 65. Let z(v) = -5v*2 - 5v + 6. Let a(q) = -4q2 - 4q + 5. Calculate bz(i) + 6a(i). i*2 + i Let a(v) = 2v3 + v2 - 4. Let t(g) = -g*3 + 1. Give -a(k) - 4t(k). 2k3 - k2 Let c(u) = -15u*3 + 11u*2 + 7u + 6. Let p(v) = 8v3 - 6v*2 - 4v - 3. Give 6c(n) + 11p(n). -2n3 - 2n + 3 Let o(i) = -7i. Let a be 3 + 3/(12/(-8)). Let m(x) = a + 27x - 1. Determine -4m(b) - 15o(b). -3b Let m(n) = 11n*2 - 7n + 7. Let j(r) = 4r2 - 2r + 2. What is 14j(t) - 4m(t)? 12t2 Let n(y) = -y2 - y - 1. Let x(w) = w2 + 4w + 3. Suppose 5 = -u, 5j + u + 15 = -0. What is jn(l) - x(l)? l*2 - 2l - 1 Let i(m) = 4m2 + 2m. Let y(d) = -4d2 - d. Give 4i(b) + 3y(b). 4b*2 + 5b Let i(m) = -9m2 + 6m - 1. Let s(n) = -5n2 + 3n. Determine 3i(r) - 5s(r). -2r2 + 3r - 3 Let d(k) be the second derivative of k4/12 + k3 - 44k + 1. Let p(o) = -4o*2 - 25o. Determine -9d(h) - 2p(h). -h*2 - 4h Let i(z) = -6z2 + 5z - 8. Let h(y) be the third derivative of y5/12 - y4/6 + 7y3/6 + 11y*2. What is -7h(c) - 6i(c)? c2 - 2c - 1 Let h(q) = -9q2 - 9q + 3. Let z(o) = -4o2 - 4o + 1. What is 3h(i) - 7z(i)? i2 + i + 2 Let q(m) = m2 + 2m + 11. Let j(n) = -n2 - 3n - 12. Calculate -3j(h) - 4q(h). -h*2 + h - 8 Let c(d) = d + 1. Let w(x) = -x + 2. Let v(k) = -k + 4. Let b(f) = 2v(f) - 5w(f). What is -b(j) + c(j)? -2j + 3 Let i(a) = -2a - 1. Suppose 3u - 2 = 10. Let b(o) = uo - 4o + 3o + 1. Determine 3b(y) + 4i(y). y - 1 Let k(r) = 11r + 1. Let l(m) = 22m + 2. What is -10k(f) + 6l(f)? 22f + 2 Let c = 5 - 1. Let t(m) = -2m3 + 4. Let r(s) be the second derivative of 0s*4 - 3s + 0 - 3/2s2 + 1/20s*5 + 0s*3. Determine cr(o) + 3t(o). -2o*3 Let a(u) = 2u2 + 7. Let z(r) = -r2 - 6. Let b(f) = -2f3 - 37f*2 - 19f - 16. Let i be b(-18). Calculate ia(t) + 3z(t). t*2 - 4 Let v(j) be the first derivative of 9j*2/2 + 5j + 5. Let a(g) = -13g - 7. Give -5a(n) - 7v(n). 2n Let r(w) = -w + 3. Let b(t) = 5t + 2. Suppose -i + 4 = 6. Let k be b(i). Let n(c) be the second derivative of -c3/3 + 4c*2 - c. What is kr(z) + 3n(z)? 2z Let m(i) = 11i2. Let s(l) = -16l*2. Give -8m(h) - 5s(h). -8h*2 Suppose 2l + p = 6, 2 + 0 = 3l - 2p. Let f(b) = b3 + b2 - 3. Let z = -11 + 8. Let k(t) = -2. Give lf(j) + zk(j). 2j3 + 2j2 Let p(n) = -n2 + 0n3 - 5n + 4n3 + 7n2 - 3. Let b(g) = g3 + g*2 - g - 1. Calculate 5b(z) - p(z). z3 - z2 - 2 Let d(n) = -5n3 - 17n*2 - 9n. Let s(p) = -p*3 - 4p*2 - 2p. Determine 2d(y) - 9s(y). -y*3 + 2y*2 Let o(f) = 3 - 5 + 0. Let u(g) = -3g - 8. Let w(q) = 2q + 4. Let h(c) = 3u(c) + 5w(c). Determine -2h(x) + 4o(x). -2x Let o = 97 + -103. Let l(c) = -c*3 - 6c*2. Let j(d) = 3d*3 + 17d*2. Give oj(w) - 17l(w). -w3 Let u be (-3100)/(-527) + (-4)/(-34). Let n(g) = 1 - 7g + g*3 - 4g*3 - 5g*3. Let k(p) = 17p*3 + 15p - 2. Calculate uk(f) + 13n(f). -2f3 - f + 1 Let c = -44 - -43. Let d(g) = -5g. Let n(m) = -m. What is cd(q) + 3n(q)? 2q Let w(x) = -x. Let m(j) = -j2 + 3j - 1. Suppose 6 = -2d + 4t, d - t = -2t + 3. Suppose -2 - 8 = 2p - 4i, -2i + 8 = 0. What is dm(u) + pw(u)? -u*2 - 1 Let o(p) = -2p*3 + 2p*2 + p. Let b be o(-1). Let l(t) = -2t3 + t2 + 4t. Let r(d) = -d3 - 2d*2 - 2d*2 + 5d*2 + 2d. Give bl(f) - 5r(f). -f*3 - 2f*2 + 2f Let d be (3 - -1) + 8 + -4 + -9. Let b(t) = t + 1. Let m(i) = 6i + 9. Calculate dm(f) + 5b(f). -f - 4 Let j(z) = z3 + z2 + z + 1. Let b(t) = 13t*3 + 3t*2 + 2t + 3. What is -b(l) + 3j(l)? -10l*3 + l Let w be 11/(2/8). Let n(g) = -3g + 2. Let m(i) = 6i + 0i - 5i - 1. Determine wm(z) + n(z). z - 2 Let j(c) = -15c*3 + 2c*2 - 2c + 2. Let g(f) = -105f3 + 15f*2 - 15f + 15. Give 6g(l) - 45j(l). 45l3 Let t(s) = -3s3 + s2 + s + 2. Let z(j) = -7j3 + 3j*2 + 3j + 5. Suppose 2g - 3g = 2. Give gz(x) + 5t(x). -x3 - x2 - x Let n(w) = -2w3 + 4w. Let t(h) be the second derivative of -3h5/20 + 5h*3/6 - 2h. Let k = 3 + -7. Determine kt(o) + 5n(o). 2o3 Let r(l) = -28l*3 + 7l*2 - 7l + 7. Let i(f) = -14f3 + 3f*2 - 3f + 3. Determine 7i(u) - 3r(u). -14u3 Let h(t) = t2 - 5t + 4. Let r be h(4). Suppose r = 4q + 6 - 2. Let w(f) = -2f*3 - 2f + 4. Let o(l) = -1. Give qw(s) - 4o(s). 2s3 + 2s Let m(n) = 3n - 5. Suppose 1 = 2x - 3. Let t(q) = -q + 1. What is xm(c) + 10t(c)? -4c Let v(k) = -k3 - 2k*2 - 7k - 5. Let r(a) be the first derivative of -a*2/2 - a + 11. Give 5r(p) - v(p). p*3 + 2p*2 + 2p Let w be (4/8)/((-1)/(-6)). Let t(v) = 2v. Let l(a) = -a. Determine wl(f) + t(f). -f Let i(l) = -4l2. Let f(r) = -4r*2. What is -6f(s) + 4i(s)? 8s2 Let d(j) = -j3 + 3j2 - 3. Let k(i) = -5i*3 + 16i*2 - 15. Determine -11d(c) + 2k(c). c3 - c2 + 3 Let r(s) = 2s*2 - 9s - 5. Let h be 8/36 + (-119)/9. Let b(u) = -4u2 + 19u + 11. Let o(t) = hr(t) - 6b(t). Let z(p) = -p. Calculate o(w) + 5z(w). -2w*2 - 2w - 1 Let j(i) = i*2 - 5i + 8. Let v(b) = b - b + 7 - 5b + b2. Let g(p) = -5j(p) + 6v(p). Let w(z) = z2 - 4z + 2. Determine 5g(y) - 6w(y). -y*2 - y - 2 Let d(y) = -4y*2 - 11y - 1. Let i(u) = 3u2 + 10u + 1. What is 4d(k) + 5i(k)? -k*2 + 6k + 1 Let s(m) = -m + 4. Let f be 6/7(-42)/(-6). Let l(h) = 2h - 9. Calculate fl(k) + 14s(k). -2k + 2 Let y(k) = -754k. Let n(q) = -13q. Give 117n(a) - 2y(a). -13a Let m(p) = -4p + 0p + 2p + 3p. Let c(l) = -3l. Let b(a) = -a + 2. Let f be b(4). Give fm(s) - c(s). s Let p(d) = 9d3 + 11d*2 - 15. Let m(k) = -8 + 6k*2 + 5k3 - k3 + k*3. Determine 11m(u) - 6p(u). u3 + 2 Let a(u) = 7u - 5. Suppose 64 + 21 = -5o. Let y(c) = 20c - 14. Calculate oa(j) + 6y(j). j + 1 Let w(g) = -2g3 + 5g*2 - 5g + 4. Let u(j) = -6j3 + 16j*2 - 16j + 12. Give 5u(m) - 16w(m). 2m3 - 4 Let v(m) = 5m + 4. Suppose 4w + 0 + 9 = -5k, -17 = -3w + k. Let d be 8/2 + (-2 - -4). Let b(r) = d + 5r - 1 + 5r - 4r. What is wv(f) - 3b(f)? 2f + 1 Let g(h) = -1 - 6h - 3h - 4h*2 - 3 + 13h + 3h3. Let f(t) = -3t*3 + 3t*2 - 3t + 3. Calculate 4f(k) + 3g(k). -3k3 Let m(b) = 3b*2 + 4b - 2. Let o(u) = 10u2 + 12u - 7. Give -7m(q) + 2o(q). -q*2 - 4q Let z(p) = 72p2 + 8p + 8. Let d(c) = -24c2 - 3c - 3. What is 8d(j) + 3z(j)? 24j2 Let t(f) = -1. Let z(a) = -2a*2 - 2a + 4. Let n(j) = 4j3 - j2 + 2j - 2. Let u be n(1). What is ut(p) + z(p)? -2p*2 - 2p + 1 Let d(y) = 161y - 112. Let v(q) = -10q + 7. Let h(l) = 3d(l) + 49v(l). Let i(n) = -11 - 1 + 14 - 1 - n. Determine -h(j) + 6i(j). j - 1 Let g be -2(6/4)/(-1). Let c(v) = 4v - 3v + 4v - 3v - 2 + 2v2 + vg. Let s(a) = a2 + a - 1. Determine c(m) - 2s(m). m*3 Let v(n) = 7n3 - n2 + 2n. Let g(u) = u3. Let q be (4/(-6))/(16/24). Give qv(o) + 6g(o). -o3 + o2 - 2o Let s(n) = -n + 1. Let g(i) = 17i - 5. Determine -g(h) - 6s(h). -11h - 1 Let a(l) = -4l*2 + 2l - 2. Let p(i) = 2i - 3i*2 - 5 + i + 2. Let w(t) = -7t*2 + 7t - 7. Let q(r) = -5p(r) + 2w(r). What is	{ "pile_set_name": "DM Mathematics" }
hich is greater: 0 or -32/30383? 0 Is -103995 greater than -103999? True Is -4560639 at least -4560638? False Is 50146 greater than 50145? True Which is smaller: -191 or -72? -191 Which is greater: -21/441853 or -1? -21/441853 Which is greater: -367/2 or -0.727? -0.727 Is 60349 equal to 60353? False Which is smaller: 137/2 or -562? -562 Is 10001 less than 9999? False Which is bigger: 1086.7 or -17? 1086.7 Does 19007 = 76029/4? False Is 2 bigger than 283/108? False Do -981753 and -981753 have different values? False Is -253784/7 != -36255? True Which is smaller: 1819 or 181857/100? 181857/100 Which is greater: 0 or 8/1147935? 8/1147935 Is 25639 smaller than 25641? True Which is greater: 8/345 or -1? 8/345 Which is smaller: -66 or -1649/25? -66 Which is bigger: -484 or 220? 220 Which is greater: 95168 or 95167? 95168 Are 2/808281 and 0 unequal? True Is 1 <= -106/401? False Which is greater: -1 or 19806? 19806 Is -123111 at least as big as -123111? True Which is greater: -2 or -1067.7? -2 Which is bigger: 25513 or 102055/4? 102055/4 Is -889 > 2.52? False Which is smaller: 9807 or 107890/11? 9807 Is -2766088 less than -2766088? False Which is smaller: 3906/2669 or 1? 1 Is 1/604965 bigger than 2/5? False Is -2/3 at least as big as 5758/3? False Which is smaller: -3.843 or 163? -3.843 Are -4448 and -48913/11 unequal? True Which is greater: 2 or 2302730? 2302730 Which is smaller: -392/157 or -3? -3 Is 1531/3 less than -0.9? False Which is greater: 344238 or 344240? 344240 Do -663 and -679 have the same value? False Which is smaller: 1/1234 or -11? -11 Is -1 < 471/6604? True Which is greater: 10108/13 or 777? 10108/13 Which is bigger: -8749 or -8750? -8749 Which is greater: -1 or 462.7? 462.7 Is -1 at least 32/3959? False Are 20140 and 20137 equal? False Is 3188 smaller than 0.6? False Are -255/14 and -17 equal? False Is 0 at least as big as -7134? True Which is smaller: 43723 or 43727? 43723 Are -21481 and -21491 nonequal? True Which is bigger: -48733 or 5? 5 Is 81606 at least as big as 81606? True Is -0.1 > -4/145197? False Which is greater: 9201 or 9200? 9201 Is -1059 bigger than -37? False Is -16455 equal to -16628? False Which is smaller: -2/15 or -7/17306? -2/15 Which is smaller: 189 or 2082/11? 189 Is -1/233 less than 0.06? True Is -10681222 > 0.1? False Is -3978 > -3965? False Which is smaller: -4/7 or -127/19? -127/19 Is 161607 > 161608? False Is 943282 less than or equal to 943282? True Is 9 not equal to -52296/7? True Are 0 and -100/403 non-equal? True Which is bigger: -211604 or -211606? -211604 Does 2029 = 2049? False Is -5340 bigger than -5404? True Which is bigger: -21761 or -369942/17? -21761 Which is greater: 0 or 1/534100? 1/534100 Is -2750 <= -6? True Is 38764 != 1? True Which is smaller: -0.64492 or -0.07? -0.64492 Which is smaller: 807083 or -2? -2 Are 20055/43 and 465 nonequal? True Which is greater: -1/4055835 or 1? 1 Do 48/79 and -2/3 have different values? True Is -1/64 < 219? True Is -2/29 < 5/4031? True Is 18338 not equal to 18318? True Which is smaller: -56 or -0.364? -56 Is -2789 > 761? False Is 93 at most as big as 13? False Do -6/1054451 and -1 have different values? True Which is greater: 6 or -5592? 6 Which is greater: 521 or 520? 521 Which is smaller: -30565 or -5/18? -30565 Does 0 = 41/9347? False Which is smaller: 1 or 127/472? 127/472 Which is smaller: -2/8065 or 112/3? -2/8065 Which is bigger: -27135/181 or -149? -149 Which is greater: -1125 or -1117? -1117 Are 26 and -224 non-equal? True Is 554/7 less than -7/8? False Which is smaller: 286 or 770? 286 Is -1 != 39/40090? True Is -205413 greater than or equal to -205412? False Which is bigger: 1/5 or 246131? 246131 Does -1 = 3/33994? False Do -26.1 and -153 have different values? True Which is greater: -3392 or -98366/29? -98366/29 Does -75/9302 = 0? False Which is greater: 291 or -0.15? 291 Which is greater: -447 or -448? -447 Is -2051.31 smaller than 0.04? True Which is bigger: 241097 or 241090? 241097 Is -7502 less than or equal to -7510? False Which is smaller: 21383 or 21391? 21383 Which is smaller: 1462 or 97? 97 Is -3794187 greater than -3794188? True Which is smaller: 0.1 or 57479? 0.1 Which is bigger: 97085 or 97087? 97087 Which is greater: -82267 or -82266? -82266 Which is bigger: 44501 or 44499? 44501 Which is smaller: -1164 or 25/36? -1164 Which is smaller: -625/38 or -17? -17 Which is bigger: -5 or -165.64? -5 Which is greater: 39/214180 or -1? 39/214180 Are 2180753 and 2180752 nonequal? True Which is smaller: -145943 or -145925? -145943 Which is greater: 186 or 0.1631? 186 Is 280041 at least 0? True Are -6904 and -6900 equal? False Which is bigger: -20907 or -1? -1 Do -1 and -4/89099 have the same value? False Which is greater: 353 or 402? 402 Which is smaller: -32047/7 or -4579? -4579 Is 848897 not equal to 848896? True Which is smaller: 0 or 2/1160051? 0 Are 62890 and 62890 nonequal? False Is -2/23155 less than 1? True Which is smaller: 1 or 2/48827? 2/48827 Is -3526/761 at most -6? False Is 169829 smaller than 169826? False Is -1 less than or equal to -4/42037? True Which is bigger: -423 or -411? -411 Which is bigger: 725292 or 725293? 725293 Is -2175420 > -2175422? True Is -161170 less than or equal to -161170? True Are -0.32 and -76/23 non-equal? True Which is smaller: -89/5437 or 1? -89/5437 Which is greater: -541 or -557? -541 Is 2010 at least 40207/20? False Which is smaller: 2/109 or 1/3? 2/109 Which is greater: 17/142383 or 0? 17/142383 Which is smaller: -3468 or -3451? -3468 Which is smaller: 0.2 or 383676? 0.2 Which is bigger: -155638 or -155639? -155638 Which is greater: -216520 or -216518? -216518 Which is smaller: 65497 or 65544? 65497 Which is smaller: -1 or 126.8374? -1 Which is greater: -18663 or -18660? -18660 Is -12 <= -3998? False Is -1877 at most as big as 124? True Is 3179 greater than or equal to 2744? True Which is smaller: -2489959 or 0.1? -2489959 Is 4 <= 386/115? False Is 1 at most 925/3436? False Is 0 less than -29/42422? False Is 55912 < 55935? True Which is smaller: 89/16 or 2261? 89/16 Which is smaller: -11106/7 or -1587? -1587 Which is smaller: 6/106993 or -1? -1 Are -15/10823 and 1 nonequal? True Does -3 = 2151/2? False Is -314 != -71944/229? True Is -203/1616 equal to 1? False Which is bigger: 2361 or -9? 2361 Is 25378 at most as big as 25359? False Which is smaller: -22460 or -22457? -22460 Which is smaller: 0 or 23266? 0 Is -75 at least as big as 33? False Is -587878 > -587880? True Is -885497 equal to -885496? False Is -331 bigger than 217? False Is -2134/175 <= -11? True Which is smaller: 53660 or 53667? 53660 Which is smaller: -1 or 2/2693245? -1 Which is smaller: -9213323 or -9213324? -9213324 Is 520 greater than 27? True Which is greater: -5989 or 2/3? 2/3 Is 247 smaller than 115? False Which is greater: -3/921359 or 0? 0 Is -141306 >= -989134/7? False Is -2667905 bigger than -2667905? False Is -813/2 smaller than -0.1? True Do 0 and 168/110233 have the same value? False Which is smaller: -1629 or -2? -1629 Which is smaller: 6.94 or -1/75? -1/75 Is -69565 less than or equal to -139127/2? True Which is smaller: 1528 or 1441? 1441 Is 2/35459 greater than or equal to 19/3? False Does 14508/25 = 580? False Is -24766/11 bigger than -2252? True Which is smaller: -1 or 3/2138? -1 Is -1156 >= 4? False Is 2/35 < -0.74? False Which is greater: 2297/22 or 105? 105 Which is smaller: 267508 or 535013/2? 535013/2 Is -33/962 > 80? False Do -184223 and -184232 have the same value? False Which is bigger: -2159 or -2160? -2159 Which is bigger: -18/8875 or 1? 1 Is -14326 equal to -14242? False Is 206947 at least 206947? True Is -20/4059 less than 0? True Is -2/1630887 equal to -1? False Is -3/245 at least -15/7? True Is 17233 <= 17231? False Is 120/4121 >= 0? True Are -917/106 and -10 equal? False Is 36522 > 0? True Is -494 equal to -539? False Which is smaller: 755 or 16? 16 Is -25125/2 <= -12563? False Is 93189 < -0.2? False Do -404504 and -0.1 have different values? True Which is bigger: -11602 or -14/13? -14/13 Does -40293 = -40325? False Which is smaller: -3222 or -38671/12? -38671/12 Which is smaller: 92071 or 4? 4 Which is smaller: -2/7 or 72.2464? -2/7 Is -570 at most -559? True Which is smaller: 17 or 14? 14 Which	{ "pile_set_name": "DM Mathematics" }
m + 156, -228055m = 3h - 228059m - 326 for h. -2 Solve -3 = 3k, -1021 = -i + 4k - 1023 for i. -6 Solve 66517n - 2l - 6 = 66521n, 0 = -4l + 12 for n. -3 Solve -2h - h + 30o = 231, 4h + 317 = 3o + 156 + 149 for h. 3 Solve -68 = -9q - 2o + 47, 3q + o = -4o + 34 for q. 13 Solve -v + j = -24, 0 = -3v - 76709j + 76704j - 88 for v. 4 Solve 0g = -41f + 42f - 2g + 40, -242 = 7f + 5g for f. -36 Solve 6q + 5l + 37 = 0, 24043 = -4q - 11l + 23934 for q. 3 Solve 39t - 56 = 40t - 3y, -3y - 31 = 4t - 92 for t. 1 Solve 0 = 4m + 2p - 78, 3p + 35454 = 3m + 35544 for m. 3 Solve 3 = s + 2m, -3201s + 3m - 12 = -3204s for s. 5 Solve 6 = 4i + 50b - 52b + 8, 17i + 5b = 32 for i. 1 Solve 1431 = 36f + 3f + 432 - 1068, -7f + 432 - 71 = 5o for o. -2 Solve 3d - 91 = 71825o - 71826o, -5o + 125 = 4d for d. 30 Solve s - 444m + 1 = -440m + 3, -40 = -5s + 5m for s. 10 Solve 20q = 15q - 2v - 8 - 35, -5q - 52 = 3v for q. -5 Solve 1294 = -2i + 1154, -564 = -2y + 7i + i + 4 for y. 4 Solve 24 = 4d - n, 78573 = -5d + 4n + 78614 for d. 5 Solve 566m + 559m = -4o + 1121m - 20, 4o - 2m - 40 = 0 for o. 5 Solve 0 = i + 5l + 29, i + 293l - 294l - 7 = 0 for i. 1 Solve 2a - a - 4 = 3a, 4i = 2i - 8a + 4a + 13 - 9 for i. 6 Solve -3o + 0o - 19215y + 19218y - 42 = 0, 0 = -6o - y - 77 for o. -13 Solve -889p - 360 = -949p - 0q + 4q, 3q - 30 = -6p + p for p. 6 Solve -4p - 288 = -3s, -11096s + 11101s + 288 = -4p for s. 0 Solve -1198 = 4p + 5v - 1265, 0 = 4p - 3v - 107 for p. 23 Solve 0 = -t - 4r - 17, -49t + 90t = 39t + 4r - 58 for t. -25 Solve 0j - 2j = -4j - 4w + 48, 0 = 26w - 28w + 6 for j. 18 Solve 12 - 30 = 4m + 3u, -4u = -8179m + 8176m - 1 for m. -3 Solve -7g + 6g - 6 = -7g + 3t, -3t + 2t - 8 = 4g for g. -1 Solve -4q - 4c + 40 = 0, -4q + 63c - 51c - 83 = -27 for q. 4 Solve -3z = -19x + 295, -3879914z = -3879919z - 555 for x. -2 Solve 87q = 82q - 5n - 160, 5q = 2q - 4n - 92 for q. -36 Solve 3z + z - 3z = -5h - 18, -5h + z = 12 for h. -3 Solve 2l - 5l = 3m - 90, -33m + 35m - l = 1 + 53 for m. 28 Solve -5r = -15, 893m - 889m - 44 + 0 = -4r for m. 8 Solve -4v = 2409604k - 2409608k + 48, -78 = -4k - 0k - 2v for k. 17 Solve -4a + 2i = 4, -429a + 4i = -433a + 20 for a. 1 Solve -50k + 198 = -31a - 53k, a + 0a = -2k - 14 for a. -6 Solve 5k + 0o - 4o = -5, -k - 93 = -5k + 422o - 193 + 96 for k. -1 Solve 0 = -4i - 28x - 32, 597i = 600i + x + 4 for i. -1 Solve 3f + 22 = 5y, -5y + 472f = 423f - 666 for y. -4 Solve 2n - 62 = -2y, n - 38y = -0n + 8 + 62 for n. 32 Solve -100 = -35v - 5p, -3v + 6p + 24 + 3 = 12 for v. 3 Solve 0 = 10y - c + 544, y - 5y - 556 = -c - 336 for y. -54 Solve 0 = 82r - 87r + 70, 0n + 4r = -4n + 52 for n. -1 Solve -34 = -0g - 2g - a - 6, 153g + 21 = 253g - 103g + 2a for g. 5 Solve -18 = 5a + 2z, -z = -17363a + 17356a - 48 for a. -6 Solve 4f = -1000s + 1001s - 39, -279 = -5s - 8f for s. 51 Solve 0 = -2o + 4, 3n + 893o - 898o = 5n for n. -5 Solve -852 = -2n + 66k, -5n + 6543k - 6546k - 54 = 0 for n. -3 Solve -5w - 47t = -68t - 29, 2w + 17t - 13t + 38 = 0 for w. -11 Solve -21s = -20s - 4v - 8, 571v - 566v = 2s - 1 for s. -12 Solve 5d = -5j + 20, -3d + 153 = -26j + 112 for j. -1 Solve -427g + 430g + 18 = -4m + 39, 0 = -2m + 2g + 14 for m. 6 Solve 27c + 273 = -3r, -40 = -7061r + 14109r - 7048r + 4c for r. -1 Solve -3w + 340n - 89n = w - 5w - 25n - 837, 5w - 2n = -39 for w. -9 Solve 0 = 6538z - 6540z + 2w - 134, 5z - 20w = -4w - 1116 for z. 4 Solve 15p - 62p + 45p - a - 12 = 0, 21p + 45 = 3a for p. -3 Solve 62y + 1598o = 1600o - 304, 2y + o = -13 for y. -5 Solve 7z + 3 = -s - 3z + 9z, -3s - 2 = z + 17 for s. -8 Solve -4w + 6 = -2g, 0 = -2g - 3g - 683w + 689w - 15 for g. -3 Solve -413o - 2f - 3 + 12 = -415o - 3, -3o - 50 = 5f for o. -10 Solve 22j = 5q + 83, 3215q + 9 = 3216q + 2j for q. 1 Solve -a = 5h - 5, -4a + h = -100223 + 100203 for a. 5 Solve 0 = -3i + 3z - 24, -4z - 7443931 = -7443939 for i. -6 Solve 5b = -11z - 122, 2587z - 2586z + 40 = 14b for b. 2 Solve 0q = -17q + 2k - 138, -865q + 430q + 430q + 3k - 43 = 0 for q. -8 Solve 8s - 57 = -5x, 2216s - 5x + 33 = 2218s for s. 4 Solve -n + 5651 - 5622 = y, 5y = -3n + 95 for y. 4 Solve 109b - p - p = 73, 1491b - 1486b = 5p - 85 for b. 1 Solve -2j - 4j = -5d - 82, 5j - 3j - 66d = -71d + 54 for j. 17 Solve 2w - 3w + 150 = -33m - 52, -5w - 3m + 2 = 0 for w. 4 Solve s + 54 - 90 = -r - 3s, -13r - 6r = 4s - 108 for r. 4 Solve 14a - 71 = 3y, 4a + 4y = -183 + 179 for a. 4 Solve 0 = 6z - 337b + 332b + 45, 5z - 5b = -35 for z. -10 Solve 2r - 16 = 28, -25r = -6l - 31r + 18r - 288 for l. -4 Solve 3330d - 3327d + 5t - 47 = 0, 0 = -2d + 9t + 93 for d. 24 Solve 4o + 1902u + 59 - 36 = 1897u, 0 = -o - 2u + 1 - 6 for o. -7 Solve -6v = 3z + 3, -15z = -14z - 16v + 12v + 19 for z. -7 Solve -3 = -3b, 2x + 28 = 2059b - 2063b for x. -16 Solve -19378f - h + 51 = -19373f, -3h = -7f - 87 for f. 3 Solve 145 - 168 = 2h + 5u, -5u - 87 + 55 = 3h for h. -9 Solve -2u + 2x + 99 = u, -6u + 6x = -6u + 28x + 990 for u. 3 Solve 4w = -15v - 69 - 18, 3w + 50 = 10 - 14 for v. -1 Solve -41 = 7a - 4317n + 4315n, -35 = 4a - 5n for a. -5 Solve k = 10r - 11r, -5k + 9r - 56 = 0 for k. -4 Solve 413 - 410 = j + 2s, 0 = -2j - 42s - 11s + 55 for j. 1 Solve -139 = -4g - v, -109g + 112g - 5v + 63 = 150 for g. 34 Solve 2x + 2v - 8 = 0, -36 + 96 = -11x + 23v - 21v for x. -4 Solve -4v - 114 = -3k, -v + 1107 = 5k + 1124 for k. 2 Solve -4h - h + 222 - 61 = -4x, 0 = h - 3x - 118 for h. 1 Solve 244q = 3u + 243q - 14, 0 = -2u + 11q - 1 for u. 5 Solve 22 + 115 = -4f - 5z, 47742f = 47739f + 42z - 57 for f. -33 Solve -4z + 130t + 19 = 127t, 0 = -26z + 2t - 104 for z. -5 Solve -5l + 7p + 462 = 397, -499 = -79l + 5p for l. 6 Solve d - 59 = 20 - 76, -2u - 18d = -94 + 20 for u. 10 Solve 88n - 210n + 4i = -125n + 32, -4n = 7i - 46 for n. 8 Solve 5i = -4c + 5, 32c - 4 = -4i + 20c - c for i. 1 Solve 0 = 5m - 8y - 299, -189877m + 189870m + 5y = -400 for m. 55 Solve 7u + 41 = 2b, 0 = 9u + b + 133 - 116 for u. -3 Solve 4o - 32 = 2t, -3957t + 212 = 38o - 3953t for o. 6 Solve 5u - 37515 = -s - 37508, 2s - 45 = 21u for s. 12 Solve 2o - 23 = 5s, -14748 = 5o - 4s - 14763 for o. -1 Solve 0 = b - 5h + 124, -4b + 111 = -b + h + 99 for b. -4 Solve 7i = 2c - 2431 + 2406, c + 4i - 50 = -0c for c. 30 Solve -8v - 13 = 2c + 1, -7v - 49 = 9c - 2c - 2v for c. -7 Solve 65 = l - 4m, 16l + 5m + 45 = 10l for l. 5 Solve 150n + 24 = 154n + 3c, 7n - 113 = -23c for n. 3 Solve r = 8, 0 = 3f + 5f - 7f + 95r - 762 for f. 2 Solve 14b - 104 = -4k + 288 + 26, 2b - b - 25 = 6 for k. -4 Solve -4x - 10g - 48 = 0, 3647g - 3659g - 81 = -3x for x. 3 Solve d + 4d - 35t - 58t + 240 = -71t, -3t + 30 = 0 for d. -4 Solve -2t + 195p = 387p - 198p + 8, -3t + 28 = 11p for t. 2 Solve z - 2d = 15, -2z - 7z = 2z - 2z + 12d - 45 for z. 9 Solve 52s + 74s - 123s + m = 31, -3m + 53 = -s for s. 4 Solve 0 = -4t - z + 61, 4t + 61z - 187 - 119 = 53 + 2 for t. 14 Solve -70r + 32816f = 32819f + 104, 2r - 56 = -5f for r. -2 Solve 4s + 739 = -3x + 573, 5x - 96 = 2s for x. 2 Solve 6d - 4j + 21 = 3d - 103, 3d + d - 7j + 222 = 0 for d. 4 Solve 6 = -3j, -u = -5j + 9j + 70 - 49 for u. -13 Solve 5p = 4y + 34, -20994p - 3 - 17 = -20995p + 2y for p. -2 Solve 17c = -3x + 672, -c - 68x + 69x - 81 = -3c for c. 39 Solve -145788s + 145791s = -162, -2a + 6s + 0s - 2s = -212 for a. -2 Solve 29i + 8i - 61i = k + 19, 0 = k - i - 6 for k. 5 Solve 147a - 154a - 4d - 23 = -0d, a - 15d + 17 = -19d for a. -1 Solve 68y + 12 = 64y, 0y = 2v - 2y - 4 for v. -1 Solve -2 = -4c + v + 5v, 4c = 5v - 775 + 776 for c. -1 Solve -13t + 17 = -3u + 9 - 64, -41t + 2u - 22 = -44t for t. 6 Solve 15u - 601 = -b, 4b + u = 12u - 2u - 14u + 204 for b. 1 Solve 115 = 28n - 0k + 5k, 5n + 3k - 45 = -0k + 7k for n. 5 Solve -k - 4*k	{ "pile_set_name": "DM Mathematics" }
- 5x3 - 4x*3 + 4x3. -x3 Expand (-13 - 10 + 18 + (3 + 3 - 4)(1 + 0 - 2))(-u3 - u4 + u*3). 7u*4 Expand (1 - 7a*2 - 1)(a - 2a - a) + (-3a + 3a + 2a*3)(-5 + 4 + 3) + 3a3 - a3 - 4a*3 + 0a*3 + 4a*3 - 5a*3. 15a*3 Expand (2 - 5 + 2)((-4q2 + 2q*2 + 3q*2)(5q - q - 5q) + (-2 + 2 - q)(-q2 + 2q*2 + 0q*2)). 2q*3 Expand (3q + 4q + q)(2 - 7 + 4 + 4 - 1 - 1 + 2 + 3 - 4 + (-3 + 6 - 1)(-3 - 2 + 6) - 1 + 2 + 1 + 3 + 2 - 3). 64q Expand (1 - 1 - 2p)(55p3 - 3 - 28p*3 - 25p*3) - 2p*4 + 2p*3 - 2p*3. -6p*4 + 6p Expand (-1 - 4a + 1)(-2a - a2 + 2a) + (a - 2a2 - a)(1 + a - 7 - 3). 2a3 + 18a2 Expand -m + m3 + m + (-1 - 2m3 + 1)(-2 + 2 + 2) + (3m2 - 3m*2 + 2m*2)(3m - 2m + m) - m2 + m3 + m*2 + 5m*3 - 5m*3 + 3m*3. 5m*3 Expand (3 - 2 + 1)(2o2 - 4o*2 + 3o*2) + (1 + 1 + 1)(-1 - o2 + 1). -o2 Expand (-3n5 + 2n*3 - 2n*3)(0 - 1 - 1 - 1 - 2 + 4 + (-1 + 1 - 2)(2 - 5 + 2)) + (0n*5 + 0n*5 - 2n*5)(3 + 0 - 1) + n*5 - 2n*5 - 2n*5. -10n*5 Expand 2 - 2j - 2 - 2j - 5j + 5j + (-1 + 0 - 2)(3j - 2j + 0j). -7j Expand (-3 - 1 + 3)(-3n - 9n + 6n). 6n Expand (2f + 3f - 3f + (-4f + 0f + 3f)(2 - 4 + 3) - 4f + 5f - 3f - f + 0 + 0)(1 - 1 + 2f3). -4f4 Expand -v3 - 1 + 1 + (-5v - 2v + 5v)(11v2 - 9v + 9v). -23v*3 Expand (0g - 6g - 15g + (-g + 4g - 5g)(4 + 0 - 3) - 2g + 0g + 0g)(1 + 1 - 1)(0g + 0g + 2g2). -50g*3 Expand 0v*2 - 3v2 + v2 - 2v2 + 2v*2 + 2v*2 + (0v*2 + 3v*2 - 4v*2)(-1 + 1 - 1) - 19 + 19 - 4v2 + 0v2 - v2 + 0v2. -4v*2 Expand (-12k + 42k + 2k)(0k - 2k + k). -32k*2 Expand 0f*5 + 0f*5 - 2f*5 + (4f*4 - 3f*4 + 3f*4)(1 + 2f - 1) - 3f*5 - 2f*5 + 3f*5 + (-4f4 - f4 + 4f4)(f - 2f + 2f). 3f5 Expand (-51g*2 - 52g*2 - 17 + 105g*2 - g)(-3g3 + 3g*3 - 3g*3). -6g*5 + 3g*4 + 51g*3 Expand (-2c + 3c + 0c)(-20 + 5c + 20) - 3c2 - 3c*2 + 4c*2. 3c*2 Expand (0 + b + 3 + 0b)(-1 + 3 + 0)(34 - 13b - 34). -26b*2 - 78b Expand (15i - 16 + 16)(2i - i + 0i + (2 + 0 - 1)(-2i - 1 + 1) + 2i - 4i + i). -30i2 Expand (d5 + 2 - 2)(1 + 19 - 4). 16d5 Expand (-4u - 2u + 7u)(-5 + 2 - 8)(1 + 2u - 1 + (-u - u + 4u)(1 + 2 - 2)). -44u*2 Expand -j + 2 - 2 + (-3j - 2j - j)(-2 + 1 + 0). 5j Expand (0w*3 + 2w*3 + 2w*3)(-12w + 9w*2 + 12w). 36w5 Expand -3s*2 - 10s*2 + 2s*2 - 2 + 3s*2 + 2 + (2s + 4 - 4)(0 + 0 + 2s). -4s2 Expand 2q + 2 - 2 + (1 - 4 + 5)(-3q + q + q) + 2 - 2 - 2q + 2q + q + 0q + (2 - 6 + 2)(2q - 3q + 0q). 3q Expand (-2g3 - g + g)(0 - 8 + 10 - 9g). 18g*4 - 4g*3 Expand (-2x*2 + 0x*2 + 4x*2)(12x + 39 - 39)(-4 + 3 + 4). 72x3 Expand (1 + 1 - d - d)(15d - 3d - 6d). -12d*2 + 12d Expand (1 + 2u - 1)(-8 - 3u2 + 8 - 3u). -6u3 - 6u*2 Expand (2 + 1 + 2)(9 - 9 - 19g). -95g Expand (-w + w + 2w3)(3w - 4w - w) + (0w2 - 3w*2 + 4w*2)(-7w2 + 13w*2 + 7w*2). 9w4 Expand (a4 + 0a4 - 2a*4)(-a - 1 + 1) + 19a5 + a3 + 6a*3 - 9a*3. 20a*5 - 2a*3 Expand (0 + 1 + 1)(x2 - x2 - x*2) + 7 - 7 + 7x2 + x2 - 4 + 1 + 1. 6x2 - 2 Expand -3a + 3a + 2a*2 - 3a - 3a2 + 3a + (5a - 2a - 2a)(3a - 6a + a). -3a2 Expand i2 + 3i*2 - 3i*2 + (-4i - i + 4i)(10 - 10 + 4i). -3i*2 Expand 4v*4 - 5v*4 + 2v*4 + (-2v*3 + 4v - 4v - 1)(3v + 6v - v). -15v4 - 8v Expand (0n + 0n - 3n)(-5n + 2n + n) - n2 + 3 - n2 - 1. 4n2 + 2 Expand (1 + 2 - 4)(-11h - 1 + 1). 11h Expand (-4 + 0 + 0)(3t + 3t - 5t)(3t*2 - 3t2 - t2). 4t3 Expand -5 - 3d*2 + 5 + (-5 + 4 + 3)(d*2 + 0d*2 - 5d*2). -11d*2 Expand (-2h + 0h + h + (4h + 1 - 1)(1 - 7 + 4))(-2h + 1 - 1). 18h*2 Expand (-2 + m + 2)(-4 - 23 + 5). -22m Expand (n - n - n)(-2 - 1 + 4) - 2n + 2n + 2n + (-2 + 1 - 1)(-n + n + n). -n Expand (0 + 4 - 1)(-m + 0m + 0m) - 3m - m + 3m - 2m + 3m - 3m. -6m Expand -c2 - 3c*2 + 3c*2 + (-4c + c + c)(3c - 2c - 5c). 7c2 Expand 104 + 7n*5 - 104 + (-2n + 3n + 2n)(0n*4 - 2n*4 + 4n*4)(-3 + 0 + 1). -5n5 Expand 6t*3 - 6t*3 + 5t*3 + (5 + t - 5)(t*2 + 2t - 2 + 2). 6t3 + 2t*2 Expand (-25z*2 + 17z*2 - 13z*2)(0z + z + z) + (-5z + 2z + z + (0 + 0 - 2)(7z - 3z - 2z))(-3z + 3z + 2z2). -54z*3 Expand (-2r + 2 - 2)(16r + 12r + 0r). -56r2 Expand (-4c + 5c + 0c)(-3 + 1 + 1) - 5 + 5 + 7c. 6c Expand c - c + 2c*2 + (3c + c - 3c)(2c - 3c + 3c) - 3c*2 + 2c - 6 - 6c + 5c. c*2 + c - 6 Expand (-4s*2 + 3s*2 + 0s*2 - 3s*2 + 7s*2 - 2s*2 + (-2s + 1 - 1)(s - 4s + s) + 97s + 6s*2 - 97s)(4s*3 + 0s*3 - 2s*3). 22s*5 Expand 4q*3 - 3q*3 - 2q3 + q3 + 3q3 - 3q3 + (-2 + q2 + 2)(0q + 2q - 4q). -2q3 Expand -2x*3 + 2x*3 + 3x*3 + (0x*2 + 2x*2 - 3x*2)(2x + 0x - 6x) + 5 - 5 + 2x*3. 9x*3 Expand (-7y*4 - 5y*3 + 5y*3)(y + 4y - 4y). -7y5 Expand (0 - 2 + 0)(2s - 1 + 1) + 27s + 60s - 38s. 45s Expand 3a*5 + 3a*5 - 3a*5 + (2a4 + a4 - 4a4)(-5a + 2a + a) + 2a5 + 2a - 2a - 5a*5 + 2a5 + a5. 5a5 Expand ((4 + 1 - 4)(0 - 2 + 1) + 0 - 3 + 2 - 2 - 2 + 3 - 4 - 2 - 1)(-3a + 0a - 2a). 50a Expand -4i*2 + 5i*2 - 2i*2 + (i - 4i + 2i)(-2 + i + 2) + 2i - i2 - 2i + 2i - 2i + 3 - 2i2 - 2i. -5i2 - 2i + 3 Expand (v - 4v + 8v)(2 + 2 - 3)(2 - 2 + 2v). 10v*2 Expand (m + 3m - 2m + (-2m - 1 + 1)(3 - 4 + 0) + 2m + 2m - 2m + (6m - 3m - 2m)(3 + 0 - 2) - 6m + 4m - m)(-8m*3 - 17 + 17). -32m*4 Expand 2w*3 - 3w*3 + 6w*3 + (-5 + 2 + 4)(6w3 - 4w*3 - 4w*3). 3w*3 Expand (3d + 0d + d)(1 + 3 - 3)(d2 + 35d - 35d). 4d*3 Expand (-1 - 3 + 2)(o4 + o4 - o*4) + (0o4 - o4 + 3o4)(4 + 3 - 5) + 5o4 - o4 - 2o*4. 4o*4 Expand (-8r*2 + 7r*2 + 3r*2)(1 + 0 + 0)(-3r + r + 3r). 2r*3 Expand (-2 + 1 + 2)(2 + 3 - 6)(-44y - 22y - 96y). 162y Expand (-2o*3 + 0o + 0o)(42 + 0o - 48 + o). -2o*4 + 12o*3 Expand 0o*4 - 3o*4 + 0o4 + o2 + 5o4 - o2 + (0o + o + 0o)(2o3 - o3 + 0o*3) - o + o - 2o4. o4 Expand (b - 4b + 4b)(0 + 0 - 1) - 3b + 6b - 5b. -3b Expand (2u - u - 3u)(-u + 1 - 1) + (0 + 0 - 2u)(2u + u + 0u). -4u2 Expand (-3v - 4v + 4v)(-2 - 1 + 0)(5v + 0v - 2v) + (-2v + 0 + 0)(-2v - 3v + 3v). 31v2 Expand (1 + 0 + 1)(4k4 - 4k + 4k) + 2k3 + k4 - k*3 - 2k*4. 7k4 + k3 Expand (-2 + 2 + z - 1 + 1 + 2z + (4 - 4 - z)(5 - 2 - 4) + 0 + 0 + 2z + (3z + 2z - 6z)(0 + 0 + 3) + 2z - z + 0z)(z - z + z). 4z2 Expand (1 - 1 - 2)(5y2 - 8y2 + y3 + 2y2). -2y*3 + 2y*2 Expand (2q - q + 0q)((3q2 - 3q2 - q3)(-1 + 3 + 0) - 2q*3 + 2q3 + q3). -q*4 Expand 4y*5 - 2y*4 + 2y4 - y5 - 4y5 + 4y*5 + (-3y2 - y2 + 2y2)(y2 + y3 - y2) + y5 - 4y5 + y5. -y5 Expand (2n - n + 0n)(2n - 4n + 4n)(-3n - 6 + 2n + 7). -2n3 + 2n*2 Expand (4 + l - 4)(-2l4 + 0l*4 + 0l*4) - 9l*5 - 7l*4 + 7l*4. -11l*5 Expand (-148k*2 + 2 - 4 + 2k*3 + 149k*2)(-4k + 4k - 2k). -4k*4 - 2k*3 + 4k Expand -2j2 - j2 + 4j*2 + 2j*2 + 2j*2 - 3j*2 + (-4 + 5 + 5)(2j2 - 3j2 - j2) + 0j2 + j2 - 2j*2. -11j*2 Expand (2g*4 + 33g*4 + 0g*4)(-1 - g + 1) + 2g3 - 2g3 + g5. -34g5 Expand (-17 - 12 + 19 + (3 + 2 - 4)(-2 + 3 - 2) - 1 + 2 + 0)(-3 + 3 - 1)(-3 + 3 + v). 10v Expand (-1 + 1 + y2)(-3y - y + 2y) + 328y2 - 328y*2 + 27y*3 + (-y + 2y*2 + y)(y - 2y - y) + 2y - y*3 - 2y + 2y2 - 2y*2 + 2y*3. 22y*3 Expand (-1 - 1 + 0)(0 - 8f + 0) + 3 - f - 3. 15f Expand ((3 - 2 + 1)(2j - 5j - j) + 3j + 2j - 3j)(3 + 2j*2 - 3). -12j*3 Expand (3w - 7w + 2w)(-4 + 2 + 1)(w*3 - 2w*2 + 2w*2). 2w*4 Expand -2q*3 - 3q*2 + 3q2 - q3 - 2q3 + q3 + (3q - 3q - 2q*3)(2 + 1 - 1) + 2q2 + 0q + 3q + 2q*3 - 2q. -6q3 + 2q*2 + q Expand -5m*4 + 3m*4 + 0m*4 + (4m*2 + 3m*2 - 5m*2)(	{ "pile_set_name": "DM Mathematics" }
llest value in 28, -3, 1/9, 1/2, 0? 0 Which is the second smallest value? (a) 1 (b) 2/5 (c) 189 a Which is the fourth smallest value? (a) 4/3 (b) 4 (c) -0.5 (d) 9 d Which is the third smallest value? (a) -2 (b) 21 (c) 2 (d) 3 (e) -6/25 c What is the fourth biggest value in 8, 1, -2/7, -22? -22 Which is the second biggest value? (a) 1 (b) 0.2 (c) 0.4 (d) -0.31 c Which is the biggest value? (a) -5 (b) 8 (c) 0.1 (d) 289/4 d What is the third smallest value in -108, -3, 5? 5 Which is the fourth smallest value? (a) -2/7 (b) -12 (c) -0.4 (d) 2 d Which is the biggest value? (a) 11 (b) -2 (c) -4 a Which is the third biggest value? (a) 3 (b) -4 (c) -107 (d) -1 (e) -2/7 d What is the second smallest value in -2/9, 0.3, 2/7, -6? -2/9 What is the second smallest value in 1, 3, -0.01, 2? 1 Which is the smallest value? (a) -0.4 (b) 7 (c) -4 (d) 2/11 c What is the smallest value in -0.1, 329, 1/4, 3/4? -0.1 What is the third smallest value in -3/2, -1, -0.4, 0.8? -0.4 What is the second smallest value in -1/3, 294, 2/5, -0.4? -1/3 Which is the fourth smallest value? (a) -4 (b) -2/5 (c) 3 (d) -6 c Which is the biggest value? (a) 2 (b) 0.4 (c) 25 (d) 1/3 c What is the third biggest value in 5, 3, 1, -4, 31/4? 3 What is the third biggest value in -4/5, 18, -5? -5 Which is the second smallest value? (a) 3 (b) 0 (c) 5/12 (d) -0.5 b What is the fourth smallest value in -0.2, -2.8, -5, -22? -0.2 Which is the third biggest value? (a) -2/7 (b) -4 (c) -5 (d) -58 c Which is the biggest value? (a) 9 (b) 0 (c) 0.2 (d) -0.3 (e) 30 e Which is the smallest value? (a) -0.06 (b) 0.4 (c) 7 (d) 1.2 a What is the second smallest value in -0.1, 1/5, -17, 0.3? -0.1 What is the second biggest value in 1, 292, 2? 2 What is the smallest value in -0.6, -3.8, 1/5, -0.06? -3.8 What is the third biggest value in 0.2, -3, -15, 10? -3 What is the smallest value in 4/7, -31/2, -0.1? -31/2 What is the fourth biggest value in -2/3, 9/4, -1/2, 2/3, -1? -2/3 Which is the third smallest value? (a) 5 (b) 0.04 (c) -2 (d) -3/7 (e) -0.15 e What is the smallest value in 2, 0.11, -0.01, 1/4? -0.01 What is the biggest value in 0.07, -3, -2/15? 0.07 Which is the second smallest value? (a) -5 (b) 39 (c) 3/5 c What is the biggest value in -0.5, -1.89, 0.2, 3/8? 3/8 What is the third biggest value in 1, 1.3, 9? 1 What is the fourth biggest value in 2/13, 0.1, 1/14, 0.2, 0.04? 1/14 Which is the second biggest value? (a) 81 (b) 0.4 (c) -5 b What is the third biggest value in 1/5, -1, 5, -0.004? -0.004 Which is the smallest value? (a) 5 (b) 56 (c) -84 c What is the smallest value in -7, 19, -0.1? -7 What is the third smallest value in -0.1, 2/31, 1/5? 1/5 Which is the smallest value? (a) -1.1 (b) 1 (c) 0.9 (d) 0.4 a Which is the second biggest value? (a) 1/2 (b) -1/6 (c) -0.3 (d) 0.042 d Which is the third smallest value? (a) 3 (b) 0.23 (c) -1/3 a What is the third biggest value in 0.1, 5, -0.2, -1? -0.2 Which is the smallest value? (a) 3 (b) 0.62 (c) -4 (d) 2/19 (e) 2/5 c Which is the second biggest value? (a) -6/11 (b) 1 (c) 4 b What is the second smallest value in -0.2, -6.13, -2, 0.5? -2 What is the fourth smallest value in 9/26, 5, 2/9, -2/5? 5 What is the third smallest value in 1, -4/3, 147.3? 147.3 Which is the third smallest value? (a) -7/13 (b) -2 (c) 9 c What is the fourth biggest value in 9, -8, 0, 2/37? -8 Which is the fourth smallest value? (a) 91 (b) -4 (c) 0 (d) -2 (e) -0.05 c What is the biggest value in -0.3, -2/61, 3? 3 Which is the third biggest value? (a) 10/9 (b) -3 (c) -2/3 (d) -0.5 c What is the third biggest value in 0.1, 38/3, -35, -4, 0? 0 What is the third smallest value in -3/4, 1/5, -2, -4/5? -3/4 What is the smallest value in 0.04, -2/15, -0.2, -1/6? -0.2 Which is the fifth smallest value? (a) 1 (b) -3/5 (c) 4 (d) 0.16 (e) -3/2 c What is the fourth biggest value in -1, -3.1, 3, 4? -3.1 What is the fourth biggest value in 1, -19/4, 2/7, 0.1? -19/4 Which is the second biggest value? (a) -1 (b) -0.1 (c) -4 (d) -0.35 d What is the third smallest value in 2, -2, 7? 7 Which is the second biggest value? (a) 0 (b) -3 (c) 2/5 (d) -1 (e) 1 c What is the fifth smallest value in -3/5, -4, -44, 0.4, 15? 15 What is the second biggest value in 4, -1/3, 5, -9? 4 What is the biggest value in 14/11, -2, 1/3, -3/2, 2/17? 14/11 What is the smallest value in 0.3, 0.1, 1/13, -1? -1 What is the second biggest value in 1, -7, -4, 21? 1 What is the second biggest value in 5, -19, -3? -3 What is the smallest value in -0.561, -2, 7? -2 What is the fourth biggest value in 6/23, 0, -0.5, 4? -0.5 Which is the second smallest value? (a) -175 (b) 6 (c) -0.2 c What is the second biggest value in -4, -0.2, 2/5, 5? 2/5 What is the biggest value in -4, -7/2, 0.5? 0.5 What is the fourth smallest value in -5/4, -0.4, 2/11, 48? 48 What is the biggest value in 2.75, -1, 113? 113 What is the fifth biggest value in 1/3, 2/7, 0.13, 0.5, -2/9? -2/9 What is the third smallest value in -3, 1/4, 0.3, -4/5? 1/4 Which is the second biggest value? (a) -2/7 (b) -1/3 (c) -0.2 a What is the second biggest value in 2/15, -0.02, -3? -0.02 What is the third smallest value in 2/7, 12, -1/3, -2? 2/7 What is the second smallest value in -2, -0.5, -6.44, 3? -2 Which is the second biggest value? (a) -4 (b) -0.1 (c) 1/3 (d) -7/6 b What is the second biggest value in 2, -0.3, -1/41? -1/41 Which is the biggest value? (a) -2/9 (b) -2/259 (c) 4 c Which is the third biggest value? (a) -10 (b) -0.006 (c) 0.1 a What is the second biggest value in 5, -0.1, 206? 5 Which is the second smallest value? (a) 923 (b) -0.5 (c) -0.06 c What is the fourth smallest value in 3, -30, 2/67, 5? 5 Which is the fourth biggest value? (a) -0.2 (b) -3 (c) 8 (d) 1 (e) -8 b What is the biggest value in -0.024, -1, 3? 3 Which is the third smallest value? (a) -10 (b) 0.2 (c) -1/3 (d) -5 c What is the second smallest value in -0.5, 0, -62, 1/12? -0.5 What is the third biggest value in 0, -0.3, 3, -1/8? -1/8 What is the fourth biggest value in 1/2, -47, -2/13, 81/2? -47 What is the fourth biggest value in 0.4, 4, -20, 2/15? -20 Which is the second smallest value? (a) 2 (b) -0.1536 (c) -1/2 (d) -0.3 d What is the third smallest value in 0.02, 0.2, -5/3, 12? 0.2 Which is the second smallest value? (a) 9 (b) 1 (c) 0.01 b Which is the second smallest value? (a) -322 (b) -0.5 (c) 2 b What is the third biggest value in -0.2, -1, -0.1? -1 Which is the second biggest value? (a) -14 (b) -5 (c) -1 (d) 3/7 c What is the fourth biggest value in 1/2, -1, 18, -5? -5 Which is the third smallest value? (a) -52 (b) 0.5 (c) 0.4 (d) -126 (e) 1/3 e Which is the second biggest value? (a) -4 (b) 41/66 (c) 2 b What is the biggest value in 0.1, -3/8, 4, -178? 4 What is the second smallest value in 3/10, -3, 56, 1? 3/10 What is the second smallest value in -2/17, -3, -2/3, 12? -2/3 What is the fifth biggest value in 0.3, 2/9, -1/4, -1, -0.2? -1 What is the third biggest value in -4, 2/11, 1/6, 39/8? 1/6 Which is the smallest value? (a) 3/4 (b) -1.9 (c) -4 (d) -0.08 (e) 2 c Which is the second smallest value? (a) 1/2 (b) 3/8 (c) -33 (d) -0.5 d Which is the second biggest value? (a) -6 (b) -0.4 (c) -1/5 b What is the second biggest value in 2, 1/3, 1/4, -403? 1/3 What is the smallest value in 5, -10.8, -0.5, -0.1? -10.8 What is the second smallest value in -8, -1/3, 1/5, 3/5? -1/3 What is the fourth biggest value in -2/3, 4/9, 5/2, -2/5? -2/3 What is the fourth smallest value in -0.3, 0, 76, -0.4? 76 What is the third smallest value in -6, 0.4, -8? 0.4 Which is the biggest value? (a) -2 (b) -0.3 (c) 15 (d) 2/3 (e) 3 c Which is the second smallest value? (a) -3 (b) 33 (c) 2/5 (d) -1 d What is the second smallest value in 0, 0.1, -1.787, 4? 0 What is the third biggest value in 0.3, -4, -4/7, -40? -4 What is the second smallest value in 5, -86, -2/7? -2/7 Which is the third biggest value? (a) 41/6 (b) 2 (c) 2/11 c Which is the smallest value? (a) -4 (b) -153 (c) -3/4 b Which is the fifth biggest value? (a) -1/2 (b) -28 (c) 0.06 (d) 8 (e) -0.4 b What is the fourth biggest value in 0.08, -0.3, -2/7, 6	{ "pile_set_name": "DM Mathematics" }
etermine q(h(f)). -75f Let t(u) = 37u*2 + 381u + 291. Let g(l) = -2l2. Calculate t(g(z)). 148z*4 - 762z*2 + 291 Let f(l) = 8l + 99978. Let g(s) = 30s2. Determine f(g(x)). 240x*2 + 99978 Let p(w) = -66770w*2 - 3. Let h(k) = k. Give p(h(r)). -66770r2 - 3 Let a(g) = -g2 - 6g2 - 7g*2. Let j(t) be the first derivative of -3t*3 - 16174. Give j(a(n)). -1764n*4 Let r be (4/(-1) - (-5)/1) + 5. Let a(h) = 2h*2 + 34h. Let v(t) = -t*2 - 12t. Let b(i) = ra(i) + 17v(i). Let d(j) = 4j2 + 0j2 - j2. Give b(d(z)). -45z4 Suppose 69j - 111 = 32j. Let t(p) = -27p*2 + 54p*2 - 19p*2 + j - 3. Let y(s) = 18s. Determine y(t(k)). 144k2 Let d(i) = 118i - 9. Let w(v) = -129v. Calculate d(w(f)). -15222f - 9 Let t(o) = -45223 - 4o2 + 22612 + 3o*2 + 22611. Let v(j) = 594j. Give v(t(s)). -594s2 Let k(j) = 17j*2. Let i(l) be the third derivative of 49l*5/15 + 13l*2 + 17l + 1. Give i(k(h)). 56644h4 Let o(g) be the first derivative of 4/3g*3 + 0g + 2 + 0g2. Let t(p) = -5p*2. Calculate o(t(n)). 100n*4 Suppose 0 = -d - 10d + 187. Let b(w) = dw - 3 + 4 + 0. Let a(j) be the first derivative of 2j*3/3 - 3. Determine b(a(n)). 34n*2 + 1 Let u(h) = -205 + 99 + 106 + 57h. Let f(t) = t*2. Calculate u(f(r)). 57r*2 Let g(q) = -q. Let y be ((-849)/(3 + 0))/(-1). Let d = 41 - 39. Let u(f) = 2f*d + y - 283. Determine g(u(z)). -2z2 Let y(a) be the second derivative of a4/12 + 38a2 + 2a + 5. Let g(j) be the first derivative of y(j). Let n(l) = -365l. Give n(g(q)). -730q Let n(m) = 9m2. Let v(x) = -14x - 21x + 15x - 3 + 4 + 26x. What is v(n(i))? 54i*2 + 1 Let s(u) = 2u*2 + 3u. Let p(n) = -4n2 - 3n. Suppose 6 = -13z + 19. Let l(b) = zs(b) + p(b). Let r(t) = -7t - 10. Give l(r(q)). -98q*2 - 280q - 200 Let j(g) = -35g - 4978g*2 - 76g - 1424g2 + 110g. Let a(w) = w*2. Give j(a(m)). -6402m4 - m2 Let d(n) = -33n. Let i(f) = f2 + 9f + 2. Let v be i(-9). Let j(t) = 89tv - 42t*2 - 45t*2. Determine j(d(k)). 2178k*2 Suppose 0 = -0a + a - 4. Let k(q) = aq - 2q - q + q. Let o(d) = d + 3. Let p(j) = 2j - 29. Let i(r) = 4o(r) - p(r). Determine k(i(g)). 4g + 82 Let o(i) = 18929i*2 + 6. Let b(w) = -6w. Determine o(b(g)). 681444g2 + 6 Let z(w) = 2w*2. Let g(i) = -506935i*2 - 849i. Determine g(z(q)). -2027740q4 - 1698q*2 Let w(m) = -4878m*2 + 6. Let a(b) = 37b. Determine a(w(v)). -180486v2 + 222 Let q(c) = -17c2. Let j(p) be the third derivative of -p3/6 - 10p2 - 3. Let m(g) = 2g + 11. Let u(d) = 22j(d) + 2m(d). Give q(u(t)). -272t2 Let c(x) = x. Let h(r) be the second derivative of 7r*5/40 - 5r*4/24 + 4r*3 + 306r. Let n(w) be the second derivative of h(w). Determine c(n(q)). 21q - 5 Let p(b) = 81b - 64b - 26b. Let u(c) = -c + 220. Give p(u(h)). 9h - 1980 Let d(u) = 132u*2. Let y(a) be the first derivative of 31a*2/2 + 2367. Determine d(y(x)). 126852x2 Let b(n) be the second derivative of -n4/4 + 7n2/2 + 7061n. Let a(p) = 3 - 4 + p + 1. Determine b(a(u)). -3u2 + 7 Suppose -2y - y = -63. Let w(m) = m*3 - 57m*2 + 57m - 54. Let u be w(56). Let j(h) = 8h2 - yh*2 + 14h*u. Let s(f) = -7f. Calculate s(j(p)). -7p2 Let k(b) = 3b - 21. Let l be -3 - (-8 + (-8 - -4) + 4). Let f(u) = -2u + 15. Let i(p) = lk(p) + 7f(p). Let v(s) = s2 + 12s. What is i(v(x))? x*2 + 12x Let q(s) = -2s2. Let u(b) = -19b*2 + 511b + 5. Let c(i) = 27i2 - 768i - 6. Let h(j) = -5c(j) - 7u(j). What is h(q(g))? -8g4 - 526g*2 - 5 Let g(o) = o + 2. Let x be 132/108 - 2/9. Let p(d) = 45d - 10. Let c(f) = xp(f) + 6g(f). Let u(r) = -r. Calculate u(c(w)). -51w - 2 Let o(s) = -17s*2 - 8s - 8. Let n(a) = -3a - 4a*2 + 2a*2 - 22 + 2a + 21. Let y(z) = -24n(z) + 3o(z). Let f(t) = 3t2. Calculate f(y(k)). 27k*4 Let m(d) = 49d*2 + 16d - 8. Let f(t) = 198t2 + 60t - 30. Let o(i) = 4f(i) - 15m(i). Let r(y) = -6y2. Calculate r(o(q)). -19494q*4 Let f(n) = -2n*2. Let d(k) be the first derivative of 0k - 211/3k3 + 0k*2 + 26. What is d(f(u))? -844u*4 Let d(s) = 17s*2 - 6s + 10. Suppose 19k + 47 + 29 = 0. Let n(g) = 17g*2 - 5g + 8. Let l(c) = kd(c) + 5n(c). Let m(p) = p*2. What is l(m(r))? 17r4 - r2 Let q(j) be the third derivative of -j*5/6 + 5801j*2. Let y(r) = 8r - 3. Determine q(y(x)). -640x2 + 480x - 90 Let g = -175 + 176. Let i(c) = -12c - 9. Let x(f) = -f - 1. Let n(w) = gi(w) - 9x(w). Let o(h) = -4h*2. Determine n(o(l)). 12l*2 Let k(i) = -1673761i. Let t(m) = -32m2. Determine t(k(q)). -89647228323872q*2 Let r(u) = -14u + 3. Let o(d) = -134d + 28. Let z(t) = 3o(t) - 28r(t). Let m(c) = 548c. Determine z(m(g)). -5480g Let z(k) = -5k. Let o(n) = -8n. Let q(l) = 4o(l) - 7z(l). Let s(t) be the first derivative of 2t*3 - 10. Give s(q(i)). 54i*2 Let x(l) = -5l*2 + 8l - 16. Let f(j) = 5j2 - 6j + 12. Let d(v) = -4f(v) - 3x(v). Let c(r) = 4r2 - 11. What is d(c(u))? -80u*4 + 440u*2 - 605 Let x(a) = -5a2. Let w(i) be the third derivative of -i5/120 + i*4/4 - 33i*3/2 - 192i*2. Let u(c) be the first derivative of w(c). Calculate u(x(t)). 5t2 + 6 Let m(y) = y2. Let a(h) = 2h + 30. Let d be a(-10). Let i(j) be the second derivative of 1/3j*3 + 0 + 0j*2 + dj. What is m(i(k))? 4k2 Let w(z) = -2z*2. Let o(k) = -k - 23. Let p(a) = 14388a - 230. Let x(h) = 10o(h) - p(h). What is x(w(d))? 28796d*2 Let b(o) = 13o*2 - 4 + 17o*2 + 3 - 1 - 2o2. Let m(i) be the third derivative of -i4/6 + 19i2. Calculate b(m(z)). 448z2 - 2 Let r(v) be the first derivative of v5/30 + 43v2 - 42. Let p(t) be the second derivative of r(t). Let n(i) = -39i. Give n(p(k)). -78k2 Let g(m) = -21m*2. Let l(y) = 5y*2 + 63763. Give l(g(f)). 2205f*4 + 63763 Suppose -33y + 65 - 98 = 0. Let p(n) = -30n2 + 10n + 5. Let u(j) = 2j + 1. Let r(k) = yp(k) + 5u(k). Let m(z) = 9z*2. Calculate m(r(b)). 8100b4 Let d(j) = -j2. Let m(t) be the third derivative of -t*4/24 - 1589t*3/6 - 5t*2 + 246t - 1. What is d(m(i))? -i*2 - 3178i - 2524921 Let o(a) = 4a. Let q(u) = -43u + 36. Let h(z) = -12z + 11. Let j(f) = 7h(f) - 2q(f). What is o(j(d))? 8d + 20 Let h(t) = -3t. Let q(v) = 8736470v - 939250. Let a(g) = 1451g - 156. Let s(w) = -36125a(w) + 6q(w). Calculate s(h(i)). -4335i Let k(s) = -2s. Let l(x) = -8x*2 + 417x + 6. Let g(b) = -b*2 + b + 1. Let f(t) = -6g(t) + l(t). What is k(f(y))? 4y2 - 822y Let l(z) = 2z. Let y(v) = 69403v - 2192. Determine l(y(j)). 138806j - 4384 Let m be (-180)/126(-114 + 2). Let a(c) = -mc + 305c - 153c. Let p(b) = -b2. Give p(a(q)). -64q*2 Let j(k) = -6k*2 - 36k. Let d(h) = -2139h2. What is j(d(r))? -27451926r*4 + 77004r*2 Let r(t) = -1294t. Let j(i) be the third derivative of -i5/60 + i2 + 69i. Determine j(r(s)). -1674436s*2 Let l(s) = 7s. Let d(n) = -2n. Let q(k) = -6d(k) - 2l(k). Let z(p) = -940p - 24. Let h(i) = 2471i + 63. Let r(b) = -8h(b) - 21z(b). What is q(r(o))? 56o Let z(r) = 11133785r. Let q(u) = 25u*2. Give q(z(n)). 3099029210655625n2 Let b(r) = r2. Let y(z) = 2z2 + 16z + 51. Let i(g) = -5g2 - 36g - 103. Let p(m) = -4i(m) - 9y(m). What is b(p(c))? 4c4 - 188c*2 + 2209 Let j(y) = -3y + 4y + y. Let a(b) = b2 + 10. Let t(c) = -2. Let l(m) = -2. Let x(h) = 2l(h) + t(h). Let d(i) = 3a(i) + 5x(i). What is d(j(u))? 12u2 Let n(y) be the third derivative of y5/15 - 2y*2 + 5y - 101. Let w(b) = -b - 833. What is n(w(t))? 4t2 + 6664t + 2775556 Let x(r) = 6r. Let l(z) = 30z*2 - 47236. Calculate x(l(c)). 180c*2 - 283416 Let h(g) = 2. Let b(w) = 13w + 10. Let k(j) = -11j - 9. Let t(f) = 6b(f) + 7k(f). Let r(z) = 6h(z) + 4t(z). Let c(n) = -38n*2. What is r(c(m))? -152m*2 Let t(a) = 32643603a. Let y(k) = 32k. What is t(y(b))? 1044595296b Let h(b) = -4b2 + 4. Let l(w) = w2 + 23w + 79568. What is l(h(f))? 16f4 - 124f*2 + 79676 Let t(y) = 3y*2. Let v = -86 + 41. Let x = v - -76. Let p(r) = 17r - xr - 5r*2 + 14r. Calculate p(t(h)). -45h*4 Let b(p) = -p - 15594. Let u(k) = k + 6606. Determine u(b(d)). -d - 8988 Let p(d) =	{ "pile_set_name": "DM Mathematics" }
e units digit of j? 1 Suppose 2z = 4z - 8. Let o(l) = 8l - 3l*2 - 3l + zl2 + 1. What is the units digit of o(-6)? 7 Let i(u) = u + 1. Let d be i(3). What is the tens digit of 69/6 + (-2)/d? 1 Let s(q) = -3q*3 - 1 + q - 3q*2 + q - q + 4q*3. Let w be s(3). Suppose 5j = -4c - w + 42, -3c - 8 = -j. What is the units digit of j? 8 Let w be (-6)/(-10) + 126/15. Let p(m) = -3m - 4m - 12 + 3m2 - 4m*2 + 2m*2. What is the units digit of p(w)? 6 Let r(p) = 2p + 1. Let m be r(2). Suppose -15 = c - mx - 48, 3x - 53 = -2c. What is the tens digit of c? 2 Let j be 136/3 - (-2)/(-6). Suppose -j = -4k + 7. What is the tens digit of k? 1 What is the tens digit of 2/(-11) - (-7496)/(-176)-2? 8 Suppose -31 + 35 = k. Suppose -5r + k = -6. What is the units digit of r? 2 Let j = 46 - 29. Suppose -j + 1 = -k. Suppose -4h + 0h + k = 0. What is the units digit of h? 4 Suppose -4y = -s - s + 138, -3s = -5y - 205. Suppose 0 = 3l + 2k - 55, k - 5 = -4l + s. What is the tens digit of l? 1 Let u = 4 - -28. What is the tens digit of u? 3 Suppose -4x + 3 = -17. Suppose -xb - 13 = -73. What is the tens digit of b? 1 Suppose 0 = g + 2u - 46, 0g + 42 = g - 2u. What is the tens digit of g/(-6)(-12)/4? 2 Suppose 5v - 520 = 4d - 0d, -4d - 304 = -3v. Let c = -64 + v. What is the units digit of c? 4 Suppose 2w = -4c - 0w + 198, 4c = 3w + 183. What is the units digit of (c/(-1))/(18/(-12))? 2 Let k(g) = 2g2 - 3g - 2. Let m be (-32)/6 + (-2)/3. Let y = m - -10. What is the units digit of k(y)? 8 Let k(n) = n*2 - 2n + 2. Let m = -1 - -3. Let q be k(m). What is the units digit of q - (4/1)/(-2)? 4 Let v be (-4)/(-18) + 48/27. Let c(x) = -x*2 + x + 1. Let s be c(0). What is the units digit of (v1)/(s - 0)? 2 Let i(h) = 34h + 7 + 12 - 19. What is the tens digit of i(1)? 3 Suppose z - 6z = 0. Let w(y) = -y3 + y2 + y + 38. What is the tens digit of w(z)? 3 Let n be 5 + (-1 - -1) + -3. Suppose -3v - x + 69 = nx, 0 = -x - 5. What is the units digit of v? 8 Let k(r) = r*3 + 8r*2 + 6. Let g be k(-8). Let x be (-2 - -19) + (0 - 2). What is the units digit of 5/x - (-52)/g? 9 Let i be 25/28/10. Let v(a) = -a*2 - 8a + 2. Let b be v(-9). Let d = b + i. What is the units digit of d? 3 Let j(r) = -1 - 3 - r + 1 + 6. What is the units digit of j(-3)? 6 Let k(s) = -s*3 + 3s*2 + 2s - 2. Let j be k(3). Suppose 0 = -4w - jq + 212, 4w - 5q - 41 = 3w. What is the units digit of w? 1 Let v(l) = l2 + 3l3 + l - l2. Let p be v(1). Suppose -p - 9 = -b. What is the tens digit of b? 1 Let t be 49 + (3 - 8/2). Suppose -22 = -5x + t. What is the units digit of x? 4 Let f(s) = -2s3 + s2 + 3s + 2. Let y be f(-2). Suppose -3 - 5 = 4x. Let i = x + y. What is the tens digit of i? 1 Let t = 23 + -4. What is the units digit of t? 9 Suppose -r + 3l - 4 = 0, -5r - 2l + 1 = -4r. Let q = r + 6. What is the units digit of q? 5 Let f = -33 + 54. What is the units digit of f + 6/((-6)/(-3))? 4 What is the units digit of (-2)/((-3)/72 - 0)? 8 Let o = 2 - 1. What is the tens digit of 2o - (-2 + -9)? 1 Let c = -11 + 27. Suppose -5g - c = -g. Let d = -2 - g. What is the units digit of d? 2 What is the tens digit of 18/(-12) + 1 + (-203)/(-2)? 0 Suppose r - 156 + 9 = 0. What is the units digit of r? 7 Suppose 0 = r - q - 20, 5q - 3q = 3r - 57. What is the units digit of r? 7 Let k(s) = 2s2 + s. Let l be k(1). Let m(d) = -7 - d3 - 3d2 + 2d + 8d2 + 0dl. What is the units digit of m(5)? 3 Let q(l) be the third derivative of l5/60 + l4/24 - l3/6 + 2l2. What is the units digit of q(1)? 1 What is the units digit of (-1)/(-1)(-6 - -33)? 7 What is the units digit of (-339)/(-12) + 3/4? 9 What is the tens digit of -78(26/(-4) + 5)? 1 Let z(s) = s3 + 5s*2 - 6s - 1. Let p be z(-6). Let r be 2 + (2 - (16 + p)). What is the units digit of (-3)/1 - (4 + r)? 4 Let k be (1 + -2)/(3/21). Let t = k - -4. What is the units digit of t/1 + 3 + 3? 3 Suppose 2x + 2x - 3l = 42, 4l = 5x - 52. Let y = 4 + x. Suppose 0 = 2d + 2u - y, 9 = 2d + u - 5. What is the units digit of d? 6 Let d(y) = 2y - 16. Let u be d(10). Suppose 16 = -up + 176. What is the tens digit of p? 4 Let n(f) = -f + 13. Let c be n(10). Suppose 0 = -cu + 17 + 34. What is the units digit of u? 7 Let g be (20/12)/((-2)/(-6)). Suppose -2x + x + 2 = 0. Suppose -8 = -w - o, -3w - xw - 10 = -go. What is the units digit of w? 3 Let z be (75/(-9))/((-4)/12). Suppose 45 = 2w - z. What is the tens digit of w? 3 Suppose -5t - 5d + 40 = 0, 5t - 10 = 4d + 3. Suppose t = 4w + w. What is the units digit of w? 1 Let x(v) = 184v - 2. What is the hundreds digit of x(1)? 1 Suppose -9q + 15 = -6q. What is the units digit of q? 5 Suppose 0r = 3r - 2l - 58, -2l = -2. What is the units digit of r? 0 Suppose -2x + 0a + 3a = -263, -3a - 644 = -5x. Suppose 2v = -3f - 44 - 5, -5v - 3f - x = 0. What is the tens digit of (5/(-10))/(1/v)? 1 Let x(o) be the third derivative of o4/6 - o3/2 + 2o*2. What is the units digit of x(3)? 9 Let d(u) = -u + 8. Let g be d(5). Suppose -gl = -5a + 7, -3l + 1 = -a - 0. Suppose -y + 4w = -20, -ay - 2y + 36 = -5w. What is the units digit of y? 4 Let h be ((-200)/32)/((-1)/(-4)). Let x = h - -42. What is the units digit of x? 7 Let l = 74 - 5. What is the units digit of l? 9 What is the tens digit of (4 - 5)(-32 - 2)? 3 Let q(f) = f2 + 2f - 2. Let w be q(-4). Let g = 19 - w. What is the tens digit of g? 1 Let p(a) = 4a - 3a - a - a. Let g be p(-1). Suppose 6v - 3j = 2v - 2, 2j + g = 5v. What is the units digit of v? 1 What is the units digit of (-1)/(0 - 3/21)? 7 Suppose -2f + 3 = -17. Let z = 27 - 26. Suppose y - f = z. What is the units digit of y? 1 Suppose v + 5v = 924. What is the units digit of v? 4 Suppose 79 = 5d + 29. Suppose -2b = -0b. Suppose -4t - 2m + d = -24, 4t + 3m - 33 = b. What is the units digit of t? 9 Let y = 16 + -25. Let h = 17 + y. What is the units digit of h? 8 Let f = 0 - -3. Let p be 4(10/(-8) + f). Let q = p - 5. What is the units digit of q? 2 Let l = -18 + 23. Suppose li = 2t - 63, 0t + 2t + 5i = 73. What is the tens digit of t? 3 Suppose -2d - 2n = -n - 38, -d = 2n - 16. Let s be 24/d(-5)/(-1). What is the tens digit of (8/s)/((-2)/(-15))? 1 Let g(d) = -d*3 + 4d*2 - 4. Let t be 4/218/12. Let y be g(t). Suppose -yh = 2w - 110, -h - 22 = -2h + 2w. What is the units digit of h? 2 Let k(v) = -3v - 16. What is the units digit of k(-11)? 7 Let j = -6 - -6. Let l = 9 - 7. Suppose l + j = d. What is the units digit of d? 2 Let l(u) = u3 + u2 + 3. Let w be l(0). Suppose 0 = -wo + 16 + 2. What is the units digit of o? 6 Let d = 203 - 111. Suppose -c = c - d. What is the tens digit of c? 4 Let n = -11 + 45. What is the tens digit of n? 3 Suppose -3c + 6 = -c. Suppose -l = -d + c, 4d + 2l - 8 = 5l. Let g(n) = -4n3 - 2n*2 - 2n - 1. What is the units digit of g(d)? 3 Let d(f) = -5f2 + 1. Let o(t) = -15t*2 + t + 2. Let n(u) = 8d(u) - 3o(u). Let r be n(3). What is the units digit of (-8)/(-12) + r/6? 7 Let l = -8 + 11. Suppose 10 = 4b + 2d, -d = b - 0d - l. Suppose -r = -br + 21. What is the units digit of r? 1 Suppose -5t + 0p + p = -485, -2p + 182 = 2t. What is the tens digit of t? 9 Let l(h) = -9h - 1. Let w be l(1). Let o = w + -4. Let t = -5 - o. What is the units digit of t? 9 Let g = -1 + -1. Let m be g + 56/3. Suppose -4d = -2d - m. What is the units digit of d? 4 Let s(w) = w3 - 12w*2 + 12w - 8. Let g be s(11). Suppose gk = -1 + 4. Let p(l) = 18l - 1. What is the units digit of p(k)? 7 What is the tens digit of (-3)/12 + (-891)/(-12)? 7 Let f(d) = -d*2 - 8d - 1. Let v be f(-8). What is the units digit of (-1)/v - 0/6? 1 Let a be 14/2 + (3 - 4). Suppose -2o = -ao - 60. What is the units digit of 117/15 + (-3)/o? 8 Let f(p) = 69p. Let r be f(1). Suppose j - r = -2j. What is the tens digit of j? 2 Suppose 4m - 8 = 0, r - 3m - 1 = -3. What is the units digit of (-1)/((8/(-10))/r)? 5 Let t be 122(-4)/2. Let j be (-2)/(-2 + t/(-26)). Suppose 2h - j = -3. What is the units digit of h? 5 Suppose 5c + 4 - 22 = -4g, -c - 8 = -5g. Let p be c/(-6) + (-14)/3. What is the units digit of 2/p +	{ "pile_set_name": "DM Mathematics" }
)/((-6)/(-9)). Let i be -2 + ((-2)/z - (-474)/66). Find the second derivative of -4bi + 21b*5 - 4b + 7b wrt b. 340b*3 Let v(h) be the second derivative of 223/12h*4 + 2 + 0h*3 + 24h + 167/20h5 + 0h*2. What is the third derivative of v(p) wrt p? 1002 Let z be (0 - 1)(2 - 29). Suppose 4p - 14 - 33 = -w, 2w = 3p - z. Differentiate -18 + pi*3 + 2 - 3 with respect to i. 33i*2 Let c(a) = 3a*2 + 2a + 1. Let d be c(2). What is the second derivative of -n + 15n3 + 54n*3 - dn3 - n3 wrt n? 306n Suppose 2262 = 2d + 2254. Let s(n) be the first derivative of -12 - 5/2nd + 0n*3 - 11/2n*2 + 0n. Find the second derivative of s(l) wrt l. -60l Let u(s) = 14s + 1. Let n be u(-2). Let j be 1/(1 + n/30). Find the third derivative of 10f4 - 4f*5 - 3f*2 - jf*4 wrt f. -240f*2 What is the second derivative of -442q*2 - 253q*2 + 495q - 322q2 - 175q*2 wrt q? -2384 Let c(f) = 6674f*3 + 4f*2 + 14f + 132. Let n(s) = -6671s3 - 5s*2 - 14s - 132. Let o(y) = -5c(y) - 4n(y). Find the second derivative of o(d) wrt d. -40116d Let t(g) = -1338g*2 + 1524g + 1. Let m(s) = -5s + 1. Let d(j) = -m(j) + t(j). Find the second derivative of d(v) wrt v. -2676 Let x(h) = h3 + 8h*2 - 22h + 10. Let a be x(-10). What is the third derivative of ac3 - 13c*3 + 115c*2 + 0c*3 wrt c? 102 What is the third derivative of -78k*4 + 90k*2 - 1242k*4 + 83k*2 wrt k? -31680k Suppose v - 5z + 4 = 0, -4v + 2z = -49 + 11. Let u(r) be the first derivative of -42 - vr + 41/2r2. Differentiate u(k) wrt k. 41 Differentiate -244 + 689c*2 - 292 - 291 - 217 with respect to c. 1378c Find the first derivative of -941q3 - 6594 + q4 + 584q + 536q - 1120q wrt q. 4q3 - 2823q*2 Let j = -73 - -157. Find the third derivative of -jq*2 - 83q*2 - 22q*4 - 2q*3 + 196q*2 wrt q. -528q - 12 Let y(r) be the third derivative of 97r7/35 - 67r*3/6 - 655r*2. What is the first derivative of y(x) wrt x? 2328x*3 Let f(y) be the third derivative of -1429y6/60 - y5/60 - 247y4/3 - 2008y*2. Find the second derivative of f(k) wrt k. -17148k - 2 Let y(v) be the third derivative of 901v5/60 - 33v*3/2 - 46v*2 + 5. What is the first derivative of y(l) wrt l? 1802l Let z(t) = -t + 17. Let k be z(15). What is the third derivative of 121yk - 302y*2 - 38y*6 + 140y*2 wrt y? -4560y*3 Let i(z) be the third derivative of 397z*4/4 + 587z3/6 + z2 - 114. What is the derivative of i(b) wrt b? 2382 Let x(v) be the second derivative of 789v5/5 + 249v*4 + 72v - 15. Find the third derivative of x(u) wrt u. 18936 Suppose 4g + g - 2 = 4x, -g = 5x - 12. Find the second derivative of -2y*2 + 3y*x + 32y*3 + 14y*3 + 12y*3 - 14y wrt y. 348y + 2 Let v(l) be the first derivative of 1/3l*6 + 23l*4 - 150 + 0l + 0l5 + 9l*2 + 0l*3. What is the second derivative of v(m) wrt m? 40m*3 + 552m Differentiate 4f4 - 1454 + 126f - 34f - 36f wrt f. 16f3 + 56 Let w be (0 + (-478)/8)/(30/(-2040)). Suppose 5f - w = -3o, 4o - 6f - 5389 = -7f. Differentiate 62 + 1390p - 15 - op wrt p. 44 What is the first derivative of 56g + 4g*2 - 789g - 2140 - 5g2 - 134 - 723g wrt g? -2g - 1456 Suppose 4a + 163 = 3k, -2k = 2k + 2a - 210. What is the third derivative of -11l6 + l3 + 166l*2 - 167l2 - l3 + k - l*4 wrt l? -1320l*3 - 24l Let x(q) = 528q + 1264. Let y(k) = 549k + 1263. Let i(s) = 5x(s) - 4y(s). What is the first derivative of i(w) wrt w? 444 Suppose 778 - 3 = 25w. Find the third derivative of -5r*2 - wr*4 + 10r*2 - 3r*2 - 7r*2 + 6 - 31r*4 wrt r. -1488r Let d(k) be the second derivative of -325k7/21 + k6/15 + 5k*4/12 + 195k*2/2 - 214k + 2. Find the third derivative of d(o) wrt o. -39000o2 + 48o Let n(c) be the second derivative of -c*6/15 + 243c5/10 - c4/12 - 166c3/3 - 2c*2 - 959c. Find the third derivative of n(i) wrt i. -48i + 2916 Let j be (-230)/(-30) - (-5)/(-3). What is the third derivative of -21 + 60a*4 - 61a4 - a2 + 2aj + 108 wrt a? 240a*3 - 24a Let g(s) be the third derivative of -44s7/105 - s6/120 + 2275s*4/24 - 5s*2 + 28s. What is the second derivative of g(w) wrt w? -1056w2 - 6w Let h be (-1 - (-6)/(-2))/(3 + -4). Suppose -4i + 68 = -hq, 3q = 3i + 5q - 36. What is the derivative of -15 - ir - 2r + 36 - 51 wrt r? -16 Suppose 127g - 134g + 14 = 0. Differentiate 0s + 116s - 7 - g + 3 - 3 wrt s. 116 Find the first derivative of -24 - 37t*2 + 289 + 202 - 4t wrt t. -74t - 4 Differentiate 74r + 41 - 273r - 284r - 210 - 111 wrt r. -483 What is the second derivative of -266d5 + 6d*4 - 6d*4 - 343d - 667d5 - 1352d wrt d? -18660d3 Let f(h) be the third derivative of -1063h*5/60 + 337h*3/6 - 1081h*2. Differentiate f(i) wrt i. -2126i What is the second derivative of 1091l2 + 645l*2 + 4192 + 2l + 157l2 - 72l*2 wrt l? 3642 Let s(g) = -3012g*3 - 4g*2 + 8g - 3004. Let o(v) = 6022v3 + 9v*2 - 18v + 6008. Let f(u) = 4o(u) + 9s(u). Differentiate f(w) wrt w. -9060w2 Suppose 3l - 26 = -x, -8l + 5x - 18 = -9l. Suppose -3y = -ly + 125. What is the first derivative of 6c*2 - 14 - 5 + y wrt c? 12c Let z be ((-24)/(-15))/(8/20). Differentiate 129k4 + 61k*z - 63k*4 - 101 wrt k. 508k*3 Let d(w) = -12053w*2 - 7849w + 128. Let f(c) = 12057c2 + 7850c - 160. Let l(y) = 5d(y) + 4f(y). Find the second derivative of l(p) wrt p. -24074 Suppose 44 + 53 = -5f - y, 3f - 4y = -72. Let s be (-9)/12 - 495/f. Differentiate sp - 10p - 6 - 3p wrt p. 11 Let o(u) = 3183u5 + 18u*2 - 3712u. Let f(x) = -15915x5 - 98x*2 + 18560x. Let n(h) = -2f(h) - 11o(h). Find the second derivative of n(j) wrt j. -63660j3 - 4 What is the third derivative of -108d*2 + 5 + 208d*2 - 40 - 842d*3 - 3 - 103d*2 wrt d? -5052 Let i(o) be the third derivative of 0o - 4 + 13/24o4 - 31o*2 - 1/60o*5 - 34o*3. What is the derivative of i(f) wrt f? -2f + 13 Let w(n) = n*2 - 13n - 38. Let h be w(-36). Find the first derivative of h - 6v - 838 - 791 + 4v*2 wrt v. 8v - 6 Find the second derivative of 10107j + 10756j - 2527j2 - 18953j wrt j. -5054 Let l(i) be the second derivative of -40i8/7 - 209i*4/6 + 262i - 1. Find the third derivative of l(x) wrt x. -38400x3 Let t(d) be the third derivative of d5/30 - 269d*4/6 + 761d*3/2 - 11438d*2. Find the first derivative of t(z) wrt z. 4z - 1076 Suppose -24 = -15s + 3s. What is the second derivative of -240m4 + 174m + 3m2 - 852 - 3m*s + 854 - 464m wrt m? -2880m2 Differentiate -2b*3 - 2598 + 1293 + 1297 - 339b*4 wrt b. -1356b*3 - 6b*2 Find the first derivative of 40 + 254 + 46b4 + 190 - b4 - 153 + 6b wrt b. 180b*3 + 6 Let m(c) be the third derivative of -1/105c*7 - 4c*2 + 0 + 4/3c*3 - 5c - 1/60c5 + 1/4c*4 + 0c*6. What is the second derivative of m(v) wrt v? -24v2 - 2 Let w(l) be the second derivative of -l7/42 + 21l5/10 - 346l*3/3 - 1236l. Find the second derivative of w(t) wrt t. -20t3 + 252t Differentiate -78g + 5197 + 2610 + 52g + 18g3 wrt g. 54g*2 - 26 Suppose -31l = -30l - 5. Find the third derivative of -40m*2 + 265m*l - 262m*5 - 2m*6 + 9m*6 wrt m. 840m*3 + 180m*2 Let g(d) be the second derivative of 4d - 58d2 - 1/6d*3 - 17/12d*4 + 1. What is the first derivative of g(r) wrt r? -34r - 1 Suppose 2q - 3r = 3q - 12, 0 = q - 5r + 4. What is the third derivative of 65p2 - 29p*6 - qp*3 - 8p*3 + 14p*3 wrt p? -3480p*3 Let s(n) be the second derivative of -1/6n*3 - 2 - 5n - 2n2 - 21/2n*4. Find the second derivative of s(o) wrt o. -252 Let q(n) be the third derivative of 6719n6/120 - n5/30 - n4/12 + n3/3 + 29n2 + 65n. Find the third derivative of q(u) wrt u. 40314 Let b(s) be the second derivative of -395s7/42 + s6/10 + 223s4/4 + s3/6 + 3s2/2 + 305s - 1. Find the third derivative of b(o) wrt o. -23700o2 + 72o Suppose 112 = 46l - 39l. Find the second derivative of -lp + 2p*3 + 2 - 7p - 16p5 + 13p wrt p. -320p3 + 12p Let a(q) = -2174q - 418. Let w(v) = 2175v + 457. Let o	{ "pile_set_name": "DM Mathematics" }
-14.031257 What is 46.6923 plus 0.2? 46.8923 Add 384.63 and 3. 387.63 What is -44.2 minus -2? -42.2 Put together -105.6 and -0.062. -105.662 Add together -0.14748 and -0.01. -0.15748 Calculate -0.000572 + -29. -29.000572 What is 0 + -278? -278 What is -198 take away 76? -274 Subtract 6 from -571. -577 Calculate 0.2074 - 91. -90.7926 -0.3 - 309998 -309998.3 4676+-2 4674 Calculate 19.62 + 0.095. 19.715 What is -344 less than -0.16? 343.84 What is the distance between 25502518 and -1? 25502519 Calculate 362.4 + 0.28. 362.68 Work out -5 + -2452454. -2452459 What is 0.1 minus 28.9? -28.8 Add -3.2 and 45. 41.8 What is 23 minus 0.27? 22.73 Put together -0.4 and -1133. -1133.4 What is 37 minus 13329? -13292 What is 56.1 take away 0.06? 56.04 Work out 9 + -422.9. -413.9 Calculate 83.3 - 14. 69.3 Work out -15 - -0.0311. -14.9689 Subtract 95667 from 0.16. -95666.84 Put together 31 and -0.4. 30.6 Work out 97.9 - 792. -694.1 What is 1.12 less than -4? -5.12 Work out -9 + -138826. -138835 Total of -126 and -35189. -35315 What is -1.3743 minus -521? 519.6257 What is 5 + 26025? 26030 4.28 - -309 313.28 What is 6.2 plus 845? 851.2 Total of 1.929 and -0.13. 1.799 What is 190722 plus 0.2? 190722.2 Subtract 25.38 from -286. -311.38 Add together 0.1 and -3598. -3597.9 Calculate 0.283467 - 0.4. -0.116533 What is -43 less than 755? 798 Add together -2.1 and 67. 64.9 Calculate 2.6 + -15960. -15957.4 Work out 5 - -0.66461. 5.66461 Calculate -0.02 + -214.22. -214.24 0.3 + -346245 -346244.7 What is 7759 - -14? 7773 What is the difference between -92.59 and -0.017? 92.573 -9+-96665 -96674 What is -24.021 take away 4? -28.021 Total of -81 and 0.055. -80.945 Add together -648 and 4.98. -643.02 Calculate 27.476 - 14.5. 12.976 Calculate 3.02 - -0.07. 3.09 Total of -4 and -708. -712 What is 0.23 plus -1065? -1064.77 What is 5 + -0.881? 4.119 Total of 1.9 and -461. -459.1 What is 5 plus 45? 50 Calculate -0.2 - 0.93. -1.13 Calculate 5 - -39091. 39096 Put together 5 and -744. -739 Sum -14.94 and 0.09. -14.85 What is 0 + 15649? 15649 Sum 222 and 11.44. 233.44 What is -8.6554 minus 2? -10.6554 Total of -0.037 and -2.1. -2.137 Subtract -70086 from -1. 70085 5 - -108004 108009 What is the distance between 0.428 and -0.42? 0.848 17877 + -0.3 17876.7 What is 1072 plus -4232? -3160 Work out 0.2 + 954561. 954561.2 Sum -21 and 156. 135 Calculate -1 + -0.531. -1.531 What is -6.9 plus 0.3? -6.6 What is 2.4 less than 34.4? 32 1374199+0.4 1374199.4 What is -167979 - 1? -167980 -1.8 + -13.5137 -15.3137 Work out 1499.8 + -29. 1470.8 Add -78638 and -0.8. -78638.8 Sum 4061 and 0.02. 4061.02 What is -1 minus 17137? -17138 Put together -2532383 and 2. -2532381 What is -4 minus 804836? -804840 Work out -0.17 + -0.3. -0.47 0.34 + -59.2 -58.86 Subtract -0.12 from -74.18. -74.06 What is 0.053 + 0.2569? 0.3099 What is 0.148 - -55? 55.148 Work out 28599 - 31. 28568 3 - -335.066 338.066 -0.4 - 613 -613.4 Calculate 899711 + -0.5. 899710.5 Calculate 0.4 - 594.937. -594.537 2027 + -6 2021 Sum -814 and 1070. 256 Add 3443 and 0.1. 3443.1 What is 4900 + -919? 3981 What is 0.2 minus 5081? -5080.8 15+0.024 15.024 What is 1 minus 3.939? -2.939 2 - -37415 37417 What is the distance between -21.1 and -0.3946? 20.7054 -841 + -284 -1125 What is -202 less than -0.137? 201.863 Sum 0 and 4349. 4349 What is 3 less than -0.29? -3.29 What is 12691 plus -109? 12582 Add together -7727 and -4. -7731 Put together -12729 and -0.3. -12729.3 What is -366 minus -7.21? -358.79 Total of -138 and 20817. 20679 Add together 2 and 2794. 2796 Sum 0.4 and 73.8. 74.2 What is 5 take away 65? -60 Total of 768 and -1.11. 766.89 What is the difference between -23 and 20? 43 Work out -488 + 72. -416 110 + 0.0618 110.0618 -1+-0.0984 -1.0984 What is -17 plus 0.4? -16.6 Calculate -0.23 - 60. -60.23 Add 0.4 and -0.40144. -0.00144 What is 11 - 0.237? 10.763 What is the distance between 0.063 and -3.39? 3.453 Put together -44 and 0.045. -43.955 What is -3 minus -0.3566? -2.6434 Put together 6.57 and 185.3. 191.87 What is -0.5 - -0.034372? -0.465628 What is -596 plus 9? -587 Subtract -2 from -93570. -93568 What is the distance between 1.5 and 0? 1.5 What is 0.076 - -3.15? 3.226 What is 0.022 take away -1.15? 1.172 What is 0.47061 + 0.8? 1.27061 What is 53112 minus -0.055? 53112.055 314 + 104 418 What is the difference between -1 and -18238? 18237 What is the difference between 8 and -203.5? 211.5 135238 + 11 135249 Total of -1048 and 4. -1044 Add -923 and -0.2. -923.2 -0.2+-3824 -3824.2 What is 0.3 plus -14329? -14328.7 0.1637 - -4 4.1637 Calculate -1986 - 5. -1991 What is -21 minus 0.9098? -21.9098 Total of -17 and -450. -467 9 - -2.683 11.683 Add 0.4 and -26.91. -26.51 -795 + -0.21 -795.21 What is -6.36 - -0.009? -6.351 What is 2.3903 plus -0.06? 2.3303 What is 314627 less than -2? -314629 What is 2 plus 0.02514? 2.02514 Total of 0 and -0.215965. -0.215965 Put together 784 and 5. 789 What is 8 take away -106? 114 Add -45 and -0.0373. -45.0373 Add together 1 and -30. -29 Work out 4.67 - -0.335. 5.005 Subtract -123.5 from -0.142. 123.358 What is 2240 plus -2.2? 2237.8 What is the distance between 4 and -13839? 13843 Work out -0.4 - -387180. 387179.6 Subtract 67 from -22.43. -89.43 What is the distance between -0.3 and -57.67? 57.37 -0.3+668 667.7 Subtract 819 from -0.1. -819.1 Total of 30 and 0.01. 30.01 Work out 5 + -37.58. -32.58 Total of 0.133084 and 1.4. 1.533084 0.4 + 183 183.4 Sum -0.22 and 483. 482.78 Sum -11 and 89561. 89550 What is 54 plus -27649? -27595 What is 0.01967 - 0.08? -0.06033 What is 209.24 minus -3? 212.24 What is 0.2 take away 28808.4? -28808.2 Calculate -30 - 9.8. -39.8 Work out 9.2 - 1206. -1196.8 Put together -0.14 and 0.157. 0.017 Sum 115.9 and -4. 111.9 Work out -0.03 - -496. 495.97 What is -169 plus -14? -183 What is -2 less than -11.9? -9.9 What is 176 less than -9616? -9792 Calculate -16 - 88. -104 Calculate 0.5 + -154455. -154454.5 Calculate 6821 - -8. 6829 Add together 0.2 and -0.0250965. 0.1749035 What is 2348 - 0.4? 2347.6 Work out 186301 + 4. 186305 807 + 2 809 Put together -4 and 0.084289. -3.915711 What is 0.1 - 0.541? -0.441 Work out -3 - 3.72408. -6.72408 What is -0.220602 - -6? 5.779398 -0.588+4 3.412 Put together 548 and 5020. 5568 What is -40 less than 5296? 5336 -0.01 - 14110 -14110.01 What is -0.07 - 227? -227.07 What is 1 + -0.1002? 0.8998 32 - -49 81 -0.1392+4 3.8608 What is -44.23 + 0.4? -43.83 What is -6.54 take away -0.016? -6.524 Put together 146980 and 0.2. 146980.2 What is 1588 plus 7? 1595 What is -1.87 - 0.493? -2.363 Work out -115 + -0.07. -115.07 Subtract 4 from -3022.844. -3026.844 Work out -304 - -0.43. -303.57 Add together 0.3 and 0.26101. 0.56101 What is 8.073 - -0.1582? 8.2312 Sum -0.1032 and -8. -8.1032 3 + -2230 -2227 Put together 109 and 2.1. 111.1 What is 0.027713 plus -30.7? -30.672287 Work out -16185 + 478. -15707 -1.3+15.5 14.2 What is 10 minus 20.20765? -10.20765 What is -32 minus 9198? -9230 Put together -24334.2 and -5. -24339.2 Put together 2 and -0.76. 1.24 Work out 1010 + 0.054. 1010.054 Subtract 353.1 from -0.2. -353.3 -15 + 14 -1 Calculate -15972 - -0.4. -15971.6 Calculate 154 - -14.3. 168.3 What is the distance between 38.6 and -0.29? 38.89 What is the difference between -16 and -1157? 1141 Total of 2140 and -0.0413. 2139.9587 Calculate 2 - 2363. -2361 Calculate -45 + 0.17. -44.83 Add -408 and -6. -414 What is the difference between -3 and -23493? 23490 What is the difference between 207 and 0.922? 206.078 What is 0.2 take away 2725063? -2725062.8 What is the distance between -62 and 0.7? 62.7 What is the difference between 1451 and -7896? 9347 Add 62642 and 0.1. 62642.1 1757 - 0.3 1756.7 Work out -0.2 + -2569. -2569.2 130.61 - -47 177.61 Add 1 and -21.6. -20.6 Sum -0.27 and 1560. 1559.73 What is the difference between -0.3 and -61291? 61290.7 0.3 - 2076520 -2076519.7 Put together 2.6 and 489.78. 492.38 Add -4.82 and -8094. -8098.82 What is 20 - 707? -687 What is 0.118 less than 981? 980.882 1.4 - -1338 1339.4 Add together -1369 and 490. -879 210939 + 1.3 210940.3 Add together 0.0067537 and 0.12. 0.1267537 What is -105950 minus -0.2? -105949.8 -12 - 8705 -8717 Work out 10 + -5.3. 4.7 -3912.3+-0.3 -3912.6 What is 72905 take away -0.1? 72905.1 What is -39 + -140.8? -179.8	{ "pile_set_name": "DM Mathematics" }
n decreasing order. 5, y, 1 Let n be 4 + -4 - 6/(-5). Sort n, -2/5, 2 in decreasing order. 2, n, -2/5 Let f(j) = j - 7. Let n be f(9). Suppose -h + 9 = nh. Suppose -hm - 4s + 6 = 0, 2m + 3s = 4m + 13. Sort 2, -1, m in ascending order. m, -1, 2 Let n = -1 + 0.4. Let g = -0.2 - n. Let t be (-15)/28 - (-2)/8. Sort 1, t, g. t, g, 1 Suppose 2u = 2 - 10. Let z be 8/(-45) + u/18. Put z, 0.2, -3 in increasing order. -3, z, 0.2 Let j = 4 - 1. Suppose -5z + jh + 6 = 0, z - 4z + 4h = 3. Suppose 3w + 12 - 5 = 5f, zf = 2w + 5. Put f, -5, 3 in decreasing order. 3, f, -5 Let v be (4/(-6) + 1)9. Put -3, v, 5 in ascending order. -3, v, 5 Let x = -8 + 16. Let y = x + -4. Put -4, -5, y in decreasing order. y, -4, -5 Let t = 2.94 + 0.06. Put 1, -5, t in increasing order. -5, 1, t Let i = 461.3 - 424. Let s = -31 + i. Let v = s - 6. Sort v, 2, -4 in decreasing order. 2, v, -4 Suppose 2r - 4r = 4i - 4, -7 = -r + 3i. Suppose 0 = -b - 3b - r. Sort b, 0.5, -3 in decreasing order. 0.5, b, -3 Let p = -0.36 - -0.06. Let y be 6/15 + 21/(-35). Let q = 0 - 3. Sort q, y, p in descending order. y, p, q Let h be (6/4)/(3/(-6)). Let j = -2.4 + 3.4. Put j, h, 6 in decreasing order. 6, j, h Let z(b) = b + 1. Let a be z(5). Put 1, a, 0 in decreasing order. a, 1, 0 Let m = 1 - -1. Suppose s - 2 = -1. Let g be ((s - m)/1)/(-1). Put g, -2, 5 in descending order. 5, g, -2 Let m = -73 + 73.05. Put 1, m, 1/3, -3 in decreasing order. 1, 1/3, m, -3 Let u be (4 - 3) + (-7 - -2). Let l be 1/u - 2/(-8). Suppose lb = 2b. Put b, 5, -5 in ascending order. -5, b, 5 Let x = 0.9 + -2.9. Let v = 1 + -2. Let b = -1.3 - v. Put b, x, 0.5 in decreasing order. 0.5, b, x Suppose 4k - 5 = -k. Suppose -y = -k - 1. Let m(p) = p*3 - 3p*2 + 4p - 2. Let s be m(y). Sort 0, 4, s. 0, s, 4 Let w = -3 + 2. Let j be (-51/1)/w. Suppose 0 = -4t - 3c + 4c - 8, c = -2t + 2. Sort t, 2, j in descending order. j, 2, t Let u(h) = 3h - 1. Let s be u(-1). Sort -12, s, 3 in increasing order. -12, s, 3 Let k be (-51)/(-12) - 1/4. Suppose 5i - ki = 5. Suppose 2o + o - 9 = 0. Sort 2, o, i in decreasing order. i, o, 2 Let h = -16.76 + -0.24. Let j = h - -16.8. Let u = 0 + 0.4. Put -4, j, u in decreasing order. u, j, -4 Suppose 4b + 25 - 1 = 0. Let m be (b/4)/((-15)/20). Suppose -4i - mx - 2 = 0, -4x + 23 = 4i - 5i. Sort 4, i, 3. i, 3, 4 Let u be ((-5)/2)/5(0 + 0). Sort u, -0.1, -0.3, 0.2 in descending order. 0.2, u, -0.1, -0.3 Let h(f) = -f*2 + 6f + 3. Let k be h(6). Let w = 3 - 4. Let y be ((-1)/3)/((-5)/(-30)). Put y, k, w in increasing order. y, w, k Let o = -30 + 27. Let s = -43/78 - -2/39. Sort 1/2, o, s. o, s, 1/2 Let h = 5 + -10. Let u = h - -5.2. Let o = 3.6 - 0.6. Sort u, 2, o in decreasing order. o, 2, u Suppose 10k - 22 - 8 = 0. Sort 18, 1, -3, k in descending order. 18, k, 1, -3 Let q = 7 - 11. Let h(w) = -w2 + 19w + 25. Let a be h(20). Sort a, -8, q in ascending order. -8, q, a Let p = -0.2 + 0.7. Let t = -12 + 27. Suppose -5n - 5h = t, -3n = -2n - h + 7. Put p, 0.1, n in ascending order. n, 0.1, p Let l be (-2)/(-10) + (-18)/15. Suppose -5t = 5r - 79 - 11, 0 = 2r - 5t - 50. Suppose f - 3k = 2k + 10, 0 = f + 5k + r. Sort -4, f, l. f, -4, l Let m = -6.82 + -0.18. Let b = -7.1 - m. Sort b, -1, -3 in decreasing order. b, -1, -3 Suppose 4d = -j - 26, 5j + 2d + 55 = 7d. Sort 1, 5, j in increasing order. j, 1, 5 Let t(q) be the second derivative of -q5/20 - q4/6 - q2 - 2q. Let s be t(-3). Suppose -2w - 3k = -10, 4w - s = -2k - 3. Sort -2, w, 2. -2, w, 2 Suppose 5 = n + 5v, v + 3 = n + 4. Suppose 5z + 0z - 25 = n. Suppose -x + 5x + 5f - 6 = 0, 0 = zx + 5f - 10. Sort 0.2, x, 0.3. 0.2, 0.3, x Suppose 5o - 18 = 4n, 0n - n - 6 = -2o. Sort 0, n, -3. -3, n, 0 Let y(a) = a3 - 5a*2 + 4a + 1. Let x be y(3). Suppose -9 = -r - 5t, 2r + 0t + 4t = 12. Let j = 13.5 - 13. Sort x, j, r in descending order. r, j, x Let m = -0.4 + 0.3. Suppose 3q = -a + 4 + 4, 0 = -4a - 4. Put q, m, -4 in descending order. q, m, -4 Let x = 1/6 + 1/6. Suppose -h - 1 = 1. Put x, -0.2, h in descending order. x, -0.2, h Let g = -3 - -6. Suppose -a - 1 = -gv - 0a, 2v + 2 = -2a. Let y = 1.3 - 0.3. Put v, y, -2 in decreasing order. y, v, -2 Let s = 1.4 + 2.6. Put 5, s, 1 in decreasing order. 5, s, 1 Suppose -5x = -0x + 15, 3k + x = 9. Suppose -kj = -j - 9. Let r = -0.2 - -0.2. Put j, -0.3, r in descending order. j, r, -0.3 Suppose -g + 5a = 42, -93 = 5g - 4a + 54. Put g, -5, -1 in ascending order. g, -5, -1 Suppose -2 = a + 5n - 4, 5a - 10 = -n. Suppose -4t - 27 = -3z, 2t + 0z - 4 = -az. Put t, 5, 0 in ascending order. t, 0, 5 Let n(r) = r*3 - 7r*2 + 5r + 6. Let f = 21 - 15. Let i be n(f). Sort 0.3, 2/7, i in ascending order. i, 2/7, 0.3 Suppose 5p = 3d - 6d - 3, 2p - d - 1 = 0. Sort p, 0.2, -3, -2/17 in increasing order. -3, -2/17, p, 0.2 Let s(n) = n*3 + 10n*2 + 8n - 7. Let c be s(-9). Sort c, 4, 2/9, 0 in ascending order. 0, 2/9, c, 4 Let y = -0.8 - -0.7. Suppose -3b = 15, b = -2p + 3b + 26. Suppose -5r = -pr + 9. Put -0.4, r, y in descending order. r, y, -0.4 Let j = -2 - -4. Put j, 0.1, 0.5, -4 in descending order. j, 0.5, 0.1, -4 Let k = 57 - 55. Put -2, k, 0 in increasing order. -2, 0, k Suppose -2w + 3o = w + 6, 2 = 4w + o. Suppose w = -3a + 4h - 0h - 24, -2h = -5a - 26. Sort 0.5, -0.5, a in ascending order. a, -0.5, 0.5 Let q(d) = -2d + 2. Let n be q(3). Sort 0, 2, n in increasing order. n, 0, 2 Suppose -4r = -5j + 19, -3r - 3j + 5 = -1. Let b be r/3 + (-39)/(-9). Suppose bc + 3k = -25, -4k = -3c - 0k. Sort c, 1, -2. c, -2, 1 Let w = -1.28 - -1. Let v = 0.72 - w. Put 3, v, -3 in increasing order. -3, v, 3 Suppose 7l - 30 = 2l. Let y = 5 - l. Sort y, -1/4, -2/7 in decreasing order. -1/4, -2/7, y Let c = -0.58 - 0.02. Let b = c - -0.9. Let a be 14/12 + (-4)/6. Put b, 1, a in ascending order. b, a, 1 Let d(b) = -4b*2 - 3b*2 + 6b*2 - 4b + 2 - 7. Let k be d(-4). Sort 0, k, 4. k, 0, 4 Let p = -22 + 22.58. Let v = p - 6.18. Let h = -6 - v. Sort -0.3, 3, h in increasing order. h, -0.3, 3 Suppose 15k = -0 - 60. Sort 0.8, k, 2/3 in descending order. 0.8, 2/3, k Suppose 2i - 8 = 4i. Let z(u) = u2 - 5u + 6. Let y be z(4). Let c = 3 - y. Sort i, 3, c in ascending order. i, c, 3 Let c = -1627/9 + 181. Sort c, 0.1, -3. -3, 0.1, c Let v = 1.34 - 1.354. Sort -1/4, v, 2/3 in decreasing order. 2/3, v, -1/4 Suppose 5s - 22 = -3p + 2p, s + 3p - 10 = 0. Put -1, 3, s in ascending order. -1, 3, s Let h(a) = a*2 + 20. Let b be h(0). Suppose -4j = j + b. Put j, 5, 0 in ascending order. j, 0, 5 Let i = -2.2 + 2.4. Put -4, i, -0.4 in ascending order. -4, -0.4, i Suppose 4w = 1 + 3. Suppose -5c - 16 = -1. Put 4, c, w in increasing order. c, w, 4 Let r = -0.86 - 0.14. Sort r, 0.4, 4, 0.2 in descending order. 4, 0.4, 0.2, r Let q = -3 - 2. Let f(v) = v*3 + 15v*2 + 13v - 14. Let p be f(-14). Sort 5, p, q. q, p, 5 Let f = -0.2 - -0.3. Let u = -10/11 + 103/77. Let r = -12 - -14. Put r, f, u in descending order. r, u, f Let d = 134.01 - 132. Let h = d + -0.01. Let l(i) = -i*2 - i + 3. Let k be l(0). Sort h, k, -1 in descending order. k, h, -1 Suppose -8 + 2 = 3d. Sort 5, 4, d. d, 4, 5 Suppose 4s - 3f = 17, 0s - s = -4f - 14. Let p(h) = -h*2 - 3h - 1. Let a be p(-1). Sort -5, a, s in increasing order. -5, a, s Let s = -40 + 44. Let m(z) = -z*3 + 4z*2 - 4z - 1. Let c be m(3). Let w = 1 + c. Sort w, s, -5 in increasing order. -5, w, s Let p be (4/(-8))/(3/6). Put p, 5, -2 in decreasing order. 5, p, -2 Let k(i) = -i*3 + 1. Let c be k(-1). Suppose -z = 3h - 7h - c, 0 = 2z - 4. Let f = 1 - 0. Sort -3, f, h in ascending order. -3, h, f Let t be (2/6)/((-2)/(-12)). Suppose -3v + 8 = -v, -5v = -5m - 45. Let u be 7 + (0 - -3) + m. Sort 3, u, t. t, 3, u Let n(x) = -2x - 7. Let r be n(-5). Let v(y) = y*3 + 5y*2 - 7y - 6. Let t = -13 - -7. Let q be v(t). Put -1, q, r in decreasing order. r, q, -1 Suppose u + w + w = 3, u + w = 2. Let h = u - -1. Let k be -2 - 1 - 4/(-2). Sort h, -1/6, k. k, -1/6, h Let s(q) be the second derivative of q3/6 - q2/2 + 2*q. Let a be s(-1). Let l = 13 + -8. Put a, l, 1 in descending order. l, 1, a Let a = -2 - -1. Let g = 67.6 - 68. Sort g, a, 5. a, g, 5 Let d = -0.2 +	{ "pile_set_name": "DM Mathematics" }
3 + 3 - 192o + 33 - o*3 + 285o*2 = 0. 2/5, 3 What is o in 0o*4 + 0o*2 - 2/9o*3 + 2/9o*5 + 0o + 0 = 0? -1, 0, 1 Suppose 7h + 7 = 4h - 5c, -h - 4c = 14. Suppose -2z = -hz. Solve -2d4 - 2d*3 + 2d*2 + zd*3 + 2d*2 = 0 for d. -2, 0, 1 Let n(x) = 4x*2 - 2x - 11. Let v(k) = k*2 - 1. Let w(g) = -2n(g) + 6v(g). Solve w(l) = 0. -2, 4 Let i be -1 + 2 + -3 - -11. Suppose iq = -k + 4q + 7, 5k - 5q = 5. Factor z2 - zk + z2 - 2z. z(z - 2) Let c(m) = m2 + m. Let p(k) = -5k*2 - 5k. Let o = -3 + 6. Let a(j) = oc(j) + p(j). Factor a(g). -2g(g + 1) Let c be (-28)/49 - (-36)/14. Let s = -35 - -107/3. What is t in s - 1/3t*c - 1/3t = 0? -2, 1 Let i(p) be the third derivative of 0p + 0p*4 - 1/150p*5 - 3p*2 + 0p*3 + 0. Factor i(k). -2k*2/5 Let j = 24 - 22. Let w(g) be the first derivative of -1 - g + 0g*j + 1/3g3. Find t such that w(t) = 0. -1, 1 Let t(g) = g - 1. Let n(d) = d2 + 1. Let r(q) = 2n(q) + 2t(q). Factor r(b). 2b(b + 1) Let p(t) be the first derivative of t6/12 - t4/2 + t*3/3 + 3t2/4 - t + 4. Factor p(z). (z - 1)3(z + 1)(z + 2)/2 Let f be 4/12 + (-7)/3. Let z(y) = -3y2 - 2y + 5. Let h(b) = 21b2 + 15b - 36. Let w(c) = fh(c) - 15z(c). Factor w(i). 3(i - 1)(i + 1) Let z(q) be the third derivative of -q8/1680 - q7/840 - q*3/2 - 2q2. Let c(f) be the first derivative of z(f). Factor c(s). -s3(s + 1) Factor -4o*3 - 5o*2 - 4o - 3o2 - 8o*2 + 8o*2. -4o(o + 1)2 Let h(d) = d2 + d + 2. Let q be h(0). Suppose 2g + 2j - 8 = 0, qj - 4 = -0. Determine x so that -2/3xg - 2/3x + 2/3x3 + 2/3 = 0. -1, 1 Suppose -u = -3u - 3a - 8, -3a = 4u + 4. Let s(q) be the first derivative of -uq*2 - 2/3q*3 - 2q + 3. Determine g so that s(g) = 0. -1 Let z(f) be the third derivative of f9/7560 - f8/2100 + f6/450 - f5/300 + 5f3/6 - 2f*2. Let i(s) be the first derivative of z(s). Factor i(v). 2v(v - 1)3(v + 1)/5 Let r(t) be the third derivative of t*2 + 0 - 1/60t*6 + 1/6t*5 + 0t - 2/3t4 + 4/3t3. Solve r(d) = 0 for d. 1, 2 Let y(a) = -a + 9. Let g be y(6). Let r(l) be the third derivative of -l2 + 1/105l7 + 1/10l*5 - 1/20l*6 - 1/12l*4 + 0l + 0lg + 0. Factor r(t). 2t(t - 1)3 Let g be (6/(-5))/(8/(240/(-27))). Factor -2/9i*4 - gi*2 + 8/9i*3 - 2/9 + 8/9i. -2(i - 1)4/9 Let g(y) be the first derivative of y7/420 + 7y6/540 - y5/30 + y*3 - 3. Let j(c) be the third derivative of g(c). Factor j(p). 2p(p + 3)(3p - 2)/3 Suppose 13 = -2u + 3u - 5q, 4q + 17 = 3u. Let -4/3r2 + 1/3r*u - 2/3 + 5/3r = 0. Calculate r. 1, 2 Suppose -5h = -7 + 2. Let x be 0h/(-3) + 2. Determine g, given that -1/2gx - 1/2 - g = 0. -1 Let u be 3 + (4 - 48/3). Let o be u/(-24) + 6/(-16). Factor 1/4w*2 + 0w + o. w*2/4 Let y(k) = 2k*3 - 3k*2 - 2k - 3. Suppose 0 = -b + 5 - 2. Let n(x) = 10x3 - 14x*2 - 10x - 14. Let f(m) = bn(m) - 14y(m). Factor f(w). 2w(w - 1)(w + 1) Let a(x) = x - x2 + 2x*2 - 1 - 4x*2 - 1. Let h(n) = -4n*2 + 2n - 3. Suppose f + 1 = 2u - 2, 5u = -2f + 21. Let j(m) = ua(m) - 2h(m). Factor j(o). -o(o + 1) Let h be (((-30)/(-4))/5 + -2)-4. Factor 0 + 0b*3 + 2/7b*h + 0b - 2/7b4. -2b*2(b - 1)(b + 1)/7 Find i such that -845i*2 + 65i + 10985/3i3 - 5/3 = 0. 1/13 Let z(d) = -20d - 5. Let c be z(-4). Suppose -4j + c = j. Find w, given that -23w*3 - 9/2w + jw2 + 33/2w*4 + 1/2 - 9/2w*5 = 0. 1/3, 1 Let m(l) = -7l*3 + 9l + 11. Let r(i) = -36i3 + 44i + 56. Suppose -81 + 17 = 4b. Let x(a) = bm(a) + 3r(a). Factor x(w). 4(w - 2)(w + 1)2 Suppose -5i + c = -3i - 10, 0 = -2i - 2c + 4. Let t(r) be the third derivative of 2r*2 + 1/60r*i + 0 - 1/150r*5 + 0r*3 + 0r. What is z in t(z) = 0? 0, 1 Suppose -4a + 9a - 15 = 0. Find m, given that -2m + am - m - 3m2 = 0. 0 Let i(f) be the first derivative of -f5/10 - f4/8 + f3/8 + f2/4 + f/8 + 31. Suppose i(s) = 0. What is s? -1, -1/2, 1 Factor -100w*2 + 364w*4 + 20w + 36w5 - 14w*4 - 15w*3 + 209w*5. 5w(w + 1)2(7w - 2)2 Let b = -1 + -2. Let d be 20/(-8) + b/(-1). Determine l so that -dl*2 + 1/2 + 0l = 0. -1, 1 Suppose -3/7a - 1/7a*3 - 5/7a*2 + 9/7 = 0. What is a? -3, 1 Let g = -138 - -1657/12. Let u(q) be the second derivative of 2q + 0 + gq3 - 1/8q*2 - 1/48q4. Factor u(h). -(h - 1)2/4 Let o be (2/(-14))/(-11 + -1). Let i(w) be the third derivative of -3w2 + 0w + 0w3 + 0 + ow*4 - 1/210w*5. Let i(x) = 0. Calculate x. 0, 1 Let n be (1 - 3)6/(-3). Suppose b + n = 6. Factor 2/7g + 0 + 2/7g*b. 2g(g + 1)/7 Factor g2 + 2g*4 - 1/2g*5 - 5/2g*3 + 0g + 0. -g*2(g - 2)(g - 1)2/2 Suppose 3k - 3w + 14 = -w, 0 = k + 2w + 2. Let g be 250/(-15)k/10. Factor 4d*2 + gd*4 + 0 - 8d*3 - 2/3d - 2d5. -2d(d - 1)3(3d - 1)/3 Suppose -35t = -31t. Let u(b) be the third derivative of 0b*3 + tb + 1/210b5 - 2b*2 + 0 + 1/84b*4. Factor u(d). 2d(d + 1)/7 Let i(j) = -j2 + 4j - 3. Let w(a) = 6a2 - 27a + 21. Let m(l) = 15i(l) + 2w(l). Suppose m(v) = 0. Calculate v. 1 Let i(p) = -20p3 + 48p*2 - 36p. Let v(h) = 7h3 - 16h*2 + 12h. Let j(q) = 3i(q) + 8v(q). Determine t, given that j(t) = 0. 0, 1, 3 Let m(v) = -1 - 21v3 - 18v*3 - 42v + 13v2 + 78v. Let t(x) = -10x3 + 3x*2 + 9x. Let j(n) = 4m(n) - 18t(n). Find k such that j(k) = 0. -2/3, -1/4, 1 Let y(k) be the first derivative of -k6/30 - k5/5 - 2k4/5 - 4k*3/15 - 4. Determine j so that y(j) = 0. -2, -1, 0 Suppose -16 = 4w + 5k, 5 = -2k - 3. Let b be 22/4 + 6/(-3). Factor -15/2a2 + 19/2a*3 + 1/2a + w - ba4. -(a - 1)3(7a + 2)/2 Factor 16 - 11f*2 - 7f*2 + 16f + 22f2. 4(f + 2)2 Let a(n) be the third derivative of -n8/840 - n7/525 + n6/60 - n*5/50 + 5n*2. Factor a(s). -2s*2(s - 1)*2(s + 3)/5 Let x(b) = b + 1. Let y be x(-4). Let u be (1 - y) + -1 + -1. Solve -c + c + 2c - 2c*u = 0. 0, 1 Let b(g) = 3g*3 - 3g. Let j be 9/4 + (-4)/16. Let i(p) = -3p3 + 3p. Let w(n) = ji(n) + 3b(n). Determine k so that w(k) = 0. -1, 0, 1 Let v(d) be the first derivative of -d*6/3 + 2d*5/5 - 8. Suppose v(j) = 0. Calculate j. 0, 1 Let a(c) be the first derivative of 1 + 0c*4 + 0c*2 + 1/9c*3 - 1/15c*5 + 0c. Let a(t) = 0. Calculate t. -1, 0, 1 Let n(v) be the third derivative of -v8/336 + v7/42 - v*6/60 - 7v5/30 + v4/8 + 3v3/2 + 8v2. Factor n(l). -(l - 3)2(l - 1)(l + 1)*2 Suppose 1 = -0g + g. Let p be g + 5/15 + 4. Solve 3w4 + pw*2 + 4/3w + 0 + 7w3 = 0. -1, -2/3, 0 Let q be 8/(-2 + -1 + 13). What is r in -qr*2 + 4/5 + 6/5r - 6/5r3 = 0? -1, -2/3, 1 Let l be 0/(3 - (-2 - -3)). Let g(v) be the second derivative of -1/3v*3 - v - 1/12v*4 + l - 1/2v2. Determine p so that g(p) = 0. -1 Let p(x) be the second derivative of x6/240 + 3x2/2 - 4x. Let n(q) be the first derivative of p(q). Determine k so that n(k) = 0. 0 Let w be 12/(-18)(-3)/4. Determine q so that -wq*3 - 1/2q*2 + 0q + 0 = 0. -1, 0 Let o(c) be the second derivative of -2/15c5 + 2c - 1/18c3 + 0c*2 + 7/36c*4 - 8/45c*6 + 0. Factor o(q). -q(q + 1)(4q - 1)*2/3 Let q be (3/2)/(2/4). Let a be (2 + 1 - q)/(-1). Factor 1/5z*5 + 0z*4 + 1/5z + 0 + az2 - 2/5z*3. z(z - 1)*2(z + 1)*2/5 Solve 8v*2 - 7v + 11v + 10v + 18 + 7v + v3 = 0. -3, -2 Let k(f) be the third derivative of 4f*2 + 1/20f*5 + 1/210f*7 + 0f + 0f4 + 0f*3 + 1/24f*6 + 0 - 1/336f8. What is t in k(t) = 0? -1, 0, 3 Let a(t) be the first derivative of t6/30 + 7t5/25 + 3t*4/4 + 13t*3/15 + 2t*2/5 + 18. Factor a(y). y(y + 1)*3(y + 4)/5 Let c be 2 + -2 - 2 - -2. Suppose -6h + 4h + 4 = c. Factor 0 + 0v - 1/3vh. -v2/3 Factor 0 + 1/4b4 - 1/4b*2 - 1/4b + 1/4b3. b(b - 1)(b + 1)2/4 Suppose 4v - 30 = 42. Let t be 51/v - 3/9. Factor 9/2y4 - ty*2 - 1/2y - 3/2y3 + 0. y(y - 1)(3y + 1)2/2 Let d(p) be the first derivative of p3/3 - p - 2. Let b(h) = -3h2 - 3h + 6. Let w(k) = -b(k) - 4d(k). Factor w(x). -(x - 2)(x - 1) Suppose 0 - 4/3b + 1/3b2 = 0. What is b? 0, 4 Let i(s) be the third derivative of -s7/4410 + s*	{ "pile_set_name": "DM Mathematics" }
nvert 16.30113 weeks to minutes. 164315.3904 How many minutes are there in 23/6 of a day? 5520 What is 3/8 of a millimeter in micrometers? 375 How many millimeters are there in 3/5 of a centimeter? 6 How many nanoseconds are there in 24.06275us? 24062.75 How many millilitres are there in 59/4 of a litre? 14750 How many millilitres are there in 11/2 of a litre? 5500 How many months are there in 10/3 of a decade? 400 What is 3/8 of a hour in seconds? 1350 What is 4/21 of a week in hours? 32 What is six fifths of a minute in milliseconds? 72000 What is 51989.86ng in micrograms? 51.98986 How many millilitres are there in 44/5 of a litre? 8800 What is twenty-one fifths of a kilometer in meters? 4200 What is 1792.7238 months in centuries? 1.4939365 What is 0.0601808ug in tonnes? 0.0000000000000601808 How many milligrams are there in 9/10 of a gram? 900 Convert 53.39578 millilitres to litres. 0.05339578 How many seconds are there in 7.497391 microseconds? 0.000007497391 How many nanograms are there in 64.28028 grams? 64280280000 How many millilitres are there in 55/2 of a litre? 27500 What is 3/5 of a microsecond in nanoseconds? 600 What is 21/4 of a millimeter in micrometers? 5250 What is 479498.3 minutes in microseconds? 28769898000000 How many litres are there in 325414.4 millilitres? 325.4144 What is 17/2 of a milligram in micrograms? 8500 What is 9/10 of a century in years? 90 What is one tenth of a milligram in nanograms? 100000 How many decades are there in 31787.21 years? 3178.721 How many centimeters are there in 94.67874mm? 9.467874 How many micrometers are there in eighteen fifths of a millimeter? 3600 How many millilitres are there in six fifths of a litre? 1200 Convert 4.481003 grams to tonnes. 0.000004481003 How many months are there in 0.796236 centuries? 955.4832 How many millimeters are there in three tenths of a centimeter? 3 What is 37.22536ng in milligrams? 0.00003722536 Convert 53796.5 litres to millilitres. 53796500 How many grams are there in 788.975 micrograms? 0.000788975 What is 33/10 of a meter in centimeters? 330 What is 6.224098 millilitres in litres? 0.006224098 Convert 284042.6s to nanoseconds. 284042600000000 How many weeks are there in 702.14634us? 0.00000000116095625 What is 21/8 of a decade in months? 315 How many micrograms are there in 83.18973ng? 0.08318973 What is eleven eighths of a gram in milligrams? 1375 How many micrograms are there in 21/8 of a milligram? 2625 What is 29/2 of a litre in millilitres? 14500 How many millimeters are there in 4011.698 kilometers? 4011698000 How many micrometers are there in 3278.574m? 3278574000 How many minutes are there in eleven quarters of a hour? 165 How many microseconds are there in 43/4 of a millisecond? 10750 What is 150161.8 decades in millennia? 1501.618 Convert 32560.3 weeks to nanoseconds. 19692469440000000000 What is 788593.4 centuries in years? 78859340 How many months are there in one tenth of a millennium? 1200 What is eighty-seven halves of a litre in millilitres? 43500 What is 10/3 of a decade in months? 400 Convert 0.6340098 litres to millilitres. 634.0098 What is 7/2 of a minute in seconds? 210 What is 2751.5907ns in hours? 0.00000000076433075 What is 6/5 of a meter in centimeters? 120 How many grams are there in 46/5 of a kilogram? 9200 What is 9964.687 grams in kilograms? 9.964687 What is sixty-four fifths of a microgram in nanograms? 12800 How many tonnes are there in 0.871667g? 0.000000871667 How many millilitres are there in 5/4 of a litre? 1250 How many centimeters are there in 40.20087 kilometers? 4020087 How many meters are there in 0.43857mm? 0.00043857 What is 0.8551623 millennia in centuries? 8.551623 Convert 380072.8 milliseconds to microseconds. 380072800 How many weeks are there in 765369.864ms? 0.0012654925 How many litres are there in 7.53755ml? 0.00753755 What is twenty-one fifths of a litre in millilitres? 4200 What is 0.8585061mm in meters? 0.0008585061 What is 904.055 litres in millilitres? 904055 What is 67/5 of a kilometer in meters? 13400 How many millimeters are there in 4363.154nm? 0.004363154 How many litres are there in 9.015394 millilitres? 0.009015394 How many nanoseconds are there in 250292.7 milliseconds? 250292700000 How many millilitres are there in 0.818087l? 818.087 How many millimeters are there in 3/40 of a meter? 75 How many millilitres are there in 88/5 of a litre? 17600 How many millilitres are there in one quarter of a litre? 250 Convert 0.4999212 millimeters to micrometers. 499.9212 Convert 6.437385 weeks to microseconds. 3893330448000 What is three tenths of a kilometer in meters? 300 How many millilitres are there in 6/25 of a litre? 240 How many years are there in 271.41276 months? 22.61773 How many hours are there in 8/3 of a day? 64 What is 3/40 of a litre in millilitres? 75 What is 17/4 of a millisecond in microseconds? 4250 How many grams are there in 765.1522 milligrams? 0.7651522 What is one quarter of a meter in centimeters? 25 How many minutes are there in 1/4 of a hour? 15 Convert 719995.5 minutes to seconds. 43199730 How many millilitres are there in thirty-two fifths of a litre? 6400 What is 8.931852 nanograms in milligrams? 0.000008931852 How many microseconds are there in 42995.11 days? 3714777504000000 What is thirteen quarters of a tonne in kilograms? 3250 What is 0.466805 kilometers in micrometers? 466805000 What is 0.3303255 millimeters in meters? 0.0003303255 What is one ninth of a hour in seconds? 400 What is 23.3890983ns in days? 0.00000000000027070715625 Convert 0.8485317 tonnes to milligrams. 848531700 What is seven halves of a gram in milligrams? 3500 What is 6/5 of a centimeter in millimeters? 12 What is 19/4 of a microsecond in nanoseconds? 4750 How many kilograms are there in 536696.1 milligrams? 0.5366961 What is 842150.8 micrograms in grams? 0.8421508 What is 8.782896s in nanoseconds? 8782896000 What is one quarter of a millennium in years? 250 How many milliseconds are there in three tenths of a second? 300 What is 15/4 of a litre in millilitres? 3750 How many millennia are there in 29556.933 months? 2.46307775 How many millimeters are there in 2.68944um? 0.00268944 What is 8/25 of a millimeter in micrometers? 320 How many nanograms are there in 18/5 of a microgram? 3600 How many years are there in 1330.243 decades? 13302.43 How many nanograms are there in 967.411 milligrams? 967411000 What is fourty-eight fifths of a gram in milligrams? 9600 How many kilometers are there in 807.89um? 0.00000080789 How many millilitres are there in seven quarters of a litre? 1750 What is 3/25 of a hour in seconds? 432 What is 27/5 of a century in months? 6480 Convert 7.855023 decades to millennia. 0.07855023 How many centimeters are there in 34.83189km? 3483189 Convert 14.44298 centuries to months. 17331.576 What is thirty-two fifths of a decade in months? 768 How many months are there in 33/5 of a decade? 792 What is five quarters of a litre in millilitres? 1250 What is 8030.246 years in centuries? 80.30246 How many nanoseconds are there in fifty-three quarters of a microsecond? 13250 What is 0.183898 years in millennia? 0.000183898 How many minutes are there in two fifteenths of a hour? 8 How many milligrams are there in 63181.16 tonnes? 63181160000000 What is 938.8572ns in microseconds? 0.9388572 How many centuries are there in thirty-one fifths of a millennium? 62 Convert 14151.02 litres to millilitres. 14151020 What is 3/50 of a meter in millimeters? 60 How many nanometers are there in 144.8508mm? 144850800 What is 81/2 of a millennium in years? 40500 How many millilitres are there in 7.221882 litres? 7221.882 How many seconds are there in 305613.7 minutes? 18336822 Convert 6.53305 tonnes to micrograms. 6533050000000 How many millennia are there in 9006.68 decades? 90.0668 How many milligrams are there in one tenth of a gram? 100 What is twenty-seven fifths of a kilometer in meters? 5400 What is 42/5 of a milligram in micrograms? 8400 What is 1594.781 microseconds in nanoseconds? 1594781 What is 19/4 of a kilometer in meters? 4750 Convert 316307.7 litres to millilitres. 316307700 What is seven eighths of a meter in millimeters? 875 What is one fifteenth of a hour in seconds? 240 What is 658	{ "pile_set_name": "DM Mathematics" }
(45) + sqrt(180)/sqrt(64))/(sqrt(1296)-6) + -3). -15 - 365sqrt(5)/288 Simplify (sqrt(108)3 + 2 + -4 + (sqrt(108) + 2 - sqrt(108)) - -1((-2sqrt(144))/sqrt(6))/(sqrt(1152)2 + sqrt(8)))*2. 602112/625 Simplify 1 + 1-3(sqrt(2057) + -3)-24. -71 + 264sqrt(17) Simplify -4 + (-3 + (1 + 5 + sqrt(75) - (sqrt(75) - (sqrt(75) - 24sqrt(75)))))*2. -210sqrt(3) + 3680 Simplify (2 + 1((-3sqrt(2057)4 - sqrt(2057)) + sqrt(2057) + -4)-6)*2. 41184sqrt(17) + 10664164 Simplify -4(-6(sqrt(68) + -1 + 2 + sqrt(68) + 0 + 0 + ((0 + sqrt(68))-4 - sqrt(68)) + 4)-3)*2. -825552 + 77760sqrt(17) Simplify -2 + ((sqrt(832) + (sqrt(832) + -1 + sqrt(832))3 - -6(sqrt(832) + -2 + sqrt(832))) + 1 + 2)*2 + -5. -3648sqrt(13) + 300489 Simplify -4 + -3(-5(sqrt(252) - 1sqrt(252)-5))/((sqrt(64) - ((sqrt(64)2 - sqrt(64)) + sqrt(64)))-5). -4 + 27sqrt(7)/2 Simplify (-5(-2sqrt(720) + sqrt(720))-6)/(-1sqrt(45)/sqrt(5) + -4sqrt(36)). 40sqrt(5)/3 Simplify ((sqrt(5) + -2 - sqrt(5))1 - (2 + sqrt(5) + sqrt(5) + sqrt(180))) + -4 + (sqrt(80)2 + 2 - sqrt(80))2. 8sqrt(5) + 76 Simplify 4(-4 + ((2sqrt(936) - sqrt(936))/sqrt(2) + (sqrt(78)-22)/sqrt(6) + 0)*2). 192 Simplify ((3 + sqrt(567) + sqrt(7))53 + ((sqrt(49)-2)/sqrt(7) + 3)6)2. 17388sqrt(7) + 137277 Simplify (1 + -2(3-2sqrt(13) - (1 + sqrt(26)/sqrt(2)))63)2. 18648sqrt(13) + 826921 Simplify -6(-5 + sqrt(1372)-3 + sqrt(1372) + 3 + -5)*2. -33222 - 2352sqrt(7) Simplify (((sqrt(832) - (3 + sqrt(832)))6 + -1(sqrt(832) + 5))-3-1)*2. 3312sqrt(13) + 12249 Simplify (-2 + sqrt(396) + -4)*2 + -3-1sqrt(396) - (((sqrt(396) + 3)-5)2 - (1 + sqrt(396) + -3)2). -9293 - 978sqrt(11) Simplify (-3 + 1 + (-2 + (3 + -1sqrt(275) - (sqrt(275) + 0 + sqrt(275))3))-3)*2. -1050sqrt(11) + 121300 Simplify 2(1 + (sqrt(3) + ((sqrt(54)/sqrt(3) - sqrt(18))/sqrt(6) - sqrt(3))2 + sqrt(3) + (sqrt(300) - (0 + sqrt(300))) - sqrt(3888)2))1. -140sqrt(3) + 8 Simplify ((sqrt(175) - (0 + sqrt(175))) + -3 - ((2sqrt(175) - sqrt(175))2 + -1)) + (1 + (2sqrt(7) + -3 - sqrt(7)) + sqrt(28)/(-5sqrt(12)/sqrt(3)))2. -4213/25 - 16sqrt(7)/5 Simplify (3 + (sqrt(2560)2)/(sqrt(8)-16) - (((sqrt(70) + sqrt(70) + sqrt(70) + sqrt(70)2 + sqrt(70))/sqrt(7) + sqrt(10))/sqrt(32) + 5))*2. 53sqrt(5)/3 + 14621/144 Simplify (sqrt(152) + -2sqrt(152))/sqrt(8) + (sqrt(114)/sqrt(6))2 + -3 + 1((sqrt(2299) + 1)*2 + -4) + -5. 21sqrt(19) + 2307 Simplify ((2sqrt(30)1 - sqrt(30)) + sqrt(120) + 1sqrt(120))/(sqrt(4374) + -6sqrt(384)). -5sqrt(5)/21 Simplify (5(sqrt(65) - -6-1sqrt(65))1)/((-5(sqrt(40) + sqrt(160)))/(sqrt(392) + sqrt(392)1)). 70sqrt(13)/3 Simplify ((sqrt(110) - sqrt(110)21) + (sqrt(110) - (-33sqrt(110) - sqrt(110))))/(2(sqrt(450) - 1sqrt(450) - sqrt(450) - sqrt(450))/sqrt(5)). -5sqrt(11)/6 Simplify 2 + ((sqrt(32)2-3 + (-1 + sqrt(1152) - sqrt(1152)))2 - (4 + (3(-2sqrt(288) + sqrt(288)))/sqrt(9))). 60sqrt(2) + 1151 Simplify (-4(4(sqrt(704) - sqrt(704)6-5) - ((sqrt(704) + (sqrt(704) + 0 + -4 - sqrt(704)) - sqrt(704)) + -2sqrt(704)-4)) + 5)*2. 81664sqrt(11) + 151568505 Simplify -541(-6(sqrt(1872) - (sqrt(1872) - 2sqrt(1872)-3)))*2 + 1. -48522239 Simplify 5 + (((sqrt(72) - sqrt(72)13 - sqrt(72)) + 2 - (2sqrt(72) + 3 - 5(sqrt(72) + 0)))-3)*23. 32 Simplify -1 + 5(sqrt(625) + 52sqrt(625) + sqrt(625))/(sqrt(245) - ((-2sqrt(245) - sqrt(245)) + sqrt(245))3). -1 + 300sqrt(5)/49 Simplify ((-1(sqrt(16) - (sqrt(144) + (sqrt(144) - (5sqrt(144) - sqrt(144) - sqrt(144) - sqrt(144))))))/(sqrt(88)/(sqrt(11)-3) + 6sqrt(128)))*2. 18/5041 Simplify (3(sqrt(272) - sqrt(272)2) + sqrt(272))2 - ((3 + sqrt(272))-1 + sqrt(272))*2 - ((4sqrt(272)1 - 1sqrt(272)2)2 + 1). -10 Simplify (-2(-2 + (sqrt(304) + -5 + -5 - ((sqrt(304) + (sqrt(304) - (2 + sqrt(304))) + sqrt(304) - sqrt(304)) + 4))))*2. 784 Simplify (-34(-4 + -2sqrt(1100) + 4 + 6sqrt(1100)2))*2. 15840000 Simplify (3-1sqrt(5100)2)/((sqrt(105)/sqrt(5))/sqrt(7) + sqrt(3) + -5sqrt(27)). 60sqrt(17)/13 Simplify -6(3 + 1(4 + (sqrt(117)1 - sqrt(117))))6. -252 Simplify 6(sqrt(32) + -2) + -2 + (-1 + sqrt(18) - (5 + sqrt(14)/sqrt(7))2). -42 + 17sqrt(2) Simplify 0 + (2sqrt(175) - (sqrt(1008) + -1)2) + 4 + (-2sqrt(350))/(sqrt(128)-1) + -3. -1008 + 141sqrt(7)/4 Simplify ((2sqrt(132)2)/((sqrt(16)2)/sqrt(4)))/((sqrt(792) - (-2sqrt(792) - sqrt(792)))/(sqrt(72) - (sqrt(72) + (sqrt(72)-1 - sqrt(72))))). sqrt(3) Simplify ((sqrt(220)22)/sqrt(4))/(sqrt(20)-3-6) + -4. -4 + sqrt(11)/9 Simplify ((sqrt(2448) + 0 + 5 + 2)4)*2 + ((-4 + (sqrt(2448) - (sqrt(2448) - 2sqrt(2448))) + -3)-3)2. -336sqrt(17) + 128521 Simplify (3sqrt(3993)2-1)/((sqrt(44) + sqrt(176)/(sqrt(4) - sqrt(64)))/(sqrt(64)3 + sqrt(4))). -1287sqrt(3) Simplify -3(sqrt(20)/(sqrt(45)2))/(-6(-2sqrt(20))/sqrt(10))-2. sqrt(2)/12 Simplify ((1 + (sqrt(171) - (sqrt(171) + 1 + 2)))*2 - (1(sqrt(171) + sqrt(171)2 + 4 - sqrt(171)))2)2-3. 288sqrt(19) + 4176 Simplify 2(1 + 3(((2 + sqrt(1377))-4)2 + (-3 + sqrt(1088) + 4)2)). 3552sqrt(17) + 139112 Simplify (5 + -5 + -4 + sqrt(300) + sqrt(300))*2 - (-5 + (sqrt(300) - 1sqrt(300))*2 - -2(sqrt(300)-3 - sqrt(300))). -80sqrt(3) + 1221 Simplify (-2 + ((sqrt(5200)3 - sqrt(5200)) + 1 - sqrt(5200))2 + 4)1 + 4. 40sqrt(13) + 5207 Simplify (-2 + sqrt(99) + -2 - sqrt(99) - ((-2 + sqrt(99))-1 + sqrt(99)))*2 - 3(sqrt(66) + (2sqrt(66) + sqrt(66))2 + sqrt(66))/(-5sqrt(6)1). 24sqrt(11)/5 + 36 Simplify -1(5 + 1((sqrt(4)-4)/sqrt(2) + -1) + -3 + -5). 4 + 4sqrt(2) Simplify ((-2sqrt(100))/sqrt(10))/(-2sqrt(2)-1) - (-4 + ((sqrt(225)/sqrt(5))/sqrt(9) - sqrt(125)-1)). -7sqrt(5) + 4 Simplify 5(sqrt(112) + 2sqrt(112)-1)2 - (-1 + (-3sqrt(21)/sqrt(3) - -4sqrt(21)/sqrt(3))). -sqrt(7) + 561 Simplify (((sqrt(200) - (-2sqrt(200) + -5)) + 2)*2 + ((sqrt(200) + (sqrt(200) + 0)-5)2)2)-2 + -4. -29302 - 840sqrt(2) Simplify (sqrt(63)/(-5sqrt(225) - sqrt(225)) - 6sqrt(7)62)2 + -4. 32685847/900 Simplify (5 + (1sqrt(1700) + 3 - ((sqrt(1700)3 - sqrt(1700) - sqrt(1700)) + sqrt(1700) + 0))-54)2 + -1. -22000sqrt(17) + 683024 Simplify -2 + (3 + (sqrt(2) - (2(-3 + sqrt(2)) + sqrt(2))) + 5 + 4 + -2sqrt(128) + sqrt(128) + 1)*2. -380sqrt(2) + 559 Simplify ((3(-1sqrt(91) + sqrt(91)) - 1((1sqrt(91) - sqrt(91)) + sqrt(91)))-3)/((sqrt(7) - 4sqrt(7)3) + sqrt(1008)-1 + sqrt(1008) + sqrt(1008)). 3sqrt(13) Simplify 2(-2 + 1(sqrt(2) + 1) + sqrt(242)1 + sqrt(242) + -2 + sqrt(18)/(sqrt(576) - sqrt(576)2))2. -549sqrt(2)/2 + 33777/16 Simplify (sqrt(170)/(sqrt(160)-2))26 - ((sqrt(68))2 + -3 - (sqrt(833) + 1 + sqrt(833))2). 28sqrt(17) + 104627/32 Simplify ((sqrt(152) + (sqrt(152)-2 - sqrt(152))3 - sqrt(152)) + -4-2sqrt(152) + sqrt(152))/((-1sqrt(64)1)/sqrt(8))25. 0 Simplify 1(2 + (sqrt(2736) - (sqrt(2736) + sqrt(2736) + 3)*25 - (sqrt(2736) - (sqrt(2736) + (sqrt(2736) - (sqrt(2736) - -3sqrt(2736)3))))*2) + -4). -276383 - 708sqrt(19) Simplify 2 + -5 + (-4 + sqrt(2156) + 6(sqrt(2156) + sqrt(2156) + 0 + sqrt(2156) + sqrt(2156)) + 3 + (1 + sqrt(2156) + sqrt(2156))4)*2. 2772sqrt(11) + 2347890 Simplify (4 + sqrt(75) + 1 + -4 - (sqrt(75)12 + sqrt(75) + sqrt(75))-3)24 + 4. 520sqrt(3) + 50708 Simplify (5 + -3((sqrt(684)-1 - sqrt(684)) + 2) + (6(sqrt(684) - -1sqrt(684)) - (sqrt(684)2 + -4)) + 4)*2. 1344sqrt(19) + 175153 Simplify ((-4sqrt(175)/sqrt(5))/(sqrt(7) - (-2sqrt(343) + sqrt(343))) - -4(sqrt(245) - (sqrt(245)-2-1 + sqrt(245) + sqrt(245))))2. 142805/4 Simplify (-3 + sqrt(300) + 4(sqrt(300) + sqrt(300)-2) + -1 + -2(-5 + -1sqrt(300) + 5) + -5)2. 180sqrt(3) + 381 Simplify -5 + 1((sqrt(500) + 2 + -1)2 - sqrt(500) - ((1 + sqrt(500) - sqrt(500)) + -1))1. 10sqrt(5) + 496 Simplify ((sqrt(175) + 4 + sqrt(175) + sqrt(175) + sqrt(175) + -3 + 0)2 - (sqrt(175)4 + -3 - ((sqrt(175) + 5)-6 + sqrt(175))))*2. 250sqrt(7) + 800 Simplify -2((3-2-2sqrt(891)2)2 + 0)-1. 1026432 Simplify 1((((sqrt(70) + (-2sqrt(70) - sqrt(70)) - sqrt(70) - sqrt(70)) + sqrt(70))/sqrt(7))/(-2sqrt(2)-3 + sqrt(2)) + (-1 + sqrt(2880) + 2)*2). 333sqrt(5)/7 + 2881 Simplify (-2*(5 + sqrt(405) + 0 + -1) + 3 + ((sqrt(405) + 0 - sqrt(405)	{ "pile_set_name": "DM Mathematics" }
+ 11222u/5 - 62966642/5 = 0. 11222 Factor -s2/8 - 715s + 109041/8. -(s - 19)(s + 5739)/8 Factor -27556d*2 + 28386d - 29241/4. -(332d - 171)2/4 Factor -905z*2 + 9035z + 150. -5(z - 10)(181z + 3) Factor -2a*3 + 176a*2 - 502a - 680. -2(a - 85)(a - 4)(a + 1) Find x such that -3000x*5 - 83700x*4 + 766290x*3 + 734049x*2 + 224613x + 22680 = 0. -35, -3/10, 8 Solve -2f4/7 - 122f*3/7 - 338f*2 - 15510f/7 - 32400/7 = 0 for f. -27, -24, -5 Factor 4f2 - 340384f + 7241329216. 4(f - 42548)2 Factor -d4 - 14424d*3 - 52085014d*2 - 519768840d - 1298521225. -(d + 5)*2(d + 7207)*2 Find c, given that 15c*2/7 - 362349c/7 - 20706 = 0. -2/5, 24157 Factor -5c3 - 110c*2 - 375c - 270. -5(c + 1)(c + 3)(c + 18) Determine l, given that l3/9 - 13648l*2/9 - 27308l/9 + 36400/3 = 0. -4, 2, 13650 Factor 537w3 + 36522w*2 + 137880w + 1536. 3(w + 4)(w + 64)(179w + 2) Let 3l4 + 177l*3 + 831l*2 + 1143l + 486 = 0. What is l? -54, -3, -1 Determine l, given that -2l2/9 + 8l/9 + 34840/9 = 0. -130, 134 Find c such that 7965c3/7 - 318606c*2/7 - 326325c/7 + 246/7 = 0. -1, 2/2655, 41 Factor d*2/8 - 777d/4 - 10927/8. (d - 1561)(d + 7)/8 Solve -u5/4 + 65u*4/2 - 5713u*3/4 + 22120u*2 - 40084u + 19360 = 0. 1, 40, 44 Factor 3y3 - 675y*2 - 209475y + 47719875. 3(y - 245)2(y + 265) Find y such that -7y2 - 427677y + 122194 = 0. -61097, 2/7 Let c*3 + 186c*2 + 549c = 0. What is c? -183, -3, 0 Solve t*4/6 - 103t*3/3 + 580t*2/3 + 4000t/3 = 0 for t. -4, 0, 10, 200 Suppose -20i3 + 2359147i*2 + 1533452i + 235916 = 0. Calculate i. -2/5, -1/4, 117958 Suppose 3h2/7 - 167628h/7 + 2341595532/7 = 0. Calculate h. 27938 Solve 3c2/8 + 18339c/4 + 18333 = 0. -12222, -4 Determine q so that -4q2/5 + 205584q/5 - 2641548816/5 = 0. 25698 Factor -2w2 + 34w + 16968. -2(w - 101)(w + 84) Find n such that 5n2 + 27785n - 2397850 = 0. -5642, 85 What is d in 3d4 + 71793d*3/7 + 1122894d*2/7 - 326688d/7 = 0? -3403, -16, 0, 2/7 Let -2c3/7 - 184248c*2/7 + 368502c/7 - 184252/7 = 0. Calculate c. -92126, 1 Find x, given that 5x2 - 24880x - 124525 = 0. -5, 4981 Let 2t2/9 - 42836t/9 + 229365362/9 = 0. What is t? 10709 Find j such that -21j4/2 + 468051j*3 + 1604799j*2/2 + 200604j - 133734 = 0. -1, 2/7, 44578 Find o such that 2o3/17 + 10646o*2/17 + 63820o/17 + 85072/17 = 0. -5317, -4, -2 Factor -27u2/5 + 606u/5 + 3321/5. -3(u - 27)(9u + 41)/5 Find g such that 934g*3 - 7484g*2 - 8310g + 108 = 0. -1, 6/467, 9 Factor -4w4 + 548w*3 + 2244w*2 + 1692w. -4w(w - 141)(w + 1)(w + 3) Factor c*3 + 20c*2 - 2977c + 11524. (c - 43)(c - 4)(c + 67) Factor 5a3/2 - 12730a*2 + 31764705a/2 + 826255125. 5(a - 2571)2(a + 50)/2 Let -2s2/3 + 154s - 15580/3 = 0. What is s? 41, 190 Factor 4u4/5 - 2018u*3 + 5044u*2/5. 2u*2(u - 2522)(2u - 1)/5 Let -2t3/9 + 17962t*2/9 + 143794t/9 + 89890/3 = 0. What is t? -5, -3, 8989 Find z such that -2z2 + 15944z + 480120 = 0. -30, 8002 Solve -23601a5/7 - 424812a*4/7 - 327027a*3 - 3397962a*2/7 - 1509600a/7 + 384/7 = 0 for a. -8, -1, 2/7867 Factor -4h2/7 + 2152h/7 + 146156/7. -4(h - 599)(h + 61)/7 Factor -3z2 + 621z - 3030. -3(z - 202)(z - 5) Suppose 2t2 - 324t - 27206 = 0. What is t? -61, 223 Find d such that 1365d3 - 138760d*2 + 270565d + 2990 = 0. -1/91, 2, 299/3 Factor -p*4 - 133p*3 - 6174p*2 - 111132p - 518616. -(p + 7)(p + 42)3 Let -10u*3 - 1522u*2 + 2776u + 616 = 0. Calculate u. -154, -1/5, 2 Suppose g*2/6 + 1175g/6 - 786 = 0. Calculate g. -1179, 4 Find n, given that 2n2/13 - 2962n/13 + 14760/13 = 0. 5, 1476 Factor -h*3/5 - 931h*2/5 - 45227h - 869505. -(h + 21)(h + 455)2/5 Suppose 4h*4 - 5264h*3 - 47592h*2 - 142992h - 143100 = 0. Calculate h. -3, 1325 Determine t so that 5t2 + 30t - 6800 = 0. -40, 34 What is h in -4h2/7 + 184h + 20220/7 = 0? -15, 337 Factor -3c3 + 18039c*2 - 27126144c + 27108108. -3(c - 3006)2(c - 1) Find c, given that 2c5 + 308c*4 + 12956c*3 + 79736c*2 - 199582c + 106580 = 0. -73, -10, 1 Solve -3p5 + 261p*4 - 6048p*3 + 15876p*2 = 0 for p. 0, 3, 42 Determine s, given that 2s*2 + 30954s + 30952 = 0. -15476, -1 Determine h so that h*4/6 + 37h*3/6 + 61h*2/6 - 111h/2 - 105 = 0. -35, -3, -2, 3 Suppose -50x4/3 + 11988410x*3/3 + 11189284x*2 + 21099832x/3 + 3836336/3 = 0. What is x? -2, -2/5, 239771 Suppose 4n3 - 19807n*2/5 + 6924n/5 + 1188 = 0. Calculate n. -2/5, 3/4, 990 Factor -12762y2 - 38289y - 9. -3(y + 3)(4254y + 1) Factor q2/3 - 23q/3 - 946. (q - 66)(q + 43)/3 Factor 3o*3 + 36o*2 - 1431o + 1392. 3(o - 16)(o - 1)(o + 29) Suppose 10l*5/9 + 129848l*4/3 + 3793301536l*3/9 - 2023530464l*2/3 - 3035139872l/9 = 0. Calculate l. -19478, -2/5, 0, 2 Factor 68f4 - 468f*3/7 - 8f*2/7. 4f*2(f - 1)(119f + 2)/7 Factor 7069w2/4 + 49459w/4 - 42. (w + 7)(7069w - 24)/4 What is x in -x*2/4 - 683x/4 - 9765 = 0? -620, -63 Solve -14a5/9 - 4418a*4/3 + 17060a*3/9 - 1264a*2/3 = 0 for a. -948, 0, 2/7, 1 Factor -3p*4 + 96p*3 - 261p*2 - 8760p - 8400. -3(p - 20)2(p + 1)(p + 7) Suppose 3a*5/4 + 219a*4/4 + 639a*3/4 + 633a*2/4 + 105a/2 = 0. What is a? -70, -1, 0 Factor -4h3 - 1048h*2 - 22940h - 21896. -4(h + 1)(h + 23)(h + 238) Solve 3q*4 + 147q*3 + 2166q*2 + 9240q + 10944 = 0. -24, -19, -4, -2 Factor h*2/4 - 1013h/2 + 3030. (h - 2020)(h - 6)/4 Solve -3j*2 - 915j - 45198 = 0 for j. -243, -62 Factor 2u2 - 48214u. 2u(u - 24107) Determine q so that 3q2/2 + 155163q + 310323/2 = 0. -103441, -1 Solve 5x2/3 + 38420x/3 + 73804820/3 = 0 for x. -3842 Factor 2d4 + 534d*3 - 5540d*2. 2d*2(d - 10)(d + 277) Determine u, given that -2u*2/7 + 18162u/7 - 18160/7 = 0. 1, 9080 Suppose 3p5 + 117p*4 - 9729p*3 - 19797p*2 - 9954p = 0. Calculate p. -79, -1, 0, 42 Factor a*2 - 141730a + 5021848225. (a - 70865)*2 Solve -2r*2/3 + 337820r - 42795882150 = 0. 253365 Find p such that 391p2/4 + 787p/4 + 5/2 = 0. -2, -5/391 Factor 2x3/13 + 14702x*2/13 + 26996534x/13 - 81121974/13. 2(x - 3)(x + 3677)*2/13 What is v in 2v*2/9 - 25504v/9 - 25522 = 0? -9, 12761 Let -5j2 - 71275j = 0. What is j? -14255, 0 Let -405u5 + 5661u*4 - 19353u*3 + 7443u*2 + 30510u + 3888 = 0. What is u? -8/9, -2/15, 3, 9 Factor -8q2 + 1139364q - 569680. -4(q - 142420)(2q - 1) Let -25n*5/2 + 3805n*4 + 20085n*3/2 - 19975n*2 + 6140n = 0. What is n? -4, 0, 2/5, 1, 307 Suppose -x*5/4 + 45x*4/4 - 631x*3/4 + 2979x*2/4 - 598x = 0. Calculate x. 0, 1, 8, 13, 23 Find p such that p*3 - 70683p*2 + 1249127640p - 3746746800 = 0. 3, 35340 Suppose r*5 - 46r*4 + 569r*3 - 836r*2 - 1452r = 0. What is r? -1, 0, 3, 22 Factor -8y2/3 - 22258y/3 - 5564/3. -2(y + 2782)(4y + 1)/3 Factor -5r*2 + 1595445r - 4786290. -5(r - 319086)(r - 3) Factor 2312s2/5 + 9242s/5 - 24/5. 2(s + 4)(1156s - 3)/5 Solve 3q*4/5 + 2532q*3/5 + 154224q*2 + 20322480q + 984565200 = 0 for q. -334, -170 Let 7z3 + 1070z*2 + 4043z + 2980 = 0. Calculate z. -149, -20/7, -1 Factor -3d2 + 272427d. -3d(d - 90809) Factor -2f3 + 53724f*2 - 360837240f + 721459600. -2(f - 13430)2(f - 2) What is k in 17956k2 + 20368k + 5776 = 0? -38/67 Factor k*3/4 + 796k*2 + 389277k/4 + 6068601/2. (k + 63)*2(k + 3058)/4 Solve -u*4/5 + 231u*3 - 18304u*2/5 + 91248u/5 - 145792/5 = 0 for u. 4, 8, 1139 Let 4t4 + 24012t*3 + 48119832t*2 + 32335232400t + 287136863712 = 0. What is t? -1998, -9 Let -3s2 - 270954s - 270951 = 0. Calculate s. -90317, -1 Suppose 3q3/2 - 47541q*2/2 + 187893105q/2 + 3587151873/2 = 0. What is q? -19, 7933 Let -t*5/5 - 65t*4 + 654t*3/5 = 0. Calculate t. -327, 0, 2 Factor -4u*3 - 212172u*2 - 2813453760u + 2813665936. -4(u - 1)(u + 26522)*2 Let -1444z*5/3 - 27892z*4/3 + 158828z*3 - 486324z*2 - 165600z - 13392 = 0. What is z? -31, -3/19, 6 Solve -5j3 - 248810j*2 - 3094823125j + 12383273780 = 0. -24883, 4 Suppose a*4/8 - 29a*3/4 - 51551a*2/8 + 189921a + 85778802 = 0. What is	{ "pile_set_name": "DM Mathematics" }
+ -245/4. Are v and 0.3 unequal? True Let h(f) = f*2 - 1. Let n be h(2). Suppose 3o = -2o + 15. Are n and o non-equal? False Suppose -5z + 3p = 4p + 3, 0 = -3z + 5p + 15. Suppose v + v = z. Suppose -17 = -a - 3s + 6s, 3a + 4s + 14 = v. Is a >= 2? True Let n(i) = i*2 - 4i - 1. Let w be n(5). Let y = 3 - -2. Suppose -d + y = wq, -5 = -q - q - d. Is q less than 0? False Let r be (-6)/4120/(-9). Suppose -6p + r = -p. Is 3 not equal to p? True Let r be 4/(-18) - 2/(-36). Suppose 4x + 28 = -v - 4v, 5x - 4v - 6 = 0. Let i = x - -3. Is i greater than or equal to r? True Let z = -145/798 + 2/133. Are 1 and z nonequal? True Suppose -5k - 5y - 140 = 0, 5y - 6 + 2 = k. Let u be (-18)/k - 2/8. Let s = -4 - -6. Is u at least as big as s? False Suppose m + 4g + 4 = -6, 50 = 5m - 5g. Which is greater: m or 4? m Suppose -5r + 15 = 0, 7r - 3r = g + 18. Let l = -9 - -6. Let h be g((-6)/4)/l. Which is smaller: h or -3/2? h Let b(d) = 2d - 2. Let i be (-10)/(-5) + 4-1. Let a be b(i). Let y = -5 + -1. Is a at least y? True Let u = -5 - -24/5. Suppose 2a + c - 2 = a, -3a - 2 = -c. Is u equal to a? False Let x = -4.12 - -3.92. Let l be (-32)/30 - (-2)/5. Which is smaller: l or x? l Let d(k) = k3 - k2 + 4. Let s be d(0). Is 5 smaller than s? False Let q = -19484 + 97054/5. Let s = -73 - q. Is -2/11 at least s? False Let v = -1 - -2. Let c = -0.3 - -0.3. Which is greater: v or c? v Let s = 18 - 15. Suppose -4n + 5f = -18, 0 = -sn + 2n - f. Which is greater: n or -3? n Let f be (-24)/15 + (52/20 - 3). Is f less than or equal to -24/11? False Let z = -1 - 2. Let r = -3.1 - z. Are r and -2/5 unequal? True Let h = 5 + -2. Suppose 18 = m - 4f, 2f + 2 = -6. Let d = h - m. Which is smaller: 2/7 or d? 2/7 Suppose 7r = 10 + 46. Is 10 bigger than r? True Let n = -5.7 + 6. Let v = -1 - -1. Suppose -4c + 6 - 2 = v. Which is smaller: c or n? n Suppose 4 = -3d + 16. Suppose -j + d = 6. Let p be 0j(-3)/12. Do p and -2/9 have the same value? False Let o be 1(-2 - 0 - -7). Suppose 3k + 5q - 5 = 0, k + o = 3q + 16. Let g = 9 - k. Which is greater: g or 2? g Let x be 4/3(-6)/(-4). Let f be (-51)/(-15) + x/(-5). Which is bigger: -1 or f? f Let g be ((9 - 4) + -4)0. Let j = -2459/13 - -189. Are g and j non-equal? True Let i be (4 - 55/15)15/10. Let x = 6 - 6.3. Let g = -0.4 - x. Does g = i? False Suppose -2k + 2w + 8 = 0, 2k - w - 20 = 4w. Suppose 0 = -5r - kr. Which is greater: -1/4 or r? r Let g(o) = -2o - 6. Let d be g(-5). Suppose -8 = -3u - dt, -2t - 4 = -4u - 4t. Suppose u = 3a - 4a - 1. Which is smaller: -4/7 or a? a Suppose -15 = 5m - 2m. Which is greater: -3 or m? -3 Let b be 3 + (-8)/(-6) - 4. Let w = 3 + -4. Let y = -1 + w. Which is smaller: b or y? y Let y = 31/46 + -4/23. Suppose 2n - 7n = 20. Let t be 1 - 2 - n - 1. Which is smaller: y or t? y Let g = -5 + 26/5. Let j = -5 + 3. Let m = -2 - j. Which is smaller: g or m? m Let y = 0.002 - 0.002. Let t = 8.9 - 0.9. Let x = t - 7.7. Is x bigger than y? True Let w = -0.239 - -0.039. Is w less than or equal to -8/5? False Let t(z) = -z2 + 7z - 6. Let x be t(6). Is x <= 1/22? True Let g = -8.13 + 8.3. Which is smaller: 0 or g? 0 Let m(x) = x*3 + 12x*2 + 11x + 1. Let f be m(-11). Suppose 6g - 4g = 0. Is g equal to f? False Let o be (-4)/(-14) + (-28)/49. Is o > -1? True Let n = 0.021 + 2.279. Let c = n - 2. Let y = -1.3 + c. Which is smaller: y or 2/7? y Let y = -6 + 11. Suppose -5u + 3f = 11, 2u = -2u - yf + 6. Is -2 != u? True Let b = 25/7 - 639/175. Which is smaller: 1 or b? b Let z = 5 - 4.5. Let c = 4.3 + -5. Let p = z + c. Is p smaller than 0.1? True Suppose 3t = 3m - 3, 2m - 13 = -2t - m. Let i be (-1)/4t2. Is i equal to -1/13? False Let s = 31 + -21. Let r be s/6 + (-2)/3. Let i be ((-26)/156)/((-6)/(-4)). Is r bigger than i? True Let t be (-3)/((-6)/(-4)) - -3. Is t less than or equal to 33? True Let z be (2/204)/((-2)/(-9)). Which is smaller: z or -1? -1 Let k = 1 - 0.9. Let x = -3 + -1. Let f = x - -3. Is k less than or equal to f? False Let h = -1/506 - 2523/3542. Are h and -1 non-equal? True Suppose r = -0r + 4i + 9, -3i = 6. Let z = 2.32 - -1.73. Let o = 4 - z. Which is smaller: r or o? o Suppose -5g = -47 - 78. Is g smaller than 25? False Let v = 0.14 + 5.86. Let y = 0.2 + 0.03. Let h = -0.13 + y. Which is greater: v or h? v Suppose -3z + 2m + 2m = 0, m = 4z. Suppose -2w + 10 = z, -4u + w = 2w + 11. Which is bigger: -10/3 or u? -10/3 Let a = 3.9 + -1.9. Is a smaller than 5? True Suppose 8y = 9y - 3. Let g = -7 - -10. Is y bigger than g? False Let y(m) = -m*2 - 2m + 5. Suppose r = 5r + 16. Let g be y(r). Which is greater: -2 or g? -2 Let i = -0.6 + 0.6. Let s = i + -0.1. Are s and 1/2 equal? False Let g = -87/34 - 1975/238. Is g greater than or equal to -12? True Suppose -2m = -6m + i + 24, 0 = -3m - 5i - 5. Suppose -15 = mn, -5g - 56 = -n + 3n. Is -12 greater than g? False Suppose 0o - o = 15. Which is smaller: o or -16? -16 Let a = 88 + -113. Is a greater than -27? True Let w be (1/6)/((-4)/(-24)). Which is smaller: 2/33 or w? 2/33 Let a be (-18)/5 + (-5)/(-5). Which is smaller: -4 or a? -4 Let z be (4/16)/(55/40). Is z > -3/7? True Let f = 0 - 4. Let c = -6 - f. Is c != 0.1? True Suppose 0 = 2i + i - 3. Is i less than 13/6? True Let x be 3/(21/2) + (-52)/182. Which is smaller: 3 or x? x Let o = -7.97 + 8. Suppose 3k = 4p - 12, 4p + 2k - 1 + 9 = 0. Which is bigger: o or p? o Let b be 734/12 + (-10)/(-5). Let x = 63 - b. Let v(z) = z + 2. Let f be v(-3). Is x bigger than f? True Let c be (-6)/(-27) + (-40)/18. Which is smaller: c or -1? c Let w = 7468/14115 - -4/941. Let z = 17/60 - w. Are -1 and z nonequal? True Suppose -v + 5 = q - 2v, v - 3 = -3q. Let k be 1/q + 9/(-26). Suppose 0 = 2j + 1 + 1. Which is bigger: k or j? k Suppose 2t - 2r = 3r + 27, 0 = -5r - 25. Let o be 0(0/1 - t). Suppose o = 2v - 5v + 3. Is 3/2 at most as big as v? False Let d(q) = -12q2 - 1. Let o be d(1). Are -11 and o unequal? True Let p(t) = -3t*2 + 48t - 1. Let f be p(16). Let y = -1058/11 + 96. Is f at most as big as y? True Suppose -2t + 7416 = -3n - n, -5t = 4n - 18526. Let u = t - 10910/3. Let l = -70 + u. Which is greater: l or 1/3? 1/3 Suppose 2q + 5d = 4, -4q + 33 = q + d. Suppose -4y - 10 = -34. Is y smaller than q? True Let w = 11/4 + -4. Let c be ((-10)/6 - -2)(-5 + 2). Which is smaller: c or w? w Let h = -5.2 - -5. Let i = -0.5 + 0.5. Let o = 0.1 + i. Which is smaller: o or h? h Let i(q) = -6q - 4. Let j be i(-2). Which is greater: 0.2 or j? j Let b(p) = -2p + p3 + 3p*2 - 1 - 1 + 1 - 3p. Let f be b(-4). Which is smaller: 1/5 or f? 1/5 Let x(g) = -g*2 - 4g - 2. Let l be x(-3). Suppose 5r - l = -31. Are r and -6 unequal? False Let d be (-76)/(-18) - 2/9. Suppose 4w + 2n - 10 = 3w, 0 = dn - 20. Let m be 2/(-11)(-1 + w). Which is greater: 0 or m? m Suppose -4g + 26 = -0l + l, -l + 16 = -g. Suppose 0 = -0c - 3c + l. Which is bigger: c or 7? 7 Let f(k) = -k*3 - 10k*2 - 2k - 16. Let m be f(-10). Which is smaller: 2 or m? 2 Let s = 0.09 + -0.29. Which is smaller: s or 4? s Let j = -6 + 5.7. Let d = -0.8 - j. Let y = 1.5 + d. Which is bigger: y or 2/7? y Suppose y + 1 = l + 7, y - 3l = 4. Let t be y/10 - 3/6. Which is greater: t or -1/3? t Suppose -7 - 1 = -4f. Suppose -4p + f = -3p. Which is bigger: p or 4? 4 Let x be 8 - 6 - -1 - (-10)/(-4). Let i be 33/1264. Is i less than or equal to x? True Let r be 25/(-30) - (-2)/(-12). Which is smaller: r or -2/13? r Suppose -2j = 2j. Let l be 2 + 5/(15/(-9)). Is j greater than l? True Suppose -2 = -x - 0x. Let w(j) = -3j + 6. Let g be w(x). Is -1 != g? True Let h be (-29)/(-9) - 18/81. Let p be (4/6)/(h/6). Which is bigger: 0 or p? p Let u = 17.1 - 17. Which is smaller: -5 or u? -5 Let v = 0 + 1. Let c = 1.1 - v. Let q = -301 + 899/3. Do c and q have the same value? False Let k = -20 - -28. Let m = -4 + k. Is m < 2? False Let y be 2 - (1 + (-2)/(-4)). Let g(w) = -w*3 + 6w*2 - 3w + 8. Let q be g(6). Is q equal to y? False Let l(t) = -t*2 + 8t - 7. Let p(y) = y*2 - 5y. Let k be p(6). Let n be l(k). Is n < -1? False Let y = 59 - 61. Is y bigger than -4? True Let x = -11 - -7. Suppose -4*d - d = -15. Let q = d	{ "pile_set_name": "DM Mathematics" }
xpress (1 - z - 1)(-8z + 7z + 15z) + (-z + 2z - 3z)(-z + 0 + 0) as n + pz + fz2 and give f. -12 Rearrange (2 + 4 - 5)(2b - 4b + 5b)(-201 - b + 201)(-4 - b + 4) to ub*3 + p + sb*2 + vb and give u. 3 Express 3u4 - 2 - 43u*4 + 14u4 + u2 + 9u4 - 49u + 15u4 - 2u*3 as du*4 + s + vu*3 + zu*2 + ou and give v. -2 Express -2k - 3k + 4k + 4k + 4k - 5k + 3k - 2k - 2k + (1 + 1 - 3)(-2k + 2 - 2) + (5 - 4 + 1)(23k + 8k - 3k) as l + zk and give z. 59 Express (8 - 8 - 10j2)(24 + 48j2 - 24) as wj*4 + k + lj*2 + zj + qj3 and give w. -480 Express -40 - 2c + 10 + 10 - 26 in the form r + lc and give l. -2 Rearrange 2q*3 + 26q - 4q4 + 36q - 92q + 30 - 5 + 32q to kq4 + xq*2 + n + dq*3 + mq and give m. 2 Express (-5 + 2 + 2)(-42g*4 - 124g + 124g) + 5g4 - g4 - g*4 as ig*4 + z + xg*2 + qg*3 + bg and give i. 45 Express 3s3 - 28s*2 - 74 + 23s*2 + 5s2 + s4 as m + bs + js*4 + ns*2 + zs*3 and give j. 1 Express -5 + 6 - 7 + 28x - 5 - x as q + ox and give o. 27 Rearrange (-u2 + u2 + 3u*2)(-11 - 212u + 11) + (2u*2 - 2u2 - u2)(-1 + 2u + 1) to the form du + x + mu*3 + au*2 and give m. -638 Rearrange 5s + 12s2 - 107s*3 - 4s*2 + 105s*3 to the form ps*3 + z + js + rs2 and give j. 5 Rearrange -20s*3 + 12s*3 - 5s*2 + 7s*3 + 1 + 2s*4 to the form ns*4 + cs*2 + d + js*3 + ks and give d. 1 Rearrange (0 + 2 - 4)((1 + 1 - 4)(1 - 1 + 1) + 5 - 3 - 1)(118h - 62h - 63h) to q + lh and give q. 0 Rearrange 191w*2 + 224w*2 + 34w*2 to l + yw + rw2 and give r. 449 Rearrange 15g + 929 - 929 - 3g2 + (-g + 5g - g)(2 + 2g - 2) to the form s + pg2 + ug and give p. 3 Express s*3 - 6s*2 + 13s*2 - s - 34 - 9s*2 + 2s*3 in the form ks + js2 + m + fs*3 and give j. -2 Express 229q*3 - 76q*3 - 10q*2 + 13 - 75q3 + q4 - 78q3 as sq + tq3 + fq*4 + nq*2 + m and give f. 1 Express (-3c*3 + 0c*3 + 5c*3)(1286 + 1305 - 2799)(-5 + 3 + 0) in the form dc*2 + o + qc + rc3 and give r. 832 Rearrange -8b - 12b2 + 4b - 14b2 + 74b*2 - 26b*2 to the form lb*2 + i + ob and give o. -4 Express 6 + l*3 - 1 - 6 + 7l*2 - l + 8l*2 + 27l*4 as zl*3 + pl*4 + bl + v + ol2 and give o. 15 Express -d + 91d*2 - 111d*2 - 200d2 + d3 as qd2 + y + pd*3 + hd and give q. -220 Express (-1 - 4 + 1)(-3u + u - 2u)(5 - 2 - 15)(3u - 2u - 2u) as l + du2 + pu and give d. 192 Express -d + 2 + 49d3 + 123631d*2 - 123631d*2 as wd*2 + rd*3 + q + sd and give q. 2 Express (7l + 0 + 0)(-l*2 + 3l*2 - 6l*2) + 4l3 + l3 - 3l3 in the form xl + ml2 + k + bl*3 and give b. -26 Express -4953c*2 + 177c + 100c + 4955c*2 in the form fc*2 + m + oc and give f. 2 Express 5 + 1 - 2 + 6 - 14q - q3 in the form x + vq*3 + gq*2 + pq and give p. -14 Rearrange -81x + 16x + 23x + 3 + 21x + 11x to mx + l and give m. -10 Express 3g3 + 0g3 - g3 + (-3g - 1 + 1)(-7g + 5g*2 + 7g) + (1 - g*2 + 4g*2 - 5g*2)(-5g + 2g - 2g) as dg + vg2 + b + og*3 and give o. -3 Express (-1 + 1 + 2v*2)(601v + 208v - 134v)(-2 + 0 + 0) in the form bv2 + s + rv + av3 and give a. -2700 Rearrange -s2 - 6s4 - s4 + 2s4 + s + 3s*4 - 27 - 15 to ts*3 + b + ns + rs2 + ks*4 and give k. -2 Rearrange (2420 - 1520 - 1783)(z*3 + z - z) to the form y + xz + gz3 + bz2 and give g. -883 Rearrange 309 + t2 - 3t2 + 1087 + 134 + t2 to wt + m + rt2 and give r. -1 Rearrange 0x*3 - 8x*2 + 21x + 2 - 2 - 24x - 6x*3 to the form f + tx + bx3 + rx*2 and give b. -6 Rearrange (-7d + 30d + 2d)(16 - 18d*2 - 16) to vd + y + bd2 + xd*3 and give x. -450 Rearrange 704o - 703o + 5 + 9 to the form a + po and give p. 1 Rearrange ((-2o + 2o + 3o)(-1 - 1 + 3) - 3o + 8o - 2o)(-2 - 2 + 9) to mo + r and give m. 30 Express -7o*2 + 0 - 4 + 0 - 4o*2 - 5o*2 in the form c + ho + lo2 and give c. -4 Express (-15n + 8n - 20n)(222 + 49n*2 - 222)(3n - 7n + 3n) as in*3 + m + fn*2 + wn*4 + gn and give f. 0 Express (-1139v - 340v + 343v)(5v + 0v - 4v) in the form gv + rv2 + s and give r. -1136 Express (1 - 1 - 2)(1 - 1 - 2q) + 0q + 2q - 3q + 4q - q - 2q - q - 1 + 1 + (q - 3q + 0q)(-2 + 9 + 1) as v + hq and give h. -13 Express 16 + 5o2 - 70 - 6o + 6o as m + ao*2 + wo and give a. 5 Express 7w3 + 4w4 - 4 + 1 - w2 - 6w3 + 7 + 0w*3 in the form qw*2 + o + gw*3 + vw + aw4 and give q. -1 Rearrange (469d - d*2 - 469d)(-3336 + 28d*2 + 3336) to the form id*2 + yd*4 + cd*3 + rd + h and give y. -28 Rearrange 5z3 - 8z*3 - 63 + 59 to the form vz*3 + pz + uz2 + d and give d. -4 Express -307 + 434i*2 - 309 + 616 in the form fi + o + ri2 and give r. 434 Express (-5o + 3o + o)(3 - 4 + 3) + 1210 - 12o - 610 - 613 as jo + h and give j. -14 Express (-8 + 3 - 7w + 9w)(0 + 0 + 2 + (4 - 4 - 2)(-14 + 19 - 58))(-2w + 2w - 3w) as o + aw2 + iw and give a. -648 Express 6h2 - 571 + 773 - 4h*2 as ph + b + uh2 and give u. 2 Express 52 - 16l*2 - 28 - 20 in the form wl*2 + ml + a and give w. -16 Express 220h + 305h + h*2 - 1 - 1 - 772h in the form d + fh + zh2 and give z. 1 Express -x2 - 6 + 8 + 5 - 20x - 5 in the form fx + m + yx2 and give m. 2 Express (-63 - 61 + 42 - 20)(6v - 7v + 8v) in the form r + hv and give h. -714 Express (6 - 4 - 5)(c4 - 2c*4 + 6c*4) + 0c4 - c4 + 3c4 + 11c*4 + 6c - 6c - 2c as k + vc2 + uc*3 + nc*4 + tc and give t. -2 Express 8u2 - 3u*2 - 5u*2 + 20 + 1 - 8u*2 in the form z + qu*2 + ru and give z. 21 Express w + w*4 + 20w*2 - 149w*3 + 2w - 3w + 150w*3 in the form cw*3 + ow + zw4 + f + qw*2 and give z. 1 Express 216f*2 + 3 - 5f*3 - 1 + 2f*4 - 214f*2 - 2f in the form uf3 + m + xf*2 + df + jf4 and give u. -5 Express 3o - 28o2 - 31 - 25 + 56 as do + k + ho2 and give h. -28 Express 635k2 - 2 + k3 - 656k2 - 3k*4 + 2 in the form ck + zk3 + tk*2 + l + ak*4 and give z. 1 Rearrange (-2l + 0l + 0l)(-4 + 1 + 2) + 796 - 848 + 16l - 15l to al + w and give a. 3 Express 6l - 193 + 47 - 6l - l*2 as vl*2 + al + q and give q. -146 Express (-2g + g - g)(50 + 63 - 31)(-2 + 2 + 2g*3) as ag*4 + m + fg*3 + dg*2 + cg and give a. -328 Rearrange ((-1 + 0 + 3)(0a + 2a + 0a) - 2a + 0a + a)(-46a*2 + 164 - 164) to ba + la3 + v + wa*2 and give l. -138 Rearrange (18m - 38m + 13m)(3m - 2m + 2m) + 4m2 + 68m + 3 - 68m + (2m*2 + 4m*2 - 5m*2)(2 - 3 + 0) to q + dm + um*2 and give u. -18 Rearrange (-81 + 28 - 4)(4l + 7l - l*2 - 11l) to hl2 + ol + z and give h. 57 Express (-1 + 3 - 5)(-1809 - 58i*2 + 1809 + 2405i*2) as mi + s + di2 and give m. 0 Express -245 + 123 + 126 + 36f*2 in the form yf*2 + r + nf and give y. 36 Express c*3 + 3c*4 + 6c*2 - 2c*3 + 2c*3 - 5c*2 - 20c in the form ac3 + yc + rc2 + jc4 + m and give r. 1 Rearrange 1 - v2 - 32v3 - v + 31v*3 + 3 - 3 to the form jv*3 + lv + xv2 + r and give j. -1 Rearrange 170m - 2 - 4m2 - 86m - 86m to the form gm + i + wm2 and give w. -4 Express ((-3w + 2w + 2w)(0 + 0 + 2) + 4 + 2w - 4 - 4w + w + 0w)(-4 + 4 - 7w) in the form dw + aw*2 + b and give a. -7 Express (-424j + 460j4 + 424j)((4 + 1 - 3)(0 + 3 - 4) + 5 - 2 - 4)(-4 + 1 + 1) in the form wj*3 + cj + lj2 + z + mj*4 and give m. 2760 Rearrange (4f*3 - 4f*3 + 2f*3)(2 + 2 - 9 + (-3 + 2 - 1)(1 - 2 + 2)) to the form vf + af3 + sf*2 + q and give a. -14 Rearrange (4 + 351n - 347n + 613)(0 - 2n + 0) to yn + h + tn2 and give y. -1234 Rearrange (2 + 2y - 2)(2y*2 - 5y*2 + 2y*2) - 2230706y + 2230706y + 3569y*3 to u + fy*2 + ry + zy3 and give z. 3567 Rearrange (-a + a - a)(-10027 - 100a + 10027) + 3a*2 + 5a*2 + 6a*2 to the form y + da + xa2 and give x. 114 Rearrange f + f4 + 0f - f*2 - 4f - 1 + 2f + 14f*3 to the form u + mf*4 + pf*2 + kf*3 + xf and give k. 14 Rearra	{ "pile_set_name": "DM Mathematics" }
igit of z? 2 Let j be (-574)/(-4) - (-39)/(-26). Let t = -96 + j. What is the units digit of t? 6 Let b = 82 - 63. Let m = -5 + 9. What is the units digit of 1b - 12/m? 6 Suppose 0l + l + f = 3, 3l - f - 5 = 0. Let j be 5/l - (-5)/10. Suppose 0 = 3d - 3t - 99, 0 = d - 3t - 40 - j. What is the units digit of d? 8 Suppose 6 = 3k, -2z - 3k + 6 = 3z. Suppose -5r + 2r + 354 = z. What is the tens digit of r? 1 What is the units digit of 207/168 - 757/(-6)? 7 Let n(t) = 2t3 - t2 + 2t + 6. Let f be n(4). Suppose -v + 4v - f = 0. What is the units digit of v? 2 Suppose 3g + z = -3z + 35, 0 = 5g + 3z - 51. Suppose 0 = -4h + gh. Suppose o + 27 = -3t + 135, -4t + 4o + 128 = h. What is the tens digit of t? 3 Let z be 264/42 - 2/7. Suppose -4o - g - 10 = g, 0 = -o - 4g - z. What is the units digit of o/7 + 226/7? 2 Let v be ((-1)/(-3))/((-1)/(215 + 4)). Suppose -3t + 0t - 324 = 0. Let n = v - t. What is the units digit of n? 5 Suppose -3p - 10 = c - 0c, 12 = -2c - 4p. Let y be c + 0 - (-46)/(-2). Let w = 4 - y. What is the tens digit of w? 2 Suppose 3o + 4i - 7 + 0 = 0, 5i - 4 = o. Let s be o/3 - 22/(-6). Suppose -16 = -sv, 4y - 67 = y - 4v. What is the units digit of y? 7 Let o(t) = 4t. Suppose 0n - 11 = -5n - 2h, -2n - 3h = 0. Suppose 4m = 3q + 55, 0q = m + nq + 5. What is the units digit of o(m)? 0 Suppose 5g + 16146 = 28g. What is the hundreds digit of g? 7 Let i(f) be the first derivative of -f2 + 5f + 12. What is the units digit of i(-4)? 3 Suppose -5s = 5b + 240, 3s - 2s + 4b + 63 = 0. Suppose 4a - 219 = 2p + 111, -5p = -5a + 415. Let y = a + s. What is the units digit of y? 9 Suppose 3095 = 9a - 127. What is the tens digit of a? 5 Let j(i) = 14i2 + i + 95. What is the thousands digit of j(11)? 1 Let h(w) be the second derivative of -w3/2 + 18w*2 + 3w. What is the units digit of h(11)? 3 Let c(d) = -d*3 + 37d*2 - 11d + 25. What is the tens digit of c(33)? 1 Let t(j) = 718j - 66. What is the tens digit of t(2)? 7 Let o(a) = a3 + 11a*2 - 10a - 123. What is the hundreds digit of o(-8)? 1 Let x(v) = -v*2 - 5v + 10. Let h = 11 - 18. Let k be x(h). Let b = k + 8. What is the units digit of b? 4 Suppose 0 = 7c - 9c + 1794. Suppose -c + 347 = -3q + 4o, 3o = 3q - 549. What is the units digit of q? 2 Suppose -54 = -2t + 4q - 20, -t - 5q = 18. Suppose -tc + 2001 = 811. What is the units digit of c? 0 Let r be (1 - 15/9)/(4/(-318)). Suppose -3h + o = -r, 5o = 2o - 6. What is the tens digit of h? 1 Suppose 4d = 4607 + 109. What is the thousands digit of d? 1 What is the thousands digit of (-26587)/(-6) + 62/(-372)? 4 Suppose 0 = -4u - 6b + b - 5, 0 = b + 5. Suppose uq - q - 392 = 0. What is the tens digit of q? 9 Suppose -b + 245 = 3z - 938, 5z - 3541 = -3b. What is the thousands digit of b? 1 Suppose 3361 = 2w - 489p + 494p, 3w = -5p + 5039. What is the thousands digit of w? 1 Let f be (1/3)/((-1)/(-6)). Suppose p + 11 = fp. What is the tens digit of p? 1 Let y be (7 + -4)(-2)/1. Let v be (-58)/7 + y/(-21). What is the units digit of v/(-5)(-5)/(-2)? 4 Let i = 3619 + -2278. What is the hundreds digit of i? 3 Let w(y) = 39y2 + 2y - 1. Let s be w(1). Suppose 0 = -2d + 6d + 2j + 6, -2d - 2j - 4 = 0. What is the tens digit of (d + -19)(-30)/s? 1 Let v = -46 + 15. Let u = 33 + v. Suppose -q - 339 = -5p - 0q, 2p + uq - 126 = 0. What is the tens digit of p? 6 Let c(a) = -a*3 - 4a*2 - 6a + 2. Let m(i) = i*2 + i + 1. Let l(p) = -c(p) - 3m(p). What is the tens digit of l(3)? 4 Let s(i) = 2i - 13i + 12 + 6 - 6. What is the units digit of s(-6)? 8 Suppose 5u - 564 = -u. Suppose 0 = -2v + 2g + u, 67 + 32 = 2v - 3g. What is the units digit of v? 2 Let d = 1033 + -518. What is the hundreds digit of d? 5 Suppose 6903 = 5t + 2s, 16t - 2s - 4129 = 13t. What is the hundreds digit of t? 3 Let r = 834 - 378. What is the units digit of r? 6 Let i(o) = o*3 - 7o*2 - 24o + 49. What is the thousands digit of i(14)? 1 Suppose 4j - 2w = -2, 5w - 25 = -5j + 2w. Suppose 2v + jv - 4 = 0. What is the units digit of v? 1 Suppose 3b - 195 - 231 = 0. Let v = b - 85. What is the tens digit of v? 5 Suppose 927 - 9614 = -7w. What is the hundreds digit of w? 2 Let p be (-106)/(-34) + -4 + 6/(-51). What is the units digit of 34 + -37 + (p - -143)? 9 Let l = -812 + 802. Let h = -79 - 16. What is the tens digit of (-1 - -7)h/l? 5 Let a = 96 + 8. What is the hundreds digit of a? 1 Suppose 5q + g = 16, -4q - g + 15 = 2g. Suppose 0v - 146 = -v + 5k, 130 = v + qk. What is the tens digit of v? 3 Let a = -7 + 4. Let b be (-8)/(3/3 + a). Suppose -z + u = -u - 14, 16 = bu. What is the units digit of z? 2 Let f = 18 - 80. Let g = f - -174. What is the units digit of g? 2 Suppose 25u - 18u = 2002. What is the hundreds digit of u? 2 Suppose 18h + 39 = 7509. What is the hundreds digit of h? 4 Suppose 51m = 49m + 1088. What is the units digit of m? 4 Let g = 738 - -39. What is the hundreds digit of g? 7 Let a(x) = -x*3 + x + 33. Let l be a(0). Suppose -l = -5p - 8. Suppose -15 = -5i + po, -3o = 4i - 2o - 2. What is the units digit of i? 1 Let s(u) = -49u*3 - 11u*2 - 1. What is the tens digit of s(-4)? 5 Let j be 02/4(-4)/(-6). Suppose 0 = -4t - jt + 3b + 248, 4b = 0. What is the tens digit of t? 6 Let r = 7 + -4. Suppose 4u - 21 + 0 = -i, ri = 5u + 114. Suppose 0 = f - 4f + i. What is the units digit of f? 1 Let u(b) be the first derivative of b5/24 + b4/3 - b3 + 2. Let c(y) be the third derivative of u(y). What is the units digit of c(6)? 8 Let r = -3374 - -6691. What is the thousands digit of r? 3 Suppose 7g - 8g = 2. Let f(c) = 11c2 - 1. What is the tens digit of f(g)? 4 Let b = -35 + 19. Let g = b + 21. What is the units digit of g? 5 Let g(p) = -p3 + 11p + 14. Let j = -47 + 42. What is the tens digit of g(j)? 8 Let z(u) = 7u*2 + 5u + 0u - 3u + 24 - 11u. What is the units digit of z(6)? 2 Let c be (-6)/2-23387/14. Suppose c = 22z - z. What is the units digit of z? 7 Let w be ((-6)/(-3) - -109)(-6)/3. What is the units digit of (1/((-3)/w))/(12/18)? 1 Suppose 13065 = -5x + 8x. What is the thousands digit of x? 4 Suppose 13 = 4z - 7. Let o be 54/15 - (-2)/z. Suppose -l - 1 - 17 = -2w, -38 = -2w - ol. What is the tens digit of w? 1 Suppose 396 + 3570 = 2l. What is the thousands digit of l? 1 Let h(z) = -1. Let o(d) = d + 3. Let i(t) = -2h(t) - o(t). What is the units digit of i(-6)? 5 Suppose 5l = -4 - 26. Let d be 81/l - (-1)/2. Let c = 13 - d. What is the tens digit of c? 2 Let q(k) = 58k2 + 19k - 130. What is the tens digit of q(6)? 7 Let p = 3498 - 1094. What is the tens digit of p? 0 Let n = 28 + -3. Suppose -4r + n = -39. Let z = 22 - r. What is the units digit of z? 6 Suppose -17m + 1002 = -3724. What is the hundreds digit of m? 2 Let w(x) = -2x - 7x + 2x - 6. Let p be (-3)/9(-6)/(-4)6. What is the tens digit of w(p)? 1 What is the hundreds digit of -2 - (-13)/6 - (-36132)/72? 5 Let l(t) = -100t - 134. What is the tens digit of l(-9)? 6 Let d be (3 + 21/(-6))-56. Suppose -y - d = -83. What is the tens digit of y? 5 Suppose 5f - 150 = 650. Let u = 250 - f. What is the tens digit of u? 9 Suppose -3i + 8 = -4. Let r(x) = -x - i + 1 - x + x. What is the units digit of r(-4)? 1 Suppose k - 7 = -3. Suppose 49 = kq - 127. Suppose -3r + 76 = -q. What is the tens digit of r? 4 Let j be -13 + (-6 - -18). Suppose -147 = 2w - jw. What is the units digit of w? 1 Suppose 85 = 12h - 7h. Let o(m) = 8m - 7. What is the units digit of o(h)? 9 Let d(p) = -p3 - 3p*2 + 3p + 5. Let x be d(-4). What is the hundreds digit of x/15(5 + (-3 - -363))? 2 Let l be (-4)/3((-18)/(-4))/(-1). Suppose lb - 2b = c - 8, 43 = 2c + b. What is the units digit of c? 0 Let u be 2/(((-12)/(-3))/(-12)). Let g be (-264)/18 - (-2)/u. What is the units digit of 2/10 + (-312)/g? 1 Let h = -84 + 142. Suppose -p - h = -2x, -x + 4x - 3p = 84. Suppose -2y = -7y + x. What is the units digit of y? 6 Let a(d) = d*3 + 7d2 + d + 33. What is the units digit of a(-7)? 6 Let o(l) be the first derivative of -l3/3 - 5l2/2 - 2l + 6. Let z be o(-4). What is the units digit of z/10 - (-58)/10? 6	{ "pile_set_name": "DM Mathematics" }
is the highest common factor of b and 17? 17 Let c = 9 + -13. Let p = -5 + c. Let l be 86 - (1 + p/3). Calculate the highest common divisor of l and 11. 11 Let i(b) = 0b - 6 - 3b + 1 - 7. Let v be i(-7). Let l(h) = h*3 - 9h2 + h + 11. Let k be l(v). What is the greatest common divisor of k and 30? 10 Let r(m) = m3 - m*2 + 3m + 8. Let f be r(0). Suppose 0 = k - j - 9, -2k - 3j + 24 = -fj. What is the highest common factor of 49 and k? 7 Let y = 199 + -101. Suppose 0 = 3w - 53 - 31. Calculate the greatest common factor of w and y. 14 Suppose 19 = 3i + 2u, 4u - 5 = i - u. Suppose 0h - 3h = -90. What is the greatest common divisor of h and i? 5 Suppose 8r - 5r = -a + 41, -2r = 3a - 32. What is the highest common factor of 767 and r? 13 Let i be ((-26)/4)/((-59)/236). What is the highest common factor of i and 91? 13 Suppose l + 4 = 0, 4o = 9o + l - 11. What is the greatest common divisor of o and 141? 3 Suppose 11h + 120 = 14h. Let t = h - 27. What is the highest common divisor of t and 117? 13 Let k = 278 + -263. Suppose 209 = 4d + 29. What is the greatest common factor of k and d? 15 Let r be ((-21)/(-12) - 1) + (-3537)/12. Let q be (r/(-6) - 7)/(2 + 0). Calculate the greatest common factor of 105 and q. 21 Let z(k) = 20k - 12. Let o = 4 + 2. Let i be z(o). Suppose i = 6m - 60. What is the greatest common divisor of 42 and m? 14 Suppose -2t - 38 = -p, 3p = -2p + 5t + 175. Suppose g - 2 = 2k, 2g + 3k - 26 - 13 = 0. Calculate the greatest common factor of g and p. 4 Let c be (216/90)/((-4)/(-30)). Calculate the greatest common divisor of 42 and c. 6 Let v be (16/(-12))/((-8)/(-126)-3). Calculate the greatest common factor of 14 and v. 7 Suppose 4i + 305 = -2y + 1091, -5i = y - 405. Calculate the greatest common factor of y and 10. 5 Let b(m) be the second derivative of m4/12 + 48m*2 + 4m. Let w be b(0). Calculate the greatest common divisor of w and 12. 12 Suppose 0 = 2f - 2, -5w + 2f = 4f - 52. Let q(a) = -a*3 + 9a*2 - 11a + 29. Let h be q(7). What is the highest common factor of h and w? 10 Suppose 4w - 3q - 41 = 0, -3w + q = -0q - 37. Calculate the greatest common factor of 126 and w. 14 Let l be (3/(-2))/(33/(-110)). Suppose 2v - 16 = -2n, -14 = -3n - lv + 14. Let j be n/4 + 132/8. What is the greatest common divisor of 18 and j? 18 Let u(z) = -8z - 10. Let o be u(-9). Let l(k) = -3k*3 - 16k*2 - 3k + 3. Let h be l(-6). Calculate the greatest common divisor of o and h. 31 Suppose 0 = -29q + 5 + 169. What is the highest common divisor of 126 and q? 6 Suppose -p = -0p - 1. Let c(d) = d - 1. Let b be c(p). Suppose 2i + 74 = 2z + 2z, z + 4i - 14 = b. Calculate the highest common divisor of 144 and z. 18 Suppose -2y + 622 = 2b, 4y = 5b - 456 + 1655. Calculate the highest common factor of 68 and y. 34 Let f be (-1)/(-2) - (-34)/4. Let x be f/(1/2 - -1). Suppose v - x = -1. Calculate the highest common divisor of v and 30. 5 Suppose -4a - 2z = -100, 6a - 5z - 75 = 3a. Let y = a + -13. Calculate the greatest common factor of 60 and y. 12 Let h = -1374 + 688. Let q be h/(-10) - 8/(-20). Calculate the greatest common divisor of q and 46. 23 Let n = 47 - 18. Let q(l) = 12l*2 - 8l + 5. Let c be q(2). Let z be (c + -35)(-145)/(-2). What is the greatest common factor of z and n? 29 Suppose 0 = r - 8r + 252. Let g be 14/21-66. Let s = g + r. What is the greatest common factor of 8 and s? 4 Suppose 5q - 8i - 91 = -4i, -q = -3i - 27. Let r = -169 - -244. What is the greatest common divisor of q and r? 15 Let v be (-2)/(-7) - -2(-183)/(-42). Suppose 5f = -3g + v, -4 = -0g + 2g. Calculate the greatest common factor of 48 and f. 3 Let u(z) = 2z + 2. Let j be u(2). Let g = j - -14. Let b = -28 + 208. Calculate the greatest common factor of b and g. 20 Suppose -5z = -5q - 145, -1 - 1 = -2q. What is the greatest common factor of z and 370? 10 Let w(x) = 10x - 5x - 4x + 2. Let k be w(0). Let s(n) = n*2 - 7n + 4. Let j be s(9). Calculate the highest common factor of k and j. 2 Let r be ((-20)/(-6))/(1/39). Suppose -2x = -3x + r. Let d be ((-26)/(-5))/(-5(-2)/50). Calculate the greatest common divisor of x and d. 26 Let h be -1 - 4 - (9 + -9 - 4). Let f(r) be the first derivative of 6r3 - r2 - r - 1. Let z be f(h). Calculate the greatest common divisor of 152 and z. 19 Suppose -8c + 202 + 2230 = 0. Let b = 0 - -38. Calculate the highest common divisor of b and c. 38 Let u be (-1549)/(-7) + (-28)/98. What is the highest common factor of 51 and u? 17 Let n(q) = q2 - 8q + 15. Let f be n(8). Let l = 3 + 1. Suppose -1 = -4y + 4m - 9, 0 = -4y - lm + 32. What is the greatest common divisor of f and y? 3 Let s(a) = -a3 - a2 + 3a. Let b be s(-3). Suppose 77 - b = 4p. What is the highest common divisor of p and 17? 17 Suppose 0 = 3s - 3w - 3, 0w = s - 2w - 2. Suppose 2k - 2 + 0 = s, -3h - 3k = -102. Calculate the greatest common divisor of h and 132. 33 Let l be -8 - (-4 - 5) - (-4)/2. Suppose -lh + 21 = -3c - 12, 0 = 2h + 4c - 4. Calculate the highest common factor of h and 16. 8 Let r(k) = -6k*2 + 2k + k*3 - 7 + 0k*3 + 17. Let d be r(6). Suppose 3m = -3o + d - 4, 8 = o + 3m. Calculate the greatest common divisor of o and 20. 5 Suppose 0 = 4u - u - 18. Suppose 0 = -h - 0h - u. Let v = h + 9. What is the greatest common factor of 21 and v? 3 Suppose h = 15 + 97. Let t = 80 + -64. Calculate the greatest common divisor of h and t. 16 Let k(f) be the first derivative of f*3/3 - 23f*2/2 + 23f + 9. Let a be k(22). Calculate the highest common factor of a and 11. 1 Suppose 6h = 2h + 24. Let x(a) = a*2 - 2a + 8. Let n be x(h). Calculate the greatest common factor of n and 16. 16 Let o(v) = -2v2 - 15v - 15. Let k be o(-5). What is the highest common factor of k and 35? 5 Let i = 60 + 2. What is the highest common divisor of i and 217? 31 Let z(o) = o + 3. Let n be z(-3). Suppose 4w - 3w - 12 = n. Suppose -61m - 240 = -66m. Calculate the highest common divisor of m and w. 12 Let p(n) = -n*3 + 2n*2 + 2n + 2. Let y be p(-4). Suppose -m = 4m - y. Let a = 121 - 49. Calculate the highest common divisor of a and m. 18 Let i = -15 - -19. Suppose -ix + 5x = 2. What is the highest common factor of x and 22? 2 Suppose 0 = -3h + 4x + 16 + 15, 17 = 5h + 2x. Calculate the greatest common divisor of 160 and h. 5 Suppose 30 = 2y + y + 5x, y - 21 = 2x. Let t(s) = -s*3 + 10s*2 - s - 12. Let k be t(9). What is the highest common factor of k and y? 15 Let r = -31 - -34. Suppose 2y + y + f = 198, -4f - 198 = -ry. What is the highest common factor of 44 and y? 22 Let s = -210 + 229. What is the highest common divisor of s and 361? 19 Let r(g) = g*2 + 0g - 4 + 3 + 2g + 3g. Let w be r(-6). Suppose 3f - 40 = -z - 0f, 3z - 160 = -f. Calculate the greatest common divisor of w and z. 5 Suppose 164 = 3u - 5m, 2u - 112 = -0m + 4m. Let l = 7 - 5. Suppose -lf + 52 = -u. Calculate the greatest common factor of 25 and f. 25 Let d(y) be the third derivative of -y6/120 + y5/20 - y3/6 + y2. Let s be d(2). Let h = 2609 - 2576. Calculate the greatest common factor of s and h. 3 Let d = 312 - 300. Calculate the highest common divisor of 132 and d. 12 Suppose -2z + 10z - 120 = 0. Let u be (-4)/(42/(-4)). Suppose -4f - uj = -0f - 478, -j + 599 = 5f. Calculate the highest common factor of f and z. 15 Let r be 2/10 - (-12)/(-10). Let g be 16/((-4)/(2/r)). Let n(a) = a*3 - 7a*2 - 7a - 4. Let b be n(g). Calculate the greatest common factor of 6 and b. 2 Let d = 66 - 138. Let i = d + 87. Calculate the highest common factor of 75 and i. 15 Let u(a) = 0a - 13 - 3a - 22a + a3 + 11a*2. Let f be u(-12). What is the highest common divisor of 13 and f? 13 Let u be -1864/18-6. What is the highest common divisor of 806 and u? 62 Suppose 0 = 4b - 2o - 28, 0o - 4o - 26 = -2b. Let q(m) = -m*3 + 6m*2 - 1. Let f be q(b). Calculate the highest common divisor of 120 and f. 24 Suppose -c = -4f + 65, -6f + 2f + 3c = -59. Suppose -h - 23m = -27m - 37, -4h - 2m + 58 = 0. What is the greatest common factor of h and f? 17 Suppose 3z = 6, z = -2*r - r - 127. Let m = -15 - r. What is the highest common factor o	{ "pile_set_name": "DM Mathematics" }
What is prob of picking 1 j, 2 m, and 1 r? 9/340 Two letters picked without replacement from {r: 3, t: 1, o: 6, d: 2, z: 2, k: 4}. Give prob of picking 2 z. 1/153 Two letters picked without replacement from xxxxxxqxxxxxxxx. What is prob of picking 2 x? 13/15 Calculate prob of picking 1 r, 1 w, and 1 u when three letters picked without replacement from uuwwuwwuuuurw. 35/286 Calculate prob of picking 2 o and 1 r when three letters picked without replacement from {l: 5, u: 3, r: 2, o: 2}. 1/110 Three letters picked without replacement from biffifrffxirifrifb. What is prob of picking 1 f and 2 r? 7/272 Calculate prob of picking 1 r and 1 q when two letters picked without replacement from qqmqqqqqqrqqmrqqqqmq. 3/19 Two letters picked without replacement from ayya. What is prob of picking 2 a? 1/6 Four letters picked without replacement from qotqtooq. Give prob of picking 1 o, 2 t, and 1 q. 9/70 Three letters picked without replacement from qyycyyc. What is prob of picking 1 y, 1 q, and 1 c? 8/35 Calculate prob of picking 1 s and 1 k when two letters picked without replacement from ssskkuspuo. 8/45 What is prob of picking 1 t and 1 u when two letters picked without replacement from {t: 4, u: 7, l: 2, w: 2, i: 1}? 7/30 Three letters picked without replacement from fjqjdqdjdlfdffff. What is prob of picking 3 j? 1/560 Calculate prob of picking 1 w, 1 h, and 2 r when four letters picked without replacement from {h: 1, a: 1, r: 3, w: 10}. 2/91 Two letters picked without replacement from eomqpoommoo. Give prob of picking 1 q and 1 m. 3/55 What is prob of picking 1 b and 1 e when two letters picked without replacement from {m: 1, b: 2, e: 14}? 7/34 Calculate prob of picking 2 f and 1 h when three letters picked without replacement from ffhhhhefefhhhhf. 16/91 Three letters picked without replacement from {s: 2, z: 1, t: 1, w: 1, f: 2}. What is prob of picking 1 z and 2 f? 1/35 Three letters picked without replacement from lklnl. Give prob of picking 1 n and 2 l. 3/10 Four letters picked without replacement from {z: 9, f: 2, v: 2}. Give prob of picking 4 z. 126/715 Two letters picked without replacement from cwzmzdw. What is prob of picking 1 c and 1 d? 1/21 Calculate prob of picking 3 u when three letters picked without replacement from huhwhhuhwhwuw. 1/286 What is prob of picking 1 n, 1 z, and 1 y when three letters picked without replacement from nyunzbybyabu? 3/110 Four letters picked without replacement from {z: 11, i: 3, r: 1}. What is prob of picking 2 i and 2 r? 0 Calculate prob of picking 1 z and 3 e when four letters picked without replacement from dzeeeehehs. 1/21 Calculate prob of picking 1 m and 3 p when four letters picked without replacement from {m: 3, q: 1, p: 5}. 5/21 Two letters picked without replacement from jkjsskjjjksjjjjjksj. Give prob of picking 1 s and 1 j. 44/171 Three letters picked without replacement from {a: 2, z: 5}. Give prob of picking 1 a and 2 z. 4/7 Three letters picked without replacement from xjsjsujjucsuuscsjgss. Give prob of picking 1 c, 1 x, and 1 s. 7/570 Two letters picked without replacement from eeoweew. Give prob of picking 1 e and 1 o. 4/21 Four letters picked without replacement from vxvvvvxvvxvvvvvvxvv. Give prob of picking 3 v and 1 x. 455/969 Four letters picked without replacement from {a: 5, t: 7}. What is prob of picking 1 a and 3 t? 35/99 What is prob of picking 1 a and 2 d when three letters picked without replacement from dhdrdarhnheh? 3/220 Two letters picked without replacement from {e: 1, n: 7}. Give prob of picking 2 n. 3/4 What is prob of picking 2 x and 2 r when four letters picked without replacement from rrxxrrrrrrrxrrxrrx? 13/51 What is prob of picking 2 d when two letters picked without replacement from ddvvv? 1/10 Four letters picked without replacement from duuuuuuduu. Give prob of picking 4 u. 1/3 Four letters picked without replacement from ggaykgyajg. What is prob of picking 1 j, 2 g, and 1 y? 2/35 Calculate prob of picking 1 j, 2 p, and 1 u when four letters picked without replacement from jmpummquupqm. 1/165 Two letters picked without replacement from {x: 5, e: 15}. What is prob of picking 1 e and 1 x? 15/38 Calculate prob of picking 1 h, 1 f, and 1 a when three letters picked without replacement from hmfhhfafff. 1/8 Calculate prob of picking 1 a and 1 w when two letters picked without replacement from {a: 3, w: 3, p: 1, f: 1, t: 6, s: 3}. 9/136 What is prob of picking 1 e and 1 p when two letters picked without replacement from {k: 1, g: 1, e: 1, d: 1, x: 2, p: 1}? 1/21 Two letters picked without replacement from msvswlvsss. What is prob of picking 1 w and 1 v? 2/45 Two letters picked without replacement from {g: 1, t: 1, z: 9, b: 1}. Give prob of picking 1 g and 1 z. 3/22 Three letters picked without replacement from zqmbbbmqb. What is prob of picking 1 q, 1 z, and 1 b? 2/21 Calculate prob of picking 2 l when two letters picked without replacement from {l: 2, b: 5}. 1/21 What is prob of picking 1 w and 3 r when four letters picked without replacement from {p: 4, e: 1, w: 1, r: 3, u: 2}? 1/330 What is prob of picking 1 n and 1 w when two letters picked without replacement from nwnnnnnn? 1/4 Calculate prob of picking 1 o and 1 a when two letters picked without replacement from {z: 2, a: 1, o: 1, q: 1, p: 4}. 1/36 What is prob of picking 1 c and 2 x when three letters picked without replacement from xcca? 0 What is prob of picking 1 e, 2 y, and 1 h when four letters picked without replacement from {e: 1, w: 1, y: 8, h: 6}? 6/65 Four letters picked without replacement from rykqyoooqhorqkr. Give prob of picking 1 k, 2 q, and 1 y. 4/455 Four letters picked without replacement from {j: 10}. What is prob of picking 4 j? 1 Two letters picked without replacement from {i: 4, d: 3}. Give prob of picking 2 i. 2/7 Four letters picked without replacement from vvpvaaapppavppppp. What is prob of picking 1 p and 3 a? 9/595 Three letters picked without replacement from msmmmii. What is prob of picking 2 i and 1 m? 4/35 Four letters picked without replacement from {q: 5, k: 2, n: 4, w: 1, b: 2}. Give prob of picking 1 b, 2 n, and 1 w. 12/1001 Calculate prob of picking 2 d when two letters picked without replacement from {d: 2, i: 9}. 1/55 Three letters picked without replacement from aaaaa. What is prob of picking 3 a? 1 Calculate prob of picking 2 h when two letters picked without replacement from nhmhmmnmhmmm. 1/22 Four letters picked without replacement from {s: 9}. Give prob of picking 4 s. 1 Three letters picked without replacement from yjmkyzk. Give prob of picking 1 j, 1 k, and 1 z. 2/35 Two letters picked without replacement from ciieeve. What is prob of picking 1 i and 1 e? 2/7 Four letters picked without replacement from {x: 3, q: 3, p: 5, c: 6}. What is prob of picking 1 c, 1 q, and 2 x? 27/1190 Calculate prob of picking 1 m and 1 w when two letters picked without replacement from {w: 9, m: 5}. 45/91 What is prob of picking 1 j and 1 u when two letters picked without replacement from {j: 5, u: 1, z: 3}? 5/36 Three letters picked without replacement from zxfxfiixxwzxizqiwxzx. Give prob of picking 1 z, 1 w, and 1 i. 8/285 What is prob of picking 3 q when three letters picked without replacement from {x: 6, q: 4}? 1/30 Calculate prob of picking 1 a and 3 m when four letters picked without replacement from mmmmmmaam. 5/9 What is prob of picking 4 q when four letters picked without replacement from xqxxqqxqxxx? 1/330 Four letters picked without replacement from yppyp. Give prob of picking 2 y and 2 p. 3/5 What is prob of picking 1 c and 1 d when two letters picked without replacement from {c: 11, l: 3, d: 1}? 11/105 Three letters picked without replacement from {d: 1, y: 1, e: 1, b: 1, n: 1}. Give prob of picking 1 e, 1 d, and 1 b. 1/10 Calculate prob of picking 2 n and 1 v when three letters picked without replacement from {v: 2, n: 2}. 1/2 What is prob of picking 2 j when two letters picked without replacement from wjcojjoycocoooh? 1/35 What is prob of picking 1 z and 2 y when three letters picked without replacement from yyyzzzz? 12/35 Calculate prob of picking 1 p and 1 o when two letters picked without replacement from epeoopeeeeeeeooec. 1/17 Two letters picked without replacement from	{ "pile_set_name": "DM Mathematics" }
ositive. d Simplify i/i*(2/9)(i/(i/(i*(-2/3)i)))/ii assuming i is positive. i(10/9) Simplify (y(-3/5)y*(1/14))/(y/(yyyy*2)yy)(-15/8) assuming y is positive. y(-599/140) Simplify (c(-3/4)/((c/((cc*2/c)/c)c)/c))43 assuming c is positive. c(-129/4) Simplify ((b(-1))(-32/5))(-23) assuming b is positive. b(-736/5) Simplify y*23/(yy/y(-3/22)) assuming y is positive. y(459/22) Simplify (a/a(2/19))(-3/11) assuming a is positive. a*(-51/209) Simplify (ss/((ss/(s/(s/(s4/s)))s)/s)s/(s/(s/s(3/5))))/(s(2/7)/(s(4/9)/s)) assuming s is positive. s(806/315) Simplify (v(-2))(-3/8) assuming v is positive. v(3/4) Simplify (q(-8)/(qq(qqq(2/17)q)/q))43 assuming q is positive. q(-8858/17) Simplify (z*(-3/10)zz(-1/11))/(z(1/9)z3) assuming z is positive. z(-2477/990) Simplify ((qq(2/3))/q(-5))/(q(2/5)qq)(-2/49) assuming q is positive. q(4972/735) Simplify (f13/f)(-28/3) assuming f is positive. f(-112) Simplify i(-5/11)(ii(-10/7))/i assuming i is positive. i(-145/77) Simplify (q(-16/7)/q)/q(-5) assuming q is positive. q(12/7) Simplify (c22)18 assuming c is positive. c396 Simplify (n/(n0n)n3)/(((nn*(2/7)/n)/n)/(nn(n/(n/(nn*(-2)))n)/n)) assuming n is positive. n*(33/7) Simplify (o/(o/(o/(((oo*(-1))/o)/o))o)o/(o/(o(-4/5)o)))7 assuming o is positive. o(77/5) Simplify (u(-1/8))(38/7) assuming u is positive. u(-19/28) Simplify (h(2/13)h)(1/3) assuming h is positive. h(5/13) Simplify (o/(o(1/21)/o)(oo(-6/13))/o)(1/39) assuming o is positive. o(407/10647) Simplify (o(-2/7)/o)(-34) assuming o is positive. o(306/7) Simplify (a2)(-1/6)aa3a*8a assuming a is positive. a(38/3) Simplify (f(-4)f(1/9))/((f/f0)/(f(-2/7)fff)) assuming f is positive. f(-137/63) Simplify (q(-2))5/(q/q1q/(qqq(2/9))) assuming q is positive. q(-79/9) Simplify (jj*(-9))/(jj/(j/j25)) assuming j is positive. j(-34) Simplify h*3(h/(hh/(hh(-4/15)/h)))/h assuming h is positive. h(11/15) Simplify (s(-1/3))(-19)s/s6s/(ss7) assuming s is positive. s(-17/3) Simplify (t4/t)/(t(-6)t)(tt(-2))/t(-2/15) assuming t is positive. t(107/15) Simplify (s(2/11)s/(s/(s(-2/19)s)s)s)(8/7) assuming s is positive. s(1800/1463) Simplify ff(-2/7)/f(f*(-1/5)f)/ff(f/(f*(4/7)f))/f(2/3) assuming f is positive. f(-76/105) Simplify ((o*(-2/31)o)/o)/(o(-6/5)/o) assuming o is positive. o(331/155) Simplify (f0/f)(-1/6)(f/((f/f1)/f)f)1 assuming f is positive. f(19/6) Simplify (o(-2/9)/o)(-1/56)/(o*(1/4)o(-4)) assuming o is positive. o(1901/504) Simplify (d*2(d/(d/d(-4/9)))/d)/(d(-4/7)((d(-2/3)/d)/d)/d) assuming d is positive. d(302/63) Simplify (r/((r/r15)/r))/(r/(r/r(1/21))) assuming r is positive. r(335/21) Simplify (s(s(s/(s/(sss(-1/3)s)))/ss)/ss*5)/((ssss(2/3))/s1) assuming s is positive. s*6 Simplify (cc(10/11))14 assuming c is positive. c(294/11) Simplify ((z0z)/z)44/(z/(((z(-5)zz)/z)/z)z/(z/(z*(-1)z))z) assuming z is positive. z(-7) Simplify j(-1/4)j(-37)/j assuming j is positive. j(-153/4) Simplify g/(g*(-2/3)/gg)(gg(3/23)/g)/g assuming g is positive. g(55/69) Simplify c*27/c((cc(c/c*(-5))/cccc)/c)/c assuming c is positive. c34 Simplify b/b19(bb/((bb(-7/5)/b)/bbb))/b assuming b is positive. b(-83/5) Simplify (u/(uu/(u/(u/((u/(uuu/u*(10/9)))/uu))u)))/u(-26) assuming u is positive. u(226/9) Simplify ((h/h5)/h5)25 assuming h is positive. h(-225) Simplify (a(-1/7))(6/17) assuming a is positive. a(-6/119) Simplify (s(-3))(8/3) assuming s is positive. s(-8) Simplify nn*(-4/3)n/((n/n*(2/11))/nn)n0/(nn/(nn/n(-2/9))) assuming n is positive. n(7/99) Simplify (b11b(1/4))36 assuming b is positive. b*405 Simplify (f/((ffff/(f*25/f)fff)/f))(-2/77) assuming f is positive. f(-38/77) Simplify (z/(zz/z(-3)))/(z(-1/3)z)z(3/7)z/((zz/z2)/z) assuming z is positive. z(-47/21) Simplify j(1/5)/jj*(2/17)((j/(jj(-1)j))/j)28 assuming j is positive. j(-2438/85) Simplify (d1)(2/37)d(-2/3)d/d(-1/2) assuming d is positive. d(197/222) Simplify (s*(-1/4)s)/ss13 assuming s is positive. s(51/4) Simplify (c/(ccc(-2/5)))(-3/5)(c/(cccc(-1)))/cc4/c assuming c is positive. c(34/25) Simplify r*3/rr((r4r)/r)/rrrrr*6rrr/(rr(1/2)) assuming r is positive. r(33/2) Simplify (l(-2/7)(l/(l/((l*(-6)l)/l)))/ll)/(l0l/(l*(-2/7)/l)l) assuming l is positive. l(-67/7) Simplify y(-16)y(6/7) assuming y is positive. y(-106/7) Simplify ccc/(cc*(-28))c(c/c14)/c assuming c is positive. c17 Simplify ((g(-2/15)g)/(g/g(-2/7)))10 assuming g is positive. g*(-88/21) Simplify ((u/(uu*(-4))uu)/((u(-3)/uuu)/u))/((u/(((((((uu*(6/7))/uu)/u)/u)/u)/u)/uu))/uu/(uu(-2))) assuming u is positive. u(34/7) Simplify ((((xx*(-2/3)/x)/x)/x)/(((xx(xx*(-6)x)/x)/x)/x))26 assuming x is positive. x(182/3) Simplify (s*(2/31)ss/(s/s(3/2)))(44/5) assuming s is positive. s(3498/155) Simplify (z(8/7))(2/115) assuming z is positive. z(16/805) Simplify (y(-2))(-17/3)y2/(y/y(-4/3)y) assuming y is positive. y10 Simplify z(-45)zz(-7) assuming z is positive. z(-51) Simplify (o/o2)(11/8)/((o/(o(-1)o))/(oo(3/4))) assuming o is positive. o(-5/8) Simplify ((x(4/9)x)/x9)(-21) assuming x is positive. x(476/3) Simplify (n/(n(2/3)/n)nnn/(n/n(-4)))(-2/5) assuming n is positive. n(4/15) Simplify (((y/(y(-1/2)/y))/y)/y(y(y4y)/y)/yy)(-2) assuming y is positive. y(-11) Simplify d(1/2)d*(-1)(d/d(-2/9))(1/43) assuming d is positive. d*(-365/774) Simplify f(ff16)/fff/(f(f/f*21)/f)f assuming f is positive. f*40 Simplify l/(l/(((lll(-12)/l)/l)/l))l(-6/19) assuming l is positive. l(-253/19) Simplify w*(-26)w(-21) assuming w is positive. w(-47) Simplify (s/(s/(s/s(-1/3))))(5/3)(s2)(-7/2) assuming s is positive. s(-43/9) Simplify (d/d3)38 assuming d is positive. d(-76) Simplify n(3/7)/n6((nn(2/9))/nn)/(n/n(-3)) assuming n is positive. n(-526/63) Simplify qq(5/2)qq2q((q(q*(-5)qq)/q)/q)/(q/((qq/q(-5))/q)) assuming q is positive. q(17/2) Simplify g/((g/g*10)/g)ggg/((g/(g/(gg(-14))g)g)/g)g assuming g is positive. g29 Simplify (m(1/3)/m)*(-1/45)m(mm*(-3)m)/mmm(-7/5)/m assuming m is positive. m(-322/135) Simplify m/(mm5)m(3/4) assuming m is positive. m(-17/4) Simplify (((mm26)/m)/m)(-9) assuming m is positive. m(-225) Simplify ((i(-22)/i)/i)(-32) assuming i is positive. i768 Simplify (((pp(-2/59))/p)/p)/(p/p(-7/4)) assuming p is positive. p(-893/236) Simplify (w(1/50)/www)/(ww(-1/2)) assuming w is positive. w(13/25) Simplify (r(-7)rrrrr*(1/2)/rrr)/(rr1)(-11/2) assuming r is positive. r(19/2) Simplify w5/w*1(w*1ww)(25/3) assuming w is positive. w29 Simplify s42/s41 assuming s is positive. s Simplify (aa/a*(3/5)a*(2/9)a)/((aa/(a(-2/5)a)aa)/a)(-2/31) assuming a is positive. a(3874/1395) Simplify (l(-1)/(l(-3)ll))/((l/(l/(l/((ll(-3/2))/l))))/((l/(l(-4)l))/l)) assuming l is positive. sqrt(l) Simplify i(-2)/i(-15/4) assuming i is positive. i(7/4) Simplify p/p(-17)pp/(p/(p*10p))pp assuming p is positive. p*32 Simplify ((gg(8/5))/(g/g9))/(g(-3)/(g/g(-1/3))) assuming g is positive. g*(224/15) Simplify (((q/(q/((qqq/q4)/qq)))/q)/(q(3/5)/q))(-19/5) assuming q is positive. q*(152/25) Simplify (f(((ff(-8))/f)/f)/f)(3/7) assuming f is positive. f(-27/7) Simplify c(-18)/c11 assuming c is positive. c(-29) Simplify (ss/(ss(-1)s))(2/89)/(s(2/5))(-22) assuming s is positive. s(3926/445) Simplify zz/((zz((zz/z*(3/8))/z)/zz)/z)zz*(1/4)z*6/(zz/(z/(zz(-2/21)))) assuming z is positive. z(961/168) Simplify b27b(13/3) assuming b is positive. b(94/3) Simplify ((qqq(1/4))/q)4/(qq(1/4))*(-50) assumin	{ "pile_set_name": "DM Mathematics" }
places. -7 Let h = -30110.37 + 30088.270186. Let u = h - -22.1. Round u to 5 decimal places. 0.00019 Suppose -3d = 2d + 5j + 50, -j - 25 = 2d. Let t be (-1 + d)(-4702 - -2). Suppose -2h + t = 2h. What is h rounded to the nearest one thousand? 19000 Suppose 2l - a - 382 = 0, a - 908 = -4l - 138. Let y = l - 95. Round y to the nearest 10. 100 Let q = 12.815 - -10.21. Let k = q + -23. Round k to two decimal places. 0.03 Let q = -0.16 + 0.26. Let f = 15.1 - q. Let y = f - 14.61. Round y to 1 dp. 0.4 Let q = 1609.1 + -1514. Let a = -91 + q. Let r = a - -3. What is r rounded to 0 decimal places? 7 Let m = -2111 + 2111.0879. Round m to 3 decimal places. 0.088 Let i = 178 - 177.999999879. Round i to seven dps. 0.0000001 Let l = 86 + -85.997. Let u = 0.00300164 - l. What is u rounded to 7 decimal places? 0.0000016 Let c = -12 + 9.8. Let w = 1107331 - 1107328.7999985. Let b = w + c. What is b rounded to 7 decimal places? 0.0000015 Let t = -0.01 + -0.28. Let b = -0.063 - -1.183. Let j = t + b. Round j to one dp. 0.8 Let i = -3623762.2 + 3283493. Let y = i - -340269.4129881. Let d = 0.213 - y. Round d to 6 dps. 0.000012 Let m = -0.0662 - -0.066202605. Round m to seven dps. 0.0000026 Let f = 16.75 + 1.71. What is f rounded to one decimal place? 18.5 Let o = -3879.007901 + 3879. Round o to three dps. -0.008 Let o(i) = i2 - i + 999994. Let y be o(0). Suppose -5s = -3b + y, -4s + 2b - 800006 = 5b. What is s rounded to the nearest 100000? -200000 Let k = 843 - 809.2. Round k to the nearest integer. 34 Let z = 0.0113 + 20.3687. Let d = 0.021 + 0.899. Let m = d + z. What is m rounded to zero dps? 21 Let r be (-6)/(-16) + 145/40. Suppose 3o = -b + 2383550 + 916449, ro - 3b - 4400003 = 0. What is o rounded to the nearest one hundred thousand? 1100000 Suppose -2h + 1085 + 1023 = 0. Let f = h - 1903. Let m = -241 + f. What is m rounded to the nearest 100? -1100 Let u(f) = 1026f3 - f2 + 4f - 4. Let v be u(2). Let j be (-1)/(3 - 24621/v). Let y = j + 1736. Round y to the nearest 100. -1000 Let d = 0.42 - 0.02. Let u = 0.54 - d. What is u rounded to 1 decimal place? 0.1 Let v be 10/(33/18). Suppose 4b - v = -4l, 4b + 5 = l + 10. Suppose 32005 = -2i - bi - 5u, 2u = -4i - 32002. Round i to the nearest 1000. -8000 Let y be (-15843331)/(-2)120/14. Suppose y = -9l + 14l. Let b be (-40)/140 - l/7. Round b to the nearest 100000. -1900000 Let t(z) = -z3 + z2 + 7z - 4. Let r be t(3). Let n = 5 - r. Let k(s) = -194s*2 - 4s + 8. Let u be k(n). Round u to the nearest ten thousand. -10000 Suppose 10u - 176328 = -3176328. Round u to the nearest 1000000. 0 Suppose -m - 633600048 = -7m. Suppose 0 = -2v - 2u - 52800008, 4v + 2u + m = -0v. What is v rounded to the nearest one million? -26000000 Let a = 2.85000661 - 2.85. What is a rounded to 6 decimal places? 0.000007 Let c(y) = 40y*2 + 3y - 20. Suppose 2a = 3z - 7, a - 5 = -2z + 2. Let h be c(z). What is h rounded to the nearest 10? 350 Let i = 26042 - 26151.874. Let u = i - -110. What is u rounded to two dps? 0.13 Let w = 580.3256 + -581. Round w to 2 dps. -0.67 Let g = 784 + -783.99995329. Round g to six dps. 0.000047 Let w = -1107 - 18. Let a be -17280(-7)/((-42)/w). Suppose -3d - a = d. What is d rounded to the nearest 100000? -800000 Let v = -0.0228 - -0.022431. Round v to five decimal places. -0.00037 Suppose 4d - 5411629 - 5234843 = 0. Let v = d + -1571618. What is v rounded to the nearest 100000? 1100000 Let z(q) = -4q - 1 + 321947q*2 + 0q + 3. Let r be z(2). Suppose -r = j + 182218. Round j to the nearest 100000. -1500000 Let m = 7.0184 + -7.43. Let q = 608 - 607.58. Let p = m + q. What is p rounded to 3 decimal places? 0.008 Let m = -62749 - 76550. Let o = -58299 - m. What is o rounded to the nearest ten thousand? 80000 Let t = -61 + 49. Let p be (-321)/t - (-15)/(-20). What is p rounded to the nearest ten? 30 Suppose -m - 27880 = -43l + 42l, -4m - 111520 = l. What is m rounded to the nearest 100? -27900 Suppose -12x = -3x - 15099057. Suppose 168727 + 119638 = 5z. Suppose 2i - x = -z. What is i rounded to the nearest 100000? 800000 Let o = 2852 + -2852.3994. Round o to two decimal places. -0.4 Let l = 1220.999999306 + -1221. Round l to 7 dps. -0.0000007 Let i = -9.8417015 - 0.1213185. Let y = i - -32.76123. Let v = y - 22.8. What is v rounded to four dps? -0.0018 Suppose -5k = -5o - 129965 - 155020, -3o = 4k + 171012. What is o rounded to the nearest 100000? -100000 Let i = 359.7 - 328. Let x = i - 31.6607. Round x to three dps. 0.039 Let v = 4922031 + -4922048.899468. Let x = -17.9 - v. Round x to four decimal places. -0.0005 Suppose -4l = -3b - 7, 4l + 7b = 8b - 3. Let w be 31601(1 + l) - (3 - 4). What is w rounded to the nearest ten thousand? -30000 Let m = -2.33 + -2.83. Round m to one dp. -5.2 Suppose -2714 = 2o + 4x, -3o = -4x + 2611 + 1460. What is o rounded to the nearest 100? -1400 Let j = 26103712 - 26103745.000022. Let b = 22 + 11. Let d = b + j. What is d rounded to five dps? -0.00002 Suppose -4i + 5c - 5600 = 0, -15i - 4c = -12i + 4200. Round i to the nearest one hundred. -1400 Let j = 200 - 199.9999973. Round j to 7 dps. 0.0000027 Let v = 23 + -6. Suppose -5m = 7 - v. Let y be m/(-9) - 37080004/(-18). What is y rounded to the nearest 100000? 2100000 Let t = -35065 - -35068.90829. Let s = t + -3.91. What is s rounded to 4 decimal places? -0.0017 Let r = 847933 + -847932.6000168. Let x = -0.4 + r. Round x to six dps. -0.000017 Let u = 0.55 - -41.45. Let t = u + -42.047. Round t to 2 dps. -0.05 Let o be 216194 + (0/3 - -6). Round o to the nearest ten thousand. 220000 Let i = -6.81988704 + -623.18016526. Let q = i + 630. Round q to 5 dps. -0.00005 Let d = 230.3870116 + -229.877. Let m = 0.51 - d. What is m rounded to 6 decimal places? -0.000012 Let h = -0.0284 - -0.02840281. What is h rounded to 7 decimal places? 0.0000028 Let n = -3.19 - 13.61. Round n to the nearest 10. -20 Let d = -0.2392 - -0.059. What is d rounded to 2 dps? -0.18 Let o = 0.0243 + 0.0575. Let y = -7.1718 + o. Round y to 0 dps. -7 Let k = -2054618655.0000189 + 2054619028. Let t = -704 - -331. Let x = k + t. Round x to 6 dps. -0.000019 Let l = 381.9999824 + -382. What is l rounded to 6 decimal places? -0.000018 Let x = -27.9 - -27.8975. Round x to 4 decimal places. -0.0025 Let f = 381887 + -156160. Let q = -225727.429791 + f. Let d = q - -0.43. What is d rounded to 5 dps? 0.00021 Let i = -17 - -22. Suppose iv = 2v + 8999940. Suppose -5a = -5z - v, 2a + 7 = -1. Round z to the nearest one million. -1000000 Suppose -j + 120 = -5j. Let f be 3375/j-2680. What is f rounded to the nearest ten thousand? 150000 Let q = 0.739999326 - 0.74. What is q rounded to 7 decimal places? -0.0000007 Let b = 0.143 + -104.543. Round b to zero decimal places. -104 Let t = -0.03063369095 - -93.03063310095. Let p = t - 93. Round p to seven dps. -0.0000006 Suppose -19t = -15t - 12. Suppose 2c = ty - 2y + 299, y + 449 = 3c. Round c to the nearest ten. 150 Let o = -0.48225977 + 2.5522606. Let i = o - 2.07. Round i to 7 dps. 0.0000008 Let x(n) = -2706n*3 + 15n*2 - 15n + 2. Let s be x(-7). What is s rounded to the nearest one hundred thousand? 900000 Let f = -330 - -329.9017. Round f to three decimal places. -0.098 Let t = 6254 + -5190.8. What is t rounded to the nearest one hundred? 1100 Let i = 10 + -7. Suppose -5 = -il + 1. Suppose lf + f = 3540. Round f to the nearest one hundred. 1200 Let g = -0.476 + 0.016. Let j = -33.54 + g. Let t = -34.56 - j. What is t rounded to 1 dp? -0.6 Let d = -86.3315 - -85.8. What is d rounded to two dps? -0.53 Suppose 59300 = f + j, 0 = -5f + 3j - j + 296500. What is f rounded to the nearest ten thousand? 60000 Suppose -7c + 9408321 = -316072513. Suppose -c = -6h + 36902738. What is h rounded to the nearest one million? 14000000 Let y be (-2000 - 0)/(18/(-105390)). What is y rounded to the nearest one million? 12000000 Let q = 35 + -32. Suppose -328 + 7 = ql. Let t = l + 1. Round t to the nearest ten. -110 Let i = -1308 + 1307.453. What is i rounded to two dps? -0.55 Let w = 744103 - 1900319. Let v = 436216 + w. What is v rounded to the nearest 100000? -700000 Suppose 5m - 114249 = 3*j + 109739, j = 4. What is m rounded	{ "pile_set_name": "DM Mathematics" }
5 - 14/(-49). What is the second biggest value in -2/7, c, o? o Let k = 0 + 13. Suppose 4i + 3l + k = 2l, 0 = 3i + 3l + 12. Which is the smallest value? (a) -1/4 (b) 1 (c) i c Let g be (2/7)/(240/(-112)). Which is the fourth biggest value? (a) -1/9 (b) 2/7 (c) g (d) 21 c Let v be 18/4 + (-1)/(-2). Suppose vu - 3 = 2. Let c = 4 + 1. What is the biggest value in c, u, 2/3? c Let c = -0.2 - -0.2. What is the third smallest value in c, 0.1, -0.1? 0.1 Let d = 447/8 - 56. Which is the third smallest value? (a) 1/6 (b) d (c) 0.02 a Let o = -363 + 4717/13. What is the second smallest value in -7/4, 0, o? o Let n = -8 - -5. Let s = n - -4. Let r be 2/912/(-8). Which is the smallest value? (a) r (b) s (c) 2 a Suppose 0 = 7h - 11h + 4. What is the second biggest value in -0.3, -0.4, h? -0.3 Suppose -9z - 615 = -4z. Let y = z - -1103/9. Let w = -0.2 - 0. Which is the second biggest value? (a) 5 (b) y (c) w c Let z = 31.96 + -32. What is the biggest value in z, 2, -0.5? 2 Let v be ((-267)/6)/((-1)/(-2)). Let g be -1 + (-955)/11 + -1. Let h = v - g. Which is the third biggest value? (a) -3 (b) -2 (c) h a Let n = -4 + 6. Let p be (-27)/(-18) + n/4. Which is the second smallest value? (a) p (b) -5 (c) -3 c Let s = 69 - 71. Which is the third smallest value? (a) 0 (b) s (c) 0.3 (d) 3 c Suppose -m - 2m + 3 = 0. Let y = -1 + 0.94. Let z = -1.94 + y. Which is the second smallest value? (a) z (b) m (c) 5 b Let o = -2 - 1. Let q = o + 4. What is the second biggest value in 4, 0.5, q? q Suppose 3i + 1 = 3f + 4, -2i = 4f + 16. Let p = -7 - -11. Which is the smallest value? (a) p (b) i (c) -5 c Let o = 1.3 + -1. Let v = o + -0.3. What is the third biggest value in 0.5, -5, v? -5 Let y = 40 + -38. Which is the biggest value? (a) -2/3 (b) y (c) -1 b Let q = -35.88 + 35. Let i = q + -0.02. Let t = i - 3.1. Which is the smallest value? (a) -5 (b) t (c) -0.1 a Let s = 0.12 - 3.32. Let n = s + 0.2. What is the second biggest value in 0, n, -3/5? -3/5 Let n = -3.3 + 11.3. Which is the second biggest value? (a) 2/5 (b) n (c) -3 a Let r be (-2)/3 + 188/(-6). Let j = r - -97/3. What is the third smallest value in -1, 4, j? 4 Let y = 0.16 + -2.16. Which is the second biggest value? (a) y (b) 5 (c) 2 c Let p = 3.2 + -0.2. Suppose 0 = 5l + 8 - 33. Let j be ((-4)/l)/(1/5). Which is the smallest value? (a) j (b) p (c) -1/6 a Let a = 0.28 + -1.58. Let v = 1.7 - a. Let i be (-51)/36 + 2/3. What is the second smallest value in -0.3, v, i? -0.3 Let f(p) = -3p + 1. Let u be f(-1). Which is the third biggest value? (a) 3/7 (b) 5 (c) u a Let x = 1 + 4. Let y = -0.06 + 3.06. Let n = y + -3.5. Which is the third biggest value? (a) n (b) 0.2 (c) x a Let a be (-14)/(-6) - (3 + -1). Let m = -0.14 + 0.34. What is the second biggest value in a, m, 1/2? a Let g = 0.01 - -0.29. Let h = g + 0.7. Which is the smallest value? (a) h (b) 2/3 (c) -2/3 c Let r = 0.13 - 7.13. Let l = r + 2. Which is the smallest value? (a) -2/9 (b) -3 (c) l c Let q = 12 + -18. Let f = 5.7 + q. Which is the smallest value? (a) -1 (b) f (c) -0.6 a Let u = 44 + -44.1. Which is the second smallest value? (a) -2 (b) u (c) -1/5 (d) 1 c Let w = -0.2 - -0.1. Let k = -15 - -25. Let p(o) = o*3 - 9o*2 - 10o + 3. Let u be p(k). What is the biggest value in -2/7, u, w? u Let z = -0.11 + 0.61. Let u = 8/723 + 17248/9399. Let p = 290/143 - u. What is the second smallest value in z, 2/3, p? z Let s be (4/(-6))/(16/714). Let n = 30 + s. Let v = 0.8 - 0.9. Which is the smallest value? (a) v (b) n (c) 5 a Suppose 3z = -0z - 18. Let c = z - -9. Suppose 3v + w + cw = 4, 0 = -2v + 3w + 14. What is the second biggest value in 0, -5, v? 0 Let u = -0.127 - 5.833. Let z = -6 - u. Let j = -0.04 - z. Which is the second smallest value? (a) j (b) 5 (c) -1/9 a Let u = -43 + 47. Which is the biggest value? (a) 5 (b) -1 (c) u (d) 2 a Let p = 5566 + -116863/21. Let n = p + -5/3. Suppose -2h + 4z = 3h, 0 = z. What is the biggest value in -0.3, n, h? h Let j be (-3)/(-1) - 2364/776. Let z = j - -61913/582. Let i = z - 108. Which is the biggest value? (a) i (b) 0.3 (c) -0.2 b Let u = -28 + 20. Let i be (u/26)/(-2) + 0. What is the smallest value in 0.1, i, 2? 0.1 Let y = 0.5 + -1. Let z = -9.94 - 0.06. Let s = -14 - z. Which is the third smallest value? (a) -2 (b) s (c) y c Let w = -0.25 - -0.11. Which is the third smallest value? (a) 0.4 (b) w (c) -0.4 a Let d(s) = -s. Let g be d(-5). Let f = 1633 - 146951/90. Let z = f - 11/18. What is the smallest value in -1, z, g? -1 Let d = -2 + 7. Let c be -4(-2 + 11/6). What is the biggest value in d, c, 3? d Suppose 4h = 2h - 6. Let w = -14.6 + 14.1. Which is the third smallest value? (a) h (b) -2/15 (c) w b Let k = -13.4 - -14. Let c = -0.5 + k. What is the second biggest value in c, -1/2, -4? -1/2 Suppose -s - 6 = -3. What is the second smallest value in -0.4, -0.2, -0.3, s? -0.4 Let q = -18.5 + 24. Let h = -5 + q. Which is the second biggest value? (a) -5 (b) -3 (c) h b Let k be (6/10)/(-1 - 0). Let y = 0.75 + -0.7. Let h = -0.05 - y. Which is the third biggest value? (a) k (b) h (c) 0.2 a Let t(g) = -11g + 82. Let i be t(7). Let p = -12 - -21. Suppose 5w - 15 = 0, 4l + l = -3w + p. Which is the third biggest value? (a) i (b) -0.1 (c) l b Let j be (-1 + 2 - -1) + 1. Let g = 4 + -4. Let y = 0.2 - g. Which is the second smallest value? (a) 4 (b) j (c) y b Let s = 3 + -2. Let q = -1/15 + -11/60. Let f(g) = 2g2 - 2g - 1. Let w be f(-1). What is the third smallest value in s, w, q? w Let p = 11 + -10.8. What is the second biggest value in p, -3, 2/9? p Let i = 0.1 + 1. Let t = i - 1. Let h = -48 + 46. What is the biggest value in t, 0, h? t Suppose 2h - 5 = 5m, m = -5h - 2 - 26. Let u = m - -1. Let z = 8 - 12. Which is the second smallest value? (a) u (b) -5 (c) z c Let z = 0.215 - 2.215. Let u = -0.3 + 0.4. Which is the second biggest value? (a) z (b) 3 (c) u c Let d = 17.29 + -0.29. Let g = d + -13. Which is the second biggest value? (a) -1 (b) 3 (c) g b Let r = -0.02 + 0.42. What is the second smallest value in 1/2, r, -0.2? r Let y = 13 - 13. Which is the second biggest value? (a) 1/6 (b) y (c) -0.4 b Let f = -2.06 + 0.06. Let u = -2 - f. Let y = u - 0.2. Which is the second smallest value? (a) y (b) -5 (c) -3 c Let k = -0.4 - 0.4. Let n = 1 + k. Which is the smallest value? (a) -5 (b) -0.5 (c) n a Let y = -6 + 7. Let p(r) = 2r*2 + 1. Let g be p(y). Let d = -12.5 - -12. Which is the third biggest value? (a) g (b) d (c) -4 c Let m be -2(16/(-7) - -2). Let g be 2 + 193/(-36). Let l = g + -7/12. Which is the biggest value? (a) l (b) 2/15 (c) m c Let r = -2 - -2.01. Let x = 3.99 + r. Which is the second smallest value? (a) x (b) 0 (c) 2/17 c Let o(g) = -g + 22. Let u be o(17). What is the smallest value in u, -0.7, 4? -0.7 Let n(i) = i3 + 3i*2 - 4i - 3. Let g be n(-4). Let f = 7 + -12. What is the third smallest value in 1/2, f, g? 1/2 Let y = -0.09 - 2.91. Which is the smallest value? (a) y (b) 5 (c) 2 a Suppose q + 3 - 5 = 0. Let w be q + (4 - 28/6). Let s = -2 + 0. Which is the second biggest value? (a) s (b) 0.3 (c) w b Let s be (-8)/390 - (-30)/195. What is the second smallest value in 5, s, -5? s Let g be 2((-5)/2 - 0). Let w = -6 - -7. Which is the second biggest value? (a) w (b) 0.2 (c) g b Let m = -45 + 50. What is the second biggest value in m, 0.1, -4, 7? m Let n = -2.6 + 0.6. Let p = -93 - -92.49. Let f = p + 0.11. Which is the second smallest value? (a) n (b) 1 (c) f c Let s = -507/5 + 100. Which is the biggest value? (a) -5 (b) -3 (c) s c Let w = -42 - -41.9. Let i be 31/(-2)-2. Let o be (3/(-6))/(i/2). What is the biggest value in o, w, 3? 3 Let u = -10 - -7. Let w = 3 - 3.1. Let p = 0.6 + w. What is the third smallest value in p, 1, u? 1 Let n = 1.69 + 1.31. What is the biggest value in 0.03, -0.3, n, -2? n Suppose -5d + h - 1 + 18 = 0, -5h = -15. What is the third smallest value in 0.5, -0.2, d? d Let w be (0 - -4) + 1 + 98/(-21). Which is the biggest value? (a) -4 (b) 0.2 (c) w (d) 3 d Let v = 8 + -9. Let i = 0.08 - -0.02. Which is the second smallest value? (a) i (b) -3 (c) v c Suppose 4i	{ "pile_set_name": "DM Mathematics" }
i) = 3o(i) - 7x(i). Calculate m(j). -9 Suppose 0 = -x + 4. Let a(d) = -5d3 - 15d*2 + 18d + 4. Let r(o) = 3o3 + 10o*2 - 12o - 2. Let m(z) = 5a(z) + 8r(z). Calculate m(x). -4 Let c(i) = -5i2 - 7i + 8. Let g be c(1). Let z(a) = -a - 3. Determine z(g). 1 Let f(n) = n - 1. Let p(w) = 2w - 27. Let j be p(12). Let s be -1 - -1 - (j - 1). Let r(b) = -b3 + 3b*2 + 5b + 2. Let t be r(s). Determine f(t). 5 Let u(p) be the first derivative of 1/3p3 - 1/2p*2 - 10 - 4p. Determine u(0). -4 Let j(h) = -5h - 13. Let n(v) = 32v - 547. Let c be n(17). What is j(c)? 2 Let c(s) = -8 - s*3 - 4s*2 - s + 13s*2 - 10s. Let q be c(7). Let b = q - 9. Let f(m) = -m. Give f(b). -4 Let o(s) = s - 1 + 3s3 - 4s*3 - 2s. Let z = 42 + -74. Let h = 32 + z. Give o(h). -1 Let p(r) be the third derivative of -2r5/15 + r4/12 - r3/2 - 652r2. What is p(1)? -9 Let i(y) = y2 + 4. Let w(g) = -21 + 28 + 0g2 + 2g*2. Let d(f) = -11i(f) + 6w(f). Calculate d(3). 7 Let r(a) = a - 5. Let h be (-64)/(-2) - 24/(-8). Let l = 28 - h. What is r(l)? -12 Let m(o) = -4o - 11. Let u(z) = -9z - 23. Suppose 0 = 5n - a - 0 + 31, -3a = -3n - 9. Let w(b) = nm(b) + 3u(b). Give w(-4). 4 Let v(h) be the third derivative of -h8/20160 - h7/5040 + h*6/360 + 8h*5/15 - 17h2. Let q(t) be the third derivative of v(t). Determine q(0). 2 Let a(k) = k3 - 4k2 - 4k + 6. Let d(b) = -b*2 + b + 10. Let q be d(-2). What is a(q)? -10 Let p(z) = 6z. Let b(q) = q. Let i(s) = -5b(s) + p(s). Let a(k) = -2k - 1. Let g(w) = -4a(w) - 9i(w). Determine g(0). 4 Let q(u) = -u - 1. Let z(f) = -f. Let k(p) = -5q(p) + 3z(p). Give k(-8). -11 Suppose 32 = -5p - 4u, -35p + 2u = -34p - 2. Let a(t) = 5t + 6. Calculate a(p). -14 Let y(j) be the third derivative of 0j + 0 + 1/8j*4 + 16j*2 + 0j*3. Determine y(2). 6 Let i = 3 - 5. Suppose 2q = -2a + 6q, 0 = -a - 5q. Let s(d) = -4 + 2d + 3d2 + ad2 + 5 - 3. Determine s(i). 6 Let l = -1064 + 1054. Let b(q) = -q3 - 10q2 - 5. What is b(l)? -5 Let p(y) = -2 - y3 + 2 + 3 + 62y*2 - 61y2 - 2. What is p(0)? 1 Let d(t) be the second derivative of -t3/6 + 6t2 - 17t - 3. Calculate d(15). -3 Suppose 2 = q + 3i, 3q + 5i - 37 = -39. Let y(u) = u3 + u2 - 4u + 1. Determine y(q). -31 Let w(r) = -r + 3. Let v(d) = 1. Let c = 14 - 8. Let t(p) = cv(p) - w(p). Give t(-2). 1 Let u(b) = 119b*2 + 117b*2 - 3b + 7 - 244b2 - b3 - 27. Determine u(-8). 4 Let s(k) = 3k - 2. Let w(x) = 10x - 10. Let d(y) = -5s(y) + w(y). Give d(4). -20 Suppose 0 = -3t - 4n - 12, 2n = 4t + 7n + 15. Let c(v) = v - 21. Calculate c(t). -21 Let u(x) be the third derivative of x4/8 - 7x*3/6 + 2x*2. Let r be 15/(-9 - (-138)/12). Determine u(r). 11 Suppose 4p = 12 + 4. Let r = 11 - 2. Suppose n - 3h + r = 0, -n + 3n = -h - p. Let i(d) = -d - 1. Give i(n). 2 Let r(x) = x*2 - 4x + 3. Let t = 16 - 12. Suppose -td - 12 + 24 = 0. Determine r(d). 0 Let j(s) = -7s - 1. Suppose -4 = k - 2w - 5, -3 = -k + 4w. What is j(k)? 6 Let z(x) = x + 5. Suppose -2v = 3v - 3u + 207, 5u + 5 = 0. Let d be v/(-21)(-7)/2. Give z(d). -2 Suppose 56k = 22k - 238. Suppose -m = -2 - 2. Let t(d) = -3d*2 + 4 + md*2 + 4d + 3d. What is t(k)? 4 Let w = -12 + 8. Let g(b) = 8b + 1. Let i be g(-1). Let r(d) = -5d2 + 12d + 13. Let p(k) = -2k2 + 6k + 6. Let n(t) = ip(t) + 3r(t). Determine n(w). 5 Let u(y) be the first derivative of -3y2/2 + 2y + 2. Let t(p) = 2p2 - 35p + 10. Let f be t(17). Let a be f/(7/(-3)) - 1. Give u(a). -4 Let i be 12/912/8. Suppose 4j - 6d = -id + 4, 2j - 5d + 4 = 0. Let h(z) = -4z2 + 5z2 - z3 + j - 6 + 3z. Determine h(2). -1 Let d(z) = 2z*2 - 4 - 2z*3 - 4z - 5z2 + z + 5z - 4z. Calculate d(-2). 4 Let v(m) be the second derivative of -m4/6 + m3/3 - 9m*2/2 - 8m. Let l(d) be the first derivative of v(d). Give l(2). -6 Let i be 4 + -5 + -1 + 2 + 11. Let v(x) = x*2 - 10x - 16. What is v(i)? -5 Let h(a) be the first derivative of -a*4/4 + 10a*3/3 - 8a + 114. Determine h(9). 73 Let g(t) be the third derivative of t6/120 + t5/20 - t4/8 + t3/3 + 64t2. What is g(2)? 16 Let z(g) be the second derivative of g5/20 - 7g4/12 + g3 - 2g2 + 430g. What is z(7)? 38 Let r(f) = 2f - 3. Let j be 470/90 - (-4)/(-90)5. Give r(j). 7 Let w(g) = -g*2 + 7g + 1. Let r be (-4)/7 + 240/28. Calculate w(r). -7 Let k(n) = -7n2 - 31n - 7. Let i(o) = -3o2 - 15o - 3. Let m(j) = 9i(j) - 4k(j). Give m(9). -17 Let l(o) = -o*2 + 1. Suppose 13 = -2p - 5w - 1, 3p + 7 = -4w. Let x(m) = 4m*2 + pm*2 - 2m*2 - 6m*2. Let c be x(1). Give l(c). 0 Suppose y = -13 + 10. Let w be (11 - 7) + y + 2. Let l be w/2(-8)/(-12). Let a(v) = -v*2 + 1. Determine a(l). 0 Let n(j) = -5j. Let h(q) = 2q - 55. Let i be h(23). Let a = -7 - i. Give n(a). -10 Suppose -x - 4 = -5x. Let z = 4 - x. Let a(w) = -w*2 + 0wz - w - w3 - 1 - 4w3 + 3w3. Determine a(-1). 1 Let x be 1/(-8) + 477/(-24). Let a = x - -16. Let z(g) = g3 + 4g2 + g + 2. Determine z(a). -2 Let h(b) be the first derivative of -2b4 + b3/3 + 3b2/2 + 2b + 197. Give h(-1). 8 Let v = -1 + 5. Let n(x) = 1 + 0 + vx - 7x*2 + 6x*2 - 6x. Suppose -4 = d - 6. Give n(d). -7 Suppose -27r = 84 - 30. Let k(u) = 2u*3 + u + 2. Determine k(r). -16 Let j(p) = 5p + 1. Let d be (-76)/14 + 4/(-7). Suppose 0 = a + 3 - 14. Let t(q) = -q*2 + 9q + 2. Let s(x) = aj(x) + dt(x). What is s(1)? 6 Suppose -5 = a - 6a. Let k = -1 - a. Let j(c) = 2c*2 - c - 2. Give j(k). 8 Let g(f) = -5f - 10. Let v(y) be the first derivative of 2y2 + 9y - 6. Let r(i) = -5g(i) - 6v(i). What is r(5)? 1 Let i(h) = -h*2 - 5h + 15. Suppose 2u = j - 1, -4j = 2u + 30 + 6. What is i(j)? 1 Let j(o) = -o2 - 3o + 2. Let r(m) = 6m - 10 - 10m + 1 - 3m - 2m*2. Let q be r(-2). Give j(q). 2 Let a(l) = -l + 5. Let n(y) = y + 1. Let q(p) = -a(p) - 2n(p). Let r be 6/(-10)1940/(-194). What is q(r)? -13 Let g(t) = 4 + 2t - 2t - t. Suppose -h - 24 + 6 = 0. Let w = h + 18. Calculate g(w). 4 Let y(b) be the second derivative of b5/20 + 5b4/12 + b3/3 + b*2 - b. Suppose 3 + 12 = -5x. Let s be -3x/18-10. What is y(s)? -8 Let i(f) = -2f - f - 2f - 3f - 11 + 7f. Calculate i(-10). -1 Let t(l) = 18l + 1. Suppose -97r - 4m = -95r + 6, 3r = 2m - 1. Calculate t(r). -17 Let q(u) = 3u + 1 - 7u - 6 + 2. Suppose 57n - 22n = 105. Give q(n). -15 Let z(m) be the second derivative of -m - 1/6m3 + 0 - 5/2m*2. Let w(r) = -2r*2 + 12r - 3. Let s be w(6). Calculate z(s). -2 Let o be (20/(-12))/((-4)/(-96)-5). Let h(q) = -q2 + 13q - 11. What is h(o)? 29 Let j(h) = 2h + 37h*2 - h - 8h*3 - 35h*2. Suppose 5f + 335 = 330. Determine j(f). 9 Let g = 19 - 19. Let v(w) be the second derivative of -1/20w5 - 1/6w*4 + g + 1/6w*3 - 12w - 3/2w2. What is v(-3)? 3 Let t(o) = -16o*3 + 2o*2 - 1. Suppose -41 = -3s + 5k, 0s - 3k = s - 9. Suppose -5d + 5y + 8 = -s, -4y = -d + 13. What is t(d)? -15 Let w(i) = -i + 14. Let k be w(12). Let d(g) = -2g - 1 + 1 + 1 + 0 + 7g*k. Let t = 27 + -26. Give d(t). 6 Let k(z) = 7z + 4. Let j be k(-3). Let g be (-2)/4(j + 3). Let f(r) = -2r + 8. What is f(g)? -6 Let j(g) = -g*3 + 10g*2 - 5g - 87. Let p be j(8). Let q(o) = 10o3 + 2o*2 - 2o + 1. Calculate q(p). 11 Let u(x) be the second derivative of -1/4x4 - 1/6x*3 + 0 - 1/20x*5 + 19x + x*2. Determine u(-3). 5 Let l(n) be the third derivative of -7n*5/30 + 14n*2 + 5n. Let c be 6/(-9)(-9)/(-6). Give l(c). -14 Let v(k) = -k - 4. Let z(c) = 2c*3 - 2c*2 + 1. Let h be z(2). Let b be 40/12h/6. Determine v(b). -9 Let k = 2483 - 2488. Let i(d) = 2d + 3. Give i(k). -7 Let n(y) = y3 + 20y*2 + 19y + 3. Let j be n(-19). Let f(z) be the first derivative of 2z3/3 - 5z*2/2 + 2z + 4. What is f(j)? 5 Let p = 60 - 63. Let q be (p - -4) + 5 + -8. Let u(j) = 4 - j*3 + 3j + j*2 - 2 + 0j*3. What is u(q)? 8 Let l be 21(-105)/(-42). Suppose 10 = lq - 15. Let t(r) = 2r - 3. Calculate t(q). 7 Suppose 4b + 3 = 5b. Let c(j) = -j2 - 4j*2 + 2j - j*b + 0j*2 + 10j*2. Suppose -2s + 6 = -4. Calculate c(s). 10 Let p(b) = b3 + b2 - b. Let n be (-1	{ "pile_set_name": "DM Mathematics" }
hat is -93 + 216c? 20d9 In base 9, what is -372877 - -1? -372876 In base 14, what is -4 - -6862? 685c In base 8, what is 3 + -516315? -516312 In base 3, what is -112110111102 - 12? -112110111121 In base 12, what is 20 + -2b4? -294 In base 14, what is b + 37db? 3808 In base 10, what is -23 - 1912? -1935 In base 3, what is 2211210 - -100110? 10012020 In base 8, what is 2226 - 253? 1753 In base 8, what is -22 - 20? -42 In base 4, what is 11 - 1021? -1010 In base 7, what is -20563 - 1? -20564 In base 16, what is 8 + b2d? b35 In base 9, what is -120 - 2465? -2585 In base 2, what is 111101010110 + -100? 111101010010 In base 16, what is -6 - 14573? -14579 In base 13, what is 24 + -1540c? -153b8 In base 3, what is 2212 + 12000? 21212 In base 15, what is 1e0574 + -3? 1e0571 In base 16, what is -191 + 19f? e In base 14, what is 1db + -700? -503 In base 2, what is 1111010110010010011 - 10? 1111010110010010001 In base 10, what is -304225 - -1? -304224 In base 11, what is -5 - 32653? -32658 In base 7, what is 4242 - -21? 4263 In base 16, what is -1 + -478b? -478c In base 13, what is -5 - 47c9? -4801 In base 15, what is -11e + -1ad? -2cc In base 15, what is 682842 + -3? 68283e In base 9, what is -3 - -466258? 466255 In base 15, what is 5612 - 1? 5611 In base 6, what is 5042 - -11153? 20235 In base 14, what is -30 - dd? -12d In base 13, what is 17 + -c3812? -c37c8 In base 2, what is -11111011 + 100010101001? 11110101110 In base 13, what is -5 - 4c22? -4c27 In base 12, what is 2 - -43733? 43735 In base 15, what is 24c + -6b9? -46c In base 2, what is 1101101110111 + 100? 1101101111011 In base 15, what is 3 - b56? -b53 In base 15, what is 2309 - 117? 21e2 In base 5, what is -12 + 13201141? 13201124 In base 14, what is -7a - 17b? -217 In base 15, what is -1192 + -47? -11d9 In base 8, what is 22 + -2153? -2131 In base 6, what is 243 - -14253? 14540 In base 5, what is -10 + -2243231? -2243241 In base 12, what is 328b - 185? 3106 In base 3, what is -111000212112 - -10? -111000212102 In base 13, what is 8901 - -1b? 891c In base 15, what is 4 + 18825? 18829 In base 16, what is 248777 - -5? 24877c In base 11, what is -2630 - 18? -2648 In base 6, what is 1 + 414514? 414515 In base 15, what is 549 - -2a? 574 In base 15, what is -891aa + -2? -891ac In base 4, what is -10 + -1231221? -1231231 In base 10, what is 45409 - -6? 45415 In base 7, what is 2440 + 36? 2506 In base 9, what is -1635 - -58? -1566 In base 16, what is -5c - 2d? -89 In base 7, what is 3 + -2145116? -2145113 In base 2, what is 1001011010001 + 10010111? 1001101101000 In base 10, what is -426 + -31? -457 In base 12, what is 17122a4 - 1? 17122a3 In base 11, what is 10a + 29aa? 3009 In base 2, what is 101 - 100001011000101? -100001011000000 In base 7, what is -6124 + -102? -6226 In base 11, what is 1a7 + 425? 621 In base 6, what is 201 + 30100? 30301 In base 7, what is 124 + 40064? 40221 In base 3, what is -1220001 - 201? -1220202 In base 3, what is -100 - -201212011? 201211211 In base 9, what is 5646 + 38? 5685 In base 5, what is 1241 + 244332? 301123 In base 2, what is 10100110111 - 11101111? 10001001000 In base 4, what is 13210211 - -2? 13210213 In base 10, what is 647 - 184? 463 In base 16, what is 9 - 4172? -4169 In base 10, what is -27 - -111503? 111476 In base 10, what is -1515 - -169? -1346 In base 10, what is 2719 - 148? 2571 In base 9, what is 7 + -7455? -7447 In base 12, what is -3 - -322b? 3228 In base 7, what is -110141 - 0? -110141 In base 2, what is 110011 + 11111111? 100110010 In base 5, what is 42024 - 22? 42002 In base 12, what is -277 - -a2b? 774 In base 6, what is 1033 - -2015? 3052 In base 16, what is -7a0 - 7? -7a7 In base 16, what is -1 - 198df7? -198df8 In base 16, what is -37 + -1fe8? -201f In base 8, what is 14 - 24526? -24512 In base 7, what is -21 + -520? -541 In base 16, what is -62b - -e? -61d In base 2, what is 11010010111 + 1000110? 11011011101 In base 3, what is 0 - -100011221? 100011221 In base 16, what is -41c + 77? -3a5 In base 13, what is -4 - 535c? -5363 In base 7, what is 1413 - -56? 1502 In base 9, what is -2 - -1562? 1560 In base 9, what is 18 + 1230? 1248 In base 15, what is 883 - -10? 893 In base 16, what is 1b - -57ba? 57d5 In base 9, what is 4 + 1138? 1143 In base 2, what is -111000110100 + -10100000? -111011010100 In base 9, what is -53 + -287? -351 In base 7, what is 353 - 22066? -21413 In base 15, what is 1a + 1d? 38 In base 16, what is -f39e + -21? -f3bf In base 12, what is 1 - 2a58a? -2a589 In base 16, what is 1b7e + -17? 1b67 In base 6, what is 0 + 133312? 133312 In base 6, what is -43151 - -1? -43150 In base 3, what is 202001 - -12012? 221020 In base 15, what is 41 + d06? d47 In base 6, what is 1122 + 332? 1454 In base 7, what is 24 + 244242? 244266 In base 6, what is -1 + -13543435? -13543440 In base 7, what is -3 + 313146? 313143 In base 7, what is 14024 + 343? 14400 In base 9, what is 2 + -115343? -115341 In base 6, what is 101312 - 31? 101241 In base 8, what is 562 - -66? 650 In base 2, what is -1001110001001001 + 10? -1001110001000111 In base 10, what is -39177 - -46? -39131 In base 13, what is -57a + 3bb? -18c In base 15, what is -3 - -2504? 2501 In base 5, what is -1110 + -2123? -3233 In base 9, what is 6 + 134738? 134745 In base 6, what is -1011035 - 201? -1011240 In base 4, what is -33 + -133103? -133202 In base 8, what is 30 + -745? -715 In base 6, what is 14 - -134131? 134145 In base 11, what is 18 + 30a647? 30a664 In base 10, what is -1641 + -63? -1704 In base 12, what is 22288 + -4? 22284 In base 8, what is 226205 + -73? 226112 In base 10, what is 52 + -47? 5 In base 16, what is 2 - -65a6? 65a8 In base 16, what is -3 - 6c33a? -6c33d In base 11, what is 619 - -23? 641 In base 4, what is -3232023 - 2? -3232031 In base 3, what is -11021011100 + -101? -11021011201 In base 3, what is -1020110220 + -21221? -1020202211 In base 6, what is -4210 - 1001? -5211 In base 11, what is 323a + 0? 323a In base 3, what is 21012101100 + -2? 21012101021 In base 11, what is 83 - 1293? -1210 In base 11, what is -58337 - 31? -58368 In base 13, what is -5 - -1ac3a? 1ac35 In base 16, what is -1 + -3b84c? -3b84d In base 11, what is 12 + 19544? 19556 In base 16, what is 2 - -143d5? 143d7 In base 2, what is -11011011 + 1011? -11010000 In base 16, what is 4d - 3e04? -3db7 In base 10, what is 2277 + -123? 2154 In base 2, what is -1000010011110101111000 - 101? -1000010011110101111101 In base 5, what is 2 + -200401? -200344 In base 13, what is -28 - -11088? 11060 In base 14, what is 5 - 22422? -2241b In base 7, what is 2033 - -402? 2435 In base 3, what is 2212100 - 111? 2211212 In base 2, what is 101000111111000 + 11? 101000111111011 In base 6, what is -2 - -402521? 402515 In base 7, what is 5 + 14060256? 14060264 In base 12, what is -151208 - 12? -15121a In base 2, what is -100000110001101 + -1010? -100000110010111 In base 9, what is -325 - -142? -173 In base 9, what is -101134 + 2? -101132 In base 11, what is 2 - 3300? -32a9 In base 16, what is -5 - 2651e? -26523 In base 14, what is 3 + -3d68b3? -3d68b0 In base 7, what is 2564 + -104? 2460 In base 4, what is 213111021 - 0? 213111021 In base 15, what is 5cac - -20? 5ccc In base 11, what is 3427 + -97? 3340 In base 15, what is -3cd69 - -4? -3cd65 In base 5, what is 1342430 - 1? 1342424 In base 15, what is -1 - -45be? 45bd In base 6, what is -10 + -5501? -5511 In base 10, what is 437 + -34? 403 In base 16, what is 5cf - -f9? 6c8 In base 2, what is -11 + 10011010101000? 10011010100101 In base 12, what is 271 + 59? 30a In base 16, what is 5 - -6d7f? 6d84 In base 13, what is 4 - 1cb329? -1cb325 In base 8, what is 3723 - -133? 4056 In base 3, what is -1221120112 - -10? -1221120102 In base 5, what is -320441 - 14? -321010 In base 16, what is 6 - -d3b01? d3b07 In base 9, what is -2226 + -3018? -5245 In base 16, what is 1d + b6fb? b718 In base 12, what is 8b - -41a? 4a9 In base 13, what is -25a0 + 8? -2595 In base 6, what is -1330 - 2322? -4052 In base 10, what is -846396 + 3? -846393 In base 12, what is -1108 + -2bb? -1407 In base 13, what is -19832 + 4? -1982b In base 16, what is 28b - f? 27c In base 8, what is 3 + 251533? 251536 In base 4, what is 333 - 20232? -13233 In base 5, what is 31 - 14244? -14213 In base 9, what is 400	{ "pile_set_name": "DM Mathematics" }
8s2 Collect the terms in -160t*3 + 13 + 8t - 8t - 14. -160t*3 - 1 Collect the terms in 4076k*2 + 2k + 6032k2 - 2k. 10108k2 Collect the terms in 32k*3 - 10k*3 - 7k*3 - 3k*3. 12k*3 Collect the terms in 25195i*3 - 50336i*3 + 25143i*3. 2i*3 Collect the terms in -117f + 5 + 213f - 91f. 5f + 5 Collect the terms in 65w*3 + 11 - 11 + 5w*3 + 2w*3. 72w*3 Collect the terms in -1 - 2i*2 - 108982i - 4i3 + 3i3 + 2. -i3 - 2i2 - 108982i + 1 Collect the terms in -12 + 14 - 64d - 59d - 132d. -255d + 2 Collect the terms in -36 + 28 + 12a3 + 2 + 6 + 3a*2. 12a*3 + 3a*2 Collect the terms in 204 + 159 + 2484o - 363. 2484o Collect the terms in 25h + 17h + 16h - 5 - 83h + 8h + 21h. 4h - 5 Collect the terms in -144u2 - 142u*2 - 139u*2 - 139u*2 + 708u*2 - 143u2. u2 Collect the terms in 3s3 - 8s*3 + 179s + 3s3. -2s*3 + 179s Collect the terms in -5 - 57c2 + 10c*2 - 18c*2 + 4. -65c*2 - 1 Collect the terms in -23c*2 - 3c + 3c + 0c - 49c2. -72c*2 Collect the terms in -73 + 26 + 14 - 66i. -66i - 33 Collect the terms in x2 + 368x*3 - 89x*3 - 136x3 - x2 - 136x3. 7x*3 Collect the terms in 2 - 27011c*2 - 2 - 15449c*2. -42460c*2 Collect the terms in -158479w + 3w3 + 158479w. 3w3 Collect the terms in -434 - 131l + 434. -131l Collect the terms in -621a - 148a - 101a - 1847a. -2717a Collect the terms in -86j2 - 2j + 2j + 50j*2. -36j*2 Collect the terms in -165q*3 + 6q*2 - 23q*3 - 6q*2. -188q*3 Collect the terms in 4263j*3 - 8293j*3 + 4031j3. j3 Collect the terms in 882 - 4s - 357 - 525. -4s Collect the terms in 74 - 74 + q*2 + 219475q - 219475q. q2 Collect the terms in -41571g*3 + 81g*2 - 81g*2 + 41555g*3. -16g*3 Collect the terms in 10a - 21a - a - 7a - 16a. -35a Collect the terms in -2q2 - 3q + 5030 - 5030. -2q2 - 3q Collect the terms in 19 + 58t2 + 19t + 68t2 + 65t*2 - 189t*2. 2t*2 + 19t + 19 Collect the terms in 53y + 52y + 31y - 139y. -3y Collect the terms in -10c - 4c - 178c*3 + 14c. -178c3 Collect the terms in 0s + 3 - 47 - 2s - 3 + 47. -2s Collect the terms in y*3 - 2056y*2 + 3y*3 + 2056y*2. 4y*3 Collect the terms in -1477 - 2g*3 + 650 - 1797. -2g3 - 2624 Collect the terms in w3 + 11w3 + 7w*3 - 17w3 - w3. w*3 Collect the terms in 2019i + 2022i - 8088i + 2013i + 2029i. -5i Collect the terms in 10z*3 + 304079z*2 - 304079z*2. 10z*3 Collect the terms in 11 + 20 - 2 - 3439c*2 - 1. -3439c*2 + 28 Collect the terms in 7 - 9 + 2 + 26b*2. 26b*2 Collect the terms in -11n + 6n + 12n - n - 6n2 + 12n. -6n2 + 18n Collect the terms in -7 - 488d + 0 - 14 - 451d + 938d. -d - 21 Collect the terms in -880x - 36x + 917x. x Collect the terms in 14p + 6p + 14p - 20p - 11p. 3p Collect the terms in -128u - u2 + 128u + 334 + 183 - 517. -u*2 Collect the terms in -469j*3 + 1071j*3 - 473j*3. 129j*3 Collect the terms in 2822g + 2810g - 5626g. 6g Collect the terms in 31034p*3 - p + 3p - 6p - 31023p*3 + 4p. 11p3 Collect the terms in 2934x - 2934x - 24x*3. -24x*3 Collect the terms in -15y + 28855 - 28855 + 2y2 + 5y*3. 5y*3 + 2y*2 - 15y Collect the terms in 4f - 3f - 9199724 + 2f + 9199724. 3f Collect the terms in -1788u3 - 402 + 402. -1788u*3 Collect the terms in 357z*2 + 691z*2 - 195z*2. 853z*2 Collect the terms in 4 + 43o*2 - 3 + 29o*2 + 58o*2. 130o*2 + 1 Collect the terms in 245l*2 + 310l*2 + 105l*2. 660l*2 Collect the terms in -11d*3 - 25d*3 - 11d*3 + 11d*3 - 6d*2. -36d*3 - 6d*2 Collect the terms in -6h*3 + 19h3 - h3 - 2h3 - 4h*3. 6h*3 Collect the terms in -59 + 142o + 1159o + 59. 1301o Collect the terms in 528z2 - 5z + 4z - 520z*2. 8z*2 - z Collect the terms in 1139 + 2h3 - h3 - 950. h*3 + 189 Collect the terms in 361242d - 722494d + 361251d - 31. -d - 31 Collect the terms in 17x - 3 + 19x - 53x - 227x*2 + 17x. -227x2 - 3 Collect the terms in 5681q - 328q2 + 147q*2 - 225q*2 - 5681q. -406q2 Collect the terms in 766k*3 + 701049k*2 - 764k*3 - 701049k*2. 2k*3 Collect the terms in -17o*2 - 910447o + 910447o. -17o*2 Collect the terms in -1781s*3 - 1 + 1. -1781s*3 Collect the terms in -75y*3 + 212y*3 - 77y*3 - 56y*3. 4y*3 Collect the terms in 102s + 3 + 100s + 57s + 101s - 356s. 4s + 3 Collect the terms in 14m*2 - 5m*2 + 3m*2 + 94m*2 + 29m*2. 135m*2 Collect the terms in -1333q*3 + 0q + 4890q3 + 2386q*3 - q. 5943q*3 - q Collect the terms in -111i + 62 - 28 - 69. -111i - 35 Collect the terms in -77u*2 - 65u*2 - u + 154u*2 - 122. 12u*2 - u - 122 Collect the terms in -1426n + 387n + 522n + 517n + 3n*3. 3n*3 Collect the terms in -80 - 186 - 13j*3 + 263. -13j*3 - 3 Collect the terms in 23z - 599z2 - 23z. -599z2 Collect the terms in 703d - 353d - 354d. -4d Collect the terms in -263m - 260m - 263m - 266m - 258m + 1311m. m Collect the terms in 16f*3 - 23f*3 - 40f*3 + 25f*3 + 24f*3. 2f*3 Collect the terms in -3k*2 - 555k + 555k - 1 + 9k*2 - 5k2. k2 - 1 Collect the terms in -635c3 - 40c*3 + 26c*3 - 5 + 5. -649c*3 Collect the terms in 2g + 612g2 - 630g*2 - 4g. -18g2 - 2g Collect the terms in -39 + 39 + 12r3 + 10r*3. 22r3 Collect the terms in 122 - 45 - 38 + n3 - 37. n*3 + 2 Collect the terms in 3f - 49 - 390f2 + 58f*2 + 0f. -332f2 + 3f - 49 Collect the terms in -2t3 - 746t + 746t - 14t*3 - 26t*3. -42t*3 Collect the terms in -522d + 995d - 518d. -45d Collect the terms in -4q*2 + 9976 - 4982 - 4994. -4q*2 Collect the terms in -70301q*3 + 75208q*3 + 125143q*3. 130050q*3 Collect the terms in -339d*3 + 1 - 375d*3 - 2 + 142d*3. -572d3 - 1 Collect the terms in h3 - 851 - 857 + 1708 - 18h3. -17h*3 Collect the terms in -8o*3 + 3 + 1 - 34o*3 + 10o*3. -32o*3 + 4 Collect the terms in 791979344 - 791979344 + 2x*3. 2x*3 Collect the terms in -11d + 8d + 40d*2 - 50d*2 + 8d + 8d. -10d*2 + 13d Collect the terms in -189834r2 + 379642r*2 - 189809r2. -r2 Collect the terms in 6 + 52 + 7t2 - 21t*2 - 55. -14t*2 + 3 Collect the terms in -205o + 62o + 46o + 72o + 62o. 37o Collect the terms in 646j*2 - 646j*2 + 9j*3 + 2. 9j*3 + 2 Collect the terms in -5 + 9 + 1 - 5 - 34n. -34n Collect the terms in -29b*2 - 29b*2 - 9 + 23 + 2b. -58b2 + 2b + 14 Collect the terms in -63w - 58w - 72w + 196w. 3w Collect the terms in -26 + 46 + 10w*3 - 31w*3 - 20 - w. -21w*3 - w Collect the terms in 7 + 13f + 16f - 33f. -4f + 7 Collect the terms in -27307p + 351p2 + 27307p. 351p2 Collect the terms in 5c2 + c2 + 1005c - 1005c - 4c2. 2c*2 Collect the terms in -1612z + 777z + 982z. 147z Collect the terms in -5z - 4z + 60 - 41 + 29 - 48. -9z Collect the terms in 22l - 86l + 21l + 21l + 25l. 3l Collect the terms in 9 - 3 + l*2 - 126l + 4. l*2 - 126l + 10 Collect the terms in -146 - 146 + 290 + 16d. 16d - 2 Collect the terms in -290919 - 581c + 290919. -581c Collect the terms in -t*2 - 120t - 21 + 72 - 32 - 19. -t*2 - 120t Collect the terms in -587x2 - 55x*3 + 586x*2 - 60x*3. -115x3 - x2 Collect the terms in -2359g2 + 2562g*2 + 2g - 2g. 203g*2 Collect the terms in 314h*2 - 1900336 + 1900336. 314h*2 Collect the terms in -55u - u + 27u - 65u. -94u Collect the terms in 40175k - 20048k - 20128k. -k Collect the terms in 919w2 + 1427w - 1427w. 919w*2 Collect the terms in 43t + 24t - 20t - 22 + 22. 47t Collect the terms in -4 + 109n*3 - 3n*2 - 5 + 9. 109n*3 - 3n*2 Collect the terms in -407u*2 - 415u*2 - 414u*2 - 43u*3 - 405u*2 + 1642u*2. -43u3 + u2 Collect the terms in -1129h3 - 10h + 560h3 + 564h*3. -5h*3 - 10h Collect the terms in 87503 - 87503 - 37j. -37j Collect the terms in 3677w - 7351w - 1 + 3675w. w - 1 Collect the terms in -13054o*2 - 8o*3 + 44o*3 + 13054o*2. 36o**3 Collect the ter	{ "pile_set_name": "DM Mathematics" }
) - 5g(i). Let q be l(8). Solve 3d - 6 = -3o + 3, qo - 2d = 0 for o. 1 Let p(i) = -2i + 3. Let k be p(3). Let v = -797 - -765. Let c be -2 + v/(-12) - 10/k. Solve -2s = -2z - c, 5s - z + 2 = -0 for s. -1 Let b = -394 + 127. Let h = 274 + b. Solve -hf + 3f + 8 = 2d, 0 = -f + 3d + 16 for f. 4 Suppose w - 42 = -4m + 25, 4m = -3w + 73. Solve -s = 3t - 16, -8 = 5s - 3t - m for s. 4 Let w be (-77 + 63)/((-7)/10). Let x be 33/7 - 4/(-14). Solve 4o + 5h = -w, 0o + x = -o - 3h for o. -5 Let v(a) = -a2 + 22a + 17. Let k be v(0). Let s be (((-9)/2)/(-3))/(k/34). Solve su = -2x - 13, -3u = -2u + 5x for u. -5 Suppose -4z = -4c + 8, 0 = 4c - 5c - 2z + 14. Suppose ct = 9t - 57. Solve 5n + t = -2j, -6j + 4n = -4j - 26 for j. 3 Let q(s) = s2 + 21s - 97. Let o be q(4). Let y be (2 - 22/6) + 8/12. Let u be (-5 - -1)/(-1) - (-2)/y. Solve -h = up + oh + 2, 0 = 2p + h + 2 for p. -1 Let f be ((-4)/(48/(-20)))/(35/546). Solve -21c - 21 = 4a - fc, -7 = 2a + c for a. -4 Let t = -21 - -23. Let x be ((-1)/t)/(2/(-20)). Suppose -1 = xf - 11. Solve -2s - i = -3i + 2, fs + 30 = -5i for s. -5 Suppose -s + 9 = 3r, -s + 5 = -0r + 2r. Let i = 28 + -23. Suppose 0 = -4k + id - 2d + 87, 5k - d - 95 = 0. Solve -3 = 3c + 6, -2y = rc + k for y. -3 Suppose 0 = -44b + 29b + 75. Suppose -28 = -9d - bd. Solve -z - 5o = 24, do + 3 = -7 for z. 1 Let h(u) = u*3 - 33u*2 - 43u + 308. Let s be h(34). Solve -sa + 7 = 3v, -a = 2a + 3v - 9 for a. 2 Let y = -6575 + 6579. Solve 2i + d = 36 - 34, -d = -y for i. -1 Let v be 70/6 + 8/(-12). Suppose -54o - 20 = -58o. Suppose 6 = om + 6. Solve -4y + 9y - 2s - v = m, -y - 7 = -5s for y. 3 Let t = -24778 - -24791. Solve 0 = 3o + 5h - 5, 11 = o + 17h - th for o. -5 Let c = 182 - -94. Suppose 100 = -44d + c. Solve 6h - 20 = 2h + dl, -19 = -4h + 3l for h. 4 Suppose -5y + 6 = 1. Let t be 6 + -4 - 0/y. Let s = 76 - 74. Solve -4 = -2u - sf, -2u - tf = 2u + 2 for u. -3 Let m(c) = -8c - 272. Let n be m(-35). Solve 0 = -9s + 13s - 3j - n, 0 = 2s - 2j - 4 for s. 2 Let a be 3/(-2) - ((-77)/(-22))/7. Let q be ((-8)/((-384)/36))/(a/(-8)). Solve -qm - 3k + 3 - 6 = 0, -4 = k for m. 3 Suppose -2d = -13 + 3. Suppose -2l = -2c + 13 + 7, -2l = -4c + 38. Suppose 18u = cu. Solve u = -r - w - 6, dr - 2w + 24 = -4w for r. -4 Suppose -3j = -5g + 17, -3g - 2j + 3 = 8. Solve o + g = 2t, 2t + t - 4 = o for t. 3 Let o(h) = -6h2 - 58h - 32. Let z be o(-9). Solve 0 = -y + 2i - 3, -11 = -zi + 5 for y. 5 Let i be ((-7)/((-105)/(-6)))/(5/(-200)). Let z(g) = 11 + 4g - 13 - 14 - i. Let n be z(11). Solve 12 = -4a + 4s, -s = 5a + 3s - n for a. 0 Let p be (7/((-441)/(-18)))/((-5)/(-70)). Solve -45 = -5b - pn, 4n = 2b + 3b - 5 for b. 5 Suppose 0 = 10l + 223 - 253. Solve lh = 4m + m + 25, 3h - 11 = -2m for m. -2 Let v be -12((-2)/(-20) - 42/70). Solve -4k - 22 = -2s, 2s + 20 = -2k + vs for k. -4 Suppose -18h + 476 = 440. Solve 3 = hs + i, 6s - 3s = -5i + 22 for s. -1 Suppose -749p + 750p = 6. Solve -pw + 8w + 2z = -10, -4w = -z + 15 for w. -4 Let b(y) = 3y2 - 44y + 35. Let h be b(14). Let n be (0 - h - -11)/(1 + 1). Solve 3g = 6g - 4d - n, 3d = 5g + 4 for g. -2 Let o(c) = -c + 20. Let d be o(11). Suppose 2y + 17 = d. Let v(p) = -p*2 - 4p + 2. Let t be v(y). Solve 2s = -2b - 3s, -1 = b + ts for b. -5 Let j(g) = 51g3 - 2g*2 + 2. Let l be j(1). Suppose -2s - l = -57. Solve 4f = 2x + x - 28, -sf - 5x = -8 for f. -4 Let m = -416 - -464. Suppose -11x - 15 = -m. Solve 4t = -2a + xa + 4, -5a - 20 = -4t for t. 0 Suppose -2 = p - 6. Let y = -146 - -166. Suppose 0 = 4f - 0f - y, 5f = -o + 33. Solve 0 = -2m + 5n - o, 0 = pm - 3n + 2 for m. 1 Let m be 17936/3304 - 1/(-7)-3. Solve -4f + 0z = 3z - 3, -mf + 2 = 2z for f. 0 Suppose 4z + 6 = 5s + 61, 3z = -s + 8. Solve 0 = -a + zc - 4, -a - 29c + 30c = 0 for a. 1 Suppose g = -5n + 100 + 10, 0 = -n - g + 22. Let x be (1 - -1)/(11/n). Let m(t) = t*3 - 4t*2 + 6t - 3. Let u be m(4). Solve 5i - x = u, -z - i = -4 for z. -1 Suppose 3a = 4f - 29, 14 = -f + 6a - a. Let u = f + -9. Suppose 4v - 15 = -x - 6, 2x - 6 = -uv. Solve 3p + q = 8p + 6, vp + q = -1 for p. -1 Let w(o) = -o*2 - 5o + 22. Let i be w(-6). Let g be 0 - 6 - (-42 + i). Solve -4v = -3d - g, 0d - 6 = 3v + 3d for v. 2 Let a = 2528 + -2526. Solve 10 = 2s - m - 0m, -as + 5m = -10 for s. 5 Let z(f) = 1131f + 3393. Let r be z(-3). Solve r = 5u - 2p, 135p - 136p = -4u - 3 for u. -2 Suppose j = 5f + 30, 4f + 43 - 3 = 4j. Solve -4g - 21 = -5b, 1 = -jb - 5g - 14 for b. 1 Suppose 0 = 8z - 29 + 12 + 1. Solve -c - 3c - zf = 0, -2c - 4f = 0 for c. 0 Suppose -305k + 1855 = 66k. Solve 2 = -4h - 5y, 0 = -ky - 2 - 8 for h. 2 Suppose 2f - 2z = -4z, -4f = -4z. Suppose f = 5j - 15, 9 = l + 2j - 1. Solve -5o - 4v = -5, -lo = -0v - 3v - 4 for o. 1 Let j be 14 + (42/(-18))/((-16)/(-48)). Solve 0 = jz + 35, -21 = w + 3z + 2z for w. 4 Suppose 8p + 1364 = 156. Let i = p - -154. Solve 0 = -5a - 4y + 9 + 8, -3a = -iy - 21 for a. 5 Suppose 28c - 114c - 270 = -700. Solve 2f - s + 2s = -c, -f - s = 3 for f. -2 Let o be ((2 - 5) + -2)(-3159)/(-27). Let q = o + 587. Solve 0 = -m - 3t - 8, -qm + 3m + 5t = -10 for m. -5 Suppose 0 = -2558w + 2554w + 3n + 83, 3n = 3w - 66. Solve -9d = 3p - 11d + 2, -3p - d - w = 0 for p. -4 Let a = -83 + 83. Suppose a = 29g - 24g - 30. Solve 2 = p + 4h, 2h = 3p - 3h - g for p. 2 Let u(b) = -1. Let d(n) = -2n + 18. Let i(o) = 4d(o) - 12u(o). Let k be i(9). Solve k = -f - 3a, f + 3a + 6 = 2f for f. -3 Let z = 3401 - 3401. Solve 3o + 3a = 0, -5o + zo = a + 4 for o. -1 Suppose j + 5b - 143 = -137, 2j - b = 23. Solve -3f = -4i - j, -15 = 7i - 4i for f. -3 Let x be (-10)/(-5) + 3 + (8 - 13). Solve 3o + 2g + 1 - 8 = x, 3o - g = -8 for o. -1 Let a be 1/(-4)-20 + -1. Solve 21n - 18n - 12 = -3j, -n + aj = 6 for n. 2 Suppose z = -4m + 9, z + 3 = 4z. Let i = 7 + -5. Suppose 215 + 154 - 117 = 126a. Solve p + ip + 4 = -2j, -m = aj + 4p for j. -5 Suppose g = 2b - 8 - 19, 3g = -3b + 45. Suppose 3w - 7 = 2l, 3w - 5l = -w + b. Solve 0 = -5p - 25 + 5, -3x + w = -p for x. -1 Let i = 35 - 33. Suppose -ik - 4 = b, -k = -b - b + 7. Let t = 22 + -6. Solve -2q = -2j + t, 4j - bq = -7q - 4 for j. 4 Let p = 1628 + -1623. Solve -3r = -d - 5, -16r = -5d - 11r + p for d. 4 Suppose 35i - 340 = 30i. Suppose 60 = -2r + i. Solve 5a = rq - 3, -3a + 0q + 3q = 0 for a. -3 Let o(j) = -31j + 1345. Let v be o(43). Let w = 9 - 4. Solve 2x - 4b + v = -14, -wb = x - 22 for x. -3 Suppose -2a = 3q - 12, -163q = -166q + 2a. Suppose -4z + 18 = 2. Let h be ((-10)/z)/((-12)/24). Solve 0 = -3g - qx - h, 5x = -2g + 7g for g. -1 Let s(n) = -2n - 39. Let m be s(-18). Let x be ((-2)/m)/((-2)/(-63)). Let v = -16 + x. Solve -2l = -7l - h + 12, 20 = 5l + vh for l. 2 Suppose 154p - 824 = 51p. Solve -4l - 4j = 0, -5l - j + 24 = p for l. 4 Let z(n) = 12n + n*2 + 0n*2 + 4 - 2. Let f be z(-12). Solve 3h = 9, -4g - 3h + 7 = f for g. -1 Suppose -6p = 770 - 1070. Let k be (0 + 10)/(p/75). Solve -5m + 15 = 5g, m - 5g + 0g = k for m. 5 Let u be ((0 - 0)/(-1))/(4 + -4 - 2). Let d = 0 + 2. Solve u = -3p + dg - 2, 0p = 2p - g for p. 2 Suppose -2c - 2c = 0. Let s = -264 - -307. Suppose 0 = -k + 71 - s. Solve c = -2g - 5x + 28, -6x + 3x = 4g - k for g. 4 Let h be 46 + -3 + (-56)/(-8). Suppose 36 = 2j - 3p + 35, 2p = -5j + h. Solve 0 = 2b + 4, -2v + b - j = 0 for v. -5 Let i(x) = 421x + 5489. Let u be i(-13). Solve 0 = 2h + 4y - u, -84h - 5y + 20 = -88h for h. 0 Let v(h) = -h*2 + 22h + 145. Let u be v(27). Solve 3m = 18l - 14l - u, -m + l = 2 for m. 2 Let u = 12958 - 12954. Solve -4d = 18y - 16y + 4, -2d - uy = 14 for d. 1 Let y = -1612 + 950. Let n = 666 + y. Let q = -6 - -18. Solve -2d + d + n = 0, -4b - 5d + q = 0 for b. -2 Let q(l) = 73l + 2121. Let t be q(-29). Solve -h + 4 = h - 3f, 2f = h - t for h. -4 Let s(h) be the third derivative of -h*5/60 + 7h*4/12 + 14h*3/3 - 25h*2. Let o be s(16). Let v = o - -5. Solve t + v = -4g,	{ "pile_set_name": "DM Mathematics" }
k - 3 - 11 + 11. -11k - 3 Collect the terms in 17r - 7r - 4r + 31r. 37r Collect the terms in 87 - 37r3 - 87. -37r*3 Collect the terms in -6r*2 - 36 - 35 + 110 - 39. -6r*2 Collect the terms in -1106d + 2d3 + 1106d. 2d3 Collect the terms in -20n*2 - 6n*2 + 0 + 0. -26n*2 Collect the terms in -3 + 1 - 3h + 1. -3h - 1 Collect the terms in 3051k - k*2 - 1557k - 1494k - k2. -2k*2 Collect the terms in 5d*2 + 3d*2 - 54d + 89d - 35d. 8d2 Collect the terms in 29f - 3f - 3f + 15f. 38f Collect the terms in z - 108 - z + z - 3z. -2z - 108 Collect the terms in -510m + 1029m - 2m3 - 519m. -2m3 Collect the terms in 23u + 0 + 7 - 5 + 0. 23u + 2 Collect the terms in -354r - 348r + 700r. -2r Collect the terms in -7 + 0u + 2u2 + 0u + 0u. 2u*2 - 7 Collect the terms in 1 + 53a*3 + 65a*3 - 27a*3. 91a*3 + 1 Collect the terms in 54253r - 54253r - r2. -r2 Collect the terms in 17z*2 - 2z*2 - 3z*2 + 13z*2. 25z*2 Collect the terms in -2z - 4z2 + 22z*3 + 2z*2 + 2z. 22z3 - 2z*2 Collect the terms in 17x*2 - 37 + 37. 17x*2 Collect the terms in 1 - 1 + 20p*2 - 11p*2. 9p*2 Collect the terms in 8v*2 + 6v*2 + 5v*2 - v + 8v*2. 27v*2 - v Collect the terms in 211z*2 + 209z*2 - 417z*2. 3z*2 Collect the terms in 131w*3 - 65w*3 - 72w*3. -6w*3 Collect the terms in -5c + 24c - 16c - 5c. -2c Collect the terms in 17r3 + 2r*2 - 4r*3 - 2r*2. 13r3 Collect the terms in p3 - 9 - p2 + p2. p*3 - 9 Collect the terms in 0p - 4p - 3p + 4p. -3p Collect the terms in 2853b2 - 1421b*2 - 1426b*2. 6b*2 Collect the terms in -28r2 + r3 + 0r3 - 7r*3. -6r*3 - 28r*2 Collect the terms in -99t + 99t - 16t*3. -16t*3 Collect the terms in 30x*2 - 105x*2 + 27x*2 + 27x*2. -21x*2 Collect the terms in -25r*3 + 102r - 104r + 11r*3. -14r*3 - 2r Collect the terms in 13 + 142s3 - 6 - 7 - 143s3. -s3 Collect the terms in -3u - 7u - 13u - 30u. -53u Collect the terms in -3w*3 + 4 + 2w3 - 4. -w3 Collect the terms in 56q3 - 25q*3 - 35q*3. -4q*3 Collect the terms in 136p*2 + 140p*2 - 272p*2. 4p*2 Collect the terms in 8t*2 - 7t*2 + 10t - 29t + 19t. t*2 Collect the terms in 3s*2 - 16 + 3 + 13. 3s*2 Collect the terms in -34g*3 + 11g*3 - 8g*3. -31g*3 Collect the terms in 4z*3 - 16z + 7z + 9z. 4z3 Collect the terms in n3 + 14n - 28n + 14n. n*3 Collect the terms in 6508 - 6508 + 2s*2. 2s*2 Collect the terms in 3769v*2 + 448v*2 + 3918v*2. 8135v*2 Collect the terms in 17v + 6v + 7v - 28v. 2v Collect the terms in -5522d2 + 0d - 2d3 + 0d + 5522d2. -2d*3 Collect the terms in -1276j + 1276j + 9j*3. 9j3 Collect the terms in v3 + 36 + 13 - 49 + v*3. 2v*3 Collect the terms in -9w + 8w - 9w - w. -11w Collect the terms in 5t*3 - 52t*2 + 52t*2. 5t*3 Collect the terms in 8835m*2 - 8835m*2 + 29m*3. 29m*3 Collect the terms in -9d*2 + 0d*2 + 93d*3 + 9d*2. 93d*3 Collect the terms in 0k*2 + 2k + 3k + k2 + 3k*2. 4k*2 + 5k Collect the terms in -11c2 - c2 + 8c*2 + 8c*2. 4c*2 Collect the terms in -4y*2 - 9y*2 + 7y*2. -6y*2 Collect the terms in -21 + 21 - 13r. -13r Collect the terms in l - 1036 + 1036. l Collect the terms in j - 35 + 17 - 22. j - 40 Collect the terms in 0x*3 - 100 + 2x3 - x3 + 15. x*3 - 85 Collect the terms in 6i3 - i3 - i*3. 4i*3 Collect the terms in 19c*3 - 6c*3 + 11c*3. 24c*3 Collect the terms in -16965o + 16965o - 20o*2. -20o*2 Collect the terms in 13q - 7q + 0 + 14q + 2. 20q + 2 Collect the terms in -3 + 3 + 137i*2. 137i*2 Collect the terms in 4 - 1 + 139i - 4i. 135i + 3 Collect the terms in 362t + 371t + t*3 - 733t. t*3 Collect the terms in 3y - 161y3 - 3y + 55y3. -106y3 Collect the terms in 1001 - 1001 + u2 - 17u. u2 - 17u Collect the terms in -481 + 481 + 2z - 2z - z. -z Collect the terms in -13 + 13 + 20o3. 20o*3 Collect the terms in -425p*2 - 3 + 3 + 447p*2. 22p*2 Collect the terms in 30 - 88y*3 - 22y*3 - 30. -110y*3 Collect the terms in -36 - 35d + 38d + 36. 3d Collect the terms in -2g + 948 - 948. -2g Collect the terms in -2 + 3a2 - 4 + 9 - 3. 3a*2 Collect the terms in -120 + 211u*3 - 206u*3 + 120. 5u*3 Collect the terms in -23b2 + b2 - 17b2. -39b*2 Collect the terms in -3n + n + n - 34 + 0n. -n - 34 Collect the terms in -22f*3 - 3 - 32f*3 + 0 + 56f*3. 2f*3 - 3 Collect the terms in -2v*2 + 20474v - 20474v. -2v*2 Collect the terms in 86d*2 - 43d*2 - 37d*2. 6d*2 Collect the terms in 422j - 4j3 + j3 - 422j. -3j3 Collect the terms in 18t + 2t3 - 18t. 2t3 Collect the terms in -2j2 + j2 + 16 - 16. -j*2 Collect the terms in 23i + 4i3 + i3 - 4i*3 + 5i*3. 6i*3 + 23i Collect the terms in -3o3 - 24o2 + o3 + 5o3 + 24o*2. 3o*3 Collect the terms in -10w*3 + 9w*3 - 3w*3 - 2w*3. -6w*3 Collect the terms in 0q - 40591q3 + 40594q*3 + 0q. 3q3 Collect the terms in 780r*3 - 394r*3 - 397r*3. -11r*3 Collect the terms in 1766d - 1766d + 3d*2. 3d*2 Collect the terms in 63633 + 3x - 63633. 3x Collect the terms in 0 - i3 - 4i*2 + 2i2 + 0. -i3 - 2i2 Collect the terms in -26g*3 - 31g*3 + 59g*3 + 0 + 0. 2g*3 Collect the terms in 31w + 10w - 3w - 3w. 35w Collect the terms in 7h3 + 7h*3 - 7h*3 + 4h*3. 11h3 Collect the terms in -t2 + 13t2 - 14t*2. -2t*2 Collect the terms in 7c*2 - 235 - 9c*2 - 17. -2c*2 - 252 Collect the terms in 101j*2 - 33j*2 - 40j*2 - 33j*2. -5j*2 Collect the terms in 5c*2 + 13c*2 - 2 + 2 - 27c*2. -9c*2 Collect the terms in 12k*2 - 3k*2 - 9k*2 + 24k*3. 24k*3 Collect the terms in 2 - 40919x*2 - 2 + 40918x2. -x2 Collect the terms in 2w3 + w3 - 4w*3 - 61w*2 + 61w2. -w3 Collect the terms in -11 + 71d - 13 + 25. 71d + 1 Collect the terms in 2 - 2 - 211q2 + 0. -211q*2 Collect the terms in 473 - 159 + 2l*2 - 161 - 153. 2l*2 Collect the terms in -50r + 0r2 + 3r*2 + 92r + 97r. 3r*2 + 139r Collect the terms in -3 - 3899c2 + 3 + 3911c*2. 12c*2 Collect the terms in 3 - 3 + 139r*3 + 51r*3. 190r*3 Collect the terms in -91m*3 - 4m*2 - 98m*3 + 187m*3 + 4m*2. -2m*3 Collect the terms in -32 - 245k*3 + 32. -245k*3 Collect the terms in -290c + 290c + 122c*3. 122c*3 Collect the terms in -165p*2 - 22p*2 - 73p*2. -260p*2 Collect the terms in 8 + 22d*3 - 22 + 14. 22d*3 Collect the terms in 13w + 10w + 10w - 33w + w2. w2 Collect the terms in 913j - 913j + 50j*2. 50j*2 Collect the terms in -2z*2 - 15z*3 - 2z*2 + 4z*2. -15z*3 Collect the terms in 9g + 5g - 6g - 6g. 2g Collect the terms in -151u3 - 82u*3 + 26u*3. -207u*3 Collect the terms in 3q - q + 3q - 2q. 3q Collect the terms in -19j - 4j + j + 3j + 16j. -3j Collect the terms in 24767c - 24762c + 0 + 1 - 1. 5c Collect the terms in -8u*3 + 5u*2 - 5u*2 + 23u*3. 15u3 Collect the terms in -d2 - 258d + 8 + 258d. -d*2 + 8 Collect the terms in 4q - 2q + 4q. 6q Collect the terms in 3s*3 + 92s*2 - 285s*2 - 218s*2. 3s*3 - 411s*2 Collect the terms in -32z*2 - z - 16 + 16 + 3z. -32z2 + 2z Collect the terms in 12 + 5q3 - 3q*3 + 39 - 6. 2q*3 + 45 Collect the terms in -205 + 205 + 12f*2. 12f*2 Collect the terms in 3x - 10x3 + 3x - x. -10x3 + 5x Collect the terms in 0 + 35l + 1 - l2 - 1. -l2 + 35l Collect the terms in -20s3 + 17s*3 - 10s*3 + 15s*3. 2s*3 Collect the terms in 8498l - 7l2 - 8498l - l*2. -8l*2 Collect the terms in 3 - 5 - 4 - 16x. -16x - 6 Collect the terms in 3561d + 1591d + 2232d. 7384d Collect the terms in -45 - b + 38 - 2b - 58. -3b - 65 Collect the terms in q2 + 34 + 34 - 68. q2 Collect the terms in 15 + 4g*3 - 15. 4g*3 Collect the terms in -3j*3 - 28j + 0j3 + 9j*3 + 28j. 6j3 Collect the terms in -2q - 1 - 3 + 0 - 1. -2q - 5 Collect the terms in 0 + 118z + 6 - 6. 118*z	{ "pile_set_name": "DM Mathematics" }
picked without replacement from veeeeeeeeeeve. 11/78 Calculate prob of sequence gwg when three letters picked without replacement from wwggwgbgg. 5/42 Two letters picked without replacement from {i: 2, f: 11, j: 7}. Give prob of sequence jf. 77/380 Two letters picked without replacement from cso. What is prob of sequence so? 1/6 What is prob of sequence ax when two letters picked without replacement from xajbjwe? 1/42 What is prob of sequence pq when two letters picked without replacement from {n: 2, p: 4, z: 5, w: 4, q: 2}? 1/34 What is prob of sequence os when two letters picked without replacement from ssoobsoboomsbss? 1/7 Four letters picked without replacement from {d: 2, g: 1, t: 2, h: 1, c: 1}. What is prob of sequence chdd? 1/420 Two letters picked without replacement from {h: 3, x: 2, r: 4, k: 6}. Give prob of sequence kh. 3/35 Two letters picked without replacement from xnxnxvnxxxnnxnxnxnn. What is prob of sequence xv? 1/38 Three letters picked without replacement from {a: 2, g: 1, k: 1, l: 2, e: 1}. Give prob of sequence ega. 1/105 Two letters picked without replacement from {d: 3, t: 6, m: 2, o: 2}. Give prob of sequence td. 3/26 Four letters picked without replacement from jbbwbcw. Give prob of sequence wbbw. 1/70 Three letters picked without replacement from mbmbbmv. Give prob of sequence vmb. 3/70 Four letters picked without replacement from rarqaqparrprprmmqp. What is prob of sequence pqpq? 1/1020 Calculate prob of sequence tj when two letters picked without replacement from {j: 5, v: 1, g: 2, d: 4, t: 2}. 5/91 Three letters picked without replacement from kbzzbzkoz. Give prob of sequence ozk. 1/63 What is prob of sequence mt when two letters picked without replacement from {q: 2, t: 1, m: 1}? 1/12 Calculate prob of sequence ph when two letters picked without replacement from {e: 7, p: 2, y: 1, h: 1, q: 5}. 1/120 Two letters picked without replacement from dddduduhu. What is prob of sequence dd? 5/18 Calculate prob of sequence ugud when four letters picked without replacement from jdguudugggjgujgjgd. 7/2040 What is prob of sequence sm when two letters picked without replacement from {m: 1, s: 1, w: 1}? 1/6 What is prob of sequence zc when two letters picked without replacement from {c: 2, z: 10}? 5/33 Calculate prob of sequence qcc when three letters picked without replacement from cwjqwjqtcqqj. 1/165 Calculate prob of sequence kkuu when four letters picked without replacement from {w: 1, u: 5, k: 4}. 1/21 What is prob of sequence de when two letters picked without replacement from {e: 1, d: 7}? 1/8 What is prob of sequence kp when two letters picked without replacement from {p: 11, k: 3}? 33/182 What is prob of sequence cq when two letters picked without replacement from {c: 7, q: 6, z: 2}? 1/5 Three letters picked without replacement from lplspzp. What is prob of sequence lls? 1/105 Two letters picked without replacement from {t: 9, q: 1, s: 1, w: 3, r: 3, m: 1}. What is prob of sequence tt? 4/17 What is prob of sequence yy when two letters picked without replacement from klyykklkkl? 1/45 Calculate prob of sequence zssj when four letters picked without replacement from {p: 1, m: 1, s: 3, z: 6, j: 1, r: 1}. 3/1430 Two letters picked without replacement from sksskskskk. What is prob of sequence kk? 2/9 What is prob of sequence of when two letters picked without replacement from {o: 2, a: 8, f: 5}? 1/21 Three letters picked without replacement from {n: 2, b: 4, h: 2}. What is prob of sequence bnh? 1/21 What is prob of sequence bw when two letters picked without replacement from wbwwbb? 3/10 Two letters picked without replacement from xyxyrzuzuhyh. What is prob of sequence xy? 1/22 Calculate prob of sequence nll when three letters picked without replacement from enkfzll. 1/105 Calculate prob of sequence ax when two letters picked without replacement from {a: 10, x: 10}. 5/19 Two letters picked without replacement from vxxxvxvxvvjxvv. What is prob of sequence jv? 1/26 What is prob of sequence szsa when four letters picked without replacement from {h: 3, a: 3, s: 5, z: 1, r: 1, d: 2}? 1/546 Four letters picked without replacement from iiiiiiiii. Give prob of sequence iiii. 1 What is prob of sequence dxb when three letters picked without replacement from xddxbddyyjvyyydddvdy? 2/855 Two letters picked without replacement from nnnndndddn. What is prob of sequence nd? 4/15 Four letters picked without replacement from btfpfbtefffftppthf. What is prob of sequence ffft? 7/612 Calculate prob of sequence kre when three letters picked without replacement from mrkmretmeremmrkkmjr. 5/646 What is prob of sequence rcb when three letters picked without replacement from {b: 5, r: 5, e: 3, f: 1, j: 3, c: 1}? 25/4896 Three letters picked without replacement from uyuwzrss. What is prob of sequence yru? 1/168 What is prob of sequence ffft when four letters picked without replacement from {f: 17, t: 3}? 2/19 Three letters picked without replacement from xgngxgxxxngggxn. What is prob of sequence xxn? 3/91 What is prob of sequence nnn when three letters picked without replacement from {n: 1, f: 12, b: 5}? 0 Three letters picked without replacement from fffhfhfffh. Give prob of sequence ffh. 7/40 What is prob of sequence yx when two letters picked without replacement from mxhypppp? 1/56 Calculate prob of sequence ooo when three letters picked without replacement from {z: 3, o: 12}. 44/91 What is prob of sequence miih when four letters picked without replacement from hhmhhhhhhihhhhihh? 1/2040 Three letters picked without replacement from {o: 4, e: 2, w: 1}. Give prob of sequence eeo. 4/105 Three letters picked without replacement from npnnpnnpnnnpnnnnnp. Give prob of sequence npp. 65/1224 Four letters picked without replacement from {u: 15, k: 2, w: 3}. Give prob of sequence kwwu. 1/646 Two letters picked without replacement from {p: 4, w: 3, e: 1, j: 4, a: 1}. What is prob of sequence aj? 1/39 What is prob of sequence ff when two letters picked without replacement from {f: 5}? 1 What is prob of sequence kka when three letters picked without replacement from {k: 9, e: 9, a: 1}? 4/323 Three letters picked without replacement from rwpfnph. What is prob of sequence wnf? 1/210 Three letters picked without replacement from {q: 3, v: 11}. What is prob of sequence qqq? 1/364 Calculate prob of sequence bzb when three letters picked without replacement from bbbzbzbzbbz. 28/165 Three letters picked without replacement from {s: 5, l: 1, d: 2, v: 5, o: 3}. What is prob of sequence ldv? 1/336 Calculate prob of sequence gaw when three letters picked without replacement from rrdrgwar. 1/336 Calculate prob of sequence ou when two letters picked without replacement from oououo. 4/15 What is prob of sequence ev when two letters picked without replacement from ktvaeew? 1/21 What is prob of sequence lkno when four letters picked without replacement from {o: 1, l: 3, n: 4, k: 12}? 2/1615 Two letters picked without replacement from {c: 3}. Give prob of sequence cc. 1 Two letters picked without replacement from {q: 7, w: 4}. Give prob of sequence ww. 6/55 Four letters picked without replacement from uxxuuxruuxuuur. Give prob of sequence ruux. 8/429 Calculate prob of sequence scs when three letters picked without replacement from sccsssc. 6/35 Two letters picked without replacement from {f: 2, n: 2, o: 2, m: 2}. Give prob of sequence on. 1/14 Calculate prob of sequence pqpe when four letters picked without replacement from {q: 2, p: 2, e: 2}. 1/45 What is prob of sequence rnnn when four letters picked without replacement from rnbrrnrrfrrrcrbnrrs? 11/15504 Three letters picked without replacement from {i: 5, e: 1, a: 7}. What is prob of sequence iei? 5/429 What is prob of sequence llll when four letters picked without replacement from ollollolloooolollo? 7/170 Three letters picked without replacement from ldgdtddg. What is prob of sequence dgt? 1/42 Calculate prob of sequence pox when three letters picked without replacement from {x: 2, u: 6, p: 3, a: 3, o: 2}. 1/280 Three letters picked without replacement from {z: 1, h: 3, k: 2, p: 1, n: 1, s: 3}. Give prob of sequence zph. 1/330 Calculate prob of sequence lpjj when four letters picked without replacement from {j: 2, k: 1,	{ "pile_set_name": "DM Mathematics" }
x = w + -5.01. Let q be (-4)/9(15 + -12). Sort 1, q, x. x, q, 1 Let t = 0 + -6. Let v = t - -6. Put v, 1/9, 1/5 in decreasing order. 1/5, 1/9, v Suppose -4u + 24 = -2o, -4o + 5o = 5u - 24. Let j be (-24)/63 + o/14. Sort 1/9, 1/4, j in ascending order. j, 1/9, 1/4 Suppose 1 = x + 6. Sort 3, x, -4 in increasing order. x, -4, 3 Let p be 1(0 - 1)-6. Suppose -4i + 2 = 3d, -pi + i = -d + 7. Let k = -8 + 5. Sort 5, k, i. k, i, 5 Let c be (8/(-20))/(2/(-20)). Suppose 4w + 2r = -c, 0 = -3w + 5r + 1 + 9. Let z = w - -1. Sort -3, 2, z in decreasing order. 2, z, -3 Let x be 34/60 + 4/(-10). Let p = 293 - 298. Sort p, x, -1 in decreasing order. x, -1, p Let n = 2 - 2.1. Let j = -0.1 + n. Sort j, 4, -0.03. j, -0.03, 4 Suppose 2z - 4z + 18 = 4h, -16 = -4z - 3h. Suppose 2j - 14 = -2p, -3p + 4j + 8 = 1. Let m = p + -5. Put m, z, 4 in increasing order. m, z, 4 Let j = 17 + -15. Put -0.3, j, 0.3 in ascending order. -0.3, 0.3, j Let q = -7 - -6.6. Put q, 3/5, -0.3 in descending order. 3/5, -0.3, q Let m(t) = 2t - 19. Let b be m(8). Sort 5, b, 9 in ascending order. b, 5, 9 Let b = -4 - 4. Let f = b + 8.6. Let q = 5.6 - f. Put q, 1, -2 in ascending order. -2, 1, q Let z = -3 + 3. Sort -4, 6, z in descending order. 6, z, -4 Let j(c) = 2c*3 - 3c*2 + 3c - 5. Let p be j(2). Let h(r) = r*3 - 8r*2 - r + 8. Let i be h(8). Put -5, p, i in ascending order. -5, i, p Suppose 0w + 2w = 10. Suppose -4o = -4v + 20, wo = -3v - 3 - 6. Let z be 2/(-8) + 52/16. Put z, v, -5 in descending order. z, v, -5 Let w = -36.09 + 39.9. Let n = -0.21 + w. Let m = n - 0.6. Put -2/9, m, -2/3 in descending order. m, -2/9, -2/3 Suppose -4 + 0 = -2s. Let a be s/(-20)30/(-8). Let p = 2 + -2. Put 0.4, p, a in ascending order. p, a, 0.4 Let d be -1 - -3 - (-2 + -1). Let m(f) = -f2 + 6f - 5. Let n be m(d). Suppose -10w + 5w + 10 = n. Sort w, -3, -1 in decreasing order. w, -1, -3 Suppose -3v + 2v = -6. Let t be (-15)/21v/10. Sort -0.3, t, 2/5. t, -0.3, 2/5 Let x = 33 - 37. Sort 1, 2, x in ascending order. x, 1, 2 Let p be (0 + -1)/(2/4). Let w(o) = 2o + 3. Let a be w(p). Put a, 3, 2 in increasing order. a, 2, 3 Suppose -r = -2g - 9, 21 + 1 = -5g + 2r. Sort 0, g, 3. g, 0, 3 Let r be (-6)/33 - (27/33 - -2). Sort r, 6, -1. r, -1, 6 Let k = -12.6 + 7. Let s = 6 + k. Put 2, s, -0.2 in descending order. 2, s, -0.2 Let a = -19.14 - -1.74. Let v = -17 - a. Put v, 0, -3 in descending order. v, 0, -3 Suppose 7 = 3m + 3y - 17, 3m - y - 8 = 0. Let c(o) = -o*2 + 6o - 4. Let f be c(5). Let h = f - -2. Put m, -3, h in decreasing order. m, h, -3 Let f = -5 + 10. Let s = -11 - -7. Let v = 2 + -2. Sort f, v, s in decreasing order. f, v, s Let f(m) = -m*2 + 7m + 10. Suppose -6 - 10 = -2s. Let j be f(s). Let v = -0.11 - 0.09. Put v, 0, j in decreasing order. j, 0, v Suppose 0 = -4y - 0 - 4. Let l = 1 + -4. Put y, l, -2 in decreasing order. y, -2, l Let h(b) = b*2 - 10b + 11. Let g be h(9). Sort 4, -7, 5, g in descending order. 5, 4, g, -7 Suppose 0g = g + 3a - 16, 0 = -4g + a + 12. Let p(n) = n + 9. Let r be p(-4). Let q = g - r. Put q, -3, -5 in ascending order. -5, -3, q Let j = 0 - 4.5. Let i = j + -0.5. Sort i, -0.1, 0.04 in ascending order. i, -0.1, 0.04 Let v(y) = y3 - y2 + 2y - 6. Suppose 2j = 5j. Let x be v(j). Sort x, 2, -1 in increasing order. x, -1, 2 Suppose -q - 2v + 33 = 4q, 0 = -5v + 20. Suppose -qo = -o. Put o, 3, 1 in descending order. 3, 1, o Let k be -4 - -1 - ((-3)/(-3) - 1). Suppose f = -2f - x - 18, -2x = 3f + 21. Put 5, f, k in increasing order. f, k, 5 Let q(n) be the first derivative of -n4/4 + 4n3/3 - n2 - 4n + 2. Let j be q(3). Sort j, 2, -4 in ascending order. -4, j, 2 Let w = -182/9 + 20. Sort 4, 5, w in descending order. 5, 4, w Let d(p) = -2p - 14. Let s be d(-7). Put 0.1, -0.3, s, -1/8 in increasing order. -0.3, -1/8, s, 0.1 Let t(x) = -x*2 + 11x - 8. Let j be t(10). Let f = -3 - -2. Sort f, -3, j. -3, f, j Let j be (-2 - -1) + 2 - 0. Let g be 1/(j3/(-12)). Let p(v) = v2 + 6v - 5. Let k be p(-6). Put k, g, -1 in descending order. -1, g, k Suppose 4 = -s - 12. Let a = 15 + s. Let r(x) = -x*2 - 5x + 1. Let l be r(-5). Sort l, -2, a. -2, a, l Suppose -22 - 23 = -5x. Suppose -w - x = -2b, -2b - 3 = 4w + b. Put -1, -4, w in increasing order. -4, w, -1 Let c = -8 + 7. Suppose g - 6 - 1 = -5i, 0 = 5i + 4g - 13. Put i, 2, c in increasing order. c, i, 2 Let g = 15 + -14. Sort 1/5, g, 4/5 in increasing order. 1/5, 4/5, g Suppose -4d + 40 = -3l + d, -2d + 35 = -5l. Put 2, l, 3 in descending order. 3, 2, l Let s = 6 - 5.88. Let k = 4.88 + s. Suppose -4d = -3q - 11, -2q + q = -4d + 1. Sort q, k, 4/3 in ascending order. q, 4/3, k Let z(j) = j3 - 14j*2 + 14j - 6. Let c be z(13). Let w be 74/(-14) - (-2)/c. Let x be ((-2)/(-4)2)/1. Sort x, w, 2 in descending order. 2, x, w Let i(b) = 2b*2 + 1. Let k be i(-1). Suppose 2q - 4 = 2l - 3l, -l - 21 = -3q. Let t = -7 - l. Put k, -5, t in decreasing order. k, t, -5 Let b(c) = -c2 - c + 1. Let l be b(1). Sort -5, l, -35 in decreasing order. l, -5, -35 Let g = -0.67 + 0.27. Sort g, -9, 4/3, 2. -9, g, 4/3, 2 Let z = 76 + -75. Put 5, 0, z, 3 in ascending order. 0, z, 3, 5 Let c = -4.6 + 5. Let g = 139 + -144.9. Let p = 6 + g. Sort -0.3, p, c in increasing order. -0.3, p, c Suppose 5 = 5v - 4d + 14, 7 = -2v + 5d. Let z be ((-6)/8)/(v/4). Let g be 4/12 + 2/(-6). Sort 4, g, z in decreasing order. 4, z, g Let s be 16/(-114)((-27)/(-4))/(-9). Sort 1, 2, -4, s in increasing order. -4, s, 1, 2 Let o = 6 - 5. Suppose 6u = 5u - o. Put 1, u, -3 in increasing order. -3, u, 1 Suppose -c = 4c - 5g - 90, -4c + 5g = -77. Let t = c - 10. Put -1, t, 1 in ascending order. -1, 1, t Let w = -0.05 + 0.14. Let j = w + -0.39. Let v = -3 - -3.5. Put v, 0, j in descending order. v, 0, j Suppose 4 = 44r - 48r. Put 10, 2, r in ascending order. r, 2, 10 Let y(j) = -j*2 - 8j + 3. Let p be y(-8). Suppose po + 5 - 17 = 0. Sort o, 0.1, -2 in descending order. o, 0.1, -2 Let a = 0.24 + 0.31. Let c = 0.2 - 0.25. Let q = c + a. Sort q, -3/4, 0 in decreasing order. q, 0, -3/4 Suppose -19 = -4t - 39. Suppose 0c = -4c - 4. Sort c, t, 0. t, c, 0 Let z = -10/9823 - 3917077/2259290. Let b = z - 3/46. Let o be 4/7 - (1 - 0). Sort o, b, -0.5 in decreasing order. o, -0.5, b Suppose -a = a - 26. Sort 2/9, -4, a. -4, 2/9, a Suppose 0 = u - 3 + 4. Let a = -47 + 43. Let h = 4 + -7. Put a, h, u in ascending order. a, h, u Let f(d) = d*2 - 11d + 14. Let q be f(10). Put q, -3, 8 in ascending order. -3, q, 8 Let f(y) = -y + 1. Let c be f(-4). Sort c, -3, 4. -3, 4, c Suppose -5u + 12 = -8. Suppose -h - 2i = -10, ui + 0 + 50 = 5h. Suppose -4v = -5g + 12, v + 4v - 5g + h = 0. Put -5, 1, v in ascending order. -5, 1, v Let f = -2.7 - -0.7. Sort -0.2, 0.3, f, -4/7. f, -4/7, -0.2, 0.3 Let t be (1/2)/((-1)/(-2)). Suppose 19 = -4m - t. Let n(b) = 3b + 2. Let x be n(-2). Sort x, 3, m. m, x, 3 Let i be 2/((-2)/(2 - 1)). Let b(t) = -29t3 - t2 - t + 1. Let u be b(1). Let q be 2/3 + u/(-9). Sort -2, q, i in descending order. q, i, -2 Let c = 0.7 - -0.3. Let d = c + 4. Let r = -7 + d. Sort -0.3, 0.5, r in ascending order. r, -0.3, 0.5 Let p be (-1 - 28/(-36)) + (-3)/27. Put -0.5, -5, p, -0.4 in decreasing order. p, -0.4, -0.5, -5 Let z be ((-4)/10)/((-1)/10). Put z, -4, -9 in descending order. z, -4, -9 Let n = -15 - -12. Let m = 53 - 58.4. Let d = m - -5. Sort n, d, -1. n, -1, d Suppose -b + 0 + 5 = 0. Let r = -77.8 + 85. Let n = -7 + r. Put n, b, -0.2 in descending order. b, n, -0.2 Let a = 0.4 - 0.3. Let p = -4.4 - -4. Let f = -3.96 + -0.04. Put f, a, p in ascending order. f, p, a Let a = 3.04 - 1.1. Let m = -0.06 - a. Put m, 5, -3/4 in descending order. 5, -3/4, m Let f be ((-1)/40)/(-1). Sort 4, 10, f in increasing order. f, 4, 10 Let r be 3/(1 - (-30)/(-21)). Sort -1, r, 1 in increasing order. r, -1, 1 Let r = 3 - 1. Let c = -5 + 30. Suppose -ra - c = 3a. Sort 5, 2, a in increasing order. a, 2, 5 Suppose 3 + 7 = -5h. Put h, 4, -1, -4 in ascending order. -4, h, -1, 4 Let v = -0.21 - 8.79. Let w = 6 + v. Put -0.2, -2, w in descending order. -0.2, -2, w Let m(k) = -k2 + 3k + 4. Let s = 4 - 1. Let q be m(s). Sort 0, q, -5 in descending order. q, 0, -5 Suppose	{ "pile_set_name": "DM Mathematics" }
Let y(b) = -3b2 + 3b - 4. Let j be y(-3). Let i = 25 + j. Let t = i + 16. Which is bigger: t or 2/25? t Suppose -9 + 279 = -5i. Which is bigger: -52 or i? -52 Let b = 231 - 227. Let o(t) = -t2 - 5t - 4. Let a be o(-3). Let q(w) = w + 1. Let j be q(a). Is b less than or equal to j? False Let f = -190 - -176. Let q = -6 - 8. Let h = f - q. Which is smaller: h or -0.2? -0.2 Let s be (-813)/(-30) + -38/240. Let m(o) = 6o + 4. Let q be m(4). Is q not equal to s? True Let a = -92312/85 + 1086. Suppose -20 = 4s - 4h, -2h + 3 = -5. Is s greater than a? False Suppose -6v - 45 = -v. Let m be -12/2 + -8. Let a = m - v. Is 1/3 bigger than a? True Suppose 3m - 12 = -0m. Suppose a + 12 = ma. Which is smaller: a or 11/4? 11/4 Let p be (-43537)/26061 - (-20)/12. Is p at least as big as -1? True Suppose 0 = -682x + 677x + 175. Is x >= 37? False Let m(p) = -p*2 + 7p + 10. Let d be m(7). Let t = d - 8. Let w be (-9)/9 - 2/t. Is w >= -13? True Let x = 0.749 + -1.149. Is x greater than -21? True Let j be 0/(21/(-1)). Let u be (4 - 6)(6/(-4) - -1). Suppose j = -3t + u - 4. Is t at least -2/41? False Let y be 1((140/(-16) - -4) + 5). Which is smaller: 15 or y? y Let g = -4.4 - -49.4. Let n = 45.1 - g. Which is bigger: 32 or n? 32 Let d be -931/(-63) + 4/6. Suppose 0 = -3h + 2x - 0x - 4, -h = x - 7. Is h bigger than d? False Let t = -1020/7 - -146. Let g(b) be the third derivative of -b*4/24 + 5b*3/6 - 7b*2. Let f be g(4). Which is smaller: t or f? t Let h = -0.08 - -6.08. Let u = -68 + 69. Let s be ((-28)/(-343))/((-2)/(-7)u). Which is bigger: h or s? h Suppose -4l - 2g + 1819 = -l, 3g + 621 = l. Suppose -l = 5f + q, -3f = 2q - 6q + 370. Is f less than or equal to -121? True Let f be 6-1 + 1 - -2. Let p(j) = -j*2. Let h(t) = 2t*2 - 4t - 5. Let d(s) = -h(s) - 3p(s). Let q be d(f). Which is smaller: 6/5 or q? 6/5 Let z = -679 - -679.015. Which is smaller: z or 2? z Let i = -5371/1287 - -46/11. Is -1 not equal to i? True Let u = -6 - -4. Suppose 6c + 8 = 8c. Which is bigger: u or c? c Let l(p) = -p3 + 10p*2 + 11p + 1. Let v be l(11). Let i be (-31)/11 + 2/(-11). Let y = 3 + i. Is v greater than y? True Let c be (-7)/(35/15) + (-218)/3. Is c smaller than -75? True Let h = 0.25 - -13.75. Let d = h + -13. Suppose f - 2f = 3a + 2, 0 = 5a + 4f + 1. Which is smaller: d or a? a Let d(j) = -j*3 - 8j*2 + 4j - 2. Let n be d(-6). Let b = n + 69. Are -2/3 and b equal? False Let w be (-7)/42 + 975/18. Suppose -5x + 4p = -w, 2p - 2 = -4x + 36. Which is smaller: 11 or x? x Let z = -11/13 + 101/104. Is z != 0.6? True Suppose -2q = -q + 2. Let c = 96 - 108. Which is smaller: c or q? c Let h = 25 + -20. Suppose -5c - r = -34 - 20, hr = c - 16. Let v(l) = -l3 + 2l*2 + 4l + 2. Let u be v(-2). Which is smaller: c or u? u Let y(r) = r*2 + 5r + 3. Let b be y(-4). Let z = -6416/11 - -582. Which is smaller: z or b? z Let z = -11/155 - 3721/2170. Is 3 at least as big as z? True Let p = 0.38 - -0.62. Let v be 5 - -1668/(-264). Which is greater: v or p? p Let f be (-2)/2 + 0 - 1. Suppose 2u + 2 + 2 = 0. Is u at most as big as f? True Let f = 104 + -103. Suppose 4 + f = -j. Which is smaller: j or 6? j Let t = 323.9 - 324. Do t and -10 have the same value? False Let f be 20/(-6)12/(-5). Suppose 3o + 28 = 7o. Suppose 0 = oc - 12c + 45. Is c equal to f? False Let g be ((2 - -21) + -2)10/(-6). Is g greater than -38? True Suppose -4g = -3g - 2. Let x(z) = z*3 + 14z*2 - 15z. Let q be x(-15). Let c be q + -1 - 21/(-18). Is c at most as big as g? True Let b = -8 + 12. Suppose 0z + 2r + 3 = -z, br = -5z + 9. Suppose -zc - 2 = 13. Does -3 = c? True Let f(c) = -69c - 8 + 34c + 39c - 5. Let t be f(3). Which is smaller: -4 or t? -4 Let y(w) = -3w - 43. Let j be y(-22). Which is bigger: j or 1? j Let c be (-3)/2(-2)/6. Let k be 2/(-13) + 3976/(-1365). Let h = -11/3 - k. Which is smaller: h or c? h Let q = 10 - 7. Suppose 0 = -2s + q + 11. Let k = 43/6 - s. Which is smaller: k or 0.1? 0.1 Let d = -3043 + 3043. Is 3/1064 smaller than d? False Suppose 1377 + 651 = -26q. Is q < -79? False Let p = -19561/30 + 652. Which is smaller: 1 or p? p Let q = -0.362 + -7.638. Are q and 18 nonequal? True Let p = -3.52 - 0.88. Let h = p - -4. Do h and 1.4 have the same value? False Let b(l) = l*2 + 9l. Let j be (-1)/2(-5 - -19). Let w be b(j). Let x(a) = -a3 - 6a*2 + 10a + 7. Let f be x(-7). Are w and f equal? True Let t(a) = 18a2 - a - 1. Let z be t(2). Let k be (28 + -3)(-28)/(-10). Which is smaller: z or k? z Suppose -a = 2a. Suppose -7f + 5f = 3r + 142, a = 3r - f + 127. Let p be ((-2)/r)/((-2)/(-8)). Is p at most -1/4? False Let x = -53 - -6. Let g = 48 + x. Which is smaller: -2 or g? -2 Let p(y) be the second derivative of -y3/6 - 2y*2 + 7y - 2. Let g be p(-4). Is 14/13 greater than or equal to g? True Let h be 8/(-8) + 18. Let w be 3/(-6)(1 + h). Which is smaller: w or -3? w Suppose 35k - 26k = 36. Let v(d) = 4d2 + d + 1. Let p be v(-1). Are p and k equal? True Let q = -0.532 - -0.132. Let s = 22 - 26. Is s at most as big as q? True Let d = 569 + -568. Let v be ((-2)/34)/((-3)/(-6)). Which is smaller: d or v? v Let j = -172/267 + -2/89. Let o(s) = 2s*3 - 21s*2 - 10s - 4. Let d be o(11). Suppose -du = -10u. Is u at least as big as j? True Let w = -176684775 - -20671914742/117. Let m = w - -1743. Is 1 greater than or equal to m? True Let f = -41 + 1639/40. Let i(n) = -n*3 - 3n*2 - 2n - 1. Let u be (-28)/21 - 2/3. Let j be i(u). Is f at least j? True Let l be 45/5 + -1 + -1. Let q be 5/(-5) + 2 + l. Which is smaller: 9 or q? q Let p(h) be the second derivative of h4/12 + h3/3 - 7h2/2 - h. Let g be p(-3). Which is smaller: g or -21/4? -21/4 Let a = 2.54 + -2.84. Is a equal to -51? False Let c be (5/(-4))/510/(-75). Is c smaller than -3/2? False Let x = -353 + 380. Let n(q) = q*3 + 9q*2 - 14q - 14. Let o be n(-10). Which is bigger: x or o? x Let w(t) = -4t2 - 2t + 1. Let z be w(1). Let d(x) = x + 9. Let y be d(z). Suppose 0 = ys - 7s - 9. Which is greater: s or -2? -2 Let z be -3 + (-26)/(-8) - (-114)/(-8). Let c be (4/z)/((-12)/28). Let q be (-2)/(-7) - (-2)/(-7). Which is bigger: c or q? c Let k be -4 - 0 - 0/(7 - 3). Let c be (-11 + 47)(-2)/k. Which is bigger: 16 or c? c Let b be -1 + (-55)/(-1755)32. Is b <= 0? False Let f be (2/4)/((25/(-530))/(-5)). Let i = f - 49. Which is bigger: -1 or i? i Let s be 4/560/24. Suppose 4n + 28 = -v, 7 = -sn - v - 5. Is n <= 1/2? True Let z = -789 - -790. Is 1/284 less than or equal to z? True Let a = -664 - -612. Which is smaller: a or -60? -60 Let b = -88 - 128. Which is smaller: 2/3 or b? b Let u be (-26)/8 + 1/(-4). Let s(n) be the second derivative of n4/12 + 5n3/6 + n2/2 - 5n. Let i be s(-4). Is i greater than u? True Let c be (-2 + (-30)/(-18))/((-1)/3). Does 10.1 = c? False Suppose 74 = -3w - v + 2v, 5v - 32 = 2w. Let s = -556 - -555.9. Which is smaller: w or s? w Suppose 273 - 77 = -4g + 5h, 48 = -g + h. Is 1/3 < g? False Let k = -45 - -53. Is 11 > k? True Let v be 1/(-3) + (-20)/12. Let w be 0/(0 - 5 - v). Let d be 2/(1 + 3)w. Which is bigger: d or 6/7? 6/7 Let s = 6/39595 - -2413639/10928220. Let f = s + 2/69. Let q be ((-5344)/336 - -16)/(12/63). Which is bigger: q or f? q Let s be (-2)/(12/(-279)1). Is s equal to 46? False Let m be 12/(-42) + (-68)/7. Let z = m + 14. Suppose 28 = zv - 5h, 0h - 20 = 5h. Which is bigger: v or 0? v Suppose 0 = 3x - 8 - 7. Let f = x - 16. Is -9 not equal to f? True Suppose -c - 5c = 1212. Which is greater: -203 or c? c Let g be -6 + 105/14 - (-234)/4. Which is smaller: 58 or g? 58 Suppose 3d + 3j - 30 = 0, d + 2d = 2j + 30. Suppose -3k - d = 32. Suppose -3p - 38 = -m, -3p + 4p + 2 = 3m. Is p >= k? True Let x be 14/(-399)2/36. Is x > 0? False Let c be 8 - ((-6)/(-3) + -5). Let p = c - 10. Do p and -2/15 have different values? True Let v(f) = f2 + 6f + 2. Suppose 6m + 36 = -0m. Let r be v(m). Suppose -3y + 4 = l, -2l + 15 = -ry + y. Which is bigger: 8 or l? 8 Let v = -36 - 115. Are -152 and v non-equal? True Suppose 5c + 87 + 18 = 5x, 4c = 5x - 80. Which is bigger: -28 or c? c Let z(x) = 4x*2 + 61x - 26. Let o be z(-14). Which is b	{ "pile_set_name": "DM Mathematics" }
n 42 is divided by 16? 10 Calculate the remainder when 3429 is divided by 12. 9 Calculate the remainder when 120 is divided by 49. 22 Calculate the remainder when 682 is divided by 36. 34 What is the remainder when 9537 is divided by 595? 17 What is the remainder when 568 is divided by 5? 3 What is the remainder when 3191 is divided by 94? 89 Calculate the remainder when 63 is divided by 14. 7 Calculate the remainder when 7931 is divided by 16. 11 What is the remainder when 157 is divided by 5? 2 Calculate the remainder when 738 is divided by 244. 6 What is the remainder when 23 is divided by 10? 3 Calculate the remainder when 1100 is divided by 46. 42 Calculate the remainder when 104 is divided by 90. 14 Calculate the remainder when 13 is divided by 5. 3 Calculate the remainder when 396 is divided by 16. 12 Calculate the remainder when 8 is divided by 5. 3 What is the remainder when 310 is divided by 78? 76 What is the remainder when 3093 is divided by 509? 39 What is the remainder when 61 is divided by 19? 4 What is the remainder when 3391 is divided by 117? 115 Calculate the remainder when 1877 is divided by 20. 17 Calculate the remainder when 354 is divided by 108. 30 What is the remainder when 1725 is divided by 2? 1 What is the remainder when 152 is divided by 55? 42 What is the remainder when 197 is divided by 113? 84 What is the remainder when 1223 is divided by 34? 33 What is the remainder when 51 is divided by 50? 1 Calculate the remainder when 319 is divided by 46. 43 What is the remainder when 63 is divided by 16? 15 What is the remainder when 87 is divided by 60? 27 Calculate the remainder when 1785 is divided by 89. 5 What is the remainder when 5311 is divided by 21? 19 What is the remainder when 361 is divided by 11? 9 Calculate the remainder when 72 is divided by 28. 16 What is the remainder when 543 is divided by 61? 55 Calculate the remainder when 134 is divided by 42. 8 Calculate the remainder when 921 is divided by 453. 15 Calculate the remainder when 1385 is divided by 344. 9 Calculate the remainder when 321 is divided by 155. 11 What is the remainder when 163 is divided by 15? 13 Calculate the remainder when 392 is divided by 66. 62 What is the remainder when 244 is divided by 54? 28 Calculate the remainder when 77 is divided by 39. 38 Calculate the remainder when 671 is divided by 32. 31 Calculate the remainder when 4234 is divided by 7. 6 What is the remainder when 212 is divided by 62? 26 What is the remainder when 1018 is divided by 57? 49 What is the remainder when 291 is divided by 11? 5 Calculate the remainder when 767 is divided by 261. 245 Calculate the remainder when 117 is divided by 24. 21 What is the remainder when 1570 is divided by 176? 162 Calculate the remainder when 8 is divided by 5. 3 Calculate the remainder when 832 is divided by 64. 0 Calculate the remainder when 432 is divided by 3. 0 Calculate the remainder when 874 is divided by 52. 42 Calculate the remainder when 213 is divided by 24. 21 What is the remainder when 139 is divided by 16? 11 Calculate the remainder when 1217 is divided by 174. 173 What is the remainder when 758 is divided by 17? 10 What is the remainder when 304 is divided by 61? 60 Calculate the remainder when 286 is divided by 211. 75 Calculate the remainder when 4464 is divided by 19. 18 What is the remainder when 82 is divided by 29? 24 What is the remainder when 527 is divided by 11? 10 What is the remainder when 184 is divided by 49? 37 Calculate the remainder when 856 is divided by 32. 24 Calculate the remainder when 182 is divided by 137. 45 What is the remainder when 422 is divided by 237? 185 Calculate the remainder when 117 is divided by 53. 11 What is the remainder when 245 is divided by 90? 65 Calculate the remainder when 1326 is divided by 201. 120 Calculate the remainder when 29 is divided by 10. 9 Calculate the remainder when 103 is divided by 36. 31 Calculate the remainder when 376 is divided by 77. 68 What is the remainder when 1175 is divided by 11? 9 Calculate the remainder when 462 is divided by 67. 60 Calculate the remainder when 112 is divided by 32. 16 What is the remainder when 71 is divided by 15? 11 What is the remainder when 3347 is divided by 23? 12 What is the remainder when 534 is divided by 148? 90 What is the remainder when 1122 is divided by 29? 20 Calculate the remainder when 198 is divided by 50. 48 Calculate the remainder when 8162 is divided by 26. 24 What is the remainder when 142 is divided by 15? 7 Calculate the remainder when 170 is divided by 44. 38 What is the remainder when 961 is divided by 140? 121 Calculate the remainder when 177 is divided by 45. 42 What is the remainder when 1622 is divided by 63? 47 What is the remainder when 46189 is divided by 10? 9 What is the remainder when 1460 is divided by 50? 10 What is the remainder when 9483 is divided by 93? 90 Calculate the remainder when 7977 is divided by 140. 137 What is the remainder when 2198 is divided by 44? 42 Calculate the remainder when 911 is divided by 211. 67 What is the remainder when 36 is divided by 15? 6 Calculate the remainder when 1185 is divided by 177. 123 What is the remainder when 1134 is divided by 71? 69 What is the remainder when 482 is divided by 11? 9 Calculate the remainder when 6006 is divided by 232. 206 Calculate the remainder when 333 is divided by 5. 3 Calculate the remainder when 306 is divided by 77. 75 Calculate the remainder when 563 is divided by 4. 3 Calculate the remainder when 1147 is divided by 276. 43 What is the remainder when 90 is divided by 68? 22 Calculate the remainder when 79 is divided by 5. 4 Calculate the remainder when 110 is divided by 24. 14 What is the remainder when 79 is divided by 9? 7 What is the remainder when 128 is divided by 34? 26 What is the remainder when 581 is divided by 99? 86 What is the remainder when 3419 is divided by 90? 89 Calculate the remainder when 171 is divided by 98. 73 What is the remainder when 969 is divided by 98? 87 What is the remainder when 327 is divided by 33? 30 What is the remainder when 127 is divided by 46? 35 What is the remainder when 4931 is divided by 289? 18 Calculate the remainder when 71 is divided by 24. 23 What is the remainder when 940 is divided by 48? 28 Calculate the remainder when 134 is divided by 64. 6 What is the remainder when 63 is divided by 43? 20 What is the remainder when 138 is divided by 28? 26 What is the remainder when 103 is divided by 28? 19 Calculate the remainder when 338 is divided by 31. 28 Calculate the remainder when 336 is divided by 60. 36 Calculate the remainder when 5089 is divided by 182. 175 What is the remainder when 117 is divided by 62? 55 Calculate the remainder when 218 is divided by 55. 53 Calculate the remainder when 304 is divided by 45. 34 What is the remainder when 303 is divided by 92? 27 What is the remainder when 2356 is divided by 9? 7 What is the remainder when 182 is divided by 52? 26 What is the remainder when 1295 is divided by 178? 49 Calculate the remainder when 7956 is divided by 23. 21 What is the remainder when 68 is divided by 44? 24 What is the remainder when 32 is divided by 11? 10 What is the remainder when 127 is divided by 65? 62 Calculate the remainder when 314 is divided by 120. 74 Calculate the remainder when 549 is divided by 12. 9 What is the remainder when 537 is divided by 528? 9 Calculate the remainder when 2309 is divided by 2276. 33 What is the remainder when 52 is divided by 41? 11 Calculate the remainder when 621 is divided by 16. 13 Calculate the remainder when 2572 is divided by 39. 37 Calculate the remainder when 199 is divided by 20. 19 What is the remainder when 87 is divided by 51? 36 Calculate the remainder when 218 is divided by 93. 32 What is the remainder when 1177 is divided by 34? 21 Calculate the remainder when 2326 is divided by 34. 14 What is the remainder when 615 is divided by 98? 27 What is the remainder when 1355 is divided by 16? 11 Calculate the remainder when 155 is divided by 46. 17 Calculate the remainder when 183 is divided by 63. 57 Calculate the remainder when 22 is divided by 12. 10 Calculate the remainder when 343 is divided by 165. 13 What is the remainder when 78 is divided by	{ "pile_set_name": "DM Mathematics" }
((-174)/(-1218))? 43 269/(-8)2 + 425075/1388 + -306 -67 Calculate -45 + 90 - (-12 - -10). 47 (211 - 212)/(14/(-24)) 12/7 Evaluate (1 + 1720/(-1736))833/(-476). -1/62 Evaluate (-1560)/416(-480)/(-350). -36/7 Evaluate (-24 + -17(-6592)/4896)/((-4)/126). 35 Evaluate (5/8)/((-7041)/(-619608)). 55 114182/(-221) - (-34)/(-289) -94 What is the value of (-5181440)/(-45760) + (-144)/(-52)? 116 (-27)/2 - (96/21)/((-204)/714) 5/2 What is the value of -13 - -126 - (-2201949)/(-19491)? 2/73 Evaluate (-2130)/3834 - (-528)/918. 1/51 Evaluate (2 + (-25)/(-4))/(19395/(-17240)). -22/3 (213731/77140 - (-55)/(-20))15/27 1/87 Evaluate (-12)/(-52)((-83125)/1155 + 72). 1/143 ((38/513)/(1 - 154/126))/(2/42) -7 What is 9129/16116-1? -34 What is (-1791)/51 + 9516/80886? -35 Evaluate 51/578 + 989/(-782). -20/17 Evaluate (189/756)/((45/2)/(-9)(-3)/(-1020)). -34 What is (54/(-4))/(((-66)/(-2))/(-6288 + 6294))? -27/11 Calculate 17325/(-210)(-16)/12010. 110 What is the value of (-2814)/(-67) - (678/138 - 2/(-23))? 37 What is -345126/(-882)(-112)/240? -23 Evaluate ((-63135)/(-6900) + 81/(-12))(-3)/(3/50). -120 Evaluate (34170/24)/(-17)(-156)/(-390)1/(-1). 67/2 (((-80)/(-18))/(-10))/(-29/63) - 4 -22/9 (-4 + 0 - (-637)/147)(-70)/(-210) 1/9 (-5 + 37)/2 - (-579852)/(-36218) -2/199 What is the value of (-147)/245(34/765 + (-36)/1485)? -2/165 Evaluate -40 - -57 - (-348)/(-20). -2/5 What is ((-8)/(-3) - (-1911)/441) + (21 - 0)? 28 Calculate 1920/224(-2 - (-16)/5)/((-268)/(-2345)). 90 Calculate ((-33484)/(-1080))/(-11) + (-13972)/(-4990). -1/54 What is the value of 14 + (8 - 14) + (38/(-3) - -10) + -12? -20/3 What is (-168)/(-714)2805/4884? 5/37 Calculate (-489412)/(-1408535) - (-378)/(-1071). -2/365 Evaluate (3 - 12 - -77) + -112. -44 What is 19/(-134 + 39)7(-10)/(-259)? -2/37 Evaluate (239270/2556 - 94)(-4)/(-7). -2/9 Evaluate 75 - 2(2775/(-50))/37. 78 Evaluate (6 + -4)(-1)/(-14) - (-161417)/(-8897). -18 2499/(-68)-38(-184)/2622 -98 What is the value of (14/(-336))/((-10)/(-4) + -2)? -1/12 What is the value of 1/(63 - (-32 + 20 - -6))? 1/69 13503/(-28935) + (-8)/(-12) 1/5 4316/581 + 9/(-21) + (-2)/(-10) - 16 -44/5 (882/735)/(1/(-10)) + 7 - 39/(-6) 3/2 What is the value of ((-6)/(-15))/(17/(-34))85? -68 What is the value of (-809)/(-35) - (-48 - 66 - -137)? 4/35 What is (-1 + (-684)/(-24))(-114)/95? -33 Evaluate 991047/49864 + 2/8-1(-1)/(-2). 79/4 What is the value of (-9 + (31 - -4))((-8)/(-60) - (-16)/780)? 4 What is the value of (((-275)/(-825))/((-4)/(-6)))/(20/64)? 8/5 (22/(-9))/((-215)/(-495) - 240/440) - 8 14 What is the value of -17 + (-3277)/(-145) + (0 - 12/(-8)-4)? -2/5 Evaluate 9 + 2 - (388 - 410). 33 56210/1021020 + (-2)/68 1/39 Evaluate ((-259)/84)/(-37) + (-4)/24. -1/12 What is the value of ((-3325)/(-42))/(-25)(-280)/3990? 2/9 Evaluate 69/92-2(-7)/798. 1/76 Calculate (-10)/(((-1000)/(-75))/(5/(-2))). 15/8 Evaluate (174(-33 - -1)/32)/6. -29 What is 55 + 4372/(-95) + -9? -2/95 What is 6/(-15)(-1050)/(-12810)? -2/61 Evaluate ((-33579)/3731)/(-4 - (-45)/10). -18 Calculate 14(-2200)/(-4928) + 111/(-12). -3 Calculate (((-15)/300-10)/(3/6))/(9/(-504)). -56 (-176)/198(12 - (-810)/(-64)) 7/12 Calculate (3(-108)/(-42) + -16)/(6/(-42)). 58 Calculate (40/((-9240)/99))/(2/308). -66 What is the value of ((-932)/(-32) - 17) + 18/(-144)? 12 Calculate 5/(-50)69950/18187. -5/13 Evaluate ((-6)/(-4)-2)/(-3 - (-42)/10). -5/2 Calculate (7/(1078/(-132)) + -8)/(-1 - (-12)/14). 62 Calculate ((-48)/(-88))/(76/(-76)). -6/11 Evaluate ((-4)/2 - 2)621/(-138)50/(-18). -50 What is the value of ((-156)/80 - -2)12 - (-474)/(-395)? -3/5 Calculate (-576)/648 + (-36069)/(-1728) - 20. -1/64 Calculate 3((-1160)/40 + 32) + -16. -7 57/(-1) + ((-11736)/6846)/((-2)/21) -39 1020/6023/(-12)2 -17 What is (-51429)/4898(-82)/(-63)? -41/3 (32/2)/(119401/1251 - 95) 36 What is the value of (-67)/(((-35200)/180)/(-32)) + 11? 2/55 (57/(-1596))/(1500/(-80) + 19) -1/7 Evaluate 398/11 + (-16)/(-33)(-1419)/3784. 36 Evaluate 364/(-7125) + (1126724/(-150936) - (-15)/2). -2/125 ((-456)/21)/((97 + 22040/(-228))/(14/(-12))) 76 What is the value of 854783/(-13398) + 5/(-110)-20? -49 Evaluate 1(40 + -1 - (-7)/6-6). 32 What is the value of (4020/16)/(-5) - (47/4 - 8 - 4)? -50 What is ((40/63)/(156/2106))/((-21)/196)? -80 Evaluate ((-132)/(-9)(-7)/21)/(17/(-153)) - -5. 49 What is ((-11)/(792/108))/(130/(-124) - -1)? 31 ((-154)/(-35) - -5)/(((-1)/(-5))/(14 - 15)) -47 (-24(-7)/98)/((-3126)/14588) + (-94)/(-4) 31/2 What is ((-104)/50754/12)/(128/(-1664))? 12 What is (1/((-28)/(-5)))/(((-255)/(-476))/(183/488))? 1/8 What is the value of (0 - (-2)/8)/((-675)/72)(-231624)/12868? 12/25 What is (4 - 39) + 19 + 24? 8 Evaluate ((-5)/((-1100)/48))/((-77)/((-88550)/138)). 20/11 What is (12/110)/((4/(-50))/(((-27224)/(-410))/(-83)))? 12/11 What is 0 - 15 - 1320/(19 - 52)? 25 What is the value of ((-10)/(-12))/((-2)/(-90))(46 - (-6674)/(-141))? -50 What is ((-234)/(-9) - 3) + -28 + 202/38? 6/19 ((-651)/868)/((-5)/(200-1)) -30 What is -40414/460 + (-398)/(-11)? 2/11 Evaluate (62850/18855)/((-2)/33). -55 49/(-105)3 - (-5 - (-173)/5) -31 Calculate 7((-208089)/38535 - ((-8)/(-5) - (0 - -1))). -42 -4 - (3 + 14836/(-2044) + -25(-86)/7525) -2/73 What is the value of (4416/(-2139))/32-1457? 94 What is the value of 206 + 167 + -388 - (-1 + -5 + -2)? -7 What is ((-3818)/9545)/((-342)/(-6))? -2/285 Calculate 56 - 75 - (-3468)/170. 7/5 What is (-785904)/(-34160) - (-4 + -65)/(-3)? 2/305 (33/(-242))/(230/148 + (-108)/1998) -1/11 Calculate (18/(-14))/((-38)/(-133))(1180/(-80))/(-59). -9/8 Evaluate 11/3 + 67860/(-1755). -35 3432/111 - (-1550)/(-2200)44 -3/37 Calculate (-243 - -137) + 7/112452. -93 Evaluate 3/(-63) - (-1488890)/(-35490). -42 (204/21)/((-94)/(-329)) 34 What is 748/340-38 + 76? -38/5 What is the value of ((-12)/(-70))/(1698/1981)? 1/5 What is ((-16)/(-280))/(2722/(-2772))? -4/15 What is the value of (-390)/(-4) + 11529/378 + -21? 107 (1 - -13) + 768512/(-54720) -2/45 Evaluate 80 + (308 + -306 - -25/(-2))/(-3). 81 114/(85 - 541) + (-2 - 61/(-4)) 13 (-60)/(-170)-1 - 42656/(-731) 58 What is the value of (-38)/(-2) - ((-1448)/295392)/((-1)/3732)? 12/17 What is -46 - (356/90)/(690/(-8050))? 4/27 Calculate 8 + (14/12 - (352397/(-366))/(-53)). -9 What is 51 - (26 - -35 - 66)? 56 Calculate (-9 - (-648)/64) + -66/(-108)-3. 1/8 Calculate 4/6 - (-430)/336 - 3684/6447. 11/8 What is (48/21)/(-4) + ((-33)/66 - 87/(-84))? -1/28 Calculate -24 - (32 + -38)(-53)/(-6). 29 What is the value of -87 - -147 - -5(-168)/35? 36 What is the value of 219/10-92(-715)/19734? 73 What is the value of (-79)/(4585950/1944) - ((-54)/50 + 1)? 2/43 What is the value of (-24)/(((-4)/42 + 30/21)1089/(-8228))? 136 Evaluate (-159 - (-22220)/140)2/1. -4/7 What is the value of (-50592)/(-6696) - 356/(-72)? 25/2 What is the value of (759/(-207))/(198/2214)? -41 What is -10 + (-80 - (-110 - -45))? -25 What is 11/(4114/(-100)) + -52 + 24639/473? -3/17 10 + (5 - ((-707)/606)/(14/(-174))) 1/2 What is (184/(-3) + 6)/(-23(-6)/207)? -83 What is the value of -56(-21(-17 - 820/(-48)) - (-5 + 4))? 42 Evaluate ((-3)/(-18) + 28/(-360))(89 + -99). -8/9 What is (-2181/378)/((-2)/1 + (-28)/(-8))? -3 What is -31 - -52 - 190/(-15)66/44? 40 What is the value of 459/29988196((0 - 0) + 5)? 15 What is (7 + 981/(-135))/((8658/1665)/((-6)/(-5)))? -4/65 Calculate 117/(-3)(-12)/(-36) - (0 + -16). 3 91052/(-4017) - 100/(-6) -6 What is the value of (-6)/20 + (22/(-30))/(165232/3933 + -42)? -63 Evaluate (-3078)/(-76) - 1479/29. -21/2 What is the value of 3630/(-98) - ((-6)/(-93) + (-32640)/309876)? -37 What is the value of (218/1308)/(1/354)? 59 Calculate ((-105408)/65880)/((-1)/(-25)). -40 What is the value of ((-552)/(-69) - 105/10) + -4? -13/2 Calculate (-3)/(39/52) - (4/(-22) - (-592)/(-11)). 50 What is the value of 66/21 + 76648/(-20636)? -4/7 Evaluate (33/(-18) - -2)/(181356/(-51816)). -1/21 What is the value of (-814476)/17043 - (-12)/(-57)? -48 (12/(-240))/(715/2288) -4/25 (((-14)/36)/(-7))/((-40)/1200 - (-63)/315) 1/3 Calculate 36/5(54180/(-504) - -120). 90 (-5 - (581/105 - 10))6/40 -2/25 6/(-5)(2562/91 - 27) -18/13 What is the value of -5 - (7441/(-1470) + 23/(3864/16))? -1/30 What is the value of 22/((-3	{ "pile_set_name": "DM Mathematics" }
2 - 2508z - 7497 = 0? -833, -3 Factor 180z2 - 85z - 265. 5(z + 1)(36z - 53) Determine m so that 4m*2 - 8m - 572 = 0. -11, 13 Suppose 7h3/4 - 9h*2 - 37h/4 + 3/2 = 0. Calculate h. -1, 1/7, 6 Solve -m3/6 + m2 + m/6 - 1 = 0 for m. -1, 1, 6 Let 15q5 - 140q*4 + 215q*3 + 210q*2 = 0. Calculate q. -2/3, 0, 3, 7 Factor 2o*2 + 8992o + 10107008. 2(o + 2248)2 Factor -5r*4 - 330r*3 - 4700r*2 + 26250r + 30625. -5(r - 5)(r + 1)(r + 35)2 Determine y so that 2y*3/7 + 44y*2/7 + 38y/7 - 12 = 0. -21, -2, 1 Let -d*2/3 - 938d/3 - 937/3 = 0. What is d? -937, -1 Suppose w*2/4 - 2028w + 4112784 = 0. Calculate w. 4056 Factor -4l2 - 2108l - 2104. -4(l + 1)(l + 526) Suppose -q*4/4 - 7q*3/2 + 137q*2/4 - 105q/2 = 0. Calculate q. -21, 0, 2, 5 Determine o so that -5o5 - 30o*4 + 215o*3 + 100o*2 - 540o - 400 = 0. -10, -1, 2, 4 Find k such that -k*4/10 - 4k*3/5 - 6k*2/5 = 0. -6, -2, 0 Find q such that 5q*3 + 120q*2 - 540q + 560 = 0. -28, 2 Factor -b*4 + 2104b*3 - 1104598b*2 - 2215512b - 1108809. -(b - 1053)*2(b + 1)2 Factor -u2/7 + 16/7. -(u - 4)(u + 4)/7 Suppose 2l*2/9 - 82l/9 - 172/9 = 0. Calculate l. -2, 43 Factor -2o2/7 + 24o/7 - 40/7. -2(o - 10)(o - 2)/7 Solve -2r4/5 + 4r*3/15 + 128r*2/5 - 256r/15 = 0. -8, 0, 2/3, 8 Factor 3z3 - 36z*2 + 81z. 3z(z - 9)(z - 3) Suppose -i2/2 + 21i = 0. Calculate i. 0, 42 Determine b, given that 5b5/11 - 97b*4/11 + 118b*3/11 + 148b*2/11 - 72b/11 = 0. -1, 0, 2/5, 2, 18 Factor 2v3/17 - 860v*2/17 + 1714v/17 - 856/17. 2(v - 428)(v - 1)*2/17 Factor -2m*2/19 + 10m/19 + 12/19. -2(m - 6)(m + 1)/19 Factor -4q4 - 100q*3 - 672q*2 - 576q. -4q(q + 1)(q + 12)2 Factor r3/2 - 213r*2/2 + 1224r - 3618. (r - 201)(r - 6)2/2 Determine v so that 21v*3 + 258v*2 + 639v + 162 = 0. -9, -3, -2/7 Find i, given that 4i3 - 116i*2 + 312i = 0. 0, 3, 26 Factor 5b4 + 65b*3. 5b*3(b + 13) Find j, given that j*5/3 - 11j*4/3 + 35j*3/3 - 25j*2/3 - 12j + 12 = 0. -1, 1, 2, 3, 6 Determine z so that 3z4 + 9z*3 - 72z*2 - 240z = 0. -4, 0, 5 Determine s, given that -s*5/5 + 7s*4/5 - 6s*3/5 = 0. 0, 1, 6 Determine s, given that 5s*3 - 120s*2 - 705s - 580 = 0. -4, -1, 29 Solve 3h4 - 21h*3 - 9h*2 + 57h + 42 = 0. -1, 2, 7 Factor 2f4/7 + 3126f*3/7 + 1625508f*2/7 + 279568584f/7 - 853419888/7. 2(f - 3)(f + 522)*3/7 Let 867m*3/4 + 65229m*2/2 + 1193616m - 2519424 = 0. What is m? -1296/17, 2 Factor -5r5 + 75r*4 - 135r*3 + 65r*2. -5r*2(r - 13)(r - 1)2 Factor d4/4 - 23d*3/4 - 377d*2/4 + 9219d/4 - 2205. (d - 21)*2(d - 1)(d + 20)/4 Let 50q*4 - 30q*3 - 46q*2 + 30q - 4 = 0. What is q? -1, 1/5, 2/5, 1 Let 4a5/3 - 68a*4/3 + 236a*3/3 + 596a*2/3 - 336a - 432 = 0. What is a? -2, -1, 2, 9 Find y, given that 34y4/5 - 8y*3/5 - 102y*2/5 - 44y/5 + 16/5 = 0. -1, 4/17, 2 Factor -2p3/21 - 2668p*2/7 - 3559112p/7 - 4747855408/21. -2(p + 1334)3/21 Solve 21i*4 + 36i*3 - 159i*2 + 126i - 24 = 0. -4, 2/7, 1 Let r*5/2 - 11r*4/2 + 23r*3 - 45r*2 + 81r/2 - 27/2 = 0. What is r? 1, 3 Factor 2s3/5 - 14s*2/5 - 68s/5 + 16. 2(s - 10)(s - 1)(s + 4)/5 Let 3t*4 + 9t*3/2 - 6t*2 - 9t/2 + 3 = 0. Calculate t. -2, -1, 1/2, 1 Factor n*4/2 - 45n*3/2 - 201n*2/2 + 245n/2. n(n - 49)(n - 1)(n + 5)/2 Factor 2m*4 + 208m*3 - 638m*2 + 428m. 2m(m - 2)(m - 1)(m + 107) Determine s so that -2s4 - 10s*3 + 12s*2 + 64s - 64 = 0. -4, 1, 2 Let -2m5/3 + 14m*4/3 - 10m*3 + 26m*2/3 - 8m/3 = 0. Calculate m. 0, 1, 4 Factor 578t4 + 986t*3 + 480t*2 + 72t. 2t(t + 1)(17t + 6)*2 Suppose -3o*4 + 2988o*3 - 744012o*2 = 0. What is o? 0, 498 Factor 2d*3/7 - 66d*2/7 + 558d/7 - 494/7. 2(d - 19)(d - 13)(d - 1)/7 Factor 3y*5/2 - 33y*4/2 + 129y*3/2 - 219y*2/2 + 84y - 24. 3(y - 4)2(y - 1)*3/2 Factor 2s*4/5 - 4s*3/5 - 14s*2/5 - 8s/5. 2s(s - 4)(s + 1)2/5 Find r such that -r4 + 6r*3 + 7r2 = 0. -1, 0, 7 What is l in -l2/6 - 8l/3 - 10 = 0? -10, -6 Solve f4 - 8f*3 - 3f*2 + 26f - 16 = 0. -2, 1, 8 Let 4d3 - 104d2 = 0. What is d? 0, 26 Factor y2/12 + 9y/2 - 57/4. (y - 3)(y + 57)/12 Factor q*2 - 56q + 748. (q - 34)(q - 22) Factor 4s*3 - 116s*2 - 804s - 1260. 4(s - 35)(s + 3)2 Factor d2/3 + 19d - 118/3. (d - 2)(d + 59)/3 Factor 3h4 + 21h*3 - 132h*2. 3h*2(h - 4)(h + 11) Find p, given that -4p*2 + 364p - 360 = 0. 1, 90 Factor h*3/7 - 4h*2/7 - 5h/7. h(h - 5)(h + 1)/7 Suppose 2k2/5 + 896k/5 + 100352/5 = 0. Calculate k. -224 Suppose -4o3 + 6252o*2 + 4o - 6252 = 0. What is o? -1, 1, 1563 Factor -2r2/9 + 464r/9 - 154/3. -2(r - 231)(r - 1)/9 Factor -3675t3/8 + 10815t*2/8 + 627t/8 + 9/8. -3(t - 3)(35t + 1)2/8 Factor -w3 - 10w*2 - 31w - 30. -(w + 2)(w + 3)(w + 5) Solve 5t5/3 - 4t4/3 - t3/3 = 0. -1/5, 0, 1 Determine g, given that -3g4 - 129g*3 - 570g*2 = 0. -38, -5, 0 Factor 2c*3 + 44c*2 + 280c + 400. 2(c + 2)(c + 10)*2 Find g such that -2g*2/5 + 26g = 0. 0, 65 Factor -j*2/3 + 4j + 63. -(j - 21)(j + 9)/3 Factor 18y*2/11 + 26y/11 + 8/11. 2(y + 1)(9y + 4)/11 Factor -4k*5 - 152k*4 - 568k*3 - 832k*2 - 548k - 136. -4(k + 1)4(k + 34) Factor 4s2 + 436s + 5952. 4(s + 16)(s + 93) Factor -u*2 - 9u + 10. -(u - 1)(u + 10) Solve 41209h*3/4 + 44863h*2/4 + 3735h/4 + 81/4 = 0. -1, -9/203 Let 33o5 - 50o*4 - 36o*3 + 8o*2 = 0. What is o? -2/3, 0, 2/11, 2 Factor -2z*2/7 + 192z/7. -2z(z - 96)/7 Factor a*3 + 2a*2 - 29a - 30. (a - 5)(a + 1)(a + 6) Factor y*4 - 578y*3/5 - 232y2/5. y2(y - 116)(5y + 2)/5 Factor -4x*2/9 + 460x/9 - 152/3. -4(x - 114)(x - 1)/9 Let 80j3/7 - 74j*2/7 - 6j/7 = 0. What is j? -3/40, 0, 1 Factor -i*3 - 36i*2 - 33i + 70. -(i - 1)(i + 2)(i + 35) Factor -2p3/13 + 20p*2/13 + 106p/13 + 84/13. -2(p - 14)(p + 1)(p + 3)/13 Factor -2c*2/9 + 310c/9. -2c(c - 155)/9 Find n, given that n*2/5 - 11n/5 - 26/5 = 0. -2, 13 Find x, given that 4x4 + 40x*3 + 4x*2 - 336x - 432 = 0. -9, -2, 3 Let -2n3/19 - 164n*2/19 - 3666n/19 - 12168/19 = 0. Calculate n. -39, -4 What is f in -84f4 - 452f*3 - 144f*2 + 80f = 0? -5, -2/3, 0, 2/7 Let -10z4 + 59z*3 - 47z*2 + 10z = 0. What is z? 0, 2/5, 1/2, 5 Suppose 4m2/5 + 136m/5 + 1156/5 = 0. Calculate m. -17 Factor -2z3/5 - 4z*2 + 104z/5 - 112/5. -2(z - 2)2(z + 14)/5 Solve -5m3 + 9325m*2 = 0 for m. 0, 1865 Solve -2w*5 + 10w*4 - 6w*3 - 18w*2 = 0 for w. -1, 0, 3 Factor 4h*3 + 292h*2 - 1876h + 1580. 4(h - 5)(h - 1)(h + 79) Factor -g4 - 214g*3 - 11232g*2 + 23328g. -g(g - 2)(g + 108)*2 Factor -2v*2 + 928v - 926. -2(v - 463)(v - 1) Determine m, given that -2m3 - 356m*2/9 + 1294m/9 - 920/9 = 0. -23, 1, 20/9 Factor t*4/2 + 13t*3/2 + 30t*2 + 56t + 32. (t + 1)(t + 4)3/2 Factor -2c*3 - 224c*2 + 226c. -2c(c - 1)(c + 113) What is t in 14t*5/3 - 38t*4/3 - 194t*3/3 + 662t*2/3 - 100t - 48 = 0? -4, -2/7, 1, 3 Let s*3 - 21s*2 = 0. Calculate s. 0, 21 Determine g so that -3g*4/8 - 9g*3/2 - 69g*2/4 - 45g/2 - 75/8 = 0. -5, -1 Suppose 4u4 + 32u*3 + 28u2 = 0. Calculate u. -7, -1, 0 What is u in -u5/3 + u*4/3 + 2u*3/3 = 0? -1, 0, 2 Factor -3n*2 - 12n + 63. -3(n - 3)(n + 7) Factor -2k2 - 192k + 3080. -2(k - 14)(k + 110) Determine j so that j*4/8 - 25j*3/4 + 108j*2 - 704j + 1024 = 0. 2, 16 Factor 35w3 + 171w*2/2 + 95w/2 - 3. (w + 1)(2w + 3)(35w - 2)/2 Solve v*4/4 + 3v3/2 - v2/4 - 15v/2 = 0 for v. -5, -3, 0, 2 Suppose -3r*4/5 + 43r*3/5 - 161r*2/5 + 49r/5 = 0. What is r? 0, 1/3, 7 Factor o*5 - 9o*4 - 138o*3 - 416o*2 - 288o. o(o - 18)(o + 1)(o + 4)2 Find j, given that -288j*5 + 160j*4 + 146j*3 - 10j*2 - 8j = 0. -4/9, -1/4, 0, 1/4, 1 Factor 15s4 + 85s*3 + 140s*2 + 60s. 5s(s + 2)(s + 3)(3s + 2) Determine m so that 10m*2 - 395m/2 + 940 = 0. 8, 47/4 Suppose -1058q5/9 - 6256q*4/9 + 1942q*3 - 1484q*2/9 + 32q/9 = 0. Calculate q. -8, 0, 1/23, 2 Factor -2g3 + 154g**2 -	{ "pile_set_name": "DM Mathematics" }
e there between 10:38 PM and 6:32 AM? 474 What is 33 minutes before 10:36 AM? 10:03 AM How many minutes are there between 9:02 PM and 8:27 AM? 685 What is 616 minutes before 2:00 AM? 3:44 PM How many minutes are there between 11:52 PM and 3:14 AM? 202 How many minutes are there between 4:03 PM and 2:15 AM? 612 How many minutes are there between 4:02 PM and 6:18 PM? 136 How many minutes are there between 6:01 PM and 6:53 PM? 52 How many minutes are there between 4:16 AM and 6:28 AM? 132 How many minutes are there between 10:36 PM and 12:46 AM? 130 What is 474 minutes after 8:15 AM? 4:09 PM How many minutes are there between 8:02 PM and 6:12 AM? 610 What is 184 minutes before 10:47 PM? 7:43 PM What is 597 minutes after 10:30 PM? 8:27 AM What is 462 minutes before 3:39 PM? 7:57 AM How many minutes are there between 1:01 PM and 4:59 PM? 238 How many minutes are there between 8:15 AM and 12:58 PM? 283 What is 439 minutes before 7:34 AM? 12:15 AM What is 424 minutes before 12:51 PM? 5:47 AM How many minutes are there between 11:55 AM and 3:51 PM? 236 What is 39 minutes after 2:53 PM? 3:32 PM How many minutes are there between 8:21 PM and 10:08 PM? 107 What is 597 minutes after 11:12 PM? 9:09 AM What is 693 minutes before 9:34 PM? 10:01 AM How many minutes are there between 2:42 PM and 7:16 PM? 274 What is 253 minutes after 5:40 PM? 9:53 PM How many minutes are there between 8:30 AM and 6:26 PM? 596 How many minutes are there between 4:38 AM and 9:34 AM? 296 What is 59 minutes before 6:44 AM? 5:45 AM How many minutes are there between 1:06 AM and 10:49 AM? 583 What is 310 minutes after 1:31 PM? 6:41 PM How many minutes are there between 12:25 AM and 11:37 AM? 672 What is 610 minutes before 1:07 AM? 2:57 PM How many minutes are there between 7:29 AM and 5:52 PM? 623 How many minutes are there between 2:30 AM and 7:19 AM? 289 What is 296 minutes after 12:09 PM? 5:05 PM What is 468 minutes after 7:51 AM? 3:39 PM How many minutes are there between 6:59 PM and 9:54 PM? 175 How many minutes are there between 9:05 AM and 7:10 PM? 605 How many minutes are there between 3:47 AM and 9:07 AM? 320 What is 244 minutes before 11:01 PM? 6:57 PM What is 10 minutes after 5:21 AM? 5:31 AM How many minutes are there between 12:08 AM and 5:17 AM? 309 What is 149 minutes after 11:28 PM? 1:57 AM What is 564 minutes before 5:21 PM? 7:57 AM How many minutes are there between 10:01 PM and 6:49 AM? 528 What is 457 minutes before 9:38 PM? 2:01 PM What is 699 minutes after 11:29 AM? 11:08 PM What is 141 minutes before 5:43 AM? 3:22 AM How many minutes are there between 12:21 AM and 7:49 AM? 448 How many minutes are there between 1:38 AM and 6:43 AM? 305 What is 49 minutes before 6:49 AM? 6:00 AM How many minutes are there between 7:08 AM and 2:11 PM? 423 What is 466 minutes after 7:05 AM? 2:51 PM What is 52 minutes before 4:04 AM? 3:12 AM What is 40 minutes before 2:07 AM? 1:27 AM How many minutes are there between 3:54 PM and 10:01 PM? 367 What is 321 minutes before 5:51 AM? 12:30 AM What is 60 minutes after 9:04 PM? 10:04 PM What is 123 minutes before 5:24 PM? 3:21 PM What is 386 minutes after 9:39 PM? 4:05 AM What is 123 minutes after 6:28 AM? 8:31 AM What is 211 minutes before 2:50 PM? 11:19 AM What is 49 minutes after 5:23 PM? 6:12 PM How many minutes are there between 3:09 PM and 5:42 PM? 153 How many minutes are there between 5:21 AM and 12:00 PM? 399 How many minutes are there between 2:15 PM and 3:15 PM? 60 What is 585 minutes after 8:56 AM? 6:41 PM How many minutes are there between 10:03 PM and 10:15 PM? 12 How many minutes are there between 12:55 AM and 6:00 AM? 305 How many minutes are there between 1:33 PM and 3:34 PM? 121 What is 652 minutes after 2:04 AM? 12:56 PM What is 568 minutes before 1:43 AM? 4:15 PM What is 459 minutes before 10:10 PM? 2:31 PM What is 82 minutes before 8:32 AM? 7:10 AM How many minutes are there between 8:19 AM and 4:05 PM? 466 How many minutes are there between 7:44 PM and 11:27 PM? 223 What is 313 minutes after 10:17 AM? 3:30 PM How many minutes are there between 1:07 AM and 9:53 AM? 526 What is 223 minutes after 9:28 AM? 1:11 PM How many minutes are there between 4:57 PM and 11:57 PM? 420 How many minutes are there between 4:10 PM and 3:49 AM? 699 What is 485 minutes after 3:21 AM? 11:26 AM How many minutes are there between 1:43 AM and 2:42 AM? 59 How many minutes are there between 6:35 PM and 4:08 AM? 573 What is 27 minutes before 8:51 AM? 8:24 AM What is 203 minutes after 6:04 PM? 9:27 PM What is 587 minutes after 10:29 AM? 8:16 PM How many minutes are there between 2:30 PM and 5:16 PM? 166 What is 493 minutes before 10:11 AM? 1:58 AM How many minutes are there between 11:53 AM and 4:19 PM? 266 How many minutes are there between 5:21 PM and 9:41 PM? 260 How many minutes are there between 3:41 AM and 6:37 AM? 176 What is 587 minutes before 11:43 PM? 1:56 PM What is 341 minutes before 7:02 PM? 1:21 PM What is 448 minutes after 10:41 AM? 6:09 PM How many minutes are there between 1:18 PM and 6:14 PM? 296 What is 705 minutes before 6:28 AM? 6:43 PM How many minutes are there between 4:59 PM and 10:19 PM? 320 How many minutes are there between 7:09 PM and 9:10 PM? 121 What is 142 minutes before 3:04 AM? 12:42 AM What is 578 minutes before 10:07 AM? 12:29 AM How many minutes are there between 2:25 PM and 12:21 AM? 596 How many minutes are there between 2:19 AM and 12:58 PM? 639 How many minutes are there between 6:48 PM and 1:44 AM? 416 How many minutes are there between 1:10 AM and 10:09 AM? 539 What is 387 minutes before 7:30 AM? 1:03 AM What is 250 minutes before 8:08 PM? 3:58 PM What is 627 minutes after 7:58 AM? 6:25 PM What is 539 minutes after 4:22 PM? 1:21 AM How many minutes are there between 1:51 PM and 10:25 PM? 514 How many minutes are there between 7:35 PM and 10:04 PM? 149 How many minutes are there between 10:28 AM and 9:02 PM? 634 What is 517 minutes before 7:41 AM? 11:04 PM What is 342 minutes before 10:15 PM? 4:33 PM What is 90 minutes after 4:01 AM? 5:31 AM What is 155 minutes before 12:06 PM? 9:31 AM What is 127 minutes after 9:39 PM? 11:46 PM What is 184 minutes before 12:12 PM? 9:08 AM What is 12 minutes before 3:10 PM? 2:58 PM What is 342 minutes after 10:26 AM? 4:08 PM What is 535 minutes after 1:18 AM? 10:13 AM What is 130 minutes after 12:32 AM? 2:42 AM How many minutes are there between 2:47 PM and 3:40 PM? 53 How many minutes are there between 10:53 AM and 5:00 PM? 367 How many minutes are there between 3:17 PM and 7:26 PM? 249 How many minutes are there between 1:23 AM and 12:23 PM? 660 How many minutes are there between 12:06 PM and 2:35 PM? 149 How many minutes are there between 1:21 AM and 12:02 PM? 641 What is 685 minutes before 1:23 PM? 1:58 AM What is 302 minutes before 3:18 PM? 10:16 AM What is 41 minutes after 6:38 AM? 7:19 AM What is 416 minutes after 12:42 AM? 7:38 AM How many minutes are there between 8:59 PM and 2:43 AM? 344 How many minutes are there between 11:49 AM and 2:42 PM? 173 How many minutes are there between 10:57 AM and 6:25 PM? 448 How many minutes are there between 11:28 PM and 1:05 AM? 97 What is 35 minutes before 4:19 PM? 3:44 PM How many minutes are there between 4:45 AM and 4:51 AM? 6 How many minutes are there between 9:49 AM and 1:11 PM? 202 What is 467 minutes before 5:11 AM? 9:24 PM What is 137 minutes before 3:40 PM? 1:23 PM How many minutes are there between 1:01 PM and 11:00 PM? 599 What is 98 minutes before 7:13 PM? 5:35 PM What is 612 minutes before 6:04 AM? 7:52 PM How many minutes are there between 1:30 PM and 6:34 PM? 304 What is 444 minutes after 7:16 AM? 2:40 PM How many minutes are there between 7:41 PM and 1:18 AM? 337 What is 90 minutes before 7:18 PM? 5:48 PM What is 428 minutes after 9:38 PM? 4:46 AM How many minutes are there between 10:13 AM and 6:26 PM? 493 What is 634 minutes after 7:13 AM? 5:47 PM How many minutes are there between 7:30 PM and 7:20 AM? 710 How many minutes are there between 1:22 PM and 12:24 AM? 662 What is 410 minutes after 3:57 AM? 10:47 AM How many minutes are there between 10:00 AM and 2:09 PM? 249 How many minutes are there between 6:18 AM and 4:00 PM? 582 How many minutes are there between 8:25 AM and 4:59 PM? 514 What is 341 mi	{ "pile_set_name": "DM Mathematics" }
nt from {j: 3, o: 3}. Give prob of sequence joj. 3/20 Four letters picked without replacement from zzsszzzzszszssozzz. Give prob of sequence ozzs. 11/1224 Calculate prob of sequence ji when two letters picked without replacement from {j: 17, i: 3}. 51/380 What is prob of sequence zffo when four letters picked without replacement from {o: 2, z: 2, f: 11, e: 1, t: 1, n: 2}? 55/11628 Four letters picked without replacement from tfffo. Give prob of sequence ffot. 1/20 Calculate prob of sequence mt when two letters picked without replacement from qqteqttteqteqmtqt. 7/272 Three letters picked without replacement from {w: 10, j: 7, c: 1}. What is prob of sequence wwj? 35/272 What is prob of sequence xx when two letters picked without replacement from {p: 8, x: 4, i: 2, y: 3}? 3/68 What is prob of sequence atpp when four letters picked without replacement from ptpapppaaa? 1/63 Calculate prob of sequence un when two letters picked without replacement from nunn. 1/4 Three letters picked without replacement from {n: 7, e: 2, k: 1, w: 4}. Give prob of sequence wee. 1/273 Four letters picked without replacement from uauaauu. What is prob of sequence aaua? 1/35 Three letters picked without replacement from teiwtiwitit. Give prob of sequence wie. 4/495 What is prob of sequence akkk when four letters picked without replacement from akkakkkakk? 1/8 What is prob of sequence wkzm when four letters picked without replacement from {z: 4, k: 2, w: 4, e: 1, u: 1, m: 2}? 8/3003 Four letters picked without replacement from {z: 6, r: 4, k: 4, o: 2, i: 4}. What is prob of sequence izrk? 16/4845 Calculate prob of sequence ebh when three letters picked without replacement from bbedybbbdhoeybhhyeb. 7/646 Calculate prob of sequence vt when two letters picked without replacement from uvut. 1/12 Three letters picked without replacement from {b: 6, a: 4}. Give prob of sequence bab. 1/6 Four letters picked without replacement from {x: 5, g: 6, n: 2, r: 1, e: 5}. What is prob of sequence eern? 5/11628 What is prob of sequence hjhh when four letters picked without replacement from hjjjhjhj? 1/56 Two letters picked without replacement from {y: 2, g: 3, s: 10}. Give prob of sequence sg. 1/7 Two letters picked without replacement from trpqv. Give prob of sequence rv. 1/20 Two letters picked without replacement from {n: 3, s: 2, y: 6, b: 2}. Give prob of sequence bb. 1/78 Four letters picked without replacement from {k: 6, i: 9, m: 2}. Give prob of sequence ikik. 9/238 What is prob of sequence dnt when three letters picked without replacement from tnnnd? 1/20 Four letters picked without replacement from {z: 8, r: 2, a: 3, h: 7}. What is prob of sequence zhhh? 14/969 Two letters picked without replacement from ltvvvvvgltltt. What is prob of sequence tv? 5/39 What is prob of sequence xxxq when four letters picked without replacement from qqqxqqqqqxqqq? 0 Two letters picked without replacement from {b: 9, v: 3}. Give prob of sequence vv. 1/22 Calculate prob of sequence uqqd when four letters picked without replacement from qqqqdqqqquqqq. 1/156 Calculate prob of sequence rtx when three letters picked without replacement from rxtrxrtdr. 2/63 Calculate prob of sequence ocz when three letters picked without replacement from luuulozlocrl. 1/660 Two letters picked without replacement from {j: 3, w: 4, l: 1, t: 5}. What is prob of sequence lt? 5/156 Two letters picked without replacement from uhuiuuuiuu. What is prob of sequence uh? 7/90 Three letters picked without replacement from {g: 2, d: 7, q: 3, o: 1, z: 3, h: 1}. Give prob of sequence hog. 1/2040 Three letters picked without replacement from {w: 1, k: 1, c: 2, e: 1}. Give prob of sequence cec. 1/30 Three letters picked without replacement from axadxdxxxxdaxxaxaxd. What is prob of sequence dax? 100/2907 Calculate prob of sequence cc when two letters picked without replacement from {c: 4, m: 3}. 2/7 Calculate prob of sequence ssgg when four letters picked without replacement from wewwsesegwwsewg. 1/2730 Calculate prob of sequence yy when two letters picked without replacement from ljubyluujyls. 1/66 Calculate prob of sequence iiww when four letters picked without replacement from iwihbbnibwiiinbhbiii. 2/1615 Four letters picked without replacement from {z: 4, p: 3, r: 1, b: 2}. What is prob of sequence brpb? 1/840 Calculate prob of sequence bbo when three letters picked without replacement from bbbbbbbobbbbbbbbbobb. 17/190 What is prob of sequence qqz when three letters picked without replacement from qqqqzqqq? 1/8 Four letters picked without replacement from {q: 3, s: 7, e: 2, x: 8}. What is prob of sequence qsex? 14/4845 What is prob of sequence aei when three letters picked without replacement from iefixaf? 1/105 Four letters picked without replacement from {c: 4, y: 3, x: 1, e: 11}. What is prob of sequence xeyy? 11/15504 Two letters picked without replacement from {o: 5, w: 4, b: 3, n: 1, e: 5, u: 2}. Give prob of sequence ew. 1/19 What is prob of sequence uu when two letters picked without replacement from wwwwuwwwuwuw? 1/22 Two letters picked without replacement from {h: 3, s: 5, f: 6, z: 3}. What is prob of sequence hs? 15/272 What is prob of sequence yzxk when four letters picked without replacement from {s: 2, y: 1, l: 1, x: 1, z: 2, k: 1}? 1/840 Four letters picked without replacement from ctntullducuddcc. What is prob of sequence ltlc? 2/4095 Two letters picked without replacement from oxxkm. What is prob of sequence mo? 1/20 What is prob of sequence mbgm when four letters picked without replacement from {m: 9, t: 6, g: 2, b: 1}? 1/510 What is prob of sequence kbj when three letters picked without replacement from jjjjbtkx? 1/84 What is prob of sequence qsh when three letters picked without replacement from {n: 1, q: 2, s: 1, z: 1, h: 5, g: 3}? 5/858 What is prob of sequence uu when two letters picked without replacement from {e: 4, u: 10}? 45/91 Four letters picked without replacement from {z: 5, i: 5}. What is prob of sequence iziz? 5/63 What is prob of sequence nhnh when four letters picked without replacement from hnhnhnnnnhn? 7/110 What is prob of sequence ddxx when four letters picked without replacement from xddddddddxxd? 2/55 What is prob of sequence va when two letters picked without replacement from vvvxxaaxaxaxxxavlxxx? 1/19 What is prob of sequence oy when two letters picked without replacement from {z: 2, h: 2, o: 1, j: 10, y: 3, t: 2}? 3/380 Two letters picked without replacement from jjjjjmjjjjmjjjjjjjjj. Give prob of sequence jm. 9/95 Three letters picked without replacement from {w: 8, j: 7, n: 1, h: 2}. What is prob of sequence njh? 7/2448 Calculate prob of sequence mndt when four letters picked without replacement from txtngtdgmmxmgtxn. 1/1820 Two letters picked without replacement from bblggqvaqqaa. Give prob of sequence qg. 1/22 Three letters picked without replacement from {f: 2, k: 3, m: 1, g: 2, w: 3, n: 3}. Give prob of sequence gwk. 3/364 Four letters picked without replacement from {c: 10, p: 9}. What is prob of sequence ccpp? 45/646 Three letters picked without replacement from {g: 4, j: 4, e: 6, x: 5}. What is prob of sequence gee? 20/969 What is prob of sequence ll when two letters picked without replacement from iiillyynhlll? 5/33 Two letters picked without replacement from {c: 7}. Give prob of sequence cc. 1 Three letters picked without replacement from {s: 8, a: 3}. Give prob of sequence aaa. 1/165 Three letters picked without replacement from {o: 2, n: 1, k: 1, q: 3, s: 5, l: 1}. Give prob of sequence kkl. 0 Three letters picked without replacement from {d: 3, j: 1, m: 2, w: 1, r: 3, p: 5}. What is prob of sequence jdp? 1/182 Two letters picked without replacement from uwcwczczcuwzezewwcu. Give prob of sequence ue. 1/57 What is prob of sequence tit when three letters picked without replacement from {r: 5, i: 5, n: 1, w: 2, l: 4, t: 3}? 1/228 Four letters picked without replacement from xxttxtxtyxyyyyx. What is prob of sequence ytyy? 2/273 What is prob of sequence wrwh when four letters picked without replacement from {w: 7, h: 2, p: 5, r: 2, x: 4}? 7/4845 Two letters picked without replacement from {j: 2, e: 1}. What is prob of sequence je? 1/3 Four letters picked without replacement from	{ "pile_set_name": "DM Mathematics" }
3, 0.6, 0.1, 2/101, 0, -0.3 Put -1, -2, 7236 in decreasing order. 7236, -1, -2 Put -1, -386, -13, 6 in decreasing order. 6, -1, -13, -386 Sort 2293, 4, -2, -1 in decreasing order. 2293, 4, -1, -2 Put 5, 1, -5, 2, -6, 13 in descending order. 13, 5, 2, 1, -5, -6 Sort 5, -0.5, -1, 2, -6, 8. -6, -1, -0.5, 2, 5, 8 Put -6, -4, -1/11, 8 in descending order. 8, -1/11, -4, -6 Sort -7, 3, -17. -17, -7, 3 Sort 4/79, 2, -54. -54, 4/79, 2 Sort -0.07, -4/387, -2.2 in decreasing order. -4/387, -0.07, -2.2 Sort -802.1, 0, -3/7 in descending order. 0, -3/7, -802.1 Sort -4/5, 16487, -4, 3. -4, -4/5, 3, 16487 Sort -3, -67, 11, 2/3 in descending order. 11, 2/3, -3, -67 Sort -14, -9, -2, 103. -14, -9, -2, 103 Put -977, -10, 12 in decreasing order. 12, -10, -977 Sort -16/9, -0.6, -1.24 in ascending order. -16/9, -1.24, -0.6 Sort 0, 796, 10, 4, 3 in decreasing order. 796, 10, 4, 3, 0 Put -7, 71, 5, 2, -12, -4 in increasing order. -12, -7, -4, 2, 5, 71 Sort -0.3, -4, -3/2620, 0.24 in ascending order. -4, -0.3, -3/2620, 0.24 Put -3, -6, 3, 2, -4 in descending order. 3, 2, -3, -4, -6 Sort 2/5, -1, 5 in descending order. 5, 2/5, -1 Put -4384, 0, 2, 5, -1 in ascending order. -4384, -1, 0, 2, 5 Put -0.3, -4, -32.46 in decreasing order. -0.3, -4, -32.46 Sort 11, 21, -52, 1, -3 in decreasing order. 21, 11, 1, -3, -52 Put 5, 4.24, -0.3, -111 in increasing order. -111, -0.3, 4.24, 5 Sort 1, -5, 4, -33, -2 in decreasing order. 4, 1, -2, -5, -33 Put -0.1, 142, -6, -2/3 in decreasing order. 142, -0.1, -2/3, -6 Put -4, 2/7, 783, 0.5, 2 in ascending order. -4, 2/7, 0.5, 2, 783 Sort -5, 3, 3246 in decreasing order. 3246, 3, -5 Sort 0.5, -4, 4, 5/8 in decreasing order. 4, 5/8, 0.5, -4 Put -74, -5, 5, -3, 1 in decreasing order. 5, 1, -3, -5, -74 Sort 2, 4, -606 in decreasing order. 4, 2, -606 Sort -0.59, 0.2, 1, -2/17, 0.06, 2 in descending order. 2, 1, 0.2, 0.06, -2/17, -0.59 Put -2, -4, 2, -1, 7602 in ascending order. -4, -2, -1, 2, 7602 Sort -3, 1, 0, 50, 22 in ascending order. -3, 0, 1, 22, 50 Sort 5, 2/5, 4999 in decreasing order. 4999, 5, 2/5 Put 0.2, -16311, 3 in ascending order. -16311, 0.2, 3 Sort 7, 61, -5, -2, -3. -5, -3, -2, 7, 61 Put 150, -1, 9 in descending order. 150, 9, -1 Sort -6, 1, -4, -5, 5, 895. -6, -5, -4, 1, 5, 895 Put 3/7, -0.31, 4/7, -2 in decreasing order. 4/7, 3/7, -0.31, -2 Sort -40, 4, 12, 14 in increasing order. -40, 4, 12, 14 Put 0, 5, 1, 124, -14 in descending order. 124, 5, 1, 0, -14 Sort 2, -3, -68, 1, -2, -105. -105, -68, -3, -2, 1, 2 Put 4, -624, -1, 18 in increasing order. -624, -1, 4, 18 Sort -304, -14, 3 in ascending order. -304, -14, 3 Sort 2, 11, 376, 4 in decreasing order. 376, 11, 4, 2 Sort -0.15, 27/98, -2/9, 8 in descending order. 8, 27/98, -0.15, -2/9 Sort 151/4, 4, 5, 219.1 in increasing order. 4, 5, 151/4, 219.1 Put 5, 4, 0.5, -0.4, -1.91, -3/13 in increasing order. -1.91, -0.4, -3/13, 0.5, 4, 5 Sort -2, 6, -1, -22, -89, 1 in decreasing order. 6, 1, -1, -2, -22, -89 Put -79, 25, 4, -12 in ascending order. -79, -12, 4, 25 Put -2, 30, 1014 in descending order. 1014, 30, -2 Sort 14, 19, 4, 44, -4 in decreasing order. 44, 19, 14, 4, -4 Sort 0, -113, -21, 3. -113, -21, 0, 3 Sort 58, 1/7, 3.18 in descending order. 58, 3.18, 1/7 Sort 5, -5, 3638, 3, 2. -5, 2, 3, 5, 3638 Put 0, 640, 6/11 in decreasing order. 640, 6/11, 0 Put 2, 4, -1, -30, 1, 23 in descending order. 23, 4, 2, 1, -1, -30 Sort -1, -4, 1, 68, -2, 4 in descending order. 68, 4, 1, -1, -2, -4 Put -0.002, 2, -3, -0.08 in descending order. 2, -0.002, -0.08, -3 Put -8.7, -6361, -1/6, -0.4 in decreasing order. -1/6, -0.4, -8.7, -6361 Sort 3, 4/5, -6, 0.3, -1/10 in descending order. 3, 4/5, 0.3, -1/10, -6 Sort 0, -2, -1, 4, 23495 in decreasing order. 23495, 4, 0, -1, -2 Sort 0.0021, 0.2, -5, -58. -58, -5, 0.0021, 0.2 Sort 0, -5, 3, 4, 42030, 2 in increasing order. -5, 0, 2, 3, 4, 42030 Sort -275, -4, 1/3, 0.2, 0.5, -5 in descending order. 0.5, 1/3, 0.2, -4, -5, -275 Put -6, 58, 2, 1, -1 in ascending order. -6, -1, 1, 2, 58 Put 89, 1, 5, 3, -4, 0 in ascending order. -4, 0, 1, 3, 5, 89 Put 5, 3, 1, -5, -3961 in ascending order. -3961, -5, 1, 3, 5 Sort -5, -4, -7, 5 in ascending order. -7, -5, -4, 5 Put 0.4, -4, -2/3, 4, 1219, 5 in ascending order. -4, -2/3, 0.4, 4, 5, 1219 Sort -2/103, -7, -4 in decreasing order. -2/103, -4, -7 Sort -1103, -0.8, -2/55, -0.2 in ascending order. -1103, -0.8, -0.2, -2/55 Sort -30, 0, 7, 2, 8 in descending order. 8, 7, 2, 0, -30 Sort 26, 5, -4, 4, -62 in decreasing order. 26, 5, 4, -4, -62 Put 36414, 2, 20 in descending order. 36414, 20, 2 Put -3, 11171, -0.32 in decreasing order. 11171, -0.32, -3 Put -4, 2, -0.03, -1, 1.7 in increasing order. -4, -1, -0.03, 1.7, 2 Sort -3, 15189, 3/2 in ascending order. -3, 3/2, 15189 Put 4, -9, 3, -260, -6 in increasing order. -260, -9, -6, 3, 4 Sort 5, -2, -6, -24, 23, 3. -24, -6, -2, 3, 5, 23 Put 547, 6, 0, -14 in decreasing order. 547, 6, 0, -14 Sort -3/14, -1/13, 1/6, 5. -3/14, -1/13, 1/6, 5 Put -6, -88, 1, -17, -8, -3 in ascending order. -88, -17, -8, -6, -3, 1 Sort -5, -0.5, -664. -664, -5, -0.5 Sort -19, -56, -95 in descending order. -19, -56, -95 Put 14, 0, 32, -3, 1, 6 in descending order. 32, 14, 6, 1, 0, -3 Sort -18, -43, 1, 2, -3/10 in descending order. 2, 1, -3/10, -18, -43 Sort -1, -20, 6, 5, -94 in ascending order. -94, -20, -1, 5, 6 Sort 16, 9, 48, -5, 1 in ascending order. -5, 1, 9, 16, 48 Put -0.2, -0.38, 311.7 in decreasing order. 311.7, -0.2, -0.38 Put -962, 2, -5, 6 in ascending order. -962, -5, 2, 6 Put -0.3, -2/5, -13, 5, -45/2 in descending order. 5, -0.3, -2/5, -13, -45/2 Sort -5, 2, -1, 65, 4, 17 in increasing order. -5, -1, 2, 4, 17, 65 Sort 3, 17, 14 in increasing order. 3, 14, 17 Put 18, 6, 5, -210 in decreasing order. 18, 6, 5, -210 Put -96055, 17, 4 in increasing order. -96055, 4, 17 Put 26, 8, 29, 2 in descending order. 29, 26, 8, 2 Put 3, -1, 7952, 2 in increasing order. -1, 2, 3, 7952 Put -0.7, -429, -0.3 in ascending order. -429, -0.7, -0.3 Put -1, -5, 0, 2, 239, 20 in ascending order. -5, -1, 0, 2, 20, 239 Sort -2, -1, -370, 4. -370, -2, -1, 4 Put 43, 475, -4/5 in ascending order. -4/5, 43, 475 Put 2, -655/8, 141 in descending order. 141, 2, -655/8 Sort 669, -1, 2, 17 in descending order. 669, 17, 2, -1 Sort 7, -597, -21 in ascending order. -597, -21, 7 Sort 23, -1/2, -1, -2, 0, 1.38 in descending order. 23, 1.38, 0, -1/2, -1, -2 Sort -3, -1/495, 5/14, -2/3. -3, -2/3, -1/495, 5/14 Sort 1/2, 1, 33, 0.2, -0.04 in descending order. 33, 1, 1/2, 0.2, -0.04 Sort 0.2, -2294, -1/118 in ascending order. -2294, -1/118, 0.2 Sort 498/17, -1/9, -0.08 in decreasing order. 498/17, -0.08, -1/9 Put -304, 0, 8, 3, 5 in decreasing order. 8, 5, 3, 0, -304 Sort 3, -7, 2/29, 2, 5 in ascending order. -7, 2/29, 2, 3, 5 Sort 2, 4, -17, -4/5, -0.17, 38. -17, -4/5, -0.17, 2, 4, 38 Sort -14, -57/5, 0.29, 1. -14, -57/5, 0.29, 1 Put -11, -174, -2 in increasing order. -174, -11, -2 Put 1/4, 0.4, 9.34, 2, -3, 26 in ascending order. -3, 1/4, 0.4, 2, 9.34, 26 Sort -3/4, 2/53, 28/11, 1/5 in descending order. 28/11, 1/5, 2/53, -3/4 Sort -5, -2, -1, 4, 10 in ascending order. -5, -2, -1, 4, 10 Sort -2, 5, 3, 1602, -45 in increasing order. -45, -2, 3, 5, 1602 Put 4, -390, -73 in descending order. 4, -73, -390 Sort -12, 1, 16, 3 in ascending order. -12, 1, 3, 16 Sort -1, 9, 1.1, 0.5, 0.29. -1, 0.29, 0.5, 1.1, 9 Put 0, -2, 1, 2, -3, 53470 in descending order. 53470, 2, 1, 0, -2, -3 Put 187, 0.3, -657 in ascending order. -657, 0.3, 187 Sort -4, 91, -8, -2 in descending order. 91, -2, -4, -8 Put 756, 0, 0.133 in descending order. 756, 0.133, 0 Sort 2/15, 83, 0.4, 0.2 in decreasing order. 83, 0.4, 0.2, 2/15 Sort 7593, -0.1, -0.3, -1/5, -2/3 in decreasing order. 7593, -0.1, -1/5, -0.3, -2/3 Put 3, -5, 7, 38 in ascending order. -5, 3, 7, 38 Sort -8, 212, -45. -45, -8, 212 Sort -3, -1, 4, -2236, -2. -2236, -3, -2, -1, 4 Put 3, 1, 2, -46, -125 in descending order. 3, 2, 1, -46, -125 Sort -1, -160, 28, 2, 5 in increasing order. -160, -1, 2, 5, 28 Put 215/4, -1.6, -2, -1 in decreasing order. 215/4, -1, -1.6, -2 Sort -2/171, -6, 3/7. -6, -2/171, 3/7 Sort 3, 12, -905, -3. -905, -3, 3, 12 Sort -0.4, 6.24, 2/5, -37/8 in decreasing order. 6.24, 2/5, -0.4, -37/8 Sort 0.43, 1/2, 2, 4, -0.4, -9. -9, -0.4, 0.43, 1/2, 2, 4 Sort -77, 2/17, 1. -7	{ "pile_set_name": "DM Mathematics" }
is smaller: f or l? f Let w = 30 - 303/10. Is w at least -1? True Let t(m) be the second derivative of 1/2m2 - 2m + 0 + 1/2m3. Let s be t(-1). Is s greater than -2? False Let r = -6.7 + 6.6. Does -19/8 = r? False Let t = -0.065 + 0.165. Let h be ((-2)/(-4))/((-6)/12). Is t greater than or equal to h? True Let i(j) be the first derivative of -4j + 1 - 2j3 + 1/4j*4 + 3j*2. Let y be i(5). Is 1 greater than y? False Let n be 7 - 7 - 2/(-6). Suppose 0 = u - 0u. Suppose -5o - 5g = 0, 0o - o - 4g = u. Which is smaller: o or n? o Suppose 0 = -h + 5h - 60. Let a be h(-3 - (-17)/5). Which is bigger: 2 or a? a Let c(a) = -a*2 - 7a. Let h be c(-7). Which is greater: -9/7 or h? h Suppose -3k - 4v = -29 + 219, 5k - 2v + 282 = 0. Does k = -58? True Let u be (-5 - -6)/((-2)/30). Is u != -13? True Suppose 2i + 8z = 4z + 10, 3i = 3z - 3. Let t be ((-2)/40)/1. Which is bigger: t or i? i Let n(u) = u*3 + 2u*2 - u + 5. Let y be n(-3). Which is smaller: 1/14 or y? y Let y = 0.188 - 0.288. Let z = 5.9 - -1.1. Are z and y equal? False Let t = 2 + -2. Let z be (-2)/8(-8 - -6). Is t bigger than z? False Suppose -l - 13 = -3. Is -10 > l? False Let m = 19 + 6. Is m less than or equal to 73/3? False Let f = -106 - -103. Which is greater: -21/8 or f? -21/8 Let s = 852 + -218113/256. Let p = 1553/4352 + s. Which is greater: p or 1? 1 Let b be (-2)/5 - ((-4)/10 - -1). Suppose -v = -0v + 1. Is v at most as big as b? True Let s = -88 - -89. Is 12/31 smaller than s? True Let o = 30609/1148 + 67/164. Let x = -55/2 + o. Is 0 greater than x? True Suppose 4w - 24 = 4g, -w = -5g - 0w - 22. Let h(p) = -p - 3. Let q be h(g). Is q at least -2? True Let c(x) = x3 + 5x*2 - 1. Let q be c(-4). Let s = -15 + q. Is s > 1/16? False Let t be ((-12)/(-30))/(2/10). Let o be 2 + t + -1 + -2. Let c = o - 1. Are c and 1/4 nonequal? True Let v be 0 + (-14)/8 + 2. Let a = 0.32 + -0.42. Which is bigger: a or v? v Let z be 4 + 100/(-36) - (-2)/(-9). Is -2/131 less than or equal to z? True Suppose -4k + 1 = -3. Let y be 1(-2 - (-1 + -1)). Is k < y? False Let s = 13 - 22. Let v be (s/4)/((-3)/16). Is 11 less than v? True Suppose -3r + 5f + 36 = 0, -23 = -4r - r - 4f. Suppose 2l + 3j + 7 = 0, 3 = -4j + r. Let u be ((-4)/(-12))/(l/(-6)). Which is greater: u or -2? u Let i = 57157/1122 + -874/17. Let n = 3/22 + i. Which is greater: -7 or n? n Let p be ((-4)/(-10))/(-9 + 10)-5. Which is smaller: -5/9 or p? p Let q = 1.02 - 0.02. Let c = 2 - 3. Which is greater: c or q? q Suppose 10 = 3d + 2d. Suppose -dn - y = -1, -2n + 2 + 1 = 3y. Which is smaller: 1 or n? n Suppose 4k - 7k = -2k. Is k greater than 2/15? False Let s = -112 - -112.57. Let n = 0.27 - s. Let y = 1 + -0.8. Is n equal to y? False Let m = 9 + -6. Let u be (-1 + m)(-14)/4. Are u and -7 equal? True Let k = 2 - 7. Let w = k + 8. Suppose 0 = -h - wh - 4. Is h < -3/4? True Let b = 3 - 4. Let n(g) = -3g + g*2 + 0g + 0 - 4. Let w be n(4). Is b greater than w? False Suppose 0 = -4d + 5k + 8, -2d - d = -5k - 6. Let s = 55 + -53. Is s less than d? False Let w be -4-2(-1)/(-4). Suppose 2 = wr - 4r. Let x be r/515/12. Which is smaller: x or 2/5? x Let t = -1 - -7. Let l = -4 + t. Which is smaller: -2/3 or l? -2/3 Let o = -9 - -3. Let f be (-4)/o + 22/(-6). Is -2 != f? True Let l be (-43)/(-17) - (18/(-2))/(-3). Which is smaller: l or 0? l Let h be (-1)/(-4) + (-228)/16. Let y be (-282)/22 - 8/44. Which is bigger: y or h? y Let q be 1 + 0 + 15/3. Let p = q + -4. Suppose 0 = -0j + pj. Which is bigger: -1/8 or j? j Suppose -4t + 3 = -3m - 2, 2m = -t + 4. Let s = 53 + -157/3. Which is smaller: t or s? s Let x = -638/1449 + -2/483. Which is smaller: x or 1? x Let m be (1/3)/((-5)/(-15)). Let f = m + -3. Is -3/2 <= f? False Let c = -46 + 201/8. Let d = c - -21. Let r be 1 + (-3 - 8/(-4)). Which is smaller: d or r? r Let f = 13 + -15.4. Let b = f - -22.4. Which is smaller: b or 2/5? 2/5 Let m = 0 - -0.1. Let z = -8 + 4. Which is bigger: m or z? m Let k(z) = z*3 - 3z*2 - 4z + 3. Let p be k(3). Let o(n) = -n*3 + 7n*2 - 4n. Let x be o(6). Let i be 14/x + (-3)/p. Which is smaller: i or 1? 1 Let o(s) = 2s - 9. Let g be o(6). Let m(l) = 0l + l - 2l. Let z be m(g). Is z < -2? True Let z(w) = -w2 - 4w + 1. Let d be z(-4). Let y(q) = -q*2 + 10q - 12. Let r be y(8). Let u = -4 + r. Is d equal to u? False Let f(o) be the third derivative of 3o4/8 + 2o*3/3 - 3o*2. Let i be f(4). Let p = i + -201/5. Is 0 >= p? True Let p = 219/40 + -35/8. Is 1 greater than or equal to p? False Let h(t) = 3t*2 - 2t + 3. Let y be h(3). Let j be -2(0 + (-15)/y). Which is bigger: 0 or j? j Let h be (0 - (-245)/65) + 6/(-2). Is h not equal to -1/2? True Let r be (-3 - 0)(5 - 13). Is r equal to 24? True Let v = 254 + -4573/18. Which is smaller: v or 0? v Let r = -1.7 - -1.9. Is -4 >= r? False Let v(k) = -2 - k*2 + 5k - 3 + 1. Let m be v(4). Suppose 4f + f - 5 = m. Which is greater: 1/3 or f? f Suppose -3p - 5t - 92 = -0p, -3t = 2p + 61. Which is smaller: -30 or p? -30 Suppose 6y - y = 30. Let f = y - 7. Which is smaller: f or 0? f Let y = 121/655 - -2/131. Let d be (-1)/(-2)(7/1 + -7). Which is smaller: d or y? d Let r = 17 + -13. Let s = r + -4. Which is smaller: s or 1/4? s Let l be 2/(-9) - 38/(-9). Suppose -m - 8 = -ls, -2s = 6m - 5m - 4. Let r be (-3)/(-4)(-19 + 23). Which is bigger: r or s? r Let s = 44 + -30. Let j = -43/10 - -19/5. Is j < s? True Let x be (1/1)/((-7)/(-21)). Let i = 0 - x. Which is smaller: -1 or i? i Let z = -5 - -5. Let d be 2 - (-1 + 2 + z). Is 1 less than or equal to d? True Let s be 1/(-4) + (-45)/(-20). Suppose sa + 12 = -g, 0 = 2a - a + 4. Are -0.1 and g unequal? True Let b(n) = -n2 + n. Let v be b(-1). Which is smaller: -10/9 or v? v Suppose -4j - 2t = -4, -4j + 3j + 3t = -1. Suppose -6z = -z - 3o - 18, z + 2o = j. Suppose 8 + 10 = za. Is 6 <= a? True Let v = -26/9 - -28/9. Which is greater: v or -13? v Let s be (0 - 21/(-15)) + (0 - 1). Let l = -0.1 - -0.2. Which is bigger: l or s? s Suppose -2c + 4w = -12, c = -3c - w - 12. Let u be (c/(-3))/(21/9). Suppose 0 = 3y - 1 + 4. Is y bigger than u? False Let g(x) = x3 + x2 + 3. Let b be g(0). Suppose -4 = -5d + d + 4z, -3d + 4z = -b. Let p = 1/3 + -7/12. Which is smaller: p or d? p Let g(x) = -x*3 - 2x*2 + 3x + 1. Let y be g(-3). Which is bigger: -5/14 or y? y Let r = 4.4 - 5. Let d = 1.6 + r. Let o(a) = 2a - 4. Let l be o(3). Which is smaller: l or d? d Let u = 1.45 - 1.44. Which is greater: u or -1? u Let q be 0(2 + (-3)/1). Let r = 40 - 30. Is r at least q? True Let n(j) = -j*3 + 5j*2 + 5j + 6. Let h be n(6). Suppose h = 3a - 12 - 6. Suppose -a = 2g - 2. Is -4 < g? True Let z be (0 + 24/(-18))14/1. Is -20 at least z? False Suppose p - 2r = -4r + 8, -3p + r + 3 = 0. Suppose 3x = 2x + p. Suppose h = xh. Is h greater than or equal to 2? False Let h = 27.29 + 0.71. Do 1 and h have the same value? False Let z = 2/79 + 227/395. Let t = -17/20 + z. Which is smaller: t or 0? t Let h(r) = -2r*2 + 14r. Let u be h(7). Which is smaller: u or -5/7? -5/7 Let c(g) = g + 2. Let a be c(2). Let q(v) = v*3 + 6v*2 + 4v - 3. Let o be q(-5). Is a greater than o? True Let x = -11 - -15. Suppose 3l - 2 = xl. Let u = -20 - -97/5. Which is greater: l or u? u Let t be (-5394)/45 - (-1 + 0). Let k = -119 - t. Let v = -7 + 6. Which is bigger: k or v? k Let i be 2409/3465 + (3/(-5) - 0). Is 0 greater than i? False Let n(s) = -s - 15. Let z be n(-14). Is z <= -1? True Let k be (0 + (-2)/4)/((-9)/(-18)). Which is smaller: k or 2/113? k Suppose 2 = -y + 4q, 2q + 21 = 5y - 5. Let l(f) = f3 - 5f*2 - 6f + 1. Let s be l(y). Is s at most as big as -2? False Let v = 3 - 6. Suppose 3d - 4w = -2w - 6, -2w - 2 = d. Which is greater: d or v? d Let g be 0 + 6/82. Let t be 6/2 - 242/88. Is g bigger than t? True Let w = 1.8 - 2.8. Let n = 4 + -3.96. Let h = n - -0.06. Is w <= h? True Let i(u) = -u2 - 2u + 5. Let x be i(-4). Let b = x - 4. Is b greater than or equal to -8? True Let z(k) = 2k + 4. Let t(r) = -r + 1. Let o be t(-3). Let y be z(o). Which is bigger: y or 11? y Let f be (-18)/(-8) - 1/4. Suppose -fc - 3b - 2b + 12 = 0, -2c + 4b = 6. Let r be (-4)/(5*	{ "pile_set_name": "DM Mathematics" }
two letters picked without replacement from {m: 3, p: 3}? 3/5 Two letters picked without replacement from {y: 2, r: 3}. What is prob of picking 2 r? 3/10 Four letters picked without replacement from {n: 1, x: 4, s: 2, r: 1, h: 1}. What is prob of picking 2 h and 2 s? 0 What is prob of picking 2 r and 1 b when three letters picked without replacement from drdbrzbbibbbziz? 6/455 Two letters picked without replacement from msb. Give prob of picking 1 m and 1 b. 1/3 Calculate prob of picking 2 u and 1 d when three letters picked without replacement from jxjppduuxddup. 9/286 Calculate prob of picking 2 h when two letters picked without replacement from {u: 5, h: 5, y: 1, m: 4}. 2/21 Calculate prob of picking 1 m and 1 s when two letters picked without replacement from {i: 1, u: 3, x: 3, s: 9, m: 2, j: 2}. 9/95 Four letters picked without replacement from xxxxxfxxfxxxfxxxxx. What is prob of picking 3 x and 1 f? 91/204 Two letters picked without replacement from zthzthxzyaxataht. Give prob of picking 1 x and 1 z. 1/20 What is prob of picking 1 n and 2 h when three letters picked without replacement from {h: 2, z: 1, n: 2, v: 1, x: 1}? 2/35 Three letters picked without replacement from ooooooqoooyooo. What is prob of picking 2 o and 1 q? 33/182 What is prob of picking 1 z and 2 y when three letters picked without replacement from yzyzzyzz? 15/56 Calculate prob of picking 1 k, 1 f, and 1 i when three letters picked without replacement from {f: 7, k: 1, e: 3, h: 3, i: 5}. 35/969 Two letters picked without replacement from uuuvvuvvuu. What is prob of picking 2 v? 2/15 Calculate prob of picking 1 f and 1 j when two letters picked without replacement from fnnjfxfnjnxjnjxnnfn. 16/171 What is prob of picking 2 l when two letters picked without replacement from bxipexllp? 1/36 Calculate prob of picking 1 x and 3 g when four letters picked without replacement from qbggqbguqgqgxqgqgqxq. 14/969 Four letters picked without replacement from {l: 2, k: 3, a: 3, i: 2, v: 3}. What is prob of picking 2 k and 2 l? 3/715 Two letters picked without replacement from {o: 13, y: 1, u: 3}. What is prob of picking 1 y and 1 o? 13/136 Three letters picked without replacement from {v: 8, e: 4, h: 5}. Give prob of picking 1 v, 1 e, and 1 h. 4/17 Calculate prob of picking 1 n, 2 l, and 1 z when four letters picked without replacement from {z: 4, l: 3, n: 2}. 4/21 Two letters picked without replacement from eeq. Give prob of picking 1 e and 1 q. 2/3 Two letters picked without replacement from aewhhahehhwkxaehhh. Give prob of picking 1 h and 1 x. 8/153 Two letters picked without replacement from {c: 4, y: 8, q: 1, l: 2}. What is prob of picking 1 q and 1 l? 2/105 Four letters picked without replacement from ccycucycccuccycuyc. What is prob of picking 3 c and 1 u? 11/68 Four letters picked without replacement from {d: 4, p: 1, s: 4, z: 1, v: 7, c: 3}. What is prob of picking 3 c and 1 p? 1/4845 Three letters picked without replacement from {j: 6, w: 12}. What is prob of picking 3 j? 5/204 Three letters picked without replacement from {k: 3, u: 3, t: 2, q: 5}. What is prob of picking 1 u and 2 t? 3/286 Three letters picked without replacement from ppcpvvp. Give prob of picking 3 p. 4/35 What is prob of picking 1 w and 1 k when two letters picked without replacement from eweewerecrjjerk? 2/105 Three letters picked without replacement from kkkkyy. Give prob of picking 2 y and 1 k. 1/5 Two letters picked without replacement from ifofsofiffif. Give prob of picking 1 s and 1 i. 1/22 Three letters picked without replacement from {l: 3, w: 1, h: 3, s: 2, j: 2, g: 1}. Give prob of picking 1 h, 1 l, and 1 w. 9/220 Two letters picked without replacement from {r: 1, f: 1, z: 1, e: 6, d: 1, j: 3}. Give prob of picking 1 e and 1 d. 1/13 Calculate prob of picking 2 h and 1 e when three letters picked without replacement from {h: 4, m: 1, b: 4, e: 2}. 4/55 Calculate prob of picking 1 o, 1 y, and 1 e when three letters picked without replacement from oudyosde. 1/28 What is prob of picking 1 l and 1 r when two letters picked without replacement from frffqiqrfrrrfqflqr? 2/51 What is prob of picking 1 q and 1 e when two letters picked without replacement from {e: 2, q: 4}? 8/15 Two letters picked without replacement from oooooooookokkoo. Give prob of picking 1 k and 1 o. 12/35 Four letters picked without replacement from zebzvzzbzveezev. What is prob of picking 2 b, 1 e, and 1 z? 8/455 Four letters picked without replacement from {u: 6, o: 7}. Give prob of picking 4 u. 3/143 What is prob of picking 1 m and 3 z when four letters picked without replacement from {z: 3, m: 8}? 4/165 Three letters picked without replacement from nciifscb. What is prob of picking 1 f, 1 n, and 1 s? 1/56 Four letters picked without replacement from lggggggggggg. What is prob of picking 1 l and 3 g? 1/3 Calculate prob of picking 3 v when three letters picked without replacement from {v: 4}. 1 What is prob of picking 1 r and 2 o when three letters picked without replacement from {o: 17, r: 3}? 34/95 Calculate prob of picking 2 f when two letters picked without replacement from {w: 6, f: 2}. 1/28 Two letters picked without replacement from {s: 5, q: 6, z: 2}. Give prob of picking 2 z. 1/78 Calculate prob of picking 2 l when two letters picked without replacement from {l: 1, c: 2, e: 1, r: 1, o: 1, v: 1}. 0 Two letters picked without replacement from {x: 1, t: 1, v: 1, e: 2}. Give prob of picking 1 v and 1 x. 1/10 Calculate prob of picking 3 k when three letters picked without replacement from {d: 2, k: 6}. 5/14 Three letters picked without replacement from {v: 1, r: 1, c: 1, y: 3, k: 5, f: 1}. What is prob of picking 2 r and 1 y? 0 Calculate prob of picking 1 q and 3 y when four letters picked without replacement from {n: 1, u: 4, y: 5, s: 4, q: 3, i: 1}. 1/102 Two letters picked without replacement from {t: 3, z: 1, x: 1}. What is prob of picking 1 z and 1 x? 1/10 Two letters picked without replacement from {f: 1, p: 1, n: 1, b: 2, l: 2, j: 1}. What is prob of picking 1 p and 1 j? 1/28 Four letters picked without replacement from ccqqccccccc. What is prob of picking 3 c and 1 q? 28/55 What is prob of picking 1 d and 2 f when three letters picked without replacement from {j: 4, l: 1, d: 2, f: 4, x: 5}? 3/140 Two letters picked without replacement from {i: 1, g: 7}. Give prob of picking 2 g. 3/4 Three letters picked without replacement from zzllzlll. Give prob of picking 3 z. 1/56 Calculate prob of picking 3 b when three letters picked without replacement from bbbboqbbzoqzlqozhb. 35/816 What is prob of picking 3 p when three letters picked without replacement from {w: 1, p: 3, v: 1}? 1/10 Three letters picked without replacement from fqmoaffmmmfqwff. Give prob of picking 1 a and 2 f. 3/91 Two letters picked without replacement from {j: 1, w: 5, m: 1, y: 3}. What is prob of picking 1 j and 1 w? 1/9 What is prob of picking 2 e when two letters picked without replacement from {m: 6, e: 2}? 1/28 Two letters picked without replacement from ebgggeggqgqg. What is prob of picking 1 e and 1 q? 2/33 Calculate prob of picking 1 c and 1 o when two letters picked without replacement from eovcqvb. 1/21 Three letters picked without replacement from vvvvvovv. What is prob of picking 3 o? 0 Calculate prob of picking 2 h and 1 u when three letters picked without replacement from {h: 3, w: 6, d: 2, u: 5, r: 2}. 5/272 What is prob of picking 1 a and 2 l when three letters picked without replacement from {a: 4, u: 6, l: 5}? 8/91 Two letters picked without replacement from {t: 1, s: 1, z: 1, w: 1, l: 1}. Give prob of picking 1 l and 1 t. 1/10 What is prob of picking 1 z and 1 p when two letters picked without replacement from {e: 3, z: 3, p: 2}? 3/14 Calculate prob of picking 1 s and 1 u when two letters picked without replacement from {u: 1, e: 1, l: 5, v: 6, s: 2}. 2/105 Three letters picked without replacement from {h: 6, w: 4, d: 4}. Give prob of picking 3 h. 5/91 Calculate prob of picking 1 g and 1 x when two letters picked without replacement from {l: 1, x: 4, s: 2, g: 7}. 4/13 Two letters picked without replacement from {i: 1, q: 1, z: 1}. Give prob of picking 1 z and 1 i. 1/3 Calculate prob of picking 1 k and 1 m when two letters picked w	{ "pile_set_name": "DM Mathematics" }
1? (a) 0.1 (b) q (c) p a Let d = -5 - -3. Let p = -9.05 + 9. Let n = -0.05 - p. Which is the closest to d? (a) n (b) 3 (c) 4/3 a Suppose 0p = p - 4. Let q be 1 - (-3 + p + 2). Which is the nearest to -2/5? (a) 0.3 (b) 4 (c) q a Let k = 0.29 + -13.29. Let y = 13.2 + k. Let d = 1.8 + 0.2. What is the nearest to y in 1/5, d, 5? 1/5 Let t = 0.171 + 0.229. Let i = 0.3 + -0.8. What is the closest to 2/7 in t, i, 2/9? 2/9 Let i be (3/(-7))/(15/(-10)). What is the closest to i in 2/7, -3, -4? 2/7 Let j = -0.04 - 3.96. Which is the closest to 0? (a) -2 (b) -3 (c) j a Let l = -85 - -84.9. Let y be 2/5(-5)/(-7). What is the nearest to 2/5 in y, l, -5? y Let y be ((-4)/12)/((-5)/4). Let t = 2/105 + y. Which is the closest to t? (a) 1/3 (b) 3/5 (c) -3/5 a Let n = 24.6 + -25. Let m = 0.7 + -0.7. Which is the closest to m? (a) -0.2 (b) 2/7 (c) n a Let h = 73 - 149/2. Let z = 0.04 - -4.96. Let s = -0.1 + 1.1. What is the nearest to s in h, -1/5, z? -1/5 Let q = 0.19 + -0.29. Which is the nearest to q? (a) -10/3 (b) -0.5 (c) -5/4 b Let v be ((-31)/(-15) + -2)2. Let m = -0.23 + 0.43. Which is the nearest to m? (a) 3/4 (b) 3 (c) v c Let s = 0.2 + -0.4. Let g = -813/56 + 99/7. Which is the nearest to 2/7? (a) -3/4 (b) g (c) s c Let m = 0.2 - 0.7. Let q = 17 - 16.8. Which is the nearest to 1? (a) 5 (b) m (c) q c Let q be 6/(-2) + 3 - -4. What is the closest to -2 in q, -1, 3/2? -1 Let q = 17.1 + -13.1. Let h = 0.9 - 1. What is the nearest to h in -1/2, 0.4, q? -1/2 Let i = 2 + -1. Let f = 109 + 17. Let u be (-240)/f + (3 - 1). Which is the closest to i? (a) u (b) -3 (c) 3 a Let p(i) = -26i*3 - 2i*2 + i. Let d be p(1). Let h be d/(-12) + 2/(-8). Suppose 0 = 2q + h. Which is the nearest to q? (a) -4 (b) -4/3 (c) 5 b Let v = -4.914 + 0.014. Let l = v + -0.1. Let q = 2 + -1.8. What is the nearest to q in -0.2, -3, l? -0.2 Let u = -5 - -9. Let m(d) = -97d + 1. Let j be m(1). Let i be (-56)/ju/14. Which is the nearest to 1? (a) -2/9 (b) i (c) -0.1 b Let l be 28/(-2 - 3/(-2)). Let h = 282/5 + l. Which is the nearest to h? (a) 5 (b) -0.4 (c) -0.3 c Let n = 274 - 274.5. Let d = -0.2 + 0.3. Let m = 4 - 3. Which is the closest to m? (a) d (b) -3 (c) n a Let q = -33 - -31.95. Let j = -0.05 - q. Let g be (2/(-2))/((-1)/5). Which is the nearest to -1/4? (a) j (b) g (c) -0.5 c Let f = 85 + -82. What is the nearest to -1 in f, 16, 6/11? 6/11 Let x(g) = g + 6. Let u be x(-6). Let j(h) = -2h + 12. Let m be j(4). Suppose -2 = mo - 6. What is the closest to 1 in 0.5, u, o? o Let n = -0.5 - -1. Let y = -0.2 + n. Which is the closest to 0? (a) y (b) 0.1 (c) -2 b Let f = -124 + 120. Let h = -2 - -1.9. What is the closest to h in 5, f, -2? -2 Let r = -0.32 + -0.08. Let z be (8/(-20))/(14/10). What is the nearest to 1/4 in r, -1, z? z Let q be (58/(-20) - -3)-4. Which is the closest to 1/4? (a) 3/4 (b) -3 (c) q a Let x = 55/72 - 7/18. Let k = x - -1/8. Suppose -2y + y = 2q + 9, 2q + 3y = -11. Which is the closest to k? (a) 1/2 (b) 0 (c) q a Let o = -5.3 + 5. Let i = 0.7 - -0.3. Let z = i + -2. Which is the nearest to z? (a) o (b) 5 (c) -4/9 c Let f be -1 + 3 - 20/(-2). Suppose -2o + 0s + 1 = s, 3o + f = 3s. Let q = -0.1 + 0.2. What is the closest to q in o, 1/2, -2/7? -2/7 Let z = -1.5 - -0.5. Let x = 4 + z. Let i = -4 + x. What is the nearest to i in 5, 2, 0? 0 Let l be -14 + ((-28)/(-4) - -2). What is the closest to -2 in 0.5, -1, l? -1 Let r be 2(26/12 - 2). Suppose -16p + 9p = 21. Which is the nearest to r? (a) 0.4 (b) p (c) -3/4 a Let v be 1906/812/15. Let u = 190 - v. What is the closest to 0 in u, 0.3, 0? 0 Suppose 0q = 2q + 4u + 18, 0 = -5q + 5u + 15. Let p = -13 + 13.1. Which is the nearest to q? (a) 1 (b) -0.5 (c) p b Let h = 0.032 + 4.968. What is the closest to -1 in h, -3/8, 4? -3/8 Let b = -7/6 + 4/3. Let n be ((-4)/(-10))/(4 - 0). Let o = -153/2 + 463/6. What is the closest to o in n, 0, b? b Let k = 0.2 - 0.6. Let z = -0.2 + 0. Let m = -0.05 - 0.45. Which is the closest to -1? (a) m (b) k (c) z a Let w = -22 - -14. Let d = w + 9. Which is the closest to d? (a) -0.1 (b) 2 (c) -2/7 b Let d = 0.2 - 0.2. Let g = d + -1. Let r = -18 + 158/9. Which is the closest to g? (a) 1/5 (b) 2/5 (c) r c Let o = 30.8 + -34. Let t = -0.8 + o. Let j = 0.2 - 1.2. What is the closest to j in -1, t, -0.4? -1 Suppose -y + 15 = 4y. Let t be 52/(-72) + 2/4. Which is the closest to -1? (a) 1 (b) y (c) t c Let f be 20/8(-4)/(-65). Let l = -132 - -133. What is the closest to l in 4/3, -2, f? 4/3 Let k = -6 - -6.1. Let q = 570/11 - 52. Which is the closest to k? (a) q (b) 3 (c) -1/2 a Let f be 2 + 1 - (7 + 2). Let y be (-2)/6 + f/18. Let w = -1 + 0. Which is the nearest to -1/4? (a) y (b) 0 (c) w b Let o = 19 - 20. Let s(y) = -y3 - 6y*2 + 7y + 5. Let p be s(-7). What is the nearest to o in -3, p, 1/2? 1/2 Let u = -14 + 12. Let n be (-7)/12 - 2/(-8). Let l = -9.5 + 9. Which is the closest to u? (a) -5 (b) l (c) n b Let l be 168/(-30) - (-3)/5. What is the nearest to 0.2 in 0.1, 1/7, l? 1/7 Let b = 5 + -4.9. Let g = 5 + -3. What is the closest to -1/3 in g, b, 1/6? b Let u(c) = 2c - 6. Let h be u(3). What is the nearest to 2/11 in 3, h, 2? h Let x = -1/220 + 453/2860. Let u = 1 - 1. Let n = 86/549 - -4/61. What is the nearest to 0.1 in x, u, n? x Let p = 82/3 - 27. Let h = -23 + 40. Let j = -67/4 + h. Which is the nearest to 0.1? (a) 2 (b) p (c) j c Let c = -4 - -8. Let i = 0.34 - 0.24. What is the nearest to 3 in 0.4, i, c? c Suppose -6z + 5 = -z. Let y = -2 - z. Suppose -5x + 3j + 17 = 0, -3 = -5j + 2. Which is the nearest to 0? (a) -2 (b) x (c) y a Let n(i) = i3 - 17i*2 - 19i + 13. Let l be n(18). Which is the nearest to 2/3? (a) l (b) -0.5 (c) -1 b Let x be (-1)/(-2 - (-10)/3). Let r = 0.16 + -4.16. What is the closest to -0.1 in x, -2, r? x Suppose 5x + 12 = -3. Let a be 1/(-2) + x/(-6). What is the closest to 1/3 in -1, 2, a? a Let m be (2/16)/((-2)/4). Which is the nearest to m? (a) 2 (b) -4 (c) -8 a Let r = 5.15 + -0.15. Which is the nearest to 2/3? (a) -4 (b) r (c) -4/7 c Let v = -4 + 2. Let y = -10 + 9.6. Which is the closest to 0.1? (a) v (b) 0.1 (c) y b Let i = -0.83 - -0.13. What is the closest to i in -5, -0.2, -0.5? -0.5 Let u = 0.1 + 0.2. Let q = 1/50 + -53/150. Which is the nearest to q? (a) u (b) -2/5 (c) -0.2 b Let w = -30/7 - -34/7. Let k be (-1)/((-9)/6(-55)/(-15)). Which is the nearest to -0.1? (a) -0.1 (b) k (c) w a Let r = -83/140 - -1/105. Let s = r + 1/3. What is the closest to s in -4, -0.1, -3? -0.1 Let a = 0.09 + -0.19. What is the closest to -3 in 2/11, a, -0.4? -0.4 Let r = 3 - 5. Let b = -98 + 98.39. Let l = b - -0.01. What is the nearest to -0.1 in r, 2, l? l Let k = 20.1 + -20. What is the closest to k in 2/49, -0.4, 0.4? 2/49 Let w = -108 + 109. What is the closest to -6/7 in w, 3, 2? w Let f be 1/(-3) - (-66)/9. Let o = f + -2. Let v be o/60 - 2/(-8). What is the closest to 0 in v, -0.5, -4? v Let m = 5.342 - 0.042. Let v = 35 - 40. Let n = v + m. What is the nearest to -4 in n, 0, -0.4? -0.4 Let g = -179/1045 - 1/95. Which is the nearest to 0? (a) 0.5 (b) g (c) -0.4 b Let r(g) = 6g2 - 1. Let n be r(1). Let o(t) = 2t - 7. Let x be o(n). Let p = 0 - 0.1. Which is the closest to 0? (a) 0.3 (b) p (c) x b Let x(u) = -u*2 + 2. Let y be x(-2). What is the closest to -2 in -2/7, 0.4, y? y Let l = -16 - -17. Let t be l/(-3) - 1 - -2. What is the nearest to 0 in -0.3, -3, t? -0.3 Let s = -3062/87 + -120/29. Let m = s + 40. Let b = -3/8 - -1/24. What is the nearest to b in -2/21, m, 0.4? -2/21 Let v = -0.31 + 0.01. Let x(s) = -2s + 15. Let d be x(7). What is the closest to 0.1 in d, 2, v? v Let z = -0.3 - -0.1. Let t = 0.3 + z. What is the closest to t in -0.3, 0, -0.1? 0 Suppose m = -4m - 25. Let z(k) = -k3 - 5k*2 + k + 4. Let h be z(m). Let s be h + (-3)/((-9)/6). What is the nearest to s in -3, -1, 2? 2 Suppose -3t - 7t + 0t = 0. Let m be (-1)/(-4 - (-4)/2). Which is the nearest to t? (a) -4 (b) 5/4 (c) m c Let b = 30 - 31. What is the nearest to b in 4, 0.1, -0.4? -0.4 Let k be (5/25 + 11/45)/(-2). Which is the nearest to 1? (a) -5 (b) 3 (c) k c Let p = -5 - -2. What is the closest to -	{ "pile_set_name": "DM Mathematics" }
8 is divided by z? 28 Suppose 36j - 3726 = 28j - 61j. What is the remainder when 1509 is divided by j? 51 Suppose 5643 = 5f - 2z, 0 = 3f + 72z - 68z - 3417. Calculate the remainder when f is divided by 214. 61 Calculate the remainder when (561/(-6))/((-219)/75774) is divided by 96. 95 What is the remainder when ((-20)/36 - -1) + (-86060)/(-36) is divided by 92? 91 What is the remainder when 164 is divided by (-3 - 2) + (106/4 - (-18)/(-12))? 4 Let q = 49 - 16. Let z = -23 + q. Suppose z + 9 = r. What is the remainder when r is divided by 10? 9 What is the remainder when (150 + 6)(16/80 - 8/(-10)) is divided by 80? 76 Let i(u) = 505u*2 + 140u - 274. Calculate the remainder when i(2) is divided by 186. 166 Calculate the remainder when (2 - (-76)/(-12))-321 is divided by 116. 115 Let i(c) = 47c + 15. Let j be i(6). Suppose 2k = 73 + j. Calculate the remainder when k is divided by 63. 59 Let z(p) = -p3 + 28p*2 - 28p + 38. Calculate the remainder when 107 is divided by z(27). 8 Suppose -228 = -6u - 144. Let n(c) = 197c + 6. Calculate the remainder when n(1) is divided by u. 7 What is the remainder when 3/6-10 - -94 is divided by (-153)/(-3)((-18)/6 - -4)? 38 Let n be (-9)/((-63)/(-3430)) + -4. Let q = n - -516. Calculate the remainder when 60 is divided by q. 16 Let s(k) = -k*3 + 34k*2 - 41k + 283. What is the remainder when 209 is divided by s(33)? 0 Let d(a) = -559a3 - a2 - 3a - 1. Let l be d(-1). Suppose -4t = 5f - l, -5t = -2f + 3f - 679. Calculate the remainder when t is divided by 9. 0 Let z = 4807 + -1606. Calculate the remainder when 317 is divided by (-6)/(-10) - z/(-165). 17 Let m(q) = -26q + 55. Let z be m(2). Suppose 5x - 3d = 30 - 4, 5d = -zx + 2. Calculate the remainder when 234 is divided by x. 2 Suppose -39x - 30 = -41x. Let y = 12 + x. What is the remainder when (-2)/((-16)/654) + y/(-36) is divided by 41? 40 Suppose -f = 4i - 30, -8i - 3 = -5i. Let b(s) = -2s*2 + 2s - 11. Let l be b(-8). Let u = -55 - l. What is the remainder when u is divided by f? 32 Let k = 524 - 539. Let q = 4 - 1. Calculate the remainder when q is divided by (-5)/(-25)17 - (-6)/k. 0 Suppose 2a + 43 = -z - a, 0 = 3z + 3a + 105. Let m = 35 - z. Suppose f - m = 4v, -5f + 0v + 225 = v. What is the remainder when f is divided by 8? 6 Suppose 567300 = -20s + 82s. What is the remainder when s is divided by 64? 62 Suppose -5d - 161 + 631 = 0. Let a = d + -36. What is the remainder when a is divided by (-7 - 102/(-12))/(59/510)? 7 Suppose 3k - 62 = 163. Let p(d) = -3d - 15. Let j(v) = 2v + 7. Let i(y) = -5j(y) - 3p(y). What is the remainder when k is divided by i(-9)? 18 Suppose -5y + 881s = 877s - 308, -2y + 119 = -s. Calculate the remainder when 1 + -4(-223)/2 is divided by y. 55 Let r(g) = -24g. Let z be r(1). Let b = 43 + z. What is the remainder when b is divided by (-21)/4(-92)/69? 5 Let l(a) = 4460a*2 + 53a + 82. Calculate the remainder when l(-2) is divided by 110. 106 Suppose -23s - 1372 = -16s. Let p = s + 308. Suppose -4b + 134 = b + 4k, k + 94 = 3b. Calculate the remainder when p is divided by b. 22 Let d be -6((-10)/4)/5. Suppose 110v = -3v + 7797. Calculate the remainder when (-23)/v + 208/d is divided by 36. 33 Suppose -2n = o - 6, 4o + n + n - 48 = 0. Let q(f) = -f*3 + 15f*2 - 12f + 25. Suppose -5x + 50 = 5. What is the remainder when q(o) is divided by x? 8 Let r(q) = q - 5. Let z(k) = -42k - 249. Let i(y) = -3r(y) - z(y). What is the remainder when 111 is divided by i(-6)? 21 Let m(b) = -b2 - 26b + 39. Suppose -6s - 150 = 6. What is the remainder when m(s) is divided by 23? 16 Suppose -5026 = -27b + 1431 - 274. What is the remainder when 1596 is divided by b? 222 Let i be (-4)/30 - (-420852)/765. Let h = 557 - i. Calculate the remainder when 28 is divided by h. 0 Let w = -1627 + 1753. Calculate the remainder when w is divided by (3/15)/(1/55). 5 Suppose 0 = -7z + 491 + 1539. Let w = z - 223. Calculate the remainder when w is divided by 17. 16 Suppose -1445 = -5q - a, -4a + 11 = 31. What is the remainder when 64 is divided by q/16 - (31/(-8) + 4)? 10 Let i = 106 + 7. What is the remainder when 1029 is divided by i? 12 Suppose 0 = 37i - 22029 + 4491. Calculate the remainder when i is divided by 71. 48 Let g(m) = m*3 - 4m*2 + 5m + 3. Let h be g(3). Suppose j = h - 2. Suppose -3p + 5n = 2 + j, -2n + 2 = -2p. What is the remainder when 4 is divided by p? 0 Suppose -144 = -15k + 3k. Suppose 0 = -4v + 12, -d + 3v + k = -0v. Calculate the remainder when 204 is divided by d. 15 Let w(j) = 60 - 2j + 26 + j - 21. What is the remainder when w(5) is divided by 9? 6 Suppose a + 5 - 10 = 0. Suppose 0l = -aj + 2l + 67, -3j = 2l - 37. Calculate the remainder when j is divided by (88/16)/((-1)/(-2)). 2 Let c(k) = 13k - 101. Suppose -2g = 4n - 16, -3g - 4n + 27 = 1. What is the remainder when 70 is divided by c(g)? 12 Calculate the remainder when 4212 is divided by 222180/6555 - (-2)/19. 30 Let l(j) = 8j + 37. Let b be l(-10). Let f = 63 + b. Suppose 35 = o - 5c - f, -3o - 5c + 65 = 0. Calculate the remainder when o is divided by 8. 6 Suppose 3p - 174 = -5c, -3c + 115 = -3p + 1. Calculate the remainder when 44 is divided by c. 8 Let n(o) = -3o3 - 4o*2 + 2o + 13. Let d be -101/105. What is the remainder when n(d) is divided by 72? 62 Let x(n) = -12n2 - 281n - 22. Calculate the remainder when 286 is divided by x(-23). 7 Let m(q) = -2q + 6. Suppose 5f + 13 + 17 = 0. Let s = -239 - -273. Calculate the remainder when s is divided by m(f). 16 Suppose 8m + 163 = 1043. Suppose -547 = -5s + 2a, m = s - 0a - a. What is the remainder when s is divided by 20? 9 Suppose -670 = -6m + 662. Let c = m - 119. Let n = c - 61. Calculate the remainder when 123 is divided by n. 39 Suppose 3d - 2d = 37. Let u(c) = -20c - 7. Let f be u(-2). Suppose 39o - 1326 = fo. Calculate the remainder when o is divided by d. 36 Suppose 20y - 33 = 15y + 3b, 3y - 3b = 21. Suppose 9p - 5p - 81 = -t, 4t = 5p - 75. Calculate the remainder when p is divided by y. 1 Suppose 6s - 1769 = -1019. Calculate the remainder when s is divided by 10. 5 Let f(a) = -3a3 + 241a*2 - 80a + 101. Calculate the remainder when 475 is divided by f(80). 71 Let o be (408/10)/(-1(-26)/325). Let i = o - 402. Calculate the remainder when 430 is divided by i. 106 Let k = 43 + -24. Suppose -3l = -3d - 111, -l + 36 = -2d + 1. Calculate the remainder when l is divided by k. 1 Suppose 2b + 3a = 148, -3a + 133 = 4b - 163. What is the remainder when (-7 - -17)3(-236)/(-24) is divided by b? 73 Suppose -2g - 6j + 5j + 25 = 0, 3j + 3 = 0. Let i(z) = -23z + 50. Suppose -32q = -33q. Calculate the remainder when i(q) is divided by g. 11 Suppose -5t - 15 = -1085. Let s = 118862 + -118819. What is the remainder when t is divided by s? 42 Let n = -5705 - -3099. Calculate the remainder when (-76)/(-342) - (n/(-9))/(-2) is divided by 49. 47 Let m(p) = 38p3 - p2 + 27p - 27. What is the remainder when 97 is divided by m(1)? 23 Let o(h) = -10h - 16. Let s be o(-13). Suppose 0 = -7n - s - 194. Let k = n + 46. What is the remainder when 2 is divided by k? 0 Let k = -4102 - -4332. What is the remainder when k is divided by 50? 30 Suppose 36 = 6p - 0. Let b(i) = i2 - 2i + 10. Let m be b(p). Let q = -13 + m. Calculate the remainder when q is divided by 6. 3 Let z = -10177 - -12717. What is the remainder when z is divided by 4? 0 Suppose 5o - 32 = -3o. Suppose op - 71 = 33. Let c = 296 + -195. Calculate the remainder when c is divided by p. 23 Suppose 0 = 3u - 0u - 2s - 120, 0 = 3s. What is the remainder when u is divided by (-13)/(39/(-45)) + 9? 16 What is the remainder when (-741)/(-2) - 6/(-4) - 35/(-7) is divided by 72? 17 Suppose -2m + 803 + 181 = 3c, m + c = 490. What is the remainder when m is divided by 45? 36 Let p be 112 + 1/(-22/12). Calculate the remainder when p/1 + -34 + 34 is divided by 16. 13 Let i be ((-1)/2)/((5/(-5))/8). Suppose 0 = 3l + 12, -5l - 14 = -im - 2. What is the remainder when 12 is divided by 870/105 + (-3)/((-21)/m)? 4 Suppose 7 + 9 = 4c, -3f + 4c = -308. Let i = 10873 + -10841. Calculate the remainder when f	{ "pile_set_name": "DM Mathematics" }
r? 285 What is 400750 to the power of 1/10, to the nearest integer? 4 What is the cube root of 395965 to the nearest integer? 73 What is 137937 to the power of 1/6, to the nearest integer? 7 What is the third root of 13076029 to the nearest integer? 236 What is the square root of 50620 to the nearest integer? 225 What is the eighth root of 3241684 to the nearest integer? 7 What is 1103826 to the power of 1/4, to the nearest integer? 32 What is the tenth root of 4589936 to the nearest integer? 5 What is the tenth root of 175426 to the nearest integer? 3 What is the third root of 144279 to the nearest integer? 52 What is the square root of 1853557 to the nearest integer? 1361 What is 28952709 to the power of 1/2, to the nearest integer? 5381 What is 80814 to the power of 1/2, to the nearest integer? 284 What is the ninth root of 1052765 to the nearest integer? 5 What is 684743 to the power of 1/3, to the nearest integer? 88 What is 198212 to the power of 1/10, to the nearest integer? 3 What is 12353768 to the power of 1/2, to the nearest integer? 3515 What is 10829824 to the power of 1/3, to the nearest integer? 221 What is the third root of 169949 to the nearest integer? 55 What is the tenth root of 556033 to the nearest integer? 4 What is the square root of 9482665 to the nearest integer? 3079 What is 8358640 to the power of 1/2, to the nearest integer? 2891 What is the ninth root of 980868 to the nearest integer? 5 What is the third root of 412930 to the nearest integer? 74 What is 491384 to the power of 1/2, to the nearest integer? 701 What is the third root of 5666682 to the nearest integer? 178 What is 11717578 to the power of 1/4, to the nearest integer? 59 What is the square root of 127686 to the nearest integer? 357 What is the fourth root of 2314159 to the nearest integer? 39 What is 723504 to the power of 1/3, to the nearest integer? 90 What is 47651 to the power of 1/5, to the nearest integer? 9 What is 3975375 to the power of 1/2, to the nearest integer? 1994 What is the square root of 275422 to the nearest integer? 525 What is 2539 to the power of 1/2, to the nearest integer? 50 What is 6512210 to the power of 1/2, to the nearest integer? 2552 What is the cube root of 710703 to the nearest integer? 89 What is the square root of 12305036 to the nearest integer? 3508 What is 291079 to the power of 1/3, to the nearest integer? 66 What is the cube root of 13373890 to the nearest integer? 237 What is the third root of 865386 to the nearest integer? 95 What is 2170275 to the power of 1/10, to the nearest integer? 4 What is 5442998 to the power of 1/2, to the nearest integer? 2333 What is 258333 to the power of 1/10, to the nearest integer? 3 What is the cube root of 226032 to the nearest integer? 61 What is 11967783 to the power of 1/4, to the nearest integer? 59 What is the sixth root of 612691 to the nearest integer? 9 What is the third root of 16040093 to the nearest integer? 252 What is 2835 to the power of 1/6, to the nearest integer? 4 What is the third root of 4356340 to the nearest integer? 163 What is 325440 to the power of 1/3, to the nearest integer? 69 What is 360342 to the power of 1/7, to the nearest integer? 6 What is 504832 to the power of 1/4, to the nearest integer? 27 What is 13472640 to the power of 1/3, to the nearest integer? 238 What is 57148 to the power of 1/4, to the nearest integer? 15 What is the square root of 711277 to the nearest integer? 843 What is the square root of 1212266 to the nearest integer? 1101 What is 1106460 to the power of 1/2, to the nearest integer? 1052 What is the eighth root of 485779 to the nearest integer? 5 What is the square root of 1528564 to the nearest integer? 1236 What is the ninth root of 1117397 to the nearest integer? 5 What is the fourth root of 4340898 to the nearest integer? 46 What is the third root of 1078797 to the nearest integer? 103 What is 171784 to the power of 1/2, to the nearest integer? 414 What is 6464121 to the power of 1/8, to the nearest integer? 7 What is the ninth root of 3103487 to the nearest integer? 5 What is the ninth root of 571504 to the nearest integer? 4 What is the tenth root of 32928591 to the nearest integer? 6 What is the tenth root of 9925717 to the nearest integer? 5 What is 8609468 to the power of 1/8, to the nearest integer? 7 What is the square root of 91734 to the nearest integer? 303 What is the cube root of 26904074 to the nearest integer? 300 What is the sixth root of 17095270 to the nearest integer? 16 What is 84025 to the power of 1/6, to the nearest integer? 7 What is the square root of 29815 to the nearest integer? 173 What is 21787 to the power of 1/5, to the nearest integer? 7 What is 4893742 to the power of 1/4, to the nearest integer? 47 What is the fourth root of 338425 to the nearest integer? 24 What is the sixth root of 861595 to the nearest integer? 10 What is the seventh root of 584478 to the nearest integer? 7 What is the ninth root of 1958960 to the nearest integer? 5 What is the third root of 576248 to the nearest integer? 83 What is 187492 to the power of 1/3, to the nearest integer? 57 What is the third root of 3822827 to the nearest integer? 156 What is 19898705 to the power of 1/4, to the nearest integer? 67 What is the third root of 67509 to the nearest integer? 41 What is the cube root of 976040 to the nearest integer? 99 What is the fourth root of 560031 to the nearest integer? 27 What is the sixth root of 306096 to the nearest integer? 8 What is the tenth root of 116357 to the nearest integer? 3 What is the fourth root of 19889105 to the nearest integer? 67 What is 3337625 to the power of 1/9, to the nearest integer? 5 What is the sixth root of 1072067 to the nearest integer? 10 What is the third root of 186549 to the nearest integer? 57 What is the third root of 254624 to the nearest integer? 63 What is the third root of 4551443 to the nearest integer? 166 What is the third root of 444956 to the nearest integer? 76 What is the fifth root of 6928106 to the nearest integer? 23 What is 4900666 to the power of 1/4, to the nearest integer? 47 What is the square root of 6281286 to the nearest integer? 2506 What is 621779 to the power of 1/2, to the nearest integer? 789 What is 3085368 to the power of 1/3, to the nearest integer? 146 What is the cube root of 282931 to the nearest integer? 66 What is 442673 to the power of 1/3, to the nearest integer? 76 What is the third root of 122459 to the nearest integer? 50 What is 4376519 to the power of 1/9, to the nearest integer? 5 What is 2845170 to the power of 1/3, to the nearest integer? 142 What is the sixth root of 1755 to the nearest integer? 3 What is the tenth root of 5637637 to the nearest integer? 5 What is 6641000 to the power of 1/3, to the nearest integer? 188 What is the square root of 1697141 to the nearest integer? 1303 What is the tenth root of 221260 to the nearest integer? 3 What is the third root of 15601032 to the nearest integer? 250 What is the square root of 1900849 to the nearest integer? 1379 What is the cube root of 27063525 to the nearest integer? 300 What is the square root of 72442 to the nearest integer? 269 What is the third root of 13863626 to the nearest integer? 240 What is 4840871 to the power of 1/3, to the nearest integer? 169 What is the fifth root of 1781484 to the nearest integer? 18 What is the square root of 3467299 to the nearest integer? 1862 What is 931507 to the power of 1/3, to the nearest integer? 98 What is 666778 to the power of 1/4, to the nearest integer? 29 What is the ninth root of 47219 to the nearest integer? 3 What is the cube root of 158226 to the nearest integer? 54 What is the square root of 10655974 to the nearest integer? 3264 What is 1461650 to the power of 1/10, to the nearest integer? 4 What is the third root of 13542964 to the nearest integer? 238 What is the fifth root of 278448 to the nearest integer? 12 What is 1723374 to the power of 1/6, to the nearest integer? 11 What is 63274 to the power of 1/4, to the nearest integer? 16 What is the square root of 11491099 to the nearest integer? 3390 What is the square root of 299910 to the nearest integer? 548 What is 4723411 to the power of 1/2, to the neares	{ "pile_set_name": "DM Mathematics" }
*3 + 2u*2 - 1. Let v(x) = -r(x) - w(x). Let q be v(-1). Suppose q = 3h - 18. What is the units digit of h? 6 Let t = 5 + -3. Let n = 15 - 8. Let v = n - t. What is the units digit of v? 5 Suppose 66 = b + 2n, -4b + 0b - 2n + 258 = 0. What is the units digit of b? 4 Suppose -150 = -3f - 3q + 2q, 0 = -5f - 5q + 250. What is the tens digit of f? 5 Suppose -m - 2m + 60 = 0. Suppose m = 5t - 3t. What is the tens digit of t? 1 Let m(n) = -n + 11. Let c be m(7). Suppose cj = -3 - 13. What is the units digit of j/22 - (-312)/22? 4 Let z(w) = w3 + 12w*2 + 7w - 13. What is the units digit of z(-11)? 1 Suppose 4t + a - 5a - 424 = 0, -3a = 4t - 452. What is the hundreds digit of t? 1 What is the units digit of 64/1221/4? 8 Suppose -5w + 3w + 34 = 0. Let t(n) = 11n + 1. Let c be t(-1). Let f = c + w. What is the units digit of f? 7 Suppose -2u = -a - 15, 5a = u + 2a - 10. Suppose 0 = 3y - uy + 8. Suppose 3w = -o + 26, -yw = -w + 3o - 6. What is the units digit of w? 9 Suppose 320 = -8o + 10o. What is the units digit of o? 0 Let k be (-1 - 1)/(-2)-25. Let u = -14 - k. Suppose -31 - u = -3p. What is the units digit of p? 4 Suppose 5f - 5 = 245. Suppose 0 = 6p - p - f. What is the tens digit of (-53)/(-5) + (-6)/p? 1 What is the units digit of 32/(-48) + (-22)/(-9)15? 6 Let d = -40 - -73. What is the units digit of d? 3 Let s(v) = -v2 - 14v - 3. Let k = 6 + -17. What is the tens digit of s(k)? 3 Suppose 5x = -0x - 10. Let l = x - -25. What is the units digit of l? 3 Suppose 2g = -4n + 130, 5n + 5g - 130 = 45. Let x be (n/(-2))/(-2 + 1). Suppose y - 2a = 5y - 30, -y + 4a - x = 0. What is the units digit of y? 5 Let p = -5 + 4. What is the units digit of 3 + 0 + 3 + p? 5 Let l be (3 + (-36)/8)-6. Suppose -h + l + 18 = 0. What is the tens digit of h? 2 Let f(y) = y*3 - 6y*2 - 7y + 10. Suppose 10x = 7x + 21. What is the tens digit of f(x)? 1 Let b(n) = -n*3 - 2n*2 + 5n + 4. Let h = 3 + -6. Let z be b(h). What is the units digit of (z - -1)28/(-2)? 4 Let d(a) be the second derivative of a5/60 + a4/3 + 2a3/3 + a2/2 + 2a. Let l(p) be the first derivative of d(p). What is the units digit of l(-8)? 4 Suppose 0 = -2j + 9j - 336. What is the tens digit of j? 4 What is the units digit of ((-2)/6)/(1/(-6))? 2 Let o = -12 - -17. Suppose p - 4l = 4 - 2, -op + 95 = -3l. What is the units digit of p? 2 Suppose 3z - 4f + 36 = 0, 3f - 23 + 0 = 2z. Let h(a) = a*2 + 13a - 17. What is the tens digit of h(z)? 3 Suppose 4j + 73 = 3l, -5l = 2j - 0j + 69. Let c = j + 33. What is the units digit of c? 1 Let a(d) be the second derivative of d4/12 + 3d*3/2 + 3d*2/2 + 5d. What is the units digit of a(-9)? 3 Let s(x) = -x*3 + 13x*2 - 11x - 5. What is the tens digit of s(9)? 2 What is the tens digit of 2/5 - (-58)/5? 1 Let b = 103 + 51. What is the units digit of b? 4 Let i(j) be the first derivative of j*2/2 - 4j - 3. Let k be i(4). Let h = k - -5. What is the units digit of h? 5 Let f(z) = z3 - z2 + 4z + 56. What is the units digit of f(0)? 6 Let w(h) = -3h + 1. Let x be w(-2). Let d(g) = -8g + 1. Let c(a) = a + 1. Let y(z) = -6c(z) - d(z). What is the units digit of y(x)? 7 Suppose -3s + 2q = 10 - 34, 2q = 6. Let r be (-3)/(-2)-1s. Let z = r + 24. What is the units digit of z? 9 Let b(q) = -q2 - 9q - 5. Let j be b(-5). Let r = -9 + j. What is the units digit of r? 6 Suppose 3k - z = z + 81, -z = 3. Let c be (-18)/10 - 5/k. What is the tens digit of (11 - 3 - c) + 0? 1 Let i be -2 + 5 + (0 - 2). Let m(c) = 34c + 2. What is the units digit of m(i)? 6 Let l be 160/90 - (-2)/9. Suppose 0 = n - l - 0. What is the units digit of n? 2 Let p(y) = y*3 + y - 32. Let f be p(0). Let i = 15 + f. Let t = i - -25. What is the units digit of t? 8 Suppose -3y + 0 = -78. Let q(d) = d*2 + 2d - 1. Let x be q(-5). Let r = y - x. What is the tens digit of r? 1 Let p = 56 - 32. What is the units digit of p? 4 Suppose 3 = 2o - 1. Let i be (-2 - -6)/o + 3. Suppose -5n + 50 = 5j, 0 = ij + 3n - 2n - 30. What is the units digit of j? 5 Let n = 6 + 1. Let u = 10 - n. What is the units digit of u? 3 Let c = 10 - 6. Let d = c + 10. What is the units digit of d? 4 Let f be (-1)/(6/8 - 1). Suppose 0 = fm - 2m. Suppose 4t + 4a - 24 = m, 0 = -5t + 4a + 42 + 33. What is the units digit of t? 1 Let c(i) = 3i + 25. What is the tens digit of c(14)? 6 Let g(f) = 4f*2 - 10f + 12. What is the tens digit of g(5)? 6 Let t(z) = 26z - 2. Let h(f) = -26f + 3. Let x(i) = -4h(i) - 5t(i). What is the tens digit of x(-1)? 2 What is the tens digit of (12/24)/((-2)/(-172))? 4 Suppose 2b + z - 10 = -27, b - z + 7 = 0. Let p = 19 + b. What is the units digit of p? 1 Let l(i) = 331i*2 + 13i - 14. What is the hundreds digit of l(1)? 3 Let k(r) = r + 4r - 3r. Let y be k(1). Suppose 0 = yg - g - 11. What is the tens digit of g? 1 Let g(a) = a3 + 7a*2 - a - 3. Let r be g(-7). Suppose rs - 30 = -s. What is the units digit of s? 6 Suppose -g - 3 = 1. Let l be 1 + g - (-9 + -4). What is the units digit of (-16)/l(0 - 5)? 8 Let d = 64 + -35. Suppose 0 = j - 2j + d. What is the tens digit of j? 2 Let k = -192 + 331. What is the hundreds digit of k? 1 Let h = 55 + -52. What is the units digit of h? 3 Let u(b) = -4b - 10. Let m be u(-7). What is the units digit of ((-3)/(-2))/(m/48)? 4 What is the units digit of -1(-2 + -3)3? 5 Let a = 4 - 0. Suppose 5z - ai = 167, 3z - 2i + 5i - 84 = 0. What is the units digit of (-2)/(-8) - z/(-4)? 8 Suppose -2v + 40 = 2v. Suppose -66 = -vy + 4y. What is the tens digit of y? 1 Let h be (6/(-3))/((-1)/(-2)). Let n(a) = -a*3 - 5a*2 - 3a + 5. What is the units digit of n(h)? 1 Let u(d) = d - 5. Let i be u(6). Suppose 3o = -5w - i, 0w - 4 = 2w. What is the units digit of o? 3 Let h = -24 - -74. What is the tens digit of h? 5 Let l be -1 + -1 + 15-2. What is the units digit of -15/(20/l)? 8 Let a = 23 + -1. What is the units digit of a? 2 Let h be (-1 + 2)/(3/(-45)). Let l = 23 + h. What is the units digit of l? 8 Let k(f) = f*3 + 6f*2 - 7f - 8. Let r be k(-7). Let i(h) = h + 2. Let x be i(r). What is the units digit of ((-4)/(-3))/((-4)/x)? 2 Let i(m) = m + 4. Suppose 5k - 3 = -j + 23, 2 = k - 3j. What is the units digit of i(k)? 9 Let d(y) = y*3 - 8y*2 - 11y + 12. Let k be d(9). Let l(m) = m*3 + 6m*2 - m + 1. Let a be l(k). Suppose 3 + a = w. What is the units digit of w? 0 Suppose 0 = 4q - 0 + 4. Let w be (-2 - (q - 0)) + 1. Suppose -20 = -4a - w. What is the units digit of a? 5 Let x(a) be the first derivative of a3/3 - a2 - a + 2. What is the units digit of x(4)? 7 Let a(b) = -b3 + 6b*2 - 4b. What is the units digit of a(4)? 6 Let y(q) = -10q. Suppose 4p - 2c = c - 2, -2p - 4c = 12. Let a be y(p). What is the units digit of 2/5 - (-152)/a? 8 Let k(x) = -3x + 20. Let g(h) = -5h + 30. Let v(t) = -5g(t) + 8k(t). Let m be v(-7). What is the tens digit of (1 - (m + 19))/(-1)? 2 Let l(i) = -i2 - 7i + 1. Let t be l(-6). Suppose 5f + c - 2c = 46, 2 = -2c. Suppose 4g - f = t. What is the units digit of g? 4 Let k(w) = w*3 + 14w + 2w2 - 2w*2 - 8 - 12w*2 - 7. What is the tens digit of k(11)? 1 Let n = 7 - 5. Let z(i) = 3i + 1. Let j be z(n). Suppose -3p + j = -5. What is the units digit of p? 4 Suppose -3t + 6 = -4n + 15, -5t = 3n - 14. Suppose t = -h - 0h + 3z, 2h + z = 26. What is the units digit of h? 1 Let u be (-718)/(-14) - (-4)/(-14). What is the units digit of (-3 + u/9)12? 2 Let z = 9 + -11. Let k(w) = -13w - 3. What is the units digit of k(z)? 3 Let r(h) = h*3 - 9h*2 + 8h - 6. Let i be r(8). Let x = i - -8. Suppose -k + 5k - 5b - 41 = 0, 2b + x = 0. What is the units digit of k? 9 Suppose 0 = g + 2. Let d(b) = b3 + 3b*2 + 2b. Let l be d(g). What is the units digit of (-2 - l - -3)2? 2 Suppose 34 = -4q - p + 187, p = 3q - 113. Suppose -4f - 34 = 3l + 31, -3f + 3l = 54. Let k = q + f. What is the tens digit of k? 2 Suppose -2n + 4j + 129 = -115, -326 = -3n - 2j. What is the hundreds digit of n? 1 Suppose 37p = 34p + 90. What is the tens digit of p? 3 Let o(y) = -9y - 8. What is the tens digit of o(-3)? 1 Suppose -7 - 9 = 4j. Let x(c) = c*2 + c - 3	{ "pile_set_name": "DM Mathematics" }
) = 5 - s + 2l2 - 7l2 - 2. Calculate p(-1). -4 Let k be 11 + (-2 - 4) + (-21)/(-3). Let x(i) = -i3 + 11i2 + 14i - 16. What is x(k)? 8 Let j(k) = -10k3 + 16k*3 - 1 + 476k*2 - 476k*2 - 2k. Suppose 4v = v - 3g + 9, 3v - 2g = -11. Give j(v). -5 Let h be (-80)/(-50) - (-8)/(-5). Let n(j) = j3 + j2 - 14. What is n(h)? -14 Suppose -14 = -4z + o + 2, 2o = z - 4. Let d(n) = 6 + n*2 - n - 4 + zn. Suppose -8y - 309 = -269. Give d(y). 12 Let v(p) = -8p*2 + 23p - 7. Let o(g) = 3g2 - 8g + 2. Let z(a) = 11o(a) + 4v(a). Let i(u) = u*2 + 26u + 155. Let k be i(-10). What is z(k)? -1 Suppose 2c + 2c = -3k - 18, -3k - 3c - 18 = 0. Let r(p) be the second derivative of p4/12 + p3 + p2 - 207p. Give r(k). 2 Let n(g) = -g*2 - 5g - 1. Suppose 0 = -9b + 7b, 4c + 3b - 56 = 0. Suppose -5m - 19 - c = 2h, -4h - 16 = 0. What is n(m)? -1 Let b(t) = -109t*2 + 18t - 49. Let w(z) = -78z2 + 12z - 33. Let a(v) = -5b(v) + 7w(v). Determine a(-6). 14 Suppose -183x + 194x = 44. Let f(c) be the first derivative of -3/2c2 + 1 - 4c + 1/3c3. Calculate f(x). 0 Let j(n) be the third derivative of -1/120n*5 + 0n - 4n2 + 2/3n*3 + 1/12n4 + 0. Let s(r) be the first derivative of j(r). Give s(7). -5 Let o(f) = -f3 - 9f2 + 10f + 1. Suppose 0 = -0v + 3v + 30. Let z be o(v). Let a(t) = z + 10t + t2 - 8t + 0t2. Calculate a(-1). 0 Let k(v) = v2 + 3v + 2. Let h be k(-3). Let j(z) = -5 + 3z2 + 0z + 9 - z*3 + z - hz*2. What is j(0)? 4 Let k = 0 + 0. Suppose -3j + b + 24 = -2, -5b = -j + 32. Let h(m) = -5m*2 + 15. Let s(a) = -3a*2 + 8. Let l(p) = js(p) - 4h(p). Determine l(k). -4 Suppose 39m - 8 = 47m. Let c(f) = 12f*3 - 2f - 1. Determine c(m). -11 Suppose 3s + q - 1 = 0, 0s - 2s - 21 = 5q. Let i(k) = -371 + 2k + 2k + k*s + 367. Calculate i(-4). -4 Suppose -3v = -v - 4l + 34, -4v - 18 = 2l. Let q(f) = 10f*3 - 13f + 9. Let k(z) = -7z3 + 9z - 6. Let w(t) = vk(t) - 5q(t). Give w(2). -7 Let f(y) = -8y - 15. Let o(s) = -4s - 15. Let l(a) = -3f(a) + 4o(a). Determine l(3). 9 Let s(v) = v + 4. Let k be 2/10 - (-28)/10. Let f(m) = 2 + k + 6m + 0 - 5m. Let h(l) = 4f(l) - 5s(l). Give h(0). 0 Let g = 89 - 37. Let p = -51 + g. Let d(s) = 5s2 - 1. Give d(p). 4 Let q(g) = g + 9. Let r be (2 - 1) + -17 + -2. Determine q(r). -9 Let a(z) = -z3 - 3z*2 - z + 2. Let t = 69 + -61. Suppose 6h = th + 4. Determine a(h). 0 Suppose 0 = 7s + 5s + 48. Let t(c) be the second derivative of -4c3/3 + c2/2 - c. Let u(q) = 15q - 2. Let z(p) = su(p) - 7t(p). Calculate z(1). -3 Let i(x) be the third derivative of x5/60 + 5x4/24 - x2. Let n(r) = -r*2 - 7r - 14. Let p be n(-7). Let g(z) = -z - 17. Let w be g(p). Determine i(w). -6 Suppose -2d - 35 + 9 = -2r, 4d - 29 = -5r. Suppose -o - 17 = -5x, 5x + o = -2o + r. Suppose xb + 5 = 29. Let t(q) = q - 3. What is t(b)? 5 Let g(z) be the third derivative of -z6/120 - z5/30 + z*4/24 + 4z*2 + 2. Give g(-2). -2 Let d = -1583 - -1580. Let a(w) = 3w2 - w3 + 4 + 2w + 0w*3 + 2w*3. What is a(d)? -2 Let x be 42/240 - (4 - (-93)/(-24)). Let r(n) be the second derivative of 1/3n*3 - xn*5 - 1/2n*4 + 3n2 - n + 0. Give r(-6). -6 Let v(g) be the first derivative of -g6/90 + g*5/40 - 46g*3/3 - 51. Let q(m) be the third derivative of v(m). Calculate q(2). -10 Let b(j) = j. Suppose 5h - 17 + 2 = 0. Let d(p) = p*2 - 5p - 5. Let v(n) = hb(n) + d(n). What is v(5)? 10 Let y(t) = 2t*2 + t. Let g(q) = -q + 8. Let z(i) = i - 8. Let o be z(7). Let u be (o/3)/((-2)/42). Let k be g(u). Calculate y(k). 3 Let n(x) = 2x*3 - 4x*2 + 5x - 4. Let c be n(2). Let i(d) = -d*2 + 8d - 11. Let m be i(c). Let v(f) = -8f2 - 1. Determine v(m). -9 Suppose 3x - 27 = 2y, 0 = 4x - 3y - y - 36. Let z(b) = 11 - 11 + xb. Calculate z(1). 9 Let i be ((-4795)/45)/7 - (-8)/36. Let x(o) = 2o + 23. What is x(i)? -7 Let f(y) be the first derivative of -y2 + 6y + 103. Give f(7). -8 Let x(y) be the second derivative of y*2/2 - 75y. Let f(h) = 4h + 2h - 1 - 5h. Let a(g) = -f(g) - 3x(g). Determine a(-4). 2 Let q be (2/(-4))/(3/12). Let t(l) = -l - 2. Let g be t(q). Suppose -10 = -gw + w - 3o, -4o + 8 = 0. Let c(z) = -z - 4. What is c(w)? 0 Let p(c) = c2 + 8c + 10. Let f(v) = -v*2 - 7v - 4. Let u be f(-3). Suppose -20 - u = 4q. Give p(q). 3 Let i(m) be the third derivative of m6/120 - 2m5/15 - m4/3 + 2m3/3 + 128m2 - 2. What is i(9)? 13 Let p(f) = f3 - 10f2 + 8f + 10. Let t = -99 - -99. Suppose t = 4w - 2w - 4m - 26, 49 = 5w - 2m. Calculate p(w). 1 Let y(s) = -9s*3 - 2s*2 + 1. Let k be -1 + 4/10 + (-8)/(-5). Determine y(k). -10 Let i(v) = 5v*3 + 20v*2 - 15v + 2. Let o(j) = 4j3 + 18j*2 - 14j + 2. Let w(n) = -5i(n) + 6o(n). Calculate w(7). -12 Let i(a) = a*3 - 4a*2 - 7a + 10. Let o be i(5). Let p(n) = -2 - 2 + 184n + o - 183n. What is p(10)? 6 Let l(v) be the first derivative of v*4/4 + 2v3 - v2 - 6v + 141. What is l(-6)? 6 Let v be 13 - 5 - 8/4. Let y(u) be the first derivative of -u4/4 + 5u*3/3 + 7u*2/2 - 3u + 3. What is y(v)? 3 Let y = -30 + 32. Let w(z) = 11z2 - 6z*2 - 2z - 1 - 12zy. What is w(-2)? -25 Let h(t) = -2t + 1. Let a be h(-1). Let z(j) = -j*2 + 3j - 2. Give z(a). -2 Let l(c) = -c*3 + 6c*2 - c + 2. Suppose 3 = 2y + 3t - 7, 4t + 20 = 4y. Let d(b) = -2b + 2 + 5 - y + 7b2 - 1. Let k be d(1). What is l(k)? -4 Let j = 766 - 761. Let x(p) = 7p + 7. Calculate x(j). 42 Let w be -8(-3)/61. Suppose i - 2 = -8. Let u(y) = -5y - 2. Let l(v) = 4v + 3. Let s(n) = il(n) - 5u(n). Calculate s(w). -4 Let l(u) = 30u + 4 - 69u - 5 + 52u. Give l(-1). -14 Let g(v) = v3 + 3v*2 - 4v. Suppose 3q - q = 18. Let j = 5 - q. Calculate g(j). 0 Let m(j) be the second derivative of -j2 + 3j - 1/6j3 + 0. Calculate m(0). -2 Let p = -1163 + 1163. Let h(y) be the second derivative of 7/6y*3 - 8y + p + 3y2 + 1/12y*4. Determine h(-4). -6 Let w(d) be the second derivative of -4d*3/3 + 51d*2/2 + 7d + 5. Calculate w(7). -5 Let i(l) = -l*2 - 9l - 8. Let j = 54 - 50. Suppose -4y + 2y - 22 = 2g, -jg + 5y - 8 = 0. Give i(g). 6 Suppose -3g + 2v + 20 = 1, -3g - 4v + 25 = 0. Let j(a) = 14a - 8. Let b(k) = -14k + 7. Let l(c) = gb(c) + 6j(c). What is l(1)? -13 Let m be 3/(-7) - 786/(-21). Suppose 0 = x - 4h - 3 - 11, -2x - m = 5h. Let u(g) = -g*3 - 6g2. What is u(x)? 0 Let b(p) = p3 + 4p2 + 3p + 10. Let g be b(-4). Let j(y) = 5y + 1. Give j(g). -9 Let q be -3 + 161/49 - 132/(-28). Let i(v) be the second derivative of -v5/20 + v4/3 + 2v*3/3 - 7v*2/2 - 18v. Determine i(q). -12 Let a be (-5)/(-3) - 1/(-3). Suppose -q = -5l - 11, 4l + 1 + 3 = aq. Let p = -8 - l. Let m(d) = -d - 5. Calculate m(p). 0 Let l(q) = q3 + q2 + 2q + 40. Let o be 7 - (616/(-11))/(-8). Give l(o). 40 Let c(q) = -2 - 2q + 7 + 6q - 6. Let x(k) = -k2 - k - 1. Let z be x(0). Calculate c(z). -5 Let w(v) be the second derivative of v3/6 - v*2/2 + 5v + 2. Calculate w(4). 3 Let z(c) = 23 - 15c + 42 - 60 - c2. Calculate z(-15). 5 Let r(h) be the first derivative of 5h3 - h2/2 - h - 2. Suppose -l - l = 2. Determine r(l). 15 Let s(f) = -8f - 4. Let k(x) = -2. Let r(o) = -o + 4. Let d(b) = 2k(b) + r(b). Let u(a) = 3d(a) - s(a). What is u(3)? 19 Let f(g) = -2g + 1. Let l(q) = -q + 1. Let o = 29 + -24. Let d(h) = ol(h) - 3f(h). Let i(u) = -2u + 5. Let b be i(5). Calculate d(b). -3 Suppose -4n = -11n - 42. Let l(y) = 1 - 2 + 6 + 9y + y2. Calculate l(n). -13 Let i(x) be the third derivative of x5/40 - x*4/12 + 11x*3/6 - 5x2 + 1. Let s(w) be the first derivative of i(w). Let h = 1 + -3. Determine s(h). -8 Let b(h) = -h2 - 8h - 8. Suppose 10 = 4a + a. Suppose -3v + av = 7. Determine b(v). -1 Let c(t) = -t*2 - 2t - 1. Let d = 26 - 22. Let r be (6/12)/((-1)/d). What is c(r)? -1 Let u(c) = -c*3 + 16c*2 - 16c + 17. Let y be u(15). Let b(o) = -17 - 1 + 4 - yo + 8. Let n = -6 + 2. What is b(n)? 2 Suppose 1514v - 1530v - 96 = 0. Let u(f) be the third derivative of -f6/120 - f5/12 + 3f*4/8 + 7f*3/6 - 2f*2. Calculate u(v). -11 Suppose 5k - 2w - 69 = 0, k = -3k - 2	{ "pile_set_name": "DM Mathematics" }
x = -4x - 16, 0 = 5v + 5x - 5 for v. -4 Solve 2q = 1 + 5, -2h = 4q - 14 for h. 1 Solve -8m - 3g = -5m + 9, 35 = 5m - 5g for m. 2 Solve 8y - 10y - 5q - 17 = 0, 4y = -q + 11 for y. 4 Solve z = 3d + 18, 10d = 12d + 12 for z. 0 Solve -4a + 3a = -4p + 24, a = 5p - 29 for a. -4 Solve -3d - 69u - 18 = -72u, 5u = 4d + 26 for d. -4 Solve -12u + 17u - 20 = 5q, u - 5 = 0 for q. 1 Solve -4d + 2 - 10 = 0, x + 3d = -6 for x. 0 Solve 4n - 5 + 0 = m, -3m - 2 = n for n. 1 Solve 2y - 6 = -z, 161z - 156z = y + 19 for y. 1 Solve 5c - 2 = 3r, 2c - 153 + 141 = 4r for r. -4 Solve -2d - 3d + 6 = -2f, 4d + 2f = 12 for d. 2 Solve 3c - 4c + 9 = -2h, 14 = -4c - 2h for c. -1 Solve -b + 1 = z, -137b - 16 = 5z - 139b for z. -2 Solve 3k = 5n - 25, k - 2n - 16 = 5k for k. -5 Solve 0 = -5k + 2z + 23 - 43, -4z = -k - 4 for k. -4 Solve -3s - 11 = 5b - 15, 35 = -5s for b. 5 Solve -6 = 5i - 1, 0 = q - 2i - 2 for q. 0 Solve 3c - 1 = 5l, c = -4c - 15 for l. -2 Solve i - s = 3, -3i + 8s - 6s + 8 = 0 for i. 2 Solve 3d + 5b + 3 = -2, b = -4d - 1 for d. 0 Solve 3 = 3l - 5g + 10, -3l + 3g - 9 = 0 for l. -4 Solve 127b = 130b - 6, 5b + 5 = 3u for u. 5 Solve -5x = -3a - 34, -43x - 5a = -40x for x. 5 Solve 4z + 4j = 28, -3z - 5j + 31 - 6 = 0 for z. 5 Solve 3q - 5i = 25, -3i - 6 = -2q + 10 for q. 5 Solve 5f = -3h - 11, -20 = -0h - 4h + 2f for h. 3 Solve 2h + 17 = 3i, -3h = -3i - 2 + 20 for i. 5 Solve 69w - 72w - 2i + 20 = 0, 3i = w + 8 for w. 4 Solve 5b - 20 = 0, -2o + b - 6 = -0b for o. -1 Solve 3p - 15 = -3v - 24, 3 = -v - 5p for v. -3 Solve -4b - 92 = 3d - 81, -5d - 2b - 23 = 0 for d. -5 Solve -2d + 4 = -z - 1, 2d + 2z - 14 = 0 for d. 4 Solve 3x + 3 + 21 = 5c, -x - 3 = 0 for c. 3 Solve 4 = 4t - 2m, -36m + 41m + 24 = -4t for t. -1 Solve 0 = 5t + m - 0m + 24, -5t + 5m = 0 for t. -4 Solve -4v - 15 = -2d + 9, 0 = -3v - 3d for v. -4 Solve 30 - 39 = 3m, 2f = m + 7 for f. 2 Solve 2p + 6 = v, -3v + p + 17 = -4p for v. 4 Solve 5o - 9 + 7 = -3c, -o - c = 0 for o. 1 Solve 0 = 5l - 3t - 3, 7l - 3 = 5l + 3t for l. 0 Solve 0 = u - 2g - 55 + 56, 2g = 3u - 5 for u. 3 Solve 0 = 2d - 5j - 41, -d = -j + 3 - 13 for d. 3 Solve l + 0h + 4h + 7 = 0, -l + 4h = -9 for l. 1 Solve -4c + 10 = 2k, -3c + 4k + 0k = -2 for c. 2 Solve -4q - n + 2 = q, 2q - 2n + 4 = 0 for q. 0 Solve g + 3l - 2 - 1 = 0, 0 = 3g - 3l + 3 for g. 0 Solve 8 = 5l + 5q - 37, l + 5q - 25 = 0 for l. 5 Solve 5 = -m, -3m = -i + 2m + 22 for i. -3 Solve -i - 5q - 30 = -0i, -3q = 3i + 30 for i. -5 Solve -3f = -3x + 39, 2f + 1 - 5 = -4x for x. 5 Solve s = -5a, 3s - 27a = -22a for s. 0 Solve -5r + 7r - 4q = 10, 20 = 4r + 2q for r. 5 Solve 10w - 7w - 10 = c, -5c + 30 = 5w for w. 4 Solve -3k - 8 = 5q - k, q - 8 = 2k for q. 0 Solve -4i = 91 - 111, 4i - 8 = -4u for u. -3 Solve 1 = -2a - b, 4b = -2a + 3a + 5 for a. -1 Solve m = -m + p + 4, 4m + 5p = 8 for m. 2 Solve 2i - 3k + 13 = -3i, 3i + 9 = 3k for i. -2 Solve -h = 3b + 8, -14b + 4h = -17b + 4 for b. -4 Solve 5j = -3k + 8 + 21, 11 = 2j + k for j. 4 Solve -i + 3n + 0 = 3, 4i - 5n = -5 for i. 0 Solve -12n = -3w - 14n - 2, 4 = 3w + 5n for w. -2 Solve -5k - 19 + 0 = 4n, -4n = 4k + 16 for k. -3 Solve 0p + 8 = 3z - 2p, 2z + 2 = 5p for z. 4 Solve -5j = 3u - 5u + 16, 0 = 5j + 10 for u. 3 Solve 3 = f + 64a - 68a, f + 3a = -11 for f. -5 Solve 0 = -3g + 2r + 4, -10g - r = -14g + 12 for g. 4 Solve 17q - 13q + 5w + 6 = 0, 3w + 10 = 4q for q. 1 Solve -2y = 4j - 20, 18j - 14j = 12 for y. 4 Solve 14 = 3y + o, 6o = -5y + 4o + 25 for y. 3 Solve 4c + 15v - 17v = 10, -2c + 3 = v for c. 2 Solve -t - 4d + 4 + 12 = 0, 20 = 5d for t. 0 Solve 0 = -3o + 15, 2h + h + 5 = o for h. 0 Solve -5k = -5t - 10, -5k - 2t - 2 = -t for k. 0 Solve 3t + 10 + 5 = w, 0 = 5t + 25 for w. 0 Solve 5 = 4v + 3k, 5k + 11 + 4 = -2v for v. 5 Solve -v = 2d - 2, -2d + d + 5v = 10 for d. 0 Solve 0 = q - 5y - 7 - 9, 0 = -5q - 3y - 32 for q. -4 Solve 0 = -5t + 5p - 10, -4t + 3p - 43 + 39 = 0 for t. 2 Solve 4 = -2j - 4u, -5u = 3j + 3 + 2 for j. 0 Solve 3 = 3p, 9p - 6p = -4s + 19 for s. 4 Solve 2r + 35 - 30 = 5p, -p = -r - 1 for p. 1 Solve 12 = 4g, 3k - 8g + 10g + 6 = 0 for k. -4 Solve 0 = 5k - v + 1 - 5, 5k + 4v - 9 = 0 for k. 1 Solve 5u = 0, -8u + 5u - 8 = -2r for r. 4 Solve 2o - 2r - 20 = -2o, o = -2r for o. 4 Solve 5q + 1 = -3t + 7q, -3q - 21 = 3t for t. -3 Solve 4i + 4a = 12, -2a - 78 + 69 = -i for i. 5 Solve 3p + 17 = -4m + 47, 0 = -p + 3m - 16 for p. 2 Solve 6t - 7t - 7x + 27 = 0, -2 = -2t - x for t. -1 Solve -5s - 6 = 4v - 3v, v = -s - 2 for v. -1 Solve -3y - 5u - 34 = 0, -u - 66 + 73 = -4y for y. -3 Solve -2u - 2 = 0, 24j + 5u - 11 = 28j for j. -4 Solve -4z - 3p - 10 = 0, -6z = -10z - 5p - 14 for z. -1 Solve 4q + 2k - 7 = -17, -2q - 5k - 9 = 0 for q. -2 Solve -11 = 3r - 6c + 10c, -3r + 4 = c for r. 3 Solve 3v + 3 = -w, 0 = 2w - w - 5v + 3 for w. -3 Solve -2c - 2z = 18, c + 23 = -2c - 2z for c. -5 Solve 4y - w = -18, -56y + 27 = -61y - w for y. -5 Solve -3i + 3 = 3g, 5i - 230g = -226g + 14 for i. 2 Solve 5m + 1 = x - 6, -2x + 4 = -5m for x. -3 Solve -5a + 5 = 5m, 2m = 8a - 7a + 8 for m. 3 Solve 11p = 2n + 9p - 2, 5p + 5 = n for n. 0 Solve -d - 5 = 5t - 4d, 0 = -4t - 3d - 31 for t. -4 Solve -4a + 2 = -u - 11, -5u - 19 = 3a for a. 2 Solve -j + 5 = 2j + i, 0 = j + i - 5 for j. 0 Solve -5z + 2g = -6, -2z + 3z = -g - 3 for z. 0 Solve -z - 21 = 4a, 0 = 2a + 19z - 21z + 8 for a. -5 Solve 2v = -3t + 17, -1 = -5v + 4 for t. 5 Solve -4f - 2b + 5b = -16, 4f = -5b + 16 for f. 4 Solve -2m - 4w = -0m + 30, -w - 20 = 3m for m. -5 Solve -z = -5x + 16, 0 = -4x + z + 4 + 8 for x. 4 Solve 17g - 3 = 14g + c, -5g - 3c - 9 = 0 for g. 0 Solve 3a - 3i + 101 = 110, 3a - 1 = i for a. -1 Solve -1 = -2y + c, 0 = -4c + 2c - 2 for y. 0 Solve 0 = 5t + 4o, -2o - 5 = 5 for t. 4 Solve 2t + 3c - 13 = 0, -2c = 121 - 131 for t. -1 Solve 6f + 22 = h + f, 2f = -2h - 4 for h. 2 Solve -8d = -5d + 3p + 6, -4p + 2 = 2d for d. -5 Solve -6f + 5u = 31, 0 = 5f - 8f + 2u - 16 for f. -6 Solve -3i = 4o + 31, o = i + 15 - 14 for o. -4 Solve -4u = -h + 1, -44u = -48u - 4 for h. -3 Solve -4f - 5d - 8 = 0, -3d + 8 = -5f + f for f. -2 Solve -j = -2h + 5 - 7, -2h - 2 = 4j for j. 0 Solve 0 = -2v - 2i - 4, -5v + 5i - 2 = 6i for v. 0 Solve 2m = d + 3m - 7, m - 5 = 0 for d. 2 Solve 3s = 2o + 10, 3o + 20 = -o + s for o. -5 Solve -3s + 4l - 20 = 0, 0 = -2s + s + 2l - 10 for s. 0 Solve 6f - 5f = 2i + 8, i + 11 = -3f for i. -5 Solve 3 - 1 = -a + 5n, -n - 6 = 3a for a. -2 Solve 5o + 4b + 20 = 0, 0o + 4b = -o - 20 for o. 0 Solve 4n + 2c = 10, -n - 48c = -45c + 5 for n. 4 Solve 2m - 4m = 2, 0 = -3p + m + 7 for p. 2 Solve 5c + 0 = -2u + 4, 4c - 4 = -2u for c. 0 Solve 3r + 2 = -g, 0 = 5r - 10r + 5g - 30 for r. -2 Solve -b - 13 = -2l, -5l + 0l + 4b = -37 for l. 5 Solve -3o - 9 = w, -4o - 4w - 12 + 8 = 0 for o. -4 Solve f = -4d + 5, -2d = 2d + 5f - 25 for d. 0 Solve 0d = 3d + 2x - 9, 3d = x + 9 for d. 3 Solve -2u + 5u = k - 8, u = -2 for k. 2 Solve -7r - 8v = -6v - 38, -r - 2v = -14 for r. 4 Solve 0 = 3q - 6, 5q - 35 = 9i - 14i for i. 5 Solve 0 = 5q - 2z + 13, 0 = -4q - z - 5 - 8 for q. -3 Solve 17 = -q + 3k, 0 = 4q - 0q + 3k + 23 for q. -8 Solve 4k + k + 2m = 9, -2m = k + 3 for k. 3 Solve k + 8 = -o, 3o + 9 = k + 1 for o. -4 Solve 4 = 2n - 2i, 5n + 6i = 4i + 24 for n. 4 Solve -5s - 2d + 5 = 0, -12s - 5d = -9s + 16 for s. 3 Solve -s = -5b + 19, 0 = -6b + 10b + 2s - 4 for b. 3 Solve -4w - 24 = -2m, m + 3m - 28 = 4w for m. 2 Solve -3u - 8 = 2a, 2u - 4a + a = -14 for u. -4 Solve h = -2j + 20 - 7, -h - 3 = -2j for h. 5 Solve 0 = 5m + 3j, 18 = 5m + j + 28 for m. -3 Solve 4u = 4, 3 = p - 2p + 4u for p. 1 Solve -2 = 2i - l, 5l + 6 = -82i + 84i for i. -2 Solve -4l = -3a + 11, -2 + 7 = -l for a. -3 Solve -4 = 2q + 4s, s + 3 = 3q + 9 for q. -2 Solve 2f + k + 1 = 0, -4k + 5k =	{ "pile_set_name": "DM Mathematics" }
s than -4.82? 10.98 Total of 3252 and -0.3. 3251.7 What is 0 plus 9653? 9653 What is -90 minus -1? -89 What is -1515325 + -0.1? -1515325.1 436+-12 424 65 + -488 -423 What is -769 take away -11.6? -757.4 Add 6 and 10.7475. 16.7475 What is -0.62511 less than 3? 3.62511 Total of 0.458 and -538. -537.542 Calculate -0.81 - -48. 47.19 Add 0.2 and 486505. 486505.2 Subtract -1.1 from -12575. -12573.9 4 - -1.511953 5.511953 0.9 + 0.16 1.06 What is -0.2 + -2953? -2953.2 Add -3 and 16.83. 13.83 Sum 0.038 and 36.52. 36.558 What is -0.6 plus -1292? -1292.6 Work out 99 + 26. 125 -0.073 + 446 445.927 Work out -97 - -0.07. -96.93 What is the difference between -0.0799 and -2.64? 2.5601 Calculate -5 + 661209. 661204 What is 460 + -0.416? 459.584 Work out 13.69 + -18. -4.31 Sum 1037 and 0.05. 1037.05 Work out 1.78 - 0.3. 1.48 Calculate -0.73 + 9.12. 8.39 What is 42201 take away 0? 42201 -42 - -3360 3318 Subtract 3.811 from 0.2. -3.611 What is -0.4 less than -12.6657? -12.2657 Subtract 51 from 0. -51 0.3+828216 828216.3 What is -0.04 less than -8271? -8270.96 765524 + -0.3 765523.7 0.01+49596 49596.01 8836.41 + -3 8833.41 Sum -18.9 and -0.23078. -19.13078 Sum 171 and -0.13. 170.87 -94+0.03979 -93.96021 What is 0.45 + 10896? 10896.45 What is the difference between 10 and -9.04? 19.04 Calculate -111577 - 1. -111578 Add 0.274 and -1150.5. -1150.226 What is 9.65 + -7560? -7550.35 -899 - 10 -909 What is the distance between -0.3 and -0.60327? 0.30327 Work out -0.5 + -0.090523. -0.590523 -99.45 + 11 -88.45 -27362 - -3 -27359 What is 0.6 minus 0.01883? 0.58117 3 - 0.554 2.446 What is -3 plus 73739? 73736 -8961 + 0.5 -8960.5 What is 3.0244 take away 23? -19.9756 Calculate -993 + 4. -989 What is 0.0241 + -0.0477? -0.0236 Subtract 0.03 from -1253. -1253.03 -2.9939 - -0.01 -2.9839 Calculate -3906 + 0.4. -3905.6 4 + -71.69 -67.69 What is 0.5 minus 39805.8? -39805.3 What is 5 take away 46109? -46104 Sum -2.7 and -0.0972. -2.7972 What is -90 + -7427? -7517 What is -8855 - -0.6? -8854.4 What is 0.1 minus 3610? -3609.9 Subtract -41853 from 0.2. 41853.2 What is the distance between 3963 and -3? 3966 Calculate 0.055 - 0.4. -0.345 What is 5.01 less than 1? -4.01 What is the difference between 30475 and -0.09? 30475.09 What is -1.5 less than 57057? 57058.5 Add 6 and -11444. -11438 Put together 1192.2 and 0.3. 1192.5 What is the difference between -23 and 69430? 69453 Add 22.268 and 0.058. 22.326 Sum 333 and 0.46. 333.46 Calculate 0.4 - -405.8. 406.2 What is 1171 plus 0.03? 1171.03 Sum 68 and -1864. -1796 -30.6 + -133 -163.6 -2 + 948.7 946.7 Add together -1.546 and 1.2. -0.346 What is -0.06 take away 1.868? -1.928 Sum -233859 and 0.4. -233858.6 Calculate -1.2699 - -15.1. 13.8301 What is -0.6 - 162? -162.6 What is 944043.2 take away 3? 944040.2 Add together -0.0208 and 3. 2.9792 What is -2.497 - 3.46? -5.957 Subtract 5120 from -0.1. -5120.1 Add -5.27672 and -0.03. -5.30672 What is the distance between 2049 and 3967? 1918 Calculate -318 + -1. -319 Calculate -0.356 - 0.1. -0.456 Add 2.54 and 19.791. 22.331 Add -118608 and -0.5. -118608.5 What is -94 minus -1.2? -92.8 What is 5431 plus -302? 5129 What is -3.25 less than 0.031? 3.281 Put together 0.5 and -2040. -2039.5 602 - 984 -382 What is -2.89 less than 0.28? 3.17 What is 0.2 minus -1625243? 1625243.2 Work out 1.4 + -1212167. -1212165.6 What is -755 + -0.02? -755.02 What is 4.017 plus 7? 11.017 What is -6 minus -194? 188 -8.85+638 629.15 Calculate -7 + -6.57. -13.57 15547 - -0.09 15547.09 Sum -3449 and 0.02. -3448.98 1 + -5505 -5504 90+-611 -521 Calculate -451028 + 0.1. -451027.9 Add 455 and -14.684. 440.316 What is -15134 less than -0.1? 15133.9 0.04+-476 -475.96 Put together 2 and 0.44. 2.44 Add 148 and -15. 133 Work out -1729346 - 0. -1729346 Calculate -2.65675 + 0.4. -2.25675 Work out -0.5247 - -329. 328.4753 What is the difference between -8 and 64? 72 Work out -0.5 - 134.6. -135.1 Work out -5.5 - 0.1. -5.6 82835+1 82836 Add -318 and 0.01. -317.99 -0.09 - 117 -117.09 Calculate 40462 - -2. 40464 17 + 114 131 Calculate -7 - -0.12. -6.88 Add together 283 and -1.2. 281.8 Subtract -195 from 1. 196 Work out -35059 - -0.5. -35058.5 Subtract -23 from 0.048. 23.048 What is -20 minus 854.8? -874.8 Sum -0.064 and 0.05. -0.014 What is -3.45 - 0.0703? -3.5203 What is the distance between -0.06 and 98873? 98873.06 What is 0.79932 plus -16? -15.20068 Work out 0.9 - 2237. -2236.1 Add -0.034 and 13870. 13869.966 Work out -0.1 - -9450.5. 9450.4 -218.24 - 3 -221.24 Work out 4 - -3.2. 7.2 What is -0.059 - 2? -2.059 What is -1 take away 34? -35 What is 22.2516 plus -0.1? 22.1516 Total of 0.2 and -265. -264.8 3 - -3.4277 6.4277 What is -4 take away 54.03? -58.03 What is the distance between 3.583 and -3? 6.583 Put together 0.0384 and 3. 3.0384 Calculate 228.6 + -1.2. 227.4 Subtract 0 from 4612730. 4612730 Calculate -12121 - -0.054. -12120.946 -0.052 + 84 83.948 What is the difference between -292 and 0.1? 292.1 What is the distance between -4 and 4953? 4957 Calculate 286 - 6058. -5772 Subtract 0.0868 from 118. 117.9132 Calculate -0.5 - -0.41275. -0.08725 Work out 0.18 - -362. 362.18 Total of -15 and 74.617. 59.617 What is -3.8 less than 88? 91.8 43.66+-66.2 -22.54 What is 37 - 0.046? 36.954 What is the difference between -0.05802 and -16? 15.94198 Work out 11435 - -21. 11456 Add 10 and 1.4. 11.4 What is -8433571 - 0.3? -8433571.3 Total of -0.02 and -1.610389. -1.630389 Work out 3 - 577551. -577548 What is 0.638 plus 71? 71.638 Work out 26 - 49. -23 What is -77 plus 0.05415? -76.94585 Work out -23 + -12.1. -35.1 Sum 4215967 and 5. 4215972 0.065 + 11.4 11.465 Total of -5 and 782760. 782755 What is -1 minus 0.0649? -1.0649 What is -0.13 less than 46.07? 46.2 Add 3 and -9822.73. -9819.73 Calculate 0 - 109603. -109603 What is 8 minus 2493.4? -2485.4 What is the difference between 86026 and 0.03? 86025.97 18003 - -24 18027 3+584 587 Work out 0.2 + 761521. 761521.2 What is the difference between -16 and 1.53105? 17.53105 What is -0.8024 take away -0.4? -0.4024 What is -4.7 + 47739? 47734.3 Put together -1918.28 and -0.5. -1918.78 Calculate -3 + -0.04408. -3.04408 What is -3 plus 15? 12 Add together -780 and -0.26. -780.26 What is 4 plus -981? -977 -1250.92+-0.4 -1251.32 What is -0.2 - -1291? 1290.8 1.11 + -4 -2.89 Work out 1 + 3084. 3085 Calculate 1.1 + 397. 398.1 What is -377 take away -3? -374 What is 480 less than -6? -486 What is -0.04 - 248? -248.04 What is the difference between -342 and -0.2? 341.8 103 + -1389 -1286 Total of 0.04848696 and -0.4. -0.35151304 Calculate -3 + -6794.6. -6797.6 Total of 12 and 91. 103 -492 - -54.18 -437.82 What is the difference between -0.1 and 137.7? 137.8 Work out 20 + 0.03793. 20.03793 What is 23 plus 330999? 331022 Put together 102.514 and -2. 100.514 333806 + -2 333804 Subtract 9794 from 543. -9251 What is 0.022 plus -2.13? -2.108 What is 6 - 59.287? -53.287 Add -4 and 94.79. 90.79 Subtract -78 from -193.9. -115.9 -12575+143 -12432 What is 0.032 minus 3.86? -3.828 Calculate 19801 - 0.2. 19800.8 What is 0.3 plus -100277? -100276.7 Work out -24.743 + 2.7. -22.043 What is 230398 - -0.2? 230398.2 -0.06+-0.64326 -0.70326 Add -0.5 and -36. -36.5 Work out 0.0441 + -0.15. -0.1059 What is the distance between -359 and 5? 364 Total of 3 and -660100. -660097 Add 545.622 and -3. 542.622 What is the difference between -3 and 239276? 239279 What is 26102 take away 12? 26090 Add together -3.8 and 58. 54.2 What is -2 plus 1701684? 1701682 What is 10038 less than -2.01? -10040.01 Work out -211.8 - 0.021. -211.821 -1.5+-1.17 -2.67 Sum -35 and -0.02061. -35.02061 Add 53.1 and 0.14518. 53.24518 Add together 5 and 0.7426. 5.7426 621 - -0.7 621.7 Work out -0.21084 - 3. -3.21084 What is -156 less than -36? 120 What is -1 take away 2679? -2680 Add -0.3 and -993741. -993741.3 Calculate -5 - 815. -820 Calculate -162 - -359.2. 197.2 Work out 0.3 - 127. -126.7 -2+0.3759 -1.6241 What is -94.4 + -595? -689.4 What is -0.19738 less than -10.8? -10.60262 Sum 3120.1 and 7. 3127.1 Sum -10 and 0.461. -9.539 -341+0.3 -340.7 What is -27 - -0.084? -26.916 Total of 0.11 and -2.1722. -2.0622 -2.2+117 114.8 Total of -1.2 and 14.696. 13.496 Add together -0.04 and -0.03759. -0.07759 0.06 + 217292 217292.06 Put together -157 and -16.6. -173.6 What is 0.2 m	{ "pile_set_name": "DM Mathematics" }
are root of 16606905 to the nearest integer? 4075 What is the square root of 12060048 to the nearest integer? 3473 What is 232237 to the power of 1/2, to the nearest integer? 482 What is 30980722 to the power of 1/3, to the nearest integer? 314 What is 324709 to the power of 1/9, to the nearest integer? 4 What is 870884 to the power of 1/2, to the nearest integer? 933 What is the cube root of 3986516 to the nearest integer? 159 What is the ninth root of 6601767 to the nearest integer? 6 What is the third root of 10174800 to the nearest integer? 217 What is 453096 to the power of 1/10, to the nearest integer? 4 What is 3885124 to the power of 1/4, to the nearest integer? 44 What is the tenth root of 2168870 to the nearest integer? 4 What is the square root of 53869 to the nearest integer? 232 What is the seventh root of 7768413 to the nearest integer? 10 What is the third root of 8793085 to the nearest integer? 206 What is 3864613 to the power of 1/2, to the nearest integer? 1966 What is 426689 to the power of 1/8, to the nearest integer? 5 What is the third root of 7673895 to the nearest integer? 197 What is 7029975 to the power of 1/2, to the nearest integer? 2651 What is 939904 to the power of 1/10, to the nearest integer? 4 What is 15554292 to the power of 1/7, to the nearest integer? 11 What is 171811 to the power of 1/2, to the nearest integer? 415 What is the third root of 6338920 to the nearest integer? 185 What is 1333960 to the power of 1/5, to the nearest integer? 17 What is 15596472 to the power of 1/2, to the nearest integer? 3949 What is 4678415 to the power of 1/3, to the nearest integer? 167 What is the square root of 6921143 to the nearest integer? 2631 What is the cube root of 179152 to the nearest integer? 56 What is the square root of 12229006 to the nearest integer? 3497 What is 105731 to the power of 1/3, to the nearest integer? 47 What is 1018999 to the power of 1/8, to the nearest integer? 6 What is the seventh root of 1507805 to the nearest integer? 8 What is 1564608 to the power of 1/6, to the nearest integer? 11 What is 13419450 to the power of 1/10, to the nearest integer? 5 What is the square root of 1355598 to the nearest integer? 1164 What is the eighth root of 800413 to the nearest integer? 5 What is the fourth root of 14456870 to the nearest integer? 62 What is the ninth root of 226521 to the nearest integer? 4 What is 355495 to the power of 1/2, to the nearest integer? 596 What is the square root of 24439 to the nearest integer? 156 What is the fifth root of 1117109 to the nearest integer? 16 What is the cube root of 3385743 to the nearest integer? 150 What is 1021007 to the power of 1/6, to the nearest integer? 10 What is 3397304 to the power of 1/4, to the nearest integer? 43 What is 3404330 to the power of 1/2, to the nearest integer? 1845 What is the ninth root of 1217522 to the nearest integer? 5 What is the third root of 1054733 to the nearest integer? 102 What is 11157709 to the power of 1/2, to the nearest integer? 3340 What is 441742 to the power of 1/5, to the nearest integer? 13 What is the cube root of 5865290 to the nearest integer? 180 What is 11667954 to the power of 1/2, to the nearest integer? 3416 What is the tenth root of 27928095 to the nearest integer? 6 What is 6001210 to the power of 1/8, to the nearest integer? 7 What is 1801723 to the power of 1/2, to the nearest integer? 1342 What is 13924362 to the power of 1/2, to the nearest integer? 3732 What is 3985332 to the power of 1/2, to the nearest integer? 1996 What is the third root of 1625460 to the nearest integer? 118 What is 5557759 to the power of 1/2, to the nearest integer? 2357 What is the cube root of 4512658 to the nearest integer? 165 What is 2354411 to the power of 1/3, to the nearest integer? 133 What is the square root of 1633281 to the nearest integer? 1278 What is 483946 to the power of 1/6, to the nearest integer? 9 What is the cube root of 3802509 to the nearest integer? 156 What is the fourth root of 104530 to the nearest integer? 18 What is the square root of 1361974 to the nearest integer? 1167 What is 595647 to the power of 1/6, to the nearest integer? 9 What is the tenth root of 19112 to the nearest integer? 3 What is the cube root of 1189790 to the nearest integer? 106 What is the seventh root of 1540418 to the nearest integer? 8 What is 15189395 to the power of 1/10, to the nearest integer? 5 What is the third root of 3758780 to the nearest integer? 155 What is the square root of 6673410 to the nearest integer? 2583 What is 7854365 to the power of 1/2, to the nearest integer? 2803 What is 1689100 to the power of 1/9, to the nearest integer? 5 What is the square root of 6592375 to the nearest integer? 2568 What is 559706 to the power of 1/7, to the nearest integer? 7 What is the square root of 336228 to the nearest integer? 580 What is the cube root of 1486026 to the nearest integer? 114 What is the square root of 222215 to the nearest integer? 471 What is 3493010 to the power of 1/3, to the nearest integer? 152 What is the square root of 1797487 to the nearest integer? 1341 What is the third root of 84684 to the nearest integer? 44 What is 37034075 to the power of 1/4, to the nearest integer? 78 What is 160262 to the power of 1/2, to the nearest integer? 400 What is 6764362 to the power of 1/2, to the nearest integer? 2601 What is the square root of 2264730 to the nearest integer? 1505 What is the square root of 4920320 to the nearest integer? 2218 What is the tenth root of 447748 to the nearest integer? 4 What is 557678 to the power of 1/9, to the nearest integer? 4 What is the square root of 213195 to the nearest integer? 462 What is 6720350 to the power of 1/8, to the nearest integer? 7 What is the seventh root of 68713 to the nearest integer? 5 What is the cube root of 814554 to the nearest integer? 93 What is the fourth root of 238043 to the nearest integer? 22 What is 231150 to the power of 1/7, to the nearest integer? 6 What is 10418693 to the power of 1/2, to the nearest integer? 3228 What is the square root of 2617620 to the nearest integer? 1618 What is 761141 to the power of 1/3, to the nearest integer? 91 What is 19271964 to the power of 1/2, to the nearest integer? 4390 What is the square root of 36020160 to the nearest integer? 6002 What is 23762948 to the power of 1/2, to the nearest integer? 4875 What is the fourth root of 33767590 to the nearest integer? 76 What is 1164773 to the power of 1/5, to the nearest integer? 16 What is the ninth root of 5136142 to the nearest integer? 6 What is 2840760 to the power of 1/3, to the nearest integer? 142 What is the cube root of 675370 to the nearest integer? 88 What is 18299286 to the power of 1/2, to the nearest integer? 4278 What is the square root of 270516 to the nearest integer? 520 What is 3085598 to the power of 1/8, to the nearest integer? 6 What is the third root of 8219940 to the nearest integer? 202 What is the third root of 292471 to the nearest integer? 66 What is 36824420 to the power of 1/2, to the nearest integer? 6068 What is 80896 to the power of 1/10, to the nearest integer? 3 What is the third root of 2439848 to the nearest integer? 135 What is the tenth root of 717916 to the nearest integer? 4 What is the third root of 65801 to the nearest integer? 40 What is the seventh root of 29581 to the nearest integer? 4 What is the third root of 964349 to the nearest integer? 99 What is the cube root of 103743 to the nearest integer? 47 What is the third root of 354179 to the nearest integer? 71 What is 251899 to the power of 1/5, to the nearest integer? 12 What is the cube root of 457845 to the nearest integer? 77 What is 41096 to the power of 1/5, to the nearest integer? 8 What is the ninth root of 372156 to the nearest integer? 4 What is 766323 to the power of 1/3, to the nearest integer? 92 What is 755005 to the power of 1/6, to the nearest integer? 10 What is the square root of 8773013 to the nearest integer? 2962 What is 456892 to the power of 1/2, to the nearest integer? 676 What is the fifth root of 1019191 to the nearest integer? 16 What is the square root of 1864766 to the nearest integer? 1366 What is the third root of 5071963 to th	{ "pile_set_name": "DM Mathematics" }
of 4a4hl - 150a*2l - 2ahl - ah - 27hl - 33h wrt a? 48a*2hl - 300l Find the third derivative of -197ao*4 + 2ao3 + 377ao2 - 13a + 191o4 - 5o*3 - 10 wrt o. -4728ao + 12a + 4584o - 30 Find the second derivative of -569333k*2z*2 - kz*2 - 113k + z*2 + 35z + 1 wrt k. -1138666z2 What is the first derivative of -10py2 - 2155p + 9908y2 wrt p? -10y*2 - 2155 What is the third derivative of -201037n4 + n3 - 616546n2 wrt n? -4824888n + 6 What is the third derivative of 3816g4n + g*2 + 7158n wrt g? 91584gn Find the third derivative of 2y4 - 1339825y*3 - 102y*2 + 11y + 52. 48y - 8038950 Find the second derivative of 3944040q*3 + 2667988q wrt q. 23664240q What is the first derivative of -4143856d*4p*2 + 1050838p*2 wrt d? -16575424d*3p*2 What is the third derivative of 11q*4 + 30q3 - q2 - 5570 wrt q? 264q + 180 Differentiate -3204h*4 - 24h + 1842470 wrt h. -12816h3 - 24 What is the second derivative of f3 + 16948f*2 - 23880f wrt f? 6f + 33896 What is the third derivative of 2g*2v*4 - 32g*2v*2 - 170g*2v - 3g2 + 28831gv4 wrt v? 48g*2v + 691944gv What is the second derivative of 25g2h*2z - 87g2z - g*2 - 2025gh2z + 2ghz + g + 5h*2 wrt g? 50h*2z - 174z - 2 What is the derivative of ag*3s*2 + 25ag2 - 44a + 6255g3s - g*3 - 2gs2 - 24g + 1 wrt s? 2ag*3s + 6255g3 - 4gs Differentiate -54b*4 - 2b*3 - b - 29818 with respect to b. -216b*3 - 6b*2 - 1 Find the second derivative of 320s*4 + 96s*3 + 2s*2 - 1519605s. 3840s2 + 576s + 4 Find the second derivative of 67486b4s*3 + 2b*3s*3 + 24bs3 + bs*2 - bs - 2s3 - 16 wrt b. 809832b*2s*3 + 12bs3 What is the second derivative of 2t*5 + 59t*4 - 204t*3 + 2t - 27880? 40t3 + 708t*2 - 1224t Find the second derivative of 112637f3i*2 - 50f*3i - 42109f3 + 2fi2 + 6i*2 wrt i. 225274f*3 + 4f + 12 Find the second derivative of 4416775w4 - 2150862w. 53001300w2 What is the third derivative of -670592q*3 - 1251233q*2? -4023552 Find the second derivative of -994665t*3 + 1374554t. -5967990t Find the first derivative of j3 + 19420j + 13407. 3j2 + 19420 What is the third derivative of 4m*5 - 156m*4 - 4m*3 + 1497m*2 - m - 11? 240m*2 - 3744m - 24 Find the third derivative of 160262b4 - 562548b*2. 3846288b Find the second derivative of 99o2s*3 + 10459o*2 - 3os3 + 17s*3 + 2s wrt s. 594o2s - 18os + 102s What is the second derivative of 214x*5 - 38x*3 - 57503x wrt x? 4280x3 - 228x What is the third derivative of 2598108l3 + 2l*2 - 2l + 192641? 15588648 Find the second derivative of -4w3 - 1729w*2y*3 + 8wy2 + 2117y*3 wrt w. -24w - 3458y3 What is the second derivative of 19696w*3 - 2w + 46946? 118176w Differentiate -80m*2r + 23080m2 + mr*2 + 11mr - r2 - 57 wrt r. -80m*2 + 2mr + 11m - 2r What is the derivative of -svw + 8sv - 4s + 1044vw + v + 9857w + 3 wrt v? -sw + 8s + 1044w + 1 Find the third derivative of 73803m5 + 49711m*2. 4428180m*2 What is the first derivative of -331rs2 + 2rs + 250r - 6s2 + 4s - 1424 wrt s? -662rs + 2r - 12s + 4 What is the second derivative of 86dg*3 + 4dg2 - 25dg - 14d + 6g3 - g2 - 4g + 2 wrt g? 516dg + 8d + 36g - 2 What is the first derivative of -509946o4 + 281705 wrt o? -2039784o*3 What is the first derivative of 68361k - 161878 wrt k? 68361 What is the third derivative of 6q4x - q*4 + 190q3 + q2x - 381q*2 + 50x - 2 wrt q? 144qx - 24q + 1140 Find the third derivative of -4546825o3 - o2 + 37123o - 2. -27280950 Find the second derivative of -2d*2u*2 + 5d*2u + 7304d2 + 3122du2 wrt u. -4d*2 + 6244d What is the second derivative of 44p3s*2 - 3319p*3s - p*3 + 12p*2s*2 + 76p*2s - 253ps*2 wrt s? 88p*3 + 24p*2 - 506p Find the second derivative of -19c2k*2u - 13c2mu - 6c*2u + 2ck*2m - 2ckmu - ck + 3c + 152k2mu + 3k*2u wrt c. -38k2u - 26mu - 12u Find the third derivative of 724510m*3 + 1103m*2 + m + 460 wrt m. 4347060 Find the second derivative of 364488r*4 + 7r - 26163. 4373856r2 What is the second derivative of 107u*5 - 7u*3 - 124u*2 - 626u + 958 wrt u? 2140u3 - 42u - 248 What is the second derivative of -6674a2j + 4aj + 2a - 840j wrt a? -13348j Differentiate -11r*3 + 14r*2 - 157r - 72135 with respect to r. -33r2 + 28r - 157 What is the first derivative of 110753n2 - 10949 wrt n? 221506n Differentiate -3580b3v4 - b3v3 - 14b*3 - 145b wrt v. -14320b3v*3 - 3b*3v*2 Find the first derivative of -4f*4 - 168854f*3 + 1796084. -16f*3 - 506562f2 Differentiate x3 - 18x2 - 916x + 3645. 3x2 - 36x - 916 What is the second derivative of -20y5 - 155y*2 - 52100y wrt y? -400y3 - 310 Find the third derivative of -1993977b*3 - 32b*2 - 24b - 5 wrt b. -11963862 What is the second derivative of 17148fp*4 - fp - 3f + 96p*5 - 29p - 1027 wrt p? 205776fp*2 + 1920p*3 What is the third derivative of 3852131m*3w + 2m2w - 4m2 + 16mw - 3m - 20w wrt m? 23112786w Find the third derivative of 878n3q*3 - 65n*3q + n*2q*3 + 136nq2 wrt q. 5268n*3 + 6n*2 What is the second derivative of 852670h*3 + 530328h? 5116020h What is the third derivative of -14682j*4 - 40j*3 - 339009j*2 wrt j? -352368j - 240 Find the second derivative of 1845233i2k + 25535ik - 2k wrt i. 3690466k What is the third derivative of 3c3v*3 + 170c*3v*2 + 4cv2 - 2913v*5 + 11v*2 - v wrt v? 18c*3 - 174780v*2 What is the third derivative of -4k*4 - 428k3 - k2 - 25149k? -96k - 2568 What is the third derivative of -81204a3c - 2a3o - a*2c + 9aco + 8c - 74 wrt a? -487224c - 12o What is the third derivative of 946u4 + 2512u*3 - 3608731u*2? 22704u + 15072 What is the third derivative of 14719g3h*3y*2 - 3g*3h*2y*3 - 2g*2h*3 - 270g*2h*2y*3 + 24g*2y wrt g? 88314h3y*2 - 18h*2y*3 What is the third derivative of -2d*6 + 4108d*3 + 14d*2 + 3d + 11 wrt d? -240d3 + 24648 What is the second derivative of -4u*2z*3 - 4u*2z + 129u2 - 3uz - 4u + 30309z5 wrt z? -24u*2z + 606180z3 Find the third derivative of -128584a*3c*3d*2 + 47a*2c*2d - 9ac - 5c3d - 2d2 + d wrt a. -771504c*3d*2 Find the second derivative of -2u*5 + 14443u*4 + 43435u. -40u3 + 173316u*2 Find the third derivative of -19450c*3n*2u3 + c3n2u*2 + 95c*3u*2 - 169n*2u*2 wrt u. -116700c*3n*2 What is the second derivative of -3qz2 - 4450qz - 90q - 61207z2 wrt z? -6q - 122414 Find the third derivative of -5g5 + 41g3 - g2 - 206g + 11 wrt g. -300g*2 + 246 Find the third derivative of 263955f*3 + 40934f*2. 1583730 Find the second derivative of 63m*4 + 1188m*3 + 154404m. 756m2 + 7128m Find the first derivative of 1374501d2r - 178376d2 + 8d wrt r. 1374501d2 What is the first derivative of -21105m4 - m3s - 3m*2s + 174077s wrt m? -84420m*3 - 3m*2s - 6ms What is the third derivative of -710j6p*3 - 27j*6p + 99843j2p*3 wrt j? -85200j*3p*3 - 3240j*3p What is the third derivative of -31647m3 + m2 - 324093m wrt m? -189882 Find the third derivative of -3k6s*2 + 24473k*5 - 10k*2s*2 + 282s*2 + 14 wrt k. -360k*3s*2 + 1468380k*2 What is the derivative of 1001p*3u2 + p3 - 3p2u - 5p2 + 12198p - 11u2 wrt u? 2002p*3u - 3p2 - 22u Find the first derivative of -6u3 - 1335u*2 + 3u - 1728206 wrt u. -18u2 - 2670u + 3 What is the first derivative of -53c2i + 680ci + 4c - i - 311275 wrt c? -106ci + 680i + 4 What is the derivative of 38d2g - d*2 - 2351dg + 141501g wrt d? 76dg - 2d - 2351g Find the second derivative of 296745z3 - z2 - 988z + 7. 1780470z - 2 Find the third derivative of -366301t5 - t2 + 120686 wrt t. -21978060t2 Differentiate 3287a*	{ "pile_set_name": "DM Mathematics" }
- 3g. Let q be 0/(0/1 - k) + 5. Let j be 2q(392 + 8). What is j rounded to the nearest one thousand? 4000 Let i(z) = 560z + 6. Suppose -5u - 20 = 25. Let q be i(u). Let g be 14/(-21) - q/(-9). What is g rounded to the nearest 100? -600 Let g = 0.169 - -0.016. Let o = 0.185000679 - g. Round o to seven decimal places. 0.0000007 Let n = -69.5899 + 11.5715. Let v = n - -58. What is v rounded to three decimal places? -0.018 Let s = 31.78 + -36.9. Let g = s + 5.42. Round g to the nearest 10. 0 Suppose 6c = -f + 3c - 563988, 1691988 = -3f - 3c. What is f rounded to the nearest 10000? -560000 Let n be 12/24 - 134/(-4). Let p = 40 - n. Suppose py - 468 - 618 = 0. What is y rounded to the nearest 10? 180 Let b = 116.4859 + 0.1141. Let f = b - -20.4. Let l = 162.4 - f. What is l rounded to the nearest integer? 25 Let y = 701223 - 701166.00132. Let z = y - 57. Round z to four decimal places. -0.0013 Let v = -37.7 + 7.7. Let q = -30.0912 - v. Round q to two dps. -0.09 Let d(m) = 311m + 27 - 82 - 303m + 2388m + 1009m. Suppose p - 17 = -6. Let x be d(p). What is x rounded to the nearest one thousand? 37000 Let d = -46 + 43.4. Let p = d - -2.577. Let w = p - 0.116. Round w to 2 decimal places. -0.14 Let r = 19.5305716 - 19.536. Round r to 5 dps. -0.00543 Let u = -39674 + 40062.26. Let f = -385 + u. What is f rounded to 1 dp? 3.3 Let g = -372.548 + 430.9. Round g to the nearest 10. 60 Let f = -1.76 + 1.779. Let c = f - 0.0190672. Round c to 5 decimal places. -0.00007 Let k = 169.7325 - 0.0325. Let x = k - 26.7. Let d = x - 143.0000093. What is d rounded to 6 decimal places? -0.000009 Let q = 4333 - 4333.00000015004. What is q rounded to 7 dps? -0.0000002 Let u = -4073 - -4073.583. Round u to 1 decimal place. 0.6 Let l = 0.29 + 21.81. Let u = 22.10449 - l. Round u to four dps. 0.0045 Suppose -1218k + 1251k = 13778160. Round k to the nearest 1000. 418000 Let d = 453 + -395.2. Let s = d + -57.800000727. Round s to 7 dps. -0.0000007 Let k = -82.304 - -82. Let p = 0.304000907 + k. Round p to seven decimal places. 0.0000009 Let k = -4819.14 - -4726. Round k to the nearest integer. -93 Let t = 106702 + -106701.9658205. Let q = t - 0.0343. Round q to 5 decimal places. -0.00012 Let h = 1548340 - 1540092.072. Let c = 8289 - h. Let u = c - 41. Round u to two dps. 0.07 Let z(t) = -923080t - 960. Let u be z(13). What is u rounded to the nearest 1000000? -12000000 Let k = -0.013170145 - -0.0131. Round k to six dps. -0.00007 Let c = 3641240.339 + -3641241.4098340142. Let k = c + -223.9291681258. Let y = -225 - k. Round y to seven decimal places. 0.0000021 Let q = 0.0028 + -399.9028. Let b = q + 399.71605. Let r = b - -0.191. Round r to three dps. 0.007 Let g = -692.264 - -692. Let p = g - 6.386. Round p to the nearest integer. -7 Let z(d) = -d2 - 7d + 33. Let k be z(-10). Let g be 18/k(-5)/(-3). Suppose -gl + 264000 = -2l. What is l rounded to the nearest ten thousand? 30000 Suppose -21g + 24 = -15g. Let t(u) be the third derivative of 2950003u*4/24 - 2u*3 + 7u*2. Let f be t(g). What is f rounded to the nearest 1000000? 12000000 Let s = 7190.009015 + -7190. Round s to four decimal places. 0.009 Let c = -755 - -393. Let h = 362.0804 + c. Round h to 2 decimal places. 0.08 Suppose 3i - 12 = 6i. Let f = 10 + i. Suppose fl - l - 2y - 771 = 0, l = -2y + 159. What is l rounded to the nearest ten? 160 Let d(u) = 4161u3 + 2u*2 - 3u + 5. Let g be d(4). Let p = g + -456029. What is p rounded to the nearest ten thousand? -190000 Suppose 0 = q - 3n - 375345, -282q + 279q + 4n + 1126010 = 0. Round q to the nearest 100000. 400000 Suppose 168102 = 2m - 58364. Let a be (97 - -206663) + (2 - 3 - -8). Suppose -f - m = a. Round f to the nearest one hundred thousand. -300000 Let t(o) = -3769o*2 + 15o - 16. Let s be ((-42)/3)/(1 + -2 - 1). Let h be t(s). Let f = h - -97592. Round f to the nearest 10000. -90000 Let u = -5092 + 5076. Let d = -234 + -153. Let m be (-2)/((-2)/d) + u + 15. Round m to the nearest 100. -400 Let o = 13 + -13.0675. Let u = -0.050939792 - -0.118440446. Let c = o + u. What is c rounded to 7 dps? 0.0000007 Let j = -920188.0784 + 919215. Let u = j + 973. Round u to two decimal places. -0.08 Let z(h) = 2h3 - 46 + 11 + 6h + 12 - 33h2 + 13. Suppose -c + 6c = 80. Let w be z(c). Round w to the nearest 100. -200 Let g = -132385100.88018 - -132387500. Let v = -2368.11982006 + g. Let j = -31 + v. Round j to seven dps. -0.0000001 Let y = -0.831 + 1035.431. Round y to the nearest 100. 1000 Let n = 49.56488 - -8732423.43512. Let r = -8733186.99641 + n. Let w = r + 714. What is w rounded to 4 decimal places? 0.0036 Let j = 42414.5141 - 42417. Round j to 1 dp. -2.5 Let h be (-57 - (-6468)/176)-30285. Round h to the nearest 10000. 240000 Let a = 564.924 - 399.52. Let t = -165 + a. Let m = t - 0.621. What is m rounded to two dps? -0.22 Let x(p) = 676210p*2 - 1 - 3 + 1 + 1089143p*2 + 6p. Let n be x(-3). Suppose 3k + 3911844 + n = 0. Round k to the nearest 1000000. -7000000 Let h(d) = 6d - 5d2 - 4 - 6 - 14 + 961d*3 - 6 + 58. Let j be h(-9). Round j to the nearest 100000. -700000 Let p be 56/(-8) - 1-2. Let y be (6/p)/(3 - 33/10). Suppose -yz - 7454 = 316546. Round z to the nearest one hundred thousand. -100000 Let p = -40.4465 + 40.4060769. Let i = 74 + -73.9596. Let z = i + p. Round z to 6 decimal places. -0.000023 Let o = -2114.95959 - -2115. What is o rounded to 2 decimal places? 0.04 Let t = -127279043.0000004 - -127279079. Let s = 0.1014 + -36.1014. Let n = s + t. What is n rounded to 7 dps? -0.0000004 Suppose 0 = -5r + 4n - 36, -9r = -10r + 3n - 5. Let c be (-90)/r-2(100 - -20). Round c to the nearest one hundred. -2700 Suppose -166988 = -4f + 97172. Let c be f/(-60) - (4/3 + -2). Round c to the nearest one thousand. -1000 Let r be -2924 - 5/(5/(-2)). Round r to the nearest 1000. -3000 Let q = -12369.9995003 + 12370. Round q to five decimal places. 0.0005 Let h = -10731.993455 - -10732. Round h to 3 dps. 0.007 Suppose -4m + a + 6 + 30 = 0, 12 = 4m + 5a. Suppose mz - 11z + 135 = 0. Suppose -234000 = zj - 42j. What is j rounded to the nearest 10000? -80000 Let o = -3877.3 + 3877.3000037639. What is o rounded to 7 dps? 0.0000038 Suppose -16c + 18140838 = 36348399 + 25765239. Round c to the nearest 1000000. -3000000 Let a = -7096834 - -13166819. Suppose a = -k + 2z + z, -5k = z + 30350005. What is k rounded to the nearest 1000000? -6000000 Let s = 183 - 143. Let v = -15 - s. Let l = v - -54.9999969. Round l to 5 dps. 0 Let o = 148 + -195. Let s = -47.00612 - o. Round s to three dps. -0.006 Let a(w) = w3 + 21w*2 + 21w + 15. Let d be a(-20). Let k be (-1 - 0) + (d - -8) + -18602. What is k rounded to the nearest 1000? -19000 Let l = -107067246 + 107067242.75999898. Let a = l + 3.24. Round a to seven decimal places. -0.000001 Let g = -1224196 + 1224196.830033. Let a = -0.881 - -0.051. Let x = g + a. What is x rounded to 5 decimal places? 0.00003 Suppose -3y - 6 = 0, 2y = 5l - 3y - 25. Let w(t) = t*3 - 2t*2 - 3t. Let f be w(l). Suppose -5s - s - 198000 = f. Round s to the nearest ten thousand. -30000 Let s = -0.28066 - -0.65188. What is s rounded to 2 decimal places? 0.37 Let f = 1744100 - 1225500. What is f rounded to the nearest ten thousand? 520000 Suppose 5x - 73 = 2. Suppose -3v = -2z - 27 - 14, 22 = 2v + 4z. Suppose -26800 = -xw + vw. Round w to the nearest 1000. 13000 Let c be 7 - ((0 - 0) + (-8)/(-2)). Suppose -k = -ck + 8. Suppose -5x + 4p = 586, kx + x + 3*p + 593 = 0. What is x rounded to the nearest 10? -120 Let r = -556.72 + 566. Let a = r - 9.279323. What is a rounded to 4 dps? 0.0007 Let g = 24151.000053847 - 24151. What is g rounded to 6 dps? 0.000054 Let v = 101.29125 - -0.14475. Let a = 102 - v. Let p = a + -0.014. What is p rounded to 1 dp? 0.6 Let n = 1303415.7 - 1303416.03793412. Let j = n + 0.297937. Let u = -0.04 - j. Round u to 7 decimal places. -0.0000029 Let l = 44.309989096 - 44.31. Round l to seven decimal places. -0.0000109 Let t = -24 + 73. Let g = 48.935 - t. Let u = -0.01 - g. Round u to 2 decimal places. 0.06 Let n = -337 + 336.99999046. Round n to 6 decimal places. -0.00001 Let h = 683.1028 + -684. Round h to one decimal place. -0.9 Let a =	{ "pile_set_name": "DM Mathematics" }
rt(27) + -2))*2. -52269/1936 Simplify (sqrt(119) + sqrt(119)26 - -1((sqrt(119) - (sqrt(119) - 2sqrt(119)) - sqrt(119)) + sqrt(119)))/(-1sqrt(448)3). -5sqrt(17)/8 Simplify 0 + (4sqrt(175) - (1 + sqrt(7) + -3 + sqrt(7))). 2 + 18sqrt(7) Simplify 4((sqrt(2448) - (sqrt(2448) + sqrt(2448)3 + -5)) + -1). -144sqrt(17) + 16 Simplify 1 + ((sqrt(684)-1 + sqrt(684))-4-2)2. 1 Simplify (0 + (-2 + (sqrt(147) + 2)2 - (1(sqrt(147) + sqrt(147) + 2))2)-6)5. 840sqrt(3) + 13290 Simplify (-2((sqrt(363) - (sqrt(363)-2-4 - sqrt(363) - sqrt(363))) + 4(sqrt(363) + -1)) + -5)*2. 132sqrt(3) + 1461 Simplify (sqrt(18) + sqrt(216)/(sqrt(24)/sqrt(2)) + (sqrt(72) + -1sqrt(72) + sqrt(72) - sqrt(72)))/(sqrt(27)/(sqrt(3)2) + sqrt(63)/(sqrt(7)1)). 4sqrt(2)/3 Simplify (sqrt(88)/(sqrt(8)-2))2 + 5 + -4 + 1 + sqrt(539). 19/4 + 7sqrt(11) Simplify (sqrt(612)-34 - sqrt(612) - (-3sqrt(612) + -2))2 + -5. -240sqrt(17) + 61199 Simplify sqrt(3)2-5 + 5 + sqrt(12)/sqrt(4) - 2(sqrt(3) + -1 + 4)2. -21sqrt(3) - 19 Simplify (sqrt(48)/(sqrt(288) + -2sqrt(288)))/((sqrt(60) - -1sqrt(240))/sqrt(5)). -sqrt(2)/36 Simplify 3 + (sqrt(288)2 + -4 - (sqrt(288) + -1)1)*2. -72sqrt(2) + 300 Simplify (sqrt(110)1-3 - sqrt(110))/(sqrt(10)-2-2) - (sqrt(44) + (-2sqrt(2156) - sqrt(2156)) + sqrt(2156))/((sqrt(4) - sqrt(16))1). -14sqrt(11) Simplify 0 + -4 + 5 + sqrt(1539) + -2. -1 + 9sqrt(19) Simplify (5sqrt(360))/(sqrt(242)-5 - sqrt(2)). -15sqrt(5)/28 Simplify (1 + 0 + (sqrt(2057) + -1 + 5 - sqrt(2057)) + -4)2. 1 Simplify 6(sqrt(170) - (sqrt(170) + sqrt(170) + 2sqrt(170)1))/((sqrt(10) + sqrt(10) + sqrt(20)/sqrt(2) + sqrt(10))-2)-5. -45sqrt(17)/4 Simplify (1(-6(sqrt(1377) + sqrt(1377) + sqrt(1377) + 1 + 0) + ((sqrt(1377) - sqrt(1377)2) + 4)-6))2. 6480sqrt(17) + 199188 Simplify (4sqrt(125)/sqrt(5) + sqrt(25) - sqrt(25)2-6)/(sqrt(45)-4 - -1sqrt(500)). -17sqrt(5)/2 Simplify 2(-3 + (-1 + sqrt(38)/(sqrt(4)/sqrt(2)) - (5 + sqrt(38)/sqrt(2) + -3))2). 12 Simplify (-6(-4 + -2 + sqrt(98)))2 + (5 + (sqrt(98) - (sqrt(98) + (sqrt(98) + 1 - sqrt(98)))) + 5)2. -3024sqrt(2) + 4905 Simplify (5sqrt(112)-1-6)*2 + -2((sqrt(700) + 1 + sqrt(700))-2)2. -320sqrt(7) + 78392 Simplify (1 + (sqrt(1573)1 + sqrt(1573) + -5)-6 + 5)*2. -9504sqrt(13) + 227808 Simplify 4 + sqrt(320)-4 + 0. -32sqrt(5) + 4 Simplify (sqrt(528)-1 + 5sqrt(66)/sqrt(2) + sqrt(33) + sqrt(33))/(sqrt(11) - sqrt(99)5 - (sqrt(539) - sqrt(539)-1)). -3sqrt(3)/28 Simplify (-3(-1(sqrt(153) - (sqrt(153) + sqrt(153)-3) - sqrt(153)) - sqrt(153)))/(((-4sqrt(162))/sqrt(3))/sqrt(6)). -9sqrt(17)/4 Simplify -5(1 + (sqrt(343) - (3 + -2sqrt(343)) - sqrt(343)) - (-1 + sqrt(343) + -4 + -4)). -35sqrt(7) - 35 Simplify (sqrt(243)-2 + sqrt(3) - 6sqrt(9)/sqrt(3))2 + 4(sqrt(12)/sqrt(2))/sqrt(2)-6. -24sqrt(3) + 1587 Simplify (43(-4 + 2sqrt(448))1)*2. -18432sqrt(7) + 260352 Simplify (sqrt(24) - -4sqrt(72)/sqrt(3) - (sqrt(1944)2 - sqrt(24)))/(-41sqrt(972)). sqrt(2)/3 Simplify (6(-4 + (sqrt(19) - (2 + sqrt(19)))) + (sqrt(19) + 0 + sqrt(19) - sqrt(19)) + -3 + sqrt(76)5)*2. -858sqrt(19) + 3820 Simplify (4 + (sqrt(272) - -6(sqrt(272)-1 - sqrt(272)))-4)2. 1408sqrt(17) + 526608 Simplify ((sqrt(209)-2-1)/(sqrt(11) - (-6(sqrt(11) - sqrt(396)) + sqrt(11))) + -3)26. 12sqrt(19)/5 + 4088/75 Simplify (11(sqrt(152) + sqrt(152)3))/(-2sqrt(8)-1 - ((2sqrt(800) - sqrt(800)) + sqrt(8))). -4sqrt(19)/9 Simplify (sqrt(187)16)/(sqrt(176)-3). -sqrt(17)/2 Simplify ((sqrt(196) - 1(sqrt(196) + sqrt(196)-1 - sqrt(196)))/(sqrt(6)/sqrt(3)-2 - (sqrt(2) - 2sqrt(288))))21. 8/9 Simplify (-6-5sqrt(15)/sqrt(3))*2 + (sqrt(100)-5)/sqrt(5) + 4. -10sqrt(5) + 4504 Simplify (sqrt(77) + 1sqrt(77)5 - (sqrt(77) + -1sqrt(77)-4))/(6((sqrt(1008) - sqrt(1008)1 - sqrt(1008)) + sqrt(1008) - sqrt(1008))). -sqrt(11)/72 Simplify (2(-1 + sqrt(3200)-1 + sqrt(3200)) + sqrt(3200) + sqrt(3200) + 5 + sqrt(3200)-1 + 5(sqrt(3200) + 1))2. 3840sqrt(2) + 115264 Simplify (sqrt(76) - (-4 + sqrt(76) + sqrt(76) + sqrt(76) + sqrt(76)) - sqrt(76))*2 + -4 - ((-3sqrt(1216))*2 + sqrt(19))-5. -59sqrt(19) + 55948 Simplify ((sqrt(264)-1)/sqrt(6)6)/(sqrt(324) - (sqrt(324) - sqrt(324)1)-2). -2sqrt(11)/3 Simplify -1 + 3 + sqrt(5) + 1 + sqrt(5) + -1 + -1sqrt(5). 2 + sqrt(5) Simplify sqrt(49)/(sqrt(42)/(2sqrt(6))) - (1 + sqrt(112) - (1 + (sqrt(7) + sqrt(7) + -2 - sqrt(7)))*2). -4sqrt(7) + 7 Simplify ((-4(sqrt(3) + sqrt(12) + sqrt(3)) + sqrt(30)/sqrt(40))-5 - (2sqrt(2160))/(sqrt(40)/sqrt(72)))2. 363/4 Simplify 5(3(1 + sqrt(1300))2 + (-5-3sqrt(1300))2 + 1). 300sqrt(13) + 1482020 Simplify ((sqrt(200)2)2 + 3 - 4(-2 + sqrt(200)))-2. -1622 + 80sqrt(2) Simplify 4 + -1 + 5 + ((-3sqrt(66))/sqrt(6))2 + sqrt(88)/(sqrt(8) + sqrt(8)1 + sqrt(8)). sqrt(11)/3 + 107 Simplify (5(3(sqrt(125) + 1 + (sqrt(125) - sqrt(125)-2)) + -3)-2)*2. 1800000 Simplify (sqrt(119)/sqrt(1575) + (sqrt(17) - (sqrt(170) + -3sqrt(170) + sqrt(170))/sqrt(10) - sqrt(17) - sqrt(17)) + -5)*2. -2sqrt(17)/3 + 5642/225 Simplify 0 + ((sqrt(95)/(sqrt(5) + sqrt(5)-4)5)*2 - (-5sqrt(304)4)2). -1093925/9 Simplify (-1sqrt(21)-1 + sqrt(21))/(4sqrt(448)). sqrt(3)/16 Simplify -1((sqrt(70) - -2sqrt(70)-2) + (sqrt(70) - (1sqrt(70) - sqrt(70)))-6)/(sqrt(100)/(sqrt(10) + (sqrt(80) + sqrt(20))/sqrt(2))). 36sqrt(7) Simplify ((-3 + (sqrt(1053)1 - sqrt(1053))2 - ((sqrt(65) + -1sqrt(65)-2 - sqrt(65)) + sqrt(65))/sqrt(5)) + -1)-3. 12 + 9sqrt(13) Simplify (-5 + (2sqrt(76))/sqrt(4))*2 + ((sqrt(2736) + 0 - sqrt(2736))6)*2. -20sqrt(19) + 101 Simplify -4 + -1 + sqrt(931) + 1 - (-2 + sqrt(209)/(sqrt(704)-1)). -2 + 57sqrt(19)/8 Simplify ((sqrt(96) + sqrt(96)-1)/sqrt(8) + sqrt(1452)-1 + sqrt(1452) - sqrt(300)2-3)*2. 10800 Simplify -4 + (2 + sqrt(190)/sqrt(40) - -3(sqrt(19) + (sqrt(19) + (sqrt(1216)1 - sqrt(1216)) - sqrt(19))2)) + -2. -4 + 7sqrt(19)/2 Simplify (-1(sqrt(931) - (-2 + sqrt(931) + -2))5 + 3)*2. 289 Simplify (sqrt(399)/(1sqrt(35)/sqrt(5)))/(sqrt(432)25). sqrt(19)/120 Simplify ((sqrt(119) + (-1sqrt(119)1 - sqrt(119)))-4)/(sqrt(112) - (sqrt(7) - (sqrt(7) - (sqrt(7) + 2(sqrt(7) - sqrt(63)))))). 4sqrt(17)/7 Simplify (sqrt(80)/(sqrt(8) + -4sqrt(24)/sqrt(3)))/(2sqrt(98) - sqrt(6)/(sqrt(6)/sqrt(2))). -sqrt(5)/39 Simplify -1(((sqrt(400)/sqrt(8) - (sqrt(2) + (sqrt(72) - sqrt(2)))-2) + 4)-6)*2. -21384 - 4896sqrt(2) Simplify (sqrt(468) + -1 + sqrt(468) - sqrt(117)/(sqrt(9)1))2 + -4 + (2 + (-2sqrt(91))/sqrt(7))*2. -30sqrt(13) + 1626 Simplify (-6(sqrt(90)-2)/sqrt(3))/(((sqrt(100)-2 + sqrt(100))/sqrt(10) - sqrt(10))-4)3. 9sqrt(3)/2 Simplify (4(sqrt(153) + -1) + (sqrt(153) + -1)-6 - (sqrt(153) - (-5 + 1sqrt(153)) - (sqrt(153) + 1sqrt(153) + 3)))*2. 0 Simplify (-1 + sqrt(200)/(-1sqrt(4)) - (sqrt(72)3 + 6sqrt(18)2))2. 118sqrt(2) + 6963 Simplify ((((sqrt(76)4 + sqrt(76) - sqrt(76)) + sqrt(76) - sqrt(76))-5 + sqrt(76))/sqrt(4))*2 - sqrt(76)/(sqrt(300)/sqrt(3)). -sqrt(19)/5 + 6859 Simplify (-1 + ((sqrt(114) - (sqrt(114) - sqrt(114)-1))-6)/(sqrt(6) + (sqrt(96) - (sqrt(96)-1 + sqrt(96))) + sqrt(96)))3. -3 + 2sqrt(19) Simplify -3(-3(-5(sqrt(891) + (sqrt(891) - (sqrt(891) + 1)) + sqrt(891)) - sqrt(891))-2)*2. -11646288 + 106920sqrt(11) Simplify (sqrt(8)-6-6)/(sqrt(4) - sqrt(32)/(sqrt(8)5)). 45sqrt(2) Simplify 0 + ((sqrt(45)/sqrt(3)-4)/(sqrt(192)/sqrt(4)))2. 5 Simplify ((-1sqrt(108) + -4 + sqrt(108))6 - ((sqrt(108) - 5sqrt(108)-5) + -5))2. 5928sqrt(3) + 73369 Simplify (sqrt(3400)-3)/(sqrt(18)/sqrt(9)2). -15sqrt(17) Simplify ((2sqrt(504)-5 + sqrt(504))/sqrt(12))/(sqrt(18)/sqrt(3)-5 + (sqrt(72)/(sqrt(48)/sqrt(4)) - sqrt(6))). 9sqrt(7)/5 Simplify ((sqrt(156)4 + sqrt(156))-1)/(sqrt(144)/(sqrt(12) - (sqrt(12) + sqrt(36)/sqrt(3)))). 5sqrt(13) Simplify ((3(sqrt(3388)1 - sqrt(3388)) + sqrt(3388))/((sqrt(6912)-1)/sqrt(12)))2. 847/144 Simplify 1 + (sqrt(288)2 + sqrt(288))/(-6sqrt(12)/sqrt(2)). -2sqrt(3) + 1 Simplify (sqrt(180)/(sqrt(12) - (sqrt(12) - sqrt(12)-2) - sqrt(12)))/(sqrt(80)2). -sqrt(3)/24 Simplify ((sqrt(324) + sqrt(4))-5)/(sqrt(36)/sqrt(2)). -50sqrt(2)/3 Simplify -2 + ((sqrt(77)36)/(sqrt(110)/(-3*sqr	{ "pile_set_name": "DM Mathematics" }
divisor of 50 and j? 25 Let g = 3 + 0. Suppose gx - 12 - 9 = 0. Let a = -39 - -74. What is the highest common divisor of x and a? 7 Suppose -3x + 7x - 36 = 0. Suppose 2u + 2g = 136, -3g = -u + 14 + 70. Calculate the highest common factor of x and u. 9 Let x(j) = -j*2 - 6j. Let v be x(-5). Suppose -d - v = -2d. Suppose -29 - 16 = -dz. Calculate the highest common divisor of 81 and z. 9 Let w = -32 + 137. Suppose -2 = p - 4, -142 = -5y + 4p. Suppose 3f = y + w. What is the highest common divisor of 5 and f? 5 Suppose 98z = 99z - 8. Let y be (-1)/(-3) + (-526)/(-6). Calculate the highest common divisor of z and y. 8 Suppose 306 = 5q + 6. Let i(x) = -5x - 3. Let r be 3/(-6)32. Let y be i(r). Calculate the highest common factor of q and y. 12 Let p be 20/8(-3 - 9). Let n be ((-396)/15)/(9/p). What is the greatest common factor of n and 8? 8 Suppose 4d + 0d = 16. Calculate the highest common divisor of d and 6. 2 Let i = -3 + 12. Let g(p) = p*3 - 9p*2 + 2p + 9. Let r be g(i). Let n be 141/r - 4/18. Calculate the greatest common divisor of 5 and n. 5 Let d(i) = i + 10. Let m be d(0). Suppose -8q + 4q + 36 = 0. Suppose r = x - 14, 2r + 39 = 4x - q. What is the greatest common factor of m and x? 10 Let k(f) be the first derivative of -f*2/2 - 1. Let g be k(-5). Suppose -2a = 3n - 83, n = -n + 2. What is the greatest common divisor of a and g? 5 Suppose -108 = -3m + 4x + 209, x + 5 = 0. Let p(d) = -11d*3 + d + 1. Let r be p(-1). Calculate the greatest common factor of r and m. 11 Suppose 161 = 4z - 179. Let y = -57 + z. Calculate the greatest common divisor of y and 14. 14 Let a = 53 + 2. Calculate the greatest common factor of 220 and a. 55 Let z be 8 + (0 - 4) + 5. Let x(q) be the second derivative of q*4/6 - 7q*3/6 - 3q*2/2 + q. Let k be x(z). Calculate the highest common factor of 12 and k. 12 Let b be 1-281/(-2). Let d = 23 + -16. Calculate the greatest common factor of b and d. 7 Let h = 15 - 27. Let p = h + 21. Calculate the greatest common divisor of 45 and p. 9 Let d be (-2)/8 + (-9)/(-36). Suppose 3i + 15 = d, 3i - 5 = -3j + 13. Calculate the greatest common factor of j and 77. 11 Let j(w) = 2w2 - 4. Let v(c) = -c2 - 5c + 4. Let d be v(-5). Let r be j(d). What is the highest common factor of 42 and r? 14 Let v be (-3 - (0 - 4)) + 27. Calculate the greatest common divisor of 112 and v. 28 Suppose -8 + 59 = 3b. Calculate the highest common divisor of b and 85. 17 Let j = -45 + 63. What is the greatest common factor of 12 and j? 6 Let r = 9 - 3. What is the highest common divisor of 18 and r? 6 Let h(n) = -3n - 2. Let m be h(-6). Suppose -48 = -4z - m. Calculate the greatest common factor of 64 and z. 8 Let r be 7/((-147)/(-1146)) - (-28)/(-49). Calculate the highest common factor of 12 and r. 6 Suppose 1 - 5 = -2p. Let l be (6 - -3)/(1/p). Suppose 2v - 5r - 103 = -33, 3r - 192 = -4v. Calculate the greatest common divisor of v and l. 9 Suppose 85 = 3f - 5h, 0f = 3f + 2h - 71. Let s be (-5 - 0)(-47 + 2). Calculate the greatest common divisor of f and s. 25 Let v be -21/(-2)29. Suppose f = -5k + 50, -3k + 4k = -4f + v. Calculate the highest common divisor of k and 9. 9 Let c be 7 - 3/44. Let x be (c/(-6))/((-1)/6). What is the greatest common divisor of 6 and x? 2 Let z(a) = a. Let m be z(3). Suppose -j + 17 - 155 = -5b, mj = -b + 18. What is the greatest common factor of 18 and b? 9 Let k be (-3 - 0 - -22) + 2. Suppose -4d + 7 = -k. Let w(q) = -6q + 4. Let t be w(-4). Calculate the highest common divisor of t and d. 7 Let v be 10/(-4)(1 - 3). Suppose 4i + 2b + 6 = 4b, 5b = -vi + 30. Let w = i + 1. Calculate the greatest common divisor of 2 and w. 2 Let j be (-2 - (1 + 0))/(2 - 3). Calculate the greatest common divisor of 15 and j. 3 Let d(a) = -a3 - 8a*2 - 3a + 4. Let m be d(-8). Calculate the greatest common divisor of m and 7. 7 Suppose 4v - 12 = -0v. Let d be (3 - 2)/(v/495). What is the greatest common divisor of 15 and d? 15 Let v = -8 - -8. Let p be 59 - (v + -2 + 1). What is the greatest common factor of 20 and p? 20 Suppose 5j - 2k = -21, 3j + 1 + 5 = -k. Let f be (3 + j)/(-1) - 0. Let d be (f + -3)1 - -36. What is the highest common factor of d and 22? 11 Suppose s - 3s = -32. Calculate the greatest common divisor of 4 and s. 4 Let x(o) = o2. Let w be x(-1). Let v be (485 - -1)w/2. Calculate the highest common factor of v and 27. 27 Let d(s) = -s - 2. Let m(o) = 3o + 5. Let h(f) = 17d(f) + 6m(f). Let x be h(6). Suppose -q + 8 = -x. Calculate the greatest common divisor of q and 80. 10 Let g = 49 - 35. Suppose -2z - 5b + 48 = -13, -80 = -3z + 4b. Calculate the greatest common divisor of z and g. 14 Let y = 12 + -6. Let j(b) = -b2 + 1. Let p be j(1). Suppose -g - 3g + 16 = p. Calculate the highest common divisor of y and g. 2 Suppose 0 = 4j - j + 3u, -u = -3j - 12. Let x be (-4)/(4/j) + 0. What is the greatest common divisor of 33 and x? 3 Let d(m) = -4m*3 - 2m*2 + m. Let p be d(1). Let o be (52/5)/((-2)/p). What is the greatest common divisor of o and 26? 26 Let y = 79 + -76. What is the highest common divisor of 21 and y? 3 Let l(d) = -d + 4. Let o be l(0). Let t be 6/(o/2246). Calculate the highest common factor of 8 and t. 8 Let o = 3 + 4. Let x = o - 3. Let j(s) = 26s + 4. Let r be j(x). Calculate the greatest common factor of r and 12. 12 Let g = -5 - -3. Let v be 8 + -6 - 80/g. Calculate the highest common divisor of 6 and v. 6 Suppose -1 = 2c - 3. Let j be 450/(-27)(-2 - c). What is the highest common divisor of 10 and j? 10 Let n = 11 + -10. What is the highest common factor of 4 and n? 1 Suppose -360 = -8d + 4d. Calculate the greatest common divisor of 10 and d. 10 Let v(q) = -q + 21. Let h be v(11). What is the highest common factor of h and 5? 5 Let c(k) = -k + 11. Let g be c(8). Let l = 29 + g. What is the highest common factor of l and 8? 8 Let t = 14 + 11. What is the highest common divisor of 50 and t? 25 Let v(q) = -q2 + q + 6. Suppose 3c = c. Let z be v(c). Let b(r) = -r*2 - 13r + 6. Let k be b(-10). Calculate the highest common divisor of k and z. 6 Let m be (-25/(-20))/((-3)/(-330)). Calculate the highest common factor of m and 5. 5 Let u be 29/((-4)/82)-2. What is the highest common factor of u and 87? 29 Let y = -1 - -3. Suppose 3l + 4u + 39 = 0, -3l + yu = u + 24. Let w be (-3)/l0 + 60. What is the greatest common divisor of w and 24? 12 Let g(t) = 31t - 1. Let m = -1 - -1. Let p be 1 + m/(6/3). Let y be g(p). Calculate the highest common factor of y and 75. 15 Let y = 11 - 73. Let r = y - -110. What is the greatest common factor of r and 6? 6 Let j be 20/(-70) + 172/14. Calculate the greatest common factor of 96 and j. 12 Suppose -f - 10 = -5n - 69, -3f + 121 = -n. What is the highest common divisor of f and 351? 39 Let g(w) = -3w + 9. Let k be g(7). Let s be k/(-18)(-255)/(-2). What is the highest common factor of 34 and s? 17 Let b(l) = -32l + 2. Suppose 5d = 4d + 3a + 1, -5d - 4a = 14. Let y be b(d). What is the greatest common divisor of y and 6? 6 Let i = 32 + -20. Calculate the highest common factor of i and 12. 12 Let w be 1 + 7 + -1 - 0. Let z = 9 + w. Let x be 52/z + 2/(-8). Calculate the greatest common divisor of x and 27. 3 Let k be (1/(-2))/1-34. Let x = -274 - -83. Let y = x + 276. What is the greatest common divisor of k and y? 17 Let c be 671/8 - (-6)/48. Calculate the greatest common factor of 12 and c. 12 Suppose -3v + 35 = 2v. Suppose -3 + v = 4l. Let b be -8((l - 1) + -5). What is the greatest common divisor of b and 10? 10 Suppose 16 = 3z - 2f, -5z - f - 3f = -34. Let i be 1(-4)/(z/(-3)). What is the greatest common divisor of 3 and i? 1 Suppose 5t - 153 = x, -x - 68 = 5t + 55. Let s = x - -325. What is the greatest common divisor of s and 17? 17 Let d be (-1 + 4)/3 - -1. Suppose 3z - dm = -11, 0 = 2z - 3m - m + 18. Let y = 2 + z. What is the highest common divisor of 3 and y? 1 Let f = -141 + 261. What is the highest common factor of 45 and f? 15 Let q = -68 - -78. What is the highest common factor of 80 and q? 10 Let t = 81 + -58. Calculate the greatest common factor of t and 23. 23 Suppose 0 = 4w + 209 - 41. Let r = w + 182. Ca	{ "pile_set_name": "DM Mathematics" }
ment from {h: 2, i: 1, x: 1, n: 2, a: 1, q: 2}. Give prob of picking 1 x, 1 i, and 1 a. 1/84 What is prob of picking 2 x when two letters picked without replacement from {x: 2, c: 1}? 1/3 Two letters picked without replacement from qbuu. Give prob of picking 1 b and 1 q. 1/6 Four letters picked without replacement from yzykyyikydyzkdyvizi. What is prob of picking 2 i, 1 y, and 1 k? 21/1292 Four letters picked without replacement from {j: 2, g: 1, y: 3, m: 1, i: 5}. Give prob of picking 1 m, 1 y, 1 i, and 1 g. 1/33 What is prob of picking 1 l, 1 v, and 1 j when three letters picked without replacement from {z: 6, c: 1, v: 3, j: 1, l: 1}? 3/220 What is prob of picking 2 r when two letters picked without replacement from {r: 5, c: 3}? 5/14 Three letters picked without replacement from jjjpjjjjjjjjjjjjjjjj. What is prob of picking 3 j? 17/20 What is prob of picking 2 i, 1 v, and 1 j when four letters picked without replacement from {j: 4, v: 1, i: 6, o: 2}? 12/143 What is prob of picking 1 n and 1 w when two letters picked without replacement from {a: 6, w: 4, n: 4}? 16/91 Calculate prob of picking 1 q and 2 x when three letters picked without replacement from nxqxxxqxxxqqx. 56/143 Two letters picked without replacement from {t: 12, s: 3, x: 2}. What is prob of picking 1 t and 1 x? 3/17 Three letters picked without replacement from nntttlt. Give prob of picking 2 t and 1 n. 12/35 What is prob of picking 2 a and 2 b when four letters picked without replacement from {b: 14, a: 5}? 455/1938 Two letters picked without replacement from yoyroh. Give prob of picking 2 o. 1/15 Three letters picked without replacement from zzlzrlzllrlzllz. Give prob of picking 2 r and 1 l. 1/65 Calculate prob of picking 1 f and 1 w when two letters picked without replacement from {k: 5, w: 4, f: 3}. 2/11 What is prob of picking 2 f when two letters picked without replacement from ffss? 1/6 What is prob of picking 1 p, 1 j, and 1 f when three letters picked without replacement from fpfpppppffpppfppjp? 5/68 Four letters picked without replacement from nnpvvpnnvnnnnnvnh. Give prob of picking 4 v. 1/2380 What is prob of picking 2 q and 1 w when three letters picked without replacement from {w: 8, q: 2, b: 3, f: 2, n: 4}? 8/969 Three letters picked without replacement from {v: 1, o: 5, k: 5}. Give prob of picking 3 o. 2/33 What is prob of picking 2 h and 1 g when three letters picked without replacement from {f: 1, g: 1, z: 2, h: 10}? 45/364 Two letters picked without replacement from yttyitittttittt. What is prob of picking 2 i? 1/35 Calculate prob of picking 1 w, 2 s, and 1 v when four letters picked without replacement from iisvvgwsii. 1/105 Calculate prob of picking 4 t when four letters picked without replacement from ttytttsjj. 5/126 Two letters picked without replacement from dbbcnfcbddnbdd. What is prob of picking 2 n? 1/91 What is prob of picking 1 k and 1 d when two letters picked without replacement from {c: 1, b: 3, k: 1, d: 10}? 2/21 Two letters picked without replacement from {q: 6, l: 3, f: 8}. What is prob of picking 1 q and 1 l? 9/68 Two letters picked without replacement from bppbmkhbmbbkkkkmk. Give prob of picking 1 k and 1 b. 15/68 Calculate prob of picking 2 s and 1 q when three letters picked without replacement from {s: 5, z: 1, l: 1, q: 4, f: 1, y: 1}. 20/143 Four letters picked without replacement from zzzzzzeeze. What is prob of picking 3 e and 1 z? 1/30 Three letters picked without replacement from {l: 2, h: 1, k: 2, o: 2, j: 1}. Give prob of picking 2 l and 1 j. 1/56 Three letters picked without replacement from uuduuuuuduuduuduuu. Give prob of picking 1 d and 2 u. 91/204 Calculate prob of picking 1 h and 1 w when two letters picked without replacement from whuuruuuuucchc. 2/91 What is prob of picking 1 g and 1 j when two letters picked without replacement from wgddsjjf? 1/14 What is prob of picking 4 x when four letters picked without replacement from {v: 2, x: 18}? 12/19 Three letters picked without replacement from {y: 2, d: 1, l: 2, c: 1, h: 1, k: 2}. What is prob of picking 1 y, 1 c, and 1 d? 1/42 Three letters picked without replacement from {k: 3, q: 1, t: 3}. Give prob of picking 2 k and 1 t. 9/35 Three letters picked without replacement from {n: 1, c: 1, a: 1, i: 2, m: 5}. What is prob of picking 1 m, 1 a, and 1 c? 1/24 Calculate prob of picking 1 o and 1 s when two letters picked without replacement from ossdsssddossds. 16/91 What is prob of picking 3 m when three letters picked without replacement from {m: 7}? 1 What is prob of picking 1 y and 1 m when two letters picked without replacement from {y: 5, u: 6, m: 4}? 4/21 Three letters picked without replacement from ddiodpiddaopadiaidda. What is prob of picking 2 a and 1 p? 1/95 Calculate prob of picking 4 w when four letters picked without replacement from ewewww. 1/15 Calculate prob of picking 1 u and 1 o when two letters picked without replacement from {b: 2, u: 1, t: 1, o: 2}. 2/15 Four letters picked without replacement from {v: 4, h: 3, s: 1, n: 2}. Give prob of picking 2 h, 1 n, and 1 s. 1/35 Calculate prob of picking 2 j when two letters picked without replacement from {k: 1, x: 1, b: 2, j: 4}. 3/14 Three letters picked without replacement from {w: 6, q: 2, o: 3, g: 3, v: 4}. Give prob of picking 2 w and 1 g. 15/272 Calculate prob of picking 1 n and 1 b when two letters picked without replacement from {n: 3, t: 2, b: 5, d: 1, o: 1}. 5/22 Three letters picked without replacement from yzcccrbzzzrbzrz. What is prob of picking 2 r and 1 z? 18/455 Calculate prob of picking 1 k and 2 v when three letters picked without replacement from {k: 7, v: 5}. 7/22 Two letters picked without replacement from {n: 3, h: 1, x: 1, t: 7}. Give prob of picking 1 x and 1 t. 7/66 Calculate prob of picking 4 e when four letters picked without replacement from {o: 2, v: 1, e: 4}. 1/35 Four letters picked without replacement from hthhhthhhhhh. Give prob of picking 4 h. 14/33 Four letters picked without replacement from quuhquunqhguqugunuq. Give prob of picking 2 u, 1 n, and 1 q. 70/969 What is prob of picking 1 d, 1 y, and 1 i when three letters picked without replacement from {g: 1, d: 1, i: 2, y: 1}? 1/5 What is prob of picking 2 c when two letters picked without replacement from wcwppcwpwpwkwpkpwww? 1/171 Four letters picked without replacement from cbofnbncccncnfcc. What is prob of picking 2 c and 2 f? 3/260 What is prob of picking 1 f and 3 n when four letters picked without replacement from {i: 2, f: 1, n: 3, s: 1}? 1/35 Four letters picked without replacement from hghhhfhhhhfhhh. What is prob of picking 2 h, 1 f, and 1 g? 10/91 Three letters picked without replacement from {o: 4, w: 5, r: 1, p: 1, q: 1}. Give prob of picking 1 w and 2 o. 3/22 Two letters picked without replacement from fpqqp. What is prob of picking 2 p? 1/10 Calculate prob of picking 2 x when two letters picked without replacement from exxmesxxxmxmmsmmxsm. 7/57 Two letters picked without replacement from ccscssscsbbc. What is prob of picking 1 b and 1 s? 5/33 What is prob of picking 3 r when three letters picked without replacement from rqrprrrmmqmrmqqq? 1/28 What is prob of picking 1 x, 2 h, and 1 u when four letters picked without replacement from {x: 2, o: 7, f: 2, h: 3, u: 4}? 2/255 What is prob of picking 1 i and 2 t when three letters picked without replacement from {i: 1, t: 2, o: 1, n: 1}? 1/10 Three letters picked without replacement from {h: 3, s: 5, x: 2, t: 2}. What is prob of picking 3 s? 1/22 What is prob of picking 1 b, 2 u, and 1 w when four letters picked without replacement from ubbwu? 2/5 Two letters picked without replacement from mtowb. What is prob of picking 1 b and 1 m? 1/10 What is prob of picking 2 i, 1 m, and 1 n when four letters picked without replacement from {m: 4, i: 3, n: 1}? 6/35 Calculate prob of picking 3 h and 1 e when four letters picked without replacement from {h: 18, e: 2}. 32/95 Three letters picked without replacement from {g: 1, i: 5, v: 4}. Give prob of picking 3 v. 1/30 Calculate prob of picking 2 n when two letters picked without replacement from pnnnnybnupnnntntnpt. 5/19 What is prob of picking 4 g when four letters picked without replacement from ggggglgglggg? 14/33 Two letters pick	{ "pile_set_name": "DM Mathematics" }
factors of g. 11 Let w = 19 + -7. Let h = 2 + w. Let p = 25 - h. List the prime factors of p. 11 Suppose -113 + 643 = 5x. List the prime factors of x. 2, 53 Let v = 33 - 25. List the prime factors of (-67)/(-2) - v/(-16). 2, 17 Let x = -25 - -42. What are the prime factors of x? 17 Let g(t) = -t3 + 5t*2 - 2t - 1. Let x = -4 - 0. Let b be x/10 - (-24)/10. List the prime factors of g(b). 7 Suppose 0 = -5c + 11 + 4. Suppose 5m + 4g - 20 = 45, cg - 24 = -m. What are the prime factors of m? 3 Let x = -95 + 67. Let z = 63 + x. What are the prime factors of z? 5, 7 List the prime factors of 1205/45 - 6/(-27). 3 Suppose 5m - 170 = -2u, 425 = 2u + 3u - 3m. List the prime factors of u. 5, 17 Let n(r) = 0 + 3 - 6 + r. Let s be n(7). What are the prime factors of (8/5)/(s/10)? 2 Let x(z) = z + 20. Let a(u) = u2 + 8u + 3. Let g be a(-4). What are the prime factors of x(g)? 7 Suppose 4z = -3 - 5. List the prime factors of (-97)/z - 2/4. 2, 3 Let c(t) = -14t3 - t2 - 2t - 1. Suppose -s - 1 = -0s. List the prime factors of c(s). 2, 7 Let w(q) = -26q - 1. What are the prime factors of w(-1)? 5 Let z be 30 + 3/3 - -2. Let w = z + -18. Suppose -4f = f - w. What are the prime factors of f? 3 Let b(q) = q*2 - 9q + 9. Let m be b(8). Let x be (m - -3)/(-3 + 2). Let u(n) = -3n. List the prime factors of u(x). 2, 3 Let w(c) = 2c + 7. Let n be w(-8). Let d(z) = -z*3 - 8z*2 + 8z - 9. Let m be d(n). List the prime factors of 6/(-10)(m - 5). 3 Suppose 0 = -4z + 16, 0y = -3y - 4z + 25. Suppose -9 = -yw - 0. Let q(a) = 5a - 3. List the prime factors of q(w). 2, 3 Suppose -2l = 3l - 225. What are the prime factors of (-10)/l + (-47)/(-9)? 5 Let k(q) = 2q - 12. List the prime factors of k(21). 2, 3, 5 Let y be 8(3/12 - 1). Let j be (0 + -1)(y - -1). Suppose ja + 6f = f - 10, -24 = -3a + 3f. List the prime factors of a. 3 Let x = 7 - 4. Let i(b) = -2b2 + x - 2b*3 - b + 7b + 1 + b*3. List the prime factors of i(-4). 2, 3 Suppose 8 = 3f - f. Suppose 17 = 2v - 2h - 1, -3v + 22 = -fh. List the prime factors of v. 2, 7 Let y(h) = 85h2 - 4h - 3. What are the prime factors of y(-1)? 2, 43 Let w(m) = -m*3 + 5m*2 - 8m + 0 + 3m + 3. List the prime factors of w(3). 2, 3 Suppose -5v = -0 + 20. What are the prime factors of (16/20)/(v/(-50))? 2, 5 Let r(s) be the second derivative of s4/12 - s3/3 - s. What are the prime factors of r(-5)? 5, 7 Suppose -p - 4p + 1265 = 0. List the prime factors of p. 11, 23 Suppose -2u + r + 7 = -u, 4u + r = 13. Let d be (u - 2)(-7)/2. What are the prime factors of (-103)/d + (-6)/(-21)? 3, 5 Let y(c) = c*3 - 7c*2 - 6c - 4. What are the prime factors of y(8)? 2, 3 Suppose 3a - 2o + o = 348, -4a + 3o = -464. List the prime factors of a. 2, 29 Suppose 3q - 546 = -5m, -3q - 23 = -m + 79. What are the prime factors of m? 2, 3 Let d = 41 + -20. List the prime factors of (-4)/(-14) - (-267)/d. 13 Let y be (8/6)/(6/(-9)). Let h(b) be the first derivative of -b4/2 - b3/3 + b2 - b - 2. What are the prime factors of h(y)? 7 Let z be (15 + -2)(2 - 1). Let q = z - 3. What are the prime factors of q? 2, 5 Let t = 79 + -57. Let p(x) = -4x3 - x2 - 2x - 1. Let g be p(-1). Suppose -2k + t = g. List the prime factors of k. 3 Let x(w) = -1. Let t(y) = 5y + 3. Let j(z) = t(z) + 6x(z). Let f be j(3). List the prime factors of (-2)/(-3) - (-112)/f. 2, 5 Let h be (4(1 + 0))/2. Suppose 0 = z + 2, 6x - 4x - 14 = hz. Suppose 50 = 3v - xu, 2v - 5v - 5u + 10 = 0. What are the prime factors of v? 2, 5 Let n(y) be the second derivative of 1/12y4 + 0 + 7/6y*3 + 0y*2 - y. What are the prime factors of n(-8)? 2 Suppose -2w + 49 - 1 = 0. List the prime factors of w. 2, 3 Let v(a) be the third derivative of a*5/60 - 5a4/24 - a3/3 - 2a2. Let m(y) be the first derivative of v(y). What are the prime factors of m(5)? 5 Let q be 32/14 + (-6)/21. Suppose -8 = -qc + 4c. Let g = c + 14. What are the prime factors of g? 2, 5 Suppose 10c - 175 = 5c. List the prime factors of c. 5, 7 Suppose -8c + 218 = -7c. What are the prime factors of c? 2, 109 Suppose -7q + 10 = -2q. List the prime factors of ((-1)/q)/(-1)10. 5 Let p be 1((-5 - -2) + 2). Let n be ((-1)/p)/((-2)/(-14)). Let f = 7 + n. What are the prime factors of f? 2, 7 Suppose 0d - 3d + 12 = 0. What are the prime factors of 20/(-6)(1 - d)? 2, 5 Suppose 2p - 5 = 1. Let s be 106/2 + 27/9. Suppose -s = -pf - f. List the prime factors of f. 2, 7 Let a(c) = -2c + 3. Let x be a(6). List the prime factors of (1x/(-3))/1. 3 Suppose z + 2x = 7x + 19, -4z + 10 = 2x. Let f be (-5)/((0 - 2) + 1). Let p = f + z. List the prime factors of p. 3 Suppose -5q - 3n + 586 = 0, -2q + 4n + 369 = q. List the prime factors of q. 7, 17 Let p(b) = 3 + 3b + 1 - 4b. Let v be p(2). Suppose -g = 2, vg - g - 6 = -4f. What are the prime factors of f? 2 Let r(p) be the third derivative of p5/30 + p4/8 - p*3 + 6p*2. List the prime factors of r(4). 2, 19 Let o = -122 - -212. What are the prime factors of o? 2, 3, 5 Let w be (-3 - (-68)/8)8. Suppose o - q - w = 2q, 4q - 88 = -2o. List the prime factors of o. 2, 11 Let j(h) = -h2 - h + 5. Let q be j(5). Let p = 36 + q. List the prime factors of p. 11 Let q(o) = -2o + 15. List the prime factors of q(-3). 3, 7 Suppose 0g - 8 = -4g. Suppose gw = -w + 75. Let q = -13 + w. What are the prime factors of q? 2, 3 Let l(t) = 2 + t2 + 1 + 4 + 6t + 6t. Let i be l(-10). List the prime factors of 0 - (-1 + 2)i. 13 Suppose -3s - s = -84. What are the prime factors of s? 3, 7 Let s be ((0/(-2))/(-2))/1. Suppose s = -6p + 2p + 40. List the prime factors of p. 2, 5 Let r be (-2 - 1)(-4)/(-12). Let b = 4 + r. List the prime factors of b. 3 List the prime factors of (-6 - (-72)/(-30))/((-3)/20). 2, 7 Let v(s) = -2s + 4. Let r be v(6). Let g = r + 31. Suppose 4m = g + 21. List the prime factors of m. 11 Let y be 3 - (4 - 1 - 2). Let u be -4(0 + y - 3). Let d = 3 + u. List the prime factors of d. 7 Let q = 14 - 11. Suppose 0 = qa + 2a - 45. What are the prime factors of a? 3 Let w = 128 - 90. List the prime factors of w. 2, 19 Let i = -174 - -265. List the prime factors of i. 7, 13 Let d(p) = -2p*2 + 11p - 3. Let g be d(8). Let m = -30 - g. What are the prime factors of m? 13 Let r = 3 - 3. Let c be -1 - r - (0 + 1). Let x = 0 - c. What are the prime factors of x? 2 Suppose 3h = -4s + 11 + 18, -4h = 3s - 27. What are the prime factors of ((-21)/6 + h)-12? 2, 3 Let m = -3 + 6. Suppose 0 = -mw + 6 + 3. List the prime factors of w. 3 Suppose y = -4i + 13, y = 4i - 6i + 7. List the prime factors of i. 3 Suppose -m + 2 = -17. List the prime factors of m. 19 Let k(q) be the first derivative of -q2/2 + 23q + 8. List the prime factors of k(12). 11 Let h be 14/1 + 3 + -4. Let v = 19 - h. What are the prime factors of v? 2, 3 Let r be -5(9/(-5) + 1). Suppose 0 = rn - 67 - 49. Let q = -21 + n. What are the prime factors of q? 2 Suppose -4f + 2 = i - 6, -5f + 2i + 10 = 0. Suppose 0 = w + f. List the prime factors of 0/(-3 - w) + 9. 3 Let t be 5((-24)/(-5))/(-4). Let v = 1 - t. Let y = v - 4. List the prime factors of y. 3 Suppose 0 = 4j - 346 + 98. Suppose 2z + j = 4g, -g + 4z + 19 = -0z. What are the prime factors of g? 3, 5 Let s be 2 + 5/(5/2). Let x(f) = s + f + 2f - 3 - 6f. What are the prime factors of x(-2)? 7 Suppose 3r - 3 = -4y, 6y = 2r + 2y - 22. Let q = r + 2. List the prime factors of q. 7 Suppose 0b + 6 = 4q + 3b, -2b = 4. Suppose -5a - 2r = -31, 0r + 22 = 4a + qr. List the prime factors of a. 7 Suppose 0k - k - 1 = 0, 4u = 5k + 5. Suppose -2v + v + 17 = u. What are the prime factors of v? 17 Suppose 3q + 16 = 7q. Suppose -155 = -5w + 5u, 3w - u - 99 = -qu. List the prime factors of w. 2 List the prime factors of 3/9 - (-1270)/15. 5, 17 Let d = 0 + 3. Suppose 3k - 2m - 31 = 2m, -m - 28 = -dk. Suppose -4a = -3n - 2a + 35, -k = -n - 2a. List the prime factors of n. 11 Let p(c) = 4c*2 - 6c + 15. List the prime factors of p(5). 5, 17 Suppose -m + 190 = 4a, -2a + 150 = a - 3m. List the prime factors of a. 2, 3 List the prime factors of 32/(-6) + 77. 2, 19 Let i(b) = -2*b + b + 2 - 3. List the pr	{ "pile_set_name": "DM Mathematics" }
: 0 or 3/260293918? 0 Is 18802 >= 68394? False Is 4807878 > 33655142/7? True Is -1706495/606 equal to -2815? False Is 3535209 smaller than 3535224? True Which is smaller: -1/4 or 454367039? -1/4 Is -10286 not equal to -11080? True Is 1960204 > 1960228? False Which is smaller: 11654161 or 11654140? 11654140 Which is smaller: -0.050574 or -12? -12 Which is smaller: 4031427 or 44345710/11? 4031427 Is -1259642 at most as big as -1259644? False Which is bigger: -11973134 or -11973135? -11973134 Which is smaller: 770039 or 769145? 769145 Is -20 > -33272/1757? False Which is bigger: -206 or 28835? 28835 Do 1 and -11/15449719 have the same value? False Is -2 greater than -19088501? True Is 110/7 > -216928? True Is 7930 bigger than 14069? False Is 71 smaller than 135678/1903? True Is 311 < 61249/197? False Which is bigger: 2/3 or 264.919? 264.919 Is 3144278 at least 3144274? True Is -5/23 less than 0.843147? True Is -1 <= 825/68108? True Is 28/4589077 <= 0? False Are -5491335 and -5491337 unequal? True Is -4 at most 248971.205? True Is 280434 at least as big as 280428? True Is -68 at least -184660/2769? False Which is smaller: -4434879 or -22174396/5? -22174396/5 Is -32121 < -2505517/78? False Which is smaller: -1151513 or 32? -1151513 Which is greater: -47283 or -50134? -47283 Do -194366 and -194358 have the same value? False Which is bigger: -4/1526579 or -30? -4/1526579 Which is smaller: -64 or -1322.431? -1322.431 Is -65/38188 at least 41? False Is 2055457 greater than or equal to 2055460? False Which is greater: -2135754 or -2135755? -2135754 Is -2/5 > 1693031468? False Which is greater: 10/177623 or -0.65? 10/177623 Is 1 > 18515/20933? True Which is smaller: 1309 or 3277974/2507? 3277974/2507 Is 23837192 != 119185959/5? True Which is bigger: 31052 or 1498? 31052 Is -2292598.6 < 0? True Is 7 at most 17294/2947? False Which is smaller: -142803 or -3284450/23? -142803 Is -54673608 greater than or equal to -54673605? False Which is bigger: -942030 or -942031? -942030 Is -5568405 not equal to 31? True Which is greater: 534707 or 534293? 534707 Is 8425407 less than 8425402? False Which is bigger: -8601883 or -8601879? -8601879 Is -13434731 > 0.1? False Does -113624032 = -113624037? False Is -117832900 less than -0.2? True Which is smaller: -0.06 or 12121073? -0.06 Do -3058/155015 and -1 have the same value? False Which is greater: -102996778/7 or -14713824? -14713824 Which is smaller: -752 or -364258? -364258 Which is bigger: 1/29 or -2512175? 1/29 Which is smaller: 2/7 or -22241155? -22241155 Which is greater: -31308/389 or -2/59? -2/59 Is -2/9 less than or equal to -4761839? False Does -10135464 = -212844742/21? False Do -213325649 and -213325649 have the same value? True Which is greater: 941/624657 or -1? 941/624657 Is -24636/3203 at most -8? False Which is smaller: 582276 or 582207? 582207 Which is smaller: 0 or 101588741? 0 Which is bigger: 8927805/26 or 343376? 8927805/26 Which is smaller: 55854 or -1/4147? -1/4147 Is 2648/161 < -1/37? False Is 107646309 greater than 107646313? False Which is greater: -2606080 or -2606079? -2606079 Which is smaller: -74/32304817 or 1? -74/32304817 Does 79425108 = 79425109? False Is 734642586 < -3? False Do 1 and -2866/100113 have different values? True Is -10156.66909 less than or equal to -0.1? True Which is smaller: -84306 or -84077? -84306 Do 3983278 and 3983280 have different values? True Which is bigger: 1296 or 7407? 7407 Do 1 and 13/213636 have the same value? False Do 14055 and 14058 have different values? True Is 32716/10553 greater than 2? True Is -4064748 equal to -4064748? True Is -80739992/3 bigger than -26913330? False Is -22244306 greater than -22244303? False Which is bigger: 0.0365 or -12.92? 0.0365 Which is smaller: -146126053 or -146126043? -146126053 Is 0 < -3/32084903? False Is -2485350 at most as big as -2485350? True Which is greater: 37455 or -1067? 37455 Which is smaller: 7395974 or 7395972? 7395972 Are -4752 and -950 nonequal? True Are -552534 and -552541 equal? False Is -6 greater than or equal to 4.58326? False Which is bigger: 3267/56 or -0.07? 3267/56 Which is smaller: -6747/421 or -0.4? -6747/421 Is -11313254 equal to -11313254? True Which is greater: 82944 or 83353? 83353 Which is greater: 253/362671 or 1? 1 Is -1041954 at most -1041968? False Do -7794 and -7937 have the same value? False Which is smaller: 93142 or 88520? 88520 Which is smaller: -1 or 11547/148246? -1 Is -33/177740 smaller than -1? False Is -1 smaller than 2/979659895? True Is 602 < -193903? False Is -1/39 != -402405? True Which is smaller: 508605/68 or 7478? 7478 Is -7815176 < -7815098? True Which is greater: -13/110934 or 0? 0 Do 4393345 and 4393346 have different values? True Is -1333682 not equal to -4001045/3? True Which is smaller: -12595705 or -12595714? -12595714 Is 221447/289 less than or equal to 765? False Which is smaller: -4/195 or 212237? -4/195 Is 2/21 at least as big as 1088881/3? False Is -112451 > -114497? True Which is bigger: 7832538/25 or 313302? 313302 Is -40450 equal to -40486? False Is -912056 at most -912069? False Which is bigger: 0.128 or 311358.3? 311358.3 Which is bigger: -39997 or -41089? -39997 Which is bigger: 222 or 7487/6? 7487/6 Which is greater: -2782552 or -2782551? -2782551 Is -128167 at least as big as 1165? False Which is smaller: -1/129672842 or 1? -1/129672842 Is -7932.2 at least as big as 1/1125? False Is 34.99 at most 3127? True Is 682365.61 less than 5? False Which is smaller: -2372.86 or 221/8? -2372.86 Which is bigger: 2/261 or 555400? 555400 Which is bigger: -180565 or -178583? -178583 Which is smaller: 1/128120043 or 1? 1/128120043 Do -159358 and -159307 have the same value? False Is 33867018 greater than 33867019? False Is -1 greater than 2/162236503? False Which is bigger: 1 or -2/10074549? 1 Which is smaller: -161.549645 or -12? -161.549645 Which is greater: 43 or 869336? 869336 Does 1 = 223/1745237? False Are -2207 and -1882 nonequal? True Which is bigger: 727748 or 727758? 727758 Is 2072079 at most as big as 2072082? True Is 505272972 not equal to 1? True Which is smaller: 14384 or -9215? -9215 Is -6240 at most as big as 7935? True Is 17867.24 smaller than 187? False Which is smaller: 569/638809 or 0? 0 Is -2 != -9574/13105? True Is -60270 less than -16/41? True Is -440103266 less than or equal to -440103264? True Are -1 and -918/21313 equal? False Which is greater: 4364 or 74632? 74632 Is 132056441 < 132056441? False Which is smaller: 2 or -303/370? -303/370 Which is bigger: -5/8 or 286524.04? 286524.04 Is -10 at most as big as -24497/2592? True Is -74767277 equal to -74767279? False Which is smaller: 3/1097359 or 1? 3/1097359 Which is smaller: -3384/4241 or -2? -2 Is 0 != 103/240109? True Which is greater: -24268064 or -24268061? -24268061 Which is bigger: 1119801 or 1119803? 1119803 Is 140 less than 63093/452? False Which is bigger: 417 or 94420/227? 417 Which is greater: -41938/2891 or -16? -41938/2891 Which is bigger: -0.0751 or -725/102? -0.0751 Is -399 bigger than -18826? True Are 0.0054 and -3.7549 non-equal? True Is 412494 bigger than 412348? True Which is smaller: 1 or 8652/67679? 8652/67679 Which is smaller: 554470 or 554379? 554379 Do -134681 and -135697 have the same value? False Is 0.196421 less than or equal to -212? False Is -73606625 greater than -220819874/3? False Are -19455 and -19842 nonequal? True Is 617/672421 less than or equal to 0? False Which is greater: 10880346 or 7? 10880346 Is -1506113 equal to -1506103? False Are 202283 and -139 unequal? True Are -29180/583 and -50 equal? False Which is greater: 3/5 or 257918/3? 257918/3 Which is smaller: -8/7 or 8.03408? -8/7 Which is smaller: 905464 or 905475? 905464 Which is bigger: 28400 or -6.5? 28400 Is 148554432 less than or equal to -0.2? False Are -326 and -643651 unequal? True Which is greater: -3276 or 4645? 4645 Is 5647164 at least 11294327/2? True Which is smaller: 0.08 or 39868378? 0.08 Which is smaller: 110/53 or -4012.7? -4012.7 Which is smaller: 1/252422 or 0? 0 Which is greater: -21256784/11 or -1932435? -21256784/11 Is 1/72325192 at most as big as -1? False Is -8543875 != -8543948? True Is -2436 greater than 3852? False Is 16673382 greater than 16673414? False Is 2080639 >	{ "pile_set_name": "DM Mathematics" }
215f2 + 115598f*2. -500f*2 - 2 Collect the terms in 520w + 168w - 1081w. -393w Collect the terms in 752o + 1691o - 129o + 1338o. 3652o Collect the terms in 3053329o - 1526667o - 1526632o. 30o Collect the terms in -2o2 - o2 + 1595761o + 4o2 - 3o*2 - 1595761o. -2o2 Collect the terms in 1 + 1187u - 1 + 462u - 2. 1649u - 2 Collect the terms in 8202q - 2q*3 + 0q*3 + 3q*3 + 15398q. q*3 + 23600q Collect the terms in -176c3 + 631c*3 + 1160c*3 - 3c + 449c3. 2064c*3 - 3c Collect the terms in -1277 - 178k - 662k + 97k + 1277 + 74k. -669k Collect the terms in 250 + 1242r + 241 - 488. 1242r + 3 Collect the terms in 68107882 - 13r*2 - 68107882 - 58r. -13r2 - 58r Collect the terms in -1006881458 - 4n2 - 3n*2 + 1006881458. -7n*2 Collect the terms in -7285628011s*2 + 14571256021s*2 - 7285628008s*2. 2s*2 Collect the terms in 61905 + 3c - 30953 - 30952. 3c Collect the terms in 322772u*2 - 114081u*2 + 88251u*2. 296942u*2 Collect the terms in -29 - 15 + 97 - 19 - 21 - 1028u - 14. -1028u - 1 Collect the terms in 2 + 28n*3 - 89n*3 - 2 + 470n*3 + 297n*3. 706n*3 Collect the terms in -1481c - 1493c + 5930c + 265 - 1473c - 265 - 1477c. 6c Collect the terms in -382c*3 - 225c*3 + c - 2c + 717c3 - 267c*3. -157c*3 - c Collect the terms in -107 - 1755204z*2 + 107. -1755204z*2 Collect the terms in -433m + 2192m - 434m - 443m - 428m - 432m. 22m Collect the terms in -11s2 + 557s*2 - 436s*2 + 700s*2 + 466s*2. 1276s*2 Collect the terms in -2049l - 2052l - 2047l - 2047l + 8201l. 6l Collect the terms in -66911y*3 - 760101y*2 + 760101y*2. -66911y*3 Collect the terms in 483 - 67k + 18k - 12k - 35k. -96k + 483 Collect the terms in -p + 21937950746 - 21937950746. -p Collect the terms in 29742082p2 + 343p - 59484164p2 + 5p*3 - 343p + 29742082p2. 5p*3 Collect the terms in 10r*2 + 16r*2 - 79r*2 + 16r*2 + 22r*2 + 17r*2 - 202. 2r*2 - 202 Collect the terms in -32 + f + 388f*3 - 372f*2 + 372f*2 - f. 388f*3 - 32 Collect the terms in 159i + 23 + 426i - 77i. 508i + 23 Collect the terms in -9883t + 39509t + 192 - 192 - 9877t - 9873t - 2t*2 - 9876t. -2t2 Collect the terms in 35 - 1478b - 968b - 33 - 758b. -3204b + 2 Collect the terms in -375248m*2 - 6m + 374983m2 + 2m - 8. -265m2 - 4m - 8 Collect the terms in -2h2 - 4h*2 - 383117h*3 + 3h*2 + 3h*2 + 383138h*3. 21h3 Collect the terms in -x2 + 2x + 7503799 + 74306351 - 2x. -x*2 + 81810150 Collect the terms in -6521a + 3789a + 3a*2 + 3201 - 8532a - 3201. 3a2 - 11264a Collect the terms in -76c2 - 383c*2 - 449c*2 + 151c*2 - c + 0c - 5. -757c2 - c - 5 Collect the terms in -234k - 335k + 2k*2 + 4k*2 - 178k + 747k. 6k*2 Collect the terms in -19688g + 19688g - 1048g*2. -1048g*2 Collect the terms in -8376l + 41654l + 65666l + 81430l. 180374l Collect the terms in -4537l + 10169l - 9541l. -3909l Collect the terms in 434l3 - 15148946 + 15148946 - 2l. 434l3 - 2l Collect the terms in -40 + 1754w - 24 + 5595w - 14. 7349w - 78 Collect the terms in 5 - 394v*2 + 68v*2 - 4 - 1 - 425v*2. -751v*2 Collect the terms in 42776o + 42766o + 42773o + 42774o - 213884o + 42777o. -18o Collect the terms in -29y + 2y*2 + 3686y + 1695y + 55 + 7. 2y*2 + 5352y + 62 Collect the terms in 2 + 392353471j2 - 392353476j*2 - 2. -5j*2 Collect the terms in -151s + 169s + 941s + 453s + 106s. 1518s Collect the terms in 89 + 14f - 25 + 23. 14f + 87 Collect the terms in -1189u*3 + 59363 + 59374 - 118737. -1189u*3 Collect the terms in 5555d*2 + 2485d*2 - 14 + 14. 8040d*2 Collect the terms in -8 + 7 - 1 + 15q - 6 - 12 + 20. 15q Collect the terms in 6392h*3 + 1668108h - 1668108h - 2h*2. 6392h*3 - 2h*2 Collect the terms in -45q - 10q - 23q - 78q. -156q Collect the terms in -4834q2 + 0q - 14918q2 + 3854q*2 + 0q. -15898q2 Collect the terms in 322f + 636f + 812f. 1770f Collect the terms in -1 - 329084808n*2 - 30n*3 + 1 + 329084808n*2. -30n*3 Collect the terms in 678j*2 - 223j*3 + 689j*2 + 686j*2 - 2053j*2. -223j*3 Collect the terms in 414v - 11v - 919v. -516v Collect the terms in 5j + 2 - 1 - 3j + 6 - 17 - 4. 2j - 14 Collect the terms in -78288u + 85u*3 + 78288u - 19u3 + 3u*3. 69u*3 Collect the terms in -196811r + 385329r - 188513r. 5r Collect the terms in -2h*3 - 4876628h*2 - 4h*3 - 4876523h*2 + 9753151h*2. -6h*3 Collect the terms in 118 - 223 + 914b*2 + 105 + 3476b*2. 4390b*2 Collect the terms in 670 - 691 - 18p*2 + 33p*2. 15p*2 - 21 Collect the terms in -20573056c*2 + 41145302c*2 - 20572250c*2. -4c*2 Collect the terms in -576m*2 + 258 - 576m*2 + 3m*3 + 1148m*2. 3m*3 - 4m*2 + 258 Collect the terms in -97l*2 + 68l + 168l2 - 90l*2 - l + 88l - 12l. -19l*2 + 143l Collect the terms in -18a3 + 49a + 1 - 116a + 75a + 64a3 - 8a. 46a3 + 1 Collect the terms in -17b*2 + 227b*2 + 22b + 25b + 184b*2 - 47b. 394b2 Collect the terms in -s2 + 3 + 2s2 - s2 + 626s + 3s*2 - 8. 3s*2 + 626s - 5 Collect the terms in -1987566 - 717k2 + 1987566. -717k*2 Collect the terms in -3793h - 3595h - 2883h + 12877h. 2606h Collect the terms in -19963z + 8980z - 39228z. -50211z Collect the terms in 14185007183s2 - 15s*3 - 14185007183s*2. -15s*3 Collect the terms in 8x*2 - 7 + 6 - 1 + 82x + 224x + 65x. 8x2 + 371x - 2 Collect the terms in 4 - 9 + 28 + 4238l + 6663l. 10901l + 23 Collect the terms in -18980j*2 - 25229j*2 - 7109j*2 - 1311j*2. -52629j*2 Collect the terms in 25465h*2 + 213h + 20 - 213h. 25465h*2 + 20 Collect the terms in 22u*3 - 90u*3 - 12u - 28u + 66u*3 + 16u. -2u3 - 24u Collect the terms in -96p2 + 345p*2 - 128p*2 - 5281p*3 - 121p*2. -5281p*3 Collect the terms in -39s + 93 - 184 + 89 - 349s. -388s - 2 Collect the terms in -1378013y3 + 689123y*3 + 688889y3. -y3 Collect the terms in 2251294 + 13b - 2251287 + 6b - 14b. 5b + 7 Collect the terms in -6t2 - 5 + t2 - 2222t - 10t2 + 2215t + 20t2. 5t*2 - 7t - 5 Collect the terms in 317625i2 - 636148i*2 + 318521i*2. -2i*2 Collect the terms in 26p - 113853p3 - 29p + 113828p3. -25p*3 - 3p Collect the terms in -656c + 1 - 662c + 1998c + 2 - 659c - 5. 21c - 2 Collect the terms in 16374q + 18835 - 18835. 16374q Collect the terms in -82i*3 + 90238 - 90238. -82i*3 Collect the terms in 40n + 128n + 86n*2 - 34 - 33 + 65. 86n*2 + 168n - 2 Collect the terms in -9r + 12589r*3 - 119r + 124r - 12595r*3. -6r*3 - 4r Collect the terms in -33696164j3 - 33695509j*3 + 67391667j*3. -6j*3 Collect the terms in -2 + 2526p - 9780p - 15620p + 6106p - 15270p. -32038p - 2 Collect the terms in 10 - 80k*3 + 6k*2 - 5 - 6k*2 + 10k*2 - 15k*2. -80k*3 - 5k*2 + 5 Collect the terms in -71948p*2 - 72149p*2 + 144833p*2. 736p*2 Collect the terms in 19f*3 + 17f + 13f3 - 59f3 - f2 + 5f3. -22f3 - f2 + 17f Collect the terms in 2 + 4 - 11923k + 12892k - 6. 969k Collect the terms in 10y - 11y + 785y2 - 3156y*2 + y. -2371y*2 Collect the terms in -4b2 + b2 - 77 + b*2 + 8b*2 - 54. 6b*2 - 131 Collect the terms in -35299s*2 - 35283s*2 + 105420s*2 - 35271s*2. -433s*2 Collect the terms in 58t + 1146650 - 32t - 24t. 2t + 1146650 Collect the terms in -817j*3 - 2790j*3 + 3619j*3. 12j*3 Collect the terms in -5544078 + 7f - 4479857 - 6f. f - 10023935 Collect the terms in -o - 2o*2 + 1926 - 5344 + o + 1709 + 1709. -2o*2 Collect the terms in 11 - 2d*2 - 35 + 14 + 160d + 3d2 + 21. d2 + 160d + 11 Collect the terms in -1307846f2 + 510f*3 + 514f*3 + 1307846f*2 - 1019f*3. 5f*3 Collect the terms in 429190o - 346833o - 82354o. 3o Collect the terms in -1157 + 5r + 3437 - 1138 - 1143 + 17r. 22r - 1 Collect the terms in 33 - 16665p + 2251p - 33. -14414p Collect the terms in -5d*2 - 111731055645d + 111731055645d. -5d**2 Collect	{ "pile_set_name": "DM Mathematics" }
of 1318140. 2, 3, 5, 2441 List the prime factors of 111383. 31, 3593 What are the prime factors of 1080051? 3, 7, 51431 What are the prime factors of 377605? 5, 75521 What are the prime factors of 206089? 13, 83, 191 List the prime factors of 874165. 5, 359, 487 List the prime factors of 9293787. 3, 1032643 List the prime factors of 29969. 23, 1303 List the prime factors of 3911176. 2, 488897 List the prime factors of 10296. 2, 3, 11, 13 List the prime factors of 243045. 3, 5, 11, 491 What are the prime factors of 46999? 43, 1093 What are the prime factors of 185334? 2, 3, 17, 23, 79 What are the prime factors of 375032? 2, 7, 37, 181 List the prime factors of 7123974. 2, 3, 11, 13, 19, 23 What are the prime factors of 1076260? 2, 5, 53813 What are the prime factors of 74414? 2, 29, 1283 List the prime factors of 2290057. 7, 11, 29741 What are the prime factors of 189645? 3, 5, 47, 269 What are the prime factors of 4409780? 2, 5, 79, 2791 What are the prime factors of 243416? 2, 30427 List the prime factors of 3812236. 2, 19, 103, 487 List the prime factors of 171493. 7, 24499 What are the prime factors of 4936491? 3, 7, 26119 List the prime factors of 296654. 2, 23, 6449 List the prime factors of 1407593. 11, 11633 List the prime factors of 3790112. 2, 83, 1427 What are the prime factors of 569334? 2, 3, 94889 What are the prime factors of 2391956? 2, 7, 85427 What are the prime factors of 397461? 3, 19, 367 List the prime factors of 5377574. 2, 2688787 List the prime factors of 5089534. 2, 2544767 What are the prime factors of 127200? 2, 3, 5, 53 List the prime factors of 20853339. 3, 13, 17, 71, 443 List the prime factors of 1415800. 2, 5, 7079 List the prime factors of 68032. 2, 1063 List the prime factors of 3231909. 3, 359101 What are the prime factors of 28366435? 5, 5673287 What are the prime factors of 1698832? 2, 89, 1193 What are the prime factors of 329682? 2, 3, 23, 2389 What are the prime factors of 125928? 2, 3, 11, 53 List the prime factors of 2001732. 2, 3, 31, 5381 List the prime factors of 20717. 20717 What are the prime factors of 32856485? 5, 103, 63799 List the prime factors of 571496. 2, 71437 What are the prime factors of 30256659? 3, 124513 List the prime factors of 1101105. 3, 5, 24469 List the prime factors of 2376588. 2, 3, 73, 2713 List the prime factors of 55058. 2, 27529 What are the prime factors of 191431? 47, 4073 List the prime factors of 2418. 2, 3, 13, 31 What are the prime factors of 444888? 2, 3, 37, 167 What are the prime factors of 12608040? 2, 3, 5, 29, 3623 What are the prime factors of 6645834? 2, 3, 13, 9467 List the prime factors of 13197. 3, 53, 83 List the prime factors of 191575. 5, 79, 97 List the prime factors of 101212. 2, 25303 What are the prime factors of 10104115? 5, 7, 288689 What are the prime factors of 26478339? 3, 811, 10883 What are the prime factors of 7585709? 263, 28843 What are the prime factors of 10812978? 2, 3, 11, 97, 563 List the prime factors of 9448. 2, 1181 What are the prime factors of 1692780? 2, 3, 5, 89, 317 List the prime factors of 1606474. 2, 803237 What are the prime factors of 220151? 220151 What are the prime factors of 3692980? 2, 5, 184649 List the prime factors of 198757. 13, 15289 What are the prime factors of 4057492? 2, 17, 59669 What are the prime factors of 1148062? 2, 574031 What are the prime factors of 286787? 23, 37, 337 List the prime factors of 10705143. 3, 23, 47, 3301 What are the prime factors of 753138? 2, 3, 4649 What are the prime factors of 24642? 2, 3, 37 What are the prime factors of 1625600? 2, 5, 127 What are the prime factors of 7754807? 131, 59197 What are the prime factors of 276640? 2, 5, 7, 13, 19 List the prime factors of 20821546. 2, 43, 83, 2917 List the prime factors of 75307. 75307 What are the prime factors of 45150? 2, 3, 5, 7, 43 What are the prime factors of 506447? 17, 31 What are the prime factors of 2707839? 3, 43, 6997 What are the prime factors of 3042073? 113, 26921 What are the prime factors of 1201937? 11, 109267 List the prime factors of 1228078. 2, 677, 907 List the prime factors of 23029445. 5, 1867, 2467 List the prime factors of 8608532. 2, 23, 137, 683 List the prime factors of 30016. 2, 7, 67 What are the prime factors of 154110? 2, 3, 5, 11, 467 List the prime factors of 696323. 696323 What are the prime factors of 26036424? 2, 3, 120539 List the prime factors of 16185417. 3, 757, 7127 List the prime factors of 642889. 13, 17, 2909 List the prime factors of 25059125. 5, 7, 13, 2203 List the prime factors of 974545. 5, 11, 13, 29, 47 List the prime factors of 5868694. 2, 13, 97, 179 List the prime factors of 630976. 2, 9859 List the prime factors of 1154824. 2, 11, 1193 What are the prime factors of 10031538? 2, 3, 11, 31, 4903 List the prime factors of 11731800. 2, 3, 5, 19553 What are the prime factors of 17506? 2, 8753 What are the prime factors of 623504? 2, 7, 19, 293 What are the prime factors of 4234475? 5, 7, 24197 List the prime factors of 413119. 7, 8431 What are the prime factors of 1073130? 2, 3, 5, 35771 What are the prime factors of 573390? 2, 3, 5, 23, 277 What are the prime factors of 12479129? 13, 41, 1801 List the prime factors of 344807. 344807 What are the prime factors of 7908481? 7, 23, 49121 What are the prime factors of 14148367? 14148367 List the prime factors of 696694. 2, 17, 31, 661 List the prime factors of 31525786. 2, 17, 927229 What are the prime factors of 1930733? 7, 29, 9511 List the prime factors of 897504. 2, 3, 9349 List the prime factors of 1409404. 2, 37, 89, 107 What are the prime factors of 5035820? 2, 5, 251791 What are the prime factors of 3783999? 3, 1261333 What are the prime factors of 7124627? 43, 223, 743 What are the prime factors of 86978? 2, 157, 277 What are the prime factors of 66478? 2, 43, 773 List the prime factors of 3177514. 2, 1588757 List the prime factors of 401804. 2, 13, 7727 What are the prime factors of 7846893? 3, 181, 4817 List the prime factors of 21544554. 2, 3, 3590759 What are the prime factors of 1297134? 2, 3, 17, 157 List the prime factors of 1014956. 2, 89, 2851 What are the prime factors of 657212? 2, 43, 3821 What are the prime factors of 7722271? 7722271 What are the prime factors of 923371? 923371 What are the prime factors of 189329? 7, 17, 37, 43 What are the prime factors of 31485888? 2, 3, 7, 19, 137 What are the prime factors of 217231? 7, 31033 What are the prime factors of 43214376? 2, 3, 1800599 What are the prime factors of 2687432? 2, 11, 30539 List the prime factors of 479458. 2, 7, 23, 1489 What are the prime factors of 1384772? 2, 43, 83, 97 List the prime factors of 430048. 2, 89, 151 What are the prime factors of 1361613? 3, 11, 31 What are the prime factors of 29332379? 37, 677, 1171 What are the prime factors of 15981? 3, 7, 761 List the prime factors of 78094. 2, 39047 List the prime factors of 23418917. 137, 199, 859 What are the prime factors of 2462316? 2, 3, 449, 457 List the prime factors of 101763. 3, 3769 List the prime factors of 59483. 17, 3499 What are the prime factors of 20934251? 13, 433, 3719 What are the prime factors of 27060216? 2, 3, 227, 4967 What are the prime factors of 11283588? 2, 3, 379, 827 What are the prime factors of 15840829? 157, 163, 619 What are the prime factors of 1764398? 2, 882199 What are the prime factors of 81283? 81283 List the prime factors of 7732731. 3, 701, 3677 List the prime factors of 3745936. 2, 234121 List the prime factors of 7371599. 373, 19763 List the prime factors of 35025. 3, 5, 467 What are the prime factors of 227626? 2, 7, 71, 229 List the prime factors of 1539067. 53, 71, 409 List the prime factors of 705393. 3, 13, 6029 List the prime factors of 3800730. 2, 3, 5, 126691 List the prime factors of 902915. 5, 13, 29, 479 List the prime factors of 383371. 383371 List the prime factors of 3081065. 5, 13, 107, 443 List the prime factors of 69608. 2, 7, 11, 113 List the prime factors of 2872246. 2, 13, 61, 1811 What are the prime factors of 11339144? 2, 1417393 List the prime factors of 426955. 5, 17, 5023 What are the prime factors of 8265651? 3, 509, 5413 List the prime factors of 3115884. 2, 3, 259657 List the prime factors of 770808. 2, 3, 32117 List	{ "pile_set_name": "DM Mathematics" }
- 12 for c. 2 Solve g - 3 = -6 - 4, i = 3g + 23 for i. 2 Solve -2g + 18 = -4i, 42g = 44g + i - 8 for g. 5 Solve d = -u + 3, -3d - 4u = -2u - 10 for d. 4 Solve -104h - 152 = -5d - 101h, -64 = -3d - 5h for d. 28 Solve -2t = 0, l - 216t = -3l - 221t - 12 for l. -3 Solve -2c - l = 3, 3c = 421l - 416l - 37 for c. -4 Solve 0 = -2p + 3t + 22, -2p + 349 - 411 = 18t for p. 5 Solve -4k = -2m, -620 + 602 = 5m - 4k for m. -6 Solve n = -6w + 11, 5w + 3n - 9 = -2 for w. 2 Solve -4h - 4 = -4b, -2b - 3h - 3 = 5 for b. -1 Solve 2y - 3w = -14, 5434w - 5432w = -2y - 4 for y. -4 Solve 0 = 5f - o - 14, -f + 16o - 21o + 34 = 0 for f. 4 Solve 145y + l + 48 = 158y, 2y - 4l - 42 = 0 for y. 3 Solve -33l - 10 = -2p - 37l, -4p = -4l + 4 for p. 1 Solve 907k = 909k + 5m, 0k - k - 2m - 1 = 0 for k. -5 Solve -3g + 35 = 2t - 8, g = -5t + 36 for t. 5 Solve 5i = -n + 39, -4n + 239 = 3i + 219 for i. 8 Solve t - d = 6, 33t - d = 39t + 13 for t. -1 Solve 3f - 4q = -24, 5f - 2q + 78 - 52 = 0 for f. -4 Solve 101n + 3 = 98n, -4n + 16 = 5z for z. 4 Solve 0 = 3j + 3b - 6, -2j = 900b - 895b - 7 for j. 1 Solve -5n + 3h + 17 = 0, -104h + 91h = 5n - 33 for n. 4 Solve 3c = 69j - 72j + 15, -4j + 5c + 2 = 0 for j. 3 Solve y - 122 = 54m - 16, 2m - 2 = 3y for y. -2 Solve -3t - 656n = -652n - 15, -10 = 2t - 4n for t. 1 Solve 57695q - 57692q + 19 = -4v, 0 = -v + 3q + 14 for v. -1 Solve 32 = -4n - 2o, 2n - 2165o = -2163o + 2 for n. -5 Solve -2n = -4u + 20, 3166u - 3160u = 4n + 34 for n. -4 Solve 0 = 4w - 4c + 4, -2c = 5w + 38 - 54 for w. 2 Solve c - 65x = -64x + 5, 20 = -5c - 4x for c. 0 Solve 4k + 2n - 18 = 0, k + 3n - 56 + 39 = 0 for k. 2 Solve 4f + 82r = -f + 87r - 40, -3f = 5r for f. -5 Solve 27 - 3 = -3s - 5r, 15s + 39 = 2r for s. -3 Solve 15 = 5c, 3q - 1755c = -1759c + 27 for q. 5 Solve -3r + 4g + 9 = 0, -21 + 9 = -4r - 4g for r. 3 Solve 414o - 1 = 413o - 2k, 2k - 5 = 3o for o. -1 Solve -8y = -40, -67y + 69y - 13 = -3p for p. 1 Solve -5k - 37 + 53 = 2o, 5k - 22 = -4o for o. 3 Solve 0 = -93b + 95b - 2, 7k = 4b + 10 for k. 2 Solve -20 = 5t - 5b, -63t + b = -61t + 3 for t. 1 Solve -4m = -37t + 33t - 72, 0 = -5m - 10 for t. -20 Solve -3g - 5f + 23 - 103 = 0, -4g = -5f - 45 for g. -5 Solve -2u - 167 = -151, 10u = 5k - 90 for k. 2 Solve -144z = -148z - 2q - 32, 0 = -4z - 4q - 44 for z. -5 Solve 6 = -f - 2g, 3854f - 3852f - 6g + 2g - 20 = 0 for f. 2 Solve 4g - 5w = -42, -8w + 8w = 5g + 2w + 3 for g. -3 Solve 2 = -4g + 3y, 10g + 4y + 6 = -15g + 26g for g. -2 Solve -4c = i + 2, c + i - 6 = -5 for c. -1 Solve -3n + 1264 = -67g, 14g - 17g = 4n + 69 for g. -19 Solve 263 = -5j - z + 217, 3j = -2z - 22 for j. -10 Solve -2h + 2p - 4 = 0, 1 = h + 87p - 91p for h. -3 Solve 4h - 30 = 2p, 6p + 97 = -271h + 276h for p. -17 Solve z + 852 - 869 = -2m, 2z + 65 = 5m for m. 11 Solve 12 = -2g + 4q, 177g = 178g + 5q - 29 for g. 4 Solve 89r - 92r = 2g + 41, -731 = -2r + 29g for r. 3 Solve -2r + 14 = -2q, -q - 117r = -112r + 25 for q. -10 Solve -5a - 31 = d - 57, 0 = -2d - 4a + 34 for d. 11 Solve -3k = -4s + 26, 5k - 1112s + 1108s = -30 for k. -2 Solve 0 = -12q - 355m + 350m, 5m = 0 for q. 0 Solve -2x + f = 2, -30f + 33f + 14 = -4x for x. -2 Solve -f = -5z - 28, 12 = 3f - 0f + 3 for z. -5 Solve 5v = -2r - 1, 2r + 26 - 23 = -3v for v. 1 Solve -2i = 4o - 4, 12i - 2 = 2o + 14i for o. 3 Solve -5f = 10w - 30, 3f - w - 3052 = -3041 for f. 4 Solve -50 = -4t + 2k, -76t + 72t = 4k - 32 for t. 11 Solve -4p + 185n - 12 = 181n, 4p - 3n = -5n - 18 for p. -4 Solve m + 8 = -2l, -4 = -62l + 64l + 3m for l. -5 Solve -4m = -4w + 4, 37 = 2w + 3m + 50 for w. -2 Solve -4n + 31 = 128v - 125v, 2n + 4v - 28 = 0 for n. 4 Solve 0 = -x - 8q + 2, -3767q + 3765q = -2x + 4 for x. 2 Solve -5w + 67n - 61n = 15, 3n + 15 = -5w for w. -3 Solve 4q + 14x - 16 = 13x, x = 3q - 19 for q. 5 Solve -4i - 2r + 20 = 0, -3r = 3i - 1472 + 1448 for i. 2 Solve 5c + 5l + 60 = 0, -712c + 717c = -3l - 46 for c. -5 Solve -5j = -3p - 20, -234j + 2p = -229j - 5 for j. -5 Solve -5w + 5j + 30 = 0, 11w - 12w + 7 = j + 5 for w. 4 Solve -2k = -6h + 80, 523h - 521h - 31 = 5k for k. -1 Solve -7 = -5l - 8s + 6s, 0 = -4l - 3s for l. 3 Solve -5b = -11o + 38, -4o = -83b + 84b - 11 for o. 3 Solve m + 2w - 55 = -62, -2w - 3 = 5m for m. 1 Solve 0 = 18g - 15g + z - 16, 0 = -5g + 11z + 14 for g. 5 Solve f = -2q - 10, 4q - 64 = -2068f + 2087f for f. -4 Solve 6 = 3a, -3c - 19a = 3a - 35 for c. -3 Solve 3t - 1 = -12d + 8d, 4t + 20 = 0 for d. 4 Solve 3m + 12 = 0, -5i - 7m + 1487 = 1490 for i. 5 Solve 3238t - 3242t + m = -21, -24 = -5t + m for t. 3 Solve 0 = -2l + 5c + 21, 3l - 10 = -2l + 4c for l. -2 Solve 5 = 6h - 9h + 5b, 7 = 3h - 2b for h. 5 Solve -v + 13 = -4r, 50r + 2v + 50 = 39r for r. -4 Solve 5a - 7p = -6, 16 = a - 3p + 14 for a. -4 Solve -5x + 3d - 5d - 81 = 0, -5x = -d + 72 for x. -15 Solve 6 = 2a, -25 = 4b - 22a + 19a for b. -4 Solve 0 = 11o - 5r + 110, 703o - 702o + 10 = -4r for o. -10 Solve 0 = -4m + 4o - 56, 8538m - 8533m - 4o + 65 = 0 for m. -9 Solve 3p + 6x + 30 = 6p, p + 3x + 5 = 0 for p. 4 Solve 2 = -2l + 6, -2r + 2l - 6 = -3l - l for r. 3 Solve 14u + 5g = 69, 0 = 347u - 350u - 2g - 2g + 6 for u. 6 Solve -2g = 4k + 24, -2g + 9 = 33 for k. 0 Solve -3y = 6, 3y = -5u + 1279 - 1315 for u. -6 Solve -34r + 16 = -35r + 2c, 128 = -7r - 2c for r. -18 Solve 5u = 2b - 31, -3u - 3b - 130 + 124 = 0 for u. -5 Solve -1382m + 1386m + b + 33 = 0, -5 = 5b for m. -8 Solve 0 = 3s - 5b + 34, -b - 5012 = 3s - 5026 for s. 2 Solve 4t = -4h + 12, 2045h - t = 2039h - 3t + 14 for h. 2 Solve -403 = 7b - 5w - 409, -5b + 4w = -6 for b. -2 Solve -524s + 522s = -2n - 2, -23 = -5s - 4n for s. 3 Solve -z - 2203 = f - 2206, 4z - 11 - 7 = -5f for z. -3 Solve 0 = 5w - 3c + 16, 3w = c + 115 - 123 for w. -2 Solve 21n - 44 = -5c + 17n, 5n = c - 3 for c. 8 Solve -306p = 4s - 310p + 8, -s + 6 = -5p for s. -4 Solve -4s + 5c - 29 = 0, 17s - 20s + 9c = 48 for s. -1 Solve 0n + 32 = 2p - 4n, 0 = 48n - 54n - 30 for p. 6 Solve m - 22 = -0m - 5o, 4m + 4o = 8 - 0 for m. -3 Solve 121n - 5 = -3a + 126n, 6 = 3n for a. 5 Solve 0 = -15y + 4g - 21 - 31, y = 4g + 4 for y. -4 Solve -21q + 3k + 11 = -20q, -1 = q + 3k for q. 5 Solve -2z + f = 8, 13f - 5 = -z + 9f for z. -3 Solve -v + 5r + 64 = 0, -10r + 8r = 5v + 4 for v. 4 Solve -35p + 22 = -34p - 2b, 0 = -p - 5b - 69 for p. -4 Solve 3a = -5v + 45, -300a - 3v - 7 = -305a for a. 5 Solve 60 = -4w - 4p, -4172w + 0p = -4167w + 4p + 70 for w. -10 Solve 439 = -4t - 2p + 415, -3t + p + 2 = 0 for t. -2 Solve 0 = 3o + 2u + 20, 6u - 50 = 5o + 11u for o. 0 Solve 0 = -o - 5r - 18, 0 = 3o + 5r + 6831 - 6787 for o. -13 Solve 2x - 7 = -p, 3x - 3 - 12 = -62p + 59p for p. 3 Solve -g + h = 5, -404h + 398h = 5g - 19 for g. -1 Solve -5l + 2d - 23 = 0, -187 + 184 = 5l + 3d for l. -3 Solve 3j + 22 = -4i + 26, -41 = 13i + 3j for i. -5 Solve -113b = -116b - g + 25, -b = 3g - 35 for b. 5 Solve 70z + 66 = 4a, 258z - 254z - a = -3 for z. -1 Solve 702b + a - 10 = 700b, 7b = -4a + 38 for b. 2 Solve 19s - 20s = q + 5, 8s - 3q = -40 for s. -5 Solve 56g - 24 = 53g + 6m, -22 = -5g + m for g. 4 Solve 4a - 15 = -l, -894l - a = -898l - 8 for l. -1 Solve 1336n - 1336n = -5p - 10, 0 = 4n - 3p + 10 for n. -4 Solve -2b - 2144 = -w - 2148, 4w + 3b = 28 for w. 4 Solve 2b - 7 = 5d, -4d + 5d + b + 14 = 0 for d. -5 Solve -29l = -30l - 4k + 17, -9k = 3l - 39 for l. 1 Solve 0 = -5i - 140, -663 = 4c - 3i - 763 for c. 4 Solve 2q + k + 12 = 0, -5q - 5k = 53 - 13 for q. -4 Solve 3r = 12, -810m - 4r = -806m - 28 for m. 3 Solve -4o + 20h + 60 = 0, h + 52 - 23 = -5o for o. -5 Solve -4g = 543y - 545y, 0 = -2g - 6 for y. -6 Solve 0 = 4o - 3l + 19, 2102l - 2101l - 13 = 3o for o. -4 Solve -17y + 18y + 4m + 27 = 0, 3m = -3y - 9 for y. 5 Solve -54 = -p - 54, -	{ "pile_set_name": "DM Mathematics" }
15 What is the tenth root of 181608 to the nearest integer? 3 What is the cube root of 11167558 to the nearest integer? 224 What is the tenth root of 462770 to the nearest integer? 4 What is the fifth root of 268089 to the nearest integer? 12 What is 7534244 to the power of 1/10, to the nearest integer? 5 What is the sixth root of 470330 to the nearest integer? 9 What is 2021894 to the power of 1/9, to the nearest integer? 5 What is 5105251 to the power of 1/2, to the nearest integer? 2259 What is the third root of 1300219 to the nearest integer? 109 What is the third root of 1152888 to the nearest integer? 105 What is 25180932 to the power of 1/2, to the nearest integer? 5018 What is the third root of 697366 to the nearest integer? 89 What is the fourth root of 7914765 to the nearest integer? 53 What is the square root of 3158550 to the nearest integer? 1777 What is the sixth root of 22698223 to the nearest integer? 17 What is 6541730 to the power of 1/2, to the nearest integer? 2558 What is the square root of 2218373 to the nearest integer? 1489 What is the cube root of 2960749 to the nearest integer? 144 What is 952785 to the power of 1/2, to the nearest integer? 976 What is the square root of 602733 to the nearest integer? 776 What is the third root of 952128 to the nearest integer? 98 What is the ninth root of 540981 to the nearest integer? 4 What is the ninth root of 66243 to the nearest integer? 3 What is the square root of 9764997 to the nearest integer? 3125 What is the fifth root of 4369348 to the nearest integer? 21 What is 13952459 to the power of 1/2, to the nearest integer? 3735 What is 39161 to the power of 1/2, to the nearest integer? 198 What is 241070 to the power of 1/2, to the nearest integer? 491 What is the square root of 365653 to the nearest integer? 605 What is the seventh root of 2156223 to the nearest integer? 8 What is 538704 to the power of 1/3, to the nearest integer? 81 What is the cube root of 245086 to the nearest integer? 63 What is 360969 to the power of 1/3, to the nearest integer? 71 What is the third root of 270745 to the nearest integer? 65 What is 13505131 to the power of 1/2, to the nearest integer? 3675 What is 494147 to the power of 1/8, to the nearest integer? 5 What is the eighth root of 226489 to the nearest integer? 5 What is the cube root of 119873 to the nearest integer? 49 What is 3301050 to the power of 1/3, to the nearest integer? 149 What is the cube root of 49922 to the nearest integer? 37 What is 2222236 to the power of 1/6, to the nearest integer? 11 What is 13055574 to the power of 1/5, to the nearest integer? 26 What is 5693126 to the power of 1/2, to the nearest integer? 2386 What is 3521138 to the power of 1/2, to the nearest integer? 1876 What is the fourth root of 2365608 to the nearest integer? 39 What is the cube root of 121898 to the nearest integer? 50 What is 375350 to the power of 1/4, to the nearest integer? 25 What is the sixth root of 186078 to the nearest integer? 8 What is the seventh root of 391380 to the nearest integer? 6 What is the eighth root of 607841 to the nearest integer? 5 What is 5933144 to the power of 1/7, to the nearest integer? 9 What is the cube root of 151930 to the nearest integer? 53 What is the seventh root of 920336 to the nearest integer? 7 What is 945467 to the power of 1/10, to the nearest integer? 4 What is the ninth root of 415709 to the nearest integer? 4 What is the eighth root of 579095 to the nearest integer? 5 What is 384314 to the power of 1/3, to the nearest integer? 73 What is 125602 to the power of 1/7, to the nearest integer? 5 What is 231768 to the power of 1/2, to the nearest integer? 481 What is the square root of 2489172 to the nearest integer? 1578 What is 3388738 to the power of 1/5, to the nearest integer? 20 What is 10806010 to the power of 1/4, to the nearest integer? 57 What is 3148008 to the power of 1/7, to the nearest integer? 8 What is the seventh root of 376272 to the nearest integer? 6 What is the square root of 835017 to the nearest integer? 914 What is 118529 to the power of 1/10, to the nearest integer? 3 What is 4620674 to the power of 1/5, to the nearest integer? 22 What is the third root of 704219 to the nearest integer? 89 What is the eighth root of 229037 to the nearest integer? 5 What is 1487998 to the power of 1/3, to the nearest integer? 114 What is the square root of 70805 to the nearest integer? 266 What is the seventh root of 6013474 to the nearest integer? 9 What is 549805 to the power of 1/4, to the nearest integer? 27 What is 3152044 to the power of 1/3, to the nearest integer? 147 What is 317748 to the power of 1/6, to the nearest integer? 8 What is 80723 to the power of 1/2, to the nearest integer? 284 What is 599651 to the power of 1/4, to the nearest integer? 28 What is 542662 to the power of 1/3, to the nearest integer? 82 What is 179487 to the power of 1/3, to the nearest integer? 56 What is the third root of 38524684 to the nearest integer? 338 What is the third root of 398137 to the nearest integer? 74 What is 1673397 to the power of 1/8, to the nearest integer? 6 What is the cube root of 21265916 to the nearest integer? 277 What is 3264177 to the power of 1/2, to the nearest integer? 1807 What is 2738912 to the power of 1/3, to the nearest integer? 140 What is 792582 to the power of 1/4, to the nearest integer? 30 What is 2057574 to the power of 1/2, to the nearest integer? 1434 What is 334175 to the power of 1/5, to the nearest integer? 13 What is the cube root of 1100176 to the nearest integer? 103 What is the cube root of 10302444 to the nearest integer? 218 What is the square root of 1362049 to the nearest integer? 1167 What is the eighth root of 2345914 to the nearest integer? 6 What is 48552 to the power of 1/7, to the nearest integer? 5 What is the cube root of 83878 to the nearest integer? 44 What is 9287006 to the power of 1/2, to the nearest integer? 3047 What is the eighth root of 17243710 to the nearest integer? 8 What is the sixth root of 94904 to the nearest integer? 7 What is the square root of 107896 to the nearest integer? 328 What is 292579 to the power of 1/10, to the nearest integer? 4 What is the eighth root of 575352 to the nearest integer? 5 What is the third root of 250355 to the nearest integer? 63 What is the square root of 3886527 to the nearest integer? 1971 What is 930117 to the power of 1/3, to the nearest integer? 98 What is the square root of 734254 to the nearest integer? 857 What is the third root of 4032830 to the nearest integer? 159 What is 731068 to the power of 1/3, to the nearest integer? 90 What is the third root of 7947288 to the nearest integer? 200 What is 382742 to the power of 1/3, to the nearest integer? 73 What is 448658 to the power of 1/3, to the nearest integer? 77 What is 4976501 to the power of 1/9, to the nearest integer? 6 What is the seventh root of 405371 to the nearest integer? 6 What is the third root of 18764543 to the nearest integer? 266 What is the third root of 96350 to the nearest integer? 46 What is 1054162 to the power of 1/2, to the nearest integer? 1027 What is 1156100 to the power of 1/2, to the nearest integer? 1075 What is the eighth root of 189152 to the nearest integer? 5 What is 698844 to the power of 1/7, to the nearest integer? 7 What is 897617 to the power of 1/4, to the nearest integer? 31 What is the third root of 101679 to the nearest integer? 47 What is the square root of 1107556 to the nearest integer? 1052 What is 2854465 to the power of 1/8, to the nearest integer? 6 What is the square root of 22344895 to the nearest integer? 4727 What is the third root of 2332333 to the nearest integer? 133 What is the square root of 239226 to the nearest integer? 489 What is the cube root of 26980 to the nearest integer? 30 What is the square root of 9689227 to the nearest integer? 3113 What is 121636 to the power of 1/2, to the nearest integer? 349 What is 119031 to the power of 1/2, to the nearest integer? 345 What is the square root of 65388 to the nearest integer? 256 What is the square root of 217123 to the nearest integer? 466 What is 411829 to the power of 1/3, to the nearest integer? 74 What is 6716803 to the po	{ "pile_set_name": "DM Mathematics" }
. -5 Suppose -2x = -0x - 8. Let i = -12 + 10. Let u be ((-16)/12)/(i/6). Solve um + 2n + x = 3n, 0 = -3m - 5n - 26 for m. -2 Suppose 4 = -d + b, -3d - 2 - 8 = -2b. Let v be 3d/(-6) + 5. Solve -4l = 12, 2l + v = -h + 2 for h. 2 Suppose 2n = -0n - 16. Let f be 6/(-8)n/2. Solve -y = -fv - v + 13, 2 = v for y. -5 Let d be 0/(1/(4/8)). Solve -b - 4g - 10 = d, 4g - 6g - 10 = -2b for b. 2 Let z = 25 + -11. Solve 5o + 4 = 4w + z, 5w + 23 = o for o. -2 Suppose k = -5a - 15, 0 + 2 = 2k + 2a. Suppose 5p - p = 5l + 1, l + 17 = kp. Solve -3g = -i - 3i + 3, 0 = pg - 4i for g. 3 Let w(k) be the third derivative of -3k*2 + 1/3k*3 + 1/24k*4 + 0k + 0. Let r be w(2). Solve -10 = 2x + y + y, -8 = ry for x. -3 Suppose -4j + 3t = 0, -4j - 4 = -3t - t. Solve 2q + 0q + 14 = -2f, -jf = 6 for q. -5 Let i = 50 - 10. Suppose -3n + 0n = 5z - i, -5n = 5z - 50. Solve 2j - 4u + 3 = j, zj = 4u + 17 for j. 5 Suppose -7d + 112 + 35 = 0. Solve -5h + 4q - 41 = 0, -3h + 4q = -2h + d for h. -5 Suppose 0j + j + 2 = 2b, 0 = -b + 3j + 6. Let f be b/15/10. Solve 4h - 1 = -m - 10, -5m + 2h - 1 = f for m. -1 Let i = -85 - -87. Solve 3g = -il + 11, -3g + 5l = -4 - 0 for g. 3 Let d(k) = -7k + 4 - k2 + 4 + 2k*2. Let x = 42 + -36. Let y be d(x). Solve 1 = -v, -ys + v = s + 14 for s. -5 Let i be ((-6)/4)/(2/(-24)). Let g = i + 19. Solve 0 = -l - 5n + 10, 0n + g = -5l + 4n for l. -5 Let s(y) = -y*3 - 5y*2 - 7y + 1. Let d be s(-3). Solve -5r = 5b + 20, dr - 5b = -12 - 13 for r. -5 Suppose 0 = -5b - 15 + 5. Let f be (-2)/(-2) + b/(-2). Solve 3x - 9 = -5c + 2x, -f = -3c - 4x for c. 2 Suppose -2w + w = -4. Solve t + 5 = -2s, 0 = -3t + 1 - w for s. -2 Suppose 0 = -4l + 20, 32 + 23 = 3x + 5l. Let p = 13 - x. Solve pi - 14 = 8s - 4s, -4s = 4i for s. -2 Let f = -30 - -42. Suppose -3d + b = -6d + 4, -4b = -2d + f. Solve -4m - 14 = -j - 0m, dj = m for j. -2 Suppose 0 = -3m - s, -4s + 9s = 2m - 17. Solve 4z = 5i - 21, -4i - 2z - 3 = m for i. 1 Let q(m) = -2m + 3. Let k be q(0). Solve -g + k = -2g, 0 = -4o + 5g + 3 for o. -3 Let p(r) = r*3 - 7r*2 + 7r - 3. Let f be p(6). Let q be ((-5)/3)/((-2)/(-36)). Let j be (4/10)/((-3)/q). Solve -3n + 2h = 11, -fh + jh = -4n for n. -1 Let o be 2 - 2 - 2 - -2. Suppose f + 0f - 5 = o. Solve -4l + 28 = 4p, fl - 22 = 3p - 3 for l. 5 Let y = 65 + -42. Solve 0 = 2l - 0g + 3g + y, -3l - 4g - 32 = 0 for l. -4 Suppose -20 = -4a + 4x, 0x = a + x - 1. Let r(j) = 4 + 6 - a - j*2 - 4j. Let v be r(-5). Solve -8 = s + 3d - vd, 0 = 4d + 16 for s. -4 Let l = 4 + 1. Let o = -433 + 438. Solve 3c = -2c + 2h + 4, oh = lc - 10 for c. 0 Let s be ((-15)/10)/(6/(-8)). Let j be (-3 + 5)/((-1)/(-2)). Solve -2h - sh - jv = 28, -4h - 5v = 32 for h. -3 Suppose -2t + 21 - 21 = 0. Solve -z - 4a = t, -z = -4z + 4a for z. 0 Let v = -56 - -60. Solve -20 = y + 5s, vy = 5s - 3s + 8 for y. 0 Let f = 5 + -3. Let r be (20/(-28) + 1)7. Solve -2p + 26 = -rc + fp, 2p = 10 for c. -3 Let m = -10 + 18. Suppose w + m - 55 = 0. Suppose -3j + 125 = w. Solve 5l = -2n + j, 4l - 4n - 7 = -n for l. 4 Suppose u + u = 8. Suppose 0 = -ua - 3o + 10, 4o + 2 = -a - 2. Suppose 2 = 2r - 4. Solve -16 = rt - 2d, -at + 0d - 24 = -4d for t. -4 Let h = -120 + 57. Let k = -32 - h. Solve -3l + 0 - k = -5r, -28 = -4r + 4l for r. 5 Let w = -17 + 20. Solve -wz = -d - 19, 0d = 3d + 12 for z. 5 Let s(m) = 4m - 8m + 4m - m*2 - 4m + 1. Let f be s(-3). Solve 2k - 2j + 14 = k, -5k = fj for k. -4 Let c(b) = -b*3 + 5b*2 + 6b + 5. Let w be 8/12 + (-16)/(-3). Let r be c(w). Let q be 2 - (-2 - 0/2). Solve q = -a + l + 5, -l - 19 = ra for a. -3 Let r = 6 - 3. Suppose -k = d - 2k + 7, 9 = 3d + rk. Let i(m) = -m3 - m2 + m - 2. Let j be i(d). Solve 0o + 3n + 14 = -5o, j = 5o + 4n + 17 for o. -1 Suppose -u = 2u - 63. Suppose -2a - a + u = 0. Let x(z) = z2 + 1. Let q be x(1). Solve 2w + n - 8 = 0, -w - an = -qn - 13 for w. 3 Let w = -28 + 32. Solve -3i + w + 1 = p, 5p = -i - 3 for p. -1 Let d be ((-8)/(-12))/(2/15). Solve 2x - 24 = -4m, 4m - 14 = -2x + dx for m. 5 Let w be 60/80 + (-6)/8. Solve w = 3i - 2d - 4, -2i + 4d + d - 12 = 0 for i. 4 Suppose -c - 4c = 0. Let f(l) = l*2 + 6l - 14. Let u be f(-8). Solve -b - d - u = -c, 25 = 5b - 2d for b. 3 Let a = 58 - 40. Solve -16 = c - 5j, -2c = 3j - a - 2 for c. 4 Suppose -5a = -2b - 101, -3a + 4b = -a - 34. Solve 5k + 16 = 4o - a, 20 = -k + 5o for k. -5 Let m = -53 - -135. Let u = -58 + m. Solve -3l - 3n + 11 + 10 = 0, -4n + u = 2l for l. 2 Let x(t) = t*2 - 7t - 4. Let o be x(8). Let u = 40 + -16. Suppose -15 = 5c + 5g, -2c + 3g = -g - u. Solve -c = -n - 4k, -2n = -0n - 2k - o for n. 2 Suppose -4b = 5c + 2 + 11, 4c = 3b - 29. Solve o - bv = 0, -3o + 5v - 2 = -2o for o. 3 Suppose 5n = -5j - 15, -4n - 28 = -0j - 4j. Let w(z) = -z + 2 + jz - 1. Let o be w(2). Solve 2v + g - 5g = -18, 0 = -ov + 3g - 15 for v. -1 Suppose l = 1 + 2. Suppose -6 = -5p + 3j, -6 = -p + 5j - 2j. Solve -4z + 3f + 18 = 0, z + 3f + pf = -l for z. 3 Let h be ((-1)/(-2))/(2/20). Solve 5x - t - 3t = -5, 0 = -2x - ht - 2 for x. -1 Let j be (-5)/2(-24)/20. Solve a = 4v - 2a + 18, 0 = -jv - 5a + 1 for v. -3 Let d = -8 - -12. Suppose -v + d = 1. Solve vc + 5p = 17, -2 + 18 = -4c + 3p for c. -1 Let u be 1/((2 - 0)/14). Let b = -8 - -3. Let h = u + b. Solve -17 = 5w + hk + 8, 2w = -3k - 21 for w. -3 Let r(n) = -35n3 + n2 + 4n + 3. Let a be r(-1). Solve -5x = -0x - 5s - a, 0 = 2x - 3s - 16 for x. 5 Suppose d - 3y + 9 = -2, 3d = 5y - 13. Suppose -75 = dk - 9k. Let l(o) = 4o*2 - o - 1. Let r be l(2). Solve 4s - k = j, -s = s + 5j - r for s. 4 Suppose 4 = 3r - 2r. Suppose 2c = 3c - 3, 2i - rc = -6. Solve 2u - 2q + 12 = 0, -4u - iq + 2q = 14 for u. -4 Suppose 17 = 7v - 4. Solve 22 = -0d + 2d - 4b, -2b = -vd + 17 for d. 3 Suppose s = 2b - 12 - 0, 4b = -4s. Solve by = 2p - 4p + 28, -3p = 4y - 32 for p. 4 Let d be ((-2)/(-4))/(14/196). Suppose -p = -h + d, -5h - p + 23 = -2p. Solve -3g - 19 = -ha, -4g - 5a = -6 - 10 for g. -1 Let m(x) = -x*3 - 9x*2 - 14x. Let a be m(-7). Solve a = -4t + 3y + 13, 1 = 3t + 5y + 13 for t. 1 Let x be 132/60 + 2/(-10). Suppose 3d - 3s + 3 = 0, d + 4s - 2s = 14. Suppose -dq + 2 = -x. Solve 0 = 6c - 3c + 6, j = -2c - q for j. 3 Suppose -1 - 1 = -2v. Let i(b) = 20b + 1. Let s be i(v). Solve t + 5g - 24 = 0, 4t + 6g = g + s for t. -1 Let r(x) = x + 5. Let l = -3 + -2. Let u be r(l). Solve 2c + i - 12 = u, i + 4i - 20 = 0 for c. 4 Let j(m) = -8m + 2. Suppose 4 + 2 = -3i. Let l be j(i). Solve -5h - l = -y + 6, -40 = -5y + 5h for y. 4 Suppose -2b + 2 = -2. Suppose -2w + 4w - 10 = 0. Suppose 4g + 10 = -wt + 6g, 4t - 2g + 10 = 0. Solve -4j + t + 13 = 5q, -4j = -bq - 6 for q. 1 Let b(a) be the first derivative of a*2/2 - 6a - 2. Let m be b(6). Solve 5j = -q, m = -0q + 5q - 4j - 29 for q. 5 Let i(w) = 11w - 1. Let d be i(2). Solve 3 = l, 2o + d = -3o + 2l for o. -3 Let l(x) = x*2 - 2x + 5. Let v be l(0). Solve h + 5m + 25 = -v, -2h + 4m = -10 for h. -5 Let h be 1 - ((-4)/(-2) - 2). Let p be (h + 0)/(3/9). Solve 2a - n = 0, -a - pn + 12 + 2 = 0 for a. 2 Suppose 20 = 4p + p. Solve -3b - 5h - 29 = -0, -pb = 4h + 28 for b. -3 Let c(s) = s + 6. Let b be c(-6). Solve -5m + 2z = 0, -7z + 2z + 25 = b for m. 2 Suppose 11m = 5m. Solve m = -5j + 2p - 4p + 24, -p = -4j + 14 for j. 4 Let y(o) = o + 2. Let w be y(0). Let l = -6 - -8. Suppose -s - d + 5 = 0, ls + 4d = s + 14. Solve 0 = 3q + 15, -wf + 11 = -3q + s for f. -3 Let q = 21 - 15. Solve 0 = 2u, -f = 2u - qu for f. 0 Suppose -w + 1 = -j, -5w + 3w - 10 = 0. Let b be 3(-4)/j - 0. Let v = -9 + 13. Solve -bn - 2p = p + 3, -n + vp = -4 for n. 0 Let q = -52 - -60. Solve -5t = -t + q, -24 = -4l + 4t for l. 4 Let h = -10 + 14. Suppose -hd = 32 - 148. Solve 25 = -5v, 0 = 5m - 3m - 5v - d for m. 2 Let x(b) = -b*3 + 7b*2 + 3. Let n be x(7). Suppose na = d + 15, 3a = 5a - 3d - 17. Solve o = -2o + 5k - 12, -ak + 14 = 2*o for o. 1 Let n be	{ "pile_set_name": "DM Mathematics" }
5278. What is nh(j) + 6k(j)? 2j2 - j + 3 Let u(q) = 23q + 24q + 3 + 26q + 19q - 96q. Let i = -11 + 16. Suppose -i = 2g + 3. Let p(v) = 3v - 3. What is gu(w) - 5p(w)? w + 3 Suppose 1126n + 12 = 1123n. Let i(q) = -q*2 + 3q - 1. Let y be ((-5)/4)/(5/20). Let f(g) = g*2 - 4g + 1. What is nf(c) + yi(c)? c*2 + c + 1 Let q = -275 - -281. Let d(n) = -23n*3 + 13n*2 - 13. Let s be (0 - -1)/(12/(-156)). Let v(u) = -11u*3 + 6u*2 - 6. Give qd(x) + sv(x). 5x*3 Let x(k) = -7k*3 + 26k*2 - 4k. Let w(c) = -3c3 - c2 - 2c. Determine 4w(z) - 2x(z). 2z3 - 56z*2 Let n(a) = -2a3 + 7. Let m(f) be the third derivative of -f6/120 + f*3/3 - 742f*2. Determine 7m(j) - 2n(j). -3j*3 Let z(k) = -7k*2 + 14k - 4. Let c(l) = -10l2 + 20l - 6. Determine 5c(g) - 7z(g). -g*2 + 2g - 2 Let t(m) = 19. Let h(b) = -3. Let l(i) = -39h(i) - 6t(i). Let s(w) = -w - 16. What is -11l(z) - 2s(z)? 2z - 1 Let t(c) = -c2 - 21c - 48. Let q be t(-18). Let a(b) = -8b - 3. Let z(p) = -23p - 4 - 10 + 5. What is qz(d) - 17a(d)? -2d - 3 Let d(u) = u2 - 2u - 1. Let h(l) = -12l2 - 4l. Give -2d(r) + h(r). -14r2 + 2 Let k(z) = -z + 1. Let p(n) be the third derivative of -n4/24 + 5n3/6 + 49n*2 - 2n. Calculate -10k(s) + 2p(s). 8s Suppose -12 = a - 7a. Let n(b) = ab2 + 3b*2 - 3 + 3. Let z(y) = 5y*2. Determine 4n(o) - 3z(o). 5o*2 Let s(a) = -2a + a*2 + 5a*2 - a - 3. Let z(w) = -2w*2 + w. Let u(t) = 2t*2 - 2. Let f(j) = -u(j) + 2z(j). Determine -3f(l) - 2s(l). 6l2 Let f(c) be the third derivative of 0c*4 + 0c*3 + 0 - 1/60c*5 + 0c - c*2. Let w(a) = 2a + 1 - 13a2 + 10a*2 - 2a. What is f(z) - w(z)? 2z2 - 1 Let j(d) = 11d*3 + 16d*2 + 12. Let w(t) = 10t*3 + 15t*2 + 10. Determine -5j(r) + 6w(r). 5r*3 + 10r*2 Let j(m) = -9m*3 - 3m*2 - 3m. Let t(x) = 22x2 - 12x*2 - 2x - 5x2 - 7x*2 - 8x*3. Calculate -2j(c) + 3t(c). -6c*3 Let q(t) = 9t*2 - 7t - 40. Let y(f) = -7f2 + 6f + 38. Calculate -4q(g) - 5y(g). -g*2 - 2g - 30 Let i(v) = 29294v3 + 755v*2 - 755v - 755. Let n(k) = -155k3 - 4k*2 + 4k + 4. Give 4i(w) + 755n(w). 151w3 Suppose 1060 + 1068 = -16k. Let j(a) = -19a2 - 4. Let b(t) = -627t*2 - 133. Calculate kj(u) + 4b(u). 19u*2 Let v(m) = 11m + 21 - 15 - 8 - 12. Let q(f) be the second derivative of 2f3/3 - 5f*2/2 + 3f. Give 17q(s) - 6v(s). 2s - 1 Let v(t) = -9t - 3. Let a(h) = -3 + 1 + 6h + 3h + 6. Determine 3a(s) + 4v(s). -9s Let h(l) = 3l*2 - 3l + 3. Let i(d) = d2 - 2. Let j(y) = -h(y) - i(y). Let a(r) = -r2 + r. Determine -5a(c) + j(c). c2 - 2c - 1 Let p = -2476 - -2474. Let a(t) = -2t2 - 6t + 2. Let z(k) = k + 1. Calculate pz(n) + a(n). -2n*2 - 8n Let y(b) = 620b2 + 10b - 7. Let m(w) = w*2 + 2w - 1. Give 5m(d) - y(d). -615d*2 + 2 Suppose -3u = 7u - 50. Suppose 3d = -4f - u, 12 = 3d - d - 5f. Let v(i) = i - 1. Let r(y) = -1. Calculate dv(x) - r(x). x Let t(h) = -17h + 3. Let a(g) = 18g - 3. Determine 3a(o) + 4t(o). -14o + 3 Let x = 32 - 28. Let k be x3/61. Let v(o) = -15o*2 + 27o*k - 13o2. Let j(f) = f3 - 5f2. Determine j(d) - 6v(d). d3 + d2 Let s(h) = 2h2 + 13h - 6. Let r = -44 - -44. Suppose r = 2o + 8, 4o = -2b - 6 - 6. Let g(z) = z2 + 4z - 2. Determine bs(c) - 7g(c). -3c2 - 2c + 2 Let o(n) = 20n + 8. Let m(z) = 22z + 6. Determine -5m(u) + 4o(u). -30u + 2 Let w(b) = 7b*3 - 6b*2 + 4b. Let h(a) = -849a3 + 11a*2 - 6a*2 - 3a + 843a3. Give 4h(s) + 3w(s). -3s*3 + 2s*2 Let z(f) = -2f + 42. Let j(v) = -3v + 42. Calculate -3j(t) + 4z(t). t + 42 Let h(f) = 18963f*3 + 198f*2 + 198f. Let w(g) = 387g3 + 4g*2 + 4g. Give -6h(i) + 297w(i). 1161i3 Suppose 0 = q + 3, -5r - q - 21 = -3. Let f(y) be the second derivative of y3/6 - y2 + 2y + 2. Let x(k) = 0 + 2 - 1. Calculate rx(h) - 2f(h). -2h + 1 Let x(c) = 1321c + 4. Let j(p) = -42276p - 130. What is -2j(d) - 65x(d)? -1313d Let c(g) = -2g*3 - 52g*2 + 3g - 4. Let o(s) = s*3 + 53s*2 - 2s + 3. Calculate -3c(r) - 4o(r). 2r3 - 56r*2 - r Let f(g) = 1911g + 5. Let w(i) = 2869i + 8. What is -8f(o) + 5w(o)? -943o Let y(q) = 3q3 + 2q*2 + 5q + 5. Let n(f) = -4f3 - 3f*2 - 7f - 8. Let c = 413 - 418. What is cn(g) - 7y(g)? -g3 + g2 + 5 Let y(f) = 2f + 2. Let r = -12 + 22. Let h(j) = 2j*2 - 21j + 13. Let c be h(r). Let i(d) = d + 1. Let l = 2 + -3. Determine ci(p) + ly(p). p + 1 Let b(q) = 12q2 + 8q*2 + 4q*2 + 8q*2 - 13q2 - 4. Let r(x) = x2 - 1. What is b(p) - 4r(p)? 15p*2 Let q(h) = -10h*2 - 16h + 22. Let p(o) be the first derivative of 7 - 5/2o2 - o3 + 7o. Calculate -16p(m) + 5q(m). -2m2 - 2 Let o(f) = -3f - 667. Let c(t) = t + 222. Give -7c(a) - 2o(a). -a - 220 Let d(k) be the third derivative of -7k6/120 + k5/60 + k4/6 - k3/3 + 752k*2. Let v(o) = 8o3 - o2 - 5o + 2. Give 5d(z) + 4v(z). -3z3 + z2 - 2 Let c(p) = -4p2 - 4p + 3. Let f(o) = -3o2 - 3o + 2. Let y be ((3 - 5)/(-6))/(27/486). Determine yf(s) - 5c(s). 2s2 + 2s - 3 Suppose -3b = 2a + 10, -4a - b + 2 = -6b. Let j(i) = 0i2 - 10i - i*2 + 7i. Let r = -44 - -33. Let k(s) = 5s2 + 16s + 1. Give ak(h) + rj(h). h*2 + h - 2 Let o(q) = -2q2 - 5. Let h(z) = z3 - 5z2 - z - 9. Calculate -2h(i) + 5o(i). -2i*3 + 2i - 7 Let i(l) = -7l + 15. Let b(f) be the first derivative of f2/2 + f + 7. Let d(n) = 7n - 5. Let s(h) = -3b(h) + d(h). Calculate -6i(z) - 11s(z). -2z - 2 Let k = -2 + -15. Let x(d) = 14d - 1. Let f(p) = 5p. Determine kf(t) + 6x(t). -t - 6 Let i(w) = -7w2 - 48w + 9. Let x(v) = -8v2 - 49v + 10. Calculate 7i(k) - 6x(k). -k*2 - 42k + 3 Let h(v) = 18v + 22. Let j(w) = 2. Calculate h(z) - 12j(z). 18z - 2 Let p(q) = 3q*3 + 9q*2 + 5q + 118. Let b(a) = 4a3 + 14a*2 + 8a + 177. Calculate 5b(n) - 8p(n). -4n3 - 2n*2 - 59 Let i(k) = 2k*3 + 5k + 6. Let n(t) = -2t3 - 4t - 5. Let m = -3 - -7. Suppose 1 = 3l - 2, -3l - 17 = mx. Give xi(v) - 6n(v). 2v*3 - v Let p(x) be the third derivative of 0 + 0x + 14x2 + 7/24x*4 + 1/3x*3. Let z(a) = 13a + 3. Determine -7p(s) + 4z(s). 3s - 2 Let z(r) be the first derivative of -r2/2 - 2r - 122. Let c(f) = -4f - 4. Let p(o) = -1. Let j(u) = c(u) + 5p(u). Determine -4j(i) + 18z(i). -2i Let o(g) = -197g*3 - 3g*2 - 1. Let j(k) = -2k3 - k2 - 1. Determine -j(u) + o(u). -195u3 - 2u*2 Let q(l) = -11l*3 - 14l + 17. Let b(z) = 4z3 + 5z - 6. Suppose -16k - 420 = 1852. Let f = k + 159. Give fb(r) + 6q(r). 2r*3 + r Let t(f) = 4f*2 + 3f + 2. Let y(x) be the third derivative of 0x + 5/24x*4 + 0 + 7/60x*5 + 1/2x*3 - 6x*2. Calculate 5t(w) - 3y(w). -w2 + 1 Let p(g) = -g. Suppose -5q - 3f - 9 + 34 = 0, 2q = f - 1. Let r(c) = 6c. Give qr(o) + 4p(o). 8o Let c(s) = -s - 3. Let a(p) = 374p - 12. Calculate a(w) - 4c(w). 378w Let h(d) = d2. Let m(o) = -10o*2. Suppose f + 7 = 4f + g, 0 = -g - 5. Let w = -2522 + 2567. Calculate fm(c) + wh(c). 5c2 Let o(u) = 4u + 14. Let b(i) = -13i - 29. Calculate 3b(l) + 5o(l). -19l - 17 Let y(k) = 104747k3 - 1043k + 1043. Let a(x) = -301x3 + 3x - 3. What is -1043a(d) - 3y(d)? -298d3 Let m(c) = 12c*2 - 10c - 2. Suppose 0 = t + 4o - 22, 5o + 13 = -2t + 48. Let z(y) = -y2 + y - 1. What is tz(j) + m(j)? 2j2 - 12 Let v(j) = 7j. Suppose 0 = 2d + 5r - 26, 8 = 4d - 0r - r. Let c(i) = 3i - 3. Let s be c(d). Let m(p) = -p. What is sm(o) + v(o)? o Suppose 8v - 18 = 9v. Let z = -17 - v. Let q(a) = -z - 3a + 3a - 3a + 2a. Let b(j) = j*3 + 5j + 6. Calculate -b(x) - 5q(x). -x3 - 1 Let w(g) = 20g*2 + 2g + 5. Let n(b) = -64b2 - 7b - 16. Calculate 2n(c) + 7w(c). 12c2 + 3 Let m(v) = 13v + 2. Let o(r) = 3r. Determine 2m(y) - 14o(y). -16y + 4 Let i(s) be the second derivative of 3s5/20 - s4/3 + 2s*2 + s - 8. Let z(k) = 4k*3 - 5k*2 + 5. Determine 5i(g) - 4z(g). -g3 Let n(v) = -11v. Let m(z) be the first derivative of -14 + 0z - 5/2z*2. Determine -9m(b) + 4n(b). b Let d(r) = 11r**2 + 4. Let h(x) = -	{ "pile_set_name": "DM Mathematics" }
48) + -20 - 16/(-68) -6/11 Evaluate (3050/112 - 23) + -1 + (-16)/(-14). 35/8 What is the value of (18/891)/(9 + 8676/(-972))? 3/11 What is the value of (72/42)/(69345/10787)? 4/15 What is 18/(-4)(-4272)/(-801)? -24 95/5985455/195 1/27 What is ((-1)/2 - (-4)/(-16)-8)/(6/108)? 27 ((-3060)/(-4590))/(4/(-6)) -1 Evaluate (-16106)/(-491233)-1(-3)/(-6). -1/61 (16/168 - 16302/504)(-356 - -352) 129 Calculate 189/81204/(-112). -17/4 7((28 - -1) + (-22104)/504) -104 Calculate (7/((-280)/940) - 2)-2. 51 Evaluate (16 - 486/36)(14 - (-1730)/(-125)). 2/5 What is 10/(-65) + 30/50 + (330448/520)/(-19)? -33 Evaluate (-10)/28151/(-120800)420. 3/16 (-54)/24-2 - -1(-10)/4 2 Calculate (-10)/(-18) + ((-164536)/2196)/131. -1/61 18 - (-1705 + 1705)/(2/(21)) 18 What is the value of ((-280)/21)/(2388/8955)? -50 Evaluate -15(-5)/(-105)102/255. -2/7 What is the value of (152/(-1292) - (-1)/((-136)/(-84)))/(376/(-32))? -2/47 2 + 45/27 - (-15 - (11 + -23)) 20/3 What is ((-10)/(-248))/((-6800)/10880)? -2/31 Evaluate (-21 + ((-11448)/16)/(-27))5/(5/(-6)). -33 What is the value of 8/(-36)3 - ((-66)/1848 + (-3685)/(-1848))? -21/8 What is the value of ((5 - (-12784)/(-2560))/((-1)/3))/(40/100)? -3/64 241/((-180750)/(-1950))15/(-2) -39/2 Evaluate ((70 - 57) + -16)-111 - -1. 34 Evaluate 1/2(9 - 40(-1150)/(-400)). -53 Calculate 396/(-81)18/4. -22 What is -52 + 1/(-27)-1161? -9 134/190 + 100/(-950) - ((-508)/(-30) + -15) -4/3 (-4)/(-90) - (-184606)/(-275760) -5/8 Evaluate ((-175)/140)/(145/696). -6 What is the value of (28/(-32))/((-56)/(-112)) + (-682)/8? -87 Evaluate ((-4)/(-2))/(36/6(-25)/((-2700)/(-1206))). -2/67 What is the value of 4/(-20) - (81179/1855 - 44)? 2/53 Evaluate 4921/98 - 5 - (-408)/(-1904). 45 What is -25 + (181 + -74 - 22)? 60 Calculate (445/60 + 17/102)12. 91 9 + (-17)/51 + 39040/(-4512) 2/141 1/16 + 274040/8320 33 Evaluate (-3)/(-21)((-1476)/378 + 4 + (-8)/(-63)). 2/63 What is the value of -402 + 407 - ((-339)/(-337)1 - -4)? -2/337 ((-248)/3078 + (-60)/(-570))/((-2)/3) -1/27 What is the value of 10 - (-5 + 2445/165)? 2/11 What is the value of 645/40(-252)/(-189)2? 43 Evaluate 9244/168 + 3 + (-635)/26670. 58 Evaluate ((5 + 1281/(-255))/((-14)/(-28)))/(126/45). -2/119 (216/32 - (-45)/(-12))13/(-4) -39/4 What is the value of (-20540)/790 + (1 - 59) + 17? -67 Calculate 8/52 - (-128)/13 - 15/(-1110)-746. -3/37 Calculate 3(107/1284)/((-1)/(-128)). 32 What is the value of (-4)/46(-16269)/5742? 17 Calculate ((-7761)/(-398))/((-13)/(-2)) - (-51)/(-16). -3/16 What is (13/(-210) - ((-39592)/840 - -47))/(3/54)? 9/7 Evaluate (-2)/32-56 - 6/(36/30). -3/2 What is (-27)/((-1485)/2926) - ((-14)/77 + (-68)/110)? 54 (-3444)/3003 - 1620/(-3564) -9/13 Calculate 1500/(-171) + (-11 - (-14)/133(-211)/(-2)). -26/3 What is (2/((-8)/(-44))(-54)/18)/(-17 - -16)? 33 What is (148/(-518) - (-526)/28) + 42/(-28)? 17 What is 11322/(-7548)(-68)/6? 17 Calculate ((-18)/(-108) + (-345)/(-9))8/(-14). -22 What is the value of -25(12 - 15)16/2160? 5/9 Evaluate 2156/462 + ((-1)/9)/((-5)/15). 5 What is the value of -17 + 8/7 + (630/98)/(-3)? -18 What is 28((-74)/1295)/(10 + 990/(-100))? -16 (510/1173)/((-570)/(-89148)) 68 Calculate (1470/(-1575))/((-1260)/200). 4/27 Calculate 76 + (-4607)/595098. 3/25 Calculate (-9)/(-4) + (-8760)/3360. -5/14 What is (-92)/(-414)49761/194? 57 Calculate (2 - (3 - (-927)/(-15))) + 6172/(-7715). 60 Evaluate ((-175)/(-14) + -14)/((-630)/(-720)). -12/7 What is (-6 - 2) + 135 + -122? 5 What is the value of 35 + (-3540)/112 - ((-150)/(-24) + -2)? -6/7 Evaluate (-102 - -96)10/6. -10 What is (2(-6)/8)/(82 - 76) - 524/16? -33 Calculate (-20)/15 + (19 - (-915)/45 - (0 - -2)). 36 What is the value of 212161/(-56)(3 - 40/12)? 23 What is (466176/(-4032) + 118)/(8/(-14))? -25/6 Calculate 1/(-3)(13182/(-273) - -62). -32/7 Calculate (-98 - 2)722/2888 - 107 - (0 + 2). -134 (-84)/154188/(-141) 8/11 (1 - 10) + (81729/(-675) - -94) + (-4)/(-50) -36 Calculate 322/464 + 103 + 582855/(-5655). 5/8 17 + 2976/(-3200)20 -8/5 What is the value of 85032/(-1181) + 3 + -35? -104 Evaluate -4(-232)/75413. 16 Evaluate ((-3)/(-84))/((-5181)/(-4642176)). 32 What is the value of (-20)/(-4)(133/(-10) + (-6006)/(-462))? -3/2 (-3)/(-6) - 715/825 - (4/(-15))/(-2) -1/2 Calculate (9256320/(-70620) - -130) + 24/22. 2/107 Calculate (-12)/46(-15146 + 15054). 24 Evaluate 1/((5/302)/(4 + (-18)/2)). -15 What is the value of (-3710)/(-126) + -12 + (-21 - -3)? -5/9 250/11 + -5 + (530 - 547) 8/11 What is the value of (-44 - -34) + ((-9)/99)/((-3)/282)? -16/11 806/(-14) + (1254/(-7315))/((60/25)/6) -58 What is (20653 - 20655)(-1 - 56)? 114 Calculate 69 - (-17 - 85668/(-990)). -8/15 Evaluate 67 + 651(-145)/1421. 4/7 Evaluate 12 + (0 + (-45)/(-4))(-3820)/2865. -3 263/((-203036)/(-26055))8/6 45 What is 4/7 + 26832/7826? 4 What is (336/294)/((-55)/(-7) - 7)? 4/3 What is (-22)/(-3080)10 + (-2159)/238? -9 Calculate -19 - (111/(-4773) - (-7266)/(-43)). 150 (-432)/128 - 84819/(-25032) 2/149 Calculate (-476)/1378 - 52/(-169). -2/53 What is ((-72)/(-189))/(998/(-1497))? -4/7 (112/42)/((-1360)/52530) -103 What is the value of -23 + (2 - 3)/(4/(-32))? -15 Evaluate (-5)/(-150)-4 + (-20 + -1 - 835158/(-39240)). 3/20 Calculate -296(-15)/(-3600) + 180/75. 7/6 What is ((-265)/(-15) + -1)(-8 - 427/(-35))? 70 What is the value of (1 - 19) + (7992/(-108) - -81)? -11 (-2)/(8/68) - 3300/(89 - -11) -50 (-730 - -714) + -1 + (-858)/(-50) 4/25 Calculate (3/(-63))/((1340/(-6600))/(-67)) + 10. -40/7 Evaluate 93(-256)/(-2208192)(18/(-4) + 1). -2/53 Calculate ((-90)/(-40) + 1/3-21)1. -19/4 Evaluate (3 - (-28)/(-105)) + (-19)/(57/4). 7/5 ((-20)/(-7))/(((-3468)/119)/34) -10/3 (282/(-4))/(-1)(-6 - (-16598)/2895) -94/5 Calculate 4/(-42) - (-538835)/(-10185). -53 What is the value of (3536/(-612))/(169/1521)? -52 What is the value of (-1960)/140 + 33768/945((-284)/(-204) + -1)? 2/153 Calculate 147 - (190 - (101 + -8)). 50 Evaluate (-35256)/339060/(-13). 48 (-131)/19 + 193/(-10422)-378 2/19 What is 94/(-198) + (-31)/3348-12? -4/11 Calculate ((-2)/5 + 32/40)(20790/216)/(-77). -1/2 Evaluate (-30217/(-775))/((-243)/270(-1)/(-6)). -56 What is (128249/12838 + (-8 - 2))/(-4 + (-51)/(-12))? -2/49 What is 14/2352-4 + 1/6 + (-76)/238? -3/17 Calculate ((-67)/5092133)/((-7)/(-66)). -33/2 Calculate -60 + ((-13)/(-26) + 88/(-16))/(-1). -55 What is (-60)/(-54) - (-5719)/855? 39/5 What is ((-16)/(-58))/(26 - (-37582)/(-1444)) + 10? -14/29 Evaluate -41 + (22/(-20) - (665/350 + -2)). -42 What is the value of 2 + (-75)/33 + (-631106)/(-1479478)? 2/13 Evaluate (-9)/(45/(-55)) - (11712/80)/12. -6/5 What is the value of 13 + (-43 - 129688/(-4321))? 2/149 What is ((-8796)/183252/(-6))/(4/10)? 2/5 What is (13404/(-144) - -93)/(26/12)? -1/26 ((-24)/204)/(2/18(-77 - -74)) 6/17 9 + ((-40034)/(-15355))/(-37/105) - -4 -3/83 What is the value of ((12/(-22))/((-12)/(-440)))/(-2(1 + -2))? -10 What is (-1)/(-345)-2845 - (-4)/(-46)? -25/3 What is the value of (202/(-4242) + (-61)/42)/(5/701)? -21 Evaluate (1187/(-156684))/(1/(-16)). 4/33 Evaluate (((-2)/(-20))/(6/225))/(1030/(-4120)). -15 What is the value of -1755(-99)/(-7425) - (0 - 3/(-5))? -24 18703/503529621 - (-63)/(-672) -2/127 What is the value of (-9392)/(-128) - (8541/312 + -27)? 73 (450/81 - 5) + (4 + -5 - 7/(-9)) 1/3 Calculate 1875/(-10)(50 + 24882/(-495)). 50 What is -20((-213)/284)/((1/(-4))/(3 + -4))? 60 What is the value of 36/(-75) + ((-14)/(-16) - 1)/((-11150)/53520)? 3/25 What is the value of -235/10292/(-28616)? 1/14 Evaluate ((-16826)/2148 - ((-5 - 0) + -2))/(2/(-3)). 5/4 Evaluate 19261/(-721) + (-208)/(-56). -23 (661 + -653 + 21/(-4))-24 -66 What is ((190/(-105))/19)/(264/(-352)28/(-9))? -2/49 What is 42942/421((-5)/(-25))/(4/10)-1? -51 What is (7 - 210/28)(97 + 147)? -122 334880/(-384)7/((-385)/20) 110 What is the value of (-114)/3477 - 680/42517? -2/41 6/(-21)2121/606 -1 Calculate (-43589)/6706(-2)/(-442). -1/34 What is 25 - (40 + -15) - -62? 62 ((-368)/460)/((-36)/(-990)) -22 What is the value of ((-94)/(6486/(-345)))/(35/(-441))? -63 (-1420)/112 + (-1444)/2128 + 29/(-406) -94/7 Calculate (1122/748)/(72(-18)/(-192)). 2/9 What is (-69 - -56) + (-1)/(-9)*(-3474)/(-30)? -2/15 Evaluate (-3788)/464 + 11748/2839	{ "pile_set_name": "DM Mathematics" }
of m? 2, 73 Let w(j) = -2j - 19. Let m be w(-11). Suppose mt = -0t. Suppose t = 5p - 173 - 7. What are the prime factors of p? 2, 3 Let z(l) = 3l3 + 6l*2 + 10l + 10. What are the prime factors of z(4)? 2, 13 Let l(j) = -j*2 - 160j - 59. What are the prime factors of l(-25)? 2, 829 List the prime factors of (7/(84/(-702)))/(6/(-8)). 2, 3, 13 Let s(n) = 16n3 - 4n*2 - 6n + 21. List the prime factors of s(5). 31, 61 What are the prime factors of ((-188)/18)/((-2)/3)3? 47 Suppose 475 = h - 5j, 0 = h + j - 73 - 408. What are the prime factors of h? 2, 3, 5 Let w(p) = p*3 - 4p*2 - 4p + 2. Let x be w(5). Suppose 3i + 128 = xi. What are the prime factors of i? 2 Suppose -2s + 5618 = 4b, 0 = -s - 2s - 3. What are the prime factors of b? 5, 281 Suppose -k - 2t = -0k - 498, 0 = 5k - 3t - 2477. List the prime factors of k. 2, 31 Let l be (-1 - -2)(-1 - -12). Suppose 0 = -5y + 31 - l. List the prime factors of y((-21)/(-2) - -4). 2, 29 Let y = -51 - 25. List the prime factors of (-8)/10 - y/20. 3 What are the prime factors of (972 + 6 - -5)/1? 983 Suppose -4r + 2n + n + 45 = 0, 0 = r + n - 6. Let i(o) = 5o + 10. What are the prime factors of i(r)? 5, 11 Let k(i) = i2 + 11i - 607. List the prime factors of k(27). 419 Let q(u) = 108u2 + 9u + 39. List the prime factors of q(-4). 3, 577 Let q be 4/3 + (-3 - (-55)/15). What are the prime factors of (-1 + -218)(-1)/6q? 73 Let y(p) = p*2 + 1. Let k be y(-1). Suppose kq - q - 3h - 49 = 0, 0 = 5h + 20. List the prime factors of q. 37 Let x(i) be the second derivative of i*4/12 - 2i*3/3 - 13i*2/2 + 14i. What are the prime factors of x(8)? 19 Suppose 0g + 2g - 3251 = -3t, g - 1621 = 3t. List the prime factors of g. 2, 7, 29 Let i(c) = c + 7. Let q = -1 - -4. Let u be i(q). Suppose u + 16 = b. What are the prime factors of b? 2, 13 Let c(o) = -o - 2. Let t(b) = -b - 2. Let l(f) = -4c(f) + 3t(f). Let v be l(-5). List the prime factors of (-126)/v(-6)/(-9). 2, 7 Let p be (6/(-2) - 0)-1. Suppose -u - p = -5v, 4v - u = -4u - 9. Suppose l - 6 = -d + 18, 3l - 9 = v. What are the prime factors of d? 3, 7 Let d be -1 - 72/(-3 + 0). Let p = 20 - d. What are the prime factors of 93/6 + p/(-6)? 2 Let o = -23 - -25. Suppose 0 = 2v - 4b + o, 0 = -4v + 2b - 7b + 61. Let w(k) = k2 - 5k + 3. List the prime factors of w(v). 3, 13 Let l(t) = -114t + 927. List the prime factors of l(-15). 3, 293 Let q(g) = -5g - 2. Let x be q(5). Let r = 36 + -34. Let f = r - x. What are the prime factors of f? 29 Let z be (66/8)/((-3)/12). Let m be 44/z(-6)/(-4). List the prime factors of (1m)/((-26)/481). 37 Suppose -2m = -2q + 732, 8q - 1814 = 3q + m. What are the prime factors of q? 2, 181 List the prime factors of (-3)/(-2) + 1419/2. 3, 79 Suppose 19a - 13a - 84 = 0. What are the prime factors of (-8312)/(-56) - 6/a? 2, 37 Suppose 132888 = 52b - 30548. What are the prime factors of b? 7, 449 Let w(l) = -l2 - 6l - 3. Let q be w(-4). Suppose -5a - q = -25. Suppose 0 = 5r - 5u - 55, au - 34 = -2r + 2u. What are the prime factors of r? 2, 7 Let u(f) = -2f2 - 8f + 12. Let k be u(-5). Suppose -kq + 6q - 154 = -2h, -q - 3 = 0. List the prime factors of h. 83 Suppose -2r + 3r = 1006. List the prime factors of r. 2, 503 Suppose -3j + 6 + 3 = 0. Let v = 308 + -302. Suppose -j = 5m - vm. List the prime factors of m. 3 Let j(b) = 34b - 56. Let a be j(12). List the prime factors of ((a/(-12))/(-11))/(1/36). 2, 3 Suppose -2t + 5t - 2007 = 0. List the prime factors of t. 3, 223 Let u be ((-8)/(-10))/(6/2340). Suppose d = a - 2a + 60, 5d - u = a. What are the prime factors of d? 2, 31 Let a = -60 + 107. Let y be a + 3/(0 - -3). Suppose y = 5s - s. List the prime factors of s. 2, 3 Suppose 2p - 12 = -2p. Let s(o) = -o - 3. Let y be s(-12). Let q = y + p. What are the prime factors of q? 2, 3 List the prime factors of 720 + (92/69 - 20/6). 2, 359 Let w be (-962)/39 + (-1)/3. Suppose 5i = -2j - 103, -5i + 3j = -0j + 83. Let q = i - w. What are the prime factors of q? 2, 3 List the prime factors of (5/3)/((-19)/(-23883)). 5, 419 Let b = 52 - 52. Suppose b = -2w - 0f + 3f + 141, 5w - 362 = -2f. What are the prime factors of w? 2, 3 Let o be 512/12 - (-4)/(-6). Let c = -7 + o. Let f = c - 14. What are the prime factors of f? 3, 7 Let p = 691 - 297. List the prime factors of p. 2, 197 Suppose -3w - w = -8. Suppose 2y = -wr + 56, 0r + r = 3y + 20. What are the prime factors of r? 2, 13 Suppose -2f - n = -315, -n = 5f - 858 + 78. List the prime factors of f. 5, 31 Let l be (14/(-4))/((-11)/66). What are the prime factors of (-978)/(-21) - (-9)/l? 47 Let o = -1612 - -1135. Let w = -215 - o. List the prime factors of w. 2, 131 Let l = -139 - -309. Let h = -93 + l. What are the prime factors of h? 7, 11 Suppose -x = -5x - 3i + 18215, -5i = 4x - 18217. What are the prime factors of x? 29, 157 What are the prime factors of 12 + -15 - -1622? 349 Let z = -6 - -22. Let d = z - 5. List the prime factors of -2 + d + (2 - 4). 7 Let b be 4(3 + (-39)/4). Let f = b + 14. Let z = f + 25. What are the prime factors of z? 2, 3 Suppose 4v = -2 + 22. Suppose 0 = 3d + 3c - 18, vd - c - 22 = 2. Suppose 88 = -t + dt. List the prime factors of t. 2, 11 Let s = 64 + -58. Let q(x) = -11x - 1. Let h be q(-1). List the prime factors of ((-195)/h)/(s/(-4)). 13 Let s(q) = -55q. List the prime factors of s(-5). 5, 11 Let p(m) = 5m2 - 22m + 7. What are the prime factors of p(9)? 2, 107 Suppose 0 = -32k + 10020 - 36. What are the prime factors of k? 2, 3, 13 Suppose 0 = 22t - 19t - 90. List the prime factors of t/7 + 4/70-5. 2 Suppose -5b + 3 = -12. Let m be 0 - (1 + -2)9. Let c = m + b. What are the prime factors of c? 2, 3 Let k(l) = -l*3 - 4l*2 + l + 2. Let g be k(-4). List the prime factors of 70 - (g + (4 - 1)). 3, 23 Let g = 38 - 5. Suppose 0 = -ga + 28a + 115. What are the prime factors of a? 23 Suppose 2p = 9p - 3353. What are the prime factors of p? 479 Suppose 5h - 2460 = -5t, 3h + 2h + 2470 = 5t. List the prime factors of t. 17, 29 Let i(g) = 6g2 - 4g - 4. Let d be i(4). Suppose -2f - 12 = -d. Suppose 4o - f = 8. List the prime factors of o. 2, 5 Suppose 4r - 16 = -2v, 0 = r - 3v - 2v + 18. Suppose 3h + r = -40. Let w = h + 40. List the prime factors of w. 2, 13 Let m(q) = -37q - 24. Let g(x) = -x*3 + 20x*2 - x + 11. Let f be g(20). List the prime factors of m(f). 3, 103 Let m(q) = 57q*2 - 5q + 6. Let i be m(3). Suppose f + 5f - i = 0. What are the prime factors of f? 2, 3, 7 Let s = 127 - -630. List the prime factors of s. 757 Let v be ((-6)/(-5))/(54/(-30) - -2). Suppose 240 = vm - 2m. List the prime factors of m. 2, 3, 5 Let y be (6/(-18))/(2/(-42)). Suppose yw - 750 = -64. List the prime factors of w. 2, 7 Let k = -118 - -428. Let c = -113 + 203. Suppose 8v - c = k. List the prime factors of v. 2, 5 Suppose -896 - 372 = -5k + 2d, 5k - 1244 = -4d. List the prime factors of k. 2, 3, 7 Suppose 4l - 2454 = 2q, -4q = -5l - 2q + 3070. Suppose -5r = -l + 146. What are the prime factors of r? 2, 47 Suppose 0 = 2r - 5 - 11. List the prime factors of -4 - (-68 + r + -4). 2, 3, 5 Let w(a) = 1491a2 + 18a + 18. List the prime factors of w(-1). 3, 7, 71 Suppose -a = -3s - 3a + 129, a = -3s + 126. Suppose sn = 36n + 200. What are the prime factors of 6/(-10) - (-984)/n? 2, 3 Let a be (-1505)/(-14)(48/(-5))/3. Let f = -100 - a. List the prime factors of f. 2, 61 Suppose 1611 = w - 3t, -3w - t = -0t - 4813. What are the prime factors of w? 3, 5, 107 Let t(o) = o2 + 5o + 1. Let n be t(-7). Suppose w + 5p = -3w + 227, -n = -5p. List the prime factors of w. 53 Let y be (4 + 44/(-12))/(2/138). Suppose -19w - 216 = -yw. List the prime factors of w. 2, 3 Suppose -460 = 3r - 8r. Suppose 5t - r = 4t. What are the prime factors of t? 2, 23 Suppose -2k - 5g = -g + 2, g = -2k - 11. List the prime factors of (-11848)/(-56) + 4/k. 211 Let t be (-27)/(-3) + 0/(-4). Suppose tv - 4v + 4o = 2108, -2v + 857 = -3o. Suppose -5g - 114 = -v. What are the prime factors of g? 2, 31 Let f(k) = 133k + 203. What are the prime factors of f(6)? 7, 11, 13 Suppose -4n = -n - 5a + 813, 4n = 4*a -	{ "pile_set_name": "DM Mathematics" }
f n and 8? 8 Suppose -9d + 40 = -5d. Let w be (3 - 1 - 0) + -19. Let r = w + 27. Calculate the highest common factor of d and r. 10 Let u(a) = 3a + 22. Suppose -8c - 4 = -10c. Let g be u(c). Calculate the greatest common factor of g and 35. 7 Let i = 57 - 52. Suppose 2u + 3 - 47 = 4t, -iu - 5t = -185. Calculate the highest common factor of u and 320. 32 Let k(z) = -29z - 1. Let j be k(-1). Let m(i) = -i*2 - 6i - 15. Let g be m(-8). Let d = 38 + g. Calculate the greatest common factor of j and d. 7 Let l be (-56016)/(-200) - 14/175. Calculate the highest common factor of 42 and l. 14 Let j(h) = -h*3 + 11h*2 - 10h + 42. Let l be j(9). What is the highest common divisor of 1368 and l? 114 Suppose 23b = 10b + 5551. What is the greatest common factor of 61 and b? 61 Let a = -21 - -21. Suppose 0 = 5v + 4q - 74, 2v + 0v + 2q - 28 = a. What is the greatest common divisor of 144 and v? 18 Let c = 19 + 11. Let z(w) = w + 2. Let a be z(2). Suppose 3t + 5b = 145, -at - b + 184 = 2. What is the highest common divisor of t and c? 15 Suppose -75 = -20n + 5n. Calculate the greatest common divisor of n and 2. 1 Let x(c) = -23c - 22c + 8c2 + 51c + 10. Let l be x(-2). Calculate the highest common factor of 105 and l. 15 Suppose d + 0d + 13 = 4u, -14 = 3u + 4d. Suppose -4w = -9w - 5, -4o + uw = -502. What is the highest common factor of 50 and o? 25 Suppose -4l - 344 = -d, 258 - 1686 = -4d + 3l. Calculate the highest common divisor of 45 and d. 45 Suppose -380w - 252 = -387w. Calculate the greatest common divisor of 153 and w. 9 Suppose m + 1 = 8. Suppose -1 = -mp + 132. Let q be (-5)/(-2 + (-37)/(-19)). Calculate the highest common divisor of p and q. 19 Suppose -4p = -4z - p + 433, 0 = -z - 5p + 91. Let j = z - 72. Let i = -23 + j. Calculate the greatest common factor of 99 and i. 11 Let m = -1 - -1. Let k(d) = 5d - 4d + 25 + 13 - 6. Let l be k(m). Calculate the highest common divisor of 8 and l. 8 Let z = 59 + -55. Suppose 3f = zk + 6, -f + 0k = -2k. Calculate the highest common factor of 24 and f. 6 Let z = -11 - -61. Suppose 0n + z = 5n. Let d = n + -3. Calculate the greatest common factor of d and 21. 7 Suppose -4x = 4c - 180, -x + 50 = c + x. Let q be 356 + (2/9 - (-204)/54). Calculate the highest common divisor of q and c. 40 Let j be 1/(5/(-10)) - -133. Let z = -77 + j. Calculate the highest common factor of z and 6. 6 Suppose -18i - 345 = -21i. Calculate the highest common factor of 69 and i. 23 Let q(f) = -2f*2 + 24f - 53. Let w be q(8). What is the greatest common divisor of w and 5137? 11 Let w(i) = -i*2 - 9i + 11. Let s = 21 + -31. Let q be w(s). Calculate the highest common divisor of 3 and q. 1 Let h(t) = t*2 - 5t + 2. Let g be h(7). Let q(i) = -i*2 + 84i - 824. Let y be q(72). Calculate the highest common factor of y and g. 8 Let h(s) = 5s - 61. Let t be h(14). Let v = 11 - t. What is the highest common divisor of v and 11? 1 Suppose -10a + 3102 = 12a. What is the greatest common divisor of a and 3? 3 Let q be 24/60 - 657/(-45). What is the highest common divisor of q and 1905? 15 Let s = -669 - -689. Calculate the highest common divisor of s and 70. 10 Let o = -5 - -5. Suppose o = -t - t + 90. Calculate the highest common factor of t and 5. 5 Let j(p) = p3 + 5p*2 + 2p + 11. Let g be j(-5). Let r = 273 - g. Calculate the highest common factor of r and 34. 34 Suppose 0 = -12c - 57 - 27. Let g be ((-8)/(-6)c)/(5/(-15)). Calculate the greatest common factor of g and 98. 14 Let h = 2701 + -2553. Calculate the highest common divisor of 2146 and h. 74 Suppose -5f - 10 = -2i, -i - 8f + 3f = -35. What is the highest common factor of i and 375? 15 Let l be 8/(-3)(-462)/4. Let x = -61 - -61. Let g be -3 - (x + 62/(-2)). Calculate the highest common factor of l and g. 28 Let p(d) be the second derivative of -d5/20 - d4/2 + d3/6 - 11d. Let q be p(-8). What is the highest common factor of 15 and q? 15 Let h = -3 + 19. Let b be h + (3 + -5 - -1). Let p = b + -4. What is the highest common factor of 99 and p? 11 Suppose 3d = 2b + 11, d = -2b + 7 + 2. Suppose 2v - v - b = 0. Suppose 10 + 4 = va + 2h, 4h = 12. What is the greatest common divisor of 12 and a? 4 Let x = -85 - -119. What is the highest common factor of 153 and x? 17 Let a(b) = 10b*2 + 30b - 211. Let d be a(6). Calculate the highest common divisor of d and 47. 47 Let z be (-76)/(-18) - (-22)/(-99). Suppose -867 = -zl + 2433. Suppose 5p - l = -0p. Calculate the greatest common factor of 15 and p. 15 Let u be -3-3792/81. Let a(q) = -q3 + 5q*2 + 6q + 7. Let c be a(5). Suppose -7 - c = -4h. Calculate the highest common divisor of u and h. 11 Let t be 3(-1)/(-3)-157. Let m = -92 - t. Suppose 13u = 173 + 165. Calculate the highest common divisor of u and m. 13 Suppose a - a + 2a = 0. Suppose 0l + 5l - 75 = a. Calculate the greatest common factor of 120 and l. 15 Suppose -3b + 6q - 4q = -4, -10 = 4b + 5q. Suppose b = -6t - 66 + 822. What is the greatest common factor of t and 18? 18 Let r = 355 + -157. Suppose 13o = 408 - 122. Calculate the greatest common factor of r and o. 22 Suppose -d + a + 19 - 6 = 0, -3d = a - 27. What is the highest common factor of 14 and d? 2 Suppose -55 - 9 = -2y. Let d = -224 + 232. Calculate the highest common divisor of d and y. 8 Suppose 1053 + 1731 = 87i. Let g be (-116)/(-10) - 4/(-10). Suppose 4k - g = k. What is the greatest common factor of i and k? 4 Let u be 69 - (12 - 4 - 5). What is the highest common divisor of u and 6? 6 Let u = -15 + 33. Suppose 52 = 5c + p, -c - p = 3p - u. What is the greatest common divisor of 5 and c? 5 Suppose -4i = 3l - 0l - 25, 0 = -3i + l + 9. Suppose d + 2d - ij - 33 = 0, -3j = 0. Calculate the highest common factor of d and 11. 11 Let c = 616 + -588. Calculate the highest common factor of c and 1260. 28 Let o be 28(-1)/(0 - (-3 + 4)). Suppose -3p = -m - 34, p + 2m + m = o. What is the greatest common factor of 52 and p? 13 Suppose -103 = -13h + 14. What is the highest common divisor of 9 and h? 9 Let w be (-16)/10(-270)/(-24)4. Let k = w - -303. Calculate the highest common divisor of k and 21. 21 Suppose -7x + 94 = 2q - 3x, -5q = 5x - 225. Calculate the greatest common divisor of 172 and q. 43 Suppose 0 = -21x + 23x - 16. Let g be (-22)/(-3) + (x/(-12))/(-1). Calculate the greatest common factor of g and 88. 8 Let v(z) = -232z - 506. Let m be v(-3). What is the highest common divisor of m and 10? 10 Let h be (-1)/((-1 - 3)/12). Let s be (-21h)/((-21)/14). Calculate the highest common divisor of 28 and s. 14 Let m(k) = 2k2 - 32k + 136. Let x be m(10). What is the greatest common factor of x and 848? 16 Let x be 12 + -10 + (0 - 0). What is the highest common divisor of x and 29? 1 Suppose -3d = -5t + 71, -5d - 14 = -4. Calculate the greatest common divisor of t and 416. 13 Suppose -16 = -3p + 29. Let u(o) = o*3 - 13o*2 - 29o - 4. Let f be u(p). What is the highest common factor of f and 33? 11 Let v(z) = -2z2 + 6. Let w(n) = n3 - 6n*2 + 6n - 5. Let h be w(5). Let d be v(h). Calculate the greatest common factor of 18 and d. 6 Let k be (2 - (-3 + 0))19 + 5. What is the highest common factor of 60 and k? 20 Let p(x) = 6x*2 + 8x + 71. Let m be p(11). Calculate the greatest common divisor of m and 15. 15 Let h(f) = -f*3 - 2f*2 - f + 2. Let g be h(-2). Let w be 18/(-15)(0 + -5). What is the greatest common divisor of w and g? 2 Suppose 6d - 58 = 164. What is the greatest common divisor of d and 333? 37 Let c = 6 - 4. Let g = -156 + 76. Let v = -70 - g. What is the highest common factor of c and v? 2 Suppose 0 = -5d - 2c + 20, d + 2d - 3c - 33 = 0. Let f = d - 4. Suppose -7x = -2x - 50. Calculate the greatest common divisor of x and f. 2 Suppose 2r + 2i = 4 + 4, -9 = -4r + 3i. Suppose 0 = -4s + 5 - 1. Let b be s/(((-4)/42)/(-2)). What is the highest common factor of b and r? 3 Suppose -3f + 24 = f. Let n(a) = 2 + 3a + 2a - 8. Let z be n(6). What is the greatest common divisor of f and z? 6 Suppose -9i + 58 - 13 = 0. Suppose -w - 23 = -3n + w, 3n + 2w = 31. Suppose 0 = -12z + n*z + 60. What is the greatest common factor of i and z? 5 Let j =	{ "pile_set_name": "DM Mathematics" }
units digit of x(14)? 3 Let r = 2196 - 1505. What is the hundreds digit of r? 6 Let h(y) = -15 - 5y2 + 5y2 + y - y3 + 10. What is the units digit of h(-3)? 9 Let f be (16 + -13)16/(-3). What is the tens digit of -2 + 172/(f/(-4))? 4 Let q(s) = -s - 6. Let w be q(-8). Suppose m - w = 1. Suppose 0 = 2k - 4p, -6 = -mk + 5p - 2p. What is the units digit of k? 4 Let m be 4(-2)/(-8)18. Let u = m + -16. Suppose -2t = -l + u - 60, -t = l - 26. What is the units digit of t? 8 Let b = 8 - 4. Let f = -538 + 543. Suppose -w - fp = -4w + 68, -5p + 79 = bw. What is the units digit of w? 1 Let g be 16/6 + 4/(-6). Let n(c) = 40c + 26. What is the hundreds digit of n(g)? 1 Let h(s) = 2s2 - 9s - 2. Let c(g) = -2g2 + 8g + 1. Let w(n) = -4c(n) - 3h(n). Let f be (-168)/16(-8)/14. What is the tens digit of w(f)? 4 Let z(h) = -2h*3 - 52h*2 - 37h - 9. What is the tens digit of z(-26)? 5 Let q(k) = -3k2 + 122k + 14. What is the hundreds digit of q(23)? 2 Let p(t) = -73t2 - 6t + 35. Let a be p(9). What is the hundreds digit of a/(-44) + (-8)/(-44)? 1 Suppose 0 = -2v - v + 60. Let r = 45 - v. Suppose 3i = 5 + r. What is the units digit of i? 0 What is the units digit of ((-54)/12 - -2) + (-2733)/(-6)? 3 What is the units digit of (4/2)/(7 - 5)? 1 What is the hundreds digit of 44/4 - 6 - -239? 2 Let h(o) = o*3 - 8o*2 + o - 6. Let x be h(8). Suppose 4k - 56 = -xl, 4l - 88 = k - 21. Let g = -1 + l. What is the tens digit of g? 1 Suppose 5s + 106 = 2j, 8j = -3s + 3j - 45. Let u = s + 58. What is the units digit of u? 8 Suppose t - 30 = 5q + 16, -t = -3q - 36. What is the tens digit of t? 2 Let u = -6 - -12. Suppose 0 = 2m + um + 1600. What is the tens digit of (1 - m/12)3? 5 Let h be 1/(-1) + 720/9. Suppose -38 = 3l - 2z + h, -5l - 2z = 211. Let o = 69 + l. What is the units digit of o? 8 Let w be (15/(-2))/56/(-9). What is the tens digit of w/3 + (280/6 - 3)? 4 Suppose h + 2415 = 2s, 38s + 3h + 2413 = 40s. What is the thousands digit of s? 1 Let m(u) = 8u - 30. Let b be ((4/6)/(-1))/(24/(-540)). What is the tens digit of m(b)? 9 Let q be 40/3 - (-16)/24. Let w = q - 12. Suppose 0 = -4n + wn + 6. What is the units digit of n? 3 Let c(t) = 29t2 + 13t - 63. What is the tens digit of c(5)? 2 Let v(k) = -2k3 - 2k*2 - 7k + 7. What is the units digit of v(-4)? 1 What is the tens digit of 9/36 - 98/(-8)7? 8 Let x be (-117)/(-27)13. Let u = x - 9. Let m = u - -6. What is the tens digit of m? 1 Let i(o) = 95o3 - o2 - 5o + 8. What is the tens digit of i(2)? 5 Let p = 1555 + 242. What is the units digit of p? 7 Let t = -57 - -61. Suppose -148 = -tj + 152. What is the units digit of j? 5 Let i(w) = w - 1. Let b(o) = -38o - 6. Let u(y) = -b(y) + 5i(y). What is the tens digit of u(1)? 4 Let w = -300 - -133. Let j be 3/18 + w/(-6). Let u = j + -15. What is the units digit of u? 3 Let f(h) = h*2 + 2h - 4. Let g be f(-4). Let l = g - 2. Suppose z - 48 = -lz. What is the tens digit of z? 1 Let j(p) = -16p*3 - 3p*2 + 8p + 16. What is the tens digit of j(-4)? 6 Suppose -3m + 528 = -2j, -3m + 706 = m - 2j. Suppose -5u = -7u + m. What is the units digit of u? 9 Suppose -5d - 2m = 2m + 9, 4d - 2m = -2. Let c be 4 + d + 0 + -6. Let s = 13 + c. What is the units digit of s? 0 Suppose -4n + n - 3l = -7329, 9780 = 4n - 4l. What is the thousands digit of n? 2 Let k be 0 + 1/6 - (-1633)/426. Suppose 8j - kj = -3c + 123, -3j - 5c + 84 = 0. What is the units digit of j? 3 What is the units digit of 2/8 + (-3590)/(-8)? 9 Let i(h) = 101h + 78. What is the units digit of i(9)? 7 Suppose -36 - 792 = -4n. What is the hundreds digit of n? 2 Suppose -6o + 4o + 8 = -z, 12 = -4o - 5z. Suppose 4a = 3g + 130, 0 = -4a - og - 0g + 140. Let p = -22 + a. What is the units digit of p? 2 Let j(i) = 41i + 22. Let h be j(-5). Let k = 258 + h. What is the units digit of k? 5 Suppose 23n - 133 = 741. What is the tens digit of n? 3 Let s be 0/(1 + (1 - 0)). Let m = 23 + -19. Suppose s = u + 3 - m. What is the units digit of u? 1 Suppose -u - d + 1 = -3d, 5d - 38 = -2u. What is the tens digit of (-3 - (67 - 1))(-6)/u? 4 Let h(o) = -o3 + 14o*2 + 16o + 35. What is the hundreds digit of h(14)? 2 Let y be (-155)/(-35) + (-4)/(-7). Suppose -s = yh - 3s + 7, s = -4h - 16. What is the tens digit of 3 - (h + 4 - 18)? 2 Let j = -708 + 2237. What is the hundreds digit of j? 5 What is the hundreds digit of (20 - 14)(-478)/(-6)? 4 Suppose -20a - 5088 = -24a. What is the thousands digit of a? 1 Let u(t) = t + 8. Suppose 0s - 20 = 4s. Let d be u(s). What is the units digit of (0 + 3)5/d? 5 Let q(v) = -v2 + 6. Let n be q(0). Let j = n - 5. What is the units digit of 0 + -1 + j + 9? 9 Suppose -5v = 3i - 32, -9 = -i - 4v + 11. Suppose j = 2, j + 752 = in - j. Suppose -63 = -p - 2d + 5d, -3p + 2d = -n. What is the tens digit of p? 6 Let t(x) = x2 - 31x + 44. What is the units digit of t(-27)? 0 Suppose -9 = 2z - 81. Suppose -14u + 21 = 49. Let l = z - u. What is the tens digit of l? 3 Let x = 7 - 3. Suppose 65 = 5u + m - xm, -65 = -5u + 2m. Let j = 25 - u. What is the tens digit of j? 1 Suppose -x + 786 = 264. What is the units digit of x? 2 Let w = 17 + -17. Suppose -4h + 0h + 180 = w. Let c = -6 + h. What is the units digit of c? 9 Suppose -7s + 5s + 2057 = f, -3f = -3. What is the tens digit of s? 2 Let p = 337 - 40. Suppose 9l - 6l - p = 0. What is the tens digit of l? 9 Suppose 4m - 314 = -0q + 2q, 9 = 3q. What is the tens digit of m? 8 Suppose -7f = -8f. Suppose -v + f = -3. Suppose 4w - 15 = n, 8n = vn + 5w. What is the units digit of n? 5 Suppose -3m + 0m - 2461 = -4x, 619 = x - 2m. What is the tens digit of x? 1 Suppose -3 = -3i + 3t, -5i + 53 + 2 = 5t. Let o(c) = -c3 + 8c*2 + 6c - 9. What is the units digit of o(i)? 9 Let z = 316 + -212. Let q = z - 71. What is the tens digit of q? 3 Suppose 3a + 2c + 541 = 0, -a - 5c = -2c + 178. Let v = 290 + a. What is the hundreds digit of v? 1 Let d(b) = -17b3 - 6b*2 - 6b + 5. What is the hundreds digit of d(-3)? 4 What is the hundreds digit of -6 + (-9 - -742 - 8)? 7 Let j(b) = b2 + b - 2. Let r be j(0). Let p be (r + 5)/(-3) - 11. What is the units digit of p/(-4) - (-12)/3? 7 Let x(u) = -u3 - 6u2 + 18u + 15. Let t be x(-8). What is the hundreds digit of t + 0 + 3102? 3 Let u = -13 - -15. Let w be 1/(u/644). What is the units digit of (w/3)/(4/30)? 0 Let w = 8 + 200. Let b be 3/(61/w). Suppose -34 - b = -3a. What is the tens digit of a? 4 Suppose x = -5r + 5399, -2142 = -2r + x + 3x. What is the tens digit of r? 7 Let m(v) = -v2 - 3v + 4. Let o be m(-4). Suppose o = 3i + 2i - 10. Suppose -it + 45 = 3p, -4t - p - p = -70. What is the tens digit of t? 1 Let b be (-21)/(-4) - 5/20. Let d be (2 - 0)(2 + b). Let u = d + 17. What is the tens digit of u? 3 Let p be -3 - ((-18)/(-3) + 4). Let b = 25 - p. Suppose -3t + 2r = -149, -t + 0r + 3r = -b. What is the units digit of t? 3 Suppose -969 = 7h - 3706. What is the tens digit of h? 9 Suppose 2r + 8 = 4r. Suppose 4y = y - 9. Let f = r + y. What is the units digit of f? 1 Let i = -166 - -315. Let a = 244 - i. What is the tens digit of a? 9 Let j = -4469 - -8030. What is the tens digit of j? 6 Let b = 7 + -4. Let k = 129 + -124. Suppose -bx + 10 = -k. What is the units digit of x? 5 Suppose 2o - 8 = 0, 4o = 4b - 70 + 430. Let n = b + 278. What is the hundreds digit of n? 1 Let x = 295 - -315. What is the tens digit of x? 1 Let g(q) = q + 9. Let u be g(-6). Suppose -up = -4t + 16, 0 = 5t - p + 2p - 1. Let x = t + 13. What is the tens digit of x? 1 Suppose 0 = 3k - 4r - 1465, -2k - 145 + 1123 = -4r. What is the hundreds digit of k? 4 Let q(g) = -4g - 3. Let p(m) = -28m - 20. Let a(n) = 3p(n) - 20q(n). What is the tens digit of a(-13)? 5 Let c be (-3 + 1)(-20)/10. Suppose 16 = x - 3u, -3x + cu + 63 = -0u. Let w = x - -2. What is the units digit of w? 7 Let n(g) = 0 + 3 - 8g + 2g2 + 6g. What is the tens digit of n(5)? 4 Let p(x) = x*2 - 2x + 5. Let c be p(3). Suppose z - c = 63. What is the tens digit of z? 7 Let x(w) = -184w3 + w2 + 4w + 2. Suppose -2j = -12j - 10. What is	{ "pile_set_name": "DM Mathematics" }
e nearest to x? (a) o (b) 2/21 (c) 0.4 (d) -9 b Let y be (-25)/(-25)-36 + 38. Let g = -3.5 + 3. Which is the nearest to -0.04? (a) -5 (b) y (c) g c Suppose 0 = -4v - 2f + 1 + 1, -5v = -3f + 3. Suppose v = b - 7 + 5. Let z = -5 + -2. What is the closest to -2/5 in z, 1/3, b? 1/3 Let o = -0.57063 - -0.27063. What is the closest to -2/9 in o, 0.2, -108, 2? o Let d be 0 + (0 - (-2 + 2)). Let n = 12964 + -12963.7. Let r = 4 - 7. Which is the nearest to d? (a) 0.5 (b) n (c) r b Let x = -52/3 + 17. Let v = 7435 + -7438. What is the nearest to -0.3 in v, x, 3? x Let p = -0.1152 - 0.8848. Which is the closest to -0.11? (a) p (b) 1.1 (c) -3 (d) 3 a Let i = -6169.9 - -6170. What is the closest to i in -1/14, -4/7, -26, 1? -1/14 Let s = -22.6 + 22.1. Let i = s + 0.6. Let t = -325/186 - -5/62. Which is the closest to -0.3? (a) i (b) 2/3 (c) t a Let h = 145.4 - 145.4. What is the closest to 1 in h, -0.7, 18/5? h Let n = 6/37 + -166/111. Let h = 7.77 - 6.77. What is the nearest to h in -18, n, -0.4? -0.4 Let n = -1.06125 - -1.06125. Let g = 6.7 + -7. Which is the closest to n? (a) -4 (b) g (c) 28 b Let q = -3563 + 3565.057. Let r = 75.943 - 76. Let d = r + q. What is the closest to d in 1, 0.3, 2/7? 1 Let o = -8.28 + 13.81. Let t = -4.33 + o. Which is the closest to t? (a) -2 (b) 0.4 (c) -1 (d) -2/15 b Let j = -6.3 - -6.6. Suppose 14z + 662 - 690 = 0. Let p = -1 - -0.5. What is the nearest to 0 in j, p, z? j Let j = 1923 + -1922.8. Let q = -6 - -6.01. Let o = -0.29 - q. What is the nearest to j in -1, o, -4/9? o Let m = 985 + -982. Which is the nearest to 0? (a) -0.4 (b) -2/9 (c) m b Let v = 1631.5 + -1631. Let t be (-20)/35(-2)/(-4). Let j = 12 + -12.2. What is the closest to j in 0.7, v, t? t Let t = -0.8325 + 1.1325. Let c be (3 - 1) + 6 + -5. What is the nearest to c in t, 0.2, 1/4? t Let h = -129/31 + 24799/5952. Let l = -239/192 - h. Let g(i) = -i2 - 19i + 559. Let y be g(-35). Which is the nearest to y? (a) 3 (b) l (c) 0 b Let y = -158 + 163. Let w be -3 + 4 - 2/y. What is the closest to 1 in -2/3, 2/11, w? w Let g be 4/8-1-24. Let k be g/1810/(-4). Let y be ((-2)/(-28))/((-2)/4). What is the nearest to 1 in k, y, -0.1? -0.1 Let v = -2812.3 + 2812. Which is the nearest to 1? (a) v (b) -2/71 (c) 0 (d) 4 c Let i = 0.6732 + -0.2732. Which is the nearest to -0.3? (a) i (b) -0.08 (c) -3 b Let n(q) = 2q*2 + 19q - 191. Let t be n(6). Which is the closest to -1/9? (a) 2 (b) -4 (c) t a Let h = -640 + 640.045. Let g = h - 6.045. Which is the nearest to 0.1? (a) 0 (b) g (c) -0.5 (d) -4/3 a Suppose 5n = -3s + 13, 0 = -n + 3s - s. Let y = 28 - 53. Let i = 29 + y. What is the nearest to 1/6 in 0.4, n, i? 0.4 Let w = 2145/7504 + -1/7504. Suppose -5 = -2g - 3g. Which is the nearest to w? (a) g (b) 1/3 (c) 1.5 b Suppose -2x + 5 = 1. Suppose xy = 8y + 24. Let h = -239 + 244. Which is the nearest to y? (a) h (b) -1/3 (c) -1 c Let v = -6.5 + 4. Let o be (-9 - (9 - 1161/63))6/9. Which is the nearest to v? (a) -3 (b) -1/2 (c) o a Let q be (313/3)/((-54)/(-162)). Let f = q - 313. Which is the closest to f? (a) 21 (b) 5 (c) -3 c Let q be (-22)/10 - (-12 + (2 - -7)). Which is the nearest to 1/7? (a) -0.1 (b) -0.3 (c) q (d) -3/4 a Let k = -43913/9 + 4879. What is the closest to -1/3 in -3, -0.01, k? k Let q = 3460 - 3465. Which is the nearest to 0? (a) -4/9 (b) -19.5 (c) -3/2 (d) q a Let u be (1/3)/(4/(-6)). Let k = 79 - 74. Let o be (-19 - -20) + 4 + -6 + 4. Which is the closest to u? (a) k (b) o (c) -1/5 c Let p = 32 - 16. Let t be (-3)/(-2)p/(-6). Let r be (-690)/(-575) + 29/(-20). Which is the nearest to 1/2? (a) r (b) -2/3 (c) t a Let w = 12348 + -49393/4. Let u = -2.1 - -2.6. Which is the closest to -0.1? (a) 4 (b) u (c) 1/6 (d) w d Let z = -0.089 + -8.811. Let a = -8.8 - z. Let i be 9/122/(-3). What is the closest to 1/4 in -4, a, i? a Let z = -1.03 + -103.97. Let u = z - -106. What is the closest to u in 20, -4, 3? 3 Let n = -0.69 + 0.73. Let k = n - 6.04. What is the nearest to 0.1 in 5, -5/6, k? -5/6 Let k = 7.685 - 16.685. Which is the nearest to -0.5? (a) k (b) 1 (c) 1/4 c Let y = 23807/63528 - -2/7941. Which is the closest to 0.8? (a) -3/2 (b) -45 (c) 0.1 (d) y d Let w = 77992/5 - 15599. What is the closest to 0.1 in w, -1/5, -3, -162? -1/5 Let n = -81 + 159/2. Let g be (-1127)/(-2070) - 7/(-126). Which is the closest to -1/4? (a) -0.25 (b) n (c) g a Let t = -5700 - -5700. Which is the closest to 0.4? (a) t (b) 0.1 (c) -1/2 b Let x = 1140 - 1756. Let b = x + 615.8. What is the closest to -0.09 in 0, 3, 2, b? 0 Let k = -0.11234 - -0.51234. Which is the nearest to 3? (a) k (b) -353 (c) -5 a Let k = 6030 - 6031. What is the nearest to -2 in k, -23.1, 1? k Let g be (-54)/16 + (-15)/10-2. Suppose -5j = 5w - 30 + 50, -2j = 3w + 7. What is the closest to w in g, 1, -10? 1 Let n = -6.82 - 4.18. Suppose -4 = m + 4z, 0 = 2m - z + 2z + 8. Which is the nearest to -2/7? (a) m (b) 1/4 (c) n b Let j = -36166 - -36170. What is the closest to 0 in -12.2, 3/5, j, -5? 3/5 Let k(z) = -207z + 202. Let v be k(1). Which is the nearest to -1? (a) v (b) 0.14 (c) 14 b Let t = 298/5 - 60. Let c = 389 + -388.8. What is the closest to 0 in 4/3, t, c? c Let l(w) = -49w - 251. Let f be l(-5). Let b be (-4)/28-10f/(-30). Let d = -0.2 - -4.2. What is the closest to 2/5 in b, 1/4, d? b Suppose 0 = n + y - 34, 2y - 6y - 68 = -2n. Let s = 29 - n. Let l be 7/s + 1 - (-22)/80. Which is the nearest to 1? (a) l (b) -4/7 (c) 1 c Let t = -499/52 + 39/4. Let a = -788.14 - -788.14. What is the closest to t in 0.3, 5, a? 0.3 Let d = 345 + -343. Let q be (-3)/12 + (-16689)/(-132). Let k = -126 + q. What is the nearest to d in 2, k, 9? 2 Let u = 12 - -35.4. Let r = -46.9 + u. What is the closest to 0 in r, -2/17, 14? -2/17 Let f = 5822.3 - 5822. Which is the closest to 0.1? (a) -5 (b) 0.09 (c) f b Let w = -16881 + 16879. What is the nearest to -3 in 6, -0.2, 0, w? w Suppose -48 = 5z + 5f - 18, 0 = -z - 4f. Suppose -4v = 3j - 3, -2v = -2j + 4j - 4. Which is the nearest to -1? (a) j (b) -0.05 (c) z b Suppose 4t - v - 16 = 0, 6t - 4 = 5t + 5v. Let l = -1143 + 1148. Which is the nearest to -0.1? (a) l (b) -3 (c) 3/5 (d) t c Let w = 1392 - 1397. What is the nearest to -2 in -4, w, 4, 1/2? -4 Let f = 1.753 - 1.633. Let i be (-2)/(-14)56/(-48). Which is the nearest to -1/3? (a) f (b) 2 (c) i c Suppose 0 = -23m + 13m + 90. Let r be (-7)/(-21)2m/(-30). Let y = -0.35 + 0.05. Which is the nearest to -2/5? (a) r (b) y (c) 2/11 b Let v = -0.1 + -0.4. Suppose 181w - 173 - 19 = 117w. Which is the nearest to w? (a) 1 (b) 0.2 (c) v a Let u = 18 + 10. Let z = u - 26. Let p = -0.121 - -1.121. Which is the closest to p? (a) 16 (b) 1 (c) z b Let r = -383.5 - -383.6. Which is the nearest to -1/3? (a) r (b) -0.3 (c) -38 (d) -1/6 b Let h = 22857 + -22862. What is the closest to 0.1 in -1/7, -0.4, h, 949? -1/7 Let t = -1612.9 + 1616.9. Which is the closest to -15/4? (a) 0.13 (b) t (c) -2/3 c Let d = -4572 + 4572.5. What is the nearest to 79 in -0.5, -1/5, d, -5? d Let l = 3.7 - 3.7. Let k be 8 - -3 - (-736)/(-69). What is the closest to l in 3/4, 3, k, 2? k Let j = -0.77 - -0.8. Let r = 0.37 + j. Let x = -398.5 - -398.1. What is the nearest to 3 in -0.5, x, r? r Let s be (-2278)/(-14) + -7 - -6. Let v = 162 - s. Let g = -9 - -4. Which is the nearest to v? (a) -2/7 (b) 4 (c) g a Let s = 2130 - 2083.76. Let o = s + -46. Let z = 0.54 - o. What is the closest to z in -1, 5, -2/13? -2/13 Let n = -12.5 - 13.5. Let w = 325.4 - 299. Let j = w + n. What is the nearest to -0.4 in -0.4, -2/9, j? -0.4 Suppose -3y + 2r = -14, -2y - 3r + 8 = -4r. Let t be y/(-6)(-29)/(-3) - -3. Which is the nearest to 3/4? (a) 2 (b) 1/2 (c) t b Let j = -4 + -1. Let x = 232.36 - 230.56. Which is the nearest to -3? (a) 2/11 (b) j (c) x b Suppose -y + 3 = -4y. Suppose 2k + 22 = 46. Suppose 23m - 55 = k*m. What is the closest to y in -1, m, 0? -1 Let h = -426.895 + 423. Let x = -0.105 + h. What is the nearest to 21 in -2/3, 2/5, x? 2/5 Let i = 73.3 - 73. Let y be ((12/5)/(-3))/((-21)/(-105)). Which is the nearest to -2/5? (a) i (b) y (c) -2 a Let h = 673 + -	{ "pile_set_name": "DM Mathematics" }
from {f: 1, i: 1, x: 3, e: 1, g: 5, n: 1}? 1/440 Two letters picked without replacement from oskskdq. What is prob of sequence sk? 2/21 What is prob of sequence dy when two letters picked without replacement from {k: 7, d: 2, y: 4}? 2/39 Two letters picked without replacement from tncccntcnnnnttcn. Give prob of sequence nc. 7/48 Two letters picked without replacement from {m: 3, l: 1}. What is prob of sequence lm? 1/4 What is prob of sequence bccc when four letters picked without replacement from ccbxxcbccxxxxbbcx? 1/119 What is prob of sequence kyzx when four letters picked without replacement from {o: 1, x: 2, k: 2, z: 3, y: 1, a: 3}? 1/990 What is prob of sequence jjyj when four letters picked without replacement from yyjjyjjyjyjjjjjjyyyy? 99/1292 Three letters picked without replacement from {n: 2, b: 2, o: 2, e: 1, z: 3, x: 2}. Give prob of sequence bnx. 1/165 Four letters picked without replacement from {g: 8, b: 2, t: 9}. Give prob of sequence ttgt. 14/323 Two letters picked without replacement from rfjjvjvvrp. What is prob of sequence rf? 1/45 Calculate prob of sequence qmoq when four letters picked without replacement from {q: 2, g: 3, m: 3, o: 1, z: 1}. 1/840 Two letters picked without replacement from cacaacssscaa. What is prob of sequence cc? 1/11 Calculate prob of sequence jjj when three letters picked without replacement from jjjvjjjjjvjjjjjvvj. 91/204 What is prob of sequence ugiu when four letters picked without replacement from uquuguiggquugqqgig? 1/204 Calculate prob of sequence dj when two letters picked without replacement from dddddjddddj. 9/55 Three letters picked without replacement from wwjjjjjwwjjww. Give prob of sequence jwj. 21/143 Four letters picked without replacement from pvvvvvbvbvvvppvvpvpv. What is prob of sequence pbbv? 13/11628 Calculate prob of sequence bzz when three letters picked without replacement from bbzbbzzb. 5/56 Two letters picked without replacement from jaaxtlttaj. What is prob of sequence al? 1/30 Three letters picked without replacement from {r: 2, n: 2, i: 2, m: 4}. What is prob of sequence rrn? 1/180 Four letters picked without replacement from abqyayyayaabb. What is prob of sequence aaba? 3/286 Three letters picked without replacement from eprttetytoeo. Give prob of sequence oto. 1/165 Four letters picked without replacement from wmxwmwwjjwwmmwnn. What is prob of sequence jmmj? 1/1820 Three letters picked without replacement from hwswzuwshs. What is prob of sequence zus? 1/240 Three letters picked without replacement from fhhhfphphffh. What is prob of sequence pff? 1/55 Calculate prob of sequence bb when two letters picked without replacement from ubuyyufbbfibubffufi. 10/171 Calculate prob of sequence vkeu when four letters picked without replacement from {r: 1, e: 2, g: 3, k: 4, u: 2, v: 3}. 2/1365 Four letters picked without replacement from {i: 4, h: 5, g: 4, l: 3}. Give prob of sequence ligg. 3/910 What is prob of sequence zzrr when four letters picked without replacement from uzuruurruuzzuuru? 3/1820 Four letters picked without replacement from hhhhhfffhfhhhhhhfh. What is prob of sequence fhfh? 13/306 Calculate prob of sequence uhf when three letters picked without replacement from {x: 1, h: 1, f: 2, u: 1}. 1/30 What is prob of sequence zz when two letters picked without replacement from {w: 10, z: 2}? 1/66 Four letters picked without replacement from rzrnu. Give prob of sequence rruz. 1/60 Four letters picked without replacement from {v: 2, w: 1, a: 1, u: 1}. Give prob of sequence vauv. 1/60 What is prob of sequence wa when two letters picked without replacement from ggakw? 1/20 Calculate prob of sequence ji when two letters picked without replacement from {j: 2, i: 4}. 4/15 Four letters picked without replacement from {z: 1, m: 7, x: 8, q: 2, y: 2}. What is prob of sequence yxqz? 4/14535 Calculate prob of sequence df when two letters picked without replacement from {f: 12, d: 3}. 6/35 Calculate prob of sequence ooo when three letters picked without replacement from eoeeeeoeeoooee. 5/182 Calculate prob of sequence abz when three letters picked without replacement from zzkzbazbbzbbjbzzz. 1/85 Four letters picked without replacement from {z: 4, o: 13, v: 3}. Give prob of sequence oooz. 286/4845 Four letters picked without replacement from {x: 2, v: 2, q: 3, h: 1, w: 2, n: 2}. What is prob of sequence nqhx? 1/990 Calculate prob of sequence qf when two letters picked without replacement from {b: 5, f: 1, m: 3, s: 2, q: 1, v: 1}. 1/156 What is prob of sequence df when two letters picked without replacement from {d: 2, f: 5, c: 2}? 5/36 Three letters picked without replacement from {k: 7, w: 9, h: 3}. What is prob of sequence whk? 21/646 Three letters picked without replacement from nnffnnffffffffznzff. What is prob of sequence zfz? 4/969 Calculate prob of sequence vccc when four letters picked without replacement from {v: 1, c: 7, t: 10, w: 1}. 35/15504 Four letters picked without replacement from cuuuuucuuv. What is prob of sequence cuvc? 1/360 Three letters picked without replacement from tttwttyndtntytypd. What is prob of sequence tnt? 7/255 Four letters picked without replacement from {f: 3, q: 6, j: 2, p: 2, h: 3, v: 2}. What is prob of sequence qhjj? 1/2040 Calculate prob of sequence gpgd when four letters picked without replacement from gndppndng. 1/378 Two letters picked without replacement from {f: 5, j: 1, y: 1, a: 6, m: 1}. What is prob of sequence mj? 1/182 Calculate prob of sequence dvd when three letters picked without replacement from doeoveeqeyoedyyoovoo. 1/1710 Three letters picked without replacement from rwwarawrddtrwrradr. Give prob of sequence wrr. 7/204 Calculate prob of sequence oy when two letters picked without replacement from ooooooyoooooo. 1/13 Three letters picked without replacement from {r: 1, o: 2, v: 6, h: 4, x: 2}. Give prob of sequence xor. 2/1365 What is prob of sequence bobo when four letters picked without replacement from {o: 2, i: 1, b: 2}? 1/30 Calculate prob of sequence uu when two letters picked without replacement from {u: 7, s: 7}. 3/13 Three letters picked without replacement from wcckgcckkkxncnnck. What is prob of sequence nng? 1/680 What is prob of sequence ui when two letters picked without replacement from uuffffiufffufi? 4/91 What is prob of sequence aqaa when four letters picked without replacement from {q: 1, r: 5, a: 8, j: 2}? 1/130 What is prob of sequence yr when two letters picked without replacement from {r: 1, y: 1, t: 2, a: 1}? 1/20 Two letters picked without replacement from {s: 8, c: 8, p: 2}. What is prob of sequence cp? 8/153 Calculate prob of sequence vtxp when four letters picked without replacement from vtpvpvvyddxd. 1/1485 What is prob of sequence ff when two letters picked without replacement from {v: 7, p: 3, x: 2, l: 1, f: 4}? 3/68 Three letters picked without replacement from niiciiiii. What is prob of sequence ini? 1/12 Two letters picked without replacement from {p: 5, a: 6, j: 2, q: 1, o: 1}. What is prob of sequence qp? 1/42 What is prob of sequence tfto when four letters picked without replacement from {f: 3, o: 1, q: 4, x: 4, v: 1, t: 4}? 3/4760 What is prob of sequence ny when two letters picked without replacement from yyyyyyycyyyyynyy? 7/120 Four letters picked without replacement from cptnt. What is prob of sequence ttnc? 1/60 Calculate prob of sequence jrou when four letters picked without replacement from ujoejmr. 1/420 Calculate prob of sequence re when two letters picked without replacement from {e: 3, r: 7}. 7/30 Calculate prob of sequence jrr when three letters picked without replacement from {j: 13, r: 6}. 65/969 Two letters picked without replacement from yyayqyynfyyunyyauyy. What is prob of sequence yn? 11/171 What is prob of sequence jg when two letters picked without replacement from jjjjjjcjcgjjcjjjg? 3/34 What is prob of sequence uq when two letters picked without replacement from qsucggssussasss? 1/105 Calculate prob of sequence nn when two letters picked without replacement from {b: 5, n: 8}. 14/39 Four letters picked without replacement from {l: 5, e: 2}. What is prob of sequence llee? 1/21 Three letters picked without replacement from {i: 5, l: 3, z: 1, b: 3}. Give prob of sequence bib.	{ "pile_set_name": "DM Mathematics" }
87? False Is 57969 a multiple of 57? True Is 97259 a multiple of 79? False Is 377052 a multiple of 39? True Is 193267 a multiple of 24? False Is 102898 a multiple of 264? False Does 404 divide 86982? False Is 33472 a multiple of 64? True Is 24 a factor of 118200? True Does 3 divide 1773991? False Is 772 a factor of 440812? True Is 623750 a multiple of 12? False Is 26 a factor of 435148? False Does 8 divide 122144? True Does 5 divide 2055945? True Is 4271160 a multiple of 20? True Is 15006775 a multiple of 29? True Does 23 divide 35918845? False Is 63 a factor of 163863? True Does 3 divide 1146210? True Is 398 a factor of 622980? False Is 12138 a multiple of 238? True Does 315 divide 742365? False Does 48 divide 1013616? True Is 465963 a multiple of 38? False Does 1240 divide 2411800? True Is 72 a factor of 304992? True Is 1440942 a multiple of 122? True Does 143 divide 46189? True Does 205 divide 1146032? False Does 360 divide 505239? False Is 85 a factor of 13461960? True Is 94 a factor of 252672? True Is 15 a factor of 795? True Does 53 divide 36080002? False Is 399815 a multiple of 13? True Is 601822 a multiple of 1027? True Does 77 divide 739200? True Is 11 a factor of 14367? False Is 12 a factor of 1044? True Does 111 divide 545232? True Is 1378142 a multiple of 39? False Does 2 divide 369245? False Does 27 divide 466722? True Is 38 a factor of 309741? False Does 661 divide 31761050? True Is 724986 a multiple of 369? False Does 18 divide 722826? True Is 606 a factor of 425412? True Does 211 divide 12145? False Does 20 divide 462340? True Is 103660 a multiple of 142? True Is 39 a factor of 529340? False Does 291 divide 42574? False Does 366 divide 186086? False Is 50865 a multiple of 5? True Is 4 a factor of 222268? True Is 78499 a multiple of 3? False Is 16 a factor of 2591495? False Is 77 a factor of 15124? False Is 6246664 a multiple of 9? False Is 11876623 a multiple of 11? True Is 621032 a multiple of 4? True Is 24948 a multiple of 12? True Is 2746016 a multiple of 16? True Is 58 a factor of 2298714? True Does 103 divide 467417? False Is 11 a factor of 18753933? True Is 14 a factor of 351301? False Does 31 divide 307299? False Is 73656 a multiple of 9? True Is 47744 a multiple of 316? False Does 5 divide 185850? True Is 56 a factor of 377776? True Is 37 a factor of 15837239? False Is 1699246 a multiple of 194? True Does 427 divide 967582? True Is 12627912 a multiple of 132? True Is 104892 a multiple of 19? False Is 32868 a multiple of 33? True Is 1401270 a multiple of 10? True Does 36 divide 421848? True Is 21 a factor of 2409524? False Does 286 divide 205973? False Is 4038801 a multiple of 39? True Is 22 a factor of 6921090? True Is 21 a factor of 8673? True Is 2380525 a multiple of 58? False Is 8 a factor of 8335? False Is 1918832 a multiple of 688? True Is 70251 a multiple of 23? False Does 207 divide 210312? True Is 113 a factor of 1280855? True Does 11 divide 1982128? False Does 374 divide 373997? False Is 6 a factor of 3758843? False Is 3849000 a multiple of 125? True Does 11 divide 141603? True Is 846 a factor of 12808709? False Is 1003040 a multiple of 32? True Is 146 a factor of 62912? False Is 12 a factor of 44388? True Is 3460537 a multiple of 234? False Is 9 a factor of 101691? True Is 1002 a factor of 3729444? True Is 58 a factor of 3348? False Is 19423668 a multiple of 492? True Is 132 a factor of 218135? False Does 426 divide 4464102? False Is 51 a factor of 113510? False Is 9 a factor of 11184? False Does 16 divide 122960? True Does 35 divide 1315727? False Is 556038 a multiple of 42? True Does 13 divide 34853? True Is 18 a factor of 2908494? True Is 402138 a multiple of 54? True Does 58 divide 977010? True Is 275568 a multiple of 8? True Is 279425 a multiple of 45? False Is 689926 a multiple of 41? False Is 367 a factor of 1146253? False Does 113 divide 879818? True Is 3185948 a multiple of 31? False Is 830 a factor of 9917762? False Is 2013825 a multiple of 99? False Does 132 divide 51996? False Is 993450 a multiple of 74? True Is 87803 a multiple of 3? False Is 867 a factor of 1132302? True Is 6966804 a multiple of 156? True Is 38 a factor of 484690? True Is 451 a factor of 3917837? True Does 13 divide 1798174? False Is 493864 even? True Does 46 divide 75992? True Is 1476055 a multiple of 181? True Is 168 a factor of 119280? True Is 51107 a multiple of 49? True Is 21 a factor of 210040? False Is 6279 a multiple of 9? False Is 81606 a multiple of 14? True Does 338 divide 415738? False Is 38493 a multiple of 63? True Is 78 a factor of 277857? False Does 215 divide 1473180? True Is 1862820 a multiple of 15? True Is 36464 a multiple of 16? True Is 37469 a multiple of 9? False Does 994 divide 4954485? False Is 258970 a multiple of 29? True Is 15 a factor of 579022? False Does 235 divide 9428148? False Is 5 a factor of 17545? True Is 1259 a factor of 2918403? False Does 56 divide 464016? True Does 9 divide 7225428? False Is 1486 a factor of 4660833? False Is 18 a factor of 804090? False Is 3 a factor of 28753? False Is 180919 a multiple of 37? False Is 70043 a multiple of 3? False Is 373037 a multiple of 23? True Is 15207365 a multiple of 26? False Is 16 a factor of 689354? False Does 50 divide 81300? True Does 3 divide 16766? False Is 159 a factor of 315297? True Is 123208 a multiple of 6? False Does 3 divide 3384? True Does 664 divide 324703? False Does 111 divide 87357? True Does 11 divide 21439990? True Does 2 divide 247519? False Is 2949185 a multiple of 359? True Is 134 a factor of 752812? True Is 663 a factor of 757146? True Is 8 a factor of 267600? True Is 247813 a multiple of 11? False Is 2934012 a multiple of 19? False Does 7 divide 888391? True Is 35877 a multiple of 2? False Is 6 a factor of 74725? False Is 159300 a multiple of 118? True Is 569408 a multiple of 95? False Is 183303 a multiple of 81? True Is 42 a factor of 839679? False Does 12 divide 358248? True Is 3448564 a multiple of 274? True Is 13 a factor of 356887? False Is 717 a factor of 2995626? True Is 10 a factor of 783300? True Is 100 a factor of 61721? False Does 181 divide 10936763? False Is 372 a factor of 1755688? False Does 7 divide 40594? False Is 410 a factor of 1282070? True Is 3291899 a multiple of 36? False Does 21 divide 1313340? True Is 8 a factor of 152488? True Does 194 divide 462136? False Is 27720 a multiple of 330? True Is 262 a factor of 173444? True Does 12 divide 333276? True Is 155990 a multiple of 6? False Is 7282865 a multiple of 502? False Is 6931384 a multiple of 18? False Is 1650192 a multiple of 118? False Does 63 divide 186354? True Is 75 a factor of 2490975? True Does 8 divide 156949? False Is 228 a factor of 321332? False Does 30 divide 10470? True Is 6 a factor of 658716? True Does 18 divide 604648? False Is 54 a factor of 11080908? True Does 485 divide 604963? False Is 25275957 a multiple of 707? True Does 155 divide 1566343? False Is 31 a factor of 5611? True Does 617 divide 674998? True Is 1584216 a multiple of 9? True Is 4 a factor of 46320? True Is 28 a factor of 273022? False Is 58 a factor of 28768? True Does 50 divide 3604953? False Is 36 a factor of 880992? True Is 160 a factor of 4480? True Is 1735793 a multiple of 5? False Does 14 divide 775162? False Is 59 a factor of 283200? True Is 24 a factor of 302496? True Is 555863 a multiple of 288? False Does 8 divide 22437? False Is 1437362 a multiple of 4? False Is 1036 a factor of 2066820? True Is 145890 a multiple of 18? True Does 8 divide 352427? False Is 57 a factor of 74898? True Does 352 divide 3925129? False Is 362100 a multiple of 25? True Does 210 divide 15540? True Does 3 divide 2349375? True Is 1031 a factor of 2643745? False Is 1049516 a multiple of 436? False Does 36 divide 1990367? False Is 169830 a multiple of 37? True Is 2002 a multiple of 39? False Does 154 divide 53284? True Is 102 a factor of 434622? True Does 29 divide 3361796? True Is 19162 a multiple of 13? True Is 12 a factor of 13468? False Is 3807724 a multiple of 121? False Is 8 a factor of 167811? False Is 3059045 a multiple of 11? True Is 246744 a multiple of 552? True Does 12 divide 50472? True Does 7 divide 6281873? False Does 42 divide 11514064? False Does 5 divide 21658? Fal	{ "pile_set_name": "DM Mathematics" }
1 - -50. What is d(y)? 3 Suppose 5 = -5j, -5j = s - 3j - 1. Suppose -4d - 3r = 10, -sd - 2d + 4r + 3 = 0. Let v(f) = 11f2 + f. Determine v(d). 10 Let u(z) = 8z*2 - 7z + 8. Let o(k) = 7k2 - 6k + 7. Suppose 4r - 2r = -14. Let w(x) = ro(x) + 6u(x). Give w(-2). -5 Suppose -2n - 60 = -4p, -60 = -2p - 3p - 5n. Let l(s) = -s3 + 14s2 - 1. Calculate l(p). -1 Let u(z) be the second derivative of -z7/2520 - z*4/6 - 30z. Let t(r) be the third derivative of u(r). Determine t(-1). -1 Let d(h) = -h*2 - 2h + 2. Let k(t) be the first derivative of t*2 - 13t + 1. Let b be k(9). Suppose -22 = 4v - 3z, -7v + 2v - 10 = bz. Calculate d(v). -6 Let b(y) = 13 + y2 + y3 - 4 - 8. Give b(-2). -3 Let c(w) be the third derivative of -w7/1260 + w6/360 + w5/60 + w4/3 - 21w2. Let f(i) be the second derivative of c(i). What is f(3)? -10 Let f(x) = x2 - 4x - 3. Let i be -4 + (2 + -2)/(-1) + 2. Calculate f(i). 9 Let f(d) = -d2 - 4d + 10. Let b be f(-10). Let h be (b/(-4))/54/5. Let v(w) = -2w3 + w2 + w - 2. What is v(h)? -12 Let l(i) = -4i2 - 3i + 12. Let c(j) = -4. Let x(q) = -4c(q) - l(q). Give x(-3). 31 Let u be 4(7 - (-16)/(-2)) + 5. Let s(a) = 10a2 + 2a - 2. What is s(u)? 10 Let t(c) = c + 3. Suppose j - 1 = -11h + 10h, 0 = -5j - 20. Give t(h). 8 Let t(o) = -o3 - o2 + o + 1. Let w be ((-1 - 0) + 1)/1. Suppose 4a - 4c + 8 = 0, 3 = -2c + 7. Let h = w + a. Calculate t(h). 1 Let d(w) be the first derivative of -w*4/12 - 11w*3/6 - 4w*2 + 14w + 2. Let y(h) be the first derivative of d(h). Give y(-10). 2 Let s(p) = -4p3 + 2p2 - p + 2. Let b(r) = -r3 + r*2 + 1. Let k(d) = 3b(d) - s(d). Suppose 0 = -3t - 5g - 3 - 2, -4t - 4g - 4 = 0. Calculate k(t). 1 Suppose c + 4 = -2a - 4, 0 = 2c - 5a - 20. Let j(w) be the second derivative of -w3/6 + 2w*2 - 7w. Determine j(c). 4 Let i(z) = -z*3 + 5z*2 + 7z - 8. Let h be i(6). Let x(p) = -4p2 - 2p + 0p + 0p + 0p + 1. Determine x(h). -11 Let s = 42 - 40. Suppose -3u = 3n + sn - 41, u + 3n - 19 = 0. Let i(t) = 2t + 1. Calculate i(u). 15 Let o(x) = -x*3 + 4x*2 - 2x. Suppose 5s + 3q - 8 = s, -4s - 2q + 8 = 0. Let j be 7 - 2 - (3 - s). Give o(j). -8 Let i(z) be the second derivative of 0 + 3/4z4 - 3/2z*3 + 4z*2 - 1/20z*5 + 15z. Give i(8). 0 Let h(n) = -n*2 + 21. Suppose 0 = -w + 12w + w. Determine h(w). 21 Let i(y) = 13y3 + 5y*2 + 25y + 20. Let t(p) = -7p3 - 2p*2 - 13p - 11. Let k(j) = -6i(j) - 11t(j). Calculate k(-7). 1 Let n(b) = 4b + 2b - b. Let d(v) = -v*2 + 4. Let p be d(2). Suppose 79a - 74a - 5 = p. Calculate n(a). 5 Let g(z) = 7z + 15z - 36z + 2z - z2 - 7. Calculate g(-5). 28 Let f(x) = x3 + 2x*2 - 2x + 1. Let n be f(1). Let a(q) = 0q + 0q + 2q + n. Determine a(2). 6 Let p(b) = -8b*2 - 8b - 229b3 - 234b*3 + 462b*3 + 7. What is p(-7)? 14 Let n(a) be the first derivative of -3a*2/2 - 4a - 1307. Let q be (-3)/(-2)16/(-6). Give n(q). 8 Let t(b) = 4 + b3 + 6b*2 - 5 - 5b + 7b - b2. Give t(-5). -11 Let p(k) = -3k - 2. Let x be -2 - (16/7 + 6/(-21)). Give p(x). 10 Let h be (-1)/4 + 15/(-4). Suppose -2t = -g + 56, -2t + 68 = g - 0t. Let w(c) = g + c - 2c - 64. What is w(h)? 2 Let f = -7 + 11. Suppose 4t + f - 1 = -u, 0 = t - u - 3. Let w(z) = 4 + z2 - 5 + tz*3 - 11z*3. Give w(1). -11 Suppose -4g + 7 = 19. Let f be g/((-42)/(-4)) - (-209)/(-77). Let x(u) = -u - 5. Determine x(f). -2 Let u(v) = -10v. Let g(o) = o3 + 4o*2 - o - 3. Let t = -24 - -20. Let c be g(t). Give u(c). -10 Suppose 305 = 9f + 52f. Let w(y) be the third derivative of y4/24 + y3 - y2. What is w(f)? 11 Let y(t) = -2t + 4. Let b = 30 + -16. Suppose 0 = 11k - 13k + b. Suppose 0 = 3f - 11 - k. Calculate y(f). -8 Let l(r) = 3r*3 - 2r + 1. Let u be (-9)/36 - 33/(-4). Suppose -3f = f + u. Give l(f). -19 Let z(q) = -q2 - 14q - 28. Let y be z(-12). Let u(t) = t + 13. Determine u(y). 9 Let p(z) = z*3 - 2z*2 - 3z - 4. Let k be p(3). Let u(t) be the second derivative of t*3/6 + 2t*2 + 3t - 5. Determine u(k). 0 Let u(w) = -5w - 4. Let g(t) = 12t + 11. Let x(k) = -3g(k) - 8u(k). What is x(-1)? -5 Let i = 18 - 17. Let k(n) = 6n2 - n + 3 + 5 - 8. Determine k(i). 5 Suppose 3c = 11 + 4. Suppose co = -5d + 15, -5o + 4d = 18 - 6. Let s(b) = 4 + 2b + o + 2 - 2. Calculate s(5). 14 Suppose 17 - 42 = -5z. Let q(a) = a + 3. Give q(z). 8 Let c(h) = -12h. Let d be (-1 + 0)(-1)/(5/15). Suppose -di - 73 = -79. What is c(i)? -24 Let t = 28 - 28. Let s(b) be the first derivative of b4/4 - b3/3 - b2/2 - 8b + 1. What is s(t)? -8 Suppose 3 = -2q + 9. Let u(p) be the third derivative of 0p + 1/24p4 - p2 + 0 - 1/20p*5 + 1/120p*6 + 1/3p*3. What is u(q)? 5 Let m(u) = -u + 2. Let j be ((-17)/(-3))/((-16)/(-240)). Suppose -3o + 76 - j = 0. Determine m(o). 5 Let p(v) = -v*3 + 4v*2 - v - 1. Let j be (20/(-4))/(-5)(-48)/(-3). Let r(k) = -k*2 - 2k - 1. Let f be r(-1). Suppose f = 3x + 10 - j. Determine p(x). 5 Let h(v) = 4v*2 - 2v + 2. Let l(t) = -2t2 + t - 1. Let x(z) = 4h(z) + 7l(z). Let k(o) = 25 + 2o - 61 + 19. Let a be k(9). Give x(a). 2 Let v(d) = 25d3 - 2d + 1. Let a = 286 - 285. Give v(a). 24 Suppose -37m - 81 = -10m. Let z(h) = -2h2 - 4. Give z(m). -22 Let i be (-9)/12(-32)/6. Suppose -n - io = -1 - 4, -2n - 1 = -3o. Let p(l) = -9l. Give p(n). -9 Let x(k) be the third derivative of k6/120 + k5/30 - k4/24 - k3/2 - 4k2 - 33. What is x(-3)? -9 Let c(h) = -h2 + 2. Let t = 290 - 290. What is c(t)? 2 Let h = 6 - 7. Let s(x) be the second derivative of 5x4/12 + x2/2 - 2x. Calculate s(h). 6 Let y(o) = 2o*2 - 54o + 156. Let w(x) = x*2 - 28x + 80. Let z(a) = -11w(a) + 6y(a). Give z(11). 1 Let z(k) = -k*3 + 3k*2 + 2k + 1. Let x be (-50)/325 - -366/52. Calculate z(x). -7 Let r(l) be the third derivative of -46l*2 - 1/6l*3 + 0l + 0 + 1/24l4. Determine r(3). 2 Let m(p) = p + 12. Let w be m(-9). Let v(u) be the second derivative of u3/6 - u2/2 - 21u. Calculate v(w). 2 Let x be (-1)/(7/(-6))224/(-48). Let i(q) be the second derivative of 2q + 3/2q2 + 1/6q*3 + 0. Calculate i(x). -1 Let o(s) = 2s3 - s2 - 3s + 1. Let c = -225 - -227. Give o(c). 7 Let x(t) = -t. Let d(g) = -9g + 35. Let y be d(5). What is x(y)? 10 Let i(w) = -w*2 + 1. Let o(k) = -3k - 4. Let c(a) = 5a + 8. Let j(t) = 4c(t) + 7o(t). Let g be j(6). Determine i(g). -3 Suppose -2r = -3i + 25, 2i + r + 3r = 6. Suppose i = b + 3. Let m(s) = -s3 + 4s*2 - 4. Determine m(b). -4 Let v be -6(2/7 + (-190)/420). Let n(d) = -2d2 - d. What is n(v)? -3 Suppose -4c + 280 = -12c. Let w = -33 - c. Let u(g) = -5g*2 + 3g. Calculate u(w). -14 Let y(q) = q3 - q2 + 22. Let w(i) = -i*3 - 24i*2 - 43i + 22. Let h be w(-22). What is y(h)? 22 Let l(x) = x*3 - 2x*2 - x. Suppose 0 = -2t - 3t - k + 16, -3k = -3. Suppose 5i - 4n = -25, ti + 20 = 8i + 5n. What is l(i)? -2 Let a(x) = -x3 + 6x - 2. Let y be a(2). Let b(k) = 0k - 5k*y - 5k - 11 + 6k2 + 3. What is b(7)? 6 Let d(k) = k3 - 9k*2 + 15k - 1. Let m be d(7). Let y be (-6)/m + 2 - (10 + -1). Let c(u) = u. What is c(y)? -8 Let y(v) = -v*2 + 7v - 7. Let d be y(4). Let s(j) be the third derivative of 3j2 + 5/6j*3 - 1/12j*4 + 0j + 0. Determine s(d). -5 Let s(y) = -y - 3. Let i = 380 + -377. Calculate s(i). -6 Suppose -38 = -2f + 18. Let d be (-4)/(-1) - f/7. Let r(v) = 3v + dv - 5v - 2. Calculate r(5). -12 Let q(d) be the third derivative of -d7/2520 + d6/120 + d*5/12 - 7d*4/8 + 3d*2. Let z(h) be the second derivative of q(h). Give z(8). -6 Let s be ((-6)/(-9))/16. Let f(o) = o + so + 17 - 7o. Let v(z) = -z + 9. Let h(c) = -3f(c) + 5v(c). Determine h(5). -1 Let i(c) = 5c - 1. Let l be 4(6/14)/(96/168). What is i(l)? 14 Let f(g) = -6g3 - g2 + g - 1. Let x(w) be the third derivative of -w4/24 + 5w*2. Suppose 0 = 4i, 4i - 2 + 0 = 2a. Let t be x(a). Determine f(t). -7 Suppose -y = -0y + 1. Let w = -242 - -245. Let z(s) = -5s2 + 1. Let i(n) = n2. Let r(j) = wi(j) + yz(j). Calculate r(-1). 7 Let r(x) = -x*2 - 9x - 11. Let p be r(-7). Let w(g) = g*3 - 2g*p + 6g*2 + 5g +	{ "pile_set_name": "DM Mathematics" }
*3 - 1477k*3 + 1269k*2 - 1269k*2. 10392k*3 Collect the terms in 13350v2 + v3 + 5738 + 5834 - 11570. v*3 + 13350v*2 + 2 Collect the terms in 55z + 16z + 61z + 1 - 246z. -114z + 1 Collect the terms in -796k2 + 30k2 + k3 - 42k + 81k - 39k. k3 - 766k2 Collect the terms in -2822 - 2828 + 11308 + c2 - 3c2 - 2822 - 2828. -2c*2 + 8 Collect the terms in 7544l*2 + 7335l*2 - 14875l*2. 4l*2 Collect the terms in 39d - 169d + 44d - 330 + 46d + 39d. -d - 330 Collect the terms in 3587l + 9769l - 16986l + 3582l. -48l Collect the terms in 509f*2 - 492f - 479f - 507f*2 + 1529f - 509f. 2f*2 + 49f Collect the terms in 24f3 + 9340725816387f*2 - 9340725816387f*2. 24f*3 Collect the terms in 2632p + 2426p - 6241p + 2132p. 949p Collect the terms in 12208a - 16285a + 10125a. 6048a Collect the terms in 48h2 - 48h*2 - 169067198h + 4h3 + 169067212h. 4h3 + 14h Collect the terms in -3361g - 1164g - 3381g + 2084g. -5822g Collect the terms in -3k*2 - 345k + 63k + 255k + 2k2 - 4. -k2 - 27k - 4 Collect the terms in -19695d3 + 25 + 170594d*3 + 86363d*3 - 23. 237262d*3 + 2 Collect the terms in 3505b*2 + 155b*2 + 1806b*2. 5466b*2 Collect the terms in 506191k - 506191k + 867k*3. 867k*3 Collect the terms in -75905 - 75932 + 151837 + w - 25w*3 - w. -25w*3 Collect the terms in 4x2 - x2 + 5479x3 - 4x*2 - 2691x*3 - 2737x*3. 51x3 - x2 Collect the terms in 1168a + 84938a*2 - 1168a - 84930a2. 8a*2 Collect the terms in 19245y*2 + 115y*3 + 19231y*2 + 19232y*2 - 57708y*2. 115y*3 Collect the terms in 2469n + 25 - 4775n + 2307n - 25. n Collect the terms in -3383r - 4 + 144 - 154 + 14. -3383r Collect the terms in -376g2 - 135881 + 135881. -376g*2 Collect the terms in 4 - 942720739v*2 + 942720739v2 - v3 + 0v3 - 4. -v3 Collect the terms in -515q + 236q - 485q - 891q. -1655q Collect the terms in 796j - 826j - 252 - 685. -30j - 937 Collect the terms in 500853042 - 8a*2 - 500853042. -8a*2 Collect the terms in -471k - 1085k + 39 + 34 + 453k - 75. -1103k - 2 Collect the terms in 2 - 1 - 103842k*2 + 1. -103842k*2 + 2 Collect the terms in 72207n*2 - 72207n*2 - 288n*3. -288n*3 Collect the terms in -455v*3 - 2 + 218v*3 + 234v*3 - 5v*2. -3v*3 - 5v*2 - 2 Collect the terms in 6m - 14265293894 + 14265293894. 6m Collect the terms in 6m + 3m + 4m + 0m - 28m + 8. -15m + 8 Collect the terms in -3624537604 + 5r + 3624537604. 5r Collect the terms in 555u + 533u + 561u + 569u - 2798u + 571u. -9u Collect the terms in -17y - 11y - 2273 + 2670 + 3127. -28y + 3524 Collect the terms in -g2 - g2 - 2g - 2g + 47030 + 2g - 47030. -2g2 - 2g Collect the terms in -151k + 78k - 12 + 38k + 39k + 8. 4k - 4 Collect the terms in 2099s - 15s2 + 56s*2 - 710s + 43s2 - 1389s. 84s2 Collect the terms in -42698668j*3 + 21349298j*3 + 21349368j*3. -2j*3 Collect the terms in -4w + 7w - 4w - 851w2 + 867w*2 - 12 + w. 16w*2 - 12 Collect the terms in -469i - 662 + 395i - 665 + 1990 - 663. -74i Collect the terms in 2916v3 - 9 - 970v*3 - 978v*3 - 987v*3. -19v*3 - 9 Collect the terms in -b + 3950 + 6b - 3954 - b. 4b - 4 Collect the terms in -38o*2 + 8o*2 + 15o*2 + 12o*2 + 6. -3o*2 + 6 Collect the terms in -541 - h + 41h*2 - 522 + 1060. 41h*2 - h - 3 Collect the terms in 1062x*2 - 1075x*2 + 6x*3 + 12x*3 - 16x*3. 2x*3 - 13x*2 Collect the terms in -7 + 5 + 5q2 - 3 + q2 + 10 - q*2. 5q*2 + 5 Collect the terms in -101884n*3 + 204556n*3 - 102673n3. -n3 Collect the terms in -163255d3 - 2d - 9305d3 + 2d. -172560d3 Collect the terms in 107 - 3210k*3 + 110 - 320 + 103. -3210k*3 Collect the terms in 9680x*2 - 7750x*2 + 324x - 163x - 161x. 1930x2 Collect the terms in 45478546 + 23m*2 - 3m*2 - 45478546. 20m*2 Collect the terms in 746c*3 + 878c*3 + 739c*3 - 2c*2 - 3871c*3 + 744c*3 + 742c*3. -22c*3 - 2c*2 Collect the terms in -21o - 17o + 103o - 9 - 18 - 67o. -2o - 27 Collect the terms in -183z3 - 519z*3 - 335z*3 + 973z*3. -64z*3 Collect the terms in -140n*2 - 716n*2 + 193n*2 + 14n - 197n2 - 98n*2. -958n*2 + 14n Collect the terms in -638q2 + q + 1243q*2 - 601q*2 - 286. 4q*2 + q - 286 Collect the terms in 11 - 30 + 89s + 10 + 11s + 9 - 125s. -25s Collect the terms in 166947 + 6h*2 - 335846 + 168899. 6h*2 Collect the terms in -1305980u*3 + 653003u*3 + 652969u*3. -8u*3 Collect the terms in -304u*3 - 107u*3 - 629u*3 - 340u*3 + 288u*3. -1092u*3 Collect the terms in 52394d*3 - 132d + 132d + 19 - 52392d*3. 2d*3 + 19 Collect the terms in 54b*2 - 115b - 108b - 112b + 451b - 115b + 281b2. 335b*2 + b Collect the terms in -2o*3 + 299396121512o*2 - 299396121512o*2. -2o*3 Collect the terms in 1324522 - 1324522 + 11123s - 11118s. 5s Collect the terms in 7296020 + 341y - 7296020 - 685y - 3y2 + 4y*2 + 344y. y*2 Collect the terms in -1950k - 109467 + 5188k + 109467. 3238k Collect the terms in -1757g3 - 1750g*3 - 1679g*3 - 1757g*3 + 6942g3. -g3 Collect the terms in -1837693l + 3675402l - 1837699l. 10l Collect the terms in -426z3 + 20 - 66 + 43 + 3. -426z*3 Collect the terms in 514a*3 + a + 381 - 1044a*3 + 502a*3 - 381. -28a*3 + a Collect the terms in h - 3h + 3h + 403083 - 6h*2 - 14415. -6h*2 + h + 388668 Collect the terms in -396n + 182n + 73n*2 + 107n - 73n2 + 4n*3 + 107n. 4n3 Collect the terms in -3012677436 - 2k + 4k + 3012677436. 2k Collect the terms in 220l + 558l*3 - 146l - 74l. 558l*3 Collect the terms in -2319m*2 - 3627m*2 - 22 + 5948m*2. 2m*2 - 22 Collect the terms in -327330227753649 + 327330227753649 - 5g3 - g2 + g*2. -5g*3 Collect the terms in -1362929d*3 - 1363004d*3 + 2725941d*3. 8d*3 Collect the terms in 4279v - 27732731 + 27732731. 4279v Collect the terms in 122w*2 + 37 - 240w*2 + 118w*2 - 476w*3. -476w*3 + 37 Collect the terms in 2 - 12233f + 36697f - 12265f - 12245f. -46f + 2 Collect the terms in 12674908d2 - 6337514d*2 - 6337474d*2. -80d*2 Collect the terms in 28n - 2n2 + 113n - 140n + 2n*2 + 8n*3. 8n*3 + n Collect the terms in -2k + 28 + 71 - 104 + 6k + 7. 4k + 2 Collect the terms in -65778960c3 + 32889448c*3 + 32889511c3. -c3 Collect the terms in 59c2 - 21c*2 + 114 - 17c*2 - 114 - 20c2. c2 Collect the terms in 39g - 11 + 0 + 10g*2 + 5g*2. 15g*2 + 39g - 11 Collect the terms in -7o2 + 563 - 121 - 122 - 128 - 125. -7o*2 + 67 Collect the terms in -2q*2 - 5q*3 - 300991599q + 3q3 + 300991601q + 2q2. -2q*3 + 2q Collect the terms in -345312u + 690627u - 345316u. -u Collect the terms in 44 - 34 + 32 - 60 + 3w*2 + 33 + 0w*2. 3w*2 + 15 Collect the terms in 2182j - 633j - 775j + 2 - 775j. -j + 2 Collect the terms in -9381 + 4689 + 4692 + 2994t - 10621t. -7627t Collect the terms in 193343c3 + 193323c*3 - 579980c*3 + 193315c3. c3 Collect the terms in -1636a2 + 1498a*2 + 45a + 6a. -138a*2 + 51a Collect the terms in -6687427037 + 2u + 6687427037. 2u Collect the terms in -3158y - 6y*2 + 1043 - 1043. -6y*2 - 3158y Collect the terms in -20a - 41a - 28a - 25a - 32a - 32a. -178a Collect the terms in 119023n + 3928 - 4n2 - 59511n - 3928 - 59512n. -4n*2 Collect the terms in 3 + 35t*2 - 54t*2 - 46t*2 + 95t - 9t. -65t*2 + 86t + 3 Collect the terms in 237r2 + 194r*2 - 118r*2 - 361r*2. -48r*2 Collect the terms in 87a + 108a + 82622 - 82622 - 188a. 7a Collect the terms in -55431m*3 + 129446m*3 + 105478m*3. 179493m*3 Collect the terms in -1921b*2 - 1325b*2 + 3206b*2. -40b*2 Collect the terms in 386914h + 386892h - 1160739h + 386943h. 10h Collect the terms in 8u3 + 3472 - 3u*3 + 3953. 5u*3 + 7425 Collect the terms in 8s - s + 778 - 4s - 19s. -16s + 778 Collect the terms in 176939 - 88471 - 88468 + 59u - 18u2. -18u*2 + 59u Collect the terms in 25 - 83 + 112*o + 12	{ "pile_set_name": "DM Mathematics" }
f 9? True Let d(n) be the second derivative of 5n3/3 - 3n*2 + 5n. Does 13 divide d(4)? False Let u be (-3)/(-4)4 + -6. Does 8 divide 30 + (0/u)/(-3)? False Let t be (9/6)/((-3)/(-4)). Suppose 0 = -3q + 4 + t. Suppose 2y = k + 22, -5y - qk = -2y - 47. Is y a multiple of 12? False Let r(l) = l2 - l. Let d be r(-1). Let w(p) = p2 + p + 2. Is 3 a factor of w(d)? False Let a(g) be the third derivative of g5/60 - g4/4 + 3g3/2 + 5g*2. Is a(7) a multiple of 16? True Let o(w) = -2w - 7. Let i be o(-5). Suppose 4n - 4g = 12, 0n - 2n + ig = -6. Suppose 4s + nd = 92 - 8, -5s + 94 = d. Is 6 a factor of s? True Let n be (-12)/(-66) - (-282)/22. Let u = n + -5. Is 8 a factor of u? True Let w = 337 - 229. Suppose -3h + w = -84. Does 31 divide h? False Suppose 44 = -5k - 3q + 5q, 4k + 5q = -55. Does 2 divide (12/(-5))/(4/k)? True Suppose v - 5u = 40, -4v - 2u + 211 = -5u. Is 11 a factor of v? True Suppose r - 13 - 24 = 0. Let c = r + -15. Is 9 a factor of c? False Let q(w) = w + 1. Let n(h) = 24h + 12. Let m(c) = -n(c) + 20q(c). Is 16 a factor of m(-6)? True Let l be (-720)/21 + (-4)/(-14). Suppose 2g - 107 = -3f, 7f = 4g + 5f - 238. Let x = l + g. Is x a multiple of 8? True Suppose 2n - z + 6z - 30 = 0, -3n + 5z = -20. Is 3 a factor of n? False Let f be 28/(-6)(-72)/84. Suppose fr - 33 = 59. Is 8 a factor of r? False Suppose -3f = -0f - 15. Suppose 0t = v + ft - 35, -3t = 4v - 72. Is 5 a factor of v? True Let l(p) = 169p + 1. Is l(1) a multiple of 34? True Let j(g) be the first derivative of -3g2/2 - 8g + 2. Let h be j(-6). Suppose i + h = 2i. Is 6 a factor of i? False Let d(t) = t2 + 2t + 4. Is d(-3) a multiple of 7? True Suppose 4o - 11 + 3 = 0. Suppose -4v + 14 + o = 0. Suppose 5a + 55 = vr, a - 5 + 0 = 0. Is 10 a factor of r? True Is 11 a factor of (-11)/((-3)/33)? True Let f = 10 - 7. Suppose -fq = 4y - 65, 5y + 6q - 82 = 3q. Is y a multiple of 13? False Let k(m) = m*2 - 4m - 6. Let n be k(6). Suppose -2s = -42 - n. Is s a multiple of 12? True Let p(o) = -o + 1. Let z be p(-4). Suppose zs - 55 = 15. Is 7 a factor of s? True Suppose -4d + 2b - 178 = 0, 6d - d + 225 = 2b. Let v = -28 - d. Does 16 divide v? False Suppose 3v - 5d = 289, 3v + 4d = 454 - 156. Does 14 divide v? True Let a(u) = -u*3 + 12u*2 + 19u - 9. Let z = 47 - 34. Is 23 a factor of a(z)? True Suppose 0 = -2f - 13 - 67. Suppose -5 = -3w - 92. Let u = w - f. Is 11 a factor of u? True Suppose 2q + 0 = -2. Let a(v) = -5v + 1. Let t be a(q). Suppose tw - 147 = 3w. Is 13 a factor of w? False Let v(s) = 3s + 6. Is 9 a factor of v(4)? True Let i = 616 - 426. Is 19 a factor of i? True Let b = 241 - 136. Is 21 a factor of b? True Let g = 3 - 7. Suppose 2y = -0y - 2. Let j = y - g. Is j a multiple of 2? False Suppose -4v + y - 106 = -y, 0 = -5v - 4y - 100. Is 77/(-11)v/14 a multiple of 6? True Let d(n) = n3 + 3n*2 - 5n - 3. Let f be d(-4). Let l(a) = 2 - 3 + a*2 + 6a*2 + 2a. Is l(f) a multiple of 6? False Let y = 132 - 93. Is y a multiple of 13? True Let n = 23 - 8. Let p = n - 2. Suppose 2x - p = x. Is 13 a factor of x? True Suppose 0 = -0l - 3l + 63. Is 9 a factor of l? False Let f = -7 + 49. Is f a multiple of 12? False Let n(x) = x2 - 2x + 2. Suppose 14 = 4c + r, -2r + 2 = -2. Let m be n(c). Suppose 3g = g + 4q - 8, -24 = -g - mq. Is 4 a factor of g? True Does 9 divide 183 - 12(-6)/12? True Is 15 a factor of 1/(-5) - (-304)/20? True Let j be 60/(-27) + (-10)/(-45). Is 66 - (-1 - j) - -2 a multiple of 17? False Let m(s) = -13s + 1. Is m(-5) a multiple of 22? True Does 5 divide 4/(12/291) + 3? True Let s be (2 - -2)/(-1 + 3). Let a(j) = j3 - 2j*2 - 2j - 2. Let z be a(3). Suppose -6o + 31 = l - so, l - 2o = z. Is 11 a factor of l? True Let w(c) = c2 - 2c - 4. Let d be w(4). Suppose -11 = -3p + 4q, 5q = -0p + 3p - 16. Is 3 a factor of d/12 + (-14)/p? False Suppose -7o + 4o + 6 = 0. Suppose ot - 3t + 4 = 0. Suppose -w + 120 = tw. Is w a multiple of 9? False Suppose -i + 0 = -2. Suppose -iw - 396 = -5w. Suppose 0 = 5n - b - 280, -3n + b + w = -38. Is n a multiple of 14? False Suppose 2t - 4k - 26 = 0, -3t + k - 3k - 1 = 0. Suppose -4r + 19 = -tr. Let i = r + -10. Is i a multiple of 3? True Suppose 95 = 2r - 3h, 5r + 4h - 8h - 220 = 0. Does 4 divide r? True Suppose 0 = 10y - 395 - 445. Is y a multiple of 12? True Let m = 32 + 0. Does 4 divide m? True Suppose -3y - 5c = -46, 4y + c - 117 + 33 = 0. Is y a multiple of 15? False Suppose -4a - 63 = -5i + 445, -3a = 3i - 294. Is 10 a factor of i? True Suppose -4i + 7 + 301 = 0. Let s = i + -44. Does 11 divide s? True Suppose 0 = -5j + 21 + 4. Suppose 0 = -jq - 5v + 50, 20 = 5q + 3v - 4v. Does 3 divide q? False Is 5 a factor of 3/(-9) - (-136)/12? False Let b be (-8)/12-16. Is 4 a factor of 1 - 12/b - -6? True Let w(n) be the first derivative of -n*6/120 - 2n*5/15 - 5n4/12 - n3/2 + n*2 + 1. Let z(c) be the second derivative of w(c). Does 9 divide z(-7)? True Suppose 4c - 3 = k - 1, -3k + 2c + 34 = 0. Does 4 divide k? False Suppose 0 = -o + x + x - 11, -o - 7 = -x. Let c = o - -3. Suppose 63 = 4f + 5m, 4m - 2 = -f - cf. Does 11 divide f? True Let k = 4 + 32. Is k a multiple of 18? True Does 3 divide (2/(-5))/((-13)/390)? True Suppose -5o = -7o - 6. Does 10 divide (-1 - o - 3) + 11? True Let b = 62 - 33. Is b a multiple of 14? False Suppose -2f - 46 = -3s, 0f + 2f + 18 = s. Suppose -s = -u - 1. Is 13 a factor of u? True Let h be 171/((-3)/3). Let c = h + 37. Suppose c = 3q - 37. Is 10 a factor of q? False Suppose 20 = -4h, 4o = 2h - 4h + 6. Suppose -16 = -oy, -9 = -v - 2y + 1. Suppose 0g = -vg + 32. Is g a multiple of 11? False Let w be (-168)/20 + 2/5. Let c(p) = p*2 + 5p + 3. Is c(w) a multiple of 9? True Let i be 4/46/2. Suppose -x = 4y - 22, y - 2x = -ix + 7. Is -5(2 - 29/y) a multiple of 19? True Let k be ((-2)/2 - -20)-3. Suppose 0 = -5l - 4p + 400, 3l + 4p - 148 = l. Let q = l + k. Does 9 divide q? True Suppose 4i + 128 = -4w, -2w + i = 105 - 29. Let m = w + 66. Is 15 a factor of m? True Suppose 4l - 2q + 2 = -4q, -4l - 3q + 1 = 0. Let h = l + 44. Is h a multiple of 14? True Let u = 46 - 31. Let v = u - 11. Does 2 divide v? True Let f(o) be the second derivative of 3o4/2 - o3/6 + o2/2 + 3o. Does 6 divide f(1)? True Suppose 989 + 1711 = -5x. Is x/(-21) - (-2)/7 a multiple of 26? True Let c(l) = 51l - 1. Let j = 3 + -2. Let h be c(j). Is 1/(-2) - h/(-4) a multiple of 6? True Let d(n) = -10n2 + n - 2. Let c be d(2). Suppose 48 = 2y - 118. Let l = y + c. Does 15 divide l? False Is 22 a factor of 88/3 - (-4)/6? False Let u(g) = 5g2 - 3g - 3. Let j be 2 - 4 - (1 + -1). Is 9 a factor of u(j)? False Suppose -4o = -3o - 4. Suppose 4k + on + 24 = 5k, 2k = -2n + 88. Does 19 divide k? False Let b(a) = -8a - 3. Let s = -7 - -3. Does 8 divide b(s)? False Suppose -4 + 0 = -2m. Suppose -h - 48 = -mh. Is h a multiple of 17? False Suppose 0 = -k + 57 + 3. Does 15 divide k? True Suppose -4i + 22 + 10 = 0. Suppose -5f + 75 = -2j, 0f + 26 = 3f - 5j. Let q = f - i. Does 9 divide q? True Suppose 5c - 7c - 2 = 0. Let k = -3 + c. Let i = k + 17. Is i a multiple of 10? False Let r(f) = 4f + f - 13 + 4f + 16. Is r(3) a multiple of 8? False Is (-2)/(-2)1526/213 a multiple of 24? False Let u be 2/(23/(-522)). Let r = 304 + u. Is 13 a factor of ((-28)/(-35))/(4/r)? True Suppose -5q + 293 = -97. Does 17 divide q? False Suppose -3h + 6h = 561. Is h a multiple of 17? True Let t(j) = j*3 + 3j*2 - 5j - 1. Let w be t(-4). Let v be (1/(-3))/(1/3). Is 2/(w + v) - -1 even? True Let g be -5 + (-6)/(-4)-2. Let l = -9 - g. Is 3 a factor of l/((-1)/31)? True Let n(d) = -d*3 + 8d*2 + 13d - 4. Is n(9) a multiple of 7? False Suppose -2y + 3 = s - 5, 5y - 4s = 7. Let n be 17/3 + 4/(-6). Suppose 4t + 107 = np, 0 = 2p - p + yt - 10. Is p a multiple of 11? False Let r be 12/(-16) + (-1)/4. Let m be r/2 - 71/2. Let q = -17 - m. Is 14 a factor of q? False Suppose -l + 25 = -0l. Is l a multiple of 5? True Suppose 2v = 1 + 3. Does 5 divide (5/v)/((-1)/(-2))? True Let u = 4 - 4. Suppose 3a - 2*a + 2 = u. Is 4	{ "pile_set_name": "DM Mathematics" }
0.1, 69 Sort -0.4, 421, -1, 0.1, 4. -1, -0.4, 0.1, 4, 421 Sort 0.5, -2, 0.1, -2.49 in ascending order. -2.49, -2, 0.1, 0.5 Sort 0, -3, 5 in ascending order. -3, 0, 5 Put 32, -2, 3, 1/4, -48 in descending order. 32, 3, 1/4, -2, -48 Put -1/6, -0.5, 0.4, 2 in descending order. 2, 0.4, -1/6, -0.5 Sort 0.1, -2/7, 2, 1/113. -2/7, 1/113, 0.1, 2 Put 1, -1, 0, -3, 5 in increasing order. -3, -1, 0, 1, 5 Put 5, 18, -0.4 in decreasing order. 18, 5, -0.4 Sort 8, 29, 1 in decreasing order. 29, 8, 1 Sort -9, -2, -4, -3. -9, -4, -3, -2 Put 0, -28, 23, 7 in ascending order. -28, 0, 7, 23 Sort -21, -3, 2 in decreasing order. 2, -3, -21 Sort 0.039, 0.3, -3 in descending order. 0.3, 0.039, -3 Put 0.5, -4, 10, 2/11, -3/17 in increasing order. -4, -3/17, 2/11, 0.5, 10 Put 0.3, 0.1, -8, 2, 6 in descending order. 6, 2, 0.3, 0.1, -8 Put -2, 2, 4, -3 in ascending order. -3, -2, 2, 4 Sort 4, 15, -3, 31, 5 in descending order. 31, 15, 5, 4, -3 Put 3, -1, -3, -11 in descending order. 3, -1, -3, -11 Put 6/7, -25, 2/3, 5, -5 in decreasing order. 5, 6/7, 2/3, -5, -25 Sort 4, -4, -734 in ascending order. -734, -4, 4 Put 0, 11, -3 in increasing order. -3, 0, 11 Put -0.3, -3/7, -0.1, -1634 in descending order. -0.1, -0.3, -3/7, -1634 Sort -3/1102, -5, -4. -5, -4, -3/1102 Put 8, -3, 5, -2, -7 in descending order. 8, 5, -2, -3, -7 Put 5, -1189, -3 in decreasing order. 5, -3, -1189 Sort -11, -4, -50. -50, -11, -4 Put -218, -2/5, -1 in ascending order. -218, -1, -2/5 Sort 14, 0.09, 0 in increasing order. 0, 0.09, 14 Sort -0.5, -4, -43, -0.3, 5. -43, -4, -0.5, -0.3, 5 Sort -32, 2/3, 0.1, -4 in ascending order. -32, -4, 0.1, 2/3 Sort 0, 28, 2/7, -0.1 in descending order. 28, 2/7, 0, -0.1 Sort 1, 33, 1/4 in descending order. 33, 1, 1/4 Sort 0.1, -2, -2/11, -6, -1/3. -6, -2, -1/3, -2/11, 0.1 Put 3, 19, -3 in increasing order. -3, 3, 19 Sort 3, 1, -263 in increasing order. -263, 1, 3 Put -41, -0.4, -2/13 in ascending order. -41, -0.4, -2/13 Sort 3, -1/4, -4. -4, -1/4, 3 Sort -694, -3, 5, -4, 0 in ascending order. -694, -4, -3, 0, 5 Sort -5, -14, 2, 164, -2 in increasing order. -14, -5, -2, 2, 164 Put -2, -24, -3 in decreasing order. -2, -3, -24 Sort -17, 0.3, -1/6, -3 in descending order. 0.3, -1/6, -3, -17 Sort -32/5, -2, 0.1 in decreasing order. 0.1, -2, -32/5 Put 9, 1/4, -1 in descending order. 9, 1/4, -1 Sort -5, -0.014, -3, 0 in descending order. 0, -0.014, -3, -5 Put -101.2, -0.1, 5, 2/5 in increasing order. -101.2, -0.1, 2/5, 5 Sort -18, 0, -1, 3, -11. -18, -11, -1, 0, 3 Sort 1, 3, 2.7, 2/7 in descending order. 3, 2.7, 1, 2/7 Sort -2, 8, 0.4, 4, -4/7. -2, -4/7, 0.4, 4, 8 Put 4, 3, -37 in ascending order. -37, 3, 4 Put -1, 5, -85/3, 4, -0.2 in increasing order. -85/3, -1, -0.2, 4, 5 Sort 0, 5, -58, -1 in descending order. 5, 0, -1, -58 Sort 2, 3, 1, 2/7 in ascending order. 2/7, 1, 2, 3 Put -8, -4, 0, 2 in descending order. 2, 0, -4, -8 Sort 0.09, -2, -1/8, -0.9, 0 in ascending order. -2, -0.9, -1/8, 0, 0.09 Put 3, -2, 26, -0.3, 0.4 in ascending order. -2, -0.3, 0.4, 3, 26 Put 4, -19, -3, 97 in decreasing order. 97, 4, -3, -19 Put 6, -1, -2, 1, -3 in ascending order. -3, -2, -1, 1, 6 Sort 5, -3, -7 in descending order. 5, -3, -7 Sort -1/4, -1.105, 2/7. -1.105, -1/4, 2/7 Sort 1, -6, -4. -6, -4, 1 Put 1019, -3, -0.3 in descending order. 1019, -0.3, -3 Sort 0, -2, 1, -19 in descending order. 1, 0, -2, -19 Sort 3/5, -249, 0 in ascending order. -249, 0, 3/5 Put 0, -4, -1, -3, 136 in decreasing order. 136, 0, -1, -3, -4 Sort 4, 3/7, -9, -0.052 in ascending order. -9, -0.052, 3/7, 4 Put -2/7, -2/15, 191, 0.1 in increasing order. -2/7, -2/15, 0.1, 191 Sort -6, -1, 2, 0 in descending order. 2, 0, -1, -6 Put -4, 25, 2, 4 in descending order. 25, 4, 2, -4 Sort 2, -1, 5, 7, -4 in decreasing order. 7, 5, 2, -1, -4 Sort 1, 4, 0.07, 6, -112 in ascending order. -112, 0.07, 1, 4, 6 Put 5, 0.17, -3/8, 3 in descending order. 5, 3, 0.17, -3/8 Sort 2/7, 15, -3/2, -0.2. -3/2, -0.2, 2/7, 15 Put -3, 3, -2, 5 in decreasing order. 5, 3, -2, -3 Sort 26, -45, -0.3, 0.1 in decreasing order. 26, 0.1, -0.3, -45 Sort 2, 0, -1, -7 in increasing order. -7, -1, 0, 2 Sort 0.2, 0.5, -3/8, -1/20 in increasing order. -3/8, -1/20, 0.2, 0.5 Put 6, -5, 10 in increasing order. -5, 6, 10 Sort 449, 3, -5 in descending order. 449, 3, -5 Put -2, 0.3, 0, -13 in ascending order. -13, -2, 0, 0.3 Sort 1/3, 2/5, -2/9, 120 in decreasing order. 120, 2/5, 1/3, -2/9 Sort -17/3, -63, 1/8. -63, -17/3, 1/8 Sort 1, 0, 3, -7 in decreasing order. 3, 1, 0, -7 Put 2, -3, -178, -1, -4/3 in decreasing order. 2, -1, -4/3, -3, -178 Sort 0, 941, -2 in decreasing order. 941, 0, -2 Sort 2, 32, -3, 5 in decreasing order. 32, 5, 2, -3 Put 7, 0.1, -15 in decreasing order. 7, 0.1, -15 Sort 3, -1/2, -1/5, 628, 0.4 in increasing order. -1/2, -1/5, 0.4, 3, 628 Put -3, -2, 0, 18 in descending order. 18, 0, -2, -3 Put -1.7, -1, 8, -1/9, 3/4 in decreasing order. 8, 3/4, -1/9, -1, -1.7 Sort -2, -9, 8, 1. -9, -2, 1, 8 Sort -2/9, 1, -1.3, -7. -7, -1.3, -2/9, 1 Sort 1, 8, -1/44, 2 in decreasing order. 8, 2, 1, -1/44 Put -37, 4, -2, -5 in descending order. 4, -2, -5, -37 Sort -1/5, 1/3, -14, -2 in ascending order. -14, -2, -1/5, 1/3 Sort 1/7, 2/7, 2, -0.014 in ascending order. -0.014, 1/7, 2/7, 2 Sort -26, -13, 5, -3, -2 in increasing order. -26, -13, -3, -2, 5 Put 2, -3, -22, -73 in ascending order. -73, -22, -3, 2 Sort 3, 1/6, 2/93, 0.03 in descending order. 3, 1/6, 0.03, 2/93 Put -0.095, 3/4, -2 in decreasing order. 3/4, -0.095, -2 Sort -3/7, -2, -105, 2/3, 0.5. -105, -2, -3/7, 0.5, 2/3 Put -3/8, 0.04, 1/45, 3, -0.1 in decreasing order. 3, 0.04, 1/45, -0.1, -3/8 Put -2, -6, 4, 0.5 in descending order. 4, 0.5, -2, -6 Put 2, 13, -5, -4 in decreasing order. 13, 2, -4, -5 Sort 5, 2, -63, -1/9 in decreasing order. 5, 2, -1/9, -63 Put 3/52, -1/11, -0.1 in descending order. 3/52, -1/11, -0.1 Sort -1, 180, -1/9, 0.4, 0.3. -1, -1/9, 0.3, 0.4, 180 Put -0.5, -1, -11, 5, -7 in decreasing order. 5, -0.5, -1, -7, -11 Sort 3, -5, -1. -5, -1, 3 Sort 2, -3, 0, -1170 in descending order. 2, 0, -3, -1170 Sort -9, 4, -5, -3 in ascending order. -9, -5, -3, 4 Put 1, -1, 2, -12, 22 in decreasing order. 22, 2, 1, -1, -12 Sort 7, 4, 5. 4, 5, 7 Put -9, 2/15, 2/13, -6 in increasing order. -9, -6, 2/15, 2/13 Sort -49.1, 0, -4, -3/5 in ascending order. -49.1, -4, -3/5, 0 Put 3, -2/11, 0.1, -3/5 in descending order. 3, 0.1, -2/11, -3/5 Sort 1, -58, -1 in decreasing order. 1, -1, -58 Sort -5, 0, 4, 14, 24 in increasing order. -5, 0, 4, 14, 24 Put 0.01, -2/5, 9 in descending order. 9, 0.01, -2/5 Put 0.4, 4/15, 26 in decreasing order. 26, 0.4, 4/15 Sort -401, 4, -4, -3 in decreasing order. 4, -3, -4, -401 Put -5, -1, 0.146, 0.03, 1/3 in decreasing order. 1/3, 0.146, 0.03, -1, -5 Put 4, -10, -42 in ascending order. -42, -10, 4 Put -3, 13, 4, -20, -1 in increasing order. -20, -3, -1, 4, 13 Sort -4/3, 0.1, 2, 9 in increasing order. -4/3, 0.1, 2, 9 Sort 6, -1, 2, -693 in increasing order. -693, -1, 2, 6 Sort -1/4, 0.3, -2, 2.1 in increasing order. -2, -1/4, 0.3, 2.1 Put 15, 1, -7, 26 in descending order. 26, 15, 1, -7 Sort 535, -2, 5, -1 in decreasing order. 535, 5, -1, -2 Sort -5, -0.4, 4/19 in ascending order. -5, -0.4, 4/19 Sort 2/21, 1, -12. -12, 2/21, 1 Sort -936, -2/11, -0.2 in decreasing order. -2/11, -0.2, -936 Sort -0.2, 4, -42/157 in increasing order. -42/157, -0.2, 4 Sort 595, -0.3, -1/4, -2/9 in descending order. 595, -2/9, -1/4, -0.3 Sort -4, -5, -1 in increasing order. -5, -4, -1 Sort -4, 0.5, 4/3, -1 in descending order. 4/3, 0.5, -1, -4 Sort -13, 3, 6. -13, 3, 6 Sort 163/81, -2, 0.4 in increasing order. -2, 0.4, 163/81 Put -6, 0, 5, 20, -5 in decreasing order. 20, 5, 0, -5, -6 Sort 5, 7140, 3 in decreasing order. 7140, 5, 3 Put 1, -4, -144, 4, -5 in decreasing order. 4, 1, -4, -5, -144 Sort -12, 23, -4/5 in descending order. 23, -4/5, -12 Sort -3/13, -2/7, -2, 12 in ascending order. -2, -2/7, -3/13, 12 Put 1/27, -6, 34/7 in decreasing order. 34/7, 1/27, -6 Put -2, 0.265, 1 in descending order. 1, 0.265, -2 Sort -1/7, 0.28, -0.4, 2 in decreasing order. 2, 0.28, -1/7, -0.4 Put 8, 0.08, -3 in increasing order. -3, 0.08, 8 Sort 1, 796, 2 in ascending order. 1, 2, 796 Put 3, 2, -1758 in descending order. 3, 2, -1758 Put -1/2, -0.03, 0 in decreasing order. 0, -0.03, -1/2 Sort -8, -19,	{ "pile_set_name": "DM Mathematics" }
p be x(m). Suppose -z - 54 = -5n, 4z + 6 = n - p. Calculate the greatest common factor of 77 and n. 11 Let f(d) = d - 1. Let g be f(3). Suppose 4w = gw + 6. Suppose 20 = -4y, 4j - 73 = 2y - 15. Calculate the highest common divisor of j and w. 3 Suppose -35n = -36n + 12. Let x be (12)/((-4)/(-30)). Suppose -xz + 462 = -nz. What is the greatest common factor of z and 14? 14 Let x(y) = 2y - 2. Let w be x(3). Suppose j + 462 = wj. Let o be 2/(-5) - j/(-10). What is the greatest common factor of o and 30? 15 Let k(u) = -13u - 6. Let g be k(-2). Let o = -6 + 16. Calculate the highest common divisor of g and o. 10 Suppose 75 = 5f + w + 3w, f + 5w = -6. What is the highest common factor of f and 1957? 19 Let q(l) = -l*3 + 6l*2 + 3l - 9. Let m be q(6). Suppose -4n - 483 = -107. Let h = -31 - n. Calculate the highest common divisor of h and m. 9 Suppose 4y - 5r - 705 = 0, -4y = -2r - 2r - 708. Calculate the highest common factor of 45 and y. 45 Let s be (1 - 0 - 14)/(1/(-4)). Suppose -6q - 3q = -1404. What is the greatest common factor of q and s? 52 Let i be 50/(-30) + 533/39. What is the highest common divisor of 380 and i? 4 Let u be 14016/144 + 2/3. Calculate the greatest common factor of u and 294. 98 Suppose -2u + 7 = 3. Suppose d - 25 = 6d, uk + 2d = 50. What is the highest common divisor of k and 75? 15 Let u = -249 + 286. Calculate the greatest common factor of 851 and u. 37 Let h = 311 - 298. What is the highest common divisor of h and 4? 1 Let h = -60 - -46. Let l = h + 19. Calculate the highest common divisor of l and 35. 5 Let h = 51 + 399. What is the greatest common divisor of h and 270? 90 Let g be 5/4(3 + 37). Suppose -4y - y = -g. What is the highest common factor of y and 10? 10 Suppose -15w + 10w + 10 = 0. Suppose 3f - 45 = -3n, 3n + 5 = wn. What is the greatest common divisor of f and 20? 20 Suppose -3g - 19 = -5v, -11g - 3v = -9g - 19. What is the greatest common factor of g and 7? 1 Suppose -7i = -3i - 3a - 162, 0 = 4i - 5a - 158. Suppose 11 = 4q + 3. Suppose -5z - qz + 735 = 0. What is the highest common factor of i and z? 21 Let o be 2 + -3 - 103/(-6). Calculate the greatest common factor of 292 and o. 4 Suppose -v + 17 = 5g, 5v - 10 = -2g + 6. Suppose 6j + vo = 2j + 486, 2j - 2o - 234 = 0. What is the highest common divisor of j and 15? 15 Let r(y) = 87y - 848. Let l be r(10). What is the greatest common divisor of 363 and l? 11 Suppose 50 = 3g + 215. Let r = g - -91. Calculate the greatest common factor of 4 and r. 4 Suppose -2c - 55 = -3u, -3u + 114 = c + 47. What is the greatest common factor of u and 9? 3 Let i be ((-2460)/(-5))/6 - (-6)/(-3). Calculate the greatest common divisor of 460 and i. 20 Let n be 11/(-55) - (-3)/(45/183). Calculate the greatest common divisor of 768 and n. 12 Let f be (-2)/40 - -12. Suppose 3x = -3w + 678, -16x + 7w - 670 = -19x. What is the greatest common divisor of f and x? 12 Let u = 212 - 199. Let o(v) = 52v*3 + v - 1. Let f be o(1). Calculate the greatest common factor of u and f. 13 Let y(x) = 4x*2 + 20x + 13. Let s be y(-6). Calculate the greatest common factor of s and 1073. 37 Suppose 29 = 4i + w - 4, -2i - w + 17 = 0. Let r = -6 + i. Suppose rj - 4j + 174 = 4c, 3j = -9. What is the highest common factor of c and 18? 9 Let o be 576 + 1(3 + (-1 - 2)). Suppose 4m - i - o = 0, -i + 149 = m - 0m. Calculate the highest common divisor of 58 and m. 29 Suppose -3g = -0g - 111. Let i = 387 + -250. Suppose 0 = 4x + g - i. What is the greatest common divisor of x and 10? 5 Suppose 5z - 358 = -2d, -d + 5d = 2z - 148. Calculate the highest common factor of z and 90. 18 Let g be 858/(-18)(5 + -8). What is the greatest common factor of g and 11? 11 Suppose -31 = -4y + 5. Suppose -y = -i - 0. Let x(n) = 3n2 - 12n + 36. Let m be x(6). Calculate the highest common divisor of i and m. 9 Let i(b) = -b*2 + 28b + 60. Let t be i(24). What is the greatest common factor of 117 and t? 39 Let k(w) = w3 + w2 - 2w + 2. Let u be k(-4). Let q be 126 - 9/(2 - -1). Let g = u + q. What is the highest common divisor of g and 248? 31 Suppose 0 = -2m - u - 20 + 55, -2u + 6 = 0. Calculate the highest common factor of m and 48. 16 Let u be 4 + 54/((-9)/3). Let x = u - -22. What is the highest common divisor of x and 56? 8 Let d = 2135 - 2117. What is the highest common divisor of d and 138? 6 Suppose 0 = f - 4f - 45. Let m = f - -26. Let u = -13 + 24. Calculate the highest common divisor of m and u. 11 Suppose -s - 4s + 80 = -4y, 4y + s = -56. Let n be (-10)/y + (-313)/(-3). What is the highest common factor of n and 21? 21 Let m be 170/(-30) + (-1)/3. Let q be 2/3m/(-4). What is the highest common factor of 9 and q? 1 Let x(k) = k2 + 10k + 4. Let j be x(-16). Suppose 0 = 12r + 16 - j. What is the greatest common divisor of 42 and r? 7 Suppose 3i + 122 = 2q, 72q - 76q + 2i + 236 = 0. Calculate the greatest common factor of q and 10. 2 Let q(u) = -u + 9. Let j be q(7). Suppose 3y - 23 = -5i + jy, 0 = -i + 2y - 2. Calculate the highest common divisor of 2 and i. 2 Suppose -u = -8p + 4p - 78, -u + 3p = -74. Suppose o = 2a - u, -4a + 0a + 134 = 3o. Let d = 150 - 22. What is the greatest common factor of a and d? 32 Suppose -2q = -0q - 6. Let f be -1 + q/(-1) + 0. Let g be ((-54)/15)/(f/10). Calculate the greatest common divisor of 54 and g. 9 Let d = 121 - 112. Let g be 109 + d(-2)/(-6). What is the highest common divisor of 28 and g? 28 Let x = -352 - -601. Calculate the highest common factor of x and 83. 83 Let o(h) = -13h - 1. Let y(j) = j2 - 1. Let x be y(0). Let a be o(x). Let z = 5193 + -5085. What is the highest common divisor of z and a? 12 Let i(r) = -3r*2 + 4r - 8r + 7r*2. Let u be i(-4). Calculate the greatest common divisor of 16 and u. 16 Let l(j) = 11j + 157. Let b be l(17). What is the highest common divisor of 8 and b? 8 Let f = -12 + 15. Suppose -ft = -4q - 44, 2t - 6t - 5q + 69 = 0. Let u(l) = 7l - 22. Let y be u(10). Calculate the highest common divisor of y and t. 16 Suppose -5c + 29 + 91 = 0. Suppose 3 = -2d + 2t + 3t, 5d - c = 2t. Calculate the greatest common factor of 102 and d. 6 Let y = 7 - 0. Let z(h) = -5h2 + h - 6. Let c(q) = -4q*2 - 5. Let s(m) = -3c(m) + 2z(m). Let u be s(-6). Calculate the highest common divisor of y and u. 7 Let g be (12/2)/(-6 + 8). Let x(h) = 11h - 7. Let l be x(g). What is the greatest common factor of l and 39? 13 Let m(n) = -15n + 3. Let y be m(-9). Suppose -3o + 2z = -2z - 18, 2z + 30 = 5o. What is the highest common divisor of o and y? 6 Let t be 1135 - (38 + -37). What is the greatest common divisor of t and 737? 67 Let b(z) = -65z - 18. Let j be b(-2). What is the greatest common factor of 21 and j? 7 Let x(u) = u*2 + 20u + 2. Let z be x(-20). Suppose -d + 27 = zd. Calculate the highest common divisor of d and 81. 9 Let i be 2/8 + (-363)/12. Let m = 16 + i. Let o be (-6)/m + 67/7. What is the greatest common factor of o and 80? 10 Let s be ((-60)/8)/((-24)/16). Calculate the greatest common divisor of s and 10. 5 Let v(t) = -2t - 9. Let n be v(-7). Suppose 0 + 15 = no. Suppose oj + j - 24 = 0. What is the greatest common divisor of 54 and j? 6 Let y = -1341 - -2580. What is the greatest common divisor of 7 and y? 7 Let o(y) = 26y - 46. Let z be o(3). What is the greatest common divisor of 928 and z? 32 Suppose -5b + 28 - 233 = -4l, 0 = 2l + 2b - 98. Calculate the highest common factor of l and 850. 50 Let f be 6/(-9)(-19 + 1). Let s be -134/f. Let q(w) = -16w3 + w2 + w. Let u be q(s). What is the highest common factor of 112 and u? 16 Let y(u) = 9u*2 - 24u - 31 - 10u2 + 3. Let t be y(-21). Calculate the highest common factor of 10 and t. 5 Let h = -1601 - -1609. Calculate the highest common divisor of h and 100. 4 Let t(b) = -25b + 612. Let w be t(24). What is the greatest common factor of w and 69? 3 Let g be (-67)/(-268) + 1(-3)/(-4). What is the highest common divisor of 37 and g? 1 Let t be (44/(-121))/2 - (-49504)/22. Calculate the highest common factor of t and 50. 50 Let c(y) = 4y*2 - 3y - 1. Let j be c(3). Suppose 13a - 12a = j. Suppose 5*v - 275 = 50.	{ "pile_set_name": "DM Mathematics" }
9911 = -358911. What is r rounded to the nearest 10000? -110000 Let s be (8/2 - 4)/(-2). Suppose d = -2 + 7, s = -3v - 5d - 1895. Round v to the nearest 100. -600 Let y = -157023393 - -157023392.717340774. Let u = -37.717340094 + y. Let i = 38 + u. Round i to seven decimal places. 0.0000007 Suppose 1908000 = -3d + 4y, 0 = d - 3y + 755610 - 119610. Round d to the nearest one hundred thousand. -600000 Let r = -6448.57 - -6374. Let f = 74.009 + -0.009. Let x = f + r. Round x to 1 decimal place. -0.6 Let c = 0.15925 + -0.28918. Let w = c - -0.13. What is w rounded to five dps? 0.00007 Let y = -0.01 - -0.13. Let a = y + -8.12. Let r = 7.9994 + a. What is r rounded to three decimal places? -0.001 Suppose 0 = -3l + 4l + 5j - 3920, -j = -4. Round l to the nearest one thousand. 4000 Let z = -185.57 - -184. What is z rounded to 1 dp? -1.6 Let u = -66 + 65.98. Let b = -0.2565 + 0.24. Let x = u - b. Round x to 3 decimal places. -0.004 Let b be (-2 - -1)/((-2)/(-2)). What is b rounded to the nearest integer? -1 Suppose -52406 = 2h - 3y, 0h - 3y - 78594 = 3h. Round h to the nearest 1000. -26000 Let m = 1 - -1. Suppose -3b - my - 6 = 0, b + 9 = 5b - 3y. What is b rounded to the nearest 10000? 0 Let q = 103246.7035 - 103330.1418006. Let r = -83.5083 - q. Let w = -0.07 - r. Round w to seven dps. -0.0000006 Suppose 6o - 36 = 3o. Suppose -5y = -g - 13, 0 = g - 5g - o. Suppose 0 = -yn - 0n. Round n to one dp. 0 Let h(n) = 46n*2 - 3n + 6. Let r be h(4). What is r rounded to the nearest 100? 700 Let b(n) = 4n2 + 7n + 2. Let l be b(-3). Round l to the nearest 10. 20 Suppose -5y = -12y. Suppose -2h - 3h = -150. Suppose yp + 3p + h = 0. Round p to the nearest 100. 0 Suppose x + 0x - 1400 = 0. Suppose -x + 10096 = -l. Let v = l - -5096. What is v rounded to the nearest 1000? -4000 Let h = -0.047 + -85.953. Let d = 86.081 + h. What is d rounded to 2 decimal places? 0.08 Let i = -21 - -14. Let b = 7.0003 + i. What is b rounded to 3 dps? 0 Let u = -33.99976 + 34. What is u rounded to 5 dps? 0.00024 Let f = -60246 - -60295.0118. Let o = -49 + f. What is o rounded to 3 dps? 0.012 Let c = 1145427.2299777 - 1145427. Let g = -0.23 + c. What is g rounded to six decimal places? -0.000022 Let i = 3762 + -1626. Suppose 2o + i = 476. What is o rounded to the nearest one hundred? -800 Let w(l) = 4l + 11. Let a(m) = -3m - 10. Let i(c) = 6a(c) + 5w(c). Let q be i(4). Suppose p - 400 = qp. What is p rounded to the nearest 100? -200 Suppose 2i = 17957146 + 27642854. Suppose 0 = p + 2p - i. Round p to the nearest 1000000. 8000000 Let k(a) = -a3 + 2a*2 + 2. Let n be k(-6). What is n rounded to the nearest 100? 300 Suppose -n = -4, 10080 + 380 = -2h - 4n. Let u = 47254 + h. Suppose -2t + 0z + u = -4z, 0 = 5t + 4z - 104984. Round t to the nearest 10000. 20000 Let h = -115626 + 115626.0500003. Let t = 1 - 1.05. Let i = h + t. Round i to 7 decimal places. 0.0000003 Suppose 5z - 3z = -5i + 22, -2i - 5z = 8. Suppose 4n - i = -2. Round n to 0 decimal places. 1 Let i be (-51)/(-68) - 91994/(-8). What is i rounded to the nearest one thousand? 12000 Let w(b) = 13b + 42. Let a be w(-32). What is a rounded to the nearest 10? -370 Let b = 791 - 791.000000753. What is b rounded to 7 dps? -0.0000008 Let v = -3.9 - -4.075. Round v to two decimal places. 0.18 Let w = 22 - 22.022. Let k = w - -0.02221. Round k to 4 decimal places. 0.0002 Let b be 42/35 - 1/5. Let t(z) = -1020001z3 + z2. Let x be t(b). Round x to the nearest one hundred thousand. -1000000 Let u be 1 - (-28)/12-3. Let j(c) = -419c*2 + 3c + 2. Let r be j(u). Round r to the nearest one thousand. -15000 Let i = 975 - 1460. Let l = 245 + i. What is l rounded to the nearest 100? -200 Let s = -3.71 - -3.6949. Round s to three dps. -0.015 Let x = 4 + 2. Let i = x + 4. Let f = i - 10.00072. What is f rounded to four dps? -0.0007 Let d = 15828364 - 15828364.8000009. Let l = d + 0.8. What is l rounded to six decimal places? -0.000001 Let t(o) = -96135o - 1. Let g be t(-5). Suppose 4w + 3q = -4842708, -5q = 13 + 7. Let u = g + w. Round u to the nearest one hundred thousand. -700000 Let n(x) be the first derivative of 115x4/2 - 10x*3/3 - 3x*2 + 4x - 4. Let s be n(-6). Round s to the nearest 100000. -100000 Let c = 0.933 + -0.033. What is c rounded to 0 dps? 1 Let r = -88491111 + 88486021.709955. Let d = 5099.29 + r. Let g = 10 - d. What is g rounded to 5 decimal places? 0.00005 Let j = 7 - 7.000073. What is j rounded to 5 dps? -0.00007 Let b = -5 - -8. Let k be (-6 - -6)/(-1 + -1). Suppose 2q - 5l - 2380 = k, bq = -q - 4l + 4816. What is q rounded to the nearest 100? 1200 Let z = 74.62 + -10.32. Let q = 45 - z. What is q rounded to the nearest integer? -19 Let n = 532048 - 755756. Let r = -223838.111 - n. Let a = -130 - r. What is a rounded to two decimal places? 0.11 Let b = -1.2 + 1.218. Let f = 0.05 + b. What is f rounded to two decimal places? 0.07 Let r be (-4)/6 + (-728)/24. Let j = 281 + r. Round j to the nearest 10. 250 Let f = -1.05 - -1.0499927. Round f to six decimal places. -0.000007 Let x = 25 + -24.9999977. Round x to six dps. 0.000002 Let p = 120.695 - 121. What is p rounded to 2 decimal places? -0.31 Let z be (-25)/(1 - 3). Let w be 3/3 - -2259. Suppose -zo + u + w = 3u, 3o - 2u - 305 = 0. Round o to the nearest 10. 100 Suppose -v = v. Let z = v + 6. Suppose 4d - zd + 2080 = 0. Round d to the nearest one hundred. 1000 Let k = -3 - -4. Let g = 1 - k. Let h = g + -0.000015. What is h rounded to 5 decimal places? -0.00002 Let i = -10157903.96333 + 10157420.7. Let j = 482.96332989 + i. Let z = 0.3 + j. What is z rounded to seven decimal places? -0.0000001 Let z = -677.81 - -664.81007. Let q = 0.9 + -13.9. Let u = q - z. Round u to 4 decimal places. -0.0001 Let q = 5 - 3. Suppose qb = 3b + 76000. What is b rounded to the nearest ten thousand? -80000 Suppose 2 = 3q - 13. Suppose -3a = -qa + 4400. What is a rounded to the nearest 1000? 2000 Suppose 2y = -0y + 18. Suppose -5 + 4 = l. Let d be l/3 - 539997/y. Round d to the nearest ten thousand. -60000 Let i = -89 + 88.99999917. What is i rounded to 7 dps? -0.0000008 Let k be 18654/7(0 + 8659). Suppose 0 = 2z - k - 33314304. Let f = 19494651 - z. Round f to the nearest 1000000. -9000000 Suppose 0t + t - 5d + 55 = 0, 5t + 135 = -3d. What is t rounded to the nearest 10? -30 Let p = -0.8 - -1.4. Let g = p + -0.1. Let s = g + -0.3. What is s rounded to the nearest integer? 0 Let n = -1.78 - -1.7721. What is n rounded to three decimal places? -0.008 Let h = -56843 + 98488. Suppose -a = 5z + 1670 - h, 0 = -3z - 15. What is a rounded to the nearest one hundred thousand? 0 Suppose 4f + 0y = -5y + 11409359, -5704677 = -2f - 3y. Suppose -f + 52346 = 4k. Round k to the nearest one million. -1000000 Let v = -12565189 - -6844329. Let r = -2620860 - v. What is r rounded to the nearest 1000000? 3000000 Let h = 10 + -7. Suppose -4n + 3z = 243, -66 = -hn - 5z - 270. Round n to the nearest ten. -60 Let z = 1.7 + -1.725. Let m = z - -0.555. Round m to one dp. 0.5 Let t = -0.11187 + -5.67793. Let s = 32 - 26.2. Let a = s + t. What is a rounded to three decimal places? 0.01 Let q = 596.22 - 590. Let p = q - 7.9. Let y = p - -1.6799911. Round y to 6 decimal places. -0.000009 Let i = 4 + -15. Let z = i + 10.9999999. Round z to 7 dps. -0.0000001 Let c = 0.04 + 0.12. Round c to one dp. 0.2 Let p = -7 + 11. Suppose -pq + 3j = 4446, 2j + 837 = -q - 269. What is q rounded to the nearest 100? -1100 Let g(s) = -s*2 - s + 652000. Let p be g(0). Suppose 7i = 3i + p. What is i rounded to the nearest 10000? 160000 Let u = -15.88 - -0.28. Let i = u + 14. Let v = i + 1. What is v rounded to zero decimal places? -1 Let c = -43.07 - -43. Let a = -0.02 + -0.07. Let o = c + a. Round o to 1 decimal place. -0.2 Let t = 5.7 + 1.8. Let r = t + -9. Round r to the nearest integer. -2 Suppose -v - 16 = -2w - 2v, 3v = 4w - 12. Let o(b) = 2b - 7. Let a be o(w). Suppose 2y + ai - 11215 = 6y, 4i = 3y + 8412. Round y to the nearest 1000. -3000 Let h = -43 - -13. What is h rounded to the nearest 10? -30 Let g = -0.101 + -0.113. Round g to 2 dps. -0.21 Suppose 2y + 102000 = -0*y. What is y rounded to the near	{ "pile_set_name": "DM Mathematics" }
19, 43, 103, 217, 403? 679 What comes next: -16, 57, 130? 203 What comes next: 2675, 5348, 8021, 10694, 13367, 16040? 18713 What is the next term in 2029, 2025, 2019, 2011, 2001? 1989 What comes next: -1, -19, -45, -85, -145, -231, -349? -505 What comes next: -100, -43, 52, 185, 356, 565? 812 What comes next: -1813, -1812, -1811, -1810, -1809, -1808? -1807 What is the next term in 9, 2, -7, -18, -31? -46 What is the next term in -81, -165, -249, -333, -417, -501? -585 What is the next term in 347, 1389, 3127, 5561, 8691, 12517, 17039? 22257 What comes next: 11209, 11208, 11207, 11206? 11205 What is the next term in -12, -71, -170, -309? -488 What comes next: -108, -176, -244, -312, -380, -448? -516 What is next in 31, 47, 81, 139, 227, 351? 517 What is the next term in -13, -28, -43, -58, -73, -88? -103 What comes next: 3, 200, 541, 1032, 1679? 2488 What comes next: 19, 9, -1, -11, -21, -31? -41 What is next in -50, -33, -2, 49, 126, 235, 382? 573 What comes next: 20, 12, -2, -16, -24, -20? 2 What is the next term in -521, -465, -409, -353, -297? -241 What is next in 4, 45, 158, 379, 744? 1289 What is next in -94, -186, -278, -370, -462, -554? -646 What is next in -202, -406, -610, -814? -1018 What is the next term in -2400, -2408, -2416, -2424, -2432, -2440? -2448 What is the next term in 50, 103, 156, 209, 262? 315 What comes next: -39, -56, -45, -6, 61, 156? 279 What comes next: -12762, -25523, -38284? -51045 What comes next: -64, -65, -66, -67? -68 What is the next term in 238, 487, 738, 991, 1246? 1503 What comes next: -82, -156, -226, -292, -354, -412? -466 What comes next: 597, 1246, 1905, 2580, 3277, 4002? 4761 What is the next term in -941, -1880, -2819? -3758 What is the next term in 47, 188, 439, 812, 1319, 1972, 2783, 3764? 4927 What comes next: -3309, -3310, -3311? -3312 What is the next term in 924, 936, 962, 1008, 1080, 1184? 1326 What is next in -32, -34, -36, -38, -40, -42? -44 What is next in -13562, -13563, -13564? -13565 What comes next: 7, -8, -39, -92, -173, -288? -443 What is next in 49, 44, 37, 28? 17 What is the next term in 29, 171, 555, 1301, 2529? 4359 What is the next term in -32, -27, -18, -5, 12, 33, 58? 87 What comes next: -21, -42, -75, -126, -201, -306? -447 What is the next term in -6, -15, -30, -51? -78 What is next in 28, 25, 14, -11, -56, -127, -230, -371? -556 What is the next term in -130, -121, -112? -103 What is next in 1617, 1618, 1619, 1620, 1621, 1622? 1623 What is the next term in -1787, -3591, -5395, -7199? -9003 What is the next term in 27, 162, 387, 702? 1107 What is the next term in -10, 5, 34, 77, 134, 205? 290 What is the next term in 3, 23, 69, 153, 287, 483, 753, 1109? 1563 What is the next term in 13, -69, -151? -233 What is the next term in 134, 273, 412, 551, 690? 829 What is the next term in 79, 161, 239, 313, 383, 449, 511? 569 What is next in -12, 14, 56, 114, 188? 278 What is next in 3399, 6799, 10199? 13599 What is next in 43, 49, 57, 67, 79, 93, 109? 127 What is next in 14, 33, 74, 143, 246, 389, 578, 819? 1118 What comes next: -43, -45, -47, -49, -51? -53 What is next in 32, 24, 12, -4, -24? -48 What comes next: 12, 21, 24, 21? 12 What is next in -184, -381, -578? -775 What is the next term in -812, -1575, -2338, -3101? -3864 What comes next: 6, 29, 60, 99? 146 What comes next: 9, 1, -7? -15 What comes next: 5, 60, 213, 512, 1005, 1740, 2765, 4128? 5877 What is next in -14, 6, 62, 172, 354, 626, 1006? 1512 What comes next: -65, -141, -231, -341, -477, -645, -851, -1101? -1401 What is next in 7, 39, 95, 175, 279, 407? 559 What is the next term in -212, -847, -1906, -3389, -5296, -7627? -10382 What is next in -12, -44, -104, -198, -332, -512, -744? -1034 What comes next: 67, 60, 53? 46 What comes next: 5, 4, 9, 26, 61, 120, 209? 334 What comes next: -24, -114, -270, -498, -804, -1194, -1674? -2250 What is next in 193, 191, 189? 187 What comes next: -52, -75, -114, -169? -240 What comes next: -163, -153, -143, -133? -123 What is the next term in -7, -38, -79, -136, -215, -322, -463? -644 What is next in 98, 94, 88, 80, 70, 58, 44? 28 What comes next: 17765, 35544, 53337, 71150, 88989, 106860? 124769 What is the next term in 248, 497, 746? 995 What is next in 44, 93, 152, 227, 324, 449? 608 What is the next term in 64, 57, 36, -5, -72, -171, -308, -489? -720 What comes next: -42, -37, -32, -27? -22 What comes next: -532, -531, -538, -559, -600, -667? -766 What comes next: 35, 41, 51, 65, 83, 105, 131? 161 What is next in -26, -55, -86, -119, -154, -191, -230? -271 What comes next: 17, -41, -127, -247, -407, -613, -871, -1187? -1567 What is next in 3, 4, 5, 6? 7 What is next in 8, 7, -14, -67, -164, -317, -538, -839? -1232 What is the next term in 7, 1, -7, -17, -29? -43 What comes next: -32, -99, -212, -371, -576, -827? -1124 What is the next term in 293, 288, 279, 266? 249 What is next in 254, 252, 240, 212, 162? 84 What comes next: -5, -12, -21, -32? -45 What is the next term in -30, -53, -76? -99 What is next in 382, 760, 1140, 1522? 1906 What is next in -156, -310, -464? -618 What is the next term in -218, -242, -264, -284, -302, -318, -332? -344 What is next in -83, -102, -157, -266, -447, -718, -1097, -1602? -2251 What is next in 2520, 2521, 2522, 2523, 2524? 2525 What is the next term in 15, 13, 13, 15, 19, 25, 33? 43 What is next in -14, -40, -82, -140, -214, -304, -410? -532 What comes next: -417, -414, -399, -366, -309, -222, -99, 66? 279 What comes next: -213, -460, -707, -954, -1201? -1448 What is next in 85, 328, 733, 1300, 2029, 2920, 3973? 5188 What is the next term in 5065, 10128, 15191, 20254, 25317? 30380 What is the next term in -50, -65, -76, -83, -86, -85? -80 What is next in -178, -181, -172, -145, -94, -13, 104? 263 What comes next: 28, -6, -44, -86, -132? -182 What comes next: -12, -16, -16, -12, -4, 8, 24? 44 What is next in 109, 43, -49, -179, -359, -601, -917? -1319 What is the next term in 390, 391, 392, 393, 394? 395 What is next in 93, 54, 15, -24, -63? -102 What comes next: 114, 113, 112, 111, 110, 109? 108 What comes next: 233, 213, 181, 137, 81, 13? -67 What is the next term in -3140, -3147, -3154, -3161? -3168 What is the next term in 2991, 2995, 3001, 3009? 3019 What is the next term in 205, 380, 561, 748, 941? 1140 What is the next term in 70, 260, 576, 1018, 1586, 2280, 3100? 4046 What comes next: -42, -72, -106, -144, -186, -232? -282 What is the next term in 14, 43, 74, 107, 142? 179 What comes next: 11, -3, -17, -31, -45? -59 What comes next: 26, 11, -16, -55? -106 What comes next: 400, 295, 182, 55, -92? -265 What is next in -165, -168, -173, -180, -189? -200 What comes next: -26, -43, -74, -125, -202, -311, -458? -649 What is the next term in 9, 5, -11, -45, -103, -191, -315, -481? -695 What is next in -3383, -3382, -3381, -3380, -3379, -3378? -3377 What comes next: 12, 24, 48, 90, 156, 252, 384, 558? 780 What is the next term in 322, 321, 320, 319, 318, 317? 316 What comes next: -6, -6, -4, 0, 6, 14, 24? 36 What is the next term in 1936, 1929, 1922, 1915, 1908, 1901? 1894 What comes next: 1, 53, 107, 163, 221, 281? 343 What comes next: 120, 121, 122, 123? 124 What is the next term in 221, 441, 661? 881 What is next in 37, 42, 47, 52, 57? 62 What is the next term in 1, -45, -173, -425, -843, -1469, -2345? -3513 What is next in -377, -371, -365? -359 What comes next: 963, 958, 949, 936? 919 What comes next: 44, 90, 136, 182? 228 What comes next: -35, -27, -29, -47, -87, -155, -257, -399? -587 What is next in -46, -115, -224, -367, -538, -731? -940 What comes next: -539, -544, -545, -542, -535, -524? -509 What comes next: 29, 72, 131, 206, 297? 404 What is next in 891, 1781, 2671? 3561 What is the next term in 692, 694, 696? 698 What is next in 26, 73, 148, 251, 382? 541 What is the next term in 38, 76, 114, 152, 190? 228 What is next in 11, 19, 23, 23? 19 What is the next term in -2614, -2619, -2626, -2635? -2646 What is next in 13, 15, 7, -17, -63? -137 What is the next term in 10, 35, 98, 217, 410? 695 What comes next: -723, -721, -707, -675, -619, -533? -411 What comes next: -942, -1891, -2840, -3789? -4738 What is next in -2, 19, 42, 67? 94 What is next in -614, -621, -630, -641, -654, -669, -686? -705 What is next in 79, 144, 185, 19	{ "pile_set_name": "DM Mathematics" }
(12/(-6)). 1/2 What is -5(-6)/((90/4)/(-3))? -4 What is 4/322/132? 2/9 What is (-3)/(-27)(-54)/6? -1 What is (12/(-10))/3(-30)/3? 4 What is 2/(42/7)(-3)/4? -1/4 Evaluate ((-132)/55)/(4/10). -6 Evaluate ((-2)/20-3)/(42/56). 2/5 Evaluate (10/3)/(2/3). 5 What is the value of 45/18918/15? 2/7 Calculate 50/(-75)6/(-8). 1/2 Evaluate -315/54(-4)/(-4). -5/6 36/21(-2)/81 -3/7 What is ((-2)/4)/(2/16)? -4 (-16)/(-12)-2(-18)/(-8) -6 Calculate 20/(-8)13/(-15). 1/2 What is 64/704(-4)/(-2)? 2/11 What is the value of (4/(-2))/(8/16)? -4 Evaluate (3/((-6)/(-2)))/((-36)/(-252)). 7 Calculate ((-1)/(-2))/(6/8). 2/3 What is ((-99)/77)/3(-6)/(-9)? -2/7 Calculate 132/(-4)2/4. -4 What is (-2)/((-72)/(90/10))? 1/4 Calculate (117/(-18))/1312/10. -3/5 Calculate (-3)/(-24)282. 7 Evaluate (-4)/3(-42)/14. 4 What is the value of (2/38)/((-4)/(-24)-3)? -2/19 What is the value of -15(-12)/(-9)1/(-4)? 5 What is the value of (6/(-36))/(1/(-2)-1)? -1/3 ((-8)/10)/(54/405) -6 What is the value of (-2)/(26/(-3))? 1/2 (5/(-15))/((-21)/189) 3 Calculate 20/4(-18)/202. -9 What is 1/((8/(-12))/2)? -3 What is the value of (16/24)/((-20)/15)? -1/2 Calculate ((-52)/(-715))/((24/15)/(-4)). -2/11 What is 9/(-207)(-2)/(-1)? -2/23 What is 2/(4/(-1))0/23? 0 Evaluate (-2)/318/(-30). 2/5 ((-4)/(312/(-13)))/(1/(-4)) -2/3 Calculate (-5)/((-30)/8)(-15)/(-170). 2/17 (-2)/(((-6)/(-9))/1) -3 What is the value of 112/124828/(-49)? -2/39 What is 5/(70/21)2-1? -3 (-6)/2855(-8)/8 2/19 (-6)/((46/(-115))/((-2)/(-5))) 6 Evaluate 15/(-35)(-77)/3. 11 Evaluate ((-20)/4-1)/1. 5 What is the value of ((-19)/(-399))/(1/(-9))? -3/7 Calculate 2/((-6)/(-15))(-10)/(-10). 5 What is the value of (-7)/(-7)(-15)/15? -1 Evaluate (9/(-3))/(6/14). -7 What is the value of (3/25)/(1/((-45)/9))? -3/5 What is (8/10)/(3(-8)/180)? -6 (((-24)/9)/(-4))/(8/(-36)) -3 What is (-1)/5-6(-20)/192? -1/8 ((-5)/5)/((28/(-16))/7) 4 Calculate 2/(-8)1/2. -1/8 What is the value of (27/(-36))/(6/(-72))? 9 Calculate (14/(-42))/(5/(-3)). 1/5 What is the value of 21/(-70)65? -9 What is 2/(1/99)? 2 (6/60)/((-1)/(-1)) 1/10 -3(42/18)/(-7) 1 What is -5(-4)/806/(-4)? -3/8 Evaluate 53/(-90)8. -4/3 Calculate (-30)/(-24)-22/1. -5 Calculate (-220)/15(-84)/(-112). -11 Evaluate 0/((-7)/216). 0 What is (-2)/6-630/12? 5 What is (-5)/(-110)4/1? 2/11 Evaluate (8/14)/(1/7). 4 What is (-4)/(((-48)/18)/(-8)-2)? 6 Calculate (6/60)/((-10)/40). -2/5 What is (-104)/(-156)(-3)/(-2)? 1 Evaluate (3(-1)/2)/(18/6). -1/2 Evaluate (7/63)/((-2)/(-6)). 1/3 What is (4(-5)/150)/(20/25)? -1/6 Calculate -5(-9)/676/95. 6 Calculate -5120/(-500). 1/5 What is the value of -3(-7)/105(-5)/2? -1/2 Calculate 5/2010-2. -5 (-13)/((-26)/10)4/5 4 Evaluate -1((-30)/(-51))/(-5). 2/17 Calculate 5-61/(-36). 5/6 What is ((-2)/14)/((-2)/14)? 1 What is the value of ((-4)/6)/(-2(-5)/(-6))? 2/5 What is (756/(-567))/(-2(-10)/12)? -4/5 Evaluate -1(-2)/(-2)(-11)/154. 1/14 What is the value of 8(135/36)/15? 2 What is 9/1(77/7)/(-231)? -3/7 What is the value of 2((-81)/6)/9? -3 (14/(-2))/(3(-2)/(-6)) -7 10/51/((-20)/4) -2/5 Evaluate (69/23)/(7/((-14)/(-4))). 3/2 What is 7/(-3)(-600)/840? 5/3 (5/14)/5(-28)/7 -2/7 Calculate (5/3)/(-1)18/(-40). 3/4 What is 13-3(-4)/12? 3 What is the value of ((-60)/126)/(12/(-36))7? 10 What is 6/2(-225)/135? -5 What is ((8/(-12))/((-4)/(-4)))/(-1)? 2/3 Evaluate (12(-9)/24)/(-15). 3/10 Calculate (12/(-15))/(68/(-170)). 2 ((-18)/(-4))/(8/((-48)/(-9))) 3 Calculate -15((-24)/30)/(-2). -6 Calculate (16/36)/(23/207). 4 (-28)/(504/243)(-4)/(-6) -9 3/(-126)612 -2/7 What is 2/(-24)463? -6 (40/(-350))/(23/15) -2/7 Calculate -3(-2)/(6/(-5)). -5 (-90)/152/(-12) 1 (-3)/(-4)(-4)/6 -1/2 What is (-4)/(-8)-38/(-12)? 1 What is the value of -51(-9)/30? 3/2 Evaluate 3((-1)/(-4))/(20/16). 3/5 What is 2-1(-57)/(-38)? -3 Evaluate 5/(45/(-2))(-39)/(-13). -2/3 What is the value of 2/131/(-6)? -1 Calculate (-11)/((-539)/(-28))14/44. -2/11 (3/214)/2 2/7 What is the value of -3(-1)/18(-198)/88? -3/8 What is -21/(-1)8/12? 4/3 Calculate (2/(-4))/((-87)/(-58)). -1/3 What is ((-54)/(-72))/((-2)/(32/(-12)))? 1 Evaluate (-36)/275/(-70). 2/21 (-7)/35(-1)/((-1)/(-4)) 4/5 What is -620/2(-5)/(-60)? -5 ((-3)/(-9))/(15/(-45)) -1 Evaluate (4/6)/((-13)/(-39)). 2 4/((2/4)/(25/20)) 10 Calculate (-2)/(-4)((-72)/6)/4. -3/2 What is the value of ((6/5)/(-1))/(12/40)? -4 What is the value of (162/486)/((-1)/15)? -5 What is the value of (4/(-16))/(6/48)? -2 What is 3/(-18)(-141)/(-94)? -1/4 What is the value of (-1)/(-2)(-384)/32? -6 Evaluate -37/(-14)6/33. 3/11 What is ((-8)/(-8))/((-2)/2)? -1 1(-4)/33(-84)/(-56) -2/11 What is 4/6(-99)/(99/(-9))? 6 What is 232/87(-6)/8? -2 6/(-24)14/(-3) 1/3 What is ((-14)/2)/((-2)/(-14)7)? -7 Evaluate -22/104(-32)/(-8). -2/13 What is the value of 14/(-2)(-77)/22? 7 Evaluate -1(-20)/(-28)7. -5 What is ((-9)/63)/((-2)/4)1? 2/7 Evaluate 1(98/7)/(-7)1. -2 (-8)/4(-5)/(-30) -1/3 ((-1)/9)/(128/768) -2/3 104/13(-10)/(-16) 5 What is the value of (-9)/5415/10? -1/4 What is the value of ((-3)/(-6))/(5/50)? 5 Calculate -26/(24/10). -5 What is the value of ((-4)/(-110))/((85/(-25))/17)? -2/11 18/273/1 2 Calculate 8/(4/1)-2. -4 What is ((-6)/((-7)/7))/(-14)? -3/7 What is the value of (5(-22)/825)/(2/(-9))? 3/5 (-4)/312/88 -2/11 Evaluate 31/(-124)(-4)/1. 1 What is the value of (-128)/(-80)(-10)/(-4)? 4 (9/12)/(3/(-2)) -1/2 What is (-60)/(-16)80/60? 5 What is (-8)/(-44)33/(-6)? -1 What is the value of ((40/(-12))/(-1))/(1/(-3))? -10 Evaluate ((-5)/4)/((-102)/(-408)). -5 (-3)/(-20)2(-6)/18 -1/10 Calculate ((-1)/(-1))/(-14/2). -1/2 What is the value of 317(-4)/28? -3 What is ((-2)/(-8))/((-98)/(-224))? 4/7 What is the value of (1/5)/((-7)/(630/(-6)))? 3 Evaluate 5/(-15)9/(-6)2. 1 What is the value of ((-12)/(-10))/(48/120)? 3 Calculate (-1(-6)/15)/(16/60). 3/2 Evaluate -3-18/12. 2 What is the value of ((-276)/184)/(2/(-16)3)? 4 What is (8/144)/(18/216)? 2/3 (-21)/(-1)2/1 4 2(4/(-10))/(52/10) -2/13 Evaluate -12-1(-1317)/(-878). 3 Evaluate (-8)/2821/(-24). 1/4 What is (56/(-10))/(-7)(-10)/(-52)? 2/13 What is 12/21(-2)/(40/70)? -2 What is 6/99/(-12)6? -3 Evaluate (-16)/12(-75)/20. 5 Calculate ((-21)/(-28)2)/2. 3/4 Calculate -2(-1)/2842. 4/7 Calculate (196/(-14))/281-1. 1/2 Evaluate (-2)/(-12)(-21)/(-35)5. 1/2 ((-2)/(-2))/((-4)/12) -3 ((-5)/5)/(6/24) -4 What is the value of 8/8(-25)/(-5)? 5 Calculate (2/(-3)-6)/4. 1 Evaluate ((-32)/(-20))/(-2)15/2. -6 Evaluate (9/6)/(12/(-48))-1. 6 ((-41)/(-41))/((-9)/2) -2/9 Calculate 1/1(0/4)/6. 0 -27/(-315)5 2/9 (-2)/3(108/(-30))/6 2/5 (-94)/476/(-2) 6 What is the value of (7/(-7))/((4/(-14))/2)? 7 What is the value of (-15)/(-20)3/(-3)? -3/4 -2((-72)/32)/(-3)-2 3 (-160)/603/36 -2/9 Evaluate (-16)/8(-4)/(-4). -2 Evaluate 15/6-628/105. -4 Calculate ((-56)/(-5))/(-2). -3 Calculate (14/7)/((-16)/(-24)). 3 What is (48/2)/(-8)-1-1? -3 What is the value of ((-6)/15)/((-2)/10)1? 2 Evaluate 10/3(-102)/(-425). 4/5 Calculate ((-3)/15)/(((-84)/(-20))/(-7)). 1/3 (-2)/((-6)/(-10)5) -2/3 Calculate 10/2(-44)/(-55). 4 (80/(-32))/((-3)/(-6)) -5 2/3612/16 3 Calculate (16/14)/((-30)/15). -4/7 (2/(-104))/((-8)/(-32)) -1/13 4/(-5)1(-25)/230 2/23 Calculate -7((-48)/8)/(-6). -7 Calculate 18/54(-5)/(15/(-2)). 2/9 What is the value of -6((20/(-2))/5)/2? 6 (104/39)/(4/6) 4 Evaluate (77/(-714))/(-11)12. 2/17 What is the value of (6/15)/((-4)/5)? -1/2 Evaluate (-4)/6-1(-1)/3. -2/9 Evaluate 12/15235/(-94). -2 Evaluate ((-3)/27-3)/(12/(-16)). -4/9 Evaluate 10/(-12)(-48)/(-30). -4/3 What is (-3(-4)/36)/(3/(-72))? -8 What is the value of (-3)/(-5)2/(-12)? -1/10 Evaluate ((-12)/(-21))/((-12)/(-14)). 2/3 Calculate 4/5(-9)/12. -3/5 Evaluate ((-2)/(-12))/(28/(-42)). -1/4 What is (-3)/2028(-1)/(-21)? -1/5 What is the value of 1-61/3? -2 What is the value of ((-5)/10)/((6/(-3))/(-20))? -5 What is the value of 42/(-18)(-24)/28? 2 (22/(-99))/((20/(-15))/(-4)) -2/3 Evaluate 3/65/(-120)4. -1/12 Calculate (-2)/6(-6)/4. 1/2 ((-77)/(-14))/(-11)6 -3 What is (5/(-9))/(110/(-44))? 2/9 Evaluate 18/4(32/24)/1. 6 What is the value of (-3)/(-1)39/117? 1 4/((-32)/(-20))*(-8)/(-20) 1 What	{ "pile_set_name": "DM Mathematics" }
hout replacement from {c: 1, o: 1, x: 1}? 1/6 Two letters picked without replacement from nrrnrrrarnnrnrrrr. What is prob of sequence rr? 55/136 What is prob of sequence fb when two letters picked without replacement from bdmadmmmfdbfdm? 2/91 Two letters picked without replacement from {e: 2, x: 2, c: 1, k: 1, r: 1}. Give prob of sequence ck. 1/42 Two letters picked without replacement from vbfrbsfccvrb. Give prob of sequence vv. 1/66 Two letters picked without replacement from tjtjtjkttaj. What is prob of sequence jk? 2/55 Four letters picked without replacement from clhleocht. Give prob of sequence elto. 1/1512 Three letters picked without replacement from vvvavaavaa. Give prob of sequence aav. 5/36 Two letters picked without replacement from dddduu. What is prob of sequence dd? 2/5 What is prob of sequence hd when two letters picked without replacement from ffdfdfuuudfdhfd? 1/42 Calculate prob of sequence qq when two letters picked without replacement from {q: 9, v: 4, n: 3}. 3/10 Two letters picked without replacement from {t: 3, x: 4, f: 1, g: 2, y: 3, r: 3}. Give prob of sequence yf. 1/80 What is prob of sequence qqep when four letters picked without replacement from {r: 1, p: 1, n: 2, e: 1, q: 4}? 1/252 Three letters picked without replacement from aefjeeiijijee. What is prob of sequence aje? 5/572 What is prob of sequence xxxx when four letters picked without replacement from xxmm? 0 Three letters picked without replacement from wjjwjjjjzzwjzw. Give prob of sequence wjj. 1/13 Calculate prob of sequence kjd when three letters picked without replacement from hhddhddkjdkdwdhd. 1/210 Calculate prob of sequence qqf when three letters picked without replacement from hdhdldfqlhqd. 1/660 Four letters picked without replacement from {b: 11, a: 2}. What is prob of sequence abbb? 3/26 Two letters picked without replacement from {a: 2, p: 11}. Give prob of sequence pp. 55/78 Calculate prob of sequence qwh when three letters picked without replacement from qqqwwqwqhw. 1/36 Calculate prob of sequence pp when two letters picked without replacement from ppppppppcc. 28/45 What is prob of sequence nk when two letters picked without replacement from zznvhnk? 1/21 What is prob of sequence glgl when four letters picked without replacement from {g: 2, j: 2, l: 2, w: 8}? 1/6006 Three letters picked without replacement from tvpptvvtpttpptwvpvpv. Give prob of sequence vvt. 1/38 Two letters picked without replacement from alalaaagx. What is prob of sequence lg? 1/36 What is prob of sequence aa when two letters picked without replacement from aaca? 1/2 What is prob of sequence bb when two letters picked without replacement from bfbbbfbfffbfffbbfb? 4/17 What is prob of sequence kpdr when four letters picked without replacement from rddpaapdpappak? 5/8008 Three letters picked without replacement from haing. What is prob of sequence aig? 1/60 Four letters picked without replacement from mffvfcffvpfppvfvc. Give prob of sequence fmfp. 3/1360 Calculate prob of sequence mn when two letters picked without replacement from {f: 1, h: 1, m: 1, x: 1, n: 1}. 1/20 Calculate prob of sequence nuun when four letters picked without replacement from auunnnnnnuuanunau. 1/34 Calculate prob of sequence id when two letters picked without replacement from {w: 3, d: 6, h: 1, i: 1, s: 2}. 1/26 Calculate prob of sequence xn when two letters picked without replacement from nxnavaa. 1/21 Calculate prob of sequence rbrb when four letters picked without replacement from bbbbbbbrbbbbrrb. 11/455 Four letters picked without replacement from {u: 2, x: 2, s: 4}. Give prob of sequence xuss. 1/35 Calculate prob of sequence qnwn when four letters picked without replacement from lnlnlwql. 1/840 What is prob of sequence vvvn when four letters picked without replacement from {v: 7, n: 3}? 1/8 Two letters picked without replacement from {u: 7, c: 1, k: 1, r: 4}. What is prob of sequence rc? 1/39 What is prob of sequence uj when two letters picked without replacement from juouuuuuou? 7/90 Two letters picked without replacement from fffffffff. Give prob of sequence ff. 1 What is prob of sequence xjxy when four letters picked without replacement from jniiixnnjysxnni? 1/8190 Two letters picked without replacement from {l: 1, i: 3, q: 4, v: 12}. Give prob of sequence qq. 3/95 Two letters picked without replacement from {r: 1, t: 2, o: 1}. Give prob of sequence to. 1/6 Calculate prob of sequence qqj when three letters picked without replacement from qqj. 1/3 Two letters picked without replacement from {o: 4, i: 1, m: 5, x: 3, f: 1}. Give prob of sequence om. 10/91 Calculate prob of sequence ww when two letters picked without replacement from {b: 6, f: 1, o: 1, x: 3, w: 4, s: 1}. 1/20 Two letters picked without replacement from uuuuuuuuccc. Give prob of sequence uc. 12/55 Two letters picked without replacement from qldddqldqddqll. What is prob of sequence ll? 6/91 What is prob of sequence hi when two letters picked without replacement from hfiui? 1/10 Calculate prob of sequence eke when three letters picked without replacement from {k: 5, e: 14}. 455/2907 Two letters picked without replacement from {z: 6, k: 2, f: 4}. Give prob of sequence ff. 1/11 Three letters picked without replacement from {r: 3, o: 2}. Give prob of sequence orr. 1/5 Calculate prob of sequence zz when two letters picked without replacement from {z: 7, v: 4}. 21/55 Three letters picked without replacement from dmmhhmhvdzdhddhm. What is prob of sequence hzh? 1/168 Three letters picked without replacement from twttkiitiw. Give prob of sequence wtt. 1/30 Four letters picked without replacement from {e: 1, h: 2, r: 3, c: 7, z: 2, j: 3}. What is prob of sequence zhhr? 1/6120 Three letters picked without replacement from xcxbkxxxxxxx. What is prob of sequence xbk? 3/440 Three letters picked without replacement from {e: 5, d: 4, r: 6}. What is prob of sequence dde? 2/91 Calculate prob of sequence kkkk when four letters picked without replacement from kkkkk. 1 Four letters picked without replacement from {e: 5, c: 5, w: 5, s: 1}. What is prob of sequence wwcw? 5/728 Four letters picked without replacement from fiftfeyyfeef. Give prob of sequence yfif. 1/297 What is prob of sequence zza when three letters picked without replacement from {a: 1, z: 3, p: 2, e: 6}? 1/220 Three letters picked without replacement from rrrsccgszckrzcrzscr. What is prob of sequence rgk? 1/969 Two letters picked without replacement from {d: 7, g: 2, q: 4}. Give prob of sequence dq. 7/39 Calculate prob of sequence iv when two letters picked without replacement from vavvviiiai. 8/45 Two letters picked without replacement from {s: 1, q: 2}. What is prob of sequence ss? 0 Calculate prob of sequence zzw when three letters picked without replacement from {w: 2, s: 4, z: 5}. 4/99 Calculate prob of sequence ppp when three letters picked without replacement from {p: 6}. 1 What is prob of sequence ded when three letters picked without replacement from eedddededdedeeeedd? 9/68 What is prob of sequence sr when two letters picked without replacement from {n: 5, r: 2, s: 7, d: 3, l: 1}? 7/153 What is prob of sequence jjcc when four letters picked without replacement from {j: 2, c: 5}? 1/21 Three letters picked without replacement from hhqhhhhqhqhqhh. Give prob of sequence hhh. 30/91 Three letters picked without replacement from uuuqqrqurrqqd. What is prob of sequence qqr? 5/143 Two letters picked without replacement from {b: 1, k: 1, c: 1, l: 1, m: 1, r: 2}. Give prob of sequence kl. 1/42 Calculate prob of sequence bhb when three letters picked without replacement from {h: 13, b: 6}. 65/969 Three letters picked without replacement from {q: 2, m: 7, d: 2}. What is prob of sequence ddm? 7/495 Four letters picked without replacement from qoeqoqozoqe. What is prob of sequence ooqz? 1/165 Calculate prob of sequence ridd when four letters picked without replacement from {o: 7, r: 1, x: 2, d: 6, i: 2}. 1/1224 Calculate prob of sequence elel when four letters picked without replacement from {v: 1, o: 5, e: 5, l: 4}. 2/273 Three letters picked without replacement from mrwmmww. Give prob of sequence wmm. 3/35 Three letters picked without replacement from {d: 1, i: 4, o: 5}. What is prob of seq	{ "pile_set_name": "DM Mathematics" }
. Suppose -2f - 1 = -9. Find the third derivative of fm2 - m2 - 88m5 + rm*5 - 6m*2 wrt m. -300m2 What is the derivative of -u4 + 144u4 - 47u*4 - 73 wrt u? 384u*3 Let v be -310/(-45)3. What is the second derivative of -8m*v - 10m*2 + 27m*2 - 12m wrt m? 18 Let i(w) be the third derivative of -w*7/70 - 8w*6/15 - 53w*4/12 - 379w*2. What is the second derivative of i(f) wrt f? -36f*2 - 384f Let j(q) be the third derivative of -q*9/504 + 79q*6/60 + 31q*5/15 + 158q*2. What is the third derivative of j(r) wrt r? -120r*3 + 948 Let k(d) = 137d*3 - 6d2 - 167. Let o(m) = m2 - 1. Let h(l) = k(l) + 6o(l). Differentiate h(s) with respect to s. 411s*2 Let f(i) = 7i - 3. Let v be f(1). Find the first derivative of 6j - 6j - 13jv + 3j*4 - 13 wrt j. -40j*3 Let b be 24/(-6) - (-22 + 3). What is the third derivative of -7w*6 - 15w4 + w6 + bw4 - w2 wrt w? -720w*3 Let u(t) be the second derivative of -44t*7/7 - 47t4/3 - t3/3 - 45t + 2. What is the third derivative of u(l) wrt l? -15840l*2 Suppose -3q = 36 - 69. What is the second derivative of 4r - qr*4 - 3r + r*4 wrt r? -120r*2 Let n(i) = -46i*2 - 198i - 10. Let g(j) = 45j2 + 201j + 12. Let u(r) = -5g(r) - 6n(r). What is the second derivative of u(w) wrt w? 102 Let q(h) be the second derivative of 0 + 0h4 + 13h + 0h3 + 9/20h*5 - 13/2h*2. What is the derivative of q(f) wrt f? 27f*2 Suppose -29 = 4a - 69. Suppose 0 = -4m + am - 24. What is the third derivative of 20ym + 10y*5 + 0y*2 - 5y*2 - 20y*4 wrt y? 600y*2 Let g(l) be the first derivative of -101l*6/6 + 80l*3/3 + 2l - 400. Find the third derivative of g(k) wrt k. -6060k2 Let q(b) = -2b*3 + 11b*2 + 28b - 2. Let r(h) = 2h3 - 10h*2 - 28h + 3. Let k(m) = 3q(m) + 2r(m). What is the second derivative of k(o) wrt o? -12o + 26 Let i(j) = -3j - 4. Let x(y) = -3y2 + 90y + 336. Let u(f) = 2i(f) + x(f). Find the first derivative of u(d) wrt d. -6d + 84 What is the first derivative of 96n + 71 + 100n - 416n2 - 196n wrt n? -832n Let p(h) be the second derivative of -469h*6/30 - 215h*4/6 - 534h. Find the third derivative of p(o) wrt o. -11256o Suppose -3k + 4a + 20 = 0, 13 = -4k - 3a - 2. Suppose 0 = 4m - km - 8. Find the second derivative of mh*5 + 2h*5 + 6h - 6h5 - 2h*5 wrt h. -80h*3 Let c be (12/(-4) + 3)1. Find the second derivative of cn2 - 9n + 13n2 + 0n*2 + 4n*2 wrt n. 34 Let g be -6 - -6 - -31. Suppose -4j - 9 = gv, 2v + 2v + 12 = -j. What is the first derivative of -3 + r + jr - 1 - 3r wrt r? -2 Let r(h) = -h*2 + 4h + 1. Let g be r(3). Find the second derivative of -33j3 - gj*2 + 4j*2 - 13j + 27j3 wrt j. -36j Suppose 3p + 1297 - 5557 = 5s, -p + 1412 = s. What is the third derivative of -29j5 - p - 10j*2 + 1415 wrt j? -1740j2 Let a(h) be the third derivative of -h5/10 + 3h4/4 + 83h*3/6 - 12h*2 - 4h. Find the first derivative of a(q) wrt q. -12q + 18 Suppose t - 14 = 1. Let f = 17 - t. What is the third derivative of 3n*2 + fn*2 - 14n*4 + 22n*4 wrt n? 192n Let m be (-24)/56 + 6/14. Suppose 2o - 10 = -m. Find the second derivative of 3s*2 + 4s*2 - os*2 + 8s wrt s. 4 Suppose 0 = -4b - b. Suppose b = -r + 4r - 9. Differentiate -2 + 0 + rw4 - 2w*4 - 5 with respect to w. 4w*3 Let c(n) = 32n*3 + 31n. Suppose -5b + 1 = 36. Let d(a) = -33a*3 - 31a. Let r(h) = bc(h) - 6d(h). What is the second derivative of r(j) wrt j? -156j Let l be (-9)/(-6)(-10)/(-3). Find the first derivative of -139 + lh3 - 134 + 280 wrt h. 15h2 Let r(l) be the first derivative of -l6/3 + l*5/5 - 3l*2 + 5l - 30. Find the second derivative of r(k) wrt k. -40k3 + 12k*2 Differentiate -10b - 13b - 628 - 21b + 54b - 9b - 202b2 with respect to b. -404b + 1 Let f(k) be the third derivative of k6/3 + k5/20 + 239k3/6 - 6k*2 - 1. Differentiate f(v) wrt v. 120v*2 + 6v Let q = -1055 - -1738. What is the derivative of -w*3 + 5w*4 - 5w*3 - 36 - 683w*2 + qw*2 wrt w? 20w*3 - 18w*2 Let m = 41 - 39. What is the third derivative of -7q6 - q6 - 4q6 + 7q*2 - 23q*m wrt q? -1440q*3 Let c(q) = -q - 19. Let m be c(-19). Suppose 0 = n - 2 - m. Find the third derivative of -3g*2 + 3g*3 + ng*2 - 5g*2 wrt g. 18 Let c(p) be the second derivative of -115p7/21 - p3/3 - 11p2/2 + 124p. What is the second derivative of c(t) wrt t? -4600t3 Let t be -292/4. Let n be (t/(27/(-6)))/1. Find the first derivative of -98u*n + 94u*2 + 5 + 5 wrt u. -8u What is the second derivative of 13 - 169l + 509l - 172l + 32l*2 - 170l wrt l? 64 Let i(v) be the first derivative of 4v2 + 3v + 0v3 - 1/2v*4 - 36. What is the second derivative of i(r) wrt r? -12r What is the second derivative of -341d - 651d*5 + 466d + 262d wrt d? -13020d*3 Let c be ((-25)/(-30))/((-2)/(-12)). What is the second derivative of 4f*5 - 2f*5 + 8f + fc + f5 wrt f? 80f3 Let y(h) be the second derivative of 7h6/10 + h5/10 + 31h4/12 - h + 14. Find the third derivative of y(i) wrt i. 504i + 12 Let l(n) = 13n4 + 3n*3 - 9n + 45. Let d(b) = 14b4 + 2b3 - b2 - 7b + 43. Let o(s) = -3d(s) + 2l(s). Find the second derivative of o(g) wrt g. -192g*2 + 6 Suppose 5p = 5h, 7p - h - 2 = 4p. Let j(n) be the first derivative of p + 8n - 1/2n2. Differentiate j(g) with respect to g. -1 Let l = 1 - -4. Let v(b) be the first derivative of 3 + 16b*l - 6b - 18b5 + b. Find the first derivative of v(t) wrt t. -40t*3 Let w(k) = -14k - 16. Suppose 4h = -v - 30, -2h + h = -4v - 1. Let s(c) = 13c + 15. Let b(n) = hs(n) - 6w(n). What is the first derivative of b(u) wrt u? -7 Let b(s) = 98s2 - 58s + 20. Let j(u) = 33u2 - 19u + 6. Let x(p) = -6b(p) + 20j(p). Find the second derivative of x(m) wrt m. 144 Let y(m) be the second derivative of 87m5/10 + 69m*2 - 27m - 3. Differentiate y(k) wrt k. 522k2 Let j(w) = -282w*3 - 170w*2 + 24w. Let b(v) = 94v3 + 57v*2 - 9v. Let t(k) = -8b(k) - 3j(k). Find the third derivative of t(i) wrt i. 564 Let r(b) = b*2 + 12b - 35. Let j be r(-15). Find the third derivative of -18k2 - 20k*2 + jk*6 - 2k*2 wrt k. 1200k*3 What is the second derivative of 31b*2 - 735b + 2b3 - 4b*3 + 145b*2 + 54b wrt b? -12b + 352 What is the derivative of -82n*3 - 60n*3 - 93n*2 + 93n*2 - 68 wrt n? -426n*2 Let z(q) be the third derivative of -10/3q*3 + 0q + 0q5 + 0q*4 + 0 - 41/120q*6 - 37q*2. What is the derivative of z(b) wrt b? -123b*2 Let j(b) be the first derivative of 20b6/3 - b5/5 - 97b3/3 - 257. Find the third derivative of j(d) wrt d. 2400d*2 - 24d Let a(k) be the second derivative of -53k8/56 + 7k6/30 + k4/6 - 3k3/2 + 123k + 4. What is the third derivative of a(t) wrt t? -6360t3 + 168t Let c = 30 + -26. Find the second derivative of 9a4 - 2a*c - a + 3a*4 - 11a wrt a. 120a2 What is the third derivative of -10l*4 - 3l*4 - 6l*2 + 68l*2 - 14l*2 + 7l6 + l6 wrt l? 960l3 - 312l Let j(l) = 47l2 + 22l - 8. Let z(b) = 31b2 + 15b - 5. Suppose -4x - 16 = -2x. Let q(s) = xz(s) + 5j(s). What is the second derivative of q(v) wrt v? -26 Let w(n) be the third derivative of -47n9/504 - 7n5/30 + n4/24 + 22n2 - 3. What is the third derivative of w(a) wrt a? -5640a*3 Suppose 41m - 36m = 0. Find the third derivative of -5d*2 + 0d*2 + 3d*2 + md*2 - 4d*3 wrt d. -24 Let i(q) = 25q*2 + 106q + 26. Let z(p) = p*3 + 12p*2 + 53p + 12. Let w(l) = 4i(l) - 9z(l). What is the second derivative of w(f) wrt f? -54f - 16 Let u(r) be the second derivative of -25r*7/21 - 13r*3 - 2r + 17. Find the second derivative of u(c) wrt c. -1000c3 What is the second derivative of 184v*3 + 113v - 17v + 89v*3 + 51v wrt v? 1638v What is the second derivative of 9f*2 - 164 + 48f + 68f + 85 + 79 wrt f? 18 Suppose 4g - 239 - 197 = 0. What is the second derivative of 94v4 - 8v - gv4 - 2v - 3v wrt v? -180v*2 What is the third derivative of 0 + 0 - 3492a*5 + 93a*2 + 3442a*5 + 2a**	{ "pile_set_name": "DM Mathematics" }
at is the third biggest value in 4, 1/1567593, 20? 1/1567593 Which is the fourth smallest value? (a) 171 (b) 12.06 (c) 0.19 (d) 2/5 a What is the biggest value in -5.92, -6, -0.3867? -0.3867 What is the smallest value in 5/4, -27.3346, 1? -27.3346 Which is the fifth biggest value? (a) 1/2 (b) 6 (c) -2 (d) -17/29 (e) 28/11 (f) 0.1 d Which is the second biggest value? (a) 2/13 (b) 34576 (c) 5/2 (d) -8 (e) 1/7 c Which is the second biggest value? (a) -24443 (b) -3/7 (c) -0.1 (d) 11/2 (e) -0.3 c What is the third biggest value in -4, 1, -7.5, -88.9, 4, -5? -4 What is the second smallest value in -5/13, -4, -0.11, 34072? -5/13 Which is the second smallest value? (a) -3/7 (b) 0.3 (c) 2/7 (d) 456.59 (e) -0.5 a What is the sixth smallest value in 0.1, 3, -0.4, -5.73, -2, 15? 15 What is the second smallest value in 2.9, 1, 20, -90? 1 What is the third smallest value in 2, 847/2, -5, -0.13, 19? 2 What is the second biggest value in -1/2, 3, 4, -14, 3/10, 6/29? 3 Which is the smallest value? (a) -0.11 (b) 26 (c) -30 (d) 523 c Which is the second biggest value? (a) 769 (b) -1/7 (c) -3/8 (d) -0.5 (e) -1/4 (f) 6/37 f Which is the fifth biggest value? (a) 1/7 (b) 1 (c) -218/285 (d) 2/7 (e) -15 (f) 1/3 c Which is the smallest value? (a) -4 (b) -0.34 (c) -1476987 c What is the second smallest value in -1/3, -1, -479803, 3? -1 What is the fourth smallest value in -22, 620, -0.1, 5, 153/19? 153/19 What is the third biggest value in -1/4, 2/43, -6973? -6973 Which is the third smallest value? (a) 232 (b) -146730 (c) 3 (d) 4 d What is the third biggest value in 0.5, -0.5, -1258, 0, -347, -2/3, -2? -0.5 What is the third biggest value in -2/13, 0.29, 3, -6, -1455? -2/13 What is the third smallest value in -1, -2/35, -0.4, 339/83, -2/11, 0, -1/9? -2/11 Which is the third smallest value? (a) 3/7 (b) 0.09 (c) 42/13 (d) -1179 a Which is the fourth smallest value? (a) -0.83 (b) 0.3 (c) 8 (d) -2 (e) 78 c What is the fifth smallest value in 0.05, -40, 0.08, 26, 4, -7? 4 Which is the second biggest value? (a) -2/25 (b) -496 (c) -0.2 (d) 4/5 (e) -0.3 (f) -4 (g) 1/6 g What is the smallest value in -0.096, -2639.8, 2? -2639.8 What is the smallest value in -1.31, -3663, 3? -3663 What is the fourth biggest value in 3/14, 0.6, 14, 1/2, 8, 2/6729? 1/2 Which is the biggest value? (a) 0 (b) -1/4 (c) -1 (d) 530/285869 d What is the fifth smallest value in -26, -32, 2/729, -0.1, -3, -1? -0.1 Which is the fifth biggest value? (a) -2 (b) -3 (c) -324 (d) 0.0805 (e) 3 c Which is the sixth smallest value? (a) 7 (b) 62 (c) -1/4 (d) 4 (e) 36 (f) -18 (g) 0.1 e What is the third biggest value in -2, -2.3, -4, -0.1, 2, -113, 5? -0.1 What is the smallest value in -6, 1/6, -1.3, -1, -1/8, 13? -6 What is the biggest value in 2/77, -10, -4, -4599? 2/77 What is the smallest value in 37, 0.2, 5, 7, -9, 0? -9 Which is the third smallest value? (a) -121 (b) -3 (c) -0.121574 c What is the fifth smallest value in -25, 13, -30, -5, 12? 13 What is the fourth biggest value in 0.3, -4, 1, 72/5, 76, 1.1? 1 Which is the smallest value? (a) -2/3 (b) 0.1 (c) 5/3 (d) 5913 (e) 0.08 (f) 0.2 a Which is the fourth smallest value? (a) 6 (b) 103/3 (c) -2/33 (d) -4 (e) -0.2 (f) -0.01 f What is the smallest value in -0.15, 1.49, -74, -0.157? -74 Which is the third smallest value? (a) 6 (b) -64/5 (c) 2/27 (d) -4 (e) 479 (f) 0.5 c What is the second smallest value in 9, 11, 2/9, 7/2544, -2/3, -2/5? -2/5 Which is the fourth smallest value? (a) 20 (b) -8/313 (c) -1 (d) 0.3 a What is the smallest value in -9, 23, -4, 1/72, -1/3? -9 What is the second biggest value in 4, -0.3642, -2/33, -2/3, -25, 3/4? 3/4 What is the second smallest value in -1799, 0.4, -0.4, -1/2, -11, 2? -11 Which is the third biggest value? (a) 22093 (b) -0.1 (c) -0.3 (d) -37 c What is the second smallest value in 456, 0, -523, -11, -2/11? -11 What is the fifth smallest value in 6, 36, 4, -6, -44, -52/5? 6 Which is the smallest value? (a) 0.686 (b) -18 (c) -0.8 (d) -3 b Which is the fifth biggest value? (a) 2/5 (b) -3 (c) 3.7 (d) 5 (e) 0.94 b Which is the smallest value? (a) 1 (b) -38 (c) -5 (d) 61434 (e) 0.3 (f) 1/2 (g) 2/3 b What is the biggest value in 0.4, 0.322199, 1.7? 1.7 What is the third smallest value in -2/49, -0.5, -0.7, 3/2, -3, -14? -0.7 What is the biggest value in 405, 24, 2/65, -4? 405 What is the third smallest value in -2, 1554, 1, -1/40, 243/4? 1 Which is the fifth biggest value? (a) 7923 (b) 0.5 (c) -0.3 (d) -4/9 (e) -3 e Which is the fourth biggest value? (a) 5 (b) -16 (c) 1/4 (d) -13 (e) -8 (f) 0.09 e What is the third biggest value in 196.4155, 3/5, 0, 14? 3/5 Which is the smallest value? (a) -5 (b) -75642 (c) 4/5 (d) -67 (e) 5 b What is the second biggest value in 72, 0, -0.3, -6/7, 5, 1? 5 Which is the third smallest value? (a) -2 (b) 0.1 (c) 22/7 (d) 3 (e) 6 (f) 2/5 (g) 27 f What is the third biggest value in -0.3, 2, 28/2237747? -0.3 What is the biggest value in -7, -3863, 0.2, 0.4, 0.067? 0.4 What is the fourth biggest value in -4, -1, 43380, -3, -0.4, 0.06? -1 What is the seventh biggest value in 11/24, -3/5, -0.5088, -1, 0, 2, 1? -1 What is the seventh smallest value in 11, -3, 0.1, -5, -23, 1/2, -0.012? 11 Which is the biggest value? (a) 35686 (b) -0.4 (c) -4/5 (d) 5 (e) -2 (f) -5 (g) -0.03 a Which is the third biggest value? (a) 8 (b) -0.1947 (c) 175 b What is the fourth biggest value in 0, -4, 0.7, -1.66, 36, -2/5? -2/5 Which is the sixth smallest value? (a) 1 (b) 3 (c) -0.04 (d) -10 (e) -6 (f) 1.7 (g) 0.1 f Which is the second smallest value? (a) 3 (b) -13 (c) 3/8 (d) -5 (e) -6/11 (f) 53007 d Which is the seventh biggest value? (a) -171 (b) 6 (c) 0.087 (d) -0.3 (e) 4 (f) -3 (g) 4/7 a What is the second smallest value in -1760, 1, 6, -486? -486 Which is the fourth smallest value? (a) 1/4 (b) -1/6 (c) 1 (d) 4 (e) 23256/7 d What is the biggest value in -10/3441, -2/5, 607? 607 What is the second biggest value in -2/3, -139863, -35/8? -35/8 Which is the biggest value? (a) 0.049 (b) 0.0085 (c) 352 c Which is the third biggest value? (a) 606 (b) -0.2 (c) -0.5015 c Which is the biggest value? (a) -15.75 (b) -0.3 (c) 0.11 (d) 5 (e) 25 (f) -4 e What is the biggest value in -0.2, 5.55, -6371, -9, -3? 5.55 What is the third smallest value in -0.30368, 1/7, -6.556? 1/7 Which is the smallest value? (a) -1/3 (b) -43 (c) 87528/13 b Which is the smallest value? (a) -3 (b) 0.39976 (c) 12 a Which is the second smallest value? (a) -141 (b) -1/9 (c) -38 (d) -0.1 (e) 2/5 c Which is the sixth biggest value? (a) 3 (b) -3 (c) -0.67 (d) -9 (e) 76 (f) 0.1 d What is the seventh smallest value in 0.1, 1, 1/7, -5/4, 551, -1/3, -0.1? 551 Which is the seventh smallest value? (a) 81 (b) -3 (c) -0.4 (d) 18 (e) 3 (f) 0.04 (g) -0.04 a What is the sixth smallest value in 1/4, -0.2, -87, -67, -6, -0.4? 1/4 What is the second smallest value in 32.7, -2/33, -215/2? -2/33 What is the second biggest value in -0.5, -58523, -0.07, 1/3, 0.1, -3/2? 0.1 Which is the third biggest value? (a) 0.09 (b) -0.1 (c) 2 (d) -2388 (e) -5 b Which is the second biggest value? (a) 2/21 (b) 4 (c) 0.03821 (d) 61 b Which is the biggest value? (a) 2 (b) 0.2 (c) -1 (d) 5 (e) 20 (f) -9 (g) 0.01965 e What is the smallest value in -2/7, -0.3, 0.3, -17, -0.02, -2/5, 88? -17 Which is the third biggest value? (a) 20 (b) -1 (c) -2/3 (d) -135 (e) 0.5 (f) -16 (g) -5 c What is the smallest value in -5, 1/2, -2496/19, 5, 3, -0.2? -2496/19 Which is the fifth smallest value? (a) 939/8 (b) 3 (c) 1/3 (d) -4/5 (e) 0.135 (f) 4/7 b What is the sixth biggest value in 2, 3, -19, 0.6, -27, 4, 0.3? -19 What is the second biggest value in 12, 0.3, -1, -0.023353? 0.3 What is the second smallest value in 1, 4, 5/41, -63, 2? 5/41 Which is the biggest value? (a) -10 (b) 1.908 (c) 7 c Which is the third smallest value? (a) 0.5 (b) -1/8 (c) 60 (d) -1/7 (e) -1263.8 (f) 2/7 b What is the fifth biggest value in 90, -1/3, -0.044, -1051, -3? -1051 What is the second smallest value in 16/7, -2, -0.1, -808, 1/5, 5, 2? -2 What is the third biggest value in -4, 33,	{ "pile_set_name": "DM Mathematics" }
99 take away 0.3? -3554.8899 Calculate -24741.9971 - -0.2. -24741.7971 What is the difference between -52 and -1580013270? 1580013218 What is -3224.6808 - 13? -3237.6808 Add together 0.047 and -5977923. -5977922.953 Add -26.23 and 1336628. 1336601.77 What is -13418.31 plus 0.095? -13418.215 Add together -5 and -871.8820203. -876.8820203 3.5 + -119574 -119570.5 What is -175.3291 minus -25? -150.3291 Add together -7.9 and 753.6568. 745.7568 Put together -1.388891 and 0.3. -1.088891 Put together -10.47946 and -0.057. -10.53646 What is -1.7047 minus -398028? 398026.2953 Sum 2 and -0.05167458. 1.94832542 Add -0.086 and 34127344. 34127343.914 Add -65815727 and -59. -65815786 Sum 20659 and -101.4. 20557.6 What is 0.015206 plus -127.61? -127.594794 Calculate -17418387 - 0.329. -17418387.329 Work out 0.34922 - -795. 795.34922 Total of 0.57618 and -12373. -12372.42382 Subtract -338.1 from -976261. -975922.9 -0.01659 + 2486 2485.98341 Add -110.31428 and 1.34. -108.97428 Add together 0.1 and 1835401058. 1835401058.1 Total of -28064 and 847031. 818967 -5 - 380847083 -380847088 What is -1775 plus 5.49673? -1769.50327 Work out -106786899 + 129. -106786770 Sum 0.1 and -19122.9088. -19122.8088 Add together 2102.309869 and -5. 2097.309869 Calculate -65 + -126560.9. -126625.9 What is 140 minus -8245659.71? 8245799.71 What is the distance between 0.071 and -191343? 191343.071 What is the difference between 0.064 and 469004? 469003.936 What is 380 take away 115822? -115442 What is -207 less than 0.07713? 207.07713 Subtract -1839298545 from -12. 1839298533 Work out 235513 - 78.6. 235434.4 Add -0.2 and -22950299. -22950299.2 What is 0.3 less than 2185.388746? 2185.088746 Subtract 207 from 11.50582. -195.49418 Add together -2 and 24.38617. 22.38617 Add -94978 and -4211.74. -99189.74 What is -16.13922583 + 0.3? -15.83922583 Work out -4859 - 120.38. -4979.38 Total of -0.13886 and 65.8791. 65.74024 0.16 - -699037063 699037063.16 286 + -205427 -205141 -0.030593+65.7 65.669407 Work out -115496 + 1.387. -115494.613 Subtract -11296 from -12565.95. -1269.95 What is -18 + 65428.92? 65410.92 What is the distance between 269242 and 0.0543? 269241.9457 What is the distance between -5699 and -276291? 270592 What is 49249 - -39.2? 49288.2 Sum -187327985 and 4. -187327981 What is -2 minus 1.660036461? -3.660036461 What is -1125 plus -105.32? -1230.32 -2.38889+0.2 -2.18889 What is 1027526 less than 84.374? -1027441.626 What is the distance between -2 and -564013648? 564013646 Calculate -2 + 54967.646. 54965.646 Add together 0.3 and 44797660. 44797660.3 What is -22066 plus -8054? -30120 5061337+185 5061522 2.54 - -0.171778 2.711778 Subtract -0.7546 from -3787. -3786.2454 -1.7+-0.3708749 -2.0708749 0.191733 - 0.0588 0.132933 Total of -13263993 and -99.9. -13264092.9 What is the difference between 0 and 146806232? 146806232 What is -0.5 - 0.114319767? -0.614319767 -661.784+-32 -693.784 What is 12167891 - 0.07? 12167890.93 What is -7 minus -38948474? 38948467 Total of -3880713 and 1987. -3878726 What is 12072166 less than -585? -12072751 Calculate 0.2 + 10037793. 10037793.2 Total of 58536.9 and -2621. 55915.9 Work out 0.06 - 234748330. -234748329.94 Put together 1265.637556 and 5. 1270.637556 What is -76 less than -40.0621? 35.9379 What is -0.03 + 1.4559595? 1.4259595 Subtract -2.585 from 1094584. 1094586.585 What is -185.138753 plus -6? -191.138753 What is -5 + 5147917034? 5147917029 Calculate 0.14 - 4747177408. -4747177407.86 Total of -14.72813 and 5089. 5074.27187 Calculate 0.3452074 + 7.002. 7.3472074 What is 1031585 + 23.58? 1031608.58 Put together 502721594 and 0.04. 502721594.04 Add 1 and -30174150. -30174149 What is -69 take away 737419? -737488 -19+17281 17262 Add -62 and 36116609. 36116547 Work out -1663 - -1425.01. -237.99 Sum -0.3 and -9563.53708. -9563.83708 Sum 942 and 0.4677. 942.4677 What is 3.34866 less than 255? 251.65134 Sum -3338791 and 2.363. -3338788.637 What is 0.13 minus -729790.7? 729790.83 Add together 0.02726375833 and 0.01. 0.03726375833 What is 0.25798 plus -3153? -3152.74202 What is the distance between 425420.373 and 1? 425419.373 1.7 - 1602.8 -1601.1 Put together 5376 and 11603. 16979 What is -122299275 take away 0.044? -122299275.044 Calculate -5 - 335220767. -335220772 Work out -545 - 15919. -16464 1.23207+0.182 1.41407 What is 55407400 minus 4? 55407396 -0.1 + -67.564006 -67.664006 Put together -914849012 and 0.4. -914849011.6 What is 8 - -2116907481? 2116907489 What is the difference between 0.44 and -325748202? 325748202.44 What is 18935758 + 0.2? 18935758.2 Calculate 41742100 + -0.035. 41742099.965 Sum 0.0682 and 22271.4. 22271.4682 What is -5005 minus -1198? -3807 Add together 3.032192 and 0. 3.032192 Calculate -2.2 - 9698.27057. -9700.47057 Calculate -439159376 + 79. -439159297 2 - 8.5442967 -6.5442967 Calculate 0.1 - 38300.8854. -38300.7854 949 + 3596.4126 4545.4126 Put together -0.3570579 and 100. 99.6429421 What is -1997077 plus 13197? -1983880 0.1 - 16984168.281 -16984168.181 What is -4642813.9 minus 0.5? -4642814.4 What is -74365.26 less than -0.5836? 74364.6764 Calculate -3351800 - -693. -3351107 What is -1553.32 - -0.361? -1552.959 Work out 6068.5 - -0.8167. 6069.3167 Work out -0.4 - -282.377. 281.977 What is -98495.719 less than -0.54? 98495.179 Calculate 0.1 + -0.04750652. 0.05249348 Sum 46081.832 and -0.08. 46081.752 Add together -3748 and 1.65772. -3746.34228 What is 446 + 3763385? 3763831 Add together -0.1211877 and -0.053. -0.1741877 Put together -1.69 and 429595. 429593.31 2675657 + -5 2675652 0.21188 - 621 -620.78812 Put together -6 and 0.11706575. -5.88293425 Total of -0.5 and -7.992825. -8.492825 What is -0.367 + 9512.5? 9512.133 Put together 23.104964 and -4. 19.104964 What is -1888 plus -0.288202? -1888.288202 Add 90 and 23.11798. 113.11798 Subtract -625.94411 from -0.2. 625.74411 What is -55582505234 take away -5? -55582505229 Add 695548459 and 4. 695548463 Sum -35253 and 566.39. -34686.61 What is -0.153 plus -10.5291? -10.6821 Calculate -19558374 + -2. -19558376 -5202820.5 + -0.4 -5202820.9 Add together -0.3506622 and 0. -0.3506622 What is -0.0295 - -6.73997? 6.71047 Sum -187.6 and -0.46175. -188.06175 Put together -56969272 and -0.4. -56969272.4 Subtract -0.5 from -88233676700. -88233676699.5 Subtract -0.2 from -3666489988. -3666489987.8 2.243 + 0.221321 2.464321 What is 0.3 take away 0.4525682482? -0.1525682482 Sum -18337535 and -5. -18337540 -0.0181+-104599 -104599.0181 Subtract -11895032 from 0.5. 11895032.5 What is 1169 plus -54567? -53398 Calculate -15028 + 0.1073. -15027.8927 What is 5 minus 28560323? -28560318 -95716143+2 -95716141 What is -188 minus -425074? 424886 Add -0.482940056 and -35. -35.482940056 Add -0.12980511 and -0.3. -0.42980511 Add together -47.152 and 2042. 1994.848 Work out -0.03 + -1.0590779158. -1.0890779158 What is -46051116 take away 1561? -46052677 What is the distance between 25.867752 and 0.06? 25.807752 Sum 82007.08 and 0.1. 82007.18 Add 2395.5988 and 0.1. 2395.6988 What is the distance between 8.33015 and -0.5? 8.83015 Total of -2210 and 3125. 915 What is 316784 minus -0.0943? 316784.0943 What is -0.09 - -111481846? 111481845.91 154.63 - 0.4775 154.1525 What is -362782 plus 0.423? -362781.577 Put together 9.79 and 2430.95. 2440.74 Calculate 2 + 775259190. 775259192 Add -9.891856 and -0.01. -9.901856 What is 167154078 take away 0.4? 167154077.6 Add together -75608029 and -0.1. -75608029.1 What is the distance between 5 and -7734138416? 7734138421 Add together 8916 and -27024. -18108 Work out -0.5 + -50205808. -50205808.5 78.967+-6.1532 72.8138 Total of -585.9 and -0.144119. -586.044119 What is -0.004 minus 3494.881? -3494.885 What is 6.6193468 less than 5.69? -0.9293468 -0.2+35251.91815 35251.71815 Subtract 247403.8854 from -0.4. -247404.2854 What is -32778 minus 0.0385? -32778.0385 Sum -19 and -0.01564009. -19.01564009 Add -298.94 and 16.44. -282.5 1149.1 + -12.81 1136.29 What is 0 - 19386? -19386 Add -186.867 and -7.56097. -194.42797 Work out 874 + -162.166. 711.834 -267200056.92+0 -267200056.92 Add 34085614 and 0.1. 34085614.1 Sum -113.9 and 28212. 28098.1 What is the distance between -0.56 and 193545? 193545.56 What is -0.6 plus 2.4860464? 1.8860464 What is -2.8 + -71205567? -71205569.	{ "pile_set_name": "DM Mathematics" }
.1? -0.5 What is the nearest to 0 in 7762, -1/2, 3.633? -1/2 What is the nearest to 5864 in 1.4, -6, -7.9? 1.4 What is the nearest to 1/11 in -3, 0.2, -0.4, -55, -10? 0.2 Which is the closest to 1? (a) 49474 (b) 22 (c) -4 (d) 2/7 (e) 0.4 e Which is the nearest to -171? (a) 4/5 (b) -0.626 (c) 1 b What is the nearest to -1/2 in 2.5, 0.5, -1/5, -114, 0.4? -1/5 What is the closest to 0 in 4, -92, -107/102? -107/102 What is the closest to -3 in -0.03, -13/8, 1, 36? -13/8 Which is the closest to 98/37? (a) 0.3 (b) 3 (c) -7/8 (d) -2/11 b What is the closest to 0.1 in 5/3, 2463, 2/5, 2, 0.2? 0.2 What is the nearest to 1/5 in -0.0771, -0.2, 0.58? -0.0771 What is the nearest to -0.1 in 4.78, -3, 4, 10422? -3 Which is the closest to 440/43? (a) 4 (b) 1 (c) 2749 a What is the nearest to -2/7 in 0.3, 0.17, 97076, 0, -0.3? -0.3 What is the closest to -0.1 in -115/11878, 4, 1/2, 0.4, 2/15? -115/11878 Which is the nearest to -1? (a) 1/4 (b) -4.16 (c) 4 (d) -28 (e) -10 a What is the nearest to -0.2 in 12, -9/13, 20/3, -6? -9/13 Which is the closest to 0? (a) 136.4 (b) -0.25 (c) 2.69 b What is the closest to -1/678 in 0.3, 48, 2/5, 0.2, -27? 0.2 What is the closest to -71674 in 0, 3, -5? -5 Which is the closest to 0.02? (a) -2/3 (b) -0.3 (c) 268 (d) -27 b What is the closest to -810 in 0, 1, -909/8? -909/8 Which is the nearest to -2? (a) -3 (b) -10 (c) -0.19 (d) 1 (e) 3.4 a What is the nearest to -0.2 in -66104, -2/25, 0? -2/25 Which is the nearest to 7? (a) -81 (b) -0.19 (c) 31 b What is the nearest to 0 in 3, -2/3989, 1, -7, 0.65? -2/3989 Which is the closest to 0? (a) 3092 (b) 86 (c) -0.05 c Which is the closest to -0.1? (a) 0.6183 (b) -0.1 (c) 2.7 (d) -5 b What is the closest to -72136 in -4, 0.5, 1/7? -4 What is the nearest to 1/5 in -2/303, 6790, 3? -2/303 Which is the closest to -7? (a) -13 (b) 0.2 (c) -3 (d) -90 (e) 0.16 c What is the nearest to -746.4 in 0.2, -1, 5, 223? -1 What is the nearest to -2 in -7, 1, 0.6, -1, 7? -1 Which is the closest to -1? (a) 5.4 (b) -0.5 (c) 5/4 (d) 8/15 (e) -1 e Which is the nearest to -6? (a) 11/4 (b) 4 (c) 5 (d) -85/3 (e) 1 e What is the closest to 0.2 in 218, 4, -17/12, -4/3? -4/3 What is the closest to 77 in 3.5, -1/40, -4/7? 3.5 What is the nearest to 0.1 in 36, -953, -1/8, -2, 2? -1/8 What is the closest to 52 in -2/15, 0.4, 2/13, 4907, -0.2? 0.4 Which is the nearest to 21/8? (a) -0.4 (b) 0 (c) -3 (d) 7 (e) -870 b Which is the closest to -0.038? (a) 0 (b) -1 (c) -10 (d) 5 a What is the nearest to 0.21 in -0.2, -4/19, 11/5, 1.8? -0.2 What is the closest to -0.1 in 0, 0.7, 758853? 0 Which is the nearest to 2? (a) 0.3 (b) -3/7 (c) 1437 (d) -0.2 (e) -1 a Which is the closest to 3? (a) 1315 (b) -24 (c) -3 (d) 4 d Which is the closest to -1? (a) -7 (b) -3 (c) 0.54 (d) -0.11 (e) -2/7 e Which is the closest to -3170? (a) 2 (b) 79/5 (c) -0.3 c Which is the nearest to 5? (a) -0.5 (b) -5526 (c) -185 a Which is the nearest to -1? (a) 2/225 (b) -35 (c) 168 a Which is the nearest to 1? (a) -13 (b) -26 (c) -4 (d) -10 (e) 1/3 e What is the closest to -16 in -443/5, -10/47, 11? -10/47 Which is the nearest to 1/4? (a) 4.6 (b) -4/5 (c) 6 (d) -639 (e) 2/15 e Which is the nearest to -1/2? (a) 1/3 (b) -2/9 (c) -5 (d) 1 (e) -55.5416 (f) -3/7 f Which is the closest to 8/661? (a) 13 (b) -2/7 (c) 2 (d) -3/8 (e) 9 b What is the nearest to -3/223 in -0.5, 0.1, -0.7, 42, 2? 0.1 What is the closest to 0 in -3.1, -3/8, -153, 2/7, -5/12? 2/7 Which is the nearest to 0.1? (a) -3 (b) 3731296/13 (c) -0.2 (d) 9 c Which is the closest to 6? (a) 0.11 (b) -0.0951 (c) 0.01 (d) 11 d Which is the nearest to -1/8? (a) 3/5 (b) 5 (c) -0.3 (d) 1 (e) -272450 c Which is the nearest to 2/3? (a) 25 (b) 2/1033 (c) -53/69 b What is the closest to -0.1 in 16/7, -1, 440/7, -628? -1 Which is the nearest to -1? (a) 128.3 (b) 3 (c) -4 (d) -8 c Which is the closest to 101? (a) -2/7 (b) 3/2 (c) -71 (d) 1/68 (e) 5 e What is the closest to -6 in -6/19, -0.1, 2/17, -201? -6/19 Which is the nearest to 36.05? (a) 187 (b) 0 (c) -6 (d) 7 (e) 4 d Which is the nearest to -51/26? (a) 0 (b) -4/7 (c) -4 (d) 0.3 (e) 16 b What is the nearest to -0.1 in -0.4, 2, -8, 3, -3/2, -83.4736? -0.4 What is the nearest to -0.2 in 2/3, 0, -140/13, 5/3, 4/3? 0 Which is the nearest to 4/575? (a) -0.2 (b) 7 (c) -15 (d) 1/5 (e) 5 d What is the closest to -4 in 14281, 0.5, 0.2, 3, -79? 0.2 Which is the nearest to 0.044? (a) -14 (b) 0.03 (c) 8.6 (d) 2 b What is the closest to -2/7 in -14899, 95, -2/3? -2/3 What is the nearest to -22/25 in -4, -5, -58? -4 What is the nearest to -73 in 0.4, 39, 193/11? 0.4 Which is the nearest to 34? (a) 2/7 (b) -15 (c) -0.006 (d) 2 (e) 0.06 (f) -0.2 d What is the closest to 1/3 in -0.0784, -31, 1/7, 0.4, 3, 386? 0.4 What is the nearest to 2/7 in -0.2, -116, 2/7, -1256? 2/7 Which is the nearest to 1/4? (a) 613/6 (b) -8/13 (c) -0.5 (d) 0.4 (e) -2/3 d What is the nearest to 4 in 56, 2/7, 73106? 2/7 What is the nearest to 13 in -2/71313, -3/4, -5, -1/3, -1/4, 5? 5 Which is the closest to 2/9? (a) -6 (b) -96192 (c) -2/7 c What is the closest to 1 in -5, -96, -18363, 5, 0.4? 0.4 Which is the nearest to 6312/13? (a) 1 (b) 668 (c) 1/2 b Which is the nearest to -17548/5? (a) 0.11 (b) -2 (c) 0.2 (d) -3/4 (e) -4 (f) 1/4 e What is the nearest to 0.26 in 4.9, -0.18, -716? -0.18 Which is the nearest to 2809? (a) 3 (b) 1/127 (c) 0.4 a Which is the closest to -27.41? (a) 1.7 (b) -14 (c) 0.04 b Which is the nearest to 2? (a) 7 (b) -1/9 (c) 3/7 (d) 4 (e) -1/3 (f) 2/9 c Which is the closest to -13/3? (a) 144 (b) 3 (c) -2/1727 (d) -2/9 d Which is the closest to 276? (a) 40 (b) 4 (c) 2/19 (d) 1/7 a What is the closest to 1 in 4, 0, 32, -2/11, 0.1116? 0.1116 What is the closest to 1193 in 450, 1, -3? 450 Which is the closest to 2/3? (a) -78950 (b) 158 (c) 2/13 c Which is the nearest to 0.2? (a) -10 (b) -1/32 (c) 24125 b Which is the closest to 2.167? (a) 37 (b) 2/7 (c) 0.021 b Which is the closest to -47? (a) 4 (b) -8 (c) -162 (d) -1/2 (e) -5 b What is the nearest to 0.39 in -2, -5, 0.0269, 0.3? 0.3 Which is the closest to -0.4? (a) -2 (b) -4051/36 (c) -38 a Which is the nearest to 0? (a) -1/12 (b) -6141/2 (c) 5 (d) -0.08 d What is the closest to -17 in 0.4, 34/1867, 0.1, -5? -5 Which is the closest to 25? (a) -2/7 (b) 0.08 (c) -1.373 b What is the nearest to -0.0192321 in -1/10, 2/15, -2/9? -1/10 Which is the nearest to -2/9? (a) 2 (b) 1163 (c) -0.2 (d) -53/3 (e) 7 c What is the closest to -3 in 1/4, -2/587, 1, 0.26926? -2/587 What is the closest to 2/13 in 0.1582, 2, 0.1? 0.1582 Which is the nearest to -1.3? (a) -0.3 (b) -57 (c) 317 a What is the nearest to 3.048 in 0.1, -2/13, -1.105? 0.1 Which is the closest to 2/81? (a) 32 (b) -4 (c) 48 (d) -1/2 d What is the closest to -1/20 in 0, 10, 245, 2/11? 0 Which is the closest to -0.29? (a) 8811 (b) -0.14 (c) -5 b What is the closest to -1 in -3/59, 22/23, 0, -87? -3/59 Which is the nearest to -16? (a) -2/11 (b) 0.5 (c) -9/43 (d) 1.65 c Which is the nearest to 0? (a) -0.9 (b) 4 (c) -1/15 (d) 0 (e) -1378 d What is the closest to -89052.8 in 1/3, -0.2, -13? -13 Which is the nearest to -1? (a) 2/13 (b) 2/21 (c) 0.195 (d) -0.7 (e) 1/50 d Which is the nearest to 1? (a) -1/26 (b) -33/5 (c) -0.1 (d) 4/3 (e) 3.5 d What is the nearest to 6 in 7.41, 6/5, 11, 9/7? 7.41 Which is the nearest to -1/19? (a) 0.4 (b) -2 (c) 322 (d) 4 (e) 14 a Which is the nearest to -11? (a) -1/281 (b) -1 (c) -1.54 c What is the nearest to 1/2 in -2/5, -41, 1, -0.2, -1, -1/32901? 1 What is the nearest to 8 in 2, 3, -2/71, 64/3? 3 What is the nearest to -0.02 in 4.49, 25949, 1/2? 1/2 Which is the closest to 13? (a) 6 (b) -2471 (c) 2/15 a What is the closest to 16 in -1.1, -4/57, -21.7? -4/57 What is the nearest to -0.06 in -4/3, 3, 235169? -4/3 Which is the closest to 2? (a) -12 (b) 0.1 (c) 32398 (d) 0 (e) 11 (f) 1 f Which is the nearest to 13? (a) -167 (b) 2213 (c) -5 c What is the closest to 0 in 20/9, 0.3, -4843? 0.3 What is the closest to -14 in 0.003, 64, -77? 0.003 What is the nearest to -3 in -2, 3,	{ "pile_set_name": "DM Mathematics" }
((-143)/22 - -7)(-3891 - -1). Which is smaller: i or -1946? -1946 Suppose -14p = -14p + 49p - 13965. Is 299 greater than p? True Let m be (70/49329)/((-4)/(-150)). Let q = 4/81 - m. Let j = q - -2360/2871. Is -0.1 at least j? False Let g = 1405 + -1117. Are 0.1 and g non-equal? True Suppose 0 = 36962i - 36966i. Which is smaller: i or -4/4215? -4/4215 Suppose x - 7 + 1 = 0. Let u be 10/x2/45. Let l be (-4)/36 - (5 - (-322)/(-63)). Is u less than l? False Let t be (-8)/92 - (35410/(-2530) + 13). Which is greater: -9 or t? t Let f = -1.38 - -1.53. Let p = 25.85 + f. Which is smaller: p or 2/3? 2/3 Let k be -1 - (-16)/(-8) - (9 - 12). Is -8/301 > k? False Let n be 1055564/3215030 - 23/161. Let z = 3/3533 - n. Which is bigger: 0 or z? 0 Suppose -5x = -5h + 60, -x - 36 = -5h - 2x. Let b be 1110/(-9) - h/12. Is b > -123? False Let q be 1 + (-4)/(18780/4905). Is 0 < q? False Let u be ((-5)/(-2)36/15)/4357. Which is smaller: u or 0? 0 Let l be 4/(-18) - (-8)/36. Suppose -4c + 12 = -i - li, 3c + 8 = 5i. Let y be ((-2)/3)/23/c. Is 0 smaller than y? False Let w(k) = 9k + 13. Suppose 117 = 3m + 300. Let y = m - -58. Let d be w(y). Is d less than 0? True Let b(g) = 22g*2 - 180g - 21. Let q be b(12). Is q greater than 985? True Let a = -297 - -305. Let x be (-2 + 12/a)-2. Is 48 <= x? False Let o = 20274 - 20273. Which is smaller: 5/1623 or o? 5/1623 Let r(l) = 55l + 93. Let v be r(18). Which is greater: 1082 or v? v Suppose 0 = 59r - 56r - 615. Suppose -338 = n - r. Which is bigger: -132 or n? -132 Let y = 4696 - 1334. Let c be y/(-40) + 17 + -15. Let p = -313/4 - c. Is p less than or equal to 5? True Let a(c) = c*3 - 15c*2 + 37c + 14. Let t be a(12). Suppose 0 = tr - 5r - 1449. Which is greater: 67 or r? r Suppose -3q + 1 = -3x + 13, 2q = 0. Let a be x/7 + (-297)/(-7). Let g(t) = t3 - 21t*2 - 72t + 45. Let v be g(24). Which is smaller: v or a? a Let k = 351101/11 + -31930. Let h(g) = -12g3 - g2 + 2g - 1. Let m be h(1). Is m bigger than k? False Suppose 0 = 4c - 4t + 16, -8 = 28c - 29c - 5t. Are c and 4386 nonequal? True Let j be 204 - 727/(-63). Do 206 and j have the same value? False Let u = 0.039 - 27.039. Let x = 26.9 + u. Which is smaller: x or -1? -1 Let p be (5(-16)/40)/(-1). Let h be (-1414)/(-679) - 4/p. Are h and 1 equal? False Let s = 16416 + -16415. Which is greater: -3/2384 or s? s Let u(a) = -a3 + 16a*2 + 20a - 46. Let l be u(17). Suppose -5z + 75 = -5n, -z + 11 = 2n - ln. Are z and 19 equal? False Let v be 64612/(-29)3/4. Is -5015/3 > v? False Let m = 79 + -73. Suppose 3 = mn - 15. Suppose 0 = 5r + z + 95, r + z - 38 = nr. Is r greater than -20? True Suppose u - 3c = -379, -1380 - 569 = 5u + 3c. Let s be 0(6 + (-4 - (1 - 0))). Let z be (s + -1)(2 + u/196). Which is bigger: z or 0? 0 Let t be 48/(-10)(-2 + 27). Let u be (-2)/(-3) - t/(-27). Suppose -811d - 2d + 148d - 3325 = 0. Are d and u equal? False Suppose 18 = s - 4s. Let u = -3424 - -921054/269. Let n = -2955/538 + u. Which is greater: s or n? n Suppose 0v - 74 = -v - q, 3v + 2q = 220. Let t = v - 106. Let a be (-833)/t + (-2)/(-4). Is 25 greater than or equal to a? True Let t = -13 - -17. Let f be t/26 - (-136)/(-1222). Let u = 381 - 381. Is u greater than f? False Suppose -4z - 4l = -0z, 4z + l = 0. Suppose 0 = -4t + 2u + 18, 3u + 11 = -zt - 2t. Suppose -tg + 4 = -0. Which is smaller: g or 5? g Let f = -73 - -183. Let b = 191 + -88. Let o = f - b. Which is greater: -6 or o? o Let m(g) = -g3 + 24g*2 - 22g - 18. Let u be m(23). Suppose 0 = x + up - 5, -2x - p + 0 = -1. Is x greater than 5/16? False Let z(p) = -4p - 9. Let n be z(3). Let b be (140/56)/((-1)/6). Let h be 10/b331. Does h = n? False Let y be (-262)/11 + 26/(-143). Let c = 23 + y. Let j = 19/4 - 55/12. Which is greater: c or j? j Suppose 1 = r - 5p, 9 + 4 = 2r + p. Suppose 3a = ra + 5z + 34, 0 = 3a + 2z + 28. Is a <= -5? True Let t = 458 + -453. Let w be 4/(-6) + ((-35676)/(-6291) - t). Is w >= -1? True Let h be 0(-6)/(-18)1. Which is bigger: 27/884 or h? 27/884 Suppose -15t = -30t + 7620. Suppose 0 = -3x - 2v - t, -2v + 1 = -1. Is x greater than or equal to -171? True Let d be 24/84 - (-1998)/14. Let z = -140 + d. Which is smaller: z or -8? -8 Suppose 2u = 4u + 5u. Suppose 7k - 78 - 83 = u. Which is smaller: 22 or k? 22 Let q be 0(-1)/(-5) - -4. Suppose -4y + 2l = y - 1, -5y - 3 = -ql. Is y bigger than 5/6? True Let p = 74 - -212. Suppose -8f + 21f + p = 0. Let l = 32 + f. Which is bigger: l or 8? l Suppose 0 = 10r - 2r - 8. Let a = 14 + -12. Let p be (140/64 - a)/12. Which is greater: r or p? r Suppose -194 = -x - 1. Let u be 4/(-86) + 8550/8170. Is x greater than or equal to u? True Suppose 4r + 52 = 4q, 4q = q - 4r + 67. Suppose qo - 12o = -315. Which is smaller: o or -64? -64 Let d be (-473)/(-82) - ((-44)/(-132) + 15/9). Which is greater: d or 5? 5 Suppose -t = 2m - 738, 41t + 372 = m + 43t. Is m < 1100/3? False Suppose -1 = -7m + 20. Suppose 5f = mq - 5q + 745, 4q + 149 = f. Which is greater: f or 148? f Let k = 2640 - 2643. Which is smaller: k or -6? -6 Let n be 6/21 - (-8)/(-28). Let b be 2 - (-532 + 2 - -2). Let l = b - 25972/49. Which is greater: l or n? n Let q = -785 + 397. Let s = q - -388.11. Which is smaller: s or 1/14? 1/14 Suppose -4d - 5z - 416 = -151, d - 3z + 45 = 0. Let r be (-6)/(-27) + 3030/(-27). Let h be d/r + ((-9)/4 - -2). Is -38 greater than or equal to h? False Let s(r) = 2r*2 - 26r + 15. Let w(t) = t*2 - 2t. Let d(l) = s(l) - 3w(l). Let x be d(-17). Is x greater than or equal to 68? False Let x = 900 - 900. Which is bigger: -5/201 or x? x Let b(t) = 85t*3 + 2t*2 - t - 1. Let v be b(-3). Let o be 3 + 7539/v + (-4)/(-26). Suppose -4r - 16 = -12. Which is bigger: o or r? o Let q be 42/(-99) + 2/6. Let g = 115149/575495 - 10/115099. Do g and q have the same value? False Let q be 1778/126 + (-8)/72. Suppose 5n - 7v = -4v + 18, -4n = -5v - 4. Which is bigger: n or q? q Let h = 0.33 + -12.34. Let o = h - -12. Let b be ((-159)/15 + 10)/3. Which is greater: o or b? o Let d = 0.5143 + -132.5143. Which is smaller: 3/14 or d? d Suppose 68j + 44j = -4368. Suppose 0 = 2h - 2f - 130, 3f + 20 - 81 = -h. Suppose -5s = -4l - 135, 4s = 3l + h + 36. Is j >= l? True Let t = -63 + 19. Let l = -1271 - -1228. Which is greater: l or t? l Let o = 151 - 329. Let m be (4895/o)/(3/4 - 1). Which is bigger: 111 or m? 111 Let t = 8 + -9. Let w = -1.256 + 1.186. Is t less than w? True Let d be -14 + (-1 - -9 - (-16 - -28)). Is d != -68? True Let q be (0/8)/(12/(-6)) - -2649. Which is smaller: 2648 or q? 2648 Let k be (-1 + -8 + 9)/1. Let z be 0/(-3) - 3/159. Which is smaller: z or k? z Let b = -4.2 - -0.2. Let s = 97.8 + -101.99. Let t = 4.11 + s. Which is smaller: t or b? b Let x = -381453/1216 + 5970/19. Let n = -587/704 + x. Are n and 1 nonequal? True Let p be 0 - (1 - (-8)/(-6)). Suppose -2x = -7f + 321, -2x + 24 = 16. Which is smaller: p or f? p Let v = 220979 - 220939. Let o = 98 - 22. Suppose 5h + 2w = -3w + 200, 2h - o = -4w. Which is smaller: v or h? v Suppose 4p - w = 53, 3w = 3p - 25 - 26. Let f be (-1)/p-6-2. Which is bigger: f or -2/543? -2/543 Let j be 15/(61/(-184)). Is -461 != j? True Suppose 2h + 9 = 1, 0 = 4w + 2h + 20. Let i be -1w/(-9) - 7/(-21). Let r be (-5)/34/8. Is r != i? True Suppose -98 = 3q - 107. Let o be (-2)/(-3)q - (-1112)/(-558). Which is smaller: -1 or o? -1 Suppose -7h - 22h - 29 = 0. Let t be ((2/4)/h)/((-24)/276). Which is bigger: t or 5? t Let p(d) = -d2 - 5d - 6. Let m be p(-5). Suppose -47 + 19 = -14u. Suppose -ua - 2z - 22 = 0, z = a + 7 - 6. Do a and m have the same value? True Let u = -429 + 419. Let g = -12 - u. Is -18 less than or equal to g? True Let w be 0/((1 - -1) + -1). Suppose w = 17x - 22x + 35. Let h = 1883/11 + -171. Which is smaller: h or x? h Let k = 23.308 - -5710.692. Are 0.1 and k non-equal? True Let x be -6(272/(-72))/17 - (-280)/132. Let d be 30/9 + (-1)/3. Which is smaller: d or x? d Let c be 50(-1 - 0)-1 + -3. Suppose -4b - 5o + 0o = -131, -3b + 98 = 4*o. Let x = b - c. Do x and -13 have the same value? True Let l = 292/7 + -748/21. Which is smaller: 7 or l? l	{ "pile_set_name": "DM Mathematics" }
9 421 What is -23e8 (base 15) in base 3? -101111002 2487 (base 9) to base 16 745 Convert 1010 (base 4) to base 13. 53 What is 2222 (base 7) in base 5? 11200 What is 43123 (base 5) in base 3? 10222220 -145553 (base 6) to base 15 -4353 162a (base 15) to base 9 6474 1432342 (base 5) to base 7 154322 Convert -2053 (base 8) to base 3. -1110112 Convert -1002110 (base 4) to base 12. -2558 Convert 14536 (base 8) to base 2. 1100101011110 -59c (base 14) to base 5 -13433 1347 (base 10) to base 12 943 What is b9ad (base 16) in base 8? 134655 What is -211022 (base 3) in base 5? -4402 40 (base 5) to base 10 20 Convert bef (base 16) to base 5. 44210 What is 9259 (base 15) in base 4? 13202331 What is -31341 (base 5) in base 6? -13412 -4321 (base 6) to base 7 -2605 What is 3133 (base 6) in base 9? 863 What is 1216 (base 12) in base 6? 13230 What is 100124 (base 7) in base 3? 212010222 Convert 553 (base 10) to base 15. 26d Convert 103134 (base 5) to base 8. 6730 What is -b45 (base 16) in base 13? -140c 242240 (base 6) to base 11 14a81 What is 331513 (base 6) in base 2? 110101111100101 -1301321 (base 4) to base 5 -213124 Convert -1616 (base 9) to base 11. -a19 2a75 (base 11) to base 8 7562 Convert -20a59 (base 12) to base 3. -2011221220 -8b8 (base 12) to base 14 -684 Convert 12059 (base 11) to base 9. 25736 Convert 11211 (base 4) to base 12. 259 -32c (base 15) to base 9 -876 -851 (base 13) to base 6 -10322 What is -140033 (base 5) in base 15? -1a13 What is -714 (base 10) in base 11? -59a What is -661 (base 8) in base 16? -1b1 What is 4959 (base 11) in base 8? 14515 -236 (base 15) to base 11 -416 Convert 114404 (base 5) to base 12. 262a Convert -34732 (base 11) to base 12. -25015 What is 18b8b (base 12) in base 8? 106633 121311 (base 4) to base 13 9a2 Convert 131124 (base 5) to base 13. 2473 Convert -21065 (base 8) to base 9. -13010 Convert -33665 (base 9) to base 15. -6995 What is 7164 (base 8) in base 10? 3700 Convert 23135 (base 13) to base 10. 63926 Convert 11000001100011 (base 2) to base 12. 7203 Convert 441 (base 14) to base 12. 5a1 What is -2680 (base 10) in base 15? -bda -30122 (base 4) to base 14 -40a -1b7 (base 14) to base 10 -357 -641 (base 7) to base 11 -274 What is c800 (base 13) in base 7? 143543 Convert 3504 (base 10) to base 12. 2040 Convert -70 (base 12) to base 16. -54 What is -11304 (base 5) in base 12? -591 What is -451211 (base 6) in base 5? -2203004 250414 (base 6) to base 3 1010102201 -2639 (base 14) to base 13 -3097 Convert 7475 (base 8) to base 3. 12100111 What is -151 (base 12) in base 4? -3031 Convert 5944 (base 13) to base 15. 3ac7 What is 56790 (base 10) in base 13? 1cb06 -101100111 (base 2) to base 15 -18e Convert -613 (base 8) to base 10. -395 What is -33230 (base 4) in base 6? -4352 What is 2273 (base 8) in base 3? 1122212 Convert -46 (base 12) to base 2. -110110 Convert 3 (base 7) to base 15. 3 1054 (base 6) to base 12 18a What is -362 (base 14) in base 4? -22202 What is -499 (base 14) in base 15? -414 244242 (base 5) to base 9 13707 -1800 (base 9) to base 13 -81c What is 223314 (base 5) in base 16? 1f17 Convert -31010 (base 4) to base 10. -836 Convert 2225 (base 6) to base 3. 201022 Convert 5054 (base 6) to base 16. 45a Convert -611 (base 13) to base 5. -13103 -13d8 (base 15) to base 13 -1c22 -3273 (base 9) to base 10 -2415 Convert 1212440 (base 6) to base 11. 44187 Convert -3 (base 10) to base 15. -3 Convert 30246 (base 8) to base 7. 51211 What is -2055 (base 6) in base 16? -1d3 Convert 547c (base 15) to base 16. 45e4 What is 17c (base 13) in base 16? 110 500533 (base 6) to base 15 b8a6 Convert -43d (base 14) to base 9. -1132 What is cce3 (base 16) in base 6? 1042455 What is 1779 (base 11) in base 10? 2264 101011011 (base 2) to base 6 1335 What is -278 (base 16) in base 7? -1562 What is 819 (base 10) in base 8? 1463 Convert -2005 (base 6) to base 15. -1e2 What is -3545 (base 6) in base 8? -1531 Convert -100101101 (base 2) to base 5. -2201 5a6 (base 15) to base 11 a65 What is -1593 (base 10) in base 14? -81b Convert -1612 (base 7) to base 15. -2d1 1a579 (base 12) to base 16 97ad What is 2162 (base 8) in base 9? 1504 What is -13048 (base 11) in base 14? -6b4a 408 (base 15) to base 5 12113 What is a2 (base 11) in base 14? 80 What is 124444 (base 5) in base 7? 20401 -3e49 (base 15) to base 12 -7880 Convert -1742 (base 13) to base 4. -311222 2364 (base 8) to base 2 10011110100 73662 (base 8) to base 12 15896 10ecf (base 16) to base 4 100323033 What is 11cc (base 14) in base 16? c30 Convert -38 (base 12) to base 14. -32 Convert 279d (base 15) to base 8. 20431 Convert -1178 (base 11) to base 10. -1537 -7153 (base 13) to base 12 -9054 -11c (base 13) to base 14 -dc Convert -8665 (base 11) to base 3. -120200220 1086 (base 11) to base 8 2621 -47b (base 16) to base 9 -1514 -3666 (base 7) to base 8 -2533 -6484 (base 13) to base 16 -368e Convert 84 (base 11) to base 9. 112 -13524 (base 8) to base 5 -142342 -15053 (base 9) to base 11 -7782 Convert 33774 (base 9) to base 10. 22504 -40412 (base 7) to base 6 -113225 Convert -2110 (base 5) to base 8. -430 Convert -131 (base 13) to base 5. -1314 Convert -1000010010 (base 2) to base 15. -255 What is 102220112 (base 3) in base 11? 6582 What is 8a8b (base 12) in base 9? 23068 3712 (base 11) to base 15 1688 What is -bfa (base 16) in base 15? -d96 Convert -1110000101 (base 2) to base 8. -1605 Convert 214 (base 15) to base 10. 469 Convert -704 (base 8) to base 14. -244 Convert -5 (base 15) to base 3. -12 Convert -2957 (base 10) to base 12. -1865 Convert 1030 (base 11) to base 10. 1364 1103 (base 6) to base 15 120 37 (base 10) to base 13 2b 4c0 (base 14) to base 11 796 What is 133 (base 12) in base 13? 111 What is 12220231 (base 4) in base 3? 1101021201 Convert -2454 (base 7) to base 6. -4133 -4451 (base 7) to base 14 -828 What is 9b2 (base 16) in base 9? 3357 What is -270 (base 9) in base 3? -22100 Convert -42120 (base 5) to base 4. -223201 Convert 546 (base 12) to base 14. 3d4 What is 32242 (base 6) in base 14? 1878 14051 (base 7) to base 3 12020002 -21558 (base 12) to base 2 -1010101111010100 Convert 302553 (base 7) to base 8. 144276 What is -5217 (base 11) in base 3? -100111010 What is -163 (base 15) in base 5? -2233 What is -66b4 (base 13) in base 14? -5327 Convert 1020121 (base 3) to base 5. 12112 Convert -41a (base 16) to base 11. -875 2041110 (base 5) to base 13 12581 Convert -25134 (base 7) to base 14. -258b -16b (base 12) to base 11 -197 Convert -11343 (base 5) to base 14. -448 What is -400 (base 12) in base 4? -21000 Convert c5a5 (base 13) to base 15. 817e What is -3769 (base 10) in base 15? -11b4 Convert -222330 (base 6) to base 15. -581c 195 (base 10) to base 2 11000011 22342 (base 5) to base 10 1597 Convert -2aa (base 11) to base 9. -442 198a (base 11) to base 16 9d6 What is -3755 (base 10) in base 14? -1523 What is 711 (base 9) in base 6? 2401 What is 2565 (base 7) in base 8? 1722 3656 (base 9) to base 10 2724 Convert 61228 (base 10) to base 15. 1321d Convert 345 (base 8) to base 6. 1021 Convert 12411 (base 5) to base 10. 981 What is -1004 (base 10) in base 16? -3ec Convert 1218 (base 11) to base 2. 11000111000 What is -2656 (base 7) in base 8? -1775 -92bb (base 14) to base 15 -7738 -5442 (base 12) to base 4 -2100302 Convert -2388a (base 13) to base 5. -4041204 What is 2471 (base 11) in base 14? 1264 Convert 103a3 (base 12) to base 10. 21291 What is -37919 (base 10) in base 13? -1434b What is 2a0a (base 14) in base 10? 7458 -40136 (base 7) to base 12 -5728 Convert 24608 (base 9) to base 15. 4d72 Convert 4696 (base 14) to base 9. 17758 What is -1000200 (base 3) in base 2? -1011101011 308 (base 9) to base 8 373 What is -2e82 (base 16) in base 14? -44a6 Convert -186 (base 15) to base 5. -2401 -54a (base 14) to base 13 -626 -81c9 (base 16) to base 5 -2030400 What is -1200200 (base 3) in base 14? -641 What is 4177 (base 9) in base 11? 2339 What is -204 (base 14) in base 3? -112200 103430 (base 5) to base 16 e1f -12041 (base 5) to base 16 -380 Convert a5c (base 15) to base 5. 33322 What is 857 (base 11) in base 7? 3001 Convert -35655 (base 7) to base 11. -6a51 30a (base 14) to base 10 598 -3102 (base 5) to base 9 -486 -112220021 (base 3) to base 4 -2221231 -14304 (base 5) to base 4 -102310 2	{ "pile_set_name": "DM Mathematics" }
a composite number? True Let f(b) = -b*2 - 20b - 15. Let q be f(-19). Suppose 3546 = 3w + 2w + qm, m = 3w - 2131. Suppose -3c + 4163 - w = 0. Is c a composite number? False Suppose -87i - 5d - 189621 = -89i, -3i + d + 284438 = 0. Is i composite? True Suppose 35532 = -7a + 123515. Is a a prime number? True Suppose -190114 = -9z - 45727. Is z a composite number? True Let b = 4299 + -1481. Suppose 5x = 2t - 10939 + b, 0 = -4t - 2x + 16302. Let d = t - 2712. Is d prime? True Let o(c) = -c - 82c*2 + 206c*2 - 35 + 36. Let i be o(-1). Is (i/4 - 2)(2 - -12) a composite number? True Let l be 16 - (-5)/((-5)/(-6)). Suppose 112745 = ly - 12281. Is y a composite number? False Let f be ((-18)/(-12) + -1)6. Let g = f - -28. Suppose 39 + g = 2s. Is s composite? True Suppose 8a - 25 = -5h + 3a, 15 = 3h + 4a. Suppose -22995 = -hw + 37490. Is w prime? True Let y(p) be the third derivative of -p6/15 - p5/20 - 5p*4/24 - 7p3/6 + p2. Let f be (-4)/26 - (-126)/(-26). Is y(f) prime? False Suppose 125179 = 5l + 7l - 397697. Is l a composite number? False Let g(f) = -2f + 6. Let m be g(5). Let j(i) = i2 - 61i + 338. Let q be j(55). Is -2(955/4)/(m/q) a prime number? False Suppose 12p = -2077 - 1427. Is (885/(-20))/3p prime? False Let w be 18577/(-6) - (-280)/(-336). Is (-1)/(-2) - (w/2 + 6) a prime number? True Let n(t) = 2t*2 - 10t - 2545. Let i(y) = -4y2 + 21y + 5092. Let h(x) = -4i(x) - 9n(x). Is h(0) a prime number? False Is ((-15)/(1530/1418327))/((-11)/(-6) + -2) prime? True Let w = -570330 + 2675629. Is w composite? True Let g be ((7200/27)/10)/(2/6). Suppose gw - 81w = -9533. Is w composite? False Suppose -3t + 3o + 24 = 0, 4t - 2t + 4o = 4. Suppose 4s = h + 16, ts - s - h - 19 = 0. Let b = s - -16. Is b composite? False Let k(z) = z2 - 10z + 17. Let p be k(7). Let x = 2 - p. Suppose -xr + 0r = -1164. Is r a prime number? False Let c(d) = 4099d3 + 194d*2 - 581d + 5. Is c(3) composite? False Suppose 0 = -97n + 94900940 + 57375606 + 2391603. Is n prime? True Suppose -4l - 93 = -2h + 417, 2h - 494 = -4l. Suppose 9o - 1178 = -h. Let x = 350 - o. Is x composite? True Let l be (-4026)/10 - ((-18)/30 - -1). Let u = l - -679. Let s = u - 65. Is s prime? True Suppose -13033 = -5q + 5z + 4832, 4z - 3563 = -q. Let f = q - 1053. Is f composite? True Let v(y) = -2y*3 - 16y*2 - 30y + 12. Let a be v(-5). Let h(x) = 3x3 - 9x*2 - 31x + 25. Is h(a) a composite number? False Let h = 176 + -174. Suppose 26x + 2p = 21x + 26085, 10413 = hx + 5p. Is x prime? False Suppose -59q - 30 = -69q. Is 3132 + q5/(-3)-1 composite? False Let j = -658871 + 1031742. Is j a prime number? True Let l(u) = 2u*2 + 44u + 47. Let b be l(-21). Suppose f = -3a + 53, -18a + 265 = bf - 20a. Is f prime? True Suppose 0 = 2y + 21 + 11. Let z be 1 + (11/4 - (-12)/y). Suppose 0 = -4c - w + 2365, -zc - w = 2c - 2956. Is c a prime number? False Let c = -13533 + 7956. Let k be ((-6)/10)/(-4 + c/(-1395)). Is (-49)/(-49) - -22(k + 0) prime? False Suppose 0 = -4t + 12t + 25064. Is (4 + 0)(-1 + 2) - t composite? False Let g(t) = -45t3 - 14t*2 - 20t - 6. Let v(n) = 15n3 + 5n*2 + 7n + 2. Let a(f) = -6g(f) - 17v(f). Let q be a(-1). Is (-2443)/q + 20/150 prime? True Suppose 60k = 40k + 516580. Is k a prime number? False Let o(i) = -i*3 + 10i*2 - 5i - 29. Let b be o(10). Let r = -64 - b. Is 1111/2 - r/(-10) prime? True Let s be 2266/6 + 1(-2)/(-6). Let u be (-1 + (-3149)/(-1))s/108. Suppose 5a - 27590 = o, 4o = a + a - u. Is a composite? False Let w(p) = -59p2 - 2p - 1. Let d be w(-1). Let f = -51 - d. Let i(l) = 2l2 - 4l - 5. Is i(f) a prime number? False Let y be -165988(((-27)/(-4))/3 + -3). Suppose 3b - y = -3o - 10347, 38028 = b + 5o. Is b a composite number? False Is 10 + -12 + (-14598)/(-2) composite? False Is -6(-9)/(-135) - (-168794)/10 prime? True Let u be -5 + -75116/(-28). Suppose i + 585 = 2i - 5z, 1 = -z. Let c = u - i. Is c prime? False Suppose 16 = -6t + 10t. Suppose -th + 567 = -3q - 536, -3h - 1110 = 3q. Let l = -148 - q. Is l prime? False Suppose w - 140330 = -g + 33069, -5g = -3w + 520165. Is w a composite number? True Let o(h) = -185h - 344. Let i be o(-2). Suppose 6g = 2g + 2160. Suppose -i = -z + g. Is z prime? False Suppose 84d = 115d + 120d - 13722427. Is d prime? False Let g(i) = i*2 - 50i - 464. Let a be g(58). Suppose -5c - 3d + 2d = -21, -2c - 5d + 13 = 0. Suppose cb + 6b - 770 = a. Is b composite? True Suppose 2 = -t + 4g - 8, 10 = 2t + 2g. Suppose -tm = 1 - 5. Suppose -p + 106 = mu, 3p - p - 59 = -u. Is u composite? True Suppose 3g - 2g + 20 = -4l, -2g - 8 = 0. Let r be (8/6)/l23442. Is (34/(-6))/(4/r) a composite number? False Suppose 0 = -2i + 473 - 165. Suppose 18v - i = 16v. Is v a composite number? True Suppose -4p - 19424 = -2k, -5 = -p - 1. Suppose s = -4o + 3224, -k = -3s + 4o - 0o. Suppose 0t + 4t = s. Is t a composite number? False Suppose -43380519 - 19102916 = -35t. Is t prime? True Let j be (-8)/40 - 1/(10/8268). Let k be (-1 - 10/2) + -1714. Let a = j - k. Is a prime? False Let r(i) be the first derivative of 2i*3 + 17i*2 - 13i - 121. Is r(-24) a composite number? True Let g = 13146 + -6532. Suppose 12083 + g = 7m. Is m a prime number? True Let f = 102 + 203. Let o = 1417 + -1561. Let r = o + f. Is r a composite number? True Let t(u) = u2 - 2u - 15. Let x(w) = -w*3 + 2w*2 + w - 2. Let r be x(1). Let q be t(r). Let c(b) = 2b*2 + 4. Is c(q) prime? False Let j = 4666 - 6816. Let s = j + 3667. Is s prime? False Suppose 5i + 168219 = 4x, -7x = -5x - 3i - 84107. Is x a prime number? True Suppose -12k - q + 37666 = -11k, 5k + q - 188310 = 0. Is k a prime number? False Let r(q) be the third derivative of 439q*4 - 13q*3/6 + 3q*2 - 1. Is r(2) a composite number? False Let a = 933 + 23230. Is a prime? False Suppose 0 = -0a - 3a. Suppose a = 20y - 27y + 19040. Suppose -3d = 4v - y, 4287 - 856 = 5v - 4d. Is v a composite number? False Let l be -147(-10)/60(-4)/(-7). Suppose -p + 2q = -1639, -15q + lq - 1 = 0. Is p composite? False Suppose -15x - 38x = -14x - 1773759. Is x composite? False Suppose 11677 = -2b + 2267. Suppose -4n - 10a - 28260 = -6a, 0 = -4n + 5a - 28233. Let g = b - n. Is g a composite number? False Let d(i) = -5i*3 - 3i*2 + 1. Let z be d(-1). Let f(l) = 46l - 5. Let h(n) = 45n - 6. Let c(w) = zh(w) - 2f(w). Is c(9) a composite number? False Let z(i) = -157i3 - i2 + 3i + 9. Let q be 2/4(-8 - (4 - 4)). Let x be z(q). Suppose -x = -4r + 3383. Is r a composite number? True Is (-8 - 1) + (-28 - -36) + 17724 a prime number? False Is (4 - -3 - 14) + 197114 + -10 composite? True Let d = 15537 - -10207. Let k = -37396 + d. Let s = -5983 - k. Is s prime? True Suppose 2l - 8 = 0, 2m - 2l + 1722990 = 9090864. Is m a prime number? True Let g = 406236 - 139153. Is g a composite number? True Let s(k) = 3754k - 6713. Is s(15) a prime number? True Suppose 43n + 269848 = 51n. Suppose -3r = -10x + 8x - n, 22491 = 2r - 5x. Is r a prime number? True Is (-18 - (-2192476)/39)1/(2/3) a prime number? True Suppose u + 3z - 7472 = 0, 3u - 6z - 27898 = -5587. Is u composite? False Let a = 0 + 0. Suppose -5g = 13g - 10026. Suppose ah - g = -h. Is h prime? True Suppose -19a + 80 = -15a. Suppose 3h + a = 8h. Is h/(-16) + ((-8082)/(-8) - 1) prime? True Suppose -4v = 5g - 71, 27g - 24g = -v + 16. Let r(t) = -1 - 4 + 18 + 29 + 3t*2 - 8t. Is r(v) a composite number? True Suppose -y + 191315 = 3q, -14q + 765204 = 4y - 16q. Is y composite? True Suppose 94d + 66d = 53d + 102421577. Is d prime? True Let j be ((-9)/15)/((-138)/45 - -3). Let x = 12 - j. Suppose 0 = xa - 7a + 884. Is a a prime number? False Let n be ((-304)/12)/(1/(-6)4). Let k(r) = -nr + 49r + 51r - 1. Is k(18) a prime number? False Let d(v) = 158v*2 - 6v + 4. Let w be d(5). Suppose 12o + w = 18o. Suppose -o = -4k - 0h + h, -5h = -k + 173. Is k prime? True Suppose 0 = -102g + 93g + 18. Is (-3562 - 1)(g - 3)1 composite? True Let v be -2 - (4359 - 1) - 21. Let h be (1 - 16/28) + v/(-14). Suppose -h = -y - i, 5*y - 1035 =	{ "pile_set_name": "DM Mathematics" }
(-7/5)z)/z)/(z/(z/(((z/z(-2/9))/z)/zz)z)) assuming z is positive. z(23/45) Simplify (j(-1/20)/(j3/j))/(j(2/5)/(j(-7)j)) assuming j is positive. j(-169/20) Simplify (v/v(-2/5))(7/13)/(v(2/13)v(2/13)) assuming v is positive. v(29/65) Simplify ((l(-1))(14/5))50 assuming l is positive. l(-140) Simplify (xx*(4/5)x)/x(1/4) assuming x is positive. x(51/20) Simplify www/(ww18www)(ww/(w/w*(-14/9)w))/w assuming w is positive. w*(-194/9) Simplify (ff/f*(3/2))/(fff(f/(ff(2/7)ff))/f)f*0f(1/4) assuming f is positive. f(29/28) Simplify m/m*(3/10)m(2/83)/m assuming m is positive. m(-229/830) Simplify (p/(p(-1/9)/p))/p1 assuming p is positive. p(10/9) Simplify (b2b)/b(-1)b(2/9)/b3 assuming b is positive. b(11/9) Simplify (r(1/3))(-47) assuming r is positive. r(-47/3) Simplify (o(-1/7)/o(2/19))/(o/(oo/(oo(-2/5))))(-20/9) assuming o is positive. o(-1361/1197) Simplify s(-5/6)/((s/(s/(sss*(-4/3))))/s) assuming s is positive. 1/sqrt(s) Simplify t(t*(23/3)t)/tt(-1/9)t assuming t is positive. t*(86/9) Simplify k/(kk/k*(1/9)k)k/k(-8/3)((kk(-4/7)/k)/k)/(kkk/((kkk(5/2))/kk)) assuming k is positive. k(215/126) Simplify ((n/n0n)/nn)*(-4/5)n(1/4)/n5 assuming n is positive. n(-127/20) Simplify (v(-3/7)/v(-5))/(((v6v)/v)/(v(v/(vv(-2/3)vvv)v)/vvv)) assuming v is positive. v(-16/21) Simplify (d(-34))(-11/6) assuming d is positive. d(187/3) Simplify (yy/(yy(-1/4))y)/(yyy*(2/11)yy) assuming y is positive. y(-85/44) Simplify ((f(-1)f)(14/9))(-42) assuming f is positive. 1 Simplify x*12/xxxx/(xxx*(-2/9)x) assuming x is positive. x(101/9) Simplify n(-14)/nnn(-19) assuming n is positive. n(-33) Simplify (h*(-2/19)/(hh*(1/3)h))/(h*3hh/(h/(h(-7)h))h) assuming h is positive. h(-82/57) Simplify (a(-4)a(-6/5))46 assuming a is positive. a(-1196/5) Simplify ((r(-2/5)/r)/rr1/r)/((r/(rrr(-1)r)r)/r(-2/9)) assuming r is positive. r(-118/45) Simplify (ll*(-5)ll)/(ll/(l/(l/(l(3/4)/l)))) assuming l is positive. l(-17/4) Simplify ((p/p*12pp)/p(3/2))48 assuming p is positive. p(-504) Simplify (g/(ggg/(((g/g(9/5)g)/g)/g)g))/g(2/3) assuming g is positive. g(-82/15) Simplify vv*(2/37)vv(-12)v assuming v is positive. v(-331/37) Simplify (x(2/5)x/x(1/11))(-15/4) assuming x is positive. x(-54/11) Simplify (y19)(1/16) assuming y is positive. y(19/16) Simplify (p(-7))(-1/27) assuming p is positive. p(7/27) Simplify g(-24)/gg(-3/5) assuming g is positive. g(-128/5) Simplify (a(2/9))33 assuming a is positive. a(22/3) Simplify j(1/3)j/j(1/2)jj(j8/j)/(j/j(-2/3)jj) assuming j is positive. j(37/6) Simplify (k(-4)k(2/17))(-2/57) assuming k is positive. k(44/323) Simplify b(-4/7)bb14 assuming b is positive. b(101/7) Simplify (o/(oo/(o/o*(3/7))o)(oo*(-2))/o)/(oo/o*0o2) assuming o is positive. o(-52/7) Simplify (x/((xx/(x(-1/4)x))/xx))/x6(xxx/(x5/x))/x(-5/2) assuming x is positive. x*(-19/4) Simplify ((ppp(4/25))/p)/(p((ppp(-2/5))/p)/p) assuming p is positive. p(14/25) Simplify h*(11/5)/hh7 assuming h is positive. h(41/5) Simplify t*(-2)/(tt/t*(-2/29))t*(-3)t(-5) assuming t is positive. t(-350/29) Simplify (c(c(c/(cc/(c9/c)))/cc)/cc10)(1/22) assuming c is positive. c(9/11) Simplify (s/(s(6/11)s)s(-2))/(s(2/3)/((s/(s(2/5)/s))/s)) assuming s is positive. s(-431/165) Simplify b1/(b/b0)(b*(-1/3)b)/(((b/b(-3))/b)/b) assuming b is positive. b(-4/3) Simplify aa(-4)(a/a*2)/a(a1)(1/36) assuming a is positive. a(-179/36) Simplify ((y/(y(2/15)/y))/(y1/y))(-24) assuming y is positive. y(-224/5) Simplify (d/d(2/3)dd)*(1/22)(d/(d/(dd(-9)d)))/d1 assuming d is positive. d(-521/66) Simplify (v/v*(-5)v)/v*(-2/9)v*(1/3)vv(-2) assuming v is positive. v(59/9) Simplify ((g26/g)/g)/(g8/g) assuming g is positive. g17 Simplify x/(x(-4/13)x)x/x(29/3) assuming x is positive. x(-326/39) Simplify (a(-8)a/(a/(a/(a/a*(-10)a))))/(a(a/a(2/7)a)/aaa/(a/(((aa6a)/aaaa)/a))) assuming a is positive. a(-215/7) Simplify (j(2/9)/j)(-5) assuming j is positive. j(35/9) Simplify m(1/3)m/(m*(-5/8)mm) assuming m is positive. m(-1/24) Simplify p(1/2)pp(p/((p/p*(-1)p)/p))/pp(-4)/(p/(p/((p/p(-8/3))/p))p) assuming p is positive. p(-43/6) Simplify (g(-10/3)/gg)(12/7) assuming g is positive. g(-40/7) Simplify n12/(n(-8)n) assuming n is positive. n*19 Simplify (ii*8/ii(ii(3/4)/i)/i)/(i(-8)/(ii(1/4)i)) assuming i is positive. i*19 Simplify ((o(o/o*22)/o)/oo)/((o/o(-2/13))/o) assuming o is positive. o(-275/13) Simplify (t/((t*(-10/17)t)/t))/t(-4) assuming t is positive. t(95/17) Simplify ((d/(d*8dd)dd)/(d(-3/10)/d))/((d(dd/d6)/d)/d(-2)) assuming d is positive. d(-37/10) Simplify v(-7)vv(-4/9)/v(v/v(-7))/(v/(v/(v/((((v(-1/4)v)/v)/v)/v)))) assuming v is positive. v(-97/36) Simplify (z(-1))(-37)(zz(2/7))(-2/17) assuming z is positive. z(4385/119) Simplify ((ww*(-7/4)w)/w1)21 assuming w is positive. w*(-63/4) Simplify (ttt(2/7)t(t((t/(t*0t)t)/t)/t)/t)/(t/(tt/t*(3/5))tt7) assuming t is positive. t(-186/35) Simplify g3/g(3/2)g4/(g2/g) assuming g is positive. g(9/2) Simplify ((x(2/3))(8/11))(2/45) assuming x is positive. x(32/1485) Simplify (h(-2))*(-23)((h/(h*(2/5)h))/h)/(h*(-4)/hh) assuming h is positive. h(243/5) Simplify ((m/(m/m9))/(mm6/mm))/((m/(mm(-4)))/m((m/(mmm/(mm(mm/(m/(m/(mm*(2/5)/mm)))mm)/mm)))/m)/m) assuming m is positive. m(-8/5) Simplify ((tt*(-6)tt)/(t/((tttt/t*(-3/13)t)/tt)))(-1/13) assuming t is positive. t(-16/169) Simplify (((ooo(-1/4)oo)/oooo)(36/5))(4/3) assuming o is positive. o(276/5) Simplify ((q11/q)/q*(2/15))/(q/(q/(qq*(-1/3))q))37 assuming q is positive. q(111/5) Simplify (z(1/4))20/((zz(-2))/zzz/(zz/(zz(-6)z))z) assuming z is positive. z10 Simplify (l(-1/9))37 assuming l is positive. l(-37/9) Simplify (vv*(-1)vv)4/(v(-1/3))(-22) assuming v is positive. v(2/3) Simplify (ttt(-2/11)tt5)(-8) assuming t is positive. t(-688/11) Simplify y3/(y(1/19)/y) assuming y is positive. y(75/19) Simplify z/z(-2/29)zzz*8z assuming z is positive. z(350/29) Simplify (d/(d(-1)/d))(-3/20)/(d(2/9))(4/33) assuming d is positive. d(-2833/5940) Simplify (h36)(2/51) assuming h is positive. h(24/17) Simplify ((h/h(21/2))/(h/((hh14)/hh)))(10/3) assuming h is positive. h15 Simplify (b9/b)(-4/15) assuming b is positive. b*(-32/15) Simplify (c/(ccc/(cc(-2/11))))(-26)/((((c*(1/9)/c)/c)/c)/cc/((c/(cc3c))/c)) assuming c is positive. c*(2833/99) Simplify ii*(-6)ii(-33) assuming i is positive. i(-37) Simplify (d(-1))(-29) assuming d is positive. d29 Simplify (jj*5j*(-1/4)j)/(j((j/j(-2/3))/j)/j)(1/5) assuming j is positive. j(397/60) Simplify ((cc/(c/c*(1/3))c)/c*(-1/7))/((cc*(-1/5)/c)/(cc*(-2/21)c)) assuming c is positive. c*(481/105) Simplify ((v((v*(-1)v)/v)/v)/v)*(-32)/(v((((vv1)/v)/v)/v)/vv)(-2/23) assuming v is positive. v64 Simplify (j/(j*(-7)/j))/jj*(-4)j((j(j*(1/2)j)/j)/j)8 assuming j is positive. j9 Simplify r/r*(-20)rr(3/16) assuming r is positive. r(355/16) Simplify ((ff/(ff10))/f(-4))/((f(-2/17)f)/(f(1/17)/f)) assuming f is positive. f(-116/17) Simplify (n/(n*(2/3)n))/(n*(1/4)/n)(((nn(-3)n)/n)/n)/(n/(n/n(1/3))) assuming n is positive. n(-13/4) Simplify (hh(1/4))26/(h(1/4)h)(7/3) assuming h is positive. h(355/12) Simplify (mm/(mm*(-2/11))mm)/((mm(-20))/m) assuming m is positive. m(255/11) Simplify (t(1/4)/t)(-2) assuming t is positive. t(3/2) Simplify (d1)*12(d(d/(d(-1/5)/d))/d)/(d0/d) assuming d is positive. d(76/5) Simplify (oo*(-8/9))/(oo3) assuming o is positive. o(-35/9) Simpli	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.