Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
st value? (a) -3/2 (b) 2 (c) 6160 (d) 4 (e) 0.4 (f) -0.1 e Which is the biggest value? (a) -23 (b) 2/5 (c) 76 c What is the fifth biggest value in 2/9, -3014, 5, -3, 3/7? -3014 What is the biggest value in -0.3, -1/11766, -9? -1/11766 What is the second smallest value in 2/15, -2.3, -1/52, 2? -1/52 Which is the fourth smallest value? (a) 6.35 (b) 0.2 (c) -5 (d) 68 d Which is the second smallest value? (a) 123 (b) -0.06 (c) 1 (d) 2/19 d Which is the second biggest value? (a) -0.22 (b) -1 (c) 175.39 a What is the second smallest value in 218, 0.3, -7, 1, 0.5, 0.03? 0.03 What is the third smallest value in 2/13, -4, -4/1399, -2, 0.4, -1/2? -1/2 Which is the second smallest value? (a) 6/7 (b) -0.4 (c) -8.2 (d) -5 (e) -2/7 (f) -2/3 d What is the fourth biggest value in -5, 0.087, -4/3, -1/46? -5 What is the third biggest value in 2, 0.01, 1018, 9, 4? 4 Which is the fifth biggest value? (a) 1/5 (b) 16 (c) -2 (d) -9 (e) -1/5 (f) 1.1 c What is the second biggest value in -3/5, 1, -2, -10, 0.2, 473? 1 Which is the second smallest value? (a) 0.1 (b) 9.37 (c) 1 (d) 1/3 (e) 0.4 (f) -2/25 a What is the third smallest value in 35/2, 1.14, -40? 35/2 What is the fourth smallest value in 0.09, -0.3, -37, 1.58? 1.58 Which is the smallest value? (a) -6 (b) 1/3 (c) -0.069 (d) -1/16 (e) -1/4 (f) -2 a Which is the smallest value? (a) 2 (b) 11 (c) -18/13 c What is the fourth smallest value in -6, 0.4, -2, -82? 0.4 Which is the fourth biggest value? (a) 0 (b) 3 (c) 16043 (d) 2 a Which is the smallest value? (a) -11 (b) -406 (c) 5 b What is the fifth smallest value in 2, -2/15, 8, 79, 0? 79 Which is the biggest value? (a) -325 (b) 3/2 (c) 0.27 b What is the fourth smallest value in 2, 35, -5/4, 1/6, -4? 2 Which is the biggest value? (a) 1/8 (b) -2/9 (c) -10 (d) -1 (e) 3 e What is the fifth biggest value in -1/7, 1, -3, 79, 3/4? -3 Which is the fourth smallest value? (a) -0.02 (b) -3 (c) -2/1161 (d) 7 d What is the second smallest value in 0.15, 4/5, -2, 23/14, -5, 4? -2 What is the third biggest value in 5, 3, 1.747, 1? 1.747 Which is the biggest value? (a) -0.06438 (b) 6 (c) 1/5 (d) -3 b What is the second smallest value in -15240, 1/6, 3? 1/6 Which is the third biggest value? (a) 5 (b) -4 (c) -2 (d) -2673/7 b Which is the fourth smallest value? (a) -2 (b) -4 (c) -0.1 (d) -0.5 (e) -18 d Which is the third biggest value? (a) 0.3643 (b) -6 (c) 6/7 b Which is the second biggest value? (a) 7 (b) -0.1 (c) -2 (d) -884 (e) 2/3 e What is the smallest value in 66/73, 20, 2/5? 2/5 Which is the second smallest value? (a) -0.4 (b) 0.3 (c) -1 (d) -2626.2 c What is the fourth smallest value in -2/5, -203, 155, 0.2, -3? 0.2 What is the fifth biggest value in -0.18, 712, -2, 2/11, -0.2, 2/3? -0.2 Which is the biggest value? (a) 0.03 (b) -2 (c) 0.18 (d) 69 d What is the third smallest value in -0.055, -0.04, -0.3, -3.5, 2? -0.055 What is the fourth biggest value in -1, 442, -3, 6, -4? -3 What is the second smallest value in 1/2, 11551, -0.4, -10? -0.4 Which is the fifth biggest value? (a) 0.4 (b) -0.07 (c) 88 (d) 0.1 (e) -0.2 e Which is the fifth smallest value? (a) -4/17 (b) 137/5 (c) 4/5 (d) 5 (e) 2/9 (f) 0.2 d Which is the third biggest value? (a) -5 (b) -53 (c) -4 (d) 3 (e) -58 a What is the second biggest value in -3, -1, 66.972? -1 What is the third smallest value in 145, -1/4, -16, -0.3? -1/4 What is the third biggest value in 662/7, 0, 1/11? 0 Which is the biggest value? (a) 1003 (b) -14 (c) -6 a What is the second smallest value in -14354, 0.2, 2/33? 2/33 Which is the second biggest value? (a) -3 (b) -0.03 (c) 18.09 b Which is the second smallest value? (a) -0.3 (b) 2 (c) 3 (d) -2/7 (e) -7/4 (f) -1 f What is the second smallest value in 1/5, 2.3248, -4/3? 1/5 What is the third biggest value in -1/7, -1, -0.1, -0.08, -0.5, -0.4? -1/7 Which is the biggest value? (a) -0.3 (b) -4 (c) 0.9 (d) -3 (e) 2 e What is the fourth smallest value in 0.3, -0.8, 0.2, -6/307? 0.3 What is the fourth biggest value in -5, 5/6, -418, -0.1? -418 Which is the second smallest value? (a) -0.1 (b) -1.0542 (c) -39 b What is the second biggest value in 80, 0.088, -3, 4, 0.3? 4 Which is the third biggest value? (a) 1/3 (b) 4 (c) -0.2 (d) -3/2 (e) -5 (f) -66160 c What is the third smallest value in -0.1, -2/9, 0.5, -39/7, 2? -0.1 Which is the second smallest value? (a) -4 (b) -0.07 (c) -2149 (d) 2/3 a Which is the second smallest value? (a) -58/7 (b) 0.4 (c) -1/16 (d) -3 (e) -4/33 d Which is the biggest value? (a) 3 (b) 270 (c) -2/7 (d) 0.1 b Which is the fifth smallest value? (a) 0.1591 (b) 12 (c) -0.2 (d) 5 (e) -3/2 b Which is the fifth biggest value? (a) -0.1 (b) -39 (c) 0 (d) 15 (e) 2 b Which is the third smallest value? (a) -2437/3 (b) -1/106 (c) 2/3 c What is the third biggest value in 1, 18, -2/9, -5, 52? 1 What is the smallest value in -5/4, -0.5, 1433, -0.2? -5/4 Which is the third smallest value? (a) 1/13 (b) 6/49 (c) -5 (d) 4/7 b What is the biggest value in -643, -129, 0.5? 0.5 Which is the fourth biggest value? (a) 33 (b) 0.4 (c) 2/21 (d) 4 (e) -8/17 (f) 3 b What is the second smallest value in 2/285, -2/5, 1, 2/11, -1/3? -1/3 What is the fourth biggest value in -0.6, -65, 1/6, 1024? -65 What is the biggest value in 113, -1, 5, -0.3, 0.4? 113 What is the third smallest value in 6, -3, 2/15, 5? 5 Which is the fourth smallest value? (a) 1/2 (b) 0 (c) 0.32 (d) -2/3 (e) -3/2 (f) -6 b Which is the second smallest value? (a) -0.06 (b) -5 (c) 0.1928 a Which is the smallest value? (a) 2294 (b) 6/7 (c) -7/4 c Which is the third smallest value? (a) 9 (b) 2/13 (c) 3 (d) 1 (e) 0.1 d What is the second smallest value in -131, -3, 0.8, 0.4? -3 What is the second biggest value in 0.08, 2/35, 5.8? 0.08 Which is the second biggest value? (a) -2/9 (b) 48.9 (c) -0.4 (d) 2 d What is the fourth smallest value in -0.15, -1, 256, -5, 2? 2 Which is the biggest value? (a) 0.4 (b) -3/4 (c) -31 (d) -1715/2 a What is the second smallest value in -1/6, 0.5, -3/11, -8, -41, 0.3? -8 What is the fifth smallest value in -0.5, -5/4, -3/11, -11, 17? 17 Which is the second smallest value? (a) -0.263 (b) 0.2 (c) 0.3 (d) -160 a Which is the fifth biggest value? (a) -3/5 (b) -7 (c) 3 (d) 125 (e) 0.1 (f) -5 f Which is the third smallest value? (a) -1/10 (b) 11 (c) -3 (d) 0.009 (e) -5 a Which is the second smallest value? (a) -1.2 (b) -0.3 (c) -2/15 (d) -2/61 (e) -1/3 (f) -0.15 e What is the biggest value in -0.2, 3/7, 3/13, 1311? 1311 Which is the third smallest value? (a) -1/2 (b) -2.5 (c) 13/2 (d) 36/5 c Which is the second biggest value? (a) 0.4 (b) 2/51 (c) 292 (d) -5/3 (e) -2/5 a What is the fourth biggest value in 1, -0.72, -0.24, 0.2, 8? -0.24 What is the smallest value in 3/8, 0, 3, 1.4? 0 Which is the smallest value? (a) -86 (b) -22 (c) -6 (d) -1 a What is the biggest value in -9, 52/71, 1, -0.3? 1 Which is the third biggest value? (a) -1/11 (b) -139 (c) -4 (d) 4 (e) 0.19 (f) 1 e What is the fifth smallest value in 1, -197, -7/13, -0.1, -5, -3? -0.1 Which is the fifth biggest value? (a) -0.1 (b) 1/2 (c) -278/7 (d) -0.2 (e) -2/9 c Which is the third smallest value? (a) 39 (b) 4 (c) -281/31 (d) -0.2 (e) 0.4 e Which is the fourth smallest value? (a) -3/4 (b) 5 (c) -22 (d) 326 d Which is the fourth smallest value? (a) 0.20969 (b) -4 (c) -3 (d) 3 d What is the fourth smallest value in 5, -0.5, 0.07, -10, -3? 0.07 What is the fourth smallest value in -0.6, -5, -15/2, -28? -0.6 Which is the fourth smallest value? (a) 4 (b) 0 (c) 1/3 (d) 65 (e) 5 e Which is the smallest value? (a) 4 (b) -0.4 (c) -0.0842583 b Which is the fourth biggest value? (a) -4 (b) -5 (c) -4497 (d) -11 c Which is the biggest value? (a) -18 (b) 5 (c) 2/3 (d) 253 d Which is the fifth smallest value? (a) -65 (b) 2 (c) 4 (d) 1 (e) 28 e What is the second biggest value in -266, -352.5, 3, -1? -1 What is the second biggest value in 13, 1.45, 0.2? 1.45 Which is the fifth smallest value? (a) -3 (b) 0.3 (c) -1/2 (d) -14077 (e) -2/5 b What is the fifth biggest value in -4/5, -5, -0.02, 1	{ "pile_set_name": "DM Mathematics" }
= f + 4. Let c(i) be the first derivative of -4 - 3 + 3 - i. Give -6c(v) - n(v). -v + 2 Let x(c) = -c2 + 1 + 0c*2 - 5c + 2c + 0c. Let k(y) = 2y2 + 7y - 2. Let j = 5 - 8. Let l = -13 - j. Calculate lx(g) - 4k(g). 2g2 + 2g - 2 Let t(p) = 2p3 + 5p*2. Suppose a + q - 6 = -3, a - 3 = -5q. Let d(h) = -4h2 - h3 + 4h - 4h. Give at(l) + 4d(l). 2l3 - l2 Let w(z) be the first derivative of 5z2/2 + 5z - 1. Let g be (-2)/5 - (-27)/5. Let x be g/(5/24) - 2. Let p(i) = -i - 1. What is xp(d) + 4w(d)? -2d - 2 Let w(s) = 5s + 1 + 4s - 5s. Let g be 66/15 + (-4)/((-80)/12). Let t(j) = 6j + 2. What is gt(a) - 8w(a)? -2a + 2 Let l(y) = -4y3 + 5y*2 - 2y + 5y3 - 3y*3 + 11y*3. Let r(q) = -4q*3 - 2q*2 + q. Give 2l(j) + 5r(j). -2j*3 + j Let w(h) = 6h + 5. Let i(q) be the second derivative of -q5/10 + q4/6 + q3/3 - q2 - 2q. Let u be i(2). Let y(o) = -7o - 6. Calculate uw(r) - 5y(r). -r Let i(s) = 4s2 - 4s - 9. Let l(j) = 3j2 - 5j - 8. Determine 5i(h) - 6l(h). 2h2 + 10h + 3 Let g(q) = -2q2 - 2q. Let h(v) = v*2 + 1. Determine g(l) - h(l). -3l*2 - 2l - 1 Let w(y) = 5y2 + 2y - 8. Let i(p) = 6p2 + 2p - 9. Let h(b) = b + 7. Let t be h(0). What is tw(k) - 6i(k)? -k*2 + 2k - 2 Let p(a) = -a*2 + 1. Let i(o) be the third derivative of -8o*2 + 1/6o*3 + 0o + 0. What is i(c) - p(c)? c*2 Let g(c) = 7c*2 - 5c - 3. Let y(a) = 6a2 - 5a - 2. Give 3g(n) - 4y(n). -3n2 + 5n - 1 Let i(p) = -4p2 + 32p + 3. Let t(a) = -5a2 + 32a + 4. Calculate -4i(c) + 3t(c). c*2 - 32c Let m(q) = -4q2 - q. Let x(s) = -s2. Calculate 2m(h) - 10x(h). 2h*2 - 2h Let c be -1(4 + -1)1. Let l(y) = -2y. Let b(p) = -2p - 2. Let a(n) = -n - 3. Let m(j) = 2a(j) - 3b(j). Calculate cl(w) - 2m(w). -2w Let n(d) = -5d*3 + 11d. Suppose 44 = -4f - 0f. Let j(l) = l*3 - 2l. Give fj(v) - 2n(v). -v*3 Let z(k) = -6k - 7. Suppose 22 = 5c + 3p, -4c + p - 5 = -26. Let f(x) = x + 1. Calculate cf(o) + z(o). -o - 2 Let w = -4 + 6. Let s(b) = 4b - 2. Let x(t) = -9t + 7 + 0 - 4t. Let z be 4/6(-147)/(-14). Give wx(r) + zs(r). 2r Let z(f) = f - 4. Let m be z(7). Let r(t) = -tm - 3 + 0 - 4 + t + 6 - t2. Let c(d) = -5d*3 - 6d*2 + 6d - 6. Give -c(a) + 6r(a). -a3 Let m(z) = 3z*2 + 2z + 3. Let i(l) = l*2. Determine -4i(r) + m(r). -r*2 + 2r + 3 Let m(g) = -2g3 + 11g - 4. Let i(p) = 2p3 - 11p + 3. Give 4i(o) + 3m(o). 2o3 - 11o Let b(w) = 2w - 3. Let r(v) = v - 2. Let y(i) = 6i - 13. Let q(s) = -5r(s) + y(s). Determine 2b(l) - 3q(l). l + 3 Let n(h) = -8 - h + 0h + 12 - 4h2 + 0h*2. Let w(x) = -x - 11. Let f be w(-5). Let m(y) = -3y*2 - y + 3. Calculate fm(t) + 5n(t). -2t*2 + t + 2 Let b be 3 - -1(0 - 1). Suppose -bw - 16 = -2k + 2w, -4k - 3w - 23 = 0. Let i(s) = -3s*2 + 2. Let l(a) = -7a*2 + 5. Calculate kl(f) + 5i(f). -f2 Let i(x) = -4x*2 + 2. Let y(k) = 17k*2 - 9. Suppose 0 = -2u - 4r + 24, 5u = 4r - 6 - 4. Give uy(h) + 9i(h). -2h*2 Suppose 0 = 4c + 5g + 43, -g + 18 = -3c - 0g. Let t(r) = 6r*3 - 9r*2 - 7r - 7. Let q(j) = 4j3 - 6j*2 - 5j - 5. Determine cq(s) + 5t(s). 2s3 - 3s*2 Let p(a) = -8a + 13. Let v(n) = n. Let k(m) = 2m - 1. Let w(h) = -3k(h) + 4v(h). Determine 2p(c) - 9w(c). 2c - 1 Let p(u) = 32u + 1. Let f(o) = -64o - 2. Calculate 3f(j) + 5p(j). -32j - 1 Let s(d) = -d + 1. Let k be -2 - ((-8)/1 + 2). Let o(n) = 6n - n2 - k + 0 - n2. Let z = -24 - -20. Determine zs(w) - o(w). 2w*2 - 2w Let g(q) = q*3 + 3q. Let p(z) = -3z3 - 11z. Give -22g(c) - 6p(c). -4c3 Let c(g) = 15g3 + g2 + 7. Let b(o) = 10o3 + o2 + 5. Determine -7b(j) + 5c(j). 5j*3 - 2j*2 Let u(q) = -13q - 4. Let k(v) = 12v + 3. What is -5k(g) - 4u(g)? -8g + 1 Let b(l) = 2l2 + 3l. Suppose 5 - 29 = 3i. Let j = -5 - i. Let f(o) = -3o*2 - 4o. What is jf(w) + 4b(w)? -w*2 Let y(v) = v - 2. Let t be 34/18-3. Let z(b) = 1. Let w = -8 + 7. Let r(h) = 5h - 6. Let a(m) = wr(m) + 3z(m). What is ta(k) - 9y(k)? k Let n(b) = 4b + 1. Let v(f) = f. What is -n(l) + 5v(l)? l - 1 Let j(z) = -8z - 5. Let a(n) = 12n + 8. Give -5a(v) - 8j(v). 4v Let y(d) = 9d. Let b(r) = r. What is -42b(z) + 4y(z)? -6z Let i(y) = 5y + 8. Let s(c) = -9c - 15. Let p(h) = -h2 + 4 + 2h*2 - 3 - 4h. Let m be p(5). Determine ms(a) + 11i(a). a - 2 Let r(w) = -w + 5. Let s(h) = -4. Let z(i) = -4r(i) - 5s(i). Let x(f) be the third derivative of 0f - 23/24f4 + f2 + 0f3 + 0. Give -6x(b) - 34z(b). 2b Let h(j) = j + 1. Let w(b) = -123b - 1. Calculate h(f) + w(f). -122f Let k = 41 + -39. Let a(m) = -3m3 + 2m*2 - 4m - 2. Let i(p) = -4p3 + 3p*2 - 5p - 2. Determine ki(s) - 3a(s). s*3 + 2s + 2 Let n(u) = -5u2. Let c(k) = -9k*2. Suppose 15 = 4z + 3. Suppose -2r + 10 = -2d, -zr - 9 = d + 2d. Suppose w + r = -2. What is wc(s) + 5n(s)? 2s2 Let d(h) = 5h + 4. Let g(q) = q + 1. Determine d(f) + 3g(f). 8f + 7 Let f(z) = -4z2 + 4z - 7. Let r(j) = -j*2 + j - 1. Calculate -f(p) + 5r(p). -p*2 + p + 2 Let g(n) = 23n + 11. Let d(z) = -2 + 9z - 13z + 0. Calculate 34d(k) + 6g(k). 2k - 2 Let m(z) = 3z*3 - 2z2. Let l(g) = -g3 + g*2. Suppose 0y - 2y = 2o + 4, -16 = 3y + 5o. Let s be ((-12)/(-10))/(y/(-10)). What is sl(w) - 2m(w)? -2w3 Let n be 62(-2)/12. Let d(m) = 2m*2 + 5m + 2. Let g(v) = -v*3 - 11v*2 - 26v - 11. What is ng(k) - 11d(k)? 2k3 - 3k Let o(r) = 3r + 4. Let m be (1 - (5 + -1))4/3. Suppose 15 = 3d + 2p, 2d + 4p = -0p + 10. Let a(l) = 3l + 5. Determine do(v) + ma(v). 3v Let f(x) = -3x*2 + 34x + 13. Let g(l) = -l*2 + 9l + 3. What is 2f(z) - 9g(z)? 3z2 - 13z - 1 Let p(l) = -l + 2. Let g(n) = -n + 1. Let s(i) = 2g(i) - p(i). Let m(x) = 1. Let z(a) = a + 3. Let y be z(-5). Give ym(v) - s(v). v - 2 Let q = 10 + -14. Let k(w) = -2w2 + 3w - 3. Let u(x) be the third derivative of -x5/60 + x4/12 - x*3/3 + 4x*2. Determine qk(l) + 6u(l). 2l*2 Let j(x) = x. Let k(z) = 11z + 3. Let l(o) = -4j(o) + k(o). Let t(a) = 3a + 1. Let s(w) = -w*2 - 9w - 3. Let b be s(-8). Determine bt(d) - 2l(d). d - 1 Suppose 3p - 5o - 2 = 0, 3p - 7 + 29 = -o. Let j(g) = 2g - 5. Let s(k) be the second derivative of -k*3/3 + 3k*2 - 60k. Give ps(u) - 7j(u). -2u - 1 Let t(m) = 10m - 6. Let f(b) be the second derivative of -b3/3 + b2/2 + 9b. Give 16f(i) + 3t(i). -2i - 2 Let x(o) = -2o + 4. Let p be 4 + 0 + -4 + 2. Let g(n) = 4 + n - 1 - 2n - 3np. Let w(z) = 7z*2 + 2z - 7. Let h(j) = 5g(j) + 2w(j). Give 2h(k) - x(k). -2k*2 - 2 Let w(c) = 11c3 - 3. Let f(o) be the third derivative of o6/24 - o*3/6 + 7o*2. Calculate 9f(h) - 4w(h). h3 + 3 Let f(y) = -4y3 - y2 - y - 2. Let g(h) = -5h3 + h + 3 + 17h*3 + h - 7h*3. Calculate -3f(s) - 2g(s). 2s*3 + 3s2 - s Let l(o) be the second derivative of -o3/6 - o*2/2 - 2o + 22. Let j(d) = -d. Let w(c) = -c*2 - 4c - 1. Let q(k) = 6j(k) - 2w(k). Give 3l(r) + q(r). 2r*2 - r - 1 Let r(y) = 1 + 1 + 4 - 9y. Let f(m) = 8m - 5. What is 6f(s) + 5r(s)? 3s Let u(m) = -6m + 3. Let b(s) = -s3 + 3s - 3. Let f be b(2). Let n(k) = 7k - 4. Give fu(c) - 4n(c). 2c + 1 Let l(n) = -4n2 + n + 1. Let x(o) = o - 1. Determine l(u) + x(u). -4u*2 + 2u Let s(q) = 6q3 + 15. Let t(d) = d3 + 1. Give s(l) - 15t(l). -9l3 Let r(g) = 12g*2 - 11g. Let u(i) = -i*2 + i. Calculate 4r(z) + 44u(z). 4z*2 Let p(f) = -10f*2 - 9f + 9. Let n(a) = -a*2 - a + 1. Calculate -36n(v) + 4p(v). -4v*2 Let g(o) = 1 - 2o + 24o - 22o - o2. Let l(y) = y3 + 5y2 - 4. What is 4g(j) + l(j)? j3 + j2 Let g(n) = -n*2. Let w(r) = 0r + 2r2 - r + r. What is -3g(y) - 3w(y)? -3y*2 Let i(k) = -3k*2 + 4k + 6. Let r = 61 - 56. Let w(f) = 4f2 - 5f - 7. Determine ri(a) + 4w(a). a2 + 2 Let y(z) = -z + 1. Let l(k) = -k3 + 3k2 + 2k - 4. What is l(d) + 4y(d)? -d3 + 3d*2 - 2d Let g(r) = -r3 + 1. Let o(s) be the second derivative of -s5/10 + s*4/12 + 3s*2/2 + 25s. What is 3g(h) - o(h)? -h3 - h2 Let a(s) = -5s*3 - 6s + 5s2 + s3 + s*3 + s. Let	{ "pile_set_name": "DM Mathematics" }
= -107 - -102. What is the closest to 3 in 3, z, -1/9? 3 Let y = -0.874 + -4.126. Which is the nearest to -0.1? (a) 0.07 (b) -21/4 (c) y a Let w = -1278 + 1278.1. Which is the nearest to -1/2? (a) 4 (b) w (c) -6 b Let d(s) = -s*2 - 12s - 24. Let k be d(-3). Suppose -5l - 2 = -3w + 6, 2w - 2l = 0. Let i = k + w. Which is the closest to i? (a) 1 (b) -5 (c) -7/4 c Suppose -5y = 3m - 6 - 26, 4y = -5m + 36. Which is the closest to -3? (a) -1/6 (b) -0.2 (c) 50/9 (d) m b Let p be 1512/198 + (13 - -3)/(-2). Suppose -5 + 3 = 2m. Which is the closest to m? (a) p (b) -1/3 (c) -1 c Let v = 4.3 - 4.18. Let x = 0.08 + v. Let s = 2 + -1. Which is the nearest to x? (a) 0.2 (b) s (c) 4 a Let z = -0.13 + -0.67. Let v = -3.2 + z. Let y = v + 4.5. What is the closest to 2/3 in -0.2, 2, y? y Let k = -2.04 - -0.04. Let g be 90/5 + (-1)/((-1)/3). Suppose 8f - 3 - g = 0. What is the nearest to f in -0.5, 4, k? 4 Suppose 9w - 2t - 4 = 5w, -t = w - 4. Let g = 0.2 - -0.8. Which is the closest to g? (a) w (b) -4 (c) 12 a Suppose 0 = -2m, -2x + 2 = -4m - 6. Let l = -1363/7 + 195. What is the nearest to -3/5 in 0.5, l, x? l Let n be 8/(-18) + 2/455. Let s = -0.49 - 0.01. What is the nearest to n in 3/4, -2/7, s? -2/7 Let s = 4.01 - 0.01. Let r = -3278.3 - -3464. Let j = -186 + r. What is the closest to -2 in s, -5, j? j Let y = 108 - 102. Suppose 9n - yn = 15. What is the closest to -0.1 in -5, n, 3? 3 Let t = 105.51 - 105. Let s = 0.31 - t. What is the closest to s in 4, -0.7, 1? -0.7 Suppose 0 = -3w - 93 - 6. Let u = 6103/3 + -2001. Let h = u + w. Which is the closest to h? (a) -4 (b) -2/7 (c) 1 b Let g = 0.064 + -0.008. Let i = g - -0.944. What is the closest to i in 0.4, -0.1, -2? 0.4 Let l be (1/(-22))/(6/(-24)). Let s be (1/(-5))/(6/5). Let p = -339.5 - -339. What is the closest to 2 in p, l, s? l Let a = -2 - -8.6. Let i = -6.54 + a. What is the closest to i in -1, 3, -0.3? -0.3 Let w = -1070 + 1065. Which is the closest to 1/2? (a) 1 (b) -8 (c) w a Let y be (-12)/(-30)(8/(-4) - -1). Let g = 0.03 - -0.27. Which is the nearest to y? (a) g (b) -3 (c) -5 a Let a = -3.5 - -3.6. What is the nearest to 33 in -0.2, a, -1/3? a Let m be (2 - 1) + (-4)/6. Let l = 471 + -466. Which is the closest to -2/5? (a) l (b) 2/13 (c) m b Let x = -25.031 - -0.031. Let y = 26 + x. Let o = 0 + -2. What is the closest to y in -0.1, o, -0.3? -0.1 Let c = -277 - -1943/7. Let x = 27.2 + -8.3. Let b = x + -19. What is the closest to b in 2/7, 2, c? 2/7 Let x be (0 - (-4)/(-6))/(48/18). Which is the closest to -1/2? (a) -2/5 (b) x (c) 0.07 a Let x be (-245)/10784/5. Let b = 29 + -29. What is the nearest to b in x, -0.3, 0? 0 Let z = -39 - 82. Let d = z - -121.1. Which is the closest to 0? (a) d (b) -1/6 (c) 1/4 a Let t = 0.1 + -2.1. Let g be (-13)/(-78)6 + 18/(-16). What is the closest to 1/4 in t, -1/11, g? -1/11 Let n = -0.0124 - -0.4124. Let m = -9 + 4. Which is the nearest to -1.2? (a) -4/7 (b) m (c) n a Let n be (-43)/((-33)/(-22)). Let r = -13 - n. Which is the nearest to -0.1? (a) 1/6 (b) r (c) 0.3 a Let l = -1.5 - -2.5. Let r(j) = 8j + 13. Let o be r(-5). Which is the closest to l? (a) 3 (b) o (c) 4 a Let t = 55 - 55.2. Let x = -4.5 - 0.5. Which is the closest to 3? (a) x (b) t (c) -2/11 c Let f(g) be the second derivative of g3/3 + 2g*2 + 4g. Let v be f(-4). Let z be 3/9v - -1. Which is the nearest to -1? (a) 3/7 (b) z (c) 2 b Let q be -1 + 70/49 + 106/(-182). Let m = 7.96 - 5. Let j = m - -0.04. Which is the closest to 3? (a) 0 (b) q (c) j c Let q be 22/20 - 6/(-15). Let j = -258 - -263. Let v = -1.3 + 1.8. Which is the nearest to -1? (a) j (b) q (c) v c Let m = 60.5 + -60.4. Let i = 0.2 - -0.8. What is the nearest to i in -1/3, -0.1, m? m Let k be 4/26 + (-462)/1482. Let z = k - -52/209. Let w = -0.03 + -1.97. Which is the nearest to w? (a) -3 (b) 0.5 (c) z a Let u be ((-196)/4165)/(-22/(-10)). What is the closest to -37 in -1, 2/9, u? -1 Let z = -0.0296 - -0.0296. Which is the closest to z? (a) 0.04 (b) 0.4 (c) 5 (d) -4 a Let f = 0.38 - -0.02. Let g = 4.276 - 4.3. Let o = -0.176 + g. Which is the closest to -2/7? (a) o (b) f (c) -4 a Let i = -31.9 + -5.1. Let d = i - -37.1. Let w = -1 + 2. What is the nearest to w in -1/10, 0, d? d Let h be 6 - (-4 + 7) - 6/4. What is the closest to 1 in -11, -1/2, h, 2/7? h Let w = 1427/7185 - -2/1437. Which is the closest to 5? (a) w (b) 0.4 (c) 3/4 c Let f = -434.3 + 434. What is the closest to 9 in -1/2, f, -5, 1? 1 Let d = -46293/70 - -661. Let i = -1/14 + d. Which is the closest to i? (a) 3 (b) -0.06 (c) 4 b Let d = -1 - -1.01. Let j = 5.01 - d. Let u = -209 - -209.4. Which is the closest to 0.1? (a) -4/3 (b) j (c) u c Let f = -39.8 - -40. Let k = 131/380 - 9/20. What is the closest to f in k, -0.3, 2/11? 2/11 Let p(y) = 2y + 1. Let h be p(-1). Suppose -4v = v + 2l - 73, 0 = -5l - 5. Let o be v/75(0 + 1). Which is the closest to -1? (a) 5 (b) o (c) h c Let t = 16/95 + 12/19. Which is the nearest to -4? (a) -2/17 (b) t (c) 1/3 a Let q(k) = -5k*3 + 18k*2 - k - 18. Let u be q(3). Which is the closest to -1/3? (a) -2/3 (b) u (c) 0.6 a Let a = 0.3 + 0. Let w = -11.3 - -11.3. Let q = a - w. What is the nearest to -2 in 4, q, -2? -2 Suppose -z = -3g + 19, -4g + 4z + 34 = g. Let t be 6/9 - (g + -5). Which is the closest to 0.2? (a) 5 (b) t (c) -2 b Let p = -1.04 - -0.04. Let x(q) = -q*2 + 5q + 1. Let o be x(5). Let u be 48/(-21) + o + 1. What is the nearest to u in 3, p, -0.5? -0.5 Let z = 30 - 26.5. Let g = -4 + z. What is the nearest to 0 in g, 0, -5? 0 Let d = -17.103 + 18.103. Let c be (4/10)/((-19)/5). What is the nearest to d in c, 0.1, 2? 0.1 Let z = -1.7 + 1.84. Let c = 0.54 - z. Let g = 3.9 - -0.1. What is the closest to -1/3 in g, c, -2/11? -2/11 Suppose 6 = -2p + 20. Suppose -4d - 5 - p = 0. Let j = -2/99 - -35/99. Which is the nearest to 0.1? (a) d (b) j (c) 2/5 b Suppose -7z + 5o = -4z - 2, 0 = 3z + o + 4. What is the closest to -20.1 in 6/5, -2, z? -2 Let n be (-1)/(-2) + (-22)/4. Let k be n/(-6) + (-4)/12. Let y = 35 + -34. What is the closest to y in 3/8, k, -2/3? k Let p(v) = 4v + 4. Let j be p(7). Let w be (-38)/6 + j/24. Let k be 6/(-10) - (-32)/(-80). Which is the closest to k? (a) 0 (b) w (c) 0.2 a Let o = -2.822 - -2.58. Let l = o - -0.042. Which is the closest to l? (a) -1/4 (b) 2 (c) -0.2 c Suppose 0 = -12n + 14n + 5t + 10, 0 = -3n - 3t - 6. What is the closest to n in 1/3, -3/2, -4? 1/3 Suppose 5x + 2h + 13 = 0, -4x = 3h + 9 - 0. Let u = -19/6 - -29/12. Which is the nearest to 0? (a) 0.1 (b) x (c) u a Let o = 0.16 - 1.07. Let s = 1.41 + o. Which is the closest to -1? (a) -0.3 (b) s (c) 22 a Let l = 80 + -398/5. What is the closest to 10/19 in -0.2, 0.2, l? l Let v = 2.97 + 0.03. Suppose -2z = -3z + 2, -2l + 2 = z. What is the nearest to l in -4, 3/8, v? 3/8 Let k = -358 - -359. Let t(y) = -2y - 1. Let w be t(-3). Let z = -0.2 - -0.3. Which is the nearest to z? (a) k (b) w (c) 2/7 c Let u = 1.2 + -0.4. Let j = u - 0. Let o = 0.2 + j. What is the nearest to o in -4, -3, -0.2? -0.2 Let s = 24 + -26. Let o = 51 - 49. Let i = 2 + -5. What is the nearest to s in i, -2, o? -2 Let u = 1142.1 - 1215. Let j = u + 73. Which is the nearest to 1/2? (a) 2/7 (b) j (c) -3 a Let i(v) = -2476v - 5 + 2474v + 16. Suppose -2a - 3h - 6 = 2h, 0 = -5h - 20. Let l be i(a). What is the closest to -2/11 in 2, l, 0.2? 0.2 Let z = 0.7 + -38.7. Let r = -41 - z. Let u be (-2)/4 + (0 - -1). Which is the closest to 2/3? (a) u (b) r (c) 3 a Let n be (2/5)/(2/8). What is the nearest to -1 in n, 0.3, -0.2? -0.2 Let w = 0.57 - 0.67. Let d = 37 - 41. Let p(m) = 2*m - 9. Let k be p(6). Which is the nearest to w? (a) k (b) 0.1 (c) d b Let o = 0.01 - 1.01. Let x = 0.15 + -14.15. Let d = 14.4 + x. Which is the closest to d? (a) 1/6 (b) o (c) 4/3 a Let k = 1/110 - 337/770. Which is the nearest to 1/3? (a) 14/3 (b) k (c) 3 b Let z = -1.9 - 0. Let o = z - -2. Let h = 3.43 + -3.03. Which is the nearest to o? (a) h (b) 0 (c) -5 b Let k = 484 - 483.87. Let m = -0.1 - 3.9. What is the closest to 1 in k, m, 1? 1 Let x = -6.97 + 7.27. Let r = -0.7 + 0.2. What is the closest	{ "pile_set_name": "DM Mathematics" }
(-40/9) assuming y is positive. y(54280/189) Simplify ((v/(v/(v/v(-2/31))))/(v/v(-2))(v6/v)/(v/(v(-7)vv)))(-2/63) assuming v is positive. v(26/279) Simplify n/(n/n(1/13))nnn*0n(n/((n/(n/n(-3)))/n))/(n(-13)n) assuming n is positive. n(261/13) Simplify ((m(-2/3)/(m(-1/6)/m))/((m/m(-1/8)m)/mmm/m(1/5)mm))(-3) assuming m is positive. m(531/40) Simplify (f(1/12)f)/(ff/(f/(f/((f(-14/9)f)/f)f)))(((ff((f/(f*(-1)/f))/ff)/ff)/f)/f)(-49) assuming f is positive. f(-5417/36) Simplify ((rr/(rrr*(1/2)/rr))/rr(-6)r5/r(-1/2))(-2/29) assuming r is positive. r(4/29) Simplify m*10/(mm*(-17))((((m*17m)/m)/m)/m)/((m/(mm16))/mm) assuming m is positive. m*57 Simplify ((pp*(-1/16))/(pp(-1/9)))/(p(-1/5))(-2/33) assuming p is positive. p(289/7920) Simplify (x*7/xxxx*3x)/((x*4/x)/(xxx/(x/(x/x(-1/5)xx)))) assuming x is positive. x(71/5) Simplify (x(3/4)x)(1/4)/((x(-3)/x)/(xx/x(-1/7))) assuming x is positive. x(737/112) Simplify (pp(pp*(-14)p)/p)/(pp(3/2)p)(p6)48 assuming p is positive. p(547/2) Simplify n9nnnn(6/5)n*(-3/8)n/((n(-2)/n)/n) assuming n is positive. n(713/40) Simplify (fff*(4/3)f)/f*(-4/11)(f*(-3)ff)/(f/(f/(ff(-1/28)/f))) assuming f is positive. f(3449/924) Simplify (h*(-13)hhh(-1/17))(-24) assuming h is positive. h*(4512/17) Simplify ((zz/z*(-4/9))/z)/(zz*(-28))(z*(-7/6)/zz)(-3/13) assuming z is positive. z(6719/234) Simplify ((j/((jj(1/6))/jj))/jj/j(1/10)j(j(1/3))25)(-30) assuming j is positive. j(-272) Simplify (r(-20)/r((r/((r/(r*(-28)/rr))/r))/r)/r)/(r(-2/45)/r0) assuming r is positive. r(-2248/45) Simplify (w(-1/7))*(-11)/(ww1)42 assuming w is positive. w(-577/7) Simplify (((y(1/11)y)/y(2/17))/(y/(y(2/3)/y)y)17)(-2/51) assuming y is positive. y*(43414/28611) Simplify (oo(-8))/o(-4)o(2/11)/(o(-10)o) assuming o is positive. o(68/11) Simplify ((p2)(-1/28)/(p/(p/((p/(p0/p))/p))p5p))(2/75) assuming p is positive. p(-33/175) Simplify ((((w(w/(w(((((w*(-16)w)/w)/w)/w)/ww)/w))/ww)/ww)/w)/w)/(w17/w)w*(-1/15)w(6/5)/w assuming w is positive. w(32/15) Simplify (((t/t0)45)(1/25))(-15) assuming t is positive. t(-27) Simplify (y(18/13)y)(-1/27)/(y(1/30)y(-34)) assuming y is positive. y(118913/3510) Simplify (n(-2/15))(-10)n(-28)nnnn(-28)n assuming n is positive. n*(-152/3) Simplify ((v/(((v/(v/(vvv(7/2)))v)/v)/v))/(v/(vv(-4)v)))/((v*(-6)v)/(vv(-1/2))) assuming v is positive. 1/v Simplify ((jj(j/j(3/4)j)/j)/j20)49 assuming j is positive. j(-3479/4) Simplify ((z(-2/11)/z)(-4/13))(-21/2) assuming z is positive. z(-42/11) Simplify h(16/7)h(2/9)/hh*(2/13)h20/h assuming h is positive. h(16922/819) Simplify (dd/((d/d(-3))/d))/(dd*(1/15))(d/(d/(dd3)))(44/5) assuming d is positive. d(497/15) Simplify (p(-10))(1/20)(p(-1/9))(3/19) assuming p is positive. p(-59/114) Simplify (k(4/5)k/((k/((k(3/7)k)/kk))/k)kk/k1k/(k4/k))(-3/25) assuming k is positive. k(-234/875) Simplify (o/(o(1/50)o))/(o(5/6)/o)(o(-3/7))(-8) assuming o is positive. o*(1877/525) Simplify ((uuu/(uuuu*20))/(uu/(uuu*(7/6))u))/(u(16/7)/(u/u(2/19))) assuming u is positive. u(-16937/798) Simplify ((q/q(4/3))/q)/q*(2/3)(q(2/7))(15/4) assuming q is positive. q(-13/14) Simplify (((h/((h29/h)/h))/h)/h)*(-42)/((h/(((hh((h(-3/13)hh)/hh)/h)/h)/h))/h36) assuming h is positive. h(15753/13) Simplify zz/(z/(z30z))z(-2/33)((z/(z/z*(-20))z)/z)(-2/67) assuming z is positive. z(71938/2211) Simplify (ll(-8/5)/lll(-8)/l)48 assuming l is positive. l(-2304/5) Simplify (m/(m(m/(mm/m31))/mm))*28m2/(m/m5m) assuming m is positive. m(-835) Simplify uu/(uu19u)u18u(-6/5)/(u/u(-9)uu) assuming u is positive. u*(-71/5) Simplify ((((cc*(1/7)c)/c)/c)/(c*(-6)c))/(c*(3/2)c*(-2/33)c) assuming c is positive. c(1249/462) Simplify (x0/(xx(1/3))(xx/x(-7))/x(-1/3))(-17) assuming x is positive. x(-136) Simplify (((u11/u)(-1/21))(-1/7))50 assuming u is positive. u(500/147) Simplify (r(-1)r)*(1/11)r*(3/7)r(5/3) assuming r is positive. r(44/21) Simplify (b*(1/4)b(b/b(2/15))/bb)/(((b*(-3/4)b)/b)/(((b(-15)/b)/b)/b)) assuming b is positive. b(-227/15) Simplify ((l/((l/l*(-16))/l))/ll)/(l*(3/16)l)l(7/5)(l/(l/(l*15l)))/ll assuming l is positive. l(97/80) Simplify (g/g(-1/7)g/((gg(-22)ggg)/g))/(g(-6)/g)5 assuming g is positive. g*(393/7) Simplify (t/((tt/(t/(tt(-4/3))))/t))(-3/43)/(t(-7))14 assuming t is positive. t(4210/43) Simplify ((v/(v/(vv*(-2/5)v)v))/((v1v)/v)(v(1/3)/v)(-7))(-19/5) assuming v is positive. v(-1216/75) Simplify (((l(1/11)/l)/l(4/5))/(l(-2/7))(-36))(2/95) assuming l is positive. l(-9236/36575) Simplify c(-12)c/(c/c*(1/2))(ccc/(c/((cc(-1/8))/cc)))/(c(c(1/5)c)/c) assuming c is positive. c*(-393/40) Simplify (c(c/(c/((c*(-5/6)/c)/cc)c))/c)/c(-3)(c/((cc(-2/37))/c))/(c/c(2/19)) assuming c is positive. c(1375/4218) Simplify ((h28/h)/(h/(hhh11h)))/(h/h(6/11))(7/2) assuming h is positive. h(845/22) Simplify (g(-3/2)/(gg(-22)))/((g/(g/(ggg11gg))g)/(gg(-4/13))) assuming g is positive. g(109/26) Simplify (((t(-1/3)/t)/t)(-31/4)(tt(1/6)/t)/(t/t(-1)))7 assuming t is positive. t(455/4) Simplify ((nnnnn/(n(2/5)/n)nn)(14/3)n(nn*(-1)/n)/nn*(-6)nn)(-19/4) assuming n is positive. n(-8683/60) Simplify (c(-4/7)c/c*(-1/4)(c/(c/((c/(c0/c))/c)))50)(-2/65) assuming c is positive. c(-1419/910) Simplify ((d*(-9)d)/dd)4/(d19((dd/(d/(d/d9)))/d)/dd) assuming d is positive. d*(-43) Simplify ((((((kk*(-13)kk)/k)/kk)/kk)/k)/kkk10)/(k/((k25/k)/k)k(2/5)) assuming k is positive. k(98/5) Simplify (ii(-30)(i(i/i(-18))/i)/i)(-49) assuming i is positive. i539 Simplify (u/u(1/23))39(uu22)/(uu/(uu(-14))uu) assuming u is positive. u(996/23) Simplify (o2)7(oo(-3))(-1/6) assuming o is positive. o(43/3) Simplify ((d16)(7/8))44 assuming d is positive. d616 Simplify (g/(g/g(2/3)))8/((g(5/7)/gg)/(gg1)) assuming g is positive. g(139/21) Simplify ((c/(c/(ccc(1/3))c)c1)/(c(-6/11)/c(-6)))(3/38) assuming c is positive. c(-103/418) Simplify w(-7)(w/(w/(ww(-1/12))w))/www*33ww/w(-2/23) assuming w is positive. w(7729/276) Simplify (z1)(-1/4)(zz/z(-5/6))/(z(-2/7)z) assuming z is positive. z*(157/84) Simplify n/(nn*7)n*13((n7/n)/n)(1/17) assuming n is positive. n*(107/17) Simplify ((r/(r/(r/(rr/(rr(((rr(-9))/r)/r)/r)))))/(rr/(rr(-10)r)))(2/45) assuming r is positive. r(-8/9) Simplify y*(-31)yy(1/19)y/(yy(20/9))y(-2/19) assuming y is positive. y(-5519/171) Simplify ((s/s(1/3))(-25)s3/((s(-4)s)/ss))(-17) assuming s is positive. s(544/3) Simplify ((v(-29)v10)13)(-3/38) assuming v is positive. v(39/2) Simplify ((m*(-21/5)mm)/mmm)/m4((m*(-2/7)m)/m)(2/15) assuming m is positive. m(-110/21) Simplify ((k(-30))1)35 assuming k is positive. k(-1050) Simplify (x(4/11)/x)/(x25/x)x(6/19)x(-3/17) assuming x is positive. x(-87038/3553) Simplify (n21/n(4/19))(-3/13) assuming n is positive. n(-1185/247) Simplify w*(-8)(ww(-6)/w)/ww*12w/w*(-1/2)w assuming w is positive. 1/sqrt(w) Simplify (k*(9/5)/(k/(k/(kkk(-22)k))))19 assuming k is positive. k(1976/5) Simplify (o4)(4/7)o/(oo*(-6))o*(3/17)o assuming o is positive. o(1126/119) Simplify ((o(-3/20)/o(2/7))(1/28))(-32) assuming o is positive. o(122/245) Simplify (v((vv/(vv(1/16)/vv))/v)/vv)(1/29)/(vv*(3/20)/v(v/(v/(v/(v/(v(vv/((vv13/v)/v))/vv)v)v)v))/v) assuming v is positive. v(25247/2320) Simplify f(2/5)/ff*(5/6)ff15f/(f((f(1/4)f)/f)/f) assuming f is positive. f(1019/60) Simplify (i(-3/4)i(-5)(i(-1))(2/	{ "pile_set_name": "DM Mathematics" }
the remainder when 13244218 is divided by 5694. 5668 What is the remainder when 3340576 is divided by 59? 55 Calculate the remainder when 347455 is divided by 2411. 271 Calculate the remainder when 168721 is divided by 1680. 721 What is the remainder when 102464455 is divided by 4454976? 7 What is the remainder when 264209 is divided by 363? 308 Calculate the remainder when 386411 is divided by 17564. 3 Calculate the remainder when 146916 is divided by 15976. 3132 Calculate the remainder when 1573694 is divided by 475. 19 What is the remainder when 255114439 is divided by 102? 97 What is the remainder when 65186 is divided by 3739? 1623 Calculate the remainder when 25352957 is divided by 12676445. 67 Calculate the remainder when 2841658 is divided by 18. 16 What is the remainder when 289485376 is divided by 20? 16 Calculate the remainder when 296491901 is divided by 6. 5 What is the remainder when 521092 is divided by 2504? 260 What is the remainder when 154454 is divided by 8503? 1400 Calculate the remainder when 303460 is divided by 1509. 151 Calculate the remainder when 15499066 is divided by 417. 10 Calculate the remainder when 46905034 is divided by 56717. 75 What is the remainder when 109458702 is divided by 31? 27 Calculate the remainder when 14686269 is divided by 199. 69 What is the remainder when 18586641 is divided by 619554? 21 What is the remainder when 8078512 is divided by 110664? 40 Calculate the remainder when 16024378 is divided by 516. 514 Calculate the remainder when 15088910 is divided by 17. 16 What is the remainder when 10100485 is divided by 92665? 0 Calculate the remainder when 41345 is divided by 6890. 5 Calculate the remainder when 770560230 is divided by 26. 24 What is the remainder when 42266429 is divided by 1091? 1089 What is the remainder when 934 is divided by 249? 187 Calculate the remainder when 2463582 is divided by 2463421. 161 What is the remainder when 1954464 is divided by 8648? 16 What is the remainder when 15855546 is divided by 3171104? 26 Calculate the remainder when 506479 is divided by 1319. 1302 Calculate the remainder when 126314 is divided by 3404. 366 Calculate the remainder when 704166335 is divided by 18. 17 What is the remainder when 372377 is divided by 20? 17 Calculate the remainder when 118552841 is divided by 4936. 4929 What is the remainder when 1058201 is divided by 1326? 53 Calculate the remainder when 618258 is divided by 29. 7 Calculate the remainder when 921770 is divided by 2845. 2835 Calculate the remainder when 3909293 is divided by 88. 69 What is the remainder when 118554664 is divided by 2785? 2784 What is the remainder when 1073172 is divided by 39746? 30 What is the remainder when 1510315 is divided by 16591? 534 What is the remainder when 87475830 is divided by 672891? 0 What is the remainder when 43242077 is divided by 33? 32 Calculate the remainder when 169121 is divided by 84481. 159 What is the remainder when 142024 is divided by 3013? 413 Calculate the remainder when 1141013 is divided by 8710. 3 Calculate the remainder when 10195848 is divided by 364137. 12 Calculate the remainder when 680568 is divided by 138. 90 What is the remainder when 57049507 is divided by 10? 7 What is the remainder when 147008 is divided by 147004? 4 What is the remainder when 172605 is divided by 2982? 2631 Calculate the remainder when 4514429 is divided by 11787. 8 What is the remainder when 32928040 is divided by 15? 10 What is the remainder when 3156108 is divided by 16185? 33 What is the remainder when 2404272 is divided by 150267? 0 What is the remainder when 11893473 is divided by 35? 18 Calculate the remainder when 186529 is divided by 1727. 13 What is the remainder when 96790028 is divided by 18? 14 What is the remainder when 242154 is divided by 2518? 426 Calculate the remainder when 189617 is divided by 15417. 4613 What is the remainder when 56899 is divided by 8116? 87 Calculate the remainder when 397559 is divided by 9035. 19 What is the remainder when 439106286 is divided by 141? 138 Calculate the remainder when 15023 is divided by 2473. 185 What is the remainder when 5027 is divided by 253? 220 What is the remainder when 133896 is divided by 2433? 81 What is the remainder when 282983 is divided by 1474? 1449 Calculate the remainder when 1510256 is divided by 105. 41 What is the remainder when 60641919 is divided by 877? 0 Calculate the remainder when 22643058 is divided by 33. 9 Calculate the remainder when 122088 is divided by 5442. 2364 What is the remainder when 3109 is divided by 290? 209 Calculate the remainder when 2236896 is divided by 4045. 11 What is the remainder when 206875 is divided by 2722? 3 Calculate the remainder when 47114533 is divided by 249. 247 Calculate the remainder when 21374 is divided by 3849. 2129 What is the remainder when 80385 is divided by 39928? 529 Calculate the remainder when 22577640 is divided by 4171. 17 Calculate the remainder when 1437686 is divided by 18665. 481 Calculate the remainder when 582421 is divided by 95. 71 Calculate the remainder when 886610 is divided by 975. 335 Calculate the remainder when 168053 is divided by 55888. 389 What is the remainder when 167053 is divided by 3? 1 What is the remainder when 69182509 is divided by 264? 253 What is the remainder when 43656250 is divided by 331? 329 Calculate the remainder when 48129260 is divided by 242. 58 What is the remainder when 1778 is divided by 293? 20 Calculate the remainder when 1817960 is divided by 862. 2 Calculate the remainder when 15423238 is divided by 33. 28 Calculate the remainder when 58391438 is divided by 175. 63 What is the remainder when 75843845 is divided by 424? 421 Calculate the remainder when 21573 is divided by 21564. 9 Calculate the remainder when 59587251 is divided by 33. 9 What is the remainder when 3470803 is divided by 221? 219 What is the remainder when 2936288 is divided by 83? 80 Calculate the remainder when 134272 is divided by 161. 159 Calculate the remainder when 1016868 is divided by 131. 46 What is the remainder when 6328303 is divided by 647? 643 Calculate the remainder when 27509925 is divided by 33713. 117 What is the remainder when 2059120 is divided by 24? 16 What is the remainder when 4144837 is divided by 818? 31 What is the remainder when 76586 is divided by 332? 226 Calculate the remainder when 40410246 is divided by 10246. 22 What is the remainder when 100313 is divided by 2388? 17 Calculate the remainder when 1652867 is divided by 26. 21 Calculate the remainder when 19175 is divided by 1621. 1344 What is the remainder when 251948 is divided by 251725? 223 Calculate the remainder when 44497 is divided by 64. 17 What is the remainder when 9795611 is divided by 327? 326 Calculate the remainder when 268845 is divided by 2149. 220 Calculate the remainder when 218127 is divided by 54520. 47 What is the remainder when 67905 is divided by 33516? 873 What is the remainder when 179152532 is divided by 1093? 1088 What is the remainder when 3265188 is divided by 22212? 24 What is the remainder when 446171 is divided by 4165? 516 What is the remainder when 9382016 is divided by 25564? 28 Calculate the remainder when 3146752 is divided by 5. 2 What is the remainder when 457437 is divided by 10637? 46 What is the remainder when 102546 is divided by 32931? 3753 What is the remainder when 7012170 is divided by 2970? 0 Calculate the remainder when 500355 is divided by 20788. 1443 What is the remainder when 737402 is divided by 1514? 84 Calculate the remainder when 13169916 is divided by 255. 186 Calculate the remainder when 2833919 is divided by 1700. 19 Calculate the remainder when 1947243 is divided by 648877. 612 Calculate the remainder when 2921757 is divided by 194. 117 Calculate the remainder when 4430241 is divided by 1476739. 24 Calculate the remainder when 33285512 is divided by 739678. 2 Calculate the remainder when 2003412 is divided by 14. 12 What is the remainder when 1797233 is divided by 5616? 113 What is the remainder when 23493 is divided by 18258? 5235 What is the remainder when 109036 is divided by 1210? 136 Calculate the remainder when 101398 is divided by 447. 376 What is the remainder when 218337 is divided by 3723? 240	{ "pile_set_name": "DM Mathematics" }
= 3 + 1. What is the remainder when b is divided by y? 0 Let s(x) = -2x + 3. Let k = 27 - -15. What is the remainder when k is divided by s(-6)? 12 Suppose -3r + 4r = 9. Suppose a - 8 = -b, 5a = -b + 3b + 12. What is the remainder when r is divided by b? 1 Let n(s) = -s3 + 6s*2 + 2s + 2. Let z be n(6). Suppose -z = x - 2x. What is the remainder when x is divided by 5? 4 Suppose -4h + 5 = -35. Suppose 2t - h = 40. What is the remainder when t is divided by 7? 4 Let d be (6/(-5))/((-33)/2750). Suppose 5u - 60 = d. Calculate the remainder when u is divided by 11. 10 Let z(r) = -r*2 + 2r + 7. What is the remainder when 12 is divided by z(0)? 5 What is the remainder when 19 is divided by (-2)/((-4)/18) + -4? 4 Suppose 0 = 4b - 7 + 67. Let o = 0 - b. What is the remainder when o is divided by 8? 7 Let m = 28 - 15. Let x(z) = -z - 1. Let j be x(-4). Suppose -4i + 8c - 4 = 4c, -c - 7 = -ji. Calculate the remainder when m is divided by i. 1 Let c = 45 - 31. Calculate the remainder when 37 is divided by c. 9 Let i(h) be the third derivative of 2h*2 + 0h + 0 - 1/6h3 - 5/6h4. Calculate the remainder when 36 is divided by i(-1). 17 Let w = 72 - 45. Calculate the remainder when 77 is divided by w. 23 Let r(p) = -p2 + 8p + 5. Let m = 32 - 9. Calculate the remainder when m is divided by r(8). 3 What is the remainder when 51 is divided by 2 - (4 - 2)-8? 15 Let h(a) = 14a - 10. Let w(i) = 5i - 3. Let b(f) = 4h(f) - 14w(f). Calculate the remainder when b(-2) is divided by 16. 14 Suppose -3r - 15 = -6r. Suppose -4y + 3y = -rw + 1570, w - 290 = 5y. Suppose -4l = 103 - w. Calculate the remainder when l is divided by 18. 17 Suppose 4u - 246 = t - 6t, 0 = -2t - 4u + 108. What is the remainder when 137 is divided by t? 45 Let a = 3 + -3. Suppose al - 10 = h + 3l, -5l - 40 = -3h. Suppose hq - 174 = -49. Calculate the remainder when q is divided by 7. 4 Suppose -3n + 0 = -2x + 3, 3x - 3n - 6 = 0. What is the remainder when x is divided by 2? 1 Let h(o) = o*2 - o + 2. What is the remainder when 39 is divided by h(3)? 7 Suppose 0 = -2o - 12. Let f = 31 + -12. What is the remainder when f is divided by (0 - -1)(-42)/o? 5 Suppose 0 = 5x - 2j - 15, -4x + 2j + 5 = -j. Let k(h) = 2h*2 + 6h + 1. What is the remainder when k(-4) is divided by x? 4 Suppose 3l + 0l = -9. Let r be (75/9)/(1/l). Let g = -13 - r. Calculate the remainder when g is divided by 7. 5 Let u = -5 + 8. Suppose 0 = -4n - u + 15. Let g(o) = o + 12. What is the remainder when g(-5) is divided by n? 1 Let z = 11 - 21. Calculate the remainder when 54 is divided by (-142)/z + 9/(-45). 12 Calculate the remainder when 43 is divided by 26 + 2 - (-6 + 8). 17 Suppose -5w - 26 = 24. Calculate the remainder when 20 is divided by (14 + 0)(-5)/w. 6 Let i(f) = -f3 - 9f*2 - 2f - 5. Let t be i(-9). What is the remainder when 25 is divided by t/1 - (-1 + 1)? 12 Let a be (3/(-6))/((-3)/18). Let i = a + -1. Calculate the remainder when 3 is divided by i. 1 Let t = -100 + 123. What is the remainder when t is divided by 14? 9 Let i(a) = 9a + 17. Calculate the remainder when 208 is divided by i(4). 49 Let c(s) = 0s*2 + 3s + s*2 + 4 - 12s. Let d = 0 + 9. Calculate the remainder when 11 is divided by c(d). 3 Let u be (7/(-2))/(4/(-24)). Let j be 12/7 - (-6)/u. Suppose f + jx - 24 = -4f, -5x - 2 = -3f. What is the remainder when 10 is divided by f? 2 Let o = -15 + 11. Let l = 6 + o. Suppose 4z = 4i - 32, 0 = -i - lz - 4. What is the remainder when i is divided by 2? 0 Calculate the remainder when 77 is divided by 25(1 - 3/15). 17 Suppose -4h = -4x + 108, -167 = -5x - 3h - 64. Calculate the remainder when 63 is divided by x. 17 Suppose -3a - 49 = -10a. Calculate the remainder when 21 is divided by a. 0 Suppose c - 30 = -4c. Let h = c + 3. Suppose 0 = -j + 2j - 26. What is the remainder when j is divided by h? 8 Suppose 0 = 5t + 2p - 80, 3p - 7p = 0. Suppose -3k = l - 2k - t, -4k + 75 = 5l. Calculate the remainder when 41 is divided by l. 8 Calculate the remainder when 111 is divided by 3/6 - (-275)/10. 27 Let u = 38 - 19. Let d = u + -7. Calculate the remainder when 45 is divided by d. 9 Let u = -5 + 9. Let p(c) = 3c2 - 4c + 3. Calculate the remainder when p(u) is divided by 12. 11 Let s = -8 - -11. Suppose 45 = sl - 33. Calculate the remainder when l is divided by 14. 12 Let f be (-8)/12 + 958/6. What is the remainder when 24 is divided by (-3)/12 + f/12? 11 Let q = 12 + -43. Calculate the remainder when (3 - (6 + -2))q is divided by 11. 9 Let v(l) = -36l + 1. What is the remainder when v(-2) is divided by 15? 13 Suppose -3i + 4o - 322 = 0, i - o - 3o = -102. Calculate the remainder when 25 is divided by (-3)/18 - i/12. 7 Let g be (-4)/(-10) + (-4)/10. Suppose g = -3z - 3q + 4q + 85, 0 = -4z - 3q + 122. Calculate the remainder when z is divided by 10. 9 Let j(d) = d3 + 6d*2 + 5d. Suppose -4m - 3n + 175 = m, -5m + n = -175. What is the remainder when m is divided by j(-4)? 11 Suppose 2h + 0 - 21 = -s, -s = -3h - 11. Calculate the remainder when 100 is divided by s. 15 Let b = 200 - 113. What is the remainder when b is divided by 18? 15 Let s(f) = f2 + f - 1. Let v be s(-2). Suppose b = 1 + v. Suppose bj = 4 - 0. Calculate the remainder when j is divided by 2. 0 Let t(p) = 3p2 - 11p - 1. Calculate the remainder when 17 is divided by t(4). 2 Suppose 5r - 5o - 18 = 2, 2r - 8 = 4o. Let j(i) = -2 + 4i - ri - 2i. Calculate the remainder when j(-5) is divided by 3. 2 Suppose -g - 2j = -47, -2j = 4g + 83 - 259. Let q = 8 - -7. What is the remainder when g is divided by q? 13 Suppose 0n = 2n + 5b - 52, 0 = -3n + 3b + 99. What is the remainder when n is divided by 21? 10 What is the remainder when 9 + 26 + -41 is divided by 8? 7 Let i(y) be the second derivative of y*3/6 - 3y*2 + 5y. What is the remainder when i(8) is divided by 1? 0 Let t = -56 - -122. Calculate the remainder when t is divided by 30. 6 Let j be (-75)/(21/(-6) - -2). Suppose -j = 4b - 9b - 4c, b - c - 19 = 0. Let r = b + 0. Calculate the remainder when 41 is divided by r. 13 Let d(g) = 3g*3 - g. Let y be 2(-2)/4-2. What is the remainder when d(y) is divided by 12? 10 Suppose 4i = -22 + 242. Let x be (-4)/(-14) - (-524)/28. Suppose -x = -0b - b. Calculate the remainder when i is divided by b. 17 Let d(x) = x - 4. Let y be d(0). Let k = y - -20. What is the remainder when 1165/25 + 4/10 is divided by k? 15 Let y(k) = -k3 - 6k*2 - 6k - 4. Let o be y(-5). Let i be ((-2)/o)/((-4)/(-6)). What is the remainder when 12 is divided by 10 + (i - -1) + -1? 5 Let u(g) = 77g. Calculate the remainder when u(1) is divided by 16. 13 Let z = -28 + 11. Let x = z - -26. Let o(c) = 2c + 49. What is the remainder when x is divided by o(-22)? 4 Let c = -28 + 32. What is the remainder when 6 is divided by c? 2 Suppose -3c - 5 = -20. Calculate the remainder when c is divided by 2. 1 Let b = 183 - 132. Calculate the remainder when b is divided by 13. 12 Suppose -u - 7 = -5z + 2u, 3 = 4z - 5u. Suppose 0 = j - z - 15. Calculate the remainder when 32 is divided by j. 15 Suppose -4n - 2f = -174, -2n - n - 2f = -133. Calculate the remainder when n is divided by 11. 8 Let y = 26 + 41. What is the remainder when y is divided by 23? 21 Let m be 14/91 - 1166/(-26). Let t = -27 + m. Calculate the remainder when 51 is divided by t. 15 Let t = 30 - 77. Let w be ((-316)/2)/((-8)/4). Let s = w + t. What is the remainder when s is divided by 11? 10 Let g = -20 - -13. Let w be 6/(-27) + g/9. Calculate the remainder when 16 is divided by (14/(-2))/w + 2. 7 Let u = 2 + -1. Suppose 0l + 3l = -18. What is the remainder when 11 is divided by 3/lu-12? 5 Let z = 33 - 12. Calculate the remainder when 60 is divided by z. 18 Let p = 1 + 3. Suppose 5d - 45 = 40. Let j = 24 - d. Calculate the remainder when j is divided by p. 3 Let c(u) = -u3 + u2 - 1. Suppose 0 = 3z - 3d + 9, -6z - d - 3 = -z. Calculate the remainder when 2 is divided by c(z). 0 Let g be 14/(-21) - 20/(-3). Let n = g - -5. Suppose 0 = b - 5 - 1. Calculate the remainder when n is divided by b. 5 Let n(d) = -d2 + 7d - 6. Let m be n(4). Calculate the remainder when	{ "pile_set_name": "DM Mathematics" }
t is the smallest value in 4, 1, -4102613? -4102613 Which is the fourth smallest value? (a) 2 (b) 150/9949 (c) 4 (d) -4/7 c Which is the fifth smallest value? (a) 5/4 (b) -2 (c) 21 (d) 44/5 (e) 7 c What is the fourth biggest value in 30, -1, 5/7, -5/748? -1 Which is the sixth smallest value? (a) -0.11 (b) -59 (c) 0.5 (d) -721 (e) 4 (f) 0.2 e What is the fourth smallest value in 4, 0, 1/2, -16030, -18? 1/2 Which is the second smallest value? (a) 0.5 (b) 3 (c) -0.18 (d) -547932 c What is the sixth biggest value in -0.01, -0.03, -7, -5, -6/11, 6/17? -7 What is the third biggest value in 2, 0.0738144, 5? 0.0738144 Which is the third biggest value? (a) -26/7 (b) -1/6 (c) -1 (d) -9 (e) -5.9 (f) -4 a What is the fifth smallest value in 2/3, 0.1, 0.2, 140/19, -2327? 140/19 Which is the third biggest value? (a) -1 (b) -30088/3 (c) -2/435 b Which is the fourth smallest value? (a) 1/2 (b) -2 (c) 149 (d) -1/7 (e) 1/5 a What is the third smallest value in 1, -6, -3/7, -5/17, -2/23, -445? -3/7 What is the biggest value in -0.032, -4, -13, 5/2, 1/4, -1/2, 0.4? 5/2 What is the fourth smallest value in -42, -2, 0.41, 0, 1466? 0.41 What is the biggest value in 2.6, 1/3, 22, -0.3, 0.07607? 22 What is the seventh smallest value in 1/3, 1, -1/2, -46/5, -0.13, 2/7, -8/3? 1 Which is the smallest value? (a) 0.2 (b) -4/20127 (c) -5 (d) -2/11 c What is the sixth biggest value in -3/2, 280, 5, -2, 5/4, -0.47? -2 Which is the biggest value? (a) 0.2 (b) 0 (c) 591/2 (d) 1 (e) 4 (f) -1 (g) 3 c What is the fifth smallest value in -0.2, -4/3, 1392/13, -1/67, -3/2? 1392/13 Which is the smallest value? (a) 11223/2 (b) 2/3 (c) -6563 c Which is the biggest value? (a) -0.2 (b) 0 (c) 1/4 (d) -618/11 (e) 2/5 (f) 2/23 (g) -2 e What is the fifth biggest value in 4/9, 10, 0, 246, 1, -29, 3? 4/9 Which is the fifth biggest value? (a) 1 (b) 17 (c) -0.2 (d) 0.18 (e) 5.5 (f) -5 (g) -2 c Which is the fourth smallest value? (a) 0.2 (b) -80 (c) 3/41 (d) -2846 a Which is the second biggest value? (a) 47351.1 (b) -12 (c) -2 c Which is the third biggest value? (a) 22 (b) 3/4 (c) 26715 (d) -4 b What is the fifth biggest value in 221/3, 5, -38, 16, 2/5? -38 What is the third smallest value in -4, -60, 2/13, 0.5, -8, 4? -4 Which is the smallest value? (a) 5 (b) -550888/5 (c) 2/9 b Which is the biggest value? (a) 5589 (b) -0.4 (c) -0.053 (d) 1/24 a What is the second smallest value in 12, -7868/11, -0.2? -0.2 What is the fourth smallest value in -19/2, -157898, 2, 6? 6 What is the sixth biggest value in 97, 3/4, 139, 2/7, -1, -7, 0.4? -1 Which is the fifth smallest value? (a) -413/5 (b) -4 (c) -3/4 (d) 67 (e) -5 d Which is the fifth smallest value? (a) -677 (b) 0 (c) 3 (d) 22.7 (e) 3/4 d Which is the biggest value? (a) -27 (b) 1 (c) 0.3 (d) 4 (e) 0.4 (f) -243 (g) -2/15 d What is the third biggest value in -1/2, 18.338, 1/6, -3, -4, 2.1? 1/6 Which is the third smallest value? (a) 4 (b) 1/2 (c) 4/9 (d) -0.06 (e) 47983/5 b Which is the second biggest value? (a) 2/7 (b) -2/5 (c) -5 (d) 354 (e) 1 (f) -783/5 e Which is the third biggest value? (a) -84 (b) 2/13 (c) -952 (d) 0 (e) 0.3 d Which is the second biggest value? (a) -4 (b) 2 (c) -2 (d) 0.6 (e) -11.616 (f) 2/45 d What is the second smallest value in 3, -3, -0.2, -216/1945? -0.2 What is the sixth smallest value in 1493, -5, -0.2, -2/7, 0.3, 2.9, 8? 8 What is the sixth biggest value in -2.31, 3, 1, 0, -1/6, -0.3, -3? -2.31 Which is the fifth smallest value? (a) -663.97 (b) 1 (c) -3 (d) -2 (e) -5 (f) -18 d Which is the fourth smallest value? (a) 3 (b) 1/94 (c) -2 (d) -0.31 (e) -1/27 (f) 4 (g) -2/7 e Which is the third biggest value? (a) 44 (b) 12 (c) 9 (d) 150 b Which is the fourth biggest value? (a) 14/1667651 (b) -5 (c) -2/51 (d) 1/2 b Which is the fourth smallest value? (a) 1/115 (b) -5 (c) 74 (d) 1/13 (e) 0.06 d Which is the biggest value? (a) -17/6 (b) -1004/7 (c) 7.8 (d) -5 c Which is the third smallest value? (a) 1 (b) -0.3 (c) -13/20 (d) 6 (e) 1/11 e What is the fifth smallest value in -15/2, 5/2, -2/11, 1, 112, -17? 5/2 What is the second biggest value in -1/4, 0.3, 2/441, 2.0267, -2, 0, 4? 2.0267 What is the third biggest value in -2, -2/59, -6, 52, -16, -21? -2 Which is the fourth biggest value? (a) -31 (b) -11 (c) -0.1339 (d) 2/31 a What is the biggest value in -220.1, -2, -9.279? -2 What is the third biggest value in -6, 3, 2/31, -45/7, -14, -4/3? -4/3 What is the fifth biggest value in -1.18, -1/3, 0.1, -460, 5, -2? -2 What is the fourth biggest value in 5, -1.34, -0.8, -5, 0.07, 31? -0.8 Which is the third biggest value? (a) -40 (b) -1/101 (c) -254 (d) 2/23 a What is the second biggest value in -0.212, 1/11, 200, -0.5? 1/11 Which is the fourth smallest value? (a) 231 (b) -3 (c) -162 (d) 1/5 a Which is the fifth biggest value? (a) 512 (b) -2.598 (c) 0 (d) -2/7 (e) -1/7 b What is the second smallest value in -0.3, -306/11, -47.08? -306/11 Which is the fifth biggest value? (a) 40/1103 (b) -1 (c) -3 (d) 0.06 (e) 1 (f) -3/5 b What is the second biggest value in -7, 1, 119, 20, -1/5, 0.02, -4? 20 Which is the fourth biggest value? (a) -59/323 (b) -93 (c) -4 (d) -0.2 b Which is the third smallest value? (a) -0.2 (b) 2/11 (c) 18 (d) 3.746 d Which is the third smallest value? (a) 2.06 (b) -2868 (c) 4 c What is the second biggest value in 0.5, -573, -31154? -573 What is the sixth smallest value in 0.3, 4/7, 107, -0.3, 55, -3? 107 Which is the fifth smallest value? (a) 2 (b) 5.61 (c) 0.2 (d) -1 (e) 0.15 (f) -4 a Which is the fourth biggest value? (a) -0.1 (b) -2443 (c) -6/65 (d) 1/34 b Which is the fourth biggest value? (a) 1/8 (b) -0.2 (c) -2 (d) 5 (e) 0.08 (f) 2212 e What is the fourth smallest value in 5, 0.199, -27, -3/5, -2/33, -1/8, 0.2? -2/33 Which is the fourth smallest value? (a) 3/4 (b) -11251 (c) -4 (d) -0.4 (e) -0.5 (f) -8 e Which is the third smallest value? (a) -1/4 (b) 22 (c) -5/2 (d) -158937 a Which is the third biggest value? (a) -3575/16 (b) 12 (c) -1/2 (d) 5 (e) -4 c Which is the third smallest value? (a) -0.4 (b) 0.1 (c) -1 (d) -5 (e) 89 (f) 0.058 (g) -8 c What is the third smallest value in 0.099, -1, -2/3, 0.05, 28/3? 0.05 What is the sixth smallest value in -0.0099, -4.63, -4, 0.2, 0.6, 3? 3 Which is the sixth smallest value? (a) 1 (b) 30 (c) -0.4 (d) -0.2 (e) 200254 (f) 3/7 e Which is the second biggest value? (a) 4/5 (b) -2.694 (c) -1/29 (d) -1/4 c Which is the second biggest value? (a) -2/289 (b) 13161 (c) -2.1 a What is the third smallest value in 2/68471, -2, -1, -135? -1 What is the sixth smallest value in 2/7, 3, 13656, -5, 0.4, 5? 13656 Which is the second smallest value? (a) -2/53 (b) -211 (c) 15 (d) 5 (e) -2 e What is the second biggest value in 1/3621, 3, -2009, 2/3? 2/3 What is the fourth smallest value in -3/4, 466, 57/4, -0.4? 466 Which is the second smallest value? (a) 173/130 (b) 2/9 (c) 1835 a Which is the third biggest value? (a) -4/7 (b) 1 (c) -0.22 (d) -282/89 (e) 2/11 (f) -4 (g) -1/5 g Which is the sixth smallest value? (a) -2/23 (b) 39 (c) 11 (d) 47 (e) -0.4 (f) 4/5 d Which is the fourth biggest value? (a) 23620 (b) 39 (c) -5 (d) 30 c Which is the fourth smallest value? (a) -0.5 (b) 8/9 (c) -4/9 (d) -4 (e) 486 (f) -2/11 f What is the biggest value in -378, -61/36, 1/4, -0.1? 1/4 Which is the smallest value? (a) 0.056939618 (b) -0.3 (c) 5 b What is the third biggest value in 6/4531, 1, 1040? 6/4531 Which is the smallest value? (a) -0.1501 (b) 36 (c) -10 c What is the second smallest value in 37, -0.37, 0.1, 1/8, -1/5, -8, 5? -0.37 Which is the smallest value? (a) -322/15 (b) -0.4 (c) 0.3 (d) 0.2 (e) -1/5 a What is the fourth biggest value in -34682, 4, 0, 1/2, -1? -1 What is the sixth smallest value in 0.3, -0.11, 0.5, 1/11, -0.133, -0.3, -2? 0.3 Which is the smallest value? (a) -2/3 (b) -394 (c) 348 (d) 3 (e) -3/5 b Which is the smallest value? (a) -2/15 (b) -2 (c) 0 (d) 3740 (e) -2/13 (f) -3 f What is the sixth smallest value in -7393, -0.4, -1.09, -5, 4, 2? 4 Which is the fifth biggest value? (a) -4 (b) 0 (c)	{ "pile_set_name": "DM Mathematics" }
g + 66. Does 8 divide g? True Let c = 377 - 210. Let a = -95 + c. Is 12 a factor of a? True Let m(o) = -o2 + 10o + 5. Let c be m(10). Let w be 0 - -1 - (-15)/c. Suppose -5s + 2f = -60, 2s - 5f = w - 1. Is s a multiple of 14? True Suppose -19h + 29h = 2380. Does 5 divide h? False Suppose 0 = -0d + 4d - 2n - 2, -n + 3 = 2d. Let u be (-2 - 2)d + 5. Suppose -u = 2z - w - 104, w - 152 = -3z. Is z a multiple of 17? True Suppose c + 17 = -0c. Let a = c + 21. Suppose h = a - 1. Is 3 a factor of h? True Suppose -8 - 20 = 2k - 4m, 0 = 2k - 3m + 26. Does 19 divide (-190)/(-38)(-44)/k? False Let v = -16 + 18. Suppose -60 = -d - vk, d + 3 = -4k + 63. Let p = -8 + d. Does 12 divide p? False Let q be (-9 + 9)/(13). Let i(j) = 26 + q + 2j + 15. Is 14 a factor of i(0)? False Does 13 divide (6 - (-1128)/2) + -7? False Suppose -5156 = -5d + 4a - 204, 4d = -2a + 3972. Does 10 divide d? False Suppose 4296 = 7x - 2473. Is x a multiple of 10? False Suppose -f - u = -1, 4f = 3u - 8 - 23. Let b(x) be the third derivative of x5/30 + x4/6 - 2x3/3 - 18x*2 - 2. Is b(f) a multiple of 6? True Is 31 a factor of 2/4 - (-21375)/30? True Let l(c) = -51c - 21. Is l(-1) a multiple of 6? True Let k be 6/8 + 111/12. Let r be k/15 - (-415)/3. Suppose -2p + 3x = -0x - r, p - 71 = 2x. Does 17 divide p? False Suppose 733 = -5g - 592. Let u = -149 - g. Is 18 a factor of u? False Let n(x) = 2x*2 + 20x - 23. Let b(y) = y*2 + 10y - 11. Let k(t) = 9b(t) - 4n(t). Let h be k(-11). Suppose hc - 6c + 132 = 0. Is 10 a factor of c? False Is 141 - 29 - (-1 + 0 - 2) a multiple of 5? True Suppose -19x = -18x. Suppose -i = 5p - 0i - 451, x = 5p + 5i - 455. Is p a multiple of 9? True Let v(k) = 3k2 + 3k - 22. Let c be v(-7). Suppose -5g + 118 = -2i, 2g - 4i = -2g + c. Is 12 a factor of g? False Suppose 0 = -3o - 0 - 3. Let q(w) = w*2 - 2w - 1. Let f be q(o). Suppose 2t + ft = 3j - 238, -2t = 3j - 232. Is j a multiple of 39? True Let x be (12 - 14) + 12. Suppose 4j + k - 507 = x, j - 246 = -j - 2k. Does 32 divide j? True Suppose -y - 40 = -5n - 0y, 2n + 5y - 16 = 0. Is (-9 + n)/((-2)/358) a multiple of 18? False Let u(j) = -2j3 - 2j*2 - 5j - 18. Let a(y) = y*3 + 2y + 1. Let x(s) = 3a(s) + u(s). Does 8 divide x(5)? False Let i(k) = 4k2 + k - 27. Let q(o) be the second derivative of o4/12 - 7o. Let z(r) = -i(r) + 5q(r). Is z(0) a multiple of 27? True Is (-12 + 0)/(3093/(-441) - -7) a multiple of 49? True Let t = 28 + -28. Suppose 5f - 19 + 4 = t, 3f = -5x + 584. Is x a multiple of 6? False Suppose 3v = -12p + 9p + 732, -3p - v = -740. Does 31 divide p? True Let w = 7 - 14. Let q(l) = -l2 - 37l - 79. Let u be q(-34). Let h = w + u. Does 16 divide h? True Is 7 a factor of -178(-25)/(150/36)? False Is 111/6(22 + 7 - -1) a multiple of 9? False Let m(q) = -q3 + q2 + 4q. Let i be m(-2). Suppose 2x - 60 = -if + 5f, 2x = -4f + 40. Is x a multiple of 8? False Let d = -158 - -263. Suppose 0 = 4q + h - 106 - 149, d = 2q + 5h. Is 13 a factor of q? True Let k(f) = -f + 12. Let q be 2/(1/(-4 + 6)). Suppose -qb - 12 = -4s, s - 17 = 4b + 4. Does 9 divide k(b)? True Suppose -132 = -5l + 578. Suppose 3z = -4i + 34, 4z - 2 - 46 = -4i. Suppose -2m - z + l = 0. Is m a multiple of 16? True Suppose 46c - 14291 = 3695. Is c a multiple of 3? False Let m = 342 - 294. Is m a multiple of 16? True Suppose -5n + 365 = 4i, 0 = 5i - 79 + 104. Does 7 divide n? True Suppose -4g - 4a - 4 = 64, 5g - 2a + 106 = 0. Let j = -15 - g. Is j a multiple of 3? False Suppose -54 = -3l - 15. Suppose 41 = -ls + 2654. Does 12 divide s? False Suppose -186 = -8q + 574. Is q even? False Let b(w) = -2w*2 - 13w - 9. Let f be b(-11). Let s = -76 - f. Let a = 11 + s. Does 11 divide a? False Let j be (0 + 3)/(3 + 70/(-24)). Let b = -9 + j. Is b a multiple of 10? False Suppose -3 = 3h + 5j, -3h + 2j = 2h + 5. Does 8 divide (-12)/18(h + 19)-8? True Let v = 188 + -56. Suppose 0 = -3q + v + 195. Does 41 divide q? False Let r = -303 - -401. Is r a multiple of 7? True Suppose -94 - 179 = 7g. Let m = g + 80. Does 12 divide m? False Let u(d) = -104d + 250. Is u(-11) a multiple of 50? False Let c(t) = t*3 + 18t*2 + 15t - 29. Let u be c(-17). Suppose uw - 435 = 295. Is 13 a factor of w? False Let l(i) = i + 1. Let j be l(-1). Let p be ((-1)/((-3)/2))/(53/159). Suppose j = 2m - 3w - 60, -4w + 31 - 95 = -pm. Is m a multiple of 6? True Let y be -1 + 4 + 0 + 9. Let q be -4 - -6 - y - 3. Let p(o) = -o3 - 14o*2 - 15o + 6. Is 16 a factor of p(q)? True Let i = -457 - -503. Is i a multiple of 23? True Suppose -m + 5j + 800 = 0, -2j - 2202 - 1088 = -4m. Is 33 a factor of m? True Let m(j) = -15j*2 + 237j + 4. Does 9 divide m(13)? False Let c = -65 + 509. Is 6 a factor of c? True Let f(v) = -6v - 9 - 7v*2 + 0v + 8 - v*3. Let k be f(-6). Let u(c) = 52c*2 - 1. Is 23 a factor of u(k)? False Suppose 30o = 33658 + 44792. Does 30 divide o? False Let p(g) be the first derivative of -g - 2g2 + 3 + 0g - 7g - 1. Does 2 divide p(-4)? True Let x = -19 + 23. Suppose 0r - xr + 20 = 0, 0 = -3l + r - 41. Let k = 7 - l. Is 5 a factor of k? False Let w(s) = -s + 7. Let l be w(5). Let t(i) = -i*3 - 5i*2 + 105. Let v be t(0). Suppose lh = v + 33. Is h a multiple of 23? True Suppose 0 = 9m - 3231 - 198. Is m a multiple of 3? True Let y(z) = 195z - 171. Is y(6) a multiple of 27? True Suppose 2225 = 6n + 641. Is n a multiple of 33? True Suppose 0 = 4j - 2x - 18, -2 = j + 2x + 6. Suppose 0b = -t + jb + 30, -b - 29 = -t. Suppose 2m = 6m - t. Is 2 a factor of m? False Let j(v) = v*3 - 8v*2 - 8v - 4. Let k be j(11). Let f = k - 171. Is f a multiple of 25? True Let t(y) be the first derivative of -y6/120 - y5/30 + 7y4/24 + 4y*3/3 + 2y2 - 3. Let x(f) be the second derivative of t(f). Does 4 divide x(-4)? True Is 17 a factor of 5/2 + 776/16? True Let a be ((-36)/42)/((1 + 0)/(-7)). Let j = a + 30. Is j a multiple of 6? True Let c(b) = -b3 + 2b2 - b + 8. Let h be c(0). Suppose hf - 362 = 182. Does 5 divide f? False Suppose v + 88 = 3v. Is 7 a factor of (-3 + v/8)(0 - -20)? False Let o(r) be the third derivative of r6/10 - r4/12 + r*3/3 + 13r*2. Does 6 divide o(1)? True Suppose 2x = -0r - 2r + 8, 3x = r + 4. Suppose -174 = -0z - xz. Is z a multiple of 18? False Suppose n + 2r - 19 - 1 = 0, 3n - 60 = -2r. Let j = 33 - n. Does 9 divide j? False Suppose 3v + z - 2z = -67, -v - 4z = 31. Let l = v + 25. Suppose 69 = 2j - 3f, -2j + lf + 75 = -3f. Is j a multiple of 7? False Let j be (-4)/(-6) - 365/(-15). Suppose -3f = 10 - j. Suppose 0 = -5p + d + 132, fp = d + 3d + 138. Does 10 divide p? False Let g(q) = 4q3 + 4q*2 + 3q + 1. Is g(4) a multiple of 8? False Suppose -5c - 4o = 8, -6 = 4o - o. Suppose 2m - 5b = c, 0b = 4m + 3b. Suppose ml + l = 22. Is 4 a factor of l? False Let f(s) = -s3 + 7s*2 + 2s - 7. Let q be f(7). Suppose -qw = -6w + 63. Let i = -29 - w. Is 12 a factor of i? False Let y(i) = 28i + 32. Let f be y(16). Suppose 0 = -12n + 7n + f. Is n a multiple of 16? True Let z(b) = 4b*3 - 17b*2 - 30b - 21. Does 16 divide z(9)? True Suppose 6u + 176 = 8u. Is u a multiple of 2? True Let b = 16 + -21. Is 14 a factor of (-10)/b + -2 - -42? True Let t be 4-4(-3)/12. Let w be (-2)/360/(-8). Suppose u + 179 = 3v - u, tv - wu = 248. Is v a multiple of 19? True Suppose 0 = -22w + 12w + 120. Suppose -425 = 7r - wr. Does 14 divide r? False Let p = 474 + -279. Is p a multiple of 13? True Let z = -234 + 147. Let s = 186 + z. Does 33 divide s? True Let k = 124 - -11. Let h = 200 - k. Is h a multiple of 14? False Is 2 a factor of -594(-2)/3 - -9? False Let f(z) = -z2 + 29z - 39. Does 57 divide f(15)? True Suppose 12 = -4h, -3p + 2h - 276 = h. Let o = 7 - p. Suppose -3j - 2j + 5a + 120 = 0, -4j + o = -3a. Does 18 divide j? False Suppose 2z - 22 - 18 = 0. Suppose a + a = -z. Let q = 11 - a. Does 7 divide q? True Suppose 0 = -2p + 7p - 225. Let j(r) = -r2 - 6r. Let f be j(-6). Suppose -3g - 6 + p = f. Is g a multiple of 4? False Suppose 7x + 18 = -2x. Let k(g) = -2g*3 + 2g*2 + 2g + 1. Let q(z) = z**3 -	{ "pile_set_name": "DM Mathematics" }
7)/(-12))/(2/8). Let l = v + n. What is the hundreds digit of l? 1 Suppose 8v + 8363 - 26795 = 0. What is the units digit of v? 4 Suppose 2i + r - 22 = 0, 0r = -r - 2. Let s = i - -49. Suppose -4n - 45 - s = -l, -4n + 200 = 2l. What is the tens digit of l? 0 Let c(d) = d - 18. Let f be c(8). Let m be (-1414)/(-10) - f/(-25). Suppose -10w + 13w - m = 0. What is the tens digit of w? 4 Let i be 2/(-11) - (-24)/11. Suppose -2f + ic = c - 80, 2f - 88 = 5c. Let a = 77 - f. What is the units digit of a? 8 Suppose -f = -2a + 3 + 4, 0 = -4f + 4. Let u be -3 - (a - 2)/(1/(-4)). What is the units digit of ((-54)/15 + 2)(u + -50)? 2 Let x be (-10)/(-45) + (-68)/(-18). Suppose -66 = -xj + 2j. Suppose 3m - 4h - 308 - j = 0, -5h + 465 = 4m. What is the units digit of m? 5 Let z(k) = 3k*2 - 19k - 50. Let i be z(18). What is the hundreds digit of (i/(-15) + 3)-3? 1 Let d = 843 - 837. What is the tens digit of (8 + (-135 - -7))/(d/(-20))? 0 Suppose 336 = 32r - 11r. Suppose 15o + 59 = ro. What is the units digit of o? 9 Suppose -5s + 0s = -50. Suppose 19756 = p + sp. What is the tens digit of p/30 - (-6)/1804? 6 Let q = 5403 - 2027. What is the units digit of q? 6 Let z = 6852 + 1735. What is the tens digit of z? 8 Let c be 6/(-4) + (-1415)/(-10). Suppose -64b = -79b - 300. What is the tens digit of (-1738)/b + 14/c? 8 Let n be ((-32)/(-8) - 80)/(0 + -1). Suppose -79k = -nk - 165. What is the tens digit of k? 5 Suppose y - 5g - 20 = 3y, 2y - 4g - 16 = 0. Suppose -13h + yh + 8684 = 0. What is the units digit of h? 8 Suppose 5d - 7d + 6746 = 5o, 5o - 6744 = -3d. Suppose -12u + o + 4146 = 0. What is the units digit of u? 8 Let p = -8698 - -13260. What is the tens digit of p? 6 Suppose 4f - 50201 = -4i + 7699, 0 = 13f - 5i - 188121. What is the units digit of f? 2 Suppose 9 = -t + 4z - 3, 3z = 2t + 4. Suppose 0 = 2s - 4, -2s + 2 = -2o - 2. Suppose 0q - q - 1 = o, -tn + 5q + 409 = 0. What is the tens digit of n? 0 Suppose 0 = -4a - 2x - 551 + 27165, 2a + 5x = 13327. What is the hundreds digit of a? 6 Suppose -96s = -105s. What is the tens digit of (s - -112)/(40/280)? 8 Let z(b) = 57b - 92. Let s be z(-5). Let y = 656 - s. What is the units digit of y? 3 Let t(s) = -52s. Let f(g) be the second derivative of 26g3/3 - g2/2 - 37g. Let v(i) = -3f(i) - 2t(i). What is the units digit of v(-3)? 9 Let a(h) = 351h - 898. What is the tens digit of a(31)? 8 Let n = 86262 + -33418. What is the ten thousands digit of n? 5 Let d = -753 - -751. Let v(t) = 4 + 0t*2 + 3t*2 - 1 + 2t*2. What is the units digit of v(d)? 3 Let v = 7394 - 4666. Let p = 4576 - v. What is the thousands digit of p? 1 Let m = 139 - 88. Suppose -4d - m = 9. Let f(r) = r*3 + 16r*2 + 11r + 20. What is the tens digit of f(d)? 8 Let m(t) = 17t3 + 2t*2 + 2t + 4. Let v be m(4). Let l = v - 717. What is the tens digit of l? 1 Let k = 100 - 139. Let f = 259 + k. What is the units digit of f? 0 Let j(k) = -24k3 - 50k*2 - 7k + 130. What is the thousands digit of j(-14)? 6 Let i(r) = 2r3 - r2 + 15r - 30. What is the units digit of i(5)? 0 Let b(q) = 255q2 - 6q + 31. What is the tens digit of b(6)? 7 Suppose -2t - 260 = -0t. Let j = -250 - t. What is the tens digit of j/(-9) + 1 - (-2)/3? 1 Suppose -3r = -3l + 21, -r - 2 = 2l + r. Suppose -p + 4 = 3c, -64p = -c - 62p - 8. Suppose -3j - lj + 1092 = c. What is the hundreds digit of j? 1 Suppose -4t - 5 = n, -5n - 3 = 2t - 14. Let p = 92 + n. Let r = p - 66. What is the units digit of r? 9 Let c = 6394 - -51348. What is the thousands digit of c? 7 Let b be 1/((2/(-4))/(3/(-2))). Suppose -8i + 4155 = -3i + 5x, -4i + bx = -3310. What is the hundreds digit of i? 8 Let x(d) = -d*3 - 9d*2 - 5d - 32. Let l be x(-9). Suppose i = -15v + lv + 56, i = 4v + 44. What is the units digit of i? 2 Let r(f) = -4f*3 + 4 + 0f*2 - 4f*2 - 9f + 0f + 3f. What is the tens digit of r(-5)? 3 Let d be 6/(-3)(4 - 5). Suppose 2r = dt + 138, -126 = -2r + t + 14. Suppose -2v + r = -39. What is the tens digit of v? 5 Suppose 0 = 24b - 42b - 10b + 1805804. What is the hundreds digit of b? 4 Suppose 1608 = 3l - 3h, -l + 312 = -4h - 212. Let v = l + -384. What is the hundreds digit of v? 1 Let n be 8/(-28) + -2305/(-7). Suppose 0u = 4u - 1008. Let z = u - n. What is the units digit of z? 8 Suppose -98a + 117a = 399. Suppose 28u - 5208 = au. What is the tens digit of u? 4 Suppose -13 - 87 = -2f. Suppose 0 = 3o - f + 8. Suppose -4j + o = -398. What is the units digit of j? 3 Suppose 246h - 247h + 36 = 0. Suppose 4q + 2q - h = 0. Let o(u) = 27u + 17. What is the hundreds digit of o(q)? 1 Let n be 210/280 - (-241)/4. Suppose 59q + 3154 = nq. What is the thousands digit of q? 1 Suppose 4f + 53787 = 1387t - 1386t, -t + 53752 = 3f. What is the units digit of t? 7 Let j = -80 - -85. Suppose 0 = d - jn, -2d + 3n + 2 = -d. Let y(w) = 8w*2 - 7w - 5. What is the hundreds digit of y(d)? 1 Suppose 0q - 5q + 78043 = 3g, -2q + 3g + 31234 = 0. What is the ten thousands digit of q? 1 Let t(w) = w2 - 9. Suppose 4n = -c + 25, 5c + 0n = -4n + 45. Suppose l + 4h - c = -0l, 3l - 2h + 27 = 0. What is the units digit of t(l)? 0 Let j(w) = w3 - 12w - 4 - 9w2 + 12w + 0w3 + 12w. What is the units digit of j(11)? 0 Suppose 37d + 173211 = 2823376 + 217298. What is the hundreds digit of d? 4 Let w(m) = -30m - 54. Suppose -29 = 3x - 4c, -3x = c + 2c - 6. Let o be 53/(-6) + x/18. What is the hundreds digit of w(o)? 2 Let s be ((-36)/(-24))/(6/52). Suppose 3o - a = 19, -o + 2a - 3a = -s. What is the units digit of (o/24)/((-1)/3) + 92? 1 Suppose -t = -d - 4t + 261, 5t + 555 = 2d. Suppose 0h + 18h = -54. What is the tens digit of (2/(-5))/(h/d)? 3 Suppose -11a + 63 = -20a. What is the tens digit of 1422(156/24 + a + 1)? 1 Let l(a) = 2a*3 + 12a*2 - 36a + 71. What is the tens digit of l(21)? 2 Let a(r) = 8r - 7r - 13 + 38r + 46r. Let s be a(7). Let d = 815 - s. What is the units digit of d? 3 Let g(k) = 9k - 81. Let v be g(9). Suppose 3t + 5z - 21 - 44 = v, 5t - 4z = 170. What is the tens digit of t? 3 Let s(l) = 5l + 1. Let c be s(-10). Let d = -41 - c. Suppose -2w + dw = 672. What is the tens digit of w? 1 Let m be (-119)/(-28) - ((-1)/4)/(-1). Suppose -4641 = -mz + 183. What is the thousands digit of z? 1 Let v(u) = 18u - 11. Let w be v(1). Suppose w = 15l + 7. Suppose -6j + 9j + 9 = l, -2p + 459 = -3j. What is the hundreds digit of p? 2 Let t = 35206 + -12152. What is the units digit of t? 4 Suppose -4l = 2m + 153 - 57, 4l = 2m + 72. Let x be ((-4)/6)/((-14)/m). What is the units digit of (-121)/x + 1/(-2)? 0 Suppose 0 = -b + 5r + 29231, 4r - 77881 = -3b + 9755. What is the thousands digit of b? 9 Let w = -182 - -185. Suppose h - 575 = -4l, 0h - wh = -3l + 450. What is the tens digit of l? 4 What is the tens digit of 4/((-64)/(-12)) - 55849/(-4)? 6 Let o(j) = -2j3 - 121j*2 - 2502j - 11. What is the hundreds digit of o(-23)? 8 Let b(z) be the third derivative of -5z4/12 - 3z*3 - 17z*2. Let n be b(-4). Suppose m = 3g + n, 4m = 2m + 5g + 43. What is the tens digit of m? 1 Suppose m = -2a + 24215, -42a = -44a + m + 24213. What is the ten thousands digit of a? 1 Suppose 2h + 52 = 4h. Let u = h + -37. What is the units digit of (-6)/33 + (-508)/u? 6 Let d(x) = 4x - 40. Let l(v) = -v + 8. Let m(z) = 2d(z) + 11l(z). Let q be m(22). Let n = q - -139. What is the units digit of n? 1 Let c be (-5)/(135/(-6)) - 673600/(-225). Suppose -2w - h = -1203, 5w - 3h = -h + c. What is the tens digit of w? 0 Suppose 0 = 5b + 4p - 235479, 1859b - 3p = 1863b - 188382. What is the tens digit of b? 9 Let d(n) = -265n*3 + 3n*2 - 25. What is the tens digit of d(-3)? 5 Suppose -87 = -4b + 41. Let r(l) = -6l - 5. Let j be r(-6). Suppose 0 = -jx + bx - 4. What is the units digit of x? 4 Let p(k) = -k2 - 39k - 107. Let z be p(-36). Let x(j) = 281j + 1. What is the hundreds digit of x(z)? 2 Let v(j) = 25j - 141. Let p be v(7). Suppose -f = 4r - 2, 2r - 2 = -4*f + p. What is the units digit of f? 0 What is the tens digit of (8235/(-189) + 1)/((-2)/434)? 3 Suppose -4	{ "pile_set_name": "DM Mathematics" }
e smallest value? (a) j (b) 1 (c) -1 c Let x = -15332 + 91993/6. What is the second biggest value in 9, x, -26, 1? 1 Suppose -b + 3 = -u, -148u - 4b = -144u + 28. Suppose 27 = 4x - x. Let f be (x/(-6))/(2 - 0). What is the smallest value in u, 0.6, f? u Let s = 0.355 - 0.187. Let f = -0.332 - s. Let g be (-10)/(-6)6/(-15). Which is the second biggest value? (a) 6 (b) -0.4 (c) f (d) g b Let h be (-2)/(0 + 4)-84. Let q be 8/h(5 + -2). Let k = -4092 - -4092. What is the fourth biggest value in k, 2/29, q, 4? k Suppose n - h - 5 = -2, 2n + 2h = 14. Let u = 9.01 - 8.71. Which is the biggest value? (a) u (b) -70 (c) n c Suppose 3q + 5u - 4 - 4 = 0, 0 = 4u - 16. Which is the second smallest value? (a) -3 (b) 134/13 (c) q a Let f = -0.547 - 72.153. Let v = -2.3 + f. Which is the biggest value? (a) 0.2 (b) 0.5 (c) v b Suppose -23l + 19 = -4l. Let k = -147 - -14260/97. What is the third smallest value in k, -1/4, l? l Let n = -40299.5 + 40299. Let q(m) = -m*3 + 9m*2 + m - 6. Let v be q(9). Which is the fourth smallest value? (a) -3 (b) v (c) -2 (d) n b Let k = -844 + 848. Let o be (-33)/(-102) - (1 - 3/6). What is the biggest value in k, o, 3/2, 2? k Let x = 11.9 - 15.9. Let w = 38 + -33. What is the fourth smallest value in x, w, 1/3, 2/11? w Let r = 8.8 - 7.3. Let h = r - 1.59. Which is the smallest value? (a) -1/2 (b) h (c) 4 a Suppose 3d - 9 = 4m, -2m + 4 - 14 = 4d. Let g be (-10)/m + (-5 - 51)/14. Suppose -5x - 19 - 6 = 0. What is the fourth biggest value in -4, -2, x, g? x Let x = -0.042 + 6.842. Let p = x + -3.8. Let l be (1 - (-3 + 2))/(-3). Which is the fourth biggest value? (a) p (b) l (c) 0.3 (d) 1/6 b Let y = 83.98 - -0.02. Let u = -85 + y. Suppose 0n + 2n + 4 = 0. Which is the second smallest value? (a) u (b) 7 (c) -0.5 (d) n a Let r = 1425 + -1430. Which is the smallest value? (a) 0 (b) 8 (c) r c Let p = -1/5842 + -11677/40894. What is the fourth biggest value in 2, 0, p, 4/5, 1/6? 0 Let i be (-6 - (-1632)/268)-1. What is the third smallest value in -2/17, i, 4, 1? 1 Suppose 0 = 2j + m + 22, -3j + 5j = 4m - 2. Let h = -7994 - -63955/8. Which is the fourth biggest value? (a) -0.11 (b) j (c) h (d) 4 b Let c be 1 + 2 - ((-4695)/(-7) + -4). Let t = 664 + c. Let q = -3 - -2.5. What is the third smallest value in q, t, -0.1? t Let q = 3.58 - -393.42. Let n = q + -397. What is the smallest value in 16, 3, n? n Let u = 30064/1365 + 167/105. Let z = u + -24. Which is the fourth smallest value? (a) 2 (b) z (c) -5 (d) 2/7 a Let x = -12889 - -51559/4. Which is the fifth smallest value? (a) x (b) -36 (c) -3 (d) 0.5 (e) 0 a Let l(w) = w3 - 8w*2 - 4w - 12. Let o be l(9). Let u = 29 - 31. Which is the second smallest value? (a) u (b) o (c) 5 c Let o = -820 - -825. Let y = 0.12 + -2.12. Which is the third smallest value? (a) 1 (b) y (c) o c Let w = 526/4275 + -4/225. Let u = -2.5 + 2.9. Let n = 16 + -24. What is the fourth smallest value in u, w, n, 4? 4 Let x = -2.9 - -3. Let l = -623 + 330. Let m = l + 296. What is the second smallest value in 2, m, x? 2 Let r = -1.83 + -0.17. Let p = r - -3. Let v be (12640/90)/16 - 9. What is the biggest value in -1.3, v, p? p Let p be 256/(-48)(-63)/(-84). Which is the second smallest value? (a) -0.1 (b) p (c) -5 (d) 8 (e) 11 b Let g = 0.97 + -1. Let x = -9 + 9. Let s = 8643 - 8643.5. Which is the third smallest value? (a) -0.3 (b) g (c) s (d) x b Let s be (144858/7224 + -20)/(6/(-8)). What is the third smallest value in 5, s, -6? 5 Let f = -1.473 + 27.473. Which is the third biggest value? (a) -1/4 (b) f (c) 0.3 (d) -0.5 a Let j = 4 - 5. Let p = 0.0813 - -475.9187. Let o = p - 479. Which is the fourth biggest value? (a) o (b) -0.1 (c) j (d) 2/13 a Let l = -2.046 + 0.046. Let n = -22.7 + 16.7. Suppose -4z = h - 23, -2h = z + 3h - 20. Which is the fourth smallest value? (a) n (b) l (c) -1 (d) z d Let b = 24 + -92. Let d = b + 68.1. Let t = 158 + -155. What is the biggest value in -5, t, d? t Let m = 8011 - 8014. Which is the smallest value? (a) -2/67 (b) 5 (c) m (d) -1 (e) -2 c Let v = -2113.95 + 2188. Let i = v - 74. Let o = 14 + -16. Which is the third biggest value? (a) i (b) -5 (c) o (d) -1/2 c Suppose y + 4864 = -h, -4y + 2569 = -h - 2290. What is the third biggest value in -5, h, -1? h Let h = 20.8 - 21.8. What is the fourth biggest value in h, 0.2, -24/5, -3? -24/5 Let w = -223 + 41. Let j = w + 183. What is the smallest value in j, 1/11, -1/3, 1/3? -1/3 Let g be (-4)/40 + (-8)/20. Suppose -2b = 46 - 8. What is the third smallest value in g, b, 4? 4 Let f = -6 + 6. Which is the smallest value? (a) 16 (b) 4 (c) f c Let s = 0.22 - -5.67. Let a = 5.59 - s. Let z = 1 + -3. What is the third biggest value in z, a, 15? z Let n = -4524/7 - -646. Let m = 142753/212 - 2693/4. Let y = m + 52/477. What is the smallest value in -0.2, -0.01, n, y? n Let u(t) = -15t - 44. Let n be u(-6). Let x be 2/7 + 1 + n/(-14). Which is the third biggest value? (a) -3/7 (b) 3 (c) x c Let n be (-2 + 18)-1 + -13. Which is the second smallest value? (a) n (b) -3 (c) -2 (d) 0.3 b Let z = -5.1245 + 0.1245. Let u = 22 + -15. Let y be 3/u + 1/(-1). Which is the third biggest value? (a) y (b) -4 (c) z (d) -0.1 b Let g be (-14)/612/22(-21)/147. Which is the third biggest value? (a) 0.5 (b) g (c) 19/6 (d) -0.01 b Let b = 0.5648 + -28.5648. What is the fourth biggest value in b, 3/8, -0.5, 5, -4? -4 Suppose -14p - 5 = -19p. Suppose p = -a - 5d - 15, -a + d = -8. Let g = 5.3 - 5. What is the third biggest value in g, 0.2, a, 3? g Let s = 81 - 43. Let u = -0.328 - -37.828. Let t = u - s. Which is the second smallest value? (a) -4 (b) 0.04 (c) t c Suppose 102 = -p + 4p. Suppose -pt = -36t - 18. Let i = t + 47/5. What is the third biggest value in i, -1/7, 2? -1/7 Let w = 45 - -178. Let p = w - 131. Let z = -90 + p. Which is the third smallest value? (a) -4 (b) -0.4 (c) z c Let h = 13 + -13. Let t = 91.52 + -91. Let g = -0.48 - t. Which is the second smallest value? (a) g (b) h (c) 4 b Let y = -11059 - -44237/4. Let r = -20 - -25.5. Let u = r + -8. Which is the smallest value? (a) 5 (b) u (c) y b Let o = -0.465 - -0.288. Let h = o - 220.823. Which is the third smallest value? (a) -3 (b) -1 (c) h b Let z = -12376/3 - -4044. Let f = z - -81. Let v = 3 - 1. Which is the second biggest value? (a) f (b) 3 (c) v c Let n = -12821 - -12830. What is the second biggest value in -0.5, n, -49? -0.5 Suppose 2m - 9m = -0m. Suppose 8 + m = 2s. Suppose 0 = w - 5y - 13, y = 2w - 12 + s. Which is the biggest value? (a) w (b) -25 (c) -4 a Let l(f) = 2f2 + 38f + 183. Let i be l(-9). What is the fifth smallest value in -0.5, -55, -5, i, 2/3? i Let m = -0.03 - -0.04. Let y = 1.01 - m. Let n = 18/47 - 220/329. Which is the third biggest value? (a) 5 (b) y (c) -0.3 (d) n d Let u = 2/565 - 1709/3955. Let j = -575 + 562. Which is the biggest value? (a) u (b) j (c) 0.3 (d) 5 d Suppose 6t + 18 = 3t + 12. Which is the smallest value? (a) 2 (b) t (c) -133 (d) -4 c Let p = 0.0059 + 3.1641. Let l = 2.97 - p. What is the second smallest value in 5, 2, -23, l? l Suppose 3m + 2s = 819, 4m - 5s = 5m - 260. Let g = 274 - m. Which is the fourth biggest value? (a) g (b) 0.2 (c) 0.6 (d) -1/6 a Let p = -0.1095 + 97.0395. Let q = 12.1 + p. Let k = q - 109. Which is the third biggest value? (a) 0.4 (b) -0.9 (c) k b Let k be -1 + (4 - 10) + 100/15. Let s = 13.711 - -0.289. Which is the third smallest value? (a) 2/9 (b) 0.4 (c) s (d) k b Let g(x) = 2x + 59. Let h be g(-29). Let d = 991 - 877. Which is the third biggest value? (a) d (b) -2 (c) h b Let m(y) = -2y2 - 243y + 739. Let k be m(3). What is the third smallest value in -0.1, 5, 4, k? 4 Let v = 0.327 + -0.24. Which is the third smallest value? (a) -0.3 (b) 3 (c) v (d) -2/3 c Let c = -0.09 - -5.09. Let z(r) = r*3 - 36r*2 + 37r - 63. Let u be z(35). Suppose 24 = -u*j + j. What is the smallest value in c, j, 1/6? j Let t = -740.1 - -739.1. Which is the smallest value? (a) 7 (b) t (c) -0.5 b Let m = -29569/95 - -1556/5. Which is the fourth biggest value? (a) 5 (b) -0.1 (c) -0.3 (d) m (e) 4 b Let r = -2241/155	{ "pile_set_name": "DM Mathematics" }
- q = 53. Solve -x + s - 8 = 0 for x. 2 Let w(n) be the second derivative of -n4/12 - n3/2 + 2n2 - 8n. Let i be w(-3). Solve 0 = -2a + 3a - i for a. 4 Let v be -234/(-4)1. Suppose -2r - 7 = -v. Suppose -8 = -3x + 5t, -r = -5x + 3t + 35. Solve -x = -3p + 1 for p. 4 Let x(o) be the first derivative of -o*2 - 7o + 2. Let c be x(-5). Suppose 3i + t = 24, 148t - 15 = -3i + 150t. Solve -in = -cn for n. 0 Let p be (-1)/4 - 11/(-44). Let x be 0 + (2 - p) + 2. Solve -xd + 18 - 2 = 0 for d. 4 Suppose 2r + 7 = 3s - 1, -s = -r - 2. Suppose 5d - 3w + 3 = 0, d + sw - 4 = -2d. Solve -3i = -di + 9 for i. -3 Suppose 4n + 5 = v, -2n - 3n - 25 = -5v. Let d = -3 - -5. Let c be ((-164)/(-6))/2 - (-8)/(-12). Solve vp = c + d for p. 3 Let o = 471 - 471. Solve 5m - 17m + 48 = o for m. 4 Suppose -59 = -2g - 23. Solve 7o = 10 + g for o. 4 Let j(k) = -3k2. Let w be j(-3). Let q = w + 39. Suppose -2c - 2 = -z - 10, 5z + q = 3c. Solve -cy = -6y - 8 for y. -4 Suppose 160 = -d - 4d + 5y, -2d + y - 67 = 0. Let p = -33 - d. Solve 3s + ps - 25 = 0 for s. 5 Suppose -3x + 5w + 338 = 0, -4x + 2x + 3w = -226. Let k = -116 + x. Solve -5r = -5 - k for r. 1 Suppose 6 = -7f + 6f. Let k be (2/f)/(8/(-72)). Solve kx - 12 = -0x for x. 4 Suppose 239w = 244w. Solve 0 = 2s - 4 - w for s. 2 Let k = 38 - 23. Let g be 6/15 - 231/k. Let f = g + 19. Solve -fv + 0v - 4 = 0 for v. -1 Suppose 0 = -7u + 12u + 25. Let z(m) = -m - 1. Let o(f) = f*2 + f - 8. Let i(g) = -o(g) + 4z(g). Let c be i(u). Solve 4r = -0r - c for r. -1 Let v = 209 + -206. Solve 0 = vx + 2x - 25 for x. 5 Suppose 14t = 5t. Solve r - 2 = -t for r. 2 Let t = 17 - 19. Let k be (-3)/(t - -1) + -55. Let m be 14/(-35) + k/(-5). Solve x + m = -x for x. -5 Suppose 2o = -3j + 14, -j = -4o - 2j + 28. Solve -15m = -22m - o for m. -1 Let n = 3020 - 3016. Suppose -1 = -3c + 5. Solve -n = -3v + c for v. 2 Let l be 12/(-3)(4 - (-57)/(-12)). Solve -lc + 5 = 2 for c. 1 Suppose -2r + 7 = -d, -3d - 4r = d + 76. Let y = -15 - d. Solve y = h - 3h + 2 for h. 1 Let d = 9 + -9. Suppose d = -0f - 3f + 24. Suppose 4q = 2t + 2t - 32, 31 = 4t - 3q. Solve tv - 5v + f = 0 for v. -4 Let b(m) be the second derivative of -m4/12 + m3/6 + 3m*2 + 3m. Let x be b(3). Solve x = -0i - 4i + 8 for i. 2 Let q(w) = 5w - 18. Let a be q(4). Solve av + 6 = 4 for v. -1 Suppose -5w = -2y - 1 + 15, -4y = 2w - 28. Suppose -20 = -yc + 2c. Solve o - 2o - c = 0 for o. -4 Let j(a) be the second derivative of -a4/4 + a3/2 - a2 + 5a. Let g be j(2). Let o = -8 - g. Solve o = 2c - 6c - 12 for c. -3 Let q(d) = d + 2. Let m be q(3). Suppose 3r + 38 = 65. Suppose -rz + 93 = 21. Solve t = z - m for t. 3 Let z be 1 - 240/25 - 6/(-10). Let f = z - -9. Solve 1 + f = -2y for y. -1 Let h = 1797 + -1789. Solve 62 = 18b + h for b. 3 Suppose 11n - 50 = n. Suppose -ni - 22 = -3v - 3, 0 = -4v - i + 10. Solve -vb + 7 = 10 for b. -1 Let j be (30/2)/(10/10). Suppose -9 = -4x + j. Solve -x = -4p - 18 for p. -3 Let q = -109 - -112. Solve -12 = w + qw for w. -3 Let i(h) = -2 - 51h2 - h3 + 10h*2 - 7h + 35h2. Let x = -10 - -5. Let w be i(x). Solve wv - 4v = 0 for v. 0 Suppose -2x + 5l + 38 = -4x, -57 = 3x + 4l. Let a = -19 - x. Solve a = 4p - 0 + 16 for p. -4 Let h(b) = 19b - 1. Let d be h(1). Solve 0 = 6t + d + 12 for t. -5 Let z be (84/(-56))/((-6)/41). Solve -13 + z = 3w for w. -4 Suppose -u - u + 4 = 0. Suppose -2i + 4 = -0i. Suppose 3r = -4p + i, 0 = -0p - 5p - 5. Solve -um - 4 = r for m. -3 Let o(x) = 2x + 63. Let b be o(-23). Solve 0 = 2c - 15 + b for c. -1 Let f be -2 + -1 + 8 - 1. Suppose 17 = fj + 1. Suppose 15 = 5c - 5k, -jk + 9k + 5 = 0. Solve 4o = -6 + c for o. -1 Let t(o) = o + 5. Let q be t(-6). Let h be q(-4 - -2) - -4. Suppose j - 5k = -7, -k = -4k + h. Solve u = -ju - 20 for u. -5 Let c = 35 + -32. Suppose c + 27 = 5s. Solve 0 = 2x + s for x. -3 Suppose -3518 + 3588 = 5y. Solve yt - 36 = 23t for t. -4 Let g(r) = -r + 2. Let b be g(0). Suppose 0 = bo + o. Let a be o/(8 - (7 - 3)). Solve a = -3p + p + 4 for p. 2 Let l = 171 + -170. Solve -7 - l = 4x for x. -2 Let p(r) = 61r + 562. Let h be p(-9). Solve -hk + 4k = -27 for k. 3 Suppose -4l + 6 = -2w, w + 11l - 10l - 6 = 0. Solve 7m - wm = 4 for m. 1 Let l be 5/(5/2) + 1. Let i be (-4)/(-2) - (-6)/(-3). Suppose ig - 2 = -g. Solve -gf = -f + l for f. -3 Let y = -425 - -451. Solve y = -9d - 10 for d. -4 Let m(c) = -c*3 - 3c*2 + 2c. Let x be m(-4). Let l = x - 13. Let q be 0/(7 + 20/l). Solve q = 3y + 1 - 4 for y. 1 Let y = -97 + 103. Solve -9d = -6d + y for d. -2 Let g(r) be the third derivative of -r4/24 + r3/3 - 10r*2. Let c be g(2). Solve 4y - 2 - 18 = c for y. 5 Suppose 8 - 36 = -7n. Let y be (1 - 2)/(-2)0. Solve y = -5x + x + n for x. 1 Let x be 30/(-21)(-1064)/190. Solve 21n = 17n + x for n. 2 Let n = 57 - 38. Let p = 6 + n. Suppose p = 2f + 3f. Solve 8 = fx - 17 for x. 5 Let z(s) = -s + 1. Let r be z(-1). Suppose -rl + 8 = -4l + 2m, -4l - 5m - 43 = 0. Let q be (-2)/l + 2/(-7). Solve 5b - b + 16 = q for b. -4 Suppose 0 = 10i + 17 - 57. Solve c = ic - 15 for c. 5 Suppose 0 = 13u - 300 + 27. Solve -uw + 9w = 0 for w. 0 Let m(i) = 7i + 308. Let s be m(-43). Solve -7 = -sy + 7 for y. 2 Suppose 3y + n - 91 = 0, 2y - 74 = -3n - n. Let g = y + -20. Suppose -g = -5s + 1. Solve -sq = -q - 3 for q. 3 Suppose 12 = 2h + h. Suppose -4 = p, 0 = -hf - p + 75 + 41. Let n = f + -28. Solve -k - nk = -6 for k. 2 Suppose 0 = -4r + 24x - 25x + 32, -5r - 3x + 40 = 0. Solve -rn = -17 - 7 for n. 3 Let l(b) = -b + 4. Let w be l(3). Let h be 4/(-8)(1-7 - -1). Suppose 0 = -hu + 2k + 9, -5u + 15 = -k - k. Solve -f - u = w for f. -4 Let k(l) = -l2 - 9l + 7. Let a be k(-7). Suppose 6u = -u + a. Solve y + 8 = -uy for y. -2 Let x be (3 - (-14)/(-3))/((-1)/3). Let c be -163/(-20) - (-3)/x. Solve 7 = cz - 5 for z. 4 Suppose 2t = 2b - 26, 3t = -0b + 2b - 31. Let h(s) = 18s - s*3 + 20s - 38s + 8s*2. Let l be h(b). Solve 8d - 3d - 25 = l for d. 5 Suppose -r = 2p - 3r - 20, -4p + 67 = 5r. Suppose 68 = pd + 16. Solve 6m - 2m + d = 0 for m. -1 Suppose 6x = 19x - 26. Solve -12 = xd + 2d for d. -3 Suppose -16 = -r + 4i, -2r = 3r - 3i - 97. Let o be 2/(5/r1). Solve op = 4p - 16 for p. -4 Let g(o) = 3o*2 - 16o - 98. Let s be g(-4). Solve -st = -22t + 8 for t. 1 Let t(y) = 11y2 - 1. Let s be t(-1). Suppose h - 2 = -2z + z, z + s = 3h. Suppose -217k + 64 = -370. Solve -hn - 5 = kn for n. -1 Let o = 149 + -145. Suppose -r - 2r - 16 = -5z, 0 = 2z + 4r - 22. Suppose 0p = -zp + 15. Solve 5 + p = -om for m. -2 Let g be 4/2(3 + -2). Solve -gh + 2 = -0h for h. 1 Let i(m) = -m*2 + 7m - 1. Let o be i(6). Solve ow + 9 + 11 = 0 for w. -4 Suppose 0 = -5z - 15, 0k - 2k = -z - 15. Let n(x) = x2 + 3. Let y(q) = q2 - 4q + 3. Let t be y(3). Let h be n(t). Solve h = -3p - k for p. -3 Let s = 76 - -1. Let h = -76 + s. Solve 2n + 5 = -h for n. -3 Suppose -2r + 28 = -2g + 16, -3g - 12 = -2r. Solve -rj = -8j - 10 for j. -5 Suppose -r = -3 - 3. Suppose rd - 9 = 3d. Let i(k) = k2 - k - 4. Let z be i(d). Solve -zf = 3 + 1 for f. -2 Let t(s) = 0s - 2s + s - 5. Let m be t(-5). Suppose -5z + 4f + 45 = 0, z + z - 3f = 18. Solve 3y - z = -my for y. 3 Let j(c) = -c + 20. Let k be j(15). Solve -kx - 11 = 9 for x. -4 Let j(k) = 3k2 - 10k + 28. Let c be j(8). Let b = c - 137. Solve -o = -bo + 6 for o. 3 Suppose -5k = 24 + 6. Let g be (k - -3)/(-3) - 3. Let l be ((-15)/10)/(g/4). Solve lz = 4z - 4 for z. 4 Let y(c) be the second derivative of -c5/20 + c4/2 - c*3/3 - 5c*2/2 + 4c. Let k be y(5). Suppose 0w - 5w = -k. Solve -g + w - 5 = 0 for g. -3 Let g = -51 + 47. Let q(b) = -5b - 12. Let a be q(g). Solve 0u - 4u = -a for u. 2 Suppose -4p - 77 + 105 = 0. Suppose -6v = -p - 11. Solve -v + 1 = 2m for m. -1 Let z = 532 + -525. Solve zt = 3t for t. 0 Let y = -78 - -83. Let t(s) = s*3 + 7s*2 + 5. Let a be t(-7). Let h = y - a. Solve 0 = 3z - 12 - h for z. 4 Suppose -32y + 55 = -27y. Let k be (11 - y)/(4 - 1). Solve k = -3*h - 16 + 1 for h. -5 S	{ "pile_set_name": "DM Mathematics" }
*3 + 19m*2 - 6m - 6. Determine 5d(n) - 3q(n). -3n3 - 28n*2 + 3n Let s = -6828 - -6825. Let f(k) = 5k + 2. Let u(h) be the third derivative of -h4/4 - h3/2 - h2. Determine su(m) - 4f(m). -2m + 1 Let i(v) = -v - 6. Let x be (-2)/(6/(-3)) + 24 + -24. Let l(m) = m - 1. Calculate xi(w) - 3l(w). -4w - 3 Let y(j) = -199j + 13. Let g(w) = -3w + 4. Give 9g(q) - 3y(q). 570q - 3 Let b(m) = 3 + 10m - 9m + m. Let r(o) = 327o + 15. Let h(t) = -151t - 7. Let l(v) = -13h(v) - 6r(v). Let u be 1/(-2) - (-28)/8. Calculate ul(x) - b(x). x Let s(p) = 2p3 - p2 - 6p. Let u(b) = 4b*3 - 3b*2 - 13b. Let z be (-14)/8((-10 - -12) + -6 + 8). What is zs(a) + 3u(a)? -2a*3 - 2a*2 + 3a Let a(x) = 2x2 - 6x + 2304. Let f(s) = -s*2 + 4s - 2304. Determine -4a(h) - 6f(h). -2h2 + 4608 Let a(o) = 216o*3 + 25o*2 + 9o + 7. Let v(j) = -110j3 - 13j*2 - 5j - 4. What is 5a(t) + 9v(t)? 90t3 + 8t*2 - 1 Let m be ((-4428)/28)/(-9) - 4/7. Suppose -59 - m = 19s. Let v(g) = -2g - 1. Let o(z) = 2z + 1. Determine sv(p) - 6o(p). -4p - 2 Let z(m) = 2917m + 17. Let x(n) = 5835n + 28. What is -3x(c) + 5z(c)? -2920c + 1 Let b(m) = -485m2 - 46m - 5. Let t(s) = -729s2 - 70s - 8. Give -11b(o) + 7t(o). 232o2 + 16o - 1 Let v(x) = -2430x3 - 35x - 104. Let n(t) = 405t3 + 6t + 16. Determine 13n(y) + 2v(y). 405y3 + 8y Let b(l) = 25l3 + 30l*2 + 4l - 2. Let p(w) = -48w3 - 61w*2 - 10w + 5. Calculate -5b(k) - 2p(k). -29k3 - 28k*2 Let m(a) = 5077a - 40. Let d(u) = -5352851u + 42175. Calculate -8d(h) - 8435m(h). -1687h Let l(c) = 2c2 + 4c - 19. Let z = -209 + 211. Let u(r) = -2r - 27r*z - 3r + 3r + 10 + 26r*2. What is -6l(w) - 11u(w)? -w2 - 2w + 4 Let s(n) = 6n2 - 2. Let k(x) = 10 - 607x + 18x2 - 7 + 607x - 23x2. Calculate 2k(a) + 3s(a). 8a*2 Let b(h) = -53h*2 + 4h - 4. Let r be 126/8(-54)/63(-22 - 16). Let u(t) = 6783t2 - 513t + 513. What is rb(j) + 4u(j)? -57j2 Let k(l) = 1 - 2702772l*2 + 0 + 2702773l*2 - l. Let p(a) = -171a*2 + 114a - 114. Determine 114k(v) + p(v). -57v*2 Let z(p) = 115p*2 - 9889p - 80. Let r be z(86). Let j(i) = -5i + 3. Let k(t) = 2 - 1 + 4t - 4. Give rk(f) + 5j(f). -f - 3 Let m(f) = 91f2 - 7f + 9. Let w(p) = -547p2 + 39p - 51. What is 34m(i) + 6w(i)? -188i2 - 4i Let l(h) = 1. Let f(a) = 154a2 - 20a - 14. Let t(o) = 22o2 - 3o - 2. Let y(v) = -3f(v) + 20t(v). Calculate -2l(d) + y(d). -22d*2 Let k(t) = -8t - 11. Let w(g) = 4g + 6. Let i(y) = 3y + 15 + y - 162y2 + 161y*2. Let r be i(7). Calculate rk(s) - 11w(s). 4s Let l(h) = -265h3 + 19h*2 + 65h - 10. Let y(w) = -159w3 + 12w*2 + 40w - 6. Give 8l(o) - 13y(o). -53o3 - 4o*2 - 2 Let z(k) = -2k + 6. Suppose -2l - 122b = -126b - 22, -2b = 6. Let a(q) = 3q - 9. Calculate la(p) + 7z(p). p - 3 Let o(y) = 2229y*2 - 5y - 42. Let v(l) = 4458l2 - 11l - 91. Calculate 13o(f) - 6v(f). 2229f2 + f Let m(g) = 2g*2 + 1. Let v(n) = -214n*3 + 16n*2 + 3. Give -3m(q) + v(q). -214q3 + 10q*2 Let o(j) = -3j*2 + 12j - 6 - 46j + 19j - 5j2. Let v(d) = 9d*2 + 16d + 7. Calculate 7o(g) + 6v(g). -2g2 - 9g Let c be 3 + (9 - (-10 + 27)). Let y(m) = -33m + 1. Let r(z) = 16z. Calculate cr(d) - 2y(d). -14d - 2 Let x(c) = 1983c - 10. Let j(a) = 660a - 4. Calculate 8j(o) - 3x(o). -669o - 2 Let m(s) = 2s2 + 47s + 1. Let h(u) = -6u2 + 1. Calculate h(y) - m(y). -8y*2 - 47y Let s(u) = -2u3 - 10u*2 + 15u + 25. Let x be s(-6). Let h(q) = 7q - xq + q + 13q. Let y(m) = 7m. What is 4h(d) - 7y(d)? 7d Let j(x) = -90x*3 + 2x*2 - 68x + 9. Let n(h) = 269h3 - 5h*2 + 189h - 24. Give 8j(w) + 3n(w). 87w3 + w2 + 23w Let i(p) = -1. Let a(d) = -109d + 437. Let c be a(4). Let q(n) = -n + 9. Calculate cq(b) + 3i(b). -b + 6 Let o(w) = 4w*3 + 6w2 + 3. Let b(i) = i3 + i*2 + 1. Suppose -x - 10 = -2c, -4c - 4x + 31 = -1. Determine cb(j) - o(j). 2j3 + 3 Let d(o) = -o2 + 1. Let r(h) be the second derivative of h5/30 + h3/6 + 37h2/2 - h + 37. Let w(j) be the first derivative of r(j). What is d(n) - w(n)? -3n*2 Let y(u) = 10u + 3779. Let c(v) = 13v + 3779. Calculate -4c(o) + 5y(o). -2o + 3779 Let x(v) be the first derivative of -50v3/3 - 15v*2/2 + 1275. Let q(c) = 7c*2 + 2c. What is -30q(l) - 4x(l)? -10l2 Let x(k) = -4k + 1. Let d be 0 + 2 + 4 + -3 - 5. Suppose 0 = n + 9 - 8. Let t(q) = q - 1. Give dt(w) + nx(w). 2w + 1 Let t(m) = -m3 - m2 - 1. Let a(k) = 9k*3 - 4k*2 + 6. What is -a(z) - t(z)? -8z*3 + 5z*2 - 5 Let j(h) = -5629736h - 9219. Let q(a) = 3053a + 5. What is 5j(c) + 9219q(c)? -3073c Let l(h) = -2h2 + 3h - 2. Let p(i) = -15i2 - 519i - 12. Give -6l(z) + p(z). -3z*2 - 537z Let z(p) = 28p3 - 20p*2 + 20. Let i(s) = 96s*3 + 95s*3 + 23s*3 + 3 - 3s*2 - 210s*3. Give -20i(r) + 3z(r). 4r3 Let u(v) = v3 - v*2 - 1. Let h = -396 + 400. Let t be (-5 + 2 - h/(-4)) + 1. Let g(n) = -2 - 6n*2 + 4n*3 + 0n*3 + 3n*2. What is tg(i) + 2u(i)? -2i3 + i2 Let j(p) = -3p2 + 4p - 35. Suppose -h + 41 - 43 = -2s, -3s = -h - 1. Let b(r) = -2r2 + 3r - 34. Give hb(z) + 3j(z). -z*2 + 31 Let x(b) = -b + 2. Let m(o) = -1 + 2 - o - 3 + 2o. Let r(c) = c*2 + 11c - 1. Let n be r(-11). Let l be 50/(-8) + 4/16 - n. Calculate lm(p) - 6x(p). p - 2 Let f(o) = -91o + 185o - 97o. Let b(x) be the third derivative of -3x4/8 + x2. Suppose 3s = -3n + 21 + 3, -4s = 5n - 37. Determine sb(z) - 8f(z). -3z Let q(d) = -5d - 9. Let f(a) be the first derivative of a*2/2 + a + 9. Let k = 677 - 671. Calculate kf(l) + q(l). l - 3 Let w(m) be the first derivative of 5/2m2 - 38 + m. Suppose 0 = -2r + r + 4. Let g(t) = -t. Give rg(i) + w(i). i + 1 Let k(d) be the third derivative of 0d*3 - 1/24d*4 + 0d + 8d2 + 0. Let x(w) = w - 33 + 33 + 2w*2. Determine k(m) + x(m). 2m*2 Let v(s) = -18s - 5. Let p(q) = -390q - 6. Let m(f) = -356f - 5. Let c(g) = -12m(g) + 11p(g). Calculate -5c(j) + 6v(j). -18j Let a(b) = -2b*3 + 3b - 3. Let f(n) = -266n3 + n2 - 3n + 6. What is -a(z) - f(z)? 268z3 - z2 - 3 Let c(u) be the first derivative of -2u + 116. Let m(w) = 12w + 44. Determine 44c(a) + 2m(a). 24a Let j(v) = 2v2 - 15v. Let k(y) = 132y2. Let u(l) = 527l*2 + 14l. Let c(o) = -4k(o) + u(o). Calculate 4c(p) + 3j(p). 2p*2 + 11p Let v(m) = -8m2 - 10m - 16. Let o(c) = -3c2 - 3c - 5. Let d = -4613 - -4616. Calculate dv(t) - 10o(t). 6t2 + 2 Let u(k) = 2k - 215. Let x(q) = -13q + 1318. Let t(c) = -6u(c) - x(c). Let r(d) = -5. Let l(f) = -4. Let y(g) = 6l(g) - 4r(g). Determine -4t(a) + 28y(a). -4a Let f(i) = -6i*2 + 3i - 1712. Let m(r) = -5r2 + 2r - 1714. Give 2f(k) - 3m(k). 3k2 + 1718 Suppose 0 = 4o - 6 + 58, -79z + 77z + o = -1. Let i(v) = 5 - v - 3v + 0. Let s(f) = 5f - 6. Give zs(j) - 7i(j). -2j + 1 Let m(v) = -3v + 7. Let x(g) = -g - 1. Let f(z) = m(z) - 2x(z). Let s(q) = -q + 17. What is -7f(j) + 4s(j)? 3j + 5 Let c(f) be the first derivative of 10f3/3 + 7f2 - 2509. Let p(q) = q2 - 6q. Let w(d) = -5d. Let l(u) = -2p(u) + 3w(u). Calculate -6c(j) - 28l(j). -4j2 Let n(y) = -y2 + 1. Let f(d) = 22d*3 + 88d*2 - 88. Suppose 2 = -i - 2, 4i + 18 = -2u. Calculate uf(s) - 88n(s). -22s*3 Suppose 2f = -3f + 385. Let a(x) = 3x. Let y(u) = 77u - 85. Let b(c) = -196c + 204. Let s(q) = -5b(q) - 12y(q). Calculate fa(g) - 4s(g). 7g Let b = 3971 + -3973. Let h(g) = -3g + 23. Let l(n) = 7n - 47. What is bl(m) - 5h(m)? m - 21 Let d(w) = w. Let v = 1047 + -879. Let f(i) = -vi - 174i + 338i. Determine 16d(c) + 5f(c). -4c Let j(f) = -9f - 1. Let h = -2 + -2. Let v be (-90)/36(5 - 3). Let l(t) = 8t + 1. Calculate hj(a) + vl(a). -4a - 1 Let j(x) = -38x. Let c(u) = 26u - 220. Let q(w) = 7w - 60. Let y(n) = -6c(n) + 22q(n). Determine 2j(s) - 28y(s). -20s Let i(n) = n2 + 5n - 17. Let j(s) = s*2 + 3s - 8. Suppose 41g + 207 = 50g. Suppose g = -19w - 34. Give wi(v) + 5j(v). 2v*2 + 11 Let u(r) = 444r*3 - 3r*2 + 3r + 4. Let x(l)	{ "pile_set_name": "DM Mathematics" }
biggest value in -4/5, 3/2, -1/7, 14? -4/5 What is the third smallest value in 2.2, -0.1, -2/11? 2.2 What is the third biggest value in 1/4, 2/3, -0.1? -0.1 What is the third smallest value in -5, 4, 2/27? 4 Which is the third biggest value? (a) 1 (b) 0.01 (c) 0.04 b Which is the third biggest value? (a) -2/3 (b) 3 (c) -5 (d) 43 a What is the fourth smallest value in 1/4, -5, -8, 0.2? 1/4 Which is the second biggest value? (a) -10 (b) -9/8 (c) 5 b What is the third biggest value in -0.2, 0.4, -1/24, 0.3? -1/24 What is the biggest value in 0.1, 6, -0.01? 6 Which is the third biggest value? (a) 7/4 (b) 5 (c) 41 (d) -1 a Which is the biggest value? (a) -2/131 (b) 2/13 (c) -1 b What is the biggest value in 6, 5, 2, 0.23? 6 What is the second biggest value in 1/8, 3/172, 0? 3/172 Which is the third smallest value? (a) -1/3 (b) -10 (c) 0.29 c Which is the second smallest value? (a) 0.3 (b) 130/3 (c) 1/3 c What is the second smallest value in 7, 0.1, -2/5? 0.1 Which is the second smallest value? (a) 2 (b) 1/4 (c) 625 (d) -5 b What is the second biggest value in -1/8, -4, 12/13? -1/8 Which is the second smallest value? (a) 1/2 (b) 18110 (c) 2/11 a What is the smallest value in -0.4, -1/2, 2, 0.1, 3? -1/2 What is the smallest value in -1/2, 4, -0.94? -0.94 Which is the third smallest value? (a) -5 (b) 1 (c) -5/4 (d) 3/5 d What is the fourth biggest value in -0.5, 0, -3, -0.4? -3 What is the biggest value in 1/2, -44, 2/3, 1, 2? 2 What is the fourth smallest value in 2.1, -16, -4, 5? 5 Which is the second biggest value? (a) 6 (b) -2/13 (c) -2 (d) 0.05 (e) 0 d What is the smallest value in -1, -1/4, -13, 0.3, 3? -13 Which is the fourth smallest value? (a) -2/21 (b) 0.1 (c) -0.2 (d) -45 b Which is the third biggest value? (a) 2.3 (b) 0.1 (c) 6 b Which is the fourth smallest value? (a) 4 (b) 2 (c) 5 (d) -3/5 c Which is the smallest value? (a) 3.5 (b) 5/2 (c) 4 (d) 1/4 (e) 1 d What is the third smallest value in 22, -3/7, 0.1? 22 What is the smallest value in 5, 3, -161, -0.4? -161 Which is the third smallest value? (a) 7/4 (b) 5 (c) 3 (d) -5 (e) 0.1 a Which is the third smallest value? (a) -2/1333 (b) -1 (c) 5 c Which is the third biggest value? (a) -0.5 (b) 0.14 (c) 2/15 (d) 2/17 d Which is the second smallest value? (a) -74 (b) -5 (c) 4 b Which is the smallest value? (a) 4 (b) 9 (c) -3 c Which is the third biggest value? (a) -0.4 (b) -10 (c) -1/10 (d) -13/3 d What is the biggest value in -0.5, 0.3, -113? 0.3 What is the second biggest value in 8, 3, 2.4? 3 Which is the biggest value? (a) 4.5 (b) -4 (c) 26.2 c What is the biggest value in 77, -2, -3? 77 What is the fourth biggest value in 4, -1/5, -99, 0.4? -99 What is the second smallest value in -3, -3/4, -1? -1 What is the biggest value in 1, 0.5, -4, -27? 1 What is the smallest value in -2/75, -0.4, -5.1? -5.1 What is the third smallest value in -4, -0.02, -1.4? -0.02 What is the fifth smallest value in -5, -3/5, -1/3, 2, 1/2? 2 Which is the biggest value? (a) -4 (b) 0.5 (c) -11 (d) 196 d Which is the third biggest value? (a) -3 (b) 1.28 (c) 2/7 (d) -5 (e) 0.2 e Which is the fourth biggest value? (a) 2 (b) 0.5 (c) -4 (d) 15/8 c What is the biggest value in 0.182, -8, 0.4? 0.4 What is the third biggest value in -3, -0.2, 2/3? -3 What is the smallest value in 7/16, 2, -7/4, 3? -7/4 What is the fourth biggest value in -179, 5, 3/8, -2/3, -5? -5 Which is the fourth biggest value? (a) -5 (b) 4 (c) -20 (d) -0.4 c Which is the third biggest value? (a) -4 (b) -2/5 (c) -13 c Which is the fourth biggest value? (a) -2/17 (b) -0.1 (c) 1/2 (d) 1/5 a Which is the fourth biggest value? (a) 0.2 (b) -1 (c) 2/19 (d) -0.4 b What is the fifth smallest value in -1/8, -0.1, 0, 5, 2/3? 5 Which is the fourth smallest value? (a) -3/2 (b) -0.4 (c) 5 (d) 0.0586 (e) -4 d Which is the second biggest value? (a) 2/3 (b) 2/13 (c) -1/11 (d) 0.21 d Which is the third smallest value? (a) 2/57 (b) -0.3 (c) 7 c What is the second smallest value in 3/4, -12.5, -2/17, 4/5? -2/17 What is the third biggest value in 1/3, 5, 5.2? 1/3 What is the second biggest value in -0.4, -0.2, 22? -0.2 Which is the third smallest value? (a) 228 (b) 0.02 (c) 5 a What is the third biggest value in 1/3, -6, -9, 2/9? -6 Which is the second smallest value? (a) -56 (b) -4 (c) -3 (d) 5 b Which is the smallest value? (a) -5 (b) -75 (c) -4 b What is the second biggest value in 3, 39, -3? 3 What is the fourth biggest value in -1/9, -0.4, -1, -1/35? -1 Which is the fourth biggest value? (a) 1.6 (b) -2 (c) 3 (d) -0.1 b Which is the third biggest value? (a) -2 (b) 4 (c) -8/7 (d) 0.5 (e) -4 c Which is the biggest value? (a) -0.5 (b) 1/2 (c) -5 (d) 2/21 (e) -2/11 b Which is the biggest value? (a) -482/5 (b) -5 (c) 4 (d) -2/15 (e) 1/2 c What is the biggest value in 26, 1/3, -2, -0.5? 26 Which is the fifth biggest value? (a) -42 (b) 2/27 (c) 0 (d) 0.5 (e) 1/3 a Which is the fourth smallest value? (a) 1/2 (b) -5 (c) -0.2 (d) -0.23 a What is the biggest value in 1/3, -4, -3, -0.3, -17? 1/3 What is the fourth smallest value in -0.06, 3, 2, 2/9? 3 What is the biggest value in -8, 3, 5, 0.03? 5 What is the smallest value in -2, 3/5, 2/9, -4? -4 What is the fourth smallest value in -2, 33, -1/6, -2/13, 0.3? 0.3 Which is the second biggest value? (a) -17 (b) 3 (c) -0.4 c Which is the biggest value? (a) 5 (b) -0.1 (c) 95 (d) 4 c Which is the third smallest value? (a) -0.2 (b) -12 (c) 1/2 (d) 3 c Which is the third smallest value? (a) 1/4 (b) 1/2 (c) 1 (d) 8 c What is the fourth biggest value in 2/13, 0.3, -21, -0.33? -21 Which is the third smallest value? (a) -0.4 (b) 21 (c) -6 (d) -28 a Which is the fourth biggest value? (a) 3/4 (b) 0 (c) -0.013 (d) -1/3 d Which is the second biggest value? (a) 2 (b) 3/4 (c) 46/25 c What is the second biggest value in 7, 5, -5, -1/6, 0? 5 Which is the second biggest value? (a) -12 (b) -11 (c) -1 b What is the third biggest value in -1, 7/5, 2, 0.5? 0.5 What is the third smallest value in 13, -105, 0, -1/5? 0 Which is the smallest value? (a) 2 (b) -2 (c) 0.2 (d) -2020 d What is the fourth biggest value in 0.05, 4, 0.3, -10? -10 Which is the fourth biggest value? (a) 0 (b) -0.2 (c) 5 (d) -69 d Which is the smallest value? (a) -2/7 (b) -23 (c) 1 b What is the second biggest value in 4, -110, -1/3, 0, 1/6? 1/6 What is the second smallest value in 2/9, 0.584, -0.4? 2/9 What is the second smallest value in -4, -0.3, -98/5? -4 Which is the smallest value? (a) 0 (b) 170 (c) 0.2 a Which is the third smallest value? (a) 0 (b) 1/17 (c) -2 b What is the fourth smallest value in 4, -161, 2, -0.5? 4 What is the second biggest value in -3, -199, 6? -3 Which is the smallest value? (a) -66 (b) -5.4 (c) -3 (d) 1 (e) -2 a What is the biggest value in 11, 3, 6, 5, 4? 11 Which is the fourth smallest value? (a) -4 (b) 2/5 (c) -5 (d) -20 b Which is the third biggest value? (a) -2/31 (b) 2/9 (c) 1.1 (d) 1 (e) 2 d What is the fourth biggest value in 0.006, 0.4, 1/2, 0.14? 0.006 What is the third smallest value in 1/16, -2, 0.6? 0.6 Which is the third biggest value? (a) -0.4 (b) -14 (c) 0.1 (d) 3 (e) -5/2 a What is the biggest value in 0.2, -5, -7, -6/7? 0.2 What is the second smallest value in 4, 0.04, -0.4? 0.04 What is the fourth smallest value in -2, 228, -1/2, 0.5? 228 Which is the third smallest value? (a) 30/13 (b) 0.7 (c) 0.3 a Which is the third biggest value? (a) 53/4 (b) 0.1 (c) 3 (d) -4 (e) -13 b Which is the fifth smallest value? (a) -35 (b) -2 (c) 0.3 (d) 2/15 (e) -13/4 c Which is the biggest value? (a) 0.02317 (b) 1 (c) 3/7 b What is the smallest value in 0.1, -6/5, -0.14, 0.13? -6/5 Which is the biggest value? (a) -0.3 (b) 0.4 (c) 16 c What is the smallest value in 0.09, 21, -1? -1 Which is the smallest value? (a) 0 (b) -2 (c) 5 (d) -1/2 (e) 0.08 b What is the third smallest value in -5/4, 2/15, 2, -1/6, 0.4? 2/15 What is the second smallest value in 0, 6, 432? 6 Which is the fourth smallest value? (a) -2 (b) -0.01 (c) -1 (d) -3/2 b Which is the third biggest value? (a) -0.1 (b) 3 (c) 0.48 (d) -7 a W	{ "pile_set_name": "DM Mathematics" }
Give prob of picking 4 c. 1 Four letters picked without replacement from hhhn. What is prob of picking 1 n and 3 h? 1 Four letters picked without replacement from {v: 4, i: 5, b: 5}. What is prob of picking 1 v and 3 b? 40/1001 What is prob of picking 2 w when two letters picked without replacement from wwww? 1 What is prob of picking 1 o, 1 n, and 2 l when four letters picked without replacement from lnodod? 0 Four letters picked without replacement from sfssdfsdsfdfnfssf. What is prob of picking 1 s, 2 f, and 1 n? 3/68 Four letters picked without replacement from {j: 3, z: 13, r: 2}. Give prob of picking 3 j and 1 z. 13/3060 Four letters picked without replacement from {s: 2, u: 4, f: 4}. What is prob of picking 3 u and 1 s? 4/105 Four letters picked without replacement from {g: 5, l: 2, m: 8, q: 4}. Give prob of picking 1 m, 1 l, and 2 g. 40/969 What is prob of picking 2 m when two letters picked without replacement from mabaaamababbbmmab? 3/68 Two letters picked without replacement from {s: 1, g: 1, q: 1}. Give prob of picking 1 g and 1 q. 1/3 Three letters picked without replacement from {r: 13, m: 2, l: 3, j: 2}. What is prob of picking 2 l and 1 m? 1/190 Four letters picked without replacement from {x: 1, q: 1, v: 4, z: 3, b: 2}. What is prob of picking 2 z, 1 b, and 1 v? 4/55 Two letters picked without replacement from srrrrrsrrr. What is prob of picking 2 s? 1/45 Calculate prob of picking 1 a and 2 k when three letters picked without replacement from {a: 1, h: 1, k: 2, f: 1}. 1/10 Three letters picked without replacement from pppppnqupppp. Give prob of picking 1 q, 1 u, and 1 n. 1/220 Four letters picked without replacement from {l: 3, u: 3, v: 3, m: 7, c: 2}. Give prob of picking 1 v, 1 u, 1 l, and 1 c. 3/170 Calculate prob of picking 1 c, 1 a, and 1 p when three letters picked without replacement from caghncncccnpnn. 5/364 Three letters picked without replacement from {s: 2, l: 4, i: 1, w: 1}. What is prob of picking 1 l and 2 s? 1/14 What is prob of picking 1 o and 2 n when three letters picked without replacement from owwonnwnwown? 9/110 Four letters picked without replacement from pmpjafaappfkakaakpam. Give prob of picking 1 k and 3 a. 7/323 Calculate prob of picking 2 e, 1 h, and 1 d when four letters picked without replacement from {x: 1, d: 2, m: 3, p: 3, e: 3, h: 2}. 12/1001 Four letters picked without replacement from {i: 1, d: 2, o: 1, f: 1, b: 1, n: 1}. Give prob of picking 1 o, 1 n, 1 i, and 1 b. 1/35 Two letters picked without replacement from {p: 3, j: 5}. Give prob of picking 2 p. 3/28 What is prob of picking 2 y when two letters picked without replacement from ssyysssysssyss? 6/91 Three letters picked without replacement from {m: 3, x: 2, o: 5}. Give prob of picking 1 x, 1 o, and 1 m. 1/4 Calculate prob of picking 3 t when three letters picked without replacement from {t: 6, f: 4, o: 1}. 4/33 What is prob of picking 1 m, 1 p, and 1 u when three letters picked without replacement from {u: 1, m: 2, s: 1, w: 1, p: 2}? 4/35 Two letters picked without replacement from {z: 2, v: 1, r: 1, g: 3}. What is prob of picking 1 r and 1 g? 1/7 What is prob of picking 1 i, 1 n, and 1 g when three letters picked without replacement from {i: 8, g: 4, k: 2, n: 2}? 4/35 What is prob of picking 1 n, 1 s, 1 v, and 1 x when four letters picked without replacement from xvsffmnn? 1/35 Calculate prob of picking 1 c and 1 y when two letters picked without replacement from cclccrry. 1/7 Two letters picked without replacement from zzdzzzgdguz. Give prob of picking 1 z and 1 g. 12/55 Three letters picked without replacement from {l: 3, w: 1, r: 1, t: 1, d: 4, j: 2}. Give prob of picking 2 d and 1 w. 3/110 What is prob of picking 2 y and 1 b when three letters picked without replacement from bbbbbbyy? 3/28 Four letters picked without replacement from {f: 11, y: 3}. What is prob of picking 4 f? 30/91 What is prob of picking 3 n when three letters picked without replacement from mmn? 0 Two letters picked without replacement from zzyvyvyyv. Give prob of picking 1 v and 1 z. 1/6 What is prob of picking 1 k and 2 r when three letters picked without replacement from {k: 2, r: 8}? 7/15 Two letters picked without replacement from bcbemmecmmecdcmem. Give prob of picking 1 b and 1 m. 3/34 What is prob of picking 4 m when four letters picked without replacement from mmmmmm? 1 Three letters picked without replacement from {l: 4, m: 2, o: 2, r: 3}. Give prob of picking 2 l and 1 m. 4/55 Three letters picked without replacement from vvmvvvvvm. Give prob of picking 3 v. 5/12 Two letters picked without replacement from {j: 16, x: 4}. What is prob of picking 1 j and 1 x? 32/95 Calculate prob of picking 2 g and 1 j when three letters picked without replacement from {j: 1, g: 3, e: 1}. 3/10 Two letters picked without replacement from ccccccccccucccuuucub. What is prob of picking 2 b? 0 What is prob of picking 1 q and 1 o when two letters picked without replacement from {o: 2, q: 4, m: 6}? 4/33 Three letters picked without replacement from ssaaa. Give prob of picking 2 a and 1 s. 3/5 What is prob of picking 1 s and 1 o when two letters picked without replacement from smoozzsszsz? 8/55 Four letters picked without replacement from ccbmbcmcmmmm. Give prob of picking 4 m. 1/33 Calculate prob of picking 2 t when two letters picked without replacement from qqqqjkqqqkqttjkqqqqk. 1/190 Two letters picked without replacement from {i: 11, o: 5}. What is prob of picking 1 i and 1 o? 11/24 Two letters picked without replacement from {z: 4, e: 3, r: 13}. Give prob of picking 2 z. 3/95 What is prob of picking 2 m and 1 d when three letters picked without replacement from {d: 3, m: 2, c: 1, u: 1}? 3/35 Four letters picked without replacement from {f: 2, p: 7}. Give prob of picking 3 p and 1 f. 5/9 Three letters picked without replacement from nnswhnssswhwwws. What is prob of picking 1 w, 1 n, and 1 s? 15/91 Three letters picked without replacement from {g: 1, x: 1, s: 7, r: 2, w: 9}. Give prob of picking 3 s. 7/228 Calculate prob of picking 1 f and 1 t when two letters picked without replacement from tswlstsfwt. 1/15 Calculate prob of picking 2 a and 1 s when three letters picked without replacement from {s: 1, y: 4, w: 1, a: 2, o: 2}. 1/120 What is prob of picking 1 s and 1 t when two letters picked without replacement from msmtb? 1/10 What is prob of picking 3 w when three letters picked without replacement from wwhwwwww? 5/8 What is prob of picking 1 a and 1 m when two letters picked without replacement from hahavahhmcucvhcahhma? 1/19 Calculate prob of picking 1 n and 1 d when two letters picked without replacement from dxnbx. 1/10 Three letters picked without replacement from zzkzkkkk. What is prob of picking 3 k? 5/28 Calculate prob of picking 1 s, 2 h, and 1 o when four letters picked without replacement from {s: 5, o: 1, d: 1, h: 2}. 5/126 What is prob of picking 1 s and 1 w when two letters picked without replacement from qwswrbrxrxx? 2/55 What is prob of picking 1 q and 1 p when two letters picked without replacement from {h: 1, s: 3, m: 2, p: 2, q: 2, u: 4}? 4/91 Calculate prob of picking 1 a and 1 l when two letters picked without replacement from {u: 3, i: 1, l: 4, j: 1, a: 1, h: 4}. 4/91 Calculate prob of picking 3 k and 1 y when four letters picked without replacement from amrryardkrkkkrkkk. 1/68 Calculate prob of picking 2 t, 1 b, and 1 l when four letters picked without replacement from bbtbtblbbbbbbtbbb. 39/2380 Calculate prob of picking 3 s when three letters picked without replacement from {s: 3, f: 7, n: 1, u: 1, a: 2}. 1/364 Two letters picked without replacement from wwwwwwiw. What is prob of picking 2 w? 3/4 Four letters picked without replacement from {z: 3, i: 7}. Give prob of picking 3 z and 1 i. 1/30 Two letters picked without replacement from llnvllblrbblrhbhrv. Give prob of picking 1 v and 1 h. 4/153 Two letters picked without replacement from qvxavqazaxxvvx. What is prob of picking 2 q? 1/91 Four letters picked without replacement from {b: 6, n: 3, v: 4, s: 2}. What is prob of picking 1 b, 1 n, and 2 v? 36/455 Calculate prob of picking 2 o when two letters picked without replacement from wwwwowvoo. 1/12 What is prob of picking 3 u when three lette	{ "pile_set_name": "DM Mathematics" }
implify (-4(sqrt(1210) - (sqrt(1210) - (-2sqrt(1210) + sqrt(1210) - sqrt(1210)))) + sqrt(1210))/(sqrt(12)/(sqrt(6) - (sqrt(6) + sqrt(54)/sqrt(324))))2. -33sqrt(5) Simplify (-5(0 + sqrt(19)1 + sqrt(2299)1 + sqrt(190)/(2sqrt(250)))-1)2. 278179/4 Simplify -1 + (-5 + 4sqrt(76))*2 + (2sqrt(95)-3)/(sqrt(5) + (sqrt(15) - (sqrt(15) + sqrt(540)))/sqrt(3)). -394sqrt(19)/5 + 1240 Simplify (5(sqrt(208) + -2 + sqrt(208)))2 + (-1 + sqrt(208) - sqrt(208))-1 + sqrt(208) + ((sqrt(468)3)/sqrt(12))/(sqrt(12)-1). -1595sqrt(13)/2 + 20901 Simplify (sqrt(152) + -2sqrt(152)-1 + sqrt(152) - (sqrt(152) - -3sqrt(152)4))/((sqrt(128)/sqrt(4))/sqrt(4) + -2sqrt(56)/sqrt(7)). 9sqrt(19) Simplify (5-3sqrt(100)/(sqrt(4)3))/(4sqrt(50)/(sqrt(10) - sqrt(110)/sqrt(176) - sqrt(10))). 5sqrt(5)/16 Simplify (4 + (sqrt(539) - 1sqrt(539))-2 + -2 + sqrt(539)-1 + (6-4sqrt(539) - (1 + sqrt(539))2))*2. 392931 Simplify 3 + (0 + (sqrt(20)/((sqrt(16)/sqrt(4) + sqrt(4))-1))*2 - ((0 + sqrt(5) + 1 + 3)-5)*2). -2083/4 - 200sqrt(5) Simplify ((sqrt(640)3 + sqrt(640))-1)/((sqrt(55) - sqrt(495))/sqrt(11) - sqrt(5) - (sqrt(40)/sqrt(4))/sqrt(2)) + 4 + 1. 5 + 8sqrt(2) Simplify 3(4(-2sqrt(3) + -3)-1)2 + -2 + (sqrt(30)/sqrt(2)-1)/sqrt(5) + 0. 575sqrt(3) + 1006 Simplify (-22sqrt(77) - (sqrt(77) + (1sqrt(77) - sqrt(77))5 - sqrt(77)))/(3((sqrt(132)-1 - sqrt(132))-2 + sqrt(132))/sqrt(12)). -4sqrt(7)/15 Simplify -4(-5 + -3sqrt(2299) - sqrt(2299)) + 3 + ((-3 + sqrt(1900)-1 + 1 + sqrt(1900) + 0)3)2. 59 + 176sqrt(19) Simplify -2(2 + sqrt(1573))2 - sqrt(156)/(sqrt(72)/(-1sqrt(6)))-1. -45sqrt(13) - 8 Simplify (-3 + (2(-5 + -1sqrt(612)) + -3(sqrt(612) + 4 + -2 + sqrt(612)))-1-6)*2. 57024sqrt(17) + 1419849 Simplify (((sqrt(336) - ((sqrt(336)2 - sqrt(336)) + sqrt(336)))-3)/(sqrt(147) + 6sqrt(147)-1) + -1)*2 + -5. -556/175 + 24sqrt(7)/35 Simplify ((sqrt(56)-3-3 - -1sqrt(896))/((sqrt(392)/(sqrt(21)/sqrt(3)))/(sqrt(112)1)))*2-2 + 3. -37853 Simplify (1(-5 + (sqrt(30)1-5)/(sqrt(360) - (sqrt(360) + (sqrt(360) - -1sqrt(360)) + sqrt(360))) + 6(sqrt(27)/sqrt(108))/sqrt(3)))2. -115sqrt(3)/9 + 3229/108 Simplify (sqrt(91)-24 + -31sqrt(91))/((sqrt(252) + -1sqrt(252) + sqrt(252))/sqrt(9)2). -11sqrt(13)/4 Simplify ((sqrt(252) - -31sqrt(252) - (-4(sqrt(252)-1 + sqrt(252)))2 - (-4 + (sqrt(252) + sqrt(252) + 2)2)-2) + -4)3. 360sqrt(7) + 6036 Simplify ((5 + -3 + sqrt(162))*22 - (5 + 2 + ((sqrt(8))*2 + sqrt(2) + sqrt(2))-1)) + 4. 74sqrt(2) + 337 Simplify (((sqrt(22) + sqrt(198))2)/(sqrt(11) + (sqrt(99) - -2sqrt(99))) - (sqrt(1800) + 1)3)-4. 12 + 1784sqrt(2)/5 Simplify (2((5 + 3sqrt(1573) + sqrt(1573) + 1)-1 + -2) + -3)2. 3344sqrt(13) + 101033 Simplify ((sqrt(832) - (sqrt(832) - 2sqrt(832)4))2-4 - (-3 + -2 + (1 + sqrt(832))5))2. 3961152 Simplify ((sqrt(1872) - (sqrt(1872) + 1 + sqrt(1872)))2 + -5 + 11sqrt(1872) + -1 + -4)1. 36sqrt(13) + 1863 Simplify (((sqrt(171) + 0)-4 - -2sqrt(171)2) + 4)*2 - ((sqrt(57) - (sqrt(57) + sqrt(342)/sqrt(6)))1 - sqrt(57))/((sqrt(72)/sqrt(4))/sqrt(6)). 2sqrt(19) + 16 Simplify (-5(-5(sqrt(70) - ((sqrt(70)-3 - sqrt(70)) + sqrt(70))) - sqrt(70)))/(sqrt(360)4 + sqrt(810) + 2sqrt(810)). 35sqrt(7)/17 Simplify ((0 + ((sqrt(99) - (0 + sqrt(99) + sqrt(99))) + sqrt(99))-4 - (-2 + -1sqrt(99)1))35 + -3)*2 + 0. 2430sqrt(11) + 23004 Simplify ((sqrt(209)/sqrt(275) - 2sqrt(304))2 + 5 + (sqrt(57)/(sqrt(12)/sqrt(4)) - sqrt(19)) + -2 + -5)5. 28849/5 Simplify (1 + 6sqrt(55)/sqrt(5) + (sqrt(66)1)/sqrt(6))*2 - ((1(sqrt(77) + sqrt(77)2))/(-1sqrt(847)))*2-6. 14sqrt(11) + 5994/11 Simplify (2 + sqrt(304))3 - (3 + -1 + sqrt(304)) - (-4 + (-4(sqrt(304) + 1 + sqrt(304)) + 3(sqrt(304) + 1))*2). -7593 - 32sqrt(19) Simplify (sqrt(320) + (sqrt(320) - -1sqrt(320)) + -5 + sqrt(320))2 - -5-2(sqrt(1715)/sqrt(7) + sqrt(5)). -400sqrt(5) + 5145 Simplify ((sqrt(605)/(2sqrt(11) - sqrt(11)))/(6(sqrt(11) + (sqrt(176) - sqrt(11)))))*2 + ((sqrt(140)3)/sqrt(4))/(sqrt(7) - sqrt(1008)2). -3sqrt(5)/23 + 5/576 Simplify (-2 + (4(sqrt(136)-1 + sqrt(136)) + -6sqrt(136)2)/(2((2sqrt(88) - sqrt(88) - sqrt(88)) + sqrt(88))/sqrt(11)) + -4)*2. 72sqrt(17) + 648 Simplify (1 + (-3(sqrt(500) + 3sqrt(500)) + -1 - (sqrt(500) + sqrt(500) + -1sqrt(500) + sqrt(500) + -3 - (-4 + sqrt(500)-1))))*2. 300sqrt(5) + 112501 Simplify (13sqrt(88) + 4sqrt(88)-1)/(-2((sqrt(8) - -1(sqrt(8) + sqrt(8) + sqrt(8) + (sqrt(8) - sqrt(8)2))) + (2sqrt(96))/sqrt(12))). sqrt(11)/10 Simplify (sqrt(108)-5 - (sqrt(120)/sqrt(5))/sqrt(8))2 - 1(-1(1sqrt(3) - sqrt(3)) + 1 + sqrt(3) + sqrt(3) + 1). -2sqrt(3) + 2881 Simplify (sqrt(44)/(-4sqrt(1331)))/(sqrt(8)/(sqrt(196) - (sqrt(196) - 4sqrt(196))))3. -21sqrt(2)/11 Simplify (sqrt(78) - (sqrt(78) + -11sqrt(78)) - sqrt(78))/((sqrt(150) - -2sqrt(150) - sqrt(6)) + sqrt(6) - sqrt(6)) - ((-1sqrt(26))/sqrt(2) + 1 + -1). sqrt(13) Simplify ((4-5(1 + sqrt(153))54 + 5)-4)*2. 15168000sqrt(17) + 394176400 Simplify 1(1sqrt(20)/((sqrt(4)2 - sqrt(4)) + sqrt(4)) + (sqrt(5) - sqrt(5)-1)-6 + 2 + (3(2 + -1sqrt(405) + -1))2). -347sqrt(5)/2 + 3656 Simplify (1(sqrt(1125) + sqrt(45)) + -2sqrt(180))/(((1sqrt(180))/sqrt(4))/sqrt(5)) + -3. -3 + 2sqrt(5) Simplify (4sqrt(152)-2 + (sqrt(152) - -4(sqrt(152) + sqrt(152)-2)))/(sqrt(64)/(sqrt(56)/sqrt(7)) + 1sqrt(56)/sqrt(7))4. -22sqrt(19) Simplify (-2(sqrt(187) + sqrt(187) + sqrt(187)-3) - -2sqrt(187)6)/(1(sqrt(99) - 3(sqrt(99)-5 + sqrt(99)))). 14sqrt(17)/39 Simplify (((sqrt(85) + -2(sqrt(85)2 + sqrt(85)))/(sqrt(5) - (sqrt(5) + (sqrt(5) - (sqrt(245) - 1sqrt(245))))) + 2)*2-6 + 4 + 5)3. -7695 - 360sqrt(17) Simplify -2-13((sqrt(847) + 2-1sqrt(847))2 - sqrt(847) - sqrt(847) - sqrt(847)-21) + -5. 5077 Simplify 1sqrt(38)/(sqrt(288) + sqrt(2)) - (1 + sqrt(76)/sqrt(64)). -1 - 9sqrt(19)/52 Simplify (1((-4 + (-1 + sqrt(147))-2-3)-4 + 4))2. -14784sqrt(3) + 86608 Simplify (((sqrt(12)/(sqrt(18)/sqrt(3)) + 5 + -1)*2 - (-2 + -2 + sqrt(2) - ((sqrt(2) + -3)-1)*2)) + -2)3. 3sqrt(2) + 93 Simplify 2 + (-2 + sqrt(432) + -1sqrt(432) + ((-1 + sqrt(432))1 + sqrt(432) - sqrt(432)) + (0 + sqrt(432))-1 + 0 + -3sqrt(432))2. 216sqrt(3) + 3899 Simplify (-2sqrt(85)5 + -1(sqrt(85) - (sqrt(85) + sqrt(85)2 + sqrt(85))))/(2sqrt(245)4 - (-1sqrt(245)-1 - sqrt(245))). -sqrt(17)/8 Simplify ((4(sqrt(357) - (sqrt(357) - (sqrt(357)-1 + sqrt(357) + sqrt(357)) - sqrt(357))))/(4sqrt(63) + sqrt(7)))/((-6sqrt(9)-1)/(4sqrt(3)2 - sqrt(3))). 28sqrt(17)/39 Simplify (3 + sqrt(28) + -3 - (sqrt(28) - 6sqrt(1008)))2 - (-3(1sqrt(308) + sqrt(308) - sqrt(308)))/(sqrt(1331) + -2sqrt(1331)). -6sqrt(7)/11 + 36288 Simplify (-1 + ((sqrt(396) + 1)-5 - (sqrt(396) - (0 + sqrt(396) + 4))))*2 + -1 + -1 + sqrt(396) + (-1sqrt(396)-2)2. 126sqrt(11) + 11486 Simplify ((5 + -1 + sqrt(704))*2 + 5 - (3sqrt(5324)2)2) + 5. -190934 + 64sqrt(11) Simplify ((sqrt(100)/(sqrt(4)-1))/((sqrt(320) - (sqrt(320) + (-1sqrt(320) - sqrt(320)))) + sqrt(320)))*2 + -5 + -5 + sqrt(20)/sqrt(4) + -3. -7483/576 + sqrt(5) Simplify -6(3 + (((sqrt(128) - (0 + sqrt(128))) + -3 + (sqrt(128) - (sqrt(128) - -2(sqrt(128) + sqrt(128) + 2))))3-2)2). -452970 - 96768sqrt(2) Simplify (sqrt(12)33 + -4sqrt(432))/((sqrt(864) + (sqrt(864) - (sqrt(864) + sqrt(864)-4))5)-1). 5sqrt(2)/84 Simplify 2 + (-5(sqrt(625) + 6(1sqrt(625) - sqrt(625) - sqrt(625)))/((sqrt(150)/sqrt(20))/sqrt(6)))*2 + 1. 312503 Simplify (-5(((sqrt(78)-2 + sqrt(78))-5 - sqrt(78)) + sqrt(78))-4)/(sqrt(24) + 1sqrt(2904) + -2sqrt(216)). 25sqrt(13)/3 Simplify -4(2 + -5 + sqrt(171) + (sqrt(171) + 2)2 + sqrt(171) + sqrt(171) + 0 + -3)*2-3. -720sqrt(19) + 51348 Simplify (-5(-2sqrt(272) - sqrt(17)) + -5 + sqrt(1700) + (sqrt(1700) - (sqrt(1700) + -1)))2 - ((sqrt(1088) + 0 + 0 - (-4 + sqrt(1088) + 1))2 + -3). -440sqrt(17) + 51435 Simplify (sqrt(108)/(sqrt(196) + sqrt(196)-3 + sqrt(196)))2 - (sqrt(243)-4 - (1sqrt(54))/sqrt(2))2. -223560/49 Simplify (1 + -3 + sqrt(12) + sqrt(24)/sqrt(2) + sqrt(60)/sqrt(5) + -1 + sqrt(27) + sqrt(3) + 1 + sqrt(3) + 1 + sqrt(3))2. -24sqrt(3) + 433 Simplify -6*((sqrt(500) + 2 - s	{ "pile_set_name": "DM Mathematics" }
M and 6:59 AM? 139 What is 62 minutes after 3:15 PM? 4:17 PM What is 148 minutes after 1:22 PM? 3:50 PM How many minutes are there between 5:14 AM and 7:49 AM? 155 What is 265 minutes after 11:19 AM? 3:44 PM How many minutes are there between 1:21 PM and 4:43 PM? 202 How many minutes are there between 9:50 PM and 2:01 AM? 251 How many minutes are there between 10:42 AM and 6:01 PM? 439 What is 292 minutes before 6:15 PM? 1:23 PM What is 691 minutes before 9:23 AM? 9:52 PM What is 235 minutes after 4:32 PM? 8:27 PM What is 104 minutes before 11:54 PM? 10:10 PM What is 175 minutes before 12:52 AM? 9:57 PM How many minutes are there between 5:34 AM and 7:06 AM? 92 What is 152 minutes before 10:09 PM? 7:37 PM How many minutes are there between 10:20 AM and 4:36 PM? 376 How many minutes are there between 3:25 AM and 4:01 AM? 36 What is 136 minutes before 10:24 PM? 8:08 PM What is 82 minutes after 6:08 PM? 7:30 PM What is 631 minutes after 6:27 AM? 4:58 PM How many minutes are there between 10:02 PM and 11:43 PM? 101 What is 444 minutes after 1:51 PM? 9:15 PM What is 91 minutes before 1:05 PM? 11:34 AM What is 394 minutes before 10:46 PM? 4:12 PM What is 646 minutes before 8:00 AM? 9:14 PM What is 689 minutes before 3:59 PM? 4:30 AM What is 240 minutes before 12:34 PM? 8:34 AM How many minutes are there between 7:25 PM and 8:05 PM? 40 What is 33 minutes after 8:55 AM? 9:28 AM How many minutes are there between 5:26 AM and 5:09 PM? 703 What is 453 minutes before 12:25 AM? 4:52 PM How many minutes are there between 7:50 PM and 4:00 AM? 490 How many minutes are there between 6:32 AM and 10:36 AM? 244 How many minutes are there between 12:08 AM and 11:36 AM? 688 How many minutes are there between 2:41 AM and 2:31 PM? 710 What is 568 minutes before 8:58 AM? 11:30 PM What is 685 minutes before 12:41 AM? 1:16 PM What is 244 minutes after 3:22 AM? 7:26 AM How many minutes are there between 1:33 PM and 5:29 PM? 236 How many minutes are there between 1:32 AM and 7:48 AM? 376 What is 142 minutes after 2:35 PM? 4:57 PM What is 304 minutes before 6:29 AM? 1:25 AM What is 191 minutes before 9:19 PM? 6:08 PM How many minutes are there between 1:18 AM and 1:00 PM? 702 How many minutes are there between 3:49 PM and 3:06 AM? 677 How many minutes are there between 12:27 PM and 12:22 AM? 715 How many minutes are there between 5:23 AM and 12:35 PM? 432 What is 546 minutes before 11:36 PM? 2:30 PM What is 310 minutes after 10:48 AM? 3:58 PM How many minutes are there between 1:08 AM and 6:30 AM? 322 What is 315 minutes before 1:45 PM? 8:30 AM How many minutes are there between 5:23 AM and 8:19 AM? 176 How many minutes are there between 3:54 AM and 11:06 AM? 432 What is 325 minutes after 5:24 AM? 10:49 AM How many minutes are there between 11:36 AM and 8:26 PM? 530 What is 399 minutes before 12:46 PM? 6:07 AM How many minutes are there between 8:50 AM and 3:32 PM? 402 How many minutes are there between 12:35 PM and 12:05 AM? 690 What is 117 minutes after 4:01 AM? 5:58 AM How many minutes are there between 3:37 AM and 8:46 AM? 309 How many minutes are there between 1:14 PM and 6:18 PM? 304 How many minutes are there between 9:28 AM and 4:28 PM? 420 How many minutes are there between 5:07 AM and 5:32 AM? 25 How many minutes are there between 11:46 PM and 8:23 AM? 517 How many minutes are there between 1:28 PM and 11:37 PM? 609 What is 385 minutes before 11:33 PM? 5:08 PM How many minutes are there between 7:01 AM and 4:34 PM? 573 How many minutes are there between 10:56 AM and 7:33 PM? 517 How many minutes are there between 8:56 PM and 8:29 AM? 693 What is 62 minutes after 1:13 AM? 2:15 AM What is 320 minutes before 7:53 PM? 2:33 PM How many minutes are there between 10:26 PM and 1:27 AM? 181 What is 158 minutes after 10:36 AM? 1:14 PM How many minutes are there between 9:57 AM and 1:53 PM? 236 What is 539 minutes after 7:02 PM? 4:01 AM How many minutes are there between 4:18 AM and 4:00 PM? 702 What is 359 minutes after 3:35 PM? 9:34 PM How many minutes are there between 9:02 AM and 4:55 PM? 473 What is 501 minutes before 3:14 AM? 6:53 PM How many minutes are there between 1:36 PM and 6:59 PM? 323 What is 549 minutes before 10:40 PM? 1:31 PM How many minutes are there between 3:52 AM and 9:58 AM? 366 What is 260 minutes before 6:53 PM? 2:33 PM What is 458 minutes before 4:50 PM? 9:12 AM What is 454 minutes before 10:56 AM? 3:22 AM What is 270 minutes after 10:18 PM? 2:48 AM What is 399 minutes after 12:40 PM? 7:19 PM How many minutes are there between 4:27 AM and 3:06 PM? 639 How many minutes are there between 7:02 PM and 7:42 PM? 40 How many minutes are there between 1:16 AM and 8:02 AM? 406 How many minutes are there between 11:20 AM and 10:57 PM? 697 What is 678 minutes before 3:01 PM? 3:43 AM What is 145 minutes after 4:26 AM? 6:51 AM What is 317 minutes before 8:43 PM? 3:26 PM How many minutes are there between 4:02 PM and 10:15 PM? 373 How many minutes are there between 9:23 PM and 9:12 AM? 709 What is 576 minutes after 3:53 PM? 1:29 AM How many minutes are there between 5:54 AM and 6:04 AM? 10 How many minutes are there between 9:26 PM and 4:49 AM? 443 What is 277 minutes before 5:03 PM? 12:26 PM How many minutes are there between 5:50 PM and 12:03 AM? 373 How many minutes are there between 12:09 PM and 11:14 PM? 665 What is 291 minutes before 6:19 AM? 1:28 AM How many minutes are there between 1:05 AM and 10:53 AM? 588 What is 663 minutes before 1:55 AM? 2:52 PM What is 583 minutes after 11:45 PM? 9:28 AM What is 587 minutes after 5:29 PM? 3:16 AM How many minutes are there between 11:30 AM and 4:23 PM? 293 How many minutes are there between 9:23 PM and 9:22 AM? 719 How many minutes are there between 11:45 AM and 9:37 PM? 592 How many minutes are there between 10:17 AM and 8:27 PM? 610 What is 20 minutes after 5:23 AM? 5:43 AM How many minutes are there between 7:34 AM and 5:33 PM? 599 How many minutes are there between 1:46 PM and 1:13 AM? 687 How many minutes are there between 5:02 PM and 7:17 PM? 135 What is 599 minutes after 5:16 PM? 3:15 AM What is 104 minutes before 6:51 AM? 5:07 AM How many minutes are there between 8:02 AM and 7:02 PM? 660 What is 685 minutes after 8:58 PM? 8:23 AM How many minutes are there between 1:58 PM and 4:51 PM? 173 How many minutes are there between 8:34 AM and 4:08 PM? 454 How many minutes are there between 2:56 AM and 6:00 AM? 184 What is 652 minutes before 2:53 AM? 4:01 PM How many minutes are there between 6:27 AM and 7:27 AM? 60 How many minutes are there between 7:53 PM and 3:47 AM? 474 What is 103 minutes after 2:26 PM? 4:09 PM What is 480 minutes after 5:34 AM? 1:34 PM What is 665 minutes before 12:28 AM? 1:23 PM What is 121 minutes before 5:33 PM? 3:32 PM How many minutes are there between 3:34 AM and 11:46 AM? 492 How many minutes are there between 2:57 PM and 5:00 PM? 123 What is 517 minutes before 5:17 AM? 8:40 PM How many minutes are there between 11:56 AM and 4:52 PM? 296 What is 286 minutes before 4:08 AM? 11:22 PM How many minutes are there between 6:38 PM and 6:42 PM? 4 How many minutes are there between 10:13 AM and 3:30 PM? 317 How many minutes are there between 11:50 AM and 9:07 PM? 557 What is 197 minutes before 4:13 AM? 12:56 AM How many minutes are there between 3:25 AM and 5:35 AM? 130 How many minutes are there between 4:34 PM and 5:37 PM? 63 How many minutes are there between 1:39 PM and 3:47 PM? 128 How many minutes are there between 8:49 PM and 9:27 PM? 38 What is 458 minutes before 2:37 PM? 6:59 AM How many minutes are there between 2:16 PM and 8:50 PM? 394 How many minutes are there between 10:48 AM and 3:48 PM? 300 How many minutes are there between 6:57 PM and 12:57 AM? 360 How many minutes are there between 2:04 PM and 11:50 PM? 586 What is 472 minutes before 12:42 PM? 4:50 AM How many minutes are there between 12:33 AM and 9:51 AM? 558 How many minutes are there between 10:22 PM and 2:19 AM? 237 How many minutes are there between 1:25 AM and 5:35 AM? 250 What is 710 minutes before 12:07 AM? 12:17 PM What is 53 minutes after 9:54 AM? 10:47 AM How many minutes are there between 12:44 PM and 4:21 PM? 217 What is 360 minutes after 10:34 AM? 4:34 PM What is 238 minutes before 3:57 PM? 11:59 AM What	{ "pile_set_name": "DM Mathematics" }
5, 29 Suppose -2u + f + 237 = 3u, 0 = -5u + 4f + 228. What are the prime factors of u? 2, 3 Let s(u) = 27u - 4. What are the prime factors of s(3)? 7, 11 Let r(x) = -x2 - x + 71. List the prime factors of r(0). 71 Suppose 0r + 2r = 0. Let m(b) = b + 43. What are the prime factors of m(r)? 43 Let x = 100 + 2. List the prime factors of x. 2, 3, 17 Let m = 29 + -21. Suppose 0g - 6 = -2g. Let j = g + m. List the prime factors of j. 11 Let g = 119 - 72. What are the prime factors of g? 47 Let z = -20 + 40. Suppose 62 = 4q + 22. Suppose 5i = q + z. What are the prime factors of i? 2, 3 Let l(s) = 7s + 16. List the prime factors of l(0). 2 Suppose -2l = -26 - 34. Suppose 5u = 22 - 2. Suppose 3b - l = -3g, -2b + 31 = b + ug. List the prime factors of b. 3 Suppose 2r = -2z + 82, 15r - 3z - 189 = 10r. What are the prime factors of r? 3, 13 Let n(g) = -g2 + 6g - 2. Suppose y = 3u + 11, y + 0y - u = 7. Let o be n(y). Suppose -ov = 2m + v, v = -3. What are the prime factors of m? 2, 3 Let y(r) = -r*2 - r + 24. Suppose 0h + h + 5 = 0. Let l be (-1 - 0) + (-4 - h). List the prime factors of y(l). 2, 3 Let h(k) = -2k - 2k + 4 - 2. Let b be h(-2). Suppose -4i + b = i. What are the prime factors of i? 2 Let w(i) = 5i*2 - i + 4. List the prime factors of w(-3). 2, 13 Suppose 3g - 4q - 15 = -0g, -q = -4g + 7. Let h be g + 1 - 14-7. Suppose 2x + l - 40 = 0, 5x = 6l - 2l + h. List the prime factors of x. 2, 5 Suppose 0 = 6n - 0n - 648. List the prime factors of n. 2, 3 Suppose -3b - 3f = -9, 4b - 15 - 3 = -f. Suppose -h + b - 4 = 3w, 5h + 3w - 29 = 0. What are the prime factors of h? 7 Let l = 305 - 191. List the prime factors of l. 2, 3, 19 Suppose 2h - 313 - 85 = 3o, 0 = -3h + 2o + 592. What are the prime factors of h? 2, 7 Let w(s) = s - 4. Suppose c = -5p + 32, 9 + 14 = 2p - 3c. Let j be w(p). Suppose v + 20 = jv. List the prime factors of v. 2, 5 Let q(y) = -3y + 2y - 8y - 1 + 0. Let r be q(-1). What are the prime factors of r1 - 6/3? 2, 3 Suppose 50 = -3v + 2. Let k = v + 26. List the prime factors of k. 2, 5 Let u = -8 - -8. What are the prime factors of (-6)/2 + 5 + u? 2 Let w(p) = -p2 - 12p + 3. List the prime factors of w(-10). 23 Suppose -4q + 8 = 2u, 0 = -2q + 2 - 0. Suppose 0 = -4h + ud + 56, 7h - 2h = -3d + 70. Let c = h - 10. List the prime factors of c. 2 Let l(t) = t*3 + 5t*2 + 5t + 5. Let q be l(-4). Suppose w + q = 7. List the prime factors of w. 2, 3 Suppose 24 + 32 = 4m. Suppose i - m = -6. Let n = 11 - i. What are the prime factors of n? 3 Let k = 105 + -29. List the prime factors of k. 2, 19 Let h be (0 - 1)/(2/(-10)). Let j(r) be the first derivative of r2/2 - r - 7. List the prime factors of j(h). 2 List the prime factors of ((-6)/1)/((-33)/2200) + 0. 2, 5 Suppose 5s = 2c - 6c + 22, 3c - 3s - 30 = 0. Let o be (-6)/c + 27/4. Suppose 2n = 4h - 52, -h + 4n + o = -21. What are the prime factors of h? 11 Let y = -9 - -17. Suppose -68 = -3f + 2m, -2f - ym + 58 = -3m. What are the prime factors of f? 2, 3 Let h be (-3)/(-5) - (-130)/(-50). List the prime factors of 20 + (-6 - -3 - h). 19 List the prime factors of (-5070)/(-52) + (-2)/(-4). 2, 7 Let j = -14 + -13. Let f = 67 + j. List the prime factors of f. 2, 5 Let c = -60 + 111. List the prime factors of c. 3, 17 Let w = -21 + 24. Suppose -wa - a + s + 156 = 0, 2a + 4s = 78. What are the prime factors of a? 3, 13 Suppose -4s = -10 - 2. Let z be s3/9 + 14. Let x = z + -9. List the prime factors of x. 2, 3 Let i be 2/4 - 42/(-4). Let r = i - 15. Let v = r - -6. What are the prime factors of v? 2 Let p = -200 - -295. List the prime factors of p. 5, 19 Let m(u) = u2 + 7u + 7. Let q be m(-4). What are the prime factors of (-21)/(q - -2) - 1? 2, 3 Let c(w) = 6w2 - 15w - 4. Let o(f) = -f*2 + f. Suppose 10u + 25 = 5u. Let a(m) = uo(m) - c(m). What are the prime factors of a(10)? 2 Suppose -8 = u - 3u. Let a = 9 + u. What are the prime factors of a? 13 Let a = 14 - 20. Let t = a - -11. List the prime factors of t. 5 What are the prime factors of (-9)/(-15) + 147/5? 2, 3, 5 Suppose -4d = -3u - 115, -129 - 17 = -5d + 3u. What are the prime factors of d? 31 Suppose 0 = 2t - 5t - p + 9, -5t - p + 17 = 0. Let a(z) = -3z - 1. Let y be a(-2). Let l = t + y. What are the prime factors of l? 3 Let b = 290 + -172. What are the prime factors of b? 2, 59 Let g be 2 + -2 - (-2 - -2). Suppose g = -0w + 5w + 4n, 5w = -5n. Suppose 2o = -z + o + 14, -2o = w. What are the prime factors of z? 2, 7 Suppose -n - 8 = -3n. Let r(p) be the third derivative of -p6/120 + p5/15 + p4/24 + 2p*3/3 - 3p*2. List the prime factors of r(n). 2 Suppose -4h + 10 = 2. Suppose 0x = -hx + 14. What are the prime factors of x? 7 Let f(d) be the first derivative of d4/4 - d3 - 3d2/2 + 4d + 3. List the prime factors of f(5). 3, 13 Let v be (-4)/6(-18)/4. Suppose 56 = 3r - r. Suppose -s + r = vs. What are the prime factors of s? 7 Suppose 3y = -0y + 6. Let l(p) = p3 - py + 3p2 - 1 + p3. What are the prime factors of l(1)? 3 List the prime factors of 0 + 0 - 13/((-13)/64). 2 Suppose -4f + 7f = 381. Let r = -77 + f. What are the prime factors of r? 2, 5 Let w(p) = -9p - 8. What are the prime factors of w(-5)? 37 Suppose 2r - 12 = -0r. Let i be r/15 + 16/10. Suppose 0 = -w + 4h + 2 + 24, -ih = -3w + 38. What are the prime factors of w? 2, 5 Suppose -2 = -i - 0i. Let x be ((-30 - i)/1)/(-1). Suppose -3v = v - x. List the prime factors of v. 2 Let y(m) = -32m + 39. What are the prime factors of y(-9)? 3, 109 Suppose u + 0u = 3. Let v(c) = -c*3 + 3c*2 + c + 4. List the prime factors of v(u). 7 Suppose 5w = 5g + 2w - 13, 0 = -5g + 2w + 12. Suppose -4 = -gi + 38. List the prime factors of i. 3, 7 Suppose -36 = -3c - 3j, -3j - 4 + 22 = c. Let i = c + -4. List the prime factors of i. 5 Let t(j) = j*3 + 14j*2 + 20j + 10. What are the prime factors of t(-12)? 2, 29 Let d(m) = 6m - 4. Let j(o) = -o + 17. Let y be j(12). What are the prime factors of d(y)? 2, 13 Let x be 2/(-6) - 110/30. What are the prime factors of 23/2 + (-2)/x? 2, 3 Let q(u) be the third derivative of u5/20 - u4/12 - u3/6 - 2u2. List the prime factors of q(-1). 2 Let w = -55 - -154. List the prime factors of w. 3, 11 Let l(f) = -f3 + 2f2. Let q be l(1). Suppose -b + 4 = 0, 5b + 61 - q = 5o. What are the prime factors of o? 2 List the prime factors of (26/(-39))/(4/(-846)). 3, 47 Suppose 0 = -3y - 3h - h + 3, -30 = -3y + 5h. Suppose -yj - 4d + 105 = 0, -5j + 60 = -3d - 10. List the prime factors of j. 17 Let z be (-39)/(-33) + (-6)/33. Suppose -8 = 4w - 0. What are the prime factors of 2 + z18 + w? 2, 3 What are the prime factors of (-6 - (-207 + -6)) + 14? 211 Let k be 6/(-2) - 63-1. Let n = 88 - k. List the prime factors of n. 2, 7 Let y(u) = -u3 - 4u*2 - 5u - 4. Let l be y(-3). Let r(g) = 1 + 12g + 0g2 + g2 - 2gl. List the prime factors of r(10). 3, 7 Suppose -2x = -y + 86, 0y + 2y - x = 160. List the prime factors of y. 2, 3, 13 Let a(m) be the second derivative of -m5/20 + m4/3 + m3/3 + m2/2 - m. Let z = 13 + -9. List the prime factors of a(z). 3 Let t(q) = -5 - 6 + 0q - 2q + 1. List the prime factors of t(-7). 2 Suppose 3a - 154 = -3w + 2a, -4w = -4a - 200. List the prime factors of w. 3, 17 Let c = 1 - 3. Let j(o) = -2o - 1. Let n be j(c). Suppose -3p - 2 - n = r, -15 = -2r - p. What are the prime factors of r? 2, 5 Suppose 0 = -3p + 27 - 9. List the prime factors of 279/6p/9. 31 Let p(s) = s*3 - 5s*2 - 6s + 7. Let u be p(6). Let z(l) = l*3 - 7l2 + l + 2. What are the prime factors of z(u)? 3 Let s(q) = q3 + 4 + 28q + 7 + q2 - 2 - 29q. List the prime factors of s(0). 3 Suppose -89 = -y - 3r, y + y + r - 173 = 0. List the prime factors of y. 2, 43 Suppose 292 + 463 = 5a. Let s = a + -83. List the prime factors of (-7)/21 + s/6. 11 Suppose -3u - 6 = -4u. Suppose p + 223 = 5r, -ur + 4p + 188 = -2r. List the prime factors of r. 2, 11 Suppose 244 = -0b + 4b. List the prime factors of b. 61 Let v = -9 + 13. Suppose -vt + 4 = -2t. List the prime factors of t. 2 Let a = 18 - 8. What are the prime factors o	{ "pile_set_name": "DM Mathematics" }
ivisor of 84938 and 279288278? 12134 Calculate the greatest common divisor of 10324 and 58192. 4 Calculate the greatest common divisor of 1412836 and 170. 34 What is the highest common factor of 2889 and 3986178? 321 What is the highest common divisor of 2602752 and 137472? 768 Calculate the highest common divisor of 28075 and 7055. 5 Calculate the highest common divisor of 408647052 and 1464. 732 What is the greatest common divisor of 4575566 and 212450? 1214 What is the greatest common factor of 9315631 and 117? 13 What is the highest common factor of 1863 and 59477517? 621 Calculate the greatest common divisor of 1700748408 and 408. 408 Calculate the greatest common factor of 4503 and 990186. 237 What is the highest common factor of 2176515 and 2241? 9 Calculate the greatest common factor of 83 and 50360914. 83 What is the greatest common factor of 54 and 18007083? 27 What is the greatest common factor of 10937179 and 1102? 19 Calculate the highest common divisor of 2575 and 15545687. 103 What is the greatest common divisor of 4930986 and 56202? 2958 What is the greatest common factor of 1251453 and 44436? 483 What is the highest common divisor of 9506 and 1775809? 49 What is the greatest common divisor of 981 and 219684159? 981 What is the greatest common factor of 62012 and 121508? 148 Calculate the greatest common divisor of 725 and 2901740. 145 Calculate the greatest common factor of 7338016 and 36176. 1904 What is the greatest common divisor of 1774766 and 1904? 238 What is the greatest common factor of 2320 and 219005? 5 Calculate the highest common divisor of 1147396 and 5056. 316 What is the highest common factor of 3806 and 331342? 22 What is the highest common factor of 101053 and 19043? 139 What is the greatest common divisor of 7912532 and 6817? 401 Calculate the highest common divisor of 29783532 and 15240. 1524 What is the highest common factor of 46639649 and 172? 43 Calculate the greatest common factor of 1056992 and 140128. 928 Calculate the greatest common factor of 13810 and 138726974. 2762 Calculate the highest common factor of 17079896 and 32504. 1912 What is the highest common divisor of 540 and 33497112? 12 What is the greatest common factor of 5307 and 2599734? 87 Calculate the greatest common factor of 272862324 and 9648. 2412 Calculate the highest common factor of 10784826 and 126. 18 Calculate the highest common divisor of 20880 and 2984970. 870 Calculate the highest common factor of 908408 and 64998. 46 What is the highest common factor of 132 and 18460101? 33 Calculate the highest common divisor of 563436148 and 666. 74 What is the highest common divisor of 77 and 1684276? 11 Calculate the greatest common factor of 82534458 and 2322. 258 What is the highest common divisor of 119695 and 1238390? 185 Calculate the highest common factor of 1049718 and 769133. 3301 Calculate the greatest common divisor of 4436 and 484392. 4 What is the greatest common divisor of 1062 and 1454232? 354 What is the greatest common divisor of 7100 and 1180304? 284 What is the highest common factor of 27227087 and 8809? 383 Calculate the highest common divisor of 72569535 and 30. 15 Calculate the greatest common divisor of 163882 and 575262. 134 Calculate the highest common divisor of 1583596 and 8188. 92 What is the greatest common factor of 30 and 17687130? 30 What is the highest common divisor of 53 and 44626742? 53 Calculate the highest common factor of 19276888 and 30504. 328 What is the highest common divisor of 156177294 and 21294? 7098 Calculate the greatest common factor of 19483383 and 795. 159 Calculate the highest common factor of 192612851 and 1. 1 What is the greatest common divisor of 175 and 76853525? 175 What is the highest common factor of 15744 and 242105984? 5248 Calculate the greatest common factor of 1515836 and 142072. 1204 What is the highest common factor of 8137202 and 2022? 674 What is the highest common factor of 376 and 10180294? 94 Calculate the highest common divisor of 42 and 21269514. 42 Calculate the highest common factor of 173178090 and 15. 15 What is the greatest common divisor of 59055 and 580390? 635 Calculate the highest common divisor of 1650 and 7017538. 22 Calculate the greatest common divisor of 831 and 101541552. 831 Calculate the highest common divisor of 2916751200 and 3520. 1760 What is the highest common factor of 1 and 2730893? 1 What is the greatest common factor of 88012247 and 85? 17 What is the highest common divisor of 3996417 and 1179? 393 What is the highest common divisor of 11682321 and 3864? 483 What is the greatest common factor of 114703729 and 2198? 1099 What is the highest common factor of 1615370 and 496470? 670 Calculate the greatest common factor of 5183224 and 16. 8 What is the highest common factor of 3775 and 466825? 25 Calculate the highest common divisor of 2904 and 389183432. 968 What is the greatest common divisor of 22 and 52941031? 11 Calculate the highest common divisor of 1284 and 57302673. 321 Calculate the highest common factor of 5317375 and 2425. 25 Calculate the greatest common factor of 16880094 and 63. 63 What is the greatest common divisor of 608440432 and 5381? 5381 What is the greatest common divisor of 10309775 and 350? 175 Calculate the highest common factor of 1588822 and 20234. 302 Calculate the greatest common divisor of 17570835 and 315. 45 What is the highest common factor of 1259913 and 208833? 1383 Calculate the highest common factor of 12389824 and 1748. 1748 What is the greatest common factor of 9170153 and 48068? 197 Calculate the highest common divisor of 60014 and 7918. 74 Calculate the highest common factor of 31235639 and 67811. 1577 What is the highest common factor of 15035476 and 24? 4 What is the greatest common factor of 1017640 and 794200? 760 Calculate the greatest common divisor of 230276 and 1978. 46 Calculate the greatest common factor of 852 and 4461782. 142 Calculate the highest common divisor of 54414715 and 10. 5 What is the greatest common factor of 39204040 and 3400? 680 What is the greatest common factor of 9603 and 14733? 9 What is the highest common divisor of 98432 and 11358130? 1538 Calculate the highest common divisor of 116784 and 505253. 811 Calculate the highest common divisor of 1588168 and 1474. 134 What is the highest common divisor of 135 and 15385365? 45 Calculate the greatest common divisor of 525315 and 420. 105 Calculate the greatest common divisor of 30 and 67871550. 30 Calculate the greatest common divisor of 385819916 and 4974. 1658 Calculate the highest common divisor of 31122 and 1083802902. 10374 Calculate the greatest common divisor of 22442 and 12099444. 3206 Calculate the highest common factor of 467861 and 33500. 67 Calculate the highest common divisor of 86053 and 138325. 11 What is the greatest common divisor of 154352 and 1606? 22 Calculate the highest common divisor of 418342580 and 180. 20 Calculate the highest common factor of 44032 and 76672. 128 What is the greatest common factor of 11112 and 501034524? 5556 What is the greatest common divisor of 875142 and 216? 18 What is the greatest common factor of 2136 and 2834739? 267 Calculate the greatest common divisor of 17771 and 1680043. 1367 Calculate the greatest common factor of 18543 and 504193. 883 What is the greatest common divisor of 1583436 and 79248? 1524 What is the greatest common divisor of 688599 and 963? 9 What is the highest common factor of 22240 and 1134935? 695 What is the greatest common divisor of 748680 and 34680? 2040 Calculate the highest common factor of 2422805 and 2100. 35 Calculate the greatest common factor of 10745001 and 18. 9 What is the highest common divisor of 2176 and 85236640? 544 Calculate the highest common divisor of 174 and 189254. 58 Calculate the highest common factor of 9251 and 7633873. 29 Calculate the highest common factor of 209 and 1853716. 19 What is the greatest common divisor of 7542459 and 9545? 1909 Calculate the highest common divisor of 45 and 4405581. 9 What is the highest common divisor of 195 and 10240737? 39 What is the greatest common factor of 216 and 197808? 24 Calculate the highest common divisor of 2908 and 168200174. 1454 What is the highest common factor of 18 and 37502	{ "pile_set_name": "DM Mathematics" }
actors of w/14 - 4076/(-7)? 2, 3, 97 Let m(n) = 6n - 31. Let j(c) be the second derivative of 13c*3/6 - 61c*2/2 - 5c. Let b(l) = 3j(l) - 5m(l). List the prime factors of b(10). 2, 31 Let o(u) = -u*2 - 54u - 211. What are the prime factors of o(-46)? 157 Suppose 0 = v + 4j - 1, 0 = -3v - 39j + 35j + 35. Let h = -1 - -3. Suppose v = ht - 57. What are the prime factors of t? 37 List the prime factors of (-36)/(-30) - 521488/(-110). 2, 2371 Suppose 0 = -c - 35 + 96. Suppose -5w = 171 + 54. Let g = w + c. What are the prime factors of g? 2 Suppose 27654 - 48512 = -2y. What are the prime factors of y? 10429 Let w = -86 + 87. Suppose w = s - 5c - 310, -3c - 657 = -2s. What are the prime factors of s? 2, 3, 7 Suppose -836921 = 230q - 11958341. What are the prime factors of q? 2, 3, 8059 Suppose -63n = -39n - 480. List the prime factors of (n/14)/5 - (-2577)/21. 3, 41 Let g(y) = -3y*2 + 22y + 42. Let s be g(9). Let w(h) = 15h2 - 3h - 9. What are the prime factors of w(s)? 3, 5 What are the prime factors of (-156168/(-30))/((-4)/(-70))? 2, 3, 7, 13 Let m = -6075 + 13381. List the prime factors of m. 2, 13, 281 Suppose 9a - 225 = 6a. Suppose -ah = -77h + 16. List the prime factors of (130 - 0) + h + -12. 2, 3, 7 Suppose 0 = -i - 4t + 47, 3i - 6i + 3t = -96. Let j = 163 - i. Suppose j + 28 = 4h. List the prime factors of h. 3, 13 Suppose 4p = -4, 5h - 5p = -2p - 567. Let f = -43 + h. Let n = f - -260. List the prime factors of n. 103 What are the prime factors of 41/(-7) + (-5516)/196 + 28 - -64727? 61, 1061 Let m(z) = z + 5. Let w be m(-7). Let i be 7/9 + w + (-24)/(-108). List the prime factors of (2 + i)-1-1 - -29. 2, 3, 5 Suppose -5p - 104c + 99c = -59515, -2c = -3p + 35739. What are the prime factors of p? 11909 Let p be (-223223)/(-49) + (-16)/28. Suppose 221d - p = 216d. What are the prime factors of d? 911 Suppose 2x + 14x - 37248 = 0. Suppose z = -4c + x, 17z + 1146 = 2c + 22z. List the prime factors of c. 11, 53 Let h(t) = 3t*2 - 33t + 35. Let s be h(10). Suppose j + 10p - sp = 228, 3j - 740 = -p. List the prime factors of j. 2, 31 Let f(q) = q2 + 19q + 53. Let o be f(-16). Suppose l + m + 2588 = ol, 5l - 3235 = 4m. List the prime factors of l. 647 Let w be ((-5)/((-10)/4))/((-6)/(-12)). Suppose -wv = -11 - 149. Let r = v + 78. List the prime factors of r. 2, 59 Suppose -228o + 9616320 = 249o. What are the prime factors of o? 2, 3, 5, 7 Suppose 96l + 60l - 641628 = 0. List the prime factors of l. 3, 457 Let y(l) = -l*2 + 13l + 26. Let k be y(14). Suppose -7w = -kw + 35. List the prime factors of w/((-245)/10) + (-2874)/(-14). 5, 41 Let h = -63 + 69. List the prime factors of 752 - (h + 2(-3)/6). 3, 83 List the prime factors of (-474)/323400/(-144). 5, 13, 79 Let o(k) = -6k3 + 6k*2 - 12k - 5. Let g be o(4). Let x = g - -488. What are the prime factors of x? 3, 7 Let m be (-2)/4(5 + -11). Suppose ms = d + 3d + 2818, -5d = -s + 954. What are the prime factors of s? 2, 467 Let x be (-11)/(-4) + (-33)/44. Suppose -w - 66 = n, 6n - 4w = xn - 232. Let b = n + 68. What are the prime factors of b? 2, 3 Suppose 0 = -6m + 8m - 44. Suppose 3f - 2f = 5y + m, 2f = y + 8. Suppose -5p + 4i = -275, -fp - i = -p - 46. What are the prime factors of p? 3, 17 Let r(u) = 16u2 + 106u + 84. What are the prime factors of r(14)? 2, 3, 7 Let h(j) = 7j3 - 127j*2 + 47j + 262. List the prime factors of h(25). 3, 7, 499 Suppose 4z + 3c = 121, -5z + 5c + 263 - 68 = 0. Let m = z - 31. Suppose d = -0d - 3x + 69, 2d + mx = 144. List the prime factors of d. 3, 5 What are the prime factors of ((-87404)/41)/((189/14)/(-27))? 2, 21851 Let g(d) be the third derivative of 5d*2 + 0d - 1/24d4 + 41/6d*3 + 1/60d*5 + 0. List the prime factors of g(0). 41 Let c be (113/3)/((-640)/90 - -7). Let u = -145 - c. What are the prime factors of u? 2, 97 Let y be (-3)/(-1) - 7 - 801. Let g = y - -468. Let c = -183 - g. List the prime factors of c. 2, 7, 11 Suppose 21m - 67489 = -2809. List the prime factors of m. 2, 5, 7, 11 Let q = 105 + -100. Suppose -2v = 4u - 508, 7u + 4v = qu + 266. Let n = 236 - u. What are the prime factors of n? 3, 37 Let x(a) = -7a*3 - 3a*2 + 6a + 4. Let k(w) = 6w3 + 4w*2 - 7w - 3. Let r(l) = 6k(l) + 5x(l). Let s = -4 + -5. What are the prime factors of r(s)? 2, 5, 11 Suppose 180l = -p + 178l + 9563, -28689 = -3p - l. List the prime factors of p. 73, 131 Let z = 115 - 107. Let o(h) = -45 + zh + 33 + 24. List the prime factors of o(12). 2, 3 Let x = -27705 + 44445. What are the prime factors of x? 2, 3, 5, 31 Let m = -74 + 56. What are the prime factors of (0 + 1)/(m/(-5436))? 2, 151 Suppose -84x - 76 = -88x. Suppose 6b + 7280 = xb. What are the prime factors of b? 2, 5, 7 Suppose -8w = -y - 4w + 26, 3y + 4w - 46 = 0. Let f be y/4 + 0 + 7/(-14). Suppose -2t - fb = -270, -3t - 3b + 385 = -b. List the prime factors of t. 5 Suppose -19j + 645 - 94 = 0. Let n(i) = 59i - 350. List the prime factors of n(j). 1361 Let z(i) = 1274i - 1366. What are the prime factors of z(24)? 2, 5, 23, 127 Let k = -10572 + 13653. What are the prime factors of k? 3, 13, 79 Suppose -g - 10 + 22 = 0. Let k be (2 + 8/g)/((-4)/(-6)). Suppose 151 + 1 = kc. List the prime factors of c. 2, 19 Let m(t) = 497t2 - 188t + 1306. What are the prime factors of m(7)? 11, 2213 Let h = 5402 + 5744. List the prime factors of h. 2, 5573 Suppose 4p - 3z + 0z - 45 = 0, 5z = -2p + 3. What are the prime factors of p/3 - (-14 - -9)? 2 Suppose -2y - 1 = -7. Suppose -4p - x + 1 = -4x, yp + 12 = -2x. What are the prime factors of (98/(-6))/(p/6)? 7 Suppose 5z - 762 = 5l + z, -2l = 5z + 285. Suppose 2j - 60 = -5m, -2j - 52 = -3m - 0j. Let t = m - l. What are the prime factors of t? 2, 41 Let y(i) = 341i - 24. Let b be y(-2). Let z = b - -1056. What are the prime factors of z? 2, 5, 7 Suppose 3n = -248 + 236. Let m(l) = -l3 - 7l*2 - 5l - 1. Let v(t) = -t*2 + t. Let k(g) = -2m(g) - 4v(g). List the prime factors of k(n). 2, 3, 23 Let i(w) = 5w*2 - 183w - 55. Let l(x) = 7x + 107. Let s be l(-9). List the prime factors of i(s). 11, 13 Let y(s) = 78s*2 - 2s + 2. Let b = -26 + 27. Let j be y(b). Suppose h + g + j = 2h, -3h = -4g - 234. List the prime factors of h. 2, 3, 13 Suppose 13o - 5246 = 10o + 4k, 2k + 8748 = 5o. What are the prime factors of o? 2, 5, 7 Suppose 12m - 9720 = -8m. Suppose c = -5p + 4p + m, -20 = 5p. What are the prime factors of c? 2, 5, 7 Let q(b) be the first derivative of -b4/4 - 4b*3/3 - 3b*2/2 - 2b - 1. Let c = -4114 + 4107. What are the prime factors of q(c)? 2, 83 Suppose 2i = -3f - 13, -3f - 6 = 3i + 6. Let z be (-3)/1 + (0 - f - 10). Let b = 17 - z. What are the prime factors of b? 5 Suppose 8265u - 8270u - 10 = 0, -203500 = -5y - 5u. What are the prime factors of y? 2, 47, 433 Suppose 7v = 2v + z + 1615, -5v = -3z - 1605. Let f be (2/(-5))/(39/(-390)). Suppose s + fs - v = -2p, -3s - 444 = -3p. What are the prime factors of p? 2, 19 Let c be ((-36)/15 + 3)5. Suppose 0 = y + cf + f - 427, -2y + 841 = -5f. What are the prime factors of y? 3, 47 Let r be 2/(-8) + 1/4. Suppose r = -7t + t + 2928. List the prime factors of t. 2, 61 Suppose 3n - 22 = -5h, -7h + 2h + 27 = -2n. Suppose 3a = -2w + 66, 0w = 2w - ha - 34. Suppose 59 = 2o - w. List the prime factors of o. 43 Suppose -66 = -23k + 49. Suppose -4x - 4g = -796, 4x - kg - 623 - 200 = 0. What are the prime factors of x? 2, 101 Let l = 169 + -167. Suppose -l = y - 125. What are the prime factors of y? 3, 41 Let p(l) = -101l + 9. Let a be (-2)/4((-10)/1)/(-5). List the prime factors of p(a). 2, 5, 11 Let a = 31 + -27. Suppose -186 = -3l - ac - 74, -5c = 2l - 84. What are the prime factors of l? 2 Let d(y) = y3 - 9y*2 - 9y + 19. Let x(g) = 6g - 8. Let l be x(3). What are the prime factors of d(l)? 29 Let s(i) be the third derivative of 0 + 1/6i*5 + 0i - 1/120i6 + 13/24i*4 + 12i*2 + 4/3i*3. List the prime factors of s(10). 2, 3, 23 Suppose -3n + 5r + 75 = 32, -n - 2r = 4. List the prime factors of (-1096)/6*(3/n - 2). 2, 137 Let k = 510 + -513. What are the prime f	{ "pile_set_name": "DM Mathematics" }
rt a? 2 Let q(t) be the second derivative of -2t6/15 + t3/6 + 7t. Find the second derivative of q(b) wrt b. -48b2 Let b(q) be the first derivative of -5q*4/4 + 4q + 6. What is the derivative of b(w) wrt w? -15w2 Let p(u) = -4u - 3. Let y be p(-1). Find the first derivative of -11c3 + 6 + 12c*3 + y wrt c. 3c*2 Suppose 0 = 3o - 7o - 5r - 12, r + 14 = 5o. What is the second derivative of s + 0s - os + 7s - 6s3 wrt s? -36s Differentiate -t - 3 + 2t - t - 4t wrt t. -4 Suppose -3h - 3r = -33, -2h - 2r = 2r - 28. Let m = -2 + h. What is the derivative of mo + 3 - 3 + 3 - 2o wrt o? 4 Let o(z) = 3z*3 + 35z*2 - 6z. Let d(p) = -p*2 + p. Let h(y) = 6d(y) + o(y). What is the third derivative of h(t) wrt t? 18 Let b(p) = -p*4 + 11p*3 - 11p + 20. Let r(w) = 10w - 16w - 4w3 + 10w - 7. Let v(y) = 4b(y) + 11r(y). Differentiate v(i) wrt i. -16i3 Suppose 11l - 6 = 8l. Let w(c) be the second derivative of -3/2c*2 + 0c*3 + 0 + lc - 1/3c4. Differentiate w(b) with respect to b. -8b What is the derivative of 15 + 1 + 5 - 12 + 9s wrt s? 9 Let c(k) be the third derivative of k6/120 - 3k*3/2 - 5k*2. What is the derivative of c(f) wrt f? 3f*2 Let v(n) be the second derivative of 0n*2 + 0n*3 - n + 1/20n*5 + 0 + 1/6n4. What is the third derivative of v(p) wrt p? 6 Let k(l) be the first derivative of l8/1680 + l*6/360 + 2l*3/3 - 2. Let v(h) be the third derivative of k(h). What is the third derivative of v(a) wrt a? 24a Let g(f) be the second derivative of 5f + 0 - 1/15f*6 - 1/12f*4 + 0f*5 + 0f*3 + 0f*2. What is the third derivative of g(m) wrt m? -48m Let d(p) = p*2 - p. Let u be d(2). Find the second derivative of -4z*4 + uz + z2 - z2 + 2z4 wrt z. -24z*2 Let o(i) = 1. Let j(s) = 5. Let f(x) = -j(x) + 6o(x). Let z(c) = c + 11. Let g(v) = 6f(v) - z(v). What is the derivative of g(p) wrt p? -1 Let r(z) = -8z4 + z2 - 2z. Let v(s) = -23s*4 + 3s*2 - 7s. Let k(b) = -7r(b) + 2v(b). Find the third derivative of k(w) wrt w. 240w Suppose -4i = -3w + 6w - 13, 0 = 4w - 3i - 34. Let f = w + -4. Differentiate -3c + 3 + fc - c with respect to c. -1 Let y(u) = -125u3 - 6u - 25. Let h(x) = 41x3 + 2x + 8. Let l(b) = 8h(b) + 3y(b). Find the second derivative of l(g) wrt g. -282g Let o(k) be the third derivative of -k6/40 + k4/24 + k2. Find the second derivative of o(r) wrt r. -18r Let w(k) be the second derivative of 0k3 + 0k*7 + 0k*6 + 0 + 0k*5 + 1/28k*8 + 2/3k*4 + 0k*2 - 2k. What is the third derivative of w(b) wrt b? 240b3 Let n(y) = -y2 - 5y + 8. Let a be n(-6). Find the first derivative of 0 + 0 + 4 - 5 - s*a wrt s. -2s Let f(b) = -3b2 - 33b. Let w(i) = -4i2 - 34i. Let l(d) = 2f(d) - 3w(d). Find the second derivative of l(v) wrt v. 12 Let u(k) be the second derivative of k*5/120 - 5k4/24 + k3 + 6k. Let g(o) be the second derivative of u(o). Differentiate g(q) with respect to q. 1 Let u(f) be the third derivative of -19f*6/60 - 19f*3/3 - 39f*2. Differentiate u(m) with respect to m. -114m2 Let h(g) = -g3 + 5g2 - g + 5. Let w be h(5). Differentiate t4 - 1 - 2 + 0t*4 + wt*4 with respect to t. 4t*3 Let d(i) = 0i + 0 + 1 - 2i. Let n be d(-1). Find the second derivative of 2z*2 + z + nz - 3z wrt z. 4 Let i(a) be the second derivative of -17a*5/20 + 5a*2/2 + 17a. Differentiate i(w) with respect to w. -51w2 Suppose -4y + 0y = 0. Suppose 5q + yq = 0. What is the third derivative of qh2 - h4 + 0h4 - 2h*2 wrt h? -24h Let n(p) = p + 8p3 + 4 - p2 - 5 + 2p*2 - 7p*3. Let g(t) = 9t*2 + 2t - 2. Let i(z) = -g(z) + 2n(z). Find the third derivative of i(l) wrt l. 12 Suppose -2u - 4 = -8. Find the third derivative of 0pu - 2p*2 + 0p*3 - 2p*4 + 0p*3 wrt p. -48p Let q(r) be the third derivative of -7r4/24 - 7r3/3 + r2. What is the derivative of q(u) wrt u? -7 Let p(v) = 2v2 + 3v - 3. Let w be p(-3). What is the second derivative of -6 - s + w - 4s2 wrt s? -8 Let u(t) = -t2. Suppose -2s + 2 = -2. Let z(d) = -d*2 - 2d*s - 2d - d*2 + 0d*2. Let y(c) = 6u(c) - z(c). What is the second derivative of y(x) wrt x? -4 Find the first derivative of -2g2 + 2203g + 5g2 + 8 - 2203g wrt g. 6g Let q(z) = 5z - 12. Let s be q(8). Let v be ((-10)/(-2))/(4/s). What is the second derivative of w*2 - 35 + 2w + v wrt w? 2 Let v(q) be the first derivative of 3q7/7 + q4 - 2q*3/3 + 20q*2 - 53. What is the third derivative of v(c) wrt c? 360c3 + 24 Let l(d) be the third derivative of -d7/35 - d*3 - 8d*2. Differentiate l(x) with respect to x. -24x*3 Let y(q) be the third derivative of 0q3 + q2 + 1/6q4 - 1/20q*5 + 0 + 0q. What is the second derivative of y(m) wrt m? -6 Find the first derivative of -8a2 - a2 - 28 - 4a*2 wrt a. -26a What is the second derivative of 4g + 2g*2 - 23g - 5g2 - 6g*2 wrt g? -18 Suppose 3z - 5 = 5x, 0x - 3z + 11 = -2x. Suppose -4k + q = k - 6, -1 = -xk - q. Differentiate -2w3 + k - w3 + 5w*3 wrt w. 6w*2 Suppose -5a + 2f - 6 + 42 = 0, -3f = -2a + 21. What is the derivative of -2 - t3 + at*3 + 5 wrt t? 15t2 Let t(z) = -z3 + 6z2 + 2. Let k be t(6). Find the second derivative of -4n*k + 7n*2 - 4n - 2n + 4n wrt n. 6 Let o(w) be the second derivative of 0w5 + 1/2w*3 + 0w*6 - 1/42w*7 - 6w + 0 + 0w4 + 0w*2. Find the second derivative of o(t) wrt t. -20t*3 Find the third derivative of -11s*6 + 33s*2 - 12s2 - s6 - 9s6 wrt s. -2520s*3 Suppose -7a = -11a - 4. Let d(h) = h3 - h. Let t(f) = -6f*4 + 6f*3 - 6f + 1. Let w(c) = at(c) + 6d(c). What is the first derivative of w(o) wrt o? 24o3 Let y(j) be the second derivative of j4/4 + j3 - j2 + j. Let f(u) = 5u*2 + 11u - 4. Let z(r) = 6f(r) - 11y(r). Differentiate z(p) with respect to p. -6p Differentiate -5 + 0t*2 - 3 - 3t*2 with respect to t. -6t Suppose g + 2 = k, 4g + 1 = 5g. Suppose 4b = -2n + 4, 3b = 2n - 3n + 2. Find the second derivative of kf*4 - nf + 6f - 2f wrt f. 36f2 Let l(w) = w2 - 3w + 4. Let g be l(3). Suppose -gv - 23 - 7 = -5y, 5 = 5y + v. Find the third derivative of -x6 + x3 - xy - x3 wrt x. -120x3 Let p(j) be the first derivative of j7/140 - j*5/120 - 4j*3/3 - 1. Let m(n) be the third derivative of p(n). What is the second derivative of m(z) wrt z? 36z Let f(n) be the third derivative of 0n5 + 0n*6 + 1/6n*3 + 0 + 4n*2 + 0n*4 - 1/70n*7 + 0n. Differentiate f(u) wrt u. -12u3 Let k = 8 + -4. Differentiate -2v*3 + 5v*3 + 1 - k wrt v. 9v2 Let v(n) be the third derivative of -n7/35 + n*4/8 - 2n*2. Find the second derivative of v(r) wrt r. -72r2 Let v(d) = d4 - d3 + d2. Let i be (4/(-6))/(2/6). Let y(j) = -4j4 + 2j*3 - 2j*2 + 5. Let h(n) = iv(n) - y(n). Differentiate h(l) wrt l. 8l3 Find the first derivative of 2r*3 - 7r - 12r3 + 1 + 7r wrt r. -30r2 Let m = 15 - 13. Differentiate 2u*m + 11 - 4u*3 + 0u*2 - 2u*2 wrt u. -12u*2 Let i(m) = 9m*3 + 4m*2 + 4m - 28. Let j(b) = 19b3 + 9b*2 + 9b - 57. Let g(c) = 9i(c) - 4j(c). Find the first derivative of g(d) wrt d. 15d2 Suppose 4s - 8s + 8 = 0. What is the second derivative of -u - 5u + 2u + 4u*s - 2u wrt u? 8 Suppose -c - 3 = t, t - 5 = -2c - 3c. Let v = c - 0. What is the third derivative of -3n2 + 2n*2 + 3nv - n5 - n*2 wrt n? -60n2 Let m(a) = a3 + a*2 + a + 1. Let d(o) = -24o*3 - 32o*2 - 32o - 56. Let v(q) = d(q) + 32m(q). What is the first derivative of v(k) wrt k? 24k*2 Let d(t) be the first derivative of 0t*4 - 3 + 0t*6 + 3/7t*7 + 0t*2 + 0t + 0t5 + t3. Find the third derivative of d(y) wrt y. 360y3 Let r(f) be the third derivative of f5/10 - f4/12 + f3/6 - 4f2. Let x(c) = -c2 + c. Let m(n) = -r(n) - 2x(n). Differentiate m(g) wrt g. -8g Let g(o) be the first derivative of -4o*5/5 - 2o - 2. What is the derivative of g(l) wrt l? -16l3 Let k(b) be the second derivative of -2b*6/15 - 3b*2 + 2b. What is the first derivative of k(y) wrt y? -16y*3 Let o(j) be the second d	{ "pile_set_name": "DM Mathematics" }
/r4)/r)))/(r(-1/22)r15r))(11/6) assuming r is positive. r(-1983/52) Simplify (w*(-12)w(-4)/w)(-46)(w/(w/w(-1/11))w(-1/7))13 assuming w is positive. w*(59980/77) Simplify ((d/(d/(d/(d/(ddd(-2))))))(-3/11))21/(((dd(d1/d)/d)/(d/(dd*(4/5)d)d))/(d(-1))(-2/79)) assuming d is positive. d(-701/395) Simplify u/u(3/4)u*(-5)(u(-2))(-2/43)(u(-6)/u(-2/5))26 assuming u is positive. u(-129221/860) Simplify ((v(2/3))43)(-50)(v/v*2v6)11 assuming v is positive. v*(-4135/3) Simplify (tt*(-2/5))/tt*(2/7)t(t(1/2))(1/19)(t*(3/7)t/t(-5))(-4/3) assuming t is positive. t*(-10187/1330) Simplify (hh*(-16/3)h(3/19))/(h(-9)h/(h/((h/(hh(-3/31)))/h))) assuming h is positive. h(10121/1767) Simplify (((yy(2/3))/yy)(-14))(2/21)(yyy(-2)/y)/y(1/9)(yyy(-2/3)/y)(2/7) assuming y is positive. y*(-68/21) Simplify ((s/(ss(-1/22)/s))(-27)((s(-13)/s)/s)27)(-14) assuming s is positive. s(66717/11) Simplify ((q14/q)/(q/((q(q*(-1/4)qq)/q)/qq)q))(1/51)(q*(-3/2)/(q/(qq7)))(-1/6) assuming q is positive. q(-2/3) Simplify (v(-2/39))*(2/13)v2/((v(-31)/v)/v) assuming v is positive. v(17741/507) Simplify ((n(2/5)nn)(2/3)/((n/(n/n3)n)/((n/n(-7))/n)))/(n4n*5(n(-1))(3/7)) assuming n is positive. n(-139/35) Simplify (a(-12)/(a/(a*(-14)a)))/((aa(2/119))/((a/(a/(a/(a/((a(-8/3)/aa)/aa))))aa)/a)) assuming a is positive. a(-10240/357) Simplify (o(-1/10)/(o/(ooo(-7/3)/o)o))*(-2/5)((oo(-2/5)/o)/o(-4/3))(1/35) assuming o is positive. o(7/5) Simplify ((j5/j)(20/7))(-10)/(j(-15)j(-3/5))(-5) assuming j is positive. j(-1346/7) Simplify ((f/(f(1/20)/ff))/(f/(f/(f/f(-4))))(f/(ff(3/5)))44)40 assuming f is positive. f(-1218) Simplify (aa*1aa(-2/3))/(a(-4/5)a*(-2/19))a*(3/2)aa(-9)(aa7a)/a3 assuming a is positive. a(1561/570) Simplify (ooo*4(o*(2/5)/o)/o(o/(o/(oo0)o))48)/((o6o/o(-2/13))/(o(2/7))(1/40)) assuming o is positive. o(-4999/1820) Simplify (((a(3/7)aa/a(3/8))/(a4a*(13/3)a))(6/7))(-31) assuming a is positive. a*(37913/196) Simplify ((p/(pp(-1)/p))/p)(7/11)(p(1/3))(-2)(p(-2))(1/5)(pp*(8/5)p)/((pp(2/15)pp)/p) assuming p is positive. p(57/55) Simplify ((r/r6)/(r/(rr*(-2)/rr))r7rr((r/r*(-1/7))/r)/rrr)/(((r/r(-1)r)/r)*(-28)(r/(r(-4)/r))/(r/r4)) assuming r is positive. r*(351/7) Simplify ((((tt*(9/7))/t)/tt)/(t(tt/t(-8/3))/t))(-15/7)t(-4)((t*(-6)t)/t)/tt(2/11)/(t(1/9)/t) assuming t is positive. t(-13022/4851) Simplify (((o(1/16)o(-2/11))(-2/65))(23/3))(13/5) assuming o is positive. o(161/2200) Simplify ((z/z(-1)z)(-11)(zz(-1/3)/z)(-33))/((zz(-2/9))/(z/(z4z)z))18 assuming z is positive. z(-90) Simplify ((((g(1/7)/g)(2/17))(22/3))(-1/3))(-2/33) assuming g is positive. g(-16/1071) Simplify ((h/(h*1h))(-12))49((h/((hh(-2/5))/h))(3/29))(-1) assuming h is positive. h(85239/145) Simplify (y*7(yy(3/5)/y)/y)(3/14)/(y/(y/y(-2/13)y)y6)(1/8) assuming y is positive. y(2943/3640) Simplify ((q(-1/2))(-2/21)/(q1)44)/((q/(qqq(-2/11)/qq))(-37))(3/35) assuming q is positive. q(-53762/1155) Simplify ((v(-2/7)/vv1/v)/(v6/v(-2/11)))/((v/v(2/7)v)*(18/5)/(v((v(v2/v)/v)/v)/vvv0)) assuming v is positive. v(-4866/385) Simplify ((o(-2/5))(7/5)(oo(-1)o)(-3/17))/((o1)(3/31)/(o(-5)o(1/3))) assuming o is positive. o(-217384/39525) Simplify ((l4/l)32/(l4)(1/14))14 assuming l is positive. l1340 Simplify ((o/(o/((o/((o(oo(-2/13))/oo)/o)o)/o)))/o(1/7)o*(-6)/ooo(4/5))/((o0)32/(o(-3)/ooo(2/3))) assuming o is positive. o(-10268/1365) Simplify (((w0/ww)/w*(2/3))/(w/(ww*(-2/7))w/((w(1/6)/w)/w)))/(((w(-1/4)w)/w(-5))/(w5/(w/(ww(2/5))))) assuming w is positive. w(-579/140) Simplify (((ll(1/8)lll*0l)/(l(-2/3)/l)(-1/5))(-7/6))(-6/13) assuming l is positive. l(49/24) Simplify (s0)*(-4/35)((s/s(-1))/s)(9/5)(((s(-4/3)/s)/s)/(ss(s/s(-3))/sss))48 assuming s is positive. s(-2471/5) Simplify ((((c/c2)(11/2))34)6)(-21) assuming c is positive. c23562 Simplify (c(3/2)((c/c(-1/10))/c)/c)/(c(1/4))*(2/3)(((ccc/c*(-10))/cc)/c7)(-48) assuming c is positive. c(-8627/30) Simplify i(-4)/(i/(ii3i))(iii/i(-1/3)i)*27((i*(2/27)ii)/i6)(9/2) assuming i is positive. i(298/3) Simplify ((h/h(-2/13)h*(3/5)(h/(h0/h))(-2/15))(-3))(-32) assuming h is positive. h*(1856/13) Simplify ((rr/(rr/r0r)r/r(-3/5))/((rr(2/11)/r)/r(-2/5)))/((r(-1/3)/r(-2/3))/((r/((r/(rr/r(-1/5)))/r))/r0)) assuming r is positive. r(476/165) Simplify (((((q/(qq/((q/q*(-11))/q))qq)/q)(-34))11)36)0 assuming q is positive. 1 Simplify ((aaa0)/(a/a(1/3)))25aa(5/2)aa(2/17)a*(-2)(a0/a)/a assuming a is positive. a(3463/102) Simplify (z3/z)/z(-3/7)(z/((zz*0z)/z))*(-8)(z*(-1)z(4/11))/(((z6/zz)/z)/z(z*(1/3)/zz)/z) assuming z is positive. z*(-356/231) Simplify hh/((hh(-1)h)/h)hh*(-1/31)(hh(2/137))/((h(-3/13)h)/h) assuming h is positive. h(232610/55211) Simplify ((l32ll0)/(l/l1)(-3))(-5/11) assuming l is positive. l(-15) Simplify ((w/(w/(w(-1/3)/w)))*(5/7)/(www(-6)w6))/((w(-1))*(-8/3)(w/((w/(w/(ww(-6))))/w))/((w/(w/(w/w(-3/2))))/ww)) assuming w is positive. w(-425/42) Simplify s/(s/s21ss)((sss(-15/4))/ss)/ss(s/(s(1/27)/s))/(((s(9/4)/s)/s)/s) assuming s is positive. s(539/27) Simplify (d(3/4)(dd*6d)/d)/((d/(d6/d))/d1)(d2d(1/9))/((d(-1)d)/(d(-1/2)d)) assuming d is positive. d(553/36) Simplify (((a(3/2)/aa(-1/6)/aa)(-39/2))(-23))(-10/3) assuming a is positive. a(-1495/3) Simplify (k/((k/((kk(-4/7))/kk)k)/kkk)k/k*(-1)k(k/(kk*2kk))(5/6))(-6/11) assuming k is positive. k(80/77) Simplify (j/((j(1/3)/jj)/j))*(3/2)j/(j/(j*21j))(j/(j38j))/j assuming j is positive. j(-29/2) Simplify ((u2)(-4))(-3)/((u1)25(u/(u/(u/(uu/((u/(u*7u))/uu)uu)u)uu))/(u/(u(-6/11)/u))) assuming u is positive. u(138/11) Simplify ((aa(1/39)a)*(5/11)(a/a(10/7))(-3/11))(-4/19) assuming a is positive. a(-656/3003) Simplify ((z*(-1/19)z)/((z(2/29)/z)/z))(-3/8)/(z/z*3z(-5))(-16/9) assuming z is positive. z*(-268259/19836) Simplify ((ii*2i)*(-32)/(ii/i6)(6/13))26 assuming i is positive. i(-3280) Simplify (((o/o*26o)/oo18)/(o(-16/3)oo(-1/2)o))(-4/23) assuming o is positive. o(38/69) Simplify (h(-3)/(h/(h/h(3/8))h)h*(-3)h/(h/h(-7)))/(((h/(h/(h/(h/(h(-6)h))h)h))/h)/h(1/8))(-14/5) assuming h is positive. h(-1261/40) Simplify (o(2/9)/(oo(-3/5)/o))(4/17)/((oo/o1)37)(1/27) assuming o is positive. o(-2701/2295) Simplify (((i(3/8)/i)/(i/(i(3/7)/ii)))/(((i/(iii/i*(1/4)i))/i)/(i/(((ii(-2/9)i)/i)/i))))/(i(-6)/i(-8))(-1/36) assuming i is positive. i(1931/504) Simplify ((l(3/5)/((l/l5)/l))/(l(-1/3))35)/(l(-8)/(((l/(l(-2/25)/l))/l)/l))16 assuming l is positive. l(10991/75) Simplify (((v*2v)/(vvv/v(-3/4)))/(((v/((v/v0)/v))/v)/v(v(-2/17)v)/v))/((v*(-5)v*(-3))/(vvv(-1)vv)(3/32)) assuming v is positive. v(4705/544) Simplify (((jj*(-2)j/(j0/j))29)(4/11))(-25) assuming j is positive. j(-2900/11) Simplify (x11/(x/(xx(-2/17)))(x(x/(x/(xxx(2/11))))/xxx)(-5))(26/5) assuming x is positive. x(-9750/187) Simplify (((w(-2/7))35w*(3/7)/(w(w*(-2/3)w)/w))(4/3))(-1/29) assuming w is positive. w(832/1827) Simplify (v(-2/5)vvv(1/5))(-2/25)(((v/((vv0)/v))/v)50)36 assuming v is positive. v(-18/125) Simplify (i(-1/11)/i)/(i/(i/i(-1/7)ii)i)i/((i39i)/i)i/((i/(i/i(-43)))/i) assuming i is positive. i(543/77) Simplify ((o(-4)o)*(-15/2)/((oo/(o/(oo/o(4/5))o))/oo12))9 assuming o is positive. o(927/10) Simplify ((b2b)*(-12)(b/(b**	{ "pile_set_name": "DM Mathematics" }
rt q. 660q2 Let g(t) be the first derivative of 3/5t*5 - 6t - 4 + 0t2 + 0t*3 + 0t*4. What is the derivative of g(y) wrt y? 12y*3 Differentiate -13v*2 - 6v*2 - 2v*2 - 15 - 16 with respect to v. -42v Find the third derivative of -7p4 + 17p4 - p2 + 8p + 87p*4 - 46p*4 wrt p. 1224p Let u = 37 + -23. Suppose 16 = 5f - q - u, 5f + 4q - 30 = 0. What is the first derivative of i4 + 2 - f + 3 wrt i? 4i*3 Let x(c) be the second derivative of 13c*5/20 + 4c*3/3 - 6c. What is the second derivative of x(z) wrt z? 78z Let t(n) = 16n*2 + 6n + 14. Let o(h) = h*2 + h. Let b(a) = 6o(a) - t(a). Differentiate b(p) wrt p. -20p What is the third derivative of 9m*2 - 3m*6 + 5m*6 - 3m*2 wrt m? 240m*3 Let s be 16 - 0 - -2. Suppose -s = -3c - c. Find the third derivative of 2i*c - 3i2 - i6 - i*2 wrt i. -120i*3 Differentiate 63 - 3 + 31z*4 - 1 wrt z. 124z*3 Let i(w) be the first derivative of -11w*4 - 6w*3 + 39. Find the third derivative of i(y) wrt y. -264 Let z = 5 - -1. Differentiate z + 48b*3 + 7b*4 - 48b*3 wrt b. 28b*3 Suppose -35 = -3v + 4w - 0, 2v + 3w + 5 = 0. What is the third derivative of yv + 0y*2 + 2y2 + y2 wrt y? 60y2 Let y(i) = 0 + 3 + 5 - i + 0. Let c be y(7). What is the derivative of c - 2g3 - g3 + 0g + 0g wrt g? -9g2 Suppose 2 = 3c - 7. Find the second derivative of -4a5 - a + 2a*c - 2a*3 - 3a*5 wrt a. -140a*3 Let p(g) = g - 4. Let c(w) be the first derivative of -2w*2 + 21w + 1. Let h(n) = 2c(n) + 11p(n). Differentiate h(d) wrt d. 3 Let z(i) be the third derivative of -i8/2240 - i5/30 + i4/24 + i2. Let j(p) be the second derivative of z(p). Differentiate j(x) wrt x. -9x2 Let a(h) be the first derivative of h3/3 - 7h + 6. What is the first derivative of a(p) wrt p? 2p Let t be 04/(12 - 4). Let y(u) be the first derivative of 0u3 - 1 + 0u - 2/5u5 + 1/2u*2 + tu*4. Find the second derivative of y(x) wrt x. -24x*2 Let o(z) be the first derivative of -13z*5/5 + 5z*2 + 13. What is the second derivative of o(j) wrt j? -156j*2 Find the second derivative of -3h*3 - 4h + 10h + 12h*4 + 3h*3 wrt h. 144h*2 Suppose 0n = 2n + 6. Let b(l) = -l - 2. Let j(z) = 0z2 + 3 + 0 + z2 + z. Let g(r) = nb(r) - 2j(r). What is the second derivative of g(h) wrt h? -4 Differentiate -6g4 - 2 + 3 + 6g*4 - 6g*4 with respect to g. -24g*3 Suppose -4l + 14 = 3r, -2l = -4l - 5r. Suppose -6 = -lm - 1. What is the derivative of 0 - m + 3u4 - u4 wrt u? 8u3 Let i(j) = -2j - 10. Let t(l) = l - 1. Let b be t(-6). Let d be i(b). What is the first derivative of 2 + 2s4 + 2s*4 - 3s*d - 6 wrt s? 4s*3 Let i = 11 + -7. What is the third derivative of 31k*4 + 3k2 - k2 - 29ki wrt k? 48k Let w = 6 + -4. Find the second derivative of -4j - 4j*2 + 0jw + j2 wrt j. -6 Let f(u) = u*3 + 3u*2 + 2u + 2. Suppose -13 + 5 = 4b. Let c be f(b). What is the second derivative of 0h5 + h - h5 + ch5 wrt h? 20h*3 Find the second derivative of 5d3 + d3 - 12d + 0d*3 + 2d wrt d. 36d Let c be (28/12)/(1/6). Find the first derivative of -6p*4 + 2p*4 + 18 - c wrt p. -16p*3 Suppose -4d + 2w + w + 4 = 0, -5w + 20 = 0. What is the third derivative of 18a - 6a*3 + 11a + da2 - 29a wrt a? -36 What is the third derivative of -8s6 + 6s*6 - 9s*2 - 6s*6 wrt s? -960s3 Let d(j) be the second derivative of j9/3780 + j*5/24 - 5j*4/12 - 3j. Let r(p) be the third derivative of d(p). Differentiate r(m) wrt m. 16m3 Let r(v) be the second derivative of -v8/336 + v4/24 - 5v*3/6 - v. Let i(q) be the second derivative of r(q). Differentiate i(x) with respect to x. -20x*3 Let a(f) = -7f - 9. Let g(c) = -36c - 44. Let t(w) = 11a(w) - 2g(w). What is the first derivative of t(i) wrt i? -5 What is the first derivative of 8 + 9l*4 - 3 - 3 - 6 wrt l? 36l*3 Let y be 0 + -2 + 32. Suppose 0 = -2o + 2 + y. Find the third derivative of -5t*3 + 4t*3 + 4t*2 - ot*2 wrt t. -6 Let b be 15/(-10) - (-6)/4. Find the second derivative of 40h*2 - 34h*2 + 0 + b - 3h wrt h. 12 Suppose -u + 2 = -t - 15, 3t - 47 = -4u. What is the second derivative of -9l - ul + 21l + l3 wrt l? 6l Let c(a) = a5 - a3 - a*2 + 1. Let m(y) = 19y*5 + 5y*3 + 34y*2 - 5. Let g(v) = -5c(v) - m(v). Find the third derivative of g(s) wrt s. -1440s2 Let g(c) = 3c*3 - 7c. Let k(m) = 8m3 - 6m - 3m3 + m3 - 3m*3. Let f(i) = -5g(i) + 6k(i). Find the second derivative of f(p) wrt p. 18p Let h be 6/(-12) - 1/(-2). Let g(p) be the first derivative of -3 + 0p2 + hp + p*3 + 1/2p4. Find the third derivative of g(w) wrt w. 12 Let t(h) be the second derivative of -h10/1008 - h*6/72 - 3h*3/2 + h. Let i(l) be the second derivative of t(l). Find the third derivative of i(c) wrt c. -600c*3 What is the third derivative of -5d*2 - 6d*5 - 7d*2 + 0d*2 - 9d*5 wrt d? -900d2 Let o(t) be the first derivative of t5/20 - 5t3/6 + t2/2 + 4. Let w(u) be the second derivative of o(u). Differentiate w(i) wrt i. 6i Let k(x) be the second derivative of x*5/20 - 3x*2 + 7x. What is the derivative of k(h) wrt h? 3h2 What is the second derivative of q5 + 7q - 7q5 - 4q - 17q wrt q? -120q*3 Let y(m) = -39m*2 + 45m. Let d(k) = 11k2 - 13k. Let s(u) = 18d(u) + 5y(u). Find the second derivative of s(r) wrt r. 6 Let j(g) = -g*2 + 4g + 4. Let s be j(4). What is the second derivative of -sv - v + 2v5 - v5 + 3v5 wrt v? 80v3 Let v(l) = l3 - l*2 + l - 1. Let p(f) = -4f*3 - 3f*2 + 3f + 3. Let s(a) = -p(a) + 3v(a). What is the first derivative of s(k) wrt k? 21k2 Let x(z) be the third derivative of -z9/252 + z*5/30 - 6z*2. What is the third derivative of x(y) wrt y? -240y*3 Find the first derivative of -11y + 6 + 2 - 29y wrt y. -40 Let y(a) = -5a + 6. Let r(i) = -4i + 6. Let n(m) = -3r(m) + 4y(m). Differentiate n(h) wrt h. -8 Let d(x) be the third derivative of -4x*7/105 + 3x*4/8 - 15x*2. What is the second derivative of d(p) wrt p? -96p2 Let d(o) = -o2 + 2 - 5 + 13o2 - 1. Let b(a) = 11a*2 - 5. Let q(w) = 5b(w) - 4d(w). Differentiate q(k) with respect to k. 14k Let t(q) = -18q3 + 5q. Let y(n) = -9n3 + 3n. Let a(x) = -4t(x) + 9y(x). What is the second derivative of a(b) wrt b? -54b Let t(g) be the second derivative of g4/6 + 5g*3/6 + 4g. What is the second derivative of t(h) wrt h? 4 Let k = 5 + -3. Find the third derivative of 2y6 - 4y6 + yk + 0y2 + y6 wrt y. -120y3 Let q be -7 + -2 + 0 + 1. Let v = q - 1. Let x(j) = j2. Let m(b) = b*5 - 4b*2. Let a(g) = vx(g) - 2m(g). Find the third derivative of a(r) wrt r. -120r*2 Let w(m) be the second derivative of -5m*7/42 + 17m*3/6 - 36m. What is the second derivative of w(b) wrt b? -100b3 Let f(p) = 5p + 5. Let w be (2/3)/((-6)/(-153)). Let r(l) = -wl - 3 + 6 - 19 + l. Let h(k) = -7f(k) - 2r(k). Find the first derivative of h(d) wrt d. -3 Let k be (-325)/(-117) + 2/9. Let c(b) be the third derivative of -1/3b*k - 1/24b*4 + 0b - b2 + 0. Differentiate c(y) wrt y. -1 Let x(p) = p2 - 3. Let w be x(-3). Suppose 3h - h + w = 3g, -5h = -5g + 15. What is the third derivative of 0o5 + 2o*5 + go*2 + 2o*2 wrt o? 120o*2 Suppose -3f + 16 = k, 0f - 8 = 3k - 5f. Find the second derivative of 4r - 4rk + 2r*4 - 2r4 + r4 wrt r. -36r2 Let z(w) = 39w*3 + 6w*2 - 39. Let g(y) = -118y*3 - 17y*2 + 117. Let k(f) = 6g(f) + 17z(f). What is the derivative of k(i) wrt i? -135i*2 Let a(k) be the third derivative of 0k + 0k6 + 7k*2 + 0 + 0k*4 - 1/30k*7 + 1/60k*5 + 0k*3. Find the third derivative of a(v) wrt v. -168v Let q(k) = -2k3 + k2 - k - 1. Let p be 2/63/(-1). Let j be q(p). Find the third derivative of -x*2 + 3x4 - x4 + 2x2 - jx*4 wrt x. -24x Let r = 7 + -7. Suppose 2 = x - r. Find the second derivative of -xp + 0p - 4p5 + 6p*5 - 2p wrt p. 40p3 Let h(t) = 2t*3 - 5t - 1. Let f(g) = -2 + 3g3 + 1 + 3g - 7g. Let l(q) = -5f(q) + 4h(q). Find the first derivative of l(p) wrt p. -21p**2 Find the f	{ "pile_set_name": "DM Mathematics" }
- -957. Let q = 565 + r. Suppose 4s + 41 = 3v - 0v, -4v = -2s - 48. What is the remainder when q is divided by v? 4 Let v(c) = c3 + 9c*2 + 29c + 117. What is the remainder when 251 is divided by v(-7)? 11 Suppose 38h - 68h + 540 = 0. Calculate the remainder when 462/4(4 + 60/(-18)) is divided by h. 5 Let c(l) = 2l*2 + 52l - 499. What is the remainder when 110 is divided by c(-34)? 20 Let x = -4120 - -4130. What is the remainder when 241 is divided by x? 1 Suppose 861i - 21652 + 1352 = 811i. What is the remainder when i is divided by 86? 62 Let x = -45 - -150. Let v = x + -100. Suppose vf = 2f + 342. What is the remainder when f is divided by 30? 24 Let s = 30112 + -29788. Let a(d) = -d*3 - 4d*2 - d - 5. Calculate the remainder when s is divided by a(-5). 24 Let u = 5570 + -5323. Calculate the remainder when u is divided by 145. 102 Let l be (-10)/501 - 1/(-5). Suppose 6a - 181 + 49 = l. Calculate the remainder when 263 is divided by a. 21 Let b = 81 - 78. Suppose bs - 9 = -3. Suppose -m + sn + 37 = 0, -3m + 15 + 131 = n. What is the remainder when 187 is divided by m? 46 Let c = -3064 - -3087. What is the remainder when 24 is divided by c? 1 Let c(s) = s*3 + 14s*2 + 28s + 44. Let q be c(-12). Calculate the remainder when 10 is divided by ((-7)/(196/(-48)))/(q/(-14)). 4 Let n(a) = -a3 - a2 - 1. Let h(q) = -14q3 + 5q*2 - 7q - 5. Let m(z) = -h(z) + n(z). Calculate the remainder when m(2) is divided by 51. 47 Let u = 30103 + -29738. Calculate the remainder when 4756 is divided by u. 11 Suppose 0 = -40r + 45303 - 16983. Let d = 732 - r. Calculate the remainder when d is divided by 13. 11 Let s = -663 - -1169. What is the remainder when s is divided by 20? 6 Let a be (-50)/525 - 8213/(-21). Suppose -9d = -26d + a. What is the remainder when (182/8)/(1/4) is divided by d? 22 Suppose -3n = 3d - 393, 698 = 3d + 2n + 296. What is the remainder when 1538 is divided by d? 138 Suppose 2w = -2d + 42, 0 = w + d - 5d - 11. Suppose -110p + 390p = 26040. What is the remainder when p is divided by w? 17 Let q(j) = 42j2 + 10j + 10. Let i = -241 - -240. What is the remainder when 3/1-1-27 is divided by q(i)? 39 Suppose -z + 311 = -2h, 2h + 737 - 117 = 2z. Suppose 10b - z = -199. Calculate the remainder when 175 is divided by b. 10 Suppose -4v + 148 = -2j, -4j - 1 + 29 = v. Calculate the remainder when 891 is divided by v. 27 Calculate the remainder when 610 is divided by 767/28 + (-8 - -15). 12 Calculate the remainder when 86 is divided by (-5)/(10/(-27))(-1780)/(-801). 26 Suppose 13u = 11u + 6. Let a be u - 3/((-9)/21). Suppose 2j + 5x = 20, -4j + 5x - a = -80. What is the remainder when j is divided by 7? 1 Suppose 199t = -311t - 21279 + 1930719. Calculate the remainder when t is divided by 311. 12 What is the remainder when (-14995 + 1)/(-21) - ((-1 - 1) + -1) is divided by 45? 42 Suppose 24 = 23f - 2184. Let w(s) = -11s - 14. What is the remainder when f is divided by w(-4)? 6 Let v(j) = j3 - 2j*2 - 1. Let m be v(1). Let h be -5 + 8 - (-3 - m). Suppose -hx - 3x + 147 = 0. What is the remainder when 39 is divided by x? 18 Let b(x) = 4x*2 + 7x*2 + 4x*2 - 17x + 780 - 788 + x*3. Suppose -2d = -13 - 63. Calculate the remainder when d is divided by b(-16). 6 Let k = 394 + -275. Suppose 7l - 1239 = -0. Let n = l + -167. What is the remainder when k is divided by n? 9 Suppose 0 = p + 8p - 36. Let k be (1 - p)/((-6)/(-36)). Let c = k - -22. What is the remainder when 7 is divided by c? 3 Let g = -6337 - -6439. What is the remainder when g is divided by 2 + (2/2 - -32)? 32 Let m = 32141 - 31855. Calculate the remainder when m is divided by 13. 0 Let p be ((-88)/(-66))/(4/9). Suppose 2s = 4s - 2, pg = 5s + 139. Calculate the remainder when g is divided by (-3 + 21/6)/(2/28). 6 Let s = 8829 - 8800. Suppose 5h + 2y - 93 = 0, -2h - 2h - 5y + 88 = 0. What is the remainder when s is divided by h? 12 Let g(r) = 36r - 1070. What is the remainder when 533 is divided by g(33)? 61 Suppose 2r - 1334 = -5o, 0 = -3o - 2r + 368 + 434. Suppose 26y - o = 7y. Calculate the remainder when 81 is divided by y. 11 Calculate the remainder when (1118/(-91))/((-14)/49) is divided by 11. 10 Let y = 7250 + -6842. Calculate the remainder when y is divided by 5. 3 Let y = 34413 - 34389. What is the remainder when 2879 is divided by y? 23 Let w(u) = 8u2 + 146u - 145. Let r be (-4)/6 - 2/(-3). Let m = 16 - r. What is the remainder when m is divided by w(1)? 7 Calculate the remainder when (6/(-4))/(3/(-2010)) is divided by ((-1)/(-3))/(55/2310). 11 Suppose 0 = -2p + 3k + 2393, 108p - 109p = 4k - 1202. What is the remainder when p is divided by 6? 4 Suppose -302 = -4i + 34. Suppose -13u + i = -280. Calculate the remainder when 108 is divided by u. 24 Calculate the remainder when 282 is divided by 15(-15 - 1566/(-90)). 30 Let g = 8998 + -8762. Calculate the remainder when 480 is divided by g. 8 Suppose 592 = 11l - 9000. Calculate the remainder when l is divided by 46. 44 Suppose -2j - 8 = -v, 3v + 5j + 146 = 203. Calculate the remainder when 554 is divided by v. 8 Let p = -3 + 7. Let t(g) = -g*2 + 2g + 46. Suppose -4u + u = -2q - 31, 5q + 25 = 0. Calculate the remainder when t(u) is divided by p. 3 Suppose 2l + 63 = 97. Suppose -2v - 2745 = -lv. What is the remainder when v is divided by 31? 28 Let u(l) = -9l + 232. Let p = 12 + 18. What is the remainder when p is divided by u(23)? 5 Suppose 2k - 14299 = 5a, -a - 5018 = -5011. Calculate the remainder when k is divided by 39. 34 Let n(a) = a3 + 4a*2 - 6a + 63. What is the remainder when 797 is divided by n(-6)? 14 Suppose -4308 + 180 = -86d. What is the remainder when 104 is divided by d? 8 Suppose -g - 4b + 11 = 1, -2g + b + 38 = 0. Suppose 15v + 8527 = 10132. What is the remainder when v is divided by g? 17 Suppose 0 = -m - 5n + 5, 0 = 2m + 2n - 92 + 58. Let i(o) = -3o + 2. Calculate the remainder when m is divided by i(-3). 9 Suppose 231h - 178h = 371. Suppose -y = 4a - 7, -5y + 80 = 2a + 3a. Calculate the remainder when y is divided by h. 5 Let u(j) = 50j + 4228. What is the remainder when u(-79) is divided by 130? 18 Suppose -5229 = -207u + 360. What is the remainder when 111 is divided by u? 3 Suppose 2z - 4k + 1 = 9, -z - 5k - 10 = 0. Suppose z = -0d - 6d - 288. Calculate the remainder when 178 is divided by d/1(-15)/20. 34 Let i = -5027 + 5049. Calculate the remainder when 62 is divided by i. 18 Suppose -5k = 5i - 100, -3i - i + 16 = 0. Let w be 4/14-47/(-4). Suppose v + 2c + w - 9 = 0, -v = 4c - 7. What is the remainder when k is divided by v? 2 Suppose -273a + 272a = -23. Let c(m) be the third derivative of m5/20 - m4/12 - 7m*3/6 + 3m*2. What is the remainder when c(6) is divided by a? 20 Let x(n) = 6n*2 + 19n - 12. Let j be -1 + (-3 + 7)3/(-6). Let y be 5/(45/21)j. Calculate the remainder when x(y) is divided by 25. 24 Suppose 977 + 2061 - 498 = 20w. Calculate the remainder when 249 is divided by w. 122 Suppose 63x - 66x = -5m + 8, 4m - 37 = -x. Suppose 0c + 24 = 4c. Calculate the remainder when 4/c + 147/9 is divided by x. 8 Suppose -2p = 8, 1239 - 95 = 4g - 2p. Suppose 0 + 4 = 2i. Suppose -6f = -if - g. What is the remainder when f is divided by 18? 17 Let s = -422 + 354. What is the remainder when (s + 37)1-1 is divided by 4? 3 Suppose 0 = -7n + 2n + 50. Let c(f) = -10f - 44. Calculate the remainder when (4 + n/(-4))(-1 + 87) is divided by c(-7). 25 Let o be 2/546 - (-6)/(-27). Let a(i) = -14i + 14. Calculate the remainder when 167 is divided by a(o). 13 Let t(z) = 3z*2 - 11z + 34. Let n(q) = -42q - 75. Let f be n(-2). What is the remainder when t(f) is divided by 9? 7 Let p = 360 + -360. Calculate the remainder when (2/8)/((-5)/(-820) + p) is divided by 11. 8 Suppose z + 0z + 25 = d, -d + 4z = -31. Suppose 5c = 180 + 265. Suppose j + 2h - c = 0, 2j = 2h + 70 + 102. What is the remainder when j is divided by d? 18 Suppose b - 546 + 82 = -3w, 2w - 305 = -5b. Suppose -p + w = 2z, 0p + 2z - 481 = -3p. Calculate the remainder when p is divided by 21. 16 Suppose 6 = 10*i + 16. Let t = -236 - -245. Calculate the remaind	{ "pile_set_name": "DM Mathematics" }
4 = 0 for f. -4, -1 Let d = -470521/20 + 94169/4. Factor -18/5f + d + 1/5f2. (f - 9)2/5 Let l(q) = 2q2 - 2059q + 4115. Let x be l(2). Factor 4/7ax - 4/7a*3 + 0 - 4/7a*4 + 4/7a*2 + 0a. 4a2(a - 1)*2(a + 1)/7 Let v be 2213/3 + 76/57. Let 63 - 741c + 21 - 2c*2 + vc = 0. What is c? -7, 6 Let t be (2/9)/(2220/1332). Suppose -2/3u3 - tu*2 + 2/3u + 0 + 2/15u4 = 0. Calculate u. -1, 0, 1, 5 Factor -50q*2 - 124q - 325666q3 + 17 + 508 + 325668q*3 - 93. 2(q - 27)(q - 2)(q + 4) Let q be ((-2)/6)/(1/(-6)). Factor -4 - 2y3 + 7 + qy + 0 - 10y2 + 7. -2(y - 1)(y + 1)(y + 5) Let i = -15 + 20. Suppose 5o = -2m + m - i, -3o + 9 = 3m. Factor -5x4 - 3x*5 + 5x*m - 3x5. -x4(x + 5) Let i be ((-65)/(-117))/((-25)/(-70)). Let f(y) be the second derivative of -y4 + 4/3y*2 - 15y + 0 + iy3. Factor f(n). -4(n - 1)(9n + 2)/3 Let c(w) be the first derivative of 3w5/20 + 99w*4/4 + 2111w*3/2 - 6633w*2/2 + 13467w/4 - 1228. Solve c(q) = 0 for q. -67, 1 Let l(g) be the second derivative of g*5/35 + 2g*4/21 - 2g*3/21 - 4g*2/7 - 3g - 153. Find s, given that l(s) = 0. -2, -1, 1 Let m(q) be the first derivative of 0q4 - 1/45q5 + q3 - 1/540q6 + 9 + 0q*2 + 0q. Let p(h) be the third derivative of m(h). Factor p(n). -2n(n + 4)/3 Suppose -5j + 9 + 5 = 4q, 4j + q = 9. Let v be (-2)/2 + (-153)/36-2. What is a in -vaj - 25/2a - 5/6a3 + 125/6 = 0? -5, 1 Let i(z) be the third derivative of z5/480 + 11z*4/64 - 1370z*2. Find d, given that i(d) = 0. -33, 0 Factor -8533x*2 + 14x*5 + 4220x*2 - 304x*3 - 1060x*4 + 4313x*2. 2x*3(x - 76)(7x + 2) Let b(d) be the first derivative of d*3/6 + 332d*2 + 220448d - 2456. Factor b(c). (c + 664)*2/2 Let v = -63 - -127. Suppose vw - 10w + 175w*2 + 18w + 20 + 48w - 45w*4 - 30w*3 = 0. Calculate w. -2, -1/3, 2 Suppose 13j + 2q - 56 = 10j, -5q = 3j - 59. Let f(d) = -d*3 + 20d*2 - 39d + 56. Let w be f(j). Factor 2/3pw + 8/3p + 2. 2(p + 1)(p + 3)/3 Let v = 1252 + -1261. Let h be (v - (-6 - 2))0. Factor 0 + hs*2 - 3/5s*3 + 0s. -3s3/5 Let b(t) be the second derivative of -t5/30 + 19t*4/54 + 38t*3/27 + 16t*2/9 + 967t - 1. Solve b(u) = 0 for u. -1, -2/3, 8 Let h(u) = -28u4 + 80u*3 - 326u*2 + 358u + 2. Let c(q) = -152q4 + 400q*3 - 1631q*2 + 1789q + 11. Let n(g) = -2c(g) + 11h(g). Factor n(j). -4j(j - 15)(j - 3)(j - 2) Let p(m) be the first derivative of -8m6/3 + 132m*5/5 + 125m*4 - 32m*3 - 440m*2 - 8787. Suppose p(j) = 0. Calculate j. -2, 0, 5/4, 11 Let l(d) be the second derivative of -2d*6/15 - 3d5/5 + d4 + 14d3/3 - 12d*2 + d + 99. Factor l(g). -4(g - 1)*2(g + 2)(g + 3) Factor 2458/3 + 2462/3x*2 - 2/3x*3 - 4918/3x. -2(x - 1229)(x - 1)*2/3 Let p(z) = 12z*2 + 174z - 342. Let k(w) = 5w2 + 88w - 172. Let x(y) = 9k(y) - 4p(y). Factor x(f). -3(f - 30)(f - 2) Let q(j) be the first derivative of 28j2 - 196j*3 - 4802/5j*5 + 686j*4 - 2j - 12. Suppose q(n) = 0. What is n? 1/7 Let m(n) be the first derivative of -145 + 16n - 1/4n*4 - 2n*2 + 1/5n*5 - 4n*3. Find l such that m(l) = 0. -2, 1, 4 Let s(o) = -16o*3 - 102o*2 - 36o. Let k be s(-6). Suppose k + 60w3 + 25/4w*5 - 20w + 35w4 + 20w*2 = 0. Calculate w. -2, 0, 2/5 Factor 74/11f*2 + 1350/11 - 590/11f - 2/11f3. -2(f - 27)(f - 5)2/11 Let i(l) be the third derivative of -l6/24 + 17l*5/12 - 20l*4 + 150l*3 + 223l*2 + 3l. Determine s, given that i(s) = 0. 5, 6 Let q = 96 + -56. Suppose -qo + 44o = 0. Let -2/9u2 - 2/3u*3 - 2/3u*4 - 2/9u*5 + 0 + ou = 0. Calculate u. -1, 0 Let d(k) be the third derivative of -1/24k6 - 15/4k*5 + 0k - 209k2 + 0 - 5625/2k*3 - 1125/8k*4. Solve d(u) = 0. -15 Let q be -2 + 6 - (5 - 4). Suppose 4i*q - 499 + 148i*2 + 1019i - 265i + 538i - 945 = 0. Calculate i. -19, 1 Let n be (-33)/(-143) - (-1127)/299. Let b(i) be the third derivative of -1/7in - 43i*2 + 0i + 0 - 1/70i6 + 0i*3 + 9/70i*5. Factor b(v). -6v(v - 4)(2v - 1)/7 Let d be (((-2024)/(-54648))/((-5)/(-9)))/(2/12). Determine p so that 8/5 + 2p + dp2 = 0. -4, -1 Let y be (42/(-7))/(-3) + (1 - -12). Factor 8u*2 - 4u*2 + 1 + y - 16u + 0u2. 4(u - 2)*2 Suppose -454 = -3v - 4t + 524, 981 = 3v + 3t. Let r = v + -330. Factor -2/17u - 2/17u2 + r. -2u(u + 1)/17 Let n = -4831/110 - -504/11. Let c(l) be the first derivative of -nl*2 - 3/5l - 11/5l3 - 9/20l*4 - 11. Factor c(q). -(q + 3)(3q + 1)2/5 Let p(c) = c3 + 12c*2 + 11c + 10. Let g be p(-11). Suppose z = g - 4. Factor 7v3 - 4v*4 + 15v - 14v + 2v*3 - zv*2. -v(v - 1)*2(4v - 1) Let y be 1 - (2 + -2 + -1). Let a = 2702 - 2702. Factor -533g*2 + 9g - 9g3 + 6 + ag*4 - yg*4 + 530g2 - g4. -3(g - 1)(g + 1)*2(g + 2) Let s be (-1522)/(-24) - 65/(-260). Let f = s - 560/9. Factor -fg2 - 11/9g - 2/9 - 4/9g3. -(g + 1)(g + 2)(4g + 1)/9 Let x be (-36186)/102527 + 6/17. Determine y so that -2y4 + 0y - 16/3y5 + 0y*3 + 0 + xy*2 = 0. -3/8, 0 Factor 8b*2 - 214/5b + 176/5 - 2/5b3. -2(b - 11)(b - 8)(b - 1)/5 Let a be (2/(0 - 6))/((-6)/126). Determine k, given that 15644k + a - 15640k - 8k2 - 4k*3 + 1 = 0. -2, -1, 1 Let s = -4 - -19. Let w = -12 + s. Find t, given that 23t*2 - 4t*w + 9t*3 - 58t*2 + 25t*2 + 10 - 5t = 0. -1, 1, 2 Find c such that -c*3 + 97/8c*2 - 1/8c*4 + 117/2 + 113/2c = 0. -13, -2, 9 Let h be (-80)/(-24) + (4/(-6))/(-1). Let b = -46 + 48. Solve 3s4 - 4s*3 + 6s + 3sh + 70s*2 - 6 - 74s*2 - bs*5 + 4 = 0. -1, 1 Let a(z) be the third derivative of -2z*7/105 + 437z*6/30 - 9592z*5/3 + 23762z4/3 + z2 + 482. Find i, given that a(i) = 0. 0, 1, 218 Let b(m) be the third derivative of -m*8/56 + 5m*7/14 - 47m*6/20 + 77m*5/20 + 63m*4/4 - 36m*3 - 5m*2 - 2m - 1. What is h in b(h) = 0? -1, 1/2, 3, 4, 6 Let s(y) be the third derivative of -3y4 + 95y*2 - 72y*3 + 0 - 1/20y*5 + 0y. Suppose s(w) = 0. What is w? -12 Let c(u) = 101u + 4145. Let g be c(-41). Let v(p) be the second derivative of 0p*2 + 0 + 1/50p*6 - 12p - 1/20pg + 0p*3 + 0p*5. Factor v(b). 3b*2(b - 1)(b + 1)/5 Let u be (88/(-24) + (0 - -4))15. Suppose -2s + 7s = -3b + 13, 0 = -ub + 5. Factor 2/7os + 8/7o + 8/7. 2(o + 2)2/7 Factor 220y - 8177y3 + 5y*4 + 8172y*3 - 4y*4 - 224 - 48y*2. (y - 8)(y - 2)*2(y + 7) Suppose -4j = -3d - 24, -3j + 5d = 22 - 51. Solve -22/9h5 - 32/9h*j + 0h + 62/9h4 - 8/9h*2 + 0 = 0 for h. -2/11, 0, 1, 2 Suppose 216r - 1816 = -1168. Factor 1/6c4 - 5/6 + cr + 2/3c*2 - c. (c - 1)(c + 1)*2(c + 5)/6 Suppose 0 = -886f + 809f + 154. Find l such that 3/5 - 33/5l - 15l*3 + 21l*f = 0. 1/5, 1 Let -27225/4 - 1/4u*2 - 165/2u = 0. Calculate u. -165 Let h be -2((-310)/(-20) + -18). Let z(u) be the first derivative of -84/5u*h + 291/4u*4 - 111/2u*2 - 26u*3 - 18u - 34. Suppose z(x) = 0. What is x? -2/7, -1/4, 1, 3 Factor 15/2 - 1/8c3 + 67/8c + 3/4c2. -(c - 12)(c + 1)(c + 5)/8 Let t = -2/26859 + 53728/134295. Factor 0 - tw*2 - 22/5w. -2w(w + 11)/5 Let k(r) = -4r - 34. Let a be k(-9). Let 20s - 24s3 - 244sa - s3 + 239s2 = 0. What is s? -1, 0, 4/5 Let u(g) be the second derivative of 2 + 0g*4 - 1/4g*5 + 4g + 2/3g3 + 0g*2 + 0g*6 + 1/42g*7. What is p in u(p) = 0? -2, -1, 0, 1, 2 Solve -96 + 86/3f*3 - 386/3f*2 - 2/3f*5 + 2/3f*4 + 196f = 0 for f. -8, 1, 2, 3 Factor 119b2 + 122b*2 + 120b*2 - 476b*2 - 113b + 116b2. b(b - 113) Determine s so that -5749s2 - s5 + 7s*4 - 2s*5 + 5734s*2 + 7s*3 + 4s*5 = 0. -5, -3, 0, 1 Suppose 0v = 2v - 46. Suppose 5c + 13 = -2, -4f - 3c = -v. Factor 15r2 - 13r + 5 - fr2 + 2r*3 - r. (r - 1)(r + 5)(2r - 1) Let o(s) = 14s3 - 113s*2 - 105s - 44. Let p(v) = 5v3 - 38v*2 - 35v - 16. Let c(z) = 4o(z) - 11p(z). Solve c(i) = 0. -1, 0, 35 Let b(w) be the first derivative of w*3/6 + 879w*2/2 + 772641w/2 - 2334. Factor b(o). (o + 879)2/2 Let q(f) be the second derivative of f4/12 + 200f3/3 + 20000f*2 + 1670f. Factor q(	{ "pile_set_name": "DM Mathematics" }
be z(-6). Let u be 0(-3)/h - (-29463 - 1). Suppose 2r - u = -6r. Is r a composite number? True Suppose 14614 + 8734 = 4z. Suppose -2l - 1899 = -z. Is l composite? True Let g(t) = 2t*3 + 17t*2 + 10t + 20. Let l be g(-8). Suppose 2v - lc + 28 = 12, 2v + c = -1. Is v/(4/(-282))(-188)/(-12) a prime number? False Suppose 19b - 8b = 61248. Suppose -2f = -5i - b, 5f - f - 11152 = 2i. Is f a prime number? True Let i = 13875 - -8690. Is (-100)/275 + i/11 prime? False Let a = -6179 + 10497. Let c = a + -2936. Is c a composite number? True Let r = -8 + 9. Let w(u) = -2u - 7 + 3 + r + 55u. Is w(10) composite? True Let d(h) be the third derivative of 31/6h3 - 25/8h*4 - 5h*2 + 0 + 0h. Is d(-10) a prime number? False Is 18061988/280 + (-3)/30 a prime number? False Suppose 25y = 26y - 556. Let c = y + -87. Is c a prime number? False Let t = 294 + 1507. Is t a composite number? False Let p(j) = -j*3 - 22j*2 + 25j + 49. Let s be p(-23). Suppose -4q + 4 = -sq. Is ((-3694)/q)/(3 - (-57)/(-18)) prime? False Suppose -14 = -2x - 5x. Let u be -3 + -414/(-8). Suppose -uh = xi - 174, 0 = -5i - 4h - 18 + 459. Is i composite? False Let k(p) = p + 9. Let b be k(-4). Suppose -g + b + 0 = 0. Suppose 3319 = 5i - 3f - 4957, -2f + 8291 = gi. Is i a prime number? True Let p(k) = -6688k + 1009. Is p(-5) a prime number? False Suppose 0 = -66u + 19635413 + 22713289. Is u composite? True Is 6/(288/7530132) + 5/20 composite? True Let h(d) = 47d + 22. Is h(17) prime? True Suppose -4s = -i - 516746, -313i - 129193 = -s - 316i. Is s a composite number? False Let y = -913 + 957. Suppose -yk = -37k - 82901. Is k composite? True Let g = -31 + 9. Let q(j) = -427j - 167. Is q(g) a prime number? True Let x(p) = -1253p - 303. Is x(-14) composite? False Is ((0 + -11)1)/((-241)/15927449) a composite number? True Let v(z) = 22z2 + 18z + 26. Let q be v(15). Suppose -4n - 3u + 10448 = 0, -2n + 4u = -0u - q. Let b = n + -1302. Is b prime? False Suppose -3y = 3, -3i - 4y + 1565291 = 7806. Is i a prime number? False Let p(g) = 33984g + 1101. Is p(10) a composite number? True Suppose i = 3j - 3i - 12038, 4i - 11998 = -3j. Suppose 23h = 25h - j. Is h prime? True Let o = -21 + 39. Suppose -2h + 4w + 118 = 0, -2h - o = w - 156. Let u = -9 + h. Is u a prime number? False Suppose -3653403 + 5055588 = 200h - 9303215. Is h a prime number? True Suppose -4y + 322927 = 3u, -34u + 30u = 28. Is y a composite number? False Is 20846 - (-2 - (13 - 7)) a prime number? False Suppose 0 = -6c + 31286 - 11930. Suppose -6440 = -2n + 2d, 0 = 5n - 4n - 3d - c. Is n a composite number? False Suppose 0 = 10s - 13s - 3o + 3, -4s + 2o + 34 = 0. Is (-14)/s + 2 + 27284/6 a prime number? True Let t(j) = -410j + 203. Is t(-10) prime? False Let o = -5000 + 8644. Let q = o + 1077. Is q a prime number? True Let w(a) = 148a*2 + 2a - 1. Suppose -2c - 13c + 15 = 0. Is w(c) a prime number? True Suppose -39d = -37d - 262. Let z = d - 128. Suppose 0 = 8o - zo + n - 2710, -3n - 1101 = -2o. Is o prime? False Suppose 4t + 4c - 1787392 = 0, -4t + 28c - 29c = -1787401. Is t prime? False Let m = -1938 + 3277. Is m prime? False Suppose -8p - 2956 = -18844. Suppose -53d + 47d = -p. Is d composite? False Let f = -93 + -208. Let j = 58 - f. Is j composite? False Let f be (-1)/(-4) - (-39)/(-24)-6. Suppose 70865 = -5z + fz. Is z a composite number? False Let z be 12/8(-10)/(-3). Suppose 9946 = -2x - 0x - s, -4951 = x - zs. Let u = -2534 - x. Is u composite? False Is 29/261 + (-2812784)/(-36) composite? True Let c = -680 - -703. Is 25916/1 + (20 - c) a composite number? False Suppose -y + 1222025 = 2u, 12y + 2444029 = 4u + 7y. Is u composite? False Suppose 2i - 4x - 11879 = x, 4i - 3x = 23737. Suppose -454u + i = -452u. Is u a prime number? False Let m(g) = -62983g - 513. Is m(-2) a prime number? True Let o(r) = -2r2 + 13r + 8. Let j be o(7). Let n(b) = 605b2 + 8b + 1. Is n(j) a prime number? False Suppose 2k - 14 = -f, -3k = f + 2k - 29. Let u be 4011/14f/6. Let g = u + -102. Is g a composite number? False Suppose 0 = 5s - 2v - 9296, 3v = -2s + 4804 - 1078. Let w = -869 + s. Is w a composite number? False Let d be 5 + -1 + -1 - 23-1. Let j(n) = n3 - 22n*2 - 20n + 65. Is j(d) composite? True Suppose 2j - 4j + 2z = 210, j - 5z = -105. Let w = j + 1192. Is w composite? False Suppose 2h + 3t - 177007 = 0, 2h - 118623 = 6t + 58321. Is h a composite number? False Let m = 186156 - 106373. Is m composite? True Suppose -235q + 2329744 = -219q. Is q a composite number? True Let d(j) = -j*3 + 9j*2 - 9j + 11. Let l be d(8). Suppose 13k = 16k - 9, -lz - 4k = -8343. Is z a prime number? True Let r = 198 + -170. Is (r/(-8) - -4)29182 a composite number? False Suppose -3r + 2199413 - 223059 = l, -l = 2r - 1317571. Is r prime? True Is (-188524186)/(-638) + 18/33 composite? True Let s be 4/(-22) - 100/55. Let q be 12/4 + 4/s. Is q/6 + 15999/18 prime? False Suppose -d = -3y + 11, -2y = d + 4d - 13. Suppose -16 = yb + 6s - 2s, -4b - 3s = 15. Is ((-235)/(-4) + b)/(2/8) a prime number? True Suppose 33 = k - 28. Let w = k - 56. Suppose -ws + 4s + 3207 = 0. Is s a composite number? True Is 2/(-6) + (-109071184)/(-408) a composite number? True Suppose 4h - 2j - 10 = 0, 0 = 4h + 2j - 5j - 9. Suppose -2v + hv - 139 = 0. Is v a composite number? False Suppose 0o + 5o + 125 = -5t, t - o = -19. Let l be 4/t + (-80)/44. Is (-3 - 0) + 6 + l + 2568 a composite number? True Let t(n) = 29n + 18. Suppose 3s - 60 = -s. Let a be t(s). Let j = 1516 + a. Is j prime? False Suppose 3o - 341902 = -3r - 114481, -3r + 227417 = o. Is r composite? True Suppose -5t - 5 = -0t, -84 = -3q + 3t. Suppose 0 = -qz - 5z + 30944. Is z a composite number? False Let p = 15110 + -8878. Suppose 3l = -l + p. Suppose -a = -9r + 6r - l, 3a - 4666 = r. Is a a composite number? True Let q = 13 - -24. Let b = q + -42. Is (-382)/(b/((-100)/(-48)) - -2) prime? False Let u(t) = 26t3 + 6t*2 + 7. Let b(h) = 25h*3 + 5h*2 + 6. Let r(x) = 6b(x) - 5u(x). Let m be (-4)/(-3)(0 - 18/(-12)). Is r(m) a composite number? True Let c(j) = 2j2 + 16j + 31. Let x(i) = -5i - 29. Let w be x(-6). Let p(o) = -o + 1. Let f(n) = wc(n) + 6p(n). Is f(-17) a prime number? False Is (-88798)/((3 - 2) + 7 + -10) a composite number? True Suppose -11779 = 5c + 2t, 0c + c + 2351 = 2t. Is (7 - 5)/(c/2361 + 1) a composite number? False Let d(r) = 126r - 226. Let v be d(-6). Let i = 1571 + v. Is i a prime number? False Let a(r) = 1. Let c(l) = -8l + 16. Let j(t) = 8a(t) + c(t). Let b be j(10). Is (-6636)/b4/6 prime? True Suppose 7b = -5k + 10b + 252, -5b = 20. Is (-3947373)/(-297) - (2 - k/22) prime? True Let m = 5 - 1. Suppose 2j + 3y = mj - 19, 8 = -j - 2y. Suppose -jb + c = -14125, b + 3c = 3093 + 3973. Is b a composite number? True Let s(t) = t - 2. Let w be s(4). Let q be (-2)/5 - 45546/(-15). Suppose -1022 = wn - q. Is n composite? True Let v(w) = 13409w2 - 189w - 577. Is v(-3) a prime number? True Is (-13 + 64/4)(-23794)/(-6) a prime number? True Suppose -103715 + 2300 = -15z. Is z a prime number? True Let c be (32624/(-96))/(3/(-18)). Suppose -15y - 10195 = -5v - 11y, -v = -3y - c. Is v a prime number? True Let k(t) = -403t + 22. Let x be k(-3). Let g = -164 + x. Is g prime? False Suppose 1494g = 1499g - 293285. Is g a prime number? True Let z = -58 + 51. Let w(f) = -f3 - 8f*2 - 8f - 7. Let r be w(z). Suppose -12i + 6i + 3534 = r. Is i prime? False Is (462/56 - 9) + -2(-1182236)/32 prime? False Suppose 2a + k - 283938 = 0, -5k = -6a + 4a + 283962. Is a a prime number? True Suppose -2x + x - 6 = 0. Let k(w) = -w*3 - 8w*2 - 14w - 13. Let l be k(x). Is 1733 - (-1)/l0/(-7) a prime number? True Let d = 185 - 363. Let m be (-129)/(4 + 0 + -4 + -1). Let h = m - d. Is h prime? True Suppose -76k + 81 = -85k. Is (-18)/(-4)6/k - -1904 a composite number? False Suppose 6j + 2t - 18 = 2j, -5t = -2j - 9. Suppose 5o + 9 = jv, 0v - 2v + 3o + 5 = 0. Is (v + 7/3)489 a prime number? True Let b = -35 + 40. Suppose bx = 6x. Suppose 3l = -0l - 4q + 1074, -3*q = x. Is	{ "pile_set_name": "DM Mathematics" }
g(x) = 68x2. Let f be g(y). What is f rounded to the nearest 100? 1700 Suppose -3v = -2r - 3203, -2v - v - 1597 = r. Round r to the nearest one thousand. -2000 Let g = 0.11 + -0.1099549. Round g to six decimal places. 0.000045 Suppose 0 = -0c + c - 70000. What is c rounded to the nearest one hundred thousand? 100000 Let n = -147.000118 + 147. Round n to five decimal places. -0.00012 Suppose -2w - 2 = 2f + 4, 0 = -4w + f + 13. Suppose 2l = -wl + 8. Let i be (7500/9)/(l/24000). Round i to the nearest one million. 10000000 Let f = 0.145 - -1.99. Let k = -15 - -17.2. Let q = f - k. Round q to 2 dps. -0.07 Let j = 4 + 1. Suppose -7 - 3 = ja. Let q be -2 + 4103 + a + 1. Round q to the nearest one thousand. 4000 Let d = 0.152 - 0.239. Round d to two dps. -0.09 Let n be ((-6)/4)/(9/(-24)). Suppose -2h + 1 = -3p, np - 3h + 2 = -p. Let o be 0 - p - -1 - -30. Round o to the nearest ten. 30 Let m(f) = -1 + 2f - 8 - 3f. Let d be m(-5). Let p be (0 + 92)/(d/(-5000)). Round p to the nearest 10000. 120000 Let i = -4 - -4. Let x = 2 + i. Suppose xo = 5o - 3540000. What is o rounded to the nearest one hundred thousand? 1200000 Let b = 11.201 + -11.2. Round b to 3 decimal places. 0.001 Let r = -199.99999843 + 200. What is r rounded to seven dps? 0.0000016 Suppose -2t - 3p + 268 = 0, 0 = -t - 4p + 26 + 108. Suppose -428 + t = -c - 4j, 1419 = 5c + 3j. Round c to the nearest 10. 280 Let v = -666.99414 + 667. What is v rounded to 3 dps? 0.006 Let h = -2 - -2.2. Let s = h + 0.4. Let o = 0.60038 - s. Round o to 4 decimal places. 0.0004 Let k = 2.29 - 3.122. Let b = k + 0.8. Round b to 2 dps. -0.03 Let r = -56.61 + 57. Round r to 1 decimal place. 0.4 Let i = -31.4 - -27.78. Let l = i - -0.22. Round l to zero dps. -3 Let g = -251.472 - -250. Let u = g - -1.6. Round u to 2 decimal places. 0.13 Suppose -5v + i = -4i - 2765, -5i + 25 = 0. Let b = v - -889. Suppose 5j + b - 3997 = 0. Round j to the nearest 100. 500 Let g(b) = b2 - b - 1. Let m be g(-2). Let a(n) = -4799n*2 - 5n. Let t be a(m). Round t to the nearest one hundred thousand. -100000 Let f = -0.0883 + 0.088299401. Round f to seven dps. -0.0000006 Let m = -36445535.991 - -36418404. Let z = 27143 + m. Let f = z - 11. Round f to two decimal places. 0.01 Let j = 7.5 - -0.5. Let b = j + -7.9888. Round b to three dps. 0.011 Let m = 12 + -12. Suppose m = -4k - 5s - 37599975, k + s - 5348351 = -14748346. Round k to the nearest 1000000. -9000000 Let n be ((-12)/5)/((-10)/25). Suppose -nu + 90356 + 929644 = 0. Round u to the nearest 100000. 200000 Let k = 4.9 - 1.4. Let t = k - -0.5. Let h = t + -3.9998. What is h rounded to four dps? 0.0002 Let y be -6(1 - 5/2). Let w(g) be the third derivative of -3g5/20 + 5g*4/12 + 3g*3/2 - 3g*2. Let r be w(y). What is r rounded to the nearest 100? -600 Suppose 5f = -2h - 316803 - 1851651, 3f + 3h + 1301067 = 0. Let s = -164783 - 138909. Let k = s - f. Round k to the nearest 100000. 100000 Let c = 586 - 411. Let i be (-3)/2 + c/(-2). Round i to the nearest 10. -90 Let f = 0.14 + 0.1. Let z = f + -18.24. Let g = z - -17.9999965. Round g to six decimal places. -0.000004 Let d = 3 + 2. Suppose -dq = -0 + 10. Let f be 1/2 - (-1)/q. What is f rounded to 3 decimal places? 0 Let p = 4833.63 + -6915.52. Let x = -2093 - p. Let b = -11 - x. Round b to 1 dp. 0.1 Let x = 2 - 8. Let p = 5.9 + x. Let f = p - -0.1000008. What is f rounded to seven decimal places? 0.0000008 Let j = 4220325 - 4220293.02593. Let d = -0.97355 + j. Let r = d - 31. What is r rounded to four decimal places? 0.0005 Let o = -2347 + 1347. Round o to the nearest ten thousand. 0 Let q = 0.962 - 0.072. Round q to one dp. 0.9 Suppose k - 56 = -3x, x - 3k - 20 = 12. Let n be x/8(-2598)/(-3). Suppose 2u = -3w - 2917, -4w - 2211 - n = 3u. What is u rounded to the nearest 100? -1500 Let y = 6.1 + -3.8. Let s = y - -15.7. Let b = s + -13.4. What is b rounded to the nearest integer? 5 Let l be ((-12)/(-20) + 15628/(-5))1760. What is l rounded to the nearest one million? -6000000 Let h = 5 + -4.19. Let i = 1.2 - 0.2. Let r = i - h. Round r to 1 decimal place. 0.2 Let w = 0.1325 + -0.1. Let v = -0.04 + w. Round v to three decimal places. -0.008 Let x = -8295.9944 + 8299. Let k = 0.6 + -3.6. Let j = k + x. Round j to three decimal places. 0.006 Let z be (3-8)/((-18)/(-1140)). Let a = -1020 - z. What is a rounded to the nearest 100? 500 Let k = 102 - 102.0000043. Round k to six decimal places. -0.000004 Let t be (-2 + 0)/((-10)/(-2675)). Let w be t/35 - 4/(-14). What is w rounded to the nearest ten? -20 Let a = -55.1 - -59. Let n = a - 4.94. Round n to 1 decimal place. -1 Let g(n) = 16399n*2 + 4n + 5. Let u(q) = -2q - 5. Let v be u(-5). Suppose -10 - 15 = -vy. Let t be g(y). Round t to the nearest one hundred thousand. 400000 Let a = -1 - -0.56. Let t = 0.4 + a. What is t rounded to two dps? -0.04 Let o be (-112554)/(-12)6/1. Suppose -3b + o + 51723 = 0. What is b rounded to the nearest 10000? 40000 Let p(x) = 890x3 - 3x*2 - x + 4. Suppose o = 2f + 6, -3f = 4 + 5. Let t be o - ((-24)/(-3))/2. Let g be p(t). What is g rounded to the nearest 10000? -60000 Let m = -261 + 261.311. What is m rounded to two decimal places? 0.31 Let n = 7.023 - 7.32. What is n rounded to two dps? -0.3 Let o = 266 + -266.0181. What is o rounded to 3 dps? -0.018 Let m be 25292(-1)/5-20. Suppose f + f - m = 0. Let t = -105584 + f. Round t to the nearest 10000. -60000 Let t = -6555673.911 - 1353176.799. Let u = t - -7908813.7100021. Let f = u - -37. Round f to 6 dps. 0.000002 Let i = -2.5 + 2.48. Round i to 1 dp. 0 Let x = 479.99999583 + -480. Round x to seven decimal places. -0.0000042 Let u = 1471193 - 1471122.0049. Let x = u + -71. Round x to three decimal places. -0.005 Suppose 0 = 5o - 3o - 4. Suppose -v + 3g + 3354 = -5v, -3v - 2524 = -og. Round v to the nearest 100. -800 Let y = 30.39 - -0.61. Let d = 1048.36 + -1080. Let g = y + d. What is g rounded to 1 decimal place? -0.6 Let w = 0.6 - 0.5. Let i = w + -10.1. Let c = i - -10.0028. Round c to three decimal places. 0.003 Let b = 25 - 13. Let i = b + 88. Round i to the nearest one thousand. 0 Let s = -0.63 + 13.13. Let m = -5.4 + s. Round m to the nearest integer. 7 Let a = 2.145 + -2.2. What is a rounded to two dps? -0.06 Let c = -10.11 - -0.11. Let g = -10.0000168 - c. What is g rounded to six dps? -0.000017 Let d = -833327036 + 833327125.9999929. Let r = -49 - -139. Let q = d - r. Round q to six decimal places. -0.000007 Let b = -5 - -9. Suppose -bp - 359 = -51. Let f = p + 40. Round f to the nearest 10. -40 Let g(t) = t*2 + 6t + 2. Let k be g(-11). What is k rounded to the nearest ten? 60 Suppose 20 = 4c + c. Let a be (1 - c) + (-3399998 - -1). What is a rounded to the nearest 1000000? -3000000 Suppose 0r - 2r = -4. Suppose 0 = -rh - 79 - 95. Round h to the nearest ten. -90 Let h = -5 - -4.99989. Round h to 4 dps. -0.0001 Let k(v) = 119v + 8. Let q be k(-11). Let b = 51 + q. What is b rounded to the nearest one hundred? -1300 Let g = -6.3 - -7.66. What is g rounded to 1 decimal place? 1.4 Let a = 0.0071767 + -0.0072. Round a to five dps. -0.00002 Let m = 162 + -477. Let i = -181 - m. Let n = 133.9939 - i. Round n to 3 dps. -0.006 Let u = 87 - 87.74. Let p = 0.7400081 + u. Round p to six dps. 0.000008 Let c(z) = 9z + 7z2 - 8 + 0z*2 - 3z + 45z3. Let j be c(6). What is j rounded to the nearest one thousand? 10000 Let p = 0 + 0.2. Let d = p + -0.3. Let x = d + 0.098. Round x to 3 decimal places. -0.002 Let l = 11.08815 + -0.11015. Let a = 11 - l. What is a rounded to 2 dps? 0.02 Let y be (-12)/(-16)(0 - -8). Let c be y/(-2) - (-3386)/2. What is c rounded to the nearest 100? 1700 Suppose t - 37 = 963. What is t rounded to the nearest one hundred? 1000 Let t be (-33282)/14 - (-4)/14. Let x = t + 6383. Suppose -5h - 2o = -4994, -3h + x = h - 2o. Round h to the nearest ten thousand. 0 Suppose 75614 = 2z + 475614. Round z to the nearest 1000000. 0 Let p = -65.6 - -21.9. Let w = 41 + p. What is w rounded to the nearest integer? -3 Suppose -6 = 4r + s - 1, 4r + 15 = -3s. Suppose 4c + rc = 24. Let h be 26875c(-320)/12. Round h to the nearest 1000000. -4000000 Let b = -14.6937 + 14.7. What is b round	{ "pile_set_name": "DM Mathematics" }
2/3 + 154/q. Find the third derivative of -26 + h + 37j2 - 26 + 10j*5 wrt j. 600j*2 Suppose n - 2 = t, -2n - n = -t - 4. Let j(z) = 16z + 0z + 11 + 4. Let i(w) = -w - 1. Let u(h) = tj(h) - 2i(h). Differentiate u(p) with respect to p. -14 Let s(g) be the first derivative of -36g + 2g*2 + 219 - 34/3g*3. What is the first derivative of s(v) wrt v? -68v + 4 Differentiate -11351 - 14u3 - 5u*2 + 22u*2 - 43u + 2u2 + 42u - 967 wrt u. -42u2 + 38u - 1 Suppose -33j = -9j - 768. Suppose -2l - 2l = -20. Find the second derivative of -29n4 + jn*4 + ln - 20n4 wrt n. -204n*2 Let h(w) = 6w*3 - 10w*2 + 181w - 8. Let g(q) = -5q3 + 10q*2 - 190q + 9. Let c(l) = -6g(l) - 7h(l). Find the second derivative of c(o) wrt o. -72o + 20 Find the third derivative of 9717b*4 - 9719b*4 - 362b*2 + 150b*3 + 139b*3 wrt b. -48b + 1734 Let o(l) = 36l + 12. Let n be o(0). Let u(y) be the second derivative of -7/12y*4 + 0y*3 + 5/2y*2 - ny + 0. Differentiate u(f) wrt f. -14f Find the second derivative of -183a*5 + 49a - 70a - 142a*5 - 56a wrt a. -6500a3 Let n(l) be the third derivative of 1348l*5/15 + 2017l*3/6 + 36l*2 + 4l - 3. What is the first derivative of n(k) wrt k? 10784k Let g = -20 - -43. Suppose v - g = 2. Find the second derivative of -vq*2 - 15q + 9q2 + 0q wrt q. -32 Suppose -75 = -3b + 2o, 0b + 4b + 3o - 117 = 0. What is the derivative of -4 - 12 + 8 - 74j*3 - b wrt j? -222j2 Let a(y) = y3 - 2y2 - y + 4. Let o be a(-2). Let i be (-6)/(-21) - o/(-35). What is the second derivative of if - 5f + 11f*2 + 2f wrt f? 22 Let z(t) = 17t - 89. Let r be z(8). What is the first derivative of 1974 + 72v + 71v - 1894 - rv wrt v? 96 Find the first derivative of 2588h2 - 706h*2 - 2988 + 759h*2 wrt h. 5282h Find the second derivative of -45 + 446o3 - 1436o*3 - 948o + 19 + 26 wrt o. -5940o Let p(u) be the second derivative of -151u*6/6 + 585u*2/2 - 4u - 29. Differentiate p(z) wrt z. -3020z3 Let n = -61 - -62. Find the second derivative of n - 3j*3 + 2j + 2397j4 - 2393j*4 - 2 wrt j. 48j*2 - 18j Suppose 0z + 167 = -5x + 2z, 0 = -3z + 3. Let s = x - -62. Find the third derivative of -21c5 - 19c*5 + sc*5 + 6c*2 wrt c. -660c*2 Let l be 12/5 + (-2 - 56/(-35)). Differentiate -42p*2 - 3p*l - 4p + 4p + 45 wrt p. -90p What is the third derivative of 0w - 33 + 3w - 695w2 + 940w*4 + 55 + 654w*2 wrt w? 22560w What is the third derivative of -25593138f3 + 228f*4 - 19f*4 + 25593148f*3 - 276f*2 wrt f? 5016f + 60 Suppose -756 + 762 = 3s. Let f(x) be the first derivative of 43/3x*3 + 0x + 45 - 15/2x4 + 0x*s. What is the third derivative of f(q) wrt q? -180 Suppose 3o = 4r - 301, 0o = -4o + 4r - 396. Let b = -92 - o. Find the first derivative of -2qb - q3 - q3 + 2 + 3q*3 wrt q. -3q*2 Let q(h) be the first derivative of 67h*2 + 75 + 0h + 73/3h3. What is the second derivative of q(i) wrt i? 146 Suppose -5k + z + 555 = 0, 3k - 8k + 3z + 545 = 0. Find the first derivative of 86s*2 - ks*2 + 2s + 42 + 5 + 96 wrt s. -52s + 2 Let j(z) be the first derivative of 2109z*5/5 + 492z*3 + 946. What is the third derivative of j(t) wrt t? 50616t Let t(g) = -39g + 23. Let d(o) = -118o + 71. Suppose 5q - 3i + 38 = q, -5i = 2q + 6. Let m(c) = qt(c) + 3d(c). Differentiate m(a) wrt a. -42 Find the first derivative of 489p + 137p + 26749 - 28033 wrt p. 626 Let d(s) be the first derivative of 1253s4/4 + 743s*2/2 - 3944. Find the second derivative of d(i) wrt i. 7518i Let s(g) be the third derivative of g*6/60 + 2471g*5/30 - 641g4/12 - g3/3 + 7531g2. What is the second derivative of s(l) wrt l? 12l + 9884 Let z(l) be the third derivative of -335l7/21 - l5/12 - 115l*4/12 + 4079l*2. Find the third derivative of z(s) wrt s. -80400s What is the second derivative of 486 - 486 + 1615d3 + 1186d*3 - 185d - 675d3 wrt d? 12756d Let x(p) = 32p2 - 29p - 8. Let h be x(5). Find the second derivative of hg2 - 1298g*2 - 177g*3 - 106g + 651g2 + 2 wrt g. -1062g Let l(c) be the second derivative of -3c6/10 + 11c4/4 + c3/6 - 40c2 + 1316c. Find the second derivative of l(r) wrt r. -108r2 + 66 Let l(a) be the first derivative of a6/30 + a4/8 + 17a*3/6 + 7a*2 + 9. Let p(n) be the second derivative of l(n). Differentiate p(f) wrt f. 12f*2 + 3 Suppose -8q + 4q = -16. Find the second derivative of 1 - 18o*q + 14 + 7o - 5o4 - 11 wrt o. -276o*2 Let p(y) = 1694y*2 + 7y + 3040. Let k(g) = 11865g2 + 50g + 21277. Let j(f) = -6k(f) + 43p(f). Differentiate j(b) with respect to b. 3304b + 1 Let c(a) be the third derivative of -5/6a*4 + 0 - 24a*2 - 10/3a*3 + 0a. Find the first derivative of c(q) wrt q. -20 Let r(a) be the second derivative of -5/2a2 + 11/30a*6 + 12a + 0a4 + 1 + 1/3a*3 - 2/21a*7 + 0a*5. Find the second derivative of r(h) wrt h. -80h*3 + 132h*2 Let g be 3/27 + ((-66374)/99)/(-14). Differentiate -gh*3 - 56h*3 - 288 - 123h*3 - 66h*3 wrt h. -879h*2 Let b(y) be the third derivative of -31/105y*7 + 0y*5 + 0y*3 - 21y*2 + 1 + 0y*6 + 0y + 29/12y4. Find the second derivative of b(c) wrt c. -744c*2 Suppose 2w = 3g - 0w - 25, 5g + 2w = 15. Suppose -14 = -gk + 11. Find the second derivative of ik + 12i + 6i5 - 3i*5 wrt i. 80i*3 Find the third derivative of -47z2 - z2 + 36 + 23z2 + 1981z*3 + 21z2 wrt z. 11886 Let v(c) = -c4 + c*3 - c + 4. Let j(z) = 10z*4 - 57z*3 + 2476z*2 + z - 4. Let m(x) = j(x) + v(x). What is the third derivative of m(s) wrt s? 216s - 336 Let v(t) be the first derivative of -5133t2/2 - 8603t - 8125. What is the derivative of v(b) wrt b? -5133 Let t be (-6)/428/(-21). Let v be (0 - 1)/((-7)/42). What is the second derivative of 22p + 20p2 - 9p*t + vp*2 wrt p? 34 Suppose -7p - 17 + 38 = 0. Find the second derivative of -64b + b4 + 2b*5 - pb*5 + 21b*4 + 21b*4 wrt b. -20b*3 + 516b*2 Suppose -7o + 10 = -2o. Suppose 2i = -od - 0i + 326, d - 3i = 179. What is the first derivative of 13x*4 - dx*3 + 167x*3 - 16 wrt x? 52x3 Let x(k) = -k3 - 2k2 + 139k - 49. Let q be x(-13). Suppose 2v = -0v + 22. Differentiate 3g + 2g + qg + 8 - v with respect to g. 8 Let v(g) = 3g3 + g2 - g + 1. Let y(c) = 1153c3 - 1538c*2 + 9c - 9. Let j(d) = 9v(d) + y(d). Find the third derivative of j(b) wrt b. 7080 Suppose -n + 1 = 3q - 10, 2n - 16 = -4q. What is the second derivative of 277f + 44f*n + 203f - 398f wrt f? 88 Suppose 57a - 60a = 0. Suppose -4u - 44 = -4f - au, 0 = 4f + 4u - 52. Find the second derivative of -x*2 - 11x*2 + 31x + 27x3 + fx*2 wrt x. 162x Suppose 0m = 5m - 265. What is the third derivative of -4p4 - 7p*4 - 18p*4 - mp*2 - 13p*4 wrt p? -1008p Suppose 0 = 12w - 533 - 715. What is the third derivative of -212v*2 + 5v*2 - wv*4 - 36v*2 wrt v? -2496v Suppose -5q = -289 - 161. What is the derivative of -41 + 10n*3 - 13 - qn*3 wrt n? -240n*2 Let y be ((-160)/(-24))/((-16)/(-108)). Find the second derivative of y + 4v + 0v5 + 73v*2 - 62 + 2v*5 - 3v*5 + 0v wrt v. -20v3 + 146 Suppose 4 = -4t + 12. Suppose -5r = a + 5, 0 = -4r - 3a - ta - 25. Find the second derivative of -4n - 9n - 15n4 + rn wrt n. -180n2 Let c(j) be the first derivative of 5j*7/42 + 35j*4/8 - 13j*3 - 7. Let l(z) be the third derivative of c(z). Differentiate l(p) wrt p. 300p*2 Let f(b) = -4b*3 - 151b - 196. Let c(t) = 2t3 + 75t + 98. Let y(r) = 5c(r) + 2f(r). Let s(m) be the first derivative of y(m). Differentiate s(o) wrt o. 12o Suppose -18 = 4k - 7k - 3h, -5k + 2h = -30. Suppose -41 + 5 = -kl. Differentiate 23 - 2 - 17x*2 + 0 - l wrt x. -34x Find the second derivative of -110g5 + 825g*5 + 344g*5 + 144g + 37g5 - 945g wrt g. 21920g3 Find the second derivative of -87m - 247m - 1075m*2 + 69m + 116m - 304m wrt m. -2150 Let q(y) be the second derivative of -824y5/5 - 2401y*2 + 376y. What is the derivative of q(g) wrt g? -9888g*2 Let d(x) be the th	{ "pile_set_name": "DM Mathematics" }
858 composite? True Is 36915243319 a prime number? False Is 53850064211 a composite number? False Is 44787051091 prime? True Is 3449822633 prime? False Is 142394084479 a composite number? False Is 108798102013 a composite number? True Is 13086332191 composite? True Is 1484819969 prime? True Is 32067561371 composite? True Is 1013645569 a composite number? True Is 224024653 a composite number? True Is 2989281103 prime? True Is 1456195439 a prime number? False Is 220289807 composite? False Is 936299211 composite? True Is 506610187 a composite number? False Is 4341412007 composite? True Is 77980537861 composite? True Is 1249278571 a composite number? False Is 34402759 a composite number? True Is 4448635991 prime? True Is 1386037801 composite? False Is 3372407611 a prime number? False Is 18431677921 prime? True Is 13527996073 composite? False Is 7734289091 composite? False Is 157351872533 prime? False Is 1250212703 composite? False Is 2928333719 a composite number? False Is 9844514789 a composite number? False Is 1220085143 a composite number? True Is 580295659 a prime number? True Is 882261931 prime? True Is 19312493569 a composite number? True Is 25281917 prime? False Is 161370286633 a prime number? False Is 1628623861 a composite number? False Is 24802912465 a prime number? False Is 2381860049 prime? False Is 217068497 composite? False Is 433401263 a composite number? False Is 2622377939 a composite number? True Is 535525597 a prime number? False Is 19926634015 composite? True Is 67499639509 a composite number? False Is 15361792291 prime? True Is 100820411 prime? True Is 5348102173 a composite number? True Is 308550569 a prime number? True Is 379126109 composite? False Is 1406719357 prime? True Is 308917241 a prime number? True Is 443877961 a prime number? True Is 448365271 a composite number? True Is 104269811 a prime number? False Is 557315503 a prime number? True Is 94135552761 a prime number? False Is 697438241 composite? False Is 4015950709 prime? False Is 5399737463 composite? True Is 51412575387 prime? False Is 203948821 a composite number? True Is 315482147 a composite number? True Is 10752858929 prime? True Is 7585257223 a composite number? False Is 3831889 a composite number? False Is 91445820077 prime? True Is 8159534429 a composite number? False Is 9581500619 a prime number? True Is 18011221726 a prime number? False Is 817405291 prime? True Is 2531064983 a composite number? True Is 7804472541 composite? True Is 823808903 composite? True Is 18614070907 a prime number? True Is 1296319889 composite? False Is 19056516313 a prime number? True Is 66620338541 composite? False Is 303927747157 a composite number? True Is 48336335981 a prime number? True Is 210044881 a composite number? False Is 6480366589 prime? False Is 925966751 prime? True Is 660602669 composite? False Is 1999063309 composite? True Is 1613691847 a prime number? False Is 1666627229 a composite number? False Is 180853759 prime? True Is 9055453883 prime? False Is 6252088919 a composite number? True Is 75226334369 a prime number? True Is 3646359411 a composite number? True Is 1308307709 a composite number? True Is 6776581949 prime? False Is 150154969 composite? False Is 466347529 composite? False Is 6174583727 composite? True Is 99704284829 prime? False Is 529691711 a composite number? False Is 115448740009 prime? False Is 166437911 a composite number? True Is 2455268951 a composite number? False Is 3205108027 prime? False Is 675643093 composite? False Is 958581595 prime? False Is 14843805779 composite? True Is 18777175271 a composite number? False Is 182237964671 a prime number? False Is 38014948051 prime? True Is 3586915461 prime? False Is 5021859079 composite? False Is 1028544799 a prime number? False Is 861046433 a composite number? True Is 73007382259 a prime number? False Is 755407733 composite? True Is 1349553949 prime? True Is 4679325591 a prime number? False Is 7759333999 a prime number? True Is 193437661 a composite number? True Is 34106420737 a prime number? False Is 5141324701 prime? True Is 516643133 composite? False Is 305969141 a prime number? False Is 76923804977 prime? True Is 71236751 prime? False Is 9747193273 prime? True Is 4388264533 a prime number? True Is 817148461 prime? True Is 44367430621 a composite number? False Is 2561746685 composite? True Is 77659866409 a prime number? True Is 32643177851 a composite number? True Is 903469439 a composite number? True Is 110945016583 a composite number? True Is 613184521 a prime number? False Is 6360226181 prime? False Is 5992629343 a composite number? True Is 1516851647 a prime number? True Is 6457997363 prime? True Is 1999141769 prime? False Is 13980964399 a composite number? False Is 27242131037 prime? False Is 4774616489 a prime number? False Is 771233993 a composite number? True Is 1158198391 a composite number? True Is 147627990137 a prime number? True Is 262743353 composite? False Is 45505210801 a prime number? True Is 382793491 a prime number? True Is 16561208197 composite? False Is 42864898537 a prime number? True Is 1439815711 prime? True Is 1063352837 a prime number? True Is 24832215821 prime? False Is 84074702857 a prime number? False Is 9344359019 a composite number? False Is 1981129907 a composite number? True Is 14119963919 a prime number? True Is 615798931 a prime number? False Is 55262326237 a prime number? True Is 3436654501 prime? False Is 7776427 prime? True Is 21078306026 a composite number? True Is 35046180431 a prime number? True Is 1984151809 prime? False Is 425532551 a composite number? False Is 17367756221 a prime number? True Is 1922998507 a prime number? False Is 2194502797 a composite number? False Is 6558376703 prime? False Is 520836299 a composite number? False Is 67497420367 a prime number? False Is 575186891 composite? True Is 1129087051 a composite number? True Is 968054861 prime? False Is 267711751 a prime number? False Is 781489661 a prime number? True Is 6035354735 prime? False Is 129889041682 a prime number? False Is 1952041153 a prime number? False Is 14926447 a composite number? True Is 6389388329 composite? True Is 51247578047 a prime number? False Is 11424018057 a composite number? True Is 10502495845 composite? True Is 4871805041 prime? True Is 1333859867 prime? False Is 3602000213 composite? True Is 1634465705 a composite number? True Is 1902480169 a composite number? False Is 193142101 composite? True Is 379798931 composite? True Is 40317887023 prime? True Is 23669981737 prime? False Is 6670702373 prime? True Is 196917073 a prime number? True Is 7260270503 a prime number? True Is 95741141 a composite number? True Is 993594923 prime? False Is 108041257787 a composite number? True Is 32998469549 a prime number? False Is 243102239 a composite number? True Is 386952949 a composite number? True Is 64001691257 composite? True Is 13618998205 prime? False Is 36641103826 a composite number? True Is 8822828381 composite? False Is 91805614 a composite number? True Is 9083090053 a prime number? False Is 207932567 composite? True Is 8914303459 a prime number? True Is 1540694522 a prime number? False Is 292976741 composite? False Is 58574557651 composite? False Is 3908230699 a composite number? False Is 12186256109 composite? True Is 3324601754 a composite number? True Is 2556466769 prime? True Is 208980881 a prime number? False Is 1195199573 prime? True Is 7771812929 a composite number? True Is 2399460473 prime? True Is 181024670815 a composite number? True Is 609946153 prime? True Is 15987850867 a composite number? True Is 739884853 prime? False Is 1283357107 a composite number? True Is 1229284291 a prime number? False Is 3118741531 a prime number? False Is 192367534 a composite number? True Is 2968417433 composite? True Is 923838119 prime? True Is 1051325593 prime? True Is 248434113 composite? True Is 457507663 a composite number? True Is 2800139569 prime? False Is 291640109 composite? False Is 50089614601 a prime number? False Is 701122969 a prime number? False Is 88143973 composite? True Is 3825272873 a prime number? True Is 3374311069 a prime number? True Is 26754325478 composite? True Is 3887531027 a composite number? False Is 109798901 a composite number? True Is 3421880	{ "pile_set_name": "DM Mathematics" }
d9 + -2? -2adb In base 7, what is 165220 - -4? 165224 In base 13, what is -3 - 30? -33 In base 7, what is 3044 + 12? 3056 In base 7, what is 1 + 204? 205 In base 3, what is 100111 + 22? 100210 In base 9, what is 272 + 7? 280 In base 13, what is -2b0 - -1? -2ac In base 13, what is ab + -29? 82 In base 11, what is -1 + -a25? -a26 In base 12, what is 14 - 42? -2a In base 5, what is 2 - 2? 0 In base 6, what is 52 - -5513? 10005 In base 9, what is -14 + -24? -38 In base 11, what is 2 - 820? -819 In base 16, what is c8 + -9? bf In base 4, what is 11300 + 13? 11313 In base 4, what is -12 + 1233? 1221 In base 15, what is -7 + 7? 0 In base 7, what is 0 - 10? -10 In base 6, what is 1552 + -13? 1535 In base 2, what is 1110000 + 101? 1110101 In base 6, what is 54 + -1105? -1011 In base 14, what is -94 - a? -a0 In base 10, what is -49 + -38? -87 In base 16, what is 4ef + 3? 4f2 In base 10, what is 20 - 116? -96 In base 5, what is 1 - 0? 1 In base 16, what is 10 + -580? -570 In base 6, what is 143 + 4? 151 In base 16, what is 2130 - -4? 2134 In base 6, what is 0 + -114? -114 In base 3, what is 10 + -2022? -2012 In base 13, what is -1 + 52? 51 In base 16, what is 28 - -5? 2d In base 13, what is -77a - 2? -77c In base 8, what is -244 + -2? -246 In base 13, what is 5 - -39? 41 In base 12, what is -404 - 5? -409 In base 16, what is -74 - -26? -4e In base 12, what is -933 - 3? -936 In base 15, what is 3a - -18? 53 In base 2, what is 111110001 + 0? 111110001 In base 11, what is -6 + 398? 392 In base 8, what is -104 - 6? -112 In base 7, what is 1005 + 4? 1012 In base 4, what is -1010203 + 11? -1010132 In base 8, what is 472 - 2? 470 In base 10, what is 4 + -3? 1 In base 12, what is 1 + -1359? -1358 In base 14, what is 1 + 36? 37 In base 14, what is 7 + c9? d2 In base 10, what is 12 - 41? -29 In base 15, what is -2 - -17? 15 In base 10, what is 27 + 20? 47 In base 13, what is b59 - 5? b54 In base 3, what is 0 + -2220? -2220 In base 4, what is -1230 + 10? -1220 In base 5, what is -4 + 101? 42 In base 12, what is -1 - -3a04? 3a03 In base 10, what is -70 - -10? -60 In base 9, what is -320 + 5? -314 In base 4, what is -110121 + -2? -110123 In base 4, what is -10 - -2011? 2001 In base 4, what is 12 + -203? -131 In base 12, what is 36 - 33? 3 In base 6, what is 3241 - -4? 3245 In base 11, what is -17 - 3a7? -413 In base 8, what is -11 + -4? -15 In base 10, what is 3 + -287? -284 In base 3, what is -211220 + -2? -211222 In base 14, what is 1a - 8? 12 In base 7, what is 2 - -112? 114 In base 12, what is -5a5 - 2? -5a7 In base 3, what is -11021200 - 1? -11021201 In base 4, what is -3 - 1221? -1230 In base 15, what is 1 + d9? da In base 8, what is -43 + 13? -30 In base 2, what is 1001110000 + 1? 1001110001 In base 9, what is 14212 + 4? 14216 In base 4, what is 102021 + 3? 102030 In base 16, what is -104 - 3? -107 In base 11, what is -257 + 4? -253 In base 8, what is -3 + -103? -106 In base 4, what is -10 - -200? 130 In base 14, what is 0 + -81? -81 In base 16, what is -5 - 71? -76 In base 9, what is 2430 + 2? 2432 In base 14, what is b0 + 6? b6 In base 8, what is -15 + 777? 762 In base 3, what is -2021 - 21? -2112 In base 2, what is 1 - -100100101? 100100110 In base 6, what is 5 - -14155? 14204 In base 12, what is 2060 - 4? 2058 In base 16, what is -4 - 13d? -141 In base 13, what is 8 + -19c? -194 In base 9, what is 2 - 417? -415 In base 8, what is 5 - 5064? -5057 In base 10, what is 1138 - 2? 1136 In base 7, what is 21 + 4614? 4635 In base 5, what is 222 - 1? 221 In base 3, what is -10112112 - -1? -10112111 In base 7, what is 1 - -1560? 1561 In base 5, what is 10 - -1003? 1013 In base 12, what is 204 + 5? 209 In base 12, what is -415 + -2? -417 In base 8, what is -163 + -11? -174 In base 14, what is -146 - -6? -140 In base 10, what is 767 - -1? 768 In base 8, what is -6011 - -5? -6004 In base 11, what is -3 + -1a27? -1a2a In base 10, what is 13715 - -5? 13720 In base 7, what is -251 - 12? -263 In base 3, what is 12012121 - 1? 12012120 In base 14, what is -1b + 236? 219 In base 5, what is 3 + -14? -11 In base 4, what is -3 + -333210? -333213 In base 3, what is 101222210 - -10? 101222220 In base 9, what is 1223 - 3? 1220 In base 12, what is 4 - a8? -a4 In base 10, what is 106 + 5? 111 In base 2, what is 11011011 - 100? 11010111 In base 2, what is -101 + -11000101101? -11000110010 In base 2, what is 110 + -111111? -111001 In base 5, what is 0 + -121? -121 In base 10, what is 508 - 3? 505 In base 11, what is -5 - 5? -a In base 9, what is 38 + 3? 42 In base 3, what is -10120 - 11? -10201 In base 13, what is -3 + -3c? -42 In base 2, what is -100111100 - 1001? -101000101 In base 16, what is 6 - -2? 8 In base 3, what is -12 - -11? -1 In base 10, what is -15 + -8? -23 In base 16, what is -4 - 3? -7 In base 9, what is -16 + 7? -8 In base 16, what is -1 + -8e? -8f In base 2, what is -100110011111 - -100? -100110011011 In base 16, what is -2 - -7a? 78 In base 12, what is 3 - -42? 45 In base 13, what is -1 + -545? -546 In base 3, what is 1000220 + -2? 1000211 In base 9, what is -138 + -202? -341 In base 6, what is 505 - 4? 501 In base 2, what is 100001 - 1111? 10010 In base 8, what is 61 + -76? -15 In base 13, what is -296 - 4? -29a In base 8, what is 3 - -462? 465 In base 6, what is 2 + 1221? 1223 In base 12, what is -5 - 756? -75b In base 6, what is -12 + -305? -321 In base 13, what is 4 - 16? -12 In base 8, what is -12 + -122? -134 In base 14, what is 4a1 - -1? 4a2 In base 13, what is -461b + -2? -4620 In base 8, what is 2 - 17? -15 In base 6, what is 1314 - 3? 1311 In base 14, what is -70 - 1d? -8d In base 9, what is 0 + 2? 2 In base 9, what is 3 + -107? -104 In base 6, what is -1 + -5452? -5453 In base 15, what is -3 + 2e? 2b In base 5, what is -42 + 110? 13 In base 8, what is -270 + -4? -274 In base 9, what is -2 + -64? -66 In base 13, what is 166 - 3? 163 In base 10, what is 5 + -952? -947 In base 16, what is -1d1 - -7? -1ca In base 12, what is 23 + -5? 1a In base 5, what is 1 - -22201? 22202 In base 5, what is 32 + -10? 22 In base 2, what is 10 + 11000011? 11000101 In base 5, what is 11 - 120? -104 In base 7, what is 40 + 2? 42 In base 15, what is -26 - 8? -2e In base 4, what is -11023 - -11? -11012 In base 15, what is -1 - 25? -26 In base 13, what is -112 + 7? -108 In base 13, what is -4 + -701? -705 In base 13, what is 186 - 4? 182 In base 8, what is -3 + -2346? -2351 In base 14, what is 2bc - -4? 2c2 In base 8, what is 5 - -107? 114 In base 8, what is 6 - 44? -36 In base 16, what is d44 - 5? d3f In base 12, what is 4b3 - -5? 4b8 In base 16, what is -a + 1d? 13 In base 4, what is 10 + 1313322? 1313332 In base 9, what is -30 - 71? -111 In base 3, what is -1020200 + -21? -1020221 In base 4, what is 1020 - 10? 1010 In base 15, what is a + -40? -35 In base 2, what is -10100010 + 101? -10011101 In base 14, what is 130 + 4? 134 In base 15, what is -4 - 58? -5c In base 4, what is -11 + 2133? 2122 In base 16, what is 18e6 + 5? 18eb In base 10, what is -445 - 0? -445 In base 13, what is 13c + -1? 13b In base 15, what is 4 - b? -7 In base 15, what is 22 + 31e? 341 In base 11, what is -45 - 5? -4a In base 8, what is -2 + 777? 775 In base 14, what is 0 + 7? 7 In base 2, what is -1 - 111010101110? -111010101111 In base 14, what is -5b5c - 3? -5b61 In base 3, what is -1221120 + 2? -1221111 In base 2, what is 11 + -100001101? -100001010 In base 2, what is -11001010100 - 1010? -11001011110 In base 3, what is 1000 + 12? 1012 In base 16, what is 4 + 14? 18 In base 11, what is 15 + -30? -16 In base 15, what is -e5 + 29? -bb In base 4, what is -1322 + 3031? 1103 In base 12, what is 1 - 10? -b In base 14, what is 3d1 + c? 3dd In base 9, what is -20 + -105? -125 In base 8, what is -15525 - -3? -15522 In base 8, what is 170 - -15? 205 In base 13, what is -41 - -2? -3c In base 7, what is 52434 - -1? 52435 In base 6, what is -1 - 52? -53 In base 7, what is -6 + -2550? -2556 In base 14, what is 202 + 5? 207 In base 5, what is -13414 - 2? -13421 In base 9, what is -130 - -22? -107 In base 4, what is -32120 - -11? -32103 In base 2, what is 1 - 11111110? -11111101 In base 9, what is 1782 - 6? 1775 In base 2, what is 1101 - 11001? -1100 In base 3, what is -1 + -1011202? -1011210 In base 13, what is -2	{ "pile_set_name": "DM Mathematics" }
o(p) - 6u(p). Let d(x) = -6x. Let f(s) = -7s. Let l(z) = 5d(z) - 4f(z). Determine c(l(k)). 4k Let y(b) = -5b + b + 3b. Let i be 5/(15/6) - 0. Let j(p) = -p. Let o(x) = ij(x) + 2y(x). Let z(h) = -2h. Give z(o(c)). 8c Let j(z) = -z - z - 2z. Let k(a) be the third derivative of a5/30 + 47a*2. Calculate k(j(h)). 32h2 Let c(g) = 1 - g2 - 1. Let l(v) = 37v - 17v - 19v. What is l(c(x))? -x2 Let z(g) = 3g. Let h be z(1). Let s(b) = -b + 3b - 4b + hb. Let r(c) = 4c*2. What is r(s(a))? 4a*2 Let c(r) = 2r. Let h(b) = 539b. Give h(c(f)). 1078f Let f(b) = -5b - 2. Let q(h) = -3h. Give f(q(t)). 15t - 2 Let c(x) = -11x + 3. Let q(w) = -1. Let y(l) = -c(l) + 3q(l). Let g(n) = 341n - 187. Let f(o) = -6g(o) + 187y(o). Let a(r) = 2r. What is a(f(z))? 22z Let r(v) = -7v. Let q(f) = -45f. Give q(r(a)). 315a Let w = 45 + -45. Let g(m) be the first derivative of wm - 2 + 1/2m2. Let b(o) = 2o. Calculate b(g(h)). 2h Let p(t) = 2t. Let y(v) = -4v. Let n = -3 + -1. Let b(x) = ny(x) - 9p(x). Let l(s) = s2 + s2 - 39s + 39s. What is l(b(c))? 8c*2 Let f(o) = o. Let r(p) = 105p + 13. What is f(r(a))? 105a + 13 Let m(c) = -33c - 3c2 - c2 + 33c. Let j(n) = -6n. Give j(m(l)). 24l*2 Let q(p) = -2p. Let c(y) = -580y2. Give q(c(l)). 1160l2 Let t(k) = k2 + 5k + 4. Let l be t(-4). Let y(p) = l + 0 + p. Let o(r) be the second derivative of -r4/6 - 3r + 18. Give o(y(j)). -2j2 Let b(i) = -11i. Let v(m) be the second derivative of -m*5/30 + 2m*2 - 7m. Let q(d) be the first derivative of v(d). Give b(q(r)). 22r2 Let g(y) = 11y*2 + 13y - 13. Let h(i) = -5i2 - 6i + 6. Let m(s) = 6g(s) + 13h(s). Let t(p) = -p2 + 50. What is m(t(o))? o4 - 100o2 + 2500 Let b(u) = 2u. Let a(r) be the first derivative of -7r3/3 + 7. Calculate b(a(y)). -14y*2 Let q(p) = -2p*2 + 25p*2 - 5p*2. Let s(d) = 2d. Determine q(s(t)). 72t2 Let z(b) = -20b + 2b + 9b + 10b. Let r(c) = -13c. Calculate z(r(a)). -13a Let h(u) = -5u + 9. Let c(j) = 3j - 4. Let l(m) = 9c(m) + 4h(m). Let w(b) = 8b. Give w(l(t)). 56t Let g(n) = 2n. Let u be 3/(-6) + 26/4. Let a(t) = ut + t - t - 3t. Determine g(a(z)). 6z Let o(l) = 12l*2. Let m(n) = -40n. Calculate m(o(t)). -480t2 Let f(g) = -24g*2. Let h(l) = 3l*2. Give h(f(r)). 1728r*4 Let m(s) be the first derivative of -4s*3/3 + 1. Let j(y) = -3y - y + 3y - 3y. Let n(c) = 9c. Let r(d) = 5j(d) + 2n(d). Determine m(r(p)). -16p*2 Let l(f) = 2f*2. Let s(h) = -3h*2 - 8h. Let c be (-174)/(-21) + (-4)/14. Let m(w) = -w*2 - 3w. Let x(o) = cm(o) - 3s(o). What is x(l(b))? 4b4 Let b(q) = -7q. Let t(k) = -74k2. Determine t(b(r)). -3626r*2 Let a(b) = -127b*2. Let u(q) = -5q - 18. Let h(m) = 11m + 39. Let y(x) = -6h(x) - 13u(x). What is a(y(c))? -127c2 Let k(q) be the second derivative of q5/120 + q*3/6 - q. Let u(x) be the second derivative of k(x). Let p(o) = -2o*2. Give p(u(n)). -2n*2 Let q(i) = -3i*2. Let h(n) = 733n. Give q(h(j)). -1611867j2 Let v(k) = -6k2. Let r(g) be the third derivative of g4/8 + 2g2. Calculate r(v(x)). -18x*2 Let y(r) = -2r - 4. Let p(c) = 2c + 3. Suppose 1 = 3v - 11. Let t(a) = vp(a) + 3y(a). Let j(n) = -n*2. What is j(t(f))? -4f*2 Let a(z) = 18z*2 - 3. Let c(q) = 4q. Give a(c(k)). 288k2 - 3 Let v(g) = 713g. Let f(m) = 3m2. Give v(f(h)). 2139h*2 Let n(c) = 5c. Let h(b) = -2b + 3. Let i(j) = -5j + 7. Let u(m) = -7h(m) + 3i(m). Determine u(n(g)). -5g Let p(d) = -6d. Let t(s) = 37 - 37 + 2s. Determine t(p(h)). -12h Let a(b) = -b*2. Let q(s) = 6s - 5s + 5s. Calculate a(q(x)). -36x2 Let f(c) = c2. Let m(y) = -y3 + 2y - 1. Let g be m(-2). Let t(w) = -2w + 0w + 4w - gw. What is t(f(i))? -i*2 Let n(k) = -1. Let j(u) = 3u + 6. Let g(t) = j(t) + 6n(t). Let a(x) = 7x*2. Calculate g(a(b)). 21b*2 Let q(n) = -1599n*2 - 2. Let f(z) = -3z. What is f(q(y))? 4797y2 + 6 Suppose 3y = -y + 12. Let i(x) = -4 + 2x + y + 1. Let l(o) = -2o2 + 5. Let q(r) = r2 - 1. Let j(m) = l(m) + 5q(m). Calculate j(i(u)). 12u*2 Let p(j) = 3j. Let n(v) be the second derivative of -v*3/6 - v. Let t(o) = 7n(o) + 2p(o). Let m(w) = w + 9 - 9. Calculate m(t(q)). -q Let q(w) = 219w*2. Let y(x) = 2x*2. Determine y(q(b)). 95922b*4 Let j(u) be the first derivative of -4u3/3 + 2. Let a(i) = i2. Determine j(a(k)). -4k4 Let z(o) = 23o*2. Let p(b) = 2b. Determine p(z(t)). 46t2 Let v(q) = 89q*2. Let l(o) = -3o*2. Calculate l(v(n)). -23763n4 Let u(a) be the first derivative of -a2 - 127. Let w(b) be the first derivative of 8b3/3 + 1. Calculate w(u(t)). 32t*2 Let g(j) = 2j - 12. Let z(h) = h - 2. Let v(q) = 2g(q) - 12z(q). Let u(l) = 0l + l + 2l*2 - l. Give v(u(c)). -16c2 Let j(s) be the first derivative of s5/120 + s*3/3 + 3. Let z(p) be the third derivative of j(p). Let o(c) = -2c - c + 2c. Calculate o(z(n)). -n Let r(a) = 2a + 7. Let o(j) = 6j2. Give o(r(v)). 24v*2 + 168v + 294 Let p(b) = 21b + 4. Let t(d) = -2d. What is t(p(r))? -42r - 8 Let x(o) = -68o. Let j(m) = 64m2. Calculate x(j(c)). -4352c*2 Let r(d) = 2d. Let x(p) = 9p. Let h(k) = -26r(k) + 6x(k). Let f(b) = -b. Calculate f(h(j)). -2j Let a(i) = -2i2. Let n be (2/1)/2-8. Let g = n - -11. Let v(m) = -gm2 + 6m*2 - 2m*2. What is v(a(c))? 4c*4 Let q(b) = -2b*2. Let p be 0/(-17)(0 - (-1)/2). Let v(t) be the third derivative of -4t2 + pt*3 + 0 - 1/30t*5 + 0t + 0t4. Calculate v(q(k)). -8k*4 Let l(v) = -4v*2 + 2v. Let z(t) = -18t2. What is l(z(f))? -1296f*4 - 36f*2 Let f(u) = -4 - u + 2 + 2. Let k(d) = -d - 1. Let c(x) = 1. Let p = 6 - 8. Let s(l) = pk(l) - 2c(l). Determine s(f(r)). -2r Let d(v) = v. Let r(z) = z*2 + 3z. Let g(s) = -3d(s) + r(s). Let b(x) = -9x. What is b(g(m))? -9m2 Let n(f) = -7f + 4. Let s(c) = -36c + 21. Let o(h) = -21n(h) + 4s(h). Let a(g) = g. Determine a(o(i)). 3i Let b = 6 - 14. Let s = -4 - b. Let z(w) = -3w + 0 + sw + 0. Let y(u) = -2u. Determine z(y(n)). -2n Let j(k) = 8k + 1. Let i(b) = -108b. Calculate j(i(x)). -864x + 1 Let d(i) = i2. Let t(u) be the second derivative of 5u + 0u2 + 0 + 0u*3 - 1/4u*4. What is d(t(g))? 9g*4 Let k(x) = -251x*2. Let w(j) = -6j*2. Determine w(k(y)). -378006y*4 Let l(g) = 8g + 8. Let u(n) = -3n2. Give l(u(r)). -24r*2 + 8 Let k(i) be the second derivative of 0i*2 + 1/12i*4 + 0i*3 - 2i + 0. Let l(v) be the second derivative of -5v4/12 + 2v. Determine k(l(h)). 25h4 Let f(t) = 176t*2. Let p(h) = -4h. Determine p(f(u)). -704u2 Let t(c) = 3c + 9. Let d(u) = -u - 4. Let l(k) = 9d(k) + 4t(k). Let o(w) = -3w. Calculate l(o(g)). -9g Let b(m) be the third derivative of -m*5/20 - 5m2. Let t(r) be the first derivative of r3/3 + 1. Calculate t(b(s)). 9s4 Let g(a) = 42a + 3. Let b(r) = -r. What is g(b(d))? -42d + 3 Let h(j) be the second derivative of j4/6 - 2j. Let x(c) = 2c. Give x(h(w)). 4w*2 Let p(i) = 3i. Let m(q) be the first derivative of q*2 + 7. Give p(m(t)). 6t Let z(w) be the first derivative of -3w2 + 1. Let m(n) = -2n + 2n - 2n + 4n. Determine m(z(f)). -12f Let x(p) = 79p + 2. Let y(q) = -q. What is x(y(v))? -79v + 2 Let c(j) = 3j2. Let z(x) = 3x + 7 - 7. Give c(z(y)). 27y2 Let d(w) = -5w*2 - 4w + 4. Let s(n) = -n*2 - n + 1. Let z(o) = d(o) - 4s(o). Let b(g) be the second derivative of -g*4/2 + g. Calculate b(z(q)). -6q*4 Let z(y) = 4y*2. Let x(a) = 2008a - 2. Give x(z(w)). 8032w2 - 2 Let o(h) = -3h. Let i(f) = -6f + 2f - 2f - f. What is o(i(c))? 21c Let b(j) = j - 39. Let f(x) = 16x2. Calculate b(f(q)). 16q2 - 39 Let m(t) be the third derivative of -t5/12 - 11t2. Let i(z) = -2z. Determine i(m(l)). 10l2 Let u(k) = -3k*2 + 5k*2 - 6k*2. Let z(s) = s. Give u(z(o)). -4o*2 Let p(i) = -4i. Let y(a) = -14a2 + 8a - 8. Let l(s) = -9s2 + 5s - 5. Let z = -18 - -10. Let h(c) = zl(c) + 5y(c). Calculate h(p(f)). 32f2 Let a(t) = -5t. Let r(o) be the third derivative of -o*4/12 + 3o*2. Calculate a(r(h)). 10h Let f(m) = -6m. Let z(n) = 38n. What is f(z(h))? -228*h Let m(a)	{ "pile_set_name": "DM Mathematics" }
32)) + sqrt(52)))/(((-2sqrt(180))/sqrt(9))/(sqrt(20)/sqrt(4)-2 - sqrt(5))))2. 11700 Simplify ((-3 + sqrt(63) - sqrt(63))2 + sqrt(7))-1-5 + (sqrt(84) + -2sqrt(84))/sqrt(12) + ((sqrt(7) + 3)5 - sqrt(7)). 8sqrt(7) + 60 Simplify (4 + sqrt(832)2)3 - -5(3(sqrt(832) + 0))2. 48sqrt(13) + 37452 Simplify (-2-3sqrt(45))2 + 1 + (sqrt(720) + -1 + 5)2. 96sqrt(5) + 2357 Simplify -1((sqrt(19) + sqrt(1216))2 - (sqrt(19)-4 + -3) - (-5 + sqrt(19) + sqrt(57)/sqrt(3) + 1 + -2)*2)2. -92sqrt(19) + 218 Simplify 4 + ((-5(sqrt(10)/sqrt(2) + sqrt(5)) - sqrt(5) - sqrt(5)) + sqrt(240)/sqrt(3) - (sqrt(1440) + 2sqrt(1440) + sqrt(40))/(4sqrt(72))). -115sqrt(5)/12 + 4 Simplify ((-1 + (sqrt(33) + sqrt(66)/sqrt(2) - sqrt(33))/sqrt(3) - (sqrt(99) + -1 + 3 + sqrt(99)))33)21-2. -46008 - 4860sqrt(11) Simplify (-2 + 2(5 + 4(sqrt(125) - (sqrt(125) - ((2sqrt(125) - sqrt(125)) + sqrt(125))))) + -4 + -3 + 4)2. 800sqrt(5) + 32025 Simplify -4(-25-1(3sqrt(288) + sqrt(288))-4-5 + -2). -38400sqrt(2) + 8 Simplify ((sqrt(288)2 + -2 - sqrt(288) - (sqrt(288) - (-1 + sqrt(288)))6 - (sqrt(180)/sqrt(160))/(2sqrt(36)/sqrt(4) + sqrt(9) - sqrt(9)))-1-4)2. -3040sqrt(2) + 11073/2 Simplify ((1((sqrt(95)2 + sqrt(95))-5 + sqrt(95)-2-5))/(6((sqrt(45) - sqrt(5))-1 + (sqrt(5) - -1(sqrt(20) + sqrt(5))))))*2. 475/144 Simplify (((sqrt(300) + 2sqrt(300) - sqrt(300)) + 0 - (-3 + sqrt(300)2) - -6(sqrt(300)-2 + -3)) + 1)2. 3360sqrt(3) + 43396 Simplify 3 + (((1sqrt(270) - sqrt(30))/sqrt(2))/(5(((1sqrt(500) - sqrt(500)) + sqrt(500) - sqrt(5)) + sqrt(5))))2. 1878/625 Simplify 5(-1(sqrt(171) - (-5 + sqrt(171) + -3 + sqrt(171) + sqrt(171)) - sqrt(171) - (1 + 0 + sqrt(171)))34)2. -120960sqrt(19) + 2005200 Simplify ((3 + sqrt(500) + 0 + -2 - 6(-2 + sqrt(500))-4) + -3 + 3)*2. -23500sqrt(5) + 314709 Simplify (3 + -2-4(4 + -3 + sqrt(112) + -5 + 5))*2. 704sqrt(7) + 7289 Simplify 1 + ((-5 + sqrt(1088))*25 - ((sqrt(51)-1)/sqrt(3) + sqrt(612)4)). -423sqrt(17) + 5566 Simplify -5(-21sqrt(448) - (sqrt(448) + -3 + -3))*2 + -1. -20341 + 1440sqrt(7) Simplify (2-2sqrt(88) - 31sqrt(88))/((-3sqrt(72) - sqrt(8))4)4. 7sqrt(11)/10 Simplify -5((0 + sqrt(405) + 2 + -1)56 + -3). -1350sqrt(5) - 135 Simplify ((sqrt(39) + (3sqrt(156))/sqrt(4))/(3sqrt(3)2))2 - (sqrt(156) - ((sqrt(156) + sqrt(156)1)1 - sqrt(156)))/(2sqrt(432)). 52/9 Simplify (1(-5((sqrt(162)1 - sqrt(162)) + sqrt(162)) - sqrt(162)))/((sqrt(294)-2 - sqrt(6)) + 1sqrt(24)/sqrt(4)). 9sqrt(3)/7 Simplify (((sqrt(19) + sqrt(19) + 0)6 + (2sqrt(76) - sqrt(76))/sqrt(4) - (sqrt(190)/(sqrt(60)/sqrt(6)) - (sqrt(19) + 2 + -2)))-2)2. 12844 Simplify (sqrt(99) + 3 + sqrt(99) + 2)2 + -3 - (((-5sqrt(121)-1 + sqrt(121) - sqrt(121)) + sqrt(121))/(sqrt(110)/(sqrt(90) + sqrt(10) + sqrt(10))))2. -9482 + 60sqrt(11) Simplify (4 + -4 + 4 + (((-3sqrt(275) - sqrt(275)) + -2 + sqrt(275) + 2)-4)*2)2. 79208 Simplify 3-6(4((-4(sqrt(847) + -5) - sqrt(847)) + 2(sqrt(847) + -1)) + -2)2. -2283624 + 332640sqrt(7) Simplify (-6-3(sqrt(363) - (3 + (sqrt(363) + -1 - sqrt(363)) - sqrt(363))) + -3)*2 + -5 + 4 + 1. -30888sqrt(3) + 471969 Simplify (-1 + (sqrt(325) - 53sqrt(325)) + 3 + (-5 + sqrt(325)-12)-3)2. -1360sqrt(13) + 21089 Simplify 2((sqrt(2736) - 2(sqrt(2736) - (sqrt(2736) + -1)))*2 + 3) + -2-3(2sqrt(2736)6)2. -96sqrt(19) + 2369390 Simplify 4((sqrt(1200)-2)/((sqrt(4) - sqrt(64))5) - (2 + -1 + 4 + 1 + sqrt(3)))2. -16sqrt(3) + 436/3 Simplify 4 + ((sqrt(32) + (sqrt(192)/sqrt(6))*2 + sqrt(32) - (sqrt(2) - (2sqrt(8))/sqrt(4))) + (3(sqrt(72)1 + sqrt(72))-6)2)-2. -186684 - 18sqrt(2) Simplify ((-4sqrt(99)1 + -61sqrt(99))/((sqrt(576) - -1sqrt(576)-5) + sqrt(576)2-3))2. 11/64 Simplify (sqrt(3648) + 1sqrt(3648))/(1sqrt(3)-1) + -5 + ((-1sqrt(1539)-3 - sqrt(1539))3)2. -16sqrt(19) + 55399 Simplify (3 + ((sqrt(700)2 + sqrt(700))-4 - (5 + 2sqrt(700)))26 + 1)2. 188160sqrt(7) + 19759936 Simplify (((2 + sqrt(605))-2 + 1sqrt(605)-1 + sqrt(605) + -2)-51 + 1)2-3. -184383 - 20460sqrt(5) Simplify (2 + (sqrt(216)/(sqrt(9)-1))/(-5sqrt(72)) + (-2sqrt(24))/sqrt(8)44)*2. -1916sqrt(3)/15 + 229741/75 Simplify ((1sqrt(225)-4 + sqrt(225))4)/(sqrt(960)/sqrt(3)4) + 2. -9sqrt(5)/8 + 2 Simplify (((sqrt(340)-1-5)/(sqrt(40)/sqrt(4)5))/(sqrt(14)/(sqrt(7) + sqrt(14)/sqrt(72))-1))2. 833/36 Simplify ((4(0 + sqrt(1584) - sqrt(11) - (sqrt(66)/sqrt(2))/sqrt(3)) - (-4 + 0 + sqrt(396) + (sqrt(11) - (-1 + sqrt(275))))) + 1 + -2)*2. 152sqrt(11) + 15888 Simplify -4(-5 + (-5 + sqrt(176) + 0 - (-2 + sqrt(176)2))-2)2-3 + 4. 192sqrt(11) + 8464 Simplify -1(-4sqrt(84)-2 + sqrt(84) + (sqrt(84) - -4sqrt(84)2))/((2(sqrt(132)2 - sqrt(132)))/((sqrt(220)/sqrt(4))/sqrt(5))). -9sqrt(7) Simplify (4(1(-4 + sqrt(704) + 1) + 13sqrt(99)/(sqrt(729) - sqrt(9))))2. -804sqrt(11) + 49955/4 Simplify -4((-4 + (sqrt(847) + 2)1 + -1)6-1)*2. -123264 + 9504sqrt(7) Simplify 5 + (((sqrt(66) + sqrt(66)2 - sqrt(66) - sqrt(66))/sqrt(6)-4)*2 + -2 - (-4 + (0 + sqrt(176))-6)). 24sqrt(11) + 183 Simplify (4 + -26(0 + -1sqrt(2299) - (sqrt(2299) - (sqrt(2299) + 1 + 4))) + 3)*2 + -1. -13992sqrt(19) + 333864 Simplify -1(-5(1 + (2 + sqrt(11) + -3(sqrt(11) + -3 + sqrt(11) + sqrt(11)) + -4)4))*2. -302625 + 46400sqrt(11) Simplify (1(sqrt(684) + sqrt(684) + sqrt(684) + -1(sqrt(684) + -5)) - (sqrt(684)-1-1 + -4))*2. 108sqrt(19) + 765 Simplify (3(-2 + 4 + (4 + -4sqrt(720) - sqrt(720))-2))2. -12960sqrt(5) + 648324 Simplify (6(6(2sqrt(16) - sqrt(16)) + sqrt(176)/(sqrt(11) + -1sqrt(11) + sqrt(11)))/(6((1sqrt(288) - sqrt(288)) + sqrt(8))))*2. 98 Simplify (((-1sqrt(198))/((-4sqrt(2)1 - sqrt(2)) + sqrt(2)) - (-2 + sqrt(176) - (sqrt(11) - -1(0 + sqrt(11)))))1)*2. -5sqrt(11) + 339/16 Simplify (-2 + (1(3 + sqrt(405)) - (-4 + sqrt(405)1) - (((0 + sqrt(405) + sqrt(405))6 - sqrt(405)) + -2 + 0)))2. -1386sqrt(5) + 49054 Simplify 3 + 2 + 1(2 + (-2 + 1sqrt(343) + sqrt(343))*2) + 0. -56sqrt(7) + 1383 Simplify (5-1sqrt(480)5)/(sqrt(40)/sqrt(4)3 + sqrt(10) + (sqrt(1210)1 - sqrt(1210)) + sqrt(1210) + sqrt(1210)). -50sqrt(3)/13 Simplify (-2 + sqrt(208) - (-5sqrt(117))2) + (-1sqrt(13)-4)2 + 6(sqrt(13) + 1)*2 + sqrt(13). -2635 + 17sqrt(13) Simplify ((sqrt(540)21 + 61sqrt(540))-3)/(-2(sqrt(300) + -1sqrt(300) + sqrt(300) + sqrt(300) + sqrt(192) + sqrt(192)1)). 2sqrt(5) Simplify -1 + -1 + sqrt(147) + (sqrt(147) - ((-3 + sqrt(147) + sqrt(147) + 2 - sqrt(147) - sqrt(147)) + sqrt(147))) + (3 + sqrt(147) + 1)-1. -5 Simplify (sqrt(25)/((sqrt(20)-2)/sqrt(4)))2 + -4 - (-1sqrt(320) + 0 + sqrt(245)). -11/4 + sqrt(5) Simplify -6(4 + ((sqrt(76) - (-4 + sqrt(76) + 2) - (sqrt(76) + 1sqrt(76) + 5 - sqrt(76))) + 5)*2). -504 + 48sqrt(19) Simplify (sqrt(20)/(sqrt(6)/sqrt(3)6)-6)/(sqrt(30)/(sqrt(6) - sqrt(150)) + -5(sqrt(80) + sqrt(5))). 4sqrt(2)/101 Simplify 1 + ((2sqrt(162)-2 + 3 - (sqrt(162) + 1sqrt(162) + -4 - -2sqrt(162)-2)) + 5)2. -432sqrt(2) + 793 Simplify 1(sqrt(2) - (sqrt(10)/sqrt(5) + -5))23 - -3(sqrt(16)/(sqrt(8) + sqrt(200)) + (sqrt(242) + 1)2 + sqrt(2)). 139sqrt(2)/2 + 804 Simplify 1 + (-6(-2 + sqrt(19) + -4 + -3) - (-2 + sqrt(171) + 4 + 5))2. -846sqrt(19) + 3749 Simplify (((-2sqrt(65) - sqrt(65))-6 - sqrt(65) - sqrt(65)) + 6-3sqrt(65) + sqrt(65))/(-31sqrt(180)-6). -sqrt(13)/108 Simplify (-3(1 + (-5 + -1sqrt(300))4 + -1))*2-6. -280800 - 86400sqrt(3) Simplify (-1(sqrt(425) + -1 + 3)3 - ((sqrt(425)2 + sqrt(425))-3 - (0 + sqrt(425) + sqrt(425))4))*2. -840sqrt(17) + 83336 Simplify 1(3 + (6sqrt(3)-1 + sqrt(3))-4)2 - ((sqrt(48) + 5)2-2 - ((2sqrt(270))/sqrt(10))/sqrt(9)). 202sqrt(3) + 1355 Simplify ((2 + 5-4sqrt(1300) + (sqrt(143)-2-4 + sqrt(143))/(sqrt(132)/(sqrt(12) + sqrt(300) + sqrt(12))))6)*2. -19728sqrt(13) + 8784036 Simplify (sqrt(40)/sqrt(2)-3 + sqrt(20) - ((-3sqrt(220))/sqrt(11) - sqrt(20)))/(sqrt(576)-16-1). sqrt(5)/36 Simplify ((-4 + sqrt(19)-4 - (sqrt(95) - -4sqrt(95))/sqrt(5)) + ((2sqrt(209) - sqrt(209))-4 + sqrt(209))/(sqrt(539) + sqrt(539)-2))*2. 480sqrt(19)/7 + 69184/49 Simplify (2*(0 + sqrt(147)) + sq	{ "pile_set_name": "DM Mathematics" }
4. 56 What is the remainder when 3554681 is divided by 108? 77 What is the remainder when 40588 is divided by 2232? 412 Calculate the remainder when 4552308 is divided by 379356. 36 Calculate the remainder when 83839 is divided by 195. 184 What is the remainder when 123312 is divided by 453? 96 What is the remainder when 67274 is divided by 1159? 52 What is the remainder when 385660 is divided by 4648? 4524 Calculate the remainder when 38647 is divided by 11960. 2767 What is the remainder when 1867702 is divided by 37354? 2 What is the remainder when 16747742 is divided by 369? 308 Calculate the remainder when 33966357 is divided by 874. 95 Calculate the remainder when 23434949 is divided by 55. 54 What is the remainder when 901108 is divided by 14771? 77 What is the remainder when 593080 is divided by 3802? 3770 Calculate the remainder when 30946286 is divided by 152. 150 Calculate the remainder when 96909 is divided by 2354. 395 Calculate the remainder when 2967774 is divided by 741664. 1118 What is the remainder when 241364 is divided by 26816? 20 What is the remainder when 321755 is divided by 20103? 107 Calculate the remainder when 388113143 is divided by 3342. 3341 Calculate the remainder when 735064 is divided by 364883. 5298 Calculate the remainder when 4771083 is divided by 2385538. 7 What is the remainder when 215264 is divided by 11266? 1210 Calculate the remainder when 7193440 is divided by 1893. 40 What is the remainder when 24107963 is divided by 253768? 3 Calculate the remainder when 12749681 is divided by 1821377. 42 Calculate the remainder when 733706 is divided by 5516. 78 What is the remainder when 6813658 is divided by 1362731? 3 Calculate the remainder when 9266991 is divided by 56. 55 What is the remainder when 210608 is divided by 628? 228 What is the remainder when 1974972 is divided by 260? 12 What is the remainder when 8460913 is divided by 272932? 21 What is the remainder when 993551 is divided by 248348? 159 Calculate the remainder when 1225874 is divided by 1729. 13 Calculate the remainder when 63151031 is divided by 157092. 47 Calculate the remainder when 60389417 is divided by 4. 1 What is the remainder when 5342817 is divided by 1780843? 288 Calculate the remainder when 13237463 is divided by 6618716. 31 Calculate the remainder when 1176473 is divided by 615. 593 What is the remainder when 24236 is divided by 2756? 2188 Calculate the remainder when 51953 is divided by 3986. 135 What is the remainder when 1353 is divided by 335? 13 Calculate the remainder when 95526 is divided by 4526. 480 What is the remainder when 96963585 is divided by 2407? 2404 What is the remainder when 178825 is divided by 22334? 153 Calculate the remainder when 310227288 is divided by 155113637. 14 What is the remainder when 2013561 is divided by 300? 261 Calculate the remainder when 6167413 is divided by 143428. 9 Calculate the remainder when 12199398 is divided by 3049837. 50 What is the remainder when 4083827 is divided by 2840? 2747 What is the remainder when 426363 is divided by 49? 14 Calculate the remainder when 222336 is divided by 637. 23 Calculate the remainder when 342803 is divided by 2274. 1703 Calculate the remainder when 300474 is divided by 1971. 882 Calculate the remainder when 501689 is divided by 166532. 2093 Calculate the remainder when 118327 is divided by 1229. 343 What is the remainder when 3508069 is divided by 41? 27 Calculate the remainder when 348754 is divided by 614. 2 What is the remainder when 10017101 is divided by 152? 149 Calculate the remainder when 1239971 is divided by 1239817. 154 What is the remainder when 61330 is divided by 59? 29 Calculate the remainder when 132262360 is divided by 2721. 2713 Calculate the remainder when 642315 is divided by 8451. 39 Calculate the remainder when 330356 is divided by 2131. 51 What is the remainder when 1107595 is divided by 44? 27 What is the remainder when 800611 is divided by 2922? 2905 What is the remainder when 60972 is divided by 122? 94 Calculate the remainder when 2566195 is divided by 2277. 16 Calculate the remainder when 150389 is divided by 6540. 6509 What is the remainder when 99437214 is divided by 2981? 2978 Calculate the remainder when 52905524 is divided by 98. 28 What is the remainder when 1218327657 is divided by 396? 393 Calculate the remainder when 155391 is divided by 25882. 99 Calculate the remainder when 4917471 is divided by 8. 7 What is the remainder when 1418589 is divided by 7429? 7079 Calculate the remainder when 1162862 is divided by 550. 162 Calculate the remainder when 10448560 is divided by 2808. 2800 Calculate the remainder when 2857744 is divided by 26. 6 What is the remainder when 2061700 is divided by 920? 900 What is the remainder when 15796086 is divided by 963? 960 What is the remainder when 54406457 is divided by 17? 14 Calculate the remainder when 510888 is divided by 462. 378 Calculate the remainder when 1065531 is divided by 106548. 51 What is the remainder when 19896 is divided by 4782? 768 Calculate the remainder when 1708217 is divided by 61007. 21 Calculate the remainder when 47861527 is divided by 68. 67 What is the remainder when 5417517 is divided by 9? 3 Calculate the remainder when 1746851 is divided by 109. 17 What is the remainder when 9993353 is divided by 3120? 3113 Calculate the remainder when 33172518 is divided by 123. 33 What is the remainder when 4065844 is divided by 153? 22 What is the remainder when 68479 is divided by 1396? 75 Calculate the remainder when 49022208 is divided by 5. 3 What is the remainder when 1010834 is divided by 545? 404 What is the remainder when 57126218 is divided by 845? 838 What is the remainder when 2483417 is divided by 484? 13 What is the remainder when 2906294 is divided by 3115? 3114 What is the remainder when 491212 is divided by 245597? 18 Calculate the remainder when 65083236 is divided by 121. 119 Calculate the remainder when 26318170 is divided by 457. 454 What is the remainder when 1658011 is divided by 43626? 223 Calculate the remainder when 28911629 is divided by 237. 236 What is the remainder when 324750 is divided by 16195? 850 Calculate the remainder when 14128 is divided by 14. 2 Calculate the remainder when 115675 is divided by 38403. 466 Calculate the remainder when 7296053 is divided by 34415. 73 Calculate the remainder when 3326340 is divided by 1108776. 12 Calculate the remainder when 68743903 is divided by 3730. 3 What is the remainder when 110826 is divided by 55244? 338 What is the remainder when 621229 is divided by 620893? 336 What is the remainder when 10468751 is divided by 129? 14 Calculate the remainder when 936176 is divided by 35. 31 What is the remainder when 215120 is divided by 1039? 47 Calculate the remainder when 13967832 is divided by 3576. 3552 What is the remainder when 344918 is divided by 344849? 69 What is the remainder when 1351585 is divided by 223? 205 What is the remainder when 1399491 is divided by 15379? 2 What is the remainder when 1499874 is divided by 374961? 30 Calculate the remainder when 507067 is divided by 507016. 51 What is the remainder when 6866 is divided by 209? 178 What is the remainder when 1455525 is divided by 3206? 1 What is the remainder when 18595 is divided by 1651? 434 What is the remainder when 3530979 is divided by 882737? 31 Calculate the remainder when 5521799 is divided by 1840596. 11 What is the remainder when 9256225 is divided by 18? 13 Calculate the remainder when 378288 is divided by 377921. 367 Calculate the remainder when 641199 is divided by 482. 139 What is the remainder when 92653 is divided by 29194? 5071 What is the remainder when 87426 is divided by 320? 66 What is the remainder when 2539299 is divided by 93? 27 Calculate the remainder when 4621681 is divided by 41265. 1 What is the remainder when 23993859 is divided by 869? 769 Calculate the remainder when 273747 is divided by 2106. 2073 What is the remainder when 6194651 is divided by 795? 11 Calculate the remainder when 602090 is divided by 7525. 90 Calculate the remainder when 8810386 is divided by 142. 138 Calculate the remainder when 335315 is divided by 41. 17 What is the remainder when 220163 is divided by 3192? 3107 What is th	{ "pile_set_name": "DM Mathematics" }
et z(p) = p*2 - 3p + 2. Let s be z(3). Let f be (-27)/(-1 + s + -2). Let x = 129/5 - f. Which is the closest to 1? (a) -3 (b) -2/13 (c) x b Let j = 5 - 4. Let f be (3/(-9))/(-3 - (-12)/3). What is the closest to 1 in 0.3, f, j? j Let h be (-16)/10 + (1 - 0). Let i = 169 + -1519/9. Which is the nearest to -0.1? (a) h (b) 1 (c) i c Let d be (2/(-3))/(32/(-12)). What is the nearest to d in 0.1, -1, 0? 0.1 Let f = -0.31 + 1.31. What is the closest to -1/4 in 4, f, -2/7? -2/7 Let d = 1.2 + -1. Let l be 1 - 2/2 - 2. Let z be (-8)/120 + l/(-12). Which is the nearest to 0.1? (a) d (b) z (c) -3 b Let k = 12 + -19. Let y = k - -15/2. Let w = 18 + -18. What is the closest to w in y, -1, -3? y Let g = 0.2 + -0.6. Let p(z) = z*3 - 11z*2 + 10z - 3. Let n be p(10). Let x = 0.3 + -0.8. What is the closest to -1 in n, x, g? x Let d = -7.1 - -16.1. Which is the nearest to d? (a) -1 (b) 2 (c) 5 c Let q = 3 + -1. Let o = -3 + q. Let f be (20/6)/2 + -1. Which is the closest to -1/4? (a) o (b) f (c) -0.3 c Let a = -0.017 + 0.117. What is the closest to 1 in 4, a, 0.2? 0.2 Let p be -1((-36)/75)/(-6). Let x = -79/50 - p. Let s be 24/5 + 2/10. What is the nearest to 1/3 in x, -1, s? -1 Suppose 0 = -2v + 5y + 13, 0v - 2v - 8 = 2y. Let m = -55.2 + 55. Which is the closest to m? (a) v (b) -0.1 (c) -3 b Let j(t) = -t3 + t2 - 4. Let r be j(0). Let i = -0.6 - -0.5. Which is the closest to -3? (a) r (b) -5 (c) i a Let s = -2 + 2.24. Let x = -0.04 + s. Let h = 1/12 - -1/4. Which is the closest to -0.1? (a) -2 (b) x (c) h b Let m = -0.31 + 0.31. What is the closest to m in 1/4, 3, 0? 0 Let j = -7.8 + -2.2. Let n = j + 12. Which is the closest to n? (a) 0.5 (b) 3/7 (c) 3 c Let l(h) = h*2 - 3h - 4. Let m be l(3). Let s = 12 + -8. Let o be 1s(-3)/9. Which is the closest to 0.1? (a) o (b) m (c) 0.5 c Let s(a) = -2a + 1. Let f = 1 - 0. Let x be s(f). Let m be x/4 - (-28)/48. What is the nearest to 0.2 in m, 0.5, -2/5? m Let m be (3/(-10))/((-12)/5). Let v = 8 - 6. Which is the closest to v? (a) -2/5 (b) -1/2 (c) m c Suppose 16 + 29 = -3x. Let z be (-3)/4(-5)/x. Which is the nearest to 2/5? (a) z (b) 2 (c) -1/6 c Let i = -0.34 + -0.06. Let o = 0.4 + i. Let m = -14 - -13.8. Which is the closest to o? (a) m (b) -0.5 (c) -0.3 a Let k = 0.2 - -0.2. Which is the closest to -1? (a) 1 (b) k (c) 4/5 b Let g = -23.9 + 24. Let p = 5.01 + -0.01. Which is the closest to g? (a) -4 (b) p (c) -0.3 c Let v = 64 + -64.1. Let s(r) = -r2 - 3r - 1. Let f be s(-1). What is the nearest to f in -2/11, v, 4? v Let s = -0.05 + -0.35. Let d = -2.95 - 0.05. Let f = d + 0. Which is the closest to -2? (a) s (b) 0.4 (c) f c Let v be (-8)/615/25. Let s = v - -13/10. Let r = -3 + 4. Which is the closest to -1? (a) r (b) 2 (c) s c Let i = 2/333 - -208/2331. Let x = -38.5 - -39.5. Which is the closest to 0? (a) x (b) 0.2 (c) i c Let x = -0.03 - -1.03. Let y = x + -1.2. Which is the nearest to y? (a) 2/9 (b) 0 (c) -3/4 b Let u = -4 + 4.7. Let r = u - 0.7. Which is the closest to r? (a) 0 (b) -3/2 (c) 0.2 a Let x = 0.2 + -0.2. Let p = -47 + 46.5. Which is the closest to x? (a) p (b) 2/11 (c) -5 b Let j = -4 - -3.5. Which is the nearest to 1? (a) -5 (b) j (c) -3 b Let l = 5 - 2. Let u be ((-15)/10)/((-3)/(-8)). Let v be (u/(-2))/(-2 - -12). Which is the nearest to 2? (a) -5 (b) v (c) l c Let h be 1 - 52/8. Let o = -5 - -2. Let z = -3 - o. What is the nearest to -1 in z, -0.1, h? h Let s = -0.07 - 0.03. Let d = -3 + 3. Which is the closest to -0.2? (a) d (b) 4 (c) s c Suppose -5u = -2s - 3s, 5u - 3s + 4 = 0. Let z be 2u(-2)/(-48). Which is the closest to 0.1? (a) -0.2 (b) 9 (c) z c Let v = -13.5 + 13.4. Which is the closest to -1? (a) -2/5 (b) v (c) -1/2 c Let w = -1726/9 - -192. Let q be 2/(-1) + (-9)/(-4). Which is the closest to 0.1? (a) 0 (b) q (c) w a Let w = 0 - 1. Let p(n) = -5n3 - n2. Let z be p(-1). What is the closest to w in z, -2, 5? -2 Let c = -8.3 - -8. Let u = -0.3 - c. What is the nearest to u in 0.1, 5, 2? 0.1 Let c = 1.5 - 0.5. Let y be -1 + 81 + -2. Let u = 1.2 - 1.2. What is the nearest to c in y, u, 2/11? 2/11 Let c be (-5)/10(3 + 19). Let i = c + 57/5. Let r be (-2)/(-3)-1 - 0. What is the closest to 0.1 in i, 4, r? i Suppose -4d - 1 = -5o + 13, 5o + 34 = -4d. Let n be (-2)/d - (-2)/6. What is the closest to -2/3 in -3, 5, n? n Let s = 14 - 19. Let p be (-2)/(-2) + 9/s. Which is the closest to 0.2? (a) p (b) 1 (c) -0.2 c Let s = -21 - -14. Let n = -4 - s. Let w be (-3 - -2) + 2/(-2). Which is the nearest to -1? (a) w (b) n (c) -1/4 c Let x = 0.4 + -1.4. Let j = x + 0. Let g = 0.5 - -1.5. Which is the nearest to j? (a) -0.3 (b) g (c) 3 a Let k = 79 + -79.05. What is the closest to 0 in 0.1, k, -1? k Let v = -1.29 - -0.29. Which is the nearest to 1? (a) 0 (b) 0.09 (c) v b Let y be (1/(-3))/((-2)/(-6)). What is the closest to y in -1/6, -0.2, 0? -0.2 Let x be (-85)/(-25) - (6/(-10) - -1). What is the closest to -10 in -1/2, x, -0.1? -1/2 Let l be ((-2)/(-10))/((-18)/(-12) + -2). Let f = -0.3 + 1.3. What is the closest to f in 5, -0.3, l? -0.3 Suppose -3t - 3 = -0t. Let l = 0.003 - 13.003. What is the nearest to t in l, -3, -1/2? -1/2 Let y = 0.45 - -0.05. Let i be -3 + 6/1 - 0. What is the closest to -2/5 in i, y, -1? -1 Let i = 0.2 - 0. Let q = 116 - 115.9. What is the closest to -2 in -3, i, q? -3 Let h = 149 + -151. Let x = 3.5 + -3. Which is the closest to 0? (a) 5 (b) x (c) h b Let i = -2.9 + 3. Let g(v) = v2 + 5v - 6. Let q be g(-6). Let m be (3 - 1) + q + -2. Which is the nearest to i? (a) 2/3 (b) m (c) -0.5 b Let t = 0.4 - -0.2. Let l = t - 0.8. What is the nearest to 0.4 in 2, -0.1, l? -0.1 Let q be 16/154 - (-4)/(-14). What is the closest to -0.1 in 0.5, -0.5, q? q Let j = -40.7 + 41. Let p = -0.2 + 0.3. Which is the closest to p? (a) 0.2 (b) j (c) -3 a Let y = 52 - 51. Which is the closest to -2/3? (a) 0.4 (b) 0.5 (c) y a Let t = 0.19 - -1.21. Let x = -1.6 + t. Which is the closest to 1/4? (a) x (b) 5 (c) 1 a Let u = -1.42 - -0.62. Which is the nearest to u? (a) 0.4 (b) -1/3 (c) 0.1 b Let m = 51/4 + -145/12. Let k = m + -1/3. Let i = -0.19 - -5.19. Which is the nearest to k? (a) i (b) 1/6 (c) 4 b Let x = -104/3 - -1982/57. Which is the nearest to 1? (a) -5 (b) x (c) -5/3 b Let v(w) = w*2 + 7w + 8. Let t be v(-7). Let y = t + -7. What is the closest to y in -0.2, 2, -3/4? 2 Let p be (3/213)/(-1). Suppose 5u = -t + 3, 5t - 2 + 17 = 5u. Let w be ((-10)/(-4))/(1/t). What is the closest to 0.1 in 2, w, p? p Let y = -4.146 - -0.146. Let p = -1.8 + 2. Which is the closest to 1? (a) y (b) p (c) -5 b Let k = -37 + 36.67. Let d = k + 0.03. Which is the nearest to -1/4? (a) d (b) 1/4 (c) 1 a Suppose 5x + 3 - 12 = j, 2j - 2 = 0. Let u = 3 - 3.1. Which is the nearest to u? (a) 4 (b) x (c) -1/5 c Let g = 10 + -7. Suppose 10 = -gq - 4u, -3q = -7q - 2u. Suppose qd = -2j - 4, -j - 5 = -3d - 23. What is the closest to 1 in 0.5, d, -1? 0.5 Let i = 4 - 1. Suppose 0 = -3s + 9, -5n = -is + 24. Which is the closest to 0.1? (a) -1/4 (b) n (c) -1 a Let j = 111 + -111. Let q = 231/4 + -58. Which is the nearest to q? (a) j (b) -1 (c) -4 a Let j = 1.1 - 1. Let r be 2/(-5)(-10)/38. Let h = 8 - 6. Which is the nearest to j? (a) h (b) -2 (c) r c Let q = -5 + 8. Let z = 0.2 - 0. Let p = 5/12 + 1/4. What is the nearest to p in q, z, -0.5? z Let j be 3/((-9)/(-3)) - (1 + -7). Let t = -4 + 4. What is the closest to t in j, -0.1, 0? 0 Suppose -3v = -5s + 15, 5s + 5 = 2s - v. What is the nearest to s in 4, -0.3, 1/3? -0.3 Let i be ((-3)/(-2))/1 - 1. Let w = -44 - -41. What is the closest to i in 1, -2, w? 1 Let d = 0 - -16. Let k = 16.3 - d. Let w = -0.3 - -0.2. Which is the closest to w? (a) k (b) -4 (c) 0.4 a Let i be -6 + -4 + 10 + 1-3. Which is the closest to -0.2? (a) -0.9 (b) i (c) -0.2 c Let x be 2/(-7) - (-1)/28. Let k = 180.3 - 181. What is the closest to x in k, -0.3, -1/3? -0.3 Let c = 325/3 + -107. What is the nearest to -2/7 in c, 0.4, -1.4? 0.4 Let v = -4 - -2. Suppose 0s - 4s - 5b - 17 = 0, 16 = 3s - 2b. Let l be s/4 - (-15)/(-22). What is the closest to 0.1 in l, -1/5, v? l Let r be ((-2	{ "pile_set_name": "DM Mathematics" }
ers are there in 574.5509cm? 5745509000 What is 867.7455ml in litres? 0.8677455 What is five eighths of a litre in millilitres? 625 Convert 0.163833 litres to millilitres. 163.833 How many seconds are there in 4/15 of a day? 23040 Convert 4965.08 millilitres to litres. 4.96508 How many meters are there in three tenths of a kilometer? 300 How many years are there in three fifths of a century? 60 What is 466.2675 years in decades? 46.62675 What is 15/4 of a week in minutes? 37800 How many nanoseconds are there in 6/25 of a microsecond? 240 How many months are there in 1/10 of a decade? 12 What is 42/5 of a century in decades? 84 How many micrometers are there in three fifths of a centimeter? 6000 How many millilitres are there in one tenth of a litre? 100 What is 6515.021 days in minutes? 9381630.24 What is 3074.507 nanoseconds in milliseconds? 0.003074507 Convert 0.3729932 millimeters to centimeters. 0.03729932 What is 260.081 litres in millilitres? 260081 Convert 84336.3 litres to millilitres. 84336300 What is 5/8 of a millisecond in microseconds? 625 What is 3/32 of a milligram in nanograms? 93750 Convert 935.6145 tonnes to grams. 935614500 What is 7/8 of a hour in seconds? 3150 What is three tenths of a day in seconds? 25920 How many litres are there in 555.2411ml? 0.5552411 What is 30926.9ml in litres? 30.9269 What is 64/3 of a day in hours? 512 What is 7727.129l in millilitres? 7727129 How many kilograms are there in 44.0133 tonnes? 44013.3 What is 2/125 of a second in milliseconds? 16 What is 73913.4kg in grams? 73913400 What is fourty-three halves of a microsecond in nanoseconds? 21500 What is three eighths of a gram in milligrams? 375 What is twenty-one eighths of a micrometer in nanometers? 2625 What is 11/8 of a meter in millimeters? 1375 What is thirty-one fifths of a decade in years? 62 How many hours are there in 5077146.6s? 1410.3185 How many millilitres are there in 3/10 of a litre? 300 What is fourty-four fifths of a kilogram in grams? 8800 What is 3/5 of a millisecond in microseconds? 600 How many nanometers are there in 5142.839cm? 51428390000 Convert 13895.208 microseconds to hours. 0.00000385978 Convert 105.3635499ms to weeks. 0.00000017421221875 How many centuries are there in 14854.82 millennia? 148548.2 What is 15/4 of a millimeter in micrometers? 3750 What is 33/10 of a tonne in kilograms? 3300 What is 11/4 of a millennium in months? 33000 What is two fifteenths of a millennium in months? 1600 How many minutes are there in 15.079062ms? 0.0002513177 What is 9.923605 centuries in years? 992.3605 How many millilitres are there in 3/25 of a litre? 120 How many millilitres are there in 855191.6 litres? 855191600 What is 5056.23 centimeters in kilometers? 0.0505623 What is 7/3 of a century in months? 2800 What is 5/4 of a tonne in kilograms? 1250 What is 13.41892 grams in tonnes? 0.00001341892 How many kilograms are there in 7/4 of a tonne? 1750 What is five sixths of a hour in minutes? 50 How many nanoseconds are there in 698.5853 weeks? 422504389440000000 What is 369213.2 millennia in months? 4430558400 What is 6/25 of a litre in millilitres? 240 What is 1346.441 centuries in millennia? 134.6441 How many years are there in 19031.817 months? 1585.98475 How many micrograms are there in five eighths of a milligram? 625 How many nanograms are there in six fifths of a microgram? 1200 What is fifty-one halves of a milligram in micrograms? 25500 How many millilitres are there in 3606.255l? 3606255 What is 27/4 of a kilometer in meters? 6750 How many centimeters are there in 9/25 of a kilometer? 36000 What is 3/32 of a millimeter in nanometers? 93750 What is 451.6609ml in litres? 0.4516609 What is twenty-seven quarters of a litre in millilitres? 6750 Convert 706.2165 millilitres to litres. 0.7062165 Convert 63.05623 minutes to nanoseconds. 3783373800000 Convert 7.52667 decades to years. 75.2667 How many meters are there in 98390.01 centimeters? 983.9001 How many millilitres are there in one twentieth of a litre? 50 Convert 5654.6739 nanoseconds to hours. 0.00000000157074275 What is 186.6633us in minutes? 0.000003111055 What is 7.9529103 nanoseconds in hours? 0.00000000000220914175 How many micrometers are there in 1/4 of a millimeter? 250 What is 31.79361 days in microseconds? 2746967904000 How many seconds are there in 0.5423313 days? 46857.42432 How many millilitres are there in 21/8 of a litre? 2625 How many millilitres are there in 3/8 of a litre? 375 What is thirty-one fifths of a millennium in months? 74400 What is 7/2 of a microgram in nanograms? 3500 What is seventy-one fifths of a day in minutes? 20448 Convert 7956.859ml to litres. 7.956859 What is 3/5 of a kilometer in meters? 600 What is 0.0274377 days in nanoseconds? 2370617280000 What is one tenth of a litre in millilitres? 100 What is 466.9102ml in litres? 0.4669102 What is 0.7800908 kilometers in millimeters? 780090.8 How many hours are there in 41/2 of a week? 3444 How many micrometers are there in one tenth of a millimeter? 100 How many months are there in 0.4632916 centuries? 555.94992 How many nanograms are there in thirty-two fifths of a microgram? 6400 How many milligrams are there in 3/8 of a gram? 375 What is 145.12221 months in centuries? 0.120935175 How many minutes are there in 0.0380521 days? 54.795024 Convert 3925.697 centimeters to nanometers. 39256970000 How many years are there in 0.5825674 millennia? 582.5674 How many millimeters are there in one twentieth of a kilometer? 50000 What is 75/4 of a century in months? 22500 Convert 0.3470884ml to litres. 0.0003470884 Convert 4417.084 grams to tonnes. 0.004417084 How many months are there in thirteen eighths of a millennium? 19500 What is 45/2 of a kilogram in grams? 22500 What is 15/16 of a millennium in months? 11250 How many millennia are there in 539.028 years? 0.539028 What is 981995.1 millennia in centuries? 9819951 What is thirteen fifths of a millisecond in microseconds? 2600 What is 5.126341 millilitres in litres? 0.005126341 What is 17533.761 hours in days? 730.573375 How many milligrams are there in 6/5 of a gram? 1200 How many nanometers are there in 21/5 of a micrometer? 4200 What is 32/5 of a century in months? 7680 How many milligrams are there in 0.841097g? 841.097 Convert 292.7999 millilitres to litres. 0.2927999 How many meters are there in 37/2 of a kilometer? 18500 How many decades are there in 42/5 of a millennium? 840 What is 62.96411 hours in milliseconds? 226670796 Convert 835156.1 hours to microseconds. 3006561960000000 How many millimeters are there in thirty-three fifths of a meter? 6600 What is 26/5 of a century in months? 6240 What is twenty-nine fifths of a kilogram in grams? 5800 Convert 2371.715 weeks to nanoseconds. 1434413232000000000 Convert 299.2456us to seconds. 0.0002992456 How many years are there in 19/4 of a millennium? 4750 How many seconds are there in 6/25 of a day? 20736 How many decades are there in 7.978776 months? 0.0664898 What is 183.8625ns in microseconds? 0.1838625 What is 1/4 of a litre in millilitres? 250 Convert 8538.387t to grams. 8538387000 What is 16/7 of a week in hours? 384 What is 0.0552841 weeks in milliseconds? 33435823.68 What is 1172.7918 months in centuries? 0.9773265 How many years are there in seventy-two fifths of a century? 1440 What is twenty-nine fifths of a microgram in nanograms? 5800 How many milligrams are there in seventeen halves of a gram? 8500 What is twenty-seven fifths of a litre in millilitres? 5400 What is twelve sevenths of a week in minutes? 17280 How many minutes are there in 1/30 of a hour? 2 What is five quarters of a microsecond in nanoseconds? 1250 How many minutes are there in twenty-seven fifths of a hour? 324 What is 12/25 of a litre in millilitres? 480 What is 3/32 of a kilometer in centimeters? 9375 What is 0.6546355 millilitres in litres? 0.0006546355 How many months are there in 0.481934 millennia? 5783.208 How many millilitres are there in 8.8695 litres? 8869.5 How many years are there in 647214.5 decades? 6472145 Convert 20118.915 microseconds to minutes. 0.00033531525 What is 426.7388 decades in years? 4267.388 How many nanometers are there in 3/40 of a micrometer? 75 What is 1/4 of a century in years?	{ "pile_set_name": "DM Mathematics" }
te ((-40)/80)/((153/342)/17). -19 What is ((-374)/51)/((-6)/273)? 11 What is ((-3)/12)/((-6)/(-312))? -13 (710/(-30))/(15/45) -7 What is the value of 336/142/(-18)-3? 8 ((-105)/((-2940)/(-728)))/1 -26 34/(-102)(-162)/(-24)(-5)/9 5/4 What is the value of (6/(-4))/(-3)-47948/(-7426)? 3 Evaluate 40/22540/(-16)21/(-98). 2/21 Evaluate -15(-16)/2400/(-2). 0 What is ((-2)/4)/((-357)/238)? 1/3 What is (366/305)/(2/(-15))? -9 Evaluate 30/54(-18)/4-6. 15 Calculate (12)/((-24)/18(-12)/8). 1 9(-2)/2058/(-6) 6 Evaluate 22/77(-546)/13. -12 What is ((-234)/26(-12)/54)/((-1)/6)? -12 Calculate 978/(-163)8/3. -16 Evaluate (7/14)/((-25)/663/30). -2/35 ((-4)/(-4))/(-4)162/18 -9/4 What is 20/4(-72)/144? -5/2 What is the value of (8/26)/((-794)/(-397))? 2/13 Calculate -2(16/((-1024)/48))/((-33)/2). -1/11 Calculate 13/2(60/(-50))/(6/(-30)). 39 Evaluate ((-6)/24)/(14/196). -7/2 (-639)/(-497)(-14)/(-3) 6 What is the value of ((-3042)/(-27))/(-26)3? -13 What is (((-8)/18)/((-12)/18))/(92/(-138))? -1 Evaluate -38((-1000)/(-190))/(-10). 20 Calculate ((-22)/(-143))/((-14)/(-364)). 4 What is the value of ((-28)/((-6720)/(-200)))/(10/18)? -3/2 What is ((54/240)/(9/12))/((-165)/(-25))? 1/22 What is the value of ((-8)/182)/((-212)/1378)? 2/7 What is (9/(-30))/((-3)/(-28))825/(-165)? 14 Evaluate (-2595)/(-4844)1/(-5). -3/28 15/258/(-6)250/(-400) 1/2 What is (-24)/(-64)70/(-15)? -7/4 What is ((-2)/(-30))/(86/(-3010))? -7/3 Calculate (6/15)/((-71)/5680). -32 What is the value of ((-34)/34)/((-70)/(-4))? -2/35 (350/(-840))/(110/(-88)) 1/3 Calculate (-122)/61(95/(-2))/(-5). -19 Evaluate (-13804)/580(-10)/14. 17 (348/232)/(3/2) 1 Calculate (-8)/(-3)228/(-760). -4/5 2(-5)/(-3)960/(-800) -4 (21/(-72))/(485/(-1940)) 1/9 10/(-220)3(-180)/27 10/11 Evaluate (-126)/4(-78)/(-18)(-48)/(-312). -21 What is 6(-80)/1236/66011? -24 What is ((-9)/(1125/(-20)))/(((-5016)/95)/(-22))? 1/15 What is 44/(-48)(-26)/143? 1/6 Evaluate (-110)/(-44)10/(-50)46/1. -23 What is 11(-85)/(-187)(-2)/(-10)? 1 Evaluate (-9)/741820/4095. -2/37 What is (-3)/91(-7272)/(-101)? -24 ((-3)/(-18))/((-190)/1520) -4/3 Calculate -22/24160/((-100)/5). 4/3 Calculate (10/(-2))/((-925)/37)-41. -4/5 What is 1/((-6)/129/(90/(-4)))? 5 What is the value of (-231)/28-1715/(-765)? -11/4 What is the value of ((-5)/(3975/(-20)))/(4/6)? 2/53 Calculate (-4)/((6/(-2))/(((-1323)/714)/21)). -2/17 What is (((-252)/378)/(1/6))/2? -2 ((-2)/(-28)189/27)/((-2)/(-44)) 11 (348/(-1450))/((-8)/(-180)) -27/5 What is ((-15)/9006)/((-2)/45)? 9/4 Calculate -1(-2)/(140/(-126)). -9/5 What is the value of (-16)/40(9/(-3))/(4/2)? 3/5 ((-4)/27)/(15/(45/(-2))) 2/9 122294/784 9 Evaluate ((60/(-35))/(6/42))/(-3). 4 What is ((-17)/(-51)42)/((1/1)/(-1))? -14 What is the value of (6(-4)/(-3))/((840/15)/28)? 4 What is the value of ((-3)/(-27))/((-102)/(-68)8/12)? 1/9 What is the value of ((-204)/(-5304))/((-15)/(-78))? 1/5 ((-60)/275)/((-78)/(-429)) -6/5 Evaluate ((-8)/(4/2))/((-25)/25). 4 -5((-91)/(-728))/(2/(-16)) 5 What is the value of (3/108)/(422/(-96))? -2/63 Calculate 19/1253/(-253). -19 Evaluate (10/(-9))/((-900)/1350). 5/3 ((6993/148)/63)/((-6)/4) -1/2 5/127(-9)/70 -3/8 Evaluate (-4(-4)/(-52))/((-4)/(-104)26). -4/13 What is the value of ((55/3)/11)/((-255)/18)? -2/17 ((-1)/2)/((9/45)/(2/(-55))) 1/11 (-5)/24061/2-4 1/4 What is the value of (-672)/(-288)((-18)/27)/(4/54)? -21 Evaluate (-6)/9((-110)/(-165))/(4/(-81)). 9 (-1136)/213(-9)/4 12 What is the value of ((-14)/(-21))/(-648/162)? -3/8 Evaluate (156/(-1365))/(-6(-3)/9). -2/35 Evaluate 152/190110/3652. 2/83 Evaluate 9/366648/486. 2/61 What is the value of 128/1248(-13)/2? -2/3 Evaluate ((-12)/93)/(168/(-132)). 22/7 ((-3)/45)/(28/(-72)(-24)/(-8)) 2/35 What is the value of (-124)/(-248)(80/(-125))/4? -2/25 What is (-24)/615/30? -2 Evaluate (((-81)/(-6))/(-9))/(3339/84). -2/53 Evaluate 1351/2214/22. 6/11 What is ((-336)/36)/(6/(-9)1)? 14 Calculate (-240)/8410/40. -5/7 Evaluate (-57)/3234/(-171). 26 3576/(-4470)(-10)/56 1/7 Evaluate 2-1(-1)/(((-272)/112)/17). -14 What is the value of 50/(-25)-112? 24 What is ((-20)/(-70))/((96/(-7))/(-8))? 1/6 Evaluate 8/(-12)9/84. -1/14 What is the value of (3/10)/(120/100)-2? -1/2 What is the value of (880/90)/(-22)(-2)/4? 2/9 What is the value of -1(24/2)/84? -1/7 What is the value of 45/(-12)(-228)/95? 9 What is ((36/(-60))/((-1)/3))/(-3)? -3/5 Calculate (((-2)/20)/(1/(-2)))/(2053/(-2053)). -1/5 (-7(-9)/(-378))/((-2)/4)-4 -4/3 760/418(-396)/(-270) 8/3 ((-11)/2)/(792/(-576)) 4 What is ((-18)/(-168))/(5/(240/9))? 4/7 Evaluate 35/(-4)(-144)/180. 7 What is the value of (-1)/((-3)/3)37/(-74)? -1/2 Evaluate (2/209)/(1517/50061). 6/19 (((-16)/14)/2)/(9/(189/78)) -2/13 (-11)/33216/(-360) 1/5 Calculate (1/(16/4))/((-1530)/(-816)). 2/15 Evaluate (((-8)/(-42))/(5(-2)/(-15)))/2. 1/7 Calculate ((2/6)/((-4)/(-12)))/((-3589)/(-194)). 2/37 What is (17/17682-2)/((-2)/(-4))? -1/13 Calculate ((-688)/(-129))/(10/15). 8 Evaluate ((84/(-45))/14)/((-2)/6). 2/5 (-9(-1)/30)/((-37)/(1295/168)) -1/16 Calculate 2(11/6)/(14/168). 4 What is ((-666)/144)/(-37)-62/9? -1/6 Calculate 4/3147/140. 7/5 Evaluate (146/(-2190))/(2/(-5)(-25)/60). -2/5 (22/(-99)9)/(-422/(-4)) -2/21 Evaluate (34/48)/((-32)/(-1280)). 10 What is the value of (-60)/(-24)(-2)/9264/110? -4/3 Evaluate 62000/(-1000)(-2)/4. 31 Evaluate (87/(-232))/(4/(16/(-2))). 3/4 (55/(-6))/(-11)12 10 Evaluate 1378/(-90). -13/5 What is the value of 14/112-40? 0 935/2618((-9)/(-15))/(-1) -3/14 What is 9/(-12)-6112/84? 6 What is the value of ((-1824)/(-323))/163(-2)/18? -2/17 Calculate (8/26)/((-2)/166384/(-5187)). 2 What is (6/(4(-8)/8))/((-6)/8)? 2 Calculate (12/(-8))/(24/(-768)-16). -3 Calculate 4(-43/90)/(18/(-27)). 4/5 Calculate -4(156/(-8))/(-13). -6 What is ((-1)/2)/(121/(-1452))? 6 Calculate (0/((-5)/((-10)/4)))/((-24)/6). 0 What is the value of (19/342-6)/(((-35)/7)/480)? 32 What is the value of 89/5162(-145)/(-30)? 1/12 What is (615/72(-72)/(-30))/(-5)? -3/5 What is the value of (-366)/54912/8? -1 Evaluate (6/((-4)/(-2)))/(2/23427). 13 What is (9/(54/48))/(7(-7)/(-147))? 24 Evaluate ((-1269)/(-6))/4721. 9 Calculate (-60)/2((-477)/1060)/((-18)/(-48)). 36 (-24)/144(-3)/(16/(-12)-3) 1/8 5/10(-160)/8 -10 Calculate ((-627)/1672)/((-1)/8). 3 What is 221/85(-5)/232/16? -13 Evaluate 50/3514-1. -20 Calculate 1/((-35)/(-50)1). 10/7 Evaluate 40/(-45)39/312. -1/9 Calculate (-2)/34(-168)/54613/(-2). -2/17 Evaluate ((-1485)/(-22))/(-45)30/(-9)-5. -25 Evaluate (-18)/((-63)/7)135/30. 9 6/(-92)18/(-27)(-1)/1 -1/23 What is the value of (-1)/(((-39)/(-12))/(-13)-2)? -2 Calculate (18/(-8))/(45/(-384)(-20)/25). -24 5181/(-942)2-1 11 What is (-2)/(3/27015)? -12 Calculate (-405)/45010/6192/18. -16 Evaluate (14/6)/((-168)/(-576)). 8 What is 2(27/4)/9-6? -9 What is -12((-57)/627)/(((-12)/22)/3)? -6 What is the value of ((-1)/(-3))/(((-1)/7)/((-72)/84))? 2 Evaluate (39/((-6084)/(-130)))/(2/4). 5/3 Calculate (66/4)/(-3)44/1452-9. 3/2 What is the value of (1781/26715)/(((-2)/(-1))/(-20))? -2/3 What is the value of (3225/430)/(5/(-12))? -18 Calculate (-16)/(-88)(-19)/(-57)(-3)/(-2). 1/11 (-2)/9198/(-121) 4/11 ((132/96)/(-11))/((-5)/10) 1/4 What is the value of 280/(-350)30/(-4)? 6 What is the value of (4/4242/6)/(8/36)? 3 What is the value of 6-225/1700? -3/17 What is the value of (678/5085)/((4/135)/(6/15))? 9/5 (549/183)/((-1)/(-11)) 33 What is (10/42)/(15/(-70))? -10/9 (18/(-648))/((-23)/920) 10/9 What is the value of 1/3(-4440)/(-185)? 8 Evaluate (-3)/(212/241). -3 Calculate (-4(-10)/(-600))/((-5)/50). 2/3 Evaluate ((6/(-56))/(26/1040))/((-12)/56). 20 Calculate ((-5)/3)/((17500/1080)/175). -18 What is ((-2)/(-10)-1)/((-16)/220011)? 5/2 What is the value of ((-9)/((-180)/104))/(32/(-80))? -13 Evaluate (2/(-6))/(625/(-1875)). 1 Evaluate ((-2299)/(-484))/(1/(-4)). -19 ((-55)/25)/(2189/(-995)) 1 What is the value of (6321/(-504))/438/(-14)? 1/6 What is the value of ((-112)/441)/(-4)((-495)/(-10))/11? 2/7 What is the value of 0/((((-2)/1)/(-2))/((-11)/22))? 0 Calculate (48/(-600))/((-12)/40). 4/15 Evaluate (14/7-1)/(-13). 2/13 What is (-1)/(-8)(-3)/6*(-562)/281? 1/8 What is	{ "pile_set_name": "DM Mathematics" }
5y - 68 + 523. Is y + 0 - d/(-1) a multiple of 23? True Let t(a) = -2a - 5. Let y be t(-5). Suppose -6o = -5p - 4o + 188, 0 = 5o - y. Is p a multiple of 5? False Let w(q) = -q3 - q2 - 5q + 5. Let d be w(-6). Suppose 128 = -4f + 428. Suppose -d = -5n + f. Does 13 divide n? False Let g(c) = -c3 + 9c*2 - 9c + 10. Let q be g(8). Let s be 0 + (3 - (2 - q)). Suppose p - 21 = -4d, 2d + sd + 2p - 24 = 0. Is 6 a factor of d? True Let j(y) = 14y + 8. Let k be j(-1). Is (k/(-15))/((-3)/(-120)) a multiple of 8? True Suppose -1420 + 82717 = 27z. Is 56 a factor of z? False Suppose -38j + 33j = 3a - 5269, -1760 = -a + 2j. Does 20 divide a? False Suppose 4538 = 34g - 43776. Does 9 divide g? False Let h = -9 - -43. Does 3 divide h(27/36)/(6/4)? False Let k(s) = -2s2 - 16s + 1. Let r be k(-8). Is (26 + r)(-2)/(-3) a multiple of 9? True Suppose -9s + 11s = -5r + 619, -1615 = -5s + r. Is 19 a factor of s? False Let u be (42/10 + -3)/(1/(-10)). Let i = u - -23. Is 10 a factor of i? False Let v(s) = -10s - 9. Suppose 95 + 10 = 5y. Let g = y + -25. Is v(g) a multiple of 16? False Suppose -2l + 528 = -14l. Let g = 357 + l. Is 12 a factor of g? False Is 16 a factor of -7 + 0 - (-815 + -2)? False Suppose 0 = -6s + 1119 + 1311. Is s a multiple of 81? True Let t = 606 - 262. Is 8 a factor of t? True Let x = -24 + 26. Let w(j) = 3j3 - 2j*2 - 2j. Let a be w(x). Suppose -v - 4 = -3v, -h - 2v = -a. Is h a multiple of 4? True Suppose 0 = -r + 6r. Let y be r + (-34)/2 + -1. Let h = y - -28. Is h a multiple of 5? True Let x(t) = 5t - 7. Let r(u) = u*2 + 3u - 14. Let a be r(-6). Is x(a) a multiple of 11? False Let a = 39 - 33. Suppose 315 = ah - h. Is h a multiple of 9? True Let f(j) = j3 - 9j*2 - 5j - 101. Is 14 a factor of f(14)? False Suppose -1701 = -4v - 3v. Is v a multiple of 9? True Suppose -7g + 4354 = -0g. Is 34 a factor of g? False Let c be 23/(5/(-4)(-4)/100). Suppose 4i - c = 16. Is i a multiple of 18? False Suppose 951 = 8f + 359. Is 7 a factor of f? False Suppose 3m - 91 = -5c, -4c - 12 = m - 89. Let u be c/14 - 80/(-140). Is 3 + 1/u-2 a multiple of 2? True Let w(t) = 23t*2 - 20t + 147. Does 42 divide w(7)? True Let k = 64 + 183. Suppose 8q - 727 = -k. Is 7 a factor of q? False Let q = -33 + 33. Suppose qm - 2m + 290 = 0. Is 23 a factor of m? False Let n(g) = -g3 + 4g*2 - 3g + 5. Let q be n(4). Suppose 564b = 559b - 95. Let w = q - b. Does 7 divide w? False Suppose -15k = -19k + 24. Is (-540)/(-8)(-2)/k-4 a multiple of 10? True Let r(b) = 6b3 + 6b*2 - 7b + 3. Does 13 divide r(3)? False Let n(y) = -38y + 4. Let w(g) = -g3 + 10g*2 + 11g - 4. Let b be w(11). Is n(b) a multiple of 20? False Let h(p) = 14p2 + 29p + 27. Does 21 divide h(-6)? True Let c(t) = 14t - 3. Let l be (-1 - -2)/(21/(-6) + 4). Is c(l) a multiple of 23? False Does 36 divide 197 + -3 + (-49)/(-7)? False Suppose 3x - 2v + 11 = 0, -4x - 5v = -7x + 4. Is 25 a factor of (-150)/(-2) - (7 + x)? True Suppose -221 = -3k + 5t, k + 2k + t - 251 = 0. Let z = k + 41. Is 27 a factor of z? False Suppose 0 = 3g + 4p - 1076, 2p - 1146 = -3g - 68. Suppose -6o + 248 = 4r - 2o, 0 = 5r - 5o - g. Does 26 divide r? False Suppose -4r + 471 = c, 0r = -2c + 4r + 966. Is c a multiple of 6? False Let t = -338 - -1094. Is t a multiple of 4? True Suppose -16r - 188 = -17r. Does 9 divide r? False Suppose -5v - 870 = -0n - n, -5v + 4320 = 5n. Is 12 a factor of n? False Does 18 divide -6 + 2 - (-2 + 4 + -942)? True Let t(c) be the third derivative of -c*6/120 + 13c*5/60 + 17c4/24 - c3 + 13c2. Is 9 a factor of t(14)? True Let q(y) = -12y - 18 - 7y2 - y3 - 3 + 3. Does 22 divide q(-7)? True Suppose -4v + v = -1578. Is 20 a factor of v? False Suppose 89 = 10i - 11. Let y(m) = m3 - 8m*2 - 21m + 22. Is 6 a factor of y(i)? True Let m = -155 + 182. Is 9 a factor of m? True Let c be 24/(-30) + (-18)/(-10). Suppose c = 3b - 20. Is b even? False Let m be (-4)/(-30) - (-2)/(-15). Suppose t + mt = -3a, 2a = 2t + 40. Is (56/(-3))/(10/t) a multiple of 14? True Let s(t) = 3t + 2. Suppose 2k + 4 = g, 3k + 9 - 3 = g. Let b be s(g). Suppose -ba = -a - 88. Does 17 divide a? False Does 12 divide 20/12 + -4250(-7)/42? False Let z(v) = -6v3 + 4v*2 + 2v - 2. Suppose -3a + 17 = 5q, 5a + 4q = a + 20. Suppose 3g + 2p = ap, -4g - p = 11. Is z(g) a multiple of 20? False Let h = 3078 + -1316. Does 6 divide h? False Suppose 421 = 5o - 5j - 604, 2j - 202 = -o. Is 11 a factor of o? False Suppose -54 = o + o. Suppose 11c - 14c = 48. Let l = c - o. Is l a multiple of 6? False Is 4/6 - 2457/(-81) a multiple of 2? False Suppose 13n + 831 = 5z + 11n, -3n = 5z - 816. Is 11 a factor of z? True Suppose 1568 = 4c - 2c. Suppose -u - 6u = -c. Suppose -3q - 4h + u = 0, -3q - 4h + 176 = 2q. Is 19 a factor of q? False Let h = -22 + 22. Suppose 2g - 7g + 3f = -328, h = -g - 3f + 80. Let y = g - 20. Is y a multiple of 10? False Let s(j) = 3031j2 - j - 1. Does 13 divide s(1)? True Let o = -193 + 459. Does 19 divide o? True Let y(g) = 18g + 4. Suppose 7w = 11w - 32. Let k(p) = 6p + 1. Let h(l) = wk(l) - 3y(l). Is 13 a factor of h(-5)? True Let o = 95 + -92. Suppose 0 = -2c + c + 4. Suppose 15 = -ob, 2b - 77 - 33 = -ci. Is 25 a factor of i? False Let g be (-1344)/(-70) + 1/(-5). Let d = g - 16. Suppose 0h - dh = -39. Is h a multiple of 13? True Suppose 3g - 25 = -7. Let n(l) = -l*3 + 12l*2 - 4l - 1. Let u be n(g). Suppose -4c - 15 = -u. Does 11 divide c? True Suppose -i - 4i = -4c - 75, -2c - 3i = 21. Does 17 divide c/9 + (-2320)/(-15)? True Suppose -153 = -12y + 3y. Does 14 divide y? False Let i(o) = -1. Let p(u) = 7u + 1. Let v(n) = -3i(n) + p(n). Is v(1) a multiple of 2? False Suppose 3m = 5m - 1140. Does 30 divide m? True Suppose -4l + 567 = r, -40 = 5l - 4r - 733. Is 29 a factor of l? False Suppose -17 = -7t + 18. Suppose -x + z + 15 = 3, tz = -3x + 20. Is x a multiple of 3? False Let p = -256 + 448. Is 8 a factor of p? True Let d(q) = q3 - 13q*2 - 2. Let w be d(13). Is (-68)/(-10)(-10)/w a multiple of 11? False Let f = -35 - -49. Suppose -15q + fq + 65 = 0. Suppose -q = -h - 3j, -4h + 5j + 292 = j. Is h a multiple of 22? False Let v be (-2)/((-26)/22 - -1). Let r(m) = 4 - 7m + 0 + 2m2 - v. Is r(-5) a multiple of 26? True Suppose 6g - 100 = 140. Suppose 18l = 14l + g. Is 10 a factor of l? True Suppose -12g = -7g + 845. Let p = -104 - g. Does 13 divide p? True Suppose 2q - 75 = -u + 627, 5u - 1053 = -3q. Does 6 divide q? False Let m be 1/((-2)/(-42)3). Does 10 divide 0 - -19 - (-8 + m)? True Suppose 837 = -5d - 4a, 2a + 376 = -4d - 290. Let t = 73 - d. Is 25 a factor of t? False Let i be 3((-24)/42 + 304/42). Suppose -203 - 252 = -5s - 3b, -4b + i = 0. Is s a multiple of 18? False Is 9 a factor of -12 - -13 - (1 + -250)? False Suppose 2j = 3j - 199. Suppose c - 66 = 5z, -4c + 4z + j = -65. Is c a multiple of 22? True Let p(n) = -11n*2 - 1. Let c be p(-1). Let f = -12 - c. Suppose f = -4k + 147 - 11. Is k a multiple of 17? True Let t(j) = -10j2 - 4j - 1. Let k(z) = z. Let n(w) = -5k(w) - t(w). Suppose -f + 10 = 4f. Does 14 divide n(f)? False Let q be 32/(-3) - 6. Let t be (32/q)/(1/(-4)). Suppose 2b - t - 28 = 0. Does 15 divide b? False Suppose -y + 0y + 4s = -900, y + 4s - 900 = 0. Suppose -8f = -12f + y. Does 21 divide f? False Suppose -6y + 3 = o - y, -2o = 4y - 6. Suppose n = on + 6, -3k + 39 = -4n. Is 3 a factor of k? True Is (-4 - -2) + 29 + (-57 - -52) a multiple of 22? True Let w(g) = g2 - 13g + 1. Let o(c) = -c*3 + c + 13. Let b be o(0). Let h be w(b). Is ((-28)/5)/(h/(-15)) a multiple of 14? True Suppose 0 = -2m - 2b + 8, 5m + b = -0m + 24. Is 42 a factor of (-1 + (-85)/(-1))/(2/m)? True Let b(u) = -6u*3 + 8u*2 - 9u - 17. Is 78 a factor of b(-7)? True Suppose 0y = 4y - 20. Suppose 0i + yi = w + 484, 0 = -5w + 5. Is 11 a factor of i? False Suppose 5499 = 17r - 910. Does 18 divide r? False Suppose 0 = -94s + 74s + 12040. Is s a multiple of 14? True Let z(p) = 6p2 + 4p + 6. Let t be (-3 + -2)/(-3 - (4 - 8)). Is 17 a factor of z(t)? True Let x(j) = 3*	{ "pile_set_name": "DM Mathematics" }
digit of x? 1 Let l(q) = 45q2 - 4q - 12. Let m be l(-4). Suppose 7h + m = 2922. What is the tens digit of h? 1 Let x be -30(0 - (-20)/25). Let g = x - -32. Suppose gh = 4h + 296. What is the tens digit of h? 7 Let k = -686 - -3508. What is the tens digit of k? 2 Let i(w) = 123w2 + 4w + 13. What is the tens digit of i(-2)? 9 Let h(l) = -l*2 + l + 5. Let t be h(0). Let n(x) = 3x + 12x2 - 19x*2 + 10x*2 + t. What is the units digit of n(-4)? 1 What is the hundreds digit of (262/3)/(-6 - 185/(-30))? 5 Suppose -2f = 6, f = 6t - 9t + 9261. What is the thousands digit of t? 3 Let s = 27 - 24. Suppose 0h - 4g + 1086 = sh, -2g = -2h + 710. What is the tens digit of h/8 + 6/24? 4 Let y be 1 + -2 + 3 + (-35)/(-5). Suppose -109 + 1954 = yr. What is the units digit of r? 5 Suppose 5a = 5350 - 1710. What is the hundreds digit of a? 7 Let b(i) = -i2 + 10i + 50. Let d be b(15). Let x = 49 - d. What is the tens digit of x? 7 Suppose -5x - 277 + 18 = -c, 4x - 1036 = -4c. What is the units digit of c? 9 Let l be (3 + -5)/((-8)/(-140)). Let g = 104 + l. What is the units digit of g? 9 Suppose -3m + 3467 = -4h + 956, -3m + h + 2511 = 0. What is the hundreds digit of m? 8 Let c(h) = -h*3 - 8h*2 - 13h - 6. Let b be c(-6). Let v be -4 + 38 + -3 + b. Suppose 3p - 95 = v. What is the units digit of p? 2 Let p = -17 + 20. Suppose pt = -3t + 168. What is the tens digit of t? 2 Let h = 248 - 515. Let n = h + 444. What is the tens digit of n? 7 Let l(g) = -g3 + 5g*2 - 2g - 5. Let r be l(4). Let b be ((-36)/24)/(18/48). What is the tens digit of (3 + 59 - b) + r? 6 Let a = 49 + -46. Suppose -g - 4w = -8w - 237, ag + 2w = 641. What is the tens digit of g? 1 Let o(l) = 4l. Let j be o(4). Suppose -603 = -jp + 7p. What is the tens digit of p? 6 Suppose -t - 4t + 20 = 0. Suppose 2i - 5i + 26 = 4m, 16 = tm - 2i. Suppose mg + 47 = l + 4g, -2l = 5g - 94. What is the units digit of l? 7 Let g = -333 - -959. What is the tens digit of g? 2 Let f(z) = -6z3 - z2 - 3z - 4. Let a(t) = -t2 + t - 2. Let n be a(0). What is the tens digit of f(n)? 4 Let o = 3607 - -171. What is the tens digit of o? 7 Let b(j) = -j3 + 5j + 3. Let o be b(-3). Suppose -2i + 2a + 6 = 4a, 0 = -3a + o. What is the units digit of i/211-3? 3 Suppose 3w = 5j + 1795 + 967, -3w + 2754 = 3j. What is the hundreds digit of w? 9 Let i(t) = 24t + 22. Let a be i(-2). Let w = -80 + 37. Let j = a - w. What is the units digit of j? 7 Suppose 2x = -2t + 7t + 337, -3x = -2t - 489. What is the hundreds digit of x? 1 Let q = -11 - 4. Let s be q/(-3 + (-27)/(-6)). What is the units digit of (s + 5)(0 + -1)? 5 What is the tens digit of (-102)/(-2) - (-25 - -32)? 4 Suppose -23i + 17i + 1224 = 0. What is the units digit of i? 4 Suppose 0 = -62f + 9f + 66197. What is the tens digit of f? 4 Let y = 94 - 92. Suppose 913 = 3q + 5d, yq + 5d - 877 = -260. What is the tens digit of q? 9 Let j(d) = 2d*3 + 4d - 5. Let i be 14/4 - 1/(-2). Suppose -1 - 7 = -iy. What is the units digit of j(y)? 9 Suppose -5x = -32 - 18. Suppose 0 = -xl + 12l - 92. What is the units digit of l? 6 Let b be (-2)/(-4)(3 + -3). Suppose b = 5y + 12 - 47. What is the units digit of y? 7 Let w(u) = 11u2 + 2. Let s be w(1). Suppose 0 = -5k + 3t + 9, 4k - 5t - 2 - s = 0. Suppose -5h + 65 = -kh. What is the units digit of h? 3 What is the hundreds digit of ((-4290)/8)/(26/(-104)) + 6? 1 Let h = 113 - -354. What is the units digit of h? 7 Let u(d) be the first derivative of 2d*2 - 3d - 5. Let s be u(2). Suppose -sz + 97 = -108. What is the units digit of z? 1 Suppose 5w - 459 + 59 = 0. Suppose 3o - w = o. What is the units digit of o? 0 Suppose -14a - 231 + 1939 = 0. What is the hundreds digit of a? 1 Suppose 0a = -4a + 1028. What is the units digit of a? 7 Suppose -17 = 3m + 13. Suppose -5 = -o + 6o. Let z = o - m. What is the units digit of z? 9 Let u = 625 - 490. What is the tens digit of u? 3 What is the hundreds digit of ((1 - -4)/(-5))/(4/(-692))? 1 Suppose 6z = 10z + 2340. What is the units digit of z/26(-2)/1? 5 Let w be (2/4)/(2/28). Let n(l) = -21l - 211. Let g be n(-11). Let r = g + w. What is the tens digit of r? 2 Suppose 10g - 3670 - 3400 = 0. What is the units digit of g? 7 Let x(w) = -13w + 20. Let k be x(4). What is the tens digit of (k/(-12))/((-3)/(-108))? 9 Let y(b) = 3b2 - 21b - 2. Let k be 2825/130 - 4/(-26). What is the tens digit of y(k)? 3 Suppose -8v = -7v - 14v. Suppose -13y + 90 = -12y - 4a, v = -4a + 20. What is the hundreds digit of y? 1 Let n(m) = -m*2 + 2m + 27. Let w be n(-5). What is the tens digit of ((-3)/(-12)139)/((-2)/w)? 3 Let z(w) = w2 + 11w - 15. Let d be z(-12). What is the units digit of 3/9 - 101/d? 4 Let c be 33/222/(-1). Let t(s) = -2s3 - s2 - 2s - 3. What is the units digit of t(c)? 8 Let q(s) = 4s + 6. Let c be q(-4). Let j = -30 - c. What is the units digit of (64/j)/((-2)/20)? 2 Suppose 0 = 2b - f - 998, 0 = -2f + 4 - 12. What is the tens digit of b? 9 What is the tens digit of (10 - (3 - -4)) + 772? 7 What is the tens digit of 70-34(-5)/25? 7 Suppose 326 = -3h + 4f + 1344, 5f = -4h + 1378. Suppose k - 378 = -4a, -5k + 123 + h = 5a. Suppose 0 = 6c - c - a. What is the units digit of c? 9 Let q(u) = 20u + 186. What is the units digit of q(7)? 6 Let i(w) = -2w3 + w2 + 152. Let y be i(0). Let q = y + -94. What is the tens digit of q? 5 Let w be (-22)/(-55) - (-1226)/10. Let g = -72 + w. What is the units digit of (-28)/(-6) - (-17)/g? 5 Let w(j) = -j - 18. Let n be w(-11). Suppose -5t - 2 = v - 3t, 4v - 4t = 52. Let q = v + n. What is the units digit of q? 1 Suppose 2 = -c - 3y, c + 2y = -2c - 6. Let k(b) = 5b - 13. Let u(g) = 5g - 13. Let p(f) = cu(f) + 3k(f). What is the tens digit of p(6)? 1 Suppose -6t + 2t = 3q - 147, 2t + 5q = 91. Let f = t + -29. Suppose -fr - 180 = -4k, r + 2r = -3k + 141. What is the tens digit of k? 4 Let p be (-11)/(-5) + (-2)/10. Suppose -pv = -0v - 256. Suppose -96 = -c - 2c + q, 4c = -5q + v. What is the tens digit of c? 3 Let z(j) = 3j - 12. Let d = 5 - 0. Let i be z(d). Suppose 0c = 4o - 5c - 23, io - 2c - 19 = 0. What is the units digit of o? 7 Suppose 5i = 4l - 184 + 51, 2i - 43 = -l. Let r(z) = -z*3 - 17z*2 + 17z - 16. Let x be r(-18). Suppose -37 = -xt + l. What is the tens digit of t? 3 Let o = -1021 - -4237. What is the units digit of o? 6 Let q(r) = -r2 + 8r - 5. Let f be q(8). Let v = 11 + f. Suppose vx - 40 = 2x. What is the units digit of x? 0 Suppose 5a + 4024 = q, 8a - 7a - 2 = 0. What is the units digit of q? 4 Let b be 158/6 + 2/(-6). Let g(v) = v2 - 4v + 6. Let o be g(3). Suppose 4n + 4d = 104, 0 = on + d - 50 - b. What is the tens digit of n? 2 Let b be (-4)/18 - (-96)/(-54). Let t be (-5)/((-5)/b) - -156. Let d = t - 84. What is the tens digit of d? 7 Let g(l) = 4l*2 + 104l - 53. What is the hundreds digit of g(24)? 7 Suppose -5k = -4a - 10, -4k + 2a = -0k - 8. Suppose kz - 129 = 141. What is the units digit of z? 5 Let j = 171 - 31. What is the hundreds digit of j? 1 Suppose -3z + 555 = -0i + 3i, -4z + 4i + 732 = 0. What is the tens digit of z? 8 Let p = 60 - 60. Suppose 0i + 15 = 3i. Suppose -ij - 2k - 3k + 100 = p, -k - 94 = -5j. What is the units digit of j? 9 Suppose 0 = -4w - 4f + 168, 3w - 2w - 2f = 45. What is the units digit of w? 3 Let b(p) be the third derivative of 31p4/24 - p3/6 + 7p*2. What is the units digit of b(5)? 4 Suppose 6r + 20 = 8r. Suppose -1100 = -rw - w. What is the units digit of w? 0 Let o be (-35)/(-14) + 3/(-6). Suppose 2w = -3w - q + 56, 3w - oq - 31 = 0. What is the tens digit of w? 1 Let z(p) = -23p - 31. What is the tens digit of z(-16)? 3 Suppose 3g = -3, -3g - 2g - 20 = -3c. Suppose -3z + 20 = c. What is the units digit of z? 5 Let h(i) = -i*3 - 4i*2 - 4i. Let d be h(-3). Suppose 4n = -1 - d. Let x = 13 - n. What is the tens digit of x? 1 Let t(w) be the third derivative of -4w*4/3 + 2w*3/3 - 25w*2. What is the tens digit of t(-4)? 3 Let o = 6 + -6. Suppose -29 = 5h - 5d - 4, o = -5h + 3d - 27. What is the tens digit of (-28)/8(h + 0)? 2 Suppose -2	{ "pile_set_name": "DM Mathematics" }
e the second derivative of n*4/6 - n. Let r(j) = -9j + 7j + j. Give v(r(t)). 2t2 Let y(r) be the third derivative of -r7/1680 + r*5/30 - 4r*2. Let s(v) be the third derivative of y(v). Let x(a) = 3a. Give x(s(n)). -9n Let y(c) be the second derivative of c - 3/2c*2 + 0 - 1/8c*4 + 0c3. Let j(b) be the first derivative of y(b). Let f(u) = -u2. Calculate f(j(r)). -9r2 Let j(t) = 5t*2. Let x(r) = -4r + 0r + 3r. Calculate x(j(q)). -5q2 Let t(w) = -4w*2. Let u(d) = 34d. Determine u(t(q)). -136q2 Let o(m) = 12m*2 + 9m. Let l(n) = n*2 + n. Let y(b) = -9l(b) + o(b). Let w(r) = 6. Let i(k) = k + 27. Let a(t) = -2i(t) + 9w(t). Determine a(y(s)). -6s2 Let d(z) = z + 2. Let h be d(-8). Let s be (8/h)/((-10)/15). Let n(t) = -2t. Let c(o) = -2o. Let k(l) = sn(l) - 3c(l). Let r(v) = -2v. What is k(r(f))? -4f Let q(c) be the third derivative of 7c*5/60 + 2c*2. Let g(f) = -f - 3. Let t(l) = 2. Let n(s) = 2g(s) + 3t(s). Calculate n(q(h)). -14h*2 Let r(y) = -23y2. Let n(z) be the second derivative of z3/3 - z. What is r(n(a))? -92a2 Let f(s) be the third derivative of 1/4s*4 + 4s*2 + 0s*3 + 0 + 0s. Let x(j) = 2j2. Determine f(x(c)). 12c*2 Let x(t) = 2t*2. Let d be 3/3(-1 + 3). Let u(p) = 3p2 - 2p2 + pd - 5p2. Give u(x(o)). -12o4 Let k(j) = j2 - 70. Let d(t) = -t. Calculate k(d(a)). a*2 - 70 Let t(m) = -53m*2. Let v(k) = 5k. Calculate t(v(r)). -1325r2 Let h(s) = 5s. Let k(n) = 272n2. Give h(k(p)). 1360p2 Let v(t) = t2. Let s = 39 + -60. Let y = -15 - s. Let p(n) = n + yn - n. Give p(v(i)). 6i*2 Let n be ((-5)/(-15))/((-1)/(-12)). Let j(q) = -6q + 3q + nq. Let y(m) = -13m2. Give j(y(k)). -13k*2 Let v(x) = 3x. Let b(h) = 333h2 - 72h - 72. Let z(i) = 23i2 - 5i - 5. Let n(y) = 5b(y) - 72z(y). What is v(n(a))? 27a2 Let v(w) = -w2. Let r(j) be the third derivative of 7j*4/6 - 15j*2. Give v(r(o)). -784o*2 Let l(x) = -48x. Let n(s) = -4s. Determine l(n(q)). 192q Let r(i) = -i*2. Let h(l) = -2174l*2. Give h(r(g)). -2174g4 Let p(a) = a2 + 2a. Let v(q) = -5q*2 - 9q. Let l(x) = 9p(x) + 2v(x). Let t(f) = -4f2 - 5f*2 + 7f*2 + 5f*2. What is l(t(u))? -9u*4 Let c(y) = 12y - 1 - 14y + 1. Let n(s) = 2s. Determine c(n(z)). -4z Let u(c) = 1533c + 147. Let j(p) = 52p + 5. Let s(m) = -147j(m) + 5u(m). Let k(d) = 2d. Calculate k(s(n)). 42n Let f(j) = 2j*2. Let r(d) = 814d + 2. Determine r(f(q)). 1628q2 + 2 Let z be (-1)/((-3)/(-3)) + 3. Let a(w) = w2 - 3w*2 - 6w*z + 12w2. Let k(j) = -j2. What is a(k(f))? 4f4 Let n(o) = -5o*2 - 4o. Let b(x) = 7x2 - 7x - 10x2 - 6x*2. Let q(f) = 4b(f) - 7n(f). Let m(a) = -10a*2. Give m(q(s)). -10s4 Let w(i) be the second derivative of -i3/6 - i. Let c(g) = 4g2 - 7g - 7. Let b(j) = 4j2 - 6j - 6. Let h(k) = -7b(k) + 6c(k). Determine w(h(m)). 4m2 Let y(v) = -70v. Let k(i) = 2i. Determine y(k(f)). -140f Let x(j) = -11j - 3. Let m(z) = 7z*2. What is m(x(r))? 847r*2 + 462r + 63 Let a(w) = w - 2w - 2w. Let n(k) = -k*2. Let m(g) = 2g*2. Suppose -3o + 40 = 2f, -3f = -2o - 2f + 15. Let s(u) = on(u) + 6m(u). Determine a(s(j)). -6j2 Let d(y) = -y2 - y - 1. Let n(j) = 6j*2 + 4j + 4. Suppose 3f - 1 = 17. Let m = -5 + f. Let h(s) = mn(s) + 4d(s). Let l(i) = 4i*2. Give h(l(p)). 32p*4 Let s(y) = -1881y*2. Let d(r) = 4r. What is s(d(k))? -30096k2 Let v(a) be the first derivative of -1/4a*4 + a + 0a*3 + 0a2 - 2. Let h(u) be the first derivative of v(u). Let w(k) = k2. What is h(w(y))? -3y4 Let k(z) = z. Let b(u) = 6u. Let g(x) = -3b(x) + 15k(x). Let v(d) = 2d + 4d - 2d - 7d. What is v(g(m))? 9m Let u(b) be the first derivative of b2/2 + 12. Let h(x) = 12x. What is u(h(t))? 12t Let u(l) = 2l*2 - l + 1. Let f be u(1). Let j(m) = 3m*2 - fm2 + m2. Let q(b) = -11b + 21b - 7b. Determine j(q(h)). 18h*2 Let v(c) = 7c*2. Let a(z) = 22z*2 + 2z. Give a(v(r)). 1078r4 + 14r*2 Let x(l) = 3l. Let f(p) = -9p. Let v(g) = 8g. Let o(t) = 4f(t) + 5v(t). Give o(x(s)). 12s Let c(t) = -3t*2. Let g(a) = -8a - 17. Let m(j) = j + 2. Let x(o) = -6g(o) - 51m(o). What is c(x(d))? -27d2 Let i(v) = -13v. Let u(l) = -2l. What is i(u(c))? 26c Let q be ((-2)/6)/(4/(-24)). Let a(d) = qd + d - d. Let x(i) = -2i. Determine x(a(t)). -4t Let w(k) be the third derivative of 17k*5/20 + 13k*2. Let q(b) = -2b*2. Determine q(w(d)). -5202d*4 Let g(l) = -l. Let w(m) = -10m. Let u(k) = -6g(k) + w(k). Let t(h) = -6h*2. Give t(u(s)). -96s*2 Let u(g) = -6g + g + 2g. Suppose 0r = r - 68. Let m(y) = 68y - ry + 3y2. What is m(u(v))? 27v*2 Let i(v) = -11v2. Let r(k) = -k2 + 2k. Let n(c) = c2 - c. Let h(a) = -2n(a) - r(a). Determine h(i(q)). -121q4 Let i(y) = 3y2. Let z(x) = x2. Let k(l) = 2l2. Let t(u) = -3k(u) + 2z(u). Determine i(t(v)). 48v*4 Let o(s) = 8s - 6s - 2s - s. Let r(m) = -7m2 - 2m + 2. Let n(g) = -155g2 - 45g + 45. Let k(v) = 2n(v) - 45r(v). Calculate k(o(w)). 5w2 Let m(l) = -356l + 173l + 183l + 2l2. Let w(q) = -11q*2 + 5q. Let b(u) = 54u2 - 24u. Let y(p) = 5b(p) + 24w(p). What is y(m(c))? 24c4 Let f(t) be the first derivative of 0t*2 + 8/3t*3 + 0t - 4. Let n(s) = s. Give n(f(x)). 8x2 Let d(o) = -13o. Let u(c) = -2c. Let h(j) = -d(j) + 6u(j). Let y(s) be the first derivative of 5s2/2 - 1. Give h(y(k)). 5k Let t(h) = 20h. Let f(p) = 22p. Determine f(t(o)). 440o Let s(x) = 0x - 3x - 2x + 3x. Let w(i) = i. Give w(s(c)). -2c Let k(o) = -4o. Let z(j) = -481j*2. Give z(k(f)). -7696f2 Let u(t) = t2. Let x = 8 + -14. Let d be (-2 - 0)/(3/x). Let n(y) = dy2 - y2 - y2. What is n(u(p))? 2p*4 Let l(g) = 27g2. Let y(x) be the second derivative of -x3/6 + 23x. Calculate l(y(r)). 27r*2 Suppose 0 = w - 2w, -3w = -h + 3. Let m(j) = -5 + hj + 5. Let b(g) = -g - g*2 + g. What is m(b(r))? -3r*2 Let u(z) = -2z + 30 + 34 - 64. Let m(s) = -s + 7. Let g be m(5). Let y(f) = -5f2 + 2fg + f2. Determine y(u(q)). -8q2 Let t(u) = 11 - 11 - u2. Let k(f) be the second derivative of 1/6f*4 + f + 0f*3 + 0 + 0f*2. What is k(t(g))? 2g*4 Suppose -3u - 2 = -17. Suppose -5v - 5d = -25, 4d = uv + 1 - 26. Let c(s) = -vs - 5s + 8s. Let l(o) = -2o*2. What is c(l(f))? 4f*2 Let b(l) = 2l*2 + 4l - 4. Let d(s) = 2s2 - s - 11 + 7s + 5s + 4s*2. Let o(k) = -11b(k) + 4d(k). Let i(x) = -6x*2. Give i(o(a)). -24a*4 Let o be (-1 - 0)/(6/(-18)). Let a(d) = -d - 4d + 0d + od. Let f(k) = -3k + 2. Let t(h) = 16h - 11. Let c(z) = -22f(z) - 4t(z). Determine a(c(v)). -4v Let o(b) = 16b*2 - 3b*2 - 4b2. Let v(d) be the second derivative of d4/12 - d. What is v(o(j))? 81j4 Let a(u) = 3u. Let l(k) = -4k. Let m(h) = -6h. Let c(t) = 5l(t) - 4m(t). Give c(a(i)). 12i Let g(s) = 7s*2 - 7s. Let n(f) = -4f2 + 3f. Suppose 2h = -2, 4u - 22 = -2h + 4. Let d(y) = un(y) + 3g(y). Let k(j) = 2j. Give d(k(c)). -28c2 Let c(b) = -25 + 25 + 2b*2. Let r(o) = -o. Let q(k) = -6k. Let a(v) = q(v) - 4r(v). Determine c(a(z)). 8z*2 Let w(k) = -544k. Let r(n) = -2n. What is w(r(l))? 1088l Let v(o) = 6o. Let p(a) = a2 - 2. Let i(y) = 3y*2 - 9. Let h(k) = 2i(k) - 9p(k). What is h(v(q))? -108q*2 Let z(r) = -5r2. Let s(w) = -81 + 43 - w2 + 38. Calculate s(z(l)). -25l4 Let l be 2-1 + 2 + -2. Let d(m) = -m*2 - 2. Let w(j) = -3j*2 - 5. Let c(x) = lw(x) + 5d(x). Let q(k) = 0 - 3k + 0. What is q(c(u))? -3u2 Let u(a) = -17a*2 - 14a. Let y(h) = 16h2. Calculate u(y(b)). -4352b*4 - 224b*2 Let g be (-1 - -2)/((-2)/(-4)). Let k(p) be the second derivative of 1/6p*3 + 0 + p + 0p*g. Let m(f) = 2f*2. Give k(m(i)). 2i*2 Let h(n) = -12n. Let c(j) = 20j2 + 14j - 14. Let v(l) = 7l2 + 5l - 5. Let m(d) = 5c(d) - 14v(d). Calculate m(h(a)). 288a2 Let g(x) = 3x*2 + 4x - 4. Let l(z) = 4z2 + 5z - 5. Let d(w) = 5g(w) - 4l(w). Let f(q) be the second derivative of q*4/4 + 9q. What is f(d(v))? 3v4 Let f(d) = 3d*2. Let h = -13 + 40/3. Let m(a) be the first derivative of ha**3 - 2	{ "pile_set_name": "DM Mathematics" }
ided by 17. 10 What is the remainder when 234 is divided by 59? 57 What is the remainder when 292 is divided by 98? 96 Calculate the remainder when 2278 is divided by 19. 17 What is the remainder when 324 is divided by 105? 9 What is the remainder when 105 is divided by 27? 24 What is the remainder when 69 is divided by 52? 17 What is the remainder when 11086 is divided by 24? 22 Calculate the remainder when 1577 is divided by 17. 13 What is the remainder when 157 is divided by 25? 7 Calculate the remainder when 272 is divided by 31. 24 What is the remainder when 815 is divided by 82? 77 What is the remainder when 2511 is divided by 194? 183 Calculate the remainder when 102 is divided by 7. 4 What is the remainder when 101 is divided by 90? 11 Calculate the remainder when 25801 is divided by 47. 45 Calculate the remainder when 339 is divided by 32. 19 Calculate the remainder when 92 is divided by 27. 11 Calculate the remainder when 1482 is divided by 18. 6 What is the remainder when 145 is divided by 47? 4 What is the remainder when 18 is divided by 10? 8 Calculate the remainder when 4688 is divided by 7. 5 Calculate the remainder when 184 is divided by 59. 7 Calculate the remainder when 82 is divided by 45. 37 What is the remainder when 83 is divided by 18? 11 Calculate the remainder when 393 is divided by 100. 93 Calculate the remainder when 131 is divided by 47. 37 Calculate the remainder when 15 is divided by 8. 7 What is the remainder when 2311 is divided by 21? 1 Calculate the remainder when 171 is divided by 50. 21 What is the remainder when 156 is divided by 120? 36 What is the remainder when 6697 is divided by 231? 229 Calculate the remainder when 819 is divided by 69. 60 Calculate the remainder when 72 is divided by 19. 15 What is the remainder when 24 is divided by 20? 4 Calculate the remainder when 100 is divided by 26. 22 Calculate the remainder when 581 is divided by 37. 26 Calculate the remainder when 201 is divided by 25. 1 What is the remainder when 8027 is divided by 365? 362 Calculate the remainder when 105 is divided by 27. 24 Calculate the remainder when 2553 is divided by 848. 9 Calculate the remainder when 278 is divided by 21. 5 What is the remainder when 666 is divided by 14? 8 Calculate the remainder when 1286 is divided by 117. 116 Calculate the remainder when 6716 is divided by 5. 1 What is the remainder when 150 is divided by 31? 26 Calculate the remainder when 176 is divided by 34. 6 Calculate the remainder when 39 is divided by 5. 4 Calculate the remainder when 1020 is divided by 297. 129 What is the remainder when 8190 is divided by 128? 126 Calculate the remainder when 642 is divided by 156. 18 Calculate the remainder when 357 is divided by 193. 164 What is the remainder when 10 is divided by 7? 3 What is the remainder when 191 is divided by 24? 23 What is the remainder when 629 is divided by 21? 20 Calculate the remainder when 1365 is divided by 229. 220 What is the remainder when 269 is divided by 50? 19 Calculate the remainder when 980 is divided by 45. 35 Calculate the remainder when 99 is divided by 43. 13 Calculate the remainder when 204 is divided by 23. 20 Calculate the remainder when 876 is divided by 16. 12 Calculate the remainder when 14 is divided by 3. 2 Calculate the remainder when 17 is divided by 8. 1 Calculate the remainder when 571 is divided by 41. 38 What is the remainder when 635 is divided by 166? 137 What is the remainder when 468 is divided by 11? 6 Calculate the remainder when 3040 is divided by 26. 24 What is the remainder when 16 is divided by 1? 0 What is the remainder when 1553 is divided by 21? 20 What is the remainder when 4703 is divided by 13? 10 What is the remainder when 23 is divided by 18? 5 Calculate the remainder when 195 is divided by 9. 6 What is the remainder when 697 is divided by 20? 17 Calculate the remainder when 311 is divided by 158. 153 Calculate the remainder when 656 is divided by 14. 12 What is the remainder when 68508 is divided by 13? 11 Calculate the remainder when 167 is divided by 5. 2 Calculate the remainder when 299 is divided by 40. 19 Calculate the remainder when 144 is divided by 51. 42 Calculate the remainder when 195 is divided by 32. 3 What is the remainder when 322 is divided by 58? 32 What is the remainder when 186 is divided by 56? 18 Calculate the remainder when 159 is divided by 40. 39 Calculate the remainder when 71 is divided by 8. 7 Calculate the remainder when 4106 is divided by 79. 77 Calculate the remainder when 1321 is divided by 63. 61 What is the remainder when 102 is divided by 21? 18 What is the remainder when 1175 is divided by 236? 231 What is the remainder when 473 is divided by 15? 8 Calculate the remainder when 82 is divided by 8. 2 What is the remainder when 16444 is divided by 55? 54 Calculate the remainder when 6157 is divided by 39. 34 Calculate the remainder when 262 is divided by 44. 42 What is the remainder when 164 is divided by 57? 50 What is the remainder when 210 is divided by 74? 62 Calculate the remainder when 97 is divided by 96. 1 What is the remainder when 30 is divided by 24? 6 Calculate the remainder when 32 is divided by 18. 14 Calculate the remainder when 206 is divided by 85. 36 What is the remainder when 20597 is divided by 63? 59 Calculate the remainder when 272 is divided by 119. 34 What is the remainder when 173 is divided by 90? 83 What is the remainder when 335 is divided by 173? 162 What is the remainder when 6027 is divided by 26? 21 What is the remainder when 1301 is divided by 31? 30 Calculate the remainder when 10878 is divided by 279. 276 What is the remainder when 742 is divided by 239? 25 What is the remainder when 287 is divided by 12? 11 What is the remainder when 163 is divided by 49? 16 What is the remainder when 68 is divided by 22? 2 Calculate the remainder when 1219 is divided by 338. 205 What is the remainder when 290 is divided by 40? 10 Calculate the remainder when 2036 is divided by 51. 47 What is the remainder when 128 is divided by 37? 17 What is the remainder when 239 is divided by 8? 7 What is the remainder when 100 is divided by 6? 4 What is the remainder when 242 is divided by 235? 7 Calculate the remainder when 33 is divided by 9. 6 Calculate the remainder when 20 is divided by 13. 7 Calculate the remainder when 821 is divided by 209. 194 What is the remainder when 99 is divided by 15? 9 Calculate the remainder when 49 is divided by 36. 13 Calculate the remainder when 238 is divided by 20. 18 What is the remainder when 120 is divided by 4? 0 What is the remainder when 270 is divided by 68? 66 Calculate the remainder when 499 is divided by 135. 94 Calculate the remainder when 126 is divided by 33. 27 Calculate the remainder when 69 is divided by 8. 5 What is the remainder when 200 is divided by 27? 11 What is the remainder when 79 is divided by 21? 16 Calculate the remainder when 22 is divided by 13. 9 Calculate the remainder when 4618 is divided by 12. 10 What is the remainder when 152 is divided by 21? 5 What is the remainder when 4 is divided by 1? 0 What is the remainder when 224 is divided by 4? 0 Calculate the remainder when 908 is divided by 10. 8 What is the remainder when 75 is divided by 72? 3 Calculate the remainder when 55 is divided by 34. 21 What is the remainder when 475 is divided by 39? 7 What is the remainder when 1844 is divided by 14? 10 What is the remainder when 815 is divided by 34? 33 Calculate the remainder when 1615 is divided by 50. 15 What is the remainder when 2170 is divided by 64? 58 What is the remainder when 940 is divided by 23? 20 Calculate the remainder when 945 is divided by 20. 5 What is the remainder when 13534 is divided by 32? 30 What is the remainder when 2542 is divided by 358? 36 Calculate the remainder when 1764 is divided by 7. 0 Calculate the remainder when 841 is divided by 18. 13 What is the remainder when 72 is divided by 44? 28 What is the remainder when 8357 is divided by 13? 11 What is the remainder when 127 is divided by 45? 37 What is the remainder when 118 is divided by 24? 22 What is the remainder when 328 is divided by 7? 6 Calculate the remainder when 8472 is divided by 265. 257 What is the remainder when 302 is	{ "pile_set_name": "DM Mathematics" }
y*3 + 7y*2 - 9y + 8. Let c be m(-8). Let h be c/(-24)174/(-4). Let g = h - 21. What is the least common multiple of 4 and g? 8 Let z(r) = -2r*3 - 9r*2 + 5r - 6. Let t(g) = -g*3 - 9g*2 + 6g - 5. Let m(i) = -3t(i) + 2z(i). Calculate the least common multiple of 11 and m(8). 33 Let p(u) = u*3 + 29u*2 - 33u - 60. What is the least common multiple of 55 and p(-30)? 330 Suppose -q + 162 = 8q. Let n(v) = -3v - 3. What is the smallest common multiple of q and n(-3)? 18 Let f(s) = -s*2 - 12s - 15. Let m be f(-12). What is the common denominator of 67/9 and -1(-4)/m(-285)/(-42)? 63 Suppose -2r = 4q + 8, 5r - r - 5q = 23. What is the lowest common multiple of r and 201? 402 What is the common denominator of 50/30 - (-1 + 2) and -8/15? 15 Let r(l) = -l3 + l2 - 2l. Suppose 5q = -9 - 1. Calculate the smallest common multiple of 22 and r(q). 176 Let j = -1883/2070 - -2/207. Find the common denominator of 59/144 and j. 720 Suppose -3a = -a - 38. Suppose -a = -3j + o, 4j - 17 = -4o + 35. Calculate the lowest common multiple of j and 24. 24 Find the common denominator of ((-135200)/29820)/(-13) + (-6)/14 and 31/18. 1278 Let q = -12861 - -270013/21. Find the common denominator of q and 41/8. 168 Let j(r) = -r*3 + 15r*2 - 20r - 22. What is the lowest common multiple of 8 and j(7)? 920 Suppose 0 = -2c - 5s + s + 34, c = s + 14. Let d = 1144 + -1138. What is the least common multiple of d and c? 30 Let u = 43285 - 1731441/40. Calculate the common denominator of (-178)/90 - -1 - -1 and u. 360 Suppose 2c + 8 = 4c. What is the common denominator of -19 and (-216)/(-28) + -3 - c? 7 Let y(q) = -15q. Suppose 14 = -4s - 2z, -23 = -3s + s + 5z. Let f be y(s). Suppose f + 1 = 2p. What is the smallest common multiple of p and 10? 40 Let s = -8 + 8. Suppose s = b - 4g - 16, g = -4b - 0g + 47. What is the least common multiple of b and 16? 48 Suppose -3 = 3l - 2l. Let u = 66343/18 + -3687. Find the common denominator of u and ((-891)/(-30))/l - -2. 90 Suppose -4d + 22 + 18 = -2i, -2d = i - 28. Suppose 19n - 17n = d. What is the smallest common multiple of n and (-144)/(-10) - 4/10? 42 Let r = 239 - 232. Calculate the smallest common multiple of -41/(1 - 2) and r. 28 Let d be ((-18)/15)/((-12)/40). Find the common denominator of 41/18 and (-4 - (-19)/d)/((-18)/71). 72 Let i = 55 - 28. Calculate the lowest common multiple of ((-140)/80)/(1/(-4)) and i. 189 Let g = 13 + -10. Suppose -2s + gs = 0. Suppose s = w + 5p + 23, -3p - 12 - 3 = 0. Calculate the lowest common multiple of 9 and w. 18 Let p(b) be the third derivative of -b4/24 + 2b*3 + 13b*2. What is the lowest common multiple of 3 and p(6)? 6 Let r = -1562 - -1574. What is the least common multiple of 10 and r? 60 Let y(h) = -2h. What is the smallest common multiple of y(-3) and (162/12 + (-3 - 1))4? 114 Suppose 47l + 720 = 62l. Calculate the lowest common multiple of 24 and l. 48 Let a = -337 + 391. Calculate the least common multiple of 12 and a. 108 Let v(t) = -5t - 2. Let b be v(-1). Suppose 31 - b = -2q. Let u = 17 + q. Calculate the smallest common multiple of u and 2. 6 Let g be 579738/(-1540) - (-2 - (-100)/55). Let x = -2594/7 - g. Let a = 5707/9 - 633. Find the common denominator of x and a. 90 Let v(h) = -510h - 12256. What is the common denominator of v(-24) and (1/78)/((-1)/62)? 39 Let y be (80/15 - 6)6/(-1). Calculate the common denominator of 86/15 and ((-297)/75 + y)/(18/915). 30 Let l be -3 - -102/4. Suppose ls + 0s = -3o + 8708, o - 2903 = -s. Let f = 63869/22 - o. Calculate the common denominator of -61/8 and f. 88 Let s = -159 + 167. What is the smallest common multiple of 15 and s? 120 Suppose 0 = -4n + 2n + 32. Suppose 0 = 7945m - 7944m - 4. What is the lowest common multiple of m and n? 16 Suppose 3u = -3, -4f + f + 3u + 3 = 0. Suppose -5y - 20 = -5i, 0i + i - 4y + 8 = f. Calculate the lowest common multiple of 23 and i. 184 Suppose -5 = 8i - 13i. Calculate the smallest common multiple of (0/3 - 0) + 14i and 4. 28 Let u = -5026 + 25369/5. Let s = 44 - u. What is the common denominator of -49/5 and s? 5 Suppose -34 + 160 = 21h. What is the lowest common multiple of h and 172? 516 Find the common denominator of 880/132(3 + -2)/(-6) and 16/19. 171 Let v = -1453 + 10205/7. Find the common denominator of 25/29 and v. 203 Suppose 19 = 5o - o - 5j, 0 = 2j + 6. Suppose 18w - 13w = -i + 22, -5w + 5i = -10. What is the smallest common multiple of w and o? 4 Suppose 2j - 4j + 8 = 0. Let u(x) = x*2 + 7x + 12. Let a be u(-6). Suppose 0 = al - 11l + 100. What is the least common multiple of j and l? 20 Let m(d) = -7d - 77. Calculate the lowest common multiple of 20 and m(-19). 280 Let b be (1 + 26 - 0) + (2 - 3). Suppose b - 96 = -7u. What is the smallest common multiple of -2 + (-22)/(-4)4 and u? 20 Suppose 6j + 140 = 13j. Suppose -jf - 20 = -22f. Suppose -4s = w - 33, 2s - w + 2 = 17. What is the lowest common multiple of f and s? 40 Let b = -261 - -285. What is the least common multiple of 21 and b? 168 Let h = 7 + -4. Calculate the lowest common multiple of 12 and -18(h/(-1) + 10/4). 36 Let z be ((10/(-44))/5)/(4/(-48)). Let j = -62773/78804 + 2/1791. Let d = j + z. Find the common denominator of -53/10 and d. 20 Let w = 176595/14 + -12620. Find the common denominator of w and 77/480. 3360 Calculate the common denominator of 474/180 - 10/2 and -71/33. 330 Suppose -10 - 10 = -4l. Suppose -5f + 3 = -lg + 38, 0 = 4f - 16. Let y = -5 + g. Calculate the lowest common multiple of 8 and y. 24 Let t = 4503 - 121652/27. Calculate the common denominator of -53/3 and t. 27 Let l(w) = -2w + 12. Let d be l(0). Find the common denominator of 1 + (-627)/(-15)(-2)/d and -53/15. 30 Suppose -7p + 672 = 25p. What is the least common multiple of p and 77? 231 Suppose -20k = -23k + 12. Calculate the smallest common multiple of k and 20. 20 Suppose 2o = -17 + 5. Let h = 11 + o. Suppose 0 = -hv + 74 + 16. What is the least common multiple of v and 3? 18 Suppose -5p - x - 9 - 22 = 0, 3x + 27 = -4p. Calculate the common denominator of (2 - p/(-4))/(240/992) and 35/3. 15 Let j = 1767/7 + -38573/154. Suppose 5o - 5i - 25330 = 0, 0o + 2i + 5063 = o. Let a = o - 192609/38. Calculate the common denominator of a and j. 418 Suppose -4f - 95 = 5r, 3f - 5f - 70 = -2r. Let p be 2 - f - (1 - 2). Let q = -19 + p. Calculate the lowest common multiple of q and 10. 70 What is the least common multiple of (12/(-18)3)/(1/(-4)) and 10/(-45) - (-364)/18? 40 Let v = -494833607/63 + 7854719. Let n = 2020/9 - v. Let i = -4772 - -28495/6. What is the common denominator of n and i? 42 Let f be (-8)/20 + (-88)/(-20). Let w be -10f/126. Let c = w + 25. Calculate the lowest common multiple of 2 and c. 10 Let q = -11902 + 166731/14. Calculate the common denominator of q and -97/56. 56 Let z = 10 - 1. Suppose 4m = -c - 8 - z, c - 13 = 2m. Calculate the smallest common multiple of 0 + (c - 6) + 10 and 8. 56 Suppose -3j + 4q - q = 12, -8 = -4q. Find the common denominator of 47/3 and 555/(-135)(1 + j)-1. 9 Let h = 25 + -23. Let y(o) = -6 - 7o + 8o*h + 2o + 2 - o*3. What is the least common multiple of y(7) and 22? 110 Let k = 2893/42 + -600/7. Let y = 1035 - 3076/3. Calculate the common denominator of y and k. 6 Find the common denominator of ((-475)/80 - -2) + (-1)/2 and -53/264. 528 Let y be 42/98 - 228/(-7). Let g = y - 29. Suppose -23 - 27 = -5w. What is the smallest common multiple of g and w? 20 Let v be 12/(-8) + 3826/84. Let g = v - 311/6. Calculate the common denominator of (-1305)/(-770) - (-2)/(-7) and g. 154 Let r be (1 - (-35775)/6)26/16. Let w = r - 9685. Find the common denominator of w and 73/4. 16 Calculate the common denominator of 4/345 and (-656)/40 - (-8 - -1). 345 Calculate the common denominator of ((-4)/(-50))/(-1 - (-836)/820) and -107/30. 30 Let p be (2/4-3)/(12/6928). Let u = 2537/3 + p. Find the common denominator of u and 2/(-9) - 22/(-9). 9 Suppose 3f - 5x = 341, 44 = 2f + 3x - 158. Suppose 621 = 4c - f. What is the least common multiple of c and 14? 182 Let o(y) = 8y - 3. Let i be o(1). Suppose a = 14 - i. What is the lowest common multiple of a and 11? 99 Wha	{ "pile_set_name": "DM Mathematics" }
. What is the lowest common multiple of t and 30? 1590 Let t(u) = u - 9. Let b be t(-6). Find the common denominator of 103/20 and (97/b)/((-324)/(-135)). 180 Let n = -1575/4 - -807/2. Let w = -183 - -184. Calculate the common denominator of n and w - (1 - 66/10). 20 Let o be 1((-12)/1)/(-2). Suppose 0 = -oi + 216. Calculate the least common multiple of 15 and i. 180 Calculate the least common multiple of (-87)/(-4) - (-7)/562 and 88. 88 Let s be ((-1)/10)/(202/4). Let i = s + 11623/4040. Calculate the common denominator of i and 871/(-34) + (-9)/((-1071)/14). 8 Suppose 4a = 2d + 62, 5d - 3d = -2a + 46. What is the smallest common multiple of 9 and a? 18 Let i = 3428 + -37747/11. Find the common denominator of (-3)/(((-99)/(-14))/(-33)) and i. 11 Let k = 2674 - 8093/3. Let v = -306 + -906. Let h = v + 10879/9. Calculate the common denominator of h and k. 9 Suppose 0 = -9k + 420 - 69. Calculate the lowest common multiple of 10 and k. 390 Find the common denominator of 9 - (-262)/(-32) - (-1 - -2) and (-946)/(-28) - (-4)/(-14). 16 Let o = -48961 + 5483561/112. Find the common denominator of o and -1 + 4 - (-172)/80. 560 Let a = 3317/119 - 435/17. Let c = -1527 - -10664/7. Calculate the common denominator of a and c. 7 Let u = 2 - 8. Let j(z) = z3 + 9z*2 + 4z - 4. Let s be j(u). Suppose 4b - 3o + 6o = s, 60 = 3b - 5o. What is the lowest common multiple of b and 12? 60 Let m = 29585053/10 + -2956060. Let f = -1854 - 580. Let n = m + f. Calculate the common denominator of n and 85/12. 60 What is the common denominator of 4/(-3)87/(-6) and (52/(-15))/14/14? 21 Let y(g) = 52g3 - g. Let j be y(1). Suppose 3b + 3m = j, 5m + 61 = 4b - 52. Suppose -18z + 384 = 6z. What is the least common multiple of z and b? 176 Let i = 11485/548 - -40/137. Find the common denominator of 9/422 and i. 844 Let r = 652 - 616. What is the lowest common multiple of 12 and r? 36 Let v = 27 - 25. Let o(u) = 6u - 6. Let x be o(11). Suppose -3l - x = -6l. What is the lowest common multiple of l and v? 20 Let q = -2032 + 1328. Let v(j) = -j - 1. Let m be v(4). Calculate the lowest common multiple of (-2)/m + q/(-40) and 18. 18 Suppose 11z + 132 = 176. Calculate the least common multiple of z and (32/20)/((-1)/(-5)). 8 What is the least common multiple of 68 and 1 - (-12)/41? 68 Let n = 893 - 857. What is the smallest common multiple of n and 324? 324 Let r be (5 + -111)(-1 + 5518/4800). Let z = r + 9/400. Calculate the common denominator of -52/21 and z. 42 Let n = -1570925/6 - -267193. Let y = n - 5384. Find the common denominator of y and 26/21. 42 Let m = 248/21 + -25/28. Let h = 340508/69 + -4935. What is the common denominator of m and h? 276 Let v(p) = -140p + 412. What is the smallest common multiple of 636 and v(2)? 6996 Suppose -x + 5 = -r + 2r, -2r = 3x - 9. Suppose r = -l + 12. Calculate the lowest common multiple of l and 26. 78 Let g be -1(5 + -5) - -1. Find the common denominator of g/((-71)/23 - -4) and -2/9. 63 Let i = 34 + -42. Let d = i + 17. Suppose -6 = -w + 4y, -4w + 9 = -2w - 5y. Calculate the least common multiple of w and d. 18 Suppose 0 = -d + f + 8 + 11, 3d + 5f = 33. What is the common denominator of 46/3d/(-192) and -7/16? 144 Let d = -60/11 + 579/88. What is the common denominator of 173/42 and d? 168 Let i = -13 + 18. Suppose d - 5h = -10, 5d + ih - 8 = 32. Let m(v) = v*2 + v - 1. Calculate the smallest common multiple of d and m(-4). 55 Suppose w = -3w - 68. Let h = w + 22. Suppose -hz + 2z = -18. Calculate the least common multiple of z and 6. 6 Find the common denominator of 53/2 and (-2)/65467/(-142). 6 Suppose 0 = 6f - 3f. Suppose f = 7s + 4 - 25. Suppose 2v = -sa + 17 + 14, -4v + 60 = 4a. What is the smallest common multiple of v and 20? 140 Let d be 45/282(-9868)/(-71072). Let z = d + -17/752. Let t = 124385/19989 + z. Find the common denominator of -15/8 and t. 72 Let q = 3/2225 + -78298/313725. What is the common denominator of q and 20/3? 141 Let f = -4 - -20. Let u(a) = -a3 + 12a*2 - 6a + 24. What is the least common multiple of u(10) and f? 656 Suppose 2p - 2 = 10. Let i be p/21 + (-64)/28. Find the common denominator of (i/(-24))/((-4)/28) and 23/16. 48 Let l = -4173/148 - -220/37. Find the common denominator of l and 11/68. 68 Suppose 8j - 3j = 550. Let u = -5933 - -5943. What is the smallest common multiple of j and u? 110 Let i = 171939 - 55708295/324. Find the common denominator of i and 61/22. 3564 Let r(o) = -12o*2 - o - 2. Let w be r(-1). Let u = w - -25. What is the smallest common multiple of u and 18? 36 Let c be (-2 + 1)4/(-8)-2. What is the lowest common multiple of 21 and c/((-22)/4) + 20? 21 Let l be 8 - 04/16. What is the least common multiple of 9 and ((-7)/(-3))/(l/24)? 63 Suppose -3z + 865 = -f, z + 3z + 5f - 1185 = 0. Let t = 1831/8 + -222. What is the common denominator of (9/30)/((-4)/z) and t? 8 Let p = -60551/96320 + 1/13760. Let k = 8206 - 40987/5. What is the common denominator of p and k? 35 Let o = -27 + 45. Suppose 6t = 18 - 0. Suppose 7 = tq - 23. What is the least common multiple of q and o? 90 What is the common denominator of ((-114)/3)/(600/35 - 0) and -73/100? 300 Let s = 7610/3 + -2562. What is the common denominator of 243/(-70) + (-12)/(-30) and s? 42 Let w = 468 - 156. What is the lowest common multiple of 6 and w? 312 Suppose -183 - 147 = -5k. Calculate the lowest common multiple of 18 and k. 198 Let b be (5577/(-5))/((-112)/(-10)). Let a = 740/7 + b. Calculate the common denominator of a and 53/7. 56 Suppose -10z + 0 = -20. Suppose 6 = o + z. Calculate the least common multiple of o and -1(0 + -1)1. 4 Let g be 7615/(-25)(-6 - 0). Let x = g - 1838. Let n = 538549/49410 - -2/4941. What is the common denominator of x and n? 10 Suppose 4w = -4, 4 = 3j - w - 609. What is the lowest common multiple of j and 24? 408 Suppose 5c - 30 = -5i + 70, 0 = -i - 5c + 28. Calculate the smallest common multiple of i and 26. 234 What is the common denominator of -19/18 and ((-6)/(-1584))/((-8)/(-1608))? 792 Let k(y) = y*2 + 5y - 8. Let s = -41 + 107. Suppose 3t = -0t + s. Calculate the smallest common multiple of k(-7) and t. 66 Let c(o) = -o + 19. What is the smallest common multiple of c(-6) and 55? 275 Let x be (360/(-100))/(3/(-10)). What is the least common multiple of 1 and (-1)/(-6) - (-82)/x? 7 Let x be (214/204 + -1)/((-18)/(-3272)). Let z = 154/17 - x. Calculate the common denominator of z and 131/30. 270 Let z = -1235 + 808. Let c be 1/(-1) - (-5165)/(-12). Let i = z - c. What is the common denominator of 9/14 and i? 84 Let f(v) = 3v - 27. Let s be f(9). What is the common denominator of 1 + s + 52/(-16) and 35/(-12) - (0 - 0)? 12 Suppose 0 = 2h - 3o - 26, 3h + 2 - 43 = 5o. What is the smallest common multiple of 5 and h? 35 Suppose 0 = 2v - 5d + 34, -2v - 4d = -5v - 58. Let r = v + 32. Calculate the lowest common multiple of 16 and r. 80 Let u = -44787/37051 + 96/79. Let i = 7519/2345 - u. Find the common denominator of i and 87/2. 10 Calculate the lowest common multiple of 836 and 116/(-145)(1 + (-34)/4). 2508 Calculate the common denominator of (-153)/(-20)(-2)/(-3) and 15/(-36)(-23086)/485. 30 Find the common denominator of 11302/8 and 6/21 - (1 + (-1719)/84). 4 Let f(o) = -o3 - 6o*2 - 4o - 3. Let r be f(-5). Suppose 141k - 68k = 88k - 150. Calculate the lowest common multiple of k and ((-6)/4)/(2/r). 30 Suppose -5o = k - 46, -17 = -2o + 5k + 23. What is the smallest common multiple of o and 20? 20 Let k = -303/25 + 151/12. Calculate the common denominator of -89/80 and k. 1200 Let f(p) be the third derivative of -p*5/60 + 5p4/12 - p3/2 - 5p2. Let j be f(9). What is the common denominator of 87/4 and 11 - (j/(-8))/3? 4 Let x(c) = 4c*2 + 2c - 2. Let q(j) = 3j2 - j. Calculate the least common multiple of q(-1) and x(2). 36 Let v(y) = -8y*2 - 35y - 10. What is the lowest common multiple of v(-4) and 20? 20 Let k = 427/5 + -6577/80. What is the common denominator of k and (-18)/125/(-10)? 16 Suppose 6w = w - 15. Let o be (6 - (0 - w)) + 1. Calculate the least common multiple of 7 and o + 4/((-12)/(-9)). 7 Suppose -n - 18 = -4n. Suppose -5s - 42 = -17. Let c =	{ "pile_set_name": "DM Mathematics" }
is the remainder when o is divided by 10? 9 Let z = 662 + -657. Suppose 225 = n + 4n - zd, 4n + 3d = 208. Calculate the remainder when 138 is divided by n. 40 Let k = 45 + 752. Let i(p) = 13p + 61. Calculate the remainder when k is divided by i(3). 97 Let m(r) = -67 - 2r - 2r - r3 + 58 - 3r*2 + 2r. What is the remainder when 192 is divided by m(-4)? 12 Let i(m) = -m*3 + 130m*2 - 261m + 1340. What is the remainder when 722 is divided by i(128)? 22 Suppose -2z + 149 = -123. Suppose -106s - z = -110s. What is the remainder when 44 is divided by s? 10 Suppose -2n + 376 = 2g, -2g + 4n - 1261 = -1625. What is the remainder when 245 is divided by g? 59 Suppose -2b + 20 = -2j - 22, 4j + 93 = b. Calculate the remainder when 73 is divided by 1543/18 - (-4)/j. 13 Let q(s) = -10s + 61. Let v be q(6). Let j(p) = 88p - 1. Calculate the remainder when j(v) is divided by 11. 10 Let d(x) = -x3 + 12x*2 - 6x + 5. Let n be d(4). Suppose 4u - n = -5m, -129 = -3u + 4m - 24. Calculate the remainder when 86 is divided by u. 24 Suppose 15 = -5k + 45. What is the remainder when 2393 is divided by k? 5 Let p = -50 - -81. Suppose 0 = 3y + z - 81, 56y - 27 = 55y + 5z. Calculate the remainder when p is divided by y. 4 What is the remainder when 10/(-11 + (-8371)/(-759)) is divided by 101? 42 Let u be (-6 - -24)/(-6) + -181. Let h = 202 + u. Calculate the remainder when 66 is divided by h. 12 Suppose 65a = 70a. Suppose a = 45q - 52q + 1078. What is the remainder when q is divided by 26? 24 Suppose 0 = 95b + 148b - 79636 - 359708. What is the remainder when b is divided by 50? 8 Let r = 2 - -3. Suppose -2f = 3w - 5, 0 = f - 0f - w - r. Let x = f + 119. What is the remainder when x is divided by 21? 18 Let v = -9742 + 10257. What is the remainder when v is divided by 83? 17 Suppose 4m - 51 = 13. What is the remainder when 1254/264((-4)/(-10) - 490/(-25)) is divided by m? 15 Let i be 70752/(-128) - 1/4. Let o = i + 574. Calculate the remainder when 522 is divided by o. 18 Let b(q) = 2q3 + 103q*2 + 49q - 93. What is the remainder when 991 is divided by b(-51)? 1 Let k(v) = -6v - 4. Suppose 6l = 14l - 16. Suppose 0 = -lf + 4o + 84, 4f + 2o - 232 + 24 = 0. What is the remainder when f is divided by k(-5)? 24 Suppose -3m - 2h + 7 = 0, -2h - 23 = -0m - 3m. Let u = 13 - -10. Suppose 3w - u = 19. Calculate the remainder when w is divided by m. 4 Let y be ((-54)/12 + 3 - 4)38. Let i = y - -596. Calculate the remainder when i is divided by 28. 23 Let j be 3 - (7206/(-45) - (-6)/45). Suppose 2h = -p + j, 3h - 2p - 242 = -p. Calculate the remainder when h is divided by 29. 23 Let r(j) be the third derivative of j5/20 - j4/12 - 7j*3/3 - 29j*2. Let n be (-5)/(-1) + -2 + 3. What is the remainder when r(n) is divided by 14? 12 What is the remainder when 696 is divided by ((-98)/49)/(2/(-71))? 57 Let a be (-72 - -91)(-1 + -1). Suppose -62 = 2l - 3l + p, 0 = p - 4. Let s = a + l. Calculate the remainder when s is divided by 16. 12 Let g(z) be the first derivative of 1 + 3z2 + 1/3z*3 + 18z. What is the remainder when g(-11) is divided by 19? 16 Suppose -4y = 2z - 478, 2z - 260 = -3y + 219. What is the remainder when z is divided by 27? 25 Let s = 2526 - 1585. Calculate the remainder when s is divided by 8. 5 Suppose -y + 10s - 11s = -1886, 0 = -y + 2s + 1898. What is the remainder when y is divided by 4? 2 Let c(h) = -h3 + 96h*2 - 190h + 211. What is the remainder when (-457)/(-5) + 2/(-5) is divided by c(94)? 22 Suppose w - z + 6 = 0, 0 = -5w + z - 6 - 36. Let m be 2/((w/15)/3). Let l(v) = v2 + 11v + 19. What is the remainder when 52 is divided by l(m)? 7 What is the remainder when 3161 is divided by 150(-1)/((-24)/36)? 11 Let w = 148 - 82. Let g be (-8)/(-4 + 2) + w. Let v = g + -49. What is the remainder when 41 is divided by v? 20 Suppose b - 5q - 17 = 0, 0b = b - 3q - 11. Suppose 0 = -bf + 6f - 96. Let w(z) = 47z3 - z2. What is the remainder when w(1) is divided by f? 22 Let n = -92253 - -92430. Let w = 17 - -3. Calculate the remainder when n is divided by w. 17 Let k(w) = w3 - 15w*2 + 69w - 66. What is the remainder when 1877 is divided by k(6)? 5 Let q = -98 + 1433. Suppose -q - 677 = -4d. What is the remainder when d is divided by 23? 20 Let f(g) = -6g - 37. What is the remainder when -2 - -52 - 9/(4 - -5) is divided by f(-7)? 4 Let w = -728 + 742. Suppose -wt + 16t + 3j - 9 = 0, t + j = 4. Calculate the remainder when 33 is divided by t. 0 Suppose -4j = -91 - 377. Calculate the remainder when 94 is divided by (j/(-195))/(-2 + 9/5). 1 Let n(j) = -14j - 5. Let s be n(-5). Suppose 0 = 4i - 3r - 221, 0i - 4r = -i + s. Let a = -18824 + 18843. What is the remainder when i is divided by a? 15 Calculate the remainder when 518 is divided by ((-13)/((-104)/(-16)))/(10/(-845)). 11 Let p(n) = -n2 + 9n - 1. Let k(q) = -q*3 - 17q*2 - 48q - 60. Calculate the remainder when k(-14) is divided by p(7). 11 Suppose 5o - 168 = 2q, 2q + 60 = 2o + 3q. Suppose -603 = 20b - 103. Let g = 36 + b. What is the remainder when o is divided by g? 10 Suppose 3k = 3w - 11 + 551, -2k + 4w = -352. Suppose -4s = l - 37, -16 = -5l - 5s + k. Calculate the remainder when 239 is divided by l. 34 Let g be (-4)/6 - 16/12. Let h be (-16)/(-10) + ((-16)/10 - g). Suppose 3r = 4b - hb - 13, 3b - 3r - 21 = 0. What is the remainder when 29 is divided by b? 5 Calculate the remainder when 1-71062/(-4) is divided by (-1)/52 + 6364/185. 31 Suppose -28 + 5 = -3f + 88. What is the remainder when 3316 is divided by f? 23 Let q(d) = -d3 + 6d*2 - 4d + 52. Let i be (-2 + 2)/((-4)/(-4))-1. Calculate the remainder when (-7 + 9)((-82)/(-4) - i) is divided by q(6). 13 Suppose 2m = 72 + 18. Suppose 3z + 4t - 144 = 0, 6z - 5t = z + 240. Suppose 4v + z = 8v. Calculate the remainder when m is divided by v. 9 Suppose -5u = -124 - 191. Let i be (4 + -3 + 2)210/(-9). Let d = -57 - i. What is the remainder when u is divided by d? 11 Let j(s) = -14s + 5. Let x(y) = 7y2 - 56. Let i be x(-5). Suppose 5a = w - 46 + i, 3a = w + 43. What is the remainder when j(-7) is divided by a? 13 Let h = 15 + 221. Suppose 118 = 2t - c, c = -6029t + 6030t - 57. Calculate the remainder when h is divided by t. 53 Suppose 43x - 29x = -22 + 470. Let m be (0 + 12)/(-1 - -2). Calculate the remainder when 2/(-12) - (-1106)/m is divided by x. 28 Let l(j) = -2j3 + 33j*2 - 42j + 8. What is the remainder when 529 is divided by l(15)? 52 Let a(y) = y + 3. Suppose -n = x - 24, 9x + 15 = 4x. Suppose v = 5c + 14 + 1, -3v - 3c = -n. What is the remainder when v is divided by a(4)? 3 Let p(w) = w + 19. Let v = -13 + 1. What is the remainder when p(5) is divided by (-2 + v)/((3 - -3)/(-3))? 3 Suppose 4s = 15 + 33. Suppose -2b + 32 = -s. What is the remainder when b is divided by 9? 4 Let d(h) = 2h*3 - 46h + 27 - 20h2 + 5h*3 + 20 - 6h*3. Calculate the remainder when 3 is divided by d(22). 0 Let a(x) = 31x*2 - 206x - 420. What is the remainder when 379 is divided by a(-2)? 31 Suppose 6656i - 6607i - 12740 = 0. What is the remainder when i is divided by 0 + (2 - 0 - -22)? 20 Let y(j) = 7j2 + 45j + 11. Let o(m) = 37m2 + 224m + 50. Let v(t) = 2o(t) - 11y(t). Calculate the remainder when 79 is divided by v(-15). 7 Let n(b) = -b + 65. Let k(u) = 2u - 98. Let s(a) = -5k(a) - 8n(a). What is the remainder when s(-36) is divided by (-48)/(-14)(-14)/(-4)? 6 Let a = 14979 + -14175. Calculate the remainder when a is divided by 83. 57 Suppose a = -5t + 338, 3a - 4a - 198 = -3t. What is the remainder when 220 is divided by (t/201)/(1/111)? 35 Let a be 15/(-18) - 1562/(-132). Suppose -964 = -5k + 161. Calculate the remainder when k is divided by 1/(a/625) - 22/(-121). 54 Calculate the remainder when (-1355)/(-20) - (-6)/(-8) is divided by ((-36)/21)/((-13)/(-455))(-4)/5. 19 Let x(p) = p*2 - 9p - 64. Suppose 4m - 245 - 186 = -q, 0 = 2m - 3q - 219. What is the remainder when m is divided by x(-7)? 12 Let m(k) = 24k**2 - 4. Calculate the remainder when m(-3) is divided by (-179)/30 - -6 - 25701/(-1170). 14 Let l = 517 - 546. Let p = l + 136. Let b = 9 - -18. Cal	{ "pile_set_name": "DM Mathematics" }
picked without replacement from {e: 1, r: 3}. 1/4 Three letters picked without replacement from uoxfugq. What is prob of sequence guu? 1/105 Three letters picked without replacement from {i: 4, p: 3}. What is prob of sequence iii? 4/35 What is prob of sequence ajj when three letters picked without replacement from {a: 5, j: 8}? 70/429 Calculate prob of sequence ii when two letters picked without replacement from iiiiiiiii. 1 Three letters picked without replacement from ykiibibblk. What is prob of sequence bli? 1/80 What is prob of sequence kyx when three letters picked without replacement from {k: 3, o: 1, u: 7, h: 1, x: 3, y: 3}? 3/544 Four letters picked without replacement from qnqahhhqhhnh. Give prob of sequence ahhn. 1/198 What is prob of sequence kl when two letters picked without replacement from kjjjjkjjllllkj? 6/91 Calculate prob of sequence kz when two letters picked without replacement from {p: 3, k: 1, z: 1, u: 4, d: 2}. 1/110 Three letters picked without replacement from ahhfnkckacakckhfc. Give prob of sequence fcc. 1/170 Two letters picked without replacement from ovwfw. What is prob of sequence vw? 1/10 Calculate prob of sequence oa when two letters picked without replacement from jtaotaa. 1/14 What is prob of sequence tpo when three letters picked without replacement from {t: 2, o: 1, p: 2, u: 1}? 1/30 Two letters picked without replacement from oyxxhyoxmmyy. Give prob of sequence ym. 2/33 Four letters picked without replacement from llplilennnntpel. What is prob of sequence nept? 2/4095 Calculate prob of sequence tt when two letters picked without replacement from xmmmtttmxmmt. 1/11 What is prob of sequence ad when two letters picked without replacement from jjdnjba? 1/42 Three letters picked without replacement from {z: 1, o: 4, r: 8}. Give prob of sequence ror. 56/429 Calculate prob of sequence ocoo when four letters picked without replacement from ocooooooc. 5/36 Calculate prob of sequence wf when two letters picked without replacement from uwffufffffoufff. 1/21 Calculate prob of sequence cy when two letters picked without replacement from {y: 1, m: 2, s: 4, c: 2, k: 2, h: 1}. 1/66 What is prob of sequence td when two letters picked without replacement from {r: 1, j: 1, b: 2, t: 1, d: 1, u: 1}? 1/42 Calculate prob of sequence jj when two letters picked without replacement from jjjjwjjjwwjwyijjw. 45/136 Calculate prob of sequence br when two letters picked without replacement from {b: 6, r: 2, l: 4}. 1/11 Three letters picked without replacement from {t: 5, y: 1, b: 6, z: 2, n: 5}. What is prob of sequence tyn? 25/5814 Calculate prob of sequence jj when two letters picked without replacement from ijikiijkkjkiikikj. 3/68 Three letters picked without replacement from wbwwwwbwwbwwwwww. What is prob of sequence bww? 39/280 What is prob of sequence sf when two letters picked without replacement from cfmscs? 1/15 Two letters picked without replacement from {b: 4, x: 5, u: 1, t: 10}. Give prob of sequence ub. 1/95 What is prob of sequence uy when two letters picked without replacement from {y: 2, u: 3, p: 6, b: 3, r: 1}? 1/35 Three letters picked without replacement from qjqqppqpij. What is prob of sequence jpj? 1/120 What is prob of sequence gkm when three letters picked without replacement from {b: 2, g: 3, k: 8, m: 1, q: 1, s: 3}? 1/204 Two letters picked without replacement from zzcwzzzzyzzzz. What is prob of sequence wy? 1/156 Four letters picked without replacement from iiwaaiib. What is prob of sequence wbia? 1/210 Four letters picked without replacement from gjbgjz. Give prob of sequence zggz. 0 What is prob of sequence yv when two letters picked without replacement from yvvvvmvvvyyvvvvvv? 39/272 Calculate prob of sequence gg when two letters picked without replacement from {s: 2, g: 3}. 3/10 What is prob of sequence ggvn when four letters picked without replacement from gvggnwggvggnnt? 3/286 What is prob of sequence zzz when three letters picked without replacement from zzzzziizzi? 7/24 What is prob of sequence lwm when three letters picked without replacement from mlmlwmpzyzymm? 5/858 Two letters picked without replacement from rwywvwvwvyrwwnrr. Give prob of sequence nv. 1/80 Three letters picked without replacement from gagahnghahnahgggaa. What is prob of sequence hna? 1/102 Two letters picked without replacement from aqfpafmc. What is prob of sequence ff? 1/28 What is prob of sequence rx when two letters picked without replacement from hxxrxhjhxjrx? 5/66 Calculate prob of sequence yy when two letters picked without replacement from {e: 4, y: 7, i: 4}. 1/5 Three letters picked without replacement from vrrvozmk. Give prob of sequence zvo. 1/168 Four letters picked without replacement from wmxwmwcwsc. What is prob of sequence cwcw? 1/210 Three letters picked without replacement from nnnnnnnknnnnnnnnnnnn. What is prob of sequence knn? 1/20 Three letters picked without replacement from {q: 2, i: 11}. Give prob of sequence iqi. 5/39 Three letters picked without replacement from uuusfssuuus. What is prob of sequence ufs? 4/165 What is prob of sequence mm when two letters picked without replacement from {m: 2, w: 11}? 1/78 Two letters picked without replacement from {a: 3, l: 5, p: 3, r: 1, b: 1}. Give prob of sequence bp. 1/52 What is prob of sequence rog when three letters picked without replacement from {o: 5, g: 3, r: 1}? 5/168 What is prob of sequence deww when four letters picked without replacement from eewwebdewebeededw? 3/595 Two letters picked without replacement from ccccccccccecccccccc. Give prob of sequence cc. 17/19 What is prob of sequence uu when two letters picked without replacement from {r: 2, u: 2}? 1/6 What is prob of sequence xxxx when four letters picked without replacement from {x: 6}? 1 What is prob of sequence ycx when three letters picked without replacement from {c: 3, x: 3, y: 3, i: 1}? 3/80 Three letters picked without replacement from {w: 2, n: 11}. What is prob of sequence wnw? 1/78 Two letters picked without replacement from yyyyyyyywyyyw. What is prob of sequence wy? 11/78 Calculate prob of sequence dvve when four letters picked without replacement from {d: 6, e: 2, v: 9}. 9/595 Two letters picked without replacement from poopoooppj. What is prob of sequence pp? 2/15 Two letters picked without replacement from twyrybbw. What is prob of sequence tb? 1/28 Four letters picked without replacement from {v: 9, i: 2, o: 3, g: 4}. What is prob of sequence voiv? 1/170 Two letters picked without replacement from ufbvdbuvj. Give prob of sequence vj. 1/36 Four letters picked without replacement from {e: 17, z: 1, l: 1}. What is prob of sequence zele? 1/342 What is prob of sequence zpz when three letters picked without replacement from ezmpazz? 1/35 What is prob of sequence yy when two letters picked without replacement from jyyyyjjyjjyyj? 7/26 Four letters picked without replacement from pnpppvppvnvppppppn. Give prob of sequence pnpp. 11/204 Three letters picked without replacement from {v: 4, s: 3, f: 2, y: 1, u: 4}. Give prob of sequence uvv. 2/91 Calculate prob of sequence qj when two letters picked without replacement from ooggqtqoqoetgjqgtq. 5/306 Calculate prob of sequence wj when two letters picked without replacement from {w: 2, j: 7}. 7/36 Three letters picked without replacement from aajjsnssjnjvsa. Give prob of sequence sav. 1/182 Four letters picked without replacement from {z: 7, m: 3, v: 1, k: 2, w: 4}. What is prob of sequence vkzw? 1/1020 Calculate prob of sequence zzzs when four letters picked without replacement from {z: 3, x: 1, u: 4, s: 5}. 1/572 What is prob of sequence iixz when four letters picked without replacement from xnwizjin? 1/840 What is prob of sequence vv when two letters picked without replacement from {v: 18, s: 1}? 17/19 Two letters picked without replacement from {p: 5, q: 11, h: 1, n: 3}. What is prob of sequence nq? 33/380 Calculate prob of sequence ksbt when four letters picked without replacement from uspppstbkpbs. 1/1980 Two letters picked without replacement from oooo. What is prob of sequence oo? 1 What is prob of sequence cc when two letters picked without replacement from rrrrcc? 1/15 Three letters picked without replacement from qqqqqq. What is prob of	{ "pile_set_name": "DM Mathematics" }
econd derivative of b*3dz - 2506b*3d - 10bdz + bz + 24b + 2dz + 1 wrt b. 6bdz - 15036bd What is the third derivative of -335b6 + b5 - 185b*2 + 2? -40200b*3 + 60b*2 What is the derivative of -20064o + 15908 wrt o? -20064 What is the second derivative of 6b5 + 10b*3 - 21b + 2 wrt b? 120b3 + 60b Differentiate 2jqy - 185jy + 2j + 160qy - 3q + y - 3 with respect to q. 2jy + 160y - 3 Differentiate -205u - 1004 wrt u. -205 What is the third derivative of -2b*3y3 + b3y + 168b*2y*2 + 106y*3 wrt y? -12b*3 + 636 Find the third derivative of 159o*3x*3 + 46o*3x*2 + 2x*3 + 3x*2 wrt x. 954o*3 + 12 What is the second derivative of -37tu2 - 7tu + 2t + 38u2 - 2u - 218 wrt u? -74t + 76 Find the second derivative of -68i*4 + 5i*3 - 2i*2 - 10823i wrt i. -816i2 + 30i - 4 What is the second derivative of 1397n4 - 3583n wrt n? 16764n2 Find the third derivative of 155bc3g*2h + bc3h*2 + 2bcg*2h*2 - bgh + 10c*3g - 3c2 + cg*2h + 7g2 wrt c. 930bg2h + 6bh*2 + 60g What is the third derivative of -3b4 - 4b*3 - 210b*2 wrt b? -72b - 24 What is the third derivative of -3x4 - 3945x*3 + 16601x*2? -72x - 23670 What is the first derivative of -213b2fi3 - 2b*2i - 7b2 + 49fi3 - 47fi2 wrt b? -426bfi*3 - 4bi - 14b Find the second derivative of -6n4 + 7n*2 + 93n. -72n2 + 14 Differentiate 68n*2y*3 + 3n*2 + 10 wrt y. 204n*2y*2 What is the third derivative of 128h*6 + 2h*5 - 164h*2 - h wrt h? 15360h*3 + 120h*2 Find the third derivative of -2o*4 + 12o*3 - 3o*2 - 47o wrt o. -48o + 72 What is the derivative of 9z*2 + 27z + 512? 18z + 27 Find the third derivative of -6i*2x*3 + 3i*2 - 40ix5 + 499ix2 + ix - 3x4 wrt x. -36i*2 - 2400ix2 - 72x Find the third derivative of -hr2t*3 - hr*2t + 930hrt3 + 2hrt + 8ht - 2r2t + 2t2 wrt t. -6hr2 + 5580hr Differentiate 62hu2 - 2h - 467u2 with respect to h. 62u*2 - 2 Differentiate -gh*2 + 7gh - 34g + 2h2 + 6971 wrt g. -h2 + 7h - 34 What is the derivative of -5d2t + 2dt*3 - 108t*3 wrt d? -10dt + 2t*3 Find the third derivative of -2drs*3v - 4drs2v - 2drs - 478ds3 + ds*2v - 2rs*3v - 12rv wrt s. -12drv - 2868d - 12rv Find the third derivative of -31j5 - j3 - 427j*2. -1860j*2 - 6 What is the third derivative of 17nw3z*3 - 2nw3 + 2nz3 - 29w*3z*2 wrt z? 102nw3 + 12n Find the second derivative of -76m3 + 290m. -456m Find the second derivative of 4n*3o*3 + 10n*3o2 - n2o2 + 12no3 - 3o*3 + 3 wrt n. 24no3 + 60no2 - 2o*2 Find the first derivative of -21k*4 - 11k*2 - 3k + 4009 wrt k. -84k3 - 22k - 3 Differentiate -5mqsv*3 + 2msv*3 - 4qsv*2 - qs + sv + v3 wrt m. -5qsv*3 + 2sv3 What is the derivative of -11431m*3 - 5424? -34293m*2 Differentiate -273g*4 + 1754 with respect to g. -1092g*3 Find the third derivative of 390f*4g*2 + 17f*3g3 - f2 - 2fg*3 + 280 wrt f. 9360fg2 + 102g*3 Find the first derivative of 19hju + hj - 5hou + 45ho - 3hu + 2j4 + 8j*2ou wrt j. 19hu + h + 8j*3 + 16jou Find the second derivative of 5l3w - 5l2w - 32lw + w wrt l. 30lw - 10w Find the first derivative of -2fp3 - 43fpz + 4f - 45p*3 - 3p*2z + 2z wrt f. -2p*3 - 43pz + 4 What is the second derivative of -1294p*5 + 2p*4 + 6p - 42? -25880p3 + 24p*2 What is the second derivative of -206d*3h*2z + 6d3h2 + d3hz + 1890d3 - 2d*2z wrt h? -412d3z + 12d3 Differentiate -76hm3y*2 - 3m*3y*2 - 345y*2 with respect to h. -76m*3y*2 What is the derivative of -167j*4 - 5j*2 + 3432 wrt j? -668j*3 - 10j Find the third derivative of -741b4 - 85b*2 - 3 wrt b. -17784b What is the second derivative of 158y4 + 6y + 395 wrt y? 1896y2 Find the second derivative of -48hu4 - 7hu3 + 3hu2 - 3h + 51u - 1 wrt u. -576hu2 - 42hu + 6h What is the derivative of 304iz*3 + 9i - z*4 + 1 wrt z? 912iz2 - 4z*3 What is the third derivative of 10n*3s*3 + 2n*3s*2 - 62n*3s - 5s3 wrt s? 60n*3 - 30 What is the third derivative of -2m*6 - 2008m*5o + m*2o - 52m2 + 118mo wrt m? -240m*3 - 120480m*2o Find the second derivative of 11759l5 + 10425l wrt l. 235180l3 What is the third derivative of 2c*3h*2qt3 - 81c*3hqt2 - c2h2q + c*2t*2 - 2chqt2 + h2qt2 + 5989h*2t*3 + t wrt t? 12c*3h*2q + 35934h2 What is the third derivative of -1977r*3 - 36r*2 - 23r? -11862 Find the third derivative of -343b5 - 2b*2 + 11 wrt b. -20580b*2 Find the second derivative of 2r*3y*3 - 90r*3y*2 + 3r*3 + 5009ry + 4y*5 wrt y. 12r*3y - 180r3 + 80y*3 Differentiate -61l*4 + 281 wrt l. -244l*3 Find the first derivative of -799t*4 - 26. -3196t*3 What is the third derivative of 23534o*3 + 39o*2 + 357o wrt o? 141204 Find the third derivative of b*3cg3n - b*3cgn - b*3g*3 + 8b*2cn + 2bcg*2 - 3bc - 42cg3n wrt g. 6b3cn - 6b*3 - 252cn Find the first derivative of -w3z*3 - 118w*3 + 22w*2z*3 + 2w wrt z. -3w3z*2 + 66w*2z*2 Find the third derivative of 4k*3v*3 + 31k*3v*2 + 6k*2v - 3kv*3 - 71v wrt k. 24v3 + 186v*2 Differentiate 286fx3 + 289x*3 wrt f. 286x*3 What is the third derivative of 201m*4z*2 - 2m*3z*3 - 21m*2 - 3z*3 wrt m? 4824mz2 - 12z*3 Find the second derivative of 394ch4 - 4c + 2h5 + 6h + 1 wrt h. 4728ch*2 + 40h*3 Differentiate -2a*3k*2 + 90a*3k - 18a3 + a2 wrt k. -4a*3k + 90a3 Find the second derivative of -3j*3p*2 + 32j*2p*2 - 2106j - p*2 wrt j. -18jp2 + 64p2 What is the derivative of m2n + 89mn + 176n wrt m? 2mn + 89n Find the third derivative of 4k*6 - 36k*5 + 43k*2 wrt k. 480k*3 - 2160k*2 What is the second derivative of -83k*2p*2 + 34kp2 wrt k? -166p*2 Find the third derivative of -2px4 + 3px3 - 2px - 2x*4 - 18x*2 wrt x. -48px + 18p - 48x Find the second derivative of 2kwx*2 + 2kwx - 23k + 56wx5 - 2wx - 2 wrt x. 4kw + 1120wx3 What is the derivative of v4 - 2v*3 + 2312v - 10419 wrt v? 4v3 - 6v*2 + 2312 Find the first derivative of 134j*2 - j - 761 wrt j. 268j - 1 What is the second derivative of 529k5 - k - 441 wrt k? 10580k*3 Find the second derivative of -32a*2j*2n - 77a2j - 2a2n - 4aj*2n + 3ajn - an + j*2 wrt j. -64a*2n - 8an + 2 What is the third derivative of -194v4 - 2v*3 - 536v*2? -4656v - 12 What is the third derivative of -6g3m*3n*3 - 30g*3m + 58g2m*3n - g*2m*2n - gm2n*3 wrt m? -36g*3n*3 + 348g*2n What is the second derivative of -2922b2d*3 - 4bd3 - 55bd2 + bd - 2d2 wrt b? -5844d*3 What is the third derivative of 8058i*4 - 2i*2 + 2i + 19? 193392i Find the second derivative of -99u*3 + 3u*2 - u - 10 wrt u. -594u + 6 What is the third derivative of 4n4 + n3 - 124n*2 wrt n? 96n + 6 What is the third derivative of 12985s6 + 2858s*2 wrt s? 1558200s*3 What is the third derivative of 634d*5 - 1366d*2 wrt d? 38040d*2 What is the first derivative of -7gi - 22g + 1029i wrt g? -7i - 22 Differentiate 18k4 - 221. 72k*3 What is the third derivative of 285nv5 - 3nv2 - 18nv + 6n + 16v6 + 3 wrt v? 17100nv2 + 1920v3 Find the third derivative of -a6k2 + 9a*4k2 - a2k2 - 67a*2k wrt a. -120a3k*2 + 216ak2 What is the third derivative of 2ot6 - 1462ot5 + 2ot2 + 11o + 6t2 wrt t? 240ot3 - 87720ot2 Find the second derivative of -408b*4 - 489b wrt b. -4896b2 What is the second derivative of -431d*3 + 285d? -2586d Find the third derivative of 165a*6 + 235a*2 wrt a. 19800a*3 Find the second derivative of -43l*4 + 98l wrt l. -516l2 Find the third derivative of 9209a*2i*3 + 768a**2	{ "pile_set_name": "DM Mathematics" }
/7, 2, 9 Find y, given that -25y5 + 640y*4 - 5040y*3 + 11630y*2 - 3575y - 3630 = 0. -2/5, 1, 3, 11 Factor -2h3/5 - 726h*2/5 - 13104h + 66248/5. -2(h - 1)(h + 182)*2/5 What is j in -30j*3 + 4805j*2 + 4030j - 805 = 0? -1, 1/6, 161 Let 4p5/7 - 24p*4/7 + 12p*3/7 + 40p2/7 = 0. What is p? -1, 0, 2, 5 Factor -k2/7 - 986k/7 - 243049/7. -(k + 493)2/7 Determine n so that 8n*4/15 - 32n*3/5 - 1702n*2/15 - 2338n/5 - 9016/15 = 0. -4, -7/2, 23 Solve 2m5 - 7m*4 + 9m*3 - 5m*2 + m = 0. 0, 1/2, 1 Factor -2p*2/13 - 24p/13 - 22/13. -2(p + 1)(p + 11)/13 Determine b so that 5b4/4 - 95b*3/2 - 395b*2/4 - 50b = 0. -1, 0, 40 Factor -3x2/5 + 126x - 627/5. -3(x - 209)(x - 1)/5 Find i such that -8i5/11 + 50i*4/11 - 114i*3/11 + 112i*2/11 - 40i/11 = 0. 0, 1, 5/4, 2 Suppose -5o2 + 135o - 130 = 0. What is o? 1, 26 Factor 39h3 - 115h*2 - 6h. h(h - 3)(39h + 2) Find n such that 2n*5/5 - 14n*4/5 + 4n*3 + 4n*2/5 - 22n/5 + 2 = 0. -1, 1, 5 Factor -2w2/7 - 228w/7 + 1952/7. -2(w - 8)(w + 122)/7 Suppose -5a5 - 35a*4 + 45a*3 + 335a*2 + 80a - 420 = 0. What is a? -7, -2, 1, 3 Find a, given that -10a5/11 - 294a*4/11 - 56a*3 + 960a*2/11 + 2624a/11 + 864/11 = 0. -27, -2, -2/5, 2 Factor -4h2 - 104h - 352. -4(h + 4)(h + 22) Factor 5z2 + 870z. 5z(z + 174) Find c such that -4c4 - 200c*3 - 2068c*2 + 10800c - 11664 = 0. -27, 2 Find d, given that 3d5 - 39d*4 + 150d*3 - 150d*2 - 153d + 189 = 0. -1, 1, 3, 7 Let -2t3 + 46t*2 - 320t + 600 = 0. Calculate t. 3, 10 Factor a*5/2 + 3a*4 - 73a*3/2 + 107a*2 - 126a + 52. (a - 2)*3(a - 1)(a + 13)/2 Factor o5 + 4o*4 - 5o3. o3(o - 1)(o + 5) Find z, given that -2z4 - 656z*3 + 1318z*2 - 660z = 0. -330, 0, 1 Factor -z*2/5 - 107z/5 - 312/5. -(z + 3)(z + 104)/5 Suppose -q5/2 - 11q*4/2 + 6q*3 = 0. What is q? -12, 0, 1 Factor 2u*2 + 4u - 48. 2(u - 4)(u + 6) Suppose -84p3 + 500p*2 - 416p + 80 = 0. What is p? 2/7, 2/3, 5 Factor 3n3/7 - 51n*2/7 + 132n/7 - 12. 3(n - 14)(n - 2)(n - 1)/7 Suppose 5z*3 + 770z*2 + 2275z + 1510 = 0. What is z? -151, -2, -1 Factor -k3/8 + k2/2 - 3k/8. -k(k - 3)(k - 1)/8 Determine b so that -3b*4/2 - 7b*3 + 13b*2/2 + 22b + 10 = 0. -5, -1, -2/3, 2 Factor -5m3 - 960m*2 - 1900m. -5m(m + 2)(m + 190) Factor f3 - 2f*2 - 7f - 4. (f - 4)(f + 1)2 Factor 25p*3/4 - 135p*2 - 55p. 5p(p - 22)(5p + 2)/4 Factor 3z4 + 12z*3 + 15z*2 + 6z. 3z(z + 1)*2(z + 2) Solve r*5/2 + 3r*4/2 - 3r*3/2 - 7r*2/2 + 3r = 0. -3, -2, 0, 1 Suppose 2w5/9 - 476w*4/9 + 14080w*3/3 - 182400w*2 + 2496000w + 5760000 = 0. Calculate w. -2, 60 Determine t, given that 3t3 - 9t*2 - 30t + 72 = 0. -3, 2, 4 Determine l, given that 28l2 + 2484l + 2456 = 0. -614/7, -1 Find h, given that -4h4 - 916h*3 + 1864h*2 + 3664h - 7392 = 0. -231, -2, 2 Factor -4i2 - 148i + 152. -4(i - 1)(i + 38) Suppose -4g3/7 - 40g*2/7 + 148g/7 - 104/7 = 0. What is g? -13, 1, 2 Solve r3/2 + r2 - r/2 - 1 = 0 for r. -2, -1, 1 Factor -2g3/9 + 220g*2/9 + 74g/3. -2g(g - 111)(g + 1)/9 Suppose -15y*4 - 145y*3 + 65y*2 + 145y - 50 = 0. Calculate y. -10, -1, 1/3, 1 Factor 2r5/3 - 2r*4/3 - 12r*3 + 104r*2/3 - 80r/3. 2r(r - 2)*3(r + 5)/3 Factor -b*3/2 + 326b*2 - 106925b/2 + 105625. -(b - 325)*2(b - 2)/2 Suppose 2v4 + 52v*3 - 454v*2 - 10296v + 78408 = 0. Calculate v. -22, 9 Determine k, given that 2k3 - 82k*2 - 352k - 360 = 0. -2, 45 Factor 4c3/3 + 92c*2 - 568c/3. 4c(c - 2)(c + 71)/3 Suppose -5k*3 - 177k*2 - 70k = 0. What is k? -35, -2/5, 0 Determine r so that 2r5/3 + 8r*4/3 + 4r*3/3 - 8r*2/3 - 2r = 0. -3, -1, 0, 1 Factor -30603v2/5 - 2424v/5 - 48/5. -3(101v + 4)2/5 Factor z4/3 - 7z3/3 - 8z2/3. z2(z - 8)(z + 1)/3 Let -h*4/3 + 3h*3 + 11h*2 + 35h/3 + 4 = 0. What is h? -1, 12 Factor 2o4 - 112o*3 + 1452o*2 + 3248o + 1682. 2(o - 29)2(o + 1)*2 Let 100m*5 - 115m*4 - 195m*3 + 40m*2 + 20m = 0. Calculate m. -1, -1/4, 0, 2/5, 2 What is q in -2q3/11 - 172q*2/11 - 3698q/11 = 0? -43, 0 Determine p so that 2p5/17 - 4p*4/17 - 4p*3/17 + 8p*2/17 + 2p/17 - 4/17 = 0. -1, 1, 2 Factor -2y2/15 + 32y/15. -2y(y - 16)/15 What is r in -33r2/2 + 147r/2 + 45 = 0? -6/11, 5 Determine y, given that 2y2/7 - 74y/7 - 156/7 = 0. -2, 39 Factor -3b5 - 117b*4 - 1305b*3 - 3243b*2 - 3024b - 972. -3(b + 1)3(b + 18)2 Factor r5 + 110r4 + 3024r*3 - 110r*2 - 3025r. r(r - 1)(r + 1)(r + 55)2 Solve r5 + 4r*4 + 5r*3 + 2r*2 = 0. -2, -1, 0 Suppose -3r*5/5 - 6r*4/5 + 54r*3 + 120r*2 - 3507r/5 + 2646/5 = 0. Calculate r. -7, 1, 2, 9 Factor -v*2/7 - 208v/7 + 848/7. -(v - 4)(v + 212)/7 Find m such that 2m*3 - 56m*2 + 88m + 416 = 0. -2, 4, 26 Determine t so that -t*3/3 + 10t*2 - 64t - 512/3 = 0. -2, 16 Factor -20n4 + 296n*3 - 1124n*2 + 720n. -4n(n - 9)(n - 5)(5n - 4) Factor -3t*2 - 966t - 77763. -3(t + 161)2 Determine q, given that 4q*5/5 - 6q*4 + 38q*3/5 - 12q*2/5 = 0. 0, 1/2, 1, 6 Factor -3y3/2 - y2 + 8y. -y(y - 2)(3y + 8)/2 Factor 16b5/3 - 12b*4 + 8b*3 - 4b*2/3. 4b*2(b - 1)*2(4b - 1)/3 Let g2/5 + 61g/5 - 402/5 = 0. What is g? -67, 6 Find j, given that -140j3 - 3645j*2 - 3630j - 125 = 0. -25, -1, -1/28 Suppose 2p5/9 - 4p*3/3 - 16p*2/9 - 2p/3 = 0. What is p? -1, 0, 3 Let s*5 - 12s*4 + 48s*3 - 82s*2 + 63s - 18 = 0. What is s? 1, 3, 6 Factor -q*3 + 3q*2 + 10q. -q(q - 5)(q + 2) Let -2z3 + 24z + 32 = 0. Calculate z. -2, 4 What is o in -4o3 - 1088o*2 - 3236o - 2152 = 0? -269, -2, -1 Factor 5x3 + 15x*2 + 10x. 5x(x + 1)(x + 2) Factor -2y*2 + 112y - 1568. -2(y - 28)2 What is j in 2j*5/3 - 140j*4/3 - 886j*3/3 - 1952j*2/3 - 1816j/3 - 608/3 = 0? -2, -1, 76 Suppose -4a2 - 476a + 1968 = 0. What is a? -123, 4 Factor -2v2 - 42v - 220. -2(v + 10)(v + 11) Factor p*4/3 - 6p*3 + 20p*2 - 56p/3. p(p - 14)(p - 2)*2/3 Factor 2q*2/5 + 2q/5 - 36. 2(q - 9)(q + 10)/5 Factor -135v4 - 540v*3 - 450v*2 + 500v + 625. -5(v - 1)(3v + 5)3 Let 2l*3/9 - 256l*2/9 + 938l - 1764 = 0. Calculate l. 2, 63 Suppose -2n3/3 - 78n*2 + 2240n/3 - 1176 = 0. Calculate n. -126, 2, 7 Determine a, given that -9a4 - 570a*3 + 4163a*2 - 2584a + 420 = 0. -70, 1/3, 6 Solve -2t2/3 + 226t/3 + 460/3 = 0. -2, 115 Factor -2q2/3 + 6q - 12. -2(q - 6)(q - 3)/3 Solve -6g5/5 - 72g*4/5 - 24g*3 + 12g*2/5 + 126g/5 + 12 = 0 for g. -10, -1, 1 Factor 3y3 + 1065y*2 - 2142y. 3y(y - 2)(y + 357) Factor -m2/4 - 41m/4 - 39/2. -(m + 2)(m + 39)/4 Suppose -4k*3 + 2816k*2 - 495616k = 0. Calculate k. 0, 352 Factor 5u5 + 120u*4 - 130u*3 - 10200u*2 + 36125u. 5u(u - 5)*2(u + 17)*2 Factor 3t*5 - 2136t*4 + 380208t*3. 3t*3(t - 356)2 Determine c so that c2 + 612c - 613 = 0. -613, 1 Factor 4f*2 - 48f + 144. 4(f - 6)2 Let -k4 - 11k*3 - 24k*2 + 36k = 0. Calculate k. -6, 0, 1 Let -2x4 - 732x*3 - 64728x*2 + 415152x = 0. Calculate x. -186, 0, 6 Let n*5/3 + 200n*4/3 - 1016n*3/3 + 1838n*2/3 - 1433n/3 + 410/3 = 0. What is n? -205, 1, 2 Find c such that 3c5/5 + 3c*4/5 - 168c*3/5 + 432c*2/5 = 0. -9, 0, 4 Factor 2h*3 - 22h*2 + 30h + 54. 2(h - 9)(h - 3)(h + 1) Factor 2a*3/7 + 52a*2/7 - 2a/7 - 52/7. 2(a - 1)(a + 1)(a + 26)/7 Determine d, given that -d3/3 + 4d2/3 - d = 0. 0, 1, 3 What is l in -l3/3 + l*2 + 18l - 112/3 = 0? -7, 2, 8 Suppose -15w3 + 34104w*2 - 19377891w - 7756614 = 0. What is w? -2/5, 1137 Factor -10b2/13 + 472b/13 + 384/13. -2(b - 48)(5b + 4)/13 Factor -9r3/5 - r2 + 32r/5 + 28/5. -(r - 2)(r + 1)(9r + 14)/5 What is p in -2p3/15 + 236p*2/5 - 27848p/5 + 3286064/15 = 0? 118 Let 2k2/5 - 6k/5 - 36/5 = 0. Calculate k. -3, 6 Factor 35g3 + 360g*2 + 835g + 210. 5(g + 3)(g + 7)(7g + 2) Factor 3q5/5 - 12q*3/5 + 6q*2/5 + 9q/5 - 6/5. 3(q - 1)3(q + 1)(q + 2)/5 Factor 4z*2 + 48z - 52. 4(z - 1)(z + 13) Suppose n*	{ "pile_set_name": "DM Mathematics" }
What is the l'th term of -13, -5, 9, 29, 55, 87, 125? 3l2 - l - 15 What is the n'th term of 37854, 37852, 37850, 37848, 37846? -2n + 37856 What is the u'th term of 41, 64, 63, 32, -35, -144? -u*3 - 6u*2 + 48u What is the x'th term of 33, 53, 93, 159, 257? x*3 + 4x2 + x + 27 What is the p'th term of 1262, 1261, 1260, 1259, 1258, 1257? -p + 1263 What is the d'th term of -209, -194, -193, -212, -257, -334, -449, -608? -d3 - d*2 + 25d - 232 What is the h'th term of -19, -68, -149, -262, -407, -584? -16h2 - h - 2 What is the i'th term of -45, -27, -9, 9, 27, 45? 18i - 63 What is the k'th term of -127, -126, -125, -124, -123? k - 128 What is the d'th term of 27, 44, 85, 162, 287, 472, 729, 1070? 2d3 + 3d + 22 What is the x'th term of -61, -121, -181, -241, -301, -361? -60x - 1 What is the d'th term of 126, 287, 448? 161d - 35 What is the w'th term of 397, 489, 643, 859, 1137, 1477? 31w2 - w + 367 What is the m'th term of -49, -118, -245, -436, -697, -1034? -m3 - 23m*2 + 7m - 32 What is the w'th term of 38, 51, 82, 137, 222, 343? w*3 + 3w*2 - 3w + 37 What is the n'th term of 1331, 1330, 1329, 1328, 1327? -n + 1332 What is the y'th term of -1, -54, -157, -322, -561? -2y3 - 13y*2 + 14 What is the d'th term of -229, -454, -679, -904, -1129? -225d - 4 What is the f'th term of 4708, 9418, 14128? 4710f - 2 What is the j'th term of 10, 11, 12? j + 9 What is the z'th term of 202, 1613, 5440, 12889, 25166, 43477? 201z*3 + 2z*2 - 2z + 1 What is the g'th term of -717, -722, -727, -732, -737, -742? -5g - 712 What is the h'th term of 449, 900, 1351? 451h - 2 What is the d'th term of -230, -466, -712, -968? -5d2 - 221d - 4 What is the m'th term of -1539, -3077, -4615, -6153? -1538m - 1 What is the g'th term of -10, -67, -210, -481, -922? -7g3 - g2 - 5g + 3 What is the m'th term of 118, 515, 1182, 2125, 3350, 4863, 6670, 8777? m3 + 129m*2 + 3m - 15 What is the h'th term of -524, -555, -644, -821, -1116, -1559, -2180? -5h3 + h2 + h - 521 What is the b'th term of -151, -153, -153, -151, -147, -141, -133? b2 - 5b - 147 What is the z'th term of -69, -140, -211? -71z + 2 What is the d'th term of -11, -12, -13, -14? -d - 10 What is the x'th term of -100, -150, -102, 92, 480, 1110? 8x3 + x2 - 109x What is the t'th term of 24, 19, 4, -27, -80, -161, -276? -t3 + t2 - t + 25 What is the s'th term of 310, 619, 928, 1237, 1546, 1855? 309s + 1 What is the d'th term of 1722, 1723, 1724, 1725? d + 1721 What is the x'th term of 7742, 7743, 7744, 7745, 7746, 7747? x + 7741 What is the j'th term of -1203, -2407, -3611, -4815, -6019, -7223? -1204j + 1 What is the j'th term of 308, 299, 290? -9j + 317 What is the p'th term of -1069, -1075, -1083, -1093, -1105? -p*2 - 3p - 1065 What is the x'th term of -48, -92, -140, -192, -248, -308? -2x2 - 38x - 8 What is the i'th term of 13, 13, 15, 19, 25, 33, 43? i*2 - 3i + 15 What is the o'th term of -24, -52, -66, -60, -28, 36? o3 + o2 - 38o + 12 What is the j'th term of -135, -116, -97, -78? 19j - 154 What is the v'th term of -3618, -3621, -3624, -3627, -3630? -3v - 3615 What is the n'th term of -13, -8, -1, 8? n2 + 2n - 16 What is the t'th term of 49, 97, 143, 181, 205, 209? -t*3 + 5t*2 + 40t + 5 What is the d'th term of -43, 119, 389, 767, 1253, 1847, 2549? 54d2 - 97 What is the j'th term of 58, 39, -8, -83, -186? -14j*2 + 23j + 49 What is the s'th term of 311, 300, 267, 200, 87, -84? -2s3 + s2 + 312 What is the f'th term of 45, 129, 269, 465? 28f2 + 17 What is the g'th term of -501, -503, -507, -513, -521, -531? -g2 + g - 501 What is the i'th term of 14, 81, 184, 317, 474, 649, 836, 1029? -i*3 + 24i*2 + 2i - 11 What is the v'th term of 225, 441, 657, 873? 216v + 9 What is the i'th term of -676, -690, -704, -718, -732? -14i - 662 What is the o'th term of -59, -219, -483, -851, -1323, -1899? -52o2 - 4o - 3 What is the i'th term of -43, -57, -71, -85? -14i - 29 What is the u'th term of -17, -130, -421, -980, -1897? -15u3 + u2 - 11u + 8 What is the i'th term of 12, 49, 110, 195? 12i*2 + i - 1 What is the i'th term of -376, -742, -1108, -1474, -1840? -366i - 10 What is the u'th term of -23, -30, -37, -44, -51, -58? -7u - 16 What is the p'th term of 489, 964, 1439? 475p + 14 What is the q'th term of -2, 36, 144, 358, 714, 1248? 6q3 - q2 - q - 6 What is the s'th term of -199, -392, -585, -778, -971? -193s - 6 What is the v'th term of -2627, -2623, -2617, -2609, -2599? v2 + v - 2629 What is the h'th term of 301, 282, 275, 286, 321, 386? h3 - 26h + 326 What is the v'th term of 117, 235, 349, 459? -2v*2 + 124v - 5 What is the s'th term of -1582, -3165, -4748, -6331, -7914, -9497? -1583s + 1 What is the m'th term of -115, -234, -355, -478? -m2 - 116m + 2 What is the v'th term of -50, -95, -136, -173, -206? 2v2 - 51v - 1 What is the j'th term of -6451, -6452, -6453, -6454? -j - 6450 What is the u'th term of 21, -78, -177? -99u + 120 What is the z'th term of -3283, -6567, -9851, -13135, -16419? -3284z + 1 What is the o'th term of -22, -43, -56, -55, -34, 13, 92, 209? o*3 - 2o*2 - 22o + 1 What is the u'th term of 591, 602, 627, 672, 743, 846, 987, 1172? u3 + u2 + u + 588 What is the z'th term of 102, 454, 1056, 1914, 3034, 4422, 6084, 8026? z*3 + 119z*2 - 12z - 6 What is the z'th term of -43, -157, -341, -595, -919, -1313, -1777? -35z2 - 9z + 1 What is the s'th term of -5, -18, -31? -13s + 8 What is the p'th term of -332, -327, -322, -317, -312? 5p - 337 What is the l'th term of 8, -40, -170, -424, -844, -1472, -2350? -7l3 + l2 - 2l + 16 What is the t'th term of 105, 104, 105, 108? t*2 - 4t + 108 What is the k'th term of 8915, 8929, 8957, 9005, 9079, 9185, 9329, 9517? k3 + k2 + 4k + 8909 What is the w'th term of -109, -220, -331, -442, -553? -111w + 2 What is the r'th term of 23, 52, 81, 110, 139, 168? 29r - 6 What is the f'th term of -11, -26, -47, -74, -107, -146? -3f*2 - 6f - 2 What is the n'th term of -76, -310, -700, -1246, -1948? -78n2 + 2 What is the u'th term of -22, -38, -68, -118, -194, -302, -448, -638? -u3 - u2 - 6u - 14 What is the v'th term of -2842, -2840, -2836, -2830? v2 - v - 2842 What is the w'th term of 13, -12, -47, -86, -123, -152, -167? w3 - 11w2 + w + 22 What is the s'th term of 18, 29, 36, 39, 38, 33? -2s*2 + 17s + 3 What is the y'th term of -485, -1857, -4145, -7349, -11469, -16505? -458y2 + 2y - 29 What is the n'th term of -300, -376, -452? -76n - 224 What is the u'th term of 54, 124, 194, 264? 70u - 16 What is the l'th term of -198, -398, -602, -810? -2l2 - 194l - 2 What is the y'th term of 14, 10, 6, 2, -2, -6? -4y + 18 What is the a'th term of -388, -778, -1168, -1558, -1948? -390a + 2 What is the b'th term of -68, -75, -82, -89, -96? -7b - 61 What is the r'th term of 1180, 2361, 3542, 4723, 5904, 7085? 1181r - 1 What is the c'th term of 12, -24, -98, -216, -384, -608, -894, -1248? -c*3 - 13c*2 + 10c + 16 What is the f'th term of -2207, -2204, -2199, -2192, -2183, -2172? f*2 - 2208 What is the v'th term of -3965, -3974, -3987, -4004? -2v*2 - 3v - 3960 What is the n'th term of 786, 788, 792, 798, 806, 816, 828? n*2 - n + 786 What is the c'th term of 143, 282, 421, 560? 139c + 4 What is the f'th term of -8, -25, -52, -89? -5f2 - 2f - 1 What is the f'th term of 4108, 4109, 4110? f + 4107 What is the g'th term of -1837, -1834, -1831, -1828? 3g - 1840 What is the k'th term of 139, 235, 285, 289, 247? -23k*2 + 165k - 3 What is the n'th term of -503, -993, -1483, -1973, -2463, -2953? -490n - 13 What is the n'th term of -9, -3, 13, 39, 75? 5n*2 - 9n - 5 What is the u'th term of -3, -14, -25, -36, -47, -58? -11u + 8 What is the k'th term of 719, 1438, 2155, 2870, 3583, 4294? -k2 + 722k - 2 What is the g'th term of 121, 253, 387, 523, 661, 801? g*2 + 129g - 9 What is the s'th term of 61, 84, 99, 106? -4s2 + 35s + 30 What is the h'th term of -510, -511, -512? -h - 509 What is the x'th term of 41, 80, 105, 110, 89? -x3 - x2 + 49x - 6 What is the r'th term of 32, 46, 58, 68, 76? -r2 + 17r + 16 What is the j'th term of -109, -847, -2855, -6769, -13225, -228	{ "pile_set_name": "DM Mathematics" }
2925 Express (43475p - 324p*3 - 43475p)(6 - 1 + 2)(-2 + 5 + 0) as lp2 + y + op + tp3 and give t. -6804 Express (66l + 89l + 176l)(20l*3 + 8l*3 - 12l*3) in the form hl*4 + tl*2 + pl*3 + c + dl and give t. 0 Rearrange (-p - p + 3p)(3 - 2 - 4)(-259 + 474 - 860) to the form x + zp and give z. 1935 Rearrange (5s2 - 2s2 - s2)(8037 + 36593 + 37019 + 23249) to the form qs*2 + k + rs and give q. 209796 Express 72r3 + 449r*3 - 125r*3 + (14r - 8 + 8)(0r*2 - 4r*2 + 2r*2) as n + hr + mr2 + sr*3 and give s. 368 Express (21j*2 + 47j*2 + 2j*2)(6j + 5j - 17j - 5j - 14j) in the form dj*2 + cj + m + qj3 and give m. 0 Express 45j*2 - 1239442j + 1239442j + 50 as rj + m + nj2 and give r. 0 Express -509l*2 - 2162l*2 - 567l*2 - 253l*2 - 75l*2 as il + dl2 + a and give a. 0 Express 4357u - 6839u + 5 - 5 as z + du and give z. 0 Express -10r + 20r + 27r3 - 3r - 107r2 + 103r*2 in the form o + fr*3 + cr + hr2 and give o. 0 Rearrange -1366c*2 - 13c + 1364c2 + c3 - 30 + 28 to the form hc*2 + lc*3 + nc + t and give n. -13 Rearrange (-70w - 98w + 288w)(7w - 4w - 5w) - w2 + 3w2 - w2 to the form qw + s + nw*2 and give n. -239 Rearrange 71 - 2s - 55 - 27 - 45 to k + ns and give n. -2 Express 0n - 2n - 336719 + 436n*4 - 2n3 + 336717 - n2 in the form kn2 + m + rn*3 + sn*4 + jn and give k. -1 Rearrange (-41 + 21 + 1)(0v - 3v + 5v)(87 + 83 + 0) + (0v - 2v + 0v)(-1 + 1 - 1) to the form gv + l and give g. -6458 Express (-226 - 129 + 68)(1 + 0 - 2)(-3l3 + 1 - 1) as i + ol + tl2 + rl*3 and give r. -861 Express 1440f*4 + 6f*3 - 727f*4 - 2f*2 - 718f*4 - f as kf*3 + x + lf*2 + wf + zf4 and give k. 6 Express (-1 + 3 + 1 - 1 - 4 + 3 + (5 - 29 - 8)(3 - 1 + 7))(c + 0 + 0) as zc + l and give z. -287 Express -87 + 53 + 66 - 154p as ap + u and give a. -154 Express -2085i4 - i + 4134i*4 - 3i2 - i3 - 118 - 2051i4 as ki*4 + yi*2 + h + oi + ni3 and give h. -118 Express (3 - 4 + 5)(9 + 6z3 - 9)(216 + 166 + 52)(3z - 2z - 4z) as az + rz*3 + x + dz*2 + pz*4 and give p. -31248 Rearrange (5b - 5b - 2b + 2)(9b*2 + 0b*3 - 3b + b - b*3) + 2b*4 - 2b*4 + 2b*4 to jb*3 + kb*2 + m + rb*4 + zb and give r. 4 Rearrange 294 + 267 + 6351 + 3531p - 3533p to the form x + gp and give g. -2 Rearrange 874k*4 + 2 + 81508k*3 - 81504k*3 - 45k*4 + 2k - 2 to the form vk4 + p + jk + rk3 + ak*2 and give j. 2 Express (3m - 4m + 2m)(1 + 2 + 0) + 2 - 2m - 2 + m - 2m + 5m + 7m - 4m + 4m in the form im + k and give i. 12 Rearrange (6 - 3 + 2)(-56u*3 + 27u*3 + 19u*3) to the form t + ju*2 + yu + xu3 and give x. -50 Rearrange (3z*2 + 0z2 - z2)(3 - 3 - z2) - 4z*4 + 373z - 360z - 4z*4 to pz*3 + tz*4 + w + iz*2 + kz and give t. -10 Rearrange 11l2 + 4 + 7l*2 - 3162l*3 - 2l + 3158l3 to jl*2 + pl + v + zl3 and give p. -2 Rearrange 1497s - 2988s + 1497s + 61 + (0 - 1 - 1)(-s - s + s) to the form w + gs and give g. 8 Rearrange a*2 - 2a3 - a2 + (-2a + a + 2a)(22a*2 - 20a*2 + 10a*2) + 91a*3 + 148a*3 + 0a*3 to the form qa + pa3 + da*2 + c and give q. 0 Rearrange (-3 + 3 + r)(-r*2 + 0 + 0) + (5 - 3r*2 - 3 + 7r*2)(-4r + 8r + 5r) to br*3 + hr + a + kr2 and give k. 0 Rearrange 5744z2 + 23 + z3 - 3z3 - 5701z*2 to the form kz*3 + cz*2 + gz + h and give k. -2 Express (-w*4 - 4w3 - w4 + w*3)(116 + 19 - 255) in the form fw3 + qw + a + gw2 + jw*4 and give f. 360 Express (3s*2 - 8 + 8)(15967 - 10307 + 14647) in the form ls2 + p + ts and give l. 60921 Express 119j + 115j + 1 + 1 - 219j2 + 91j - 323j in the form l + fj*2 + sj and give f. -219 Express 3 - 2r - 3 + (0r - 5r + 9r)(-1 - 1 + 1) + 2 - 2 - 2r + (3 + 6 - 6)(-88r - 162r + 35r) - r - r + 4r in the form mr + h and give m. -651 Rearrange -410y2 + 830y*2 - 427y*2 + 5y + y*3 to xy*3 + c + by*2 + ly and give b. -7 Express 9334d + 17679d - 20545d - d + 3 - 3 - 5 + 2d + 5 + (1 + 2 - 5)(-2d + 3d + d) + (5 - 5 - 2d)(-2 + 2 + 2) in the form a + yd and give y. 6461 Rearrange -636 + 335 + 315 + j - j + 3j2 to the form aj*2 + nj + s and give s. 14 Express -76q4 - 63q2 + q3 + 69q2 - 3 + 7q + 74q4 as tq + v + aq4 + kq*2 + yq*3 and give t. 7 Rearrange 5070o + 3696o + 1334o + 1403o to the form go + f and give g. 11503 Express -21049z - 7z*2 - 3 + 10538z + 2 + 10509z in the form qz + fz2 + w and give f. -7 Express -2028r*2 + 4436r*2 - r - 1963r*2 in the form kr + dr2 + m and give k. -1 Rearrange -1727r + 3458r - 2 + 15r*2 + 2r*4 - 1732r to the form sr4 + br + q + ir3 + fr*2 and give f. 15 Express -6950n + 428 - 428 - 5761n as fn + m and give f. -12711 Rearrange (1922 + 3051 + 3533)(-4 + 2 + 4)(-4 - 1 + 4)(3q + 3q - 4q) to pq + x and give p. -34024 Rearrange (18503 - 7277n - 18503)(1 + 1 - 1)(5 - 1 - 3) to the form s + rn and give s. 0 Rearrange -102u*2 - 911 + 1812 + 4u - 4u - 914 to the form wu*2 + du + k and give k. -13 Express 9404m - 1223m + 760m + 6243m - 1058m as g + ym and give y. 14126 Express (77212 - 77212 + 3623a)(2a + 10a - 4a) in the form c + va*2 + ka and give v. 28984 Rearrange 2t + 4268 - 4251 - 3t + 5t2 - 2t*3 to nt*3 + ut*2 + g + lt and give u. 5 Rearrange -50715 - 5666r2 + 50715 + 20329r*2 to the form zr*2 + k + ar and give z. 14663 Rearrange -5 + 5 + 106c + 862c + 337c to gc + v and give g. 1305 Express (-4f + 7f - 2f)(4f - 5f + 4f) + (-f + 0f - f)((3 - 2 + 0)(4f - 5f - 3f) - f + 4f + 0f) as xf + of2 + j and give o. 5 Rearrange -4n + 92 + 399n4 + 3n + n*3 - 398n*4 to rn*4 + un*2 + zn + t + jn3 and give z. -1 Express -83o + 59o + 2o*2 - 86o - 1 - 648o in the form a + po + fo2 and give a. -1 Rearrange -2n*2 + 406 + 366 + 0n - 770 + n + n*4 - 523n*3 to the form fn*4 + y + gn*2 + zn + ln3 and give g. -2 Express (170 - 376 - 661)(2z2 - 5z*3 + 2051 + 4z*3 - 4z - 2049) as pz + g + kz*2 + iz3 and give g. -1734 Express -y2 - 68 + 121 - y*3 + 41y*4 - 52 as xy*4 + zy*2 + jy + py3 + c and give z. -1 Rearrange -81p - 96p + 1 - 1 + 9 + 62p to b + vp and give b. 9 Express -3 - 1100536x*2 + 1100517x*2 + 14x + 3 in the form gx2 + mx + b and give m. 14 Rearrange 36049x - 7404x + 948x + 13067x + 4249x to lx + y and give l. 46909 Express -2710 + 852y2 - 2699 + 5409 + 4y in the form ky2 + dy + f and give k. 852 Rearrange -579u - 616u - 12u3 + 581u - 392u - 248u to the form lu2 + zu + p + wu3 and give z. -1254 Rearrange -69110015 + d3 + 69110015 + 4d*2 + 123d to c + ud2 + jd*3 + id and give i. 123 Express (-6 - 1 - 3o + 6)(-5039 + 659 - 3346 + 425) in the form k + io and give k. 7301 Express (-13 - 2 - 9)(-2327v2 + 2327v*2 - 195v*4) as mv + rv2 + yv*4 + cv*3 + p and give y. 4680 Express -14 + 161o*4 - 87o*4 - 2o + 8717o3 - 8717o*3 - 104o*4 + 5o*2 in the form ko*2 + yo*3 + vo + co4 + p and give v. -2 Express -143i*2 - 3 + 73i*2 + 1 - 12i*3 + 77i*2 in the form xi + r + si3 + ni*2 and give r. -2 Rearrange -5f - 2f2 - f4 - 12f + 4578 - 4572 to the form af2 + u + zf*3 + lf + if4 and give a. -2 Express -67w + 179 + 8w2 - 12w + 81w as sw + gw2 + t and give t. 179 Express (39k2 + k3 - 39k2)(1357 + 32 + 1225 + 305 + 560) + 0k3 - 3k*3 + 4k*3 in the form ik*2 + wk + g + qk3 and give q. 3480 Express -306r*2 + 305r*2 + 69 - 9r + 6r3 - 70 as yr + dr2 + w + zr*3 and give y. -9 Express -734h + 1506 - 148h - 1517 in the form p + vh and give p. -11 Rearrange 3d - 40d4 + 879 + d3 + 2d3 - 6d*3 + 2d*3 - 882 to the form nd*3 + gd*2 + bd + l + od4 and give g. 0 Rearrange (2954 + 51818v + 3001 - 5955)(2v + v - v) to m + cv + pv2 and give m. 0 Express ((-o2 + 4 - 4)(-44o - 381o - 51o) + (0o + 0o + o)(-6o*2 + 3o2 + o2))*(-1 + 16 - 3)	{ "pile_set_name": "DM Mathematics" }
t is ((-12)/9 - -2) + 16/12? 2 Calculate (6/162)/6. 1/8 Evaluate 15/9672/280. 4 What is ((-20)/20)/(3/21)? -7 Evaluate (-15)/(-10)4/(-10). -3/5 Calculate (-3)/(-2) - (3 - -2)/(-10). 2 Calculate 216/(-243) - (-3)/(-27). -1 What is the value of (-2)/12(-75)/(-5)? -5/2 What is (-2 - 1) + -6 - (-12 - -9)? -6 What is the value of 20/690/(-175) + 2? 2/7 (-14)/3 - 42/(-63) - -3 -1 What is the value of 8/5(-16)/(-32)? 4/5 Calculate 0((-2 - -2) + 1). 0 Evaluate 3 + (-30)/5 + 5. 2 Calculate (48/(-56) - 39/(-7)) + -5. -2/7 What is ((-2)/1)/(8 - 6)? -1 What is ((-27)/36)/((-7)/28)? 3 Calculate 9(-187)/(-459) - 4/6. 3 Calculate 4/3 - 133/114. 1/6 Evaluate 2 + (1 - 1)/4. 2 Evaluate (60/(-160))/(3/(-10)). 5/4 What is (-294)/3430 - (-4)/(-70)? -1/7 Evaluate ((-64)/336)/((-6)/7). 2/9 (18/(-12))/((-18)/(-28)) -7/3 (-10 - -2 - -10)/(-19) -2/19 Calculate (-18)/(-4)100/750. 3/5 Evaluate ((-2)/(-3))/(8/(-60)). -5 What is the value of 79/336-2? -3/8 What is -15 - -15 - (15/9)/5? -1/3 What is (-5)/(-5)3 + (12 - 15)? 0 What is the value of 460/2761/(-5)? -1/3 What is (-3)/(-1) + (-2)/(-1)? 5 What is the value of (177/(-18) + 10)8/(-2)? -2/3 Evaluate -3 - ((-25)/102 - 5). 7 What is (388/56 - -1) + 0 + -8? -1/14 Calculate 3 + 140/(-44) - (-18)/(-22). -1 Evaluate (-312)/(-390)3/4. 3/5 Evaluate 39/845 - 3/15. -2/13 Calculate ((-10)/20)/(3/(-2))-2. -2/3 10 - (-5)/(-20)20 5 2/50(-79 - -84) 1/5 What is the value of (-3)/2(6 + 8/(-4))? -6 (8/(-64))/((-2)/(-12) - 0) -3/4 ((-1)/2)/(-2(-2)/(-32)) 4 What is the value of 1 - 165/10(-6)/(-117)? 2/13 What is ((-2)/(-3))/((-20)/(-138)) + -5? -2/5 What is ((-45)/6)/5 - (-1491)/1050? -2/25 What is the value of 2/(0 - 2)4? -4 Calculate (9 - (1 + (6 - 2))) + -7. -3 Evaluate 144/81 - 10/(-45). 2 What is (-3)/3 + 1 + 0 + 1? 1 What is the value of (10/90)/((-12)/(-9))? 1/12 What is (7/(-2) - -2)18/(-27)? 1 Calculate 8/(-12) + 12/92. 2 What is the value of (-2)/(-2) + (-106)/159? 1/3 (-230)/805 + 1 + (-5)/7 0 Evaluate (1/(-3)3 + 1)/3. 0 Calculate (-2)/6(-18)/3 - 5. -3 Evaluate -3 - (-1)/((-9)/(-81)). 6 Calculate (6 - (-8 + 13))(-2)/10. -1/5 Evaluate 0/((-144)/60 - 2/(-5)). 0 Evaluate ((-212)/(-40) - 5)(-8)/(-6). 2/5 -410/(11 - 31) 2 Calculate (-7 + 6)(3 + -4). 1 What is (24 - 26)/(1/4)? -8 Evaluate ((-4)/(-3) - 1)(-162)/(-90). 3/5 Evaluate 11/1(0 - 1). -1 What is the value of (-6)/4 + (-125)/50? -4 (18/6)/(-745/10) -2/21 (10/31-3)/(-8) 5/4 Evaluate (6/(-9))/((-32)/12). 1/4 Calculate 01/(-2)31/(-93). 0 ((-18)/(-32))/(39/(-26)) -3/8 Calculate 14/44(-9)/21. -6 (-15)/(-10) + 2 + 17/(-2) -5 What is (-136)/280 + (4/(-2))/(-10)? -2/7 Evaluate (15/20)/((9/(-20))/(-3)). 5 (-42)/(-252) + (-14)/12 -1 What is the value of (96/(-40))/((-39)/65)? 4 What is the value of ((-3)/(-2))/(27/(-36))? -2 (0 + 0)(-21)/42 0 Calculate 1/(-2)(-8)/(-12). -1/3 Evaluate (-4)/(-12) + 56/(-24). -2 Calculate 12/(-32) - ((-50)/16 - -2). 3/4 What is 128/1224 - (-6)/(-27)? -2/17 Calculate 1/7 + 154/(-49). -3 45/1226/130 3/4 What is ((-9)/(-27) + 0)(-12)/(-8)? 1/2 Evaluate (-3)/2 - 16/(-12). -1/6 Calculate (-11)/((-88)/28) - 1/2. 3 Calculate (6/36)/(5/(-10)). -1/3 Evaluate (27/(-6))/((-10)/(-20)). -9 What is 14/28-2? -2/7 Evaluate 6/(-33) - (-136)/22. 6 Calculate (-22)/20 - 6/(-12). -3/5 Evaluate 90 + -86 - 126/33. 2/11 Evaluate 2(1 - 24/21). -2/7 Calculate 5 - 90/8 - -6. -1/4 What is the value of ((-552)/460)/(2/(20/(-3)))? 4 What is the value of 1/(-3) + (-5)/(-33)? -2/11 What is the value of (234/(-156))/((-5)/2)? 3/5 What is the value of 22/6 - (14 - 10)? -1/3 Evaluate ((-12)/(-42))/(16/(-28))-2. 1 Evaluate 16/12 - 6/9. 2/3 What is the value of 51/(-34)2/(-11)? 3/11 (-9)/(-12) + 369/132 - 3 6/11 Calculate (50/20)/(30/(-72)). -6 What is 2-2 + 3/((-12)/(-28))? 3 Calculate (-9)/60 - (-1)/(-4). -2/5 (-50)/(-154) + (5 - 228/44) 1/7 Calculate -6 - (23 + 234/(-18)). 1 What is ((-7 + 1)4/(-12))/2? 1 Evaluate 2 + 9/(-4) + 1/4. 0 4/(-58) - (-286)/(-58) -5 What is the value of ((-4)/22)/(116/(-319))? 1/2 (-1)/2 - (-72)/(-48) -2 What is the value of ((-21)/245)/(45/50)? -2/21 (10 + (-3 - 2))1 5 Calculate (18/(-8))/(-9)-20. -5 Calculate (15/2)/((-246)/24 + 5). -10/7 Calculate ((-3)/(-1))/(3 - (-10)/(-5)). 3 Calculate (4/24)/((-1)/10). -5/3 (-14)/382/(-7) 2/19 Evaluate (5 - 7) + 0(-3)/18. -2 Calculate 3 + 8 + 581/(-49). -6/7 Calculate 1550/5850 - (-4)/(-26). 1/9 Evaluate (-3)/(1980/32) - 4/30. -2/11 Evaluate ((-28)/(-168))/(3/(-12)). -2/3 Evaluate ((-5)/(-20))/(2/(-8)). -1 What is the value of -9 - (-6 - -8 - 11)? 0 What is the value of 165/(-21) - (-27)/(-189)? -8 2/2 - (-5)/(90/(-26)) -4/9 What is -12((-5)/3)/5? 4 Evaluate (-18)/72 + (-22)/(-8). 5/2 What is the value of -14 + 10 - 68/(-18)? -2/9 What is (-2)/(-4) + (-130)/20? -6 What is the value of -18 - -16 - 0/1? -2 Calculate (-2 - -8) + (-14 - (-110)/10). 3 (74/(-111))/((-1)/3) - 8 -6 What is (180/(-52))/(-3) - 2/13? 1 (13/(-3) + 5)/2 1/3 Evaluate 14 + -9 + -7 + 0. -2 Calculate 3/120(-2 - -1). 0 What is (31 - 27) + -1 + -7? -4 6((-121)/(-66) - 2) -1 Calculate (-24)/(-42) + (2 - (-34)/(-14)). 1/7 Calculate 2/5((-332)/(-44) - 8). -2/11 Evaluate 4/18 + (-26)/36. -1/2 Evaluate (-2057)/(-85) + -24 + 88/10. 9 What is 4/251/1173? 2/23 Calculate (-6 - -5)-8(-1)/24. -1/3 What is the value of (15/(-50)5)/(1/4)? -6 What is the value of (-2)/(-7) - (1035/35)/9? -3 Calculate -7 - (0 + (0 - 3)). -4 (-100)/198 + (-248)/(-4092) -4/9 ((-58)/(-18) - (-8)/(-36)) + -1 2 Evaluate (-1 + 5 + 0)-1. -4 What is 2/7 + (-952)/(-98) + -3? 7 What is the value of (6/(-3) - -2)/(12 - 13)? 0 What is the value of 133/(-105) + (6 - 224/35)? -5/3 Calculate (-3)/((4/(-1))/((-688)/258)). -2 ((-55)/(-5))/113 3 What is -3 - 391/(-115)10/12? -1/6 What is (-1)/2-1(-8)/(-12)? 1/3 What is the value of (-10)/(-30) - 48/9? -5 What is ((-4)/(-12)-1)/(2/30)? -5 Evaluate 10/4(-18)/45. -1 What is the value of (-25 - -27) + 12/(-10)? 4/5 Calculate (4 - (-96)/(-12))(-3)/(-6). -2 Evaluate -62/41. -3 24/10 + (-10)/25 2 Calculate (-18)/63(5 - -2). -2 What is the value of (451/44 - 8) + -1? 5/4 Calculate (-3 - -2)/((-4)/(-20)). -5 Evaluate -1 - -3 - (-6)/(-2). -1 What is the value of 40/(-60)(-21)/(-175)? -2/25 Evaluate -2 + (2 - 3) - 0. -3 What is the value of 1/39/15? 1/5 What is (2 + 4/(-3))(45 - 42)? 2 What is the value of (-1)/(-3)99/11? 3 What is the value of 10/20 - (0/2)/2? 1/2 ((-4)/6)/((-100)/15) 1/10 Evaluate (2 + -4)/(5 - (4 - 13)). -1/7 What is the value of (1/(-2))/((-2)/(-4)2)? -1/2 Calculate 0/(1 + (8 - 10)). 0 What is the value of -16 + 24 - (14 + -1)? -5 0/(-12) - ((-22)/14 - -1) 4/7 ((20/(-36))/5)/((-4)/48) 4/3 3 + (-11)/((-11)/4) 7 Calculate (7 - 40/6)(-18 + 0). -6 Evaluate 2 + 1 + 1/(-1)2. 1 Evaluate (-8)/2 - (-26)/8. -3/4 Evaluate 12/(-32) - (-2)/8. -1/8 (-52)/14 - 10/35 -4 Calculate 1012/180 - (-2)/(-5) - 5. 2/9 What is (-37)/30 + (-30)/(-75)? -5/6 What is -11 - ((-3104)/36)/8? -2/9 Evaluate (1/5)/(-27 + (-3636)/(-135)). -3 Evaluate -5 - -8(3 + -2). 3 Calculate (-75)/20 - -3 - 43/(-68). -2/17 ((-54)/108)/(2/(-12)) 3 What is ((-14)/(-21))/((-14)/(-6))? 2/7 (-1)/4 - (2 - 116/16) 5 (5 - 1)4/81 2 Calculate (-1)/((-6)/15)(-26)/(-130). 1/2 Calculate (-48)/(-128) - (61/(-8))/1. 8 -7(44/35)/115 -4 Evaluate (-2 - 1 - -6)/3. 1 What is (66/88)/(6/(-40))? -5 What is (-10)/3 + 20/15? -2 Calculate 15 + -127 + 118. -4 What is (48/(-96))/((-2)/(-12))? -3 Calculate 18/(-30) + 4/(-10). -1 What is the value of 1(-1)/100? 0 Evaluate 4 + (-6)/(5 - 11). 5 Calculate (-214)/42 - (-114)/1197. -5 Evaluate -4 - (-3 - (-3 - 86/(-20))). 3/10 Evaluate (-4 + 15/6)/(45/(-18)). 3/5 Evaluate (4/12)/(64/(-60) + 1). -5 What is the value of (-3 + 2)/(15 + 1378/(-91))? 7 6/(-15) - (-1 + 0) 3/5 Calculate ((-12)/(-32))/(2/(-4)). -3/4 88/210 - 4/1505 2/7 1/(-6) - ((-8)/48 + -5) 5 Calculate -5 + 1 + 45/5. 5 Evaluate 5(-8 - 2590/(-325)). -2/13 Calculate (((-3)/(-2))/1)/(2/(-12)). -9 1(-10 + 78/8) -1/4 What is (10/20 - 4)-2? 7 (4 + (-36)/8)(-2 - 0) 1 Evaluate ((-4)/20)/(6/(-75)). 5/2 Evaluate (-8)/36/(-8). 2 Calculate -3 - (-10)/(3 - 1). 2 What is (-1 + 2)(24/9 + -3)? -1/3 What is -1 - -4 - (-11 + 18)? -4 What is the value of (26/(-39))/((-2)/21)? 7 27/6 - 8/(-16) 5 6/(-7) + (-26 - (-9108)/336) 1/4 What	{ "pile_set_name": "DM Mathematics" }
7 a composite number? True Is 1670303 a composite number? False Is 6234859 a prime number? True Is 1517699 a prime number? True Is 1724539 a prime number? False Is 14192447 composite? True Is 87030061 a composite number? False Is 1188527 composite? False Is 1109065 a composite number? True Is 10208027 a composite number? False Is 44561087 prime? True Is 4132113 a prime number? False Is 295591 prime? True Is 2060743 composite? True Is 12962621 a prime number? False Is 2983213 composite? False Is 254877969 a composite number? True Is 1406983 prime? True Is 584303 a prime number? True Is 6383021 a prime number? True Is 9026509 composite? False Is 209521427 prime? True Is 72708731 a prime number? True Is 1285993 a composite number? False Is 329771779 a composite number? True Is 169013623 composite? False Is 16848281 a prime number? True Is 68154893 prime? True Is 914647 composite? False Is 88099 a prime number? False Is 95405779 a composite number? True Is 5884831 prime? False Is 22651091 a prime number? True Is 33531577 composite? False Is 12862097 composite? False Is 60073771 prime? False Is 14757329 a prime number? False Is 5193413 composite? True Is 28860077 prime? False Is 6110953 prime? False Is 532786633 a prime number? False Is 29814179 composite? True Is 37469 composite? True Is 2049881 prime? False Is 10997513 a composite number? False Is 23356037 composite? False Is 48766789 a prime number? True Is 50733071 a prime number? False Is 46978705 composite? True Is 168042673 a composite number? False Is 2229991 a prime number? True Is 3083071 prime? True Is 45461389 prime? False Is 11852591 a prime number? True Is 903103 prime? True Is 4269061 composite? True Is 258594359 a prime number? False Is 450714587 a prime number? True Is 3009931 a prime number? True Is 907630237 composite? False Is 99092311 a composite number? True Is 4523267 prime? False Is 40199921 prime? True Is 29441611 prime? False Is 282702151 a composite number? False Is 1878257 prime? True Is 44293 a composite number? False Is 892627 a prime number? True Is 29677309 a prime number? False Is 711041 a prime number? True Is 1063936393 a composite number? True Is 12585037 a composite number? False Is 1397381 a composite number? True Is 1877531803 a prime number? False Is 906431681 composite? False Is 198695467 a composite number? False Is 85031867 prime? True Is 503077 a composite number? False Is 1819819 composite? False Is 235783 prime? True Is 54082241 prime? False Is 48376999 a prime number? False Is 14979721 prime? True Is 364811 composite? True Is 1007008763 a composite number? True Is 17913853 a prime number? False Is 51223511 prime? True Is 8785571 a prime number? True Is 18769051 prime? False Is 13442621 a prime number? True Is 82891 prime? True Is 1646683 prime? False Is 21538061 composite? False Is 162983941 prime? True Is 3665231 composite? True Is 101658841 a prime number? True Is 38909963 composite? False Is 35685409 a composite number? False Is 1952927 a prime number? False Is 48556463 composite? True Is 9239089 prime? True Is 143661317 prime? True Is 3863549 a prime number? True Is 146804617 a composite number? False Is 27175739 prime? False Is 427990831 prime? False Is 76243763 a prime number? True Is 3910337 composite? False Is 2581039 a composite number? True Is 7193671 prime? True Is 2295109 a composite number? True Is 710081 prime? True Is 17196037 a composite number? False Is 22444291 composite? True Is 261571199 a composite number? False Is 32303263 a prime number? True Is 1863541 a composite number? False Is 499259 a composite number? True Is 520279 a prime number? True Is 10898 composite? True Is 22977881 a composite number? False Is 9286309 prime? True Is 101646977 a composite number? False Is 1455403 composite? False Is 54593087 composite? True Is 27941 prime? True Is 10428791 a composite number? True Is 10432231 prime? True Is 16282399 a composite number? True Is 1592753 a prime number? True Is 4573421 a composite number? False Is 12531927 a prime number? False Is 362300663 prime? True Is 154730377 a composite number? True Is 10093115 a prime number? False Is 97062059 prime? True Is 2139857 prime? True Is 7777663 composite? False Is 3697719 a prime number? False Is 247001063 a prime number? True Is 4125287 a composite number? False Is 950407 prime? False Is 783737 a composite number? False Is 2131651 a prime number? True Is 616963 prime? False Is 2467721 a composite number? True Is 395224283 prime? False Is 8231101 prime? False Is 188642569 a composite number? False Is 30052673 a composite number? True Is 1334663 a composite number? True Is 1603409 a composite number? True Is 1878859 composite? True Is 812682419 a prime number? True Is 8163457 prime? True Is 9140191 a prime number? False Is 662071299 a composite number? True Is 230129583 prime? False Is 403993 composite? False Is 1417437589 a composite number? False Is 20640793 composite? False Is 576354423 a prime number? False Is 5828759 a prime number? True Is 8321737 prime? False Is 488791505 prime? False Is 16477889 composite? False Is 45814039 prime? False Is 90046441 a prime number? True Is 71116973 prime? False Is 1569944661 prime? False Is 19652077 composite? False Is 249071 composite? True Is 195134699 composite? True Is 176996791 composite? False Is 5910097 a composite number? False Is 14510527 composite? True Is 48032417 a composite number? False Is 38989103 a prime number? False Is 974033 prime? True Is 15702421 composite? True Is 2380819 a composite number? True Is 1297963 a prime number? True Is 14562061 a composite number? False Is 2239183 composite? True Is 5099141 composite? False Is 3262081 prime? True Is 118091417 a composite number? False Is 6969217 a prime number? True Is 633291 a composite number? True Is 132343943 a prime number? True Is 89400083 a prime number? True Is 1615327 a prime number? False Is 43131229 composite? True Is 45757507 a prime number? True Is 32608795 composite? True Is 264167 a composite number? False Is 927203 a prime number? False Is 11665509 a composite number? True Is 30615295 a prime number? False Is 214921 a prime number? False Is 109810703 prime? False Is 23493389 prime? True Is 5120897 a prime number? False Is 4224673 a composite number? False Is 223317961 prime? False Is 13360989 composite? True Is 62068507 a prime number? True Is 291187183 a prime number? False Is 15144979 prime? True Is 58441109 prime? True Is 20876389 composite? False Is 166260083 prime? False Is 6277889 composite? False Is 16563671 composite? False Is 153936637 prime? True Is 47010419 prime? True Is 9466627 a composite number? True Is 7947587 a composite number? False Is 23663 a composite number? False Is 7137659 composite? True Is 111256111 composite? True Is 628319 prime? True Is 9168694 prime? False Is 120203077 a prime number? False Is 22432829 composite? False Is 87584117 a prime number? True Is 361409 composite? False Is 164890111 a composite number? False Is 2957873 a prime number? True Is 1331921 a prime number? True Is 222244019 a prime number? False Is 108969221 a composite number? False Is 259801 a composite number? False Is 5021693 a prime number? True Is 680623 a prime number? True Is 1102951 a composite number? False Is 4555379 a prime number? False Is 599763803 composite? False Is 257281853 a composite number? False Is 32327597 prime? True Is 1042077 prime? False Is 27702569 a prime number? False Is 11255719 prime? False Is 4721165 composite? True Is 121993 composite? False Is 401473 prime? True Is 105884581 composite? True Is 442789 a composite number? False Is 2593607 composite? False Is 9992321 a prime number? True Is 3653395 a prime number? False Is 1256531 a composite number? False Is 640529 a composite number? False Is 7974437 composite? False Is 29243 prime? True Is 14604187 a prime number? False Is 14351 prime? False Is 601506377 a composite number? False Is 10273597 composite? False Is 83261029 a composite number? True Is 6516833 prime? True Is 3265909 a prime number? False Is 11587309 a prime number? True Is 1042445 a composite number? True Is 4099237 composite? True Is 146413689 a prime number? False Is 92043331 a prime number? False Is 35491979 pr	{ "pile_set_name": "DM Mathematics" }
+ 4p - 3. Suppose -2t = -14t + 24. Give z(t). 9 Suppose -7g - g + 16 = 0. Let h(n) = -8n - 5n*g - 1 - 5n*2 + 9n*2. What is h(-8)? -1 Suppose -28t = t - 261. Let z(h) = -h - 8. Give z(t). -17 Let i = -9 + 12. Let a(p) = -p*3 + 1 + 2p + 2p2 - ip + 0p2. Suppose 0z - z = -2. Give a(z). -1 Suppose -4k + 8 = -0k. Let y be 7/5 + 3/5. Let f(a) = -6a2 - a3 - 1 - ya + a*k + 0a*2. Calculate f(-3). -13 Let x(t) = 2t + 7. Let u(c) = c*2 + 20c + 84. Let q be u(-13). Calculate x(q). -7 Let m(s) = -s*2 + 7s - 4. Suppose 12n - 17n = -30. Determine m(n). 2 Let b(h) = -h*3 + 4h*2 - 3. Let f = -70 + 73. Suppose j = -fj + 16. Calculate b(j). -3 Let k(z) = -2z2 - z + 2. Let c(f) = 5f - 69. Let h be c(13). Let q(s) = -3s2 - s + 3. Let x(t) = hk(t) + 3q(t). Give x(2). -1 Let v(d) be the first derivative of d4/4 - 5d*3/3 + 3d*2/2 + 4d - 1227. Let g be (8/10)/((-1)/(-5)). Calculate v(g). 0 Let o(b) = 8b - 3. Let y = 510 + -506. Give o(y). 29 Let n(s) be the second derivative of s3 + s2 - 21s. Let u = 38 + -40. What is n(u)? -10 Let h = 18 - 16. Let m(d) = 4d - 2d*h - 4d*2 + 5d*2 - 6 + d. Suppose -5g = -3w + 7, -4g = -g - 3. What is m(w)? -2 Let b(l) = 2l2 - 12l - 12. Let k be b(7). Suppose h + 4h = -2z + 14, -8 = -4z. Let x(a) = a + ak + ah - 3a + a + 5a3. Give x(1). 6 Let h(f) = -1. Let s(c) = c2 - c - 6. Let o(j) = -4h(j) - 2s(j). Let l(x) be the first derivative of o(x). Let u = -5 - -7. What is l(u)? -6 Let d(v) = 2v + 13. Let z(l) = -12l - 67. Let m be z(-5). Calculate d(m). -1 Let s(r) = 3r + 2. Let b(q) be the second derivative of -q*3 - 3q*2/2 - q. Let m(k) = 4b(k) + 7s(k). Let y = -5247 - -5245. What is m(y)? 8 Let f(c) be the first derivative of c4/4 + c3 - 2c*2 - 4c - 54. Let a be (-9)/31/1. Calculate f(a). 8 Let o(g) = g3 - g2 + 2g - 4. Suppose 3u - 5 = w, 19u - 5 = 14u + 5w. Calculate o(u). 4 Let a(h) = 2h2 + 28h + 2. Let u be a(-14). Let n(w) = -3w - 9w*u + w + 149 - 150. Suppose -3 = -f + 4f. Determine n(f). -8 Let x be 3(-7)/((-210)/50). Let s(y) = y3 - 5y*2 + 2y - 9. Determine s(x). 1 Suppose 122i = 119i - 6. Let j(x) = x*3 - 2x - 2. Determine j(i). -6 Suppose 5b = 3 + 7. Suppose 3c + 1 + b = 0. Let w be (15/12)/(c/(-4)). Let m(l) = l - 4. Calculate m(w). 1 Let t(w) = -w*2 + 6w - 10. Suppose -13f + 44 = -8. Determine t(f). -2 Suppose -3d + 3g + 6 = 0, -2g - 2g - 4 = -3d. Let n(v) be the first derivative of -v3/3 + v2/2 + 4v + 267. Determine n(d). -8 Let w(v) be the first derivative of -v3/3 - 3v + 17. Let m(i) = 1. Let d = 1 + -2. Let o(h) = dw(h) - 6m(h). Determine o(-3). 6 Let w(z) be the first derivative of -2z3 + z2 + 11. Give w(1). -4 Let x(d) = -6d + 5. Let b(s) = -s + 1. Let m(r) = 11b(r) - 2x(r). Determine m(-10). -9 Let o(c) = -3 - 2c2 + 2 - 2c*2. Let f be -2(68/8 + -9). What is o(f)? -5 Let y = 7 + -11. Let l = 23 - 27. Let s(n) = 5n3 + 9n*2 + 11n + 5. Let o(k) = -k3 - k2 - k. Let i(v) = lo(v) - s(v). Calculate i(y). 7 Let l(s) = s2 - 3s - 3. Suppose 4m = x + 2m, -5m + 15 = -x. Suppose 0 = q - 2h - 15, 0 = -4q + q - 5h - x. Give l(q). 7 Let q(z) = -2z3 - 3z*2 - 2z - 3. Let o = 59 + -57. Suppose 3b + 5 = u, ou + 1 + 1 = 0. What is q(b)? 5 Let z(i) = -2i3 + 17i*2 - 19i - 12. Let l be z(7). Let c(t) be the first derivative of 1/3t3 - 3t + t*l + 8. Give c(-3). 0 Let u(l) = 6l + 3. Let w(i) = -7i - 3. Let k(s) = -5u(s) - 4w(s). Let j be (5 + -8)25/15. Determine k(j). 7 Let k(h) = -h*2 - 12h + 15. Let i be (3/(-3) - 2)/(-1) - 16. Give k(i). 2 Suppose -6k - 6k = -96. Let m = 8 - k. Let o(q) = q3 - q2 - q + 14. What is o(m)? 14 Let t = 31 + -17. Let q(i) = i*3 - 13i*2 - 13i - 16. What is q(t)? -2 Let w(d) be the third derivative of -d6/120 - d5/60 + d*4/12 + 13d*3/3 - 13d*2 + 7. What is w(0)? 26 Let u(n) = -14n*2 + 13n + 52. Let z(k) = -3k2 + 3k + 13. Let m(q) = 2u(q) - 9z(q). Calculate m(0). -13 Let o(k) = k*2 + 4k + 3. Let x(h) be the first derivative of -h*4/4 + 7h*3/3 + 4h*2 - 3h - 18. Let s = 4 + 4. Let m be x(s). Calculate o(m). 0 Let m(c) = -c*2 + c + 13. Suppose 4p - p - 6 = 0. Suppose 4 = -3v - pd, d = 5v - 0 - 2. Calculate m(v). 13 Let g be (-29)/(1044/96)3/(-2). Let q(k) = k*3 - 3k*2 - k + 5. Calculate q(g). 17 Let i(t) = 3t*2 + t - 1. Let v be 51/33 - (-84)/(-154). Calculate i(v). 3 Let k = -1 + 0. Let g(i) = -11i + 1. Let x(u) = -56u + 6. Let j(a) = a2 + 14a - 11. Let c be j(-14). Let y(r) = cg(r) + 2x(r). What is y(k)? -8 Suppose 0 = -6x - 15 + 27. Let z(w) be the first derivative of -5w + 1/3w3 - 4 + xw*2. Give z(-5). 0 Let w(y) = -5y - 1. Let g(j) = -6j - 1. Let u(h) = 3g(h) - 4w(h). What is u(7)? 15 Let s be 8/(8/(-4)) - (-11 + 4). Let u(h) be the second derivative of -1/20h*5 + 2/3h*3 - 5/12h*4 + 8h + 0 + sh2. Calculate u(-5). -14 Let n(y) = 9585 + y3 - 9590 - 10y*2 - 2y - 2y. What is n(10)? -45 Let h(a) be the third derivative of a4/8 - 7a3/6 - a2. Let l(n) = -n*2 - 3n + 7. Let w be l(-7). Let f = w - -26. Calculate h(f). 8 Let v(k) = 7k2 + 4. Let j(i) = 20i*2 + 11. Let g(m) = -6j(m) + 17v(m). Let h = 1 + -4. Let d be 50/(-18) + (-10)/(-135)h. Determine g(d). -7 Let v(b) = -3b - 26. Let y(n) = 10n + 80. Let c(q) = -7v(q) - 2y(q). Give c(-23). -1 Suppose 4n - 4c - 35 = -n, n + 3c - 7 = 0. Let h(u) = n + 5u + 2u + 2 + 1 + u2. Determine h(-7). 10 Let a(c) be the second derivative of -c5/60 - c4/8 - c3/2 + c2/2 - c. Let f(j) be the first derivative of a(j). Let w = 153 - 157. What is f(w)? -7 Let c(r) = -2r*3 - 9r*2 + 14r + 47. Let b be c(-5). Let m(h) = -3h2 - 4h + 14. Determine m(b). -6 Let z(s) = -3s - 5s3 + s2 - 4s2 - 3s*2 + s. Let u(r) = 3r*3 + 3r*2 + r. Let t(w) = -7u(w) - 4z(w). Give t(3). 3 Let s(w) = w3 - 14w*2 + w - 8. Let n be (-35)/3420/(-350). What is s(n)? 6 Let v(b) be the second derivative of b6/180 + b5/120 + 2b4/3 - b. Let u(m) be the third derivative of v(m). Give u(1). 5 Let i(w) be the first derivative of w3/6 - w2/2 + w + 1. Let b(m) be the first derivative of i(m). Suppose 140 = 3c + 152, -c = -u. Give b(u). -5 Let z(s) be the first derivative of 2s3/3 + 3s*2/2 - s - 344. Calculate z(3). 26 Suppose 116 = -3u - 37. Let k = u + 58. Let r(d) = d*3 - 6d*2 - 9d + 1. Calculate r(k). -13 Let k(b) = -b3 + b2. Let z(h) = 4h2 - h - 1. Let p(s) = -5k(s) + z(s). Calculate p(-1). -6 Let r(i) = -4i + 30. Let f be r(7). Let p(d) = 2 - fd - 4 - 2 + 2. Let a(s) = -s*2 - 7s + 4. Let k be a(-8). Calculate p(k). 6 Suppose 0j + 28 = 4j + 2m, -8 = -4m. Let n be 0/j + (1 - -1). Let p(i) = -i2 - i + 2. Give p(n). -4 Let c(r) = -r3 + 7r2 - 2r - 12. Suppose -42 = -254j + 247j. Give c(j). 12 Let q(i) = -7i3 + i2 + 3i - 8. Let h(b) = 16b3 - 2b*2 - 7b + 15. Let y(v) = 4h(v) + 9q(v). What is y(0)? -12 Let h(m) = -m + 4. Suppose -g - 3g = 4z - 4, 2g - 3z = 2. Let q = g - -2. Suppose -5c - 10 + 34 = 4x, -3 = -qx. What is h(c)? 0 Let r(n) = 5n*3 - 14n*2 - 7n - 9. Let f(u) = 3u3 - 9u*2 - 4u - 6. Let p(y) = 8f(y) - 5r(y). Determine p(2). -13 Let a(s) = -s3 + s2 + 3s + 3. Suppose 2u = 2o - 4 - 36, -4u + o = 80. Let p = 23 + u. Calculate a(p). -6 Let a(r) = r*2. Let n(p) = -2p*2 - 2p - 2. Let b(x) = -6a(x) - n(x). Calculate b(-2). -18 Let w(d) = -25d - 1. Suppose -2x = -7x + 2v + 3, 3v = 4x - 1. What is w(x)? -26 Let i(l) = -14l*2 - 6l + 2. Let p(q) = -15q2 - 5q + 1. Let a(j) = 3i(j) - 4p(j). Determine a(-1). 18 Suppose -28 + 7 = 3y. Suppose -2d + n = 1 - 3, -2d + 12 = 4n. Let m(z) = -dz + 4z - 36 + 45. Give m(y). -5 Suppose -4c - 15 = 5. Let h(n) = -n2 - 6n - 3. Determine h(c). 2 Let u(j) = 8j2 + 7j - 7. Let w(m) = 7m2 + 6m - 6. Let s be (-3 - (-4 - -2)) + -1. Let r = s + 7. Let p(o) = ru(o) - 6w(o). Give p(1). -2 Suppose 3l + 4t = 16, -2t + 0 = -2l + 6. Suppose 6j = 3d, -d - 8 = 3j - 18. Let w(p) = 3p - lp + 5p - jp. Give w(2). 4 Let x(n) = -n3 + 5n*2 - n + 7. Let r be x(5). Let j(w) = 9w*3 + 4w. Let h(u) = 40u3 + u2 + 17u + 1. Let	{ "pile_set_name": "DM Mathematics" }
8? False Is 11 a factor of 56? False Does 16 divide 5824? True Does 15 divide 628? False Is 18 a factor of 2826? True Does 82 divide 1850? False Does 15 divide 112? False Is 2924 a multiple of 17? True Does 36 divide 65? False Is 720 a multiple of 90? True Does 74 divide 3182? True Is 5 a factor of 960? True Is 1889 even? False Does 64 divide 4608? True Is 64656 a multiple of 16? True Is 90433 a multiple of 209? False Does 17 divide 3942? False Does 9 divide 1918? False Is 2534 a multiple of 181? True Does 19 divide 3021? True Is 152 even? True Does 31 divide 319? False Is 5395 a multiple of 143? False Is 10 a factor of 1038? False Is 4118 a multiple of 84? False Is 2280 a multiple of 17? False Does 8 divide 1971? False Is 1496 a multiple of 34? True Is 3 a factor of 873? True Does 73 divide 2497? False Is 11 a factor of 1111? True Is 568 a multiple of 34? False Does 3 divide 105? True Is 10 a factor of 140? True Does 19 divide 18139? False Does 19 divide 42218? True Is 1144 a multiple of 32? False Is 69 a factor of 966? True Does 12 divide 2501? False Is 28775 a multiple of 5? True Does 9 divide 2833? False Is 47803 a multiple of 61? False Is 5348 a multiple of 34? False Is 7 a factor of 2172? False Does 187 divide 18797? False Is 1218 a multiple of 7? True Does 45 divide 19530? True Is 209 a factor of 48488? True Is 6 a factor of 252? True Is 2975 a multiple of 5? True Is 26 a factor of 1196? True Does 37 divide 35568? False Is 33 a factor of 327? False Is 2492 a multiple of 14? True Does 26 divide 20868? False Is 140 a factor of 91756? False Does 45 divide 7605? True Is 12495 a multiple of 21? True Is 3306 a multiple of 87? True Is 1166 a multiple of 22? True Is 3361 a multiple of 32? False Is 1171 a multiple of 24? False Is 34 a factor of 2111? False Is 456 a multiple of 32? False Does 142 divide 2737? False Is 1389 a multiple of 22? False Is 12 a factor of 78? False Does 48 divide 159? False Does 333 divide 3330? True Does 20 divide 7459? False Is 26 a factor of 2366? True Is 5874 a multiple of 11? True Does 107 divide 2461? True Is 234 a multiple of 18? True Does 2 divide 1837? False Is 69 a factor of 8209? False Is 205 a multiple of 6? False Does 4 divide 1507? False Is 290 a factor of 19456? False Is 55 a factor of 2667? False Does 35 divide 4305? True Is 10 a factor of 230? True Is 35 a factor of 27561? False Is 10 a factor of 3358? False Is 29706 a multiple of 95? False Is 17 a factor of 102? True Does 35 divide 32678? False Does 11 divide 406? False Does 7 divide 7721? True Is 592 a multiple of 22? False Does 17 divide 23875? False Is 106 a factor of 2412? False Is 25 a factor of 34819? False Is 28 a factor of 10052? True Is 73 a factor of 20237? False Is 379 even? False Does 50 divide 4350? True Is 29 a factor of 672? False Does 12 divide 1848? True Is 1444 a multiple of 11? False Is 5508 a multiple of 43? False Is 17 a factor of 5104? False Is 121 a factor of 1804? False Is 54 a factor of 1539? False Is 55 a factor of 65890? True Is 3078 a multiple of 19? True Is 10 a factor of 1190? True Is 10 a factor of 2331? False Is 178 a factor of 7298? True Is 7793 a multiple of 72? False Does 9 divide 236? False Is 61 a factor of 3416? True Does 158 divide 1960? False Is 78 a factor of 2529? False Is 56 a factor of 224? True Is 4880 a multiple of 40? True Does 9 divide 155? False Is 5 a factor of 415? True Is 570 even? True Is 2 a factor of 10872? True Does 4 divide 94? False Is 44 a factor of 4075? False Does 5 divide 43915? True Is 2652 a multiple of 156? True Is 74 a factor of 6440? False Is 4682 a multiple of 67? False Is 4060 a multiple of 10? True Is 2 a factor of 453? False Does 16 divide 256? True Is 42372 a multiple of 11? True Is 204 a factor of 14027? False Is 805 a multiple of 18? False Does 14 divide 549? False Is 5504 a multiple of 43? True Does 11 divide 31914? False Is 18047 a multiple of 7? False Does 60 divide 3616? False Is 4 a factor of 207? False Is 345 a multiple of 15? True Is 86 a factor of 6278? True Is 1155 a multiple of 15? True Is 24 a factor of 33072? True Is 9555 a multiple of 91? True Is 26 a factor of 267? False Is 98 a factor of 3989? False Does 79 divide 36953? False Does 16 divide 45200? True Does 15 divide 1800? True Is 4 a factor of 17132? True Does 3 divide 4464? True Is 15 a factor of 895? False Does 25 divide 83202? False Is 31 a factor of 775? True Does 169 divide 24456? False Is 15 a factor of 1135? False Is 134 a multiple of 3? False Is 2796 a multiple of 55? False Is 77 a factor of 548? False Is 15362 a multiple of 221? False Is 2640 a multiple of 66? True Does 6 divide 252? True Is 34 a factor of 72881? False Is 228 a factor of 44004? True Is 9 a factor of 2202? False Is 532 a multiple of 40? False Is 4 a factor of 509? False Is 2790 even? True Is 7 a factor of 376? False Is 38 a factor of 6042? True Is 54 a factor of 8100? True Is 27 a factor of 721? False Does 84 divide 40528? False Is 64512 a multiple of 18? True Is 13 a factor of 34425? False Is 18 a factor of 35770? False Does 22 divide 44902? True Does 87 divide 5769? False Is 439 a multiple of 19? False Is 18800 a multiple of 80? True Is 204 a multiple of 12? True Does 17 divide 7089? True Is 1095 a multiple of 3? True Does 6 divide 1446? True Is 101 a factor of 8989? True Does 9 divide 9045? True Is 22 a multiple of 22? True Does 10 divide 7213? False Does 10 divide 1141? False Does 18 divide 9840? False Is 3060 a multiple of 102? True Does 13 divide 4732? True Does 84 divide 5241? False Does 24 divide 17328? True Is 1250 a multiple of 10? True Is 8 a factor of 1867? False Is 500 a multiple of 17? False Is 14892 a multiple of 17? True Is 24219 a multiple of 5? False Does 15 divide 828? False Does 9 divide 234? True Is 86 a factor of 12536? False Is 45 a factor of 1080? True Does 15 divide 1184? False Does 15 divide 805? False Is 21 a factor of 568? False Is 10 a factor of 1444? False Is 1154 a multiple of 9? False Does 120 divide 45207? False Is 3509 a multiple of 121? True Is 13 a factor of 3294? False Is 2970 a multiple of 90? True Does 18 divide 414? True Is 174 a multiple of 3? True Is 2449 a multiple of 106? False Is 28 a factor of 980? True Is 1741 a multiple of 2? False Is 16 a factor of 1130? False Is 22375 a multiple of 179? True Is 346 a factor of 50252? False Is 570 a multiple of 45? False Is 2519 a multiple of 207? False Is 11692 a multiple of 179? False Is 3597 a multiple of 33? True Is 27 a factor of 1215? True Is 38 a factor of 1012? False Does 115 divide 30590? True Does 8 divide 4067? False Is 26 a factor of 650? True Does 26 divide 551? False Is 9 a factor of 4431? False Is 10 a factor of 825? False Is 4 a factor of 349? False Is 8173 a multiple of 121? False Does 93 divide 372? True Does 20 divide 5179? False Is 2808 a multiple of 26? True Is 525 a multiple of 15? True Is 11 a factor of 3069? True Does 18 divide 15966? True Is 57 a factor of 962? False Is 2305 a multiple of 177? False Is 1388 a multiple of 46? False Is 2 a factor of 13? False Is 136 even? True Is 18 a factor of 49371? False Does 9 divide 2206? False Does 4 divide 6756? True Is 63 a factor of 7749? True Is 10 a factor of 8360? True Is 2 a factor of 5354? True Does 22 divide 6817? False Is 69371 a multiple of 11? False Is 17 a factor of 3880? False Is 18 a factor of 360? True Is 68 a factor of 1983? False Is 4699 a multiple of 11? False Is 4637 a multiple of 78? False Is 17 a factor of 722? False Is 126 a multiple of 4? False Does 15 divide 649? False Does 9 divide 36? True Does 22 divide 4686? True Does 2 divide 4188? True Is 9938 a multiple of 53? False Does 11 divide 949? False Does 17 divide 510? True Is 14 a factor of 8317? False Does 103 divide 1648? True Does 57 divide 2223? True Is 2415 a multiple of 40? False Does 89 divide 2492? True Is 48 a factor of 2395? False Does 3 divide 3081? True Is 11 a factor of 110? True Is 725 a multiple of 66? False Does 102 divide 23386? False Is 241 a factor of 29884? True Is 7 a factor of 1847? False Is 184 a multiple of 10? False Does 16 divide 25360? True Does 23 divide 2284? False Does 14 divide 7630? True Does 8 divide 608? True Is 45 a factor of 4095? True Is 16 a factor of 206? False Does 6 divide 318	{ "pile_set_name": "DM Mathematics" }
or k. 35 Solve 165 = 23h + 10h for h. 5 Solve -m + 4 = -34 + 20 for m. 18 Solve -22 = 8g + 1 - 87 for g. 8 Solve 0 = -284o + 49o + 144o - 1092 for o. -12 Solve 0 = -21g - 179 + 2 - 54 for g. -11 Solve 4v + 155 = 24v - 25 for v. 9 Solve -13i - 6i = 95 for i. -5 Solve -170y = -149y + 252 for y. -12 Solve -6717 = 36a - 6753 for a. 1 Solve -371 = -56m + 137 - 4 for m. 9 Solve 28y - 5y = -11y + 544 for y. 16 Solve 185 = -134i - 1691 for i. -14 Solve 75j + 1043 = -682 for j. -23 Solve 324 = -21v + 219 for v. -5 Solve 158p - 16740 = -400p for p. 30 Solve 27a + 439 = -21a + 583 for a. 3 Solve 360m = 354m + 122 - 20 for m. 17 Solve -310x + 362x - 260 = 0 for x. 5 Solve 18 = 15j - 6j - 3j for j. 3 Solve 0 = 56g + 405 + 211 for g. -11 Solve 1943 - 2093 = 30r for r. -5 Solve -180l + 1260 = -270l for l. -14 Solve 43p = 85p - 1602 + 678 for p. 22 Solve 22r = -1646 + 1602 for r. -2 Solve -104j + 20 = -106j for j. -10 Solve 54z - 168 = 97 + 1625 for z. 35 Solve 15b - 9b = 142 - 118 for b. 4 Solve 24t = 1792 - 1768 for t. 1 Solve 10p + 44 = 67 - 173 for p. -15 Solve -49p = -91p + 5p + 925 for p. 25 Solve 569p = 1082p - 13338 for p. 26 Solve -138t = -119t + 76 for t. -4 Solve -11769 = n - 11744 for n. -25 Solve 14n - 11n + 25n - 140 = 0 for n. 5 Solve 0 = 60h - 147h - 281 + 107 for h. -2 Solve 0 = -99u - 14u + 10u - 721 for u. -7 Solve -2260o - 25 = -2265o for o. 5 Solve 87891t - 87832t - 1239 = 0 for t. 21 Solve -2219a - 22 = -2218a for a. -22 Solve -31d - 24 + 120 = -59 for d. 5 Solve -112s - 83s = -22s + 5363 for s. -31 Solve -1148l + 392 = -1205l - 406 for l. -14 Solve -28o + 4990 - 4934 = 0 for o. 2 Solve 24 = 16l + 26 - 34 for l. 2 Solve -4w - 5517 + 5557 = 0 for w. 10 Solve 31z + 24 = 11z + 16z for z. -6 Solve -2527 = -29o - 2092 for o. 15 Solve 992l - 2018l + 748 = -1004l for l. 34 Solve 9 + 114 = -6u + 47u for u. 3 Solve 68t - 4380 = 18t + 342t for t. -15 Solve -12585 = 22p - 12563 for p. -1 Solve 0 = -149r + 121r - 28 for r. -1 Solve -180y + 720 = -150y for y. 24 Solve 5 + 27 = -2008s + 1992s for s. -2 Solve -38n - 518 - 128 = 0 for n. -17 Solve -80a - 270 = 49a - 141 for a. -1 Solve 20b = 43b + 28b - 612 for b. 12 Solve 0 = 15i - 0i + 8i - 207 for i. 9 Solve -1471v + 1522v + 918 = 0 for v. -18 Solve 411z = -577z + 30628 for z. 31 Solve 19m - 59m - 320 = 0 for m. -8 Solve -202i - 199i + 405i = -16 for i. -4 Solve -34j = -56j - 308 for j. -14 Solve 94i = 17437 - 15181 for i. 24 Solve -18q - 74q + 828 = 0 for q. 9 Solve 22t + 28 + 109 + 17 = 0 for t. -7 Solve 4598 - 4570 = -0h - 14h for h. -2 Solve -119 = 15m + 62 - 31 for m. -10 Solve -5754 - 10444 = 1246k for k. -13 Solve 0 = -195u + 211u + 224 for u. -14 Solve 160y + 577 + 580 = -2523 for y. -23 Solve -51a + 801 = -1 - 524 for a. 26 Solve -466 = -168v - 1810 for v. -8 Solve 1845w - 1927w + 1394 = 0 for w. 17 Solve 36971w - 11 = 36960w for w. 1 Solve 243 = 689b - 659b - 57 for b. 10 Solve -65v - 110 = -12v + 2v for v. -2 Solve -22r - 71 - 17 = -0r for r. -4 Solve 25t - 441 = -616 for t. -7 Solve 500 + 167 = -13f + 36f for f. 29 Solve -562o + 589o + 130 = -464 for o. -22 Solve 14h + 55906 = 55822 for h. -6 Solve -6 = -8p - 4 - 18 for p. -2 Solve 5h - 10h = 20 for h. -4 Solve -432 = 19383g - 19401g for g. 24 Solve 142f - 15 = 145f for f. -5 Solve -77x + 3309 = -254x - 762 for x. -23 Solve 1879a + 22569 = -11253 for a. -18 Solve -28c + 25c + 5 = 2 for c. 1 Solve 16005q = 15975q - 210 for q. -7 Solve 473 = -295w - 1527 - 655 for w. -9 Solve 416x + 165x = 33x - 10960 for x. -20 Solve 0 = -141c + 144c - 39 - 9 for c. 16 Solve 15c - 58 = 47c - 378 for c. 10 Solve -8l + 1218 = 1298 for l. -10 Solve 41g + 685 = 767 for g. 2 Solve -416d - 888 = -305d for d. -8 Solve -42 + 105 = -9i for i. -7 Solve -234v + 288 = -139v - 131v for v. -8 Solve -24f + 615 = 1143 for f. -22 Solve 109q + 601 = -53 for q. -6 Solve -743 + 379 = -26k for k. 14 Solve 867 = 162m + 1191 for m. -2 Solve 391d = 611 + 1845 + 1063 for d. 9 Solve -13u + 113 + 70 - 66 = 0 for u. 9 Solve 0 = -2924i + 2923i + 8 for i. 8 Solve -55r - 52r + 744 = -14r for r. 8 Solve -v = 11v - 42v + 810 for v. 27 Solve 199 = 72s + 1207 for s. -14 Solve 93l - 4100 = -1124 for l. 32 Solve -948l + 332 = 3176 for l. -3 Solve 10q + 40 = -3q + 1 for q. -3 Solve -53 - 205 = 24u + 19u for u. -6 Solve 935 = -22u + 957 for u. 1 Solve 62i + 8512 = -71i + 4522 for i. -30 Solve -2668 = 96i - 1126 + 1338 for i. -30 Solve 309d + 3504 = -4437 + 1761 for d. -20 Solve 132w - 73w - 63 = 80w for w. -3 Solve 3o - 958 = -5o - 934 for o. 3 Solve 92v + 423 = 61v + 172v for v. 3 Solve -57v - 851 + 623 = 0 for v. -4 Solve 161x + 120 = 41x for x. -1 Solve 632u + 5120 = 88u - 1408 for u. -12 Solve 518 = -113j - 951 for j. -13 Solve 0 = 17u + 40u + 20u + 847 for u. -11 Solve 85f + 936 = 256 for f. -8 Solve -4451 = -8d - 4291 for d. 20 Solve -96b + 1458 = 103b - 2920 for b. 22 Solve 29h + 151 = 45 - 300 for h. -14 Solve -110p - 102p + 2332 = 0 for p. 11 Solve 316f + 110f = 426 for f. 1 Solve 1262g - 19 - 9 = 1264g for g. -14 Solve -2415 + 2399 = z for z. -16 Solve 1083 = -97m + 1568 for m. 5 Solve -26o + 3005 = 3135 for o. -5 Solve -4x + 27x - 136 - 71 = 0 for x. 9 Solve 0 = 104c - 144c + 160 for c. 4 Solve 9y - 14y = -12 - 18 for y. 6 Solve 4 = 12k + 54 - 14 for k. -3 Solve 239b = -285 + 5065 for b. 20 Solve 1769 + 990 - 479 = -95b for b. -24 Solve 27h + 121 = 38h for h. 11 Solve 0 = -35p + 40p + 60p - 195 for p. 3 Solve 0 = -38g - 1012616 + 1012768 for g. 4 Solve 8g - 350 = -398 for g. -6 Solve 39i = -4876 + 3901 for i. -25 Solve 27b = -109 - 215 for b. -12 Solve -17q + 528 + 544 = 1242 for q. -10 Solve 62f + 8f = -15f - 595 for f. -7 Solve 13i + 2i = 225 for i. 15 Solve -259f - 644 - 986 = 960 for f. -10 Solve 244 = 123x - 863 for x. 9 Solve 0 = -102o - 49o - 37o + 1880 for o. 10 Solve 552t - 1105t - 126 = -544t for t. -14 Solve 0 = -139v - 1195 - 1724 for v. -21 Solve 392i = -273 - 127 + 8 for i. -1 Solve -15a = 8263 - 7978 for a. -19 Solve 15a - 43 + 96 + 7 = 0 for a. -4 Solve 357k = 10371 - 4302 for k. 17 Solve 1487i - 24115 = 9304 + 20113 for i. 36 Solve 54s - 70 = 64s for s. -7 Solve 3u - 174u - 5082 = 71u for u. -21 Solve 0 = -86g + 29g + 114 for g. 2 Solve 65w + 1209 = -49w + 183 for w. -9 Solve -20l + 17l - 315 = -18l for l. 21 Solve 1250c - 184 = 1204c for c. 4 Solve 3672h - 3665h = -126 for h. -18 Solve 83p - 3409 = -4488 for p. -13 Solve -1044 = 43s + 21s + 52s for s. -9 Solve 0 = 11z - 22347 + 22303 for z. 4 Solve -176w - 6404 = 219w + 706 for w. -18 Solve -2342 + 500 = -236s + 1934 for s. 16 Solve 105q + 359q - 122q = 0 for q. 0 Solve 0 = -733r - 498r - 6155 for r. -5 Solve 69w - 3696 = -w - 84w for w. 24 Solve 104x + 436 = -708 for x. -11 Solve -2088v + 1871v = 6076 for v. -28 Solve -3t = 2257 - 2239 for t. -6 Solve 0 = -185v - 11196 + 4351 for v. -37 Solve 6p - 17p = -8p + 36 for p. -12 Solve 812 - 361 = -27a + 829 for a. 14 Solve 36c - 11c - 34134 + 34034 = 0 for c. 4 Solve 76k - 52038 = -51430 for k. 8 Solve 0 = 299q - 123q - 1760 for q. 10 Solve -57 - 158 = 43r for r. -5 Solve -403m = 1123m - 24416 for m. 16 Solve 43h - 3003 + 3863 = 0 for h. -20 Solve -10232 = 264y - 1247 - 537 for y. -32 Solve 185g + 149g - 117g + 3472 = 0 for g. -16 Solve -177u - 75u - 6409 = 125u for u. -17 Solve -53y = -89 - 176 for y. 5 Solve -205t = 74t + 4185 for t. -15 Solve -378 = 2936u - 2909u for u. -14 Solve -600 = 30q - 105q for q. 8 Solve -18k + 97 - 35 = -100 for k. 9 Solve 357c = 398c - 738 for c. 18 Solve -20s + 1154 = 103s + 47 for s. 9 Solve 28 = 75v + 328 for v. -4 Solve -16u = -u + 95u + 770 for u. -7 Solve 43a - 3a = -879 + 1839 for a. 24 Solve 39c = 34848 - 34692 for c. 4 Solve -1330 = -276b + 6122 for b. 27 Solve 14n - 30 - 320 = -140 for n. 15 Solve -2632b + 2436b = 0 for b. 0 Solve -55r + 621 = 54r - 40r for r. 9 Solve 48q = -45q + 163 + 209 for q. 4 Solve 0 = 306r - 315r - 117 for r. -13 Solve -10x - 991 = 57*x + 148 for x. -17 S	{ "pile_set_name": "DM Mathematics" }
, g, p? g Let h(q) be the third derivative of -q*4/8 + 14q*3/3 - 6q*2. Let n be h(9). Suppose -n + 2 = -g. What is the closest to -1 in -2, -3, g? g Suppose 3h - 4d - 28 = 0, -5h - 2d + 24 = 12. Let p = 1955/9 - 217. Which is the closest to -3/7? (a) p (b) h (c) -0.2 c Let z = -15380 - -15387. Which is the closest to 1? (a) 0 (b) 0.3 (c) 3 (d) z b Let z = 22.3 - 23.596. Let l = 0.004 - z. Which is the nearest to l? (a) 0.2 (b) 1 (c) 3 b Let d = 98 - 545. Let y = d + 450. Which is the closest to y? (a) -3 (b) 5 (c) -2 b Let d = -3/667 - -12682/2001. Suppose f + 3v = 20, -10f + 30 = -8f + 4v. What is the closest to -1 in f, d, 2/7? 2/7 Let j = -0.18258 - 0.81742. Which is the nearest to j? (a) -13.9 (b) 3 (c) 2/39 c Let h = -0.204 - 0.796. What is the nearest to 42 in h, 5, 2/11? 5 Let u be (-5888)/(-43710) - 28/210. Let m = 4325/33511 + u. What is the nearest to 1/4 in 4, 2, m? m Suppose 299y = 295y + 40. Suppose y = -4b - 2. What is the nearest to 0 in 0.2, 0.3, b, 4? 0.2 Let p = 47.79 - 48. Let y = p - -0.11. Let s = -1927.3 + 1927. What is the nearest to y in 5, s, 0? 0 Let n be 1(0 + -3) - (-4 + -2). Let k be 2/(((112)/n)/6). Let b = -14 - -10. What is the closest to -2/3 in b, 0.3, k? 0.3 Let w = 377 - 607. Let r = w - -230. Let f = -5 - -6. What is the nearest to 1/3 in 1/2, r, f? 1/2 Let f be (4/6)/(2 - 4). Let m be (1 - 10/4)60/(-744). Let g = m + 4/31. Which is the closest to -1? (a) 0.1 (b) f (c) g b Let w = -317 + 317.1. Let v be 0 - (4(-4)/8)/(-9). What is the nearest to -3 in -0.03, -1/3, v, w? -1/3 Let m = -7.53 + 7.288. Let w = 0.142 + m. Let d be (18/(-22))/1 - -1. What is the nearest to w in d, 0.1, -0.07? -0.07 Suppose -57 = -21i - 78. What is the nearest to -1 in i, 0, 3? i Let n = 0.015 - 0.015. Let k = -82 + 72. Which is the nearest to n? (a) -3 (b) k (c) -1/8 c Let w = -0.098282 - 0.201718. Suppose -2x + 4y + 8 = 0, 5 = 4x - 5y - 8. Which is the nearest to x? (a) w (b) -4 (c) 0 (d) 0.3 d Let q = -49.4113 + 0.1113. Let n = q + 46.3. Which is the closest to 40? (a) 0.3 (b) 1 (c) n b Let d(i) = -i - 15. Let j be d(-14). Let z = 3 + -8. Let m = 124.7 + -124.7. Which is the closest to m? (a) z (b) j (c) -4 b Let j = 996 + -996.2. Which is the nearest to 0.05? (a) 5 (b) j (c) -11/6 (d) -2/3 b Suppose -3r - r + 20 = 0. Let p = -0.9093 - -0.9393. What is the closest to 3/4 in p, r, 4? p Let j = -2.68 - -2.6. Let z = j + 0.38. Let t be (-2)/(-6)(-6)/(-8). Which is the nearest to -0.3? (a) -4/3 (b) z (c) t c Let d = -1 + 1.2. Suppose r + 4 = 4z, 3r - 7r - 37 = 5z. Let s be r/214/(-24). Which is the closest to -2/7? (a) s (b) 4 (c) d c Let x(u) = -u3 - 7u*2 - 5u + 9. Let d be x(-6). Let y = -34 - -36. Which is the closest to 0.1? (a) y (b) d (c) 2/13 c Let n = 141 + -208. Let g = 203.2 + -136. Let b = g + n. What is the closest to 3/2 in b, -0.4, 3? b Let y = 2862.9 + -2863. Which is the nearest to -26? (a) -27 (b) 4 (c) y (d) 0.4 a Let o be ((9/84)/((-30)/160))/((-4)/(-2)). Which is the closest to -3/32? (a) 5 (b) 1/2 (c) 0 (d) o c Suppose -3w = -4w + 1. Let y = -930011 - -1860019/2. Let q = -2 + 5. What is the closest to y in 2/7, q, w? 2/7 Let s(l) = l*3 - 8l*2 + 6l + 5. Let h be s(7). Let q be ((-210)/(-9))/(-10) + 3. Which is the nearest to q? (a) h (b) -5 (c) 0 (d) -6 c Let l be (-248)/93 - 9/(-12)4. Which is the closest to l? (a) -17 (b) 0.6 (c) 0.5 c Let x be -4 + 127 + 28/(-14). What is the closest to 1 in x, 2, -3? 2 Let h be ((-16)/(-10))/((-212)/52470). Let z = 4357/11 + h. Let k be 1(-14)/6 + 2. What is the nearest to k in 3, z, -5? z Let v = -857 + 840. Let g = v + 16.9. Which is the nearest to g? (a) 5 (b) -8/7 (c) -3/7 c Suppose 0 = 4l - 2x - 22, 0 = -2l - 15x + 14x + 1. Which is the closest to l? (a) -1/3 (b) -40 (c) -1/4 c Let u = 10348.9 - 10349. Let t = -23 + 36. Which is the nearest to 0.1? (a) u (b) t (c) 1 (d) 5 a Let u = 17.8 - -76.2. Let t = 93.6 - u. Let h = -2.96 - 0.04. Which is the closest to 1? (a) h (b) -2 (c) t c Suppose -w - 3v - 4 = 0, -9 = -2w + 4v + 13. Suppose -2b - b = -wq - 2, -b = -2q. Let n be (3 + (-18)/7)/(6/b). What is the closest to 5 in -0.4, n, 1/2? 1/2 Let m = 97277/15 + -6485. Which is the closest to -1? (a) m (b) -2/3 (c) -19 b Let k = 0.6644 - 0.2644. Which is the nearest to 1/4? (a) 1 (b) 0.02 (c) k c Let x be 18/(-30)((-40)/(-15))/8. What is the nearest to -5 in -11, 3, -5, x? -5 Let g = -0.152 + -27.848. Let n = 41 + g. What is the closest to 1 in n, 0.2, 5? 0.2 Let t = 3 - 4. Let z be (129766/80)/13 - 4/10. Let p = -124 + z. What is the closest to t in 5, p, -3? p Let q be (-9)/(-6) + 0 - (-11)/(-2). Let n be 4/((-32)/28) + 2/q. Let m = 13 - 9. What is the closest to 2 in m, n, 3/2? 3/2 Let m = 2 + -3. Let s = -0.02 + -43.98. Let j = -43.6 - s. Which is the nearest to 1/4? (a) -2 (b) m (c) j c Let b = -11570 - -11552. What is the closest to 2/3 in -0.09, 1, -1/11, b? 1 Let s = -14 - -14.3. Let t = 2790 - 2802. What is the closest to 1/2 in s, 1/6, t? s Let r = 2736.9 + -2737. Which is the nearest to r? (a) -0.2 (b) -4 (c) -56 a Let t = -575 - -575.4. Let s = 0.052 + -5.052. What is the nearest to 0 in t, s, 2.5? t Let s = 40 - 32. Let p = s + -12. Let r = p - -5. What is the nearest to -3 in -0.5, -0.1, r? -0.5 Let t = -7204 + 7208. Which is the nearest to -30/19? (a) t (b) -0.2 (c) 0 b Let i = -283.54 - -283.64. What is the closest to i in 4, -3, 181, 1? 1 Suppose -20 = -j + 5w, 2w + 8 + 0 = -2j. Suppose -17h + 15h - 60 = j. Let i be (5 - (-168)/h) + 1 + 0. What is the nearest to i in -2/17, 8, 0? 0 Let h = 0.25 + 0.15. Let y = 30 + -30.3. Let i = -74 + 73.5. What is the closest to 2/23 in i, h, y? h Let h = 89 + -89. Let z(m) = -m3 + 2m + 3. Let r be z(-2). Suppose -3i = 5w, -w = -0i + 2i - r. Which is the nearest to h? (a) 0.2 (b) 3 (c) i a Let h = -2.01 - -178.01. Let i = 178 - h. Which is the nearest to 0? (a) 10 (b) 0.5 (c) i b Let y = 21334 + -21331. Which is the nearest to 0? (a) y (b) -6 (c) 2 c Let s = -475 - -476. Let u = -2/225 - -914/1575. Which is the closest to s? (a) -3/2 (b) u (c) 5/2 (d) 0.3 b Let p = 2 - 2. Let j(u) = -4u + 40. Let m be j(12). Let c be ((-14)/m - 2)/((-6)/16). What is the nearest to -2 in 3, p, c? p Suppose 0 = 2h + z + 253, -h - 507 = 3h + z. Which is the nearest to -2/3? (a) 5 (b) 0 (c) h (d) -1 d Let n be 1 + (-65)/55 + 27108/(-220). Suppose 3q = 212 + 157. Let i = n + q. Which is the closest to 1/4? (a) -2 (b) 4 (c) i c Suppose -3p - 803 = -2l, 2l + 2l - 4p - 1596 = 0. Let i = -1967/5 + l. Which is the closest to -1? (a) -1 (b) 3 (c) i (d) 0.7 a Let d(r) = r2 + r - 3. Let a be d(0). Let l = 35 + -28. Let k be 2/l + 16/(-56). What is the closest to k in 4, -1, a? -1 Let p = -348 + 1045/3. Let i = 115 - 120. What is the closest to -1 in 2/5, i, p, 0.2? 0.2 Let r(k) = 20k*2 - 3k - 1. Let s be r(1). Let v be (68/340)/(s/(-10)). What is the nearest to 13 in 0.3, 5/4, v? 5/4 Suppose h + 2 = -t, 0 = 4t - h - 5 + 13. Let b = -851521 - -851521. What is the nearest to b in 0, 0.03, t? 0 Let t = 1.857 + -4.094. Let j = -0.237 - t. What is the closest to 0.1 in -4, 4, j? j Let r = -33004 - -33002. Which is the closest to -2/7? (a) 1 (b) -1 (c) r (d) -6 b Let v be (-30)/2 + -340 + 360. Which is the nearest to 2? (a) 4 (b) 0.08 (c) -0.27 (d) v b Let y be 2/(-17) - (-20)/(-119). Let u = 0.016 - 0.116. Let k = -1.5 + 1.4. What is the nearest to k in u, 2, y? u Let m = 28.93442 - -0.06558. What is the closest to -0.2 in 2/7, m, -2/3, 3? -2/3 Let n = 0.138 - 0.538. Let c = 1327 + -1322. What is the nearest to 0.03 in c, n, -4? n Let f = 782 - 782.4. What is the closest to -0.2 in f, 1/10, -1, -2? f Let p(l) = l2 - 1. Let m be p(-1). Suppose 14k - 10k + n + 5 = 0, 5k + 2 = 3n. Which is the closest to -9? (a) k (b) 1/2 (c) m a Let r = -0.182 - 4.618. Let k = 4.8 + r. Suppose 0 = -0w + 5w. What is the closest to k in 5, -3, w? w Let g = -39.85 + 38.85. Which is the nearest to 0.1? (a) -3 (b) 7/4 (c) g c Let m = -155.11 - -155. Let f = m - 1.89. What is the nearest to -10 in 3, f, 0.2? f Let g be 36/16 + -3 - (-13)/1404105. Let r = -11 + 6.	{ "pile_set_name": "DM Mathematics" }
a. 1/153 What is prob of sequence to when two letters picked without replacement from ntxvowvt? 1/28 Calculate prob of sequence fv when two letters picked without replacement from wfpvpdq. 1/42 Four letters picked without replacement from {l: 3, s: 5}. What is prob of sequence llsl? 1/56 Four letters picked without replacement from {y: 7, n: 4}. What is prob of sequence ynyn? 7/110 Calculate prob of sequence yyww when four letters picked without replacement from {y: 5, w: 13}. 13/306 Four letters picked without replacement from {t: 3, g: 4, i: 9, u: 4}. What is prob of sequence uigi? 16/1615 Calculate prob of sequence jddd when four letters picked without replacement from {d: 4, j: 6}. 1/35 Four letters picked without replacement from pvpvvv. Give prob of sequence ppvv. 1/15 Two letters picked without replacement from opoxpoxoxuiixxuozz. What is prob of sequence po? 5/153 Calculate prob of sequence fk when two letters picked without replacement from ffffffffffkff. 1/13 What is prob of sequence ttt when three letters picked without replacement from {p: 1, t: 3}? 1/4 Two letters picked without replacement from {r: 11, l: 3, a: 1}. What is prob of sequence al? 1/70 What is prob of sequence nnnn when four letters picked without replacement from eeeneeennnneee? 5/1001 Two letters picked without replacement from ryryrorroororrv. Give prob of sequence yr. 8/105 Three letters picked without replacement from {p: 1, m: 4, h: 2}. What is prob of sequence mhh? 4/105 Four letters picked without replacement from iytxinx. Give prob of sequence iiti. 0 Calculate prob of sequence bbbb when four letters picked without replacement from bvbbbvvvbvbbbb. 18/143 What is prob of sequence bbbr when four letters picked without replacement from vaacbbcbrarrbvvaacr? 1/969 Two letters picked without replacement from {v: 1, h: 1, q: 9, u: 3}. Give prob of sequence hu. 3/182 What is prob of sequence jjjj when four letters picked without replacement from {j: 4}? 1 Two letters picked without replacement from {n: 2, x: 1, t: 2, h: 9}. What is prob of sequence nt? 2/91 Three letters picked without replacement from iyiylyiiliyii. What is prob of sequence lyy? 2/143 Four letters picked without replacement from xxwxwxxixxxwwzx. Give prob of sequence xwzi. 1/910 Calculate prob of sequence jr when two letters picked without replacement from rqqqajjarjjjajjjq. 1/17 Calculate prob of sequence xs when two letters picked without replacement from yukxyszz. 1/56 Three letters picked without replacement from {d: 5, m: 7}. Give prob of sequence dmm. 7/44 Calculate prob of sequence gjic when four letters picked without replacement from {i: 5, g: 1, c: 6, j: 1, t: 2}. 1/1092 Two letters picked without replacement from hyskkyipkskkkk. What is prob of sequence si? 1/91 What is prob of sequence ggg when three letters picked without replacement from {g: 9}? 1 What is prob of sequence lg when two letters picked without replacement from lgmellllglel? 7/66 What is prob of sequence gwg when three letters picked without replacement from rowgowgigwiorrgw? 1/70 Three letters picked without replacement from llpjljjjljljjp. Give prob of sequence llp. 5/273 Three letters picked without replacement from {g: 2, l: 18}. What is prob of sequence lgl? 17/190 Three letters picked without replacement from {q: 1, i: 1, s: 1}. What is prob of sequence qis? 1/6 Calculate prob of sequence ew when two letters picked without replacement from weewewewweww. 35/132 Calculate prob of sequence rrr when three letters picked without replacement from adrrddr. 1/35 Calculate prob of sequence tes when three letters picked without replacement from ejteesm. 1/70 Calculate prob of sequence ff when two letters picked without replacement from fddqfqqqdqf. 3/55 What is prob of sequence dnn when three letters picked without replacement from npdjnnjtjjjjj? 1/286 What is prob of sequence mel when three letters picked without replacement from {l: 1, p: 3, m: 5, t: 4, e: 5}? 25/4896 Calculate prob of sequence ee when two letters picked without replacement from eeu. 1/3 Two letters picked without replacement from srrsrrrssrrrs. Give prob of sequence rs. 10/39 Three letters picked without replacement from nnkfnxbfffkkbffk. Give prob of sequence nbf. 3/280 Two letters picked without replacement from yoyooooyoooooo. Give prob of sequence oy. 33/182 What is prob of sequence ll when two letters picked without replacement from {i: 9, l: 9}? 4/17 Two letters picked without replacement from pptpppnpppntpp. Give prob of sequence pt. 10/91 Calculate prob of sequence qqq when three letters picked without replacement from {q: 6}. 1 Calculate prob of sequence geao when four letters picked without replacement from aaiogneiggooioa. 1/910 Four letters picked without replacement from {j: 5, f: 3, p: 1, u: 1, g: 1}. What is prob of sequence ufgf? 1/1320 What is prob of sequence iesz when four letters picked without replacement from zazezeasaieaes? 1/1001 Four letters picked without replacement from {c: 3, p: 1, h: 4, b: 6}. Give prob of sequence bbbp. 5/1001 Three letters picked without replacement from {d: 3, o: 4, b: 4}. What is prob of sequence dbd? 4/165 Two letters picked without replacement from {z: 3, e: 1, d: 7, i: 6, k: 2}. What is prob of sequence zz? 1/57 Three letters picked without replacement from uuykgyyykuu. What is prob of sequence yyu? 8/165 Two letters picked without replacement from kwkvwwwkwwwvkwvv. What is prob of sequence vk? 1/15 Three letters picked without replacement from vvvvvkvvdvvvvd. What is prob of sequence kdv? 11/1092 Two letters picked without replacement from {f: 13, i: 3, b: 1}. What is prob of sequence fb? 13/272 Four letters picked without replacement from {r: 15, y: 3}. Give prob of sequence ryyr. 7/408 What is prob of sequence la when two letters picked without replacement from ammakal? 1/14 What is prob of sequence in when two letters picked without replacement from iufafnwuwwiuuwawu? 1/136 What is prob of sequence dd when two letters picked without replacement from uuuququdqduqqquq? 1/120 What is prob of sequence wcd when three letters picked without replacement from {x: 5, w: 2, c: 1, d: 1}? 1/252 Two letters picked without replacement from pppppqpnppppppp. Give prob of sequence qp. 13/210 Two letters picked without replacement from oswosssosp. What is prob of sequence pw? 1/90 Three letters picked without replacement from {h: 3, z: 1}. Give prob of sequence hzh. 1/4 Two letters picked without replacement from {p: 1, i: 1, f: 14, o: 1, v: 3}. What is prob of sequence ff? 91/190 Two letters picked without replacement from lllllllll. Give prob of sequence ll. 1 Three letters picked without replacement from {t: 10}. What is prob of sequence ttt? 1 Two letters picked without replacement from {y: 2, m: 5, r: 1, u: 2, b: 6}. Give prob of sequence bb. 1/8 Two letters picked without replacement from aaadddkaakakd. Give prob of sequence ad. 2/13 Four letters picked without replacement from xxrrxxxpxxrxxkxkr. Give prob of sequence xxxx. 3/34 Four letters picked without replacement from zyzzzzykzzzyzyzzyz. Give prob of sequence yyzz. 11/306 Calculate prob of sequence iik when three letters picked without replacement from iynmwmmkikmknny. 1/455 Three letters picked without replacement from {j: 2, f: 2, t: 5, y: 3}. What is prob of sequence yjj? 1/220 Two letters picked without replacement from lewwcrcwccw. Give prob of sequence wr. 2/55 Three letters picked without replacement from {q: 4, s: 3, h: 6, g: 1}. What is prob of sequence qhg? 1/91 What is prob of sequence bbb when three letters picked without replacement from {b: 6, e: 1, z: 7}? 5/91 What is prob of sequence ne when two letters picked without replacement from {n: 5, e: 2}? 5/21 Three letters picked without replacement from wmwmmmwiwmm. Give prob of sequence wiw. 2/165 Four letters picked without replacement from {s: 1, n: 3, m: 4, f: 2, g: 1}. What is prob of sequence sfsm? 0 Four letters picked without replacement from rfeffeffe. What is prob of sequence rffe? 5/252 Three letters picked without replacement from qbqbjbdqqjjdjb. What is prob of sequence dqj? 4/273 What is prob of sequence jzza when four letters picked without replacement from {a: 2, f: 6, q: 4,	{ "pile_set_name": "DM Mathematics" }
qrt(5)). 7sqrt(7)/16 Simplify (1 + (sqrt(468) - sqrt(13)) + 4)2-6 - (sqrt(156)/sqrt(3)4)/(sqrt(40)/(sqrt(20)/sqrt(2))). -2100 - 304sqrt(13) Simplify (-2 + sqrt(448)-2 + -4)2-4 - 4(-5 + (sqrt(448)-1 + -3 - sqrt(448))). -7280 - 704sqrt(7) Simplify (-5 + (5sqrt(119)3)/sqrt(7) - (-1 + sqrt(1700) + -5 + (sqrt(1700) + -1)-3))*2. -140sqrt(17) + 20829 Simplify ((sqrt(2835)-3 - sqrt(35)) + -5(sqrt(35) - sqrt(70)/sqrt(2)))/(55-4sqrt(45)). 7sqrt(7)/75 Simplify -3((14((sqrt(1815)2)/(5sqrt(5)1) + -5))*2 + -5). -99321/25 + 2112sqrt(3) Simplify -6((5-3sqrt(693))/sqrt(11))/(sqrt(81)2 - (sqrt(576)-1 + sqrt(576) + sqrt(576) + sqrt(576) + sqrt(9))). -90sqrt(7)/11 Simplify ((sqrt(6912)2)/(sqrt(8)-2-1))/(((sqrt(144) + 2sqrt(144))/sqrt(12))/((-1sqrt(4) + sqrt(4))-4 + sqrt(4))). 4sqrt(2) Simplify 1 + (sqrt(56)/(4(sqrt(567) - sqrt(7))))/((sqrt(324) - (5sqrt(324) - sqrt(324)))1). -sqrt(2)/864 + 1 Simplify -6((sqrt(28) + 4sqrt(28)3)/sqrt(4) + ((sqrt(175) + -1)2 - (1sqrt(7) + -3))). -1074 - 12sqrt(7) Simplify (-5 + (4 + 3 + 3 + (1 + sqrt(162))6 + 1(sqrt(162) + 2))-5)*2. 59850sqrt(2) + 207475 Simplify 1(4 + (46(0 + sqrt(13) + -3 + sqrt(13) + ((sqrt(143)5 - sqrt(143)) + sqrt(143) - sqrt(143))/sqrt(11)))*2). -20736sqrt(13) + 274756 Simplify (-1 + (sqrt(108)-1 + 4 - (sqrt(108) + 2sqrt(108)-1)))2 + (5sqrt(192) - (2 + -3sqrt(3)))-3. -129sqrt(3) + 15 Simplify 46(2 + sqrt(684)) - (sqrt(684) + -4 + 3)-4. 44 + 168sqrt(19) Simplify 0 + -4 + sqrt(192)2 + -3 + -5 + 0. -12 + 16sqrt(3) Simplify 0 + (-5 + 5 + (sqrt(108) - (0 + sqrt(108))) + -1 + (sqrt(108) + sqrt(108) + 2)-3)*2. 504sqrt(3) + 3937 Simplify -5 + 3 + sqrt(36)/sqrt(12) + -1 - (-1sqrt(48)-5 + -1). -19sqrt(3) - 2 Simplify 1((sqrt(5) + (2 + sqrt(15)/sqrt(3) - sqrt(5))*2 + sqrt(5))-1-4 - (sqrt(55)/(sqrt(22)/sqrt(2))-4 + 2)). 14 + 12sqrt(5) Simplify (2sqrt(108))/(5sqrt(16)/sqrt(4)) - ((sqrt(33)/(sqrt(44) - sqrt(396)))2 + 3 + -5). 29/16 + 6sqrt(3)/5 Simplify 3(-2 + sqrt(6)/sqrt(3)5) + sqrt(4)/(-1sqrt(72)) + -2. -8 + 89sqrt(2)/6 Simplify (-5-1sqrt(1216) - -2sqrt(1216)1) + 1 - (-3 + sqrt(1216) + ((-2sqrt(1216) - sqrt(1216))6)*2 + -2). -393978 + 48sqrt(19) Simplify (sqrt(48)/(sqrt(12) - sqrt(3)) - sqrt(16) - (-3sqrt(64) + sqrt(16) - sqrt(16) - sqrt(16)))/(-4(sqrt(40)2-6)/sqrt(5)). 7sqrt(2)/48 Simplify (22sqrt(2400) + 2sqrt(2400)-1 + sqrt(2400))/(-6(-4sqrt(972) + sqrt(972))4). 5sqrt(2)/108 Simplify -6(-1 + sqrt(612))6 + -2 - (sqrt(612)4-1 + sqrt(612) + (3 + sqrt(612) - sqrt(612)) + -2). -198sqrt(17) + 33 Simplify -2 + (0 + (-4 + sqrt(567) + sqrt(567)-1)2 - (0 + sqrt(567) + (sqrt(567)1)2 + sqrt(567) + -1 + (sqrt(567) + -1 + sqrt(567) + sqrt(567))2)) + 2. -5654 + 36sqrt(7) Simplify 2 + 3(-1 + 2(sqrt(684) + -2 + sqrt(684) + -1 + sqrt(684) + (sqrt(684) + -1 - sqrt(684))6))*2 + 4. -4104sqrt(19) + 74961 Simplify (6((sqrt(847)2 + sqrt(847))-33-6 - (2(sqrt(847) - (sqrt(847) + -3)) + sqrt(847) - (-2 + sqrt(847) + -3sqrt(847)))))2. -1007424sqrt(7) + 770870556 Simplify 5 + ((-3sqrt(68) + sqrt(68))3 + 1sqrt(68)-3)/((sqrt(80)/(sqrt(12)/sqrt(3)))/(2sqrt(5)2)). -36sqrt(17) + 5 Simplify (2-1(sqrt(102)-2 + sqrt(102) - sqrt(102)))/(1sqrt(324)/sqrt(6)) + -5. -5 + 4sqrt(17)/3 Simplify (1 + 1sqrt(98) + sqrt(98) + -4)2 + 1(sqrt(98) - ((sqrt(98) + -1)-6)2) + 0. -3163 + 427sqrt(2) Simplify -5(sqrt(3) + 1)6 + sqrt(24)/(sqrt(216)/sqrt(3)) + ((sqrt(144) - sqrt(144)1)1 - sqrt(144))/(sqrt(96)/(sqrt(8)-1)). -83sqrt(3)/3 - 30 Simplify 1((sqrt(45)/(-1sqrt(9)))*25 + 0) - (2(4 + sqrt(405) + sqrt(405)1 + sqrt(405) + sqrt(405))6)2. -935399 - 41472sqrt(5) Simplify (6(5(sqrt(75) + -1) - (sqrt(75) + (sqrt(75) - 6(sqrt(75) + 1)))) + (sqrt(1323) + -2sqrt(1323) + sqrt(1323))/(sqrt(225)3))2. 3240sqrt(3) + 218736 Simplify -2 + -3 + (-4(sqrt(198) - sqrt(22)))/(-4sqrt(66)/sqrt(6)) + -4 + 5. -4 + 2sqrt(2) Simplify (-5 + -2 + sqrt(1216)4 - (sqrt(1216) + 3 - sqrt(1216))-21)*2. -64sqrt(19) + 19457 Simplify ((sqrt(231)/sqrt(7)-3 + (-1sqrt(297) + sqrt(297))/sqrt(9))/(-1-5sqrt(704)-1))2. 27/1600 Simplify (sqrt(833)-2 + -5sqrt(1377) - -5(sqrt(2057)3 + 1))2. 1060sqrt(17) + 191037 Simplify 34sqrt(832) + -5 + 34sqrt(832) + 4. -1 + 192sqrt(13) Simplify 2(-1 + sqrt(243)) + 5 + 2 + sqrt(3) + sqrt(30)/sqrt(10) + (sqrt(42)/sqrt(2))/sqrt(7). 5 + 21sqrt(3) Simplify (((sqrt(78) - -2sqrt(78) - sqrt(78) - sqrt(78))-1 - sqrt(78))41)/((1sqrt(432))/(-2sqrt(242) + sqrt(2) - sqrt(2))). 88sqrt(13)/3 Simplify ((sqrt(153)1)2 - (sqrt(17) + -3sqrt(17)2)2 - 2(3 + sqrt(833)))-3. 42sqrt(17) + 834 Simplify (sqrt(76)4 + 2)4 + 3 + (sqrt(19) - (1 + sqrt(19) + 3)) + -1 + sqrt(1900). 6 + 42sqrt(19) Simplify ((2(2sqrt(204) + sqrt(204) - sqrt(204)) - sqrt(204))1)/((sqrt(432) - -2sqrt(432)) + (sqrt(1452) - (sqrt(1452) - sqrt(1452)-1)) + sqrt(1452)) + -3. -3 + sqrt(17)/6 Simplify 0 + (-3((sqrt(64)2 - sqrt(64))/sqrt(8))/(sqrt(256) - (-2sqrt(256) + sqrt(256) + sqrt(256)) - sqrt(4)) + 5)2 + 3. -30sqrt(2)/7 + 1390/49 Simplify (2 + (-1 + 4(-2 + 0 + sqrt(637) + 1))6)*2. -9408sqrt(13) + 367696 Simplify ((5(sqrt(104) - sqrt(104)-1-5 - (sqrt(104)-2-1 + sqrt(104))))/(sqrt(1960)/sqrt(5) - sqrt(8) - sqrt(8) - sqrt(88)/sqrt(176)))2. 254800/361 Simplify (sqrt(400)/(sqrt(40) - sqrt(10))3)/(((sqrt(8)1 - sqrt(8)) + sqrt(8))6 + sqrt(8) + (sqrt(8) - (sqrt(88) + 1sqrt(88) + sqrt(88))/sqrt(11)))11. 3sqrt(5)/5 Simplify ((sqrt(88) + (sqrt(88) - (sqrt(88) + sqrt(88) + 1sqrt(88)6)))/sqrt(2)3)/(2(sqrt(400) + -1(-2sqrt(400) + sqrt(400)))). -9sqrt(11)/20 Simplify -1 + (4 + -3 + -5 + sqrt(320) + -4 + 2 + sqrt(320) + sqrt(320) + -1)2. -336sqrt(5) + 2928 Simplify 2 + (sqrt(140)/sqrt(7) - (sqrt(245) + 1)) - (sqrt(5) + sqrt(5) + (sqrt(5) - sqrt(405)-5) - (sqrt(605) + 2)). -42sqrt(5) + 3 Simplify (5-5(-1 + (sqrt(76) - (-3 + sqrt(76)-4)) + (sqrt(76) + 0)-1 + -2))*2. 760000 Simplify (-1(sqrt(88) + sqrt(88)-35))/(-2(sqrt(968) + sqrt(968) + (sqrt(968) - 3sqrt(968))) - sqrt(968)). -14sqrt(11)/11 Simplify 3 + (1 + (((sqrt(209) + sqrt(209)-3)-4)/(sqrt(891)5))*2)-2 + -5. -10532/2025 Simplify 6((-2sqrt(140))/(sqrt(5) + (sqrt(40) + sqrt(80)/sqrt(2))/sqrt(8)))*2 + (5 + (2sqrt(567))*2)15. 34319/3 Simplify 5 + -3((sqrt(396)-2-5)*2 + 2 + (-3 + sqrt(396)-1 + sqrt(396) + 5)*2). -118813 Simplify 1(-5(sqrt(500) + 0) + -5) - ((sqrt(720)-2)*2 + sqrt(5) + -3 + (sqrt(45) - -5(sqrt(45) + sqrt(135)/sqrt(3)))/sqrt(9)). -2882 - 62sqrt(5) Simplify ((-5(0 + sqrt(637) + sqrt(637)) + sqrt(637)21)*2 - (sqrt(104) + 2sqrt(104)1)/(sqrt(128)/sqrt(4))) + -5. -3sqrt(13)/2 + 40763 Simplify -3 + (23sqrt(2448) - (-6(-1 + sqrt(2448) - sqrt(2448)) + sqrt(2448)) - ((sqrt(2448) + 1)2 + -2 + (sqrt(2448) - sqrt(2448)-1) + -3))2. -72sqrt(17) + 2454 Simplify -3((sqrt(11) + -3 + (sqrt(44)/sqrt(4))2 + sqrt(11) - (sqrt(99)/(sqrt(18)/sqrt(2)) + sqrt(11)))-6 - (4 + (2sqrt(99)6)*2)). 42924 Simplify (((sqrt(252)1)/sqrt(6))/(sqrt(2) + sqrt(6)/(sqrt(3)-2)))/(2(sqrt(75) + 1sqrt(75)) - sqrt(75) - sqrt(75) - (sqrt(75) + (sqrt(75) - sqrt(75)2-5))). -sqrt(7)/25 Simplify (5sqrt(1215)-1)/(sqrt(30)/(-1sqrt(6)) - 2sqrt(20))5. 45sqrt(3) Simplify -5(-4(sqrt(15) + (((sqrt(15) - -2sqrt(15))-6 - sqrt(15)) + sqrt(15) - sqrt(15)))5)/(2(-3(sqrt(605) - 1sqrt(605)) + sqrt(605))). -900sqrt(3)/11 Simplify ((((-4(sqrt(204) - sqrt(204)-1) - sqrt(204)) + -2(sqrt(204) - (sqrt(204) - -2sqrt(204))))4)/(-5(sqrt(1452)2 - sqrt(1452))-1))*2. 272/121 Simplify (sqrt(1274) - -2sqrt(1274))/(sqrt(2) - sqrt(32)/sqrt(4)) - ((sqrt(637)2 - sqrt(78)/(sqrt(6)1))3)2. -19773 - 21sqrt(13) Simplify (0 + 6-4(sqrt(143)2-4)/(sqrt(1584)-2 - sqrt(1584)))-2. 32sqrt(13)/3 Simplify (5(sqrt(224) - (sqrt(224) + -4sqrt(224)4 + sqrt(224))))/(((sqrt(1152) - 1sqrt(1152)) + (sqrt(8) - -6sqrt(32)/sqrt(4)))6). 25sqrt(7)/7 Simplify 4(-4 + -2sqrt(2736))*2 + (sqrt(1216)13)2-5. -10880 + 768sqrt(19) Simplify (-2 + 2 + 1 + ((sqrt(363) - (sqrt(363) + sqrt(363) + -2)) + -1 - (sqrt(363) + -1sqrt(363)-3)) + -5)2. 330sqrt(3) + 9084 Simplify ((-1sqrt(126)-2 - sqrt(126))/(sqrt(	{ "pile_set_name": "DM Mathematics" }
ivided by 1126933? 30 What is the remainder when 16967355 is divided by 3462? 93 What is the remainder when 173895410 is divided by 6326? 6322 What is the remainder when 24270 is divided by 11219? 1832 What is the remainder when 1336 is divided by 28? 20 Calculate the remainder when 5131994 is divided by 250. 244 Calculate the remainder when 528489 is divided by 11879. 5813 Calculate the remainder when 201413 is divided by 406. 37 Calculate the remainder when 84520 is divided by 200. 120 What is the remainder when 170829389 is divided by 4013? 4005 What is the remainder when 41469 is divided by 2311? 2182 Calculate the remainder when 271574676 is divided by 40. 36 Calculate the remainder when 5369517 is divided by 1073902. 7 Calculate the remainder when 579266 is divided by 14480. 66 Calculate the remainder when 71709302 is divided by 1379025. 2 What is the remainder when 295126 is divided by 15531? 37 Calculate the remainder when 23418 is divided by 4650. 168 Calculate the remainder when 199646 is divided by 294. 20 What is the remainder when 8578469 is divided by 43? 12 Calculate the remainder when 47198903 is divided by 1555. 1543 Calculate the remainder when 649761 is divided by 322. 287 Calculate the remainder when 16558339 is divided by 2108. 2107 Calculate the remainder when 757677 is divided by 63139. 9 What is the remainder when 33026 is divided by 361? 175 What is the remainder when 1037453 is divided by 60992? 589 Calculate the remainder when 61547835 is divided by 131232. 27 Calculate the remainder when 7585 is divided by 6132. 1453 What is the remainder when 1752723 is divided by 79515? 3393 Calculate the remainder when 4924105 is divided by 1637. 9 Calculate the remainder when 4707032 is divided by 787. 772 What is the remainder when 284845 is divided by 284844? 1 What is the remainder when 2412782 is divided by 109671? 20 Calculate the remainder when 13657584 is divided by 813. 810 What is the remainder when 7588685 is divided by 280? 125 Calculate the remainder when 930910 is divided by 3145. 3135 What is the remainder when 8036051 is divided by 9848? 83 What is the remainder when 140833 is divided by 37? 11 Calculate the remainder when 75015 is divided by 210. 45 Calculate the remainder when 145799 is divided by 10. 9 Calculate the remainder when 660373 is divided by 11181. 694 What is the remainder when 34876165 is divided by 11? 5 Calculate the remainder when 153396 is divided by 49145. 5961 What is the remainder when 298888 is divided by 12994? 26 Calculate the remainder when 1618596 is divided by 1341. 9 What is the remainder when 6112393 is divided by 8? 1 What is the remainder when 160818702 is divided by 3160? 3142 Calculate the remainder when 267308 is divided by 12600. 2708 Calculate the remainder when 20706 is divided by 10314. 78 What is the remainder when 7490896 is divided by 3745314? 268 Calculate the remainder when 1267290 is divided by 29447. 1069 Calculate the remainder when 467875 is divided by 1636. 1615 Calculate the remainder when 1119614 is divided by 784. 62 What is the remainder when 69090 is divided by 2786? 2226 What is the remainder when 1485346226 is divided by 1641? 1640 Calculate the remainder when 549479 is divided by 273. 203 Calculate the remainder when 7662560 is divided by 468. 464 What is the remainder when 1533627 is divided by 992? 987 Calculate the remainder when 1566152 is divided by 522040. 32 Calculate the remainder when 161074 is divided by 20029. 842 What is the remainder when 167767 is divided by 27939? 133 What is the remainder when 333323 is divided by 33106? 2263 Calculate the remainder when 1702126 is divided by 425516. 62 Calculate the remainder when 19837558 is divided by 6612515. 13 Calculate the remainder when 1118729 is divided by 874. 9 Calculate the remainder when 14809904 is divided by 242. 230 What is the remainder when 6474419 is divided by 249011? 133 What is the remainder when 6153127 is divided by 615312? 7 Calculate the remainder when 193790 is divided by 7747. 115 What is the remainder when 25295 is divided by 2446? 835 Calculate the remainder when 27817 is divided by 1837. 262 What is the remainder when 20088830 is divided by 8? 6 What is the remainder when 354155553 is divided by 4? 1 Calculate the remainder when 51289077 is divided by 2849393. 3 What is the remainder when 72070 is divided by 4915? 3260 Calculate the remainder when 51169 is divided by 3654. 13 What is the remainder when 17701628 is divided by 211? 205 Calculate the remainder when 357367 is divided by 178632. 103 What is the remainder when 6943457 is divided by 18? 11 What is the remainder when 40086992 is divided by 4? 0 What is the remainder when 86734 is divided by 487? 48 Calculate the remainder when 29578792 is divided by 19. 10 What is the remainder when 2400676 is divided by 315? 61 What is the remainder when 455350 is divided by 131? 125 Calculate the remainder when 12995391 is divided by 55. 46 What is the remainder when 13232245 is divided by 31? 19 Calculate the remainder when 574595 is divided by 6333. 4625 What is the remainder when 2979725 is divided by 262? 261 What is the remainder when 132572 is divided by 21527? 3410 What is the remainder when 39194 is divided by 5137? 3235 What is the remainder when 4250634 is divided by 15? 9 What is the remainder when 282916 is divided by 35089? 2204 What is the remainder when 31022 is divided by 1525? 522 Calculate the remainder when 73255686 is divided by 13. 10 What is the remainder when 596572415 is divided by 384? 383 Calculate the remainder when 6487122 is divided by 2537. 13 What is the remainder when 1112242 is divided by 32? 18 Calculate the remainder when 267008 is divided by 33359. 136 What is the remainder when 545962 is divided by 11867? 80 Calculate the remainder when 52409299 is divided by 52409274. 25 What is the remainder when 295214 is divided by 132? 62 What is the remainder when 282859 is divided by 10535? 8949 Calculate the remainder when 43067408 is divided by 1010. 1008 What is the remainder when 2816774 is divided by 585? 584 What is the remainder when 4000417 is divided by 4000085? 332 What is the remainder when 12759 is divided by 5398? 1963 What is the remainder when 279508 is divided by 643? 446 What is the remainder when 17927 is divided by 941? 48 What is the remainder when 678760 is divided by 61691? 159 What is the remainder when 10922508 is divided by 51279? 81 What is the remainder when 43335 is divided by 380? 15 What is the remainder when 4544174 is divided by 1514706? 56 What is the remainder when 20343793 is divided by 813751? 18 What is the remainder when 407567859 is divided by 9? 6 What is the remainder when 658290 is divided by 918? 84 Calculate the remainder when 193366 is divided by 2129. 1756 What is the remainder when 39220430 is divided by 68? 2 Calculate the remainder when 8066974 is divided by 3205. 3194 Calculate the remainder when 233581699 is divided by 1251. 1234 What is the remainder when 128958 is divided by 128532? 426 Calculate the remainder when 693574 is divided by 1409. 346 Calculate the remainder when 42652998 is divided by 100. 98 What is the remainder when 1631753 is divided by 6374? 9 What is the remainder when 179742 is divided by 229? 206 What is the remainder when 6691331 is divided by 196802? 63 Calculate the remainder when 1068211 is divided by 178033. 13 What is the remainder when 148492513 is divided by 220? 213 What is the remainder when 8179104 is divided by 24? 0 Calculate the remainder when 80115438 is divided by 368. 366 Calculate the remainder when 822687 is divided by 98. 75 What is the remainder when 2514062 is divided by 419007? 20 What is the remainder when 905666 is divided by 41163? 80 Calculate the remainder when 2256268 is divided by 205. 38 Calculate the remainder when 6103430 is divided by 612. 566 What is the remainder when 7512975 is divided by 268320? 15 Calculate the remainder when 30809157 is divided by 1620. 1617 Calculate the remainder when 4857639 is divided by 969. 42 What is the remainder when 388446 is divided by 192635? 3176 What is the remainder when 9246649 is divided by 1849328? 9 Calculate the remainder when 11056 is divided by 6969. 40	{ "pile_set_name": "DM Mathematics" }
, 56304, 56294, 56280, 56262, 56240? 56214 What is next in -60291, -60293, -60295? -60297 What comes next: 24, 70, 120, 168, 208, 234, 240, 220? 168 What comes next: -3515106, -7030213, -10545320, -14060427, -17575534, -21090641? -24605748 What is the next term in 140621, 140617, 140611, 140603, 140593, 140581, 140567? 140551 What is the next term in 20820, 20822, 20826, 20832, 20840, 20850, 20862? 20876 What comes next: 2562, 5114, 7658, 10194? 12722 What is next in -879966, -879983, -880012, -880059, -880130, -880231, -880368, -880547? -880774 What is next in -248, -298, -348, -398, -448, -498? -548 What comes next: -422, -848, -1306, -1796, -2318, -2872, -3458? -4076 What comes next: -5189, -10388, -15587, -20786, -25985? -31184 What comes next: 33549, 67085, 100621? 134157 What is the next term in 14278, 14305, 14332, 14359, 14386? 14413 What comes next: -73996, -147994, -221992, -295990, -369988, -443986? -517984 What is next in 555, 1057, 2439, 5139, 9595, 16245, 25527, 37879? 53739 What comes next: -8822, -35300, -79438, -141236? -220694 What is next in 29951, 29957, 29963? 29969 What is the next term in 748590, 748588, 748586, 748584, 748582, 748580? 748578 What is next in -113, -677, -2213, -5207, -10145, -17513? -27797 What comes next: 42389, 84776, 127163, 169550, 211937, 254324? 296711 What is next in 79460, 79461, 79462, 79463? 79464 What is the next term in -1, -164, -435, -814, -1301, -1896, -2599? -3410 What is the next term in 1471, 2949, 4435, 5917, 7383, 8821, 10219, 11565? 12847 What is the next term in 33680, 33682, 33684, 33686, 33688, 33690? 33692 What comes next: 78, 57, -58, -261, -546, -907, -1338, -1833? -2386 What is next in 191, 435, 745, 1127, 1587, 2131, 2765, 3495? 4327 What is the next term in -54, -115, -160, -183, -178, -139, -60? 65 What is next in -113, -168, -157, -44, 207, 632? 1267 What comes next: 168795, 337598, 506407, 675222, 844043, 1012870, 1181703? 1350542 What is next in 3755549, 3755548, 3755547, 3755546? 3755545 What is the next term in 8543, 8549, 8565, 8597, 8651? 8733 What is the next term in -112, 171, 440, 695, 936, 1163, 1376? 1575 What comes next: 20654, 41293, 61932, 82571, 103210? 123849 What is next in -574, -1089, -1530, -1861, -2046, -2049, -1834, -1365? -606 What is the next term in -13796, -27447, -41086, -54707, -68304, -81871, -95402, -108891? -122332 What is the next term in 7277, 7058, 6837, 6614? 6389 What is next in -429, -606, -907, -1338, -1905, -2614? -3471 What is the next term in 82543, 82561, 82581, 82603, 82627? 82653 What is the next term in -951947, -951951, -951967, -952001, -952059, -952147? -952271 What is next in -4, -67, -154, -259, -376, -499, -622? -739 What is next in -15645, -62568, -140773, -250260, -391029, -563080, -766413? -1001028 What is the next term in 677, 1396, 2135, 2906, 3721, 4592? 5531 What is the next term in -38790, -77587, -116382, -155175, -193966, -232755? -271542 What is the next term in 10868, 21733, 32598, 43463, 54328? 65193 What is the next term in 290975, 581948, 872921, 1163894? 1454867 What is the next term in -888, -1711, -2534, -3357? -4180 What is next in 14834, 14778, 14734, 14708, 14706? 14734 What comes next: -288, -835, -1644, -2715? -4048 What comes next: -1802422, -3604842, -5407260, -7209676, -9012090, -10814502? -12616912 What is next in 3848, 6659, 9470? 12281 What is next in 1546, 3065, 4548, 5977, 7334, 8601, 9760, 10793? 11682 What comes next: -58, -96, -168, -274? -414 What is next in 79, 222, 473, 832, 1299? 1874 What is next in 268, 325, 420, 553? 724 What is the next term in 1571, 1580, 1589, 1598? 1607 What comes next: 10548, 42203, 94968, 168849, 263852, 379983? 517248 What comes next: -258, -935, -2032, -3555, -5510? -7903 What comes next: -483, -3429, -11429, -27009, -52695? -91013 What is next in -2356, -5388, -8420, -11452? -14484 What is next in 32671, 32678, 32685, 32692, 32699, 32706? 32713 What is the next term in 4513, 4516, 4519, 4522, 4525, 4528? 4531 What is next in -1050, -4712, -10814, -19356, -30338, -43760? -59622 What comes next: -975, -950, -925? -900 What is the next term in 2875, 5740, 8605, 11470? 14335 What comes next: -68730, -68738, -68746, -68754? -68762 What is the next term in 993502, 993506, 993510, 993514, 993518, 993522? 993526 What is the next term in 271, 271, 315, 421, 607, 891, 1291, 1825? 2511 What is the next term in -963, -3845, -8641, -15351, -23975, -34513? -46965 What is next in 124694, 249383, 374072? 498761 What is the next term in 85634, 85636, 85638? 85640 What is next in -79, -239, -385, -511, -611, -679, -709, -695? -631 What is the next term in 30735, 61033, 91329, 121623, 151915, 182205, 212493? 242779 What comes next: 93985, 187972, 281959, 375946, 469933? 563920 What is next in 18778, 37543, 56300, 75049? 93790 What is next in -441, -882, -1317, -1746, -2169, -2586, -2997? -3402 What is next in -360, -1360, -3012, -5304, -8224, -11760, -15900? -20632 What comes next: -1620, -1612, -1604? -1596 What comes next: -65, -139, -257, -419? -625 What is next in 2074, 3683, 5292? 6901 What is the next term in -23, -556, -1467, -2774, -4495, -6648? -9251 What is the next term in -64167, -64165, -64163? -64161 What is the next term in 20, 157, 446, 935, 1672, 2705, 4082, 5851? 8060 What is the next term in -154, -566, -1236, -2164? -3350 What is next in -550, -862, -1180, -1504, -1834? -2170 What is the next term in 793, 1487, 2079, 2569? 2957 What is next in -2151, -2138, -2127, -2118? -2111 What is the next term in -11418, -11352, -11286, -11220, -11154, -11088? -11022 What is the next term in 60079, 60074, 60069, 60064, 60059? 60054 What comes next: -638, -1157, -1582, -1913, -2150, -2293, -2342? -2297 What is the next term in 5146, 10297, 15470, 20677, 25930, 31241, 36622? 42085 What is next in 42602, 42616, 42630, 42644? 42658 What is next in 2345, 2274, 2201, 2126, 2049? 1970 What comes next: -1033, -1027, -1021? -1015 What is next in -7708, -15448, -23188, -30928, -38668? -46408 What is next in -2266, -2281, -2312, -2365, -2446, -2561, -2716, -2917? -3170 What comes next: 2340, 2329, 2296, 2229, 2116, 1945, 1704, 1381? 964 What is the next term in 10468, 10439, 10390, 10315, 10208, 10063, 9874? 9635 What comes next: 1653, 2893, 4131, 5367, 6601, 7833? 9063 What comes next: 2370, 2415, 2472, 2547, 2646, 2775, 2940, 3147? 3402 What comes next: 783, 3148, 7097, 12636, 19771, 28508, 38853, 50812? 64391 What is the next term in -26450, -26440, -26430, -26420? -26410 What comes next: -219, -691, -1639, -3303, -5923, -9739, -14991, -21919? -30763 What is the next term in -1175, -2337, -3503, -4673, -5847, -7025? -8207 What comes next: -504, -1010, -1516, -2022, -2528, -3034? -3540 What is next in -25307, -25288, -25269, -25250, -25231, -25212? -25193 What is the next term in -336, -1553, -3580, -6417? -10064 What is next in 58904, 117838, 176774, 235712? 294652 What is the next term in 25830, 25831, 25832, 25833, 25834, 25835? 25836 What is the next term in 442, 981, 2450, 5317, 10050, 17117? 26986 What is next in -209, -234, -259, -284? -309 What is the next term in -309, -1136, -2473, -4320? -6677 What comes next: 3625, 7234, 10841, 14446, 18049, 21650, 25249? 28846 What is the next term in 2096, 2127, 2180, 2255, 2352, 2471, 2612? 2775 What comes next: -40011, -40005, -39995, -39981, -39963, -39941? -39915 What comes next: 1649, 1653, 1657, 1661, 1665, 1669? 1673 What comes next: 13344, 13215, 13086, 12957, 12828? 12699 What comes next: 107, -193, -483, -763, -1033, -1293, -1543? -1783 What comes next: -85, -70, -29, 50, 179, 370? 635 What comes next: -18395, -18433, -18477, -18527? -18583 What is next in -11191, -11162, -11135, -11110, -11087, -11066? -11047 What comes next: 8285, 8233, 8117, 7913, 7597, 7145, 6533, 5737? 4733 What comes next: 395, 579, 749, 899, 1023, 1115, 1169? 1179 What is the next term in -70, -100, -126, -142, -142, -120? -70 What is next in -345, -292, -225, -138, -25, 120, 303, 530? 807 What is the next term in -137, -1374, -4757, -11366, -22281? -38582 What comes next: -6907, -6904, -6901, -6898? -6895 What is next in 1342, 1401, 1458, 1513, 1566? 1617 What is the next term in -1562, -3130, -4706, -6290, -7882, -9482, -11090? -12706 What	{ "pile_set_name": "DM Mathematics" }
cking 2 m when two letters picked without replacement from {r: 2, k: 1, t: 1, m: 2, e: 1}? 1/21 What is prob of picking 1 p, 1 m, and 2 r when four letters picked without replacement from {f: 1, u: 1, r: 6, p: 1, m: 5}? 75/1001 Two letters picked without replacement from kukkkkkkkkukuk. Give prob of picking 2 k. 55/91 Two letters picked without replacement from {k: 5, j: 1, o: 3}. Give prob of picking 2 k. 5/18 Four letters picked without replacement from yebzbzxzxbefbefzxbzz. What is prob of picking 1 b and 3 e? 1/969 Three letters picked without replacement from fifq. What is prob of picking 2 f and 1 q? 1/4 What is prob of picking 1 r and 1 y when two letters picked without replacement from {t: 1, y: 1, f: 3, q: 1, r: 1}? 1/21 Three letters picked without replacement from {j: 1, n: 1, m: 1, g: 2, q: 1, h: 1}. Give prob of picking 1 q, 1 m, and 1 g. 2/35 What is prob of picking 1 j and 1 s when two letters picked without replacement from {j: 2, t: 1, a: 2, s: 1, q: 1}? 2/21 Calculate prob of picking 1 p, 2 i, and 1 s when four letters picked without replacement from {s: 6, g: 3, i: 3, p: 1}. 18/715 Three letters picked without replacement from lccxxclllxx. Give prob of picking 1 c and 2 l. 6/55 Two letters picked without replacement from {z: 9, l: 3, r: 2, g: 3}. What is prob of picking 1 g and 1 r? 3/68 What is prob of picking 1 l, 1 n, and 2 v when four letters picked without replacement from lvlnlkvlnvvlknv? 10/91 What is prob of picking 1 b, 1 w, and 1 i when three letters picked without replacement from {i: 1, s: 2, b: 1, w: 1}? 1/10 Three letters picked without replacement from {a: 5, t: 5, u: 3}. Give prob of picking 3 t. 5/143 Four letters picked without replacement from fffwffffwwwxfwfffw. Give prob of picking 4 f. 11/102 Two letters picked without replacement from suqqqqqaqquuquqssuqa. Give prob of picking 2 u. 1/19 Four letters picked without replacement from aaavvvaaaavavaaa. What is prob of picking 1 v and 3 a? 165/364 Two letters picked without replacement from tmmgkzh. What is prob of picking 2 m? 1/21 Two letters picked without replacement from mgl. What is prob of picking 1 g and 1 l? 1/3 Two letters picked without replacement from {s: 1, d: 3, v: 4, y: 2, n: 9}. Give prob of picking 1 y and 1 d. 2/57 What is prob of picking 2 k and 1 r when three letters picked without replacement from krrrgkgkrkr? 2/11 Two letters picked without replacement from {y: 1, c: 6, b: 4}. Give prob of picking 1 b and 1 y. 4/55 What is prob of picking 2 o and 1 w when three letters picked without replacement from kkokwwkckkkcockkoo? 1/68 Three letters picked without replacement from {p: 1, s: 1, a: 1, q: 1, d: 1}. Give prob of picking 1 d, 1 s, and 1 q. 1/10 Two letters picked without replacement from {q: 6, p: 2}. What is prob of picking 2 q? 15/28 Two letters picked without replacement from tkt. What is prob of picking 2 t? 1/3 Four letters picked without replacement from mlnmlnmnlllmmnll. What is prob of picking 3 m and 1 n? 2/91 Calculate prob of picking 2 n and 2 z when four letters picked without replacement from jzjnjzzjzjznjj. 10/1001 Three letters picked without replacement from oioqooqvo. What is prob of picking 1 o and 2 q? 5/84 What is prob of picking 1 u and 1 j when two letters picked without replacement from uuuuljlumltuumlmu? 1/17 Calculate prob of picking 1 h and 2 c when three letters picked without replacement from mmmmmhmhmchmmmmmcmc. 3/323 What is prob of picking 1 h and 1 o when two letters picked without replacement from cooohohhoopohooslhoo? 11/38 Calculate prob of picking 1 r, 2 g, and 1 i when four letters picked without replacement from igrgrgrgigriirririg. 105/646 Calculate prob of picking 1 k and 1 v when two letters picked without replacement from {n: 1, a: 1, v: 1, o: 5, k: 2}. 2/45 What is prob of picking 1 c and 3 a when four letters picked without replacement from acbkkaa? 1/35 Three letters picked without replacement from bbbhbhbbhbbbbb. Give prob of picking 3 h. 1/364 Four letters picked without replacement from {d: 9}. Give prob of picking 4 d. 1 What is prob of picking 1 x and 1 e when two letters picked without replacement from uelxe? 1/5 What is prob of picking 1 u and 1 j when two letters picked without replacement from {j: 7, r: 8, u: 5}? 7/38 What is prob of picking 2 p and 1 q when three letters picked without replacement from qppppqqppqpqpqpqqpqp? 33/76 Three letters picked without replacement from {r: 3, a: 3}. What is prob of picking 3 a? 1/20 What is prob of picking 4 l when four letters picked without replacement from {l: 6}? 1 Three letters picked without replacement from wwhwtwtwtt. Give prob of picking 1 t, 1 w, and 1 h. 1/6 Two letters picked without replacement from {f: 4, d: 6}. Give prob of picking 2 d. 1/3 Three letters picked without replacement from tptkjjptttktjttkatt. What is prob of picking 3 k? 1/969 Two letters picked without replacement from jjjfjffjysjn. Give prob of picking 1 s and 1 f. 1/22 Three letters picked without replacement from {w: 7, y: 3}. What is prob of picking 3 y? 1/120 Two letters picked without replacement from kfffkfffkffffffkfff. Give prob of picking 2 k. 2/57 Four letters picked without replacement from rzzerzzerrze. What is prob of picking 3 z and 1 r? 8/99 Three letters picked without replacement from {w: 3, r: 4, j: 2, z: 1}. Give prob of picking 1 w and 2 r. 3/20 Four letters picked without replacement from bbbsbbbbbbbssbbbsb. What is prob of picking 1 s and 3 b? 364/765 Four letters picked without replacement from iiiiiiiiiiiiitiiiit. Give prob of picking 2 i and 2 t. 2/57 What is prob of picking 1 a, 1 g, and 1 l when three letters picked without replacement from logagatpoooop? 2/143 Calculate prob of picking 1 u and 2 n when three letters picked without replacement from ububbbbnbgng. 1/110 Calculate prob of picking 1 a and 2 l when three letters picked without replacement from alllllallla. 28/55 Calculate prob of picking 2 f when two letters picked without replacement from pppffpp. 1/21 Three letters picked without replacement from cpppcc. What is prob of picking 3 p? 1/20 Calculate prob of picking 2 i and 1 k when three letters picked without replacement from {z: 6, k: 6, i: 7}. 42/323 What is prob of picking 1 t and 1 i when two letters picked without replacement from {c: 1, p: 1, t: 1, x: 1, l: 1, i: 2}? 2/21 Four letters picked without replacement from rgggrgrgggrgrrrrgrr. Give prob of picking 1 g and 3 r. 90/323 Four letters picked without replacement from scccscciciccqc. Give prob of picking 3 c and 1 q. 12/143 Three letters picked without replacement from yooowohmhhh. What is prob of picking 2 h and 1 m? 2/55 Four letters picked without replacement from {a: 4, x: 1, u: 5, s: 3, n: 1}. Give prob of picking 2 a, 1 u, and 1 n. 30/1001 What is prob of picking 1 x, 1 k, and 1 c when three letters picked without replacement from {x: 1, w: 2, f: 1, r: 1, k: 1, c: 1}? 1/35 Three letters picked without replacement from {i: 2, z: 4, k: 5, r: 2, v: 1}. Give prob of picking 1 r, 1 v, and 1 z. 2/91 What is prob of picking 4 g when four letters picked without replacement from {d: 5, g: 8}? 14/143 What is prob of picking 1 a and 1 z when two letters picked without replacement from afdhahfhfdzhaa? 4/91 Calculate prob of picking 2 p when two letters picked without replacement from nnppppnppnppnpprn. 45/136 Three letters picked without replacement from {q: 1, f: 3}. What is prob of picking 2 f and 1 q? 3/4 What is prob of picking 2 y, 1 h, and 1 d when four letters picked without replacement from zyyyqzuhyyyyud? 3/143 What is prob of picking 2 n and 1 p when three letters picked without replacement from nppppppppppppppppppp? 0 Three letters picked without replacement from {r: 4, a: 1, k: 5}. Give prob of picking 1 a and 2 r. 1/20 Two letters picked without replacement from xvkkoib. What is prob of picking 1 v and 1 b? 1/21 What is prob of picking 1 w, 1 m, and 1 p when three letters picked without replacement from nmnbppnndwmwn? 4/143 Two letters picked without replacement from {p: 5, m: 2, q: 8}. Give prob of picking 2 m. 1/105 What is prob of picking 1 q and 1 w when two letters picked without replacement from {q: 3, u: 2, f: 2, e: 3, x: 6, w: 2}? 2/51 What i	{ "pile_set_name": "DM Mathematics" }
of h and 11. 11 Let v(u) be the first derivative of u3/3 - u2 - 4u + 1. Let n be (1/(-3))/(3/(-94)). Let w be v(n). Calculate the greatest common factor of w and 16. 4 Let r(s) = -2s - 2. Let t be r(-5). What is the highest common divisor of 8 and t? 8 Suppose 0 = -5j + 4u + 28, 0 = -4j + 2u - 0 + 26. Calculate the greatest common divisor of 20 and j. 4 Suppose 2m + 3 + 7 = 2f, 2f + 5m = 3. Suppose -fd + 120 = -340. Calculate the highest common factor of 46 and d. 23 Let h = 7 + -1. Let g(v) = -v*2 - 5v + 7. Let r be g(-6). Let n be 3 - r/((-1)/15). Calculate the highest common divisor of n and h. 6 Let w = 392 - 272. Calculate the highest common divisor of 15 and w. 15 Suppose -7i = -5i - 66. Let a be 1 - (-12)/1. Calculate the highest common divisor of i and a. 3 Let y(f) = f + 2. Let u be y(0). Suppose -s - us = 63. Let g be (180/(-14))/(3/s). Calculate the greatest common divisor of 36 and g. 18 Let s(h) = 3h2 + 4h + 1. Let w be s(-2). Let r be 1/w + 239/5. What is the highest common divisor of r and 6? 6 Suppose 99 = 4h - 5. Calculate the greatest common factor of h and 78. 26 Suppose -4c + 4z = -44, 2c - 7 = 3c + 5z. Let n(l) = -l*3 + 7l*2 + 10l + 2. Let r be n(c). Calculate the highest common divisor of r and 9. 9 Suppose 220 = 2h + 2h. Let b be -23 + -3 + (-2)/(-2). Let n = b - -36. What is the highest common divisor of n and h? 11 Let p be -71 + (4 - 2). Let s(l) = -l2 - 6l - 4. Let n be s(p). Suppose 20 = -17z + 71. What is the highest common divisor of z and n? 1 Let o(t) = t3 - 6t*2 - 4t + 9. Let c be o(7). Calculate the greatest common factor of c and 5. 5 Let h be (-135)/((-5)/1) + -3. Calculate the greatest common factor of h and 192. 24 Suppose 23k - 28k = -660. Calculate the greatest common divisor of 12 and k. 12 Let r(a) = 3a2 - a - 15. Let x be r(-6). Calculate the highest common factor of 33 and x. 33 Suppose 0 = -7t - 2t + 360. What is the greatest common factor of t and 4? 4 Let o(n) = -n - 3. Let i = 60 - 36. Suppose -2l = 2r + 2l + i, r + 4l = -20. Let t be o(r). Calculate the highest common divisor of 7 and t. 1 Let f = -34 - -59. What is the highest common factor of 5 and f? 5 Let z(w) = 17w + 7. Let f be z(3). Calculate the greatest common divisor of f and 464. 58 Let o(n) = -6n + 2. Let l be o(5). Let w = 0 - 6. Let j = w - l. What is the greatest common divisor of 2 and j? 2 Let l(d) be the third derivative of -d6/120 - d5/10 - d4/4 + d3 + d2. Let a be l(-5). What is the greatest common factor of a and 1? 1 Suppose 5j + 1 + 9 = 0, 2j + 14 = -t. Let p = t - -26. Let o be (-1)/((-2)/(-288))-1. What is the highest common divisor of p and o? 16 Suppose 8r - 3r = 5. Calculate the greatest common factor of r and 13. 1 Let c(f) = f*2 + 4f - 2. Let x be 5 + -12 + (-1)/(-1). Let k be c(x). Suppose 3t + 24 - 84 = 0. Calculate the greatest common factor of k and t. 10 Suppose 6j - 11j + 360 = 0. Calculate the highest common factor of j and 24. 24 Let c(w) = -2w - 5. Let j be c(-7). Suppose -8a = -7a - 18. Calculate the greatest common factor of j and a. 9 Let d(l) = 6l + 287. Let f be d(0). What is the greatest common factor of 41 and f? 41 Suppose o - 604 = 4l, 1213 = 2o - 7l + 4l. Suppose o = 2p - 250. Suppose -3j + 6j = p. What is the highest common factor of j and 13? 13 Let y be (-155)/160/(-100). What is the highest common divisor of y and 297? 33 Let z = -15 - -28. Let w(g) = -g - 4. Let o be w(-5). Let y = o + z. Calculate the greatest common factor of y and 14. 14 Suppose -5l = 5k - 50, -3l = -0l - 2k - 35. Let v = 29 - l. Calculate the highest common factor of 54 and v. 18 Let w(n) = -n3 + 8n*2 - 2n + 5. Let m be w(7). Suppose 5x = -0b - b - 5, 4x = -2b + 8. What is the greatest common factor of m and b? 10 Let a = -13 - -23. Calculate the greatest common divisor of a and 40. 10 Suppose -4j + 670 = 166. What is the greatest common divisor of 18 and j? 18 Let z(r) = 6 - 6 + 16r*2. Let a be z(1). Suppose 0 = -3f - 4 + 10. What is the greatest common factor of a and f? 2 Suppose -3p - 3b + 18 = 0, 6p = 2p + b + 29. Suppose 3j - pj = -36. Calculate the greatest common divisor of 3 and j. 3 Let b be (-10)/55 - 3174/(-33). What is the greatest common factor of 12 and b? 12 Let w(c) = -11c + 1. Let n be w(3). Let o = -22 - n. What is the greatest common divisor of 90 and o? 10 Suppose 34 + 31 = 5w. Calculate the highest common factor of 91 and w. 13 Suppose -5x - 3b = -b - 52, -4x - 2b + 42 = 0. Let y be 105/(x/(-4)). Let s be 4/5y/(-2). What is the greatest common factor of s and 4? 4 Let c(n) = n - 7. Let v be c(5). Let m(g) = 41g2 + 3g + 2. Let w be m(v). Calculate the greatest common divisor of w and 16. 16 Suppose 5n + 4 = 4n. Let i be n/6 - 3/9. Let h = i - -33. What is the highest common factor of 8 and h? 8 Let c(u) = 40u - 3. Let r be c(2). Suppose 0 = 5k + l - 52, k + 5l = -0l - 4. Calculate the greatest common divisor of r and k. 11 Let m(o) = o*3 - 14o*2 - 10o - 35. Let j be m(15). Let z be (20 + -2)/1 + -2. Calculate the highest common factor of j and z. 8 Let n(z) = 2z - 25. Let k be n(23). Let s(f) = 2f - 5. Suppose m = j - m + 6, -5 = 5j - 5m. Let g be s(j). What is the highest common factor of k and g? 3 Let n(r) = r*3 - 6r*2 - 7r - 17. Let v be n(8). Let t(l) = -3l - 4. Let k be t(-3). What is the highest common factor of k and v? 5 Let t = 281 + -185. What is the highest common divisor of t and 32? 32 Let o be ((-76)/(-57))/(2/12). Calculate the greatest common divisor of o and 32. 8 Let i be (-1 + -10)/(3/(-39)). Calculate the highest common factor of i and 13. 13 Let o = -84 - -168. Calculate the highest common factor of o and 12. 12 Suppose 130 = -5o + 5u, 170 = -2o - 3o - 5u. Let a = o + 56. What is the greatest common factor of 65 and a? 13 Let g be 13/(-26) - (-177)/2. What is the greatest common divisor of 11 and g? 11 Suppose -3s + 7 - 1 = 0. Let r = s - -12. Let k be ((-4)/14)/((-2)/r). Calculate the greatest common factor of k and 1. 1 Suppose 3d - 2d - 1 = 0. Let m(l) be the second derivative of 7l3/3 + l2/2 + 4l. Let z be m(d). What is the highest common factor of 3 and z? 3 Let x(q) = 3q*2 + q + 14. Let v be x(6). Let o(d) = 2d*2 + 5d + 4. Let t be o(-4). Calculate the greatest common factor of v and t. 16 Suppose 0 = 2u - 10, 3r - 18 = -0r + 3u. What is the highest common divisor of 55 and r? 11 Suppose 3z + 0 - 60 = 0. Suppose -3s = 2i - 11, -3i + 2i - 22 = -4s. Let c be 16/i2/(-2). Calculate the highest common divisor of z and c. 4 Let l be 68/(-51)(-2 - (-359)/(-2)). Calculate the highest common divisor of 22 and l. 22 Suppose 4a = -3a + 21. Suppose 4x = ap - 179, 0p - 3p + 3x = -177. Let t = 5 + 14. What is the highest common divisor of t and p? 19 Suppose 5b + 1 = -4, 0 = 2p + 4b - 44. What is the highest common divisor of 12 and p? 12 Let p = -16 - -7. Let y(j) = j - 15. Let h be y(0). Let s = p - h. What is the greatest common divisor of s and 18? 6 Suppose q = 21 + 21. Let o be -1 - -4 - (9 - q). What is the highest common factor of o and 4? 4 Suppose 4 = -3a + 28. Calculate the greatest common divisor of a and 1. 1 Let p = 44 + -30. Let c(f) = -36f - 1. Let q be 0 - 2 - (0 - 1). Let w be c(q). What is the greatest common factor of p and w? 7 Let a = -76 - -108. Calculate the greatest common factor of a and 24. 8 Let d be 18((-4)/(-2))/4. Suppose 0 = 5c + 10 + 25. Let h be (-2)/c + 114/42. Calculate the greatest common divisor of d and h. 3 Suppose -62 = z - 2z. Suppose -81 - z = -r. Calculate the highest common factor of 13 and r. 13 Let p(j) = j3 + j2 - 3j + 3. Let d be p(4). Suppose w - d - 46 = 0. What is the greatest common divisor of w and 13? 13 Let j(l) = 92l2 + 3l + 2. Let s be j(-1). What is the highest common divisor of 13 and s? 13 Suppose -3x + 3 = -2u + 2, 0 = 2u + 5x + 41. Let z be (u/(-12))/(3/153). Calculate the greatest common divisor of z and 136. 34 Let p = -22 - -38. Suppose -4n - 11 = z - 88, 2n = 4z + p. What is the highest common divisor of 144 and n? 18 Suppose -160 = 3k + 2*k. Let x = 10 - k. Calculate the highest common divisor of x and 28. 1	{ "pile_set_name": "DM Mathematics" }
o + 4c. Which is smaller: o or 1/7? o Let t = 0 + 0.2. Let h = 0.4 - t. Let c be (-6)/15 + (-7)/(-5). Which is smaller: h or c? h Suppose 2v - 1 = 3v + y, -4v - 10 = y. Which is greater: 3 or v? 3 Let z(h) = -h*2 - 2h - 2. Let q be z(-2). Suppose -3w = -m + 4, 5m = -2w - w + 2. Does q = w? False Let v(n) = n2 + 3n - 5. Let h = -5 - -1. Let g be v(h). Is g smaller than 4/9? True Suppose 0 = -4o - 4c + 4, c + 0c + 2 = 0. Let l be -4(o - 7/2). Let b(k) = k - 2. Let t be b(5). Which is smaller: t or l? l Let z = -6.4 + 6.6. Which is smaller: z or -0.001? -0.001 Suppose -i + 6 = -4i. Is -1/2 greater than or equal to i? True Let j be ((-1)/22)/(2/(-8)). Let c = 5 - 0. Suppose -k = 6z - 2z - 3, 0 = -cz + 2k + 7. Which is bigger: j or z? z Let n = -133/3 - -44. Which is greater: -1 or n? n Suppose -3v = 2l - 95, 24 + 21 = l + 4v. Let y = 101/2 - l. Let n(s) = s*2 + 3s - 1. Let j be n(-4). Which is smaller: y or j? y Suppose 5k = 4b - 7, 5b - 2b = -k + 10. Which is smaller: b or -6? -6 Let q = 1 + -1. Let w be (-2)/41 + 0. Which is smaller: q or w? w Let n(z) = 3z*3 + 2z*2 - z. Let o be n(1). Suppose 2s - 11 = d, 4d - o = 2s + 8d. Suppose -sp = -p. Which is smaller: p or 1/4? p Let x = 0.45 - 7.45. Is -1/4 at most x? False Suppose 4k - c = -2c - 6, 5k + 2c = -9. Let r be (-175)/55 - k3. Is 1 < r? False Let l = -8837/3857 + 3/551. Do -3 and l have different values? True Suppose 2u + 0 = -4. Let k be (u - 20/(-7))/(-2). Which is smaller: k or 1? k Let i(c) = -c - 16. Let w be i(-17). Which is greater: w or 4? 4 Suppose 4 = -w - 3w. Which is smaller: w or -20/9? -20/9 Let t be ((-2)/(-7))/(8/14). Let z be 1 - 1(1 + 0). Let j = z + 2. Which is smaller: j or t? t Suppose 5 = 2z - 1, 0 = 4b - 5z + 27. Let d(c) = -c2 - c + 2. Let k be d(2). Is k at most b? True Let k(p) = -p2 - 13p - 26. Let l be k(-12). Which is bigger: l or -15? l Suppose -5m - 3o = -3m, 2m = -4o. Is 0.6 smaller than m? False Let g = -175 - -228. Is g greater than or equal to 55? False Let s(t) = -t2 - 19t + 2. Let z be s(-14). Which is smaller: z or 71? 71 Suppose -4q + 8q = 20. Which is greater: q or 0.1? q Let b = 16 + -10. Let a = -349/9 - -39. Is a not equal to b? True Suppose 2k - 5w + 22 = 0, 2w = -5k + 7w - 40. Let n be ((-4)/k)/(2/(-12)). Let c = -5 + 3. Is n at most c? True Let k be (12/9)/(2/3). Suppose t = m - 8, 21 = -2t + m + km. Let d be 6/(2/(-1)) + -1. Does t = d? False Suppose -4z = -3t - 16, -9z + 11z = 8. Let p be ((-5)/10)/(3/(-2)). Which is greater: p or t? p Let l = 39 - 39.4. Which is smaller: l or -0.2? l Let c be ((-2)/(-59))/(13 + -15). Which is bigger: c or -1? c Let d = 1846 - 31364/17. Which is greater: d or 2? 2 Let a = -0.17 - -0.17. Let t = a - 4. Which is smaller: t or 2? t Let f be (-3)/(36/(-154)) - 6. Do 6 and f have different values? True Suppose 2q + 20 = 7q. Let h be 0/9 - (3 + -6). Which is greater: q or h? q Suppose 3j + 2j - 21 = -2z, 0 = 4j + 4z - 24. Let s be 4 + (-2)/(-2) + 0. Suppose sm = 8m + j. Which is bigger: 1/4 or m? 1/4 Let j(z) = z - 8. Let k be j(6). Let p = k - -4. Let d = -5 - -8. Which is greater: d or p? d Let f be (-15 - -3)(-2)/(-9). Which is smaller: f or -2? f Let l be (-12822/40)/(-5). Let b = -129/10 + l. Is -1 at least b? False Let x = -6 - -5. Which is greater: -3/5 or x? -3/5 Let x be (-5 + 5)(-2)/4. Are x and 13 non-equal? True Suppose -4d - 30 = -d. Let p be 12/(-3)-12/(-8). Do p and d have the same value? False Let t be -3 + 1 - 3/(-6). Suppose -5i = -5 - 5. Suppose 0 = -2m - 4 - i. Which is greater: m or t? t Let w = -42 - -461/11. Suppose 0 = -2z - 6, 2 = -3y + 5z + 20. Is y less than or equal to w? False Let c = 12 + -7. Let o be (-12)/4 - c/(-2). Which is bigger: 0 or o? 0 Suppose 0 = -22y + 24y + 2. Is -1/7 greater than y? True Let s = 10.1 + -10. Let n = 3 + -2. Is n <= s? False Suppose -a - a = -2g - 26, 4g - a = -58. Let k = -14 - g. Let o = -5 - -7. Which is bigger: k or o? o Let n(i) = i2 + i. Let t be n(-2). Which is bigger: 1 or t? t Let o(s) = s + 5. Let y be o(-5). Suppose -3k = -yk + 24. Which is bigger: k or -7? -7 Let p be (2/(-21))/((-4)/4206). Let m = 101 - p. Is m >= 2? False Suppose -3u = -7u. Suppose -4g - v = u, 2g + 5v = 4g. Which is smaller: 2/17 or g? g Suppose -b - 8 = 3b. Let o be -1 - 116/110 - b. Let t = -241/385 - o. Which is greater: -1 or t? t Suppose 4c = -5k - 11 - 1, 18 = -5k - c. Suppose 4t - w - 9 = 0, 0t - 5w = 4t - 3. Let o(r) = r - 5. Let i be o(t). Is k at most as big as i? True Suppose 0 = 5t - 13 + 3. Let o(w) = -w*2 + 4w - 7. Let c be o(5). Let i = c + 37/3. Which is bigger: t or i? t Let s = 1.6 - 1.59. Let n = s + -0.1. Which is smaller: n or -1? -1 Suppose 5s - 4s + 2 = 0. Which is smaller: -4 or s? -4 Let v(k) = k*3 - 2k*2 + 2k - 1. Let j be v(2). Let q be j1 + (-2)/1. Is 0 < q? True Suppose 5t + 2i = -90, -7i = -2i. Let c = t + 13. Is c greater than -4? False Let u be ((-24)/(-10))/((-18)/(-45)). Let k(o) = -o2 + 6o. Let g be k(u). Which is smaller: -1 or g? -1 Let d = -4576/23 + 199. Does 1 = d? False Suppose 0 = -8c + 3c + l + 20, -3c - 1 = 2l. Suppose 0y + cy = 9. Let f(x) = x + 9. Let o be f(-6). Are o and y non-equal? False Let w = -31/5 - -29/5. Is w <= 2/7? True Let m = -10 + 7. Let z = -1 - m. Let c = z + -3. Is c greater than or equal to -0.01? False Let j be (4-2)/2(-324)/(-48). Are j and -28 non-equal? True Suppose 2n = m - 1, -59m + 57m = -2n - 4. Let o be (0 - 0) + 6/(-14). Which is smaller: o or n? o Let p be (2 - 3) + 4/(-152)-30. Which is smaller: p or 1? p Let n = 456 + -461.075. Let j = 0.025 - n. Let i = 5 - j. Are i and 2/7 equal? False Let g be 170/123 - (-24)/(-12). Let r = 2/41 - g. Is -0.1 at most as big as r? True Suppose -4c + 1 = 17. Let y = -20 + 20.3. Are c and y equal? False Let i be (-10440)/66 + (-4)/(-22). Let p = i - -1110/7. Is 0 > p? False Suppose 3d = -38 + 2. Which is greater: d or -0.1? -0.1 Let q be (-2)/(-4)6 + -13. Let t be (-3)/(3 - q/(-3)). Is 9 less than t? False Let s = 9 - 9. Let w(k) = 2k3. Let i be w(-1). Let y be (i/(-65))/(3/15). Which is smaller: y or s? s Suppose 4p + 5u - 7 = 2p, 5p + 5u = 40. Suppose -p = -3r + 4. Suppose rk - 3 = 2k. Which is bigger: 4/3 or k? 4/3 Let d be 36/90 + (47/(-80) - 0). Which is bigger: 0 or d? 0 Let k = 0.1 + -0.1. Let i = -124 + 117. Which is greater: i or k? k Let r = -19 + 14. Is 0.1 != r? True Let x = -23.8 - -24. Suppose 0 = -5k + l + 11 + 4, k = -5l - 23. Do k and x have the same value? False Let u = 1910412 + -21000134/11. Let y = -1310 + u. Is y bigger than -1? False Let i(v) = 11v - 11. Let y(h) = -6h + 6. Let p(b) = -3i(b) - 5y(b). Let a be p(-6). Let m be ((-2)/6)/((-7)/a). Which is smaller: 1/3 or m? 1/3 Let n = 1 + 0. Let z be 22/243 + -3. Which is greater: n or z? n Let c(n) = -3n - 2. Let j be c(-3). Let d(s) = 5s*2 + 8s + 2s - 17s2 + s3 + 18 - j. Let l be d(11). Is l < -1? False Suppose 0 = -t + 3c - 8, 0 = 3t - 3c + 8 - 2. Suppose -w = d - 5 + 1, -2w = 5d - 14. Let z = -3/2 + d. Which is bigger: z or t? t Let c = 13 + -27. Let f = c - -13.99. Does 0 = f? False Let z = 0.75 + -0.7. Let v = z + 0.03. Which is bigger: 0.1 or v? 0.1 Let u = -3.4 - -1.4. Is 20 > u? True Let l = -16 - -11. Let p = 6 + l. Does p = -1? False Let k = 7 + -7. Suppose ky + 14 = 2y. Suppose 0 = 5l - 28 - 12. Is l <= y? False Let w = -7 + 14. Let i be 6/(-21) - (-9)/w. Let n be (3/2)/((-3)/(-4)). Which is smaller: n or i? i Suppose u = -4u + 15. Let j be (-7)/((-14)/24) - u. Let b be (-2)/13 + j/39. Do 0 and b have different values? True Suppose l = -4l + 2z - 29, 0 = 5l + 3z + 19. Let j = l - -3. Let i be 1/j + (-4)/(-56). Do 0 and i have the same value? False Let w = 3135/16 - 196. Which is smaller: w or 1? w Suppose -n + 15 = -0n. Suppose 2j + n = 3j. Suppose 3u - j = 3. Which is smaller: u or 5? 5 Suppose 3r = -3r + 90. Is -1 > r? False Let u = 0.4 + -0.3. Let z = -21 - -20.91. Let r = -0.09 - z. Which is greater: u or r? u Let a(n) = n + 1. Let y be a(-2). Let h = y + 2. Is h bigger than 0? True Let r be -1(-4)/12-10. Is r <= -4? False Let u be (-23)/(-7) - (-4)/(-14). Suppose -ul = 5 - 14. Ar	{ "pile_set_name": "DM Mathematics" }
ate the lowest common multiple of 288 and 480. 1440 What is the least common multiple of 42 and 28? 84 What is the lowest common multiple of 84 and 14? 84 Calculate the common denominator of -79/64 and 79/1008. 4032 Calculate the smallest common multiple of 1131 and 58. 2262 What is the smallest common multiple of 690 and 2? 690 What is the common denominator of -49/23 and -67/106? 2438 Find the common denominator of -121/96 and 71/640. 1920 What is the lowest common multiple of 72 and 45? 360 What is the least common multiple of 1 and 27? 27 What is the common denominator of -51/220 and 181/150? 3300 Calculate the lowest common multiple of 108 and 456. 4104 What is the common denominator of -65/2154 and -8/33? 23694 What is the common denominator of -47/22 and -25/10506? 115566 Calculate the smallest common multiple of 11 and 262. 2882 Calculate the common denominator of -67/2 and 137/3810. 3810 Find the common denominator of 7/9 and 109/54. 54 Calculate the common denominator of 31 and -58/35. 35 Calculate the lowest common multiple of 50 and 20. 100 What is the lowest common multiple of 10 and 25? 50 What is the common denominator of 17/30 and -9/466? 6990 Calculate the smallest common multiple of 16 and 98. 784 Calculate the smallest common multiple of 21 and 189. 189 What is the least common multiple of 675 and 72? 5400 Calculate the lowest common multiple of 8322 and 24. 33288 What is the smallest common multiple of 920 and 15? 2760 What is the smallest common multiple of 1188 and 4752? 4752 Calculate the common denominator of -25/117 and -83/572. 5148 Calculate the smallest common multiple of 1186 and 8. 4744 Calculate the smallest common multiple of 9 and 97. 873 What is the common denominator of -51/35 and -23/10? 70 Calculate the lowest common multiple of 1060 and 8. 2120 Find the common denominator of -85/22 and 55/12832. 141152 Calculate the lowest common multiple of 234 and 8. 936 What is the lowest common multiple of 1650 and 990? 4950 Calculate the smallest common multiple of 69 and 24. 552 Calculate the least common multiple of 18 and 2394. 2394 Find the common denominator of -57/2 and -91/94. 94 What is the lowest common multiple of 507 and 30? 5070 Calculate the common denominator of -32/669 and 52/3. 669 Calculate the least common multiple of 423 and 188. 1692 Calculate the smallest common multiple of 201 and 402. 402 Find the common denominator of 79/20 and -45/2. 20 What is the lowest common multiple of 408 and 186? 12648 Find the common denominator of -33/56 and -75/272. 1904 Calculate the lowest common multiple of 91 and 5. 455 What is the lowest common multiple of 175 and 275? 1925 Calculate the common denominator of -37/3 and 14/9. 9 Calculate the common denominator of 85/22 and 17/286. 286 Calculate the lowest common multiple of 28 and 2892. 20244 Calculate the least common multiple of 54 and 24. 216 Find the common denominator of -28/11 and -26/149. 1639 Calculate the least common multiple of 114 and 152. 456 Find the common denominator of 133/60 and -29/80. 240 Calculate the common denominator of 13/16 and -101/1118. 8944 What is the smallest common multiple of 5 and 9033? 45165 Calculate the least common multiple of 108 and 4968. 4968 What is the lowest common multiple of 2542 and 124? 5084 Calculate the smallest common multiple of 140 and 56. 280 What is the least common multiple of 896 and 14? 896 Calculate the least common multiple of 200 and 100. 200 What is the common denominator of 33/50 and -53/402? 10050 Calculate the common denominator of 67/1884 and 11/18. 5652 Calculate the smallest common multiple of 12 and 5550. 11100 Calculate the common denominator of 77/152 and 73/266. 1064 What is the common denominator of -103/182 and 15/14? 182 Calculate the lowest common multiple of 40 and 12. 120 What is the lowest common multiple of 153 and 53? 8109 Calculate the least common multiple of 85 and 187. 935 What is the least common multiple of 510 and 150? 2550 Calculate the smallest common multiple of 88 and 692. 15224 Find the common denominator of 70/3 and 33/32. 96 What is the least common multiple of 55 and 165? 165 Find the common denominator of 95/812 and 25/12. 2436 Calculate the common denominator of -52/9 and 38/545. 4905 Calculate the lowest common multiple of 368 and 46. 368 What is the least common multiple of 6 and 9? 18 What is the common denominator of -63/58 and 53/7? 406 Find the common denominator of -1/64 and 69/10. 320 Calculate the least common multiple of 14 and 30. 210 Find the common denominator of 41/14 and -29/182. 182 What is the least common multiple of 2640 and 99? 7920 Find the common denominator of 149/36 and -35/1566. 3132 What is the smallest common multiple of 450 and 15? 450 Calculate the common denominator of 65/33 and 31/385. 1155 Calculate the common denominator of -99/196 and 5/224. 1568 Find the common denominator of 91/24 and 61/60. 120 What is the lowest common multiple of 32 and 176? 352 Calculate the common denominator of -59/36 and -23/24. 72 What is the smallest common multiple of 7738 and 5? 38690 What is the common denominator of -29/2 and -26/119? 238 Calculate the lowest common multiple of 7920 and 36. 7920 What is the least common multiple of 29 and 812? 812 Find the common denominator of -25/1702 and 101/4. 3404 Calculate the common denominator of -11/72 and -79/54. 216 What is the common denominator of -7/6 and -31/4135? 24810 Calculate the lowest common multiple of 648 and 88. 7128 What is the smallest common multiple of 3084 and 6? 3084 Calculate the least common multiple of 1798 and 580. 17980 Calculate the smallest common multiple of 1310 and 14. 9170 What is the least common multiple of 630 and 3150? 3150 What is the smallest common multiple of 1652 and 1062? 14868 Calculate the least common multiple of 504 and 1032. 21672 Find the common denominator of 107/72 and 13/2934. 11736 Calculate the least common multiple of 444 and 6. 444 Calculate the common denominator of -87/40 and 7/55. 440 Find the common denominator of 109/20 and -101/2. 20 Calculate the lowest common multiple of 8 and 110. 440 Find the common denominator of -91/148 and -59/8. 296 Calculate the common denominator of -57/4 and -11/236. 236 What is the smallest common multiple of 25 and 70? 350 Find the common denominator of 59/65 and 33/65. 65 Calculate the lowest common multiple of 24 and 42. 168 Calculate the lowest common multiple of 4186 and 4. 8372 Find the common denominator of 39/5 and 121/1730. 1730 What is the smallest common multiple of 20 and 160? 160 Find the common denominator of 92/12285 and -101/126. 24570 What is the common denominator of 71/153 and 7/54? 918 What is the least common multiple of 45 and 270? 270 Find the common denominator of -109/300 and 77/40. 600 Calculate the common denominator of -7 and 45/866. 866 What is the lowest common multiple of 9 and 29? 261 What is the lowest common multiple of 480 and 1440? 1440 Calculate the lowest common multiple of 32 and 44. 352 What is the lowest common multiple of 32 and 8? 32 Calculate the smallest common multiple of 6 and 6. 6 Calculate the smallest common multiple of 46 and 14. 322 Calculate the common denominator of 143/12 and -61/3504. 3504 Calculate the smallest common multiple of 65 and 13. 65 What is the common denominator of 59/16 and 73/566? 4528 What is the least common multiple of 198 and 828? 9108 What is the lowest common multiple of 105 and 231? 1155 Find the common denominator of -29/9 and 59/24. 72 What is the smallest common multiple of 70 and 98? 490 Calculate the smallest common multiple of 13 and 7. 91 Calculate the lowest common multiple of 460 and 980. 22540 What is the common denominator of -5/62 and 44/155? 310 What is the lowest common multiple of 148 and 44? 1628 What is the smallest common multiple of 76 and 171? 684 Calculate the common denominator of -53/343 and 15/686. 686 What is the lowest common multiple of 28 and 483? 1932 Calculate the common denominator of 31/104 and -79/176. 2288 What is the least common multiple of 64 and 160? 320 Calculate the common denominator of -1/72 and 39/262. 9432 Calculate the common denominator of -121/1644 and -139/4110. 8220 Calculate the common denom	{ "pile_set_name": "DM Mathematics" }
. What is s rounded to two decimal places? -0.1 Let z = -44.7 + 42. Let o = 1654040 + -1654042.699939. Let d = o - z. Round d to five decimal places. 0.00006 Let q(z) = 70000z2. Let m be q(-2). Round m to the nearest one hundred thousand. 300000 Let w be 0 - -2 - -1951. What is w rounded to the nearest ten? 200 Let y(v) = -179664v + 16. Let i be y(-6). What is i rounded to the nearest one hundred thousand? 1100000 Let t = -84 - -79.9. Let x = t - 0.1. Round x to zero decimal places. -4 Let o(y) = -1419y3 - y2. Let h(f) = f*3 + 6f*2 + 5f - 1. Let r be h(-5). Let d be o(r). Let l = 788 - d. Round l to the nearest 100. -600 Let x = 132.16 - -1024.04. Let h = 1156.2300064 - x. Let n = -0.03 + h. Round n to six decimal places. 0.000006 Let h = 1841676 - 1067435. Let o = h - 774241.10000025. Let p = o - -0.1. What is p rounded to 7 decimal places? -0.0000003 Let m(t) = -t - 2. Let p(u) = -u*2 - 3u + 5. Let y be p(-4). Let f = 4 - y. Let g be m(f). Round g to the nearest 10. -10 Let n = 0.1 + -0.26. Let m = -0.15999981 - n. What is m rounded to seven dps? 0.0000002 Let t = 2483573.7351572747 + -213701435.7351570947. Let z = t + 211217853. Let g = -9 - z. What is g rounded to 7 decimal places? -0.0000002 Let y = 227024.1326 + -226475.2. Let c = -549 + y. Let p = -0.06 - c. Round p to three decimal places. 0.007 Let u = 1.51 + -1.7. Let v = 3.25 + -3. Let a = v - u. What is a rounded to one dp? 0.4 Let v = -4.848 + 5. Round v to two dps. 0.15 Let o = -4.16 - -4. Let t = 5956.84065 + -5957. Let b = o - t. What is b rounded to four decimal places? -0.0007 Let z(c) = 2096c + 3. Let v be z(4). Let n be (5/10)/((-1)/(-62)). Let w be -7 + 4 - vn. What is w rounded to the nearest 100000? -300000 Let p(z) = -85713z + 9. Let x(u) = 11u - 1. Let g be x(-2). Let h = g - -16. Let n be p(h). Round n to the nearest 1000000. 1000000 Let s(d) = 176d - 123d + 197d. Let u be s(-6). What is u rounded to the nearest 1000? -2000 Let a = -3332731 - -1782731. Round a to the nearest 100000. -1600000 Suppose -2g - o + 446 = -1323, -2o = -2. Let p = g - 521. Suppose p = -5b + 118. Round b to the nearest 10. -50 Let r = 1273.68 - 1279.67956. Let s = r - -6. What is s rounded to four dps? 0.0004 Let s(l) = -155l + 6. Let r = 1 + 5. Let t be s(r). Let o = 3424 + t. What is o rounded to the nearest one thousand? 3000 Let f(c) = -2c*3 + 2c*2 + 5c + 3. Let z be f(4). Round z to the nearest 10. -70 Let d = 9.5 + 2.5. Let o = d - 12.000135. Round o to 5 decimal places. -0.00014 Let z(g) = -g*3 - 3g*2 + 2g + 4. Let j be -16/21. Let v be z(j). Let t be 1159999/(-2) - (-1)/v. What is t rounded to the nearest 100000? -600000 Let s(g) = 2g2 + 3g + 3. Let i be s(-2). Suppose -2k = -0t + 2t - 1844, 4k = it - 4592. What is t rounded to the nearest one hundred? 900 Let z = 128.0091 - 128. What is z rounded to 3 decimal places? 0.009 Let p = -793 - -793.649. Round p to one decimal place. 0.6 Suppose 80093 = 5l - 159937. Suppose 0 = -2u + 5s + 24015, -4u + s = -s - l. Round u to the nearest 10000. 10000 Let f = -110 + 114.9. Let t = f + -34.9. Let m = -30.0085 - t. Round m to 3 dps. -0.009 Let s = -93804 - -812804. Round s to the nearest 100000. 700000 Let j = 0.0329 + -0.039. What is j rounded to 3 decimal places? -0.006 Let s be (-500)/(-30)(-27)/6. Round s to the nearest 10. -80 Let t = -16532 - -16491.069. Let o = t + 41. What is o rounded to 2 dps? 0.07 Let d = -340 - -370.3. Round d to the nearest integer. 30 Let r = 81.99983 + -82. What is r rounded to 4 dps? -0.0002 Let j = 48.523098 - 203.569225. Let u = 166.04621 + j. Let w = 11 - u. What is w rounded to five decimal places? -0.00008 Let w = 10.3 - 10.3000899. Round w to 5 decimal places. -0.00009 Suppose i - b - 3 = 3, -3i + 2b + 16 = 0. Suppose ix + y + 4 = -3y, -4y + 6 = -x. Let v be -187002 - x/33. Round v to the nearest ten thousand. -190000 Suppose 3020 = -40g + 41g. What is g rounded to the nearest 100? 3000 Suppose -2l + 7l + 46499990 = -5k, 3k - 18600006 = 2l. What is l rounded to the nearest 1000000? -9000000 Suppose -3w - 1529980 = -5i, 2w - 1530012 = 5w + 3i. What is w rounded to the nearest one hundred thousand? -500000 Let y(q) = -472502q3 - q2 + q. Let n be y(-2). Suppose o + o = -s - 2519995, 3o = 2s - n. Round o to the nearest one hundred thousand. -1300000 Let c = 0.4 - 0.126. Let i = 38.874 - c. Let l = 34 - i. Round l to zero dps. -5 Let n = -6.6 - -6.641. Let b = n - 0.04099939. Round b to 7 decimal places. 0.0000006 Let h be 5/15 + 237818(-33)/(-18). Round h to the nearest 100000. 400000 Let a = 1096.9499 + -1097. Let r = -0.048 - a. Round r to 3 dps. 0.002 Let h = -155424774847 - -155424760563.8899986. Let l = h - -14283. Let v = -0.11 - l. What is v rounded to 6 decimal places? 0.000001 Let u = 323246.999996 + -323244. Let c = u - 3. What is c rounded to six decimal places? -0.000004 Let y = -0.03 + -1.97. Let o = y - -1.99936. What is o rounded to four dps? -0.0006 Let t = -5 - 0. Let f = 4.505 + 0.42. Let o = f + t. What is o rounded to 2 dps? -0.08 Let p = 74 + -74.00576. Round p to three dps. -0.006 Let q = -8.70211668 + 0.80212528. Let b = -199.9 + 192. Let g = q - b. Round g to six decimal places. 0.000009 Let m = -7.2 + 7.199988. What is m rounded to six decimal places? -0.000012 Let d = -5.0012 + 5. Round d to three dps. -0.001 Suppose -2u - 13 = 41. Round u to the nearest 10. -30 Let o(i) = -22030i*3 + 3i*2 - 8i. Let a be o(-4). Round a to the nearest one hundred thousand. 1400000 Suppose -5r + 4r = -123008. Suppose 4z = t - r, 2 = -4z + 3z. Round t to the nearest ten thousand. 120000 Let s = 0.05 - 0.03. Let j = s + 11.08. Let h = j - 11.147. What is h rounded to two dps? -0.05 Suppose 3n = -3n + 1224. What is n rounded to the nearest 10? 200 Let r = -2637 - -2635.079. Let d = r + 2.03. What is d rounded to two dps? 0.11 Let o = 76.8 + -6.8. Let v = 9091191.999933 + -9091122. Let d = v - o. What is d rounded to five decimal places? -0.00007 Let v = -98 + 98.039. Let j = 0.027 + v. What is j rounded to two dps? 0.07 Let s = 46.4 + -3.4. Let p = 550518.599926 - 550561.6. Let a = s + p. Round a to 5 dps. -0.00007 Let n = -14216 - -14214.3346. Let c = n + 1.5893922. Let i = c - -0.076. Round i to six decimal places. -0.000008 Let b be (-3)/(-4) - 806399982/(-24). What is b rounded to the nearest one million? 34000000 Suppose y = 5b + 19, -3y + 4y = -4b - 8. Let v be 69 + -10 + y + -1. Round v to the nearest 10. 60 Let m = -10.00000051 + 10. Round m to seven dps. -0.0000005 Let x = -0.06 + 0.05966. Round x to 4 decimal places. -0.0003 Let f = 28 - 28.0000004. Round f to six decimal places. 0 Let i(f) = f3 - 11f*2 + 2f - 11. Let n be i(11). Suppose -nk = -7k. Round k to the nearest ten. 0 Let z = -0.042 - -0.042037. What is z rounded to 5 decimal places? 0.00004 Let f(s) = s3 - s2 - 3s - 5. Let z be f(-4). What is z rounded to the nearest 10? -70 Suppose -6g = -0g - 5160000. What is g rounded to the nearest one hundred thousand? 900000 Let m(c) be the second derivative of 7c*4/12 + 2c*3/3 - 2c*2 + 3c. Let i be m(-5). What is i rounded to the nearest 10? 150 Let i = 0.14 + -0.14000094. Round i to seven dps. -0.0000009 Let u be 8/36 - 42120004/18. Round u to the nearest one hundred thousand. -2300000 Suppose 0 = -5u - 1106 + 301. Let m be u/(-21)(-6)/2. What is m rounded to the nearest 10? -20 Let p = -212.0535 + 0.8315. Let y = 211 + p. Round y to two dps. -0.22 Let r be (-2 - 13)/((-1)/2). Suppose h - 5i + 3i = 10, 0 = 5h - 5i - r. Suppose -m = -hm + 20000. What is m rounded to the nearest one hundred thousand? 0 Let t = 1.69966 + -1.7. What is t rounded to four dps? -0.0003 Let t = 97 + -103.9. Let y = 297.82243842 + -304.722439. Let z = y - t. Round z to 7 dps. -0.0000006 Suppose 0 = 2c - 7 - 1. Suppose -5j = -cj + 48. Round j to the nearest 10. -50 Suppose -4r + 2775926 = 5c - 5024049, 3r + 5c = 5849975. Round r to the nearest one hundred thousand. 2000000 Let b be 16000/(2 + 11296/(-5650)). Round b to the nearest 1000000. 23000000 Let k = -5 - -5. Let a(x) = x*2 + 93000. Let j be a(k). What is j rounded to the nearest 10000? 90000 Suppose -2r - 1 + 11 = 0. Let x be (-1 -	{ "pile_set_name": "DM Mathematics" }
arest 10. -280 What is -0.000016224 rounded to six dps? -0.000016 What is 771.51 rounded to the nearest 10? 770 What is -0.21269 rounded to two decimal places? -0.21 What is 3517.6 rounded to the nearest 1000? 4000 Round 41300 to the nearest 1000. 41000 What is -0.002809 rounded to 4 decimal places? -0.0028 Round -0.4487 to 1 dp. -0.4 What is -383700 rounded to the nearest 10000? -380000 Round 156690000 to the nearest 1000000. 157000000 Round 176.9 to the nearest integer. 177 Round 0.04151 to two dps. 0.04 Round 60800 to the nearest ten thousand. 60000 Round 421 to the nearest 10. 420 What is 9.745 rounded to zero dps? 10 What is 389.5 rounded to the nearest ten? 390 Round -1209000 to the nearest one hundred thousand. -1200000 What is -0.0000176 rounded to five decimal places? -0.00002 What is 0.11738 rounded to two decimal places? 0.12 What is -3131 rounded to the nearest one hundred? -3100 What is 0.0005333 rounded to five decimal places? 0.00053 What is 38.44 rounded to the nearest integer? 38 What is 142120 rounded to the nearest 1000? 142000 What is 0.0006002 rounded to 5 decimal places? 0.0006 Round -5.515 to zero dps. -6 Round -1.3733 to 1 decimal place. -1.4 Round 491670 to the nearest 1000. 492000 Round 224170 to the nearest one hundred thousand. 200000 Round -0.009489 to 4 decimal places. -0.0095 Round -1.6607 to 1 decimal place. -1.7 Round 37357 to the nearest 1000. 37000 What is 0.00016 rounded to five decimal places? 0.00016 What is 0.0000366 rounded to five decimal places? 0.00004 What is 0.00006065 rounded to five dps? 0.00006 Round -0.0000110487 to 7 decimal places. -0.000011 Round -1525 to the nearest ten. -1530 What is -1580000 rounded to the nearest 100000? -1600000 What is 12.625 rounded to the nearest ten? 10 Round 86118 to the nearest 1000. 86000 What is 3.54 rounded to 1 dp? 3.5 Round 0.000017742 to 6 dps. 0.000018 What is 2043200 rounded to the nearest 10000? 2040000 Round -13.53 to 1 dp. -13.5 Round -2.17974 to 1 dp. -2.2 What is 459000 rounded to the nearest ten thousand? 460000 What is 26490 rounded to the nearest 1000? 26000 Round 13.337 to the nearest integer. 13 What is 0.0000842 rounded to six decimal places? 0.000084 What is -0.0000914 rounded to six decimal places? -0.000091 Round -855570 to the nearest 1000. -856000 Round -0.0000000842 to 6 dps. 0 Round -0.05589 to 3 decimal places. -0.056 What is -0.0002032 rounded to five dps? -0.0002 What is -3576300 rounded to the nearest 1000000? -4000000 Round -0.000597 to 4 decimal places. -0.0006 What is 0.003122 rounded to 3 decimal places? 0.003 What is 1.17332 rounded to 2 decimal places? 1.17 What is 0.000001016 rounded to seven decimal places? 0.000001 Round -701800 to the nearest one hundred thousand. -700000 Round 0.0000003 to 6 dps. 0 What is 0.00048624 rounded to 6 decimal places? 0.000486 What is -47.519 rounded to the nearest 10? -50 Round 0.000044 to three dps. 0 What is -0.0113503 rounded to four decimal places? -0.0114 Round 0.00917 to 3 decimal places. 0.009 What is -0.241069 rounded to 3 dps? -0.241 Round 0.00023468 to 5 dps. 0.00023 Round 4207000 to the nearest one million. 4000000 Round -294200 to the nearest 100000. -300000 Round 0.041975 to 2 decimal places. 0.04 Round -115100 to the nearest ten thousand. -120000 What is 2.8 rounded to the nearest ten? 0 What is -0.8047 rounded to two dps? -0.8 What is 210839000 rounded to the nearest one million? 211000000 Round 0.01849 to 4 dps. 0.0185 Round -18120000 to the nearest 100000. -18100000 Round 843630 to the nearest 100000. 800000 Round 0.0000030813 to seven dps. 0.0000031 Round 0.00079831 to six decimal places. 0.000798 Round 0.6408 to 1 dp. 0.6 Round 675400 to the nearest 10000. 680000 What is 81.05 rounded to the nearest ten? 80 Round 0.0000010646 to 7 dps. 0.0000011 Round 186.4 to the nearest ten. 190 What is 0.352 rounded to 1 decimal place? 0.4 Round 0.0000021033 to seven dps. 0.0000021 What is -41.484 rounded to the nearest ten? -40 Round -3482.9 to the nearest one hundred. -3500 What is -0.0019654 rounded to 4 dps? -0.002 Round 30.88 to the nearest 10. 30 What is -0.000020869 rounded to seven dps? -0.0000209 Round 6075400 to the nearest ten thousand. 6080000 Round -0.0005242 to 4 dps. -0.0005 What is 0.0000009769 rounded to seven decimal places? 0.000001 Round 0.000022993 to 7 dps. 0.000023 Round -0.168 to two decimal places. -0.17 Round -0.5268 to two dps. -0.53 What is -1.1151 rounded to one decimal place? -1.1 Round -17.791 to the nearest integer. -18 What is -3.3697 rounded to 0 decimal places? -3 What is 0.00055812 rounded to 6 decimal places? 0.000558 Round 2.491 to 1 dp. 2.5 What is 1596.66 rounded to the nearest 100? 1600 What is -902.68 rounded to the nearest 10? -900 What is -9.3791 rounded to the nearest integer? -9 Round 33866 to the nearest one hundred. 33900 What is -0.58758 rounded to one dp? -0.6 Round -57534.3 to the nearest ten thousand. -60000 Round -4.286 to 0 decimal places. -4 What is -5.9869 rounded to 2 decimal places? -5.99 Round -157.469 to the nearest 10. -160 What is -0.00001424 rounded to six dps? -0.000014 Round -0.016683 to four decimal places. -0.0167 Round -70.39 to the nearest integer. -70 What is -1083.18 rounded to the nearest one hundred? -1100 Round 2.31631 to 1 decimal place. 2.3 Round -4203000 to the nearest 100000. -4200000 What is -82.766 rounded to zero decimal places? -83 What is 2770 rounded to the nearest 100? 2800 What is -118361000 rounded to the nearest 100000? -118400000 Round -0.053738 to 2 dps. -0.05 Round -57170 to the nearest ten thousand. -60000 Round 0.00533 to three dps. 0.005 Round 0.00009978 to 4 dps. 0.0001 Round 0.00000751 to 7 dps. 0.0000075 Round 3360 to the nearest 1000. 3000 Round -0.0001151 to five dps. -0.00012 What is 0.00001262 rounded to six decimal places? 0.000013 What is 3270 rounded to the nearest ten? 3270 What is 0.007422 rounded to 4 dps? 0.0074 What is -26.662 rounded to the nearest integer? -27 What is 17.99 rounded to the nearest integer? 18 Round 0.0038257 to 3 decimal places. 0.004 What is -29577 rounded to the nearest 100? -29600 Round 0.12084 to 3 dps. 0.121 Round -0.083 to 1 decimal place. -0.1 What is 3510000 rounded to the nearest 1000000? 4000000 What is -0.025394 rounded to four decimal places? -0.0254 What is -25.999 rounded to the nearest 10? -30 Round -143.8 to the nearest integer. -144 What is 0.0000119479 rounded to seven decimal places? 0.0000119 What is 149.7 rounded to 0 dps? 150 Round 16095 to the nearest 1000. 16000 Round 0.0000021566 to 7 decimal places. 0.0000022 What is 0.0001072 rounded to six decimal places? 0.000107 What is -296.8 rounded to the nearest one hundred? -300 Round -0.394 to one decimal place. -0.4 Round -0.0002264 to four dps. -0.0002 What is 0.00120634 rounded to 4 decimal places? 0.0012 Round -1.202 to the nearest 10. 0 Round 4474 to the nearest one hundred. 4500 What is -0.000131009 rounded to 7 dps? -0.000131 What is -5285.9 rounded to the nearest 10? -5290 Round 7.0389 to zero dps. 7 What is -6.56 rounded to zero decimal places? -7 Round 0.001374 to four decimal places. 0.0014 Round 585930 to the nearest one thousand. 586000 Round 135100 to the nearest 10000. 140000 Round 0.005788 to 4 dps. 0.0058 Round -0.003026 to four dps. -0.003 What is 0.00000126569 rounded to seven dps? 0.0000013 What is 84015 rounded to the nearest 10000? 80000 Round -118 to the nearest one hundred. -100 Round -0.00003339 to 6 dps. -0.000033 What is -10157800 rounded to the nearest one hundred thousand? -10200000 What is -4.7039 rounded to 1 dp? -4.7 What is 4442 rounded to the nearest one hundred? 4400 Round -0.000099596 to six decimal places. -0.0001 Round -193.84 to the nearest ten. -190 What is 0.00011032 rounded to six dps? 0.00011 Round -1577.7 to the nearest one thousand. -2000 Round -2002900 to the nearest one million. -2000000 Round -0.0000094706 to six dps. -0.000009 Round 654.51 to the nearest 100. 700 Round -0.001284 to 5 dps. -0.00128 What is 20593000 rounded to the nearest 1000000? 21000000 Round -5.0159 to the nearest integer. -5 What is 257.3 rounded to the nearest ten? 260 Round 0.000073481 to six decimal places. 0.000073 What is -0.0000545 rounded to five decimal places? -0.000	{ "pile_set_name": "DM Mathematics" }
+ 22 = -5a, 0 = -4a + 2a + 4t - 20. Let c be a/5 - (252/40)/(-7). Sort -1/2, -1, -3, c in descending order. c, -1/2, -1, -3 Suppose 0 = -4u - 3b - 9, b + 2 + 1 = -5u. Let q be (4 - u)(-63)/84. Sort 5, q, 3, 4 in decreasing order. 5, 4, 3, q Let r = -19 - -22. Let y be (r + 3)(-10)/15. Sort 0, -3, y, 1. y, -3, 0, 1 Let j(r) = -r2 - 14r + 16. Let p be j(-17). Let v = p - -38. Sort -3, 4, v in descending order. 4, v, -3 Let b be 43/30 + 14/(-10). Let c be b - ((-2)/(-3))/((-10)/30). Put 2, 5, c, 0 in descending order. 5, 2, c, 0 Let n = 0.8 + -5.8. Let r = n - 6. Let s = -12 - r. Put 2/5, 0.1, s in ascending order. s, 0.1, 2/5 Suppose 13 + 1 = 14y. Let i be -15/y - -4. Put 4, i, 2, 0 in ascending order. i, 0, 2, 4 Let d = -10.948 + -0.052. Let j = -14 - d. Sort j, -10, 4. -10, j, 4 Let g = -359.514 + 359. Let d = -0.114 - g. Let b be 0/(-1) - 2/8. Sort -3, d, b in increasing order. -3, b, d Let t = -8 + 5. Let b be ((-2)/4)/((-5)/30). Let g be (-4)/8b/(3/4). Sort t, -6, g. -6, t, g Let i = 11 - 6. Suppose -14g - 3 = -19g + f, 13 = 3g + 5f. Put i, -4, g in ascending order. -4, g, i Let w be (-4)/(-10) + (-14)/10. Suppose q + 0q = 2b - 14, -9 = -b + q. Suppose -2y + 12j - 8j = 0, 5j = 5y - 10. Put y, b, w in increasing order. w, y, b Let v = 164 + -167. Sort v, -2, -4, 5 in increasing order. -4, v, -2, 5 Let x = -302 + 312. Put -0.2, 2/3, x in descending order. x, 2/3, -0.2 Suppose k - 5 + 1 = 0. Suppose 6t - 2u + 4 = 4t, -kt = 5u - 19. Let f be ((-5)/4)/(t/(-4)). Put f, -5, 15 in descending order. 15, f, -5 Let t be 8465/49335 - 2/6. Let h = t + 2/253. Sort h, -0.1, -5 in ascending order. -5, h, -0.1 Let z = -83.3 - -79. Let v = z + 3.3. Put 16, v, 3/2 in ascending order. v, 3/2, 16 Let n = -16/9 + 155/72. Sort 0.8, n, -4, 1/2 in decreasing order. 0.8, 1/2, n, -4 Suppose 7l - 3l - 12 = 0. Suppose 2v = 4v + 72. Let u = v + 48. Put 4, l, u in increasing order. l, 4, u Let d(j) = 10j2 - 88j - 15. Let t be d(9). Sort -10, 3/4, t, -3 in ascending order. -10, -3, 3/4, t Let n = 1.2 + -1.2. Let r = -9131/70 - -793/14. Let o = r - -74. Sort n, o, 5 in increasing order. n, o, 5 Let h = 129 - 86. Let k = h - 43.2. Let m = -0.6 + -2.4. Put k, -5, m in descending order. k, m, -5 Let q be (1 - (2 - -1))(-2)/(-4). Put 33, q, -4, 0 in decreasing order. 33, 0, q, -4 Let k(b) = -b2 - 6b. Suppose -5j + 4v = 26 - 1, 3v + 25 = -5j. Let t be k(j). Let p be t/3 + 2/(-3). Put p, 0, -5 in increasing order. -5, 0, p Let k = 13 + -12.8. Let r = 54 - 58. Sort k, r, 2/11 in decreasing order. k, 2/11, r Let u be (0 + 4/4)-22. Let y = u - -20. Let c = -0.1 - -4.1. Put y, c, 0.2 in increasing order. y, 0.2, c Let q = -248.94 + 244. Let o = q - 0.06. Let r = -21/43 + -1/86. Sort o, r, -1/4. o, r, -1/4 Let y = 256 - 250. Put 7, 2/7, y in descending order. 7, y, 2/7 Let a(q) = q2 - q - 3. Let v be a(-3). Let g = -17 + v. Let m be (-8)/(-9)(-4)/g. Sort 2, m, 0 in increasing order. 0, m, 2 Let b be (676/(-91) - -7) + (-1773)/(-21). Put 1/3, -2/19, b in decreasing order. b, 1/3, -2/19 Let h(f) = -f*2 + 77f + 5. Let g be h(77). Let i = 3 + -2. Sort -3, g, i. -3, i, g Let k = -921 - -921.1. Put 0.02, 0.3, k in decreasing order. 0.3, k, 0.02 Let q(s) = 45s + 450. Let r be q(-8). Put 3, -1, r, -2 in descending order. r, 3, -1, -2 Suppose -4f + 4u = f - 32, 0 = 3f - 5u - 14. Suppose -p + 5 = f. Let k = 8.83 - -0.17. Sort k, p, -5 in descending order. k, p, -5 Let y(k) = 3k - 3. Let s be y(3). Let p = s + 12. Let l = p + -20. Put l, -3, 3 in decreasing order. 3, l, -3 Let k = -4119 - -4114. Let v = -1 - -1. Put k, v, -38 in increasing order. -38, k, v Suppose -3h = -2v + 71, 5h - 5 = -0. Put -2, 5, -5, v in increasing order. -5, -2, 5, v Let l be 1/(-2)(-9 + 15). Let k(i) = 4i - 6. Let x be k(4). Let a be 8/20 + 46/x. Put l, a, -5 in ascending order. -5, l, a Let m = -24.1 - -24.2. Let o be 38/7 - 3/7. Sort m, -22, -0.5, o in descending order. o, m, -0.5, -22 Let z = -28 + 41. Let i = -11 + z. Sort -4, 0.3, i in decreasing order. i, 0.3, -4 Let k = 5 + -2. Suppose -ka - a + 26 = -2v, -4v - 12 = 2a. Suppose d + 0d = 0. Put v, 3, d in ascending order. v, d, 3 Suppose 0 = 4d - 12, 0 = 4l - 6d + 2d + 12. Suppose -3h + 12 = 0, l = -5w - 3h + 10 - 68. Sort w, 2/3, -4 in ascending order. w, -4, 2/3 Suppose 15 = 140f - 141f + 5d, 4d = f + 13. Let h = 0 - -2. Sort f, -6, h in decreasing order. h, f, -6 Let a = -2713 - -2711. Put a, -70, 3, -3 in decreasing order. 3, a, -3, -70 Let f be 12/4(-97 - 1). Put -2/3, f, 0.5 in decreasing order. 0.5, -2/3, f Let r = -1.703 - -1.303. Sort 0.1, 1, 0.8, r in decreasing order. 1, 0.8, 0.1, r Let j = 441 - 442.5. Put 2/7, 1, j, 3 in increasing order. j, 2/7, 1, 3 Suppose -38i + 5 = -43i. Suppose -3c = -12, -4l + 2c + 22 + 42 = 0. Let y be (-12)/16 - l/8. Put i, -2, y in ascending order. y, -2, i Let f(h) = -h*3 + 8h*2 - 16h - 3. Let q be f(6). Sort -4, 0, q, -5 in increasing order. q, -5, -4, 0 Let t = -27 - -41. Suppose -t = -7i - 0i. Let d = 1 + -1.2. Sort d, -4, i in descending order. i, d, -4 Let p(z) = 9z2 - 3z - 1. Let v be p(-1). Suppose 0 = -vm + 14m + 12. Sort m, 10, -1 in ascending order. m, -1, 10 Let q = 38 - 39.7. Let b = 2.2 + q. Let y = -0.4 + b. Put 0.3, 2, y in descending order. 2, 0.3, y Suppose -y + 1 = -4. Let g be (-2 - (-5)/2)(4 - -8). Let v be (6 + (-33)/g)(3 - 1). Sort y, 3, v in decreasing order. y, 3, v Let w(z) = 2z - 1. Let q(v) = -v. Let u(s) = -5q(s) - 2w(s). Let c be u(-4). Let o be -5(c/1 + 1). Sort -2, -3, o. -3, -2, o Let x = 2125 - 2122. Let a = -0.01 + 2.01. Sort a, x, -2/5 in descending order. x, a, -2/5 Let s be (-74)/120 - 15/(-20). Let m = -11 - -12. Let y = m + -3. Sort s, y, 0.5 in ascending order. y, s, 0.5 Let o = -2/227 + 512/6583. Let x = -52/87 - o. Let w = 1.1 - -2.9. Sort 2/17, w, x in descending order. w, 2/17, x Let i(p) = 18p - 12. Let t be i(-6). Let r be 165/t - (-6)/16. Let g be -17/(-5) - 1. Put g, r, -2 in increasing order. -2, r, g Let d be 12 - (-40)/(8 - 12). Put 0, d, -2, 1/4 in increasing order. -2, 0, 1/4, d Suppose -56g = 4g + 240. Sort -8, g, 4, 12 in decreasing order. 12, 4, g, -8 Suppose 22 = r + 4r + 3b, 20 = 4r + 3b. Suppose -18 = 4g + rf, -2g + 3f = -3g - 17. Let c be ((-1)/(2/(-2)))/1. Put -4, g, c in decreasing order. c, g, -4 Suppose 0 = 4i - 3b - 121, -2b = -5i + 8i - 112. Suppose 10 - i = -3l. Sort 1, l, -3 in decreasing order. l, 1, -3 Let t = -29 + 29. Let a = -5 - t. Suppose 2g = -g - 12. Sort 5, g, a in increasing order. a, g, 5 Let d = 2.42 - 1.92. Sort 0.01, 5, d. 0.01, d, 5 Let x be 3 - ((7 + -2)-1)/(-1). Put -6, -0.5, x, 1/5 in descending order. 1/5, -0.5, x, -6 Let u = 119 + -31. Let d = -85 + u. Sort -0.2, d, -0.5, -0.1 in decreasing order. d, -0.1, -0.2, -0.5 Let t = -236 + 9459/40. Let l = 3/40 - t. Let q = -0.9 - -1. Sort l, -1, q. -1, l, q Let y be 1 + 9/90-4. Let q = -0.7 + 4.7. Let t be (-5 + 1)/(-2) + 0. Put q, y, t in ascending order. y, t, q Suppose 120 = 10u - 8u. Suppose 11v + u = v. Sort v, -1, -3, 0 in ascending order. v, -3, -1, 0 Let a = -58 - -58. Let d = 9.5 + -10. Sort d, a, 1, -6 in decreasing order. 1, a, d, -6 Let v be (4/2)/(1 + 0). Suppose -4w + 12w + 8 = 0. Sort w, 4, v in decreasing order. 4, v, w Let i = -126.1 - -8.1. Let n = i + 125. Sort -2, n, 3/2 in ascending order. -2, 3/2, n Let j(x) = -x3 - 6x*2 + 6x - 1. Let p be j(-7). Let m(i) = -i*2 - 354 + 3i - 7i + 370. Let t be m(3). Put 2, t, p in ascending order. t, 2, p Suppose 38 = -2n + 110. Sort -3, -2, n. -3, -2, n Suppose 2h + 13 = p - 0h, 2p + 4h = -14. Let x(i) = 196i - 779. Let w be x(4). Sort w, p, -3 in decreasing order. w, p, -3 Suppose 19r = 25r - 318. Let m = -51 + r. Suppose -5y = -0y. Sort -3, y, m in decreasing order. m, y, -3 Suppose 4t - 3t = 3. Suppose -tg - 3o = 2o - 13, 15 = -5g - o. Suppose z = -25 + 26. Put z, -3, g in decreasing order. z, -3, g Suppose 5g + 0 - 65 = 0. Let y = g - 11. Sort 5, -4, y in decreasing order. 5, y, -4 Suppose 334f - 351f + 85 = 0. Sort 4/5, 2/103, f, 0.4 in descending order. f, 4/5, 0.4, 2/103 Let j = -109.9 - -109.6. Sort 2/3, 16, j, 2/5 in descending order. 16, 2/3, 2/5, j Let x = 2 - -	{ "pile_set_name": "DM Mathematics" }
2? 240l*2 + 1020384l Find the second derivative of -32n3 + 2n*2v - 488n2 + 3nv - 8766n - 3v wrt n. -192n + 4v - 976 What is the first derivative of -8974k*3yz - 7k*3z - k*2yz + 2k*2z + 432k2 - 6yz - 3 wrt y? -8974k*3z - k*2z - 6z What is the derivative of 709c*3f*3k + 2c3f*3 - 143cf3k - 8234f3 wrt k? 709c*3f*3 - 143cf3 Find the second derivative of 25287r*2 + 2r + 8142 wrt r. 50574 What is the third derivative of 2p3tz3 - 2p*3t - 241380p3z*3 - 2446369p*3z*2 wrt z? 12p*3t - 1448280p3 Find the third derivative of -81341h*3z*3 - 6h*3z + 13h3 + 60h*2z*2 - 5hz3 - 3z*2 wrt z. -488046h*3 - 30h Differentiate 13707kl*2u*2 - 14ku3 - 330961l*2u*3 with respect to k. 13707l*2u*2 - 14u*3 What is the third derivative of 2v*5 - 175v*4 + 69v*3 + 96897v*2? 120v*2 - 4200v + 414 What is the derivative of -buy*2 + 49bu + 9by2 + 5by + b + 10uy - 8u - 29y2 - 3 wrt u? -by*2 + 49b + 10y - 8 What is the first derivative of -1241c*3 - 60c - 809259? -3723c2 - 60 What is the first derivative of -2c*2l*3 - 17804c*2 - 260l*3 - 119l wrt c? -4cl*3 - 35608c Find the second derivative of -164649p3x*2 - 3p*3x + 4463p3 + 2px2 + 2px wrt x. -329298p*3 + 4p Find the first derivative of 2610q3 - 5q*2 - 2q - 109824. 7830q2 - 10q - 2 Find the first derivative of 2fiq - 1929fq - 96f - 2iq - 56i + 4q wrt q. 2fi - 1929f - 2i + 4 Find the second derivative of -158764s2 - 187228s + 3 wrt s. -317528 Differentiate w*4 + 801956w - 1275322 wrt w. 4w3 + 801956 What is the second derivative of 956751p*5 + 2p - 9630? 19135020p3 Differentiate -947430dr + d + 112481 wrt r. -947430d Find the third derivative of 2928c5 - 3c*4 + 13c*3 - 90441c*2 - c. 175680c*2 - 72c + 78 What is the third derivative of 182b3f*4 - 7b*3f*3 + 27b*3f*2j - 6b3f*2 + 4b*3fj2 + 2b*3 + bj2 - f3j2 wrt f? 4368b*3f - 42b3 - 6j*2 What is the second derivative of 325143y*3 + 46y + 922? 1950858y Find the third derivative of 34b*6 + 153b*5g + 5b2g - 7b - 62 wrt b. 4080b*3 + 9180b*2g Find the first derivative of 2f4 - 6271f*2 + 4f - 318614 wrt f. 8f3 - 12542f + 4 What is the third derivative of 1837ko*5 + 9ko2 + 52o*5 + 3o*2 + o + 975 wrt o? 110220ko2 + 3120o*2 What is the third derivative of 306742j*3m*3 + 2j*2 - 34jm3 - 44m wrt j? 1840452m3 Differentiate 2n*4 - 6n*3 + 1910n*2 + n + 81099. 8n*3 - 18n*2 + 3820n + 1 What is the derivative of -14c3n + 78526c3 + 4n*4 + 6n*2 wrt n? -14c*3 + 16n*3 + 12n Differentiate 2js - 130792j + 89144s with respect to j. 2s - 130792 Find the third derivative of 71094d*3 - 2d*2 + 6347. 426564 What is the third derivative of -7n*3y*3 - 16n*3y + 10n3 + 3n*2y*3 - 42094ny3 wrt n? -42y*3 - 96y + 60 What is the first derivative of -2474b2 - 226bj - 2884j - 495 wrt b? -4948b - 226j Differentiate 70754d2 - 2d - 457810. 141508d - 2 Find the first derivative of -243f*3 + 16f*2 + f - 2070. -729f*2 + 32f + 1 Find the third derivative of -19452h6r + 7h4r + 2h2r + 13h2 + 10h - 2r + 939 wrt h. -2334240h*3r + 168hr Find the third derivative of -78356j3p*4 - 2j*3p*2 + 3j*3 - 5j*2p + jp2 + 6p*5 + 402p*2 wrt p. -1880544j*3p + 360p2 What is the second derivative of w4 + w3 - 1736w*2 + 20950w wrt w? 12w2 + 6w - 3472 What is the derivative of -19094u + 6401? -19094 What is the third derivative of 9743h*2v6 - h2v2 - 367h*2 + 2hv6 - 7 wrt v? 1169160h*2v*3 + 240hv3 What is the third derivative of -15298w*5 + 9007w*2 + 2? -917880w*2 Find the third derivative of 12145a*4 + 76165a*2. 291480a Differentiate -510839bo + 161b - 4207 wrt o. -510839b Find the third derivative of 4919g6t + 10g5t - 2g2 + 65gt + 5g - 2 wrt g. 590280g3t + 600g2t Find the first derivative of -c*3fk - 90c*3 + 10765cfk - 1358f wrt k. -c3f + 10765cf What is the second derivative of -2389251pz*2 + 37p + 5z + 358 wrt z? -4778502p Find the second derivative of -230799k2v*2 + 8k*2 + 18kv - 124v wrt v. -461598k2 Differentiate 25b*2kn + 326b*2n*2 + 43b*2n - 288bkn2 + n wrt k. 25b*2n - 288bn*2 Find the first derivative of -df*2 + 46df - 149d + 136f2 - 86f + 2 wrt d. -f*2 + 46f - 149 What is the third derivative of -1902u6 - 9u4 + u3 + 209u2 - 9u + 24? -228240u3 - 216u + 6 What is the first derivative of -3c2d*2 - 793c*2 - 6cd - 794722d*2 + 2d wrt c? -6cd*2 - 1586c - 6d What is the second derivative of -k5 + 23398k*4 - 2k - 5066? -20k3 + 280776k*2 What is the second derivative of 120170co2 - 20co - 41c wrt o? 240340c What is the derivative of 48869w - 160044? 48869 Find the second derivative of 190748w3 - 206494w. 1144488w Differentiate 80b*2jm + b2m - 4165b2 - 7bjm + 4j - 2m wrt j. 80b2m - 7bm + 4 Find the second derivative of 109055n3 + 847392n. 654330n Differentiate -123my2 + 7my + 31584m + 5y2 + 2y with respect to y. -246my + 7m + 10y + 2 What is the first derivative of 2jo*3 - 850jo2 - 238j + 4o3 - 4 wrt o? 6jo2 - 1700jo + 12o*2 What is the third derivative of -71986b*3i*3 - 2b*3i*2 + 434b*3i + 2b3 + 4b*2i wrt i? -431916b3 What is the second derivative of 65q*5 + 9q3 - q2 - 6q - 3147? 1300q*3 + 54q - 2 What is the third derivative of -135288s6 - 17s*2 + 2620s? -16234560s3 What is the first derivative of 4w*3 + 6965w*2 + 14w - 1450146 wrt w? 12w2 + 13930w + 14 Find the second derivative of n*3v - 12005n3 + n2v + 713900nv + 2n - 2 wrt n. 6nv - 72030n + 2v What is the derivative of 20a*2i - 2a2 + 3ai + 4a + 369 wrt i? 20a2 + 3a Find the second derivative of 22jk*2n + 2jkn3 - 3jkn - 26k3 + 8k*2n3 + k + n3 - 80n2 wrt k. 44jn - 156k + 16n3 Find the third derivative of -h5n - 2416h5 + 3h*2n - 63133n wrt h. -60h*2n - 144960h2 Differentiate -277514w + 303352 with respect to w. -277514 What is the derivative of -3505021a2 - 2403500 wrt a? -7010042a Differentiate 6606d2 - 31475 with respect to d. 13212d Find the third derivative of -265ik*4 - 2ik2 - 14k*4 + 7k*3 + 51527k*2 wrt k. -6360ik - 336k + 42 What is the second derivative of -2y4 + 8503y*2 + 46724y wrt y? -24y2 + 17006 Differentiate 595dr2 + 208832r*2 wrt d. 595r*2 What is the third derivative of -43597x*5 - 54576x*2 wrt x? -2615820x*2 What is the first derivative of -2046k*2 - 2k - 86204? -4092k - 2 Differentiate -91965d*2u + 2d2 - 28u + 813 wrt d. -183930du + 4d Differentiate 594m*3 + 3m*2 + 2m - 65694. 1782m2 + 6m + 2 What is the third derivative of -37f4 + 27f*3 + 5735f*2 - 5? -888f + 162 What is the third derivative of 6v4y + 2100v4 + 4v*3 + 3v*2 - 2vy - v - 13y + 1116 wrt v? 144vy + 50400v + 24 What is the third derivative of 33253g*6 - 3258g*2 + 9 wrt g? 3990360g*3 Find the second derivative of -3r*2v*2 + 864r*2 + 88rv2 - 7r - 663v2 - 2v + 64 wrt v. -6r2 + 176r - 1326 Find the third derivative of -11q3v + 763q3 - 383q*2v - 5q2 + 19v wrt q. -66v + 4578 What is the third derivative of -1505174f*3 - 1765552f*2? -9031044 What is the second derivative of -302616o*3 + 10o + 1137? -1815696o Find the second derivative of -5i*2x*2 + 41i*2x + 561i2 - 20468ix - 2x*2 + 3 wrt i. -10x*2 + 82x + 1122 Find the second derivative of 114315a3 + 53356a wrt a. 685890a Differentiate -29983w*2 - 91153. -59966w What is the derivative of -1010k3n*2o + 116k3n*2 + 570k*3no + 426k*3n + 7k3 wrt o? -1010k*3n*2 + 570k*3n What is the second derivative of 3k3n - 892k3 + 11k*2n*3 - kn*3 + 53702kn wrt k? 18kn - 5352k + 22n3 Find the second derivative of 18bl3 + bl -	{ "pile_set_name": "DM Mathematics" }
biggest value? (a) 198 (b) 2.12 (c) -143 c What is the fourth smallest value in -0.3, 1, -78, 2, 0.6, -13? 0.6 Which is the third biggest value? (a) -4/13 (b) -4 (c) -39/643 b Which is the second smallest value? (a) 2/11 (b) 1479 (c) 2/323 a What is the fifth biggest value in -25, 2/3, 0.3, -0.1, -3, 0, 0.1066? -0.1 What is the fifth biggest value in -3, 4/9, 3, 2/11, -4165/3? -4165/3 Which is the third smallest value? (a) -1/8 (b) -2/1001 (c) 0.1492 c What is the smallest value in 2, 141, 21/466, -3? -3 Which is the fifth biggest value? (a) -215 (b) 1/2 (c) 37.4 (d) 3 (e) 1/28 a What is the biggest value in -177/95, 120, -4? 120 What is the smallest value in 0, -8, -0.2, 2/15, 1/7, 3/2, 5/71? -8 What is the second smallest value in -3.87, 1/72, 2/3, 1/4? 1/72 What is the second biggest value in 1/70, -12, -1176? -12 Which is the sixth biggest value? (a) -0.10651 (b) 3 (c) 3/40 (d) -1/4 (e) -13 (f) -1/9 e Which is the third smallest value? (a) 3/11 (b) -49912/15 (c) -1 (d) 5 (e) 5/2 a Which is the third biggest value? (a) 1.4 (b) -1 (c) 0.1 (d) 31 (e) -0.1 (f) -74 c Which is the third smallest value? (a) -0.05975 (b) 1 (c) -0.11 (d) -7/120 d What is the third smallest value in -2/9, 0, -12, -8, 24, -3.1? -3.1 Which is the seventh biggest value? (a) 1 (b) -31/7 (c) 6/5 (d) -79 (e) 5 (f) 0 (g) -3 d Which is the third biggest value? (a) 2 (b) -0.3 (c) -4 (d) -516 (e) -6/79 (f) -12 b What is the third smallest value in -14/19, -399, -20/9, 2? -14/19 Which is the fourth biggest value? (a) -3298 (b) 0.06 (c) 0.11 (d) 5 a What is the third smallest value in -0.11, 2/5, -0.12, -6, -10? -0.12 Which is the second biggest value? (a) -2 (b) -1 (c) -2888 (d) -0.2 (e) -0.3 (f) 13/8 d What is the fifth biggest value in 1, 0.2116, 0.04, -3/2, 4.3? -3/2 Which is the third biggest value? (a) 11/7 (b) -1/6 (c) -7.19 c Which is the third biggest value? (a) -0.3449 (b) -19.953 (c) -3 b Which is the third smallest value? (a) -0.5 (b) 214/7 (c) -5 (d) 0.03868 (e) 1/5 d What is the third biggest value in -0.5, -20451, 3, -5? -5 What is the third smallest value in -44203.8, -0.13, -5? -0.13 What is the fifth biggest value in 0.5, -1/3, -4, -1/2, -13/43, -2/1273, 3/2? -1/3 Which is the fifth biggest value? (a) -1021 (b) -1 (c) -0.2 (d) 0.05 (e) 1/3 (f) -0.3 b What is the smallest value in 1/2, 4/15, 0, 5, -0.1, -48, 2/7? -48 Which is the smallest value? (a) 1/13 (b) -2 (c) 54 (d) -0.1 (e) -0.2 (f) 5 (g) 4625 b Which is the second smallest value? (a) 0 (b) -4 (c) -2/15 (d) 5 (e) -2/5 (f) -1 (g) 2.7 f Which is the fourth smallest value? (a) 2 (b) -5626268 (c) -2/17 (d) 0.2 a What is the third biggest value in -0.78818, 7, -0.4, 0? -0.4 Which is the third biggest value? (a) 97 (b) 1.6 (c) -434 (d) 4 b Which is the second smallest value? (a) -1/44 (b) 2/19 (c) -26.491 a Which is the third biggest value? (a) -0.5 (b) -1/216 (c) -19.8 (d) -4 (e) -5 (f) 1/2 a What is the fifth smallest value in 0.39, 20912, 3, 5, -1/4? 20912 What is the sixth biggest value in -2/5, -5/4, 0.7, -0.2, -1206, -1, -2? -2 Which is the third smallest value? (a) 368 (b) 5 (c) 4 (d) 0.417746 b What is the fourth biggest value in 39, -0.6, -3, -0.1204? -3 What is the fifth smallest value in -1/5, 0.03, -7945, -0.1, 1, -2/3, -2? -0.1 Which is the second biggest value? (a) -8.64 (b) 190/27 (c) 2/61 c What is the third smallest value in -5, -24/25, -2/25, 0.121? -2/25 Which is the biggest value? (a) 2183 (b) -0.0709 (c) 0.5 a Which is the second smallest value? (a) 25 (b) 0.4 (c) 1166 (d) -3/5 (e) 0 (f) -2 (g) -4/3 g Which is the third biggest value? (a) 14 (b) 0.5 (c) 0.008 (d) -0.18 (e) 1/6 e What is the fourth smallest value in -2/9, -0.09338, 6, -0.3, -1/5, 3/8? -0.09338 Which is the biggest value? (a) -2/9 (b) -2 (c) -7820379 a Which is the third biggest value? (a) 3/353 (b) -2/3 (c) 5 (d) -19733 b Which is the fourth biggest value? (a) 0.1 (b) 8441 (c) 3 (d) 0.4 (e) -42 (f) 15 d What is the third smallest value in 9.6, 112, 4, 1, -3/7? 4 Which is the second smallest value? (a) -2/15 (b) 0.4 (c) -1/3 (d) -1274 (e) -0.5 (f) -3 (g) 10 f What is the second biggest value in 0.4, -0.2, 8.9320499? 0.4 What is the third biggest value in 1/4, -4.5, 8.275? -4.5 Which is the second biggest value? (a) -22.12 (b) 5 (c) 1/7 (d) 0.3394 d What is the fifth smallest value in 2, -0.1, -0.042, -1/51, -1, -57, 5? -1/51 Which is the biggest value? (a) 2/17 (b) 0.166 (c) -0.8 (d) -2/229 b What is the fifth biggest value in -119, -0.04, -0.192, 2/17, 1/9? -119 What is the second smallest value in 39, 2/7, 2/17, -52, -5, 116? -5 What is the third smallest value in 0.20739, 2/5, 2, 22? 2 What is the biggest value in -262, -4/7, 18122.1? 18122.1 What is the third biggest value in 2.87, 0.4, -688, -5, -0.5, 2/17, -0.3? 2/17 Which is the second smallest value? (a) 1/8 (b) -929457 (c) -0.2 (d) -8 d What is the fifth biggest value in -6/5, 0.3, -24, 168, 0.4, 3? -6/5 Which is the second smallest value? (a) 3.4 (b) 2 (c) -11150 (d) -3 d Which is the third smallest value? (a) -3/4 (b) -9061 (c) 47 (d) 5 d Which is the sixth biggest value? (a) 2 (b) -3 (c) -117 (d) 0.2 (e) 3 (f) 2/3 (g) -9.5 g Which is the fifth smallest value? (a) 2 (b) 52 (c) -5 (d) 0.012 (e) 1 (f) -9 (g) 4 a What is the second smallest value in -13, 44301, 6? 6 Which is the second smallest value? (a) 0.2 (b) -72.5 (c) 15273 a What is the smallest value in -2/13, -10, 218, 8390? -10 What is the smallest value in 0.1, 4/25, -31, 5, 2/633? -31 Which is the smallest value? (a) -4 (b) -5 (c) 1793.44 b What is the fifth smallest value in -0.2, 99, 1, -398, 0? 99 Which is the third smallest value? (a) 0.5 (b) -4/3 (c) 1/23 (d) 12 (e) -4 (f) 264 c What is the third biggest value in -3636, 0.8, 10, 1/18? 1/18 What is the smallest value in 37, -2/3, 21, 0.3, -37? -37 Which is the second smallest value? (a) 5/117 (b) 72/163 (c) -1 (d) -0.4 (e) 4 (f) -1/2 (g) -0.3 f Which is the third biggest value? (a) -252 (b) -0.03 (c) 0 (d) -3/26 (e) -5.9 d Which is the fifth biggest value? (a) 1 (b) 9/4 (c) -0.7 (d) -1.2 (e) 5 (f) -4/23 c What is the second biggest value in 2/19, -4/3, -23, -35, -38, 0? 0 What is the biggest value in -0.071, 43, -2/3, -50? 43 Which is the second smallest value? (a) -0.06 (b) -800 (c) -514 c Which is the biggest value? (a) -1/7 (b) -0.3 (c) -1 (d) 3/2 (e) -0.054 (f) -323 d Which is the third smallest value? (a) -67 (b) 3 (c) 0.3 (d) -2 (e) 1/123 (f) -11 (g) -0.3 d Which is the fifth biggest value? (a) 2/15 (b) 2/7 (c) -0.08 (d) 316 (e) 0.16 (f) 9 a Which is the third biggest value? (a) -3 (b) -1078 (c) 163 b What is the fifth biggest value in -20/7, -4.2, 48.6, -1, 5/2, 1, -8? -20/7 What is the biggest value in -2/3, 3, -341052, -8? 3 Which is the second biggest value? (a) -17/216 (b) -0.3 (c) 8 a Which is the fifth biggest value? (a) 32 (b) -9 (c) -5 (d) -82 (e) 3 (f) -1/4 b Which is the second biggest value? (a) 0.46 (b) 2 (c) 41/302 (d) 4/3 d Which is the second biggest value? (a) 5 (b) -3/35897 (c) 4/11 c What is the sixth smallest value in -60, 4, -20, 2/135, 1, -1, -1/5? 1 What is the fourth smallest value in -3/4, 1/419, 24, 0, -207? 1/419 Which is the smallest value? (a) 52 (b) -0.3 (c) 63.028 (d) 3/8 b What is the third smallest value in 3/5, -1, 2, -4, 0.11, 12/7, -6? -1 Which is the seventh biggest value? (a) 2/3 (b) 2/5 (c) 2 (d) -30 (e) 340 (f) -2 (g) 1/5 d What is the biggest value in 5/6, 13/2, -2, 0.3, -0.5, 119, 42? 119 Which is the seventh biggest value? (a) -1/6 (b) -4 (c) 1 (d) 3 (e) -5 (f) -59 (g) -39 f Which is the second biggest value? (a) -0.07038872 (b) 4 (c) 0.1 c Which is the sixth biggest value? (a) 13.6 (b) -0.15 (c) 1 (d) 3/17 (e) 20/27 (f) 0.3 (g) 0 g Which is the second smallest value? (a) 0.5 (b) 469744 (c) -5 (d) -2 d What is the fourth smallest value in -152, 1/5, -0.6, -13, -131, 1/4? -0.6 What is the second smallest value in 3, -17, 489, -9, 0.4, 0? -9 Which is the third biggest value? (a) -0.9 (b) -9011.6 (c) -5 b What is th	{ "pile_set_name": "DM Mathematics" }
icking 2 t when two letters picked without replacement from nnnttttttttntnttttn? 26/57 Two letters picked without replacement from enneeeeeeneeneneee. Give prob of picking 2 n. 10/153 Three letters picked without replacement from ggiigigigggggg. What is prob of picking 3 g? 30/91 Two letters picked without replacement from {g: 1, m: 1, u: 1}. What is prob of picking 1 m and 1 u? 1/3 Three letters picked without replacement from ywwywewewwwwwwwew. What is prob of picking 3 e? 1/680 Two letters picked without replacement from {l: 16, k: 2}. What is prob of picking 2 k? 1/153 Calculate prob of picking 1 y, 1 e, and 1 k when three letters picked without replacement from {y: 2, k: 1, z: 3, x: 4, o: 7, e: 1}. 1/408 What is prob of picking 2 h when two letters picked without replacement from vavhmhhvvuu? 3/55 Two letters picked without replacement from bbbbryy. What is prob of picking 1 y and 1 r? 2/21 Calculate prob of picking 1 l, 1 q, 1 y, and 1 g when four letters picked without replacement from {a: 1, y: 5, q: 1, g: 3, l: 3, i: 2}. 3/91 Two letters picked without replacement from {x: 1, k: 1, m: 3, v: 2, n: 1, p: 5}. What is prob of picking 1 v and 1 p? 5/39 What is prob of picking 1 b, 1 p, and 1 w when three letters picked without replacement from {w: 3, l: 4, v: 2, b: 1, p: 4}? 3/91 Calculate prob of picking 3 r when three letters picked without replacement from {r: 13, w: 6}. 286/969 Calculate prob of picking 4 b when four letters picked without replacement from {b: 6, x: 2}. 3/14 Two letters picked without replacement from aghwaggglhlhghz. Give prob of picking 2 g. 2/21 Calculate prob of picking 3 v when three letters picked without replacement from {b: 13, v: 3}. 1/560 What is prob of picking 3 v when three letters picked without replacement from {v: 14, a: 1}? 4/5 Calculate prob of picking 2 b, 1 y, and 1 e when four letters picked without replacement from ddgddbydedydbddyd. 3/2380 Three letters picked without replacement from {d: 1, r: 1, w: 1}. Give prob of picking 1 d and 2 w. 0 Three letters picked without replacement from {k: 8, y: 5}. Give prob of picking 3 k. 28/143 Two letters picked without replacement from {j: 1, c: 1, w: 2, r: 1}. What is prob of picking 1 w and 1 c? 1/5 Calculate prob of picking 1 j and 1 u when two letters picked without replacement from juuu. 1/2 Two letters picked without replacement from {n: 1, g: 2, f: 1, z: 1}. Give prob of picking 1 n and 1 f. 1/10 What is prob of picking 2 h when two letters picked without replacement from hhhrrhrhhhrhhrhh? 11/24 What is prob of picking 1 z and 2 c when three letters picked without replacement from {c: 11, g: 1, r: 1, a: 4, z: 2}? 110/969 Four letters picked without replacement from {u: 4, d: 3, n: 4}. What is prob of picking 1 u and 3 d? 2/165 Two letters picked without replacement from {c: 5, p: 2, e: 4}. Give prob of picking 1 p and 1 c. 2/11 Two letters picked without replacement from {k: 1, t: 2, n: 2, f: 1, v: 2}. What is prob of picking 1 t and 1 v? 1/7 What is prob of picking 1 i and 1 n when two letters picked without replacement from aihntaz? 1/21 What is prob of picking 2 j, 1 x, and 1 c when four letters picked without replacement from {o: 4, s: 5, x: 4, j: 6, c: 1}? 4/323 What is prob of picking 1 p, 1 a, and 1 d when three letters picked without replacement from {a: 6, d: 1, r: 2, u: 2, p: 4}? 24/455 Calculate prob of picking 2 x and 2 w when four letters picked without replacement from {w: 4, x: 15}. 105/646 What is prob of picking 1 h and 3 y when four letters picked without replacement from cycyuuyyhychycry? 1/26 Calculate prob of picking 1 o and 1 z when two letters picked without replacement from oaggozgoaoz. 8/55 Four letters picked without replacement from {d: 3, u: 3, x: 2, g: 2, q: 1, r: 1}. Give prob of picking 1 q, 2 g, and 1 x. 2/495 Three letters picked without replacement from oomoolooiiicoxmooo. What is prob of picking 1 m and 2 x? 0 Two letters picked without replacement from araararaaarr. What is prob of picking 2 a? 7/22 What is prob of picking 3 k and 1 r when four letters picked without replacement from kkkrrkkr? 3/7 Four letters picked without replacement from {t: 1, w: 6, u: 7}. Give prob of picking 3 u and 1 t. 5/143 What is prob of picking 3 s and 1 x when four letters picked without replacement from mxxsxsxmmisxmx? 6/1001 Calculate prob of picking 1 a and 1 u when two letters picked without replacement from {a: 1, g: 1, u: 1, v: 6}. 1/36 What is prob of picking 2 p when two letters picked without replacement from pqpssshqspsshssp? 1/20 What is prob of picking 2 r and 1 g when three letters picked without replacement from rrmmmrmmgmgrgg? 6/91 Two letters picked without replacement from hhhhhhhhhh. Give prob of picking 2 h. 1 Calculate prob of picking 1 x, 1 e, and 1 c when three letters picked without replacement from aexxacx. 3/35 Calculate prob of picking 1 n and 3 x when four letters picked without replacement from nxxxxn. 8/15 Four letters picked without replacement from zbbbbbbbzzb. What is prob of picking 1 z and 3 b? 28/55 Four letters picked without replacement from {j: 14, o: 5}. What is prob of picking 3 j and 1 o? 455/969 What is prob of picking 1 l and 1 c when two letters picked without replacement from {l: 1, c: 1, p: 1}? 1/3 Three letters picked without replacement from ssssbddsbbbosssppb. What is prob of picking 1 s and 2 b? 5/51 Three letters picked without replacement from {f: 4, c: 2, a: 1, r: 2}. Give prob of picking 1 f, 1 c, and 1 r. 4/21 Three letters picked without replacement from brbaaarrra. What is prob of picking 3 a? 1/30 Four letters picked without replacement from {r: 1, q: 1, n: 1, g: 2, a: 1, m: 1}. Give prob of picking 2 g, 1 a, and 1 m. 1/35 Two letters picked without replacement from {n: 2, l: 3, k: 3, o: 1, p: 3, c: 1}. Give prob of picking 1 o and 1 c. 1/78 What is prob of picking 1 c, 1 m, and 2 x when four letters picked without replacement from llxwmlmmlglwxwmlxwc? 1/323 Two letters picked without replacement from xxxxxjxpe. What is prob of picking 1 e and 1 p? 1/36 Two letters picked without replacement from hggghgoaggaghgh. Give prob of picking 1 h and 1 o. 4/105 Calculate prob of picking 3 a when three letters picked without replacement from {a: 4, e: 3}. 4/35 Four letters picked without replacement from aaggagagag. Give prob of picking 2 g and 2 a. 10/21 Two letters picked without replacement from qssqxqcxxsxcxxx. Give prob of picking 2 s. 1/35 Three letters picked without replacement from yeyyeeueyeeeeueeeeey. Give prob of picking 2 e and 1 y. 13/38 Two letters picked without replacement from llllaalllll. What is prob of picking 2 l? 36/55 What is prob of picking 2 r, 1 y, and 1 o when four letters picked without replacement from yiymhhyrmymyhyyohyir? 8/4845 Calculate prob of picking 2 d when two letters picked without replacement from {f: 4, d: 3}. 1/7 Four letters picked without replacement from {z: 1, i: 1, n: 6, d: 4, f: 1}. What is prob of picking 1 d, 1 f, 1 z, and 1 i? 4/715 What is prob of picking 1 y, 1 b, and 2 s when four letters picked without replacement from hcsbychyhcyacass? 9/1820 What is prob of picking 1 v and 1 t when two letters picked without replacement from {t: 1, u: 3, x: 1, v: 2}? 2/21 Three letters picked without replacement from {j: 4, v: 2, t: 1, k: 3}. What is prob of picking 2 k and 1 j? 1/10 What is prob of picking 2 x when two letters picked without replacement from xjxjkxkkjkz? 3/55 Four letters picked without replacement from yyiidyiiyi. What is prob of picking 1 i and 3 y? 2/21 Two letters picked without replacement from {k: 1, t: 1, x: 5, i: 5, y: 4}. Give prob of picking 1 x and 1 i. 5/24 Calculate prob of picking 2 k when two letters picked without replacement from kekokekeok. 2/9 Calculate prob of picking 1 y and 1 l when two letters picked without replacement from mlmyqallylllytqmtl. 7/51 Calculate prob of picking 2 h and 2 g when four letters picked without replacement from nhhggnhhnn. 1/35 Four letters picked without replacement from jdjndnnjnjj. Give prob of picking 1 d and 3 n. 4/165 Two letters picked without replacement from gxwfggggggdfgd. What is prob of picking 1 x and 1 g? 8/91 Calculate prob of picking 1 l and 1 y when two letters	{ "pile_set_name": "DM Mathematics" }
q(9). 2, 3 Let j = 38 - -6. Suppose 0c + c = j. List the prime factors of c. 2, 11 Suppose 4q - 26 = 3z - 6z, 3z + 14 = 4q. Suppose qm + 3i = 390, 3m - 159 = 5i + 41. List the prime factors of m. 3, 5 Suppose 0 = 5r + 2w - 5234, -3r = -9w + 7w - 3134. List the prime factors of r. 2, 523 Let c = 632 - 101. What are the prime factors of c? 3, 59 Let v be ((-12)/(-9))/((-12)/(-18)). Suppose -321 = -m - vm. List the prime factors of m. 107 Let p = 263 - 195. List the prime factors of p. 2, 17 Suppose -j + 20 = 5q + 2j, 4 = q - 3j. Let w = -4 + q. Suppose w = h - 0h - 7. List the prime factors of h. 7 Suppose -670 = -29t + 34t. Let a = t - -252. What are the prime factors of a? 2, 59 Let p be (-15)/(20/4) - -11. List the prime factors of 5/20 - (-270)/p. 2, 17 Let x(b) = 27b2 + 10b + 14. What are the prime factors of x(-5)? 3, 71 Let s(c) = 4c2 - 4c + 7. Let f(j) = 7j3 + j2 - j - 1. Let i be f(-1). Let l(m) = m + 9. Let k be l(i). List the prime factors of s(k). 31 Let z(g) = -g + 3g*3 + 0 + 3g + 4 - 4g3 + 11g2. Let q be z(11). Let b = 3 + q. List the prime factors of b. 29 Let k(o) be the first derivative of o4/4 - o3 - o2/2 + 6o + 7. Let r be k(3). Suppose -rq = -3 - 9. List the prime factors of q. 2 Suppose 5n - 482 = -47. Let v = n + -58. List the prime factors of v. 29 Suppose -2x = -4 - 12. Suppose -3t + xt = 355. List the prime factors of t. 71 Suppose -4t = r - 41 - 43, -80 = -3t - 5r. Suppose 0 = 7x - t - 85. What are the prime factors of x? 3, 5 Let a = -946 + 1268. What are the prime factors of a? 2, 7, 23 Let c(j) = 2j2 - 2j - 3. Let d be c(4). Let i = 6 - 34. What are the prime factors of i/d(-57)/2? 2, 19 Suppose 3i = t + 19, t = -0t + 2i - 14. Let q(b) be the second derivative of -5b3/2 - 2b*2 + 2b. List the prime factors of q(t). 2, 7 Suppose -3i - 1142 = -5r + 26, -4i = 3r - 695. Let u = -11 + r. What are the prime factors of u? 2, 3, 37 Let q = 250 - 139. Suppose -7t + 1247 = -q. What are the prime factors of t? 2, 97 Let w = 447 - 223. What are the prime factors of (w/20 + -4)/((-6)/(-40))? 2, 3 Suppose r + 3h = 6, 0h - 4h = 2r - 18. Let y = r + -9. List the prime factors of y. 2, 3 Suppose -13j = -1769 - 8293. Suppose -14h + 20h = j. List the prime factors of h. 3, 43 Let u(w) = -w*2 - 20w + 68. Let d be u(-23). List the prime factors of d + 4 + -3 + 3 + 252. 3, 5, 17 Suppose 3x - 102 = -2s, -5s = -x - 33 - 256. Suppose d + 7q - 11 = 4q, 0 = 3d + 3q - s. List the prime factors of d. 23 Let y be 6/3(-2 - -3). Suppose -yr + 3j + 215 = 2j, -5r + j = -533. What are the prime factors of r? 2, 53 Suppose -19 = -2a - 3i, 5a - 2 = -i + 13. Suppose -3p + ah - 2 = 0, h - 3 = -2h. Suppose p = z - 2z + 7. List the prime factors of z. 7 Let q(k) = k3 - 2k*2 + 3k + 2. Let u be q(-3). Let l = u + 231. What are the prime factors of l? 179 Suppose -23h = -13h - 5420. What are the prime factors of h? 2, 271 Suppose 0 = 3d + 24. Let o(l) = l2 + 8l + 6. Let y be o(d). List the prime factors of (2 - 0)/(y/99). 3, 11 Suppose -2w - 26 = -4u, 0 = 4u - 5u + 5. What are the prime factors of (-1 + 2 + w)/((-8)/172)? 43 Let q be 5(310/(-25) + 0). Let b = 105 + q. List the prime factors of b. 43 Suppose 4 = -4t - 5m + m, 3t - 2 = -2m. Suppose -45 = -z - 3o, 0 = 3z - 0z + to - 125. List the prime factors of z. 3, 13 Let q = -96 + 351. List the prime factors of q. 3, 5, 17 Suppose -277z = -286z + 7641. List the prime factors of z. 3, 283 Let l = -24 - -30. List the prime factors of (-3)/l - 129/(-2). 2 Suppose 0 = -3g + r + 4788, 6g = 11g + 4r - 7997. Suppose -5z + 5h + g = 4h, 5h - 15 = 0. What are the prime factors of z? 2, 5 Let m(a) = 2a - 28. Let q be m(10). What are the prime factors of q/(-2) - (-112)/2? 2, 3, 5 Let q(n) = -n*3 + 3n*2 + 2n - 1. Let t be q(3). Suppose -86 = -tr + 644. What are the prime factors of r? 2, 73 Let c = -74 - -170. Suppose -l - c + 255 = 0. What are the prime factors of l? 3, 53 Suppose 0 = -3j - 2j + 20. Let u(v) = -v3 + 11v*2 + 5v + 3. List the prime factors of u(j). 3, 5 Suppose 12j = 7j + 60. Suppose -2r = 2r - j. Suppose 5b - 4k - 360 = 0, 3k = 4b - rb - 61. List the prime factors of b. 2, 19 Let l be 1(-3)/(12/8). Let b be ((l26)/(-2))/(-1). Let t = b - -80. List the prime factors of t. 2, 3 Let o(v) = 40v*2 + 4v - 5. Suppose 0 - 2 = -2p - 2j, 0 = 5p + j - 9. What are the prime factors of o(p)? 163 Suppose -n - 8s = -7s - 52, -4s + 255 = 5n. What are the prime factors of n? 47 Let o(w) = -3416w - 68. List the prime factors of o(-1). 2, 3, 31 Suppose 5v = -3s - 0v - 7, 2s + 5v = -13. Let p = s + -2. Suppose -u + 2 = 0, 13 = 5m - pu - 9. List the prime factors of m. 2, 3 Let g be (2 - 1)(-2 + -20). Suppose 2u = -4y - 94 + 402, -4y = 4u - 316. Let c = g + y. What are the prime factors of c? 53 Suppose 4j + 4j = 96. Suppose 142 = p + j. What are the prime factors of p? 2, 5, 13 What are the prime factors of (-2)/(-4) + -2 - (-56385)/90? 5 Let j(f) = 2f2 + 3f + 2. Let r be j(-2). Let b = -8 + r. List the prime factors of 1 + 21 + b + 4. 2, 11 Let q(z) = 14z3 + z. Let v be q(1). Let i(o) = -o + 13. Let g be i(v). What are the prime factors of (-1806)/(-24) + g/8? 3, 5 Suppose 0 = -4c + 232 + 472. Let d = -74 - c. List the prime factors of d/(-12) + (-1)/(-6). 3, 7 Let h be (-2 - -23) + -2 + 0. Suppose 9 = 2b - v - 0v, -14 = -3b + 2v. Let p = b + h. List the prime factors of p. 23 Let d(t) = 7t2 - 22t + 17. Suppose 0 = -4w - 10 + 42. List the prime factors of d(w). 17 Let f = -186 - -266. Let l(p) = -p2 - 3p + 9. Let c be l(-4). Suppose 3n - 41 = 4y, 2n = -3n - cy + f. List the prime factors of n. 3, 5 Let v = -3 + 7. Suppose 5j - vc - 387 = 0, 3j + c = -3c + 213. Suppose j + 36 = 3a. What are the prime factors of a? 37 Let i(u) = -2u3 + 2u*2 - 6u + 4. List the prime factors of i(-4). 2, 47 Suppose -6h = 60 - 3942. What are the prime factors of h? 647 Suppose 4x - 6x - 28 = 0. Let j = x + 1. What are the prime factors of 2/j - 41/(-13)? 3 Let w(c) = c3 - 9c*2 + 4c - 2. Let p be w(8). Let y = 42 + -63. Let r = y - p. List the prime factors of r. 13 Suppose -5l = 128 + 12. Suppose -8 = 2h, -i + 2h - 242 = 4i. Let j = l - i. What are the prime factors of j? 2, 11 Let x(r) = r*2 - 9r - 11. Let y be x(11). Suppose 0 = -4q - y - 5, 5q - 60 = -u. Suppose u = 5g - i - 47, 5i - 15 = -g. List the prime factors of g. 5 Suppose -a = 5z - 899, 6a - 2a - 3578 = -2z. What are the prime factors of a? 2, 3, 149 Suppose 1635 = 3i + 5r, -5r - 15 = -0r. Suppose -3k = 4y - i, 6 = y - 4y. Suppose 4m - 4w - k = -w, 2m - 88 = -w. List the prime factors of m. 3, 5 Let q(h) = 2h. Let g be q(6). Let p = -10 + g. What are the prime factors of (-5 + 3)/(p/(-16))? 2 Suppose -4 = -4u, -3 = -b + 2u - 2. Suppose -bn - 4 = -7n. Let q = 36 - n. List the prime factors of q. 5, 7 Let m(w) = w2 + 10w + 1. Let d(x) = -x*2 - 11x. Let v(j) = -4d(j) - 5m(j). Let i be v(-5). Suppose io + 4o - 204 = 0. What are the prime factors of o? 3, 17 Let x = 133 - 57. Suppose -2r + x = -18. What are the prime factors of r? 47 Let u be ((-33)/(-2 - 1) - 0) + -2. Suppose uk = -3b + 4k + 35, b = 2k + 19. List the prime factors of b. 3, 5 Suppose 4q + o = 4438, 4436 = 4q - 2o + 4o. What are the prime factors of q? 2, 3, 5, 37 Let h = -3 - -3. Suppose 4z - 28 = -2l, 4z + 0z + 3l - 24 = h. List the prime factors of z. 3 Let y = 3 + 9. Suppose -y = 2s - 4q - 4, 2s - 3q + 5 = 0. Suppose 7 = sn - 61. List the prime factors of n. 2, 17 Suppose 5x + 4u - 3905 = 0, -6x + 5u + 3860 = -x. What are the prime factors of x? 3, 7, 37 Let s(u) = -9u + 0u + 5 - 8 - 2. Let k be s(-2). Suppose 0 = 4y + 2f - 42, 5y - 4f - 46 = k. List the prime factors of y. 11 Suppose -f - 4991 = -6h, h - 827 = -5f + 10f. What are the prime factors of h? 2, 13 Let u(h) = -h*3 - 3h*2 + 2. Let j be u(-3). Suppose 4o - jo = 312. Suppose 4r + 27 = b, -o = -5b + r - 2r. List the prime factors of b. 31 Let l = -41 - -82. Let v = -7 - -23. Let o = l - v. List the prime factors of o. 5 Suppose 0 = -g + 3*z + 1337,	{ "pile_set_name": "DM Mathematics" }
ve -744 = -36b - 57b for b. 8 Solve -110z + 48 = -98z for z. 4 Solve -8 = -17q + 15q for q. 4 Solve 18l + 174 = 47l for l. 6 Solve 0 = -7y + 6y + 1 for y. 1 Solve 25b = -12 - 163 for b. -7 Solve 72z = 68z + 4 for z. 1 Solve 10a = -497 + 557 for a. 6 Solve -18z = -6z - 3z for z. 0 Solve -57a - 27 = -60a for a. 9 Solve 81k = 72k - 36 for k. -4 Solve 4y - 143 + 163 = 0 for y. -5 Solve 0 = -54s + 26s + 196 for s. 7 Solve 0 = 21v + 95 + 115 for v. -10 Solve -744 + 745 = -i for i. -1 Solve 243 = -8z + 227 for z. -2 Solve 25z - 16 = 23z for z. 8 Solve 5y = -y - 12 for y. -2 Solve 208 = 13a + 169 for a. 3 Solve -5 = 97i - 92i for i. -1 Solve 32 = x + 30 for x. 2 Solve 9z + 149 = 140 for z. -1 Solve 42p + 2 = 40p for p. -1 Solve 12g + 12g + 168 = 0 for g. -7 Solve 25 = 20y - 15y for y. 5 Solve 23q + 8 + 38 = 0 for q. -2 Solve 6 = 11y - 5 for y. 1 Solve -5x + 32x = 27 for x. 1 Solve -16j = -25 - 71 for j. 6 Solve 0 = q + 114q - 345 for q. 3 Solve 12 = v - 5v for v. -3 Solve 24 = -7m - m for m. -3 Solve 2k + 7 = 5 for k. -1 Solve 8v - 574 = -494 for v. 10 Solve 7 = 13x - 32 for x. 3 Solve 54x - 61x = 14 for x. -2 Solve 4s = 5 + 11 for s. 4 Solve -v - 620 = -614 for v. -6 Solve -18a + 30 = -24a for a. -5 Solve -275z = -284z + 54 for z. 6 Solve -4g - 5g = -2g for g. 0 Solve 55b + 21b + 304 = 0 for b. -4 Solve 0 = -4k - 94 + 90 for k. -1 Solve 2r - 6 = -0r for r. 3 Solve 0 = -31a + 33a - 8 for a. 4 Solve 0 = -4i - 24 + 8 for i. -4 Solve 22q = -40q + 434 for q. 7 Solve -10u + 9u + 1 = 0 for u. 1 Solve 0 = 37y - 29y + 16 for y. -2 Solve -16g + 39g - 207 = 0 for g. 9 Solve -5w = 4 - 14 for w. 2 Solve 0 = 648u - 631u + 119 for u. -7 Solve 30l + 10 = 28l for l. -5 Solve -114 = -428q + 447q for q. -6 Solve 10 = 17r - 15r for r. 5 Solve -u - 3u = -8 for u. 2 Solve -67l - 22 = 45 for l. -1 Solve -458b + 72 = -450b for b. 9 Solve -4 = -1078w + 1077w for w. 4 Solve 0 = -31p + 46p - 15 for p. 1 Solve c - 7 = -5 for c. 2 Solve 2c + c = 3 for c. 1 Solve -26 = 48h + 214 for h. -5 Solve -51s = -60s + 36 for s. 4 Solve -59z + 64z + 10 = 0 for z. -2 Solve 52 = -49l + 3 for l. -1 Solve -23r = -67r for r. 0 Solve 3n - n = -10 for n. -5 Solve -1 = -7i + 6i for i. 1 Solve 0 - 3 = -3r for r. 1 Solve -5r = -r + 16 for r. -4 Solve 61n - 23 = 84n for n. -1 Solve -32o - 211 = -83 for o. -4 Solve 30n = 23n + 7 for n. 1 Solve -78s + 65 = -91s for s. -5 Solve -3s - 15s = 0 for s. 0 Solve -13 = -4h - 21 for h. -2 Solve 2 = -15j + 17 for j. 1 Solve 0 = 2c + 7c + 36 for c. -4 Solve 4a - 211 = -195 for a. 4 Solve t + 63 = 65 for t. 2 Solve -10r - 20 = -0 for r. -2 Solve 1517m = 1512m + 10 for m. 2 Solve -299 = -82y + 111 for y. 5 Solve -19k + 270 = 156 for k. 6 Solve 124 - 116 = -2l for l. -4 Solve 152x = 163x + 33 for x. -3 Solve 27 - 15 = 3f for f. 4 Solve -1858y + 1856y = 14 for y. -7 Solve 9y + 21 = -12y for y. -1 Solve 0 = -6i + 19 - 7 for i. 2 Solve -8j + 2j - 24 = 0 for j. -4 Solve 0 = 10q - 85 + 35 for q. 5 Solve 6a + 1 + 5 = 0 for a. -1 Solve -p = 37p - 266 for p. 7 Solve -5a + 15a - 60 = 0 for a. 6 Solve -6 = 4y - 14 for y. 2 Solve 6 = -2h - 4 for h. -5 Solve 46g - 37g = -18 for g. -2 Solve -4 = 6w - 46 for w. 7 Solve -h - 9 = -6 for h. -3 Solve 0 = 45p - 48p for p. 0 Solve 150d + 20 = 154d for d. 5 Solve -44 = -22k + 66 for k. 5 Solve 5u - 699 + 684 = 0 for u. 3 Solve -70f - 85 = -53f for f. -5 Solve -36g + 72 = -144 for g. 6 Solve 0 = -12i - 2i - 42 for i. -3 Solve 3h + 7 = -5 for h. -4 Solve 0 = -494l + 527l + 132 for l. -4 Solve 16j + 22 + 26 = 0 for j. -3 Solve -5y + 3 = -4y for y. 3 Solve -4q = -16 + 24 for q. -2 Solve 138v - 141v = 9 for v. -3 Solve -2a - 5a + 35 = 0 for a. 5 Solve -6d - 7 + 1 = 0 for d. -1 Solve -25 + 10 = -3y for y. 5 Solve 2806 = -7u + 2757 for u. -7 Solve -6 = -q + 4q for q. -2 Solve -16v - 13v = -116 for v. 4 Solve 5s - 29s - 24 = 0 for s. -1 Solve -k - 24 + 21 = 0 for k. -3 Solve 19 = 11j - 25 for j. 4 Solve 3x + 25 - 10 = 0 for x. -5 Solve 8v = 12v - 8 for v. 2 Solve 115k - 12 = 111k for k. 3 Solve -104b + 99 = -71b for b. 3 Solve 233n = 221n + 72 for n. 6 Solve g - 124 + 135 = 0 for g. -11 Solve -93c = -85c + 16 for c. -2 Solve -12 = 30q - 42q for q. 1 Solve -13 = 13g + 52 for g. -5 Solve -8m - 6 = -10m for m. 3 Solve 184j - 188j = -12 for j. 3 Solve -4 = h + 3h for h. -1 Solve 15q = 6q - 63 for q. -7 Solve 0 = -3v + 108 - 105 for v. 1 Solve 0 = 2n + 75 - 69 for n. -3 Solve -39p + 11p - 84 = 0 for p. -3 Solve 0 = 22w - 79 - 53 for w. 6 Solve -858f + 49 = -865f for f. -7 Solve 17 = -9d - 37 for d. -6 Solve 50v + 156 = 24v for v. -6 Solve 0 = 21m - 16m for m. 0 Solve 1709f = 1695f - 70 for f. -5 Solve 10j - 69 = -99 for j. -3 Solve 0 = 46s - 116 - 160 for s. 6 Solve 26s + 4 = 22s for s. -1 Solve -4y + 12 = -6y for y. -6 Solve -13 = -30c + 43c for c. -1 Solve -10a - 10 = -0 for a. -1 Solve 329t - 88 = 340t for t. -8 Solve -5458a + 75 = -5443a for a. 5 Solve 59t - 51 = 42t for t. 3 Solve 6m = -21 - 9 for m. -5 Solve 11 + 9 = -5l for l. -4 Solve k - 102 = 35k for k. -3 Solve 27v = 22v + 10 for v. 2 Solve 0 = -10y + 6 - 36 for y. -3 Solve -13s + 1 - 14 = 0 for s. -1 Solve 39u = 111 + 45 for u. 4 Solve 11x - 674 = -740 for x. -6 Solve 0 = 10s + 50 for s. -5 Solve 9l - 20l = 77 for l. -7 Solve -114 = -22j + 18 for j. 6 Solve -38 = -26p + 7p for p. 2 Solve 19n = -163 + 11 for n. -8 Solve y - 248 = -245 for y. 3 Solve 3n - 35 = -4n for n. 5 Solve 433 = -90y - 107 for y. -6 Solve -2176i - 6 = -2182i for i. 1 Solve 17u + 115 = 81 for u. -2 Solve 15f - 9 = 12f for f. 3 Solve -2u - 18 = -14 for u. -2 Solve -55c - 166 + 221 = 0 for c. 1 Solve -8 = 83d - 81d for d. -4 Solve -96i = -88i - 56 for i. 7 Solve 0 = -22z + 241 - 87 for z. 7 Solve -38 = -g - 18g for g. 2 Solve 37g + 56 = 65g for g. 2 Solve 2v = -31v - 264 for v. -8 Solve 4b + 69 = 69 for b. 0 Solve -39w + 50 + 67 = 0 for w. 3 Solve 0r + r + 4 = 0 for r. -4 Solve 3l = -2 - 10 for l. -4 Solve 0 = -5i + 3 + 22 for i. 5 Solve -5 + 14 = 9a for a. 1 Solve 2 = 2t - 0t for t. 1 Solve -74x + 64x = 70 for x. -7 Solve 45t + 25 = 70t for t. 1 Solve 0 = 7c + 26 - 19 for c. -1 Solve 6d - 25d - 76 = 0 for d. -4 Solve 585m - 12 = 582m for m. 4 Solve 7j = 6j - 3 for j. -3 Solve -55u - 243 = 197 for u. -8 Solve 0 = 27t + 28t for t. 0 Solve 0 = -12z + 97 - 157 for z. -5 Solve 9v - 322 = 55v for v. -7 Solve 0 = 7c - 4c + 15 for c. -5 Solve -51g = -73g - 66 for g. -3 Solve 32n = 10 + 54 for n. 2 Solve -8q + 4q - 4 = 0 for q. -1 Solve 10z + 10 + 40 = 0 for z. -5 Solve i + 1 = 3 for i. 2 Solve 0 = -9k - 0 - 27 for k. -3 Solve 1665 = -p + 1662 for p. -3 Solve -4o + 47 - 31 = 0 for o. 4 Solve -12 = -16p + 100 for p. 7 Solve 10r + 16 = 6r for r. -4 Solve 0 = 6c - 8c + 5c for c. 0 Solve -2 = 25y + 48 for y. -2 Solve -7 = 6j - 1 for j. -1 Solve -1 + 9 = -2x for x. -4 Solve 298 = 27y + 217 for y. 3 Solve 0 = -20o + 6o - 84 for o. -6 Solve -15 = 8o - 55 for o. 5 Solve -94y + 68y - 26 = 0 for y. -1 Solve 0 = 44h + 17h + 366 for h. -6 Solve -18n + 12 + 24 = 0 for n. 2 Solve 3s = -8s + 11 for s. 1 Solve -80 - 90 = -34q for q. 5 Solve 9w + 16 = -20 for w. -4 Solve -14 + 14 = 28q for q. 0 Solve 3p = 11 + 1 for p. 4 Solve 0 = 19v + 686 - 629 for v. -3 Solve -162 = -40j - 14j for j. 3 Solve 94 = 5j + 99 for j. -1 Solve l + 3 - 8 = 0 for l. 5 Solve 4j = -27j - 62 for j. -2 Solve -847 + 784 = 9s for s. -7 Solve -3r + 5 = 11 for r. -2 Solve -k + 32 - 30 = 0 for k. 2 Solve 31t = -2t - 99 for t. -3 Solve -43 - 25 = 17s for s. -4 Solve 16l = -27l + 215 for l. 5 Solve -54r - 12 = -58r for r. 3 Solve -3o + 158 = 173 for o. -5 Solve 0 = -5g + 15 - 0 for g. 3 Solve 3t + 9 + 12 = 0 for t. -7 Solve 95 + 10 = 21q for q. 5 Solve 10l - 4l = -12 for l. -2 Solve -13t - 210 = -158 for t. -4 Solve 38z - 40z + 6 = 0 for z. 3 Solve 4w = -0w - 16 for w. -4 Solve 0 = -13o + 60 - 21 for o. 3 Solve 12k - 15 - 9 = 0 for k. 2 Solve 3z - 6 = -6 for z. 0 Solve -3u = -5u - 8 for u. -4 Solve -q + 30 = -7*q for q. -5 Sol	{ "pile_set_name": "DM Mathematics" }
= -4.337 - -3.947. Which is the second smallest value? (a) 0 (b) 35 (c) v a Let u = 2795.1 + -2795. Let i = 742/1245 - -1/249. Let r = 2/977 - -1916/18563. What is the smallest value in r, i, 5, u? u Let g be 0 + (-3)/4-1. Let o be 860/(-145) + 2 - 88/(-22). Let s = 7.8 - 3.8. Which is the smallest value? (a) s (b) -1/7 (c) g (d) o b Let p = -135 + 216. Let j be (-1230)/240 - -15. What is the smallest value in 1/3, p, -4, j? -4 Suppose 0 = -s + 18u - 164, 24u - 20u = 2s + 40. Let g = 23 + -40. Which is the second smallest value? (a) s (b) -3/2 (c) g a Let j = 1.2 - 7.2. Let q = 2.9444 - 2.9444. Which is the fourth smallest value? (a) q (b) -1 (c) -0.1 (d) j a Let w be 254/(-762) + (-1)/(-3). Which is the second biggest value? (a) -4 (b) -0.4 (c) 1467 (d) w d Let y = 4488/7 + -642. Let j = y + 109/119. What is the fourth biggest value in 1/2, 6, j, 1? j Let i(o) = -5o - 14. Let n be i(-2). Let z be (n3/10)/((-14)/(-7)). Which is the biggest value? (a) -52 (b) -5 (c) 0.4 (d) z c Let t be 391/119 - 1 - 2. Which is the second smallest value? (a) t (b) -19/3 (c) -0.4 c Let q = 0.04 - 0.1. Let w = 1.56 + q. Let i = -1.2 + w. Which is the biggest value? (a) -0.3 (b) 9 (c) i b Let q(t) = 34t + 916. Let d be q(-27). What is the third smallest value in 2/7, -8, -6.7, d? d Let n(z) = -13z + 54. Let u be n(3). Suppose uw = -w - 16. Let q = 2 + -2. Which is the biggest value? (a) w (b) -1/5 (c) q (d) 2/5 d Let w be 3 + 0(-2)/(-8). Let n be 174/(-24) + w/12. Suppose 18o = 14o - 4. Which is the biggest value? (a) n (b) -2 (c) o c Let o = 22.6 + -24.6. Let i = 12 - 12. Let v = 0.4 + -0.9. What is the third smallest value in o, v, i? i Let d = 237/616 + -3/308. What is the smallest value in -58, d, -1? -58 Let j = -5.9537 + 1.9537. Which is the third biggest value? (a) 5 (b) -34 (c) 2/7 (d) j d Let o(r) = r*3 - 54r*2 - 50r - 276. Let c be o(55). Let j be (-3)/4 + 19/38. What is the fourth smallest value in -5, j, -0.145, c? -0.145 Let o = -906 - -905.6. What is the second biggest value in 7, o, -3.1? o Let r = 13919 + -13923. Which is the biggest value? (a) -1/4 (b) -22 (c) -0.1 (d) r (e) -2 c Suppose 2u - 6 = 4o, -4o + 3o + 9 = 3u. Suppose 38x + 9 - 123 = o. Which is the second smallest value? (a) 2/19 (b) -9 (c) x a Let d = 16508 + -16507.9. Which is the second biggest value? (a) 14 (b) d (c) -0.05 b Let y = 47.5 + -44.5. Which is the second smallest value? (a) -2/5 (b) y (c) -196 (d) -3 d Let r = -14/729 + 176/729. Which is the third smallest value? (a) 0 (b) 4 (c) r (d) -14 c Let u be 1170/975((-5)/(-9) - 0) - 1. Which is the fourth smallest value? (a) -3/20 (b) -1/7 (c) u (d) 0.8 d Let r = 156.33 + -258.12. Let g = -102 - r. Let u = -0.38 - 0.02. What is the biggest value in 3, u, g? 3 Let j = -5177.96 - -5313. Let g = j + -135. Which is the third biggest value? (a) -2 (b) -3/5 (c) g a Let m be 22/(-3)(14/16 - (-12)/(-24)). What is the biggest value in 5/2, 3, -15, m, -0.3? 3 Let w = 2.494 + -1.494. Which is the smallest value? (a) w (b) -1/9 (c) -3/5 (d) 7/3 c Let m = -3498 - -3490. Which is the fourth smallest value? (a) -0.3 (b) m (c) 0.4 (d) 2 d Let g be 697 - (-1 - -1) - (-6 + -7 + 12). Which is the third smallest value? (a) 0.2 (b) g (c) -2 b Let m = -2.977 - -3.077. What is the third smallest value in m, -3/2, 1/5? 1/5 Let p be 4 + (3/(33/(-35)) - (-146 - -147)). Which is the second smallest value? (a) 0.9 (b) -6 (c) 5 (d) p d Let q = 0.442 + -116.442. Let y = q - -116.5. Which is the second smallest value? (a) 12 (b) y (c) 5 c Let z = -28219/75 - -1129/3. What is the biggest value in -0.3, 0.4, -0.5, z? 0.4 Let c = 428.4 - 426. Let p = -2.4 + c. What is the second biggest value in p, -3, 27? p Suppose -14l + 10 = -12l. Suppose -5n = 5t - 25, -4t + 11 = ln - 4n. What is the second biggest value in 2/27, 0.3, n? 0.3 Let i = -23/3 + 8. Suppose 3n + 9k = 11k - 5, -n + 2k - 15 = 0. What is the biggest value in -2/11, -2, i, n? n Let q = 5/6 - 77/78. Let f = -48 + 101. Let v = 48 - f. Which is the biggest value? (a) v (b) q (c) 3 c Let c = 1.7471 - 60.7021. Let p = 59 + c. Let k = -2.045 + p. What is the third biggest value in 1/9, k, 0? k Let v be ((-9)/484)/3. Which is the fourth smallest value? (a) 2 (b) -4 (c) 1 (d) v (e) 38 a Let i = -15 + 19. Suppose 9v = iv. Let j = 465 + -481. Which is the second smallest value? (a) j (b) -0.2 (c) v b Let r = -18323 - -18362. Which is the second biggest value? (a) -0.17 (b) r (c) 2 (d) 1/3 c Let r be (-23)/(-115)45 - 16. What is the biggest value in r, 4/7, 0.1, 6? 6 Let f = -0.27024 - 0.72976. Which is the third biggest value? (a) 224/23 (b) -0.5 (c) f c Let a = 5.05503 - 0.05503. What is the biggest value in a, 20, 1.6? 20 Let m = -169 - -79. Let g = m - -85. Which is the second biggest value? (a) -2/17 (b) -63 (c) g c Let j be 1402/(-7) + -1 - 7. Let k = 208 + j. Which is the second smallest value? (a) k (b) 37 (c) 0.1 c Let k be 5 + 4/(-18) + (-17232)/216. Which is the second smallest value? (a) -2/13 (b) 0.1 (c) k a Let y = 19.947 + -2.947. Which is the third biggest value? (a) -2/5 (b) y (c) 0.3 a Let y = 2.03 + -2.3. Suppose 512v = 532v + 40. Which is the third biggest value? (a) 1/6 (b) v (c) y b Let r = -175 + 877/5. Let n be 45/48 + 2 - (-11 - -14). What is the biggest value in r, -1, n, -4? r Let m = -60/49 + 4838/3871. Let y = m + 71/316. What is the second smallest value in -2/7, -1/3, y, 6? -2/7 Let s = 11637.6 - 11636. What is the third smallest value in -5, s, 2/17, -4, -0.1? -0.1 Let k be (38/95)/((2/6 - 0)/(-7)). Which is the fourth biggest value? (a) k (b) -1/4 (c) -0.2 (d) -2/3 (e) 1/2 d Let s = -163 + 133.1. Let r = -6.9 - s. Which is the second smallest value? (a) -2 (b) r (c) -3 a Let m = -90 - -90.77. Let c = -81.23 - m. Let a = -81.9 - c. What is the second biggest value in 15, a, 4? 4 Let r = 640.37 - 168.37. Which is the third biggest value? (a) 1/22 (b) r (c) 1/5 a Suppose 0j + 10 = -2j. Let z = -76 + 85. Suppose -9 = zv - 0. What is the smallest value in 5, v, j? j Let a = 2848 + -2846. What is the second smallest value in a, -5, -0.1, 50? -0.1 Let v = -2435 - -2437. Which is the biggest value? (a) v (b) -2 (c) 55 c Let k = 318.9 - 317.9. Let j = 3.9 + -2. Let p = j - 1.4. What is the third smallest value in -5, p, k, 2? k Let m = -7563 - -7566. Let s = -33 + 32.2. What is the second biggest value in m, s, 0.05? 0.05 Let s = 1556 + -1590. Let x = -35.029 - -0.729. Let k = x - s. Which is the second smallest value? (a) -2/17 (b) 0.2 (c) k a Let u = 0.176 + -0.151. Let z = 0.375 + u. Let m = -3/52 + -37/260. Which is the second smallest value? (a) z (b) m (c) -6 b Let n = 0 - 5. Let t = 38.207 - 37.207. Which is the second biggest value? (a) n (b) t (c) -2/9 c Let v = 0.1 + -0.4. Let h = -16089 - -16019. What is the smallest value in h, -0.2, -5, v? h Let i = -154157.6 + 154158. Suppose 0d - 4 = -4d. What is the third biggest value in 0.3, -4, d, i? 0.3 Let v = -1228/7 - -176. Let y = -3989 - -3990. Which is the smallest value? (a) 2/17 (b) v (c) -8 (d) y c Let x = 1.3 + -1.284. Let c = x - -0.084. What is the second biggest value in c, -0.4, 0.08? 0.08 Let r be (-4)/(44/384/(-56)). What is the second smallest value in -5, r, 0.098, -2/15? -2/15 Let n = -5819743/80340 - -11267/156. Let z = 3/206 + n. What is the biggest value in z, 9, 4? 9 Let w be (23/92)/(7/(-14)). Which is the fourth smallest value? (a) -1/5 (b) -21.9 (c) w (d) -2/17 d Let z = 10 + -7. Let o = -127724.4 + 127724. Which is the second biggest value? (a) o (b) z (c) -0.56 a Let m = 7686 - 7658. What is the fourth smallest value in m, 0.2, 46, -0.3? 46 Let z = 163.549 - 161.8. Let f = -0.251 - z. Which is the smallest value? (a) 0.2 (b) -34 (c) f (d) -4 b Let m = -2.528 + -3.472. Which is the smallest value? (a) -2/9 (b) -12 (c) m b Let l = 6344 - 6343. Let r(z) = -z. Let x be r(0). Let m be (-14)/21(1 + x). Which is the second smallest value? (a) m (b) l (c) 1/4 c Let x = 0.2 + 0.2. Let q = -1.8 + -0.2. Let f(r) = -101*r + 400. Let y be f(4). Which is the biggest value? (a) y (b) x (c) q b Let x = 0.1 + -	{ "pile_set_name": "DM Mathematics" }
+ ht - 434, -t + 617 = 3p. Calculate the highest common factor of 36 and p. 9 Let n = -14 + 36. Let s(h) = n - 34h + 15h - 10 + 5h2. Let z be s(8). Calculate the highest common divisor of z and 20. 20 Let g = 2493 + -2365. What is the highest common divisor of g and 13952? 128 Suppose 0 = 174t - 195t + 1552 - 460. Calculate the highest common factor of t and 351. 13 Let k be 95 - 91 - (0 - -1 - 1). Let p = 1 + 2. Suppose -2t = pa - 1163 + 253, 0 = -4t - k. Calculate the greatest common divisor of a and 38. 38 Suppose 42s = 47s - 4380. What is the highest common factor of 84 and s? 12 Let i be 48 + (-69832)/(-290) - ((-8)/(-10) - 2). Suppose 4q + 62 = 5m, 0 = -3q - 6 - 3. Calculate the highest common factor of m and i. 10 Suppose 6n + 13n - 1683 = 882. Let o = 2 - 3. Let t be (-3)/((-3)/o)-27. Calculate the greatest common factor of n and t. 27 Let t be 28/16 + 2/8. Suppose 4v - 1476 = -tv. Suppose -3j + 258 + v = 0. What is the highest common factor of 24 and j? 24 Suppose -5x - 80 = 30. Let u = -25 - x. Let v = u + 10. Calculate the greatest common factor of v and 21. 7 Suppose 2u + 4s - 968 = -0u, -469 = -u + 3s. Let i be (-19)/(-228) - u/(-24). Calculate the greatest common factor of 320 and i. 20 Let d be (-514)/(-8) - (-1)/(-4). Let i(x) = 2x2 + 15x - x*2 + 9 + 12 - x. Let k be i(-13). What is the greatest common divisor of k and d? 8 Let v be (-6)/4 + (-45600)/(-64). Suppose -18w = -225 - v. Calculate the greatest common divisor of 676 and w. 52 Let m = 332 + -192. Let r be 70(99/(-6))/(-11). Calculate the highest common factor of r and m. 35 Let a(g) = 4g - 43. Let o be a(13). Suppose -z = 4l - 22, -5z - 1 = -l - 27. Calculate the greatest common divisor of o and z. 3 Let j = -13178 - -14635. What is the greatest common divisor of j and 31? 31 Suppose 3x = 2p - 18 + 65, 2x = p + 21. Let d = 35 + p. Let i be 9/(d + 349/(-88)). Calculate the greatest common divisor of i and 24. 24 Let m be (-6)/(-5)(-30)/(-9). Suppose 2v = mv - 24. Suppose -11z + 287 = 3l - 12z, 0 = -3l - 4z + 292. Calculate the greatest common divisor of l and v. 12 Let d(v) = 58v*2 - 1562v - 27. Let z be d(27). Let n be ((-32)/20)/(2/(-5)). Suppose -r = -n - 5. What is the highest common divisor of r and z? 9 Let s = -1481 + 2831. Calculate the greatest common factor of 54 and s. 54 Let d = -41 - -43. Suppose -2b = 5r + db - 5, r - 4b - 25 = 0. Suppose -11 + 1 = -rs. Calculate the greatest common divisor of 22 and s. 2 Let j = 714 + -510. Suppose i - j = -5i. Let l = 334 - 62. What is the highest common factor of l and i? 34 Suppose 2u + 468 = -4s, 4u - 2u = 3s - 482. Let v = -234 - u. What is the highest common divisor of v and 164? 4 Suppose -4j + 3862 + 9602 = 40j. What is the highest common divisor of j and 3468? 102 Suppose 0 = -3x - 3, 0 = -2w - w + 2x - 1. Let k = 15 - w. Calculate the greatest common factor of 20 and k. 4 Suppose 0 = -57b + 46b + 1155. Calculate the highest common divisor of 2265 and b. 15 Suppose 0 = 4r + 28, 1099 - 428 = x - 3r. Calculate the greatest common factor of x and 208. 26 Let q be 1 + 7806 + 7/(-28)-8. What is the greatest common factor of q and 114? 57 Let k = 38 - 37. Let s be 21 + -1 + -1 + 4 - k. Suppose -2p + 990 = 3p. Calculate the greatest common divisor of p and s. 22 Suppose -3m + 45 = -51. Let v be 1 - (0 - 321). Suppose -480 = -5i + 4x - v, 0 = 5i + 5x - 380. Calculate the greatest common divisor of m and i. 16 Let p = 156 - 148. Suppose -4 = -f - 5a + p, 0 = -f - 3a + 10. What is the greatest common factor of 21 and f? 7 Let j(n) = 2n*2 - 2n - 72. Let g be j(7). Let z be (1932/9 - 6) + (-8)/g. Calculate the greatest common divisor of 26 and z. 26 Suppose 31p - 4p + 13p - 39600 = 0. Calculate the highest common divisor of p and 45. 45 Suppose 0 = 4h + p - 41 - 141, h + p - 47 = 0. Let x = 217 + -181. Calculate the highest common divisor of h and x. 9 Suppose 0 = 141t - 24860 - 503890. Calculate the greatest common factor of 10 and t. 10 Suppose 2k = 2v - 5v + 5309, 1774 = v + 5k. Calculate the greatest common divisor of 29 and v. 29 Let t = -140 + 144. Let r be (-2)/(-21) - 7720/(-84). What is the highest common factor of t and r? 4 Let q be (-78)/(-26)110/3. Suppose 0c - 2 = -c. Let x be 90/2 - (c - 1). Calculate the highest common divisor of x and q. 22 Suppose -2x + 4 + 4 = 0. Let p = 35 + -35. Suppose d - 58 = -pd - xn, 0 = 2n + 4. Calculate the highest common factor of 22 and d. 22 Let m = 815 - -1465. Suppose -g - 3869 = -2l - 1577, -2l = 2g - m. What is the greatest common factor of l and 104? 104 Let y(z) = 176z - 1232. Let w(v) = 25v - 176. Let r(h) = -22w(h) + 3y(h). Let g be r(7). Calculate the highest common divisor of 506 and g. 22 Suppose u - 4t + 1 = 14, 5u - 11 = 2t. Suppose 7h - 78 = -u. What is the highest common factor of 88 and h? 11 Let r be 26/((286/451)/13). What is the highest common divisor of r and 164? 41 Let z(i) = i - 3. Let q = 41 - 37. Let t be z(q). Suppose 3o - 2p + 3 = -0p, 3 = p. Calculate the highest common factor of o and t. 1 Suppose -5a - 45 = 5z, -5a - 5z - 45 = -8z. Let q be a(-3 + 8)/(-15). Calculate the highest common divisor of q and 123. 3 Let o be -7(-48)/7015. Calculate the greatest common factor of o and 21264. 24 Suppose -2s + 63 = m, -3m - s = -140 - 34. What is the highest common factor of 6840 and m? 57 Suppose -5l + y = -y - 41, 2y = 2l - 20. Suppose 1328 = ls - 2984. What is the highest common divisor of s and 176? 88 Suppose -3s - 5u + 28 = 0, -4s + 42 = -3u - 5. Suppose 5d + 745 = 5b, 70d + 721 = 5b + 69d. What is the greatest common factor of s and b? 11 Suppose -38x - 326 = -808 - 924. Let a = 659 + 155. Calculate the highest common divisor of a and x. 37 Let u be 4/11 + 6 - -1. Suppose ux = 10x + 55. Calculate the greatest common divisor of x and 10. 5 Let m = -2126 - -2148. What is the highest common factor of 781 and m? 11 Suppose 1755 = 174k - 28869. Let y = 213 + -133. What is the greatest common factor of y and k? 16 Let p = -14 + 58. Let t be (5/((-15)/(-18)))/(3 + -1). Let i be (-183)/(-9) + 2 - t/9. What is the highest common factor of p and i? 22 Let m = -119 + 115. Let w be m/(-3) + 275/75. What is the highest common divisor of 135 and w? 5 Suppose -35 = 6x - x. Let q(n) = -n*3 - 7n*2 - 12n - 22. Let z be q(x). Let g = z + -44. Calculate the highest common divisor of g and 2. 2 Suppose -315 = 29m - 36m. Suppose 0 = c - 4d - m, 3c - 129 = -c - d. Calculate the greatest common divisor of c and 6. 3 Let k = 296 - 284. Suppose 0 = 5u + 20, 2n - 11u + 15u = k. Calculate the highest common factor of n and 10. 2 Let y be 104 - (3(-12)/45 + (-38)/190). What is the greatest common factor of y and 1065? 15 Suppose -7c + 2t = -1234, -5t = 5c + 403 - 1278. Calculate the highest common factor of c and 1712. 16 Let p = 11655 - 11635. What is the highest common divisor of p and 250? 10 Let a = 369 + 29. What is the greatest common divisor of a and 3383? 199 Let k = -222 - -215. Let w(c) = c3 + 8c*2 + 4c - 6. Let v be w(k). Calculate the greatest common divisor of 40 and v. 5 Suppose 6t - 66 = -l, -4l - 4t + 3t + 149 = 0. What is the highest common divisor of l and 1788? 12 Let x = -37 + 56. Let n(z) be the second derivative of 157z4/12 + 2z3/3 - z2/2 + 26z. Let q be n(-1). What is the greatest common factor of q and x? 19 Let i be -1 - -79 - (1 + -3). Suppose 0 = 6y - 9y - 9, 0 = 4w + 3y - 151. Calculate the highest common divisor of w and i. 40 Let z be ((-15)/3)/60 - (-2)/(336/2154614). What is the highest common divisor of 342 and z? 171 Let n be (-1)/8 - ((-9633)/8)/57. Calculate the greatest common divisor of n and 483. 21 Let n be (20/7)/((-4)/(-70)). Let u be -20(-4 + 3)/5. Let k(p) = 4p2 - 4p + 2. Let i be k(u). Calculate the highest common factor of n and i. 50 Let m(j) = 28j - 172. Let v be m(6). Let h be 1 + (-4 + v - -13). Calculate the greatest common factor of h and 138. 6 Suppose -746 = -14i + 6058 - 1260. Calculate the highest common divisor of i and 836. 44 Suppose 2c + 3p = 9297, -47p + 42p = -c + 4616. Let w = c + -3191. Calculate the greatest common fact	{ "pile_set_name": "DM Mathematics" }
is 13540e - 9? 135405 In base 2, what is 1010111100110010000111110 - -1101? 1010111100110010001001011 In base 2, what is -1110000010000010101100110 - -11001? -1110000010000010101001101 In base 15, what is 86 + 22a50? 22ad6 In base 14, what is 42b1c + -11c? 42a00 In base 8, what is -2247 - -15272? 13023 In base 8, what is -2 + 54341663? 54341661 In base 6, what is -1154212 + 10002? -1144210 In base 4, what is 2011330 + 31030? 2103020 In base 4, what is 212023 - 1001222331? -1001010302 In base 12, what is -23 + -8262? -8285 In base 2, what is 101111001101 + -10100111001101? -1111000000000 In base 11, what is -26 - 7008a6? -700921 In base 8, what is 1310556 - 174? 1310362 In base 8, what is -615475 + 2050? -613425 In base 15, what is -d91b - -949? -cec2 In base 14, what is -28665 - 511? -28b76 In base 8, what is 1 + -36466201? -36466200 In base 3, what is 21 - -2022020210212? 2022020211010 In base 2, what is 110111110011000011 - -1001000? 110111110100001011 In base 10, what is -1377 - 95? -1472 In base 9, what is -50858074 + 0? -50858074 In base 6, what is -1243035 - -454? -1242141 In base 8, what is 15772 - 10540? 5232 In base 12, what is 3 + -25825b8? -25825b5 In base 8, what is 55 + 151170? 151245 In base 8, what is 222140714 - 5? 222140707 In base 15, what is 1565a8e7 - 0? 1565a8e7 In base 7, what is 362 - -6000555? 6001250 In base 15, what is -8 + -149a6? -149ae In base 13, what is -6c12b4 - 2? -6c12b6 In base 9, what is -5 - -63257780? 63257774 In base 11, what is -8881 + -16630? -24401 In base 14, what is 2673d5 + -a7? 26732c In base 11, what is -5 - 256974a1? -256974a6 In base 12, what is 56b40842 + -2? 56b40840 In base 9, what is -2046272 + 34? -2046237 In base 2, what is 10000101000001011010 - -1111001001? 10000101010000100011 In base 15, what is 17736e - -6? 177375 In base 4, what is 211232120300 + 11? 211232120311 In base 12, what is 8 - 3705181? -3705175 In base 3, what is 12211 - -1000220102? 1001010020 In base 13, what is -35ab0 - -b3? -359ca In base 14, what is -174 - 9d7? -b6b In base 9, what is 3481866402 - -5? 3481866407 In base 7, what is 2541 - 4116313? -4113442 In base 6, what is 201 + 20405040? 20405241 In base 13, what is -6b9 - 60b? -cc7 In base 15, what is 3759d - c13? 3688a In base 15, what is -535c0a - -1b2? -535a48 In base 12, what is -1696a452 + 4? -1696a44a In base 14, what is 92 + 29da3? 2a055 In base 13, what is 3 + -7a693? -7a690 In base 7, what is 1206 - -1130150? 1131356 In base 13, what is 15043 + -254? 14abc In base 13, what is -3538c - 2? -35391 In base 7, what is 2352355 - 20351? 2332004 In base 10, what is -3356594 + 0? -3356594 In base 11, what is 222035358 - -2? 22203535a In base 10, what is 5 - -5507425? 5507430 In base 9, what is -671 - -710026? 708245 In base 14, what is -1134 - -4111? 2dbb In base 12, what is 65b43 - 12a? 65a15 In base 5, what is -43 + 12442134? 12442041 In base 14, what is 1a581 + -140? 1a441 In base 14, what is 72 + -105c? -dca In base 7, what is 16320 - 1100355? -1051035 In base 8, what is -446225 - 1161? -447406 In base 10, what is -743989 + -2? -743991 In base 5, what is -32134122332 + -2? -32134122334 In base 13, what is -1b31276 - -3? -1b31273 In base 4, what is -2031 + 2201020? 2132323 In base 15, what is 3109 - 224? 2dd5 In base 5, what is -220103010021 - 2? -220103010023 In base 7, what is 33 + -513626? -513563 In base 8, what is -6623214043 + 1? -6623214042 In base 3, what is -102002 + -2022200010222? -2022200120001 In base 16, what is -117cca + a? -117cc0 In base 6, what is 322 + -43302443? -43302121 In base 9, what is 128 + 267147? 267276 In base 15, what is 4 - 7d80e6? -7d80e2 In base 11, what is -25959 - -8727? -18232 In base 16, what is -2d85 - -1e2b? -f5a In base 5, what is -3302413441 + 14? -3302413422 In base 4, what is 203011321223 - -1? 203011321230 In base 4, what is 112331 + 303333333? 310112330 In base 14, what is 359 + -11b635? -11b2ba In base 5, what is 11223101121 + -12? 11223101104 In base 9, what is -13451307 - -27? -13451270 In base 15, what is -44ab - -2da? -41c1 In base 16, what is -1839 + b96? -ca3 In base 5, what is 2423121033 + -1? 2423121032 In base 12, what is -962 + 2979? 2017 In base 5, what is -142442 + -333010? -1031002 In base 2, what is 1110101100 - 1100100010100? -1010101101000 In base 16, what is 28f7c9c - -3? 28f7c9f In base 10, what is 2 - 55531167? -55531165 In base 2, what is -111011010010001101001001110 + 0? -111011010010001101001001110 In base 3, what is 2011002211212 + -2200? 2011002202012 In base 11, what is -6867 + 88a? -5a88 In base 7, what is -1060 + -206364? -210454 In base 12, what is -43aa - 13304? -176b2 In base 16, what is 2d3a - 7724? -49ea In base 4, what is 111321321131230 - 0? 111321321131230 In base 4, what is 12100211 - -1312331? 20013202 In base 12, what is 1006816 + -9? 1006809 In base 13, what is b315 + -6813? 4802 In base 3, what is 1120220020 - 11122? 1120201121 In base 16, what is -1cf5 - -51f5? 3500 In base 12, what is 4 + -50a429aa? -50a429a6 In base 11, what is 3730357 - -5? 3730361 In base 13, what is 306070 + -46? 306027 In base 11, what is -434622 - 11? -434633 In base 10, what is 6 + 74159955? 74159961 In base 9, what is -1424136 - -107? -1424028 In base 13, what is 2ac9b04a - 0? 2ac9b04a In base 11, what is -6999 + -11190? -18079 In base 12, what is -54b - -8498? 7b49 In base 8, what is -11616201 - -4? -11616175 In base 2, what is -101 + -1111011101010100111100011001? -1111011101010100111100011110 In base 12, what is -a104 + -1a63? -bb67 In base 3, what is 200112001001022 + 2102? 200112001010201 In base 3, what is -220011121 + -1222200? -222011021 In base 16, what is -5b3f0b - 3c? -5b3f47 In base 5, what is -114 - 143230313? -143230432 In base 8, what is -27200 - -157? -27021 In base 12, what is -ab93a1 + 3a? -ab9363 In base 2, what is 11 - -10110001001111111000001? 10110001001111111000100 In base 7, what is 2 + -1634265460? -1634265455 In base 16, what is 1c57db + 6? 1c57e1 In base 3, what is -11001220111001002 - 11? -11001220111001020 In base 2, what is -10000001001100110000 + -100001? -10000001001101010001 In base 10, what is -69079 - 87? -69166 In base 8, what is -4216 - -7006? 2570 In base 12, what is -57 - 2b0136? -2b0191 In base 7, what is -3526 + 544522? 540663 In base 7, what is -262052410 + -2? -262052412 In base 11, what is -11 - -86a738? 86a727 In base 14, what is -6 + -ca073a? -ca0742 In base 16, what is 1fab67c4 - -4? 1fab67c8 In base 5, what is 2130023343 + -1? 2130023342 In base 3, what is 201012120012 + 10111? 201012200200 In base 7, what is -10012 - -24242? 14230 In base 4, what is -13310 + 1110212312? 1110133002 In base 3, what is -12 - 2102112110100021? -2102112110100110 In base 10, what is -219058662 + -4? -219058666 In base 6, what is 2032420 + 24? 2032444 In base 2, what is -1010000111111100110011000 - -10? -1010000111111100110010110 In base 3, what is 12 + 1010222222120011? 1010222222120100 In base 3, what is 120 - -111001121012220? 111001121020110 In base 11, what is -3 + 36504aa8? 36504aa5 In base 15, what is 7d4d - 16c? 7bd1 In base 6, what is -14244314 + -12554? -14301312 In base 5, what is 2111 + -101413023? -101410412 In base 7, what is -12 + 105032561? 105032546 In base 3, what is -10112101 - -11002120110? 10222001002 In base 6, what is -153205 - -123204? -30001 In base 10, what is -749529 + -7? -749536 In base 12, what is 3b9854b + -8? 3b98543 In base 3, what is -1120222002002 - -101? -1120222001201 In base 13, what is 3 - -3321ab69? 3321ab6c In base 4, what is 2101 - -1302122322? 1302131023 In base 4, what is 2012223 + 1130? 2020013 In base 9, what is 133 + 73710? 73843 In base 13, what is -1573b + 3b0? -1535b In base 2, what is 100111001110001 - 1001100011111? 11101101010010 In base 3, what is -1211101212102120211 + -11? -1211101212102120222 In base 12, what is -6748b8 - 9? -674905 In base 13, what is -223 + -1c243? -1c466 In base 4, what is -13 - -10133130113? 10133130100 In base 2, what is 100111111 - 10100001110100010111? -10100001101111011000 In base 4, what is -11 + -33131102213310? -33131102213321 In base 4, what is -101022211223 - -30? -101022211133 In base 7, what is -1032 - -20441216? 20440154 In base 4, what is 1031031230301 + -10? 1031031230231 In base 7,	{ "pile_set_name": "DM Mathematics" }
teger. -10 Let h = -141.02 - -2.02. Let f = 73 + h. Let t = f - -58.4. Round t to the nearest integer. -8 Let j = 18 - 11. Let c = -1.3 - 2.1. Let g = j + c. Round g to the nearest integer. 4 Let y = -15 + 15.01. Let n = 1.87 + -2.5. Let q = n + y. Round q to 1 dp. -0.6 Let c = 886.8 + -821. Let o = 6.8 - c. Let r = 59.0162 + o. Round r to three dps. 0.016 Let l = 10.8 + 3.2. Let k = l - 31. Let p = k + 16.99999948. What is p rounded to 7 dps? -0.0000005 Let v = -78 + 82. Let c(h) = 278124h3 + 4h*2 - 3h + 12. Let i be c(v). What is i rounded to the nearest 1000000? 18000000 Let t = 28.36 - 28.41692. Let v = -0.055 - t. Round v to 4 dps. 0.0019 Let y = 279.999990584 + -280. Round y to six dps. -0.000009 Let w = 6 + 10. Let o = -23 + w. What is o rounded to zero dps? -7 Let o = -1.19 - -1.18824. Round o to four decimal places. -0.0018 Suppose -16q + 18q = 11797266. Suppose 5y = 3g + 21601370 + q, 4y - g - 22000001 = 0. What is y rounded to the nearest 1000000? 6000000 Let t = -29588469.0173 + 23635081.017484. Let i = -5953413 - t. Let o = i - -25. What is o rounded to 5 dps? -0.00018 Let n = 80.956281588 + 0.043744412. Let w = -81 + n. Round w to five decimal places. 0.00003 Let x = 1.1 + -6.6. Let o = x - -5. Let l = 0.49999984 + o. What is l rounded to 7 decimal places? -0.0000002 Let x(o) = -2o - 7. Let u be x(-11). Let r be u(-9 - -4) - 0. Round r to the nearest 10. -80 Let p = 6200429768530.200097 + -6200511865146.2. Let o = p + 82096662. Let d = o - 46. Round d to five dps. 0.0001 Let z = -4.06 - -8.7. Round z to 0 dps. 5 Suppose 61w = 6385 + 69865. Round w to the nearest one hundred. 1300 Let z = 20971 + -20970.9999981831. What is z rounded to seven decimal places? 0.0000018 Suppose -x - 3 = -4q, 28 = 3x + x + 4q. Suppose 3m = 4m - 5a - 412, 0 = 4m + xa - 1773. What is m rounded to the nearest 100? 400 Let c = 25.95 + -20.66. Round c to one dp. 5.3 Let i be 110399988/2 + -3 + 9. What is i rounded to the nearest 1000000? 55000000 Let s = -17 - -16.9894. What is s rounded to 2 decimal places? -0.01 Let q = -2.86351 - -3.143488. Let m = 278.72 + -279. Let r = m + q. What is r rounded to 5 dps? -0.00002 Let t = -46 + 46.028. Let f = t - -0.077. What is f rounded to 2 decimal places? 0.11 Let i = -32.3 + -4.7. Let q = i - -55. Let f = q + -17.05. Round f to 1 decimal place. 1 Suppose 194m + 1568000 = 190m. What is m rounded to the nearest one hundred thousand? -400000 Let u = 7.3 + -0.41. Round u to 1 dp. 6.9 Let i = -8510 + 3090. What is i rounded to the nearest ten thousand? -10000 Let u(x) = 3549x - 1. Let v be u(8). Let q = -74991 + v. Round q to the nearest 1000. -47000 Let z = 4.69302 - 4.71. What is z rounded to three decimal places? -0.017 Suppose 0 = 2a - 55148 + 1548. What is a rounded to the nearest 10000? 30000 Let h be (4/(-18))/((-14)/126)-4. Suppose -2s + 7s + 8799982 = 4g, 5s - g = -8799988. Let t be s/h + 6/24. Round t to the nearest ten thousand. 220000 Let v(g) = g2 + 19g - 1722. Let r be v(0). What is r rounded to the nearest one hundred? -1700 Let i be 10/(1 - -1) + -2. Suppose -3g - 1826998 = y, -5y + 2485700 = -ig + 658690. What is g rounded to the nearest 100000? -600000 Let z = 1517.1185255 + -1509.0185. Let b = 8.1 - z. What is b rounded to 6 decimal places? -0.000026 Let k = 1.4858 - 0.9447. Round k to two dps. 0.54 Let m = 167.9 - 167.4792. Round m to two dps. 0.42 Suppose -s - 2 = -2s. Let t be ((-35)/s)/(2(-2)/(-256000)). Round t to the nearest one hundred thousand. -1100000 Let m = 105 - 104.95. Let w = -0.046 + m. Round w to three decimal places. 0.004 Let o = -5365.999997487 + 5366. What is o rounded to 7 decimal places? 0.0000025 Let d be (-12274)/(-9) + (-22)/(-99) + 3. What is d rounded to the nearest one hundred? 1400 Let f = -4.64 + 0.14. Let h = f - -4.31. Let c = -0.19009 - h. Round c to five decimal places. -0.00009 Let l = 0.13329787 - 59.12890787. Let i = 59 + l. Round i to 3 dps. 0.004 Suppose -810080 = -5o + 848495. Suppose -i - o = 228285. Round i to the nearest 100000. -600000 Suppose 173327 = 15x + 2327. Round x to the nearest 10000. 10000 Let o = -4.2 + 4. Let u = 17.318 + -17.5. Let z = u - o. What is z rounded to 2 decimal places? 0.02 Let y = 91.200958 + -91.001. Let j = 0.2 - y. What is j rounded to 5 dps? 0.00004 Suppose -4r = -4 - 16. Suppose -v + 4 = c - 1, -2c = rv - 10. Suppose -2o = -cm - 0o - 160, -80 = 3m + 2o. Round m to the nearest 10. -30 Let m = -3183 + 1870. Round m to the nearest 10. -1310 Let b = -2.6 + 2.48. Let c = -153.1216 + 153. Let f = c - b. What is f rounded to three dps? -0.002 Let z = 676456.6999 + -676625. Let n = z + 168. Let s = -0.318 - n. Round s to three dps. -0.018 Let d = -310.000696 + 310. Round d to 4 dps. -0.0007 Let g = 0.05 + -21.05. Let o = -21.1 - g. Let m = 0.2 - o. What is m rounded to zero decimal places? 0 Let l = -1.113 + 1.16. Let a = l - 0.074. Let h = 0.343 - a. Round h to 1 decimal place. 0.4 Let m = -1595 - -382. Let f = m + 1212.99999399. Round f to 6 dps. -0.000006 Suppose 5r - 11 - 14 = 0. Suppose -r = -a - 1. Suppose -3w - 4320006 = at, 3t + 4w = -1614291 - 1625717. What is t rounded to the nearest 100000? -1100000 Let r = 28.002047 - -145.998723. Let v = 174 - r. What is v rounded to four decimal places? -0.0008 Let c = 44234919.000196 - 44234796. Let l = c + -123. What is l rounded to 5 dps? 0.0002 Let z = 0.4295 + -0.385. What is z rounded to three dps? 0.045 Let t(m) = m*2 - 2m - 293819. Let y be t(0). Let d = -17819 - y. Round d to the nearest ten thousand. 280000 Let c be 67200014/21(-6)/(-1). Let z(x) = -2x + 30. Let a be z(17). Let s be c/12 + a/12. Round s to the nearest one million. 2000000 Let x = -42 - -42.34. Let z = -397967.3400208 + 397967. Let g = z + x. What is g rounded to 6 dps? -0.000021 Let t = 4334509 + -4334508.986662348. Let y = t - 110.013424652. Let c = y - -110. Round c to five dps. -0.00009 Let q = 6.83 - 7. Let l = q - 0.13. Let f = -0.335 - l. Round f to 2 dps. -0.04 Let r = 257.9 - 258.1031. Round r to three decimal places. -0.203 Suppose d - 9350 = -3p + 688, -4d - 2p = -40192. What is d rounded to the nearest 100? 10100 Let z = 6.72000302 - 6.72. What is z rounded to six dps? 0.000003 Let d = -31 - -36. Suppose dj = -70 - 10. Let l(f) = 12890f2 - 10f. Let v be l(j). Round v to the nearest 1000000. 3000000 Suppose 6u + 2u - 55532664 = 0. Let j = 5858417 + u. Round j to the nearest 1000000. 13000000 Let s = -584 + 583.9999277. What is s rounded to five dps? -0.00007 Let o = -1.87 + 23.47. Let k = 21.729 - o. Round k to 2 dps. 0.13 Let r = -59.58 + 59.590238. What is r rounded to three decimal places? 0.01 Suppose -q + 348704 = 124478. Suppose 3a = v + 1970349 + q, -2194595 = v + a. Let m = 844590 + v. Round m to the nearest 100000. -1400000 Let q = -511 + 510.999994525. What is q rounded to 6 dps? -0.000005 Let x = -19 + 19.36. Let o = x - 0.35944. What is o rounded to 4 decimal places? 0.0006 Let c = -9 + -16. Let x = -145878411.9999948 + 145878437. Let s = x + c. What is s rounded to 6 decimal places? 0.000005 Let z = -86544.059 - -86588. Let c = -44 + z. What is c rounded to 2 dps? -0.06 Let p = 0.01 + -9.01. Let k = p - -8.97. Let c = 0.012 - k. What is c rounded to two dps? 0.04 Let f = -0.044 + 0.312. Let a = 1.562 + f. Round a to 1 dp. 1.8 Let b = -330380 + 70380. Round b to the nearest 10000. -260000 Let p = 32.99999968 - 33. Let d = 0 + p. Round d to 7 decimal places. -0.0000003 Let f = 46 - 43. Suppose fv = 2v + 3r + 1629991, -5r = -v + 1629985. What is v rounded to the nearest one hundred thousand? 1600000 Let b = 87.99812 - 88. What is b rounded to four dps? -0.0019 Let c = 57.54 + 1.46. Let i = -79788.7452 + 79847.74520051. Let m = c - i. What is m rounded to seven decimal places? -0.0000005 Let p = -1994.7 + -81.3. Let f = -2076.00001171 - p. Round f to 6 decimal places. -0.000012 Let g = -121 - -182. Let k = -0.0919 - -55.3919. Let o = g - k. Round o to zero dps. 6 Let m = -116 + 116.094. Let h = -32.012142 + 32.106. Let c = h - m. What is c rounded to 5 dps? -0.00014 Let y = -915 + 3428. Suppose -7733 = 3x - y. Round x to the nearest one hundred. -1700 Let a = 5804 - 1195.6. Let o = a - 4857.61. Let s = o + 248. Wh	{ "pile_set_name": "DM Mathematics" }
when 2169 is divided by l. 81 Suppose 0 = -5p + 3s - 965, 5s = 5p + 1191 - 236. Let t = p - -234. Calculate the remainder when t is divided by 17. 4 Let z(t) = 10t2 + 16t - 519. Calculate the remainder when z(-11) is divided by 75. 65 Let u be 14/91 + (-3426)/(-39). Let o = u + -89. Calculate the remainder when 29 is divided by 4/(-6)-3 - o9. 7 Let m = -944 + 1276. What is the remainder when m is divided by 42? 38 Let l = 1475 + -1420. What is the remainder when 490 is divided by l? 50 Let m(p) = -p*3 + 22p*2 + 7p - 283. Calculate the remainder when m(14) is divided by 139. 132 Suppose -2054 - 6935 + 916 = -13k. What is the remainder when k is divided by 125? 121 Let g = -513 + 1040. Calculate the remainder when g is divided by 33. 32 Suppose 4u - 2u - 44 = 5h, 5u = -5h + 75. Suppose -5y + 4f = -0f - 1770, 4y - 1416 = -5f. Calculate the remainder when y is divided by u. 14 Let l = -1 + 2. Suppose -41 = -a - 47, 3r - 120 = 3a. What is the remainder when (l - -1)/(-2) + 68 is divided by r? 33 Let l(d) = -9d*3 + 14d + 67. Calculate the remainder when l(-4) is divided by 86. 71 Suppose -b + 1102 = 5y, -48b + 2y = -50b + 2204. What is the remainder when b is divided by 16? 14 Suppose 7k + 22826 = 32k + 76k. Calculate the remainder when 635 is divided by k. 183 Let z(a) = -3a*3 + 72a*2 + 13a - 170. What is the remainder when z(21) is divided by 22? 2 Calculate the remainder when 202 is divided by (-720)/(-54)(-390)/(-50). 98 Let c(k) = -16k*3 - 14k*2 - 31k - 75. What is the remainder when c(-4) is divided by 397? 55 Let b = 884 + -878. Calculate the remainder when 247 is divided by (-2)/b + (-5096)/(-78). 52 Suppose 333v = 89239 + 233438. What is the remainder when v is divided by 155? 39 Let z = -12 + 33. Let j = -112 - -120. Suppose -jy + 1311 - 319 = 0. What is the remainder when y is divided by z? 19 What is the remainder when 1891 is divided by (1 + 243/21)(378/12)/9? 43 Calculate the remainder when 527 is divided by (-1 + -9)((-45)/(-18) - 3). 2 Suppose -92f + 3633 = 81f. Calculate the remainder when 488 is divided by f. 5 Suppose 0 = 2o - 2k - 44, 2o + 32 = -k + 73. Suppose -3f = 2r - 61 - 12, 4r = -3f + 137. What is the remainder when r is divided by o? 11 Suppose -5j - 3x + 6x - 7 = 0, -5x = -5j - 5. Suppose -2r + 42 = 10. What is the remainder when ((-152)/r)/(1/j) is divided by 10? 9 Calculate the remainder when 1(8 + 21/6)14 is divided by 14. 7 Suppose -75p + 717698 = -116227. Calculate the remainder when p is divided by 83. 80 Suppose 6t - 185 - 463 = 0. What is the remainder when 287 is divided by t? 71 Suppose -2y = -0y + 4t - 58, 4y - 152 = 4t. Suppose -4195 = 4g - o - 4611, -4g - 3o + 416 = 0. What is the remainder when g is divided by y? 34 Let r = 10387 - 10375. Calculate the remainder when r is divided by -1 + 3/1 + 1. 0 Let m(h) = 4h + 37. Let i(v) = -v*2 - v - 19. Let f(n) = -5i(n) - 2m(n). What is the remainder when 27 is divided by f(0)? 6 Suppose -3552q - 7700 = -3562q. Calculate the remainder when q is divided by 77. 0 Let c(j) = 7j*2 - 8j + 15. Let t be c(4). Suppose -3s + t + 73 = 0. Suppose 0 = 4l - 51 - 29. What is the remainder when s is divided by l? 16 Let k(d) = 6d2 + 153d + 40. What is the remainder when k(-26) is divided by 77? 41 Let v = -20028 - -20147. What is the remainder when 4639 is divided by v? 117 Let f = -42399 - -45117. Calculate the remainder when f is divided by 16. 14 Let h = 71 - 51. What is the remainder when ((74 - 1) + 5)1 is divided by h? 18 Let b = -23 - -31. Suppose 4u + 112 = bu. Let p = -155 - -170. What is the remainder when u is divided by p? 13 Let v = -531 + 671. What is the remainder when 4337 is divided by v? 137 Let x(n) = -4n + 15. Suppose 9d - 10d = -9. Suppose q + d + 13 = 3r, q + 12 = r. What is the remainder when x(q) is divided by 25? 18 Let z = -824 - -868. What is the remainder when 78 is divided by z? 34 Let v(z) = -11z - 2. Let p(h) = -45h - 9. Let n(u) = -5p(u) + 21v(u). Calculate the remainder when 62 is divided by n(-3). 20 Let f = 3 - -7. Suppose -5c = 4z - f, -2c - 4z - 7 = 1. Calculate the remainder when c is divided by 1. 0 Let f(c) = -c3 + 4c*2 - 7c + 88. Let w = 226 + -90. What is the remainder when w is divided by f(5)? 24 Suppose -3k = 2s - 1604, -s + 1175 = 3k - 425. What is the remainder when k is divided by 19? 0 Let g = 13425 - 13364. What is the remainder when 26532 is divided by g? 58 Let t(x) = x3 + 6x*2 - 11x - 12. Calculate the remainder when (-3484)/(-21) + (-28)/(-294) - (-14 - -16) is divided by t(-7). 4 Suppose 0 = -3f + n + 529 + 277, 2f - 4n - 544 = 0. What is the remainder when f is divided by 90? 88 Suppose -13s + 10164 = 12s + 17s. What is the remainder when s is divided by 17? 4 Suppose -t = 4f + 15, -t + 3f = 2t. Suppose -88 = 4i + 32. Calculate the remainder when 123 is divided by ((-5)/(-2))/(t/i). 23 Suppose -7 = 4f - 143. Let w(n) = -n + 7. What is the remainder when (f/4)/(-3 + 2)-2 is divided by w(3)? 1 Let g = 85525 + -85468. Calculate the remainder when g is divided by 162/31/2. 3 Calculate the remainder when -927(-14 - 0 - -13) is divided by 19. 15 Let h = 25827 - 25583. Calculate the remainder when h is divided by 15. 4 Calculate the remainder when 37/(-3)(-12)/4 is divided by (24/(-40))/((-1)/25). 7 Suppose 16354 - 1234 = 29f - 14866. What is the remainder when f is divided by 115? 114 What is the remainder when 178 is divided by (40/30)/(-5(-8)/1860)? 54 Suppose 3h + n - 95 = 0, -n + 89 = 3h - 3n. Suppose -242w = -247w + 935. Suppose -52l = -35l - w. What is the remainder when h is divided by l? 9 Let f(z) be the second derivative of z*5/20 + 13z*4/12 - 11z*3/2 - 5z*2 - 18z. Calculate the remainder when f(-15) is divided by 9. 8 Suppose 1562 = 4p - 3o, -4o = 5p - 1528 - 471. What is the remainder when p is divided by 198? 197 Suppose -111s + 378 = -90s. Let j be (7/7)/((-2)/(-22)). Let h = j - 0. What is the remainder when s is divided by h? 7 Calculate the remainder when -6 - (-552)/((-48)/(-6)) is divided by 35 + 4(-1 + 1/2). 30 Let r(i) = -i3 - 3i*2 + 3i - 5. Suppose -96292q = -96229q - 441. Calculate the remainder when r(-5) is divided by q. 2 Suppose i + 610 = 3v, -19i = -15i - 20. Calculate the remainder when 1229 is divided by v. 204 Let s(u) = 5u*2 + 6u - 28. Let g be s(-11). Let c = g + -415. What is the remainder when c is divided by 34? 28 Let j(a) = -a*3 + 7a*2 + 3a - 9. Let c be (1 + (-5)/2)/(9/300). Let y = -44 - c. Calculate the remainder when 134 is divided by j(y). 44 Calculate the remainder when 966 is divided by (-204)/(-8)(23 + -21). 48 Let a = -13120 - -14050. What is the remainder when a is divided by 106? 82 Suppose -c = 7v - 2v + 21, 4c = -v - 27. Let t = -5 + 9. What is the remainder when 2-1 - ((3 - 10) + c) is divided by t? 3 Suppose -172s + 170s = 303s - 305610. What is the remainder when 1024 is divided by s? 22 Let o = -146 + 52. Let s = 100 + o. What is the remainder when 17 is divided by s? 5 Calculate the remainder when 6371 is divided by (11/231450)/(32/14 - 2). 71 Let w(l) = 9l + 6. Suppose 0 = -4x - 2i - 10, -2i - i - 11 = 5x. Calculate the remainder when w(8) is divided by (-1216)/(-57) + x/3. 18 Calculate the remainder when 4(-10 + 594/24) is divided by (0 - -2) + -3 + 11. 9 Let g be (-1)/(-3 - 14/(-5)). Suppose 12j + gk = 9j + 192, -4j - 3k + 267 = 0. What is the remainder when 344 is divided by j? 68 Let k be (-12)/36 - (192/9)/(-4). Suppose -q - 22 + 179 = -3s, 0 = kq + 4s - 728. What is the remainder when q is divided by 32? 20 Suppose -f = -9 - 27. Let d be 146/(-9) - (-16)/72. Calculate the remainder when (-444)/d4 - 7 is divided by f. 32 Let x = 991 - -4892. What is the remainder when x is divided by 6? 3 Suppose 0 = 13p + 4p. Suppose -d - 9 = -3j - 4d, -3j + 2d + 14 = p. What is the remainder when (-20)/(-2) + (-2 - -1) is divided by j? 1 Let f = 6350 + -6321. What is the remainder when 174 is divided by f? 0 Let i = 12 + -12. Suppose 3f + 4d - d - 99 = i, 4f - 147 = -d. Let n = f + 33. Calculate the remainder when n is divided by 24. 23 Let s(y) = -8y + 48. Let o be s(6).	{ "pile_set_name": "DM Mathematics" }
)? 7 Evaluate 132/3320/(-5)58/(-16). 58 Evaluate (335/(-90))/((-2)/((-14)/(-49)))-582. -97 What is -345((-43)/15)/(-43)? -23 (((-2720)/840)/(6/7))/((-5)/(-45)) -34 Calculate (1157/(-445))/135/3. -1/3 What is (160/1820)/((-78)/(-819))? 12/13 What is 4212/(-810)9/((-36)/(-20))? -26 What is the value of 26/8(-10)/((-4)/3441/1176)? 65 Calculate ((-11)/11)/((-45)/5)(-168)/8. -7/3 What is the value of ((-6972)/3320)/((-9)/120)? 28 What is the value of ((-8442)/(-46431))/(2/(-352))? -32 What is the value of (-126)/5731882/(-5873)? 12 What is the value of -100(-31)/46521/525? 4/15 Evaluate ((-18)/(-3))/((-168)/3724019). -70 Evaluate (-966)/(-23)(24/(-8))/3. -42 What is the value of (-405)/(3(-30)/10)? 45 (-1(6/3)/6)/((6308/(-15687))/(-76)) -63 What is (-9)/4(-103488)/(-3696)? -63 Evaluate ((-3)/14)/(((-102)/10)/(518/370)). 1/34 (5/3)/((-18245)/(-153258)) 14 (-7)/((-2772)/55)9/5(-7)/(-21) 1/12 Calculate ((102/68)/(1035/30))/(14/(-7)). -1/46 ((-18)/40-5)/(37/(62160/90)) 42 What is the value of (-33)/(-117)(-15925)/2450? -11/6 Calculate 2064/40(-8215)/4929. -86 What is ((-1)/(-10119/(-340)))/((-7)/112)? 32/7 ((-7099)/(-1895433))/((2/4)/((-2)/(-2))) 2/267 What is the value of 5/(-570)(-5436)/(-453)? -2/19 -7(-36)/(-126)(93/(-434))/((-60)/(-21)) 3/20 What is the value of (-4)/(-16)(-41615)/(-2378)? 35/8 (-172)/((-38184)/(-7215))((-6)/1)/3 65 Evaluate (-3258)/(-35295)(-39)/(-45). 2/25 Evaluate ((-75)/225)/(2/121)(-340)/(-17). -40 What is (-616/240)/(((-108)/45)/6)? 1 What is (39/90)/(20826/(-2403))? -1/20 What is the value of (16(-51)/(-7616))/((-1)/20)? -15/7 Evaluate 5/10(-57)/(-4)(-1648)/618. -19 What is (((-1062)/9027)/((-8)/17))/(78/16)? 2/39 Evaluate (-4(-177)/36264/(-88))/(-1). 59 What is (-468)/2016(-220)/143? 5/14 Calculate (80/12)/(((-627)/(-33))/(-228)). -80 What is the value of ((-4)/116(-8)/(-12))/((-17)/102)? 4/29 Evaluate 25/245684/31725. 18 Evaluate 1294/((-38728)/(-1545)). 45 Evaluate 1396/5235(-5)/(-4)0. 0 What is 39/61106/(-3445)-90? 18 What is the value of (2340/(-30))/(-26)(-3)/(9/4)? -4 What is the value of 2/2238156/10868? 12/11 What is (-2145)/39012/(-44)? 3/2 Evaluate (621/(-11))/3(-252890)/68970. 69 What is (-2)/2(59015/(-165))/29? 37/3 What is ((-54)/4)/(27/(-234)4117/(-216))? -54 ((-4841)/1316)/(-103)-14 -1/2 Calculate 265/(-53)(-112)/35060/(-8). -12 Evaluate (((-2)/(-91))/1)/(15(-12)/(-1512)6). 2/65 Evaluate ((-36)/(-132))/((-258)/(-10406)). 11 52767/3042-9 -118 Calculate 93/4968(-12)/(-45)-5. -2 ((-13)/26025)/(50/240) -6 Evaluate (-225)/(11605/(-18568)16/15). 75 Calculate (3408/355)/((-21)/70). -32 What is (-664)/(-83)17/8-1? -17 What is the value of ((-1)/(-2)-2)/(1239/(-35931))? 29 Calculate 22((-12)/(-2))/(31356/(-402)). -22/13 (-3004)/22532/8-87 29 What is ((5/5)/(20/2))/((-40278)/14385)? -1/28 Calculate (((-28)/3)/(-2))/((-66)/(-9)). 7/11 (-8(-2)/(-3556))/(642/2247) -2/127 Calculate (((-138)/(-24))/(1012/44))/((-1)/178)-2. 89 Calculate ((-65)/(-7))/((-12)/1778-127). 65/6 What is 1/(((-13)/26-2)/(-88))? -88 Evaluate ((-7)/(-1)(-6)/84)/((-30)/(-40)-12). 1/18 What is the value of (8976/(-476))/((-8)/((-504)/(-27)))? 44 What is ((-14)/56)/(1826/(-176))? 2/83 What is the value of ((-1176)/(-144))/((-12460)/20025)? -105/8 What is the value of 1353(4847/(-407))/(-131)? 123 Evaluate (-18)/5170/51(-8)/56-14. -24 What is the value of 18/2(-1)/15-3? 9/5 Calculate 49/((15540/40)/111). 14 Evaluate (((-70692)/685)/(-43))/((-1)/(135/(-6))). 54 What is ((107/428)/(14/32))/(10/10)? 4/7 Evaluate ((-10)/(-15))/(3044/(-205470)). -45 What is the value of (6786/21489)/(28/266)? 3 What is (56350/12888/21)/(((-56)/(-3))/(-4))? -25/7 What is ((169/(-507))/(1/(-15)))/((-215)/86)? -2 What is (-230)/104(68/(-16))/17? 23 What is the value of ((-36)/(-352))/(648/384)? 3/22 Calculate ((-894012)/(-12845))/((-5)/((-50)/(-8))). -87 What is (58014/21096)/((-1738)/16)? -2/79 (748/448)/(195/(-20)-4) 1/52 -12((-39)/2)/(8/((-1120)/315)) -104 18/45(1/(12/600))/(-8) -5/2 Evaluate 1(-8)/(-70)(10/18)/(524/(-2358)). -2/7 Evaluate (3/(-3))/(-11(-2)/(-154)91). 1/13 Evaluate (-24(-17)/(-1530))/((-28)/60). 4/7 What is 2677/(-500599)111? -1/17 Evaluate (-7)/((-21)/138)14(-99)/924. -69 (((-33033)/154)/(-143))/((-2)/((-28)/1)) 21 (-24)/(-20)637/(-182)400/28 -60 What is 876/73015/(-1251)? -2/139 What is the value of (1519/(-4340)15/(-14))/((-1)/((-28)/(-259)))? -3/74 What is the value of (-28)/((-22)/(-792)-21)? 48 Evaluate -2049/(490/12)((-60)/9)/(-5). -32 (-784)/(-224)((-80)/(-644))/10 1/23 Calculate 1650((-6460)/(-76))/2550. 55 What is (-4)/(8/(-90))((-5775)/(-105))/55? 45 Evaluate (104/(-156))/((-12/(-45))/(228/380)). -9 (-1)/((-10)/6)(-228)/(283176/4830) -7/3 (8/28)/((114/(-2527))/1) -19/3 ((5/(-45))/((-134)/(-6)))/(2025/(-6075)) 1/67 What is the value of 134/(-6)(3117/10390)/((-2)/(20/1))? 67 What is the value of -1(177/177)/(531)? -1/53 Evaluate 44/((-8)/25)((-135)/54)/5. 25 Evaluate ((-75)/75)/((-3)/(-7)). -7/3 Evaluate ((-34)/(-4))/((-10)/52013). -34 -55(-85)/2431026 5 What is the value of (-60)/(-140)147/1134? 1/18 Calculate ((-444)/(-3330))/((-10)/(-6)). 2/25 Calculate (-325)/(-39)53040/8500. 52 89/((-24030)/1440)6/(-8)6 24 What is ((56398/(-1903))/326)/((2/(-2))/55)? 5 What is the value of 7/(-14)18(-1995)/(-189)? -95 What is the value of (-14)/30(-9)/(630/(-20))? -2/15 15684/(-16991)364/32(-62)/(-7) -93 Calculate ((77/12)/7)/(((-5)/28)/((-4000)/4200)). 44/9 Calculate 50/(-3)608/3040. -10/3 ((16/(-6))/2)/(964/1205) -5/3 Calculate -7((-429)/(-26))/((-231)/(-176)-4). 22 29/(-15)(-5)/(-6)(-6674)/710 47/5 Evaluate ((3/(-15))/(6/(-5)))/(54/((-4104)/76)). -1/6 What is the value of (-206558/2030)/((1/(-2))/((-6)/12))? -59 What is (250/25)/((87/2610)/(2/(-12)))? -50 1484/636(27/(-63))/((-11)/7) 7/11 -6(-12)/(-16)80/12(-1624)/580 84 ((-1)/(-23))/(33/363858/117) 3/46 Evaluate ((14/(-28))/((-2)/7))/(((-135)/48)/(-45)). 28 Evaluate (8/2)/(((-84)/32)/(2779/1588)). -8/3 Evaluate (-63)/(-24)7560/1470. 27/2 Evaluate (-10)/(-416)7811/((-55)/(-120)). 45 What is ((-1160)/(-170))/(((-10)/34)/((-90)/36))? 58 What is (-5(-6)/45-3)/(((-888)/37)/(-48))? -4 What is the value of (5/((-250)/15))/((-1602)/3560)? 2/3 ((-5)/138/(-40))/(23/303622) 6/13 Calculate 39403/12124(3/(-3))/(3/(-36)). 39 Calculate -4134/(-7)(-392)/(-112). 24 What is 2158/(-8)(-3)/((-79)/((-4898)/(-93)))? -79 What is ((-255)/((-397800)/(-240)))/((-158)/13)? 1/79 What is ((-7472)/48568)/((-5)/10)? 4/13 (-12)/(60/65)4002/(-1131) 46 Evaluate (27/(-8))/(270/72)16/216-66. 22/5 (((-16200)/27)/(-60))/(20/48) 24 Calculate ((-3)/4)/(6388/1597). -3/16 Evaluate ((-27)/(-18)2)/(-4)(-8)/129. 2/43 What is the value of ((-450)/((-10)/(-2)))/((-38)/(-1577)83)? -45 What is the value of ((-466)/3495(-465)/(-6))/(3/(-18))? 62 Evaluate (162/(-117))/9298506/(-534). 86 Evaluate 1512/(-54)(1/5)/((-1572)/(-41265)). -35/2 Evaluate (-17)/((-578)/(-459))((-2744)/63)/14. 42 What is 11/3((-450)/40518)/66? -10/9 Calculate (115/(-50))/(21635/1120). -2/45 Calculate (42/8)/(40/(7360/69)). 14 What is ((-1392)/(-870))/((-1312)/40)? -2/41 What is the value of ((-9770)/(-7816))/(9/(-30))? -25/6 What is the value of 5((-27)/(-3))/45(-19)/(532/(-70))? 5/2 What is the value of (-110556)/(-4482)(-9)/10(-5)/3? 37 ((-247)/(5928/(-18)))/((-894)/(-16)) 2/149 Evaluate 1/((-10)/(-8)(371316/290)/(-33)). -2/97 Calculate (656208/1520736)/((-18)/(-219)). 21/4 (154/(-220)-1054/21)/(-2) -9 What is the value of (-1370)/(-1096)3/((-810)/(-12))-4? -2/9 Calculate (((-660)/45)/(-22))/(((-4)/(-500))/((-9)/(-30))). 25 Evaluate ((-3)/(-8))/((5229/42)/(-83)). -1/4 ((250/(-120))/((-50)/540))/((7/2)/(-7)) -45 What is 77/(-3)(-20)/(-15)((-552447)/1738)/111? 98 4420/13(68/(-600))/((-12)/(-60)) -136 What is (-9532)/(-1622823)6/4? 2/227 12/84707/202(-79)/(-2)-4 -79 What is the value of (169/54)/((460/6348)/(10/(-4)))? -92 What is ((-68635)/(-518))/(10/(-4))? -53 Evaluate (340/(-51))/((-753380)/1626). 2/139 (-8-321/(-336))/((-2)/(-3)) -8/7 Calculate ((-3645)/945)/((-1)/7). 27 Calculate 10/1563591/(-5292). -19/7 Calculate (-5928)/1170418/168(-245)/14. 38 Calculate ((-77)/14)/(154/(-56))	{ "pile_set_name": "DM Mathematics" }
at is -10000 + 101110? 11110 In base 8, what is 1733736 + 5? 1733743 In base 12, what is -3 + -109242? -109245 In base 16, what is 12 + 390? 3a2 In base 5, what is 14 + -2304? -2240 In base 15, what is d0bc - 44? d078 In base 5, what is 111400011 + 0? 111400011 In base 3, what is -2001022101 + -10? -2001022111 In base 5, what is 2 - 344210? -344203 In base 7, what is 1305601 + -52? 1305516 In base 10, what is -2 + -219126? -219128 In base 3, what is 211002221 + -12? 211002202 In base 11, what is 448a - 3? 4487 In base 12, what is -1 + -3b27? -3b28 In base 16, what is b2 - -11e? 1d0 In base 13, what is -1b - 71c? -73a In base 5, what is 2 + -2421322? -2421320 In base 12, what is 30651 + a? 3065b In base 4, what is -11 + 10300320? 10300303 In base 4, what is -1321 + 121130? 113203 In base 10, what is -25 + 15616? 15591 In base 14, what is 5 - -120aa6? 120aab In base 16, what is 5 + 79c1? 79c6 In base 15, what is 55 - -248? 29d In base 3, what is 11212111212 + -10? 11212111202 In base 4, what is -12302 + -22220? -101122 In base 8, what is 14673 - -2? 14675 In base 6, what is -3 - 4250351? -4250354 In base 6, what is -53014 + 233? -52341 In base 9, what is 63 + 237? 311 In base 3, what is -22210200 - -11? -22210112 In base 16, what is -2f29 + 3? -2f26 In base 15, what is 79be - -1? 79c0 In base 3, what is -22120012 + -21? -22120110 In base 9, what is -1722787 - 0? -1722787 In base 6, what is 253 + 110015? 110312 In base 13, what is 2 + -5724? -5722 In base 13, what is 88 + 312c? 31b7 In base 3, what is 1 - 212102202202? -212102202201 In base 8, what is 11 + -12256? -12245 In base 2, what is -11101011 - -1110000101? 1010011010 In base 3, what is 22100000220 - 2? 22100000211 In base 7, what is -3 - -2461? 2455 In base 2, what is -101110 - -11001010110110? 11001010001000 In base 7, what is 0 + 1101561? 1101561 In base 3, what is 10 - -200002112? 200002122 In base 7, what is 10 + -32411? -32401 In base 12, what is -a - a63? -a71 In base 11, what is -13 - 21622? -21635 In base 16, what is -5e9a2 + 1? -5e9a1 In base 6, what is 230 + -2012? -1342 In base 9, what is -5851811 - -3? -5851807 In base 2, what is 0 - -1110010100111011? 1110010100111011 In base 7, what is 2 - -56401? 56403 In base 4, what is -321233 + -1? -321300 In base 2, what is 10100 - 11100111101? -11100101001 In base 12, what is -5 - -513790? 513787 In base 16, what is 5f420 - 4? 5f41c In base 15, what is 39a04a + -3? 39a047 In base 8, what is 1 - 3004467? -3004466 In base 6, what is 104233 - -10? 104243 In base 8, what is -1 + -657731? -657732 In base 13, what is 1436942 + -1? 1436941 In base 8, what is 1100 - -6424? 7524 In base 4, what is -101201311033 + 11? -101201311022 In base 16, what is 3 + -3174? -3171 In base 14, what is -564a2 - -3? -5649d In base 15, what is 2e8 + 29? 322 In base 16, what is -20a15 - -10? -20a05 In base 13, what is -3449 + 0? -3449 In base 5, what is 11 + -100? -34 In base 14, what is -124c1 - 9? -124ca In base 10, what is 4 - -69377? 69381 In base 6, what is -215423 + 25? -215354 In base 6, what is -455405 - 45? -455454 In base 9, what is -3382 + 44? -3337 In base 4, what is 10 + 310321322? 310321332 In base 13, what is 22 + -1806? -17b4 In base 6, what is 32454054 + -3? 32454051 In base 3, what is -10 + -102112102? -102112112 In base 11, what is -5 + -145165? -14516a In base 16, what is d - 883b? -882e In base 5, what is -30442 - 1213? -32210 In base 10, what is -80723 + -2? -80725 In base 5, what is -10 - 222324044? -222324104 In base 12, what is -4 - -1b73b3? 1b73ab In base 13, what is 100 + -3b? 92 In base 11, what is -544 + -834? -1278 In base 13, what is -1045 - 3? -1048 In base 5, what is 2441 - -344? 3340 In base 12, what is 68 - -361? 409 In base 7, what is -534561 + 2? -534556 In base 14, what is -3c6 - 931? -d17 In base 2, what is 101000000110011 - 10? 101000000110001 In base 16, what is 16d07 - -5? 16d0c In base 7, what is 62 + 102150? 102242 In base 12, what is -15 + 1275a? 12745 In base 16, what is -5f9 + 24? -5d5 In base 4, what is 11011 + 11? 11022 In base 3, what is -100 - -211122002? 211121202 In base 11, what is -a29 + 1a27? aa9 In base 3, what is -221210 - 10110021? -11102001 In base 9, what is 1 + -432541? -432540 In base 2, what is 11111011111000011 - -1011? 11111011111001110 In base 11, what is 6 - -4030? 4036 In base 7, what is -110052 - -112? -106640 In base 8, what is 12 - 641172? -641160 In base 3, what is 122202 - -10121201? 11021110 In base 10, what is 2239 + 0? 2239 In base 12, what is -109 - -25a? 151 In base 3, what is 1021111100000 - 12? 1021111022211 In base 15, what is -230121 - -1? -230120 In base 12, what is 103 + -4b? 74 In base 2, what is 100011 + 11100011001001? 11100011101100 In base 13, what is 788 + -7? 781 In base 15, what is 33d0 - -d? 33dd In base 9, what is 18 - -10621? 10640 In base 11, what is 97 - -2768? 2854 In base 15, what is 47 + 21d? 265 In base 12, what is 3b7a + 5? 3b83 In base 13, what is 3c - b0b? -a9c In base 10, what is 145253 - -2? 145255 In base 6, what is -1243 - 55? -1342 In base 3, what is -1102 + 11020002? 11011200 In base 2, what is 11 + 1010100101111101? 1010100110000000 In base 11, what is -39 + 3114? 3086 In base 4, what is 3 + -202102312? -202102303 In base 8, what is 55201 + 15? 55216 In base 11, what is 216381 - -3? 216384 In base 16, what is -1573 - 3? -1576 In base 16, what is -92c + -9? -935 In base 12, what is -312 + -257? -569 In base 9, what is 51152 - -2? 51154 In base 14, what is 1075 - 1b0? ca5 In base 15, what is -571 + -22? -593 In base 11, what is 517425 - 5? 517420 In base 14, what is 49aa3 + 1? 49aa4 In base 4, what is 13211 + -10223? 2322 In base 3, what is 120100 - 1010? 112020 In base 4, what is -23313113 + -3? -23313122 In base 12, what is 184 - -987? b4b In base 4, what is 21021 - 3302? 11113 In base 14, what is 5 - -d00c? d013 In base 2, what is -101000100110 + -1101110? -101010010100 In base 7, what is -10211 - 114? -10325 In base 14, what is a063c9 - 0? a063c9 In base 12, what is -1017 + -86? -10a1 In base 7, what is -5 + 151641? 151633 In base 2, what is 1000000 + 101101100? 110101100 In base 15, what is 34 - 366b? -3637 In base 3, what is 20 + 202011210? 202012000 In base 14, what is a - -4ba? 4c6 In base 10, what is -468879 + 4? -468875 In base 3, what is -1102100101 - -12? -1102100012 In base 5, what is -2 + -224440? -224442 In base 9, what is 4818 - -46? 4865 In base 7, what is 23 - -51116? 51142 In base 5, what is -1034121303 - -10? -1034121243 In base 10, what is 19 + 4207? 4226 In base 5, what is 2032223 - 4? 2032214 In base 11, what is 181452 + -11? 181441 In base 14, what is ad49 - 6? ad43 In base 15, what is 12 - -d20? d32 In base 10, what is 116 - 11664? -11548 In base 11, what is -246 - a9? -344 In base 6, what is -244 + -1013? -1301 In base 9, what is 42 + -2488? -2446 In base 16, what is -a - 11ed? -11f7 In base 15, what is 4 + -106e4? -106e0 In base 4, what is 1 - -100233320? 100233321 In base 7, what is 1 - -61203? 61204 In base 2, what is 100000 + -11011110101001000? -11011110100101000 In base 12, what is -37 - 2a91? -2b08 In base 16, what is -b - ce52? -ce5d In base 9, what is 616 - 5065? -4348 In base 6, what is 2 + -240033? -240031 In base 16, what is -26 - c1c6? -c1ec In base 7, what is 5 - 115646? -115641 In base 15, what is 445 + -4? 441 In base 10, what is 167489 - 3? 167486 In base 12, what is -47047 + 31? -47016 In base 2, what is -101 - 110010011110000011? -110010011110001000 In base 5, what is -1341311430 - -3? -1341311422 In base 9, what is -28167 + 8? -28158 In base 7, what is -15326312 + 4? -15326305 In base 7, what is 1651 + 2630? 4611 In base 10, what is 212721 + 0? 212721 In base 12, what is -4 + -a278? -a280 In base 12, what is -a + 8669? 865b In base 15, what is -94b6b + -2? -94b6d In base 15, what is -1b217 + a? -1b20c In base 11, what is 5 - -2311? 2316 In base 16, what is 3e - 852? -814 In base 11, what is -446a5 - 5? -446aa In base 4, what is -30122002 - 3? -30122011 In base 7, what is 50503 + 30? 50533 In base 15, what is 5 - -d44aa? d44b0 In base 15, what is 5 - ad6b9? -ad6b4 In base 15, what is 114e - 2? 114c In base 14, what is 3 + -1dd1? -1dcc In base 4, what is -1 + 100131111? 100131110 In base 12, what is 63b - -	{ "pile_set_name": "DM Mathematics" }
me value? False Suppose 10n - 52 = 28. Let q be (-3)/(n/4 - 5). Let h be -2 + ((-10)/(-4))/(-1). Is q equal to h? False Let p be ((-2)/(-14))/(-15 - -14) + (-36)/42. Is p equal to 1/29266? False Let r = 17.2 + -18. Let f = r + -0.2. Let d be (-12)/35 + (-7)/(-49). Does d = f? False Let g = 3.323 - 3.053. Let p = 4/13 + 5/26. Is p less than g? False Suppose 0 = 29b + 4b - 34b - 505. Is -505 at most b? True Let r = -17 + 32. Suppose 0 = 2k + 4, 16k - 16 = -4d + 18k. Is r > d? True Suppose -3x - 2g = -1503, 5g - 905 - 1092 = -4x. Let p = 537 - x. Do 33 and p have the same value? False Suppose 4v - 1378 + 66 = 0. Suppose 0 = -309z + vz - 19. Is z equal to -1/10? False Let s be (-7)/1((-238)/(-49) + -4). Let g be 136/(-850) - (-1 + s/(-5)). Let t be ((-1)/(-3))/((-12)/(-36)). Which is greater: g or t? t Let c = -18905/1773 - -43/197. Which is smaller: c or 1? c Let p = 3880 + -3870. Let v = -20 + 8. Let n be 2 + 33/v1. Is p greater than or equal to n? True Let x be (-1 - -9)(27 - 28) - (-12 + 5). Which is smaller: x or 2/6985? x Let r(q) = q*2 + 7. Let k be r(0). Suppose 4b + 8y - 33 = 3y, -b = y - k. Suppose 3o - 30 = 6o + 3u, 19 = -bo - 3u. Do o and -11 have the same value? True Let z = 37 - 32. Suppose -56 = zu - 266. Let d be 77/u - (-2)/12. Which is greater: d or 1? d Let j = -26 - -21. Let h be j - 38/(-16)2. Suppose -4t = -3t. Which is greater: h or t? t Let p(m) be the first derivative of m5/40 + 11m*4/24 + 13m3/3 - 1. Let t(x) be the third derivative of p(x). Let q be t(-5). Which is smaller: q or -2? q Let q(l) = l3 + 5l2 + 2l - 2. Let z be q(-3). Suppose -5b = -3r - 1226, -4r - 9 = -7r. Let y = b - 236. Which is smaller: z or y? z Let i be (-960)/(-2112)-192/14. Let n = i + 21804/385. Do n and 54 have the same value? False Let w = -9488 - -10971. Is 1483 != w? False Let c = 268972/5 - 52760. Let n = -1034 + c. Which is smaller: 0.39 or n? 0.39 Let p be 4(156/8 + 7). Suppose pt - 504 = 112t. Which is smaller: t or -88? -88 Let z(g) = g2 + 81g + 1620. Let c be z(-45). Which is greater: c or 19/1073? 19/1073 Let i(t) = -118t - 23. Let d be i(-4). Let s be -2 + d1/1. Let c = -1799/4 + s. Which is bigger: -4 or c? c Let c = 89 - 84. Suppose 0 = 5i + y + 385, 3i - cy + 312 - 53 = 0. Which is smaller: -77 or i? i Let s(c) = -32c*2 - 1211c - 25. Let i be s(-38). Let v = 130 - 344. Do v and i have the same value? False Suppose 0 = -33v + 21v + 312. Let b be 31/(-4)(4 + (-3 - 5)). Is b <= v? False Suppose 0 = -2a + s - 2s + 6, -3s - 4 = -5a. Let f(v) = -11v + 3va + 17 - 16v*2 + 164v*3 - 165v3. Let k be f(-12). Which is greater: k or 5/6? k Let r(t) = -t2 + 2t + 1. Let g be r(-1). Let d be 2 + (-3 + 4)0. Let j = d + g. Is -4/11 bigger than j? False Let a = 106.7374 - 0.0374. Let g = 0.7 - a. Let m = g + 120. Is -3/4 at most m? True Let b(u) = u*3 - 8u*2 + 6u + 7. Let d be b(6). Let g = 120 - 111. Let i be (g + -8)(0 - 31). Which is smaller: d or i? i Let p be 5 + (-3 - (-2055)/25). Let y = p + -1679/20. Is 0.1 at least as big as y? False Let t = 0 - 1. Suppose 55 = 4n - 5b, n - 6b + 2b = 0. Let h be (n/12)/(44/(-12) - 5). Which is smaller: t or h? t Suppose 14z - 6z + 7264 = -4g, 4g - 1846 = 2z. Which is smaller: -1 or z? z Suppose 4b = 3n + 22, -b - 4 = -3b - 2n. Suppose -m + 9 = 4v, 5m - bv = 3m - 18. Let j be ((-2)/m)/(52/(-78)). Which is greater: j or 3? 3 Let z(c) = c*2 - 6c*3 - 8c3 - c3 - 27c + 1 + 29c + 3c3. Let h be z(-1). Which is bigger: 29 or h? 29 Suppose -4s + 3s + 4 = 0. Suppose 6 = -7q + sq. Let w = -2929 - -32204/11. Which is bigger: w or q? w Let f = -16.12 + 0.12. Let i = f - -11. Let k = 24 + -23.7. Which is smaller: i or k? i Let f = 12374.1 - 12374. Which is bigger: f or -58/159? f Let j = 2.1 + -0.1. Let f = -4/303 + -637/202. Let g = 3/2 + f. Which is smaller: j or g? g Let d = -133 - -133. Let c = -114 - -78. Let m be 3/(-11)c/(-27). Which is greater: m or d? d Let n = 0.3 - 3.3. Let c = n - -2.9. Let t be 18/(-424)(-10520)/35505. Which is greater: c or t? t Let j = -124.1 + 116. Let x = 146.9 - j. Is x less than 1? False Let l = 15 - 2. Let w = 19 - l. Suppose -3z - 8 = 5u, -u - w = 3z - 2. Which is smaller: 4 or u? u Let n(d) = 2d. Let s be n(-3). Suppose -4m - 2 = 2k, -13 = -3m - 4. Let i = s + k. Is i at least as big as -13? True Let z(i) = i*2 + 1. Let n be z(3). Suppose -56 - 14 = nb. Which is smaller: b or -2/7? b Let h = 62 - 88. Let j = -1946 - -1945. Which is bigger: h or j? j Let i = -1 - -0.98. Let p(a) = 497a2 - 82a - 161. Let m be p(-2). Let w = -1984 + m. Is i >= w? False Let j be (1/(-283))/(-2 - 0). Let a(w) = -414w - 1242. Let c be a(-3). Which is greater: j or c? j Let r be (6/410)/((-1)/(-5)). Let q be 4 - (262/45 - 2). Let u = 2/9 + q. Which is bigger: r or u? u Suppose -64 + 16 = -6g. Suppose 13 = 7p - g. Suppose 0 = -pm + 8k - 3k - 7, 2m + 3 = 3k. Do m and 0.07 have different values? True Let k = 120.32 + -7.32. Let l = -104 + k. Let p be (-9)/15 + 1 + 0. Is p less than or equal to l? True Let x(h) = 45h + 269. Let z be x(-6). Let p be (-2)/(-15)9/28. Is p equal to z? False Let l = -2146748607/12328 + 174136. Is l at most as big as 1? True Suppose -3k - 2k - 5 = 0. Let c be k((15 - 0) + 0). Let j(g) = 2g*3 + 75g*2 - 341g - 11525. Let x be j(-38). Is c at most x? True Suppose 106 = -v - 2r, v - r + 3461 = 3349. Which is bigger: v or -121? v Let k be ((-65)/(-15))/(14/(-12)). Suppose 1 + 24 = -25v. Let i be ((-3)/(27/(-36)))/(v - 0). Which is bigger: k or i? k Suppose -12y + 6y = -30. Let h(r) = 9r2 + 2r - 4. Let v be h(3). Suppose -p - 2p + v = -yz, -4z - 4p - 92 = 0. Is -18 at least as big as z? True Let w be (4/(-3))/((-5)/225). Suppose -6o + 600 = 4o. Let a = w - o. Which is smaller: a or -1/40? -1/40 Let t = 24.938 - 25.938. Is -21610 < t? True Let j be (-3)/5 - 20508/(-30). Let u = -811 + j. Is u >= -127? False Suppose 5b = 25, 5d + 9b - 35 = 5b. Suppose -14t - d = 39. Is -11 greater than or equal to t? False Suppose 3l - t = -651, 3l + 2t + 660 = -0l. Let f = -206 - l. Which is smaller: -5 or f? -5 Let u be (2 - 1)/((-3)/(-9)). Let r(h) = -h + 4. Let f be r(2). Suppose -4q + 2t - 2 = 0, -q = -fq - 2t - u. Which is greater: 1/67 or q? 1/67 Suppose 102n = 104n - s - 104, 0 = -n - s + 49. Which is greater: n or 163? 163 Let m = -0.3 - -0.2. Let f be (-7)/(-63) + 5/(675/(-17178)). Let o = f + 127. Do m and o have the same value? False Let c = 37.808 - 38. Let a = -0.187 - c. Which is smaller: a or 0? 0 Let k be 17/(-36) + (-2)/(-9). Let j = -0.078 + 0.13. Let s = 33.052 - j. Is s > k? True Let q = -64 + 75. Let h = 10.9 - q. Let m = 280/1661 + 2/151. Which is smaller: m or h? h Suppose 0 = -0o + 5o - 3x - 1005, -5x + 371 = 2o. Let y be 36/o + (1 - -1). Is y less than or equal to 3? True Suppose 5r + 5j - 70 = 0, 3r - 7r = -2j - 38. Let g(k) = -6k + 33 - 9 - r. Let i be g(5). Which is bigger: i or -18? i Let z be (211 + -196)6/(-200895). Which is bigger: z or 1? 1 Let q = 1431/10 - 143. Suppose 20v + 28 = 22v. Let a be 2/((-5)/v1) + 6. Which is smaller: q or a? q Let c = -274/35 - -4728/595. Does 144 = c? False Let j = -8.24 - -8. Let s = -27246 - -27245. Is j less than or equal to s? False Suppose -88u + 88u - 167u = 1169. Let l = 0.06 + -0.12. Which is smaller: u or l? u Let y = 942.4 + -686. Let g = y + -296. Let d = g + 38. Which is greater: -0.2 or d? -0.2 Let h be 39/(-2)((-64)/(-24) + -2). Let c be 427/(-14) - -7. Does h = c? False Let o = 99181 - 1290361/13. Which is smaller: o or -79? -79 Suppose 9m - 16331 - 5044 = 0. Let l = 30900/13 - m. Which is bigger: l or 2? 2 Let l(a) = a - 1. Let u be l(3). Suppose ut - 2i - 17 = 7, 0 = 4t + 3i - 41. Is t smaller than 125/11? True Suppose 27y = 23y + 8. Suppose -6h - y = -8. Which is greater: h or 6/145? h Let q = -8358 + 8357.8138. Is q > 0.1? False Let f = 4550.36 - 4555.36. Let x(o) = -o. Let i be x(-5). Suppose in - 2*n = -3. Which is smaller: n or f? f Let q = 1277001051 + -21702665040/17. Let d = 373378 - q. Let j = 317 + d. Do 0 and j have the same value? False Let c = -5.301 - -2.301. Let p = 0.55 - -42.45. Is c > p? False Let	{ "pile_set_name": "DM Mathematics" }
3 - 129780l2 + 129780l*2 to the form f + kl*2 + hl + nl4 + ol3 and give o. -2 Express -c2 + 16811c - 16589c - c*2 - 16c*2 in the form x + fc*2 + vc and give v. 222 Express (10s2 + 166s*2 - 2s*3 - 42021 + 20997 + 21029)(s + 2s - 5s) as t + ws3 + qs + ks2 + ns*4 and give q. -10 Express -28 + 21 + 3y - 5y - 2y - y + 2y - 41y - 130y + 57y + (-2y + 2y + y)(-1 - 2 + 5) in the form iy + k and give i. -115 Rearrange -3d4 + 2d*2 + 6d - 1200721d3 + 1200720d*3 - 2 - 5 to hd*2 + od*3 + x + id + fd4 and give o. -1 Express -6375x*2 + 2x + 2x3 - 4705x*2 + 8437x*2 + (4 - 4 - 2x*2)(2 - 2 - x) in the form p + tx2 + ux + sx3 and give p. 0 Express (-74 + 144 - 5g*2 - 48)(6g + 8 - 8) in the form jg*3 + wg + kg2 + l and give j. -30 Express -18997 + 18997 - 1451z + (-4 + 3 - 1)(0 + 0 + z) + 2z - 5z + 0z in the form l + iz and give i. -1456 Express 3641v + 3001v + 1411v + 1389v as dv + f and give d. 9442 Express (d - 2d - d)(-4 + 3d + 5 + 2) + ((4 + 1 - 3)(1 - 1 - 2d) + d - 2d - d)(-d - 9d + 18d) in the form m + xd*2 + sd and give x. -54 Rearrange ((3 - 6 + 1)(-4u + 4u + u) + 2 - 2 + u)(-1215 + 2418 - 4u - 1205 - 105u*2) to f + zu + xu2 + yu*3 and give z. 2 Express -3 + 270g + 2 - 915g as k + ug and give u. -645 Express 573g + 575g - 1081g in the form t + og and give o. 67 Rearrange 133 - 26 - 7c - 21 - 33 - 21 - 5c*2 to fc + o + ic2 and give f. -7 Express (-2 + 9 - 29 - 11)(-6611m + 13206m - 6473m - 2) as jm + s and give j. -4026 Rearrange (7c - 3c + 2c)(-2c2 - c2 + c2) - 854 + 402 - 3740c*3 - 2c + 452 to qc3 + vc + dc2 + x and give q. -3752 Express 4774d*2 - 9554d*2 - 3d*4 + 4779d*2 + 39d as ad2 + md*3 + v + hd + bd4 and give b. -3 Rearrange (((-42 - 30 + 34)(-1 - 1 + 4) + 0 + 4 - 2)(3b + b - 2 - 3b) + b + 1 - 1)(-b + 4 + 5 - 5) to the form xb2 + qb + c and give x. 73 Rearrange -z + 47z2 + 0z + 11z + 331z*2 - 83z*2 to the form tz*2 + a + cz and give t. 295 Express -2s3 + 33723s + 2s2 - 11 - 7 + 3s*4 - 33730s as f + xs + zs*3 + ps*2 + vs*4 and give z. -2 Rearrange (0p2 - p3 + 0p2)(2110 + 2235 - 3973)(15p - 7p - 28p) to q + op3 + mp*4 + fp + bp2 and give m. 7440 Rearrange 614g*2 - 229g*2 + 505g*2 + 62g*2 to the form ng + xg2 + o and give x. 952 Rearrange 15266 - 9581y - 5087 - 5086 - 5095 to h + fy and give f. -9581 Express (114m*3 - 3861m - 57m3 - 58m*3)(-4 - 1 + 3) in the form zm3 + x + lm*2 + ym and give z. 2 Rearrange ((-4 + 0 + 5)(-3x + 6x + 0x) + 2x - 5x + x)(23x*3 + 3x*3 - 6x*3)(-33 - 7 - 5) to the form fx4 + cx + tx2 + ox*3 + i and give f. -900 Rearrange (5p*3 - 10 - 2p*3 + 9)(-6p + 32 - 32 + (3 - 3 + 2)(p + 0p - 3p) - 49p + 88p + 166p) to yp*3 + ap*4 + vp*2 + g + op and give a. 585 Rearrange (20881s - 4195s - 775s)(1 - 2 + 4) to the form d + xs and give x. 47733 Express 2z*2 + 325z*4 - 6 - 6 - 3 - 3z*3 - 323z*4 - 6z + z*3 as g + iz + vz2 + yz*4 + sz*3 and give y. 2 Rearrange (-916o*3 - 49o*3 - 20o*3)(-6o + o + 3o) to vo2 + m + to + ao3 + do*4 and give d. 1970 Express 4k*3 - 5k*3 + 2k*3 + (-44494k + 3 + 22249k + 22254k)(2k*2 + k - k) in the form tk*3 + ok + y + wk2 and give w. 6 Rearrange 30c*3 - 605c - 28c3 - 1051c - 203c + 173c to the form kc3 + pc + h + xc2 and give k. 2 Express 0g + 5g2 + 2g*3 - 6g - 3 + 3g2 - 8g*2 + 6g*2 as qg*2 + a + kg*3 + vg and give q. 6 Express -4v3 + 514 - 344 - 173 - 17v in the form kv3 + m + sv + tv2 and give t. 0 Rearrange 145n - 4n2 + 2n*2 - 287n + 142n + 1369 to the form wn*2 + p + rn and give w. -2 Rearrange 2670h2 + 11723h*2 + 10997h*2 to the form mh + fh2 + s and give f. 25390 Express (2o - 2o - 2o)(-17 + 15 + 9)(-4o + 2o + 0o) + (2o + 0o + 0o)(-1 + o + 1) + 2 + o2 - 4 + 2o + 1 as mo + g + fo*2 and give g. -1 Express 2b + 1719 - 3435 - b + 590 in the form i + pb and give i. -1126 Rearrange 107b + 474b + 174b - 2b2 - 136b + 1004b to d + kb + pb2 and give p. -2 Express (6y*3 - 2y*3 - 2y*3)(169 - 169 - 2881y + 11511y) in the form j + my2 + fy*3 + ny + ty4 and give t. 17260 Express (-12j - 13j - 28j)(2316j - 2316j - 180j*2) as vj*2 + ij + q + yj3 and give y. 9540 Express (2 + 2 - 2 + (-2 - 4 + 4)(5 - 4 - 2) + 584 + 382 - 104 + 103)(5l + 2l - l) in the form dl + o and give d. 5814 Rearrange -34a - 35 + 108 - 38 - 20 to i + ka and give i. 15 Express 1259c3 + 40c*2 - 2627c*3 + 1436c*3 as kc*3 + f + wc*2 + dc and give k. 68 Express 10 + 14 - 9751s - 50 + 26 as as + p and give a. -9751 Express -50 + 7s4 + 486s + 486s + 459s - 1433s + 2s*3 - 2s*2 in the form ds + fs3 + i + ms*4 + os*2 and give m. 7 Rearrange -9a*2 + 6a*4 - 10a*4 + 10a*2 + 0a*4 + 7a*4 - 239a to the form za + ia*4 + qa*2 + s + la*3 and give q. 1 Express (0 + 0 + 2v)(13 + 3 + 2) - 16014v + 7094v + 7142v in the form j + uv and give u. -1742 Rearrange -125n*3 - 261n*3 - 997n*2 + 996n*2 - 2 - 10n*3 to yn + pn2 + z + hn*3 and give h. -396 Rearrange (22058w*2 - 3 - 2 + 23367w*2 + 5 - 11921w*2)(-1 + 1 + 2w) to iw + sw3 + xw*2 + o and give s. 67008 Rearrange 2o*2 + 27o*3 - 45o*3 - 657o + 656o + 3 - 2o*4 to io*4 + zo + qo2 + ro*3 + b and give b. 3 Express 133z*4 - 1635z*4 - 985z*4 + (-z - 3z + 2z)(6z3 - 3z3 - z3) as jz3 + yz + tz4 + fz*2 + l and give t. -2491 Rearrange (31p - 8p - 8p)(1 + 3 - 6)(33 + p - 8p3 - 33 + (2 - 2 - 2p)(-4p + 4p + 4p*2)) to tp*3 + bp + cp2 + o + xp*4 and give c. -30 Express -916o - 7464o + 3972o - 6208o as x + ro and give r. -10616 Rearrange -59b + 8865b*2 + 10b*3 + 0 - 8866b2 + b4 + 2 - 3 to the form ab3 + vb*4 + jb*2 + ub + t and give u. -59 Rearrange -29p2 + 177p + 2p3 - 25p*2 + 437p + 54p2 + 2 to the form ap*2 + h + cp*3 + tp and give t. 614 Rearrange (5 - 5 + 21)(2 - 3 + 0)(-5f - 20f + 3f) to the form df + g and give d. 462 Rearrange (4p2 - 5p2 - p2)(874p + 3892p + 134478 - 134476) to qp*3 + mp*2 + w + np and give m. -4 Rearrange -971472w + 963144w + 2 - 3 + (-w - w + 0w)(2 + 0 - 1) to c + tw and give c. -1 Rearrange -26x*3 - 29x*2 + 30x*3 - 2x*4 - 7x*2 - 18x*3 - 2 + 18x*2 to the form dx + m + px2 + ix*4 + cx*3 and give p. -18 Rearrange 0r - 2r3 + 0r + (-7r3 + r3 - 11r*3)(2 + 0 + 0) + 324r3 + 270r*3 - 176r*3 to the form x + lr*3 + gr + ur2 and give l. 382 Express (111z + 179z - 60z)(20z*2 - 26 + 26) as y + nz*2 + hz + kz3 and give k. 4600 Rearrange -332l*2 + 8l - 74525 + 74525 to the form cl + r + gl*2 and give c. 8 Rearrange -1281i - 54i - 4517i to s + zi and give z. -5852 Rearrange -32s + 0s - 3s + (-2 + 1 + 2)(s - 3s + 0s) + (2 + 2s - 2)(-1 + 1 + 6) + 3 - 3 - 2s to os + t and give o. -27 Rearrange -3y + 4y + y + (-4 + 0 + 6 + (-1 - 3 + 5)(1 + 2 - 4))(5y - 4y + y) to the form n + fy and give f. 4 Express -1155 - 22a2 - 1151 - 162a*2 + 3448 - 1153 in the form na + xa2 + u and give x. -184 Express (0 - t2 + 0)(8822 + 32262t + 8833 - 17655) as c + pt*2 + jt + wt3 and give w. -32262 Rearrange 16807r*2 - 2 - 15r - 8209r2 + 14r - 2r4 - r3 + 5r*3 - 7734r*2 to yr + ur4 + p + dr*2 + xr*3 and give x. 4 Rearrange -1205z*2 + 1204z*2 + 17 - 75 + (34z - 5z - 6z)(z + 0 + 0) to the form t + iz*2 + jz and give t. -58 Express z*4 - 48 + 54z - 2z2 + 55 + 2z*3 + 15z + 2z2 in the form s + fz*4 + vz*2 + qz + wz3 and give s. 7 Rearrange 2o*2 - 36o*3 - 172o + 0 - 25o3 + 2 - 30o*3 + 156o to the form po2 + h + io + vo3 and give v. -91 Rearrange -36 - 55 - 66 + 4 - 11m + 33 to a + qm and give a. -120 Express (-2k*2 - 9k + 9k)(16755 - 16756 + 8k2 + 9k*2 - 3k) as z + jk + ik*3 + ok*4 + nk*2 and give n. 2 Express 2 - 1493d + 99d + 610d a	{ "pile_set_name": "DM Mathematics" }
d without replacement from rrrrzaza. Give prob of sequence zz. 1/28 Calculate prob of sequence uu when two letters picked without replacement from {u: 2, t: 2, a: 2}. 1/15 Calculate prob of sequence wtte when four letters picked without replacement from twtwwtwttttwxwttett. 55/7752 What is prob of sequence ef when two letters picked without replacement from fmemmqq? 1/42 What is prob of sequence zc when two letters picked without replacement from {d: 2, o: 4, h: 1, c: 7, z: 4}? 14/153 Two letters picked without replacement from {y: 4, n: 7, k: 5}. What is prob of sequence nn? 7/40 Four letters picked without replacement from ywwuwusysywyy. What is prob of sequence swus? 2/2145 Calculate prob of sequence ww when two letters picked without replacement from wwwwwwwwww. 1 Four letters picked without replacement from {p: 5, m: 2}. What is prob of sequence mmpp? 1/21 Three letters picked without replacement from kkfyuggd. Give prob of sequence kdk. 1/168 What is prob of sequence jx when two letters picked without replacement from jcqxxjxx? 1/7 What is prob of sequence ret when three letters picked without replacement from {r: 2, m: 3, t: 2, e: 6, l: 2}? 4/455 Calculate prob of sequence cbe when three letters picked without replacement from bcebbbe. 4/105 Calculate prob of sequence ggg when three letters picked without replacement from jjjjjjjjjjggjjgj. 1/560 Calculate prob of sequence qm when two letters picked without replacement from {w: 5, m: 5, d: 5, q: 1}. 1/48 What is prob of sequence uyyb when four letters picked without replacement from {q: 1, r: 1, b: 1, y: 2, u: 1, w: 1}? 1/420 Calculate prob of sequence ms when two letters picked without replacement from {y: 2, s: 1, o: 8, e: 1, a: 1, m: 3}. 1/80 Calculate prob of sequence nww when three letters picked without replacement from nnwnwwwnnkw. 10/99 Three letters picked without replacement from rrryryyyry. Give prob of sequence ryy. 5/36 Two letters picked without replacement from kmggmkkttkmktkm. Give prob of sequence gk. 2/35 Two letters picked without replacement from ccccccobbzzycaa. What is prob of sequence ob? 1/105 Calculate prob of sequence zr when two letters picked without replacement from {k: 3, z: 5, a: 1, r: 11}. 11/76 Calculate prob of sequence twwm when four letters picked without replacement from amxwmwwnntaw. 1/495 Calculate prob of sequence zzc when three letters picked without replacement from zdzszcc. 2/35 What is prob of sequence xpl when three letters picked without replacement from kpawxlxw? 1/168 What is prob of sequence al when two letters picked without replacement from ssalasso? 1/28 Three letters picked without replacement from {e: 5, z: 7}. Give prob of sequence zee. 7/66 What is prob of sequence yy when two letters picked without replacement from {p: 3, w: 7, y: 3}? 1/26 Calculate prob of sequence ej when two letters picked without replacement from {j: 1, w: 2, c: 2, e: 2, o: 1}. 1/28 Calculate prob of sequence awkw when four letters picked without replacement from akpccknwcpcw. 1/2970 What is prob of sequence qkk when three letters picked without replacement from {e: 2, q: 3, x: 1, l: 1, k: 6}? 15/286 Two letters picked without replacement from uvtdtuvuuuvuvucdtx. Give prob of sequence xt. 1/102 Four letters picked without replacement from ukkuk. Give prob of sequence ukkk. 1/10 Four letters picked without replacement from {e: 5, o: 13}. Give prob of sequence ooee. 13/306 What is prob of sequence ll when two letters picked without replacement from wllllwlwlllwlw? 36/91 Calculate prob of sequence zrr when three letters picked without replacement from zzrrr. 1/5 Two letters picked without replacement from {u: 2, l: 9}. Give prob of sequence ul. 9/55 What is prob of sequence xx when two letters picked without replacement from {x: 11, e: 3}? 55/91 What is prob of sequence sdds when four letters picked without replacement from {d: 13, s: 3}? 3/140 Two letters picked without replacement from {f: 3, g: 3, c: 1, s: 4}. Give prob of sequence fs. 6/55 What is prob of sequence zzs when three letters picked without replacement from {s: 2, z: 4}? 1/5 Calculate prob of sequence jj when two letters picked without replacement from zzllljjjjljjzljs. 7/40 What is prob of sequence ij when two letters picked without replacement from iijjijjjjjj? 12/55 What is prob of sequence ik when two letters picked without replacement from {x: 1, k: 4, i: 5, n: 1}? 2/11 Two letters picked without replacement from yioyiioioiioy. What is prob of sequence io? 2/13 What is prob of sequence hhu when three letters picked without replacement from {x: 2, h: 2, u: 4}? 1/42 Four letters picked without replacement from xjxjxjxxjxjxxx. What is prob of sequence jjxx? 60/1001 Calculate prob of sequence zpzp when four letters picked without replacement from zzzzzpzpzzzzpzpzzz. 91/3060 Four letters picked without replacement from mmhhhdmmd. Give prob of sequence mhhh. 1/126 What is prob of sequence kg when two letters picked without replacement from {o: 1, k: 1, u: 1, e: 2, g: 2}? 1/21 What is prob of sequence kdd when three letters picked without replacement from ldqldk? 1/60 What is prob of sequence tnt when three letters picked without replacement from {t: 7, n: 6}? 21/143 What is prob of sequence ww when two letters picked without replacement from iiwwmmmmwim? 3/55 What is prob of sequence zpi when three letters picked without replacement from ipzi? 1/12 What is prob of sequence bd when two letters picked without replacement from bbbebeedenqebbb? 1/30 What is prob of sequence zck when three letters picked without replacement from {k: 1, c: 1, z: 2, l: 2, g: 1, x: 2}? 1/252 Two letters picked without replacement from mqqqjqmqjqtqqqjvj. What is prob of sequence tq? 9/272 Two letters picked without replacement from {w: 14, p: 5}. What is prob of sequence pw? 35/171 What is prob of sequence xzzx when four letters picked without replacement from {n: 1, z: 5, x: 3, d: 4}? 1/143 Two letters picked without replacement from kkxxxkkqxkxkqkk. What is prob of sequence kx? 4/21 Four letters picked without replacement from {l: 5, v: 8}. Give prob of sequence vvlv. 14/143 Calculate prob of sequence kkkk when four letters picked without replacement from {k: 10}. 1 What is prob of sequence lm when two letters picked without replacement from {n: 1, p: 2, m: 1, l: 1}? 1/20 Two letters picked without replacement from {h: 3, y: 1, q: 5}. Give prob of sequence qq. 5/18 Calculate prob of sequence dg when two letters picked without replacement from dwkwskksxgkkkkkgkg. 1/102 Two letters picked without replacement from miyyyymyt. What is prob of sequence my? 5/36 Four letters picked without replacement from {p: 2, z: 3, w: 4}. What is prob of sequence wwpz? 1/42 Four letters picked without replacement from sseessssssssesesssss. Give prob of sequence ssse. 112/969 Two letters picked without replacement from {v: 2, l: 1}. Give prob of sequence vl. 1/3 Four letters picked without replacement from {u: 1, f: 1, j: 2, r: 1}. What is prob of sequence fjfu? 0 Two letters picked without replacement from pmllppplmc. Give prob of sequence mm. 1/45 Three letters picked without replacement from {p: 1, q: 2, o: 2, v: 1, x: 1, u: 1}. Give prob of sequence upv. 1/336 Three letters picked without replacement from eefeefeffoooffefo. Give prob of sequence eoe. 1/34 Four letters picked without replacement from {g: 16, e: 4}. Give prob of sequence ggeg. 112/969 Two letters picked without replacement from {s: 3, p: 3}. What is prob of sequence ps? 3/10 Two letters picked without replacement from illlilliililii. What is prob of sequence ii? 3/13 What is prob of sequence hc when two letters picked without replacement from {h: 4, y: 7, c: 1, f: 1, m: 3}? 1/60 Two letters picked without replacement from hppphnwwwj. What is prob of sequence wp? 1/10 Two letters picked without replacement from {l: 1, m: 1, y: 2, q: 1}. Give prob of sequence my. 1/10 Three letters picked without replacement from {v: 1, c: 6, e: 1, f: 3, r: 1, m: 1}. What is prob of sequence fmf? 1/286 Four letters picked without replacement from {i: 5, w: 15}. What is prob of sequence wiii? 5/646 Two letters picked without replacement from kyyyyyyyyyyyyyy. What is prob of sequence ky? 1/1	{ "pile_set_name": "DM Mathematics" }
he second derivative of 201344z3 + 78z - 201344z3 - 181z*5 wrt z? -3620z*3 What is the first derivative of -114 - 116 - 159 + 489o - 117 + 435 wrt o? 489 Suppose 29x + 95 = 48x. Let s(b) be the third derivative of 0 + 1/10bx + 0b*4 + 2/3b*3 + 0b + 3b2. What is the first derivative of s(h) wrt h? 12h Let k(g) = 552g2 - 9g + 18. Let v(i) = 548i2 - 8i + 20. Let h(w) = -6k(w) + 7v(w). What is the second derivative of h(c) wrt c? 1048 Let p(u) be the second derivative of -u*6/30 - 21u*5/2 - 205u*4/12 + 2u + 4. What is the third derivative of p(j) wrt j? -24j - 1260 Suppose 23t + 0t = 0. Let b(p) be the second derivative of -3/2p*2 + tp*4 + 2p + 0p3 + 7/20p*5 + 0. Differentiate b(c) wrt c. 21c*2 Let r be 47/4 + 42/(-56). Suppose -5u + r = 2z, -2z - 3u = -z - 6. Differentiate 7k*3 - 5k*z - 1 - 2 - 5 with respect to k. 6k*2 Suppose -2q = 2t + 3 - 21, -5t - 4q = -40. What is the second derivative of -138y + 4y4 - 2y*t + 120y wrt y? 24y2 Let j be 1(-8 + 3) + -3. Let v = 0 - j. Find the second derivative of 4c - vc + c + c*4 + 4c*4 wrt c. 60c*2 Find the third derivative of 37x + 78x2 + 160x*3 - 36x*2 - 39x*2 + 37x3 + x6 wrt x. 120x3 + 1182 Let h(c) = 20c*4 + 5c*3 + 5c - 346. Let m(o) = -19o4 - 4o*3 - 4o + 346. Let q(r) = -4h(r) - 5m(r). Differentiate q(y) with respect to y. 60y3 Let f(u) = -106u*3 - 6u*2 - 3u + 203. Let v(a) = 211a3 + 10a*2 + 5a - 407. Let s(p) = 5f(p) + 3v(p). Differentiate s(w) wrt w. 309w2 Let p = 29 - 23. Let y(x) = -x2 + 8. Let u be -4 + (-2 - (1 + -2)). Let f(q) = -2q*2 + 9. Let a(t) = py(t) + uf(t). Differentiate a(d) wrt d. 8d Suppose 41 = 5f - 24. Find the third derivative of -fu*3 + 22u*3 + 6u*3 - 17u*2 + 6u*3 wrt u. 126 Find the third derivative of 22g*5 - 4g + 105g4 - 105g4 + g2 - 191g5 - 9g*2 wrt g. -10140g*2 Let c(m) be the first derivative of 2m*5/5 - 5m*4/2 - 125m*2 + 250. What is the second derivative of c(u) wrt u? 24u*2 - 60u Let h be (11 + -11)(3 + -2). Let d(r) be the third derivative of 0 + 5r*2 - 1/210r*7 + 0r*5 + 0r + hr4 + 0r*6 - 1/3r*3. Differentiate d(k) wrt k. -4k*3 Let n(w) be the first derivative of 0w*2 + 0w + 8/3w3 - 12 + 0w*4 - 2w*5. What is the third derivative of n(s) wrt s? -240s Suppose 9f - 72 = 9. What is the second derivative of 4b - 4 + 2 - fb2 + 2 wrt b? -18 Let r(z) be the first derivative of 29z6/2 + z3/3 - 103z2/2 - 129. Find the second derivative of r(k) wrt k. 1740k*3 + 2 Let j(b) = 44b*3 + 51b*2 + 3b + 99. Let y(r) = -15r3 - 18r*2 - r - 33. Let w(h) = 6j(h) + 17y(h). Differentiate w(z) wrt z. 27z*2 + 1 Let p be (-54)/10 + (-45)/75. Let t = p + 8. Find the second derivative of -4a2 - a2 + a - ta2 wrt a. -14 Let l(i) = -14i*3 - 24i*2 - 68i - 65. Let d(u) = -2u3 - 4u*2 + u - 1. Let a(b) = -6d(b) + l(b). Find the first derivative of a(g) wrt g. -6g2 - 74 Let c be (-1102)/(-87) + 2/(-3). Find the second derivative of -26p - cp5 + 3p - 16p5 wrt p. -560p*3 Let x(v) be the first derivative of 7v*6/15 + 9v*2/2 - 12v + 6. Let w(i) be the first derivative of x(i). Find the first derivative of w(l) wrt l. 56l3 Let g(z) = -67z*3 - 37z + 256. Let q(n) = 22n3 + 13n - 85. Let l(d) = 6g(d) + 17q(d). Differentiate l(j) with respect to j. -84j2 - 1 Let n(h) be the first derivative of h7/6 + h4/3 - 12h + 12. Let q(t) be the first derivative of n(t). Find the third derivative of q(w) wrt w. 420w2 Find the third derivative of 250r*2 + 328 - 72r4 - r5 + 2 - 249r2 - 10r*4 wrt r. -60r*2 - 1968r Differentiate x*3 + 212 - 26 + 66x*2 + 140x*2 + 136 wrt x. 3x*2 + 412x Differentiate -259 - 301 + 356 - 636k with respect to k. -636 Let z(b) = 219b*3 - 14b*2 - 10b + 2. Let n(t) = 221t3 - 16t*2 - 12t + 2. Let d(c) = 5n(c) - 6z(c). Find the third derivative of d(r) wrt r. -1254 Let m(o) = 8o2 + o - 1. Suppose -2t - 2 = 2r - 0r, -r + 4t + 9 = 0. Let b be m(r). Find the third derivative of -9q*2 + 2q*4 + bq*2 - 6q*4 wrt q. -96q Let u be (30/(-54))/(3/(-27)). Let i(d) be the first derivative of 0d + 0d3 - d2 - 1/2d4 - u. What is the second derivative of i(b) wrt b? -12b Let h(u) = -u*2 + 5u + 5. Let k be h(6). Let v = k + 6. Find the third derivative of 112pv + p2 - 112p*5 + 7p*6 wrt p. 840p*3 Let u be (12 - (2 - 1/(-1))) + 4. What is the derivative of 7v*2 + 65 + uv*2 - 89 wrt v? 40v Suppose j - 32 = -7j. Suppose s - 18 = -5l, -3s + 14 = 2l - 6s. Find the third derivative of -9q*2 + 10q*2 - 4q*j + 3q*l wrt q. -24q Suppose -6u = 4u. Differentiate us2 + s2 - 14 - 14s*2 + 1 with respect to s. -26s Let l(d) be the third derivative of 2d9/21 - d7/210 + 13d*5/60 - 2d*2 - 62d. What is the third derivative of l(p) wrt p? 5760p3 - 24p Let t(l) = 15l3 - 5l*2 + 3l - 122. Let v(o) = -o*2 + o. Let z(j) = t(j) - 5v(j). Differentiate z(k) wrt k. 45k2 - 2 Suppose -2p - 3p = y - 15, -2p - 5y = 17. Let a(b) be the first derivative of -3 + 0b*3 - pb + 0b2 - 1/4b*4. What is the derivative of a(d) wrt d? -3d*2 Differentiate -24h*2 + 8 + 8h + 15h - 23h + 86 wrt h. -48h Let x(z) = 143z*2 - 7z - 20. Let v(h) = 72h2 - 4h - 9. Let c(r) = -5v(r) + 2x(r). Find the second derivative of c(y) wrt y. -148 Let f(h) be the first derivative of 68h5/5 + 69h*2/2 + 2h - 78. Find the second derivative of f(s) wrt s. 816s2 Let a(u) be the first derivative of -5u7 + u6/3 - 26u3 + 116. What is the third derivative of a(n) wrt n? -4200n*3 + 120n*2 Let n(z) be the second derivative of 0z*4 + 19/20z*5 - 1/2z*2 + 11z + 0 + 0z3. Differentiate n(b) wrt b. 57b*2 What is the second derivative of 21s*4 - 3s - 130s2 + 129s*2 - 2s wrt s? 252s2 - 2 Let h(c) = 76c*4 + 9c*3 - 213c*2 - 5. Let f(y) = -38y*4 - 4y*3 + 107y*2 + 2. Let n(s) = 5f(s) + 2h(s). What is the third derivative of n(o) wrt o? -912o - 12 Let i(v) = v*4 - 2. Let r(z) = 4z*4 - 18z*3 + 3z*2 + 2. Let d(a) = -2i(a) + r(a). What is the third derivative of d(p) wrt p? 48p - 108 Let a(x) be the third derivative of 23x5/60 + x4/8 + 121x3/6 + 99x*2. Find the first derivative of a(k) wrt k. 46k + 3 What is the second derivative of -4w + 24 - 20 - 3 - 6w + 73w3 wrt w? 438w Suppose -2x - x = -9. Let q(g) be the first derivative of -2g*3 + 4g3 - g7 + 0g3 - x + 2g*7. What is the third derivative of q(i) wrt i? 840i*3 Find the third derivative of 67c*3 + 234c - 473c + 239c + 9c2 wrt c. 402 What is the first derivative of 99 + 129b + 10b - 37b wrt b? 102 Let b(a) be the second derivative of 19a8/56 + a7/21 - 5a*4/3 + 2a*2 + 232a. Find the third derivative of b(o) wrt o. 2280o3 + 120o*2 Let l(t) = -14t*4 + 16t*2 + 175t - 6. Let y(x) = -2x2 + 1. Let n(i) = l(i) + 6y(i). Find the second derivative of n(c) wrt c. -168c2 + 8 Suppose -6 = -12q + 9q. Let k be 2/(-1 + 0 - -2). Find the third derivative of -kt*2 - 3t*2 + 0t4 - t4 + 4tq wrt t. -24t Let j(u) be the third derivative of 0u + 29/6u*3 - 11u*2 + 0 + 0u*4 + 11/30u*5. Differentiate j(k) with respect to k. 44k Let k(m) be the third derivative of 29m9/504 - 31m*5/30 + 84m*2. Find the third derivative of k(y) wrt y. 3480y*3 Let q be 8(-2 + (-25)/(-10)). What is the first derivative of -1 + 3 + 3 + 7r2 - q wrt r? 14r Differentiate -3k4 - 209 - 113k*4 - 116k*4 - 25k*4 with respect to k. -1028k*3 Let c(p) be the third derivative of -5p9/168 + p8/56 + p5/6 - p4/6 + 289p2 - p. What is the third derivative of c(i) wrt i? -1800i*3 + 360i2 Let q(m) = m2 - 2m + 1. Let n be q(2). Let a = 3 + n. What is the derivative of 5 + 2d*4 - 2d*4 + 2d*a wrt d? 8d*3 Find the third derivative of -12y*4 + 12y*4 + 12y + 2y2 + 6y*5 + 0y*2 + 8y*4 wrt y. 360y*2 + 192y Let v(j) be the third derivative of 11j9/84 - 17j*5/12 + 38j*2. Find the third derivative of v(s) wrt s. 7920s**3 Let m(f) be the second derivative of -3	{ "pile_set_name": "DM Mathematics" }
7, 179343? 184019 What is next in 560, 438, 52, -718, -1992? -3890 What is next in 50, -29, -20, 71, 238, 475? 776 What comes next: -167, -171, -311, -599, -1047? -1667 What comes next: 90285382, 180570764, 270856146? 361141528 What comes next: -91579, -92467, -93953, -96043, -98743? -102059 What comes next: -1607, -3210, -4829, -6470, -8139, -9842, -11585? -13374 What comes next: 174267, 174288, 174325, 174378, 174447? 174532 What is next in 896448570, 896448569, 896448568, 896448567, 896448566, 896448565? 896448564 What is next in -1755740, -3511486, -5267236, -7022990, -8778748? -10534510 What comes next: -24356724, -48713449, -73070174, -97426899? -121783624 What is the next term in 1657, 6329, 10989, 15637, 20273? 24897 What is the next term in 3879, 15470, 34769, 61764, 96443, 138794, 188805? 246464 What is next in -4844437, -9688866, -14533295, -19377724, -24222153? -29066582 What comes next: 185306, 369723, 554140, 738557, 922974? 1107391 What is the next term in 14633, 29780, 44929, 60080, 75233? 90388 What is the next term in 24385, 23862, 23339, 22816? 22293 What comes next: -7106617, -28426475, -63959571, -113705905? -177665477 What is the next term in -107862794, -215725589, -323588384? -431451179 What is the next term in -3099406, -3099360, -3099276, -3099136, -3098922, -3098616, -3098200, -3097656? -3096966 What is next in -3297, -6667, -10117, -13647, -17257, -20947, -24717? -28567 What is the next term in -6160, -15200, -24242, -33286? -42332 What comes next: -406342, -812221, -1218100? -1623979 What is next in 1671981, 1671952, 1671891, 1671780, 1671601, 1671336, 1670967? 1670476 What comes next: -6949, -12465, -15103, -13423, -5985? 8651 What is next in 3151, 5295, 7499, 9763, 12087, 14471, 16915? 19419 What is next in 188800, 189049, 189298, 189547, 189796, 190045? 190294 What comes next: 30797361, 30797363, 30797365, 30797367, 30797369? 30797371 What comes next: 1054, 2988, 5830, 9580, 14238? 19804 What is next in -156170, -156139, -156090, -156023, -155938, -155835? -155714 What comes next: -169, -999, -3035, -6811, -12861? -21719 What is the next term in -102220, -204438, -306668, -408922, -511212, -613550, -715948? -818418 What is the next term in -12755, -13291, -13827, -14363? -14899 What is the next term in -55567, -108439, -161311, -214183, -267055, -319927? -372799 What comes next: -62, -119, -212, -353, -554, -827? -1184 What is next in -43116, -172538, -388242, -690228? -1078496 What is next in -2250, -18155, -61396, -145653, -284606? -491935 What is the next term in -518180, -518228, -518276, -518324? -518372 What is the next term in 12804, 30267, 47730, 65193, 82656? 100119 What comes next: 39029, 38874, 38719, 38564, 38409, 38254? 38099 What is next in -957, -1553, -2123, -2667? -3185 What is the next term in 586, 1104, 1972, 3190, 4758, 6676? 8944 What is next in 13832, 14635, 15438, 16241? 17044 What is the next term in -13895, -13993, -14095, -14201? -14311 What is next in -10518481, -10518482, -10518483, -10518484, -10518485? -10518486 What is next in 14945, 29950, 44955, 59960, 74965? 89970 What is next in 2331601, 2331608, 2331617, 2331628? 2331641 What is the next term in -1687, -2934, -4277, -5764, -7443, -9362? -11569 What is next in -407, -525, -621, -695, -747, -777, -785? -771 What comes next: 3438745, 13754951, 30948627, 55019773, 85968389, 123794475, 168498031? 220079057 What is the next term in -4991, -4315, -3189, -1613, 413, 2889? 5815 What is the next term in -48608292, -97216576, -145824860, -194433144, -243041428? -291649712 What is next in -99340356, -99340359, -99340362, -99340365? -99340368 What comes next: -303172, -303449, -303728, -304009, -304292, -304577, -304864? -305153 What is the next term in -73380, -70988, -67002, -61422, -54248, -45480, -35118? -23162 What is the next term in 455, 0, -839, -2068, -3693, -5720? -8155 What comes next: -1376689, -1376749, -1376809? -1376869 What is next in 128462, 129680, 130898, 132116? 133334 What is next in 11003, 87679, 295753, 700925, 1368895, 2365363, 3756029? 5606593 What is the next term in -748593, -1497121, -2245649, -2994177, -3742705? -4491233 What is the next term in 703078, 1406188, 2109304, 2812426, 3515554, 4218688, 4921828? 5624974 What comes next: 156142600, 312285197, 468427794, 624570391, 780712988, 936855585? 1092998182 What comes next: -122578, -245306, -368180, -491200, -614366, -737678, -861136? -984740 What is next in 7327961, 14655923, 21983885, 29311847, 36639809? 43967771 What is the next term in -15219, -60555, -136113, -241893, -377895, -544119? -740565 What is the next term in 271976, 271953, 271914, 271859, 271788? 271701 What comes next: 27236, 53863, 80488, 107111, 133732, 160351, 186968? 213583 What comes next: -21542997, -21543001, -21543009, -21543021, -21543037, -21543057, -21543081? -21543109 What is the next term in 11701, 14586, 17471, 20356, 23241, 26126? 29011 What comes next: 1206, 1281, 1450, 1731, 2142, 2701, 3426? 4335 What is next in 1158276412, 1158276410, 1158276398, 1158276370, 1158276320? 1158276242 What is the next term in -9061, -36428, -82083, -146026, -228257, -328776, -447583? -584678 What is next in 37373092, 37373065, 37373012, 37372927, 37372804? 37372637 What is the next term in 215623, 431237, 646837, 862417, 1077971, 1293493, 1508977, 1724417? 1939807 What is next in 15122, 15323, 15524? 15725 What is the next term in 6974, 14917, 22762, 30461, 37966, 45229, 52202, 58837? 65086 What is the next term in 50423, 100719, 150993, 201233, 251427? 301563 What is next in -1913, -7874, -17801, -31694? -49553 What comes next: 9771, 10555, 11339, 12123? 12907 What comes next: 56, 1636, 4306, 8066, 12916, 18856, 25886? 34006 What is next in -9811, -19588, -29331, -39040, -48715? -58356 What comes next: 7452, 7343, 7310, 7473, 7952, 8867, 10338, 12485? 15428 What is next in -1579818, -1579815, -1579812, -1579809, -1579806, -1579803? -1579800 What comes next: 39451, 157385, 353941, 629119, 982919, 1415341? 1926385 What is the next term in 2415, 2682, 2963, 3258? 3567 What is the next term in 39060, 155978, 350842, 623652, 974408? 1403110 What comes next: -684, -2460, -6220, -12612, -22284, -35884, -54060, -77460? -106732 What is the next term in 1586976, 3174296, 4761616, 6348936? 7936256 What is the next term in -140372, -280775, -421206, -561665, -702152, -842667? -983210 What is next in 941109, 941152, 941223, 941322? 941449 What is the next term in 41761, 42327, 42893? 43459 What comes next: -266656, -1066739, -2400218, -4267093, -6667364, -9601031, -13068094? -17068553 What is next in -73214, -292859, -658932, -1171433, -1830362, -2635719? -3587504 What comes next: -58617, -117383, -176153, -234927, -293705, -352487, -411273? -470063 What is the next term in 207728, 415450, 623172, 830894? 1038616 What comes next: -320413, -320773, -321133, -321493, -321853, -322213? -322573 What is next in -26075, -104190, -234175, -415862, -649083, -933670? -1269455 What comes next: 4863, 38617, 130233, 308643, 602779, 1041573, 1653957, 2468863? 3515223 What comes next: 3147, 6178, 9249, 12354, 15487, 18642? 21813 What is next in -9001, -35463, -79557, -141283? -220641 What comes next: 31150906, 31150908, 31150912, 31150918, 31150926, 31150936? 31150948 What is next in -12270, -50276, -113620, -202302, -316322, -455680? -620376 What comes next: -1093221, -2186681, -3280141, -4373601? -5467061 What is next in 840, 3578, 8096, 14394? 22472 What is next in 47650, 188324, 422772, 750988, 1172966? 1688700 What is the next term in 393955, 393960, 393965, 393970, 393975, 393980? 393985 What is the next term in -762, -3040, -6734, -11772, -18082? -25592 What comes next: -8514, -33438, -74986, -133164, -207978? -299434 What comes next: -13531, -26768, -40003, -53236, -66467, -79696? -92923 What is next in 7870, 13357, 18850, 24355, 29878, 35425, 41002, 46615? 52270 What is next in 10250, 10288, 10326? 10364 What is the next term in 9582940, 19165882, 28748824, 38331766, 47914708, 57497650? 67080592 What comes next: 70859, 141719, 212529, 283277, 353951, 424539? 495029 What is next in 344392, 688772, 1033152, 1377532, 1721912, 2066292? 2410672 What is the next term in 462084, 924192, 1386316, 1848462, 2310636? 2	{ "pile_set_name": "DM Mathematics" }
cement from ueuuuuiieuueuuu. Give prob of sequence iiu. 2/273 Calculate prob of sequence wvv when three letters picked without replacement from vvvwvvvwvvwww. 70/429 Calculate prob of sequence ttzt when four letters picked without replacement from zzzzztzzzzztzzzzztt. 5/1292 Three letters picked without replacement from {w: 2, i: 5, h: 3, y: 9}. Give prob of sequence yii. 10/323 What is prob of sequence gmm when three letters picked without replacement from ggssgmgggmg? 7/495 Calculate prob of sequence qqw when three letters picked without replacement from {u: 3, l: 1, w: 4, q: 3}. 4/165 Three letters picked without replacement from {d: 2, z: 1, i: 1}. What is prob of sequence ddi? 1/12 Calculate prob of sequence hacc when four letters picked without replacement from {a: 4, h: 2, c: 8}. 8/429 Two letters picked without replacement from {v: 3, r: 5, t: 3}. What is prob of sequence vr? 3/22 What is prob of sequence im when two letters picked without replacement from cicllviillmimlmivccc? 3/76 Three letters picked without replacement from {h: 1, d: 2, s: 2}. Give prob of sequence dhs. 1/15 Three letters picked without replacement from {e: 1, y: 12}. What is prob of sequence yye? 1/13 Two letters picked without replacement from {k: 1, z: 1, w: 1, p: 1, i: 1}. What is prob of sequence kz? 1/20 Calculate prob of sequence rvrt when four letters picked without replacement from gvrgtvrq. 1/420 What is prob of sequence ee when two letters picked without replacement from {e: 2, m: 7, v: 3, w: 5, j: 1}? 1/153 Four letters picked without replacement from {a: 3, l: 5, j: 1, h: 1}. What is prob of sequence ljhl? 1/252 Three letters picked without replacement from {a: 7, d: 9, i: 1, o: 2}. What is prob of sequence dia? 7/646 Calculate prob of sequence ky when two letters picked without replacement from {u: 1, k: 1, y: 1, x: 1, d: 1, t: 2}. 1/42 What is prob of sequence ppa when three letters picked without replacement from paaapaaaaaaaa? 1/78 Four letters picked without replacement from vvllrrrrrrrvrrr. What is prob of sequence rllr? 1/182 Two letters picked without replacement from lvl. What is prob of sequence vl? 1/3 What is prob of sequence xx when two letters picked without replacement from {x: 1, b: 1, v: 1, p: 4, q: 9, g: 1}? 0 Two letters picked without replacement from ahrhaahjaaaa. What is prob of sequence ha? 7/44 What is prob of sequence zh when two letters picked without replacement from hzh? 1/3 Four letters picked without replacement from eeeeeeereeereeeeeeer. What is prob of sequence eree? 2/19 Four letters picked without replacement from {m: 3, h: 1, p: 3, o: 2, g: 1}. What is prob of sequence mopp? 1/140 What is prob of sequence ww when two letters picked without replacement from nnnwwwww? 5/14 Two letters picked without replacement from {a: 4, j: 1, e: 10, f: 4}. What is prob of sequence ff? 2/57 Three letters picked without replacement from {b: 11, u: 5}. What is prob of sequence uub? 11/168 Calculate prob of sequence zfff when four letters picked without replacement from {z: 2, f: 4}. 2/15 Three letters picked without replacement from ypvyggynpyyuyy. Give prob of sequence pun. 1/1092 Three letters picked without replacement from {h: 7, p: 1, w: 11}. Give prob of sequence hhw. 77/969 Four letters picked without replacement from jkjkiajkjfafxjj. What is prob of sequence ixaj? 1/2730 Calculate prob of sequence qq when two letters picked without replacement from {c: 1, q: 16, p: 3}. 12/19 What is prob of sequence kf when two letters picked without replacement from fukekkueukfuubkuk? 3/68 What is prob of sequence iuff when four letters picked without replacement from {u: 4, i: 7, f: 5}? 1/78 Two letters picked without replacement from jujjhhjjwhjujjhj. Give prob of sequence uu. 1/120 Calculate prob of sequence dde when three letters picked without replacement from wwejeerwdjjzjejdwjd. 4/969 Calculate prob of sequence lz when two letters picked without replacement from {z: 2, l: 2, h: 10}. 2/91 Four letters picked without replacement from ojooyooooyojyoo. What is prob of sequence yoyy? 1/546 Three letters picked without replacement from ykccycyfckcyaccycy. What is prob of sequence cky? 1/51 Calculate prob of sequence llwo when four letters picked without replacement from owwolwwlwwwjll. 1/143 What is prob of sequence nnn when three letters picked without replacement from {l: 1, n: 1, b: 1, k: 1, i: 1}? 0 What is prob of sequence www when three letters picked without replacement from kkkaawwwwwkkk? 5/143 Two letters picked without replacement from dhhhjddhh. What is prob of sequence dh? 5/24 Calculate prob of sequence gfg when three letters picked without replacement from {f: 2, g: 2, a: 2}. 1/30 Three letters picked without replacement from vxvwxwvvvwvv. What is prob of sequence xvw? 7/220 What is prob of sequence kz when two letters picked without replacement from kkzzkkkzzkzkk? 10/39 Calculate prob of sequence qk when two letters picked without replacement from qqxkyqk. 1/7 Two letters picked without replacement from snnhhsnh. What is prob of sequence ns? 3/28 Three letters picked without replacement from nngpn. Give prob of sequence gpn. 1/20 Calculate prob of sequence dudu when four letters picked without replacement from {d: 2, x: 7, u: 5}. 5/3003 Three letters picked without replacement from ppwwcwwtcpwppctwppw. What is prob of sequence wcc? 7/969 Two letters picked without replacement from {t: 2, w: 4, b: 2}. What is prob of sequence bt? 1/14 Two letters picked without replacement from {a: 6, g: 6}. Give prob of sequence ga. 3/11 Two letters picked without replacement from {l: 2, n: 3, d: 2, u: 1, t: 1, s: 3}. What is prob of sequence nl? 1/22 Two letters picked without replacement from nmnmmmpnnnnnmp. What is prob of sequence np? 1/13 What is prob of sequence dvd when three letters picked without replacement from vdadpgavdd? 1/30 Two letters picked without replacement from {j: 4, p: 1, d: 1, w: 4}. What is prob of sequence wj? 8/45 What is prob of sequence ddd when three letters picked without replacement from dddddd? 1 Four letters picked without replacement from xxbbbxxbxb. Give prob of sequence bxxx. 5/84 Four letters picked without replacement from pbupznbbpbbb. What is prob of sequence unbn? 0 Calculate prob of sequence lss when three letters picked without replacement from {s: 9, l: 5}. 15/91 Calculate prob of sequence dcdc when four letters picked without replacement from {d: 2, c: 4}. 1/15 What is prob of sequence uto when three letters picked without replacement from yytyttoyyyyuytyyt? 1/816 Calculate prob of sequence ss when two letters picked without replacement from {p: 1, a: 1, m: 1, r: 1, s: 5}. 5/18 Calculate prob of sequence jb when two letters picked without replacement from {b: 1, k: 3, j: 5, w: 4}. 5/156 Calculate prob of sequence xkck when four letters picked without replacement from {k: 6, c: 4, x: 7}. 1/68 Three letters picked without replacement from {x: 4, m: 6}. What is prob of sequence mmm? 1/6 Four letters picked without replacement from {s: 1, u: 3, b: 2, r: 8, m: 2, w: 1}. Give prob of sequence rbsu. 1/1190 What is prob of sequence zzzz when four letters picked without replacement from {z: 7, d: 6}? 7/143 Four letters picked without replacement from wwwwwwfzwwwwwz. Give prob of sequence zzww. 5/546 Four letters picked without replacement from {i: 3, u: 3, v: 4, b: 1, p: 3, r: 1}. What is prob of sequence vbrp? 1/2730 What is prob of sequence nnn when three letters picked without replacement from ntnnnnnnnnznn? 15/26 What is prob of sequence vve when three letters picked without replacement from efovvbre? 1/84 Three letters picked without replacement from zvvztvjovvz. What is prob of sequence ojt? 1/990 What is prob of sequence wkwi when four letters picked without replacement from okkooiokvwkkoko? 0 What is prob of sequence si when two letters picked without replacement from {s: 6, i: 2}? 3/14 Two letters picked without replacement from {p: 2, t: 1}. Give prob of sequence pt. 1/3 Four letters picked without replacement from llclcllllllc. What is prob of sequence llll? 14/55 Three letters picked without replacement from hffhhhhffhhf. Give prob of sequence hhf. 7/44 What is prob of sequence ahnp when four	{ "pile_set_name": "DM Mathematics" }
1 Simplify 5(3(sqrt(3) - sqrt(12)/sqrt(4)) + (sqrt(3) - -3sqrt(147)))2. 7260 Simplify 2(-2 + sqrt(132)/sqrt(3))*22 + 1. -32sqrt(11) + 193 Simplify (sqrt(40)/sqrt(160))/(sqrt(2) - sqrt(6)/(sqrt(3) - sqrt(108))). 5sqrt(2)/24 Simplify ((sqrt(80)/sqrt(4)5)/(5(sqrt(90) - sqrt(10))) - (sqrt(352)/(sqrt(11) + sqrt(99)) - (2 + sqrt(512))))*2. 62sqrt(2) + 969/2 Simplify 2(2sqrt(2736))*2-6 + (5(sqrt(228)2 - sqrt(228)))/((sqrt(120) - 1sqrt(120))/sqrt(10) - sqrt(12)). -131328 - 5sqrt(19) Simplify (-3 + -2 + sqrt(85)/sqrt(5) + (sqrt(17) + 1)2-5)*2. 270sqrt(17) + 1602 Simplify (sqrt(7) - sqrt(168)/sqrt(6)) + -2 - (sqrt(21)/sqrt(3)-2 + -3). 1 + sqrt(7) Simplify (2(-4sqrt(20) + sqrt(20) - sqrt(20)))/(-53sqrt(10)). 8sqrt(2)/15 Simplify (5 + sqrt(720) + -1 + -5 + 2)5. 5 + 60sqrt(5) Simplify (-5sqrt(76) + -3 - sqrt(76) - -2sqrt(76)4)-6. -24sqrt(19) + 18 Simplify ((sqrt(50)1)/sqrt(2))/(sqrt(20)/sqrt(256) + sqrt(5)). 8sqrt(5)/9 Simplify (3(6-1sqrt(684) + (sqrt(684) - (sqrt(684) + -3)) + -4))*2 + 1. 648sqrt(19) + 221626 Simplify (-3 + -6(sqrt(112) + -1)-3 + 5)*2. -2304sqrt(7) + 36544 Simplify (-2(sqrt(891) - (sqrt(891) - (-2 + sqrt(891))))-5 + (sqrt(66) - (sqrt(66) - -1sqrt(66))-3)/(sqrt(60)/(sqrt(10) - (sqrt(10) - sqrt(90)))))*2. -4440sqrt(11) + 135931 Simplify 2(1 + (-1 + -6sqrt(2)-2 + sqrt(22)/(sqrt(22)/sqrt(2)) + 1)2). 678 Simplify ((sqrt(200) + -3(sqrt(200) - (sqrt(200) + -1)) + sqrt(200) + (sqrt(200) + 0 - sqrt(200))-5)-1)*2. -120sqrt(2) + 809 Simplify -2sqrt(8)/(sqrt(32)/sqrt(128)) + (-2sqrt(288) - ((sqrt(14) - (sqrt(504) + sqrt(14))) + sqrt(14) - sqrt(14))/sqrt(7)). -26sqrt(2) Simplify (sqrt(270) - ((sqrt(270) + 1sqrt(270)5 - sqrt(270)) + sqrt(270) + sqrt(270)))/(sqrt(162)/sqrt(3) - sqrt(6)). -9sqrt(5) Simplify ((-5 + -6(0 + sqrt(1125)))-5)*2. 22500sqrt(5) + 1013125 Simplify ((sqrt(1078) - -2sqrt(1078))5)/((2sqrt(20))/sqrt(10) + sqrt(162)1 + sqrt(162)). 21sqrt(11)/4 Simplify ((((sqrt(175) + -1)-2 + sqrt(175) - (4 + (sqrt(175)-1 - sqrt(175)))) + (sqrt(175) - -6(sqrt(175) - (-1 + sqrt(175)))) + -4)-3)2. 6300 Simplify ((sqrt(90)/sqrt(3)-2)/(sqrt(6) + sqrt(162)/sqrt(3)))*2 + sqrt(35)/(3sqrt(7)) + (sqrt(45)3)/sqrt(9). 5/4 + 10sqrt(5)/3 Simplify (2 + 1 + sqrt(1377)-1 + -2 + sqrt(1377))2 + 0. 1 Simplify (sqrt(88) - -4sqrt(88)-2)/((sqrt(88)/sqrt(2))/sqrt(4))1-6. 84sqrt(2) Simplify -3 + (5 + sqrt(200) + -5 + 1)*2 + 4. 20sqrt(2) + 202 Simplify ((sqrt(448)2-4 + 1sqrt(448)-4)53)*2. 14515200 Simplify ((sqrt(112)4-1)2 - (sqrt(70) + (sqrt(70)-3 - sqrt(70) - sqrt(70))-6 - sqrt(70))/sqrt(10)) + 3. -30sqrt(7) + 1795 Simplify (0 + (sqrt(27) - sqrt(27)-24))*2 + -2. 2185 Simplify (sqrt(315)/sqrt(81) - sqrt(35))/(-3sqrt(252)). sqrt(5)/27 Simplify (3(sqrt(312)-2 - sqrt(312))/sqrt(6))/(3sqrt(24)/(sqrt(36)/sqrt(6) + sqrt(6))). -6sqrt(13) Simplify 3(0 + sqrt(153))2 + (sqrt(68)/(sqrt(100) + sqrt(4)) - (sqrt(17) + (sqrt(17) - ((sqrt(187) + -2sqrt(187) + sqrt(187))/sqrt(11) - sqrt(17))))). -17sqrt(17)/6 + 459 Simplify (5 + (2sqrt(68))/sqrt(4) - ((-2sqrt(136))/sqrt(8) - 1sqrt(17)-1))2. 30sqrt(17) + 178 Simplify (sqrt(96)/sqrt(3)1-3)*2-5. -1440 Simplify (-3sqrt(360))/(sqrt(64)/sqrt(8)5)-1. 9sqrt(5)/5 Simplify (sqrt(325) - 1sqrt(325))2-55 + (sqrt(325) + (-3 + -1sqrt(325) + sqrt(325) - sqrt(325))*2)1. 35sqrt(13) + 334 Simplify sqrt(65)/sqrt(5) + sqrt(13) + sqrt(13) + 0 + sqrt(1872) + 1 - ((sqrt(26)/sqrt(2)-2)*2 + 0 + sqrt(208)). -51 + 11sqrt(13) Simplify (-6-3sqrt(84)4)/(-1-41sqrt(12)). 18sqrt(7) Simplify 1((-2sqrt(384)2)/(sqrt(768)2))2. 2 Simplify (5(3 + 1 + sqrt(637) + sqrt(637)))*25 + 2. 14000sqrt(13) + 320502 Simplify 4 + (sqrt(2) - -3sqrt(18)) + sqrt(128) + 1 + -1. 4 + 18sqrt(2) Simplify 4 + sqrt(9)/(sqrt(3) - sqrt(27)) + -2 + -2(sqrt(3) - (sqrt(3) - (-1 + sqrt(3))))*2. -6 + 7sqrt(3)/2 Simplify (sqrt(136)-2-5)/sqrt(8) - (-5 + (sqrt(17) - sqrt(272))-1). 5 + 7sqrt(17) Simplify (4 + 6(2 + 3sqrt(2048))-6)2. 470016sqrt(2) + 23892496 Simplify (sqrt(70) + 2(sqrt(70) - (sqrt(70) - sqrt(70)-2)) + sqrt(70))/(sqrt(80)/sqrt(8)3). -2sqrt(7)/3 Simplify -3 + 1sqrt(363)6 + (sqrt(363) + -1sqrt(363))2 + -1 + 0 + (sqrt(363) - sqrt(363)1)*2. -4 + 66sqrt(3) Simplify (-5(0 + sqrt(336)/sqrt(48)) + 0)2. 175 Simplify (sqrt(450) - 5sqrt(450)-3 - sqrt(450))/(sqrt(360)5 + sqrt(360)). 5sqrt(5)/4 Simplify 4((-2 + sqrt(76) + -3 - (-4 + -1sqrt(76)))5)*2. -800sqrt(19) + 30500 Simplify 4sqrt(288) + 0 + sqrt(288) + sqrt(288) - (2 + -6sqrt(288)). -2 + 144sqrt(2) Simplify (sqrt(1900)1 + sqrt(152)/(1sqrt(8)))2 - (-2 + sqrt(931) + -1 + sqrt(931) + sqrt(931) + sqrt(931) + 1 + -5). -28sqrt(19) + 2306 Simplify (-6(5(1 + sqrt(11)) + (sqrt(121) + (sqrt(121) - (-3sqrt(121) - sqrt(121)) - sqrt(121)))/sqrt(11)))2. 3600sqrt(11) + 40500 Simplify ((5(sqrt(4) - (sqrt(36) - sqrt(4))))/(sqrt(40)/sqrt(5)))2 + (-2sqrt(24)/sqrt(4))/(-1sqrt(432)). sqrt(2)/6 + 25/2 Simplify -1 + (sqrt(5)5-1 - sqrt(10)/(sqrt(8) + sqrt(2))). -16sqrt(5)/3 - 1 Simplify -3 + -5 + sqrt(72) + -4. -12 + 6sqrt(2) Simplify (((sqrt(190) + sqrt(190)-2 + sqrt(190))-6)/(2sqrt(1210)) + -5)*2. 25 Simplify -3 + ((sqrt(1216) - (sqrt(1216) - (sqrt(1216) + 0 - sqrt(1216)))) + 5 - (2 + sqrt(1216)2))*2-2. -9749 + 192sqrt(19) Simplify ((sqrt(3900)-1 + sqrt(3900))/sqrt(3)-1 - (-5 + sqrt(13)-3 + (sqrt(52) + sqrt(1300))/sqrt(4)))*2. -30sqrt(13) + 142 Simplify (-1sqrt(405))21 + (sqrt(245) + ((-1 + sqrt(245) - sqrt(245))*2 - sqrt(245)) + -2 + sqrt(245))-5. -35sqrt(5) + 410 Simplify (-2 + 3(sqrt(98) - (sqrt(98) + 3)))*2-4. -484 Simplify ((sqrt(49)/sqrt(7)2)2 - sqrt(7)) + 3 + sqrt(7)4 + -1. 3sqrt(7) + 30 Simplify sqrt(7) + 3(sqrt(21)/sqrt(3) + sqrt(7)) + sqrt(77)/(-3sqrt(11)) - (sqrt(70) - (1sqrt(70) - sqrt(70))4)/(sqrt(1210)-1). 223sqrt(7)/33 Simplify 1((sqrt(171) + 1)-3 + ((sqrt(171) + 3)2 - sqrt(171))6). 81sqrt(19) + 1077 Simplify -5(5 + (-1 + sqrt(121)/sqrt(11) - (4 + -2 + sqrt(11))*2)). 15sqrt(11) + 55 Simplify -2(1sqrt(495) - sqrt(495))/(sqrt(1331)1). 0 Simplify -5 + sqrt(325) + sqrt(325)1 + (2sqrt(325) - sqrt(325))1 + 3. -2 + 15sqrt(13) Simplify (((sqrt(121) + sqrt(121)-1)-1)/(sqrt(396) + -3sqrt(396) + sqrt(396)) + 0)*2. 0 Simplify -1(-5 + ((sqrt(112) + (sqrt(112) - (-2 + sqrt(112) + 1)))6)2). -4063 - 288sqrt(7) Simplify (sqrt(280)/(sqrt(7)-1 - sqrt(7))4)/(sqrt(56)/(sqrt(448) + sqrt(448)2 + sqrt(448))). -64sqrt(5) Simplify (2sqrt(1440))/(6sqrt(15)/sqrt(3)) - ((sqrt(288) + 1 + -5)*2 - -5sqrt(288)1). -304 + 40sqrt(2) Simplify (-5 + sqrt(833)2)2 + 3(sqrt(1377) + (sqrt(1377) - (sqrt(1377) - (3 + sqrt(1377) + 1 + sqrt(1377))))). 2 + 109sqrt(17) Simplify ((sqrt(110) - (sqrt(110) - (sqrt(110)-3 - sqrt(110)))6)/sqrt(11))/((sqrt(24) - (sqrt(24) - sqrt(120)/(sqrt(30)/sqrt(6))))/sqrt(12)). -29sqrt(5) Simplify 0 + -2sqrt(11) + (sqrt(132) - sqrt(132)-2)/sqrt(12) - (sqrt(66)/(sqrt(6) + sqrt(24)) - ((sqrt(11) - sqrt(22)/sqrt(2)) + 3)). 2sqrt(11)/3 + 3 Simplify (-3(4sqrt(66) - sqrt(66)))/((1sqrt(72) + sqrt(72))/sqrt(12)). -9sqrt(11)/2 Simplify 4(-4(sqrt(76) + -1 + -1 + sqrt(76) + sqrt(76) + -4))*2. -4608sqrt(19) + 46080 Simplify -2sqrt(325)-2 - sqrt(104)/(sqrt(288)2). 239sqrt(13)/12 Simplify -4(((sqrt(72) + 1 + sqrt(72))2-3 - ((sqrt(72) - (-5 + -2sqrt(72))) + sqrt(72) - sqrt(72))2) + -1). 1008sqrt(2) + 6164 Simplify (3 + sqrt(27))*2 + -3 - -6(4 + sqrt(6)/sqrt(2)). 24sqrt(3) + 57 Simplify (sqrt(572)/(sqrt(11)-1))/((sqrt(40)-4)/sqrt(10)). sqrt(13)/4 Simplify -5(-1((sqrt(175) - (0 + sqrt(175) + 2)) + sqrt(56)/(sqrt(8) + 1sqrt(8)-2)))2. -55 - 20sqrt(7) Simplify ((sqrt(360)/sqrt(4)3)/((sqrt(2) + (sqrt(2) - sqrt(6)/sqrt(3))-6)-3))2. 45 Simplify -5(0 + (sqrt(63) - (5sqrt(1008) + sqrt(1008) + sqrt(63))2)). -15sqrt(7) + 196875 Simplify (-5 + (sqrt(200) - 1sqrt(200))5 + 5)*22. 0 Simplify 3(3 + -6((-2 + sqrt(720))-4 - sqrt(720))2). -325143 + 17280sqrt(5) Simplify ((sqrt(2112)-1-6)/(-5(sqrt(891) + sqrt(891)-2)))*2. 256/75 Simplify ((4sqrt(36) + sqrt(36))-5)/(-4sqrt(12)3) + 1. 1 + 25sqrt(3)/12 Simplify (sqrt(2560)-4)/(sqrt(72)6). -16	{ "pile_set_name": "DM Mathematics" }
r. -5, -92, -314 Put -4, -21, -6, 58, 3, 0 in decreasing order. 58, 3, 0, -4, -6, -21 Put 151, -3, 3, -2, -1 in decreasing order. 151, 3, -1, -2, -3 Sort -1374, -6, 5. -1374, -6, 5 Sort 5, -22, -33, 3 in descending order. 5, 3, -22, -33 Sort -974, -5, -1/3, 2, 1, 0.5 in increasing order. -974, -5, -1/3, 0.5, 1, 2 Sort 6693, -5, -9, 0 in descending order. 6693, 0, -5, -9 Put 1/3, 2/19903, 2 in increasing order. 2/19903, 1/3, 2 Put 43, 1402, 4, 0 in descending order. 1402, 43, 4, 0 Put -4, -5, 410/9, 3/2, 0 in ascending order. -5, -4, 0, 3/2, 410/9 Put -6, -30, -4/111, 3, -1 in decreasing order. 3, -4/111, -1, -6, -30 Put 5, -106, -0.9, -0.1, -5 in ascending order. -106, -5, -0.9, -0.1, 5 Sort 3, 1, 109813, 0 in descending order. 109813, 3, 1, 0 Sort -0.131, 2/5, -0.5, -4 in increasing order. -4, -0.5, -0.131, 2/5 Sort 78, 433, -3, -5, 1 in descending order. 433, 78, 1, -3, -5 Put -4, 4, 0, 0.3, -20, 2/5 in ascending order. -20, -4, 0, 0.3, 2/5, 4 Put -4, 2, 30, -16, -7, -1 in increasing order. -16, -7, -4, -1, 2, 30 Sort 93, -0.3, -3, -1, -6/13 in increasing order. -3, -1, -6/13, -0.3, 93 Put 1/5, 5, 12.24, -6 in decreasing order. 12.24, 5, 1/5, -6 Sort -5, -3, 2, 10148, -1 in descending order. 10148, 2, -1, -3, -5 Sort -1086, -2, -19. -1086, -19, -2 Sort 2, 1/7, -629, -174 in decreasing order. 2, 1/7, -174, -629 Sort 0.353, -19, 3 in ascending order. -19, 0.353, 3 Sort 780, 4, 5 in descending order. 780, 5, 4 Put 0, 41, 1/3, -1/6 in descending order. 41, 1/3, 0, -1/6 Sort -1, -4, 107, 3, 0 in descending order. 107, 3, 0, -1, -4 Put 187, 2, 5, 7, 3 in ascending order. 2, 3, 5, 7, 187 Sort -96, -401, -6. -401, -96, -6 Put 1.105, -0.4, 5/9, 3/5 in decreasing order. 1.105, 3/5, 5/9, -0.4 Sort 5, -1, 3, -8, 4, -2 in ascending order. -8, -2, -1, 3, 4, 5 Put -21, -1, -153, 4, -3 in descending order. 4, -1, -3, -21, -153 Sort 3, 1, 5, -2395, -0.5, -1 in decreasing order. 5, 3, 1, -0.5, -1, -2395 Sort -2/11, -6380, 1/2, -1/7. -6380, -2/11, -1/7, 1/2 Put -3, -5/2, -6, -2/11 in increasing order. -6, -3, -5/2, -2/11 Sort 5, -1, 451, 1, 7 in ascending order. -1, 1, 5, 7, 451 Sort 2.9, 2/33, 1, 0.3, -46 in descending order. 2.9, 1, 0.3, 2/33, -46 Put 16, 15, -23 in increasing order. -23, 15, 16 Sort 5, 0.3, -0.84, -2/9, 1/4, -4 in descending order. 5, 0.3, 1/4, -2/9, -0.84, -4 Put -4, 5, -6, -436, 4 in descending order. 5, 4, -4, -6, -436 Sort 4/7, -44/3, 131 in descending order. 131, 4/7, -44/3 Sort 5, -0.3, -2, -0.5, 77/46. -2, -0.5, -0.3, 77/46, 5 Put 4, -4.26, 2/9 in ascending order. -4.26, 2/9, 4 Put -4, 2, -2837 in descending order. 2, -4, -2837 Sort -1, 3, -2391, -2, 4 in descending order. 4, 3, -1, -2, -2391 Sort -1, -374, -3, 2, 12 in increasing order. -374, -3, -1, 2, 12 Sort -1/68, -671, -2/19, 5, -0.1 in decreasing order. 5, -1/68, -0.1, -2/19, -671 Put -565, -3, 0.3, 3, 3/7 in descending order. 3, 3/7, 0.3, -3, -565 Put 0, 1596, -3, -5, -4 in descending order. 1596, 0, -3, -4, -5 Sort 2, -1/45, -6/11, 4/5, -1, 40 in decreasing order. 40, 2, 4/5, -1/45, -6/11, -1 Sort -11, 4, 1210, -47 in descending order. 1210, 4, -11, -47 Put 5, -25/6, -37/5 in descending order. 5, -25/6, -37/5 Sort -5, -63, 32, -4, -13, 0 in descending order. 32, 0, -4, -5, -13, -63 Sort -1, 66, -67. -67, -1, 66 Put 3/64, 417, 2/3 in ascending order. 3/64, 2/3, 417 Sort -155, 3, -4, 54, -34 in descending order. 54, 3, -4, -34, -155 Put -1, 0, 13, 32, 3 in decreasing order. 32, 13, 3, 0, -1 Sort 6, -48, 4, 2, 1, 73 in descending order. 73, 6, 4, 2, 1, -48 Put 2, -4, 3, -18, -32, 1 in increasing order. -32, -18, -4, 1, 2, 3 Put -2, 4, -1, 7352 in ascending order. -2, -1, 4, 7352 Sort -1, 735, 9, -4, -5 in descending order. 735, 9, -1, -4, -5 Sort -1, -100, 4, -0.2, -20 in decreasing order. 4, -0.2, -1, -20, -100 Sort 5, -1, 1/3, 0.07, -5 in descending order. 5, 1/3, 0.07, -1, -5 Put 1/2, -7299, 2, 0 in increasing order. -7299, 0, 1/2, 2 Put -1, 581, -0.2, 16 in decreasing order. 581, 16, -0.2, -1 Sort -10, 181, -2/73. -10, -2/73, 181 Put 86, -2, -5, 1, -6, -3 in descending order. 86, 1, -2, -3, -5, -6 Put 14, 156, -29 in ascending order. -29, 14, 156 Sort -8, 0.1, -1425, -2. -1425, -8, -2, 0.1 Sort 7, 1/7, 2/14231, -1/3 in increasing order. -1/3, 2/14231, 1/7, 7 Put -6, 3, -445, 2, 1, -3 in ascending order. -445, -6, -3, 1, 2, 3 Put 5, 2, 1/2499 in increasing order. 1/2499, 2, 5 Put 0.3, 3, 2.4, -5, -0.1 in decreasing order. 3, 2.4, 0.3, -0.1, -5 Sort -6, 0.17, 0.6, -1/6 in decreasing order. 0.6, 0.17, -1/6, -6 Put -3/310, 0.19, -3 in descending order. 0.19, -3/310, -3 Sort 0, -4, -16.2, -0.1. -16.2, -4, -0.1, 0 Sort 2, 6, -37, -130 in descending order. 6, 2, -37, -130 Put 0, -1/58, 89, 42/11 in ascending order. -1/58, 0, 42/11, 89 Put -2, -22, 13, 4 in ascending order. -22, -2, 4, 13 Sort 24, -9570, 4. -9570, 4, 24 Put -14, -56, -1, -495 in descending order. -1, -14, -56, -495 Put -687, -5, 2, -1, -3, -2 in decreasing order. 2, -1, -2, -3, -5, -687 Sort -4, 5, 3, 3700, 4, -2 in descending order. 3700, 5, 4, 3, -2, -4 Sort -6, -0.06, -1.202. -6, -1.202, -0.06 Put -0.5, -1.62, -0.2, -0.1, -35/4 in increasing order. -35/4, -1.62, -0.5, -0.2, -0.1 Sort 4, 12933, 0, 5, -2. -2, 0, 4, 5, 12933 Put -5, -13/2, 163 in decreasing order. 163, -5, -13/2 Sort 0.2, -16/7, 10, -0.2 in increasing order. -16/7, -0.2, 0.2, 10 Sort -4, 48, -11, 2, 8. -11, -4, 2, 8, 48 Sort -2, -47500, 4, 3, -1. -47500, -2, -1, 3, 4 Put -70, 24/11, -2, 1 in ascending order. -70, -2, 1, 24/11 Sort 1629, 0.5, 82 in ascending order. 0.5, 82, 1629 Sort -1273, 4, -946, -2 in ascending order. -1273, -946, -2, 4 Put 2, 4, -828, -4 in descending order. 4, 2, -4, -828 Put -3, -2/13, 56, -15, 3 in decreasing order. 56, 3, -2/13, -3, -15 Sort -5, -3/2, -8, -2/23, -7 in descending order. -2/23, -3/2, -5, -7, -8 Put -8, -4, 1, -2, -632, 0 in decreasing order. 1, 0, -2, -4, -8, -632 Put 1, 24, 0, -52 in decreasing order. 24, 1, 0, -52 Put 3, 10, -5, -4, 39 in descending order. 39, 10, 3, -4, -5 Sort -2, 637, -1 in ascending order. -2, -1, 637 Sort 6, -10, 3, -106, -21 in descending order. 6, 3, -10, -21, -106 Sort -1.8, 5, 0.43, -4, -0.2 in increasing order. -4, -1.8, -0.2, 0.43, 5 Put -1, 0, 7/4, -3, -0.06, 4.78 in ascending order. -3, -1, -0.06, 0, 7/4, 4.78 Sort 13, 2, 2825. 2, 13, 2825 Put 1, 4, 6583, -88 in descending order. 6583, 4, 1, -88 Sort 5, -73, -9. -73, -9, 5 Sort -25, -1, -2/11. -25, -1, -2/11 Put 8, -1, 54, 24, -10, 1 in descending order. 54, 24, 8, 1, -1, -10 Sort -2/9, 125, -19, 4/9, 37. -19, -2/9, 4/9, 37, 125 Sort 29, -11, -66, -14, 5 in ascending order. -66, -14, -11, 5, 29 Sort -643, -76, -2 in increasing order. -643, -76, -2 Sort 497, 0, 12, 2. 0, 2, 12, 497 Sort -72374, 3, 24 in ascending order. -72374, 3, 24 Sort 0.04, 2104, -0.4, -34. -34, -0.4, 0.04, 2104 Put 2, 65, -405, -48 in decreasing order. 65, 2, -48, -405 Put 11301, 4, -18 in descending order. 11301, 4, -18 Sort -1, -7, -358 in descending order. -1, -7, -358 Sort -2, -1, 0, 5870, -5 in decreasing order. 5870, 0, -1, -2, -5 Sort -2, 334, -22 in ascending order. -22, -2, 334 Sort -1, -3, 6507 in descending order. 6507, -1, -3 Sort 50, -1, 3, 16287, -2, 0 in descending order. 16287, 50, 3, 0, -1, -2 Sort 1, 3/4, -23, -111, 5, 2. -111, -23, 3/4, 1, 2, 5 Sort -0.3, -4, 2, 0.41, -0.1, -2/7 in increasing order. -4, -0.3, -2/7, -0.1, 0.41, 2 Sort -15, -98, -2, -10 in increasing order. -98, -15, -10, -2 Sort -5, 0.4, 5, -2/9, 1, -476 in descending order. 5, 1, 0.4, -2/9, -5, -476 Put 2, 0, -2, -0.9, -0.59, -131 in decreasing order. 2, 0, -0.59, -0.9, -2, -131 Sort -5, -6, 20850 in ascending order. -6, -5, 20850 Put 0.105, -3, 69, -5 in decreasing order. 69, 0.105, -3, -5 Put -11, 5, -5, 0, -225, 3 in descending order. 5, 3, 0, -5, -11, -225 Sort -2, 2, -632. -632, -2, 2 Sort 2061, -1, 4, 186 in increasing order. -1, 4, 186, 2061 Put -2/13, 2068, 0.4, -7, -0.4 in decreasing order. 2068, 0.4, -2/13, -0.4, -7 Sort -1/8, 3/10, 1386 in ascending order. -1/8, 3/10, 1386 Sort -17, 110, -5, -2 in descending order. 110, -2, -5, -17 Sort -11, -17, 1 in ascending order. -17, -11, 1 Sort -22, 6, -1, 1/3 in ascending order. -22, -1, 1/3, 6 Sort 4, 2, 0, -22, 16, -1 in decreasing order. 16, 4, 2, 0, -1, -22 Sort 5, 1051, 2/13 in decreasing order. 1051, 5, 2/13	{ "pile_set_name": "DM Mathematics" }
en four letters picked without replacement from {s: 2, n: 1, t: 4, o: 2, m: 5, d: 1}. 1/3276 Calculate prob of sequence kbe when three letters picked without replacement from kbjkezn. 1/105 Calculate prob of sequence qfel when four letters picked without replacement from llmflmfhhmhmmmqmmemq. 1/9690 Two letters picked without replacement from rzrzrrr. Give prob of sequence zz. 1/21 Three letters picked without replacement from {m: 7, u: 7}. What is prob of sequence mmu? 7/52 What is prob of sequence ccgb when four letters picked without replacement from rcdbgcx? 1/420 Calculate prob of sequence pup when three letters picked without replacement from {p: 5, c: 11, d: 2, u: 2}. 1/171 Two letters picked without replacement from mjqmqjqqbqjqbqqjb. What is prob of sequence qj? 2/17 What is prob of sequence si when two letters picked without replacement from {s: 1, i: 2}? 1/3 What is prob of sequence iiie when four letters picked without replacement from rxireiiriex? 1/165 What is prob of sequence wwf when three letters picked without replacement from {q: 1, f: 3, w: 4}? 3/28 Three letters picked without replacement from {d: 8, y: 2, t: 2}. Give prob of sequence tyt. 1/330 What is prob of sequence hxxx when four letters picked without replacement from {x: 6, t: 2, h: 4}? 4/99 Calculate prob of sequence du when two letters picked without replacement from tkkdukkkkbdbbzd. 1/70 What is prob of sequence ssgs when four letters picked without replacement from {g: 15, s: 3, y: 2}? 1/1292 Calculate prob of sequence ysb when three letters picked without replacement from {s: 4, b: 2, y: 6}. 2/55 Two letters picked without replacement from pmzbmz. Give prob of sequence bz. 1/15 Two letters picked without replacement from {m: 4, t: 2, o: 3, s: 1, j: 1}. Give prob of sequence oo. 3/55 Calculate prob of sequence hhhz when four letters picked without replacement from xhzkkhhkhh. 1/84 Calculate prob of sequence kyx when three letters picked without replacement from {x: 5, k: 3, o: 1, y: 1}. 1/48 Two letters picked without replacement from stbbbbttbsstmttttmb. Give prob of sequence bt. 8/57 Four letters picked without replacement from {k: 3, d: 3, u: 2, j: 1, h: 1}. What is prob of sequence uduk? 1/280 What is prob of sequence mmml when four letters picked without replacement from {m: 7, l: 2, t: 9}? 7/1224 Calculate prob of sequence vgxw when four letters picked without replacement from vxgfw. 1/120 Two letters picked without replacement from {b: 11, n: 3}. Give prob of sequence nb. 33/182 What is prob of sequence lmrr when four letters picked without replacement from {l: 2, r: 3, y: 1, m: 1}? 1/70 Two letters picked without replacement from {u: 1, v: 1, x: 1}. What is prob of sequence vu? 1/6 What is prob of sequence tll when three letters picked without replacement from {l: 2, t: 4, z: 1, v: 1}? 1/42 Two letters picked without replacement from wozwzzwzoz. Give prob of sequence wz. 1/6 Three letters picked without replacement from xdmmxnrmnbrm. Give prob of sequence xdm. 1/165 Calculate prob of sequence wpi when three letters picked without replacement from pwvip. 1/30 Four letters picked without replacement from {a: 1, w: 1, q: 10, k: 2}. What is prob of sequence wkqa? 5/6006 Three letters picked without replacement from xayxk. Give prob of sequence ykx. 1/30 Calculate prob of sequence cgg when three letters picked without replacement from gaggihhiifghcai. 2/455 Four letters picked without replacement from wuuapwucauuuwcuuau. What is prob of sequence awap? 1/4080 Three letters picked without replacement from {f: 2, s: 4}. What is prob of sequence ssf? 1/5 Calculate prob of sequence cmm when three letters picked without replacement from mccmccmmccmcccmccc. 5/68 Three letters picked without replacement from {n: 1, m: 3, o: 4, g: 2}. What is prob of sequence gmg? 1/120 Three letters picked without replacement from {s: 6, q: 5, l: 2, g: 2, b: 1}. Give prob of sequence qqs. 1/28 Calculate prob of sequence kknv when four letters picked without replacement from ddkkkdkvddiidniiikn. 5/11628 Calculate prob of sequence zaz when three letters picked without replacement from aaazzaaaa. 1/36 Two letters picked without replacement from wgaatwawtaaatgg. Give prob of sequence ga. 3/35 Four letters picked without replacement from aafaaaaaaaaaafaaaa. What is prob of sequence faaf? 1/153 What is prob of sequence eppp when four letters picked without replacement from ppgrpurueuuu? 1/1980 Two letters picked without replacement from zjoeu. What is prob of sequence ou? 1/20 What is prob of sequence zu when two letters picked without replacement from suicz? 1/20 What is prob of sequence waa when three letters picked without replacement from {a: 2, t: 4, w: 2}? 1/84 What is prob of sequence lbbb when four letters picked without replacement from sssbslbb? 1/280 Two letters picked without replacement from {o: 8, z: 3}. Give prob of sequence zz. 3/55 Calculate prob of sequence cc when two letters picked without replacement from {i: 3, c: 1, m: 1}. 0 Two letters picked without replacement from ddddlld. Give prob of sequence dl. 5/21 What is prob of sequence izz when three letters picked without replacement from iiiziziini? 7/360 What is prob of sequence qa when two letters picked without replacement from tqqaaqqftqfffb? 5/91 What is prob of sequence xbw when three letters picked without replacement from {d: 1, a: 1, p: 1, x: 3, b: 2, w: 3}? 1/55 Four letters picked without replacement from {h: 2, d: 2, i: 5}. Give prob of sequence dhid. 5/756 Three letters picked without replacement from mgggaarmggaaagggpg. Give prob of sequence pgr. 1/544 Calculate prob of sequence hb when two letters picked without replacement from {h: 1, b: 6, c: 8, s: 3}. 1/51 Two letters picked without replacement from {w: 1, o: 11, m: 2, d: 2}. What is prob of sequence mm? 1/120 What is prob of sequence yy when two letters picked without replacement from yqy? 1/3 Four letters picked without replacement from hmbebfbb. Give prob of sequence mmfh. 0 Four letters picked without replacement from alycyaa. What is prob of sequence aaac? 1/140 Calculate prob of sequence rrro when four letters picked without replacement from rgoroooagogaaarr. 1/364 What is prob of sequence wtlq when four letters picked without replacement from {s: 1, w: 1, q: 3, l: 6, t: 4, p: 5}? 1/1615 Two letters picked without replacement from {y: 5, q: 5, e: 1}. What is prob of sequence qq? 2/11 Calculate prob of sequence lvv when three letters picked without replacement from {i: 2, v: 4, z: 1, l: 1}. 1/28 What is prob of sequence qm when two letters picked without replacement from qxqaiym? 1/21 Calculate prob of sequence rj when two letters picked without replacement from {r: 7, j: 6}. 7/26 What is prob of sequence lf when two letters picked without replacement from lfls? 1/6 Calculate prob of sequence vr when two letters picked without replacement from {j: 2, v: 1, r: 1, w: 2, z: 1, o: 1}. 1/56 Three letters picked without replacement from adhafzdufzfh. What is prob of sequence fdu? 1/220 Three letters picked without replacement from {z: 1, y: 1, v: 1, g: 1, w: 1}. What is prob of sequence wzg? 1/60 Calculate prob of sequence ex when two letters picked without replacement from {x: 5, f: 3, w: 4, g: 4, r: 3, e: 1}. 1/76 Calculate prob of sequence lcw when three letters picked without replacement from lcccwdwcc. 5/252 Calculate prob of sequence yqq when three letters picked without replacement from {y: 3, q: 2}. 1/10 Two letters picked without replacement from qqaadqqaq. Give prob of sequence qq. 5/18 Four letters picked without replacement from amaaamaammam. Give prob of sequence aama. 35/396 Calculate prob of sequence sksk when four letters picked without replacement from rsskkkks. 3/70 Four letters picked without replacement from ycyyptcctc. What is prob of sequence pcyt? 1/210 What is prob of sequence uu when two letters picked without replacement from ptwjzupu? 1/28 Calculate prob of sequence ddp when three letters picked without replacement from {d: 2, s: 1, o: 8, p: 6, l: 1}. 1/408 Two letters picked without replacement from {j: 1, r: 4, h: 2}. What is prob of sequence hh? 1/21 Four letters picked without replacement from {v: 11, a: 5}. What is	{ "pile_set_name": "DM Mathematics" }
2u2 - 3u - 2. Let m be b(p). Is 2 a factor of (2/m)/((-1)/17)? False Let p = -12 + 15. Is 43 a factor of ((-43)/p)/(27/(-243))? True Suppose 3c = 4030 + 662. Is 23 a factor of c? True Suppose 46 = -2s - 38. Let v = 72 + s. Is v a multiple of 6? True Let x(y) be the first derivative of -y*2/2 + 8y + 2. Is 2 a factor of x(4)? True Let p = -25 - -29. Does 3 divide (-33)/(-6) + 5 + 2/p? False Suppose 6g - y + 111 = 9g, 0 = -2g - 4y + 74. Suppose 0 = -45s + 46s - g. Is 37 a factor of s? True Let y = 54 - 50. Suppose -yd + 198 = i, -3i = -3d + 171 - 15. Does 10 divide d? True Suppose 9b + 24 = 15b. Is (b/3)/(-3 - 218/(-72)) a multiple of 24? True Let u = -177 + 502. Is u a multiple of 25? True Let l be 11/(-2) + 10/4. Suppose -46 = 2u - lt - 154, -2u = -t - 108. Is 27 a factor of u? True Let h(o) = -130o*3 - 2o*2 - 33o - 67. Does 8 divide h(-2)? False Let t(x) = -2x2 + 40x + 58. Is t(19) a multiple of 12? True Let x = 112 + 8. Suppose 0 = g - 3, -195 - x = -4i - 5g. Is 25 a factor of i? True Suppose -2299 = -22k + 1155. Is 6 a factor of k? False Suppose 4k - 163 = k + s, k = -3s + 71. Let p = k + -18. Suppose 12 = -2c + p. Is 8 a factor of c? False Let l(c) = -c*3 - 11c*2 - 3c - 10. Does 20 divide l(-14)? True Let q = -77 - -118. Suppose q = 6m - 5m. Is 10 a factor of m? False Suppose 3l - 1521 = -a, 9l + 5a = 10l - 491. Is 22 a factor of l? True Suppose -30w = -39w + 1161. Does 6 divide w? False Is 20 a factor of (-8)/(-192)30752? True Let m = 0 - -3. Suppose -mh + 45 = -2h. Is h a multiple of 6? False Let f be (-4)/6 + (-2 - 40/(-6)). Is 28/f - (2 - (1 - 1)) even? False Suppose 0 = -2g - 1 - 1. Let j be g + (-2 - -4) - -2. Suppose -jz = -k - 15, -z + 4k - 4 = 2. Is z a multiple of 6? True Suppose -2h + 124 = -4t + 36, 3h + 4t - 152 = 0. Let o = -19 + h. Is 5 a factor of o? False Let x = 19 + -14. Let b = 17 - x. Is b a multiple of 2? True Let j(w) = w3 + 11w*2 - 14w - 16. Let z be j(-12). Does 13 divide 833/z + (-1 - 7/(-8))? True Let a(k) = k + 10. Let c be a(-10). Suppose -4d + 225 + 7 = c. Let r = 7 + d. Is 20 a factor of r? False Let o be ((-12)/10)/((-5)/150). Let b(w) = w - 1. Let z be b(0). Is 18 a factor of ((-1)/2)/zo? True Let k(r) = -r*3 + 17r*2 + 45r - 11. Is k(18) a multiple of 39? False Let l(z) = -2z2 + 37z - 5. Is l(15) a multiple of 3? False Suppose -2q - 3q = -1560. Suppose 3o + 0o = q. Is 8 a factor of o? True Does 13 divide (-297 + 21/3)/(2/(-8))? False Let n(h) = 2 + 8 + 11h3 - 10h*3 - 9h - 11h2. Let d be n(12). Suppose -4j + d = -3j. Is j a multiple of 23? True Let i(b) = b3 - 5b*2 + 3b - 5. Let j be i(4). Let o = -3 + j. Does 6 divide o/(-22/2)? True Suppose -3q = -4o - 20, -3q - 2q + 5o = -35. Let n = q - 15. Is (-275)/n + 6/(-21) a multiple of 13? True Suppose g = 5x - 33, 5g + 85 = 6x - x. Let m = -79 - g. Let j = m - -99. Does 11 divide j? True Suppose -47x + 21x = -24882. Is x a multiple of 87? True Let u = -546 - -899. Suppose 0 = -7h + 1110 + u. Is 19 a factor of h? True Suppose x = 5g + 15 + 10, g = -4x - 5. Is (-13 + 1)(x + (-21)/28) a multiple of 4? False Let c be (78 - (10 - 5))/((-1)/(-1)). Let n(g) = -5g*3 + 2g*2 + g. Let a be n(-1). Let z = c - a. Is 24 a factor of z? False Let w be (18/(-21))/((-2)/28). Let i = w - 10. Suppose q = -iq + 18. Is 6 a factor of q? True Let k(r) = -r*2 + 19r - 29. Is k(7) a multiple of 40? False Suppose 2r = -4b, -5r - 10 = 5b - 0r. Suppose 0 = -4z - 2m + 232, -4z + 242 = -m - b. Does 10 divide z? True Suppose -7j + 8j + 1 = 0, 0 = -5o - 5j + 5715. Is o a multiple of 8? True Let w(m) = -3m + 14. Let b be w(3). Suppose 0 = -bv - 5x + 65, 2x + 19 = v + 6x. Does 2 divide v? False Let r(o) = -85o*2 + o. Let h be r(2). Let y = 478 + h. Does 35 divide y? True Let t(m) = -50m + 740. Is 48 a factor of t(-29)? False Let t(w) = 7w3 - 1 + 6w*2 + 3 - 7w3 + w3. Let c be t(-6). Suppose -q + 17 = 2q + y, y + 8 = cq. Is 2 a factor of q? False Let l be (-3 + -7)(-6)/10. Suppose 3o - lo = 45. Let m = 20 - o. Does 14 divide m? False Suppose -3w + 8 = -2r - 28, 2r = 4w - 40. Let y = r + 54. Let j = 140 - y. Does 30 divide j? False Does 4 divide 226/(74/42)? False Let n(p) = -11p3 + 18 + 14p*2 + 14p + 6p3 + 4p*3. Let t be n(15). Suppose -tf + 115 = 2f. Is 23 a factor of f? True Let h(s) = -3s*2 + 2s. Let f be h(2). Let i(g) = -8g - 10. Let c be i(f). Suppose c = 8a - 5a. Does 9 divide a? True Suppose -2072 = 15l - 62. Let j = -14 - l. Is j a multiple of 15? True Let s be 4 + (2/(-4))/((-6)/(-336)). Does 10 divide (-2290)/(-12) - 4/s? False Let l(r) = 6r - 2. Let u(t) = -t + 1. Let g(s) = -l(s) - 5u(s). Let p be g(-5). Let x = p + 8. Is x a multiple of 5? True Let r = -25 + 18. Let n = r - -4. Is 16 + (-2)/(-1 - n) a multiple of 10? False Let u(b) = 20 - b*2 - 19b - 33 + 13. Does 15 divide u(-10)? True Let y(z) = -z*2 - 12z + 5. Let v be y(-10). Let j = 28 - v. Suppose 0w + jw + 137 = 4a, a + 2w = 48. Is a a multiple of 6? False Suppose 11b + w = 6b + 3310, -3w = 0. Is 10 a factor of b? False Suppose 4i = 2i + 156. Is 26 a factor of 64/36i - (-4)/(-6)? False Suppose 5q + 2c = -49, 4q + 38 = -0q - 2c. Let h(t) = -t3 + 8t*2 + 2t + 2. Let y be h(8). Let o = q + y. Is o even? False Suppose 0 = -3u - 4p + 520, -2p + 68 - 396 = -2u. Suppose 4w + 24 = u. Is w a multiple of 12? True Let i(o) = -o3 + 32o*2 - 132o - 11. Is i(21) a multiple of 47? True Let i be 2 + 2 + -2 - -2. Suppose -io - 3z + 351 = 0, 5z + 70 = 2o - 125. Is (12/30)/(1/o) a multiple of 19? False Suppose -399 = -3f + 1371. Does 33 divide f? False Let v(p) = -p2 + 4p - 1. Let g be v(3). Suppose gq = -2, -5q = 4k - 9 + 2. Suppose kb - 2o - 11 = 6, 0 = 4b - 3o - 24. Is 3 a factor of b? True Let o = -20 - -25. Suppose 4d = 3d + ok + 97, -5d + k = -413. Is d a multiple of 14? False Let y(d) = 159d + 2. Suppose -2z = -v - 4z + 1, 3v - 3 = -2z. Let o be y(v). Is 9 a factor of o/5 + (-8)/40? False Suppose 1201j - 6376 = 1193j. Is 34 a factor of j? False Let d = -7 - -12. Suppose -5z = -dp - 4z - 41, -4z = -4. Is (84/p - 1)-2 a multiple of 23? True Suppose 64q + 14128 = 65712. Does 24 divide q? False Let r(p) = -p*3 + 10p*2 + 9p + 27. Let z be r(11). Suppose 694 - 94 = zm. Is 40 a factor of m? True Let v be ((-8)/5)/(4/(-10)). Suppose 3w + 0w = 2z + 90, vw - 120 = 2z. Is w a multiple of 4? False Let w(g) = -g*2 + 11g - 6. Let i be w(6). Let p = 24 - i. Suppose 2h = -ph + 88. Does 13 divide h? False Let y = 5 - 3. Suppose 23 = m - y. Does 2 divide (m/20)/((-1)/(-4))? False Let u(a) = 17a2 + 17a - 9. Is u(-4) a multiple of 13? True Let v(g) = g*2 - 13g + 1. Let h be v(13). Let b be (1 - h)/(-2) - -58. Let p = b + -20. Does 15 divide p? False Let n = -1 + -7. Let k be 1476/24n/6. Let f = k + 115. Is 4 a factor of f? False Let y = 165 - 9. Suppose -t = -2h + 60 + 98, 2t = 2h - y. Does 3 divide (-6)/9 - h/(-12)? True Suppose 0 = -8y + 13y + 115. Let a = y + 34. Does 3 divide a? False Let a = -52 + 62. Suppose -an = -839 - 31. Is n a multiple of 29? True Let l = 151 + -251. Let j = -57 - l. Is 7 a factor of j? False Let w(h) = -h - 8. Let x be w(-11). Is (2/x)/((-12)/(-3852)) a multiple of 29? False Let s = 627 + -355. Suppose -4 = 4v, 4k = 2k - 2v + s. Is 20 a factor of k? False Suppose u + 3 = 3. Is 3 + -4 + 86 + u a multiple of 17? True Suppose 5i = -5q + 145, -2i - 25 = -q + i. Let s = -13 + q. Suppose sh - 13h = 66. Does 11 divide h? True Let g = -137 - -630. Does 94 divide g? False Let p(c) = -c*3 + 2c*2 + 6c - 2. Let u be p(4). Suppose -2b = 2a - 54, -43 = -3a - b + 40. Let f = u + a. Is f a multiple of 9? True Let y be (-27)/(-15) + 2/10 + 58. Suppose 0 = 5p - 2t - 512, 2t + 146 = 2p - y. Is p a multiple of 31? False Let q = -15 - -17. Suppose 0 = qt - 1 - 47. Does 12 divide t? True Let t(i) = 9i2 + 2i - 1. Suppose -4b - 10 = 2. Is t(b) a multiple of 6? False Suppose 35s - 6229 = 4306. Does 7 divide s? True Does 23 divide (-6 - -4) + 2 + 3 + 549? True Suppose -3*z - 2 = -41. Let a = 27 - z. Is 5 a factor of 6/a - 469/(-49)? True Let s be (-4178)/(-18)	{ "pile_set_name": "DM Mathematics" }
895/184) Simplify (y*(-10)y1)(2/3)/(yyy*(1/8)y(y/y(-3/2))/yy*(-7)y(y/(y/(yy(-2))))/y) assuming y is positive. y(-21/8) Simplify ((t/(t*(1/4)/t)t)18)15/(((t/(t/(t/((tt/(t(tt/((t/(tt*0))/t))/t))/ttt)t)))/t)(1/10)/(t(-2/7)/t(-1))) assuming t is positive. t(26009/35) Simplify ((ll/(l(-5/4)/l)lll(2/17)/l)/((((l4/l)/l)/l)/(l*(-1/5)l)))/(l*(-2)((l/(l*(-1/2)l))/l)/ll(-3)/l5) assuming l is positive. l(5667/340) Simplify (xxx(-1/6))26x(9/7)/(x(-8/7)x) assuming x is positive. x(1031/21) Simplify (((l/((l(-1)/l)/l))35/(l(-11)/l(1/5)))43)(-3/5) assuming l is positive. l(-97524/25) Simplify ((((kkk/(k/k(3/8)k))/k)/k)/((kkk/k(-7/3))/k))/(k(-32))(-1/15) assuming k is positive. k(-851/120) Simplify ((x(2/5))(-3/7)x(-8)x(1/3))/((x(-4/7)xx*9xx)/(x8xx/((xx/(x*(1/7)x))/x))) assuming x is positive. x*(-958/105) Simplify (((ll*(-2/17)l)/(l/l*(-4))(l(l5lll)/l)/(l*(-4/7)ll))19)(-3/10) assuming l is positive. l(-23427/1190) Simplify ((r13)9/((r/(rr/(rr42))rr)/r18))(28/5) assuming r is positive. r(2548/5) Simplify ((x/(xx*(2/3)/x)xx(2/5)x)/((x*(5/4)x)/((x/(x*(-1/3)x))/xx)))/(x(1/5)(x/x*(-3/2))/x(x(2/7))(2/15)) assuming x is positive. x*(-129/140) Simplify ((hh(-2/3))/h(2/7))*25/((hhh/(h(-1/2)/h))(-42))(-5/3) assuming h is positive. h(-6590/21) Simplify (z/z(-5)zz(-9))(-43)/((z(-4)/z(-4))/(z0/z)(-1/4)) assuming z is positive. z(345/4) Simplify (h6h(-7))/((h/(h7h)h)/hh(1/7)h)h/(h/(hh*6h))(h/(hhh(-3/5)/h))/hh*5/hh3 assuming h is positive. h(681/35) Simplify (((mm(-1)mmm)/m)*(-21)(m/m1)(-35))/((m*(-1)mm((m/(m*(-1/2)m)mm)/m)/mmm)/(m(-2/5))(-42)) assuming m is positive. m(-287/10) Simplify ((y/y(1/4))*(-2/25)y*5y*(1/9)y)/(y/(y/y*1)y*(-3)y(y(-1/2)y)(-1/62)) assuming y is positive. y(196951/27900) Simplify ((((r(rr*10r)/r)/r)13)(20/7))(19/2) assuming r is positive. r(27170/7) Simplify ((l/(l/l*1l))/(((l*(-1/3)l)/l)/l))(-47)/(((l(2/5)/l)/l)/ll/(l/(ll*1ll)))12 assuming l is positive. l(-1192/15) Simplify ((g/(((gg*(2/9))/gg)/g))(2/9))38/((gg(7/4)gg(4/7))/(g(2/15)g(gg4)/g)) assuming g is positive. g(83687/11340) Simplify (((ii(i(3/7)/i)/i)/i)/i)/i2i4/i(-1/4)(i*3/ii(-3/10))(-1/43) assuming i is positive. i*(3847/6020) Simplify ((jj/(((j(-4/9)/j)/j)/j))(-2/81)/((j*(2/7)j)/(jj(9/7))))(-23) assuming j is positive. j(-14513/729) Simplify (x(-1/11)/(x/x20x)x(-17/4)/(x(x*(-18)/xx)/x))27 assuming x is positive. x(37611/44) Simplify (j*(-1/6)/(jj/j(3/4)))/(j(1/9)/(jj/(j/j(-1/5))j))(j/j1)(-4/21)/(jj*(1/2)j(1/2)) assuming j is positive. j(-311/180) Simplify (((m/m*(-18)m)/m(-2/5))/(m/(m/m(-21))m(-1/20)/m))(-3/8) assuming m is positive. m(-2547/160) Simplify ((y(-2/7))(3/35)(y(-2/5))(-8))/(yy(-4)/yyyy/((y*(4/3)/y)/y)(y(-2/5))(-15)) assuming y is positive. y(-1831/735) Simplify (w(2/7)/(w*(-2)w))*3(w(-1/4))(-1/12)/(w2/w(-5/3)) assuming w is positive. w(71/336) Simplify ((h1)*(3/2)(hh(3/4))/h(1/5))/((h0/h(-3/5))/(h(-2/19)(hh0)/h)) assuming h is positive. h(891/380) Simplify ((o(-2/17))(-1/8)(o/(ooo0))(-14/9))(-50) assuming o is positive. o(-24025/306) Simplify (v(-2/7))(-33)(v/((vv/v*(3/5)v)/v))/vvv(v(-1/4)v)/vv(v*4vv4)/(v(-1/4))(9/10) assuming v is positive. v(5601/280) Simplify (o(-34)/ooo/(o(-17)o)((o(-2/11)/o)/o)/o(8/3))(3/14) assuming o is positive. o(-103/22) Simplify ((uuu/(u/(uuu(-1/14))))/(u/(u/(uu/((u*10/u)/u))))((uu/(u/((u/u(5/9))/u)))/u)/u(-2/29))5 assuming u is positive. u(172505/3654) Simplify ((w/(w/w1))23)(-6/29)/((w0w/(wwww4/ww))/(w(w/w(-1/3))/www(-1/7))) assuming w is positive. w(2090/609) Simplify ((((iii(17/2)ii)/i(-9))(1/30))40)(-29) assuming i is positive. i(-2494/3) Simplify ((a/(aa*0a))(-30))(1/12)/((a(-1))18)(-13/2) assuming a is positive. a(-229/2) Simplify (k(k/(((kk*(4/3))/k)/k))/kkk(1/2))(-47)/(k(3/2)kk(-8))18 assuming k is positive. k(-17/6) Simplify ((d1)(-2/5)d(4/5)/d(-2/15))/((d(-1/2))(-3/10))(-5/7) assuming d is positive. d(269/420) Simplify ((ww(-1/4))(1/9))10/(ww*(-1/16)/ww(3/5))(1/13) assuming w is positive. w(2471/3120) Simplify (j/(j26/j)(j/(j/j(-1/17)))/j(j(2/17)/j)/(j/(j/(j/(j(-14)/j)))))(-39) assuming j is positive. j(27807/17) Simplify (tt6t)/t*(-2/13)((tt(-1/4))/t)(18/11)t*(2/5)ttt*(-7)tt3t7 assuming t is positive. t(20227/1430) Simplify (((q*(-3)/q)/q(q*(-4/11)/q)/qq)/(q(2/7)/q(-13)))2 assuming q is positive. q(-3026/77) Simplify (a/(aa12a)a3)(-2/191)(((a/((a(a/(((a(-11)aa)/aaa)/a))/a)/a))/a)/(aaa/(a6a)aa))22 assuming a is positive. a(-29394/191) Simplify ((((n/n(-1/4))(2/11))(-2/165))(-2/11))(-30) assuming n is positive. n(-20/1331) Simplify ((rr(-2))/r(r*(-5)r)/r)*(-3/17)((rr3/r)/(((((r/(r/r1rr))/r)/r)/r)/r))/(rr*(1/2)r)(-6/7) assuming r is positive. r(1354/119) Simplify (d(-3/5)/d)0/(d34/d3) assuming d is positive. d(-31) Simplify ((b(2/7)/bb)(-42)(b/((b/(b*(-3)bb))/b))/(b2b))/((bbb(-2))(6/13)/(b/b(-1))42) assuming b is positive. b69 Simplify (((l(2/11)/ll)/l)/l(-2))(-19)((l/(ll/l(-3)l)l)(-1/4))(-5/7) assuming l is positive. l(-1784/77) Simplify (h(-3/5)h*(3/4))/(hh*(2/11)h*4/h)((hh/h(-6/11))/h6)(5/8) assuming h is positive. h(-681/110) Simplify ((b(b/(bb0)b)/b)(-3/10))24((b(-1/4)b)/(bb(2/5)b))49 assuming b is positive. b(-1761/20) Simplify (q*5q(1/2))/(q/(q(-1)/q))*(-1/77)q*(-5)q*5q(-1/2)/(q(-2/17)/qq) assuming q is positive. q(6750/1309) Simplify (m/(m/(m/(mmm(3/11)mm)))mm(-4))(20/9)((mm/m1)(3/10))(1/2) assuming m is positive. m(-9101/660) Simplify q8q*(1/3)q(q(-2)/qq)*(3/14)(q(2/3))(-2/13)(((q(qq(-4/7))/q)/q)/q)/((qq/(qq(1/8)qq))/q) assuming q is positive. q(973/104) Simplify (((c/(c(-6)c)((cc(-10))/c)/c)(10/17))(-48))(-26) assuming c is positive. c(-62400/17) Simplify ((m/(m/m1))(-1/53))(11/8)(m(-2/3))26/(m(-5)m(1/9)) assuming m is positive. m(-47587/3816) Simplify ((r/((r1/r)/r))/r)(-32)/((r/r*(-1/4)r)/(rr/r3))r(4/11)/(r(1/5)rr)r(-2/11)r2/r assuming r is positive. r(-7979/220) Simplify (((((n(n/n2)/n)/n)/n)/n)(-4)/(((n/n(1/12)n)/n)/(n*(-1/2)n)))/(n/n*(2/3)n(-14))6 assuming n is positive. n(1171/12) Simplify (j(2/5)jjj)(1/48)(jj7j)/(j/j*2)(j(2/11)/j)/j(-2/13)(j(-1/4)/jj)(4/13) assuming j is positive. j(320191/34320) Simplify ((ss(-1/11))/s11)(-2/91)((s*(2/5)s)/(ss/(ss*(-1/3))))/(s/(sss(-7))ss5s) assuming s is positive. s*(-190864/15015) Simplify (uu*6u)/(u/(uu4))u*(-5)uuu(uu/(u/(u/u*(4/5))))/u(uuuu(-5)u*(-2)u)/(u*3uuu/(uu1u)) assuming u is positive. u(21/5) Simplify (f(-1)f(((ffff(2/5)ff)/f)/f)/fff)(-1)/((ff0)0/((f*(3/2)f)/fff/(ff3))) assuming f is positive. f(-49/10) Simplify ((y/y(-2/7))(-30))(-33)/(yy*(-2/19)yyy(7/2))(-8) assuming y is positive. y*(176094/133) Simplify (((((((h(h1/h)/h)/h)/h)/h)/h)(-1/41)/(hh(1/3))(-48))22)(24/7) assuming h is positive. h(1387584/287) Simplify zz*(-1/8)z/z*6z*(-1/6)z/z*(2/5)((z*(-2/19)/zz)/z(-5))(-19/3) assuming z is positive. z*(-4163/120) Simplify (((gg/(g*4g))/gg)14/(g(gg2g)/g)(-2/13))41 assuming g is positive. g*(-22058/13) Simplify ((aa*5a/(aaa*(-2/13)a)a)/(a/(((a(aa/a(-4))/a)/aaa)/a)a*(-4)))/(((aa/a*(4/3)aaa)/a0)/(a/a(-1))(-6)) assuming a is positive. a(-59/39) Simplify (d(-4/19)/(d28dd))/(d*32d*(-3/25)d) assuming d is positive. d*(-29968/475) Simplify (((mmm1m)/m)**(-	{ "pile_set_name": "DM Mathematics" }
q. 24q*3 Collect the terms in 2706n*2 - 5332n*2 + 2659n*2. 33n*2 Collect the terms in -22471b - 22486b + 12b*2 + 44957b. 12b2 Collect the terms in 472y*2 - 233y*2 - 240y2 + 12 + 5. -y2 + 17 Collect the terms in 29n - 2 - 420n + 77n - 231n. -545n - 2 Collect the terms in 76310 - 38157 - 2z - 38153. -2z Collect the terms in -2473z + 41z2 + 2473z + 62z2. 103z*2 Collect the terms in 533m*3 - 520m*3 + 645m - 645m. 13m*3 Collect the terms in -386n*2 + 755n*2 + 2 - 359n*2 + 3. 10n*2 + 5 Collect the terms in -1096u*3 - 1102u*3 - 1106u*3 + 3298u*3. -6u*3 Collect the terms in 59d*2 + 104d*2 - 199d*2 + 51d*2. 15d*2 Collect the terms in -79p*2 + 29p*2 + 20p*2 + 23p*2. -7p*2 Collect the terms in 69f*2 + 70f*2 + 420f + f*3 - 139f*2 - 420f. f*3 Collect the terms in 200o*3 - 24583 + 3o + 24583. 200o3 + 3o Collect the terms in 572p3 - 28p*2 + 26p*2 + 45p*3 + 234p*3. 851p*3 - 2p*2 Collect the terms in 2043n - 718n - 23 + 11 + 12. 1325n Collect the terms in 0 - 80p3 + 3 + 3 - 6. -80p*3 Collect the terms in 162 - 38w - 84 - 81. -38w - 3 Collect the terms in -1105p*2 - 6p*3 + p + 565p*2 + 540p*2. -6p*3 + p Collect the terms in -746w*2 - 749w*2 - 739w*2 - 743w*2 + 2974w*2. -3w*2 Collect the terms in -9o*3 - 13o*3 + 11 - 7o*3 - 4. -29o*3 + 7 Collect the terms in 6v*2 + 6725v - 10v2 + 6v*2 - 2. 2v*2 + 6725v - 2 Collect the terms in -88j + 85j - 26j2 - 35j*2. -61j*2 - 3j Collect the terms in -46n3 + 5572n*2 - 5572n*2. -46n*3 Collect the terms in -2111 - 2112 + 4223 + 3044n - 571n. 2473n Collect the terms in i + 4i + 234i*2 - 11i + 5i - 5. 234i*2 - i - 5 Collect the terms in -2 + 0 + 2 - 1249n. -1249n Collect the terms in 5486d + 25206d + 18680d. 49372d Collect the terms in -4512r*2 + 2215r*2 + 2299r*2. 2r*2 Collect the terms in 254c + 958c - 1210c - 21c3. -21c*3 + 2c Collect the terms in 17 - 23b2 - 30 + 12 - 10 + 11. -23b*2 Collect the terms in -1175w*2 - 27 + 2346w*2 - 1173w*2. -2w*2 - 27 Collect the terms in -16251345 + 4r*3 + 16251345. 4r*3 Collect the terms in -4f - 627661 + 627661. -4f Collect the terms in 399p + 2p2 - 894p - 800p - 1. 2p*2 - 1295p - 1 Collect the terms in 333w2 + 145w*2 - 89w*2. 389w*2 Collect the terms in 79s*2 - 232s*2 - 21s*2. -174s2 Collect the terms in -l2 - 356 - 241l + 356 + 36l. -l*2 - 205l Collect the terms in -1355a2 - 1391a*2 + 4138a*2 - 1389a*2. 3a*2 Collect the terms in 110x - 54x - 57x. -x Collect the terms in 77q - 149q + 72q + 2361q*2. 2361q*2 Collect the terms in -138480 + 138480 + 72q*3. 72q*3 Collect the terms in 4118068823 - 2a*3 - 4118068823. -2a*3 Collect the terms in 5g - 3g - 8g*2 - 39g*2 + 16g*2 + 8g*2. -23g*2 + 2g Collect the terms in -35145 + 17578 - 27k + 17567. -27k Collect the terms in -330z3 + 3101z*2 - 3101z*2. -330z*3 Collect the terms in 996n*2 - 495n*2 - 253n*2 - 252n*2. -4n*2 Collect the terms in 10g*2 + 3847734 - 4g - 3847734. 10g2 - 4g Collect the terms in -30j + 322j*3 + 6j + 13j + 11j. 322j3 Collect the terms in 2q + 17 + 0q - 5q - 96 + q. -2q - 79 Collect the terms in -2456x*3 - 6508x*3 - 5804x*3 + 775x*3. -13993x*3 Collect the terms in 11n*2 - 460612n + 460612n. 11n*2 Collect the terms in -23 + 26l*3 + 8 - 36l*3 + 8 + 7. -10l*3 Collect the terms in 1 + 7491g*2 - 8233g*2 - 1. -742g*2 Collect the terms in -22x*2 + 43x*2 + 50x*2 + 39x*2 - 21x*2. 89x*2 Collect the terms in -96128b + 604501b + 208924b. 717297b Collect the terms in 2050q + 0 - 2052q - 22. -2q - 22 Collect the terms in -48w - 44w + 92w - 1 + 114w*2. 114w*2 - 1 Collect the terms in -3b*2 - 506068b - 506067b + 1012135b. -3b2 Collect the terms in -47w*3 - 37w*3 - 160w*3 - 372w*3. -616w3 Collect the terms in k2 - 8969800k - 3k*2 + 8969800k. -2k2 Collect the terms in 1933v*2 - 1367v + 1367v + 906v*2. 2839v*2 Collect the terms in 13a*3 + 8a*3 - 2a*3 + 19a*3. 38a*3 Collect the terms in -3 + 8k*2 + 1 + 3k*2 - 7k*2. 4k*2 - 2 Collect the terms in -8c*3 - 95c + 95c + 23c*3. 15c*3 Collect the terms in -2121 - 88q + 2121 - 156q + 2q*2 - 6q. 2q2 - 250q Collect the terms in 1495v3 + 1158v*3 + 2183v*3 + 3197v*3. 8033v*3 Collect the terms in 801y*3 + 2433y*3 + 1976y*3. 5210y*3 Collect the terms in -65o - 131o + 198o - 3. 2o - 3 Collect the terms in -208a + 408a - 200a + 21a2. 21a*2 Collect the terms in -218j*3 + 125j*3 + 3j*3 + 104j*3. 14j*3 Collect the terms in 3323c*2 + 3347c*2 + 3354c*2 - 13371c*2 + 3349c*2. 2c*2 Collect the terms in 10847786616 - 10847786616 + 13k*3. 13k*3 Collect the terms in -825q*3 - 754q*3 + 3251q*3 - 837q*3 - 833q*3. 2q*3 Collect the terms in -237i - 196i + 474i + 13. 41i + 13 Collect the terms in 372f*3 + 625f*2 - 1283f*2 + 658f*2. 372f*3 Collect the terms in 3 + 21 - 11m + 5 + 1. -11m + 30 Collect the terms in -p3 + 0p3 + 1172 + 1166 - 2338. -p3 Collect the terms in 18w2 + 16w*2 + 12w*2 - 10w*2 - 7w*2. 29w*2 Collect the terms in 49g - 205g + 50g - 7g2 + 47g + 59g. -7g*2 Collect the terms in -323t*2 + 648t*2 + 53t*2. 378t*2 Collect the terms in 169u*3 - 895u*3 + 734u*3. 8u*3 Collect the terms in -4l + 13136l3 + l2 + 4l - 12996l3. 140l3 + l2 Collect the terms in 10 - 19 + 169476f3 + 9. 169476f*3 Collect the terms in 11g - 13g + 18 + 17 - 14. -2g + 21 Collect the terms in s*2 + 6395482s - 6395482s. s2 Collect the terms in k2 - 1036k - 14 + 0 - 436k3 + 1036k. -436k3 + k2 - 14 Collect the terms in 61f + 65f + 78f + 251f - 163f. 292f Collect the terms in 20m*2 + 23734028 - 23734028. 20m*2 Collect the terms in 142p*2 - 52p*2 - 94p*2. -4p*2 Collect the terms in -3o*2 - 4o*2 + 2920o - 2918o. -7o*2 + 2o Collect the terms in 3 + 12 - 31 + 16 - 239z2. -239z*2 Collect the terms in 205599b*2 - 205599b*2 - 16b*3. -16b*3 Collect the terms in 3368 - 3368 - 15377m*2. -15377m*2 Collect the terms in 2141d - 1062d - 1072d. 7d Collect the terms in 60s*2 - 306s - 1 - 60s2 - s3. -s3 - 306s - 1 Collect the terms in -9m3 + 2374 - 795 - 789 - 790. -9m*3 Collect the terms in -3q - 95q - 30q - 47q. -175q Collect the terms in 6c - 11c + 5c + 418c*3 + 779c*3. 1197c*3 Collect the terms in 8d*2 + 10d*2 - 13d*2 - 4d*2 - 15d*2. -14d*2 Collect the terms in 3o*2 - 113514 + 33o*3 - 31o*3 + 113514 - 3o*2. 2o*3 Collect the terms in -107v*3 - 94v*3 - 8v*3 - 238v*3 + 73v*3. -374v*3 Collect the terms in -459s*2 + 1816s*2 + 2s*3 - 460s*2 - 460s*2 - 437s*2. 2s*3 Collect the terms in -56781j + 52808j + 265865j. 261892j Collect the terms in -309 + 585 - 276 + 237m*3. 237m*3 Collect the terms in 66a - 15a + 136a - 184a. 3a Collect the terms in 13o2 - 58o*2 + 17o*2 + 8o*2 + 11o*2 + 10o2. o2 Collect the terms in 1780l - 438l - 427l - 474l - 437l. 4l Collect the terms in 3h + 19h - 38h - 4h*3 - 2h*3 - 29h. -6h3 - 45h Collect the terms in 3w2 + 6602w + 11476w + 4919w. 3w2 + 22997w Collect the terms in 1284562 - g3 - 1284562. -g3 Collect the terms in 31235685986m2 - 31235685986m2 - m3. -m*3 Collect the terms in -153c*3 - 156c*3 + 472c*3 - 159c*3. 4c*3 Collect the terms in 35657k + 3k2 - 233971k - k*2. 2k*2 - 198314k Collect the terms in -19381c + 27556c + 48659c. 56834c Collect the terms in -357x3 + 715x*3 - 357x3. x3 Collect the terms in -13219006x + 6609507x + 6609511x. 12x Collect the terms in 4628w - 4628w + 300w3 - 303w*3. -3w*3 Collect the terms in 686f*2 + 803f*2 - 1492f*2. -3f*2 Collect the terms in 83y + 48 - 56y - 19 - 12 - 16. 27y + 1 Collect the terms in 73k2 + 238 - 824k*2 - 233. -751k*2 + 5 Collect the terms in 1628a + 1522a - 3319a. -169*a Collect the terms in 36	{ "pile_set_name": "DM Mathematics" }
56))))/(sqrt(72)/(sqrt(144) - sqrt(144)-2))24. -168sqrt(7) Simplify (sqrt(6) - sqrt(18)/sqrt(3)-4 - (sqrt(6) - sqrt(24)/sqrt(4))-6)/(2sqrt(50)-1). -sqrt(3)/2 Simplify 5(-5(5(sqrt(80)/sqrt(8) - sqrt(10)) + sqrt(10) + sqrt(10)))/(3sqrt(20)/(-4sqrt(10))). 200sqrt(5)/3 Simplify -1(3 + (5 + (-2 + sqrt(612))-1)3 + 1)2. -6133 + 900sqrt(17) Simplify (1(sqrt(96) - (sqrt(96)-1-4 - sqrt(96))))/((1sqrt(16)6)/((sqrt(224)/sqrt(4))/sqrt(7))). -4sqrt(3)/3 Simplify 6(sqrt(39)/sqrt(27) + 5 + sqrt(52))2 + -3(5 + -1 + sqrt(468)). 122sqrt(13) + 1688/3 Simplify sqrt(1584)-3 + 5 + 5(-2 + sqrt(1584)) - (sqrt(1584)11 + -4 + 2). -3 + 12sqrt(11) Simplify ((-21(sqrt(363) + -1) + 1 + (1 + sqrt(363))-6 + 2)3)*2. 1584sqrt(3) + 209097 Simplify 1 + ((sqrt(128) + 2)4 + (-2 + sqrt(128))4 + (-52sqrt(128) - sqrt(128))2)2. 25089 Simplify ((sqrt(66) + (sqrt(66) - sqrt(66)-2)4)/(1sqrt(150)) - (-3(0 + sqrt(11)-1) + sqrt(44)-2 + sqrt(880)/sqrt(5)))2. 44/25 Simplify 3 + 5(-2sqrt(3388))2 - -4((sqrt(175) - (sqrt(175) + 1 + sqrt(175) + -5 + sqrt(175))) + -3)*2. -80sqrt(7) + 70567 Simplify (4(0 + (sqrt(891) + (sqrt(891) - 1sqrt(891)-5) - (sqrt(891) + (sqrt(891) - (-2(sqrt(891) - (sqrt(891)-2 - sqrt(891))) - sqrt(891))))))-3)*2. 2052864 Simplify 1(((sqrt(637) - 4sqrt(637)) + sqrt(13) + -1 + sqrt(1573))1 + 3)3. -27sqrt(13) + 6 Simplify ((1 + (sqrt(208) + 1sqrt(208))2 + sqrt(208) + 43sqrt(208))-6 + -2)2. -10000 - 624sqrt(13) Simplify 5 + 3((-1 + sqrt(343))-1 + 3 + -2)*2-5. -5200 + 420sqrt(7) Simplify -3(sqrt(10)/(sqrt(5)-24) + sqrt(8)-6-3) + -5. -861sqrt(2)/8 - 5 Simplify (-2sqrt(11) + 2 + -4sqrt(33)/sqrt(3))2 + 2 + -5 + (1sqrt(11))*2-4. -24sqrt(11) + 353 Simplify ((-4sqrt(30)1)/sqrt(10) - -6(3 + -2sqrt(3))) + (3sqrt(9)/(sqrt(12)/sqrt(4)-1))2 + 1. -16sqrt(3) + 46 Simplify -2 + (6(sqrt(704) + 0))2 + -4 - ((sqrt(704)-2 + 3 + sqrt(704) - (0 + sqrt(704))-3) + -2)2. -32sqrt(11) + 22521 Simplify 4 + ((-3-3(sqrt(117) + sqrt(117)3 - sqrt(117)))2 - (-5 + 0 + sqrt(117) + (sqrt(117) - (2 + -1 + sqrt(117))))). -3sqrt(13) + 85303 Simplify -2 + (((sqrt(204) + (sqrt(204)-2 - sqrt(204)))6)/(-2sqrt(300)) - (sqrt(68) + -6(sqrt(68) + -1sqrt(68)) + sqrt(68))/((sqrt(40)/sqrt(2))/sqrt(5))). -4sqrt(17)/5 - 2 Simplify 6(4 + (-5 + -11sqrt(1872))2 + 0 + 3(-1 + sqrt(1872) + sqrt(1872))). 1152sqrt(13) + 11388 Simplify -4(3(sqrt(700) + -1)2 + -4 - (-6(sqrt(700) + (sqrt(700) - sqrt(700)-1)) + -5)2)5. 37200sqrt(7) + 4494520 Simplify (-3 + (sqrt(242) - -1sqrt(242)4) + 4(0 + sqrt(242)) + 2 + 1(5 + -3 + -1 + sqrt(242)))2. 24200 Simplify (-2(-5 + 1sqrt(1800) + sqrt(1800)) + (sqrt(800)-21 - sqrt(800))6)*2. -9600sqrt(2) + 460900 Simplify 1(-5 + -3 + -2 + sqrt(425) + 4(sqrt(425) + -1) + -2)*2. -800sqrt(17) + 10881 Simplify ((sqrt(77) + -2(sqrt(77) + sqrt(77) + -3sqrt(77)))2)/(sqrt(84)/(sqrt(84)/sqrt(112)))3. 9sqrt(11)/2 Simplify 1(5 + sqrt(275)-1 + sqrt(275) - (0 + sqrt(275))-2 - 3((1 + sqrt(275))2 + sqrt(275)))*2-1. -13476 - 70sqrt(11) Simplify ((-4 + (sqrt(72)1 + sqrt(72) - sqrt(72))-2 + sqrt(72) + sqrt(72) + (2 + sqrt(72) + sqrt(72))-4 + 3)-4-3)*2. 124416sqrt(2) + 675216 Simplify ((sqrt(18)3-2 + (1sqrt(72))/sqrt(4))/((sqrt(1296) - sqrt(1296)-3) + (sqrt(81) + -1sqrt(81) - sqrt(9))))2. 50/2209 Simplify (4 + 4((sqrt(1331) - -3sqrt(1331)) + sqrt(1331) + 0 + sqrt(1331) + (sqrt(1331) - (sqrt(1331) + 2))1))*2 + 4. -2112sqrt(11) + 766676 Simplify (-2 + sqrt(720)1)-4 + (3(sqrt(720) - (sqrt(720) + 3)) + -2)2 + 2. -48sqrt(5) + 131 Simplify (((0 + sqrt(684) - sqrt(684)) + -4 - -4sqrt(684)1) + 4 - (sqrt(38)/(sqrt(14)/sqrt(112)) - (sqrt(2299) + sqrt(2299) + -1)5))2. -1300sqrt(19) + 321125 Simplify (-5(sqrt(144)-2 - sqrt(144))5)/(6(sqrt(12) + -6sqrt(48))) + -5. -5 - 25sqrt(3)/11 Simplify (3(3 + (((1sqrt(475) - sqrt(475)) + sqrt(475))-1 - (-1 + sqrt(475))-2) + (2 + sqrt(475) + -1)-2))22. 180sqrt(19) + 8568 Simplify -2 + (-2sqrt(648) + sqrt(16)/(sqrt(2) + sqrt(4)/sqrt(2)))/(sqrt(576) - (sqrt(576) + sqrt(576)2 + sqrt(576))). -2 + 35sqrt(2)/72 Simplify 4((-1sqrt(1331)2 + sqrt(1331))2 + (sqrt(1331) - -5(-1 + sqrt(1331)))*2 + 61sqrt(1331)2). -2112sqrt(11) + 197088 Simplify 3(sqrt(171) + sqrt(171)1 + -1 + sqrt(171))24 - -1(sqrt(2299) + (sqrt(2299) - (1 + sqrt(2299))) + sqrt(2299) + sqrt(2299) - (2 + sqrt(684)))2. -378sqrt(19) + 32340 Simplify (sqrt(36)/sqrt(3)6)/(sqrt(384) - sqrt(384)-1) + (2(2sqrt(98))2 - (0 + (-1 + sqrt(98))2)). 115sqrt(2)/8 + 685 Simplify (1(sqrt(65)-3-4 - sqrt(65))6)/(((1sqrt(165))/sqrt(3))/(sqrt(44)/(2sqrt(4)) + sqrt(11))). 99sqrt(13) Simplify 3 + (4 + (sqrt(637) + 1)-4 - ((sqrt(637) + 0)5 + (-4 + 0 + sqrt(637) - sqrt(637))))*2 + 1. -504sqrt(13) + 51617 Simplify ((4 + sqrt(208))*2 - (sqrt(52) - sqrt(312)/((sqrt(6) - sqrt(486)) + sqrt(6)))) + (-4(3 + sqrt(52)) + 2)-5. 488sqrt(13)/7 + 274 Simplify 1 + (-1 + (3sqrt(4840) - sqrt(4840))/sqrt(8) + (-3 + sqrt(5)6)6)2. -2204sqrt(5) + 17182 Simplify (-4(sqrt(176) + ((-1sqrt(176) - sqrt(176)) + sqrt(176))1))/(4sqrt(64) + sqrt(432)/sqrt(12))3. 0 Simplify ((sqrt(270) - sqrt(270)3)/(sqrt(10) - sqrt(60)/(-1sqrt(6) - sqrt(6))))2 - (5 + sqrt(1728) + -3 + sqrt(1728)2)*2. -15508 - 288sqrt(3) Simplify (2sqrt(2156)6 - sqrt(2156))/((-1sqrt(12))/sqrt(3) - sqrt(40)/sqrt(90))-1. 231sqrt(11)/4 Simplify -12(3(sqrt(17) + (sqrt(17)-2)2 + sqrt(17))-1 + (-41sqrt(612))*2). -19176 + 12sqrt(17) Simplify (-6(-5(sqrt(684) - 3sqrt(684)) - (3 + (sqrt(684) - sqrt(684)-4))))*2 + 2 + 1. -6480sqrt(19) + 615927 Simplify 5 + (((sqrt(240) - -4(sqrt(240) + sqrt(240)-3))/sqrt(12))/((sqrt(90) + sqrt(90)-5)4) + 5)*2. 35sqrt(2)/24 + 34609/1152 Simplify (4sqrt(28)-1 + sqrt(140)/sqrt(5)-6)/(sqrt(576)-4 + (-1sqrt(64) - sqrt(64)) + sqrt(64) + sqrt(64))1. 5sqrt(7)/24 Simplify ((((sqrt(40) - sqrt(80)/sqrt(2)) + sqrt(40))2)/sqrt(2)5)/(-2(sqrt(10) + sqrt(10) + sqrt(30)/(sqrt(6)/sqrt(2)) + sqrt(10))5). -sqrt(2)/4 Simplify (3 + (sqrt(847) + (sqrt(847) + 1 + 3)2 - (sqrt(847) + 2 + 1)) + ((sqrt(847) + sqrt(847) + 3)-5)*2-2)-6. 39072sqrt(7) + 1013922 Simplify 4 + -4(sqrt(70)-16 - sqrt(70)-16)/((sqrt(90)-3-3)/sqrt(9)). 4 Simplify ((-5(sqrt(375) - 1sqrt(375)) - sqrt(375))/(-6sqrt(20) + sqrt(500) + 2sqrt(500)))26. 25/18 Simplify -3 + -2sqrt(2299) + sqrt(2299) + sqrt(2299) + (sqrt(2299) + (sqrt(2299) + 0 - sqrt(2299)))21 + -1(3 + sqrt(1900))2-2. 120sqrt(19) + 6114 Simplify -5(-4 + (-2(sqrt(3) - (sqrt(3) + sqrt(27)/(sqrt(9)4))) - 2sqrt(12)4)*2). -14335/4 Simplify (2sqrt(850))/(sqrt(12)/(sqrt(6) + sqrt(6)1 - sqrt(6))) - (sqrt(136) - (sqrt(136) - sqrt(136)2))/((sqrt(32)/sqrt(2))/sqrt(8)). 6sqrt(17) Simplify (1-6(sqrt(864) - sqrt(864)1))/(-3(sqrt(12) + sqrt(432) + sqrt(12)) - 4sqrt(192)). 0 Simplify 0 + -1(4 + (sqrt(2057)-2 - sqrt(2057))*2 + 1)2. -37036 Simplify (sqrt(432) + -1 - (sqrt(363) - 1sqrt(363)))2 - ((5 + -1 + sqrt(3) + sqrt(3) - (-1 + sqrt(3) + 3)2) + -4). -22sqrt(3) + 440 Simplify ((sqrt(130)26 + sqrt(130) + -1-1sqrt(130))/(-6sqrt(60)/(sqrt(6)-4)))*2. 10192/9 Simplify (33(-1 + -5(-1 + -1-2sqrt(208)))-6)2. -933120sqrt(13) + 60699456 Simplify -5(1((sqrt(119) - 1sqrt(119)) + sqrt(119))-2)/(-4(sqrt(567)-1 - sqrt(567) - sqrt(567))). 5sqrt(17)/54 Simplify (sqrt(272) - 2sqrt(272)2 - sqrt(272) - sqrt(272)-3-1 - 5-5(sqrt(272) + -3sqrt(272))4)2. 11654928 Simplify 3(sqrt(76)/(sqrt(48)/(sqrt(48)/sqrt(4))))*2 + ((-1sqrt(209)-6)/(2sqrt(99)))*2. 76 Simplify -6((-2sqrt(165) + sqrt(165))/sqrt(11))/(sqrt(5)-16) + 1((-4 + 3sqrt(48))2 + 2). -97sqrt(3) + 450 Simplify ((sqrt(33)/(sqrt(18)/sqrt(6)) - sqrt(11) - (4sqrt(99))/sqrt(9)) + sqrt(891)-16 + 1)2. -116sqrt(11) + 2 Simplify (4 + -1 + sqrt(147) + 6(sqrt(147) + -2))*2 - (4 + (1sqrt(108) + -2)*2-6). -1026sqrt(3) + 7952 Simplify ((1sqrt(1584) - sqrt(44) - sqrt(44)) + sqrt(704) + sqrt(704)-4 + sqrt(44))/((-2sqrt(144)/sqrt(4))/(-2sqrt(1296))) + -5. -84sqrt(11) - 5 Simplify ((-5 + ((-1 + sqrt(208))5 + 5 + sqrt(208) + 1 + -2 + sqrt(208) + sqrt(208)-2 + -3 + (sqrt(	{ "pile_set_name": "DM Mathematics" }
uppose 3s + s + 8 = -4k, -4k + 5s + v = 0. Does 12 divide (33 - 9)/(1/(3/k))? True Suppose -11o - 160o = -34o - 537040. Is o a multiple of 20? True Suppose q - 115 = -4y, y + 5q - 7 + 2 = 0. Is 655/(-2)(-36)/y a multiple of 18? False Suppose u - 194 - 606 = 0. Suppose -u = 4l + 48. Let q = -40 - l. Does 20 divide q? False Suppose -2t - 24 = t. Let v(d) be the second derivative of -d*3/3 - 3d*2 - 9d + 7. Is 5 a factor of v(t)? True Suppose -8476 = -h + 2f, h - 20f = -21f + 8482. Is 16 a factor of h? True Let a(v) = 225v*2 + 5v + 5. Let m be a(-4). Suppose -j - 717 = -2j - 5i, 5j - 2i = m. Does 13 divide j? False Let d(k) = 4k + 2k - 108 + 95 - 5k2 + k - 3k*3 + 2k*2. Is 12 a factor of d(-5)? True Let v(a) = 117a + 941. Does 8 divide v(-7)? False Let c(d) = -27 + 53 - 33d - 39. Is c(-5) a multiple of 7? False Let x be ((-368)/(-12))/(-1)(18 - 0). Let w = x + 1043. Is 26 a factor of w? False Let d = -1162 + 592. Is 5/1 - d/6 a multiple of 3? False Suppose 20 = -5a, -5m = -4a - 7495 - 48731. Is m a multiple of 146? True Let n(h) = -2h*3 - 6h*2 - 5h - 6. Let y be n(-5). Suppose 4f = 0, -4r - y = 3f - 335. Suppose -j - 26 = -5l + r, 0 = 4j. Does 3 divide l? False Let l(b) = -2b*2 - 65b - 21. Let n be l(-32). Does 10 divide n/33(-810)/(-5)? False Suppose 23n + 477582 = 73n - 29n. Is 166 a factor of n? True Let g(p) = p*2 - 6p - 5. Let v be g(7). Suppose -vq + 219 = o, -o - 2o = 3q - 645. Does 11 divide o? False Let k(j) = -19j - 205. Let g be k(-11). Suppose -4w = w + 4t - 1328, 2w - 536 = -gt. Is w a multiple of 24? True Let d = -8495 - -26397. Is 7 a factor of d? False Let u(i) = -17i + 29i - 9i - 7. Let y be u(3). Suppose -5g = -3g + 5n - 140, -yn + 146 = 2g. Does 21 divide g? False Suppose 2c = -2k + 832, -k - 5c + 400 = -0k. Suppose -6g - k = -2f - 2g, -3f = g - 609. Is 8 a factor of f? False Let a(g) = 78g + 24. Let y be a(5). Suppose 68t - 74t = -y. Is 19 a factor of t? False Suppose -832 = -m + 5r, -2m - 356r + 1712 = -360r. Does 5 divide m? False Let g = 472 - 476. Does 2 divide 1146/26 - g/(-52)? True Let k(c) = -6c*3 + 4c*2 + 28c + 227. Is k(-7) a multiple of 41? False Suppose -2l - 3q - 803 = 0, 6l - 7l + 2q = 412. Let o = l + 705. Is 17 a factor of o? False Suppose -7n = -2372 - 5755. Is n a multiple of 27? True Let b = 23555 - -11474. Does 26 divide b? False Does 3 divide ((-1650)/(-20))/(15/30)? True Suppose -z + 1020 = -4q - 3945, 0 = 2z - 2q - 9948. Is 79 a factor of z? True Suppose -38335 = -2g - 7u, -3g - 4u = -u - 57510. Does 150 divide g? False Let r be ((-32)/6)/(-2)(-1425)/(-10). Suppose -b - 5d + 95 = 0, 4b + 6d - r = 9d. Does 7 divide b? False Suppose -7l + 3l + 102 = 2m, -m - 27 = -l. Suppose -ly + 10y + 1344 = 0. Is 14 a factor of y? True Let j = 26 + -28. Let n = 3 - j. Suppose -3v = -3b + 72, -2b + nv = v - 42. Is 14 a factor of b? False Suppose 24 = -4x - 4s, -3x + 5s + 9 = 3. Let j(b) = -30b + 30. Does 5 divide j(x)? True Let d(x) = -x + 8. Let k be 12 + (-3 - (0 - 2))-1. Let z be d(k). Let s = z - -27. Is s a multiple of 9? False Suppose 615h - 37878 = 614h + 5l, -h = 2l - 37836. Is h a multiple of 249? True Let p be 3135/171(-6)/(-5). Suppose p = 2j - 2512. Is 54 a factor of j? False Let d be ((-1)/2)/(2/(-252)). Suppose -25z = -765 + 265. Let n = d - z. Is n a multiple of 20? False Let r be (1 - 1)23/(-69). Let s be (r + 0)(28/8 + -3). Suppose h = o - 34, 3h + 176 = 5o - sh. Is 30 a factor of o? False Let q = -1519 + 3816. Is 7 a factor of q? False Is 36 a factor of 11436/(-5)(-5)/3? False Let y(d) = 6d3 - 17d*2 - 31d - 7. Let f(h) = 7h3 - 18h*2 - 32h - 8. Let m(b) = -4f(b) + 5y(b). Is m(11) a multiple of 11? False Suppose -11 = 2k - k. Let h = 15 + k. Suppose c - hc + 285 = 0. Does 19 divide c? True Suppose -2105 = 2n + 5q - 36054, 0 = -4n - 3q + 67947. Is n a multiple of 32? True Let j be (-6)/(-4) + 15/6. Suppose -z + 1 = -jm, 3z = 6z - 2m - 53. Suppose -zo + 23o = 120. Is o a multiple of 12? True Suppose 0f + 5k - 5 = 4f, 4 = 4k. Suppose f = 24h - 22h - 4. Suppose 12b - 2250 = hb. Is b a multiple of 15? True Suppose 29k = 4f + 28k - 1452, -k = 5f - 1797. Let n = 92 + -178. Let j = f + n. Does 25 divide j? True Let l be 8/(-28) + (4 - 235/35). Let g(c) = -91c - 33. Is 20 a factor of g(l)? True Let a(i) = 12i*2 + 24i - 186. Is a(-29) a multiple of 42? False Suppose -2i = -i + i. Suppose 2z = 3d - 41, id + d = 3z + 9. Suppose 4n + 5k = -9, -5n + 5k + 30 + d = 0. Does 4 divide n? True Let a = 202 - 200. Suppose -ab - 88 = -3v - v, -2v + 36 = b. Does 5 divide v? True Suppose 10 = 2p + 2t, -5p + 23 = 5t - 2t. Suppose -h = 3s - 95, -5s = -ps - 1. Is 10 a factor of h? False Let h(q) = -q + 38. Suppose 2z + 3z = 0. Let s be h(z). Let y = 138 - s. Is y a multiple of 25? True Suppose b - 539 = -10b. Let z be (14/b)/((-2)/14) + 1. Does 10 divide ((-186)/2z/(-3))/(-1)? False Suppose -33 = -24g + 21g. Let k(v) = v*3 - 11v*2 + 13v + 20. Let x be k(g). Is (0/(-4) - -5) + x a multiple of 12? True Is 12 a factor of (20/(-50))/((-65757)/(-16440) - (-4)/(-1))? False Let l = -25 - -24. Let z be (-8l/(-6))/((-2)/6). Suppose -zi = -x + 101, 0 = x + 4x + 5i - 605. Does 13 divide x? True Suppose 3j = -z + 7370, -6j + 4z = -3j - 7360. Suppose -2462y + 1800 = -jy. Is y a multiple of 22? False Let h(s) = -s*3 - 4s*2 + 7s + 9. Suppose 0 = 11i + 7 + 15. Let b be i/(-5) + 160/(-25). Does 10 divide h(b)? False Let y(r) = 13r - 4525 + 4439 - 65r. Is y(-3) a multiple of 11? False Let a(o) = -o3 + o2 + 5o + 3. Let y be a(-1). Suppose n + s - 231 = y, -s = -5s. Does 7 divide n? True Let j = -1006 - -1016. Suppose 7w - 4q + 5212 = jw, 0 = 5w - q - 8656. Is w a multiple of 16? False Suppose 3574 + 1056 = 5a + 5f, -2a + 1870 = 5f. Is a a multiple of 8? True Let z(t) = 10t - 22. Let c be z(5). Suppose 5u - c = u. Let l = 41 - u. Is l a multiple of 16? False Let t(f) be the first derivative of -25f*2/2 - 54f - 1. Is t(-24) a multiple of 26? True Let r be (-9)/18(0 - 6) - 0. Suppose 3j - 4j + 147 = -i, -5j + 732 = -2i. Suppose 4g - j - 362 = 4k, rg - 402 = -4k. Does 11 divide g? False Does 28 divide ((-5)/10 - 1/(-2)) + (3432 - 57)? False Let m(f) = -2f - 10. Let a be m(-9). Suppose 10l - 36 = al. Suppose 0 = -lu + 24u - 588. Is u a multiple of 14? True Let g(s) = -5s2 + 533s - 114. Is g(57) a multiple of 123? True Let w = 42 - 44. Let j(c) = -3c2 - 3c - 1. Let b be j(w). Let k(z) = -18z + 6. Is k(b) a multiple of 33? True Let b = 121 + -122. Let l(k) = 161k2 - 1. Is 8 a factor of l(b)? True Let o(q) = q3 + 8q2 + q - 4. Let g be o(-7). Let v(m) = -2m*2 - 18m + 20. Let x be v(-12). Let f = g - x. Is f a multiple of 30? True Let q = 99 - 139. Let p = 194 + q. Does 7 divide p? True Suppose -4d + 5d = 4. Suppose 3m + 2f = -993 - 370, -4m = df + 1820. Is 31 a factor of m/(-2) + (-9)/61? False Does 15 divide -2790((-40)/20)/(8/6)? True Let v = 20 + -17. Suppose 2m = -a + 2, m = a + 2m - v. Suppose 4y + 0g = g + 188, 76 = 2y + ag. Is 9 a factor of y? False Let v = 29105 + -8616. Does 38 divide v? False Suppose -4x - 28 = 0, -2f + 3x = -10540 - 7423. Is 5 a factor of f? False Suppose -2n + 28 + 22 = 5c, 160 = 5n - 5c. Suppose -3u + 2x + 102 = -3x, -u = -3x - n. Suppose -u = -f + s, 2s + s = 4f - 155. Is f a multiple of 19? True Let o(d) = -20d + 16d + 5d + 32. Is o(-5) a multiple of 9? True Suppose -2y = 10f - 8f - 4406, -3f + 8807 = 4y. Is 7 a factor of y? True Let a be (1 + 99/(-27))9/(-2). Suppose 19z - a - 121 = 0. Suppose zn - 936 = -5n. Does 6 divide n? True Let g(o) = 1030o2 + 26o - 3. Is g(-2) a multiple of 13? False Let k = 36043 - 15637. Does 38 divide k? True Let v be (96)/(68/748). Suppose 5z + 4d - 3562 = 0, 2d + v = z - 124. Is 38 a factor of z? False Let v(g) be the third derivative of -7g4/12 - 59g*3/6 - 3g*2. Suppose -2m = -3r - 65, m - 13 = -4r - 107. Is v(r) a multiple of 26? False Suppose 0 = 2w + 5n - 11869, 3w + 94n - 17778 = 95*n. Is w a multiple of 12? False Let r = 8871 - 6775. Is r a multiple	{ "pile_set_name": "DM Mathematics" }
v - 5o + 56 + 54 = 0. List the prime factors of v. 2, 11 Suppose -40 = -3j - 3p + 182, 3p + 210 = 3j. List the prime factors of j. 2, 3 Let s be 2/(34/16 + -2). Let a = s - -2. What are the prime factors of a? 2, 3 Suppose 0n + 188 = 2n - 4a, 0 = 4n + 4a - 316. What are the prime factors of n? 2, 3, 7 Let q = 3 - 0. Suppose qo = 7o + 36. What are the prime factors of (-6)/o(-36)/(-2)? 2, 3 Let c(z) = -1 + 3z*2 + 11z + 3z2 - 5z*2 - 2z*2. Let k = 14 - 4. List the prime factors of c(k). 3 Suppose 2x - 792 = -v, 2v = -5x - v + 1982. What are the prime factors of x? 2, 197 Let z = -4 + -2. Let v = 9 + z. Let j(p) = p*2 - p + 3. What are the prime factors of j(v)? 3 Let h(i) = 2i*2 + 6i + 7. Let g(v) = -v - 1. Let k(w) = 6g(w) + h(w). Let c be k(-1). Suppose 6 = a + c. List the prime factors of a. 3 Suppose -15k = -17k + 154. List the prime factors of k. 7, 11 Let x(b) = b2 - 5b + 6. Let q be x(4). Let y be (q - 0) + -1 + 1. Suppose m = -ym + 30. List the prime factors of m. 2, 5 Suppose 0 = 4r - 95 - 49. List the prime factors of r. 2, 3 Let s = 8 - 8. Suppose -2c = -2a + 2, sa - 13 = -5a + c. List the prime factors of a. 3 Let k(f) = -6f + 2. Let i be k(-3). Suppose 4c - i = -2y, 4c - 14 = -2y + 2c. What are the prime factors of y? 2 Let m be (-1)/(-2)6/(-1). Let o(t) = 3t + 6t - 6t + 3t2 - 1. List the prime factors of o(m). 17 Let i be (24/3)/((-2)/(-2)). Let x be 1/(2/i-1). Let f(b) = b*3 + 3b*2 - 4b + 5. List the prime factors of f(x). 5 Suppose -13s = -16s + 24. List the prime factors of s. 2 Let x = 5 + -2. Suppose -3f + 23 = -h, -2f - xh + 0 = -19. Let a = -4 + f. What are the prime factors of a? 2 Let l(z) = -z3 - 4z*2 - 4z + 2. Suppose -3p = -p + 8. Let y be l(p). Suppose 26 = 4d - y. List the prime factors of d. 11 Let f(v) = v*2 - v + 2. Let d be f(10). Let k = d + -33. List the prime factors of k. 59 Let z = 106 - 62. List the prime factors of z. 2, 11 Let l be (-1)/2 + (-21)/(-6). Let v be (l/(-4))/(1/(-4)). Suppose -6 - 36 = -vu. List the prime factors of u. 2, 7 Suppose -5m - 157 = -3p - 0p, 5p - 215 = -m. List the prime factors of p. 2, 11 List the prime factors of -4(0 - (-129)/(-6)). 2, 43 Suppose 5 + 0 = -c. Let w(u) = -6u - 21. Let g be w(-6). Let d = g + c. What are the prime factors of d? 2, 5 Suppose -2t + 177 = 2m - 145, -5t + 491 = 3m. What are the prime factors of m? 157 Let z be -8(3 + 15/(-4)). Suppose 0 = 2x - zx + 56. List the prime factors of x. 2, 7 Let p = -3 + 43. Suppose 0g - 2g = -3l + p, 20 = 3l + 2g. List the prime factors of l. 2, 5 Let b(n) = n*2 - 11n - 19. What are the prime factors of b(14)? 23 Let v = -15 - -15. Suppose 0 = -vs + s - 28. List the prime factors of s. 2, 7 Let o be -24(2 + (-2 - 1)). Suppose 3j - o = -0j - 3s, -s = -2j + 1. What are the prime factors of (1 - j) + 16/4? 2 Let w = -1 - 2. Let z be 21/1426/3. Let l = z + w. List the prime factors of l. 2, 5 Suppose w + 3d + 360 = 4w, 0 = -w + 2d + 122. List the prime factors of w. 2, 59 Suppose -3u = -10u + 357. What are the prime factors of u? 3, 17 Suppose 5x + 4 = 6x. Suppose -3d - 2f + 95 = -xf, 3f = 4d - 128. List the prime factors of d. 29 Let y(f) = f3 + 10f2 - 7. List the prime factors of y(-5). 2, 59 Suppose z = 19 + 7. List the prime factors of z. 2, 13 Let y(x) = x3 - 2x2 - x - 3. Let q = -1 + 5. What are the prime factors of y(q)? 5 Let k = -9 - -11. Suppose -o - 8 = 4r, -ko + 3r = -48 + 9. List the prime factors of o. 2, 3 Suppose -2f = -3k + 140, k + f - 33 = 17. Let s = -33 + k. What are the prime factors of s? 3, 5 Let t = -6 - -8. Let p be (-148)/(-18) - (-10)/(-45). Suppose -4h = -p, -k - 4h + th = -11. List the prime factors of k. 7 Suppose -y + 3c = 47, -113 - 27 = 5y + 4c. Let r = 18 + y. Let t = 24 + r. What are the prime factors of t? 2, 5 List the prime factors of 12/(4 + 5/(-2)). 2 Suppose 7c - 3c = 184. What are the prime factors of c? 2, 23 Let w be (-3)/(27/48)3. Let l = w + 23. List the prime factors of l. 7 What are the prime factors of ((-3)/959)/(2/(-6))? 59 What are the prime factors of ((-4)/14)/(3/(-21))? 2 Let y(j) = j*3 + 6j*2 - 2j + 3. Let i = -4 - 2. List the prime factors of y(i). 3, 5 Suppose -4l + 5o + 1001 - 307 = 0, 3l - 4o - 520 = 0. What are the prime factors of l? 2, 11 Let j be 18/4 + (-1)/2. Suppose -jm + 9m - 3h = 150, 2m + 2h = 44. What are the prime factors of m? 3 Suppose -3t - 5j + 337 = 0, -j - 547 = -5t - 2j. List the prime factors of t. 109 Let s be 20 + (6/(-3) - 0). Let z = s - 13. Suppose -3 = -0o + o - zw, 0 = 2o - w - 21. List the prime factors of o. 2, 3 Let r = -10 + 17. Let o(v) = -2v - 7. Let q be o(-6). List the prime factors of (2-2)/(q - r). 2 Let b(n) = -n*3 - 12n*2 + 0n*3 + 1 + 12 - 10n. Let a be b(-11). Let t(y) = 3y2 + 2y. List the prime factors of t(a). 2 Suppose v + 4o = -19, 63 = -5v - o + 25. Let k = 12 + v. What are the prime factors of k? 5 Let p = 5 + 4. Suppose -2m + p = -m. What are the prime factors of 210/27 - (-2)/m? 2 Let l(n) be the third derivative of -n4/24 + 7n*3/3 - 6n*2. List the prime factors of l(-14). 2, 7 Let s be (-2)/1 - -4 - 2. Suppose z - 3z + 6 = s. Let w = 5 - z. What are the prime factors of w? 2 Let o(c) = -c*2 + 5c + 1. Let f be o(4). Suppose -4v - 5s = -112, fv - 3s = -0s + 103. List the prime factors of v. 23 Suppose 2c - 4c = 10. Let m be 15/(-6)6/c. What are the prime factors of ((-1)/m)/(4/(-120))? 2, 5 Let y(u) = -u*2 - 4u + 7. Let a be y(-5). Let l(m) = 0m2 + am*2 + 2m + 1 - 2. What are the prime factors of l(1)? 3 Let x be (-44)/(-16) + (-2)/(-8). Suppose xq - 2q + 9 = 0. Let m = q - -19. What are the prime factors of m? 2, 5 Let c(l) = -311l3 + 2l*2 - 1. What are the prime factors of c(-1)? 2, 3, 13 List the prime factors of (-7 + 55 + -5)/(1/5). 5, 43 Let s = 5 + -7. Let j be 2/s + 0/(-1). List the prime factors of (-4)/39/j. 2, 3 Suppose 4u + 2 - 10 = 0. Suppose f = 3x + ux - 14, 2f = -2x + 32. List the prime factors of f. 11 Suppose -y = -4m + 2y + 5, 0 = -4m - 3y + 11. Suppose 3t = mt. Suppose 2h - 16 = -t. List the prime factors of h. 2 Let a = -31 - -16. Let k = a + 22. List the prime factors of k. 7 Let r(z) = 2z3 + 2z*2 - 1. Let s be r(-1). List the prime factors of (3/6)/(s/(-16)). 2 Suppose 22 = 3l + l - 5v, -4l = 3v - 6. Suppose -2i = 5s - 0 + 2, -li + 14 = -s. Suppose q + 18 = iq. List the prime factors of q. 2, 3 Let o be 4/(-18) - (-152)/36. Suppose 0h = -oh + 100. List the prime factors of h. 5 Let y(z) = -6z + 6. Let w be y(4). Let h = -36 - w. Let q = h + 29. List the prime factors of q. 11 Let o = -9 - -13. Suppose 0 = 3v - 3 - 6. Suppose -oa - 4q + 36 = -9q, -va + 3q = -30. What are the prime factors of a? 2, 7 Suppose -2f - 6 = -o - 0o, -2f = o - 6. List the prime factors of (-3 + 1)/((-3)/o). 2 Suppose o + 4k - k = 9, 4k + 20 = 0. Let h = o + 2. What are the prime factors of h? 2, 13 Let m be 16/5 - (-1)/(-5). Suppose 2k + c = -mk + 55, 0 = 4k - c - 44. What are the prime factors of k? 11 Let i(f) be the third derivative of f5/60 + f4/8 - 5f3/6 + 2f*2. What are the prime factors of i(-5)? 5 Suppose 3l - 2r - 4 = 0, -4l + 8l = 5r + 3. Suppose 4n = li - 34, 2i = 3n - n + 44. What are the prime factors of i? 3 Suppose -2m + 0m = 4. Let n(j) = j*3 + 4j*2 + 2j. Let k be n(-2). Let f = k + m. What are the prime factors of f? 2 Suppose -18z = -23z + 250. List the prime factors of z. 2, 5 Let o = -17 - -33. List the prime factors of o. 2 Suppose -6b + 7b - 4 = -2i, 5b = 0. List the prime factors of i. 2 Let q(z) be the second derivative of -1/2z3 + 2z - 1/2z2 + 0. List the prime factors of q(-2). 5 List the prime factors of (-1)/(-5) - 129/(-5). 2, 13 Let h = 1 - -89. Suppose 5 = -g, h = 5r - 2r - 3g. What are the prime factors of r? 5 Let a(u) = u*2 + 7u + 5. Let v be a(-6). Let r(s) = -24s + 1. What are the prime factors of r(v)? 5 Let a be -2 - (1 + 16/(-2)). Let k(i) = -ai + 0 + i + i - 6. List the prime factors of k(-4). 2, 3 Let h(p) be the third derivative of -5/6p3 + 3p*2 + 1/8p*4 + 0p + 0. List the prime factor	{ "pile_set_name": "DM Mathematics" }
12 + 65m. What is u(k(b))? -1875b*4 Let a(v) = -2v*2. Let s(g) be the second derivative of 1/12g*4 - g + 0 + 0g*2 + 0g*3. Give a(s(j)). -2j*4 Let o(u) = -2u. Let d(v) = -10v. Let h(l) = -l. Let b(n) = 3d(n) - 15h(n). Calculate o(b(f)). 30f Let z(d) = -2d. Let n(w) = 33w - 17w + 2 - 17w. Let g = 6 - 1. Let f(i) = 3i - 5. Let r(m) = gn(m) + 2f(m). What is z(r(v))? -2v Let c(u) = 2u2. Suppose 10 = -4v + 26. Let y(t) = -t*3 + 3t*2 + 6t - 5. Let m be y(v). Let b(i) = 3 - i - m. Determine c(b(g)). 2g2 Let s(y) = -y. Let t(x) = -7x*2 - 4x. Let q(h) = 4s(h) - t(h). Let i(k) = -k - 1. Let o(v) = 10v + 9. Let m(z) = 18i(z) + 2o(z). Give m(q(j)). 14j2 Let u(n) = 8n*2 - 11n - 11. Let j(f) = -3f2 + 4f + 4. Let p(y) = 11j(y) + 4u(y). Let x(m) = -8m2. Determine x(p(h)). -8h*4 Let c(h) = -h + 2h + 0h. Let x(i) = -i. Let j(v) = 3v. Let u(a) = -6j(a) - 17x(a). What is u(c(s))? -s Let h(u) = 22u2. Let o(z) be the first derivative of -2z*3/3 - 9. Determine o(h(b)). -968b*4 Let m = 13 - 9. Let x = m - 4. Let g(o) = xo - o + 2o. Let c(b) = -2b*2. Give c(g(l)). -2l*2 Let x(u) = -6u. Let i(p) = 36p. Give i(x(o)). -216o Let t(s) be the second derivative of -s*4/2 + 13s*2/2 + 12s. Let y(b) = -2b2. What is t(y(h))? -24h*4 + 13 Let y(g) = 3g + 5. Let w(c) = -4c - 6. Let q(n) = -5w(n) - 6y(n). Let v(a) be the second derivative of a3 - 136a + 1. Determine v(q(t)). 12t Let q(v) = 6v. Let g(w) be the second derivative of -w6/240 + w4/3 - w. Let m(x) be the third derivative of g(x). Calculate m(q(k)). -18k Let t(x) be the third derivative of 0x + 0x3 - 1/24x*4 + 0 - 2x2. Let f(l) = -l. Give t(f(k)). k Let q(y) = -y2 - 6y - 1. Let s be q(-7). Let h be s/44 + (-92)/(-22). Let a(z) = 5z + z - hz. Let o(i) = -4i. Calculate a(o(x)). -8x Let b(z) be the third derivative of -z5/60 + z3/3 + 2z*2. Let d(p) be the first derivative of b(p). Let k(g) = 4g. What is k(d(a))? -8a Let n be (-27)/(-5) + (-32)/80. Let j(i) = -ni + i + 5i. Let w(l) = -8l*2. Determine j(w(k)). -8k*2 Let f(p) = -2p*2. Let g(t) = -2t*2 + 4251. What is g(f(w))? -8w*4 + 4251 Let v(t) = -5t. Suppose 2d + 2b - 3b = 96, -2b = -5d + 238. Let q(k) = 46 + 2k - d. What is q(v(h))? -10h Let l(w) = w + 3w - w - w. Let h(n) be the second derivative of 0n3 + 2n + 0n2 + 0 + 1/6n*4. Give h(l(f)). 8f*2 Let l(h) = 3h - 3 - 2h + 3. Let c(d) be the second derivative of 0d*2 + 0 + d - 1/6d*3. Give l(c(o)). -o Let w(j) = 5j*2 + 2j2 + j2 - 4j2. Let q(p) = -5p + p + 5p. What is w(q(a))? 4a*2 Let b(o) = -3o. Let l(i) be the first derivative of i*3/2 + i - 6. Let q(d) be the first derivative of l(d). Give q(b(x)). -9x Let n(m) = 29m2. Let c(y) be the first derivative of -y2/2 + 35. Determine n(c(a)). 29a*2 Let g(m) = 10m - 2. Let l(r) = 70r - 15. Let s(h) = -15g(h) + 2l(h). Let n(x) = x. Give s(n(a)). -10a Let v(p) = -4p. Let w(u) be the third derivative of -u5/60 + 10u*2. What is v(w(s))? 4s2 Let a(f) = f2 - 8f2 + 9f2 - f2. Let z(i) = -4i + 2. What is z(a(s))? -4s*2 + 2 Suppose -3t = -4t + 2. Let q(a) = -a - t + 1 + 1. Let f(z) = z2 + 2z*2 - 5z*2 + 3z2. What is f(q(d))? d2 Let v(w) = 1769w2. Let d(h) = 5h. What is v(d(m))? 44225m2 Let f(n) = -4n2 + 1. Let j(o) be the second derivative of o3/6 + 17o. Calculate f(j(v)). -4v*2 + 1 Let w(f) = -3f - 3. Let g be w(-3). Suppose n = 4 - 0. Let i(y) = -2y2 - ny2 + y2 + gy2. Let o(r) = -r2. Give o(i(s)). -s4 Let d(i) = -i. Let u(k) = -k - 4. Let v(q) = q3 - 3q*2 - 3q + 4. Let s be v(3). Let p be u(s). Let x(r) = -1 + p + 2r2. What is x(d(c))? 2c*2 Let z(k) = 27k + 16k2 - 10k - 17k. Let w(n) = -2n*2. Calculate z(w(y)). 64y*4 Let f(h) be the first derivative of -5h*2/2 - 2. Let l(a) be the first derivative of -2a*3/3 - 4. What is l(f(r))? -50r*2 Let m(c) = -560c - c*2 + 560c. Let o(q) = -3q2. What is m(o(g))? -9g*4 Let c(u) = 2u. Let i(l) = 14l + 2. Let h = -7 + 9. Let x(k) = 99k + 15. Let m(d) = hx(d) - 15i(d). Give c(m(b)). -24b Let a(d) = 17d*2. Let p(v) = 5v. What is a(p(o))? 425o2 Let u(t) be the first derivative of -2t*3/3 + 7. Let v(o) = o + 5o - o - o. Calculate v(u(b)). -8b2 Let s(j) = 2j. Let g(q) = q. Let v(i) = 8g(i) - 3s(i). Let r(b) = -13b2 + 4b - 4. Let k(n) = n*2 - n + 1. Let t(o) = -4k(o) - r(o). Determine t(v(m)). 36m2 Let r(q) = 36q + 1. Let m(y) = y. Determine r(m(b)). 36b + 1 Let i(m) be the third derivative of m4/12 + m2. Let w(r) be the first derivative of -2/3r*3 + 0r + 0r2 + 2. Give w(i(b)). -8b2 Let t(g) = g2 + g*2 + 2g*2. Let r(b) = 10b + 11. Let z(p) = p + 1. Let j(n) = -2r(n) + 22z(n). Give j(t(u)). 8u2 Let t(j) = j2. Let b(n) = 1093n*2. Calculate b(t(k)). 1093k4 Let t(k) = -k2. Let h(b) = 4b2 - 3b + 3. Let c(f) = 20f2 - 16f + 16. Let r(w) = 3c(w) - 16h(w). Calculate t(r(i)). -16i4 Let n(c) = 6c*2 + 0c*2 - 2c*2. Let x(p) = -111p - 98p + 206p. Give n(x(b)). 36b2 Let y = -1/6 - -1/4. Let c(g) be the third derivative of yg*4 + 0g*3 + 0 - 2g*2 + 0g. Let j(o) = o*2. Give c(j(r)). 2r*2 Let y(k) = -4k*2 - 2k - 2. Let s(u) = -u + 2. Let n be s(-5). Let t(p) = -13p2 - 7p - 7. Let r(d) = ny(d) - 2t(d). Let f(m) = -m. What is r(f(v))? -2v2 Let u(b) = b. Let d(q) be the second derivative of -43q*3/6 - 18q. Determine u(d(f)). -43f Let o(s) = -s + 3. Let m(p) = -2. Let n(l) = 3m(l) + 2o(l). Let t(y) = -20y*2. Determine n(t(w)). 40w*2 Let m(f) = 5f*2 - 2. Let a(x) = 51x*2 - 21. Let s(o) = -2a(o) + 21m(o). Let c(q) = -q - 2q + 4q. Give c(s(n)). 3n*2 Let s = 5 + -2. Let n(j) = sj - 3j + 4j2. Let h(w) = -w2. Determine h(n(v)). -16v4 Let x = -122 - -178. Let n(q) = x - 56 + 13q. Let i(y) = 2y2. Give n(i(b)). 26b*2 Let a(v) = 16v + 7. Let f(u) = -5u - 2. Let p(k) = 4a(k) + 14f(k). Let b(t) be the second derivative of t4/6 - 8t. What is p(b(w))? -12w2 Let h(q) = 11q. Let r(f) = 6f2 + 17f - 17. Let b(i) = -2i2 - 6i + 6. Let a(m) = -17b(m) - 6r(m). Calculate h(a(j)). -22j2 Let y(x) = -x2. Let k(i) = -5 - 1 - i3 + 4 - 2i*2 - 3i. Let a be k(-2). Let p(s) = s - as - s. What is y(p(g))? -16g*2 Let h(u) = 6u. Let o(t) = -8t2 - 5t + 5. Let k be (-4)/(-14) + (-10)/(-14). Let m(j) = -j*2 - j + 1. Let s(n) = ko(n) - 5m(n). Determine h(s(v)). -18v2 Let l(g) = g2. Let t(j) = j + 1. Let o(h) = -3h + 2 - 6 + h - 1. Let k(q) = o(q) + 5t(q). Give k(l(x)). 3x2 Let t(b) = b3 + b2 + 2. Let g be t(0). Let m(d) = gd + 12 + 3d - 12. Let n(v) = -v. Determine n(m(z)). -5z Let d(m) = -7m2. Let h be (-14)/4(-8)/14. Let p(f) = -6f2 + 4fh + f2. Calculate p(d(t)). -49t4 Let p(y) = 8y*2. Let h(g) = g - 1. Let u(c) = -5c + 3. Let l(v) = -3h(v) - u(v). Calculate l(p(a)). 16a*2 Let a(d) = 1573d. Let q(m) = 2m. Determine q(a(f)). 3146f Let z(j) = -j. Let m(a) = -2a2. Determine m(z(o)). -2o*2 Let p(z) = -52z. Let a(o) = 42o. Determine a(p(h)). -2184h Let r(l) = 2l2. Let b(j) = j2 + 8j + 5. Let d be b(-8). Let i(h) = 12h - dh - 14h. Calculate r(i(f)). 98f*2 Let m(f) = -f. Let z(y) be the first derivative of 9y*3 - 3 + 6 - 10y*3. What is m(z(o))? 3o*2 Let r be 105-21/(-6). Suppose -5k - 3c + r = -8c, -5c - 15 = 5k. Let i(l) = 3l - 5l + kl - 2l. Let u(b) = -b. Determine i(u(z)). 2z Let v(a) = -35a. Let p(s) = 4s. Calculate p(v(y)). -140y Let r(i) = -7i2 + 4. Let a(c) = 5c. Determine a(r(m)). -35m2 + 20 Let l(w) = 3w. Let u(j) = 6j - 11. Let f(i) = i2 + 6i + 4. Let k = -3 - 1. Let p be f(k). Let c(y) = y - 2. Let n(s) = pu(s) + 22c(s). Give n(l(t)). -6t Let l = 2 + 0. Let r(d) = -d - d + 2d - ld. Let w(k) = -4. Let a(c) = -c2 + 11. Let n(o) = -4a(o) - 11w(o). Determine r(n(y)). -8y*2 Let h(l) = l + 2. Let g(i) = i - 3 + 1 + 3. Let c(d) = 4g(d) - 2h(d). Let z(n) be the first derivative of -n2 - 2. Give c(z(v)). -4v Let v(h) = -2h. Let l(z) = 16z - 2. Let g(u) = 81u - 11. Let n(t) = -4g(t) + 22l(t). What is v(n(a))? -56a Let k(w) = -4w*2	{ "pile_set_name": "DM Mathematics" }
ulate q. -5, -1/8, 0, 1, 17 Determine v, given that -4v4 - 6658732v*3 + 299648928v*2 - 3515903600v + 3222913408 = 0. -1664728, 1, 22 Factor -p*3/2 + 10525p*2/2 - 14380504p + 2780218738. -(p - 5158)*2(p - 209)/2 Solve 33b3 - 3122004b*2 + 284396181b - 51605190 = 0 for b. 2/11, 91, 94515 Factor -2f4/3 - 602f*3/3 + 89380f*2/3. -2f*2(f - 109)(f + 410)/3 What is a in a4/3 - 39512a*3/3 + 23012671a*2/3 - 1129107196a + 1121449476 = 0? 1, 294, 38923 Let 5o2/6 + 11725o/6 + 824780 = 0. What is o? -1793, -552 Find q such that -2q2/9 + 11916208q/9 - 17749501637408/9 = 0. 2979052 Factor x*4 + 769x*3 - 84002x2. x2(x - 97)(x + 866) Solve u*4/12 + 21077u*3/12 + 485857u*2/2 + 24914995u/3 - 25649050/3 = 0. -20938, -70, 1 Solve 4r4/11 - 693486r*3/11 - 5201322r*2/11 - 8322224r/11 + 5548128/11 = 0 for r. -4, 1/2, 173379 Determine a, given that -5a5 - 34730a*4 + 5363765a*3 + 39246410a*2 = 0. -7097, -7, 0, 158 Determine w, given that -2w*3 + 153606w*2 - 1842984w = 0. 0, 12, 76791 Factor -z*2/4 + 902975z/2 - 815363850625/4. -(z - 902975)*2/4 Solve -4l*3 + 2783312l*2 + 38966956l + 136385032 = 0 for l. -7, 695842 Find q, given that -q*4/2 + 1172681q*3 - 1375180727757q*2/2 - 4690724q + 2750361455522 = 0. -2, 2, 1172681 Factor 19i2 - 110497i - 110516. (i + 1)(19i - 110516) Determine y, given that 2y3/3 - 289224y*2 - 867698y/3 + 3470696 = 0. -4, 3, 433837 Determine l, given that -48l4 - 671332l*3 - 2348696376l*2 - 9579543588l - 781985296 = 0. -6991, -4, -1/12 Let -l*3/2 + 25168l*2 - 8535445l/2 + 181224675 = 0. Calculate l. 85, 50166 Suppose 2w4 - 116820w*3 + 4553088w*2 - 8755724w + 4319454 = 0. Calculate w. 1, 37, 58371 Factor 81006j2 + 12150920j + 3000. 2(j + 150)(40503j + 10) Factor -o3/2 + 2814o*2 + 401310o + 14131600. -(o - 5768)(o + 70)2/2 What is b in 3b*4 - 980606b*3 - 25824933b*2 + 74532176b - 37919820 = 0? -29, 2/3, 2, 326895 Determine a, given that a*2/2 - 1518382a = 0. 0, 3036764 Find v such that -9v2 - 192513v + 320880 = 0. -21392, 5/3 Solve -3t3 - 85848t*2 - 798454095t - 2388359865450 = 0. -11045, -6526 Factor 5f2 - 67945f + 7079100. 5(f - 13484)(f - 105) Let 2w3/17 + 16470w*2/17 - 38267250w/17 + 19802292250/17 = 0. What is w? -10205, 985 Factor 4k2 - 25414152k - 50828320. 4(k - 6353540)(k + 2) Determine w, given that -3w2 - 264w + 32842635 = 0. -3353, 3265 Let 2f2/7 + 22227832f/7 + 88911296/7 = 0. What is f? -11113912, -4 Suppose z*2/2 + 87293z/2 - 2533179 = 0. What is z? -87351, 58 Suppose 2x4/7 - 3882x*3/7 - 1767848x*2/7 - 3520152x/7 = 0. What is x? -379, -2, 0, 2322 Find v, given that 15v4 + 10670v*3 + 1451915v*2 - 5446320v + 2982420 = 0. -526, -189, 2/3, 3 Let -j*3/5 + 3596599j*2/5 + 3596602j/5 - 1438640 = 0. Calculate j. -2, 1, 3596600 Let 10d3 - 547236d*2 - 218896d = 0. What is d? -2/5, 0, 54724 Determine w so that 2w2/11 + 35833528w/11 + 160505216115848/11 = 0. -8958382 Determine c so that -5c2 - 63351560c - 200671007721680 = 0. -6335156 Find y, given that 3y3/2 - 2868717y*2/2 + 5737425y/2 - 2868711/2 = 0. 1, 956237 Factor -3g3/4 + 9261g*2/2 - 2226195g/4 + 16889619. -3(g - 6052)(g - 61)*2/4 Determine r so that 3r*2/2 + 2309370r - 4618743/2 = 0. -1539581, 1 Let -6v5 - 64953v*4 - 616455v*3 + 617457v*2 + 10219797v - 14309568 = 0. Calculate v. -10816, -7, 3/2, 3 Suppose u*4/4 + 1063u*3 + 63629u*2/4 + 156829u/2 + 127110 = 0. What is u? -4237, -6, -5, -4 Factor 116086t2/15 - 6810378t/5 - 352/15. 2(t - 176)(58043t + 1)/15 Factor y3/4 - 9170709y*2 - 73365675y/4 - 18341419/2. (y - 36682838)(y + 1)2/4 Factor 5j*2 - 49303580j. 5j(j - 9860716) Solve -y*2 - 26719y - 15390570 = 0 for y. -26130, -589 Factor 4b3 - 3434508b*2 - 3434512b. 4b(b - 858628)(b + 1) Find k, given that -3k*4/4 - 1023k*3/4 + 19089k*2 = 0. -404, 0, 63 Find f, given that -18845169800f*4/3 + 75381844040f*3 - 226156015734f*2 + 41934888f - 1944 = 0. 9/97070, 6 Solve 3z2/5 - 7262508z/5 + 4395335204172/5 = 0. 1210418 Find r such that -4r2/7 + 112012r/7 + 3363960/7 = 0. -30, 28033 Suppose 784996r4 + 54224972r*3 + 57537996r*2 + 4176628r + 78608 = 0. Calculate r. -68, -1, -17/443 Find t such that -3t4 - 537t*3 - 20757t*2 + 304533t + 324756 = 0. -97, -93, -1, 12 Determine j, given that -j*2 - 3457j - 1940160 = 0. -2752, -705 What is s in s*5 + 131s*4 - 13510s*3 - 348716s*2 - 574392s + 18740736 = 0? -192, -14, 6, 83 Let v*4 + 64133v*3 + 256411v*2 - 6733653v - 6925932 = 0. What is v? -64129, -12, -1, 9 Find u such that 3u2 + 35298u + 141144 = 0. -11762, -4 Solve 4a5 - 3508a*4 + 145776a*3 - 1949504a*2 + 6605312a + 22231104 = 0 for a. -2, 14, 17, 834 Solve 8i3/7 + 17932i*2 - 15265320i - 53460000/7 = 0. -16500, -1/2, 810 Factor -3d2 + 19953d + 2935440. -3(d - 6795)(d + 144) Determine u so that -10u2 - 440315u - 369793875 = 0. -43175, -1713/2 Suppose -3d5 + 1597d*4 - 298192d*3/3 - 29845596d*2 - 1138224192d - 14875239680/3 = 0. Calculate d. -56, -5, 974/3 Factor -i*3 - 5907i*2 - 9381015i - 1904822325. -(i + 237)(i + 2835)2 Factor -3c*2/2 - 12180c - 10753344. -3(c + 1008)(c + 7112)/2 Let -5l4 + 1640l*3 - 11310l*2 + 24120l - 14445 = 0. Calculate l. 1, 3, 321 Factor 2g2/7 + 14148g/7 + 6293538/7. 2(g + 477)(g + 6597)/7 Factor -5o2 - 44690o - 1025225. -5(o + 23)(o + 8915) Factor -2q2 - 70458q/7 + 2876. -2(q + 5033)(7q - 2)/7 Suppose q5/4 - 184q*4 + 5427q*3/2 - 6998q*2 - 91495q/4 - 12978 = 0. What is q? -1, 8, 9, 721 Find s such that 2s2/13 + 26126s/13 - 26152 = 0. -13076, 13 Let 2f4 - 800f*3 + 45748f*2 + 7215440f + 60637050 = 0. What is f? -61, -9, 235 Solve p*3 - 78818p*2 - 3153920p - 31543200 = 0 for p. -20, 78858 Find k such that -2k4/11 - 17706k*3/11 - 21181804k*2/11 = 0. -7427, -1426, 0 Factor -3z*3 - 1764z*2 + 33600z + 15685632. -3(z - 96)(z + 92)(z + 592) Factor 2j*3/17 + 3412j*2/17 + 1552178j/17 + 81279480/17. 2(j + 60)(j + 823)2/17 Factor -h3/2 + 172980h2 + 1383864h + 2767744. -(h - 345968)(h + 4)2/2 Factor -12w*2/11 - 170770w/11 + 2935088/11. -2(w + 14248)(6w - 103)/11 Factor -15o*2 - 12438o + 8603496. -3(o + 1278)(5o - 2244) Factor -4i*2 + 1795660i + 7182704. -4(i - 448919)(i + 4) Factor w*2 + 1846455w/8 - 230807/8. (w + 230807)(8w - 1)/8 Factor -2n3 + 38252n*2 - 184044098n + 10905370680. -2(n - 9533)2(n - 60) Suppose 3s4/4 - 50553s*3/2 - 9s*2 + 303306s + 404424 = 0. Calculate s. -2, 4, 33702 Factor q*3/7 - 5381q*2/7 - 3900116q/7. q(q - 6028)(q + 647)/7 Let 2t5/13 + 1244t*4/13 + 234482t*3/13 + 1423440t*2/13 - 288921600t - 21745152000 = 0. Calculate t. -195, -176, 120 Let y*3/5 + 4246y*2/5 + 197893y/5 + 453492 = 0. What is y? -4199, -27, -20 Determine f so that 3f2/5 - 317526f/5 + 3492423/5 = 0. 11, 105831 Factor q*2 + 2410q - 21809304. (q - 3618)(q + 6028) Let 2w*5/5 - 82w*4/5 - 2198w*3 - 19966w*2/5 + 41308w + 43120 = 0. What is w? -55, -5, -1, 4, 98 Factor 2j2 + 3476j + 1506960. 2(j + 828)(j + 910) Factor 5b5 + 2550b*4 - 7680b*3 + 7690b*2 - 2565b. 5b(b - 1)*3(b + 513) Let 5f4 - 577535f*3 + 38102790f*2 - 838154900f + 6146078840 = 0. Calculate f. 22, 115441 Factor -18464q3 - 55620q*2 - 42228q - 513. -(2q + 3)2(4616q + 57) Find d such that -d2 + 7424197d - 14848390 = 0. 2, 7424195 Let 12z4/7 - 357z*3 + 106677z*2/7 + 29133z - 59535 = 0. Calculate z. -3, 5/4, 63, 147 Solve -193600j4/3 - 126619680j*3 + 729382396j*2/3 + 20527944j + 424224 = 0 for j. -1964, -9/220, 2 What is h in 4h5 + 1392h*4 + 47660h*3 + 167248h*2 - 47664h - 168640 = 0? -310, -34, -4, -1, 1 Factor -2h2 + 165474976h - 3422745960275072. -2(h - 41368744)2 Find j, given that 2j*4/5 + 2312j*3/5 - 3716026j*2/5 + 5923344j - 59158944/5 = 0. -2061, 4, 897 Let -4z5 + 72z*4 + 29140z*3 - 412920z*2 + 1507104z - 1596672 = 0. What is z? -84, 2, 3, 9, 88 Solve 4s4 - 19881632s*3 + 79526448s*2 + 79526528s - 3181058	{ "pile_set_name": "DM Mathematics" }
= r*2 + 7r + 5. Let f be j(-6). Let y = 1 - 1.2. Which is the third biggest value? (a) g (b) f (c) y b Let m = 20 + -21.1. What is the second biggest value in -3, m, 5? m Suppose 5s + 3x = -10, -s = 4s - 5x - 30. What is the smallest value in 4, s, -0.06? -0.06 Let d = 1.2 - 0.84. Let b = -0.06 + d. Let q = -0.1 + b. What is the second smallest value in -2, -0.3, q? -0.3 Let j = -1.1 - -1.2. Let v = 0.04 - 0.34. Which is the second biggest value? (a) -3/5 (b) j (c) v c Suppose 2v + 2a - 2 = -6, 19 = -5v + 4a. Let f = 24.8 - 20.8. Let y(q) = 2q - 5. Let h be y(4). What is the second biggest value in h, v, f? h Let k = -0.34 - -0.3. Let m = -0.16 + k. Which is the third smallest value? (a) m (b) -0.5 (c) 1/4 c Let r be 20/(-210)(-7)/(-3). Let n be (2 - 1) + 11/(-13). Which is the biggest value? (a) -4 (b) r (c) n c Let n = 2 - 0. Let m = 4 - n. Let s = 3 + -2. Which is the third biggest value? (a) s (b) -5 (c) m b Let k(m) = m + 12. Suppose -3h = -7h - 32. Let r be k(h). What is the second smallest value in 5, r, 1/7? r Let t = 0.1 + -0.15. Let y = t + -1.95. Let v = -2 + y. Which is the third smallest value? (a) -1 (b) -2 (c) v a Let f = 9 + -13. Let b = 22 + -22.22. Let m = -0.08 + b. What is the third biggest value in m, -2/3, f? f Let g = 0.1 + -6.1. Let y = g + 6.1. Let w = -14 + 13. Which is the second smallest value? (a) 0.3 (b) y (c) w b Let k(w) = 3w - 1. Let r be k(1). Let p be (-1)/(-1) - (-3 + r). Let n be (-5)/p16/(-20). What is the second smallest value in -0.2, n, -1? -0.2 Let v = -18.4 - -17. Let i = v - -7.4. Let r = 5.7 - i. Which is the third smallest value? (a) -1/5 (b) r (c) -5 a Let y = -3.9 + -0.1. Let n = -12 - -11.7. Let s be 2/(-6)5 - -1. Which is the second biggest value? (a) s (b) n (c) y a Let m = -6 + 5.8. Let d = m + 0.7. Which is the second biggest value? (a) -5 (b) 1/8 (c) d b Suppose 0 = 2m - 5 - 3. Let y be 23/3 + m. Let v be y/28 - 10/(-35). Which is the biggest value? (a) v (b) -4 (c) 3 c Let f = -3.8 - -0.8. What is the second biggest value in -3/5, 2, f? -3/5 Let b = -0.18 + 8.18. What is the smallest value in 1/3, b, -4? -4 Let z = 1 - -1/3. Let g = 1 + -3. Let u = g + 0. What is the third smallest value in z, 1/2, u? z Let p = -31 + 39. What is the smallest value in p, 3/4, -2/5, 3? -2/5 Let l = 0 + -4. Let r be 2 - (1 + 1)2. What is the second biggest value in r, -5, l? l Let j = -4.9 + 4.4. What is the second biggest value in -6, 4, j? j Let x = -3 + 2.7. Let q = -10.97 + 11. Let w = 4.03 - q. Which is the second smallest value? (a) x (b) 3/7 (c) w b Suppose g + 8 = -g. What is the third smallest value in g, 1, 3? 3 Let v = -0.49 - -0.09. What is the third smallest value in 3, 0.04, v? 3 Suppose -1 - 5 = -3x. Suppose -z - 410 = z - 2s, -3s = -15. Let p be 4/14 + z/210. What is the third smallest value in x, -0.5, p? x Let r = -19.6 + 25. Let f = r + -5. Which is the third smallest value? (a) f (b) -2/9 (c) 0.01 a Let k(m) = -m2 - 6m - 5. Let d be k(-4). Let y be (-1 - -2)d/(-21). Which is the second biggest value? (a) y (b) 5 (c) -0.1 c Let y be (-6 - -6) + (-4)/6. What is the second biggest value in 5, 1, y? 1 Let g = -30 + 29.5. Let k = 2.1 + -2. What is the second smallest value in g, -0.1, k? -0.1 Let i = -2.5 - -2.63. Let h = i - 0.03. Which is the biggest value? (a) 0 (b) h (c) 2/19 c Let o(q) = 109q - 4. Let z be o(3). Let x be -2 + (2 - z/5). Let m = x + 65. What is the smallest value in m, -3, 5/4? -3 Let s = -3 + 3.02. Let i = -0.42 + s. Which is the third biggest value? (a) 2 (b) i (c) 0.3 b Let b(c) = c + 1. Let i be b(3). Suppose -5g + g = -i. Let j = 14 + -10. What is the third biggest value in j, g, -2/5? -2/5 Let j be 12/6(-1)/(-10). Which is the second biggest value? (a) 4 (b) j (c) -0.5 b Let q = -16 - -11. Let n = -8/55 - 6/715. Which is the second biggest value? (a) 1/7 (b) n (c) q b Let c = 1 - 1.1. Let u = 0 - 2. Let z = 1 + u. What is the smallest value in c, 4/5, z? z Let u = -13/3 + 5. Which is the biggest value? (a) u (b) -0.3 (c) 2/9 a Suppose -2g + 7 - 17 = 0. Let m = 89 - 90. What is the second smallest value in 0.1, g, m? m Let r = -66 + 122. Let n = r + -58.7. Let y = n + -0.3. Which is the second biggest value? (a) 0 (b) 4/5 (c) y a Let s = -17/3 - -5. Which is the biggest value? (a) 2/9 (b) 0.3 (c) s b Let x = -0.9 - -7.9. Let b = x - 4. Let c be 10/24 - (-1)/(-4). What is the third smallest value in b, c, 0.3? b Let g be (-1)/(3/(3 + -12)). Suppose 2p - 8 = 5w - 3w, -p - 4 = gw. Which is the biggest value? (a) 0 (b) 0.4 (c) p c Let r = 202/805 + 4/115. What is the second biggest value in r, 2, -1/3? r Let s = -6 + 3. Let h = -2.6 + 3. Let q = h + -2.4. What is the second biggest value in q, s, -4? s Let d = 18 + -13. Let l be 2 + 22/4. Which is the second smallest value? (a) d (b) l (c) -2 b Let q be ((-1)/17)/(6/8). Let d = q - 27/17. What is the biggest value in d, 4, -5? 4 Let t = -0.11 + 0.11. What is the second biggest value in t, 2/15, 0.3? 2/15 Let m = -2.6 + 7. Let y = 4 - m. Suppose 2h - f + 8 = 4h, 4h + 4f = 12. Which is the third smallest value? (a) y (b) 3/2 (c) h c Let o be 2/(((-60)/9)/(-5)). Which is the biggest value? (a) 0.1 (b) -6 (c) o c Let p = -77 - -82. Which is the fourth smallest value? (a) p (b) 7 (c) -0.1 (d) 1 b Let s(v) = 3v - 5. Let d be s(3). Let z = -0.6 - -1. Which is the smallest value? (a) -0.3 (b) z (c) d a Let t be (2/(-4))/(2/16). Let w = 2.46 - 0.06. Let m = 2.6 - w. Which is the smallest value? (a) m (b) 3 (c) t c Let p = 0.2 - -0.2. Let z = -7 - -5. Let r = 2.2 + z. Which is the smallest value? (a) r (b) 2 (c) p a Let c be 1 + 2/(-8)-2. Suppose 4t + 0t = -12. Let f = 3 + t. What is the biggest value in f, 0.2, c? c Let h = 68/3 + -23. Let m = -4 - -6. Suppose mq + 2q = 16. Which is the second biggest value? (a) h (b) -2 (c) q a Let y = -5/8 + 1/8. Which is the third smallest value? (a) -3 (b) -1 (c) y c Let s(h) = h - 1. Let p be s(4). Suppose -t = -p - 1. What is the third smallest value in -0.2, -3, t? t Let r = 0.9 + 3.1. Let w = 14 + -10. Suppose -g - j = -w, -2g + 2j = -0j. What is the third smallest value in r, g, 5? 5 Let h = 31.1 - 31. Let r(j) = j2 + j. Let u be r(1). Let n be (3 + -1)5/u. Which is the second biggest value? (a) h (b) -2 (c) n a Let j = -4 + 4.2. Which is the second smallest value? (a) 1/3 (b) -2 (c) j c Let h = -21 + 30. Let x be (-2)/(-3)h/10. What is the second smallest value in 2/7, 4, x? x Suppose -w = 3w - 4. Let n = 1.1 - 1. Let u = n - 0. Which is the second biggest value? (a) 0.2 (b) u (c) w a Let v = 3.3 - 0.3. Let l = -1 - 3. Let i = v + l. Which is the biggest value? (a) 0 (b) 5 (c) i b Suppose 0 = -3y - 5 - 4. What is the second smallest value in 0.5, y, -4? y Let a = 0.7 + -0.3. Let z = -2597/15 - -173. What is the second biggest value in a, 0.5, z? a Let p be ((2/7)/1)/(-1). Let k = 0.02 - -3.48. Let m = 4 - k. Which is the second smallest value? (a) 1/3 (b) m (c) p a Let n = -11 - -11.13. Let r = -0.07 - n. Which is the second smallest value? (a) r (b) -5 (c) -0.04 a Let f be (-264)/(-121) - 2/11. Suppose 4g + fx - 20 = 0, 0 = -2g + x - 1 + 7. Which is the smallest value? (a) -0.4 (b) g (c) 1/5 a Let y = 13 - 13. What is the second smallest value in -2, 5/2, 5, y? y Let a = 92 + -96. What is the biggest value in a, 2/7, 2/9, -2? 2/7 Let s = -63 - -59. What is the second biggest value in 1/9, s, 22? 1/9 Let n be 18/(-4)(4 - (-22)/(-6)). Which is the smallest value? (a) 0.1 (b) -2/3 (c) -3/5 (d) n d Suppose -s + 124 = 3s. Let m = s - 22. Let w be 3/m - -2 - 1. Which is the biggest value? (a) w (b) 0 (c) 4/7 a Let q = 6.3 - 6.1. What is the biggest value in 0.08, 4/3, q? 4/3 Suppose -5*d + 28 = -d. Let g = d - 11. Let f = 0 - 0.2. Which is the third smallest value? (a) g (b) f (c) 2 c Let l = 0.15 + -0.24. Let a = l - 3.91. What is the biggest value in 0.3, 2/11, a? 0.3 Let g be (-16)/(-105) + (-4)/14. Let u = -1.01 - -0.01. Which is the biggest value? (a) -1/2 (b) u (c) g c Let d = -0.159 - -17.089. Let j = d - 17. Let r = j - 0.23. Which is the second biggest value? (a) r (b) 2/11 (c) -0.4 a Let s	{ "pile_set_name": "DM Mathematics" }
q + 44 = -0k + 2k, -q + 5k + 4 = 0. Suppose -n + 11 = -q. Does 5 divide n? True Let w = 11313 - 2184. Let x be w/34((-16)/(-6) - 2). Let o = 29 + x. Is 27 a factor of o? False Let q be 160/5(-1)/(-1). Is q/(-208) - (-574)/13 a multiple of 4? True Let c(n) = -n*3 - 23n*2 - 15n - 19. Let u be c(-23). Let y = -131 + u. Is y a multiple of 13? True Let n = 61 - -1268. Is 67 a factor of n? False Let d(f) = -2f2 - 9f + 10. Let r = 39 - 44. Let n be d(r). Is 25 a factor of 36/2(n - (-3)/(-1))? False Let h(d) = -4d*3 - 138 + 67 + 61 - 5d*2 - d. Does 11 divide h(-4)? False Suppose 2i - 7i = -4y + 2917, 3y - 2205 = -2i. Let g = -323 + y. Is 22 a factor of g? False Let o = -205 + 175. Is (-84)/(-10) - 2(-6)/o a multiple of 8? True Suppose 33b - 28848 = 49b. Let d = b + 3050. Is 56 a factor of d? False Is 116 a factor of (1404/45)/(6/(-15) - (-833)/2030)? True Let v(r) = 2r*3 - 2r*2 - 4r + 4. Let h be v(2). Suppose b = 2b + 5, hb = -f + 28. Suppose 0 = -0l + 4l - f. Is l a multiple of 12? True Suppose -46q + 50q - 40 = 0. Let d be ((-7)/5 + 2)(q + -5). Suppose 2z + dz = 530. Does 54 divide z? False Let p(c) be the second derivative of 2c*4 + 8c3/3 - c2/2 - 19c. Let a be p(-4). Suppose -4y + 0y - 20 = 0, 2k - a = 3y. Does 30 divide k? False Let q be ((-30)/(-25))/(-3) + (-141)/(-15). Is q/(-12) - 3297/(-28) a multiple of 13? True Suppose 0 = 4c + 2a - 18, -2a = -6c + 3c + 24. Suppose 2r - 1016 = cr. Let n = -74 - r. Is n a multiple of 34? False Let b = -135 + 148. Suppose -5n + 107 = -3i, -3n = 11i - bi - 65. Does 2 divide n? False Suppose -v + 3 = -4o, 2 = 2v - 4. Suppose 2d - 2 = -h - 0h, o = -4h - d + 15. Suppose 0 = 5u - 6u - hi + 108, 5u - 565 = 5i. Does 16 divide u? True Let m(j) = 2409j*2 + 64j + 124. Is 55 a factor of m(-2)? False Let o(r) = 7r - 8r*2 - 5 - 8r - 7r + 7r2. Let y be o(-5). Suppose -80 = -x - y. Does 14 divide x? True Let w(k) = k3 - 19k2 + 4. Let y be w(19). Suppose yt = 8t - 148. Suppose 13 + t = 2l. Is 5 a factor of l? True Suppose 4a = 3u + 548, 0 = -3a + 3u + 163 + 245. Let q be (-23)/(-7) + (-40)/a. Suppose 199 = 5x - 2t, 8x - 205 = qx + 5t. Is x a multiple of 10? False Suppose -3m - r = -38, -2m + 4m = -r + 27. Let w = m - 17. Let g(c) = -2c3 - 11c*2 - 10. Is 6 a factor of g(w)? False Let n(a) = 6a*2 + 4a - 2. Let z be n(-5). Let c be (225/(-30) - -8)24. Suppose ct - 11t = z. Does 32 divide t? True Does 6 divide (-2364)/1773(-20487)/4? False Let m(f) = f*2 + 10f - 3. Let g be m(-11). Suppose -79 = -9h + gh - z, 8 = -2z. Is 12 a factor of h? False Suppose -12m = 12m - 91200. Is m a multiple of 20? True Let z(i) = 38i + 69. Let u(v) = 38v + 69. Let o(p) = 3u(p) - 2z(p). Is o(6) a multiple of 19? False Suppose 4d + 2a - 398 = 0, 4d - 3a - 89 = 294. Is 98 a factor of d? True Let a = -22086 + 41729. Is a a multiple of 13? True Let c(k) = 53k*2 + 14 - 83k*2 + 53k*2 + 14k + 0k - 22k*2. Let z(r) = -3r + 1. Let l be z(5). Is 3 a factor of c(l)? False Let g = -229 - -236. Suppose -2m + 4f = -352, -4m + 704 = gf - 3f. Is 11 a factor of m? True Let k(f) = 4f*3 + 14f*2 - 9f - 2. Let i be k(-4). Let t(y) = 48y3 - y2 - 4y + 4. Does 5 divide t(i)? False Suppose 11629 + 19615 = 15a - 10696. Is a a multiple of 32? False Suppose -19j + 18j + 132 = 0. Suppose 0k + j = k - 2s, s - 274 = -2k. Is k a multiple of 4? True Let d(f) = -852f - 41. Does 10 divide d(-6)? False Let z(s) = 20s*2 - 31s + 129. Does 49 divide z(-12)? True Let m(a) = 38a2 - 4a + 2. Suppose -4q + 2q = 10. Let u be m(q). Suppose 12t - 204 = u. Is t a multiple of 49? True Let j(a) = a2 + 11a + 164. Is j(34) a multiple of 22? True Suppose 4 = 4g - 4i, 5g - 3i + 0 - 1 = 0. Let w(o) = 144o2 - 4o - 4. Is w(g) a multiple of 8? True Suppose -3f + 0f - 15 = -4z, 3z - 25 = 5f. Let u be (15/12)/f - (-1602)/8. Suppose a = -s + 104, -180 - u = -4a + 5s. Does 18 divide a? False Let x(i) = i3 - 5i*2 + 2i + 4. Let d(f) = -19 - 3f + 13 + 8. Let a be d(-1). Is 14 a factor of x(a)? True Suppose 0 = -q - 3o + 64, 26 + 43 = q + 4o. Suppose 0 = -52v + qv + 630. Does 42 divide v? True Let u be (298/4 - 1)/(24/224). Does 66 divide (u/(-5))/((-78)/195)? False Let h = 11 + -16. Let g be h + -2 - 21/(-7). Does 4 divide (g - (1 + -44)) + 13? False Suppose 187 = i + 5n, 2i + 682 = 6i - 2n. Let v = -139 + i. Does 11 divide v? True Let j = 48426 - 28258. Does 91 divide j? False Is (((-132)/55)/2)/((-2)/3800) a multiple of 57? True Suppose -8v - 6 = 2. Is 18 a factor of ((-26)/39)/(v/804)? False Let w = 32 + -31. Let d be 1 + 62/63. Suppose 2f + 1 = -2l - w, -4l + d = -5f. Does 2 divide l? False Let x(f) = 1359f2 + 232f - 691. Is 25 a factor of x(3)? False Let h = 1507 + -1333. Does 12 divide h? False Suppose -3k - 9 = -3i - 69, 3i - 2k = -64. Let s be (10/i - (-33)/44)6. Suppose -v = -2, -5v - 138 = -sz + 70. Is 10 a factor of z? False Suppose -9a = 7588 - 29566. Suppose -5m - 3042 = -5l - 6m, a = 4l + 5m. Does 19 divide l? True Let v(g) = 17g + 31. Let q(k) = -k - 1. Let w(h) = 6q(h) + v(h). Is w(11) a multiple of 25? False Suppose 0 = 4n - 8, 2n + 5 - 25 = 4t. Is 12 a factor of 5/t - 4090/(-8)? False Suppose -139d = -44d - 1152730. Is 17 a factor of d? False Suppose 13a - 149a = -1407464. Is 79 a factor of a? True Suppose 0 = -5b + 3674 + 3936. Let i = 2406 - b. Is 34 a factor of i? True Suppose 3h + 24 = -3h. Let r(j) = 16j*2 + 9j - 4. Let z be r(h). Let p = z - 80. Is 14 a factor of p? False Is (-10)/(-80)-4 + (-4465)/(-10)49 a multiple of 18? False Let k(o) = -3o2 + 44o + 21. Let y be k(15). Suppose 7020 = yi + 24i. Does 18 divide i? True Let v(k) = -362k - 304. Does 7 divide v(-2)? True Let o = 32122 - -24540. Is o a multiple of 90? False Suppose -5j - 2n + 16716 = 0, -5n - 80 = j - 3414. Is j a multiple of 9? False Suppose 0 = -3c - h - 14, 2c - 11h = -6h + 19. Does 15 divide c(-10568)/132 + (-2)/11? True Suppose -21s - 29s = -2s - 26256. Does 9 divide s? False Let t be 473/121 - (-1)/11. Suppose ta - 2a - 6 = 0. Suppose 7q - aq + 3x - 945 = 0, -495 = -2q + 3x. Is q a multiple of 24? True Let m = -28446 - -32602. Is 11 a factor of m? False Suppose 56b - 19 = -2t + 61b, -23 = -2t + b. Suppose 0 = tw - 60w + 9408. Does 10 divide w? False Suppose 3w + 4l + 1 = -0w, -w + 4l = -21. Suppose -p = h + 3p - 35, -175 = -wh + p. Is h a multiple of 7? True Let u = -726 - -1914. Suppose 21m - 12m = u. Is 24 a factor of m - (-2 - 2 - -2)? False Let t = -68 - -68. Suppose -4s + 4q = -3s - 54, t = 4s + 2q - 234. Does 3 divide s? False Let j be (4 + 28/(-6))/((-4)/(-6)). Let p be 13 + -14 + (0 - -3) - j. Suppose -g + 8 + 19 = -pc, 0 = -3c - 3. Does 4 divide g? True Suppose 2138f = 2060f + 1461642. Does 74 divide f? False Let i = -11143 - -34901. Is 71 a factor of i? False Let g(a) = -179 + 73 - 244a + 222a. Does 18 divide g(-13)? True Suppose 0 = -154b + 151b + 264. Is b a multiple of 6? False Let f(x) = -x + 2. Let l be f(1). Suppose -c + 4y + l + 3 = 0, 3c + 5y = 12. Suppose -2m + 4m = cv + 176, -3m + 240 = 2v. Is 14 a factor of m? False Suppose -4u = 58r - 60r - 2154, 3u + 4r - 1566 = 0. Is 3 a factor of u? True Suppose -36w = 226w - 1611824. Does 12 divide w? False Let r(b) = -b3 - 8b*2 + 2b + 5. Let h be r(-4). Let c be 7(-11)/154 - (-1393)/14. Let w = c + h. Does 8 divide w? True Suppose 171k = 300k - 222k + 3912696. Is k a multiple of 12? True Let m = 60 - 54. Suppose 0 = 5i - 2k - 41, i + k - 22 = mk. Suppose -37 + 107 = ih. Is 5 a factor of h? True Suppose 0 = -u + 3o + o + 4586, 4u + 4o - 18364 = 0. Is 18 a factor of u? True Let w be (-3096)/43 + 4/(-12). Let d = 261 - 45. Let a = d + w. Does 21 divide a? False Suppose 2r = -3s + 27150, -13s - 3r + 27153 = -10s. Is s a multiple of 7? False Let p(r) = -19 + 42r + 45 - 19. Let w be p(-2). Let h = w - -119. Does 14 divide h? True Let d(w) = -380w - 280. Is 25 a factor of d(-3)? False Suppose -237u + 4426332 = 752121. Is u a multiple of 5? False Let g = 462 - 463. Is 34 a factor of (-23 + 21)/(g/225)? False Let v be (-16)/(-2	{ "pile_set_name": "DM Mathematics" }
and n. 9 Let t(v) = v*3 + 7v*2 - 14v - 20. Let p be t(-8). What is the highest common divisor of p and 252? 28 Suppose z + 0o = 2o + 99, 4z = -5o + 435. Calculate the highest common factor of 70 and z. 35 Suppose 3q - 4o = 266, q + 1002o = 1006o + 86. What is the highest common divisor of 1710 and q? 90 Suppose -6n + 2n = c - 230, -4n - 960 = -4c. What is the highest common factor of c and 14? 14 Let v(l) = 7l2 - 3. Let i be v(-2). Let a = 11 + -7. Suppose u - 6 = a. What is the greatest common divisor of u and i? 5 Let f be (-5484)/(-10) - (72/30)/(-4). Suppose -2j - 3k = j - f, 0 = -j - 3k + 189. What is the greatest common divisor of j and 72? 36 Let v = -12 - -13. Let y = v - -11. Suppose -2g = -3t - 83 + 11, -2g = -2t - 68. What is the highest common factor of g and y? 6 Let x = 1772 - 1338. What is the highest common factor of x and 186? 62 Let g be 260 - 0/(-2) - (11 - 15). Suppose 0 = -9h + 4h + 20. Let l = 28 - h. What is the highest common divisor of l and g? 24 Let k be (-4)/10 + 102/5. Let u = 114 + -108. Suppose 0 = -4h - l + 12, u = -4h + 3l + 34. Calculate the greatest common divisor of h and k. 4 Let s be (1 - -1) + (1/(-1) - -39). Let q(x) = x2 - 4x - 5. Let r be q(7). What is the greatest common factor of s and r? 8 Let a(m) = -m*2 - 18m. Suppose 2r + 2r + 40 = -3o, 2o = 2r + 34. Let s be a(r). Calculate the greatest common factor of s and 26. 13 Let b(o) = o. Let h be b(9). Let a(f) = -217f - 1. Let m be a(-1). Suppose -5i + 2i + m = 0. Calculate the greatest common divisor of i and h. 9 Let k be (-30)/(-9) + 2/3. Let a(s) = s - 2s + 0s + k. Let t be a(1). What is the highest common divisor of t and 9? 3 Suppose -110 - 79 = -5d - 2y, 0 = -3y + 6. Let z = d + -17. Let r be (2/5)/((-76)/(-25) + -3). Calculate the greatest common divisor of z and r. 10 Let o(i) = -i3 - i2 + 5i + 2. Let z = -1 - 2. Let k be o(z). Let l(d) = 7d - 9. Let x be l(7). Calculate the greatest common divisor of k and x. 5 Let b(l) be the first derivative of l4/4 - 2l*3/3 - 4l*2 + 10l - 9. Let y be b(4). Calculate the highest common divisor of 5 and y. 5 Suppose -10 = -a + 3a, -3m = -3a - 27. Suppose 0 = -5r + 5b, 3r - 2b = 3b - m. Let g = -1708 + 1718. Calculate the greatest common divisor of r and g. 2 Suppose -5h - 116 = 129. Let k = 81 + h. Let i(n) = 3n*2 + 1. Let p be i(-1). What is the greatest common factor of k and p? 4 Suppose -16t + 32 = -64. Suppose 3n - 322 = -4m, -2n - 5m = -0n - 224. Calculate the highest common factor of t and n. 6 Let v be 7(26/14 + -1). Suppose vt = 4t. Let a = 1 - t. Calculate the greatest common divisor of a and 10. 1 Let i(m) = -2 - 9m2 - 11m - 2m3 + m3 - 6. Let a be i(-8). Suppose 5l = l + a. What is the greatest common factor of 10 and l? 2 Let o(q) = q*2 - 21q - 742. Let y be o(-19). Let n be 0 - -4 - 2 - 0. What is the greatest common divisor of y and n? 2 Suppose -4s + 52 = -0s - 4i, 11 = 2s + 3i. Calculate the greatest common divisor of 545 and s. 5 Let r = -228 - -333. What is the greatest common divisor of 15 and r? 15 Let i = 110 - 55. Let a = 67 - i. What is the greatest common divisor of a and 48? 12 Suppose 7p = -17 - 25. Let r(u) = u*2 - 5u - 2. Let d be r(p). Calculate the greatest common divisor of 8 and d. 8 Let o = 40 + -143. Let a = o + 151. What is the highest common divisor of a and 6? 6 Let z = 19 - 14. Suppose 0 = -zi + i + 72. Let p(q) = -q2 - 10q + 3. Let h be p(-9). Calculate the highest common divisor of h and i. 6 Let x = -234 - -249. Calculate the greatest common factor of 5 and x. 5 Suppose -37o = -2776 + 963. What is the greatest common factor of o and 1127? 49 Let w = -41 + 24. Let a = -15 - w. Calculate the greatest common divisor of a and 2. 2 Let k = 435 - -41. Calculate the greatest common factor of 68 and k. 68 Suppose x - 427 = -z - z, 5z = 2x + 1090. What is the greatest common factor of 16 and z? 8 Let i = 69 - 28. Let m = i - 23. What is the greatest common factor of m and 45? 9 Let f be 34(1 - 3/6). Let n = f + -6. Calculate the greatest common divisor of n and 11. 11 Let c = 160 + -132. Let s be (-6)/(-3)106/4. Suppose -u + s = 3w, 2u + 4w - 13 = 95. What is the greatest common divisor of u and c? 28 Let w be 15 + -4 - (-2)/(-1). Let m(v) = -2v2 - 38v + 9. Let a be m(-18). What is the highest common divisor of w and a? 9 Let d = 26 + -22. Let l be 182 - (d + -3 - 3). Calculate the greatest common factor of 23 and l. 23 Suppose s + 66 = 5b, -3b + 58 = -0b + 4s. Suppose -16x - b = -78. Calculate the greatest common factor of x and 4. 4 Suppose 3f + 12 = 5f. Suppose 7r - f = 4r. Suppose -rk - 4a + 32 = 0, 5a + 2 = -0k + k. Calculate the greatest common factor of k and 84. 12 Let b be 40/(-15)18/(-4). Let n(l) = -l*2 - 5l - 4. Let v be n(-3). What is the greatest common divisor of v and b? 2 Suppose -2t + t + 30 = -3r, 2t - 3r - 54 = 0. Suppose -11k + 72 = -8k. What is the highest common factor of k and t? 24 Let w = -1 - -3. Suppose -31 = 13o - 36 - 34. Calculate the highest common factor of o and w. 1 Let r be 4/(-4(-2)/1102). Calculate the greatest common divisor of r and 145. 29 Suppose -8d + 5d + 12 = 0. Let w(g) = 15g + 1. Let r be w(1). Calculate the highest common factor of r and d. 4 Let k be -4((-22)/(-4))/(-1). Suppose -21g + 2993 = -1165. Calculate the greatest common divisor of k and g. 22 Let t(y) be the third derivative of -5y*4/24 - 13y3/6 + y2. Let s be t(-6). Let a be 51/(-2 - 1)-4. What is the greatest common divisor of s and a? 17 Let v be 30(-3)/(9/(-13)). Let o(w) = -3w + 25. Let g be o(-9). Calculate the highest common factor of g and v. 26 Let p be (11 - 3) + -17 + 24. What is the greatest common factor of 55 and p? 5 Suppose -4s + 11s = 651. Suppose -3f - 15 = -s. Calculate the greatest common factor of f and 2. 2 Suppose -12a = -13a + 276. Calculate the greatest common factor of 1196 and a. 92 Let w(n) = 4n2 - 3n - 2. Let h be w(4). Let a be (-13)/(3 + h/(-16)). What is the greatest common divisor of a and 13? 13 Let i(y) = -95y + 2139. Let s be i(22). Suppose -2j + 10 + 32 = 0. What is the highest common factor of s and j? 7 Suppose -83o + 4774 = -69o. Calculate the highest common divisor of 33 and o. 11 Let b = -145 + 241. Calculate the greatest common divisor of 24 and b. 24 Suppose 9n - 2n - 3570 = 0. Let v = -339 + n. Calculate the greatest common factor of 19 and v. 19 Let o = 322 - -497. What is the greatest common factor of 351 and o? 117 Suppose -2t = -0t - 8. Suppose -to + 17 = 5s, o = s + 2s - 17. Suppose -6 = 4w - sw. What is the highest common factor of w and 66? 6 Let k = -117 - -223. Suppose 4w - 8 = 4n, 3n = 4n + 3w - 14. Suppose 53 + 75 = 4d + nt, 3d + 4t = k. Calculate the highest common divisor of 10 and d. 10 Let t be (12 - 6)1/3. Suppose -d = td. Suppose -4g + dj - 2j = -92, -2j + 8 = 0. What is the greatest common factor of 168 and g? 21 Suppose -d - 316 = -5z, 56 = z - 4d - 11. Calculate the highest common factor of z and 77. 7 Let c = 1012 + -1009. What is the highest common divisor of c and 3? 3 Suppose -4h + w = -75, -4 = -2w + 6. Let m(b) = -20b + 460. Let p be m(12). What is the greatest common factor of p and h? 20 Suppose c + c = 6, j - 2c = 63. Suppose 0 = o - 3m - 36, -4o + 47 = -5m - j. What is the highest common factor of 168 and o? 24 Let v be 265/(-25) + 2/(-5). Let p be 1956/18 + 6/(-9). Let m be (-2)/v + p/11. What is the highest common factor of 10 and m? 10 Suppose -3j + 5j = 0. Suppose -4d - 2z - 4 = 0, 18 = -5d + 4z - jz. Let r be ((-26)/d)/(3 + -2). What is the highest common factor of 65 and r? 13 Let j(c) = -19c + 186. Let d be j(-3). What is the highest common factor of 108 and d? 27 Suppose -2y = -2m - 684, -2y + 434 + 250 = 5m. What is the greatest common factor of 36 and y? 18 Let r(c) = c3 + 11c*2 + c + 27. Let a be r(-11). What is the highest common divisor of a and 752? 16 Suppose 20n - 23*n - 21 = 0. Let p = n + 34. Calculate the greatest common factor of 9 and p. 9 Let y = 220 + -106. Let a = y + -110. Calculate the greatest common divisor of 10 and a. 2 Let j be (-22641)/(-14) -	{ "pile_set_name": "DM Mathematics" }
86l in millilitres? 58417.86 What is 0.9082862 milligrams in grams? 0.0009082862 What is 11/2 of a micrometer in nanometers? 5500 How many nanograms are there in twenty-six fifths of a microgram? 5200 How many centimeters are there in 343652.4 nanometers? 0.03436524 How many months are there in 9/10 of a century? 1080 How many nanometers are there in 13/5 of a micrometer? 2600 Convert 5824.333 years to decades. 582.4333 How many kilograms are there in 73.97373ng? 0.00000000007397373 How many millilitres are there in 1/5 of a litre? 200 Convert 24.86639 millennia to centuries. 248.6639 What is 42/5 of a litre in millilitres? 8400 Convert 0.286605 meters to kilometers. 0.000286605 What is twenty-nine fifths of a centimeter in millimeters? 58 What is 89.8232 centuries in months? 107787.84 Convert 1.8386412 months to years. 0.1532201 What is 1/4 of a micrometer in nanometers? 250 What is twenty-six fifths of a hour in minutes? 312 How many grams are there in ninety-one quarters of a kilogram? 22750 How many millilitres are there in 1/5 of a litre? 200 How many months are there in 445.6224 centuries? 534746.88 How many months are there in thirty-seven halves of a century? 22200 Convert 44.46252mm to kilometers. 0.00004446252 What is three fifths of a decade in years? 6 How many millilitres are there in seven halves of a litre? 3500 What is 25/4 of a hour in minutes? 375 Convert 7.893962ml to litres. 0.007893962 How many minutes are there in thirty-two sevenths of a week? 46080 How many millilitres are there in twenty-seven halves of a litre? 13500 What is 7.379091kg in micrograms? 7379091000 What is seventeen quarters of a litre in millilitres? 4250 What is 71.93512us in seconds? 0.00007193512 How many micrometers are there in 7/2 of a millimeter? 3500 What is sixty-eight thirds of a minute in seconds? 1360 What is one fifth of a millimeter in micrometers? 200 What is five eighths of a litre in millilitres? 625 What is 86.83693 grams in tonnes? 0.00008683693 Convert 6585.587 micrograms to grams. 0.006585587 What is 9944.311 litres in millilitres? 9944311 What is nine tenths of a gram in milligrams? 900 Convert 7.499982 weeks to days. 52.499874 How many millilitres are there in 3/50 of a litre? 60 How many millilitres are there in 21/5 of a litre? 4200 How many kilograms are there in three fifths of a tonne? 600 What is 10/3 of a year in months? 40 How many years are there in 86.77078 millennia? 86770.78 How many microseconds are there in 13/8 of a millisecond? 1625 Convert 0.5058164 kilometers to centimeters. 50581.64 How many seconds are there in four fifteenths of a minute? 16 What is 3/25 of a litre in millilitres? 120 Convert 7755.6l to millilitres. 7755600 What is 33782.99 litres in millilitres? 33782990 What is 17/2 of a gram in milligrams? 8500 What is 74/5 of a decade in years? 148 How many days are there in 1196449.5 hours? 49852.0625 What is 3/32 of a kilometer in centimeters? 9375 How many milligrams are there in 69/2 of a gram? 34500 What is 589172.5 kilograms in milligrams? 589172500000 Convert 55511.03 minutes to seconds. 3330661.8 What is 5.229535 centuries in years? 522.9535 What is 97958.65 millilitres in litres? 97.95865 Convert 732938.5cm to meters. 7329.385 How many millimeters are there in 3.444394 centimeters? 34.44394 What is 13/4 of a litre in millilitres? 3250 What is one tenth of a litre in millilitres? 100 How many millilitres are there in 7/8 of a litre? 875 What is 49/4 of a hour in minutes? 735 How many kilograms are there in 11/4 of a tonne? 2750 What is 21/2 of a litre in millilitres? 10500 What is three fifths of a micrometer in nanometers? 600 What is 3/50 of a microsecond in nanoseconds? 60 What is 7/2 of a litre in millilitres? 3500 Convert 584569.5g to micrograms. 584569500000 How many years are there in 168.4004 decades? 1684.004 How many litres are there in 0.4645731 millilitres? 0.0004645731 What is 95195.8 centuries in decades? 951958 What is 21/5 of a litre in millilitres? 4200 What is 914.762 years in decades? 91.4762 Convert 197636.1 months to millennia. 16.469675 How many nanometers are there in 1047.982 kilometers? 1047982000000000 What is 6/5 of a decade in months? 144 Convert 7.620227 tonnes to kilograms. 7620.227 How many kilograms are there in one tenth of a tonne? 100 What is five quarters of a century in years? 125 What is 1564.5717ns in days? 0.00000000001810846875 How many years are there in 13/4 of a century? 325 How many grams are there in 1/4 of a kilogram? 250 How many hours are there in ten thirds of a week? 560 Convert 6.651497nm to centimeters. 0.0000006651497 What is 0.5892508m in kilometers? 0.0005892508 What is 1/10 of a litre in millilitres? 100 How many litres are there in 93.66296ml? 0.09366296 What is 3/8 of a century in months? 450 What is 21/5 of a litre in millilitres? 4200 What is one tenth of a milligram in nanograms? 100000 What is 33/5 of a century in months? 7920 How many kilometers are there in 450501.3mm? 0.4505013 What is 7/8 of a milligram in micrograms? 875 Convert 888233.1 millennia to months. 10658797200 How many months are there in seventeen quarters of a year? 51 How many years are there in 5/8 of a millennium? 625 What is 5.947649 centuries in decades? 59.47649 What is 5.787713 tonnes in grams? 5787713 What is 48.93857nm in centimeters? 0.000004893857 How many kilograms are there in 57/5 of a tonne? 11400 What is 45/2 of a litre in millilitres? 22500 What is twenty-one quarters of a meter in centimeters? 525 What is 6.282151mg in grams? 0.006282151 How many millilitres are there in 11/4 of a litre? 2750 What is 155.01 months in decades? 1.29175 What is three fifths of a microgram in nanograms? 600 What is 5/8 of a millimeter in micrometers? 625 What is 37/2 of a litre in millilitres? 18500 Convert 67.0789t to micrograms. 67078900000000 What is 33.7879ns in seconds? 0.0000000337879 What is 64/5 of a meter in millimeters? 12800 How many millimeters are there in 202.5355cm? 2025.355 Convert 366540.4 micrometers to millimeters. 366.5404 How many millilitres are there in seven eighths of a litre? 875 How many kilometers are there in 8.17119 nanometers? 0.00000000000817119 What is 63/8 of a litre in millilitres? 7875 How many months are there in 1/5 of a century? 240 What is 923370.8nm in meters? 0.0009233708 What is 165447.3m in nanometers? 165447300000000 What is 92032.47 years in decades? 9203.247 How many millennia are there in 132499.26 months? 11.041605 Convert 91.26434ml to litres. 0.09126434 What is 8.306878 weeks in nanoseconds? 5023999814400000 What is 34/5 of a millimeter in micrometers? 6800 What is 49.2397 litres in millilitres? 49239.7 What is one tenth of a kilometer in meters? 100 How many grams are there in 37/2 of a kilogram? 18500 Convert 956482.3 millilitres to litres. 956.4823 How many millilitres are there in thirty-one fifths of a litre? 6200 How many millimeters are there in twenty-seven fifths of a centimeter? 54 How many millilitres are there in 7/8 of a litre? 875 How many meters are there in 11/4 of a kilometer? 2750 How many nanoseconds are there in 74.753 microseconds? 74753 What is one fifth of a day in minutes? 288 Convert 4.921316 kilograms to nanograms. 4921316000000 What is 1/5 of a kilogram in grams? 200 Convert 18486.21 micrograms to tonnes. 0.00000001848621 How many nanograms are there in 2.190752ug? 2190.752 Convert 275.4075 nanograms to micrograms. 0.2754075 Convert 0.6943473kg to tonnes. 0.0006943473 What is 47438.57km in micrometers? 47438570000000 How many grams are there in 0.0880746 milligrams? 0.0000880746 How many milligrams are there in one tenth of a kilogram? 100000 What is 91.6545 millimeters in meters? 0.0916545 What is five quarters of a centimeter in micrometers? 12500 How many centimeters are there in 26/5 of a meter? 520 What is 7/2 of a hour in minutes? 210 What is 1/5 of a second in milliseconds? 200 How many millilitres are there in 86469.99 litres? 86469990 How many litres are there in 9509.821ml? 9.509821 What is 46.215km in micrometers? 46215000000 How many weeks are there in 98.2338462s? 0.0001624236875 Convert 27.641109 months to centuries. 0.0230342575 How many tonnes are there in 997203.9ng? 0.000000	{ "pile_set_name": "DM Mathematics" }
est to 0.2? (a) 5 (b) 0.2 (c) d b Let m be ((-4)/(-10))/(-4(-7)/(-14)). Let v be 264/20 - 2/5. Let y = v + -443/35. What is the nearest to 0.1 in y, 2, m? y Let w be (-20)/(-25) - -6 - 6. Which is the nearest to 1? (a) 1 (b) 9/5 (c) -1 (d) w a Let s be (-1 + 1)/(2/(9 - 10)). What is the closest to -0.04 in -1, s, 1/3, 1/17? s Suppose -28 = 4q + 8. Let j(f) = f + 8. Let c be j(q). Let h = -5 + 6. What is the closest to h in 5, -0.1, c? -0.1 Let u = 6/19 + -5/76. What is the closest to u in 5, -2/15, -1/11? -1/11 Let l = -0.614 - -0.114. What is the closest to 0.016 in 0, 0.1, l? 0 Let j = -2429 + 2428. Let t = 19/10 + -189/110. What is the closest to j in -2, -4, t? -2 Let b = -19.7 + 20.1. What is the nearest to b in 0.5, -1, -4, -2/13? 0.5 Let l = 12.6 - 15. Let p = 2.1 + l. What is the closest to 3 in -5, p, 0.1? 0.1 Let z = -7.7 - -7.8. Which is the closest to z? (a) -3 (b) -2 (c) -4 b Let m = -242 + 241.7. What is the closest to 3/5 in m, 2, -0.2? -0.2 Let r = -169 - 122. Let t = r - -292.91. Let l = -0.09 - t. What is the closest to -2/5 in 5, l, 0? 0 Suppose 4h = -h. Let z = 0.759 + -0.359. Let i = -0.2 + -0.8. Which is the closest to 2/5? (a) i (b) h (c) z c Let n = -49 + 53. Let q = -69/2 + 761/22. Which is the nearest to 11? (a) q (b) 3/4 (c) n c Let k be ((-94)/(-6))/(5/(-3)). Let i = -9 - k. Suppose w - 2 = -0. Which is the closest to 1/4? (a) 1 (b) w (c) i c Let c = -114/11 + 353/33. Let u = 5/6 + -43/66. What is the nearest to c in -0.5, u, 0.3? 0.3 Let x be 123/14 - 10/35. Let p = x + -77/10. Which is the closest to 1/4? (a) p (b) -1/4 (c) 1 b Let q be -4 - (174/(-48) + 0). What is the closest to 1/12 in -5, -0.2, 1/22, q? 1/22 Let i be (-52)/(-130)15/(-4). What is the closest to i in -2/31, -1/11, -1? -1 Suppose 2p - 12 = 4p, 2p + 12 = -2j. Let m = 208 + -212.08. Let x = m - -0.08. What is the closest to j in x, 3, -2/7? -2/7 Let x = -15 + 18. Let l be 24/(-21) + x/21. Let f be ((-8)/(-20))/((-19)/5). Which is the nearest to 0? (a) 0 (b) l (c) f a Let y = 0.0634 - -3.9366. Which is the closest to -1? (a) -2 (b) -0.2 (c) 0.4 (d) y b Let z(i) = 2i2 + 54i - 716. Let d be z(12). Which is the closest to d? (a) 0.5 (b) 4 (c) 1 b Let p(c) = -c*3 - 6c*2 - 6c - 4. Let o be p(-5). Let n = 4/13 + 5/26. Suppose -29 + 13 = -4w. What is the closest to o in w, -4, n? n Let z = -144 + 72. Let v = z + 72.1. Which is the closest to v? (a) -4 (b) 2/7 (c) 3 b Let o be (-2)/4 - (-2)/4. Suppose -s - 2 = -12. Suppose 4k + k = s. Which is the nearest to 0? (a) -3 (b) k (c) o c Let f(m) = m + 4. Let k be f(0). Let g(j) = 0 - j*2 - 3j - 2 - 4j - k. Let t be g(-6). Which is the closest to 2? (a) 0.4 (b) t (c) -0.3 a Let m be -3(-6)/(-27) + 0. Let y = -23/12 + 5/4. Let u = -311 - -308. What is the nearest to m in y, u, 1.2? y Let u = 0.16242 + -0.06242. Suppose -2h = h. Let r = -0.6 + 0.1. What is the nearest to u in 1, r, h? h Let z = 15.1 - 13. Let o = 2 - z. Let l = -9 - -4. Which is the nearest to 0.3? (a) 0 (b) o (c) l a Let v = 26.5 - 22.5. Let l be (7/(-56))/(2/4). What is the nearest to l in v, -3, -0.02? -0.02 Let n = 162 - 115. Let p = -12 + n. Let u = p - 37. What is the closest to -2/7 in -5, u, -1/3? -1/3 Let f = 880 - 885. What is the nearest to 2/7 in 1, -0.12, 9, f? -0.12 Let g = -5.1 - -5.42. Which is the closest to -1? (a) 4 (b) 1 (c) g c Let j = -160.2 + 160.1. What is the nearest to -4 in j, 4, -2, 1/31? -2 Let s = 0.12 - 0.02. Let k = -1839/16 + 115. Let x = -73/144 + k. Which is the closest to s? (a) x (b) 0.4 (c) 2 b Let w = -1021 + 1014. Which is the closest to 1? (a) w (b) 0 (c) -6/5 b Let b = 389.7 + -390. What is the nearest to 6 in -5, b, 4? 4 Let g = -1 - 2. Suppose 2j - 2h + 30 - 44 = 0, 0 = h + 3. Which is the nearest to -1/3? (a) j (b) g (c) -0.4 c Let p = -12 + 58/5. Let j = -98 + 95. Which is the nearest to 2? (a) j (b) p (c) -3/7 b Let j = 264 + -2109/8. Let i be (-2)/56 - 2/8. Which is the closest to i? (a) 0.3 (b) -0.4 (c) j b Let m = -9 + 44/5. Suppose 2o + 3 + 1 = 0, 2g + 3o = -6. Suppose -5a + 0 = -c + 4, -4a = g. What is the closest to 1 in -0.5, m, c? m Let m(i) = -i*2 + 44i - 191. Let t be m(5). Which is the nearest to -1? (a) t (b) 2/5 (c) -1.9 (d) -2/17 d Suppose 8f - 3f + 4z = 33, -5z + 15 = f. Suppose -s - 3k - 2 = 1, -5k = -2s + 5. Which is the closest to s? (a) -1/4 (b) -0.04 (c) f b Let d be (-20)/5 + (-176)/(-33). Let h be -2((-9)/2)/(-3). Which is the closest to h? (a) d (b) 3 (c) -0.5 c Let q = -199/3 - -67. Let d = -2.02 - -1.62. Let y = -0.13 - 0.07. Which is the closest to q? (a) y (b) d (c) -1/2 a Let y(g) = -g*2 + 3g - 5. Let k be y(0). Let x be -2(4 + (-60)/16). Which is the closest to -3/4? (a) 2/13 (b) x (c) k b Let b = 8 - 3. Suppose -2r - 2 = 4d - 4r, 5r = d + 23. What is the nearest to 1/3 in 9, b, d? d Let j = -235 - -463/2. Which is the closest to 1/2? (a) -0.1 (b) 0 (c) j b Let z be (-25 - -2)12/(-60). Which is the closest to 0? (a) 4 (b) -2/25 (c) z b Let g = -3 + 2.7. Let m = 425.4 + -425. Which is the closest to 0.1? (a) g (b) -4 (c) m c Let q = 56.958 + -57. Let u = q - -0.242. Which is the nearest to -4/3? (a) -2 (b) 0.1 (c) u a Let d be (2/(-4))/(2/(-16)). Which is the nearest to 2/5? (a) -3 (b) d (c) -5 a Let n = 19 + -19.1. Let w = -207 + 205. Let h be (-1)/((-2)/4) - 3. Which is the closest to n? (a) 3/7 (b) w (c) h a Let n be (3 + (-12)/5)5. Let c be (n - 1/1)-2. Let r be (2/(-5))/(c/5). What is the nearest to r in 2/9, -0.1, 5? 2/9 Let m be (-1)/6 + (-4)/3. Let y = 34.5 + -30.5. Which is the closest to m? (a) y (b) 0.2 (c) -0.5 c Let g = 0.925 - -2.775. Let o = 37/93 + -2/31. Which is the closest to o? (a) g (b) 0.4 (c) 0.5 b Let f = 2.028 + -0.028. Let o = -1.9 - -2. Let z = o + 3.9. Which is the nearest to f? (a) -0.2 (b) -0.1 (c) z c Suppose 5 = 7w - 6w. Which is the closest to 1? (a) -2 (b) w (c) 0.07 (d) 0 c Let h = 0.1 - -0.9. Let t = h - 1.1. Let m = -0.00437 - -0.20437. Which is the nearest to m? (a) t (b) -4 (c) 1 a Let w = 4 - 2.7. Let z = -16 + 14.7. Let y = w + z. Which is the nearest to y? (a) -2/11 (b) 2 (c) -1/3 a Let d = 30 - 22. Let l = d - 7.6. Which is the closest to -0.1? (a) 0 (b) -0.08 (c) l b Let o = 0.5 - 0.1. Suppose -9j + 196 = 19j. Suppose -2c - 21 = 5y, 0 = 3c - 4y + 4 - j. What is the closest to c in o, -2, 2/3? -2 Let g = -368 - -371. Let r be (-4 - -1)(-12 + 1). Let y = r - 133/4. Which is the nearest to y? (a) -5 (b) g (c) 2/9 c Suppose -3n + 5v + 5 + 6 = 0, -4n + 4v + 28 = 0. Let y be ((-1)/3)/(6/n). Let o = 58 - 988/17. Which is the closest to y? (a) o (b) -1/3 (c) -1/7 b Let y = 0.3 - 0.2. Let c be (-16)/(-10) + (-5)/((-75)/(-9)). Let r be c - 2 - (-13)/11. What is the nearest to y in -2/5, 7, r? r Let g = 11.464 - 8.4. Let a = g - 0.064. What is the nearest to 0.06 in 5, a, -1/2? -1/2 Let f = 0.5 - 0.2. Let y be 34/42/105. Let r = -2/105 + y. What is the closest to 1 in -2/7, r, f? f Let d = 1022 - 1021.7. What is the nearest to 1 in 9, 1/3, d, 2? 1/3 Let l = -87 + 23. Let o = l - -705/11. Which is the nearest to -1/3? (a) o (b) -3 (c) -0.1 c Suppose -2 = 2v + 2d - 4, -5v + 4d = 40. Let r = -0.4 - -4.4. Let j = -2.37 - -3.37. What is the nearest to j in 5, v, r? r Let z be 2/48 + 19418/(-6384). What is the closest to 0.1 in 22/9, z, -1/13? -1/13 Let t = -0.184 - 4.766. Let q = t - 0.05. Let a = -42 + 41. What is the closest to a in q, -4, -0.4? -0.4 Let z = -45/34 - -107/68. Which is the nearest to 1/3? (a) 6 (b) z (c) 3 (d) 5 b Let r = -450 + 449.7. What is the nearest to 0 in -0.2, r, -6/7? -0.2 Let l = 1 - 1.4. Suppose -2m + 2x + 7 = -1, 34 = 5m + 2x. Let p = m - 7. Which is the nearest to p? (a) 3/7 (b) l (c) -2/7 b Let t = 0.027 - 2.727. Let i = -2.5 - t. Let m = 3 - 0. Which is the closest to -4? (a) i (b) 0 (c) m b Let g = 0.01 - 0.07. Let x = 76.1 - 76. Let j = x + g. Which is the closest to -2? (a) -2 (b) -0.5 (c) j a Let y = -2431 + 2431.5. What is the nearest to -2/3 in -2, -5, 2, y? y Let g = -102/19 + 1772/323. Let w = -12 + 11. Let j = 7 + w. Which is the closest to j? (a) -3 (b) 0 (c) g c Let d be 13/30 + (-6)/(-1	{ "pile_set_name": "DM Mathematics" }
2o - v. Let t(a) = 93a + 115a - oa. What is p(t(i))? 972i2 Let u(z) = -3z*2 - 4382z + 2. Let f(n) = 2n + 107. What is f(u(s))? -6s*2 - 8764s + 111 Let t(o) = -17 - 602o2 - 599o*2 + 1199o*2 + 17. Let z(c) = 3c + 1 - 28 - 21 + 6. Determine t(z(i)). -18i2 + 504i - 3528 Let o(l) = -7499253l. Let h(a) = -3a. Calculate h(o(k)). 22497759k Let y(n) = 6n*2. Let i(t) = 2t*2 + 3t + 122640. What is i(y(d))? 72d4 + 18d*2 + 122640 Let d(f) = -23f. Let g(t) = 6t - 216. Let b(q) = -5q + 240. Let l(v) = -9b(v) - 10g(v). Calculate l(d(p)). 345p Let g(f) = -2f + 0f + 4f. Let j(s) be the third derivative of s8/504 - s5/10 + s*2. Let z(u) be the third derivative of j(u). Calculate g(z(v)). 80v*2 Let r(k) = -1610k - 1614k - 1615k + 4838k. Let n(b) = -50b. Determine r(n(i)). 50i Let o(h) = h3 - 5h*2 + 11h - 9. Let j be o(4). Let t(r) = -2r - 20 - j + 79 - 25. Let a(c) = -c2. Determine t(a(m)). 2m*2 + 15 Let h(d) = -159d + 309d - 150d - 26d2. Let v(q) = 2q*2. Give v(h(x)). 1352x*4 Let m(t) = -41t. Let x be 1/((-50539)/(-25269) - 2). Let p(f) = -3f2 + 25269 - x. Determine m(p(g)). 123g*2 Let z(f) = -3816053f. Let y(b) = 14b. Give z(y(g)). -53424742g Let u(m) = 7 - 2 - m - 5. Let c be -4 + 6 - 03/(-6). Let i(k) = -8k*c + 0k*2 + 10k*2 + 3k. Determine u(i(x)). -2x2 - 3x Let z(w) = -178526w. Let q(h) = 22h*2. Calculate z(q(d)). -3927572d*2 Let y(v) = 3v + 17. Let c(k) = -2k2 + 2k + 8637. Give y(c(q)). -6q2 + 6q + 25928 Let g(i) = -44i2 - 291i - 231. Let t(c) = 2c. What is g(t(o))? -176o*2 - 582o - 231 Let x(j) be the third derivative of j*4/12 - 2j*2 + 9. Let o(d) = -d + 2. Let p(v) = -24v + 40. Let w(i) = 60o(i) - 3p(i). Give x(w(m)). 24m Let t(y) = -9y*2 - 6014y. Let a(f) = 6f. Calculate a(t(h)). -54h*2 - 36084h Let h(s) be the second derivative of s*4/12 - 505s*2/2 + 1961s. Let c(v) = 2v2. Calculate h(c(u)). 4u*4 - 505 Let o(k) be the third derivative of -21k*2 + 1/8k*4 + 0 + 0k + 0k3. Let b(q) = -3q + q + 5q. Calculate b(o(p)). 9p Let l(q) be the second derivative of 3q4/4 - q. Let g(w) be the third derivative of 0 - 1/12w*4 + 0w*3 + 0w - 129w2. Determine g(l(k)). -18k2 Let a(g) = -g2. Let r(z) = 4z - 1. Let u(c) = 6080c - 1824. Let v(t) = -1824r(t) + u(t). What is a(v(o))? -1478656o*2 Let o(p) = -13 + 21p + 1 + 12. Let m(s) = -8s - 9. Let c be 6/5(-60)/(-8). Let u(y) = 2y + 2. Let f(i) = cu(i) + 2m(i). Determine o(f(h)). 42h Let y(b) be the third derivative of b*4/24 + 7637b*2. Let g(o) = -3o + o + 7 - o. Calculate g(y(c)). -3c + 7 Let g(r) = -r - 57. Let a(z) be the second derivative of z3/6 - 808z. What is g(a(p))? -p - 57 Let p(y) = -52y. Let q = 8450/12657 + -4/4219. Let n(x) be the first derivative of -13 + 0x*2 - qx*3 + 0x. Calculate p(n(h)). 104h2 Let u(k) = 4k*2 - 7k + 14. Let q(n) = 0 + 7 + 1 + 0n2 + 2n*2 - 4n. Let t(v) = 7q(v) - 4u(v). Let x(z) = -5z2 + 7. What is t(x(a))? -50a*4 + 140a*2 - 98 Let p(i) = 52i. Let t(v) = 69v2 - 9v - 9. Let y(c) = -34c2 + 4c + 4. Let u(a) = 4t(a) + 9y(a). Give u(p(r)). -81120r2 Let s(g) = 543355841g*2. Let p(c) = -3c. Calculate s(p(b)). 4890202569b2 Let a(h) = 6944h*2 + 416h + 416. Let r(u) = -50u2 - 3u - 3. Let f(w) = 3a(w) + 416r(w). Let c(l) = 11l. Give f(c(z)). 3872z*2 Let w(m) = -2309342m. Let z(l) = 4l. Calculate z(w(o)). -9237368o Suppose -2v = -487 - 537. Let o(j) = 509j*2 + vj*2 - 1020j*2. Let m(c) = -2c - 116. Give o(m(a)). 4a2 + 464a + 13456 Let j(h) be the first derivative of h*3/3 - 825. Let g(b) = -26b. What is g(j(z))? -26z2 Suppose -406 + 406 = -z. Let h(p) be the second derivative of 0p*2 - 7p + 7/6p4 + z + 0p*3. Let s(q) = -q. Give s(h(f)). -14f2 Let a(t) = t2. Let n(c) = 1844691c2 + 3c. Give n(a(r)). 1844691r4 + 3r*2 Let w(m) = -2m*2 - 595m - 13. Let z(p) = 246p. Give z(w(t)). -492t*2 - 146370t - 3198 Let h = 26 - 22. Let t(g) = -9 - g*2 - hg - 8 + 17. Let n(q) = -q + 9. Let f(l) = 4l - 54. Let s(w) = f(w) + 6n(w). Calculate t(s(z)). -4z2 + 8z Let o(b) = -480b. Let z(m) = -2m*2 + 17m - 34. Let h(u) = -u + 2. Let i(r) = 34h(r) + 2z(r). What is o(i(l))? 1920l2 Let m(n) = 200 - n - 200 + 4n. Let b(q) = 3q - 36. Let p be b(12). Let g(f) = 4f + 4f + pf - f. Calculate m(g(z)). 21z Let t(b) = 55b. Let m(z) = -z*2 + z - 24. Let u(y) = -7y*2 + 4y - 96. Let g(o) = -12m(o) + 3u(o). What is t(g(n))? -495n2 Let h(o) = -25554o - 25517o + 50776o. Let c(q) = 47q. Calculate c(h(t)). -13865t Let w(q) be the second derivative of -1/2q3 + 5q*2 - 2q + 14. Let d(n) = -n*2. Determine d(w(c)). -9c*2 + 60c - 100 Let p = -71 - -76. Let b(n) = -3 + 2 - p - 101n2 + 7. Let j(t) = -2t. Give j(b(c)). 202c2 - 2 Let l(f) = f - 1. Let w(b) = 424b*2 + 4b + 19. What is l(w(m))? 424m2 + 4m + 18 Let i(x) be the second derivative of x*4/6 - x. Suppose 149a - 148a = 144. Let w(q) = -141q*2 - aq*2 + 262q*2. Calculate i(w(s)). 1058s*4 Suppose -4q + 2729 - 2713 = 0. Let r(k) be the third derivative of -1/20k5 + 0k*3 + 0k + 0kq - k2 + 0. Let n(y) = 5y. Determine n(r(w)). -15w2 Let a(q) = -2q + 832. Let i(x) = 3x2 - 2x + 2. Let v(n) = -13n2 + 8n - 8. Let l(j) = 4i(j) + v(j). Calculate a(l(b)). 2b*2 + 832 Let i(k) = -827 + 827 - 2k. Let d(r) = -4r2 - 137r + 14. Let s(w) = w*2 + 45w - 4. Let q(j) = -2d(j) - 7s(j). Calculate i(q(n)). -2n2 + 82n Let a = -125 - -136. Suppose aj - 568 = 7j. Let y(d) = j - 142 + d - 3d. Let r(o) = 34o*2. Determine r(y(z)). 136z*2 Let d be ((-9)/24114)/((-1)/24). Let o(z) = -8z - d + 1026. Let f(g) be the second derivative of g4/12 + g. Calculate o(f(j)). -8j*2 Let t(q) = -3q. Let w(j) = 36811136j2. Give w(t(c)). 331300224c*2 Let s(b) = 2b. Let d(o) = -71o2 + 106o - 17. Let y(m) = -14m2 + 19m - 3. Let i(h) = 2d(h) - 11y(h). What is s(i(u))? 24u2 + 6u - 2 Let s(c) be the first derivative of 1314c2 + 1152. Let y(d) = 3d. Calculate s(y(r)). 7884r Let d(l) = -20l. Suppose -18f + 4f + 210 = 0. Let o(i) = -f - 10 + 25 - 3i. Give o(d(m)). 60m Let h(x) be the third derivative of 0 + 0x3 + 0x + 15x2 - 1/3x*4. Let t(s) = 4s. Calculate t(h(a)). -32a Suppose 5g + 17 = 4j + 6g, 0 = -2j - 2g + 4. Suppose -10 = -2r, -4r + 20 = jf - 3r. Let u(a) = -10a + fa + 4a. Let i(z) = 18z*2. Give u(i(m)). -54m*2 Let n(m) = 2m*2. Let s be (-3)/(-12)-20 + 7. Let u(b) = sb - 5b + 14b. Give u(n(o)). 32o2 Let n(f) be the second derivative of 24f + 1/6f4 + 0f*3 + 3 + 0f*2. Let i(w) = -2w + 17. Determine i(n(s)). -4s2 + 17 Let y = -43 - -43. Suppose 4z = -o + z + 11, -o + z - 1 = y. Let f(t) = -9. Let i(n) = -n + 11. Let h(u) = of(u) + 3i(u). Let c(p) = 2p. Calculate c(h(m)). -6m + 30 Let y(t) = -7t. Let h(u) = 6327u. Let q(k) = h(k) - 148y(k). Let x(w) = -w. What is x(q(j))? -7363j Let h(n) = 11n. Let y(k) = -k3 - 8k*2 - 17k - 11. Let l be y(-10). Let p(d) = -ld - 369d + 735d. Give p(h(c)). 77c Let s(h) = 4h2. Suppose 81 = 2t + 4p - 5p, 5p - 128 = -3t. Let y(q) = -16q2 - 15q*2 - 4q + tq2 + 2q - 9q2. Give s(y(u)). 4u*4 - 16u*3 + 16u*2 Let l(u) = 377u*2. Let t(o) = 69 + 72 - 3o*2 + 66 - 207. Determine l(t(h)). 3393h*4 Let s(p) = -98p - 5. Let j(y) = 39y + 2. Let m(k) = 10j(k) + 4s(k). Let w(u) = -642u. Determine m(w(c)). 1284c Let p(i) = i + 297. Let k(b) = -49b + 40b + 7b - 2b. Give p(k(y)). -4y + 297 Let k(t) = -5t. Let x(v) = -129v*2 + 15v. Let c(j) = 60760j2 - 7068j. Let s(r) = 5c(r) + 2356x(r). Calculate s(k(b)). -3100b2 Let l(s) be the third derivative of s4/8 - 3092s*2. Let v(h) = -2h*2 - 34h + 1. Determine l(v(a)). -6a2 - 102a + 3 Let z(i) = 2i - 19. Let k be z(12). Let j(y) = 56y - 24. Let c(s) = -11s + 5. Let u(g) = kj(g) + 24c(g). Let b(x) = -12 + 6 - 2x + 6. What is u(b(t))? -32t Let b(o) = -8o2 + 6. Let a(u) = -u2 - u + 1. Let j(q) be the first derivative of q*2/2 - q + 138. Let d(r) = -a(r) - j(r). Give d(b(v)). 64v*4 - 96v**2 + 36 Let w(b)	{ "pile_set_name": "DM Mathematics" }
here in 3/40 of a litre? 75 What is two fifteenths of a day in minutes? 192 How many meters are there in 40662.2mm? 40.6622 Convert 63670.54 millilitres to litres. 63.67054 How many centimeters are there in three tenths of a kilometer? 30000 How many grams are there in seven eighths of a kilogram? 875 How many nanograms are there in 6/5 of a microgram? 1200 What is 70419.72ml in litres? 70.41972 What is twenty-five quarters of a litre in millilitres? 6250 What is 7/3 of a millennium in months? 28000 What is 3/5 of a centimeter in millimeters? 6 How many seconds are there in thirty-two fifths of a hour? 23040 How many weeks are there in 1106.671167 seconds? 0.0018298134375 What is twenty-seven quarters of a litre in millilitres? 6750 How many millilitres are there in one twentieth of a litre? 50 How many years are there in 0.9683379 millennia? 968.3379 What is eleven eighths of a microgram in nanograms? 1375 What is 154.6941um in centimeters? 0.01546941 How many centimeters are there in 2224.777 nanometers? 0.0002224777 What is 7/6 of a week in hours? 196 What is 3/8 of a litre in millilitres? 375 How many millilitres are there in 7/2 of a litre? 3500 What is 8/3 of a week in hours? 448 How many millilitres are there in 96976.45 litres? 96976450 What is 33/5 of a meter in millimeters? 6600 How many litres are there in 67185.98ml? 67.18598 How many kilograms are there in 0.8666929ng? 0.0000000000008666929 What is 685.5851mm in micrometers? 685585.1 How many months are there in 5/4 of a millennium? 15000 How many kilometers are there in 1.222241um? 0.000000001222241 What is 4/15 of a decade in months? 32 Convert 0.3676421 micrograms to tonnes. 0.0000000000003676421 Convert 71.87939ng to milligrams. 0.00007187939 Convert 7.679038 micrograms to kilograms. 0.000000007679038 Convert 0.968522 millilitres to litres. 0.000968522 How many nanometers are there in 11/4 of a micrometer? 2750 Convert 0.5918647 litres to millilitres. 591.8647 What is one tenth of a centimeter in millimeters? 1 What is 655.0223 milligrams in nanograms? 655022300 How many kilometers are there in 39.05839 meters? 0.03905839 How many kilograms are there in 3/50 of a tonne? 60 How many meters are there in 4.22999mm? 0.00422999 What is thirty-seven fifths of a meter in millimeters? 7400 What is three eighths of a microgram in nanograms? 375 How many minutes are there in 5/6 of a week? 8400 Convert 53494.91 millilitres to litres. 53.49491 How many months are there in 3/8 of a century? 450 How many litres are there in 9.57087ml? 0.00957087 What is one ninth of a day in minutes? 160 Convert 0.9035175 milliseconds to minutes. 0.000015058625 What is 32147.9l in millilitres? 32147900 How many micrometers are there in 3/5 of a millimeter? 600 How many millilitres are there in fourty-five halves of a litre? 22500 What is 17/2 of a micrometer in nanometers? 8500 How many kilograms are there in 632.9204 micrograms? 0.0000006329204 How many millilitres are there in five quarters of a litre? 1250 How many minutes are there in 8/7 of a week? 11520 What is 17/2 of a microgram in nanograms? 8500 What is 7/2 of a millennium in years? 3500 What is 31837012.2 microseconds in weeks? 0.0000526405625 What is 21/4 of a litre in millilitres? 5250 Convert 512.8964 weeks to minutes. 5169995.712 What is 156586.8cm in meters? 1565.868 Convert 0.968017m to micrometers. 968017 What is 45/4 of a litre in millilitres? 11250 How many minutes are there in eleven quarters of a day? 3960 What is 97.41289l in millilitres? 97412.89 What is 74/5 of a litre in millilitres? 14800 What is five quarters of a century in years? 125 What is 3/40 of a milligram in nanograms? 75000 Convert 247802.8ml to litres. 247.8028 What is 8/25 of a meter in millimeters? 320 How many seconds are there in five sixths of a minute? 50 What is 31/2 of a decade in years? 155 What is 2289.669 weeks in days? 16027.683 What is 3/5 of a millimeter in micrometers? 600 What is thirteen fifths of a micrometer in nanometers? 2600 Convert 628182.2 micrometers to kilometers. 0.0006281822 Convert 6698.788 millennia to years. 6698788 How many nanoseconds are there in fourty-two fifths of a microsecond? 8400 How many months are there in 19/4 of a millennium? 57000 Convert 957.4486kg to milligrams. 957448600 Convert 650.06km to centimeters. 65006000 What is 24.80741 grams in milligrams? 24807.41 Convert 35.94548 micrometers to millimeters. 0.03594548 How many centimeters are there in twenty-seven fifths of a meter? 540 Convert 0.6566127ug to kilograms. 0.0000000006566127 How many micrograms are there in 99.45229 tonnes? 99452290000000 Convert 0.3064468ml to litres. 0.0003064468 How many nanograms are there in 678.6789 kilograms? 678678900000000 What is 3/40 of a milligram in nanograms? 75000 What is 29424.9186s in weeks? 0.0486523125 How many grams are there in 21/8 of a kilogram? 2625 What is 3/25 of a litre in millilitres? 120 How many millilitres are there in 3/5 of a litre? 600 What is 72061.94 millimeters in micrometers? 72061940 How many micrometers are there in 6/25 of a millimeter? 240 How many years are there in 242.7726 decades? 2427.726 How many millimeters are there in 6/5 of a meter? 1200 How many years are there in 9.610342 millennia? 9610.342 How many milliseconds are there in 0.7898236 seconds? 789.8236 What is 3.948246 nanoseconds in seconds? 0.000000003948246 What is fourty-five halves of a millimeter in micrometers? 22500 How many centimeters are there in 86106.35nm? 0.008610635 What is 4.781245 microseconds in milliseconds? 0.004781245 How many micrometers are there in three tenths of a centimeter? 3000 What is 32.38842 decades in millennia? 0.3238842 What is one sixth of a day in hours? 4 What is 6/5 of a centimeter in micrometers? 12000 Convert 4.354692l to millilitres. 4354.692 How many nanometers are there in one sixteenth of a millimeter? 62500 How many decades are there in twenty-nine fifths of a millennium? 580 How many months are there in 27887.77 decades? 3346532.4 What is thirty-three fifths of a decade in years? 66 What is 1/20 of a millennium in months? 600 Convert 0.7103681 decades to months. 85.244172 How many weeks are there in 2831.38884 minutes? 0.28089175 What is 83.87049 years in centuries? 0.8387049 How many millilitres are there in three fifths of a litre? 600 Convert 11.96075g to tonnes. 0.00001196075 Convert 0.1339951 millennia to decades. 13.39951 What is seven halves of a litre in millilitres? 3500 What is 5/4 of a meter in millimeters? 1250 How many nanograms are there in 17/2 of a microgram? 8500 How many decades are there in 0.9244001 years? 0.09244001 Convert 1.281936 months to decades. 0.0106828 What is 32722.44 centuries in years? 3272244 How many millilitres are there in 29/5 of a litre? 5800 What is 2/125 of a micrometer in nanometers? 16 How many seconds are there in 7456.582ms? 7.456582 Convert 721.4612ml to litres. 0.7214612 Convert 85671.07 micrograms to nanograms. 85671070 Convert 0.1315501km to centimeters. 13155.01 What is 166293.5 meters in centimeters? 16629350 Convert 30927.39 nanoseconds to minutes. 0.0000005154565 How many litres are there in 37.60304ml? 0.03760304 Convert 13.117788s to minutes. 0.2186298 How many microseconds are there in five eighths of a millisecond? 625 How many microseconds are there in 0.53552 weeks? 323882496000 What is fourty-one halves of a micrometer in nanometers? 20500 What is 14.388729 minutes in hours? 0.23981215 How many millilitres are there in 5/8 of a litre? 625 What is 1.3285656 months in years? 0.1107138 How many litres are there in 0.81419 millilitres? 0.00081419 Convert 24.5139kg to micrograms. 24513900000 How many millilitres are there in 21/4 of a litre? 5250 How many meters are there in 11.73842 centimeters? 0.1173842 Convert 7.870197 milligrams to micrograms. 7870.197 What is 12/7 of a week in days? 12 How many millilitres are there in 56104.53l? 56104530 What is twenty-nine sixths of a day in hours? 116 What is 5134.098km in centimeters? 513409800 How many centimeters are there in 11218.29nm? 0.001121829 How many months are there in 11/4 of a century? 3300 What is 1/5 of a tonne in kilograms? 200 How many months are there in 1/4 of a year? 3 What	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.