Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
s2 - s Collect the terms in -2 - 12z*3 + 2 + 16z*3. 4z*3 Collect the terms in -141x*3 + 288x*3 - 146x3. x3 Collect the terms in -40x3 + 12x*3 + 17x*3 + 20x*3. 9x*3 Collect the terms in 26k*2 - 21k*2 + 37k*2 + 24k*2. 66k*2 Collect the terms in 10j*3 + 9j*3 - 4j*3 + 17j*3. 32j*3 Collect the terms in -9m + 123800 - 123800. -9m Collect the terms in -14n - 13n + 22n. -5n Collect the terms in -61m - 57m - 3 - 61m - 3 + 183m. 4m - 6 Collect the terms in 7b2 - 22b - 15b2 + 5b*2. -3b*2 - 22b Collect the terms in 2g3 - g3 - 6g*3 + 0g*3. -5g*3 Collect the terms in -4q*2 + 2q + 2q + 8q. -4q2 + 12q Collect the terms in -19b - 3 + 5 - 2. -19b Collect the terms in 50v + 54v + 50v - 153v. v Collect the terms in 22y + 3y - 25y - 28y*2. -28y*2 Collect the terms in 3w + 5w - 10w - w. -3w Collect the terms in 4m*3 - 4m + 3m + 0m - 5m3. -m3 - m Collect the terms in 3v - 1 + 0v - 5v - 2v. -4v - 1 Collect the terms in -8c3 + 11c*3 - 11c*3 + 2c*3. -6c*3 Collect the terms in -4n*2 - 30n*3 + 2n*2 - 14n*3. -44n*3 - 2n*2 Collect the terms in 3 + 3l - 31 - 14 - l. 2l - 42 Collect the terms in -4g - 72 + 83 - 14. -4g - 3 Collect the terms in -6b*2 - 10b*2 + 26b*2 - 4b*2. 6b*2 Collect the terms in 6 + 23l - 41l - 30l - 4. -48l + 2 Collect the terms in -4261l*2 + 8514l*2 - 4261l*2. -8l*2 Collect the terms in 3g - g*2 - 921g*2 - 3g. -922g2 Collect the terms in -23c*2 + 572 - 1145 + 573 + 25c*2. 2c*2 Collect the terms in 3 + 2r + 11r + 1. 13r + 4 Collect the terms in 2169 - 2k - 2169. -2k Collect the terms in 3c + 14c*2 - 3c - 26c2. -12c*2 Collect the terms in 51j*2 - 17j*2 - 12j*2 - 11j*2 - 12j2. -j2 Collect the terms in 76p - 614p*2 - 76p. -614p2 Collect the terms in 2q*2 - 2q*2 + 158q*3. 158q*3 Collect the terms in 6r*2 - 2412 + 2412. 6r*2 Collect the terms in 24l - 5l - 17l. 2l Collect the terms in 5 - 4 + 67z - 69z. -2z + 1 Collect the terms in -11d - 12d - 7d2 + 23d. -7d2 Collect the terms in -479158 + 479158 + 5o2 - o2 - 2o2. 2o*2 Collect the terms in -406c*2 + 3c + 417c2 - 3c. 11c2 Collect the terms in -6m2 + m2 + 3m2. -2m*2 Collect the terms in 1 + 3q - 3q + 15q*2. 15q*2 + 1 Collect the terms in -12f*3 - 6f + 4f + 2f. -12f3 Collect the terms in 5s*2 - 3s2 + s2 + 0s2. 3s*2 Collect the terms in 529j - 529j - 38j*2. -38j*2 Collect the terms in -119y*3 - 116y*3 + 213y*3. -22y*3 Collect the terms in 3h*2 + 5h*2 + 10 + 3h*2. 11h*2 + 10 Collect the terms in 2w*3 + 189w - 189w. 2w*3 Collect the terms in 14947 + 2g*2 - 14947. 2g*2 Collect the terms in -237j*3 + 77j*3 + 80j*3 + 82j*3. 2j*3 Collect the terms in 59g - 30g + 2g*2 - 29g. 2g2 Collect the terms in 0 - 646y*3 - 14y*3 + 0. -660y*3 Collect the terms in 223n*2 + 225n*2 + 213n*2 - 660n2. n2 Collect the terms in -2x + x2 + 0x*2 - 11x. x*2 - 13x Collect the terms in 626p3 - 1261p*3 + 623p*3. -12p*3 Collect the terms in 0t + 109t3 + 0t + 23t3. 132t*3 Collect the terms in -6n2 - n2 + 25n2 - 12n*2 - 10n*2. -4n*2 Collect the terms in 53u*2 - 37u*2 + 2 - 2. 16u*2 Collect the terms in 67 + 64 + 60 + 14g*3 - 191. 14g*3 Collect the terms in 10p - 2p3 - 10p. -2p3 Collect the terms in -26236 - d + 26236. -d Collect the terms in 0n - 220n3 + 71n*3 + 0n. -149n3 Collect the terms in 24 - 24 - 8f*2 - 2f*2. -10f*2 Collect the terms in -259i + 91i - 228i. -396i Collect the terms in -5s2 + s3 + 4s2 + s2. s3 Collect the terms in -2 + 53q*2 + q + 12 - 10. 53q*2 + q Collect the terms in -2g*2 - 5 + 5 - 8g*2 + 3g*3. 3g*3 - 10g*2 Collect the terms in 26 - 63 - 2p + 37. -2p Collect the terms in -289k + 4k2 - 4k*2 - 5k*2 + 283k. -5k2 - 6k Collect the terms in -8 + 9n + 8. 9n Collect the terms in 1186c2 + 1188c*2 + 1195c*2 - 3570c2. -c2 Collect the terms in -4n2 - 2n*2 - 2n*2. -8n*2 Collect the terms in 7y - 3y - 14y2 + y2. -13y2 + 4y Collect the terms in 2277 + 2q - 2277. 2q Collect the terms in -14 + 8i - 13 + 27. 8i Collect the terms in -4983v2 + 4983v*2 - 3v*3. -3v*3 Collect the terms in -1421g + 710g + 708g. -3g Collect the terms in 2379f*3 - 790f*3 - 793f*3 - 795f3. f3 Collect the terms in 92c3 + 2 - 2 - 72c*3. 20c*3 Collect the terms in 1168u*2 - 635u*2 - 319u*2 + 2724u*2. 2938u*2 Collect the terms in 33p*3 - 17p*3 - 20p*3. -4p*3 Collect the terms in -5f - 4f + 5f - 3f. -7f Collect the terms in -4o2 + o3 - 26 + o3 + 4o*2. 2o*3 - 26 Collect the terms in 35j2 + j2 - 7j2. 29j*2 Collect the terms in 8p - 293 + 295 + 11p + 10p. 29p + 2 Collect the terms in -44 - 2p + 75 + 53. -2p + 84 Collect the terms in 14v*2 + 27281 - 27281. 14v*2 Collect the terms in -3y + 30 - y + 67 + 3y. -y + 97 Collect the terms in 3 + 5 + 7l*3 - 8. 7l*3 Collect the terms in -2b*3 + 3 + 2 + 4. -2b*3 + 9 Collect the terms in 243s + 2 - 2 + 201s - 447s. -3s Collect the terms in -6m + 20m - 4m + 5m - 14m. m Collect the terms in 22 - 3z - 54 + 32. -3z Collect the terms in -591g - 667g + 1258g - 2g*2. -2g*2 Collect the terms in -24u*2 + 38u*2 + 19u*2. 33u*2 Collect the terms in -284b - b*2 + 0b*2 + 589b - 305b. -b2 Collect the terms in 0h*3 + 2h*3 - 2h*3 - 7h*3. -7h*3 Collect the terms in 1 + 1483j + 4 - 5. 1483j Collect the terms in -2g*2 + 190 - 190. -2g*2 Collect the terms in 2844b*3 - 314b*3 + 368b*3. 2898b*3 Collect the terms in 646r*3 - 302r*3 - 341r*3. 3r*3 Collect the terms in 36g + 11g - 44g. 3g Collect the terms in 3d - 106 + 246 - 140. 3d Collect the terms in -5v + v + 31 - 31. -4v Collect the terms in 40b + 30b + 7b - 6b. 71b Collect the terms in 25i + 19i - 14i2 - 60i + 16i. -14i*2 Collect the terms in -m + 36m - 13m - 20m. 2m Collect the terms in 13z*2 - 2z*2 + 17z*2 - 25z*2. 3z2 Collect the terms in -177 + 189 + i2 + 0i2. i2 + 12 Collect the terms in -15p*2 + 11p - 30p2 - 11p. -45p2 Collect the terms in 2h + 58 - 2h + 2h. 2h + 58 Collect the terms in -3950 + 3n + 1972 + 1978 - 10n. -7n Collect the terms in -4n - 10n - 38 + 40. -14n + 2 Collect the terms in -743o*3 - 119o + 119o + 61o*3. -682o*3 Collect the terms in 1326r*3 + 3r - 2643r3 + 1319r*3 - 3r. 2r3 Collect the terms in -30i + 30i - 44i*2. -44i*2 Collect the terms in -71q + 216q - 71q - 75q. -q Collect the terms in -38l*3 + 39l3 + 80 - 80. l3 Collect the terms in 422h + 411h - 837h. -4h Collect the terms in 18p3 + 4p + 12p3 - 36p*3. -6p*3 + 4p Collect the terms in -2716q2 + 916q*2 - 573q*2. -2373q*2 Collect the terms in 1888i*2 - 1888i*2 - 11i*3. -11i*3 Collect the terms in -24l*2 - 11l*2 - 9l*2 - 8l*2. -52l*2 Collect the terms in 409h - 1 + 1 - 397h. 12h Collect the terms in -18r - 9r - 2r. -29r Collect the terms in 13j + 3j - 4j + 19j. 31j Collect the terms in 2700a - 1346a - 1357a. -3a Collect the terms in 113445d - 3d2 - 113445d. -3d2 Collect the terms in -6q*2 + 296791 - 296791. -6q*2 Collect the terms in 1 + 2v - 4 + 3. 2v Collect the terms in 3 + 4m*3 + 4m*3 + 2. 8m*3 + 5 Collect the terms in -2487h + 2487h + 13h*2. 13h*2 Collect the terms in -70r*3 + 0r + 0r + 61r*3. -9r*3 Collect the terms in 0k + 13k2 + 4k - 4k. 13k*2 Collect the terms in -16r*3 + 4 - 22r*3 + 36r*3. -2r*3 + 4 Collect the terms in -5 + 2b*2 - 24 - 4. 2b*2 - 33 Collect the terms in 0 - 218t*2 + 0. -218t*2 Collect the terms in 0f*3 + 7f*3 - 12f*3. -5f*3 Collect the terms in 56z*3 + 3 + 0 - 3. 56z*3 Collect the terms in 7g - 4g - 7g. -4g Collect the terms in -22o*3 + 33o*3 + 13o*3. 24o*3 Collect the terms in 5h*2 - 6538h + 6538h. 5h*2 Collect the terms in 79 - 79 - 2o + 5o. 3o Collect the terms in -41 +	{ "pile_set_name": "DM Mathematics" }
to 4 in -43/2878, 1/8, 0.1? 1/8 Which is the closest to -5? (a) -2/7 (b) 4 (c) 5/2 (d) -1 (e) 430 d What is the closest to -1 in -1/2, 128, 11? -1/2 Which is the nearest to 1/139737? (a) 3/7 (b) 2/19 (c) 3 b Which is the closest to -0.1? (a) -13 (b) 1/14 (c) -2/9 (d) 31 (e) -2 c Which is the nearest to 0.2? (a) 0.06 (b) -6 (c) -27.4 (d) 24 a What is the closest to 3 in -167, -0.5, -4, 0.5? 0.5 What is the closest to 4/5 in 0, 0.4, 64/43, -2/3? 0.4 Which is the nearest to 0.9? (a) -168 (b) -2 (c) -6 (d) 3 d Which is the closest to 2? (a) -5 (b) -0.012 (c) -415 b Which is the closest to -7? (a) 9 (b) -21 (c) -0.04 (d) 1/6 c Which is the closest to -0.1? (a) 2 (b) -5 (c) -3/2 (d) 1.41 c Which is the closest to -0.1? (a) 3 (b) -2/11 (c) 250779 b Which is the closest to -4.3? (a) -0.3 (b) -1/9 (c) -4/3 (d) -1/3 (e) -1.8 e Which is the closest to -2? (a) 7 (b) -26 (c) 0 (d) -15/7 d What is the nearest to -1 in 0.12, -2/5, 5, 0, -0.1? -2/5 Which is the nearest to 1? (a) 210 (b) -0.05 (c) 30 b What is the nearest to -2/5 in 48.6, -0.063, -5, 2? -0.063 What is the nearest to 1/18 in 0, -0.1, 5? 0 What is the closest to -0.2 in 1, -1/3, -4, -2, 0.51? -1/3 Which is the closest to -6/65? (a) 1 (b) -0.5 (c) 122 b What is the nearest to 3 in 2, -4, -1, 6887, -2/9? 2 What is the closest to -0.02 in 1, -4, -2/27, 1/4, -1/8? -2/27 What is the nearest to 0 in -38, -1, 3.1? -1 What is the closest to -1/2 in -7, -1/2, -10/3, 0.12, 2? -1/2 What is the closest to 1 in 11, 0.1, -0.7, 4, 21/4? 0.1 Which is the closest to 0.3? (a) 3 (b) 1 (c) 2 (d) 15.9 (e) -4 b What is the nearest to -0.85 in -0.4, 1/34, 17, -3, -4? -0.4 Which is the closest to 2/7? (a) -4 (b) -2/2429 (c) -27/7 b Which is the nearest to -2/9? (a) 13 (b) -1/4 (c) 0.18 b Which is the closest to -1/4? (a) 3/2 (b) 0.4 (c) 124188 b What is the nearest to 0 in -0.086, -0.9, 1/9, 0, 9/4? 0 Which is the nearest to -4? (a) 1/5 (b) 516 (c) 3 (d) -3 d What is the nearest to 3 in -4, 78, 2/7, -3/2, 7.4? 2/7 Which is the nearest to -5/6? (a) 2/11 (b) 3/7 (c) 4 (d) -1.8 d What is the nearest to 1.6 in 4/9, -4/7, 1, 13? 1 Which is the nearest to 0.3? (a) -24105 (b) 4 (c) -1 c Which is the closest to -0.9? (a) 0.4 (b) 0.2 (c) -29 (d) 1 (e) 0.3 b Which is the closest to -2.1? (a) -2 (b) 11/3 (c) -3 (d) -4 (e) 43 a Which is the nearest to -1.39? (a) 5/3 (b) 0.9 (c) -0.4 (d) 0.3 c Which is the nearest to -0.17? (a) -8 (b) -9 (c) -1/6 (d) -1 (e) -5/4 c Which is the nearest to -0.1? (a) 0.5 (b) 0.079 (c) 5/4 (d) -3 (e) -4.56 b What is the closest to 0 in -3, -0.04, 1, 25, 2/13? -0.04 What is the nearest to 1086 in -0.4, -5, 12, 4? 12 Which is the nearest to 1? (a) -0.3 (b) 23 (c) 0.2 (d) 31 (e) -3 c Which is the nearest to 1? (a) 0.2 (b) 0.1 (c) 5 (d) 1928 a What is the nearest to 0 in -0.89, -1/3, 4/3, 0, 5? 0 What is the nearest to 18 in -2/15, 1.02, -1? 1.02 Which is the nearest to -0.1? (a) 1/7 (b) 2 (c) 110 (d) -86 a What is the closest to 0.5 in 2465, -2, -6? -2 Which is the closest to 0.2? (a) 5 (b) -6597 (c) 1 c Which is the nearest to -1? (a) 0.9 (b) 4/17 (c) 1 b What is the closest to 4 in 4/7, -3/5, -2, 1/10? 4/7 What is the closest to 0.2 in 4/79, -0.1, 2/3? 4/79 What is the nearest to 4955 in -3, 1, -1? 1 Which is the closest to -1? (a) -5 (b) 0.0701 (c) 0 (d) -0.02 d Which is the nearest to -1? (a) 1/6 (b) -0.3 (c) 3 (d) 0 (e) -504 b What is the nearest to 23 in 0, 0.04, -0.5, -0.4, 6/19? 6/19 What is the closest to 2/23 in 0, 3, -20, -1? 0 Which is the nearest to 1/3? (a) -1.598 (b) 0 (c) -0.2 b What is the nearest to -18 in 40, 2/13, -3, 11? -3 Which is the nearest to -0.6? (a) 54/11 (b) -2 (c) -4 b What is the nearest to -6 in 0.9, 1/6, 1/3, -0.3, 20? -0.3 Which is the closest to 0? (a) -57 (b) 38 (c) 3 c Which is the nearest to 1/5? (a) 2/17 (b) 0.5 (c) 1.8 (d) 4/9 a Which is the closest to -0.1? (a) 1 (b) 4/2081 (c) -5 b Which is the closest to -24? (a) 22 (b) 2/13 (c) -0.3 (d) -4 d Which is the closest to -476? (a) -3 (b) 0.4 (c) 288 a Which is the closest to -2? (a) -44421 (b) -0.4 (c) 3 (d) 0.6 b Which is the nearest to -3/65? (a) -4 (b) -0.4 (c) -0.5 (d) 2 (e) 38 b What is the nearest to 0.13 in -65, 1, -5? 1 What is the closest to -8 in -0.2, 11, -0.1, 16, -3/5? -3/5 What is the closest to -59 in 14822, 1/4, 5? 1/4 What is the nearest to 46 in 84, -3, 0.3, 5/3, 0? 84 Which is the closest to 0.1? (a) -5 (b) 0 (c) -15247 (d) -3 b Which is the closest to -2/15? (a) -7/6 (b) -0.2 (c) -4 (d) -3/29 d Which is the closest to 3? (a) -2 (b) 970 (c) -1 (d) 5 d What is the closest to -508 in -0.5, -2/179, -1/7? -0.5 What is the nearest to -0.06 in 4/3, 2.96, 2/9? 2/9 What is the nearest to -2/511 in -15, -1/9, -1/7? -1/9 What is the closest to 27 in 1/3, -1.6, 1/12, 6? 6 What is the closest to 10 in -0.5, 2, 0.1, -1/6? 2 What is the closest to 2 in 2.06, -1/3, -0.11? 2.06 Which is the closest to 5? (a) 2 (b) -3/8 (c) 7 (d) -2/15 (e) 1/11 c Which is the nearest to 3/4? (a) 0.5 (b) -3794 (c) -5 (d) -1 (e) -3/2 a Which is the nearest to 7? (a) -3/5 (b) 5 (c) -69 (d) -0.4 b Which is the nearest to 0? (a) 4084 (b) 0.4 (c) -2/7 (d) 16 c Which is the closest to -305? (a) 5 (b) -1 (c) -0.3 (d) -71 d What is the closest to 9 in 0.1, -1.08, 20? 0.1 What is the closest to 0 in -28690, 1/6, -0.1, -0.4? -0.1 What is the closest to 0.2 in 48/19, 1, -4, 5? 1 What is the closest to 2/7 in -3/7, -2/7, -0.91, -0.1, -5? -0.1 Which is the closest to -0.04? (a) -1/2 (b) -4 (c) 5 (d) 3 (e) -2 a What is the closest to 0 in -1790, -4/5, 5, 0.3, -1/2? 0.3 What is the nearest to -12 in -2, 0, 607? -2 What is the closest to -2 in -4/79, -5/2, -3/8? -5/2 What is the closest to 1 in -272, 2, 11/5, 3, 1/8? 1/8 Which is the closest to -18? (a) -1 (b) 3 (c) -3/2 (d) 21 c Which is the nearest to 0.1? (a) 5 (b) 2.2 (c) 508 b Which is the nearest to 2/13? (a) 1/7 (b) 0.09 (c) -3 (d) 0.4 (e) -2/9 a What is the closest to 0 in -4574, -1, 3, -5? -1 Which is the nearest to 1? (a) -0.13 (b) -6 (c) -2 (d) -132 a Which is the nearest to 0.03? (a) -27 (b) -4/7 (c) -5 (d) -1/5 d What is the nearest to 2 in 6, 2/9, 1/6, -1.4? 2/9 What is the nearest to -1 in -1, -1/4, 0, 43? -1 What is the closest to 1/3 in -4, 0, 682, -1? 0 Which is the closest to 1? (a) -12 (b) 16 (c) 1.71 c What is the closest to 0 in -7, 105, -0.1? -0.1 Which is the closest to 0.4324? (a) -5 (b) 4/7 (c) 4 (d) 1 b What is the nearest to 0.7 in 0, 13, -2/5, 6? 0 What is the closest to 1 in -3, 2, -773, -80? 2 What is the closest to 196 in -4, 1, 1.2, -1? 1.2 Which is the closest to 1/3? (a) -0.4 (b) 4 (c) -0.3 (d) 3.2 c Which is the nearest to 2/7? (a) -3/2 (b) 27 (c) -2/3 (d) 2 c What is the nearest to 1 in -4/7, -4, -86934? -4/7 Which is the nearest to -0.1? (a) -117716 (b) -5 (c) 5 b Which is the nearest to 0.01? (a) -1/6 (b) -9 (c) -0.057 (d) 5 (e) 2 c What is the closest to -11 in 9, -0.15, -0.5, 0.35? -0.5 What is the nearest to -3/4 in -0.5, 8, 0.5, -149/2? -0.5 What is the closest to -1.9 in 13, 0.9, -1, 5? -1 Which is the nearest to 2/3? (a) -0.03 (b) 117.8 (c) -0.2 a What is the nearest to 1/3 in -0.2, 4, 4182? -0.2 What is the closest to 0 in -2408, -0.17, 20? -0.17 Which is the nearest to -1/4? (a) -1/43 (b) 15 (c) 1 (d) -2/9 d Which is the closest to -65? (a) 0 (b) 13 (c) -14 (d) 0.5 c Which is the nearest to 1480? (a) -1 (b) -4 (c) -2/467 c Which is the closest to -99/5? (a) -5 (b) 0.05 (c) -3 a What is the closest to -0.1 in -0.3, 0.4, -0.414, 0.8, -0.04? -0.04 What is the closest to 6 in -2, 35, 23? -2 What is the closest to 61/13 in 3, 0.5, -5/2, 1, -3/4? 3 What is the closest to 2 in -5, 2473, 0.45? 0.45 Which is the nearest to -6.97? (a) -2/11 (b) 17 (c) 1/4 (d) 0 a What is the closest to 4 in -1/5, 0.3, -13, 13.6? 0.3 What is the closest to -2/7 in -3690/107, 1/2, -5? 1/2 What is the closest to -0.1 in 17/70, -1, -0.4? -0.4 What is the nearest to -25/3 in 9/10, 12, 3/13? 3/13 Which is the nearest to -2? (a) -1 (b) -37.02 (c) 0.1 (d) -0.3 a What is the nearest to -1/244 in -4, -14, -1/8, -0.1? -0.1	{ "pile_set_name": "DM Mathematics" }
o be (45/r)/(1 + 0). Suppose 5j - 4y + 20 = y, 5y = o. Are 0 and j nonequal? True Let a = 2260 + -2260. Which is smaller: a or -2/3161? -2/3161 Let a be (6/18)/(1/3). Let h be a((-9)/3 - -5). Suppose 6 + 6 = -hv. Are v and -6 equal? True Suppose -20 = 15q - 19q. Let f be q + 0 - (-4 + 41). Is f greater than or equal to -32? True Let l = -135 + 116. Let y = -38 + 22. Let j = y - l. Is j < 2/3? False Let g = -2 - -5. Suppose 0x = gx. Let m be (-15)/10 - (-51)/24. Which is smaller: m or x? x Let q(k) = k2 + 2k - 20. Let v be q(-6). Suppose -4u + 15 = 3j - vj, j + u = 5. Let c = 31/10 + -151/50. Is c at least j? False Let a be 1349/19(-2 + 1). Which is greater: a or 2/3? 2/3 Let c(k) = 7k - 36. Let s be c(6). Let r be 894/(-45) - 2/s. Which is smaller: -20 or r? r Let v = -6587/44 - -601/4. Suppose 0 = -k + 2, -4g + 17 - 1 = 4k. Which is smaller: g or v? v Suppose -t + 4a = -3, -3t - 2t + 3a = -15. Let c = -709 + 714. Is c smaller than t? False Let g = -189 - -192.33. Let b = g - 0.33. Which is greater: b or 5? 5 Let b(a) = 3a + 43. Let t be b(-13). Suppose 3h + 5v - 3 = 2, -4h - t = -4v. Does 2/365 = h? False Let b be ((-270)/75)/(7/5)7. Let f be -12b/114 + -2. Which is smaller: 0 or f? f Let k be 2(40/10 - (3 + -1)). Let w = -2/81 + 218/81. Is k greater than or equal to w? True Suppose -3c = 2 - 20. Let b be (-16)/c15/(-10). Suppose -f + 4f = 15. Which is bigger: f or b? f Let a be (-116 + 446)(18/5)/(-3). Is a bigger than -394? False Let p = -93 + -48. Which is smaller: -140 or p? p Suppose -2p = -2y - 494, 47p - 42p = -4y - 988. Is y smaller than -246? True Let p = 1191869/321 + -3713. Are p and 0 non-equal? True Suppose 0 = -5l - 2o + 3, -3l + l - o = -1. Let v be l2/(-16)63/(-84). Which is smaller: v or 0? 0 Let w = 19 - 13. Let i = 7 - w. Let x = -219 + 2421/11. Which is bigger: i or x? x Let a(i) = i3 - 3i*2 - 2i - 1. Let m be a(3). Let w be (1/m)/(9/(-63)). Let p(o) = 4o2 - 1. Let y be p(w). Is y greater than 3? False Let a = -2/1113 + 13378/12243. Is 1 greater than a? False Let a = -2/365 + 77/730. Let g = 279 - 280. Is g not equal to a? True Let t(c) = -c + 20. Let k(u) = 1. Let l(n) = 3k(n) + t(n). Let v be l(11). Let x = 18 - v. Which is smaller: x or 5? 5 Let h = 5 + -9. Let b be (-1)/h + 78/(-280). Let c = b - -43/280. Which is bigger: c or -1? c Let j = -7317/53 - -138. Let s(g) = g*2 - 2g - 2. Let l be s(3). Is l at least as big as j? True Let z be (2/46)/((-18)/(-18)). Which is greater: z or 1? 1 Let r = -196 - -133. Let c = r - -60. Which is greater: c or -12/7? -12/7 Let j be 2/(-5) - ((-654)/10 + 4). Is 62 greater than j? True Let w = -300.066 + 0.066. Which is smaller: w or -1? w Suppose -11y + 16 = -12y - 3z, 5z + 24 = y. Is y smaller than 1563? True Let j(m) = 5m - 9. Let y be j(4). Let x(d) = d3 - 11d*2 + 4d - 15. Let o be x(y). Is 1 bigger than o? False Let d = 1240 - 1734. Which is smaller: d or -495? -495 Let i = -334 - -201. Is i equal to -132? False Let o = -4596.052 + 4583. Let s = o + 0.052. Is s not equal to 0? True Let b(w) = w + 4. Let x be b(-4). Let n be (-5)/(-160)3/6. Which is smaller: n or x? x Let x be ((-3)/6)/(3/(-222)). Let i = 38 - x. Which is bigger: 3/4 or i? i Let l(b) = b2 + 19b + 56. Let y be l(-5). Let p be 5-162/(-10). Let k be (-71)/36 + p + y. Are k and -1 nonequal? True Suppose -6c + 369 = -3c. Let w = c - 71. Suppose 13 = 2h - q, -5h = q + 3q - w. Do 7 and h have different values? True Let a(k) = -105k + 144. Let u be a(16). Is -1535 at least u? True Let y(w) = -w*3 + 3w*2 - 5w + 4. Let q be y(3). Suppose -24 = -3z, 2h = -20z + 15z + 20. Is q less than or equal to h? True Let u be (2/(-3))/(38/(-57)). Let w be (22/6 - u/(-3))/2. Which is smaller: 10/11 or w? 10/11 Let f = -27 - -42. Let l be (6/f)/((-2)/10). Suppose 4m + 19 = 3o, m - 13 = 5m + 3o. Which is greater: l or m? l Suppose -y = 54 - 14. Let a = -39 - y. Which is smaller: a or -8? -8 Suppose j = 4j - 15. Suppose -l + jl = -20. Is l smaller than -5? False Let v = -486 - -27698/57. Suppose s - 2w - 7 = 0, 7w = -2s + 10w + 10. Is s greater than or equal to v? False Let g be ((0 + 0)/1)/2. Which is greater: g or 20/47? 20/47 Suppose -b + 5 = 2. Let k be b/2(-8)/12. Let w be (12 - 4) + (-1235)/133. Which is smaller: k or w? w Let k(v) = -v2 - 9v - 7. Let i be k(-8). Suppose -9g = -8g + i. Let w be (3/(-30))/((-3)/12). Which is bigger: w or g? w Let f = 229/55 + -48/11. Let s be 69/2 - (-4)/8. Suppose 0 = -si + 38i - 3. Is f greater than i? False Let k = -0.42 + -63.58. Let f = k + 63.9. Which is greater: 13 or f? 13 Let w(a) = -4a - 11. Let b be w(-4). Suppose -4p - 4 = v, 2p - b = -3v + 3. Is p greater than 0.1? False Let l = 3605 - 10463/3. Are l and 118 equal? False Let a = 4/63 + -205/252. Let o = 10 - 7. Suppose 0 = ob + b. Which is bigger: b or a? b Suppose -2i = 4x + 68, -18x + 23x = -3i - 103. Which is smaller: -38 or i? -38 Let q be (-1 - (-4)/6)/(4/(-24)). Suppose 0 = f - 2n + n + 6, f - 9 = -qn. Which is bigger: -9/11 or f? -9/11 Suppose 4m + 736 = -3j, m + 5j + 165 = -36. Which is greater: -182 or m? m Let v = 13283 + -29873469/2249. Which is smaller: v or -1? -1 Suppose 3k - t - t - 5 = 0, 0 = 4k + t - 3. Let q be 1131/(-84) + (-2)/8. Let c = q - -14. Which is greater: k or c? k Let p(x) = 9x*2 + 14x*3 - 4 - 10x*3 - 5x*3. Let f be p(9). Let o be 1/4 + (-35)/f. Which is smaller: o or 2/3? 2/3 Let p = 0.0664 + -56.0664. Which is greater: p or 5? 5 Let a = -69 - -70. Let j be (-8 + -1)(-1 - 5). Let s be ((-1)/(-3))/((-96)/j). Is a less than or equal to s? False Let g be 314/(-5232) + 67/1608. Suppose -4n + 7n - 23 = 4s, n - 2s = 11. Which is greater: n or g? n Let z = 25 + -25.01. Let u = 0.12 - 0.04. Let i = u + 1.92. Which is greater: i or z? i Suppose -c + 2d - 5d = -68, c = 5d + 52. Suppose -h = -69 + c. Which is smaller: h or 8? h Let t(n) = -n - 6. Let s be t(-8). Suppose 6 = -5z + 2z. Let m be (-4)/4 + z/(-1). Is s at least m? True Let d be (-2 - -4)(-2)/(-4). Let g = -117 - -116.9. Which is smaller: g or d? g Let h = -101679/35 - -13872/5. Let a = -131 - h. Is a >= -8/9? True Let q = -4.9 + 5. Suppose 3i - 3 = -2c, 2i - 5i - 3 = 0. Suppose -y - 7 = 4y - cd, 0 = -2y + 5d - 18. Is y > q? True Let w be (-4)/(-22) - 44720/238095. Are w and 1 equal? False Let f = -5.2 + 5.17. Let m = f - -3.03. Is m greater than 0.06? True Let l be 0/(6/((-18)/(-15)) - 1). Is -1/154 at most as big as l? True Let f = 17.4 + -18. Let s = 1.6 + f. Which is bigger: s or 2/65? s Suppose -3z + 0 = -3. Let i(d) = 17d + 25. Let t be i(7). Let n be (-1 + 148/t)12/(-8). Which is smaller: n or z? n Let j = -4.176 - 0.024. Let t = j - -0.2. Let g = -42 + 124/3. Which is smaller: g or t? t Let r(u) = u + 8. Let c be r(-8). Is -3/20 greater than or equal to c? False Suppose -2r - 93 = -371. Let h be (-33)/44 + r/4. Let q be h/84 - 3/9. Which is smaller: q or -1? -1 Let s(b) = 3b - 3. Let d be s(4). Let m = -43/228 - 7/114. Is d less than m? False Suppose 4v + 4d = -169 - 7, -4d = -5v - 247. Are v and -54 unequal? True Let k = -266/3 - -90. Let f(s) = -7s*3 - 2s*2 + s - 1. Let p be f(2). Let l = -61 - p. Which is bigger: k or l? l Let j = -3.11 + -6.89. Let d = -4.6 + 0.6. Which is smaller: j or d? j Let u(s) = -5s*2 + 6s - 9. Let n be u(8). Let g = -396 - n. Let i = -801/7 - g. Which is greater: 1 or i? 1 Suppose 2x - 14 = -2p, 5p - 10p = -20. Which is smaller: x or 1/2? 1/2 Let v be 60/40 - (-4)/(-24)13. Which is smaller: 1393 or v? v Let j be 87/14(21/(-9) - -5). Is 18 < j? False Let k(x) = x*2 + 2x + 5. Let y be k(-5). Let c be 2/y(-644)/2. Let g = c - -32. Is g < -3? False Let k be -1 + 1-3(-819)/513. Which is smaller: 3 or k? 3 Let q(z) = 2z - 12. Suppose 0 = 2r - 0r - 16. Let p be q(r). Let b be p2/24-9. Which is greater: b or -4? b Let d = -1877 + 1875. Which is greater: 104/11 or d? 104/11 Suppose -5o = 3b - o - 396, 0 = 4b - 3o - 553. Do 136 and b have the same value? True Let i = 227 + -227. Let l = -14411/262 - -55. Which is bigger: i or l? i Suppose 0 = -16r + 22r - 72. Let m(s) = -3*s + 39. Let u be m(r). Which is bigger: 16/7 or u? u Let i be (32 + -34)/(	{ "pile_set_name": "DM Mathematics" }
= 3, -p + vg - 11 = -2p. What is the units digit of p? 2 Let h be 124/10 + 2/(-5). Let t(q) = -5q + 43. Let o be t(7). Suppose 2u - 4g + h = 6u, -o = -4u - 2g. What is the units digit of u? 1 What is the units digit of -2 - 44/(-20) - 2457/(-15)? 4 Let i = -25 + 37. Suppose -38 = -2u - 0. Let n = i + u. What is the tens digit of n? 3 Let r(s) = s - 7. Let o be r(8). Suppose -3 - o = j. What is the units digit of 82 - 1(-8)/j? 0 Let b = 8 + -25. Let t be (-28)/10170/b. Suppose t = 4m - 3m + s, 118 = 4m + 2s. What is the units digit of m? 1 Suppose -39h + 40h = 98. What is the tens digit of h? 9 Suppose m - 13 = -3k, 5m - 20 = -0. Suppose -a + 138 = 2r, kr + 2a = 6a + 229. What is the tens digit of r? 7 Suppose 2b = -2b + 104. Let l = 55 - b. What is the tens digit of l? 2 Let m = -31 + 40. Let b be (4/6)/(m/27). Suppose -3p = l + bl - 153, 5p - 264 = -2l. What is the units digit of p? 4 Let m(u) = -4u + 1. Let z be m(3). Let l(w) = w*2 - 2w + 4. Let n be l(4). Let v = n + z. What is the units digit of v? 1 Let s be (16/(-6))/((-2)/(-12)). Let w = -7 - s. What is the units digit of w? 9 Suppose 11v + 4 - 26 = 0. What is the tens digit of 2 - 2824/(-30) - v/15? 9 Suppose 4h + r = -9, -2h - 12 = -6r + 4r. What is the tens digit of (-2 - (-2 + h)) + 45? 4 Let d(f) = -f2 + 9f + 2338. What is the tens digit of d(0)? 3 Suppose 0 = 3t + 3a - 33, t - 21 = -5a + 2. Suppose 2m + t = 296. What is the tens digit of m? 4 Suppose -1029c = -1035c + 852. What is the units digit of c? 2 What is the hundreds digit of (-1812)/(-15)(20/(-8))/(-1)? 3 Let n = 21 + -7. Suppose 3s = n - 2. Suppose 0 = -sa + 201 - 9. What is the units digit of a? 8 Suppose -2n - 408 = -10. Let p = -73 - n. What is the tens digit of p? 2 Let b = 124 - 119. What is the units digit of (2102 - b) + -3? 6 Suppose 15i + 1448 = 16643. What is the tens digit of i? 1 Let i = -64 + 49. Let m(k) = k*2 + 12k + 5. What is the tens digit of m(i)? 5 What is the units digit of 919/2 - 10(-8)/(-32)? 7 Let h(q) = 23q - 68. Let n be h(10). Suppose 0 = -6r + n + 1308. What is the tens digit of r? 4 Let q = 189 - 198. Let x(b) = b - 1. Let p(i) = -7i - 1. Let v(w) = p(w) + 4x(w). What is the units digit of v(q)? 2 Let c be (-2 + 0)/60. Suppose 0 = 4l - c - 12, 2l = 4f - 818. What is the units digit of f? 6 Let m(g) = 182g - 439. What is the tens digit of m(9)? 9 Suppose 14h = -18h + 45216. What is the tens digit of h? 1 Let g(y) = 2y3 + 9y*2 + 11y - 3. Let t be g(-5). Let i = 180 + t. What is the units digit of i? 7 Let c = 0 - -3. Suppose 0 = ci - 2i + 17. Let p = -11 - i. What is the units digit of p? 6 Let l(y) = -y*3 + 18y*2 - 16y - 16. What is the units digit of l(16)? 0 What is the units digit of 5/(-1 - -26) + 3548/10? 5 Suppose 4b - 279 = 705. Let i be (b/8)/(13/(-52)). What is the tens digit of 2/4 - i/6? 2 Let h(l) = 433l + 22. What is the units digit of h(1)? 5 Let g(x) = 19x2 - 6x + 5. Let z be g(2). What is the units digit of (1 - 0/(2 - 1)) + z? 0 Let j = 2014 + 212. What is the units digit of j? 6 Let u(r) = -6r - 10. Suppose -2m + 6m = -32. What is the units digit of u(m)? 8 Let q be (-2)/(-6)162/9. Let z = 63 - 35. Suppose -5g - z = -qg. What is the units digit of g? 8 Let o = 15 + -11. Suppose t - 80 = -2z, -4t = -oz - 93 - 251. Suppose 0 = 14a - 10a - t. What is the tens digit of a? 2 Let f(c) = 25c - 142. What is the hundreds digit of f(11)? 1 Let p = 1033 + 114. What is the units digit of p? 7 Let b(m) = -9m - 106. What is the tens digit of b(-32)? 8 Let k(h) = -20h + 23. What is the tens digit of k(-7)? 6 Let q = 2493 - 1597. What is the tens digit of q? 9 Suppose -h = -2h + 5. Suppose o = -5k - 0k + 20, -3o - 40 = -hk. Suppose 3g = -2s + 24, -4s + 9s - kg = 110. What is the units digit of s? 8 What is the units digit of -120((-3)/1 - (-20)/40)? 0 Suppose 137764 = 23u + 8u. What is the units digit of u? 4 Let z(q) = -q3 + 18q*2 - 17q + 2. Let o be z(17). Suppose -5c = m - 272, -om = -5c + 2m + 262. What is the tens digit of c? 5 Suppose 3t - 427 = 122. Suppose 0 = 5v - 232 - t. What is the tens digit of v? 8 Let h(n) = 7n2 + n + 12. What is the hundreds digit of h(-8)? 4 Let s(k) = k3 - 8k*2 - k + 11. Suppose -2d + 19 - 3 = 0. Let g be s(d). Let a = 5 + g. What is the units digit of a? 8 Suppose 0 = -5r + m + 23, 0m - 12 = 4m. What is the units digit of (r - -11)/(-3)-1? 5 Let x(v) = -4v + 2. Let t be x(-4). Let q = t - -165. What is the hundreds digit of q? 1 Let n(i) = 1389i*2 - 12i - 27. What is the hundreds digit of n(-2)? 5 Suppose 0 = -53r + 73r - 38860. What is the thousands digit of r? 1 Let b(w) = 10w + 11 - 7w + 13w - 3w + 2w2. Let m(i) = i3 - 5i*2 - 4i + 12. Let x be m(5). What is the tens digit of b(x)? 3 Suppose 2t + 5 = s, t + 2t = -2s + 10. Let z = 6 + -5. Suppose 4n - sn = -z. What is the units digit of n? 1 Let v(h) be the second derivative of h5/20 + 13h*4/12 - 7h*3/6 + 4h*2 - 20h. What is the tens digit of v(-13)? 9 What is the tens digit of 1/(-5) - (-90960)/300? 0 What is the units digit of (7/(-7))/1-915? 5 Suppose 4x - 12 = 0, -124t + 126t + 4x - 718 = 0. What is the hundreds digit of t? 3 Let v(w) = w3 + 10w*2 - 12w - 19. Let g(k) = k*2 - 2k - 9. Let p be g(0). Let u be v(p). Suppose u = -7m + 12m. What is the tens digit of m? 3 What is the tens digit of (6/4)/(-3)2466/(-3)? 1 Suppose -6t + t = -25. What is the tens digit of 7/35 + 499/t? 0 Suppose -c - 16 = 19. Let f = 5 + c. What is the units digit of 2/((14/f)/(-7))? 0 Let j(v) = v - 1. Let k(w) = -w*3 - 13w*2 + 8w + 30. Let u(l) = -3j(l) - k(l). What is the units digit of u(-13)? 6 What is the hundreds digit of (-369)/(-6)(-52)/(-6)? 5 Let d(i) = -2i3 + 2i*2 + 2001. What is the thousands digit of d(0)? 2 Suppose -155 - 2038 = -5x + 4h, -4x - 3h + 1773 = 0. What is the tens digit of x? 4 Suppose -7517 = -16n + 755. What is the units digit of n? 7 Suppose -3t + 7t + 4 = 0, -3r - 3t + 984 = 0. What is the units digit of r? 9 Let h(l) = -6 + 2 + 2l + 0l. Let k be h(10). Suppose -ks + 128 = -12s. What is the tens digit of s? 3 Suppose 0 = 2f - 4f + v + 24, 0 = -2f - 5v + 12. Suppose -fg + 2816 + 572 = 0. What is the tens digit of g? 0 Let s(r) = 2r - 4. Let p(h) = -3h + 7. Let j(b) = 3p(b) + 5s(b). What is the units digit of j(1)? 2 What is the tens digit of ((-480)/(-18))/((16/(-18))/(-8))? 4 Suppose 3j + 2j - 1350 = 5u, 0 = 5j + 3u - 1390. Let l be 0 + 2 + -4 + 7. Suppose 6q - 5i - j = q, li = -25. What is the tens digit of q? 5 Suppose j = 1 - 5. Let n = j + -3. What is the tens digit of 3/1 + (2 - n)? 1 Let s = 398 + -198. Suppose -6d + 8d - s = 0. What is the tens digit of d? 0 Let b(j) = -6j + 5j + 2j + 0j - 5j*2 - 19. Let x(m) = -2m*2 - 9. Let v(u) = -4b(u) + 9x(u). What is the units digit of v(-2)? 1 Let k(m) = -m2 - 8m + 3. Let d be k(-8). Let h = -12 - -21. Suppose d = z - h. What is the units digit of z? 2 Let z be (1 - 10)(0 + 3). Let o = z - -30. Suppose -69 - 9 = -2g + 4h, 0 = -og + 5h + 118. What is the tens digit of g? 4 Let l(i) = -i2 + i - 1. Let r(c) = -7c*2 + 6c + 3. Let n(t) = 6l(t) - r(t). Let f be n(-6). Suppose 2s = 3s - f. What is the tens digit of s? 2 Suppose g = 38 + 40. Let l = -43 + g. What is the tens digit of l? 3 What is the tens digit of -2 + 7 + (240 - -15)? 6 Suppose 0 = 4c + 55 + 93. Suppose 3m + 18 = -3u, 4u + 1 = 3m - 2. Let z = u - c. What is the units digit of z? 4 What is the hundreds digit of (-443287)/(-427) - (-6)/7? 0 Suppose 5i = -3k + k + 168, -5i + 166 = 4k. What is the units digit of i? 4 Let n(d) = 6d - 2. What is the tens digit of n(11)? 6 Let f(l) = 3l - 33. Let z be f(12). Suppose zr - 170 + 20 = 0. What is the units digit of r? 0 Let o be ((-252)/147)/((-4)/14). Suppose on = n. Suppose 2r + 3w + 6 = 0, 2r + 0r - w - 10 = n. What is the units digit of r? 3 Suppose 3v - 12 = -0v. Let s be 115/10 - (-2)/v. What is the units digit of -3 + s8/12? 5 What is the units digit of -2 - (-1 - (94 - 6))? 7 Let y(j) = j2 - 12j. Suppose 4*w - 12 = 44. What is the units digit of y(w)? 8 Let f = -83 +	{ "pile_set_name": "DM Mathematics" }
/9. Let x = 88 - p. What is the common denominator of 19/22 and 1702/x + 8/36? 22 Let j = 61 - -29. Suppose -10l = -5l - j. Calculate the least common multiple of 12 and l. 36 Suppose 4b + u = 189, 5b = -3u + 220 + 11. What is the lowest common multiple of b and 40? 240 Let n be 3 + (0/4 - 2). What is the common denominator of ((-4)/(-64))/(15/1452) and (1 - n) + (-37)/(-16)? 80 Let m = 109723/20 - 5481. What is the common denominator of m and -1/80? 80 Let f be 0 - 10400308/(-176). Let j = f - 22749. Find the common denominator of j and ((-4)/(-32))/(8/(-194)). 352 Let c(d) be the second derivative of -d5/20 - d4/4 - d*3/3 + 6d*2 + 26d. Calculate the smallest common multiple of c(0) and 9. 36 Let p be (2/6)/((-13)/39). Calculate the least common multiple of 6 and 504/(-70)(p - (-6)/(-4)). 18 Let c = 2/20261 + 6908541/4660030. Let q = 18/23 - c. Calculate the common denominator of -121/6 and q. 30 Let o = -98/267 - -1067929/534. Let t = o - 2042. Calculate the common denominator of 71/3 and t. 6 Let b(h) be the third derivative of -1/6h*3 + 0h + 0 + 1/60h5 - 1/8h*4 + 13h*2. Calculate the smallest common multiple of 5 and b(4). 15 Calculate the least common multiple of 84 and (-430)/(-20) - (-3)/(-6). 84 Let p(r) = 5r*3 - 3r*2 + 9r - 10. Calculate the lowest common multiple of 96 and p(2). 288 Suppose -3n - 2s + 79 = 0, -s = -3 + 7. Suppose 0 = 3o + 5 - n. Calculate the least common multiple of o and 37. 296 Suppose 39w = 38w - 3. Find the common denominator of (195/66 + w)/(1/62) and 95/4. 44 Let i = -34 - -37. Suppose 2s + iu + 4 = 0, -s - 4u - u - 9 = 0. What is the smallest common multiple of 3 and s? 3 Let j = -198190559767/744 + 266385218. Let h = 1614/31 - j. Find the common denominator of 97/16 and h. 48 Find the common denominator of -13/464 and (-19 + (-3933)/(-72))(-1)/6. 464 Suppose -3w = -0w - 33. Let c(n) = -1 + 1 - n + 3 + 2n. What is the least common multiple of c(-2) and w? 11 Let g = -4/57 - -749/114. What is the common denominator of g and 10/45 + (-6147)/(-1134)? 14 Let k be (933/7772)/((-867)/218 - -4). Let q = k + -4/5829. Find the common denominator of -34/9 and q. 90 Suppose 5x - 33088 + 8218 = 0. Let z be (-4)/(-752)-1x. Let o = 2/47 - z. Find the common denominator of o and -55/7. 14 Suppose 4q - 142 = 5n, 3q = 7n - 3n + 113. Let r = n + 42. What is the smallest common multiple of 6 and r? 48 Let r(g) = -5 - g - 6 - 16g - g2 - 3. Calculate the least common multiple of r(-16) and 16. 16 Let m(j) = -3j + 33. Calculate the smallest common multiple of m(-11) and 66. 66 Suppose 0 = -n - 0n + 45. Let i be ((-8)/12)/(6/n). Let q = i + 21. What is the smallest common multiple of q and 8? 16 Find the common denominator of (-254)/(-70)(-170)/884 and 53/10. 910 Let i be 407 - (-2 - -2) - -1. Let v = 4089/10 - i. Find the common denominator of 42/8930/1085 and v. 10 Let n(p) = -7p*3 - 19p*2 - 4p + 4. Calculate the least common multiple of 12 and n(-3). 204 What is the common denominator of (-1 - (-114)/(-8))/((-18)/(-4)) and ((-228)/(-8))/(3/(-5))? 18 Let p = 10 - 23. Let u = p - -14. Let o = u - -1. Calculate the smallest common multiple of 8 and o. 8 Suppose -52 = -2a + 5u + 7, 0 = a - 5u - 27. Let w = -52 + a. Let c = w + 36. What is the least common multiple of 20 and c? 80 Let u be (3827/(-645))/((-2)/(-933)). Suppose -8279 = 3j - 2g, 2g = 5j + 5g + 13830. Let p = u - j. Calculate the common denominator of p and -27/10. 10 Find the common denominator of (-58)/(-1015)(-31)/(-2) and 29/50. 350 Let y(u) = -2u + 17. Let q be y(7). Let j = q + 19. What is the least common multiple of 18 and j? 198 Let l = 532 - 1145/2. Let g = -183288 + 2022320/11. Let k = g + -560. Calculate the common denominator of l and k. 22 Let x = -1/6023 + 319237/108414. Let u = 388275/182 - 66044/13. Let y = -2943 - u. Calculate the common denominator of y and x. 126 Suppose 0 = -4j + 88 + 172. Suppose -475 = -5o - j. Calculate the least common multiple of o and 16. 656 Let o = -148 - -164. What is the lowest common multiple of o and 74? 592 Let g = -413/864 - 1/288. Find the common denominator of -88/399 and g. 3591 Find the common denominator of 0(-5)/(-50) + (-43)/(-18) and 89/372. 1116 Let z(a) = -17a + 39. What is the lowest common multiple of z(-18) and 57? 6555 Suppose 2p - 5o = -3p - 41060, -p - 2o = 8197. Let f = p - -5773. Let v = 26812/11 + f. Find the common denominator of 43/8 and v. 88 Let s(n) = -3n3 - 7n*2. Let v be 15/(-2) - (-1)/2. Let q = v - -4. What is the lowest common multiple of s(q) and 44? 396 Let o = 204 + -188. Calculate the least common multiple of o and 48. 48 Let b be (-20)/(-110) + 19648/(-11). Let o be (-4)/30 + (-321981)/(-180). Let u = o + b. What is the common denominator of 75/22 and u? 220 Suppose 0 = 2o + o + 15, -2x + 254 = -2o. Find the common denominator of -87/32 and (-19)/95 - x/(-80). 160 Let w(x) = -3x2 - 24x - 2. What is the common denominator of 48 and w(-7)? 1 Suppose -12m - 108 = -15m + 3v, 0 = -5m + 2v + 192. Calculate the least common multiple of m and (44/(-5))/((-3)/15). 440 Let l(s) = s + 10. What is the smallest common multiple of ((-6)/(-2))/((-6)/(-8)) and l(6)? 16 Let o = -321/790 + 1/158. Calculate the common denominator of 7/16 and o. 80 Let v = 614 + -605. Let s = 4 - -1. Calculate the lowest common multiple of v and s. 45 Let l(k) = -k3 - 4k*2 + 15. Let n be l(-4). Calculate the common denominator of (-170)/(-16)(-6)/5 and 9n/6-11. 4 Let b(r) be the first derivative of 5r*2/2 + 46r - 36. What is the lowest common multiple of b(-6) and 40? 80 Let p be 2/(-5) - (-40713792)/1765080. Let d = 2/4903 + p. What is the common denominator of d and 10/9? 9 Let v = -28 + 26. Let r be v5/(-790)10. Let h = -1403/474 + r. What is the common denominator of -49/12 and h? 12 Let q = 89729 - 9511203/106. Find the common denominator of q and 61/4. 212 Let a = -192 - -237. Calculate the smallest common multiple of a and 9. 45 Let z = -135 - -3235/24. Let g = z - 109/72. Find the common denominator of g and 22/(-24) + (-8)/(-16). 36 What is the common denominator of 149/72 and 6/56(-901)/153? 504 Suppose -3k = -4g - 5k + 68, -4k - 85 = -5g. Suppose o - 31 = 3m - 6, 0 = 3m + o + g. Let j = m + 29. What is the least common multiple of 8 and j? 88 Let o(f) = 4f - 22. Let m be (-18)/1240/(-6). Calculate the lowest common multiple of 14 and o(m). 126 Suppose 4o + 226 = 2p + 2o, 98 = p + 2o. What is the lowest common multiple of p and 24? 216 Let j be 5 - 2 - (3 - 3). Suppose -9 = -0i - ji. Calculate the lowest common multiple of 5 and (-2 + (3 - i))-4. 40 Suppose -5d + 4l = -41, 0 = 3d - 6l + 2l - 31. Suppose 8 = -4s + ds. Suppose -20j = -9j - 176. Calculate the least common multiple of j and s. 16 Suppose -7y + 2y - 5v = 10, 4v + 16 = 0. What is the lowest common multiple of y and 8? 8 Let o = -42221/30 + 5637/4. Find the common denominator of o and -28/65. 780 Suppose 0 = 5q + 3f - 285, -7q = -6q + 2f - 50. What is the lowest common multiple of 24 and q? 120 Let t = 276 - 150. What is the least common multiple of 112 and t? 1008 Suppose 9 + 3 = -t. Let n be 20/6t/(-17). Let v = n - 593/187. What is the common denominator of v and 43/6? 66 Let m = -126028 - -1010105/8. Let c = m - 5581/24. Calculate the common denominator of c and 111/14. 84 What is the common denominator of (14/4 + -4)(-140)/18 and 113/80? 720 Let t(w) = w2 - 21w - 56. What is the smallest common multiple of 198 and t(-4)? 396 Calculate the common denominator of 109/12 and (-26)/(-189) - 48/(-168). 756 Let w(b) = -3b - 19. Let v be 11/22(31 + -1). Let m be w(v). What is the common denominator of (-186)/m(8 - 10) and -89/14? 112 Let h be ((24 - -1) + -4)15. Find the common denominator of 71/2 and 0 + h/(-24) + 3. 8 Let l = -3805/4 + 2828/3. Calculate the common denominator of l and -65/68. 204 Let u be (-5906)/(-918) - (-14)/7. Let r = u - 500/51. What is the common denominator of r and 50/9? 27 Let p = -3784423/154 + 24574. Calculate the common denominator of p and -83/33. 462 Calculate the least common multiple of 11 and (0 - 6)*(-16)/(-24) + 14. 110 Let b = -1340813/63 + 21282. Calculate the	{ "pile_set_name": "DM Mathematics" }
? -20.102573 What is the distance between 20 and 324006? 323986 What is 93.11 take away -0.058531? 93.168531 -0.7+-2717603302 -2717603302.7 Calculate -0.2 - 63051352. -63051352.2 Total of -0.057 and -0.014854892. -0.071854892 What is 1265.761 take away -0.99? 1266.751 -51247.9592 - -1.1 -51246.8592 What is 220.924705 minus -0.3? 221.224705 -0.09+368.38856 368.29856 What is -9893.79509 + -1.7? -9895.49509 Sum 14803532 and 4. 14803536 What is the difference between -5 and 1216659847? 1216659852 What is -500578687 minus 361? -500579048 Total of 5208 and -42.7135. 5165.2865 What is 1600595 - 0.1? 1600594.9 Calculate 1560627117 + 0. 1560627117 Work out -2.27 + -0.230879. -2.500879 What is -1.42 minus 1.04? -2.46 Sum -349 and -708.36597. -1057.36597 Sum 475.2 and 2824.853. 3300.053 85 + 63051 63136 Calculate -0.7 - -20.838827. 20.138827 Calculate -73.77 + -3.4531. -77.2231 Put together 19 and 707295612. 707295631 Work out -0.4 - -0.994170029. 0.594170029 Total of 50.09 and 1360.427. 1410.517 What is the difference between -0.01 and -92489.03939? 92489.02939 What is -0.34 minus 8413842? -8413842.34 Add together 0.03343 and 410.045. 410.07843 0.05 + -624738838 -624738837.95 What is 0.0207 minus 2.1416? -2.1209 What is 1.521247 minus 4307? -4305.478753 Put together 468 and -11295. -10827 What is 0.076 minus 9503? -9502.924 0.0837023+-0.04722 0.0364823 -9+-1819.593 -1828.593 Work out -11712891 + -22.5. -11712913.5 What is -24 less than -0.361879542? 23.638120458 Add -1023487 and -0.033859. -1023487.033859 What is -11512572 + -17? -11512589 Sum 70.7514 and -0.27. 70.4814 Sum 176761 and -0.262. 176760.738 Put together 13 and -0.4126871. 12.5873129 Put together 0.017 and 0.25402. 0.27102 What is the difference between -2 and 107853953.6? 107853955.6 Add 0.5 and -3745652069. -3745652068.5 What is the difference between 0.01 and -7227394? 7227394.01 Calculate 0.3 + 70532319. 70532319.3 What is the difference between -2 and 129584827? 129584829 What is 0.331 plus 2.095607? 2.426607 1.293917+0.04 1.333917 Work out -11152 - 11.75665. -11163.75665 Work out 43494.568 + 13. 43507.568 What is -32.9483 + 936? 903.0517 Work out -5 - -1422121. 1422116 What is 29956.1285 plus -4? 29952.1285 What is 13023884 plus 1062? 13024946 Add 9.465656 and 1.1. 10.565656 What is -1379169.04 - -5? -1379164.04 What is -236828.5 take away 2? -236830.5 What is -411794062 minus 5? -411794067 Add 96471 and 191. 96662 Subtract 564.75758 from -58. -622.75758 What is -8761 + 0.18403? -8760.81597 What is -6 minus -70101157? 70101151 Work out 15.9078 + 19.772. 35.6798 Add -14 and 18209.75665. 18195.75665 -36989746852+0.4 -36989746851.6 Sum 11 and -33309.19. -33298.19 What is -49 + 645710.46? 645661.46 What is the difference between 1 and -1158.976435? 1159.976435 1699.93+262 1961.93 What is the distance between -84 and -217.882401? 133.882401 Sum 671409660 and 2. 671409662 What is -0.9724 - 3710? -3710.9724 Subtract -5 from -18584.0161. -18579.0161 Sum -10 and 4026.336821. 4016.336821 Work out 0.04911 - -4.42014. 4.46925 Work out 31265839 + -4.378. 31265834.622 Sum 644212 and 59. 644271 What is the difference between 0.13892 and -47.36? 47.49892 3 - 2727102137 -2727102134 What is 1693.05 less than 9? -1684.05 What is -269482 take away -244748? -24734 957.9 + -41.53 916.37 Sum 984282001 and -0.021. 984282000.979 Sum -1607476545 and 0.19. -1607476544.81 Work out 0.159824 + -11.3563. -11.196476 Work out -71145653 + -53. -71145706 -114912.089 - 0.02 -114912.109 What is the distance between -27766.88 and -0.4? 27766.48 Add -887590 and 153.7. -887436.3 What is the difference between -0.03 and 0.672490238? 0.702490238 What is -25952.3389 + 0.5? -25951.8389 Sum -165022356 and -0.07. -165022356.07 What is -4265266 take away -287? -4264979 What is 40296598613 + 4? 40296598617 Subtract -4.73069 from -19. -14.26931 Subtract -210977939 from 6. 210977945 Put together -0.007 and 208.792. 208.785 -0.39+15406653 15406652.61 What is -2466948466 plus 15? -2466948451 Work out -38 - -2274.4177. 2236.4177 Calculate -2695.445165 + -0.5. -2695.945165 3.30827 - 18.8 -15.49173 Work out 0.0589317 - 30. -29.9410683 Calculate -2498474 - -0.11848. -2498473.88152 What is -1.9 - -12366260? 12366258.1 Sum -155553 and 14139. -141414 5401 + 128 5529 0.41 - -1144700229 1144700229.41 Put together -0.4 and 2508865. 2508864.6 Add -0.9 and 11695089. 11695088.1 What is 590.394 less than -128? -718.394 What is 0.2 less than 593855.88? 593855.68 Work out 70284777 - 9.83. 70284767.17 -81800 + 10046 -71754 What is -58 less than 13096183.9? 13096241.9 Work out 0.5049454 + -3. -2.4950546 What is the difference between 2.238 and 115? 112.762 -0.3 + -76091942 -76091942.3 Subtract -1320 from -108934759. -108933439 Total of -0.1 and 18420629142. 18420629141.9 -303582 + -0.05348 -303582.05348 Add 42 and 2705172. 2705214 What is -4907 less than 0.0162? 4907.0162 -478716745+-0.3 -478716745.3 Work out -16314704 + -0.18. -16314704.18 Calculate 4806655 - 2. 4806653 What is 0.109 plus 52120? 52120.109 Add 1.6 and -3106211.47. -3106209.87 What is 11.02 - 7271? -7259.98 What is 1742 less than -41107? -42849 Work out -0.878278 - 17. -17.878278 Add together 78065 and 94. 78159 What is -103386.9 plus 3.29? -103383.61 What is 0.4 - 0.51105? -0.11105 Add together 120470757 and -0.008. 120470756.992 What is -1456076736 minus -76? -1456076660 Calculate 8852060258 - 2. 8852060256 What is the distance between 544544656 and 0.1? 544544655.9 Add together -842 and 1124201. 1123359 Subtract -1.42315 from -1469. -1467.57685 Work out 99577 + -1651. 97926 Work out 0.6 - 159284. -159283.4 Put together 0.073 and 1534.10805. 1534.18105 What is 0.4 less than -4771.2667? -4771.6667 What is -0.5 take away -62272398.91? 62272398.41 Put together -4 and 0.9696467. -3.0303533 Work out -2788663 + -5098. -2793761 Work out 62203063 - 0.59. 62203062.41 What is -61095.5 - 37772? -98867.5 What is 17.4967 minus 10574? -10556.5033 -5.1+49431.8 49426.7 What is -9 - 1294.4448794? -1303.4448794 Subtract -409 from -1981554.2. -1981145.2 What is the distance between -0.18 and 31.403? 31.583 What is -28 minus 42706? -42734 What is 115 + -323539907? -323539792 -403 - 7.68389 -410.68389 Calculate 10.4 + 79.97557. 90.37557 Work out 30.6984 - -0.14. 30.8384 Calculate 0.12477 + -0.01. 0.11477 Work out -4008 - 1119680. -1123688 772786921 + -20 772786901 What is 3731287 - 435? 3730852 What is -7274.44 - 1699? -8973.44 What is 1.56036 minus -0.8? 2.36036 Put together -23.8 and -187483.74. -187507.54 What is the difference between -0.0037 and 1338784? 1338784.0037 Put together -3028683836 and 1.2. -3028683834.8 Subtract 2 from -24.147964. -26.147964 Calculate 4 - -8479500.86. 8479504.86 Calculate -0.044 + -30.2872. -30.3312 Add -21610199 and -339. -21610538 Work out 0.0142 - -230928. 230928.0142 What is 0.15754 take away -38.573? 38.73054 What is 2670040 - 2? 2670038 What is the distance between 69 and 10.237? 58.763 What is the difference between -24984 and -1576? 23408 What is the difference between -93 and 136302? 136395 -0.3+-31254005 -31254005.3 Work out 0.43887 + -9793. -9792.56113 -93252 + 7387 -85865 Put together 0.43 and -0.8865287. -0.4565287 What is the distance between -2.114784 and -0.09? 2.024784 Calculate 1575.68 + 58936. 60511.68 What is 22609084 take away 5.4? 22609078.6 Put together -0.716716 and 19383. 19382.283284 What is the difference between -214760.4581 and 0? 214760.4581 -95193 + 89550 -5643 Total of -2 and 5045499. 5045497 What is the distance between -43358879 and -0.166? 43358878.834 What is 1 + 3420.4537? 3421.4537 -2.048 + -5.455 -7.503 Add together 48614 and 1.67. 48615.67 Work out -384069 + -0.207. -384069.207 Calculate -213943 + -16.9. -213959.9 Calculate 26 + 2797923. 2797949 Put together -0.2 and -11823564. -11823564.2 What is -8221 take away 9? -8230 What is 9.26 less than -201.207? -210.467 Add together -366889143.54 and -3. -366889146.54 What is 18039 - -76? 18115 What is 63154503 less than 3? -63154500 147859 + 55509 203368 Add together -0.03627079 and -3529. -3529.03627079 What is 108.3 - -1826.5? 1934.8 Sum -24 and -7525094. -7525118 5 - 1019604746 -1019604741 Sum -9.98991 and 7.73. -2.25991 Calculate 989.963 + 2284. 3273.963 Total of 131.52 and -2714.1.	{ "pile_set_name": "DM Mathematics" }
is the third biggest value in s, -0.105, -2.6, -2/3? -2/3 Let b = -199697/5 + 39940. What is the second biggest value in -0.0031, 0.1, -3, b? 0.1 Let c = -10.4 - -10.9. Let j = c + -0.43. What is the second smallest value in -1/2, j, -4? -1/2 Let f = -4498 - -4731. What is the second biggest value in -0.3, f, 1? 1 Suppose -60j + 16588 = -16712. Which is the second smallest value? (a) 1 (b) -2/5 (c) j (d) -12/11 b Let a(k) = 337k + 1311. Let y be a(-4). What is the smallest value in -2/5, -17, y, 4? y Let l = -64.829 + -0.171. Let h = -65.3 - l. Let k = -29 + 21. Which is the biggest value? (a) 2/7 (b) h (c) k (d) 1/8 a Let l be 30/4 + (10 - (2 + 15)). Let v = -4.85 - 0.85. What is the third smallest value in -0.5, v, l, 1/3? 1/3 Let r be (-3 + 1)(-7055)/(-68)2. Let q = r - -413. Which is the smallest value? (a) -26 (b) q (c) 0.3 a Let v = -0.3 + -1.7. Let d = v + 1.8. Suppose -u - 10 = 2n, -1265u - 4n = -1264u + 22. What is the third biggest value in 0.4, -2/13, d, u? -2/13 Let n = 1377/4340 + -15/868. What is the second biggest value in -16, -2/29, n? -2/29 Suppose 18k - 3978 = 2772. Let t = k + -1120/3. Which is the second biggest value? (a) t (b) -3 (c) 27 a Let v = 1 - 1. Let u = 363848.8 + -363849. What is the fourth smallest value in v, -0.5, 14, u? 14 Let l = -5.673 + 9.88. Let y = l + -0.207. Let q = 4.72 - -0.28. What is the smallest value in y, 2/5, q? 2/5 Let k be 6/(-27)(-68 - 1). Suppose 4d = -q - 15, 2d + 57 = -3q + 22. Which is the smallest value? (a) k (b) 0.2 (c) d c Let k = -188660/723373 - 2/31451. What is the third smallest value in k, -10, 3, 1? 1 Let a(j) = j3 + 182j*2 + 2199j + 335. Let s be a(-169). What is the fourth smallest value in -7, 1, -3/8, s? 1 Let n = -237 - -271.3. Let x = -39.3 + n. Let t = -0.45 + 0.05. Which is the biggest value? (a) -4 (b) t (c) x (d) 1/2 d Let p be (0 - -6)1/2. Let g be 10/(-80)p(-1 - -5). Which is the second smallest value? (a) -20 (b) 0.4 (c) g c Let o = -47 - -46.9. Let h = 927 + -912. Which is the fourth smallest value? (a) o (b) 1 (c) -3 (d) h d Let u = 9052 + -9052. Which is the fourth biggest value? (a) -21/11 (b) -2 (c) u (d) -1/2 b Let s = 0.179 + 0.221. Let i = -3.828 - 0.072. What is the third smallest value in s, -4, -0.3, i? -0.3 Let h = -142.8 + -1454.2. Which is the second smallest value? (a) 2/3 (b) 1 (c) 0.3 (d) h c Let t = -0.02 - -2.92. Let r = t - 2.83. Let m = 0.27 - r. Which is the third biggest value? (a) -5 (b) m (c) -7 c Let k be 11/(-44) + 7/(-4). Let n be 1/k + 120/48. Suppose 4 = nq + 12. What is the third smallest value in q, -0.3, 1.7? 1.7 Let t(z) = 136z - 1221. Let y be t(9). Which is the biggest value? (a) 10 (b) -2 (c) y (d) -1 (e) 0 a Let j = 5.676 - 5.876. What is the third smallest value in 1, -4, j, 33/13, -5/2? j Suppose 5g = 7f - 11f + 25, -2f = -4g + 20. Which is the second smallest value? (a) f (b) 2/23 (c) 4/5 (d) 20 b Suppose -21r + 31r - 10 = 0. What is the third smallest value in r, 0.8, -0.4, 2/111? 0.8 Let c = 12 - 17. Let u = -77.5 - -73. Let i = c - u. What is the smallest value in 1, -1, 2, i? -1 Let v be ((-16)/24)/(8/1332). Let k = -114 - v. Let z = -0.03 - -5.03. What is the second biggest value in k, 2.3, z? 2.3 Let u = 20447 - 20448. What is the third biggest value in -0.1, -2022, u? -2022 Let l = -592 - -337. Let r = l - -253. Which is the second smallest value? (a) r (b) -1 (c) -3 a Let v = 13806 + -13806.1. Which is the second smallest value? (a) -238/11 (b) 0.5 (c) v c Let m be 76/570(-15)/12-2. Which is the smallest value? (a) 8 (b) 5/9 (c) -3/7 (d) -1 (e) m d Let c = -7511/10 - -22513/30. What is the fifth smallest value in c, 1/2, 15, 4, 2/11? 15 Let v = 1.1 - 0.1. Let j be (1/5)/(3/6). Let m = -59531 + 59531. What is the third biggest value in m, v, j, 3/5? j Let d = -745 - -2234/3. Let w = -23294/11 + 2122. Which is the biggest value? (a) -0.2 (b) w (c) d b Suppose 0 = 2q + w + 1, -22q + 19q + 4w = 7. Which is the third biggest value? (a) -7 (b) -4 (c) -2/9 (d) q (e) -3/8 d Let p = 120807 + -120802. Let y = -80/11 - -367/55. Let g = 121/2 - 59. What is the smallest value in -7/4, y, p, g? -7/4 Suppose -74 + 28 = 140b + 94. Let t = 86 - 604/7. What is the biggest value in b, -8, t? t Let t = -66053/55 + 1201. Let i = -0.03122 + 3.03122. Which is the second smallest value? (a) i (b) t (c) 2/11 c Let v(w) = -17w + 3. Let s be v(3). Suppose -2p - n = -105, -3p = -6p + 5n + 125. Let o = p + s. What is the fourth smallest value in 4/5, 0.1, -0.3, o? o Let d = -13783 + 13783. What is the fourth smallest value in 2, 18, d, 0.4? 18 Let z = 910.1 + -910. What is the smallest value in z, -2/7, 0.08, 0? -2/7 Let a = -2.4 + 2. Suppose -38s + 925772 = 925734. What is the biggest value in s, 68, a? 68 Suppose 29c - 350 = 43c. Let t be 22/(-126) + c/225. What is the biggest value in 0.4, t, 1, -9? 1 Let g be (-2)/(-4)(-248)/806. Which is the smallest value? (a) -8 (b) 127 (c) g a Let x = -7349/3 + 2448. What is the fourth smallest value in -0.1, x, 3/2, 373? 373 Let s = 2.98 - 2.28. Let w = s + 0.4. Which is the fourth smallest value? (a) w (b) 2 (c) -1 (d) -5 b Let w = 58 + -60.7. Let o = -16.04 - -10.34. Let g = w - o. Which is the second biggest value? (a) -4/11 (b) g (c) 4 b Suppose -y - 3k + 27 = 0, -3y + 5k - 10k = -45. Let t = 3.02 - 0.02. What is the third smallest value in t, 192, y? 192 Let z = -780.33 + 780. What is the biggest value in 0.2, z, -5, 5, 0.3? 5 Let l = 78.7 + -78.9. Which is the third biggest value? (a) l (b) -0.6 (c) 2 (d) -1 (e) -4/7 e Let s = -1480.98 - -1480.68. Let m = -5 - -2. Which is the third biggest value? (a) 2/7 (b) m (c) 4 (d) s d Let t = -70 + 70.4. Let g = 867 + -868. Which is the second biggest value? (a) 4 (b) t (c) g b Let u = 0.05711 - 9.05711. What is the second biggest value in -1/11, -13, u? u Let h = 5.0336 - 0.0336. Which is the biggest value? (a) h (b) 11 (c) 1 (d) -0.2 b Let n be (14/(-5))/2 - -1. Let t be 4/21(-10)/(2000/(-150)). What is the fourth smallest value in -0.1, 2/17, n, t? t Let z be (30/(-4) - 496/(-96)) + 5/6. Which is the second biggest value? (a) z (b) -2 (c) 29 a Let q = -15 + 13. Let n = 20.3 + -142.5. Let x = n - -122. What is the second smallest value in q, 5, x, 3? x Let d = -279/11 + 613/22. What is the biggest value in d, -32, -0.3? d Let m(k) = 4k*3 + 7k*2 + 3. Let j be m(3). Let q = 172 - j. What is the smallest value in q, 2, 1.2? q Let o be (-6 + 0)/(3843/(-488) + 3/8). Which is the second smallest value? (a) -3 (b) o (c) 1 (d) -5 (e) -8 d Suppose -13g - 126 = -11g. Let k = -23 - g. Let q be 38/k + 5/(-25). Which is the biggest value? (a) -0.1 (b) 0.5 (c) q (d) -3 c Suppose 0 = 5f - 205 + 20. Let j be 7 - f/5 - (-4)/5. Which is the biggest value? (a) j (b) 2 (c) -3/5 (d) 53 d Let w = -5378 + 5382. What is the fifth biggest value in -3, 4/9, w, -26, -3/2? -26 Suppose l + 2 = 5t, -56t + 2 = l - 57t. What is the third biggest value in l, -3/16, 4? -3/16 Let s = 80686/3 - 26894. What is the biggest value in s, 0.3, -4, -6, 1/6? s Let y be (-7)/2(-13)/(-91). Let m = 286/5 + -57. What is the smallest value in m, -2, y, 8? -2 Let h be ((-2)/(2/(-5)) - 238/51)-3. Which is the third smallest value? (a) 0.4 (b) 7.3 (c) -6 (d) h a Let k = -3197.1 + 3194. What is the biggest value in k, -25, 5? 5 Let o = -373.4 + 390.4. Which is the smallest value? (a) 0.3 (b) 1 (c) 0.23 (d) o c Let m = -205/253 + 27/23. Which is the second smallest value? (a) -2 (b) m (c) -0.5 (d) 0 (e) -1 e Let q = -53 + 98. Let z = q + -43. Suppose -3l + 9 = -2i, -4l + i + 12 = 4i. What is the fourth biggest value in 0.2, l, -2, z? -2 Suppose 5k + 9 = -2s, 2s - 3 = 3k - 4. Let p = 152 - 152.4. Let j = 4 - 4.5. What is the third smallest value in s, p, j? p Let z = 7219 - 14439/2. What is the third smallest value in 3, -9.53, z? 3 Let q be ((-4)/(-18))/((-2)/(-3)). Let s = 2898 - 2891. Which is the second smallest value? (a) q (b) -0.1 (c) 5 (d) s a Let m = -2749 + 2720. What is the fourth smallest value in m, 3, -0.2, 0.05? 3 Suppose -13 = -4y + 7. Let u = -2.8565 - -0.0565. Let z = -2.2 + u. What is th	{ "pile_set_name": "DM Mathematics" }
29 -12121 (base 4) to base 7 -1123 What is -111011010101 (base 2) in base 14? -1553 -8bbc (base 13) to base 2 -100110010000110 Convert -1b370 (base 13) to base 3. -2201011001 10567 (base 8) to base 3 20010121 Convert 11111011011101 (base 2) to base 7. 64630 Convert 223 (base 5) to base 9. 70 -4a6 (base 15) to base 10 -1056 Convert 4166 (base 9) to base 10. 3057 53 (base 10) to base 3 1222 What is 1887 (base 9) in base 5? 21311 2a257 (base 12) to base 15 127a7 What is -7358 (base 10) in base 4? -1302332 What is -322410 (base 5) in base 4? -2223210 What is 1021 (base 3) in base 7? 46 -122124 (base 5) to base 2 -1001000111000 2036 (base 16) to base 4 2000312 Convert 7b5c (base 14) to base 5. 1141241 Convert 91da (base 16) to base 7. 213600 3535 (base 8) to base 11 1464 10b4 (base 15) to base 5 103134 Convert 213 (base 14) to base 7. 1123 What is -16622 (base 9) in base 5? -331231 100010 (base 3) to base 10 246 What is -1a42 (base 12) in base 13? -1607 Convert 112011 (base 3) to base 10. 382 1021001201 (base 3) to base 6 310544 211111 (base 3) to base 2 1001011111 What is -38862 (base 10) in base 6? -455530 What is 692 (base 11) in base 15? 3a2 What is -3100002 (base 5) in base 7? -265531 Convert -1101010101 (base 2) to base 14. -44d 1154 (base 12) to base 7 5434 What is -102010 (base 4) in base 15? -521 What is -52431 (base 6) in base 13? -32b3 What is 552 (base 9) in base 3? 121202 -10033 (base 6) to base 13 -7a4 Convert -4995 (base 10) to base 4. -1032003 What is -319 (base 14) in base 13? -380 What is -9035 (base 11) in base 14? -4545 What is -59f (base 16) in base 5? -21224 What is 6561 (base 8) in base 10? 3441 What is 7b97 (base 12) in base 16? 35e3 1010101001010000 (base 2) to base 10 43600 Convert -3271 (base 10) to base 12. -1a87 -29ca (base 16) to base 2 -10100111001010 -1000010010110011 (base 2) to base 13 -12602 Convert -2789a (base 11) to base 8. -115374 -145432 (base 6) to base 13 -6608 What is -206341 (base 8) in base 5? -4200313 1001111100011 (base 2) to base 5 130331 1025 (base 7) to base 5 2422 416 (base 15) to base 10 921 What is 31b (base 13) in base 4? 20103 What is 2276 (base 9) in base 10? 1689 Convert -b1c (base 16) to base 10. -2844 1011010 (base 2) to base 15 60 bac (base 14) to base 3 10011111 Convert 502 (base 11) to base 2. 1001011111 -47050 (base 8) to base 11 -1403a What is 24a (base 11) in base 13? 19a What is 1662 (base 9) in base 14? 66b What is 983 (base 13) in base 12? b38 What is 200024 (base 5) in base 7? 24156 Convert 199 (base 16) to base 15. 1c4 Convert 11001111101110 (base 2) to base 7. 53521 -ca (base 16) to base 11 -174 Convert 110434 (base 6) to base 5. 243423 Convert -62156 (base 8) to base 13. -b919 235 (base 16) to base 13 346 -110000110111 (base 2) to base 11 -2393 Convert 2b5 (base 13) to base 16. 1e6 100101110110101 (base 2) to base 16 4bb5 Convert 132064 (base 7) to base 11. 17653 Convert 3b0 (base 15) to base 11. 6a4 Convert -4a7 (base 12) to base 5. -10303 What is 110435 (base 6) in base 12? 541b What is -31231030 (base 4) in base 14? -16660 3223011 (base 4) to base 16 3ac5 What is -1024 (base 8) in base 2? -1000010100 -11050 (base 7) to base 13 -135a What is -8a (base 13) in base 7? -222 What is -16012 (base 9) in base 12? -6402 What is 10131112 (base 4) in base 7? 104146 Convert -18480 (base 9) to base 16. -31f5 Convert -225c (base 15) to base 5. -213122 Convert -2566 (base 7) to base 14. -4dd What is 4a4 (base 14) in base 9? 1241 -1645a (base 11) to base 13 -a71a Convert -1775 (base 10) to base 8. -3357 563 (base 14) to base 13 641 a9b4 (base 13) to base 8 56126 What is 1290 (base 13) in base 6? 20140 Convert 22032 (base 8) to base 9. 13608 What is -1e9a (base 16) in base 11? -5982 198a2 (base 11) to base 3 1101222221 What is 8868 (base 9) in base 14? 2554 Convert -712 (base 11) to base 2. -1101011100 -251 (base 9) to base 15 -dd Convert -3760 (base 8) to base 11. -1588 -254b (base 13) to base 16 -14b6 What is -44533 (base 7) in base 4? -2233231 What is -78a (base 14) in base 15? -699 Convert -1108 (base 14) to base 4. -232010 Convert 3053 (base 6) to base 16. 2a9 10301213 (base 4) to base 5 1111214 11201 (base 3) to base 4 1333 -2070 (base 16) to base 15 -26d9 Convert 592 (base 11) to base 9. 864 7051 (base 14) to base 4 10231033 6ab (base 13) to base 7 3240 What is 6e3 (base 15) in base 7? 4362 Convert -21523 (base 7) to base 2. -1010100011111 Convert -10200100 (base 3) to base 5. -41212 1122101 (base 3) to base 13 712 Convert 23130 (base 4) to base 5. 10412 Convert 20c (base 14) to base 13. 251 Convert -19f (base 16) to base 6. -1531 What is 3149 (base 12) in base 16? 1509 Convert 20031 (base 4) to base 9. 643 Convert -405 (base 7) to base 10. -201 What is 2003 (base 5) in base 7? 511 What is 100100101000001 (base 2) in base 16? 4941 Convert 621 (base 13) to base 4. 100101 What is -1776 (base 15) in base 6? -35233 -211001 (base 3) to base 9 -731 What is 12355 (base 9) in base 12? 4988 What is -1113 (base 8) in base 4? -21023 What is 1334 (base 16) in base 8? 11464 What is 1143 (base 7) in base 11? 355 What is 3857 (base 10) in base 16? f11 Convert -406 (base 13) to base 7. -1663 What is 112142 (base 5) in base 3? 12112220 Convert -202 (base 12) to base 13. -194 Convert 5317 (base 10) to base 11. 3aa4 What is -19d2 (base 14) in base 8? -11124 What is -159 (base 12) in base 3? -21220 Convert e5d (base 15) to base 2. 110010100110 -1447 (base 11) to base 14 -974 -1124 (base 10) to base 9 -1478 303033 (base 4) to base 12 1a93 356a (base 14) to base 4 2101122 Convert -7742 (base 8) to base 13. -1b0a Convert -1004044 (base 5) to base 15. -4bb9 What is -5a (base 15) in base 9? -104 Convert -12011100 (base 3) to base 11. -2910 What is 465 (base 11) in base 12? 3a3 What is -45521 (base 6) in base 14? -24d3 Convert -353 (base 9) to base 4. -10203 Convert 419b (base 15) to base 3. 201000202 1210 (base 9) to base 2 1110000100 What is -3313 (base 5) in base 12? -322 -13835 (base 9) to base 14 -3616 -388 (base 9) to base 16 -143 Convert -363 (base 13) to base 8. -1114 Convert 4423 (base 5) to base 14. 31b What is 42362 (base 8) in base 7? 102313 Convert -1050 (base 8) to base 16. -228 What is -2001 (base 6) in base 12? -301 Convert 230 (base 15) to base 5. 3440 -622 (base 16) to base 8 -3042 Convert -615a (base 12) to base 8. -24526 Convert 30c8 (base 15) to base 4. 2201021 Convert 1b0 (base 13) to base 15. 15c What is -110201 (base 3) in base 6? -1331 77c (base 16) to base 12 1138 Convert 155 (base 14) to base 15. 131 Convert -141 (base 14) to base 9. -311 Convert -845 (base 10) to base 6. -3525 111000 (base 2) to base 9 62 -3bc (base 14) to base 2 -1011110010 10d (base 14) to base 2 11010001 -33a (base 15) to base 4 -23122 -1316 (base 10) to base 6 -10032 Convert 13561 (base 11) to base 16. 4b6a Convert 35b (base 15) to base 6. 3305 What is 472 (base 11) in base 3? 202212 -203003 (base 6) to base 15 -4c03 -2772 (base 9) to base 12 -1262 What is -268 (base 10) in base 9? -327 Convert -240 (base 11) to base 4. -10132 211201 (base 3) to base 15 2ad Convert -1432 (base 8) to base 3. -1002102 Convert -25354 (base 6) to base 8. -7346 Convert 1633 (base 8) to base 12. 64b 12a7 (base 15) to base 2 111110001110 What is -11011000001011 (base 2) in base 5? -420320 Convert 45 (base 16) to base 11. 63 What is -40 (base 13) in base 2? -110100 957 (base 16) to base 13 111c -442 (base 8) to base 10 -290 Convert -664 (base 7) to base 6. -1324 Convert 36742 (base 8) to base 4. 3313202 Convert 98b (base 12) to base 2. 10101111011 Convert -777 (base 9) to base 7. -1600 -10010110111 (base 2) to base 7 -3343 Convert 5434 (base 10) to base 12. 318a Convert -60 (base 14) to base 11. -77 -10010000000001 (base 2) to base 14 -3505 What is -31434 (base 6) in base 14? -17b0 Convert 19c8 (base 13) to base 4. 330222 What is -3202 (base 5) in base 8? -653 Convert -1081 (base 9) to base 8. -1442 Convert -134330 (base 5) to base 14. -2074 Convert -83 (base 12) to base 8. -143 3062 (base 12) to base 10 5258 What is -178a (base 11) in base 7? -6431 What is 111000011 (base 2) in base 12? 317 Convert 114512 (base 6) to base 9. 14788 What is 1b9c (base 13) in base 3? 12202000 What is -114532 (base 7) in base 14? -7852 Convert 4222 (b	{ "pile_set_name": "DM Mathematics" }
rrange -139r3 + 88430r - 88430r - 3 + 1915r*3 to the form d + ar*2 + gr + lr3 and give l. 1776 Rearrange 2 - 211r*2 + 243r*2 + 73r*2 + r to the form u + pr + wr2 and give p. 1 Rearrange 58n*2 - 27n*2 - 13n*2 - 212n - 3 - 20n2 to the form hn*2 + an + f and give a. -212 Express -97r - 87 + 102 + 302r + 294r in the form dr + c and give c. 15 Rearrange -2p4 - 112381p + 111922p - 4 + 2 to np*3 + lp*2 + d + cp*4 + qp and give d. -2 Rearrange 970y2 - 2528y*2 + 1311y*2 + (0 - 3 + 1)(-7 + 7 + 2y2) + 2y2 - y2 - 2y2 to dy*2 + sy + g and give g. 0 Express -378k3 - 1 - k2 - k - 612k*3 + 1 - 2 as ik*2 + dk*3 + uk + j and give i. -1 Express -2z - z + 2662 - 1256 - 1220 in the form s + lz and give l. -3 Rearrange (2 - 5 + 2)(3 + 0 + 0)(48636q - 91009q + 66192q)(-3 - 4 + 5) to the form r + lq and give l. 142914 Express 2l*4 + 14l*2 - 6l3 + 1 + l2 + 50l2 + 6 - l - 6 as hl*2 + bl + nl3 + s + al*4 and give a. 2 Express 10h*2 + 0h*2 - 4h*2 + (935h + 1581h + 254h)(-3h + 0h + h) in the form lh*2 + q + dh and give l. -5534 Express 1 - 30d3 - 5080d*2 - 5078d*2 + 10151d*2 - d in the form xd*3 + sd*2 + f + cd and give f. 1 Rearrange -73 - 2830u4 + 2849u*4 + u - 5u*2 + 75 + 2u*3 to the form ju + gu4 + vu*3 + ru*2 + i and give r. -5 Rearrange (5u - 3u + 0u)(-38u*2 - 231 + 231 + (-2 + 2u + 2)(-6u + 4u + 5u) + 1 - u*2 - 1 + 2u) to lu2 + nu + fu3 + x and give l. 4 Express 34l + 30 + 40 + 17 - 27 - 19l as z + kl and give z. 60 Express (-3 + 1 + 1)(-47a + 102a - 48a)(2a*3 - 31 + 31)(1 - 1 - 3) as qa3 + pa*4 + wa + ia2 + d and give p. 42 Express 899j + 906j + 341j + 822j + 83j as g + bj and give b. 3051 Rearrange (f3 + 2f*3 + 10f*3)(-50f - 5 + 5) + 0 + 0 + 3f*4 + (2 - f - 2)(1 + 2f3 - 1) to the form pf*4 + cf*2 + wf*3 + uf + k and give p. -649 Rearrange (-27 - 22 - 23 + 2114f - 18 + 90)(3f - f + 6f) to the form qf2 + l + wf and give q. 16912 Rearrange 261c - 5c*3 + 3c*3 + 36c - 2c4 to the form uc + sc2 + mc*3 + y + hc*4 and give h. -2 Express -434h*2 + 12h - 14h - 560h*2 - 561h*2 as j + bh + gh2 and give b. -2 Rearrange 88 - 1554t + 82 - 170 - 1746t to nt + b and give n. -3300 Express (7 - 15 + 64)(5p - 5p + 2p + (-1 - 3 + 2)(0p + p - 2p) + 3p - 3p + 9p) as mp + d and give m. 728 Express 63295q - q*2 - 2q*2 - 65304q + 4q2 in the form k + sq*2 + nq and give n. -2009 Express -7r3 + 0 - 23r*3 - 4 + 49r*3 - 5r + r*2 as x + br*3 + nr*2 + ar and give b. 19 Express -5740s + 2881s + 2865s + s2 - 126 in the form x + fs*2 + ls and give x. -126 Rearrange 5y3 + 0y*3 + y + 0y2 - y2 + 4y to the form xy + ay2 + q + vy*3 and give x. 5 Rearrange (-5 + 10k*2 + 5)((k + 0 + 0)(-65k - 67k + 17k) + k*2 + 2k*2 + 0k*2) to the form l + zk*2 + xk + fk3 + dk*4 and give d. -1120 Rearrange 62w + 2129w + 1444w - 69w to the form u + sw and give u. 0 Rearrange 315n4 + 3n - 5n2 + 8n*2 - 671n*4 + 346n*4 + 4 to the form ln*4 + yn + mn3 + t + fn*2 and give y. 3 Rearrange 51614v - 103461v + 49597v + (0v - v + 0v)(0 - 4 + 3) to the form lv + n and give l. -2249 Rearrange -45 - 77 + 12q + 123 - 54q*2 + (1 - 1 + 2q)(5q + 30 + 8q - 31) to wq*2 + b + kq and give w. -28 Rearrange 46b2 + 10117 - 5b*3 - 10112 - 44b*2 + 6b to pb + hb*2 + kb*3 + n and give h. 2 Rearrange -7614z + 0z2 + 7614z + 7z2 + 412 to v + tz + bz2 and give b. 7 Rearrange (2 + 2 - 3)(2d - 1 + 1)(0 - 5 - 2)(4 + 2 - 3 + 2 + 1 - 1 + (0 + 1 + 1)(-2 - 3 + 2) + 5 - 2 + 0 + 0 + 0 - 5) to wd + q and give w. 42 Rearrange (567y - 1266y + 617y)(8 + 0 - 4)(y - 2y - 2y) to fy2 + w + iy and give f. 984 Express -7u3 - 26u*3 + 91 - 95 - 7u*3 as g + yu + cu2 + au*3 and give a. -40 Rearrange -216n*2 + 35n*2 + 720n*2 + 149n*2 + 515n*2 to the form cn*2 + mn + g and give c. 1203 Express -16h - 6 + 16h + 50 - 2h - 5 as dh + t and give t. 39 Express -w*3 + 35w*2 - 6w - 13w - 143w*2 - 1 + 20w as iw3 + rw + vw2 + x and give x. -1 Rearrange (3t - 3t - 5t)(763t - 956t + 420t) - t2 + t2 + t*2 to jt + f + ot2 and give f. 0 Rearrange (-22 + 29 - 165)(5f - 5f - 2f2 - 4)(3f - f + f) to wf + jf3 + c + if*2 and give w. 1896 Rearrange (0 + 3 - 1)(-2f - 2f + f)(-4 + 4 - 1)(27 - 114 - 81) to the form of + u and give o. -1008 Rearrange (0 - 1 + 2)(-2 + 0 + 0)((-2z - z + 5z)(0 - 4 + 6) + 436z + 559z + 702z) to the form kz + f and give k. -3402 Rearrange (1 + 2 - 1)(-109l + 10l + 234l) + 13l + 4 + 18l - 34l to w + il and give i. 267 Express (746 - 852 + 3947)(2v - 1 + 1)(4 + 0 - 6) in the form l + kv and give k. -15364 Express 1677i2 - 374i*2 + 1356i*2 in the form ji + y + vi2 and give v. 2659 Express 130170q*3 - 65081q*3 + 3192q*2 - 65086q*3 in the form wq*2 + x + iq + aq3 and give a. 3 Rearrange -41m*4 + 2 - 77m + 21m4 + 52m + 28m3 + 18m*4 + 3m*3 to the form dm*3 + sm*2 + gm*4 + w + jm and give d. 31 Rearrange -69n3 + 0n*2 + 135n*3 + 103n*2 - 2n - 62n3 + 46n*2 + 1 to the form qn*3 + jn + hn2 + s and give q. 4 Rearrange 88v*2 + 2v*3 - 26680 + 3v + 26679 + 59v2 to the form ov*3 + d + cv + tv2 and give d. -1 Express -816h + 5304h - 561h as bh + r and give r. 0 Rearrange -163 + 2h*3 + 4h - 3h3 + 21h*2 - 157 + 318 to ph*2 + ah + nh3 + j and give p. 21 Rearrange -407m + 102 + 823m - 442 - 407m to the form s + am and give s. -340 Express -3r + 5r - r + (1 - 2 - 1)(469 - 469 - 122r) - 5r + 7r + 4r as f + wr and give f. 0 Rearrange (9695 - 1823 + 12206 + 553 - 5237 + 8923)(4n2 - 5n*2 + 3n*2) to the form wn*2 + l + pn and give l. 0 Rearrange 1191q2 + 50q - 1191q2 - 311q*3 + 1 + 319q*3 to the form hq*2 + oq*3 + u + gq and give g. 50 Rearrange (2 - 2 - 2k2)(5 + 3 - 13) + 199k2 + 2k - 4048k2 - 2k - 1254k2 to dk*2 + ak + q and give d. -5093 Express (1 - 1 - b)(-2b*3 + 5b3 - b3) - 2 - 30b4 + 3506b*2 - 1760b*2 - 9b*3 - 1758b*2 as q + nb*4 + ub*2 + ob + mb3 and give q. -2 Rearrange (19m + 19m - 10m)(10240 + m2 + 86m - 10240) to the form cm + jm*2 + o + gm*3 and give j. 2408 Express 256057t + 0 - 275902t + 0 as qt + p and give p. 0 Express 117j4 - 228j4 - j3 - 5j + 4 - 11j*2 - 1 - 5 + 113j*4 as mj*4 + tj*2 + k + vj*3 + sj and give t. -11 Rearrange 39275i2 - 39275i2 + i3 - 18i4 - 436 to the form ki + fi4 + z + bi*2 + hi*3 and give z. -436 Express 990s*2 - 208s*2 - 290s + 290s + 1685s*2 in the form js*2 + bs + r and give j. 2467 Express -17x + x3 - 1 + 0x*3 + 16x + 2x3 + 963x*2 - 4x*3 as hx + sx2 + y + jx*3 and give j. -1 Rearrange (0 - 6 + 4)(a + 2a - a) + 2a + 4a - 5a - 1157485a + 2507018a - 1258941a to ua + m and give u. 90589 Express 3290d2 - 572d + 470d - 3262d*2 in the form ld*2 + w + nd and give n. -102 Express (-5 + 7 + 1)(32 + 5 - 2)(r + 6r - 4r) in the form fr + n and give n. 0 Express -7369 + 7950 - 5v + 7v in the form t + kv and give t. 581 Rearrange -3542d + 4 + 3542d - 2924d2 - 4 to od + q + zd2 and give z. -2924 Express 1 - 1 + h + 3 - 3 - h + 2h - 3h - h + h - 4h + h + (3 + 0 - 4)(h - h + h) + 1 - 1 + h + 266h + 601h - 1002h - 4 as ih + n and give n. -4 Express (-67p + 15613 - 15613)(-88p + 88p + p2 + 13) as k + ap + gp2 + jp*3 and give j. -67 Rearrange (-969 + 1814 + 1748)(4s2 - 6s + 6s + (-s2 + 7s*2 - 2s*2)(-3 + 1 + 4)) to the form cs2 + xs + h and give c. 31116 Express (112b - 230b + 108b)(b*2 - 4b*2 + 4b*2 - 8b) + 0 + b*3 + 0 - 2 as zb*2 + qb*3 + o + sb and give z. 80 Express -726 + 1460 - 734 - 4943o in the form no + x and give n. -4943 Express -4r2 + 7343r*3 + 2 - 7306r*3 - 25r*2 + 2r*3 + 4r - 4r + (0 + 0 - r)(-3r2 + 2r*2 + 2r*2) as hr*3 + vr + jr2 + p and give p. 2 Rearrange 450	{ "pile_set_name": "DM Mathematics" }
0z2 + 0z + 3/2z4. Factor t(m). -2m*2(m - 2)(m - 1) Factor 0 - 2/7g*2 - 2/7g*4 + 0g + 4/7g3. -2g*2(g - 1)*2/7 Let z(t) = 39t*2 - 39t - 207. Let p(n) = -3n2 + 3n + 16. Let x(o) = -27p(o) - 2z(o). Find j, given that x(j) = 0. -2, 3 Suppose -2y = y. Let o(h) be the second derivative of -1/90h*5 + 0 + 1/54h*4 + yh*2 + 1/27h*3 - 1/135h*6 + h. Factor o(n). -2n(n - 1)(n + 1)2/9 Let d(u) = u3 + 8u2 + 8u + 6. Let l be d(-7). Let s be 2/(l(-3)/2). Suppose 2/3 - sk*2 + 0k*3 + 2/3k*4 + 0k = 0. What is k? -1, 1 Let k = -7 - -9. Let n(w) be the first derivative of 1/5w5 + 0w + 1/2w4 + 1/3w*3 + k + 0w*2. Determine f so that n(f) = 0. -1, 0 Let m(l) be the first derivative of 5l*3/3 + 5l*2/2 - 10l - 8. Find u such that m(u) = 0. -2, 1 Let m(c) be the third derivative of 0c + 0c*5 + 0 + 0c*3 + 3c*2 - 1/70c*7 - 1/20c*6 + 0c*4. Find p, given that m(p) = 0. -2, 0 Let q(f) be the first derivative of -1/10f*5 - 1/2f + 0f2 - 1 + 1/3f*3 + 0f4. Factor q(c). -(c - 1)2(c + 1)2/2 Let h(k) be the third derivative of k8/392 + 26k*7/735 + 6k*6/35 + 9k*5/35 - 9k*4/28 - 12k*2. Let h(y) = 0. What is y? -3, 0, 1/3 Let m = -809 + 813. Suppose 2/5n - 2/15nm + 4/15 - 2/5n*3 - 2/15n*2 = 0. What is n? -2, -1, 1 Let c = 1124 - 2193/2. Let g = c + -27. Factor gb*2 + 2 - 2b. (b - 2)*2/2 Let s be 5/(-15) - (-17)/(-3). Let u = 11 + s. Factor 5b*4 + 9b*3 + 13b + 4bu + b2 + 6b*4 - 14b. b(b + 1)3(4b - 1) Factor -3r*3 + 0r*3 + 0r*5 + 3r*5 - 3r*3 - 3r*4. 3r*3(r - 2)(r + 1) Find w, given that 10/3w + 2/3 - 4w4 + 10/3w*2 - 10/3w*3 = 0. -1, -1/2, -1/3, 1 Let c be (-14 - -17)(-3)/(-18). What is h in ch + 1/4 + 1/4h2 = 0? -1 Let a(y) = y2 - 2y - 2. Let b be a(-2). Find z such that 3z*3 - 6z - 12z4 + 9z*3 + 9z*3 - bz*3 + 21z*2 = 0. -1, 0, 1/4, 2 Let g = 237 + -2131/9. Find n, given that -gn*2 - 4/9n - 2/9 = 0. -1 Let q(t) = -6t2 + 11t - 7. Let f = 8 + -13. Let k = f - -4. Let w(o) = o*2 - o + 1. Let d(m) = kq(m) - 3w(m). Find s, given that d(s) = 0. 2/3, 2 Find p such that 521p - 4p2 - 2p*3 + 2p*4 - 521p = 0. -1, 0, 2 Factor -1037 + 1035 - 23f - f - 96f*2 - 128f*3. -2(4f + 1)3 Let s = 2806/3 - 919. Factor 23/3p*2 - 4/3 - 67/3p*3 + 16/3p - sp5 - 119/3p4. -(p + 1)3(7p - 2)*2/3 Let t be 4 - (-2 - 52/(-9)). Let u be (-3 - 1)/((-36)/4). Factor -2/9f*3 - uf*2 - tf + 0. -2f(f + 1)*2/9 Let k(n) be the first derivative of 1/10n*2 - 3 - 1/15n*3 + 1/5n - 1/20n4. Factor k(h). -(h - 1)(h + 1)*2/5 Suppose 5f = 2f + 18. Let t = 1 - -1. Factor -v3 - v3 - fv*2 - tv*3 - 1 + 0v*3 - 4v - v4. -(v + 1)4 Let o = 535 - 51359/96. Let c(s) be the third derivative of 0s - 1/480s*6 - 1/24s*3 + 0 + 1/240s*5 + os*4 + 3s*2. Solve c(b) = 0 for b. -1, 1 Determine g, given that -3/2g*2 - 1/6g*4 - 1/3 + 5/6g*3 + 7/6g = 0. 1, 2 Let w be 1 + -4 - (-2 + -1). Factor 2/7 + wy - 2/7y*2. -2(y - 1)(y + 1)/7 Let c be (-30)/(-2 + -4)(-4)/(-330). Let r(p) be the first derivative of -1 + 1/33p6 + 6/55p*5 + cp*3 + 0p*2 + 3/22p*4 + 0p. Factor r(t). 2t2(t + 1)*3/11 Factor -2/5 - 2/5h*2 + 4/5h*4 + 4/5h*3 - h + 1/5h*5. (h - 1)(h + 1)*3(h + 2)/5 Let 1/6u + 1/6u*3 + 1/3u*2 + 0 = 0. What is u? -1, 0 Let o = 51 - 48. Suppose 0 - 7/3w*5 + 2/3w + 3w2 + 5/3w*3 - ow*4 = 0. What is w? -1, -2/7, 0, 1 Let l(m) be the third derivative of 1/105m*7 + 0m*4 + 0m*6 + 0 + 0m + 0m3 - 5m*2 - 1/30m*5. Factor l(k). 2k*2(k - 1)(k + 1) Let k(n) be the third derivative of n6/1980 - n5/330 + n4/132 + n3/2 + n2. Let r(o) be the first derivative of k(o). Find y such that r(y) = 0. 1 Let p = 3 + -1. Determine v, given that -p - 10v - 16 - 3v2 - 9 - 8v = 0. -3 Let o(f) = -f*3 - 3f*2 + 13f + 15. Let h be o(-5). Let -2/3b3 + h + 4/3b*2 - 2/3b = 0. Calculate b. 0, 1 Let g(x) = x*3 - 5x*2 + x + 1. Let b be g(5). Let u be ((-6)/(-16))/(9/b). What is t in 0 + 0t - 1/4t3 - ut*2 = 0? -1, 0 Suppose 0g + 4g - 8 = 0. Suppose 4b - 4 - 20 = -2h, 5h + 4b - 54 = 0. Factor hc*3 + 5 - 8c - 2c4 + 5 - 12c*g + 6. -2(c - 2)*3(c + 1) Factor 12v3 + 6v*2 + 5v*4 + 8v - 2v4 - 20v - 4 - 5. 3(v - 1)(v + 1)*2(v + 3) Let g(o) be the first derivative of -o*3/3 + 4o - 6. Factor g(q). -(q - 2)(q + 2) Let u(a) be the third derivative of a7/1890 + a6/135 + 4a*5/135 - 25a*2. Suppose u(b) = 0. What is b? -4, 0 Let k be (-470)/(-20) + (-1)/2. Let r = k - 45/2. Factor 1/2a3 + a4 - 3/2a2 + 1/2 - ra. (a - 1)(a + 1)2(2a - 1)/2 Let w be (-12)/(-16)(4 - 0). What is i in 2i4 + iw + 4 - 16i - 6i2 + 18i - 3i3 = 0? -1, 1, 2 Let t = -16 + 19. Solve o3 + to*3 + 9o + 12o2 + o3 + 2 = 0. -1, -2/5 Let z(t) = 14t*2 - 2t + 8. Let u(g) = -5g2 + g - 3. Let d(l) = 8u(l) + 3z(l). Factor d(w). 2w(w + 1) Let g = 20285/7 + -170455/63. Let q = g + -192. Factor -2/9b + 0 - qb2. -2b(b + 1)/9 Let l = 181 + -177. Find b such that -4/7b + 0 - 9/7b5 + 6/7b*l - 4/7b*2 + 11/7b3 = 0. -2/3, 0, 1 Factor s2 - 1/2s + 0 - 1/2s*3. -s(s - 1)*2/2 Let r be (-4)/10 + (-4)/20. Let u = r - -1. Factor 2/5f*2 - u - 2/5f + 2/5f3. 2(f - 1)(f + 1)2/5 Let p(v) = v - 2. Let y be p(4). Factor -3q*y + 0 - q - 8q + 1 - 7. -3(q + 1)(q + 2) Let w be (-33)/(-4) - 1/4. Suppose -3t = -t - w. Find c such that -tc3 - c5 + c*3 - 3c*2 + 4c*2 + 3c*4 = 0. 0, 1 Let y be 3 - 4 - -4 - -25. Find b such that -24b*3 - 4b*2 + 7b*4 - 8 + 20b*4 + yb - 14b2 - 3b3 = 0. -1, 2/3 Let n(t) = -t3 + 2t2 + 5t - 2. Let o be n(3). Suppose 0 - 2/3a3 + 2/3a*2 - 2/3a*o + 2/3a = 0. What is a? -1, 0, 1 Suppose -m + 0m - 3 = 0. Let r be -3(2/m - 0). Factor -2b2 - b2 + b2 - rb. -2b(b + 1) Solve 0a4 + 0 - 16/7a*3 + 2/7a*5 + 0a*2 + 32/7a = 0. -2, 0, 2 Let i(y) be the first derivative of y*4/3 + 2y*3 + 4y*2 - 5y + 7. Let m(k) be the first derivative of i(k). Factor m(r). 4(r + 1)(r + 2) Let i(j) = j*2 + 6j + 7. Let z be i(-5). Let -4m + 8 - 5 - mz - 1 + 3m*2 = 0. What is m? 1 Let p(d) be the first derivative of 2d*3 - 3/4d*4 + 3/2d*2 - 2 - 6d. Factor p(c). -3(c - 2)(c - 1)(c + 1) Let p be 0 + -8 - 1440/(-150). Determine m, given that pm*3 + 0m*4 - 2/5m*5 - 4/5 + 4/5m*2 - 6/5m = 0. -1, 1, 2 Suppose 4 = -3i + 19, 4i - 20 = -2r. Suppose r = -s + 5s - 8. Factor -1/2h3 + 0 + 1/4h*s + 1/4h*4 + 0h. h*2(h - 1)*2/4 Suppose -3y = -5f - 14, 0 = 4y - f + 4f - 9. Factor 18j*3 - 5j*3 - 4j - 12jy. j(j - 2)(j + 2) Let b(x) be the third derivative of x10/680400 + x9/272160 + x5/15 + 4x*2. Let j(y) be the third derivative of b(y). Factor j(g). 2g*3(g + 1)/9 Suppose 0 = -0r + 2r - 6. Let 0s3 - 15s + 6 + 9s2 - 3s*4 + 3s*3 + 0s*r = 0. What is s? -2, 1 Suppose -45 = -3s - 2s. Suppose 5l - 1 - s = 0. Factor -6q3 - 5q + 6q4 + 3q - lq5 + 2q*2 + 2q. -2q2(q - 1)*3 Let o be (3 + 1)/(2/32). Factor ol + 343l3 - 8 - 294l*2 + 4l + 16l. (7l - 2)3 Let g = -4 - -10. Factor -b2 - 2 - 2b - b2 + gb. -2(b - 1)2 Let z be ((-490)/4)/(-13 + 15). Let u = -61 - z. Solve uh*2 - h + 1 = 0. 2 Let 12/5k*4 + 18/5k*3 + 2/5k*5 + 0 + 0k + 8/5k2 = 0. Calculate k. -4, -1, 0 Let c(j) be the third derivative of 1/420j*7 - 1/240j*6 + 0j + 0j3 - 1/120j5 + 0 - j2 + 0j4 + 1/672j8. Factor c(m). m2(m - 1)(m + 1)*2/2 Suppose 23 = 4a - 3i, -3 = -0a - 4a - i. Determine o, given that -16o*2 + 3 + 13o*a + 0 = 0. -1, 1 Let m(h) be the first derivative of -4/3h - 6h2 + 3 - 9h3. Let m(x) = 0. What is x? -2/9 Let n(y) be the second derivative of -y5/60 - y*4/4 - 3y*3/2 + 2y*2 - 4y. Let t(i) be the first derivative of n(i). Factor t(p). -(p + 3)2 Let g(q) be the first derivative of q7/735 + q6/140 + q5/105 - 2q2 + 2. Let w(n) be the second derivative of g(n). Factor w(i). 2i*2(i + 1)(i + 2)/7 Let y be 1(-6)/(-1) + 2. Determine o, given that -6 + 3 - 1 - yo2 - 2o*3 - 10o = 0. -2, -1 Factor -32/5	{ "pile_set_name": "DM Mathematics" }
520749 Add together -326.813201 and 0.2. -326.613201 0.055 + 585973 585973.055 Calculate 9.27 - -15711563. 15711572.27 Calculate -432074 + 270. -431804 Work out -0.076 - 41829769. -41829769.076 What is the distance between 4746 and 7235? 2489 What is the difference between 196.1677 and 24? 172.1677 Work out -0.5 - 29342385. -29342385.5 Subtract -0.3 from -0.718951823. -0.418951823 Work out 6 + -24560950. -24560944 Total of 20.46 and 409412. 409432.46 What is -713.3 less than 1343565? 1344278.3 Calculate 465 - 1273319. -1272854 Sum 1801 and 49963.8. 51764.8 Calculate -0.1 - -291458072. 291458071.9 Sum 4327.9444 and 0. 4327.9444 What is -35 + -193779799? -193779834 Work out 1988.9757 - 0.2. 1988.7757 Add together 31159 and 10. 31169 What is -0.3 - -520787177.7? 520787177.4 What is the difference between 894485.3 and 2.818? 894482.482 What is -8062 plus 0.0423784? -8061.9576216 Sum 775857.863 and 2. 775859.863 Work out 42804 - -153737. 196541 Calculate -10448 - 10222.9. -20670.9 What is -2508698 plus -4? -2508702 0.1+14544771 14544771.1 Put together -0.5 and -1487113. -1487113.5 Subtract 261.55268 from -1.4. -262.95268 875452307 + 2 875452309 -22 - 40932870 -40932892 Work out 0.15411432 + 0.2. 0.35411432 What is 0.2324 plus -90978? -90977.7676 Sum -312334262.7 and 0.2. -312334262.5 What is 5575402 plus -0.1? 5575401.9 Calculate -3.7132 + 3061. 3057.2868 Total of -5 and -2388227.72. -2388232.72 Work out -6501 - 7547.1. -14048.1 Sum 26 and 45652731. 45652757 What is 0.03 - 652.49751? -652.46751 Calculate 0.0316327562 - 4. -3.9683672438 Sum 1182010 and 13. 1182023 -1 - -185.26583484 184.26583484 Work out 80645 - -177.39. 80822.39 Add 292699 and -1063. 291636 0.5 - -207436 207436.5 What is -0.02 minus -5.43017804? 5.41017804 What is -7 minus 14871.47? -14878.47 What is 45.65 minus 73.69? -28.04 Sum -409014 and -5.72. -409019.72 Work out 3 + -4170309. -4170306 -171+-174.71 -345.71 What is 0.5158 less than 0.139? -0.3768 What is 1290852019 less than -0.2? -1290852019.2 Calculate -0.9567 - 1369.8. -1370.7567 Subtract -3 from -55675964. -55675961 -1423941 - 5231 -1429172 What is -3 - 484063.227? -484066.227 What is the distance between -0.038 and -27254398.4? 27254398.362 0.32549912 + -0.46 -0.13450088 What is -0.01 minus -3173177? 3173176.99 Total of 1299.3 and 2717994. 2719293.3 Total of -3319705 and 3679. -3316026 Calculate -0.4 - 4423956. -4423956.4 What is 516227.54 less than -25.5? -516253.04 -8+19059.666 19051.666 Calculate 1.54 - -29. 30.54 Calculate 20060989 + 4. 20060993 Put together -420535.7 and 703. -419832.7 Put together 98.54996 and 0.4. 98.94996 Sum -54796.33129 and -5. -54801.33129 Subtract 0.01 from -261174. -261174.01 What is the distance between 230 and 55097351? 55097121 What is -0.0626369 take away 180005? -180005.0626369 36593235 + 1.5 36593236.5 Work out 492.7 - -587418. 587910.7 What is 0.08 + 13062433? 13062433.08 Add 24 and -4814730. -4814706 Total of 0.03713095 and -0.4. -0.36286905 What is 68358189 + -0.3? 68358188.7 What is -17936693 - 27? -17936720 What is -63 - -108.790028? 45.790028 What is 592522 less than -0.017? -592522.017 What is the distance between -213.703 and -526321? 526107.297 Sum -0.4 and 132000.51. 132000.11 Sum 0.1 and -991586.164. -991586.064 -271.418 - 0.53 -271.948 Subtract 9 from 95204446. 95204437 -25696+-3.154 -25699.154 What is 1926 less than 578.0801? -1347.9199 What is -0.1984 + -13581.8? -13581.9984 Total of -1072 and 515.51. -556.49 What is -148.5548525 minus -5? -143.5548525 299.941 - 1449 -1149.059 What is 2.51 plus -283.05319? -280.54319 What is -3983 + -0.077589? -3983.077589 What is the distance between 0.6 and 0.04576572? 0.55423428 Calculate -45732.95 + 63. -45669.95 What is -203123 minus 19650? -222773 Add together -0.47399 and -437. -437.47399 What is 6 less than -750.2445? -756.2445 What is 0.14 less than 609914823? 609914822.86 191+-6664.2367 -6473.2367 What is -6.7 take away 164898? -164904.7 Work out -6083.208 - -391. -5692.208 What is the distance between 10363.811 and -15.8? 10379.611 What is -11 plus -329685? -329696 -0.8302644 - 0.4 -1.2302644 What is -12616 - 0.064? -12616.064 Total of 80 and 88157458. 88157538 What is 3 + 49805.491? 49808.491 Add together 886 and -2.4998. 883.5002 0.2+-35.239002 -35.039002 What is 76 take away -10187212? 10187288 Work out -1.6 + 559274. 559272.4 What is -45 minus 3013.66? -3058.66 Calculate -16882898501 + 0.3. -16882898500.7 What is 3 less than 9194605? 9194602 What is 1084351 take away -3.3? 1084354.3 Work out -0.336382191 + -0.1. -0.436382191 Add -10.3 and -164760. -164770.3 Work out 1 + -0.177021233. 0.822978767 What is -41286.8486 take away 0? -41286.8486 Put together 3077459.3 and -0.38. 3077458.92 What is -3.5 plus 3469.888? 3466.388 Calculate 1196962 - 117.9. 1196844.1 What is -136280 take away 123.1? -136403.1 Total of -1229645119 and 4.2. -1229645114.8 What is 0.02 less than -402789.567? -402789.587 What is 0 less than 57603527171? 57603527171 -17746 + -0.3601 -17746.3601 What is -174 + 0.4312526? -173.5687474 -0.074188 + -10 -10.074188 Add 18134 and -59. 18075 Subtract -0.12 from 0.0873584. 0.2073584 Sum -39343 and -8. -39351 Calculate -26.9522 - 332. -358.9522 Subtract 0.18 from -332194.675. -332194.855 Work out -15 - 1482.087. -1497.087 Total of 25697 and 602502. 628199 What is -183 less than -195403272? -195403089 Work out -5956329 - 1238. -5957567 Work out -102 - 215096123. -215096225 What is -41 plus 4741.753? 4700.753 What is -2344488 - 38.1? -2344526.1 Put together 10340350 and 0.007. 10340350.007 What is 0.9389 take away 394.4? -393.4611 What is the distance between 86.0179 and 10.13? 75.8879 Subtract 0 from -70959810. -70959810 -7250.1 - 1 -7251.1 Subtract -1801.15 from -550. 1251.15 Total of -0.11 and 244689. 244688.89 Subtract 2247794 from -246. -2248040 Work out 0.1 - 8312084. -8312083.9 Work out -376725 + 1661. -375064 What is -5807.75 - -32.9? -5774.85 What is the distance between 139.4 and -3903182? 3903321.4 3 - -14779412 14779415 What is 2 plus -2590746? -2590744 -7759+1054.8 -6704.2 Sum 0.08004591 and -13. -12.91995409 Add together -5161414539 and 1. -5161414538 What is 1 take away -145338744? 145338745 2788988+4916 2793904 Work out -2126695 - 0.8. -2126695.8 Subtract -5824.26 from -8. 5816.26 2 + 4918121836 4918121838 What is -14 plus -99305784? -99305798 What is the difference between 879.830306 and -8? 887.830306 What is 1078645 + 688? 1079333 What is the difference between 0.741 and 16710635? 16710634.259 -1916173684+-3 -1916173687 What is the difference between -7 and -84076623? 84076616 Add together -82 and 110219. 110137 What is the difference between 2743 and -98775? 101518 10992.27 - -232 11224.27 What is -7.30593 take away -10.73? 3.42407 What is the difference between 1.525494 and 0.01? 1.515494 Calculate 0.3 + -0.04117668. 0.25882332 -91.24+803.966 712.726 What is 46.249303 take away 0.2? 46.049303 Work out 323797454 + 1. 323797455 What is -0.3 - 0.130723258? -0.430723258 What is -7201341 take away -26? -7201315 Add -0.06 and 1588.7. 1588.64 Work out 11.1656 + 32.39. 43.5556 0.0877766962 + 3 3.0877766962 49215943+-5 49215938 Calculate 0.2 - 28.33870641. -28.13870641 Calculate 33.5 - 18767655. -18767621.5 Subtract 4.1189 from 26682. 26677.8811 Calculate -6212917471 - 2. -6212917473 What is the distance between 64440 and -0.037505? 64440.037505 Add together 2109 and -13761806. -13759697 Total of 0.5 and -25974.409. -25973.909 Calculate -42.1 - 2354752. -2354794.1 Work out 2 - 399803.9. -399801.9 Sum 380 and 0.828739. 380.828739 Sum 2409637.3 and -0.184. 2409637.116 What is 122.5904 plus 1854? 1976.5904 What is -203913 plus 0.07? -203912.93 -0.089 - -22366322 22366321.911 Calculate -16664 + 4362. -12302 Add together 0 and 3911785. 3911785 What is -12026.2 minus 3124? -15150.2 What is -1003833 take away 19? -1003852 What is the difference between 7 and -5.877539? 12.877539 Calculate -1631720 - -0.22. -1631719.78 -5498149 - 0.2 -5498149.2 Calculate 400 + -904856. -904456 Add together -489060 and -2.5. -489062.5 Sum 95492 and -13.7. 95478.3 What is -0.0508472 - -0.17? 0.1191528 Work out 160229711 - -31.1. 160229742.1 Calculate 2.3306 + 78.695. 81.0256 Subtract -0.08 from -27525621. -27525620.92 -1.0273069 -	{ "pile_set_name": "DM Mathematics" }
0c - c) + c - c + 2c). 12c2 Expand (-10 + 9 - 2i + 3i2 - 3i)(3 + 1 - 2). 6i*2 - 10i - 2 Expand (2 - 2 - 2)(-2i + 4i - 3i) + (1 + 2 - 1)(26i - 54i + 29i). 4i Expand 2v*2 - 1 + 1 + (3v + 0v - 2v)(v + 3v - 3v) + 0v*2 + 2v*2 - 6v*2 + (-2v + 0 + 0)(-2v + 0v + 3v) + 3v - 3v - v*2. -4v*2 Expand (7 - 7 - 4)(24b2 + 25 - 25). -96b*2 Expand (3d*3 - 4d + 4d)(-2d - 5d + 2d) + (2d*2 + 2d*2 - 6d*2)(d*2 - 2d*2 + 0d*2). -13d*4 Expand (2b*2 + 0b*2 - 5b*2)(-b - 3b + 0b - 1). 12b3 + 3b*2 Expand (-1 - 3 + 6)(-r + 28 - 73 + 36). -2r - 18 Expand (-1 + 16f + 0 - 20f)((3 - 4 + 2)(3f - 6f + f) + 7f - 3f - 3f). 4f2 + f Expand (-3 + 2 + 0)(-14k3 + 40k*3 + 15k*3). -41k*3 Expand (-18 + 6 + 4)(-2w3 - 2w*3 - 10w + 8w). 32w*3 + 16w Expand (-4 + 4 - 4k3)((-5 + 6 - 2)(1 - 1 - 1) - 4 - 2 + 8). -12k*3 Expand (-2l - 2l + 2l)(-2l*2 - 3l*2 + 6l*2) - 9l*3 - 10l*2 + 10l*2. -11l3 Expand -p2 - 5p3 + p2 + 0p*3 + 4p*3 - 2p*3 + (-3p + 2p - p)(-4p2 + 7p*2 - 15p*2). 21p3 Expand -n2 + n3 + n2 - 3n3 + 0n*3 + 4n*3 + (3n + 0n - n)(3n2 + n2 - 3n*2). 4n*3 Expand (4 - 1 - 2)(-2 + 7 - 3)(6i*2 + 5i*2 + 4i*2). 30i*2 Expand (-163w - 35w + 30w)((-3 + 3 + 2w*2)(1 - 2w - 1) + w3 - w3 - 2w*3). 1008w*4 Expand 0o - o + 0o + 2o + 29o - 13o + (o + 0o - 2o)(-4 + 7 - 2) - o + 0o + 0o - 2o - 3 + 3. 13o Expand (2 - 1 + 0)(-2 + 2 - 2z2)(3z2 + 1 - 1). -6z*4 Expand (-n + 3n + n)(4n - n - 5n + (n - n - n)(-3 + 1 + 4) - 3n + 2n - n)(0n - 3n + n). 36n*3 Expand -2v*2 - v + v + (v + 0v - 2v)(0 + 0 + v) - v*2 + 3v*2 - 3v2 + v2 + 0 + 0. -3v2 Expand 3k*4 - 4k4 - k4 + (0k4 - 2k*4 - 5k*4)(-3 + 0 + 4). -9k4 Expand (-9 + 2 + 1)(6 - 6 + 3u). -18u Expand 3g2 + g2 - 5g*2 + (-2 + 5 - 4)(2g2 - 10g*2 + 4g*2). 3g*2 Expand 182a*2 - 24a*3 - 182a2 + (a3 + 2a - 2a)(1 - 3 + 4). -22a*3 Expand ((-2 + 1 - 1)(4 - 5 + 2) + 5 - 3 - 3 + 3 - 2 + 1 - 1 - 5 + 3)(4i*4 + 1 - 1). -16i*4 Expand -2u*5 + 3u*5 - 2u5 - u5 - 2u3 + 2u*3 + (-6u*4 + 2u*4 - 5u*4)(0 - u + 0). 7u5 Expand (5o - o - 5o)(o + 3o + 4 + 3o)(3 - 1 - 3). 7o*2 + 4o Expand (0q - 3q + 4q)(1 - 1 - 3)(-3 + 4 + 0) + (8 + 2 - 2)(0q + q + 0q). 5q Expand (4 - 4 - 4b)((0b + 0b + b)(2 - 3 - 2) + (-2b + 3b + 0b)(-4 + 0 - 1)). 32b2 Expand 5h*3 - 4h*3 + 4h*3 + (-3 + 2h*2 + 3)(3h - h - 4h) + (-3 + 6 - 2)(-2h3 + h - h). -h3 Expand 1 + 1 + f + 0f + (0f - f - f)(-1 + 1 - 4). 9f + 2 Expand (-3 + 3 + z)(2z + 2z3 - 2z) - 3z4 + 2z*4 + 0z*4 + 3z*4 + 8z*4 - 3z*4 + (4z*3 - 6z3 + z3)(-2z + 2 - 2) - z*4 + 2z4 + z4. 13z4 Expand (2f + 0f - f + 3f + 4 - 4 + (0f - 2f + f)(-2 + 0 + 0) - f + f + 2f - 2f - 1 + 1)(-4 - 1 + 10). 30f Expand (-1 + q - 2q + 3q)(q + q - 3q). -2q*2 + q Expand (2g*5 + 0g + 0g + (4 + 1 - 2)(4g5 - 4g5 - g5))(3 + 1 + 2). -6g*5 Expand (-1 + 1 - p)(-3p2 + p2 + 0p*2) + (2p2 - p2 - 3p2)(4 - 2 - 4)(-4p + p + 5p). 10p3 Expand (-2 + u3 + 2)(3u - 3u - u2) - 21u*5 - 21u*5 + 11u*5. -32u*5 Expand (1 + 2u*3 - 1)(-5 + 1 - 5). -18u3 Expand (4 - 5 - 3)(0s4 + 9s*4 + 34s*2 - 35s*2). -36s*4 + 4s*2 Expand (-11 + p + 11)(8 - 17 - 7 - 33). -49p Expand (4u + 0u - 5u)(2u + u - u) - 9u2 - u + u2 + 3u. -10u2 + 2u Expand -6z2 - z2 + z2 + (-2z + 1 - 1)(-5z + 4z + 2z) - 2z + 2z - 2z2 + (0 + 2 - 4)(-4z2 + 6z2 - z2). -12z2 Expand (-4a3 + a3 + 5a3)(-10 - 7 + 4). -26a3 Expand 0p5 + p5 + 0p5 - 51p*5 + 27p*5 - 17p*5 + (3p + 3p - 5p)(2p*3 + 2p*4 - 2p*3). -38p*5 Expand (2 + 1 + 3)(0y + y3 + 0y)(-15 + 15 - 3y). -18y4 Expand (-4s + 3s + 3s)(-41 + 1 - 10). -100s Expand (-4g2 - 7 + 7 + (3 - 3 - g2)(2 + 3 - 4))(-g3 + 2g*3 - 3g*3). 10g*5 Expand (4m + 86 - 86)(4 - 2 - 4). -8m Expand (-5y3 + y3 + 6y*3)(-14y + 1 + 1 - 5). -28y*4 - 6y*3 Expand (-4 - g + 4)(6g - 5g + 2g + (1 - 3 + 3)(-2g + 3g - 3g)). -g2 Expand (4h - 5h + 0h)(-1 - 1 + 1) - 7h - 4 + 4 + 0h + 3h - 4h + (3 + 4 - 5)(-5h + 4h - h) - 2h + 0h + 4h. -9h Expand 3 + 5 + 2 + 2t3 + t4 + (-t3 + 0t*2 + 0t*2)(-4t + 5t - 3t). 3t*4 + 2t*3 + 10 Expand 8 - 8 + 3n + (2n + 3 - 3)(7 - 2 - 3) + 3n - 3n + n + (0 - 1 + 2)(0n + 4n - 3n)(1 + 0 - 3). 6n Expand -12n2 - 11n*3 + 12n2 + n3 - 3n3 + 3n*3 + (-6n + 4n + 4n)(2n*2 + 2 - 2) - 3n*3 + 2n*3 + 0n3 + n3 - 3n3 + 3n*3. -6n3 Expand (m3 - 3m3 + 0m*3)(-4m2 - 9 + 9) + 5m*5 - 4m*5 - 5m*5. 4m*5 Expand (11 - 9u - 11)(-3 + 3 + u)(3 + 0 - 1). -18u2 Expand 1871 - 1871 - g3 - g3 + 2g - 2g + (-2g*2 + 4g*2 - 3g*2)(g + 2 - 2). -3g3 Expand 3h*2 - 4h + 4h + (-5h2 + h2 + 2h2)(0 - 5 + 4) - 2h2 + 0h*2 + 3h*2 + 3h + h*2 - 3h. 7h2 Expand -28a + 28a - 4a4 + (a4 - 3a4 + a4)(6 + 0 - 4) + 0a3 - 2a4 - a3 + 2a3. -8a4 + a3 Expand (6 + 3 - 16)(-5m*2 + 3m*2 + 0m*2) - 4m*2 + 5m*2 + 2m*2 + (-1 + 1 + 2)(-m*2 + 0m2 - m2). 13m2 Expand (-p3 + p2 - p2)(-16p - 4p + 3p). 17p*4 Expand (9p*2 + 15p - 15p)(p*2 - 2p*2 + 2p*2). 9p*4 Expand (-1 + 1 + 2)(3f2 + 15f*2 + 3f*2). 42f*2 Expand -2z*2 - 2 + 2 - 3z*2 - 4z + z + z + (2z - 2z + z*2)(3 - 5 + 0) - 4z2 + 2z*2 + 0z2 + z2 + 4z2 - 6z*2. -10z*2 - 2z Expand (-1 - 4 + 0)(-n + 2n - 2n). 5n Expand (0b + 0b - 2b)(0b + 0b - 2b2) - b3 + 3b3 - b3. 5b3 Expand (-3 + 6 - 1)(4c - 2 + c5 - 3c*3 + 2020c*4 - 2020c*4). 2c*5 - 6c*3 + 8c - 4 Expand -a - 4a + 3a + (-7a + 2a + 4a)(-3 + 4 + 1) - 3a + 0 + 0. -7a Expand (0y + 4y - y)(3y*2 + 0y2 - y2). 6y3 Expand 3p*2 - 3p2 + p2 + (5p2 + p2 - 5p*2)(0 - 2 + 1) + (p*2 + 2p - 2p)(5 - 6 + 5). 4p2 Expand (2 - 2 - t)((-t + 2t + t)(0 + 3 - 2) + 0t + 4t - 3t - 82 - t + 82). -2t*2 Expand (-8s*2 - 23s*2 + 2s*2)(-s*2 + 0s2 - s2). 58s4 Expand (0q - q - 3q)(-9q3 - 7q*2 + 7q*2). 36q*4 Expand -8t*2 - 29t + 29t + 3t2 - t2 - t*2 + (5t - 3t - 3t)(-3t + 2t + 3t). -9t2 Expand -l + 5l - 3l + (0l + l - 3l)(-5 + 1 + 3)(44 - 18 - 20). 13l Expand h*3 - 3h*3 + 0h*3 + (0 + 1 - 2)(0h3 - 4h*3 + 3h*3) - 2h*3 + 2h*3 - 2h*3 - 4h*3 - 2h3 + h3. -8h3 Expand (-5i - 3 + 2 + 3i)(2i - 2 + 2 + (-2i + 1 - 1)(1 - 2 - 1)). -12i*2 - 6i Expand 4i2 - 4i*2 - 2i*4 + 5 - 5 - 7i*4 - 2i*4 - 3i*4 + 3i*4 + (i - 1 + 1)(4i3 + 3i*3 - 6i*3). -10i*4 Expand (3 - 3 + 2h*4)(4 - 13 + 1). -16h4 Expand (-2 - 2 + 3)(-3d3 - 3d*3 + 3d*3)(d*2 + 2d2 - d2). 6d5 Expand (-g - g + 0g)(3g - 2g + 2g)(-g2 + g2 + 6g*2). -36g*4 Expand (-6z*2 + 2z*2 + 2z*2)(-141 + 8z + 141 + 2z*2). -4z*4 - 16z*3 Expand (6 + 3p + 3 - p)(2 + 4p - 2). 8p2 + 36p Expand (-g + 2 + 4 - 1)(-2g*4 - 1 + 1). 2g*5 - 10g*4 Expand (-r + 0 + 0)(-16 + 1 + 0). 15r Expand -2l*2 + 2l*4 + 2l*2 + (-2l - 2l2 + 5l2 - l2)(l2 + 1 - 1). 4l*4 - 2l*3 Expand (-s - 8s + 0s)(-4s + 6s + 2s). -36s*2 Expand (-2q - 3q + 4q)(-4 + 5 - 2)(44 - 14 - 14). 16q Expand (n - 5n + 2n)(-13n + 39n + 12n). -76n*2 Expand (-2d - 2d + 2d)(1 + 2 - 5)(-3 - 3 - 1) + (3d + 3d - 7d)(0 + 3 - 1) - 3d - d + 3d. -31d Expand (1 - 2b - 1)(2b*3 + 11b - 9b - 37b). -4b4 + 70b*2 Expand (-6f + 2f + 2f)(-1 - 3 + 3)(5f2 - 13 + 13). 10f*3 Expand (-2w - 4 + 4 + 0w + w + w + (2w - 5 + 5)(3 + 3 - 5))(5w - w - w). 6w*2 Expand (0o + 6o - o + (1 - 1 + 3o)(-5 + 2 + 1))(0 + 3 - 2)(3 - 1 - 1). -o Expand (y - y + 5y)(-1 - 3 + 1). -15y Expand (-3b3 + b3 + 4b*3)(-4 + 7 - 5 - 2b). -4b*4 - 4b*3 Expand (-2n*5 + 0n*5 + 0n*5 + (3n*3 - 5n*3 + 3n*3)(n*2 + 2n*2 - 4n*2))(1 - 3 + 0). 6n*5	{ "pile_set_name": "DM Mathematics" }
multiple of 16? True Is 11200 a multiple of 17? False Is 2393033 a multiple of 3? False Does 62 divide 358299? False Is 418304 a multiple of 38? True Is 51 a factor of 11920026? True Is 6 a factor of 4640487? False Is 98 a factor of 2343941? False Is 25470 a multiple of 10? True Is 617 a factor of 3162742? True Is 675 a factor of 191553? False Is 16 a factor of 784366? False Does 289 divide 138720? True Is 2025750 a multiple of 146? True Is 485805 a multiple of 5? True Does 335 divide 5052470? True Is 20107 even? False Does 16 divide 61384? False Is 562016 a multiple of 16? True Does 23 divide 317933? False Is 7 a factor of 2012172? False Is 73 a factor of 179021? False Does 12 divide 1850419? False Is 2 a factor of 1116295? False Is 291 a factor of 3265672? False Does 74 divide 4280456? True Does 333 divide 3091239? True Is 665722 a multiple of 3? False Does 6 divide 41902? False Does 49 divide 5978? True Is 133 a factor of 3502041? False Does 163 divide 141973? True Is 5 a factor of 481475? True Is 167522 a multiple of 4? False Is 2696696 a multiple of 78? False Is 217009 a multiple of 197? False Does 33 divide 237915? False Is 993535 a multiple of 5? True Is 513 a factor of 165449? False Is 3025838 a multiple of 13? False Is 24 a factor of 1548477? False Is 254996 a multiple of 186? False Is 105 a factor of 1053990? True Is 15368 a multiple of 9? False Is 541 a factor of 1325047? False Does 432 divide 21168? True Is 15 a factor of 2887530? True Does 3 divide 13002? True Does 4 divide 220874? False Is 3432525 a multiple of 909? False Is 118580 a multiple of 118? False Is 41 a factor of 23821? True Does 158 divide 510542? False Is 45479 even? False Is 825513 a multiple of 126? False Is 99376 a multiple of 9? False Is 281 a factor of 398177? True Is 141253 a multiple of 20? False Does 1247 divide 1465225? True Is 224805 a multiple of 45? False Is 89031 a multiple of 177? True Is 9 a factor of 271096? False Is 19355965 a multiple of 335? True Is 262 a factor of 541189? False Does 45 divide 122891? False Does 8 divide 1770656? True Is 6909397 a multiple of 337? False Is 438792 a multiple of 151? False Does 96 divide 4849593? False Is 9 a factor of 1257876? True Does 127 divide 1380109? True Does 325 divide 183490? False Is 338 a factor of 976144? True Does 358 divide 162584? False Is 4 a factor of 61620? True Is 2448170 a multiple of 9? False Is 4535565 a multiple of 125? False Is 456118 a multiple of 53? True Is 28 a factor of 1229872? True Is 52824 a multiple of 8? True Does 253 divide 15418073? True Is 194543 a multiple of 23? False Is 27015 a multiple of 96? False Does 150 divide 60750? True Is 145472 a multiple of 8? True Is 38 a factor of 1462164? True Is 1610782 a multiple of 19? True Is 188630 a multiple of 13? True Is 501 a factor of 315716? False Is 2671732 a multiple of 12? False Does 126 divide 6632793? False Is 1458 a factor of 4512510? True Is 20 a factor of 24880? True Is 10581 even? False Is 181 a factor of 3078542? False Does 26 divide 11802119? False Is 88 a factor of 9941933? False Does 50 divide 122180? False Is 1133792 a multiple of 10? False Is 8 a factor of 1700736? True Is 46210 a multiple of 12? False Does 125 divide 106690? False Does 1175 divide 4933825? True Does 38 divide 143942? False Does 1913 divide 22506445? True Is 26 a factor of 2127136? False Is 57 a factor of 80769? True Is 1305331 a multiple of 531? False Does 201 divide 276526? False Is 5663 a multiple of 14? False Is 146392 a multiple of 232? True Is 160 a multiple of 4? True Is 768405 a multiple of 33? True Is 66 a factor of 2927430? True Is 119 a factor of 294685? False Is 675228 a multiple of 41? False Is 1522412 a multiple of 164? True Is 13 a factor of 113873? False Is 262 a factor of 850190? True Does 11 divide 1312797? False Does 143 divide 1074359? True Does 266 divide 246582? True Is 6146328 a multiple of 18? False Does 14 divide 128352? True Does 274 divide 152767? False Does 157 divide 14262? False Does 1387 divide 1982023? True Is 496268 a multiple of 104? False Is 1151982 a multiple of 9? True Does 59 divide 6709952? True Is 12 a factor of 1942332? True Does 18 divide 256024? False Does 38 divide 1026950? True Is 736 a factor of 6939744? True Does 27 divide 659776? False Is 5 a factor of 1144835? True Is 21188950 a multiple of 12? False Does 96 divide 6155520? True Does 29 divide 537457? True Does 28 divide 160188? True Is 832790 a multiple of 38? False Is 9 a factor of 1830240? True Does 17 divide 1466299? False Does 5 divide 297990? True Is 13 a factor of 530569? True Is 248 a factor of 224936? True Is 206 a factor of 10094? True Is 10 a factor of 121187? False Is 402492 a multiple of 158? False Is 539 a factor of 2331449? False Is 238128 a multiple of 16? True Is 90 a factor of 1855074? False Is 24 a factor of 8794800? True Is 9707 a multiple of 5? False Is 98685 a multiple of 43? True Does 28 divide 319396? True Does 1020 divide 3050154? False Is 5 a factor of 16585? True Does 730 divide 4747964? False Is 434 a factor of 72226? False Is 131412 a multiple of 5? False Is 15 a factor of 587870? False Does 2 divide 3489? False Is 20 a factor of 1580680? True Is 100 a factor of 9588? False Does 19 divide 5608002? True Is 327 a factor of 1002582? True Is 284987 a multiple of 521? True Is 66730 a multiple of 130? False Is 24828 a multiple of 5? False Is 23 a factor of 424528? False Is 112877 a multiple of 17? False Is 72216 a multiple of 134? False Is 24447801 a multiple of 21? True Is 5795629 a multiple of 587? False Is 11 a factor of 155743? False Is 2665590 a multiple of 30? True Does 150 divide 181449? False Does 76 divide 205517? False Does 2 divide 35548? True Does 1503 divide 882261? True Does 34 divide 915767? False Does 3 divide 7427? False Does 12 divide 4077767? False Does 41 divide 1698938? False Does 105 divide 229239? False Does 35 divide 103989? False Is 114 a factor of 11469969? False Is 107709 a multiple of 69? True Does 182 divide 135590? True Is 270 a factor of 462059? False Does 66 divide 219228? False Does 685 divide 2213235? True Is 16562083 a multiple of 71? False Does 53 divide 5230358? True Is 179 a factor of 186160? True Does 75 divide 1601616? False Is 5142955 a multiple of 50? False Is 183 a factor of 262422? True Is 52 a factor of 29640? True Is 40353 even? False Does 23 divide 87821? False Does 18 divide 703620? True Is 62 a factor of 155828? False Is 85 a factor of 37877? False Does 300 divide 133517? False Is 107 a factor of 2708254? False Is 6100418 a multiple of 89? False Is 64 a factor of 1024789? False Is 23 a factor of 3041925? False Is 85 a factor of 4335? True Is 1485952 a multiple of 52? True Does 21 divide 3319995? True Does 8 divide 806531? False Is 12 a factor of 1417524? True Is 149 a factor of 308472? False Does 614 divide 638946? False Is 9422440 a multiple of 515? True Is 740640 a multiple of 160? True Is 155264 a multiple of 52? False Is 555553 a multiple of 2? False Is 5 a factor of 13508? False Is 429 a factor of 5412132? False Does 518 divide 132090? True Is 25 a factor of 233627? False Is 443 a factor of 121031? False Does 108 divide 938952? True Is 86 a factor of 97696? True Does 393 divide 2605197? True Is 124127 a multiple of 29? False Does 341 divide 3812380? True Is 271607 a multiple of 241? True Is 15 a factor of 1187354? False Is 265088 a multiple of 218? True Is 152604 a multiple of 104? False Is 2 a factor of 2704? True Is 1083220 a multiple of 527? False Does 4 divide 129816? True Is 41013 a multiple of 330? False Is 1159825 a multiple of 9? False Is 863 a factor of 820843? False Is 114660 a multiple of 9? True Is 272 a factor of 603774? False Does 82 divide 424514? True Is 13 a factor of 58565? True Is 2825592 a multiple of 21? True Is 289852 a multiple of 124? False Does 17 divide 154689? False Is 46 a factor of 836832? True Does 105 divide 122850? True Does 41 divide 1757930? False Does 1745 divide 16977105? True Is 5 a factor of 53030? True Is 123 a factor of 7204? False Does 8 divide 43121? False Does 136 divide 2656950? False Is 4228596 a multiple of 23? True Is 573980 a multiple of 20? True Is 54 a factor of 435132? True Is 106656 a multiple of 176? True Is 52 a factor of	{ "pile_set_name": "DM Mathematics" }
n denominator of 27/8 and w? 104 Suppose 0k - 3 = -k. Let b be (2 - 1) + 14/(-2). Calculate the smallest common multiple of k and (0 - b)(-10)/(-20). 3 Let o = 9 - 5. Suppose -9 = 3q - 5x + 2x, -q = -2x + 7. Calculate the least common multiple of q and o. 4 Let u = 12 + -6. Suppose x = -2x + u. Let h = -21 + 23. What is the least common multiple of x and h? 2 What is the common denominator of (-7 - 86)(-2)/27 and 2/(-2) + (-164)/28? 63 Let g = -2/109 + -5991/218. Calculate the common denominator of 27/2 and g. 2 Let j(f) = f*3 - 3f*2 - 4f + 3. Let d be j(4). Suppose 2i + 2y - 32 = 0, -di = 2i - y - 56. What is the smallest common multiple of 10 and i? 60 Let k(m) = m*3 - 12m*2 - 14m + 15. Calculate the lowest common multiple of 4 and k(13). 4 Let p(q) be the second derivative of q5/20 - q4/3 - q*3/2 - 2q*2 + 6q. Suppose 2r + 3 = 7. What is the least common multiple of r and p(5)? 6 Suppose 2t + 2l = -90 + 12, -5t = -l + 207. Let i(z) = -z*2 + 4z - 1. Let a be i(3). What is the common denominator of ta/423 and 97/4? 28 Suppose -3y + 5 = -7. What is the smallest common multiple of 3 and y? 12 Let q(p) = -8p - 1. Let c be q(1). Let z = c - -11. Calculate the least common multiple of 3 and z. 6 Let n(d) = d + 3. Let v be n(-3). Suppose l + v = -6. Let i(m) = -m*2 - 10m - 1. What is the common denominator of -99/10 and i(l)? 10 Suppose 0q - 8 = -2q. Suppose g = 2g - 2b - 18, -3b - 97 = -5g. Calculate the lowest common multiple of q and g. 20 Let c = -185070/79933 - 2/4207. Calculate the common denominator of 71/4 and c. 76 Suppose 0w + 2w = 14. What is the smallest common multiple of 8 and w? 56 Let s be (-405)/11 - (-27)/9. Let u = s + 2569/88. Find the common denominator of 133/6 and u. 24 Let c = -3 + -2. Let i = 9/445 - -31568/1335. Find the common denominator of i and ((c - -1)2)/(-3). 3 Find the common denominator of 62/27 and (-5110)/(-1008) + 3/544. 216 Calculate the common denominator of 11 - (-2 - 5/(-3)) and 114/(-40) - (-4)/(-10). 12 Let f = 8 - 0. Suppose 1 = c - 3. Suppose 5q + p = 95, 4q + 0q + cp = 60. What is the least common multiple of f and q? 40 Let x = 387 + -9682/25. What is the common denominator of x and 18/55? 275 Let o = 24 + -15. Suppose 5z = v + 7, -5z + 3v + 2 = 1. What is the smallest common multiple of z and o? 18 What is the common denominator of 6/(-4) + (-96)/(-15) and 89/12? 60 Let h = -15 - -32. Let b = h + -14. Calculate the smallest common multiple of b and 17. 51 Calculate the common denominator of 3/(-15) - (136/(-15))/(-8) and -111/10. 30 Suppose -2c - 17 = a, 4c - 5a - 13 = 5c. Let b = c - -28. Suppose -5n + n = 3o - b, -n = -5o + 18. What is the least common multiple of 6 and n? 6 Let g be 0 + (-7 - (-4)/2). What is the common denominator of 2/((-44)/(-10))g and -13? 11 Suppose -5o = -33 + 3. Suppose 3n + 4i - 70 = 0, -o = -n + 4i - i. What is the least common multiple of 20 and n? 180 Let x = 49 + -31. Let j(m) = -13m + 27. Let r(w) = -3w + 7. Let l(i) = -2j(i) + 9r(i). Calculate the smallest common multiple of l(7) and x. 18 Let z = -276 - -2479/9. Find the common denominator of z and 30/31. 279 Let p = 87791/16387 - 1/4682. Let g = 87533/11242 + -3/5621. What is the common denominator of g and p? 14 Let u be -1 + -2 + 4 + 2. Let t = u + 17. Calculate the least common multiple of 35/3 + (-1)/(-3) and t. 60 Let d = 6 - 0. Suppose -3t + 63 = 3i + 2i, -3i = -4t + 55. Suppose 5s + d = t. Calculate the smallest common multiple of 8 and s. 8 Calculate the common denominator of -13/3 and (3 - (-22)/18) + 3. 9 Let u = -12 + 20. Calculate the least common multiple of (-1)/((-75)/(-20) + -4) and u. 8 Calculate the smallest common multiple of ((-60)/35)/(5/(-175)) and 8. 120 Let x = -2208 - -19829/9. What is the common denominator of 16/3 and x? 9 Let v = -4820 + 144559/30. What is the common denominator of -71/22 and v? 330 Let x(d) = d2 - 2d + 2. Let c be x(6). Suppose c = s + 5v, -4s = -9s + v + 52. Calculate the smallest common multiple of 10 and s. 110 Let u be 1/4 + 12270/(-49128). Let k = u - 165817/40940. Let f = 971 + -5755/6. Find the common denominator of f and k. 60 Let a = -11456/9 - -1271. Calculate the common denominator of a and 89/34. 306 Find the common denominator of -77/10 and (35/(-30))/((-2)/(-11)). 60 Suppose -2u = -6u + 40. What is the least common multiple of u and 2? 10 What is the common denominator of 89/6 and 0/14 - 22/(-32)? 48 Let l = -4 + -11. Suppose -d + 3 - 6 = 0. What is the common denominator of 765/(-12)d/l and 21/5? 20 Let x(m) = 8m - 1. Let g be x(3). Let d(w) = 5 + 5 - 5 - 6 - gw. Calculate the lowest common multiple of d(-1) and 20. 220 Let p = 11291/2 + -3787. Let t = p + -1821. What is the common denominator of -1/2 and t? 2 Let l = 23 + -11. Suppose 4h + 38 = -2i, 0 = -i + 5h - 10 - 9. Let p = -9 - i. Calculate the least common multiple of l and p. 60 Let y(k) = k3 + 3k*2 + k + 5. Calculate the least common multiple of (-330)/(-27) - (-4)/(-18) and y(-3). 12 Let d be (-1 + -1 + 2)/(-2). Suppose d = -g + 4 - 0. Calculate the smallest common multiple of g and 12. 12 Let v = -24 - -26. Let c(r) = 3r*2 - 3r - 4. Let w be c(4). Let m = w - 18. What is the smallest common multiple of v and m? 14 Let q = 1865/17 + -51013/476. Find the common denominator of q and -61/14. 28 Let v = 6/2389 + -11410/738201. Let t = v + -5189/4944. Find the common denominator of t and 35/12. 48 Let h(z) = -z*2 - 4z - 3. Let x be h(-2). Let j be 10 + -1 + -3 + 2. What is the least common multiple of 16 and 1 + j + x + 0? 80 Let j(b) = b*2 - b + 3. Let i be j(-5). Suppose 3 = -5o + i. Calculate the lowest common multiple of 18 and o. 18 Let q(v) = 2v2 - 4v + 2. Let n = -3 + 5. Suppose -ng = -3g + 11. Calculate the smallest common multiple of q(3) and g. 88 Let v = -3 + 1. Let t(x) = x*2 + x - 2. Let b be t(v). Suppose 3 = 3i - bi. Calculate the least common multiple of 11 and i. 11 Let i = 57 - 45. Suppose 4v = 4x + 20, v - 2x - 14 = 2x. What is the lowest common multiple of v/(-1) + i + 2 and 16? 48 What is the common denominator of 5/11 and (-459)/6(-2)/(-12)? 44 Suppose f = 2f - 5. Calculate the least common multiple of 1 and f. 5 Let o be 1557/(-24) + (-1)/(-2). Let t = -585/8 - o. What is the common denominator of (250/12)/(-1) + 3 and t? 12 Let u = 2/2511 + 112957/47709. What is the common denominator of -37/3 and u? 57 Suppose 0 = -2d - 0d - 2, 0 = -5h + 5d + 25. Suppose -4n + hu = -16 - 16, 5u + 15 = 0. Let p = n - 4. What is the smallest common multiple of p and 8? 8 Let g = -301411271259/175019805862 + -6/52685071. Let y = -90/151 + g. Calculate the common denominator of y and -7/2. 22 Let g = -406 + -1745. Let k = -38621/18 - g. Calculate the common denominator of -71/4 and k. 36 Let h be 0/(-2) - (-200)/(-5). What is the common denominator of -41/7 and (-9)/(-54)h/(-6)? 63 Let b be ((-343986)/32 + -1)/(-1). Let i = -10746 + b. Find the common denominator of -101/20 and i. 80 Suppose 0 = 3j + 3u - 3, -40 = -2j - 3j + 2u. Let k = j - -18. What is the common denominator of -29/14 and (-29)/5(-10)/k? 84 Suppose -4u + 4b = -40, -4b - 48 = -2u - 3u. Suppose y - u - 20 = 0. What is the common denominator of -115/14 and 10/(-35) - 226/y? 14 Let r(o) = o2 + o + 18. Let p be r(0). Let j = p - 4. Let c = 21 + -7. Calculate the lowest common multiple of j and c. 14 Let i(w) = -w + w3 - 3w2 - w3 - 7w*3 + 3w3. Calculate the lowest common multiple of 18 and i(-2). 198 Let p(v) = v2 + 20v - 35. Let k = -2 - -12. What is the smallest common multiple of k and p(-22)? 90 Let j = -193/5 - -341/10. Calculate the common denominator of 65/4 and j. 4 Suppose -17 = -2h + 11. What is the smallest common multiple of 7 + -6 + 68/4 and h? 126 Suppose -3 = -y - 1. Calculate the least common multiple of 4 and y. 4 Let h(u) = -4u - 10. Let s = 7 - 12. Calculate the lowest common multiple of h(s) and 2. 10 Suppose 3s - 2s - 2 = k, -s - 3k = -22. Let a = 21 - 13. What is the lowest common multiple of s and (a/10)/(2/15)? 42 What is the lowest common multiple of 63/(-18)24/(-14) and 10? 30 Suppose 47o - 48*o = -9. What is the lowest common multiple of 19 and	{ "pile_set_name": "DM Mathematics" }
0000 How many years are there in twenty-nine fifths of a millennium? 5800 What is seven halves of a decade in years? 35 What is 1005.621 grams in kilograms? 1.005621 Convert 0.871377kg to micrograms. 871377000 What is fifty-two fifths of a century in months? 12480 What is 0.9916008ml in litres? 0.0009916008 How many millilitres are there in 6290.003l? 6290003 What is 43/2 of a litre in millilitres? 21500 How many seconds are there in three eighths of a day? 32400 What is 24.630195 months in millennia? 0.00205251625 What is 21/8 of a litre in millilitres? 2625 What is 17/4 of a millennium in years? 4250 What is 302970.1l in millilitres? 302970100 Convert 6352.31 millennia to months. 76227720 What is 16.66603t in kilograms? 16666.03 How many milligrams are there in 69453.6 micrograms? 69.4536 How many months are there in one fifth of a century? 240 How many months are there in 1/15 of a century? 80 What is 0.3225654 years in centuries? 0.003225654 Convert 6065.972ml to litres. 6.065972 How many years are there in 1/4 of a century? 25 What is three fifths of a decade in months? 72 How many nanometers are there in 6/25 of a micrometer? 240 What is three eighths of a milligram in micrograms? 375 How many grams are there in 48.40918mg? 0.04840918 What is thirteen fifths of a meter in centimeters? 260 How many litres are there in 7.011492ml? 0.007011492 Convert 85815.1mm to meters. 85.8151 Convert 869047.2 weeks to milliseconds. 525599746560000 What is 9.510369 centuries in millennia? 0.9510369 How many millilitres are there in 43/2 of a litre? 21500 How many minutes are there in 6.57145 days? 9462.888 Convert 34.93061um to kilometers. 0.00000003493061 What is 13/7 of a week in minutes? 18720 How many millilitres are there in one twentieth of a litre? 50 What is 84557.17ml in litres? 84.55717 Convert 13.02835 nanometers to meters. 0.00000001302835 What is twenty-one fifths of a week in minutes? 42336 How many months are there in fifty-five thirds of a decade? 2200 What is 31/2 of a meter in millimeters? 15500 What is 127750.3t in kilograms? 127750300 What is 1/10 of a day in minutes? 144 Convert 46334.85 millilitres to litres. 46.33485 What is 38/7 of a week in days? 38 How many microseconds are there in 1/4 of a millisecond? 250 What is three tenths of a century in months? 360 Convert 33066.49 micrometers to meters. 0.03306649 How many tonnes are there in 10.00571 kilograms? 0.01000571 What is 3/25 of a meter in centimeters? 12 Convert 602.4033 milliseconds to nanoseconds. 602403300 How many minutes are there in 11616.123ms? 0.19360205 How many microseconds are there in 8.003274s? 8003274 What is 6396.643 hours in minutes? 383798.58 How many micrometers are there in one fifth of a centimeter? 2000 What is 7/2 of a millennium in months? 42000 How many millilitres are there in fifteen quarters of a litre? 3750 How many months are there in seventy-seven halves of a decade? 4620 What is thirteen fifths of a tonne in kilograms? 2600 Convert 655101.3 weeks to hours. 110057018.4 How many millilitres are there in 34/5 of a litre? 6800 What is 5425.953g in nanograms? 5425953000000 Convert 0.4243879 litres to millilitres. 424.3879 How many years are there in five quarters of a century? 125 How many meters are there in fourty-four fifths of a kilometer? 8800 How many minutes are there in 1/5 of a hour? 12 How many years are there in three fifths of a decade? 6 What is 27/4 of a gram in milligrams? 6750 What is 3/25 of a century in years? 12 What is 7/16 of a century in months? 525 How many centimeters are there in 1/5 of a meter? 20 What is 13/5 of a hour in seconds? 9360 What is 7/8 of a microsecond in nanoseconds? 875 What is 1/24 of a week in minutes? 420 How many centimeters are there in 8/25 of a kilometer? 32000 How many kilometers are there in 171.9304 centimeters? 0.001719304 How many millilitres are there in fifty-four fifths of a litre? 10800 What is 7/8 of a litre in millilitres? 875 How many minutes are there in 2/7 of a week? 2880 What is twenty-seven halves of a millennium in years? 13500 How many millimeters are there in thirty-three fifths of a meter? 6600 What is eleven quarters of a litre in millilitres? 2750 How many micrometers are there in 6/5 of a centimeter? 12000 How many millilitres are there in ninety-five halves of a litre? 47500 How many decades are there in 82.46439 months? 0.68720325 What is 1/5 of a decade in months? 24 How many grams are there in 4690.117ug? 0.004690117 What is three fifths of a century in decades? 6 How many micrometers are there in twenty-seven quarters of a millimeter? 6750 Convert 0.191588kg to nanograms. 191588000000 How many millilitres are there in 7/4 of a litre? 1750 How many litres are there in 1170.858ml? 1.170858 How many litres are there in 97.80245ml? 0.09780245 What is 1499.921766s in weeks? 0.002480029375 What is 37/2 of a microgram in nanograms? 18500 How many milligrams are there in 3/40 of a gram? 75 What is 969.2765mm in nanometers? 969276500 What is 5612.244 years in decades? 561.2244 How many nanometers are there in three fifths of a micrometer? 600 How many nanograms are there in twenty-five halves of a microgram? 12500 How many micrometers are there in 718.5524cm? 7185524 How many millilitres are there in 6/25 of a litre? 240 Convert 23.2421l to millilitres. 23242.1 How many meters are there in 3.810858km? 3810.858 What is 7/3 of a decade in months? 280 What is 91268.63 tonnes in micrograms? 91268630000000000 Convert 71.52675 centuries to years. 7152.675 What is 375049.7cm in micrometers? 3750497000 What is 5/8 of a litre in millilitres? 625 What is twenty-one halves of a kilometer in meters? 10500 How many millilitres are there in 8493.414 litres? 8493414 What is one twentieth of a gram in micrograms? 50000 What is fourty-five halves of a gram in milligrams? 22500 Convert 38925.22 weeks to seconds. 23541973056 How many decades are there in 14654.106 months? 122.11755 How many litres are there in 73764.15ml? 73.76415 How many micrometers are there in 0.6702973 kilometers? 670297300 How many seconds are there in 75.28729ms? 0.07528729 How many micrometers are there in 29/2 of a millimeter? 14500 How many nanograms are there in 1/16 of a milligram? 62500 What is 3/40 of a litre in millilitres? 75 Convert 16.067973 months to decades. 0.133899775 How many tonnes are there in 4918.1g? 0.0049181 What is seventeen quarters of a litre in millilitres? 4250 How many days are there in 0.5247284 weeks? 3.6730988 How many micrometers are there in seventeen quarters of a centimeter? 42500 What is 6.050918 nanometers in centimeters? 0.0000006050918 How many nanograms are there in 5/8 of a microgram? 625 What is 8411.073 litres in millilitres? 8411073 Convert 313.3415 nanograms to grams. 0.0000003133415 What is 87/4 of a microgram in nanograms? 21750 Convert 45.351747s to hours. 0.0125977075 Convert 8.449016um to kilometers. 0.000000008449016 How many millilitres are there in 281117.6l? 281117600 How many milliseconds are there in 49/4 of a second? 12250 How many litres are there in 236768.2ml? 236.7682 What is thirty-two fifths of a millennium in centuries? 64 What is 25/2 of a litre in millilitres? 12500 Convert 914.9579 weeks to hours. 153712.9272 Convert 296204.22us to minutes. 0.004936737 What is 0.4317286ml in litres? 0.0004317286 How many nanograms are there in 1/20 of a milligram? 50000 How many centuries are there in 24.912561 months? 0.0207604675 What is 1071.844 millennia in months? 12862128 How many milligrams are there in fourty-nine fifths of a gram? 9800 Convert 65099.51ml to litres. 65.09951 What is 0.2367838 centuries in millennia? 0.02367838 How many millilitres are there in 52/5 of a litre? 10400 How many micrograms are there in 3/32 of a gram? 93750 How many nanometers are there in thirty-two fifths of a micrometer? 6400 What is 1.769389km in centimeters? 176938.9 What is 6902.53 nanograms in grams? 0.00000690253 How many millimeters are there in three eighths of a meter? 375 How many micrograms are there in eighteen fifths of a milligram? 3600 What is 8.044385 micrometers in nanometers? 8044.385 What is fifty-nine fifths of a decade in months? 1416 How many seconds are there in	{ "pile_set_name": "DM Mathematics" }
+ 12p - 6y - 72 What is the first derivative of 172l2qx2 - 8l*2x + 97lqwx - 46lwx2 + 15wx + x2 wrt q? 172l*2x*2 + 97lwx What is the second derivative of -4q5 + 2027q*3 - 3q*2 - q - 4478 wrt q? -80q*3 + 12162q - 6 What is the second derivative of 2z5 - 4z*4 + 1645z*3 + 4z + 29246 wrt z? 40z3 - 48z*2 + 9870z Differentiate 4407622n2 - 1819254 with respect to n. 8815244n What is the second derivative of 14l5 + 2l*4 + 4l*3 - 10l*2 + 740l + 56 wrt l? 280l3 + 24l*2 + 24l - 20 What is the derivative of 4p2 - 48938p + 1938535 wrt p? 8p - 48938 What is the second derivative of -4an2p*2 - 10anp*2 + 240ap3 - 14n*3p - 130n2p*3 - 2np3 - 3np2 wrt n? -8ap2 - 84np - 260p*3 Find the third derivative of 56513x*5 + 10x*2 + 5024. 3390780x*2 Find the second derivative of 2u*5 + 10366u*2 + 25906u wrt u. 40u3 + 20732 Find the second derivative of 3083p*4 - 87p*3 + 2p + 840928 wrt p. 36996p2 - 522p What is the derivative of -5146z2 + z + 175438 wrt z? -10292z + 1 Find the second derivative of 1740p5u - 3p3u - 2p3 + pu + 5p + u - 438 wrt p. 34800p*3u - 18pu - 12p What is the derivative of 3q*2y - 2q2 + 44qy2 + qy + 120q - 2y + 3 wrt y? 3q2 + 88qy + q - 2 Find the second derivative of -16789s*3z*2 + 3s*3 + 341sz2 + 9s wrt s. -100734sz*2 + 18s What is the third derivative of -126467r4 + 1754r*2 + 2r - 6? -3035208r What is the derivative of -3146643o*4 + 1575220? -12586572o*3 What is the second derivative of -24955b*4w + b*2 + 92bw - 130b + w wrt b? -299460b2w + 2 What is the second derivative of 854i2k*3z*3 + 5i*2k*3 - ik*3z*3 - ikz - 1713k*3z*3 + 5z*2 wrt i? 1708k*3z*3 + 10k*3 Find the second derivative of -3978z*2 + 44387z wrt z. -7956 Differentiate 2f3w + 3927f2w + 7w + 860 with respect to f. 6f*2w + 7854fw What is the first derivative of -15999n4 + n2w*3 - 319765w*3 wrt n? -63996n*3 + 2nw3 What is the second derivative of 12a*3o - 1250a2o*2 - 6ao2 - 8a + 432o2 wrt a? 72ao - 2500o*2 What is the third derivative of 9d*5 + 2d*4 + 270d3 + d2 + 105415d? 540d*2 + 48d + 1620 What is the third derivative of 1893v4 + 4v*3 - 76990v*2 + 2v - 1 wrt v? 45432v + 24 Differentiate -43s*3u - 1623000s3 + 8s*2u - su + 4u with respect to u. -43s3 + 8s*2 - s + 4 What is the second derivative of -mq*3r*3 - 2mqr*3 + 2mqr*2 + 2mq - 2mr + 22092q*4r*2 - 88qr3 wrt q? -6mqr*3 + 265104q*2r*2 What is the second derivative of -26429i*2 - 43602i wrt i? -52858 Find the third derivative of -37233x3 - 182734x*2. -223398 What is the third derivative of 736s*4 - 14s*3 + 14s*2 - 14s - 26 wrt s? 17664s - 84 Find the second derivative of 22467i*3u*2 - 25233iu2 + 2iu + i - 1 wrt i. 134802iu2 Differentiate 105616k - 69300 with respect to k. 105616 What is the third derivative of -7bz*6 + 216bz5 - 7bz2 + 473b - z wrt z? -840bz*3 + 12960bz2 Differentiate -a3 - 993a*2 + 26a - 138559. -3a2 - 1986a + 26 Find the first derivative of 2173g3 + 3g*2 + 22g + 1430132. 6519g2 + 6g + 22 Differentiate -344041d3u3 + d3 - d + 30204 with respect to u. -1032123d3u*2 What is the derivative of -723192k*2 - 455202 wrt k? -1446384k Find the first derivative of -58996a2 - 84119 wrt a. -117992a What is the second derivative of -5k3r*2 - 40k*3r - 732k3 + 7808r*4 wrt r? -10k*3 + 93696r*2 Find the second derivative of -1527996d*3 + 73d + 1718 wrt d. -9167976d Differentiate -l3s - 27242l3 + 571s with respect to s. -l*3 + 571 Find the second derivative of 12o*5 + 1175o*4 + 3o - 3302. 240o3 + 14100o2 Find the third derivative of m5 + 82815m4 + m3 - 423078m*2 wrt m. 60m*2 + 1987560m + 6 What is the second derivative of -2bc*2w - 6138bc*2 + 3bcw - 619bc - 6bw - 118c2w - 2 wrt c? -4bw - 12276b - 236w Find the third derivative of 2831754k3 - 2k*2 + 77k + 347. 16990524 What is the first derivative of -2062287o4 - 852113 wrt o? -8249148o3 What is the second derivative of d5 + 52402d4 + 2d - 5199 wrt d? 20d3 + 628824d*2 What is the first derivative of -83557b*2 - 4859273? -167114b What is the derivative of -60282f2 + 36919 wrt f? -120564f What is the first derivative of -10038q4 - 8939? -40152q*3 Find the first derivative of 18988o3 + o2 - 4o + 101709. 56964o*2 + 2o - 4 Find the second derivative of 24g4l*3 + 28878g*2l*3 + gl*3 - 2gl2 + 4g + 2225l3 - 2l wrt g. 288g2l*3 + 57756l*3 What is the second derivative of 379kv4 + kv + 190k + 517v*4 - 8v + 24 wrt v? 4548kv*2 + 6204v*2 What is the third derivative of 14c*3ov2 - 103c*3ov - 2c*3v - 4c2v - 3c2 - 4cov + 40cv*2 wrt c? 84ov2 - 618ov - 12v What is the third derivative of -262a6p + 57a5p*2 - 122152a*2p*2 wrt a? -31440a*3p + 3420a2p*2 Find the third derivative of 2f*3j*3 - 3f*3j*2k*3 - 7533f*3 + 48f*2j + fj3k + fk3 wrt f. 12j*3 - 18j*2k*3 - 45198 Find the second derivative of 19a*3z*3 - 13a*3z + 9a2z + a*2 + 436az4 wrt z. 114a*3z + 5232az*2 Find the third derivative of 84r*4 - 7312r*3x + 2r3 + 259r*2x + r*2 - 464x - 2 wrt r. 2016r - 43872x + 12 Differentiate -5bm*2 - bm - 48043b + 5m*2 - 23m with respect to m. -10bm - b + 10m - 23 Differentiate 2a*3q*2 + 235a*3r + 3688a3 - 2a*2q*2 + 69q*2r*2 + 2qr2 with respect to r. 235a*3 + 138q*2r + 4qr Find the third derivative of -136i2l4 + i2l2 - 84il6 + 16730il wrt l. -3264i*2l - 10080il*3 Differentiate 972599l - 664263 wrt l. 972599 Differentiate goy - 213g - 117059o*2y + 34o2 wrt y. go - 117059o2 What is the first derivative of -97104i - 902018 wrt i? -97104 Differentiate 233077z + 149988. 233077 What is the derivative of b2ky2 - 10907b*2k - 16446b2y*2 + 2b*2 - 21bk - 2by2 + 6by wrt k? b2y*2 - 10907b*2 - 21b Find the second derivative of 38553o2 - 2195o - 1. 77106 Find the third derivative of -14dgj3 - 11165dgj*2 - dg - 3407dj*3 - 2gj2 wrt j. -84dg - 20442d Differentiate 129489n3 - 7117 wrt n. 388467n*2 Differentiate -583lw3 - 3lw2 - 34872w*3 with respect to l. -583w*3 - 3w*2 Differentiate -4812n4 + n2 + 7n + 63938 wrt n. -19248n*3 + 2n + 7 What is the second derivative of -2b2v*3 + 16b*2v*2 - 75b*2 + 2994bv - 8v*3 wrt b? -4v*3 + 32v*2 - 150 Find the third derivative of 18u*4 + 243u*3 - 74485u*2. 432u + 1458 Find the third derivative of -u*5 + 59974u*4 - 3u*3 - 772u*2 + 404. -60u*2 + 1439376u - 18 What is the derivative of 2dqv2 + 337dqv + 35qv*2 + 287qv wrt d? 2qv2 + 337qv What is the second derivative of -129587g*2x*2 + 300843g*2x - gx - 3x*2 wrt x? -259174g*2 - 6 Find the second derivative of 5o*5 - 45692o*3 - 886126o. 100o3 - 274152o Find the second derivative of 62701h2v + 2hv + 415h - v + 5 wrt h. 125402v Find the third derivative of 959402t3 - 4471t*2 - t + 11. 5756412 What is the derivative of -1131116u - 3616185? -1131116 Find the second derivative of -8390m4 - 119m3 + m2 + 2514590m. -100680m*2 - 714m + 2 Find the second derivative of -104838z5 + 107695z. -2096760z3 Find the second derivative of -2319bi4r + 7bir - 3br + 27b - 12i3r - 2ir + 2i - 10r wrt i. -27828bi*2r - 72ir What is the derivative of fh3 + fh*2 + 76094fh - f + 34205h3 - 2 wrt f? h3 + h*2 + 76094h - 1 Find the third derivative of 14g4 + 12677g*3t + g*2 - 13018t wrt g. 336g + 76062t Find the second derivative of 4d5 + 59832d3 + d2 + 516549d. 80d*3 + 358992d + 2 Differentiate -147142j3 + 68042. -441426j*2 Find the third derivative of -7i*3n*2y - i*3n*2 + 33672i*3y + i*2n2 - i2y - 1378409n*2 wrt i. -42n*	{ "pile_set_name": "DM Mathematics" }
25n + 93 + 32 = 0. Solve -4h + nd - 24 = -9, 5d + 15 = -2h for h. -5 Let w(s) = 3s*2 + 145s - 93. Let c be w(-49). Solve -3m = -2m - 2a + c, 4 = 4m - 2a for m. 3 Suppose 5u = 3o + 53, -u - u - 5o + 15 = 0. Let z(p) = p - 6. Let j be z(u). Solve -y - 3v = jy - 19, 0 = v - 3 for y. 2 Suppose -2f - 21 + 69 = 0. Suppose 6b = -0b + f. Solve -3m + 9 = -d - 2m, bd - 3m + 31 = 0 for d. -4 Let m(a) = -6a - 27. Let d be m(-5). Let k be -1 + (-3)/3 + d. Let g be 27/6 - 2/4. Solve -k = -u + go - 14, 0 = -4u + o + 8 for u. 3 Suppose -3x + 2186 = 2174. Solve -3z - 2i - 11 = 0, 0z = xz - 4i + 8 for z. -3 Let a(q) = q*3 + 9q*2 + 7q - 4. Let g be a(-8). Suppose -g = 4h + 8. Let s = 3 + h. Solve -5v - 20 = s, -3v + 4v + 8 = -2m for m. -2 Suppose 50g = 21g + 87. Solve 15 = 3i + gq - 0q, -4q + 15 = -i for i. 1 Suppose 2o = -3o + 25. Let j be (-4)/(-3)(2 + -8). Let h(b) = 2b2 + 12b - 5. Let p be h(j). Solve ol + 5 = -5k, -5l + 2k - p = -8 for l. -3 Suppose 3u = 0, 0 = -5y + 4y + 3u. Solve -2g - 5o + 20 = -yg, 5g - 3o = -12 for g. 0 Suppose 882v = 915v. Solve 5x = 2f - 3, x = -vx + f for x. -1 Let a = -5 + 7. Let k be (a/(-2))/((-2)/10). Suppose -24 = 2t - 5t. Solve 3s - 4m - 1 = 0, -ks - 5m = -2m + t for s. -1 Let h = -45 - -61. Suppose 11l - h = 116. Solve 2t + l = -3p + p, 3p - 4t = -4 for p. -4 Let s = 475 - 468. Solve -s = i - 2t, 3i - 12 - 2 = -t for i. 3 Suppose -9u + 175 = 26u. Solve 0 = uy - 3n - 6 + 9, -3n = -2y + 6 for y. -3 Let p = -332 + 14. Suppose 5d - 77 + 197 = 0. Let w be d/56 - p/7. Solve 5c - 2r = -35, c - 4r = -4c - w for c. -5 Let c(i) = -i3 - 4i*2. Let t = -2 + -2. Let a be c(t). Suppose a = -2p + 3p - 2. Solve -5d - 8 = -v, -p = -v + 3d - d for v. -2 Let i be (2 + -2)/(-1 + 0). Let u = 5 - i. Solve 0 = a + 7j - 2j + 9, 0 = -uj - 5 for a. -4 Let u(t) = -t*3 + 2t*2 + 3t + 4. Let q be u(3). Let a be 18 + (2 + -4)/(q/6). Solve 5n - 22 = n - 2c, 0 = 2n + 5c - a for n. 5 Suppose 0 = -h, 7a + 4h = 3a + 16. Solve -ad = -3o, 7 = -2o + 4d + d for o. 4 Let b(t) = -t. Let z(p) = p3 - 5p*2 - 5p - 8. Let j be z(6). Let h be b(j). Suppose 0 = 4d - 9 - 3. Solve 4w + hs + d - 21 = 0, -11 = -3w + s for w. 4 Let u(w) = 2w + 26. Let h be u(-12). Suppose -3t = 6, -n - 4n + 4t + 18 = 0. Solve 3 = -6j + j + 3r, -hr + n = 5j for j. 0 Let x be (-716)/(-6) + 20/(-15) + 2. Let n = -115 + x. Solve -3q = -nl + 4 - 18, l - q = -2 for l. -4 Suppose q + 3k = 8, q + 2k = 5k + 2. Suppose -2u - 2l = -0l - 8, 5l + 5 = 0. Solve -y + 4s = -9, qs + u + 0 = 0 for y. 5 Suppose -146 = 2h - 152. Solve -4o - u + 17 = 0, 0 = hu - 1 - 2 for o. 4 Suppose 1 = -2o + 15. Suppose l = 3u - 1, -ol + 6l - 3 = -5u. Solve 2r - ls - 8 = -r, 5r + 2s = 8 for r. 2 Let p(y) = -5y - 6. Let d be p(-8). Let x be ((-3440)/(-12))/(-10) + (-1)/3. Let w = x + d. Solve q - 2 = -q - 2i, w = 2q - i for q. 2 Let g = 494 + -491. Solve -gi - i = 3w + 15, -4w = 3i + 13 for w. -1 Let a be ((-6)/(-7))/((-3)/21). Let d be (-29)/(-3) + (-2)/a. Let q be (-20)/(-70) + 5/(70/24). Solve 4h = -f - 4 + 22, qh - d = 0 for f. -2 Let v(l) = 2l3 - 5l*2 + l + 4. Let f be v(2). Solve -2 = -fr + 2q, -4r + q - 3q = 8 for r. -1 Let p(f) = -f2 + 5f + 6. Let j be p(4). Let q(x) = -x*2 + 9x + 12. Let t be q(j). Solve -a - to - 1 = -0, -35 = 5a - 5o for a. -5 Let a(v) = v3 - v2 - v + 1. Suppose 3t + 1 = -8. Let p be a(t). Let q be (-4 - -5)p/(-2). Solve c - 13 = -2x - x, 2c - q = -4x for c. -2 Let c be -4 + (-60)/(-8)-4. Let m = -31 - c. Solve -29 = -mh + h + 5p, 0 = -3p - 15 for h. 2 Suppose 0 = -a + 2b + 2, 0a + 3b - 6 = -3a. Solve -5x + 2h = 0, -3x + 0x = -ah + 4 for x. 2 Let a be (16/(-10) - -1)/((-2)/10). Suppose -19 = -ah + 2. Solve 0 = -c - w + 9, 0c - h = 2c - 3w for c. 4 Suppose 0 = 15r - 67 + 7. Suppose 0 = 6h - 4h - rh. Solve hn = -3n + 2c + 9, 3c = -n - 8 for n. 1 Let x be 72 + (-45 - -52) - 7. Solve 2f + x = -5u + f, u - 2f = -5 for u. -3 Let h = -14 - -19. Let w be 2/((-1)/(-10)h). Solve -k = 3m - 13, 3m = -2m - wk + 24 for m. 4 Suppose -2a = a. Let k(p) = -5p + 2p2 - 2p2 - p2 + 0p + 10. Let h be k(-6). Solve 4x - 2c + 28 = -ac, -4 = 4x + hc for x. -5 Suppose 0 = 6l - 39 + 15. Suppose -3n = lj - 14, -3j + 2n + 23 = -2n. Solve 0 = -jk - 3z + 15, 0 = -2k - 0k + z + 6 for k. 3 Let r be 8/10(-105)/(-6). Suppose -2i - 2s + r + 10 = 0, i = 5s - 18. Suppose -io + 6 = -4o. Solve 2t = 5h, -3t = 3h + oh for t. 0 Let w(a) = -12a*3 - 4a*2 + 2a + 4. Let p be w(-1). Solve -4b - 4 = 2i, 2b + p = -b - 5i for b. 0 Suppose -118q - 108 = -154q. Solve qp + 3v = 12, 4p + 10v - 12v + 8 = 0 for p. 0 Suppose 4j = -3j + 196. Solve 2d - 16 = -4r, 0d + 4d + j = 4r for d. -2 Let b be 116/261 + 14/273. Solve -bw - 3w + 3f + 4 = 0, f = 3w for w. -1 Suppose 8 = -4d + 4o + 68, 3o = -5d + 67. Solve -2z = -4m - 6 - 20, m - 3z = -d for m. -5 Let h(n) = n*2 + 3n + 4. Let s be h(-3). Solve 3p + s = 5o, 0 = 4o - 3p - 6 + 1 for o. -1 Let r be -2 - 342/(-16) - 780/2080. Solve -8 = -x - 2f, -3x + r = -0x + 5f for x. -2 Let d(i) = -i*3 + 4i*2 + 11i + 11. Let k be d(6). Solve 3c = kl - 24, 2l + c = 2c + 9 for l. 3 Let d(z) = z*2 - 15z - 47. Let p be d(-3). Solve -4j + 3 + p = 2a, -35 = -5j + 2a for j. 5 Suppose -2w + 3g - 3 = 0, -3w - 2g + 68 - 66 = 0. Solve w = -5l - 5k - 17 + 2, 1 = -k for l. -2 Let t(r) = -7r2 - 10r - 2. Let w(v) = 15v2 + 20v + 4. Let z(u) = 13t(u) + 6w(u). Let m be z(-7). Solve m = b + 5o, b - 4b = -4o for b. 4 Let m(j) = -j3 + 18j*2 + 2j - 31. Let h be m(18). Suppose 0 = ho - 5, -g + 2g + 3o - 11 = 0. Solve a + 5 = x - 2, 0 = x + 2a + g for x. 2 Suppose -t + 1 = -2o + o, 0 = -2o + t + 3. Suppose oy = -2 + 18. Solve 0 = 4i + 4n + 20, yi - 2n + 17 = -5n for i. -2 Let n(l) be the first derivative of -l*3/3 + 7l*2/2 - 3l - 6. Let r be n(6). Solve h + r = -3f + 13, 2f + 5h = 11 for f. 3 Suppose -v + 6u = u - 11, 0 = 5v + 2u - 1. Solve 2a = -3h - 13, -2a = -3h + 3a + v for h. -3 Let u be ((-24)/4)/(-6) + 4. Solve 10n + 2 = 5n - g, 2 = un - g for n. 0 Let v(j) = j*3 - 2j*2 - 3j - 4. Let a be v(3). Let l be (-6)/a(-2)/(-3). Suppose l = 4c - 11. Solve -2t - 4 = cy - 4y, y = -2 for t. -3 Suppose 15q - 80 + 5 = 0. Solve -17 = 2m - 5i, -3m - 3 - q = -4i for m. 4 Let m be (-4 - -5)/(2/2) - 1. Let r be 315/9 - m. Solve 26 = 3g - rb, -g + 4b - 5b = 2 for g. 2 Suppose -4d + 84 = 4b, 0 = 5d - 0d - b - 123. Let z = d - 20. Suppose -2t + 3 + 3 = 0. Solve -4v = -2p - 2, -tp - zv - 2 - 1 = 0 for p. -1 Let x be 0 + 16 + -2 + 1. Suppose 288 = 31h + 45h - 4h. Solve -3f + x + 17 = hd, 0 = -2d + 10 for f. 4 Let d be ((-76)/20 + 3)-5. Suppose p = d - 0. Suppose ph - 12 = 8. Solve 2w = -5c - 4 - 6, -hc - 15 = w for c. -4 Let v = 46 - 40. Suppose 4 = h + m, -2h + 17 - 4 = -3m. Solve l - 2 = -0l + hc, -l - 3c = v for l. -3 Let a be ((-14)/(42/(-9)))/3. Solve -2h - 12 = 2n, -h - 10 = 2n + a for n. -5 Suppose -15 = -8x + 17. Suppose 4 = -xi + 12. Solve 0 = v + 4p, -3v + 4p = ip for v. 0 Let d = 240 - 238. Solve dh + 2w + 18 = -2w, 0 = 3h - 3w for h. -3 Suppose 5a + 0a = -4q + 26, -5q - 29 = -4a. Suppose -3j + 9 = -3. Let u = j + 9. Solve 5t = -o + 21, -ao + o + u = 2t for t. 4 Let p(s) be the second derivative of -s4/12 + 13s3/6 + s2 + s. Let o be p(13). Let w = 6 + -3. Solve wy - 19 = oz, -6z - 34 = -z - 3y for z. -5 Suppose 4h = -3z - 22, 2z + 3z + 3h + 22 = 0. Let d be ((-30)/4)/5z. Solve -dr = n - 10, -29 - 1 = 5n - r for n. -5 Let n = -255 + 267. Solve -8 - n = -4k + 5d, 0 = -k - d - 4 for k. 0 Let y(s) = 3s - 3. Suppose w + 3 - 11 = 0. Let k be y(w). Suppose -3l = -2j - k, 4j + 23 = 4l + 3j. Solve 5 - 25 = 3r - ln, 5r + 4n - 16 = 0 for r. 0 Suppose 0m = -2m + 62. Let k = m + -31. Solve k = 3h + 3o - 18, 4h + 2o - 24 = -h for h. 4 Suppose 0 = 52m - 44m - 64. Solve -p - 27 = 5y - m, -4y = -5p + 21 for p. 1 Let d be (-1)/(0 + 2/(-2)). Suppose g - 4 = -d. Suppose 4m - 7m + 6 = 5x, 0	{ "pile_set_name": "DM Mathematics" }
ss -4i - 52i*2 + 2i + 5i + 17i*2 as xi*2 + u + oi and give o. 3 Rearrange (-b*3 - 9b - 8b + 0b*3)(9b + 9b - 6b) to the form vb + zb4 + jb*3 + n + tb*2 and give v. 0 Express 8d - 21d + 13d - 103d2 - 854d*2 as od*2 + p + id and give o. -957 Express 86 + 13w - 9w - 40 + (-3w - 2w + 4w)(0 - 2 + 3) + 2w + w - 2w as b + cw and give b. 46 Express 2 - 1 + 6 + 0 - n + 16n*2 - 6 in the form p + zn + in2 and give p. 1 Express 114c - 3c3 - 2c3 - c4 + c*2 + 6c*3 - 31c + 2 - 1 as o + uc + dc*3 + yc*4 + nc2 and give n. 1 Express (-a2 + 11a2 - 3a*2)(3 + a - 3) + (-1 + 2a + 1)(0 - 2a2 + 0) + 11a*3 + 182a - 182a as ja*3 + ia + ya2 + x and give j. 14 Express (-3l - 2l - 5l)(4 + 9 - 1) in the form i + bl and give b. -120 Rearrange -87v - 722v*2 + 1440v*2 - 721v*2 to the form lv*2 + pv + x and give p. -87 Express 811c - 8 - 319c + 21 - 13 as oc + p and give p. 0 Rearrange 6l + l - 2l2 + 3 - l4 + l - 6l - 4l + 2l*3 to the form bl*2 + jl*3 + tl + v + yl4 and give v. 3 Express 73d*2 - 37 + 8 + 15 + 88d*2 + 8 as bd + fd2 + s and give s. -6 Rearrange (-5 + 1 + 3)(-2b - b + b) + 4b - 5b + 0b + (2b + 2b - 2b)(-1 + 1 - 2) + 659b + 30b + 857b to the form a + wb and give w. 1543 Rearrange (-636l + 16 + 7l*3 + 636l)(-l - 3 + 3) to the form ml*2 + ul*3 + rl + i + gl4 and give i. 0 Express 13r - r*3 + 2r*2 - 3r*2 + 19r - 5r as dr*2 + vr*3 + ur + h and give d. -1 Rearrange (f - 5f + 5f)(-245f*3 - 33f*3 - 290f*3) to mf*2 + qf*3 + tf + xf4 + h and give x. -568 Rearrange 20c*2 + 65 - 46c*2 + 27c*2 to the form s + dc + jc2 and give j. 1 Rearrange (-199t*2 - 1049t - 1 - 342t2 + 1049t)(0 + 5 + 2) to the form at*2 + jt + f and give a. -3787 Express 1265h + 140072 - 140072 in the form i + bh and give b. 1265 Express 84n2 + 7n*2 - 73n*2 in the form z + bn*2 + in and give z. 0 Express (3j + 0j - j)(6 - 4 - 4) + (0 - 2j + 0)(-3 + 22 + 3 + (-5 + 3 + 4)(4 - 4 + 3)) in the form hj + i and give h. -60 Express -15m*2 + 831m*2 - 8m + 9m - m in the form im + n + rm2 and give r. 816 Express (0 + 0 + 3a)(-4a + 13a3 + 4a) - a*4 + 2a*4 + 0a*4 + (4 - 4 + 3a)(a3 + 2 - 2) in the form ja*4 + ca + i + ka3 + va*2 and give j. 43 Express -p + 2 - p + 702p*2 + 5p*3 - 706p2 + p4 as xp4 + cp*3 + u + vp*2 + gp and give c. 5 Express (40m - 40m + 11m3)((3 - 1 - 3)(0m + 5m - 2m) - 3m + m + 4m) in the form hm2 + vm*3 + u + im*4 + pm and give i. -11 Express -26t + 8t + 58t + 56t in the form s + at and give a. 96 Express 221d*2 - 34d - 444d2 + 240d*2 as kd*2 + zd + p and give k. 17 Rearrange (-3d + 2d - 3d)((2d - d + 2d)(-4 + 2 + 3) - 1 + 1 + 3d) + (2d - 3d + 2d)(-3d + 0d + 4d) to pd + cd2 + q and give c. -23 Express -104 + 4y*3 + 0y*2 + 2y*2 - y - 3y*3 + 3y*2 + 102 as ny + fy2 + oy*3 + x and give x. -2 Rearrange 80t + 67t + 49t + 151t to ft + x and give f. 347 Rearrange 266m4 - 532m*4 + 23m - 3m3 + 265m*4 to p + rm*2 + ym + cm4 + om*3 and give o. -3 Express -19g + 9g + 5g*2 + 8g + 4g - 3 in the form ug*2 + mg + f and give m. 2 Rearrange 212l + 3l*4 - 8l2 + l2 - 2 - 214l + 0l*2 to the form tl*2 + gl*3 + dl*4 + m + ul and give m. -2 Express -44d + 3 + 5d*2 + 42d - 4d2 + 1 as x + jd + yd2 and give y. 1 Rearrange -4606g - 5 + 4604g - 3g*2 + 0 - 9g*3 to the form s + ng*2 + qg*3 + ig and give n. -3 Rearrange (-3s + 4s - 3s + 3s - 3s + 6s + (s + 2s - 2s)(-5 + 0 + 4))(-s*2 - 2 + 2)(6 + 4 - 1) to ms3 + y + as*2 + ts and give m. -27 Rearrange (-2z + 2z + 8z)(-100 + 65 + 47) to az + q and give a. 96 Rearrange 0 - 1467g - 1 + 1072g + 1 to the form l + fg and give f. -395 Rearrange -239f - 202f + 63f + 82f to the form cf + t and give c. -296 Rearrange 512z + 733z + 36z - 51z + 277z to the form xz + n and give x. 1507 Express -c - 30c - 9c + (3c + 2c - 2c)(3 + 0 - 2) as mc + u and give u. 0 Rearrange 9 + 27g - 6 - 2g*3 - 79g + 26g to the form og*3 + ag + yg2 + d and give a. -26 Express 78v - 158v - 49 + 79v as t + dv and give t. -49 Express (4 + 7d - 4)(2d + 512 + 4d2 - 5d*2 - 678) as z + ad*2 + yd*3 + gd and give a. 14 Express 3 + 2345t - 3 - 1424t as k + ct and give c. 921 Rearrange 1 - 681d - 677d - 8d*2 + 2042d - 683d to the form a + md + cd2 and give m. 1 Express -48s*2 - 32s*2 + 79s*2 + 4 - 1497s - 4 in the form vs2 + u + gs and give g. -1497 Rearrange 0g4 + 0 + 1 - 282g3 + g4 + 2g + g2 + g2 + 281g*3 to the form vg*4 + h + sg + zg3 + rg*2 and give h. 1 Express (-13i + 26i + 46i)(0i*3 + 0i*3 - 3i*3) - 3i4 + i4 + 10i4 as di*4 + qi + ti2 + j + wi*3 and give d. -169 Rearrange 82m + 65m - m + 45m to q + nm and give n. 191 Express (-v + 3v + v)(66v*3 - 220v*3 - 100v*3) in the form tv*4 + jv + n + xv3 + rv*2 and give t. -762 Rearrange (30 - 25 + 41)(20o + 21o - 12o) to the form so + t and give s. 1334 Express (-6f + 3f + 2f)(19 - 152 + 11)(-1 + 0 + 0) in the form if + q and give i. -122 Express (-5x2 + 127x*3 + 0x*2 + 4x*2)(-3x + 8x + x) - 4x4 + 4x4 - x4 as mx3 + cx*4 + b + ax*2 + tx and give c. 761 Rearrange (6h + h + 10h)(0 + 4h*2 + 0) to wh*2 + jh*3 + r + ah and give j. 68 Express 16w2 - 8 + 2w + 6w2 + 6w*3 + 9 + 1 in the form sw*3 + a + qw*2 + kw and give s. 6 Express -25c + 0c + 35c + 35c + 46c in the form yc + j and give y. 91 Express 63y2 - 343y*2 - 301y*2 + 4y*2 - 523y*2 in the form cy + a + dy2 and give d. -1100 Rearrange 15b*2 + 142b*2 - 441b - 450b + 895b to tb2 + gb + p and give g. 4 Rearrange -5 - q*3 + 5 + (32q - 9q + 5q)(-q2 + 3q2 + q2) + 0q3 - 2q3 + q3 to xq3 + vq + oq2 + a and give x. 82 Express (-5n*2 + 3n*2 + 15n*2)(0n + 5n + 0n) - n3 + 4n*3 + 0n3 - n3 - 8 + 0 + 5 in the form sn2 + zn + q + an3 and give q. -3 Rearrange 362 - 4w*2 + 10w*3 - 358 + 3w*2 to bw*2 + gw*3 + xw + h and give g. 10 Rearrange 3117l4 + 2l*3 + 14 - 3111l*4 + 8 to vl + dl2 + m + rl*3 + xl*4 and give x. 6 Express p - 9 - 2p + p*2 - 6p*3 + 4p + 24 - 13 as yp + zp*3 + f + dp*2 and give z. -6 Express -95 - 7375i - 57 - 55 + 207 + (-i + 3i - 3i)(3 - 1 + 0) in the form c + bi and give b. -7377 Rearrange (8y2 - 59y + 59y)(1 + 7y2 - 1) + (-3y3 + y3 + 3y3)(-2y - 2y + 2y) to wy + by3 + g + ly*4 + oy*2 and give l. 54 Rearrange 45l*2 - 139l*2 - 49l*2 - 2l to fl + ol*2 + y and give o. -143 Rearrange ((6g + 9g + 42g)(-1 + 4 - 1) + 2 - 2 + 9g)(g - g - g) to ag + wg2 + p and give w. -123 Express 63o - 273o - 126o + 12o - 255o as yo + s and give y. -579 Rearrange -209x*2 - 26x + 577x2 + 230x*2 + 26x to k + hx2 + lx and give h. 598 Rearrange -7h2 - h2 - 10h + 9h - 2h*3 + 0h + 3h2 to the form zh*2 + qh*3 + rh + a and give z. -5 Rearrange (-89 - 94 - 70)(1 - 1 - r)(-5 + 1 + 3) to the form gr + d and give g. -253 Express (43 + 6 + 3)(2o + 2o - 3o)(2o - 2o - o*2) in the form q + po + ko3 + do*2 and give k. -52 Express -36u + 45u - 26u - 1 in the form a + zu and give a. -1 Express -49w*3 - 46w*3 + 83w*3 - 2 - w + (2w*3 - 5w3 + w3)(-6 - 3 + 0) in the form tw + nw3 + g + dw2 and give t. -1 Rearrange 1 - 2 + t4 - 2t - t + 7t*3 - 27t*3 + 0 to the form ot*2 + st*3 + nt*4 + m + lt and give m. -1 Rearrange 16x2 + 128x - 128x - 12 + 18x*2 to bx + r + kx2 and give k. 34 Express -19 - y3 + 3y*3 + 4y*3 + 2y - 25 as hy + my*3 + j + iy*2 and give j. -44 Rearrange 2858n - 2382n + 13n*3 + 2n2 - n4 - 14n3 to the form dn*2 + zn*4 + c + kn + fn3 and give k. 476 Express -203131m - 47m2 - 5 + 203131m as rm + qm*2 + f and give f. -5 Rearrange (-v + v - 2v*2)(-1 + 3 + 0) + (5 - v - 3 + 0v)(-55v + 33v - 77*v) to the	{ "pile_set_name": "DM Mathematics" }
6. Let m(k) = k + 7. Let f(q) = -6g(q) - 5m(q). Let j be f(5). What is the highest common divisor of v and j? 6 Let k(p) = 46p3 + p2 + 8p - 3. Let l be k(4). What is the highest common divisor of l and 49? 49 Suppose 0 = -3p + v + 617 + 122, -2p - 5v = -504. What is the highest common divisor of 95 and p? 19 Suppose 4z + 78 = -w - 2w, 0 = -3w + 3z - 57. Let a be (w/(-10) - 1)15. Let y be 3 + (-4)/10135/(-18). What is the highest common factor of y and a? 6 Let r be (-2)/(4 + 78/(-19)). Suppose -4b = -9 - r. Calculate the highest common factor of 35 and b. 7 Let i be ((-285)/6)/((-5)/6). Calculate the highest common divisor of i and 21. 3 Suppose 2l + 2 = -8, 2f + 4l = -8. Let a be 26/f - 9/27. Suppose 2q = 5y - 0y - 104, -ay + 97 = 3q. What is the greatest common factor of y and 22? 22 Suppose -1095 = -5n + 5h, 665 + 436 = 5n + h. Calculate the highest common factor of n and 495. 55 Let p(w) = -3w + 132. Let u be p(-7). What is the highest common factor of 17 and u? 17 Suppose 0 = -3l - 3u - 6, -l + 4u + 25 = 7. Let b be 3/l - 114/(-4). Let x be ((-160)/b)/((-2)/6). What is the greatest common factor of 128 and x? 16 Let b(c) = c2 - 17c - 326. Let p be b(-29). What is the highest common factor of p and 63? 63 Let j = -163 + 102. Let y = j + 67. Calculate the greatest common divisor of y and 6. 6 Let p = 11 - 2. Suppose -40 = 5l - 9l. Let a = l - p. What is the greatest common divisor of 8 and a? 1 Let s be 9/3 + -22. Let v(n) = 15n + 18. Let g(i) = -i*2 + i. Let u(w) = sg(w) + v(w). Let k be u(-13). Calculate the highest common factor of k and 20. 5 Suppose 5c - 3t = 19 + 21, -20 = -2c + 2t. Suppose m = 5, 4m + 260 = 5r + m. What is the highest common factor of c and r? 5 Suppose 0 = s + 4r - 64, -4s - 4r + 2r + 326 = 0. Let w be (8/6)/((-2)/48). Let h be w/29/(-12). What is the highest common divisor of h and s? 12 Let c(b) = 6b + 2. Let u be c(2). Suppose -5s + s + 56 = 0. Let y be ((-7)/s)/((-1)/14). What is the highest common factor of u and y? 7 Let c be (-15)/(-12)24/2024. What is the greatest common divisor of 2556 and c? 36 Suppose 0 = -3j + 46 + 41. Let b = -9 + j. Calculate the highest common divisor of 180 and b. 20 Suppose -9933 + 1733 = -4d. What is the highest common factor of 82 and d? 82 Let y = 138 + -133. Suppose 4q + 141 + 431 = 4n, 0 = -yq + 25. What is the highest common divisor of n and 37? 37 Let p = -59 - -29. Let g = -26 - p. Suppose 4i + 2 = 2t, -i = -gt - 2i + 13. What is the greatest common divisor of 12 and t? 3 Let c(d) = d*3 + 24d*2 + 3d + 97. Let y be c(-24). Let i = -83 - 219. Let w = -27 - i. Calculate the greatest common divisor of w and y. 25 Suppose -u = -2u + 3. Suppose ul - 5l = 244. Let z = 221 + l. What is the highest common factor of z and 9? 9 Let g = -1200 - -1280. What is the greatest common factor of g and 3280? 80 Let m(h) = -4h + 16. Let t be m(4). Suppose t = 5f - 12 - 13. Calculate the highest common divisor of f and 5. 5 Let l = -1665 + 1714. Suppose 9 = 4i - 19. Calculate the highest common factor of i and l. 7 Suppose -42f = -15f - 2079. Suppose h + q = -h + 19, 0 = -q - 3. Calculate the highest common divisor of h and f. 11 Let k be ((-160)/(-25))/4605/2. Calculate the highest common divisor of 44 and k. 44 Suppose -3m - 9 = -6m. Suppose 0 = -3v - m + 12. Suppose 4q - 8q + 60 = 0. Calculate the greatest common factor of v and q. 3 Let f = -330 + 414. Let b be 4/(-4) + 2 - -6. Calculate the highest common divisor of b and f. 7 Let z(u) = 1. Let n(l) = 13l - 1. Let t(w) = n(w) + 2z(w). Let f be t(3). What is the greatest common divisor of 30 and f? 10 Let y be 1506/(-9) + 4/(-6). Let k = y + 288. Suppose -30 = 5r - 150. What is the highest common factor of r and k? 24 Let n be 65/15 + -4 - (-1114)/6. Calculate the greatest common divisor of n and 6. 6 Let d(s) = -12s*2 - 4s + 10. Let l be d(2). Let h = l + 94. Calculate the highest common factor of h and 120. 24 Suppose 13336 + 7217 = 51k. Calculate the highest common factor of 13 and k. 13 Suppose 62k = k + 2440. What is the greatest common factor of k and 1000? 40 Let d = 2 - -2. Suppose 3k - 4o = 374, dk - 5o = -k + 625. Suppose 0x - 5x + g = -95, 5x - 105 = 3g. Calculate the highest common divisor of k and x. 18 Suppose 0 = 10f - 36 - 74. Calculate the highest common divisor of 99 and f. 11 Let t(x) = x3 - 4x*2 - 2x - 2. Let d be 9 + 1 + -3 - 3. Let q be t(d). Let z be q/(-6)(-12)/(-4). What is the greatest common divisor of 10 and z? 5 Let p(k) = 21k*2 - 5k + 6. Suppose 4x + 3s - 8 = 0, -3x + 4 = -x + 3s. Let o be p(x). What is the greatest common divisor of o and 20? 20 Suppose 291 = 5u - 4t - 131, 2t = -6. What is the highest common factor of u and 2? 2 Suppose -152 = 10z - 12z. Calculate the highest common divisor of 19 and z. 19 Let i = 17 + -25. Let w = 7 + i. Let g be w/(4/(-15 + -1)). What is the greatest common divisor of g and 44? 4 Suppose -67 = -0s - 2s + 3u, 4u = -s + 61. Let j be (-12)/(-36) + s/3. Calculate the greatest common divisor of j and 2. 2 Suppose w + w = 5m + 10, -m + 10 = 2w. Suppose -2o = -mo - 150. Suppose 4v + p = 83, 0 = -2v - v - 5p + o. What is the greatest common factor of v and 4? 4 Suppose -35 = 2d + 3d. Let i(c) = c*2 + 8c + 4. Let k be i(d). Let w = -2 - k. Calculate the highest common factor of w and 1. 1 Let p = 111 - 101. Let t(v) = -v*3 + 14v*2 - 6v - 2. Let j be t(p). What is the highest common factor of j and 26? 26 Suppose 0v - 3v + 213 = -3j, -327 = 5j + 2v. Let i = 11 + j. Let f = -24 - i. What is the highest common divisor of f and 32? 32 Let n = 638 + -518. Calculate the highest common factor of 48 and n. 24 Let g be (1 - 9)4/(-2). Let o(m) = 87m - 134. Let v be o(2). Calculate the highest common divisor of g and v. 8 Suppose 321 = -4v + 2y + 2777, 0 = -4v + 3y + 2460. Calculate the highest common divisor of 72 and v. 36 Let v be 8/8 - -21. Suppose vh = 4h - 45. Let z be h/10(4 + -2). What is the greatest common divisor of 27 and z? 9 Let a(l) = -l2 - 14l + 27. Let u be a(-15). What is the greatest common divisor of 12 and u? 12 Suppose -5j - 12 = -11j. Calculate the highest common divisor of j and 62. 2 Let h = -36 - -41. Suppose y = 5y - 60. Let i = y + 10. What is the greatest common factor of i and h? 5 Let s(w) = 54w + 363. Let z be s(15). What is the highest common factor of 69 and z? 69 Let d(v) = 9 - 20v - 2 + 1 + v3 + 8v*2 - 1. Let m be d(-10). What is the greatest common factor of m and 14? 7 Suppose 118 + 34 = 8l. Suppose 0 = -3x - 2w + 6w + 61, 3x - 53 = -4w. Calculate the greatest common divisor of l and x. 19 Let w(o) = 165o. Let l be w(3). Let r = 19 - 16. Suppose rc = -0c + l. Calculate the greatest common factor of 15 and c. 15 Suppose -2h - 5c + 977 = 0, 2c = -5h - 17 + 2407. What is the highest common divisor of 612 and h? 68 Suppose 2c - f + 5f = 404, 2c = 4f + 404. Suppose 12i + 34 = c. What is the highest common factor of 14 and i? 14 Let i(u) = -u3 - 10u*2 + 28u + 70. Let n be i(-12). Calculate the highest common factor of n and 583. 11 Let r(j) = -j*3 + 13j*2 + 5j + 5. Let x be r(13). Let z = x + -50. What is the highest common factor of z and 70? 10 Let d = 36 + 4. Let b be (-1 - 1) + -1 - -1. Let a be (-13)/b - (-27)/(-18). What is the highest common factor of d and a? 5 Let b(t) = -9t - 55. Let l be b(-7). What is the greatest common factor of l and 536? 8 Let i(m) = -6m - 2. Let j(q) = -q*2 + 4q - 2. Let t be j(4). Let a be i(t). Let c = -101 - -116. Calculate the greatest common divisor of c and a. 5 Suppose 4h + 4a = 64, 5h - 4a - 70 = a. Calculate the greatest common divisor of h and 165. 15 Let b(t) = -46t + 852. Let x be b(18). Calculate the greatest common divisor of x and 3504. 24 Suppose 5w + 14p = 19p + 1600, 0 = -3p. Calculate the highest common divisor of w and 20. 20 Suppose 22 = p + 63. Let b = 63 + p. What is the highest common factor of 198 and b? 22 Let f(u) = -2u*3 - 2u*2 + 16u + 32. Let h be f(-2). What is the highest common factor of 40 and h? 8 Let z(y) be the second derivative of -y*4/12 - 7y*3/6 + 15y*2/2 + 18y. Let d be z(-	{ "pile_set_name": "DM Mathematics" }
87a2 - 8a*2). -946a*3 Expand (35 - 35 - 24z*5)(0 - 3 + 1) + 0z5 + 5z*5 - 6z*5. 47z*5 Expand (52 + 10 + 2z - 20 + (0 + 1 - 2)(z - 4z + z))(-83z + 9 + 0 - 11)(-3 - 2z + 3). 664z3 + 6988z*2 + 168z Expand ((4l - 5l + 0l)(4l - 2l - l) + 88l2 + 29l*2 + 39l*2 + (3l - 3l + 2l)(-l + 3l + 0l) + 3l*2 + 5l*2 - 3l*2)(-1 - 3 + 2). -328l2 Expand (-3 + 3 + q + 0q + 4q - 5q + (0q - 2q + 3q)(-3 + 2 + 4) + 3q - q - q)(-1 - 19 - 10). -120q Expand (-4577 - 6094 - 3744 - 6695 + 3881)(-4k - 2k + 5k). 17229k Expand (17b - 2b + 34b)(0 + 5 - 2) - 3 + 0 + 1 + 32b. 179b - 2 Expand 862p - 858p - 16 - 1 + (0p - p + 3 - p)(1 + 1 - 5). 10p - 26 Expand (2 - 2f - 2)(-331f + 9f2 + 640f - 237f). -18f*3 - 144f*2 Expand 2192 - c - 1097 - 1098 - 63c*2 + (4c - 5c - 4c)(5c - 2c - c + (3 - 5 + 1)(c - 3 + 3) - 3c + 2c - c + 1 + 3c - 1). -73c*2 - c - 3 Expand (-356s*2 + 1477s*2 + 804s*2)(6s3 + 0s*3 - 5s*3)(-1 + 4 + 0). 5775s5 Expand (6y - y - 4y)(-3y + 0y + 6y)(3306y - 22949y + 1 - 1377y). -63060y*3 + 3y*2 Expand (2t*2 - 3t*2 - 6t*4 + 11t*4)(-2t - 3t - 2t) + 0t*5 - 4t*5 + 2t*5 + (-3t*3 + 3t*3 - 2t*4)(3t - t - t). -39t*5 + 7t*3 Expand (36f - 31f - 19f)(-33 + 13 - 1 + (4 - 4 + 1)(-1 - 4 + 2)). 336f Expand (1 + 2 - 2)(-2u + 2u + u)(-110u - 15 + 91u + 15u - 2u2). -2u*3 - 4u*2 - 15u Expand (-2t2 - 4t + 4t)(2 - 2 + 1)(-30t - 1228 + 2634 - 1327). 60t3 - 158t2 Expand l2 + l5 - l2 + (12l2 + 6l*5 - 12l*2)(-3 + 2 - 3) - 39l5 + 66l*5 + 162l*5. 166l*5 Expand (-6i*2 + 7i*2 - 22i*2)(-i - 1 + 1) + (6 - 8 - 13)(i3 + 3i*3 - 7i*3). 66i*3 Expand -5045 - 802 + 4j + 934 + (5 - 1 - 2)(3j + j - 2j). 8j - 4913 Expand (0 + 0 - 1)(-599 - 647 - 729)(-4t + 2t + 3t). 1975t Expand (39u + 7u - 13u)(7 - 3 + 3)(-1 + 1 + 4u). 924u2 Expand (5z2 - z2 - 6z2)(4471z3 - z2 - 2225z*3 - 2221z*3 - 2z). -50z5 + 2z*4 + 4z*3 Expand (-2j - 2j + j)(1156j4 + 430j*4 + 689j*4). -6825j*5 Expand (-4r + 15 - 15)(r2 - 4r*2 + 2r*2) + (5 - 2 - 2)(0r - r + 0r)(3r + 0r - r)(-4r + 2r + r)(0 + 3 - 2). 6r*3 Expand 6o*2 + 31o*2 - 3o2 - o2 - o*2 + 4o*2 + (o - 2o + 0o)(-52o + 947 - 947). 88o*2 Expand (1 - 2 + 0)(-i - 2i - i) + (-5 + 2 + 0 + (-5 + 2 + 1)(0 - 5 + 2))(4i - 5i + 2i + (-3 + 5 + 2)(-2i + i + 2i)). 19i Expand (-1 - 7 - 2)(-4d + 4d - 2d*2)(-56 + 3d3 + 34 - 53) + (2d*5 + 3d*5 - 6d*5)(4 + 3 - 5). 58d5 - 1500d2 Expand (-k3 - 4k3 - k3)(2k - k - 7k)(0 + 3 - 5 + (-1 + 0 + 2)(3 - 1 - 1) + 0 + 4 - 1). 72k4 Expand r5 - r5 - 3r*5 + (-17r*5 + 33r*5 - 14r*5)(-1 - 5 + 2). -11r5 Expand (-35 + 13 + 23)(2l + 21 + 9l*2 + 8 - 19). 9l*2 + 2l + 10 Expand (22 + 4w + 6 - 8)(-w*2 - 3w*2 + 20w*2). 64w*3 + 320w*2 Expand -16948b*4 + 652b*2 + 3b + 33890b4 - 16943b4 + (b3 - 2b4 - b3)(-3 + 1 + 0) + 0b - 2b*4 + 0b. b*4 + 652b*2 + 3b Expand (-2r2 + r2 + 4r*2)(2r3 + r3 - r3 + (-270 + 145 + 12)(-7r3 - 9r*3 + 18r*3)). -672r*5 Expand (-5 + 3 + 3)(2y - y + y) + (395y + 22915 - 22915)(2 - 2 + 2). 792y Expand r*3 + 4r*2 - 4r*2 + (-4 + 0 - 3 + 2 + 2 - 5 + (-3 - 2 + 3)(0 + 6 - 4) + 1 + 0 - 2 - 1 + 0 + 0)(2r*3 - 7r*3 + 0r*3). 71r*3 Expand y + 0y - y3 + y + y3 + 1 - 1 - y*3 + 3y*3 + 0y*3 + (-6y + 2y + 3y)(-2y*2 + 3y - 3y) - 22y*3 - 33y*3 + 16y*3. -35y*3 + 2y Expand (4c3 - 4c*3 + 2c*4)(0 + 0 - 2) + (-3c2 + 2c*2 - 2c*2)(-6 - 9 - 27 + 2c)(33 + c + 39 - 47). -10c4 - 24c*3 + 3150c*2 Expand (4 - 1 - 1)(-2w - 4w + 5w) + 2w - w - 2w + 0 - 3w + 0 + 4979w - 9217w + 4595w. 351w Expand (9w4 + 18w*4 - 3w*4)(-w + 0w + 2w)(2 - 12 - 10) - 4w*5 - 3w*5 + 5w*5. -482w*5 Expand (1 - 6 + 4)(926l2 - 1855l*2 + 931l*2 - 297)(-6l2 + 6l*2 - 22l*3). 44l*5 - 6534l*3 Expand (0w4 + w4 + w*4)(4 + 1 + 1 + (6 - 5 + 5)(1 - 1 - 2) - 1 + 2 + 2 - 6 - 3 - 12). -48w*4 Expand 73559 - 3978j - 147117 + 73558 + (4 - 2 - 4)(3 + 2j - 3). -3982j Expand -873k*4 + 2627k*4 - 1007k*4 + 2k*4 + 0k*4 + 0k*4 + (-2k + 2k + 2k*3)(5k - 3k - k). 751k4 Expand (-a2 + 6a*2 + 7a*2)(6a - 39a - 12a). -540a3 Expand (j2 - 4j2 + 5j*2)(408 + 524 - 718)(0j + 4j - 3j)(6j + j - 3j). 1712j*4 Expand -24966 + 49934 - 24961 - 321k + (k - k + 2k)(5 + 2 - 5) - 2k + 3k + k. -315k + 7 Expand (-35 - 28 - 4)(q3 - q3 + q*3) + 2q*3 - 4 + 4. -65q*3 Expand (1 + 0 + 1)(3w + w - 6w)(787 + 93 + 41)(0w + 3w - w). -7368w2 Expand (a2 + 0a*2 + 0a*2)(-4a2 + 3a*2 + 0a*2 + (-a + 5a - 2a)(2a - a + 0a) + (0a + 0a - 2a)(-a + a + a) - 717a2 + 511 - 511). -718a*4 Expand 2x*3 + 0x*3 - 5x*3 + (4x*2 - 7x*2 + 2x*2)(-x + 2x + 0x). -4x3 Expand (-2 - 2o*2 + 2)(3o2 - o2 - 4o*2) - 955o*4 + 587o*4 - 1368o*4 + (-2o - 2o + 3o)(5o*3 + 8o*2 - 8o*2). -1737o4 Expand -u4 - 2u4 - 4u4 + (-u3 + 1 - 1)(-1 + 1 + 2u) - 1 + 12u4 + 6 - 7. 3u*4 - 2 Expand ((-1 + 3 - 4)(3 - 3 + 2s) + 27s - 64 + 64)(90s - 135s + 125s). 1840s2 Expand (11 - 21 + 2 - 3d)(19d + 59 - 32 - 29). -57d2 - 146d + 16 Expand (-2 + g + 2 + (5 - 4 - 3)(-3g + 5g - 3g))(-425g - 26834 + 26834). -1275g2 Expand -305c + 94c2 + 305c + 0c + 0c + 2c2 + (0 + 0 + 2c)(-5c + 2c + c) + 2c*2 - 2c2 + c2 + (0c + c + 0c)(-1 - c + 1) - 4c*2 - 5 + 5. 88c*2 Expand (8 - 34 - 26)(-2r - 7r + 10r + (2 + 3 - 7)(3 - 3 - 2r) + 0 + r + 0)(-1 - 3 + 2). 624r Expand (-995k + 1222k + 3458k)(-2k*2 + 0k*2 + 3k*2). 3685k*3 Expand (4f*3 + 14f*3 + 12f*3)(-3 + f + 3) - 7f4 + 6f*4 + 2f*3 - 11f*3. 29f*4 - 9f*3 Expand -2026s*2 - 71291 - s + 142581 - 71291 + (0 + 0 + 2s)(-s - s + 0s) + s - s - 2s2. -2032s*2 - s - 1 Expand (-11v*2 + 12v*2 + 31v*2)(-38v2 + 63v*2 - 50v*2) + 4v4 + v4 - 2v4. -797v*4 Expand (190l*5 - 98l*5 - 123l*5)(-6 + 4 + 0 + 21 + 15 - 22 + 1 - 2 + 0 + (1 + 1 - 3)(-5 + 0 + 3)). -403l*5 Expand (2r*2 + 1228 - 517 + 945)(-r*2 - 4r*2 + 2r*2). -6r*4 - 4968r*2 Expand (-4a*2 + 4a*2 - 2a*3)(4584a - 7562 - 2a*2 + 3794 + 3769). 4a*5 - 9168a*4 - 2a*3 Expand -4a + 4a - a3 + 0a*3 - 3a*3 + 2a*3 + (3a*2 - 2a*2 - 5a*2)(5a - 15 + 15) - 107 + 14a*3 + 107. -8a*3 Expand (-6 + 3 - 6)((0 - 2 + 4)(-r + 2r + 0r) - 2r + 2r + 5r) - 12r + 34r + 13r. -28r Expand (c*3 + 0c*3 + 3c*3)(-25c2 + 36c*2 - 20c*2) + (4c - 2c - 4c)(1 + 6 - 1)(2c4 - 4c*4 + 3c*4). -48c*5 Expand (-1263 - 3641 + 1430 - 7470 - 3088)(4p - 3p + p). -28064p Expand 18 + z4 - 2z*5 - 18 + (-8 - 15 - 10)(2 - z*5 - 13z*5 + 5z*5). 295z5 + z4 - 66 Expand (0c3 + c3 - 4c*3)(-4 - 5 + 5) - 11 - 403c3 - 6 - 9 + 28. -391c*3 + 2 Expand (0a2 - a4 + 0a2)(a - 4a + 5a) + (3a3 + 5a - 5a)(2a2 - 812a - 805a + 1629a). 4a5 + 36a*4 Expand (a - a + a)(3 - 3 + 2)(-1072 - 619 - 991)(3 + 2 - 8). 16092a Expand (-2 - 1 + 4)(-2 - 1 - 1)(-33f + 250 - 250). 132f Expand 4662y*2 + 5575y*2 - 2629y*2 + (0y - y + 2y)(-3y + 2y - y) + (4 - 2y - 4)(-y + 3 - 3)(2 - 2 - 1). 7604y*2 Expand (-4 + 4 - 7c)(-5 - 1 + 3)((-c + 3c - 4c)(2 - 3 + 0) + 144c + 22c - 36c). 2772c2 Expand (4991g*2 - 66142g + 66142g)(0g2 - 3g*2 + 5g*2). 9982g4 Expand z2 - z*2 + 2z*4 + (-4z*2 + 4z2 - z2)(-3z*2 + 3z*2 - 2z*2) + (-11965 - 23z + 11965)(4z*3 + 21z - 21z). -88z*4 Expand (-2 + 2 - 2p)(34 + 48 - 128)(1 + 4 - 3)(-1 - 5 + 4)(-4p3 - 11p*2 + 11p*2). 1472p*4 Expand (-39f*2 - 33f*2 - 15f*2)(f + 3f - 2f)(-3f - f + 2f). 348f*4 Expand (-4j2 - j2 + 4j2 + (-2j - j + 2j)(-3j + 5j + 0j))(-15599 + 7804 + 56917j2 - 845j*2 + 7795). -168216j*4 Expand (14y*3 - 11y*2 + 11y*2)(-4y - 3y + 0y)(-4 + 3 - 3 + (-1 + 0 - 1)*(5 - 6	{ "pile_set_name": "DM Mathematics" }
+ 13 Let k = 9 - 5. Let g(c) = -4c3 + 4c*2 + 4c. Let t(q) be the third derivative of q*6/15 - 3q*5/20 - 3q*4/8 + 2q*2. Determine kt(i) + 9g(i). -4i3 Let w(u) = -u2 - u. Let j = 13 - 7. Suppose -t + j = -2o, -4t = -0t + 2o + 26. Let q(l) = 2l3 - 6l*2 - 4l. Give tw(y) + q(y). 2y*3 - 2y*2 Let s(n) = 92897n. Let p(c) = -165c. Determine -1127p(r) - 2s(r). 161r Let m(h) = 256h + 1. Let n(y) = -256y. Give -2m(u) - 3n(u). 256u - 2 Let d(q) = -q - 2. Let g(o) = -3o + 33. What is -2d(l) + g(l)? -l + 37 Let j(v) = 5v - 4. Let r = -92 + 101. Let b(u) = u - 1. Calculate rb(a) - 2j(a). -a - 1 Let q(w) be the third derivative of w*4/4 - 4w*3/3 + 31w*2. Let p(u) = -1. Determine -8p(a) + q(a). 6a Let b(r) be the first derivative of -2r*2 + 4 - 3r - 1/3r3. Let l(u) = -2 - 2u + 2u - 3u. Give -2b(n) + 3l(n). 2n2 - n Let x(t) = -2t*2 + 2t. Let k(r) = -120r3 + 90r*2 - 90r. What is 2k(a) + 90x(a)? -240a3 Let p(n) = 20n - 8. Let s(c) = 61c - 22. Determine 11p(d) - 4s(d). -24d Let s(a) = 6a3 - 22a*2 - 32a + 9. Let d(l) = -3l3 + 10l*2 + 16l - 4. Determine 9d(y) + 4s(y). -3y3 + 2y*2 + 16y Let n(z) = -z*2 + z. Let t(y) = 2y*2 - 4y + 2. Let r be 390/(-33) + 8/(-44). Let k be r/10(-30)/9. What is kn(c) + t(c)? -2c2 + 2 Let k(u) = 7u + 2. Let l(j) = 9j + 3. Determine 5k(x) - 4l(x). -x - 2 Let z(o) = -293o*3 - 6o*2 + 63o + 51. Let f(y) = -y3 - y2 - 2. Let a(u) = 6f(u) - z(u). Let t(s) = -18s*3 + 4s + 4. Give -4a(q) - 63t(q). -14q3 Suppose -10z - 3 = -13z. Let a(t) = -3 + 0 + z. Let w(y) = -y - 2. Determine 3a(f) - 2w(f). 2f - 2 Let d(w) = -2. Let q(a) = -a + 40. Calculate -4d(i) - q(i). i - 32 Let c(w) = -7w + 17. Suppose -2p = -7p - 990. Let l be (p/27)/((-2)/(-3)). Let i(u) = 4u - 9. Determine li(v) - 6c(v). -2v - 3 Let j(p) = 5p - 7. Let m(g) = -12g + 543. Let v be m(46). Let s be (-4)/(-10) + 44/(-10). Let f(y) = -2y + 3. Determine sj(l) + vf(l). -2l + 1 Let q(r) = 152 + 139 - r - 291. Let b(g) = -5g - 2. Calculate b(s) - 6q(s). s - 2 Let u(v) = -11v - 6. Suppose t + 19 = 25. Let z(b) = -12b - 7. What is tu(q) - 5z(q)? -6q - 1 Let k(u) = 32u - 5. Suppose -4d + 72 = 28. Let v(z) = -11z + 2. Determine dv(c) + 4k(c). 7c + 2 Suppose -5g - 33 = -15f + 13f, 4g + 5f = 0. Let r(h) = h3 - h2 - h - 1. Let l(z) = -7z3 + 3z*2 + 3z + 5. What is gr(a) - l(a)? 2a*3 + 2a*2 + 2a Let x(h) = -h*2 + h + 1. Let f(s) = -14s*2 + 2s + 2. Determine 4f(a) - 8x(a). -48a2 Let k(n) = 2n*3 - 23n*2 + 5n - 2. Let b(v) = -v + 1. Determine -2b(f) - k(f). -2f*3 + 23f*2 - 3f Let k(d) = 7d3 + 3d*2 + 4d - 6. Let h be (476/(-98))/(4/(-14)). Let n(x) = -20x3 - 8x*2 - 11x + 17. Determine hk(t) + 6n(t). -t*3 + 3t*2 + 2t Let p(j) be the third derivative of -j5/15 + j4/12 - 5j3/6 - 3j*2 + 41j. Let c(m) = 3m2 - m + 4. What is -3c(b) - 2p(b)? -b2 - b - 2 Let s(z) = 4z + 3. Let u(f) be the second derivative of -7f + 0f*4 - 13/6f*3 - 9/2f*2 + 1/20f*5 + 0. Calculate -7s(r) - 2u(r). -2r*3 - 2r - 3 Let t(o) = o + 1. Let m(s) = -3s + 3s - 9 - s + 11 + 7s. Give m(z) - 8t(z). -2z - 6 Let b(m) = -4m*2 - 5m + 9. Suppose -9 = -3c - 6. Let u(i) = -3i + c - 2 - 1 - 2i2 + 7. What is -3b(s) + 5u(s)? 2s*2 - 2 Let j(x) = 42x*2 + 5x - 5. Let c(f) = -525f2 - 63f + 63. Suppose -1198v + 35 = -1191v. Determine vc(r) + 63j(r). 21r2 Let q(v) = -9v*2 - 4v + 5. Let b(p) = 13p2 + 7p - 8. Calculate 5b(r) + 8q(r). -7r2 + 3r Let t(m) = m*3. Let a(g) = -324 + 163 + 162 + 3g*3. Let p = -23 + 27. Determine pt(q) - a(q). q*3 - 1 Let i(p) = -266p*2 + 56p. Let o(n) = 14n2 - 3n. Suppose 0 = -38r + 17 + 97. Give ri(s) + 56o(s). -14s*2 Let c(b) = 16 + 5 - 8b*2 + 17b*3 - 13. Let p(m) = -6m*3 + 3m*2 - 3. Let x be 4 - -34/3. Calculate xp(f) + 3c(f). 3f3 Let c(w) = -13w*3 + 3w2 + 4. Let b(s) = s3 + s*2 + s. Let a(z) = -9z*3 - 4z*2 - 5z + 1. Let f(h) = a(h) + 5b(h). What is -2c(v) + 7f(v)? -2v3 + v2 - 1 Let w be ((1 + 0)-3)/(-7 + 6). Let v(x) = -x + 5 + 0x3 - w + x3. Let b(z) = 3z3 - 3z + 6. Determine -4b(l) + 11v(l). -l*3 + l - 2 Let x(j) = -2j - 4. Let o(l) = -36l + 176. Determine 6o(y) + 264x(y). -744y Let n(k) = 25k - 5 + 13 - 27k. Let m(h) = 1. Let a(x) = -4x - 1. Let g be a(-2). Let t = g + 1. Give tm(q) - n(q). 2q Let i(c) = 5c*2 - 2c + 2. Let x(v) be the third derivative of v5/60 - v4/24 + v*3/6 + 31v*2 - 2v. Calculate 2i(j) - 4x(j). 6j2 Let k(n) = 2n*2 + 5n + 5. Let w = -53 + 29. Let h(b) be the third derivative of -3b5/20 - b4 - 4b*3 - 191b*2. What is wk(r) - 5h(r)? -3r*2 Let b(x) = -7x - 3. Suppose -205m = -217m - 132. Let i(f) = -1. Let o(t) = -5t - 11. Let q(z) = 36i(z) - 4o(z). What is mb(c) - 4q(c)? -3c + 1 Let j(i) be the first derivative of -3i2/2 - 3i + 115. Let r(y) = y - 1. What is 2j(x) - 6r(x)? -12x Let y(o) = -o + 1. Let h(f) = -26 + 4 + 19 - 3f + 4. Calculate -h(w) + 5y(w). -2w + 4 Let j = 4 - -2. Let r(p) = -2p2 - 6p + 6. Let y(t) = -21t2 + 7t + 17. Let o(s) = 16s2 - 5s - 13. Let g(u) = -4o(u) - 3y(u). Give jg(w) - r(w). -4w*2 Let k(h) = 10087 - 5019 - 5046 + 4h. Let a(l) = l + 7. What is 7a(j) - 2k(j)? -j + 5 Let c(r) be the first derivative of -4r2 - 1. Suppose 0 = m + 3t - 2, -2m + 10 = -5m - t. Let h(l) = -4l. What is mc(x) + 7h(x)? 4x Let l(w) = -5w - 5. Let z(r) be the third derivative of -r4/4 - r3 + 2r*2. Let f = 160 - 163. Let n(a) = -a - 5. Let x be n(-9). What is fz(b) + xl(b)? -2b - 2 Let f(r) = -3r3 + 5r*2 - 4r. Let u = -8 + -11. Let x = -17 - u. Suppose 2 = xt - 3t. Let w(c) = -c*3 + 2c*2 - 2c. Calculate tf(y) + 5w(y). y*3 - 2y Let z(o) = -2127o2 - 21o. Let n(f) = 425f2 + 4f. Determine -21n(v) - 4z(v). -417v2 Let a(u) = 8u + 1. Let l(w) = -23w - 106 + 307 - 103 - 100. Calculate 8a(t) + 3l(t). -5t + 2 Let u(y) be the second derivative of -7y5/20 - 3y*4/4 - 5y3/6 - y2 + 13y - 3. Let g(k) = 11k*3 + 14k*2 + 8k + 3. What is 5g(f) + 8u(f)? -f*3 - 2f*2 - 1 Let v(b) = -20b*2 + 95. Let y(s) = -14s*2 + 63. What is -5v(r) + 7y(r)? 2r*2 - 34 Let q(l) = -l - 2. Let a = 68 + -62. Suppose 0 = -g + ag - 5. Let r(b) = 1. Calculate gq(m) + r(m). -m - 1 Let t(o) = -5o*3 - o + 2. Let h be (24/(-2))/(1/(-11)). Suppose u = 12u - h. Let f(j) = j3. What is uf(n) + t(n)? -n*3 - n + 2 Let c(s) = 18s*3 + 4s + 4s2 + 3s*2 + 5s - 21s3 - 2s. Let k(q) = -3q3 + 6q*2 + 6q. Give 6c(f) - 7k(f). 3f3 Let x(f) = 7f - 1. Suppose 28 = 4a + 2l, 3a + 3l - 29 = -5. Let o = -1 + a. Let i(z) = 3 + 7 - oz + 13z - 11. Determine 6i(y) - 7x(y). -y + 1 Let p(k) = -3k3 + 2k*2 - 5k - 18. Let f(j) = -8j3 + 4j*2 - 11j - 34. Give 3f(o) - 7p(o). -3o3 - 2o*2 + 2o + 24 Let g(n) = -8n2 + 295n + 4n2 + 4 - 595n - 18n3 + 296n. Let u(x) = -x3 - x2 - x + 1. Calculate g(i) - 4u(i). -14i3 Let c(w) = w2. Suppose -8 = u + u, 4b = u. Let i(s) = -8s*3 - 12s*2. What is bi(z) - 12c(z)? 8z*3 Let t(w) = -12w*2 - 4w + 5. Let d(j) = 3j2 + j - 1. Suppose -y - 33 = -35. What is yt(g) + 9d(g)? 3g*2 + g + 1 Let n(h) = -10h*2 - 3h. Let c = 1322 - 1319. Let y(l) = -39l2 - 13l. What is cy(s) - 13n(s)? 13s2 Let q(t) = -8t - 3. Let b(s) be the third derivative of -23s4/24 - 3s*3/2 + 3s*2. Suppose -u - h + 14 = h, -h = -4. Give ub(v) - 17q(v). -2v - 3 Let m(d) = 4d2 + 6d. Suppose -3f - b = -10 - 34, 0 = f - 5b - 36. Let g be (-5)/(15/2) + f/(-3). Let j(t) = t*2 + t. Give gj(u) + m(u). -2u2 Suppose -8j - 34 - 6 = 0. Let d(w) = -5w2 - 9w + 5. Let c(y) = -4y2 - 8y + 4. Let k be 15/(-20)-4 - -3. Determine jd(x) + kc(x). x2 - 3x - 1 Let t(x) = 4x2 - 3x - 3. Let u = 514 - 508. Let l(w) = -14 + 9w2 + 14w*2 - 3 - 17w. Determine ul(y) - 34t(y). 2y2 Let l(o) = -4o*3 + 16o*2 - 6o - 6. Let z(p) be the second derivative of 9p5/20 - 11p*4/4 + 13p*3/6 + 13p*2/2 - 223p. Calculate 13l(a) + 6z(a). 2a3 + 10	{ "pile_set_name": "DM Mathematics" }
. Let b = f - 8. Solve -2c2 + bc*2 - 3c*2 = 0. 0 Let r(d) be the second derivative of 5d*4/4 + 5d*3/3 - 11d + 1. Factor r(u). 5u(3u + 2) Let z(y) be the third derivative of -3/56y*4 + 0y + 0y5 - 8y*2 + 1/280y*6 + 1/7y3 + 0. Let z(r) = 0. What is r? -2, 1 Let j(h) = h3 - 8h2 + h - 4. Let o be j(8). Factor 3d*3 - 5d*3 + od*3 + 2d*2. 2d*2(d + 1) Suppose 0 = -14k - 10k + 48. Factor -6/5s - 2/5 + 8/5s*k. 2(s - 1)(4s + 1)/5 Let a = 5 + -5. Suppose -2h = -4u + 6, 0u + u - 3 = a. Determine v so that -hv*4 - 5v + 2v5 + 4v2 - v4 + 3v = 0. -1, 0, 1 Let f(c) be the second derivative of c8/1344 - c6/240 + c4/96 + 3c*2/2 + 2c. Let k(w) be the first derivative of f(w). Factor k(o). o(o - 1)2(o + 1)*2/4 Let h(m) = 7m + 1. Let u be h(-1). Let q be ((-1)/u)/(2/4). Suppose 0 - qt - 1/3t*2 = 0. Calculate t. -1, 0 Determine t, given that 6t + 0 - 3t2 - 3/2t*3 + 3/4t*4 = 0. -2, 0, 2 Suppose 0b - 2 = -b. Let o = b + 0. Let -9m2 + 0m*3 - 2m3 + m2 + om + 8m4 = 0. What is m? -1, 0, 1/4, 1 Factor q3 + 2 - q*4 + 2q*3 + 3q*4 + 5q*3 + 12q*2 + 8q. 2(q + 1)4 Let 5r*4 + 5r + 5r2 + 0r - 10r2 - 5r3 = 0. What is r? -1, 0, 1 Let o(x) be the second derivative of x6/6 - 5x4/12 - 4x. Determine a, given that o(a) = 0. -1, 0, 1 Let c(v) be the third derivative of v8/336 - v7/35 + 13v6/120 - v5/5 + v4/6 + 7v*2. Suppose c(u) = 0. What is u? 0, 1, 2 Let t be (-3 - -2) + 1 + 3. Suppose td = -4m + 5m + 8, 5m + 10 = 0. Factor ds*2 - 18/7s + 4/7. 2(s - 1)(7s - 2)/7 Let z(m) = m2 + 7m - 13. Let n be z(-9). Suppose 0 = -nu + 10. Factor 0 + 3/5v*u + 3/5v. 3v(v + 1)/5 Let h(a) be the third derivative of a8/13440 - a7/1680 + 7a4/24 + a2. Let k(b) be the second derivative of h(b). Let k(w) = 0. Calculate w. 0, 3 Let p = -15 - -17. Let k(y) be the second derivative of -1/75y*6 + 0 - 1/5y*2 + 1/15y*4 + 0y*5 - py + 0y3. Let k(t) = 0. Calculate t. -1, 1 Let f(r) be the second derivative of r6/45 + r5/6 + 7r4/18 + r3/3 + 35r. What is v in f(v) = 0? -3, -1, 0 Let q be (-1155)/(-297) - 1/(-9). Let c(d) be the first derivative of 4/15d*6 + 0d*2 - 14/25d*5 + 3 + 0d + 1/5dq + 2/15d*3. Factor c(i). 2i*2(i - 1)*2(4i + 1)/5 Let k be -2 + 1 + (-218)/(-216). Let m(n) be the third derivative of 0n + 1/90n5 - kn*4 - 2/27n*3 - 3n*2 + 0. Determine q, given that m(q) = 0. -2/3, 1 Let t be -86/(-60) - (0 + 0). Find v, given that 6/5v + t + 2/5v2 = 0. -2, -1 Let p(w) be the second derivative of -w7/14 + w*6/15 - 10w. What is h in p(h) = 0? 0, 2/3 Determine d, given that -8d5 - 42d*2 - 4d*5 + 3d*4 + 9d*5 + 33d - 2 - 7 + 18d3 = 0. -3, 1 Suppose 6o + 128 = 2o. Let j be o/(-14) - (-2)/(-7). Factor -1 - 1 + 4w - 8w - 2w*j. -2(w + 1)*2 Let r(i) be the second derivative of 0 - 1/3i*4 + 0i*2 - i + 2/3i*3. Factor r(h). -4h(h - 1) Suppose 20o + 17 - 57 = 0. Suppose -2i - 3 - 1/3i*o = 0. What is i? -3 Let g be 3/4 + (-1)/2. Let v be 5 + ((-8)/12 - (-49)/(-12)). Determine q so that -gq + vq2 + 0 = 0. 0, 1 Let r(w) be the third derivative of w5/150 + w4/10 + 22w*2. Factor r(k). 2k(k + 6)/5 Suppose 0 = -3t - 2i + 7, 5i = 3t + t - 17. Let g(u) be the first derivative of -4u*2 + 2 - 6u*t - 8/9u. Solve g(d) = 0 for d. -2/9 Let t = -33 - -37. Let y(g) be the first derivative of -1/4gt + 0g + 8/9g3 - 2/3g*2 - 2. What is m in y(m) = 0? 0, 2/3, 2 Let h be -2 - (-4 - (-2 + -4 + 4)). Factor 0v - 1/4v2 + h. -v2/4 Let r = 178/3 - 59. Factor -2/3y*3 + 1/3y*4 + 0y + 0 + ry2. y2(y - 1)2/3 Let f(c) be the second derivative of c6/120 + 8c. Determine z so that f(z) = 0. 0 Suppose 0z + 5t + 32 = 4z, -2t + 7 = 5z. Let -7d4 + 2d*5 + 0d4 + d2 + 2dz + 2d5 = 0. What is d? -1/4, 0, 1 Let x(o) be the second derivative of -o6/195 - o5/65 + o4/78 + 2o3/39 - 19o. Determine c, given that x(c) = 0. -2, -1, 0, 1 Let q(g) be the second derivative of g7/21 - g6/5 + 3g5/10 - g4/6 + 4g. Factor q(c). 2c2(c - 1)3 Let d(h) be the second derivative of h6/45 - h5/15 + h4/18 + 11h. Solve d(f) = 0 for f. 0, 1 Let -243o*5 - 15o + 41o4 - 39o*3 + 127o*2 + 3o - 419o4 - 43o*2 = 0. Calculate o. -1, 0, 2/9 Let c(k) = 15k*4 - 36k*3 + 29k*2 - 4k. Let t(d) = 15d4 - 36d*3 + 30d*2 - 3d. Suppose -9o + 6o = 9. Let j(i) = oc(i) + 2t(i). Factor j(w). -3w(w - 1)*2(5w - 2) Let f be (4 + -1)/((-2)/(-2)). Find t such that -t3 + t3 + t5 + 2t*4 + 4t*3 - ft*3 = 0. -1, 0 Let p(w) be the first derivative of -2w*5/35 + 4w*3/21 - 2w/7 - 9. Find s such that p(s) = 0. -1, 1 Factor 2/3h5 - 10/3h*4 + 2 + 4/3h*2 + 4h*3 - 14/3h. 2(h - 3)(h - 1)*3(h + 1)/3 Factor 15y4 - 78 + 13y + 2y - 5y*5 - 10y*2 - 10y*3 + 73 + 0y. -5(y - 1)4(y + 1) Let v(z) be the third derivative of -z8/2184 + z7/1365 - 8z2. Factor v(t). -2t*4(t - 1)/13 Let l(d) = d4 + d3 - d + 1. Let f(t) = t*4 + 16t*3 - 10t*2 - 56t + 41. Let a(c) = -f(c) - 4l(c). Suppose a(m) = 0. Calculate m. -3, 1 Factor 4/9s*2 + 2/9s - 2/9s4 + 2/9s*5 - 2/9 - 4/9s*3. 2(s - 1)*3(s + 1)*2/9 Let d(j) = -3j*3 - 3j*2 - 3j. Let y be d(-2). Let w be 1/3 - 6/y. Factor w + 1/5f3 + 3/5f*2 + 2/5f. f(f + 1)(f + 2)/5 Factor 44k2 + 49k*2 - 118k*2 + 35k + 5k3 - 19 + 4. 5(k - 3)(k - 1)2 Let k(b) be the third derivative of -b7/3780 + b4/24 - 2b2. Let y(a) be the second derivative of k(a). Find o such that y(o) = 0. 0 Let a(d) = d2 + 21d + 42. Let j be a(-19). Determine k, given that 0 - 2/9k - 2/9kj + 2/9k*2 + 2/9k*3 = 0. -1, 0, 1 Let g = -5 - -29. Suppose p - 3y = -9, 3y + 0y = -4p + g. Find x, given that -6 - 5x*3 + 9x + x*3 + 2x3 - xp = 0. -2, 1 Let y = 3 - 3. Let z be 3 - 13/5 - y. Factor -2/5r2 - 4/5r*3 + 0r - zr4 + 0. -2r*2(r + 1)*2/5 Let f be 2(10/4 - 0). Factor -2y2 - 3y - 1 + 3y5 + 3 - 4y*f + 4y3. -(y - 1)3(y + 1)(y + 2) Suppose 0 = -0o - 3o + 9. Suppose 0 = -5j + 8j - 15. Let -3a4 + 3a*3 - 5a*5 - 2a*5 + 2aj - ao = 0. What is a? -1, 0, 2/5 Factor 1/7u3 + 1/7u*2 + 0 - 2/7u. u(u - 1)(u + 2)/7 Let c be (0 - -1)/(0 + 1). Suppose 1 + c = l. Factor 4hl - 3h - h3 - h2 + 0h + 1. -(h - 1)3 Let x(f) be the first derivative of -f - 1 - 1/30f*4 - 1/15f*3 + 0f*2. Let q(d) be the first derivative of x(d). Suppose q(u) = 0. Calculate u. -1, 0 Factor 0 + 1/5n*5 + 2/5n*2 - 1/5n - 2/5n4 + 0n*3. n(n - 1)*3(n + 1)/5 Let j(b) = -b*3 - 2b*2 - 2b - 3. Let u be j(-2). Let r = 3 - u. Let 3 - 4 + ra + 0a - a*2 = 0. Calculate a. 1 Let w be 3(2 + -3) + 5 + -2. Let z(v) be the third derivative of 1/15v3 + 0 + wv4 - v2 - 1/150v5 + 0v. Let z(t) = 0. What is t? -1, 1 Let w(s) be the second derivative of s6/30 - s5/10 + s3/3 - s2/2 - 6s. Factor w(q). (q - 1)3(q + 1) Let b = 0 + 2. Determine f so that -13f3 - 4f - 27f4 - 12f*b + 23f*4 + 7f*3 - 6f*3 = 0. -1, 0 Let s = -15 + 11. Let a be s/(-42)37. Factor -1/4 + 1/2m + 3/4ma. (m + 1)(3m - 1)/4 Let d(k) be the second derivative of -k6/12 + k5/8 - 10k. Determine x so that d(x) = 0. 0, 1 Let p(d) = -20d4 + 14d*3 - 17d + 17. Let n = 0 - -4. Let i(k) = 7kn + 6k - 6 - 5k3 + 0k*3 + 0. Let q(c) = -17i(c) - 6p(c). Factor q(r). r3(r + 1) Suppose 2l - 9 = -3j, -3j = -4l - 0l + 9. Let -12 + 12 + lc*2 = 0. Calculate c. 0 Let y be (-4)/(-3) + (-6)/(-9). Solve 1 + 6b*y - 4b*3 + 4b - 3b2 + b4 - 5 = 0. -1, 1, 2 Let r(b) be the first derivative of -b6/6 + 4b*5/5 - 3b*4/4 - 4b*3/3 + 2b2 - 8. Find u, given that r(u) = 0. -1, 0, 1, 2 Let f(s) be the second derivative of -s6/540 + s5/90 - s4/36 + s*3/6 + 3s. Let n(m) be the second derivative of f(m). Find r, given that n(r) = 0. 1 Let z(l) = 4l2 - 5l + 4. Let u(i) = i*2. Let o(s) = -3u(s) + z(s). Let k be o(4). Factor 0 - 2/7p3 - 2/7p*2 + kp. -2p2(p + 1)/7 Let g be (-294)/(-30) - 8 - 0. Find w, given that 3/5w2 - gw + 6/5 = 0. 1, 2 Factor -146l2 + 294	{ "pile_set_name": "DM Mathematics" }
531 - -1216. What is the units digit of l? 7 Suppose 3 = -w + 6. Let q(z) = 10z - 10z - w + 6z + 7z. What is the tens digit of q(2)? 2 Let z(u) = u*2 - u + 3. Let f be z(0). What is the units digit of -4 - (-7 + f + -46)? 6 Suppose 4o - 2x + 640 - 3086 = 0, -3x = -o + 614. What is the units digit of o? 1 Let c = 53 - 50. Suppose 12 = ci - 15. What is the units digit of i? 9 Let m(t) be the second derivative of -5t*3/6 - 5t*2/2 + t. Let r = 1724 - 1728. What is the tens digit of m(r)? 1 Suppose -3w - 12 = -5w. Suppose -5b + 2u = -51, -wu = -b - 3u + 5. What is the units digit of b? 1 Suppose -5 = 13v - 18v, 3v - 3639 = -3t. What is the hundreds digit of t? 2 Suppose 4b + 0s = -3s - 323, 5b = s - 418. Let m = b + 187. What is the hundreds digit of m? 1 Let m = 746 + -444. Suppose 360 = 2r - 5n, -215 = -3r - 4n + m. What is the tens digit of r? 7 Suppose 4u - 416 = 232. What is the units digit of u? 2 Let p(y) be the first derivative of y*3/3 - 3y*2/2 + 10y - 2. Suppose -3 = 2w - 11. What is the tens digit of p(w)? 1 Suppose 0 = 4a + 134 - 1154. Let s = a - 149. What is the hundreds digit of s? 1 Suppose -97 = -6a + 17. What is the tens digit of a? 1 Let s = 9213 + -4742. What is the tens digit of s? 7 Let x be -3 - (-3 + (140 - -1)). Let a = x + 203. What is the units digit of a? 2 Let a = 8 - 19. What is the units digit of 180/153/((-6)/a)? 6 Let g = -34 + 36. Suppose 0 = -gp + 5p - 585. What is the hundreds digit of p? 1 Let l(t) = -t + 7. Let q(f) = -f + 15. Let n be q(7). Let x be 1/2 - (-20)/n. What is the units digit of l(x)? 4 Let b(l) be the second derivative of l*4/12 - 5l*3/6 - 6l*2 - 7l. What is the units digit of b(7)? 2 Let d be (-2 - -1) + 2(-18)/(-12). Let m(v) = -25v - 3. Let n be m(-4). Suppose -dg + 4j + 31 + 69 = 0, 2g = 3j + n. What is the tens digit of g? 4 Suppose 0q + q = 0, 3b + 6 = 4q. Let g(m) = 2m + 1. Let k be g(b). What is the tens digit of (212/(-20))/(k/15)? 5 Suppose -2k = 2r - 8692, -6k - 8716 = 3r - 5r. What is the thousands digit of r? 4 Let i be 33/((-27)/(-30)). Suppose -5y = -10y + i. Suppose -ya + 98 = 5c, -5c - a + 106 = 3a. What is the units digit of c? 8 Let m(v) = -3v - 10. Let d be m(-4). Let i(j) = j - 5 - 2j*2 + 7 + 0j*2 - dj + 2j3. What is the units digit of i(1)? 1 Let h = 453 + -311. What is the hundreds digit of h? 1 Let u be (65/(-15) - -4)/((-1)/9). What is the tens digit of u/(-9) - (-265)/3? 8 Let l be ((-3)/(-6))/(4/104). Let g = -8 + l. Suppose -4c + 2q + 20 = 0, gc - 5q + 3 = 28. What is the units digit of c? 5 Let o(f) = 3f*2 + 4f - 6. Let c(w) = -w*3 - 2w*2 + 4w - 1. Suppose -t = -g - 2t - 2, -g = -t + 4. Let u be c(g). What is the units digit of o(u)? 6 What is the tens digit of (-39)/(-52) + 3370/8? 2 Suppose 0 = 4x - 10 - 10. Let v be 3 + -3 + x - 3. Suppose h + vb = -2h + 30, 2b - 6 = 0. What is the units digit of h? 8 Let b(g) = 1670g*2 - g - 5. What is the units digit of b(-1)? 6 Suppose 7p - 664 - 3585 = 0. What is the hundreds digit of p? 6 Let u(b) = -130b3 - b2 + b + 3. Suppose -3r + 33 = 36. What is the tens digit of u(r)? 3 What is the units digit of ((-2)/(-5))/((-61)/(-786290))? 6 Let r(h) = 10h - 2. Suppose -u - o + 2 = -4, -3u = -5o - 42. What is the tens digit of r(u)? 8 Suppose 22 = 4y - z, -3z - 9 = -y - z. Suppose 2g - x + yx - 24 = 0, 5g - 81 = -3x. What is the tens digit of 456/g - 2/(-3)? 2 Let i(s) = s + 5 - 7 - 3 + 4s*2. Let o be i(-4). What is the units digit of (-38)/5o/(-22)? 9 Let b(i) = i*3 + 21i*2 + 7i - 1. What is the tens digit of b(-14)? 7 Suppose -5q + q + 196 = 0. Suppose -5z + 11 = -q. Suppose zx = 9x + 75. What is the units digit of x? 5 Let f be 2/38(5 + -2). Let u(n) = -n*3 + 16n*2 + 4n + 17. What is the units digit of u(f)? 1 Suppose 13c - 1116 = -2s + 8c, -3c = 2s - 1108. What is the hundreds digit of s? 5 Suppose -3k - 3f + 7f + 53 = 0, 0 = f + 2. Suppose -5l = k, d - l - 4l = 34. What is the tens digit of d? 1 Suppose -5 = x - 17. Let u(m) = -7 + 13m + m2 - 5m*2 + 3m*2. What is the units digit of u(x)? 5 Suppose 5j - 15 = -2q, -5q + 0j = 2j - 6. Suppose 4y = 16, -2y = m - qy - 33. Suppose 2l - m = -2h + h, -5h = 4l - 35. What is the tens digit of l? 1 Suppose 12d - 20d + 10344 = 0. What is the units digit of d? 3 Let q = -188 + 654. What is the units digit of q? 6 Let q be 3 - (2 + 5)-1. Suppose -5t = -2d - 7, -5t + 5d + q = -0. What is the tens digit of 26t/(2 - 1)? 2 Let c be 14/(-5)(-10)/4. Let x(q) = -q*2 + 9q - 7. Let t be x(c). What is the units digit of 8/(-20) - t/(-5)? 1 Let h(j) = 133j2 - 5j - 2. What is the units digit of h(-2)? 0 Let z be (((-6)/(-4))/(-3))/(6/(-24)). Suppose 2k - 2s = 260, 0 = -zs - 3s. What is the tens digit of k? 3 Let q = -907 - -1608. What is the tens digit of q? 0 Suppose 4m + 56 = 1708. What is the tens digit of m? 1 Suppose 5u - u + 3u = 0. Suppose u = -2g - 7 + 37. What is the units digit of g? 5 Let z(j) = 5j - j - 2j - 4j - 16. Let r be z(-9). Suppose -4 = 2p + 2o - 22, rp - 2o - 34 = 0. What is the units digit of p? 3 Let b = 126 - 75. Let d = 64 - b. What is the tens digit of d? 1 Suppose 3v - 5 - 7 = 0. Suppose 2b + 4 = 0, vh - 40 = 2b - 12. Let a(r) = 2r*2 - 5r + 13. What is the units digit of a(h)? 5 Let t = 3430 + -1637. What is the tens digit of t? 9 Let b(t) = -7t - 161. Let c(z) = -42z - 966. Let f(n) = 35b(n) - 6c(n). What is the units digit of f(0)? 1 Let i = -18 - -23. Suppose -ic + 4c + 8 = 0. What is the units digit of c? 8 Let r = -11 + 21. Let u be 2/r - 76/(-20). Suppose -ua + 30 = a. What is the units digit of a? 6 Suppose 2j = 61 - 3. Let y = 31 - j. Suppose 5m - 78 = y. What is the tens digit of m? 1 Let s = -1524 + 2533. What is the tens digit of s? 0 Suppose 3y = w - 25, 3w - 46 = -2y - 4. Let f(d) = -d*2 + 17d + 16. What is the units digit of f(w)? 2 What is the hundreds digit of (-87430)/(-245) + (2/7)/2? 3 Let s(w) = w - 9. Let b be s(9). Suppose b = -t - 2i + 11 + 83, 0 = -2i - 2. Suppose 4d = -16 + t. What is the units digit of d? 0 Let s(b) = -34b + 44. Let n be s(-10). Suppose -5z + n = -4k, -z + k + 84 = 2k. What is the tens digit of z? 8 Let l = 16 - -609. What is the hundreds digit of l? 6 Suppose -23527 = -23x + 16x. What is the tens digit of x? 6 Let h(s) = -15s*3 - 2s*2 - s. Let c be h(-1). Let a = -8 + c. What is the units digit of a? 6 Suppose 3t - 2p - 3p + 5255 = 0, 5 = 5p. Let s be t/(-8) + 69/(-92). Let i = s - 156. What is the tens digit of i? 6 Let g(a) = -a2 - 19a - 38. Let u be g(-13). Suppose -465 = -ul + 37l. What is the hundreds digit of l? 1 Suppose 377 = -2s + 4s - 3c, s - 178 = 5c. Let h = 333 - s. What is the hundreds digit of h? 1 Suppose -3r = -9, -45 = 2v - 5v - 2r. What is the tens digit of (-892)/(-10) + v/(-65)? 8 Let j(v) = 3v - 19. Let o be j(8). Suppose -y - y = 2, -oh - 4y + 21 = 0. What is the units digit of h? 5 Let s(t) be the third derivative of 13/6t*4 - 1/2t3 + 0 - t2 + 0t. What is the tens digit of s(1)? 4 Suppose 0 = q + 6n - n + 61, 5q = -5n - 225. Let f = q + 211. What is the tens digit of f? 7 Let p(r) = 22r2 - 4r. Let z(b) = -b*2 + b + 4. Let k be z(3). What is the tens digit of p(k)? 9 Suppose -4 - 2 = -t. Let j be ((-3)/1)/(t/4). What is the units digit of 20/((-3)/(-1 + j))? 0 Let j = -29 + 30. What is the units digit of j/(-4)-1812? 4 Suppose l = 5l - 128. Suppose -3k - y = -28, 4y = -0k - 3k + 31. Let i = k + l. What is the tens digit of i? 4 Suppose 3k - 5 = -14, 5w = 4k + 22. Let d(v) = 2v*3 - 3v*2 - v + 4. What is the units digit of d(w)? 6 Let v = 806 + -535. What is the hundreds digit of v? 2 Let u(t) = -43t + 324. What is the units digit of u(-28)? 8 Let m = -274 - -389. What is the units digit of m? 5 Let v(c) = -27c3 + c2 - 6c - 8. Let r be v(-4). What is the tens digit of 72/126 - r/(-7)? 5 Suppose 2 = y + y. Let f be (4/(-6))/(70/(-315)). Suppose 4o + fw = 6w, o = w - y. What is the units digit of o? 3 Let x(u) = -u3 + 5u*2 + 7u - 5. Let g be x(6). Let l be (-3)/(g/2 + -1). Let k = 26 - l. What is the units digit of k? 0 Suppose	{ "pile_set_name": "DM Mathematics" }
picking 2 f. 1/28 Three letters picked without replacement from bbbbbbbbbb. Give prob of picking 3 b. 1 Four letters picked without replacement from {j: 4, g: 1, s: 9}. Give prob of picking 1 s, 2 j, and 1 g. 54/1001 Calculate prob of picking 3 y when three letters picked without replacement from {b: 4, y: 16}. 28/57 What is prob of picking 1 e and 1 x when two letters picked without replacement from {a: 1, e: 1, y: 1, h: 7, x: 7}? 7/136 Calculate prob of picking 2 b when two letters picked without replacement from {b: 7}. 1 Four letters picked without replacement from nlsgg. What is prob of picking 1 l, 1 n, and 2 g? 1/5 What is prob of picking 1 q, 1 i, and 1 h when three letters picked without replacement from {b: 3, i: 6, h: 3, q: 1, r: 1, n: 1}? 18/455 Calculate prob of picking 1 u and 2 y when three letters picked without replacement from ylyzyucuzluluuc. 3/91 Three letters picked without replacement from cnjynjfnjnjfnynjyn. What is prob of picking 3 y? 1/816 Two letters picked without replacement from zntxzsxtozxzztt. What is prob of picking 2 o? 0 What is prob of picking 1 y, 1 v, and 1 p when three letters picked without replacement from cuvyp? 1/10 What is prob of picking 1 o and 2 s when three letters picked without replacement from {i: 1, z: 1, h: 3, r: 4, o: 4, s: 6}? 20/323 Calculate prob of picking 1 o and 1 x when two letters picked without replacement from {x: 3, o: 2, k: 3}. 3/14 Three letters picked without replacement from bbtbefttbbbb. Give prob of picking 1 t and 2 b. 63/220 Calculate prob of picking 1 z and 1 x when two letters picked without replacement from {x: 2, w: 7, j: 3, h: 3, v: 2, z: 1}. 2/153 Calculate prob of picking 2 x and 1 i when three letters picked without replacement from {x: 3, k: 3, g: 3, v: 6, i: 4}. 4/323 Four letters picked without replacement from {z: 4, s: 1, n: 1, e: 3, a: 1, q: 2}. Give prob of picking 2 e, 1 q, and 1 z. 8/165 Four letters picked without replacement from zssssszskssssskzs. What is prob of picking 1 s, 1 k, and 2 z? 18/595 Calculate prob of picking 1 d and 3 q when four letters picked without replacement from dqqddddqddddqd. 40/1001 Three letters picked without replacement from {b: 4, d: 2}. Give prob of picking 2 b and 1 d. 3/5 Four letters picked without replacement from ecxzegegecxeegg. Give prob of picking 2 x, 1 g, and 1 e. 8/455 Calculate prob of picking 1 t, 1 l, and 2 o when four letters picked without replacement from {l: 4, t: 7, o: 2, a: 2, i: 1}. 1/65 Calculate prob of picking 2 o and 2 j when four letters picked without replacement from ojojjjojjjjjjojjjj. 91/510 Four letters picked without replacement from wdqssqdqw. What is prob of picking 1 d and 3 q? 1/63 Calculate prob of picking 1 t, 2 w, and 1 e when four letters picked without replacement from {e: 1, w: 3, t: 5}. 5/42 Four letters picked without replacement from {e: 1, m: 1, q: 1, p: 1, j: 4, a: 4}. Give prob of picking 2 a, 1 j, and 1 q. 8/165 What is prob of picking 2 q when two letters picked without replacement from qmaqm? 1/10 What is prob of picking 3 r when three letters picked without replacement from {b: 1, r: 3}? 1/4 What is prob of picking 4 p when four letters picked without replacement from {p: 9}? 1 Three letters picked without replacement from wwwwwwqqwwwwwwqw. Give prob of picking 3 q. 1/560 Four letters picked without replacement from gmmmjgggggkiggm. What is prob of picking 1 j and 3 g? 8/195 Calculate prob of picking 2 u when two letters picked without replacement from {z: 3, u: 3}. 1/5 Two letters picked without replacement from nwqsaunq. Give prob of picking 1 u and 1 a. 1/28 Four letters picked without replacement from {z: 2, e: 2, h: 4, s: 3}. Give prob of picking 2 z, 1 s, and 1 e. 1/55 Two letters picked without replacement from {z: 1, o: 1, b: 10, p: 3, e: 2}. Give prob of picking 1 e and 1 z. 1/68 Two letters picked without replacement from {y: 2, f: 2, b: 8, g: 3}. What is prob of picking 2 g? 1/35 Calculate prob of picking 1 v, 1 r, and 1 b when three letters picked without replacement from rverbrbrbrwvwfvrbebe. 3/38 What is prob of picking 2 r, 1 a, and 1 e when four letters picked without replacement from {a: 1, e: 2, l: 1, p: 1, r: 2, j: 1}? 1/35 Two letters picked without replacement from hqcqhgqcvuc. What is prob of picking 1 q and 1 u? 3/55 Two letters picked without replacement from {l: 1, u: 1, d: 3}. Give prob of picking 1 l and 1 u. 1/10 Two letters picked without replacement from xxxfxxfxxfxfxd. What is prob of picking 2 x? 36/91 Three letters picked without replacement from ddqdqvdqqqqdvqqdqdqk. Give prob of picking 1 v and 2 q. 3/38 Four letters picked without replacement from cwcvwww. Give prob of picking 2 c and 2 w. 6/35 Two letters picked without replacement from {g: 5, p: 5, r: 1}. What is prob of picking 2 p? 2/11 Calculate prob of picking 1 d and 1 b when two letters picked without replacement from {h: 9, d: 2, b: 5}. 1/12 Two letters picked without replacement from mmeeyyynnmnnmyynynnw. What is prob of picking 1 e and 1 w? 1/95 Three letters picked without replacement from sdkkvesskdddkk. Give prob of picking 2 d and 1 s. 9/182 What is prob of picking 1 v and 1 k when two letters picked without replacement from kttv? 1/6 What is prob of picking 2 l when two letters picked without replacement from lal? 1/3 Calculate prob of picking 3 y when three letters picked without replacement from {y: 4, m: 7}. 4/165 Two letters picked without replacement from wsfllfswlfsfls. Give prob of picking 1 f and 1 w. 8/91 Three letters picked without replacement from {h: 2, f: 1, k: 1, u: 1, i: 1, x: 1}. What is prob of picking 1 x, 1 i, and 1 h? 2/35 Three letters picked without replacement from {y: 1, a: 1, i: 1, e: 2, v: 2}. Give prob of picking 2 v and 1 a. 1/35 What is prob of picking 1 x, 1 l, and 1 f when three letters picked without replacement from {x: 2, f: 3, h: 3, l: 4, b: 3, i: 1}? 3/70 Three letters picked without replacement from {n: 1, v: 1, x: 1, t: 1, d: 1}. What is prob of picking 1 t, 1 d, and 1 n? 1/10 What is prob of picking 1 d and 2 y when three letters picked without replacement from nhdyjjynjjjnu? 1/286 Calculate prob of picking 2 g, 1 r, and 1 t when four letters picked without replacement from {r: 2, g: 2, t: 7, l: 1}. 14/495 Two letters picked without replacement from hhhlw. Give prob of picking 1 h and 1 w. 3/10 Calculate prob of picking 1 m and 2 d when three letters picked without replacement from dmddmdddd. 1/2 Calculate prob of picking 2 t when two letters picked without replacement from {t: 6, s: 2}. 15/28 Calculate prob of picking 1 p, 1 m, and 1 f when three letters picked without replacement from ffpfkkpfxmfkfkkf. 1/40 Three letters picked without replacement from zuqdudxxduuuqxudxxd. What is prob of picking 2 u and 1 z? 5/323 Calculate prob of picking 2 z when two letters picked without replacement from {z: 7, d: 2}. 7/12 Calculate prob of picking 4 w when four letters picked without replacement from wwwwwdwdwwww. 14/33 Four letters picked without replacement from {i: 1, j: 1, l: 3, o: 2, p: 4, w: 1}. Give prob of picking 1 p, 1 w, and 2 l. 4/165 Four letters picked without replacement from {s: 2, r: 6, j: 7, n: 2, f: 1}. Give prob of picking 1 n, 1 j, and 2 s. 7/1530 What is prob of picking 1 e, 1 f, and 1 u when three letters picked without replacement from {f: 3, x: 1, u: 2, e: 10}? 3/28 What is prob of picking 3 q when three letters picked without replacement from hqchihhchghqzqqhcc? 1/204 Four letters picked without replacement from dmbddbbddddbmbbbdm. What is prob of picking 4 b? 7/612 What is prob of picking 2 f and 1 e when three letters picked without replacement from {a: 4, e: 7, y: 2, m: 2, f: 2}? 7/680 What is prob of picking 1 x and 1 j when two letters picked without replacement from {d: 1, j: 1, x: 1}? 1/3 Two letters picked without replacement from {r: 7, x: 2, s: 1, u: 2, l: 2, b: 1}. Give prob of picking 1 r and 1 b. 1/15 Calculate prob of picking 1 c, 1 l, and 1 v when three letters picked without replacement from {v: 1, p: 3, c: 4, l: 2, x: 4, u: 1}. 8/455 Calculate prob of picking 3 f when three letters picked without replacement from {f: 5, i: 5}. 1/12 What is prob of picking 3 m when three letters picked without	{ "pile_set_name": "DM Mathematics" }
t of 13852895 and -0.1. -1385289.5 What is the product of 4 and 240.893? 963.572 What is -9.1 times -83.15? 756.665 What is the product of -18502 and -2695? 49862890 -373513120.1 -3735131.2 Calculate -12.7440167. -89.208112 8507603.4 times -2 -17015206.8 2.3 times -6.70128 -15.412944 What is -3 times 3245333? -9735999 Work out -2671728 * -1. 2671728 Multiply -0.0551 and -614. 33.8314 Calculate -18482933.5. -6191771.5 What is the product of 18453 and -0.698? -12880.194 Product of 160 and 461049. 73767840 11 times -3.3255 -36.5805 -5701 358.4 -2043238.4 -7 * 28.63126 -200.41882 What is the product of -5 and 1613811? -8069055 Multiply -198341132 and -0.5. 99170566 Calculate 172.22831-4.1. -706.136071 What is -447 times -1197? 535059 0.06 513604 30816.24 Calculate 104641.82-108. -11301316.56 Calculate 301320.031. 934.092 -0.4 * 52025327 -20810130.8 -0.17640.05237 -0.009238068 Calculate 22-8386956. -184513032 Multiply 1257.1 and 1.38. 1734.798 What is -629 times -4.9653? 3123.1737 What is -2 times -1449685? 2899370 What is the product of -14897 and -473.5? 7053729.5 1020.223943 24426648.6 What is 1.1778 times 2789? 3284.8842 Multiply -10394404 and -3. 31183212 What is 22996 times -0.1846? -4245.0616 What is the product of -0.2 and 293733657? -58746731.4 -4 -168346474 673385896 What is the product of 0.5 and -614098? -307049 What is the product of -0.007 and -10999? 76.993 Product of -38813 and -2.92. 113333.96 Multiply 0.054673 and 4. 0.218692 What is the product of 290623102 and 0.1? 29062310.2 -90529709 times 0 0 What is the product of -113 and 400035? -45203955 50.41656399 2.08281995 Multiply 324.7 and -4721.6. -1533103.52 -324522.51 -73044.95 Calculate -2967-0.38113. 1130.81271 Work out -49049092 3. -147147276 What is -5524971.1 times -0.3? 1657491.33 -4138-11.8477 49025.7826 Multiply -1 and -17259.442. 17259.442 -58349 -90 5251410 Work out -19 * 39167383. -744180277 What is the product of -743 and -1.7778? 1320.9054 -5 * 2573207 -12866035 3.1073 times 113.6 352.98928 Calculate 27232177. 19062519 -0.0194916 -0.31184 -0.5 times -44082.73 22041.365 0.357683 * -0.1 -0.0357683 Multiply -2 and -12248.1141. 24496.2282 -310801 * -4.74 1473196.74 220984 times 0.06504 14372.79936 What is the product of 29098 and 1155? 33608190 Calculate -2572701-0.064. 164652.864 Product of 18918 and -0.353. -6678.054 What is -7 times -74274306? 519920142 Calculate 425.53696. 102.14784 Product of -48.02 and -247.37. 11878.7074 -7075 times 2.068 -14631.1 Multiply 0.08952932 and 1. 0.08952932 1809393 times -4 -7237572 407365149 * 2 814730298 Calculate 100.02450801. 0.2450801 33100 26 860600 5.382-1358.8 -7313.0616 0.025594 28 0.716632 -6 times -199423 1196538 What is the product of 209282 and -2817? -589547394 What is the product of 327.902 and -0.6? -196.7412 -862441 * -99 85381659 Calculate -0.19104-2.859. 0.54618336 -2648 -13616 36055168 What is -0.0787 times -26620? 2094.994 -1 times 134220.71 -134220.71 Calculate 127413061. 77721930 -21015.6312 -2031.2624 Calculate -138556.75. -38556.75 -7816.434 times -0.4 3126.5736 Work out -2 0.167561178. -0.335122356 5912.1736 times 3 17736.5208 1 times 0.00309336 0.00309336 What is the product of 6423 and 1329? 8536167 Calculate -27698-1.129. 31271.042 What is the product of 23 and 0.7821119? 17.9885737 138812.1-11 -1526933.1 110.3 times -32444 -3578573.2 Multiply -4 and 2.2609237. -9.0436948 Multiply -304054 and -0.2. 60810.8 Product of 38 and 3337268. 126816184 Calculate 131959-582. -76800138 What is the product of 3 and -482395? -1447185 What is the product of -0.17813 and -34436? 6134.08468 What is 17.4 times -0.1963? -3.41562 Product of 7 and 10546442. 73825094 -11745589 times -0.1 1174558.9 Multiply -0.3 and 919351. -275805.3 Multiply 352 and 1334459. 469729568 What is 0.02 times 147.444442? 2.94888884 Multiply 82 and -673049. -55190018 What is 3176560.8 times 3? 9529682.4 Work out 465957 -0.1. -46595.7 Product of 0.0263 and 278.728. 7.3305464 What is the product of -17134 and 1048? -17956432 Work out -524819.06 * 0.18. -94467.4308 1 times -3074859 -3074859 Product of 11 and 2.655745. 29.213195 What is the product of 427 and 36396? 15541092 Product of -0.2 and 17538199. -3507639.8 -421443227 -135998688 Calculate -0.2160.201624. -0.043550784 -0.4724 * 0.9971 -0.47103004 -3460.108523 -37.548958 Calculate 89106-1. -89106 Product of 3 and 0.064096163. 0.192288489 What is the product of -16191.7292 and -0.4? 6476.69168 -35.30168-3 105.90504 Work out 56 2335.237. 130773.272 Product of -13569.5677 and 4. -54278.2708 What is the product of -1.3 and -31.0648? 40.38424 Calculate 101717924.2. 80597038.2 Multiply -1113281 and -3. 3339843 Calculate 57570647. 37853235 12303 * -195 -2399085 Multiply -69 and -318717. 21991473 -250487.25 -100974.5 What is 92332 times -5940? -548452080 0.1 times 63445534 6344553.4 What is -0.0405533826 times -3? 0.1216601478 What is the product of 0 and -58305804? 0 Work out 1493096 177. 264277992 -2492728 * 0.08 -199418.24 Work out -194062 * 3107. -602950634 236.767-0.92 -217.82564 Multiply 0.06 and -1812176. -108730.56 Calculate -0.069-6308957. 435318.033 What is 23171 times 161.6? 3744433.6 What is -3920531 times 0? 0 Multiply -0.0478168 and -3. 0.1434504 Work out 0.5 * 101926308. 50963154 Multiply 2438 and -24253. -59128814 -0.4 * -3043298 1217319.2 3.82429274 111943.776 Work out -16 -1712949. 27407184 What is -41579.01 times -7? 291053.07 Product of 0.74 and -306630. -226906.2 9005 * 3114.6 28046973 Multiply -0.6537 and -26.275. 17.1759675 Work out -66.436 * -0.047. 3.122492 What is 0.8 times -2.94176? -2.353408 Calculate -682-0.47873. 326.49386 What is -5 times 162948.3? -814741.5 Calculate 12051204-0.2. -2410240.8 Multiply -460 and 13064. -6009440 What is the product of 0.1381343 and -0.19? -0.026245517 Work out -164 * -6420.12. 1052899.68 Multiply 3445242 and -0.4. -1378096.8 17828.86 * 0.3 5348.658 0.1-1.5524245 -0.15524245 What is -0.12 times 55015056? -6601806.72 Multiply -102425.01 and 10. -1024250.1 Product of -328.0203 and 1.7. -557.63451 -32655 0.396 -12931.38 Multiply -0.01959616 and 0.3. -0.005878848 Work out -969840 * 1. -969840 -5.7730197 -4162122.9 998.35 -12.4 -12379.54 Work out 0.026105 * -145.86. -3.8076753 What is -0.6351 times -575? 365.1825 -2.05701 times -0.04 0.0822804 What is -2 times 58821870? -117643740 Calculate -65542-216. 14157072 What is -5.082 times -642? 3262.644 Multiply -20488 and 2.1. -43024.8 138357077 0.1 13835707.7 Work out 22.74162 * -0.099. -2.25142038 Product of 0.3 and -79325712. -23797713.6 Multiply 2 and -2099010.2. -4198020.4 Work out -0.52 * 267333. -139013.16 0.13926 * -23779 -3311.46354 What is -689265 times 0.2? -137853 Calculate -339139-0.97. 328964.83 What is 20 times 1806092? 36121840 -79721154 -31888460 Work out 0.39 * 11.68226. 4.5560814 What is the product of -1.22 and -2502? 3052.44 Multiply -0.1 and 72.50212. -7.250212 0.1-303.063 -30.3063 What is the product of -0.1 and 2592803.3? -259280.33 -496950 7 -3478650 What is 0.0526 times -0.027029? -0.0014217254 11 * 0.06247497 0.68722467 Calculate -1.49185-89. 132.77465 7378-1.18341 -8731.19898 161 times 2109.35 339605.35 Product of -9 and 9241107. -83169963 Calculate 181155045. 20790810 What is -3612 times 131982? -476718984 -49832.2030 0 What is 42 times 16.882? 709.044 5-213.3897 -1066.9485 Product of 0.123 and -0.98942. -0.12169866 -0.3 times 0.005741744 -0.0017225232 What is the product of 6893 and 1.5? 10339.5 Product of -65.006 and -0.79. 51.35474 What is -18068 times -11181? 202018308 What is 0.108 times -295694? -31934.952 Work out 1 50.55055. 50.55055 What is the product of -19660235 and -3? 58980705 What is 74463341 times -0.5? -37231670.5 Product of -0.5 and 34030424. -17015212 Work out -1.6 * 453.06. -724.896 2.09421618 3388.4156 Calculate 0.3717963960.3. 0.1115389188 0.4 times 20.9988088 8.39952352 Product of -0.015 and -6913. 103.695 What is -31404691 times -3? 94214073 -345337 times -4482 1547800434 What is the product of -0.83 and -0.443912? 0.36844696 What is 27758 times -19.5? -541281 Calculate 14865.13400. 5946052 What is -21689 times 5.46? -118421.94 -148.6-0.0848 12.60128 Calculate -162	{ "pile_set_name": "DM Mathematics" }
0.45450.0256. -0.0116352 Work out -91 30.9. -2811.9 Calculate 0.25694.3. 1138.86 5.7 times 7151 40760.7 Multiply -50.289 and -1. 50.289 Product of -61.456 and -10. 614.56 -0.4 1651 -660.4 Work out -5991 * 833. -4990503 Product of -1606 and 0. 0 Product of -383 and 109. -41747 -23788 times 0.07 -1665.16 -0.29593-25 7.39825 What is the product of -1 and 0.49661? -0.49661 Work out 32 -2346. -75072 0.2 * -0.017 -0.0034 Multiply -14.83 and -3. 44.49 What is the product of -3 and -0.19395? 0.58185 -1422.1 times -0.5 711.05 Product of -1437139 and 0. 0 0 * 18683 0 -70760.05 -353.8 What is the product of 704 and 25? 17600 -3072 times 0.58 -1781.76 17 4836 82212 Calculate -61260-0.4. 24504 -1033 times -35 36155 Work out -296 7426. -2198096 Product of -2 and -0.091. 0.182 Calculate 627-2.13. -1335.51 Calculate -0.06244-3.2. 0.199808 What is 1.8299 times -0.5? -0.91495 Work out 0.198029 * -13. -2.574377 28-228.7 -6403.6 Multiply 0.5 and -0.0236. -0.0118 Calculate 95527. 50065 What is -126 times 350? -44100 -1-0.0573322 0.0573322 116037 times -0.1 -11603.7 Work out 25187 -9. -226683 Calculate -0.0947-25. 2.3675 What is the product of 0.3 and 39? 11.7 What is the product of 118174 and -0.5? -59087 Work out 0.07175 -267. -19.15725 Work out 28 * -294. -8232 -134.4265-0.3 40.32795 What is the product of 14605 and 80? 1168400 5-14832 -74160 Multiply 61470 and 1.7. 104499 What is the product of 0.63 and -70444? -44379.72 What is -84.75 times 2.2? -186.45 -91615 times -4 366460 Calculate -0.2-23.6375. 4.7275 What is 60 times 45.84? 2750.4 1.2305 times -0.06 -0.07383 37 times 559.7 20708.9 -70.10701 -0.74907 0.2 times -17586 -3517.2 1 times 46492 46492 10 times 15301 153010 Product of -3.895402 and -1. 3.895402 0.2 times -655433 -131086.6 -1872242 times -4 7488968 What is 0.053952 times 2? 0.107904 What is the product of 128.249 and -0.1? -12.8249 Work out -230555 * -22. 5072210 0.4 * -0.7686 -0.30744 Work out 6.878 * -7. -48.146 353 times 8190 2891070 -0.07-56.85 3.9795 Work out 13 -0.72. -9.36 2 * -406334 -812668 Multiply -115350 and -0.01. 1153.5 Work out -3690 * 0.07. -258.3 0.059822 times 0.5 0.029911 -1.2706 times 0.97 -1.232482 Calculate -26.5-1336. 35404 Calculate 0.30.3387. 0.10161 Multiply -0.3 and 10598. -3179.4 -19158.62 * -4 76634.48 What is 3.229127 times -0.5? -1.6145635 What is the product of -4 and -0.03719? 0.14876 17 times 6743 114631 Work out 260.347 * -1. -260.347 What is 0.4 times -7170.8? -2868.32 Work out 6.5 * 1381. 8976.5 0.2 * 8367 1673.4 What is the product of -0.22 and 9? -1.98 -0.038 * 37077 -1408.926 Work out 69 * -238.2. -16435.8 Product of 104049 and -2. -208098 Work out 557.3 * -4. -2229.2 9-4.84 -43.56 -2710 times -3 8130 What is the product of -0.2 and 12469? -2493.8 11.3265 1.3265 What is -0.161 times -555? 89.355 What is -734 times -0.483? 354.522 What is the product of 0.03 and -18741? -562.23 Work out -9 * -107751. 969759 What is the product of 15148 and 0.3? 4544.4 Work out 0.4 * 787.889. 315.1556 -47432 -9486 Multiply 0.316 and -0.1. -0.0316 25 -4.49 -112.25 Product of -1808054 and -0.4. 723221.6 Work out -4.4 * -462. 2032.8 Calculate -0.0099494-0.2. 0.00198988 0.3 times -66572 -19971.6 What is the product of 0.38 and -4868? -1849.84 Calculate -13307793. -3992337 Work out 1.976 * -181. -357.656 5469604 2187840 -1115-0.18 200.7 Calculate -6.807-0.03. 0.20421 -0.14211 -29.54 What is 0.4 times 6985? 2794 -0.2 * -58632 11726.4 -2.63 times -31.2 82.056 -4363 times 3.82 -16666.66 Calculate -194.722. -389.44 Multiply 0.3 and 1.44236. 0.432708 Work out -4 1095. -4380 What is the product of 2 and -1.8525? -3.705 Multiply 2.93 and 0.756. 2.21508 Multiply 0.005 and 11084. 55.42 3-2297 -6891 What is -18 times -3.63? 65.34 What is 2246 times 68? 152728 Product of 2810.5 and -1. -2810.5 What is 18379.9 times -4? -73519.6 Product of 4 and -78.283. -313.132 Multiply 0.5 and 1562. 781 -19-1.4104 26.7976 Calculate 555678. 444536 Calculate 0-55183. 0 Work out 1 * -22.75. -22.75 Multiply 40 and 98. 3920 0.58 * 10623 6161.34 Product of 0.3 and 44739. 13421.7 Calculate -0.2674283. -134856.6 Work out 11.03 -144. -1588.32 What is -17445 times 0? 0 What is the product of 10278.25 and 3? 30834.75 4-716.085 -2864.34 What is -47 times -0.1557? 7.3179 -13.8 times -64 883.2 Work out -0.1 -1323.5. 132.35 What is -956 times 0.22? -210.32 What is the product of 3872 and -2.6? -10067.2 Work out -2.3 * 9.05. -20.815 What is -63220 times 5? -316100 What is 0.3 times -96243? -28872.9 What is -35.43 times 11.73? -415.5939 Product of -14.71 and 1. -14.71 0.5 * -0.049944 -0.024972 Work out 0.49 * -1.005. -0.49245 Calculate 0.41.938. 0.7752 Work out -0.2 -5.33053. 1.066106 0.480355 * 2 0.96071 47049 times 6 282294 What is the product of 0.5 and -11.97341? -5.986705 Multiply 688 and 16.4. 11283.2 132.9 * 43 5714.7 Calculate 0.4113755. 45502 Product of 624095 and -9. -5616855 What is 0.02596 times -0.6? -0.015576 1.5 times 1101 1651.5 What is 0.043 times 0.1517? 0.0065231 -5 -22108 110540 Multiply -83.6 and -5182. 433215.2 What is -2217 times -27? 59859 What is the product of 0.5 and -997.37? -498.685 -0.162982 -6298.2 Work out 0.245276 0.5. 0.122638 Calculate -30.71452. -61.429 -68.171 -0.1 6.8171 Work out 27974 * -0.02. -559.48 -5 * -34696 173480 What is -0.1616 times -0.25? 0.0404 14.48 times -0.04 -0.5792 Calculate -0.047-0.575. 0.027025 -3.5 times 0.08172 -0.28602 -0.095 times 0.248 -0.02356 0.1267 times -14.8 -1.87516 5.073-3 -15.219 Product of -3.9 and 0.0175. -0.06825 19 times 4.1256 78.3864 Product of -0.3 and -0.014234. 0.0042702 -10.6919 * 0.4 -4.27676 -30535 * -11 335885 Calculate 0.491.7. 36.68 -1 -375.29 375.29 7391 * 2.6 19216.6 4 times -28944 -115776 Calculate -1.8842-0.3. 0.56526 Work out -545 -11960. 6518200 What is -0.18283 times 0.035? -0.00639905 What is -1185 times 23? -27255 Product of 0.3 and 1113.6. 334.08 Work out 0.05 * -383724. -19186.2 What is the product of 4 and -63282? -253128 Work out 0.0359 * -432. -15.5088 Multiply 0.8 and 12750. 10200 2 * 15401.9 30803.8 Work out 41 * -0.618. -25.338 Work out -18993 * 4.2. -79770.6 0.4 times -49651.9 -19860.76 What is -40.82 times -7? 285.74 -315.3 * -1.6 504.48 0.051218 * -4 -0.204872 0.82 times 2037.8 1670.996 What is the product of -29.4 and 2.8? -82.32 Work out -0.18 * 782. -140.76 Work out -3 * -1252. 3756 Multiply -263 and -2.8205. 741.7915 Multiply -323.6 and 7. -2265.2 Calculate -0.373440.055. -0.0205392 198-0.4 -79.2 0.03439133 4.57387 Multiply -544.67 and 1. -544.67 Product of 9064 and -5. -45320 What is the product of -304 and 1847? -561488 -0.1409 times 1213 -170.9117 -10.86 -442 4800.12 101 times 6310 637310 What is the product of -53.04 and 0.33? -17.5032 0.054776-4 -0.219104 Work out 5 -13377. -66885 19637-0.1 -1963.7 2 -7.429 -14.858 Calculate 2111.239-0.3. -633.3717 -7398 times -8 59184 Multiply 3 and 92896. 278688 0 0.04578 0 What is 13502 times 0? 0 Calculate -4159223-2. 8318446 -121 times 0.2287 -27.6727 Work out 21993 39. 857727 Work out 1.76 * -1.372. -2.41472 Work out -112.72 * 104. -11722.88 Work out 4112 * -439. -1805168 Work out -36 * 2. -72 Multiply -4 and 49.558. -198.232 Product of 0.2 and 178.1178. 35.62356 0.609 * -135.2 -82.3368 Work out -0.3 * 0.08815. -0.026445 Multiply -149 and -4307. 641743 529574 147870 1208.1 times -9 -10872.9 27 0.1097 2.9619 Multiply 196.934 and 1.9. 374.1746 Work out -0.09539 * 0.3. -0.028617 Multiply 0.2 and -0.28054. -0.056108 0.2 times -79.16 -15.832 Product of 543 and -217. -117831 What is 0.5973 times -91? -54.3543 Work out 14200 * -16. -227200 Work out 3 * 883987. 2651961 What is the product of 5 and 8288? 41440 Product of 0.2 and 0.04149. 0.008298 -24.3-154.3 3749.49 Calculate -127260.2. -2545.2 2.153043 6.45912 Calculate 163205. 33415 Work out 56 * -0.375. -21 Product of -20.43 and -33. 674.19 Calculate 11337.1-32. -362787.2 -0.8 1.499 -1.1992 Work out -632 * 3046. -1925072 -137234 * -0.12 16468.08 -58885 -44425 Product of 0.9 and 42813. 38531.7 -0.2 131.269 -26.2538 What is the product of -0.12 and -25.8533? 3.102396 385151 * 3 1155453 Product of 0.05 and -21714.6. -1085.73 Calculate 0.1*-55502. -5550.2 What is the pro	{ "pile_set_name": "DM Mathematics" }
mon divisor of 12240 and 2517615? 765 Calculate the highest common divisor of 5026528 and 3328. 416 What is the highest common factor of 105 and 21736015? 35 Calculate the greatest common divisor of 1607840 and 1160. 40 Calculate the greatest common factor of 1340058270 and 30. 30 Calculate the highest common divisor of 50362 and 2473146. 338 Calculate the highest common divisor of 518 and 225293. 37 What is the greatest common factor of 102775994 and 885? 59 What is the greatest common divisor of 4894 and 5299? 1 Calculate the highest common factor of 67954 and 1586. 122 Calculate the greatest common factor of 154 and 21173614. 154 What is the highest common factor of 12384502 and 717? 239 Calculate the greatest common factor of 1624401 and 1785. 51 What is the greatest common divisor of 1107 and 18714204? 369 What is the greatest common divisor of 34 and 10317300? 34 What is the highest common divisor of 169215267 and 5226? 2613 Calculate the greatest common factor of 250480 and 109847600. 8080 What is the greatest common factor of 9834 and 5393? 1 Calculate the highest common factor of 12 and 126891090. 6 Calculate the highest common factor of 43799 and 1841. 7 Calculate the highest common factor of 4263 and 84181809. 87 Calculate the highest common factor of 18852290 and 7025. 1405 Calculate the highest common factor of 1497352 and 17784. 152 Calculate the greatest common factor of 280395 and 95715. 135 Calculate the highest common factor of 40640 and 296090. 10 Calculate the greatest common factor of 21648 and 3444984. 984 Calculate the highest common factor of 3147964 and 828. 92 What is the highest common divisor of 155480745 and 15? 15 What is the highest common factor of 122126 and 229270? 454 What is the highest common factor of 6 and 26687805? 3 Calculate the highest common divisor of 14535 and 95895. 45 What is the highest common factor of 329070785 and 17575? 3515 Calculate the greatest common factor of 24840 and 72680. 920 Calculate the highest common divisor of 28146286 and 848. 106 Calculate the highest common divisor of 207437986 and 406. 406 What is the greatest common factor of 244378 and 310517? 1121 Calculate the greatest common factor of 168 and 2276134. 14 Calculate the highest common factor of 1099919694 and 974. 974 Calculate the greatest common divisor of 5662 and 3418. 2 Calculate the highest common factor of 36991170 and 10530. 90 Calculate the highest common divisor of 64 and 16002864. 16 Calculate the greatest common factor of 187 and 579832. 11 Calculate the greatest common factor of 44618 and 106722. 14 What is the greatest common divisor of 80808 and 66293640? 6216 Calculate the highest common factor of 178752654 and 34. 34 What is the greatest common divisor of 380125 and 28250? 125 Calculate the highest common divisor of 71371 and 145573. 149 Calculate the greatest common factor of 3250 and 74269250. 250 What is the greatest common factor of 129816 and 25290? 18 What is the highest common factor of 702 and 222316536? 78 Calculate the highest common factor of 324 and 414456. 12 Calculate the greatest common divisor of 2114 and 1078154. 14 What is the highest common factor of 10658 and 789422? 146 What is the greatest common divisor of 1004018 and 446918? 1238 What is the highest common divisor of 44314109 and 75789? 2807 What is the highest common factor of 621949373 and 31? 31 What is the highest common factor of 601980 and 17145? 1905 Calculate the greatest common factor of 4 and 38870564. 4 What is the greatest common factor of 9537804 and 2444? 188 Calculate the greatest common divisor of 23556 and 1598428. 52 Calculate the highest common factor of 17360772 and 2412. 804 What is the greatest common factor of 20085 and 7720365? 1545 Calculate the greatest common factor of 24329739 and 7. 7 Calculate the highest common divisor of 90 and 1297707930. 90 What is the greatest common divisor of 1099983 and 258? 129 Calculate the greatest common factor of 330 and 103469190. 330 Calculate the greatest common factor of 8550626 and 34. 34 Calculate the greatest common divisor of 435 and 4868665. 145 Calculate the highest common divisor of 553 and 147730079. 553 What is the highest common divisor of 12249195 and 7? 7 Calculate the highest common divisor of 198 and 64654425. 99 What is the highest common divisor of 111137 and 102427? 13 Calculate the greatest common factor of 298662 and 4. 2 Calculate the greatest common factor of 3223925 and 4300. 1075 Calculate the greatest common divisor of 164 and 5802074. 82 Calculate the greatest common factor of 2235058 and 77826. 238 Calculate the greatest common divisor of 9 and 4226091. 3 Calculate the greatest common divisor of 4894 and 3578. 2 Calculate the greatest common divisor of 76784 and 129008. 16 Calculate the highest common factor of 510 and 12628535. 85 What is the greatest common divisor of 2607490 and 15? 5 Calculate the greatest common factor of 261639 and 315. 63 What is the highest common factor of 206887200 and 1040? 1040 What is the greatest common factor of 129841950 and 210? 210 Calculate the highest common factor of 32279 and 271793. 191 Calculate the highest common factor of 432 and 777616. 16 Calculate the greatest common divisor of 2603097 and 1701. 567 What is the highest common divisor of 1948 and 54160? 4 Calculate the highest common divisor of 76232 and 797576. 104 Calculate the greatest common factor of 8014496 and 1918. 14 Calculate the highest common factor of 224448 and 2743643. 1169 Calculate the highest common divisor of 434112 and 10692592. 5168 Calculate the greatest common divisor of 267633 and 18078. 393 Calculate the highest common divisor of 46587 and 274248. 879 What is the greatest common divisor of 8156112 and 592? 16 Calculate the greatest common divisor of 2989558 and 682. 22 What is the highest common divisor of 122222 and 217097? 23 Calculate the greatest common divisor of 27 and 13759839. 9 Calculate the greatest common factor of 38289162 and 8838. 2946 Calculate the highest common factor of 670 and 155701300. 670 What is the highest common divisor of 2586109 and 19? 19 What is the highest common divisor of 2134 and 27940? 22 Calculate the greatest common factor of 56 and 78453608. 8 What is the highest common factor of 206784 and 14943375? 3231 What is the greatest common factor of 17 and 129993679? 17 Calculate the highest common divisor of 24 and 54530940. 12 What is the highest common factor of 105 and 128933875? 35 What is the highest common divisor of 274 and 5414377? 137 Calculate the greatest common factor of 77529030 and 30. 30 Calculate the highest common factor of 213 and 18006168. 213 What is the greatest common factor of 48595485 and 195? 15 What is the highest common divisor of 3652460 and 1960? 980 Calculate the greatest common divisor of 708402811 and 167. 167 What is the greatest common factor of 69 and 105460221? 69 What is the greatest common divisor of 280 and 12344780? 140 Calculate the highest common divisor of 9396 and 5466268. 116 Calculate the highest common factor of 296 and 74776184. 8 Calculate the greatest common factor of 225528249 and 43. 43 Calculate the highest common factor of 585 and 932945. 65 Calculate the greatest common divisor of 426591 and 537075. 3069 What is the greatest common factor of 377 and 1366857? 29 What is the greatest common divisor of 325 and 27636700? 325 What is the greatest common factor of 45 and 4682754? 9 Calculate the greatest common divisor of 9583427 and 112. 7 Calculate the highest common divisor of 2114091 and 220248. 1449 What is the greatest common divisor of 294 and 6910260? 42 What is the greatest common factor of 264 and 13165878? 66 What is the greatest common factor of 33397240 and 8600? 1720 What is the greatest common divisor of 618953 and 5474? 391 Calculate the highest common divisor of 16004211 and 12. 3 What is the greatest common divisor of 21888285 and 6080? 95 What is the highest common divisor of 11 and 3614489989? 11 What is the highest common factor of 55854 and 880182? 1926 Calculate the greatest common divisor of 3268 and 3451198. 38 Calculate the highest common factor of 2654876 and 826. 14 What is the highest common divisor of 84393722	{ "pile_set_name": "DM Mathematics" }
00371? 233946 What comes next: -247260, -494652, -742182, -989850? -1237656 What is next in 115172, 230535, 345898, 461261? 576624 What comes next: -5354, -21441, -48254, -85793, -134058, -193049, -262766? -343209 What comes next: 208, 393, 630, 949, 1380, 1953? 2698 What is the next term in 815, 1289, 2623, 5267, 9671, 16285, 25559? 37943 What is next in -35810, -71711, -107612, -143513? -179414 What comes next: 14633, 14294, 13955? 13616 What is next in 630, -566, -2042, -3804, -5858? -8210 What is next in -7787, -15597, -23567, -31697? -39987 What is the next term in 14642900, 29285794, 43928688? 58571582 What is next in -585, 4737, 13599, 26001? 41943 What is next in 28348, 128397, 295152, 528619, 828804, 1195713, 1629352, 2129727? 2696844 What is the next term in 113382, 112327, 111272, 110217? 109162 What is the next term in 840204, 3360804, 7561792, 13443168, 21004932? 30247084 What is next in 126, 1308, 4512, 10740, 20994, 36276? 57588 What is next in 12303, 4189, -3925, -12039? -20153 What is the next term in 89492, 89878, 90268, 90662? 91060 What is the next term in -44661, -72301, -99941, -127581? -155221 What comes next: -613208, -2452979, -5519302, -9812183, -15331628, -22077643? -30050234 What is the next term in 1910, 12306, 39668, 92480, 179226, 308390? 488456 What is the next term in 24180, 48309, 72378, 96357, 120216, 143925, 167454, 190773? 213852 What is the next term in 1799, 1999, 2333, 2801? 3403 What is next in -9287235, -9287215, -9287183, -9287139? -9287083 What comes next: 178, 119, 28, -113, -322, -617, -1016, -1537? -2198 What comes next: 21537908, 43075810, 64613708, 86151602, 107689492, 129227378, 150765260? 172303138 What comes next: -2002, -1598, -1210, -850, -530, -262, -58? 70 What is next in 30748073, 30748072, 30748071, 30748070, 30748069, 30748068? 30748067 What comes next: 1395320, 2790612, 4185904, 5581196? 6976488 What is next in -22060, -25139, -28208, -31261, -34292, -37295, -40264? -43193 What is next in -7339621, -7339624, -7339627, -7339630, -7339633? -7339636 What comes next: -49934, -101626, -155070, -210272, -267238? -325974 What is next in -59070, -472210, -1593564, -3777240, -7377346? -12747990 What is next in 12073, 11875, 11655, 11413, 11149? 10863 What is next in 45011672, 45011687, 45011702, 45011717, 45011732, 45011747? 45011762 What is the next term in -2188077, -4376000, -6563921, -8751840, -10939757? -13127672 What is the next term in -81674, -163371, -245092, -326843, -408630? -490459 What is the next term in -77412, -620893, -2096520, -4970367, -9708508, -16777017, -26641968, -39769435? -56625492 What is next in 27898, 31009, 34110, 37195, 40258? 43293 What is next in 1492622, 2985254, 4477890, 5970524, 7463150? 8955762 What is next in -21153, -45369, -69595, -93837, -118101? -142393 What is next in 3362, 577, -8352, -23425, -44642, -72003, -105508? -145157 What is next in 7980075, 7980073, 7980071, 7980069, 7980067? 7980065 What is next in 154076, 156406, 158736? 161066 What is the next term in 86112280, 86112278, 86112276? 86112274 What comes next: 214, 767, 1506, 2281, 2942, 3339, 3322, 2741? 1446 What is the next term in 1481951, 1481911, 1481873, 1481837, 1481803, 1481771? 1481741 What is next in 2156039584, 2156039585, 2156039586? 2156039587 What is the next term in -442062, -441829, -441596? -441363 What comes next: -110274, -216686, -323098, -429510? -535922 What is the next term in -848354, -1696687, -2545022, -3393359, -4241698, -5090039? -5938382 What is next in -6296, -50382, -170066, -403148, -787428, -1360706, -2160782, -3225456? -4592528 What is next in 93198, 93208, 93218, 93228, 93238, 93248? 93258 What comes next: 21341050, 42682099, 64023148, 85364197? 106705246 What is next in 3780, 3218, 2638, 2034, 1400, 730? 18 What is the next term in 940874, 1881653, 2822420, 3763169, 4703894, 5644589, 6585248, 7525865? 8466434 What is the next term in -9031, -8834, -8473, -7930, -7187, -6226? -5029 What is next in 5608553, 11217095, 16825631, 22434161, 28042685, 33651203, 39259715? 44868221 What comes next: -17875, -17882, -17889, -17896, -17903? -17910 What comes next: -53031, -106129, -159211, -212277, -265327, -318361? -371379 What comes next: 16005, 16548, 17091? 17634 What is next in -2061550, -4123168, -6184774, -8246362, -10307926, -12369460? -14430958 What is the next term in -1565615, -1565450, -1565183, -1564820, -1564367, -1563830? -1563215 What is the next term in 3273205, 3273173, 3273141? 3273109 What is the next term in 4117, 3974, 3841, 3724, 3629, 3562, 3529, 3536? 3589 What is next in 3017949, 6035876, 9053803, 12071730, 15089657? 18107584 What comes next: -841292, -6730719, -22716418, -53846525, -105169176? -181732507 What is next in 504073, 1008178, 1512293, 2016418? 2520553 What is next in -435415, -3483473, -11756835, -27868153, -54430079, -94055265? -149356363 What comes next: -174229, -173685, -173141, -172597? -172053 What comes next: -82744, -330862, -744486, -1323694, -2068564, -2979174? -4055602 What is the next term in -906100, -1812209, -2718318, -3624427, -4530536, -5436645? -6342754 What comes next: -407848, -407856, -407870, -407890? -407916 What comes next: 4832, 19324, 43478, 77294, 120772, 173912? 236714 What comes next: -53033, -106223, -159413, -212603, -265793? -318983 What comes next: 4932801, 4932799, 4932797, 4932795, 4932793? 4932791 What is next in -685555323, -685555324, -685555325, -685555326? -685555327 What is next in 40306, 81002, 121698, 162394, 203090, 243786? 284482 What comes next: 434, 215, -134, -613, -1222, -1961? -2830 What is next in 112946, 226015, 339084? 452153 What is next in -42024, -168166, -378432, -672822, -1051336, -1513974, -2060736? -2691622 What is next in -205490, -410923, -616358, -821795, -1027234, -1232675? -1438118 What is next in 1283, 8979, 28845, 66641, 128127, 219063, 345209? 512325 What is next in -306820, -305685, -304548, -303409? -302268 What is the next term in 30296, 61654, 93026, 124418, 155836, 187286? 218774 What is the next term in 84161684, 84161689, 84161696, 84161705, 84161716? 84161729 What is the next term in -156322, -156150, -155978, -155806, -155634? -155462 What is next in 384630, 769163, 1153702, 1538253, 1922822, 2307415, 2692038, 3076697? 3461398 What is the next term in 1624, 3394, 5014, 6490, 7828? 9034 What comes next: 101501, 104378, 107255, 110132, 113009, 115886? 118763 What comes next: 16505, 14350, 12211, 10094, 8005, 5950? 3935 What is next in -2556, -5846, -9868, -14622, -20108, -26326, -33276? -40958 What is next in -4356539, -4356535, -4356529, -4356521, -4356511, -4356499? -4356485 What comes next: 14413, 28818, 43217, 57610, 71997, 86378? 100753 What comes next: 1829, 1604, 1375, 1142, 905, 664, 419? 170 What is next in 193259, 387410, 581561, 775712? 969863 What is the next term in -2858, -11255, -25264, -44903, -70190, -101143? -137780 What is next in -56324, -122926, -210084, -328076, -487180, -697674, -969836? -1313944 What is next in -79323, -162397, -252971, -354795, -471619, -607193? -765267 What comes next: 16830, 67338, 151528, 269406, 420978, 606250? 825228 What comes next: 7568519, 7568521, 7568523, 7568525, 7568527? 7568529 What comes next: -857798, -1715597, -2573398, -3431201, -4289006, -5146813, -6004622? -6862433 What comes next: -15024, -18127, -21216, -24285, -27328, -30339, -33312, -36241? -39120 What is next in 7213, 13139, 19065, 24991? 30917 What is next in 4538805689, 4538805690, 4538805691, 4538805692, 4538805693? 4538805694 What is the next term in 1231600, 2463223, 3694844, 4926457, 6158056? 7389635 What is next in -27828, -55642, -83452, -111258, -139060? -166858 What is next in -717, -934, -1295, -1806, -2473, -3302, -4299, -5470? -6821 What is the next term in -159380, -320370, -481360? -642350 What comes next: 15490, 15482, 15536, 15658, 15854, 16130? 16492 What is next in -297, -1116, -2463, -4338, -6741? -9672 What is the next term in 4050582, 4050584, 4050588, 4050594? 4050602 What is next in 350142, 700283, 1050424? 1400565 What is the next term in 310, -5711, -11732? -17753 What is the next term in 385, 593, 905, 1297, 1745, 2225, 2713, 3185? 3617 What comes next: -8654264, -17308527, -25962790, -34617053? -43271316 What i	{ "pile_set_name": "DM Mathematics" }
2 + 2c - 1. Calculate the common denominator of o(1) and q. 2 Let j(r) = -r*2 + r. Let u be j(2). Let y be u/(-2) - 1/1. Suppose -32 = -yo - 4o. What is the lowest common multiple of 1 and o? 8 Let d(w) = -w3 - 5w*2 - 4w. Suppose 4v = -4 - 4. Calculate the least common multiple of d(-5) and (-4 + -1)/(v/8). 20 Suppose -2a + 123 = a. Suppose -5t = -3c + 31, 3c + 2t = -3t + a. What is the least common multiple of 10 and c? 60 Let k be ((-77)/28)/((-4)/6). Let x = -47/24 + k. Calculate the common denominator of x and 37/4. 12 Let d = 3325/3 + -46877/42. Calculate the common denominator of -73/24 and d. 168 Calculate the common denominator of -2 + 2 + 97/(-8) and 44/5. 40 Suppose -3h + 99 = 33. Suppose -4k + 10 = -30. What is the least common multiple of h and k? 110 Let z = -5 + 9. Find the common denominator of 131/12 and z/((-320)/212) + 3. 60 Suppose -2z + 4 = 18. Let h = 11039/234 + -640/13. What is the common denominator of h and (-591)/(-14) - 2/z? 18 Let f = -1 - -5. Suppose h + 1 = -3c, -6 = fh - 4c - 50. Suppose -b - h = -3b. Calculate the least common multiple of b and 1. 4 Let c be 3/1 + 2 + -3. Suppose -4 = cb - 8. Calculate the lowest common multiple of 18 and b. 18 Let a = -48/31 + -2815/124. Let l be (-431347)/(-42616) + (-1)/4. Let d = l - -5/1522. Find the common denominator of d and a. 8 Let f = 49 - 36. Calculate the lowest common multiple of f and 8. 104 Let z(p) = 1 - 2 - p + 2 - p. What is the least common multiple of 10 and z(-2)? 10 Let q = 5371122/7 - 768832. Let b = q + 1532. Calculate the common denominator of b and -77/4. 28 Let s = 585892390 + -2661709146905/4543. Let w = -47090145/1298 + 36279. Let k = w + s. What is the common denominator of k and 133/18? 126 Suppose -3q + 40 = q. Suppose -5m + 2k + 82 = 0, 0 = 4m - 3k - 2k - 52. What is the least common multiple of q and m? 90 Let g be ((-4)/(-5))/((-1)/(-5)). Suppose 3r + 3q = -2q - 18, -gr = q + 7. Calculate the common denominator of -95/6 and r + ((-13)/(-1) - 1). 6 Suppose 4i - 3042 = 3018. Find the common denominator of -1 - (-136)/22 - 2 and i/198 + 6/33. 66 Suppose 4y + 24 = 2t, 3t - y - 2y = 42. What is the smallest common multiple of 18 and t? 144 Let f(v) = -2v + 1. Let k be f(-3). What is the common denominator of (-47)/(-2) + (k - 7) and -5/26? 26 Suppose 0 = -n - 3 + 5. Find the common denominator of (-75)/(-27) + -3 + n and -87/2. 18 Let h(t) = 5t - 1 + 1 + 0 + 1. What is the least common multiple of 6 and h(5)? 78 Let l(t) = 2t - 1. Let b be l(1). Suppose -r - 10 = -2r. What is the common denominator of b/(-25)r/(-4) and 54/11? 110 Let y(h) = -4h*2 + 3h + 3. Let b be y(-2). Let s be -9 + -2 + (-1 - -1). Let o = s - b. What is the least common multiple of o and 10? 40 Let r(n) be the first derivative of n*4/4 - 8n*3/3 + 9n*2/2 + 2n - 1. Calculate the lowest common multiple of 8 and r(7). 16 Let x = -43/21 + -109/14. What is the common denominator of x and 52/15? 30 Suppose -5h + 34 = -6. Calculate the smallest common multiple of 10 and h. 40 What is the common denominator of 61/24 and ((-14)/(-20))/((-2)/(-17))? 120 Suppose 16 - 1 = 5l. Suppose 0 = lh - 2n - 15, -h - n = -2h + 6. Let u = 9 + 1. Calculate the least common multiple of u and h. 30 Let r(j) = 2j*3 + 2j - 2. What is the least common multiple of 20 and r(1)? 20 Suppose 5s - 3s = 2n + 80, -2s - 52 = n. Calculate the common denominator of -21/10 and 12 - (-160)/n. 110 Let z = -6/175 - 3977/1400. Find the common denominator of (2/8)/((-7)/(-66)) and z. 56 Let d(b) = b3 - 2b*2 - 5b - 1. Suppose 3q - 19 = 14. What is the least common multiple of q and d(4)? 11 Let g(a) = a2 + 7a - 19. Find the common denominator of -52/7 and g(-11). 7 Let u = -1/1092 - -27119/1092. Calculate the common denominator of ((-4)/(-5) - 1)-43 and u. 30 Suppose a = -2i + 10, -2i = a + 2i - 18. Suppose -ah = 0, -4u + 0h - 16 = -h. Find the common denominator of 11/16 and 6/(-15) + 2/u. 80 Suppose 7s = 3s. Let v be 2/4(s - 0). Calculate the common denominator of -49/18 and v + 1 + 106/24. 36 Suppose 0 = 2k - 6k - 4. Calculate the common denominator of -47/10 and 147/(-6) + (-1)/k. 10 Let f(u) = 2u3 + 11u*2 - 4u + 13. Let h(o) = o*2 - 2o - 2. What is the lowest common multiple of h(-2) and f(-6)? 6 Let r(m) = 24m2 - m + 2. What is the lowest common multiple of 1 and r(1)? 25 Let k(f) = f2 - 5f - 6. Let n = -76 - -85. Calculate the smallest common multiple of k(7) and n. 72 Let w(q) = -1824q + 3. Let l(g) = -4g*3 + 1. Let y be l(-1). Let s be w(y). Let b = s - -200481/22. Calculate the common denominator of -73/8 and b. 88 Let s(g) = -g + 8. Let l be s(10). Let m be 5/(-4)2l. Suppose 0 = -mw + 83 - 23. Calculate the least common multiple of w and 8. 24 Suppose 5c - 2r = c - 142, -2r - 191 = 5c. Find the common denominator of c and 5/16. 16 What is the smallest common multiple of 4 and 118/12 + (-6)/(-36)? 20 Let v be ((-1151)/4)/((-258)/(-8)). Let p = -54/43 - v. Calculate the common denominator of p and 1/8. 24 Suppose 5f + 4g = 90, f + 2f - g - 54 = 0. Suppose q = 3w + 6, 0 = 3q - 4q - 2w - 14. Let p = q + 10. What is the least common multiple of p and f? 36 What is the lowest common multiple of 9 and (-6)/18 + 66/9? 63 Let o = -1 - 10. Let q = 18 + o. Calculate the smallest common multiple of q and 9. 63 Suppose 3y + 4 = 5a + 1, -23 = -2y - 5a. Calculate the lowest common multiple of 1(2 - (-5 - -2)) and y. 20 Let p = -4001/1278 - 184/71. Calculate the common denominator of p and (-2317)/882 + 1/(7/4). 18 Suppose 3k + 4a = a + 501, 2k - 5a - 327 = 0. Let r be (-12)/42 + k/(-7). Calculate the least common multiple of (3 - 1)/((-4)/r) and 20. 60 Calculate the common denominator of -20/9 and 1/(-2) - (-43)/(-10). 45 Let g = 8803/9 + -977. Find the common denominator of g and 17/21. 63 Let n(t) = -t - 7. Let w be n(-7). Suppose -2c + wc = -18. Suppose -f = -4x + 26, -f = -5x - 0f + 32. What is the least common multiple of c and x? 18 Suppose 309 = -3k + 3h, 4h + 98 = k - 2k. Calculate the common denominator of (-1 - 1) + 22/12 and (k/(-198))/((-4)/(-30)). 66 Let q = 5801 - 319094/55. Calculate the common denominator of -121/50 and q. 550 Let h(y) = y2 + 6y - 6. Let r be h(-7). Let s be (-22)/(-4)-2 + r. Let u(l) = -l2 - 11l - 8. What is the lowest common multiple of 14 and u(s)? 14 Suppose -2r + 13 - 1 = 0. Let y(g) = 4g*2 - 9g + 9. Calculate the lowest common multiple of y(1) and r. 12 Suppose 3l - 25 = 71. Calculate the least common multiple of l and 36. 288 Let z = 507/127 - 82847/10668. Let f = -71/12 - z. Calculate the common denominator of f and 97/4. 28 Find the common denominator of 23/8 and (-4 + 414/(-48))/2. 16 Let n = 5719/25 + -4007719/17525. Let u = 96973/12618 - n. What is the common denominator of u and (26/16)/((-45)/54)? 180 Let u(x) = 3x*2 + 2x2 + x3 + 4 + 3x - 4x*2 + 4x*2. Calculate the common denominator of u(-3) and -93/8. 8 Let l = -169/20 + -27/20. Calculate the common denominator of l and 32/7. 35 Let x = 4603522 + -46081161/10. Let s = x - -4582. Let f = -2057/1062 - -52/59. Find the common denominator of f and s. 90 Suppose -10r + 9r = -5. What is the lowest common multiple of 3 and r? 15 Let m(c) = c3 + 10c*2 - 15c + 16. Let s be m(-11). Find the common denominator of -93/8 and (-258)/s + (2 - 1). 40 Let p = -109/3 + 137/3. Calculate the common denominator of 85/16 and p. 48 Suppose -3o - 15 = -0o. Let j = o - -11. Let t(v) = v*2 + 4v + 3. Calculate the least common multiple of t(-5) and j. 24 Suppose -w + x + 6 = 0, 3w + 4x = -w + 56. Suppose -w = 2s, 2k - 4s - s - 29 = 0. What is the smallest common multiple of 1 and k? 2 Let m = -19/43 - -2116/215. Calculate the common denominator of m and -103/6. 30 Suppose -10 - 16 = -4p - 3y, 3p + 4y - 16 = 0. Suppose 4n + 4o = 72, -7n - 2o + 72 = -3n. Calculate the smallest common multiple of n and p. 72 Let m = -16 + 36. Calculate the lowest common multiple of m and 8. 40 Let f = 1 - -9. Let k(c) = 9c + 2. Let o be k(-1). What is the lowest common multiple of -1(o + 9/3) and f? 20 Let k = 7174/75 + -593/25. Let v = 181/3 - k. Let l = 396/35 + v. What is the common de	{ "pile_set_name": "DM Mathematics" }
2 What is the m'th term of -112115773, -224231552, -336347331, -448463110, -560578889? -112115779m + 6 What is the u'th term of -2210, -3034, -3732, -4304, -4750, -5070? 63u*2 - 1013u - 1260 What is the b'th term of -1524, -2019, -2452, -2817, -3108, -3319, -3444, -3477? b*3 + 25b*2 - 577b - 973 What is the f'th term of -51603707, -51603718, -51603729, -51603740? -11f - 51603696 What is the a'th term of 340924, 681824, 1022726, 1363630, 1704536, 2045444? a2 + 340897a + 26 What is the j'th term of 10160576, 10160505, 10160434, 10160363? -71j + 10160647 What is the z'th term of -564179, -563311, -562443, -561575, -560707, -559839? 868z - 565047 What is the i'th term of -5750, -15181, -31970, -59795, -102334, -163265? -613i3 - i2 - 5137i + 1 What is the w'th term of 164101, 327603, 491105, 654607? 163502w + 599 What is the s'th term of 2174044915, 4348089829, 6522134743, 8696179657? 2174044914s + 1 What is the t'th term of 3422, 4334, 5246, 6158, 7070, 7982? 912t + 2510 What is the a'th term of 9784856, 19569714, 29354572, 39139430, 48924288, 58709146? 9784858a - 2 What is the q'th term of 4792, 9169, 13546? 4377q + 415 What is the i'th term of -293, -921, -1531, -1763, -1257, 347? 60i*3 - 351i*2 + 5i - 7 What is the l'th term of -1323830, -5295300, -11914418, -21181184, -33095598? -1323824l2 + 2l - 8 What is the p'th term of 4200, 4318, 4458, 4620? 11p2 + 85p + 4104 What is the i'th term of 59756, 59637, 59518, 59399, 59280? -119i + 59875 What is the v'th term of 12454, 13389, 14956, 17161, 20010, 23509? v3 + 310v*2 - 2v + 12145 What is the b'th term of 261104, 522149, 783138, 1044071? -28b2 + 261129b + 3 What is the m'th term of -1548, -14319, -49004, -116559, -227940, -394103, -626004? -1826m3 - m2 + 14m + 265 What is the u'th term of 133224, 133078, 132930, 132780, 132628, 132474? -u*2 - 143u + 133368 What is the r'th term of -3627, -7552, -11445, -15300, -19111? r*3 + 10r*2 - 3962r + 324 What is the q'th term of -2732, -10702, -23562, -40970, -62584, -88062, -117062? 57q3 - 2787q*2 - 8q + 6 What is the x'th term of 1324, 5240, 11756, 20866, 32564, 46844, 63700? -x*3 + 1306x*2 + 5x + 14 What is the o'th term of 100145, 100192, 100239? 47o + 100098 What is the n'th term of -1464967529, -1464967528, -1464967527, -1464967526, -1464967525, -1464967524? n - 1464967530 What is the s'th term of 165, 6482, 25085, 62118, 123725? 1024s3 - s2 - 848s - 10 What is the u'th term of 190607, 743847, 1665913, 2956805, 4616523, 6645067? 184413u*2 + u + 6193 What is the m'th term of -230, -920, -2630, -5870, -11150, -18980? -85m*3 - 95m - 50 What is the z'th term of 642232, 2568875, 5779932, 10275403? 642207z2 + 22z + 3 What is the o'th term of -10081, -10092, -10095, -10090, -10077, -10056? 4o2 - 23o - 10062 What is the t'th term of -49, 22, 175, 440, 847, 1426? 5t3 + 11t*2 + 3t - 68 What is the z'th term of 2875, -3432, -9739, -16046? -6307z + 9182 What is the t'th term of 3013184, 6026365, 9039546, 12052727, 15065908, 18079089? 3013181t + 3 What is the r'th term of 12249794, 24499567, 36749340, 48999113, 61248886, 73498659? 12249773r + 21 What is the s'th term of 344702449, 344702448, 344702447, 344702446, 344702445? -s + 344702450 What is the v'th term of 84263, 167229, 250195, 333161, 416127, 499093? 82966v + 1297 What is the f'th term of 984, 3735, 8348, 14823, 23160, 33359? 931f2 - 42f + 95 What is the p'th term of 2918, 11604, 26114, 46472, 72702, 104828, 142874? 4p3 + 2888p*2 - 6p + 32 What is the o'th term of -917491, -1835012, -2752533, -3670054, -4587575, -5505096? -917521o + 30 What is the g'th term of -546, 557, 2404, 5007, 8378, 12529, 17472, 23219? 2g*3 + 360g*2 + 9g - 917 What is the b'th term of 360578, 721143, 1081708, 1442273, 1802838, 2163403? 360565b + 13 What is the t'th term of 906112, 906028, 905888, 905692, 905440? -28t*2 + 906140 What is the i'th term of -4936083, -19744369, -44424845, -78977511, -123402367? -4936095i2 - i + 13 What is the a'th term of 240234, 480457, 720668, 960861, 1201030, 1441169, 1681272? -a3 + 240230a + 5 What is the f'th term of 4846, 19417, 43716, 77743? 4864f*2 - 21f + 3 What is the a'th term of 6471, 6764, 6807, 6606, 6167, 5496? a*3 - 131a*2 + 679a + 5922 What is the t'th term of -4081849, -4081843, -4081837, -4081831, -4081825? 6t - 4081855 What is the o'th term of -130606, -129056, -127506, -125956, -124406? 1550o - 132156 What is the r'th term of -3730, -7488, -11280, -15106, -18966, -22860? -17r2 - 3707r - 6 What is the c'th term of 21989871, 43979743, 65969615? 21989872c - 1 What is the b'th term of -772551, -772614, -772677, -772740? -63b - 772488 What is the d'th term of -3648099, -3648096, -3648093, -3648090, -3648087, -3648084? 3d - 3648102 What is the u'th term of -64142, -258798, -583226, -1037426, -1621398? -64886u*2 + 2u + 742 What is the q'th term of -3355992, -6712014, -10068036, -13424058? -3356022q + 30 What is the q'th term of 770, 1625, 2558, 3575, 4682, 5885, 7190, 8603? q3 + 33q*2 + 749q - 13 What is the l'th term of -498, -901, -1554, -2451, -3586, -4953, -6546, -8359? l*3 - 131l*2 - 17l - 351 What is the k'th term of 18958305, 18958303, 18958301? -2k + 18958307 What is the k'th term of -496, -2090, -6420, -14854, -28760? -228k*3 + 2k - 270 What is the a'th term of 435862, 435796, 435686, 435532? -22a2 + 435884 What is the g'th term of -187617, -374941, -562265, -749589, -936913? -187324g - 293 What is the t'th term of 26, -81, -320, -691, -1194, -1829? -66t2 + 91t + 1 What is the a'th term of 8425, 8302, 8111, 7852, 7525, 7130? -34a2 - 21a + 8480 What is the x'th term of -66964683, -66964684, -66964685? -x - 66964682 What is the z'th term of 395281, 3163666, 10677857, 25310758, 49435273? 395484z3 - z2 - 202 What is the g'th term of -181888, -181549, -180984, -180193? 113g*2 - 182001 What is the l'th term of -3497, 5226, 13949, 22672, 31395, 40118? 8723l - 12220 What is the u'th term of 17174, 137524, 464286, 1100702, 2150014, 3715464, 5900294? 17207u3 - 36u*2 + 9u - 6 What is the k'th term of 1815, 7562, 17229, 30816, 48323, 69750? 1960k2 - 133k - 12 What is the w'th term of -1223890, -2447774, -3671654, -4895530, -6119402? 2w2 - 1223890w - 2 What is the c'th term of 904, 2460, 5046, 8656, 13284? -c*3 + 521c*2 + 384 What is the g'th term of 321359, 321371, 321383, 321395, 321407, 321419? 12g + 321347 What is the f'th term of 116973, 233929, 350885, 467841, 584797, 701753? 116956f + 17 What is the m'th term of -5290845, -10581713, -15872581, -21163449, -26454317, -31745185? -5290868m + 23 What is the h'th term of 198, 873, 1884, 3093, 4362, 5553, 6528, 7149? -23h3 + 306h*2 - 82h - 3 What is the g'th term of -2191, -4100, -5433, -5902, -5219? 48g3 - 2245g + 6 What is the v'th term of 87613, 87582, 87551, 87520? -31v + 87644 What is the y'th term of 22922, 45945, 69174, 92711, 116658, 141117, 166190, 191979? 17y3 + y2 + 22901y + 3 What is the k'th term of -8472, -17832, -27192, -36552, -45912? -9360k + 888 What is the s'th term of -3078, -2692, -2006, -1020? 150s2 - 64s - 3164 What is the x'th term of 116662, 233335, 350018, 466711, 583414, 700127? 5x2 + 116658x - 1 What is the s'th term of -170424, -340855, -511260, -681639, -851992? 13s2 - 170470s + 33 What is the z'th term of -7493658, -7493588, -7493518, -7493448, -7493378, -7493308? 70z - 7493728 What is the v'th term of 52891, 57029, 61167, 65305, 69443? 4138v + 48753 What is the u'th term of 183279, 367931, 553959, 741363? 688u2 + 182588u + 3 What is the d'th term of -71977, -287377, -646203, -1148455? -71713d2 - 261d - 3 What is the l'th term of -32819, -33408, -34343, -35624, -37251? -173l2 - 70l - 32576 What is the j'th term of 1639906, 1639927, 1639948? 21j + 1639885 What is the t'th term of 13916705, 27833395, 41750085, 55666775? 13916690t + 15 What is the c'th term of -32765022, -32764932, -32764830, -32764710, -32764566, -32764392, -32764182, -32763930? c*3 + 83c - 32765106 What is the c'th term of -2316, -2297, -2238, -2115, -1904, -1581, -1122, -503? 4c3 - 4c*2 + 3c - 2	{ "pile_set_name": "DM Mathematics" }
What is the remainder when o is divided by 29? 26 Let s(l) = -l*2 + 18l - 17. What is the remainder when s(14) is divided by 14? 11 Let a = 74 + -15. What is the remainder when a is divided by 15? 14 Let t be (3/((-9)/201))/1. What is the remainder when (-3)/(-12) - t/4 is divided by 6? 5 Let o(j) = -j*3 - 4j*2 - 2j - 6. Let t be o(-4). What is the remainder when ((-41)/(-2))/(t/4) is divided by 11? 8 Let m(o) = -o*2 + 2o + 2. Let q be m(2). Suppose k + 1 = z, qz - k = -0 + 3. Suppose -3 = -y + 1. Calculate the remainder when y is divided by z. 0 Calculate the remainder when 7 is divided by 1/2(0 + 4). 1 Calculate the remainder when 94 is divided by 46 - ((-5)/5 - 1). 46 Suppose -9d + 595 = -4d. What is the remainder when d is divided by 41? 37 Suppose -10m - 20 = -15m. Calculate the remainder when 13 is divided by m. 1 Let v(q) = 3q + 9. Calculate the remainder when 119 is divided by v(7). 29 Suppose 2h = -183 + 59. What is the remainder when (h/4 - -1)-2 is divided by 10? 9 Suppose -5u + 20 = -5p, -5p + 2 = -13. Suppose -3b - y = 4y + 8, -2y + 12 = 5b. What is the remainder when u is divided by b? 3 Let j be -20 + 0 + 4/2. Let z = 29 + j. Calculate the remainder when (((-6)/2)/6)/((-5)/430) is divided by z. 10 Suppose -5w = 2w - 217. What is the remainder when w is divided by 8? 7 Suppose 21 = 8o - 59. What is the remainder when o is divided by 4? 2 Let k = 5 + -2. Suppose j + 6 = kj. What is the remainder when 12 is divided by j? 0 Let p(x) = -x*2 - 4x + 3. Let k be p(-4). Suppose 0 = kg - 111 - 60. What is the remainder when g is divided by 4 + (9 - (1 + 0)) + 3? 12 Let b(h) = -h3 - 16h*2 - 5h - 55. Calculate the remainder when b(-16) is divided by 14. 11 Let m = 8 + -11. Let l = m + 16. Calculate the remainder when 24 is divided by l. 11 Suppose -24 + 0 = -4i. Let w(q) = -7q - 27. Calculate the remainder when w(-7) is divided by i. 4 Let k = -4 + 8. Calculate the remainder when 14 is divided by 2 - 2 - k-2. 6 Suppose -5f - 7 = -4x, 4x - 2f - f - 17 = 0. Suppose 5a = 4w - 125, -3w - 152 = -8w + 2a. What is the remainder when w is divided by x? 6 Suppose -5y - 140 + 385 = 0. Suppose 4p + 44 = 112. Calculate the remainder when y is divided by p. 15 Let d = -46 + 89. Let a = -6 - -8. Let x = a - -9. Calculate the remainder when d is divided by x. 10 Suppose f + 166 = 3f. What is the remainder when f is divided by 17? 15 Suppose -4m + 166 = 30. Suppose 22 = 2b - 0b. What is the remainder when m is divided by 1b/1 - -1? 10 Suppose 7c - 8c = -18. Calculate the remainder when 70 is divided by c. 16 Suppose -6f = -3f - 12. What is the remainder when 8 is divided by f? 0 Let c(x) = x3 + 6x*2 - 9x - 6. Let w(u) = u*2 + 11u + 5. Let d be w(-5). Calculate the remainder when (2 + d - 0)/(-1) is divided by c(-7). 7 Let x = -1 + 10. Suppose -4o = -5w + o + 30, x = -3o. What is the remainder when 8 is divided by w? 2 Let h(g) be the third derivative of g5/15 - g4/12 + g3/6 + 2g2. Calculate the remainder when h(-3) is divided by ((-3)/(-6))/((-2)/(-60)). 13 Let o(t) = -t2 + 7t - 6. Let l be o(5). Suppose ly + 92 = -j, -j - 116 = -y + 6y. Calculate the remainder when (16/(-6))/(4/y) is divided by 6. 4 Suppose f + 0f - 2d + 3 = 0, d = f. What is the remainder when 6 is divided by f? 0 Suppose -c - 6 + 0 = 0. Let h = -7 - -19. Calculate the remainder when (-1)/(-3) - 130/c is divided by h. 10 Suppose -10m + 16 = -8m. What is the remainder when 23 is divided by m? 7 Let y be (-4)/(-14) - (-145)/7. Let g = y + -9. What is the remainder when 22 is divided by g? 10 Suppose 5j = -m + 10, -5j + 35 + 5 = -5m. Suppose 3n + 3z - 3 = 0, -z = jn - 3 - 8. Calculate the remainder when n is divided by 3. 2 Suppose 4z + 30 = 118. Let q = -8 - -18. Suppose -5b - 4j = -8j - q, 4j - 26 = -b. What is the remainder when z is divided by b? 4 Let n(c) = -6c + 1. Let w be n(5). Let p = w + 48. Calculate the remainder when 37 is divided by p. 18 Let y be ((-12)/(-9) + -2)-51. Suppose r = 3r - y. Calculate the remainder when r is divided by 5. 2 Let t(d) = -d - 1. Let y be t(2). Let w(g) = 7g - 2. Let s be w(-2). Calculate the remainder when 22 is divided by (y/4)/(1/s). 10 Let a be ((-2)/6)/(5/(-285)). Suppose n = r + a, 4 + 0 = -r. What is the remainder when 43 is divided by n? 13 Suppose 5 = 2v - 193. Calculate the remainder when v is divided by 20. 19 Let y(s) = -s3 - 2s*2 - 2s - 4. Let c be y(-2). Suppose c = 4f + f - 30. Let m = 26 + -9. Calculate the remainder when m is divided by f. 5 Suppose 4s + 2 - 38 = 0. What is the remainder when 33 is divided by s? 6 Let i(m) = -m - 7. Let t(w) = w + 8. Let v(j) = -3i(j) - 2t(j). Let o be v(-4). Calculate the remainder when 9 is divided by 2 + (1 - (o + -3)). 4 Suppose 2l - 72 + 6 = 0. Let t = 431 + -301. Calculate the remainder when t is divided by l. 31 Suppose -3o = -4u + 2o + 13, -3o + 1 = 2u. Suppose -uw + 60 = -0. What is the remainder when w is divided by 16? 14 What is the remainder when ((-54)/10)/((-2)/10) is divided by 14? 13 Let r = -6 + 9. Suppose -n - 4w + 32 = rn, 27 = 4n - w. What is the remainder when 27 is divided by n? 6 Let t = -83 + 122. Suppose -3v + 34 = 4a, -3v + 0v + 4a = -50. Calculate the remainder when t is divided by v. 11 Suppose 0 = -9w + 14w - 650. What is the remainder when w is divided by 33? 31 Let b = 17 + -9. Suppose bh - 81 = 5h. What is the remainder when 78 is divided by h? 24 Let o(m) = -3m*2 + m - 1. Let t be o(2). Let z be 265/55 - 2/t. Suppose 135 = -0u + zu. What is the remainder when u is divided by 7? 6 Suppose -34 = -3c + c. Suppose -2s - 2a = -8, -5a = 3s - a - 12. What is the remainder when c is divided by s? 1 Suppose 0 = -9x + 7x. Suppose o + 3h = 18, o - 4h + 17 = -xo. Calculate the remainder when 3 is divided by o. 0 Let w = 13 + 3. Suppose -4b + 445 + 495 = 0. Suppose c - b = -4c. Calculate the remainder when c is divided by w. 15 Suppose -3u + 5j + 51 = 0, 27 = 2u - 3j + 2j. Calculate the remainder when 1/(-2) - 279/(-6) is divided by u. 10 Suppose -3c + 6 = -15. Suppose 0 = -2m - 4, -f - 2m + 4 = -3f. What is the remainder when c is divided by (f - -4) + (2 - -1)? 1 Let m(o) = -o*3 - 7o*2 - 2o - 5. Calculate the remainder when m(-7) is divided by 5. 4 Let h = -25 - -46. Calculate the remainder when h is divided by 11. 10 Suppose -4a + 1 = -27. Let y be (-352)/24 - (-4)/6. Let m = y - -18. What is the remainder when a is divided by m? 3 Let c be (1 - -7)(-35)/(-5). Calculate the remainder when 17 is divided by c/6 - (-1)/(-3). 8 Suppose -2g = 13 + 1. Suppose r + 2o - 17 = 0, 5o + 2 - 50 = -3r. Let u = g + r. What is the remainder when 13 is divided by u? 1 Let q = -23 - -63. Let j(p) = 6p + 2. What is the remainder when q is divided by j(2)? 12 Suppose -3x - 3t + 306 = 0, -2x + t = -2t - 209. Suppose x = -5c + 328. Calculate the remainder when c is divided by 16. 13 Let l = 21 + 20. Let f = l + 1. Suppose n - f = -2n. Calculate the remainder when 39 is divided by n. 11 Let l(x) = 5x*2 - 3x - 10. Calculate the remainder when l(4) is divided by 118/6 - (-2)/6. 18 Suppose 11 = 3c + 2. Suppose -4s - 37 = -3r - 5s, -4r - cs = -41. Calculate the remainder when r is divided by 8. 6 Let p(u) = u*3 + 13u*2 + 13u + 17. Let t be p(-12). Suppose -2n = 4v - 56, 4v - 3v = tn - 8. Calculate the remainder when v is divided by 7. 5 Suppose -9 - 1 = -4n + 3u, n - 3u + 2 = 0. Let y = 0 + n. What is the remainder when y is divided by 0 - (-3 - -2) - -1? 0 Let c be 1/((-1)/(-15)) + 1. Suppose 0 = -2s + 30 + c. Calculate the remainder when s is divided by 12. 11 Let s = 90 + -57. Calculate the remainder when 65 is divided by s. 32 Suppose 19 + 0 = f. Let v(u) = -u3 + 4u*2 - 2u - 1. Let a be v(3). Suppose -5j + 30 = -aj. What is the remainder when f is divided by j? 9 Suppose 5j + 12 = 2k, -18 = -3k - j + 3j. Let p = 11 - -1. What is the remainder when p is divided by ((-4)/k)/((-2)/21)? 5 Calculate the remainder when 34 + -4(-3)/(-9)3 is divided by 9. 3 Let c(l) = -l + 32. Calculate the remainder when 31 is divided by c(16). 15 Suppose 3f = 3s + 39, -3f + 2f - 5*s = -43. Calculate the rem	{ "pile_set_name": "DM Mathematics" }
7? 6 Let m be (4 - 2) + 16 - 2. Suppose -5 = n + 3v, 5n - m = 5v + 59. What is the remainder when 42 is divided by n? 2 Suppose 684 = 2d + 4w, -9d + 4d = 2w - 1718. What is the remainder when 354 is divided by d? 10 Suppose 69u - 28285 - 9379 = -38u. What is the remainder when 1058 is divided by u? 2 Suppose 0b + 6b = 0. Let m(h) = h*2 + 2h + 15. Let d be m(7). Suppose -5c + 11c - d = b. What is the remainder when 153 is divided by c? 10 Let l(b) = -5b + 35. Let s be (-7)/(42/(-9))126. Suppose 0 = 10m - 151 - s. What is the remainder when m is divided by l(6)? 4 Let u be (-5 - (-3 + -1))/(1/(-4)). Suppose -24 = -ug + h + h, 0 = 3h - 6. Calculate the remainder when 13 is divided by g. 6 Suppose -73y + 4466 = -1167 - 645. What is the remainder when 698 is divided by y? 10 Let h be 2583/(-1) - 13/(15 - 2). What is the remainder when 118 is divided by (h/(-64) - 0) + 3/(-8)? 38 Suppose -6a + 5r + 17 = 0, -r = -a + 20 - 18. Calculate the remainder when 5556 is divided by a. 5 Suppose 3m - 96 = -15. What is the remainder when (-74)/((2496/(-130))/48) is divided by m? 23 Suppose 0 = 3o - 5i - 31, o - 3i - 16 + 7 = 0. Calculate the remainder when 116 is divided by o. 8 Let m(i) = -i*2 - 9i - 9. Let g be 40/51/1 - 4. Suppose y = 2y - gk + 11, 4k - 25 = 3y. Calculate the remainder when 28 is divided by m(y). 3 Suppose 5p + 124 = -11. Let g = 32 + p. Suppose -gz + 9z - 272 = 0. What is the remainder when z is divided by 10? 8 Let n(x) = 139x - 267. Let w(i) = -35i + 67. Let l(h) = -2n(h) - 9w(h). Suppose 21 = 2g - 31. Calculate the remainder when l(6) is divided by g. 23 Suppose -2m + 543 = 207. Let v be (-4)/14 - (-888)/m. Suppose 3p - 13 - 28 = -2s, 0 = 5s + vp - 95. Calculate the remainder when 77 is divided by s. 13 Let f(v) = -3v3 - 7v*2 + 4v + 5. Let a(b) = 2b3 - 31b*2 - b - 103. What is the remainder when a(16) is divided by f(-4)? 68 Suppose -5r - 5v = -2r - 1383, 0 = -2v. Let t = 476 - r. Calculate the remainder when 479 is divided by t. 14 What is the remainder when 728 is divided by (-1176)/(-119) + (-6)/(-51)? 8 Let w = 12265 + -11295. What is the remainder when w is divided by 6? 4 Let u = 30184 + -30152. Calculate the remainder when 47 is divided by u. 15 Let c(d) = 2d*3 - 76d*2 + 77d + 168. Calculate the remainder when 559 is divided by c(37). 1 Suppose 29 = d - 6. Suppose r + 69 = -5z, -r - d = 4z + 34. Let f = -27 - r. Calculate the remainder when 166 is divided by f. 40 Suppose -5w - 59260 = -4k, 0 = -67w + 70w + 24. What is the remainder when k is divided by 6? 3 Suppose -9h = -11h + 16h - 812. What is the remainder when 178 is divided by h? 4 Let s(i) = i - 4. Let k be s(8). Suppose 49 = 3n - 2c + 7c, c = -kn + 71. Calculate the remainder when n is divided by 10. 8 Let k(p) = -141p*3 - 54p*2 - 54p + 1. What is the remainder when 479 is divided by k(-1)? 53 Calculate the remainder when 175 is divided by 1226277/25051 - (-2 + 160/82). 28 Let f(d) = 18d - 155. Let v be f(10). Let u = v - -32. Calculate the remainder when 203 is divided by u. 32 Let r be 98/(-441) + (-9482)/18. Let b = r - -1251. Calculate the remainder when b is divided by 66. 64 Let n = 9090 + -8987. Calculate the remainder when 793 is divided by n. 72 Suppose 412 = j - 3c - 2c, 5j + 4c = 2089. Calculate the remainder when j is divided by (504/(-16))/(0 - 15/20). 39 Calculate the remainder when 798/15224/14 - -1385 is divided by 198. 8 Let k(j) be the third derivative of j5/60 - j4/12 + 79j3 - 3j*2 + 14. Calculate the remainder when k(0) is divided by 53. 50 Suppose -180 = -7r + 100. Let u = -39 + r. Suppose -3t + 5n + 15 = 0, -4t - n = u - 21. Calculate the remainder when 14 is divided by t. 4 Let b(w) = -w3 - 19w*2 - 19w - 39. Let z be b(-18). Let o(i) = 2i2 + 39i - 59. Calculate the remainder when 77 is divided by o(z). 1 Suppose 0b = -2b - 2. Suppose -1442o = -290o + 605o - 40411. Calculate the remainder when o is divided by 2/((b - 0)/(-4)). 7 Let a = 873 - 358. Let i = -305 + a. What is the remainder when i is divided by 24? 18 Suppose 3z + 3h + 18 = -0h, 10 = -3z - h. Calculate the remainder when 11 is divided by z/(-8 - (-13 + 6)). 1 Suppose -39h = 6h - 33165. Let p = h + -677. Calculate the remainder when 80 is divided by p. 20 Let q = 1679 - 1607. Calculate the remainder when q is divided by 16. 8 Suppose 20m = 5818 - 5138. Calculate the remainder when 441 is divided by m. 33 Let a be ((-152)/(-114))/(10/6 + -1). Suppose -ao + 13 + 11 = 0. Suppose 15p - op - 39 = 0. What is the remainder when 86 is divided by p? 8 Let s = 45 - 11. Let i(u) = 6u - 21. Suppose -2h + 5x + 35 = 0, 2h - 8 - 7 = x. What is the remainder when s is divided by i(h)? 7 Suppose -3k = 4r - 790, -5k + 286 = -2r - 1048. Calculate the remainder when k is divided by 132. 2 Let h = 75 - 45. Let p(c) = 10736c*2 + 6c - 10737c2 + 144 + 6c. What is the remainder when h is divided by p(19)? 8 Let b be 128/(-10)(11/22 + -3). Let k be (-8)/(2 - 0)-1. Suppose -2l = u - ku + 14, 5u - b = -l. What is the remainder when 22 is divided by u? 4 Suppose -5b = -30 - 15. Suppose -3u = bu - 288. What is the remainder when 43 is divided by u? 19 Let q(u) = -33u - 3. Let k = 359369 + -359365. Calculate the remainder when q(-2) is divided by k. 3 Suppose 2z + 567 + 267 = 5m, -5m + 828 = z. Suppose -30p + 4j - 36 = -32p, 57 = 4p + 3j. Calculate the remainder when m is divided by p. 10 Suppose 707i - 34067 + 26369 = 43913. Calculate the remainder when i is divided by 3 + (-24)/2-1. 13 Let o = 1940 + 1971. Calculate the remainder when o is divided by 38. 35 Let j be (42/(-28))/(9/5322). Let o = j - -956. Calculate the remainder when o is divided by 16. 5 Let p be (1 - -2)/(2 + (-94)/50). Suppose -p = -11n + 63. Calculate the remainder when 14 is divided by n. 6 Let u(q) = q*2 + 2q + 87. Suppose 3f + 8 = -2d, 3d + 12 = -f - 0d. Let j be u(f). Let c = -47 + j. Calculate the remainder when 116 is divided by c. 36 Let t be ((-14)/6)/(210/(-180)). Suppose -tf = -2o - 283 - 153, 3f - 636 = -3o. Calculate the remainder when f is divided by 32. 23 Let r(i) = -i*3 + 4i*2 - i. Let v be r(4). Let g(p) = 0p*3 - 3p*3 - p + 2p*3 - 20 - 2p*2 + 18. What is the remainder when 134 is divided by g(v)? 32 Suppose 3j = -t - 3, -2t - 1 = 3j + 5. Let y = 45 + -37. Calculate the remainder when 165 is divided by (j + 7)/(2/y). 25 Let f be 2/25 + 354/(-50). What is the remainder when 6 is divided by f/(42/5) - 17/(-6)? 0 Suppose 4v + 43 = 2i - 123, -3i + 284 = v. Calculate the remainder when 196 is divided by i. 10 Let z(d) = 143d*2 - 44d + 448. Calculate the remainder when z(11) is divided by 10. 7 Calculate the remainder when ((-2)/2 - 1324)(110 - 111) is divided by 17. 16 Suppose 5k - 20 = 45. Suppose -17303t = -17321t + 1062. Calculate the remainder when t is divided by k. 7 Let t(c) = 13c2 - 99c + 11. Let j(g) = -g*2 + 8g + 11. Calculate the remainder when t(8) is divided by j(8). 7 Let n be 12/(-2 + 4) + -233. Let q = -204 - n. Calculate the remainder when q is divided by 13. 10 Let d = -133 - -193. Suppose 10z + d = 220. Let j = z - 1. What is the remainder when j is divided by 9? 6 Let o(f) = -f3 - 2f*2 - 2f + 1. Suppose -3h = -5a + 2h - 10, 0 = -4h - 4. Calculate the remainder when (3422/290)/(2/10) is divided by o(a). 11 Let i = 712 + -708. Suppose 253 = 5z + x - 241, z + 2x - 97 = 0. What is the remainder when z is divided by i? 3 Let b = -244 + 247. Suppose ba = -4w + 121, 2w = -4a + 2a + 58. Calculate the remainder when 100 is divided by w. 32 Suppose 2h + 4 = 4z, -4h + 3h = -4z - 2. What is the remainder when 111 is divided by (h + -76)1/(-2)? 29 Let p(v) = -2v*2 + 29v - 5. Calculate the remainder when p(13) is divided by 3328/312 + 4/(-6). 4 Let j = -36 - -45. Suppose 5h - x - 1164 = 0, -4h + 6x - 3x + 929 = 0. What is the remainder when h is divided by j? 8 Suppose 14a - 35a + 63 = 0. Suppose af = 5k - 50 - 2, 0 = 5f + 20. What is the remainder when 151 is divided by k? 7 Let x = -832 + 871. Suppose 0i - 32 = 3i - 4s, 5 = 5i + 5s. Calculate the remainder when x is divided by (-5)/1	{ "pile_set_name": "DM Mathematics" }
sing order. u, q, 3 Suppose 12l = 16l - 20. Sort -3, 2, l. -3, 2, l Suppose t - 2t + 6 = 0. Sort -2, t, 4 in ascending order. -2, 4, t Let n = -21 - -18.4. Let o = n - -0.6. Let f = o + -1. Sort -1, -2, f in ascending order. f, -2, -1 Let g = -2.4 + 35.4. Sort -0.3, g, -5, 3 in descending order. g, 3, -0.3, -5 Let n(c) = -2c - 9. Let o be n(-7). Suppose 0 = x + 3t + 1, -x - o = 4x - 3t. Sort x, -2, -3 in increasing order. -3, -2, x Let q(g) = -g3 + 6g*2 + 6g + 7. Let h be 8 + (-2 + 0 - -1). Let k be q(h). Let a be (4/3)/((-2)/6). Put a, k, 5 in decreasing order. 5, k, a Let r = -29 - -28.7. Put 5, r, -4, 1 in increasing order. -4, r, 1, 5 Let q be (4/10)/(1/5). Suppose 0 = 4m + 5w, qm + w = -0m. Sort 5/3, -3, m in decreasing order. 5/3, m, -3 Let s = 0.37 + -0.07. Let y be (-16)/24(-6)/16. Sort y, s, -4/5 in ascending order. -4/5, y, s Suppose s = 3f + 15, 0 = -s - 5f - 2 - 23. Let l(r) = r3 + 5r*2 + 2r + 7. Let h be l(-5). Sort 3, s, h in increasing order. h, s, 3 Let u = 31 - 31.4. Put 7, u, 2 in increasing order. u, 2, 7 Let z = -11 - -11.8. Let q = -0.74 + z. Let k = q + 2.94. Sort k, 2, 2/9 in descending order. k, 2, 2/9 Let k = -263.9 - -283. Let f = k + -22. Let v = 3 + f. Put v, -2, 0.4 in increasing order. -2, v, 0.4 Let v be 8/1060/(-8). Let f(w) = w + 8. Let l be f(v). Suppose 3z - 20 = -0j + j, -45 = -4z + 5j. Sort l, z, 0 in increasing order. 0, l, z Let o = 1.4 - 1.2. Sort 2/7, o, -0.5. -0.5, o, 2/7 Let s = 0.1 + 0.1. Let h be ((-5)/(-75))/(2/1878). Let p = h - 62. Sort s, p, -3. -3, s, p Suppose -7i = -3i - 4. Sort 2, i, -1 in decreasing order. 2, i, -1 Suppose -k = -0k - 3. Sort k, 2, -1. -1, 2, k Suppose 0 = -5p - 6 + 31. Suppose g = -2k + 5k - 14, k + pg - 10 = 0. Suppose -w = -4f + 12, w + 6 = 2f - 0f. Sort k, w, -5 in ascending order. -5, w, k Let u = 18.7 - 10.3. Let q = -2.2 + u. Let a = q - 6. Sort a, 0.1, 0.3 in ascending order. 0.1, a, 0.3 Suppose 2n = f, -8 + 3 = -5n + 5f. Suppose 2m + 11 = 5w, -3w = m - 0m. Sort n, 5, w in decreasing order. 5, w, n Let l(h) = h. Let q be l(4). Sort 5, -3, q in descending order. 5, q, -3 Let a = -6 - -2. Suppose -b - 7 = -2b + r, 3r + 6 = 0. Sort a, b, 1. a, 1, b Suppose 13 - 7 = m. Let h be ((-26)/m - -3)3. Put h, -3, -2 in decreasing order. -2, -3, h Suppose 0 = -5c - p - 50, -2c + 5c + p + 30 = 0. Put 0, -2, c in descending order. 0, -2, c Suppose 0 = 5k - 2f - 28, -2k - 5f - 10 = 2. Let w be (0 + k)/((-16)/(-8)). Sort w, -7, 3 in descending order. 3, w, -7 Suppose 3p = 4x - 3x + 10, 4p + 3x - 35 = 0. Suppose 5n + 7 = 2. Put p, -2, n in descending order. p, n, -2 Let k(b) = -b*2 + 16b + 22. Let h be k(17). Sort -2, h, -4 in increasing order. -4, -2, h Let j(t) = t*2 + 8t + 7. Let r be j(-6). Suppose -v - 4s = 0, v - 3v - 5s = 0. Sort v, 4, r in descending order. 4, v, r Let a = -0.0171 + -4.9629. Let l = a - 0.02. Let d = -1 - l. Put d, -0.5, -0.4 in increasing order. -0.5, -0.4, d Let y = 1.1 - -0.3. Let j = y - 1. Let t = 274/15 + -56/3. Put -4, j, t in increasing order. -4, t, j Let m = -135.7 - -136. Put m, -0.3, 0 in ascending order. -0.3, 0, m Let d be (-2 + -1 - 0)/(9/6). Sort d, -5, 6 in descending order. 6, d, -5 Let n be ((-2)/(-28))/(7 + 78/(-12)). Sort 0.3, -2, n. -2, n, 0.3 Let c = 18.9 + -19. Sort 2, 1, c in decreasing order. 2, 1, c Let h be (-1 + 2)/(25/(-42)). Let q = h - -251/75. Let m = 9 - 14. Put m, -1, q in increasing order. m, -1, q Suppose 0 = -3o + 4 - 19. Let l be -3 + (-1 - (4 - 10)). Sort 0.4, o, l. o, 0.4, l Let y = 3 - 2.5. Let f = -31 + 23.8. Let i = 7 + f. Put i, y, 5 in increasing order. i, y, 5 Let s be (35/14)/((-2)/4). Sort 4, s, 1 in decreasing order. 4, 1, s Let h = -1 - -1. Let u = -2.1 - 4.9. Let m = u - h. Put m, 3, 5/3 in decreasing order. 3, 5/3, m Suppose 3w = -0 - 6, -4 = -4p + 4w. Let s be 1/(-3) - (-5 - -4). Let u be (0 - -3)/(0 - -1). Sort u, s, p in descending order. u, s, p Let g = 8 - 7.97. Let v = -0.087 + -0.343. Let s = g + v. Put 2/5, -2, s in decreasing order. 2/5, s, -2 Suppose -2k - 10 = 4x, x - 5x = -2k + 30. Sort -1/4, x, 0.1 in descending order. 0.1, -1/4, x Let k = 62 + -62.3. Sort 0.2, k, -0.2, 0 in descending order. 0.2, 0, -0.2, k Suppose -2k = 5w - 10, w - 6k + 25 = -k. Sort w, 1, -2, 3 in descending order. 3, 1, w, -2 Let n(o) = -o*3 + 6o*2 - 8o - 3. Let d be n(3). Sort d, -8, 1 in decreasing order. 1, d, -8 Suppose 4n = -11 + 19. Sort n, -2/19, -0.4, 2/15 in decreasing order. n, 2/15, -2/19, -0.4 Suppose -4k = 19 - 7. Let v = -8 + 12. Suppose g - 5t = -2, g + t = -vg - 10. Sort 0, g, k. k, g, 0 Suppose -10 = 2h, 5v - 3h = 5 + 20. Let f be (2 - (-2)/(-1)) + v. Suppose 3u + 4 = -fs - 0, 0 = u - 2s + 4. Sort 1, -1, u in decreasing order. 1, -1, u Let k be (4/(-6))/(4/6). Let x(l) = -l*3 - 3l*2 + 4l - 2. Let u be 12/(-2) + -4 + 6. Let j be x(u). Put k, j, 1 in descending order. 1, k, j Let w be (-8)/(-3) + 8/(-12). Suppose 5r + wb + 33 = 3, -3r + 13 = -5b. Put 4, -3, r in increasing order. r, -3, 4 Let c be -2 + 0 - (-1 - 0). Let j = 4 - c. Sort j, 1, 4. 1, 4, j Let h(m) = 2m2 - m. Let k be h(-1). Let g(l) = 3l - 4. Let a be g(3). Sort -5, a, k in decreasing order. a, k, -5 Let x = 0.01 + -0.01. Let u = -0.06 + -3.94. Sort x, u, 1/4. u, x, 1/4 Let d be (-3 - -9)/3 + 9/(-5). Let r = -2/253 + -11879/1518. Let c = 623/78 + r. Put -2, d, c in increasing order. -2, c, d Let u be 4/42 - (1 - 1). Let f be (3(-1)/9)/(0 - -1). Sort -2, u, f. -2, f, u Suppose 3k + 10 = -2. Sort 7, k, -5. -5, k, 7 Let f be 3/(20/(-16) - -2). Suppose f - 3 = -s. Sort 0, 5, s. s, 0, 5 Let m(f) = 40f2 + 1. Let g be m(-1). Suppose -v - g - 29 = -4w, 5v - 64 = -3w. Let l be (-4)/w - (-2)/9. Sort l, -1, 4 in increasing order. -1, l, 4 Let o = 0.13 + -8.13. Let c = o - -7. Let b = -0.26 + 0.06. Sort c, 1/3, b. c, b, 1/3 Suppose 5z - 7z + 8 = 0. Let f = 2 - 1. Suppose 0 = d + 2v - 0 - 1, -d - f = v. Sort z, d, -1 in increasing order. d, -1, z Let g = -11 + 19. Suppose -g + 3 = 5f. Let h(d) = d + 1. Let k be h(f). Put k, -5, -2 in ascending order. -5, -2, k Let x = 1.7 - 1.7. Sort x, -2/7, -6 in descending order. x, -2/7, -6 Let q = 109.6 + -120. Let o = 10 + q. Suppose 16 = -3y - y, 5a + 3y = -2. Sort a, o, -1. -1, o, a Let q(x) = -x - 11. Let n be q(-12). Sort -2, 0, n, -4 in descending order. n, 0, -2, -4 Let m = 9 + -8.5. Suppose 4 = -3b - 32. Let y be 2/(-7) - b/(-7). Put y, m, 1/7 in increasing order. y, 1/7, m Let t be (1/(-3))/((-3)/9). Let i be (t - -2 - 1) + 1. Suppose 12 = q - 0q + 2d, iq + 2d = 16. Sort -5, q, -2 in decreasing order. q, -2, -5 Let l = -72 - -72. Put -5, 4, -2, l in descending order. 4, l, -2, -5 Let b = -9 + 5. Sort 3, -3, b. b, -3, 3 Let p be 18((-3)/2 + 2). Let k = p + -6. Let f(v) = -v3 + 5v*2 - 1. Let w be f(5). Sort k, w, -3 in decreasing order. k, w, -3 Let m = 4 + -7. Sort m, -4, 2 in descending order. 2, m, -4 Let m = -88 + 92.1. Let l = -4 + m. Put 5, -0.2, l in ascending order. -0.2, l, 5 Let v = 11 + -7. Suppose p + 5t = -2, -3p + t + t + 11 = 0. Put -3, p, v in ascending order. -3, p, v Let m(u) = -u3 + 7u*2 - 7u + 5. Let q be m(6). Let j be (-4)/6(q - -4). Sort -3, 1, j in descending order. 1, j, -3 Let p = 1.5 + -1.9. Sort p, 0.02, -0.2 in decreasing order. 0.02, -0.2, p Let t(v) = -v2 + 3v + 2. Let c be t(0). Sort 1, 3, c. 1, c, 3 Suppose 5p - 11 = 9. Suppose -7t = -3t - p. Sort t, 2, -2 in decreasing order. 2, t, -2 Let w = 2.8 + -3. Put 1/5, -1, 3/5, w in increasing order. -1, w, 1/5, 3/5 Let b(h) = h2. Let q be b(-2). Let g = 6 - 9. Let f be ((-42)/18 + 2)/(2/(-18)). Put f, g, q in ascending order. g, f, q Let v = 32.01 + -32. Sort v, -3/4, 0.5. -3/4, v, 0.5 Let p = 0.2 + -0.28. Let m = -2.92 + p. Put 4, m, -5 in decreasing order. 4, m, -5 Let o = -0.029 + 7.129. Let q = o + -7. Put -1, q, 2/3 in descending order. 2/3, q, -1 Let t = -3 - -8. Let k = -6.3 - -1.8. Let j = k + t. Sort 2/7, j, 1. 2/7, j, 1 Let a(u) = u2 - 10u - 15. Let z be a(11). Sort 5, -5, z, 2. -5, z, 2, 5 Let v = 0.4 + 0.1. Let g = -23.57 + 24. Let t = 0.03 - g. Sort t, v, 0.3 in increasing order. t, 0.3, v Suppose 2 + 0 = u. Let q be 56/(-6) + 1/3. Let x = q - -4. Put u, 3, x in descendin	{ "pile_set_name": "DM Mathematics" }
2 Let p = -7628 - -7633. Solve -4z - 10 = 5k - 9z, -pz = 10 for k. -4 Suppose -5a = q + 30, -2q + 5684a = 5680a - 24. Solve -u + f + 2 = q, -35u = -33u - f - 1 for u. -1 Let g(n) = 6n2 + 14n - 31. Suppose 186c - 176c = -40. Let r be g(c). Solve r = -5v + z - 3, -12 = 4z for v. -3 Suppose -22t + 15 = -20t + 5i, 2t - 9 = -3i. Solve -5 = 5v, q + 0q - 4v - 5 = t for q. 1 Suppose 43k = 62k - 76. Solve -3r = 3m + 21, 13m + 24 = -kr + 10m for r. -3 Let w(k) = -k3 - 2k*2 + 7k - 1. Let f be 341/(-77) + 1 + 4/(-7). Let y be w(f). Suppose -8 = -2n + n. Solve -14 = -4a - yc, na - 35 = 3a + 5c for a. 5 Let l = 15453 + -15449. Solve -35f - 5z = -33f - 8, -lf - 28 = -z for f. -6 Suppose -3f - 4y = -2y - 7, -f + y = 6. Let w be 42/(5 - f) - 4. Solve -3g + 3l = 2l + 16, 2g - wl = -20 for g. -4 Let k = -1100825 - -1100830. Suppose n - 3t = 15, 0 = 6n - n + 4t + 20. Suppose -v + nv + 1 = 0. Solve -4h = -x - 2, -3x - 5h - k = v for x. -2 Let y = -1196 - -1212. Solve -4z - y = -0z, 4z + 15 = g for g. -1 Suppose v + m - 78 = 0, -2v + m = v - 258. Solve 4b - 85p + vp = 15, -3b + 11 = -p for b. 4 Suppose 2n - 7l + 6l - 13 = 0, -2l + 10 = 5n. Suppose 5m - 5 = -b + 2b, 2b = -nm + 4. Solve 4x + 4r - 4 = 0, b = 5x - 0r + 3r - 1 for x. -1 Let k(a) = a2 + 12a - 317. Let b be k(-25). Suppose -bx + 211 = 147. Solve 11 = 5v - w, v - 6v - 2w = -x for v. 2 Suppose 0 = 71n - 41 - 172. Solve f + r + 10 = -2r, nr + 18 = -3f for f. -4 Let k = 280 - 282. Let z be k(-3)/(-36) + (-110)/(-12). Solve -4y - 2 = -p + 1, -3p = -5y - z for y. 0 Let g(f) be the first derivative of -f*4/4 + 14f*3/3 - 12f*2 + 4f - 145. Let o be g(12). Solve 0 = od - 4r - 4, r - 2 = 3d + 5 for d. -4 Suppose -64z - 15 = -65z + 5s, 8z + 5s - 30 = 0. Solve 4j + zi - i = -4, -j = 5i + 13 for j. 2 Suppose -3a = 4v + 5 - 8, a - 3v - 14 = 0. Solve -15k + 16k = -w, 0 = 4k - aw - 18 for k. 2 Suppose -3m + 4x - 62 = 0, 2 = -m - 5x - 6. Let l be m/(-9)(-2)/(-1). Let p be 2((-3)/(-3) - (-4)/8). Solve 0 = 5z - b - 1, pb - 8 = lz - 0b for z. 1 Let c be ((-12)/(-10))/((-9)/(-30)). Let v(p) = 2p*2 + 15p - 18. Let d be v(8). Let z = d - 227. Solve -3r = 7l - zl - 31, 0 = cr - 20 for l. 4 Let z = -72 - -100. Suppose 14w = -0w + z. Suppose -8b + 3v = -4b - 5, -4v = -wb. Solve 0 = -bo - 2q + 5q + 1, 0 = -2o - 4q + 22 for o. 5 Let u be (-4)/(((-60)/(-180))/(2/(-12))). Solve 0 = 3z + 15 - 3, 0 = 5d - uz - 18 for d. 2 Suppose 4s = 3s + 5. Let y(n) be the third derivative of -5n*4/24 - 73n*3/6 + 18n*2. Let q be y(-16). Solve 2o - q = 4d - d, 13 = 4o - sd for o. 2 Let m be (-1)/(66/4) - (-76380)/18810. Solve -ms - 19 = -3, -h = -5s - 23 for h. 3 Let i be (-16 - -1)/((-39)/52). Suppose i = 5z - 60. Let s be 3/(12/z) + -4. Solve s = t - 2, 6 = -5l - 2t - 0 for l. -2 Suppose -4f - 4j + 3 + 5 = 0, 0 = -3j + 9. Let w be f + 33/39 - 432/(-104). Solve 2n + x = 4x + 6, -wx = -3n + 8 for n. 0 Let u(f) = -f2 - 74f + 409. Let t be u(5). Solve -3d = -13g + 16g - 9, 4g + 3d - t = 0 for g. 5 Suppose 0 = 2v + v + b - 87, -2b - 126 = -4v. Solve -v = 5t - 14q + 9q, 2t + 16 = 3q for t. -2 Let c = 8568 + -8565. Solve i = -cq + 2i - 13, -5i = -5 for q. -4 Let f(o) = 13 - 184o + 176o + 40. Let a be f(6). Solve -3u - 2h = -5, 3u + ah - 3 = 5u for u. 1 Suppose 10 = -4y + 98. Suppose -y = -6s + 8. Suppose sa + g - 28 = -0g, 21 = 3a + 2g. Solve -11 = at - n, 3n = -3t + 7n - 10 for t. -2 Let n = 16842 - 16838. Solve -2o + g = 0, -g = -no - 4g + 10 for o. 1 Let h be (5/4)/(7/28). Let x(o) = o*2 + 5o + 4. Let c be x(-7). Let a = 252 + -250. Solve -am = 5p + c, -hp = -3m + m + 22 for p. -4 Let k(j) = -j - 5. Let m(f) = -3f - 66. Let x(b) = -4k(b) - m(b). Let r be x(-12). Solve -4w = 4a + 28, 4w - ra = 2a - 12 for w. -5 Suppose -14d = -2d - 120. Suppose 35 = 4k + 3z, 6z - 3z + d = 5k. Solve y + g = -0g - k, 3 = 3y - 3g for y. -2 Let n = -2501 + 2501. Solve -2v = -3v + 2l + 4, -4v + 4l = n for v. -4 Let d(a) = 2a3 + 94a*2 - 91a + 253. Let u be d(-48). Solve 5p = 3o - u, -6 + 8 = -2p + 2o for p. -5 Let b(t) = 17t - 39. Let c be b(11). Let a = c + -83. Let z = 94 - a. Solve 0 = 4g - 4f - 8, -3f + z = 5g - g for g. 5 Let o(m) = m3 - m2 - 11m + 25. Let q be o(3). Let n be 1(2 - 4/(q/5)). Solve -2l - 3c = -21, -2l + nc = c - 11 for l. 3 Let x be -75 + 70 + 14(-6)/4. Let l be 2/6 + x/(-18)6. Solve l = q - 4b, 4b - 3 + 0 = 5q for q. -3 Let r(k) = -83k - 821. Let u be r(-10). Solve -us - 10 = -4s - 2b, -5b - 8 = 4s for s. -2 Suppose -3v + 18 = -m, -4m + 21v = 26v - 47. Solve d + 9 = -2h, -7h + 6 = -6h - md for h. -3 Let z(a) be the second derivative of -a*3/3 + 11a*2/2 + 4a - 8. Let r be z(0). Solve 3p = -2o - 6, -2o = 3o + p - r for o. 3 Let r be ((-2)/4)/(2/(-4)). Let s be (14 + (-1)/1)/r. Suppose -4m = 2y - 28, 118m - 117m + 38 = 4y. Solve s = 3g + mg + 4p, -g = 3p + 4 for g. 5 Let u(r) be the first derivative of -r4/4 + 3r3 - r2 + 19r - 1. Let b be u(9). Solve b = 5q - l, 2q - l = q - 3 for q. 1 Let n be (1 - 18/(-6)) + 17. Let p = n + -14. Solve -1 = u - pj + 4j, 0 = 5u - 5j + 5 for u. -1 Let z(j) = -j3 + 10j*2 + 14j - 25. Let t be z(11). Let l(n) = 2n - 14. Let g be l(t). Solve -3k - 3h = h + 14, -5k + 20 = -gh for k. 2 Suppose -n - y = -4, 2n = -n + 3y. Let v be (25 + 148/(-6))6. Solve -2 = 2z - 0l + nl, v = -2z + 3l for z. -1 Let r(y) = -y2 - y + 77. Let j be r(8). Solve js + 14 + 1 = -h, -h - 13 = 4s for h. -5 Let j(b) = 6b*2 + 2b - 1. Let v be j(-2). Let z = -141 + 144. Suppose 0 = zm - 4u - 16, -4u - 20 = -5m + m. Solve -q - v = 5x, -4x - 9 - m = 3q for q. 1 Let h(a) be the first derivative of -a4/4 + 5a*3/3 - 3a*2/2 + a + 96. Let f be h(1). Solve -b - f = -2m - 2m, -m = -5b + 9 for m. 1 Suppose -3o - 47 = -2c, -2c = -3c - 2o + 6. Solve -4b - n = -c, -22b + 28 = -18b + 4n for b. 3 Suppose -3q = b - 7 - 1, 2q - 2b = 8. Suppose 2l = -2a + 18, -908 + 934 = -l + 4a. Solve qm - lf + 4f - 13 = 0, 16 = -4m + 4f for m. 1 Let t = 74527 + -74515. Suppose 0 = 3p - 5i - 25, -3p + 4p + 5 = -i. Solve 2c = 4b + t, p = 4b + 2c + 5 - 1 for b. -2 Let s = 19556 + -19554. Solve 4c = -5i + 7c + 24, -sc = 6 for i. 3 Let u be 291 - 11088/616. Solve -4b - 14 = -g, 0 = ub - 8b - g + 10 for b. -4 Let u be 6/321/(-2). Let j be (4/u)/((-10)/15). Solve 4l - 5c = 4, 2c = 3l - c - j for l. 1 Let y be (((-855)/24)/19)/(23/(-184)). Solve 0 = -4g - 3z - y, -15g + 14g + 3z = 0 for g. -3 Let k be (3630/(-132))/(4/6(-3)/4). Solve 2u + 56y - ky = -3, -3 = 4u - y for u. -1 Let a be ((-5)/20)/((21 + -7)/(-112)). Solve -5m + 7 = -m - 3d, 0 = 2m + ad + 14 for m. -2 Suppose 28f = 21f - 42. Let x be (8/(-2) - f) + 4. Solve -4a + h = -x - 12, 0 = -4a - 4h + 28 for a. 5 Let s be (6/4)/((-72)/(-16) - 4). Suppose sy - 22 = -3a - y, 4y = -5a + 42. Solve -2q - a = -5n, 3q - 4 - 15 = -n for n. 4 Let r(n) = 35 + 6 - 5n + 6 + 33. Let z be r(15). Solve 4q = -3f + zf, f = -5q + 14 for f. 4 Let d(o) = o2 - 8o + 19. Let l be (72/45)/(8/20). Let f be d(l). Suppose -5c - q = -8, -3c + 3q = 7q + 2. Solve cj = -5k - 4, f - 1 = 5k - j for k. 0 Suppose 0 = 4i - 0i + 24. Let k be 28/6 - 8/i. Let d be ((-264)/15)/(-8) - 3/15. Solve 19 = h + u + du, -2u = -4h + k for h. 4 Let a(g) = -g*3 - 16g*2 + 32g + 259. Let w be a(-17). Solve wr = -u - 4u - 10, 0 = 4r - 2u - 4 for r. 0 Suppose 6x + 2751 = -15x. Let u = -131 - x. Solve 2w - 3q + 5 = u, 5q - 4 - 11 = 0 for w. 2 Suppose -12b = 13b. Let w be ((-1)/(-1) + 0)b. Solve 0 = -p - p + 8, w = 4k - 3p - 4 for k. 4 Let s be (80/600)/(3/45). Solve -2u + 3x = -7, 2x - 14 = -su - 2x for u. 5 Let i(y) be the third derivative of y6/120 - y5/15 - 5y*4/24 - 41y*3/6 + 33y*2 + 1. Let p be i(6). Solve 2t - 9 = 6t - w, 0 = -2t - 3w - p for t. -2 Let s = 409 - 198. Let j = s - 207. Solve 24 = 4n - jf, -3n - f - 2 + 4 = 0 for n. 2 Suppose -4r + g = -121, 4r + r = g + 151. Suppose 0 = 34o + o - 210. Suppose oa	{ "pile_set_name": "DM Mathematics" }
1/252m8 + 0m - 4/315m7 + 0 - 2/9m*6 + 230m*2. Find d such that l(d) = 0. -2, 4 Suppose 2f = 3v + 86 + 60, -87 = -f + 5v. Let b = 69 - f. Suppose 0p3 - 20p*b + 22p*2 + 2p*5 - 2p*3 - 2p*4 = 0. Calculate p. -1, 0, 1 Let p be (-12)/(-2 + 0 + -2). Let n(w) be the first derivative of -11/8w*p - 9/16w*2 + 0w + 22 + 3/8w4. Factor n(m). 3m(m - 3)(4m + 1)/8 Let a(n) = 2n*2 - 9n + 11. Let r be a(3). Let w be (-2)/(-4) + 15/6. Factor w - 49x - 4x*r + 49x + x*2. -3(x - 1)(x + 1) Let m(u) = 30u*4 - 56u*3 + 72u*2 + 280u - 488. Let w(q) = 11q4 - 18q*3 + 23q*2 + 93q - 163. Let c(k) = -3m(k) + 8w(k). Factor c(d). -2(d - 10)(d - 2)*2(d + 2) Let u(z) = 2z2 - 315z - 653. Let x(j) = 7j2 - 941j - 1960. Let l(f) = -10u(f) + 3x(f). Determine g, given that l(g) = 0. -325, -2 Let z be ((-2)/(-4) + 18/(-4))/(13702/(-41106)). Factor -80/3 + 2/3j2 - zj. 2(j - 20)(j + 2)/3 Factor 154/5b - 34/5b*3 + 118/5b*2 + 0 + 2/5b*4. 2b(b - 11)(b - 7)(b + 1)/5 Suppose -167q + 180q - 4732 = 0. Suppose -q = -12b - 220. Suppose 0 + 4/3r + 4r*3 - 20/3r*2 + br4 = 0. What is r? -1, 0, 1/3 Let y(i) be the third derivative of i5/600 - i*4/240 - 6i*3/5 + 33i*2 + 4. Factor y(a). (a - 9)(a + 8)/10 Let s(g) = 47g3 + 648g*2 - 1275g - 19. Let q(b) = -5b3 - 72b*2 + 142b + 2. Let m(k) = 38q(k) + 4s(k). Solve m(i) = 0. -74, 0, 2 Let l = 13 + -6. Suppose 3 = 8n - 13. What is t in lt - 10 + 5t + 2 - 4t*n = 0? 1, 2 Let d = 447 + -901/2. Let l = 25/6 + d. Determine t, given that 2/3t*5 - 2t + 2t4 + 4/3t*3 - l - 4/3t*2 = 0. -1, 1 Let n(t) be the second derivative of 0 + 3/2t*2 + 34t + 1/10t6 - 1/10t*5 - 1/2t*4 + 1/42t*7 + 1/6t*3. Let n(a) = 0. What is a? -3, -1, 1 Let o(x) be the third derivative of 0x*5 + 0x*7 + 1/2352x*8 + 11x - x*2 + 0x*4 + 0 + 0x*3 + 0x*6. Determine g, given that o(g) = 0. 0 Suppose -4a - 11 = -5a - z, 4z = 4a - 4. Find f such that 7140f*4 + 6 + a - 7146f*4 - 33f*2 + 27f*3 = 0. -1/2, 1, 2 Let r(m) be the second derivative of -11/6m*4 + 0m*2 + 4/3m*3 + 9/10m*5 + 0 + 200m - 1/21m7 - 1/15m*6. Factor r(f). -2f(f - 1)3(f + 4) Let j(d) be the first derivative of 4d5/45 + d4/9 - 292d*3/27 - 290d*2/9 - 32d + 3460. Factor j(n). 4(n - 9)(n + 1)*2(n + 8)/9 Suppose 8p = 11p + 115p - 1888. Let b(u) be the first derivative of -28/5u*5 - pu - 100/3u3 + 32u*2 + 2/3u*6 + 19u*4 + 20. Factor b(t). 4(t - 2)*2(t - 1)*3 Let j = 26613088/1376539 - 2/4129617. Factor 1/9c*3 + 3364/3c + 195112/9 + jc2. (c + 58)3/9 Let x be (-6 - (9 - 18))/(-3). Let z be (-210)/(-12) + x + -4. Determine y, given that 15/2y - 9/2y2 + z + 1/2y*3 = 0. -1, 5 Let j(b) be the first derivative of 7b*6/13 + 2b*5/5 - 111b*4/13 + 488b*3/39 - 24b*2/13 - 64b/13 + 1937. Solve j(i) = 0 for i. -4, -2/7, 2/3, 1, 2 Suppose -34c + 130c = 480. Let -1/2i + 0 + 9/4i*4 + 13/4i*2 - ci3 = 0. Calculate i. 0, 2/9, 1 Let g(s) be the third derivative of s7/840 + s*6/48 + 11s*5/80 + 11s*4/24 + 5s*3/6 - 37s*2 + 3. Factor g(r). (r + 1)(r + 2)*2(r + 5)/4 Determine g so that -54/7g3 + 264/7g*2 - 42g - 36/7 = 0. -1/9, 2, 3 Let j be (-45520)/25 + (-2)/10. Let b = j - -1824. Factor -486/5 + 162/5m - 18/5m*2 + 2/15m*b. 2(m - 9)*3/15 Factor -209x*2 + 85x*2 + 121x*2 + 55x - 532x. -3x(x + 159) Let a = -16 - -37. Let m(q) = q2 - 14q + 38. Let k be m(a). Factor c*2 + 193c - 5c2 - kc. -4c(c - 2) Factor -6g2 + 3/2g*3 - 3 + 15/2g. 3(g - 2)(g - 1)2/2 Let k(p) be the third derivative of p5/90 - 287p4/36 - 578p*3/9 - 5p*2 + p - 16. Factor k(u). 2(u - 289)(u + 2)/3 Let z be 08(-19)/304. Let s(n) be the second derivative of zn*2 + 1/3n*3 + 31/48n*4 + 0 - 1/20n*5 + 43n. Let s(d) = 0. Calculate d. -1/4, 0, 8 Suppose 50g - 139g = 0. Let b(p) be the third derivative of 1/3p3 + 0 - 1/24p*4 - 1/60p*5 - 21p*2 + gp. Let b(u) = 0. What is u? -2, 1 Let p(w) be the third derivative of w*6/10 - 436w*5/3 + 132253w*4/2 - 175692w*3 + 1961w*2. Factor p(s). 4(s - 363)*2(3s - 2) Let p be (0 - (-2 - -3))/(-1). Let o be -2 + ((-68)/(-20) - p). Factor -3/5n*3 + 1/5n*2 + 1/5n*5 + on + 0 - 1/5n4. n(n - 2)(n - 1)(n + 1)*2/5 Let x = 8 - 6. Let f(a) = -2a + 3a - 5a*3 - 4 + 2a*3 + 4a3 + 5. Let g(v) = -v4 - 2v3 - v2 + 4v + 3. Let t(y) = xg(y) - 2f(y). Factor t(j). -2(j - 1)(j + 1)*2(j + 2) Let d(l) = -14l2 + 4l - 10. Let r(m) = 11m2 - 4m + 9. Suppose -15 = 5o + 5t + 15, 2 = -o + 3t. Let k(h) = or(h) - 4d(h). Solve k(c) = 0 for c. -5, 1 Let g be 18/15((-1140)/(-24))/19. Let x(v) be the second derivative of 0vg + 0 - 1/54v*4 + 0v*2 + 31v. Factor x(t). -2t2/9 Let w(m) be the second derivative of -7m*5/20 + 22m*4/3 - 125m*3/6 + 22m*2 + 482m - 3. Determine r, given that w(r) = 0. 4/7, 1, 11 Find n such that 4/3n4 - 880/3 + 16/3n + 220n2 - 232/3n*3 = 0. -1, 2, 55 Determine o so that -4o*2 + 12 + 636 - 151 - 1032o + 539 = 0. -259, 1 Suppose t + 31 = -3z + 46, 4t + 5z - 25 = 0. Let b be (30 + -27)(1 + t). Factor 12/7i2 - 2/7i*b + 0 + 0i. -2i2(i - 6)/7 Let s(b) be the second derivative of -b7/21 + b6/15 + 3b5/2 - 5b*4/6 - 34b*3/3 + 24b*2 + 36b + 8. Suppose s(h) = 0. Calculate h. -3, -2, 1, 4 Let k(l) be the first derivative of 1/32l4 - 13/16l*2 + 15/8l - 1/8l3 + 8. Factor k(r). (r - 5)(r - 1)(r + 3)/8 Let w(o) be the first derivative of -o5/25 + 68o*4/5 + 91o3/5 + 812. Factor w(q). -q2(q - 273)(q + 1)/5 Let l(x) = x*2 + 15x + 13. Suppose -43y = -38y - 5. Let i(b) = -b - 2. Let g(w) = yl(w) - i(w). Suppose g(h) = 0. What is h? -15, -1 Let t be 742/106 - (-78)/(-12). Factor 30h*2 + 600h + 4000 + th3. (h + 20)3/2 Let o be -4 - -3 - (-20220)/1092. Let t = -224/13 + o. Solve -8/7 + 0x + tx2 = 0 for x. -2, 2 Let -9c - 5c4 - 1101052c*3 - 1521c + 775c2 + 1101812c*3 = 0. Calculate c. -2, 0, 1, 153 Let d(s) = -s + 7. Let j be d(5). Let 34950p*j + 36p*3 - 34798p*2 + 24 + 72p + 68p = 0. Calculate p. -3, -1, -2/9 Let p(f) = -5f*2 - 20f - 21. Suppose -8 = -4d - 4b, -b = 4b - 15. Let w(q) = -1. Let c(u) = dp(u) + 6w(u). What is z in c(z) = 0? -3, -1 Let w = 655/117 - -9/26. Let h = w - 31/9. Solve -hu - 1/2u2 - 2 = 0 for u. -4, -1 Suppose 145k*3 + 14k*5 - 80584 - 9k*5 + 80544 - 215k*2 - 45k*4 + 150k = 0. Calculate k. 1, 2, 4 Let u = -38860 - -77721/2. Factor -1/2j3 - uj + 0 - j*2. -j(j + 1)*2/2 Factor -296 - 579 - 168g + 2g2 - 224 + 209. 2(g - 89)(g + 5) Let y(v) be the third derivative of 0 + 26v*2 - 2v + 1/450v5 + 0v*3 - 1/180v*4. Factor y(h). 2h(h - 1)/15 Let a = -711 - -715. Let j(m) be the first derivative of -8m - 10/3m6 - 40/3m*3 + 17 - am*4 + 18m*2 + 48/5m*5. Find n, given that j(n) = 0. -1, 2/5, 1 Let i(u) be the third derivative of 0u*3 - 8/105u*5 + 13/588u*8 + 0u + 1 + 2u2 + 0u*4 + 22/105u*6 + 20/147u*7. Factor i(n). 4n*2(n + 2)*2(13n - 2)/7 Let r(v) be the second derivative of v6/120 - v5/15 - v4/24 + 2v*3/3 - 47v*2 + v - 8. Let k(h) be the first derivative of r(h). Factor k(n). (n - 4)(n - 1)(n + 1) Let c(t) be the third derivative of t7/105 + 197t*6/15 + 262t*5/5 + 3450t*2. Let c(u) = 0. What is u? -786, -2, 0 Let q be (383/(-50))/(-1) + (-59)/59. Let v = 1/150 + q. Solve 1/6l*4 + 11/2l*2 + 8/3 - 5/3l*3 - vl = 0 for l. 1, 4 Let m = 135 - 73. Let u = 64 - m. Let -b*u + 2b - 2b - 3b - 2b2 = 0. Calculate b. -1, 0 Let a(n) be the first derivative of 2n*3/3 + 19n*2/3 - 248n/3 - 4320. What is s in a(s) = 0? -31/3, 4 Let v(b) be the second derivative of -b*6/90 + 7b*5/3 - 1225b*4/6 + 185b*3/6 - 158b. Let o(p) be the second derivative of v(p). Factor o(f). -4(f - 35)2 Let d(z) be the second derivative of -1/4z*2 - 7/120z*6 - 23/80z*5 - 9/16z*4 - 3z - 13/24z3 - 6. Factor d(h). -(h + 1)3(7h + 2)/4 Suppose -3b = 6g + 102, -b + 3g - 106 + 167 = 0. Find z, given that 4/3 + 1/3z - 13/6z*2 - 1/6z*3 + 5/6z*b - 1/6z**5 = 0. -1, 1, 2, 4	{ "pile_set_name": "DM Mathematics" }
divided by (-159)/(-15) + (-21 - -11) + 1662/5. 331 Suppose -106p + 71479 = -58371. Calculate the remainder when p is divided by 11. 4 Let p(h) = h3 + 8h*2 - 105h + 49. Let d(v) = 94v. Calculate the remainder when d(1) is divided by p(-15). 45 Suppose -s = -3d - 131, -s + 5d = -3s + 240. Let r be 5-1 + -4 + (-4 - -12). Calculate the remainder when s is divided by (r/(-2))/(3(-1)/(-252)). 41 Suppose -1247 = 12q + 241. Let d = -114 - q. Calculate the remainder when 19 is divided by d. 9 Let a(t) = 2t*2 + 21t - 13. Let b be -5 + 13 + (9 - -1)/5. What is the remainder when a(b) is divided by 57? 55 Let f(q) = 71q2 + q + 2. Let l be f(-1). Let d = 40 - l. Let a = d + 39. Calculate the remainder when a is divided by 4. 3 Suppose 8z = 11z - 9. Suppose -t + 15 = 4k, 0 + 9 = 3t. Suppose 34 = kg + 10. Calculate the remainder when g is divided by z. 2 Suppose 19o = -10 + 10. Suppose 2c - 5n - 15 - 18 = o, n - 3 = 0. Calculate the remainder when 52 is divided by c. 4 Let a be 0 - -2 - 0 - 0. Suppose 29 = -ad + 123. Let l(y) = 50y + 1510. Calculate the remainder when d is divided by l(-30). 7 Suppose 6t + 28t - 95668 = -29674. What is the remainder when t is divided by 103? 87 Let r be 4 + (-11 - -4) - (-548 + 6). Let d = -366 + r. What is the remainder when d is divided by 60? 53 Let t(r) = -r3 + 17r*2 + 20r + 12. Calculate the remainder when t(16) is divided by 33. 27 Let j(v) = 14v3 + 4v*2 + 3v + 2. Let q be j(-2). Let o = 268 + -260. What is the remainder when -4 - q/o2 is divided by 5? 1 Let p(q) = 17q - 43. Let m be p(5). Suppose 66f - 61f = -3z + 34, m = 3z + 3f. Calculate the remainder when 51 is divided by z. 15 Suppose y = -2v + 33, -117 = -4y - 3v - 5. Let d = 47 - 21. Suppose -2r = -3n - d, -3n + 27 = 4r - y. What is the remainder when r is divided by 6? 1 Let x be (-3)/(-4 - (-205)/55). Let n = x + 13. What is the remainder when 59 is divided by n? 11 Let w be 10/95 - 8/76. Suppose w = 3t - 2l - 74, -3l = 4t + 2l - 137. Calculate the remainder when t is divided by (-1)/(4/(-411)). 6 Suppose 117j - 5600 = 67j. What is the remainder when 30798 is divided by j? 110 Suppose 7q = -133 - 133. Let x = 23 - 147. Let z = q - x. What is the remainder when z is divided by 15? 11 Suppose 4d = -5k + 221 + 138, -7k = 7. What is the remainder when 998 is divided by d? 88 Let q(r) = r*2 - 14r - 502. Calculate the remainder when 594 is divided by q(-18). 2 Suppose 0 = -8z + 4z. Suppose 4h - 812 = 4b - 36, z = -h - 4b + 184. Suppose -3u - h = -11u. Calculate the remainder when 88 is divided by u. 16 Let f(u) = 2u*3 + 39u*2 + 20u + 15. Let i be f(-19). Let d(k) = -27k - 100. What is the remainder when 62 is divided by d(i)? 6 Suppose 52h + 1891 - 8495 = 0. Let k be 2-1(-1101)/6. Suppose 4z = -3f + 6z + k, -f + h = -3z. What is the remainder when f is divided by 41? 39 Calculate the remainder when ((-2)/4)/((-1)/512) is divided by 9/63 + 2404/28. 84 Suppose -78c - 289 + 483 = -1288. Calculate the remainder when 111 is divided by c. 16 Let i(x) = -4x - 14. Let u be i(-4). Suppose -uv + 4 = 8. What is the remainder when 21 is divided by v/(-7) + 80/14? 3 Suppose 15f - 10f = 10. Suppose -2u - 136 = -5y - 0u, -u = -f. Let x = 278 - 196. What is the remainder when x is divided by y? 26 What is the remainder when 114/(-608) + (-3480)/(-128) is divided by (9/6)/((-3)/(-42))? 6 Let t(q) = q*2 - 3q + 21. Let g be t(9). Suppose g = 4u + 87. Calculate the remainder when 12 is divided by 2(-1)/u(-42)/(-4). 5 Let n(c) = -45c*2 - 31c + 31. Let s be n(1). Let j be (-1)/((5/8)/(-5)). What is the remainder when (s/10 - 0)j/(-3) is divided by 10? 2 Let f(c) = 29c - 62. Let w be f(2). Let p(u) = -43u + 7. What is the remainder when p(w) is divided by 30? 29 Let l = -2502 + 2969. What is the remainder when l is divided by 156? 155 Suppose 0 = 5k + 3t - 2074, -t = k + 123 - 537. What is the remainder when k is divided by 105? 101 Let j = -31 - 3. Let c = -22 - j. Suppose cv - 318 - 222 = 0. Calculate the remainder when 223 is divided by v. 43 Let m = -4168 + 4171. Let p(g) be the second derivative of g5/20 - g4/6 - 2g3/3 + 3g*2 - g. Calculate the remainder when 11 is divided by p(m). 2 Calculate the remainder when 691 is divided by 9 - 17 - -16 - -30. 7 Let x be (42/181)/(4/(-348)). Calculate the remainder when (-1)/((-1617)/x + -8) is divided by 15. 14 Suppose 4720 = -5i + 6737 + 5563. What is the remainder when i is divided by 40? 36 What is the remainder when (-31)/(38/20216-21) - -8 is divided by (-2)/5 + (-174)/(-10)? 16 Let q(z) = 15z - 36 + 29 - 40z - 2z - 44. Calculate the remainder when q(-6) is divided by 18. 3 Let g = -35 - -20. Let j be 28/(-14) - -6 - (-6)/4-28. Let l = g - j. What is the remainder when 158 is divided by l? 20 Let a = 2681 + -1862. Let g = a - 390. What is the remainder when 134 is divided by g/15 - (-6)/(-10)? 22 Let h = -2393 - -5714. What is the remainder when h is divided by 151? 150 Suppose 22f - 106 = -18. Let z(s) = s*3 - 4s*2 - 5s - 3. What is the remainder when z(6) is divided by f? 3 Suppose g + 217a - 219a = 3g - 20, 4g - 14a - 454 = 0. Suppose -3u = 2u + 170. Let i = -17 - u. What is the remainder when g is divided by i? 16 Suppose 25 = 5v + w + 4w, -2v - w = -8. Let b(d) = 4d + d - v + 2d. What is the remainder when b(2) is divided by 7? 4 Let p be 4(2 - 27/12). Calculate the remainder when 96 is divided by p/3(-47 - 4). 11 Calculate the remainder when (354/4)/(5(-5)/(-50)) is divided by 55. 12 Suppose -5u + 5 = 0, 0n - 5n + 3u + 117 = 0. Calculate the remainder when n is divided by (-628)/(-1099) + ((-236)/(-28) - 2). 3 Suppose -30l = -33l + 39. Suppose lk = 1124 - 149. What is the remainder when k is divided by 26? 23 Let z(k) = k - 2. Let f(o) = -5o + 28. Let s(a) = f(a) + 6z(a). What is the remainder when 25 is divided by s(-3)? 12 Let m(u) = 9u + 491. Let r be (-3 + 4)/3141. Let w = r - 27. What is the remainder when m(-46) is divided by w? 17 Calculate the remainder when 485 is divided by (-10)/(-3)(2 - (-16)/40). 5 Let b(y) = -y3 - 3y*2 + 8y + 3. Let c be b(-4). Let s(t) = t*2 + 22t + 1. Let m be s(c). Let g = m + 189. What is the remainder when g is divided by 40? 33 What is the remainder when 4575 is divided by (-148)/2516 + (681/17 - -2)? 39 Let b = 200889 - 200877. Suppose -2l - 5 = -13. Calculate the remainder when b is divided by l. 0 Suppose -276p + 271p = -90. Let n = -48 + 204. What is the remainder when n is divided by p? 12 Let z = -1617 - -1631. Let h = 23 - 2. Let t = h + z. Calculate the remainder when t is divided by 9. 8 Suppose -4z + 8 = 0, 4k + 4z - 9841 - 1639 = 0. Calculate the remainder when k is divided by 18. 6 Let y = -1139 + 1628. Let w = -338 + y. Calculate the remainder when w is divided by 43. 22 Suppose -102 = -29i - 15. Suppose 0 = -3z - 2o + io + 50, -4z + 2o + 66 = 0. Calculate the remainder when 389 is divided by z. 15 Let w = -84027 + 84045. Let c = 0 - -9. Let g = c + 25. What is the remainder when g is divided by w? 16 Let t = 2968 + 3264. What is the remainder when t is divided by 29? 26 Let j be -2 + (-1 - 1/((-2)/10)). Suppose 0 = 3h - jb - 14, b = -3h + 2h + 3. What is the remainder when 12 is divided by h? 0 Suppose -2r + 94 + 226 = 8r. Let l = -57 + 100. Suppose -4w + l = s, 3s - 52 + 22 = -3w. Calculate the remainder when r is divided by w. 10 Let h(m) = 53m*3 - 7m*2 - 2m + 1. Let v be h(3). Suppose 9q - v = -38q. Suppose 0 = -3k + 5k - 22. What is the remainder when q is divided by k? 7 Let p(l) = -l + 29. Let t be p(18). Let c(u) = u*2 - 10u + 26. Suppose -2f = 186 - 554. Calculate the remainder when f is divided by c(t). 36 Let b(z) = z - 15. Let c be b(15). Let x(w) = w - 31. Let s be x(c). Let f = 140 + s. Calculate the remainder when f is divided by 28. 25 Suppose 15r - 1002 - 108 = 0. Calculate the remainder when 960 is divided by r. 72 What is the remainder when (-6)/934/(612/(-36882)) is divided by 342? 340 Suppose r = -7r + 24. Suppose -113 = -rn - u - 25, 25 = -5u. What is the remainder when n is divided by 16? 15 Let f = -41854 - -42592. Calculate the remainder when f is d	{ "pile_set_name": "DM Mathematics" }
p(d). 6d3 Suppose 2 = -2n, -n = -s - 2n + 1. Let a(f) = -f + sf + f + 0 + 1. Let d(u) = -u*2. Calculate -a(c) - 2d(c). 2c2 - 2c - 1 Suppose 3o = 2c - 4, -4 = -3c - 7. Let u(y) = -2y - 2. Let b(l) = l*3 + 2l + 2. Give ob(r) - 3u(r). -2r3 + 2r + 2 Let l be -6(1 - 1/3). Let r(t) = t - 1. Suppose 5 = -5g + 2k, 2g + 2 = -0g - 2k. Let a(x) = 4 - x*2 - 3x - x + 0x. Calculate ga(z) + lr(z). z2 Let t(q) = -33q + 1. Let c(g) = 33g - 1. Calculate -3c(j) - 2t(j). -33j + 1 Let f(b) = -4b3 + 3b*2 - 5b + 6. Let t(y) = -4y3 + 2y*2 - 4y + 5. Calculate 4f(s) - 5t(s). 4s3 + 2s*2 - 1 Let g(y) = y + 3. Let z be (4 + -3)/((-2)/8). Let c(k) = k - 1. Let m be c(z). Let n(l) = 5l - 4 - 1 + 5l - 12l. Calculate mg(d) - 3n(d). d Let i(o) be the third derivative of o6/60 + o5/30 - o4/8 - o3/3 + 17o2. Let x(l) = -6l*3 - 7l*2 + 10l + 7. Determine 7i(k) + 2x(k). 2k3 - k Let i(s) = -2s + 5 - 5 + 3s + 1. Let w(l) = -l - 1. Calculate 6i(t) + 5w(t). t + 1 Let f(k) = 15k - 15. Let c(z) = 7z - 7. Determine -13c(v) + 6f(v). -v + 1 Let p(d) = -d2 + d. Let n(s) = 4s*2 - 6s + 3. Let a be (-6 - -5)/(2/(-12)). Determine ap(h) + n(h). -2h*2 + 3 Let b(q) = 12q + 9. Let p(c) = -8c - 6. Let x(g) = 5b(g) + 7p(g). Let o(v) = 7v + 5. Let f = 19 + -16. Give fo(i) - 5x(i). i Let f(k) = 18k2 - 5k - 5. Let b(z) = -19z2 + 6z + 6. What is -5b(c) - 6f(c)? -13c2 Let d(i) = 2i*2 - 3i. Let q(g) = -3g2 + 5g. What is 5d(j) + 3q(j)? j2 Let x(v) = v2 - v - 4. Let k(b) = -4. Let r(c) = 3. Let j(i) = 2k(i) + 3r(i). What is -3j(z) - x(z)? -z2 + z + 1 Let j(l) = -88l*3 - 2l*2 - 2l. Let c(g) = -89g3 - 3g*2 - 3g. What is -2c(q) + 3j(q)? -86q3 Let d(b) = -2b*3 + 3b*2 + 2b - 1. Let h(y) = -4y3 + 7y*2 + 5y - 2. What is 5d(r) - 2h(r)? -2r3 + r2 - 1 Let c(k) = -5k*3 + 4k*2 + 3k. Let p(i) = -i*2 - i + 9i3 - i3 - 7i3. Give -c(t) - 4p(t). t3 + t Let h(l) = 1. Let r(i) = i3 + 1. What is 3h(q) - r(q)? -q3 + 2 Let m(k) = -8. Let y(c) = c + 1. Calculate m(t) + 10y(t). 10t + 2 Let c(p) = 9p*2 + 6p - 6. Let z(k) = 42k2 - 1 - 23k*2 - 18k*2 + k. Calculate -c(v) + 6z(v). -3v2 Let w(b) = b + 1. Let z(q) = -2q*2 - 3q - 2. Let a(u) = 9u - 77. Let s be a(9). Give sw(x) + 2z(x). -4x*2 - 2x Let u(b) = -b*2 - b + 1. Let k(n) = -2n*2 - 5n + 9. Give k(c) - 4u(c). 2c*2 - c + 5 Let v = -42 - -35. Let u(w) = -14w + 7. Let a(j) = 29j - 15. Let i(g) = -3a(g) - 7u(g). Let h(t) = -6t + 2. Give vh(k) - 4i(k). -2k + 2 Let t = 11 + -9. Let n(o) = 4o*2 + 13o*t + 4o*3 - 6o2 + 6 + 9. Let i(d) = -4 - 3 + 3 - d3 - 3d2. Give 22i(p) + 6n(p). 2p*3 + 2 Let r(z) = 2z*2 + 5z - 2. Suppose 3g = 4g - 6. Let d(x) = -2x2 - 6x + 3. Give gr(c) + 5d(c). 2c2 + 3 Let h(f) = -5f*3 - 3. Let y(z) = -4z*3 - 2. What is -4h(c) + 6y(c)? -4c*3 Let q(i) = 7i + 14. Let x(l) = -20l - 41. Give -17q(z) - 6x(z). z + 8 Let j(w) = -962w - 221. Let k(h) = 13h + 3. Calculate -6j(v) - 442k(v). 26v Let l(d) = -4d - 7. Let h(u) = -3u - 6. What is -3h(j) + 2l(j)? j + 4 Let c(r) = -27r3 - 4r*2 - 6r - 2. Let u(l) = -26l3 - 5l*2 - 7l - 3. Calculate -5c(k) + 4u(k). 31k3 + 2k - 2 Let g(h) = 17h2 - 5. Let c(q) = -324q*2 + 96. What is 5c(z) + 96g(z)? 12z2 Let g(w) = w + 1. Let q(u) = u3 - 5u2 - 6u + 20. Let s be q(5). Let l(j) = 2j2 + 5j + 6. Calculate sg(d) + 2l(d). 4d2 + 2 Let d = -21 - -15. Let w(b) = 9b*2 - 2. Let f(g) = -5g*2 + 1. Calculate dw(z) - 11f(z). z2 + 1 Let l(q) = -1. Let f = -14 + 16. Let m(b) = -b + 1. Let x be m(f). Let c(g) = 2g + 5. Determine xc(j) - 4l(j). -2j - 1 Let f(b) be the third derivative of -b5/10 + b4/4 - 3b*3/2 + 10b*2. Let y(q) = 7q*2 - 7q + 10. What is -5f(x) - 4y(x)? 2x2 - 2x + 5 Let y(b) be the third derivative of b5/60 - b4/24 - 2b2. Let n(q) = -2q*2 + 4q + 1. Determine n(m) + 4y(m). 2m*2 + 1 Suppose 3m + 3g = -0m - 18, 3m = 2g - 13. Let c(o) = 5o3 - 4o*2 + 4o - 2. Let k(b) = 6b3 - 5b*2 + 5b - 3. Determine mc(s) + 4k(s). -s*3 - 2 Let d(y) = -y + 1. Let u(g) = -4g3 + g2 - 6g + 6. What is 6d(m) - u(m)? 4m3 - m2 Let t(h) = h2 - 1. Let q(k) = 16k*2 + 2k - 12. Let o(n) = -q(n) + 12t(n). Let v(w) = 5w*2 + 3w. Give -6o(l) - 5v(l). -l*2 - 3l Suppose -2b + 5 = -3. Let i(z) = -z2 - z - 6 + 3 + b. Let t(g) = 2g*2 + 6g - 3g + 0g - 3. Calculate -3i(u) - t(u). u2 Let c(t) = 3t*3 + 3t + 4. Let o(q) = q - 8. Let z be o(4). Let j(v) = 4v3 + 3v + 5. Give zj(f) + 5c(f). -f*3 + 3f Let t(b) = 21b + 7. Let n(p) = -14p - 5. Give -7n(q) - 5t(q). -7q Let q(t) = 78t*3 - 5t*2 + 5t - 5. Let h(d) = 1833d3 - 117d*2 + 117d - 117. Determine 5h(u) - 117q(u). 39u3 Let i(z) = 2z*2 + 2z - 1. Suppose -b - 5r + 15 = 0, -3r + 10 = -2. Let y(n) = -4n2 - 5n + 3. What is bi(k) - 2y(k)? -2k2 - 1 Suppose -6a - 5 = -a. Let w(z) = z - 15. Let d = 20 - 11. Let j be w(d). Let s(m) = m*3 - 1. Let u(p) = -7p*3 + 6. Determine au(f) + js(f). f3 Let t(g) = g3 - g2 + g + 1. Let r(k) = -2k*2 + 4k + 4. Let m be ((-6)/12)/(3/(-12)). What is mt(i) - r(i)? 2i*3 - 2i - 2 Let h(b) = 10b2 + 9b - 9. Let d(f) = f*2 + f - 1. Let o be 16/1015/6. Let t be o/(-3)(-18)/(-12). Calculate th(i) + 18d(i). -2i2 Let a(r) be the first derivative of -r4/2 - 2r2 + 3r - 2. Let w(j) = -5j3 - 11j + 8. Let v = -5 + 8. Give vw(x) - 8a(x). x*3 - x Suppose -j = 4j + 10. Let y(v) = -4v - 4v - 6 + 3v. Let u(x) = -3x + 1. Let q(w) = -4w + 2. Let l(s) = -2q(s) + 3u(s). Calculate jy(n) + 11l(n). -n + 1 Let q(u) = 2u*2 + 5u - 13. Let k(m) = m*2 + 2m - 6. Let z(w) = 0w - 4w - 4w + 7w - 1. Let f be z(-1). Let h = f + 9. Calculate hk(c) - 4q(c). c*2 - 2c - 2 Let p(j) = j*2 + 1. Let y(u) = -4u*2 - 5. Let z be ((-15)/(-2))/(7/42). Let d be z/(-6)(-6)/9. Give dp(l) + y(l). l2 Let o(g) = 8g*2 + 17g - 17. Suppose -6b - 6 - 30 = 0. Let s(n) = -3n*2 - 6n + 6. Give bo(i) - 17s(i). 3i2 Let u(l) = 16l*2 + 7. Let g(r) = 5r*2 + 2. Let d be (-5 - -3)/(6/21). Determine dg(t) + 2u(t). -3t2 Let g(m) = m - 1. Let k(y) be the second derivative of -y5/120 + y*4/3 + 3y. Let u(r) be the third derivative of k(r). What is -g(f) + u(f)? -f Let r(k) = 5k + 40. Let l(d) = 4d + 41. Calculate 6l(q) - 5r(q). -q + 46 Let w(s) be the third derivative of s5/30 - s4/6 + s*3/3 - 10s*2. Let d(r) = -2r*2 + 3r - 1. Suppose -2 - 10 = -4o. What is ow(y) + 4d(y)? -2y*2 + 2 Let o(x) = -4x*3 + 2x - 6. Let l(c) = -c + 6. Let j be l(9). Let v be ((-1)/(-2))/(j/(-36)). Let a(m) = 5m3 - 2m + 7. Calculate vo(f) + 5a(f). f*3 + 2f - 1 Let k(u) = -u*2 + u. Let i(j) = 3 - 24j*2 + j + 26j*2 - 3. Determine i(l) - 2k(l). 4l2 - l Let k be 3/(-12)14(2 - 4). Let f(l) = 7l*3 + 3l*2 - 3l*2 + 6. Let o(w) = 8w*3 + 7. Calculate kf(h) - 6o(h). h3 Let v(c) = 17c*2 - 4c - 4. Let r(g) = -g - 1. Give 4r(d) - v(d). -17d*2 Let n(s) = 5s + 8. Let t(y) = 4y + 9. Calculate 7n(w) - 6t(w). 11w + 2 Let h(z) be the second derivative of z3/2 - z2/2 + 14z. Let b(n) = n - 1. Calculate -2b(m) + h(m). m + 1 Let u(j) = -j*2 - 4j - 5. Suppose -2a = 5k - 30, 6k + 5 = 5a + k. Let v(w) = 13w2 - 28w*2 - 1 + 2w + 4 + 16w2. Calculate av(q) + 3u(q). 2q*2 - 2q Suppose 0 = -3i + 5i - 20. Suppose i = -3j + j. Let h(m) = -4m*3 + 4m*2 + 3m. Let u(x) = 7x3 - 7x*2 - 5x. Determine jh(b) - 3u(b). -b3 + b2 Let q(k) = -2k - 10. Let p(f) = 10f + 51. Determine -2p(r) - 11q(r). 2r + 8 Let o(s) = -s + 5. Suppose 2y + 2u + 4 = 0, -5u = -3y - 12 + 14. Let t(g) = 1. Let n be 2/6 + (-14)/(-3). Give nt(b) + yo(b). b Let c(o) = -3o*2 - 2o - 4. Let l(y) = -y*2 + 1. Calculate -c(t) - 2l(t). 5t2 + 2t + 2 Let n(v) = v + 1. Let j(x) = 0x - 7x + 0 + x - 3. Calculate j(d) + 3n(d). -3d Let u(h) = -h2 + h - 1. Let p(j) = -j2 + j - 2. Let v(s) = 2p(s) - 3u(s). Let r(q) = 4 + 2q2 - 1 - 6q2 + q3 + 2q. Calculate r(t) + 4v(t). t*3 - 2t - 1 Let v be (0 - (-3	{ "pile_set_name": "DM Mathematics" }
in milliseconds? 120 Convert 12.43336s to milliseconds. 12433.36 What is 25/2 of a decade in months? 1500 How many nanometers are there in 710.8092um? 710809.2 Convert 3177.53 centuries to decades. 31775.3 Convert 88.16435 years to millennia. 0.08816435 What is 590.53001 days in weeks? 84.36143 What is 3/8 of a litre in millilitres? 375 What is 21/2 of a milligram in micrograms? 10500 What is 3.80723 days in minutes? 5482.4112 How many micrometers are there in 7/4 of a centimeter? 17500 How many minutes are there in twenty-five quarters of a week? 63000 Convert 49.1227254s to weeks. 0.0000812214375 How many grams are there in 3814.44 micrograms? 0.00381444 Convert 725851.2 years to months. 8710214.4 Convert 1.557796 kilograms to milligrams. 1557796 What is 43376.23 litres in millilitres? 43376230 What is fourty-five halves of a week in hours? 3780 How many millilitres are there in 4337.83l? 4337830 How many nanometers are there in seven eighths of a micrometer? 875 What is 13/8 of a litre in millilitres? 1625 What is 641.0863 years in centuries? 6.410863 What is 1923.0687 months in years? 160.255725 How many litres are there in 458.8834 millilitres? 0.4588834 How many millilitres are there in 1/4 of a litre? 250 How many millilitres are there in 5/4 of a litre? 1250 What is 0.4441067g in kilograms? 0.0004441067 What is 0.907002 tonnes in grams? 907002 How many seconds are there in 5697.64 weeks? 3445932672 What is one sixteenth of a millennium in months? 750 Convert 509.1184mm to micrometers. 509118.4 Convert 0.8089755 weeks to seconds. 489268.3824 How many hours are there in 34.84827 microseconds? 0.000000009680075 How many millilitres are there in 1/4 of a litre? 250 How many meters are there in one twentieth of a kilometer? 50 What is 11/8 of a millimeter in micrometers? 1375 How many minutes are there in 0.2242799 weeks? 2260.741392 What is 21.30641um in kilometers? 0.00000002130641 How many millimeters are there in 1/5 of a meter? 200 What is 49/5 of a micrometer in nanometers? 9800 Convert 9551.112 months to decades. 79.5926 Convert 465774.9 decades to millennia. 4657.749 How many kilograms are there in 475697.5 milligrams? 0.4756975 What is 21/2 of a litre in millilitres? 10500 What is 26/7 of a week in minutes? 37440 Convert 8.256292 weeks to minutes. 83223.42336 What is 82655.5 microseconds in milliseconds? 82.6555 Convert 6532.895ml to litres. 6.532895 What is 7/4 of a meter in millimeters? 1750 What is seventeen halves of a kilometer in meters? 8500 How many nanograms are there in nineteen quarters of a microgram? 4750 What is 2019.247 millimeters in nanometers? 2019247000 What is 3/25 of a centimeter in micrometers? 1200 What is 81/4 of a day in hours? 486 What is 657.6833l in millilitres? 657683.3 How many minutes are there in 6.916652 hours? 414.99912 How many millilitres are there in 17/2 of a litre? 8500 Convert 471.0242 centuries to years. 47102.42 How many meters are there in 29/5 of a kilometer? 5800 What is 5719.582 millimeters in centimeters? 571.9582 How many years are there in 13/4 of a millennium? 3250 Convert 7.775136 kilograms to milligrams. 7775136 What is 1/20 of a kilogram in grams? 50 How many hours are there in 11540.655ns? 0.0000000032057375 Convert 5460.03 litres to millilitres. 5460030 Convert 4281.523m to millimeters. 4281523 What is 8584.3 years in centuries? 85.843 How many micrometers are there in seventeen halves of a centimeter? 85000 How many millilitres are there in 13/5 of a litre? 2600 How many centimeters are there in twenty-one halves of a meter? 1050 How many kilograms are there in 0.337809 milligrams? 0.000000337809 What is 749625.408us in weeks? 0.00000123946 What is three eighths of a litre in millilitres? 375 How many decades are there in 0.962021 centuries? 9.62021 What is 0.9133621 weeks in minutes? 9206.689968 What is fifty-seven fifths of a century in months? 13680 How many millilitres are there in 92481.58l? 92481580 Convert 678671.3 microseconds to seconds. 0.6786713 Convert 0.6140492 millimeters to nanometers. 614049.2 How many litres are there in 87263.4ml? 87.2634 How many millilitres are there in 5/4 of a litre? 1250 How many millennia are there in 1826255.1 months? 152.187925 What is 19140.41 millennia in months? 229684920 What is 7/8 of a litre in millilitres? 875 What is 638.8499l in millilitres? 638849.9 What is 5755.7214 seconds in hours? 1.5988115 Convert 8.352463l to millilitres. 8352.463 What is 9/14 of a week in minutes? 6480 What is 3068.78 millennia in centuries? 30687.8 What is 3/5 of a century in years? 60 How many milliseconds are there in 31/5 of a second? 6200 What is eleven halves of a tonne in kilograms? 5500 How many years are there in 97640.82 months? 8136.735 Convert 9.99792kg to tonnes. 0.00999792 What is 71.56694 nanograms in tonnes? 0.00000000000007156694 What is 3/25 of a day in seconds? 10368 How many milligrams are there in one quarter of a gram? 250 What is 42/5 of a kilogram in grams? 8400 Convert 82.9535 centuries to years. 8295.35 How many millilitres are there in 9354.322l? 9354322 Convert 0.5775003mm to nanometers. 577500.3 What is fourty-eight fifths of a litre in millilitres? 9600 How many millilitres are there in 2/125 of a litre? 16 What is 999157.1 millennia in decades? 99915710 Convert 255.5267 litres to millilitres. 255526.7 What is 18/5 of a decade in months? 432 How many microseconds are there in 18/5 of a millisecond? 3600 Convert 333.2408 micrometers to kilometers. 0.0000003332408 How many microseconds are there in 62.17632 minutes? 3730579200 What is seven eighths of a kilogram in grams? 875 Convert 0.9074935 millimeters to nanometers. 907493.5 Convert 290104.6 microseconds to nanoseconds. 290104600 What is 0.6979787 centuries in years? 69.79787 What is 52608.258ms in hours? 0.014613405 What is 41/2 of a litre in millilitres? 20500 Convert 8.982014um to millimeters. 0.008982014 What is twenty-two ninths of a hour in seconds? 8800 What is three fifths of a gram in milligrams? 600 How many micrometers are there in 0.4136969 centimeters? 4136.969 How many millilitres are there in 0.7705269 litres? 770.5269 How many hours are there in 7/6 of a day? 28 What is 3/25 of a tonne in kilograms? 120 Convert 0.513816 months to millennia. 0.000042818 How many hours are there in 80752.887 milliseconds? 0.0224313575 What is 657229.6cm in nanometers? 6572296000000 What is sixty-seven fifths of a litre in millilitres? 13400 Convert 88539.95 meters to millimeters. 88539950 Convert 20309.67 months to years. 1692.4725 What is 4.057653kg in tonnes? 0.004057653 How many seconds are there in 5/6 of a minute? 50 How many nanograms are there in 839744.7 grams? 839744700000000 What is 18/5 of a milligram in micrograms? 3600 What is 1/10 of a gram in micrograms? 100000 What is 4.446805l in millilitres? 4446.805 Convert 18613.653us to minutes. 0.00031022755 How many nanograms are there in 6.622387 grams? 6622387000 How many milligrams are there in 6/5 of a gram? 1200 How many meters are there in fifty-seven halves of a kilometer? 28500 What is 1.348243 minutes in milliseconds? 80894.58 What is one quarter of a milligram in micrograms? 250 How many tonnes are there in 340204.7ng? 0.0000000003402047 Convert 43184.03ng to tonnes. 0.00000000004318403 Convert 9021.666 millennia to months. 108259992 How many nanograms are there in 3/25 of a microgram? 120 How many months are there in 15/4 of a year? 45 How many millilitres are there in 6/5 of a litre? 1200 What is 19/4 of a litre in millilitres? 4750 What is 1711.308 months in decades? 14.2609 How many millilitres are there in 26.99855l? 26998.55 How many millilitres are there in 47.65212 litres? 47652.12 What is 106.9554 centuries in decades? 1069.554 Convert 799.4222 centuries to millennia. 79.94222 What is nineteen quarters of a litre in millilitres? 4750 Convert 65.06025 nanometers to micrometers. 0.06506025 What is 5/6 of a century in months? 1000 Convert 620216.5 minutes to milliseconds. 37212990000 What is seventeen halves of a kilogram in grams? 8500 Convert 431868.1 milligrams to micrograms. 431868100 What is 0.0519135km in nanometers? 51913500000 What is 22/9 of a week in minutes? 24640 How many centimeters	{ "pile_set_name": "DM Mathematics" }
many minutes are there between 6:06 PM and 11:10 PM? 304 How many minutes are there between 6:09 PM and 1:34 AM? 445 How many minutes are there between 10:31 AM and 1:03 PM? 152 How many minutes are there between 10:02 PM and 10:37 PM? 35 How many minutes are there between 3:45 AM and 5:32 AM? 107 What is 689 minutes after 6:30 AM? 5:59 PM What is 400 minutes after 9:22 AM? 4:02 PM How many minutes are there between 6:24 AM and 2:16 PM? 472 How many minutes are there between 4:46 AM and 7:08 AM? 142 What is 611 minutes after 2:11 AM? 12:22 PM What is 293 minutes before 6:19 PM? 1:26 PM How many minutes are there between 3:37 AM and 8:59 AM? 322 What is 52 minutes after 12:13 PM? 1:05 PM How many minutes are there between 4:28 AM and 9:52 AM? 324 What is 408 minutes before 2:57 PM? 8:09 AM How many minutes are there between 9:21 AM and 5:34 PM? 493 What is 170 minutes before 11:36 AM? 8:46 AM What is 501 minutes before 1:28 PM? 5:07 AM How many minutes are there between 2:25 PM and 4:41 PM? 136 What is 240 minutes before 1:55 AM? 9:55 PM How many minutes are there between 4:17 AM and 12:25 PM? 488 How many minutes are there between 10:59 PM and 7:01 AM? 482 How many minutes are there between 8:57 PM and 8:51 AM? 714 What is 249 minutes after 12:55 AM? 5:04 AM How many minutes are there between 10:14 AM and 7:06 PM? 532 What is 197 minutes after 10:52 AM? 2:09 PM How many minutes are there between 6:08 AM and 5:29 PM? 681 How many minutes are there between 10:18 AM and 3:21 PM? 303 What is 462 minutes after 1:51 AM? 9:33 AM How many minutes are there between 5:17 AM and 1:18 PM? 481 What is 587 minutes before 10:46 AM? 12:59 AM What is 430 minutes after 12:28 PM? 7:38 PM What is 170 minutes after 2:57 AM? 5:47 AM How many minutes are there between 5:30 AM and 11:07 AM? 337 How many minutes are there between 12:03 PM and 8:08 PM? 485 How many minutes are there between 4:05 AM and 6:15 AM? 130 What is 454 minutes after 5:25 AM? 12:59 PM What is 420 minutes before 1:09 PM? 6:09 AM What is 318 minutes before 1:34 AM? 8:16 PM How many minutes are there between 12:25 AM and 6:41 AM? 376 What is 176 minutes after 6:21 PM? 9:17 PM What is 485 minutes before 4:52 PM? 8:47 AM How many minutes are there between 3:15 AM and 8:13 AM? 298 What is 367 minutes after 12:26 PM? 6:33 PM How many minutes are there between 6:54 PM and 3:44 AM? 530 What is 315 minutes before 11:52 PM? 6:37 PM How many minutes are there between 5:38 PM and 11:54 PM? 376 What is 184 minutes after 12:54 AM? 3:58 AM What is 274 minutes before 3:19 PM? 10:45 AM What is 173 minutes after 12:20 AM? 3:13 AM How many minutes are there between 11:46 AM and 9:42 PM? 596 What is 700 minutes after 9:08 AM? 8:48 PM How many minutes are there between 9:59 AM and 4:57 PM? 418 How many minutes are there between 4:20 AM and 10:31 AM? 371 How many minutes are there between 6:30 AM and 6:18 PM? 708 What is 691 minutes before 2:30 AM? 2:59 PM What is 102 minutes before 5:14 AM? 3:32 AM How many minutes are there between 7:28 AM and 8:58 AM? 90 How many minutes are there between 9:25 PM and 6:37 AM? 552 How many minutes are there between 1:45 AM and 10:35 AM? 530 What is 559 minutes after 4:49 AM? 2:08 PM How many minutes are there between 3:32 AM and 11:05 AM? 453 What is 423 minutes after 7:26 PM? 2:29 AM What is 414 minutes before 2:49 PM? 7:55 AM What is 298 minutes before 3:52 PM? 10:54 AM How many minutes are there between 3:43 AM and 6:33 AM? 170 How many minutes are there between 1:31 PM and 4:53 PM? 202 What is 305 minutes before 10:42 PM? 5:37 PM How many minutes are there between 9:13 AM and 4:46 PM? 453 What is 323 minutes after 10:39 AM? 4:02 PM What is 424 minutes after 11:28 PM? 6:32 AM What is 398 minutes before 7:02 AM? 12:24 AM How many minutes are there between 1:23 AM and 11:57 AM? 634 How many minutes are there between 10:26 AM and 3:47 PM? 321 How many minutes are there between 11:11 AM and 12:02 PM? 51 How many minutes are there between 2:05 AM and 8:51 AM? 406 How many minutes are there between 3:46 AM and 5:33 AM? 107 What is 323 minutes before 11:54 PM? 6:31 PM How many minutes are there between 6:13 AM and 12:55 PM? 402 How many minutes are there between 2:30 AM and 4:02 AM? 92 How many minutes are there between 12:39 PM and 10:24 PM? 585 What is 552 minutes before 1:11 AM? 3:59 PM What is 578 minutes after 8:46 AM? 6:24 PM How many minutes are there between 10:58 AM and 12:42 PM? 104 How many minutes are there between 3:45 PM and 2:49 AM? 664 What is 430 minutes before 7:51 AM? 12:41 AM How many minutes are there between 8:34 AM and 10:15 AM? 101 How many minutes are there between 11:32 PM and 7:11 AM? 459 How many minutes are there between 10:58 PM and 10:35 AM? 697 How many minutes are there between 6:26 PM and 6:51 PM? 25 How many minutes are there between 5:12 PM and 6:59 PM? 107 What is 681 minutes after 9:43 AM? 9:04 PM What is 92 minutes before 6:54 AM? 5:22 AM What is 332 minutes before 3:27 AM? 9:55 PM What is 117 minutes before 6:10 PM? 4:13 PM What is 130 minutes before 11:27 AM? 9:17 AM What is 457 minutes before 7:32 AM? 11:55 PM What is 467 minutes before 1:55 PM? 6:08 AM What is 91 minutes before 3:20 PM? 1:49 PM How many minutes are there between 11:21 PM and 1:46 AM? 145 What is 623 minutes before 12:15 AM? 1:52 PM How many minutes are there between 6:26 PM and 8:32 PM? 126 What is 578 minutes before 7:12 AM? 9:34 PM What is 488 minutes before 10:09 AM? 2:01 AM What is 693 minutes after 4:07 AM? 3:40 PM What is 693 minutes before 9:47 PM? 10:14 AM How many minutes are there between 5:38 PM and 9:15 PM? 217 What is 40 minutes before 7:43 PM? 7:03 PM How many minutes are there between 6:22 AM and 5:06 PM? 644 What is 345 minutes after 3:56 AM? 9:41 AM How many minutes are there between 5:14 PM and 5:02 AM? 708 What is 96 minutes after 9:34 PM? 11:10 PM What is 503 minutes after 11:11 AM? 7:34 PM What is 141 minutes before 2:57 PM? 12:36 PM How many minutes are there between 2:30 AM and 9:53 AM? 443 What is 320 minutes after 11:26 PM? 4:46 AM How many minutes are there between 4:46 PM and 4:08 AM? 682 How many minutes are there between 12:21 PM and 4:21 PM? 240 How many minutes are there between 1:37 AM and 4:13 AM? 156 How many minutes are there between 7:23 PM and 10:10 PM? 167 What is 41 minutes after 7:55 AM? 8:36 AM What is 682 minutes after 2:28 AM? 1:50 PM How many minutes are there between 2:14 AM and 7:00 AM? 286 What is 687 minutes before 2:31 AM? 3:04 PM How many minutes are there between 12:52 AM and 2:35 AM? 103 What is 624 minutes after 1:12 PM? 11:36 PM What is 445 minutes before 10:42 AM? 3:17 AM How many minutes are there between 2:50 AM and 4:07 AM? 77 What is 236 minutes before 11:26 AM? 7:30 AM How many minutes are there between 5:54 AM and 11:03 AM? 309 How many minutes are there between 8:38 AM and 12:15 PM? 217 What is 325 minutes before 6:48 PM? 1:23 PM What is 553 minutes after 12:36 AM? 9:49 AM What is 639 minutes after 9:00 PM? 7:39 AM How many minutes are there between 8:51 AM and 9:02 AM? 11 What is 692 minutes before 11:49 AM? 12:17 AM How many minutes are there between 9:47 AM and 5:29 PM? 462 How many minutes are there between 6:01 AM and 1:27 PM? 446 How many minutes are there between 3:29 PM and 11:52 PM? 503 How many minutes are there between 12:27 PM and 9:13 PM? 526 How many minutes are there between 11:47 AM and 11:33 PM? 706 What is 678 minutes after 2:09 PM? 1:27 AM How many minutes are there between 1:42 AM and 12:05 PM? 623 What is 90 minutes after 2:25 AM? 3:55 AM What is 572 minutes before 9:08 PM? 11:36 AM What is 310 minutes after 12:27 AM? 5:37 AM What is 680 minutes before 2:21 AM? 3:01 PM How many minutes are there between 7:26 PM and 3:18 AM? 472 What is 128 minutes before 2:28 AM? 12:20 AM What is 543 minutes after 2:35 PM? 11:38 PM What is 25 minutes before 9:28 AM? 9:03 AM What is 203 minutes before 2:56 AM? 11:33 PM What is 255 minutes before 1:27 PM? 9:12 AM How many minutes are there between 11:40 AM and 6:21 PM? 401 What is 634 minutes after 6:07 AM? 4:41 PM What is 153 minutes after 12:10 AM? 2:43 AM How many minutes are there between 12:15 AM and 11:37 AM? 682 What is 120 minutes before 6:35 PM? 4:35	{ "pile_set_name": "DM Mathematics" }
r 12:08 PM? 5:06 PM What is 507 minutes before 7:10 AM? 10:43 PM What is 123 minutes after 12:41 PM? 2:44 PM How many minutes are there between 6:28 PM and 3:37 AM? 549 What is 141 minutes after 9:15 AM? 11:36 AM How many minutes are there between 2:09 PM and 11:22 PM? 553 How many minutes are there between 7:54 AM and 4:07 PM? 493 How many minutes are there between 5:48 PM and 4:29 AM? 641 How many minutes are there between 9:36 AM and 12:12 PM? 156 What is 175 minutes before 4:49 AM? 1:54 AM What is 588 minutes after 8:16 AM? 6:04 PM How many minutes are there between 3:32 PM and 3:59 PM? 27 What is 418 minutes before 11:36 AM? 4:38 AM What is 52 minutes before 3:02 PM? 2:10 PM What is 610 minutes after 1:27 PM? 11:37 PM What is 535 minutes before 7:12 AM? 10:17 PM What is 366 minutes after 5:07 PM? 11:13 PM How many minutes are there between 4:27 PM and 3:44 AM? 677 What is 104 minutes after 7:48 PM? 9:32 PM What is 388 minutes before 5:41 PM? 11:13 AM What is 98 minutes before 10:56 PM? 9:18 PM How many minutes are there between 4:54 PM and 4:27 AM? 693 What is 595 minutes before 1:24 PM? 3:29 AM How many minutes are there between 6:31 PM and 9:05 PM? 154 How many minutes are there between 10:32 PM and 6:48 AM? 496 What is 176 minutes after 9:26 PM? 12:22 AM What is 373 minutes before 4:15 AM? 10:02 PM How many minutes are there between 1:58 PM and 10:57 PM? 539 What is 171 minutes before 9:25 AM? 6:34 AM What is 25 minutes before 4:20 PM? 3:55 PM How many minutes are there between 2:36 AM and 11:56 AM? 560 What is 597 minutes after 7:24 AM? 5:21 PM How many minutes are there between 8:49 AM and 8:29 PM? 700 How many minutes are there between 8:48 PM and 6:39 AM? 591 What is 115 minutes after 4:51 PM? 6:46 PM What is 400 minutes after 9:21 AM? 4:01 PM What is 175 minutes after 2:38 AM? 5:33 AM What is 104 minutes before 2:16 PM? 12:32 PM What is 148 minutes before 6:23 AM? 3:55 AM How many minutes are there between 7:26 PM and 5:36 AM? 610 What is 156 minutes after 7:43 AM? 10:19 AM What is 149 minutes after 5:00 AM? 7:29 AM How many minutes are there between 1:27 AM and 7:04 AM? 337 What is 507 minutes before 11:09 AM? 2:42 AM What is 687 minutes before 4:14 PM? 4:47 AM How many minutes are there between 4:50 PM and 9:52 PM? 302 What is 235 minutes before 11:25 PM? 7:30 PM What is 676 minutes after 11:52 AM? 11:08 PM What is 439 minutes after 10:16 AM? 5:35 PM How many minutes are there between 4:35 PM and 2:30 AM? 595 How many minutes are there between 10:55 PM and 7:08 AM? 493 How many minutes are there between 4:00 AM and 11:54 AM? 474 What is 462 minutes after 2:53 PM? 10:35 PM How many minutes are there between 9:03 AM and 9:14 AM? 11 How many minutes are there between 3:24 AM and 7:49 AM? 265 What is 665 minutes before 3:49 AM? 4:44 PM How many minutes are there between 4:48 PM and 9:40 PM? 292 How many minutes are there between 9:38 PM and 12:49 AM? 191 How many minutes are there between 11:26 PM and 4:15 AM? 289 What is 264 minutes after 8:52 AM? 1:16 PM How many minutes are there between 1:20 PM and 1:08 AM? 708 What is 156 minutes after 8:28 PM? 11:04 PM How many minutes are there between 3:27 AM and 9:34 AM? 367 What is 647 minutes before 9:39 AM? 10:52 PM What is 631 minutes before 9:16 PM? 10:45 AM How many minutes are there between 6:06 AM and 10:12 AM? 246 What is 624 minutes after 2:42 AM? 1:06 PM What is 63 minutes after 7:12 AM? 8:15 AM How many minutes are there between 5:26 PM and 7:04 PM? 98 How many minutes are there between 3:59 PM and 4:11 PM? 12 What is 166 minutes after 5:59 AM? 8:45 AM What is 250 minutes before 4:52 PM? 12:42 PM What is 4 minutes before 11:44 PM? 11:40 PM What is 468 minutes after 6:33 PM? 2:21 AM What is 144 minutes before 7:51 AM? 5:27 AM How many minutes are there between 1:31 AM and 1:21 PM? 710 What is 167 minutes after 8:59 AM? 11:46 AM What is 89 minutes before 6:40 PM? 5:11 PM What is 298 minutes after 2:05 PM? 7:03 PM What is 423 minutes before 5:56 PM? 10:53 AM What is 647 minutes after 3:19 PM? 2:06 AM What is 543 minutes after 2:35 AM? 11:38 AM What is 110 minutes after 6:51 AM? 8:41 AM How many minutes are there between 9:03 PM and 3:29 AM? 386 What is 328 minutes before 7:59 AM? 2:31 AM How many minutes are there between 9:09 AM and 2:30 PM? 321 What is 616 minutes after 9:34 PM? 7:50 AM How many minutes are there between 4:16 PM and 11:17 PM? 421 How many minutes are there between 1:47 PM and 6:47 PM? 300 What is 255 minutes before 1:19 PM? 9:04 AM How many minutes are there between 12:29 PM and 7:17 PM? 408 What is 474 minutes after 6:34 AM? 2:28 PM How many minutes are there between 3:09 AM and 2:56 PM? 707 How many minutes are there between 9:40 PM and 9:34 AM? 714 How many minutes are there between 11:31 PM and 3:35 AM? 244 What is 482 minutes before 4:47 PM? 8:45 AM How many minutes are there between 3:23 PM and 9:07 PM? 344 How many minutes are there between 2:58 PM and 6:09 PM? 191 What is 692 minutes after 7:53 PM? 7:25 AM How many minutes are there between 2:24 PM and 10:24 PM? 480 What is 678 minutes before 5:46 PM? 6:28 AM How many minutes are there between 3:28 AM and 11:36 AM? 488 How many minutes are there between 1:03 PM and 7:43 PM? 400 How many minutes are there between 6:59 PM and 7:52 PM? 53 How many minutes are there between 9:42 PM and 8:12 AM? 630 What is 552 minutes before 6:00 AM? 8:48 PM What is 586 minutes after 10:10 PM? 7:56 AM How many minutes are there between 11:37 AM and 1:54 PM? 137 What is 644 minutes after 6:06 AM? 4:50 PM How many minutes are there between 2:42 AM and 1:28 PM? 646 How many minutes are there between 8:51 PM and 4:27 AM? 456 How many minutes are there between 4:00 AM and 11:53 AM? 473 What is 270 minutes after 10:32 AM? 3:02 PM What is 318 minutes after 12:46 AM? 6:04 AM What is 137 minutes after 2:19 AM? 4:36 AM How many minutes are there between 12:48 AM and 11:12 AM? 624 What is 51 minutes before 10:48 AM? 9:57 AM How many minutes are there between 5:21 AM and 9:35 AM? 254 How many minutes are there between 9:35 AM and 11:57 AM? 142 How many minutes are there between 8:50 PM and 3:49 AM? 419 How many minutes are there between 11:06 PM and 11:48 PM? 42 How many minutes are there between 6:30 AM and 3:25 PM? 535 What is 693 minutes before 12:01 AM? 12:28 PM How many minutes are there between 10:39 AM and 10:29 PM? 710 What is 408 minutes before 11:22 PM? 4:34 PM What is 102 minutes after 7:25 PM? 9:07 PM What is 360 minutes after 7:14 AM? 1:14 PM How many minutes are there between 1:08 PM and 8:18 PM? 430 What is 59 minutes before 8:23 PM? 7:24 PM What is 12 minutes before 1:12 AM? 1:00 AM How many minutes are there between 9:43 AM and 7:15 PM? 572 How many minutes are there between 1:13 AM and 6:58 AM? 345 What is 699 minutes after 2:53 AM? 2:32 PM What is 11 minutes after 10:26 AM? 10:37 AM How many minutes are there between 12:29 AM and 2:51 AM? 142 How many minutes are there between 11:04 AM and 12:41 PM? 97 What is 117 minutes after 1:59 PM? 3:56 PM What is 321 minutes after 7:26 PM? 12:47 AM What is 661 minutes after 11:50 PM? 10:51 AM How many minutes are there between 7:13 PM and 8:05 PM? 52 How many minutes are there between 11:32 PM and 11:02 AM? 690 What is 652 minutes before 1:02 AM? 2:10 PM What is 170 minutes before 6:05 PM? 3:15 PM What is 652 minutes before 12:27 AM? 1:35 PM How many minutes are there between 1:15 AM and 12:18 PM? 663 How many minutes are there between 3:17 AM and 4:28 AM? 71 What is 419 minutes before 8:27 AM? 1:28 AM How many minutes are there between 9:48 PM and 7:12 AM? 564 How many minutes are there between 2:01 AM and 9:38 AM? 457 What is 682 minutes after 3:05 PM? 2:27 AM What is 573 minutes after 7:22 AM? 4:55 PM How many minutes are there between 7:17 AM and 11:00 AM? 223 What is 535 minutes before 10:52 PM? 1:57 PM What is 42 minutes before 11:08 AM? 10:26 AM What is 699 minutes before 5:09 AM? 5:30 PM How many minutes are there between 1:38 PM and 10:30 PM? 532 How many minutes are there between 7:10 AM and 10:00 AM? 170 How many minutes are there between 12:55 PM and 12:41 AM? 706 How many minutes are there between 11:50 AM and 6:32 PM? 402 What is 491 minutes before 4:12 AM? 8:0	{ "pile_set_name": "DM Mathematics" }
qq))(3/11) assuming q is positive. q(138/11) Simplify (l(-5)(l*(-1/5)/l)/lll(-1/11)l(3/2))(-2/27) assuming l is positive. l(527/1485) Simplify ((((k/k(-2))/k)(40/3))6)18 assuming k is positive. k2880 Simplify ((hh(((h/h*8)/h)/h)/hh)/(hh(2/7)))/(h(3/4))(-3/19) assuming h is positive. h(-4345/532) Simplify i(2/13)/(iii/i14)(i/(i*(-8)/i)ii)/(i(-5)/i) assuming i is positive. i(379/13) Simplify ((r(-4))(-31))(13/4) assuming r is positive. r403 Simplify ((pp(-1))(1/15))*(-3/5) assuming p is positive. 1 Simplify ((jj*(-1)jj)/(jj*(-9/2)/jj)(j(-3)/j)25)(-28) assuming j is positive. j2646 Simplify ((c(-1))(-4/25)/(c(-13)/(cc5)))8 assuming c is positive. c(3832/25) Simplify ((y/(y(-15)/y))/y)/y*25(y/(yy/y(1/6)))/y(-8) assuming y is positive. y(-11/6) Simplify (r/r(-14))/(r/((r/((r/(r/r(-2/17)))/rr))/r))r19/rrr(11/6) assuming r is positive. r(3565/102) Simplify (k(1/8)kk8k*2/((kk*(-3)k)/k))(2/63) assuming k is positive. k(5/12) Simplify h(-7)/(h/(h(-4)h)h)(h12h)(-23/2) assuming h is positive. h(-323/2) Simplify xx(-8)x*(-28)((xx/(x/((x/(x(2/95)/xx))/x)))/x)/xxxx(2/33)x assuming x is positive. x(-103331/3135) Simplify g/(g/g12)g/(gg*(1/16)g)(g/g(1/7))(-37) assuming g is positive. g(-2327/112) Simplify (x6)(-19)x(1/4)/x(1/15) assuming x is positive. x*(-6829/60) Simplify v/(vv*(-2/11)v)v17v*6v(2/61)/v assuming v is positive. v(14235/671) Simplify (t2)39t(-1/13)/(tttt8) assuming t is positive. t(870/13) Simplify (t*(2/25)ttt*(3/34)t)(21/2) assuming t is positive. t(56553/1700) Simplify (k(-2/11))(-12)((k((k/(k/(k/(k/k*(-2/5)k)k))k)/k)/k)/k)/(k/(k/k(9/2))) assuming k is positive. k(-409/110) Simplify (u*(-1/11)u)*(6/11)u/u*17u(2/33) assuming u is positive. u(-5606/363) Simplify ((v*(-2/3)v)*(-1)v/(((v/(vv(2/11)/vv))/v)/v)v(2/7))(-2/123) assuming v is positive. v(-1448/28413) Simplify (((m/m10)/(m/m(-7)))(-12))(2/73) assuming m is positive. m(408/73) Simplify ((h/(hhhh(5/6)))/h)/(h/h16h)h(-9/7)/h(2/7) assuming h is positive. h(361/42) Simplify (a/((a(-15)/a)/a))2/(a(-15)/a(-16)) assuming a is positive. a35 Simplify ((v0)(-35)/(vvvv(-1/10)vv/v(2/15)))(-41) assuming v is positive. v(5863/30) Simplify ((g/(g/g9))/g)/g16g*2/gg*(-1/9)gg assuming g is positive. g(-46/9) Simplify (((ww/w1)/(w/w(-4)))/(w(2/9))(-2/5))(-3/25) assuming w is positive. w(176/375) Simplify o*17/(oo/o*(1/3))((o*16o)/o)/oo/(o/(o/o(-2/7))) assuming o is positive. o(664/21) Simplify (dd*(3/4))/(d/(dd*(-1/7)dd))d/d*2d1 assuming d is positive. d(101/28) Simplify (((p(2/9))(-15))(2/41))(-47) assuming p is positive. p*(940/123) Simplify hhh15hh15h/(h/h*34)hh(-15) assuming h is positive. h53 Simplify (nn*(2/15)nnn/((nn(16/5)/n)/n)n)/(n*(-8/7)n(-25)) assuming n is positive. n(3053/105) Simplify (k*(-5/4)/kk*(-5)/kk*(-1/9)kk(-3/11))6 assuming k is positive. k(-3023/66) Simplify (h(-13)/h(-2/3))/(h(2/11))(23/5) assuming h is positive. h(-2173/165) Simplify (y6)(-26)/((y/y(-6/7))/(y(y/(y/y4))/y)) assuming y is positive. y(-1077/7) Simplify c*(-2/7)/(((c/((ccc(-11/5)cc)/c))/c)/c)c*8(((cc(-9)c)/c)/c)/c assuming c is positive. c(-17/35) Simplify (b10/b)/b*(-1)(b(-6))(2/11) assuming b is positive. b(98/11) Simplify (y/(y(5/2)/yy)y)/y*4y*(14/5)y(-13) assuming y is positive. y(-147/10) Simplify ((ii/(iiiii(-2/11)))20/(((ii(ii/(i/i(-1/7)))/i)/i)/(i/i0)))(9/5) assuming i is positive. i(-25101/385) Simplify (((zz/(z/z8z))(-42))(-11))32 assuming z is positive. z118272 Simplify (y*(2/5)/(y(y/(y/(yy(-9/8))))/y))/((y(yy(-1/8))/y)/(y/(y/(yy*(2/21)yyy))y)) assuming y is positive. y(1993/420) Simplify (w(-12)w(ww*(-11/3))/w)/(w(ww4)/wwww(-6)) assuming w is positive. w(-47/3) Simplify (n(-2/7))11/(n*13(n*(-3/14)n)/nn) assuming n is positive. n(-237/14) Simplify (((i/(iii23))/i)/i)/(i3i)i0/(i(-18)i) assuming i is positive. i(-13) Simplify i(7/2)/((i/i*1)/ii)(ii(-12))/(i14i) assuming i is positive. i(-45/2) Simplify (q/(q/q(2/3)))(-3)/((qq*13q)/((q/(q/(q/(q/q(1/4)))))/q)) assuming q is positive. q(-71/4) Simplify (w*(-25)w(w/((((ww*27)/w)/ww)/w))/ww)17 assuming w is positive. w(-833) Simplify (w/w5www/(w/(((w/(ww/(w/(ww*(2/43)ww))w))/w)/w)w))/(w(10/3)w(w(1/21)/w)/w) assuming w is positive. w(-10319/903) Simplify (((cc*(2/55))/(cc/(c/(c/c(-9)))))(2/11))(-27) assuming c is positive. c(29592/605) Simplify ((i/i(-1))(9/10)/((ii/(i/(ii*1/i)ii))/i)49)(4/3) assuming i is positive. i(1016/15) Simplify (((mm*26/m)/mm)/(m*(3/8)mm))(21/2) assuming m is positive. m(3969/16) Simplify ((www5w*(-4))/(ww/(wwwww/(w*(2/13)ww)w)w(-4)))(-3/25) assuming w is positive. w(-69/65) Simplify o(-12)/ooo/(oo*(-1/6))(o(2/51))(-4/29) assuming o is positive. o*(-11673/986) Simplify (kkk(-2/11)/kkk)(-35)/(kk2)38 assuming k is positive. k*(-2339/11) Simplify (((kk11/k)/k)/k)(9/7)/(k/k(2/3))(15/4) assuming k is positive. k(289/28) Simplify ((k(-4/3)/k)/k(2/21))/(k/k(-11)((k/(k/k(-2/3)k))/k)/k) assuming k is positive. k*(-226/21) Simplify (k/(kk(k/k(-7/5))/k))(-17)/((((k((k/((kk(-27)kkkk)/k)k)/k)/k)/k)/kk)/(k/k(-7))) assuming k is positive. k(129/5) Simplify t9/t5tt(2/43)/ttt/t(-11) assuming t is positive. t(733/43) Simplify b4/bb/(bb/b(-20)bbb)b(-17)b(16/3) assuming b is positive. b(-98/3) Simplify d/d*(1/3)dd/(dd/((d(d(dd(7/4))/dd)/d)/d))(d(7/5))(-1/29) assuming d is positive. d(5861/1740) Simplify (h/(h(-7/2)/h)h(hh/h*(-3/10))/h)/((h/(hh(2/5)))/h)(-25) assuming h is positive. h*(-136/5) Simplify (uu*(-3/2)uuu)*5((u/(u(4/7)/u))/u)/u(23/2) assuming u is positive. u(10/7) Simplify (h(2/7)(h7/h)/hh)/(h*(-1/7)hh/(h/h(-1/27)hhh)) assuming h is positive. h*(1600/189) Simplify ((pp*8p(-6))/(p(4/5)/p(1/2)))(-3/11) assuming p is positive. p*(-81/110) Simplify (ll(2/5))(-16)(l/l(-1/15)l)/(l*0l) assuming l is positive. l(-64/3) Simplify (i/(i(-2/5)ii)((i7i)/i)/ii)/(i(-1/25)(ii(-14)/iii)/i) assuming i is positive. i(486/25) Simplify ((q/q10)(-15/7))(5/8) assuming q is positive. q(675/56) Simplify ((f(ffff/((f(1/4)/f)/f)ff)/fff)(-1/2)f/(ff(-2/7)/f)f(-1/7))(-30) assuming f is positive. f(3135/28) Simplify (v(-3/10)/(vv(-2/9)v))/(((v(-21)/v)/v)/(v10/v)) assuming v is positive. v*(2693/90) Simplify ((n/(n((nn8)/n)/n))/n(-2/5))/(n(-5/3)/n7) assuming n is positive. n(31/15) Simplify (x/(((xx/x2)/x)/x))16x(-2/51)x(19/3)/x assuming x is positive. x(906/17) Simplify (n(-1/4))(-4/3)/(n*(-1/15)n(2/57)) assuming n is positive. n(104/285) Simplify xx(2/7)x/(x(xx/x*(1/10)x)/xx)x(-1/19)/x(2/31) assuming x is positive. x*(-71387/41230) Simplify y/((yy/y*(-34))/y)y/(yy(-8/9))(yy(-12/11))/yy/y*23y assuming y is positive. y*(-5465/99) Simplify ((ff*(-1))/ff*5f)/(f*4f(-13)) assuming f is positive. f14 Simplify (f(-3))(2/3)/(f0/f)(-5) assuming f is positive. f(-7) Simplify (j(-1/2)/j)(4/5)/(j3)(2/33) assuming j is positive. j(-76/55) Simplify d*(-3/2)d*(-2/7)(d*21d)(3/20) assuming d is positive. d(53/35) Simplify (h(-1/2))(-20/3)(h/h32)/(h(-29)/h) assuming h is positive. h(7/3) Simplify x(6/11)xx(-8/9)xxx(-4/5)/x(-1/16) assuming x is positive. x(15199/7920) Simplify v/v(-11)v(1/6)(v/((v/v*(5/6))/vv))(-3/2) assuming v is positive. v(131/12) Simplify (j/j(-24))/j(1/4)(jj*(-2)jj)/j25 assuming j is positive. j(3/4) Simplify (y(-22)yy/y(-30)y)/(y23/(y/y(3/8))) assuming y is positive. y(-91/8) Simplify ((l(	{ "pile_set_name": "DM Mathematics" }
st to -0.06? (a) 0.09 (b) -2 (c) -2.1 (d) -90 a Which is the nearest to -1? (a) -8/3 (b) -5 (c) -0.1 (d) -3 c Which is the nearest to 0.06? (a) 0.5 (b) 0.3 (c) 0 (d) 5 (e) 12 c Which is the nearest to -1? (a) 35 (b) -1/4 (c) -2/3 c Which is the nearest to -0.07? (a) 0.6 (b) 0.5 (c) -0.5 (d) -21 (e) 1/6 e What is the nearest to 1 in 5, 1, 0.2, -1/16582? 1 What is the nearest to -16 in -1.01, 3, 1/5? -1.01 Which is the nearest to -0.043? (a) -0.6 (b) 5 (c) -5 (d) 8 (e) -0.1 e Which is the closest to -7.73? (a) -4 (b) 1026 (c) -3 a What is the nearest to 1/6 in 1, 2, -1/6, -0.197, -3? -1/6 Which is the closest to -4446? (a) 0 (b) -0.1 (c) 8 (d) -4 d What is the nearest to -3/8 in -3, 0.02, 131? 0.02 Which is the nearest to 0.342? (a) -2/91 (b) -9 (c) 2/17 (d) 2/7 d Which is the closest to -2? (a) -22 (b) 1/3 (c) 1 b What is the closest to 1 in 0.3, -2/3, -31, 7.2? 0.3 Which is the closest to -1/5? (a) 2/5 (b) 944 (c) -12/5 (d) -2/7 (e) 5 d What is the nearest to 0.5 in -6, 0.5, 20/3, 3/5, 22/7? 0.5 What is the closest to -6 in -0.5, 2/9, 1826? -0.5 What is the closest to 0.2 in -7122, -5/2, -5, 1/7? 1/7 What is the nearest to -3 in 5, 2231, 0.5, 0.1? 0.1 Which is the closest to -3/5? (a) 4 (b) 16 (c) 0.078 c What is the closest to 3/32 in 8, 1.01, 2? 1.01 What is the closest to -1 in -5, -1/3, 1206? -1/3 What is the nearest to 2/5 in -2, 15/2, -24.5? -2 What is the nearest to -5 in -51/13, 1/9, 10/13? -51/13 Which is the nearest to -0.1? (a) 10 (b) 75 (c) 2/315 (d) 3 c Which is the closest to 18/17? (a) 69 (b) 6 (c) 5/2 (d) -0.2 d What is the closest to -38 in 1.4, 25/3, -0.1? -0.1 What is the closest to -2/5 in 1, 37, 1/6, 2/27, 0? 0 Which is the nearest to -56? (a) 4 (b) -3.4 (c) 15 (d) -0.5 b What is the closest to 1 in 707.01, 2, 0.1? 0.1 What is the nearest to 1.7 in -0.2, 2, 12/7, 1/4? 12/7 Which is the closest to 2? (a) -7 (b) -3/7 (c) 1/10 (d) 4/5 d Which is the nearest to -1.8? (a) 1/6 (b) 0.3 (c) -331 a Which is the nearest to -9? (a) 57 (b) 5 (c) 1 (d) 2 (e) 2/23 e Which is the nearest to 1? (a) -3 (b) 12 (c) 4/7 (d) -5/53 c Which is the closest to -5? (a) 55 (b) -2 (c) 2/9 (d) 0.2 b What is the nearest to 15 in 11.4, -6/5, -58? 11.4 Which is the closest to 4.358? (a) 2/5 (b) 0.01 (c) 4/21 a Which is the nearest to 2? (a) 133 (b) -0.5 (c) 3 c Which is the closest to 0.2? (a) -0.07604 (b) -36 (c) -5 a Which is the closest to 2/3? (a) 0.5 (b) 0.2 (c) -3/2 (d) 7 (e) 226 a Which is the nearest to -0.2? (a) 2/3 (b) -149 (c) -5 (d) 4 a What is the closest to -79 in 7, -92, 2/5? -92 Which is the nearest to -2? (a) -4 (b) -1.6 (c) 6.3 b What is the nearest to -2/5 in 5, 3/5, -6, -142? 3/5 What is the closest to 378 in 3, -0.2, -3/716? 3 Which is the nearest to 0.1? (a) -1/2 (b) 11 (c) -2 (d) 0.14 (e) 8 d What is the nearest to 4/9 in 2/13, -4, -34? 2/13 What is the closest to -5 in 109, 7, 1/4, -3, 2? -3 Which is the closest to -7/41? (a) 0.2 (b) -2/11 (c) 24 b Which is the nearest to -2/11? (a) 69 (b) -6 (c) 1 (d) 2/15 d Which is the nearest to 5? (a) 2/287 (b) -1 (c) 4 c Which is the nearest to -0.1? (a) 3/178 (b) -1 (c) -2/37 (d) 2 c What is the closest to 0 in -157, -0.2, -2/3, -2/17? -2/17 Which is the nearest to -5/2? (a) -9 (b) -0.1 (c) 5 (d) 1 b Which is the closest to -12? (a) 2/5 (b) -1/41 (c) -2/9 (d) -2/27 c What is the nearest to -0.05805 in -1, -31, 3? -1 Which is the nearest to -1? (a) -8 (b) 2 (c) -5 (d) -2.7 (e) -33 d What is the nearest to -2/5 in 0.1, -1/267, 0? -1/267 What is the closest to 231 in 0, -0.5, -2, 2/3? 2/3 Which is the closest to 3? (a) -0.547 (b) 0.03 (c) -17 b What is the nearest to -6 in 53, 2, -5, 21? -5 What is the nearest to -1 in 0.3, 2/3, -0.1, 5.766, 3/8? -0.1 What is the nearest to -1/15 in -0.01, 0.09, -25? -0.01 What is the closest to 1/3 in -0.1, 0.1, -260, -5? 0.1 Which is the nearest to -0.1? (a) -6.4 (b) 6/5 (c) -1 (d) 0 d Which is the closest to 0? (a) -0.3413 (b) -3 (c) -15 (d) -2/3 a What is the nearest to 0.6 in -0.11, -3, -4, 0, 15? 0 What is the closest to -3 in -0.2, -90, -0.16, -5, 0.2? -5 Which is the closest to 1/4? (a) 2/13 (b) 4 (c) -1/4 (d) 2.59 (e) 9/4 a Which is the closest to 14? (a) -4/9 (b) 0 (c) 0.3 (d) 0.2 (e) 976 c Which is the closest to 23/4? (a) -5 (b) -0.1 (c) 2/9 (d) -6 (e) -5.4 c Which is the closest to 0? (a) 44.8 (b) -2/3 (c) -2/11 c What is the nearest to -89 in 2, 3, 2/11, 0.2, 2/3? 2/11 What is the closest to -0.1 in 80/33, 2, 11, -0.2? -0.2 Which is the closest to -4? (a) 4 (b) -1.5 (c) -1/4 (d) -24 b Which is the closest to 15? (a) -8/7 (b) 0 (c) -3/5 (d) -5/4 b What is the nearest to -6/7 in 1/5, -0.1, -5, -0.5, 0.9? -0.5 Which is the nearest to -2? (a) -0.4 (b) 1/9 (c) 1 (d) 50.4 a Which is the nearest to -2/9? (a) -8 (b) 122 (c) 1/10 c What is the nearest to -0.04 in -33, 1, 2/7, 1/2? 2/7 What is the closest to 2/163 in 5, -0.5, 2/7, 142? 2/7 What is the nearest to -9/40 in 4/5, -0.062, 0.5, -5? -0.062 Which is the closest to -2.86? (a) -0.17 (b) 2 (c) -4 c What is the nearest to -1/107 in 0, -2/11, -0.8, -2? 0 Which is the closest to -0.48? (a) 395/3 (b) -3 (c) 1/6 c Which is the nearest to 0.05? (a) 0.1 (b) -88 (c) -0.4 (d) 1/6 a What is the nearest to -30 in 2/3, 6, -5? -5 Which is the nearest to -63? (a) -0.1 (b) 0.4 (c) 0.01 (d) -0.7 d Which is the nearest to 2/17? (a) -0.0508 (b) -4/3 (c) -1 (d) 5 a What is the closest to -2/3 in -0.1, -2, 330? -0.1 Which is the closest to 8/13? (a) 5 (b) 2 (c) -26/41 (d) 2/5 (e) 5/2 d Which is the nearest to -18/5? (a) 1 (b) 30 (c) -0.24 c What is the nearest to -0.2 in 1, 6.58, -0.32? -0.32 Which is the nearest to 0.1? (a) 5 (b) 0.2 (c) -2/3 (d) -2 (e) 118 b Which is the closest to 1? (a) 0.254 (b) 1/5 (c) 806 a What is the nearest to 1/3 in -976, -7, -2? -2 What is the closest to 0.6 in 0.0559, -3, -1/8, 5? 0.0559 What is the nearest to 0.5 in -0.1, 28, -2? -0.1 Which is the closest to 74? (a) -1 (b) -30/7 (c) -1/8 c Which is the closest to -2/5? (a) -4 (b) 0.2 (c) 3/4 (d) 40.49 b Which is the nearest to -3/7? (a) -127 (b) -0.13 (c) -0.3 c What is the nearest to 1/2 in 21, 0.12, -1/10? 0.12 Which is the nearest to -8? (a) 0.1 (b) 108 (c) 6 a Which is the closest to 2033? (a) -0.08 (b) 28 (c) -5 b Which is the nearest to -0.1? (a) -2 (b) -11 (c) 61/5 (d) -4/7 d Which is the nearest to -1? (a) 2.8 (b) 3 (c) -1636/5 (d) -0.2 (e) 1 d Which is the closest to 2.59? (a) 2/15 (b) 651 (c) -0.2 a Which is the closest to 2/19859? (a) 0.1 (b) -3 (c) -1 a Which is the nearest to 1/3? (a) -5 (b) 1 (c) -2/17 (d) 6/5 c Which is the closest to -0.1? (a) -13385/4 (b) -5 (c) -30 b What is the closest to -40/7 in -0.03, 2/7, -1/75, 2/5? -0.03 Which is the nearest to 1/3? (a) -0.2 (b) 46/9 (c) -1/3 a What is the nearest to -3.6 in -0.3, -5, -3/4, 5, -4? -4 What is the closest to -2/5 in -81, -0.1, 3, 2/9? -0.1 What is the closest to 1 in 20, 2/189, -2/7, 4, 0? 2/189 Which is the closest to 0.64? (a) -1/2 (b) 4 (c) -3 a Which is the closest to -1? (a) -0.196 (b) 0.5 (c) -301 (d) 2/5 a Which is the closest to -9? (a) 2 (b) -5 (c) 2/13 (d) -50/27 b Which is the closest to -2? (a) -0.3 (b) -0.122 (c) -3 (d) 8 c Which is the nearest to 2? (a) 4 (b) -2 (c) 114 a Which is the closest to 3? (a) -2/7 (b) -5 (c) -7/15 (d) -63 a Which is the nearest to -1/4? (a) -0.1 (b) 1 (c) 10.13 (d) -0.2 (e) 0.5 d What is the closest to 47 in 2/3, -0.27, -13? 2/3 What is the nearest to -4/5 in -2, 3/7, -5? -2 What is the nearest to 2/7 in 3, -2/7, -4, 0, 4.35? 0 Which is the nearest to -2/9? (a) 1386.8 (b) 2/7 (c) 5 b Which is the closest to 3? (a) -1/4 (b) -0.8 (c) -1 (d) -5 a What is the nearest to 1155 in 5, -0.5, -31/9, 1/2? 5 What is the closest to -2.4 in 15, -5, -1/2, 1? -1/2 Which is the closest to -137? (a) 38 (b) -1 (c) -3/5 (d) 0.1 (e) -1/3 b What is the closest to -2/7 in -1, 0.4, -138, -21? 0.4 What is the closest to 17/6 in 0.04, 5, -0.3? 5 Which is the closest to -1? (a) -13/3 (b) 1/76 (c) -75 b Which is the closest to -4/59? (a) -3/5 (b) 2/7 (c) -3/	{ "pile_set_name": "DM Mathematics" }
is the smallest value in 178/7, -0.7, -3, -5, 3, 5? -5 What is the fifth smallest value in -3/4, 1/5, 3, -0.5, -29? 3 What is the biggest value in 0.4, 175428, 5? 175428 Which is the fourth smallest value? (a) -5 (b) -0.02 (c) -0.4 (d) -5/12 (e) 1 b What is the third biggest value in -4, -0.1, -3, -12, -1/2? -3 Which is the fourth smallest value? (a) -4/75 (b) 0.3 (c) -4 (d) -2 b What is the second smallest value in 439, 2/9, 9, -5? 2/9 What is the fourth biggest value in 0.9671, 5, 0.1, -4? -4 What is the third smallest value in 4, 0.3188, 0, -2/9? 0.3188 What is the fourth biggest value in 2/9, -97, 3, 1/6, -6/5? -6/5 Which is the sixth smallest value? (a) 0.2 (b) 17 (c) 0 (d) -2/15 (e) -0.4 (f) 5/4 b What is the fourth smallest value in 0.2, -17, 12, 0? 12 Which is the second smallest value? (a) -3 (b) 1.8 (c) -8 (d) 35 a Which is the second smallest value? (a) 22 (b) -1 (c) 1 (d) -4 (e) -3 (f) 3 e What is the biggest value in -792, 4, 2.2? 4 Which is the second biggest value? (a) 1243 (b) -0.2 (c) -18 b What is the fifth biggest value in 31, 4/9, 3/4, -5, -0.1, -2/17? -2/17 What is the second smallest value in -2/33, -3, 2/155? -2/33 Which is the second smallest value? (a) 99 (b) -2 (c) 659 a What is the second biggest value in -89, -0.05, 1.1? -0.05 What is the second biggest value in -7.19, -2/5, -4? -4 What is the smallest value in -4/7, 3, -2, -58/37? -2 What is the fifth biggest value in -0.21, 4, -1/8, 1, -3? -3 What is the biggest value in 1/13, -332, 0.5? 0.5 What is the second smallest value in 0.25, 36, -0.4, -2/11, 13, -0.1? -2/11 What is the biggest value in 12036, 0.4, -2.5? 12036 Which is the second biggest value? (a) -0.2 (b) 1/5 (c) 6912/7 b What is the fifth smallest value in 4, -2/9, 3/5, -7310, 0, 0.3? 3/5 Which is the second smallest value? (a) 548 (b) 4 (c) -3/28 b Which is the third smallest value? (a) 4 (b) -999 (c) 11/3 (d) 1 (e) -0.3 d What is the fourth smallest value in 0, -0.3, 0.3, 69, -1/4? 0.3 What is the smallest value in -63/8, 2, 2/5, -6/5? -63/8 What is the smallest value in 1/2, 1/114, -4, -7.5? -7.5 Which is the third smallest value? (a) 13 (b) 0.1 (c) -26/7 a Which is the second smallest value? (a) -363 (b) -2/19 (c) 1 (d) 1/16 (e) -0.5 e Which is the second biggest value? (a) 2/9 (b) 47 (c) -1/281 a Which is the third biggest value? (a) 0.5 (b) -134 (c) 15 b What is the fourth smallest value in -0.2, 29, -38, -0.18, 2/5? 2/5 Which is the second smallest value? (a) 2/7 (b) -30 (c) -766 b Which is the fifth smallest value? (a) 0.4 (b) 10 (c) 0.5 (d) 2/9 (e) -746 b Which is the fifth smallest value? (a) 6 (b) -1 (c) 0.7 (d) 1/8 (e) -66/13 a What is the biggest value in 19, -5, 1, 3/2, -60, -39? 19 Which is the smallest value? (a) -2 (b) 11 (c) -0.5 (d) 2/5 (e) -10 e Which is the third biggest value? (a) 2/3 (b) 5 (c) 89 (d) 14 (e) -0.5 (f) -1.9 b Which is the fifth biggest value? (a) -5/2 (b) -23 (c) 2 (d) 0.5 (e) -2/7 b Which is the biggest value? (a) -0.07209 (b) -2/9 (c) 0.4 c What is the fourth smallest value in 4/5, -4, 0.4, 5, 3, -40? 4/5 Which is the second smallest value? (a) -1 (b) -2 (c) 2/56907 (d) -0.03 a Which is the sixth biggest value? (a) -89/6 (b) 2 (c) -1/3 (d) 3 (e) 1/5 (f) 0 a Which is the third smallest value? (a) 263 (b) 0.2 (c) -6 (d) -1 (e) 1/3 b What is the smallest value in 35, -2/13, -5, 3/26, 0.1? -5 Which is the smallest value? (a) -35 (b) 177 (c) 0 (d) -0.06 a Which is the fifth smallest value? (a) -3.1 (b) 0.5 (c) 0.3 (d) 2/7 (e) -5.2 (f) -4 c Which is the smallest value? (a) -0.5 (b) 0.044 (c) 7 (d) -0.1 a What is the third biggest value in 1172, 0.0277, -3? -3 Which is the second smallest value? (a) -0.03 (b) -18 (c) -4 (d) -3 c What is the third smallest value in -6/5, -17, -24, -4, -1? -4 Which is the second smallest value? (a) 1 (b) -1/7 (c) -2196 (d) 0 b Which is the biggest value? (a) -0.5 (b) -2 (c) 332 (d) 5 (e) -3 (f) 9 c Which is the second smallest value? (a) -1/6 (b) 3.87 (c) -30 (d) 1/7 (e) -0.5 (f) 0.2 e What is the fourth smallest value in 1/9, 2, -19/2, -21? 2 What is the second smallest value in -2, -7, -0.07, 199.6? -2 Which is the smallest value? (a) -0.058 (b) 1/3 (c) -2 (d) 1/11 (e) 3.1 c What is the sixth biggest value in 2/5, 21/8, 24, -4, -3/5, -0.3? -4 What is the fourth biggest value in 2.9, 2/29, 0.2, -2/3? -2/3 Which is the fourth biggest value? (a) 2/13 (b) 1368 (c) -5 (d) -19/2 d Which is the fifth smallest value? (a) -0.4 (b) -545 (c) 0.5 (d) -3 (e) 4 e What is the second smallest value in 5, -1/7, -0.5, 34/7? -1/7 What is the second smallest value in 2/7, -1, -108, 71? -1 Which is the second smallest value? (a) 2/11 (b) 3/2 (c) -88078 a Which is the biggest value? (a) 17 (b) -81/4 (c) 1/21 a What is the second smallest value in -3, 3, -3/5, -18, -0.01? -3 Which is the third biggest value? (a) -2/35 (b) 2/3 (c) 99/7 (d) 0.02 d Which is the biggest value? (a) 0.0824 (b) 0.3 (c) -2 b What is the second smallest value in -17534, 1/9, -1/6? -1/6 What is the fifth biggest value in -0.07, -2/5, 1, 6, -1/2? -1/2 Which is the fifth biggest value? (a) -5 (b) -0.08382 (c) 2 (d) -0.4 (e) 0.1 (f) -4/3 f What is the third biggest value in 294, -12, -0.08? -12 Which is the third biggest value? (a) 37/16 (b) -4 (c) -1/6 (d) 2/7 c Which is the second biggest value? (a) -0.03 (b) 1/6 (c) 0.06 (d) -44 (e) 0.4 b What is the third biggest value in 13, -37, -5, 0.3, 0.2? 0.2 What is the fourth smallest value in 2/19, -0.0483, -2, -0.1, -5, 34? -0.0483 What is the second smallest value in -57683, 0.3, -4? -4 Which is the biggest value? (a) 6/13 (b) 11 (c) 1/115 b What is the fourth smallest value in 0.6, 7, -0.4, 0.23, 0, -0.1? 0.23 Which is the second smallest value? (a) -2/9 (b) -367996 (c) 4 a Which is the fifth smallest value? (a) 0.1 (b) 37 (c) -1/5 (d) -3 (e) 0.28 b What is the second smallest value in 2/53, -141, -2? -2 Which is the second biggest value? (a) -0.4 (b) 0.8098 (c) -2/121 c Which is the third smallest value? (a) 1 (b) -16 (c) -0.1245 a What is the second biggest value in 154235, -0.2, -5? -0.2 Which is the fifth smallest value? (a) -0.06 (b) -13 (c) 1/8 (d) -118 (e) 3 e Which is the third smallest value? (a) -5 (b) -2 (c) 822 c What is the third biggest value in -2/7, -2, -8, -1, -16, -5? -2 Which is the fifth biggest value? (a) -2/3 (b) -2/7 (c) -14 (d) 3 (e) -1/10 c What is the second smallest value in 2/9, -60, 0.478? 2/9 Which is the second biggest value? (a) -2 (b) -3/5 (c) -13 (d) 2 (e) -2.7 b What is the second smallest value in 5, 3, -4/111, -1? -4/111 Which is the second smallest value? (a) 23077/3 (b) -2/15 (c) -4 b Which is the third smallest value? (a) -22 (b) -16 (c) 4/327 c Which is the smallest value? (a) -5 (b) 4 (c) -136 (d) 8/3 (e) 5/2 c What is the second biggest value in -3, 4270/9, -4/5, -4? -4/5 What is the biggest value in -3, 0, 79, -5/6, 15? 79 Which is the fourth smallest value? (a) -2/15 (b) 0.5 (c) -0.712 (d) -1 (e) 18 b What is the smallest value in 5877, -8, 0.5? -8 What is the smallest value in 1, 5, 47494? 1 Which is the second biggest value? (a) -7 (b) 4 (c) -3 (d) 28/11 (e) -2/13 d What is the fifth smallest value in 1/8, 2/13, 38, 0.1, 3/22? 38 What is the third biggest value in 0, -0.1, 0.05, 5.26, 2/261? 2/261 What is the third smallest value in -3, -2, -0.1, -58, 2? -2 Which is the smallest value? (a) -2/37 (b) -0.08 (c) -2 c Which is the second smallest value? (a) -10/11 (b) -0.3 (c) -3/5 (d) -6 (e) -0.12 a Which is the third biggest value? (a) -1.5 (b) 3092 (c) -0.3 a Which is the smallest value? (a) 0.122 (b) -0.3 (c) 2/13 (d) 3 (e) 0.4 (f) -1.1 f What is the second biggest value in -4, 4, -0.01, 56, 0? 4 Which is the fifth smallest value? (a) 0.7 (b) 0.5 (c) 2 (d) 7 (e) -17/6 d What is the fourth smallest value in -2, 5.892, 2/15, 0.016? 5.892 What is the second biggest value in -5, 5, -207, -0.3? -0.3 What is the biggest value in -1280, 0.1, -7, -5? 0.1 What is the second smallest value in 0.05, -3026, 1.14? 0.05 Which is the smallest value? (a	{ "pile_set_name": "DM Mathematics" }
t x(d) = -55d - 18. Let k(r) = -54r - 16. Let n(f) = -2k(f) + 3x(f). What is the derivative of n(j) wrt j? -57 Suppose 0 = -5b - 0b + 40. Find the second derivative of -4z5 + 6z - 4z + bz*5 wrt z. 80z*3 Let h(n) be the third derivative of 0n - 1/8n4 - n2 - 1/6n3 + 0. Differentiate h(v) with respect to v. -3 Let u(x) be the third derivative of -x7/105 - x*6/120 - 11x*4/4 - 24x*2. Find the second derivative of u(k) wrt k. -24k*2 - 6k Let a(u) be the second derivative of -u5/2 - u4/4 - 41u3/6 - 4u + 1. What is the second derivative of a(m) wrt m? -60m - 6 Let k(c) = -6c*4 - 11c + 36. Let d(o) = o*4 + 2o - 7. Let q(j) = 11d(j) + 2k(j). Differentiate q(s) with respect to s. -4s3 Find the third derivative of 6p*5 - 7p*2 - 36p*5 + 10p*5 wrt p. -1200p2 Find the third derivative of g2 - 5g2 - 3g*5 + 12 - 12 wrt g. -180g*2 Suppose -62 = -3x + 2t, 60 = 4x + t + 2t. What is the derivative of xg - g*4 + 2g*4 + 5 - 18g wrt g? 4g3 Suppose 0y - 2y + 3h - 2 = 0, -5h - 13 = -y. Let u = 9 + y. Find the second derivative of 5k*2 - 3k + 0ku - 4k*2 wrt k. 2 Let l be 14/4(-12)/(-7). Differentiate 76v2 + 6 + lv*3 - 76v*2 with respect to v. 18v2 Let w(l) = -l3 - 3l2 - 2l - 2. Suppose -2f = 3 + 3. Let r be w(f). Find the first derivative of 1 + 0b4 + br - 3b4 wrt b. -8b*3 Suppose 5o = 1 + 9. Suppose -7x + 42 = -ox - 2w, -3x + 14 = -4w. Find the second derivative of -xr*2 - 4r*2 + 13r*2 - 3r wrt r. -2 Let o(w) be the second derivative of w*6/6 - 5w*2 - 10w. Find the first derivative of o(a) wrt a. 20a3 Let o(w) be the third derivative of 1/120w*6 + 2w*2 + 0w*4 + 0 + 0w + 0w5 + 1/2w*3. Differentiate o(z) with respect to z. 3z2 Let w(p) = -p2 - p + 1. Let i be w(-2). Let y = 1 + i. What is the second derivative of yc5 + 0c*5 + 2c*5 - 2c wrt c? 40c3 Differentiate 16 + 22 + 6s + 31s with respect to s. 37 Let y(n) = -n2 + n - 1. Let s(q) = 10q*2 - 3q + 4. Let v(r) = s(r) + 4y(r). What is the second derivative of v(o) wrt o? 12 Let z(g) be the third derivative of 0g*7 + 0g + 0 + 0g6 + 0g*4 + 0g*3 + 4g*2 - 1/10g*5 - 1/48g*8. Find the third derivative of z(t) wrt t. -420t*2 What is the derivative of -16m - 313 + 304 - 13m wrt m? -29 Let a(i) be the third derivative of i7/42 - i4/6 - 4i*2. Find the second derivative of a(r) wrt r. 60r*2 What is the derivative of -2 + 3h*3 + 5 - 10h*3 wrt h? -21h2 Let i(x) = x2 - 3x - 2. Let w be i(3). Let f(d) = 4d - 3. Let l(b) = -9b + 7. Let g(m) = wl(m) - 5f(m). Differentiate g(n) with respect to n. -2 Let d(b) = b2 + b - 1. Let w(y) = -2y*2 - 4y + 0y + 2 + y + 0. Let r(q) = -3d(q) - w(q). What is the first derivative of r(m) wrt m? -2m Let b(n) = 17n*2 - 10n. Let d(x) = 17x2 - 10x. Let i(m) = 2b(m) - 3d(m). What is the second derivative of i(u) wrt u? -34 Let w(a) = -5a4 + 3a*3 + 5a. Let t(s) = -24s4 + 16s*3 + 26s. Let l(c) = 3t(c) - 16w(c). Find the second derivative of l(x) wrt x. 96x2 Differentiate 287u*2 - 331u*2 + 13 + 25 wrt u. -88u Let n(u) be the first derivative of -1/2u2 + 0u*4 + 0u*5 + 0u*3 + 0u - 1 - 1/6u6. Find the second derivative of n(h) wrt h. -20h*3 Suppose -6 = -4h - 0h + 2a, 3a - 6 = h. What is the second derivative of -3g4 + g4 + hg + g4 wrt g? -12g*2 What is the second derivative of -5o*3 + 9 + 9o - 9 - 3o wrt o? -30o Let q(o) = o*2 + 3o. Let f be q(-3). Suppose 17 = 4p + 9. What is the third derivative of 0d*5 - 3d5 + dp + fd5 - 4d*2 wrt d? -180d*2 Find the first derivative of -37u + 37u + 12 + 9u*4 wrt u. 36u*3 Let q(j) be the first derivative of -3/5j*5 + 0j*2 + 1 + 0j*4 - j + 0j*3. Find the first derivative of q(r) wrt r. -12r*3 Let h(f) = -4f*5 - 5f*2 - f. Let n(a) = 2a + 2a5 + 8a*2 + 4a*5 + 0a*5. Let c(v) = -8h(v) - 5n(v). What is the second derivative of c(u) wrt u? 40u*3 Let h(g) be the third derivative of -11g9/504 + g5/60 - 13g2. Find the third derivative of h(i) wrt i. -1320i*3 Let v(i) be the third derivative of 0i + 1/42i7 + 0 + 0i*3 + 0i6 + i2 + 0i4 - 1/30i*5. Find the third derivative of v(c) wrt c. 120c Let r(a) be the third derivative of 0a6 - 1/168a*8 + 0 + 0a*3 + 0a*5 + 0a7 + a2 + 0a + 1/8a*4. What is the second derivative of r(z) wrt z? -40z3 Let q(k) be the third derivative of k8/1680 + k6/90 - k3/3 + 5k2. Let u(f) be the first derivative of q(f). What is the third derivative of u(o) wrt o? 24o Let s(v) = 2v2 + v. Suppose 0h + 2 = -2h. Let q be s(h). Differentiate -m2 - q - 2 + 4 wrt m. -2m Let f(a) be the third derivative of -5a8/112 + a5/20 - 17a*2. Find the third derivative of f(i) wrt i. -900i*2 Let s(k) = 13k*2 - 7k. Let o(w) = -13w2 + 7w. Let t(r) = 5o(r) + 4s(r). What is the second derivative of t(l) wrt l? -26 Let m(v) be the third derivative of v9/1008 - v6/180 + v*3/2 + 3v*2. Let i(r) be the first derivative of m(r). Find the third derivative of i(t) wrt t. 180t*2 Let q be (04/(-20))/(-1). Let c(m) be the third derivative of -2/3m3 - 1/6m*4 + qm + 0 - m*2. What is the derivative of c(s) wrt s? -4 Let b(x) be the first derivative of -2x*3 + 13x + 12. Differentiate b(l) with respect to l. -12l Let x(t) be the third derivative of -t8/3360 - t5/60 + t4/24 + t2. Let q(v) be the second derivative of x(v). What is the derivative of q(o) wrt o? -6o*2 Suppose -6z = -4z - 16. Find the second derivative of 5 + 2t + 4t5 - z + 3 wrt t. 80t*3 Let k(n) be the first derivative of -17n*2/2 + n + 3. What is the derivative of k(c) wrt c? -17 Let o(r) be the second derivative of -7r*6/30 + 35r*4/12 + 48r. Find the third derivative of o(t) wrt t. -168t Let g(c) be the first derivative of -3c + 1/3c3 + 0c*2 - 3. Differentiate g(t) with respect to t. 2t Suppose 6 = 2f - 5f. Let c = 4 + f. Find the third derivative of o*6 - 6o6 + o6 - 4o2 + 5o*c wrt o. -480o3 Let o(y) be the third derivative of -y9/504 - y5/120 + y3 - 5y2. Let w(k) be the first derivative of o(k). What is the second derivative of w(u) wrt u? -120u*3 Let g(o) be the second derivative of 29o6/30 + o2/2 + 36o. What is the first derivative of g(w) wrt w? 116w*3 Let o(f) be the second derivative of -5f*4/12 - 4f*2 + 4f. Differentiate o(x) wrt x. -10x What is the derivative of 10v*3 - 8v*3 + 4v*3 + 1 wrt v? 18v2 Let k = -6 + 6. Find the second derivative of -m4 + km4 + 2m*4 + 2m - 3m wrt m. 12m*2 Let o(r) = -16r*3 + 4r*2 + 14r - 4. Let h(w) = -w*2 + 1. Let a(g) = -4h(g) - o(g). Find the second derivative of a(d) wrt d. 96d Let j(g) = -g + 15. Let y be j(13). Differentiate 0o*3 + yo*3 + 0o*3 + 4o*3 + 10 wrt o. 18o*2 Suppose -w + 8 = w, 5q = -w + 14. What is the second derivative of -8r - 5rq - r + r2 + 5r wrt r? -8 Suppose 3f = -4n + 6, -16 = -5f - 5n - 6. Let u(b) = -b3 + 2b*2 + 5b - 2. Let x be u(3). Find the second derivative of 7v + 4v*2 - fv - xv wrt v. 8 Suppose h + 27 = 3o, -3o - 5 = -2o - 5h. What is the third derivative of 3q*4 - 5q*2 - 9q*4 + oq*2 wrt q? -144q Suppose 3s + 28 + 2 = 3x, 3s = 5x - 40. Let r = s + 8. Find the second derivative of 2l3 + l - l3 - 2l*r wrt l. -6l Suppose -p = -6p + 110. What is the first derivative of -3 - 18v*4 + pv*4 + 1 wrt v? 16v*3 Suppose 0 = 7q - 8q. Differentiate -12v + 2 + q + 4v with respect to v. -8 Let x(o) be the first derivative of o7/420 + o4/4 - 2o*3 + 6. Let s(c) be the third derivative of x(c). What is the first derivative of s(d) wrt d? 6d*2 Differentiate 11 - 11t*2 - 11t*2 - 2 + 16t*2 with respect to t. -12t Let b(k) be the second derivative of -2k6/15 + 15k*2/2 + 10k. Differentiate b(y) with respect to y. -16y3 Suppose 0 = -n - 2r + 15, 5r - 50 = -11n + 6n. What is the second derivative of 3y + 2yn - 5y*5 + 0y*5 - 4y wrt y? -60y3 Let x(z) = z4 - z3 + z2 - 1. Let f(k) = -6k*4 - 6k3 + k2 - 6. Let m(l) = f(l) - 6*x(l). Find the third	{ "pile_set_name": "DM Mathematics" }
he third derivative of -7y5/60 + 18y*2. What is o(m(d))? -28d*4 Let o(n) = n. Let m(l) = 3l*2 + 109. What is m(o(d))? 3d*2 + 109 Let r(z) = 3z. Suppose 9 + 6 = 5c. Let n(t) = -t2 + c - 3. Determine n(r(v)). -9v*2 Let s(v) = -175v. Let f(w) = -w. Give s(f(x)). 175x Let c(b) = 3b2. Let t(n) be the second derivative of -n6/240 + n*4/6 - 4n. Let k(w) be the third derivative of t(w). Determine k(c(d)). -9d2 Let n(k) = k + 4k - 6k. Let g(c) be the second derivative of -1/12c*4 + 0c*2 + 0c*3 + 0 - 4c. Determine g(n(p)). -p*2 Let p(m) = -13m*2. Let b(s) = 0 - s - 8 + 8. Give b(p(v)). 13v2 Let q(m) be the second derivative of m4/3 + m. Let t(h) be the first derivative of h*2 + 1. Determine q(t(b)). 16b*2 Let a be (-2)/8 + 1/4. Let g(o) = a - 2o*2 + 0. Let w(u) = 2u*2 - 4. Let f(k) = 2k*2 - 5. Let d(z) = 4f(z) - 5w(z). What is d(g(c))? -8c*4 Let b(p) = -4p*2. Let s(r) = 4r*2 + 30. Determine s(b(v)). 64v*4 + 30 Let s(l) be the first derivative of 0l*2 + 0l + 7 - 2/3l3. Let h(z) = -2z*2. What is s(h(u))? -8u*4 Suppose -5i = -4i - 2. Let q(u) = 4u*2 - 4u2 - ui. Let b(h) = -2h2. What is q(b(c))? -4c*4 Let a(s) = 5s. Let l(w) = 4w. Let b(c) = -5a(c) + 6l(c). Let n(f) be the third derivative of f5/15 - 14f*2. Give n(b(j)). 4j*2 Let k be (-4)/((-4 - -1) + 1). Let s(z) = -2z*k + 3z*2 - 3z*2. Let o(v) = 2v*2 - 5v2 + v2. Give o(s(p)). -8p4 Let w(p) = 872p*2. Let s(c) = -2c*2. Determine w(s(x)). 3488x*4 Let z(q) = 5q*2. Let n(y) = 12y*2 - y. Calculate z(n(k)). 720k*4 - 120k*3 + 5k*2 Suppose -4o - 7 = -l - 23, -10 = -2o. Let h(v) = v - 2. Let k be h(l). Let m(f) = kf + 2f + f. Let y(g) = g. Calculate y(m(a)). 5a Let z(r) = -r. Suppose -10 = -6o + 4o. Let y(g) = -4 + 0g2 - og*2 + 4. Give y(z(l)). -5l*2 Let g(t) = 3t2. Let o(a) be the third derivative of -a5/12 + 2a2 - 46. What is g(o(b))? 75b*4 Let j(r) = 2r2. Let i(p) be the third derivative of -p4/8 + p*2 - p. What is i(j(n))? -6n*2 Let i(y) = 5y*2. Let u(d) be the first derivative of -1/2d*2 + 0d*3 - 1/24d*4 + 0d - 1. Let c(m) be the second derivative of u(m). What is c(i(b))? -5b2 Let w(u) = -24290u2. Let h(f) = -f2. Calculate w(h(b)). -24290b4 Let s(b) = -45b - 4. Let u(a) = -5a2. Calculate u(s(v)). -10125v*2 - 1800v - 80 Let y(u) be the second derivative of 7u3/6 - 20u. Let g(s) = -8s. Calculate y(g(h)). -56h Let j(s) = -4s. Let o(b) = -b2 - 9. Let n = -3 + 1. Let r(v) = -2. Let l(m) = no(m) + 9r(m). Give j(l(t)). -8t*2 Let j(q) = -q. Let p(d) = 382d. Determine p(j(v)). -382v Let r(v) = 3v*2. Let j(s) = 9s + 1. Determine j(r(x)). 27x2 + 1 Let l(f) = -4f. Let z(m) = -4m2 + 5m*2 + 5m*2 - 4m*2. Determine z(l(u)). 32u*2 Let c(j) = 3485j*2. Let y(q) = q. Determine c(y(x)). 3485x2 Let b(w) be the second derivative of w4/12 - 2w. Let x(f) = f - 1. Let q(m) = 9m - 6. Let o(u) = -q(u) + 6x(u). Give o(b(k)). -3k*2 Let u(y) = 2y*2. Let v(m) = -10m*2. Calculate v(u(t)). -40t*4 Let s(r) = 2r*2. Let x(y) = -6 - 9y + 6. What is s(x(v))? 162v2 Let y(a) = 4a2. Suppose -5 = -j - 6. Let v(c) = -c2 + c. Let m(w) = -9w2 + 6w. Let h(l) = jm(l) + 6v(l). Determine h(y(p)). 48p4 Let z(r) = -3r*2. Let i(g) = -g + 1. Let p(a) = 6a - 14. Let f(y) = 18y - 43. Let k(c) = -2f(c) + 7p(c). Let x(s) = -12i(s) - k(s). Calculate z(x(q)). -108q2 Let m(z) = z. Let o(p) = 3p - 2. Let j(f) = -f + 1. Let q = 3 - 4. Let x(b) = qo(b) - 2j(b). Give x(m(a)). -a Let n(y) = -2y. Let g = 1 + 3. Let m(r) = -gr*2 + 9r*2 + 2r*2 + 6r*2. What is n(m(k))? -26k*2 Let n(p) = -18p. Let o(j) = -8j. What is n(o(g))? 144g Let w(f) be the first derivative of -50 + 0f2 + f2 + 47. Let r(j) = j2. Determine r(w(q)). 4q2 Let u(r) = r2. Let g(t) = 3t2 + 3t. Let a(x) = -x. Let w(b) = -5a(b) - g(b). Let p(y) = 7y*2 - 5y. Let d(f) = -2p(f) - 5w(f). Calculate d(u(n)). n*4 Let i(h) = 21h. Let w(b) = -2b2 + 4b. Let n(j) = 3j2 - 5j. Let m(t) = -4n(t) - 5w(t). Give i(m(d)). -42d2 Let u(m) = 5m*2. Let i(r) = 4r*2 - 3r - 3. Let k(d) = -d - 1. Let y(l) = i(l) - 3k(l). Calculate y(u(x)). 100x4 Let l(d) = d. Let q(p) = p - 4. Let v be q(7). Let n(g) = 0 + v - 3 + g. What is l(n(u))? u Let q(z) = -z2 + z - 1. Let j(a) = -8a2 + 10a - 10. Let c(b) = -j(b) + 10q(b). Let v(u) be the first derivative of 5u*3/3 + 3. Calculate v(c(d)). 20d*4 Let v(g) = 9g*2. Let q(p) = 29p*2. What is v(q(a))? 7569a*4 Let k(c) = 215c. Let l(b) = 11b. Give l(k(q)). 2365q Let a(s) = -37s2. Let y(v) = -2v. Give y(a(q)). 74q2 Let t(c) = -2c*2. Let s(u) = -432u. Calculate s(t(r)). 864r2 Let t(a) be the first derivative of -a5/60 - 3a2/2 - 5. Let j(z) be the second derivative of t(z). Let s(i) = 2 - i2 - 2. Give s(j(m)). -m*4 Let m(r) = -2r2. Let o(i) be the first derivative of i2 + 25. Determine o(m(y)). -4y2 Let u(k) = -5k*2. Let d(l) = -l + 2. Give d(u(p)). 5p*2 + 2 Let p(c) = c. Let t(g) = 8g. Let h(r) = -18p(r) + 2t(r). Let f(x) be the second derivative of -x*4/3 - 2x. Determine h(f(a)). 8a2 Let x(v) = -v. Let q be (3/(6/(-8)))/1. Let b be -1 + (1 + q)/(-1). Let r(i) = bi + i - 5i. Calculate r(x(y)). 2y Let k(s) = s. Let u(w) = -21w - 3. Determine k(u(b)). -21b - 3 Let t(b) = -b*2. Let m = 23 - 12. Let g(k) = -11 + 4k + m + 2k. Calculate t(g(v)). -36v*2 Let z(l) = 7l - l + 25l. Let j(h) = -h2. What is j(z(r))? -961r*2 Let s(t) = -2t + 6. Let r(a) = 1. Let j(c) = 6r(c) - s(c). Let l(g) = 21g. Calculate j(l(o)). 42o Let z(t) = 6t*2. Let f(k) = -183k. Give f(z(l)). -1098l2 Let n(z) = 2z. Let l be ((-6)/5)/(2/(-10)). Suppose -3q + l = -0q. Let c(h) = 5h2 - hq - 2h*2. What is n(c(w))? 4w*2 Let w(o) = 12o2. Let r(m) = -m3 + 16m2 - 12m - 4. Let x be r(15). Let p(s) = -3s + 39s*2 - xs*2 + 3s. Determine p(w(f)). -288f4 Let f(v) = -395v*2. Let s(z) = 6z*2. Calculate f(s(w)). -14220w*4 Let m(l) = -45l*2 - 2l. Let z(x) = 3x2. What is z(m(i))? 6075i*4 + 540i*3 + 12i*2 Let z(c) = -10 + 6 - 3c + 4. Let n(t) = -11t2. What is z(n(a))? 33a*2 Let c(n) = 2n + 18. Let b(w) = -161w2. Give b(c(a)). -644a*2 - 11592a - 52164 Let s(c) = 4c. Let p(k) = -6494k*2. What is s(p(m))? -25976m*2 Let s(c) = -3c. Let l(p) = 119p2. What is s(l(d))? -357d*2 Let l(c) = 4c. Let v(h) = -25h2 + 3h. Calculate v(l(g)). -400g2 + 12g Let s(i) = -5i - 101. Let g(b) = b2. Determine s(g(k)). -5k2 - 101 Let d(n) = n3 + 1. Let u(i) = 7i3 + i2 + 8. Let g(a) = 6d(a) - u(a). Let h be g(-2). Let q(x) = x - hx + 5x - 2x. Let o(b) = 2b. Determine o(q(w)). 4w Let c(m) = 2 - 2 - m2. Let n(x) be the first derivative of -x2/2 - 11. What is n(c(h))? h2 Let f(m) = m3 + 3m*2 + 2m + 2. Let x be f(-2). Let l(k) = xk + k + 0k. Let b(g) = g + 2. Let t(a) = -2a - 3. Let u(w) = 3b(w) + 2t(w). Give u(l(s)). -3s Let j(v) = -v2. Let h(p) be the first derivative of -p2 - 9. Determine j(h(s)). -4s2 Let m(t) be the second derivative of t3/3 + t - 35. Let h(k) = -2k + 4 - 4. Calculate h(m(a)). -4a Let q(n) = -2n. Let u(r) be the second derivative of r*5/30 - 2r*2 + 5r. Let o(w) be the first derivative of u(w). Give q(o(b)). -4b2 Let k(q) = -5q. Let d(u) = -u*2 + 7u + 7. Let c(t) = t*2 - 6t - 6. Let a(l) = 2l - 10. Let x be a(8). Let s(i) = xd(i) + 7c(i). Calculate k(s(r)). -5r*2 Let m(s) = 6s*2 + 6s*2 + 3s*2 - 19s2. Let l(a) = a2 - 3 + 3. Calculate m(l(t)). -4t4 Let f(h) = -9h + 5. Let p(n) = 2n2. Give f(p(w)). -18w*2 + 5 Let p(i) = 2i. Let k(c) = -961c2. Calculate p(k(z)). -1922z*2 Let q(s) = 16s. Let m(d) = -2d - 471. Calculate m(q(x)). -32x - 471 Let u(y) = 4y2. Let j(n) = -n2 - n2 + 3n*2 + 0n*2. Determine u(j(s)). 4s*4 Let v(o) = 125o + 55. Let x(f) = -9f - 4. Let y(a) = 4v(a) + 55x(a). Let t(r) = 2r. Determine t(y(k)). 10k Let g(b) = 5b*2. Let l(d) = -37d. Determine g(l(c)). 6845c2 Let d(j) = -3j2 + j2 + 3j2. Let c(t) = 12t*2. What is c(d(x))? 12x**4 Let c(h) =	{ "pile_set_name": "DM Mathematics" }
False Is 139775312 a multiple of 358? False Is 659 a factor of 54569813? True Does 205 divide 132709663? False Is 95425652 a multiple of 14? True Is 1533 a factor of 1705527099? False Does 59 divide 3254263? True Does 3 divide 2149955? False Is 94521196 a multiple of 63? False Is 147311010 a multiple of 462? True Does 1059 divide 116236899? True Does 38 divide 23264867? False Is 8052 a factor of 700169712? True Is 2282572 a multiple of 1887? False Does 117 divide 1515022885? False Does 19 divide 32933767? False Is 53306371 a multiple of 2454? False Is 9 a factor of 418769595? True Is 43 a factor of 43834931? True Does 16 divide 39330627? False Is 608 a factor of 20721160? False Is 50 a factor of 340705336? False Does 219 divide 299840514? False Is 699327051 a multiple of 604? False Is 2520757860 a multiple of 6? True Is 6 a factor of 9637704? True Is 1032 a factor of 57546384? True Is 6456 a factor of 1389428040? True Does 79 divide 19932332? True Is 9059 a factor of 1025264819? False Does 12 divide 195577306? False Does 15 divide 83135370? True Does 36 divide 11017891? False Does 419 divide 24177557? True Is 622 a factor of 127171759? False Is 905844 a multiple of 70? False Is 9 a factor of 191497356? True Is 7640136 a multiple of 504? True Is 3833 a factor of 160027750? True Is 20040546 a multiple of 11? False Is 162930655 a multiple of 4756? False Is 1432736736 a multiple of 12? True Is 156 a factor of 196455956? False Does 20 divide 249410070? False Does 148 divide 78721792? True Is 17097 a factor of 2436484795? False Does 10 divide 676464360? True Does 2657 divide 1139008074? True Is 120 a factor of 10239360? True Is 553792850 a multiple of 36? False Does 6 divide 61051464? True Is 128 a factor of 13924992? True Is 1120 a factor of 33555200? True Does 16 divide 300331056? True Is 30 a factor of 6810538? False Is 66 a factor of 1492418400? True Is 38 a factor of 58710? True Does 707 divide 15715055? False Is 35 a factor of 83100948? False Does 2456 divide 111695044? False Is 863346262 a multiple of 46? True Is 1496 a factor of 482453723? False Is 136 a factor of 302939784? False Is 1365262 a multiple of 91? False Does 40 divide 11790041? False Is 4 a factor of 356318220? True Does 137 divide 2764112? True Is 25664968 a multiple of 325? False Does 13 divide 9373815? False Does 3949 divide 69435267? True Is 50798336 a multiple of 8? True Is 20253442 a multiple of 1243? True Does 330 divide 94772040? True Is 79 a factor of 66189? False Does 42 divide 35108178? True Is 5369 a factor of 402036089? True Does 15 divide 43375140? True Does 40 divide 90005320? True Is 30896375 a multiple of 71? False Is 68 a factor of 33729768? True Is 153156652 a multiple of 44? True Is 299 a factor of 2350393851? True Is 28 a factor of 5025440? True Is 5 a factor of 992133645? True Is 6 a factor of 10105083? False Is 669303793 a multiple of 5? False Is 25886781 a multiple of 32? False Is 371893980 a multiple of 738? False Does 17 divide 1105885188? False Does 41 divide 5233732? True Does 15 divide 581023337? False Is 2231079405 a multiple of 51? True Is 187 a factor of 14396943? True Is 150 a factor of 1789781403? False Is 1007 a factor of 92639441? False Is 141254492 a multiple of 344? False Does 446 divide 285933722? True Is 538329435 a multiple of 393? True Does 454 divide 1560611834? True Is 5502870 a multiple of 45? True Is 69 a factor of 415231197? False Is 473 a factor of 401108860? False Is 125443105 a multiple of 2711? False Is 2 a factor of 60044104? True Is 1002 a factor of 123451410? True Is 204759632 a multiple of 616? True Is 756 a factor of 345001067? False Is 32372918 a multiple of 910? False Is 128574182 a multiple of 1227? False Is 270257708 a multiple of 68? False Is 1263 a factor of 154624348? False Is 256 a factor of 99006771? False Does 60 divide 20119920? True Is 5760453 a multiple of 597? True Is 59980735 a multiple of 239? False Is 4 a factor of 178856172? True Is 110170160 a multiple of 8? True Does 68 divide 64448320? False Is 2242597279 a multiple of 17? True Is 816037654 a multiple of 1679? True Does 309 divide 18204426? True Is 248 a factor of 502518305? False Is 100509623 a multiple of 1123? True Is 37 a factor of 91275411? True Does 6 divide 111243? False Is 16090760 a multiple of 5? True Is 64 a factor of 17395804? False Is 687 a factor of 430007040? True Is 233 a factor of 99307455? False Does 9158 divide 774018317? False Is 189749901 a multiple of 5093? True Is 1289879918 a multiple of 34? False Does 991 divide 567166519? False Does 117 divide 229347963? True Does 4 divide 83960853? False Is 3470640 a multiple of 4? True Does 6 divide 1178666724? True Is 281203148 a multiple of 4462? False Does 114 divide 30634076? False Does 141 divide 28654161? True Is 81420294 a multiple of 1214? False Is 908 a factor of 11091833? False Does 11 divide 29211403? False Is 663 a factor of 3310276641? False Is 86722158 a multiple of 197? True Is 3014875 a multiple of 89? True Is 444 a factor of 751318963? False Does 1036 divide 87592661? False Is 14048851 a multiple of 17? True Does 3206 divide 213144498? True Does 12 divide 432455201? False Is 3318280 a multiple of 70? True Does 698 divide 10063230? False Is 47216975 a multiple of 325? True Is 321 a factor of 80982712? False Is 681 a factor of 60755415? True Is 941064122 a multiple of 12? False Does 16 divide 16436624? True Is 46 a factor of 170542562? True Is 3200064 a multiple of 8? True Is 144 a factor of 175721266? False Is 7884645 a multiple of 8? False Is 8 a factor of 420262632? True Is 29 a factor of 86612993? False Is 629 a factor of 22168555? False Does 366 divide 50208978? True Is 3606565907 a multiple of 3995? False Does 13 divide 243792237? True Does 13 divide 931854040? True Does 2935 divide 203102463? False Is 1760 a factor of 297682880? True Is 79556611 a multiple of 3071? False Is 2878083978 a multiple of 21? True Is 1307276304 a multiple of 57? True Does 849 divide 687654470? False Is 1711 a factor of 33102622? False Is 3835 a factor of 592074145? True Is 37 a factor of 7303315? False Is 116 a factor of 432272816? False Is 131839930 a multiple of 4570? True Does 16 divide 199086320? True Is 4 a factor of 16193640? True Does 27 divide 463033908? True Is 138587400 a multiple of 157? False Does 22 divide 29301159? False Is 33 a factor of 1999867626? False Does 22 divide 552032118? True Does 27 divide 368594388? True Is 4 a factor of 351679527? False Is 677 a factor of 20077789? True Does 54 divide 9423891? False Is 11 a factor of 103717153? False Does 43 divide 1180134709? False Does 134 divide 21710171? False Is 23 a factor of 270624440? True Is 221954615 a multiple of 22? False Is 77750927 a multiple of 11? False Does 44 divide 3924877484? True Does 1188 divide 40530996? True Is 33 a factor of 100918191? True Is 5 a factor of 223164890? True Does 2260 divide 3340280? True Does 349 divide 159488114? True Is 6541536 a multiple of 48? True Is 176 a factor of 16201152? True Is 8 a factor of 6170320? True Is 894 a factor of 232351494? True Is 90 a factor of 120069000? True Is 10 a factor of 1424038180? True Is 19767495 a multiple of 33? True Does 40 divide 5245337? False Does 29 divide 264990475? False Does 290 divide 3192594? False Is 52 a factor of 430322048? True Does 5 divide 2867937? False Is 683 a factor of 1623428864? False Does 1687 divide 74050735? False Does 228 divide 2580155269? False Is 31 a factor of 16714146? True Does 560 divide 2716018480? True Does 2357 divide 16546924? False Is 4201 a factor of 117207900? True Is 556 a factor of 20879093? False Is 69 a factor of 16277583? True Does 25 divide 449438075? True Is 805781 a multiple of 19? False Is 26 a factor of 678064? False Is 19897504 a multiple of 15? False Does 97 divide 3733863? False Is 373341310 a multiple of 1620? False Does 2725 divide 241838300? True Is 85165492 a multiple of 13? False Is 12488167 a multiple of 26? False Is 356 a factor of 156959688? True Does 251 divide 46223407? True Does 1299 divide 108967914? True Is 17 a factor of 160986362? True Is 2847 a factor of 33933104? False Is 15 a factor of 534843960? True Does 14 divide 670184215? False Is 21 a factor of 1973919024? True Is 470878805 a m	{ "pile_set_name": "DM Mathematics" }
d + 10d + 2d4 + 5d wrt d? 24d2 Let t(v) be the third derivative of 0v*6 + 0v + 1/60v5 + 0v*3 + 2v*2 + 0 + 0v*7 + 1/112v*8 + 0v*4. Find the third derivative of t(y) wrt y. 180y*2 Let a be (5 - 2) + 0 - 1. Find the third derivative of -6h*2 - 2h4 - h4 + 5ha + 6h*2 wrt h. -72h Suppose -3g = -g. Suppose g = c - 4s - 22, 2c + 16 = -0s - 4s. Find the third derivative of -2l3 + l3 - 5l2 + 9lc - l2 wrt l. -6 Let x(u) = -6. Let c(w) = w*2 - 9w + 10. Let b be c(7). Let h = -2 - b. Let o(l) = -l - 5. Let j(y) = hx(y) - 3o(y). Differentiate j(t) with respect to t. 3 Find the second derivative of -2g - 2g2 - g2 + 7g - 2g2 wrt g. -10 Let k(h) be the first derivative of -h7/42 - h*3/2 - 3h - 4. Let j(o) be the first derivative of k(o). Find the second derivative of j(c) wrt c. -20c3 Let w(h) be the first derivative of 2h6/3 + h3 + 13h2/2 + 3h - 7. What is the second derivative of w(k) wrt k? 80k3 + 6 Let g(i) be the first derivative of 2i4 + i4 - 4i4 - 2i + 3. Differentiate g(o) with respect to o. -12o2 Let a(b) be the third derivative of -5b*6/24 - 11b*5/30 - 22b*2. Find the third derivative of a(i) wrt i. -150 Let w(z) = 2 - 4 + 5z*2 - z + 4 + 2. Let h(i) = -5i*2 + 2i - 5. Let a(m) = 4h(m) + 5w(m). Find the second derivative of a(n) wrt n. 10 Suppose -3c + 12 = 2s, 3s - 2c + c - 7 = 0. Differentiate 0r3 - 3r*s - 7 + 2r*3 with respect to r. -3r2 Let z(j) be the first derivative of j9/756 + j6/72 + j3/3 + 7. Let g(h) be the third derivative of z(h). Find the third derivative of g(k) wrt k. 240k2 Find the first derivative of 0 - 2 + 3 + 4 - 2i*2 wrt i. -4i Let t(m) = m - 1. Let b be t(10). Find the second derivative of -bk3 + 4k*5 + 9k*3 - k wrt k. 80k*3 Let k = 3 - 5. Let x(j) = 3j*4 + 2j*2 + 2j + 1. Let t(g) = 10g4 + 7g*2 + 7g + 3. Let y(c) = kt(c) + 7x(c). Differentiate y(i) with respect to i. 4i3 Let r(b) be the third derivative of b8/210 - b5/20 - 5b*3/6 + 10b*2. Let j(v) be the first derivative of r(v). Find the second derivative of j(p) wrt p. 96p2 Let s(c) = -c2 + 9c + 3. Let b be s(9). Suppose 8f - 5f = 0. What is the first derivative of 3 + fu - bu + u + 0 wrt u? -2 Let j(u) = u + 1. Let m(a) = 17a - 30. Let s(n) = 4j(n) + m(n). What is the derivative of s(b) wrt b? 21 What is the second derivative of -5r*3 - 1 + 19r - 24r + 1 wrt r? -30r Let o(z) be the third derivative of z9/6048 - z6/144 + z*5/30 - 10z*2. Let b(m) be the third derivative of o(m). What is the derivative of b(i) wrt i? 30i*2 Suppose 4a = -0a - 72. Let l be (-4)/a - (-86)/18. Find the second derivative of 0u*2 + 3u*5 + 2u - 7ul + 0u*2 wrt u. -80u*3 Find the second derivative of -2z + 13z3 - 20z*3 - 3z wrt z. -42z Let q(w) = 185w*4 - 40w. Let s(i) = -37i4 + 8i. Let v(z) = -2q(z) - 11s(z). What is the second derivative of v(h) wrt h? 444h2 What is the first derivative of -7g4 - g4 - g*4 - 24 wrt g? -36g*3 Let y(j) be the first derivative of 3j + 1/12j4 + 0j3 - j2 + 3. Let g(p) be the first derivative of y(p). Differentiate g(f) with respect to f. 2f Let f(k) be the first derivative of -5 + 2k*2 + 0k*5 + 0k + 0k4 + 1/6k*6 + 0k*3. Find the second derivative of f(o) wrt o. 20o*3 Let r(a) be the first derivative of -2a*5/5 + 4a - 2. Find the first derivative of r(f) wrt f. -8f3 Find the first derivative of -18l*2 - 20 + 12 + 37 wrt l. -36l Suppose 3c - 60 = -c. Suppose 0t + 4b + c = t, 0 = -2t + b + 16. Find the second derivative of u*3 - tu - 4u3 + 3u + 0u3 wrt u. -18u Suppose -3p = p. What is the third derivative of 4x*2 + 3x*5 - 2x*2 + px*2 - 2x*5 wrt x? 60x*2 What is the first derivative of -8 + 0d*2 - 9 + 13 + 8d*2 + 2d wrt d? 16d + 2 Let x(c) = c3 - 5c*2 + c - 1. Let f be x(5). Suppose 0 = -s - 5l + l, 5s - 5l = 25. Find the first derivative of -1 - 2 - 10ps + 8p*f wrt p. -8p*3 Suppose -3a - 5d = -6a - 123, a + 24 = -4d. Let p be a/(-10) - (-4)/10. Find the first derivative of 3 + 3h*4 - p - 2h*4 wrt h. 4h*3 Let n(w) be the first derivative of -7w*3/3 - 5w + 3. Differentiate n(o) wrt o. -14o Let h be (-2)/3 - (-24)/9. Let f(m) = -m + 1. Let u(b) = 2b. Let g(y) = hu(y) + 3f(y). What is the first derivative of g(w) wrt w? 1 Differentiate 13 + 12 + 10 - 34u with respect to u. -34 Let n be (1 - 1) + 0 - -2. Suppose 3s = -2s + 10. Find the first derivative of 1 + 0l*s - 2l*n + 1 + 2 wrt l. -4l Let u(f) = -3 + f + 5 - 3. Let y be u(3). What is the derivative of -yw2 - 1 + 0 + 2 wrt w? -4w What is the third derivative of -466v2 + 0v*3 + 433v*2 - 6v*6 + 0v*3 wrt v? -720v*3 Find the second derivative of 0m*4 - 3m*4 + 3m - 12m4 - 5m*4 wrt m. -240m2 Let d(n) be the third derivative of n8/1680 - n4/12 - n3/6 - 3n2. Let k(z) be the first derivative of d(z). What is the first derivative of k(t) wrt t? 4t*3 Find the second derivative of 25p + 40 + 35 - 73 - 41p2 wrt p. -82 Find the second derivative of 12z - 5z + 5z2 - 1 + 1 wrt z. 10 Let q(p) be the third derivative of p6/120 - 11p5/30 + p4/24 - 4p*3 - 40p*2. What is the second derivative of q(r) wrt r? 6r - 44 Let q(y) be the first derivative of y6/10 + y3/3 - 3y - 3. Let g(v) be the first derivative of q(v). What is the second derivative of g(x) wrt x? 36x2 Let j(r) = r2 - r. Let w(x) = -28x2 - 24x. Let h(p) = 6j(p) + w(p). What is the second derivative of h(u) wrt u? -44 Suppose 5k + 23 = -12. Let o = -5 - k. What is the third derivative of 3s2 - 5s*o + 2s*6 + 0s*6 wrt s? 240s*3 Let w(o) = -2o - 6. Let k = 18 - 7. Let z = 7 - k. Let f(s) = 2s + 7. Let y(h) = zf(h) - 5w(h). Find the first derivative of y(d) wrt d. 2 Let c(k) be the second derivative of 0k*2 + 0 + 0k*5 - 2k + 0k4 + 1/30k*6 + 1/6k*3. What is the second derivative of c(f) wrt f? 12f*2 Let v = 15 - 12. What is the derivative of -49n*3 + 3n + 4 - vn + 43n*3 wrt n? -18n*2 What is the derivative of -11 + 54n*3 - 28 + 12 wrt n? 162n*2 Let w(l) be the second derivative of 20l*7/21 + 11l*3/2 - 26l. What is the second derivative of w(x) wrt x? 800x3 Let j = -2 + 7. Find the third derivative of -8h*3 - 13h*3 - jh*2 + 27h3 wrt h. 36 Let b(d) be the second derivative of d7/1260 + d6/240 + d4/3 + d. Let c(p) be the third derivative of b(p). What is the second derivative of c(m) wrt m? 4 Let q(c) = 9c + 4c - 5c + 6 + c2. Let g be q(-8). Find the third derivative of -3s6 + s2 + s*g - 3s*2 wrt s. -240s3 Let p(a) be the third derivative of a4/3 - 7a3/2 + 13a*2. Differentiate p(j) with respect to j. 8 What is the second derivative of 28y + 3y4 - y4 - 28y*4 - 5y wrt y? -312y2 Let f(m) = -3m + 7. Let b(c) be the first derivative of 3c2/2 - 6c + 4. Let t(h) = 6b(h) + 5f(h). What is the derivative of t(k) wrt k? 3 Let k(i) = 21i4 + 3i*3 - 3i + 7. Let n(z) = 21z4 + 4z*3 - 4z + 7. Let u(g) = 4k(g) - 3n(g). Differentiate u(x) with respect to x. 84x3 Let w(z) be the second derivative of 7z*4/12 + 25z*2/2 + 12z. Find the first derivative of w(j) wrt j. 14j Let h be (-6)/4-2 + -1. What is the second derivative of -3w2 + 5w*h - 9 - 3w + 9 wrt w? 4 Let f(n) = -n5 + n3 - n - 1. Let v(i) = 32i5 + 5i*3 + 10i*2 - 5i - 5. Let o(d) = 5f(d) - v(d). What is the third derivative of o(y) wrt y? -2220y*2 Let b(o) = -10o2 + o - 4. Let g(i) = -i2 - i - 1. Let u(n) = b(n) + g(n). What is the first derivative of u(j) wrt j? -22j Suppose 0 = -4h - 33 + 13. Let x(g) = g*3 + 5g*2 + g + 7. Let s be x(h). Find the third derivative of 5z*5 + 3zs - z2 - 2z5 wrt z. 180z*2 Let r(p) be the first derivative of 0p + 2/3p3 + 0p*2 + 1/4p4 - 3. What is the third derivative of r(x) wrt x? 6 Let h(a) be the first derivative of -a4 + 3a2/2 + 6. Find the second derivative of h(j) wrt j. -24j Let v(k) be the first derivative of -33k4/4 - 9k + 30. Differentiate v(h) wrt h. -99h2 Find the third derivative of -539y + 539y + y*2 +	{ "pile_set_name": "DM Mathematics" }
-4? -3/2716 What is the nearest to -0.3 in 1, -10640, 143, 5? 1 Which is the nearest to -7/3? (a) -11 (b) -0.072 (c) -2/5 c What is the nearest to 0 in -0.2, 0.0687, -1/7? 0.0687 Which is the nearest to 218.9? (a) 46 (b) -3 (c) 3/11 (d) -0.3 (e) 2 a Which is the nearest to 4.3? (a) 2/9 (b) -12.65 (c) 1/9 a What is the closest to -0.2 in -5, -2, 2/367, -0.02, -8? -0.02 Which is the nearest to 0.1? (a) 0 (b) 0.5 (c) 0.17742 (d) -164 (e) 1/3 c Which is the nearest to 2/3? (a) 0.04 (b) -0.6 (c) 0.305 (d) 2/233 (e) -0.5 c Which is the nearest to -0.3? (a) -10 (b) 7227/4 (c) 1/2 (d) 0.4 d Which is the closest to 8.22569? (a) -4 (b) 13 (c) 0.2 b Which is the nearest to -0.5? (a) 0.14 (b) -18 (c) 177 a What is the closest to -2 in -6129, -5, -1/48, 5? -1/48 What is the closest to 2/7 in -4212, -1/3, 0.3, 8/3, -1/8? 0.3 Which is the closest to -5/3? (a) 0.2 (b) 26 (c) -2/43 (d) 3/110 c Which is the closest to -18? (a) 2/13 (b) -5 (c) 5 (d) 4.6162 b Which is the nearest to -0.1? (a) -4 (b) -66 (c) -3 (d) 1.51091 d What is the nearest to -1/11 in -692, -2, -1? -1 What is the closest to -5/6 in 6, 0.5, 3/7, -8/13, 1? -8/13 What is the closest to -0.1 in -514, -0.09, -1, 9681? -0.09 What is the nearest to -2/3 in 0.7, 0.65, -300, -1/4, 0.2? -1/4 What is the nearest to -0.1 in -95104, -3.6, 1/2? 1/2 What is the closest to 1 in 2, -2/9, 8, -37, -8? 2 Which is the nearest to 1? (a) 4/3 (b) -3/4655 (c) 2/7 a Which is the closest to -0.04? (a) 1328/5 (b) 1/4 (c) -7 (d) -4 b What is the closest to 0 in 0, -9, 1/2, 0.338, -0.158? 0 Which is the nearest to 2? (a) 1/10 (b) -0.13 (c) 1 (d) 4.8 (e) 0.4 (f) 3/82 c What is the nearest to 0.08029 in 1/6, -23, -3/10, -2? 1/6 Which is the closest to 1/4? (a) -107 (b) 3 (c) -12541 (d) 4 b Which is the closest to 10? (a) 4/9 (b) 4 (c) -150 (d) -6/181 b What is the nearest to 3 in -739, -1.1, -39, -0.4, -2/9? -2/9 What is the nearest to -7 in 0, -38, -5, 0.23, 3/11? -5 What is the nearest to 3/2 in 17/2093, 4, 50? 17/2093 What is the closest to 70 in -12, -13, 2/7, -7? 2/7 What is the closest to -1 in -14/5, 1/6, -101959, 5, -1/4? -1/4 Which is the closest to -344? (a) -2/27 (b) 0.0487 (c) 20 a Which is the nearest to -0.14? (a) 0.09 (b) 256 (c) -11 a What is the closest to 1 in -2.2, 6, -2/11, 0.5, -10, 0.0288? 0.5 What is the closest to 1/490 in 8, 10, -28, 4? 4 Which is the closest to -1? (a) -113295/19 (b) -4 (c) 5 b Which is the closest to 14850? (a) -15 (b) -0.3 (c) -3/4 b Which is the closest to 10? (a) -2 (b) 0.2 (c) 80 (d) 5 (e) -3.2 d What is the nearest to -204/139 in 4, 1, -3.2? -3.2 Which is the closest to 11/5? (a) -4/17 (b) 3/5 (c) -14 (d) -0.03 (e) -5/4 b Which is the closest to -2? (a) -308205/7 (b) -4 (c) -1 c What is the closest to -1 in 1/28, -1/6, 7.94, -125, -1/10? -1/6 What is the closest to 25/2 in 3/4, 2/7, -0.34638, -0.5? 3/4 Which is the nearest to 2793? (a) 3 (b) 1.6 (c) -5 (d) 0 (e) 0.1 a Which is the nearest to -0.3? (a) 1.3 (b) 412.8 (c) -1 c What is the closest to -1 in 1/250, 6, 0, 5, 15? 0 What is the closest to 1/9 in 43, 0, 1/29, 1, -1/27? 1/29 What is the nearest to -153 in -0.5, 1/5, -12, -3/8? -12 What is the nearest to 4 in 0, -17, 280? 0 What is the nearest to 0 in 0.126, 2.3, 0.3, -5, 2? 0.126 What is the closest to 0.01 in 17/2083, -3/7, 1? 17/2083 What is the nearest to -3/7 in -3/1267, -78, -17, 0.6? -3/1267 What is the nearest to 2/7 in 26552, -550/19, -3? -3 Which is the closest to -1971834? (a) -2 (b) 0.111 (c) -3/5 a What is the nearest to 0 in 4, 3, -103, 2478? 3 What is the nearest to 0.1 in -5, 2/23, 216, -70471, -2? 2/23 What is the nearest to -1/4 in 0.09, 1, 5.586? 0.09 Which is the nearest to -2/5? (a) -2 (b) 1269.73 (c) 3 (d) -0.03 (e) 1/4 d What is the nearest to 1/2 in -0.2, -0.305, -0.4, 0.1102? 0.1102 What is the nearest to 5/2 in 1178982, -2/3, 3/7? 3/7 What is the nearest to -1/3 in -123, 4, -1.084? -1.084 What is the closest to 7 in -2/5, 42/13, 26, -17, -3/8? 42/13 What is the nearest to -14.841 in -2/3, -0.4, 1.9, 1/4, 3? -2/3 Which is the nearest to 331? (a) 295 (b) 1 (c) -0.01 (d) -3 a Which is the closest to -2/7? (a) -1/4 (b) 19143/8 (c) 8 (d) 0.5 (e) -2/3 a Which is the nearest to -12/11? (a) 14 (b) 0.5 (c) 5/3 (d) 11.5 (e) 7 (f) -3 b Which is the nearest to 4? (a) -3 (b) -30 (c) 0.4 (d) -18/35 (e) -1/6 c What is the closest to 9 in -57024, 0.3, -0.4, 5, -0.1? 5 Which is the closest to 1/2? (a) 0.7 (b) -17 (c) -3.63 (d) 2/17 (e) -0.4 a Which is the nearest to 1/6? (a) 1 (b) 7 (c) -3 (d) 9 (e) -46 a What is the closest to 3/4 in -6/11, 0.4, 12, 2, -0.33? 0.4 Which is the nearest to 1/258? (a) 0.1 (b) 2.7 (c) -5/4 (d) 36 a What is the closest to 27 in -13548, 3, 0.3, 1? 3 What is the nearest to 161088 in 0, -1/3, 2, -0.3, 2/3, 1/3? 2 Which is the closest to 0.074? (a) -2/15 (b) 8/11 (c) -0.383 a Which is the nearest to 0.1? (a) 69192 (b) -63 (c) 1 c Which is the closest to 299? (a) -9 (b) -2/9 (c) -5 (d) 45 (e) 1 d What is the closest to -1 in -2/7, 76, 1712, -0.4, -3, -0.01? -0.4 Which is the closest to 0? (a) -0.019 (b) -3/4 (c) 0.08 (d) 1/5 a Which is the nearest to 3? (a) -2/5 (b) -2/9 (c) 0 (d) -92.1 (e) 12 c What is the nearest to -20/11 in 1, 3/10, 0, -0.5? -0.5 What is the nearest to 0 in -1/2810, 0, -1, -2/7? 0 Which is the nearest to -4? (a) 4/5 (b) -49/810 (c) -17 (d) -1 d Which is the closest to -3/7? (a) -1/27 (b) 3/2 (c) 0 (d) -5 a What is the closest to 1 in -18/49, -1/5, 0.2, 1375? 0.2 Which is the nearest to -4/5? (a) 3 (b) -6 (c) 2/191 c What is the closest to -0.1 in 14587, 0, 0.03, 1, -116? 0 Which is the closest to 15? (a) -13 (b) -1 (c) -5 b Which is the nearest to -2/19? (a) 11/2 (b) 2/13 (c) -7674 (d) 6 b What is the nearest to 19 in 4/13, 2/5, 23.7? 23.7 Which is the closest to -1/3? (a) -38 (b) 3/1250 (c) -17 b What is the closest to -11 in 0.2, -1/10, 21, 2/5, -50? -1/10 Which is the closest to 225496? (a) -3 (b) 4 (c) -0.4 b What is the closest to -1 in -524, -7/6, 0.27, -0.3? -7/6 Which is the nearest to 2/7? (a) 0 (b) -1 (c) -2/21 (d) -70796 (e) 2 a Which is the closest to -1/2? (a) -5 (b) 0.608 (c) -414 (d) 0.6 (e) 1 d What is the nearest to 1/19 in -5, -1706/13, -2, -1? -1 What is the closest to 6 in -2/159, -4, -1960? -2/159 Which is the nearest to 0.16? (a) -0.072 (b) -24 (c) -21/5 a What is the nearest to 315 in -789.58, -0.3, -1/4? -1/4 What is the closest to 2485 in 17, -0.078, -2? 17 Which is the closest to 2? (a) -98/3 (b) 6 (c) -594 b What is the nearest to 1/3 in -50/13, -0.4, 353? -0.4 Which is the nearest to -1/12? (a) 7.8 (b) -1/14 (c) -0.4 b What is the nearest to -1 in 2, 9, -0.2, 7/1180? -0.2 Which is the closest to 0.1? (a) -1/14 (b) -15 (c) 4 (d) -12.321 a Which is the nearest to 0? (a) -4624 (b) 0 (c) 5 (d) 1/2 (e) -2 (f) 0.4 b Which is the nearest to -3? (a) 0.4 (b) -1741 (c) 9 (d) 5 (e) 201 a What is the closest to -40306 in 4, -117, 2? -117 Which is the closest to -0.5? (a) 1/674 (b) 18 (c) -647 a What is the closest to -42 in 28, 242, 4/3, 2, 4? 4/3 Which is the nearest to -4? (a) -1.1 (b) 1 (c) -1/2115 a Which is the closest to 0.1? (a) -1/2 (b) -3 (c) -5 (d) 1/30 (e) -57 d What is the nearest to -1/2 in 1/2, 0.1, -1, -2, -310? -1 What is the nearest to 4 in 3/70, 3, 121? 3 Which is the nearest to 2/15? (a) 1/6 (b) 0.4 (c) -3/13 (d) 1.7 (e) 18/7 a What is the closest to 3 in -1/26, 4.75, 4? 4 What is the nearest to -1/9 in 3/4, 0.079, -2/2151, -0.2? -0.2 Which is the nearest to 0? (a) -1 (b) -1/4 (c) -36 (d) 106 (e) 0.3 b What is the nearest to -1709 in -0.421, -2/11, 5, -4/7, -1? -1 What is the nearest to -266 in 1, 0.05, -0.077, -0.1, 0? -0.1 Which is the nearest to 390? (a) -0.3 (b) 3.15 (c) 0.2 (d) 3 (e) 0.5 (f) 0.4 b What is the nearest to -438 in -1/23, -0.2, -1/6, -2/13, -1? -1 What is the closest to -5090 in -0.2, -2/15, 0, 0.03? -0.2 Which is the closest to 1/2? (a) -0.7 (b) 0.5 (c) -3/7 (d) -12 (e) 2/2323 b What is the nearest to 3/7 in 13, 16, -0.7, 5, -5? -0.7 Which is the closest to -1/1957? (a) 0.5 (b) 1/15 (c) 3/5 (d) -1 b What is the	{ "pile_set_name": "DM Mathematics" }
+ 112.8. Let i = -2.9 - s. Let y = i - 7. What is the biggest value in -0.4, y, 0? y Let f = 38 + -43. Let z = -1.1 - -0.1. Let h = z + 5. What is the biggest value in f, h, -0.3? h Let m = 156 - 163.3. Let l = m - -7. Which is the third biggest value? (a) l (b) 4/5 (c) 1/3 a Suppose 0 = -3n + 15, 3n = -4c + 2c - 135. Let o be 1/(-2 - c/39). What is the third smallest value in -4, o, -1/2? -1/2 Let y = -0.05 + 0. Let v = y - 0.25. Let c = 1 - 1. What is the biggest value in c, v, -4? c Let c = 31 - 30. Let w = 0.07 - -0.43. What is the smallest value in c, -4/5, w? -4/5 Suppose -u - 8 = u. Let l = -41 + -147. Let o = l - -1313/7. Which is the third smallest value? (a) o (b) 4 (c) u b Let u = 66 + -67. Which is the third smallest value? (a) 3/4 (b) 2/23 (c) 0.5 (d) u c Let v = 0.55 + -0.65. Which is the second biggest value? (a) -3 (b) 0.5 (c) v (d) 5/4 b Suppose 6 = 4l - 2. Let k = -0.45 - -0.75. Which is the second smallest value? (a) 3/4 (b) l (c) k a Suppose 0 = -y - 2y. Let z = -2 + y. What is the second biggest value in -0.2, z, 2? -0.2 Let h = -80 + 83.3. Let g = h + -0.3. Let j = g - 4. Which is the third biggest value? (a) 3/7 (b) j (c) 0.1 b Let o = -0.25 + 0.05. Let z = 0.1 + 0.2. Let t(g) = 2g2 + 9g - 4. Let r be t(-5). Which is the biggest value? (a) z (b) r (c) o b Let p = -3.04 - -0.04. Let g = p + 1. Let o = -47/3 - -16. Which is the third smallest value? (a) g (b) 0 (c) o c Let u be 3 - (-1 - (-2 - -2)). Let i be (-1)/2 + u/12. What is the biggest value in 4, i, -1? 4 Let q = 4 + -3.9. Let f = 0.15 + -0.85. Which is the second smallest value? (a) f (b) q (c) 4 b Let t = 6.97 + -7. Let l = t - -1.03. What is the second smallest value in 1/4, -0.4, l? 1/4 Let h = -15 + 14.6. Let l = -5 - -4.7. What is the biggest value in h, 0.5, l? 0.5 Let d be 1/2 + 1554/(-1860). Let i = -2/31 + d. Which is the biggest value? (a) 3/2 (b) -4 (c) i a Let o be ((-3)/(-38))/(6/8). Let w = -22.3 + 22. Which is the smallest value? (a) 2 (b) o (c) w c Let x = 0.21 - 0.21. Let d = 0.4 - 0.5. What is the third biggest value in x, -0.04, d? d Let z = -0.499 - -0.399. Let f = -1527/11 - -139. Which is the biggest value? (a) f (b) z (c) 2/17 a Let x = 13/14 + -3/7. What is the third biggest value in x, -0.2, -0.4? -0.4 Let l(n) = -2n + 4. Let w be l(2). Let t = -1 - -5. Let q be (-6)/30 + t/(-5). Which is the biggest value? (a) q (b) w (c) -2/13 b Let d = 3 + 20. Let n be -2 + 4 + (-40)/d. Let s = n - -4/161. Which is the second smallest value? (a) -3/5 (b) 1 (c) s c Let f = 12 - 11.93. Which is the second smallest value? (a) 2 (b) -5/2 (c) f c Let v = -0.5 - -1.5. Let y be -3 + 0 - 0/(-3). What is the biggest value in 1/6, y, v? v Suppose -1 = x + 2m + 5, -3x - 4m = 16. What is the third smallest value in 1, -2/5, x? 1 Let v(p) = p*2 - 12p + 10. Let w be v(8). Let r be (-3 + (-74)/w)/(-2). What is the second biggest value in -1, 1, r? r Suppose 0s = -4s - i - 1, 3s - 4i - 4 = 0. Let d = s + 2. Which is the smallest value? (a) d (b) 1 (c) -8 c Let i = 15 + -10. Which is the third smallest value? (a) 0.5 (b) -1/10 (c) i (d) -5 a Let s = -0.26 - -0.06. Let i = 1 - -3. Suppose 5f - 2 = 2q, 0 = if + f + 2q + 2. Which is the smallest value? (a) 4 (b) s (c) f b Let j = 1.9 + -0.9. Which is the third smallest value? (a) -5 (b) j (c) -0.2 b Let q be 49/(-70) + (-2)/(-10). What is the second smallest value in q, 0.5, 0? 0 Let y = -5 + 23/5. What is the biggest value in -1, 2, y? 2 Suppose -2o + 3n - 13 = 0, -4n + 0 = 5o - 2. Let q = 404.07 + -401. Let t = -0.07 + q. What is the third biggest value in o, -0.1, t? o Let h = 7 + -7.3. Let j be (3/(-3) - -1)/(-2). What is the third biggest value in 3, j, h? h Let p = 9 + -8. Which is the third biggest value? (a) 2 (b) p (c) -4 c Let k be ((-20)/40)/((-1)/(-2)). Which is the biggest value? (a) 2 (b) k (c) 0 a Let l = -15 + 19. What is the second biggest value in 0.07, -0.2, l? 0.07 Let j = -90 + 89.6. Which is the third biggest value? (a) j (b) 4 (c) 5 a Let s = 28.5 + -28. What is the third smallest value in -5, s, -4? s Let p be 3/(-12) - 6/(-56). Let w(k) = k + 9. Let i be w(-9). What is the second biggest value in i, 3, p? i Let f = 5/27 - 79/135. Which is the smallest value? (a) -0.5 (b) -12 (c) -0.2 (d) f b Let x = -145.5 - -146. Let h = 10 - 15. Which is the second smallest value? (a) -0.5 (b) x (c) h a Let o = -0.862 + -0.138. Which is the smallest value? (a) 41 (b) -4 (c) o b Let n be 5/12 + 2/8. Let l(k) = k - 4. Let g be l(3). Let w be g/22 - -3. Which is the third smallest value? (a) n (b) -0.1 (c) w c Let s = 1 + -0.8. Let a(r) = -r2 - 11r + 9. Let g be a(-12). What is the second biggest value in s, -0.4, g? -0.4 Let n = 0.1 - -0.9. Let g = 2.6 + -6.6. Let f be (-2)/(-8) + (-2)/24. Which is the second biggest value? (a) n (b) f (c) g b Let u = -3 - -6. Suppose uw - 7w + 8 = 4m, -22 = -5w + m. Let d be 4/22 - 21/77. Which is the third biggest value? (a) d (b) 1 (c) w a Let b = 0.5 + -0.8. Let k = -1 + 1.4. Let x = k + b. What is the third biggest value in x, -1, 4? -1 Let k = 44 - 44. Let x(v) = -v*3 - 3v*2 - 2v + 2. Let z be x(-2). Suppose k = -0u - zu - 4. Which is the smallest value? (a) -2/13 (b) u (c) -0.3 b Let p = 0.3 + -0.2. Let k = -2.21 - -1.71. What is the biggest value in k, 3, p? 3 Let q = -15 - -15.05. What is the smallest value in q, -0.3, -4? -4 Suppose -2q - 3q + 17 = 4v, 2q - 3v - 16 = 0. Let j be (-1)/q - 17/(-35). Which is the third biggest value? (a) -0.2 (b) 1 (c) j a Suppose 3m + 0 = 4z - 1, -5z - 3m = -35. What is the third biggest value in -0.3, z, 0.3? -0.3 Let s = -137/189 - -17/27. Suppose -4l + 1 - 9 = 0, -5q + 16 = 2l. Let g be q/10 + 18/(-18). What is the third biggest value in -1, g, s? -1 Let n = 2.07 - 2.2. Let m = n + -0.37. Which is the second smallest value? (a) -4 (b) m (c) 1 b Let u = -5 - -5.4. Let h = 0.5 + 0.3. Let c = h + -0.5. What is the second biggest value in c, 0.1, u? c Let o be ((-11)/(-3))/(2/(-12)). Let z = o - -65/3. Let d be (-15)/(-10)2/6. What is the third smallest value in d, z, -0.2? d Let d = -2 - 1. Let q = d + 3.1. Suppose 14l + 2 = 16l. Which is the smallest value? (a) l (b) q (c) -1/4 c Let v be 6 - -310/(-15). What is the third smallest value in 5, -2, v, 0.2? v Let z = -1.313 + 0.313. Let q = -2 + 2. Let y = 129 + -391/3. Which is the second biggest value? (a) z (b) q (c) y a Let f = -3.3 + 3.3. Which is the biggest value? (a) f (b) -3 (c) 0.5 c Let q = 0.39 + -0.59. Let h = -1 - -1.1. What is the third biggest value in q, -5, h? -5 Let y = -10 + 5. Let h = -0.06 - 1.94. Let g = h + 3. What is the third biggest value in 1/2, y, g? y Let w = 23 - 17. Let i = w + -9. What is the second smallest value in 1, -0.5, i? -0.5 Let s be ((-84)/9)/(-4) - 3. What is the biggest value in -1/2, 0.1, s? 0.1 Let j = 37 - 23. Let r = j + -15. What is the third smallest value in -3, r, -0.3? -0.3 Let n = 11 - 11. What is the biggest value in n, -0.2, -2? n Let t be (-2)/(-4) + 5/10. What is the third biggest value in t, 2/9, -0.2, 2? 2/9 Suppose 0n + 4n - 2n = 0. Which is the third biggest value? (a) n (b) -0.09 (c) -0.4 c Let y = -100 + 99.8. Let v = 1.3 - 0.3. What is the third biggest value in y, 0.3, v? y Let j = -2/45 + 32/45. Let d = 109/24 + -14/3. Which is the third biggest value? (a) j (b) d (c) 3 b Let l = -1.96 + -0.04. Let d = -1 - l. Let x(j) = -j3 + 2j*2 - 3j + 15. Let w be x(3). What is the smallest value in w, -5, d? -5 Let v be 0 + (-3)/(18/(-4)). Let u = -0.18 + 0.29. Let h = -0.01 + u. What is the third biggest value in h, 5, v? h Let u = 6.3 - 7. Let o = u - -2.7. Which is the second smallest value? (a) o (b) -1/13 (c) -5 b Let z be (3/153)/((-6)/18). Which is the fourth biggest value? (a) z (b) 4 (c) 0 (d) -0.5 d Let x = 0.05 - 2.05. Let d = x - -1. What is the third biggest value in 0, -0.1, d? d Suppose 5k = -5u, -k - 2 = -2u + 10. Suppose -12 = -uc - 28. Let d = -174/77 - -28/11. What is the biggest value in 0.5, c, d? 0.5 Let r be (28/(-35))/(18/(-15)). Let w = -0.9 - -0.6. Which is the third smallest value? (a) r (b) 2/9 (c) w a Let u = -14.7	{ "pile_set_name": "DM Mathematics" }
)/(sqrt(72)/(sqrt(24)/sqrt(2))). -2sqrt(17) Simplify ((2 + sqrt(1584) + 1)1)*2. 72sqrt(11) + 1593 Simplify (sqrt(1300) + -2(1 + sqrt(1300)) + -4)2. 120sqrt(13) + 1336 Simplify -2 + -4sqrt(13) + 1. -4sqrt(13) - 1 Simplify (2 + sqrt(4)/sqrt(2))*2 + sqrt(2) + sqrt(16)/sqrt(2). 6 + 7sqrt(2) Simplify -4(sqrt(1053) + 1)2 - (4(sqrt(637) - (0 + sqrt(637))))*2. -4216 - 72sqrt(13) Simplify sqrt(17) + 2 + 0 + 5. sqrt(17) + 7 Simplify 1 + (5 + 2sqrt(405) - sqrt(405)) + -3 + (sqrt(405)1)*2 + sqrt(405). 18sqrt(5) + 408 Simplify 3 + (sqrt(208) + -2)*2. -16sqrt(13) + 215 Simplify -4(-1 + sqrt(1331) + sqrt(1331)) - (3 + (sqrt(1331) + -2)2). -1334 - 44sqrt(11) Simplify (0 + sqrt(1088))*2 + ((sqrt(612)-2 - sqrt(612) - sqrt(612))*2 - sqrt(612)). -6sqrt(17) + 10880 Simplify -53sqrt(32). -60sqrt(2) Simplify (1(sqrt(68) - (sqrt(68) + sqrt(68) + -1)5))2. -180sqrt(17) + 5533 Simplify (-5sqrt(117)/sqrt(3))/(sqrt(363)1). -5sqrt(13)/11 Simplify -2(sqrt(147) + 1) + 1. -14sqrt(3) - 1 Simplify (2(sqrt(12) - sqrt(300)))/(sqrt(18)/(sqrt(3) - sqrt(12))). 8sqrt(2) Simplify (((sqrt(448) - (sqrt(448) + (sqrt(448) - sqrt(448)-1))) + 5)-34)*2. -23040sqrt(7) + 261648 Simplify 3 + sqrt(176)2 + sqrt(44)/(sqrt(16)/sqrt(4)) + 5. 8 + 9sqrt(11) Simplify -1 + (sqrt(475)-2 - (-3 + (sqrt(19)-1 - sqrt(19))))*2. -48sqrt(19) + 1224 Simplify (2sqrt(1620))/(5(sqrt(10) - (sqrt(10) - sqrt(360)))). 3sqrt(2)/5 Simplify (sqrt(5) - sqrt(125))5 + (-4sqrt(20) - sqrt(5)). -29sqrt(5) Simplify (((sqrt(280)-1)/sqrt(8))/(sqrt(1008) - sqrt(1008)2)-2)2. 5/36 Simplify ((1sqrt(95) + sqrt(95))/sqrt(5))*2 + sqrt(19) + 3sqrt(19)2 - ((sqrt(19) + 0)-6 + -5)*2. -633 - 53sqrt(19) Simplify (-1(0 + (sqrt(9)/sqrt(3) - sqrt(3))))2. 0 Simplify (((-3sqrt(136) - sqrt(136)) + sqrt(136))-6 + sqrt(136))/(sqrt(8) - (sqrt(88)/(sqrt(11) + sqrt(66)/sqrt(6)) + sqrt(8)) - sqrt(8)). -38sqrt(17)/3 Simplify (-2(sqrt(5) + -2 - sqrt(5)) - (-5 + sqrt(5) + 2))2. -14sqrt(5) + 54 Simplify sqrt(104)/(sqrt(288) + sqrt(8))4. 4sqrt(13)/7 Simplify -2 + ((4sqrt(1300))2 - sqrt(13)). -sqrt(13) + 20798 Simplify sqrt(468) + 1 + 2. 3 + 6sqrt(13) Simplify (sqrt(35)/(sqrt(605)2 + sqrt(5)))2. 7/529 Simplify (-2sqrt(720) + sqrt(720))5. -60sqrt(5) Simplify -2sqrt(275)-1. 10sqrt(11) Simplify (sqrt(9072) + (-2sqrt(9072) - sqrt(9072) - sqrt(9072)) + sqrt(63))/(sqrt(576)-3). 35sqrt(7)/24 Simplify ((sqrt(480)/(sqrt(12)1))/(-6sqrt(72)))*2. 5/324 Simplify (sqrt(52)2)*2 + sqrt(39)/sqrt(3)-1. -sqrt(13) + 208 Simplify 2((1 + sqrt(2057))2 + sqrt(2057)). 66sqrt(17) + 4116 Simplify (5sqrt(168)/sqrt(3))/(2sqrt(392)). 5sqrt(7)/14 Simplify -22(1sqrt(5) + 3). -12 - 4sqrt(5) Simplify 5((sqrt(48) - (sqrt(48) + -1))-4-1)*2. 80 Simplify ((sqrt(396) + -2)1)*2. -24sqrt(11) + 400 Simplify (sqrt(637) + -1)*2-1. -638 + 14sqrt(13) Simplify (3 + sqrt(1053) + 0 + sqrt(1053) + sqrt(1053))2. 162sqrt(13) + 9486 Simplify 0 + 1 + sqrt(75) + sqrt(75). 1 + 10sqrt(3) Simplify (sqrt(170) + sqrt(170)-1)/sqrt(10) - (sqrt(17) + (3sqrt(272) - sqrt(272))). -9sqrt(17) Simplify (-1(sqrt(152) + 2sqrt(152)))/sqrt(512). -3sqrt(19)/8 Simplify ((sqrt(847) + 4 + -5)6)*2. -792sqrt(7) + 30528 Simplify (sqrt(637) + sqrt(637) + -1 + -5 - sqrt(637))*2 + 5. -84sqrt(13) + 678 Simplify (sqrt(36)/sqrt(3))*2 + sqrt(363)4. 12 + 44sqrt(3) Simplify (sqrt(6)/(sqrt(363)-4) + -4)*2. 2sqrt(2)/11 + 15489/968 Simplify 1(sqrt(128)/sqrt(4) + 2 - sqrt(32)). 2 Simplify ((sqrt(128) + 3)-4)*2 - sqrt(128). 760sqrt(2) + 2192 Simplify (-5sqrt(3)1 + sqrt(243)1 + -2)2. -16sqrt(3) + 52 Simplify (5 + sqrt(1053) + sqrt(1053) + -1 + sqrt(1053))*2 - 4(-2sqrt(1053))2. -7355 + 216sqrt(13) Simplify 1 + sqrt(34)/sqrt(2) + (sqrt(102)/(sqrt(36)/sqrt(6)) + sqrt(17))*2. sqrt(17) + 69 Simplify 5sqrt(88)/(1sqrt(8)). 5sqrt(11) Simplify sqrt(22)/(6(sqrt(11) + sqrt(275)))-1. -sqrt(2)/36 Simplify (-1(0 + sqrt(7) + sqrt(7)))2 + 5 + -1 + sqrt(7) + sqrt(252) + -1. 7sqrt(7) + 31 Simplify (sqrt(19) - (2 + sqrt(1216)) - sqrt(76)5)2 + 2. 68sqrt(19) + 5497 Simplify (sqrt(684)-1 + 2)2 + 4. -24sqrt(19) + 692 Simplify 4 + (sqrt(50) + -2)*2. -20sqrt(2) + 58 Simplify ((sqrt(4)/sqrt(2) + sqrt(2))2 - (sqrt(32) + 5))2. 25 Simplify (0 + sqrt(300) + (sqrt(3) - sqrt(48))5)3. -15sqrt(3) Simplify -3 + sqrt(132)/(sqrt(300)-6 - sqrt(12)). -3 - sqrt(11)/31 Simplify ((1sqrt(24)1)/sqrt(1200))2. 1/50 Simplify (-3sqrt(2560))/(sqrt(48)/(sqrt(6) + sqrt(384))). -216sqrt(5) Simplify ((sqrt(102) + (sqrt(102) - -6sqrt(102)2) - sqrt(102))/(sqrt(864)/sqrt(9)))2. 2873/16 Simplify (-5(sqrt(13) - sqrt(468))1)2. 8125 Simplify (-3sqrt(416))/sqrt(2). -12sqrt(13) Simplify -5 + (sqrt(13) - (sqrt(325)2)2). -1305 + sqrt(13) Simplify 3 + (sqrt(7) - (-2 + (sqrt(7) - sqrt(21)/sqrt(3))))2. 4sqrt(7) + 14 Simplify sqrt(847)-21. -22sqrt(7) Simplify ((sqrt(448) - (sqrt(448) + -1)) + 5 - sqrt(448)) + -3. -8sqrt(7) + 3 Simplify (sqrt(51)/(-4sqrt(12)/sqrt(4)))*2. 17/16 Simplify (sqrt(304) + 0)5. 20sqrt(19) Simplify (1 + (sqrt(1700) - sqrt(17)) - (sqrt(17) + 4 + 2))2. -80sqrt(17) + 1113 Simplify (-52sqrt(324))/sqrt(12). -30sqrt(3) Simplify (-2 + sqrt(567))2 + -4 + sqrt(63) + -1. -33sqrt(7) + 566 Simplify (sqrt(19) + -1sqrt(1539))2 + (sqrt(190)-1)/sqrt(10) + 4. -sqrt(19) + 1220 Simplify (sqrt(1539) + sqrt(19))-2 + (sqrt(342)/sqrt(6))/sqrt(3). -19sqrt(19) Simplify -4(sqrt(176))2 - (-1sqrt(11) + 0). -704 + sqrt(11) Simplify (-1(sqrt(119)-1 - sqrt(119)))/((-2sqrt(21))/sqrt(3)). -sqrt(17) Simplify (sqrt(1088) - 1-1sqrt(1088)) + -2(sqrt(272))*24. -2176 + 16sqrt(17) Simplify (sqrt(55)/(-3sqrt(5)))*22. 22/9 Simplify (-5sqrt(550))/(sqrt(8)/sqrt(4)4). -25sqrt(11)/4 Simplify -6(4 + sqrt(108) + 3). -36sqrt(3) - 42 Simplify sqrt(95)/(sqrt(30)/(sqrt(6)1)). sqrt(19) Simplify (sqrt(1331) - (1 + sqrt(1331))) + 2 + 4 + (sqrt(1331) + -3sqrt(1331))2. 5329 Simplify 4((sqrt(275) - sqrt(275)-1)2)*2. 17600 Simplify 4(0 + sqrt(171) + sqrt(19)). 16sqrt(19) Simplify ((sqrt(84) + 2sqrt(84))/sqrt(3))*2. 252 Simplify -3 + sqrt(11)-1 - 1sqrt(44)/sqrt(4). -2sqrt(11) - 3 Simplify sqrt(5) + ((sqrt(100)/sqrt(5))/sqrt(4) - sqrt(5)) - ((-5sqrt(5)6)*2 + sqrt(5)). -4500 Simplify (3sqrt(2156))/((sqrt(4) + (sqrt(4) - sqrt(64)))-1). 21sqrt(11)/2 Simplify (sqrt(1458) - (-3sqrt(1458) - sqrt(1458)) - sqrt(18))/(sqrt(6) + (sqrt(294) - (sqrt(294) - (1sqrt(294) + sqrt(294)))) + sqrt(6)). 11sqrt(3)/4 Simplify (2(sqrt(208) + 0))*2. 832 Simplify (-6(-1 + sqrt(19)))*2 - (sqrt(19) - (sqrt(475) + -1)). -68sqrt(19) + 719 Simplify sqrt(27)-3 + -2. -9sqrt(3) - 2 Simplify 4 + sqrt(68) + -1. 3 + 2sqrt(17) Simplify (3(-2 + sqrt(125)))*2. -180sqrt(5) + 1161 Simplify (5(sqrt(13) + 1) - sqrt(13)) + -2. 3 + 4sqrt(13) Simplify sqrt(132)/(sqrt(72)/(1sqrt(6))) - (sqrt(396) + -2(1 + sqrt(396)))*2. -400 - 23sqrt(11) Simplify 1 + (1 + sqrt(3) + -2 - -1sqrt(48)). 5sqrt(3) Simplify 4(sqrt(99) + 2 + -4)2. -48sqrt(11) + 412 Simplify 6-1sqrt(95)/sqrt(5). -6sqrt(19) Simplify 6(sqrt(19) + -2) - (sqrt(19)-1 + -1). -11 + 7sqrt(19) Simplify ((5(sqrt(76) - sqrt(76)2))/sqrt(4))*2. 475 Simplify ((sqrt(77) - sqrt(77)1-5)/sqrt(7))2. 396 Simplify (sqrt(187)/(sqrt(11) - (sqrt(99) + sqrt(11))))2 + -3. -10/9 Simplify sqrt(209)/(-3sqrt(1331)). -sqrt(19)/33 Simplify -4(sqrt(88)/(sqrt(32)/sqrt(4)))2-3. 132 Simplify (sqrt(170) - (sqrt(170) + 2sqrt(170)5))/((2sqrt(1210) - sqrt(1210)) + sqrt(1210) - sqrt(1210)). -10sqrt(17)/11 Simplify (1 + sqrt(200) + 0)*2. 20sqrt(2) + 201 Simplify (6(sqrt(190) + (sqrt(190) - (sqrt(190) - (2sqrt(190) + sqrt(190))))))/sqrt(10). 24sqrt(19) Simplify sqrt(117)/((sqrt(90) - -2sqrt(90))/sqrt(10)) - ((sqrt(13)2 + -3)2 + 1). -62 + 37sqrt(13)/3 Simplify sqrt(117)/(1sqrt(81)/sqrt(9)). sqrt(13) Simplify -4 + -5 + sqrt(52) + 5. -4 + 2sqrt(13) Simplify (sqrt(1008) + sqrt(1008)1 - sqrt(1008))21. 1008 Simplify (-2sqrt(1331) + 4)2. -176sqrt(11) + 5340 Simplify -3(sqrt(300) + sqrt(3))2. -1089 Simplify sqrt(40)/(1sqrt(8)) + -3 + (2sqrt(5))2. sqrt(5) + 17 Simplify (2(sqrt(19) + 2))*2 + sqrt(19) + -2 + 1. 17sqrt(19) + 91 Simplify (sq	{ "pile_set_name": "DM Mathematics" }
e 19k - 25k = 12 for k. -2 Solve 0 = -5y - 8y + 52 for y. 4 Solve 33k + 84 = 12k for k. -4 Solve -14 - 10 = 12f for f. -2 Solve 56 = -16k - 40 for k. -6 Solve 0 = 8y - 46 + 14 for y. 4 Solve 23p + 15 = -77 for p. -4 Solve -96 = -547b + 559b for b. -8 Solve 41j = 10j for j. 0 Solve 380q - 378q = -6 for q. -3 Solve 4d - 3d = -4 for d. -4 Solve -34v + 24 = -10 for v. 1 Solve 28c + 48 = 36c for c. 6 Solve -24i = -28i - 4 for i. -1 Solve 46 + 2 = -8y for y. -6 Solve 188v = 191v for v. 0 Solve r - 58 + 61 = 0 for r. -3 Solve 232 = -133y - 34 for y. -2 Solve -56 = -9l - 5l for l. 4 Solve -18t + 144 - 72 = 0 for t. 4 Solve 0 = 148n - 130n + 54 for n. -3 Solve 1 = -15w + 16 for w. 1 Solve 0 = 6x - 90 + 108 for x. -3 Solve -9m + 13m - 8 = 0 for m. 2 Solve 0 = 13w - 189 + 72 for w. 9 Solve -235 + 107 = 16i for i. -8 Solve 0 = 7r + 80 - 31 for r. -7 Solve -19d + 3 = -16d for d. 1 Solve 14 - 29 = -3d for d. 5 Solve -84j - 31 - 389 = 0 for j. -5 Solve 286v + 6 = 280v for v. -1 Solve 0 = -39y - 25y - 256 for y. -4 Solve -q - q = -6 for q. 3 Solve -2j - 2 - 4 = 0 for j. -3 Solve -8b + 12 = -12b for b. -3 Solve -q = 14 - 8 for q. -6 Solve -1 = 15f - 14f for f. -1 Solve 13y = 162 - 97 for y. 5 Solve 0 = 24k - 14k - 10 for k. 1 Solve -64i = -23i + 369 for i. -9 Solve -7z + 7 = 28 for z. -3 Solve -108l + 117l = 81 for l. 9 Solve 0k = 5k + 20 for k. -4 Solve -21 = 9m + 6 for m. -3 Solve 0c = -c + 4 for c. 4 Solve -13 = 35d - 22d for d. -1 Solve -20 = -5i - 15 for i. 1 Solve 302w - 306w + 28 = 0 for w. 7 Solve 5x + 16x - 21 = 0 for x. 1 Solve 0 = 43o - 76o + 297 for o. 9 Solve -8n = 130 - 170 for n. 5 Solve 16d - 3d = -26 for d. -2 Solve -28 = 14l + 14 for l. -3 Solve -25d + 544 = 43d for d. 8 Solve -122r + 123r - 4 = 0 for r. 4 Solve -63 + 113 = -25i for i. -2 Solve f + 2 = -f for f. -1 Solve -31 = -18f + 59 for f. 5 Solve 0u + 3u - 6 = 0 for u. 2 Solve 0 = -4i + i + 3 for i. 1 Solve -3445f = -3459f for f. 0 Solve 0 = -21n + 3 - 129 for n. -6 Solve 3g = -9g for g. 0 Solve 644h - 82 = 685h for h. -2 Solve 27z - 22z = 5 for z. 1 Solve 10 = -2u + 8 for u. -1 Solve -13z + 5z + 24 = 0 for z. 3 Solve 0 = 4s + 4 + 8 for s. -3 Solve -44 = -23z + 25 for z. 3 Solve 0 = 13w - 9w + 20 for w. -5 Solve 24v + 23v = 47 for v. 1 Solve 10v - 24 = 16v for v. -4 Solve 0 = -24l + 63 - 15 for l. 2 Solve -60p + 44p = 112 for p. -7 Solve -4k + 38 = 26 for k. 3 Solve -261y = -263y + 16 for y. 8 Solve -2m + 11m = 45 for m. 5 Solve 40z + 20 = 45z for z. 4 Solve 9 = -6l + 21 for l. 2 Solve -7c + 30 = 3c for c. 3 Solve -4y + 3y = -5 for y. 5 Solve -48 = 10n + 14n for n. -2 Solve 8 = -3x + 8 for x. 0 Solve 4x + 14 = -6 for x. -5 Solve -6z - 28 = 2 for z. -5 Solve -25o - 27 = -16o for o. -3 Solve -253u = -264u + 66 for u. 6 Solve 3s = -87 + 72 for s. -5 Solve 0 = -28h + 15 + 41 for h. 2 Solve -7l + 14 = 21 for l. -1 Solve 0 = -12z + 168 - 192 for z. -2 Solve -4c + 13 = 21 for c. -2 Solve -24n = -17n + 28 for n. -4 Solve -91 = -44x + 261 for x. 8 Solve 214 - 226 = -12f for f. 1 Solve 0 = -883z + 866z + 85 for z. 5 Solve 6 = -18u + 21u for u. 2 Solve -3h = h - 20 for h. 5 Solve -77 = -25u + 48 for u. 5 Solve -17f + 785 - 751 = 0 for f. 2 Solve -r = 2r + 12 for r. -4 Solve 8q - 4 = 12q for q. -1 Solve -21y = -37y + 16 for y. 1 Solve 3r - 14 + 26 = 0 for r. -4 Solve -63d + 108 = -18 for d. 2 Solve 5x = 3 - 18 for x. -3 Solve y = 86 - 89 for y. -3 Solve 0 = 25x - 3 - 22 for x. 1 Solve 5o + 6o = -33 for o. -3 Solve 68a - 11a = 0 for a. 0 Solve 0 = 46v - 42v for v. 0 Solve 16j - 90 = 25j for j. -10 Solve -16q = -81 - 15 for q. 6 Solve -10 = -3q + 8q for q. -2 Solve -14n - 13 = -83 for n. 5 Solve 0 = 35u - 54 - 121 for u. 5 Solve 322l = 317l - 25 for l. -5 Solve 258f = 287f - 87 for f. 3 Solve -5g + g + 4 = 0 for g. 1 Solve -46l + 50l - 12 = 0 for l. 3 Solve 62 = 35z + 167 for z. -3 Solve 0v - 35 = -7v for v. 5 Solve 8v - 56 = -32 for v. 3 Solve -8 = -5r + 13r for r. -1 Solve 3w - 20 = -17 for w. 1 Solve -4 = -8v - 28 for v. -3 Solve -9u = 29u + 228 for u. -6 Solve 24r = -33r + 171 for r. 3 Solve 4f + 3 = 23 for f. 5 Solve 96f = 93f + 3 for f. 1 Solve -43 = -8m - 11 for m. 4 Solve -17w + 380 = 448 for w. -4 Solve 0 = -75c + 2 - 2 for c. 0 Solve 25n - 96 = 49n for n. -4 Solve 0 = -6f - 898 + 880 for f. -3 Solve 0 = -11t + 1 + 32 for t. 3 Solve 37 = -12k - 25k for k. -1 Solve 0 = -6s - 78 + 30 for s. -8 Solve 13i - 14i - 6 = 0 for i. -6 Solve -4b - 240 + 248 = 0 for b. 2 Solve 19m = 44m - 16m for m. 0 Solve -15g = -4 - 11 for g. 1 Solve -199t - 1 = -200t for t. 1 Solve -57 = -19l + 57 for l. 6 Solve 4r = 3r + 6 for r. 6 Solve 22a + 26 = -62 for a. -4 Solve -7i = 8i - 15 for i. 1 Solve -10 = -b + 6b for b. -2 Solve -15a = -493 + 658 for a. -11 Solve -6c + 23 + 7 = 0 for c. 5 Solve 88p = 66p - 88 for p. -4 Solve 5 = w - 6w for w. -1 Solve 33 - 13 = 4u for u. 5 Solve 143 = 132h + 11h for h. 1 Solve -2v - 40 = 6v for v. -5 Solve -7 + 3 = 4o for o. -1 Solve 196 = -7r + 224 for r. 4 Solve 71c - 106c = -70 for c. 2 Solve 3i = -30 + 30 for i. 0 Solve -15 = 164g - 167g for g. 5 Solve -139 = -17i - 207 for i. -4 Solve 21r - 44 = -86 for r. -2 Solve -3c + 6 = -5c for c. -3 Solve 3a = 25 - 10 for a. 5 Solve -9w + 2w + 21 = 0 for w. 3 Solve 4r - 541 = -529 for r. 3 Solve 0 = 604n - 610n + 6 for n. 1 Solve 21w = 42w + 63 for w. -3 Solve -3d - 572 = -578 for d. 2 Solve a - 85 = -91 for a. -6 Solve -816 = 123p - 21p for p. -8 Solve 0 = 3l - 5 + 2 for l. 1 Solve 43 - 30 = -13d for d. -1 Solve 0 = -9o - 3o + 24 for o. 2 Solve -55m - 177 = -67 for m. -2 Solve -6w - 3 = -5w for w. -3 Solve -29d = -20d - 9 for d. 1 Solve 5z - 31 = -11 for z. 4 Solve -r - 13 = -10 for r. -3 Solve 6y - 24 + 84 = 0 for y. -10 Solve -51k - 35 = -58k for k. 5 Solve 5z = 3z - 0z for z. 0 Solve 0 = -72h + 297 + 207 for h. 7 Solve -156 + 198 = 42r for r. 1 Solve -9m = 7 + 38 for m. -5 Solve 2p = -3p + 10 for p. 2 Solve -4 = -8f + 4 for f. 1 Solve -1369g + 1377g = 0 for g. 0 Solve 59o - 50o - 81 = 0 for o. 9 Solve 15x = 11x - 12 for x. -3 Solve 0 = 31n - 27n + 8 for n. -2 Solve -15h + 47 = -43 for h. 6 Solve -11x = 7x + 90 for x. -5 Solve 7b - 12b + 5 = 0 for b. 1 Solve 5y - 12y + 7 = 0 for y. 1 Solve -43 = 6x - 25 for x. -3 Solve 175 - 177 = 2u for u. -1 Solve 5s - 22s + 119 = 0 for s. 7 Solve -198s + 70 = -212s for s. -5 Solve 0 = 68o - 88o for o. 0 Solve 21b + 130 = 25 for b. -5 Solve 0 = -3u - 62 + 59 for u. -1 Solve 21o + 70 + 14 = 0 for o. -4 Solve 2o = -2o for o. 0 Solve 0 = -4v - 9 + 1 for v. -2 Solve t + 3 = -1 for t. -4 Solve 0 = -76x + 91x + 30 for x. -2 Solve -4j + 3 = -j for j. 1 Solve -48 = 11u + 7 for u. -5 Solve 15k = 20k for k. 0 Solve 0 = 3y + 80 - 68 for y. -4 Solve -32 = -8l - 0l for l. 4 Solve 0 = -22v - 16v - 76 for v. -2 Solve -636 = 6m - 612 for m. -4 Solve -38f + 27f + 55 = 0 for f. 5 Solve -24 = 2u - 14u for u. 2 Solve 0 = -100m + 83m + 85 for m. 5 Solve 21m = 18m for m. 0 Solve -9 = 6j - 21 for j. 2 Solve 252 = 4z + 59z for z. 4 Solve -135w + 131w + 32 = 0 for w. 8 Solve 0 = 3l + 148 - 160 for l. 4 Solve 0 = 2b + 8b - 30 for b. 3 Solve 1709t + 36 = 1713t for t. 9 Solve 50u = 62u - 96 for u. 8 Solve -75 = 96f + 21 for f. -1 Solve 51j = -612 + 153 for j. -9 Solve 13r = -245 + 258 for r. 1 Solve -59a + 42 = -73a for a. -3 Solve 0 = 4l - 4 for l. 1 Solve 103h = 90h + 26 for h. 2 Solve 52 = -12b + 4 for b. -4 Solve 350z + 5 = 355z for z. 1 Solve 15g + 42 = -3 for g. -3 Solve -50 = -10t + 20t for t. -5 Solve 12x + 10 = 17x for x. 2 Solve 2994 - 3084 = 18g for g. -5 Solve 0 = 17k - 22k - 5 for k. -1 Solve -26r + 9 = -17r for r. 1 Solve 5r + 29 = 39 for r. 2 Solve -145y = -133y - 48 for y. 4 Solve 10q = -9q + 8q for q. 0 Solve 0g = -9g + 27 for g. 3 Solve -30 = 32q - 42q for q. 3 Solve -45u + 65u = 160 for u. 8 Solve 4p - 24 = -4 for p. 5 Solve 48w = 53w - 25 for w. 5 Solve 178 = 15v + 43 for v. 9 Solve 12 = -2c + 6 for c. -3 Solve -49x + 12 = -46*x for x. 4 Solve	{ "pile_set_name": "DM Mathematics" }
False Let b = 0.119 + -0.119. Let q be 1/(3/8) + -2. Is b < q? True Let a(q) = -q3 + q2 + 1. Let o(m) = 3m3 - m2 + m. Let b(n) = 2a(n) + o(n). Let s be b(0). Let y = -167 - -168. Which is bigger: y or s? s Suppose 0 = -6y + 7y - 1. Let b be (-9)/(-4)(-2)/(-3). Is y smaller than b? True Suppose -4x + 5k + 20 = -8x, 5x + 2k = -25. Suppose 7t + 12 = 3t. Which is bigger: x or t? t Let m = -0.2 - -0.2. Let t = -29 + 27.9. Let v = 0.1 + t. Is m smaller than v? False Let f be (5/(-2) + 3)/((-1)/16). Which is smaller: -3 or f? f Let q = -0.14 + -1.36. Let w = q - -1.5. Which is smaller: -2 or w? -2 Let o = 35 + -32. Which is bigger: o or 6? 6 Suppose 9w = 3t + 4w - 2, -2t - 5w - 7 = 0. Let v = 57/4 + -14. Is v not equal to t? True Let m = 1.76 - 6.76. Which is bigger: 1.4 or m? 1.4 Suppose f = -f + 36. Suppose -4b = f + 2. Are -21/4 and b nonequal? True Let o = -17.1 + 17. Which is greater: 3/8 or o? 3/8 Suppose 34 = 5t - d, -5t = -2t + d - 22. Let y = -9 + t. Let c = y - -3. Is -2/7 < c? True Let q(j) be the third derivative of -j4/12 + j2. Let i be q(-3). Let d = i + -8. Which is greater: -1/2 or d? -1/2 Suppose -3w = 4g - 4w + 2, 5w = 10. Let l be (-20)/(-3)6/(-5). Let a be (-2)/l + 38/(-88). Is g >= a? True Let i = 2 - 3. Which is bigger: i or -3? i Let d = 0.013 + 0.987. Which is smaller: d or -2.2? -2.2 Let k be -1-43/(-24). Is k equal to 0.2? False Let v = 3.06 - 3. Let z = v - 2.06. Which is smaller: 3 or z? z Let f = -0.4 + 0.4. Let m = -1 + f. Let w = -0.1 + 0.3. Which is smaller: w or m? m Let m be (-2)/9 - 49/(-126). Which is bigger: m or 1? 1 Suppose 5t - 5d = -4 - 61, t + d + 3 = 0. Let g = 25/3 + t. Which is bigger: g or 2/3? 2/3 Let d be 10/436/45. Suppose -v + 10 = -dv. Is -11 greater than or equal to v? False Let n be (-12)/(-1) + 6/(-6). Suppose 0 = -5h + n - 1. Suppose 0 = -ho + 1 - 3. Is o greater than or equal to 0? False Let s = 2 - 4. Let v be ((-1)/7)/(s/(-8)). Is v less than -1? False Suppose 0 = -2g + 5o - 59, g + 0g = -3o - 13. Which is greater: -1 or g? -1 Suppose 0z - z = g + 5, 25 = -4g - 5z. Let c = -1 - -1. Does c = g? True Let x be ((-6)/(-4))/((-1)/2). Let y(m) = -m2 + 5m - 3. Let l = 12 + -7. Let q be y(l). Is q greater than x? False Let q be 12/16 + (-3 - 10/(-8)). Which is smaller: q or -3/43? q Suppose 0 = -b + 2b. Suppose b = 3p - 2p + 1. Let t be (p + 0)/(4/2). Which is greater: -2 or t? t Let q be (-3)/1 + (-7)/(-2). Let i = 0.04 + -0.34. Is q at least as big as i? True Let p = -2 + 5. Suppose -pn = -n - 8. Which is greater: 0 or n? n Let t(j) = j*2 - 4j - 1. Let d be t(4). Let r(u) = u*2 - 4u. Let b be r(3). Which is bigger: b or d? d Let k(d) = -d*3 + 8d*2 - d + 11. Let h be k(8). Suppose hg - 5b - 5 = 0, 4g = -2b - 3b - 5. Let j = 109/3 - 36. Is g smaller than j? True Let q = 2/7 + -8/77. Which is smaller: q or -1/7? -1/7 Let a = -0.07 + -0.13. Is -1 greater than a? False Let q = -2 + 12. Which is smaller: q or -1? -1 Suppose -16 = -g - 3g. Suppose -g = -u + 5u. Suppose l + 4 = -l. Which is smaller: l or u? l Suppose -g - 2o - 2 + 9 = 0, 2g + 5o - 16 = 0. Which is bigger: 2 or g? g Let a(c) = -c2 + 7c - 4. Let i be a(6). Let y = i + 6. Which is smaller: 7 or y? 7 Let z be (0/(1 + 2))/2. Let p be 1/(-1) + (-2812)/(-2198). Let k = p - -1/157. Which is smaller: k or z? z Let o = 244 - 2198/9. Is -1 <= o? True Let l be (-3)/(12/8) + 4. Suppose 0 = -5t - l + 22. Which is smaller: t or 3? 3 Let l = -32.2 + 28. Let b = l - -4. Which is smaller: b or 4? b Let l = -106 - -105. Is l smaller than -2/9? True Let s = -231 + 2538/11. Let m = -4/11 - s. Which is greater: -1 or m? m Let v = -2.06 + 2. Let o = -1.06 - v. Is -1 < o? False Let j be 6/(-4)1-2. Suppose -s + js = -4. Suppose -i - 9 = -2o, 2o + o = 5i + 17. Which is smaller: s or i? s Let a(o) = -6 + 2o*2 + 7o + 13 - 3o2. Let q be a(8). Which is greater: q or 0.1? 0.1 Suppose 0 = -2g - 0g - v, 0 = -5g - 3v. Let z be 116/1914 - (1 - (-1 + 2)). Is z >= g? True Suppose 6i - 2v - 34 = 3i, 0 = 2i + v - 32. Is 15 greater than or equal to i? True Let j be (-8 + -1)/(3/2). Let z(m) = m2 + 6m + 1. Let t be z(j). Let r = 3 + -3. Which is smaller: t or r? r Let c be 75/(-20) + 2/(-8). Let l be 54/24 + c/2. Are -0.4 and l equal? False Let q = 0.7 + 0.3. Let h = 0.546 + 0.354. Is h less than q? True Let d = 21 - 23. Let u be 1/5 - 14/35. Which is greater: d or u? u Let d = 2 + -1. Let n be -4(-1 + (-178)/(-48)). Let o = -11 - n. Which is smaller: o or d? o Let d be (-13)/4 - 4/(-16). Suppose -4t = 0, 3j = -2j - t. Let k = d + j. Do -4 and k have different values? True Suppose 0 = 3p + 3g + 3, -4g + 16 = -0g. Let h(r) = -r*2 - 5r - 3. Let y be h(p). Are -1 and y nonequal? True Let f be -6 + 0 + 1 + 0. Let b be f/(-3) - (-3)/9. Let r be 1 + 1 - (b + 1). Is r >= -1/7? False Let k be 2/(-8) - 3/4. Let d be ((-8)/(-6))/(182/21 - 8). Is d at least as big as k? True Let d(k) = k + 6. Suppose 3g = -g - 32. Let p be d(g). Let y = 1/96 - 145/96. Is y at least as big as p? True Let u be (-1)/12 - 2/(-6). Let k = -194 + 197. Which is bigger: u or k? k Let r(u) = -u + 6. Let b be r(4). Let x = 0.2 - -0.8. Let d = x - 1. Which is smaller: b or d? d Let y(i) = -i2 + i + 8. Let s be y(0). Let x = s - 15. Let t be -1 - -1 - (-3)/x. Which is smaller: t or -1? -1 Let w = 31 + -152/5. Let k be 0 + 1 + (3 - 3). Which is greater: w or k? k Let h be 3 + (1 - 15/6) - 1. Are 46 and h non-equal? True Let x = -0.057 - 20.943. Which is smaller: 3 or x? x Let z = -2 + 3. Let i be (-53)/(-12) - z/3. Let o = -19/4 + i. Do o and 0 have the same value? False Let x be 4/(-14) - (-37)/7. Suppose -y - 2a + a = 4, -3y + xa = -12. Let r be 12/(-16) - (2 + -2). Which is bigger: r or y? r Let f = -2 + 2. Let z = 15 + -9. Which is smaller: f or z? f Suppose 0 = 2u + d + 2d + 10, 2d = -2u - 8. Let y = 1 - 1. Suppose j + j + 4 = y. Is j bigger than u? False Let u(w) = 10w2 + w + 1. Let j be u(-1). Let m = j + -13. Suppose -4r + 20 = -9r. Which is smaller: m or r? r Let f(s) = -s2 + 5s + 1. Let n be f(5). Suppose 0 = 5d + 4w - 3, 0 = -5d + d + 3w + 21. Is n at least d? False Suppose -5d + 11 = 4t, -2t + 5t + 2d = 3. Suppose -c + 4c + 4j - 16 = 0, 4c - 12 = 4j. Let r be c/(-10)5/17. Which is greater: t or r? r Let j = 24.3 - 28. Let t = -0.3 + j. Let w = -3.9 - t. Is w greater than or equal to -1? True Suppose 3s - 5 = -3k + k, -4s = -4k. Let i(o) = -o*3 - 2o2 - 2. Let w be i(-3). Let g = w - 5. Is s >= g? False Let f = -3 - -2. Let x(n) = -n2 - n. Let l be x(-2). Which is smaller: f or l? l Let p = 0.43 - -18.57. Let d = p + -18. Is d at most -0.1? False Suppose -406 - 104 = -10y. Which is greater: 50 or y? y Let l = 150 - 445/3. Let d = -3 - -5. Which is smaller: l or d? l Let a be (-9)/3 + (2 - 19). Let y = 5 + -4. Which is greater: y or a? y Let s = 5 - 2. Suppose -c - 2 - 4 = -m, 5m - sc = 28. Which is smaller: 4 or m? 4 Let o(n) = n2 + 6n - 6. Let j be o(-7). Let q be 0 + (0/j)/2. Let h(r) = r*2 - 4. Let w be h(q). Which is bigger: w or -6? w Suppose 4k - 3s = 0, s + 22 = -2k - 3s. Let u = -1 - k. Let h = u + -1. Is 1 > h? False Suppose o + 5d + 23 = 2o, 5o + 5d = 25. Suppose -3c - 15 = -oc. Which is smaller: 9/4 or c? 9/4 Let m = -2 - -1. Let q = -63 + 312/5. Let k = q + 1/5. Does m = k? False Let m = -135121/2162 + -2/1081. Let r = -33 - m. Let q = -29 + r. Is 0.2 not equal to q? True Let n(a) = -a3 - 3a*2 + 3a - 3. Let q be n(-4). Let z be -1 + (q-12)/3. Is z greater than -5? False Suppose -3t + 22 = -2. Let v = 125 + -117. Is v <= t? True Suppose 4j - 12 = -5w, w + 0w - j = 6. Let b be 1/4 - 33/(-12). Suppose bd = d - w. Is d >= -2? True Let i = 25 - 12. Is i smaller than 14? True Let y be 0 - (5 - 5)/(-3). Which is smaller: 3/11 or y? y Let t = 841/633 + 1/211. Let u be 1 + 1/2-2. Which is smaller: u or t? u Let z = 19944/69617 - 12/1619. Is z greater than or equal to -1? True Let o = -4.9 - -5. Let k = -3.9 - o. Is k bigger than -0.3? False Let c = -17/5 + 21/5. Let x = -0.4 + 0.6. Is x > c? False Let l = -5 + 9. Suppose -3z - l = 2o, -z + 4z + o = -2. Is 3/7 bigger than z? True Let g be 11/(-5) - (-2 - 0). Let d(m) =	{ "pile_set_name": "DM Mathematics" }
i - 408 = -132i for i. 2 Solve 164m + 634 = -3302 for m. -24 Solve -20c - 59 + 39 = 120 for c. -7 Solve 23q - 768 = -4q - 21q for q. 16 Solve 88b + 56b - 1682 = 766 for b. 17 Solve -47r + 82r + 82r = -702 for r. -6 Solve 81 = 27j - 27 for j. 4 Solve -220a + 3434 = 794 for a. 12 Solve 21m - 649 = m - 39m for m. 11 Solve 73p - 8 = 75p for p. -4 Solve -100f - 816 = -255f + 131f for f. 34 Solve -4104 = 357y - 891 for y. -9 Solve 16136 = -687u + 1022 for u. -22 Solve -1931k = -1975k - 440 for k. -10 Solve 100g - 2808 = -64g + 60g for g. 27 Solve -26c - 3 - 225 = -14c for c. -19 Solve 5990 = -2141s - 9476 + 2620 for s. -6 Solve 292x - 3144 = 30x for x. 12 Solve -87g + 284 = -16g for g. 4 Solve -65 + 352 = 48t - 145 for t. 9 Solve -208n - 3320 = 1048 for n. -21 Solve -51h + 382h = 0 for h. 0 Solve 234n + 16 = 226n for n. -2 Solve 86 = 25j + 61 for j. 1 Solve 48b = 16815 - 17199 for b. -8 Solve -11441 = -1497o - 3956 for o. 5 Solve -28f - 11f - 6f + 630 = 0 for f. 14 Solve -463 = -8n + 50n - 1 for n. -11 Solve 1748 - 1476 = -34p for p. -8 Solve -68b + 458 = 1818 for b. -20 Solve 26o + 53 = 365 for o. 12 Solve 145p = -219p + 6188 for p. 17 Solve 329s + 1153 - 1460 = -3926 for s. -11 Solve -67r + 34r - 1992 = 50r for r. -24 Solve 84f + 7f - 1065f = 11688 for f. -12 Solve 215q - 97q = 826 for q. 7 Solve 29f - 924 - 454 = 135f for f. -13 Solve 131n - 1460 = 112 for n. 12 Solve 18q = -109q + 28q for q. 0 Solve 163h = -39h - 1010 for h. -5 Solve -118 = 38v - 1410 for v. 34 Solve 228a - 18a = 5460 for a. 26 Solve 780 = 20z - 71z - 87 for z. -17 Solve -116j = 15j + 1048 for j. -8 Solve -850b + 1662b + 550 = 837b for b. 22 Solve 28a + 61 = -21a - 233 for a. -6 Solve 2436 = -15o + 61o + 41o for o. 28 Solve 0 = -10729x + 10735x - 26 + 176 for x. -25 Solve 6n - 327 = -61n + 276 for n. 9 Solve -473r - 7605 = 112r for r. -13 Solve -24y + 359035 - 358843 = 0 for y. 8 Solve -26i - 116 = 14 for i. -5 Solve -699 + 2159 = 21p + 52p for p. 20 Solve 52c - 79c - 197 - 127 = 0 for c. -12 Solve -34w = -108208 + 107392 for w. 24 Solve -2l - 20 = 2l for l. -5 Solve -742 = 71014y - 71067y for y. 14 Solve 163z - 462z - 431 = 167 for z. -2 Solve -65 = 51x + 303 + 754 for x. -22 Solve 0 = 29i + 155 + 2 + 17 for i. -6 Solve 7n + 1080 - 1171 = 0 for n. 13 Solve 244f - 427 = -25 + 818 for f. 5 Solve 468z + 4248 = -4z for z. -9 Solve -6754 = -342y - 111y + 3212 for y. 22 Solve -15h = -116h - 275 - 28 for h. -3 Solve 4033b + 5607 = 3766b for b. -21 Solve 164t + 1717 = -24t - 1479 for t. -17 Solve -1620a + 4064 = -1366a for a. 16 Solve 131c - 5456 = -210c for c. 16 Solve -37n - 27n = 25n - 712 for n. 8 Solve -346 = -36r - 526 for r. -5 Solve -843 = -474x - 5109 for x. -9 Solve 374w + 6806 = -125w - 1178 for w. -16 Solve 0 = 131n - 52n - 52n + 162 for n. -6 Solve 25v - 66v - 205 = 0 for v. -5 Solve 162z - 26z + 1530 = -17z for z. -10 Solve -8f + 254 = 128f - 426 for f. 5 Solve 0 = 3155407q - 3155435q + 812 for q. 29 Solve 374i = 311 + 324 + 113 for i. 2 Solve -8v + 156 = 7v - 2v for v. 12 Solve -76i + 17620 - 19292 = 0 for i. -22 Solve -207d + 76d - 373 = -1290 for d. 7 Solve -313h - 232h + 88h = -10511 for h. 23 Solve -56 - 7 = 14y + 49 for y. -8 Solve 0 = 45m + 214 - 159 - 685 for m. 14 Solve 43x - 13x = -36x + 132 for x. 2 Solve -8619 = -357o - 423 - 699 for o. 21 Solve 26w + 13w = 27w + 228 for w. 19 Solve 197z = 1199 - 17 for z. 6 Solve 2c - 12c = 18c - 336 for c. 12 Solve -104s - 28s = 1703 - 4343 for s. 20 Solve -25a + 217 - 12 = -120 for a. 13 Solve 850 - 1404 = 34a - 826 for a. 8 Solve 656l - 213l = -421l + 10368 for l. 12 Solve 0 = -443s - 1216s + 133s - 12208 for s. -8 Solve -63 - 21 = 51878x - 51872x for x. -14 Solve 50j + 16968 = 16918 for j. -1 Solve 36 = 10642x - 10630x for x. 3 Solve -49q + 50 + 173 - 27 = 0 for q. 4 Solve 47 = 22q - 22 - 41 for q. 5 Solve -85k - 55k = 920k - 24380 for k. 23 Solve 396t = 80t - 2079 - 2345 for t. -14 Solve -174w - 123w = 1121 - 230 for w. -3 Solve 41 = 7v - 18 - 11 for v. 10 Solve 19980 = 143o + 20409 for o. -3 Solve 110 = -80v + 90v for v. 11 Solve -239c = 226c - 947 - 7888 for c. 19 Solve -487i + 2416 = -19 for i. 5 Solve -105 = -51y + 116 - 68 for y. 3 Solve -22r - 85 = 7r - 404 for r. 11 Solve -98p = -1453 - 340 - 1931 for p. 38 Solve -28880a + 28977a = 3201 for a. 33 Solve -23u - 18u - 24 + 352 = 0 for u. 8 Solve -46b + 141 = -b + 996 for b. -19 Solve 0 = -35r + 101 + 109 for r. 6 Solve -1074y = -1091y - 17 for y. -1 Solve -339v - 2002 = -262v for v. -26 Solve 0 = -18k - 25k + 8k - 105 for k. -3 Solve -256 = 58y - 411 - 715 for y. 15 Solve 1356 = 16m + 1372 for m. -1 Solve 0 = 18g + 48 - 103 - 143 for g. 11 Solve 7 = 6i + 7 - 18 for i. 3 Solve -2628 = -6v - 135v - 5v for v. 18 Solve -649 - 1200 = 197l + 712 for l. -13 Solve -137 - 31 = -102f + 36 for f. 2 Solve -870l + 624 = -918l for l. -13 Solve 532 + 772 = 120w + 224 for w. 9 Solve 18x + 620 = -32x + 320 for x. -6 Solve -562t - 108 = -556t for t. -18 Solve -1542g + 1596g = -715 + 13 for g. -13 Solve 174j - 644 = -148j for j. 2 Solve -173659w = -173674w - 315 for w. -21 Solve -58 + 58 = 41x for x. 0 Solve 468 = -18c - 12c - 48c for c. -6 Solve 0 = -73y + 103y + 270 for y. -9 Solve 50424g = 50397g + 567 for g. 21 Solve 162i - 42i + 1200 = 0 for i. -10 Solve -675g - 7231 + 11724 = -9682 for g. 21 Solve 368r = -589r - 10527 for r. -11 Solve -43l + 0l + 977 = -528 for l. 35 Solve -2907q = -3140q - 3728 for q. -16 Solve -652v = 225v - 9647 for v. 11 Solve 208c + 1458 = 370c for c. 9 Solve 6l - 22l = 31l + 188 for l. -4 Solve 136x - 704 = -117x + 77x for x. 4 Solve 0 = 1284m - 1293m + 54 for m. 6 Solve 255 - 423 = -69d - 1410 for d. -18 Solve -211i - 6024 = 197i - 157i for i. -24 Solve -311y + 293y = -306 for y. 17 Solve 6x - 1889642 = -1889480 for x. 27 Solve 454q - 2115 = 219q for q. 9 Solve 0 = 214b + 301 + 4193 for b. -21 Solve -4o + 340 = -2o + 372 for o. -16 Solve 630v - 7346 = -78v + 1150 for v. 12 Solve -75p - 671 = -95p + 81p for p. -11 Solve 242 + 345 = 179m + 50 for m. 3 Solve 175g - 85g - 78g - 60 = 0 for g. 5 Solve 0 = 16t - 115 + 243 for t. -8 Solve 38163p - 38106p = -342 for p. -6 Solve 24v - 52 = 27 - 511 for v. -18 Solve -636w + 52w = 3458 - 538 for w. -5 Solve 1984t - 1428 = 2052t for t. -21 Solve -2y + 218 = 238 for y. -10 Solve 12w - 578 = -614 for w. -3 Solve -2218j + 2143j = 1125 for j. -15 Solve -274 = -63b - 915 - 808 for b. -23 Solve -285 = 72h + 3 for h. -4 Solve 206h - 384h + 1068 = 0 for h. 6 Solve -859d + 2536d - 21909 = 9954 for d. 19 Solve -6777p = -6771p - 54 for p. 9 Solve 306 - 124 = 13k for k. 14 Solve 25z - 40z - 360 = 30z for z. -8 Solve -21k + 47875 = 47938 for k. -3 Solve -162d + 104d + 348 = 0 for d. 6 Solve -219g = -4839 + 1263 - 1242 for g. 22 Solve 132h = 373 + 510 + 437 for h. 10 Solve -3139 = -180x + 1901 for x. 28 Solve 8p + 327 + 89 = -24p for p. -13 Solve -3485h + 3543h = -464 for h. -8 Solve 0 = 200h - 194h - 60 for h. 10 Solve 306667h = 306675h - 128 for h. 16 Solve -1673 = -760y + 2588 + 4099 for y. 11 Solve -297q - 7758 = -1818 for q. -20 Solve 26a - 18 = -15a + 38a for a. 6 Solve 59y + 690 = -424 - 125 for y. -21 Solve -82q = 119q - 7638 for q. 38 Solve -161t + 4 = 5t + 4 for t. 0 Solve 1117p + 4331 + 3907 = -6283 for p. -13 Solve 2628 + 11736 = 684q for q. 21 Solve 5895p + 119 = 5878p for p. -7 Solve 91h = 200h - 65h + 352 for h. -8 Solve -33u - 323u = 240u + 2980 for u. -5 Solve 1743 - 1813 = 2r for r. -35 Solve 52r - 5r = 403 + 20 for r. 9 Solve -246d - 5908 = -668d for d. 14 Solve -21w + 782 - 740 = 0 for w. 2 Solve -8809 = -10f - 9069 for f. -26 Solve 21a + 563 - 689 = 0 for a. 6 Solve -38j - 52j + 1199 = 19j for j. 11 Solve 29s - 11873 = -863s + 12211 for s. 27 Solve -83b - 1764 - 2486 = -1428 for b. -34 Solve -31l - 5282 - 380 = 267l for l. -19 Solve 707c - 769c = 496 for c. -8 Solve -197a - 922 = 1048 for a. -10 Solve -11912 = -654z + 1822 for z. 21 Solve 0 = -13l +	{ "pile_set_name": "DM Mathematics" }
the nearest to -1? (a) v (b) 3/5 (c) 0 c Let v be (-2)/(-2) + (-5)/3. Let k = -7/50 + 249/350. Let o = 6 + -6.1. Which is the nearest to o? (a) 0.3 (b) k (c) v a Let o = 23.3 - 20. Let q = 8.7 - 8. Let z = q + o. Which is the nearest to 1? (a) 0.3 (b) 0.2 (c) z a Let y = -0.03 - -1.03. Let f = y - -4. Let u = 1 - 1.2. What is the nearest to 0.1 in f, -4, u? u Let q = -10 - -11. Let h = 0 + q. Which is the nearest to h? (a) 2/5 (b) 1/2 (c) 5 b Let m be 2/(-5) + 120/(-75). Let s be ((-2)/(-16))/(2/(-12)). Which is the closest to 1? (a) s (b) m (c) -0.2 c Let u be 1234/8 + -3 + 5. Let w = u + -157. What is the nearest to -1/2 in -6/5, w, -2? w Let y = 110 + -659/6. What is the nearest to 0.3 in y, -0.5, 2? y Let v = -26 - -23. What is the closest to -1 in v, 2/11, -2? -2 Suppose 24 = -3s - s. Let p = s - -5. Let g = -1.1 - -0.1. What is the nearest to p in -1/4, g, 0? g Let s = 0.015 + 0.985. What is the nearest to -0.02 in 0.5, -1, s? 0.5 Let s = -49.24 + 36.1. Let c = s + 0.14. Let h = c - -8. What is the closest to 0.1 in -2, h, -0.2? -0.2 Let s = 3.1 - 3. Let k = 0.3 - s. Let j = -1 - 2. What is the closest to 1 in k, j, -0.2? k Let m = 0.67 + -0.47. Let o = 1 + -5. Which is the nearest to -1? (a) -4/7 (b) m (c) o a Let q = 1 - -3. Let j = 0 + q. Suppose -5 = 5m + 5x, -m - x - jx = 1. Which is the nearest to 0? (a) 3 (b) m (c) 4 b Let g = -0.57 + 0.64. Which is the closest to -0.1? (a) 0 (b) g (c) -3 a Let k = -3 - -6. Let h = k + -1. What is the closest to 1/4 in 4, h, -2/3? -2/3 Let s = 11.92 - 0.72. Let v = -1.2 + s. Let q = v - 14. What is the nearest to -0.1 in -1/8, q, -3? -1/8 Let x = 4 - 23/5. Suppose 3b + 2b - 2y + 39 = 0, 5b = -y - 48. Let p be (-1 + (-12)/b)/(-1). What is the nearest to p in 5, x, 0.4? x Let y = -4 + 1. Let i = -2.9 - y. Suppose 0 = -8f + 3f + 3o + 25, -4f + o = -20. Which is the closest to i? (a) -0.4 (b) 2/7 (c) f b Let r(p) = -p3 + p2 + p - 2. Let w = -14 + 16. Let c be r(w). Let v = 14 - 27/2. What is the nearest to 2/5 in c, v, -0.4? v Let i = 1.4 - 1.2. What is the closest to 0 in i, -4/5, 1/2? i Let b = 5 + -2. Let r be (6/b)/1 - 1. Let w = -11 + 7. What is the closest to r in 0.4, w, 0? 0.4 Let h(l) = l*3 - 10l*2 + 9l + 2. Let k be h(9). Let i be (2 - k)2/(-4). Let n be 14/(-6) - (i - 2). Which is the closest to 2/7? (a) n (b) -0.1 (c) -3 b Let t = 4 + -2. Suppose -2v + 3 = -3x, tv - 1 = x + 4x. Which is the closest to 0? (a) 0.5 (b) v (c) 5 a Let t = -1 + -2. Suppose 7y + 20 = 3y. Which is the closest to -0.1? (a) 1 (b) y (c) t a Let w = 13 - 7. Let z = -8 + w. Which is the closest to -1? (a) 0.3 (b) 1/6 (c) z c Let l be 33/36 + (-1)/4. Let f = -36.2 + 36. What is the closest to f in -3, -1, l? -1 Let f = 0.8 - 0.83. Let j = 0.03 + f. What is the nearest to j in -0.5, 0.1, -3/4? 0.1 Let w = -15 - -11. What is the closest to 2 in w, 0, 2/7? 2/7 Let f = -0.0036 + -5.8664. Let v = -0.13 + f. Let l = 5.5 + v. What is the closest to 0 in 4, 0.3, l? 0.3 Let t = 297/14 - 21. Let p = -19/42 - t. What is the nearest to 0.3 in -5, -0.5, p? -0.5 Let k = -0.148 + 0.048. What is the closest to 2/5 in 2, k, 1? k Let a be (-8 + 172/20)(-2)/(-3). What is the closest to -10/7 in 4, -5/2, a? -5/2 Let j = 33 - 33.3. Let f = 1 + -1.5. Which is the nearest to -1/4? (a) j (b) f (c) 1/3 a Let f = -30 + 30.2. What is the closest to f in -1, 2/19, 4? 2/19 Let f = 28.03 - 28. What is the closest to 0 in -2/5, f, -3/8? f Let k(m) = 3m3 - 2m*2 + m. Let r be k(1). Which is the nearest to r? (a) -2/13 (b) -2 (c) -0.3 a Let m = -2/5 - -11/15. Let s = -1 - -6. Suppose sj = 4o + 26, 0 = o + 5j - 4j + 2. What is the nearest to m in o, -3/7, 2? -3/7 Let j = -28 + 27.5. Which is the closest to -3? (a) -2/3 (b) -1/3 (c) j a Let w = 1/14 + 3/7. Which is the nearest to -1/4? (a) 11 (b) w (c) 3 b Let j be (-15)/28 + 12/42. Let i = 0.4 + -0.2. What is the closest to j in 4, -0.1, i? -0.1 Suppose 2v + q - 2 = 2q, 16 = 3v + 5q. What is the closest to 1 in v, 3, -0.3? v Let t be 5(-14)/(-220) - 4/(-22). Which is the nearest to t? (a) 1/6 (b) 7 (c) 4 a Let n = 1.6 - 2. Let y = -2.4 + 0.4. What is the closest to y in 1, -3/4, n? -3/4 Let i = -0.1 - -0.06. Let x = -7.86 + 8. Let r = x + i. Which is the closest to r? (a) 1/2 (b) -0.2 (c) 0.1 c Let f(t) = -t + 17. Let p be f(12). Suppose 5s = -i - 2, ps + 16 - 2 = 3i. Which is the nearest to s? (a) -3 (b) -0.2 (c) 3 b Let o = 4 + -3. Let c = 7 - 5. Let m = -0.1 - 3.9. What is the closest to o in -1/6, m, c? c Suppose -5i + 9 = -c, -4i = 2c - 5c - 16. Let o = -0.62 - 0.38. What is the closest to o in i, -5, -1/7? -1/7 Let j(h) = 3h + 2. Let u be j(-2). Which is the closest to 1? (a) 2 (b) u (c) 5 a Let d = 4 + -2. What is the closest to d in 1/5, 3, -0.2? 3 Let q = 0.4 - 0.2. Which is the nearest to -2/9? (a) -0.3 (b) -0.4 (c) q a Let z be ((-3)/(-5))/(6/15). Suppose 4s + 7 = 4q - 5, 4q = s + 3. What is the nearest to z in 4, 1/3, s? 1/3 Let r = -18.23 - -18. Which is the nearest to -0.1? (a) r (b) 2/13 (c) 4 a Let n = -0.1 + 3.1. Let l = 18 + -26. Let v = l + 7. Which is the closest to v? (a) n (b) 2/3 (c) -2 c Suppose 5t - x = 3 + 17, -40 = -4t - 4x. Let c = -0.03 - 0.05. Let b = c + -2.92. What is the closest to 0.2 in 2/11, b, t? 2/11 Let n = -8 + 11. Which is the closest to 1/4? (a) n (b) 5 (c) 0.1 c Let b = 0.34 - 0.34. What is the closest to b in 3, -0.2, 0.01? 0.01 Let u = -6.4 + -0.6. Let l = u + 11. Let q be 6/21 - (-4)/(-28). Which is the closest to -2? (a) q (b) 1/6 (c) l a Let u(l) = l - 22. Let c be u(18). What is the nearest to -2/7 in 4, c, -0.4? -0.4 Let t = -0.3 - -0.8. Let j = 12 - 12.4. Let m = j + t. What is the closest to m in 2/7, -2, -0.5? 2/7 Let s = 6 + -3. Let n = 0 - s. Suppose -3d - 2l + 3 = 10, -l - 2 = 0. Which is the closest to 1? (a) 0 (b) n (c) d a Let o = 1 + -1.04. Let h = -0.16 + o. Which is the closest to h? (a) 1 (b) 0.1 (c) 4 b Let l = 2 + -3. Let h = -299 + 298. Which is the nearest to l? (a) h (b) 1/7 (c) 0 a Let l = -26 - -53/2. Suppose -5y = 4v + 9, v - 5y - 21 = 2v. What is the nearest to -0.2 in -2, v, l? l Let m = 6 - 5.7. Let p(d) = d - 4. Let n be p(6). What is the closest to n in m, -1, -3? m Let f = -83 - -82.6. Which is the closest to -1/2? (a) -3 (b) -1 (c) f c Let i be 4/(-22) - (-96)/165. Which is the nearest to 0.1? (a) -2 (b) 1.2 (c) i c Suppose -4l + f = -6, -4l - 3f = 2 - 0. Suppose 3 = 5c - h - l, 4h - 9 = -5c. Let y = c - 1. What is the nearest to -0.1 in y, -1/6, -0.5? -1/6 Let n = -1 - -3. Let h be (12/(-10))/(n/(-5)). Suppose 1 = -g + 4o - 7, hg + 3 = 5o. Which is the nearest to g? (a) -0.3 (b) 1 (c) 0.5 b Let i = -171 + 168. What is the closest to i in 4/5, -0.5, 3? -0.5 Suppose -2c + 6c = 4l - 920, -3c + 5l = 698. Let m = c + 2032/9. What is the nearest to 0 in -0.2, -4, m? -0.2 Let a = -4 + 1. Let l = -2.9 - -3. What is the closest to l in -0.1, 1/3, a? -0.1 Let h = 0.2 + 0.2. Let x = -3.77 + -0.23. Let y = 2 + -1. What is the nearest to y in -5, h, x? h Let w be -32/3 + 3/3. Let z = -15653/2807 + 2/401. Let x = 227/42 + z. What is the nearest to w in 4, 0.3, x? x Let z be 3 - 39/(-3)1/(-5). Which is the nearest to -5/2? (a) -5/4 (b) -1/4 (c) z a Let l(m) = -2m2 - m - 2. Let t be l(-1). Which is the nearest to 0? (a) -5/2 (b) 2 (c) t b Let y = -0.3 + 0.8. Let f = -1.71 + 0.11. Let c = 1.5 + f. What is the nearest to c in -2, 3/2, y? y Let l = 0.4 + 0.1. Let p = 0.3 - -0.7. Let q = 3 + p. Which is the closest to 1? (a) l (b) 0 (c) q a Let i = 12 - 10. Suppose 7m = im. Let q = -5 + 2. What is the nearest to m in 1/2, -0.2, q? -0.2 Suppose -o - 63 = -5y - 237, -3y = -3o + 114. Let g be y/90 + 2/(-9). Which is the closest to 2/7? (a) -0.5 (b) -1 (c) g a Let q be (4 - 5)/(-71). Let d = 4 + -7. Let i = -0.3 + 0.2. What is the closest to i in d, 0.1, q? 0.1 Let o = -4 - -5. Let c = o + -2. What is the closest to 1 in 1, c, 0.1? 1 Let z = 14 - 14. Let f = 34342/333 + -124/37. Let m = f - 100. What is the closest to -2 in -0.3, m, z? -0.3 Let d(a) = -a2 - 9a - 8. Let m be d(-8). Suppose g + 3 - 2 = m. Let j = 5 + g. What is the closest to 0 in j, -	{ "pile_set_name": "DM Mathematics" }
3, 2917 What are the prime factors of 17128137? 3, 13, 439183 What are the prime factors of 91621987? 91621987 What are the prime factors of 1997492? 2, 7, 71339 List the prime factors of 159724139. 53, 3013663 What are the prime factors of 854721824? 2, 11, 89, 27283 List the prime factors of 7398110304. 2, 3, 13, 1975991 What are the prime factors of 8824679? 8824679 What are the prime factors of 3221774259? 3, 11, 2689, 36307 List the prime factors of 99210589. 17, 43, 135719 What are the prime factors of 192060190? 2, 5, 7, 31, 67, 1321 What are the prime factors of 406266555? 3, 5, 97, 279221 What are the prime factors of 498775962? 2, 3, 83129327 List the prime factors of 3586760636. 2, 31, 193, 149873 List the prime factors of 45283469. 7, 11, 588097 What are the prime factors of 6980963454? 2, 3, 79, 545473 What are the prime factors of 1885527998? 2, 109, 8649211 What are the prime factors of 160337791? 1999, 80209 List the prime factors of 283363269. 3, 7, 367, 36767 What are the prime factors of 4837611204? 2, 3, 19, 7072531 List the prime factors of 1477793137. 61, 24226117 List the prime factors of 752324. 2, 19, 521 What are the prime factors of 1089002794? 2, 11, 433, 114319 List the prime factors of 42236733. 3, 7, 11, 67, 2729 List the prime factors of 975335. 5, 97, 2011 What are the prime factors of 7980362650? 2, 5, 13, 47, 261223 List the prime factors of 4220707239. 3, 7, 41, 467, 3499 List the prime factors of 73308955. 5, 29, 31, 47, 347 List the prime factors of 705678509. 705678509 What are the prime factors of 294222150? 2, 3, 5, 37, 41, 431 List the prime factors of 76628700. 2, 3, 5, 101, 281 List the prime factors of 4891566. 2, 3, 815261 What are the prime factors of 1875874406? 2, 7, 449, 457, 653 List the prime factors of 2557071666. 2, 3, 3109, 5077 What are the prime factors of 185856785? 5, 59, 630023 What are the prime factors of 449722420? 2, 5, 7, 17, 37, 5107 What are the prime factors of 3241361869? 157, 2621, 7877 What are the prime factors of 50908573? 251, 202823 List the prime factors of 91768527. 3, 10196503 List the prime factors of 1276786018. 2, 173, 419, 8807 What are the prime factors of 55706405? 5, 491, 22691 List the prime factors of 3288589463. 17, 139, 1391701 List the prime factors of 1272411053. 17, 157, 476737 What are the prime factors of 5956999894? 2, 5501, 541447 List the prime factors of 83180734. 2, 7, 13, 109, 599 List the prime factors of 907546646. 2, 307, 1478089 What are the prime factors of 481090289? 481090289 What are the prime factors of 778278287? 778278287 List the prime factors of 81542866. 2, 23, 191, 9281 List the prime factors of 867261283. 7, 127, 173, 5639 List the prime factors of 1155033809. 1155033809 What are the prime factors of 249317602? 2, 359, 347239 What are the prime factors of 63680536? 2, 7960067 What are the prime factors of 171246793? 171246793 List the prime factors of 706304142. 2, 3, 97, 404527 What are the prime factors of 3446802509? 3446802509 What are the prime factors of 22462461? 3, 7, 157, 757 What are the prime factors of 295338451? 19, 233, 66713 List the prime factors of 5127338662. 2, 43, 661, 90197 What are the prime factors of 12749459? 181, 70439 List the prime factors of 153850209. 3, 79, 649157 What are the prime factors of 167818463? 167818463 What are the prime factors of 8303700476? 2, 67, 30983957 What are the prime factors of 1769124367? 2579, 685973 What are the prime factors of 7449368827? 101, 2237, 32971 List the prime factors of 1894636399. 367, 5162497 List the prime factors of 146796037. 17, 8635061 What are the prime factors of 218645844? 2, 3, 19, 958973 What are the prime factors of 7271084? 2, 1817771 What are the prime factors of 362043818? 2, 337, 537157 List the prime factors of 1415819008. 2, 5530543 List the prime factors of 193722772. 2, 373, 129841 List the prime factors of 1836785391. 3, 7, 823, 106277 List the prime factors of 107209198. 2, 103, 520433 List the prime factors of 137759522. 2, 68879761 List the prime factors of 1798412309. 61, 29482169 What are the prime factors of 76286322? 2, 3, 7, 41, 14767 List the prime factors of 265656617. 29, 53, 307, 563 List the prime factors of 1556300343. 3, 13, 17, 2347361 What are the prime factors of 6574103748? 2, 3, 2081, 29251 List the prime factors of 829079700. 2, 3, 5, 2763599 List the prime factors of 36569192. 2, 11, 415559 What are the prime factors of 127484237? 127484237 What are the prime factors of 277914440? 2, 5, 6947861 What are the prime factors of 130027818? 2, 3, 103, 210401 List the prime factors of 65285756. 2, 151, 108089 List the prime factors of 499430276. 2, 19, 6571451 What are the prime factors of 52289766? 2, 3, 968329 What are the prime factors of 127060455? 3, 5, 29, 292093 List the prime factors of 28128362. 2, 37, 593, 641 What are the prime factors of 1578967324? 2, 11, 35885621 List the prime factors of 473870089. 7, 11, 19, 323903 What are the prime factors of 749899? 749899 What are the prime factors of 585546217? 191, 373, 8219 List the prime factors of 2426628187. 19, 127717273 What are the prime factors of 227434595? 5, 6301, 7219 List the prime factors of 68815899. 3, 283193 What are the prime factors of 10137113? 7, 379, 3821 List the prime factors of 632151694. 2, 41, 353, 21839 What are the prime factors of 77559952? 2, 4847497 What are the prime factors of 198795399? 3, 11, 17, 109, 3251 List the prime factors of 272483218. 2, 7, 19, 61, 2399 List the prime factors of 119580602. 2, 59790301 What are the prime factors of 1107586958? 2, 17, 157, 207491 What are the prime factors of 243288839? 149, 227, 7193 What are the prime factors of 1905273027? 3, 7, 4320347 What are the prime factors of 1148532312? 2, 3, 47855513 What are the prime factors of 1436483682? 2, 3, 79804649 List the prime factors of 4896518007. 3, 17, 61, 1573937 List the prime factors of 8565137. 7, 1223591 List the prime factors of 927385229. 29, 1289, 24809 List the prime factors of 925413489. 3, 7, 11, 13, 139, 739 What are the prime factors of 235648064? 2, 23, 160087 List the prime factors of 10580014. 2, 5290007 List the prime factors of 5158327. 17, 303431 What are the prime factors of 572542222? 2, 7, 40895873 List the prime factors of 33328506. 2, 3, 5554751 What are the prime factors of 29447597? 37, 103, 7727 What are the prime factors of 67595596? 2, 37, 456727 List the prime factors of 1218552513. 3, 41, 9906931 List the prime factors of 2195494550. 2, 5, 47, 934253 What are the prime factors of 1950170458? 2, 79, 12342851 What are the prime factors of 95163268? 2, 29, 313, 2621 What are the prime factors of 1556837455? 5, 23, 13537717 List the prime factors of 158951685. 3, 5, 10596779 List the prime factors of 5108107. 5108107 List the prime factors of 91600757. 91600757 What are the prime factors of 705743410? 2, 5, 19, 3714439 What are the prime factors of 2581168554? 2, 3, 143398253 What are the prime factors of 1147427114? 2, 573713557 What are the prime factors of 2288244? 2, 3, 7, 27241 List the prime factors of 240844991. 240844991 What are the prime factors of 3293656124? 2, 11, 74855821 List the prime factors of 242291582. 2, 13, 17, 149, 283 List the prime factors of 8148568. 2, 19, 53609 What are the prime factors of 117205921? 7, 41, 47, 8689 List the prime factors of 48214616. 2, 6026827 What are the prime factors of 88890180? 2, 3, 5, 1481503 What are the prime factors of 73310536? 2, 13, 31, 22739 List the prime factors of 7537082. 2, 7, 10987 List the prime factors of 964943095. 5, 192988619 List the prime factors of 1099422359. 7, 229, 13997 What are the prime factors of 144679230? 2, 3, 5, 535849 List the prime factors of 244789004. 2, 61197251 List the prime factors of 11077656. 2, 3, 461569 What are the prime factors of 64629368? 2, 8078671 What are the prime factors of 7217925980? 2, 5, 211, 1710409 What are the prime factors of 1104053965? 5, 7, 83, 389, 977 List the prime factors of 152007703. 727, 209089 List the prime factors of 45651319. 7, 19, 343243 List the prime factors of 483732230. 2, 5, 71, 487, 1399 What are the prime factors of 4897170891? 3, 251, 2167849 List the prime factors of 10408935. 3, 5	{ "pile_set_name": "DM Mathematics" }
+ 2211244? 2211102 In base 5, what is -33 - 23244? -23332 In base 2, what is 10111111 + 111110011100000101? 111110011111000100 In base 16, what is -9f92 - 36? -9fc8 In base 3, what is -201 + -1010022021100002? -1010022021100210 In base 9, what is -3 + -70358582? -70358585 In base 16, what is -7 + -4bf3de? -4bf3e5 In base 13, what is 858c3c + 5? 858c44 In base 7, what is 5 - -122446123? 122446131 In base 5, what is -3143334 + 1341? -3141443 In base 13, what is 83 - -4a81? 4b34 In base 13, what is 2b34bb - 31? 2b348a In base 15, what is -201 + 671c? 651b In base 5, what is -1430 - 1001334130? -1001341110 In base 7, what is -4 + -121166004? -121166011 In base 7, what is -1405321250 + -1? -1405321251 In base 9, what is -26 - 12237355? -12237382 In base 10, what is -219098744 - -2? -219098742 In base 7, what is 113512 + 31033? 144545 In base 15, what is 5 + b48? b4d In base 4, what is 22213322 - 21002? 22132320 In base 6, what is 34433 - 141122? -102245 In base 14, what is -271 - -80d16? 80a85 In base 15, what is 4b - -7eb2? 800d In base 7, what is -22 + -262316620? -262316642 In base 2, what is 111010001011 + -111101011100? -11010001 In base 10, what is 4 - 23458000? -23457996 In base 11, what is 276a9 - 76? 27633 In base 5, what is 13130200 + -14213? 13110432 In base 3, what is -10 - 10212202100012101? -10212202100012111 In base 6, what is -3231345321 - 24? -3231345345 In base 14, what is 3 - -24716b? 247170 In base 4, what is 122023 - 133201? -11112 In base 11, what is 4 + a22195? a22199 In base 3, what is -2200210 + -20121102102? -20201010012 In base 11, what is -1 + 43644563? 43644562 In base 7, what is 202264564 - -2? 202264566 In base 7, what is 1134345 + -44? 1134301 In base 16, what is -1a39f0 + 5? -1a39eb In base 2, what is -10 + 11000000011111000011? 11000000011111000001 In base 2, what is -10010001101110 + 110011101010? -1011110000100 In base 10, what is 186 - 58714? -58528 In base 12, what is -9ba26b - -75? -9ba1b6 In base 4, what is 12 + 203012133301? 203012133313 In base 9, what is 1231 - -208046? 210277 In base 15, what is 29 + 881e? 8848 In base 6, what is 23 + -202334253? -202334230 In base 6, what is -3100 + 4521315? 4514215 In base 10, what is -33010 + 245? -32765 In base 5, what is -112224144213 + 12? -112224144201 In base 7, what is 162352011 - -1? 162352012 In base 5, what is 3 - -2314410140? 2314410143 In base 2, what is -10 + 100110000010100101111000? 100110000010100101110110 In base 4, what is 1321220221320 - 2? 1321220221312 In base 4, what is 23 + 22002223223? 22002223312 In base 9, what is -13863105 + 20? -13863075 In base 15, what is -1c71a79d - 2? -1c71a7a0 In base 3, what is -12 + -120200112101122? -120200112101211 In base 4, what is -3100112 + -10212301? -13313013 In base 11, what is -1303308 - -5? -1303303 In base 7, what is 44 - -110433262? 110433336 In base 11, what is -93185281 - -1? -93185280 In base 3, what is -1001011110112 + -10? -1001011110122 In base 3, what is 2000220121 - -1200100? 2002120221 In base 10, what is 3 + 10936132? 10936135 In base 12, what is -3 + -442566a? -4425671 In base 4, what is 202 + 1232322033? 1232322301 In base 5, what is 2 - -12430323112? 12430323114 In base 9, what is -8402063 - 8? -8402072 In base 5, what is 1 - 34024044020? -34024044014 In base 9, what is 86776403 + -1? 86776402 In base 9, what is 7536 + -175657? -167121 In base 3, what is 100110120122 + 1221? 100110122120 In base 13, what is 97a - -9372? a01c In base 11, what is -199 + -10116? -10304 In base 5, what is -33424 + 23120043? 23031114 In base 12, what is -57a356 + 11? -57a345 In base 9, what is -40273867 - -3? -40273864 In base 15, what is -4 - 500cb76? -500cb7a In base 9, what is -115 + -13036050? -13036165 In base 10, what is 3860 - -7857? 11717 In base 5, what is 113340234 - 4033? 113331201 In base 15, what is -29b8bde + -e? -29b8bed In base 4, what is 1220 + 130133300? 130201120 In base 5, what is -33421 - 43242? -132213 In base 6, what is -42512 + -214? -43130 In base 8, what is -4 + -27513354? -27513360 In base 14, what is -53b8 + 293? -5125 In base 12, what is 8590307 + 5? 8590310 In base 6, what is 3 - 52035022014? -52035022011 In base 8, what is -1107623425 + -3? -1107623430 In base 11, what is -8 - 198921? -198929 In base 10, what is -397 + -3121? -3518 In base 2, what is -1010 + 110111110100110011010? 110111110100110010000 In base 14, what is -8 + 97b32c? 97b324 In base 4, what is -3311203200 - 2? -3311203202 In base 15, what is -24142 - 66? -241a8 In base 6, what is -213454015 + 15? -213454000 In base 11, what is 307 - 13760? -13454 In base 15, what is -157a8 - -162? -15646 In base 16, what is -f65ad - 18? -f65c5 In base 3, what is 20002222 - -1200? 20011122 In base 13, what is -30bc - -84c? -2570 In base 6, what is 24002 + 120034? 144040 In base 11, what is -5 - 96190164? -96190169 In base 6, what is 14 - 10440422055? -10440422041 In base 8, what is -2 - -144544433? 144544431 In base 13, what is -12103 + 4869? -a567 In base 7, what is -301 + -1361410? -1362011 In base 5, what is -2020324420 + -32? -2020330002 In base 7, what is -1324 - -1060? -234 In base 7, what is 330445546 - -11? 330445560 In base 16, what is -fe + -1475a? -14858 In base 16, what is -1836d + 22f? -1813e In base 11, what is 3 + -10532883? -10532880 In base 2, what is 101010010000001011001000000 - 0? 101010010000001011001000000 In base 11, what is -5 - 130188a? -1301894 In base 14, what is 5 + -14a02c19? -14a02c14 In base 11, what is 461 - -2a4? 755 In base 13, what is -645854 - 68? -6458bc In base 16, what is -fcd - -16439? 1546c In base 14, what is 3a06 - 4941? -d39 In base 7, what is -115520662 + 22? -115520640 In base 5, what is 32 - -1343222102? 1343222134 In base 7, what is 204233301 - 1? 204233300 In base 2, what is 11 - -1001101011110001101011100? 1001101011110001101011111 In base 8, what is -4655 + -15227? -22104 In base 6, what is 14250140 - 3? 14250133 In base 15, what is -5 + 595668? 595663 In base 4, what is -12 + -30223122233? -30223122311 In base 16, what is -2 - c0909? -c090b In base 6, what is -2211214 - 233? -2211451 In base 4, what is -220 - -10332033103? 10332032223 In base 16, what is 3 + 76eab2b? 76eab2e In base 4, what is 133 - 230131322? -230131123 In base 10, what is -26 - -56196232? 56196206 In base 11, what is -234907 + 5? -234902 In base 13, what is 3 - -cb5b40? cb5b43 In base 4, what is 120 + 1022202310203? 1022202310323 In base 14, what is 1223a0 + 27? 1223c7 In base 7, what is 641 - 655112? -654141 In base 13, what is -116a87ab - 4? -116a87b2 In base 7, what is 4 - 320605516? -320605512 In base 6, what is 505554 + 1351? 511345 In base 2, what is -1000101111111001111011 + 1? -1000101111111001111010 In base 15, what is -dc25ab - -4? -dc25a7 In base 11, what is 172110a + -20? 172109a In base 6, what is 23 - 503231033? -503231010 In base 8, what is -3 - -165317021? 165317016 In base 3, what is -101220 + -12112202? -12221122 In base 13, what is 25b11b + -2a? 25b0c1 In base 2, what is -111010011001000 - -10000? -111010010111000 In base 3, what is 10122202010 - 1102? 10122200201 In base 11, what is 4 + -810841? -810838 In base 5, what is 1113 - 142432233? -142431120 In base 16, what is -1180 + 416b? 2feb In base 6, what is 43523 - -51212? 135135 In base 6, what is -145 + 2400240? 2400051 In base 13, what is -21c834 - -58? -21c7a9 In base 4, what is 21113131122 + 0? 21113131122 In base 3, what is -1022201001110 + -200? -1022201002010 In base 5, what is -211033 + -1103034? -1314122 In base 9, what is 376 - -102458? 102845 In base 11, what is -3562843 + -38? -3562880 In base 12, what is 133 - 24958? -24825 In base 7, what is -3 + 130163641? 130163635 In base 16, what is 1 + af72846? af72847 In base 3, what is -12 - -212022100211? 212022100122 In base 8, what is 243 + -331162? -330717 In base 8, what is -10615665 + -33? -10615720 In base 15, what is -3 - 54a0b4? -54a0b7 In base 3, what is -1221120200111 - 101? -1221120200212 In base 3, what is -1 + 1002012202020022? 1002012202020021 In base 14, what is 3 - 293ccca? -293ccc7 In base 16, what is 2256f92e + -3? 2256f92b In base 10, what is 2603 - -58696? 61299 In base 16, what is 5 + -810fde? -810fd9 In base 12, what is -34428a7 + -3? -34428aa In base 4, what is 1	{ "pile_set_name": "DM Mathematics" }
k. Calculate the highest common divisor of k and 130. 10 Suppose -18u + 5u = -91. Suppose 6h - uh = 3x - 440, -x - 3h + 160 = 0. Let b = 184 + -126. Calculate the highest common factor of b and x. 29 Suppose -l = 3d - 1, -3d = -2l + 55 - 17. Suppose -17b = -lb - 20. Let m be 12/21 - 1 - 340/(-140). What is the highest common factor of b and m? 1 Suppose -2n - 4 = -3y, 60n - 32 = 57n - 5y. Calculate the greatest common divisor of 788 and n. 4 Suppose 5h = 75 - 5. Let j(f) = -f + 20. Let x be j(h). Let l be 32/4(-99)/(-44). Calculate the highest common factor of x and l. 6 Let d = 552 - 447. Suppose -4 = -4v + b + 248, 4b + 126 = 2v. What is the greatest common factor of v and d? 21 Suppose -507 - 431 = -6h - 794. Calculate the greatest common factor of h and 328. 8 Suppose -195 = -4v + 2q - 7q, q + 42 = v. Let y = v - 82. Let c = -22 - y. What is the highest common factor of c and 165? 15 Let d = -19 + 19. Suppose -u = -du - 132. Suppose 797m - 779m - 216 = 0. Calculate the greatest common divisor of m and u. 12 Let s(k) = -2k3 + k - 1. Let u be s(-2). Let n = 88 + -81. Let r = n - -97. What is the greatest common divisor of r and u? 13 Let v(u) = -4u*3 - 2u - 2. Let t be v(-1). Suppose -tr + 32 = -2q, -8 = -2r + 3q + 12. Calculate the highest common factor of r and 91. 7 Let y = -1261 - -1268. Let i = -70 + 119. Calculate the highest common divisor of i and y. 7 Let u be (-30)/6(-6 + (-28)/(-20)). Calculate the greatest common divisor of 15295 and u. 23 Let n = 80 + 110. Let k(h) = 6h*2 - 7h + 1. Suppose 4m = 0, -a - m - 3 = -0m. Let v be k(a). Calculate the highest common divisor of n and v. 38 Let g(a) be the second derivative of 19a4/12 + 5a*3/3 + 12a*2 - 23a - 2. Let d be g(-6). Calculate the greatest common divisor of 72 and d. 72 Let s = 442 - 277. Suppose 2q = -4c + 622, 5q - 1611 = -0q + 4c. Let m be (-1 + 7)q/58. Calculate the greatest common factor of m and s. 33 Let q(b) = 21b - 32b + 127 - 79 - 24b - 70. Let r be q(-2). What is the greatest common divisor of 256 and r? 16 Let j be ((9/(-5))/((-21)/35))/((-24)/(-1664)). Calculate the highest common factor of j and 1274. 26 Let v be (-439 - (1 - 3))-2. Suppose 7t + v = 26t. Suppose 2r - 26 = 20. Calculate the highest common factor of t and r. 23 Let c be (-479 - -5)(-650)/300. What is the highest common factor of 1343 and c? 79 Let l(b) = -b*3 + 3b*2 + 2b - 3. Suppose -9u - 16 = -61. Let c = 8 - u. Let s be l(c). What is the highest common divisor of s and 27? 3 Suppose -2h = c - 200, -3c + c - 300 = -3h. Let u = -45573 - -45648. Calculate the greatest common divisor of h and u. 25 Let b be (25/(-200) + 10394/(-48))(-3)/2. Calculate the highest common divisor of b and 4160. 65 Let g(j) be the second derivative of 1/20j*5 - 13/6j*3 + 9j*2 + 5/6j*4 - 3j + 0. Let s be g(-11). Calculate the greatest common divisor of s and 5. 5 Let k(t) = 4t2 + 38t - 29. Suppose -9j - 120 = -j. Let h be k(j). What is the greatest common divisor of h and 43? 43 Let k = 171 - 129. Suppose 17y = 13y. Suppose -3b - 6b + 126 = y. What is the greatest common factor of b and k? 14 Suppose 0 = 2l + 3t - 1605, -107l = -102l + t - 4045. Let y(b) = -2b*2 + 13b - 2. Let i be y(4). Calculate the highest common factor of l and i. 18 Let c be (4/2)/(2/22). Let s(a) = -a*2 - 12a - 11. Let p be s(-12). Let w be ((-10)/3)/(p/363). Calculate the highest common factor of w and c. 22 Let c(n) = 7n2 - 254n + 759. Let m be c(3). What is the greatest common factor of m and 7485? 15 Let z = -31517 - -31999. What is the greatest common divisor of 21449 and z? 241 Let o = -2 - -21. Let f be 1/(1/(-2)) + (-5 - -7 - -10 - 2). What is the highest common divisor of o and f? 1 Suppose 21x - 917 = -77. Suppose 10 = m + 1. Suppose 8p - mp = -x. What is the highest common factor of p and 360? 40 Suppose 4o + 1778 = 4m + 1694, -o + 189 = 6m. Let z be 2/(-3)-12 - 2. What is the greatest common divisor of z and m? 6 Suppose 6 = 2s, 3 = 2p - s - 0s. Suppose -2v - pc = -23, -3v - 4c = -72 + 40. Calculate the greatest common divisor of v and 26. 2 Suppose -o - o - 3438 = 0. Let k = -1136 - o. Let w be 53 - ((-3 - -3)/(-4))/1. What is the greatest common factor of w and k? 53 Suppose -5g - 25 = -p - 4p, 0 = g + 5p - 25. Suppose -48 = -gd - 3d. Suppose 4b + 23 - 16 = 15. Calculate the greatest common factor of b and d. 2 Let b = -3493 - -3858. What is the highest common divisor of 949 and b? 73 Let v(w) = 10w + 13w*2 - 78w*3 + 7w*2 - 5w*2 - 11 + 76w3. Let n = -2 + 10. Let z be v(n). What is the greatest common factor of 5 and z? 5 Let b(m) = m3 - m*2 - 4m + 5. Let k(j) = 8j + 54. Let n be k(-6). Let s be b(n). Calculate the highest common factor of s and 46. 23 Suppose -4m + 15080 = -7772. Calculate the highest common divisor of 197 and m. 197 Let u be (28/21)/(21128/(-21132) - -1). What is the greatest common factor of 12 and u? 12 Let u(k) = -7 + 135k2 + 2 - 3 + 22 - 13k + 18. Let g be u(2). What is the highest common divisor of 26 and g? 26 Let f be ((-11)/3)/(4/(-780)). What is the highest common factor of 130 and f? 65 Suppose -6k = 4j - 11k - 2624, 0 = j - 2k - 656. Suppose -5u + t + 262 = -3u, -2t - j = -5u. What is the highest common factor of u and 12? 12 Let b = -35 + 0. Let v = b + 38. Let c be (20/50)/(v/45). What is the greatest common divisor of c and 30? 6 Suppose 9s = -w + 7s + 13, 5s - 20 = 0. Let g be (-1)/w - (-67758)/115. What is the greatest common factor of 31 and g? 31 Suppose -3p = -3256 - 23234. Suppose 38o - p = 20240. Calculate the greatest common divisor of o and 9. 9 Let h be (1/(-2))/((-5)/(-90)). Let t be 366 + 1/((-3)/h). Suppose -505f = -509f + 164. What is the greatest common divisor of t and f? 41 Suppose 2l - 10 = -0a + a, 5l = 0. Let d be -5a/(-100)(-16)/2. What is the greatest common divisor of d and 28? 4 Suppose 1342 = 34l - 23l. Suppose 0 = 5f - 5v - 200, f = -2f + 5v + l. Calculate the highest common divisor of 52 and f. 13 Let n = 37828 + -37672. What is the greatest common factor of 3952 and n? 52 Let k(d) = 9d. Let v be k(5). Let m = 5616 - 5589. What is the greatest common divisor of v and m? 9 Let i(y) = 9y + 2. Let z be i(2). Let f = 128 - z. Let t = 4112 + -4100. Calculate the greatest common divisor of t and f. 12 Suppose 5j + k = 82, 3j = -4k + 4 + 52. Calculate the highest common divisor of 5296 and j. 16 Let v = -3829 + 4312. Calculate the highest common factor of 5152 and v. 161 Suppose 5u - 3n = 694 - 170, 2n + 314 = 3u. Suppose -25x = -244 - u. What is the greatest common factor of 119 and x? 7 Let l = 30 + 2. Let p(u) = 18u - 136. Let w = 33 - 21. Let b be p(w). What is the highest common divisor of b and l? 16 Let x = 3628 - 2823. What is the greatest common divisor of x and 35? 35 Let y be 1043/11 - ((-168)/(-44) + -4). Let m be (-2)/(-5) + 2242/y. Calculate the greatest common divisor of m and 36. 12 Let y(z) = -6z - 27. Let h(u) = -5u - 122. Let w be h(-21). Let j be y(w). What is the greatest common divisor of j and 60? 15 Let s(f) = f + 3. Let y be s(3). Suppose 4t + a = 10, -5t = -3t - 5a + y. Suppose -16p - 5 = p - 107. Calculate the greatest common factor of p and t. 2 Let g = 4524 - 4473. What is the highest common divisor of 63 and g? 3 Suppose -24f - 2350 + 442 = -130f. Let g = 3 + 19. Let m = 76 - g. Calculate the greatest common divisor of f and m. 18 Let a be (-1 + 13/3)/(30/(-540)). Let t = a + 246. What is the highest common divisor of 6 and t? 6 Let m(f) = f*2 + 8f + 19. Let c be m(-5). Let p(i) = 10i2 - 8i - 2. Let q be p(c). Calculate the greatest common factor of 162 and q. 18 Let g be 40332/(-33)-1 - 6/33. Suppose -5i + g = -4f, 5i - 2f - 739 = 477. What is the greatest common factor of 22 and i? 22 Suppose -60c - 14200 = -3j - 62c, -j - 4c = -4720. What is the highest common factor of j and 192? 64 Let a(g) = -g3 - 9g*2 - 12g - 27. Let r be a(-8). Suppose 0 = -q + rq - w - 383, 0 = -2w + 2. What is the highest common factor of 12 and q? 12 Let p = 116 + -88. Let c be p/3*(-10)/(40/(-78)). What is the highest common divisor of 14 and c? 14 Suppose -16	{ "pile_set_name": "DM Mathematics" }
1384082 is divided by 67. 63 Calculate the remainder when 973545 is divided by 243384. 9 What is the remainder when 50931 is divided by 12732? 3 What is the remainder when 6001273 is divided by 575? 573 What is the remainder when 74587 is divided by 306? 229 Calculate the remainder when 34785562 is divided by 66. 64 What is the remainder when 4167075 is divided by 6678? 3 What is the remainder when 915848 is divided by 61055? 23 What is the remainder when 14608502 is divided by 112373? 12 Calculate the remainder when 299124 is divided by 149554. 16 What is the remainder when 161619 is divided by 3167? 102 What is the remainder when 27350 is divided by 9564? 8222 Calculate the remainder when 130615 is divided by 153. 106 What is the remainder when 1579390 is divided by 42630? 2080 What is the remainder when 978899 is divided by 42540? 479 Calculate the remainder when 2811759 is divided by 1827. 6 Calculate the remainder when 75955 is divided by 25262. 169 What is the remainder when 81832 is divided by 5444? 172 What is the remainder when 93374 is divided by 11? 6 Calculate the remainder when 690952 is divided by 3156. 2944 Calculate the remainder when 1455952 is divided by 485000. 952 Calculate the remainder when 1649922 is divided by 1616. 1602 Calculate the remainder when 17837665 is divided by 1189177. 10 What is the remainder when 294585 is divided by 16355? 195 What is the remainder when 1549230 is divided by 5? 0 What is the remainder when 2628076 is divided by 32849? 156 Calculate the remainder when 232234 is divided by 100. 34 What is the remainder when 3087663 is divided by 47? 45 Calculate the remainder when 352055424 is divided by 57. 54 What is the remainder when 198155 is divided by 84? 83 Calculate the remainder when 722890361 is divided by 192. 185 What is the remainder when 401583 is divided by 3? 0 Calculate the remainder when 140354 is divided by 14031. 44 What is the remainder when 13949615 is divided by 278992? 15 What is the remainder when 287145 is divided by 19143? 0 Calculate the remainder when 252062 is divided by 84020. 2 Calculate the remainder when 1524031 is divided by 8197. 7586 What is the remainder when 274887 is divided by 369? 351 Calculate the remainder when 3841034 is divided by 7. 1 Calculate the remainder when 43996717 is divided by 42550. 17 Calculate the remainder when 40003 is divided by 458. 157 What is the remainder when 199501 is divided by 99676? 149 Calculate the remainder when 21305 is divided by 20429. 876 Calculate the remainder when 326602 is divided by 4804. 4734 What is the remainder when 13797255 is divided by 36891? 21 Calculate the remainder when 4581574 is divided by 416502. 52 Calculate the remainder when 15124014 is divided by 356. 66 What is the remainder when 235721 is divided by 235212? 509 What is the remainder when 242377 is divided by 80663? 388 What is the remainder when 71818499 is divided by 260? 259 Calculate the remainder when 86834 is divided by 99. 11 Calculate the remainder when 4194900 is divided by 123. 108 What is the remainder when 1895681 is divided by 519? 293 What is the remainder when 14025125 is divided by 103? 27 Calculate the remainder when 6848240 is divided by 6848105. 135 What is the remainder when 78078 is divided by 38287? 1504 Calculate the remainder when 239383 is divided by 1131. 742 Calculate the remainder when 106510150 is divided by 223. 221 What is the remainder when 1161807 is divided by 19046? 1 What is the remainder when 258680 is divided by 222? 50 What is the remainder when 144146 is divided by 48043? 17 What is the remainder when 1185046 is divided by 38225? 71 What is the remainder when 24312302 is divided by 12156145? 12 What is the remainder when 1306469 is divided by 1070? 1069 Calculate the remainder when 6663090 is divided by 1106. 546 Calculate the remainder when 55068 is divided by 644. 328 What is the remainder when 1402822 is divided by 467607? 1 Calculate the remainder when 14565 is divided by 333. 246 Calculate the remainder when 62145937 is divided by 314. 313 What is the remainder when 242162 is divided by 117? 89 Calculate the remainder when 7590668 is divided by 91. 85 What is the remainder when 16906220 is divided by 16906220? 0 Calculate the remainder when 8177108 is divided by 37. 34 Calculate the remainder when 7960513 is divided by 612346. 15 Calculate the remainder when 3079131 is divided by 97. 60 What is the remainder when 32911273 is divided by 341? 340 What is the remainder when 2351536 is divided by 569? 428 What is the remainder when 2926745 is divided by 975531? 152 Calculate the remainder when 2692013629 is divided by 836. 833 What is the remainder when 232399 is divided by 116085? 229 What is the remainder when 1933685 is divided by 509? 503 Calculate the remainder when 2982 is divided by 584. 62 What is the remainder when 1504237909 is divided by 33? 31 What is the remainder when 6217840 is divided by 1850? 1840 Calculate the remainder when 91627455 is divided by 10180828. 3 What is the remainder when 127378342 is divided by 2404? 2402 Calculate the remainder when 16655458 is divided by 356. 354 What is the remainder when 123056 is divided by 8696? 1312 Calculate the remainder when 57420 is divided by 881. 155 Calculate the remainder when 20909811 is divided by 5. 1 What is the remainder when 39684833 is divided by 8035? 8003 Calculate the remainder when 4550728 is divided by 5001. 4819 What is the remainder when 536929 is divided by 143? 107 What is the remainder when 11996080 is divided by 70982? 122 Calculate the remainder when 70928669 is divided by 166. 23 Calculate the remainder when 87206 is divided by 43365. 476 Calculate the remainder when 740130 is divided by 178. 6 What is the remainder when 23436 is divided by 22680? 756 What is the remainder when 1797996 is divided by 449494? 20 Calculate the remainder when 141797 is divided by 110. 7 Calculate the remainder when 9788536 is divided by 386. 348 What is the remainder when 681706 is divided by 340674? 358 Calculate the remainder when 128395 is divided by 2041. 1853 What is the remainder when 2561216 is divided by 22? 20 Calculate the remainder when 6701 is divided by 188. 121 What is the remainder when 380541 is divided by 76077? 156 Calculate the remainder when 11903 is divided by 3942. 77 Calculate the remainder when 3289601 is divided by 365502. 83 What is the remainder when 3531623 is divided by 99? 95 Calculate the remainder when 10303 is divided by 222. 91 Calculate the remainder when 179000005 is divided by 57. 55 What is the remainder when 280779 is divided by 1276? 59 What is the remainder when 2956767 is divided by 492791? 21 Calculate the remainder when 41829867 is divided by 69. 66 Calculate the remainder when 626945409 is divided by 12. 9 Calculate the remainder when 21360 is divided by 586. 264 Calculate the remainder when 82468 is divided by 638. 166 What is the remainder when 11167190 is divided by 446669? 465 What is the remainder when 13886589 is divided by 2494? 2491 What is the remainder when 915704 is divided by 457539? 626 What is the remainder when 110610770 is divided by 19240? 10 What is the remainder when 259471291 is divided by 1951? 1948 Calculate the remainder when 5818 is divided by 3799. 2019 Calculate the remainder when 2661914 is divided by 43637. 57 What is the remainder when 38161150 is divided by 6912? 6910 Calculate the remainder when 213398 is divided by 1201. 821 Calculate the remainder when 218118578 is divided by 761. 758 Calculate the remainder when 14024262 is divided by 7012128. 6 What is the remainder when 715184 is divided by 3083? 3011 Calculate the remainder when 61441 is divided by 10178. 373 What is the remainder when 45991811 is divided by 335? 331 What is the remainder when 5235056 is divided by 127? 116 Calculate the remainder when 173237448 is divided by 8350. 8348 Calculate the remainder when 15182270 is divided by 2739. 2732 What is the remainder when 6326108 is divided by 176? 140 Calculate the remainder when 50685 is divided by 4736. 3325 What is the remainder when 1031806907 is divided by 1683? 1682 Calculate the remainder when 352759 is divided by 58770. 139 Calculate the remainder when 17	{ "pile_set_name": "DM Mathematics" }
/7 nonequal? True Which is smaller: 4 or 721/166? 4 Is 21 at least 146/7? True Which is greater: 0 or 43/61030? 43/61030 Is 3636 > 3121? True Which is bigger: -1/39645 or 0? 0 Does 3366/79 = 44? False Is 230555 smaller than 230546? False Is 1409/3 smaller than 0.16? False Is -1/3 != 1005/556? True Which is smaller: 0 or -7/537273? -7/537273 Do -2319 and -2354 have the same value? False Is 2811 at most 2824? True Is -277785/4 at least as big as -69446? False Is -58421 > -2/49? False Which is greater: 7173 or 3? 7173 Which is bigger: 2.354 or -28? 2.354 Is -4514/13 smaller than -348? False Is -0.2345084 < -0.1? True Is 1/5601 greater than or equal to 3/8? False Is -15588 at most 14? True Is -938 bigger than 0.3? False Which is greater: -16858 or 72? 72 Is 10710 at most as big as 10528? False Which is smaller: 90 or 744? 90 Which is greater: 1 or -8/14621? 1 Is 626552 < 626550? False Is 6/17 < 281.05? True Is 0 smaller than 26203/4? True Which is bigger: 17.6964 or 2/5? 17.6964 Which is smaller: 5713 or 5703? 5703 Is -2 greater than -27689? True Which is bigger: -579174 or -579175? -579174 Which is smaller: 127 or 9091/71? 127 Do -598 and -18 have the same value? False Which is greater: 2/9 or -207.9? 2/9 Is 2005/608 greater than 3? True Is 9751 at most as big as 9756? True Is 1889 at least -18? True Which is smaller: -14643 or 1? -14643 Is -1 smaller than 1/415280? True Which is smaller: -976 or -28347/29? -28347/29 Which is smaller: 12/82657 or 0? 0 Which is smaller: -1 or 23/1038? -1 Which is bigger: -2/14544859 or 0? 0 Is -1.2417 less than or equal to 0.25? True Is 410/53 bigger than 8? False Which is smaller: 708629 or 2834511/4? 2834511/4 Is -267312 at most as big as -267317? False Which is greater: -39.96 or -0.3? -0.3 Is -48101/2 bigger than -24052? True Is 18097 at least as big as 18097? True Which is smaller: -7039 or -7064? -7064 Which is smaller: 3108 or 3100? 3100 Is 3 < -35582? False Which is greater: 2 or -962428? 2 Which is bigger: 14037 or 14033? 14037 Which is smaller: -6480 or -1.4? -6480 Which is bigger: -234851 or -234849? -234849 Are 6752565 and 6752566 equal? False Is -1136576 > -1136576? False Which is bigger: -0.02 or 1426/19? 1426/19 Which is smaller: -8/3 or -1638? -1638 Is -168299 greater than -168298? False Which is smaller: 0 or -628/3613? -628/3613 Is 6722 less than 14? False Is -31 bigger than 10020? False Is 3062297 not equal to 3062297? False Are -10720 and -10877 unequal? True Which is bigger: 9/8 or -9.77? 9/8 Which is bigger: 4 or 506/147? 4 Is 1/507 at most as big as -89? False Which is smaller: 903 or 946? 903 Which is smaller: 686484/31 or 22146? 686484/31 Is -1 smaller than -18/512027? True Which is smaller: -11/56 or 0? -11/56 Is 1 greater than -95/284? True Is -5623 bigger than 2/37? False Which is bigger: -15 or -8/623? -8/623 Does -40682 = -40682? True Is -205 at most as big as 403? True Is -379079 equal to -1137241/3? False Which is smaller: -647 or -596? -647 Is -0.2 > 73996? False Which is bigger: -19074 or -4? -4 Is 1.7 at most -1700? False Is -1/31501 <= 1? True Which is greater: -3457/5 or -690? -690 Is 5758 equal to -402? False Which is greater: -90558/7 or -12936? -12936 Which is greater: 61668 or 34? 61668 Which is bigger: 423/38 or 32? 32 Is 427666/7 less than 61096? True Is -67/12327 at least as big as 0? False Which is greater: 4616/877 or 6? 6 Is -2313 < 7? True Which is smaller: -24095 or -24096? -24096 Which is smaller: -362109 or 1/2? -362109 Is 30 > -4877? True Is -296885 equal to -296886? False Which is greater: -859701 or -859702? -859701 Is 105311 > 105311? False Which is smaller: -547859/28 or -19567? -19567 Which is smaller: -9154 or -2.4? -9154 Which is greater: 1 or 254/37869? 1 Which is bigger: 5.8277 or 1? 5.8277 Which is greater: -365 or -694? -365 Which is smaller: -36 or -42? -42 Is -415 smaller than -7032/17? True Which is greater: -335863 or -3022766/9? -3022766/9 Is 4392855 less than 4392853? False Is 49765 bigger than -1? True Is -2802169 smaller than -2802169? False Is -4517 at least as big as -4536? True Which is smaller: 62751 or 62753? 62751 Is -230 greater than -19831/86? True Is -222 > -188? False Is -4113442 < -4113443? False Which is smaller: -3.8898 or 0.7? -3.8898 Does -57039 = -57038? False Does -12364 = -12364? True Which is smaller: 194/287 or 25/2? 194/287 Are -0.1 and -8991.09 nonequal? True Are -28464 and -28468 nonequal? True Is -8865 > 6? False Which is smaller: 46968 or 0.1? 0.1 Is 13027 >= 13032? False Which is smaller: -637 or -621? -637 Which is bigger: 93430 or 93424? 93430 Which is bigger: -6786/253 or -26? -26 Which is smaller: 0 or -45/964? -45/964 Is 1/49286 less than 0? False Which is smaller: 663/275 or 1? 1 Which is smaller: 1825 or 1761? 1761 Which is greater: 2323251 or 2323249? 2323251 Is -45/1336 at most 3/4? True Which is smaller: -1856 or 0.413? -1856 Is 14352 >= 14352? True Which is smaller: -1 or 1/2081776? -1 Which is smaller: 127113 or 635568/5? 127113 Which is smaller: -1/4 or 113593? -1/4 Which is smaller: -1 or -1/133233? -1 Which is smaller: 19 or -7156? -7156 Does -212 = -568? False Which is greater: -470984 or -470983? -470983 Which is greater: 47961 or 47962? 47962 Which is smaller: 148131 or 148129? 148129 Is -38/7 != 0.007? True Is -23523 greater than -23525? True Which is greater: 2493 or 2489? 2493 Which is smaller: -894 or -1135? -1135 Is -4.342 at most -5? False Is -140598 smaller than -140591? True Which is greater: -56/57021 or 0? 0 Which is bigger: 152907 or 152908? 152908 Is 1017595 smaller than 1017595? False Which is greater: 8823/5 or 1764? 8823/5 Which is smaller: -1126 or -1048? -1126 Which is bigger: -2 or 36793? 36793 Which is smaller: -78 or -2909? -2909 Which is smaller: 116 or -585? -585 Is -770005 equal to -770004? False Which is greater: -34745 or 0.3? 0.3 Which is bigger: 52/355 or 1? 1 Which is greater: -22025 or -1? -1 Which is smaller: 0 or -66/2305? -66/2305 Which is smaller: 21635 or 21636? 21635 Which is greater: -13.36 or -128? -13.36 Is -2119369 < -2119369? False Which is smaller: -14 or 26071? -14 Which is smaller: 2.241 or 3? 2.241 Do 395787 and 395787 have the same value? True Which is smaller: -1783 or -41038/23? -41038/23 Which is bigger: 28241/9 or 3139? 3139 Which is bigger: 2/583 or -22? 2/583 Which is smaller: 19804 or 19849? 19804 Is 0 greater than -2/236587? True Is -276161 > -276156? False Is 8181 equal to -29? False Are 67475/234 and 289 nonequal? True Is 94256 <= 94247? False Is 6216 greater than or equal to 5996? True Is 1251 at least as big as 1249? True Is -1/51952 < 0? True Which is smaller: 1400 or 1329? 1329 Which is smaller: 21241 or 21262? 21241 Is -523896 > -523893? False Is 18516 < 18458? False Which is bigger: 24099 or 24100? 24100 Is -68 != -421? True Is -280367 >= -280365? False Which is bigger: -783738 or -783739? -783738 Is 1/37061 greater than 1? False Is 1 greater than or equal to 102044? False Is 35 greater than -1591? True Which is bigger: 470941 or 470938? 470941 Which is bigger: 58686 or 58688? 58688 Is 72 < 48? False Is 47908 greater than 622810/13? False Is -5240689 at least -5240689? True Which is smaller: 1 or -1638/16181? -1638/16181 Which is bigger: 85 or 2933? 2933 Is 4/12397 < 1? True Which is greater: 4020 or 4024? 4024 Is 10360 >= 10365? False Which is smaller: 1346 or 1366? 1346 Which is smaller: -13411 or -13231? -13411 Which is smaller: 32 or 15.99? 15.99 Is 1 less than 145/1602? False Which is smaller: -70980 or -1? -70980 Is 184 less than -5/306? False Is -82 bigger than -4/149? False Which is greater: 805169 or 805170? 805170 Which is smaller: -1020 or -68? -1020 Which is greater: -3.72 or -938? -3.72 Which is smaller: 1 or -302/623? -302/623 Is -494780 less than or equal to -494778? True Which is greater: 1 or -7/63953? 1 Is 36936/25 at most 1476? False Are 58868 and 58851 non-equal? True Are 1 and -1/18730 nonequal? True Is -10664 at least -181306/17? True Is 6951 >= 6956? False Is -1520 < -1520? False Is -4573 bigger than -4581? True Which is smaller: 1332 or 3? 3 Which is smaller: 613 or -1023? -1023 Does -8823599 = -8823600? False Which is smaller: 0 or 76/20139? 0 Is 5069 > 57? True Which is smaller: -39125 or 3/4? -39125 Is 5717 >	{ "pile_set_name": "DM Mathematics" }
+ 4 Find the second derivative of 174453688l3 - l + 32379485. 1046722128l Find the second derivative of 3683258d3 - 114d*2 - 118605359d. 22099548d - 228 Find the third derivative of -4935761i*3 - 631631i*2 - 8. -29614566 Find the third derivative of tw*6 + 2060293tw5 + tw + 604t - 3735w*2 wrt w. 120tw3 + 123617580tw2 Differentiate -166746326o*3 + 175181164 wrt o. -500238978o*2 What is the first derivative of -6673i*4 + 2056i - 101095 wrt i? -26692i3 + 2056 Find the third derivative of -f4s - 16152f4 + 69f*3 - 2f*2s - f*2 + 15095fs + f + 9s wrt f. -24fs - 387648f + 414 What is the second derivative of 13164293i*3 - 29968i - 183? 78985758i Differentiate 88j*4 + 3047891j - 853137111. 352j3 + 3047891 Find the second derivative of 510d*2o*2 - 105998d*2o + d*2 - 74022do2 - 6do - o - 16 wrt o. 1020d*2 - 148044d Find the second derivative of 18738354a2 + 4489417a. 37476708 What is the second derivative of 6ms*2 + 9ms - 2123m + 449883s3 + 22s wrt s? 12m + 2699298s Find the third derivative of 145368034z3 + 1023z*2 + 75089 wrt z. 872208204 What is the first derivative of -7436508bs3 + 11s*3 + 3s*2 - 496s - 9 wrt b? -7436508s3 Find the third derivative of -107c*4y*2 - 30066c*4y + 7489065c2y*2 wrt c. -2568cy2 - 721584cy Find the third derivative of 1770329hj3 + 4266981hj + j2 wrt j. 10621974h What is the first derivative of -1482874bx + 2793367b wrt x? -1482874b What is the first derivative of 171283613w3 - 197907727 wrt w? 513850839w*2 Find the third derivative of 3691134h*6 - 2h*5 + 96798630h*2 wrt h. 442936080h*3 - 120h*2 What is the second derivative of -15556834k*2u - 2k2 - 3308ku + 4k + 93u wrt k? -31113668u - 4 Find the third derivative of 1635309q5 + 9957523q*2. 98118540q*2 What is the second derivative of 65979659b*2 + 4241345b wrt b? 131959318 What is the third derivative of -2cq*3u*3 + 29760955cqu*3 - cqu2 - cu - 20c + 521q*3u*2 - 30u wrt u? -12cq*3 + 178565730cq What is the second derivative of -62271522i*5 - 5i + 3895198 wrt i? -1245430440i3 What is the second derivative of -354797o*3 - 16o*2 - 2o + 36067986? -2128782o - 32 What is the first derivative of 102923050y - 274171101 wrt y? 102923050 What is the second derivative of 9885299v3 - 3477442v wrt v? 59311794v What is the derivative of -3045393u*3 - 5484419? -9136179u*2 Differentiate 408l*2x*2 + 2380lx2 - x2 + 233x - 2875 wrt l. 816lx*2 + 2380x*2 Find the first derivative of 384935p*2y + 39p2 - p + 18y*2 + 10355 wrt y. 384935p*2 + 36y Differentiate gj - 3g - 2j3 - 8j*2 + 10902j - 1437195 wrt j. g - 6j2 - 16j + 10902 Find the first derivative of 15115873i2k3 - i2k2 + 133063848k*3 wrt i. 30231746ik3 - 2ik2 Find the third derivative of -6031q*5 + 5838q*3 + 427q*2 - 70930 wrt q. -361860q*2 + 35028 What is the second derivative of -38y*4 + 2y*3 + 90626y*2 - 145155y - 313? -456y2 + 12y + 181252 Find the third derivative of 5jpv3 + 4621jp + 10jv2 + 3j + 1965208pv*3 - 5pv2 - 2pv - 2v*3 wrt v. 30jp + 11791248p - 12 Find the third derivative of -2068d5 + 1250d*4 + 40027484d*2 wrt d. -124080d*2 + 30000d What is the third derivative of -384881125ky*3 + ky*2 - 217ky - 4k + y*2 + 8y + 6 wrt y? -2309286750k Find the third derivative of -7196467v*4 + 27v*2 - 2v + 1471 wrt v. -172715208v Find the second derivative of 664dy3 - 175797dy + 134844y*3 - 75y wrt y. 3984dy + 809064y What is the second derivative of 2t*3z2 + t3 - 1264t2z - 119t2 + 139802tz2 + 9t - 2z wrt t? 12tz2 + 6t - 2528z - 238 What is the second derivative of 76m*3v + 602m3 + 120m*2x*2 - 2mvx + 2mx + 36m - 80vx2 - 11v - x + 2 wrt m? 456mv + 3612m + 240x*2 Differentiate 7416425w + 13742748 wrt w. 7416425 Find the third derivative of 108483342q3 - 597q*2 + 15752q wrt q. 650900052 What is the second derivative of 86516463c3 - 165926760c? 519098778c What is the third derivative of -50012392y*6 - 973y*2 + 5y + 88? -6001487040y3 Find the second derivative of -18869i*3r - 8i3 - i2r - 2i2 - 4124511i - 2r wrt i. -113214ir - 48i - 2r - 4 What is the second derivative of d5 + 172354662d*2 - d + 801803632? 20d*3 + 344709324 What is the derivative of -6726301t*3 - 12t*2 - 1015158449 wrt t? -20178903t*2 - 24t What is the third derivative of -19a3k*3 - 5938a*3k + 25a3 + 46a*2k*3 - 2a*2k*2 - 3ak2 - 11151k*2 + k wrt a? -114k*3 - 35628k + 150 What is the second derivative of -318983635iw*2 + 2iw + 9i - 3w + 744601 wrt w? -637967270i What is the second derivative of -67057k2x2 - k2x - 62k*2 + 41kx2 + 12kx - 2k - 7x2 - 101x wrt k? -134114x2 - 2x - 124 Find the second derivative of 323124647k3 + 7k + 4404942. 1938747882k What is the second derivative of -139r*3 - 8901r*2 - 92747410r? -834r - 17802 Find the third derivative of -681040384b*5 - 534230059b*2 wrt b. -40862423040b*2 Find the second derivative of -398860215y*2 + 2y - 66808705. -797720430 What is the third derivative of 34513852p3 + 102p*2 + 19259p + 4? 207083112 Find the second derivative of -441012d3 + 2d*2 + 82933d - 351. -2646072d + 4 What is the second derivative of -2pwz*2 - 28pwz + 29573pz*2 - 11pz - p + 46wz2 - wz - w + 96z wrt z? -4pw + 59146p + 92w What is the third derivative of 258u*5 - 101u*4 - 23u*3 - 43u*2 - 17369u + 1 wrt u? 15480u2 - 2424u - 138 Differentiate 11093435n2 - 2789649 wrt n. 22186870n Find the second derivative of 89w3 + 392358w*2 - 6021274w + 2. 534w + 784716 Find the third derivative of -4871t*5 + 24955t*4 - 34018040t*2 + t. -292260t*2 + 598920t What is the derivative of 10ntu - nu + 8n + 1564099tu - t + 4034008 wrt u? 10nt - n + 1564099t Differentiate 130218465a - 11048850 wrt a. 130218465 Find the second derivative of 3n*3 + 218n*2s*2 - 32623n*2s - 4ns - 112n - 4748s*2 - 2s - 2 wrt n. 18n + 436s*2 - 65246s Find the second derivative of 535m4 - 437m*3 + 3956208m wrt m. 6420m2 - 2622m What is the second derivative of -1285m2r*3 + 489m*2r + 5mr*2 + 2m - 8r4 - 22r + 3 wrt r? -7710m2r + 10m - 96r*2 Find the third derivative of 18l*3m*3u*2 + 2l*3m*2u + 457l2m*2u*2 - 226835l*2u*2 - 11969452m*3u*2 wrt m. 108l*3u*2 - 71816712u*2 What is the third derivative of -27141520z*3 + 27226738z*2? -162849120 What is the third derivative of 5im3 - 19im2 - 249440im + 10535m*5 - 2m*4 wrt m? 30i + 632100m2 - 48m What is the third derivative of 3145325k4 + 2k*3 + 1803158k*2 - 5? 75487800k + 12 Find the first derivative of -442f4 - 372f*3 + 194f - 81517221. -1768f3 - 1116f*2 + 194 Find the first derivative of -177948864mq + 36378063q + 2 wrt m. -177948864q Find the third derivative of -53j*3m*3 - 12975j*3m - 21j3 - 51434j*2m*3 + 4j*2m + j*2 - jm*3 wrt j. -318m*3 - 77850m - 126 What is the third derivative of 72g5 + 717g*4 - 53g3 + g2 + 1168050g + 3 wrt g? 4320g*2 + 17208g - 318 What is the third derivative of 235k4 + 125891k*3 - 48683395k*2? 5640k + 755346 What is the third derivative of -718a3t*3 + 2065a*3 - 12656a*2t*2 - 52334at5 wrt t? -4308a*3 - 3140040at2 What is the third derivative of 148187417d*6 + 131809411d*2 wrt d? 17782490040d*3 Find the third derivative of 8s*6 + 103s*5 - 1543s*4 - 932s*2 + 85s - 6 wrt s. 960s3 + 6180s*2 - 37032s What is the third derivative of -6b2d*3 + 38b*2d*2 - 18b*2 + 994525d*4 + 18791d*2 wrt d? -36b*2 + 23868600d What is the second derivative of 3z3 + 1596116z*2 - 2z - 94600522? 18z + 3192232 What is the derivative of -wz*3 + wz*2 - 7w - 1089187z + 3446784 wrt z? -3wz2 + 2wz - 1089187 Differentiate 12g*3y - 9970g3 - g2y - g*2 - 2g - 4383*y - 46 with respect to y. 1	{ "pile_set_name": "DM Mathematics" }
307776 and 1084748. 138847744 Calculate the least common multiple of 321 and 265454. 85210734 Find the common denominator of -71/955737 and 22/6690159. 6690159 Calculate the common denominator of -1/250145 and 41/12557279. 62786395 Calculate the lowest common multiple of 22 and 255583778. 2811421558 What is the smallest common multiple of 2777418 and 295470? 13887090 What is the least common multiple of 96 and 10616352? 10616352 What is the common denominator of 59/65196 and 47/24588? 44528868 Calculate the common denominator of 92/816375 and -109/3750. 8163750 Calculate the least common multiple of 8671 and 10982764. 252603572 Find the common denominator of -23/135824 and -93/961216. 12495808 Find the common denominator of 115/406 and -85/925974. 26853246 What is the lowest common multiple of 1260 and 8408295? 33633180 Find the common denominator of 49/372186 and 101/10. 1860930 What is the smallest common multiple of 24288 and 64768? 194304 What is the smallest common multiple of 24864 and 32256? 1193472 Calculate the least common multiple of 2112 and 29526420. 472422720 What is the least common multiple of 40651977 and 7? 284563839 Calculate the common denominator of 70/8019 and -43/198000. 16038000 Find the common denominator of -109/16698354 and -29/12. 33396708 Calculate the lowest common multiple of 1052 and 196984. 51806792 Find the common denominator of 161/13140090 and -43/162. 39420270 Find the common denominator of -109/3656364 and -149/172470. 18281820 What is the least common multiple of 140232085 and 590? 280464170 What is the smallest common multiple of 759676 and 112? 21270928 Calculate the least common multiple of 460210 and 264344624. 1321723120 Find the common denominator of 26/3762495 and -71/15300813. 229512195 What is the common denominator of -75/4022 and 197/3300? 6636300 Calculate the common denominator of 77/5704140 and -5/11154. 815692020 What is the least common multiple of 2254595 and 145? 65383255 Calculate the least common multiple of 84992 and 2822. 1444864 Calculate the least common multiple of 226786 and 12610. 14741090 What is the lowest common multiple of 1131 and 3246724? 9740172 Calculate the least common multiple of 4979 and 94146. 36057918 What is the lowest common multiple of 40 and 1169836? 11698360 What is the smallest common multiple of 673482007 and 5? 3367410035 Calculate the lowest common multiple of 24708 and 1917426. 111210708 What is the least common multiple of 140883258 and 840258? 422649774 Calculate the lowest common multiple of 12 and 96084968. 288254904 What is the common denominator of 38/109921 and -13/102261? 29348907 Calculate the lowest common multiple of 313248 and 7392. 24120096 Calculate the lowest common multiple of 2400 and 2575200. 2575200 What is the common denominator of -59/14444 and -41/19364? 69923404 Calculate the least common multiple of 405 and 602774. 244123470 Calculate the smallest common multiple of 9233000 and 63. 83097000 What is the least common multiple of 3776 and 6153228? 98451648 Find the common denominator of 71/1161963 and -59/23958. 2323926 Find the common denominator of 181/154350 and 53/904050. 6328350 Calculate the lowest common multiple of 38857413 and 1558192. 621718608 What is the common denominator of -27/6188 and 1/982940? 12778220 What is the smallest common multiple of 43850520 and 78? 570056760 Calculate the smallest common multiple of 618 and 20735136. 20735136 What is the lowest common multiple of 10290 and 2280264? 11401320 Calculate the smallest common multiple of 25180135 and 14206. 50360270 Find the common denominator of -1/1283490 and 187/390. 1283490 Calculate the lowest common multiple of 825100 and 1554. 17327100 What is the common denominator of -117/267218 and -31/419914? 2939398 Find the common denominator of -115/20124288 and 101/69876. 20124288 What is the least common multiple of 438515 and 5236? 1754060 What is the common denominator of -82/69578733 and -46/791? 69578733 Calculate the common denominator of -63/41641772 and -37/427. 291492404 Calculate the smallest common multiple of 73008 and 146016. 146016 Find the common denominator of -49/198932026 and -59/12. 1193592156 Calculate the smallest common multiple of 87182198 and 7. 610275386 What is the common denominator of 79/1132160 and -45/7076? 1132160 Find the common denominator of 13/11 and -125/57469932. 632169252 Find the common denominator of 149/7576200 and 77/345. 7576200 What is the smallest common multiple of 30417492 and 7604373? 30417492 Calculate the lowest common multiple of 2012895 and 13218. 8868815370 What is the common denominator of 139/54 and 151/488124? 1464372 What is the common denominator of 101/24 and -7/2809794? 11239176 Find the common denominator of -57/6158 and -93/1915138. 1915138 Find the common denominator of -97/739160 and 48/203269. 8130760 What is the least common multiple of 4703655 and 25? 23518275 Calculate the smallest common multiple of 21840 and 10205. 3428880 What is the common denominator of -23/16063065 and -16/76335? 112441455 Calculate the least common multiple of 13690080 and 57042. 13690080 Calculate the common denominator of 33/2533820 and -9/106167058. 1061670580 What is the common denominator of 33/87480071 and 87/49988612? 349920284 What is the lowest common multiple of 420 and 74321310? 148642620 Calculate the smallest common multiple of 47 and 29905. 1405535 Calculate the least common multiple of 9611703 and 105728733. 105728733 Calculate the common denominator of 53/11824455 and -46/319260285. 319260285 What is the least common multiple of 7309423 and 161? 51165961 Calculate the smallest common multiple of 4812 and 571. 2747652 What is the smallest common multiple of 112896 and 108? 338688 What is the least common multiple of 8691754 and 369? 78225786 What is the common denominator of -81/2713892 and -5/9? 24425028 Calculate the least common multiple of 2038615 and 2854061. 14270305 Calculate the least common multiple of 2484920 and 14785274. 295705480 What is the common denominator of 113/35136 and 55/8274528? 16549056 Find the common denominator of 22/367181 and 13/825. 302924325 What is the least common multiple of 10118230 and 16189168? 80945840 What is the least common multiple of 42745764 and 922? 42745764 What is the common denominator of 64/24742161 and -59/228? 98968644 Calculate the least common multiple of 416280 and 10500. 72849000 Find the common denominator of 23/462393 and 44/5571. 462393 Find the common denominator of -53/4878 and 49/63685. 1146330 Calculate the common denominator of 26/2689665 and 67/1124769. 61862295 Calculate the common denominator of -75/1366498 and -79/6149241. 12298482 Calculate the lowest common multiple of 41094 and 702. 534222 Calculate the common denominator of 71/150 and 71/1083752. 81281400 What is the lowest common multiple of 3 and 311031? 311031 What is the common denominator of 85/12 and 83/2576424? 2576424 Calculate the least common multiple of 31488319 and 233. 31488319 Calculate the common denominator of 85/6503698 and -107/1342. 71540678 Calculate the lowest common multiple of 6943383 and 370. 69433830 Find the common denominator of -145/558 and -5/314915856. 944747568 Calculate the least common multiple of 75057 and 12411. 1576197 Find the common denominator of -121/722514 and 5/16. 5780112 Calculate the least common multiple of 19899 and 64154376. 64154376 What is the common denominator of -43/434 and -65/2337338? 16361366 What is the lowest common multiple of 1732 and 10412351? 41649404 Calculate the common denominator of -53/25168880 and -167/17760. 151013280 Calculate the common denominator of 53/1975974 and 17/86856. 7903896 What is the common denominator of -107/107712 and -25/6528? 215424 What is the common denominator of 127/10804452 and -8/1747779? 118848972 What is the smallest common multiple of 24036 and 117186? 469447116 Find the common denominator of -109/3198 and 76/554853. 1109706 What is the common denominator of 45/209 and -71/9207514? 101282654 Calculate the lowest common multiple of 230436 and 5588592. 620333712 What is the common denominator of 55/282 and -33/796876? 112359516 What is the lowest common multiple of 444177 and 1678002? 15102018	{ "pile_set_name": "DM Mathematics" }
4) - (-4 - 0)/(-8))-2. What is the biggest value in z, -10, 0.3? 0.3 Let h(i) = -2i + 4. Let u be h(-5). Let t = 15 - u. Let v = -654 - -663. Which is the third biggest value? (a) v (b) 4/9 (c) t b Let q = 2992.8 + -2992.5. Which is the second biggest value? (a) q (b) 2/13 (c) 0 (d) -14 b Let x = -3214 - -748861/233. Let o = x - 463/699. Let b be (-669)/(-45) + (-2)/(-6). What is the third biggest value in 1, b, o? o Let w = -1339 + 1339. Let m be 4/14 + 328/(-168). Which is the fourth smallest value? (a) 5 (b) m (c) w (d) -1/3 a Let v = 0.5 - 0.1. Suppose 7g + 567 = -2g. Let n be 228/(-210) - 18/g. What is the second smallest value in n, 2/23, v? 2/23 Let m = -188 + 222. Let k = 36 - m. Which is the third smallest value? (a) 49 (b) k (c) -5 (d) 4 d Suppose 4a = 3l - 111, 0 = 4l - 6l + 3a + 74. Let u = 221/6 - l. Let d = 49 - 46. What is the third smallest value in d, u, 2/3? d Let z = 0.09 - -24.61. Let m = -21.7 + z. What is the biggest value in -3, m, 9? 9 Let y be (-1 - (582/(-120) + 4))(-2)/(-39). Which is the second biggest value? (a) 0 (b) -4/5 (c) y (d) -5 c Let n(h) = h - 4. Let m be n(6). Suppose 3o + m = -1. Let x be 30926/(-23030) + (-12)/(-10). What is the smallest value in x, o, 2, -17? -17 Let f be (-1)/(-6)(-15)/10015. Which is the second smallest value? (a) -0.4 (b) 31 (c) f c Let m be (-35 + 3429/108)4/(-26). Which is the second biggest value? (a) -0.01 (b) 12 (c) m (d) 2/11 c Let t = 215.6 + -210.6. What is the third smallest value in 3/2, -19, t? t Suppose 6v - 211 + 211 = 0. Let l be v + ((-12)/8)/((-45)/(-12)). Let q = 446/7 - 64. Which is the third biggest value? (a) -0.5 (b) q (c) 2/11 (d) l d Suppose -5y + 10 = -4o, -5y + 3 = -5o - 7. Suppose 8f = yf + 162. Let n be ((-9)/12)/(f/(-9)). What is the second biggest value in -1/7, n, 2? n Let d = 0.306 - -156.694. Let o = d + -160. What is the third biggest value in 4, 0.1, 3/4, o? 0.1 Let i = 1.27 - -147.73. Let j = 183.5 - 29.5. Let r = j - i. What is the third smallest value in -0.2, r, -1, 0? 0 Let z = 119.78 + -119.93. Which is the third smallest value? (a) -5 (b) 1/13 (c) z (d) 3 (e) -2 c Let r = -2153/7 + 309. Let s = -3.84056 - 0.15944. What is the fourth biggest value in -0.3, r, 3, s? s Let p = -1 - 1. Let l = -12252.1 + 12252. Which is the third biggest value? (a) -1 (b) l (c) -4 (d) p d Suppose -45r = -55r + 5000. What is the third smallest value in -0.5, -3/4, 0.4, r? 0.4 Let l be (7/63)/((-1)/39) + 18/6. What is the biggest value in -31, l, 20? 20 Let k = 9420 - 9419.7. Which is the smallest value? (a) 2 (b) k (c) 390 b Let q = -0.1 + 0.2. Let w = -3 + 2.6. Let m = 8790 + -8780. Which is the fourth smallest value? (a) -1/8 (b) q (c) m (d) w c Let h = -450 + 450.4. Let v = 0.48 + -5.48. What is the fourth biggest value in 4, 5, h, v? v Let i = 368 - 368.03. Let t be (((-4)/6)/((-30)/(-45)))/6. What is the second biggest value in i, t, -2? t Suppose -4m = 0, m = 3z + 17 - 14. Let g be z/(-1 + 0)-2. What is the third smallest value in g, 3, 9? 9 Let w be ((-24)/(-22) + 209840/(-201025))/((-2)/(-5)). Which is the biggest value? (a) 709 (b) w (c) -0.3 a Let q = -150717/10 + 15072. Which is the fourth smallest value? (a) 6 (b) q (c) 3 (d) -0.05 a Let t = -0.6015 + 0.6015. Which is the biggest value? (a) t (b) 2 (c) 2/7 b Let a = 26.9757 + -24.95. Let v = -0.0257 + a. What is the third biggest value in -0.3, -20, v? -20 Let v = 9 + -13. Let i be ((-72)/(-40))/(-6 - (4 + 371/(-35))). What is the third smallest value in v, i, -1/2, 0? 0 Suppose -24 = -14f + 8f. Suppose 4w - fr = 20, 3w - 7 = -5r + 8. Which is the second biggest value? (a) 4 (b) -7 (c) 3/8 (d) w a Let k be (-4 + -4)(-4)/(-6)(-3)/56. What is the fifth biggest value in k, 2, 7/20, 3, 7? k Let f = 300 - 270. Suppose -b - 9 = -5t, 5t + 28b - fb = 8. What is the fourth smallest value in -17, t, 4, -1? 4 Let r = -228.78 + 228.88. Let h = -5 - -3. Which is the smallest value? (a) 3.1 (b) r (c) h (d) 4 c Let j = 35 + -31. Suppose 2r = -4k - 8, 4r = k - jk - 16. Suppose 4o + 4 - 12 = k. Which is the third smallest value? (a) o (b) -1/3 (c) 0.2 a Let n = -1538 + 1538. Let j = -23 - -24. Which is the smallest value? (a) n (b) j (c) 0.11 (d) -2 d Let q = 1237 - 1236.96. What is the second biggest value in 8, q, 17? 8 Let n be 7/(280/(-15))(-88)/66. What is the third smallest value in n, 3, -15, -1/8? n Let n = -307.52 - -312.52. What is the second smallest value in n, 6, 58.8? 6 Let j = 40071 - 120223/3. Which is the fourth biggest value? (a) 4/13 (b) -0.5 (c) j (d) -5 d Let s = -1723.3 - -1725.3. Which is the second smallest value? (a) 0.4 (b) 4 (c) 3 (d) 0.3 (e) s a Let r = -280.043 - -280. Let j = r - -2.043. Which is the biggest value? (a) 3 (b) j (c) -19 a Let w be (-2216)/(-576) + -4 - 10/45. Let t = -3 - -3.2. Suppose 0 = c + 2d - 11, 3d - 22 = -4c + 2. What is the biggest value in -3, c, t, w? c Let z(q) = q3 + 9q*2 - 10q - 8. Let c be z(-10). Let u = 32.66 - 32.16. What is the smallest value in c, u, -1/10? c Suppose 3t + 0t = 12. Let m = 45.77 - 47.77. Let y = 2.06 - 0.06. Which is the fourth biggest value? (a) y (b) m (c) -5 (d) t c Let v = -0.0403 - -10.0403. Let b be 54/189 - 4/14. What is the second biggest value in 2/5, v, b? 2/5 Let f = 1629 + -1631. Let o = -0.3 + 0.2. What is the fourth smallest value in -2/5, f, o, -3/2? o Suppose 47v - 49v = -4p + 18, -3v + p - 12 = 0. What is the third biggest value in -2, -0.075, 1/2, v, 0.4? -0.075 Let d(l) = 3l3 - 2l2 + 1. Let w be d(2). Let j = 22 - w. Let s(c) = -c3 - 8c2 - 2c - 17. Let v be s(-8). What is the smallest value in j, -0.2, v? v Let k = -740 + 752. Suppose 6z - 2z + k = 0. What is the biggest value in -2, 0.4, 1, z? 1 Let p = 0.02 + 0.78. Let n = 272 - 637. Let h = -4743/13 - n. What is the third smallest value in p, h, -0.3? p Let o = -5.1227 - -0.1227. What is the fourth smallest value in -0.1, -1.8, -3, o? -0.1 Let m be (4 - 1)/(-21) + 1264/28. Let u be m/20 + 3 + 5-1. Which is the smallest value? (a) 3 (b) -2/23 (c) 1/5 (d) u b Suppose 0 = -3q - q + 3s - 27, 2s = 10. Let c = 4 + q. Let v = -594.2 + 592.2. What is the smallest value in c, -3/8, v, -0.4? v Let l = 55280/9 + -6142. Which is the third smallest value? (a) -7 (b) l (c) 4 (d) 3/2 (e) -6/5 b Let t be 18/27(-3 + 240). Let r be (-36)/27 - t/(-114). What is the biggest value in 7, r, 2? 7 Let b = 14.3 - -1.2. Let v = -15.4 + b. What is the smallest value in 1.9, v, -1/8, -0.3? -0.3 Let p = -3965.2 + 3965. What is the third biggest value in 16, 0, -1/2, p? p Let i = 27924 - 27924.2. What is the second biggest value in i, -75, -1? -1 Let d be (-2)/5 - 6/30. Suppose 5r - 2c + 35 = 0, 9r - 11r - c = 5. Let l = 643/5 + -127. What is the third biggest value in -0.4, d, r, l? d Let b = 640 - 645. Let y be (1070/(-105))/(-2) - (-25)/b. What is the second smallest value in -5, y, 0.5, 2? y Let u = 349 + -492. Let w be u/(-156) + 2/(-8). Which is the third smallest value? (a) w (b) 0.54 (c) -3 a Let j = -313.2 - -313.5. Which is the third smallest value? (a) 9 (b) j (c) -10 a Let p = -2.8288 + -29.1712. Which is the fourth smallest value? (a) 21 (b) 1 (c) 3 (d) p a Let w = -1115 - -1159.7. Let r = 49.7 - w. Let h = 44 - 219/5. Which is the fourth biggest value? (a) -0.3 (b) r (c) h (d) 0 a Let u be 8/40(0 - 4). Let g = u + 29/30. Let s be (-1)/28 + (-2)/8. Which is the fourth smallest value? (a) 0.4 (b) 3 (c) g (d) s b Let v be (-1650)/1430 - (-1 - 0). What is the third smallest value in -2/7, -0.05, -0.4, -5, v? -2/7 Let u(w) = -w*2 - 103w - 392. Let h be u(-4). What is the biggest value in -2/7, -0.4, h, 11/3? h Suppose 0 = -7n + 6n - 1. Let p(c) = -c*3 - 3c*2 - 3c. Let l be p(-2). Let i = -9 + l. What is the third biggest value in n, -0.1, i? i Let n(u) = u*2 - 15u - 287. Let i be n(26). Let f = -0.04 - -1.14. Let h be 64/132 - 10/15. What is the third biggest value in i, f, -1/11, h? h Let x = 0.18 + -3.38. Let l(o) = -o*3 + 26o*2 + 61o - 135. Let s be l(28). What is the second biggest value in x, -4, s? x Let n be (-10)/(-2) - (-141)/(-9)*(-54)/(-162). Which is the second bigg	{ "pile_set_name": "DM Mathematics" }
mainder when o is divided by 4. 0 Suppose 3i - 4v = -v + 528, -i = v - 186. Suppose 64 = 3h + i. Let n = h - -62. What is the remainder when n is divided by 12? 11 Suppose 0 = 2u - 7u + 65. Let h(x) = -x2 - 6x - 3. Suppose -g = -2r + 5r + 1, 4g = -r - 15. Calculate the remainder when u is divided by h(g). 3 Let p(o) = 2o*2 + 2o - 1. Suppose -6b = -3b - 15. Calculate the remainder when b is divided by p(1). 2 Let i be (-2)/(-9) - 4424/63. What is the remainder when (-303)/(-7) - (-4)/(-14) is divided by 4/14 - 1030/i? 13 Let v(b) = -8b - 25. Let i(a) = 3a + 8. Let g(o) = -11i(o) - 4v(o). Let w = 19 + -5. Calculate the remainder when w is divided by g(7). 4 Let m = -41 + 77. Calculate the remainder when m is divided by 13. 10 Let k(w) = w*2 + 5w. Suppose 0 = 3v - 3c + 21, 0v - 12 = -4v - 4c. What is the remainder when k(-6) is divided by v/3 + (-42)/(-9)? 2 Calculate the remainder when 34/6(1 - 14/(-7)) is divided by 10. 7 Suppose -5o + 50 = -10. Let x(u) = 2u*2 - 4u + 3. Calculate the remainder when x(5) is divided by o. 9 Suppose j + 4o - 21 = 0, -2o - 15 = -j - 0o. Suppose -5d + 2k = -55, 45 + 5 = 5d - k. What is the remainder when j is divided by d? 8 Let u = 38 + -57. What is the remainder when 1/26 - u is divided by 6? 4 Let z(d) = -d3 + 6d*2 + 7. Let i be z(6). Suppose -2y + i = -49. Calculate the remainder when y is divided by 0 - (0/(-2) - 15). 13 Suppose -3q - 2 = 1, 0 = -5w + 3q + 393. What is the remainder when w is divided by 20? 18 Let g(k) = -55k*3 + 2k*2 - 1. Let z be g(1). Let w = -107 + 197. Let l = w + z. What is the remainder when l is divided by 19? 17 Suppose -35 = -2j + c, -5c = 4j - 44 - 47. What is the remainder when 55 is divided by j? 17 Suppose f + 108 = 3f + q, -5f + q = -263. Let t(x) = -8x. Let i be t(-2). Let k = i + 2. Calculate the remainder when f is divided by k. 17 Suppose c - 5z = 148, -4c - z = -5z - 512. Suppose -44 = -v + n, 2v = 4v + 5n - c. What is the remainder when v is divided by 13? 10 Let r(z) = 6z - 1. What is the remainder when r(2) is divided by 3? 2 Let d = -1 - -9. Let f(m) = -m*2 + 12m - 7. What is the remainder when f(d) is divided by (-37)/(-4) - (-1)/(-4)? 7 Suppose 0 = -p - d - 0 + 10, 37 = 4p + 3d. What is the remainder when 20 is divided by p? 6 Suppose 0n - 31 = n + 4v, 2n = -v - 27. Let i = n + 23. What is the remainder when 28 is divided by (-8)/i + (-32)/(-3)? 8 Let l = -12 - -10. What is the remainder when 12 is divided by -1 + 4 + (-8)/l? 5 Let i = 1 - -6. Let c = 11 - i. Suppose -2d + 0 + 4 = 0. What is the remainder when c is divided by d? 0 Let z(r) = r*2. What is the remainder when z(-7) is divided by 18? 13 Suppose 2x - 4x = -24. Let q = 19 - 12. What is the remainder when x is divided by q? 5 Let b(d) = 2d*2 + 10d - 2. Let y(j) = -3j2 - 11j + 3. Let n(i) = 4b(i) + 3y(i). What is the remainder when 2 is divided by n(7)? 0 Suppose 38 = 2h - 22. Calculate the remainder when h is divided by 8. 6 What is the remainder when 25 is divided by (-3)/(10/6 + -2)? 7 Let k(f) = -f3 - 6f*2 + f + 3. What is the remainder when k(-7) is divided by 16? 13 Suppose 10l - 490 = -4l. Calculate the remainder when 209 is divided by l. 34 Let r = -11 - -40. Calculate the remainder when r is divided by 15. 14 Let r = -16 - -38. Let v(i) = -13i - 9. Calculate the remainder when v(-4) is divided by r. 21 Let q(c) = 13c2 - 2c - 1. Let x = -8 - -7. What is the remainder when 41 is divided by q(x)? 13 Suppose 3n + 7 = -2. Let u = -2 - n. What is the remainder when (4/(-8)-4)/2 is divided by u? 0 Let c(g) = 4g2 + 8g - 15. Suppose 59 = -5r - 3t - 16, -5r = -4t + 40. Let h be c(r). What is the remainder when h/6 - 1/2 is divided by 26? 25 Calculate the remainder when 42 is divided by -1(25/(-5) - 4). 6 Let a(h) = h + 2. Let u be a(-2). Let d(w) = -w - 4w + 0 - 5 + uw. What is the remainder when 59 is divided by d(-5)? 19 Let o(w) = -w3 + 4w*2 - 3w + 2. Let b be o(3). Suppose 2p + bh = 18, -p + 4h + 27 = -h. What is the remainder when 33 is divided by p? 9 Suppose -2x - x = 0. Suppose u = 14 - x. Calculate the remainder when u is divided by 8. 6 Let h(v) = 10v + 5. Let t be h(4). Suppose 0 = -7g + 4g + t. What is the remainder when g is divided by 8? 7 Let u be 80/6 + 8/12. Let l = -2 + u. Calculate the remainder when l is divided by 7. 5 Calculate the remainder when 66 is divided by 1/3 - (-606)/18. 32 Suppose b = -2b - 420. Let j(f) = f*3 - 11f*2 + f + 4. What is the remainder when j(11) is divided by 2/9 + b/(-18)? 7 Suppose -2v - i + 17 = 0, -7i - 9 = -4i. Calculate the remainder when v is divided by 4. 2 Let s(h) = 4h + 7. Calculate the remainder when s(8) is divided by 20. 19 Let k = -8 - -4. Let r = 2 + k. Let q = 7 + r. What is the remainder when q is divided by 3? 2 Let u(l) = -l + 10. Let t be u(8). Let k(y) = 2y*3 - y + 1. What is the remainder when k(t) is divided by 9? 6 Let c(x) = 3x - 2. Let a(r) = -4r - 36. Calculate the remainder when a(-12) is divided by c(3). 5 Suppose 5c - 14 = 36. Let l = 4 + 2. What is the remainder when c is divided by l? 4 Let o(t) = t - 7. Let q be o(9). Suppose -52 + 6 = -qr. Calculate the remainder when r is divided by 12. 11 Suppose 0 = -5x + 9 + 86. Let k be (-2)/(-3) - (-184)/3. What is the remainder when x is divided by k/6 + 2/(-6)? 9 Let k = 314 + -213. Suppose u - 23 = 4p - 2p, -5u - 4p = -k. Let i = 32 - 21. What is the remainder when u is divided by i? 10 Let q = 16 + -10. What is the remainder when 21 is divided by q? 3 Let k(g) = -2g2 - 8g + 16. Calculate the remainder when 29 is divided by k(-5). 5 Suppose 9 = 3t + 2n, -5n = -0n. Suppose 0y = -ty + 6. Let h(p) = 5p + 2. Calculate the remainder when h(y) is divided by 5. 2 Suppose -4g + 1 = -5g, 5g - 45 = -5q. What is the remainder when 39 is divided by q? 9 What is the remainder when 114 is divided by (1 - 4/3) + 2596/66? 36 Suppose q + 2l + 4 - 5 = 0, -2l = 4q - 10. Calculate the remainder when 9 is divided by (q/44)/1. 0 Let u(z) = -z3 + 8z*2 - 5z + 5. Calculate the remainder when u(5) is divided by 19. 17 Calculate the remainder when 103 is divided by ((-140)/60)/(2/(-18)). 19 Let k(f) = -f*2 - 7f - 4. Let d be k(-3). Suppose 0 = -2r - 2p - 8, -24 - 8 = 4r - 4p. Let s = d + r. Calculate the remainder when 5 is divided by s. 1 Suppose 0u - 4u - 4x - 12 = 0, -2u - 3x = 9. Suppose -2c - c + 102 = u. Let h = -27 + 45. What is the remainder when c is divided by h? 16 Suppose 6x - 2x - 72 = 0. Let s = -5 - -4. What is the remainder when x is divided by (s/2)/(3/(-60))? 8 Let t(y) = -y*2 - 19y - 59. What is the remainder when 75 is divided by t(-14)? 9 Let c(a) = -a*3 + 12a*2 - 12a + 17. Let h be c(12). Let z = 194 + h. What is the remainder when z is divided by 17? 16 Let w = -4 + 4. Suppose w = -3z - 0z + 24. Calculate the remainder when 29 is divided by z. 5 Let j = 13 - 9. Suppose -3l - jm + 22 = -l, 3l = -m + 18. Calculate the remainder when 17 is divided by l. 2 Let t = 4 - -8. Suppose 7o = to - 190. Calculate the remainder when o is divided by 13. 12 Let q(h) = h3 - 5h*2 - h + 8. Calculate the remainder when 7 is divided by q(5). 1 Suppose 3v + 1 = -11. Let y(m) = 4m2 + 5m - 3. Let i be y(v). Suppose -2z + 53 = -i. Calculate the remainder when z is divided by 16. 15 Suppose t = -5v + 25, 3t + 10 = 2t + 2v. Suppose 3h - 26 = d + 3d, -h - 3d = t. What is the remainder when 117/7 + (-6)/(-21) is divided by h? 5 Let y(b) = 2b2 - 3b + 1. Suppose 0 = 5r - 8 - 2. What is the remainder when y(r) is divided by 2? 1 Let b(w) = w - 1. What is the remainder when b(4) is divided by 1? 0 Suppose -2r = 10, q - 73 = 7r - 5r. Calculate the remainder when q is divided by (1 + -14)/(-1 - 0). 11 Let m(t) = 9t + 1. Let o(a) = -a2 - 6a + 10. What is the remainder when m(2) is divided by o(-6)? 9 Let r be ((-108)/21)/(1/(-7)). Let x = r - 17. Suppose 2l + 0 - 10 = 0. Calculate the remainder when x is divided by l. 4 Let w(s) = s3 - 11s*2 + 10s + 4. Calculate the remainder when 15 is divided by w(10). 3 Let y = 1 + 0. Let x = y + 12. Let g = x + 6. Calculate the remainder when g is divided by 7. 5	{ "pile_set_name": "DM Mathematics" }
3 + 60183. -s Collect the terms in 3k + 22k + 5k. 30k Collect the terms in -16f + 16f - 131f2. -131f*2 Collect the terms in -7t + 14t - 3t + 4t3 - 4t. 4t3 Collect the terms in -16 - 16 + 55 - 23 + 3i. 3i Collect the terms in -4u*2 + 3u*2 - 66 - 3u*2 + 2u*2. -2u*2 - 66 Collect the terms in -14n*2 + 2n*2 + 9n*3 + 12n*2. 9n3 Collect the terms in -f3 - 102f + 0f*3 - 4f - f*3. -2f*3 - 106f Collect the terms in 21l - 3175 + 3175 - 23l. -2l Collect the terms in 42o + 71o - 4 + 4. 113o Collect the terms in 238815r2 - 238815r*2 + 5r*3. 5r*3 Collect the terms in 31b - 15b - 450b*2 - 16b. -450b2 Collect the terms in -31h*3 + 80h + 4h2 - 4h*2. -31h*3 + 80h Collect the terms in -3 + 1 - 66u + 4. -66u + 2 Collect the terms in 627t2 + 28t*3 - 627t*2 + 30t*3 - 63t*3. -5t*3 Collect the terms in 62d*2 - 20d*2 - 27d*2. 15d*2 Collect the terms in -457p + 0p2 - p2 - 2p*2. -3p*2 - 457p Collect the terms in -20g2 - 1703 + 855 + 848. -20g*2 Collect the terms in 149520 - 8f*3 - 149520. -8f*3 Collect the terms in -470h - 5h2 + 470h. -5h2 Collect the terms in 25u - 96u + 2 - 4. -71u - 2 Collect the terms in -28 + 20 + 5r3 + 8. 5r*3 Collect the terms in 33k + 37k - 15k + 36k - 89k. 2k Collect the terms in 11z*3 + 9z*3 + 8z*3. 28z3 Collect the terms in -f2 + 0f + 11f - 11f. -f2 Collect the terms in 27f - 49f + 23f. f Collect the terms in 126z + 127z - 7z3 - 253z. -7z3 Collect the terms in -3k - 4k + 19k - 11k. k Collect the terms in 2d*3 + 6d*3 - 17d*3. -9d*3 Collect the terms in -3477x + 3477x + 14x*3. 14x*3 Collect the terms in 17r + r*2 - 28r + 11r. r2 Collect the terms in -8 - 9z + 23z - 6z. 8z - 8 Collect the terms in 7r*2 + 10r*2 - 3r*2 - 4r*2. 10r*2 Collect the terms in 18t - 37t + 11t + 6t. -2t Collect the terms in 50h2 - 20h*2 - 34h*2. -4h*2 Collect the terms in 59i*3 + 71i*3 - 128i*3. 2i*3 Collect the terms in 6 + 4t*2 + 0 + 7 - 13. 4t2 Collect the terms in -10 + 14 - 4 - a3 + 0. -a*3 Collect the terms in 60g*3 - 337g*3 - 25g*3. -302g*3 Collect the terms in -4v + 47v - 8v. 35v Collect the terms in 8h*2 + 2h*2 + 14h*2. 24h*2 Collect the terms in 17r*3 - 441r + 441r. 17r*3 Collect the terms in -n + 9n + 40n. 48n Collect the terms in 8u2 + 2 - 4 + 2. 8u*2 Collect the terms in -175339a*2 + 175339a*2 - 2a*3. -2a*3 Collect the terms in -5a - 156 + 156. -5a Collect the terms in 163b*2 + 139 - 139. 163b*2 Collect the terms in 2 - 15o + 11o + 6o - 66o. -64o + 2 Collect the terms in -18720 - 18724 + 37444 - f2. -f2 Collect the terms in 16 - 16 - 11f3. -11f*3 Collect the terms in -13 + 0x + 7x + 13. 7x Collect the terms in 1506 - 3r - 1506. -3r Collect the terms in 42q + 8q - 17q. 33q Collect the terms in -161z3 - 32 + 159z*3 - 33. -2z*3 - 65 Collect the terms in 16p*2 - 34p*2 - 38p*2. -56p*2 Collect the terms in -5g - 5g + 2g. -8g Collect the terms in 4 - 6543r + 6582r - 4. 39r Collect the terms in 126a - 2a*2 - 39a + 49a. -2a*2 + 136a Collect the terms in 38z2 + 6z + 5z - 11z. 38z2 Collect the terms in -7885v*2 + 3947v*2 + 3943v*2. 5v*2 Collect the terms in 0x*2 + 8x*2 + 0x*2 - 2x*2 + 4x*2. 10x*2 Collect the terms in 33f - 12f - 20f. f Collect the terms in -293s - s3 + 574s - 281s. -s3 Collect the terms in 39v*2 - 84v*2 + 26v*2. -19v*2 Collect the terms in -487 - n + 487. -n Collect the terms in -2k*3 - 8k*3 + 83k*3. 73k*3 Collect the terms in -13j - 4j + 10j - 13j. -20j Collect the terms in -2 - 3z + 0z + z. -2z - 2 Collect the terms in -2 - 38x*3 + 5 - 3 + 31x*3. -7x*3 Collect the terms in 2p + 30 - 12 + 34 - 3. 2p + 49 Collect the terms in -160v + 369v - 168v. 41v Collect the terms in -21 - 107606t*3 + 107607t3 + 21. t3 Collect the terms in -12 - 165b3 + 143b*3 + 12. -22b*3 Collect the terms in 1173f - 6f2 - 1173f. -6f2 Collect the terms in -2g + 7g + 2g + 3g. 10g Collect the terms in -q*2 + 4416q - 4416q. -q2 Collect the terms in -2i*2 + 6i*2 - 3i2. i2 Collect the terms in 6w3 + 38w*3 + 13w - 13w. 44w*3 Collect the terms in 13y*3 - 34y*3 + 13y*3 + 6y*3. -2y*3 Collect the terms in -2 - 10l*3 + 6 - 2 - 7l*3. -17l3 + 2 Collect the terms in y + y2 - 18y + 17y. y*2 Collect the terms in -1116d + 1116d - 16d*3. -16d*3 Collect the terms in 8q - 1 + 3q - q - 1. 10q - 2 Collect the terms in 348 - 348 + 2s2. 2s*2 Collect the terms in 23 - 17c - 23. -17c Collect the terms in 5r - 3r2 - 11r*2 + 31r*2. 17r*2 + 5r Collect the terms in -2g + 5468 - 5468 + 4g. 2g Collect the terms in 5s - 4s - s + 11s. 11s Collect the terms in -21i*2 + 10i*2 + 6i*2. -5i*2 Collect the terms in 10x*2 + 4x*2 - 5x*2. 9x*2 Collect the terms in 4p - 4p + 2p + 13 + 6p. 8p + 13 Collect the terms in 43r3 + 41r*3 - 89r*3. -5r*3 Collect the terms in 4f - 9 - 3f - 9 + 18. f Collect the terms in 8i - 6 + 0i - 5i. 3i - 6 Collect the terms in 17k*3 + 7k*3 - 7k*3. 17k*3 Collect the terms in -19r*3 - 3r*3 - 29r + 29r. -22r*3 Collect the terms in 12z*3 - 6z*3 - 29z*3 - 22z*3. -45z*3 Collect the terms in -264g*3 + 134g*3 + 128g*3. -2g*3 Collect the terms in -9v*3 + 20v - 20v - 7v*3. -16v*3 Collect the terms in 5119 - 3y*2 - 5119 - 2y*2. -5y*2 Collect the terms in 0g*2 + 8g*2 - 3g*2 - 8g*2. -3g*2 Collect the terms in 1919q - 1919q - 80 + 80 - 2q*2. -2q*2 Collect the terms in 17o*3 - 8o*3 - 8o3. o3 Collect the terms in 781h2 + 952h*2 + 3h - 3h. 1733h*2 Collect the terms in -2t*2 + 32t*3 + 7t*3 + 2t*2. 39t*3 Collect the terms in -2038 + 2038 + x. x Collect the terms in -2y*2 + 2y*2 + 75y*3. 75y*3 Collect the terms in 0 + 2t - 18t + 0 + 13t. -3t Collect the terms in -21v*3 + 37v*3 - 16v*3 + 2v*3. 2v*3 Collect the terms in -8l - 9732 + 9732. -8l Collect the terms in 5o + 0o + 11o + 0o. 16o Collect the terms in 4c + 1 + 6 + c - 4. 5c + 3 Collect the terms in 7g2 + 6g*2 - 1 - 11g*2 - 1 - 18g*2. -16g*2 - 2 Collect the terms in 7 - 7 + 22y - 8y. 14y Collect the terms in 24 - 6o + 5o*2 - 22 + 6o. 5o2 + 2 Collect the terms in -6n - 9n3 - 3n + 9n. -9n*3 Collect the terms in -72p*3 - 4 + 16 - 12. -72p*3 Collect the terms in -11o2 - o2 - 6o2 + o2. -17o*2 Collect the terms in -62 + 17q + 62. 17q Collect the terms in 8v*2 + 157v*2 + 526v*2. 691v*2 Collect the terms in 2h - 6h + 4h + 598h3. 598h*3 Collect the terms in -14x*2 - 25x*2 - 7x*2 + 11x*2. -35x*2 Collect the terms in -5v*2 + 3v + 22v2 - 2v. 17v2 + v Collect the terms in 1 - 47j*3 - 1 - 30j*3. -77j*3 Collect the terms in -25l + 8l + 8l + 7l. -2l Collect the terms in -1 - 8950x - 3x*3 + 8950x + 1. -3x3 Collect the terms in 6p3 - p3 + p*3 - 2p*3. 4p*3 Collect the terms in 453y + 451y + y2 - 1355y + 451y. y2 Collect the terms in -2f + 4215070 - 4215070. -2f Collect the terms in 5 - 1 - 4 - 221n*2 + 217n*2. -4n*2 Collect the terms in 10m*3 - 17m*3 + 4m*3. -3m*3 Collect the terms in -1 + 2 + 14f*3 + 4f*3. 18f*3 + 1 Collect the terms in -114x*2 + 59x*2 - 2x*3 + 55x*2. -2x*3 Collect the terms in -14v + 49v - 8v - 9v - 11v. 7v Collect the terms in 1215f*3 + 0 - 1205f*3 + 0. 10f*3 Collect the terms in 11 - 6 - 30r - 5 - 2r2. -2r*2 - 30r Collect the terms in 5z + 3z - 4z - 5z. -z Collect the terms in 40 + 364i3 - 40. 364i*3 Collect the terms in -14x - 349 + 349. -14x Collect the terms in -k2 + 17k*2 + 7k*2. 23k*2 Collect the terms in 5i*3 - 11i*3 + 2i3 + i3. -3i3 Collect the terms in -452f - 11 + 8 + 3. -452f Collect the terms in -38s*3 + 11s*3 - 21s*3. -48s*3 Collect the terms in 2t*2 - 3t*2 - 28t3 + t2. -28t3 Collect the terms in -2 - 8 + 3 - 4k. -4*k - 7 Collect the terms in z + 5 -	{ "pile_set_name": "DM Mathematics" }
13k(m). Determine b(4). -10 Let h(v) = 660v + 25 - 331v - 327v. Let c be 1 + (1 - (0 + 18)). What is h(c)? -7 Let g be (213/142)/((-6)/(-32)). Let t(i) = gi + i - 6i*2 + 13 - 6i - i*3 + 6i. Determine t(-7). -1 Let o(a) be the third derivative of a5/60 + a4/6 - 5a2 - 5. Let h be (-13)/(-78) + ((-21)/18 - 2). Determine o(h). -3 Let a be ((-2)/2)/((-1)/(-5)). Let w(i) be the third derivative of i6/120 + i5/10 + 5i4/24 + i3/6 - 71554i2. Give w(a). 1 Suppose -2b + 4b + 3t - 13 = 0, 0 = -3t + 3. Let a(f) = f2 + 1. Let m = 406 - 403. Let z(s) = -4s*2 + 3. Let d(l) = ma(l) + z(l). Calculate d(b). -19 Let d(o) be the first derivative of 1/2o2 + 254 + 19o. Calculate d(0). 19 Let k be (-12)/(-9)((-3450)/40)/23. Let m be ((-3)/(-2))/((-1)/(-2)). Let d(x) = x2 + 7x + 7 - 3 + m - 2. Determine d(k). -5 Let p(d) = 9d - 19. Let u be p(6). Let x(y) = -12 - 13 - y + u + y2 - 9. Give x(3). 7 Let r(y) = 46y*2 - 135y*2 + 90y*2 - 39 + 2y. Determine r(0). -39 Let o(q) = -8. Let a(r) = -r - 2. Let y(w) = a(w) - o(w). Suppose 0 = 6k - 2k - 5n + 17, 12 = -4n. Calculate y(k). 14 Let u = -21 - -25. Suppose 5d = -20, -3f = -0f - ud - 22. Let o(w) = -w + 10w2 - 7w*f - 2w*2 - 2. Give o(0). -2 Let i = -13 - -10. Let k(y) = 2 + 27y + 23y - 48y + 0. Calculate k(i). -4 Suppose 318 = -40l - 2. Let k be l + 602/70 + (-17)/(-5). Let y(x) = -2x*2 + 8x - 2. What is y(k)? -2 Let a be (5/(-2) + 2)-10. Suppose a = k - 6k. Let j(r) be the first derivative of 6r2 - r - 338. What is j(k)? -13 Let t = 80 + -79. Let c(s) = s3 - 8s*2 - 19s + 3. Let j(a) = 2a + 1. Let v(g) = tc(g) + 5j(g). Give v(9). 8 Suppose 0 = 183u - 84 + 84. Let p(y) = y*2 - 9y - 28. Determine p(u). -28 Let o(f) = 2f2 - 35f + 63. Let k be o(16). Let h(w) = 3w + 3w + 1 - 4w - kw. Calculate h(1). -12 Let s(h) = 10h - 464. Suppose 0 = 9z + 512 - 935. Determine s(z). 6 Suppose 55k - 174 = -3k. Let l be (-3)/(k/(-2)) + 48/12. Let y(h) = h*2 - 8h + 21. Give y(l). 9 Let x(a) = 8a + 19. Let c(v) be the third derivative of -23v*4/24 - 55v3/6 - v2 - 14. Let y(i) = 6c(i) + 17x(i). Determine y(-8). 9 Let s(l) = -2l2 - 103l - 93l - 69 + 274l. Give s(38). 7 Suppose -5p + 6 = 2q, 2q + 0q + 2p - 6 = 0. Let j(f) = f2 - q + 2f + 0f + 3f + 0f. Let k(y) = -y2 - 44y - 368. Let u be k(-33). Calculate j(u). -3 Let q(w) = -w*3 + 24w*2 - 6w - 3. Let k(p) = 7p2 - p - 1. Let v(m) = -3k(m) + q(m). Calculate v(2). -2 Let a(g) = -41g + 34. Let b(c) = 24c - 18. Let y(z) = 4a(z) + 7b(z). What is y(-2)? 2 Let l(o) be the third derivative of o*5/20 + 7o*4/24 + 4o*3/3 - 8o*2 - 66o. What is l(-5)? 48 Let b(h) = -2h - 19. Let j = -339 + 371. Suppose 2w + j = 6. Give b(w). 7 Let v be ((0 + 1)0/(6 + -5))/1. Let d(k) = 2k3 - k2 + 3k + 3. Give d(v). 3 Suppose -104l + 97 = 182l - 189. Let a(g) = 7g - 9. What is a(l)? -2 Let q(z) = z*3 - 19z2 + 2. Let h be q(19). Let b(i) = -2 + 1 - h + i2 + 6i. Suppose 2x + 4l + 3 = 1, 5x - 5l + 35 = 0. Determine b(x). -8 Let l(h) = h + 6. Let q(b) = -3b - 16. Let a(t) = 17l(t) + 6q(t). Let i(c) = -2c + 11. Let z(g) = -5a(g) + 3i(g). Let n = 70 - 64. Calculate z(n). -3 Let c(n) be the first derivative of 1/360n*6 + 22 + 0n*2 - 1/30n*5 + 9n*3 - 1/6n*4 + 0n. Let h(i) be the third derivative of c(i). Give h(5). 1 Let f = -30 - -18. Let m(k) = -2k3 - 48k*2 - 2k - 26. Let r(j) = -j*3 - 23j*2 - 12. Let v(l) = 6m(l) - 13r(l). What is v(f)? 0 Suppose -28 + 22 = -q. Suppose -3k + 12 + q = 0. Let j(y) = y*3 - 7y*2 + 8y - 4. Calculate j(k). 8 Let x(f) = -27636138f2 - 26f + f*3 + 27636131f*2 - 7f + 23. Give x(10). -7 Let z(m) = -6m + 8. Let n(w) = -2w*3 - 8w*2 - 11w + 1. Let l be n(-8). Let q = l - 595. What is z(q)? -28 Let z(w) = 0 + 2 + 3 - w*2 + w. Let f = 14270 - 14263. Determine z(f). -37 Let n be (-5)/(-2) + 8/(-16)-1. Let i(h) = -6 + n - 22h2 + 6h + 12h2 + 3h - 5h3. Let k(a) = a3. Let v(u) = -i(u) - 6k(u). Determine v(9). 3 Suppose -24g + 15 + 155 = 61g. Let a(p) = 3p2 - 2. Give a(g). 10 Let g(s) = -s3 - 9s2 + 8. Let n(x) be the third derivative of x4/6 + 31x3/6 - 9x*2 - x. Let b be n(-10). Determine g(b). 8 Let c(k) = 26k - 82k + 29 - 2k*2 + 107k. Calculate c(26). 3 Let p(v) be the third derivative of 1/24v4 + 0 + 16v*2 + 0v + 0v3. Give p(-5). -5 Let u(n) be the second derivative of -n3/2 - 7n*2/2 - 4n + 18. Suppose -15k = -16k + 7. Determine u(k). -28 Let g(m) = m*2 - 2m - 2. Suppose 3f + 0n = 4n + 33, -f + 19 = -4n. Suppose fa + 405 = 4a. Let v = a + 138. Give g(v). 1 Let u be 373 - (0 + 10/(-2)). Let g(i) = 384 - i*2 + 4i - u + 3i2. Let d(c) = -3c*2 - 5c - 7. Let o(b) = 5d(b) + 6g(b). Calculate o(-2). -9 Let q be (-40)/28-72. Let y be q/(-15)21/14. Let t(o) = -o3 - 4o*2 + o. Give t(y). -10 Let m(o) = -2o*2 + o - 2. Let s(l) = -2l*2 + l - 2. Let h(t) = -6m(t) + 5s(t). Let c(a) = -a2 + 19a - 50. Let y be c(16). Give h(y). 12 Let s(p) = -36p - 184. Let m be s(-5). Let w be 68/(-11) - m(-7)/(-154). Let d(h) = -h*2 - 4h. Calculate d(w). -12 Let c(v) = -7v + 8. Suppose -5n - 23 = -3i, -7i = -5i - 4n - 18. What is c(i)? 1 Let f(c) = -27c + 412. Let o be f(15). Let m(x) = x3 - 5x*2 - 13x + 8. Determine m(o). 15 Let l(z) = -z*3 + 12z*2 - 10z + 2. Let c be 10/55 - -1193/33. Let d be l(c). Let q(y) = -y2 + 14y - 16. Determine q(d). -3 Let b(r) be the second derivative of r5/20 + r4/12 - r*3/6 - 5r*2 - 812r. Let p(f) = f*2 - 3f + 4. Let d be p(3). Suppose 0 = -s + ds. What is b(s)? -10 Let b(c) = c3 - 8c*2 + 11c - 4. Let u = -1926 + 1933. What is b(u)? 24 Let x(q) = 7 - 25 + 254950q2 - 21q + q*3 - 254952q*2. Give x(6). 0 Suppose -z - z = -0z. Let w(b) = zb3 - 3b2 + b3 + b*2 - 1 - 41b + 43b + 0b*2. Let o = 2 - 1. Calculate w(o). 0 Suppose -w + 5w + 3f - 34 = 0, -f = -w + 5. Let j(m) = 13m - 6m + m - wm. What is j(-3)? -3 Suppose 4r = -3t + 2, 2r - t + 3t = 0. Suppose ro + 1 - 149 = 0. Let x(g) = 0g2 + g2 - 74 + 2g + o. Calculate x(-2). 0 Suppose -4t - 4z + 1 = -3, 5t - 3z - 37 = 0. Suppose -5 = tk, 5k = 2x - 12 - 11. Suppose -4 = -u - x. Let v(g) = -g*3 - 6g*2 - 5g - 2. Give v(u). -2 Let c(t) = 3t3 - 5t*2 - 2t + 3. Let j be (117/156)/((-1)/(-4)). Give c(j). 33 Let l = -5761 - -5758. Let r(i) = 6i2 + 18i + 5. Give r(l). 5 Let u(i) = i*3 - 10i*2 + 2i - 1. Let c(a) = 2a3 - 37a*2 + 5a - 1. Let o(w) = c(w) - 4u(w). Give o(3). -33 Let y(k) = -k3 + 7k*2 - 9k + 19. Suppose -6f = -12f - 3m + 36, -4f - 3m + 24 = 0. Calculate y(f). 1 Suppose -5w + v - 457 = 2v, w - 4v + 104 = 0. Let z = 97 + w. Let a(b) = -6b2 + zb - 7 + 4b2 + 5. Give a(3). -5 Suppose -37g + 864 = 395g. Let i(u) = u2 - 7u + 2. Let v(w) = w. Let a(s) = -i(s) - 5v(s). Calculate a(g). -2 Let h(i) be the first derivative of i4/4 + 26i3/3 - i2/2 - 47i - 2949. What is h(-26)? -21 Let t(v) = 12v*3 - 15v*2 - 25v + 56. Let h(r) = -7r3 + 11r*2 + 13r - 29. Let z(g) = -5h(g) - 3t(g). What is z(-11)? -12 Suppose 17d = 2d - 15. Let k(b) = -5b - 14 + 52 - 14 - 14 - 9. Give k(d). 6 Let m(b) = -b3 + 14b*2 - 15b + 29. Let k be m(13). Suppose kj - 16y + 20y + 34 = 0, 2y = -j - 10. Let h(a) = a*2 + 15a + 20. What is h(j)? 6 Let a(i) = -i2 - i + 1. Let m(f) = f3 + 6f2 + 2f. Let o(s) = -a(s) - m(s). Suppose 134 = 53p + 346. Give o(p). -13 Let z(l) = -10l - 62. Let o be (0 - 1)(1 - -3)161/92. Calculate z(o). 8 Let d(l) = -4 - 4279l3 + 4278l*3 + 33l + l*2 + 4l2. What is d(-4)? 8 Let f be (6/(-2))/((-1)/(-152)). Let q be f/28 - (-2)/7. Let m be 4/2 - q/(-4). Let i(p) = p3 + 3p2 + 2p - 1. Give i(m). -1 Let y(i) be the first derivative of 15i4/4 + 3i*2/2 + 2i + 204. Determine y(-1). -16 Let s(m) = -m + 2. Suppose 2f + f - 12 = 0. Suppose 4i = -l + 3i - f, -4i - 10 = l. Let z be (8/(-2))/l - -5. Calculate s(z). -5 Let s(y) = 7y + 36. Let p be s(-6). Let o = -8 - p. Let z(x) = -3x - 4. Calculate z(o). 2 Let v(t) = -t + 2. Suppose 0 = -12m - 18 + 102. Suppose 15 = 2x + m. Suppose -56 = -x*g +	{ "pile_set_name": "DM Mathematics" }
ppose -25 = -3s + 2r, 0 = 2s - 3r - 9 - 1. Let y(c) = 3c3 - 11c*2 - 6c + 8. Let q be y(4). Suppose q = -k - 7 + s. Is k a multiple of 3? False Let t be (-4)/(-26) + (-4980)/(-78). Suppose -s - 3y = -31, 0 = 2s - 4y - t - 8. Suppose -o - 4f = -5f - s, -5o - 2f + 170 = 0. Does 9 divide o? False Suppose 0 = 16b - 1192 - 968. Does 5 divide b? True Let x(i) = 44i2 + i. Let d be x(1). Let l be 1/((-3)/d-3). Suppose 2 - 102 = -lt. Is t a multiple of 20? True Let t(f) = 4f*2 + 13f - 8. Does 27 divide t(-14)? True Let y = 1092 - 492. Suppose -y = 14g - 26g. Is g a multiple of 9? False Let y(f) be the second derivative of 31f4/12 + f3/6 - f2/2 + 3f. Let w(s) = s3 - s2 + s + 1. Let u be w(0). Is 8 a factor of y(u)? False Let u(r) = -2r3 - r2 + 7r + 11. Let o(f) = -3f3 - 2f*2 + 10f + 17. Let p(v) = -5o(v) + 8u(v). Is p(-4) a multiple of 15? True Let z = 4 - 20. Let r = -49 + 45. Let w = r - z. Is w a multiple of 6? True Suppose -4235 = 10h - 17765. Is h a multiple of 41? True Let h be 14/(-35) + (-12)/(-5). Suppose 0 = 3n, -hs - 4n + 212 = -3n. Is 10 a factor of 3/2s/3? False Let p = -156 - -90. Let u = 125 + p. Does 30 divide u? False Suppose -8h + 22 = -2. Let a(i) = -6i + i + 3i - 14i - h. Is a(-1) even? False Let y(f) be the first derivative of -f*2 + 6f + 12. Does 5 divide y(-3)? False Let c(j) be the first derivative of 14j3/3 + 5j*2/2 - 7j + 3. Does 52 divide c(-3)? True Suppose -2o - 39 = 3x, 0 = -5o + 2x + 3x - 60. Is (-66)/(-1(-6)/o) a multiple of 22? False Let w = -19 - -58. Suppose -2s + w = 219. Is -5 + 1 - (2 + s) a multiple of 21? True Let o be ((-1)/(-2))/((-4)/(-24)). Let s = -4 + 9. Suppose ox + 4 = sx. Is x a multiple of 2? True Does 21 divide 129352/1026 - (-4)/(-54)? True Suppose -4x + 127x - 605529 = 0. Does 82 divide x? False Suppose -388 - 548 = -12x. Suppose 5n - 42 = x. Is n a multiple of 3? True Suppose -138 = -4g - 5j, -3g + 103 - 15 = -4j. Is g a multiple of 3? False Let d(r) = 58r + 126. Is d(13) a multiple of 8? True Suppose 40 - 137 = -3y + 4t, -5t + 80 = 2y. Let u = y + 19. Does 18 divide u? True Suppose 8f = 6f + 20. Let d = -8 + f. Suppose -4s - 41 = -a, 4a + ds = 5s + 138. Is 10 a factor of a? False Suppose -4a + 208 = 5f - 2a, -a - 76 = -2f. Is 3 a factor of f? False Let v = -500 + 357. Let z = -53 - v. Is 12 a factor of z? False Does 12 divide (-9)/(-6)1888/24? False Suppose -2341 = -3q + 2u, 0q = -4q - 3u + 3144. Does 17 divide q? False Let d(r) = -r3 - r2 - 4r + 47. Is 11 a factor of d(-8)? False Suppose -u + 135 = i + 32, 0 = u + 1. Let w = i + -7. Does 10 divide w? False Suppose 5z + 7l = 9l + 2582, -5l = 2z - 1027. Is 65 a factor of z? False Let j(l) = 9l2 - 4l + 4. Let u(w) = w*2 - w + 1. Let b(h) = j(h) - 5u(h). Let p be b(1). Does 4 divide (p - 0) + (-24)/(-12)? False Suppose 4a - 25 + 13 = 0. Does 7 divide a/((9/42)/((-3)/(-2)))? True Does 37 divide (-2960)/(-12)9/6? True Let i(o) = -o*2 - 16o - 14. Let z be i(-14). Does 8 divide 4/z + 414/21? False Suppose 9024 = 4c - 4x, 3c - 5x = -3x + 6769. Is 13 a factor of c? False Suppose -2q + 5 = -47. Suppose -6 = -5v - q. Is 37 - v4/(-16) a multiple of 15? False Let n(u) = 324u2 - 3u - 2. Is 25 a factor of n(-1)? True Suppose 7f - 40 = 6f. Suppose 22 - f = -3b. Is 2b2/4 a multiple of 6? True Suppose 0a + 4a - 488 = 0. Let y = -82 + a. Is y a multiple of 8? True Is ((-230700)/(-110))/10 - 3/(-11) a multiple of 35? True Suppose 13 + 55 = 4o. Let u = 63 - o. Is u a multiple of 13? False Does 7 divide (-3)/117/102-1120? True Suppose -i = -4i + 15. Suppose 4m - io - 36 = -o, 0 = -3m + 2o + 31. Is 12 a factor of m? False Suppose -4w = -10 + 14. Let r(b) = 71b2 + 3b + 3. Does 8 divide r(w)? False Let k(o) = -o3 - o2 + o. Let b be k(1). Suppose 3h - 7h - 4n = -240, 2h - 5n - 106 = 0. Is 19 a factor of (b + h)14/21? True Suppose -9t - 2892 = -13t + 4f, -5f - 1449 = -2t. Is 10 a factor of t? False Is 27 a factor of 4456/12 + -1(-3)/(-9)? False Let j(i) = 292i2 + i + 2. Is j(-1) a multiple of 15? False Is (-2)/((-154)/310009) + (-7)/77 a multiple of 33? True Let d(n) = -n - 10. Let j be d(-12). Suppose jf - f - 92 = 0. Does 23 divide f? True Let b(f) = 7f - 4. Suppose 0 = 2s - s - 3. Let x be b(s). Suppose -19 = -2y + x. Does 18 divide y? True Suppose -15 = 4s + 13. Let m be (-8 - s)(-386 + 1). Suppose 5r - 8 = -4l + 321, 5l = -r + m. Is 19 a factor of l? True Suppose -27 = -3v - 21. Suppose 0 = vx + 2x + 4b, -x - 5 = 2b. Suppose 4s = -3u + 269 - 7, xs = -u + 91. Does 17 divide u? False Suppose 0c + 3p + 306 = c, -5p - 5 = 0. Suppose 3b = -123 + c. Is b a multiple of 30? True Let r = -29 - -68. Let o = 84 - r. Is 18 a factor of o? False Suppose 4u - 1205 = 5x, -2u = -x - 4x - 615. Does 5 divide u? True Suppose 3d + 112 = 4x, x - 3d - 43 = -6d. Suppose 5k - 15 = 2k, -k = 2l - x. Is 5 a factor of l? False Suppose -7 = -a - h + 6, 0 = 3a - 2h - 14. Is 2 a factor of a? True Suppose 1916 = -3d + 488. Is 12 a factor of (d/633)/((-2)/9)? False Let b = -22 - -28. Suppose -99 = -bf - 21. Does 13 divide f? True Let u(w) = -20w - 31. Is u(-20) a multiple of 9? True Let s(m) = 4m + 20. Let l be s(15). Does 10 divide 20(-5)/(l/(-36))? False Is 19 a factor of ((-33462)/(-39) - 3/1)6? True Let f(q) = q*2 + 18q - 29. Let n(i) = i*2 + 17i - 30. Let h(d) = 3f(d) - 2n(d). Is h(-23) a multiple of 7? True Let l = 41 + 176. Is 7 a factor of l? True Suppose -2x + 586 = 2z - 766, -4z + 1360 = 2x. Does 24 divide x? True Let w(b) = 16b2 - 14b + 27. Does 29 divide w(9)? False Let f(p) = -p*3 + 41p*2 + 64p - 24. Is f(42) a multiple of 25? True Let s be (-2 - 1)(-246)/9. Suppose s = a + 3k - 0, 3k - 246 = -3a. Is a a multiple of 11? False Suppose -3i + 4r + 65 = 0, 2i - 5r - 41 = -0. Let m = i + 9. Suppose -28 - m = -2k. Does 10 divide k? True Let m = 10 + 165. Is 16 a factor of m? False Suppose -4 = m - 3m. Suppose 5h - 11d - 140 = -6d, -5d + 76 = 4h. Suppose -k + h = mk. Is k a multiple of 7? False Is ((-6)/(-12))/((-1)/13)-64 a multiple of 10? False Let g be (-196)/91 + (-6)/(-39). Is 14 a factor of ((-41)/2)/(g/4) - -1? True Let m(l) = l2 - l + 2. Let a be m(2). Does 14 divide 7/a(64 - -12)? False Suppose u = 2z - 26 - 3, 26 = 2z - 4u. Let i(j) be the third derivative of -j6/120 + 7j*5/30 + 17j*4/24 - 2j*3 + 35j*2. Does 8 divide i(z)? False Suppose -4v = -w + 263 + 269, 2w - 4v = 1060. Is 58 a factor of w? False Let a = -280 + 167. Suppose 5s + 195 = -v - 0s, -5v = 5s + 875. Let b = a - v. Is 19 a factor of b? True Let k be 83/1(7 - 4 - 4). Let n = 369 + k. Does 22 divide n? True Let p(k) = 9 + 6k + k*2 + 6k - 2k. Let b be p(-8). Let h = b + 24. Does 17 divide h? True Let d(a) = 5a*2 - 11a - 160. Does 36 divide d(-13)? True Let k = -39 + 33. Let i be k/(5/10-4). Suppose -3m + 5a + 263 = 0, -7m + im + 374 = -2a. Is 32 a factor of m? True Suppose 4 = -7a + 8a. Suppose i = 5w - 8, -2w + 2 = -a. Let k(x) = -x*2 + 10x - 17. Does 2 divide k(i)? True Let c(x) = 520x - 315. Does 10 divide c(9)? False Let y = 366 + -223. Is y a multiple of 13? True Let q = 709 - 115. Is 66 a factor of q? True Suppose -4j = -2u - 10, 0j + 25 = j - 5u. Suppose -5q - 3r + 276 = j, q + 4r - 2r - 58 = 0. Is 18 a factor of q? True Let j(q) = -q2 - 11q + 11. Let m be j(-12). Is 146/((1/(-1))/m) a multiple of 14? False Let k be ((-228)/(-18))/(1/3). Suppose 3i = 2o - 0o + 65, -4i + 3o = -88. Let h = k - i. Is h a multiple of 7? False Let b be 4/(-10) - 1143/(-45). Let n = 37 - b. Let y = 2 + n. Is 7 a factor of y? True Let w(t) = 3t + 14. Let k be w(-8). Let q = -3 - k. Is 14 a factor of -1 + 20 + (q - 7)? False Let c(a) = 2a3 - a2 + 10a - 8. Let s be c(4). Let i = 234 - s. Does 30 divide i? True Is 17 a factor of (-170)/(-4)16/20? True Let p(v) = -243v + 356. Is 16 a factor of p(-4)? True Let a(r) = -15r - 6. Let t be 0 + 84/(-8). Is 9 a factor of a(t)? True Let d be (-10)/40 - 33/(-4). Is 27 + d/(8/(-2)) a multiple of 11? False Let c(l) = l*3 - 8l*2 - 2l - 17. Let p = -3 + 12. Is c(p) a multiple of 15?	{ "pile_set_name": "DM Mathematics" }
)))))cc*21c assuming c is positive. c(9337/495) Simplify (g(1/3))(25/4)/(g/(g(-2/9)/g))(-1/53) assuming g is positive. g(4055/1908) Simplify ((ll/(l1l))/l)*(3/23)(l(-5))(21/2) assuming l is positive. l(-2421/46) Simplify (l(-1/8)l/((l(l20/l)/l)/l))/(l(1/3))(-24) assuming l is positive. l(-73/8) Simplify (x(-1)/x5x(-6)x/x(-2))(-2/65) assuming x is positive. x(18/65) Simplify ((q(-9)/qq/(qqq(-1/6)/q))/(q2q(-4)))(32/7) assuming q is positive. q(-752/21) Simplify o(-2/13)o(-21)oo39o/(oo(-6/29)) assuming o is positive. o(7183/377) Simplify (((yy/(y/((y/(yy(3/4)))/y)yyy))/((yyy/y*(2/9)y)/y))/(y/(yy9)y/(y/y(-6))))36 assuming y is positive. y*305 Simplify (((x/(xx/x(-1/2)))/((x(-13/3)x)/x))(1/8))(-2/17) assuming x is positive. x(-1/24) Simplify (x(-3)/(x(xx0/x)/xx)x(1/6)xx/((xx8)/x))(-45) assuming x is positive. x(885/2) Simplify p(1/26)/pp(-17)((p*(-25)p)/p)/(p*(-22/3)/pp) assuming p is positive. p*(-2779/78) Simplify (t(t/t*(6/11))/ttt)/(ttt/(tt/t*13t))(t/t(-4/11))/((t/((tt*5t)/t)t)/t) assuming t is positive. t(-46/11) Simplify ((w/(w(-4/29)/w))/w(1/9))/((ww/w(-2/9))/((w/w26)/w)) assuming w is positive. w*(-2279/87) Simplify cc/((c/(c*17/c))/c)cc(c*(-2/15)/ccc)/cc(c/(ccc19cc))33 assuming c is positive. c(-10577/15) Simplify y(-14)y((y(yy13)/y)/y)/y((y*6yy)/y)/y(-13) assuming y is positive. y19 Simplify bb*(-2/35)b*5(b/b*2)/(b/(b/((b/(b(bb(b/b*(4/5))/bb)/b))/b))) assuming b is positive. b(50/7) Simplify (((g/(g/(g/(g/g(1/2)g))))/gg)*(4/11)(g/(gg/(g(-9)/g)g))/g(-2/33))50 assuming g is positive. g*(-20000/33) Simplify (yy*33)/(yy*31)(yy(-27))/yyyy*(1/10)yy assuming y is positive. y(-209/10) Simplify ((mmmm/(m/((m*11/m)/mm)))/((((mm2)/m)/m)/m))/(m/(m(m/(m*(-2/9)mm))/m)mm)(-3/4) assuming m is positive. m(95/6) Simplify ((u38u)/(uu/u7))31 assuming u is positive. u1364 Simplify (m(2/9))45/(m2m9) assuming m is positive. 1/m Simplify (o(-10/17)/oo(-11/3)o)1 assuming o is positive. o(-217/51) Simplify ((nn(1/6)n*(1/4)n)/(n/(n/n*(1/2))n(-2/3)/n))(-3/4) assuming n is positive. n*(-43/16) Simplify (mm2)(-17)/(m*(2/11)m(3/2)) assuming m is positive. m(-1159/22) Simplify (m/m*(-3/8))/(mm*12)m(-6)/(m/(((m(-13)/m)/m)/m)) assuming m is positive. m*(-277/8) Simplify (vv8)/v(-1/13)v(-19)vv1 assuming v is positive. v(-103/13) Simplify f16f/(f/(f/(ff27f)))(f(-5/3)f)/ffff/f(-11)f assuming f is positive. f*(4/3) Simplify ((i(i*12i)/i)/ii/(ii28))44 assuming i is positive. i*(-704) Simplify (((g/(g/(g(g*(2/13)/gg)/g)g))/g0)/(g(-6)/g(-2/7)))(-9) assuming g is positive. g(-3987/91) Simplify (p/(pp(-2/5)))(-4/21)/((p/(p*(-2/9)p))/((pp/p(-4/7))/p)) assuming p is positive. p(401/315) Simplify ((((q/q(2/17))/q)/q)/q)(-1/9)/(q(-4/7))(-10) assuming q is positive. q(-652/119) Simplify ((c38)(-2/19))(25/6) assuming c is positive. c(-50/3) Simplify (((x(-1/9)/x)(-25))28)30 assuming x is positive. x(70000/3) Simplify d(-2/3)/d32d*(3/11)d((d(-2/81)d)/d)/d assuming d is positive. d*(-28885/891) Simplify (cc*(-12))/(c/(cc*(8/9)/c))((c*(-1)cc)/c)(-3/19) assuming c is positive. c(-100/9) Simplify p(4/5)p*(-2/45)p/(p/p*(15/7))p(-8/3) assuming p is positive. p(73/315) Simplify ((b/(bb4))/bb)/b*(-16)(b*(-5/9)b)/(bb/b(19/2)) assuming b is positive. b(359/18) Simplify (u(-1/7)u/u*7(u0)28)(-5/6) assuming u is positive. u(215/42) Simplify (r0)28(r/r0r)(-28) assuming r is positive. r(-56) Simplify (z*(15/7)z)/(zz23)(zzz*(1/22)zzz)(7/3) assuming z is positive. z(-1399/154) Simplify (t/t(-20))/t(-4/11)(t/(t/(ttt(-2/9)t)))/t(1/8) assuming t is positive. t(19021/792) Simplify g*(-25)/(gg*(1/7)ggg)(g(-13/2))(3/5) assuming g is positive. g(-2313/70) Simplify (g(4/9)/g)/(gg*(-7/6))g4/g(-4/21) assuming g is positive. g(479/126) Simplify (k(-5)/kkk*5k)/(((k/(k*(5/6)k)k)/k)/k)21 assuming k is positive. k(79/2) Simplify ((((y(1/3)/y)/y)/y(-2))/(y(-5/6)y(-3)))(-5/4) assuming y is positive. y*(-125/24) Simplify (((bb*3)/bbbbb)/bb)*(-37/3)b6/(b(1/4)/b) assuming b is positive. b*(-955/12) Simplify (ggg(-3/8)g*(2/3))/((gg*(7/5))/(gg20)) assuming g is positive. g(2507/120) Simplify (b*0(b*(1/2)b)/b(bb/b*1b)(-2/25))(-3/17) assuming b is positive. b*(-3/50) Simplify (ll(-5))/((l(2/15)l)/ll)(l0/l)(-1/31) assuming l is positive. l(-2372/465) Simplify ((a/a5a(-2/7))/(a5a(-1)))28 assuming a is positive. a(-232) Simplify ((j(-3))39)(-40) assuming j is positive. j4680 Simplify ((v(1/2))(5/21)(vv3)/vvv(2/11))(-6/29) assuming v is positive. v(-1987/2233) Simplify (t3t)(-3)/(t0t/t(-18)) assuming t is positive. t(-31) Simplify ((k/k9)/kk/k*(-1))/(kkk(-2/9))(1/11) assuming k is positive. k(-709/99) Simplify ((v(-7)/v)/(vv/v(-2/15)))/(v(4/9))(7/4) assuming v is positive. v(-491/45) Simplify (((w/((ww/w(2/15))/w))/w)/w(-9))/(w(-3/14)/(ww(2/11))) assuming w is positive. w(22013/2310) Simplify (j/(jj(3/7))j/(j*(-3)j)jj)/(j*7j(6/11)) assuming j is positive. j(-229/77) Simplify (jj/((jj/j*(-12))/jj)j)/(jj*(10/7))(j/j2)(2/99) assuming j is positive. j(-9320/693) Simplify (((f/f(1/11)f)(2/101))(20/3))(-3/8) assuming f is positive. f(-105/1111) Simplify (((i/(i(ii(2/5)/i)/i))34)(-17/5))(1/41) assuming i is positive. i(-1734/1025) Simplify (g/g19ggg)*(-22/5)((g/(gg/(gg*(-31)/g)g))/g)/ggg(-2/53) assuming g is positive. g(1694/53) Simplify ((t(2/5))(-46)(tt1)(-1/11))(-12/7) assuming t is positive. t(1752/55) Simplify (l(2/17)/l)/(l(-2/7)l)l(-13)/l(-2) assuming l is positive. l(-1499/119) Simplify (v2)*(-47)v/(vv7)v/((v*(2/3)v)/vv) assuming v is positive. v(-305/3) Simplify s(-1/7)s*(-1/10)(s(1/5))(-4/5) assuming s is positive. s(-141/350) Simplify (c(1/4)/(c*5/cc)(cc/(cc(-3/4)))/c(2/9))(9/5) assuming c is positive. c(-29/5) Simplify (a(-1/9)/a16)/((aa/a*(1/11)a)/a)(3/8) assuming a is positive. a(-13327/792) Simplify (w/w*16w12)/(((w(-6/11)w)/ww)/(w/w(-2/11))) assuming w is positive. w(-25/11) Simplify (r/(rr21))/(r/(r/(r/r25)))r/(r/r*(8/5))r(-22) assuming r is positive. r(-87/5) Simplify f*17/ff/(ff(1/30)/f)(f/f8)(-6/11) assuming f is positive. f(6859/330) Simplify (((a(-1))2)7)(-32) assuming a is positive. a448 Simplify ((qqq(1/11))/(q(5/6)q))/(qq/(q/((qq(11/4)qq)/qq))qq/q(-5)) assuming q is positive. q(-1781/132) Simplify (a*5/aa)*1(aa(2/15))/(a/a(3/11)a) assuming a is positive. a*(727/165) Simplify ((nn/(nn/n(-7/4)))/(nn(1/9)))/((n1/n)/n(-5)) assuming n is positive. n(-283/36) Simplify ((zz(-3))(-11)((z/(z/z*(5/2)))/zz)/(z/z10))(-1/11) assuming z is positive. z(-67/22) Simplify ((i/i(-7/4)i)/i)/i(i*(4/3)i)/i(i/i(-19)ii)/(i20i) assuming i is positive. i(49/12) Simplify l18/l*(3/5)(l/(l/l*5l))(7/5) assuming l is positive. l23 Simplify (aa17/a)/(a/(aa*1))(aa/a(-2/25))/a(a*(-1/5)a)/a assuming a is positive. a(472/25) Simplify (j(-10)j)/(j/((jj*2)/j))(j*(3/7)j)/(j/j13) assuming j is positive. j(38/7) Simplify (w*(5/9)/(www/(wwwww(-14)w)))/(w(-13))(-41) assuming w is positive. w(-4900/9) Simplify (((i0/i)/i*(-2))/(ii/(i*(-7/6)i)(i4/i)/ii))(4/9) assuming i is positive. i(-50/27) Simplify (n*(1/6)n)*(3/4)n(-12)/n(-1/7) assuming n is positive. n*(-615/56) Simplify (s/(sss/(ss*(-9))s))/ss(-10/9)s*(-7)/(s/(sss/((s/(ss*(-23)))/ss))) assuming s is positive. s*(-370/9) Simplify (((ss(-1/35))/(s(-4)s))38)(7/4) assuming s is positive. s(2641/10) Simplify (((n/(n/(n/n(2/13)))n)/	{ "pile_set_name": "DM Mathematics" }
3) + 5). Let i(m) = 20m2 - 26m*2 + 0m - 6 - m*3 - tm. Calculate i(-6). 6 Let u(k) = 0k3 + k3 - 2k*3 - k - 2k3 + k2 + 4k3 + 31. What is u(0)? 31 Suppose 0 = -c + 18 - 13. Let v(y) be the first derivative of y2 - 2y + 12. What is v(c)? 8 Let w(v) = v*3 - 11v*2 + v - 3. Suppose 30 + 25 = 5i. Determine w(i). 8 Let q(m) = 2m + 6. Let g be q(-6). Let i(j) = 6j - 24j - 9 + 10j + 5j + j. Calculate i(g). 3 Let j(k) = -8k + 21. Suppose 112x - 36 = 103x. What is j(x)? -11 Let m(h) = -4h + 0h2 + 2 + h2 + h. Let q(u) = 9u. Let c be q(1). Suppose -cz + 8 = -7z. Determine m(z). 6 Let g = 4 + -2. Let z(f) = 0f3 - fg - 4 + f*3 + 0 - f. Suppose -v + 2x = -4v + 11, -4x = 3v - 13. Determine z(v). 11 Let n be 24/40 + (-12)/(-5). Let j(h) = -h2 - 7h - 7h3 + 4h - 2h2 + 6hn. Let m = -7 + 5. Give j(m). 2 Suppose 1 - 3 = -j. Let m(x) = 3 + x2 + 4x + jx - 11. Let f = -30 + 24. Determine m(f). -8 Let k(j) = 3j2 + 3j*2 - j - 2j2 + 2 + j3. Let p = 63 + -67. What is k(p)? 6 Let b(k) = k*2 - 4k + 3. Let d be (18/6 + 21)(-2)/(-6). Suppose -6c + 2c = -d. Calculate b(c). -1 Let n(u) = u3 - u2 + 3. Let g(l) = 17l*3 - 5l*2 + 2l + 20. Let c(j) = -g(j) + 6n(j). What is c(-1)? 10 Let z(k) = -14k - 7. Let m be z(-1). Let w(l) = -l*3 + 6l*2 + 6l. What is w(m)? -7 Let t(n) = n. Suppose 0p - 14 = -7p. Suppose -2u - 3 - 3 = 2i, -pu - 3i - 11 = 0. Suppose a + 3o - 13 = 0, -3a - uo = a - 2. Give t(a). -2 Let g(m) be the first derivative of -m2 + 74. Determine g(2). -4 Let f(w) = w3 - 9w*2 + 10w + 12. Let l(r) = r - 2. Let x be l(-6). Let b(g) = 3g3 - 28g*2 + 30g + 35. Let i(h) = xf(h) + 3b(h). Determine i(11). -2 Suppose -49z = 132 + 211. Let i(w) = -2w + 1. Calculate i(z). 15 Let j(m) = 5m2 - 5 + 9m - m*2 + 3m - 2m2 + 2m. Determine j(-7). -5 Suppose 0p + p - 6 = 0. Let c(r) = -r2 + 6r + 6. Calculate c(p). 6 Let d(y) = -y*2 + 3y. Let f be 4 - ((-2 - 2) + 3). Suppose c - 6b = -3b - f, c + 11 = 5b. Determine d(c). -4 Let m(d) be the third derivative of 12d*2 + 1/6d*3 + 0d + 1/6d4 + 0 + 1/120d*6 + 1/15d5. Give m(-4). -15 Let j(q) = -q2 - q - 10. Let d(g) be the third derivative of -g6/120 - g5/10 + 7g4/24 + 15g*2. Let z be d(-7). Give j(z). -10 Let v(z) = z - 5. Suppose -g + 3i = -5, 5g - 2i - 8 = 2g. Suppose -gf = -10, 3f = -2b + 3b + 9. Determine v(b). 1 Let c(j) be the second derivative of -j5/60 - j4/24 - j3/3 + 3j*2/2 - 9j. Let r(g) be the first derivative of c(g). What is r(-4)? -14 Suppose 3j = 13 - 1. Suppose 16 = ju - 4s, s = 5u - 27 - 1. Let c(m) = -m*3 + 7m*2 - 6m - 1. Give c(u). -1 Let p(w) = -2 - 324w + 637w - 309w. Give p(-6). -26 Let x(n) = n3 - n. Suppose 3l + 16 = 2v, 10 = v + 3v + 5l. Suppose -vb + 4b = -5b. Give x(b). 0 Let g be 3 + 0 - 5(-18)/45. Let z(i) be the first derivative of -7/2i2 - g - i. What is z(-1)? 6 Let r(a) = a2 - 7a. Let y be (-24)/10(-40)/16. Let g(m) = -y + 0 + 1 - 11m - 1 - m3 + 13m*2. Let p be g(12). Give r(p). -6 Let b be 1(1 - 7)2. Let h = b - -17. Let j(i) = -3i + 5. What is j(h)? -10 Let z(m) = 14m + 1. Let c(a) = 14a + 1. Let o(b) = 8c(b) - 7z(b). Determine o(1). 15 Let m(s) = -4s2 - 3s - 6. Let w(u) = 7u2 + 6u + 11. Let p(j) = 5m(j) + 3w(j). Let z be (24/(-36))/(4/30). Let q be 2/z(-160)/(-16). Calculate p(q). 7 Let y be (4/(-8))/((-2)/(-20)). Let h(w) = -28w + w2 - w2 + 4 + 35w + w2. What is h(y)? -6 Let h(i) = i - 11. Let s(p) = -p3 - 13p*2 + 10p + 13. Let r be s(-14). Let o = -57 + r. What is h(o)? 1 Let c(s) = -7s + 44. Let q be c(8). Let j(m) = -m + 9. What is j(q)? 21 Let x(n) be the first derivative of n3/3 + 3n*2 + n - 1. Let u be 4/82/(-1). Let t(q) = 4q. Let c be t(u). Calculate x(c). -7 Let f(d) = -3d + 3. Let k be -4(-2)/(-12)3. Let n = k + 5. Determine f(n). -6 Let s(m) = m - 8. Let h be s(11). Let v(p) = 2p2 - 5p + 2. Let x be v(h). Suppose k = -xk. Let q(g) = g + 2. What is q(k)? 2 Let i(m) be the first derivative of 3/2m*2 + 2 + 5m - 1/3m3. What is i(5)? -5 Suppose 12 = 5z + 3t - t, -t - 4 = 0. Suppose -zv - 10 = -3q, 0v + 3v + 3 = 0. Let k(a) = -qa + 0 - a + 5a + 1. Give k(-1). -1 Let i(y) = 3y + 67. Let o be i(-17). Let b be (-122)/o + 6/(-16). Let z(k) = -2k - 5. Determine z(b). 11 Let r(w) be the second derivative of -3w3/2 + w2/2 - 3w. Let p(x) = -x3 + 13x*2 + 13x + 16. Let d be p(14). Give r(d). -17 Let c(y) = -y3 - y2 - y - 1. Let i = 140 + -139. Let b be i/2 - (-1 - 10/(-4)). Determine c(b). 0 Suppose -3z - 5 = -11. Suppose 3p + zp = 15. Let y(j) = -j - 7 + p - 8 + 0j. What is y(-5)? -7 Let g = -607 + 604. Let s(k) = -k*2 - 4k. What is s(g)? 3 Let d(p) = 4p - 4 + 5p + 3 - 8p. Let a = 4 + -11. Let t be (2 + 0)/(9 + a). Give d(t). 0 Let u(w) = -3w + 3. Let t(i) = -2i + 28 + 0i + i. Let z be t(0). Let g be 1/4 + z/16. Calculate u(g). -3 Let i be ((-15)/6)/5(1 - 5). Let l(v) = -v2 - 2 + 5v*2 - 4vi + v2 - 5v. What is l(5)? -2 Suppose 3n - 4g + 23 = 0, 4n - 2g = -3g + 1. Let z(a) = a. Let d(k) = 4k + 1. Let q(c) = nd(c) + 5z(c). Give q(-1). -2 Let i(o) = 9 + 83o - 48o - 41o - o2 - 3. Let j be (2/4)/(1/(-12)). Determine i(j). 6 Let k(i) be the second derivative of -i5/20 + 7i4/12 - i3/2 - 7i2/2 - i - 14. What is k(6)? 11 Let o(m) be the first derivative of m5/120 + m*4/8 + 7m*3/3 + 5. Let g(a) be the third derivative of o(a). Determine g(-5). -2 Suppose -h + 4l + 8 = 0, 5l + 7 - 22 = -5h. Suppose hi = -7 - 9. Let a(q) = -q3 - 5q*2 - 4q - 4. Calculate a(i). -4 Let a(k) = k + 29. Let p(q) = q*2 + 13q. Let i be p(0). Give a(i). 29 Let d(z) = z*3 - 3z*2 - 5z + 5. Suppose -5b + 6 = -3c + 19, 14 = -2b - c. Let x be b - -6 - (-3 + 0). What is d(x)? 1 Let h(s) = -s3 + 6s*2 + 30s - 21. Let p be h(9). Let y(n) = 11 - p - 9 + 7n - n2. Calculate y(4). 8 Let o(a) = 5a - 4. Suppose w - 39 = -12w. Calculate o(w). 11 Let x(g) = -g2 - 2g + 1. Suppose 5b - 5 = 3c + 2c, 3c - 5b = 1. Let m(j) = j2 + 3j + 1. Let o be m(c). Give x(o). -2 Let t(l) = 10 + l*2 - 15 + 3 + 2l*2 - 2l*3. What is t(2)? -6 Let p(v) = -v + 0 + 1 - 3 + 1. Suppose 5i + 2o = 20, -3i + 6 = -o - 6. Calculate p(i). -5 Let u(l) = -l*2 - 8l - 4. Let d(h) = -5h + 6. Suppose 11o - 7 - 15 = 0. Let q be d(o). Determine u(q). 12 Suppose 6 = -r + 2g, 5r - 2g = 2g - 12. Let z(s) = s*3 - 4s2 + s - 3. Let t be z(4). Let n(q) = q + 1 - t - 3. Calculate n(r). -3 Let b(n) be the third derivative of -n8/20160 - n7/5040 + n6/360 + 7n5/30 - 5n2. Let w(h) be the third derivative of b(h). What is w(2)? -4 Let f(d) = d3 - 10d2 + 19d - 185. Let j be f(10). Let p(i) = -5i + 0i - 4i2 - 4 - i3 + 2i3. Give p(j). -4 Let z = -2594 - -2580. Let l(s) = s3 + 14s2 + 2s + 5. Calculate l(z). -23 Suppose -10 = -2n - 0n. Suppose 0 = 5o - 3s - 174, 4o + ns - 31 = 123. Let v be 5/6o/6. Let z(r) = r3 - 5r2 + r - 4. Determine z(v). 1 Let s(c) be the first derivative of -c3/3 - 21c2/2 - 4c - 320. Determine s(-21). -4 Suppose -4a + 22 = 6. Let o(d) = -5 + ad - 2d - d. Let m = 798 - 794. Give o(m). -1 Let a(b) be the third derivative of b4/3 + 23b*3/6 + 911b*2. What is a(-4)? -9 Let b(m) = 2m - 36. Let i be ((-32)/(-3))/((-46)/(-69)). What is b(i)? -4 Let k(n) be the second derivative of -n5/20 - n4/12 - n*3/6 + 5n*2/2 - n - 294. Suppose -3 - 2 = -3v - d, 5 = 4v + d. Calculate k(v). 5 Let x(k) be the second derivative of 1/2k*3 + 1/12k*4 - 5k + 0 - 5/2k2. Let g be (-32)/126/4. What is x(g)? -1 Let d(u) be the first derivative of -8u2 + u + 77. Determine d(2). -31 Suppose -2x + 3 + 7 = c, -4c = 3x - 25. Let l(b) = -8b - 1. Let h(q) = -7q. Suppose 0 = 10v - 0 + 40. Let g(z) = vh(z) + 3l(z). What is g(x)? 9 Let k(x) be the second derivative of x5/20 + x4/2 + x3/6 + 5x*2/2 + 2x + 17. What is k(-6)? -1 Suppose -177g + 183g - 54 = 0. Let c(r) be the first derivative of g - 1/3r3 - 2r - 4r2. Calculate c(-7). 5 Let g(i) = i + 9. Let b(q) = 4q + 37. Let j(l) = 2l3 + l - 2. Let p be j(0). Let t(x) = pb(x) + 9*g(x).	{ "pile_set_name": "DM Mathematics" }
cending order. s, -1, d, -3 Let f = 339.7 - 340. Sort 5, f, -5 in descending order. 5, f, -5 Suppose -19 = 2w + 3p, -40w + 34 = -45w - 3p. Put -10, 5, -1, w in ascending order. -10, w, -1, 5 Suppose 0 = 5z + 343 - 333. Sort z, 0, -32, 1 in descending order. 1, 0, z, -32 Let a be (-1)/(1 - (-56)/(-52)). Suppose -ab + 7b = -36. Suppose 0 = -3g + 10 - 1. Sort -2, g, b. -2, g, b Suppose 22 = 5x - 3. Suppose -15o + 13o + 4s = -16, -5s = 10. Sort -24, o, x in descending order. x, o, -24 Let j = 2 - 8. Let w be -5 + (-5)/(10/j). Let g(k) = k*3 - 6k*2 + 6k - 3. Let z be g(5). Sort w, z, -1 in ascending order. w, -1, z Let f be (-7)/(-3) + -21. Let o = -24 + 52. Suppose -7a + o = -0. Sort a, -1/2, f in increasing order. -1/2, f, a Let v = -21 - -23. Let q(h) = -35h - 65. Let z be q(-2). Put 1, v, z, 0 in increasing order. 0, 1, v, z Let x(z) = z2 - 10z + 1. Let w be x(11). Let t be ((-8)/w)/((-2)/(-39)). Let b = t - -8. Sort 5, b, -1 in descending order. 5, -1, b Let f = 11 + -14. Let y be (2/(-3))/(f + (-78)/(-18)). Let q = 1 - 3. Put y, q, -4 in ascending order. -4, q, y Suppose 9 = 3h - 0. Suppose -hy = -y + 2. Let n = -0.4 - 3.6. Put -1/2, y, n in ascending order. n, y, -1/2 Let t = 596 + -600. Sort t, 0, 22 in descending order. 22, 0, t Let l(x) = -7x + 125. Let v be l(18). Sort v, -6, -4, -2 in ascending order. -6, -4, -2, v Suppose -4k - 42 = 2p, 4k + 33 = 3p - 2p. Sort -3, -1, k in descending order. -1, -3, k Suppose -4n - 4t - 4 = 0, 0n - 3n + 4t + 25 = 0. Put -2/3, 0.135, n in increasing order. -2/3, 0.135, n Suppose -7m = -6m - 5. Suppose -2t - 3t + 5 = mv, -2v + 8 = 5t. Sort -4, t, 1 in ascending order. -4, 1, t Suppose -5m - 57 = 113. Let l = m - -29. Sort 0.2, 0, l in ascending order. l, 0, 0.2 Let o be -3 + 1 + (1 - 2 - -4). Let i(d) = -d3 - d2 + 2d - 1. Let w be i(1). Let x = 4 + -6. Sort w, x, o. x, w, o Suppose 2h = -5i - 1, 3i - 77h + 82h + 12 = 0. Put -2, 5, i, -5 in descending order. 5, i, -2, -5 Let f = 5 + -20. Let l be (f/(-70))/(2/(-4)). Put 0.3, -4, 1/2, l in ascending order. -4, l, 0.3, 1/2 Suppose 2g + 4d + 64 = 0, -4g - 200 = g + 2d. Let c be (-81)/(-84) + (-12)/g. Suppose -b + 5 + 0 = 0. Sort c, b, 2 in decreasing order. b, 2, c Let a = -2.3 - -0.3. Let t = 895.8 - 897. Put t, 0.3, a in descending order. 0.3, t, a Suppose -2w + 11 = -u, -4u + 7 = -5w + 39. Suppose -9x - 72 = -3x. Let m(a) = a + 13. Let g be m(x). Sort -5, u, g in decreasing order. g, u, -5 Let k = -6.49 + -567.51. Put 2, k, -0.4 in decreasing order. 2, -0.4, k Suppose 2l + 2r + 23 = 7l, 4r = 4l - 16. Let j = -7421 + 7423. Put l, 9, j in decreasing order. 9, l, j Let n = 1091/5 + -219. Sort n, 28, 0 in decreasing order. 28, 0, n Let g be -12(4/(-12) + 0). Let y = -2 + 5. Suppose -2a = ya. Sort g, a, 1. a, 1, g Suppose -4z + 12 = -6f + 2f, -2f + 3z = 7. Sort 5, f, -4, -11 in decreasing order. 5, f, -4, -11 Suppose 4g - 2n - 7 = 9g, 0 = -2g - 4n - 6. Let v(l) = l*3 - 15l*2 - 15l - 16. Let q be v(16). Put g, q, 2, 20 in descending order. 20, 2, q, g Let d(w) = -6w2 - 2w - 1. Let p be d(-1). Let b = 20161/9 + -2240. Sort -0.5, p, -0.4, b in increasing order. p, -0.5, -0.4, b Let x be (-21)/(-14) + 58/4. Suppose -2v = -0v + 4m - x, 5v + 2m - 16 = 0. Sort v, 4, -6. -6, v, 4 Let q = 1791 - 1794. Sort 5, q, -4, 4 in ascending order. -4, q, 4, 5 Suppose -x - 3x + 8 = 4k, 5x = 4k - 8. Let t(c) = 2c*2 - c - 4. Let a be t(3). Sort 4, a, 5, x in increasing order. x, 4, 5, a Let g = 1398 + -15376/11. Sort 1/12, g, -0.1 in descending order. g, 1/12, -0.1 Let n be ((-30)/(-20))/(3/20). Let c be -2-1n/(-4). Sort 1, c, -1 in descending order. 1, -1, c Suppose -8d + 9d - 4z - 1 = 0, 3d - 14 = z. Let b be 4/14 - 47/(-7). Suppose bl - 15 = -x + 2l, -dx - 9 = 4l. Put x, -4, 3 in decreasing order. 3, -4, x Let q(a) = 11a - 302. Let g be q(27). Suppose 0 = -8c + 3c + 75. Let z = c - 21. Put g, -3, z in descending order. -3, g, z Let k = -102 + 84. Put k, -2/9, -2, -2/7 in descending order. -2/9, -2/7, -2, k Let l = -77 - -76. Let h(z) = -z*2 - 5z + 1. Let u be h(-4). Suppose -5g + 2i = 58, ug - 3i = -2i - 54. Sort -0.3, l, g in increasing order. g, l, -0.3 Suppose 17 - 3 = 2o. Let a(b) = b*3 + 8b*2 - 26b - 208. Let x be a(-8). Sort 2, o, x in ascending order. x, 2, o Let h = -29/34 - 11/17. Sort 1/6, h, -2. -2, h, 1/6 Suppose m - 22 = -2. Let t be m/35 - 3448/(-140). Let g = -25 + t. Put g, -2, -0.5 in descending order. g, -0.5, -2 Let h = -2.2 + 1.2. Sort -0.2, -14, -1/10, h in decreasing order. -1/10, -0.2, h, -14 Let y be 0 - (-4 - (-2)/2) - 2. Sort -7, -4, -5, y in ascending order. -7, -5, -4, y Let q = 453.1 + -412. Let t = q + -41. Suppose -4j = 3p + 3 - 15, 0 = -p. Sort -3, t, j in descending order. j, t, -3 Let a = -2784 + 2778. Suppose -4h = -6h + d - 5, 4h - 4d + 16 = 0. Sort a, 4, 0, h in increasing order. a, h, 0, 4 Suppose 26 = -278i + 276i. Sort 3, 2, i, 0.1 in decreasing order. 3, 2, 0.1, i Suppose 1 = -2x + 3, -2g + x + 23 = 0. Suppose 4o + g + 0 = 0. Put 3, o, -5 in decreasing order. 3, o, -5 Let x(l) = -3l - 2l2 + 1 + l + l2. Let t be x(1). Let j(w) = w3 - 14w*2 + 7w - 335. Let s be j(15). Sort s, t, -10 in descending order. t, s, -10 Let o = 7 - 5. Suppose 65u - 40 = 75u. Sort -0.1, 0.5, u, o in increasing order. u, -0.1, 0.5, o Let f(z) = z*2 + 2z - 10. Let u be f(-4). Let c = -7 + 7. Suppose c = -2p - 2i + 8, 3p - i = -0i + 28. Sort p, -3, u in descending order. p, u, -3 Let s be 0/2 + 3/(-8). Let v = -19.12 + 27.03. Let p = v - 7.9. Put -4, s, p in descending order. p, s, -4 Suppose -4r + 2r - 4 = 0. Suppose 7a = 7 - 0. Let k be a/(-3 + (-13)/(-4)). Sort r, k, 2 in descending order. k, 2, r Let a be ((-69)/46)/((-1)/2). Sort -0.028, 4, a. -0.028, a, 4 Let o = 12 + -23/2. Let p = 3.68 - 4.08. Sort o, p, 0.12. p, 0.12, o Let q = -11.925 + 12. Sort -3, 1/6, q. -3, q, 1/6 Let q(v) = -v3 + 2v*2 + 3v - 7. Let j be q(2). Let l = -4 + 4. Let a(c) = c + 1. Let z be a(l). Put 5, j, z in decreasing order. 5, z, j Let j be (-4)/8-22 + -23 + 16. Put j, -1, 2, -54 in decreasing order. j, 2, -1, -54 Let d = -307 - -307.5. Sort -5, 5, d in ascending order. -5, d, 5 Let u(g) = 4 - 16g + 9g + 5g. Let r be u(3). Let p = 3 + -1. Put r, p, -5 in descending order. p, r, -5 Let y(k) = k*3 + 5k*2 - 5k + 2. Let p be y(-6). Let n be -2 + (-3 - p)-1. Let j(l) = -l2 - 10l + 16. Let m be j(-11). Sort 4, m, n in decreasing order. m, 4, n Suppose -27z - 184 = -76. Sort z, 5, -3. z, -3, 5 Let l = -3.7 - -0.7. Suppose -14y - 5 = -19y. Put y, 0.4, 1/2, l in increasing order. l, 0.4, 1/2, y Suppose 16n - 3o = 12n + 23, -3 = 3o. Sort -12, -1, 4, n in decreasing order. n, 4, -1, -12 Suppose 0 = -5u + c - 17, 3u = -4c + 26 - 27. Let x(z) = -z*3 + 4z*2 + 5z. Let s be x(5). Put s, u, -6 in descending order. s, u, -6 Let p = -681 - -681.2. Let z be 3186/21 - 2-1. Let q = 154 - z. Sort q, -3, p. -3, p, q Let f = -4 + 1. Let d(g) = g3 + 4g*2 + 3g - 4. Let m be d(f). Suppose 53c + 210 = 11c. Put c, m, 5 in descending order. 5, m, c Let d be (-18 + 22)1/(-4) - 0. Sort 5, 57, d. d, 5, 57 Let p(n) = 0n*2 - 7n*2 + 8n*2 + 5. Let f be p(0). Suppose -4l = t + 3t + 4, l = -ft - 9. Put -2/13, l, 0.5 in decreasing order. l, 0.5, -2/13 Suppose -2a + 8n + 6 = 10n, 0 = -5a - 4n + 16. Put 0, 6, 2, a in increasing order. 0, 2, a, 6 Suppose 4z - 50 = -42. Put -3, z, -6 in decreasing order. z, -3, -6 Let m be 9 + (-45)/(-9) + -12. Sort m, 176, 5. m, 5, 176 Let i be 342/(-2508)(-4)/3. Let m = -4 + 2. Let c = -29/55 + -4/55. Put m, c, i in decreasing order. i, c, m Let y = -456 - -451. Let h(d) = d3 - d2 - 2d + 5. Let m be h(0). Sort m, 1, -4, y in descending order. m, 1, -4, y Let z be 3/(11/(-36) - 12/27). Put z, 0.2, -4/7, -5 in descending order. 0.2, -4/7, z, -5 Let f = -57 + 56. Put 15, 5, f in decreasing order. 15, 5, f Let f be (-13 - -18)(2 - 3). Sort -3, -7, -17, f in descending order. -3, f, -7, -17 Let c(f) = -f3 + 3f*2 - 2f. Let o be c(3). Suppose 6l + l - 28 = 0. Let r(x) = 4x3 + x2 - x - 3. Let v be r(-1). Put l, o, v in ascending order. o, v, l Let s = -210 + 207.74. Let r	{ "pile_set_name": "DM Mathematics" }
232) Simplify ((hh(-1/7))/(h/(hhh/((h/(h/h(-1)))/h)))hh4hh(2/5))10 assuming h is positive. h(788/7) Simplify (j28j/(j*(-3/13)j))(-38) assuming j is positive. j(-13946/13) Simplify (a(-1/42)/(a(-16)/a))/(aa11)(-22) assuming a is positive. a(11801/42) Simplify b(-11)/(bb*(-4/5)/b)(b*(2/19)bb)/(b(-2/9)/b) assuming b is positive. b(-5876/855) Simplify (x/(x/(xx*(-2/39)x)x)xx)39x*(-1/4)xx(-2/37)x assuming x is positive. x(17271/148) Simplify p4/((pp(-14))/p)((p/p(-5))/p)(-4/19) assuming p is positive. p*(322/19) Simplify (aaaa4)(-14)(a(a/(aa(-13)))/a)/a0 assuming a is positive. a(-85) Simplify (((ddd/d(-2/3))38)(-2/69))(-9) assuming d is positive. d(836/23) Simplify ((ii*(15/4))/(i/(i/(i/(iiii/(ii(-1/8))i)))i))/((i/i1i)/i13) assuming i is positive. i(151/8) Simplify (((o(1/3)/o)/o(2/5))/(o/o*6o(3/5)))(-5/7) assuming o is positive. o*(-50/21) Simplify (((a(aa(-1)aa)/aa)/a)(1/35)/(a(1/4)a)44)(-24) assuming a is positive. a(46152/35) Simplify ((xx/(xx13))/(xxx/x(-3/5)x))/(((x/(x/((xx8x)/x)))/x)/(xx/(x(-13)x))) assuming x is positive. x(-53/5) Simplify (u(2/9)u/u(2/11)uu(1/4)/(u(-5)u))18 assuming u is positive. u(2491/22) Simplify (d(-3/2)/(d/(d/(d/(d/(d(-4)d))))))/(((dd(-2/7))/d)/d)(-4/21) assuming d is positive. d*(123/98) Simplify (rr(-1/13))(-4/3)(rrrrr(1/4)rrr)3 assuming r is positive. r(1067/52) Simplify (s*(-2/27)s)(-2/11)/((s/((s(2/3)s)/s)s)/((ss/s(3/7))/s)) assuming s is positive. s(-1934/2079) Simplify (q/q(-2/11))1(q/(qq(-3)q))/q(-13) assuming q is positive. q(178/11) Simplify n*(2/23)/((n(n*(2/69)/n)/n)/n)(nn((n*(2/7)n)/n)/n)(-20) assuming n is positive. n(-11426/483) Simplify ((ww/(w/w2))(13/6)(w(-4/3)/w)/((w/((w(-1)ww)/w))/w))(-1/2) assuming w is positive. w(-25/12) Simplify g*6/(gg(g/(gg*(-2/7)))/g)g*12/gg/(g/(g(((g(-11)/g)/gg)/gg)/ggg)gg) assuming g is positive. g(26/7) Simplify ((aaa(-7))/(aa*1a)(a/(a(a/(aa(a/(a/a*(2/27))a)/a))/aa))/(aa10))(12/11) assuming a is positive. a(-176/9) Simplify i(1/28)/(((ii(-5)i)/i)/ii)((i/(i*14/i))/ii)/(i/(i(-1/2)/i)) assuming i is positive. i(-293/28) Simplify (f/((ff10)/f)f)/ff/((f/(f(f*(1/3)f)/f))/f)(ff(1/17)/f)/(f10/ff) assuming f is positive. f(-847/51) Simplify (h/h(1/24)hh)/(h1h)(h10)(19/4) assuming h is positive. h(1163/24) Simplify (b10bb)(15/4)(b/(b21/b))/(b/b(3/4)) assuming b is positive. b(103/4) Simplify (l(-2))(-1/17)/(((l(-5/3)/l)/l)/l(-16)) assuming l is positive. l(-623/51) Simplify (kk(-5/4)/k)17((k*4/k)/k)/(kk*20/kk) assuming k is positive. k(-161/4) Simplify l/((l(2/27)l)/l)l*(5/2)/l(ll(-1)ll)/(l7/lll) assuming l is positive. l(-193/54) Simplify (s/s(-3/17))/s(-4/7)(((s/s*(-15)s)/s)/s)/(s(ss/(s(s(-15/7)s)/ss))/ss) assuming s is positive. s*(1619/119) Simplify ((rr*(-4/7)r)(-46))(-2/31) assuming r is positive. r(920/217) Simplify (g(-18)(g/((gg/(g*(-1/32)/g))/gg)g)/g)/((g(-4)g)/(g17/g)) assuming g is positive. g(-33/32) Simplify ((o/(oo(-2))o)/oooo(-2)o)/(o(-2/7))(-3/4) assuming o is positive. o*(39/14) Simplify (c(c*(2/5)cc)/c(ccc(-3/10))/c)/(c/(c10/c)c)(-11) assuming c is positive. c(-739/10) Simplify (k22/(kk(-9/5)))(7/8) assuming k is positive. k*(399/20) Simplify (jjj22j)/((((j/(j*8j))/j)/j)/j)jj*(2/21)j/((j/j(13/5))/j) assuming j is positive. j(4273/105) Simplify ((k*4k)/k)/(k*12k)kkk(-8/3)kk(-19)k assuming k is positive. k(-80/3) Simplify (s(-7))*(1/8)(ss(-6))0 assuming s is positive. s(-7/8) Simplify (((b12/b)/b)/b(15/7))/(b(-2/3))(2/19) assuming b is positive. b(3163/399) Simplify (l(-11)/lllll(2/9)/l(l(l/(l(-3)/l)l)/l)(-30))14 assuming l is positive. l(-23912/9) Simplify (((o(2/5))9)(-3))(-8) assuming o is positive. o(432/5) Simplify (p(-6)/p17)/(((p*22p)/pp)/(p(pp/p(7/2))/p)) assuming p is positive. p(-95/2) Simplify ((q/q(-1/7))36(((q*2/q)/q)/qq)18)29 assuming q is positive. q*(8352/7) Simplify (z/(zz/z*(2/9)z)z(5/4))/(z4)(3/8) assuming z is positive. z(-73/36) Simplify ((d(-13))(2/77))(-23) assuming d is positive. d(598/77) Simplify (k/((k/(k(-4/5)k))/k))/kk(-6/11)/kk/(kk11/kk)k/k(3/19) assuming k is positive. k(-12021/1045) Simplify (q/q(-4/11)q*15)/(qq*(-14/3)q(-6/11)) assuming q is positive. q(679/33) Simplify ((i(10/9))(2/3))(-30) assuming i is positive. i(-200/9) Simplify (k*(2/7)k*(1/9))/(kkk(-2/5)k)21 assuming k is positive. k(-17074/315) Simplify (m(-2/15)/m)(-36)/(mm(-8)/mm/m(-10/11)) assuming m is positive. m(2579/55) Simplify ((hhh(h/((h(-4/15)h)/hh))/hh)/(h*(-13)h))/(h0)(-1/8) assuming h is positive. h(229/15) Simplify (y(-1/11)y)/y16(((y/y*16y)/y)/y)/((y*(-2/21)y)/y) assuming y is positive. y*(-7160/231) Simplify (cc1)(-45)/(c(1/5)/(c(-13)c)) assuming c is positive. c(-511/5) Simplify (y(4/7)y)/y*(-13)y*12yyy/(y/((y/(y/(yy9)y))/yy)) assuming y is positive. y(263/7) Simplify (t(3/5)/(((t(1/2)/t)/t)/t))/(t(-1/3)/(t2t)) assuming t is positive. t*(193/30) Simplify (ss(1/2)/s)41(s/(s/(s/(s5s))))(1/2) assuming s is positive. s18 Simplify m*(11/4)m*(-1/16)(m(3/8)/m)(-2) assuming m is positive. m(63/16) Simplify (m(-1/3)/(m13/m))/(m(1/4))(-15) assuming m is positive. m(-103/12) Simplify (y*(4/21)y/(y/((y/y*(-10))/y)))/((y/(yyy36))/y(-27)) assuming y is positive. y(424/21) Simplify c/(c/c(-2/17))c*(-3/14)/cc/(c/(c*(3/4)c))ccc10 assuming c is positive. c(5911/476) Simplify (a2/a)(-10/11)/((aaaaa(1/5)aa)/a)43 assuming a is positive. a(-12348/55) Simplify ((h/h(-2/29))/h)/hhh(2/5)(h/(h/(h/(h/h*(-15/8)))))/hh(-1/21) assuming h is positive. h(-59771/24360) Simplify (i*(-2/25)i)*(32/7)ii8i(2/23) assuming i is positive. i(53503/4025) Simplify ((q/((q*19/qq)/qq))/q(-2))/(q(-4))(-48) assuming q is positive. q(-208) Simplify ((r(1/2)r)/r)(2/17)/(r17/(r/(r*(-12)/rr))) assuming r is positive. r*(-67/17) Simplify (qq(-2))(6/11)q1/q(-2) assuming q is positive. q(27/11) Simplify (((ss*(-1))/ss)(-35/3)/(s(2/9))(-20))(-3) assuming s is positive. s*(-40/3) Simplify ((qq/(q/(qqq*(-5)))q)/(qq/(q/(q/(q1/q)))))/(q(8/5)q/q21) assuming q is positive. q(77/5) Simplify ((((oo/o(-4))/o)(2/5))(2/7))(2/3) assuming o is positive. o(8/21) Simplify (ii/(i/i*8)i/(i/(ii/(i/(i0ii))i)i))18 assuming i is positive. i216 Simplify ((o/(o(-12/7)/o))/(ooo29))/(o(-1/4)o/(o/(oooo2))o) assuming o is positive. o*(-925/28) Simplify (ii*17((i*(-3)/ii)/i)/i)/((i/(ii(i*(2/55)/i)/iii))/(i/(ii/((i*(1/39)i)/ii))ii)) assuming i is positive. i(34453/2145) Simplify ((u/u4)/u)(3/31)u/(uu(-10)u)uuuuu/u(-2/3) assuming u is positive. u(1328/93) Simplify (g(9/5))(25/4)/(g15g*(-3)g) assuming g is positive. g(-7/4) Simplify (d(2/13))6/((d/d(1/10))/(d(5/4)/d)) assuming d is positive. d(71/260) Simplify mmm*13mmm/((m*18/m)/m)m(1/12)/m(-10) assuming m is positive. m(145/12) Simplify (b/(b(-6/7)/b)bb*(1/5)b)/(b*(-3/10)b/((bb(-13)/b)/b)b) assuming b is positive. b(-149/14) Simplify (((b0)(-22))(-17))*(-2/35) assuming b is positive. 1 Simplify (yy*(-7)yyy*(-1)(yy(-3/4))/(y/(yy(-6))))4 assuming y is positive. y(-43) Simplify (v9/vv(-1/6)v*(-3/4)vv(-8))(-5/2) assuming v is positive. v(-5/24) Simplify (s10)(-4/15)s/(ss10)s(-1/19) assuming s is positive. s(-725/57) Simplify ((kk(1/6))/k(-1/24))/(k(-2)/k)(-28/5) assuming k is positive. k(-1871/120) Simplify p(-10)pp(-20)pp(-9)p(-2/19) assuming p is positive. p(-705/19) Simplify ((n(-8))45)**(1/40) assumin	{ "pile_set_name": "DM Mathematics" }
5. Let l(c) = c*2 + 2c - 1. Calculate -6l(w) + p(w). 119w*2 + 1 Let c(l) = -l - 1. Let n(s) = -s - 1. Let b = -18682 + 18680. Suppose 4k - 3k = 3. What is bc(i) + kn(i)? -i - 1 Let p(z) = 2z*3 - 3z*2 - z + 4. Suppose -9v + 77 = 122. Let x(s) = 3s3 - 5s*2 - s + 7. Determine vp(l) + 3x(l). -l3 + 2l + 1 Let v(i) = 701038i2 + 12796i - 6398. Let g(x) = 986x2 + 18x - 9. What is -6398g(k) + 9v(k)? 914k2 Suppose 351 = 237r - 92r - 106r. Let k(b) = -b*2 - 4. Let n(z) = -2z*2 - 9. Calculate rk(i) - 4n(i). -i2 Let a be (40/12)/((-7)/(-504)20). Let c(z) = -30z2 + 2. Let o(n) = n2. Give ao(i) + c(i). -18i2 + 2 Let h(w) = -2w - 5. Let f(u) = -4u - 9. Let o(v) = 3f(v) - 5h(v). Let p(y) = -4y - 4. Let s(t) = -t + 3. Let b be s(6). Determine bp(g) + 7o(g). -2g - 2 Let v(l) = 2356l. Let h(n) = 51832n. Determine -6h(o) + 133v(o). 2356o Let l(y) be the first derivative of -6y + 110. Let a(o) = o + 4. Let j(t) = -5a(t) - 4l(t). Let u(i) = -i + 1. Give j(w) - 6u(w). w - 2 Let u(q) = 31q2 + 71q - 7. Let b(h) = -57h2 - 130h + 13. Let z(k) = -6b(k) - 11u(k). Let i(p) = -26p2 + 34p + 34. What is 6i(n) + 204z(n)? 48n2 Let c(r) = -94r*2 - 27r - 12. Let m(p) = 283p2 + 81p + 33. Determine 11c(a) + 4m(a). 98a2 + 27a Let x(i) = -2i3 + i2 - 4i + 1. Suppose 0 = -1022h + 1006h + 64. Let w(a) = 4a3 - 2a*2 + 9a - 3. Give hw(o) + 9x(o). -2o3 + o2 - 3 Let q(y) = 5y + 8. Let b(f) = -1. Suppose 5p + 6 = 4v + 22, -2v - 18 = -5p. Determine pb(l) + q(l). 5l + 4 Let h(z) = -14z2 - z - 2. Let w(i) = 13i*2 + i + 3. Let j = 16570 - 16566. Give jh(v) + 3w(v). -17v*2 - v + 1 Let f(l) = -21l*3 - 6l*2 - 3l + 7. Let j(w) = w3 + w2 + 3w. Give -f(z) - j(z). 20z*3 + 5z2 - 7 Let i(b) = b3 + 2b2 - b. Let n(f) = 3f*3 - 6f*2 + 29. Determine -2i(j) - n(j). -5j3 + 2j*2 + 2j - 29 Let m(v) = 2v3 - 25v*2 + 76v + 4. Let s be m(5). Let c(j) = -3j + 8. Let h(r) = 6r - 15. Calculate sc(b) + 5h(b). 3b - 3 Let u(j) = -j3 - j - 1. Let m(f) = f3 - 3f*2 - 15f + 41. Let i be m(7). Let r be (-1)/12 + 803/i. Let v(x) = 7x3 + 6x + 6. Calculate ru(w) + v(w). w3 Let n(j) = -2j*3 + 6j + 5. Let c(v) be the second derivative of v3/6 + v2/2 - 10v + 2. Determine -3c(u) + n(u). -2u3 + 3u + 2 Let b(z) be the first derivative of -3z4/2 + 2z*2 - 3z - 30. Let l(t) = -7t3 + 5t - 4. Let f = 163 + -158. Calculate fb(h) - 4l(h). -2h3 + 1 Let u(a) = 1017a*2 - 18. Let x(n) = -9n*2 + 2. Give u(c) + 9x(c). 936c2 Let t(z) = 3z*3 + 6z*2 + 6z + 22. Let s(d) = 45d2 + 534d - 55. Let n be s(-12). Let w(i) = -8i3 - 17i*2 - 17i - 66. Calculate nt(p) + 6w(p). 3p3 - 22 Let g(t) = 22t*2 + t - 2. Let v(n) = -1245n*2 + 83n - 166. Calculate 332g(k) - 4v(k). 12284k2 Let g(r) = r3 + 16r*2 - r - 6. Let a be g(-16). Suppose -u - au = 77. Let l(j) = -2j2 + 6. Let s(p) = 3p*2 - 7. Determine ul(z) - 6s(z). -4z*2 Let f(s) = 118s*3 - 4s*2 - 20s - 5. Let o(j) = 314j3 - 13j*2 - 60j - 14. Calculate -8f(b) + 3o(b). -2b3 - 7b*2 - 20b - 2 Let q(p) = -2p + 5. Let f(l) = -l + 2. Let b(t) = -11f(t) + 4q(t). Let u(o) be the third derivative of 0o + 0 - 15o2 + 1/6o*3. Give -b(k) - 4u(k). -3k - 2 Let a(b) = -5b - 20. Let g(u) = -22u - 40. Give -5a(q) + 3g(q). -41q - 20 Let u(t) = -t*2 - t - 41. Let v(s) = 6s*2 + 5s + 201. Give 22u(p) + 4v(p). 2p2 - 2p - 98 Let f(k) = -31k - 18. Let b(h) = 88h + 56. Let c(d) = -6b(d) - 17f(d). Let z(q) = 3q + 60. Calculate 5c(x) + 2z(x). x - 30 Let j(v) = -520v*2 + 2v - 3. Let w(l) = 124l2 - l + 1. What is 3j(z) + 11w(z)? -196z*2 - 5z + 2 Let i(r) = 19r3 + 11r + 8. Let o(x) = 17x3 + 12x + 10. Give 5i(v) - 4o(v). 27v3 + 7v Let x(g) = 25 + 25 - 2g + 16 - g - 68. Let s(m) = -1. Suppose -u + 8 = -3u. Give us(f) + 2x(f). -6f Let a(g) = -g. Let p(v) be the second derivative of -2v3/3 + v2/2 + 3779v. Give 5a(w) + p(w). -9w + 1 Let a(z) = z3 + 307z*2 + 11577z + 1301. Let k be a(-263). Let o(x) = 5x + 1. Suppose 22 - 4 = 3l. Let j(m) = 11m + 2. Calculate ko(f) + lj(f). -4f - 2 Let k(f) = 406f3 + 164 + 4f + 408f3 - 163 + f2 - 819f*3. Let d(g) = 11g*3 - 2g*2 - 9g - 2. Determine 6d(v) + 14k(v). -4v3 + 2v*2 + 2v + 2 Let l(c) = -c*2 - 10c + 1. Let w be l(-10). Let q(v) = 2 + 2v3 + 2v*2 + 2 + 1. Let s(f) = -278 + 115 + 164. Determine wq(z) - 5s(z). 2z*3 + 2z*2 Let m(o) = 33o*2 + 13o - 21. Let r(j) = 95j2 + 38j - 59. Give -17m(b) + 6r(b). 9b2 + 7b + 3 Let x(o) = 47o2 - 14o + 40. Let l(d) = 17d2 - 4d + 14. Calculate 11l(q) - 4x(q). -q*2 + 12q - 6 Let z(s) = 7s2 + 3s + 16. Let o(t) = 8t2 + 4t + 17. Suppose 0 = 1404y - 1388y + 80. Determine yo(m) + 6z(m). 2m2 - 2m + 11 Suppose 388t = 351t + 74. Let f(o) = 1. Let q(d) = 21d + 2. Determine tq(y) - 4f(y). 42y Let u = -1410 + 1401. Let x(v) = v*2 - 8v + 21. Let i(l) = 2l - 5. Calculate ui(b) - 2x(b). -2b*2 - 2b + 3 Let u(f) = -15f2 + 13f + 13. Let t be 3/((-96)/(-160)) - 11. Let n(q) = -7q2 + 6q + 6. Let w be 15 - (-3)/(3/(-2)). Calculate tu(b) + wn(b). -b*2 Let n(z) = -9z*2 - 61z - 370. Let l(q) = 3q2 + 22q + 124. Give -11l(u) - 4n(u). 3u2 + 2u + 116 Let f(g) = 1. Suppose 5h - 4v = -22, -v = -4h - 5v - 32. Let d be (6 - 3 - 2)4. Let y(n) = -4n + 5 + 0 + 6n + d. Calculate hf(i) + y(i). 2i + 3 Let p(m) = -m + 6. Let g be p(8). Let r(y) = 4y*2 - 21y + 1. Let b(j) = j*2 - 5j. Let q be 504/1967/2. Calculate gr(d) + qb(d). d2 - 3d - 2 Let b(u) = 93u3 + 6u*2 - 3u - 14. Let y(r) = 192r3 + 12r*2 - 5r - 25. Determine -5b(p) + 3y(p). 111p3 + 6p*2 - 5 Let h(y) = -6y. Let f be (3 - 1) + 3 + 0. Suppose -fr = -5w + 30, 0 = -2r + w - 3 - 10. Suppose 2t + 19 = 23. Let s(g) = -19g. Give rh(j) + ts(j). 4j Let s(j) = -1. Let r = -2913 + 2914. Let g(h) = -h + 6. Determine rg(c) + 4s(c). -c + 2 Let f(u) = 87u3 + 4u2 + 4. Let l(s) = -s3 - 115s2 - 55s + 6722. Let o be l(-114). Let n(t) = 173t3 + 7t*2 + 7. Determine on(b) + 7f(b). -83b*3 Let d(z) = 8175z + 65. Let w(b) = -8180b - 43. Give -2d(a) - 3w(a). 8190a - 1 Let v(i) = 2i + 8 + 17 + 29 - 49. Let o(t) = -2t - 4. Give -6o(m) - 5v(m). 2m - 1 Let h(c) = -172c3 - c2 + 5c - 2. Let w(n) = -n2 + 4n - 1. Determine h(q) - 2w(q). -172q3 + q2 - 3q Let u(q) = 96q*3 - 4q*2 + 2q + 7. Let n(y) = 96y3 - 3y*2 + 2y + 7. What is -6n(l) + 5u(l)? -96l3 - 2l*2 - 2l - 7 Let s(b) be the first derivative of -b*3/3 - b + 8707. Let v(p) = -4p*2 - p - 5. Determine 6s(m) - v(m). -2m2 + m - 1 Let c(s) be the second derivative of -s4/3 + 5s3/3 - s2/2 - 263s. Let f(y) = 7y*2 - 19y + 2. Give 5c(n) + 3f(n). n*2 - 7n + 1 Let c(g) = -2g3 - g2 + 20g - 1. Let q(f) = -5f3 - 4f*2 + 78f - 1. What is 3c(d) - q(d)? -d3 + d2 - 18d - 2 Let z(n) = -99n2 + 134n + 69. Let r(j) = 25j2 - 35j - 18. Give 15r(h) + 4z(h). -21h2 + 11h + 6 Let t(f) = 3f2 + 86f + 2. Let u(k) = -5k2 - 128k - 3. What is 8t(l) + 5u(l)? -l*2 + 48l + 1 Let i(g) = -102g2 + 4g - 913. Let o(b) = -47b2 + 2b - 455. What is -6i(h) + 13o(h)? h*2 + 2h - 437 Let b(u) = -22u2 - 3. Let j(a) be the first derivative of 323a*3 + 133a - 1331. Determine 133b(n) + 3j(n). -19n2 Let j(q) = -5q*2 - 6q + 5. Let k = 18 - 26. Let u = 14 + k. Let b(a) = -7a - 441a*2 + 435a*2 + 2224 - 2218. Give ub(r) - 7j(r). -r2 + 1 Let m = -8613 + 8608. Let c(y) = 9y + 14. Let l(j) = 13j + 21. Calculate ml(f) + 7c(f). -2f - 7 Let d(n) = 21n + 9. Let v(j) = 9447j + 113356. Let r be v(-12). Let w(x) be the second derivative of -16x3/3 - 7x*2 + x. Give rd(f) - 5w(f). -8f - 2 Let b(l) = -l*3 - 28l*2 + 9l + 255. Let t be b(-28). Let w(u) = -2u + 4. Let c(s) = s2 + 2s - 4. What is tw(m) + 2c(m)? 2m2 - 2m + 4 Let w(y) = 2y2 + y + 1. Let z(b) = -63b - 54b + 238b - 61b + 2 + 5b*2 - 58b. Give -7w(v) + 3z(v). v*2 - v - 1 Let h(m) = 4m**3 + m + 6. Let o be 3/4 - (	{ "pile_set_name": "DM Mathematics" }
- 12, 3z - 3 = -5l. Let u = 0.8 + -0.5. What is the second smallest value in z, s, u? s Let u = 0.05 - 4.05. Let b(h) = -16h + 17. Let f be b(1). What is the second biggest value in u, -0.1, -2/7, f? -0.1 Let z = -133 - -129. What is the third smallest value in z, -0.15, 1/2? 1/2 Suppose 2 = 5h - 38. Suppose -5v - 14 = -p, 390p - 14 = v + 387p. What is the biggest value in v, -3, h? h Let s = -246.05 + 246. Suppose 6 = -3x + 3t + 30, -3x = t - 12. What is the second biggest value in -5, x, 0.3, s? 0.3 Let t(j) = -13j2 + 9 - 11j + 0j2 + 0 - j3. Let h be t(-12). Which is the third biggest value? (a) 12/7 (b) -2 (c) h (d) 5 b Let r be 0 - (0 - (-3 - -4)). Suppose -2h - r = -h. What is the biggest value in -2, h, 5? 5 Let q = 366 - 373. What is the biggest value in q, -2.2, -1? -1 Let t be (10 - -2)(-64)/(-24). Suppose 13q = tq - 76. Which is the third smallest value? (a) 0 (b) q (c) -4/7 b Let r = 2537/15 + -849/5. Suppose 10s = 5s + 125. Suppose -q = 3q + 2i - 30, 4i = -q + s. What is the second smallest value in -4, r, q? r Let n = 269/6 + -136/3. Suppose 2i + 4 = 3o, 4o = 3i - 2 + 6. Let f be 10/o(-2 + 0). What is the biggest value in n, 0.3, f? 0.3 Let f = -191 - -191.5. Which is the fourth smallest value? (a) 1 (b) 2 (c) 4 (d) f c Let h = -53.4 + 47.4. Which is the smallest value? (a) h (b) 3/7 (c) 0.5 (d) -5 a Let i be (1/(-2))/((-408)/136). What is the second biggest value in -0.2, -1, i, 1/3? i Let v = 1 - 1. Let f(x) = 5x - 63. Let i be f(12). What is the third smallest value in -5, i, v? v Let m = 1 + -1. Let l be ((-15)/(-10) - 2)878. Let s = 9221/21 + l. What is the second smallest value in s, 0.3, m? s Let q = -79 - -78.7. Let j be 5 - 2 - (-134)/(-46). Which is the second biggest value? (a) 0.3 (b) j (c) q b Let d = -1.5 + 3. Let s = 0.8 + 0.3. Let f = s - d. Which is the second smallest value? (a) -0.1 (b) 2 (c) f a Let r = 1956 + -1956.2. Which is the biggest value? (a) -0.9 (b) r (c) 2/9 c Let f = 257.1 - 257.2. Which is the third smallest value? (a) f (b) -2 (c) 2/11 (d) 3/8 c Let r = 616 + -616. Which is the second biggest value? (a) 4 (b) r (c) 3.2 c Let u be ((-6)/(-12))/(8/80). Which is the third smallest value? (a) 4 (b) -5 (c) u (d) 1/10 a Let r = -315 - -315.3. What is the second biggest value in -1, r, 3, -2/9? r Let d be (-135)/(-75) + 1370/(-25). Which is the smallest value? (a) d (b) -1 (c) 1/4 a Let y = -42 - -23. Let u = y - -18. Let t = 1.1 + -3.1. What is the second smallest value in 3/5, t, u? u Let l = -43.32 - -43.7. Which is the third smallest value? (a) -1 (b) 5 (c) l (d) 7 b Let r = -58/9 + 62/9. Let z(n) = n3 + 6n*2 + 7n + 10. Let j be z(-5). Suppose 0 = -2l + 2 - j. Which is the second smallest value? (a) -1/6 (b) r (c) l b Let v = 154.2 + -154.3. What is the fourth smallest value in 0.2, -88, 2/9, v? 2/9 Let v = -786 - -784. Which is the biggest value? (a) -5 (b) 270 (c) v (d) -0.5 b Let h = 11 + -8. Let w = -20.66 + 21. Let p = -0.23 + w. What is the smallest value in h, 5, p? p Let i = 0.86 - 86.36. Let q = -86 - i. Which is the smallest value? (a) 2 (b) 1/9 (c) q c Let j = -309 + 308. Which is the second biggest value? (a) j (b) -4 (c) -5 (d) 4 a Suppose 3g - 15 = -3. What is the second smallest value in -3/8, g, 8? g Let t = 1 - 6. Suppose -11s = -14s + 15. Which is the second biggest value? (a) 1 (b) t (c) -1/2 (d) s a Let s = 6 - 3. Let p = -0.25 + 0.2. Let f = p + -1.95. What is the second biggest value in s, -0.1, f? -0.1 Let i = -1.921 - 0.079. Which is the smallest value? (a) 2/9 (b) i (c) -0.1 b Let f be (6/14)/(1/7). Let t = -1.3 + 0.1. Let k = t - -0.9. Which is the smallest value? (a) 0 (b) k (c) f b Let y = 247 - 252. Let n = -49/4 + 629/52. Which is the biggest value? (a) y (b) n (c) 6 c Let x be (10/(-3) - -4)6/(-10). What is the smallest value in -0.5, x, -1, -1/14? -1 Let w be (3/(-4))/((-3)/5). Let v = 2608.9 + -2609. What is the third biggest value in w, -1/3, -2, v? -1/3 Let n = -5.3 - -6. Let j = -1.2 + n. Let l = -3.9 - -1.9. What is the biggest value in 1, l, j? 1 Suppose 0 = -5j + 2q - 61, 5j + 4q + 32 = -11. Let p = 12 + 4. Let g = j + p. What is the biggest value in 4, g, -3? g Let y = -336 - -336.2. What is the second smallest value in 2/7, -1, y, -9? -1 Let t = 0.0738 - 0.4738. What is the biggest value in 3, 2/9, -0.07, t? 3 Let t = -1419/3535 + 1/707. Which is the second biggest value? (a) 16 (b) 1/6 (c) -5 (d) t b Let k = 152.7 - 153. What is the fourth smallest value in 4, k, -21, 0.5? 4 Let j = 2.188 + -5.188. Which is the smallest value? (a) j (b) -5 (c) -18 (d) -0.2 c Let f = 487 + -487.1. Which is the second smallest value? (a) -1/9 (b) f (c) -0.5 (d) -5 c Let r = 0.02 - -4.98. Suppose -5b - 202 = 108. Let s = 808/13 + b. What is the biggest value in r, 3/7, s? r Suppose -2v + 20 = 14. Suppose v + 9 = -3y. Which is the third smallest value? (a) -0.4 (b) -0.3 (c) y b Let f be (-22/14)/(-74 + 79). Let l be 2/(-3) - (-122)/210. Let m = l + f. What is the third biggest value in -1/2, 0.1, m? -1/2 Let b = -0.18 - 1.62. Let w = -1.7 - b. Let k = w - -0.3. What is the second smallest value in 3, k, -4? k Suppose f = x + 2, 8f - 3f = 5. Let y be (-15)/(-20) + 5/4. Suppose 5r - 4h = y, -3r - 2 = -h - 6. What is the second biggest value in r, 0.4, x? 0.4 Let p = -1031.3 + 1205. Let m = 174 - p. Suppose 7y = 2y. Which is the biggest value? (a) m (b) 0.4 (c) y b Let v = -1421.6 + 1411. What is the second biggest value in v, 2, -2/3? -2/3 Let z = 17 + -20. Let r = -0.3 - -2.2. Let k = r + 0.1. Which is the second smallest value? (a) z (b) k (c) 1/6 c Suppose 0 = 32m - 37m - 680. Let z be m/777/(-3556). Let p = 1/127 + z. What is the second biggest value in -0.5, -3/2, p? -0.5 Let l = -9 - -10. Let t = 9.2 - 5. Let f = -1.2 + t. Which is the second smallest value? (a) -1 (b) l (c) f b Let r = -1697/7 - -243. What is the smallest value in 2/9, 0.3, -3, r? -3 Let c = -52.91 + 0.91. Let t = 51 + c. What is the fourth biggest value in -2/15, t, 4, -3? -3 Let o = 1.98 + 0.02. Let w = 275 - 275. Which is the second smallest value? (a) o (b) 5 (c) w a Let b be 10/(-45) - 4/((-108)/(-129)). What is the second smallest value in 2/91, 1, b? 2/91 Let i = 114.6 + -115. What is the third biggest value in i, 0.6, 1? i Let i = 10.9 + -12.9. Let j = -17 - -16. Which is the second smallest value? (a) 0 (b) i (c) j c Let w = 13.2 + -13. Suppose -15 = o + 6. Let n be (-9)/o8/(-12). What is the third smallest value in 5, n, w? 5 Let w = 3.22 - 3.02. What is the second biggest value in w, 2, 3? 2 Let s be (-1)/(-5(-21)/30). Let o be 28/(2 - -2) - 2. What is the smallest value in 0.3, s, o? s Let g be 14 - 11 - 386/(-6). Let l = g - 68. Let i = 0.6 + -5.6. What is the smallest value in 3/4, l, i? i Let b(x) = x - 7. Let m(c) = -3c + 22. Let n(y) = -17b(y) - 6m(y). Let q be n(14). What is the smallest value in -2, q, -10? -10 Suppose b + 5 = -5n - 4b, -4n = -5b - 41. Let d(k) = -k*3 + 6k*2 - 5k - 8. Let x be d(n). What is the smallest value in -3, x, -0.1? -3 Let k = 18 + -6. Let x be (1 - (k + 0))/(-1). Which is the smallest value? (a) -5 (b) x (c) -0.3 a Let a = 0.1 - 1.1. Suppose 2z = -4j + 208, 4z + 124 = -8j + 10j. Let f be -3(-4)/(-30) + j/60. What is the biggest value in a, 2/3, f? 2/3 Suppose -q - 6 = -3q. Let x be ((q - 4) + 0)17. Let h = x - -15. What is the third smallest value in 1/10, 5, h? 5 Let n = -50.9 - -55. Let z = -3.6 + n. Which is the second biggest value? (a) 2 (b) z (c) -3/11 b Let i = 161 - 809/5. Let r = -143 + 142. Which is the second biggest value? (a) i (b) 3 (c) r (d) -4 a Suppose 2 = -3p + 2p. Let d be (-3)/(-6) - ((-25)/p)/(-5). Suppose -3 = -n, 0w - 4n = 5w - 7. What is the biggest value in d, -4, w? d Let t = -16 - -15.91. Let o = -4.91 + t. Which is the second smallest value? (a) 5 (b) 4 (c) o b Let x = -0.369 + 0.569. Which is the smallest value? (a) x (b) -2/15 (c) 4 (d) 1.4 b Suppose -9 = -2o - o. Suppose 2r = r - o. Which is the third smallest value? (a) 2 (b) r (c) -2 a Let q be 4/5 + -2(0 - -1). Let o = -7/10 - q. Which is the smallest value? (a) -0.	{ "pile_set_name": "DM Mathematics" }
= 187 - 177. Calculate the highest common divisor of 250 and z. 10 Suppose 3v - 67 = 2p + 3p, 0 = 3v - 3p - 69. What is the highest common divisor of v and 96? 24 Suppose 4s + 4d - 116 = 0, -4d = -5s - d + 177. Suppose 5y + 4h = 23, -h + 0 - 4 = -2y. What is the highest common divisor of s and y? 3 Let d = -17 - 1. Let m be (-420)/d12/10. Suppose 2o = 6o - m. Calculate the greatest common divisor of o and 21. 7 Suppose -5r - 4w + 3 = -37, w - 9 = -r. Suppose -3i = y - 12, ry - i - 12 = 23. Let g be (-1 + y)60/6. What is the greatest common divisor of g and 20? 20 Let g = -1204 + 1214. Calculate the highest common factor of 130 and g. 10 Let b be -6(15/(-2) - (4 - 2)). Suppose -3f + 2l = -b, 0f + 5l - 57 = -2f. Calculate the greatest common factor of f and 14. 7 Suppose -h + 44 = -3q, -176 = -4h - 3q - 2q. What is the greatest common factor of 55 and h? 11 Let b be 266/21 + (-1)/(-3). Let l = b - 9. Suppose -j = -lj + 105. What is the highest common divisor of j and 5? 5 Let f = 438 - 404. Calculate the greatest common divisor of f and 221. 17 Let o(y) = 448y*2 + 2y + 5. Let u be o(-1). Calculate the highest common factor of u and 33. 11 Suppose 0 = 6h + 25h - 279. Let z(d) = -25d - 3. Let c be z(-3). What is the greatest common divisor of c and h? 9 Let k be 92 - 120/15. Calculate the highest common factor of k and 960. 10 Suppose r = 4p + 12, 0 = -4r - 3p - 7 - 40. Let t = r - -20. What is the highest common factor of t and 48? 12 Let x be ((-18)/1210)/(-1). Suppose p = 2b - 9, b - 3p - 21 = -2b. Suppose i = bi - 3. Calculate the greatest common factor of i and x. 3 Let l be (-15 + -5)/(-4)(-7 + 17). What is the greatest common factor of l and 850? 50 Let c(j) = -99j - 1. Let o be c(-2). Let d be -4(-12)/16 + o. Suppose 0 = 2n - 6n + d. Calculate the greatest common factor of 25 and n. 25 Let l = 33 + -15. Let z = -42 - -46. Suppose 0 = v - z - l. What is the greatest common divisor of 44 and v? 22 Let f(w) = w3 + 3w*2 + 3w + 2. Let r be f(-2). Suppose 3s + r = -12. Let b be (-15)/(-30) + (-2)/s. What is the greatest common divisor of b and 3? 1 Let f = 117 - 93. Calculate the highest common divisor of f and 1500. 12 Let r = 803 - 739. Calculate the greatest common divisor of r and 16. 16 Suppose -2x = -3 - 1. Let a be (0 + x + 2)/2. What is the greatest common divisor of a and 22? 2 Let m(t) be the first derivative of -5t2 - 1. Let i be m(-1). Let c(h) = 9h*2 - 15h - 2. Let w be c(2). Calculate the greatest common factor of w and i. 2 Suppose 17n = 21n + 116. Let i = n + 56. Calculate the highest common divisor of i and 189. 27 Suppose -2w + 50 = 3w. Suppose 13g - 17g + 240 = 0. Calculate the highest common divisor of g and w. 10 Suppose 10p = 15p + 375. Let o = -63 - p. Calculate the greatest common divisor of o and 108. 12 Let h(l) be the third derivative of 5/24l4 - 8/3l3 - l2 + 0l + 0. Let b be h(14). Calculate the greatest common factor of 18 and b. 18 Let h(w) = -w3 + w2 - w - 1. Let a be h(-2). Let q be (-13(-18)/4)/((-67)/(-134)). Calculate the highest common divisor of q and a. 13 Let t = 34 - 145. Let n = -107 - t. Calculate the highest common divisor of 28 and n. 4 Let t(o) = -10o - 174. Let i be t(-46). Calculate the highest common factor of 22 and i. 22 Let r = -426 - -660. What is the highest common divisor of 26 and r? 26 Let n be (-3)/(-15) + (-5215)/(-175). What is the greatest common divisor of 120 and n? 30 Suppose -12i + 20 = -7i. Let y be -1 - -22/i. Let r(u) = -u*2 - 2u + 50. Let w be r(y). Calculate the greatest common divisor of w and 125. 25 Let a(w) = w*3 + 15w*2 + 11w - 30. Let k be a(-14). Suppose 23 = f - 2l - 5, 3f - 3l = 69. What is the greatest common divisor of f and k? 6 Let n be ((-80)/25)/(-8)65. What is the greatest common factor of 416 and n? 26 Suppose 0 = -3j + 4i + 340, -256j + 258j - 5i - 222 = 0. Calculate the greatest common divisor of j and 261. 29 Suppose 5h = -5a + 25, 0a + h + 1 = 5a. Let q be (-1 - a) + -3 + 68. Suppose -42 = p - 2p. Calculate the greatest common factor of p and q. 21 Let a be (15/4)/(18/24). Calculate the highest common factor of 15 and a. 5 Let o be (-15)/(-5)(-7)/(-3). Let p(f) = -51f - 2. Let x(r) = -2r - 9. Let a be x(-4). Let z be p(a). Calculate the highest common factor of z and o. 7 Let s(d) = -28d + 5. Let r be s(-1). Calculate the greatest common factor of r and 3. 3 Suppose 4m = -0m + 84. Suppose 4p = 89 - m. Suppose 0 = -s + 4 + p. What is the highest common factor of s and 14? 7 Let j be (-2)/(-40) + (-2995)/(-100). What is the greatest common factor of j and 48? 6 Let l(g) = 8g*2 + 1. Let w be l(-2). Let n = w - 29. Calculate the greatest common factor of n and 1. 1 Let m = -136 - -166. Calculate the highest common factor of m and 18. 6 Let h = 228 + -172. Calculate the greatest common factor of 1400 and h. 56 Suppose 3o - 3 = 0, -5u = -u + o - 73. Suppose 4a - u = 6a. Let k(p) = -p3 - 8p*2 + 9. Let x be k(a). Calculate the greatest common factor of 10 and x. 10 Let s = 50 + -34. Let m = 91 - 87. Calculate the greatest common divisor of s and m. 4 Let j be 3 - 19/((-95)/60). Calculate the highest common divisor of 60 and j. 15 Let y = -257 - -301. Calculate the greatest common factor of 8 and y. 4 Let k be 42189/42 + (-2)/(-4). Calculate the highest common divisor of k and 15. 15 Suppose 0 = -h - 4k + 3, 3k - 25 = -9h + 5h. Suppose -f + 3 = 0, 612 = -hy + 12y + 4f. What is the greatest common divisor of 8 and y? 8 Let z(b) = 20b2. Let d be z(-1). Let l be (-34)/(-3) - d/(-30). Suppose 11m - lm = -27. What is the greatest common divisor of m and 27? 27 Suppose 30f = -9f + 2028. What is the greatest common factor of 195 and f? 13 Suppose -21s - 5670 = -42s. Calculate the greatest common divisor of 60 and s. 30 Let j be (67/2)/(136/156). Calculate the highest common factor of 268 and j. 67 Let o(q) = -q*3 - 11q*2 - 29q - 33. Let m be o(-8). Calculate the highest common factor of 1687 and m. 7 Let r be 1 + (2 - 0 - 1). Let g be r/(-6) - (-21)/9. Suppose y - 4t = -9t + 67, -2y + 142 = gt. What is the highest common divisor of y and 24? 24 Let w(f) = f*3 + 2f*2 - 2f - 5f2 + 2 - 6f*3. Let p be w(-2). Suppose 6g - 134 - p = 0. What is the greatest common factor of g and 7? 7 Suppose 76 = -3r + j + 377, -4r = -5j - 394. Calculate the greatest common factor of 1111 and r. 101 Let a(p) = -p3 + 7p*2 + 24p - 21. Let x be a(9). Let z be 1 - (42 + 0)/(-2). What is the greatest common factor of x and z? 11 Let t(c) = -c*3 + 15c*2 + 11c + 455. Let w be t(17). Calculate the highest common divisor of w and 2752. 64 Suppose -3r = -4d + 2r + 150, -2r + 4 = 0. Let h = 66 - -47. Let n = h + -53. What is the highest common factor of d and n? 20 Let n = -13 + 13. Suppose -55 = -6w + w - s, w - 4s + 10 = n. Calculate the greatest common divisor of w and 90. 10 Suppose -12 = -3f - 4o, 5f - 4o - 42 = 10. Let q = 8 + -2. Let t be 4/q + (-188)/(-6). What is the highest common factor of t and f? 8 Let c be (3 - 1 - -111) + -1. What is the highest common factor of c and 42? 14 Suppose 4a = 22 + 18. Let y be (-52)/754 + (-4356)/(-87). What is the highest common factor of a and y? 10 Let t = 42 - 40. Suppose 4 = -3q - 2, 313 = 5k + q. Suppose -5b + k = -tb. Calculate the highest common factor of b and 14. 7 Let w be 4 - 02/4. Let l = 29 - 13. Suppose l = 2o - wp - 10, 4p = o - 21. What is the highest common divisor of 45 and o? 5 Let v be 6/2 + 6/(24/220). Suppose p - 6p - 105 = 0. Let w = p + 50. Calculate the highest common divisor of v and w. 29 Let h be (-1935)/(-18) - (-3)/(-6). Suppose -h + 5 = -6t. Calculate the greatest common factor of t and 51. 17 Let a be 1/(-4) - 9/(-4). Let q be ((-9)/a)/(6/(-16)). Let u = -180 - -204. What is the greatest common factor of q and u? 12 Let z = 148 - -8. What is the greatest common factor of z and 52? 52 Suppose -5o - 10 = -115. Suppose -13 = n - o. Let m = 28 - 12. Calculate the highest common divisor of m and n. 8 Let k(n) = 4n + 7. Let h be k(-4). Let o be (-7 - 1)/(h + 7). What is the highest common factor of 20 and o? 4 Let v(s) = -2s + 63. Let p	{ "pile_set_name": "DM Mathematics" }
4d5 + (4d5 + d5 - 3d5)(0 - 1 + 0). 3d5 - 2d - 1 Expand (5 + 1 - 1)(-2l*2 + 2l2 + l2 + (-2l + 4l - 4l)(-5l + 4l + 3l) - 2l*2 + 4l2 - l2 - 2l2 + l2 + 2l*2). -5l*2 Expand (-2p - 3p - 2p)(-3p*4 + 0p4 + p4) + 2p5 - 4p5 + p5. 13p5 Expand ((-2p*2 + 0p2 + p2)(-5 + 3 + 0) - 3p*2 + 0p2 - p2)(2p + 6p - 3p)(2p + p*2 - 2p). -10p5 Expand (3 - 3 - 1)(0o + 3o - 4o)(3o + 3o - 5o). o2 Expand (3i + i - 7i)(0 - 1 + 3) + (0i + 0i + i)(6 - 3 - 2). -5i Expand (-1 + 0 + 0)(-29d*5 - 149d*4 + 149d*4). 29d*5 Expand (0i - 5i - i)(2i2 - 3i*2 + 2i*2)(1 - 1 + 1). -6i3 Expand 0l + 0l - l + (1 + 4 - 4)(-l - l + l) + 4 - 4 + l. -l Expand (35s - 64s + 28s + 58s)(-6 + 1 + 2). -171s Expand (-1 - 2 + 1)(-2t*3 - 2t + 2t)(145 + 27t - 145). 108t*4 Expand (8t*2 + 2 + t - 4t*2 - 1)(-2t - t + t). -8t*3 - 2t*2 - 2t Expand (-f - 2f + 6f)(4 + 78f + 8 - 12). 234f2 Expand (-3i - 2i + 6i)(4i - 6i + 1 - 3i). -5i2 + i Expand -3v2 + v2 - 5v2 + (0v + 0v + v)(-2 + 2 + 2v) + 2v2 - v2 - 4v2. -8v*2 Expand (-5i*3 + 3i*3 + 4i*3)(-3i - 4i - 3i). -20i*4 Expand (-4 + 1 + 5)(2g + 0g - 4g) - 44 - 2g + 44. -6g Expand (-8r*4 - 2r*4 - 5r*4)(5 - 1 - 2)(-3 + 3 + 1). -30r*4 Expand (-p + 4p - p - 2)((0 + 4 - 5)(-2p + p + 2p) + p + 0p + p) + 2 - 4p*2 - 2. -2p*2 - 2p Expand -3 + 0n + n + 5 + 3n + 0 + 0 - 2 - 2n + 2 - 2n - n + 0n + (2 - n - 2)(1 - 1 + 1) - 2n - 3 + 3 - 3n + 5n - 3n - 5 + 5 + 2n. -3n + 2 Expand (-4 + 0 + 0)(-t + 3t*2 + t). -12t*2 Expand 2j*2 - 2j*2 + 2j*3 + (4j*2 + 14 - 14)(3j + 0j - j). 10j3 Expand 2a5 - a4 + a*4 + (2a*2 - 8a*2 + 4a*2)(-3a3 + 3a*3 - 3a*3). 8a*5 Expand (-5t - 5t + 16t)((2t - t + t)(-2 - 2t + 2) - t2 - t2 + 5t2). -6t*3 Expand (-6a*3 + 4a*3 + 3a*3 + 2a*2 - 2a2 + a3 + (0a3 - 2a*3 + 3a*3)(2 - 1 + 1) - 4a + 4a + 2a3 - 7931 + 7931 + 19a*3)(2 + 1 - 4). -25a3 Expand (2x*5 - 2x5 + x5)(-1 - 4 + 0) + 2x*5 + 0x5 - x5. -4x5 Expand (j - 4j + 2j)(4j2 - 5j*2 + 5j*2) + (-j + 0j + 2j)(j*2 + 0j*2 - 5 - 3j*2). -6j*3 - 5j Expand (5 - 4 + 2)(-6 - 7b + 6). -21b Expand ((1 + 2 - 5)(0 + 0 + 2) + 0 - 3 + 1)(-3o - 2o2 + 3o). 12o2 Expand (2 - 2 - 1)(-19s2 - 22s*2 + 14s*2) + (4s*2 - 3s*2 + 0s*2)(3 - 5 + 0). 25s2 Expand (-3k*3 + 4k*3 + 0k*3)(-5 + k + 5)(3k - 4k - 5k). -6k5 Expand (17 + 20f - 17)(5 - 3 + 0). 40f Expand (-1 + 5 - 2)(d + 6 + 1 - 5). 2d + 4 Expand (5r + 2r - 4r)(0 - 2 + 3 + (2 + 0 - 1)(-4 + 5 + 1) - 5 + 3 + 0)(0r + r + 0r). 3r2 Expand (2l + 2 - 2)(-5l*4 + 4l*4 + 2l*4) + (-16l*4 - 15l*4 + 0l*4)(-2l + l + 3l). -60l5 Expand (0o2 - o2 + 3o2)(0 - 2o + 0) + (-3o*2 + 5o*2 - 3o*2)(-3o + 5o - o) + o*3 + 3o*3 - 5o*3. -6o*3 Expand -9f + 9f + f2 - 3f*2 + 2f - 2f + (f + 3 - 3)(2 - 2f - 2). -4f*2 Expand ((-3b2 - b2 + 2b2)(1 - 1 + 1) - 2b2 - 4 + 4)(-1 + 1 - 1). 4b2 Expand ((1 + 2 - 4)(-3o - 8o - 17o) - 2o + o + 3o)(2 - 2 - o). -30o2 Expand -t4 - t4 + 3t4 + (-t + t2 + t)(-t + t2 + t) - 2t*4 + 2t4 + t4 - 5t4 - t4 - 4t*4. -7t*4 Expand (-6 + 3 + 2)(2v2 - 4v*2 + 3v*2) + 5v*2 + 2v*2 + 3v*2. 9v2 Expand (-m2 + 5m2 + 2m*2 + (4 + 3 - 6)(-4m2 - 2m*2 + 3m*2))(0 + 5 - 2). 9m2 Expand (-6l*5 + 0l*5 + 4l*5)(4 - 5 + 2 - 1 + 2 + 0 + 6 - 4 + 0 + (-2 + 0 + 0)(-1 + 1 - 1) - 2 - 1 + 1)(-4 - 1 + 3). 16l5 Expand (-29u*3 + 4u*2 - 4u*2)(4 + 0 - 2). -58u3 Expand 0v*5 + 3v*5 - 2v*5 + (2v*3 - 2v*3 - 13v*3)(0v2 - v2 + 3v*2). -25v5 Expand 0 + 0 - i3 + (1 - 3 + 1)(3i - 3i + i3) + 3i*3 + 3i*2 + 3i*3 - 7i*3. -3i*3 + 3i*2 Expand -2m5 - m5 + 2m5 + (-44 + 44 - 2m)(0m2 + m4 + 0m2). -3m*5 Expand ((-2 + 2 - 2)(a2 + a2 - a*2) - 3a*2 - 2a*2 + 4a*2)(6a - 6a + 11a3). -33a5 Expand -a4 + a4 + a4 - 5a4 - 2a4 + a4 - a*4 - 2 + 2 + (-2a + 4 - 4)(-4a*3 + 3a*3 + 0a*3) + 2a*4 + 0a*4 + 0a*4. -2a*4 Expand (-1 + 0 - 2)(-2i - 3i + 4i). 3i Expand (3o2 - 4o*2 + 0o*2)(-3o + o - 5o + (2 - 2 - 3o)(-3 + 4 + 1)). 13o3 Expand (21q + 8q - 38q)(5q + q - 4q). -18q2 Expand -g3 - g*3 + 7g3 + g3 - 4g3 + 0g*3 + (-5g + g + 3g)(-3 + 3 - 2g2) - 8g*3 - 3g + 3g. -4g*3 Expand ((x - 2x + 3x)(4 - 4 - x) - 2x2 - 4x + 4x)(3x3 - 1 + 4 - 2). -12x*5 - 4x*2 Expand (-2p*3 + 2p3 + p3)(p + 3p - 5p) + 2 - 2 + 6p*4. 5p*4 Expand (3h - 4h - h)(-3 - 4 + 4)(1 - 2 + 6). 30h Expand (4 - 1 - 2)(7 - 7 + 2a). 2a Expand 3 - 3 + 2p*2 + (3 - 3 - 2)(-4p2 + 5p*2 - 3p*2) + 0p*2 + 3p*2 + 0p*2 + (0p2 + p2 - 2p2)(-6 + 5 - 2). 12p2 Expand ((5 - 3 - 1)(-3 + 4 - 3) + 3 + 0 - 2)(81 - 5c - 81). 5c Expand (2p - 2p - 2p)(4 + 1 + 5). -20p Expand -3m2 + m3 + 3m*2 + (2 - m - 2)(-6m - 2m*2 + 6m). 3m3 Expand (s - 2s + 2s)(-3s + 107s*3 + 5s - 108s3 - 5s2). -s4 - 5s3 + 2s*2 Expand (2n*2 - 2n*2 + 2n*2)(-1 + 3n + 1) - 2n*3 - 2n*3 + 2n*3 + (-n + 0n + 0n)(-n2 + n2 + n*2). 3n*3 Expand 0c*5 - 6c*5 + 5c*5 + 2c + (-2c - c2 + 2c)(c3 - c + c) - c4 + c4 - 3c*5. -5c*5 + 2c Expand (4 - j*2 - 4)(-3j - 1 + 1) + (0j*3 + 0j*3 - 2j*3)(-2 - 1 + 1) - j3 + j3 + j*3. 8j*3 Expand (-3386 + 11s + 3386)(-1 + 2 + 0). 11s Expand -w*4 + 3w*4 + 0w*4 + 5w*3 - 2w2 + w4 + 2w2 - 4w*4 + 2w*4 + 4w*4 + (0w*2 + 0w*2 + 2w*3)(2w + 2w - 6w). w4 + 5w*3 Expand -209a*4 + 8a + 17a - 25a + (a*3 + 0a*2 + 0a*2)(0a - 4a + 5a). -208a*4 Expand (-4 + 7 + 5)(2 - 2 + 1)(-z + 0z + 0z). -8z Expand z2 - z2 - 3z4 + (0z2 - z2 + 2z2)(-12 + 12 + 8z2) - 4z3 + z4 + 4z3. 6z*4 Expand (-42g*4 - 2g + 41g4 + 0 - 3)(4g - 5g - g). 2g5 + 4g*2 + 6g Expand (-171 - 26s + 171)(2s2 - 1 + 1) - 3 + s3 + 3. -51s*3 Expand (1 + 1 + 0)(-2v2 + 2v*2 + 2v*2) + 0v + 0v2 + 2v*2 + 2v. 6v2 + 2v Expand (1 + 0 - 2)(0y*2 + 3y*2 - 2y*2)(9y3 - 3y*3 + 7y*3). -13y*5 Expand (5 - 3 - 4)(2z - 7z + 3z)(4 - 1 + 4). 28z Expand (-2u + 2u + u)(-4409 + 4409 - 67u). -67u*2 Expand (1 - 2w - 1)(0w*4 + 0w4 - w4) - w*5 + 3w*3 - 3w*3 + (-2w*2 + 1 - 1)(-2w + 2w - 2w3). 5w*5 Expand -60 + 3i*5 + 60 + (2 - 2 - i)(5i4 - 3i*4 + 0i4). i5 Expand (1 + 1 - 1)(2o + 3o - 3o)(1 + 0 + 1 + (2 - 4 + 4)(1 + 0 + 0) + 1 - 5 + 5 + 2 + 1 - 1 + 3 + 4 - 2). 24o Expand -l3 - 2l*3 + 4l*3 + (-1 + 2 - 3)(-7l + l - 9l)(0l*2 - 2l*2 + 3l*2). 31l*3 Expand 0 - 2a2 + 0 + (-a + a + a2)(-2 + 2 - 1) - 2a*2 + 0a*2 - 4a2 + a2 + 0 + 4 - 5. -8a2 - 1 Expand (-s - 4s + 0s)((2s + s - 5s)(0 - 2 + 0) + 2s - 2s - 2s + 4s + 3s - 6s). -15s*2 Expand 9 - 15x - 9 - 2x2 + (5x - 3x - x)(2x - 2x - 2x). -4x*2 - 15x Expand (2z3 + 0z*2 + 0z*2)(1 - 4 + 5) + 2z3 - 3z*3 + 3z*3. 6z*3 Expand (-1 + 1 - 2c)(-83c*2 + 83c2 + c3). -2c4 Expand (0 + 3 - 6)(2a - a - 3a)(-a - a - 2a)(2a - 2a + a2). -24a*4 Expand (-6 + 3 - 1)(-1 - 2s + 1)(-1 + 4 - 2) + 2s + s + 0s. 11s Expand (0k*2 - 3k*2 + 4k*2)(1 - 2 + 3)(-2k + k - k). -4k3 Expand (q3 - q2 + q2)(-3q2 - 2q + 2q) + 2q*5 - q + q + 37q*2 + 11q*3 - 37q*2 - 3q*5. -4q*5 + 11q*3 Expand (2q - 8q2 - 2q)(2q*2 + 0q + 0q). -16q*4 Expand (-2 + 0 + 3)(-5 + 5 + k) + 2k + k - 5k. -k Expand (-3r3 + 5r*3 - 3r*3)(5r + 3r*2 - 3r - 11r2)(-3 + 1 + 3). 8r5 - 2r*4 Expand (0l2 + l2 + 0l2)(4 - 3 + 0 + (-3 + 3 + 1)(-3 - 1 + 2) - 6 + 3 + 16). 12l*2 Expand -8j + 2j - 2j + (-3j + 6j - 2j)(3 + 1 - 2) + j - 4j + 2j - 1 + j + 1. -6j Expand (4 + m - 4)(2m + m - m)(2 - 6 - 6) - m*2 - 1 + 1 + (1 + 0 - 2)(-2m2 + 3 - 3). -19m**2 Expand (3 - 2 - b - 2	{ "pile_set_name": "DM Mathematics" }
(sqrt(147) + 1)-5. -42sqrt(3) - 5 Simplify sqrt(24)/(sqrt(12) + sqrt(192)) - sqrt(216)/sqrt(12). -14sqrt(2)/5 Simplify (sqrt(28)/sqrt(4) + -3 + -3)2 + 5. -12sqrt(7) + 48 Simplify (sqrt(252)-2 + -4)2 + (sqrt(567) - (0 + sqrt(567) + sqrt(567)))2 + 5. 96sqrt(7) + 1596 Simplify -5 + (sqrt(10)/sqrt(2)-1 - sqrt(400)/sqrt(5)). -5sqrt(5) - 5 Simplify (sqrt(110)-56)/sqrt(10). -30sqrt(11) Simplify (sqrt(272) + 2)6 + -4. 8 + 24sqrt(17) Simplify -1 + ((sqrt(72) + 1sqrt(72))/sqrt(4))*2. 71 Simplify 6-3sqrt(20). -36sqrt(5) Simplify 0 + sqrt(325) + sqrt(325)-2. -5sqrt(13) Simplify sqrt(88)/sqrt(11) - (sqrt(22)2 - sqrt(22))/sqrt(11). sqrt(2) Simplify sqrt(720)-11. -12sqrt(5) Simplify (sqrt(48) - (sqrt(192) + ((-2sqrt(192) - sqrt(192)) + sqrt(192) - sqrt(192)))/sqrt(4))-6. -72sqrt(3) Simplify ((sqrt(1400)2 - sqrt(1400)) + sqrt(1400) - sqrt(1400))/sqrt(2). 10sqrt(7) Simplify (0 + -4 + 0 + sqrt(7))-3. -3sqrt(7) + 12 Simplify (sqrt(1053) - -42sqrt(1053) - sqrt(1053))2. 67392 Simplify (3sqrt(190))/sqrt(10) + (5 + -1sqrt(19))2. -7sqrt(19) + 44 Simplify 5(sqrt(119)-2)/sqrt(7). -10sqrt(17) Simplify sqrt(117) + 2 + -5. -3 + 3sqrt(13) Simplify sqrt(2) + 0 + -5 - (0 + sqrt(2) + 2). -7 Simplify (((sqrt(260) + (sqrt(260) + (sqrt(260)-2 - sqrt(260)) + sqrt(260) + sqrt(260))-2 - sqrt(260)) + sqrt(260))/(sqrt(5)-12))*2. 13 Simplify (sqrt(17) + sqrt(17)-1)3 - (3 + sqrt(17)-1). -3 + sqrt(17) Simplify 3(sqrt(25)/(sqrt(10)/sqrt(2)))252. 150 Simplify ((sqrt(170) + sqrt(170) + sqrt(170) + 2sqrt(170) + sqrt(170) - sqrt(170))/sqrt(10) + (sqrt(136)1)/sqrt(8))2. 612 Simplify (5 + -4 + sqrt(288) + sqrt(288)-1 + sqrt(288) + 0)*2. 24sqrt(2) + 289 Simplify ((sqrt(2)2 + 2)5)*2. 200sqrt(2) + 300 Simplify sqrt(28)/(-1sqrt(324)). -sqrt(7)/9 Simplify 0 + (sqrt(5) - sqrt(30)/sqrt(6)) - sqrt(5) - sqrt(50)/sqrt(490). -8sqrt(5)/7 Simplify 2(1 + sqrt(637))2. 28sqrt(13) + 1276 Simplify ((-2sqrt(35))/sqrt(7) + sqrt(5))3. -3sqrt(5) Simplify 1(0 + sqrt(1872)) + sqrt(1872). 24sqrt(13) Simplify sqrt(52)/sqrt(4) + sqrt(13) + -3 + 4. 1 + 2sqrt(13) Simplify (sqrt(133) - (1sqrt(133) - sqrt(133))5)/sqrt(7). sqrt(19) Simplify (3 + (sqrt(2016) - sqrt(2016)2)/sqrt(8))2. -36sqrt(7) + 261 Simplify sqrt(170)/(sqrt(360) - (sqrt(360)-5 + sqrt(360))). sqrt(17)/30 Simplify (sqrt(1440)1 - sqrt(10))/(sqrt(18)/(sqrt(45)/sqrt(5) + sqrt(9))). 22sqrt(5) Simplify (sqrt(153)2)*2 + -4. 608 Simplify 1((sqrt(1584) + sqrt(1584) + 0 + 0)4)2. 101376 Simplify (3((sqrt(1375) - sqrt(1375)1) + sqrt(1375) - sqrt(55))/sqrt(11))2. 720 Simplify ((sqrt(180)2)*2 - (sqrt(45) + 0))-3. -2160 + 9sqrt(5) Simplify 1(sqrt(95)/sqrt(5) + sqrt(19)) + (-4(sqrt(19) - sqrt(304))2 - sqrt(19)) + -5. -689 + sqrt(19) Simplify sqrt(19) + (sqrt(76) + 4)2 + sqrt(2736) + 1. 93 + 29sqrt(19) Simplify (sqrt(110)/(sqrt(10)-2) - sqrt(99)1)*2. 539/4 Simplify (sqrt(18)-3)/sqrt(9) - -1sqrt(98). 4sqrt(2) Simplify (-4sqrt(60))/(sqrt(288)/sqrt(6)). -2sqrt(5) Simplify (-3sqrt(567)1)*2 - (-4 + sqrt(567) + -1). -9sqrt(7) + 5108 Simplify (((sqrt(102)3)/sqrt(6) - sqrt(17)) + sqrt(17) + sqrt(17))3. 12sqrt(17) Simplify (((1sqrt(1900) - sqrt(1900))-5 - sqrt(1900)-2-6) + 3)2. -720sqrt(19) + 273609 Simplify (sqrt(187) + -1(sqrt(187) + (sqrt(187) + (sqrt(187)1 - sqrt(187)) - sqrt(187) - sqrt(187))))/((sqrt(11)1 + sqrt(11))-5). -sqrt(17)/10 Simplify sqrt(171)12 - (-3 + (-2sqrt(171) - sqrt(171)))2. -1548 - 48sqrt(19) Simplify (sqrt(126)/(sqrt(4)/sqrt(2)))/(3(sqrt(36)/sqrt(4) - sqrt(9)) - sqrt(9)). -sqrt(7) Simplify sqrt(21)/(sqrt(3) + (sqrt(18)1)/sqrt(6)). sqrt(7)/2 Simplify (sqrt(99)-2 - sqrt(99))/sqrt(9)1. -3sqrt(11) Simplify sqrt(7) - (sqrt(7) + 5 + (sqrt(35)/sqrt(5))2) - sqrt(7) - ((sqrt(7) - sqrt(112)) + 1). -13 + 2sqrt(7) Simplify ((sqrt(75) - (2(sqrt(75) + 1 + sqrt(75)) - sqrt(75))) + sqrt(75) - (2sqrt(75)-1 - sqrt(75)))2. -40sqrt(3) + 304 Simplify 2sqrt(76) - sqrt(19) - (sqrt(19) + (-1sqrt(1900) + sqrt(1900) - sqrt(1900))). 12sqrt(19) Simplify (1(sqrt(204) - (sqrt(204) + 2sqrt(204) - sqrt(204)) - sqrt(204)))/(sqrt(48)/sqrt(4)-3) + 1. 1 + 2sqrt(17)/3 Simplify -4(sqrt(396) + (sqrt(396) + sqrt(396)2)2 + sqrt(396)). -14256 - 48sqrt(11) Simplify (sqrt(10)/(sqrt(200)2))2. 1/80 Simplify ((sqrt(14) - -4sqrt(14)-1) + sqrt(14))/(sqrt(63)/sqrt(36)). -4sqrt(2) Simplify sqrt(171) + (1sqrt(171)1)*2. 3sqrt(19) + 171 Simplify -1(-4sqrt(110))/sqrt(10) + 4. 4 + 4sqrt(11) Simplify (-3 + (sqrt(19) - -2sqrt(19)) - (sqrt(19) - (1sqrt(19))2)3) + 3. 57 Simplify (3sqrt(152)2)/sqrt(8). 6sqrt(19) Simplify (sqrt(85)/(sqrt(20)/sqrt(4)6))*2 - (2sqrt(17) + 0 - (0 + sqrt(17))-5). -7sqrt(17) + 17/36 Simplify 4 + ((sqrt(385) + -2sqrt(385) + sqrt(385))/sqrt(7))/sqrt(11). 4 Simplify (-1 + sqrt(448))2 + 3. -16sqrt(7) + 452 Simplify ((sqrt(17) - (sqrt(2448) + -1)) + -3sqrt(1700))2. -82sqrt(17) + 28578 Simplify 5(sqrt(52) - (sqrt(52) + -1)). 5 Simplify (5 + 1sqrt(405) + sqrt(405))*2 + 55sqrt(15)/sqrt(3). 205sqrt(5) + 1645 Simplify (sqrt(350)/(sqrt(7) - (sqrt(7) + sqrt(112))) + sqrt(50))/sqrt(10). 3sqrt(5)/4 Simplify -5-2sqrt(2) + sqrt(2) - sqrt(16)/(sqrt(24)/sqrt(3)). 10sqrt(2) Simplify sqrt(108) + (3 + sqrt(108)4)2 + -1. 150sqrt(3) + 1736 Simplify (sqrt(228)-3)/(sqrt(3) - sqrt(30)/sqrt(360)). -36sqrt(19)/5 Simplify sqrt(27)/(sqrt(9) - sqrt(576)-1). sqrt(3)/9 Simplify ((sqrt(378)2)/sqrt(6))/(6sqrt(144)) + -3. -3 + sqrt(7)/12 Simplify (-4 + (5sqrt(143)-4)/sqrt(11))2. 160sqrt(13) + 5216 Simplify (sqrt(96)-3)/sqrt(2). -12sqrt(3) Simplify sqrt(4)/(sqrt(2)-2) - (sqrt(12) + sqrt(192))/sqrt(6) - sqrt(16)/(sqrt(160)/sqrt(5)). -6sqrt(2) Simplify -1 + -2sqrt(832)5 + 2sqrt(832) + sqrt(832) + -5. -56sqrt(13) - 6 Simplify (-2 + sqrt(17) + -3)*21. -10sqrt(17) + 42 Simplify ((sqrt(30)3-2 - sqrt(30))/(sqrt(10) + -3sqrt(10)1))2. 147/4 Simplify (sqrt(2) + sqrt(288) + 0 + sqrt(2))3. 42sqrt(2) Simplify ((sqrt(240)/sqrt(6) + sqrt(40))3)/(sqrt(8) - (sqrt(200) + (sqrt(200) + -3sqrt(200) + sqrt(200) + sqrt(200) - sqrt(200)) + sqrt(200))). -3sqrt(5)/2 Simplify 3 + ((sqrt(1053) + 0 + sqrt(1053) - sqrt(1053))-5 - sqrt(1053)). -54sqrt(13) + 3 Simplify (-3sqrt(325) + -1 + -4)2. 150sqrt(13) + 2950 Simplify sqrt(2448) + (sqrt(2448) + 3sqrt(2448)2 + sqrt(2448))*2. 12sqrt(17) + 156672 Simplify -1 + sqrt(245) - (sqrt(40)/sqrt(4))/sqrt(2). -1 + 6sqrt(5) Simplify 3 + ((sqrt(280) - ((sqrt(280)2 - sqrt(280)) + sqrt(280) + sqrt(280)))-6 + sqrt(280))/sqrt(10). 3 + 26sqrt(7) Simplify (-4(2sqrt(5)1 - 2sqrt(720)))*2. 38720 Simplify (5 + -3 + sqrt(833))5. 10 + 35sqrt(17) Simplify (sqrt(52)/sqrt(64) + 3)2. 3sqrt(13)/2 + 157/16 Simplify (sqrt(14) - (sqrt(112) - sqrt(112)-1)/sqrt(8) - sqrt(14))/(sqrt(6)/(sqrt(3)2)). -4sqrt(7) Simplify (sqrt(1050)/sqrt(6) + sqrt(1008)3)*2. 11767 Simplify -3(sqrt(153) + sqrt(153)-2 + sqrt(153)) + 5. 5 Simplify (sqrt(528)/((1sqrt(96))/sqrt(8)))*2. 44 Simplify -1sqrt(171) + -1. -3sqrt(19) - 1 Simplify -4 + ((sqrt(343) + 3 + sqrt(343))2)*2. 336sqrt(7) + 5520 Simplify (3(sqrt(80)1 + -4))*2. -288sqrt(5) + 864 Simplify (-3(sqrt(343) + -1))2 + 1. -126sqrt(7) + 3097 Simplify (sqrt(65)-2)/sqrt(5) + (sqrt(13) + 1)-5. -7sqrt(13) - 5 Simplify (4 + -1 + sqrt(245))6. 18 + 42sqrt(5) Simplify -4(-1sqrt(343) + -3) + 4. 16 + 28sqrt(7) Simplify (sqrt(1377) - (sqrt(1377) + 0))*2 + 5(sqrt(17) - sqrt(272)) - (sqrt(425) - (2sqrt(425) + 4)2). 60sqrt(17) + 1716 Simplify 2 + (sqrt(567) + -1 + 0)*2 + 3. -18sqrt(7) + 573 Simplify ((sqrt(684) + -2 + sqrt(684))4)2-6. -263040 + 4608sqrt(19) Simplify 3sqrt(2) + -1 - (((2sqrt(6) + sqrt(6))/sqrt(3))2 + sqrt(2)). -19 + 2sqrt(2) Simplify 4 + -3 + (sqrt(75))*2. 76 Simplify 1 + sqrt(7) + 0 + -1 + sqrt(700). 11sqrt(7) Simplify (-2sqrt(500) - sqrt(500))2 - sqrt(500)-1 - (2sqrt(180) + 4)2. -86sqrt(5) + 3764 Simplify ((-1sqrt(76) - sqrt(76))1)*2. 304 Simplify (5 + ((sqrt(448) - (sqrt(448) + sqrt(448)-4))/sqrt(8))/sqrt(8))*2. 40sqrt(7) + 137 Simplify 1 + sqrt(432) + -5. -4 + 12sqrt(3) Simplify (0 + sqrt(17) + 2 + sqrt(17))2 - (sqrt(17) + -1sqrt(17)2)2. 8sqrt(17) + 55 Simplify	{ "pile_set_name": "DM Mathematics" }
inder when w(-2) is divided by 18. 16 What is the remainder when 3 + -2 - (-56 + -5) is divided by 9? 8 Suppose 2d - 3c - 57 = 0, -3d - 2c + 128 = 2c. What is the remainder when 107 is divided by d? 35 Calculate the remainder when (-137)/(-4) + 6/8 is divided by 12. 11 Let a be ((-1)/2)/((-3)/270). Suppose -a = -2z - z. Calculate the remainder when 43 is divided by z. 13 Let j be 2/(32/(-31) - -1). What is the remainder when (-1 - j) + 6/(-2) is divided by 15? 13 Let d(l) = l + 23. Calculate the remainder when d(-8) is divided by 4. 3 Suppose -4u + w + 2w = 115, 2w = -4u - 90. Let h = u + 44. Suppose 0y = -4y + 148. What is the remainder when y is divided by h? 18 Let u(j) = 24j2 + 3j + 8. What is the remainder when u(3) is divided by 39? 38 Let f(h) = -2h + 5. Calculate the remainder when 15 is divided by f(-2). 6 Suppose -4x + 32 = -0x. Let l(r) = r2 - 8r - 6. What is the remainder when l(10) is divided by x? 6 Suppose -30 = -5q - 10. Suppose 3i - 7 = 11. Let z = i - q. What is the remainder when z is divided by 2? 0 Let h(f) = f*2 + 6f - 2. Let v be h(-7). Suppose 4s + 69 = va, -a = -6a + 2s + 77. What is the remainder when 31 is divided by a? 14 Let k = -1 + 6. Suppose 32 = ka - 13. Suppose g = 22 + 11. What is the remainder when g is divided by a? 6 Suppose 0 = -5p, -5b + b - 5p + 28 = 0. Calculate the remainder when 30 is divided by b. 2 Suppose 3j = 42 - 12. Let c = j - 16. What is the remainder when 10 is divided by 1/(-3) + (-26)/c? 2 Let c be 0/(-2) - -1 - -1. Suppose 4h = 2s + 188, -ch + 3h - 54 = 4s. What is the remainder when h is divided by 12? 10 Let o(h) be the first derivative of -3h - 1/2h*2 - 2. Calculate the remainder when 7 is divided by o(-7). 3 Let p = -5 - -3. Let i(o) = -6o - 2. Calculate the remainder when 17 is divided by i(p). 7 Let y = 23 - -27. What is the remainder when y is divided by 17? 16 Let s(a) = -a + 16. What is the remainder when 75 is divided by s(-22)? 37 Calculate the remainder when (-2 - (4 + -8))/(2/74) is divided by 1/(-3) - (-58)/3. 17 Let z(r) = -3 + 7 + r - 3r + 0. What is the remainder when 49 is divided by z(-3)? 9 Suppose -2y = -4y + 90. Let d = 26 + -14. Calculate the remainder when y is divided by d. 9 Let a = 44 - 18. Calculate the remainder when a is divided by 27/(-15)(-2 - 3). 8 Let w(g) = 21g - 34. What is the remainder when 84 is divided by w(3)? 26 Calculate the remainder when 0 + (-4)/2 + 62 is divided by 31. 29 Let k(z) be the third derivative of z4/24 - 2z3/3 + z2. Let g be k(0). Calculate the remainder when (-66)/g - 1/(-2) is divided by 9. 8 Let k be 23/(-6) - -116. Suppose 0 = -3s - 5h + k, 3s + 3h - 118 = h. What is the remainder when s is divided by 14? 12 Let v(l) = -l2 - 9l - 12. Let x be v(-8). Suppose -5r + 87 = 2u, 3r = 4r + 1. Let m = x + u. Calculate the remainder when m is divided by 22. 20 Let y be ((-26)/6)/((-2)/6). Suppose 5t - y = -3r, -8 = r - 5t + 1. Let b(k) = k2 + 9k - 9. Calculate the remainder when r is divided by b(-10). 0 Let t(q) = -q*2 + 2q + 6. Let v be t(-3). Let p(b) be the third derivative of -b4/24 + b3/6 - 2b2. What is the remainder when p(v) is divided by 6? 4 Suppose -3k = -k - 66. Let l(t) = 18t2 + t. What is the remainder when k is divided by l(-1)? 16 Suppose 0 = s + 4c + 9, 0s + 3 = -2s - 5c. Let v = 55 + -48. Calculate the remainder when s is divided by v. 4 Suppose -76t + 141 = -73t. What is the remainder when t is divided by 17? 13 Let x = -9 - 14. What is the remainder when 44 is divided by x/((-3)/62)? 21 Suppose -3 = 4k + 4a - 7, 4a = 8. Let u = 1 + 2. What is the remainder when (-3)/(-2)2 - k is divided by u? 1 Let x = 20 - 11. Suppose -5o = -4o - x. Calculate the remainder when 15 is divided by o. 6 Let w(t) = t - 14. Let h be w(12). Calculate the remainder when 76 is divided by -261/h2. 24 Suppose 0 = 4o - 4b - 44, -4 = -2o - b + 21. Let v = o - 7. Suppose 3c + 4d = 14, -c - d + 0d + v = 0. What is the remainder when 16 is divided by c? 4 Let s(i) = 2i2 + 10i + 7. Let g(w) = -1. Let k(y) = 4g(y) + s(y). What is the remainder when k(-7) is divided by 17? 14 Let a(w) = w2 - 9w - 3. Calculate the remainder when a(11) is divided by 10. 9 Suppose 7h - 2h = 2w + 93, 20 = -5w. What is the remainder when 63 is divided by h? 12 Suppose -f = 2u - 23, -5u + f - 3f + 59 = 0. What is the remainder when u is divided by 3? 1 What is the remainder when 24 is divided by 0/(-4) - -114? 10 What is the remainder when 70 is divided by 0 - ((-48)/(-4))/(-2)? 4 Let x be 4/(-12)-3 + -1. Let a = -2 - -4. Suppose x - 10 = -af. Calculate the remainder when f is divided by 3. 2 Let l(o) = o + 7. Let w be l(-5). Suppose 3z = wz + 144. Suppose -8i = -4i - z. Calculate the remainder when i is divided by 19. 17 Let o = -10 + 13. Suppose -oq = -7q + 132. What is the remainder when q is divided by 7? 5 Let b(p) be the third derivative of -4p2 + 0p - 1/60p5 - 1/120p*6 + 7/2p*3 - 1/24p*4 + 0. Calculate the remainder when b(0) is divided by 11. 10 Suppose -2k = -2c - 24, 0k + 39 = 2k + 3c. Suppose 2i - 4 - 4 = 0. Calculate the remainder when k is divided by i. 3 Suppose s = -d + 7 + 11, 5s + 2d = 81. What is the remainder when s/(42/8) is divided by 4? 3 Let q(a) = 2a2 + 2a - 1. Let x be 2/(-4) + (-15)/(-6). What is the remainder when 19 is divided by q(x)? 8 Let a(z) = z*3 - 12z*2 + z + 8. What is the remainder when 97 is divided by a(12)? 17 Suppose 4r = 3r - 20. Suppose -w - 5l - 65 = -6w, -23 = -2w + 5l. Calculate the remainder when w is divided by r/(-6)3/2. 4 Calculate the remainder when (59/(-3))/(4/(-12)) is divided by 32. 27 Let q(s) = 18s2 - s - 1. What is the remainder when q(-1) is divided by 10? 8 Calculate the remainder when 57 is divided by (-1)/(-2) + (-11)/(-2). 3 Let q = 11 - -15. Suppose -f + x = -q, 0f - 4x - 38 = -f. What is the remainder when 41 is divided by f? 19 Let z(s) be the first derivative of s4/4 - 5s*3/3 + 3s*2 + 4s + 1. What is the remainder when z(6) is divided by 26? 24 Let q = 6 - 6. Suppose -3w - 6 = -2b, b + qw - 17 = -2w. Let d = -17 - -33. Calculate the remainder when d is divided by b. 7 Suppose 129 = 4a - a. Let q(n) = n2 + 13n + 1. What is the remainder when a is divided by q(-14)? 13 Suppose 0 = -2j - 9 - 1. Let w = 0 - j. What is the remainder when w is divided by 3? 2 Let j = 12 - 7. Suppose -3l - 5k + 2k = 6, -jl + 2k = -25. Calculate the remainder when 53 is divided by (0 + l)(-98)/(-21). 11 Suppose -3d = -6d + 12. Let k be 6/(-1) + (2 - -1). Let v = k + d. What is the remainder when 1 is divided by v? 0 Let f be (-2)/5-5 - -27. Suppose 2t - 67 = -3k, -f = -4t - 3k + 108. Calculate the remainder when t is divided by 9. 8 Suppose 4c + x + 0x = 284, -92 = -c + 5x. Calculate the remainder when c is divided by 15. 12 Let h(t) = 8t3 - t2 + t - 1. Let n be h(1). Let m = n + 1. What is the remainder when 15 is divided by m? 7 Let f = 88 - 54. Calculate the remainder when f is divided by 18. 16 Let i = 128 + -35. Calculate the remainder when i is divided by 24. 21 Suppose 21 = b + 4u, -2b - 4u + 95 = b. Let f = b + -18. Calculate the remainder when 55 is divided by f. 17 Suppose 2 = 2l + 10. Calculate the remainder when (l/(-3))/(2/33) is divided by 12. 10 Suppose -2p + 0p + 48 = -4f, 2f = -4p + 96. Suppose -j = 2u - 101, -4j - p = -4. What is the remainder when u is divided by 14? 11 Let l(b) = -b2 + 5b + 4. Let s be l(5). Suppose -5 + 193 = sp. Calculate the remainder when p is divided by 16. 15 Suppose -23 = -5d + 72. What is the remainder when 55 is divided by d? 17 Let j(p) = -p*2 - 10p + 9. What is the remainder when 73 is divided by j(-8)? 23 Let c = -4 - -9. Suppose -5 = 5d, ci - 9d + 4d = 25. Suppose 0 = ih - 3y - 64, 4h + 2y = h + 65. Calculate the remainder when 36 is divided by h. 17 Let z = -18 + 38. What is the remainder when z is divided by 8? 4 Suppose 180 = 6d + 3d. What is the remainder when d is divided by (-2)/214/(-2)? 6 Suppose 3w - 2 = 31. What is the remainder when w is divided by (-12)/2(-2)/4? 2 Let v be (3 - 1) + (-4)/(-1). Suppose 2q - q + 4*p + v = 0, 0 = -q	{ "pile_set_name": "DM Mathematics" }
sqrt(17) + 18526 Simplify (-4 + sqrt(1377) + -1)*2 + -2 + ((-1 + sqrt(1377))2 - (sqrt(1377)-1 + 4)). -63sqrt(17) + 1394 Simplify (-2(sqrt(7200) + 2sqrt(7200)))/((5sqrt(120))/sqrt(3)). -36sqrt(5)/5 Simplify 5 + ((sqrt(21) + sqrt(21)5 + sqrt(21) + sqrt(21))/sqrt(3) + sqrt(343) + -3)2. -90sqrt(7) + 1589 Simplify -1 + (sqrt(110) + sqrt(110) + sqrt(110) + -63sqrt(110))/(sqrt(160)-1). -1 + 15sqrt(11)/4 Simplify ((-3(sqrt(1008) + sqrt(1008)-2) - 5(sqrt(1008) + sqrt(1008) + sqrt(1008) + -2))2)*2. -11520sqrt(7) + 581008 Simplify (((sqrt(468) + 1 + sqrt(468) + -1)*2 - sqrt(468))5 - (sqrt(468) + 0 + -3 + 2))-1. -9361 + 36sqrt(13) Simplify -3 + ((sqrt(500) - (sqrt(500) + 0 - sqrt(500))) + sqrt(605)-1)-5. -3 + 5sqrt(5) Simplify -1(-2 + sqrt(8) - (sqrt(2) + -5sqrt(162))). -46sqrt(2) + 2 Simplify (sqrt(12)/(sqrt(28)/sqrt(175)) - (2 + sqrt(75))1)2 + 0 + -1. 3 Simplify 2((-5 + (sqrt(605) + -1)-15)6)2. 1089000 Simplify ((sqrt(7) + sqrt(42)/sqrt(96))-1 - (-3 + 2sqrt(28)))2-5. -16155/16 + 315sqrt(7)/2 Simplify -3 + ((-41sqrt(18))/((sqrt(54) + sqrt(54)1)/sqrt(9) - sqrt(6)))*244. 765 Simplify 4 + (0 + 1sqrt(162)1)2 + -5. 161 Simplify (((1 + sqrt(396) - sqrt(55)/sqrt(5)4) + (-4-3sqrt(66))/sqrt(6))-5)2. 700sqrt(11) + 53925 Simplify ((sqrt(12)/sqrt(4)-4 - sqrt(3))-4-1 - (sqrt(243)-6)/(sqrt(108)/(-1sqrt(12))))2. 4332 Simplify (-3(sqrt(77)-2 - sqrt(77)) - 5sqrt(77)2)/((sqrt(896)-3)/sqrt(8)). sqrt(11)/12 Simplify (-64-3sqrt(65))/((sqrt(45) - -2sqrt(45))-3). -8sqrt(13)/3 Simplify sqrt(882) + 1 + 2 - (-12sqrt(72) - sqrt(72))/sqrt(4). 3 + 30sqrt(2) Simplify -2 + (sqrt(22)/(sqrt(72)1) - (-2sqrt(77)-1)/sqrt(7))*2. 1259/36 Simplify 4 + ((-4 + sqrt(99))5 - (4 + 2sqrt(99))). -20 + 9sqrt(11) Simplify sqrt(128) + (sqrt(128)-2 + 5)2 + (1sqrt(4)/sqrt(2))*2 + 3. -152sqrt(2) + 542 Simplify (sqrt(180)/(sqrt(30)/sqrt(3)))/(-5sqrt(486)). -sqrt(3)/45 Simplify (-2sqrt(1300)-3 + -2 + 1sqrt(1300) + 1)*2. -140sqrt(13) + 63701 Simplify (-4((sqrt(121) - sqrt(121)1 - sqrt(121)) + sqrt(121) - sqrt(121))-6)/(sqrt(176)4). -3sqrt(11)/2 Simplify 3((sqrt(208) + 2 + sqrt(208) + 5)2-2)*25. 26880sqrt(13) + 211440 Simplify 1 + (-5(sqrt(75) - sqrt(3)) - sqrt(36)/(sqrt(12)-1 - sqrt(12)))6-4. 1 + 468sqrt(3) Simplify (22sqrt(190))/(sqrt(10) + (4sqrt(1000) - sqrt(10)) + sqrt(10)). 4sqrt(19)/41 Simplify -5(5(sqrt(90)/sqrt(2))/sqrt(9))*2 + (-1sqrt(180)-15)*2. 3875 Simplify (-3-5sqrt(684)-245 + -3)*2. 21600sqrt(19) + 246240009 Simplify (-2sqrt(931)-1)*2 + (sqrt(931) - sqrt(931)1) + -5 + (sqrt(19) - sqrt(171)). -2sqrt(19) + 3719 Simplify 5 + (5-3sqrt(275) + -3)2. 450sqrt(11) + 61889 Simplify (3(sqrt(76) - (sqrt(76) + 2sqrt(76) - sqrt(76))))/(sqrt(4) + (-4sqrt(4)-4 + sqrt(4) - sqrt(4))). -3sqrt(19)/17 Simplify (-4sqrt(816) + (2sqrt(153))/sqrt(3))/((2sqrt(363) - sqrt(363))1). -14sqrt(17)/11 Simplify (sqrt(120)/(sqrt(24)/sqrt(3)) - (sqrt(15) + (sqrt(150)-1)/sqrt(10)))/(-2(sqrt(75) + (sqrt(75) - sqrt(75)-1) + sqrt(75))). -sqrt(5)/40 Simplify 4 + (-4 + ((-2sqrt(275))*2-5 - sqrt(275)))-3. 15sqrt(11) + 16516 Simplify ((-1 + sqrt(275))4 - -4(1sqrt(275))2)-5 + -2. -5482 - 100sqrt(11) Simplify ((6(sqrt(210) - (sqrt(210) + 2sqrt(210))))/sqrt(10))/(3((sqrt(567)4 - sqrt(7)) + sqrt(7))). -sqrt(3)/9 Simplify (((-2sqrt(240) + sqrt(240))/sqrt(8))/(-2sqrt(24)/sqrt(4))1 + -4)*2 + 5. -4sqrt(5) + 89/4 Simplify -2(-6sqrt(228)1)/(sqrt(36)/(sqrt(9)/sqrt(3)) + sqrt(12) + sqrt(12)) + 4. 4 + 4sqrt(19) Simplify ((-1sqrt(612) + 4)2 - sqrt(612)) + (1 + 2sqrt(833))*2. -26sqrt(17) + 3961 Simplify 5 + sqrt(288) + -2sqrt(2)4-3. 5 + 36sqrt(2) Simplify -2(sqrt(800) - sqrt(2))5-3. 570sqrt(2) Simplify ((2(sqrt(3630)-4 - sqrt(3630)))/(-3(sqrt(360)-3 - sqrt(360))))*2. 3025/432 Simplify -1 + (sqrt(88)-25 - sqrt(88))/((sqrt(132) - (2sqrt(132) - sqrt(132))-4)/sqrt(12)). -22sqrt(2)/5 - 1 Simplify 2sqrt(931)1 + -4 - (5sqrt(931)-1 - (-1 + sqrt(931) + 0))*2. -33521 + 98sqrt(19) Simplify -5((sqrt(77) - (sqrt(77) - 6(sqrt(77) + sqrt(77)4))) + sqrt(77) + sqrt(77))/(-1(sqrt(11) + (sqrt(77)/sqrt(7) - sqrt(11))) - sqrt(11)). 80sqrt(7) Simplify ((-6(sqrt(208) + 0)-1)2 + 2((sqrt(208)1)2 + sqrt(208)) + (-1 + sqrt(208))-3)-6. -47442 + 24sqrt(13) Simplify 0 + -4 + (sqrt(700)-3-6-6 + -3)2. 6480sqrt(7) + 8164805 Simplify (6-1sqrt(108) - sqrt(108))/(1sqrt(99)/(-1sqrt(11))). 14sqrt(3) Simplify 2 + -2(sqrt(81) - 4sqrt(81)2)/sqrt(3) + 3. 5 + 42sqrt(3) Simplify (sqrt(19) + 2sqrt(1216) - sqrt(1216)-2)2 - (2sqrt(513))/(sqrt(3) + sqrt(528)/sqrt(11) + sqrt(3)). -sqrt(19) + 20691 Simplify (5 + 0 + sqrt(11) - (sqrt(44)/sqrt(4) + -5))*2 - (4sqrt(99) + -3). -12sqrt(11) + 103 Simplify sqrt(18) + 6sqrt(162)/sqrt(9) - (4 + sqrt(1800))*2. -1816 - 219sqrt(2) Simplify (-2sqrt(88)1 - sqrt(88))/((sqrt(64)-2 - sqrt(64))/sqrt(8) - sqrt(8)) - -2(sqrt(176) - -31sqrt(176))*2. 3sqrt(11)/4 + 5632 Simplify -4(sqrt(245)-2 + 3) + -3 + (sqrt(245) - (sqrt(245) + 0 - sqrt(245)))2 + (-4 + -1 + sqrt(245))2 + 4. -14sqrt(5) + 504 Simplify (-3 + sqrt(468)2)*2 + 1 + 1 + sqrt(637) + 5. -65sqrt(13) + 1888 Simplify ((2sqrt(165)1 - sqrt(165))/sqrt(3))/(sqrt(704) + (-6sqrt(704)2 - sqrt(704)) + sqrt(704)). -sqrt(5)/88 Simplify (-2sqrt(171)-6 - (sqrt(171) + -2sqrt(171) + sqrt(171))4)/(sqrt(729)1-5). -4sqrt(19)/15 Simplify -42(sqrt(931) + -1 + 1sqrt(931) + 4 + -1 + sqrt(931) + sqrt(931))*2. -119200 - 896sqrt(19) Simplify -1 + (-1 + 1sqrt(832)26)2 + 4. -192sqrt(13) + 119812 Simplify 1(-1sqrt(128) + 0) - (sqrt(128) + 3 + sqrt(128))-24. 24 + 120sqrt(2) Simplify (-3 + (-2 + sqrt(11) + (sqrt(11) - ((sqrt(275) - sqrt(11)) + -2 - sqrt(11))))-4 + 5)*2. 16sqrt(11) + 180 Simplify ((-4(-5 + (sqrt(684) + sqrt(684) + 2 - sqrt(684) - sqrt(684))))2 + 0)-56. -4320 Simplify 2-3(-6(sqrt(833) + 1 - sqrt(833)) + -1)*26. -1764 Simplify (sqrt(15) + (1sqrt(120))/sqrt(8))/(-5-2sqrt(5)) - (-1 + sqrt(12) + (sqrt(108) - (sqrt(108) + 1))2). -9sqrt(3)/5 Simplify -2 + ((sqrt(19) - (sqrt(19) + sqrt(19)26) - sqrt(19) - (sqrt(57)/sqrt(3) + -5))6)2. -5040sqrt(19) + 134962 Simplify sqrt(55)/(sqrt(110)/(sqrt(20)/sqrt(2))) + 5 - (sqrt(5) + sqrt(720) + 1 + sqrt(125)5). -37sqrt(5) + 4 Simplify (-1sqrt(242)-2 + ((2sqrt(242) - sqrt(242)) + 2)2)-42. -1968 - 528sqrt(2) Simplify (sqrt(40)/sqrt(2)-4)/(-6sqrt(1210)). 2sqrt(2)/33 Simplify (-4(1 + (sqrt(65) - sqrt(65)-26)/(sqrt(125)-2))1)*2. -208sqrt(13)/5 + 9188/25 Simplify -5 + (2sqrt(833)2 - (-1 + (sqrt(833) - (sqrt(833) + -1sqrt(833)) - sqrt(833)) - sqrt(833))). -4 + 35sqrt(17) Simplify ((((sqrt(72) - -2sqrt(72)) + sqrt(72))-1)/(sqrt(18)/sqrt(3)5 + (sqrt(24) - (sqrt(24) - sqrt(96)/sqrt(4))))4)*2. 3072/49 Simplify ((4-3sqrt(77))/(5sqrt(539) + sqrt(539)))2. 4/7 Simplify (1 + sqrt(252)/sqrt(4))2 + sqrt(336)/(sqrt(36)/sqrt(3)) + -2. 8sqrt(7) + 62 Simplify ((-4(1 + sqrt(180)) + sqrt(180) + -5(sqrt(180) + 1))2 - (0 + 0 + sqrt(180) - (-1 + sqrt(180)2))*2) + 3. 876sqrt(5) + 11423 Simplify (3(sqrt(152) + (sqrt(152) - (sqrt(152) - (sqrt(152) - sqrt(152)1 - sqrt(152))))))/(1-2sqrt(8)) + 5 + 1. 6 Simplify (4 + (sqrt(180) + 1sqrt(180))2 - (-6(sqrt(180) - sqrt(180)2) + sqrt(180)))4. -168sqrt(5) + 2896 Simplify (sqrt(52) + -2 + sqrt(52) + 0)2 + -3 + (11sqrt(520))/sqrt(10). -14sqrt(13) + 209 Simplify (0 + sqrt(171)1 + -3 + (sqrt(95)2)/sqrt(5))*2. -30sqrt(19) + 484 Simplify 0 + 3 + (0 + (sqrt(98) + 1)-4)2. 224sqrt(2) + 1587 Simplify 5((5 + 2sqrt(637))-6)25-6. -13894200 - 756000sqrt(13) Simplify ((sqrt(76)-4 + sqrt(76))-5 + -1 + sqrt(76) + -4)*2. -320sqrt(19) + 19481 Simplify (2sqrt(39) + sqrt(39))/sqrt(3) + (sqrt(832) + 0 - sqrt(832)) + 1 - ((sqrt(156)-1 + sqrt(156))2)/(sqrt(36)/sqrt(3)3). 1 + 3sqrt(13) Simplify (((sqrt(136) - (sqrt(136) + sqrt(136)5))-1)/(4sqrt(8)-2) + -2)2. 5sqrt(17)/2 + 681/64 Simplify (((sqrt(140) + sqrt(140)3)/sqrt(7))/sqrt(4) + sqrt(50)/(sqrt(360)1))*24. 3125/9 Simplify ((sqrt(448) + -2)-3 - sqrt(448)-2-1) + 0. -40sqrt(7) + 6 Simplify (((3 + ((2 + sqrt(1584))2 - sqrt(1584)))-2 + 0	{ "pile_set_name": "DM Mathematics" }
letters picked without replacement from {b: 4, x: 7}. Give prob of sequence xbxb. 7/110 Calculate prob of sequence gxgz when four letters picked without replacement from kcggvxzv. 1/840 Three letters picked without replacement from {p: 2, r: 3, o: 1, q: 1, m: 7, k: 3}. What is prob of sequence pqo? 1/2040 Four letters picked without replacement from awwviniziaiiii. What is prob of sequence iziv? 1/572 What is prob of sequence ewte when four letters picked without replacement from ptewewtttetptwpepee? 15/2584 Two letters picked without replacement from {d: 2, h: 4, o: 9, g: 4}. Give prob of sequence oh. 2/19 Two letters picked without replacement from {b: 1, f: 6, g: 2, e: 6, n: 2}. What is prob of sequence fb? 3/136 Three letters picked without replacement from {w: 3, x: 2}. Give prob of sequence xwx. 1/10 Two letters picked without replacement from {z: 1, e: 1, n: 3, w: 1, j: 1}. Give prob of sequence zw. 1/42 Two letters picked without replacement from {a: 1, m: 9, v: 1, q: 2, x: 4}. What is prob of sequence xm? 9/68 What is prob of sequence zzz when three letters picked without replacement from {z: 13, w: 3}? 143/280 What is prob of sequence mk when two letters picked without replacement from {m: 5, k: 1, p: 10, w: 1}? 5/272 Two letters picked without replacement from {h: 3, q: 6, e: 2, c: 2}. Give prob of sequence eh. 1/26 Three letters picked without replacement from iiiigiiiiiiiiiiiiiii. Give prob of sequence iii. 17/20 Two letters picked without replacement from bzzzzzzzzzzz. What is prob of sequence bz? 1/12 Calculate prob of sequence uu when two letters picked without replacement from nppuu. 1/10 What is prob of sequence lnny when four letters picked without replacement from lnnnylllnlnlnnlnnnl? 5/646 Four letters picked without replacement from {a: 1, s: 3, o: 1}. What is prob of sequence saao? 0 Four letters picked without replacement from hhhiihhi. What is prob of sequence hihi? 1/14 Four letters picked without replacement from {w: 2, q: 2, r: 2}. What is prob of sequence wqwq? 1/90 Calculate prob of sequence aa when two letters picked without replacement from {n: 2, a: 2, x: 5, h: 11}. 1/190 What is prob of sequence ff when two letters picked without replacement from {z: 1, q: 1, w: 2, y: 2, f: 2, i: 1}? 1/36 What is prob of sequence udd when three letters picked without replacement from {y: 2, u: 8, d: 8}? 14/153 Calculate prob of sequence rc when two letters picked without replacement from crrcrcrcrcrrrrrccccc. 5/19 Three letters picked without replacement from ppjpjwt. Give prob of sequence jtw. 1/105 Four letters picked without replacement from cccccvccccccc. Give prob of sequence cccc. 9/13 Three letters picked without replacement from yayamaamamaayapaama. Give prob of sequence mpm. 2/969 Calculate prob of sequence ao when two letters picked without replacement from {v: 5, a: 4, o: 5, l: 1, j: 3}. 10/153 Three letters picked without replacement from {w: 7, n: 12}. What is prob of sequence nww? 28/323 What is prob of sequence mcec when four letters picked without replacement from {e: 12, m: 2, c: 3}? 3/1190 What is prob of sequence mmxx when four letters picked without replacement from {w: 6, m: 3, x: 4}? 3/715 Four letters picked without replacement from bavjjip. What is prob of sequence pjbj? 1/420 Three letters picked without replacement from {g: 4, s: 3, a: 6, q: 1}. What is prob of sequence ags? 3/91 What is prob of sequence uyoy when four letters picked without replacement from qqoquuqquymquoyq? 1/2730 Four letters picked without replacement from kqfqfggkggq. Give prob of sequence gffk. 1/495 What is prob of sequence mnn when three letters picked without replacement from ssssssmsnnssnsmsnsns? 1/171 Calculate prob of sequence ku when two letters picked without replacement from {u: 5, c: 5, k: 1}. 1/22 Calculate prob of sequence bfcc when four letters picked without replacement from cbacf. 1/60 What is prob of sequence qqmm when four letters picked without replacement from qqqmqmqqqqq? 1/55 What is prob of sequence ec when two letters picked without replacement from {l: 4, c: 3, p: 2, h: 6, e: 3}? 1/34 What is prob of sequence zii when three letters picked without replacement from {m: 1, p: 1, z: 3, i: 2}? 1/35 Three letters picked without replacement from {k: 5, l: 1, y: 3}. What is prob of sequence yyk? 5/84 Two letters picked without replacement from {a: 1, z: 3, r: 1}. Give prob of sequence za. 3/20 What is prob of sequence ll when two letters picked without replacement from lplplzlcxxlrrpr? 2/21 Three letters picked without replacement from {o: 2, e: 2, b: 4, g: 2}. Give prob of sequence bge. 1/45 Calculate prob of sequence wwai when four letters picked without replacement from {a: 8, i: 4, w: 5}. 4/357 Calculate prob of sequence ww when two letters picked without replacement from {w: 8, k: 6, g: 3}. 7/34 Four letters picked without replacement from atrbgrbgbgrtf. Give prob of sequence tagt. 1/2860 Three letters picked without replacement from {s: 3, a: 1, l: 1, t: 2, b: 3}. What is prob of sequence tab? 1/120 What is prob of sequence ooo when three letters picked without replacement from oooo? 1 Two letters picked without replacement from {b: 2, i: 5}. What is prob of sequence bi? 5/21 Two letters picked without replacement from {p: 9, u: 9}. Give prob of sequence uu. 4/17 What is prob of sequence rryr when four letters picked without replacement from ryyyrrryrryy? 2/33 Calculate prob of sequence yzpk when four letters picked without replacement from {y: 2, p: 4, h: 7, z: 2, k: 2}. 1/1785 Three letters picked without replacement from wnwllwnlwlw. What is prob of sequence lln? 4/165 What is prob of sequence cs when two letters picked without replacement from {c: 1, s: 19}? 1/20 What is prob of sequence gw when two letters picked without replacement from {j: 3, g: 1, f: 3, w: 5}? 5/132 Three letters picked without replacement from eaaaaeaaaaaaae. Give prob of sequence eaa. 55/364 What is prob of sequence ttt when three letters picked without replacement from ttttttttt? 1 Four letters picked without replacement from hyyyyhyyhyhyyyyhyh. Give prob of sequence hhyy. 11/204 Calculate prob of sequence eebf when four letters picked without replacement from fbfneefbf. 1/189 Two letters picked without replacement from iipgiggggvggigggvgg. What is prob of sequence vv? 1/171 What is prob of sequence gjxm when four letters picked without replacement from gjmggmgggmmgmxxg? 1/546 Calculate prob of sequence plla when four letters picked without replacement from anaaldlpdllll. 3/572 Calculate prob of sequence wwn when three letters picked without replacement from {i: 3, g: 1, n: 6, w: 5, b: 5}. 1/57 Calculate prob of sequence guzy when four letters picked without replacement from uzjujjjjuggyuygjgzuj. 2/2907 What is prob of sequence gtpf when four letters picked without replacement from {f: 7, t: 3, e: 7, p: 1, g: 1}? 7/31008 Calculate prob of sequence vbb when three letters picked without replacement from {o: 11, l: 3, v: 3, b: 2}. 1/969 What is prob of sequence wpp when three letters picked without replacement from wpspsppspswppwssppv? 12/323 Calculate prob of sequence qkcw when four letters picked without replacement from {q: 3, w: 4, c: 1, i: 1, e: 1, k: 2}. 1/495 Three letters picked without replacement from {f: 1, l: 3, x: 3, p: 2, n: 1}. What is prob of sequence flf? 0 Calculate prob of sequence rjr when three letters picked without replacement from {r: 2, j: 7}. 1/36 Two letters picked without replacement from vuvvuxvkpkkkuvuv. What is prob of sequence kp? 1/60 What is prob of sequence shsh when four letters picked without replacement from {a: 5, l: 1, h: 2, s: 1}? 0 What is prob of sequence di when two letters picked without replacement from {d: 6, i: 4}? 4/15 What is prob of sequence zo when two letters picked without replacement from {z: 1, o: 1, a: 1, w: 2, n: 5, d: 3}? 1/156 Three letters picked without replacement from {m: 5, f: 2, e: 4, z: 4}. What is prob of sequence mzz? 2/91 Three letters picked without replacement from zsszikisbszkzizzi. What is prob of sequence kki? 1/510 What is prob of sequence xxxc when four letters picked without replacement from {c: 1, x: 14}? 1/15 Three letters picked without replacemen	{ "pile_set_name": "DM Mathematics" }
z + 7. Let s(w) = 5w - 4. Calculate -4o(b) - 5s(b). -b Let t(h) = 2h*2 - 5h + 5. Let w(u) = -2u2 + 4u - 4. Let x be 382/(-16) + (-1)/4. Calculate xw(d) - 4t(d). 2d*2 Let l(v) = 4v*3 - 6v*2 + 2v + 7. Suppose -2r + 5 - 1 = 0. Suppose 0 = ru - 17 - 5. Let p(f) = 7f3 - 11f*2 + 4f + 13. Calculate ul(q) - 6p(q). 2q3 - 2q - 1 Let v(q) = 15q + 1. Let y(b) = -29b - 2. Determine 5v(c) + 3y(c). -12c - 1 Let z(o) = o2 - o. Let b(a) = -27a*2 - 3a - 1. What is -b(j) + 3z(j)? 30j*2 + 1 Let j(w) = -5w - 20. Let d(a) = -3a - 13. Let z(o) = o3 - 8o*2 + 15o + 5. Let v be z(5). Calculate vj(b) - 8d(b). -b + 4 Let c(q) = -5q2 + 2q + 2. Let z(t) = 14t2 - 7t - 7. Give -7c(y) - 2z(y). 7y2 Let w(a) = 3a + 9a - 3a + 0a - 4. Let p(s) = 5s - 2. What is 5p(z) - 3w(z)? -2z + 2 Let q(c) = 5c*2 + 2c + 3. Let a(v) = -25v2 - 10v - 15. Calculate -2a(x) - 11q(x). -5x2 - 2x - 3 Let x(i) = 7i2 - 7i - 1. Let c(z) = 8z2 - 8z - 2. What is 5c(j) - 6x(j)? -2j2 + 2j - 4 Let c be 4(0 - (-6)/(-4)). Let f(h) = 2h*2 + h - 6. Let v(q) = -4q*2 - 2q + 11. Give cv(a) - 11f(a). 2a2 + a Let t(y) = 4y*2 - 6y. Let z(n) = -3n2 + 5n. Calculate 5t(j) + 6z(j). 2j2 Let l = -15 + 19. Suppose -o + l = -1. Let i(m) = 9m - 7. Let y(t) = -4t + 3. Calculate oy(u) + 2i(u). -2u + 1 Let z(j) = -1 + 2 + 0j + 0j - 2j. Let x(f) = 3f - 2. Let y(a) = 3a - 2. Let t(r) = 5x(r) - 6y(r). Give -3t(m) + 5z(m). -m - 1 Let v(l) = -l3 + 9l*2 + 5l - 3. Suppose 0 = 4z - 3 + 23. Let w(t) = t3 - 5t*2 - 3t + 2. Determine zw(g) - 3v(g). -2g3 - 2g*2 - 1 Let m(z) = -2z*2 + z + 5. Let i(g) be the second derivative of 0 - 2g + 1/3g3 - 1/4g*4 + 4g*2. What is 5i(x) - 8m(x)? x2 + 2x Let a(h) = -10h3 + 2h + 1. Let w(c) = -c*3 - c + 1. Calculate -a(z) + w(z). 9z*3 - 3z Let f(a) = -3a3 + a2 + a + 6. Let w(m) = -9m*3 + 3m*2 + 3m + 17. Give 17f(j) - 6w(j). 3j3 - j2 - j Let u(o) = -2o - 92. Let p(t) = t + 46. Determine -10p(y) - 4u(y). -2y - 92 Let m(s) = -s - 2. Let h(f) = 3f + 5. Suppose -2u + 8u = -24. Give uh(x) - 9m(x). -3x - 2 Let u(o) = -o + 1. Let n(m) = 7m - 10. Calculate -n(s) - 6u(s). -s + 4 Let v(q) = -21q*2 + 5q + 5. Let d(r) = 62r2 - 16r - 16. Give -5d(x) - 16v(x). 26x2 Let i(f) = f + 7. Let x(z) = -z3 - 8z*2 + 21z + 14. Let k be x(-10). Let w(j) = k + 0 - 3. Calculate -i(c) + 6w(c). -c - 1 Let k(g) = g2 + 61g + 59g - 2 - 125g. Let r(c) = -c. Determine -k(n) + 4r(n). -n2 + n + 2 Let o(v) = -v - 10. Let u be o(-6). Suppose 2r + 0r = 0. Let y(w) = rw*2 - 6w*2 + 6w + w2 + 4. Let h(f) = f2 - f - 1. Determine uh(g) - y(g). g2 - 2g Let p(a) = -6a + 11. Let u = -33 + 11. Let c(m) = m - 2. Determine uc(f) - 4p(f). 2f Let x(t) = -t*3 - t. Suppose -4z + 3r = -z + 6, 0 = 2r. Let b(u) = -4u3 - 5u. Calculate zb(d) + 10x(d). -2d3 Let o(t) be the first derivative of 2t*2 - 5t + 1. Let l(n) = -n + 1. Give 5l(s) + o(s). -s Let m(u) = -2u*3 + 5u*2 + 5u - 5. Let d(o) = 2o3 - 6o*2 - 6o + 6. Suppose 5k + 0 + 5 = -4r, -17 = 4r + k. Calculate rd(n) - 6m(n). 2n*3 Let j(h) = 41h*3 + 11h*2 + 21h - 6. Let b(p) = -8p3 - 2p*2 - 4p + 1. Give 11b(i) + 2j(i). -6i3 - 2i - 1 Let z(h) = -h + 1. Let q(x) = 14x - 9. Let s(l) = q(l) + 6z(l). Let w(u) = -9u + 3. Give 7s(f) + 6w(f). 2f - 3 Let w(z) = -14z2 + 2z + 8. Let a(d) = -5d2 + d + 3. Suppose 22 = f + 14. Determine fa(l) - 3w(l). 2l*2 + 2l Let b(g) = -8g + 4. Let m(r) = 9r - 5. Let q(c) = -4c2 + 18c - 3. Let l be q(4). Calculate lb(d) + 4m(d). -4d Let t = -552 - -573. Let j(d) = 33d. Let i(u) = -1. Let r(a) = -2a + 9. Let h(w) = -36i(w) - 4r(w). Determine th(b) - 5j(b). 3b Let n(o) = 6o + 4. Let f(r) = r. Let y(p) = 3p - 1. Let i(s) = 5f(s) - y(s). Let l = -1 + 3. Determine ln(d) - 7i(d). -2d + 1 Let y(x) be the second derivative of x*3 + 4x2 - x. Let o(b) be the third derivative of b4/12 + b3/2 + b2. Let i = 11 + -3. What is io(n) - 3y(n)? -2n Suppose 3w + 4 = 10. Let n(y) = -y - 1. Let j be n(w). Let c(h) = 2h3 + 2h*2 - 3h + 1. Let g(a) = 2a3 + 2a*2 - 4a + 1. What is jg(p) + 4c(p)? 2p3 + 2p*2 + 1 Suppose 3y - 11 = 2y - 3m, 3y - 4m = -19. Let r be (2 + y)/((-1)/6). Let b(i) = -5i2 - 4i + 8. Let v(g) = 4g2 + 3g - 7. What is rb(s) - 7v(s)? 2s2 + 3s + 1 Let w(m) = -7m + 9. Let o = 5 - 2. Let c(z) = -4z + 5. Let v(n) = -n*3 - 4n*2 - 5. Let r be v(-4). Give ow(h) + rc(h). -h + 2 Suppose -4u + 9u = 5. Let c(a) = 7 - 2a + a - 2. Let k(b) = -b + 1. Give uc(f) - 3k(f). 2f + 2 Suppose -1 = 2n + b, 4n - 3b + 8 = 1. Let j(l) = -l*2 + 6l - 3. Let s be j(6). Let a(d) = -2d + 1. Let r(t) = 2 - 3 + t + 0. Determine na(c) + sr(c). -c + 2 Let s(n) = -9n + 6. Let g(a) be the first derivative of a*2/2 - a - 21. Suppose 0 = 5l + 4b + 15 + 3, 0 = -5l + 2b - 36. Calculate lg(w) - s(w). 3w Let g = 29/69 - 2/23. Let q(c) be the second derivative of 2c*2 + 0 - 2c - gc3. Let b(s) = -1. Determine 5b(m) + q(m). -2m - 1 Let t(x) = -x2 - x. Let w(v) = v2 - 3. Let d(f) = f2 - 1. Let c(j) = 3d(j) - w(j). Give -c(r) - 3t(r). r2 + 3r Let w(t) = t2 + t - 7. Let u(n) = n. Let q(l) = -l2 + l + 8. Let v(x) = q(x) - 2u(x). Determine -6v(f) - 7w(f). -f2 - f + 1 Let w(o) = -8o - 5. Let a(z) = z + 1. Let m be (-39)/(-13)(4 + -2). What is ma(g) + w(g)? -2g + 1 Suppose -z = -k - 6z - 10, 3z - 2 = k. Let a(o) = -o2. Let h(n) = 0n*2 + 7n*3 + 6n*3 + 5n*2 - 18n*3 + 4n*3. Calculate ka(g) - h(g). g*3 Let y(s) = s + 1. Let v(r) = -r - 2. Calculate v(a) + 4y(a). 3a + 2 Let b(v) = v3 + v2 + v - 1. Let m(p) = p3 + 8p*2 + 8p - 7. Determine 14b(d) - 2m(d). 12d3 - 2d*2 - 2d Let l(z) = -13z2 - 7z + 9. Let i(d) = 7d2 + 4d - 5. Let f(m) = 2m3 - 15m*2 - 10m + 5. Let o be f(8). Determine oi(u) - 6l(u). u*2 - 2u + 1 Let s(f) = 7f2 + 6f - 6. Let m(i) = 7i2 + 5i - 5. Determine 6m(w) - 5s(w). 7w2 Let f(p) = -75p*3 + 4p + 4. Let n(t) = 6674t3 - 355t - 355. What is 355f(v) + 4n(v)? 71v3 Let j(z) = 5z*3 + 67z*2 + 3z. Let d(s) = -2s3 - 22s*2 - s. Calculate -11d(y) - 4j(y). 2y*3 - 26y*2 - y Let v(m) = -100m*2 - 2m. Let l(y) = -67y2 - y. Calculate 8l(k) - 5v(k). -36k*2 + 2k Let x(h) = -2h2 - 4h - 3. Let n(t) = t*2 + 3t + 2. Let u(a) = a*2 + 3a + 2. Let s(m) = -3n(m) + 4u(m). Determine 3s(j) + 2x(j). -j*2 + j Let z(h) = 3h*2 - 5h - 5. Let u(n) = -3n2 + 5n + 5. Let v(w) = 2u(w) + 3z(w). Let l(y) = -y - 1. What is 5l(x) - v(x)? -3x*2 Let w(u) = 12u + 16. Let q(j) = -j - 1. Let g(p) = 42q(p) + 3w(p). Let f(o) = 7o - 7. Calculate -4f(d) - 5g(d). 2d - 2 Let i(g) = -9g + 12. Let u(a) = 19a - 25. Determine 13i(h) + 6u(h). -3h + 6 Let n(q) = -2q. Suppose -2z + 15 = 3z. Let c(w) = -8w + 4. Let a(m) = -23m + 11. Let y = 19 - 8. Let b(j) = yc(j) - 4a(j). What is zb(h) + 7n(h)? -2h Let f be 4/14 + 5/7. Let g(x) = -3 + 0 + 2x + x*2 - 2 + 7. Let h(v) = -1. Calculate fg(b) + 4h(b). b2 + 2b - 2 Let q(z) = 17z2 - 8z - 11. Let k(a) = -8a2 + 4a + 5. Give -7k(p) - 3q(p). 5p2 - 4p - 2 Let i(k) = -10k + 2. Let c(f) = -f + 1. Determine -2c(d) + i(d). -8d Let o(k) = -k - 1. Let v(w) = -w2 + 8w + 5. Suppose -4q + 0b = 2b + 26, 2q + 11 = b. Let g(m) = m + 7. Let i be g(q). Calculate iv(j) + 6o(j). -j*2 + 2j - 1 Let o(k) = 2k2 - 5k + 1. Let m(b) = -5b2 + 14b - 3. Suppose 0 = 6s - 2s + 8. Let y be 11 - (4/s + 2). Give yo(x) + 4m(x). 2x2 + x - 1 Let p(c) = -c - 2. Let h(d) = 7d - 5. Let j(z) = z - 1. Let g = 8 - 7. Let r(o) = gh(o) - 6j(o). What is -p(f) - 2r(f)? -f Let j(h) = 13h*2 - 10h - 3. Let n(b) = -9b2 + 7b + 2. Calculate -5j(t) - 7n(t). -2t2 + t + 1 Let c(q) = -4q + 6. Let z(n) = -2n + 3. Calculate 2c(t) - 5z(t). 2t - 3 Let r(s) be the first derivative of -s4/4 - s3/3 - s*2/2 - s + 1. Let b(h) = -4h*3 - 5h*2 - 5h - 5. Suppose 0k = 4k - 8. Calculate kb(n) - 10r(n). 2n3 Let i(f) = f2 + 1. Let j(l) = 42l**2 + 28	{ "pile_set_name": "DM Mathematics" }
3. -21sqrt(19) + 148 Simplify (sqrt(125) + (sqrt(125) + -2sqrt(125))-2 + 3 - (sqrt(60)/(sqrt(12)2) + sqrt(60)/(sqrt(72)/sqrt(6))))*2. 81sqrt(5) + 3681/4 Simplify ((sqrt(448)/sqrt(8))/sqrt(8) + -1 + sqrt(112))-2-6. -12 + 60sqrt(7) Simplify 3 + (-2sqrt(162)/sqrt(6))/(sqrt(9) + sqrt(9) + 4sqrt(99)/sqrt(11) - sqrt(9)). -2sqrt(3)/5 + 3 Simplify ((sqrt(15)-2)/sqrt(3) - sqrt(5))2 + sqrt(320)2 + sqrt(5) + 0 + 3. 17sqrt(5) + 48 Simplify sqrt(17) + -1 + 5 + (sqrt(68)2)2 + (sqrt(17) + sqrt(17) + -1 + 3 - (sqrt(272))2-5). 3sqrt(17) + 1638 Simplify (sqrt(405)3)/sqrt(9) + 1 + sqrt(5) + 5 + (sqrt(150)/sqrt(3))/sqrt(10). 6 + 11sqrt(5) Simplify 4 + (((1 + sqrt(1900) + 0)*2 - sqrt(1900)) + -5)1. 10sqrt(19) + 1900 Simplify 5 + (-2 + 4sqrt(192) + 1)*2. -64sqrt(3) + 3078 Simplify (((sqrt(490) + (2sqrt(490) + sqrt(490) - sqrt(490)))/sqrt(10) - sqrt(49))/sqrt(7) - sqrt(28)/(sqrt(36)-4))*2. 4375/144 Simplify (sqrt(180)/(sqrt(5) + sqrt(45)))/(3sqrt(1452)). sqrt(3)/132 Simplify sqrt(132)/(sqrt(60)/sqrt(5)6) - (sqrt(33)/sqrt(75) + -4). -sqrt(11)/30 + 4 Simplify -4 + -3((0 + sqrt(832) + 4 - sqrt(832))*2 - (sqrt(832)2 + 1)). -49 + 48sqrt(13) Simplify (-2(sqrt(49) - sqrt(49)1) - sqrt(49))/(sqrt(252)-1) + (-3(sqrt(63) + sqrt(252)/sqrt(4))-4)*2. sqrt(7)/6 + 36288 Simplify (5(sqrt(156) - ((sqrt(156) + sqrt(156) + -1sqrt(156) + sqrt(156) - sqrt(156))5 + sqrt(156) + sqrt(156))))/((-3sqrt(144)-5)/sqrt(12)). -2sqrt(13) Simplify ((-4(sqrt(209)-1 + sqrt(209)) - sqrt(209))2)/(-2sqrt(891)-3). -sqrt(19)/27 Simplify (((sqrt(684) + sqrt(684)-2)-5 - 3sqrt(684)-4)4)2. 3162816 Simplify (-2(4sqrt(480) + sqrt(480)))/(-3(sqrt(360) - (sqrt(360) + sqrt(360) + (sqrt(360) + sqrt(360)4 - sqrt(360) - sqrt(360))))). -5sqrt(3)/9 Simplify ((sqrt(133) - (sqrt(133) + (-1sqrt(133) - sqrt(133))))41)/(-2sqrt(2268)). -2sqrt(19)/9 Simplify 2 + -2 + sqrt(468) + -4 - (4sqrt(468)-52)*2. -748804 + 6sqrt(13) Simplify ((sqrt(2178) - 2sqrt(2178))/((sqrt(72)/sqrt(4) + sqrt(18))/sqrt(3)) - (-3sqrt(36)/sqrt(3) - (sqrt(576) - sqrt(36))/sqrt(3)))*2. 507/4 Simplify ((sqrt(288) - 5sqrt(288)-2 - sqrt(288)) + -5 + -2sqrt(288))*2 - (3 + sqrt(288) + ((-1 + sqrt(288))1 - sqrt(288) - sqrt(288)))*2. -960sqrt(2) + 18453 Simplify (-3-22sqrt(245) - (sqrt(245) + sqrt(245) + -3 + sqrt(245) + -1 + sqrt(245) + sqrt(245) + 1 + sqrt(245) + 1))26. 1008sqrt(5) + 52944 Simplify 4(1 + sqrt(1900) + sqrt(1900)) + 0 + (-2sqrt(114)1)/((sqrt(6) - sqrt(12)/sqrt(2))-4 + sqrt(6)). 4 + 78sqrt(19) Simplify -3 + -44sqrt(1216) + (sqrt(1216)362)2. -128sqrt(19) + 1575933 Simplify -3(-1 + (sqrt(6050) + -1)2 + 1(-1sqrt(6050))2) + -2. -36302 + 330sqrt(2) Simplify (4(sqrt(102) - (sqrt(102) + (sqrt(102) - sqrt(102)-1)))-6)/(sqrt(42)/(sqrt(28)/(sqrt(8)/sqrt(2)))). 48sqrt(17) Simplify 465sqrt(2736)1-5. -7200sqrt(19) Simplify -2(3 + (sqrt(160)/sqrt(8))/sqrt(4))6. -36 - 12sqrt(5) Simplify (1(sqrt(432) - sqrt(432)-4-6)4)2. 3656448 Simplify (-2(sqrt(170) + 1sqrt(170)) - 3(sqrt(170) + (sqrt(170) - sqrt(170)-1) - sqrt(170)))/(sqrt(360) - (sqrt(360) - (-1sqrt(360) + sqrt(360)))-6). -5sqrt(17)/21 Simplify (-4 + 3 + sqrt(175)1 + sqrt(175) + sqrt(175) + (-1(sqrt(175) + 1) - sqrt(175)) + -2)*2 + 3. -40sqrt(7) + 194 Simplify (3-2sqrt(1728))/(sqrt(8)/(sqrt(18)-2)). 432sqrt(3) Simplify -4(6(sqrt(242) + 2)-6)2. -1275264 - 228096sqrt(2) Simplify -1 + (3(2sqrt(171) - sqrt(171)))/sqrt(9) + (sqrt(57)/(sqrt(9)/sqrt(3)) - sqrt(19)) + 5 + -2. 2 + 3sqrt(19) Simplify (sqrt(130)/((sqrt(240) - sqrt(60))/sqrt(6)))2 - 6((sqrt(130) - (sqrt(130) - (-3sqrt(130) + sqrt(130))) - sqrt(130)) + sqrt(130))/sqrt(10). 13 + 12sqrt(13) Simplify (sqrt(84)/((-1sqrt(84))/sqrt(12)))/(-2(sqrt(144)3 + sqrt(4))). sqrt(3)/38 Simplify (-3 + 3 + 5(sqrt(425) + 2 + -2 - (sqrt(425)-1 + -5)))2. 2500sqrt(17) + 43125 Simplify (((sqrt(108) - sqrt(12))-3)/(3sqrt(24)/sqrt(6) - sqrt(4) - sqrt(4)))*2. 108 Simplify (sqrt(1700) + (sqrt(1700) - sqrt(1700)2)3)2 + 3(sqrt(119) + sqrt(119) + sqrt(119)-3 - sqrt(119))/sqrt(7). -6sqrt(17) + 6800 Simplify (1sqrt(576))/((sqrt(96)1)/sqrt(8)) - (1 + -1sqrt(12)-6). -8sqrt(3) - 1 Simplify 4 + 1(-5(0 + sqrt(1100)) - (0 + -1 + sqrt(1100) - sqrt(1100)))2. -100sqrt(11) + 27505 Simplify (((5sqrt(70)-2)/(sqrt(490)-2) + 1)2)*2. 40sqrt(7)/7 + 128/7 Simplify -4 + (sqrt(112) + 3)-3 + 5. -12sqrt(7) - 8 Simplify 1(6((sqrt(65)-2 - sqrt(65)) + sqrt(65)))/((sqrt(450)/sqrt(9))/sqrt(10)). -12sqrt(13) Simplify 5(sqrt(13) + -5 + (sqrt(65)/sqrt(5))2) - (sqrt(65)3)/sqrt(5)4. -7sqrt(13) + 40 Simplify (sqrt(44)/(1sqrt(4)))2 + 4 - 3(1 + sqrt(99)). -9sqrt(11) + 12 Simplify 5 + (-3sqrt(72))*2-5 + (3sqrt(72)1)*2 + -2. -2589 Simplify -44sqrt(2448) - sqrt(102)/(sqrt(6) + (sqrt(6) - 6sqrt(216))). -6527sqrt(17)/34 Simplify (sqrt(960)1 - ((sqrt(60) + sqrt(60)-1)-4 + sqrt(60) - sqrt(60)))/((sqrt(108)-15 + sqrt(108))/sqrt(9)). -sqrt(5) Simplify -36(sqrt(2) - (-1 + sqrt(2))*2) - (sqrt(32)-2 + sqrt(40)/sqrt(5)). -48sqrt(2) + 54 Simplify ((4(sqrt(117) - 2sqrt(117))-5)/(-2sqrt(144)1))*2. 325/4 Simplify -5 + (2 + sqrt(2448)1 - (5 + sqrt(17) + -2 + sqrt(17) + 5)). -11 + 10sqrt(17) Simplify ((-3-2sqrt(312))/((sqrt(90)/sqrt(3))/sqrt(5)))2 + 4. 1876 Simplify 6(sqrt(128) + (2sqrt(128) - sqrt(128)) + 3 + 2)2-3. -9666 - 2880sqrt(2) Simplify -1(-1(sqrt(2299) + 3 + sqrt(2299))2 + (sqrt(2299) - (sqrt(2299) + sqrt(2299)-6))2). 9205 Simplify 2(1 + -1sqrt(700) + 3)2. -40sqrt(7) + 16 Simplify ((2 + 3 + (sqrt(1700) - -2sqrt(1700)) + sqrt(1700) + 0)1 + 2)2. 560sqrt(17) + 27249 Simplify 2(sqrt(1088) + sqrt(1088) + -3)5 + -5. -35 + 160sqrt(17) Simplify ((sqrt(6776) + sqrt(6776)-2 - sqrt(56))/sqrt(8) + (sqrt(84)-34)/sqrt(12))*2. 4032 Simplify -3-6(sqrt(539) + 3) + 0. 54 + 126sqrt(11) Simplify 2(sqrt(130)-2 + sqrt(130))/sqrt(10) + -2 + sqrt(468) + (sqrt(13) - (-1 + sqrt(52)/sqrt(4))). -1 + 4sqrt(13) Simplify (((sqrt(171) - (1 + sqrt(171))) + 3)3 + 5)*2 + -3. 118 Simplify (-2 + 5((5(sqrt(2) + sqrt(2)3))*2 + (sqrt(200) - (-3sqrt(200) + sqrt(200)))*2))3. 38994 Simplify 2(-5 + (2sqrt(2) + 4 + 5 - (-1 + sqrt(24)/(sqrt(12)-1)))). 6sqrt(2) + 10 Simplify 2 + (sqrt(1088) + 4)*2 - sqrt(153)/(1sqrt(9)4). 255sqrt(17)/4 + 1106 Simplify (sqrt(720) + 0 + -2)*2 - ((sqrt(720) - (sqrt(720) + 1)) + -1) - (sqrt(720) + (3 + -2sqrt(720))*2)-6. -840sqrt(5) + 18060 Simplify (sqrt(10) - sqrt(1210)1)/(sqrt(22)/(sqrt(11) - sqrt(176))) + -5 + ((sqrt(5) - sqrt(20)/sqrt(4))*22 - sqrt(55)/(sqrt(44)/sqrt(4))). -5 + 29sqrt(5) Simplify (((sqrt(320) - (sqrt(320) - (2sqrt(320) + sqrt(320))-3)) + sqrt(320))/(sqrt(120)/(sqrt(24)/sqrt(2)))3)*2. 18432 Simplify -1(1(1 + sqrt(720)) - (2(sqrt(320) + 1))*2). 52sqrt(5) + 1283 Simplify sqrt(891) + (sqrt(891) + (sqrt(891) - (sqrt(891) + sqrt(891) + 1 + 0)))*2 + -3 - (-5 + -5(-2 + sqrt(891)))*2. -22302 + 459sqrt(11) Simplify sqrt(36)/(sqrt(24)/sqrt(2)) + 1 - (sqrt(6)/sqrt(2) + 3)*24. -47 - 23sqrt(3) Simplify (sqrt(171)/(sqrt(81)1) - (-2sqrt(228)1)/sqrt(12))1. 7sqrt(19)/3 Simplify (2sqrt(242)-51 + ((0 + sqrt(242))3 + sqrt(242) - sqrt(242)) + sqrt(242) + sqrt(242) + (sqrt(242) - (1 + sqrt(242))) + 5)*2. -440sqrt(2) + 6066 Simplify -5 + (sqrt(704) + 3 - sqrt(704))-5 - (((sqrt(704) + -2)-1)2 - (sqrt(704) - (sqrt(704) + (1 + sqrt(704) - sqrt(704)) + 1))2). -724 + 32sqrt(11) Simplify 0 + 5sqrt(26)/sqrt(2) + -3 + ((sqrt(39)/sqrt(3) + 3 - sqrt(13)) + 2)*23. 5sqrt(13) + 72 Simplify (sqrt(900) - (-3sqrt(900) - sqrt(900)))/((-5sqrt(84))/sqrt(7)). -5sqrt(3) Simplify 4(sqrt(7) + (sqrt(63) - sqrt(252))/sqrt(9)) + sqrt(84)/((sqrt(132)-1)/sqrt(11)). -sqrt(7) Simplify 3(-4 + 1 + sqrt(72) + 0)2 + 2. -108sqrt(2) + 245 Simplify (3 + sqrt(1900)1 - sqrt(1900) - sqrt(1900) - 4(1 + sqrt(1900)))*24. 400sqrt(19) + 190004 Simplify -5 + (sqrt(5808)-3 - (2 + sqrt(48))-6). -108sqrt(3) + 7 Simplify (52sqrt(133) + 1sqrt(133)1)/(sqrt(112)-6 - sqrt(567)1). -sqrt(19)/3 Simplify 5(-2(sqrt(19) - (sqrt(114)/sqrt(6))*2)4 - (sqrt(133)/((sqrt(28) + sqrt(7))-1 + sqrt(7)))2). -40sqrt(19) + 2945/4 Simplify ((s	{ "pile_set_name": "DM Mathematics" }
of f? 1 Let r(m) be the second derivative of m3/2 + m2/2 - 2m. Let w be r(-5). What is the units digit of (w/2)/(-1) - -1? 8 What is the units digit of -1 + -3208/(-12)? 1 Suppose -1186 = -11s + 1861. What is the hundreds digit of s? 2 Suppose g = -5c + 10c - 187, 4c + 3g - 142 = 0. What is the tens digit of c? 3 Let m = -83 + 184. What is the units digit of m? 1 Let z(x) = x3 - x2 + x + 4. Let c be z(0). Suppose -5m = -ck + 29, 3k + 17 = -m - 3m. What is the units digit of k? 1 Suppose 5n = 4i + 14, -30 = 4i + 2n + n. Let k(j) = j3 + 5j*2 - 5j + 6. Let f be k(i). Let z = f + 3. What is the units digit of z? 3 Let s = -44 - -69. Suppose 14 + s = 3p. Suppose -26 = -3r + p. What is the units digit of r? 3 Let k(r) = r*3 - 7r*2 + 3r - 1. Let g be k(6). Suppose -2j = 3j - 145. Let l = g + j. What is the units digit of l? 0 Let h(o) = -o*2 + 5o + 3. Let a be h(5). Suppose 9 = -aq, 4t + 2q + 2 = -0t. What is the units digit of (6/(-18))/(t/(-51))? 7 Suppose 2v = -4h + h + 17, -4v = -h + 29. Suppose hy - 6y = -171. Let s = -36 - y. What is the tens digit of s? 2 Suppose 3s + 5 = -3d - 7, 2s - 4 = 4d. Let c(l) = -l2 - 4l - 3. Let n be c(s). What is the units digit of n/(-2) - 18/(-4)? 4 Let i be (-1)/(-1(-2)/(-6)). Suppose -5f = -iq + 4, -4q - 2f = -9q - 25. Let y = q - -17. What is the tens digit of y? 1 Let c = -33 + 60. What is the units digit of c? 7 Suppose 2s + s = 15. Suppose -5f + s + 0 = 0. What is the units digit of f? 1 Suppose 3q + 0 + 11 = 5k, 0 = 5k + 2q - 26. Suppose -x = z - 6x - 32, kz - 32 = -4x. Suppose 3l = z - 3. What is the units digit of l? 3 Let t(c) be the first derivative of c3/3 + c2/2 - 2c - 3. What is the units digit of t(-3)? 4 Let a be (-5)/((0 - 1)/5). Suppose -5z - a = -v, -5z - 30 = -3v + 15. What is the tens digit of v? 1 Let j be 2/(-3) + 20/3. Let z(f) be the third derivative of f4/12 - f3/2 - 7f2. What is the units digit of z(j)? 9 What is the hundreds digit of (-3 - (-3 + 2))(-478)/4? 2 Let g = 3 + -3. Suppose -2p + gd + 33 = d, -d = -p + 15. What is the tens digit of p? 1 Suppose -g - y = 17, 3g - 5g - 22 = -y. Let t = g - -23. What is the tens digit of t? 1 Let d = 193 + -96. What is the units digit of d? 7 Let q(d) = d*2 + 5d + 4. Let g be q(-4). Suppose ga = 3a. Suppose 4v + v + 10 = 0, 2m - 3v - 12 = a. What is the units digit of m? 3 Let f(m) = -m2 - 19m + 7. Let w = -18 + 2. What is the units digit of f(w)? 5 Suppose 0 = -14q + 1563 + 3491. What is the hundreds digit of q? 3 Let f(q) be the second derivative of -1/20q5 + q2 + 1/2q4 - 5/6q*3 - 3q + 0. What is the units digit of f(5)? 2 Let d = -1 - -9. What is the units digit of d? 8 Suppose 0 = f - 1 - 2. Let y be (f - -1 - 2) + 1. Suppose -6 = yh - 21. What is the units digit of h? 5 Suppose -2o + 1 - 4 = n, -3n - 2o - 13 = 0. Let d = -1 - n. What is the units digit of d? 4 Suppose 8g = 3g + 165. What is the tens digit of g? 3 Let m = -5 + 9. Suppose -o + 35 = mo. What is the units digit of o? 7 Suppose 3t + 0 - 15 = 0. Let v = t + -3. What is the units digit of (v1)/(1/1)? 2 Let n = 327 + -170. What is the tens digit of n? 5 Let t be 0/(4(-2)/(-4)). Suppose -2w - w + 42 = t. What is the tens digit of w? 1 What is the units digit of 100 - (-6 + 4/(-8)-6)? 3 Let a = 21 + -15. Suppose 5d = 2d + a. Suppose 5p = 3w - 10, -dw + 7 + 2 = -p. What is the units digit of p? 1 Let r(d) = -4d - 24. What is the units digit of r(-16)? 0 Let k be -9 - -6(-3)/(-6). What is the tens digit of 2/k + 219/9? 2 Suppose f + 294 = 7f. What is the tens digit of f? 4 What is the tens digit of (25/10 - 3)-70? 3 Let z(x) = -x + x + 8 - 2x. What is the tens digit of z(-12)? 3 Let u(l) = l*3 + 7l*2 + 5l - 3. Let v be u(-6). Suppose -vf = -5f + 10. What is the units digit of f? 5 What is the tens digit of 4 - (23/(-1) + 1)? 2 Let v(z) = -2z + 93. Let s(b) = b - 46. Let l(x) = -13s(x) - 6v(x). What is the units digit of l(0)? 0 Suppose 203i = 201i + 364. What is the units digit of i? 2 Let m be 9/(-3)4/(-3). Let p be 2/(-3) - 184/(-6). Suppose mc + c = p. What is the units digit of c? 6 Let d be (-4)/(-10) - 266/(-35). Let o = -5 + d. What is the units digit of o? 3 Suppose 0 = -5y - 0y - 20. Let a = 3 + y. Let i = 2 + a. What is the units digit of i? 1 Suppose r - 105 = -2r. Suppose -l + 53 = -r. What is the units digit of (-2)/9 - l/(-72)? 1 Let o(z) = -z*3 - 5z2 + 4. Let f be o(-5). Let m = f - -25. What is the units digit of m? 9 Let o(i) = -i2 + 4i - 1. Let b be o(3). Suppose -bw + 10 = 3w. Suppose z - 17 = -4f + 11, 4z - wf - 22 = 0. What is the units digit of z? 8 Let n(a) = 18a2 + a + 25a*2 - 45a*2 - 2a*3. Suppose 0x - 5x - 10 = 0. What is the units digit of n(x)? 6 Let x(l) = -l - 3 + 4 + 2. What is the units digit of x(-3)? 6 Let f = -3 + 3. Let b(z) = 2z - 9. Let k be b(6). Suppose 6i - ki - 21 = f. What is the units digit of i? 7 What is the units digit of 7 - -2(1 - 0)? 9 Suppose -13 = -k - 2. Suppose -2u = 3u - o - 8, -4u - 5o - k = 0. What is the units digit of u/(-3)(-5 + -16)? 7 Let c(j) = -6j - 11. Let y be c(-6). Let x = y - 15. What is the tens digit of x? 1 Let g be (-28)/(-6) + (-4)/6. What is the units digit of (6/g - 1)14? 7 Suppose -2o = o - 132. What is the tens digit of o? 4 Let x be 6(4 - (-11)/(-3)). Let k(z) = 4z. What is the units digit of k(x)? 8 Let d = -465 - -671. What is the tens digit of d? 0 Suppose 4f - 3y = 212, 2y = -5f - 2y + 265. What is the tens digit of f? 5 Suppose -6w + 3w = 0. Let y = w - -4. What is the units digit of y? 4 Let q = 49 + -21. What is the units digit of 8/q - (-80)/14? 6 Suppose 3n - 1719 = -6n. What is the units digit of n? 1 Let d(c) = -c*2 - 9c - 10. Let f be d(-8). What is the tens digit of 16/12(-21)/f? 1 Let q = -196 + 293. What is the tens digit of q? 9 Suppose 5x - 6x + 4 = 0. Let f be (2/x)/(3/12). Suppose 4v + 2 = -18, -5b = fv - 65. What is the tens digit of b? 1 What is the tens digit of (158/4)/(1 - 3/6)? 7 What is the units digit of 4/((-9)/(1116/(-8)))? 2 What is the units digit of ((-14)/(-4) - 4) + 345/2? 2 Let n be 9/(-18) + (-14)/(-4). Suppose -4d = -nb - 67, -5d + 0b + 104 = 3b. What is the tens digit of d? 1 Let a(u) = -2u*2 + 28u - 20. What is the tens digit of a(11)? 4 Let j(z) = -z*2 + 6z - 6. Let n(t) = -t*2 + 5t - 6. Let k(b) = 5j(b) - 6n(b). Let l be k(0). What is the units digit of (-1)/(l/(-15))2? 5 Suppose -5j + 5n = -35, -j - 4n = -11 - 16. What is the units digit of j? 1 Let r(h) be the first derivative of h*3/3 - 4h*2 - 6h - 4. What is the tens digit of r(10)? 1 Let d = 50 + 21. What is the tens digit of d? 7 Let x = 9 + -3. Let m = -3 + x. What is the units digit of m? 3 Suppose 4 = -3o + 10. What is the tens digit of (-1 - -31)/(o/1)? 1 Let r(d) = d3 + 8d*2 - 7d - 5. What is the units digit of r(-7)? 3 Let z(n) be the first derivative of n*2/2 + 3n + 3. What is the units digit of z(-1)? 2 Let g be 2/7 + 4/(-14). Suppose -3 = x - gx. Let q = x + 6. What is the units digit of q? 3 Suppose -2k - 3l + 10 = -7l, -k - 5l + 5 = 0. Suppose k = 3y - 49. What is the units digit of y? 8 What is the hundreds digit of (-430)/(-4) - 3/6? 1 What is the units digit of (-10)/45 + (-389)/(-9)? 3 Let r = 23 + 57. Suppose -4p = -9p + r. What is the tens digit of p? 1 Let o = -29 + 57. What is the tens digit of o? 2 Suppose -2 = 3j + 2z - 5, 4z = 5j - 27. Suppose 2k = jp + 8, -4k = k - 3p - 29. What is the units digit of k? 7 Suppose 0n = 5n - 10. Let t(h) = h3 - h2 + 3h - 1. What is the units digit of t(n)? 9 Let x(s) = -s + 2. Let j be x(0). Let u = 2 - j. Suppose u = -k + 3k - 4. What is the units digit of k? 2 Suppose 4y + 9 = 29. Suppose -4d + 3v + 6 = 0, 0 = -yd - 2v - 2 - 2. Suppose di = 5i - 50. What is the tens digit of i? 1 Let l = 22 + -13. Let t(v) = v2 - 9v + 2. Let f be t(l). What is the units digit of (-195)/(-20) - f/(-8)? 0 Let g(z) = -z*3 - 9z*2 - 9z + 1. Let q be g(-8). Let x = -24 - -31. Let u = q - x. What is the units digit of u? 2 Suppose 3z - 4 - 2 = 0. Suppose 0 = zv - v - 4. Suppose 3o + 2o - 4 = 3a, 18 = 5o	{ "pile_set_name": "DM Mathematics" }
Sort -5, 1, -0.05, 8, -0.3 in decreasing order. 8, 1, -0.05, -0.3, -5 Put -3, 4306, 311 in increasing order. -3, 311, 4306 Sort 0.2, 37.11, 1/9 in decreasing order. 37.11, 0.2, 1/9 Sort 0, -1, -11522 in ascending order. -11522, -1, 0 Put 6, -5, -8, 0, 3 in decreasing order. 6, 3, 0, -5, -8 Sort -3, 19, 12, 1 in decreasing order. 19, 12, 1, -3 Put 207, 3, -4, 11, 5 in increasing order. -4, 3, 5, 11, 207 Sort 2, -16.31, -0.4. -16.31, -0.4, 2 Sort 0.01, 25, 1.8, -1/2 in decreasing order. 25, 1.8, 0.01, -1/2 Sort -1/981, -0.2, -5, 1 in decreasing order. 1, -1/981, -0.2, -5 Sort -821, -3, -49 in increasing order. -821, -49, -3 Put 0.5, -0.4, 43369, 1 in descending order. 43369, 1, 0.5, -0.4 Put 6810, -3, 2/5, -1/3, -2/5 in ascending order. -3, -2/5, -1/3, 2/5, 6810 Sort -0.1, -74, 0.4, 0.48 in descending order. 0.48, 0.4, -0.1, -74 Sort 4, -4, 4/7, -755 in decreasing order. 4, 4/7, -4, -755 Sort 2/7, 1, 4, -0.2, -2/89, -1. -1, -0.2, -2/89, 2/7, 1, 4 Sort -48, 0.3, 3, 0, 35. -48, 0, 0.3, 3, 35 Sort -2/19, -432, 0.4, 1/3, -1/4. -432, -1/4, -2/19, 1/3, 0.4 Put -3, 23, -30347 in decreasing order. 23, -3, -30347 Sort 92, 2/3, -4, -5/3. -4, -5/3, 2/3, 92 Put 3, -31, 0, 1, -1, 2 in decreasing order. 3, 2, 1, 0, -1, -31 Sort 5, 2/7, -0.5, 518, 4/5 in decreasing order. 518, 5, 4/5, 2/7, -0.5 Put -0.1, -14431, 71 in descending order. 71, -0.1, -14431 Sort 2/11, 6, -3, 3/2, -1.9, 3/7. -3, -1.9, 2/11, 3/7, 3/2, 6 Sort 61, -36, 16 in decreasing order. 61, 16, -36 Sort 0, 5, -2702 in increasing order. -2702, 0, 5 Put 1/3, -5, 5, -4, 0.099, -3103 in ascending order. -3103, -5, -4, 0.099, 1/3, 5 Sort 0.4, 1, 41, -49, 0.3. -49, 0.3, 0.4, 1, 41 Put -2, 5, -23, -0.44, -2/9 in descending order. 5, -2/9, -0.44, -2, -23 Sort 69, -3, 4, -2, -24, -5 in decreasing order. 69, 4, -2, -3, -5, -24 Sort 0.15, -5.7, -6, 1, -3 in decreasing order. 1, 0.15, -3, -5.7, -6 Put -1/3, -136, 5, -1/10, -2 in ascending order. -136, -2, -1/3, -1/10, 5 Put -67, -4, 2, 6, -1, 7 in descending order. 7, 6, 2, -1, -4, -67 Sort -0.02, -0.2, 3/7, 3, -2/7. -2/7, -0.2, -0.02, 3/7, 3 Put -4, -12, -5, 1, -2, -10 in decreasing order. 1, -2, -4, -5, -10, -12 Sort -3, 1, -2046, -117. -2046, -117, -3, 1 Sort 11, 14.14, 5 in decreasing order. 14.14, 11, 5 Put 0, -1435, 12 in descending order. 12, 0, -1435 Sort -111, 2, 3942. -111, 2, 3942 Sort 34, 1, -7672. -7672, 1, 34 Sort 30, -4, -5, -6, 26 in decreasing order. 30, 26, -4, -5, -6 Put -5, -6, 2, -3596 in increasing order. -3596, -6, -5, 2 Put 2, 6, -5, -17, 4 in ascending order. -17, -5, 2, 4, 6 Put -5, 3, 1019, -4, -3 in descending order. 1019, 3, -3, -4, -5 Sort 13, -1, 2, 2291 in decreasing order. 2291, 13, 2, -1 Sort 0.078, -9, -4, 2, -1 in decreasing order. 2, 0.078, -1, -4, -9 Put 3, 2, 4, -5, 109, -2 in decreasing order. 109, 4, 3, 2, -2, -5 Sort 3, -22, -6, -3, 4 in ascending order. -22, -6, -3, 3, 4 Sort -21, 1, 184, 3 in ascending order. -21, 1, 3, 184 Put -4, 0, 2, 1575 in decreasing order. 1575, 2, 0, -4 Put -2, -8, 247 in descending order. 247, -2, -8 Sort 1, 5, -127612 in ascending order. -127612, 1, 5 Sort 32042, -7, -5, 0 in decreasing order. 32042, 0, -5, -7 Put 3, -5, -41863 in descending order. 3, -5, -41863 Sort 95, -4, 2/31. -4, 2/31, 95 Put 142, -6, -9 in increasing order. -9, -6, 142 Put 0.3, 4883, 4 in descending order. 4883, 4, 0.3 Sort -256, -2, -4, -3, -17, 4 in descending order. 4, -2, -3, -4, -17, -256 Put 0.04, -6344, 2, 0 in descending order. 2, 0.04, 0, -6344 Sort -4, 1, 7094, 3/7 in descending order. 7094, 1, 3/7, -4 Put -0.3, -0.349, 7 in decreasing order. 7, -0.3, -0.349 Put 1, -5, -20, 4/3, -3592 in ascending order. -3592, -20, -5, 1, 4/3 Put 4, 37, 45, -3, -2 in decreasing order. 45, 37, 4, -2, -3 Put 0.9, -1.3, -2/11 in increasing order. -1.3, -2/11, 0.9 Sort -5, 93, -3 in decreasing order. 93, -3, -5 Sort 0.04, 303, 14/51 in descending order. 303, 14/51, 0.04 Sort -1/49, -33, -15. -33, -15, -1/49 Sort 2/57, 46, -0.1, -3/5 in increasing order. -3/5, -0.1, 2/57, 46 Sort 2, 3, -5, 52, -760 in decreasing order. 52, 3, 2, -5, -760 Put 16, 15, 0 in decreasing order. 16, 15, 0 Sort 5, 220, -15 in decreasing order. 220, 5, -15 Sort -16, -0.02, 3, 4/41, 2/5, -0.1 in ascending order. -16, -0.1, -0.02, 4/41, 2/5, 3 Sort -23, 5, 6 in increasing order. -23, 5, 6 Sort -327, -3, 0, 16 in ascending order. -327, -3, 0, 16 Sort 27, -9, 1, 11. -9, 1, 11, 27 Put -4/9, -4, 3, 25, -2/7, 4 in decreasing order. 25, 4, 3, -2/7, -4/9, -4 Sort 0, 2, -5389. -5389, 0, 2 Sort -11, -2348, -4. -2348, -11, -4 Put -2170, 3, 250, 1 in increasing order. -2170, 1, 3, 250 Sort 1/3, 0.6, -1, 0.1, -5, -1/6 in descending order. 0.6, 1/3, 0.1, -1/6, -1, -5 Put 1, 4, 8, 3, -5, -2 in decreasing order. 8, 4, 3, 1, -2, -5 Sort 17464, -10, -3, 5. -10, -3, 5, 17464 Put 0.4, -0.7, -1.747 in decreasing order. 0.4, -0.7, -1.747 Sort 4, -14, 0.2, -1/2, 1 in descending order. 4, 1, 0.2, -1/2, -14 Put -4, 3, 2440 in increasing order. -4, 3, 2440 Put 23, -6/13, -11 in increasing order. -11, -6/13, 23 Put 5, -0.1, 923/7 in ascending order. -0.1, 5, 923/7 Put -4, -2, 61, 3, -23, -3 in increasing order. -23, -4, -3, -2, 3, 61 Sort 2, 0, -1, -10, -5, -105. -105, -10, -5, -1, 0, 2 Sort 2, 5, 55, 86 in ascending order. 2, 5, 55, 86 Sort -9, -1104, 2, -4/7, -11 in ascending order. -1104, -11, -9, -4/7, 2 Sort 227, -4, 4, 2, -3, -1 in increasing order. -4, -3, -1, 2, 4, 227 Sort 495, -5, 5, -10. -10, -5, 5, 495 Put 3146, -55, 1 in descending order. 3146, 1, -55 Put 5, -2/13, -2557, -88 in decreasing order. 5, -2/13, -88, -2557 Sort -117, -5, 0, -6, -8. -117, -8, -6, -5, 0 Put 0, -3, -1, -21, -52 in ascending order. -52, -21, -3, -1, 0 Put -2/5, 4/5, 1242, 5 in descending order. 1242, 5, 4/5, -2/5 Sort -2, 23, -95, 5, -18 in ascending order. -95, -18, -2, 5, 23 Sort -4, 0, -391 in ascending order. -391, -4, 0 Sort 5, -39, 1. -39, 1, 5 Sort 16, -0.05, -17, 1, 0.4 in ascending order. -17, -0.05, 0.4, 1, 16 Put 6, -4, -29, 19 in increasing order. -29, -4, 6, 19 Sort 5, -3, 2/9, -1/25 in decreasing order. 5, 2/9, -1/25, -3 Put -4/5, -0.9, 9, 3/5, 13 in descending order. 13, 9, 3/5, -4/5, -0.9 Sort 119.8, -9, -1, -2, -0.5, 0.2 in increasing order. -9, -2, -1, -0.5, 0.2, 119.8 Put -2, -3/4, 1.29, 5 in ascending order. -2, -3/4, 1.29, 5 Sort 3, -23, 198 in decreasing order. 198, 3, -23 Sort -20, -2.4, 0.6, -3/4, -0.1. -20, -2.4, -3/4, -0.1, 0.6 Sort -47, 0, -13, -44 in increasing order. -47, -44, -13, 0 Sort 27, -1, 11, -836, 3, 0 in ascending order. -836, -1, 0, 3, 11, 27 Put -4, 5, 11, -101, 4 in decreasing order. 11, 5, 4, -4, -101 Sort -1/5, 2, -1.5, -0.06, 5, -3. -3, -1.5, -1/5, -0.06, 2, 5 Sort 27, 1, -13, -5 in ascending order. -13, -5, 1, 27 Sort -11385, -1, 0, 6. -11385, -1, 0, 6 Sort 1, -1098, -3, -4 in decreasing order. 1, -3, -4, -1098 Put 14, -1, 8, -5, 7 in descending order. 14, 8, 7, -1, -5 Sort 5, -1, 2/7, -258/7 in ascending order. -258/7, -1, 2/7, 5 Put 0.5, -170, 10, 1, 268 in decreasing order. 268, 10, 1, 0.5, -170 Put -366, 11, -1, 63 in ascending order. -366, -1, 11, 63 Put -0.2, -0.048, -3, -1/4, -9 in descending order. -0.048, -0.2, -1/4, -3, -9 Sort 0.01, -1, -5, 175, -0.4, 4/7. -5, -1, -0.4, 0.01, 4/7, 175 Put -5, -16, 7, -3, 44, -1 in decreasing order. 44, 7, -1, -3, -5, -16 Put -1, 1, 3, -5, -34 in increasing order. -34, -5, -1, 1, 3 Sort 13, 2040, 2. 2, 13, 2040 Sort 1726, 3, 1, 124. 1, 3, 124, 1726 Sort 1/8, 3, 68, -0.2, -0.3 in ascending order. -0.3, -0.2, 1/8, 3, 68 Put 2, -1/5, 4, 0.1, 0.1241, -4 in descending order. 4, 2, 0.1241, 0.1, -1/5, -4 Sort -1, 2, -3, -2, 5, -18 in descending order. 5, 2, -1, -2, -3, -18 Put 0, -2/7, 2, -46439, 3 in decreasing order. 3, 2, 0, -2/7, -46439 Put -1, 2, 3, 1, 872, 5 in decreasing order. 872, 5, 3, 2, 1, -1 Put -162/5, 1, 31 in descending order. 31, 1, -162/5 Put 5, -272, -5, -1854 in increasing order. -1854, -272, -5, 5 Sort 1, 1394, -10 in decreasing order. 1394, 1, -10 Sort 25279, 3, -8 in decreasing order. 25279, 3, -8 Put -4/5, 5, 0, 457, -0.07 in ascending order. -4/5, -0.07, 0, 5, 457 Put 4, -684, 2, 3 in ascending order. -684, 2, 3, 4 Put -34/5, -2/97, 0.3, -5 in decreasing order. 0.3, -2/97, -5, -34/5 Put -24, -3, -290 in increasing order. -290, -24, -3 Sort 56, 5, -4, -2, -38, 2. -38, -4, -2, 2, 5,	{ "pile_set_name": "DM Mathematics" }
ed without replacement from {g: 4}. What is prob of picking 3 g? 1 Three letters picked without replacement from coocccccc. Give prob of picking 3 c. 5/12 Four letters picked without replacement from {d: 5, e: 2, c: 2, g: 4}. Give prob of picking 1 g and 3 d. 8/143 What is prob of picking 2 o when two letters picked without replacement from nnnnnnnnnnnnooo? 1/35 What is prob of picking 1 x, 2 k, and 1 s when four letters picked without replacement from {f: 5, x: 5, d: 3, s: 4, k: 2}? 5/969 What is prob of picking 1 g and 1 b when two letters picked without replacement from {e: 1, b: 2, o: 2, g: 1}? 2/15 Two letters picked without replacement from krerrjrkgrdrkdd. Give prob of picking 1 k and 1 e. 1/35 Calculate prob of picking 2 f and 1 r when three letters picked without replacement from {f: 3, r: 8}. 8/55 What is prob of picking 1 q, 1 u, and 1 m when three letters picked without replacement from qqmmmumqmmuuuqumuumu? 64/285 Three letters picked without replacement from {y: 1, k: 6, r: 9, i: 1}. What is prob of picking 3 r? 21/170 Calculate prob of picking 1 v and 3 u when four letters picked without replacement from vvvuuvuvvvv. 4/165 Two letters picked without replacement from rouyyyo. Give prob of picking 1 u and 1 o. 2/21 What is prob of picking 1 n and 2 f when three letters picked without replacement from fnnnnnf? 1/7 What is prob of picking 2 x when two letters picked without replacement from uxuuuuuuuxuuxuuuxu? 2/51 What is prob of picking 1 o and 1 q when two letters picked without replacement from iqilogg? 1/21 Two letters picked without replacement from tddladdtaatglgadtgtc. What is prob of picking 2 t? 1/19 Two letters picked without replacement from {m: 1, x: 2, d: 1, a: 1}. What is prob of picking 1 x and 1 m? 1/5 Three letters picked without replacement from slqzzcy. Give prob of picking 1 l, 1 q, and 1 z. 2/35 Three letters picked without replacement from yyiiyyiyyyyyyyyyyy. What is prob of picking 3 i? 1/816 Calculate prob of picking 1 o and 1 a when two letters picked without replacement from afpappxoxxooox. 8/91 What is prob of picking 2 h when two letters picked without replacement from {d: 2, h: 2, r: 8, e: 4, k: 3}? 1/171 Two letters picked without replacement from pppplppppppplppppppp. What is prob of picking 1 p and 1 l? 18/95 Calculate prob of picking 1 e and 2 l when three letters picked without replacement from lnllllllnlnpnppllep. 15/323 What is prob of picking 1 j, 1 k, and 2 p when four letters picked without replacement from pppkwjwnkp? 2/35 Three letters picked without replacement from {o: 3, r: 2, u: 3, w: 1, f: 4, m: 3}. What is prob of picking 1 f and 2 r? 1/140 Calculate prob of picking 1 u, 1 h, and 1 b when three letters picked without replacement from gbahsbsuubs. 2/55 Three letters picked without replacement from {x: 2, s: 8}. Give prob of picking 3 x. 0 Calculate prob of picking 1 f and 1 c when two letters picked without replacement from oowooofoc. 1/36 Calculate prob of picking 4 b when four letters picked without replacement from ybyyyybbyyybbbybyyy. 35/3876 What is prob of picking 1 q, 1 j, and 1 p when three letters picked without replacement from {p: 1, b: 5, j: 10, q: 4}? 2/57 Two letters picked without replacement from dodddoxxxdxdxddd. What is prob of picking 1 x and 1 o? 1/12 Calculate prob of picking 2 n when two letters picked without replacement from nnnsnrnnnnnnsssss. 45/136 Three letters picked without replacement from wwwwwywwhy. What is prob of picking 2 y and 1 h? 1/120 What is prob of picking 1 u and 2 d when three letters picked without replacement from {g: 1, d: 1, h: 4, u: 1, m: 2}? 0 What is prob of picking 3 e and 1 g when four letters picked without replacement from {g: 3, e: 9}? 28/55 Two letters picked without replacement from lllplpp. What is prob of picking 2 l? 2/7 Three letters picked without replacement from bbeebebbbbbbbbebbb. What is prob of picking 3 e? 1/204 Two letters picked without replacement from daatddd. Give prob of picking 1 d and 1 a. 8/21 Calculate prob of picking 3 q and 1 v when four letters picked without replacement from vqqvqq. 8/15 What is prob of picking 2 v when two letters picked without replacement from {f: 1, q: 1, e: 1, v: 3, l: 1, o: 5}? 1/22 What is prob of picking 2 y when two letters picked without replacement from {m: 5, y: 14}? 91/171 Three letters picked without replacement from {e: 3, d: 2, s: 3}. What is prob of picking 1 e and 2 d? 3/56 Calculate prob of picking 2 b when two letters picked without replacement from {d: 3, b: 3, t: 5, r: 2}. 1/26 Three letters picked without replacement from {h: 1, u: 5, t: 1, l: 3}. What is prob of picking 1 h and 2 l? 1/40 Calculate prob of picking 2 u when two letters picked without replacement from huuhuhhuuuuuhhuhhh. 4/17 What is prob of picking 1 v, 1 e, 1 i, and 1 r when four letters picked without replacement from {r: 3, e: 1, q: 1, c: 3, v: 2, i: 1}? 1/55 Two letters picked without replacement from {i: 12, t: 7}. Give prob of picking 2 t. 7/57 Calculate prob of picking 1 h, 1 r, and 1 c when three letters picked without replacement from hchccrc. 8/35 Four letters picked without replacement from iicricccccrriric. Give prob of picking 2 c and 2 i. 3/26 Two letters picked without replacement from reqbqrqheqqbbhserqb. What is prob of picking 1 h and 1 q? 4/57 What is prob of picking 1 d and 2 g when three letters picked without replacement from {e: 2, g: 2, f: 1, p: 1, d: 1}? 1/35 Calculate prob of picking 3 c and 1 b when four letters picked without replacement from {c: 6, n: 3, b: 4}. 16/143 Calculate prob of picking 2 t and 1 x when three letters picked without replacement from tttxititxiitiit. 6/65 Three letters picked without replacement from sirrclrviirvlrisi. What is prob of picking 1 s and 2 v? 1/340 Calculate prob of picking 1 l and 3 q when four letters picked without replacement from {l: 2, q: 3}. 2/5 Calculate prob of picking 1 w and 1 c when two letters picked without replacement from wfppcbpffpfpcbfbpcpp. 3/190 Three letters picked without replacement from cvvlvlv. Give prob of picking 1 v and 2 l. 4/35 Calculate prob of picking 2 b when two letters picked without replacement from bzeziebsbbesusz. 2/35 Two letters picked without replacement from kkjaajajajtjdadjjk. What is prob of picking 1 j and 1 k? 7/51 Three letters picked without replacement from {j: 1, k: 6, e: 1, p: 3, v: 1, u: 3}. Give prob of picking 3 k. 4/91 Two letters picked without replacement from {g: 1, s: 2, k: 2, q: 1, n: 1, x: 1}. Give prob of picking 2 k. 1/28 What is prob of picking 1 b and 1 n when two letters picked without replacement from nnnnnbnb? 3/7 What is prob of picking 3 n and 1 a when four letters picked without replacement from znnnqiqiqiqanqi? 4/1365 Calculate prob of picking 2 s when two letters picked without replacement from {u: 3, l: 1, z: 2, e: 2, s: 2, n: 2}. 1/66 What is prob of picking 4 o when four letters picked without replacement from {o: 4, p: 3, l: 6}? 1/715 What is prob of picking 2 j and 2 h when four letters picked without replacement from uuhjubbjuuuuwhbuuwzb? 1/4845 Two letters picked without replacement from {d: 2, h: 6}. What is prob of picking 1 d and 1 h? 3/7 Calculate prob of picking 1 d and 1 z when two letters picked without replacement from zdizididddz. 3/11 Calculate prob of picking 2 v when two letters picked without replacement from {d: 1, v: 10, q: 3, k: 1, i: 4}. 5/19 Calculate prob of picking 2 x and 1 n when three letters picked without replacement from ddxnbxnjbjdjj. 1/143 What is prob of picking 1 i and 1 m when two letters picked without replacement from {h: 3, i: 3, s: 3, m: 8}? 3/17 Calculate prob of picking 1 j, 1 h, and 1 c when three letters picked without replacement from tmtcjmhnhmhtn. 3/286 Two letters picked without replacement from moomooo. Give prob of picking 2 m. 1/21 Four letters picked without replacement from jssjjhshjcheeyjyhj. What is prob of picking 1 e, 2 y, and 1 c? 1/1530 Four letters picked without replacement from {e: 4, i: 6}. What is prob of picking 1 i and 3 e? 4/35 What is prob of picking 3 u when three letters picked without replacement from mmmmummuumuum? 5/143 Four letters picked without replacement from vrgmvmmrbgmmmmvmmgmr. Gi	{ "pile_set_name": "DM Mathematics" }
r(t) = -9t + 4. Let h(q) = -99r(q) + 4y(q). Let l(i) = 2221i - 2221i - 2i*2 + 3i*2. Calculate l(h(n)). 81n*2 Let h(i) = 2i - 5i + 2i. Let m(q) = -q*2 - 16q + 4. Let c be m(-11). Let u(k) = -ck + 116k - 56k. Give h(u(t)). -t Let a(d) = -2d. Let c(w) = 396870w. Give c(a(y)). -793740y Let i(f) = 4f. Let b be (-2)/11 + 96/44. Suppose 4k = 10 - b. Let o(g) = 6gk + 0g*2 - 7g*2. Give o(i(r)). -16r*2 Let t(k) = 1 - 1 + 634k - 1265k + 633k. Let o(m) = 3m - 1. Give o(t(s)). 6s - 1 Let h(s) = -3s. Let u(o) = 27 + 7o - 80 + 4o + 40 + 7o. What is h(u(x))? -54x + 39 Let b(i) be the second derivative of -i3/2 + i. Let k(z) = z - 14z + 3z. Calculate b(k(f)). 30f Let b(u) = -5u2 + 9u + 48. Let g(d) = -d*2 + 3d - 1. Let f(c) = -b(c) + 3g(c). Let k(v) = 2v. Determine k(f(p)). 4p2 - 102 Suppose 4a = -k + 4k - 4, 0 = -5a - 3k + 22. Let s(v) = 2v - 2v - 49v*a + 44v*2. Let u(f) = -3f*2. Determine u(s(n)). -75n4 Let t(s) = -s2. Let d(j) = -476j - 11. Let r(i) = 159i + 4. Let b(k) = -4d(k) - 11r(k). Give t(b(n)). -24025n2 Let f(z) = 4z - 10z + 2 + 1 - 3. Let a(b) = -24b*2. Calculate a(f(v)). -864v*2 Let b(c) = -305c*2. Let l(h) = h + 36. Determine b(l(v)). -305v*2 - 21960v - 395280 Let d(s) = 15s2 - 6s - 6. Let q(y) = -16y2 + 7y + 7. Let r(l) = 7d(l) + 6q(l). Let x(g) = 2g2 - 17. What is x(r(k))? 162k*4 - 17 Let v(p) = 111 + 136 - 247 - 2p. Let k(i) be the third derivative of -i4/4 + i2. Give v(k(g)). 12g Let f(u) = 281185u. Let j(q) = -8q2. Calculate j(f(x)). -632520033800x*2 Let s(f) = -3f*2. Let d(l) be the third derivative of -5l*4 - 35l*2. Give d(s(y)). 360y*2 Let b(g) = 5g + 5g - g. Let j(c) = 3c*2 + 6c + 12. Let o(z) = -z - 2. Let t(a) = -j(a) - 6o(a). What is t(b(n))? -243n*2 Let w(f) = 11f*2. Let x(h) = h + h - 5h + 10h. Determine w(x(j)). 539j*2 Let d(p) = -12p. Let m(s) = 50s2 + 10. Give d(m(l)). -600l2 - 120 Let k(b) = b2 + 6b - 3. Let v(j) = -j2 - 4j + 2. Let i(d) = -2k(d) - 3v(d). Let l(f) = 257f. Give l(i(n)). 257n*2 Let u(k) = 3k. Suppose 5w + 8 = 3t + 9w, 2t + 8 = 4w. Let l(d) be the second derivative of td*2 + 0 - 6d - 1/2d3. What is u(l(i))? -9i Let v be ((-8)/12)/(2/(-6)). Let k(q) = -3qv - 4q2 - q2 + 6q2. Let h(t) = 14 - 17 + 3 + 9t. What is k(h(g))? -162g2 Let d(a) = -2a. Let m(y) = 1608541y2. Determine d(m(r)). -3217082r*2 Let o(x) = -19x*2 + 2. Let i(l) = 449l*2. What is o(i(p))? -3830419p*4 + 2 Let b(k) = -7k2. Let r(g) be the second derivative of g3/6 - g*2/2 - 14g. Let w(t) = -5t + 4. Let j(x) = 20r(x) + 5w(x). What is j(b(s))? 35s*2 Suppose -4s + 4 = 5a - 0a, 4s - 4a - 4 = 0. Suppose -5v + 16 = 3t, 5v - 2t = 3v. Let d(x) = x + s + v - 3. Let n(j) = -7j. Calculate d(n(q)). -7q Let v(l) be the third derivative of -1/24l*4 + 0 + 0l*3 + 4l*2 + 0l. Let k(y) = -6y2 - 2y*2 - 2y*2 + 3y*2. Give k(v(u)). -7u*2 Let i(a) = 3a - 3. Let y(x) = -57x. Determine i(y(l)). -171l - 3 Let f(b) = -121476b2. Let d(w) = -w. What is d(f(j))? 121476j*2 Let x(r) = 8881r. Let g(j) = -71j2. Calculate x(g(q)). -630551q*2 Let m(z) = -2z. Let o(p) = -10428p. Let j(w) = -79w. Let g(q) = -790j(q) + 6o(q). Calculate m(g(c)). 316c Let v(j) = -157 + 157 - 23j + 24j. Let f(u) = 99u. Give v(f(t)). 99t Let h(f) = -33f*2 - 38f*2 - 34f*2 + 104f*2. Let x(k) = -36k*2. Calculate h(x(d)). -1296d*4 Let f(o) = -2o. Let z(x) = -7623703x. Give f(z(i)). 15247406i Let z(g) = -3g. Let c(v) = 4v*2 - 4v. Let k(o) = o + 23. Let f be k(-24). Let y(q) = q. Let n(s) = fc(s) - 4y(s). Determine z(n(r)). 12r2 Let i = -1 + 36. Let l(u) = 74u - 35u - iu. Let g(j) = j*2. Calculate l(g(c)). 4c2 Let t(a) = a2. Let w(b) be the first derivative of -12 - 77b2 + 42b*2 + 36b*2. Give t(w(p)). 4p*2 Let f(l) = -2l. Let c be 22 - 5(-4)/(-20). Let g(w) = -w3 + 21w*2 + w - 11. Let i be g(c). Let q(n) = -11n*2 - in*2 + 8n*2. Calculate q(f(x)). -52x*2 Let f(m) be the third derivative of 5m*4/8 - 14m*2. Let t(p) = -8p. Let d(w) = 3f(w) + 5t(w). Let i(v) = v. What is d(i(a))? 5a Let d(m) = -3m2 + 0 + 0. Let c(i) = -i2 - 6i. Let t(a) be the first derivative of -a3/3 - 5a*2/2 - 5. Let b(l) = -5c(l) + 6t(l). What is d(b(v))? -3v*4 Let u = -4 + -2. Let y = 8 + u. Let i(n) = -2ny - n2 + 6n2. Let w(f) = 2f*2. Determine i(w(v)). 12v*4 Let k(v) = 73381v. Let b(o) = 3o. Calculate k(b(d)). 220143d Let s(h) = -44h2. Let p(q) = -10q - 11q - 10q + 35q. Calculate p(s(b)). -176b*2 Let k(h) = -27h. Let x(j) = 6j2 - 4j - 4. Let c(y) = -y*2 + y + 1. Let z be 50/15(-6)/5. Let p(g) = zc(g) - x(g). Give k(p(w)). 54w*2 Let o(k) = 89k2. Let g(r) be the third derivative of -r5/15 + 9r2 - 4. What is g(o(c))? -31684c*4 Let i(l) be the third derivative of 0l*4 + 21l*2 + 0l*3 + 0l + 0 - 1/60l5. Let t(c) = -12c*2. Determine t(i(d)). -12d*4 Let u(r) = -3r - 2. Let f(h) = 1089h2. Determine f(u(q)). 9801q*2 + 13068q + 4356 Let r(s) = 2s2. Let a(x) be the second derivative of 0x*2 + 0 - 32x - 5/6x3. Give a(r(q)). -10q*2 Let p(r) = -60647r2. Let k(x) = x2. Give k(p(f)). 3678058609f4 Let g(u) = -u2 + 15. Let s(z) = -2z*2 + 29. Let c(h) = 10g(h) - 6s(h). Let t(i) be the first derivative of i2 - 191. Determine t(c(w)). 4w*2 - 48 Let k(h) = 4h + 0h - 3h. Let m(x) be the third derivative of -x*4/4 + 4x*2. What is k(m(f))? -6f Let g(f) = 208f2. Let b(o) = -82o. Give b(g(w)). -17056w2 Let t(v) = 8v. Let u(o) = 33o2. What is t(u(q))? 264q*2 Let k(a) = -4a + 10. Let c(r) = 12r - 32. Let o(x) = -5c(x) - 16k(x). Let f(v) = 142v*2. Calculate o(f(p)). 568p*2 Let t(j) be the first derivative of 11j*3/3 - 7. Let b(f) = 5f + 6. Let u(h) = -18h - 22. Let r(w) = -22b(w) - 6u(w). Determine r(t(k)). -22k*2 Let f = -3 + 9. Suppose -2j - 2 = -f. Let b(v) = 3 - j - v - 1. Let s(z) = -12z. Calculate s(b(h)). 12h Let s(q) = 1078q2 - 1. Let h(u) = 6u*2 - 2u. What is h(s(y))? 6972504y4 - 15092y*2 + 8 Let t(v) = 4v + 8. Let p(z) = -5z - 12. Let s(w) = 2p(w) + 3t(w). Let h(j) = 2j + 151. Give h(s(b)). 4b + 151 Let g(n) = 5n + 3. Let r(m) = 6m + 4. Let t(s) = -4g(s) + 3r(s). Let o(i) = -21i. What is t(o(y))? 42y Let u(o) = -124o2. Let m(j) = j2 - 2j. Let h(s) = -5s*2 + 11s. Let c(b) = -2h(b) - 11m(b). Give u(c(p)). -124p4 Let p(r) = -26024r*2. Let i(x) = 3x. What is p(i(w))? -234216w2 Let v(u) = -4u + 33. Let g(s) = 11s2 + 3. Determine g(v(p)). 176p*2 - 2904p + 11982 Let b(m) = 9m + 2. Let s(q) = 39q + 9. Let x(v) = 18b(v) - 4s(v). Let h(t) = 0 + t*2 + 0. Calculate x(h(f)). 6f*2 Let p be (-33)/88 - 35/(-8). Let o(q) be the second derivative of 0q*2 + pq + 0 + 1/2q3. Let d(u) = -6u. Determine d(o(l)). -18l Let g(v) = -116v*2 + 39v*2 + 34v*2 + 38v*2. Let a(b) = -13b*2 + 2b. Calculate a(g(m)). -325m4 - 10m*2 Let r(u) = -8u*2. Suppose 222x = 116x + 113x. Let h(d) be the third derivative of 0 + 0d + 0d*4 + xd*3 + 1/30d*5 - 5d*2. What is h(r(v))? 128v*4 Let w(h) = -10h + 2100. Let o(u) = 4u2. Calculate o(w(i)). 400i*2 - 168000i + 17640000 Let g(o) = o. Let i(z) = 5z. Let b(t) = 7g(t) - 2i(t). Let x(w) = 10w*2 + 2. What is x(b(m))? 90m*2 + 2 Let o(h) = -21h. Suppose -2t + 0 + 4 = 0. Let b(d) = -8d*2 + 2d*2 + 4d*t. Give b(o(l)). -882l*2 Let a(j) = -5j*2 - 69j. Let u(d) = d*2 + d + 1. Let b(l) = -5l*2 - 6l - 6. Let r(v) = b(v) + 6u(v). Give a(r(q)). -5q*4 - 69q2 Let l(t) = t2 - 2t - 2. Suppose 4p - 25 = 3p - 4m, 4m - 15 = p. Let r(h) = -3h*2 + 5h + 5. Let v(b) = pl(b) + 2r(b). Let y(g) = -14g. Give v(y(a)). -196a*2 Let f(q) = 5q + 10. Let s(x) be the first derivative of 0x + 0x*2 - 1/3x*3 - 48. Determine s(f(a)). -25a*2 - 100a - 100 Let z(k) = 139k2. Let q(d) = 3750d. Determine q(z(o)). 521250o2 Let l(u) = 3u. Let s be -3 - (-16 + 5 + -4). Suppose -s = -4i + 12. Let j(d) = id - d - 2d. What is j(l(q))? 9q Let s(o) be the second derivative of -11o*4/1	{ "pile_set_name": "DM Mathematics" }
rest integer? 10 What is the eighth root of 543 to the nearest integer? 2 What is the fifth root of 22174 to the nearest integer? 7 What is 62992 to the power of 1/2, to the nearest integer? 251 What is 39957 to the power of 1/2, to the nearest integer? 200 What is the cube root of 104 to the nearest integer? 5 What is the ninth root of 8359 to the nearest integer? 3 What is the square root of 35455 to the nearest integer? 188 What is the sixth root of 150 to the nearest integer? 2 What is 1006 to the power of 1/2, to the nearest integer? 32 What is 14802 to the power of 1/2, to the nearest integer? 122 What is the seventh root of 927 to the nearest integer? 3 What is 2064 to the power of 1/5, to the nearest integer? 5 What is the fifth root of 31970 to the nearest integer? 8 What is the fourth root of 11437 to the nearest integer? 10 What is the eighth root of 620 to the nearest integer? 2 What is 934 to the power of 1/2, to the nearest integer? 31 What is the eighth root of 4441 to the nearest integer? 3 What is the cube root of 5011 to the nearest integer? 17 What is the fourth root of 141392 to the nearest integer? 19 What is the sixth root of 1293 to the nearest integer? 3 What is 1622 to the power of 1/3, to the nearest integer? 12 What is the cube root of 1519 to the nearest integer? 11 What is the third root of 11642 to the nearest integer? 23 What is the square root of 21417 to the nearest integer? 146 What is the square root of 1308 to the nearest integer? 36 What is the seventh root of 7788 to the nearest integer? 4 What is the square root of 2890 to the nearest integer? 54 What is the cube root of 433 to the nearest integer? 8 What is the tenth root of 530 to the nearest integer? 2 What is the cube root of 1096 to the nearest integer? 10 What is the square root of 678 to the nearest integer? 26 What is 4543 to the power of 1/3, to the nearest integer? 17 What is the third root of 7929 to the nearest integer? 20 What is the sixth root of 12855 to the nearest integer? 5 What is the fourth root of 372 to the nearest integer? 4 What is 984 to the power of 1/4, to the nearest integer? 6 What is 84245 to the power of 1/4, to the nearest integer? 17 What is the third root of 6621 to the nearest integer? 19 What is 62991 to the power of 1/2, to the nearest integer? 251 What is the square root of 286 to the nearest integer? 17 What is the cube root of 13289 to the nearest integer? 24 What is the seventh root of 842 to the nearest integer? 3 What is 296 to the power of 1/3, to the nearest integer? 7 What is the fifth root of 708 to the nearest integer? 4 What is the third root of 53572 to the nearest integer? 38 What is the cube root of 3965 to the nearest integer? 16 What is the third root of 4394 to the nearest integer? 16 What is 3898 to the power of 1/2, to the nearest integer? 62 What is the cube root of 202 to the nearest integer? 6 What is the square root of 110345 to the nearest integer? 332 What is the third root of 6598 to the nearest integer? 19 What is the cube root of 4013 to the nearest integer? 16 What is 1024 to the power of 1/8, to the nearest integer? 2 What is 4167 to the power of 1/2, to the nearest integer? 65 What is 2353 to the power of 1/2, to the nearest integer? 49 What is 14962 to the power of 1/2, to the nearest integer? 122 What is 27498 to the power of 1/3, to the nearest integer? 30 What is 213 to the power of 1/5, to the nearest integer? 3 What is 4885 to the power of 1/2, to the nearest integer? 70 What is 19116 to the power of 1/2, to the nearest integer? 138 What is 11846 to the power of 1/5, to the nearest integer? 7 What is the square root of 10695 to the nearest integer? 103 What is the fifth root of 25888 to the nearest integer? 8 What is the square root of 136 to the nearest integer? 12 What is the cube root of 420 to the nearest integer? 7 What is 14013 to the power of 1/6, to the nearest integer? 5 What is the square root of 21858 to the nearest integer? 148 What is 188 to the power of 1/2, to the nearest integer? 14 What is 45025 to the power of 1/3, to the nearest integer? 36 What is the third root of 563 to the nearest integer? 8 What is the square root of 503 to the nearest integer? 22 What is 3417 to the power of 1/5, to the nearest integer? 5 What is the cube root of 592 to the nearest integer? 8 What is 1415 to the power of 1/2, to the nearest integer? 38 What is 10 to the power of 1/3, to the nearest integer? 2 What is the square root of 235 to the nearest integer? 15 What is 1301 to the power of 1/3, to the nearest integer? 11 What is 26718 to the power of 1/10, to the nearest integer? 3 What is 55 to the power of 1/3, to the nearest integer? 4 What is 1380 to the power of 1/7, to the nearest integer? 3 What is 204 to the power of 1/7, to the nearest integer? 2 What is 60261 to the power of 1/2, to the nearest integer? 245 What is the third root of 15112 to the nearest integer? 25 What is the tenth root of 776 to the nearest integer? 2 What is 14411 to the power of 1/2, to the nearest integer? 120 What is 1087 to the power of 1/8, to the nearest integer? 2 What is the fifth root of 1099 to the nearest integer? 4 What is 28271 to the power of 1/5, to the nearest integer? 8 What is 18492 to the power of 1/2, to the nearest integer? 136 What is the sixth root of 9032 to the nearest integer? 5 What is the cube root of 73507 to the nearest integer? 42 What is 704 to the power of 1/8, to the nearest integer? 2 What is the cube root of 9 to the nearest integer? 2 What is the square root of 628 to the nearest integer? 25 What is the cube root of 14231 to the nearest integer? 24 What is the third root of 189 to the nearest integer? 6 What is the cube root of 27 to the nearest integer? 3 What is the square root of 15207 to the nearest integer? 123 What is 8502 to the power of 1/4, to the nearest integer? 10 What is 6190 to the power of 1/3, to the nearest integer? 18 What is the cube root of 101948 to the nearest integer? 47 What is the square root of 1557 to the nearest integer? 39 What is 2437 to the power of 1/2, to the nearest integer? 49 What is 175536 to the power of 1/3, to the nearest integer? 56 What is 1033 to the power of 1/2, to the nearest integer? 32 What is 47797 to the power of 1/8, to the nearest integer? 4 What is 172 to the power of 1/6, to the nearest integer? 2 What is the cube root of 1228 to the nearest integer? 11 What is the fourth root of 208819 to the nearest integer? 21 What is 170 to the power of 1/5, to the nearest integer? 3 What is the fifth root of 3528 to the nearest integer? 5 What is 44000 to the power of 1/10, to the nearest integer? 3 What is 30504 to the power of 1/2, to the nearest integer? 175 What is the third root of 2693 to the nearest integer? 14 What is 3926 to the power of 1/3, to the nearest integer? 16 What is the fourth root of 7893 to the nearest integer? 9 What is 1635 to the power of 1/2, to the nearest integer? 40 What is the cube root of 1430 to the nearest integer? 11 What is the third root of 1274 to the nearest integer? 11 What is the cube root of 62068 to the nearest integer? 40 What is the square root of 19167 to the nearest integer? 138 What is the fourth root of 3645 to the nearest integer? 8 What is the square root of 266 to the nearest integer? 16 What is 113 to the power of 1/2, to the nearest integer? 11 What is 24112 to the power of 1/2, to the nearest integer? 155 What is 58299 to the power of 1/3, to the nearest integer? 39 What is 884 to the power of 1/2, to the nearest integer? 30 What is the cube root of 7349 to the nearest integer? 19 What is 14186 to the power of 1/2, to the nearest integer? 119 What is the seventh root of 1850 to the nearest integer? 3 What is the fifth root of 11163 to the nearest integer? 6 What is the square root of 853 to the nearest integer? 29 What is the square root of 67420 to the nearest integer? 260 What is 49059 to the power of 1/2, to the nearest integer? 221 What is 45601 to the power of 1/7, to the nearest integer? 5 What is the third root of 117216 to the nearest integer? 49 What is the fourth root of 25549 to the nearest integer? 13 What is the cube root of 1440 to the nearest integer? 11 W	{ "pile_set_name": "DM Mathematics" }
= 0. Suppose 0 = -3o + 2l + 25, 8o + p = 11o + 2l. Solve -oj = -19 + 4 for j. 3 Let p(v) = -30v - 1743. Let a be p(-59). Solve 0 = 37c - 46c + a for c. 3 Let y be 3 + -1(1 - 0). Let n(i) = -i*3 - 34i*2 + 33i - 70. Let w be n(-35). Suppose -yu - 3u = w. Solve ug - 3 = g for g. -3 Let w(b) = -7b*2 + 393b - 45. Let d be w(56). Solve 2q - 36 = dq for q. -4 Let l = 55 - 50. Let s(x) = -x + 4. Let m be s(-2). Let d be -2 + 8/m - (-930)/45. Solve 0z - lz = d for z. -4 Suppose -g - 5z + 4 = -41, 0 = -2g - 3z + 62. Suppose x - 11l + 9l = 10, -3x - g = 5l. Solve -12 = -xy + 4y for y. -3 Let l = -33 + 36. Suppose -lt = 35 + 4. Let h(q) = 2q + 31. Let p be h(t). Solve 2u + 12 = pu for u. 4 Suppose -102 = -13m + 80. Let y(f) = -f + 20. Let j be y(m). Solve -j = 2o - 4o for o. 3 Suppose 2j - 54 = -14. Let k be ((-13)/4 + j/5)36. Solve 2b = -7b - k for b. -3 Suppose -2t = l + l - 412, -4l = -3t - 852. Let c = 215 - l. Solve -c = -2n - 13 for n. -4 Let u be -3(0 + 196/21). Let b(i) = -i - 23. Let h be b(u). Solve -h = 4t - 1 for t. -1 Suppose 0 = -5k - 3g + 39, k + 2g - 137 + 125 = 0. Solve 1 + k = -n for n. -7 Let r be 4/6 - (-23)/(-3). Suppose -147 = -17s - 4s. Let d be ((-2)/s)/(r/245). Solve -do + 13o = -12 for o. -4 Let q be 226/10 + -1522/(-825). Suppose -qk - 22k = -8k. Solve -c + 3 - 6 = k for c. -3 Let s(g) = -g2 - g + 6. Let n be s(-3). Let k(v) = -8v. Let w be k(n). Solve 10f - 15f = w for f. 0 Let v(o) = o*3 + 86o*2 - 86o + 87. Let u be v(-87). Solve u = 51j - 46j + 25 for j. -5 Suppose 13z = -5j + 10z + 727, -2z = -2j + 294. Let h = -144 + j. Solve h + 8 = -2x for x. -5 Let q = -9 - -135. Suppose -4g = 3u + q, -2g - 2u - 95 = g. Let v be (g/6 - 2)-2. Solve -14w + v = -9w for w. 3 Let g = 2768 + -2704. Solve 9z - 10 = -g for z. -6 Let u(y) = y + 11. Let b be u(-14). Let h be (-75)/65 - 2/(-13). Let m be ((-12)/b - 5)h. Solve -7 = -2s - m for s. 3 Let f(n) = n*2 - 9n - 10. Let x(b) = 2b2 - 17b - 19. Let t(v) = -5f(v) + 3x(v). Suppose -d = -83 + 76. Let i be t(d). Solve ic = c + 4 for c. -4 Suppose 3u - 5w + 6 - 16 = 0, 3w + 6 = u. Suppose u = -12m + 122 - 74. Solve -5l - ml = 45 for l. -5 Let c = 7 + -34. Suppose 99 = -4q + 3t, -4t = -5q - 6t - 118. Let m = q - c. Solve 3y + m = 2y for y. -3 Suppose -603 = -3z - 189. Solve z = 11k + 83 for k. 5 Suppose -3v = 12k - 8k - 302, -5k - 5v = -385. Solve ky = 57y - 98 for y. -7 Let t(h) = h3 - 6h*2 - 6h - 5. Let m be t(7). Suppose 8l = 10l - 412. Let q = l + -200. Solve -mx = -4 + q for x. -1 Suppose 0 = -2m - 3g - 338, -2g - 698 = 4m - 7g. Let x = m + 175. Solve -2d - xd = -10 for d. 2 Let k(v) = 2v3 - 19v*2 - 7v - 5. Let p be k(10). Solve pi = -157 + 7 for i. -6 Suppose -8c + 4c = 0. Let y = 23 - 5. Let d be (y - 18) + (0 - -2). Solve -dz + z + 3 = c for z. 3 Let a = -8302 - -8307. Solve -m - a = -2 for m. -3 Let z(x) = 11x + 1. Let s be z(2). Let j(q) = 2q*3 + 120q*2 + 113q - 291. Let c be j(-59). Solve s = -cf + 15 for f. -2 Suppose 19 - 23 = -2a. Let m be 3 + (a - 4)/(-1). Suppose -m + 17 = 6w. Solve -d = 5 - w for d. -3 Let r = 20587 + -20231. Solve rs - 348s - 8 = 0 for s. 1 Let c = 108 - 100. Let k be c - 27/3 - (-7 - 0). Solve 7d = kd - 1 for d. -1 Let r(i) = i2 - 13i - 14. Let o(g) = -12 + 18 - 5g - 12. Let w be o(-4). Let t be r(w). Solve -3l + 3 - 18 = t for l. -5 Let i = 13 + -9. Let p(a) = 12a - 54. Let y be p(5). Let v be (-93)/(-4) - y/24. Solve ig + v - 7 = 0 for g. -4 Suppose 3i = 5x + 352 + 133, -147 = -i - 2x. Solve 32p + 27 - i = 0 for p. 4 Suppose -2w = -4c, -2w + 5 = -w + 3c. Suppose 0 = -9d + 14d + 255. Let r = d - -53. Solve 0l + wl = -r for l. -1 Let w = -1093 - -1108. Solve 31 - 91 = -wn for n. 4 Let o = -3712 - -3717. Solve -o = 18c - 95 for c. 5 Let p = 39 - 37. Suppose -2a = 2 + 2, 2q = -2a + p. Let o be (q/3)/((5/(-3))/(-5)). Solve 0 = -4s + o + 9 for s. 3 Let w be (378/(-216))/(1/(-48)). Solve -3v - w + 90 = 0 for v. 2 Let m(s) = -s2 - 62s - 891. Let a be m(-24). Solve 36 + 6 = -ac for c. -2 Let c(o) = -o3 + 46o*2 + 258o - 76. Let q be c(51). Solve -75k = -qk + 6 for k. 3 Let t = -107 + 111. Suppose -2r = r + ty - 8, 0 = -2y - 2. Let n be 0(r + (-39)/9). Solve -c + 2 + n = 0 for c. 2 Let v(p) = 2p3 - 94p*2 + 115p - 179. Let d be v(46). Solve 0 = 9n + 825 - d for n. 6 Suppose 3h - 42 = 2u + 22, -h - 4 = 0. Let b = -16 - u. Let c = -22 + b. Solve c = -3v + 7 + 5 for v. 4 Let s = -15681 + 15700. Solve -sz + 0 = -76 for z. 4 Suppose 208 = -8r + 272. Suppose l + 5 = h + 11, 3h + r = -2l. Solve lx + 7 - 15 = 0 for x. 4 Let u be (2/3)/((-1)/(-3)). Suppose 5c = -4v + 122 + 3805, 3v + 4c - 2944 = 0. Let k = 990 - v. Solve -kl + 0 = -u for l. 1 Suppose 204 = 5l - 2j - 131, 3l + 2j = 185. Suppose 3v + 4d = l, -4v - 4d + 2d + 70 = 0. Solve -v - 7 = -11o for o. 2 Let n(u) = u3 - u2 - 4u + 3. Let j be n(2). Let f be j + 0 + 35 + (-17 - -7). Solve 19 - f = l for l. -5 Suppose -i - q = -6, -4q - 6 = -3i - 3q. Suppose 20d + id = -22d. Solve -5 + d = -5l for l. 1 Suppose -46w + 277 = -91. Solve -wl - 6l - 2l = 0 for l. 0 Let m = 8800 - 8800. Solve 7q + 2q - 54 = m for q. 6 Let z be (-6)/(-4)(-39 + 41). Let n be 3 + (16/(-1))/(-1). Suppose 2a + n = 5a - 2i, -5 = 5a + 4i. Solve au + z = -6 for u. -3 Suppose 0 = 36h + 13h. Suppose h = -29y + 27y + 6. Suppose -4c - c + 12 = -3r, 3c = -2r - 8. Solve yz = -cz + 15 for z. 5 Let k(v) = -v2 + 5v + 46. Let d be k(9). Solve dn - 22n = 36 for n. -3 Let d(c) = 2c3 + 3c*2 - c - 10. Let o be d(3). Suppose 3k - o = -44. Solve -4t = -2t - k for t. 4 Suppose 4n - 215 = 3p, -5p = 4n - 2n - 127. Let g = n - 44. Solve 8 = -4y - g for y. -5 Let y be 10/3(-6720)/200. Let x be ((-3)/2)/(21/y). Solve 12r - xr = -4 for r. -1 Let l(r) = 3r*2 + 194r + 1116. Let x be l(-6). Solve -48p = x - 12 for p. -1 Let n be ((-16)/(-32))/((-1)/10)296/(-40). Solve s + n - 33 = 0 for s. -4 Let h(j) = 2j2 + 12j - 52. Let y be h(-9). Let l(r) = 2r - 10. Let v be l(9). Solve -2z - yz = -v for z. 2 Suppose -26w + 665 = 22w - 13w. Suppose c = 2c - 3. Suppose -cl + r + 3 = 0, 5r - 2 - w = -3l. Solve lq + 1 = 5 for q. 2 Suppose 270 + 40 = -5j. Let z = 87 + j. Suppose -3u = -z - 8. Solve 3b + 4 = -u for b. -5 Suppose -34h + 344 = -26h. Solve hr - 28r + 45 = 0 for r. -3 Suppose -5g - 4c + 104 = 0, -2g + 7c = 2c - 68. Let p be (-8)/g0/2. Solve -12 + p = 3l for l. -4 Let n(o) = -o3 + 2o*2 + 14o - 22. Suppose 327t = 325t + 8. Let c be n(t). Solve 0v + c = -v for v. -2 Let f be (-9)/(-252)1887. Solve -28 = -fa - 28 for a. 0 Suppose -3n - 2 = -17. Suppose 12q - 105 = nq. Suppose -3t + 40 = -5c, t - 4c - q = 10. Solve -tj + 7 + 18 = 0 for j. 5 Suppose 3v - 643 = -a, 4v = a + 896 - 34. Let t = -200 + v. Solve tw - 4 = 19w for w. -1 Suppose -4w - 161 - 207 = 0. Let c = 96 + w. Suppose cm + 28 = 2n, n + 6m - m = -21. Solve no - o + 12 = 0 for o. -4 Let h = 2136 - 2108. Solve 0l + 140 = hl for l. 5 Let f = 18711 + -18612. Solve -34 = 116z - fz for z. -2 Let c(m) = -m*3 + 14m*2 - 15m + 28. Let t be c(13). Suppose -tg - 7 = -71. Let x = -32 + g. Solve -3q - 2q - 20 = x for q. -4 Let j(c) = -c3 - 2c*2. Let k(w) = 2w*3 + 24w*2 - 5w + 24. Let v(r) = -4j(r) - k(r). Let b be v(8). Solve -11t - b = -3t for t. -2 Suppose 388p = 470p - 6396. Solve 94h = ph - 80 for h. -5 Let u be ((-1)/(-2) - 1)-40. Let h be (-8)/u - 54/(-10). Solve 6 = -hf + 11 for f. 1 Suppose -3p + 5a - 3 = 8a, 2p = 4a + 16. Suppose 4k - 20 = -2v, 3k - 17 = v - p. Solve q + 4q = -k for q. -1 Let f be (-4233 - -4228) + (0 - (-6 + 1)). Suppose -4n - 23 = -x, -3x + 5n + 0n + 34 = 0. Solve -xg - g = f for g. 0 Suppose -2w + 101g + 152 = 99g, -11g + 44 = 0. Solve -wu + 76u = 0 for u. 0 Let f = -894 - -904. Solve f - 1 = -3c for c. -3 Suppose -40t = -37t + 18. Let o(f) = 9f + 59. Let c be o(t). Solve -5r = 10 - c for r. -1 Suppose -2m - 7m = 10m. Suppose -2s - 2v + 10 = -0s, m = s + 4*v - 8. Solve 8 - s = -f for f. -4 Let n = -5150 - -5556. Solv	{ "pile_set_name": "DM Mathematics" }
ithout replacement from olawj? 1/10 Three letters picked without replacement from zwlllzmlmewgwglwl. What is prob of picking 2 g and 1 e? 1/680 Two letters picked without replacement from ffpppf. Give prob of picking 2 f. 1/5 Four letters picked without replacement from {u: 2, e: 4}. Give prob of picking 1 u and 3 e. 8/15 Calculate prob of picking 1 c and 1 s when two letters picked without replacement from {j: 7, c: 6, h: 2, s: 1, w: 4}. 3/95 Three letters picked without replacement from {r: 12, b: 1, p: 6}. Give prob of picking 1 p and 2 r. 132/323 What is prob of picking 1 d and 1 x when two letters picked without replacement from {w: 3, d: 3, r: 1, q: 2, x: 1}? 1/15 Four letters picked without replacement from rrxrrrrrrrrr. Give prob of picking 4 r. 2/3 What is prob of picking 3 a when three letters picked without replacement from ajljajjjaa? 1/30 Four letters picked without replacement from {m: 6, v: 1, c: 1, f: 2, t: 6, u: 2}. Give prob of picking 1 v, 1 t, 1 c, and 1 f. 1/255 What is prob of picking 1 r and 1 o when two letters picked without replacement from rruoo? 2/5 What is prob of picking 2 k when two letters picked without replacement from {k: 3, t: 1, s: 3, e: 1, c: 2, q: 1}? 3/55 Calculate prob of picking 1 z, 2 a, and 1 c when four letters picked without replacement from ccacacaaccz. 6/55 Four letters picked without replacement from ttdgllljddlllgtltjjg. What is prob of picking 1 g, 1 d, 1 l, and 1 t? 84/1615 Calculate prob of picking 2 t when two letters picked without replacement from {b: 5, k: 8, t: 3}. 1/40 Calculate prob of picking 1 s, 1 z, and 1 c when three letters picked without replacement from czcsncszczn. 8/55 Two letters picked without replacement from {r: 1, s: 1, p: 1, f: 2, i: 1, a: 1}. Give prob of picking 1 f and 1 r. 2/21 Calculate prob of picking 1 y, 2 a, and 1 z when four letters picked without replacement from azzezeauzy. 2/105 What is prob of picking 1 l, 1 u, and 1 h when three letters picked without replacement from {l: 1, u: 6, h: 7, r: 1}? 6/65 Three letters picked without replacement from uaiimuaukmkuaamauap. What is prob of picking 1 m and 2 i? 1/323 What is prob of picking 2 t and 1 l when three letters picked without replacement from {x: 4, g: 4, t: 5, w: 1, l: 2}? 1/28 Three letters picked without replacement from {m: 2, t: 8}. Give prob of picking 1 t and 2 m. 1/15 What is prob of picking 3 b when three letters picked without replacement from bbbkbdkbbbbbdb? 30/91 What is prob of picking 1 y and 1 g when two letters picked without replacement from {c: 2, g: 3, b: 2, y: 2}? 1/6 Three letters picked without replacement from {r: 2, d: 3}. Give prob of picking 2 d and 1 r. 3/5 Three letters picked without replacement from ppvvvuvuvvuvvvv. Give prob of picking 3 v. 24/91 Calculate prob of picking 1 w and 1 a when two letters picked without replacement from {h: 1, t: 1, b: 4, a: 2, w: 2}. 4/45 Two letters picked without replacement from {j: 7, a: 1, m: 1, r: 4, s: 4, q: 3}. Give prob of picking 1 m and 1 r. 2/95 What is prob of picking 2 p and 2 v when four letters picked without replacement from {v: 1, p: 3, b: 1, q: 2}? 0 Calculate prob of picking 1 m and 3 s when four letters picked without replacement from {r: 1, s: 4, m: 2, b: 7}. 8/1001 What is prob of picking 2 a when two letters picked without replacement from {a: 12, d: 1}? 11/13 Four letters picked without replacement from {p: 5, v: 15}. What is prob of picking 4 p? 1/969 Four letters picked without replacement from vvqjjqvyvyvqjjq. Give prob of picking 3 q and 1 v. 4/273 What is prob of picking 3 i when three letters picked without replacement from iiiiiii? 1 Two letters picked without replacement from {e: 1, l: 2, d: 2}. Give prob of picking 1 l and 1 e. 1/5 Two letters picked without replacement from oooeoevooooeveeoee. What is prob of picking 2 e? 7/51 Calculate prob of picking 1 x and 1 c when two letters picked without replacement from xhhhxhhhcchh. 2/33 Calculate prob of picking 1 r, 1 e, and 2 o when four letters picked without replacement from oeeoememmeoeeoooromo. 196/4845 What is prob of picking 2 d and 1 o when three letters picked without replacement from okddkdddddo? 14/55 Calculate prob of picking 2 a when two letters picked without replacement from uaanaajuuaazajju. 7/40 Calculate prob of picking 1 b and 2 a when three letters picked without replacement from abbaabb. 12/35 Two letters picked without replacement from hrhwhzwwwwrz. What is prob of picking 1 w and 1 z? 5/33 Calculate prob of picking 2 n when two letters picked without replacement from {n: 3, e: 1}. 1/2 Two letters picked without replacement from {s: 3, g: 9, c: 1, j: 1}. Give prob of picking 1 j and 1 g. 9/91 Four letters picked without replacement from {h: 9}. What is prob of picking 4 h? 1 What is prob of picking 2 p and 1 l when three letters picked without replacement from llllllplp? 1/12 Three letters picked without replacement from {u: 3, h: 1, a: 1, c: 8, b: 3, w: 2}. Give prob of picking 1 h, 1 a, and 1 b. 1/272 What is prob of picking 3 q when three letters picked without replacement from {q: 7}? 1 Three letters picked without replacement from {b: 1, g: 2, e: 1, i: 1, d: 1, r: 1}. Give prob of picking 1 e, 1 b, and 1 d. 1/35 Calculate prob of picking 1 m and 1 d when two letters picked without replacement from dddmdddddm. 16/45 Calculate prob of picking 2 f and 1 x when three letters picked without replacement from fxfxfxf. 18/35 Calculate prob of picking 1 u and 2 s when three letters picked without replacement from {r: 3, u: 2, s: 5, j: 3}. 10/143 Two letters picked without replacement from {p: 7, v: 2}. Give prob of picking 2 v. 1/36 Calculate prob of picking 3 n when three letters picked without replacement from nnn. 1 Three letters picked without replacement from {c: 7, f: 4}. Give prob of picking 3 f. 4/165 Two letters picked without replacement from asoadaduxuoa. What is prob of picking 1 s and 1 o? 1/33 Calculate prob of picking 1 l and 1 u when two letters picked without replacement from {s: 1, c: 10, l: 4, r: 1, u: 3}. 4/57 What is prob of picking 2 m and 1 l when three letters picked without replacement from rrrlrmlllrmllmrrrl? 7/272 What is prob of picking 4 r when four letters picked without replacement from rrrrbrrrrbbrrr? 30/91 Two letters picked without replacement from {p: 1, g: 2, t: 4}. Give prob of picking 1 p and 1 g. 2/21 What is prob of picking 1 p and 2 e when three letters picked without replacement from {x: 1, p: 4, n: 2, e: 2, v: 7}? 1/140 Two letters picked without replacement from {d: 1, j: 2, r: 1, q: 1, f: 6, w: 4}. What is prob of picking 1 d and 1 w? 4/105 Two letters picked without replacement from kvgzcsszkzzkzkksk. What is prob of picking 1 k and 1 c? 3/68 What is prob of picking 1 b and 3 m when four letters picked without replacement from mbhmeembqheqhqqq? 1/910 Two letters picked without replacement from {v: 2, k: 3, s: 2, y: 4, w: 2}. What is prob of picking 1 k and 1 s? 1/13 Four letters picked without replacement from uuwuuwuwuuwwwwuuwwww. What is prob of picking 3 u and 1 w? 308/1615 What is prob of picking 1 i, 1 n, 1 t, and 1 u when four letters picked without replacement from {t: 1, i: 2, n: 2, u: 2, m: 1}? 4/35 Calculate prob of picking 1 g and 1 j when two letters picked without replacement from cqcgercgggeejge. 1/21 What is prob of picking 2 n and 2 q when four letters picked without replacement from qqnnqoqnq? 5/21 Calculate prob of picking 1 r, 1 a, and 1 z when three letters picked without replacement from {q: 3, a: 10, z: 2, r: 1, t: 1}. 1/34 Calculate prob of picking 2 m when two letters picked without replacement from {m: 6, v: 1, r: 7, q: 6}. 3/38 What is prob of picking 2 t and 1 n when three letters picked without replacement from ttnttnnnnn? 3/10 Three letters picked without replacement from {i: 2, b: 1, k: 3, u: 1}. Give prob of picking 1 b, 1 i, and 1 k. 6/35 Calculate prob of picking 2 v when two letters picked without replacement from vlvv. 1/2 Two letters picked without replacement from jllff. Give prob of picking 1 j and 1 l. 1/5 Four letters picked without replacement from {u: 4}. Give prob of picking 4 u. 1 Calculate prob of picking 1 y and 2 s when three letters picked without rep	{ "pile_set_name": "DM Mathematics" }
-36, -2, 7 in decreasing order. 7, 2, -2, -36 Sort -525, 1/3, 53, 2. -525, 1/3, 2, 53 Put -4, -28, 173/3 in decreasing order. 173/3, -4, -28 Sort -32, 0, 446 in increasing order. -32, 0, 446 Put 3, 1/4, 3/5, 341, 1 in decreasing order. 341, 3, 1, 3/5, 1/4 Sort 14, 47, -4, -1. -4, -1, 14, 47 Put -6681, -5, 2 in descending order. 2, -5, -6681 Sort -1, 2, 364, 3, 4, 15 in descending order. 364, 15, 4, 3, 2, -1 Sort 23, 1, 0, -3, -1, 200 in descending order. 200, 23, 1, 0, -1, -3 Sort 4, 5, -278, -6, -3. -278, -6, -3, 4, 5 Sort -4, 4, 460, 0 in increasing order. -4, 0, 4, 460 Sort 5, 1317, 1, -3 in decreasing order. 1317, 5, 1, -3 Put -2, -18, 2773 in ascending order. -18, -2, 2773 Put -1, -12387, 2/7, -2/9 in descending order. 2/7, -2/9, -1, -12387 Sort 2, 3, 19, -3328 in decreasing order. 19, 3, 2, -3328 Put 1, -2, 48, -130, -3 in descending order. 48, 1, -2, -3, -130 Put 1830/73, 0.1, -1 in descending order. 1830/73, 0.1, -1 Sort 30, 2, 1.3145, -3/2 in descending order. 30, 2, 1.3145, -3/2 Sort -2, -59, -1.83, 1/5, -5, -0.4 in ascending order. -59, -5, -2, -1.83, -0.4, 1/5 Sort -1, 1/473, 3/4, -0.1, 2 in descending order. 2, 3/4, 1/473, -0.1, -1 Sort 125.5, -1/10, -0.11 in decreasing order. 125.5, -1/10, -0.11 Sort -45, -0.1, -33 in decreasing order. -0.1, -33, -45 Put 4, 20, -3, -1, 2 in decreasing order. 20, 4, 2, -1, -3 Sort 4/9, 5, 107, 2, 7, -1/7. -1/7, 4/9, 2, 5, 7, 107 Sort -466, -0.8, -5 in descending order. -0.8, -5, -466 Sort 5/2, -78.8, 12, -0.4, 2 in decreasing order. 12, 5/2, 2, -0.4, -78.8 Put -98, -3, 9, 2 in ascending order. -98, -3, 2, 9 Put -2/7, -1/2, -0.04, -1/7, -3/4 in descending order. -0.04, -1/7, -2/7, -1/2, -3/4 Put -190, -1, 5, 23, 1 in descending order. 23, 5, 1, -1, -190 Put -8, -6, -2099, -1 in descending order. -1, -6, -8, -2099 Sort -13468, 0.3, -5, -0.1, 1/8 in decreasing order. 0.3, 1/8, -0.1, -5, -13468 Sort -12, -900, 0.5 in decreasing order. 0.5, -12, -900 Sort 2, 6, -3, -86, -2, 5 in increasing order. -86, -3, -2, 2, 5, 6 Sort -0.5, -18, -21, 1/12, 0.4. -21, -18, -0.5, 1/12, 0.4 Put -6/155, 5/2, 0.199 in ascending order. -6/155, 0.199, 5/2 Sort 1062, 4, 2, 0, -1, 5 in decreasing order. 1062, 5, 4, 2, 0, -1 Sort -70, 1, 0, -19 in decreasing order. 1, 0, -19, -70 Sort -0.3, 3, 9, -0.454, -4 in descending order. 9, 3, -0.3, -0.454, -4 Sort 5920, 15, 0 in increasing order. 0, 15, 5920 Put 17/4, -3, 49 in decreasing order. 49, 17/4, -3 Sort 7, -8873, -8, -3 in ascending order. -8873, -8, -3, 7 Put 0, -7873, -1 in decreasing order. 0, -1, -7873 Sort 17, -328, -57. -328, -57, 17 Sort -1/7, -3, 0.34629, 2/5. -3, -1/7, 0.34629, 2/5 Put -8, 3, 2, 9, 1 in descending order. 9, 3, 2, 1, -8 Sort -1, 145, 3, 4, 5 in decreasing order. 145, 5, 4, 3, -1 Sort -1, -4, -5, 252, 4, 0. -5, -4, -1, 0, 4, 252 Sort -12, -6, 0, 4, -34 in decreasing order. 4, 0, -6, -12, -34 Sort 0.014, -9, -85/6, -1 in decreasing order. 0.014, -1, -9, -85/6 Sort 1979, 1, -217 in decreasing order. 1979, 1, -217 Sort 19, 2, 126, 22 in ascending order. 2, 19, 22, 126 Put -3, -511, 37 in descending order. 37, -3, -511 Sort -3, -0.413, -5, -2, -0.4. -5, -3, -2, -0.413, -0.4 Put -2, -102, -28, -9 in descending order. -2, -9, -28, -102 Put 133, 3, 2, 25, -3, -5 in ascending order. -5, -3, 2, 3, 25, 133 Sort 6, 5, -6146, 4 in decreasing order. 6, 5, 4, -6146 Put 4, -0.05, -2, 2/9, 1/5 in descending order. 4, 2/9, 1/5, -0.05, -2 Put -0.1, 0.4, 292/623 in ascending order. -0.1, 0.4, 292/623 Sort -5, -4, 89 in increasing order. -5, -4, 89 Sort 0.1, 1/7, 1 in decreasing order. 1, 1/7, 0.1 Sort -3/7, 0.11, 15/2, 1, 0 in ascending order. -3/7, 0, 0.11, 1, 15/2 Put -2/7, 0.5, -5, -1012, 54 in decreasing order. 54, 0.5, -2/7, -5, -1012 Sort 2, -14, 1128, -0.3. -14, -0.3, 2, 1128 Put -5, 1, -8, 4, 3907 in decreasing order. 3907, 4, 1, -5, -8 Sort 2/7, 2/23, -0.5, 2/163, -5, 5. -5, -0.5, 2/163, 2/23, 2/7, 5 Sort -1163, 3, -1, -10 in decreasing order. 3, -1, -10, -1163 Sort -2, -1329, -1 in decreasing order. -1, -2, -1329 Sort 510, 0.4, 1, 4/3, -113. -113, 0.4, 1, 4/3, 510 Sort 13, -1, -178 in ascending order. -178, -1, 13 Sort 4, -4/3, -40/67 in decreasing order. 4, -40/67, -4/3 Sort -9, 5, 7, -2, -1/4, -48. -48, -9, -2, -1/4, 5, 7 Sort -5, 756, -2, 0, 10 in ascending order. -5, -2, 0, 10, 756 Put -2, -8, 5, 15, -69 in increasing order. -69, -8, -2, 5, 15 Sort 72, -3, -0.2, 0.3 in ascending order. -3, -0.2, 0.3, 72 Put -16/11, -1/23, 1/2 in decreasing order. 1/2, -1/23, -16/11 Put -1/2, 1/3, 524 in ascending order. -1/2, 1/3, 524 Put -0.15691, -0.07, 1.7, -5 in ascending order. -5, -0.15691, -0.07, 1.7 Sort 5, -8, -147 in decreasing order. 5, -8, -147 Sort 2, -2, 13143 in ascending order. -2, 2, 13143 Put -0.1, -3/4, 1/85, 0, 5, 0.092 in decreasing order. 5, 0.092, 1/85, 0, -0.1, -3/4 Sort -3, 2/9, -2/5, -2, 0.9774. -3, -2, -2/5, 2/9, 0.9774 Put 4, 1, 3, -106 in decreasing order. 4, 3, 1, -106 Sort -5, 67, -4, 0.4, 1036, -0.4. -5, -4, -0.4, 0.4, 67, 1036 Put -20, -192, -4 in descending order. -4, -20, -192 Put 1, 44, -114 in decreasing order. 44, 1, -114 Sort -127, 1825, -3. -127, -3, 1825 Put 4, 114, 51 in descending order. 114, 51, 4 Put -7371, -2, -6 in decreasing order. -2, -6, -7371 Put -40, -3, -124, 2, -1 in increasing order. -124, -40, -3, -1, 2 Sort -4054.8, 5, 0.3 in increasing order. -4054.8, 0.3, 5 Put 10581, 1, 2, 0 in increasing order. 0, 1, 2, 10581 Sort 2, -222, -4, -2/19, -0.9 in decreasing order. 2, -2/19, -0.9, -4, -222 Put -5, -15717, 18, -3 in decreasing order. 18, -3, -5, -15717 Sort -1, 1, -4, 15003 in descending order. 15003, 1, -1, -4 Put 181, 100, 28 in decreasing order. 181, 100, 28 Sort -0.5, -11, 0.5, -96. -96, -11, -0.5, 0.5 Sort 17, -23, -2/3, 5, 0, 4 in decreasing order. 17, 5, 4, 0, -2/3, -23 Sort -5, 2, -8, 3, 307. -8, -5, 2, 3, 307 Put 1/8, 9, -12, 1/21, 4 in descending order. 9, 4, 1/8, 1/21, -12 Sort 8, 1, -4, -5, -2, 10 in increasing order. -5, -4, -2, 1, 8, 10 Sort 4, -38, -1, 0, -269. -269, -38, -1, 0, 4 Sort -2, 0.5, 2/7, -698, 0.2, 0.1 in decreasing order. 0.5, 2/7, 0.2, 0.1, -2, -698 Sort -2, 16, 2.1, 31. -2, 2.1, 16, 31 Put -5/2, 2, -0.01, 17/3, 27 in increasing order. -5/2, -0.01, 2, 17/3, 27 Sort 0, -21, -3, -65, 3, 4 in descending order. 4, 3, 0, -3, -21, -65 Put 2, 45645, 0, -3 in increasing order. -3, 0, 2, 45645 Sort 1, -1, 5726, 3 in increasing order. -1, 1, 3, 5726 Sort -4, -1, 1, -6, 20. -6, -4, -1, 1, 20 Sort 11, 7, -30, -4 in increasing order. -30, -4, 7, 11 Sort 2, 25, 49, -3, 3 in decreasing order. 49, 25, 3, 2, -3 Sort 2, -7.3, 1/23. -7.3, 1/23, 2 Sort -3687, 0.2, 1/12 in descending order. 0.2, 1/12, -3687 Sort 1, 3, 5, -4, -490 in ascending order. -490, -4, 1, 3, 5 Sort -0.9, -5, 5, 95/3 in decreasing order. 95/3, 5, -0.9, -5 Sort -6258, -3, 1, 2 in increasing order. -6258, -3, 1, 2 Sort 11, 1, -4, 0, -1. -4, -1, 0, 1, 11 Sort -2/9, 0, -5, 1/8, 17 in decreasing order. 17, 1/8, 0, -2/9, -5 Sort -2/53, 40, 0.05, 3/4 in descending order. 40, 3/4, 0.05, -2/53 Put -16/7, 0.1, 2, 186 in descending order. 186, 2, 0.1, -16/7 Put 0.5, 2/5, -29, 4/665 in decreasing order. 0.5, 2/5, 4/665, -29 Put 3, -4, 190 in decreasing order. 190, 3, -4 Sort 5, 0, 164, 408, 2 in increasing order. 0, 2, 5, 164, 408 Sort -1, 391, -2, 2, 1 in decreasing order. 391, 2, 1, -1, -2 Sort -29, 2, -235, -3 in ascending order. -235, -29, -3, 2 Put -2/1217, -4, 2/15, -2/15, -5 in increasing order. -5, -4, -2/15, -2/1217, 2/15 Put -9, 2, 4352, 1 in decreasing order. 4352, 2, 1, -9 Put -5, -30884, 7 in descending order. 7, -5, -30884 Sort 0.4, 4, -0.3, 0.2699, -3 in ascending order. -3, -0.3, 0.2699, 0.4, 4 Sort -1/3, -232, 4, 11, -2/3, -1. -232, -1, -2/3, -1/3, 4, 11 Sort -2, -8, 11, -1, -5, 16 in decreasing order. 16, 11, -1, -2, -5, -8 Put -11, -0.4, -1/6, 26, -3, 0.02 in decreasing order. 26, 0.02, -1/6, -0.4, -3, -11 Put 5, 3, -1, -4, -37, 0 in increasing order. -37, -4, -1, 0, 3, 5 Put -20216, -2, -2/5, 0.4, -1, 3 in increasing order. -20216, -2, -1, -2/5, 0.4, 3 Put -2, 3/2, -11566, 0.01, 1 in increasing order. -11566, -2, 0.01, 1, 3/2 Sort 176948, -5, -8 in descending order. 176948, -5, -8 Sort -11, -109, 1/6, 3, 1 in ascending order. -109, -11, 1/6, 1, 3 Put -0.3, -14, -13/3, -54 in increasing order. -54, -14, -13/3, -0.3 Sort -84, 1/	{ "pile_set_name": "DM Mathematics" }
20)-3 - (sqrt(10) + (-2sqrt(50))/sqrt(5))/sqrt(2)5. -18sqrt(5) - 2 Simplify (3 + (4-4sqrt(121))/sqrt(11))*2 + (((sqrt(539)-2 - sqrt(539)) + sqrt(539) + sqrt(11) + sqrt(44)/(sqrt(16)/sqrt(4)))2)2 + -1. -96sqrt(11) + 9160 Simplify sqrt(36)/(sqrt(48)/sqrt(4)) + -3-1sqrt(3) + sqrt(3) - (sqrt(63)/sqrt(27))/(4sqrt(35)/sqrt(5)). 59sqrt(3)/12 Simplify (2(sqrt(2673) - 5(-5sqrt(2673) - sqrt(2673) - sqrt(2673))))/((-4sqrt(36))/sqrt(12)-1-6). -27sqrt(11) Simplify (2 + (sqrt(2299) + -2(0 + sqrt(2299)) - sqrt(2299))-4 - (-1 + 1 + -1 + sqrt(19) - sqrt(209)/(sqrt(11) + (sqrt(77)2 - sqrt(77))/sqrt(7))))*2. 525sqrt(19) + 581911/4 Simplify ((sqrt(42)-2)/sqrt(2))/(-1sqrt(700)) + ((-1sqrt(3))2 + -2 - (sqrt(3) - (sqrt(3)-3 + -5))). -19sqrt(3)/5 - 4 Simplify (sqrt(36)/((sqrt(24)2)/sqrt(4))-4)/(sqrt(363)-1 - sqrt(300)-1). 2sqrt(2) Simplify ((-2sqrt(252))/sqrt(4) - ((sqrt(126) - (sqrt(126) - 2sqrt(126)))/sqrt(2) - sqrt(63)))/(1(sqrt(18) - sqrt(2592)-2)/sqrt(2)). -3sqrt(7)/25 Simplify (sqrt(7344)2 + sqrt(51))/(sqrt(3) + (sqrt(3) - (sqrt(3) + sqrt(48)4 + sqrt(3)))) + 2 + sqrt(119)/(sqrt(7)-2) + -1 + 2. -33sqrt(17)/16 + 3 Simplify ((sqrt(24)/sqrt(2))/sqrt(6) + sqrt(22)/sqrt(1584))2 + ((sqrt(264)/sqrt(12))/sqrt(11) - sqrt(12)/(sqrt(6) + sqrt(150))). 5sqrt(2)/6 + 169/72 Simplify (5-2sqrt(85) - ((sqrt(85) - 2sqrt(85))-6 + sqrt(85)))/((-2sqrt(45)-1)/(sqrt(36)/(sqrt(16)/sqrt(4)) + sqrt(9))). -17sqrt(17) Simplify -6((1(sqrt(70) + -2sqrt(70)))/((-1sqrt(490) - sqrt(490)) + sqrt(10)) - (2sqrt(1344))/(sqrt(15)/sqrt(5)6)). 202sqrt(7)/13 Simplify ((sqrt(27)4-3)/((sqrt(90) + (sqrt(90) - (sqrt(90)4 + sqrt(90) + sqrt(90))))/sqrt(10)) + -6((sqrt(24)/sqrt(2))/sqrt(4) + sqrt(3)-2 + -1) + -5)2. 18sqrt(3) + 244 Simplify ((sqrt(325) - (sqrt(325)-1 + 3))5 + -5 + sqrt(39)/sqrt(3)3 + 5)2 + 3. -1590sqrt(13) + 36745 Simplify 2 + -4 + ((6(2sqrt(684) + sqrt(19)))*2 + sqrt(171)/(sqrt(18)/sqrt(2)) + 4)5. 5sqrt(19) + 577998 Simplify (sqrt(539) + 1)-1 + 0 + (sqrt(176) + 1)*2 + -4 + 3. sqrt(11) + 175 Simplify -1(1((sqrt(1331) - sqrt(1331)2) + 1 + (sqrt(1331) + 2 + -1sqrt(1331) - sqrt(1331)))2 + -1). -5332 + 132sqrt(11) Simplify (-1(-1 + sqrt(833))-6)*2 + (sqrt(17) + sqrt(153)5 + sqrt(17) - (sqrt(1700) + -2)). -497sqrt(17) + 30026 Simplify (sqrt(12) + -1sqrt(1452))/(-3(sqrt(6) + -2sqrt(6))) - 1(sqrt(50) + sqrt(250)/sqrt(5) - sqrt(50))2-5. -10sqrt(2)/3 + 250 Simplify 2(1 + (sqrt(726)-4 - sqrt(726))/(4sqrt(6)/sqrt(2)) + -2). -55sqrt(2)/2 - 2 Simplify (2(-1 + 3(sqrt(128) + sqrt(128)-2)) + (-2 + (1 + sqrt(128) - sqrt(128)) - -2-2sqrt(128)))*2. 480sqrt(2) + 12809 Simplify (1(-1sqrt(1250)2 - (5 + 3 + sqrt(2450)))4)*2. 21760sqrt(2) + 232224 Simplify (((-4 + sqrt(304))5 + 0 - (1sqrt(304) + sqrt(304) + 3 - 3(sqrt(304) - sqrt(304)-2))) + 2)*2. -2016sqrt(19) + 44217 Simplify 4 + ((((sqrt(162) - sqrt(162)2)-6)/sqrt(9))/(sqrt(1089)1 + 1sqrt(9)6))2. 1228/289 Simplify 4 + (sqrt(108) + -2 + -1 + sqrt(108))2 + sqrt(108) + -2 - (sqrt(108) + -2 + sqrt(108) + 0 - (5 + (sqrt(108)-3)*2 - sqrt(108))). -84sqrt(3) + 1422 Simplify -4 + 3 + sqrt(99) + -3 + 1 + ((3 + sqrt(99) + -5)*2 - -4-1sqrt(99)). -21sqrt(11) + 100 Simplify -62(4(sqrt(171) + 3 + -4 + sqrt(171) + (-1((sqrt(171) - (sqrt(171) + -1)) + sqrt(171)) - sqrt(171))))*2 + 5. -763 Simplify (-5 + -1 + sqrt(15)/(6sqrt(15)/sqrt(5)) + (6sqrt(270) - sqrt(30))/(-6sqrt(18)/sqrt(3)))*2. 32sqrt(5) + 644/9 Simplify 6(sqrt(5) - (sqrt(5) - (3 + sqrt(25)/sqrt(5))) - -2sqrt(320))2 + -2 + ((sqrt(80) - (2 + sqrt(80)))2-4 + sqrt(80) + sqrt(80) - sqrt(80)). 616sqrt(5) + 8706 Simplify (-4sqrt(28)/sqrt(2)-56)/(sqrt(800) - (sqrt(800) - (sqrt(800)1 + sqrt(800))1)). 3sqrt(7) Simplify ((-2(sqrt(1008) + 1) + 3)2 + (1 + 0 + sqrt(1008))1)-32. -24204 + 216sqrt(7) Simplify 2 + ((-2sqrt(3024)2)/((sqrt(7) - (sqrt(7) + (sqrt(700) - sqrt(700)1 - sqrt(700)))) + (sqrt(7) - sqrt(42)/(sqrt(18)/sqrt(3))) + sqrt(7)))*2. 7154/121 Simplify 3(-2 + sqrt(252) + sqrt(28)) + sqrt(140)/sqrt(245)1. -6 + 170sqrt(7)/7 Simplify (-6((sqrt(720) + 2 + -1 - sqrt(720)3-5) + (5-1sqrt(720) - (sqrt(720) + (-1sqrt(720) + sqrt(720))6))-4))*2. 34560sqrt(5) + 41472036 Simplify 2 + (-1((sqrt(637) - (-3sqrt(637) + sqrt(637) + -5)*2) + sqrt(637)) - 6(sqrt(637) + 2sqrt(637) - sqrt(637))-6) + -2. 630sqrt(13) + 2573 Simplify (0 + ((sqrt(2) - (sqrt(2) + 5-2sqrt(2))) + 0 + sqrt(200) + 1)22)-6. -9612 - 480sqrt(2) Simplify 33-6((sqrt(425)-2)*2 + 1)4-6. 2204496 Simplify ((sqrt(225) + sqrt(225) + sqrt(225) + (sqrt(225) - -2sqrt(225)-1) + sqrt(225) + sqrt(225))1)/(-13sqrt(80)-4). sqrt(5)/4 Simplify (5(5(sqrt(56) - sqrt(56)4)-5)/(1sqrt(32) - sqrt(96)/(sqrt(12)-2)))2. 157500 Simplify ((2sqrt(2880) - sqrt(20)) + (sqrt(20) - (3sqrt(40))/sqrt(2)))/(4(sqrt(324)-6 + sqrt(36))/sqrt(9))-2. 21sqrt(5)/34 Simplify ((3(sqrt(1800)-2 - sqrt(18)))/(sqrt(30)/sqrt(5)1-6) + -5)2. -105sqrt(3) + 1423/4 Simplify -5 + -5((-2 + sqrt(468)1 + -3)*2 + (4 + 3(0 + sqrt(468)))*2) + 3. -23607 - 420sqrt(13) Simplify ((1sqrt(18) + sqrt(18) + sqrt(2) + (sqrt(72) + 2 - sqrt(2)) - 2(-6sqrt(32) - (2 + sqrt(8)/sqrt(4) + sqrt(2))))4-4)2. 196608sqrt(2) + 2106368 Simplify 2(3 + 4 + 1sqrt(2448) + sqrt(2448) - (-6(sqrt(2448) + -1) - -2sqrt(2448)5))2-4. -78344 + 384sqrt(17) Simplify 5(5 + sqrt(245)-1 + 2)2 - ((sqrt(100)1 + sqrt(25))/sqrt(5) - ((sqrt(5) + -1)*2 + sqrt(5))1-1). -492sqrt(5) + 1464 Simplify (6(-2 + (sqrt(539) - (sqrt(539) - sqrt(539)1)) + 5(1 + sqrt(539) + sqrt(539) - sqrt(539)) + 4(sqrt(539) + 3(2sqrt(539) - sqrt(539)))) + 0)*2. 33264sqrt(11) + 9391860 Simplify (6(sqrt(170) + 2sqrt(170)2 - sqrt(170))/(sqrt(10) + sqrt(10) + -2sqrt(90)) - (6sqrt(102)-1)/(sqrt(1470)/sqrt(5)))*2. 22032/49 Simplify ((sqrt(153) - (sqrt(153) + sqrt(153) + 4sqrt(153)-3 + sqrt(153))) + (sqrt(153) - (sqrt(153)4-5 + sqrt(153)) - sqrt(153)))/(-6sqrt(81)-12). 29sqrt(17)/36 Simplify (sqrt(133)/(sqrt(35)/sqrt(5)) + -2sqrt(475) + 0 + sqrt(304) + 2)*22. -40sqrt(19) + 958 Simplify ((sqrt(128) - sqrt(128)6) + sqrt(128) + sqrt(128))/(sqrt(64) - sqrt(64)36). 3sqrt(2)/17 Simplify ((-1 + (sqrt(91) + -2sqrt(91)3)/sqrt(7))-2)*2 + 5sqrt(156)/(-2(1sqrt(12) + sqrt(12)))2. 75sqrt(13)/2 + 1304 Simplify ((sqrt(102)/sqrt(24)-6 + ((sqrt(187) - (sqrt(187) - sqrt(187)1))-2)/sqrt(11) + 4)1)*21. -40sqrt(17) + 441 Simplify (-3 + 1(sqrt(1216)-2 + -1) - (sqrt(190)/sqrt(5)-2 + sqrt(38))/(sqrt(648) - sqrt(18)))*2. 1912sqrt(19)/15 + 1088899/225 Simplify 6(-1(((-1(sqrt(275) + sqrt(275) + -1 + sqrt(275)))2 - sqrt(275)) + sqrt(275)) + (-1 + sqrt(275) + -1 + 1)2 + -4). -13224 + 120sqrt(11) Simplify (-6(sqrt(55) + 1sqrt(55)-2 + sqrt(55) - sqrt(55)1-5))/(((sqrt(3645) - (sqrt(3645) - 2sqrt(3645))) + sqrt(3645) - sqrt(3645))2). -5sqrt(11)/18 Simplify -3 + (-5(-3 + -1((sqrt(1300) + -3 - sqrt(1300))4 + sqrt(1300) + (sqrt(1300) + 2sqrt(1300)-5 + sqrt(1300) - sqrt(1300) - sqrt(1300)))))2. 40500sqrt(13) + 2634522 Simplify ((sqrt(102) + sqrt(102)1-4 - 4(sqrt(102) + sqrt(102)-2))-2)/(sqrt(60)/(-31sqrt(10))-4). -3sqrt(17)/2 Simplify (2 + (sqrt(304) - (-1 + -2sqrt(304))) + 1 + (sqrt(304) + sqrt(304)1 - sqrt(304)))2 - ((-41sqrt(1900))2 - (1 + 0 + sqrt(1900))). -25519 + 138sqrt(19) Simplify -3 + (-1 + (-4 + sqrt(260)/sqrt(5)1)-1 + 2)*2. -20sqrt(13) + 74 Simplify 1(0 + (-2 + -2sqrt(2057) + 5(sqrt(2057)-4 - sqrt(2057)) + 0)*2). 1188sqrt(17) + 1499557 Simplify ((sqrt(170) + (sqrt(170) - -1sqrt(170)3 - sqrt(170) - sqrt(170)) + sqrt(170))5-2)/(6(sqrt(160) - -1sqrt(160))4). -5sqrt(17)/24 Simplify (-5(-6sqrt(800)4 + sqrt(800)))/(sqrt(20)/(sqrt(2) + sqrt(2) + (sqrt(288) - (sqrt(288) - sqrt(288)-2)))-6). 5060sqrt(5)/3 Simplify 2((3(sqrt(78) - sqrt(78)2))/(sqrt(72)/sqrt(3) + sqrt(6) + sqrt(6)))244. 234 Simplify -2-3sqrt(80) + 0 - 4-6(4(sqrt(30)/sqrt(6) + sqrt(5)) - sqrt(5))*2. 24sqrt(5) + 5880 Simplify (43(5 + 2sqrt(68)) + ((-2sqrt(153) - sqrt(153)) + sqrt(153))6-56)2. 135360sqrt(17) + 21634128 Simplify 12((sqrt(1944)1 + sqrt(24))2)/(-1*(sqrt(162)	{ "pile_set_name": "DM Mathematics" }
common factor of c and 161. 23 Let p(c) = -9c - 10. Suppose -4v + 2g = 18, 4v + 15 = -0g - g. Let j be p(v). What is the highest common divisor of 182 and j? 26 Suppose -n + q + 0q = -33, q - 66 = -2n. Calculate the greatest common factor of n and 1056. 33 Let f = -29 - -53. Let s be ((-7)/(-2))/((-2)/4). Let n = f + s. What is the highest common factor of n and 17? 17 Let x(y) = 3y*2 + 26y - 7. Let m be x(-9). Let i(s) = s*2 + 3s. Let u be i(-5). Calculate the highest common divisor of m and u. 2 Suppose -10c + 210 = -290. Calculate the greatest common factor of 25 and c. 25 Let s(i) = -6i - 17. Let v be s(-8). Suppose 3w + 125 = 4h - 0w, -h + w + v = 0. Calculate the greatest common factor of 8 and h. 8 Let j(t) = -t2 - 26t - 74. Let v be j(-11). Calculate the highest common factor of 26 and v. 13 Suppose 0 = 5f - 40 - 35. Let i = 9 + f. Suppose -y + 6 = -6. Calculate the highest common factor of i and y. 12 Let z(l) = -1 + l - 4 + 4l + 1. Let w be z(5). Suppose -b = 4b - 735. What is the highest common factor of w and b? 21 Let j(y) = y2 - 20y - 105. Let t be j(27). Calculate the highest common factor of t and 56. 28 Let z = 116 + -109. Let y(p) be the second derivative of p4/12 - p3 + p*2/2 - p. Let s be y(z). Calculate the highest common factor of 2 and s. 2 Let f = -118 + 154. Let n be (48/f)/((-4)/(-342)). Calculate the greatest common factor of n and 171. 57 Let k = 932 + -185. Suppose -3i - 2x + 4 = 0, -2i + 8 = i + x. Suppose 0 = ip - k + 207. What is the greatest common divisor of p and 15? 15 Suppose -3l = 0, -80 = 7r - 11r - 3l. Let f be ((-40)/(-6))/((-2)/(-30)). Calculate the greatest common divisor of r and f. 20 Let z = -52 + 38. Let t be (-8)/1(12 + z). Calculate the highest common factor of 112 and t. 16 Suppose 0 = 16d - 25d + 72. Calculate the greatest common divisor of d and 640. 8 Suppose -30 = -2a + 102. Let n be 2(-2 + 4 + a). Let y = -345 - -362. What is the highest common divisor of n and y? 17 Let s = -27 - -31. Suppose 0 = -3o + 5o + 8, -3h = -so - 61. Calculate the greatest common divisor of h and 10. 5 Let x(c) = 6c2 - 15c - 41. Let w be x(-12). Calculate the highest common factor of w and 17. 17 Let b(w) = -10w - 49. Let l be b(-5). Let h be (13 + -6)3l. What is the greatest common divisor of 42 and h? 21 Let b(i) = i2 + 2i. Suppose 5t - 19 - 16 = 0. Suppose -c + 3f = t, -f - f + 26 = 2c. Let r be b(c). What is the highest common divisor of 10 and r? 10 Let q = 99 - 67. Calculate the greatest common factor of 400 and q. 16 Let f = -833 - -1561. Calculate the greatest common factor of f and 56. 56 Let h(r) = -r3 + r2 - 4. Let y be h(0). Let o(k) = -6 - 2 - 1 - 6k + 3. Let b be o(y). What is the greatest common divisor of 9 and b? 9 Let z = 27 + -18. What is the greatest common divisor of 6 and z? 3 Let x(g) = g + 69. Let v be x(7). What is the greatest common divisor of v and 38? 38 Suppose 0y = 5y - 2r + 18, -5y - 2r = 2. Let i be 13 + 2y/4. Let f = -94 + 106. What is the highest common factor of i and f? 12 Let j = -9 - -9. Let d be (-130)/(-1)(1 + j). Calculate the greatest common divisor of 52 and d. 26 Suppose -32 = -2k + n, 2k + 3n - 5 = 43. Let r be (-1)/(-3)-3 + 8 + -2. Suppose 36 = 8m - rm. Calculate the greatest common divisor of m and k. 6 Suppose 2g - 77 = -5c, -g = -5c - 2g + 76. Suppose 27 + 3 = 6f. What is the highest common divisor of f and c? 5 Let z = -31 - -32. Let f be (-2 - -11)/(-3) - (-4)/z. Calculate the highest common factor of 1 and f. 1 Let b(h) = -27h2 + 2h - 1. Let k be b(1). Let v = 31 + k. Suppose -2l = 3l - v. What is the highest common factor of l and 8? 1 Let d(f) = -2f3 + 72f*2 + 4f - 112. Let k be d(36). Suppose -4i + 400 = i. What is the greatest common factor of i and k? 16 Suppose 27k = -882 + 2583. Suppose 142 = h + 16. What is the greatest common divisor of h and k? 63 Suppose -w = 4p - 4w - 10, 3p - 2 = 5w. Suppose -pk + 5k = 40. Let r be (-332)/(-32) + (-3)/8. What is the highest common divisor of r and k? 10 Suppose z + 30 = -2r + 72, -2z + 90 = r. Calculate the greatest common factor of 782 and z. 46 Suppose -3u = -5b + 2, 11u - 2 = 2b + 7u. Calculate the highest common factor of 7 and b. 1 Suppose -3s + 331 = -59. Let t(u) = -u*3 + 9u*2 - 6u - 11. Let y be t(8). Let x(q) = 3q - 2. Let m be x(y). What is the highest common factor of s and m? 13 Let x = 1211 + -1205. Calculate the highest common factor of x and 654. 6 Suppose 1437 = 4d + 117. Calculate the highest common divisor of d and 66. 66 Suppose 4w - 143 = 217. Let r = 9940 - 9904. Calculate the greatest common factor of r and w. 18 Let h be 56/(-30) - 2/15. Let v = h + 48. What is the highest common divisor of 69 and v? 23 Suppose -4w - 1 + 5 = 0, w - 81 = -2c. What is the highest common factor of c and 15? 5 Suppose 24d = 23d + 1362. What is the highest common divisor of d and 6? 6 Suppose 2t - 186 = -5y, 13t - 260 = 10t + 2y. What is the greatest common divisor of 16 and t? 8 Suppose -b - 4 = 0, 0 = -14s + 19s + 4b - 3554. Calculate the highest common divisor of s and 42. 42 Suppose 14 = -2x + 3c, 0 = 3x + 5c - 3 + 5. Let z be -5(x + (-16)/20). Suppose 21o + 3 = zo. What is the highest common divisor of o and 5? 1 Let l be 86 - ((-20)/(-15))/(4/6). What is the greatest common factor of l and 18? 6 Let t = -7 - -30. Suppose -s + 2y + 180 = 0, 3s - 558 = -4y + y. Calculate the greatest common divisor of s and t. 23 Let d = 14 + -12. Suppose -8q = dq - 350. What is the highest common divisor of q and 14? 7 Let q be ((-119)/(-1))/(((-255)/(-34))/15). What is the greatest common divisor of 1547 and q? 119 Suppose 6 = -34x + 8846. Let s(u) = -u3 - u2 - u - 1. Let l be s(-3). What is the greatest common divisor of l and x? 20 Let j = 15 + -91. Let m = -62 - j. Suppose 2w + 2i - 622 = -2w, -3 = -i. What is the greatest common factor of w and m? 14 Let k = 3 - 0. Let j(c) = -6 - 159c + 167c + 20 - 4c2 - ck. Let u be j(-6). What is the greatest common factor of u and 19? 19 Let c = -19 + 25. Suppose -2m + cm = 80. Let s be -6(-3 - m/12). Calculate the greatest common divisor of s and 42. 14 Let u = 84 - 57. Calculate the greatest common divisor of 18 and u. 9 Suppose -3a - 5k = -30, -4a - 8 = -5a - k. Suppose 3l = 4q - 337, al - 3 - 22 = 0. What is the highest common factor of 8 and q? 8 Suppose -16c + 396 = -10c. Let n = c + -48. Suppose 2o = 2q - 13 - 249, -2o = -3q + 388. What is the greatest common divisor of n and q? 18 Suppose 5873 = 3r - m, -62r + 57r - 2m = -9781. What is the greatest common divisor of 19 and r? 19 Suppose -19w + 409 - 86 = 0. What is the greatest common divisor of w and 187? 17 Suppose -2 = 2d - 6, 3v + 4d - 41 = 0. What is the highest common divisor of v and 22? 11 Let k be ((-2)/(-4))/((-6)/(-12)). Let f be (k/2)/((-2)/(-224)). Let q be -1(-7)/11. What is the greatest common factor of f and q? 7 Suppose -2j = 3j. Let d be j + -2 + (26 - 1). Suppose 1931l - 1916l - 345 = 0. What is the highest common divisor of d and l? 23 Let m = 107 + -93. Suppose m = -6i + 13i. Calculate the highest common factor of i and 4. 2 Let i = 29 + -27. Suppose n + 15 = 5x, 4x = -3n + n - i. Calculate the greatest common divisor of 18 and x. 2 Let x(k) = -8k + 17. Let n be x(12). Let t = n + 92. Let h be ((-1)/(-2))/((-1)/(-182)). Calculate the highest common factor of t and h. 13 Let p(z) = -z*3 - 10z*2 + 6z + 8. Let m be p(-11). Let j = m - 58. Calculate the highest common factor of j and 15. 5 Let x = 25 - -16. Let u = 7 + x. Suppose r = -2r + u. Calculate the highest common divisor of 176 and r. 16 Let i be -5 - 71(-8)/(32/20). What is the highest common factor of i and 280? 70 Let y be 1345/66 - 4. What is the greatest common divisor of y and 31? 31 Suppose -4n = 3y - 61, 2y - 47 = 4n - 7n. Calculate the greatest common factor of 513 and n. 19 Suppose 138 + 332 = -2d. Let o = -136 - d. What is the greatest common factor of o and 9? 9 Let w(j) = j*2 - 46j + 50. Let l be w(45). What is the highest common divisor of l and 155? 5 Suppose 4j = 37f - 32*f - 83, 0 = f + j - 22. Calculate the highest comm	{ "pile_set_name": "DM Mathematics" }
6 - -2. Let a be g(i). What is the least common multiple of 6 and 4/6(7 + a)? 12 Suppose -5w = -5f + 7 + 18, 4w + 16 = 0. Find the common denominator of -107/6 and f/6(-258)/4. 12 Suppose -3f = -2 + 113. Let o = f + 295/8. Calculate the common denominator of o and 13/5. 40 Let s(d) = -5d - 15. Calculate the lowest common multiple of 22 and s(-5). 110 Suppose k = -3k + 20. Suppose -5y + 2t = -34, 3t = -ky - 0t + 24. Suppose 0 = -5d + 2d + 6. What is the least common multiple of d and y? 6 Let k = 1 + 1. Let d be k/(6/(-9))-529. Let s = d - 3253/2. Calculate the common denominator of 71/10 and s. 10 Let c = -16 - -14. What is the common denominator of 93/14 and 0/c - 819/54? 42 Let q = 2529 + -40405/16. Let u be 452(-4)/(-6). Find the common denominator of (27/u)/(2 - 1) and q. 80 Let f(g) = 15g. Let q be f(5). Find the common denominator of (q/(-9))/((-12)/(-27)) and 63/2. 4 Let m be 14/56 + 95855/(-20524). Let l = m - 6/733. What is the common denominator of l and 7/2? 14 What is the common denominator of -53/17 and 5 - (-5 - 415/(-10))? 34 Let w be (-3 + 6 - 3)/1. Suppose -2k + 7 + 9 = w. Calculate the lowest common multiple of k and 12. 24 Suppose -67 = -22w + 109. Let l(n) = -n - 4. Let v be l(-6). Suppose vh + 2 - 6 = 0. What is the smallest common multiple of h and w? 8 Let y = -4703026702/5112603 + 1/568067. Let q = y - -921. What is the common denominator of q and -79/8? 72 Let k(q) = -16q2 - 4q. Let l be k(-7). What is the common denominator of 17/6 and l/(-7)1/22? 66 Let l = -23525/1912 - 17/239. Let f = 443/70 + -13/14. Calculate the common denominator of f and l. 40 What is the common denominator of (-6034)/560 - (-4)/10 and 61/5? 40 Suppose -4m + 9m = 0. Suppose -3v + 4 + 8 = m. Calculate the lowest common multiple of 51 + 2 + -1 and v. 12 Let p be 3/(-20)1644366470/8. Let g = 30820333 + p. Let u = g - -11543. What is the common denominator of -109/6 and u? 48 Let s(u) be the third derivative of -u5/30 + u4/12 + u3/6 + u2. Let c be s(-1). What is the common denominator of -20/11 and (5/(-15))/((-7)/c)? 77 Let m(f) = -4f + 2f + 2 - f - 2f. Let a be (-20)/(-8)8/(-10). What is the smallest common multiple of 6 and m(a)? 12 Let d = -69 - -80. Calculate the smallest common multiple of 2 and d. 22 Suppose 2t - 22 = 2b, 4b = 5t - 0b - 51. Let l(g) = -3g - 3. Let v be l(4). Let c = v - -25. What is the least common multiple of t and c? 70 Suppose j - 3j + 8 = 0. Suppose 4p - 2a = -68, -p - ja - 19 = -5a. What is the smallest common multiple of 10 and 6/p + (-7)/(-5)? 10 Let v = -3 - -2. Let j = 11 + v. Calculate the common denominator of -77/4 and (-4)/j - 277/(-30). 12 Find the common denominator of (-32 + (-2 - -5))/(3-4) and 29/12. 12 Suppose -4j + 34 = 18. What is the least common multiple of 22 and j? 44 Let i be 1 - 1/((-1)/(-3)). Let a(r) = 2r*2 + 0r2 + 3 + r3 - 1. Calculate the least common multiple of a(i) and 9. 18 Let f = 5 - -2. Calculate the least common multiple of 8/6 + 125/75 and f. 21 Find the common denominator of -139/6 and (8/(-12))/(0 + 96/477). 48 Suppose 5g + 3s - 30 = 0, 5g - 30 = -0g - 4s. Suppose -2h - h - 5n = 140, -h = -n + 52. Calculate the common denominator of h and (15/72)/((-2)/g). 8 Let v = 2953/1860 + -15/124. Calculate the common denominator of v and 41/50. 150 Let k(j) = j3 - 2j*2 + 3j + 2. Calculate the smallest common multiple of 44 and k(3). 220 Let a be (8/(-16))/((-1)/(-6)). What is the smallest common multiple of (18/8)/(a/(-16)) and 4? 12 Let z = 12 - 7. Suppose -2i = -zt + 25 - 7, 0 = -3t + i + 11. What is the smallest common multiple of t and 4? 4 Suppose 2y - 4f - 34 = 0, f = 3f - 6. Let x = y + -11. Let a = -1 + 7. What is the lowest common multiple of x and a? 12 Let t = -9645/32 - -1215/4. Let z = t + -1741/224. Find the common denominator of 1 + 17/(-24)-3 and z. 56 Suppose k - h + 41 = 6k, k + 4h + 7 = 0. Calculate the smallest common multiple of k and 8. 72 Suppose 3t = -1 + 28. What is the smallest common multiple of t and 2? 18 Let v be (2/(-6) - -1)3. Suppose vf = 4g + 28, -4f = -f - 3g - 36. Let i(o) = 9o - 2. Calculate the smallest common multiple of i(2) and f. 80 What is the common denominator of (-2)/((-24)/(-189))30/(-385) and -133/12? 132 Let k = 15 + -22. Let y = 10 + k. Calculate the least common multiple of y and 30. 30 Suppose 3l - 3 = 9. What is the lowest common multiple of l and 9? 36 Let i = -18 - -32. What is the least common multiple of 315/i + 2/(-4) and 10? 110 Let c be (10/(-4))/((-2)/8). Calculate the common denominator of (-417)/(-18) + (-2)/(-6) and c/15 - (-290)/(-84). 14 Calculate the smallest common multiple of 20 and (-31)/(-93) + (-29)/(-3). 20 Suppose -4q = -3p + 4, 0q - 4q - p = 20. Let d = q + 15. What is the lowest common multiple of d and 3? 33 Let h = -2250 + 15717/7. What is the common denominator of (-1)/(-4) + 1475/(-60) and h? 21 Let d(w) = w*3 + 4w*2 + 2w - 3. Let y be d(-3). What is the common denominator of -3 + (39/24 - y) and -11/4? 8 Let i be (3/6)/((-2)/(-12)). Suppose 4k - 12 = 3k - 3w, 3w = ik - 24. What is the lowest common multiple of k and 10? 90 Let v(x) be the first derivative of 2x*3/3 + 2x*2 + 2x - 2. Let p(y) = y*2 - 3y + 4. What is the smallest common multiple of v(-3) and p(3)? 8 Let i(m) = m - m + 2m - 6 - m. Calculate the smallest common multiple of 8 and i(7). 8 Let j = 665 + -294. What is the common denominator of (-2)/(-9)j/(-14) and (1/20)/((-1)/98)? 90 Suppose 4p + 34 = -j - j, p = 3j + 44. Calculate the common denominator of j and 38/5. 5 Find the common denominator of (-260)/72 + -1 + 5 and 85/14. 126 Calculate the common denominator of (-36)/38 - 3 - -4 and 85/4. 76 Let y = -769/24 - -86/3. Find the common denominator of (21/64)/(9/108) and y. 16 Suppose 2k + 32 = 6k. Calculate the least common multiple of (-1 + 0)/((-2)/k) and 20. 20 Let l = 34 - 26. Calculate the smallest common multiple of l and 11. 88 Let n be 1624/(-6) + (-8)/(-12). Calculate the common denominator of 6/(-3) + n/(-44) and -111/10. 110 Let s(c) = -c*2 - 9c - 6. What is the least common multiple of 11 and s(-8)? 22 Find the common denominator of 99/2 and (126/(-88))/3 - (-84)/112. 22 Suppose 0 = -3r + 2t + 100, 124 = 3r + 5t - t. What is the smallest common multiple of r and 20? 180 Let b(j) = -j*3 - 5j*2 - 4j + 5. Suppose 3c - 14 = 5x, -2c - x = -2 + 10. Let a = c + -2. What is the smallest common multiple of b(a) and 2? 10 Suppose -3q + 66 = -q. Find the common denominator of q and 17/3. 3 Suppose 0l = 2l. Find the common denominator of l + ((-16)/44 - -2) and 67/6. 66 Calculate the least common multiple of 7 and 4 - (-6 - (-5 + 3)). 56 Let y = 3346/9 - 34477/90. What is the common denominator of y and 57/(-6)2/(-8)? 40 Let i(z) = -z2 + z + 1. Let a be i(2). What is the smallest common multiple of 3 + a + 4 - -1 and 7? 7 Let x = -530 + 4321/8. Let s = -1224/25 - -17263/300. Calculate the common denominator of s and x. 24 Let j = -73 - -89. Calculate the least common multiple of j and 158. 1264 What is the common denominator of (-16)/4 + 0 - 23/(-30) and 143/6? 30 Suppose 0 = -4g - 11 + 55. What is the smallest common multiple of 6 and g? 66 Let b = 551 - 4447/8. Let c be 3/6 - (-218)/21. Let d = c + -8/21. What is the common denominator of b and d? 8 Let l = 703 - 1342. Let w = 5035/8 + l. Calculate the common denominator of w and 73/12. 24 Suppose 5q + 2 = -2z, -2z = 2z - 5q + 4. Let y = 1989 + -7999/4. Find the common denominator of 2/(-9)-12z and y. 12 Let d be ((-2)/6)/((-1)/6). What is the least common multiple of (-15)/(-2) + 1/d and 1/((-3)/63-3)? 56 Let o = -7 - -29. Let k = 118 + -70. Suppose 0 = -z - 2z + k. What is the smallest common multiple of o and z? 176 Let x be 12/((-6)/(-56)-2). Let m = x - -222. Find the common denominator of -23/18 and ((-2)/22)/((-4)/m). 198 Suppose -5b = -3b - 8. What is the common denominator of b - -323/(-27) and 16/5? 45 Suppose -5r + 19 + 61 = 0. Calculate the smallest common multiple of r and 18. 144 Let y = -1 + 6. Suppose 2f = -f + 54. Calculate the lowest common multiple of (-2)/(-5) - (-8)/y and f. 18 Suppose -8 = 5a - 4r, 4a - r + 2 = a.	{ "pile_set_name": "DM Mathematics" }
d biggest value? (a) -2/85 (b) 46 (c) -4/5 (d) 6 (e) 4 d What is the sixth smallest value in 3, -1/9, -5, -18, 4, 299? 299 What is the smallest value in 0.3, 0.2, 40203? 0.2 What is the third biggest value in 9, 5/2, -11/2? -11/2 What is the second biggest value in 90, -91/4, -4, 1/5? 1/5 What is the third smallest value in -1/26, -2/13, 12/11? 12/11 What is the second biggest value in -0.046, 2/15, 723? 2/15 What is the fifth biggest value in -2, -0.3, 25, -1, 1.1? -2 What is the fifth smallest value in 0.2, -2, 0.1, 4, -46/19? 4 What is the biggest value in 0, 191179, 1/5? 191179 What is the second smallest value in -1.9257, -2, 7? -1.9257 What is the smallest value in 0.03, -46, -149? -149 What is the fourth biggest value in -3/4, 4/7, 830, -4? -4 What is the fifth smallest value in 36, 3, -23, 5, -2? 36 What is the second smallest value in 32, -0.22, 4, -0.8? -0.22 Which is the second biggest value? (a) -106 (b) 39 (c) -161 a What is the second biggest value in -2, -9/8, 65/3? -9/8 Which is the fourth smallest value? (a) 16 (b) 1/3 (c) 0.021 (d) -2 a What is the second smallest value in 4/5, -6130, -26? -26 Which is the biggest value? (a) 1207 (b) 5/6 (c) -4/3 (d) -5 (e) 1 a What is the second smallest value in -2, -373, 1/37, -0.04? -2 Which is the second biggest value? (a) 3/8 (b) 2/13 (c) 756 (d) 5 (e) -5 d Which is the second biggest value? (a) 5/4 (b) -426 (c) 3/11 c What is the biggest value in -2/5, 2, -2/11, -0.117? 2 Which is the third biggest value? (a) 6 (b) -2/3 (c) 15 (d) -3/8 (e) 1/5 e What is the second biggest value in -2/5, 0.4, 1/2, -370? 0.4 What is the fourth biggest value in -202.6, 2/3, 2/9, -3, -29? -29 Which is the smallest value? (a) 0.5 (b) 5 (c) 0.6 (d) 1249 a Which is the second biggest value? (a) -14 (b) 4 (c) 52.3 (d) -0.3 b What is the third smallest value in 74, 1/5, -12, -0.4? 1/5 Which is the third smallest value? (a) -2/7 (b) 2/9 (c) -3/4 (d) -5 a Which is the fourth smallest value? (a) 2/15 (b) -11 (c) -0.5 (d) -68 (e) 0 (f) 0.3 e What is the third biggest value in 4, -0.01, 31, -4, 5/76? 5/76 What is the third smallest value in 0.32, -158, -0.03? 0.32 What is the smallest value in 4/4309, 16, -9? -9 What is the biggest value in 16.9, 4, -25/3? 16.9 Which is the second smallest value? (a) -2 (b) 1/4 (c) -1/13 (d) -5 (e) -14 d Which is the smallest value? (a) 1/4 (b) -46 (c) 3/10 (d) -16 b Which is the third biggest value? (a) 2/3 (b) 655 (c) 6 (d) 1/2 a Which is the smallest value? (a) -3/7 (b) -0.08 (c) -2/427 (d) 3 (e) 0 a Which is the third biggest value? (a) -4/7 (b) 11 (c) 5/6 (d) 1/5 (e) 0.1 (f) 2/235 d Which is the fourth biggest value? (a) -0.06 (b) 0 (c) -167 (d) -101 (e) 2/9 d What is the biggest value in 0.3, -5, 2/11, -3, 1/4, 1/38? 0.3 What is the biggest value in -0.2513, 2/55, -5? 2/55 Which is the fourth smallest value? (a) 144 (b) 0.6 (c) -1/9 (d) -0.3 a What is the third biggest value in 6, -13, -0.4, -2, 0.36, 4? 0.36 Which is the second smallest value? (a) -50 (b) -4 (c) -8296 a Which is the biggest value? (a) 12 (b) -0.5 (c) -5 (d) -1585 a Which is the third biggest value? (a) 5 (b) -1/2 (c) 1809 b What is the third smallest value in 0, 2/5, -18077, -2/15? 0 Which is the third biggest value? (a) 710 (b) -2/7 (c) 4 (d) 0.3 d Which is the second biggest value? (a) 2 (b) 5/7 (c) 42301 a Which is the second biggest value? (a) 3/7 (b) 47 (c) -0.13 (d) 3 (e) 0 d Which is the third smallest value? (a) -0.2 (b) -0.4 (c) -2727 (d) 5 (e) -0.3 e Which is the second smallest value? (a) -1/4 (b) -1.4 (c) -3/7 (d) 0.5 (e) 2.1 (f) 3 c Which is the fourth biggest value? (a) -4 (b) 2/13 (c) -1/458 (d) 1903 a Which is the third biggest value? (a) 1/10 (b) -136 (c) 2/65 (d) 33/5 c Which is the third smallest value? (a) 1 (b) 1/4493 (c) -0.028 a Which is the fifth smallest value? (a) -2 (b) 0.2 (c) 1 (d) -125 (e) -2/5 c Which is the third biggest value? (a) -0.2 (b) -22468 (c) -2/11 b Which is the fifth biggest value? (a) 0.04 (b) 500/7 (c) 0.5 (d) -1/10 (e) 4 (f) 3 a Which is the fourth biggest value? (a) 0.171 (b) -0.17 (c) 3 (d) -0.06 (e) 1/10 (f) 5 e Which is the second smallest value? (a) -0.4 (b) -0.3 (c) 12 (d) 0.04 (e) -2.6 a Which is the third biggest value? (a) -1 (b) 1/8 (c) -5158/9 c Which is the second biggest value? (a) -1/2 (b) 0.012 (c) -2 (d) 4 (e) -0.03 b Which is the third smallest value? (a) -0.3 (b) 0.063 (c) -2/5 (d) 1/579 d Which is the second biggest value? (a) -1/8 (b) -2/7 (c) -38 b What is the smallest value in 0.1319, -36, -7, -0.5? -36 Which is the fourth smallest value? (a) 0.14 (b) 3 (c) -13 (d) 3/7 (e) -0.2 d What is the third smallest value in -4, 0.2, 0.28, -246, 1/4? 0.2 Which is the third biggest value? (a) -81 (b) 1.476 (c) 5 a What is the biggest value in -0.1, 0.13, 27, -1? 27 Which is the third smallest value? (a) -0.01 (b) 5 (c) 3/16 (d) -23 c What is the fifth biggest value in -110, 0.1, 11, -3, 0.5, 0? -3 What is the second smallest value in -32, 3/2, 0, -4/3, 9, -59? -32 What is the smallest value in 1, 11, 8687? 1 Which is the second biggest value? (a) 18 (b) -25004 (c) 0.1 c Which is the second smallest value? (a) 0.2 (b) 5 (c) 1851 b Which is the second smallest value? (a) 6/13 (b) 0 (c) 10 (d) 1/50 d Which is the third smallest value? (a) 13 (b) 0.03 (c) -3 (d) 2 (e) -0.14 (f) -0.4 e What is the third biggest value in 5, 4, -3, -2/13, 6456? 4 What is the third biggest value in -84, -5/6, 74.36? -84 Which is the biggest value? (a) -16319 (b) -2 (c) 0.4 (d) -1 c What is the third smallest value in -0.1, 0.5, 4, 4/9, 85? 0.5 What is the fourth smallest value in -0.3, -0.1, -4/3, -0.2, -6? -0.2 What is the third smallest value in -4/7, -19, -10, -2, 2/31? -2 What is the third smallest value in 0, 64, 112, 0.4, -4/3? 0.4 What is the third smallest value in 2/5, 0.069876, 3? 3 What is the second biggest value in -13039, 1, -1, -5? -1 What is the third biggest value in 5, 1141, -10/9? -10/9 What is the second biggest value in -1/3, -0.4, 36.33? -1/3 What is the fifth biggest value in -0.07, -14/11, -5, 3, 0.2? -5 What is the third biggest value in -2, 23, 0.2, 15, 26? 15 Which is the smallest value? (a) -0.4 (b) 245.7 (c) -0.3 a Which is the fifth biggest value? (a) 107 (b) -3 (c) -0.4 (d) -0.2 (e) -4 (f) -6 e Which is the sixth smallest value? (a) 0.09 (b) 0.3 (c) -3/2 (d) 0.06 (e) 0.17 (f) -0.1 b Which is the smallest value? (a) -0.399 (b) 18/11 (c) 0.07 (d) -2 d What is the fifth smallest value in -0.2, 4/5, -1/7, 35/2, -109? 35/2 Which is the second biggest value? (a) 0.4 (b) 9 (c) 76.7 b What is the fifth biggest value in 3/4, -206, 1, -1/8, -0.5, -0.7? -0.7 What is the second biggest value in -29, -6, -5/19? -6 What is the second smallest value in -3345, -0.07, 0.83? -0.07 Which is the second smallest value? (a) 0.4 (b) -143 (c) 2 (d) 0 (e) -29 e Which is the third biggest value? (a) -0.1 (b) 3 (c) 2/5 (d) -18 (e) 0.89 c Which is the second smallest value? (a) 4 (b) 0.1 (c) 272 (d) 5 (e) -5 b Which is the third smallest value? (a) -4 (b) -243 (c) -166/11 a What is the fourth biggest value in -1/4, 0.02, 79, 0, 11, -1? 0 What is the second biggest value in -5, -1/4, 319, 0.2, 2, 0.4? 2 What is the third biggest value in -12, 1, -22? -22 Which is the fourth biggest value? (a) 15/7 (b) 1/10 (c) 0 (d) -267 d What is the fifth biggest value in -1/5, -31, -0.4, -2, -3215? -3215 Which is the second smallest value? (a) -2 (b) 0.5 (c) -246/127 c Which is the fifth biggest value? (a) 398/11 (b) 4/7 (c) 0.2 (d) 1/2 (e) 3/2 c What is the fourth smallest value in 58, -3, -5, -493, -0.4? -0.4 What is the third biggest value in -0.11, -5, -2/967, -1? -1 What is the third biggest value in 0.3, -54/11, 8, -5/7? -5/7 Which is the fourth biggest value? (a) -0.2 (b) -8 (c) -1/27 (d) 5 (e) 8 (f) 9 c What is the fifth smallest value in -0.0541, 5, 2/7, -0.19, 0.3? 5 Which is the biggest value? (a) 4385 (b) 80 (c) 1/3 a What is the third biggest value in -4, 0.07, -1172/9, 1/5? -4 What is the third biggest value in 20.4,	{ "pile_set_name": "DM Mathematics" }
391 What comes next: 437, 681, 925, 1169, 1413, 1657? 1901 What is the next term in -7319, -7298, -7263, -7214, -7151, -7074? -6983 What is the next term in -336, -270, -228, -222, -264? -366 What comes next: 17542, 35088, 52638, 70192, 87750, 105312? 122878 What is the next term in -120270, -240538, -360806? -481074 What is the next term in 100, 73, 34, -11, -56, -95? -122 What is the next term in 1171, 4824, 10911, 19432, 30387, 43776, 59599? 77856 What is the next term in -3619, -7229, -10843, -14467, -18107? -21769 What comes next: 1360, 10009, 33488, 79213, 154600, 267065, 424024, 632893? 901088 What comes next: 2778, 10986, 24658, 43788, 68370, 98398, 133866, 174768? 221098 What is next in 231139, 462275, 693411, 924547? 1155683 What is the next term in -1106, -2212, -3314, -4412, -5506? -6596 What is the next term in 344, 351, 322, 239, 84, -161, -514, -993? -1616 What comes next: -84, -247, -482, -789, -1168, -1619, -2142? -2737 What is the next term in 13481, 27014, 40547, 54080, 67613? 81146 What is the next term in 193, 573, 1155, 1945, 2949? 4173 What comes next: -1007, -938, -757, -410, 157, 998, 2167? 3718 What comes next: 2486, 2478, 2470, 2462? 2454 What comes next: -45, -114, -217, -354, -525? -730 What is the next term in -18, -162, -404, -744? -1182 What comes next: -338, -553, -768, -983, -1198? -1413 What is next in 794, 852, 910? 968 What is next in 233058, 233056, 233054, 233052, 233050? 233048 What comes next: -504, -1014, -1524? -2034 What comes next: 10115, 40401, 90877, 161543? 252399 What is next in 91, 213, 413, 691, 1047, 1481? 1993 What is next in 10724, 21474, 32248, 43046, 53868, 64714? 75584 What is next in 1131, 2167, 3203, 4239, 5275? 6311 What is next in -8591, -17172, -25745, -34304, -42843? -51356 What is next in -2367, -9522, -21463, -38196, -59727, -86062? -117207 What comes next: -282, -1034, -2276, -4008, -6230, -8942, -12144? -15836 What comes next: 104, 139, 178, 221? 268 What is the next term in 692, 1009, 1326? 1643 What comes next: -105687, -105678, -105669? -105660 What comes next: 1179, 1129, 1079? 1029 What comes next: -902, -972, -1088, -1250, -1458, -1712? -2012 What comes next: -1144377, -2288754, -3433131, -4577508, -5721885? -6866262 What comes next: -1622, -1537, -1396, -1199? -946 What is next in 27994, 28388, 29044, 29962, 31142? 32584 What comes next: -1350, -443, 1060, 3153, 5830, 9085, 12912? 17305 What comes next: 65, 188, 267, 278, 197? 0 What is the next term in 100, 220, 340, 460, 580? 700 What comes next: 71473, 71469, 71465, 71461? 71457 What is next in -8546, -34200, -76958, -136820? -213786 What is the next term in -2383831, -2383826, -2383819, -2383810, -2383799, -2383786? -2383771 What comes next: -4820, -38621, -130360, -309005, -603524, -1042885? -1656056 What comes next: -2137, -2134, -2129, -2122, -2113, -2102? -2089 What comes next: 770, 811, 866, 935, 1018? 1115 What comes next: 1588, 1569, 1516, 1411, 1236? 973 What comes next: 11866, 11862, 11856, 11848, 11838? 11826 What is next in 662075, 662077, 662077, 662075, 662071, 662065, 662057? 662047 What is next in 97101, 194201, 291299, 388395, 485489, 582581, 679671? 776759 What is next in -5692, -5583, -5474, -5365, -5256? -5147 What comes next: 6846, 6952, 7058, 7164, 7270, 7376? 7482 What is the next term in -3054, -6111, -9172, -12237, -15306? -18379 What is next in -320196, -320186, -320162, -320118, -320048, -319946, -319806? -319622 What is next in -465611, -465610, -465609, -465608, -465607? -465606 What is the next term in 2296, 2149, 2020, 1915, 1840, 1801? 1804 What is next in -48513, -48514, -48515, -48516? -48517 What is the next term in -119, -228, -353, -500, -675, -884, -1133? -1428 What is the next term in 742, 2956, 6646, 11812, 18454? 26572 What is next in 3710, 3726, 3752, 3788, 3834? 3890 What is the next term in -2769, -11102, -25009, -44496, -69569, -100234? -136497 What is next in 165, 220, 313, 444, 613? 820 What comes next: 796, 3320, 7526, 13414, 20984? 30236 What is the next term in 4293, 4295, 4297, 4299, 4301, 4303? 4305 What is next in 234, 72, -102, -294, -510? -756 What is the next term in 4, 7, 18, 43, 88? 159 What is next in -100, -114, -120, -118, -108, -90, -64? -30 What is the next term in 10965, 44239, 99695, 177333? 277153 What is the next term in 243649, 243652, 243655, 243658, 243661, 243664? 243667 What is the next term in -2024, -1927, -1830, -1733? -1636 What is the next term in -15893, -31649, -47401, -63149, -78893? -94633 What is next in 58, 309, 968, 2239, 4326, 7433, 11764, 17523? 24914 What is the next term in -30144, -60285, -90428, -120573? -150720 What comes next: -115, 85, 579, 1367, 2449, 3825, 5495? 7459 What is the next term in -67, 539, 1145? 1751 What is the next term in -916, -981, -1050, -1123? -1200 What comes next: 466, 860, 1252, 1642, 2030, 2416? 2800 What is next in 25340, 25338, 25336? 25334 What is the next term in -4376, -17550, -39506, -70244, -109764, -158066, -215150? -281016 What is next in -389894, -389890, -389882, -389870? -389854 What comes next: -231887, -463773, -695661, -927551, -1159443? -1391337 What comes next: 4716, 4739, 4776, 4827, 4892, 4971, 5064? 5171 What is the next term in 374, 474, 750, 1292, 2190, 3534, 5414, 7920? 11142 What comes next: 183, 613, 1043, 1473, 1903, 2333? 2763 What comes next: -59, -317, -975, -2231, -4283, -7329, -11567? -17195 What is next in -3, -188, -497, -930, -1487? -2168 What is the next term in -36853, -36862, -36893, -36958, -37069, -37238, -37477, -37798? -38213 What is next in 388, -102, -918, -2060, -3528, -5322? -7442 What comes next: -1481178, -1481186, -1481206, -1481244, -1481306, -1481398? -1481526 What is the next term in -4057, -4059, -4063, -4069, -4077, -4087, -4099? -4113 What comes next: 39, 406, 1019, 1878, 2983, 4334, 5931? 7774 What is the next term in 4164, 4116, 4068, 4020, 3972, 3924? 3876 What is the next term in -58683, -58684, -58679, -58662, -58627? -58568 What comes next: 583, 549, 515, 481, 447, 413? 379 What is next in 9564, 9569, 9574, 9579, 9584, 9589? 9594 What comes next: 331, 1598, 3709, 6664, 10463, 15106? 20593 What is the next term in -24286, -24287, -24288, -24289? -24290 What is the next term in -133, -112, -93, -76, -61, -48, -37? -28 What comes next: -8701, -8695, -8683, -8665, -8641? -8611 What is the next term in 2093, 4285, 6479, 8675, 10873, 13073? 15275 What is the next term in -60, -141, -224, -309, -396, -485, -576? -669 What is next in 832, 842, 858, 880, 908? 942 What comes next: 1259, 2814, 4373, 5936, 7503? 9074 What comes next: -1230, -2433, -3636, -4839, -6042, -7245? -8448 What is the next term in -16303, -32684, -49065, -65446, -81827, -98208? -114589 What is next in 4964548, 9929098, 14893648, 19858198, 24822748, 29787298? 34751848 What is the next term in -2086, -16753, -56584, -134161, -262066? -452881 What comes next: 1504, 12073, 40752, 96595, 188656, 325989, 517648, 772687? 1100160 What is the next term in 225, 195, 143, 69, -27, -145? -285 What is next in -71318, -142644, -213974, -285308, -356646, -427988, -499334? -570684 What is the next term in -4959, -4982, -5019, -5070, -5135, -5214? -5307 What is the next term in 2476, 2324, 2166, 2002, 1832, 1656, 1474? 1286 What comes next: -3883, -3888, -3893? -3898 What is next in 976, 1991, 3006? 4021 What comes next: 4302, 8567, 12818, 17049, 21254, 25427? 29562 What is the next term in -6133, -6132, -6131, -6130? -6129 What is next in -55, -168, -335, -556? -831 What is the next term in 2437, 9813, 22149, 39451, 61725, 88977? 121213 What comes next: -14251, -57016, -128287, -228064, -356347, -513136? -698431 What is next in -876, -1098, -1330, -1578, -1848, -2146, -2478? -2850 What comes next: 41949, 41899, 41849? 41799 What comes next: 8, -363, -1110, -2233, -3732, -5607, -7858? -10485 What is next in -24701, -24694, -24701, -24728, -24781? -24866 What is next in 19529, 19609, 19689, 19769? 19849 What comes next: 121, 210, 455, 934, 1725, 2906, 4555, 6750? 9569 What is next in -612211, -1224416, -1836621? -2448826 What is next in -9376, -9460, -9544, -9628, -9712? -9796 What comes next: 587924, 587918, 587908, 587894, 587876? 587854 What is next in 76, 243, 530, 943, 1488, 2171? 2998 Wh	{ "pile_set_name": "DM Mathematics" }
sqrt(216) - sqrt(6))/((sqrt(22) + sqrt(88))/sqrt(11))). 192sqrt(3) Simplify ((-5-1sqrt(88) + sqrt(88) + sqrt(88))/(sqrt(12)/(sqrt(12)/sqrt(4))))/(-2sqrt(242)-6 + -2sqrt(242)2 + sqrt(242)). 7sqrt(11)/99 Simplify 5(2 + -1sqrt(637) - (sqrt(13) - (4 + sqrt(117))2 - (sqrt(468) + -1sqrt(468)))). 80sqrt(13) + 675 Simplify (5sqrt(32)/sqrt(8)2-4)/(((sqrt(96)-3)/sqrt(3) - sqrt(32))2). 5sqrt(2)/4 Simplify (-3(-2sqrt(52)/(sqrt(12)/sqrt(3)) - -2(-4 + 3 + sqrt(13) + sqrt(13) - sqrt(13))) + 0)*2. 36 Simplify -4 + 2(-62-2sqrt(128)4 + -1). -6 + 1536sqrt(2) Simplify (((sqrt(15) - (sqrt(15) + sqrt(135) - sqrt(15))1) + 2sqrt(1500))/(-4-3sqrt(245)6))*2. 3/784 Simplify -5((0 + sqrt(539) + -2sqrt(539) + -5 - ((sqrt(539) - ((sqrt(539) + 1 - sqrt(539)) + sqrt(539) + 4)) + 0))1)*2. -2695 Simplify (3(4 + -2sqrt(605) + sqrt(605) + -5 - (1 + 3 + -1 + sqrt(605))) + -5)2. 2244sqrt(5) + 22069 Simplify (0 + -3 + sqrt(539) + 2 + (-1sqrt(99))/sqrt(9) + -5(sqrt(11) - sqrt(11)-1) + 3)2. -16sqrt(11) + 180 Simplify 2(-3 + 1(sqrt(72) - (sqrt(72) + sqrt(72) + sqrt(72)-3))2 + 4 + -2(-3 + sqrt(72))). -24sqrt(2) + 590 Simplify 3(3 + (2sqrt(1008))23)11 + 1. 36298 Simplify (1sqrt(78)1)/(sqrt(6) + sqrt(6) + sqrt(36)/(1sqrt(6))) + (-2sqrt(117)-5 + sqrt(117) + -6sqrt(117)-1)2. sqrt(13)/3 + 33813 Simplify (-4(sqrt(264) - (sqrt(264) - (sqrt(264) + sqrt(264)13))))/((sqrt(30)/sqrt(5) + sqrt(6))4-1) + 4. 4 + 4sqrt(11) Simplify (((-1sqrt(136) - sqrt(136) - sqrt(136))-2)/((-2sqrt(24) - sqrt(24))/sqrt(3)) - ((1sqrt(204))/sqrt(12) + sqrt(85)/sqrt(5)-5)) + -2. -2 + 2sqrt(17) Simplify (6(22sqrt(96) - sqrt(96)))/(4sqrt(392)22). 9sqrt(3)/28 Simplify (sqrt(171)2 + 6(sqrt(57)/sqrt(3))*2 - (-2 + (sqrt(19)-52)2)) + -3 + 0. -1787 + 6sqrt(19) Simplify 3 + -1-1(-2 + ((2sqrt(48))2 - sqrt(48)) + 5)-6. -1167 + 24sqrt(3) Simplify (3sqrt(187)-4 - -41sqrt(187))/(-5(sqrt(11) - sqrt(22)/sqrt(18) - sqrt(11))-6). 4sqrt(17)/5 Simplify (4 + sqrt(28)/(sqrt(400)-1) + (((sqrt(35) - sqrt(315) - sqrt(35)) + sqrt(35))/sqrt(5) - (sqrt(252)/sqrt(4) + sqrt(7) + sqrt(7) - sqrt(7))))265. -1464sqrt(7) + 82941/10 Simplify -3(-5 + (-1 + 5 + 1(sqrt(243)31 + 1))*2). -6621 - 810sqrt(3) Simplify -3(2((-4 + sqrt(17) + sqrt(17) + sqrt(17)2 + 0)4 + 3))*2. -54252 + 4992sqrt(17) Simplify 6(0 + (sqrt(275) - (sqrt(275) + -1)-1) - (-11sqrt(275) + 2))*2. -540sqrt(11) + 14904 Simplify (-6((sqrt(117) + 6(sqrt(117) + -1) - sqrt(117)) + sqrt(117) + -2sqrt(117)4)-5-1)*2. 32400sqrt(13) + 137700 Simplify ((2sqrt(27)-2)/(-2sqrt(81)) + (2sqrt(864))/(sqrt(2) + sqrt(98) + sqrt(98)2 + sqrt(98)))2. 16900/2523 Simplify ((2sqrt(70)-1)/(sqrt(110)/(sqrt(176) - sqrt(11))))2 + (-4 + (-3(sqrt(77)1 + sqrt(77)))/sqrt(11))2 + 3 + 5. 48sqrt(7) + 528 Simplify (-5 + -4(-3 + -1sqrt(243)) + (sqrt(243) - -2sqrt(243)1) + 5 + -4)*2. 1008sqrt(3) + 11971 Simplify (3 + sqrt(6)/(sqrt(2)-2))2 + -4 + (sqrt(432) - (0 + sqrt(432) + sqrt(432) - sqrt(432)))2-3 + 2. -3sqrt(3) + 31/4 Simplify (sqrt(102) - (sqrt(102) + sqrt(102)-2)-2 - 6-3sqrt(102))/((sqrt(486)2)/(-6sqrt(18)/sqrt(2) - sqrt(9))). -119sqrt(17)/6 Simplify (-3(3sqrt(7))*2 - (sqrt(1008) + -1 + sqrt(1008))) + 5 - (1 + ((sqrt(343) - (-1 + sqrt(343)))5)*2 + 5). -214 - 24sqrt(7) Simplify (5 + -4 + (sqrt(11)5-3 - (sqrt(1584) + sqrt(44))))1. -29sqrt(11) + 1 Simplify -5((sqrt(2) - (1 + sqrt(50))) + sqrt(4)/sqrt(2)-2)*24 + (sqrt(126)/sqrt(36))/(sqrt(56)/(2sqrt(8))). -1460 - 239sqrt(2) Simplify (sqrt(140)/(2sqrt(10)1)2)/((3sqrt(18))/sqrt(9) + (2sqrt(12))/sqrt(6)). sqrt(7)/5 Simplify (-4(-4 + 5 + 1 + (1sqrt(245) - sqrt(245)) + sqrt(245) + -1 + (sqrt(245) + 0)-4)3)2. -6048sqrt(5) + 317664 Simplify sqrt(200)2-5 + 0 + 3sqrt(98) + 2. -79sqrt(2) + 2 Simplify (sqrt(1911)-1 + -1sqrt(2496) + sqrt(2496) + sqrt(39))/(((sqrt(336)/sqrt(7))/sqrt(2))/sqrt(8)) + 3. -6sqrt(13) + 3 Simplify (-2((sqrt(1008) + -1)5 + sqrt(1008) + 3 - (4 + -1sqrt(1008) - -2sqrt(1008)-2))3)2. -57024sqrt(7) + 4392144 Simplify 5 + -4(-2-1(sqrt(931) + (sqrt(931) + -4 + sqrt(931) - sqrt(931)))2-5 + 3). -4480sqrt(19) + 149593 Simplify ((-1 + 3(sqrt(125) - (sqrt(125) + 0)))*2 - -5((sqrt(125) - (sqrt(125) + (sqrt(125) + 2 + sqrt(125))*2) - sqrt(125)) + 2))5. -12545 - 1125sqrt(5) Simplify (1sqrt(228)2-54)/(-6sqrt(192) - 2(sqrt(12) + -3sqrt(12))). 2sqrt(19) Simplify (((4-2sqrt(78) - sqrt(78)) + sqrt(78))-36)/((-5-2sqrt(42))/(-6(sqrt(7) - -1sqrt(7))))-3. 2592sqrt(13)/5 Simplify -4((sqrt(63) - (2 + (sqrt(63) - (sqrt(126)/sqrt(2) - sqrt(63))))) + sqrt(5103)2 + 0 + sqrt(1008) + sqrt(126)/sqrt(2)5)*2-4. -5184sqrt(7) + 734896 Simplify (-4((-1 + sqrt(11) + -2 - sqrt(275)-1) + 0 + 1sqrt(891)))*2 + 4. -1440sqrt(11) + 39748 Simplify (3(sqrt(200)2 + sqrt(200))53)*2 - (-2(sqrt(200) - (sqrt(200) + (sqrt(200)-1)2)) - (-5 + -1 + sqrt(200))2). -120sqrt(2) + 3644836 Simplify ((-42sqrt(550) - sqrt(550))4)/(((sqrt(66) + (sqrt(66)-2 - sqrt(66)))-3)/(-3sqrt(12)/sqrt(2))). 90sqrt(2) Simplify (-3 + 0 + (sqrt(300)15 + sqrt(300) + -2sqrt(300) + -2 - (3-2sqrt(300) - (-4 + sqrt(300)-2 + sqrt(300)))))2 + 0. -1620sqrt(3) + 24381 Simplify (sqrt(2)14 + sqrt(24)/(sqrt(12) + sqrt(12)4) - (sqrt(22) + (sqrt(264) - -2sqrt(264))/sqrt(12))/(-2sqrt(891) + sqrt(11)))-2. -754sqrt(2)/85 Simplify (-5 + sqrt(75)4 + -1)2 - ((sqrt(1728) + 0)2 + -1). -491 - 240sqrt(3) Simplify (-3sqrt(1701)-3-5)/(2(-4sqrt(2240) + sqrt(2240) - sqrt(2240) - sqrt(2240))/sqrt(5)). 81sqrt(3)/16 Simplify (5 + -1sqrt(6300) + 51sqrt(6300) + (sqrt(6300)15 - (-1 + sqrt(6300) + -1 + sqrt(6300))))*2. 2940sqrt(7) + 308749 Simplify ((sqrt(78)-14 - (sqrt(78) + sqrt(78)4)4)/(sqrt(864) - sqrt(864)16 - 2sqrt(864)1))*2. 52/49 Simplify ((sqrt(120)/sqrt(2)3)/(sqrt(40)/sqrt(4)-4))/(sqrt(288) + 2sqrt(288) + sqrt(12)/sqrt(6)-5). -3sqrt(3)/124 Simplify (sqrt(171)/(sqrt(9)1) - sqrt(38)/sqrt(50)) + 3 - ((sqrt(95)-2)/sqrt(5) - (sqrt(931) + (sqrt(931) - (1sqrt(931))2))). -928 + 84sqrt(19)/5 Simplify 2 + 1((-2(sqrt(1377) + 2) + sqrt(1377) - ((sqrt(1377)1 - sqrt(1377)) + -2))5)*21. 900sqrt(17) + 34527 Simplify ((sqrt(891) - (sqrt(891) + sqrt(891) + sqrt(891) + 1 + 4) - sqrt(891))2 - (3 + 2sqrt(891) + sqrt(891))*2) + 2(1 + (0 + sqrt(1331))*2 + 4). 108sqrt(11) + 2688 Simplify (-31sqrt(204))/((sqrt(24)-2)/sqrt(2) + sqrt(12)) - ((1sqrt(136))/sqrt(8) + (4sqrt(51)/sqrt(3) - sqrt(17)) + -1). -sqrt(17) + 1 Simplify (-3-1sqrt(5324) - 61sqrt(5324))/(31sqrt(196) + (sqrt(196) - (-2(sqrt(196) + -2sqrt(196)) + sqrt(196)))). -33sqrt(11)/7 Simplify (((-1 + sqrt(405))16 - (sqrt(25) + (sqrt(25) - -4(sqrt(25) - sqrt(50)/sqrt(2))))/((sqrt(220) - sqrt(55))/sqrt(11))) + -5)2. -1144sqrt(5) + 13641 Simplify 3 + -2((sqrt(363) + 5 + sqrt(363) + sqrt(363) + 0 - (sqrt(363) - (sqrt(363) + 2 + sqrt(363)))1)6)2. -421701 - 44352sqrt(3) Simplify (sqrt(1100) + sqrt(1100) + (sqrt(1100) - -1sqrt(1100)) - sqrt(1100))/(sqrt(4) - -4sqrt(16)) - (((sqrt(176) + 1 + sqrt(176))5 + sqrt(176))2 + -3). -21318 - 1315sqrt(11)/3 Simplify -1 + ((4-2sqrt(864)-1)/(-2sqrt(968) - 4sqrt(392)))2. 1103/625 Simplify -5(-3 + -2 + sqrt(300)3 + sqrt(300) + sqrt(300) + ((sqrt(300) - sqrt(300)-1) + 1)-3)2. -1820 - 800sqrt(3) Simplify -2(sqrt(800) + (0 + sqrt(800))2 + -5 - (sqrt(800) - ((sqrt(800)-2)*2 + -4)))-6. 47892 Simplify (1(-1 + -3(sqrt(242) + 2 + (-4sqrt(242) - sqrt(242))) + -3 + 0)-3)*2. -23760sqrt(2) + 314532 Simplify (1(sqrt(95) + sqrt(95)-26)5)/(sqrt(45)4 - sqrt(605)-1). -55sqrt(19)/23 Simplify sqrt(80)/(-6sqrt(8)/sqrt(2)) + (2(sqrt(5)-6)2 - (-5 + sqrt(180))2). 179sqrt(5)/3 + 155 Simplify ((sqrt(44) + sqrt(396))-2 + (sqrt(220)2)/sqrt(5))/(-5-3sqrt(576)-4). sqrt(11)/120 Simplify -3(5 + 4(0 + sqrt(448)))*2 + ((1 + (-2(sqrt(448) + (sqrt(448) - (sqrt(448) - (-1 + sqrt(448)) - sqrt(448)))) - sqrt(448)))-1)2. -1296sqrt(7) + 382 Simplify (3 + (1 + sqrt(13) + -5 + sqrt(13) + 1 - (sqrt(39)/sqrt(3)-6 + -5)) + 3)2. 128sqrt(13) + 896 Simplify 4(1((0 + (sqrt(720) - (sqrt(720) + -1 - sqrt(720))) - s	{ "pile_set_name": "DM Mathematics" }
g. 3 Let b(a) = 12a + 1. Let p be b(2). Let s = p - 18. Solve -5h - s = -2 for h. -1 Let o(w) = -w*2 + 3w + 1. Let j be o(4). Let n be ((-6)/(-2) + j)/1. Solve q + 3q = n for q. 0 Suppose 0 = -5t - 3c - 11 - 4, -3t - 5c - 25 = 0. Solve t = -2x - 4 - 2 for x. -3 Suppose 3y + r - 20 = 0, -4y - r + 0r = -25. Suppose -7t + 2t + y = 0. Let c = -1 + t. Solve -l = -cl for l. 0 Let v be (-2)/(-7) + (-24)/(-14). Suppose 2m - 63 = -vr - 25, -5r + 35 = m. Solve -p + m = 4p for p. 3 Suppose 4b - 2b = 6. Let t = -14 - -28. Let o be (4 - -3)4/t. Solve -k = -ok + b for k. 3 Let a be 17/4 - (-11)/(-44). Solve -a = 4n - 0 for n. -1 Let t(y) = y - 1. Let r be t(1). Let d = 42 - 41. Suppose 2g - 5 + d = r. Solve gu + 3u = 25 for u. 5 Let c = -58 - -36. Let a = -16 - c. Solve 3m - am = -12 for m. 4 Suppose -5h - 1 = -11. Solve -hp = -0p - 6 for p. 3 Let h = 0 + 6. Solve -hg = -3g + 3 for g. -1 Suppose 0 = 5i + 39 - 144. Let f(r) = r*3 - 7r*2 + 8r - 8. Let t be f(6). Suppose -5n + 11 + 14 = 0. Solve -t = -nc + i for c. 5 Suppose 3y = -2y + 10. Solve n - 1 + y = 0 for n. -1 Let j = -9 - -13. Solve 0 = -0w - 2w - j for w. -2 Suppose 5o - 3a = 6o - 17, -2o + 3a = 11. Solve 0 = -2u - ou - 16 for u. -4 Let y be 4-1(2 + -3). Let p be (-2)/y(-3 - 1). Let s be (-1)/((-15)/(-9) - 2). Solve -px + 25 = sx for x. 5 Suppose -w + 30 = -6w. Let z = w + 11. Solve 2s - 13 + z = 0 for s. 4 Suppose 0 = -r - 0r + 7. Solve -5x = -3 - r for x. 2 Suppose -18 = -u - 3l, 5l - 41 = -3u - 3. Let q be 43 + u/((-4)/2). Suppose -q = -5c + 10. Solve -4m - c = -2m for m. -5 Let c = 7 + 9. Suppose 4k = -2y + c, -2y + 5k + 28 = 3. Solve -3w + 8w = y for w. 2 Suppose -2w + 5f + 25 = 0, -3w + 10 = -2f - 0. Solve wq = q for q. 0 Let c(z) = -3z*2 + 5z - 5. Let u(r) = -4r2 + 6r - 6. Let q(x) = 6c(x) - 5u(x). Let p be q(-1). Solve -p = -i + 3i for i. -1 Suppose 0 = -5i + 14 + 11. Let k = 2 - -1. Suppose 0 = km - 7 + 1. Solve v = mv - i for v. 5 Let n = 44 + -28. Solve -n = -2a - 2a for a. 4 Let v be 2((-36)/8)/(-3). Let c = 12 - 9. Solve va = -c - 0 for a. -1 Let s = 0 - 0. Suppose -2r - 9 = -4r - 3p, -3p = r - 3. Let w be s + -2 + 1 + r. Solve -3 = 2d + w for d. -4 Let z(v) = -4v - 3 + 3v - 2v + 0v. Let j be z(-3). Solve jc + 9 = 3c for c. -3 Let n(t) = t3 - 2t + 3. Let u be n(1). Solve -4 = -ub - 14 for b. -5 Suppose 4a - 26 + 10 = 0. Let q = -1 + a. Suppose 0m + 5t + 9 = m, -t + 7 = 2m. Solve mk = 5k + q for k. -3 Let g(b) = -b2 + 6b - 3. Let p be g(2). Let f = 31 + -21. Let w be f - p/(5/2). Solve 4k - w = 8 for k. 4 Suppose -3g + 7g = 0. Solve -2t + 2 - 4 = g for t. -1 Let d(s) = -2s - 4. Let p be d(-3). Solve pc - 4 = -0c for c. 2 Let q(x) = x + 10. Let n be q(-9). Solve -s - n = -2s for s. 1 Let h be 2/(-8)(0 + 1)-4. Solve 3w - h + 13 = 0 for w. -4 Suppose -3s = j - 20, 0s + 24 = 4s + 4j. Let n = s + 2. Suppose 3v - 14 = -w, w + 2w - 30 = -5v. Solve vg + 0g = -n for g. -3 Let y be 51/9 - 2/3. Solve 11 = 4x - y for x. 4 Let l = 2 + 1. Let k(c) = 4c*2 - 20c - 21. Let r be k(6). Solve -rp - l = -2p for p. -3 Let d = -145 + 150. Suppose 3v - 2 - 4 = 0. Suppose 0 = -2c - 2h + v - 8, 0 = c - 5h - 15. Solve -2t + dt = c for t. 0 Suppose 5 = v + 3t, -3v - v = -t + 32. Let y be ((-6)/(-7))/((-1)/v). Let p = -193 + 196. Solve -pz - y = -z for z. -3 Let d be 0 + 0 + -61. Let h = d - -18. Suppose -3s + 1 + 8 = 0, -i - 4s + 14 = 0. Solve -iu + h = u for u. 4 Suppose -3a + 4a = 5. Suppose -g = -2g + a. Solve 0 = gc - 3c + 10 for c. -5 Suppose k + 0k - 8 = 0. Suppose -2c = c - 5i - 1, -i = 5c - 11. Suppose -4 = -4n + cn. Solve -ng - 2 = k for g. -5 Let p(r) = 4r - 17. Let g be p(5). Let a = -13 + 20. Solve gm - 12 = am for m. -3 Let h(j) = j*2 - 7j + 12. Let d be h(5). Solve 3g = dg + 5 for g. 5 Let t be (1 + -2)-111. Suppose 3j = t + 4. Solve -j = -4o - 1 for o. 1 Let p(z) = -8z. Let j be p(-1). Let b be (12/j)/((-1)/(-2)). Let g(c) = c2 + 7c - 3. Let o be g(-8). Solve -br - 4 = -or for r. 2 Let b be 5/(-10)(-2 + 0). Let c(l) = 2l*2 - 3 + 4l + b + 1. Let h be c(-3). Solve ht + 5 - 30 = 0 for t. 5 Let y = -3 - -4. Suppose -4r + 8 = -12. Suppose 0 = -2z + r - y. Solve h - z = -3 for h. -1 Let t(f) = f3 + 5. Let r = -3 + 3. Let b be t(r). Suppose -bw + 4 = -1. Solve 0 = -g + w + 2 for g. 3 Let q(c) be the third derivative of -c6/120 - c5/60 - c*4/24 - 3c*2. Let p be q(0). Solve -n = -p - 4 for n. 4 Let o = -5 + 5. Solve o = w - 4 - 1 for w. 5 Suppose -1 - 1 = 2b. Let j be (-94)/(-6) - b/3. Suppose 4k = j + 4. Solve -kd = -1 - 4 for d. 1 Let p be (-1 - 3 - 0)-1. Solve 4h + p = 5h for h. 4 Suppose 2d - 9 = -c + 3d, -c + 25 = -5d. Suppose -5 = 4m + m. Let w be ((-8)/20)/(m/c). Solve -q + w = 1 for q. 1 Suppose z + 26 = 3z. Solve 3v + 4 = z for v. 3 Let v = -11 - -15. Suppose 0 = s - 3s + v. Solve 3t - st - 4 = 0 for t. 4 Suppose -4z - 19 = 53. Let s = -18 - z. Solve g - 2 = -s for g. 2 Suppose -2k + 2z = -10, -k = -0k + 3z + 15. Let w(y) = y - y - y + k. Let n be w(0). Solve n = r + r for r. 0 Let x = 7 - 5. Suppose xy - 6 = -y. Let m be (-1)/(y/(-10) + 0). Solve mj + 4 + 11 = 0 for j. -3 Suppose 4 = b - 1, -b = -2c + 1. Solve c + 3 = 2q for q. 3 Let u = -14 - -14. Solve -g + u + 2 = 0 for g. 2 Let q(m) = -m3 - 9m*2 - m - 7. Let u be q(-9). Solve 5l - 27 = -u for l. 5 Suppose z + 2z - 6 = -2n, -5n = 15. Let i(y) = y3 + 6y*2 + 4y - 4. Let f be i(-5). Solve z = -o - f for o. -5 Let d(s) = -2s3 - 2s*2 + 3s + 3. Let a be d(-2). Solve 0x - 25 = ax for x. -5 Let h be 6/(-4)12/(-9). Suppose -34x = -31x - 6. Suppose 4 + 10 = xj. Solve -hc + jc + 25 = 0 for c. -5 Suppose 14 = 3q - 1. Solve -2f = 3 + q for f. -4 Let c(v) = 5v2. Let i(s) = -24s*2. Let u(r) = -14c(r) - 3i(r). Let a be u(2). Solve 4x - 2x = a for x. 4 Suppose z + 4v = -1, -2z = -2v - 0 - 8. Suppose 0g = zg. Let p be (-8)/(-2) - (g + 1). Solve 0 = -2y - 7 - p for y. -5 Suppose -4p - w + 30 = -59, 0 = 4p + 4w - 92. Let s = p - 13. Solve -4a - 5 = -sa for a. 1 Suppose 5h - u - 8 = 0, -4h + 2 + 0 = -3u. Suppose -3q - hg + 35 = -g, -20 = -4g. Let t = 0 + 0. Solve t = d + d - q for d. 5 Let t(m) = -1. Let x(j) = j - 1. Let c(p) = -6t(p) + 7x(p). Let r(z) = -z*2 + 6z + 8. Let g be r(7). Let l be c(g). Solve u + 15 = lu for u. 3 Let r(h) = 4h - 96. Let p be r(24). Solve pd + 12 = 3d for d. 4 Let q(v) = v*2 + 8v + 10. Suppose -5r - 21 - 14 = 0. Let p be q(r). Suppose 3b + j + 3j = 32, j + 22 = pb. Solve 0w - 2w - b = 0 for w. -4 Suppose 0 = 2p - 2 - 6. Suppose pn + 3 = 3s, -4s + 31 + 4 = 5n. Solve 0 = -o - 1 + n for o. 2 Let s = 2 + 4. Let x be 1/(-4) - (-26)/8. Suppose l = -xl + 16. Solve 4d + l = sd for d. 2 Let y(a) = 0a - a - a + 0a - 9. Let d be y(-6). Solve -h - 4 = -d for h. -1 Let w = -5 + 7. Let c be (7 - w)(-2 - -3). Solve 3n + c = -1 for n. -2 Let b = 7 - 4. Let r(t) = t*2 - t - 3. Let u be r(b). Suppose n - 4 = -2v + 2, 0 = -uv + 5n - 4. Solve 0 = -7s + vs + 25 for s. 5 Let n = 351 - 350. Suppose 3v + a + 0 = 8, -2a = -v + 5. Solve vs + n = -2 for s. -1 Let h be 43/24-6. Let m(a) = a2 + 2a - 3. Let r be m(h). Solve i + 3i - 12 = r for i. 3 Suppose 0 = 4w - 14 - 30. Solve 4n = -3 + w for n. 2 Let m = -2 + 2. Solve m = k - 2 - 1 for k. 3 Let h(b) = -b + 4. Suppose -p = 2 - 5. Let l be (2/(-6))/(p/(-36)). Let s be h(l). Solve s = -4m + 27 - 11 for m. 4 Let s(j) = -j3 + j2 + j - 1. Let l be s(1). Suppose -p + 25 = -lp. Solve 4q + p = -q for q. -5 Let s(l) = -l + 14. Let j(h) = -3h + 41. Let w(x) = 6j(x) - 17s(x). Let p = 6 - 1. Let b be w(p). Solve -br - 10 + 4 = 0 for r. -2 Let y be (-246)/(-12) + 2/4. Let s be 46/14 + (-6)/y. Solve -18 + s = -3d for d. 5 Let n be -1 + 5/1 - 3. Solve 0 = -5m + 19 + n for m. 4 Let i be 0/(-1 - (2 - 1)). Suppose 0 = -d - id + 6. Solve -r = -dr for r. 0 Let b = -14 + 19. Solve -5p + b = -10 for p. 3 Let z be (1-1)/((-1)/1). Suppose 3g = 2g + 3, 0 = -o + 2g - 15. Let u(h) = h2 + 10h + 13. Let c be u(o). Solve c + z = a for a. 5 Let a be ((-4)/6)/(4/(-72)). Let u be (-4)/24 - (-26)/a	{ "pile_set_name": "DM Mathematics" }
4)). -21sqrt(19) Simplify ((-1sqrt(684) + sqrt(684))-2-2)*2 - ((sqrt(19)-3 + 1)*2 + (sqrt(684) - -2sqrt(684))*2 + sqrt(19)). -6328 + 5sqrt(19) Simplify -1 + (4 + (sqrt(3) + -2sqrt(3) + 4 - (sqrt(3) + sqrt(3) + sqrt(6)/sqrt(18))))2. -160sqrt(3)/3 + 289/3 Simplify 2 + 2 + ((sqrt(108)-3)2 - sqrt(108) - (-1sqrt(75))*2). -6sqrt(3) + 901 Simplify ((sqrt(637) + sqrt(637) + 0)-4 + (-4(sqrt(117) - 1sqrt(117)))/sqrt(9))2 + -1. 40767 Simplify -4 + (-4 + ((-2 + sqrt(931))4)*2)5. -2240sqrt(19) + 74776 Simplify (-1(sqrt(5324) + -4sqrt(5324)))/(sqrt(48)/(sqrt(768)4 + sqrt(12))). 1089sqrt(11) Simplify -1 + (sqrt(14)/(sqrt(12)/sqrt(6)) + -2 - (sqrt(252) + sqrt(252)2 + sqrt(7) - (sqrt(7)-13 - sqrt(7))*2)). -18sqrt(7) + 109 Simplify (((sqrt(330)-2 + sqrt(330))-6)/sqrt(10))/(1sqrt(891)-5). -2sqrt(3)/15 Simplify -2 + ((sqrt(4455) - ((sqrt(4455) - sqrt(4455)2) + sqrt(4455))) + sqrt(4455) - sqrt(4455))/sqrt(5)1. -2 + 9sqrt(11) Simplify 3 + ((sqrt(136)-24 + sqrt(136) - sqrt(136) - sqrt(136))-3)/(sqrt(24)/(sqrt(147)2 + sqrt(147) - sqrt(147))). 3 + 378sqrt(17) Simplify (sqrt(220) - -1sqrt(220))/sqrt(5) + -2 + (sqrt(99) - -1sqrt(99))2 + sqrt(99). 7sqrt(11) + 394 Simplify ((sqrt(36) + sqrt(216)/sqrt(6))24)/(1(sqrt(12) + 1sqrt(432) + sqrt(12))). 2sqrt(3) Simplify (-4 + sqrt(288) + 4 + 1 + (sqrt(288)-1 + sqrt(288))-24)*2. 24sqrt(2) + 289 Simplify (3sqrt(880))/sqrt(5) + (sqrt(275)/sqrt(5)-1)/sqrt(5). 11sqrt(11) Simplify (sqrt(228) + 1sqrt(228)-1 + (-1sqrt(228) - sqrt(228))-2)/(5sqrt(24)/sqrt(2) - 1sqrt(192)). 4sqrt(19) Simplify 1((sqrt(68)-4)/sqrt(4) - sqrt(272)4). -20sqrt(17) Simplify 2 + -1 + 0 + (-4 + sqrt(63) + -2)*2 + -2. -36sqrt(7) + 98 Simplify ((sqrt(78) - (-2sqrt(78) + sqrt(78)))-1 + sqrt(78) - -3(sqrt(78) + (sqrt(78) - sqrt(78)2) - sqrt(78)))/(-21sqrt(600)). sqrt(13)/5 Simplify (1 + 0 + ((sqrt(84) - sqrt(21))/sqrt(7) - sqrt(3)) + ((sqrt(12) - sqrt(24)/sqrt(2)) + sqrt(12) - sqrt(12))/sqrt(4) + -3)*2. 4 Simplify 1(sqrt(55)/(sqrt(22)/sqrt(2)))*2 + (sqrt(30)21 - sqrt(30))/sqrt(6). sqrt(5) + 5 Simplify ((sqrt(720) + 5)-5 - 5sqrt(720)-5)*2. -12000sqrt(5) + 288625 Simplify (sqrt(21)/(-1sqrt(7) - sqrt(7)) + sqrt(27)-1 + ((sqrt(108) - (1 + sqrt(108))) + -2)*2)6. -21sqrt(3) + 54 Simplify -4(-5 + -3sqrt(7)-5) + -3. -60sqrt(7) + 17 Simplify (sqrt(228) - (3sqrt(228)-4 + sqrt(228)))/(sqrt(192)-1). -3sqrt(19) Simplify (-2(5 + sqrt(720)-2 + sqrt(720) + (sqrt(720)-2-3 - sqrt(720) - sqrt(720))))2. 1440sqrt(5) + 26020 Simplify (0 + -4(4 + sqrt(42)/sqrt(6))2)2-3. 192sqrt(7) + 552 Simplify 2 + sqrt(13)2 + sqrt(13) + 0 - 3(sqrt(13) + sqrt(117))-3. 2 + 39sqrt(13) Simplify 2(1 + (-3 + (sqrt(288) - (sqrt(288)3 + sqrt(288))4))2). 2160sqrt(2) + 129620 Simplify ((4sqrt(75)2 - (-5 + sqrt(432) + -2))5)2. 9800sqrt(3) + 60025 Simplify ((sqrt(980) + 1sqrt(980))2 + 5 + sqrt(980) - sqrt(980)) + ((sqrt(980) + 2 + sqrt(980))-2 - sqrt(980))*2 + 1. 560sqrt(5) + 28442 Simplify (5(-3(sqrt(637) + 1) + sqrt(637)) + -6(-2sqrt(637) - sqrt(637)) + 1 + sqrt(637) + 0)*2. -1764sqrt(13) + 51793 Simplify (-3 + 3(-2 + sqrt(468) + -2 + sqrt(468)))1. -15 + 36sqrt(13) Simplify (-2 + 5 + (sqrt(304) + -2)-2 + sqrt(304) + -3(-3 + sqrt(304)) + sqrt(304))2. -384sqrt(19) + 2992 Simplify (1(0 + sqrt(539)) - (sqrt(539) + (sqrt(539) - -3sqrt(539)-1)))2 - (1 + ((0 + sqrt(275))-2 - sqrt(275))). 15sqrt(11) + 2155 Simplify -1sqrt(18)2 - -3sqrt(2)-33. -33sqrt(2) Simplify (sqrt(726) - (sqrt(726) + (sqrt(726) - (sqrt(726)-2 + sqrt(726))))5)/(1sqrt(98) - (sqrt(128) + sqrt(128) + sqrt(128) + 2sqrt(128))). 14sqrt(3)/3 Simplify (sqrt(14) + -2sqrt(504))/(sqrt(600)/sqrt(12))5. -11sqrt(7) Simplify sqrt(21)/sqrt(63) + -3 - (5 + sqrt(27)4). -35sqrt(3)/3 - 8 Simplify (2 + (sqrt(70)22)/(sqrt(40)/sqrt(100)))2. 80sqrt(7) + 2804 Simplify (2 + (sqrt(117) + sqrt(117) + 1 + 0 - (1 + sqrt(117) + 0)))*2. 12sqrt(13) + 121 Simplify ((-6((sqrt(119) - (sqrt(119) - 5(sqrt(119)-3 - sqrt(119)))) + sqrt(119) + sqrt(119)))/(-4-2sqrt(343)))2. 12393/196 Simplify (sqrt(209)-1-4 - -2sqrt(209)-4)/(sqrt(396) + (sqrt(11) - sqrt(55)/(-2sqrt(5)))). -8sqrt(19)/15 Simplify ((sqrt(6292) - 1sqrt(6292)) + -1sqrt(208)/sqrt(4))/(sqrt(4) + 3(sqrt(12)/sqrt(3) - sqrt(4)) - (sqrt(4) + -3-2sqrt(4))). sqrt(13)/6 Simplify (2(sqrt(220) + (sqrt(220) - sqrt(220)-1)))/((-1sqrt(25))/sqrt(5)). -12sqrt(11) Simplify 64(6(-4 + sqrt(3)) + 3)1. -504 + 144sqrt(3) Simplify (sqrt(99) - ((-4(sqrt(99) + sqrt(99)-2) - sqrt(99)) + sqrt(99)))/(-5-2sqrt(9)) + 5. -3sqrt(11)/10 + 5 Simplify -2 + 1 + ((sqrt(136)/sqrt(8))*25 - (-2 + sqrt(136)/sqrt(8))*2)5. 20sqrt(17) + 319 Simplify 3((sqrt(176) - (5 + -1 + sqrt(176) - sqrt(176))) + -5(sqrt(176) + sqrt(176) + -2))2. -1296sqrt(11) + 42876 Simplify (4(sqrt(1377) + -2)5)*2-4. -2209600 + 57600sqrt(17) Simplify (2sqrt(102)6)/sqrt(6) + sqrt(17) + 1sqrt(68)/sqrt(4) + (sqrt(2057) + 1)*2. 36sqrt(17) + 2058 Simplify (-3 + sqrt(11) + -1 - (sqrt(44)/sqrt(4) + -1))*2 + sqrt(88)/(sqrt(48)/(sqrt(24) - sqrt(6))). sqrt(11) + 9 Simplify -4(3(-2sqrt(272) - sqrt(272))-2 + (sqrt(272) + (sqrt(272) + -1sqrt(272) + 2 + sqrt(272))*2 - (-51sqrt(272) - sqrt(272)))). -464sqrt(17) - 1104 Simplify ((0 + 1sqrt(98) + sqrt(98) - 5(sqrt(98) + 1)) + (sqrt(98) + 0)-6 + -2)2. 882sqrt(2) + 7987 Simplify (((sqrt(1500) - sqrt(1500)3)-6 - sqrt(1500))/((-1sqrt(96))/sqrt(8) + (sqrt(300)1 + sqrt(300) - sqrt(300)) + sqrt(300)))*2. 15125/81 Simplify (51sqrt(160) - sqrt(160) - sqrt(160) - (((sqrt(160) - -2sqrt(160))-3 - sqrt(160)) + sqrt(160) - sqrt(160)))/((2sqrt(392) + sqrt(392))4). 13sqrt(5)/42 Simplify ((-61(-3sqrt(66) - sqrt(66) - sqrt(66)))/(6(sqrt(486) - (sqrt(486) + sqrt(486)3 + sqrt(486) + sqrt(486)) - sqrt(486) - sqrt(486))))2. 275/3969 Simplify (-4(sqrt(1900) + sqrt(1900)2)5)*2 - ((sqrt(1900) - (5sqrt(1900)2 - sqrt(1900)))2 - (sqrt(1900) + 2sqrt(1900) + 1)*2). 60sqrt(19) + 6735501 Simplify -2(-1(sqrt(187) + 4(sqrt(187) + sqrt(187) + (sqrt(187) - (sqrt(187)1 - sqrt(187))))))/(1sqrt(11)-1 + 5(sqrt(22)/sqrt(2) + sqrt(11) + sqrt(11))). 13sqrt(17)/7 Simplify -1 + ((4(sqrt(540)-2 + sqrt(540)) + sqrt(540))/(sqrt(588)1))2. 356/49 Simplify -5(sqrt(2) + sqrt(4)/sqrt(2) - sqrt(2))*2 + 0 + (sqrt(4)/sqrt(2)-6)*23. 206 Simplify (((sqrt(605) - sqrt(605)1 - sqrt(605))5)/sqrt(11))/(-51sqrt(5) - (sqrt(5) - (sqrt(110)/sqrt(2))/sqrt(11))). sqrt(11) Simplify sqrt(432)/sqrt(4) + sqrt(3) + sqrt(75) + (sqrt(75)1 - sqrt(75)) - 6(sqrt(27) + sqrt(108)5)/sqrt(9). -54sqrt(3) Simplify 4 + (-34(-3 + sqrt(468)))*2. -5184sqrt(13) + 68692 Simplify -5 + ((sqrt(448) - (-1 + sqrt(448)))3 + (sqrt(448) + -1)3)*2. 4027 Simplify (-5 + -5(-2 + sqrt(125)1)-3)*2. -5250sqrt(5) + 29350 Simplify -3 + sqrt(91)/(sqrt(35)/sqrt(5)) + 3(5 + sqrt(26)/sqrt(2)). 12 + 4sqrt(13) Simplify -3(-4 + sqrt(833) + (1 + sqrt(833))2 - (-4 + 2 + sqrt(833))). -2496 - 42sqrt(17) Simplify (-1(sqrt(684) + -5))2 + ((-4sqrt(19) + -3)4)2. 324sqrt(19) + 5717 Simplify (-3sqrt(77)-1 - 5(sqrt(77) + sqrt(77) + 1sqrt(77)))/(-1sqrt(99)-4). -sqrt(7) Simplify (5 + (4(sqrt(320) + -1) - -2sqrt(320)2)2)3. -1536sqrt(5) + 61503 Simplify 2(3 + (5sqrt(144)/sqrt(3) - sqrt(48)))2-4. -6216 - 768sqrt(3) Simplify (sqrt(288) + 0 - (sqrt(20)/(sqrt(20)/sqrt(2)))2 - ((1 + sqrt(2))-1 - sqrt(8)/(sqrt(8)/sqrt(2)))) + 5. 4 + 14sqrt(2) Simplify (sqrt(119)15 + (1sqrt(119) + sqrt(119))-1)/(6(sqrt(70)/sqrt(2))/sqrt(5)). sqrt(17)/2 Simplify 1 + (1sqrt(190)-3)/(sqrt(1000) + (sqrt(1000) - sqrt(1000)1) + sqrt(1000)). -3sqrt(19)/20 + 1 Simplify (-2sqrt(396)-2 - -2sqrt(396)-1) + 3. 3 + 12sqrt(11) Simplify (-3 + -2(-2sqrt(162) + 0 - (-3 + sqrt(162)-2 + sqrt(162))))*2. -324sqrt(2) + 729 Simplify ((5(sqrt(66) + 2sqrt(66) + sqrt(66)) - (42sqrt(66) - sqrt(66)))/(sqrt(36)/(sqrt(6) - sqrt(12)/sqrt(128))))*2. 91091/64 Simplify (sqrt(108) - (sqrt(108) + ((sqrt(108) - 2sqrt(108))-1 + sqrt(108) - sqrt(108))))/(sqrt(96)6). -sqrt(2)/8 Simplify (-2(sqrt(143) + -2sqrt(143))2)/((sqrt(396)/sqrt(36))/sqrt(4)) + -4. -4 + 8sqrt(13)	{ "pile_set_name": "DM Mathematics" }
-3094492, -3094260, -3094028? -3093796 What comes next: 13626, 27178, 40672, 54102, 67462? 80746 What is next in 92657302, 185314636, 277972010, 370629430, 463286902, 555944432, 648602026? 741259690 What comes next: 16646, 16988, 17564, 18380, 19442, 20756, 22328? 24164 What is next in -876, -386, 1020, 3804, 8428, 15354, 25044, 37960? 54564 What is the next term in -770, -2593, -5664, -10013, -15670, -22665, -31028? -40789 What is the next term in 887094, 887081, 887080, 887097, 887138, 887209, 887316, 887465? 887662 What is the next term in -654822, -654838, -654860, -654888? -654922 What comes next: -573, -1054, -1485, -1866, -2197, -2478? -2709 What is next in -95330, -95350, -95370, -95390, -95410? -95430 What comes next: -6460, -26333, -60270, -108937, -173000, -253125, -349978? -464225 What comes next: -262933, -525282, -787049, -1048234, -1308837? -1568858 What comes next: -5023, -40685, -137571, -326299, -637487, -1101753? -1749715 What is the next term in -349, -646, -969, -1318, -1693? -2094 What comes next: 3200, 6425, 9712, 13097, 16616, 20305? 24200 What comes next: -1136, -2814, -5614, -9536, -14580? -20746 What comes next: -19582400, -39164793, -58747186, -78329579, -97911972? -117494365 What comes next: 68686, 274931, 618672, 1099909, 1718642, 2474871, 3368596? 4399817 What is the next term in -1045, -985, -909, -817? -709 What comes next: -15022, -14874, -14726, -14578, -14430, -14282? -14134 What is next in 10758760, 10758761, 10758762, 10758763, 10758764? 10758765 What is the next term in -12301, -21774, -31247? -40720 What comes next: -1146, -1436, -1854, -2466, -3338, -4536, -6126, -8174? -10746 What is next in -410844, -410694, -410544, -410394, -410244, -410094? -409944 What comes next: -1338, -11571, -39590, -94287, -184554? -319283 What is next in -3087, -6188, -9287, -12384, -15479, -18572? -21663 What is next in -184701802, -184701803, -184701804, -184701805, -184701806? -184701807 What is the next term in -41633, -159906, -357027, -632996, -987813, -1421478, -1933991? -2525352 What comes next: 17, -46, -177, -382, -667, -1038, -1501? -2062 What is the next term in 1554, 1635, 1656, 1587, 1398, 1059, 540, -189? -1158 What is next in -20199, -20817, -21817, -23175, -24867, -26869? -29157 What is the next term in -9556, 438, 10432? 20426 What is the next term in -2781488, -5562966, -8344428, -11125868, -13907280, -16688658, -19469996? -22251288 What is next in -3294204, -3294218, -3294240, -3294270, -3294308, -3294354? -3294408 What is next in -19820, -19842, -19832, -19790? -19716 What comes next: -10208, -20253, -30296, -40337, -50376? -60413 What is the next term in -8206934, -16413876, -24620816, -32827754? -41034690 What comes next: -17886702, -17886704, -17886706? -17886708 What comes next: -50915, -50891, -50835, -50735, -50579, -50355, -50051? -49655 What comes next: -4107, -32417, -109249, -258861, -505511? -873457 What is next in -35409, -35374, -35341, -35310, -35281, -35254, -35229? -35206 What is next in 5404, 10076, 14784, 19546, 24380, 29304, 34336, 39494? 44796 What comes next: -5100, -10253, -15460, -20727, -26060? -31465 What comes next: 2196, 6911, 14146, 23901, 36176? 50971 What is the next term in -21013, -84028, -189041, -336052, -525061, -756068? -1029073 What comes next: 26380, 52682, 78982, 105280, 131576, 157870? 184162 What is the next term in -13270, -13206, -13154, -13120, -13110, -13130, -13186, -13284? -13430 What is next in -4163, -3658, -3155, -2654, -2155? -1658 What is next in -8485, -16977, -25469, -33961? -42453 What comes next: 41820, 41834, 41860, 41898? 41948 What is next in -271176, -271152, -271128, -271104? -271080 What comes next: 1006, 1002, 1004, 1006, 1002? 986 What comes next: 10724176, 21448347, 32172518, 42896689? 53620860 What is the next term in 114648, 234122, 353596, 473070, 592544? 712018 What is the next term in 1002, 3390, 7048, 11976? 18174 What comes next: 714102, 714110, 714118, 714126, 714134, 714142? 714150 What comes next: 397113, 397072, 397031, 396990, 396949, 396908? 396867 What is the next term in 217819, 435481, 653143, 870805, 1088467, 1306129? 1523791 What is the next term in -3568, -15891, -36456, -65269, -102336, -147663? -201256 What is next in -63510, -63664, -63818, -63972, -64126? -64280 What is next in -6429, 1928, 10283, 18636, 26987? 35336 What is next in 2925, 2851, 2767, 2667, 2545, 2395, 2211? 1987 What is the next term in -112165, -111885, -111605, -111325? -111045 What comes next: 989, 6782, 22133, 51818, 100613, 173294, 274637, 409418? 582413 What is the next term in 5516, 12692, 19868, 27044, 34220? 41396 What is the next term in 520939, 2083630, 4688071, 8334262, 13022203? 18751894 What is next in 66782858, 66782865, 66782872, 66782879, 66782886? 66782893 What is next in -202706, -405356, -608006? -810656 What is next in -129, -467, -1127, -2211, -3821, -6059, -9027, -12827? -17561 What is the next term in 1834214, 7336956, 16508192, 29347922, 45856146? 66032864 What is the next term in -57471, -114856, -172241, -229626? -287011 What is next in 5012441, 10024805, 15037097, 20049323, 25061489, 30073601, 35085665, 40097687? 45109673 What comes next: 3664, 7118, 10572, 14026, 17480, 20934? 24388 What is the next term in 7782, 14602, 20464, 25368, 29314, 32302, 34332? 35404 What is next in -6984, -13947, -20926, -27921, -34932, -41959? -49002 What is the next term in 192624, 385240, 577858, 770478, 963100, 1155724, 1348350? 1540978 What comes next: -305605, -1222348, -2750229, -4889248, -7639405, -11000700, -14973133? -19556704 What is the next term in -47589, -47546, -47521, -47520, -47549, -47614? -47721 What comes next: -662, -1044, -1502, -2060, -2742, -3572, -4574? -5772 What is next in 15522, 30829, 46136, 61443, 76750, 92057? 107364 What comes next: 10294, 10165, 9950, 9649, 9262, 8789? 8230 What comes next: 96189, 192514, 288839, 385164, 481489, 577814? 674139 What comes next: 832, 2711, 5630, 9595, 14612, 20687, 27826, 36035? 45320 What is next in 845, 3071, 6697, 11723, 18149? 25975 What is the next term in -74363, -74281, -74247, -74285, -74419, -74673, -75071, -75637? -76395 What comes next: -97329933, -194659865, -291989797, -389319729, -486649661? -583979593 What comes next: -6716049, -13432090, -20148127, -26864160, -33580189, -40296214? -47012235 What is next in -71381, -77850, -95399, -129566, -185889, -269906, -387155? -543174 What is the next term in -8298, -7503, -6178, -4323, -1938? 977 What is the next term in -45724908, -45724874, -45724840, -45724806? -45724772 What is the next term in -56799129, -56799112, -56799095? -56799078 What is next in -23861, -191035, -644779, -1528373, -2985097, -5158231, -8191055, -12226849? -17408893 What is the next term in 112687235, 225374467, 338061699? 450748931 What is the next term in -426637, -426615, -426571, -426499, -426393? -426247 What is the next term in 17771342, 35542685, 53314028, 71085371, 88856714? 106628057 What comes next: 1743, 2188, 3087, 4440, 6247, 8508? 11223 What comes next: 54822, 108593, 162364, 216135, 269906? 323677 What is next in 1308931854, 1308931850, 1308931844, 1308931836, 1308931826, 1308931814? 1308931800 What is next in 190758, 381537, 572316, 763095? 953874 What comes next: 3771515, 7542951, 11314387, 15085823? 18857259 What comes next: -6120, -12115, -18144, -24231, -30400, -36675, -43080, -49639? -56376 What is next in 51836831, 103673662, 155510491, 207347318, 259184143, 311020966, 362857787? 414694606 What is next in -370, -1086, -2276, -3940, -6078, -8690, -11776? -15336 What is the next term in 11426501, 11426502, 11426503, 11426504, 11426505? 11426506 What is next in -35879, -143509, -322893, -574031, -896923, -1291569, -1757969? -2296123 What is next in 69480848, 69480851, 69480854, 69480857, 69480860, 69480863? 69480866 What is the next term in 486834, 3894684, 13144568, 31157502, 60854502, 105156584, 166984764, 249260058? 354903482 What comes next: 7081, 7102, 7125, 7150, 7177, 7206, 7237? 7270 What is next in 62769, 125520, 188257, 250980, 313689? 376384 What comes next: 21080, 60995, 100910, 140825, 180740, 220655? 260570 What comes next: 66278, 66224, 66154, 66074, 65990, 65908? 65834 What is next in -12328, -13893, -16454, -	{ "pile_set_name": "DM Mathematics" }
the smallest value in -3, b, 4? -3 Let u be (2 + (-10)/4)-10. Suppose -2 = -uw - 7. Let b be w + 3 - (-21)/(-12). What is the second biggest value in -3, b, 0? 0 Let y be (7/(-7))/(1/1). Let n = 3 + y. What is the third biggest value in n, -2, -0.1? -2 Let c = 67/85 + 1/85. Let f be (4/78)/(2/(-6)). What is the third smallest value in c, -0.4, f? c Let z = 6 + 2. Let r = 8.4 - z. Let m = 3 - 6. Which is the second biggest value? (a) 1/8 (b) m (c) r a Suppose 0 = -2q - 4 - 2. Let m = -36 - -37. What is the second biggest value in m, q, -0.3? -0.3 Let g = 2.5 - 6.5. What is the second smallest value in -0.09, 1/9, -1/7, g? -1/7 Let z = 6.7 + -7. Let k be ((-2)/(-6))/(26/(-12)). Which is the biggest value? (a) k (b) -1 (c) z a Suppose -5a - 4 = -7a. Let b be ((-30)/34 - 1) + a. What is the second smallest value in b, 4, 5? 4 Let g be -4(27/14 + -2). What is the third smallest value in 0.3, g, -2? 0.3 Let l = -59/87 + 1/87. Let i = -0.02 - 21.98. Let s = i + 22.5. Which is the third biggest value? (a) -0.1 (b) s (c) l c Let k = 4.03 - 4. Let v = -2.03 + k. Let u = -41/4 + 275/28. Which is the smallest value? (a) 3/8 (b) u (c) v c Let w be 12/(-24)-101. What is the smallest value in -3, w, -1/2, -1.1? -3 Let y = 1.4 + 0.6. Let j = -5/1514 + -5121/283118. Let f = j + -728/935. What is the second biggest value in -2/5, y, f? -2/5 Let n = -67 + 70. Let p = 3/25 - 52/225. Which is the third smallest value? (a) n (b) p (c) 0.4 a Let i = -0.8 + -3.2. Let w = i + 1. Let p = 0 + -4. Which is the second biggest value? (a) -1 (b) w (c) p b Let f = 1 - -4. Which is the third smallest value? (a) f (b) 4 (c) -1 (d) -2/5 b Let n be ((-1)/(-5))/((-8)/5). Which is the second smallest value? (a) 7 (b) n (c) 2 (d) 1/3 d Let w = -2815/6601 - 2/943. Let o = -2 + 2.01. Let i = -2.01 + o. Which is the second biggest value? (a) i (b) -1/5 (c) w c Let u be (12/7)/(18/63). What is the biggest value in 5, -5, u, -2/9? u Let d = -134 + 398/3. What is the third biggest value in d, 2/7, 1, -2/9? -2/9 Let w be 14/(-63) - (-8)/9. Let x = -0.01 - -0.11. Which is the biggest value? (a) -5 (b) w (c) x b Suppose -4f = -2r + 26, 6r + f = r + 21. Let t = -0.1 - -0.3. What is the third smallest value in 1/4, t, r? r Let j be (-4)/10(-130)/105. Let d = 6/35 + j. Which is the biggest value? (a) d (b) 5 (c) 4/3 b Let k = -29.5 + 31.5. Let c be 8/70(-10)/(-4). What is the second smallest value in -5, c, k? c Suppose -r + 6 = -2r. Let o(f) = -f - 8. Let m be o(r). Which is the third biggest value? (a) 0.05 (b) -0.1 (c) m c Suppose 2y + 3 + 3 = 0. Let h be 1 - ((-244)/(-72) - 2). Let g = h - 1/9. What is the smallest value in 4, y, g? y Let m = -9 - -7. Suppose 4u = -20, 0j + 35 = -5j - 4u. What is the third smallest value in j, m, -1/2? -1/2 Let w = -62 + 88. Let k be 2/(-13) - 100/w. Let q = -4 - -1. What is the second smallest value in k, 0.2, q? q Let i be 35/150 + 4/(-10). Let q = 1.2 - 1.7. Which is the biggest value? (a) i (b) -13 (c) q a Let n = -0.8 - -1.2. Which is the second biggest value? (a) n (b) 0.1 (c) -0.2 b Let l = -0.16 + 0.56. Which is the biggest value? (a) 3 (b) l (c) 0.1 a Let p = 1 - -1. Let y = -12070 - -603471/50. Let q = -2/25 - y. What is the second biggest value in q, 1, p? 1 Let n = 0.1 + -0.1. Let j = n + 1. What is the second biggest value in j, 0, 0.08? 0.08 Let f = -5 + 4.4. Let i = -7.6 - f. Let c = i + 7.09. What is the third biggest value in 0, -1, c? -1 Let v = -162/175 - -16/25. Which is the third biggest value? (a) -4 (b) -0.4 (c) v (d) -3 d Let x = -0.098 - -0.148. Which is the biggest value? (a) x (b) -2/19 (c) 0.2 (d) -2 c Let k = -7.8 + 8. Which is the biggest value? (a) -0.5 (b) k (c) -2 b Let c = 8 - 3. Let a be (-124)/56 - 25/(-10). What is the third smallest value in c, -7, a? c Suppose 2g + 2g + 20 = 0. Let p = -0.2 - 0.8. Let l = -2 + p. Which is the second smallest value? (a) g (b) 5 (c) l c Let l be 2/8 + (-57)/(-12). What is the smallest value in 0.1, l, -2/7? -2/7 Let h = -11 + 5. What is the biggest value in -0.3, -4, h? -0.3 Let i be (-12)/70 - (17/5 - 3). What is the third smallest value in i, 2, 1/3, -0.2? 1/3 Let h = 10 + -10.1. Let s(o) = o3 - o2 - 3o + 3. Let n be s(2). Suppose t - 4 - n = 0. What is the second smallest value in -1/3, h, t? h Suppose 5m + 4i + 0i = 5, -5m + 4i = -5. Let k be 1 - 1/(-6) - m. Which is the biggest value? (a) k (b) -0.3 (c) -1/4 a Suppose -8 - 7 = 5m + 5n, -5n - 7 = -3m. Let p = 1/4 + 1/4. Which is the second biggest value? (a) m (b) p (c) 2/11 c Let u = 4.04 - -0.96. Let v = 0.03 - 2.03. Which is the third smallest value? (a) -1/3 (b) v (c) u c Let j(u) = -u3 + 7u*2 - 5u. Let y be j(6). Let b be y/15 + (-34)/60. Let v = -26 + 21. What is the third biggest value in v, 1, b? v Let f = 10 + 4. Suppose 5u = -3t - t + 11, -3u = -5t - f. Which is the third biggest value? (a) 2 (b) t (c) 4/9 b Let c = -103 + 100. What is the second smallest value in -3/5, -1/4, c? -3/5 Let p be (-54)/(27/6 - 3). Let f be 21 - (-76)/p. Let i = 4/27 + 10/297. What is the smallest value in f, 2/5, i? f Let d = 3 - 2. Let p = 0.8 - d. Let q = 250 - 2748/11. What is the third biggest value in 0.3, p, q? p Let x = 8.7 + -9. Let t = -2.7 + x. Which is the biggest value? (a) -0.3 (b) -0.5 (c) t a Let r be -2 + 2/312. Let m = r + -8. Let n(k) = 4k2 - k. Let a be n(1). What is the biggest value in 2/5, m, a? a Let x = -6 + 3. Let t = x + 1. Let d = -0.07 - 0.93. Which is the third smallest value? (a) t (b) d (c) 0.3 c Let k = -0.95 - -1. Let z = k + 1.95. Let j = 10 + -11. What is the third biggest value in z, j, -1/4? j Suppose 0 = -0z - z + 100. Suppose 4g + g = z. Suppose 5b - 3y = -g, -5 = -2b + y - 13. What is the smallest value in b, -5, -3/2? -5 Let w = 1 + -0.5. Let x = -2.5 + w. Which is the third biggest value? (a) -3 (b) x (c) -0.5 a Let u = 5 - 9. Suppose -2k + 4i - 12 = 0, -k + 4i - i = 11. Let r = k - 4. What is the second smallest value in r, u, 2/9? r Let p = -10.25 - -0.25. Let v = p + 9. Which is the second biggest value? (a) v (b) 5 (c) 0.3 c Suppose q - 4 = -3w - 3q, w + 3q - 3 = 0. Suppose w = 4p - p. What is the smallest value in -0.01, p, -1/2? -1/2 Suppose 0 = -0t + 2t - c + 4, 0 = -3t + 5c - 20. Let n(q) = q + 10. Let p be n(t). Let r be 4/p90/24. What is the third smallest value in -5, r, 5? 5 Let h = -4.22 - -0.22. What is the third smallest value in h, -0.1, 0? 0 Let g be ((-8)/(-10))/(84/30). What is the biggest value in -3/2, 0.5, g? 0.5 Let m be (-9 - -6)/(15/2). What is the third biggest value in 0.7, 4, m? m Let x = -0.28 - 1.12. What is the smallest value in x, 1/8, 5? x Let y = 12.8 - 13. Which is the second smallest value? (a) 1 (b) y (c) 0.4 c Let h = -1/5 - -9/20. Let i = -19 + 75/4. Which is the biggest value? (a) h (b) i (c) 2/3 c Let s = -8.2 + 9. Let h = s + -1.1. Suppose -21 = -10i + 19. Which is the biggest value? (a) i (b) -6/5 (c) h a Suppose 3r + 9 = -2m + 5m, -4m = -2r - 8. Which is the second smallest value? (a) 3/2 (b) m (c) -2/25 b Let t = -24971 + 3146363/126. Let l be 124/(-63) + (-8)/(-4). Let h = t + l. What is the second smallest value in 0.2, h, -2/13? h Let w be 186/(-42) - (-6 + 2). Suppose -3j = -j + 4. Let m be (-3)/j(-8)/(-18). Which is the third smallest value? (a) m (b) 0 (c) w a Let u = 16 - 15. Which is the third smallest value? (a) 1/6 (b) u (c) 3 c Let s be 2/(-8)(-20)/(-10). Which is the third smallest value? (a) -2 (b) s (c) 0.7 c Suppose r = -3g - 8, -g + 5r = -4g + 8. Let p = 2.1 + -0.1. Which is the smallest value? (a) g (b) -2 (c) p a Let q be (2/(-14))/((-16)/(-32)). Which is the biggest value? (a) -5/2 (b) -5 (c) q c Let k be ((-25)/(-2))/(-2). Let v = 179/555 - -2/185. Let p = 0.3 + -0.1. What is the second biggest value in v, k, p? p Let h = -24 - -13. Let n = h - -11.1. Which is the second biggest value? (a) n (b) -0.2 (c) 9 a Suppose -14 = 7u + 21. Let i be (1 + u)(-3)/30. Which is the third biggest value? (a) i (b) 2/13 (c) 4 b Let w = 40 - 38. Let j be (-12)/42/(-9). What is the second biggest value in j, 0.3, w? j Let w = -0.9 - -1.4. Let u = w + -0.1.	{ "pile_set_name": "DM Mathematics" }
ime? True Is 357701 a composite number? True Is 10637 a composite number? True Is 125065 a composite number? True Is 6499 a composite number? True Is 49031 prime? True Is 14977 composite? True Is 9719 a prime number? True Is 1642917 composite? True Is 71531 a prime number? False Is 797813 composite? False Is 41807 composite? True Is 15101 prime? True Is 1141 composite? True Is 18923 a prime number? False Is 22367 composite? False Is 185947 prime? True Is 109673 composite? False Is 162989 a prime number? True Is 29477 composite? True Is 32649 a prime number? False Is 1832057 a composite number? False Is 317721 prime? False Is 21451 composite? True Is 3603 a composite number? True Is 743 composite? False Is 8369905 a composite number? True Is 12067 prime? False Is 525457 a prime number? True Is 35897 composite? False Is 1642 a composite number? True Is 14677 composite? True Is 24937 prime? False Is 11771 composite? True Is 2501 a prime number? False Is 2321 prime? False Is 6163 a prime number? True Is 39869 a prime number? True Is 13517 composite? True Is 24117 a composite number? True Is 33265 a composite number? True Is 356621 prime? True Is 282137 prime? False Is 5345 prime? False Is 305 composite? True Is 2039 a prime number? True Is 1342049 a prime number? True Is 135977 composite? False Is 299 prime? False Is 10673 a prime number? False Is 800063 a composite number? True Is 323737 composite? True Is 138091 prime? False Is 123001 prime? True Is 1693987 composite? False Is 1096786 a composite number? True Is 8861 a prime number? True Is 1742723 composite? False Is 983771 composite? False Is 43961 a prime number? True Is 2201 composite? True Is 97919 prime? True Is 89255 composite? True Is 74653 a prime number? True Is 541283 a prime number? True Is 7621 a prime number? True Is 404597 a prime number? True Is 1412393 prime? True Is 41486 a prime number? False Is 30293 composite? False Is 20569 a composite number? True Is 35753 composite? False Is 25057 composite? False Is 10681 prime? False Is 1122281 a composite number? False Is 160141 composite? False Is 14699 a composite number? False Is 7999 a composite number? True Is 1839283 a prime number? True Is 38393 composite? False Is 423971 a composite number? True Is 20053 composite? True Is 85987 prime? False Is 96139 a composite number? True Is 30239 prime? False Is 27589 a prime number? False Is 177697 a composite number? True Is 374639 a prime number? True Is 1135259 composite? True Is 2437 a composite number? False Is 298493 a composite number? True Is 862727 composite? False Is 1901 a prime number? True Is 723505 composite? True Is 8297 prime? True Is 125527 prime? True Is 23227 a composite number? False Is 3989 a prime number? True Is 261427 a prime number? True Is 5513 a composite number? True Is 617983 prime? True Is 31019 composite? False Is 85135 composite? True Is 399593 a prime number? False Is 223 a prime number? True Is 550841 a prime number? True Is 4967 a composite number? False Is 135697 composite? False Is 170333 a composite number? True Is 9989 prime? False Is 1169249 prime? True Is 1901 a prime number? True Is 26339 prime? True Is 78691 a composite number? False Is 23923 a composite number? True Is 128009 prime? False Is 24907 a composite number? False Is 39019 a prime number? True Is 18143 prime? True Is 167626 composite? True Is 7499 a prime number? True Is 13789 prime? True Is 5167 a prime number? True Is 5003 prime? True Is 591439 a prime number? False Is 161869 composite? False Is 176777 composite? False Is 2371 prime? True Is 38593 prime? True Is 370057 a prime number? True Is 7039 a prime number? True Is 3876253 composite? False Is 68569 a composite number? True Is 19841 prime? True Is 2363 prime? False Is 9647 composite? True Is 14969 prime? True Is 664637 prime? False Is 4861 prime? True Is 3789035 prime? False Is 383219 prime? True Is 50891 composite? False Is 36587 prime? True Is 60185 composite? True Is 285599 prime? True Is 8389 prime? True Is 45299 composite? True Is 3003833 a composite number? True Is 135389 a prime number? True Is 143095 composite? True Is 47653 prime? True Is 42257 prime? True Is 1303811 composite? True Is 9511 a prime number? True Is 655507 a prime number? True Is 222403 a composite number? False Is 39929 a prime number? True Is 1091969 composite? True Is 152135 a prime number? False Is 549053 prime? False Is 295189 a prime number? False Is 26305 a prime number? False Is 2909 a prime number? True Is 4861 composite? False Is 304541 a composite number? False Is 6911 a composite number? False Is 740167 prime? False Is 190681 a composite number? True Is 127 a composite number? False Is 587 prime? True Is 4267 a prime number? False Is 4279 prime? False Is 6197 prime? True Is 11369 composite? False Is 3103 prime? False Is 100907 a composite number? False Is 1031 prime? True Is 360719 prime? False Is 1844411 a composite number? False Is 647 composite? False Is 128789 composite? True Is 139067 a composite number? False Is 18371 a prime number? True Is 14851 a composite number? False Is 342971 composite? False Is 169637 a prime number? False Is 33403 a prime number? True Is 14227 prime? False Is 67699 prime? True Is 1046041 composite? True Is 14867 prime? True Is 507527 prime? False Is 26599 a composite number? True Is 289589 a composite number? False Is 249349 composite? True Is 1407461 a composite number? True Is 191413 a prime number? True Is 63493 a prime number? True Is 120278 prime? False Is 52237 composite? False Is 64166 a composite number? True Is 2129 a composite number? False Is 64211 a composite number? True Is 45431 a composite number? True Is 103101 a prime number? False Is 30671 composite? False Is 301343 a prime number? False Is 175471 a prime number? False Is 189169 prime? True Is 163543 prime? True Is 757 a prime number? True Is 952241 a composite number? True Is 1817 a composite number? True Is 24391 prime? True Is 27059 a composite number? False Is 3116651 prime? True Is 7583 prime? True Is 106553 a composite number? True Is 18539 prime? True Is 3935 composite? True Is 8849 prime? True Is 464939 composite? False Is 3065 a composite number? True Is 68033 composite? True Is 25661 prime? False Is 2182489 prime? True Is 315607 prime? False Is 33427 a composite number? False Is 306931 composite? True Is 249601 a composite number? True Is 62791 a composite number? False Is 975827 composite? False Is 3887899 prime? True Is 2528651 composite? False Is 3791 a prime number? False Is 3259513 a prime number? False Is 271619 prime? True Is 691433 prime? True Is 20899 composite? False Is 33479 a prime number? True Is 409561 composite? True Is 8201 a prime number? False Is 425309 prime? True Is 10299 prime? False Is 4742 a composite number? True Is 1413427 a composite number? False Is 2819 prime? True Is 21169 composite? False Is 1797 prime? False Is 16817 prime? False Is 47 a prime number? True Is 16561 prime? True Is 89189 a composite number? False Is 551227 composite? True Is 20053 a composite number? True Is 61322 a prime number? False Is 1429107 prime? False Is 437111 composite? False Is 10453 prime? True Is 461359 composite? False Is 108073 prime? False Is 180039 a composite number? True Is 37063 prime? False Is 20059 prime? False Is 109661 a composite number? False Is 41647 a composite number? False Is 52147 prime? True Is 52051 a prime number? True Is 23393 composite? True Is 26339 a composite number? False Is 761435 a prime number? False Is 12367 a composite number? True Is 64741 composite? True Is 44381 a composite number? False Is 9407 a prime number? False Is 39361 a composite number? True Is 99347 composite? False Is 50981 composite? True Is 44111 prime? True Is 24359 a prime number? True Is 2004377 composite? False Is 7981 a prime number? False Is 301439 a prime number? False Is 45509 prime? False Is 23891 composite? True Is 12153 composite? True Is 114451 prime? True Is 413 a prime number? False Is 7985 composite? True Is 15107 composite? False Is 32063 composite? False Is 77305 prime? False Is 310627 a prime number? True Is 9733 prime? True Is 21439 a prime number? False Is 63445 a prime number? False Is 5579 prime? False Is	{ "pile_set_name": "DM Mathematics" }
q when three letters picked without replacement from {f: 3, q: 4, g: 3, x: 1}. 4/55 What is prob of picking 1 w, 1 d, and 1 l when three letters picked without replacement from dfjwl? 1/10 Two letters picked without replacement from {s: 2, n: 6, v: 3, u: 2}. What is prob of picking 2 u? 1/78 Three letters picked without replacement from {o: 5, q: 15}. What is prob of picking 2 q and 1 o? 35/76 What is prob of picking 2 y and 2 v when four letters picked without replacement from {y: 5, v: 15}? 70/323 What is prob of picking 1 n, 2 w, and 1 v when four letters picked without replacement from wwccnccncgwccv? 6/1001 What is prob of picking 1 d and 1 c when two letters picked without replacement from cssicvdddd? 8/45 Three letters picked without replacement from llljggl. What is prob of picking 2 l and 1 j? 6/35 Four letters picked without replacement from {u: 1, v: 1, e: 1, b: 6}. Give prob of picking 1 v, 2 b, and 1 e. 5/42 Calculate prob of picking 1 z and 1 i when two letters picked without replacement from {i: 4, z: 2, r: 2, x: 2, w: 3, m: 2}. 8/105 Four letters picked without replacement from {e: 1, n: 1, s: 3}. Give prob of picking 1 n, 1 e, and 2 s. 3/5 Three letters picked without replacement from qkfefqkqkewwql. What is prob of picking 1 w, 1 l, and 1 q? 2/91 Four letters picked without replacement from tattgtgqttttqtqq. What is prob of picking 2 a and 2 t? 0 What is prob of picking 1 v and 1 t when two letters picked without replacement from vvwwwzvtwzzwz? 1/26 Calculate prob of picking 1 u and 2 p when three letters picked without replacement from uuvuvuuppuuu. 2/55 Calculate prob of picking 3 n when three letters picked without replacement from eeeeeeneeenneeeeeen. 4/969 Two letters picked without replacement from {t: 3, s: 2, a: 9, g: 2}. What is prob of picking 1 a and 1 t? 9/40 Calculate prob of picking 1 w and 3 j when four letters picked without replacement from {w: 3, j: 9}. 28/55 Three letters picked without replacement from {i: 3, e: 17}. What is prob of picking 3 e? 34/57 What is prob of picking 1 o and 1 m when two letters picked without replacement from lmqoiouli? 1/18 Two letters picked without replacement from wbwmmmbwbjb. Give prob of picking 1 b and 1 j. 4/55 Calculate prob of picking 3 s when three letters picked without replacement from srrzsrrrszzzz. 1/286 Calculate prob of picking 1 k, 1 f, and 1 e when three letters picked without replacement from fkcfe. 1/5 Calculate prob of picking 3 r when three letters picked without replacement from {z: 2, r: 3, w: 1, c: 1}. 1/35 Calculate prob of picking 1 g and 1 a when two letters picked without replacement from {a: 3, z: 1, g: 2, c: 4, m: 2}. 1/11 Calculate prob of picking 3 u when three letters picked without replacement from {r: 4, u: 6}. 1/6 Three letters picked without replacement from jxcljgjallg. Give prob of picking 1 g, 1 l, and 1 c. 2/55 Calculate prob of picking 1 e and 2 s when three letters picked without replacement from sees. 1/2 Calculate prob of picking 1 w and 1 g when two letters picked without replacement from cgww. 1/3 Four letters picked without replacement from {o: 19, c: 1}. Give prob of picking 3 c and 1 o. 0 Three letters picked without replacement from kxkkkkkkkxk. What is prob of picking 1 k and 2 x? 3/55 What is prob of picking 2 n when two letters picked without replacement from {n: 3, t: 13}? 1/40 Three letters picked without replacement from fzzzzzf. Give prob of picking 3 z. 2/7 Four letters picked without replacement from {r: 9, p: 2, d: 2}. What is prob of picking 2 r and 2 d? 36/715 Two letters picked without replacement from {q: 1, x: 6, d: 7}. Give prob of picking 1 x and 1 q. 6/91 Calculate prob of picking 1 n, 1 a, and 1 f when three letters picked without replacement from nafa. 1/2 Three letters picked without replacement from uuuuuquq. Give prob of picking 1 u and 2 q. 3/28 Calculate prob of picking 2 m when two letters picked without replacement from {m: 3, c: 3, n: 5}. 3/55 What is prob of picking 1 i and 3 b when four letters picked without replacement from {m: 1, s: 6, i: 2, e: 6, b: 3}? 1/1530 Two letters picked without replacement from {x: 2, l: 10}. What is prob of picking 2 x? 1/66 Calculate prob of picking 1 p, 1 y, and 1 f when three letters picked without replacement from {y: 1, f: 2, p: 2, z: 1}. 1/5 What is prob of picking 2 p and 2 r when four letters picked without replacement from rrpprrrr? 3/14 Calculate prob of picking 1 n and 1 k when two letters picked without replacement from xkxcnxkgxc. 2/45 Calculate prob of picking 1 k and 1 a when two letters picked without replacement from {k: 5, a: 5}. 5/9 Three letters picked without replacement from qqpqnddpqqnhnppn. Give prob of picking 2 d and 1 p. 1/140 Two letters picked without replacement from {i: 5, c: 2, n: 3, p: 3, j: 7}. Give prob of picking 1 c and 1 n. 3/95 What is prob of picking 1 s and 1 v when two letters picked without replacement from {i: 2, s: 3, v: 3}? 9/28 Three letters picked without replacement from {t: 1, x: 10, n: 4, g: 1, w: 4}. Give prob of picking 1 g, 1 n, and 1 x. 2/57 Calculate prob of picking 2 k, 1 f, and 1 b when four letters picked without replacement from {k: 3, j: 2, f: 2, b: 1, l: 8, n: 1}. 3/1190 Three letters picked without replacement from llmmlllmmmml. What is prob of picking 3 l? 1/11 Two letters picked without replacement from {v: 5}. Give prob of picking 2 v. 1 Four letters picked without replacement from gfjggjggggfffjgfjgfg. What is prob of picking 2 g and 2 f? 45/323 Two letters picked without replacement from lllldlddll. Give prob of picking 2 d. 1/15 Two letters picked without replacement from {z: 4, s: 1, k: 2, b: 1, h: 3, f: 1}. What is prob of picking 1 h and 1 b? 1/22 Three letters picked without replacement from nnxnx. What is prob of picking 3 n? 1/10 What is prob of picking 2 s and 2 m when four letters picked without replacement from {t: 1, l: 4, m: 10, s: 2}? 9/476 Calculate prob of picking 1 q and 1 d when two letters picked without replacement from {q: 1, p: 2, g: 1, j: 9, d: 4}. 1/34 Calculate prob of picking 2 x and 1 v when three letters picked without replacement from xbyiyyvbevvxx. 9/286 Four letters picked without replacement from {f: 3, b: 13, a: 4}. What is prob of picking 3 f and 1 b? 13/4845 What is prob of picking 1 b and 2 x when three letters picked without replacement from geexwbjxjejbjbjxb? 3/170 Three letters picked without replacement from muaumusrsmur. Give prob of picking 1 m, 1 r, and 1 a. 3/110 Three letters picked without replacement from bbjkjbebbblj. What is prob of picking 1 e, 1 b, and 1 j? 9/110 Calculate prob of picking 1 q, 1 w, and 1 r when three letters picked without replacement from {t: 2, m: 1, r: 1, q: 3, w: 3, y: 2}. 9/220 Three letters picked without replacement from {q: 2, l: 5, o: 12}. Give prob of picking 1 o, 1 l, and 1 q. 40/323 Calculate prob of picking 1 a, 1 s, and 2 y when four letters picked without replacement from {f: 1, a: 1, y: 2, s: 1}. 1/5 Calculate prob of picking 4 l when four letters picked without replacement from {l: 6}. 1 What is prob of picking 2 h, 1 u, and 1 d when four letters picked without replacement from {a: 3, q: 5, u: 4, h: 2, d: 5}? 5/969 Three letters picked without replacement from {b: 3, m: 5, t: 1, f: 2, c: 1, v: 1}. What is prob of picking 2 f and 1 t? 1/286 What is prob of picking 4 y when four letters picked without replacement from {y: 4, b: 16}? 1/4845 Three letters picked without replacement from qtqqqqtqqqqtqtqt. What is prob of picking 3 t? 1/56 Calculate prob of picking 1 d and 1 s when two letters picked without replacement from dssdddddbbssbsdd. 1/3 What is prob of picking 1 v and 1 f when two letters picked without replacement from fvv? 2/3 Calculate prob of picking 3 w when three letters picked without replacement from wuwwlwlu. 1/14 Four letters picked without replacement from {g: 14, f: 4}. What is prob of picking 3 g and 1 f? 364/765 Four letters picked without replacement from cdccvccdvddcdvddd. What is prob of picking 3 d and 1 c? 12/85 What is prob of picking 4 l when four letters picked without replacement from {o: 7, l: 6, t: 2}? 1/91 What is prob of picking 3 q when three letters picked without replacement from	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.