Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
What is the value of (27/(243/(-30)))/(2/3)? -5 Calculate (0/3)/(-3)1. 0 (-1)/2-6 + (-130)/39 -1/3 What is the value of ((-3)/12)/(2/(-48))? 6 What is the value of (-455)/19512/14? -2 ((-12)/2)/(19/(266/21)) -4 What is the value of (4 - (-6 - -12))/(12/24)? -4 What is 4/(-22) - 2/110? -1/5 What is -3 - (-1 - 2) - 1/(-4)? 1/4 Evaluate (9/(-4))/((-72)/(-96)). -3 ((-357)/39 - -7) + (-4)/(-26) -2 What is the value of 2/(-40) - 10251/(-1020)? 10 Evaluate 1 + (3/(-15))/(6/45). -1/2 Calculate 114/42 - 2/(-7). 3 Calculate (-11)/(-44)8/(-1). -2 What is (-1 - (-4)/(-34)) + (-56)/(-476)? -1 Evaluate (-4)/(1/(((-42)/(-156))/(-7))). 2/13 What is the value of 2/(-3)(-204)/(-1292)? -2/19 Evaluate (-5 - -17) + -7 + -15. -10 What is 72/65/(11 + 4)? 4 (228/(-20))/3 + (-8)/(-2) 1/5 What is the value of (-5)/6 + 963/1026? 2/19 Evaluate (-22)/12 + -108/(-160). -4/3 What is the value of 1/(-4) + (-2)/(-8)? 0 -136(-3)/1248 - (-1)/(-4) 1/13 ((-9)/12)/(51/(-68)) 1 What is the value of 3/(-3) - (-1 + -1)? 1 What is the value of ((-24 - -8)/(-8) - 2)/(-7)? 0 Evaluate -1 - (3/(-6) + 1/2). -1 Calculate (-5 + 1)(-20)/200. 2/5 What is (-20)/684/(-70)? 4 What is the value of (-64)/(-384)21? 1/3 What is ((-1)/6)/(((-8)/4)/24)? 2 84/(-15) - 21/(-35) -5 What is the value of (6/14 + 117/(-126))-2? 1 Calculate 15/(-20) + (-21)/(-36). -1/6 What is 5 + -1 - (4 - 1)? 1 Calculate (-3)/((-2 - (-8)/4) + -1). 3 What is the value of 98/39 + 8 + -10? -2/13 What is 264/(-42) - -6 - (-45)/(-504)? -3/8 Evaluate 6/9 - (3050/390 - 7). -2/13 (1 + 3)2/24 1/3 Calculate (-10)/(-4) - (-235)/94. 5 What is (-1 - (20/(-5) - -4))1? -1 What is the value of (12/(2 + -6) + 2)0? 0 Calculate (-19)/(-4) - ((-264)/32)/(-11). 4 Calculate (3/(-9))/((-36)/(-216)). -2 What is -4 + ((-58)/40)/((-32)/80)? -3/8 What is 2/9-3 + 160/168? 2/7 What is ((-307)/(-7368))/((2/6)/(-1))? -1/8 (-100)/48 + (7 - 5) -1/12 What is the value of 174/1455/2? 3 What is (-1 - (-60)/28)5/(-20)? -2/7 What is the value of 2/(1/(-6)-6)? 2 What is -2(-3)/(-12)1-6? 3 What is (-9)/(-5)280/84? 6 What is (-3)/(3 + -2) + 31? 0 Evaluate ((-1)/(-44))/(-10(-12)/(-320)). -2/33 What is -1 + 0 + (6 - 2)? 3 Evaluate 240/(-28) - 20/(-35). -8 Calculate (-36)/(-10) - (-12)/30. 4 What is 28/13 + -2 - 48/(-26)? 2 What is ((-198)/(-264))/((-3)/28)? -7 Evaluate ((-6 + 3)/(-3))/3. 1/3 Evaluate 2 - ((-465)/(-51) - 4/34). -7 What is 9/(-4) - 525/140? -6 What is ((-42)/84)/((-1)/(-10))? -5 What is the value of 2/34/((-40)/(-75))? 5 Calculate (1/(-4))/((-4)/64). 4 What is -3 - (0 - 4) - (-1 + 3)? -1 1-1 + 7/((-7)/(-6)) 5 What is (-18)/30 - 24/(-15)? 1 Evaluate ((-16)/(-112))/(6/(-21)). -1/2 Calculate (-1 - 9/5)/((-24)/(-60)). -7 What is the value of 102/(-14) - (-287)/41? -2/7 What is the value of -3 + 5/((-225)/(-130))? -1/9 What is (-2 + -3)/((-130)/104)? 4 96/241/4 1 What is the value of (-1)/((-11)/(-13) - (-8)/52)? -1 What is the value of 4/(-11)((-63)/14)/9? 2/11 32/(-72)(-18)/84 2/21 Calculate ((-6)/144-6)/(3/6). 1/2 (-210)/(-735) - 4/(-126)-2 2/9 Calculate (-1)/(((-48)/(-28))/(36/168)). -1/8 What is (4/6)/(26/(-6) - -2)? -2/7 What is (8 - 6)/1 - 7? -5 ((36/(-16))/3)/((-1551)/(-376)) -2/11 Evaluate (1/7)/((-399)/21 - -17). -1/14 Calculate 0 + -1(-2)/7. 2/7 What is the value of ((-78)/48)/133/1? -3/8 What is (-32)/7 - (-8)/2? -4/7 Calculate (-13)/(-6) + 17/51. 5/2 ((-104)/(-130))/(3/(-3 + -12)) -4 What is the value of -11 + (4 - (11 - 12))? -6 What is (-393)/1834(13/(-3) + 2)? 1/2 (-25)/(-10) - 1 - 1/(-2) 2 What is the value of (-70)/(-25) - 2 - 273/35? -7 Evaluate -8 + 954/81 + -22. -2/9 1 + ((-18)/(-54))/(10/(-21)) 3/10 Evaluate (-4)/(-14) + (-72)/56. -1 What is the value of 146/90 + (-21)/151? 2/9 Evaluate ((-6)/88)/(303/(-808)). 2/11 2604/(-588) + 3/7 -4 Calculate (-396)/(-704)6/9. 3/8 What is 1/(-2) - (-5)/14? -1/7 -1 - (-5 + 7 + -8) 5 Calculate 7/28 - 3/(-24). 3/8 What is -112/42 - (-2)/3? 1/7 (-8)/(-28)-1 - (-3)/(-14) -1/2 3/((-4 + 3)1) -3 Evaluate (11/44)/((-3)/4). -1/3 Evaluate (-31)/(-31) + 8/(-4). -1 What is the value of 46/16(-496)/(-93)? 8 Calculate (2/(-2)6)/((-72)/(-16)). -4/3 What is the value of (-1 - (-178)/162)(-12)/16? -2/27 What is the value of ((-11)/(-72))/1 - (-10)/45? 3/8 Evaluate ((-1)/(-3))/((-18)/27). -1/2 What is (((-30)/(-8))/(-5))/54? -3/5 What is the value of (-26)/24 + 64/48? 1/4 What is 96/112 - 128/(-14)? 10 Calculate (-30)/50 - 17/5. -4 What is 3 + (-4 - -11) + -9? 1 Evaluate (-6)/7-21(-1)/3. -6 What is the value of (0 - 2/(-3))/5? 2/15 4/7 - (-2)/56-23 -1/4 Evaluate 48/(-728)-71. 6/13 What is (-8)/10 - (8096/(-120))/46? 2/3 Calculate ((-2)/14)/((-6)/4). 2/21 What is the value of (-3 - (-21)/3)/(160/360)? 9 Evaluate (-2)/(-4)-6 + 78/(-13). -9 Evaluate (37 - 31)/((-2)/1). -3 Evaluate (1/12)/((-302)/(-1812)). 1/2 Evaluate (0 + -6)/(1 + 2/4). -4 What is the value of (29/33 + -1)(-510)/(-340)? -2/11 Calculate -7(-4)/14(-1 + -1). -4 What is -5 - -12(-15)/(-40)? -1/2 Calculate 1035/140 + -7 - 2/8. 1/7 (((-1)/(-2))/((-6)/48))/(-9) 4/9 What is -2 + (-104)/(-8) + -7? 4 What is ((-70)/(-15) - 6)/(7 - 1)? -2/9 What is the value of (-4)/(-12) + (-88)/(-24)? 4 Calculate (-5 - (-53)/11) + (-63)/(-891). -1/9 Evaluate (-160)/(-128)(-2)/15. -1/6 Calculate 560/(-700) + 86/120. -1/12 Calculate -1(-1(-2 + 3) - -4). -3 What is ((-230)/(-30))/234? 4/3 Evaluate (19/(-114))/((-1)/3). 1/2 What is (-3)/(4 - 1) + 4? 3 Evaluate (4/(-30))/(39/(-10) + 4). -4/3 What is (1920/12)/16 + (2 - 6)? 6 6(-3)/12 + (-26)/(-12) 2/3 What is (36/24)/((-3)/4)? -2 (-9(-6)/(-24))/(84/(-32)) 6/7 Evaluate (16/6)/(-4)168/(-280). 2/5 Evaluate 5(5 + (-2616)/520). -2/13 What is the value of 4400/(-748) - (-2)/(-17)? -6 What is 3/(-2) - ((-303)/90 + 2)? -2/15 Evaluate (-2583)/(-6150) - 2/(-25). 1/2 What is the value of (2/(-10)-5)/(-19 + 12)? -1/7 What is (1 - 5) + (-20)/(-5)? 0 What is 56/84 + 1 + (-14)/12? 1/2 What is 63/((-54)/(-6)) - 0? 7 (-6)/4(4/12 + 1) -2 Evaluate ((-120)/(-27) + -4)/2. 2/9 What is (-5)/2(-27)/(54/4)? 5 Calculate -2 - ((-44)/(-8) + -4) - -4. 1/2 Evaluate 1((-20)/10)/(-2 + 1). 2 Calculate ((-96)/(-20) - 5)/(21/140). -4/3 Calculate (204/(-272))/((-19)/(-8) + -2). -2 Evaluate (1/5)/(3/5). 1/3 Evaluate 8/63/(-6)-1. 2/3 Evaluate 8(-18)/(-240)(-10)/(-4). 3/2 Evaluate (-10)/3(-24)/(-48). -5/3 What is -6(-3)/(-6)10/(-105)? 2/7 336/832 + 1/(-13)2 1/4 What is 11(-2 - (-6)/2)/1? 11 What is the value of 1/(-6)492/410? -1/5 Calculate 8/((-448)/(-31)) + 6/(-14). 1/8 10 + 2022/(-55) 2 What is the value of 1615/(-70) + 13 + 10? -1/14 (144/(-42))/(-6) + (-318)/336 -3/8 What is (-147)/63(-4)/(-42)? -2/9 What is the value of (168/63)/(3/9)? 8 Calculate (0 + (-2)/(-36))(91 - 93). -1/9 What is (((-24)/18)/(-4))/(2/12)? 2 Calculate (4 - 10) + 9 + -3. 0 (-10)/(-8)(4/(-3))/2 -5/6 What is (3 + 25)/7 + 1? 5 Evaluate 0 + (26/(-6) - -5). 2/3 (-22)/40 + 8/(-40) + 0 -3/4 What is the value of (-392)/147(-6)/8? 2 Evaluate 1/43 - (-111)/(-148). 0 Evaluate 45/(-5)(0 + (-2)/261). 2/29 Evaluate -5 + 22/55 + 87/20. -1/4 What is 2 + (-4 - 0) + 0? -2 (-3 - (-26)/8)2 1/2 (-7)/9 + 80/(-360) -1 ((-2)/(-7))/((-520)/(-182)) 1/10 (-64)/(-30) + (-128)/96 4/5 Calculate -3((-44)/990)/(2/(-6)). -2/5 What is (7 + -11)6/24? -1 Evaluate 7/8 - 1 - (-663)/(-136). -5 What is the value of 19/30 - 1/(2 - 8)? 4/5 Calculate (-12)/(-81)18/484. 2/9 (-141)/(-15) + ((-24)/(-15))/(-4) 9 Calculate (68 + -23)1/5. 9 What is (((-15)/14)/(-15))/((-12)/16)? -2/21 Evaluate (-6)/(-4 - 0 - -2)-1. -3 Evaluate 60/(-16) + 4 - 20/(-48). 2/3 28/350 + (-808)/100 -8 What is the value of (10/(-15))/(4 + 66/(-18))? -2 (-10)/75 + (-292)/60 -5 What is the value of 6/15175/14? 5 What is the value of (-32 - -7)(-2)/10? 5 Evaluate 5/15 - (5 - 2/(-6)). -5 Calculate ((-2)/(-18))/(6/24). 4/9 What is the value of ((-80)/70)/((-4)/14)? 4 What is 176/(-330) - 1/(-3)? -1/5 Calculate (-5)/((-20)/6)(0 - 1). -3/2 What is the value of ((-52)/(-65))/((-2)/5)? -2 What is ((-6)/(-45))/(60/(-75))? -1/6 Calculate ((-13)/(455/(-5)))/((-4)/(-7)). 1/4 Calculate 6/420/(-105). -2/7 Evaluate 14 + -16 + 16. 4 ((-1)/((-26)/(-6)))/(1017/678) -2/13 Calculate ((-42)/154)/((-4)/44). 3 Evaluate 78/11 - -106/(-660). 7 What is the value of (-235)/(-188) - 26/(-24)	{ "pile_set_name": "DM Mathematics" }
n 2, d, -1? d Suppose -2h + 8 = -4d + 3d, 4h + 4d = 28. What is the closest to 2/5 in h, -5, -3? -3 Let k = 0 - -1. Let x(q) = q3 + 8q*2 + 7q - 2. Let w be x(-7). Let p = 82 - 86. Which is the closest to k? (a) p (b) -2/7 (c) w b Let j = 0.3 - 0.3. Let o = 8 - 9. Let m = o - j. What is the nearest to 0 in -2, 0.3, m? 0.3 Let d be (-62)/240 + (-8)/(-60). What is the closest to 2/3 in -2/9, 2, d? d Let j be (-14)/49 + 150/(-14). What is the closest to j in -0.3, 0, 2? -0.3 Let m = -10456/21 + 498. Let f = -61/455 - -2/35. Let g = f + 15/26. Which is the nearest to g? (a) 0.3 (b) 1 (c) m a Let a = -11.1 - -11. What is the closest to a in -1, -2, -3? -1 Let r = -0.2 - -5.2. What is the nearest to -1 in 0.5, r, -0.4? -0.4 Suppose -2r = 3r - 20. Which is the closest to -0.1? (a) 0.2 (b) 3 (c) r a Let p = 141 + -139. Which is the closest to -1/2? (a) -4/7 (b) -4 (c) p a Let t = -67 - -61. What is the closest to 3/2 in 2/13, 1, t? 1 Let v = -0.57 + 0.07. Which is the closest to -1? (a) v (b) -0.2 (c) 3/8 a Let w = 8 + -8. Suppose w = z - 0z - 5v - 28, 0 = z - 3v - 18. Which is the closest to -3? (a) 0 (b) 4 (c) z a Let i = -0.2 + 1.2. Let s = 0.3 - -0.2. Which is the closest to i? (a) 1 (b) 2/3 (c) s a Let l = 1.8 + -11.8. Let d = l - -9.5. Which is the nearest to -1/4? (a) d (b) 0.4 (c) -1/3 c Let u = -101 + 101.1. Which is the nearest to u? (a) -1 (b) -0.1 (c) 7 b Suppose 0 = 5d + 4j - 27984, -6393 = -2d - j + 4800. Let a be (-2)/(-4)d/(-14). Let i = a + 199. What is the nearest to 1 in i, -2, -0.1? -0.1 Let y = 338/5 - 68. Let z = -0.11 + -4.89. Let i = -4 + 3.9. Which is the closest to i? (a) 4 (b) y (c) z b Let y = -0.02 - 0.08. Let s = -0.07 - 3.93. Which is the closest to y? (a) s (b) -0.5 (c) -0.4 c Let v = 0.6 + -0.9. Let f = -4.9 + 5. What is the closest to 1 in f, 0.3, v? 0.3 Suppose 12 = -2p - 2n, -1 + 14 = -3p - 2n. Which is the nearest to p? (a) -1 (b) -0.03 (c) 0 a Let r = 5 - 0. Let t = 4 + -6. Let l be ((-2)/4)/(t/6). Which is the closest to -0.1? (a) -0.5 (b) r (c) l a Let y be (-10)/2(9 - 8). Which is the closest to 0? (a) -3 (b) 2/5 (c) y b Let m be (-16)/56 + (-40)/7. Let i be (-19)/m1 - 3. What is the closest to 0 in 0.3, 2/7, i? i Let x(c) = 2c - 9. Let s be x(7). Suppose sz - 3 = -28. Let j be -1(-2)/(-12)1. What is the closest to 2 in j, 1, z? 1 Let m = 1.1 - 0.1. Which is the closest to m? (a) 2/3 (b) -3 (c) -2/15 a Let w = 5 - 19/4. Which is the nearest to -4/7? (a) w (b) -4 (c) 0 c Suppose -c + 15 = 2o, -5c + 2o + 19 = -2o. Let n(s) = s3 - 7s2 - s + 5. Let y be n(c). What is the closest to y in -4, 2, 5? -4 Let d = -0.11 + -0.39. Which is the nearest to 2/3? (a) 0 (b) 3 (c) d a Let d = 0.1 + -3.1. What is the closest to -1 in -2, d, 2? -2 Let r(p) = p2 - 13p + 9. Let u be r(12). Let z = 16/117 - 14/39. Which is the closest to z? (a) u (b) 2 (c) 1/9 c Let t = 34/21 + -16/7. Let x = 0.22 + -0.02. Suppose -2z = -z + 3. Which is the closest to x? (a) 0.2 (b) z (c) t a Let y be -1 - (-12)/3 - 18/5. Let n = -0.7 + 0. What is the closest to n in y, 0.3, 0.1? y Let x = 15522 - 30597. Let o be 1780/x - (-2)/5. Let p = o - 4/67. Which is the closest to -1/2? (a) p (b) -4 (c) 1 a Let u = 0.53 + -0.13. Which is the nearest to 0? (a) u (b) -2/13 (c) 1/2 b Let m = -151/2 - -76. Which is the nearest to -1? (a) -2 (b) 3 (c) m a Let u = 3.46 + -0.46. What is the nearest to -0.1 in 3/2, 2, u? 3/2 Let l = 17 + -16.5. Let r = 1.01 + 4.89. Let u = r + -6. What is the nearest to -1 in l, -0.2, u? -0.2 Let h be 9/(-63) - (-33)/(-63). What is the closest to -2 in h, 1, -0.3? h Suppose 0 = 3g + 6 - 0. Let y be (-3)/g3/9. Let i be (-22)/(-8) - 2/(-8). Which is the closest to 1/4? (a) y (b) i (c) -4 a Let g = -6 - -5. Let b = g + 1.2. Let d = 0.8 + -0.7. What is the closest to d in 1/2, b, -2/15? b Let n = 186 + -1300/7. Let u = -0.12 - 0.08. What is the nearest to 0.1 in u, 4, n? n Suppose -5j = -i + 9, -30 = -5i - 3j + 15. Let f be -3((-12)/i + 2). Let g = -0.4 + -0.1. Which is the nearest to f? (a) 1/3 (b) 5 (c) g c Let b = 33 - 97/3. What is the closest to b in 0.5, -4, -0.2? 0.5 Let k = 0.06 - -1.94. Let f(w) = 2w3 + w2 + w. Let l be f(-1). Let b = -2 - l. What is the nearest to -2/5 in k, b, 3? b Let m be 5/(-50)-6 + (-11)/35. What is the nearest to -2/7 in 1/2, m, 0.1? 0.1 Suppose -3i - 9 - 3 = 0. Let n(v) be the second derivative of -v4/12 - 2v*3/3 + 2v. Let z be n(i). Which is the closest to z? (a) 3 (b) -2/3 (c) 2/15 c Let h = -0.1 + 0. Let o = -5 + 4.4. Let x = o + 0.2. Which is the nearest to h? (a) 1/6 (b) x (c) -1/4 c Let o = 0.2 - 0.7. What is the closest to 1 in 0.1, o, -0.3? 0.1 Let o = -2.8 - -2.84. Let h = -0.24 + o. What is the nearest to h in 3/5, 1/3, 2? 1/3 Let t = -21 - -21.1. Which is the nearest to t? (a) 2/9 (b) -5 (c) 3 a Suppose 0 = 3v + 3, -4v - 3 = -p + 2. Which is the nearest to -0.4? (a) 5 (b) p (c) -0.3 c Let h = -13.8 + 14. Let c = 8/7 + -47/35. What is the closest to 0.2 in 4, c, h? h Let s = 0.448 - -0.052. What is the nearest to s in 0, 2/13, -1? 2/13 Let l be 4/(-10) + (-136)/(-40). Let x be (1 - l)/((-14)/2). Which is the closest to 0? (a) x (b) 5 (c) -2/5 a Suppose -5j + 2c - 5c - 2 = 0, -c = -3j + 10. Let h be 17/(-5) - (-10)/25. What is the closest to 2/3 in 1, j, h? 1 Let r be 1/(0 + (2 - 1)). Suppose r = -2q + q. Let i = 3/7 - 19/28. Which is the nearest to q? (a) -0.3 (b) -3/4 (c) i b Let s = 0.9 + -1. Let z = -0.9 + s. Let o = -2 + 1.9. Which is the closest to z? (a) 1 (b) 2 (c) o c Suppose -2m = 2m, 2z - 4 = 4m. Let b be ((-4)/(-5))/(4 - z). What is the nearest to 0.2 in b, 0.3, -1? 0.3 Let r = -0.082 - 5.838. Let o = -6 - r. Let t = -0.22 + o. What is the nearest to 2/7 in 4, t, -0.1? -0.1 Let t = -38 + 25. Let y = 0.94 - 11.94. Let k = y - t. What is the closest to -2/7 in -0.3, k, -2/5? -0.3 Let k be 1(-28)/24 - -2. Which is the nearest to 0.2? (a) k (b) 0.4 (c) 0.5 b Let y = 0.21 - 0.21. Which is the nearest to y? (a) -1 (b) 0 (c) 0.5 b Let h = 6.1 - 6. Which is the closest to 2? (a) -0.5 (b) h (c) -1 b Let n = 1.2 + -1.2. Let s(w) = w*2 + 5. Let u be s(0). What is the nearest to -0.1 in n, -5, u? n Let u be 40/4((-2)/4)/1. What is the nearest to -1/3 in 1/2, u, -4? 1/2 Let l = -0.28 - -0.08. Which is the nearest to 0? (a) 1 (b) -3 (c) l c Let r = -7.9 + 8. Let q = 7/3 - 3. What is the closest to q in -3, r, 2? r Let x = 83/171 - 5/19. Let d = 0.038 - 0.238. Which is the closest to 0? (a) d (b) -2/3 (c) x a Let p = 4.3 - 0.3. Which is the nearest to 0.1? (a) p (b) 5 (c) -1 c Let j = -1.8 - -2. Let t = 0.2 - j. Let p = -0.069 - 0.031. Which is the closest to t? (a) p (b) -0.3 (c) -4 a Let y be (-3)/45/15. Let v = -0.06 - -1.06. Let o = v - 0.8. Which is the nearest to y? (a) -1/2 (b) -1 (c) o a Let b be (4/3)/(60/18). What is the closest to b in 3, 1, -1? 1 Let j = 25/2 + -183/14. Let n = -19 - -155/8. What is the nearest to -1/4 in n, j, -5/6? j Let x = 0.7 + -1.3. What is the closest to 0 in 0.2, 2, x? 0.2 Let k = -3.36 - -3.46. Let y = -4 + 3. Let v = -1 - y. Which is the nearest to -1/3? (a) -2 (b) k (c) v c Suppose 0 = -4m - 20, 3m + 27 = -z - 2m. What is the closest to z in 2/3, -5/3, 0.4? -5/3 Let x = -0.6 + -5.4. Let w = x - -6.3. Let v be 5/2(-1)/5. Which is the nearest to v? (a) w (b) -1/4 (c) -0.1 b Let t be (-9)/(-6)(-8)/(-12). What is the nearest to 0 in 0.3, t, 0.5? 0.3 Let x = 1 + 0. Let z = -2 + -4. Let l = z + 5. Which is the closest to -0.1? (a) 0.3 (b) l (c) x a Let i(x) = -x*3 + 5x*2 + 7x - 6. Let d be i(6). Let k = 2.5 + -3. Let o = -0.15 - -0.45. Which is the nearest to d? (a) o (b) k (c) 0 c Let f be ((-3)/(-12))/(2/10). Let y be (-10)/6 + (-1 - -1). Which is the nearest to -1/2? (a) y (b) -0.4 (c) f b Let w be (-10)/24 - (-1)/6. Which is the closest to w? (a) -4 (b) -1/4 (c) -2 b Let n = -3 - -3.7. Let i = -1.1 - 0.1. Let z = n + i. Which is the closest to 0.2? (a) -1 (b) z (c) 4 b Let x = -1 + 5. Let q be (-3)/x(-3)/9. What is the closest to 0 in -0.5, -5, q? q Let l = 0.45 + 0.05. Let s be (-3)/16(-6)/9. Which is the nearest to -1? (a) 4 (b) l (c)	{ "pile_set_name": "DM Mathematics" }
r*3 + 2r*3 - 3r*3)(-2r2 - 3r*2 + 6r*2) + 3r5 - r5 - r*5. -13r*5 Expand (0s - 2s + 1 + 1)(-s - 11s - 2s). 28s2 - 28s Expand -2x2 + 2x*2 + 2x*2 + (-x + 1 - 1)(3x - 6x + x) - 4x2 - 2x*2 + 4x*2 - 22x*2 + 8x*2 + 3x*2 + (-2x + x - x)(3x - 3x + x). -11x*2 Expand 2t*2 - 12t4 + t4 + 11063t3 - 11034t*3 + (-2t*3 + 5t*3 - 2t*3)(-1 + 2t + 1). -9t*4 + 29t*3 + 2t*2 Expand (4 - 4 - b)(75b - 2b*2 - 122b + 136b). 2b*3 - 89b2 Expand v4 + 0v4 + v4 + (2 - 2 - 3v)(-4v*2 + 3v*3 + 4v*2) - 1 - 36v*4 - 62v*4 + 22v*4. -83v*4 - 1 Expand (3m3 - m3 + 0m3)(-1 - 1 + 1) + (-9m2 - 6m*2 - 8m*2)(5m - 4m - 3m). 44m*3 Expand -184l*4 + 2l*4 - 5l*4 + 0 + 0 + 2l4 + (-l2 + 2 - 2)(-l2 + 3 - 3) + l4 + 0l*3 + 0l*3 - 3l*4 + 5l*4 - 4l*4. -185l*4 Expand (0f - f + 2f)(223 - 223 + 66f4) + 2f5 - f5 + 0f5. 67f*5 Expand (-2h*2 - 2h*2 + 0h*2)(9h - 9h - 12h3 - h2). 48h*5 + 4h*4 Expand (370 - 186 - 43g*3 - 181)(2 - 2 - 2)(-2 - g + 2). -86g*4 + 6g Expand (-20 + 2 - 5)(0o + 5o - o)(-3o + 3o - o). 92o2 Expand -4x*3 + 9x*2 - 9x*2 + (-6x*2 - 2x*2 - 4x*2)(x - 2 + 2) + x*3 + 2x*3 - 2x*3. -15x3 Expand v3 - 5v3 - 3v*3 + (-4v + 0v + 2v)(v + 6v - 14v)(2v - 4v + 3v). 7v*3 Expand 11w*3 - 124w + 124w + (-3w - w + 2w)(3w2 - 5w*2 + 4w*2) + 3w*3 - 6w3 + w3 + 2w3 - 2w + 2w + 3w*3 + 0w3 - w3. 9w3 Expand (-2a*2 - 2a + 2a)(2a3 - a + a) - 3a5 + a5 + a*5 + 162a - 218a5 - 167a + 79a5. -144a*5 - 5a Expand -2h + 2 + 3h*2 + 0h2 - h2 + (-406 + 406 - 16h)(6h + 4h - 6h). -62h*2 - 2h + 2 Expand -4i5 - i5 + 3i*5 + (-16i*4 + 11i*4 - 24i*4)(-1 + 1 - i) - 6i5 + i5 + 0i*5. 22i*5 Expand -163d + 163d - 94d5 + (0 - d2 + 0)(2d*3 - 3d*3 + 5d*3). -98d*5 Expand (-9 + 13 - 12)(j*2 + 2j*2 + 10j*2). -104j*2 Expand (-3o2 - o2 + 5o2)(415o - 415o - 425o2) + 5o*4 - 4o*4 + 0o*4. -424o*4 Expand (-2s + 9s + 3s*2 - 4s*2)(-s*3 + 13s - 13s)(-1 + 2 + 1). 2s5 - 14s*4 Expand (2 - 2 - 2g)(-2g3 - g3 + 2g3) + 5 + 31034g*4 - 29809g*4 - 5. 1227g*4 Expand 9 - 18d*5 - 9 + (d + 3d*3 - 5d*3 + d)(3d2 - 22d*2 + 6d*2). 8d*5 - 26d*3 Expand (-2c + 4c + 2c)(-1 + 2 - 8)(-9 - 18c + 9 + (5c + 0c - 4c)(0 + 0 - 1) + 2c - 2 + 2). 476c2 Expand -k - 5k + 4k + (2 + 0 - 3)(-5k + 3k + 3k) - 172k - 465k - 185k. -825k Expand (0 - 6 - 2)(17 + 16v - 12 - 6). -128v + 8 Expand (4 - 3 + 0 + (2 + 3 - 4)(-3 + 2 - 1))(0 - 1 + 3)(-4 + 6 - 4)(-2g - 4g + g). -20g Expand (-121k + 32 - 32)(-3 - 2 + 3). 242k Expand (-6i2 - 47 + 47)(29 - 9 + 5)(-2i*2 + 2i - 2i). 300i*4 Expand (-2x - 7x + 2 + x)((-4 + 1 + 1)(2 - 3 - 1) - 19 + 23 + 90). -784x + 196 Expand (0o2 - 2o*2 + 4o*2)(-10o + 8 - 8 + 2o - 2o - 2o + (-2 + 4 - 3)(-o + 0o + 3o) - o + o - o). -30o*3 Expand (6t - 2t - t)(2t4 + t4 + 0t*4) + 3t*4 - 3t*4 - 2t*5 + 2t5 - t5 + 2t5. 10t*5 Expand (-21z*3 + 29z*3 - 35z*3)((2z - 3z - z)(-2 + 1 + 4)(0 + 7 + 0) - 3z + z + 0z). 1188z4 Expand (17 - 352 + 665 + 562)(2x + 2 - 2)(0 + 2x + 0). 3568x*2 Expand (-21m - 221m - 80m)(m + 0m - 3m)(0 + m + 0) + 3m3 - m3 + 0m*3 + (3 - 3 - 2m)(-3m + 3m - m2) + 0 + 0 + 2m*3. 650m*3 Expand (-30r - 10r - 27r)(1 + 3 + 0). -268r Expand (-11g2 - 13g*2 + 148g*2)(-g - 5g + g - 3g). -992g3 Expand (-26d - 1 - 16d + 4d)(-d + 3d + d)(-1 + 2d + 1) + 4d3 - d3 - 2d*3. -227d*3 - 6d*2 Expand (-1 - 2 - 2)(13l3 + 221l*2 - 221l*2) + (3 - 3 + 2l)(3l*2 + 0l*2 - 2l*2). -63l*3 Expand -2o2 - o2 + 2o2 - o2 + 3o2 - o2 + (0 + 2o + 0)(2 - o - 2) - o*2 + 2o*2 - 2o*2 + (12o - 40 + 40)(-o + 3o + 2o). 45o*2 Expand 6x*3 + 25x*3 + 39x*3 + (6x*2 - 9x*3 - 6x*2)(2 - 4 + 3). 61x3 Expand (-1 + 2a*2 + 1)(3 + 0 + 0) + (0a + 2a + 2a)(-5a + 4a + 3a). 14a*2 Expand (-8f*2 - 52f*2 + 10f*2)(3 + 2 - 4). -50f2 Expand -6h - 4h - h + (0 - 2 + 1)(14h - 25h - 11h). 11h Expand (-5 + 2 - 2)((6 + 1 + 8)(3 + 5y - 3)(-1 + 3 - 3) + 2y - 4 + 4). 365y Expand (0 - 1 + 3)(0 - 5 + 0)(3 - 6q - 6 + 3q). 30q + 30 Expand 30b*2 + 32b*2 - 9b*2 + 0b*2 + 2b*2 - 3b*2 + (0b + 0b - b)(4 + 2b - 4) - 3b + 3b - 2b*2. 48b*2 Expand (11 - 10 + 9)(-v + v + 3v) - 2v - 3v + 2v. 27v Expand (-3g + 5g + 0g)(g - 2g2 - g) - g3 + 3g3 - 4g*3 + (0g + g + 0g)(53g2 - 8g*2 + 32g*2). 71g*3 Expand (-14 + 5 + 7 + v)(4v - v - 2v)(4 - 2 + 2). 4v*2 - 8v Expand (311v2 - 804v + 804v)(-v2 + v2 - 3v3). -933v*5 Expand (0 - p + 0 + (0p - 3p + 5p)(1 - 1 + 2) + 0 + 2p + 0)(7 - 14 - 5)(-3p + 4p - 2p - 4). 60p*2 + 240p Expand (-2t + t + 3t)(t3 - 5t*3 + 2t*3) + (3t - 3t - t2)(-4t + 2t*2 + 4t). -6t4 Expand (2q + 2q2 - 2q)(-35q - 28q + 94q)(4 + q - 4). 62q*4 Expand (22g - 6 - 3 + 8)(7g*2 - 3g*2 - 3g*2) - 2g*3 - 3g*3 + 4g*3. 21g3 - g2 Expand (-5 + 4 - 1)(59h*3 - 874h + 874h)(-h - 6h - 2h)(-1 + 1 - 2). -2124h*4 Expand 4y*3 + 13y*3 + 2y*3 + (-4y + y - 2y)(2 - y*2 - 2). 24y*3 Expand 0j*2 + 2j*2 + 0j*2 + (-2j + 2j + 2j*2)(2 - 1 + 0) - 7j2 + 5j*2 + 8j*2 - 4j*2 + 0j*2 + 2j*2. 8j*2 Expand (7 - 7 + 5r*2)(7r - 4r*2 - 10r + 2r). -20r*4 - 5r*3 Expand 3u*2 - 3u*2 + 2u*5 + 0u - 4u5 + 0u + (-2u + 3 - 3)(3u4 + 48u4 - u4). -102u5 Expand (-19s - 11s + 10s)(-1 - s2 + 1 + (31s - 467 + 467)(0s - s + 0s)). 640s*3 Expand -2s4 + s4 - s4 + (s3 + s3 + s3)(-1 - 2s + 1) - 10s4 + 152s - 152s - 3s + 3s - 2s*4. -20s*4 Expand (b + 5b - 2b)(-b + 2b - 3b)(2b*2 + 464b - 146b - 213b). -16b4 - 840b*3 Expand (i + 2i*2 - i)(6 + 1 - 1) - 4i2 + 4i2 + i2 + (0 + i + 0)(i + 4i - 4i). 14i2 Expand (z2 + 0z2 - 2z*2)(369 - 735 + 365 + 187z). -187z3 + z2 Expand ((0 + 0 + 2)(1 - 5 + 2) + (4 - 4 - 1)(7 - 3 - 2)(-1 + 0 + 4))(3452 - 3452 - 78z2). 780z*2 Expand (-191m + 66m - 457m)(-m2 - m2 + 0m*2). 1164m*3 Expand (103v*4 + 12v*4 + 4v + 4v4 - 3v)(-2 - 1 - 1). -476v*4 - 4v Expand -2t5 + 0t*5 + 4t5 + 18 - t5 - 18 + (2t3 - 3t + 3t)(-1 + 1 - t*2) + 2t*5 - 3t*5 - 9t*5 + t - t + 2t*5. -9t*5 Expand (-43w*3 - 3w*3 + 12w*3)(0 - 2 + 1)(1 - 3 + 0)(3 - 3 + 2). -136w3 Expand (-6 + 2 + 3)(-f - 2f - f + (-1 - 5 - 10)(-f - 2f + 7f)). 68f Expand (3w - 2w + 5 + 0)(7w - 3 - 9 + 11 - 4w + 0w + 5w + 0 - w + 0 + 5 + w - 5 + (3 - 3 - 2w)(-2 - 1 + 4) + w + w - 4w + 3w - w - 3w). 3w*2 + 14w - 5 Expand (19f - 2f + 6f)(-3 + 6 - 1). 46f Expand ((-2 - 1 + 1)(-3 + 1 + 4) - 1 - 2 - 5)(4 - 3 - 4)(-37n2 - 39n*5 + 37n*2). -1404n*5 Expand -4 + 2u*3 + 3 - 3u*3 + (-3 + 6 - 1)(-9u3 - 2 + 2)(-1 + 5 + 1). -91u3 - 1 Expand -5j*3 + 4j3 - j3 + (2j2 + 2j*3 - 2j*2)(4 - 5 - 1) + (2 - 2 - 4j)(-j*2 + 4j*2 + 2j2) + j3 + 4 - 4. -25j3 Expand (-2h + 0h + 3h)((3 + 0 - 4)(-14 - 8 - 4) - 2 - 3 + 6)(3h*3 - 2h*3 - 3h*3)(-h - 6h - 9h). 864h5 Expand (251n*2 + 194n*2 - 240n*2)(-2n2 + 2n2 + n2)(2n + 4n - 5n). 205n5 Expand (-3 + 5 + 1)(-2k2 + 10k*2 + 41k - 44k). 24k*2 - 9k Expand (-3 + y*2 + 3)(y + y - y) + (-5 + 5 + 4y2)(244y - 153y - 161y). -279y*3 Expand (4n + n - 4n)(n + 0n + n) + 1 - n2 - 1 - 3n*2 - 4n*2 + 5n*2 + 19 - 40 + 3n*2 + 17. 2n*2 - 4 Expand (-4f + 2f + f + (-3 + 2f + 3)(-9 + 5 - 1))(-3f + 3f - 2f) + 2f*2 - f + f. 24f*2 Expand (-3s - 2 + 0s + 3)(-11 + 11 - 14s2). 42s*3 - 14s2 Expand -z3 - z*3 + 3z*3 + 3z*3 + 6 - 6 + (-3z + 3z - z2)(-4 - z + 4) + 19z3 - 6z*3 + 6z*3. 24z*3 Expand (71y*5 - 28y*5 + 37y*5)(1 - 2 + 3) - y*5 + 5y*3 - 5y*3. 159y*5 Expand (4g - 1 + 1)(3 + 0 + 0)(4*g -	{ "pile_set_name": "DM Mathematics" }
without replacement from ttvvttaovvvotvvavtvv. 1/190 Two letters picked without replacement from {w: 3, l: 7}. What is prob of picking 2 l? 7/15 Three letters picked without replacement from {b: 15, z: 3}. Give prob of picking 1 z and 2 b. 105/272 Two letters picked without replacement from nnnpnpnffnnn. What is prob of picking 1 n and 1 f? 8/33 Three letters picked without replacement from demtamr. What is prob of picking 2 r and 1 a? 0 What is prob of picking 2 x when two letters picked without replacement from {e: 1, x: 19}? 9/10 Four letters picked without replacement from {q: 3, j: 1, f: 5}. Give prob of picking 1 f and 3 q. 5/126 Three letters picked without replacement from {e: 1, d: 1, x: 5, n: 1, a: 2}. What is prob of picking 3 x? 1/12 Two letters picked without replacement from {k: 13, r: 1, z: 5, p: 1}. What is prob of picking 2 k? 39/95 Two letters picked without replacement from iicici. Give prob of picking 2 c. 1/15 Two letters picked without replacement from rrrmmruwr. Give prob of picking 2 m. 1/36 Three letters picked without replacement from ortrrjorornrjoopn. What is prob of picking 1 r, 1 o, and 1 t? 3/68 Four letters picked without replacement from {s: 6, f: 1, n: 1, d: 11}. Give prob of picking 3 d and 1 s. 165/646 Three letters picked without replacement from ffaaawwjwmaa. Give prob of picking 1 w, 1 j, and 1 a. 3/44 Calculate prob of picking 2 t and 1 v when three letters picked without replacement from ftgfpgftvttti. 5/143 What is prob of picking 1 m and 1 d when two letters picked without replacement from uuuquunuquuumsd? 1/105 Three letters picked without replacement from {r: 2, z: 1, k: 1, s: 1}. What is prob of picking 1 k and 2 z? 0 Two letters picked without replacement from {l: 2, d: 1, s: 2, x: 4, n: 1}. What is prob of picking 1 n and 1 d? 1/45 Calculate prob of picking 3 p and 1 d when four letters picked without replacement from {o: 1, p: 12, d: 1}. 20/91 Calculate prob of picking 2 f when two letters picked without replacement from {y: 2, f: 4}. 2/5 Three letters picked without replacement from iiussyussyssfds. What is prob of picking 1 d, 1 u, and 1 y? 4/455 Three letters picked without replacement from {h: 1, c: 1, l: 1, t: 1, m: 1}. What is prob of picking 1 m, 1 l, and 1 h? 1/10 What is prob of picking 2 j when two letters picked without replacement from {f: 2, k: 3, p: 1, j: 4, s: 1}? 6/55 Four letters picked without replacement from ubejebleejuu. What is prob of picking 1 j, 1 l, 1 e, and 1 u? 8/165 What is prob of picking 2 g, 1 p, and 1 o when four letters picked without replacement from nggxxpioggox? 4/165 Three letters picked without replacement from {y: 11, t: 5}. Give prob of picking 2 y and 1 t. 55/112 Four letters picked without replacement from {c: 2, q: 1, h: 3, f: 1, r: 1, p: 3}. Give prob of picking 1 r, 2 h, and 1 q. 1/110 Three letters picked without replacement from ggghggggkgzgggzztkg. Give prob of picking 1 k and 2 g. 44/323 Four letters picked without replacement from aaaaaijiiaiajaaa. What is prob of picking 1 j and 3 a? 12/91 Four letters picked without replacement from {n: 6, y: 4, b: 1, l: 1, m: 1}. What is prob of picking 1 b and 3 y? 4/715 What is prob of picking 1 p, 2 s, and 1 j when four letters picked without replacement from {j: 3, p: 1, s: 2, i: 10, z: 1, k: 2}? 1/1292 Four letters picked without replacement from ibtlbttlft. Give prob of picking 1 l, 1 i, 1 b, and 1 t. 8/105 Calculate prob of picking 2 e when two letters picked without replacement from {c: 5, e: 6, w: 4}. 1/7 Four letters picked without replacement from {w: 3, q: 12}. Give prob of picking 1 q and 3 w. 4/455 Two letters picked without replacement from {f: 1, s: 4, r: 2}. Give prob of picking 1 r and 1 f. 2/21 Calculate prob of picking 3 q when three letters picked without replacement from {f: 2, s: 5, q: 3, a: 2}. 1/220 Calculate prob of picking 2 y and 1 t when three letters picked without replacement from {k: 1, h: 2, u: 1, o: 1, t: 5, y: 6}. 15/112 Three letters picked without replacement from roriirri. Give prob of picking 3 r. 1/14 Calculate prob of picking 2 a, 1 p, and 1 h when four letters picked without replacement from babbbhpbbbbbaabab. 3/1190 Three letters picked without replacement from hpl. Give prob of picking 3 p. 0 What is prob of picking 1 a and 1 h when two letters picked without replacement from apaaahhphpapapp? 6/35 What is prob of picking 3 d when three letters picked without replacement from dddddddddddddkdddd? 5/6 Three letters picked without replacement from zzvvzzvzzvzvz. Give prob of picking 2 z and 1 v. 70/143 What is prob of picking 1 a and 1 b when two letters picked without replacement from ahjybyhj? 1/28 Four letters picked without replacement from {l: 2, p: 3, y: 3, d: 2, v: 3}. Give prob of picking 1 p, 1 v, 1 d, and 1 l. 36/715 What is prob of picking 1 x and 2 o when three letters picked without replacement from {x: 5, o: 7}? 21/44 What is prob of picking 1 b and 1 w when two letters picked without replacement from {b: 2, w: 7}? 7/18 Two letters picked without replacement from {d: 3, q: 7, x: 2}. What is prob of picking 2 q? 7/22 Calculate prob of picking 4 k when four letters picked without replacement from {e: 1, b: 6, k: 4}. 1/330 Three letters picked without replacement from aagjvvnavuuv. What is prob of picking 1 a and 2 n? 0 What is prob of picking 1 o, 1 l, and 1 u when three letters picked without replacement from sososlsuspsl? 1/55 Three letters picked without replacement from {x: 3, m: 1, r: 1, a: 2, c: 5}. What is prob of picking 2 c and 1 r? 1/22 Two letters picked without replacement from qxxtxlqqqltlqlxxtqt. Give prob of picking 1 q and 1 l. 8/57 Calculate prob of picking 1 n and 2 j when three letters picked without replacement from nnjkmhjp. 1/28 Three letters picked without replacement from nffxnfffn. What is prob of picking 1 x and 2 f? 5/42 Four letters picked without replacement from llwlffvl. Give prob of picking 2 f and 2 l. 3/35 What is prob of picking 2 r and 1 y when three letters picked without replacement from {r: 2, g: 1, y: 1, a: 1, b: 1, e: 1}? 1/35 Calculate prob of picking 1 w and 1 e when two letters picked without replacement from woewoww. 4/21 What is prob of picking 2 w when two letters picked without replacement from {f: 7, w: 3, s: 1, b: 1}? 1/22 Four letters picked without replacement from {n: 2, a: 1, i: 1, l: 1, q: 1, k: 2}. What is prob of picking 1 q, 1 n, 1 i, and 1 l? 1/35 Calculate prob of picking 3 r when three letters picked without replacement from rwwrrrwwrw. 1/12 Four letters picked without replacement from {a: 1, g: 2, e: 2, n: 1, f: 1, u: 7}. Give prob of picking 2 u, 1 a, and 1 f. 3/143 Calculate prob of picking 1 u and 1 h when two letters picked without replacement from {u: 1, c: 1, h: 2}. 1/3 Calculate prob of picking 3 b and 1 e when four letters picked without replacement from bebjb. 1/5 Three letters picked without replacement from {t: 2, u: 5, w: 3}. What is prob of picking 1 u and 2 w? 1/8 Three letters picked without replacement from {u: 1, d: 1, z: 1, j: 1, h: 1}. What is prob of picking 1 z, 1 d, and 1 u? 1/10 Four letters picked without replacement from {v: 7, k: 2, i: 1}. Give prob of picking 4 v. 1/6 What is prob of picking 1 p and 2 c when three letters picked without replacement from {p: 1, j: 1, e: 1, b: 5, c: 1}? 0 What is prob of picking 3 j and 1 m when four letters picked without replacement from mmjjjmmjmmmjjmjm? 9/52 Two letters picked without replacement from {c: 8, b: 2, z: 6, u: 2}. Give prob of picking 1 c and 1 b. 16/153 Calculate prob of picking 2 a when two letters picked without replacement from ddaaaddddddddddd. 1/40 Two letters picked without replacement from xnxxxxxxxxxxxnxxxn. Give prob of picking 1 x and 1 n. 5/17 Four letters picked without replacement from {e: 3, l: 1, k: 3, f: 3}. What is prob of picking 2 k, 1 l, and 1 e? 3/70 Three letters picked without replacement from {i: 11, e: 2}. What is prob of picking 3 i? 15/26 Three letters picked without replacement from iidizdztiizid. Give prob of picking 3 z. 1/286 What is prob of picking 1 n and 1 h when two letters picked without replacement from {p: 7, h: 2, n: 1}? 2/45 What is prob of picking 2 v when two letters picked w	{ "pile_set_name": "DM Mathematics" }
e number? False Suppose 0 = -5k - 3f + 37, -k - 4f + 17 = -f. Suppose -kb + 1525 = 420. Is b prime? False Suppose -2p - 4q + 43122 = 0, -5p + 4q + 107775 = -q. Is p prime? True Let s(m) be the third derivative of -3m6/20 - m5/60 - m4/6 - m3/6 + 10m*2. Is s(-4) a composite number? False Suppose -444 = -2l + 4q, -q + 20 = -6q. Is l a composite number? True Suppose -31d = -d - 535890. Is d prime? True Let w(p) = 3 - 5p + 0p - 9. Is w(-4) composite? True Suppose -46832 = 25y - 41y. Is y prime? True Suppose 5r + 5t + 25950 = 177725, 0 = -3t - 12. Is r a composite number? True Suppose 3m - 3c + 39 = 0, -25 = 4m - m + 4c. Let p = 208 - 142. Let l = m + p. Is l prime? False Let v = -1007 - -1524. Is v a composite number? True Let b(i) = -96i - 5. Let v(j) = -95j - 5. Let q(u) = 4b(u) - 5v(u). Is q(8) prime? True Let f be ((-21)/7)/(-11). Suppose fg - 5 = 1. Suppose -35 = a - ga. Is a a prime number? False Suppose 0 = 3h + 6h + 45. Is 58-141h/30 composite? True Let i(g) = g2 + 10g - 78. Let j be i(-33). Suppose -5a = -13 - 12. Is a/((-2040)/j + 3) a composite number? True Let a(p) = -p2 - 15p - 30. Let x be a(-12). Suppose -10 = -2r - 0. Is 53/r - x/10 prime? False Let v(g) = -g3 - g2 + g + 725. Let h be v(0). Suppose -2n = -h + 1905. Let f = -219 - n. Is f prime? False Let z(a) = 69a - 2 - 1 + 27a + 8a. Is z(2) composite? True Let r = 5033 + -7805. Let s = -1885 - r. Is s prime? True Let g = 16 - 23. Let z = g + 7. Suppose 3l - k - 674 = z, 0 = 4l - 5k - 154 - 763. Is l a prime number? True Suppose -84 - 50 = -4p + 2s, -4s + 47 = p. Suppose -11 + p = -3c. Let i(w) = -21w - 23. Is i(c) composite? True Let s = 12279 - 6568. Is s composite? False Let p(b) be the first derivative of 43b*3 + 5b*2/2 + 11b - 3. Is p(4) a composite number? True Suppose z + 24307 = 6z - h, -h = -3z + 14585. Is z a composite number? False Suppose 2l = 26717 - 8247. Is l composite? True Let v = 2 + 0. Let z(g) = 2 + 9g*v - 3 + 8. Is z(-8) prime? False Suppose p + 275 = -2y, 5p - 5y + 3y = -1375. Let x = 120 - 608. Let z = p - x. Is z prime? False Suppose 4w + 5s - 58223 = 0, w - 58263 = -3w + 3s. Is w/42 - 4/(-14) composite? False Suppose 0 = -w + 3w - 6. Suppose wp + 0p = 6. Is 4 + -4 - (p - 85) composite? False Suppose 5r - 50 = 5o, -4o + 3r = -2o + 25. Is 2/o + 1034/10 a composite number? False Suppose 2c - i - i = 0, 4c + 4i - 32 = 0. Suppose -5y + 636 = 2x, cx + 0y = -2y + 1288. Is x composite? True Let n be (-6)/39 + (-4)/(-26). Suppose 2z + 0z + 2852 = n. Is 27/36 + z/(-8) prime? True Let c = 13 + -7. Let t(y) be the second derivative of y4/12 - y3/2 + y2/2 + 6y. Is t(c) a composite number? False Let d(h) = 3h2 - 3h + 2. Let x be d(2). Is ((-46770)/(-24))/5 - 6/x a composite number? False Suppose 0 = 3u + 3h + 804, 12 = h - 4h. Is -3 + (-2 - u/1) prime? False Let m(a) = 61a + 59. Let p(z) = -12z - 12. Let g(u) = 2m(u) + 11p(u). Suppose 4y = 5h - 44, -h = -4y + 2h - 36. Is g(y) a prime number? False Let y(q) = -14q*2 - 8q + 14. Let u be y(2). Let v = u + 77. Is v composite? False Let x be (4/(-8))/((-1)/10). Suppose -5d - x + 100 = 0. Is d a prime number? True Let y be -3 + (-4 - -6) + -5. Is (2524/(-20))/(y/30) composite? False Let z be -8 + 5/10-2. Is (1187 + 2)/((-9)/z) a prime number? False Let r be -56 + 0/((-9)/(-3)). Let u be (-2)/(-14) + 8/r. Let a(v) = -v*3 + 499. Is a(u) a prime number? True Suppose 5l = -15, 2l + 12446 + 7172 = 4b. Is b composite? False Let n(w) = -2w2 - 13w + 4. Let u be n(-6). Suppose -y = -6y - u. Is y/(-5) - (-1053)/5 prime? True Let t(c) = 68c*2 + 3c - 5 - c - 66c2. Let z = -5 - -2. Is t(z) a composite number? False Suppose 3j = 5r - 7838, 4699 = 3r - 4j + 6j. Is r composite? False Let o(s) = s*3 + 4s*2 - 5s + 1. Let v be 4/1 + (-12)/(-6). Is o(v) a composite number? False Let d(a) = -a*2 + 2a + 10. Let x be d(0). Suppose 1757 = -3h + xh. Is h a composite number? False Let l(m) = -m*3 + 2m*2 - 9m + 6635. Is l(0) prime? False Let f(g) = -3 + 6 - 3g - 4 - 1 - g3. Let a be f(-1). Suppose ay - 8 = 62. Is y prime? False Suppose -57584 - 40732 = -3z - v, -32788 = -z + 5v. Is z a composite number? True Suppose -3v + 6v = 8499. Is v composite? False Suppose 0n - 3n + 75 = 0. Let k be n142/4. Suppose 0t + k = 5t + 3w, 5w - 140 = -4t. Is t prime? False Suppose 2c + 2h - 4802 = 0, -4c - 2h + 9625 = -5h. Suppose 5o = s + 3961, 5s - c = -5o + 1581. Is o a prime number? False Let b(p) = -2661p + 157. Is b(-2) prime? True Suppose 0 = 3x + 3x - 11448. Let b = 3847 - x. Is b composite? True Is (1 + (-1)/2)2824/4 a prime number? True Let l be (210/(-4))/(12/(-16)). Suppose 0 = -4y - y - l. Is 4/y - (-1533)/49 a composite number? False Suppose 0 = -2f + 5f. Let o be 1071 - (f/2 + 3). Suppose 13k - o = 9k. Is k a prime number? False Is (201/(-268))/(2/(-9208)) composite? True Let n(q) = -10q3 - 7q*2 + 12q + 2. Let k be n(-6). Let h = -883 + k. Is h composite? True Let a(p) = -329p3 - 2p*2 + p + 5. Let z be ((-1)/2 - 1)/(21/28). Is a(z) prime? False Suppose 0 = -5h + 33 - 8. Let p(v) = 37v - 4 + 3 + 3. Is p(h) a prime number? False Let w be (-44)/(-6) - (-6)/9. Suppose 2705 = 3n - 4a - 0a, 0 = 2a - w. Is n a prime number? True Suppose 0 = -4a - a. Let i = -1172 + 1872. Suppose as - 5s = 4v - 965, -3v + i = -s. Is v a composite number? True Suppose 10m - 55 = -m. Suppose -20 = -4r, 5000 = mw - 5r - 26030. Is w a prime number? True Let f(r) = 194r3 - r2 + r. Let b(w) = 195w3 - w2 + w. Let x(u) = 3b(u) - 2f(u). Let j be x(1). Let t = j - 112. Is t composite? True Let n = 4218 - 2741. Is n prime? False Suppose -2w + 3l + 510 = 0, -w + 310 = 5l + 29. Let h = 440 - w. Let o = h + 86. Is o prime? False Let i be ((-96)/20)/(-4)-145. Let g = 385 + i. Is g a composite number? False Suppose -68319 = -u - 8u. Is u a prime number? True Let a(h) = 68h + 20. Let t be a(11). Let w(q) = 3q - 5. Let p be w(3). Suppose -o = -pj + 2065, t = 3j + o - 786. Is j a prime number? False Let u(i) = -i2 - 1 + 2 + 4 - 10i. Let q = 256 - 265. Is u(q) a composite number? True Let x(v) = v + 4 - 5v - 3v. Let q be (-112/8)/(2/4). Is x(q) prime? False Suppose -4a + 18 = 6. Suppose -5q - k + 505 = 0, -131 - 172 = -aq - 3k. Is 14 + q - (3 - -1) composite? True Let f(x) = -x3 - 8x*2 + 9x - 41. Is f(-11) composite? False Suppose w = 4w + 9, -5a - 4w = -443. Suppose 2d - a = 763. Is d composite? True Suppose 4p = -3k - 111, -p - 141 = 4k + 2p. Let j be -2 + (-3 - k - -1). Suppose -5x = -3z + j, 3z - 4z + x + 11 = 0. Is z prime? True Suppose -41l = -856611 + 50264. Is l a composite number? True Let n(b) = -1369b - 57. Is n(-6) composite? True Let q = -9440 - -28153. Is q composite? False Let l(t) = 1032t2 + 4t + 11. Is l(3) composite? False Is 4/(8/(-16634))(2 + -4) a composite number? True Suppose 2h + 21 = 8z - 3z, 4h + 2 = 2z. Suppose -811 = -ht - 141. Is t a prime number? False Suppose -4p = -5s + 10943 + 20192, -s - 2p = -6227. Is s composite? True Suppose 3n + 5 = -r - 4, 7 = -n + r. Is n/(-16) + (-2022)/(-8) a composite number? True Let h = 284 - 279. Suppose 0c - f = -c - 50, -188 = 4c + 2f. Let j = h - c. Is j a composite number? False Suppose 360 = 2t + 2a + 80, 3a = 2t - 255. Let p = 49 - t. Let r = 241 + p. Is r a prime number? False Let v(k) = 578k + 11. Is v(12) prime? True Let m be 4582/41. Let l = m + 379. Suppose 156 = -4q + l. Is q a composite number? False Let n(w) = -56w - 11. Suppose 3z = -z + 3u - 39, -3z = -4u + 38. Let g be n(z). Let q = g + -32. Is q composite? False Suppose 0 = 2w - 3g + 4, 0 = 5w - 4g - 7 + 3. Suppose -l - 989 = -7i + 4i, 0 = -2i - wl + 650. Is i/((12/(-3))/(-4)) prime? False Is -4 + 83881 + (3 - 7) + -4 composite? False Suppose -2445 = -6r + 9933. Is r composite? False Is ((-40)/24 - -1)8994/(-4) a composite number? False Suppose 5t - 8548 = -3y, 3t + 370 = 3y + 5494. Is t prime? True Suppose -61o + 36063 = -52o. Is o a composite number? False Let f(h) = 6h*3 - 13h*2 + 10h + 9. Let o be f(10). Suppose -l + o = -5w, -7w - 4825 = -	{ "pile_set_name": "DM Mathematics" }
4 - 8. (5j - 2)*3(5j + 2)2/4 Let b = -1435139/420 - -3417. Let m(i) be the third derivative of 1/210i*5 - bi*6 + 1/84i4 + i2 + 0 + 0i3 + 0i - 1/735i7. Factor m(o). -2o(o - 1)(o + 1)*2/7 Let i = 2077/3 + -691. Let 2/3x*2 + 0 - ix = 0. Calculate x. 0, 2 Suppose 3p + 4l = 75, 22 + 3 = p - 5l. Let q be (30/p)/(3/10). Factor 10r*5 + 8r*3 - 20r*2 + 2 - 6 - 11r + 24rq - 7r. 2(r - 1)(r + 1)*3(5r + 2) Factor 2/7y - 2/7y3 - 4/7 + 4/7y*2. -2(y - 2)(y - 1)(y + 1)/7 Let w(f) = -f*5 + 6f4 - f3 - 6f2 - f. Let r(j) = j4 - j2 - j. Let s(d) = -3r(d) + w(d). Find t, given that s(t) = 0. -1, 0, 1, 2 Find d such that -12d4 + 2d*5 + 26d*4 - 12d*4 = 0. -1, 0 Let n(o) = 13o*4 + 5o*3 + 7o2 + 5. Let z(b) = 5 + b - b3 + b2 - b + b4 - 4. Let s(h) = -n(h) + 5z(h). Factor s(v). -2v*2(v + 1)(4v + 1) Factor -8/7o2 + 0 - 8/7o - 2/7o3. -2o(o + 2)2/7 Let w = -15 + 9. Let y = w + 9. Let z(a) = -a2 + 1. Let g(o) = -2o*2 + 2. Let b(q) = yg(q) - 8z(q). Solve b(i) = 0. -1, 1 Factor -3z*2 - 2z + 2z2 + 3 + 4z. -(z - 3)(z + 1) Let w be ((-168)/(-18))/(3(2 - 0)). Find j such that 8/9j2 - 4/9 + wj*5 + 14/9j - 28/9j3 - 4/9j*4 = 0. -1, 2/7, 1 Let l be (0 + 4)/(752/282). Factor 0x + l - 3/2x2. -3(x - 1)(x + 1)/2 Let v(w) = 2w*3 - 2w*2 + 2w. Let l(g) be the first derivative of 0g - 2g*2 + 5/3g3 - g4 - 3. Let y(u) = 6l(u) + 13v(u). Factor y(t). 2t(t + 1)*2 Suppose 4r - 12 = -2k, -4k + 3r = -25 + 1. Suppose -21 = -5g - k. Let 3pg + 4p*3 - 6p*3 = 0. What is p? 0 Find l, given that -4 - 5l + 3l - 3l*2 + 10l = 0. 2/3, 2 Let h(s) be the first derivative of -3s4/32 + 9s*2/16 + 3s/4 + 8. Factor h(j). -3(j - 2)(j + 1)*2/8 Let r(j) be the second derivative of -7j*4/6 + 41j*3/6 - 6j*2 - 3j. Let g(z) = -5z2 + 14z - 4. Let c(b) = 14g(b) - 4r(b). Factor c(i). -2(i - 2)(7i - 2) Let o(k) be the third derivative of 0 + k2 + 0k + 1/240k5 + 0k*3 - 1/96k4. Let o(i) = 0. What is i? 0, 1 Let o(j) be the second derivative of -j6/135 - j5/45 + j4/54 + 2j3/27 + 9j. Factor o(n). -2n(n - 1)(n + 1)(n + 2)/9 Suppose -5p + 3p = -9p. Factor -2/3d + p + 7/3d2. d(7d - 2)/3 Let q(v) be the second derivative of 1/25v*5 + 0 + 1/30v*4 + 0v*3 - 3v + 1/75v6 + 0v*2. Solve q(w) = 0 for w. -1, 0 Factor -10s - 6s3 + 33s2 + s3 - 48s2. -5s(s + 1)(s + 2) Let c(s) be the third derivative of -1/6s3 + 0s + 1/60s6 + 2s*2 - 1/12s*4 + 0s*5 + 0 + 1/210s*7. Factor c(r). (r - 1)(r + 1)*3 Let f = 2/31 + 23/124. Suppose -5u = -15, -2 - 1 = 2v - u. Determine k, given that -1/2k*5 + 1/2k*3 + 0 - 1/4k*2 + vk + fk4 = 0. -1, 0, 1/2, 1 Let a(n) be the third derivative of -n7/420 - n6/120 + 11n*2. Let a(p) = 0. Calculate p. -2, 0 Let y(r) = 2r + 8. Let t be y(-6). Let m be (-2)/t(0 + 0). Factor 9z - 3z2 - 4 + mz - 2. -3(z - 2)(z - 1) Let b(o) be the third derivative of 0o - 1/280o*8 + 0 - 1/150o*5 + 1/105o*7 + 0o*4 + 0o3 + o2 - 1/300o6. Factor b(r). -2r*2(r - 1)*2(3r + 1)/5 Suppose -5s = -21 + 6. Factor 14zs - z + 2z + 18z2 + 3z. 2z(z + 1)(7z + 2) Let d(s) = -s*2 + s - 1. Let x(m) = 6m*2 + 6m + 2. Let z(c) = -2d(c) - x(c). Factor z(v). -4v(v + 2) Let s(y) be the second derivative of -y4/2 + 4y*3/3 + 4y*2 - 8y. Factor s(m). -2(m - 2)(3m + 2) Let s(l) = -10l*4 + 39l*3 - 69l*2 + 29l - 11. Let p(d) = -5d4 + 19d*3 - 34d*2 + 14d - 6. Let i(c) = -11p(c) + 6s(c). Factor i(k). -5k(k - 2)*2(k - 1) Let p(q) = q*2 + 17q + 10. Let n be p(-12). Let l be 6/8n/(-15). Factor 1/2w*3 - 1 - 2w*2 + lw. (w - 2)(w - 1)2/2 Let f(w) be the third derivative of 0w - 1/330w5 + 0w*3 - 1/132w*4 - 3w*2 + 0. Factor f(o). -2o(o + 1)/11 Let t(h) = -h3 + 11h*2 - 10h. Let o be t(10). Suppose b = -ob. Factor 1/2u*5 + bu - 1/2u4 + 0 + 1/2u*2 - 1/2u3. u2(u - 1)2(u + 1)/2 Suppose 12 = -13v + 38. Factor 0 + 0h + 2/7h3 - 2/7h*v. 2h*2(h - 1)/7 Factor 15/4g2 - 6g - 3/4g3 + 3. -3(g - 2)*2(g - 1)/4 Factor 3r2 - 6r + 9 - 6r2 + 0r*2. -3(r - 1)(r + 3) Let a(s) = -s2 + s. Let w(j) = -14j*2 + 6j + 4. Let b(z) = 8a(z) - w(z). Find l, given that b(l) = 0. -1, 2/3 Let u(n) be the second derivative of n7/126 + n6/36 + n5/120 - n4/36 + 13n. Solve u(s) = 0. -2, -1, 0, 1/2 Let f(s) = 4s4 - 20s*3 + 23s*2 - 7s. Let x(d) = -d4 + d3 + d*2 - d. Let a(q) = -4f(q) + 12x(q). Suppose a(l) = 0. What is l? 0, 2/7, 1, 2 Let y be (6/(-9))/((-2)/15). Suppose p = -6 + y. Let z(n) = n2 - n + 1. Let q(m) = -4m*2 + 4m - 10. Let v(r) = pq(r) - 6z(r). Solve v(d) = 0. -1, 2 Let s(c) = -5c - 5c*3 + 3 + 6 - 2 - 3 - 10c*4 - 18c*2. Let x(i) = -3i*4 - 2i*3 - 6i*2 - 2i + 1. Let j(a) = -4s(a) + 14x(a). Factor j(w). -2(w + 1)4 Let x(a) be the third derivative of -a7/945 - a6/180 - a5/135 - 8a*2. Factor x(n). -2n*2(n + 1)(n + 2)/9 Let l(w) be the first derivative of -2/15w*5 - 3 + 0w*4 - 2/3w + 0w2 + 4/9w*3. Factor l(h). -2(h - 1)*2(h + 1)*2/3 Let o(n) = 17n*3 - 18n*2 - 8n. Let q(t) = 11t3 - 12t*2 - 5t. Let k(w) = -5o(w) + 8q(w). Factor k(d). 3d2(d - 2) Determine y, given that -2/3y2 + 8/9 + 0y - 2/9y3 = 0. -2, 1 Let z(y) be the first derivative of 2y*5/5 - 2y*3/3 - 3. Let d(t) = -2t*4 + 2t*2. Let u(b) = 4d(b) + 3z(b). Solve u(j) = 0 for j. -1, 0, 1 Let d(y) be the first derivative of 4y*5/5 - 37y*4/4 + 39y*3 - 135y*2/2 + 27y + 8. Find a, given that d(a) = 0. 1/4, 3 Factor 6u2 + u - 6u*2 - 3u*2 + 4u*5 - 5u*3 + 3u*4. u(u - 1)(u + 1)2(4u - 1) Suppose 3r = -0p + 2p - 2, -3r + 3 = 3p. Suppose -2s = -2d + 2, -6 = -d - p. Factor -3z2 + sz + 4 - z*2 + 5z2. (z + 2)2 Let q be (-2)/(-14) - (-7)/49. Find g, given that 2/7 + qg2 - 4/7g = 0. 1 Let u = 511/2994 - 2/499. Let -up2 + 1/2p - 1/3 = 0. Calculate p. 1, 2 Suppose -4 - 35 = -3r. Factor -12f*3 - rf*4 - 17f*4 - 9f5 - f2 + 25f2. -3f*2(f + 2)*2(3f - 2) Suppose -2i + 6 = i. Suppose l - 6 + i = 0. Factor -3/5f5 + 0 + 0f*2 + 3/5f*3 + 0f + 0fl. -3f*3(f - 1)(f + 1)/5 Let s(o) = -6o*4 - 3o*4 + 3o + 2o4 - 3o*3 - 2 + 5o*2. Let t(n) = 20n*4 + 8n*3 - 15n*2 - 8n + 6. Let z(b) = -11s(b) - 4t(b). Factor z(k). -(k - 1)*2(k + 1)(3k + 2) Let h(b) = 3b2 + 8b*2 + 11b + 6b + 3b - 8. Let k(i) = -i*2. Let m(v) = h(v) - k(v). Factor m(a). 4(a + 2)(3a - 1) Let l(j) be the third derivative of j8/6720 - j6/720 + j4/12 + j2. Let h(i) be the second derivative of l(i). Find p, given that h(p) = 0. -1, 0, 1 Let d(f) be the first derivative of -f*5/5 + 3f4/4 - f3 + f*2/2 - 1. Factor d(t). -t(t - 1)*3 Let o(i) be the second derivative of 3i5/20 - i4/2 - i*3/8 + 3i*2/4 - 13i. Find x such that o(x) = 0. -1/2, 1/2, 2 Let w(l) be the first derivative of l6/18 + l5/15 - 5l4/12 - l3/9 + 4l*2/3 - 4l/3 + 1. What is d in w(d) = 0? -2, 1 Suppose b - 3 - 15 = 0. Let v = b - 13. Factor -5k4 - 10k*3 - 6 - 5k + 3 - k*v - 10k2 + 2. -(k + 1)5 Suppose -51d + 114 = -39. Determine c, given that -c2 + c4 - 2/5c + 3/5c5 - 1/5c*d + 0 = 0. -1, -2/3, 0, 1 Let w = -109 - -112. Let s(o) be the second derivative of -1/50o*5 + 1/5o*4 - 4/5o*w + 0 - 3o + 8/5o2. Factor s(p). -2(p - 2)*3/5 Let y(v) = 4v*2 - v - 5v*2 + 8v*3 - 3v*2 + 6v*2. Let b(z) = 7z*3 + 2z*2 - z. Let h(p) = 5b(p) - 4y(p). Solve h(g) = 0. -1, 0, 1/3 Suppose -5y + 10 = -s - 0s, 2s = -2y + 4. Let r be y/((-30)/(-39)) + -1. Solve 0 + 14/5k*3 + rk*2 - 6/5k*5 - 8/5k*4 - 8/5k = 0. -2, -1, 0, 2/3, 1 Let j(z) be the first derivative of 0z3 + 2/3z + 1/2z2 + 3 - 1/12z*4. Factor j(v). -(v - 2)(v + 1)*2/3 Let n(m) be the third derivative of 0m*5 + 0m*3 - 1/1848m*8 + 0 - 1/1155m*7 + 0m*6 + 0m - 3m2 + 0m4. Suppose n(h) = 0. What is h? -1, 0 Let b(a) be the third derivative of a5/30 + a4/3 + a3 + 8a2. Factor b(w). 2(w + 1)(w + 3) Let s(j) be the first derivative of -j*7/28 -	{ "pile_set_name": "DM Mathematics" }
f be (-2)/((-43)/8 - -3). Let c = 150/133 - f. What is the smallest value in -3/5, -2/3, 1/2, c? -2/3 Let r = 1569 - 1571. Which is the second biggest value? (a) r (b) -1/2 (c) 4/7 (d) -0.1 d Suppose -30u = -7u - 23. Which is the smallest value? (a) 4 (b) u (c) 0.051 c Let y be 7/(-2)252/(-6615). Let z = 23/14 - 8/7. Which is the smallest value? (a) -0.08 (b) z (c) y a Let q = -16.7 + 19. Let m = -1.9 + q. Suppose 8s + r - 2 = 3s, 0 = s + 2r - 4. What is the smallest value in m, s, -2/5? -2/5 Let j be 14(-1 - (-1)/2). Let r = j + 2. Which is the second smallest value? (a) r (b) -2/7 (c) -0.4 c Let m be 7/(-6) + (14/(-4))/(-7). What is the third smallest value in 3/5, 0.3, -0.1, m? 0.3 Let m = 100 + -95.1. Let g = m - 4. Let p = g - 1.2. What is the third smallest value in 0, p, -2? 0 Let l = 2 - 1. Let m = 167 + -499/3. Which is the fourth biggest value? (a) 2 (b) m (c) l (d) -4/5 d Let r = 4 - 3. Let y = 16.44 + -16. Let p = -0.06 - y. What is the second biggest value in p, -10, r? p Let l = -1.076 - -109.276. Let r = l - 108. Which is the fourth smallest value? (a) -6 (b) -1/3 (c) r (d) 1 d Let b = 12 + -8. Let d = 0.3 + -3.3. Let p = d - 2. What is the third biggest value in 3/8, p, b? p Let r = -0.1 + 0.1. Let q be ((-99)/(-27))/11-6. Which is the second biggest value? (a) 5 (b) q (c) r c Let p = 3.894 + 0.006. Let w = p + 1.1. Let g = 3/7 - 16/21. What is the third smallest value in g, 1, w? w Let v = -5 - -5.07. Let r = 251 + -246. Let z = 707/5 - 142. Which is the third biggest value? (a) r (b) z (c) v b Let x = -11.6 - -26.6. Which is the biggest value? (a) 0 (b) 4 (c) x c Let u = -115.2 - -115. Suppose -5v = -5w - 10, w + 2w - v + 6 = 0. What is the second biggest value in u, w, 3/7? u Suppose 0 = 39s + 16s - 55. Which is the second biggest value? (a) -1/11 (b) s (c) -0.2 (d) 0.02 d Let t be (-1)/40246. Which is the third biggest value? (a) t (b) 2/3 (c) 1 a Let m = -104 - -62. Let s be ((-201)/m)/(1/(-2)). Let d = s - -65/7. What is the second biggest value in 0.2, 5, d? 0.2 Let k = -27.18 - -0.18. Let d = 26.8 + k. What is the third biggest value in -7, d, -0.1? -7 Let w = 0.024 - 23.024. Let j = -23.3 - w. Let t = 8 - 5. Which is the third smallest value? (a) j (b) t (c) 2 b Let y = 0.2 - 0. Let r = -0.6614 - -1.0614. What is the second smallest value in -5, -4, y, r? -4 Let r = -409 + 395. Which is the second smallest value? (a) 5 (b) r (c) -5 c Let d be 22/24180/165. What is the smallest value in -3, 16, 2/27, d? -3 Let l = 613.3 - 613. Let r = 5 - 5.2. Which is the third smallest value? (a) 0.2 (b) l (c) r b Let c = 789 + -787. What is the second biggest value in 12, c, -8? c Let m = -17.4 + 18.1. Which is the third biggest value? (a) -5/3 (b) m (c) -5 c Suppose -l + 3l = 2c + 16, 2l - 4c = 22. What is the biggest value in 1/2, 0.4, 4/3, l? l Suppose -509i - 3 = -5y - 511i, -5y - 3i = -7. Which is the third smallest value? (a) y (b) 145 (c) -3 b Suppose 0 = 5h - 2p + 4, -5h - 2p + 0p - 16 = 0. Which is the second biggest value? (a) -5 (b) -0.5 (c) 4 (d) h b Suppose 4t - 4h = -36, -8t + 11t = -3h - 3. Suppose -2w - 4g - 2 = 0, 3g - 5g - 10 = 4w. Which is the second biggest value? (a) -0.5 (b) t (c) w c Let k = -11.74 - 0.26. Let i = 1499 - 1498. Which is the second biggest value? (a) -3 (b) k (c) 4 (d) i d Let j be ((-4)/(-14))/((-2)/(-14)). Suppose 7 - 23 = -jw. Suppose -2y + 3 = 3s - w, 5s = 25. Which is the third smallest value? (a) 2/11 (b) 4 (c) y b Let c = -7 - -1. Let l be c/(-63) + (-4)/6. Let u be 151 - 4350/300. What is the smallest value in u, l, -1? -1 Let w = 0.29 - -0.01. Let f = 10/37 - -24/185. What is the second biggest value in w, f, -0.29? w Let d = 5.9 + -0.9. Let j = -110.1 - -109.1. What is the fourth smallest value in j, -2/11, -0.7, d? d Let b be ((-1)/3)/((-8)/(-18)). Let o = -0.11 + -64.89. Let i = 65.1 + o. What is the third smallest value in b, i, 0.09? i Let g = 20.4 - 20.6. Which is the fourth biggest value? (a) -3/7 (b) 2/11 (c) g (d) -2 d Let l(n) = -2n2 + 3n. Let i be l(2). Suppose 2f - 3f = -2. Let z = -1.47 + 1.17. What is the biggest value in z, i, f? f Let z = 1 - 2. Let s = -94090 + 660199/7. Let w = s + -225. What is the second smallest value in z, 2, w? w Let s = 1205.08 - 1205. Which is the second biggest value? (a) 4 (b) s (c) -0.02 b Let k = 4.902 - -0.098. What is the second biggest value in k, -0.8, -0.3? -0.3 Suppose -16 = 7m - 23m. Let n = 0.06 - 0.26. Which is the fourth biggest value? (a) 1/4 (b) 3 (c) n (d) m c Suppose 0 = u - 1 + 5. Let n(t) = t3 - t2 - t - 1. Suppose 0 = 5k + 4 + 1. Let w be n(k). What is the third biggest value in 0, w, u? u Let k = -0.084 - -0.184. Which is the fourth smallest value? (a) k (b) -11 (c) -0.1 (d) 0 a Let r = 0.1 + 3.9. Let w = r + -3.8. Let d = -5.6 + 0.6. Which is the smallest value? (a) w (b) d (c) 0 b Suppose -2h = 5t + 17, 3h + 6t - 5t + 6 = 0. What is the third smallest value in h, -4, 1? 1 Let x = 0.06 - -59.94. Let a = x - 57. Let l = 5.3 - 0.3. What is the third smallest value in l, -2/9, a? l Let s(w) = -w*2 - 7w - 6. Let t be s(-5). Let p = t + 1. Let d = -6.88 - -6.9. What is the smallest value in d, 0.5, p? d Let z = 56 + -56. Suppose -b + z + 3 = 0. What is the smallest value in b, 0, -1? -1 Let u be 6 - (-7)/((-14)/8). Let d = 0.18 - 2.18. Let q = 7 + d. Which is the second smallest value? (a) q (b) -6 (c) u c Let w = -953/4 - -239. Which is the third biggest value? (a) 3 (b) w (c) -52/5 c Let j = -19.6 - -20.6. Which is the second biggest value? (a) j (b) -1.8 (c) -1/3 c Let v = -4.4 - -4. Let a = -24.6 - -25. Let u = 2.4 - a. What is the second smallest value in v, 1/8, u? 1/8 Let q = 2461.93 - 2462. What is the second biggest value in -2, q, 2/3? q Let h = -1 - -0.5. Suppose 0 = -2v - 8v + 180. Let p be v1/405/3. Which is the smallest value? (a) h (b) -2 (c) p b Let d = 6 - -4. Let h = d - 4. Suppose -2z + 2 = 0, hz - 2z - 6 = k. Which is the third biggest value? (a) 0.1 (b) k (c) 1 b Let o be -4 + 2 + -6 + 9. Which is the third biggest value? (a) -2/7 (b) 0.06 (c) o (d) 4 b Let z = 98 - 393/4. Which is the biggest value? (a) -2/7 (b) -10 (c) z (d) 1 d Let y = 24 + -24.3. Let r = 0.5 + y. Which is the third smallest value? (a) r (b) 5 (c) 16 c Let j = -0.0658 + -1.3342. What is the third smallest value in 4/9, 2, -3, j? 4/9 Let l = 0.1495 + -80.1495. Which is the second biggest value? (a) -0.3 (b) l (c) 3/4 a Let n = -0.798 + 1.398. What is the biggest value in n, -0.4, 5, -11? 5 Let j(s) = -s2 - 7s - 2. Let t be j(-7). Let x be t + (-2)/(-6) + 1. Let v be 3/(-18)(14/4 + -2). Which is the second smallest value? (a) 0.5 (b) v (c) x b Let u = 2/28807 + -3111422/3831331. Let w = 10/19 + u. What is the second smallest value in -3, w, -0.5? -0.5 Let m = 439/8 + -55. Let h be ((-2)/2)/(5/(-4)). Which is the smallest value? (a) m (b) 1 (c) h (d) 0.4 a Let a = 0.15 - 4.15. Let z = 0.12 + -0.12. What is the second biggest value in 1/2, a, z? z Let q(f) = 4f - 65. Let m be q(15). Which is the biggest value? (a) m (b) 1/3 (c) 36 c Let g = 66 + -395/6. Suppose 4m = 82 - 250. Let z be 32/m - (-4)/(-7). Which is the smallest value? (a) z (b) g (c) -3/4 a Let v = 0.09 + 0.41. Let o = -2.67 - -2.3. Let h = o - 0.13. Which is the third biggest value? (a) v (b) h (c) 2 b Let s be ((-6)/12)/(24/(-80)). What is the third smallest value in 4, s, 6.4, -1/4? 4 Let o = 0.38 - 0.88. What is the second smallest value in -7, o, -1/3? o Let v = -0.581 - -0.081. What is the third smallest value in -2/11, -13, 0.3, v? -2/11 Let j = -293 + 298. What is the biggest value in -8/3, j, 4, -11? j Let m = -435 - -430. What is the smallest value in 2, -63, m? -63 Let p = 126 + -114. Which is the third biggest value? (a) p (b) 3 (c) -3/2 (d) 4 b Let g = 0.171 - -0.129. What is the third biggest value in -15, g, 4/3, 0.5? g Let v(z) = 4z*2 + 50z + 27. Let r be v(-12). What is the biggest value in 0.64, -0.5, r? r Let b = -1469 - -1478. What is the second smallest value in -0.2, b, -0.7, -3/7? -3/7 Let h be ((-5)/(-3))/(0 + 8). Let u = h - -1/8. Which i	{ "pile_set_name": "DM Mathematics" }
M What is 69 minutes after 10:21 PM? 11:30 PM How many minutes are there between 5:05 PM and 12:28 AM? 443 How many minutes are there between 9:24 PM and 8:52 AM? 688 What is 203 minutes after 7:54 AM? 11:17 AM How many minutes are there between 9:29 AM and 2:08 PM? 279 What is 558 minutes after 1:35 AM? 10:53 AM What is 194 minutes before 2:02 PM? 10:48 AM What is 152 minutes before 4:06 PM? 1:34 PM How many minutes are there between 12:45 AM and 5:48 AM? 303 How many minutes are there between 8:38 AM and 3:34 PM? 416 What is 706 minutes before 10:11 AM? 10:25 PM What is 482 minutes after 12:30 AM? 8:32 AM How many minutes are there between 11:29 AM and 12:36 PM? 67 What is 360 minutes before 5:51 AM? 11:51 PM How many minutes are there between 4:52 AM and 12:40 PM? 468 How many minutes are there between 11:09 AM and 12:08 PM? 59 How many minutes are there between 4:39 AM and 7:30 AM? 171 How many minutes are there between 5:04 PM and 3:15 AM? 611 How many minutes are there between 5:06 AM and 3:53 PM? 647 How many minutes are there between 12:40 AM and 3:01 AM? 141 How many minutes are there between 4:51 PM and 1:16 AM? 505 How many minutes are there between 2:18 PM and 9:22 PM? 424 What is 139 minutes before 4:05 PM? 1:46 PM What is 591 minutes before 11:43 AM? 1:52 AM How many minutes are there between 9:05 AM and 3:47 PM? 402 How many minutes are there between 5:30 AM and 3:15 PM? 585 What is 587 minutes before 2:50 AM? 5:03 PM What is 557 minutes before 9:58 AM? 12:41 AM What is 172 minutes after 5:26 AM? 8:18 AM What is 355 minutes before 10:30 PM? 4:35 PM What is 424 minutes after 5:34 AM? 12:38 PM How many minutes are there between 4:35 PM and 10:20 PM? 345 What is 376 minutes after 3:08 AM? 9:24 AM How many minutes are there between 2:35 PM and 10:08 PM? 453 How many minutes are there between 9:46 AM and 7:31 PM? 585 What is 700 minutes before 5:53 PM? 6:13 AM How many minutes are there between 11:55 PM and 2:03 AM? 128 What is 605 minutes before 11:43 AM? 1:38 AM How many minutes are there between 9:26 PM and 8:13 AM? 647 What is 401 minutes after 10:14 AM? 4:55 PM How many minutes are there between 4:35 PM and 8:55 PM? 260 How many minutes are there between 6:42 PM and 8:14 PM? 92 How many minutes are there between 6:20 PM and 4:48 AM? 628 How many minutes are there between 5:16 PM and 7:17 PM? 121 How many minutes are there between 3:59 PM and 4:37 PM? 38 How many minutes are there between 10:53 AM and 11:45 AM? 52 How many minutes are there between 10:24 AM and 10:57 AM? 33 How many minutes are there between 3:54 AM and 9:36 AM? 342 What is 255 minutes before 8:33 AM? 4:18 AM What is 360 minutes before 10:41 PM? 4:41 PM How many minutes are there between 5:51 AM and 3:32 PM? 581 What is 92 minutes before 7:11 AM? 5:39 AM What is 572 minutes after 10:20 PM? 7:52 AM What is 142 minutes after 11:52 AM? 2:14 PM How many minutes are there between 2:19 PM and 11:07 PM? 528 What is 166 minutes after 2:48 AM? 5:34 AM How many minutes are there between 8:32 AM and 6:23 PM? 591 What is 709 minutes before 6:06 AM? 6:17 PM How many minutes are there between 2:03 PM and 12:33 AM? 630 How many minutes are there between 7:32 PM and 1:39 AM? 367 What is 660 minutes before 6:37 PM? 7:37 AM What is 121 minutes after 10:46 AM? 12:47 PM How many minutes are there between 1:20 PM and 1:07 AM? 707 How many minutes are there between 11:07 PM and 1:35 AM? 148 What is 96 minutes before 8:02 PM? 6:26 PM What is 528 minutes before 2:07 AM? 5:19 PM How many minutes are there between 4:46 PM and 4:57 PM? 11 What is 62 minutes before 8:29 AM? 7:27 AM How many minutes are there between 2:04 AM and 1:21 PM? 677 What is 607 minutes before 7:13 PM? 9:06 AM How many minutes are there between 4:51 AM and 5:00 AM? 9 How many minutes are there between 8:38 AM and 9:22 AM? 44 How many minutes are there between 12:35 AM and 8:03 AM? 448 What is 667 minutes after 2:56 PM? 2:03 AM How many minutes are there between 5:12 PM and 7:29 PM? 137 How many minutes are there between 5:46 PM and 6:39 PM? 53 How many minutes are there between 10:02 AM and 12:17 PM? 135 How many minutes are there between 9:43 PM and 9:12 AM? 689 What is 376 minutes after 2:59 PM? 9:15 PM What is 636 minutes before 4:35 AM? 5:59 PM What is 128 minutes before 4:16 PM? 2:08 PM What is 616 minutes before 11:05 PM? 12:49 PM What is 274 minutes before 12:51 AM? 8:17 PM How many minutes are there between 6:03 PM and 5:51 AM? 708 How many minutes are there between 2:15 AM and 1:31 PM? 676 How many minutes are there between 2:53 AM and 11:04 AM? 491 How many minutes are there between 10:40 AM and 2:43 PM? 243 How many minutes are there between 5:43 PM and 11:36 PM? 353 What is 355 minutes after 8:14 PM? 2:09 AM What is 91 minutes before 4:15 AM? 2:44 AM How many minutes are there between 1:52 PM and 4:21 PM? 149 How many minutes are there between 11:35 AM and 6:25 PM? 410 What is 528 minutes after 11:45 PM? 8:33 AM How many minutes are there between 2:03 AM and 11:41 AM? 578 How many minutes are there between 10:29 PM and 1:43 AM? 194 What is 11 minutes after 12:23 PM? 12:34 PM What is 588 minutes after 1:31 PM? 11:19 PM What is 715 minutes before 8:28 PM? 8:33 AM What is 636 minutes before 1:18 AM? 2:42 PM How many minutes are there between 6:06 PM and 7:49 PM? 103 What is 235 minutes before 5:25 AM? 1:30 AM How many minutes are there between 5:59 AM and 7:36 AM? 97 What is 405 minutes after 3:34 PM? 10:19 PM How many minutes are there between 4:29 AM and 9:44 AM? 315 How many minutes are there between 6:58 PM and 12:22 AM? 324 What is 573 minutes before 7:28 PM? 9:55 AM What is 596 minutes after 10:47 PM? 8:43 AM What is 472 minutes after 12:55 AM? 8:47 AM What is 646 minutes after 12:33 AM? 11:19 AM How many minutes are there between 10:16 PM and 3:36 AM? 320 What is 453 minutes after 4:00 AM? 11:33 AM What is 203 minutes before 8:58 PM? 5:35 PM What is 254 minutes after 9:28 PM? 1:42 AM How many minutes are there between 4:02 PM and 6:26 PM? 144 What is 568 minutes after 4:18 PM? 1:46 AM How many minutes are there between 7:40 AM and 1:21 PM? 341 What is 260 minutes after 1:39 AM? 5:59 AM What is 652 minutes after 1:44 PM? 12:36 AM What is 172 minutes after 6:44 AM? 9:36 AM What is 625 minutes before 6:05 AM? 7:40 PM What is 191 minutes before 2:47 PM? 11:36 AM How many minutes are there between 4:14 PM and 5:13 PM? 59 What is 260 minutes before 5:59 AM? 1:39 AM What is 181 minutes before 2:36 AM? 11:35 PM How many minutes are there between 4:08 PM and 9:03 PM? 295 What is 63 minutes before 8:05 AM? 7:02 AM What is 387 minutes after 6:11 AM? 12:38 PM What is 354 minutes after 1:51 AM? 7:45 AM How many minutes are there between 6:10 PM and 8:07 PM? 117 What is 578 minutes after 7:14 AM? 4:52 PM How many minutes are there between 7:20 AM and 12:11 PM? 291 How many minutes are there between 12:02 PM and 7:03 PM? 421 How many minutes are there between 3:46 AM and 2:47 PM? 661 How many minutes are there between 12:14 AM and 5:24 AM? 310 How many minutes are there between 4:52 AM and 8:21 AM? 209 How many minutes are there between 7:36 PM and 2:37 AM? 421 What is 203 minutes before 8:46 AM? 5:23 AM What is 300 minutes after 5:28 AM? 10:28 AM How many minutes are there between 11:26 PM and 4:39 AM? 313 How many minutes are there between 11:53 PM and 1:44 AM? 111 How many minutes are there between 7:22 AM and 7:08 PM? 706 How many minutes are there between 6:02 PM and 11:20 PM? 318 How many minutes are there between 3:03 AM and 8:07 AM? 304 What is 586 minutes before 1:30 AM? 3:44 PM What is 49 minutes after 8:07 PM? 8:56 PM How many minutes are there between 8:28 PM and 8:53 PM? 25 What is 625 minutes after 10:35 PM? 9:00 AM How many minutes are there between 6:07 AM and 3:24 PM? 557 What is 624 minutes before 1:31 AM? 3:07 PM What is 292 minutes after 8:37 AM? 1:29 PM What is 56 minutes after 3:53 AM? 4:49 AM What is 408 minutes after 11:39 AM? 6:27 PM How many minutes are there between 12:47 AM and 1:14 AM? 27 What is 568 minutes after 5:38 PM? 3:06 AM What is 103 minutes after 8:57 PM? 10:40 PM What is 692 minutes after 12:10 AM? 11:42 AM How many minutes are there between 1:07 PM and 1:42 PM? 35 What i	{ "pile_set_name": "DM Mathematics" }
hat is the smallest value in 1, -1.3, -1/441, 1.73? -1.3 What is the fourth biggest value in 4, 2, 1/191, -14, 7? 1/191 What is the biggest value in -0.059, -0.59, 2, 75? 75 Which is the second smallest value? (a) 0.08 (b) 3.985 (c) 4 (d) 1 d Which is the second smallest value? (a) 0.1 (b) 235 (c) 2 (d) -14 a Which is the second biggest value? (a) -3 (b) 0.9 (c) 34276 b What is the fourth smallest value in 27.74, -6, -1, 3/7? 27.74 Which is the second biggest value? (a) -4 (b) -169 (c) -5 (d) -1073 c Which is the third smallest value? (a) -2 (b) -1/2 (c) 8 (d) -0.023 (e) 0 d What is the smallest value in 6, 2, 1.2, -168? -168 What is the third biggest value in -1/5, -10, -38/5, 2/3? -38/5 What is the second biggest value in 2/3, 3/7, 37189, -2/5, 0.4? 2/3 Which is the second biggest value? (a) 2/5 (b) 1.746 (c) 92 (d) -2/3 b What is the third biggest value in -667, -4, -5? -667 Which is the fourth smallest value? (a) 1 (b) 1/17 (c) -0.01 (d) -3 a Which is the smallest value? (a) 5/6 (b) -0.6 (c) -2/23 b Which is the smallest value? (a) -4 (b) -0.3 (c) 1063 (d) 2 a Which is the smallest value? (a) -1/5 (b) 0.0347 (c) -3 (d) -0.74 c Which is the fourth smallest value? (a) 2 (b) 56 (c) -0.3 (d) -1 b What is the fourth smallest value in -0.4, 5, -2/9, -57, -2, 3/13? -2/9 What is the third smallest value in -0.0108, -1/7, -8? -0.0108 What is the fifth smallest value in -13, 1, -59, -0.2, 7? 7 What is the fifth smallest value in -1/22, 5, -1/5, 1/8, 0.6? 5 Which is the fourth biggest value? (a) 3 (b) -0.3 (c) -605 (d) -0.4 (e) -1/2 e Which is the second biggest value? (a) -0.069676 (b) -2 (c) 3 a Which is the fifth biggest value? (a) -1/3 (b) 3/5 (c) 18/79 (d) 0.2 (e) 17 a What is the second smallest value in 43, -0.138, 1, 8? 1 Which is the second biggest value? (a) -2 (b) 3/4 (c) -0.0045 (d) -0.04 c Which is the biggest value? (a) -213 (b) 7 (c) 59 c What is the third smallest value in -3, 1/4, -2/3, 0.5, 982? 1/4 Which is the fourth biggest value? (a) 0.05 (b) 5/4 (c) -1 (d) 1 (e) -97 (f) -22 c Which is the fifth smallest value? (a) 1 (b) 194 (c) 14 (d) -1/6 (e) 1/6 b Which is the third biggest value? (a) -1/3 (b) 982 (c) 4/5 a Which is the second smallest value? (a) 80 (b) -0.3 (c) -0.1353 c What is the third smallest value in 5, -61.4, 0.5? 5 Which is the second smallest value? (a) -1.11 (b) 0.1 (c) -17 a Which is the third biggest value? (a) -0.3 (b) 3 (c) 9.3 (d) 1 (e) -2 d Which is the biggest value? (a) -2/7 (b) -3/4 (c) -0.022 (d) -2/3023 d Which is the fourth biggest value? (a) -5 (b) -30.2 (c) 0 (d) -3 (e) -2/5 (f) 4 d Which is the smallest value? (a) -33 (b) 0.13 (c) -1 (d) -6 a Which is the second smallest value? (a) 26 (b) 135 (c) 1 a Which is the fourth smallest value? (a) -26 (b) -0.05 (c) -9 (d) -5 (e) 0.4 b Which is the fourth biggest value? (a) -35 (b) -0.2 (c) -3/4 (d) 5 (e) 2/15 (f) 18 b Which is the fourth smallest value? (a) 14 (b) -3 (c) -0.1 (d) 8 a Which is the smallest value? (a) 1/3 (b) -0.13 (c) 3 (d) -1/3 (e) -7 (f) 143 e Which is the third smallest value? (a) 5 (b) -0.273 (c) 0.4 (d) 958 a What is the biggest value in -3.3, -2.96, -0.1, -2/5? -0.1 Which is the biggest value? (a) 0.28 (b) 3 (c) -2/5 (d) 4 (e) 2 d Which is the third smallest value? (a) 0 (b) 6 (c) -52.1 (d) 31 (e) -3 (f) 3 a What is the third smallest value in 3, -1, -2/17, -173.78? -2/17 What is the smallest value in 12, -41, -196? -196 Which is the biggest value? (a) -10 (b) 27/68 (c) -0.5 b Which is the fourth smallest value? (a) 3 (b) -0.4 (c) 1/3 (d) -635/3 a What is the third biggest value in -15168, 2/7, -15? -15168 What is the third biggest value in 5, -1/58, 550? -1/58 Which is the sixth biggest value? (a) 11 (b) -0.4 (c) 1883 (d) 3 (e) -2 (f) -0.1 e What is the smallest value in 40/7, 561, 2/5? 2/5 Which is the smallest value? (a) -12 (b) -27.7 (c) 2.7 (d) 2 (e) 3/8 b Which is the sixth smallest value? (a) -5 (b) -4/181 (c) -0.4 (d) -0.6 (e) 2 (f) 5 f What is the second smallest value in -72, -28, -30? -30 Which is the third smallest value? (a) 1/6 (b) 188.3 (c) 5 b Which is the second smallest value? (a) -0.5 (b) 0.2 (c) -42.4 (d) 1/14 (e) 22 a What is the fourth smallest value in 221, 16, -2/5, 2/7, -4? 16 Which is the third biggest value? (a) -84 (b) -1 (c) 5/5248 a What is the fifth smallest value in -0.2, -6/41, 1/11, 6/7, -5, 17? 6/7 What is the smallest value in 0.4, -5, -21011? -21011 Which is the third biggest value? (a) -3 (b) 7 (c) 336/23 (d) -5 a Which is the fourth biggest value? (a) -1/16 (b) 5 (c) -6 (d) 2 (e) 7.91 a Which is the fourth biggest value? (a) 291/4 (b) 2/17 (c) -1 (d) -0.2 (e) 3 d What is the fifth biggest value in 0, -3, -127, -57, 5/3? -127 What is the fourth smallest value in -1, -3, 0.06, 4/59? 4/59 Which is the third biggest value? (a) -279/7 (b) 0.45 (c) 2 a Which is the fourth biggest value? (a) 2 (b) -0.06 (c) 3 (d) -268 d What is the third biggest value in 1776, -0.1, 3/14? -0.1 What is the fourth smallest value in -6, 0, 1/4, -5825? 1/4 What is the fourth smallest value in -21/2, -0.2, -6, 5, 0.4, -4? -0.2 Which is the second smallest value? (a) -0.5 (b) 2/3 (c) 986 (d) -5 a Which is the fourth smallest value? (a) 4 (b) -1.7 (c) 43/4 (d) 5 c Which is the second smallest value? (a) 1280 (b) -10 (c) 1/3 (d) -1/4 (e) 0 d What is the second smallest value in -1367, 2, 25/3? 2 Which is the fourth smallest value? (a) -0.09 (b) 1/18 (c) 0.5 (d) 2/17 (e) 0.2 (f) 2 e Which is the third smallest value? (a) 3 (b) -1811719 (c) 2/5 a What is the third smallest value in 5, 4/441, -5, 3.6, 0.1? 0.1 What is the second smallest value in -60, 2, 3/5, -12/23? -12/23 What is the third smallest value in -1, -6, 1/3, -2, 1, 236? -1 Which is the third smallest value? (a) 3/2 (b) 0 (c) -2.7143 a Which is the third biggest value? (a) 34/11555 (b) -0.3 (c) -0.1 b Which is the smallest value? (a) -14 (b) 54 (c) 0.1 (d) -2/3 (e) 0 (f) -2 a What is the third smallest value in 1/15, 6, -13, -0.5, 0.1? 1/15 Which is the third biggest value? (a) 1 (b) 2 (c) 161786 a What is the second smallest value in 3/5, -2/3, -167? -2/3 What is the fifth biggest value in -1/6, -159, 0, 0.3, -9.9, 0.2? -9.9 What is the third biggest value in 0, 109, -1, -6, -0.06, 1/5? 0 Which is the fourth biggest value? (a) -4 (b) -14/29 (c) 8 (d) -1 (e) -0.19 d Which is the fourth biggest value? (a) 2/23 (b) -0.2 (c) 2/35 (d) 45 (e) -4 b What is the fifth biggest value in -3/7, 1/2, -13, -87, 2/9? -87 Which is the fourth smallest value? (a) -268 (b) -1 (c) 1/4 (d) -41 (e) 2/15 (f) -4 b Which is the biggest value? (a) -10 (b) -3 (c) 2/7 (d) 0.403 d What is the sixth biggest value in -6, -6/11, 0.07, 1, 3/7, -0.03? -6 What is the fourth biggest value in -0.5, 3, -37, 7, -19? -19 What is the sixth smallest value in 6, 39, 0.2, -19/6, -2, 4? 39 What is the third smallest value in -15, -18, -1.6, -1? -1.6 Which is the second biggest value? (a) 0.4 (b) 2/7 (c) -6 b What is the third smallest value in 125, -0.038, 4, -1, -3? -0.038 What is the third biggest value in -2/85, 0.1, -623.2? -623.2 Which is the fourth smallest value? (a) -69.6 (b) -3 (c) 3/2 (d) -0.2 (e) 2 (f) 5 c What is the third biggest value in 1, -3, -0.0038, 33.5? -0.0038 Which is the fourth biggest value? (a) 1 (b) -4 (c) 0.16 (d) 2/51 (e) 3 d Which is the third biggest value? (a) -81 (b) 1 (c) 4 (d) 2/5 (e) -13 d What is the fourth smallest value in 37, -0.1, 5872, 1? 5872 What is the smallest value in -1, 1, 0.4, 0.1, -12.1? -12.1 Which is the fifth smallest value? (a) 5 (b) 0.06 (c) 5/4 (d) -9 (e) 1 (f) -3/2 c What is the fifth biggest value in -0.06, 0.3, 3, 1, 310, -4/7? -0.06 What is the second biggest value in 41, -2, 253.9, 0.5? 41 Which is the smallest value? (a) 1 (b) -27/20 (c) 0.07 (d) 120 b Which is the smallest value? (a) -0.3 (b) -39 (c) -5 (d) -2/3 (e) 10.3 b What is the smallest value in 1/3, -4, 34707? -4 What is the second biggest value in 367, 0.5, 3, -1/5, 2? 3 What is the second biggest value in	{ "pile_set_name": "DM Mathematics" }
= 25l + 99. What is p(-4)? -1 Let l(x) = 14x + 56. What is l(-4)? 0 Let w(t) = -9t + 23. What is w(3)? -4 Let o(m) = 78m + 254. Determine o(-3). 20 Let x(j) = j*3 - 5j*2 - 2j - 5. Determine x(5). -15 Let u(b) = -8b - 27. Determine u(-5). 13 Let q(k) = k2 - 13k + 27. Calculate q(11). 5 Let k(x) = 3x3 - 40x*2 - 30x + 45. Calculate k(14). 17 Let q(c) = 107c3 + c2 - c - 1. Give q(-1). -106 Let a(f) = 6f*2 + 2f - 1. Calculate a(2). 27 Let p(n) = -2n3 + 16n2 - n + 11. Calculate p(8). 3 Let a(n) = -n3 - 23n2 + 21n - 54. Calculate a(-24). 18 Let v(n) = n*3 + 9n*2 + 6n - 13. Give v(-8). 3 Let j(o) = -4o2 - 53o - 10. Determine j(-13). 3 Let q(j) = -j*3 - 8j*2 - 8j + 10. Determine q(-7). 17 Let j(t) = -t*3 - 3t*2 + 2t - 6. Give j(-4). 2 Let w(f) = 4f - 27. What is w(8)? 5 Let f(b) = b2 + 10b + 16. Calculate f(-6). -8 Let v(n) = -9n3 - n2 - 2n - 1. Give v(-2). 71 Let r(c) = -5c + 11. Give r(-7). 46 Let k(b) = -b3 + 36b*2 - 34b - 40. What is k(35)? -5 Let k(q) = -6q2 + 5q. Determine k(2). -14 Let q(v) = -v3 - v2 + 7. Determine q(4). -73 Let b(w) = -w*2 + 41w - 83. What is b(38)? 31 Let r(f) = -3f2 + 5f. Determine r(2). -2 Let u(v) = -12v2 + v. Calculate u(1). -11 Let t(r) = -2r*2 - 5r + 4. Calculate t(0). 4 Let n(z) = z*3 - 11z*2 + 19z - 2. Give n(9). 7 Let n(i) = i*3 + 5i*2 - 3i - 19. Give n(-3). 8 Let a(s) = -s*2 + 27s - 101. Calculate a(5). 9 Let b(w) = -3w2 - 19w + 7. What is b(-6)? 13 Let y(n) = -4n3 - 57n*2 - 11n + 44. Calculate y(-14). 2 Let j(d) = d - 13. Determine j(8). -5 Let d(n) = n*3 - 7n*2 - 10n + 11. What is d(8)? -5 Let k(z) = z*3 - 4z*2 - 4z + 3. Calculate k(5). 8 Let t(s) = -2s3 - 13s*2 + 25s + 10. What is t(-8)? 2 Let w(k) = -k*3 - 10k*2 - 9k - 1. What is w(-9)? -1 Let m(f) = f - 9. Calculate m(6). -3 Let u(q) = q*3 + 5q2 + q + 8. What is u(-5)? 3 Let k(m) = -m2 + 79m - 69. Determine k(78). 9 Let y(x) = 3x*2 - 28x - 3. Determine y(8). -35 Let n(b) = -b*2 - 7. What is n(-7)? -56 Let d(z) = -23z - 57. Give d(-5). 58 Let c(j) = -j*3 - 10j*2 - 4j + 6. Calculate c(-11). 171 Let t(v) = v*2 + 11v - 15. Determine t(-13). 11 Let l(p) = -p*3 + 2p*2 - p - 1. Calculate l(-3). 47 Let i(t) = 3t*2 - 2t - 2. What is i(-1)? 3 Let o(l) = l*3 - 4l*2 - 5l + 12. Give o(5). 12 Let t(g) = g*2 + 9g + 8. What is t(-6)? -10 Let j(n) = n*3 - 20n*2 - 21n + 3. Determine j(21). 3 Let d(k) = k*3 + 21k*2 + 16k - 74. What is d(-20)? 6 Let q(r) = -r*3 + 34r*2 + 111r - 10. Determine q(37). -10 Let x(y) = -y*3 - 2y*2 - 1. Determine x(-2). -1 Let x(n) = 3n - 5. Calculate x(1). -2 Let z(y) = -6y3 - y - 2. Give z(-2). 48 Let k(a) = 4a + 1. Calculate k(2). 9 Let d(k) = k*2 - 10k - 16. What is d(10)? -16 Let q(j) = -j*3 - 7j*2 + 9j - 1. Determine q(-8). -9 Let t(v) = -v*2 + 20v - 18. Calculate t(19). 1 Let t(v) = -v*3 + 4v2 + v - 1. Determine t(2). 9 Let w(r) = r2 - 12r + 20. What is w(8)? -12 Let y(c) = -2c*2 - 10c - 17. Calculate y(-4). -9 Let u(t) = -t + 15. Determine u(8). 7 Let j(r) = 7r - 12. What is j(2)? 2 Let w(a) = -a3 + 18a*2 - 17a + 6. Give w(17). 6 Let a(n) = -2n2 + 4n. Give a(-3). -30 Let s(k) = -22k + 11. Determine s(-2). 55 Let l(q) = 2q*2 - 10q + 2. Determine l(4). -6 Let a(z) = z*3 + 15z*2 + 49z - 42. Calculate a(-9). 3 Let i(r) = -27r - 1. What is i(1)? -28 Let j(m) = m2 + m - 35. Give j(-7). 7 Let f(w) = -w3 + w2 + 4w - 6. What is f(-4)? 58 Let c(q) = 2q3 + 3q*2 + 3q + 3. What is c(-2)? -7 Let t(m) = -6m2 - 29m - 9. Give t(-6). -51 Let z(d) = -d - 29. Calculate z(4). -33 Let r(y) = -y*2 - 19y - 70. Give r(-5). 0 Let v(t) = t*3 + 18t*2 - 4t. Determine v(-18). 72 Let u(t) = -9t - 132. What is u(-15)? 3 Let n(h) = h2 + 3h + 4. What is n(-1)? 2 Let l(d) = -2d + 21. Determine l(11). -1 Let k(m) = 12m + 78. Calculate k(-5). 18 Let w(q) = 2q2 + 28q + 26. Calculate w(-1). 0 Let w(q) = q*2 + 39q + 265. Determine w(-30). -5 Let c(b) = -2b + 1. Determine c(-4). 9 Let p(r) = r - 18. Give p(12). -6 Let j(i) = -i2 - 5i + 14. Give j(-11). -52 Let v(k) = -k + 3. Give v(6). -3 Let t(s) = 2s3 - 22s*2 + 4s + 13. Give t(11). 57 Let j(s) = -19s - 187. Calculate j(-9). -16 Let a(c) = 5c2 - 1. Calculate a(2). 19 Let k(b) = b2 - 2b + 4. What is k(3)? 7 Let o(j) = -j3 + 8j*2 - 8. Calculate o(7). 41 Let t(i) = -5i + 3. Calculate t(-3). 18 Let o(z) = 11z + 13. Give o(-6). -53 Let a(l) = -l3 + 3l*2 + 7l - 6. What is a(4)? 6 Let a(l) = l*3 - 7l*2 + 10l - 2. Determine a(5). -2 Let j(q) = -q*3 + 5q*2 - 2q - 1. What is j(2)? 7 Let o(t) = -t - 4. Calculate o(2). -6 Let p(u) = -2u + 15. Determine p(7). 1 Let q(j) = j2 + 28j + 179. What is q(-19)? 8 Let i(q) = 3q + 34. Determine i(-8). 10 Let f(r) = -r3 - r2 - 2r + 2. Give f(1). -2 Let l(t) = -t*3 + 3t*2 + 7t - 2. Calculate l(5). -17 Let o(t) = -3t - 13. Calculate o(-11). 20 Let m(u) = -u3 + 4u*2 - 6u + 6. Determine m(3). -3 Let x(v) = -v*3 + 2v2 - v - 2. Determine x(2). -4 Let s(g) = g + 14. Give s(0). 14 Let x(j) = j3 + 16j2 + 13j - 15. Determine x(-15). 15 Let s(q) = -2q2 - 53q - 344. Determine s(-14). 6 Let j(d) = -d + 6. Calculate j(2). 4 Let f(l) = -2l + 1. What is f(-1)? 3 Let f(z) = 9z*2 - 4z. Calculate f(1). 5 Let n(l) = 3l - 6. Calculate n(5). 9 Let c(k) = k2 + 28k + 82. Calculate c(-4). -14 Let k(f) = 2f3 - 84f*2 + 83f - 32. Determine k(41). 9 Let o(b) = -b3 - b2 - 2b - 7. Determine o(-2). 1 Let i(b) = 2b. Determine i(1). 2 Let m(j) = j*3 - 20j*2 + 17j + 29. Determine m(19). -9 Let k(z) = -z*3 + 20z*2 - 35z - 7. What is k(18)? 11 Let y(c) = -7c - 4. Calculate y(5). -39 Let i(o) = -3o + 25. Calculate i(12). -11 Let u(j) = -6j - 3. Give u(-1). 3 Let f(v) = v3 + v2 - 1. What is f(-2)? -5 Let d(y) = -y3 - 16y*2 + y + 22. Calculate d(-16). 6 Let a(p) = 3p - 9. Calculate a(6). 9 Let c(b) = b*2 + 26b + 82. Give c(-22). -6 Let w(g) = -g*3 - 30g*2 + 5g + 74. What is w(-30)? -76 Let r(g) = -g + 15. Determine r(0). 15 Let t(i) = 2i3 + 15i*2 - 28i - 5. What is t(-9)? 4 Let s(y) = y*2 + 10y - 12. Give s(-11). -1 Let u(m) = -17m. Calculate u(2). -34 Let j(g) = -g3 - 7g*2 + 6g - 9. Calculate j(-8). 7 Let m(z) = 52z + 206. What is m(-4)? -2 Let d(f) = 24f + 415. Determine d(-17). 7 Let z(l) = l*3 - 5l*2 - 4l - 23. What is z(7)? 47 Let j(i) = 2i3 + 26i*2 + 27i - 11. Give j(-12). -47 Let n(k) = -k2 + 10. Calculate n(3). 1 Let u(m) = m2 - 4m - 4. Determine u(5). 1 Let t(j) = -j2 - 5j + 77. What is t(-12)? -7 Let x(c) = -8c. Calculate x(-1). 8 Let u(j) = -4j*2 + 21j + 48. Determine u(7). -1 Let m(k) = 2k3 + k2 - k + 2. Give m(-2). -8 Let w(a) = a3 - 5a*2 - 4a + 13. Give w(5). -7 Let h(l) = 87l + 782. What is h(-9)? -1 Let o(h) = h3 - 11h*2 - 14h + 20. Give o(12). -4 Let u(y) = 7y - 85. Give u(14). 13 Let w(l) = 14l + 45. Determine w(6). 129 Let d(y) = 12y3 - y2 + 4y - 2. Determine d(2). 98 Let s(i) = -111i - 108. Determine s(-1). 3 Let c(x) = -7x + 5. Determine c(7). -44 Let k(n) = 7n + 41. Determine k(-5). 6 Let a(i) = -i2 - 4i + 5. What is a(-4)? 5 Let o(h) = -h*2 + 6h + 16. What is o(-3)? -11 Let l(s) = 14s + 80. Determine l(-8). -32 Let j(p) = -35p + 71. Give j(2). 1 Let w(i) = -11i3 + 14i*2 + 7i + 2. What is w(2)? -16 Let f(z) = -2z3 + 24z2 + 3. What is f(12)? 3 Let l(r) = r3 + 2r2 - r - 1. Determine l(-1). 1 Let y(r) = -r3 + 3r*2 + 10r - 4. Calculate y(5). -4 Let o(l) = 168l - 2. Calculate o(-1). -170 Let s(d) = 3d + 48. What is s(-20)? -12 Let l(o) = -o + 4. Determine l(-2). 6 Let t(n) = n*2 + 4n - 22. Determine t(-7). -1 Let i(n) = 247n + 240. Calculate i(-1). -7 Let r(q) = -q3 + 12q*2 - 29. Give r(0). -29 Let j(h) = 6h*2 - 34h - 52. What is j(7)? 4 Let l(b) = -b*2 - 3b - 2. Determine l(-8). -42 Let a(r) = -r*2 - 4r - 12. Calculate a(4). -44 Let l(r) = 13r + 209. Calculate l(-15). 14 Let q(o) = -2o*3 - 2o*2 - 2o - 1. Determine q(-1). 1 Let c(h) = -20h + 6. Calculate c(0). 6 Let i(d) = -d2 - 15d + 14. What is i(-16)? -2 Let r(d) = d*3 - 11d*2 + 5d + 12. Give	{ "pile_set_name": "DM Mathematics" }
from bqbqb. What is prob of picking 2 b? 3/10 Calculate prob of picking 2 m, 1 n, and 1 u when four letters picked without replacement from nnmzmzmzzznzuz. 9/1001 Three letters picked without replacement from jqjjrojqajqja. Give prob of picking 1 r, 1 o, and 1 a. 1/143 Calculate prob of picking 1 y and 1 d when two letters picked without replacement from {y: 3, d: 4, o: 1}. 3/7 Three letters picked without replacement from {j: 1, x: 1, v: 1, b: 2, y: 1, h: 1}. Give prob of picking 1 j, 1 x, and 1 b. 2/35 Calculate prob of picking 1 r and 1 s when two letters picked without replacement from {a: 3, b: 1, s: 1, r: 2}. 2/21 Two letters picked without replacement from lllljlllllljljl. Give prob of picking 2 l. 22/35 Four letters picked without replacement from {d: 4, j: 6}. Give prob of picking 2 j and 2 d. 3/7 What is prob of picking 1 p and 1 t when two letters picked without replacement from vtvptp? 4/15 Four letters picked without replacement from ififixxfkxkfazxki. Give prob of picking 2 f, 1 z, and 1 i. 6/595 Two letters picked without replacement from {q: 2, b: 2, s: 4}. What is prob of picking 2 q? 1/28 Calculate prob of picking 2 v when two letters picked without replacement from wwvwvwvwvwwvvwwwww. 5/51 Calculate prob of picking 1 a and 1 q when two letters picked without replacement from {y: 1, q: 4, r: 1, h: 4, x: 1, a: 1}. 2/33 Four letters picked without replacement from xhhdhdxhx. Give prob of picking 3 x and 1 h. 2/63 What is prob of picking 1 w and 2 r when three letters picked without replacement from {w: 5, m: 1, x: 1, v: 2, r: 9}? 15/68 Two letters picked without replacement from {m: 1, i: 3, v: 3}. Give prob of picking 2 v. 1/7 Calculate prob of picking 2 k when two letters picked without replacement from kkkkkkkkkkknkknnnn. 26/51 Calculate prob of picking 3 p and 1 n when four letters picked without replacement from {n: 12, p: 3}. 4/455 What is prob of picking 2 m when two letters picked without replacement from amam? 1/6 Four letters picked without replacement from {x: 4, d: 6}. Give prob of picking 3 d and 1 x. 8/21 Calculate prob of picking 2 q and 1 b when three letters picked without replacement from qqyyb. 1/10 What is prob of picking 2 p and 1 u when three letters picked without replacement from cuvvczlp? 0 Three letters picked without replacement from dmdmmdmmddddd. Give prob of picking 3 d. 28/143 Two letters picked without replacement from {g: 1, b: 6, k: 7, i: 3, p: 2}. Give prob of picking 2 p. 1/171 Calculate prob of picking 2 x when two letters picked without replacement from {b: 1, x: 2, w: 1, s: 7, e: 2, p: 2}. 1/105 Two letters picked without replacement from eeererewrrerw. What is prob of picking 2 e? 5/26 Four letters picked without replacement from guggllueccellulgu. Give prob of picking 4 g. 1/2380 What is prob of picking 1 b, 1 x, and 1 j when three letters picked without replacement from bgxxbjjbjbjxjjxx? 3/14 Calculate prob of picking 2 f when two letters picked without replacement from {f: 10}. 1 Four letters picked without replacement from biyibtbiiybibhb. Give prob of picking 1 y and 3 b. 8/273 Four letters picked without replacement from {q: 1, m: 1, w: 3, x: 2, p: 4}. Give prob of picking 1 p, 1 w, 1 q, and 1 m. 2/55 Three letters picked without replacement from xxuxukuuuuuuuuk. What is prob of picking 3 u? 24/91 Four letters picked without replacement from owdgddgdx. Give prob of picking 1 g, 1 o, and 2 d. 2/21 Two letters picked without replacement from {f: 1, j: 2, c: 2, g: 3, u: 5, q: 7}. What is prob of picking 1 j and 1 g? 3/95 Two letters picked without replacement from {y: 3, i: 8}. What is prob of picking 2 y? 3/55 Two letters picked without replacement from wcdcdcdwdcccccdddd. Give prob of picking 2 c. 28/153 Calculate prob of picking 1 y and 2 k when three letters picked without replacement from {k: 7, y: 9}. 27/80 Three letters picked without replacement from fffz. What is prob of picking 2 f and 1 z? 3/4 What is prob of picking 2 w when two letters picked without replacement from wwwww? 1 Two letters picked without replacement from {z: 1, e: 3, y: 1}. What is prob of picking 1 e and 1 y? 3/10 Two letters picked without replacement from {s: 9, i: 9}. Give prob of picking 2 s. 4/17 Calculate prob of picking 3 h and 1 u when four letters picked without replacement from uuhhhuuuuuuu. 1/55 Four letters picked without replacement from ydctdttvytdtyyyydyd. What is prob of picking 3 d and 1 t? 25/1938 Calculate prob of picking 2 x and 2 f when four letters picked without replacement from xfxfxxfxxfxxffffxf. 36/85 Calculate prob of picking 2 v when two letters picked without replacement from {o: 2, r: 8, v: 2}. 1/66 Calculate prob of picking 1 m, 1 n, and 1 g when three letters picked without replacement from {g: 2, i: 8, x: 1, m: 2, n: 5}. 5/204 Three letters picked without replacement from dbkbbbkbbdbb. What is prob of picking 1 k and 2 b? 14/55 Three letters picked without replacement from efeeeefwf. Give prob of picking 3 f. 1/84 Calculate prob of picking 2 k and 1 n when three letters picked without replacement from nqnnnqnkk. 5/84 Two letters picked without replacement from {k: 2, f: 16}. What is prob of picking 1 k and 1 f? 32/153 Three letters picked without replacement from vvolhovohooogo. What is prob of picking 2 h and 1 v? 3/364 Four letters picked without replacement from lldldlf. Give prob of picking 2 d, 1 l, and 1 f. 4/35 Two letters picked without replacement from yymmq. What is prob of picking 1 y and 1 m? 2/5 What is prob of picking 1 t and 1 u when two letters picked without replacement from eeeuuettue? 2/15 Four letters picked without replacement from smsmssqsssssq. What is prob of picking 3 s and 1 q? 168/715 Two letters picked without replacement from {f: 2, m: 3, l: 1, c: 4, w: 1}. Give prob of picking 1 w and 1 c. 4/55 Two letters picked without replacement from wwwsnqqsnnswwwnwnnw. Give prob of picking 1 n and 1 s. 2/19 Calculate prob of picking 3 f and 1 c when four letters picked without replacement from {f: 7, c: 9}. 9/52 Calculate prob of picking 3 h when three letters picked without replacement from {h: 3, v: 12, u: 2}. 1/680 Two letters picked without replacement from nnssjsnnjnnjsnjjj. What is prob of picking 2 s? 3/68 Three letters picked without replacement from nztzzntzt. What is prob of picking 1 n and 2 z? 1/7 Two letters picked without replacement from {k: 1, o: 1, d: 1, h: 1, n: 2, p: 2}. What is prob of picking 1 h and 1 o? 1/28 Calculate prob of picking 3 v when three letters picked without replacement from vvvggcqqvvxqqgt. 2/91 What is prob of picking 2 h, 1 q, and 1 j when four letters picked without replacement from wwqqjhtwwjwwhthwqa? 1/170 What is prob of picking 2 v when two letters picked without replacement from ivvdkrm? 1/21 Three letters picked without replacement from gejsgsgsgsv. What is prob of picking 2 g and 1 v? 2/55 Three letters picked without replacement from {o: 6, j: 7, d: 4}. Give prob of picking 2 j and 1 d. 21/170 Calculate prob of picking 1 l and 1 i when two letters picked without replacement from {i: 5, d: 2, l: 1, k: 11}. 5/171 Two letters picked without replacement from oroobpb. What is prob of picking 1 p and 1 r? 1/21 Calculate prob of picking 1 d and 1 f when two letters picked without replacement from {j: 3, d: 4, f: 2}. 2/9 Three letters picked without replacement from {u: 3, r: 9, y: 3, s: 2, g: 2}. What is prob of picking 2 s and 1 r? 3/323 Three letters picked without replacement from {o: 4, d: 14}. What is prob of picking 3 d? 91/204 Calculate prob of picking 1 s and 1 g when two letters picked without replacement from oesewsg. 2/21 Two letters picked without replacement from pspsppp. What is prob of picking 2 p? 10/21 Two letters picked without replacement from {x: 2, k: 7, m: 1, g: 1, b: 3}. Give prob of picking 2 b. 3/91 What is prob of picking 2 r when two letters picked without replacement from ororrrooorrr? 7/22 Two letters picked without replacement from kmkdfif. What is prob of picking 1 i and 1 k? 2/21 Three letters picked without replacement from {w: 2, n: 1, o: 1, m: 2}. What is prob of picking 1 o, 1 w, and 1 n? 1/10 Four letters picked without replacement from {a: 2, k: 5, w: 2, e: 3}. What is prob	{ "pile_set_name": "DM Mathematics" }
1 a What is the biggest value in -46, -2/9, 3, -5, -3? 3 Which is the fourth biggest value? (a) -128 (b) 2/9 (c) -0.4 (d) 0.4 a What is the fifth smallest value in -4/3, -11, 4, 0, -3/8? 4 What is the biggest value in 0.1, 0.2, -98? 0.2 Which is the second biggest value? (a) -7 (b) -0.2 (c) -33 a Which is the biggest value? (a) -1.5 (b) 7 (c) -3 b What is the smallest value in -2/5, 0.3, -37, 1.3? -37 Which is the fourth biggest value? (a) -1/12 (b) 11/4 (c) -4 (d) 0.2 c Which is the third smallest value? (a) 1/6 (b) 16 (c) 3 (d) 2 c What is the second smallest value in 0.2, 2/143, 0.07? 0.07 What is the biggest value in 4, -4, 2/19, -42? 4 Which is the biggest value? (a) -14 (b) 4 (c) -6 (d) -5 (e) -0.4 b What is the fourth biggest value in 5, -0.7, 10, 2/15? -0.7 What is the third biggest value in -63, -0.06, -2/5, 3? -2/5 Which is the second biggest value? (a) -1/5 (b) -1/2 (c) 6/5 a Which is the fourth smallest value? (a) 0 (b) -2/7 (c) -4/9 (d) 0.03 (e) -47 a Which is the second smallest value? (a) -0.03 (b) -1 (c) -0.01 (d) 0.2 a Which is the biggest value? (a) 3 (b) 1 (c) -2 (d) -5 a What is the third biggest value in 51, 4, -213? -213 What is the smallest value in 4, 3/2, 8, 0.2? 0.2 What is the fifth smallest value in -0.5, 4, 1/3, -5, 65? 65 What is the second smallest value in -0.2, 23, -2? -0.2 What is the fourth biggest value in 1, -1/9, 4, -0.2? -0.2 Which is the fourth smallest value? (a) -2/11 (b) 1 (c) 4/27 (d) 5 d Which is the fourth smallest value? (a) 0.3 (b) 0 (c) 0.29 (d) -5 (e) 2/13 c What is the third smallest value in -5, 5, -58? 5 Which is the smallest value? (a) -0.2 (b) -2 (c) -2573 c Which is the second smallest value? (a) 0.2 (b) -5 (c) 1 (d) 2/19 d Which is the second smallest value? (a) -4 (b) 30 (c) 0.7 c What is the second biggest value in -16, -0.033, 0.1? -0.033 Which is the fourth biggest value? (a) -5 (b) 2/325 (c) 0.1 (d) -3 a What is the second biggest value in -5, 5, 2/13, -1.2? 2/13 What is the third biggest value in 0, 7, 1/5? 0 Which is the second biggest value? (a) -1.3 (b) 7 (c) 2/7 (d) 5 d Which is the third smallest value? (a) 2/9 (b) 0.2 (c) 6/55 (d) 5 a Which is the biggest value? (a) -105 (b) -3 (c) -1 c What is the third smallest value in 64, 0.1, 0.62? 64 Which is the third biggest value? (a) 0 (b) -2/5 (c) 16 (d) -2 b What is the fourth smallest value in -22, -3, 2/3, 35? 35 What is the fourth smallest value in 1/2, 1/3, 5, 9? 9 What is the second biggest value in -5, -10/3, 0, 1? 0 What is the third biggest value in -2, -92, -38? -92 Which is the fourth smallest value? (a) 3 (b) 7/54 (c) 1/9 (d) 2 a Which is the second smallest value? (a) -4/13 (b) -0.2 (c) -4 a Which is the second smallest value? (a) 1/2 (b) -0.5 (c) -2/7 (d) -3/2 b Which is the second smallest value? (a) 0 (b) 10 (c) 52 (d) 5 (e) 0.2 e What is the biggest value in 13, 0.2, -3? 13 Which is the biggest value? (a) 3/10 (b) -1/6 (c) 5 (d) -2 (e) 1/2 c Which is the smallest value? (a) 0.04 (b) 1/109 (c) 1 b Which is the biggest value? (a) 0.28 (b) 3/4 (c) -2/11 (d) -3 b Which is the second smallest value? (a) -1 (b) 1/2 (c) -0.41 c Which is the second smallest value? (a) 2.1 (b) -1 (c) 3/8 (d) -16 (e) -3 e What is the biggest value in -0.5, 0, 1/5, 92? 92 What is the second smallest value in -0.14, -4/5, -14, -3/4? -4/5 What is the biggest value in 5/3, -7.2, 5, 0.4? 5 What is the third biggest value in -32, -7, 2? -32 What is the second biggest value in -111, 2/9, 0.1, -2/3? 0.1 Which is the fifth biggest value? (a) -0.7 (b) 0.5 (c) -4 (d) 0.4 (e) -3 c Which is the second biggest value? (a) 0.1 (b) -5 (c) -33 (d) 0 d Which is the smallest value? (a) 2 (b) -1 (c) -5 (d) -14 d Which is the fourth smallest value? (a) -5 (b) 0 (c) 5 (d) 0.14 c What is the third smallest value in 2, 1/8, -17, 0.3? 0.3 What is the fourth smallest value in -1.5, 6, 1/3, -5, -0.4? 1/3 Which is the fourth biggest value? (a) 6/5 (b) 3 (c) -2/7 (d) 88 (e) -11 c Which is the second biggest value? (a) 2/9 (b) -5 (c) 1.1 (d) -2/3 a What is the second biggest value in 38, -0.3, -1/4? -1/4 What is the smallest value in 4, -11/4, 23/5? -11/4 Which is the smallest value? (a) -2 (b) 1 (c) -0.1 (d) 0.06 a What is the biggest value in 217/78, 0.2, -1? 217/78 Which is the second smallest value? (a) -0.03 (b) -11 (c) 0 a Which is the second smallest value? (a) -2/7 (b) 0.1 (c) 3 b What is the smallest value in -0.2, -563, 1.1? -563 Which is the second biggest value? (a) -5 (b) 3 (c) 0.1 (d) 18 b Which is the biggest value? (a) 0.041 (b) -2 (c) 0 (d) 2/5 (e) 5 e What is the third smallest value in 4, 0.2, 12? 12 What is the smallest value in 22, -2, -7? -7 What is the third smallest value in 21, 0.4, 1.6, 4? 4 Which is the second smallest value? (a) -67 (b) 3 (c) -0.2 c Which is the biggest value? (a) 4 (b) -2 (c) -199 a Which is the third smallest value? (a) -4 (b) 9 (c) 3 b Which is the smallest value? (a) 1.1 (b) -10 (c) -4 b What is the second smallest value in -0.09, 5, -5.6? -0.09 What is the biggest value in 5, 54, -0.2, -0.4? 54 Which is the fourth biggest value? (a) -0.1 (b) 2/9 (c) 2/15 (d) 0.43 (e) -2/23 e What is the second smallest value in 0, -273, -2/13, 2? -2/13 Which is the biggest value? (a) 1 (b) -2/5 (c) 4 (d) -204 c Which is the smallest value? (a) -1 (b) -2/3 (c) 128 (d) 0.1 a Which is the third biggest value? (a) -3/11 (b) 1/5 (c) -16 (d) 3 a Which is the fourth smallest value? (a) -552 (b) -0.5 (c) 1/5 (d) 15 d Which is the second biggest value? (a) -1/2 (b) -25 (c) 0.2 (d) 3 c Which is the third biggest value? (a) -0.4 (b) 4 (c) -1 (d) 12 (e) 0.3 e Which is the third smallest value? (a) 0.5 (b) 132 (c) 0.23 b What is the third smallest value in 5, -3, 3/4, -1/6, -1/52? -1/52 What is the third smallest value in -3/2, -105, -0.2? -0.2 What is the second biggest value in -0.5, 3, -1/8? -1/8 What is the fourth smallest value in 3/4, 3, -5, -3.5? 3 Which is the second smallest value? (a) 2/11 (b) -1/5 (c) 5 (d) -0.02 d Which is the smallest value? (a) 1 (b) 0.1 (c) -3/5 (d) -20 (e) 0.3 d What is the third biggest value in -20, -0.5, -16? -20 Which is the second biggest value? (a) -1/6 (b) -0.153 (c) 3 b What is the fourth biggest value in -0.5, 12, -5, 2/5? -5 Which is the second biggest value? (a) -12 (b) 0.4 (c) 28 (d) -0.1 (e) 0.5 e What is the third biggest value in -1, 0.3, 14, -0.85? -0.85 Which is the biggest value? (a) -0.4 (b) 11/4 (c) -0.12 (d) 1/6 b Which is the biggest value? (a) -0.11 (b) 1/4 (c) -1/3 (d) -2 b What is the biggest value in 0.2, -1, 0.4? 0.4 What is the third biggest value in -5, -2, 1/2, 6/13? -2 Which is the second biggest value? (a) -0.43 (b) -3 (c) 0.5 a Which is the second smallest value? (a) 4 (b) -124 (c) 0 c Which is the second smallest value? (a) -0.5 (b) -0.61 (c) -2 b What is the fourth smallest value in -0.1, 0.5, -23, 0.1? 0.5 What is the fourth smallest value in 4, -97, 1/14, -2? 4 Which is the smallest value? (a) -6 (b) -3/5 (c) -5/6 (d) -15 d What is the smallest value in -0.1, -318, -2? -318 What is the fifth biggest value in 0, -4, -9, -1, -0.08? -9 Which is the second biggest value? (a) 2/3 (b) 0.7 (c) 2/9 (d) -20 a Which is the third biggest value? (a) 0.2 (b) 0 (c) -5 (d) -3/7 d What is the third smallest value in -3, -5, 3.8, 1? 1 Which is the smallest value? (a) 5 (b) -4/9 (c) -2 (d) 65 (e) -0.4 c Which is the smallest value? (a) 0.2 (b) 60 (c) 2 (d) -4 d What is the fourth smallest value in -7, -2/3, 5, 0.5? 5 What is the biggest value in -1/2, -5, -2, 2/9? 2/9 What is the biggest value in 0.07, 180, 0.5? 180 What is the fourth smallest value in 2, 0.01, -15/2, 8? 8 Which is the smallest value? (a) -1/4 (b) 0.072 (c) -1 c Which is the biggest value? (a) 2/17 (b) 1320 (c) 12 b What is the fifth smallest value in -0.3, 4/3, -1, 12, 12/11? 12 Which is the fourth biggest value? (a) -8 (b) 1 (c) -0.2 (d) 2/27 (e) -4 e What is the second biggest value in 0.015, 2, 1? 1 Which is the third biggest value? (a) -3.4 (b) 22 (c) -0.4 a	{ "pile_set_name": "DM Mathematics" }
-8602. Let m = a - -1635. Is m prime? True Let d(h) be the third derivative of 4h2 + 0h + 191/6h3 + 1/24h*4 + 0. Is d(0) composite? False Suppose 80o = 72o + 6920. Is o prime? False Let o = -35 - -36. Is -2 + 256 + o + 2 a prime number? True Suppose -p + 7 = 2o - 2p, 3o - 13 = 4p. Let l(c) = o - c2 - 2c*2 + 2c*2 + c - 3c2 + c3. Is l(7) a composite number? False Suppose 4w = 5 + 3. Suppose -2t = -4u - 566, -t = -wt - 3u + 293. Is t a prime number? False Let k = 1 + 1. Let i(z) = z2 - 3z + 1. Let t be i(k). Let r(q) = -293q3 + q2 + q. Is r(t) prime? True Is 2 + 1314 + (-24)/(-8) a prime number? True Let z = 74 + -26. Let y = z - 83. Let v = -20 - y. Is v composite? True Is 11056210/176 - (21/8)/7 a composite number? False Let g(f) = -67f + 12. Let h be g(-3). Suppose i = h + 374. Is i a prime number? True Let v(p) = 12833p + 117. Is v(4) composite? False Suppose 0 = 25g - 29g + 28004. Is g a prime number? True Let r be 1 + -1 + 441/7. Suppose 5p - 1018 + r = 0. Is p a composite number? False Suppose -3o + 4o = 0. Suppose -12v + 51 - 3 = 0. Suppose o = -0f - vf + 372. Is f composite? True Let w be (15/9)/(32/18). Is 26/(1 + 6w/(-34)) a composite number? True Suppose 16y - 13y - 6 = 0. Suppose 3h - 400 - 441 = -5t, yt = 3h - 869. Is h composite? True Let k = 29228 + -15733. Is k prime? False Let o(y) = -48y*3 - 3y*2 + 5y - 3. Is o(-5) a prime number? True Let i = 42 - 21. Let t(x) = -8x2 + ix*2 + 0x + 3x - 5x - 1. Is t(-2) composite? True Let g = 53 - 53. Suppose -4l + 4m = -556, gl + 286 = 2l + 2m. Is l composite? True Let z(c) = 787c*2 - 2c - 2. Is z(-1) a prime number? True Suppose -2n + 4u + 609 = -1137, 0 = n + 2u - 885. Is n composite? True Is (-71538)/(-21) - (-9)/21 composite? False Suppose -4o + 2o = 0, 0 = -4c + 3o + 3624. Suppose u + 0u - 611 = 2p, 3p = -2u - c. Let v = p + 431. Is v a prime number? True Let j be 2/(5/(-45)-6). Suppose -7m = -jm - 348. Is m composite? True Let g(l) = l*2 + 9l - 8. Let s be g(-10). Is 143 + 4(s + -3) a composite number? False Let a = -499 - -54. Let f = 295 + a. Let w = -67 - f. Is w a composite number? False Let y(r) = -r3 - 23r*2 - 9r + 34. Is y(-25) a composite number? True Let r = -291 + 1606. Is r a composite number? True Suppose 179953 - 12004 = 9z. Is z composite? False Is 2/(4/(13820/(-17265)) - -5) a composite number? False Suppose 13 = 8y - 35. Suppose 2f = 5d + 1836, yf - 5f - d - 915 = 0. Is f a prime number? False Let g(d) = -3d + 11. Let a be g(2). Is (-19 - 1)/a - -115 prime? False Let d(v) = 2v*3 - 5 + 8v + v*2 + 0v*2 - 3v*3 - 2v. Suppose 0 = -3j + 1 - 16. Is d(j) a prime number? False Let a(m) = 34m + 1. Let s(w) = 3w2 + 5w + 4. Let d be s(-3). Let z = d - 7. Is a(z) composite? False Let a(r) = 101r3 + r2 - 4r + 3. Let n be a(2). Let t = n - 358. Is t prime? True Let a(o) = o3 - o2 - 6o - 7. Let q be a(-3). Let v = q + 23. Is ((-183)/9)/(v/42) a composite number? True Let k be (28/(-6))/((-8)/12). Let x(j) = -j + 7. Let t(v) = -v + 8. Let i(s) = 7t(s) - 6x(s). Is i(k) a prime number? True Let k(s) = 12s*2 - 4s*2 + 4s + 6 - 3s. Is k(-7) a prime number? False Let o be 10/(-6)(4 - 7). Let d(y) = -y*3 + 6y*2 - 3y - 1. Let j be d(o). Is 1182/9 + (-3)/j a composite number? False Let u be ((-16)/10)/((-2)/5). Let a = -8 + u. Is ((-14)/(-4))/(a/(-136)) a prime number? False Let t(s) = 13s3 - 5s*2 + 6s + 8. Let i be t(6). Suppose -5v = -3v + 5q - 1803, q = -3v + i. Is v prime? False Let d(n) = 2n2 - 4n - 1. Let m be d(-6). Suppose -7h = -8h + m. Is h a composite number? True Let h(v) = -v*3 - 8v*2 - 9v - 8. Let t be h(-7). Let z = 79 - t. Let o = 162 - z. Is o a prime number? True Let h(a) be the third derivative of -115a6/12 + a5/60 + a4/12 + a3/3 - 27a*2. Is h(-1) a prime number? True Let k(o) be the second derivative of 17o*4/4 - 2o*3/3 - 3o*2/2 - 6o. Is k(4) a prime number? True Suppose 38u - 29u = 3780. Let f be 86/18 + 6/27. Suppose 2k - v = 124 + 59, 5v - u = -fk. Is k a prime number? True Let i be 13/1316-1. Let u = i + 49. Is u a prime number? False Let j be -1(-1)/((-2)/(-16)4). Suppose -1424 - 494 = -jm. Is m a composite number? True Let y be (-196)/(5/((-20)/4)). Let v(t) = 2t - 1. Let m be v(2). Suppose y = 4x - 2d - md, x = d + 49. Is x a prime number? False Let c be ((-3)/(-6))/((-2)/(-12)). Suppose b - c = 0, d - 2d - 5b = -648. Is d prime? False Suppose -62950 = -1810a + 1800a. Is a a composite number? True Let h(u) = u*2 - 7. Let t be h(3). Let i = -3 + 5. Suppose -iv = tv - 344. Is v composite? True Let z(r) = 86r - 15. Let t be (5 - 9) + 38/1. Suppose 5s - t = 4d - 6, -d + 3 = 0. Is z(s) a composite number? False Let o(c) = -6c - 10. Let i be (-1)/3 - (-21)/9. Suppose 2d - ij = 3j - 31, -3d - 27 = -j. Is o(d) prime? False Let k(r) = 2r - 22. Let t be k(13). Suppose -38 = tg - 114. Is g composite? False Suppose 0 = 4f - f - 5z + 5, 0 = -5f - 3z - 31. Let x(m) = 17m*2 - 18m - 10. Is x(f) a prime number? False Let h(n) be the first derivative of -n*2 + n - 1. Let l be h(3). Let t(x) = 10x*2 + 12x + 1. Is t(l) composite? False Let i = 185 + -353. Is (-2)/(-7) - 51528/i composite? False Is (-2)/9 + 2415622/342 a prime number? False Let k be 9/3 - (4 - 3). Let l be (8/12)/(k/6). Suppose p + 144 = 4v, -lp = -5v + 194 - 11. Is v a composite number? True Suppose -7v = -128 - 89. Is v composite? False Suppose 8q + 36900 = -18988. Is (-23)/5 + 5 - q/10 composite? True Suppose 5b + y = 2b + 2302, -3y - 764 = -b. Is b a composite number? True Let b be (-1 - 0/2)-5. Suppose bo - 7 = 4o. Is (-161 - 2)/(o/(-7)) a prime number? True Let k = -6 + 8. Suppose -5f + 0q + kq = 773, -f + 4q = 169. Let n = f - -218. Is n composite? True Suppose 3z = 4r - 1, 4r - 2z + 7z + 23 = 0. Let g(o) = 341o2 - o - 3. Is g(r) composite? True Let a(u) = 9u*2 + 5u - 2. Suppose 0 = 4z - 4b + 12, -2z - 5b - 55 = 3z. Let l be a(z). Let q = 615 - l. Is q a composite number? False Let v = -49 - -33. Let r be 3 - v18/3. Let o = 190 - r. Is o a composite number? True Is 42/7 - (-6 - 14959) composite? True Let q(k) = 2k2 - 55k + 190. Is q(43) a prime number? True Let p be 12/6 + (0 - -1). Suppose -pd + 4567 = 1306. Is d composite? False Is -17 + (-224)/(-16) - 16506/(-1) a composite number? True Let q(s) = -7s + 4. Suppose -36 = 4o - 3b, -2b - 3b = -2o - 32. Let x be (-19)/3 + 4/o. Is q(x) composite? False Suppose 0c + 2h = -2c + 37274, h - 93177 = -5c. Is c a composite number? True Let l be (-11)/22 + 9/2. Suppose 0o + lb = -3o + 17929, 11938 = 2o - b. Is o prime? False Let a = -46674 + 66625. Is a prime? False Suppose l + 19381 = 5h, 5l - 5607 = -h - 1710. Is h a composite number? False Let k be -2 - (-1)/2 - (-69063)/2. Suppose -16t = 3586 - k. Is t a composite number? True Let d(l) = 386l3 - l2 - 2l. Let f be d(-2). Let x = -2033 - f. Is x a prime number? False Let q = -1812 + 3290. Let c = -489 + q. Is c prime? False Let m = -4094 + 9261. Is m a prime number? True Let a(x) = x*3 - 7x*2 + 9x - 10. Let k be a(9). Let z = k + -42. Is z composite? False Let b(i) = 78i2 - 47i - 129. Is b(22) a prime number? False Is 5/(315/1857438) - 1/7 a prime number? True Let k(v) = 2060v - 67. Is k(7) prime? False Let p(q) = 26q*2 + 5q - 57. Let n(j) = -26j2 - 6j + 57. Let r(y) = 3n(y) + 4p(y). Is r(-9) a composite number? True Suppose -r - 3t = -13, -t - 2t - 7 = -4r. Suppose -n - rn + 430 = 0. Is n a prime number? False Suppose 3186 = 4k + 5k. Suppose 0 = t - 5v - k, 3t + v + 4v = 1162. Is t a composite number? False Let s = -3 + 9. Is -3 + s - (-808 + 2) composite? False Let s(a) = -96a3 - a2 - 15a + 5. Is s(-4) a composite number? True Let c(f) = 5f*3 - 2f*2 + 4f - 3. Let l be c(2). Suppose 0x - l = j + 3x, x = -3j - 95. Is 2-1j/2 composite? False Let n(f) = 4f*2 + 8f + 163. Is n(-39) composite? True Suppose 21y - 251478 = -73839. Is y composite? True Suppose 5w + 3090 = -3p + 26907, -5p + w = -39667. Is p a prime number? False Suppose k + 2k + 6 = 0. Let z be -18k/((-4)/(-90)). Suppose -v + 4*	{ "pile_set_name": "DM Mathematics" }
. Let c = 50 + -48. Let f(v) = 3 - 17v + 20v - 4vc + k + 3v*2. Calculate f(4). 1 Let a(j) = 9j2 + j2 - 7j2 + 8j - 14j - 2. Calculate a(5). 43 Let n(o) be the first derivative of o4/4 + 2o*3 - 7o*2/2 + 2o + 212. Give n(-7). 2 Let m(u) be the second derivative of -u7/120 + u6/180 - u*5/120 - 7u*3/3 - 16u. Let i(o) be the second derivative of m(o). Calculate i(1). -6 Let p(q) = q + 5. Let c(l) = -l - 4. Let j = -6 + 11. Let n(d) = jp(d) + 6c(d). What is n(-1)? 2 Let v(l) = 0l2 + 8l*2 + l + 0l*2 - 7l*2 - 1. Let p be 13 + (6 - (2 + 1)). Suppose 4z - u + 8 = 3u, -2z = 2u - p. What is v(z)? 11 Let l(p) = -p + 9. Let n be l(5). Suppose nu = 2f + 2f - 16, -u - 2 = f. Let z(s) be the third derivative of -s4/24 + s3/6 + 18s2. Give z(f). 0 Let z(v) be the first derivative of v - 1 + 1/12v*4 - 5/2v*2 - 5/6v3. Let d(o) be the first derivative of z(o). Give d(5). -5 Let c(j) = -j2 - 5 + 3j2 - 6j + 2j. Let a = 422 - 418. Calculate c(a). 11 Let o(u) = u3 + 4u*2 - 2u - 1. Suppose -8 = 27r - 31r. What is o(r)? 19 Let z(f) = 7f. Let o = 10 + -4. Let r(n) = -n. Let y(x) = or(x) + z(x). Suppose l = -2, 3t - 4 = 5t - l. Determine y(t). -3 Let c be -6 + 7/(-14)6. Let f(q) = q2 + 8q - 16. Give f(c). -7 Let b(l) = -l. Let q be b(2). Suppose 0 = 6a - 24 + 6. Let y(z) = 3z - 2 + 2z - 3z - 2za - 2z*2 - z. What is y(q)? 4 Let l be ((-84)/70)/(-1 + 26/30). Let x be (l/4 + -2)20. Let z(y) = y*2 - 5y + 5. Calculate z(x). 5 Let l(q) = q + 2. Let a(r) = -r*3 + 3r*2 - 7r + 16. Let g be a(3). Determine l(g). -3 Let u(k) = -26k - 3 + 1 + 1. What is u(2)? -53 Let c(b) = -2b*2 - 4b + 3. Let w(r) = -r*2 - r + 1. Let g(f) = -c(f) + w(f). Suppose 0 = 4t - 2t. Suppose t = 4l - l + 12. Determine g(l). 2 Let l(w) = 3 + 21w + 14w - 59w + 23w. Determine l(7). -4 Let u(a) = -3a3 + 3a*2 + 2a + 4. Let h(q) = -4q3 + 3q*2 + 2q + 4. Let d be (9/15)/((-5)/(-25)). Let m(f) = du(f) - 2h(f). Calculate m(3). 10 Let b = -186 + 187. Let d(g) = 12g - 1. Give d(b). 11 Let w(c) be the third derivative of 11/6c*3 + 0 - 7c*2 + 0c + 1/24c4. Suppose 0 = -0u - 2u - 14. Determine w(u). 4 Let x(j) = -14j + 1. Let y(m) = -41m + 3. Let f(u) = -8x(u) + 3y(u). Let v(c) = -11c + 1. Let n(i) = -5f(i) + 6v(i). Determine n(-1). 12 Let o(r) be the third derivative of r4/12 - r3/2 - 129r2. Determine o(-3). -9 Let g(k) = -k - 1. Let t(j) = -6j - 4. Let f(d) = 5g(d) - t(d). Let n(y) = -7y + 16. Let v(i) = -6f(i) - n(i). Determine v(5). -5 Let z = -11 + 18. Let a(b) = zb + 2b + 6 - 3b - 2b2. Let p(r) = -r3 + 21r*2 - 37r + 345. Let w be p(20). Calculate a(w). -14 Let s(x) = -2x - 30. Suppose -4y = 3t + 41, 5y + 10 = 4y - t. What is s(y)? -8 Let y(t) = t3 - 4t*2 - 21t + 4. Let a be y(7). Suppose -ad + 13 - 41 = 0. Let f(q) = q + 5. Calculate f(d). -2 Let m(q) = -q3 - 5q*2 + 10q + 61. Let v be m(-4). Let c(d) = -d*2 + 6d. Calculate c(v). 5 Suppose 15 = 5k, 4y + 3 = 3k + 6. Let o(a) = 5 - ya - 1 - a*2 - 1. Suppose 4f + 5w + 30 = 0, 2w + 7 = -f + w. Determine o(f). -7 Let w(b) = 3b. Let h(a) = 3a + 1. Let y(d) = 3h(d) - 5w(d). What is y(3)? -15 Let h be 1/((-63)/99) + 6/(-14). Let i(x) = 2x2 + 4x + 5. Determine i(h). 5 Let c be 100/(-6)(2 - -4). Let q be (12/(-10))/((-30)/c). Let a = -9 - q. Let b(d) = -d2 - 7d - 4. What is b(a)? 6 Let f(b) = 4b + 1. Suppose -n + 3 = -4j, -j - 1 = 4n + 4. Let u(m) = -8 - 3 - 3 + 2 + 13. Let s(w) = nf(w) + 3u(w). Give s(4). -14 Let d be (-3)/((-3)/(-2)) - (-6 - -2). Let g(f) = -48 - f + df + 57. Give g(0). 9 Suppose -4v = -4i + 39 + 5, 0 = i. Let p = v + 7. Let y(g) = -4g2 - 83 + 82 + 3g*2 - 5g. Calculate y(p). 3 Let i(j) = -11j2 - j - 9. Let w(b) = 14b*2 + 10. Let m(u) = -5i(u) - 4w(u). What is m(7)? -9 Let v(a) = -a3 + 7a*2 - 5a - 6. Let m be 6 + (5 - (-1 + 6)). Determine v(m). 0 Let k(u) = 899 - 893 + 2u - 4u. Determine k(7). -8 Let o = 55 + -31. Let w = o - 18. Let a(b) = 7 + 0 - 6b3 - 4 - 6b*2 + 7b*3. Determine a(w). 3 Suppose 2x = f + 41, -5x + 6f + 109 = 10f. Let a be (x/(-6))/((-14)/28). Let q(b) be the first derivative of -b2/2 + 12b - 1. Determine q(a). 5 Let q(f) = -16f - 177. Let p be q(-11). Let v(s) = -5s*2 + 2s + 1. Give v(p). -6 Let h be 13 + 0 + 3 + 0. Let c(p) = -p*3 - h + 39 + 7p2 - 17. Determine c(7). 6 Let u(c) = c3 + c*2 + 5. Suppose 0 = 3f - f + p + 81, p = -4f - 167. Let i = f - -43. Give u(i). 5 Let z = -2030 + 2029. Let w(f) = 2f - 2. Calculate w(z). -4 Let x(y) = -y2 - y - 1. Let q(r) = r3 - 2r2 - 4. Let p be q(3). Let s(o) = 4o*2 - 2o - 4. Let n(t) = px(t) + s(t). Calculate n(-7). -9 Let i(v) = 7v2 + v3 + 186 - 90 - 86 - 8v. What is i(-8)? 10 Let n(w) be the first derivative of -w3/3 + w2 - 353. Determine n(-2). -8 Suppose -2c + 18 = 4c. Let a(s) = -3s - 1. Let h(w) = 4w + 1. Let n(i) = ca(i) + 2h(i). What is n(-2)? 1 Let n(z) be the third derivative of z5/60 - z4/3 + z3/2 - 52z2. Let t(b) = -b3 - 11b2 - 2b - 16. Let k be t(-11). Determine n(k). -9 Let h(a) = -a3 + a2 + a - 6. Let c be h(0). Let f be 23(-3)/(-9). Let q(s) = -2 - 6s + 0s + 2s2 + 6 - 3sf. Determine q(c). 4 Let h(p) = -p2 - 11p + 3. Let n(l) = -10l*2 - 22l - 21. Let v be n(-1). Give h(v). 21 Let i(z) = z - 7. Let m(a) = 2a + 2 - 15 + 5 - 8. Let y(u) = 5i(u) - 2m(u). What is y(6)? 3 Let b(m) = m + 1. Let z be b(-5). Let p be (6/(-4))/((-2)/z). Let f(g) be the second derivative of g4/12 + g3/6 - 3g*2/2 - 5g. Give f(p). 3 Let r(p) = p*3 + 8p*2 - p - 6. Let s be r(-8). Suppose 36 = y + sy. Let d = -12 + y. Let j(u) = u - 8. Calculate j(d). -8 Let d be 1 - (-1 - -1) - -4. Let s(r) be the second derivative of -1/3r3 + 3/2r*2 + 3r + 0. Give s(d). -7 Let o(n) = 2n3 + 3n*2 - 15n. Let p(q) = -q*3 - 2q*2 + 8q. Let d(j) = 6o(j) + 11p(j). Let m = -91 + 95. What is d(m)? -8 Let w = 9 - 28. Let i = w - -22. Let q(a) = 7a3 + 5a*i - 9a3 + a2 - a. What is q(1)? 3 Suppose 0 = -5r + 3u + 4, -4r + 7r - 3u = 0. Let h(l) = 3l - 3. Calculate h(r). 3 Let o be (10/(-6))/(23/(-207)). Let w be (-4)/(-3) + o/9. Let b(h) = -h*2 + h + 3. What is b(w)? -3 Let h(j) = -2j + 4. Let w be (-2)/(-2 + (-13)/(-6)). Let v = w + 16. Suppose 2g + g + 4 = -o, -vg + 3 = 3o. Determine h(o). -6 Let s(b) = 2b. Suppose 3f - 81 = -114. What is s(f)? -22 Let b(t) = t2 + 4t + 7. Let l(w) = w*3 - 5w*2 - 9w - 6. Let d be l(7). Let r = d - 21. Let o(g) = g*3 - 8g*2 - g + 3. Let s be o(r). Give b(s). 12 Let n = -7 - -7. Suppose j = -n + 6. Let x(a) = -54a*2 + 53a2 - a3 + ja3. What is x(-1)? -6 Suppose 2g - 4t + 24 = 0, -17 = 3g - 3t + 13. Let v = 10 + g. Let p(w) = 3w*3 + 3w*v - 2 + w - 2w*3 + 0w. Calculate p(-2). 0 Let c = -30 + 40. Suppose 102r = 100r - c. Let a(m) = 4 + 4 - m - 6. Give a(r). 7 Let p = -460 + 464. Let r(x) be the third derivative of -4x2 + 0x + 0 - 5/24xp + 1/20x5 - x3 + 1/120x6. Determine r(-4). -2 Let v be (3/(-5))/(48/240). Let g(p) be the first derivative of -p3/3 + p2/2 - 3p - 2. Give g(v). -15 Let g(t) = t*3 + 5t*2 - 2t - 5. Let u be g(-6). Let h = u - -32. Let r(j) = j*3 - 3j*2 - 5j + 2. Give r(h). -13 Let i(x) be the second derivative of 13x - 1/20x*5 - 11/2x*2 + 0 - 1/12x*4 + 1/6x*3. What is i(0)? -11 Let u(s) = 2s*3 - 2s*2 - 4s. Let n(d) = d3 - d2 - d + 1. Let q(a) = 3n(a) - u(a). Let y be 0/((-4 - -3) + -1). Let k = y + 0. Determine q(k). 3 Let w = 279 + -277. Let t(b) be the second derivative of 0 + 6b + 3/2bw - 1/2b*3. Determine t(2). -3 Let o be (5/(-3))/(-1)(-3)/(-1). Let y(h) be the second derivative of -h*3/6 - 3h. Give y(o). -5 Let r be 2/(16/12)2. Suppose ra = 25 + 47. Suppose 4 = -k + 2p, -3k + 5p = a - 11. Let g(o) = o + 1. What is g(k)? -5 Let u(w) = -20w + 8w - 49 - 1. Let n be u(-5). Let d(s) = s3 - 9s*2 - 12s + 13. Give d(n). -7 Suppose -8 = -4h - 12, 0 = 3x + 2h - 4. Let g(s) = 76 - 74 - s3 + 2s*2 + xs + 0s3. Calculate g(3). -1 Suppose 5c = -0c - 4k + 7, 0 = -c - 3k - 3. Let m be 48/120 + 66/10. Let a(i) = 2i + 20. Let j(z) =	{ "pile_set_name": "DM Mathematics" }
) to the form gr + qr*3 + ar*2 + j and give q. 14 Express (3q - 4q + 2q + (-1 - 4 + 3)(-3q + 2q - q) + 5 + 2q - 4 + 3)(4 - 3 - 7) as yq + d and give y. -42 Rearrange -3 + 3n4 + 7n*2 - 15n*2 + 7n*2 to vn*3 + in + mn2 + h + jn*4 and give h. -3 Express (1 + 13s - 9s + 4s)(-3s*2 - 4s*2 + 2s*2) in the form ns*2 + qs + b + cs3 and give q. 0 Express -2k*2 - 1 + 1 + 2k*2 - 14k + 14k + (2 + k - 2)(4k - k - k) + k2 + 2k*2 - 4k*2 + 4 - 4 + 2k*2 as q + nk*2 + fk and give n. 3 Express (-2a4 + 9 + 4a - 4a)(0 + 3 - 1) in the form ja2 + n + va*3 + ya + ga4 and give n. 18 Express 18 - 39 + 21 + 99q in the form aq + r and give a. 99 Rearrange (-2r - r + 2r)(-4 + 1 + 1) + (r + 3r + 8r)(1 + 0 + 3) to nr + h and give n. 50 Express 4n2 + 0n*2 - 7 - 4n2 - n2 as x + rn + in2 and give x. -7 Rearrange -k2 - k*3 + 19k - 42k + 18k to the form z + pk2 + ck*3 + mk and give p. -1 Express -40n2 - 64n*2 + 127n*2 as jn + mn2 + p and give m. 23 Express (-u + u + 6u)(-1 + 4 - 6)(-4u - u + 3u) in the form fu2 + ju + r and give f. 36 Express -2w4 + 2w - 2w3 + 2w*2 - 5w*2 + 0w*4 in the form dw*2 + aw*4 + n + mw + sw3 and give a. -2 Rearrange -21 + 2h*2 + 5h*3 + 24 - 15h*3 to ah + wh3 + nh*2 + t and give t. 3 Express -202i*2 - 1 - i + 99i*2 - 8i*3 + 101i*2 in the form di*2 + li + o + ti3 and give l. -1 Express (0n - 2n - n)(96 - 194 + 97 + 49n) as h + kn + ln2 and give k. 3 Rearrange 6b*2 - 3b*4 - 16b*2 - 5b + 10b2 + b3 to the form jb + cb4 + n + db*2 + ob*3 and give o. 1 Express 8v + 0 + 0 + 0 in the form yv + c and give y. 8 Express z + z - 2z + 24z2 in the form xz + w + qz2 and give q. 24 Express -24q*3 + 20q3 - 6 + 4 + q4 + 0q4 + 3q as sq3 + u + hq*4 + vq*2 + yq and give y. 3 Express -11f2 + 16f*2 + f - 12f*2 as z + gf + vf2 and give g. 1 Rearrange (-2w*2 + 4 - 4)(7w - 1 - 3w - 2w)(-5 - 12 + 1) to the form pw + r + uw*2 + gw*3 and give u. -32 Express (4v - 4v - v2 - 2)(0v - 6v + 2v) as u + hv*2 + iv + gv3 and give u. 0 Express 2 + 2 - 6 - 5n + 2n in the form fn + t and give t. -2 Express -2b - 7b - 2 - 3b + 0 in the form m + vb and give v. -12 Rearrange -4 + 72o3 + o - 73o*3 - 1 + 0 to the form m + no*2 + xo + fo3 and give f. -1 Express -3 + 2l*3 + 11l*2 - 8l*2 + 1 + 2l*4 as jl + ql3 + t + cl*4 + wl*2 and give c. 2 Rearrange -2 - 2 + 2m*2 + 2m*4 - 2m*2 - 2m*3 to the form cm + hm4 + im*3 + y + xm*2 and give i. -2 Express (-51 - 3j + j*4 + 51 + 2j*2)(7 - 3 - 2) in the form o + mj3 + wj + cj2 + pj*4 and give c. 4 Rearrange (-3v + 3v - 2v)(0v2 - v2 + 6v2)(0v - v + 3v) to cv4 + yv*2 + av + q + gv3 and give c. -20 Rearrange -6a + 26a + 3a + 11a to t + na and give n. 34 Rearrange -2 - 374u2 + 377u*2 + 0u + 8u to the form gu*2 + ou + n and give n. -2 Express -4k2 - 5 + 7k*2 - 3k*2 + 3k*3 as u + pk*2 + vk*3 + jk and give p. 0 Express -k*2 + 1615 - 1616 + 2k*2 - 13k in the form gk + a + xk*2 and give g. -13 Rearrange (2 + 2j*2 - 2)(((-3 + 4 - 2)(-1 + 0 + 2) + 0 - 3 + 5 - 1 - 5 + 4)(3 + 4 - 10) - 5 + 3 + 5) to yj + pj*2 + t and give p. 12 Rearrange 15i*3 - 39i*3 + 6i*3 + (-3 + 3 - i)(2i2 - i2 + 0i*2) + 0i + 0i + 2i*3 + 0i + 2i3 + 0i to n + zi2 + wi*3 + ki and give w. -15 Rearrange 4 + 4r3 - 4r*2 - 4 + 15r*2 - 1 to the form ar*2 + sr*3 + xr + u and give a. 11 Rearrange 8 + 2 - 10 - 3w to the form rw + i and give r. -3 Express 70i - 2 - 2i*2 + 2i*4 + 3 - 72i as pi2 + ji + x + ai4 + mi*3 and give a. 2 Rearrange (-2 + 7 - 2)(0 + 2 - 5)(-n + 3n + n) to tn + x and give t. -27 Express y2 + 42 + 4y*2 - 3y*2 - 4y*2 as uy*2 + w + ly and give u. -2 Express 0 - 3 - 2 - 2i3 + 0i*3 in the form yi + di2 + g + bi3 and give b. -2 Rearrange -1 - m2 + 18 + 3m2 to hm + am2 + c and give a. 2 Rearrange d4 - 4d + 3d3 - 2d + 3d to the form pd*2 + a + xd + jd4 + kd3 and give a. 0 Rearrange w2 - 10w2 + 7w*2 + 4 to kw + rw2 + c and give c. 4 Rearrange -8 + 9 - 2p*2 - 4p*3 + p + 3p*3 to the form bp + w + qp3 + xp*2 and give x. -2 Express ((-3 + 3 - 2g)(-1 + 4 - 1) - g - 3g + 3g + g - g + g + g - g - 6g)(-5 + 0 + 4) in the form ag + h and give a. 10 Express -72l2 + 5l - 3l + 71l*2 in the form ul + r + zl2 and give z. -1 Rearrange (3g - 5g + 5g)(-g - 2g + 4g) to t + hg*2 + dg and give h. 3 Express -2j2 - j2 + 5j*2 + (3 + 0 - 5)(-j + j - j*2) + 0j + 3j2 + 0j + (4 - 4 + 2j)(2j + 11 - 11) as n + fj + pj2 and give p. 11 Rearrange (-25 - 10n + 25)(n2 + 0n + 0n) - 5 + 0n*3 + 0n3 + n2 + 2n3 to the form cn*3 + jn + un2 + l and give c. -8 Rearrange 24l - 41 + 41 to the form sl + v and give s. 24 Rearrange 5u*3 + 2u*4 - 17u*2 + 19u*2 + 0u*4 to su + o + tu3 + bu*4 + vu*2 and give b. 2 Rearrange -116d - 1 + 73d - 68d to the form hd + m and give m. -1 Express 3w4 + w4 - 2w4 + 20w*4 + 80w*2 - 80w*2 + (-5w + 2w + 2w)(-2w*3 + 0w + 0w) as nw + jw2 + zw*4 + hw*3 + s and give z. 24 Rearrange (-4 - 2p + 4)(0 - 5 - 1)(1 + 3 - 2) to w + tp and give t. 24 Rearrange 13v + 0 - 13v - 11v - 3 to the form sv + r and give s. -11 Express 6u*2 - 2 - 7u*2 + 8u*2 - 3u*3 as au + nu3 + vu*2 + t and give n. -3 Rearrange -3 - 55t + t*3 - 60t + 108t to ht*2 + nt + qt3 + l and give n. -7 Express (-4s - 26s + 3s)(-2 - 1 + 4) - 2s + 4s - 4s as z + ds and give z. 0 Rearrange 2b*2 - 1 + 5b*3 - 8b*3 - 1 to cb*2 + tb*3 + z + qb and give t. -3 Express (730h3 - 731h*3 + 4h2 + 1 - h2)(3 - 4h - 3) in the form j + lh4 + wh*3 + gh + nh2 and give g. -4 Express 3a*2 + 2 + 4a*2 + 0 - 4a*2 as ca + ra2 + o and give o. 2 Express 725d*2 - 2 - 2d*4 - 725d*2 + d as ld*4 + gd + h + zd2 + vd*3 and give g. 1 Express (1 + b - 1 + (2 + 0 - 3)(0b + 2b - 4b))(3b + b + 4b)(0 + 1 + 6) as lb*2 + ub + z and give l. 168 Rearrange (-2 - 3 + 2)(0h - 35h + h) to ih + j and give j. 0 Express 2i2 - i2 - 3 - 2i*2 - 3i + 4i2 in the form ni + qi2 + r and give q. 3 Rearrange -31l*3 + 5l*3 - 32l*3 + (3l*3 - 5l*3 + 0l*3)(-1 + 3 - 3) to wl3 + gl*2 + nl + c and give w. -56 Rearrange (1 + 1 - 5)((1 - 1 - 1)(-a - 5 + 3 + 1) - 6a + 18 - 18) to ra + j and give j. -3 Express (-t*2 + 7t3 + t2)(1 - 1 - 2) in the form g + wt + it2 + ht*3 and give w. 0 Express (2 - 1 + 0)((10z + 0z - 3z)(3 - 2 + 0) + z + 2z - 4z) as b + pz and give p. 6 Express (4 + b - 4)(-5 + 60 + 24) in the form zb + d and give z. 79 Rearrange (-11 + 7 - 12)(-n - 2n + n + (-4n + n + 2n)(4 - 5 + 3) - n - n + n - 4n + n + n) to k + fn and give f. 112 Express 513y3 + 1 + y2 - 2y - 3y4 - 2 - 513y*3 as k + jy*3 + zy + dy2 + uy*4 and give d. 1 Express -1 - 7x - 3x3 - 2x*3 + 7x*3 in the form mx*2 + ix*3 + hx + p and give i. 2 Express (4r + 8r - 5r)(2 + 4 - 1) as xr + j and give x. 35 Rearrange -5 - 4 - 11t*2 + 11 to yt + l + dt2 and give d. -11 Express 5k3 - k4 - 2k - 4 - 1 + 3 + 5k*2 - 3k*3 in the form lk + mk4 + gk*3 + r + ok*2 and give g. 2 Rearrange (11g*2 - 34 + 61 - 28 - 3g)(-2 - 3 + 4) to s + mg + jg2 and give m. 3 Rearrange (11o*2 - 88 - 6o*4 + 94 + 7o*4)(-5 + 4 + 0) to wo3 + v + po + go4 + io*2 and give v. -6 Rearrange 2p - 10p + 49p + 31p to r + dp and give r. 0 Express -17 + 17 + 14k + 31k in the form gk + r and give g. 45 Express -3w3 - w2 + 14w4 - 6w*4 - 6w*4 as hw*3 + gw*4 + cw + lw2 + j and give g. 2 Rearrange -3i3 - i4 - 2i2 + 0i*4 + 5i*3 - 2 + 3i*2 to the form ui + li4 + p + oi*3 + hi*2 and give h. 1 Express (-2h + 2h - 2h)(-4h + h + 0h)(1 - 7 + 1) as nh + rh*2 + s and give r. -30 Rearrange 5481u - 5481u + 104u*2 to the form qu*2 + gu + i and give	{ "pile_set_name": "DM Mathematics" }
108 (e) -1/4 c What is the closest to 0 in 372, -4/7, -1, 3.21? -4/7 Which is the nearest to -2? (a) -5 (b) -0.2 (c) 5209.986 b Which is the closest to 3412? (a) -1/9 (b) -0.5 (c) 2 (d) 3/2 (e) 130 e Which is the nearest to 0.1? (a) 1 (b) -7 (c) -755378 a What is the nearest to 1 in -0.04, -0.3, -0.5, -24, -1/741? -1/741 Which is the nearest to 3? (a) 679 (b) 29 (c) -2 (d) -5 (e) 0.12 e What is the closest to 0.35 in 7, -3, 87/25? 87/25 Which is the nearest to -18? (a) -7 (b) -0.55 (c) -0.4 (d) -3 (e) 0.2 (f) -3/23 a What is the closest to -1/3 in 3, -5, 0.22, 117, 1/2? 0.22 Which is the nearest to -2/7? (a) 0 (b) -4 (c) -2 (d) -3 (e) -343 a Which is the nearest to 13? (a) 7 (b) -35.1 (c) 2 (d) -1/8 a Which is the nearest to 2.4? (a) -0.5 (b) 0 (c) -86.27 b What is the closest to 1/13 in -0.11, 4, 0, -1/88, -5, 4/11? 0 What is the nearest to 0 in -994, -1/481, 4, -3/4, -5? -1/481 Which is the nearest to 145486? (a) -3 (b) -10 (c) 0.2 c Which is the nearest to -31114? (a) -3 (b) -2/7 (c) -0.2 (d) -22 d Which is the nearest to 195252? (a) 0.3 (b) -4 (c) 1/4 (d) 3 (e) 0.4 d What is the closest to 0.098 in 3/17, -1, 1/4, -17, 0.4? 3/17 Which is the closest to 0.1? (a) 0.052 (b) 0.4 (c) 2/25 (d) 33 (e) -4 c Which is the closest to 0.2? (a) -0.1956 (b) 0 (c) 0.021 (d) -1/2 c What is the nearest to -61 in -3, -20, 18? -20 Which is the closest to -21010? (a) -2/15 (b) 3 (c) -53 (d) 0 c Which is the closest to 1? (a) 0.2 (b) -0.69 (c) -101 (d) -7 a Which is the closest to -1? (a) -135 (b) 3 (c) 22692 b What is the closest to 1 in -16040, -16/9, 1? 1 What is the nearest to -3 in 2, 1.69, 12, -0.21, 3/14? -0.21 What is the closest to 0.2 in -45, 282/7, -26, 1/2? 1/2 Which is the nearest to 1318/9? (a) -0.05 (b) -2/13 (c) -0.025 c What is the closest to -1 in 135, -6, 3/8, -1, 13/3? -1 What is the closest to -41350 in 2/21, -5, 1066? -5 What is the nearest to 8 in 1/4, 1, -430, -0.8, -2.1? 1 Which is the closest to -1/7? (a) -2812 (b) -5 (c) -0.06 c Which is the nearest to 2/9? (a) -0.27 (b) -0.4 (c) -4/7 (d) 4 (e) -1.9 a What is the closest to -0.0616 in -3/28, 14, -2/21? -2/21 What is the closest to -0.7 in -1/4, -2/25, 2.466? -1/4 What is the closest to 1/11 in -45, 5, 488/5? 5 What is the closest to -1/3 in 947.4, -4.35, 4? -4.35 Which is the nearest to -0.04? (a) -1 (b) -9 (c) -0.3 (d) 10566 (e) 3/26 e Which is the nearest to 1? (a) -505 (b) -186 (c) 18 (d) 4 d Which is the nearest to 40? (a) 4 (b) 1/2 (c) -1/367 (d) 9 d What is the closest to 2/3 in 1240, 29, 5, -2, 1/4? 1/4 What is the closest to 0 in -19, 4/9, -7/118, 4/3, -5? -7/118 What is the nearest to 252 in 11, -2/13, -1/5, 2/5, -122? 11 Which is the closest to -2? (a) -5 (b) -0.06 (c) 328 (d) 10 b What is the nearest to 1/3 in 5/6, -153, 1/2, 0.18, -4? 0.18 What is the closest to -88416 in -5, -9, 0.4, 5? -9 What is the closest to -2 in 3.5, -692, -5/3, 8? -5/3 Which is the nearest to 8? (a) -1580 (b) 0.0536 (c) 3 c What is the nearest to -2/2529 in 27/32, -0.1, -1/3? -0.1 Which is the closest to 23? (a) 51 (b) -0.4 (c) 5 (d) 1/7 (e) -11 c What is the closest to -99 in 0.26, -0.1, 1/50, 4, -0.024? -0.1 What is the nearest to 5 in 0.289, 1, -1/5, -9, 1/247? 1 Which is the nearest to 94? (a) -5 (b) 3/55 (c) -2/5 (d) -10 (e) -11 b Which is the nearest to 1/2? (a) -89 (b) 2 (c) 316 (d) -0.1 (e) -3/11 d Which is the nearest to -8? (a) -2/5 (b) -6 (c) 821725 b Which is the nearest to -0.2? (a) 3 (b) -8 (c) 22115.6 a What is the nearest to -0.1 in 1/5578, 2/3, 0.3, 36, -1/5? -1/5 What is the nearest to -0.1 in 0.41, -297/5, -4? 0.41 Which is the closest to 44.7? (a) 2/5 (b) 3 (c) 3/7 (d) 0.1 (e) -29 b What is the closest to -6 in -3, -38032, 24? -3 What is the nearest to -10 in 55, -1/12, 2/7, 1893? -1/12 What is the closest to 0.096 in 0.3, -2.9, -1, -7, -0.4? 0.3 Which is the closest to -31? (a) 0 (b) -3 (c) 0.1 (d) 20 (e) -25 (f) 0.5 e What is the nearest to 13 in -4, -0.5, -3, 10813? -0.5 What is the closest to -2 in 4, -3, 2/13, -48/5, -17? -3 What is the nearest to -1/3 in -0.2, 512, 2, -164? -0.2 Which is the nearest to -13? (a) -0.08 (b) -2 (c) -1/131 (d) 22 (e) -1/6 b What is the closest to -0.00895 in 0, 189, 3/14? 0 Which is the nearest to -0.36? (a) -5 (b) 0.08 (c) 93.18 (d) -0.5 d What is the closest to 0.1 in 1863, -0.2, 1/838? 1/838 What is the nearest to -2278 in -0.5, 0.2, 520? -0.5 What is the nearest to -1/2 in 0.1, 346, -2/17, -0.13, 3/7? -0.13 What is the nearest to -1 in -16, 59, 15/34? 15/34 Which is the nearest to 12.3? (a) -193 (b) -2 (c) 1/4 (d) 10/3 (e) -3 d What is the closest to 2.22 in -0.4, 3/11, -136, -1/18, -5? 3/11 Which is the nearest to -187? (a) -292 (b) 14 (c) -3 (d) 0 a Which is the nearest to -0.123? (a) -1/6 (b) -107 (c) 0.4 (d) 1 (e) -95 a What is the closest to -3442 in 1, 0.025, -8/5, 1/6? -8/5 What is the nearest to 40684 in -1.5, -2/3, 1? 1 Which is the nearest to 1/21? (a) -175 (b) -0.2 (c) 42 b Which is the closest to -0.07? (a) 70/43 (b) 1.31 (c) -1/4 (d) -2 c Which is the nearest to 1971.1? (a) 5 (b) 0.1 (c) 2 (d) -2/9 a What is the closest to -1 in 17, -1/5, -0.1986, 18, 0, -3? -1/5 Which is the nearest to 2/141? (a) -71/22 (b) 0.4 (c) -33 (d) 4 b Which is the nearest to 10? (a) 12 (b) 32.6 (c) 0 (d) -1/5 (e) 5 a What is the nearest to 1/4 in -1413, 2, -2/5, 1/4, 208.5? 1/4 Which is the nearest to 13? (a) -1.23 (b) -2/13 (c) -2 (d) 2 (e) 1 d Which is the closest to 11? (a) -0.3 (b) -27 (c) 0.2 (d) 17.65 (e) 3 d What is the closest to 395 in 1/22, -0.8, -18? 1/22 What is the closest to 0 in -36, -2, -4, -3/19, -245? -3/19 What is the closest to -1/2 in 0.2, -155/12, -0.05, 2/3, -5, -0.338? -0.338 What is the nearest to -93 in 0.3, -3/2, 79, 0.1, 17, -5? -5 Which is the nearest to 746? (a) 4 (b) -2003 (c) -1/23 a What is the closest to 423 in 2478, -0.1, 3/7? 3/7 What is the closest to 1/6 in 2/17, -1/3, 2/1090631? 2/17 What is the nearest to 55/26 in -28, 0.3, 23, -1? 0.3 What is the nearest to 1/4 in -523, -2, 0, -7/32? 0 Which is the nearest to 4? (a) 7 (b) -5 (c) -4 (d) -13 (e) 1.29 e Which is the nearest to 0.8? (a) -5 (b) -2/11 (c) 68068 b Which is the closest to 2/5? (a) 0.1281 (b) 0.06 (c) 1 (d) -59 (e) 0.5 (f) 2/11 e What is the closest to 2/7 in 20, 0.5, 0.4, -0.2, 2030? 0.4 Which is the closest to 592? (a) 0 (b) 1/3 (c) 18 (d) -3 (e) -7 (f) -10 c Which is the nearest to 2? (a) 0.7 (b) -2/15 (c) 3.7 (d) 116 (e) -45 (f) 1 f Which is the closest to -1? (a) -0.4 (b) -44 (c) -0.27 (d) 19/24 a Which is the nearest to 0.56? (a) 789.85 (b) -2 (c) 5 (d) -4 (e) -0.4 e Which is the closest to -2/7? (a) -491 (b) 2/3 (c) -724 b What is the nearest to -85.882 in 2/17, 3/2, 14? 2/17 Which is the nearest to -18? (a) 5 (b) -9/73 (c) 0.2 b Which is the nearest to 0.096? (a) -4 (b) -5 (c) 0.18 (d) -11.5 c What is the closest to -0.05 in 26, 16, -3, 8.4, 13? -3 Which is the closest to -57? (a) 6/9817 (b) 1 (c) -4 c Which is the nearest to 2? (a) -118 (b) 2 (c) -151142 b What is the nearest to 1.2 in 7, -168/11, -3, 2, 0.5? 0.5 What is the nearest to -429 in -0.3, 17/6, 2/13, -3/202, 2? -0.3 Which is the nearest to -1/5? (a) 1.8 (b) -30 (c) -2 (d) 0.1 (e) 60 d Which is the nearest to -1? (a) -66 (b) 0.018 (c) -2/9 (d) 3 (e) 6 c What is the closest to 0.1 in 515.46, 0, -0.03? 0 What is the nearest to -0.41 in 168, 8/9, -5, -2.1, 3? 8/9 Which is the nearest to 0.058565? (a) -5 (b) -0.3 (c) -1/2 (d) 0.03 d Which is the nearest to 4/7? (a) 5 (b) -2/9 (c) -979 (d) -12 b Which is the nearest to 3? (a) 2/9 (b) -226.5 (c) 24 (d) 4 (e) 0.4 (f) 8 d What is the nearest to 121 in -3, 1/3, -88, -0.12? 1/3 Which is the closest to -64/15? (a) 4 (b) 1/110 (c) 0.1 (d) 25 (e) 0 (f) 3 e What is the nearest to -2 in -0.4, -0.02, -1, -2/7, 86/73? -1 What is the closest to 2/3 in -0.4, -3, 12883, 6? -0.4 What is the closest to -1/22 in 0.08, 5, -3514/3, 2/9? 0.08 Which is the closest to -30? (a) 6/6925 (b) 3/7 (c) 0.1 a What is the nearest to -0.04 in -0.4, 12306, 5, 0? 0 Which is the nearest to 0? (a) 15 (b	{ "pile_set_name": "DM Mathematics" }
is the common denominator of 149/18 and (-1)/15-19150/120? 36 Suppose 0 = -8r + 14 + 18. What is the smallest common multiple of 20 and r? 20 Suppose -3r = 3, s - 22 = -4s + 2r. What is the lowest common multiple of 1 and s? 4 Let o = 10 - -23. What is the least common multiple of 24 and o? 264 Suppose -138 = 2d - 18. Let j be d/(-14) + (-4)/14. Calculate the least common multiple of (j/8)/(1/32) and 22. 176 Let h = 23933/2 + -12199. Let c = -283 - h. Calculate the common denominator of 41/7 and c. 14 Let p = 3931/1315831 + 1/2257. Let c = -29729/1166 - p. Calculate the common denominator of c and 71/2. 2 Suppose -6l + 4l + 40 = 0. Suppose 3w - l = 10. Calculate the least common multiple of 6 and w. 30 Let l = 3 - 2. Suppose 4y - 16 = -0y. Suppose 2v + 3u = -y, v - 6v + 3u + 32 = 0. Calculate the lowest common multiple of l and v. 4 Suppose 0 = -3z + 8z - 10. Calculate the least common multiple of z and 164/10 + (-12)/30. 16 Calculate the common denominator of (8/(-36))/((-2)/(-7)) and 1 - 6/(-16)-14. 36 Suppose -6b + b = -245. Suppose 6v = 4x + v - b, v + 11 = x. Let k(c) = -2c + 4. Calculate the lowest common multiple of k(-6) and x. 48 Let h = 1547 - 7762/5. What is the common denominator of h and 48/11? 55 Suppose 352 = 5c - 3b, 2b + 2 = 4c - 280. Suppose 2j - 4 = 5a - 2, -5j + c = 4a. What is the lowest common multiple of 11 and j? 11 Find the common denominator of -1/36 and (-712)/432 + (-3)/6. 108 Suppose x + 2x = 0. Suppose -3h = -0p - 3p + 561, -p - 4h + 177 = x. What is the common denominator of 45/22 and p/42 - (-4)/6? 154 Let z = 25 - 15. Let h = -6 + 10. What is the smallest common multiple of h and z? 20 Let y = -17 + 25. Suppose -4a + 12 = 2r, 3r = r - 5a + 12. Calculate the least common multiple of y and r. 24 Let h = 1451227/240510 - 5/8017. What is the common denominator of -62/15 and h? 30 Let v = -19 - -27. What is the least common multiple of 1 and v? 8 Let s = -2 - -9. Suppose 3 = -2o + 11. Suppose w + ow = 10. What is the lowest common multiple of w and s? 14 Suppose -5z + 2w - 4286 = 0, -5w + 3230 = -4z - 209. Let b be 1011/(-40)z/132. Let y = -1820/11 + b. Calculate the common denominator of y and 113/12. 60 Let o be 4/16 + (-198)/(-8). Suppose -10 = 5z + 4l, 2z - 4 = 5l + o. Let q(h) = 6h*2 - 3h + 2. Calculate the smallest common multiple of q(z) and 20. 20 Let x = 283 + 83. Find the common denominator of -95/4 and (-6)/(x/123 - 2). 20 Calculate the common denominator of (316/50)/((-36)/(-15)) and 139/18. 90 Suppose -o - 3 + 2 = 0. Let j be (5/((-15)/12))/o. Suppose 0 = 2p + 10, a - jp - 9 = 21. Calculate the lowest common multiple of 1 and a. 10 Suppose 0 = -3h - 5f + 67, 3 = -4h - 4f + 87. Let b = h - 11. Calculate the smallest common multiple of b and 3. 24 Suppose 3 = 2m + 7. Let f be ((-1)/m)/((-2)/3111). Let q = -799 - f. What is the common denominator of -17/16 and q? 16 Let v = 1345 + -12083/9. Let t = 13/12 + 461/84. Calculate the common denominator of v and t. 63 Let c = -500807/32 - -15648. Find the common denominator of c and -65/2. 32 What is the common denominator of (-1729)/156 + (-1)/(-3) and 16/37? 148 Let b be (-8)/(2/12-1). Find the common denominator of 75/14 and 4/b261/6. 56 Let g be 2 - (119/(-22) + -2). Let i be 4/(-18) + (-3254)/99. Let r = i - g. Find the common denominator of r and 93/8. 8 Suppose 15 = 5g + 5r - 0r, -5g + 9 = 3r. Suppose 5x - 64 = -z, 2x + 2z = -gx + 32. What is the lowest common multiple of 14 and x? 84 Find the common denominator of ((-8)/(-126))/((-2)/(-48)) and 143/12. 84 Let g be (0 + 1 - 1) + 9. Let d = 19 - 137/8. Find the common denominator of (26/(-6))/((-4)/g) and d. 8 Let r = 79 + -69. What is the least common multiple of r and 14? 70 Suppose u = 2u - 12. What is the smallest common multiple of 27 and u? 108 Let m = -18/5 - -74/15. What is the common denominator of -93/8 and m? 24 Let m = 1772 + -8806/5. Let l = -3 - -1. Find the common denominator of (l/6)/((-30)/(-189)) and m. 10 Let s(l) = 17l*2 + l. Let x(z) = 2z. Calculate the smallest common multiple of x(3) and s(1). 18 Let m(i) = -i*3 + i + 10. Let r be m(0). Let x = 22 - r. What is the smallest common multiple of 16 and x? 48 Let i = 398/145 + -10/29. Find the common denominator of 0 + 1 - (0 - 47) and i. 5 Let m = -74341/18 - -4132. Suppose -3o = 80 + 4. What is the common denominator of 10/o(-113)/(-5) and m? 126 Let x = -9 - 15. Let w = -12 - x. Calculate the lowest common multiple of 12 and w. 12 Let h = 2844 + -25565/9. Let j = 1186 + -8346/7. What is the common denominator of j and h? 63 Let s = 4231 - 6266. Let d = s + 8079/4. Let y = -11664/1345 - 15/538. Calculate the common denominator of d and y. 20 Let r = 187/15 + -64/5. What is the common denominator of r and 71/18? 18 Let m(g) = -g3 + g - 4g*3 + 2 - 1. Let k = 63 - 55. What is the lowest common multiple of m(-1) and k? 40 Let d be ((-27602)/(-10))/((-18)/15). Let g = d - -2294. What is the common denominator of g and (-170)/36 + (-3)/9? 18 Let v be (-2)/10 - 306/(-30). Let y be 1/v(-480)/(-115). Let z = -5023/1840 + y. Calculate the common denominator of z and 55/4. 16 Let r be 1 - (-3 + 2)21. Let j = 12 - r. What is the least common multiple of 4 and (-1)/2(j + 0)? 20 Let l = 15 - 7. Let z(c) = c*2 - 8c + 3. Calculate the smallest common multiple of 8 and z(l). 24 Let i(x) = x*2 - 8x. Let k be i(8). Suppose 2n - 4 + 2 = k. Find the common denominator of 133/6 and n/(-3)(-268)/(-8). 6 Suppose 6s - 40 = s. Suppose 0 = 4y - s. Calculate the lowest common multiple of y and 9. 18 Suppose 12 = 4m, -c - 3m + 20 = 5. Suppose 3x - cx + 135 = 0. Suppose 5j + 3d - x = 2d, -3j + 25 = d. Calculate the lowest common multiple of j and 6. 30 Suppose 3z = -5c - 9, 4z + 3 = -3c + 2. Let p = -4 + 3. Let n = p - -3. Calculate the smallest common multiple of n and z. 2 Suppose -4u + 0u + 2632 = 0. Let o be (u/(-12))/((-4)/(-8)). Let v = o + 2192/21. What is the common denominator of -97/10 and v? 70 Suppose 2w - 2463 = -285. Let o = 363884 + -2539605/7. Let m = w - o. Calculate the common denominator of m and -47/10. 70 Let l be (1/(-2))/((-1)/20). Suppose 0 = -v - v + l. Suppose 0 = 5h - 857 + 842. Calculate the least common multiple of v and h. 15 Suppose 4x = -4d + 44, -5d - x + 36 = -31. Let g = 20 + -10. What is the least common multiple of g and d? 70 Let y(x) = -x2 - 8x - 8. Let j be y(-6). Calculate the common denominator of 15/16 and j/18 + 4255/(-720). 16 Let f = -11 - -5. Let w = f + 10. What is the common denominator of 2/(-3) + (-30)/w and -32/7? 42 Suppose -5r = -4d + 22 + 6, 14 = 5d - r. Suppose u = -u - 3i - 19, -4u - di - 42 = 0. What is the common denominator of 89/12 and (u/(-12))/((-6)/45)? 24 Suppose g - 16 + 5 = 0. Calculate the least common multiple of g and 15. 165 Let n = -4/1967 - 11582/108185. Let u = 397/110 + n. Find the common denominator of -71/18 and u. 18 Suppose -5c = -3v + 49, -2c + 3 = 2v - 3. Suppose n - v = -3n. Let l(o) = o2 - 2o + 2. What is the lowest common multiple of l(3) and n? 10 Let x(s) = 2s. Let k be x(-2). What is the common denominator of k/((-16)/138) - -2 and 13/22? 22 Suppose 3n = 3p + 6, -n + p + 3p - 10 = 0. What is the lowest common multiple of n and 8? 24 Suppose -10 = -2n + 14. Suppose 3k - 24 = -k. What is the lowest common multiple of k and n? 12 Let g = -1841/4 - -9087/20. What is the common denominator of g and (24/(-440))/((-4)/70)? 110 What is the smallest common multiple of 1 and 2 + -3 + 3 - 0? 2 Let b = -21941 - -526667/24. Calculate the common denominator of -127/6 and b. 24 Let f(d) = -2d - 1. Let y = 0 + 11. What is the lowest common multiple of f(-3) and y? 55 Let a(z) = 2z*2 - 22z - 24. What is the least common multiple of 11 and a(13)? 308 Suppose 55 = 4p + p. Calculate the lowest common multiple of 7 and p. 77 Suppose 0 = -3u - 3f + 327, -539 = -0u - 5u - 3f. Suppose -5c + 3j - 7j = -u, 4j = 5c - 74. Calculate the smallest common multiple of c and 14. 126 Let l = 50066053/11 + -4555815. Let r = 4351 + l. What is the common denominator of r and 59/3? 33 Suppose 4a - 12 + 0 = 0. Suppose 44 = ab - 4n - 4, 3n = -3b + 69. Calculate t	{ "pile_set_name": "DM Mathematics" }
/(2 + -5 - -4). Suppose -3c + 44 = 8r - 3r, -2c + 8 = -2r. Let d = 12 - c. Solve 5s - 9 = -4q, v = -2q + 3q + d for s. 5 Suppose x = -4j - 10, 4x + 2j + j = 12. Solve -4t + n = 9 + x, -t - n - 10 = 0 for t. -5 Let w = 1 - -9. Let c be 4/10w1. Suppose -5k - 8j = -4j - 27, 4k + cj = 24. Solve -3b + 15 = 0, 2h + k = 5b - 12 for h. 5 Suppose 22 = -0t + t - 5d, 4d + 47 = 5t. Let q = t + 2. Solve -2h - 2 + q = 5p, 0 = 2h + 8 for p. 3 Let u = -2 + 2. Solve -5q = n - 29, 3q - 4q - n + 9 = u for q. 5 Let y = -6 - -8. Solve 4k + 4m = -0m - 4, 2m + y = -k for k. 0 Let n = -63 + 63. Solve 3w + 4c + 1 = -nc, w - 3c = 17 for w. 5 Suppose 5n = 5 + 10. Solve 4 = -2s + 10, n = -3l + 2s for l. 1 Let u be (16/(-5) - 0)/((-20)/50). Solve -s + 3k = -u, -3s - 4k = -0k - 11 for s. 5 Let n be (1 - 5)(-18)/(-8). Suppose 3l + l + 132 = 0. Let w be l/n - (-2)/6. Solve wz + 2 = 2v - 0v, 3v = -2z - 13 for z. -2 Suppose -6p = p - 28. Solve pn - 12 = 4i, -2i - 5n - 3 = -4 for i. -2 Let p = 3 - 0. Suppose 0 = 5l - t - 130, 5l - 40 = -t + 80. Solve 10 = 5d - 0o + po, -5o = l for d. 5 Let d be (-8)/28(2 + 5). Let u = -9 + 16. Let a be (0 - 2)/du. Solve -5v + 4s + 4 = 0, 2v - s - a = -3 for v. 4 Let q be ((-3)/(-6))/(2(-2)/(-16)). Solve qw = 5n - 11, 4n = -7w + 2w - 11 for n. 1 Let t be (4/(-7))/((-23)/161). Solve 1 + 9 = -2g, tg + 20 = -3p for p. 0 Let i be (-2)/((-4)/2) + 2. Let k = i + 0. Solve 2g - 9 = 5b + 2, 3b - kg = -3 for b. -3 Suppose 4 = 4h - 0. Let y be 123h/9. Solve 2 + 1 = -3g, -yw + 4g = -4 for w. 0 Let w = 21 - 5. Suppose -2d - 2d + w = 0. Suppose s = -ds + 70. Solve 2p + 4r = -13 - 1, -3p = -r - s for p. 3 Suppose -28 + 36 = 2c. Solve -5z = 3i - 2i + 18, 2z - 6 = ci for i. -3 Let i(b) = -b2 - 16b - 18. Suppose 0q - 5q = -2y - 28, 0 = -5q. Let x be i(y). Solve 2r + 7 = m - 4m, 3r = -5m - x for m. 1 Let c = 16 - 14. Solve 0h - h = -3a - c, 3h - 15 = 0 for a. 1 Suppose 5m + 4t - 3t - 13 = 0, -t - 5 = -4m. Solve -4 = c - 2x, mc = c + 4x - 10 for c. 2 Let q be (-3 + 2)(-5 + 3). Let m be (1/q)/(3/36). Suppose 7b = 5b + m. Solve -5z = -4r + 13, -4z - 10 = -br + 1 for z. -5 Let y be (9/(-2))/((-3)/4). Let g be ((-8)/y)/((-2)/3). Solve -3f + 3a - g = 2a, 0 = -3f + 4a - 17 for f. 1 Let k(d) = -d*2 - 10d + 4. Let z be k(-8). Let h = z - 14. Solve -y + 2 = 4j, -3y + 0y = -2j - h for y. 2 Let h be -2 + (-2)/4-2. Let p = -42 - -25. Let y = h - p. Solve y = -5l + x, 4x - 15 = 4l + x for l. -3 Let n be 162/90(-5)/(-3). Let w be (0 + -3)(1 - 2). Solve -na = -s + 9, -4s = -5a - w - 5 for s. -3 Let g(u) = u3 + 16u*2 - 18u - 13. Let x be g(-17). Solve -s - 18 = s + xz, -3s - 19 = 4z for s. -1 Let z(c) = 56 - 70 + 2c - 4c. Let s be z(-13). Solve 4q + s = -h, -2h + 2q = 7q + 15 for h. 0 Let c(h) = 11h - 1. Let a be c(1). Suppose 2s - 3p - a = s, 2p + 2 = 0. Solve 4r + 2 = -i, -sr = -2r + 5 for i. 2 Let z = 24 - 21. Solve -p + z = 5m - 4m, 4m + 23 = 3p for p. 5 Let p = 0 - -2. Let r be ((-3)/p)/((-6)/16). Solve 3q + k - 3k = -4, 2k + r = q for q. -4 Let d = 55 - 52. Solve 0 = -t - dh + 8, -3t + h + 3 = -1 for t. 2 Let b be ((-1)/3)/(5/(-225)). Let a = 18 - b. Solve 4f + ay - 9 = 0, 0y = -5f + 4y - 12 for f. 0 Let o be 4 - 1 - (1 - -2). Suppose -3q + 8 + 1 = o. Suppose -2j + 0j = -8. Solve -jx = a - 3a - 2, -a - qx + 4 = 0 for a. 1 Let n = -9 + 11. Let m be 6/(0 + 3)1. Solve 0p + mp + 3b = -n, -2p + 2b + 18 = 0 for p. 5 Let g be 4/6 - 7/(-3). Let z be (1 + -1)/(1/1). Suppose -5v = -zv - 25. Solve 5c = vj - 2j + 4, gj - 3c = -6 for j. -3 Let c(h) = h - 2. Let y be c(5). Solve -5m + 18 = 3x, -yx + 5m - 12 = -0 for x. 1 Let h = 55 + -29. Suppose 5v = 4n - h, -25 = -4n + 3v - 3. Let i(u) = u2. Let g be i(2). Solve -p + np = -gs + 2, 5s = -2p + 6 for p. -2 Let b = 2 - 9. Let v = b + 9. Let n be (-2)/7 - 2/(-7). Solve 5y = 3o + 22, n = y - 3o - vo for y. 5 Let b = -4 + 3. Let f be (16 - 1) + -3 + b. Solve 5j + 20 = 5n, 0 = 5n - j - j - f for n. 1 Suppose -6q + 5q + 8q = 0. Solve -3t - a + 11 - 1 = q, -3a = -3 for t. 3 Let d be 1 + (-3)/((-3)/5). Let a be d - 2/(-2) - 2. Let u be 1 - 1 - 26/(-2). Solve u = 4w + j + a, -j = 4 for w. 3 Let q be (-2)/(5/30-3). Solve 2a + 3s = 6 + 10, -qs + 13 = a for a. 5 Let q be (36/14)/(2/14). Suppose q = -3r - 6. Let t be (-2)/8 - 26/r. Solve a = 5u + 12, 2u - 3u + 2a = -t for u. -3 Let c(i) = i3 - 4i*2 - 11i - 3. Let b be c(6). Solve 0 = 5k + 2g + 1, -4k = g - bg - 10 for k. 1 Suppose 10 = 2n + 5d, -2n - 4d = 2n - 20. Suppose nz - 5 = 70. Let b = 43 + -37. Solve 0 = -5k + z, -u + 5k + b = 22 for u. -1 Let v be 2 - (-1)/(2 - 1). Suppose -25 = i + vn, 3n + 56 = -3i + 11. Let u = 15 + i. Solve -25 = 5y + 5r, r + 5 + 12 = -uy for y. -3 Let c = -2 + 4. Suppose -5m = l - 15, 2l - 4m + 8 = -18. Let w be 6/l120/(-18). Solve -5n = 4p + w, -c - 7 = 3n + p for n. -4 Let p be 8(-5 + 3)/(-1). Solve 0 = -2r + 5b - 6, -2r - 5b + p = r for r. 2 Let m = 0 - -5. Suppose -x = -2, 3x + 4 = 3s - x. Solve sd + mq = -8, -3d = -4d + 5q + 23 for d. 3 Let y be 6/4(-96)/(-18). Let p(m) = m*2 - 9m + 11. Let s be p(y). Solve so - 3h + 3 = h, -5o - 5 = -3h for o. -1 Suppose -13d - 30 = -16d. Solve d = 5n + y, 0y = n - 3y + 14 for n. 1 Let f(u) = u + 10. Let j be f(-8). Suppose 0 = 4c - 4d - 48, -2d + 46 = 6c - c. Suppose 0 = 5g - c. Solve -gw + 3m - 12 = -2, 0 = -jm for w. -5 Let j be 42/1221. Suppose -4m + j = -1. Solve -g - mq = -0g - 4, -3g = 2q - 8 for g. 2 Let r(d) = d3 + d2 - 8d - 2. Let s be r(-3). Solve -14 = -4k + 2y, 0 = 2k - sy - 4 - 6 for k. 3 Suppose -t = 3t - 24. Let m be 1/3 - (-250)/t. Suppose 0 = 2l - 0l - m. Solve -d - 4x - l = 0, 4x - 2 = -3d - 33 for d. -5 Let t = 32 - 27. Let v(z) be the first derivative of z2/2 + 1. Let d be v(t). Solve -o - 20 = -0n + 5n, -4n = -do - 13 for o. -5 Let q(y) = y2 - 3y - 23. Let l be q(8). Solve -5n - l = 3k - 4, 3k - 37 = 5n for k. 4 Let f = 3 + 1. Suppose fb - 12 = -0. Suppose 5w - 12 = 3z, 3w = 4w - bz. Solve wu - 10 = -3n + 4u, 4n = 4u + 16 for n. 3 Let y = -10 + 6. Let k be 1/(-1) + (1 - y). Solve -2s - 4j + 10 = 0, -kj + 0j = 5s - 1 for s. -3 Suppose 0 = 2k + 12 - 36. Solve -2z - 2a = -0a - k, -4 = -a for z. 2 Let o(r) = -2r3 - 2r*2 + 3r + 1. Let g be o(-2). Solve 0 = 3j + y + 3, -y - 4y - 15 = -gj for j. 0 Let s(v) = v3 - 5v*2 + 5v - 5. Let q be s(4). Let x be 30/12 + q/(-2). Solve -m - 2m = 4a - 4, 6 = -xa for m. 4 Let j(m) be the second derivative of m4/12 - 5m*3/6 + 3m*2 - 7m. Let x be j(4). Solve 4n + 4q + 28 = 0, 4q + 0q + 10 = xn for n. -3 Let x(c) be the third derivative of c5/60 - c4/24 + 2c*2. Let z be x(2). Solve 2y - 10 = 2q - q, -5q - zy - 2 = 0 for q. -2 Let v be ((-3)/4)/(1/(-4)). Let b be -21((-3)/v - 0). Let k = b + 3. Solve 2x = o - 5o + 14, 0 = -3x + 3o - k for x. -3 Suppose 10r = -4x + 7r + 11, 0 = 3r - 3. Solve -6q = -q + c - 9, -xq - 14 = -4c for q. 1 Let u be -1 - (-8)/6 - 135/(-81). Solve 0z + 11 = -2r + z, -r - 3z = u for r. -5 Suppose 2a + a = 33. Let c(h) = -h2 + 13h - 17. Let t be c(a). Solve -tm + 8 = -2k - 0m, 12 = -3k - 3m for k. -4 Let d(c) = c + 16. Let g be d(-16). Let i = 7 - 3. Solve -3s + 17 = 5u, g = 5s - iu + 9u - 25 for s. 4 Let n be -3 - (84/(-7) - (1 + -3)). Solve 2q - nq = 5j + 5, -3j - 4q - 6 = 0 for j. 2 Let x be (1/(-3))/(4/(-24)). Solve -2n + 2 = -x, 2l - 4n = -10 for l. -1 Let y be (6/(-2))/(-1) - -1. Let i = 12 - 26. Let s be 96/42 + y/i. Solve -4w = h - 17, 0 = sh - 2w + 2 + 4 for h. 1 Let x(q) = -q3 - 3q*2 + 6q + 13. Let d be x(-4). Solve -2t = h + 5, 0 = dt - 4h + 13 + 6 for t. -3 Let j be (-4)/(-16) + 22/8. Solve jh = 8h - 4k - 30, -5k = -3h + 31 for h. 2 Let b(n) = 6n2 - n - 1. Let m be b(1). Solve 2l = -2a - m, l + 5a + 1 + 1 = 0 for l. -2 Let b = -59 - -61. Solve -4c = -i - 21, -4i - bc = -c - 1 for i. -1 Let p(w) = 5w + w*2 + 3w + 0w2 - 2w*2 - 6. Let g be p(7). Let l = g + 7. Solve 4j + li = 3i - 28, -5*j	{ "pile_set_name": "DM Mathematics" }
r s. -5 Suppose 0 = r - 4r + 9. Suppose -t = rl - 20, -4l + 5t + 2 = -2l. Solve l - 1 = -o for o. -5 Suppose -5r = -8r + 6. Solve 0 = ra - 4a + 2 for a. 1 Let c(h) be the first derivative of h4/4 - 2h3/3 + h2/2 + h + 6. Let v be c(2). Solve -5 = 2i - vi for i. 5 Let n = -11 + 13. Solve 0 = -6v + nv + 20 for v. 5 Let v(n) = n*2 + 3n - 4. Let x be v(-5). Let d be 110/(x/3). Solve -2 = -3p - d for p. -1 Let f(s) = -3s3 - s2 - s - 1. Suppose -5 = 4w - 2a + 3a, -4a = -3w + 1. Let x be f(w). Solve -xc + 4c + 8 = 0 for c. -4 Suppose b + 5w - 8 = 0, 3b - 3w + 4w = 10. Suppose -4 = -4i, -4g - bi = -3g - 28. Solve 0 = 6h - h + g for h. -5 Let i = 24 - 35. Let c = 14 + i. Solve 0 = cx - 9 - 6 for x. 5 Let n = -11 + 22. Suppose -2a + 1 = -13. Let z = n - a. Solve 0 = -0g - zg + 4 for g. 1 Let q(j) = -j3 + 4j*2 - 2j. Let r be q(3). Let p be (-110)/((-1)/16). Let v be (r/(-2))/((-12)/p). Solve 0 = x + 3x + v for x. -5 Let l(u) = 4u2 + u + 12. Let a be l(5). Let p be (-8)/(-28) - a/(-7). Solve 0 = 3s + p - 2 for s. -5 Suppose -d + v - 5 = -2d, -d + 17 = 5v. Let m(x) = 3x2 - 1. Let i be m(-1). Suppose 0s - is = -dy - 4, 0 = -4y + s + 7. Solve -yh = -0h for h. 0 Let x(a) = -a3 - a2 - a - 1. Let v be x(-2). Let t(i) = i3 + 6i*2 + 5i + 6. Let r be t(-5). Solve ro = o - v for o. -1 Let t = 6 - 3. Suppose -2w - 3b = t, -w - b = 2w + 8. Let r be (w + 6/2)/(-1). Solve -2a + 6a - 20 = r for a. 5 Let a be 10/(-3)(-6)/1. Suppose 3i = 4t + 15, 2t - 4i + 0i + a = 0. Suppose 2k + k - 2p - 11 = 0, -6 = -2k + 2p. Solve 4o - ko - 3 = t for o. -3 Let s(n) = -n - 2. Let x be s(-5). Solve 2b - x - 3 = 0 for b. 3 Let q = -11 + 14. Solve 8t = qt - 25 for t. -5 Let a(w) = 9w*2 + w. Let x be a(1). Suppose -6v + xv = 16. Solve -2b - 2b = -v for b. 1 Let v(u) = -u2 + 2. Let g be v(0). Solve -4 = -gm - 14 for m. -5 Suppose 3y + 6 = -2w, -4y - 12 = -2w - 4. Let j = 6 - w. Suppose -18o = -21o. Solve jc - 3c + 12 = o for c. -4 Let r(q) = q*2 - 6q - 10. Let k be r(7). Let n = k + 5. Solve ns = -3s for s. 0 Let r = 10 + -5. Suppose -q = q - a - r, -4a = 5q - 32. Suppose -4u + q + 8 = 0. Solve -3s = -0s + u for s. -1 Let t = -10 + 20. Let h(b) = -b3 + 9b*2 + 9b + 3. Let x be h(t). Let z be -3x/(21/20). Solve -u - 4u = -z for u. 4 Let p = 41 + -21. Let l(y) = 4y + 1. Let u be l(6). Suppose 3i = 2b + u, -2i - 3i + 4b + 45 = 0. Solve -ir = -r - p for r. 5 Suppose 4 = 4s - 3s. Solve -j = -sj for j. 0 Suppose 0 = -f - 4f + 70. Solve 4u + 2 = -f for u. -4 Suppose 2x - 80 = 3k - 8k, 3k - 41 = -x. Suppose 5c - x = 2b, 2c - 3b + 4b = 5. Suppose -cl + 3l = -12. Solve li = 3i + 15 for i. 5 Let m(j) = 3j*2 - 3j + 1. Let s be m(2). Let q be 0 + 3 - (-2)/(-2). Solve -qf - 25 = -sf for f. 5 Suppose 0q = 2q - 88. Let y = q - 16. Suppose -g - g + y = 0. Solve -6 = 5k + g for k. -4 Let g(u) = u3 + 5u*2 + 2. Let t be g(-5). Let j be (-2)/t + (0 - -4). Suppose 0 = r + 4x + 4, r + r + 2x = 4. Solve 2d - jd = -r for d. 4 Suppose -r - 7 = 5n - 37, -3r + 71 = -4n. Solve o = -4o - r for o. -5 Suppose 10 = 4d + j, -4d + 20 = d + 5j. Solve -h - d = -1 for h. -1 Let j(s) = -s + 3. Let q be j(-4). Solve qo + 4 = 3o for o. -1 Let j = 10 + -28. Let u = 29 + j. Solve u = -5k + 1 for k. -2 Suppose t = -t. Suppose 3q - 88 = -5z, 0q = 5q + 20. Suppose ti + 5i - z = 0. Solve -2s - i = -0 for s. -2 Let l = 0 + 4. Suppose -lr - 20 = -3o + 1, -o + 4r = -15. Solve -q = -oq for q. 0 Suppose 0 = 6h - 3h - 9. Solve 20 = hi + 2i for i. 4 Let s = 17 - 13. Solve -sq = -3q + 1 for q. -1 Let l be ((-3)/((-18)/24))/(8/6). Let d = 8 - 4. Solve dx = lx for x. 0 Let g(l) = -l*2 + 6l + 9. Let k(f) = f*3 - 4f*2 + 2f - 1. Let x be k(4). Let a be g(x). Solve 6 = -ar - r for r. -2 Let n be (-21)/284 - 1-3. Let y = 0 - -2. Solve n = yv - 6v for v. 0 Suppose -5t - 2b + 5 = 0, -14 = 5t - 3t + 4b. Suppose 0 = -tg + g. Solve -3w = -gw - 3 for w. 1 Let k be (-3)/(-9) - 28/(-6). Let o = k + -6. Let m = o + 2. Solve g - m = 3 for g. 4 Let r(q) = -q3 + 9q*2 - 9q + 10. Let n be r(8). Let a be (1/n)/(-1)16. Let l = -7 - a. Solve l = 5b - 14 for b. 3 Suppose 1 = -4u + 13. Suppose 12 = us + g, -4s + 4 = -3s + 4g. Solve 2w = -0w + s for w. 2 Let x = 8 - 8. Let i = x - 1. Let b be (1 - i)40/16. Solve -20 = -h + bh for h. -5 Suppose -p + 7 = -3f, 3p + 0f - 2f = 14. Let h(i) = i3 - 8i*2 + 13i - 3. Let b be h(6). Solve 0 = -pl + bl + 3 for l. 3 Suppose -5j + 6 + 9 = 0. Suppose -3s + 21 = -ja, -5a = 4s - 2a. Solve sb = 5b for b. 0 Let p(j) = -49j - 1. Let t be p(1). Let o = -30 - t. Suppose 4x + s - 20 = -0s, -o = -5s. Solve -2a + a + x = 0 for a. 4 Suppose 2 = z - 1. Solve -2q - z = -3q for q. 3 Suppose -3 = p - x, p = 4x + 5 - 23. Let v be (-12)/(-15)(3 + p). Solve vm = 5m + 3 for m. -3 Let z(g) = -10g - 7. Let b be z(-2). Solve b - 5 = 2r for r. 4 Let u = -2 - -6. Suppose -2l = -5v + 5, 2l - 2v = ul - 2. Solve -w - 1 - 1 = l for w. -2 Let p be 22 + (-1 + -3 - -3). Suppose -5s = -p - 4. Solve sm + 4 = m for m. -1 Let z(m) = 5m3 - 2m*2 + 3m - 1. Let a be z(1). Solve aq = 3q for q. 0 Let u be -2(-2)/(8/10). Suppose -12 = -a + 2s, 4a + 0a + us = -17. Let q = 15 - 9. Solve ql = 4l + a for l. 1 Suppose 5u + 0u = -10. Let a be 1 + -21/u. Let b(p) = p*3 - 4p*2 + p - 1. Let o be b(4). Solve -ov = 1 + a for v. -1 Let m be 3/(-6) + (-42)/(-4). Suppose -m = 3j - 8j. Suppose 0s - js = -6. Solve -si + 4 = 19 for i. -5 Let q(x) = 9x - 4. Let s be q(3). Suppose -5z - s = -j - 0j, -9 = 3z. Suppose jn = 3n + 10, 5n + 14 = 2l. Solve 4g + 0g = -l for g. -3 Let d(x) = x2 + 8x + 23. Let b be d(-5). Solve -7w + b = -9w for w. -4 Let c(r) = -4r - 1. Let d(f) = -4f. Let b(n) = 4c(n) - 3d(n). Let w be b(-3). Let o be (-18)/(-4) - (-4)/w. Solve 0 = ot + 25 for t. -5 Let x(l) = l. Suppose 2s = -2s - 24. Let n(c) = c2 + 7c + 9. Let d be n(s). Let y be x(d). Solve -5p - 2 = -yp for p. -1 Let a(i) = 4i + 8. Let h be a(-4). Let y = 8 + h. Solve yp = -p for p. 0 Let q(w) = w*2 + 11w - 17. Let t be q(-14). Let p = t - 21. Solve -pm = -5m for m. 0 Suppose -2f + 103 = 3f + u, 0 = 5f + 5u - 115. Suppose -f = 2a - 0a. Let t be ((-8)/a + 0)10. Solve 0 = -p - 3 + t for p. 5 Let f(q) be the first derivative of -q3/3 + 5q*2/2 - 2q + 4. Let h be f(3). Solve -hr = -2 + 6 for r. -1 Let r be -10(10/4 - 1). Let w be 4/(0 + (-6)/r). Suppose -2u - w = -5x + 2u, u = 3x - 6. Solve -2n - 4 = xn for n. -1 Let v(g) = -g*3 - 7g*2 - g - 3. Let h be v(-7). Solve hd = 2 + 18 for d. 5 Let u(t) = -t*3 + 5t*2 + 7t - 2. Suppose 6 = 2i - 6. Let x be u(i). Solve xg + 16 = -0g for g. -4 Let h = 11 - 9. Solve hd = -d for d. 0 Suppose 0 = -3s - s. Suppose 0b + b - 2 = s. Suppose 2t + bt - 12 = 0. Solve t = -u + 1 for u. -2 Let m be -1 + (-2 - -16) + -3. Solve -2z + 0z = m for z. -5 Suppose 2i = -4 + 10. Suppose -i = -5k + 7, -4h = -5k - 2. Solve 4j + h + 13 = 0 for j. -4 Let w = 74 - 62. Solve -x = -5x - w for x. -3 Suppose -z = -19z + 36. Let m = 49 + -27. Suppose -2j - m = -8h + 4h, 3j - 3 = 0. Solve h = zb - 4 for b. 5 Let o = -17 - -19. Let w be 6 + -2 + (1 - 1). Let l be (-10)/(-4) - (-2)/w. Solve o + 7 = -lt for t. -3 Let j be (0/(-2))/(-1 + 3). Suppose 9z - 7z = 0. Solve z = -jn + 3n for n. 0 Let d(t) = -t + 1. Let l(k) = 3k - 12. Let s = 3 - 4. Let z(n) = sl(n) - 4d(n). Let m be z(-5). Solve 0 = -mu + u - 2 for u. -1 Suppose 2g - 5o = 32, 3o + o = -16. Solve f = gf for f. 0 Let u(d) = 2d*2 - 2d - 3. Let y be u(3). Let w(h) = 2h - 12. Let b be w(y). Let j = 1 - 1. Solve j = -0c + 3c - b for c. 2 Let q be 7/3 + 2/3. Suppose -qx - 4a + 23 = 0, -x + a + a + 1 = 0. Suppose 0l + 4 = 3l - m, 5m = xl + 10. Solve -lb + 9 - 3 = 0 for b. 2 Let b(h) = -h*2 - 4h + 1. Let s be b(-3). Suppose -sd + 36 = -d. Suppose -d = 4f, 5f + 36 = z - 4. Solve 10u = 5u + z for u. 5 Suppose 5g - 2 = 4g. Suppose -5 = -4u - 3q - g, 2u + 4q - 4 = 0. Solve -p + 0 + 3 = u for p. 3 Suppose -32 = -5i + 18. Suppose -2c = -5c + 4*v	{ "pile_set_name": "DM Mathematics" }
0.7 in 4, j, 2/5, -27/2? j Let k = -6840 + 54719/8. Let r = 0.35 + -0.3. Let o = r + 8.95. Which is the nearest to 2? (a) o (b) -4 (c) k c Let n be ((-6042)/(-530))/((-2)/(-180)). Let k = n - 1030. Which is the closest to k? (a) 0.8 (b) -1/8 (c) 4 b Let y = -3523.9 - -3524. What is the nearest to 3 in -0.3, y, -0.2, -5? y Let u = -0.688 + 9.688. Let o = -1.46 + 0.46. Which is the nearest to -0.2? (a) o (b) u (c) -0.4 c Let h = 41.4 - 39. Let f = h + 2.6. Let l = 55/7 - 103/14. Which is the closest to l? (a) 0.5 (b) -4/3 (c) f a Suppose o + 10 = -4o. Let t = 391 + -390. Which is the nearest to -2? (a) -1 (b) t (c) o c Let z be 63/6(-592)/(-518) + -18. Let x be -3 - 0/(6 + -3). What is the nearest to z in x, 1/3, 1? x Let x = 6 + -3. Let p = -147775.7 + 147776. Which is the nearest to -7/4? (a) 2 (b) p (c) x b Let o = -92 + 90. Let f(n) = n*2 - 10. Let p be f(4). Suppose 0 = -14x + px + 8. Which is the closest to o? (a) x (b) -10/9 (c) 3 b Let z = 3289.8 + -3674. Let d = -384 - z. Which is the closest to 33? (a) d (b) 2/3 (c) 0 b Suppose -5g + 72 = 3n + 157, -3g - 56 = 2n. Which is the closest to n? (a) 0.5 (b) -2 (c) 1/3 b Let d(a) = a3 - 47a*2 + 44a + 101. Let l be d(46). Let y be (308/63 + -5)/((-3)/l). What is the closest to 26 in 0, -0.1, y? y Let q = -9 + 8.7. Let o(g) = 3g2 + 27g - 5. Let v be o(-9). Let y be (((-2)/(-5))/(-2))/((-2)/v). Which is the nearest to y? (a) q (b) -8 (c) -3/7 c Let n = 7085.5 - 7085. What is the closest to 0 in 86.9, -0.3, n, 3/4? -0.3 Let k = 178 + -104. Let v = -50285/672 + 107/96. Let i = v + k. Which is the nearest to -3/4? (a) 0.2 (b) i (c) 0.1 c Let i = 12.873 + -18.68. Let o = -5.8 - i. Let g = o - 0.187. Which is the nearest to 0? (a) -0.2 (b) 1 (c) g c Suppose -9 = -f + 4f. Let l = 8338.3 + -8338. Which is the closest to 4? (a) l (b) f (c) 2/9 a Let i = -26858.8 + 26859. Let o = 0.255 - 0.045. Let b = 0 - -2. What is the nearest to o in -3, i, b? i Let d = 3907/2 + -1952. Suppose 12 = 14p - 20p. Which is the nearest to p? (a) d (b) -3 (c) -0.07 b Let o = -93 - 202. Let s = 291 + o. Let t = 18 + -19. Which is the closest to 2/7? (a) s (b) t (c) -1/3 c Let p = -6369 + 6369.3. Which is the closest to -0.2? (a) 1/12 (b) p (c) -1/2 (d) 1/6 a Let p = 0.0075 + 0.2925. Which is the closest to p? (a) -1/7 (b) 3 (c) 1 a Let l = 0.04034 + -0.44034. What is the nearest to 1 in 2, -0.2, l, -4/625? 2 Let g = 90 - 62. Suppose 9t + 62 = -g. Which is the nearest to -2? (a) t (b) 4 (c) -4/3 c Let t = 10415 + -10417. Which is the closest to 0.1? (a) 0.3 (b) t (c) -8 (d) -14 a Let h = 24299 - 24299.24. Which is the closest to -2/7? (a) h (b) 1 (c) 5/4 (d) -2/15 a Let t = -1233 + 1235. What is the nearest to 0 in -0.4, t, 88? -0.4 Suppose 2v = -z + 11, 44z + 35 = 49z + 5v. Which is the nearest to 1? (a) z (b) -0.05 (c) 0.2 (d) -33 c Let m = 0.2195 - 0.3195. Let u = -32 - -34. Let j(z) = -z - 3. Let f be j(-4). What is the nearest to f in 7, u, m? u Let h = 105794 + -105794. Let q = 0.46 + -0.06. Which is the closest to h? (a) 5 (b) -0.5 (c) -3 (d) q d Let i = -82538/3 + 27512. Let j = -248/497 + 5/71. Which is the closest to -0.7? (a) 7 (b) i (c) j b Suppose -83209t = -83184t - 50. Let m(f) = 3f - 2. Let k be m(3). Which is the closest to -1/4? (a) k (b) t (c) -4/3 c Let v = -350 + 586. Let d = v - 236.2. What is the nearest to -3 in 1, -2/3, d, -2/21? -2/3 Let t = -25.5 + -210.5. Let q = -236.1 - t. Let m = -23/36 - -8/9. Which is the closest to q? (a) m (b) -0.4 (c) 1/15 c Let o = -4.137 - -2.137. Which is the closest to o? (a) -0.2 (b) 5 (c) 2/11 (d) -0.4 d Let h be 5/(-3) + (-4592)/(-2784). Which is the nearest to h? (a) 1/4 (b) 3 (c) 0 (d) -3 c Let b = -23795 - -23794.9. What is the nearest to -2 in 1.6, b, 2/9, 0.08? b Let p = -671 - -709.9. Let w = 0.9 - p. Let g = w - -38.2. Which is the nearest to g? (a) -2/5 (b) 4 (c) 0 c Suppose 0 = 2d + 2k + 468, 4d - 2d + 475 = 5k. Let l = d + 232. Which is the closest to l? (a) -1/3 (b) -0.5 (c) 1/4 b Suppose 411d + 544d - 3720 - 100 = 0. Let f be (-8)/546054/(-4). Let m = f - 224. Which is the closest to -3? (a) m (b) -0.5 (c) d b Let u = -7 - -7. Let r be -1 + -32 + (7 - 2). Let h be (r/3)/712/8. What is the nearest to h in u, -5/6, 2? -5/6 Suppose -27l + 362 - 281 = 0. What is the closest to -7/3 in 4, l, 2, -3/7? -3/7 Suppose -3q + 4 = -2. Let k = -9794 + 9781. Which is the closest to 2? (a) -0.3 (b) q (c) k (d) 0.5 b Let h = 206/33 - 316/33. Which is the nearest to -2/9? (a) 15 (b) -4 (c) h c Let l be 222/(-259)((-2)/(-16))/((-3)/(-42)). What is the nearest to l in -11, 0.5, 1/11? 1/11 Let u be 194/38 - (-30)/(-12)2. Let n = 87.4 - 87.435. What is the nearest to n in 0.5, 0, u? 0 Let m = 19/52 - -5/13. Let s = -1370.4 - -1373. What is the closest to -2 in s, 4/9, m? 4/9 Let k = 0.161 + -0.102. Let m = 1.341 + k. Let q = m + -3.4. Which is the nearest to -2? (a) q (b) -3/2 (c) 1/6 a Let h = -2.6 + 3. Let z = -96 + 100.6. Let q = -4 + z. Which is the closest to q? (a) 5/2 (b) h (c) -1/3 b Let j = -24.912 - -25. Let s = j + 0.012. Let g = 323/555 + 2/111. Which is the nearest to -7? (a) -1/6 (b) s (c) g a Let p = 228.549 - 0.549. Let i = 227.9 - p. Which is the nearest to -2/9? (a) i (b) -5 (c) -1/3 c Suppose -2n - q + 4 = 5, -14n - 3q = -5. Which is the closest to 0? (a) -301/3 (b) n (c) -4 (d) 5 b Let o = 7041 - 35204/5. What is the closest to 0.1 in 0.124, o, 0.4? 0.124 Let l = -127325/6 + 21222. Which is the closest to -1? (a) -1/4 (b) -3/10 (c) l b Let z = 18668 + -18667. What is the closest to z in 1/2, 0.041, -1? 1/2 Let l = -32416 - -32416. What is the closest to l in 2/55, 0.5, 3/7, 4? 2/55 Let y = 3.384 + -4.384. Let h = -2.62 - 0.38. What is the nearest to -6 in y, h, 4? h Let i = 7 - 10.7. Let n = i + -3.3. Let o = -65.6 + 65.7. Which is the nearest to n? (a) 0 (b) o (c) -4 c Let y = 53.811 + -2.811. What is the nearest to 0.1 in y, -0.2, 1/2, -1/7? -1/7 Let d be 2/11 + 126/(-88). Suppose 9o + 24 = 15o. Let v be 46/(-12) + o + 1. What is the closest to -0.1 in -5, d, v? d Let t be -1 + 0 + (-9)/(-7). Let l(j) = -j3 + 21j*2 - 83j + 14. Let q be l(5). What is the closest to 0 in t, -3/2, q, -0.07? -0.07 Let j be (16 - (-1167)/(-42)) + 12. What is the nearest to 0.1 in 5, j, -5/6, -0.3? j Let z = 279.1 + -278.9. Which is the nearest to -39? (a) 44/3 (b) z (c) 2/7 b Let o = 29826 - 29826.058. What is the closest to -2 in o, 2, 3, 2/13? o Let x = -0.439 + -2.431. Let o = -2.57 - x. Let b = -5.25 - -0.25. What is the nearest to 2 in b, o, -3? o Let m be 59 + -50 - (9 + -1). What is the nearest to 0.1 in -19, 0, m? 0 Let o be (-4)/14 - 0(-9)/45. Which is the nearest to -2/9? (a) o (b) -2 (c) 12/7 (d) 0.2 a Let y be ((-40)/220)/((-328)/9020). Let w = 929/86 - 13/43. What is the nearest to -1/2 in -3/5, w, y? -3/5 Let q(l) = -2l*2 - 20l + 111. Let m be q(-14). Which is the closest to -1? (a) -94 (b) -4 (c) -5 (d) m d Let o = -3677 - -3678.803. Let d = o - -0.197. What is the closest to 28 in -2, -0.4, d? d Let f be (21/(-9) - -1)(-126)/924. Which is the closest to 1? (a) f (b) 24 (c) 14 a Let p = -157 - -155.84. Let v = p - -0.76. Which is the closest to 0.1? (a) v (b) 5 (c) -1 a Let l = -222 - -428. Let n = -202 + l. Which is the nearest to 10? (a) 0.5 (b) n (c) 5 c Let b = -6194.06 + 6194. What is the closest to b in -2/9, -6, 6? -2/9 Let j be (0 + -1)/((-315)/420 + (-78)/(-8)). Which is the nearest to -1/6? (a) 2/3 (b) 1 (c) -4 (d) j d Let b = 1311.04 - 1311. Let t be ((-12)/(-9))/2 + -1. What is the nearest to b in 0.3, t, 2? 0.3 Suppose -16c = 33 - 209. Let z be (c - (-318)/(-30)) + (-56)/90. Suppose 4o - 1 = 3n, 4o + n + 2 = -9. What is the closest to o in -3, -27, z? -3 Let i = 0.29 - 0.29. Let g be ((-2877)/(-210) - 14) + (-2 - (-38)/20). Which is the closest to i? (a) -4 (b) 4/9 (c) g c Let f = 3429 - 3429. What is the closest to f in 1, 5/2, 4, -35? 1 Let i(x) = -x + 3. Let j be i(4). Let a = -51250 + 51250.3. What is the nearest to 2 in 3, j, -4, a? 3 Let l be (-16)/123/14. Let d = -1.7889 - -2.0889. What is the nearest to 7/4 in 4/3, d, l? 4/3	{ "pile_set_name": "DM Mathematics" }
72? 23 Calculate the highest common factor of 7930427 and 327259. 4483 Calculate the highest common divisor of 2892 and 46307427. 723 Calculate the highest common factor of 14351 and 9379. 113 What is the highest common factor of 14886179 and 385? 77 Calculate the greatest common divisor of 3970588 and 340. 68 What is the greatest common divisor of 159 and 183805431? 159 Calculate the highest common divisor of 3896 and 2179256. 8 Calculate the greatest common divisor of 43 and 16575812. 43 What is the highest common factor of 8923573 and 118? 59 Calculate the greatest common factor of 740621 and 14632. 31 Calculate the highest common factor of 168 and 3959508. 84 Calculate the greatest common divisor of 81702 and 60129. 459 What is the highest common divisor of 355458 and 13860? 6 Calculate the greatest common factor of 108147173 and 414. 23 Calculate the greatest common factor of 23819870 and 10. 10 What is the highest common divisor of 4888 and 973088? 376 Calculate the greatest common divisor of 648 and 32163759. 9 Calculate the highest common factor of 946858519 and 1741. 1741 What is the highest common divisor of 392 and 23839672? 8 Calculate the highest common factor of 510946394 and 3922. 3922 What is the greatest common factor of 69780 and 388? 4 Calculate the greatest common divisor of 4948 and 24493837. 1237 What is the highest common factor of 2559012 and 2044128? 1284 Calculate the highest common factor of 2070 and 1588656. 138 What is the greatest common factor of 15094542 and 2? 2 What is the greatest common factor of 951171 and 1653? 87 Calculate the greatest common divisor of 236 and 317057150. 118 What is the highest common divisor of 3130 and 42122914? 626 Calculate the highest common divisor of 41626 and 674414. 26 Calculate the greatest common divisor of 4711 and 1419033. 7 Calculate the greatest common divisor of 6169400 and 981. 109 What is the greatest common divisor of 21 and 20620802? 1 Calculate the highest common factor of 8476798 and 76442. 2066 Calculate the greatest common factor of 310 and 77690402. 62 What is the highest common divisor of 3836685 and 20? 5 Calculate the greatest common divisor of 343123 and 528. 11 What is the highest common divisor of 784410074 and 1239? 413 Calculate the highest common divisor of 645707912 and 8. 8 What is the greatest common factor of 6856 and 4099? 1 What is the highest common factor of 76291 and 3628798? 3317 Calculate the greatest common divisor of 770476 and 14112. 196 What is the greatest common divisor of 180273270 and 714? 102 What is the highest common factor of 1542932831 and 1177? 1177 What is the greatest common factor of 22587290 and 880? 110 Calculate the highest common factor of 18 and 5551950. 6 What is the highest common factor of 1269960 and 6726? 114 Calculate the greatest common factor of 296 and 15079868. 148 What is the highest common factor of 159453 and 25662? 21 Calculate the greatest common factor of 14335 and 159800. 235 What is the highest common factor of 1329 and 22509273? 1329 Calculate the highest common divisor of 222348 and 1764504. 84 Calculate the highest common factor of 18 and 37866618. 18 Calculate the greatest common factor of 9655280 and 144. 16 Calculate the highest common divisor of 7312 and 224512. 16 Calculate the highest common divisor of 160 and 83030. 10 Calculate the greatest common divisor of 49601 and 268656. 193 What is the greatest common factor of 11232 and 3166? 2 What is the highest common factor of 12 and 73901908? 4 What is the highest common factor of 3 and 72563? 1 Calculate the highest common factor of 14417886 and 34629. 2037 Calculate the greatest common divisor of 6146 and 1710128. 14 What is the highest common divisor of 33342708 and 168? 84 Calculate the greatest common factor of 52768 and 124548. 388 What is the highest common divisor of 3551519 and 148? 37 Calculate the highest common divisor of 3 and 3740161. 1 Calculate the highest common divisor of 5178 and 161178. 6 Calculate the greatest common divisor of 1812787 and 1209. 31 Calculate the greatest common factor of 225 and 6276885. 15 Calculate the greatest common divisor of 11760 and 1139838. 294 Calculate the highest common factor of 108605 and 357380. 535 Calculate the highest common factor of 70378862 and 438. 146 Calculate the highest common divisor of 1136012943 and 26. 13 Calculate the highest common factor of 3417 and 10721407. 1139 Calculate the greatest common factor of 1068325 and 1280575. 7075 Calculate the highest common divisor of 2400 and 4708050. 150 Calculate the highest common factor of 10 and 568865. 5 What is the highest common divisor of 43921 and 3205444? 263 What is the greatest common factor of 3896700 and 14246? 838 Calculate the highest common divisor of 489503905 and 11165. 1595 What is the greatest common divisor of 12584 and 2667236? 572 Calculate the highest common divisor of 2126974 and 13052. 502 Calculate the greatest common factor of 119 and 198874109. 119 What is the greatest common divisor of 740 and 38880? 20 What is the greatest common divisor of 4703349 and 1071? 21 What is the highest common divisor of 30790542 and 30? 6 Calculate the highest common divisor of 54900 and 5020. 20 Calculate the greatest common divisor of 2682 and 25400030. 298 Calculate the highest common factor of 66 and 5404069. 11 Calculate the greatest common factor of 56472306 and 66. 66 What is the greatest common factor of 22371135 and 60? 15 Calculate the highest common divisor of 10502 and 27495180. 118 Calculate the greatest common divisor of 98232433 and 104. 13 Calculate the highest common divisor of 2563 and 147466. 11 What is the greatest common divisor of 6674 and 345920? 94 Calculate the highest common divisor of 33939072 and 168. 24 Calculate the greatest common factor of 780923 and 731. 43 Calculate the greatest common factor of 43967988 and 2886. 222 What is the greatest common factor of 221192 and 1118? 86 Calculate the highest common factor of 44252 and 1260220. 1924 Calculate the highest common divisor of 12644 and 300092. 116 Calculate the highest common factor of 58576 and 262552276. 14644 Calculate the greatest common factor of 271818 and 1650. 6 What is the greatest common factor of 34452 and 6400746? 198 What is the greatest common divisor of 60 and 5537820? 60 What is the highest common divisor of 191900807 and 196? 49 What is the highest common divisor of 20 and 3986790? 10 Calculate the greatest common divisor of 1710 and 277824840. 570 Calculate the highest common factor of 31192 and 3003448. 56 What is the greatest common factor of 55968 and 154866? 318 Calculate the greatest common factor of 17395827 and 146. 73 Calculate the greatest common divisor of 2487456 and 30024. 216 What is the highest common divisor of 239367 and 8249? 73 What is the highest common factor of 1155045 and 420? 15 What is the greatest common factor of 10549 and 44251? 137 What is the highest common factor of 7921 and 4758563? 89 What is the greatest common factor of 20696961 and 1251? 417 What is the greatest common divisor of 286924 and 29414? 22 What is the highest common factor of 709 and 320835971? 709 Calculate the highest common divisor of 1215 and 495497169. 243 Calculate the highest common divisor of 1115932 and 48124. 908 What is the highest common divisor of 67264836 and 82316? 6332 What is the highest common factor of 55182 and 10928? 2 What is the greatest common factor of 175990668 and 98? 14 Calculate the highest common factor of 8541 and 25527151. 949 What is the greatest common divisor of 20 and 819725? 5 What is the greatest common divisor of 54491646 and 552? 138 Calculate the highest common factor of 2582 and 103162519. 1291 Calculate the greatest common divisor of 1311 and 22865151. 1311 Calculate the highest common factor of 1024 and 723024. 16 What is the highest common factor of 20511716 and 32? 4 Calculate the greatest common divisor of 1127 and 202727. 7 What is the greatest common factor of 92 and 101316? 4 Calculate the highest common factor of 11950 and 2110. 10 Calculate the highest common divisor of 204 and 30495756. 204 Calculate the greatest common factor of 46312 and 122362093. 5789 What is the greatest comm	{ "pile_set_name": "DM Mathematics" }
0.256 Work out 0.4 - -465914. 465914.4 Add together -257 and -0.0752. -257.0752 10 + 1514 1524 Work out -0.4 - 3805. -3805.4 Put together 27.9 and -7. 20.9 What is the distance between -2.6 and 2223.4? 2226 What is -343983 + -3? -343986 Subtract -0.39 from 0.62. 1.01 What is -13 less than 906? 919 What is -10 take away 361.49? -371.49 What is the distance between -110 and -5.92? 104.08 What is 2 take away -464.6? 466.6 What is -4668 + -1? -4669 -1.333 - 0.3 -1.633 Add together 8870 and 3. 8873 Work out 0.314 - -0.2. 0.514 What is the distance between 0.1 and 259? 258.9 38 + 65 103 What is -0.03 minus -20.15? 20.12 What is -19 + 1340? 1321 What is the distance between 366 and -9? 375 What is 82702.1 less than 2? -82700.1 What is the distance between 41.46 and 1? 40.46 Put together 1.08917 and -0.006. 1.08317 What is the difference between 0.29 and -18? 18.29 Put together -148.9 and -0.018. -148.918 What is 0 + -195580? -195580 What is -1.69 + -707? -708.69 What is 2 + -700? -698 Work out -1 - 0.18. -1.18 Add -2525 and -2.6. -2527.6 What is -1.7 minus -0.60074? -1.09926 What is -884592 - -0.3? -884591.7 Calculate -7.671 - 10. -17.671 Put together 0.257 and -105. -104.743 Add together -13.177 and -0.3. -13.477 -4 + 1.303 -2.697 What is 0.062 plus 3? 3.062 Subtract -322 from 35. 357 What is the difference between 1902270 and 0.5? 1902269.5 -28.3+0.0757 -28.2243 -17876 - 0 -17876 What is -0.00194 plus 0.3? 0.29806 What is 241 plus 0.02? 241.02 Add -3 and -369870. -369873 6.2 - 78 -71.8 Work out -0.5 + 282. 281.5 Total of -12241 and 0.086. -12240.914 35790 + 5 35795 Work out -884.9 - -0.7. -884.2 Put together -6 and 355.295. 349.295 What is the distance between -599079 and -0.1? 599078.9 What is 89882 - 0.4? 89881.6 Work out 177 + 49. 226 What is -0.32352 less than 0.4? 0.72352 What is the difference between -18 and -0.81? 17.19 31598 - 0.6 31597.4 Work out 0.7 - -1377. 1377.7 Work out -5.551 - 4. -9.551 Subtract -2 from -1794688. -1794686 What is -133070 plus -0.4? -133070.4 What is the distance between -0.4 and -654? 653.6 Add 22.172449 and 3. 25.172449 Sum 4235 and -25. 4210 Work out -0.02 - -9.29652. 9.27652 Subtract 0.1 from -93859. -93859.1 Work out 47587 + 11. 47598 -0.4 + 4693.3 4692.9 Calculate -0.76092 - 0.04. -0.80092 -0.14 - 0.203 -0.343 60+-2930 -2870 20.83 - -0.1 20.93 2.798+12.67 15.468 What is -19490 take away 3? -19493 -9 + -32.742 -41.742 What is 35 minus -480? 515 16.9+2 18.9 What is the distance between -75.2882 and 0.4? 75.6882 Work out -0.7 + -18354. -18354.7 -0.56 + -27 -27.56 Add -5 and -166. -171 What is -0.115 minus 2.821? -2.936 What is 11.29 plus 24? 35.29 What is 31 take away 0.34? 30.66 Work out -16 + -0.027. -16.027 Work out -0.66 - 92. -92.66 What is -0.00859 minus 6.07? -6.07859 Calculate 0.819 - 4. -3.181 Calculate 0.21419 - 3. -2.78581 1+123475 123476 What is the difference between 0.11 and 679? 678.89 Work out -295 - -0.04. -294.96 -21.5 + 0.414 -21.086 Subtract -3566 from 2282. 5848 What is 1 + 4375.11? 4376.11 What is -0.0515 less than 0? 0.0515 -356 + -49 -405 What is -13 plus 311? 298 What is 3654 less than 0? -3654 Work out 1437.76 + -5. 1432.76 Put together -16 and 315712. 315696 What is -8371 minus 0.1? -8371.1 What is -68 + -8200? -8268 What is -0.09 plus -2423? -2423.09 Subtract 0 from 0.042265. 0.042265 What is 1 plus 2363? 2364 Add 0.1 and 1.61857. 1.71857 What is 0.35 + -23.8? -23.45 What is 70 - 0.8? 69.2 What is the difference between -0.08 and 4.88? 4.96 What is -0.1 less than 0.359? 0.459 Calculate 457 + 181. 638 What is 47 less than 96? 49 Work out 908 + 0.2182. 908.2182 2.69 + -10 -7.31 Work out -7.55 - 0.082. -7.632 What is 1.716 less than -328? -329.716 Work out 0.3 - 3.874434. -3.574434 Calculate 4563 + -0.4. 4562.6 Calculate -66 - -1.7. -64.3 Work out -15082 + 3. -15079 178118+-0.5 178117.5 Sum -0.3 and -833. -833.3 What is 200.2 plus -0.05? 200.15 Add -27.681 and -104. -131.681 Subtract -60 from -1960. -1900 What is 54 plus 0.1409? 54.1409 What is 58132 less than 0.4? -58131.6 What is -0.5 minus -12.39? 11.89 Sum 120 and 55331. 55451 -48 - -0.015 -47.985 What is -172 + 2.28? -169.72 What is the difference between 1113 and -0.416? 1113.416 What is the distance between -6 and -11.08? 5.08 -0.8406 + 0.29 -0.5506 Add -2.3 and -2.2469. -4.5469 What is 0.06661 take away 15? -14.93339 -3 + 338.08 335.08 6.282+80 86.282 What is -5 minus 4840? -4845 -0.03253 + -7 -7.03253 What is 107 - 220.21? -113.21 What is -43.9 take away 2? -45.9 0.44 + 0.039798 0.479798 Work out 0.04 - 1330. -1329.96 Work out 0.4 - -11.24. 11.64 -0.0749338 - 0.1 -0.1749338 Add together 4 and 34095. 34099 Calculate -0.07295 - 0.07. -0.14295 Calculate 0.4 + 69859.5. 69859.9 Add 235 and -0.351. 234.649 What is 8813785 - 0? 8813785 Add together -255 and 50. -205 What is 3.51 less than -5? -8.51 Put together 0.1 and 121.6. 121.7 -1602.67 - -9 -1593.67 What is -5405 plus -0.3? -5405.3 What is -55455 - 0.18? -55455.18 What is the distance between 257 and 172? 85 Add together -52.1 and 5.6. -46.5 Calculate 15 - -140508. 140523 What is -478 minus 5? -483 What is the distance between 2.198 and -0.1? 2.298 Calculate -0.3 - -110.72. 110.42 What is -5 - 11504? -11509 What is -79 plus -0.301? -79.301 Work out -746402 + 0. -746402 What is the distance between 0.339 and -3.3? 3.639 What is the distance between 9.566 and 13? 3.434 What is -1823 minus 0.1? -1823.1 Calculate -8261 - 0.04. -8261.04 What is -0.62 + 375? 374.38 What is -170 minus 0.9412? -170.9412 Put together 0.028 and -0.05. -0.022 Work out 1 - -20.8. 21.8 Add together 4 and 351008. 351012 Work out -4 - -0.00713. -3.99287 Work out -2 - -382.231. 380.231 What is -6 less than 12.05? 18.05 Add together 138062 and -0.5. 138061.5 Add together -4 and -784. -788 Work out -0.0051 - -0.68. 0.6749 -0.6 + 2 1.4 Work out -988 + 496.8. -491.2 Calculate 65993 + 0.8. 65993.8 Calculate -747.03 - -4. -743.03 Subtract 0.1 from -41069. -41069.1 -2 - -0.0517 -1.9483 What is -4 plus 30566? 30562 Add 5.2008 and -5. 0.2008 What is the distance between -966283 and 0.1? 966283.1 Add together 2.97 and 0.7. 3.67 Total of -156 and 268. 112 Total of -493496 and 0.2. -493495.8 435 + 0.047 435.047 Add 0.74 and -0.0678. 0.6722 Add -0.04 and 13629. 13628.96 Calculate 10573 - 3. 10570 What is -1117 take away 0.0085? -1117.0085 What is 3 minus 680? -677 What is 1.3 less than -0.051097? -1.351097 Put together 22.4 and -0.05. 22.35 Work out 2 + -296. -294 Add -5 and 8.09. 3.09 Add 11 and -5886.8. -5875.8 Sum 5.95 and -0.4. 5.55 What is 11 - -1476.83? 1487.83 0.748+-0.1 0.648 Total of -52 and 1579. 1527 What is -15 minus -13.7? -1.3 Subtract 0.1 from -15.43. -15.53 What is -0.4 minus -551? 550.6 What is 0.1376 take away -115? 115.1376 Subtract 5 from 0.0586136. -4.9413864 0.1 - 60.06 -59.96 What is the distance between -0.167 and 0.8? 0.967 Total of 0.9 and 5.763. 6.663 What is the difference between -0.0435 and -0.0166? 0.0269 What is 6.122 - -17? 23.122 Work out 1394 - -14. 1408 What is 3.36 - 0.013? 3.347 Calculate -48 - 5772. -5820 Subtract 0.06 from -2693.43. -2693.49 Put together 2525.9 and 0.15. 2526.05 What is 10 less than -145099? -145109 What is 0.09 minus 3.73? -3.64 What is -0.3 minus -642? 641.7 Work out -0.038 - 4. -4.038 Work out -57854 - 0.1. -57854.1 -22194.18+-0.5 -22194.68 Work out -0.05 + 256079. 256078.95 Sum 3 and -0.0460573. 2.9539427 What is 0.21 minus -222736? 222736.21 What is 0.0071561 - 0.1? -0.0928439 11+-6.02 4.98 Put together -0.0315208 and -10. -10.0315208 Calculate 6.6 - 368. -361.4 Total of -1 and -4379. -4380 What is 0.0513 plus -6? -5.9487 -0.4 + 24.4 24 158 - -12 170 What is 0.974 less than 2? 1.026 What is 0.1 + -2112? -2111.9 What is -390 minus 17? -407 Sum 0.4 and 284. 284.4 What is -241 less than 15? 256 Subtract 3 from 0.13143. -2.86857 Calculate -999 - -5. -994 -91810 + -4 -91814 What is -0.2 less than -312604? -312603.8 What is 0.0475 + 0.9? 0.9475 25.45+-0.1 25.35 What is -0.104 minus -0.375? 0.271 What is -114375 + -50? -114425 What is -147 plus -8993? -9140 What is -0.1 less than -13549161? -13549160.9 Work out -333 - 12. -345 0.5 - 2.13 -1.63 What is -1310 less than -3? 1307 Subtract -8813 from -2. 8811 What is -3 minus 1888.51? -1891.51 What is the distance between	{ "pile_set_name": "DM Mathematics" }
est value? (a) -0.2 (b) 0.2 (c) -58 (d) 8 (e) -1/4 (f) 0.08 a What is the third biggest value in -35/3, 0.52, 0.5? -35/3 Which is the third biggest value? (a) 0.5 (b) -1716/17 (c) 1/8 (d) 0.2 (e) -2/7 c Which is the fifth biggest value? (a) 3 (b) -3 (c) -0.4 (d) 0.3495 (e) 2 b Which is the third biggest value? (a) 166/3 (b) 8 (c) -0.3 (d) 3 (e) 2/7 (f) -0.1 d What is the third biggest value in -4, -0.6, 5/4, -0.2, -2? -0.6 What is the smallest value in -2/3, 3/8, 20/17, 0.1, -1/2, 0? -2/3 What is the fourth biggest value in 0.152, 0.53, 2, 0.5, -1/8? 0.152 Which is the second biggest value? (a) -116 (b) 43/33 (c) -0.5 (d) -0.1 d What is the fourth biggest value in -2, 11/7, 4, -1, 0.5? -1 What is the fourth smallest value in 2/3, -0.12, 2, 494? 494 What is the smallest value in -0.323, 5/17, -1/3? -1/3 Which is the second smallest value? (a) -1/4 (b) -2779/2 (c) 4 a Which is the third biggest value? (a) 2 (b) -2/3 (c) 7 (d) 1/4 (e) 0.7 e What is the smallest value in -1, 1/4, 277005? -1 What is the fourth biggest value in -19, -0.3, 29/10, -6? -19 What is the smallest value in -4, 5, -177, -13, -5, -0.2? -177 What is the second smallest value in -2/115, 0, 2/333? 0 Which is the biggest value? (a) 22 (b) 0.2227 (c) 11 a Which is the fourth biggest value? (a) -1 (b) -0.2 (c) 48 (d) -270 (e) 1.7 a What is the fifth smallest value in -2/11, -2/515, -6, -0.4, -1/14, 2? -2/515 What is the third smallest value in -3/4, -1/4, 373, 5? 5 Which is the smallest value? (a) 5.5 (b) 2 (c) -0.1 (d) 10 (e) -196 (f) 0.1 e What is the third biggest value in 77.6, -87, -6? -87 What is the third smallest value in 0, -16, 1/9, -25? 0 What is the biggest value in 0.01, 5, -8, -0.4, 2/13, 232? 232 What is the second smallest value in -4428, -0.01, -2, -0.5? -2 What is the second smallest value in -3, -470, 0.3, 2/7, 0.005? -3 Which is the sixth biggest value? (a) 0.11 (b) -2 (c) -0.7 (d) -5 (e) 3.7 (f) 0 d Which is the fourth biggest value? (a) -2 (b) 5 (c) -6 (d) -37 (e) -12 e What is the second biggest value in -0.7, 4, -0.167, 5? 4 Which is the fourth biggest value? (a) -1/9 (b) -5 (c) -1 (d) 3 (e) 237/5 (f) -4/7 f Which is the third smallest value? (a) -2.581 (b) -0.15 (c) -7 b Which is the biggest value? (a) -5 (b) -119 (c) -13 (d) -6 a Which is the third biggest value? (a) -2857 (b) -2/15 (c) -3/5 (d) -4 d Which is the second biggest value? (a) 0 (b) 227 (c) -2/3 (d) -3/5 (e) -20 a What is the fourth smallest value in 0.2, -1435.1, 3, -3? 3 Which is the fourth biggest value? (a) 4 (b) -18/1909 (c) -0.06 (d) 3/2 c Which is the fourth smallest value? (a) 5 (b) 222/223 (c) -1/6 (d) -1/9 a Which is the second smallest value? (a) 4/11 (b) 1534 (c) -0.2 (d) -1/3 c What is the fifth smallest value in 3, 0.01, -2/7, 1, -1/2, -1/4? 1 Which is the third biggest value? (a) -3 (b) 170169 (c) -0.4 (d) -4 (e) 1/4 c What is the fourth biggest value in -10/3, 1, 3, 16, -0.5, -6? -0.5 Which is the second biggest value? (a) 40/7 (b) -0.3 (c) 0.0397 (d) 2 d What is the second smallest value in -30, 206, -0.3? -0.3 What is the second smallest value in 0.24, -27, 467? 0.24 What is the smallest value in 5, -4/15, -1.7, 4, 0.3? -1.7 Which is the second biggest value? (a) 0.3 (b) -0.072 (c) -0.05 (d) 29/4 a What is the biggest value in -38/21, -0.8, 0.1, -9? 0.1 What is the third biggest value in -1, -17, -57? -57 Which is the fourth biggest value? (a) -1/2296 (b) 0.8 (c) -0.3 (d) 1 c What is the second smallest value in 57, 9, 1/34? 9 What is the fifth smallest value in 0.3, -4/5, -5, 890, -2? 890 Which is the smallest value? (a) 0.045 (b) 5 (c) -0.04184 c Which is the biggest value? (a) 0.05 (b) 0.2 (c) -3 (d) -1/3 (e) 0.1 b What is the third biggest value in 43, 48/41, 1/6? 1/6 What is the fifth biggest value in 3/28, 2/19, 6, -2, -1/35? -2 Which is the second smallest value? (a) 0.8585 (b) -6 (c) 3 a What is the fifth smallest value in -0.1, -0.5, 2/11, 1425, -2/253? 1425 What is the third biggest value in -0.05044, 0, -3? -3 Which is the second smallest value? (a) 1/9 (b) 1/2 (c) 23162 b Which is the second biggest value? (a) -1.04 (b) -391/4 (c) -0.4 (d) -0.1 c Which is the third smallest value? (a) 0 (b) -29.09 (c) -9 a What is the fourth smallest value in -0.3, 0.3, -8532, 10? 10 What is the smallest value in -2/15, 1900, 0, -5? -5 Which is the fourth smallest value? (a) -0.4 (b) -0.07 (c) -2 (d) 1/3 (e) -2/35 e Which is the fourth biggest value? (a) -227 (b) -5.1 (c) -1 (d) 104 a What is the smallest value in 9, -94/9, 19? -94/9 Which is the smallest value? (a) 1 (b) -5 (c) -1 (d) 0.06 (e) -4 (f) -119 f What is the smallest value in -351, -1670, -0.3? -1670 What is the fifth biggest value in 131, -0.5, 6/11, 1/5, 1/2? -0.5 Which is the fifth smallest value? (a) 1/48 (b) -2/5 (c) 2 (d) 25/4 (e) -3 (f) 5 f Which is the third smallest value? (a) -70 (b) 3/7 (c) 4 (d) -0.18 b What is the smallest value in -1/4, 5091/7, 4/3, 0, 5? -1/4 What is the third smallest value in -4, 1/6, 0.1, -0.4, -0.05923? -0.05923 What is the second smallest value in -7, -3/7, 9/7, -8/19? -3/7 What is the third biggest value in -5, 0.1, 44/9? -5 What is the third smallest value in -8/9, -18, -5, 0, 132, -1/2? -8/9 Which is the second smallest value? (a) 179397 (b) -5/3 (c) 0.5 (d) -1/4 (e) -4 b Which is the biggest value? (a) 2/43 (b) 5 (c) 0.2 (d) 371 (e) -2 d Which is the second biggest value? (a) -490 (b) -5 (c) 118 b What is the third smallest value in 5/2, 67, -6, -1/5? 5/2 What is the fourth biggest value in 31, 0.0358, 4, -3/5? -3/5 Which is the smallest value? (a) 221 (b) 4 (c) -10 (d) -9 (e) 0 (f) -5 c What is the second smallest value in -1, 2, -1990, 8? -1 What is the fourth biggest value in -13, 1/9, 60, 11, -1? -1 Which is the third biggest value? (a) 0.5 (b) 0.3 (c) -0.1 (d) 653 (e) 0.11 (f) 2/9 b What is the biggest value in 3, 4/5, 0, -6.043? 3 What is the fourth biggest value in -3, -12, 7, -0.38, 2/13, -4? -3 What is the fourth biggest value in 0.3, 0, -663, -1/14, 6/11? -1/14 What is the third biggest value in -2/441, -21, -0.4? -21 What is the fourth biggest value in -0.09, 0.06, 0.4, -702, -0.4, 2/11? -0.09 Which is the second smallest value? (a) -2 (b) -2109 (c) 4 (d) 1/6 a What is the fifth biggest value in 0.5, -2/25, 3, 2/17, -72? -72 Which is the biggest value? (a) -0.5 (b) 3/5 (c) -2/11 (d) 1/3 (e) -92/17 b Which is the third smallest value? (a) -0.2 (b) -2 (c) 10.5 (d) 0.05 d Which is the second biggest value? (a) 2/9 (b) 94896 (c) -3/4 a Which is the fifth smallest value? (a) 1/4 (b) -1/2 (c) -0.3 (d) 5 (e) 253 (f) -4/5 d What is the third smallest value in -2/11, -0.5, 0.2, -0.3, -53, 265? -0.3 Which is the fifth biggest value? (a) 11/3 (b) -3 (c) -3/5 (d) -73 (e) -0.1 d What is the second biggest value in 2, -4, 5, 64? 5 Which is the smallest value? (a) -31.4787 (b) 1/3 (c) -0.5 a What is the third biggest value in 0.2, -3, -3/7, -0.01, -29? -3/7 What is the smallest value in 4, 1, 0.4, -5, 1450? -5 What is the fourth smallest value in -3.4, -1, -0.17, -2/3, 7/3? -0.17 Which is the second biggest value? (a) 29484 (b) -5 (c) -0.2 c Which is the third smallest value? (a) 6/7 (b) 1/6 (c) 85093 (d) 2 d What is the second biggest value in 2/203, 0, -1/4, 2/21? 2/203 What is the second biggest value in -0.3, -10, -3.44, 2/5, -0.5? -0.3 What is the smallest value in -19234, 0, 15? -19234 What is the fifth biggest value in -3, -2/25, -1/2, -1/52, 2? -3 Which is the fourth biggest value? (a) -4 (b) -0.4 (c) 30.311 (d) 1 a What is the smallest value in 9, 1/2, -1.4, -2, -0.01? -2 Which is the second smallest value? (a) -151/10 (b) 9 (c) 4 c Which is the fourth biggest value? (a) 3 (b) 2/11 (c) -2.66 (d) -12 (e) 1/8 (f) -0.2 f Which is the third smallest value? (a) -4 (b) 0.3 (c) -11956 (d) -1/3 d What is the second smallest value in -1, -0.02, -67/3, 41? -1 Which is the second smallest value? (a) -11/13 (b) 0.9 (c) 0.1 (d) 0.29 c What is the smallest value in 1, -10203, 0.4? -10203 What is the smallest value in 761, -5, 0.072? -5 Which is the	{ "pile_set_name": "DM Mathematics" }
68 divided by -2. 84 Calculate -2220 divided by -2. 1110 What is 192 divided by 6? 32 Divide 3 by 24. 1/8 What is 47 divided by -1? -47 Calculate -1 divided by -2407. 1/2407 3 divided by -4 -3/4 What is 315 divided by -5? -63 Calculate 854 divided by 122. 7 Calculate 672 divided by 48. 14 What is 320 divided by -40? -8 Divide -1032 by 5. -1032/5 -120 divided by -3 40 Calculate 3 divided by 27. 1/9 Divide 13616 by 1702. 8 Divide -164 by 1. -164 What is 550 divided by -4? -275/2 What is -23 divided by 13? -23/13 Calculate -249 divided by 83. -3 -196 divided by -14 14 What is -882 divided by -14? 63 Calculate 32 divided by -13. -32/13 Calculate 14 divided by -35. -2/5 Calculate -10 divided by 283. -10/283 What is 1 divided by -40? -1/40 7252 divided by 3626 2 Calculate 76 divided by -28. -19/7 What is 5892 divided by -1473? -4 What is -25 divided by 2? -25/2 What is 14781 divided by 3? 4927 Divide 27173 by 1. 27173 2 divided by -350 -1/175 15 divided by 85 3/17 Calculate -3 divided by -46. 3/46 112 divided by 2 56 Calculate -5 divided by 3015. -1/603 What is 0 divided by 4739? 0 Calculate 136 divided by 136. 1 Divide -6 by 10. -3/5 1933 divided by 8 1933/8 3 divided by -56 -3/56 Calculate 39 divided by -3. -13 What is -2 divided by -140? 1/70 Calculate 2466 divided by -3. -822 What is -1 divided by 116? -1/116 660 divided by -330 -2 715 divided by -65 -11 What is -3 divided by 3? -1 Calculate 8286 divided by 6. 1381 -438 divided by -146 3 What is 3 divided by 3035? 3/3035 20385 divided by 9 2265 Divide 6861 by 3. 2287 What is -21 divided by 11? -21/11 Divide 1190 by -85. -14 -2916 divided by -36 81 Calculate -440 divided by 440. -1 Calculate 124 divided by -31. -4 -1200 divided by 6 -200 What is 10530 divided by 390? 27 Divide 1845 by 15. 123 -30 divided by -2 15 What is -472 divided by 1? -472 What is 3396 divided by -3? -1132 Divide 28 by 2. 14 Divide 103080 by -6. -17180 Divide -382 by -191. 2 Calculate 320 divided by 80. 4 -32 divided by -67 32/67 1806 divided by 6 301 What is -42 divided by 7? -6 Divide -1085 by 2. -1085/2 Divide 7 by -716. -7/716 What is -4190 divided by 1? -4190 Divide -2185 by -23. 95 Calculate 0 divided by 181. 0 Divide 255 by -51. -5 What is -7 divided by -51? 7/51 203 divided by 6 203/6 Divide 583 by -11. -53 What is 203 divided by 5? 203/5 53316 divided by -6 -8886 Divide 91 by -1. -91 Divide 4 by 137. 4/137 Calculate 244 divided by -2. -122 9156 divided by -6 -1526 Calculate -264 divided by -3. 88 Calculate -558 divided by 93. -6 Calculate 1255 divided by 251. 5 Calculate -4 divided by -118. 2/59 Divide 14 by -36. -7/18 652 divided by 326 2 What is -6 divided by -12? 1/2 Divide -4 by -141. 4/141 Calculate 85 divided by 17. 5 -208 divided by -2 104 Calculate 3 divided by 48. 1/16 -4980 divided by -249 20 Divide 72 by -18. -4 Calculate 45393 divided by 3. 15131 What is -4 divided by -17? 4/17 What is -3510 divided by -3? 1170 Divide 4 by -49. -4/49 14 divided by 32 7/16 Calculate -173 divided by -1. 173 What is 50 divided by 25? 2 Divide 1836 by 27. 68 Calculate 362 divided by 6. 181/3 Calculate 48 divided by 24. 2 984 divided by -4 -246 What is 15 divided by -801? -5/267 Divide -7 by 19. -7/19 What is 7 divided by 75? 7/75 What is -460 divided by 23? -20 What is -8 divided by -8? 1 Calculate -13 divided by -30. 13/30 What is 0 divided by 793? 0 Divide -174 by 3. -58 1026 divided by -2 -513 334 divided by 25 334/25 What is -5 divided by -8? 5/8 What is -121 divided by 1? -121 Divide -957 by 319. -3 43 divided by 120 43/120 Divide 6 by 3. 2 What is -2248 divided by -562? 4 Divide 2205 by 315. 7 420 divided by 5 84 Divide -5 by -103. 5/103 -2 divided by 337 -2/337 -3 divided by -499 3/499 -1229 divided by 4 -1229/4 Divide -3160 by 10. -316 4151 divided by -7 -593 -395 divided by 79 -5 What is 8 divided by -103? -8/103 7392 divided by 6 1232 -168 divided by -7 24 Divide -33444 by 6. -5574 Divide 1716 by 4. 429 -25398 divided by -6 4233 Calculate -5261 divided by 5. -5261/5 Divide -100 by 95. -20/19 Calculate -3204 divided by 6. -534 Divide 13 by 17. 13/17 What is 5 divided by 3? 5/3 Calculate 10 divided by -3. -10/3 344 divided by -4 -86 What is -2824 divided by 1412? -2 -4 divided by 2733 -4/2733 What is 4 divided by -4? -1 -506 divided by -253 2 Divide -288 by 96. -3 Calculate 45 divided by 9. 5 What is -343 divided by -2? 343/2 What is -4 divided by 15? -4/15 Divide -3 by 618. -1/206 What is -502 divided by 5? -502/5 What is -1610 divided by -322? 5 Calculate -2816 divided by 352. -8 Divide -38015 by 5. -7603 Divide -12036 by -4. 3009 Divide 467 by 1. 467 Calculate -40 divided by 10. -4 1860 divided by 15 124 -4 divided by 31 -4/31 Divide -9 by 13. -9/13 Divide 3225 by 3. 1075 What is 329 divided by -1? -329 -4158 divided by 27 -154 Calculate 8 divided by -418. -4/209 Calculate -101 divided by 27. -101/27 Calculate -7895 divided by 5. -1579 Divide 22554 by -63. -358 Calculate 324 divided by 4. 81 What is -472 divided by 2? -236 What is -1710 divided by 19? -90 -4 divided by 58 -2/29 Calculate 5 divided by -32. -5/32 Divide -72 by -5. 72/5 Calculate 1093 divided by 9. 1093/9 Calculate -608 divided by -76. 8 Divide 340 by -68. -5 What is 2766 divided by 1383? 2 Divide -7188 by 2396. -3 Calculate 175 divided by -58. -175/58 Calculate -1782 divided by 2. -891 What is 0 divided by 51? 0 What is -2322 divided by 774? -3 What is 5 divided by -31? -5/31 Calculate 78 divided by 6. 13 Calculate 13 divided by 3. 13/3 What is 1789 divided by -1? -1789 What is 310 divided by 10? 31 Divide -4 by 36. -1/9 What is -2860 divided by -22? 130 Calculate -1805 divided by 5. -361 9 divided by 74 9/74 Divide 994 by 142. 7 -63 divided by -7 9 Divide -847 by -77. 11 Calculate -4 divided by -2934. 2/1467 Divide -36 by 36. -1 What is 4 divided by 1? 4 Divide 4 by -71. -4/71 2870 divided by -6 -1435/3 Divide 0 by 4477. 0 Calculate -258 divided by 3. -86 What is 1134 divided by 42? 27 Divide 6330 by 6330. 1 Divide 138 by -2. -69 What is 5049 divided by -187? -27 What is 1758 divided by -586? -3 Divide 107 by -5. -107/5 Calculate -12 divided by -10. 6/5 What is 29110 divided by -4? -14555/2 -1 divided by -85 1/85 Calculate 47 divided by -4. -47/4 4695 divided by -3 -1565 129 divided by -41 -129/41 286 divided by -2 -143 -9 divided by -31 9/31 648 divided by 216 3 What is 1 divided by 918? 1/918 What is -3 divided by -30? 1/10 Calculate 2862 divided by -3. -954 Divide 234 by -7. -234/7 -5950 divided by 1190 -5 What is 7042 divided by -14? -503 -40 divided by 1 -40 1 divided by -36 -1/36 Calculate -2 divided by -5. 2/5 -4074 divided by -2 2037 Calculate 1827 divided by -609. -3 12 divided by 5 12/5 Calculate 4784 divided by 26. 184 -13066 divided by 94 -139 Divide 2 by -66. -1/33 -130 divided by 6 -65/3 Divide -3 by 238. -3/238 What is 31920 divided by 5? 6384 Divide 28 by 125. 28/125 What is 1306 divided by -1? -1306 Divide -14100 by -235. 60 5 divided by -146 -5/146 What is 1535 divided by 5? 307 Calculate -3 divided by 6. -1/2 Divide 618 by 3. 206 2 divided by -1053 -2/1053 -64 divided by 6 -32/3 What is 1265 divided by 4? 1265/4 Calculate 73 divided by 19. 73/19 Divide 2 by 131. 2/131 Calculate 455 divided by -5. -91 150 divided by -50 -3 23 divided by 23 1 What is 1 divided by -21? -1/21 -48 divided by -2 24 Calculate 218 divided by 12. 109/6 Divide 38400 by 30. 1280 What is -181 divided by -4? 181/4 Calculate 19820 divided by -3964. -5 Divide -11258 by 13. -866 Divide -54 by -18. 3 Calculate -3474 divided by 6. -579 Divide 58 by -5. -58/5 What is -655 divided by -131? 5 -762 divided by -6 127 1980 divided by 2 990 Calculate 1826 divided by 22. 83 Divide -30 by -424. 15/212 What is -1032 divided by 6? -172 Divide -5065 by 5. -1013 -121 divided by -5 121/5 Divide 91 by 21. 13/3 Calculate -1 divided by 32. -1/32 What is -6 divided by 96? -1/16 -204 divided by 4 -51 -2124 divided by 59 -36 What is 7088 divided by 3544? 2 Calculate -429 divided by 11. -39 Divide -1740 by -348. 5 Divide -1626 by 3. -542 11 divided by -32 -11/32 Divide 160 by 6. 80/3 Calculate 17 divided by -110. -17/110 Divide 2686 by -5. -2686/5 Calculate -95 divided by 19. -5 What is 33970 divided by -4? -16985/2 Divide -4482 by -6. 747 Divide -448 by -28. 16 Divide -45 by -8.	{ "pile_set_name": "DM Mathematics" }
se 4) to base 2 -110010000111001 -155b7 (base 12) to base 7 -154102 Convert 1197a (base 11) to base 10. 17148 What is 3282 (base 11) in base 7? 15416 4335 (base 6) to base 13 5b7 Convert 2af (base 16) to base 3. 221110 What is 73736 (base 8) in base 5? 1440221 -4789 (base 12) to base 15 -25a0 Convert badf (base 16) to base 15. e294 What is -47a8 (base 12) in base 3? -102001002 2174 (base 13) to base 3 20101112 2222 (base 5) to base 16 138 Convert 31818 (base 9) to base 15. 63a2 Convert 4b2 (base 15) to base 5. 13232 1202211220 (base 3) to base 13 12b52 Convert 1100011001110111 (base 2) to base 9. 76622 What is bc8b (base 16) in base 14? 13839 120012101 (base 3) to base 12 64b4 Convert -2360 (base 8) to base 14. -664 -12331 (base 6) to base 10 -1855 What is 1ba7 (base 15) in base 11? 4571 What is -ab (base 12) in base 10? -131 1010111 (base 3) to base 16 337 195e (base 15) to base 2 1010101110001 What is 14314 (base 5) in base 14? 625 What is -1210220 (base 3) in base 6? -10040 a41a (base 15) to base 5 2102200 3435 (base 13) to base 3 101000210 What is ab87 (base 14) in base 13? 106aa 94e0 (base 16) to base 12 1a080 Convert -34434 (base 6) to base 2. -1001100110110 What is -5122 (base 9) in base 11? -28a6 What is -306 (base 13) in base 8? -1001 What is -36420 (base 7) in base 2? -10010011111111 What is -3495 (base 14) in base 16? -23bb What is 652 (base 15) in base 10? 1427 Convert 10111210 (base 3) to base 9. 3453 What is -113303 (base 4) in base 7? -4304 Convert 3af3 (base 16) to base 8. 35363 Convert -1110100111010 (base 2) to base 6. -54350 What is -271 (base 15) in base 10? -556 10100 (base 3) to base 5 330 What is -1323123 (base 4) in base 3? -101211120 1520 (base 8) to base 15 3b8 What is -1499 (base 16) in base 6? -40225 What is -21204 (base 5) in base 14? -741 Convert 2229 (base 12) to base 5. 110102 What is 68aa (base 13) in base 9? 22114 Convert 1100110010110 (base 2) to base 8. 14626 54130 (base 7) to base 13 6175 What is -4313 (base 11) in base 3? -21211011 Convert -2491 (base 10) to base 3. -10102021 Convert -2303 (base 7) to base 13. -4c4 -904 (base 16) to base 2 -100100000100 Convert 32414 (base 8) to base 6. 142512 What is -71b9 (base 13) in base 10? -15700 What is 296a (base 13) in base 9? 8210 Convert 210312 (base 4) to base 16. 936 22055 (base 8) to base 14 3537 -4244 (base 5) to base 11 -482 What is 4424040 (base 5) in base 9? 126270 Convert -150155 (base 8) to base 4. -31001231 Convert 288 (base 14) to base 9. 628 -5152 (base 11) to base 8 -15261 What is -330234 (base 6) in base 11? -19578 25544 (base 6) to base 3 12022201 Convert -1210100 (base 3) to base 7. -3543 Convert 1113 (base 4) to base 15. 5c What is 11110001101110 (base 2) in base 9? 23188 -2222100 (base 4) to base 8 -25220 What is 2122020110 (base 3) in base 11? 36022 What is -1122 (base 5) in base 11? -138 Convert 169 (base 10) to base 5. 1134 -5a6 (base 13) to base 10 -981 Convert 5412 (base 12) to base 9. 13585 Convert -11212333 (base 4) to base 2. -101100110111111 What is 101201 (base 3) in base 2? 100100001 -22667 (base 9) to base 6 -154011 Convert -125041 (base 6) to base 15. -35ed What is -11b7 (base 12) in base 6? -13151 Convert -343423 (base 6) to base 14. -a983 Convert -111111010001001 (base 2) to base 14. -bb3b Convert 819 (base 12) to base 10. 1173 Convert -24a1 (base 12) to base 4. -1000321 -12211 (base 3) to base 8 -235 What is -15521 (base 8) in base 5? -210433 Convert -22c (base 13) to base 7. -1045 What is -6103 (base 8) in base 11? -23a4 What is -1447 (base 9) in base 4? -101020 1121 (base 6) to base 2 100001001 What is -602 (base 11) in base 13? -440 Convert -2142 (base 6) to base 15. -22e Convert 2189 (base 11) to base 7. 11253 32054 (base 6) to base 13 1c9c Convert -102201021 (base 3) to base 8. -20533 11010101001 (base 2) to base 5 23310 What is -110003 (base 4) in base 3? -1202112 54244 (base 6) to base 8 16424 -560 (base 16) to base 4 -111200 30340 (base 5) to base 11 1531 70016 (base 9) to base 10 45942 What is 11120012 (base 3) in base 6? 23222 Convert 1100453 (base 6) to base 8. 152521 Convert 4eb (base 15) to base 8. 2141 Convert 2456 (base 13) to base 3. 21001102 What is 1426 (base 7) in base 8? 1057 What is 1010001010101 (base 2) in base 15? 1820 What is -7383 (base 9) in base 7? -21543 Convert 10111011010010 (base 2) to base 13. 55c0 What is -722 (base 14) in base 15? -637 Convert 8b53 (base 12) to base 11. 10695 -15623 (base 12) to base 6 -352043 Convert 1001001110 (base 2) to base 7. 1502 What is -1414 (base 5) in base 3? -22200 What is 221011 (base 3) in base 16? 2a7 What is -4773 (base 9) in base 6? -24233 48 (base 11) to base 4 310 What is 2403 (base 7) in base 8? 1565 -32755 (base 8) to base 9 -20838 Convert 358 (base 10) to base 6. 1354 Convert 1211001 (base 3) to base 15. 5d4 Convert -1452a (base 11) to base 15. -6187 -24c (base 14) to base 13 -295 16736 (base 9) to base 15 3640 Convert 2f42 (base 16) to base 15. 38b8 What is -5a5 (base 11) in base 13? -435 What is -49a9a (base 11) in base 15? -1645c -13489 (base 10) to base 13 -61a8 What is 14510 (base 6) in base 16? 92a 1125553 (base 6) to base 10 58317 -110222 (base 3) to base 14 -1b0 Convert -240 (base 13) to base 3. -112110 Convert -106 (base 10) to base 8. -152 154 (base 10) to base 9 181 -10120101 (base 3) to base 5 -40402 14380 (base 9) to base 12 5800 What is 4364 (base 16) in base 2? 100001101100100 -319 (base 12) to base 9 -553 What is -2dc7 (base 15) in base 13? -4648 -934 (base 12) to base 16 -538 What is 100001010011 (base 2) in base 16? 853 18c53 (base 14) to base 15 13913 3110 (base 5) to base 9 500 Convert -7074 (base 9) to base 11. -3980 Convert -11737 (base 10) to base 4. -2313121 Convert 100111 (base 2) to base 11. 36 What is 114423 (base 5) in base 7? 15502 Convert -1110101111111110 (base 2) to base 9. -101776 -11246 (base 11) to base 7 -65263 What is -100003 (base 4) in base 13? -610 What is -342 (base 8) in base 12? -16a Convert -4677 (base 10) to base 4. -1021011 Convert -28 (base 14) to base 3. -1100 What is 12245 (base 9) in base 8? 20036 Convert 230b (base 12) to base 7. 14240 What is 110010212 (base 3) in base 12? 5158 9d9 (base 15) to base 5 32404 Convert -1107 (base 10) to base 6. -5043 Convert 3120 (base 6) to base 14. 37a Convert 1240 (base 9) to base 4. 32133 -21313 (base 4) to base 7 -1561 What is 120111122 (base 3) in base 4? 2300213 34a (base 15) to base 16 2e9 1093 (base 16) to base 8 10223 110130232 (base 4) to base 8 243456 210222 (base 3) to base 13 368 What is 656 (base 9) in base 16? 219 What is -366 (base 13) in base 10? -591 110111101 (base 2) to base 11 375 1590 (base 11) to base 2 11111110011 What is 103411 (base 5) in base 11? 2789 -11441 (base 5) to base 7 -2353 -d4a (base 16) to base 10 -3402 -12003 (base 4) to base 15 -1ac Convert -70752 (base 9) to base 6. -555245 -32434 (base 6) to base 8 -10606 Convert 42b2 (base 14) to base 10. 11524 -22011 (base 5) to base 7 -4251 Convert e45b (base 15) to base 13. 18c56 What is 6111 (base 7) in base 13? c69 What is -17264 (base 13) in base 5? -2404420 What is 13134 (base 5) in base 11? 86a -58b (base 13) to base 14 -4c8 Convert -2064 (base 10) to base 6. -13320 Convert 61504 (base 9) to base 10. 40504 -11301 (base 4) to base 6 -1413 What is 3031 (base 4) in base 6? 541 1320213 (base 5) to base 8 63304 10102122 (base 3) to base 14 ca9 Convert 201 (base 14) to base 3. 112120 What is -1303 (base 12) in base 14? -b07 -4415 (base 10) to base 12 -267b Convert -235 (base 13) to base 10. -382 What is -9200 (base 12) in base 10? -15840 -383 (base 15) to base 6 -3410 Convert 1033 (base 11) to base 13. 812 What is -21020202 (base 3) in base 13? -2537 11110010010100 (base 2) to base 5 444013 Convert 4b5 (base 16) to base 10. 1205 Convert 30210 (base 4) to base 15. 389 What is 1141 (base 5) in base 14? c3 Convert -14248 (base 9) to base 4. -2113103 -4420 (base 12) to base 10 -7512 Convert -35523 (base 6) to base 9. -7066 a548 (base 11) to base 2 11011010001111 Convert 345 (base 8) to base 15. 104 What is -7617 (base 8) in base 12? -237b Convert 2044 (base 6) to base 5. 3320 What is -1011111110100 (base 2) in base 9? -8363 -314 (base 5) to base 11 -77 What is 1100011101000000 (base 2) in base 1	{ "pile_set_name": "DM Mathematics" }
etters picked without replacement from ggwwwobwowwwwowwwww. 13/171 Three letters picked without replacement from gagaggg. Give prob of sequence aag. 1/21 What is prob of sequence xcpx when four letters picked without replacement from peeeepepxppxcexe? 1/1456 Two letters picked without replacement from {v: 13, a: 3, e: 3}. Give prob of sequence ee. 1/57 Calculate prob of sequence ii when two letters picked without replacement from mrrrriirrmmrrrr. 1/105 Calculate prob of sequence qn when two letters picked without replacement from qqn. 1/3 Calculate prob of sequence ssoo when four letters picked without replacement from {o: 10, s: 9}. 45/646 Calculate prob of sequence ze when two letters picked without replacement from {z: 2, e: 4, f: 2}. 1/7 What is prob of sequence nx when two letters picked without replacement from mnxxmnnnm? 1/9 What is prob of sequence kwdk when four letters picked without replacement from {d: 1, k: 2, w: 4}? 1/105 What is prob of sequence mffm when four letters picked without replacement from fmffmmmfmfmmf? 21/286 Four letters picked without replacement from {j: 4, i: 7, x: 2, m: 2, z: 5}. Give prob of sequence ixzx. 7/11628 Two letters picked without replacement from evkeeekeevehvk. What is prob of sequence he? 1/26 Two letters picked without replacement from yiqyixe. What is prob of sequence qy? 1/21 Two letters picked without replacement from wtttwjw. What is prob of sequence tw? 3/14 Two letters picked without replacement from {a: 4, r: 5, c: 1}. Give prob of sequence ac. 2/45 Two letters picked without replacement from {w: 1, j: 4, d: 2}. Give prob of sequence jw. 2/21 Calculate prob of sequence peeq when four letters picked without replacement from {e: 1, q: 2, p: 1}. 0 What is prob of sequence eep when three letters picked without replacement from eeepeeeeeeeeeeeeeee? 1/19 Three letters picked without replacement from kiinikiinkteni. What is prob of sequence kin? 9/364 Two letters picked without replacement from {m: 16, d: 2}. Give prob of sequence mm. 40/51 What is prob of sequence lm when two letters picked without replacement from lllmc? 3/20 Two letters picked without replacement from {w: 6, v: 6}. What is prob of sequence wv? 3/11 Two letters picked without replacement from eqwqjtm. Give prob of sequence qq. 1/21 Two letters picked without replacement from wwwwwjjwwwwwwwwjwwww. Give prob of sequence jw. 51/380 What is prob of sequence lfll when four letters picked without replacement from {w: 2, u: 8, f: 3, l: 4}? 3/2380 What is prob of sequence vo when two letters picked without replacement from vvyov? 3/20 Three letters picked without replacement from jmjjmmm. Give prob of sequence jmj. 4/35 Calculate prob of sequence ut when two letters picked without replacement from tcu. 1/6 Three letters picked without replacement from {l: 1, e: 2, a: 3, j: 5, u: 1}. What is prob of sequence ujj? 1/66 Three letters picked without replacement from {g: 5, b: 4, q: 7, p: 3}. What is prob of sequence bpg? 10/969 What is prob of sequence lp when two letters picked without replacement from mmmmmmmmplmmm? 1/156 Calculate prob of sequence ggk when three letters picked without replacement from ggkggjkkjgkgkg. 5/52 Calculate prob of sequence ee when two letters picked without replacement from veveev. 1/5 What is prob of sequence kx when two letters picked without replacement from xkycx? 1/10 Calculate prob of sequence llb when three letters picked without replacement from blblbllbblllbbblbbl. 40/323 Two letters picked without replacement from tttttbbbbtqtqtqb. Give prob of sequence tt. 7/30 Three letters picked without replacement from {j: 4, e: 3, h: 2}. Give prob of sequence ejh. 1/21 Calculate prob of sequence py when two letters picked without replacement from pypyp. 3/10 What is prob of sequence vsuz when four letters picked without replacement from fsfvfvfzfvfvvvvuf? 1/8160 Three letters picked without replacement from awhanwnnnnwaawwwanan. What is prob of sequence hwn? 7/1140 Calculate prob of sequence bbib when four letters picked without replacement from ibbbbbbbbibiiibbbib. 143/1292 Three letters picked without replacement from ppppcppccppppc. Give prob of sequence pcc. 5/91 Calculate prob of sequence sss when three letters picked without replacement from {v: 1, w: 6, s: 7}. 5/52 Calculate prob of sequence pd when two letters picked without replacement from nrdpk. 1/20 Four letters picked without replacement from rrhhrdyrb. What is prob of sequence drby? 1/756 What is prob of sequence ssq when three letters picked without replacement from sycyyqqcqqcscccsqccc? 1/228 Four letters picked without replacement from sbsmbssmaasa. Give prob of sequence aama. 1/990 Calculate prob of sequence fkk when three letters picked without replacement from {k: 10, f: 4}. 15/91 Two letters picked without replacement from {h: 1, u: 1, e: 3, v: 1, q: 2, f: 5}. What is prob of sequence ve? 1/52 Calculate prob of sequence bb when two letters picked without replacement from {b: 2, p: 4, v: 3, e: 10}. 1/171 What is prob of sequence ztd when three letters picked without replacement from dtzqr? 1/60 Four letters picked without replacement from {j: 6, i: 3, z: 1, x: 2, v: 5}. Give prob of sequence xvix. 1/1904 What is prob of sequence drrr when four letters picked without replacement from {r: 3, d: 11}? 1/364 What is prob of sequence yuz when three letters picked without replacement from {z: 3, y: 1, u: 1}? 1/20 What is prob of sequence nnn when three letters picked without replacement from {q: 1, m: 4, n: 6}? 4/33 Calculate prob of sequence uk when two letters picked without replacement from {k: 1, l: 4, q: 2, u: 2, h: 5}. 1/91 Three letters picked without replacement from wweewwwwwwweww. Give prob of sequence ewe. 11/364 Four letters picked without replacement from rersseesrrsrsssrre. What is prob of sequence eeer? 7/3060 Two letters picked without replacement from qlwxqqqwx. What is prob of sequence wx? 1/18 Two letters picked without replacement from {q: 3, j: 4, d: 6}. What is prob of sequence dd? 5/26 Calculate prob of sequence uh when two letters picked without replacement from {w: 1, u: 3, h: 16}. 12/95 Three letters picked without replacement from iswssiiswsiiiissww. What is prob of sequence wii? 7/204 Two letters picked without replacement from nwxjxsnk. Give prob of sequence ws. 1/56 Four letters picked without replacement from {x: 8, z: 2, m: 2, i: 1}. What is prob of sequence xmxx? 28/715 Four letters picked without replacement from lalmmalmlfafmammmf. What is prob of sequence flfl? 1/1020 Calculate prob of sequence hwqd when four letters picked without replacement from wqddrhqqcdqdqrqr. 1/1820 What is prob of sequence qyy when three letters picked without replacement from {n: 5, q: 2, y: 3, w: 5, e: 5}? 1/570 Three letters picked without replacement from trtjjjttrrtrjtt. Give prob of sequence rjj. 8/455 Three letters picked without replacement from {b: 1, s: 1, e: 2, m: 1}. Give prob of sequence sem. 1/30 What is prob of sequence fe when two letters picked without replacement from {f: 1, e: 2, i: 1, a: 1}? 1/10 Calculate prob of sequence yj when two letters picked without replacement from pyqjjsjycyyspq. 6/91 Three letters picked without replacement from qqqqqqmwqmqmwmmumqqm. What is prob of sequence wmu? 7/3420 What is prob of sequence myh when three letters picked without replacement from hhmhmhymhmmhhmh? 8/455 Calculate prob of sequence mxl when three letters picked without replacement from glmgxmj. 1/105 What is prob of sequence uhhs when four letters picked without replacement from huhssw? 1/90 What is prob of sequence cs when two letters picked without replacement from {s: 3, v: 2, c: 2, b: 8}? 1/35 Calculate prob of sequence hi when two letters picked without replacement from nhhnhhnnhniiinin. 1/12 Calculate prob of sequence ffff when four letters picked without replacement from {q: 2, g: 2, f: 11}. 22/91 Calculate prob of sequence aa when two letters picked without replacement from {s: 3, r: 1, a: 2, f: 4, u: 4, w: 1}. 1/105 Four letters picked without replacement from mdddmhmd. What is prob of sequence dmdm? 3/70 Four letters picked without replacement from {m: 7, t: 2, n: 7, r: 3}. What is prob of sequence rmnm? 49/5168	{ "pile_set_name": "DM Mathematics" }
+ 3l(i). i2 - 33i - 2 Let m(j) = 2j2 + 24j + 5. Let p(u) = u*2 + 16u + 3. Give 5m(v) - 8p(v). 2v2 - 8v + 1 Let c(h) = 6h + 2h - 4h - 5h - 1. Let r(a) = -4a - 1. Suppose 5x - 12 = x. Give xc(z) - r(z). z - 2 Let j = 10 + -6. Suppose 8 = -jr + 6r. Let i(q) = 16q + 6. Let g(u) = 3u + 1. What is ri(w) - 22g(w)? -2w + 2 Let p(g) = 5g2 - 3. Let j(q) = -30q*2 + 17. Determine -6j(r) - 34p(r). 10r2 Let m(z) = z3 - z*2 - z - 1. Let k(h) = -30h*3 + 6h*2 + 6h + 6. Calculate -k(f) - 6m(f). 24f*3 Let f(p) = -27p + 15. Let l(i) = 13i - 7. What is 6f(x) + 13l(x)? 7x - 1 Let s(q) = 4q2 + 7q. Let g(t) = 9t2 + 15t. Determine -3g(l) + 7s(l). l*2 + 4l Let s(l) = 31l2 - 21l - 16. Let g(m) be the third derivative of -m5/10 + m4/6 + m*3/2 - 64m*2. What is -11g(h) - 2s(h)? 4h*2 - 2h - 1 Let o(r) be the second derivative of 2r3/3 - 5r*2/2 + 2r. Let n(g) = g - 1. Suppose 3h + s = 2s + 19, -4h - 5s = -19. Give hn(p) - o(p). 2p - 1 Let q(l) = -l*2 - l + 1. Let w(s) = 7s*2 + 5s + 4. What is 5q(y) + w(y)? 2y*2 + 9 Let c(q) = -4q*2 + q + 2. Let k(i) = 7i*2 - 2i - 4. Give 5c(y) + 3k(y). y*2 - y - 2 Let r(q) = q + 1. Let f(n) = -6n. Determine -f(v) - 3r(v). 3v - 3 Let s(g) = 3g + 4 - 8 + 2. Let t(n) = -2n + 2. Give -3s(h) - 4t(h). -h - 2 Let z be 0/(4 + 1 + -4). Let x(p) = -2 + zp3 + p3 - 2p3. Let c(h) = -h3. Suppose 3m = -7 + 4. Determine mx(q) - c(q). 2q3 + 2 Let w(z) = -7z*2 + 6z + 5. Let u(o) = 15o2 - 13o - 11. Suppose -16 - 36 = 4s. Determine sw(n) - 6u(n). n2 + 1 Let m(s) = -2s*2 + 4. Let i(k) = -3k*2 + k + 5. Determine 3i(r) - 4m(r). -r2 + 3r - 1 Let l(n) = -1. Let u(s) = -s*2 + 2s - 5. Calculate 5l(t) + u(t). -t2 + 2t - 10 Let i(o) = 27o3 - 14o + 17o3 - o - 11o. Let a(h) = -5h3 + 3h. Determine -52a(w) - 6i(w). -4w3 Let k(m) = -6m*2 + 5. Let b(z) = -7z*2 + 6. Determine -5b(y) + 6k(y). -y2 Let n(o) = -2o*3 - 4o*2 - 16o + 3. Let y(j) = 5j3 + 9j*2 + 31j - 7. What is -9n(s) - 4y(s)? -2s3 + 20s + 1 Let h(n) be the first derivative of 9n4/4 - n3 - 7n*2/2 + 5n - 7. Let s(l) = 4l3 - l2 - 3l + 2. Determine -2h(m) + 5s(m). 2m3 + m2 - m Let q(f) = -3f*3 - 4f*2 + 5f. Let i(m) = m3 + m2 - m. Suppose 4n = -5n + 9. Calculate nq(x) + 4i(x). x*3 + x Let k(l) = -26l*2 - 5l. Let t(f) = 39f2 + 7f. Give -7k(i) - 5t(i). -13i2 Let d(t) = 6t*2 + 14t + 14. Let k(j) = 2j2 + 5j + 5. Give -4d(y) + 11k(y). -2y2 - y - 1 Let a(z) = z2 + z. Let v(y) = 3y*2 - 2. Determine 4a(q) - v(q). q*2 + 4q + 2 Let o(q) = -q*2 - 4q - 3. Let v be o(-2). Suppose 0 = -16w + 14w - 2. Let k(y) = -3y. Let g(j) = -j + 1. Calculate vg(u) + wk(u). 2u + 1 Let g(h) = -h*3 - h + 1. Let b(u) = -105u*3 - 140u + 112. Let q(x) = -35x3 - 47x + 37. Let a(l) = 5b(l) - 14q(l). Give -a(z) + 42g(z). -7z*3 Suppose 0 = -2b - 175 + 165. Let w(z) = -4z3 - 9z - 3. Let d(l) = -2l3 - 4l - 1. What is bd(p) + 2w(p)? 2p3 + 2p - 1 Suppose -12 = 3l, -5b - 5l = -25 - 30. Suppose 4g - b = 2c + g, 5g = 2c + 21. Let d(t) = 5t + 2. Let s(h) = -4h - 2. Give cd(y) - 4s(y). y + 2 Let q(m) = 4m - 6. Let a(l) = 3l2 + 1 + l + 4l - 2l2. Let f be a(-5). Let d(w) = w - 1. Calculate fq(o) - 5d(o). -o - 1 Let g(s) = -7s + 1. Let a(v) = -35v + 5. Give -2a(w) + 11g(w). -7w + 1 Let b(a) = -5a + 6a*3 - 3a - 1 - 2 + 5a2 - a3. Let l(o) = 2o*3 + 2o*2 - 3o - 1. Give 3b(j) - 8l(j). -j3 - j2 - 1 Let w(g) = -7g3 - 5g*2 - 5. Let n(a) = 4a*3 + 3a2 + 3. Let j(f) = f3 - 13f2 + 11f + 17. Let z be j(12). Determine zn(y) + 3w(y). -y*3 Let w = 9 - 17. Let g(v) = -9v*2 - 5v - 5. Suppose -3x - x + 8 = 0. Let y(m) = 14m*x + 8m - 3 + 10 + 1. What is wg(z) - 5y(z)? 2z2 Let x(o) = 4o + 1. Let v(p) = 912 - 912 - p. Determine 2v(a) + x(a). 2a + 1 Let h(r) = r*3. Let i(w) = 30w*3 + 2w*2. Give h(k) + i(k). 31k*3 + 2k*2 Let c(r) = 90r*3 + 14r*2 + 14. Let h(s) = -18s*3 - 3s*2 - 3. Give -3c(j) - 14h(j). -18j*3 Let r(a) = -6 - 3a*3 - 2a*3 - 3a*3 - 6a. Let s(p) = -p - 7. Let x be s(-7). Suppose x = 4d + 5 - 1. Let n(t) = -t3 - t - 1. Determine dr(v) + 6n(v). 2v*3 Let l(a) = -4a - 2. Let n(f) = -17f - 9. What is 9l(g) - 2n(g)? -2g Let x(u) = -u*2 - u. Let y(z) = 15z*3 - 6z*2 - 5z. Give -5x(s) + y(s). 15s3 - s2 Let n(m) = m + 1. Let z(h) = -3h - 2. Let v(r) = -r3 + 11r*2 - 8r - 10. Let q be v(10). What is qn(b) + 4z(b)? -2b + 2 Let j(x) = -3 - 4x + 2x3 + 10x + 2x3. Let d(a) = a3 + a - 1. Suppose -5v + 4 = 9. What is vj(n) + 5d(n)? n*3 - n - 2 Let p(o) = -6o*2 - 3o - 17. Let d(k) = -2k2 - k - 6. Calculate -11d(x) + 4p(x). -2x*2 - x - 2 Let n = -21 - -15. Let r(d) = d. Let k(v) = -v. Determine nr(h) - 3k(h). -3h Let b(p) = 9p2 - 37p + 5. Let o(c) = 5c2 - 18c + 3. Determine 3b(k) - 5o(k). 2k2 - 21k Let d(w) = 2w + 3. Let u(t) = 3t + 2. What is 4d(p) - 3u(p)? -p + 6 Let z(x) = -2x - 2. Let a(p) = -6p - 5. Suppose -2c + 6 = l - 3c, -c = 4l - 34. What is lz(j) - 3a(j)? 2j - 1 Let t(g) = -6g + 3. Let w(b) = 4b - 2b - 1 + 0b. What is -4t(y) - 11w(y)? 2y - 1 Let t(y) be the second derivative of -y2/2 + 8y. Let m(q) = 2q2 - q - 4. Calculate m(r) - 4t(r). 2r2 - r Let w = 17 + -16. Let l(h) = h. Let i(o) = -7o + 1. Let z be ((-18)/(-8))/(12/32). Calculate wi(n) + zl(n). -n + 1 Suppose 0f + 6 = 2f. Suppose -f = -0p + p. Let i(w) = -2w + 3. Let d(o) = 1 - o + 0 + 0. What is pd(c) + i(c)? c Let l(m) = -22m - 560. Let z(w) = -9w - 224. Calculate -5l(q) + 12z(q). 2q + 112 Let g be (-8)/(-2) - (15 + -13). Let a(s) = -2s3 + s2 + s. Suppose 6 = 2l - 0. Let q(b) = 2b3 - b2 - b. Calculate ga(f) + lq(f). 2f3 - f2 - f Let q(s) = 4s + 8. Let l(h) = -3h - 7. Calculate -6l(p) - 5q(p). -2p + 2 Let k(n) be the first derivative of n3 + 3n - 8. Let q(z) = -4z2 - 4. What is 3k(x) + 2q(x)? x2 + 1 Let d be 0 - (0 - -2) - -13. Let z(i) = -33i - 9i - 16 + 33i - 12i. Let s(u) = 4u + 3. Determine ds(a) + 2z(a). 2a + 1 Let r(a) = -a. Let z(u) = -5u + 1. Suppose 0 = 4t + 10 - 14. Give tz(w) - 2r(w). -3w + 1 Let i(c) = -5c3. Let x(p) = 4p*3 - 5p*2. Let y(k) = -45k*3 + 54k*2. Let l(a) = 54x(a) + 5y(a). Determine -5i(f) + 3l(f). -2f*3 Suppose 19 - 7 = -2j. Let g(m) = 2m2 + m. Let n(a) = -2a*2 - 2a. What is jg(h) - 5n(h)? -2h2 + 4h Let m(z) = 9z2 - 4z - 1. Let r(p) = 5p2 - 2p. Let x(v) = 4m(v) - 7r(v). Let b(s) = -3s2 + 7s + 12. Determine -2b(l) - 7x(l). -l*2 + 4 Let m(u) = 1. Let d be (-6)/7 - 11/77. Let n(z) = 2z*2 + 1. Determine dn(v) + 2m(v). -2v*2 + 1 Let z(m) = 6m3 + m2 - m - 1. Let i be z(-1). Let j(d) be the first derivative of -3d2/2 - 4d - 17. Let v(t) = -t - 1. Give iv(a) + j(a). 2a + 1 Let c(d) = -5d3 + 8d - 4. Let r(k) = -8k3 - 23k + 28 - 16 + 22k3. Let x(i) = 11c(i) + 4r(i). Let b(z) = z - 1. Determine 4b(g) + x(g). g*3 Let w(c) = -8c + 3. Let m(s) = 23s - 9. Determine -4m(b) - 11w(b). -4b + 3 Let i(x) = -9x3 - 8x2. Let w(d) = -d2. Give -3i(q) + 24w(q). 27q3 Let w(y) = -4y - 5. Let x be 3/(-2 + 15/6). Let b(r) = 14r + 17. Let a(u) = u + 1. Let q(j) = 3a(j) - b(j). Calculate xq(d) - 17w(d). 2d + 1 Let n(v) = -v2 + 6v + 1. Let i(x) = -2x - x - 1 + 0. Let d(s) = 5i(s) + 2n(s). Let g(o) = -o2 - o - 1. Give d(z) - 3g(z). z*2 Let j(k) = 3k*3 - 5k*2 - 5k - 5. Let v(f) = -2f3 + 4f*2 + 4f + 4. What is -4j(b) - 5v(b)? -2b3 Suppose 0 = -2c - q + 1, 2c + 3q + 2q = -3. Let p = 2 + c. Let u(n) = 2n*3 - 3n*2 - 3n - 3. Let o(t) = t*3 - 2t*2 - 2t - 2. Give po(f) - 2u(f). -f*3 Let f(m) = -2m*3 - 8m*2 - 6m - 5. Let a(h) = -2h3 - 7h*2 - 5h - 4. Give -6a(d) + 5f(d). 2d3 + 2d*2 - 1 Let k = -14 - -13. Let h(l) = 4 - 5l - 2l - 3 + 8l. Let g(u) = 4u - 1 + 0 - 5u. Determine kg(o) - 2h(o). -o - 1 Let a(s) = 4s2 + s + 1. Let v be a(-1). Let w(t) = 5t - 7. Let q(h) = 3h - 4. Calculate vw(x) - 7q(x). -x Let m(o) = 7	{ "pile_set_name": "DM Mathematics" }
-2z Let b(u) = -7u*2 + 2u - 3. Let m(y) = -y*2 - y + 1. What is b(k) + 4m(k)? -11k2 - 2k + 1 Let a(l) be the second derivative of l*4/3 - 5l*3/6 + 2l*2 - 15l. Let u(m) = -m*2 + m. What is -a(n) - 3u(n)? -n*2 + 2n - 4 Let n(q) be the second derivative of q*3 + 4q*2 + 2q. Let j(y) = 30y + 39. Let s(z) = -5j(z) + 24n(z). Let w(o) = o + 1. What is s(g) + 4w(g)? -2g + 1 Let m(n) = -7n*3 - 6n*2 - 2n + 6. Suppose t - 2 = 13. Let i(v) = 2v + 6v*3 + tv*2 - 1 - 10v*2 - 3 - 1. Determine 6i(j) + 5m(j). j3 + 2j Let o(g) = 13g - 3. Let x(q) = -14q + 4. What is -5o(p) - 4x(p)? -9p - 1 Let p(f) = -14f - 7. Let b(h) = 13h + 6. Determine -6b(m) - 5p(m). -8m - 1 Let z(s) = -15s2 - 9. Let v(i) = -4i*2 - 2. Determine -18v(j) + 4z(j). 12j2 Let l(c) = 3 - c + 2 + 0 - 4 + c2. Let u(w) = 5w - 7. Let i(p) = l(p) + u(p). Let y(d) = d2 + 3d - 5. What is -3i(g) + 4y(g)? g*2 - 2 Let n(q) = 41q + 3. Let y(b) = -21b - 2. Determine -3n(d) - 5y(d). -18d + 1 Let g(n) = n*3 - 3n - 5. Let z(u) = -1. Let o(j) = -j - 4. Let x(v) = -2o(v) + 4z(v). Calculate 2g(l) + 3x(l). 2l3 + 2 Let v(f) = f3 + f2 + f - 1. Let b(d) = 2d - 42. Let l be b(20). Let c(r) = r*3 + 4r*2 + 2r - 3. Determine lv(s) + c(s). -s3 + 2s*2 - 1 Let b(f) = 3f*3 - 4f*2 + 4f + 4. Let j(x) be the first derivative of -x4/2 + x3 - 3x2/2 - 3x - 31. What is 3b(l) + 4j(l)? l3 Let l(a) = -a3 + 8a2 + a + 6. Let k(h) = -h2 - 1. What is 10k(r) + 2l(r)? -2r*3 + 6r*2 + 2r + 2 Let s(t) = -22t2 + 5t + 5. Let q(p) = -23p2 + 6p + 6. What is -5q(x) + 6s(x)? -17x2 Let l(t) be the third derivative of 7t5/60 + t4/3 - 4t3/3 + 23t*2. Let r(v) = 2v*2 + 3v - 3. Calculate 3l(h) - 8r(h). 5h2 Suppose -2d + 0d = 12. Let r(b) = -3 + 5 - 3. Let f(v) = -v + 3. Calculate dr(o) - 2f(o). 2o Let f(l) = -l. Let i(c) = 3c - 2. Determine 2f(b) + i(b). b - 2 Let a(q) = 1. Let u be 8 + -12 - (-1 - 2). Let f(y) = -2y2 - 2y + 3. Calculate uf(d) - 2a(d). 2d2 + 2d - 5 Let l(x) = -44x3 - 3x*2 - 3x - 3. Let g(a) = -87a3 - 5a*2 - 5a - 5. What is -3g(q) + 5l(q)? 41q3 Let o(q) be the second derivative of -q3/6 - q2/2 - 11q. Let u(d) be the first derivative of 2d3/3 - 4d*2 - 5d - 1. What is 6o(y) - u(y)? -2y*2 + 2y - 1 Let u(m) be the third derivative of -1/24m4 - m2 + 0m - 1/2m3 + 0. Suppose -1 - 4 = 5v. Let a(o) = -1. What is vu(w) + 3a(w)? w Suppose 15 = -3k - 3v, 5v - 4v - 20 = 4k. Let g(s) = s3 - 3s*2 + 3s - 3. Let h(m) = 2m3 - 5m*2 + 5m - 5. Give kg(n) + 3h(n). n*3 Let z(k) = -1. Let d(q) = -2q - 8. Calculate d(j) - 2z(j). -2j - 6 Let d(z) = -z*2 + z + 1. Let x(o) = 5o*3 - 4o*2 + o + 6. Determine -4d(t) + x(t). 5t3 - 3t + 2 Let d(w) = -340w + 65. Let p(a) = 31a - 6. Calculate 6d(k) + 65p(k). -25k Let i(p) = -7p*2 + 2p - 7. Let b be 1 - 2/(-1 - (-9)/7). Let l(s) = 20s2 - 6s + 20. Calculate bl(a) - 17i(a). -a*2 + 2a - 1 Let i(o) = -3o + 30. Let z(h) = -h + 10. Calculate 6i(g) - 17z(g). -g + 10 Let m(o) = -o - 1. Let d(l) = 23l + 14. Let u(p) = 8p + 5. Let a(b) = -3d(b) + 8u(b). Give -a(i) + 6m(i). -i - 4 Let h(l) = -4l2 - l + 6l + 2 - 5. Let y(z) = 5z2 - 6z + 4. Let b(x) = 2x2 + x2 - x3 - 2x*2. Let d be b(2). What is dh(k) - 3y(k)? k2 - 2k Let s(l) = 27l + 7. Let q(p) = -13p - 4. What is -7q(a) - 4s(a)? -17a Let t(n) = -3n*2 - 2n - 3. Let g(q) = 4q2 + q + 2. Give 3g(i) + 2t(i). 6i*2 - i Let b(l) = 2l - 8. Let m(p) = p. Let o be m(-1). Let g(n) = 1. What is ob(z) - 10g(z)? -2z - 2 Let z(u) = -3u*3 - 2u*2 + 5. Let y(k) = -5k*2 - 3k3 + k3 + 7 - 3 + 4k2. What is 4y(h) - 3z(h)? h3 + 2h*2 + 1 Let k(j) = 6j*2 + 5. Let s(u) = -21u*2 - 18. Let t(z) = 2z3 - z2 + 3z. Let p be t(2). Suppose -3y - p = -2y. Determine yk(a) - 5s(a). -3a*2 Let o(g) = 559g*3 + 104g*2 + 104g. Let h(d) = -16d3 - 3d*2 - 3d. Give 104h(a) + 3o(a). 13a3 Let r(z) = -297z - 54. Let g(a) = 27a + 5. Calculate 54g(n) + 5r(n). -27n Let v(o) = 24o - 10. Let a(d) = 8d - 3. Calculate -7a(x) + 2v(x). -8x + 1 Let z(p) = -13p*2 + 5p*2 - 2p + 5p2. Suppose 1 = -o - 0. Let u(s) = -s. Determine oz(c) + 2u(c). 3c*2 Let u(n) = 3n + 2. Let t(r) be the third derivative of r4/12 + r3/3 + 8r2. Determine -4t(y) + 3u(y). y - 2 Let z(s) = -4s*3 + 3s + 3. Suppose 3f - 8 = -5q + 13, -3q + 19 = 5f. Let r(x) = 4x - 6x*q - 1 + 6 - 1. What is 5r(d) - 7z(d)? -2d3 - d - 1 Let g be ((-4)/10)/(4/20). Let p = 4 + g. Let u(t) = t2 - t - 2. Let y(k) = -5k2 + 4k + 9. Calculate py(v) + 9u(v). -v2 - v Let w(p) = p2 + 5p + 2. Let x be w(-7). Let z(v) = xv*2 - 16v2 - v3 + v + 1. Let n(g) = -4g - 2. Calculate -n(y) - 2z(y). 2y3 + 2y Let z(t) be the third derivative of t5/120 - t4/6 + 5t2. Let w(x) be the second derivative of z(x). Let k(o) = -o2 + 8. Determine -3k(m) + 24w(m). 3m2 Let d(f) = f + 1. Let l(x) be the third derivative of x4/6 - x*3/6 - 10x*2. Give 2d(b) - l(b). -2b + 3 Let p(h) = -8h*2 + 5h - 1. Let i(q) = 17q2 - 11q + 2. Calculate -6i(x) - 13p(x). 2x2 + x + 1 Let k(g) = 3g + 2g + 5g*2 - 4g*2 - 2g + 1. Let w be k(-1). Let z(y) = 6 + 3y2 - 11y*2 + 0y - y. Let o(t) = -t*2 + 1. Determine wz(u) + 6o(u). 2u*2 + u Let v(c) = -7c*2 - 2c*2 + 8c*2 - 5. Let m(x) = 4x*2 + 16. Determine 5m(k) + 16v(k). 4k*2 Let d(t) = -t - 10. Let k(z) = -1. What is -d(g) + 5k(g)? g + 5 Let s(y) = -y*2 - 1. Let d(u) = 6u*2 + u + 4. Let b(o) = 2o + 6. Let c be b(-4). Calculate cd(x) - 11s(x). -x*2 - 2x + 3 Let r(o) = -2o3 - 3o*2 - 4o + 2. Let w(f) = -2f3 - 4f*2 - 5f + 2. Calculate -5r(p) + 4w(p). 2p3 - p2 - 2 Let q(m) be the first derivative of -m2/2 - 1. Suppose 2l - l = -p + 18, 2l + 5p = 36. Let h be (-9)/(-2)12/l. Let o(t) = -t3 - 4t. Give hq(f) - o(f). f3 + f Let o(g) = 5g*2 - 5g - 6. Let w(c) = -2c2 + 2c + 2. Suppose 4a - 8 - 16 = 4j, -3a + 5j + 14 = 0. Give aw(z) + 3o(z). -z2 + z - 2 Let l(q) = -q2 - q. Let z(p) = -4p3 - 5p*2 - 5p. Let i = 27 - 26. What is iz(j) - 5l(j)? -4j3 Suppose -1 + 13 = -2z. Suppose -4n = -n. Let w = 5 + n. Let c(r) = 5r*3 - 6r*2 - 5. Let v(s) = 4s*3 - 5s*2 - 4. What is wc(k) + zv(k)? k3 - 1 Let g(y) = 4y*3 - 7. Let o be 7/(-1) + -27 + 27. Let z(m) = 3m - 2m3 + 3 - 3m. Determine oz(r) - 3g(r). 2r3 Suppose j - 3z = -3 - 4, -2j + 7 = z. Let o(m) = 12m*2 + 9. Let t(u) = -3u*2 - 2. What is jo(a) + 9t(a)? -3a2 Let a(h) = h2 - 10. Let r(y) = y*2 - 5. What is 3a(o) - 5r(o)? -2o2 - 5 Let x(k) = -k2 + 11k + 15. Let j be x(12). Suppose -jo + i = 16, -4i - 2 = 3o - 4o. Let t(m) = -5m. Let p(a) = 4a. Determine op(u) - 5t(u). u Let d(k) = -2k*2 - 2. Suppose 5g - 6 = -6o + 3o, 0 = -5g. Let i(t) = -t2 - 1. Calculate od(z) - 3i(z). -z2 - 1 Let z(a) = -3a + 2. Let w(o) be the first derivative of 1/2o2 + 0o + 2. Give -4w(b) - z(b). -b - 2 Let l(v) = v3 - 5v*2 - 8v + 9. Let w be l(6). Let i(g) = -g. Let k(m) = 4m - 2. Suppose r - 2r - 2d = 1, -2r - 2 = -2d. Determine rk(y) + wi(y). -y + 2 Let m(q) = -135q*2 - 35q + 35. Let t(a) = -8a2 - 2a + 2. Calculate 4m(f) - 70t(f). 20f2 Let w(u) = -u. Let j = -24 - -15. Let b be (2 + j/6)-6. Let a(z) = 4z. What is bw(p) - a(p)? -p Let u(k) = -2k3 + 2k*2 - 3k + 3. Let r be ((-2)/3)/((-2)/9). Let g(i) = i3 - i2 + i - 1. Give rg(t) + u(t). t3 - t2 Let y(o) = 4o - 5. Let n(h) = -h + 1. Suppose -3j = -2r - 8, j - 4 = r + r. Let q(k) = -k*2 - 2k + 5. Let p be q(-4). Determine pn(g) + ry(g). -g + 2 Let k(z) = 5z2 - 10z - 5. Let y(n) = -9n2 + 19n + 9. Give -11k(h) - 6y(h). -h*2 - 4h + 1 Let k(t) be the first derivative of -3t4/4 - 2t*2 + 2t - 2. Let l(w) = 4w3 - 3 - w2 + w2 + 5w. Suppose 4 = -c + 2. Calculate cl(d) - 3k(d). d*3 + 2d Let v(f) = -7f2 + 5f + 1 + 10f2 - 11f. Let y(u) = -8u2 + 17u - 3. Determine -17v(z) - 6y(z). -3z2 + 1 Let n(v) = -v2. Let q(m) = 4m*2 + 8m - 2. C	{ "pile_set_name": "DM Mathematics" }
210. 21 Calculate the highest common divisor of 1497 and 12216. 3 What is the greatest common divisor of 14385 and 1485? 15 What is the greatest common factor of 26911 and 85? 17 Calculate the highest common factor of 10060 and 2680. 20 What is the greatest common divisor of 260661 and 247? 19 What is the highest common factor of 2013 and 7799? 11 Calculate the greatest common factor of 813106 and 98. 98 Calculate the greatest common divisor of 190 and 44555. 95 What is the highest common factor of 108539 and 349? 349 Calculate the highest common divisor of 77 and 404992. 7 Calculate the highest common factor of 10244 and 65404. 788 What is the highest common factor of 300 and 90260? 20 Calculate the greatest common divisor of 10020 and 2420. 20 Calculate the highest common factor of 597125 and 375. 125 What is the highest common factor of 3125 and 2625? 125 What is the greatest common divisor of 6995097 and 361? 361 Calculate the greatest common factor of 176 and 11198. 22 What is the greatest common divisor of 467789 and 51? 17 Calculate the highest common factor of 8568 and 369376. 952 What is the highest common factor of 15666 and 1176? 42 What is the greatest common factor of 1300 and 4551820? 260 Calculate the greatest common factor of 276 and 8796. 12 What is the highest common factor of 23013 and 9? 9 What is the highest common divisor of 328725 and 33603? 1461 What is the highest common divisor of 85715 and 31? 31 What is the greatest common divisor of 424201 and 272? 17 Calculate the highest common factor of 265 and 339995. 265 Calculate the highest common factor of 105 and 70805. 35 What is the greatest common factor of 3570 and 6195? 105 Calculate the highest common factor of 386005 and 5. 5 Calculate the highest common factor of 27209 and 13. 13 What is the highest common divisor of 11809 and 196? 49 Calculate the greatest common divisor of 1184424 and 1224. 408 What is the greatest common divisor of 950 and 2800? 50 What is the highest common factor of 112 and 7133? 7 What is the greatest common factor of 3 and 30333? 3 What is the highest common factor of 1804 and 35629? 451 What is the highest common factor of 7 and 115339? 7 What is the highest common factor of 52078 and 143? 13 Calculate the highest common divisor of 144890 and 90. 10 What is the highest common divisor of 153 and 585? 9 Calculate the highest common divisor of 46737 and 4039. 577 Calculate the greatest common factor of 7 and 4768. 1 What is the highest common divisor of 19844 and 44? 44 What is the greatest common divisor of 522 and 126498? 174 Calculate the highest common factor of 129 and 2365. 43 Calculate the greatest common divisor of 871 and 17219. 67 What is the greatest common divisor of 8121132 and 1116? 1116 Calculate the greatest common divisor of 3072 and 1054848. 384 Calculate the greatest common divisor of 146625 and 1625. 125 What is the highest common factor of 13932 and 891? 81 What is the greatest common divisor of 2748018 and 91? 91 What is the highest common factor of 37 and 3947? 1 What is the highest common factor of 205 and 32718? 41 What is the highest common factor of 54 and 8070? 6 Calculate the highest common divisor of 126 and 73934. 14 What is the greatest common factor of 124208 and 63? 7 What is the greatest common factor of 226 and 983778? 226 Calculate the highest common divisor of 20061425 and 25. 25 What is the highest common divisor of 216 and 1416? 24 What is the highest common divisor of 341744 and 23744? 848 What is the highest common divisor of 350 and 319975? 25 Calculate the greatest common factor of 1995188 and 481. 481 What is the greatest common divisor of 1220 and 462990? 610 Calculate the greatest common divisor of 198 and 33198. 66 Calculate the highest common factor of 10 and 10985450. 10 Calculate the highest common divisor of 57343 and 286. 143 What is the highest common factor of 77 and 5085157? 77 What is the greatest common divisor of 759 and 40931? 11 What is the highest common divisor of 187925 and 575? 25 What is the greatest common divisor of 38577 and 11? 11 What is the highest common factor of 510 and 56865? 255 Calculate the highest common factor of 59398 and 16. 2 What is the greatest common factor of 10 and 14670? 10 What is the highest common divisor of 1185030 and 385? 385 Calculate the highest common divisor of 6937 and 1267. 7 What is the highest common factor of 365390 and 15? 5 What is the greatest common divisor of 363 and 12111? 33 Calculate the highest common divisor of 222 and 402. 6 What is the highest common factor of 208 and 3088? 16 Calculate the highest common factor of 57778 and 1526. 14 What is the greatest common factor of 77013 and 398? 199 Calculate the highest common factor of 2415 and 197547. 483 What is the highest common divisor of 19514 and 22? 22 Calculate the greatest common factor of 360 and 14960. 40 What is the highest common divisor of 278075 and 50? 25 Calculate the greatest common divisor of 22 and 1451175. 11 Calculate the greatest common factor of 90 and 18820. 10 What is the highest common factor of 36 and 2448? 36 What is the greatest common factor of 303 and 65347? 101 Calculate the greatest common divisor of 116040 and 3360. 120 What is the highest common factor of 812 and 141085? 203 What is the highest common divisor of 115 and 1147815? 115 Calculate the highest common divisor of 1479 and 276080. 493 What is the highest common divisor of 16 and 1259760? 16 What is the greatest common factor of 385 and 5705? 35 Calculate the greatest common factor of 2180 and 13952. 436 What is the highest common divisor of 444 and 216192? 12 What is the greatest common divisor of 5525 and 6800? 425 Calculate the greatest common factor of 188 and 159142. 94 Calculate the highest common divisor of 36 and 13086. 18 What is the highest common factor of 70 and 368886? 14 What is the highest common divisor of 432 and 59832? 216 Calculate the highest common factor of 314303 and 462. 11 Calculate the highest common factor of 255 and 89580. 15 Calculate the greatest common factor of 31739 and 187. 17 What is the greatest common factor of 500 and 498875? 125 Calculate the highest common factor of 815941 and 287. 287 Calculate the highest common factor of 136485 and 162. 81 Calculate the highest common factor of 450 and 79965. 45 What is the highest common divisor of 56 and 259504? 56 What is the highest common divisor of 7967472 and 508? 508 Calculate the highest common factor of 711984 and 260. 52 Calculate the greatest common divisor of 11085 and 270. 15 What is the highest common divisor of 880 and 53152? 176 What is the highest common divisor of 962 and 4726306? 962 What is the greatest common factor of 224499 and 33? 33 Calculate the greatest common factor of 1250 and 2606750. 250 What is the greatest common factor of 256 and 2933760? 256 Calculate the highest common divisor of 2424 and 40. 8 Calculate the highest common factor of 12400 and 14384. 496 What is the greatest common factor of 38304 and 7776? 288 Calculate the highest common factor of 36 and 18396. 36 Calculate the highest common factor of 2011492 and 28. 28 What is the highest common divisor of 58545 and 900? 45 Calculate the highest common factor of 394 and 1. 1 What is the highest common divisor of 1097948 and 212? 212 What is the greatest common divisor of 381649 and 1185? 79 What is the highest common divisor of 112 and 350448? 112 Calculate the highest common factor of 12728 and 6020. 172 What is the highest common divisor of 697 and 25379? 41 What is the highest common divisor of 95473 and 1186? 593 What is the greatest common factor of 109188 and 337? 337 Calculate the highest common divisor of 160 and 10735. 5 What is the greatest common divisor of 746261 and 401? 401 What is the highest common factor of 752 and 4841? 47 Calculate the highest common factor of 19 and 390545. 19 What is the highest common factor of 1411 and 1394? 17 What is the highest common factor of 5863725 and 73? 73 Calculate the greatest common factor of 122 and 117242. 122 What is the greatest common divisor of 31518 and 16660? 34 What is the highest common factor of 631470 and 840? 210 Calculate the greatest common factor of 2183	{ "pile_set_name": "DM Mathematics" }
hat is the least common multiple of 10 and i? 80 Suppose 3o = 2o + 27. Suppose -7 = -q - 2, -o = -b - 4q. Suppose 13x - 33 = 10x. Calculate the smallest common multiple of b and x. 77 Let m(k) = 4k*2 + 15k - 5k2 - 5k - 12. What is the smallest common multiple of 10 and m(8)? 20 Let d(r) = 3r3 - 8r*2 + 7r + 7. Let y(a) = -a*3 + 4a*2 - 3a - 4. Let u(q) = -2d(q) - 5y(q). What is the lowest common multiple of u(-4) and 9? 18 Let y(o) = o*3 + 7o*2 + 7o + 2. Let x be y(-6). Calculate the common denominator of (-10)/8(-5)/(-2) and (327/72)/(2/x). 24 Suppose -3 - 14 = -3i + 4w, -3i - 4w + 25 = 0. What is the smallest common multiple of i and 10? 70 Let k = -102682/14245 + -284/385. Let s = 1973/222 - k. Find the common denominator of 21/11 and s. 66 Let o(l) be the third derivative of l4/8 - l3/2 + 5l2. What is the smallest common multiple of 10 and o(5)? 60 Let z(f) = -f2 - 2f + 2. Let r be z(2). What is the common denominator of 43/r + 1-1 and ((-26)/(-10))/((-216)/(-90))? 12 Let l(f) = -f*3 - 6f*2 - f + 5. Let j = 7 + -3. Suppose -d + 0d + 2 = 0, -j = -2a + 3d. What is the lowest common multiple of a and l(-6)? 55 Suppose 0t + 3m = -t, 0 = -2t + 5m. Suppose 6 + 36 = w - 4f, t = -f - 5. What is the smallest common multiple of w and 16? 176 Let k = -51 - -69. Suppose -24 - 8 = -2y. What is the smallest common multiple of y and k? 144 Let h be 35/14(-56)/(-10). What is the least common multiple of (12/h)/(12/42) and 4? 12 Let t(w) = 9w3 + w2 + w - 2. What is the least common multiple of 9 and t(1)? 9 Suppose i + 2 - 1 = -3q, 0 = -q + 5i + 5. Let l = 149053/22 + -6771. Find the common denominator of l and (274/(-12))/1 + q. 66 Let g = 16 - 6. Let v(c) be the second derivative of c*4/6 + 2c3/3 + c2 - 2c. What is the least common multiple of g and v(-2)? 10 Calculate the smallest common multiple of 5 and (-2)/6 - (-40)/30. 5 Let v = 54 + -18. Suppose 0 = 5c - c - v. Calculate the lowest common multiple of 11 and c. 99 Let z = 579/8 + -85. Let c = -2/985 - -35474/6895. Find the common denominator of z and c. 56 Suppose 3w + 2w = 0. Let r = 2915/42 + -452/7. Calculate the common denominator of (-333)/(-60) + w + 0 and r. 60 Let n(j) = -2j - 4. Calculate the least common multiple of 12 and n(-11). 36 Calculate the lowest common multiple of 8 and (111/(-6) + 4)-12. 696 Let l be 130 + -2 - (0 - 2). Let i = l - 58. Find the common denominator of 8/i(-186)/4 and -61/12. 12 Suppose k + 154 = 51. Let o = 10 + -12. Find the common denominator of -97/10 and k/(-10) - (o - 0). 10 Let d(v) = v2 - 10v + 1. Let r be d(10). What is the common denominator of (-1 - r) + (-55)/(-198) and 103/10? 90 Find the common denominator of (-34)/(-14) - 16/56 and -65/6. 42 Let k be 1/(-4) + (-41)/(-4). What is the common denominator of (-5)/k + 64/22 and -33/8? 88 Let s be 1406/(-4)(-223)/(-10). Let u = s - -7843. Find the common denominator of 101/2 and u. 20 Let b be 336141/(-120) + 21/(-56). Let k = 2797 + b. What is the common denominator of k and 5/18? 180 Let a = -55 - -143. What is the least common multiple of a and 10? 440 Find the common denominator of (-12)/(-10)60/14 and (-2 - -1)/((-5)/1). 35 Let q be (0 - 6/(-7))7. Suppose 3w - 4j - 91 = -0w, 5j = 3w - 95. Suppose -p - w = -qp. Calculate the lowest common multiple of 7 and p. 35 Let m = -16355 + 392579/24. What is the common denominator of 103/6 and m? 24 Let i = 790471/24 + -32931. Find the common denominator of 103/18 and i. 72 Calculate the smallest common multiple of 2 and 1 + -3 - (-24)/3. 6 Let a = 536 - 374. What is the common denominator of (a/(-90))/((-8)/(-15)) and -19/3? 24 Let j(k) = 4k + 11. Let n(s) = 3s + 10. Let g(h) = 2j(h) - 3n(h). Calculate the lowest common multiple of g(-10) and 3. 6 Suppose 5y - 15 = -u, 7y - 2y = -3u + 5. Let b = u - -12. Calculate the lowest common multiple of b and (-2)/9 + 9/(-324)-404. 77 What is the smallest common multiple of 3/6 - (-665)/14 and 42? 336 Suppose m = 3s - 2, -s + 16 = 3s + 2m. Suppose -4o + 35 = -3j, -7o + so + 3j + 43 = 0. Calculate the lowest common multiple of o and 7. 56 Let c = 6 - 1. Suppose 0 = -j - ch + 16 - 2, 0 = 2j + 3h. Find the common denominator of (2/j)/(10/39) and -73/6. 30 Let q = 2628 + -10587/4. Let n be (-3)/((-675)/1194) - 2. Let y = -103/300 - n. Find the common denominator of q and y. 20 Suppose 6z = 2z + 16. Calculate the least common multiple of z and 66. 132 Let j = -2029/138 - -618/23. What is the common denominator of 11/2 and j? 6 Find the common denominator of 0 - ((-381)/15 - -1)/4 and 101/24. 120 Find the common denominator of -45/8 and (3/4)/(18/82). 24 Suppose -5c + 0c + 60 = 0. Calculate the common denominator of 1/(-1 + c/21) and -46/7. 21 Let s = -1180736/49 + 24113. Let o = -963799/58947 + s. Let z = 131183/16842 + o. Calculate the common denominator of 89/20 and z. 140 Let t = 22 + -13. Let d = t - 6. What is the smallest common multiple of 12 and d/(-5) - 279/(-15)? 36 Let o be (-6)/9 + (-259)/21. Let u be (4 - 0)21/4. Let m = u + o. What is the smallest common multiple of m and 7? 56 Suppose -d + h = -0h + 18, 3d - 4h + 54 = 0. Find the common denominator of 43/d - (-1 - -4) and -93/16. 144 Let z be 4008/(-2) + 1-1. Let q = 412 + z. Let y = q + 12779/8. Calculate the common denominator of 3/8 and y. 8 Let x = -35 - -53. Suppose 1 + 7 = a. What is the lowest common multiple of x and a? 72 Suppose w = 6w - 4z + 49, -5 = -5z. Let y = 18827/6 + -3162. What is the common denominator of 3/w + (-73)/(-12) and y? 12 Let z = 211 - 411/2. Calculate the common denominator of z and 51/4. 4 Let o(p) = 19p - 4. Calculate the lowest common multiple of o(2) and 10. 170 Let y = 28 - -92. Let w = y + -609/5. What is the common denominator of 22/7 and w? 35 Let u(s) = -16s3 + 2s + 2. Let q(x) = -x*2 - 15x - 1. Let f be q(-15). Calculate the least common multiple of u(f) and 7. 112 Let i = 7 - 4. Suppose 2p = i + 9. Calculate the least common multiple of p and 7. 42 Let n(u) = 11u3 + u2 + 2u + 1. Let c be n(-1). Calculate the common denominator of -1 + c9/(-4) and -101/6. 12 Let i(j) = -j + 11. Let l be i(6). Suppose 2h + s - 17 = 2s, 2s + 44 = lh. Let x = h - 11/3. Calculate the common denominator of -33/14 and x. 42 Let x(z) be the third derivative of 0z + 1/2z3 + z2 + 1/24z4 + 0. What is the least common multiple of x(0) and 9? 9 Suppose -f - 9 = 3z, -2z + f - 3 = z. Let i be (-4 - -3)/(z/6). Calculate the common denominator of 17/2 and (i/27)/(8/678). 12 Suppose 4n - 5n + 6 = -c, 0 = 2n + 3c - 32. Calculate the least common multiple of 22 and n. 110 Let x be 442853/36 - -1. Let g = x + -10478. Find the common denominator of g and ((-122)/11)/(6 - 2). 198 Let z(q) = q*2 - 9q + 6. Let p be z(8). What is the common denominator of -74/3 and 9/7(-7)/p? 6 Let z = -1 + -15. Let d = 4 + z. Let s(c) = c + 14. What is the lowest common multiple of s(d) and 9? 18 Let n(v) = v2 - v - 4. Calculate the smallest common multiple of 6/(-5)(-10)/1 and n(5). 48 Let k(m) = m*2 + 2m + 1. Let y(i) = -5i2 + 32i - 3. What is the lowest common multiple of y(6) and k(2)? 9 Let t = 1480769 + -14794339/10. Let p = -1338 + t. Calculate the common denominator of p and -8/9. 90 Let q = 3 - -17. Calculate the lowest common multiple of q and 18. 180 Let p be 2 - 16125481. Let d be ((-6)/9)/(80/p). Let m = d + -1677. Calculate the common denominator of m and -89/14. 140 Let r = 83/21 - 445/63. Calculate the common denominator of -4/7 and r. 63 Calculate the common denominator of -11/25 and ((-152)/(-12))/((-8)/18). 50 Let x = -8920 + 71449/8. What is the common denominator of x and 0/(-1) - 142/(-20)? 40 Let r(q) = 2q3 + q2 - q + 44. What is the lowest common multiple of 4 and r(0)? 44 Let x be (-10)/(-4)(-3)/(-3385). Let k = 33504/3385 + x. Find the common denominator of k and 6/(-9) - (-128)/18. 90 Let y(i) = -5i - 8. Let d = -8 - -8. Suppose 2q - 5q = -3f - 33, -4q + 20 = d. Calculate the lowest common multiple of y(f) and 8. 88 Let g(i) = i3 + i2 - i + 6. What is the least common multiple of g(0) and 18? 18 Calculate the least common multiple of -1(-125)/1 - 1 and 22. 1364 Let i	{ "pile_set_name": "DM Mathematics" }
in meters? 0.02318058 What is 2/63 of a week in seconds? 19200 What is seventeen quarters of a kilogram in grams? 4250 How many kilometers are there in 779.3512mm? 0.0007793512 What is five quarters of a millimeter in micrometers? 1250 What is 6/25 of a millennium in months? 2880 What is fourty-one halves of a century in years? 2050 How many months are there in five quarters of a century? 1500 Convert 49824.24km to centimeters. 4982424000 What is 178777.5 nanometers in centimeters? 0.01787775 Convert 9.202224 tonnes to kilograms. 9202.224 How many grams are there in one twentieth of a kilogram? 50 What is 6.417936 millilitres in litres? 0.006417936 How many milliseconds are there in 496280.8 days? 42878661120000 Convert 3.428583ml to litres. 0.003428583 What is fifty-three fifths of a litre in millilitres? 10600 What is 0.3349481 milligrams in nanograms? 334948.1 How many millilitres are there in 6/25 of a litre? 240 What is 11/4 of a litre in millilitres? 2750 How many microseconds are there in 0.5597107 milliseconds? 559.7107 How many millimeters are there in seven eighths of a meter? 875 How many millilitres are there in 11/4 of a litre? 2750 How many months are there in nineteen quarters of a year? 57 What is 1/15 of a minute in milliseconds? 4000 Convert 86.86334l to millilitres. 86863.34 What is 3/5 of a hour in minutes? 36 How many years are there in 482.738 decades? 4827.38 Convert 9606.578 nanometers to meters. 0.000009606578 What is three fifths of a kilometer in meters? 600 What is 32/5 of a second in milliseconds? 6400 What is 457.9384 meters in nanometers? 457938400000 What is seventy-one quarters of a millimeter in micrometers? 17750 What is 31/2 of a century in months? 18600 How many decades are there in 7/2 of a century? 35 What is five eighths of a kilometer in centimeters? 62500 How many millilitres are there in eighteen fifths of a litre? 3600 How many meters are there in 42470.68nm? 0.00004247068 What is 257.337 nanometers in meters? 0.000000257337 What is 632.1284ml in litres? 0.6321284 Convert 9204.92ml to litres. 9.20492 What is 0.204975 meters in kilometers? 0.000204975 How many nanometers are there in fifty-three fifths of a micrometer? 10600 How many microseconds are there in 3460.102 nanoseconds? 3.460102 How many millimeters are there in fourty-two fifths of a meter? 8400 How many millilitres are there in sixty-one quarters of a litre? 15250 What is fifty-four fifths of a litre in millilitres? 10800 What is 1/4 of a meter in centimeters? 25 How many micrograms are there in 5/8 of a milligram? 625 Convert 18.1554 weeks to days. 127.0878 Convert 38380.9 millilitres to litres. 38.3809 How many micrograms are there in one fifth of a milligram? 200 How many years are there in 283.2236 millennia? 283223.6 What is 5.335549 weeks in microseconds? 3226940035200 How many nanometers are there in 1/5 of a micrometer? 200 How many grams are there in 1/20 of a kilogram? 50 How many months are there in twenty-seven halves of a century? 16200 How many meters are there in thirty-one fifths of a kilometer? 6200 How many millilitres are there in 68738.64 litres? 68738640 What is 8/15 of a minute in seconds? 32 How many centimeters are there in 7/2 of a meter? 350 Convert 4413.831 millimeters to meters. 4.413831 What is 3/8 of a kilometer in centimeters? 37500 How many millilitres are there in 1/5 of a litre? 200 How many grams are there in 75/4 of a kilogram? 18750 What is one fifth of a century in years? 20 What is 0.7328688 tonnes in milligrams? 732868800 What is twenty-six fifths of a millennium in centuries? 52 What is 29151.723 months in years? 2429.31025 Convert 535.1213km to millimeters. 535121300 Convert 74302.73 tonnes to nanograms. 74302730000000000000 What is 5.641139 nanograms in grams? 0.000000005641139 What is 5/8 of a second in milliseconds? 625 What is 264.0676 years in months? 3168.8112 How many milligrams are there in 8984.739 kilograms? 8984739000 How many nanometers are there in 25/4 of a micrometer? 6250 Convert 88.09582l to millilitres. 88095.82 Convert 734.8338 hours to seconds. 2645401.68 Convert 6645.37 centuries to millennia. 664.537 Convert 0.3215827 millimeters to micrometers. 321.5827 Convert 61602.03 litres to millilitres. 61602030 How many millilitres are there in 67/4 of a litre? 16750 What is 55638.96 days in milliseconds? 4807206144000 What is 93/4 of a meter in millimeters? 23250 What is 8/3 of a hour in seconds? 9600 What is 73.123488 minutes in days? 0.0507802 Convert 23061.153 months to millennia. 1.92176275 Convert 0.7432021 centuries to months. 891.84252 What is three fifths of a millimeter in micrometers? 600 How many litres are there in 634.6605 millilitres? 0.6346605 How many milligrams are there in eleven quarters of a gram? 2750 Convert 747996.8 micrometers to meters. 0.7479968 What is 1572.8874 days in weeks? 224.6982 How many centimeters are there in 5.555249m? 555.5249 What is 25228.6nm in kilometers? 0.0000000252286 How many grams are there in 1.378665t? 1378665 Convert 704.4987ng to grams. 0.0000007044987 What is 2.5062651 months in decades? 0.0208855425 How many millilitres are there in 4.89973l? 4899.73 How many millilitres are there in 3/10 of a litre? 300 What is 0.2190594 microseconds in seconds? 0.0000002190594 What is 11/8 of a meter in millimeters? 1375 How many kilograms are there in 79/2 of a tonne? 39500 What is 56.91919 grams in nanograms? 56919190000 What is 21/5 of a century in months? 5040 What is seven eighths of a kilometer in meters? 875 What is 26.453403 months in decades? 0.220445025 What is 5/8 of a centimeter in micrometers? 6250 How many micrometers are there in 0.6200401 kilometers? 620040100 What is 29/5 of a milligram in micrograms? 5800 What is seven halves of a kilometer in meters? 3500 What is 3/25 of a microgram in nanograms? 120 How many millilitres are there in 98086.65l? 98086650 What is 1/20 of a centimeter in micrometers? 500 What is 22720.46mm in centimeters? 2272.046 What is 19852.91 tonnes in kilograms? 19852910 Convert 219132.1 decades to centuries. 21913.21 How many meters are there in three eighths of a kilometer? 375 What is 29/3 of a decade in months? 1160 How many months are there in 1/30 of a millennium? 400 What is twenty-one halves of a micrometer in nanometers? 10500 Convert 0.2614928 millennia to months. 3137.9136 Convert 7.50773mm to centimeters. 0.750773 How many nanograms are there in 1/16 of a milligram? 62500 What is 3060.348mg in kilograms? 0.003060348 What is three fifths of a century in months? 720 What is 216060.4ml in litres? 216.0604 Convert 0.7112387 micrometers to kilometers. 0.0000000007112387 What is 15/4 of a second in milliseconds? 3750 How many millilitres are there in nineteen quarters of a litre? 4750 How many microseconds are there in 2.337029 weeks? 1413435139200 How many months are there in 0.870104 centuries? 1044.1248 What is six fifths of a millennium in centuries? 12 How many milliseconds are there in 4292.782 weeks? 2596274553600 Convert 39.74348ml to litres. 0.03974348 What is 5358.655 grams in nanograms? 5358655000000 What is 6904.678l in millilitres? 6904678 Convert 452424.5l to millilitres. 452424500 How many meters are there in 53.94758 centimeters? 0.5394758 How many micrograms are there in 0.5580553 milligrams? 558.0553 How many microseconds are there in 5.645681 hours? 20324451600 What is 1/5 of a litre in millilitres? 200 How many micrometers are there in 1/4 of a centimeter? 2500 How many millilitres are there in fourty-seven quarters of a litre? 11750 Convert 1.178265m to kilometers. 0.001178265 How many hours are there in 10/21 of a week? 80 What is 29/2 of a year in months? 174 What is 13/4 of a litre in millilitres? 3250 What is 721335.2 decades in millennia? 7213.352 What is seven quarters of a litre in millilitres? 1750 What is 0.0607013 years in months? 0.7284156 Convert 0.0373761 micrograms to kilograms. 0.0000000000373761 How many millilitres are there in 9.308158 litres? 9308.158 How many litres are there in 946315.2 millilitres? 946.3152 How many millilitres are there in 3/5 of a litre? 600 How many millennia are there in 57.31391 centuries? 5.731391 What is 17238.88ml in litres? 17.	{ "pile_set_name": "DM Mathematics" }
6 - 10p2 + 5730 - 11456. -10p*2 Collect the terms in 27 - s - 71 + 7s - 12s. -6s - 44 Collect the terms in -2164 + x - 2167 + 6628 - 2297. x Collect the terms in 9 + 34 - 64 + 18 + 60k3 + 3. 60k*3 Collect the terms in 2 - 158i*2 + 52i*2 + 49i*2 + 59i*2 - 149i. 2i2 - 149i + 2 Collect the terms in 61o2 + 59o*2 - 174o*2 + 60o*2. 6o*2 Collect the terms in -51h + 66001h2 - 65997h*2 + 51h. 4h2 Collect the terms in -29q*3 - 3q*3 - 9q*3. -41q*3 Collect the terms in 113p*2 - 1980p*3 - 57p*2 - 56p*2. -1980p*3 Collect the terms in 3w + 6w - 27w*2 + 4w + 9w2 - 18w. -18w2 - 5w Collect the terms in 4r + 0 + 24r - 9r + 4 + 15r. 34r + 4 Collect the terms in -5453405 - 780k + 5453405. -780k Collect the terms in -13567y - 8769y + 3762y - 8247y. -26821y Collect the terms in -323q3 - 18882q*2 + 18882q*2 + 319q*3. -4q*3 Collect the terms in 1446i*3 - 742i*3 - 706i*3. -2i*3 Collect the terms in -127w*3 - 229w*3 - 777w*3. -1133w*3 Collect the terms in 22 - 90 + 500c - 499c. c - 68 Collect the terms in -194374b - 194357b + 388716b. -15b Collect the terms in -88857580626y + 88857580626y + 3y*2. 3y*2 Collect the terms in 3974u - 1323u - 1329u - 1319u. 3u Collect the terms in 56054m2 - m - 56228m*2 + 2m. -174m2 + m Collect the terms in 3379o - 10146o + 3388o + 3378o. -o Collect the terms in -1081f*3 - 18f*2 + 2162f*3 - 1079f*3. 2f*3 - 18f*2 Collect the terms in 652222z*2 - 4z - 652213z2 + 5z. 9z2 + z Collect the terms in -4i + 4i + 361168i*3. 361168i*3 Collect the terms in -110603t + 55339t + 55266t. 2t Collect the terms in -153q*2 - 1187129593q + 1187129593q. -153q*2 Collect the terms in 30j + 30j - 68 - 64j. -4j - 68 Collect the terms in 3r - 3220 - 3r + 8r*2 + 3220. 8r*2 Collect the terms in 475d*3 - 1178d*3 + 701d*3. -2d*3 Collect the terms in 138d*2 + 439d*2 - 719d*2 + 140d*2. -2d*2 Collect the terms in -30283v + 15140v + 3v*2 + 15143v. 3v2 Collect the terms in -8p*2 - 18p*2 - 45p*2 + 19p*2 - 56p*2. -108p*2 Collect the terms in -238x*3 + 101x*3 - 353x*3 - 3x*3. -493x*3 Collect the terms in -2k - 3 - 2k - 3k + 7k - k. -k - 3 Collect the terms in 58g + 47g - 5g*2 + 52g - 157g. -5g*2 Collect the terms in 10z + 632 - 12z + 2043. -2z + 2675 Collect the terms in 10453 - 352 - 2y2 + 817. -2y*2 + 10918 Collect the terms in 57s + 62s - 262s + 90s + 52s. -s Collect the terms in -182s2 + 116s*2 + 16s*2 + 33s*2 + 36s*2. 19s*2 Collect the terms in -45 + 184 - 39 + 4c - 45 - 55. 4c Collect the terms in -246i*3 - 245i*3 + 3 + 497i*3. 6i*3 + 3 Collect the terms in 668762x - 668762x + 12x*3. 12x*3 Collect the terms in 490d*3 - 244d*3 - 238d*3. 8d*3 Collect the terms in -1711z*2 + 5062z*2 + 5428z*2. 8779z*2 Collect the terms in -1 - 1782r + 1 + 3710r - 1929r. -r Collect the terms in -7768f2 - 9103f*2 + 16882f*2. 11f*2 Collect the terms in 298 - 890 - 19i + 294 + 298. -19i Collect the terms in -73x*2 - 7x*2 - 37x*2 - 96x*2. -213x*2 Collect the terms in 53y + 5 + 16y2 - 7 + 50y*2. 66y*2 + 53y - 2 Collect the terms in 198j - 43j - 58j - 48j - 56j. -7j Collect the terms in -63d3 - 176d*3 - 126 + 126. -239d*3 Collect the terms in -3g*2 - 391024391 + 391024391. -3g*2 Collect the terms in 8g*2 + 9708g*3 - 26g*2 + 18g*2. 9708g*3 Collect the terms in -14n + 4n - 8 + 0n. -10n - 8 Collect the terms in -35i + 87i + 7i*2 - 33i - 28i. 7i*2 - 9i Collect the terms in 181 - 379 + 199 + 10j2. 10j2 + 1 Collect the terms in 593720 - 296854 + r2 - 296866. r*2 Collect the terms in 119690 + 73u - 119690. 73u Collect the terms in 15955v + 21513v - 20611v + 57307v. 74164v Collect the terms in 3w2 + 115w*3 - 1 - 4 - 2w*2 - 5. 115w3 + w2 - 10 Collect the terms in -132x2 + 2 + 218x*2 - 181x*2. -95x*2 + 2 Collect the terms in -11767g*2 + 5880g*2 + 5887g*2 - 26g*3 + 18g*3 - 24g*3. -32g*3 Collect the terms in -78676s*2 + 3 + 78056s*2 + 1 - 4. -620s*2 Collect the terms in -2w*3 + 2w*3 - 25w*3 + 4w*3 - 21w*3. -42w*3 Collect the terms in -2981l + 6495l + 19696l. 23210l Collect the terms in -3142h + 1687h - h2 + 1455h. -h*2 Collect the terms in 3q*2 - 1000q*3 + 146 - 145 + 5657q*3. 4657q*3 + 3q*2 + 1 Collect the terms in 760d*2 - 782d*2 + 616d*2. 594d*2 Collect the terms in -140d*2 + 331d*2 + 3 - 6 - 189d*2 + 3. 2d*2 Collect the terms in 18g + 5279g2 + 13303g*2 - 18g. 18582g2 Collect the terms in -3098 + 6309 + 13i - 3211. 13i Collect the terms in 68609 - 68609 - 260c - 17c. -277c Collect the terms in 5 + 12s + 68s - 23s. 57s + 5 Collect the terms in a - 3a + 183407380 - 183407380. -2a Collect the terms in -90d - 57d + 20d - 233d. -360d Collect the terms in -4 + 3g - 4g + 120. -g + 116 Collect the terms in -16o + 20o - 34o + 22o + 9o. o Collect the terms in 2p2 - 3705p*3 - 3701p*3 + 7502p*3. 96p*3 + 2p2 Collect the terms in c2 + 16917 - 15641 + c*2 - c. 2c*2 - c + 1276 Collect the terms in 173l*2 - 34l*2 - 39l*2 + 102l*2. 202l*2 Collect the terms in -1 + 185j*3 + 1306j*3 - 1. 1491j*3 - 2 Collect the terms in 189c + 188c + 185c + 188c - 924c + 180c. 6c Collect the terms in 66 - 110 + 28r3 - 45r*3 + 44. -17r*3 Collect the terms in 23r*2 + 8 + 7 - 3 - 12. 23r*2 Collect the terms in -5h + 3h2 + 155525 - 155525 + 5h. 3h2 Collect the terms in -198 - 243 + 0b*3 - 5b*3 + 441. -5b*3 Collect the terms in -1 - 4095i + 14548i + 1. 10453i Collect the terms in 290p + 301p - 911p + 283p. -37p Collect the terms in 217i*3 - 2610i*3 - 536i*3. -2929i*3 Collect the terms in -28 - 76 + 104 - 5s. -5s Collect the terms in -310w*3 - 291w*3 - 981w*3. -1582w*3 Collect the terms in 717m + 17 - 39 + 22. 717m Collect the terms in 107920l - 2l2 - 107920l. -2l2 Collect the terms in -161j + 767j - 607j - 4j2. -4j*2 - j Collect the terms in 47v*3 - 2v*2 + 2v*2 + 2v*3 + 2v*2. 49v*3 + 2v*2 Collect the terms in 54g + 48g + 64g - 148g. 18g Collect the terms in -2430l + 1209l + 1218l. -3l Collect the terms in -562u3 + 123515u*2 - 123515u*2. -562u*3 Collect the terms in 1828 - 1828 + 11n*2. 11n*2 Collect the terms in -33o - 24o + 18o + o. -38o Collect the terms in -40074063 + 40074063 - 14j*3. -14j*3 Collect the terms in 4215v*2 + 745v*2 + 1 + 4v - 6v. 4960v*2 - 2v + 1 Collect the terms in 77678k2 + 69537k*2 - 49698k*2. 97517k*2 Collect the terms in 903 + 4a*2 - 9a + 9a - 2a*3 - 903. -2a*3 + 4a*2 Collect the terms in 31 - 2k*3 - 4496k - 12 - 19 + 4515k. -2k*3 + 19k Collect the terms in 5 + 37r - 2 - 2 - 2 + 22r. 59r - 1 Collect the terms in -10m*3 - 153 + 140 + 14m*3. 4m*3 - 13 Collect the terms in -89707 - 29o*2 + 89707. -29o*2 Collect the terms in -462g + 1268g - 450g - 438g. -82g Collect the terms in -4q2 - 60q*3 + 49q*3 - 1239q*3 + 2q*2. -1250q*3 - 2q*2 Collect the terms in 4481f - 6f2 - 6 - 4481f. -6f2 - 6 Collect the terms in -262 + 0z + 0z - 42z*2 + 261. -42z*2 - 1 Collect the terms in 4 - 1323b - 4 + 1318b. -5b Collect the terms in -5 - 367g2 + 360g*2 - 9 + 17 - 3. -7g*2 Collect the terms in -3n*3 + 3n3 - 1 + 0 - 2 + n3. n3 - 3 Collect the terms in -q2 + 894894 - 894894. -q*2 Collect the terms in 23v - 74v + 27v + 6 + 28v + 23. 4v + 29 Collect the terms in 515n3 - 2 + 2 + 3n*3 + 2n*2. 518n*3 + 2n2 Collect the terms in z3 - 4z3 + 8z*3 + 9z*3 - 29z*3. -15z*3 Collect the terms in 484n - 44n2 - 46n*2 - 50n*2 + 138n*2. -2n*2 + 484n Collect the terms in 2d2 - 208448 + 208448. 2d*2 Collect the terms in -371 - 189t + 371 - 335t - 388t. -912t Collect the terms in 232o - 29o - 27o - 199o. -23o Collect the terms in 39r + 14r - 122r + 17r. -52r Collect the terms in 170h*3 - 416h*3 - 159h*3. -405h**3 Collect the terms i	{ "pile_set_name": "DM Mathematics" }
e 0 = -rv - 5o + 1111, -2v = 5o - 1005 + 271. What are the prime factors of v? 13, 29 Suppose 0 = -2p - 1116i + 1111i + 18286, -3i = -p + 9165. List the prime factors of p. 3, 113 Let s(q) = -q*3 + 3q*2 - q - 814. Let u(m) = -2m*2 - 2m - 1. Let a(k) = -s(k) - 2u(k). What are the prime factors of a(0)? 2, 3, 17 Let q(i) be the second derivative of i4/12 - 8i*3/3 + 30i. Let w be q(16). Suppose w = 2c + 54 - 246. List the prime factors of c. 2, 3 List the prime factors of 106270/4 + -8 + (-42)/(-28). 26561 Let k = 619 + -403. Let v = k + 65. What are the prime factors of v? 281 Let n = 1852 - -266. Suppose -5 = -4f + 3, 3f + n = 2z. What are the prime factors of z? 2, 3, 59 Suppose 0 = -3o - k + 33, 46 = 3o + 5k + 13. List the prime factors of 0 - -4 - (o - 185). 2, 89 Suppose 12 - 32 = -5n. Let u be -1 + 2/n4. What are the prime factors of 0 + u/4 + (-1086)/(-8)? 2, 17 Let m(s) be the third derivative of s4/6 - 3s*3/2 - 5s*2. Let f be m(-3). Let a = f + 23. What are the prime factors of a? 2 Suppose -228 - 132 = -10y. Let x(j) = -j*2 + 2j + 2. Let a be x(3). Let w = y + a. What are the prime factors of w? 5, 7 Let p(q) = 35q2 + 12q + 2. Suppose 4a = 3a - 2. What are the prime factors of p(a)? 2, 59 Let h = -35904 + 51861. What are the prime factors of h? 3, 197 Let h(t) = -t3 + t2 + 2t. Let x be h(-2). Suppose 5l = -2d - 65, -2d + 17 - 58 = -3l. Let n = x - d. What are the prime factors of n? 3, 11 Let r = -221 + 343. Suppose 119l - rl = -2181. What are the prime factors of l? 727 Let b = -5774 + 44720. List the prime factors of b. 2, 3, 6491 Suppose -12l + 16l = 88. Suppose -452 = -6s + l. Suppose -w = -s - 14. List the prime factors of w. 3, 31 Suppose 79r - 76r + 9 = 0. What are the prime factors of 745 - (0 - r) - 35/(-7)? 3, 83 Let c = -23470 - -32876. List the prime factors of c. 2, 4703 Suppose -1267742 + 4985066 = -93k + 327k. What are the prime factors of k? 2, 13, 47 Let m(o) = -o*3 + 48 + 21 - 5o*2 + 23 + 54o - 29o2. What are the prime factors of m(-36)? 2, 5, 37 Let m(c) = -c2 + 18c + 88. Let j be m(-4). Suppose 9o - 4586 - 409 = j. What are the prime factors of o? 3, 5, 37 Suppose -4v = -49q + 50q - 55671, 5q = -4v + 55683. List the prime factors of v. 3, 4639 Let n(a) = a*2 + 23a + 40. Let j be n(-21). What are the prime factors of (j/(-4))/(12/3912)? 163 Suppose -40803 = -4f - 3p, 4f - 12605 - 28163 = 4p. What are the prime factors of f? 3, 11, 103 Suppose -4n = n - 20. Let w(m) = 82m - 19. Let h(j) = 9j - 1. Let c(y) = -24h(y) + 3w(y). What are the prime factors of c(n)? 3, 29 Suppose -4w - 1 = -4h + 15, 3h + 4 = -5w. Suppose -hq - 5b + 3b + 524 = 0, b - 792 = -3q. What are the prime factors of q? 5, 53 Let k = 40017 + -23017. What are the prime factors of k? 2, 5, 17 Let m(p) = 1655p + 808. What are the prime factors of m(6)? 2, 7, 13, 59 List the prime factors of (-4335)/(-34)(4/12)/(2/592). 2, 5, 17, 37 Suppose -5t + 405 = -n - 366, -t = -2n - 156. Suppose -t = -3f + 173. Let c = 191 - f. List the prime factors of c. 2, 41 Let x(l) = 6l - 48. Let d be x(10). What are the prime factors of (d/(-4))/((-3)/610)? 2, 5, 61 Suppose -1 = -q, 2p = 5p + q - 94. Let m(c) = -c3 + 45c*2 + 423c + 33. Let b be m(53). List the prime factors of (p + -2)/((-5)/b). 2, 29 Suppose 2n = -3r + 4456, 7n - 2r = 3n + 8896. List the prime factors of n. 5, 89 Let k = -295 - -291. What are the prime factors of (k/4)/((-10)/4800)? 2, 3, 5 Suppose 0 = 6r - 647 - 11653. What are the prime factors of r/8 - 2/(-24)-3? 2 Let v(a) = 13a*2 + 24a + 24. Suppose -22t + 71 = -127. List the prime factors of v(t). 3, 431 Let t(y) = -2y*2 - 3y - 40. Let n be t(-13). Let s = n - -543. What are the prime factors of s? 2, 3, 17 Let m be (-24)/(-15)(-2)/(16/(-20)). Suppose -my + 907 = -565. Let x = y + -256. List the prime factors of x. 2, 7 Suppose 9678952 = 262q - 9375784. List the prime factors of q. 2, 9091 Let r(s) = s3 + 7s*2 + 3s*2 - 4s - 5s2 + 2s*2 - 3. Suppose 4o + 16 = 0, 6z - 3o = z - 23. List the prime factors of r(z). 5 Let w(r) = -3r2 + 40r - 42. Let j be w(12). Suppose 228 = 4z + 4h, -jz = -3z - h - 151. What are the prime factors of z? 2, 13 What are the prime factors of (1 - 959)/(14 + (-5984)/425)? 5, 479 Let h be (45/(-27))/(3/927). List the prime factors of 4h/(-100)15. 3, 103 Let v = 41553 - 18962. Suppose -v = -40b - b. What are the prime factors of b? 19, 29 Let r = 202 - 252. List the prime factors of 1076/20 + (-10)/r. 2, 3 Let z(a) = a2 + 66a - 37a - 26a - 4. Let q be z(2). Suppose 0 = qp - 551 - 961. List the prime factors of p. 2, 3, 7 Let p = 963 + -957. Suppose 955 = -pm + 1447. What are the prime factors of m? 2, 41 What are the prime factors of 1/10 + 756197/70? 2, 19, 199 What are the prime factors of 31647/22 + 7(-7)/(-98)? 1439 Let n be -321 + (-5)/1012. Let x = 721 + n. What are the prime factors of x? 2, 197 Suppose 3 = 3a, 8a - 8351 = -2k + 7a. What are the prime factors of k? 5, 167 What are the prime factors of 2/5 - (-5 + (-20568)/5)? 3, 1373 Let p = 167 - 19. Suppose -p = -3f + 5c, -3c + 22 = 4f - 156. What are the prime factors of f? 2, 23 List the prime factors of -7798(14 - (-464)/(-32)). 7, 557 Let g = -732 + 22565. What are the prime factors of g? 7, 3119 Let h(a) = -a*2 - 23a + 54. Let c be h(-25). Suppose -4b - 4098 = -3v - 2v, cb = -2v + 1628. What are the prime factors of v? 2, 409 Let o = 2 + 1. Suppose 126 = 5f + ok, 5f - 4k - 129 = -17. Let x = f - -71. List the prime factors of x. 5, 19 Let c(r) = 2069r*2 + 32r + 39. List the prime factors of c(-3). 2, 3, 7, 13, 17 List the prime factors of (-91707)/14((-1068)/414 + 10/(-115)). 2, 11, 397 Suppose 49i = 51i - x - 67643, -5 = 5x. List the prime factors of i. 31, 1091 Let w(s) = -721s + 4881. What are the prime factors of w(-86)? 211, 317 Suppose 3y = -i + 2540, -4y = -2i - 1193 - 2197. Suppose -s + y = -b, -4227 = -6s + s + b. What are the prime factors of s? 5, 13 Let m(g) = -g3 + 46g*2 - 34g + 389. List the prime factors of m(43). 2, 2237 Suppose -2 = n, -5g + g = -n - 6. Let t(w) = 359w2 + w - 1. What are the prime factors of t(g)? 359 Let m(x) = x2 + 13x - 38. Let o = -41 - -24. What are the prime factors of m(o)? 2, 3, 5 Let k be (-4)/(-26) - (-3040)/520. Suppose 0 = ku - 2751 + 45. List the prime factors of u. 11, 41 Let l be (-25440)/260 - 4/26. Let s = l + 5. Let i = -4 - s. List the prime factors of i. 89 Suppose -45z - 239583 = -50z - k, -3k = -4z + 191674. What are the prime factors of z? 47917 Let s = -137 + 502. Let j be s + 2/3 + 20/6. Suppose 9l + j = 12l. What are the prime factors of l? 3, 41 Let l(z) be the third derivative of -z*5/60 - 31z*4/24 + 31z*3/6 - 31z*2. What are the prime factors of l(-22)? 229 Let o(k) = 12k + 113. Suppose 0 = 12z - 3z - 207. What are the prime factors of o(z)? 389 Suppose 0 = -2y - 5d + 18, 4y = -10d + 5d + 16. Let h(c) = -259c*3 + 3c*2 + 3c + 1. What are the prime factors of h(y)? 2, 5, 13 Let r(y) = -1691y - 8834. What are the prime factors of r(-41)? 60497 Let s be (0 - -1)(112/14 - 13). List the prime factors of 246 - ((-6 - s) + 5). 2, 11 Let h be 2/(-4)(-22 + 16). Suppose 20 - 5 = hj. Suppose jx = 64 + 66. What are the prime factors of x? 2, 13 Suppose -132 - 63 = -i. Let s = i + -124. What are the prime factors of s? 71 Let a(c) = -3098c - 469. List the prime factors of a(-3). 5, 353 List the prime factors of (-410)/1845 - ((-2988903)/135 + (-2)/10). 2, 3, 5, 41 List the prime factors of 4181440/(-128)-21. 5, 73, 179 Suppose -117325 = -15o + 215. What are the prime factors of o? 2, 3, 653 Let j(f) = 10f*2 + 22f + 165. Suppose -26y = -44y - 216. What are the prime factors of j(y)? 3, 149 List the prime factors of 2/6(-71603145)/(-355). 3, 73, 307 Let s = 36118 + -23449. List the prime factors of s. 3, 41, 103 Let w = -158 - -158. Suppose 5t - 420 = -wt. What are the prime factors of t? 2, 3, 7 Let l(j) = -4 + 0j - 1 + 3j2 + 2j - 7j. Let x be l(-1). Suppose 0 = 3g + 3f - 186, -4f = -xg - 2f + 181. What are the prime factors of g? 61 Let t(m) = -m + 12. Suppo	{ "pile_set_name": "DM Mathematics" }
4 - 2r*2 wrt r? 120pr2 - 6p - 528r What is the second derivative of -123p*2u - 26p2 + 17p - 241u wrt p? -246u - 52 What is the first derivative of 28dq*3z - 77dz + 3q3 - 2qz wrt q? 84dq2z + 9q2 - 2z Find the second derivative of 3c3g3 + c3 - 6c + 1023g*4 - 47g wrt g. 18c3g + 12276g2 Find the third derivative of -2f*4j*3 - 375f*4jz2 - f2j*3 - 3f*2z*2 + 3f2 - j2z wrt f. -48fj3 - 9000fjz*2 What is the derivative of -34s*4 + 2s*3y*2 - 2sy - 4y*2 + 7y wrt s? -136s3 + 6s*2y*2 - 2y What is the derivative of 33n3v*4 - 5n*3v*3 + 337n*3 wrt v? 132n*3v*3 - 15n*3v*2 Find the second derivative of 2ah2o*3 + 2054ah2o*2 + 2aho*2 + 28ao + 11ho - o3 wrt h. 4ao3 + 4108ao2 What is the third derivative of -3w*6 + 102w*4 + 23w*2 - w wrt w? -360w*3 + 2448w Find the second derivative of 2fn*2s*2z + fn2s - 3fns2 - fsz - 25n*2s*2 + 187z wrt s. 4fn*2z - 6fn - 50n2 What is the first derivative of -355f*3r + 1058f3 wrt r? -355f*3 What is the third derivative of 12009j3 - j2 + 6127? 72054 What is the derivative of -37d3 - 16d - 495? -111d2 - 16 Differentiate -380i*3w - 8i3 + 142i + 9w2 with respect to w. -380i*3 + 18w Find the second derivative of -2708n3 - n2 + 6122n wrt n. -16248n - 2 What is the first derivative of 345q - 261 wrt q? 345 Find the third derivative of -47r5 + 910r*2 wrt r. -2820r*2 What is the third derivative of 10020u*3 + 5u*2 - 776? 60120 Find the third derivative of 3182t*3 + 31t*2 - 10t. 19092 Find the third derivative of -195n5 + 165n*2 - 1. -11700n*2 Differentiate 172s*4 - 2sz2 + 616z*2 wrt s. 688s*3 - 2z2 Find the second derivative of n4 - 165n3 + 422n - 2 wrt n. 12n2 - 990n What is the derivative of 810bs - 740b wrt s? 810b Find the second derivative of -891ab*2 + 13a + 17b wrt b. -1782a What is the second derivative of 90q2s3 + q2s + qs*3 + 319q wrt q? 180s3 + 2s What is the second derivative of -az4 + 6717az2 + 15az + 2a - 399z wrt z? -12az2 + 13434a Find the second derivative of -3jp*2w - 2jpw + 2ju + p2u + p*2w - 16p2 + 14puw + 2uw wrt p. -6jw + 2u + 2w - 32 What is the third derivative of o*6 - 5o*4 - 8o*2 - 2? 120o*3 - 120o Find the third derivative of -r*2z*4 + 18r*2z*2 + 2r*2 + 82rz5 + rz*2 wrt z. -24r*2z + 4920rz*2 What is the second derivative of 3d*3su2 + 2d*3su + 2d*3s + 10d2ju2 - 9du + ju + 3j wrt u? 6d*3s + 20d2j Find the second derivative of 24t5 + t + 22 wrt t. 480t*3 What is the third derivative of 695ai3rx - ai*2 + 678ai + 3i*3rx - i3r - 2i2rx + 2rx wrt i? 4170arx + 18rx - 6r Find the first derivative of 809o + 705 wrt o. 809 What is the third derivative of -4d4j - 19d4 + 60d*2 + dj wrt d? -96dj - 456d Differentiate 3ku3y + 4ky*2 + ky + 8u3y*2 - 4u*3y - 4uy*2 + 2uy with respect to k. 3u*3y + 4y2 + y What is the second derivative of -536g*2 + 2g - 68 wrt g? -1072 What is the third derivative of 13b4f*2 - 5b*4 + 6b*2f + bf2 - 24bf wrt b? 312bf2 - 120b What is the third derivative of 2526ny*5 - 2ny2 + 70n + y*5 - 3y + 1 wrt y? 151560ny*2 + 60y*2 Find the second derivative of 847p*2 + 612p wrt p. 1694 Find the second derivative of -10o3 - o + 19 wrt o. -60o Find the first derivative of -57bcp - 3bc + 81bp - 13b + 2cp - 2c wrt c. -57bp - 3b + 2p - 2 Differentiate -1135r + 172. -1135 Find the second derivative of -1459k2v*2 - 66k + 4v2 + v wrt k. -2918v*2 What is the derivative of 179m*4 + 64 wrt m? 716m*3 Find the second derivative of 4960j*5 + 2j + 6137 wrt j. 99200j3 What is the third derivative of -2c*2w*3 - 3c*2w*2 - 17c*2w - 2w4 + 5w*3 wrt w? -12c*2 - 48w + 30 What is the third derivative of 57q3 - 148q*2 wrt q? 342 Find the second derivative of 32z*5 + 43z*2 + 47z - 6. 640z3 + 86 What is the second derivative of -28c*2i*2s*3 - 17c*2is3 + 3ci2 - c - 8is - 12s*3 wrt c? -56i*2s*3 - 34is3 Find the third derivative of 595y*5 + 297y*2. 35700y*2 What is the second derivative of 9a*2gv3 - a2g - 74agv3 + 2av3 wrt a? 18gv3 - 2g What is the second derivative of -13s3 + 13s*2 + 616s wrt s? -78s + 26 Find the third derivative of 8480n*5 - 3n*2 - 1336n - 1 wrt n. 508800n2 Differentiate -137o*3 + 224 wrt o. -411o*2 Find the second derivative of 1508f*2 + 3414f. 3016 What is the third derivative of 2g6 + 6g5 - g2 - 88g? 240g*3 + 360g*2 What is the third derivative of 12as4 - 2as2 - 2as + 2s*6 + 2s*4 - 2s*2 wrt s? 288as + 240s*3 + 48s Find the second derivative of -15l4 + l2 + 542l - 2. -180l2 + 2 Find the third derivative of -5425m*3 - 5154m*2 wrt m. -32550 What is the first derivative of 2p*4 - 64p*2 - 25 wrt p? 8p*3 - 128p Find the second derivative of gr4 - 70gr3z - 3gr + gz - r wrt r. 12gr2 - 420grz What is the second derivative of -253ad*2 + 2a + d wrt d? -506a Find the first derivative of 1051r - 1095 wrt r. 1051 Find the second derivative of -114k2 - 2k - 122 wrt k. -228 What is the second derivative of 3l5 + 32l*4 - 6l + 18 wrt l? 60l3 + 384l*2 Find the third derivative of -9q*3y*2 - 209q*2y*2 wrt q. -54y*2 What is the second derivative of -192b*3 - 30b + 2? -1152b What is the third derivative of 380i*5 + 2i*4 - 2636i*2 wrt i? 22800i*2 + 48i Differentiate -15c3 + 16c*2 - 4c - 5475. -45c2 + 32c - 4 Find the first derivative of 5419f - 142. 5419 Find the second derivative of -3bq3 - 2b + 2q5 + 2q*4 - 28q - 1 wrt q. -18bq + 40q3 + 24q*2 What is the third derivative of 319j*3 + 2j*2 + 57? 1914 Find the first derivative of -25dhv - 6dh - 14hv + 21h wrt d. -25hv - 6h What is the second derivative of n*5 + 7420n*4 + 7n + 550? 20n3 + 89040n*2 Find the third derivative of -305l*3u*3 - 9l*3u*2 - 3l*2u - 2l2 + 193u*3 wrt l. -1830u*3 - 54u*2 What is the second derivative of 38c*2i*2 - 112c*2i + 3c - 101i*2 - 4 wrt c? 76i*2 - 224i What is the second derivative of -509b3 + 14169b? -3054b What is the second derivative of 23x*3 - 10x*2 - 732x? 138x - 20 What is the second derivative of 4435d*2q + 2dq - 3288d wrt d? 8870q What is the third derivative of cv5 - 435cv - 2c + 812v5 + 2v*2 wrt v? 60cv2 + 48720v2 What is the derivative of j4 + 454jx + 41x + 1 wrt j? 4j*3 + 454x What is the second derivative of 21a5 + 4a*3 + 5a - 6 wrt a? 420a3 + 24a What is the third derivative of 8f3hlw + 6f3hl - f3hw3 - f3h + f*3w*3 - 2flw*2 + 207lw3 + 4lw2 wrt w? -6f*3h + 6f3 + 1242l What is the third derivative of -54g5 + 4g*3 - 3g*2 + 75g wrt g? -3240g2 + 24 What is the first derivative of 16a*2r - 3a2 + 4a + r*2 - 39r - 48 wrt r? 16a2 + 2r - 39 What is the second derivative of -6ds*3w*2 - 365ds2w + dsw*2 + 24ds - 4dw2 + dw - s*3w + 2sw*2 wrt s? -36dsw*2 - 730dw - 6sw Find the first derivative of -3s*2v + 47s2 - 2v - 49 wrt s. -6sv + 94s Differentiate -62k*2muv + 23k2mv2 + k2v*3 + 21kmuv3 + 2kv3 - 3mv3 wrt u. -62k*2mv + 21kmv*3 What is the third derivative of 50l*5 + 2l*3 + 3l*2 + 12? 3000l2 + 12 What is the third derivative of k6 + 673k5 - 17k*2 + 169 wrt k? 120k*3 + 40380k*2 What is the second derivative of -5co2q*2x + 2coqx + 10cq*2x + 7c - 3o*2q - 13ox + 6q2x wrt q? -10co*2x + 20cx + 12x Find the third derivative of 1107b*3 + 13b*2 + 146. 6642 Differentiate -34jl3 + 3l*3 + 4 with respect to j. -34l*3 What is the third derivative of 2t*3u*3 + 2t*3 + 4t*2 + 28tu4 + 6u*2 wrt u? 12t*3 + 672t*u Find the second derivative of	{ "pile_set_name": "DM Mathematics" }
ainder when i is divided by 40 - 0/((-2)/2)? 38 Let g be 1/4 - 147/(-4). Let l = g + -23. Let z(o) = o3 - o2 + 25. What is the remainder when z(0) is divided by l? 11 Suppose 5s - 4k - 32 = 0, -23s - k - 38 = -28s. What is the remainder when 140 is divided by s? 4 Suppose -k + 0 = -5. Suppose 5w = g + 2020, -3g - 5w = -0w + 6080. Calculate the remainder when g/(-105) - 2/7 is divided by k. 4 Suppose -1 + 9 = 4c. Suppose cn - 111 = -29. Suppose 0 = -4z + 2 + 42. Calculate the remainder when n is divided by z. 8 Let v(i) = 45i*2 + 70i + 139. What is the remainder when v(-2) is divided by 49? 32 Let t(u) = u*2 - u - 5. Let h = 16 - -3. What is the remainder when t(7) is divided by h? 18 Suppose -3253p + 3258p - 290 = 0. What is the remainder when p is divided by 54? 4 Let o = 21 + -37. Let k = -3 - o. What is the remainder when k is divided by 5? 3 Let j(c) = -2c*2 + 9c + 12. What is the remainder when 34 is divided by j(5)? 6 Let v = -154 - -159. Let w = 6 - -13. Calculate the remainder when w is divided by v. 4 Let d(s) = s*2 - 21s + 4. Let y(k) = -k*2 + k - 1. Let m(a) = d(a) + 2y(a). What is the remainder when m(-18) is divided by 1 - 1 - 12-1? 8 Let s(x) = -2x*2 - 13x - 5. Let z be s(-5). Suppose -8n + zn - 10 = 0. What is the remainder when 89 is divided by n? 4 Let i = 6 + -1. Suppose 4a = 0, 5u + a = i + 5. What is the remainder when 19 is divided by ((-7)/(-5))/(u/10)? 5 Calculate the remainder when (183/(-2))/(35/(-70)) is divided by 44. 7 Let z be ((-94)/4)/((-2)/4). Suppose -x - 44 = -2s, 3s + 3x - z = 10. Calculate the remainder when s is divided by 11. 10 Suppose 3s - 2s - 2 = 0. What is the remainder when ((-63)/5)/(6/(-20)) is divided by 13 + (s - (6 - 2))? 9 Suppose -2h = z - 43, z + 3 = 4h + 40. Calculate the remainder when z is divided by (0 - (-22)/6)6. 19 Let o(a) = a*2 - 8a - 18. What is the remainder when 449 is divided by o(12)? 29 Suppose -4s - 5t + 626 = 0, -4s - 2t - 163 = -5s. Calculate the remainder when s is divided by 31. 4 Calculate the remainder when 190 is divided by (0 - 4)/(8/(-92)). 6 Calculate the remainder when 7036/18 - 26/(-234) is divided by 99. 94 Let n(z) = 26z - 404. What is the remainder when 224 is divided by n(24)? 4 Let g(a) = a*3 - 4a*2 - 5a + 3. Calculate the remainder when (-6 - -8 - -3) + 3 is divided by g(5). 2 Let f = -59 - -71. Let g(x) = x*2 - 4x - 38. What is the remainder when g(11) is divided by f? 3 Let k = 369 + -307. Let o(i) = 3i2 + 3i - 4. Calculate the remainder when k is divided by o(-4). 30 Let b be 16/2 + -4 - -39. Let s = -23 + b. Calculate the remainder when 2/(1/((-154)/(-4))) is divided by s. 17 Suppose -5d + 5 - 12 = -h, -2d = 2. Suppose 0 = -hz + 4z - 158. Calculate the remainder when z is divided by -2 + (261/3)/3. 25 Suppose -17 = -o - 5. Suppose 0 = q + 3q - 32. Suppose -om + 11m = -q. Calculate the remainder when 12 is divided by m. 4 Let w = 807 + -780. Calculate the remainder when 76 is divided by w. 22 Suppose f - 31 = 3c, -4c + 52 = -2f + 4f. Suppose 5d - 2d = 48. Calculate the remainder when f + 4/d4 is divided by 10. 9 Suppose 7y = 4y - 45. What is the remainder when (y/(-5))/((-3)/(-38)) is divided by 6? 2 Let i(n) = -5n2 + 23n - 17. Let s(d) = -2d2 + 11d - 8. Let a(l) = 3i(l) - 7s(l). What is the remainder when 20 is divided by a(-7)? 8 Let b(a) = -a + 38. Let z(f) = -11f3 + 3f*2 - 1. Let h be z(1). Calculate the remainder when 279 is divided by b(h). 44 Let p = 1191 + -1150. Calculate the remainder when 68 is divided by p. 27 Let q = -90 - -151. Suppose q = 4r - 0w - 5w, 3w = -4r + 85. What is the remainder when 68 is divided by r? 11 Suppose 0 = 3z - 5d - 12, z + 16 = 5z + 2d. What is the remainder when 11/(-7)(42 - 49) is divided by z? 3 What is the remainder when (-35)/(-49)21/(-3) + 266 is divided by 14? 9 Suppose 0 = -j + 5 - 4. Let z(d) = -d*3 - d + 1. Let v be z(j). Calculate the remainder when 32 + 0 - 1/v is divided by 17. 16 Suppose -52b = 479 - 3911. What is the remainder when 525 is divided by b? 63 What is the remainder when ((-35184)/30)/8-5 is divided by 123? 118 Let v = 515 + -485. What is the remainder when 149 is divided by v? 29 Suppose -3a + 4k = -6, 4 = 5a + k - 6. What is the remainder when 369 is divided by a? 1 Let h be ((-45)/(-15))/(6/56). Suppose 70 = 5p - 5b + 3b, 2p = 2b + h. What is the remainder when 39 is divided by p? 11 What is the remainder when 60 is divided by (-2)/6(-516)/4? 17 Let d(g) = -g*2 + 9g - 10. Let h be d(9). Suppose -10f + 7f = -45. What is the remainder when 584/20 + 2/h is divided by f? 14 Let f(t) = -23t3 + t. Let m be (0 - -2) + (-5778)/(-9). Calculate the remainder when f(-1) is divided by -2 + 2/(-9) + m/63. 6 Suppose 2f - 1 = 17. Suppose -fb + 7b = -16. What is the remainder when 28 is divided by b? 4 Let k(y) = y*3 - 5y*2 - 2y - 2. Suppose -2h + 5 = -7. Let x be k(h). Let a = x + 6. What is the remainder when a is divided by 10? 8 Suppose 19 = 7i - 23. Suppose 1 = iu - 347. Suppose 0 = m - 8 - 7. Calculate the remainder when u is divided by m. 13 Let t = 8 - 7. Let r = 118 - 81. What is the remainder when r is divided by (-244)/305-1(9 + t)? 5 Let q be ((-18)/(-27))/(6/927). Suppose 2m - 58 = 2f, -4f + 12 = 3m - q. Let v(x) = -2x - 13. Calculate the remainder when m is divided by v(-11). 6 Suppose 5j = 4g - 7 - 25, 4g + 2j - 32 = 0. Suppose -4f + 20 = 0, 5x - 18 = -2f + 22. What is the remainder when g is divided by x? 2 Let k(j) = j3 - 3j*2 + 3j - 4. Suppose 3v - 9 = -0v. Let b be k(v). Suppose bd - 5 = 5. What is the remainder when 4 is divided by d? 0 Suppose 10g - 80 = 2g. Let i = -53 - -121. Calculate the remainder when i is divided by g. 8 Suppose -14g + b - 61 = -16g, 0 = g + 3b - 33. Calculate the remainder when 62 is divided by g. 2 Let d = -251 - -440. Let k = 300 - d. What is the remainder when k is divided by 16? 15 Suppose -2v + 6v = 16, -3g + 157 = -2v. Calculate the remainder when g is divided by 32. 23 Let a(t) = 46t - 227. What is the remainder when 96 is divided by a(6)? 47 Suppose 0 = -5h + 8 + 7. Suppose ht - 4 = 2. What is the remainder when (-1 - 17/(-6)) + 9/54 is divided by t? 0 Suppose 0 = 3b + 4r - 70, 4b = -r + 75 + 27. Calculate the remainder when 179 is divided by b. 23 Calculate the remainder when 1/((-6)/(-1608))3/12 is divided by 36. 31 Let y = -34 - -24. Calculate the remainder when 25 is divided by y/(-45) + (-79)/(-9). 7 Suppose -3t + 375 = -4a, -t + 3a - 7a = -125. Suppose -279 = -8p - 23. What is the remainder when t is divided by p? 29 Let a(o) = -o*2 - 25o - 52. Let w = -178 + 280. Let p = 155 - w. What is the remainder when p is divided by a(-22)? 11 Let s(k) = k*3 + 9k*2 - 1. Suppose -6b + 58 = -3b + 28. Calculate the remainder when s(-7) is divided by b. 7 Suppose 37 = 5h - 2p - 33, -2h + p + 27 = 0. What is the remainder when 92 is divided by h? 12 Let c(k) = 11 + 2k - 3k - 9. What is the remainder when 15 is divided by c(-6)? 7 Let o = 922 + -907. Let g(a) = 2a2 + 8a + 5. What is the remainder when g(-6) is divided by o? 14 Let k = -2 - -5. Let s be 5/10 + k/2. Calculate the remainder when 21/s - -27 is divided by 10. 8 Suppose -v = 6v - 1155. Suppose -5y = 5l - v, -l + 2y - 99 = -4l. What is the remainder when l is divided by 12? 9 Suppose -2l - 6o = -7o - 41, -3o - 69 = -3l. Let q = 6 + l. Suppose 33 + 247 = 4t. What is the remainder when t is divided by q? 22 Suppose 1126 - 366 = 10j. Calculate the remainder when j is divided by 27. 22 Let k(r) = -r2 - 32r - 73. What is the remainder when k(-21) is divided by 54? 50 Let w = -40 - -57. What is the remainder when w is divided by 4? 1 Suppose -5h - 68 = -438. Let q = -1717 + 1736. Calculate the remainder when h is divided by q. 17 Let p = -22 - -40. Let q be (-24)/16 + 2/(-4). Calculate the remainder when (-3)/q(-212)/(-6) is divided by p. 17 Let s = 21 - 9. Calculate the remainder when s - 4/(-8 + 4) is divided by 8. 5 Let i(n) = 2n3 - 2n*2 - 4. Let m be i(2). Suppose -5v = ma - 25, 2v + v + 4*a = 7. Calculate the remainder when v is divided by 7. 2 Let b = 1 - -8. What is the remainder when	{ "pile_set_name": "DM Mathematics" }
3300w2 + 12w What is the third derivative of -26b4 + 42481b*3 - 24b*2 - 665b - 4 wrt b? -624b + 254886 Find the second derivative of -2188i*4 - 61i*3 + 56i + 2978 wrt i. -26256i2 - 366i Differentiate 3f3w + 1010fw*2 + 6w*2 + 9w + 5 with respect to f. 9f2w + 1010w2 What is the first derivative of 35av2 + 33872a - 4v4 + 13v*2 wrt v? 70av - 16v*3 + 26v Differentiate -127595f3pu2 + 2481f*3u*2 - 2pu2 + 33u*2 with respect to p. -127595f*3u*2 - 2u*2 Find the third derivative of 50533o*4 - 1732o*2. 1212792o Find the second derivative of -224a2l*2 - 2a*2l - 10a2 + 245al2 - 65al wrt a. -448l*2 - 4l - 20 What is the first derivative of -17369h3r*2 - 5h*3 + 23h*2 + 3h + 7r2 - 14 wrt r? -34738h*3r + 14r What is the first derivative of -84191t*2 + 3t + 856174? -168382t + 3 Find the third derivative of -4426bd3y*3 - 3bd3 - 2bd2y - 7by*3 - 304d*2y*2 - 5dy2 wrt y. -26556bd3 - 42b Find the third derivative of -4b4x*2 - 257180b*4 + 7b*2 - 3bx2 - 7282x*2 wrt b. -96bx2 - 6172320b Find the second derivative of -154509o3 - 1064467o. -927054o Find the second derivative of a3j*2n + 5a3jn3 - a3n*2 - 4a*2j*2n*3 + 9a*2jn2 - 2a*2j + 30jn*2 wrt j. 2a*3n - 8a2n*3 Find the second derivative of 3313139c*3 - 2011c - 685. 19878834c Find the first derivative of -8g*3 + 65g*2 + 5008. -24g*2 + 130g Differentiate gv3x - 16583gv*3 - 18571v*3x with respect to g. v*3x - 16583v3 Find the first derivative of -3a*4b*3 + 381211a*2b*3 + 911b*3 + 364b wrt a. -12a3b*3 + 762422ab3 What is the derivative of -1604z*4 + 2z*2 + 21218? -6416z*3 + 4z Find the second derivative of 225757g2u*2 + 2g*2u + 23110u wrt u. 451514g*2 What is the third derivative of 690489k*6 - 710k*2 - 346k + 2? 82858680k3 What is the first derivative of -47673y*2 + 70396? -95346y Find the third derivative of 5977310n3 + 3750022n*2. 35863860 Find the second derivative of -5w*3 - 10652w*2 - 195455w wrt w. -30w - 21304 What is the second derivative of -4a*2fz + 92a*2f - 2a2z2 + a2z + afz2 + 3az + 33fz + 2f wrt a? -8fz + 184f - 4z*2 + 2z Find the first derivative of 50610t2 + 30831 wrt t. 101220t Differentiate mv3 - 5m + 11969v4 - 23612 wrt v. 3mv2 + 47876v*3 Differentiate -180626i*4 + 337544 wrt i. -722504i*3 What is the third derivative of -19206n5 + n2 + 318n + 2? -1152360n*2 Find the first derivative of 7h*3r*4 - 108844h*3r + 26h3 - 3750h*2 wrt r. 28h*3r*3 - 108844h*3 What is the third derivative of -34518y*5 - 162y*2 - 36y? -2071080y2 Differentiate 2189o*3 - 12042. 6567o*2 What is the third derivative of -668794h*3w + h*2w - 4h2 - hw - 691w wrt h? -4012764w Differentiate -617d3 + 68d*2 + 291459. -1851d*2 + 136d Differentiate 2s2tx - 37124s*2 + 2st - 49425sx with respect to x. 2s*2t - 49425s What is the third derivative of -68hi5 - 4hi4 - 260hi2 - 38hi + 107i*4 wrt i? -4080hi2 - 96hi + 2568i Find the third derivative of -783c5 - 13c*4 + 447c*2 - 11c wrt c. -46980c2 - 312c Differentiate 273q4r - 42q3r + 2qr - 36305r with respect to q. 1092q*3r - 126q2r + 2r Find the first derivative of 218877x + 149738 wrt x. 218877 Find the third derivative of 480f4w + 5f4 - f3w + 8f3 - 34f*2w + 57fw + 3f + 2w wrt f. 11520fw + 120f - 6w + 48 Find the third derivative of 2do*3 - 30925do2 - 7o*6 + 628o*4 wrt o. 12d - 840o3 + 15072o What is the second derivative of 2h3p*2 - 145h*3p + 31456hp*2 + 20hp wrt p? 4h*3 + 62912h Find the first derivative of 4w2z + 13226w2 - 3w + 8969z2 - 1 wrt z. 4w*2 + 17938z What is the second derivative of 71904g3j + 3gj - 464g + 2j + 1 wrt g? 431424gj Find the third derivative of -13c3d*3 - 2454c*3d + 2754c2d*3 + 3c*2 - 26cd3 wrt c. -78d*3 - 14724d Find the third derivative of 4795868l6 - 17l*2 - 140l + 30. 575504160l3 What is the third derivative of -8h*5 - 884h*4 - 397h*2 + 6h + 3 wrt h? -480h2 - 21216h Find the first derivative of 2h2tv + 27h*2v + 988074ht + 1229hv - 12h - 2tv wrt t. 2h*2v + 988074h - 2v What is the derivative of 4101453r - 5500102 wrt r? 4101453 What is the first derivative of p4 - 112819p + 893109? 4p3 - 112819 Find the second derivative of 72126a*5m + 6359am - 6a wrt a. 1442520a*3m What is the second derivative of -1086486z4 + 4558871z wrt z? -13037832z2 What is the third derivative of 1776b*3q*2 + 15b*3 + 14b*2q*2 + 7b*2q + q*2 - 73q wrt b? 10656q2 + 90 Find the third derivative of -136277o*4 + 16o*2 + 21o - 1516. -3270648o What is the second derivative of -34l*3z - 4l3 + 19l*2z - 32767lz wrt l? -204lz - 24l + 38z What is the second derivative of 316t3 - 58t*2 + 25386t + 5? 1896t - 116 What is the first derivative of 9067i*4 - 12834? 36268i*3 Find the first derivative of -67357dy - 77220y wrt d. -67357y Find the second derivative of -53g*5 - 21g*3 - 8g*2 - 28466g. -1060g3 - 126g - 16 Find the third derivative of -17d3oz2 - 33d*3z*3 + 2d3 - d2oz*3 - 4doz*3 - 601oz2 wrt d. -102oz2 - 198z*3 + 12 Find the first derivative of 234996fr - 378586r wrt f. 234996r What is the second derivative of 11283l*2 - 8652l? 22566 Find the third derivative of 275988u3 + 254965u*2. 1655928 Differentiate 8hx3 - 14hz2 - 2h - 1525x3z - 2x2z*2 - 567x - 10 wrt z. -28hz - 1525x3 - 4x*2z Find the second derivative of -66840w2 + 160419w wrt w. -133680 Find the third derivative of -125013m6 + 12m*2 + 22m - 31 wrt m. -15001560m3 What is the second derivative of 601265l*3w*2 + 67488l3 + l2w - 2lw3 wrt w? 1202530l*3 - 12lw Differentiate -2i*3q - 2i3 - 2548i*2 + 12735q + 2 wrt i. -6i2q - 6i2 - 5096i What is the first derivative of -301542ho2 - o2 - 69o + 4502 wrt h? -301542o*2 What is the third derivative of -2952675o*3q*3 - 21447o*2q*3 - oq*3 - 5oq - 2q*2 wrt o? -17716050q*3 What is the second derivative of -2476d5 - d3m - d2m - dm + 39d - 445m wrt d? -49520d*3 - 6dm - 2m What is the second derivative of -2u4 - 463853u*3 - 15u + 54096 wrt u? -24u2 - 2783118u Differentiate 2258169x2 - 1667106 with respect to x. 4516338x Differentiate 767g2 - 72g + 290388. 1534g - 72 What is the second derivative of -kz*2 + 52kz + 3k + 15524z3 + 80 wrt z? -2k + 93144z What is the second derivative of 99127s*3x*2z*3 + 7290s*3xz3 + 2s*3xz - 2s*3x - 2sz + xz3 wrt x? 198254s*3z*3 Find the first derivative of 17821j*4 - 2j*3 - 80266 wrt j. 71284j*3 - 6j*2 Differentiate -75220j*2k*3 - 3jk2 + k3 + 6k - 98686 with respect to j. -150440jk*3 - 3k*2 Differentiate 202h*2w - 65h2 - 66hw - 1381h wrt w. 202h2 - 66h Find the second derivative of -196f3h + 348f2h*3 + 4fh3 - 2fh2 - fh - 12h3 - 9h*2 wrt f. -1176fh + 696h*3 What is the first derivative of 527g*3s4 + g3 + 22g2s*4 - 2g*2 + 1880g wrt s? 2108g3s*3 + 88g*2s*3 Differentiate 2f*2 - 13809f - 69000 wrt f. 4f - 13809 What is the first derivative of 2325u*3 - 53u*2 + 5453021 wrt u? 6975u*2 - 106u Find the second derivative of 36773i2 + 31i - 98 wrt i. 73546 Differentiate -2dhs2 + 22846ds2 - 824hs2 - h + 3s*2 - 1 wrt h. -2ds2 - 824s*2 - 1 Find the second derivative of -10n*5z + 8n3z*2 - 4n*2z - 6nz*2 - 2n - 471z2 - 3z wrt n. -200n3z + 48nz*2 - 8z Find the third derivative of 6359315n3 - 33n*2 + 211n - 1. 38155890 What is the second derivative of -11949t3u*2 - 173t*3u - t*3 + 2t*2u*2 + 2t*2 wrt u? -23898t*3 + 4t*2 What is the second derivative of -13514v*4 + 8v*2 + 682040v wrt v? -162168v*2 + 16 What is th	{ "pile_set_name": "DM Mathematics" }
n a prime number? False Suppose -n = 5 - 9. Suppose -2k - 5v + 893 = -2v, 0 = 4v - n. Is k a prime number? False Suppose 7u - 10u = 3861. Let v = -754 - u. Is v a prime number? False Let a(d) = -45952d - 161. Is a(-1) prime? False Let m(s) = 1 - 8s + 4s + 7s. Let t be (-2)/(-8) + 282/24. Is m(t) prime? True Suppose 0 = -4x + 30 + 18. Let m = -10 + x. Suppose mj - 97 = -5. Is j composite? True Let o be 07/21 + 12/(-2). Is 22((-819)/o + -2)/1 a composite number? True Suppose -2a + a - 3s + 7568 = 0, 3s = -5a + 37852. Suppose 0 = -2f + 4j + 5026, 2f - 5f = 2j - a. Is f composite? False Let x be (0 + (-3 - -2))1 - -4. Suppose -195 = -xs + 2c, 3s - 118 = c + 80. Is s prime? True Let w(y) = 993y + 47. Is w(20) a prime number? False Let p = 11523 + -1696. Is p a prime number? False Let i be (-10)/159/(-6) + 2. Suppose d = it + 6d - 6938, 4622 = 2t + 4d. Is t composite? True Let q(z) = 8z*2 + 20z - 49. Is q(12) prime? False Let b = -6 + 13. Let j be 2775/b - (-3)/(-7). Let y = -281 + j. Is y a composite number? True Let p be (-13)/39 + 10/3. Suppose -pb = 3a - 2145, b + 5a - 1418 = -b. Is b a prime number? True Let i(y) = y + 1. Let v be i(1). Suppose -j + 3t = vt - 192, 5t - 930 = -5j. Suppose -5c + j = 2u, 4c + 0u = -u + 150. Is c composite? False Let y = 6912 - 2209. Is y a prime number? True Suppose -1720 = -6y + 566. Suppose y = 3i - v, -4i - 3v + 254 = -2i. Is i composite? False Is (-8)/(-28) - (-603387)/21 a prime number? False Let x = 94 + -94. Suppose -4t + xc - 5c = -1518, 5c - 10 = 0. Is t a prime number? False Suppose -3t = 5t - 16. Is ((t - 3) + 2)1345 a composite number? True Is ((-102)/30)/(1/(-1795)) composite? True Suppose 4f - 24 = -2f. Let l(j) = 116j - 15. Is l(f) prime? True Let h be 2/(-5) - 19520/(-50). Suppose -4k - k = -20, 3v - 3k + h = 0. Let p = v + 385. Is p composite? True Let h = 9608 + -23834. Let p be (-2)/3 + h/(-9). Suppose 3w = 7w - p. Is w a composite number? True Let d be (-2)/(-3)(-9)/2-49. Let k = d - -368. Is k a prime number? False Let q(v) = -v3 - 6v*2 - v - 1. Let g be q(-6). Suppose -gb - 223 = -5d + 232, -4d - b = -354. Suppose -5u + 4u = -d. Is u a prime number? True Suppose -3y + 698 = -238. Suppose 9r + y = 5181. Is r a composite number? False Suppose 0 = 4k - 7a + 2a - 65, -3k = 2a - 66. Suppose -k = -5c, 3z = -2c - c + 804. Suppose 4i = z + 208. Is i a prime number? False Suppose -410d = -391d - 605701. Is d a composite number? True Let f(r) = r2 - 49. Suppose -i + 3i = 0. Let a be f(i). Is -2(-2)/(-4)a a composite number? True Let i be (10/3)/((-18)/(-27)). Suppose iu = -0u - 5w + 215, -4u = -3w - 158. Suppose 0 = 5x - 74 - u. Is x prime? True Suppose 3 = 3d + 4o, -5d + d + 5o - 27 = 0. Is d/((-3)/2293)1 a prime number? True Let k = 4799 + -2340. Is k prime? True Suppose -7w - 626 = -1557. Let m = 168 + w. Is m prime? False Let c(h) = h3 - h2 + 2h - 11. Let z be c(0). Let u be 1322/z + 8/44. Let g = -67 - u. Is g a prime number? True Suppose 2q + 1986 = 5q. Is q a prime number? False Let v(f) = 94f - 99. Is v(28) prime? False Suppose -361 = -14b - 5b. Suppose 0 = -15k + bk - 9452. Is k a prime number? False Suppose -9f - 650 = -4f. Let g = f + 212. Is g prime? False Suppose 6 = 2c, 2j - c + 7 = -2. Is 2720/(0 + 4) - j composite? False Suppose o - 4q = -0q + 4361, -13138 = -3o + q. Is o prime? False Suppose m - 6 = -m. Suppose -mz = -4 - 5. Suppose -125 = -zf + 112. Is f a composite number? False Suppose 7v - 24 = 4. Suppose -2y - 2535 = -vd - 207, d - 591 = -4y. Is d a prime number? False Let t = -21 + 20. Let q = t + 4. Let p(l) = 5l - 1. Is p(q) composite? True Suppose 4g = -3i - 37, -3g - 5i = 2g + 40. Let w = g - -15. Suppose -2d = wd + 2f - 2218, -5d = -3f - 2756. Is d a prime number? False Let z(f) be the third derivative of 3f5/20 + 5f4/24 - f3/2 - f*2. Suppose -2n = 5h - 33, -n - 5h = -5n + 21. Is z(n) a prime number? False Let h be ((-3)/(-9))/((-1)/(-9)). Suppose -93 + 510 = -ho. Let l = -8 - o. Is l composite? False Let p(q) = q3 + q2 + 7q - 1. Suppose -26k = -25k - 6. Is p(k) composite? False Let s be 11-1 - (-28)/7. Let l(n) = 2n2 - 1 - 1 + 3n*2 + 8n. Is l(s) composite? True Suppose 3z = -4l, 2z + 7 = -1. Let i = -5 + 7. Suppose io - 5o = a - 346, 2a + lo = 677. Is a composite? False Suppose -3g = -5b - 7248, 14 = -b + 11. Is g composite? False Let u(p) = 13p - 14. Let k be u(8). Suppose 23 = d - 5w, 4d = 5w + 62 + k. Is (3 - -5)d/4 a prime number? False Suppose 0 = 2i - s - 121 - 39, 0 = 5s + 10. Suppose -2r = -3r + i. Suppose k + r = 2k. Is k composite? False Suppose 4n - 40s - 132 = -44s, 5s = n - 57. Is n a composite number? False Suppose -5j - 200 = -1915. Suppose -j = -0u + u. Let o = -84 - u. Is o a composite number? True Let a be (2 - -1335)/((-3)/6). Let o = -1613 - a. Is o composite? False Suppose 22f = 7f + 23145. Is f composite? False Suppose -14o + 51313 = 13877. Let t = o + -1265. Is t prime? True Is (-20133)/676/(-6) composite? True Let a be ((-8)/(-4) + 0)107. Let s be (-4)/(-18)a. Let u = s - 54. Is u prime? True Let t(f) = 3f2 - 2f + 15f2 - 5 - 4 + 5f. Is t(4) prime? False Is (-6)/12(-6558 - -10) prime? False Let c be 1546/((-3)/((-18)/(-4))). Is c/(-11) - 2/(-11) a composite number? False Let m = 15 + -8. Let i = m - 2. Suppose 2n = -3z + 321, 0 = -3n - iz - 39 + 521. Is n a composite number? True Let c(o) = o2 + 7o - 7. Let r be c(-8). Let i(k) be the first derivative of 109k4/4 + k2/2 - k + 2. Is i(r) a prime number? True Let k(d) = d2 + 2d + 322. Let u be k(0). Let l = -99 + u. Is l a prime number? True Let a = -29 - -52. Let o = 27 - a. Suppose 0 = 4j + h - 187, 68 = oj - 5h - 101. Is j a prime number? False Let f be (4/6)/(46/(-483)). Is f/((-7)/(-1213))(0 - 1) a composite number? False Let v = 37680 + -6593. Is v a prime number? False Let q(p) = p*3 - p - 1. Let v(g) = -3g*3 + 4g*2 + 7g. Let k(w) = -4q(w) - v(w). Let j be k(-3). Is j/(-2) + 122/2 a prime number? True Let d be -31(-6)/(-9). Suppose 0 = -y + 6y - 2525. Is (-8)/10y/d prime? False Let t(i) = -i3 + 3i*2 + 6i - 5. Let p(w) = 2w3 - 9w*2 - 18w + 15. Let m(g) = -3p(g) - 8t(g). Let y be m(4). Let f = y - 108. Is f composite? True Suppose -3g + k + 42434 = 0, -7k - 56607 = -4g - 0k. Is g a composite number? False Let d(m) = 5m2 + 22m - 18. Is d(-13) composite? False Let a(t) = t*3 + 5t*2 - 2t - 1. Let b be a(-5). Let f = -7 + b. Suppose 2x - 20 = -3z, 5z = -fx + 20 + 4. Is x composite? False Let m(w) be the third derivative of 7w7/720 + w6/180 + w5/12 - 7w*2. Let r(q) be the third derivative of m(q). Is r(6) a composite number? True Let d = -96 + 98. Suppose -2243 = -dn + 1619. Is n prime? True Let j = 72622 - 47045. Is j prime? True Is 2660 + ((-23)/9 - 4/9) a composite number? False Let c = 71 - 738. Let r = c + 181. Let a = -221 - r. Is a a prime number? False Let m = 57362 - 14571. Is m a prime number? False Let o(a) = a*2 + 16a + 5. Let f(h) = -h*2 - 16h - 6. Let k(s) = -6f(s) - 5o(s). Let p be k(-9). Let y = 114 + p. Is y composite? True Let a(c) = c*3 + 13c2 + 17. Let l(z) = -z3 + 11z2 - 11z + 14. Let r be l(10). Suppose -q - 47 = rv, -3v = 3q + 24 + 9. Is a(v) a prime number? False Let x(m) be the third derivative of m5/60 + m4/24 + 211m*3/6 - 10m*2. Is x(0) composite? False Let s = 953 + -2053. Is (1 - s) + 12/(3 - -3) composite? False Let m(v) = -352v + 10. Let p be m(-10). Suppose p = j - 1251. Is j a prime number? False Suppose 1 = 2i + 2m - 3m, -2i + 2 = -2m. Let y(j) = -896j*3 - 2j - 3. Let x be y(-1). Suppose i = -z - 4z + x. Is z prime? True Let s be 2/(-1) + 02/(-8). Is 1486(-3)/6(-3 - s) a prime number? True Let q = -7 + 7. Is (q + 1)/(2 - 69/35) composite? True Suppose -3c - 412 = a, 129 = -4c + 3c - 2a. Let k = 434 + c. Is k a prime number? False Let k(s) = -4s2 - 8s - 11. Let v(b) = 5b2 + 7b + 11. Let g(q) = -4k(q) - 3v(q). Let i be g(-10). Is (2 - 111/i)-1 composite? False Let b(i) = -i3 + 16i*2 - 17i + 19. Let k = -3 + 14. Is b(k) prime? False	{ "pile_set_name": "DM Mathematics" }
Let d = 42.1 + -43.1. Which is the nearest to d? (a) o (b) 0.1 (c) -2/21 c Let s = -80 - -83. Suppose -5x - 8 = 4l + 1, 2l + sx + 5 = 0. What is the closest to l in 6, -1, 3? -1 Let j = -1 - -0.9. Let x = 215 - 234.8. Let v = x + 20. Which is the closest to -1/3? (a) j (b) v (c) -0.5 c Let r be (-10)/(-15) + 5/(-3). Let q = -1.294 - -0.894. What is the nearest to r in -4, q, -5? q Let d be -2 + 5 - 285/76. Let k = 0.34 + -0.04. Let f = 0.3 - k. What is the nearest to 1/4 in f, d, -1/5? f Let y = -2.91 - -2.88. What is the nearest to -1/3 in y, -2, -2/11? -2/11 Let n = 4.83 + -4.53. Which is the closest to -2/7? (a) 1/7 (b) 0.2 (c) n (d) 1/8 d Let f = 1.6 + -0.6. What is the nearest to f in 0.2, 0, -10, -0.4? 0.2 Let w = -341.4 + 345. Which is the closest to -0.1? (a) -0.1 (b) w (c) -0.4 a Let g = -181.6 + 189.6. What is the nearest to 0 in 1/8, g, 1/5, -5? 1/8 Let u = -23 + 117/5. Let v(k) = k*2 - 5k - 3. Let w be v(6). Let n = 18.9 - 19. Which is the closest to -1? (a) n (b) w (c) u a Let k = -148 - -162. Which is the closest to k? (a) -1 (b) 2/19 (c) 3 c Let x = -0.3 - -0.1. Let t = -12 + 17. Let o = -44 - -48. Which is the nearest to x? (a) t (b) 0 (c) o b Let z = -343 + 348. Let y = 0.07 + 0.13. Let m = 7 + -11. Which is the nearest to 0? (a) z (b) m (c) y c Let m = 3.98 + -2.01. Let v = -24.03 + 24. Let s = m - v. What is the closest to -1 in -5, s, 0? 0 Suppose -120s - 91 = -107s. What is the nearest to -2 in 1, s, 0.2? 0.2 Let p = 54 - 46. Let y(x) = -x*3 + 6x*2 + 14x + 18. Let z be y(p). Which is the nearest to 0? (a) 0.4 (b) z (c) -3/7 a Let c = 0.301 + -0.001. Suppose -5j - 25 = 15. Let t be 6/93/j. What is the nearest to t in 0.4, 5, c? c Let x(a) = a + 13. Let u be x(-9). Let p = 9 + -7.8. Let y = 1.2 - p. What is the nearest to y in 1/6, u, -0.4? 1/6 Let r be (-205)/51 + 1 - (-64 - -61). Let g = 6/17 + r. Let u = 2 + -2.1. Which is the nearest to u? (a) g (b) 1 (c) 0.1 c Let m = -0.142 + 0.342. Let x = -62.8 + 54. Let q = -9 - x. Which is the closest to m? (a) 3 (b) 0 (c) q b Let u = 0.1 + -0.2. Suppose -12 = 2k + 2t, 5k + 5t - 10t - 20 = 0. Let f be (-26)/(-14)1 - 2. What is the nearest to k in f, u, 1/5? f Let p = 123.8 + -124. Let j = 1 + -0.9. Let g = 5.02 - 0.02. Which is the nearest to j? (a) 2 (b) p (c) g b Let z = 0.2 - -0.8. Let i be (1 + 3 + -5)(-1)/3. Which is the closest to z? (a) -4 (b) i (c) -15 b Let m = 1.07 + -0.07. Suppose 0j + 3j = 2o - 1, -2 = -2j + 4o. Let s be (-7)/(-6) - j/(-6). Which is the nearest to m? (a) -3 (b) -0.3 (c) s c Let s = 180.1 - 180. Which is the closest to 1/4? (a) -2 (b) s (c) 2.2 b Let f = 2407 - 2264.1. Let t = f + -132. Let w = t - 11. Which is the nearest to -0.1? (a) 3 (b) w (c) 5 b Let f = -2.8 + 3. Let q = 1.8 - -3.5. Let r = 1.3 - q. What is the nearest to f in r, 0.5, -3? 0.5 Let f be (-2)/(-12) + (-295)/(-30). What is the nearest to -1/4 in 3/5, f, -2/13, 2? -2/13 Let m = 0 + -0.4. Suppose 88 = 2d - 8. Let u be (0 - 3) + 128/d. Which is the closest to u? (a) -2 (b) 2/9 (c) m c Let p be 16/84((-9)/(-6) + -3). What is the nearest to p in 1, -1/7, -2? -1/7 Let o(u) = u*2 + 10u + 8. Let m = 11 + -6. Suppose f - 6f + m = 0, -2f + 38 = -4q. Let n be o(q). Which is the nearest to n? (a) 0.5 (b) -1/3 (c) 3/2 b Let m = -1 + 3. Let h = m - 0. Let r = 0.7 - 0.6. What is the nearest to -1/3 in h, r, -1? r Let v = -3 - -4. Let h = 79.79 + -1.79. Let g = -77.6 + h. What is the nearest to 0.2 in g, 4, v? g Let p be (-294)/(-266) + (-6)/57. Which is the nearest to 2? (a) p (b) 2/39 (c) -0.5 a Let p = 0.95 - 1. Let z(r) = r3 + 2r*2 - r. Let n be z(-2). Let x be n((-9)/2 + 2). Which is the nearest to p? (a) x (b) 0.2 (c) 0.3 b Let f = 0.441 - -3.559. What is the nearest to 2/5 in 0.5, -2/45, f? 0.5 Let d = 118.8 + -138. Let f = d + 19. Let t = -331/7 + 47. What is the closest to -0.1 in -2/3, t, f? f Suppose 5s + 1 = 1. Let k be 10/((-4)/((-2)/1)). Suppose 2g = -2g + 32. Which is the closest to 0? (a) g (b) s (c) k b Let n = 114.2 + -117. Let z = 0.2 - n. Which is the nearest to -1? (a) 0.3 (b) -1 (c) z b Let r = 0.894 + 4.14. Let p = -0.034 + r. What is the nearest to 2/3 in p, 0.4, -2? 0.4 Let q = 2 - 1.8. Let d = 161 + -156. Which is the nearest to -1? (a) 0 (b) q (c) d a Let o = -87 + 90. Let u = -4.9 - -5. Let k = 0.1 - -0.9. What is the nearest to 0 in k, o, u? u Let m = -1180/7107 - 27/206. Let t = m + 3/23. What is the nearest to 0 in -2/3, 1, t? t Let s be 160/52 - -76/(-546). What is the closest to -2 in s, 1/2, -5, 0.3? 0.3 Let i = -1322 - -1322. Which is the closest to i? (a) 0.13 (b) -0.02 (c) 0.4 b Let d be 2 + 0 - 36/27. Let s be 3((-3)/(-8)4)/27. Which is the nearest to s? (a) 4 (b) -2 (c) d c Let u be (0 - (-7)/(-21)) + 14/6. Suppose -2 = -a, -2q + 5a - u = 6. What is the closest to q in 3/4, 0, -1/2? 3/4 Let w be 1/(2/4) + 864/(-378). What is the nearest to -2 in 3/4, -5, w? w Let d = 54 + -54. Let y be 1 + 0 + d + 4/(-6). What is the closest to -1 in 2, y, -14? y Let y be 3/(-54)(10 - (12 - 5)). Let a(c) = -c3 + 6c + 2. Let n be a(-3). What is the closest to 0 in y, n, -0.5? y Suppose -3f = 3z, 0 = -4z - 3 - 5. Let q(g) = -g3 - fg*2 + 5g*2 + 7 - 2 + 2g. Let k be q(4). Which is the closest to k? (a) -0.5 (b) -4 (c) -0.1 b Let t = -0.01 - -1.01. Which is the nearest to t? (a) -1 (b) -12 (c) -0.7 c Let p = 681 + -679. Let z = 5.8 - 6. Which is the nearest to z? (a) 11 (b) -0.5 (c) p b Let a = -0.5584 - -0.1584. Let w = -19 + 37/2. What is the closest to 1 in w, -3, a? a Suppose 3w = 4w - 1. Let i be (-14)/(-6) - 1 - w. Let b = -0.16 - -0.26. What is the nearest to b in 1, i, -1/2? i Suppose 4w = -0 + 8. Let k be (3/((-405)/6))/(w/(-6)). Which is the closest to -0.2? (a) k (b) 2 (c) 0 c Let d be (-18)/24 - 20/(-112). What is the nearest to 1/4 in -2/5, 1.4, 1/4, d? 1/4 Let l be (2 - 2140/1050)5/(-2). Which is the closest to 1? (a) -2 (b) 0 (c) 22.8 (d) l d Let l = -399.1 + 399. Which is the closest to 0.01? (a) l (b) -3/7 (c) -2 a Let n = 0 - -1. Let j = 4.4 + 0.6. Let o = -0.0831 + -0.0169. What is the closest to o in n, 2, j? n Let f = 152.6 + -153. Let l = -3/22 - 15/11. Let w = 0.1 + 0.9. Which is the closest to -1? (a) w (b) f (c) l c Let w = 92672/51 + -1817. Let u = w - -4/17. What is the closest to 0.1 in 0.4, u, 0.2? 0.2 Suppose 3r - 14 = 13. Let w(i) = -i2 + 7i + 8. Let s be w(r). Let h be (-2)/s + (-24)/70. Which is the nearest to 0? (a) 4 (b) -0.3 (c) h c Let d = -287.6 - -286. Let o = -0.67 + 0.07. Let i = o - d. Which is the closest to 1/2? (a) i (b) 0.1 (c) -2 b Let q be 2(-1 + 9/6). Suppose -2c - 3f = -335 - 128, 0 = -3c - 4f + 697. Let p = -2631/11 + c. What is the closest to q in -0.3, p, 3? p Let g(q) = q2 - 14q + 11. Let y be g(13). Which is the nearest to 1/4? (a) 1 (b) -5 (c) y (d) -2/23 d Let w = 121.712 + 2.188. Let n = w - 124. What is the closest to 1 in 0.1, n, 0.2? 0.2 Let j = -0.021 + 0.831. Let r = j - 0.31. What is the nearest to -2 in r, -0.5, 6/7? -0.5 Let a(x) = -x + 2. Let m be a(0). Let i = -3731 - -3732. What is the nearest to 0.1 in i, m, -0.3? -0.3 Let m = -1345.9 + 1346. What is the nearest to 0 in m, 1, -104? m Let f = 37 + -34.1. Let o = f + -7.9. Which is the closest to 0? (a) o (b) 0.1 (c) -3 b Let z = 12.022 + -12. Let q = 0.022 - z. Let d = -0.5 + 1. Which is the nearest to 0.3? (a) 2/5 (b) d (c) q a Let i = -0.38 - 21.62. Let z = 21.8 + i. Let s = -4.9 - -5. Which is the nearest to z? (a) -5 (b) s (c) 1/2 b Let i = 42 + -83. Let a = 41 + i. What is the nearest to a in 4/3, -5, 4? 4/3 Let o = 3 + -2.9. Let h = o - -4.9. Suppose 0 = -u - i + 9, -2i = 3u - 3i - 7. What is the nearest to 2 in u, -0.3, h? u Let y = 177 - 883/5. What is the closest to -0.16 in y, -0.01, 3/7? -0.01 Let w = -98 + 97. What is the nearest to 0.7 in w, 0.5, 1? 0.5 Let p be (-4 - 20/(-8))2/3. Which is the nearest to p? (a) 1/13 (b) -3 (c) -1 c Let c be 76/(-399)6/(-4). What is the nearest to c in -0.4, 2/15, -2, 5? 2/15 Let h = -71.4 + 71.31. Let k be (-18)/42 + (-1)/(-35). Which is the closest to h? (a) 0.3 (b) k (c) -1/7 c Let t be 2/(-3)(4 - 10). Which is t	{ "pile_set_name": "DM Mathematics" }
- -10310. Let b = -2 - -1. What is the second biggest value in b, -0.2, -0.3, n? -0.3 Let o = -256/3 + 1790/21. Suppose -5w = -5c - 85, 5w = 10c - 11c + 1. Suppose -a = a - 2l + 2, -3a + 2l - 4 = 0. What is the biggest value in a, w, o? w Let y = -0.217 - -0.017. Let g be 2(-1 - 0)/(12/(-102)). Let t be g/855/2. What is the second smallest value in 3, t, y? t Let k = 13 + -38. Let v = k + 24.5. Let h = -223.6 - -224. Which is the fourth biggest value? (a) v (b) -2 (c) h (d) 1/7 b Let n = -2.2 - -2.1. Which is the fourth biggest value? (a) 257 (b) 6 (c) -3/4 (d) n c Let k be 62/(-4) - (-3)/2. Let w be (-6)/k(-5)/(-5). Let q = 6746 - 6746.4. Which is the third biggest value? (a) -2 (b) -1 (c) q (d) w b Let s be (-4)/((-1)/((-3)/2)). Let a be (s/28)/(6/(-16)). Let r = -1202314 - -1202313. What is the smallest value in -1/3, r, a, 24? r Let g = -13652.9 + 13652. Which is the third smallest value? (a) g (b) 0 (c) 191 c Let v(p) = -2p - 4. Let r be v(0). Let g = 2020.6 - 2021. Which is the fourth smallest value? (a) 0.7 (b) g (c) r (d) -3 a Let i = 12037 - 60184/5. What is the smallest value in 0.09, -31, i? -31 Let q = -2395 - -2398. What is the third smallest value in -1/5, -4, -3, q? -1/5 Suppose -s = -4p - 17, 13s = 9s - 5p - 16. Let l = 0.8 + -0.85. What is the third smallest value in 5, 3, s, l? 3 Let r = -88.823 - 0.177. Let y = -88.9 - r. Which is the second biggest value? (a) 2/19 (b) -4 (c) y c Suppose 4g = -5 + 41. Suppose -5i - 4 = -g. Let h = 21.6 + -22. Which is the third biggest value? (a) 0.2 (b) h (c) -2/3 (d) i b Let n = -1134.2 + 1131.2. Let y = 0.2 - 0.17. What is the smallest value in n, y, -14, -2/11? -14 Let x(q) = q*2 + 10q + 12. Let m be x(-8). Let p = -9060 + 72483/8. Which is the second smallest value? (a) m (b) p (c) -1 c Let m = 13.1 - 18.1. What is the smallest value in 5, 1, -3/2, 2/15, m? m Let r be (-24)/96(-264)/6. Let p(w) = 5w*2 + 2w - 1. Let t be p(1). Suppose -rg - t = -14g. Which is the smallest value? (a) 2/7 (b) 4 (c) g (d) 1 a Let u be (-4)/((-80)/6)-2. Let x = -220311 - -1105419/5. Let d = x - 773. Which is the second smallest value? (a) 13 (b) d (c) u b Let d = 67 - 268. Let l = d - -803/4. Let r = 0.5 + 0.1. Which is the smallest value? (a) l (b) -2 (c) r b Let n = -0.12 - -2.12. Suppose 0 = -4x - 5t - 36, 5t = 3x + 23 - 31. What is the second biggest value in -20, -0.2, x, n? -0.2 Let h be (3/10)/((-2)/5). Suppose 154d = 168d. Let v be (6/9)/1-1. Which is the second biggest value? (a) v (b) h (c) d a Let p be (8/(-28))/(6/(-21)). Let z be (p - (-142)/(-28)) + 4. Let i = z + -3/7. Which is the biggest value? (a) i (b) 3/7 (c) 2/7 b Let r = -2.188 - -2.088. What is the fourth smallest value in 1.4, r, 0.4, 0.06? 1.4 Suppose -15g + 8 = -13g. Let r be 3g/(-8)(-6)/18. Let b = 4.5 - 0.5. What is the fourth smallest value in b, -1/4, r, 3? b Suppose 22y - 206 = 20y. Let t = 310/3 - y. Which is the biggest value? (a) -1 (b) 1 (c) t b Let y = 17 - 12. Let r = -12.15128 + 0.15128. What is the third smallest value in y, 0, 1/5, r? 1/5 Let y = 39.298 - 39.098. Which is the fourth smallest value? (a) y (b) -0.5 (c) 1/12 (d) -0.3 a Let m = 42 + -74. Let i = m + 31.94. Let h = 52 + -52. Which is the smallest value? (a) -1 (b) h (c) i (d) 3 a Let j = 150.718 - 204.718. Let w = -2.9 - -3. Which is the fourth smallest value? (a) j (b) 2/9 (c) 0 (d) w b Let r = 30/1367 - 3064/15037. Which is the third smallest value? (a) 11 (b) 0.15 (c) 2.2 (d) r (e) 3 c Suppose 18p - 2839 + 2749 = 0. What is the fourth biggest value in -0.2, -0.74, p, -5? -5 Let x be (8 - -6) + (-29)/2. Let s = -0.26 - -0.56. Let l = -0.7 - -0.3. Which is the smallest value? (a) x (b) s (c) l (d) 0.2 a Let z = -0.392 + 0.382. What is the fourth smallest value in 1/7, -1/4, 0.2, z? 0.2 Let z = -677 + 62957/93. Let l = z + 295/372. What is the third biggest value in 0, l, -1/14? -1/14 Let l be (-142)/(-426) + 2/((-2)/(-3)). Which is the third smallest value? (a) 2 (b) l (c) 1 (d) -2 (e) -1 c Let k = -1512 - -1390.6. Let s = k - -121. Which is the smallest value? (a) s (b) -3 (c) 25 b Let m be 104/156 - 12/452. Let x be 21/6 - (-2)/4. Which is the second smallest value? (a) x (b) m (c) 0.1 b Let r = 6 - 3. Let s = 1331.7 - 1332. Let l = -8.7 - -3.7. Which is the third smallest value? (a) 1/3 (b) l (c) r (d) s a Let k = -1699 + 15289/9. Which is the fifth smallest value? (a) 5 (b) -5/3 (c) 1/28 (d) -6 (e) k a Let p(d) = -19d3 + 2d*2 - 1. Let a be p(1). Let i be (-9)/a - (-18)/(-20). Let b = -3.17 - -2.67. What is the second smallest value in b, -0.1, -2/19, i? i Let w = -341/45 - -39/5. Let a = -99 + 99. What is the smallest value in w, -2/9, 6, a? -2/9 Let q = -0.01861 + -0.38139. What is the fifth smallest value in -11, 2/19, -1, q, 5? 5 Let w = -0.3605 - 2.6395. What is the biggest value in -1, w, 0, -315? 0 Let o = -117 - -122.2. Let l = 3.2 - o. Let s = -2.1 + 1.92. Which is the third smallest value? (a) l (b) 3 (c) s b Suppose -4k - 48 = -4v, 5k + 0v + 30 = -v. Suppose 4m + 2u - 24 = 0, -5m - 3u - 33 = -66. What is the smallest value in k, 0.4, m? k Let y = 5.2 - 5. Let z = 2677 - 2673. Which is the fourth biggest value? (a) 2 (b) z (c) y (d) -5/3 d Let i = 4.5 + -2.8. Let a = -117.18 + 113.18. What is the second biggest value in i, 1/3, a? 1/3 Let i = -73.32 + 71. Let u = 2.52 + i. What is the third smallest value in -1/4, u, -0.3, 0.5? u Let p(i) = -2i*2 - 89i - 116. Let g be p(-43). Let h be ((-1 - 14) + g)(-1)/7. Which is the smallest value? (a) -0.1 (b) h (c) 67 a Let z = 9575/12 - 3189/4. Which is the third biggest value? (a) 3/4 (b) -9 (c) z (d) 14 c Let x be (-24)/64 - (210006/176)/9. Let u = x + 133. Which is the third biggest value? (a) u (b) 2 (c) 3/5 a Let g = 0.046 + -0.546. Let c = 5.8 - 5.84. Let w = 0.06 - c. What is the third biggest value in g, w, -0.1, -2/11? -2/11 Let o be 24/110 - 2/5. Let z = -51204 - -51206. What is the smallest value in o, -11, z, -0.5? -11 Let j = -3001.6 + 3002. What is the third smallest value in -24, 1/4, j? j Let q = 1 + -2. Let i(y) = -y3 + 5y*2 - y + 7. Let f be i(5). Let d = 864450.2 - 864452. What is the smallest value in f, d, q, 0.2? d Let c = -3898/13 + 300. Suppose 0 = -3z + 5n - 11, -2n + 11 = z - 0z. What is the third biggest value in z, c, -7? -7 Let w = 1235 + -705. Let u be (106/w)/((-7)/(-15)). Which is the second biggest value? (a) u (b) -2 (c) 3.5 a Let h = -41/42 - -8/7. Let a = -24 + 22. What is the second smallest value in h, 2, a? h Let m be ((-1)/(-12))/(5/15). Let j = -45966/13 - -3536. What is the smallest value in m, -0.2, 4, j? -0.2 Let x = -18.8581 - 0.1419. What is the smallest value in x, -0.2, -6.8? x Let z be (1/2 + 1)/((-11)/(-22)). Let f = 1567/39 - 121/3. What is the third smallest value in -8, z, f, -0.2? f Let s be 12/91/4. Let y(t) = 2t2 + 10t + 15. Let h be y(-5). Let z = h + -11. Which is the second smallest value? (a) s (b) z (c) -1/2 a Let g = 2 - -1. Let b = 3.3 - g. Let y(v) = -v - 17. Let c be y(-13). What is the biggest value in 4, b, c? 4 Let y = 20236 - 20014. What is the smallest value in 0.5, -15, y? -15 Let x = -46 + 41. Let i(u) = u*3 - 3u - 7. Let s be i(0). Let h = s + 6. Which is the second smallest value? (a) 9 (b) h (c) x b Let y be ((-28)/(-49))/(7 - (-335)/(-35)). Which is the third smallest value? (a) y (b) -3 (c) -1/2 (d) -14 (e) 0.16 c Suppose -d - 245 = 27. Let t = 2450/9 + d. What is the fourth smallest value in -81, t, 0.1, 2? 2 Let k = 7954 - 7956. Let w(a) = a + 2. Let q be w(-1). What is the third biggest value in k, q, -5? -5 Let g be ((-2)/8)/(3/4). Let i = -59067 + 59020. What is the biggest value in i, g, -0.2? -0.2 Let p = 181 + -908/5. Let q = 0.7566 + -0.0366. Let y = q + 4.28. What is the smallest value in 0.2, -2/5, p, y? p Let k be ((-500)/24-2)/(170/(-30)) - -7. Which is the fourth biggest value? (a) 5 (b) k (c) -5 (d) -4/3 (e) -0.64 d Let q be (-86)/110 - -318/297. Let z = -2.99 + -0.01. Which is the second biggest value? (a) 0.2 (b) q (c) z b Let d = -886.2 + 893.2. What is the biggest value in 2, 13, d? 13 Suppose 2t + 5h	{ "pile_set_name": "DM Mathematics" }
t(147))*2-5 + sqrt(147))5-3 + 4. -630sqrt(3) + 10954 Simplify (sqrt(896)2 - (sqrt(14) - sqrt(56)/(sqrt(4) - -2sqrt(4)) - sqrt(14)))/(-1(sqrt(56)-1)/sqrt(8)3)-6. -98sqrt(2)/3 Simplify -1 + (-2(3 + (sqrt(1331) - (1sqrt(1331) + sqrt(1331) + sqrt(1331))) + sqrt(1331)))2 - (-3 + sqrt(1100) + 0 + sqrt(1100) + 1 + 0)2. -184sqrt(11) + 955 Simplify (4sqrt(500)3 + -5 - (sqrt(200)/sqrt(2))/((sqrt(5) + sqrt(20))5))*2. -3596sqrt(5)/3 + 3233929/45 Simplify (-1sqrt(180) + 3 + -2sqrt(180) + -2)*2 - (-3 + (1-3(sqrt(405) - (sqrt(405) + 2 + sqrt(405) + sqrt(405))))2). -12992 - 684sqrt(5) Simplify (5 + (sqrt(171)-2 + sqrt(171))2 + 3 - ((sqrt(171)2 + 0 + sqrt(171))*2 - 4(2sqrt(171) + sqrt(171) + sqrt(171)))) + 0. -1360 + 48sqrt(19) Simplify -3(5 + ((sqrt(52) + sqrt(832))2 - 2sqrt(65)/sqrt(5)))2 + 3. -7827 + 12sqrt(13) Simplify (-3 + -1(sqrt(76) + (-1 + sqrt(76))6) + (sqrt(19) - (0 + sqrt(19) + sqrt(19)1)) + (sqrt(19) - sqrt(19)15))2. -114sqrt(19) + 6868 Simplify (2sqrt(171)1 + sqrt(171) - (sqrt(171) - (sqrt(171) - sqrt(171)3))1)/(sqrt(72)/sqrt(2) - sqrt(36) - sqrt(45)/sqrt(245)). 0 Simplify 3(3 + (sqrt(27)-2-5 + -4sqrt(135)/sqrt(5))/(2sqrt(81)1)). 3sqrt(3) + 9 Simplify 4(sqrt(567)1 + -4 + (5((-1sqrt(567) - sqrt(567)) + sqrt(567)))2) - (3(sqrt(567) + 1) - (-6(sqrt(567) + 1 + sqrt(567)) + sqrt(567)))1. -90sqrt(7) + 56675 Simplify 1 + -3sqrt(567) + (1 + sqrt(567) + -2 - sqrt(567)) + ((2 + -1 + sqrt(7) - ((sqrt(7) + 1)4 + sqrt(7))) + -2)2. 13sqrt(7) + 137 Simplify (5 + (-2(5 + 1sqrt(200) - sqrt(200)) + -4)-25)*2. 21025 Simplify (2(-6sqrt(495)/(sqrt(66)/sqrt(6) - sqrt(11) - sqrt(11)) - (sqrt(135) + sqrt(135)21 + sqrt(135))/sqrt(3)))2. 720 Simplify -5 + (5 + -3(-1sqrt(1700)1 - ((4 + (sqrt(1700) + 1 - sqrt(1700) - sqrt(1700)))*2 - sqrt(1700))))1. -300sqrt(17) + 5175 Simplify (2-6(6(0 + sqrt(243)) - (sqrt(243) + 4(sqrt(243) + -1)))4 + 0)*2. 165888sqrt(3) + 596736 Simplify 5 + 4 + -6(31sqrt(931) - -2sqrt(931)-1)2 + 5. -84sqrt(19) + 14 Simplify -5 + (-5 + -2sqrt(17) + 3 + -4)*2 + -1((sqrt(17) + 0)3 + sqrt(816)/sqrt(3))2. -734 + 24sqrt(17) Simplify (4 + (sqrt(80)1-3)*2 + -5 + 1 + (((sqrt(80)2)*2 - sqrt(80))2 - (2 + 1 + sqrt(80))))4. -48sqrt(5) + 5428 Simplify ((-5(sqrt(68) + sqrt(68)2 + 5) + 2 + sqrt(68)1 + 4)3-1)2 + 4. 9576sqrt(17) + 123205 Simplify 1 + -1 + -2 + -3 + ((-3 + sqrt(704) + 4 + sqrt(704))*2 - sqrt(704) - sqrt(704)). 16sqrt(11) + 2812 Simplify -4 + (-5(sqrt(242) + (sqrt(242) + -1)2 - (sqrt(242) - ((sqrt(242) + (sqrt(242) - (-1 + sqrt(242))) + sqrt(242) - sqrt(242)) + 0))))*2 + 0 + -5. -1650sqrt(2) + 54466 Simplify (sqrt(176)/sqrt(396) - 6sqrt(64))/(sqrt(80)/((sqrt(810) + sqrt(10))6)). -710sqrt(2) Simplify ((sqrt(24) - -1sqrt(48)/sqrt(2)) + sqrt(24))/(2sqrt(24)/sqrt(2)) + (sqrt(96) - -4(sqrt(96) + (sqrt(96) - -2sqrt(96))))/sqrt(3). 139sqrt(2)/2 Simplify ((sqrt(192)/(sqrt(96)/sqrt(3)))/(-1sqrt(1728) - sqrt(1728) - sqrt(12) - 3sqrt(12)-1))2-6. -3/484 Simplify (6((-2sqrt(200) - sqrt(200)) + 1 + ((sqrt(200) - (-1 + sqrt(200) + sqrt(200)))5 - sqrt(200)) + -5))2. -6480sqrt(2) + 583236 Simplify (3(sqrt(192)/sqrt(1200) - sqrt(16)))/(2(sqrt(392) + (sqrt(392) - (sqrt(392) + sqrt(392)1) - sqrt(392) - sqrt(392))))-2. -27sqrt(2)/140 Simplify ((sqrt(209)1-2 - 12sqrt(209))-5)/(sqrt(176)/((sqrt(48)3)/sqrt(12))). 30sqrt(19) Simplify 1(3 + (sqrt(300) - (sqrt(300) + 0)))2 + (5 + (sqrt(243)-22 - sqrt(243)) + 5)2. -900sqrt(3) + 6184 Simplify (1 + (sqrt(847) + 1 + 0)*2)-5 + -4 + 4((sqrt(112) - (sqrt(112) + 0)) + 5)2. -4149 - 110sqrt(7) Simplify (-4-3-3(-4 + -2 + sqrt(245) + -5(sqrt(245) + -1 - sqrt(245)))3)2. -163296sqrt(5) + 2869344 Simplify (-6(6(sqrt(432) + -1sqrt(432) + 5 - (-4 + 1 + sqrt(432))) + ((sqrt(432) - (sqrt(432) - -1sqrt(432))4) + 1)-1))*2. 40608sqrt(3) + 95076 Simplify (-2 + (sqrt(1100) + -4(sqrt(1100) - (sqrt(1100) + 1)))-1 + -5(2 + 1 + sqrt(1100) + sqrt(1100) + sqrt(1100) + sqrt(1100) + 0 + -5))2. -1680sqrt(11) + 485116 Simplify (0 + sqrt(208) + 3 + -1 + sqrt(117) + (sqrt(52) + (sqrt(52) + sqrt(52)-2)4)/(sqrt(32)/(-1sqrt(8))))2-4. -5216 - 160sqrt(13) Simplify 0 + -2 + ((sqrt(20) + (-2sqrt(180) - sqrt(180)) - (sqrt(80)-2)/sqrt(4))/((-23sqrt(70))/sqrt(7)))2. 0 Simplify 3 + (6sqrt(12)/sqrt(4) + (sqrt(6)4)/sqrt(2) - (-2 + sqrt(3) + 3 + sqrt(24)/sqrt(392)))2. -124sqrt(3)/7 + 11728/49 Simplify (-5(1 + -4 + sqrt(272) + 2 + sqrt(272) - -5(sqrt(272) + sqrt(272)1 + -4)))2. -50400sqrt(17) + 990225 Simplify ((-2sqrt(320)3)*2 - sqrt(320) - (22sqrt(320))2)-6 + (sqrt(320) - (-4sqrt(320)3)2) + ((sqrt(320) - (sqrt(320) + 2)) + -2)2. -84464 + 56sqrt(5) Simplify (-4 + (2sqrt(90) - sqrt(90))/(-3sqrt(5)-1) + -1(sqrt(6)/sqrt(3)-1 - (sqrt(2) + sqrt(242) + 1sqrt(242) + sqrt(242))))2. -288sqrt(2) + 2608 Simplify -5((5(-1(sqrt(1008) + 1 - sqrt(1008)) - sqrt(1008)))2 + sqrt(70)/(sqrt(10)-2 - sqrt(10) - sqrt(10)) + (-2sqrt(343) - sqrt(343))2). -141560 - 11995sqrt(7)/4 Simplify (1(sqrt(468) - sqrt(52)))2 + 3 + ((sqrt(156) - sqrt(156)1)6 + sqrt(156) - sqrt(156) - sqrt(156))/(-12sqrt(12)). sqrt(13)/2 + 211 Simplify (-111sqrt(70)4)/(4(sqrt(90)/(sqrt(18)/sqrt(2)) - (sqrt(10) + sqrt(120)/sqrt(3)))) + -4. -4 + sqrt(7)/2 Simplify 4 + -3sqrt(27)/((sqrt(9) - (sqrt(9) + (sqrt(225) - sqrt(9))))-6) + sqrt(36)/(sqrt(12) + sqrt(12)1) + 3 + sqrt(192). 7 + 67sqrt(3)/8 Simplify -1((-3(sqrt(304) - 5sqrt(304))5)*2 - ((1 + sqrt(304)-2)2)2). -1089532 - 64sqrt(19) Simplify 1((sqrt(18) + sqrt(288)-2 - (sqrt(18) - sqrt(72)1))/(-611sqrt(6)) + -3). -3 + sqrt(3) Simplify ((sqrt(4) - sqrt(48)/sqrt(3)) + (sqrt(64)/sqrt(2))/sqrt(8))/(-5(sqrt(1250) + sqrt(2) + sqrt(2))) + -2. -2 Simplify (sqrt(32)/(sqrt(16)/sqrt(4)))/(sqrt(4) - sqrt(576)) + -5 + ((sqrt(32)/(sqrt(4) - sqrt(16)))/(sqrt(16)/sqrt(36))6)*2. -sqrt(2)/11 + 643 Simplify (-3 + ((-4sqrt(192)-2 + sqrt(192) - 4(-2sqrt(192) - sqrt(192))) + sqrt(192)25 + -3((sqrt(192) - (sqrt(192) + 0)) + sqrt(192)))-4)2. 5376sqrt(3) + 2408457 Simplify sqrt(42)/(4sqrt(384))-5 + (((1sqrt(112) + sqrt(112))/sqrt(4))/(sqrt(4) - (sqrt(4) - ((sqrt(16)/sqrt(4) - sqrt(4))-1 - sqrt(4)))))*2. -5sqrt(7)/32 + 28 Simplify (3(1 + sqrt(720)))2 + (3(sqrt(720) + 2))*2 - (-6sqrt(245)25)*2. -868995 + 648sqrt(5) Simplify (1 + 1 + 2(-2 + sqrt(52)) - (sqrt(130)/(sqrt(30)/sqrt(3))-2 + (sqrt(13) - -4(-1 + sqrt(13)))-4))*2. -936sqrt(13) + 9112 Simplify (6sqrt(13)-1)*2 + ((sqrt(156)-4)/sqrt(12))2 - (1 + (sqrt(117) - (sqrt(117) + 3 + sqrt(117))2)4). 132sqrt(13) + 2583 Simplify 1(sqrt(2299) - ((sqrt(2299) - (0 + ((sqrt(2299) + -1)2 - sqrt(2299)))) + sqrt(2299))) - (-2sqrt(95)-2 - sqrt(95))/((1sqrt(35))/sqrt(7)). -47sqrt(19) + 2300 Simplify 3 + (-2(4 + 0 + (sqrt(242) + (sqrt(242)-1 - sqrt(242))4 - -1sqrt(242)5) + -1))*2. -528sqrt(2) + 3911 Simplify 0 + (-4sqrt(1573))2 + sqrt(1573) + -3 + sqrt(1573) + 1 + (5 + (sqrt(1573) + 2sqrt(1573))*2)6 + -1. 22sqrt(13) + 110137 Simplify ((-4sqrt(100)-2 - sqrt(100))4)/(-2sqrt(35)/sqrt(7) - sqrt(605)5). -56sqrt(5)/57 Simplify 6((1sqrt(1053)-1 + sqrt(1053) + 4 + 1 + -5)1 + -5). -30 Simplify ((sqrt(2400)3 + sqrt(24) - (sqrt(168)-2)/sqrt(7))/(4((3((-1sqrt(72) - sqrt(72)) + sqrt(72)) + sqrt(72) - sqrt(72)) + sqrt(72))))*2. 363/64 Simplify (sqrt(891) + (sqrt(891) + (sqrt(891) - (sqrt(891) + -5)) + sqrt(891))4 + sqrt(891) + 6(0 + sqrt(891)) - (2 + sqrt(891)-2 + 1 + -1))*2. 5832sqrt(11) + 289008 Simplify (1 + -2 + 6-5-4sqrt(175)-6)*2. 7200sqrt(7) + 90720001 Simplify (45(sqrt(2736) + sqrt(2736) + -2 + 1))*2 - (-4 + -6((sqrt(2736) + sqrt(2736) + -1 + sqrt(2736) - sqrt(2736))*2 + sqrt(2736)) + 0). -19416sqrt(19) + 4443674 Simplify -1(2 + ((sqrt(539) + -1 + -2)-2)*2 + ((1 + (sqrt(539) + 0)5)4)2). -217810 - 952sqrt(11) Simplify 3((sqrt(931) + sqrt(931) + -2)2 + sqrt(684)-3) - (sqrt(19) - (-2sqrt(171))2 - (sqrt(228)-2)/sqrt(12)). -225sqrt(19) + 11868 Simplify (5 + (-2sqrt(300) + -2 - (5 + sqrt(6)/sqrt(2))4))2 + -5. 816sqrt(3) + 2012 Simplify ((sqrt(312)-16)/(sqrt(84)/sqrt(63)))	{ "pile_set_name": "DM Mathematics" }
? 96x2 + 498 Find the first derivative of l2w*2 - 5l*2 - 2lw2 - 7lw - 27l - 4w - 4 wrt w. 2l*2w - 4lw - 7l - 4 Find the second derivative of 4s*3y + 2s3 - 25s*2 + 11sy + 4s - 7y wrt s. 24sy + 12s - 50 What is the second derivative of 1403x3 + 3x + 258 wrt x? 8418x What is the second derivative of -664jz5 + 12jz4 - 2jz + 7j + 101z wrt z? -13280jz3 + 144jz2 What is the second derivative of -280b*2 + 13b + 5 wrt b? -560 What is the second derivative of 22256b4 + 24818b wrt b? 267072b2 Differentiate -1948qv - v + 1063 with respect to q. -1948v Find the first derivative of 39a3 + 50a*2o*2 + 846o*2 + 5o wrt a. 117a2 + 100ao2 Find the second derivative of -2a*3c - 27a2c*3s + a*2c*2s - 4ac*2 + 2acs - a - 47c3s wrt a. -12ac - 54c3s + 2c2s What is the derivative of -k*2 + 3883k - 14435? -2k + 3883 What is the second derivative of -150g*5w*3 - 8g*2w*3 - g - 500w*3 wrt g? -3000g*3w*3 - 16w*3 Differentiate -12b*2l*4 + 3b*2l - 71b2 with respect to l. -48b*2l*3 + 3b*2 What is the second derivative of -2s*5 - 889s*2 + 917s - 4? -40s3 - 1778 What is the third derivative of -2588o*4 + 1172o*2 - 2o wrt o? -62112o Find the second derivative of -1191p*4r*2 - 4pr2 + 10p + 3r wrt p. -14292p*2r*2 What is the second derivative of 150p*3 - 108p - 3? 900p Differentiate 2624l + 4969 with respect to l. 2624 Find the third derivative of o*6 - 56o*4 + 21o*2 - 3 wrt o. 120o*3 - 1344o Find the third derivative of bi6 + 67bi3 - 15bi2 - 2b + 2i6 - 10i*2 wrt i. 120bi3 + 402b + 240i3 Differentiate 371o*4 + 378 wrt o. 1484o*3 What is the third derivative of 13s*5 - 4s*3 + 8s*2 + 2s wrt s? 780s2 - 24 Find the third derivative of -3d*3v*2z + 6d3vz3 + 4d*2z*3 + 3d*2z*2 - 15dv2z*3 wrt d. -18v*2z + 36vz*3 What is the first derivative of 356x - 229? 356 Find the first derivative of -ot2 - 205ot + 2365t2 - 1 wrt o. -t2 - 205t Find the third derivative of 2f*5 + 9f*4 + 201f*3 + 37f*2 + 13f wrt f. 120f2 + 216f + 1206 What is the third derivative of -29h5i*2 + 6h*4i - 11h2i*2 - 16hi2 wrt h? -1740h*2i*2 + 144hi What is the third derivative of -128a*5 - 19a3 + a2 + 6a - 17 wrt a? -7680a2 - 114 Find the second derivative of -w5 + 842w2 + 2522w. -20w3 + 1684 Find the second derivative of -76d*3y*3 + 3d*3y*2 + 15d*3y - 2d3 - dy*3 wrt y. -456d*3y + 6d3 - 6dy Find the second derivative of 11q*2z*2 - 26q*2z - 2656qz*2 wrt q. 22z*2 - 52z What is the second derivative of 89pu*5 + 32pu + 8u wrt u? 1780pu*3 Find the second derivative of 532z*3 + 57z - 2. 3192z What is the second derivative of -c4 + 20c*3r - 2cr + 346r wrt c? -12c*2 + 120cr Find the first derivative of -735n - 757. -735 What is the third derivative of 1287g3 + 2g*2 + 1326? 7722 What is the third derivative of -4ux3 - ux*2 + 37u - 2x6 + 2x*3 wrt x? -24u - 240x3 + 12 What is the second derivative of -1100v*3 + 37v + 1? -6600v Find the second derivative of 8247l*5 + 983l wrt l. 164940l3 What is the first derivative of -13tx3 - 8t + 14x3 - 34x*2 wrt t? -13x*3 - 8 Find the first derivative of -2t*2x - 5tu*2x - 10tu*2 - 553u*2x - 2u2 wrt t. -4tx - 5u*2x - 10u2 What is the third derivative of 1354v*3 - 2v*2 - 603 wrt v? 8124 What is the third derivative of 14nor*3 + 4nor*2 + nor + 304no - 86or4 + 3or2 wrt r? 84no - 2064or Find the third derivative of -17qs3 + 2qs2 - qsu + 3qs - 3s*4u*2 + 4s*4u - s*2u*2 - 10s*2u wrt s. -102q - 72su2 + 96su What is the derivative of -3005h*2 + 3302? -6010h Find the second derivative of -77hw*5 + 2hw3 + 4hw - 2h + 18 wrt w. -1540hw*3 + 12hw What is the third derivative of i4 - 10i*3 + 675i*2 wrt i? 24i - 60 What is the third derivative of -54m3q*3 + 453m*3q*2 + 8mq3 - 2mq2 wrt q? -324m*3 + 48m Find the second derivative of 4007f2 - 1702f wrt f. 8014 Differentiate u*2y + 132u2 + 2uy2 - 63y2 with respect to y. u2 + 4uy - 126y Find the second derivative of d3f*4 - 69d*3f*3 - 10d*3f + df wrt f. 12d*3f*2 - 414d*3f Find the third derivative of -6646d3nv2 + 2d*2nv + dnv2 - 2dv2 + v wrt d. -39876nv2 Differentiate -3a*3 + 2a*2 - 353a + 8588 with respect to a. -9a2 + 4a - 353 Find the third derivative of 2319b2x*3 + 50b*2x - 4bx - x*2 wrt x. 13914b*2 What is the derivative of -2g*2u*3 - 4953g*2u*2 - 3999u*3 - 2u*2 - 2 wrt g? -4gu3 - 9906gu2 What is the second derivative of -57h*2u*4 + 16h*2u + h*2 wrt u? -684h*2u*2 What is the first derivative of -4mw2 - mw - 2m - 3w - 1 wrt w? -8mw - m - 3 Find the second derivative of 15w5 - 28w*2 - 59w + 2. 300w3 - 56 What is the second derivative of 1608t*2 + 2828t wrt t? 3216 Find the first derivative of im2u*2 + 9im2 + 21i + 2mu*2 - 93u*3 wrt u. 2im2u + 4mu - 279u2 What is the second derivative of -436u*3y*3 + 2uy3 - 98uy + 5y wrt u? -2616uy*3 Find the third derivative of -12509j*4 - 301j*2 - j - 5. -300216j What is the second derivative of -1208t2 - 2t + 359? -2416 What is the third derivative of -430r6 - 2219r*2? -51600r*3 Find the first derivative of -2k*2q + k*2t - 2kqt + 86kqw + 278ktw wrt q. -2k*2 - 2kt + 86kw Find the first derivative of 2h*4z + 112hn*2 - 68n*2z wrt h. 8h3z + 112n2 What is the third derivative of 5459c*5 - 97c*2 + 4 wrt c? 327540c*2 Find the third derivative of iy*4 + 3iy3 - 24iy2 - iy + 16y4 + 41y*2 wrt y. 24iy + 18i + 384y Differentiate 4356d - 1518. 4356 What is the first derivative of -8j3o - 2j2o*3 + 7jo3 - 22o*3 - 12o wrt j? -24j2o - 4jo*3 + 7o*3 What is the third derivative of 1734j*3pt3 + 3j*2pt3 + 2j*2pt2 - j2t + 9t3 wrt j? 10404pt3 Find the first derivative of -2c*2s - c*2 - 55c - 40s4 wrt s. -2c*2 - 160s*3 What is the first derivative of 6829h + 1523? 6829 Find the third derivative of 3g2v4 - g2v2 - 103g*2 + gv*6 + 23v*4 wrt v. 72g*2v + 120gv*3 + 552v What is the second derivative of 8c5 + 191c*4t*2 + 7ct2 - 2ct - 10c - 13t2 wrt c? 160c*3 + 2292c*2t*2 What is the derivative of 2x*4 - 33x - 2205 wrt x? 8x3 - 33 Differentiate -200jkx - jk - jx + 24kx + 11x with respect to j. -200kx - k - x What is the third derivative of -304h*3n*3 + 129h*3n + 3h2n*2 wrt n? -1824h*3 What is the first derivative of 270dk2q - 79dk*2 + 4d wrt q? 270dk2 What is the third derivative of -q3x3 - q3x*2 + 31q*2x*6 + 84q*2x*2 wrt x? -6q*3 + 3720q*2x3 What is the second derivative of g5 - 4g3 - 106g*2 + 719g? 20g3 - 24g - 212 What is the derivative of 1274h3i - 14h3j*2 + 63h3 - h2ij*2 wrt i? 1274h3 - h2j2 What is the derivative of -52j*3 + j + 278 wrt j? -156j*2 + 1 Find the second derivative of -2012q*2t*3 - 82qt3 + qt*2 + 6t*3 wrt q. -4024t*3 What is the third derivative of -13h*4v - 2h4 + h3 + 4h*2v + 93hv wrt h? -312hv - 48h + 6 What is the second derivative of o5 + 250o*4 + 405o wrt o? 20o3 + 3000o2 Find the second derivative of -q3 - 1486q2 - 3868q. -6q - 2972 What is the second derivative of -204l*3 + 230l wrt l? -1224l What is the third derivative of -2452i*4n*3 - 3336i*2n*3 wrt i? -58848in3 Find the third derivative of -18155o*4 + 1037o*2 - 1 wrt o. -435720o What is the first derivative of -2p2q3 + p2q2 + 481p*2 + 9q wrt q? -6p2q*2 + 2p*2q + 9 Find the second derivative of -7u2w*3 - 99u*2wx + 2u*2x - 2uw*3 + 3uwx + 4w3x wrt w. -42u2w - 12uw + 24wx Find the second derivative of 3576z3 + 1725z - 1. 21456*z What	{ "pile_set_name": "DM Mathematics" }
5k + 4 + 2 + 13k. -2k + 7 Collect the terms in 9c*2 - 5c*2 + 19c*2. 23c*2 Collect the terms in 18b + 9b + 13b - 38b. 2b Collect the terms in -5q - 1449 + 1449. -5q Collect the terms in 0z - 5z + z + 3. -4z + 3 Collect the terms in -23w + 10w - 5w. -18w Collect the terms in 2y*2 - 4y*2 - 3y2 - y2. -6y2 Collect the terms in 46s*2 + 19s*2 - 36s*2. 29s*2 Collect the terms in -3a + 0a + 2a + 7a + 3a*2. 3a*2 + 6a Collect the terms in -32 + 4j3 + 62 - 30. 4j*3 Collect the terms in -1445 + 1445 + 3g*3. 3g*3 Collect the terms in -5t - 92t + 5t + 7t. -85t Collect the terms in 4 - 3237u2 + 3228u*2 - 4. -9u*2 Collect the terms in -3v*3 + 47 - 13 - 16 - 18. -3v*3 Collect the terms in 26780 - 26780 - 9c. -9c Collect the terms in 0m2 + m2 + 7 + 0. m*2 + 7 Collect the terms in -1644h + 1644h + 4h*2. 4h*2 Collect the terms in 2t - 2t + 72t*2 + 0t - 2t3. -2t*3 + 72t*2 Collect the terms in -9g*2 - 12g*2 + 18g*2. -3g*2 Collect the terms in 13d*2 + 8d*2 + 11d*2 - 24d*2. 8d*2 Collect the terms in 16 + 18t - 9 - 9. 18t - 2 Collect the terms in -g + 4g - 789g2 + 788g*2 - 3g. -g*2 Collect the terms in -6y + y + 3y + 0y. -2y Collect the terms in 1030581m - 1030581m - 6m*3. -6m*3 Collect the terms in 15 - 15 + 3z*2. 3z*2 Collect the terms in 12s*2 + 2 - 2 - 5s*2. 7s*2 Collect the terms in 28v*2 - 18v + 18v. 28v*2 Collect the terms in -2f*2 + 18f*2 - 22f2 - f2. -7f2 Collect the terms in 85v*2 - 83v*2 + 3 - 3. 2v*2 Collect the terms in 92l*3 - 41l*3 - 49l*3. 2l*3 Collect the terms in 9v*2 - 547 + v + 547. 9v*2 + v Collect the terms in 3560a - 13a2 - 3560a. -13a2 Collect the terms in 43z + 45z + 42z - 127z. 3z Collect the terms in -8a - 6a - 2a + 14a. -2a Collect the terms in -11k + 7k - 2k. -6k Collect the terms in -80k + 80k - 47k*2. -47k*2 Collect the terms in -14y + 13y + 18y + 5y. 22y Collect the terms in -121 - 23g + 74 + 47. -23g Collect the terms in -9w + 15w - 3 + 19 - 5w. w + 16 Collect the terms in 463 - 463 - 41g. -41g Collect the terms in -29 + 64 + 8w - 35. 8w Collect the terms in 57 - 33 - 24 + 0b3 - b3. -b*3 Collect the terms in -30g*2 - 7g*2 - 5g + g. -37g2 - 4g Collect the terms in -4p + 43 + p - p + 2p. -2p + 43 Collect the terms in l3 - 3l*3 - 10l*3 - 16l*3. -28l*3 Collect the terms in 84y*2 - 34y*2 - 43y*2 - 27y*2. -20y*2 Collect the terms in 2d*3 + 4d2 - d2 + 5d2 - 8d*2. 2d*3 Collect the terms in -679a + 2a2 + 679a + 2a2 - 3a2. a2 Collect the terms in 432x - 867x + 428x. -7x Collect the terms in 18r + 9r + 1 - 4r. 23r + 1 Collect the terms in 3a2 - 84a + 42a + 42a. 3a2 Collect the terms in -3t*3 - 7981 + 7981. -3t*3 Collect the terms in -626 + 318 + 316 - 3i + 2i. -i + 8 Collect the terms in 6g*3 - 26g*3 + 4g*3 + 11g3 + g3. -4g3 Collect the terms in 2b2 + b2 - 8b2 + 0b*2. -5b*2 Collect the terms in -37p*2 - 6p*2 + 9p*2 - 43p*2. -77p*2 Collect the terms in 2k - 3k + 3k. 2k Collect the terms in 94v*3 + v - 95v*3 + 25v. -v*3 + 26v Collect the terms in -7l + 9l*3 + 4l + 3l + 7l*3. 16l*3 Collect the terms in z + 42 - 1 + 49. z + 90 Collect the terms in 4r*2 + 0r*2 + 9r*2 + 6r*2. 19r*2 Collect the terms in 6u*3 + 10u*3 - 13u*3. 3u*3 Collect the terms in 597 - 1209 + 612 + t. t Collect the terms in -42w*2 - 48w*2 + 94w*2. 4w*2 Collect the terms in -37 + 2r - 36 - 88 + 2r. 4r - 161 Collect the terms in -10r + 12 + 13 - 25. -10r Collect the terms in -1896t + 948t + 952t. 4t Collect the terms in 3 - o*2 - 9 + 67o + 6. -o*2 + 67o Collect the terms in -p3 - 15 + 49 - 34. -p3 Collect the terms in 1712a3 - 3a + 4a - 1711a3 - a. a3 Collect the terms in 134w2 + 109w*2 - 250w*2. -7w*2 Collect the terms in -18b + 31b - 17b. -4b Collect the terms in q2 + 145 - 181 + q2. 2q*2 - 36 Collect the terms in 341 - 164 - 177 - 30j. -30j Collect the terms in 505o*2 - 10o*3 - 505o*2. -10o3 Collect the terms in 660 + b3 - 660. b*3 Collect the terms in -29n - 24 - 27 + 49 - 28n. -57n - 2 Collect the terms in -1 - 9c2 - 2 - 2 + 4c*2. -5c*2 - 5 Collect the terms in -5y*3 - 4y*3 + 3y*3. -6y*3 Collect the terms in -2k - 4k + 3k + 37 + k. -2k + 37 Collect the terms in -12s*3 + 17s*3 + 7s*3 + 8s*3. 20s*3 Collect the terms in -5s*3 - 22s*3 + 42s*3. 15s*3 Collect the terms in 0g*3 + 2g*3 - g - g - 13g*3. -11g*3 - 2g Collect the terms in -2f3 + 49f*2 - 56f*2 + 7f*2. -2f*3 Collect the terms in -7f - 4f - 4f. -15f Collect the terms in -16 + 8d - 10 + 26. 8d Collect the terms in 69202 - 69202 + 4k. 4k Collect the terms in -47p - 47p + 96p. 2p Collect the terms in 2o*2 - 7o - 6o2 + o2. -3o*2 - 7o Collect the terms in -148r - 146r - 153r + 591r - 146r. -2r Collect the terms in -2b2 + 7b*2 - 5b2 + b2. b*2 Collect the terms in 0j*2 - 53j*2 - 39j*2 - 11j*2. -103j*2 Collect the terms in -10x*2 + 10x - 12x + 2x. -10x2 Collect the terms in 0d*2 + 0d*2 - 6d*3 + 23d*3. 17d*3 Collect the terms in -2036k + 6120k - 2044k - 2040k + 2k*2. 2k*2 Collect the terms in 11b + 10b - 11b. 10b Collect the terms in -7 + 7 + 0k*2 + 2k*3 - 6k*2 - 5k*3. -3k*3 - 6k*2 Collect the terms in -291r - 301r + 892r - 299r. r Collect the terms in 33d*2 - 25d*2 - 7d2. d2 Collect the terms in 464m3 + 463m*3 - 924m*3. 3m*3 Collect the terms in -2z + 5z + 19z*3 - 3z + 2z3. 21z*3 Collect the terms in -990n + 2n2 + 2965n - 985n - 990n. 2n2 Collect the terms in 13 + 10 - m - 23. -m Collect the terms in -33w + 107w - 33w + 2w2 - 41w. 2w2 Collect the terms in -2w2 - w2 - 4w2. -7w*2 Collect the terms in 753 - 1510 - 2k*2 + 757. -2k*2 Collect the terms in -2 + 2 - 4t - 1. -4t - 1 Collect the terms in 13n*2 - 561n + 561n. 13n*2 Collect the terms in 8t*2 - 34t*2 - 38t*2. -64t2 Collect the terms in 26982 - 26982 + k3. k*3 Collect the terms in 278d + 2d2 - 36 + 36. 2d*2 + 278d Collect the terms in 441o3 - 226o*3 - 219o*3. -4o*3 Collect the terms in 315q - 632q + 295q. -22q Collect the terms in 35l*2 - 10l*2 - 12l*2. 13l*2 Collect the terms in -29z*2 - 11z*2 + 76z*2 - 17z*2. 19z*2 Collect the terms in -650r*2 + 326r*2 + 331r*2. 7r*2 Collect the terms in -4u*3 - 10u + 10u + 28u*3. 24u*3 Collect the terms in -841268 + 841268 - 3v. -3v Collect the terms in 20i*2 + 0i*2 - 11i*2. 9i2 Collect the terms in n2 - 263n + 263n. n2 Collect the terms in w3 + 20w - 30w + 10w. w3 Collect the terms in 19s - 19s + 24s*2. 24s*2 Collect the terms in -37j - 22j + 314j. 255j Collect the terms in -2 - 21 - 15a*2 + 27 - 4. -15a*2 Collect the terms in -y - 613 + 613. -y Collect the terms in -10 - 17 + 2f*3 + 27. 2f*3 Collect the terms in -17 + 3f - 2 + 19 - 2f. f Collect the terms in 76a*3 + 100a*3 - 131a*3. 45a*3 Collect the terms in 112b + 111b + 114b - 343b. -6b Collect the terms in 0 + 1428r + 1431r - 2863r + 0. -4r Collect the terms in -5j2 + 15j*2 - 8j*2 + 12j*2. 14j*2 Collect the terms in 3n*2 + 0n*3 + 2n*3 - 5n*3 + 0n*2. -3n*3 + 3n*2 Collect the terms in 4c + 2c - 6c + 4c2. 4c*2 Collect the terms in 14 - 467r - 14 + 464r. -3r Collect the terms in 0 + 0 + 1209x. 1209x Collect the terms in 2d3 + 0d*3 + 126d2 - d3. d*3 + 126d*2 Collect the terms in 31h*3 - 23h*3 + 24h*3 + 24h*3. 56h*3 Collect the terms in 5c - 5c + 275720c*3 - 275727c*3. -7c*3 Collect the terms in -29 - 8l + 1 + 28. -8l Collect the terms in -27 + 10 + 7v + 17. 7v Collect the terms in 2c*2 + 0 + 0c*2 + 5 - 2. 2c*2 + 3 Collect the terms in -530 + 1069 - 8d*3 - 539. -8d*3 Collect the terms in -10m*2 - 10m*2 + 5m*2. -15m*2 Collect the terms in 8p + 4p3 + 2p*3 - 38p - 5p3. p3 - 30p Collect the terms	{ "pile_set_name": "DM Mathematics" }
s the greatest common divisor of 94 and 177566? 94 Calculate the highest common divisor of 795112 and 152. 152 What is the highest common divisor of 177399 and 261? 9 Calculate the highest common factor of 12903 and 289. 17 What is the highest common divisor of 288 and 628? 4 Calculate the greatest common factor of 64 and 79048. 8 Calculate the highest common divisor of 8510 and 92. 46 Calculate the greatest common divisor of 8 and 32792. 8 What is the greatest common divisor of 2464 and 238? 14 Calculate the highest common factor of 96 and 19018464. 96 Calculate the highest common factor of 9416 and 368. 8 Calculate the highest common divisor of 228 and 45468. 12 Calculate the greatest common factor of 15484 and 196. 196 Calculate the greatest common factor of 1246461 and 978. 489 What is the greatest common factor of 27693 and 5792? 181 Calculate the highest common factor of 56553 and 21. 21 Calculate the greatest common divisor of 290 and 116. 58 What is the greatest common factor of 40339 and 29? 29 Calculate the highest common divisor of 12 and 12234. 6 What is the highest common factor of 6076 and 992? 124 What is the greatest common divisor of 5120 and 620? 20 Calculate the greatest common divisor of 275 and 79915. 55 Calculate the greatest common divisor of 987 and 133950. 141 Calculate the greatest common divisor of 60 and 926920. 20 Calculate the highest common divisor of 15440 and 2000. 80 Calculate the highest common factor of 12426 and 18696. 114 Calculate the highest common divisor of 864466 and 73. 73 Calculate the highest common factor of 3388 and 8833. 121 What is the highest common factor of 1342 and 32086? 122 What is the greatest common divisor of 186 and 85777? 31 What is the greatest common factor of 32469 and 711? 237 What is the highest common divisor of 9990 and 6210? 270 Calculate the greatest common divisor of 2336 and 18031. 73 What is the highest common factor of 181373 and 47? 47 Calculate the highest common divisor of 83436 and 153. 51 Calculate the greatest common divisor of 290 and 2285. 5 What is the highest common divisor of 349 and 1583413? 349 Calculate the highest common factor of 2944 and 5704. 184 What is the greatest common divisor of 1155 and 1991? 11 What is the highest common factor of 26049 and 1938? 57 Calculate the highest common factor of 83580 and 35. 35 What is the highest common factor of 1330 and 2870? 70 What is the greatest common divisor of 39 and 600132? 39 Calculate the greatest common factor of 155359 and 43. 43 Calculate the highest common factor of 810 and 68490. 90 What is the greatest common factor of 10439 and 39? 13 What is the greatest common factor of 462 and 10813341? 231 What is the greatest common factor of 714 and 4242? 42 What is the greatest common factor of 121127 and 118? 59 What is the greatest common factor of 86127 and 57? 57 What is the greatest common factor of 8205 and 180? 15 Calculate the greatest common factor of 63 and 6132. 21 What is the highest common factor of 128 and 876448? 32 What is the greatest common divisor of 1350 and 655800? 150 Calculate the highest common divisor of 12 and 557704. 4 Calculate the highest common factor of 390 and 72280. 130 What is the greatest common factor of 67952 and 1644? 548 Calculate the highest common divisor of 36 and 7704756. 36 What is the greatest common divisor of 406 and 1566? 58 What is the highest common factor of 50008 and 44? 4 What is the greatest common factor of 645342 and 354? 354 What is the greatest common factor of 36 and 307422? 18 What is the greatest common factor of 8646 and 6? 6 Calculate the greatest common divisor of 150 and 10410. 30 What is the highest common factor of 948 and 743469? 237 Calculate the highest common divisor of 232 and 56492. 116 What is the highest common factor of 164 and 3157? 41 What is the greatest common divisor of 381744 and 432? 144 What is the highest common factor of 1158 and 1266? 6 Calculate the greatest common divisor of 65186 and 154. 22 What is the highest common divisor of 175 and 340550? 175 Calculate the highest common factor of 35769 and 3. 3 What is the greatest common factor of 101988 and 72? 36 What is the greatest common factor of 8375 and 6499? 67 Calculate the highest common divisor of 39329 and 67. 67 Calculate the highest common divisor of 770 and 41250. 110 What is the greatest common divisor of 1826307 and 81? 81 What is the highest common factor of 144039 and 2394? 399 What is the greatest common factor of 4616109 and 243? 81 What is the greatest common divisor of 84 and 77892? 12 What is the highest common factor of 532 and 159828? 76 What is the greatest common divisor of 608 and 2976? 32 What is the highest common factor of 86426 and 82160? 158 Calculate the greatest common divisor of 1099326 and 6. 6 Calculate the greatest common divisor of 107 and 41623. 107 Calculate the highest common factor of 2570 and 1270. 10 What is the greatest common divisor of 72926 and 7? 7 What is the highest common factor of 112 and 80248? 56 What is the highest common factor of 193990 and 30? 10 Calculate the greatest common factor of 30 and 316770. 30 Calculate the greatest common divisor of 31 and 9565. 1 Calculate the greatest common divisor of 154 and 66154. 22 Calculate the highest common factor of 104765 and 115. 115 Calculate the greatest common divisor of 82574 and 3498. 106 Calculate the greatest common factor of 360 and 2328. 24 Calculate the highest common divisor of 2340264 and 18. 6 What is the highest common factor of 655290 and 30? 30 Calculate the highest common divisor of 23165 and 1353. 41 Calculate the highest common divisor of 497 and 224. 7 What is the greatest common divisor of 170 and 187510? 170 What is the greatest common factor of 147 and 166943? 49 Calculate the greatest common divisor of 251070 and 30. 30 Calculate the highest common factor of 56361 and 129. 3 What is the highest common factor of 53557 and 147? 49 Calculate the greatest common factor of 76006 and 14945. 427 What is the highest common factor of 4812 and 2688? 12 What is the greatest common divisor of 1860 and 10788? 372 What is the greatest common divisor of 64681 and 58304? 911 Calculate the highest common divisor of 5586 and 2337. 57 What is the greatest common factor of 62 and 1282966? 62 What is the greatest common factor of 104489 and 322? 161 Calculate the greatest common divisor of 180255 and 61. 61 Calculate the greatest common factor of 21 and 1405299. 21 What is the highest common divisor of 288 and 68316? 12 What is the highest common factor of 318493 and 519? 173 Calculate the highest common divisor of 5208 and 8232. 168 What is the greatest common factor of 1813507 and 157? 157 What is the greatest common divisor of 1103175 and 675? 225 Calculate the greatest common divisor of 2216790 and 234. 18 What is the highest common divisor of 2806 and 14306? 46 What is the greatest common divisor of 243200 and 200? 200 What is the greatest common factor of 122211 and 28638? 333 What is the highest common divisor of 126315 and 1008? 63 Calculate the highest common factor of 54 and 1678. 2 Calculate the greatest common factor of 121184 and 2016. 224 Calculate the greatest common factor of 248 and 1381298. 62 Calculate the greatest common divisor of 440 and 26840. 440 What is the highest common factor of 196 and 296401? 49 Calculate the greatest common factor of 24794 and 172480. 1078 Calculate the greatest common divisor of 6463 and 343944. 281 Calculate the greatest common factor of 46 and 10862. 2 What is the highest common factor of 10327 and 115? 23 What is the highest common factor of 110171 and 524? 131 What is the greatest common factor of 25661 and 268? 67 Calculate the highest common divisor of 234 and 17406. 18 Calculate the greatest common factor of 7825 and 313. 313 Calculate the highest common divisor of 690 and 2236290. 690 Calculate the greatest common divisor of 202224 and 352. 176 Calculate the greatest common factor of 10440 and 520. 40 Calculate the highest common factor of 595224 and 12600. 504 Calculate the greatest common divisor of 10787 and 282338. 469 What is the greatest common factor of 270 and 2490? 30 Calculate the highest common divisor	{ "pile_set_name": "DM Mathematics" }
w*3/6 + 6w*2. Let n be o(1). What is the third derivative of 15d*2 + 2dn + d6 - 17d2 - 2d*4 wrt d? 120d*3 Let s(o) = o - 1. Suppose -35m + 6 = -38m. Let w(b) = 19b - 14. Let g(d) = ms(d) - w(d). Find the first derivative of g(c) wrt c. -21 Let c(j) be the first derivative of -13j*6/120 + 11j*3/3 - 9j*2 - 5. Let h(o) be the second derivative of c(o). Find the first derivative of h(q) wrt q. -39q*2 What is the third derivative of -48c*3 - 5c3 - c2 - 241c + 183c*3 + 285c*3 wrt c? 2490 Let b(o) be the first derivative of -8o*2 + 36o - 11. What is the derivative of b(s) wrt s? -16 Let m = 210 - 210. Let c(s) be the second derivative of s*2 + ms*3 + 0 + 1/3s*4 - 6s. Differentiate c(v) with respect to v. 8v Let x(j) = j2 + 15j + 6. Let v(c) = 3c. Let b be v(-2). Let t(q) = q + 1. Let m(p) = bt(p) + x(p). What is the second derivative of m(n) wrt n? 2 Let r be 4 + -4 + 8 + -3. Find the third derivative of rp2 + p5 + 10p2 - p2 + 4p5 wrt p. 300p*2 Differentiate 23j + 135j + 876 - 684 wrt j. 158 Suppose -s + 13 = -4n + n, 2s - 5 = -n. Let a be (-4)/(-2) + 27 + 2. What is the second derivative of 8z + az4 - 16z*4 - 16z*s wrt z? -12z*2 Let z(p) = -7p - p*3 + 16p - 10p. Let k(c) = 3c*4 + 9c*3 + 9c + 1. Let j(n) = -4k(n) - 36z(n). What is the derivative of j(t) wrt t? -48t3 Find the third derivative of -262q*5 - 5q*5 + 6 - q - 232q*5 - 61q*2 - 6 wrt q. -29940q*2 Find the third derivative of -8l + 396l2 + 7l - 239l4 + 463l*4 wrt l. 5376l Let u(x) be the third derivative of -16x2 + 0 + 0x*3 + 0x*4 + 0x - 23/210x7 + 0x*6 + 31/60x*5. Find the third derivative of u(h) wrt h. -552h Let v(r) = 464r3 - 5r*2 - 415r. Let t(f) = -233f3 + 2f*2 + 207f. Let l(w) = 5t(w) + 2v(w). Find the second derivative of l(z) wrt z. -1422z Suppose 4r + k = 9, 4r + k = -4k + 13. Find the second derivative of -189y + 194y - y*2 + 0y*r wrt y. -2 What is the second derivative of -6073g*4 + 87g*2 + 6071g*4 - 33g - 5g - 12g*2 wrt g? -24g*2 + 150 Let d(f) = -295f*3 - 168f*2 - 22f. Let n(c) = 148c3 + 85c*2 + 12c. Let b(t) = 6d(t) + 11n(t). Find the third derivative of b(j) wrt j. -852 Let q(w) = -81w3 + w2 - 11w + 3. Let c(s) = 74s3 - s2 + 12s - 4. Let y(n) = -3c(n) - 4q(n). Find the third derivative of y(m) wrt m. 612 Differentiate 79 + 15 - 5s2 + 105s + 4s2 + 3s*2 + 140 with respect to s. 4s + 105 Let z(w) = w*2 + 4w + 8. Let h be z(-4). Let f be (h/(-32))/((-2)/8). Find the first derivative of -86p - 5 + 86p - f + 7p2 wrt p. 14p Let d(x) = -113x4 - 10x*3 - 5x*2 + 5x - 87. Let h(j) = j*4 + 2j3 + j2 - j + 1. Let k(s) = -d(s) - 5h(s). What is the derivative of k(c) wrt c? 432c*3 Let k(p) be the second derivative of -19p7/21 - p6/15 - p*4/6 + 4p*3/3 + p - 4. Find the third derivative of k(v) wrt v. -2280v*2 - 48v Let s(a) = -33a - 13. Let u(c) = -7 - 2 - 8c + 6. Let r = 6 + -4. Let v(w) = rs(w) - 9u(w). What is the first derivative of v(q) wrt q? 6 Suppose -3y = -3r + 21, 3y - 5 = -3r - 2. What is the second derivative of 12s - 42s*2 + 14s - rs2 + s wrt s? -92 Let k(g) = -5016g*3 + 133g*2 - 10735. Let m(u) = -114u*3 + 3u*2 - 244. Let l(c) = 3k(c) - 133m(c). Differentiate l(a) with respect to a. 342a2 Let f(g) = g2 - 9g - 22. Let u be f(11). Let n(m) be the third derivative of 0m + u + 1/4m4 + m2 + m3. Find the first derivative of n(t) wrt t. 6 Let t(b) be the second derivative of b7/140 + b6/24 + 7b*3/3 - 19b. Let l(c) be the second derivative of t(c). Find the third derivative of l(y) wrt y. 36 Let b(n) = -n*3 - 8n*2 - 2n + 7. Let q be b(-8). Find the second derivative of -4w3 + 2w*3 + 19w - 6w3 + qw*3 wrt w. 90w Let p(h) be the first derivative of 11 + 15h + 0h*2 + 7/3h*3. Differentiate p(w) with respect to w. 14w Find the first derivative of -14v2 - 8v*2 + 24 + 61 + 44v2 - v4 wrt v. -4v3 + 44v Let t(z) = z*4 - 2z*3 + 2z - 42. Let b(i) = 3i4 - 126 + 0i*4 + 10i - 2i - 7i*3 - i. Let y(d) = -2b(d) + 7t(d). Differentiate y(l) wrt l. 4l*3 What is the first derivative of -143 - 1635z*2 - 480z*4 + 1635z*2 - 219 wrt z? -1920z3 Let c(y) be the first derivative of -y2 - 70y + 89. What is the derivative of c(i) wrt i? -2 Suppose d + 9d = 40. What is the third derivative of -185 + 12o2 + od + 185 wrt o? 24o Let b(o) = -3o. Let t be b(-2). Suppose -2y = -24 + 18. Find the first derivative of -y + tw + 0w - 2w - w wrt w. 3 Let w(s) = -s4 - s2 - 1. Let y(d) = 0d*2 + 30d*2 - 14d*4 - 10d*2 + 3 + 5d*4. Let r(x) = -3w(x) - y(x). Find the third derivative of r(n) wrt n. 288n Let v(u) be the third derivative of u8/84 - 5u*6/24 + 263u*5/30 - 530u*2. Find the third derivative of v(w) wrt w. 240w*2 - 150 Let s(d) = 622d*2 + 2d - 410. Let l(r) = -623r2 - 3r + 420. Let q(p) = -2l(p) - 3s(p). Differentiate q(i) wrt i. -1240i Suppose 0f - 2f = -p - 2, 0 = -2f + 5p + 10. Let k = 131 + -99. Find the second derivative of -g + fg + kg3 - 36g*3 - 4g wrt g. -24g Let b(f) be the third derivative of f7/70 + f5/30 + f4/12 - 47f*3/3 + 26f*2 + 1. Find the second derivative of b(i) wrt i. 36i2 + 4 What is the third derivative of -3549913 + 3549913 - t5 - 144t3 - 508t*2 wrt t? -60t*2 - 864 Let b(z) be the first derivative of 0z*4 + 9z*5 + 0z*3 + 19 - 47/2z*2 + 0z. What is the second derivative of b(p) wrt p? 540p2 Suppose 8q - 4q - 24 = 0. Let h(w) be the second derivative of qw + 1/3w3 + 0 + 0w*2 + 1/2w*4. Find the second derivative of h(z) wrt z. 12 Let x(n) = -1109n - 830. Let s(o) = -371o - 277. Let t(i) = -11s(i) + 4x(i). Differentiate t(g) with respect to g. -355 Let a be (-2)/(-6)(37 - 1). Suppose -5k + 8 = -a. What is the third derivative of -7z*k + 15z + 0z4 - 15z + 8z2 wrt z? -168z Suppose -3h - 3d - 9 = 0, -6 - 6 = -h + 2d. What is the second derivative of 8t*2 + 2t*3 - 8t*h - 10t wrt t? 12t Suppose b - 2z - 10 = 3b, 5z = b + 23. Let s = 10 + b. What is the third derivative of 3 - 4x4 - 4 - xs + 1 wrt x? -96x Let h = 1 + 5. Suppose 584 - 206 = hy. Find the second derivative of -1 + yb*5 + 1 - 56b*5 + 9b wrt b. 140b3 Let x(m) be the second derivative of -m8/28 + 7m6/10 - m4/4 - 23m2/2 + 9m - 21. What is the third derivative of x(y) wrt y? -240y3 + 504y Find the third derivative of m*3 + 19m*2 + 2m*5 - 21 + 2m*3 + 21 - 3m wrt m. 120m2 + 18 Differentiate -454i + 212i2 + 454i - i*4 - 186 wrt i. -4i*3 + 424i Let o(g) = -18g - 3. Let c(n) = 343n + 56. Suppose 3h + 177 = -54. Let x(m) = ho(m) - 4c(m). Find the first derivative of x(v) wrt v. 14 Let w(p) = -p3 - 12p*2 + 13p + 10. Let f be w(-13). Let d be -2 + f/(2 + 0). What is the second derivative of 7i5 + i - 3i*3 + di*3 wrt i? 140i*3 Differentiate 0a*4 + 448 + 134 - 812a*4 + 83 wrt a. -3248a*3 Let z(k) = 7k*3 - 4k*2 + 4k. Let l(t) = 5t + 3t*2 - 4t2 - t3 - 1 + 2t3 - 4t. Let b(j) = -4l(j) + z(j). What is the derivative of b(u) wrt u? 9u*2 Let s(z) = 3z. Let c(d) = -4d + 110. Let n(a) = -c(a) - 8s(a). Differentiate n(l) with respect to l. -20 Suppose 4 = -10o + 6o. Let y = 3 + o. What is the second derivative of 2w2 - 5w*2 - w - 3w + 7wy wrt w? 8 Let b(f) be the first derivative of -f5 + 10f*3/3 - 175f - 65. Differentiate b(y) wrt y. -20y3 + 20y Let t(x) be the third derivative of -587x4/24 + 209x*3/6 + 270x*2. Find the first derivative of t(w) wrt w. -587 Let n(b) be the second derivative of 0 + 3b + 0b4 + 0b*3 - 3/10b*5 + 15/2b*2. Differentiate n(u) with respect to u. -18u2 Let b(v) = -v3 + 3v2 + v. Let l(q) = -174q*3 - 38q*2 - 30q. Let z(r) = 12b(r) + l(r). What is the third derivative of z(j) wrt j? -1116 Let n(k) = k5 - 6k*4 - 6k*3 + 156k*2 - 468k + 2. Let v(l) = -l4 - l3 - 3l2. Let s(m) = n(m) - 6v(m). Find the second derivative of s(i) wrt i. 20i3 + 348 Let t(u) be the second derivative of 58u*3/3 - 24u*2 + 200u.	{ "pile_set_name": "DM Mathematics" }
the remainder when a is divided by 1/(-3) - 201/m? 20 Suppose 87 = 5a - 4f, 0 = a - 3a - 2f + 24. Suppose 0 = -24b + 26b + 172. Let u = b + 110. What is the remainder when u is divided by a? 9 Suppose -14c + 5c + 41248 = -c. Calculate the remainder when c is divided by 120. 116 What is the remainder when 131 is divided by (-16)/(-120) - (-1884)/45? 5 Suppose z + 3z - m - 2415 = 0, -5m = 3z - 1794. Suppose -4g + 2031 + 345 = 4n, -z = -g - 4n. Calculate the remainder when g is divided by 119. 115 Let x(k) = 10k + 3. Let b be x(9). Let p be (3 - -1) + b - 4. Suppose -3i + p = -57. What is the remainder when i is divided by 18? 14 Suppose 0 = -20c - 210 + 610. What is the remainder when 199 is divided by c? 19 Suppose 5h + 94 - 684 = 0. Calculate the remainder when h is divided by ((-42126)/(-112))/59(-24)/(-9). 16 Let b = -19153 + 19196. Let x = 159 - 35. What is the remainder when x is divided by b? 38 Let v(s) be the first derivative of 3s*2/2 - 9s - 11. Let t be v(10). Let h = t + 13. Calculate the remainder when 99 is divided by h. 31 Suppose -10o = 15 - 65. Suppose -5y = -6y + o. Suppose 3m - 4a - 384 = 0, ym + 2a + 186 = 800. Calculate the remainder when m is divided by 18. 16 Suppose 0i - 262 = 2w + 2i, -2i + 655 = -5w. Let s = w + 157. What is the remainder when s is divided by 9? 8 Suppose 2419f = 2371f + 61824. What is the remainder when 5156 is divided by f? 4 Let c = 20470 - 14647. What is the remainder when c is divided by 52? 51 Let k(w) = w - 13. Let u(h) = -h + 13. Let r(p) = -4k(p) - 3u(p). Let n be r(0). Let j = 21 - n. What is the remainder when 30 is divided by j? 6 Let r = 206 - 243. Let q = r + 56. Calculate the remainder when 94 is divided by q. 18 Let k(n) = 168n2 + 4n + 3. Let c be k(-1). Let s = c - 134. What is the remainder when 95 is divided by s? 29 Let l(w) = 24w - 141. Let y be l(6). Suppose -4n + 3b + b = -24, 3 = yn + 2b. Suppose 3j + j = 36. What is the remainder when j is divided by n? 0 Let i(z) = 8z2 - 154z - 56. What is the remainder when i(20) is divided by 23/4 + 2/8? 4 Let a = 1222 + -1208. Let z(j) = 3j - 20. Let u be z(8). Suppose ud + w - 182 = 0, 2d + 2w - 61 = 27. Calculate the remainder when d is divided by a. 4 Let r = 401 - 296. Suppose 37 = -17j + r. Calculate the remainder when 61 is divided by j. 1 Let k = -11901 + 14742. Calculate the remainder when k is divided by 472. 9 Suppose -4326 = 3w + 2j, -j + 0j + 7210 = -5w. Let i be (-8)/6 + w/(-42). Let y = i - 21. What is the remainder when 22 is divided by y? 10 Suppose -4h = -5q + 167, 2h = 3q - q - 68. Calculate the remainder when ((-29)/(-3)1)/(3/27) is divided by q. 25 Let p(o) = 4o2 + o - 3. Suppose -7f + f = -54. Suppose f = 10u - 201. Calculate the remainder when u is divided by p(-2). 10 Let t be (-15)/6(-42)/35. Suppose 0 = 3h + 15, 2i - th + 7h = 82. Suppose -i = y - 89. What is the remainder when 150 is divided by y? 36 Suppose -14a + 101 = 51a - 289. Calculate the remainder when 74 is divided by a. 2 Suppose 20a - 21a = 0, 4n - 2a = 136. Calculate the remainder when 915 is divided by n. 31 Let w(z) = 3z + 6. Suppose -340i - 349i + 1980 = -644i. Calculate the remainder when i is divided by w(5). 2 Let k = -134 - -126. What is the remainder when 1(k/(-2) - -93) is divided by 10? 7 Suppose -4d - 3000 = -4o + d, -4458 = -6o - 3d. Calculate the remainder when o is divided by 30. 25 Suppose 6n - 99 = 3n. Let r = n - 18. Let p = 38937 + -38913. What is the remainder when p is divided by r? 9 Let z = -2066 + 2267. Suppose 0 = -5c + 7c - 70. What is the remainder when z is divided by c? 26 Suppose 75219 + 10681 = 104v - 4v. Calculate the remainder when v is divided by 428. 3 Let t(a) = 3a + 5. Let y(n) = -n - 1. Let d(k) = 2t(k) + 9y(k). Let o be d(-2). Let f = 31 + o. What is the remainder when f is divided by 14? 10 Let c(i) = -2i3 + 56i*2 + 6i - 123. Calculate the remainder when 240 is divided by c(28). 15 Let i be 2 - 1 - (-6 + (4 - 19)). Calculate the remainder when 359 is divided by (-33)/i - 46/(-4). 9 Suppose 5f - 4f = 5. Suppose 5x - 6 = 3o, -2x + fo - 6o = -9. What is the remainder when (-2)/(-4) + 62/4 is divided by x? 1 Let h = 72292 + -72276. Suppose 7b - 4b - p = 241, -b - 3p + 67 = 0. What is the remainder when b is divided by h? 15 Suppose -3h + a = -483, 2829 = 5h + 4a + 2058. What is the remainder when h is divided by (-4)/(-3)38? 31 Let g(d) = -d3 + 9d*2 - 6d + 9. Suppose -71v + 6c + 65 = -70v, -78 = -4v - 2c. What is the remainder when g(6) is divided by v? 12 Suppose 23q + 214 - 820 = 21q. What is the remainder when 1319 is divided by q? 107 Suppose -f + 2i + 1372 = 0, 0 = -6f + i + 9775 - 1609. What is the remainder when f is divided by 339? 4 What is the remainder when (18/4)/(-3)1000/36-12 is divided by 19? 6 What is the remainder when 545 is divided by (-5746)/(-130) - 12/10? 29 Suppose 2o = -4q + 16, o = 3o + 5q - 19. Let p(k) = k - 23. Let h be p(30). Suppose -oj + 31 = h. Calculate the remainder when 35 is divided by j. 11 Suppose -4k - 14 = -5f, 4f + 22k - 17k - 44 = 0. Suppose c + 12 = 4h - 8, -2c - 28 = -5h. Calculate the remainder when 13 is divided by (10/3)/(h/f). 3 Let h(u) = 13u - 35. Let d be h(15). Suppose -35x + d = -31x. What is the remainder when x is divided by 9? 4 Let t = 66 - -119. Let x = 247 - t. Calculate the remainder when x is divided by 18. 8 Suppose 13q - 680 = 2q + 783. What is the remainder when 439 is divided by q? 40 Calculate the remainder when 178 is divided by (-328)/(-6) + (-638)/174. 25 Let k = 15228 + -15198. Let w = -189 - -273. What is the remainder when w is divided by k? 24 Suppose -28 = 2q - 3q + 2d, q + 3d = 23. Suppose -4b + 123 = 5u - 154, b - 226 = -4u. Calculate the remainder when u is divided by q. 5 Calculate the remainder when 159 - (5 - (-4)/(-4)) is divided by ((-280)/21)/10(-369)/12. 32 Suppose -3285t + 4926 = -3280t + x, -3t = -5x - 2978. Calculate the remainder when t is divided by 43. 40 Suppose 2h + 4n - 774 = 860, 5n = 4h - 3242. What is the remainder when h is divided by 41? 34 Suppose 4l - 45 = -4s + 15, -3s - 5l = -47. What is the remainder when 460 is divided by s? 12 Let d(k) = -k2 - 119k - 752. What is the remainder when 1288 is divided by d(-10)? 274 Let g(d) = d*3 + 16d2 + 81. What is the remainder when g(-12) is divided by 20? 17 Let z(h) = -h3 - 104h2 + 1262h + 84. What is the remainder when 1307 is divided by z(-115)? 20 Let y be (0 + 4/12)-309. Let l = -94 - y. Let q = 69 - 62. What is the remainder when l is divided by q? 2 Let x be 23/60. Suppose 202j - 203j + 12 = x. Calculate the remainder when 332 is divided by j. 8 Suppose -6q + 356 = 38. Suppose 0h = 7h - 56. Calculate the remainder when q is divided by (31 - 1)4/h. 8 Let l = 894 - 889. Let t = -3 + 3. Suppose t = 2c - 0c - 26. Calculate the remainder when c is divided by l. 3 Let m = 7033 + -6324. What is the remainder when m is divided by 51? 46 Let s(i) = -i2 - 18i - 10. Let t be s(-13). Let r = 55 - t. What is the remainder when 29 is divided by r(-3)/(-3) + 11? 7 Suppose -41f = 4676 - 23331. Calculate the remainder when f is divided by 162. 131 Let t(m) = 7m3 - 4m*2 + 4m - 99. What is the remainder when t(6) is divided by 26? 19 Suppose -28t + 10t = -702. Suppose 410 = 5i + 35. Calculate the remainder when i is divided by 6 + t/3 + 7. 23 Suppose 0n = -5n + 5t + 95, 4n - 56 = -t. Suppose 0 = -0h - 4h + 60. Suppose hx - 14x = 24. What is the remainder when x is divided by n? 9 Calculate the remainder when 279 + 13/((-234)/72) is divided by 94. 87 What is the remainder when 204 is divided by 15 - (1 - (29 + -2))? 40 Let c(h) = -51h - 950. Calculate the remainder when c(-26) is divided by 188. 0 Let o(y) = -304y - 1605. What is the remainder when o(-7) is divided by 17? 13 Suppose 0a - 38 = 5a + 2i, -24 = 2a + 3i. Let w be -1 + 3 + (-12)/a. Suppose -wk - 1494 = -13k. What is the remainder when k is divided by 28? 26 Let i(w) = 7w2 + 30w + 12. Suppose 5k = -s + 50, -5s + 2k + 190 = -3k. Calculate the remainder when s is divided by i(-4). 0 Let c be (-495)	{ "pile_set_name": "DM Mathematics" }
798357 rounded to seven dps? 0.0013798 What is -0.000000815 rounded to 6 dps? -0.000001 What is 0.023926189 rounded to four decimal places? 0.0239 What is -0.1807806 rounded to three decimal places? -0.181 Round -0.0007514752 to 6 dps. -0.000751 Round -12137882 to the nearest 10000. -12140000 What is 13543.25 rounded to the nearest one hundred? 13500 Round 0.004338143 to four decimal places. 0.0043 Round 16564590 to the nearest 10000. 16560000 What is 0.03450186 rounded to 2 dps? 0.03 What is -3683.362 rounded to the nearest 100? -3700 What is 20340.67 rounded to the nearest 1000? 20000 What is 36407.3 rounded to the nearest one hundred? 36400 Round -0.0000012336788 to 7 decimal places. -0.0000012 What is -0.00524557 rounded to four dps? -0.0052 What is 3.3618511 rounded to three decimal places? 3.362 Round -0.673682 to 2 dps. -0.67 What is 3.630759 rounded to one dp? 3.6 Round 95584100 to the nearest one hundred thousand. 95600000 Round -203.026 to the nearest one hundred. -200 Round -0.009226188 to four decimal places. -0.0092 Round 5376.975 to the nearest one thousand. 5000 What is -0.2867972 rounded to 2 dps? -0.29 What is 0.0010886617 rounded to 6 decimal places? 0.001089 What is -0.000394303 rounded to 4 dps? -0.0004 Round 0.0455926 to 2 decimal places. 0.05 Round -1524.036 to the nearest one hundred. -1500 Round 1770800 to the nearest 10000. 1770000 What is -332.2149 rounded to the nearest one hundred? -300 What is -985.793 rounded to the nearest integer? -986 Round 1.408672 to one dp. 1.4 What is 0.00036395 rounded to six dps? 0.000364 What is -123503.2 rounded to the nearest ten thousand? -120000 What is 104.6189 rounded to one decimal place? 104.6 Round 0.001659394 to six decimal places. 0.001659 What is -0.0000159582 rounded to 7 dps? -0.000016 What is -1540.561 rounded to the nearest ten? -1540 Round -297076.52 to the nearest one hundred thousand. -300000 Round 141.83855 to 2 decimal places. 141.84 Round -863.45 to 0 dps. -863 Round -1427986.65 to the nearest one thousand. -1428000 What is -0.02470957 rounded to 4 decimal places? -0.0247 What is -7573.34 rounded to the nearest ten? -7570 Round 160094.9 to the nearest 100. 160100 What is 0.000180868 rounded to 7 dps? 0.0001809 Round -107613 to the nearest 100. -107600 What is 2713432 rounded to the nearest one thousand? 2713000 What is 0.1006289 rounded to three dps? 0.101 Round 1243.6 to the nearest ten. 1240 Round -0.01306416 to 5 dps. -0.01306 What is -184.78 rounded to the nearest 10000? 0 What is 0.020150603 rounded to 4 dps? 0.0202 What is 0.000246973 rounded to six decimal places? 0.000247 What is -428765.8 rounded to the nearest one hundred? -428800 Round -191.93 to zero dps. -192 Round -52.7408 to 1 decimal place. -52.7 Round -0.1385995 to two decimal places. -0.14 What is 0.1582759 rounded to three dps? 0.158 What is 4995.981 rounded to the nearest 100? 5000 What is -0.03733058 rounded to 2 decimal places? -0.04 What is -198035.9 rounded to the nearest ten thousand? -200000 Round -0.0007297457 to three dps. -0.001 Round -2909190 to the nearest ten thousand. -2910000 What is 570656 rounded to the nearest one hundred thousand? 600000 What is -850.6537 rounded to the nearest ten? -850 What is -7237589 rounded to the nearest ten thousand? -7240000 Round -5784470 to the nearest ten thousand. -5780000 What is 1629240 rounded to the nearest 100000? 1600000 Round 0.08579445 to 1 decimal place. 0.1 Round 1121.9857 to the nearest 100. 1100 What is 4068652.1 rounded to the nearest one hundred thousand? 4100000 What is 11137140 rounded to the nearest one hundred thousand? 11100000 What is -75182.1 rounded to the nearest one hundred? -75200 Round 1093.19 to the nearest one hundred. 1100 Round 15.60236 to 0 dps. 16 Round -18193800 to the nearest 1000000. -18000000 Round 239841 to the nearest one thousand. 240000 What is -0.000644259 rounded to five dps? -0.00064 What is -20144090 rounded to the nearest 100000? -20100000 What is 5210.903 rounded to the nearest 10? 5210 What is 29774.9 rounded to the nearest 100000? 0 Round -62520110 to the nearest 100000. -62500000 Round -0.0000146306 to 6 decimal places. -0.000015 What is -0.0000385155 rounded to 5 dps? -0.00004 Round -0.00000559476 to seven dps. -0.0000056 Round 0.00120485 to six dps. 0.001205 What is -4645.827 rounded to the nearest 1000? -5000 Round 14.190847 to 0 decimal places. 14 What is -0.4509096 rounded to one decimal place? -0.5 What is 360708 rounded to the nearest 100000? 400000 Round 108815000 to the nearest one hundred thousand. 108800000 What is -8.41787 rounded to zero dps? -8 Round -0.42389 to two decimal places. -0.42 What is -0.0000603637 rounded to 5 decimal places? -0.00006 What is -217790 rounded to the nearest 10000? -220000 Round -93.459556 to the nearest ten. -90 What is -68258.1 rounded to the nearest ten thousand? -70000 What is 0.00002903416 rounded to seven dps? 0.000029 Round -794.6337 to the nearest integer. -795 Round -29138.124 to the nearest 100. -29100 What is 0.8783822 rounded to one decimal place? 0.9 What is 5579.313 rounded to the nearest one hundred? 5600 Round 0.01279728 to three dps. 0.013 What is -49162.3 rounded to the nearest ten thousand? -50000 What is -0.0000005519552 rounded to seven decimal places? -0.0000006 What is -29156960 rounded to the nearest 100000? -29200000 Round -0.000362071 to six dps. -0.000362 Round -0.01104658 to 5 decimal places. -0.01105 What is -1921446 rounded to the nearest one hundred thousand? -1900000 What is 8161.248 rounded to the nearest ten? 8160 What is -0.00000022189267 rounded to 7 dps? -0.0000002 What is 0.000002741993 rounded to 6 dps? 0.000003 Round -0.0003887453 to five decimal places. -0.00039 What is 262738.9 rounded to the nearest ten thousand? 260000 What is -0.026707 rounded to four dps? -0.0267 What is -1.733871 rounded to 1 decimal place? -1.7 What is 1179198000 rounded to the nearest one million? 1179000000 Round -6.117368 to three decimal places. -6.117 Round 0.00001253458 to six dps. 0.000013 Round -2.896113 to three decimal places. -2.896 Round 540.9951 to the nearest one hundred. 500 Round 33.27285 to 2 dps. 33.27 Round 1853.2147 to one dp. 1853.2 What is -40.8566 rounded to the nearest integer? -41 What is 0.000017058903 rounded to seven dps? 0.0000171 Round 2348.754 to the nearest one thousand. 2000 Round -96.188 to zero decimal places. -96 Round 0.0000026753 to 6 decimal places. 0.000003 What is -5.930967 rounded to two dps? -5.93 Round 0.01589636 to three dps. 0.016 What is 0.647833 rounded to one decimal place? 0.6 Round -2124.59 to the nearest 1000. -2000 What is 0.005416772 rounded to three dps? 0.005 Round 0.000116737 to four decimal places. 0.0001 What is -8184.28 rounded to the nearest ten thousand? -10000 What is 1080161.51 rounded to the nearest 100000? 1100000 Round -4.91715 to the nearest 10. 0 What is 950242.5 rounded to the nearest ten thousand? 950000 What is 0.050781437 rounded to five dps? 0.05078 Round 0.00731076 to 5 dps. 0.00731 What is 12.2612 rounded to 1 dp? 12.3 What is -0.000000468791 rounded to 5 decimal places? 0 What is -113118460 rounded to the nearest one hundred thousand? -113100000 Round -0.0001281851 to six decimal places. -0.000128 What is 94603000 rounded to the nearest 1000000? 95000000 Round 3877018 to the nearest one million. 4000000 Round -8629812700 to the nearest one million. -8630000000 What is -1077967.95 rounded to the nearest 10000? -1080000 Round -0.000373133 to five dps. -0.00037 What is -162812580 rounded to the nearest 100000? -162800000 What is 2591.0841 rounded to the nearest 100? 2600 What is 0.00001341792 rounded to 5 decimal places? 0.00001 Round 0.0001188886 to five decimal places. 0.00012 What is 18057150 rounded to the nearest 1000000? 18000000 What is -236.7753 rounded to the nearest ten? -240 Round 0.0300508 to 3 dps. 0.03 Round 0.000074674143 to 5 decimal places. 0.00007 Round -1145.537 to the nearest integer. -1146 What is 0.0000056753845 rounded to 7 decimal places? 0.0000057 Round 0.0004010736 to 7 decimal places. 0.0004011 Round -732097 to the nearest one hundred thousand. -700000 What is -3.863044 rounded to one dp? -3.9 Round -0.000431062 to five decimal places. -0.00043	{ "pile_set_name": "DM Mathematics" }
? -4 What is the closest to 5 in 5, 4, -2, -0.4? 5 Which is the nearest to -28? (a) -3 (b) -0.2 (c) -1/3 (d) -1 a What is the closest to -2 in -5, 28/3, 0.4, 0.16? 0.16 What is the nearest to -6 in 0.2, 60, 0.8? 0.2 Which is the closest to -2? (a) -0.05 (b) -6/13 (c) -0.5 (d) -0.4 (e) -0.12 c Which is the closest to -4.2? (a) 5/2 (b) -3/4 (c) -3829 (d) -5 (e) -3 d What is the nearest to -1 in -6, 0.4, 0.1, -58? 0.1 What is the closest to -0.1 in -3/37, 0.4, -4, -17, -1/5? -3/37 What is the closest to -2 in 45, -2/61, 1? -2/61 What is the nearest to -2 in -2/7, -0.2, 373438? -2/7 Which is the closest to -2? (a) 2/7 (b) -4/5 (c) 0.1 (d) -2559 (e) -2/17 b What is the closest to 0 in 23, -5, -0.5, -2/3, 3/53? 3/53 Which is the closest to -2/3? (a) 2/7 (b) 1/16 (c) 0.3 (d) 0.37 (e) -0.03 e Which is the closest to 2/5? (a) -123 (b) -3 (c) -1/2 (d) -22 (e) 1/8 e Which is the closest to -1/4? (a) -4 (b) -164 (c) -0.11 c Which is the closest to -0.1? (a) 306/7 (b) -5 (c) -13/8 c What is the nearest to -0.01 in 18.1, -44, 0.3, -0.3? -0.3 What is the closest to 1 in 15, -3/7, 0.2, -2/7, 5? 0.2 Which is the closest to -5? (a) 5 (b) 0.0202 (c) -1/3 c Which is the closest to 12/11? (a) -774/7 (b) 2 (c) -2 b Which is the nearest to 0.2? (a) -1/6 (b) -2181 (c) -1/8 (d) 4 c Which is the nearest to 8/3? (a) 1/3 (b) 0.4 (c) -359/7 b What is the nearest to -3 in -0.015, 0, -0.2, -0.1? -0.2 What is the closest to -2/5 in 3/19, -787.3, 4? 3/19 What is the closest to 25/14 in -2/31, 2/13, -0.1? 2/13 Which is the nearest to 2/7? (a) 2 (b) -0.0181 (c) 4 (d) -3 b What is the closest to 8/5 in 29, -0.2, 2/5, -5, -1/6? 2/5 What is the closest to -3/11 in -4/5, 33, 3/2? -4/5 What is the closest to -0.1 in 4, -2/3, -50, 0.3, -461? 0.3 What is the closest to -0.3 in -1/8, -0.5, 69, -47? -1/8 Which is the nearest to 34/7? (a) -10 (b) 0.1 (c) 1/3 (d) 1/235 (e) 3/4 e Which is the closest to 1? (a) -3/7 (b) 128 (c) -2/19 (d) -2 (e) 3/8 e Which is the closest to 1/2? (a) 0.1 (b) -1 (c) 0.3572 c What is the closest to -0.1 in -1, 0.1, -2, -2/7, -5? -2/7 What is the nearest to -1/4 in 2, 7, -4/3, 7/57, -1? 7/57 Which is the closest to -0.2? (a) -1/2 (b) 22 (c) 0 (d) 2.75 c What is the closest to 57 in 0.2, 0.9, -4? 0.9 What is the closest to -1/5 in -117/5, 13, 22? 13 What is the closest to 1.3 in -5, 0.29, 215, -0.3? 0.29 What is the closest to 30/43 in -3/2, -4, -0.1? -0.1 What is the closest to -2/133 in -2, 2, -1/2, 0? 0 Which is the nearest to 2? (a) 0.9 (b) -0.3 (c) 1/93 (d) -0.054 (e) -1/3 a What is the nearest to -3 in 0, 7.3, -0.1, -9? -0.1 What is the nearest to 5 in -2, 0.5, -276? 0.5 What is the nearest to -0.1 in 3206, 0.3, 0.5? 0.3 What is the closest to 2 in -0.5, -1.8, -69, -0.4, 1/8? 1/8 What is the nearest to -0.1 in 3/2, 1/4, 7, -157? 1/4 What is the closest to -2/9 in -2/13, -1/3, -11, 0? -2/13 What is the closest to 2/5 in 5, 0, 78, 9.5? 0 Which is the nearest to 0.2? (a) -1/7 (b) -4 (c) -336 (d) 115 a Which is the nearest to 0? (a) -3/4 (b) 219 (c) 3 (d) -2 a What is the closest to -13 in -118, 1/2, -2? -2 What is the nearest to -1/4 in -28101, -2, 4? -2 Which is the closest to -4? (a) 0.5 (b) 2 (c) -3 (d) -0.79 (e) -488 c Which is the closest to -19? (a) 0.06 (b) -3/14 (c) -1 c Which is the nearest to 1/3? (a) 1/3 (b) -2727 (c) 0.1 (d) -0.1 a What is the nearest to 0 in 6, -0.367, 21/8? -0.367 Which is the closest to -0.1? (a) 7 (b) -2/9 (c) 0.4 (d) 0.033 b What is the closest to 0.2 in -0.3, -1/3, -1, -3/2? -0.3 Which is the closest to 20? (a) 5/2 (b) 3 (c) -2 b Which is the closest to -1? (a) 27 (b) -0.03 (c) 19 b Which is the nearest to 0? (a) 8 (b) -42 (c) 1/9 (d) -3.03 c What is the nearest to 2/5 in -2/31, 19, -0.04? -0.04 What is the nearest to -3 in 4.12, -179, -4? -4 What is the nearest to 115 in -8, 3, 6/7, 1? 3 What is the nearest to 0.1 in 3/5, -148, -4? 3/5 Which is the closest to -0.24? (a) 5 (b) 0.01 (c) 2/5 (d) 12 b What is the closest to -3.37 in -7, -4, 98? -4 Which is the nearest to -1/79? (a) 3/7 (b) -0.3 (c) 0.3 (d) 0 (e) 82 d What is the closest to -1/2 in 2/13, -1.38, -0.2, 7, 3? -0.2 Which is the nearest to 2/9? (a) -4 (b) 5/9 (c) 0.15 (d) 2/5 c What is the closest to -0.32 in 17, -2.1, -0.5, -1? -0.5 Which is the closest to -2? (a) -3/38 (b) 3 (c) 2/5 (d) 0.1 a What is the closest to -10 in 197, 1, 3, 5/2? 1 Which is the closest to -34? (a) -2 (b) 0.2 (c) -6 c What is the nearest to 16 in 3/4, -988.7, 2/7? 3/4 What is the closest to 2 in 15/41, 0, 6, -2/9? 15/41 Which is the nearest to 1/227? (a) 1/16 (b) 0.05 (c) 2/3 b Which is the nearest to -1? (a) 3/3254 (b) 0 (c) 1 b Which is the nearest to 1? (a) -1/2 (b) 428 (c) -2 (d) 5 a What is the closest to 1/5 in 1827, 2/15, -2/13, 0.5? 2/15 Which is the closest to -24? (a) 2 (b) -0.4 (c) -31/5 (d) 1 c What is the nearest to 1 in -1/12, -6/7, 1, -5/6? 1 Which is the closest to 0? (a) -8 (b) 0 (c) -2 (d) -0.1 (e) -1 b Which is the nearest to 0? (a) 0 (b) -1/3 (c) -16816 (d) 1/6 a Which is the closest to -1? (a) 1/6 (b) 2 (c) 11 (d) 1318 a What is the nearest to -1 in 2/9, 0.4, -0.34? -0.34 What is the closest to 22.9 in -4, 5, -3, 0.5, -1/2? 5 What is the closest to -1/4 in 3, 8/7, 1, 4.1? 1 Which is the nearest to 2/5? (a) -57 (b) -0.14 (c) -4 b Which is the nearest to 22? (a) 6/5 (b) 1 (c) -43 a What is the closest to 2/5 in -4658, 0.22, -4? 0.22 What is the nearest to -0.2 in 20, -2/11, 3, -2/415, -5? -2/11 What is the nearest to -144 in 2, -0.03, -0.4? -0.4 Which is the nearest to -32? (a) -163 (b) 3 (c) 2/7 c What is the closest to -1730257 in 2/3, 1/7, -3? -3 Which is the nearest to 2248? (a) 0.02 (b) 0.1 (c) 25 c Which is the nearest to 4/7? (a) -3 (b) -1 (c) 108698 b What is the nearest to 4/217 in 4, -4, 8? 4 Which is the closest to -3/2? (a) 1 (b) -2/7 (c) 6 (d) 0.06 b What is the nearest to -0.15468 in 2/19, -1, -5? 2/19 What is the nearest to 0 in -3, -173, -0.052, 13? -0.052 What is the nearest to 0.1 in -2/9, 6, 139, 2/3, 2/5? 2/5 Which is the nearest to 3/4? (a) -227 (b) -2/13 (c) 0.26 (d) -1 (e) 0.4 e What is the closest to -17/2 in -0.1, -1/7, -0.9, -2? -2 What is the nearest to 1/5 in 4, -3, -2/19, -2? -2/19 Which is the nearest to 0.1? (a) 1.79 (b) -7 (c) -1 c What is the closest to 1155671 in -0.3, -0.1, 1/2? 1/2 Which is the nearest to -0.3? (a) 4/5 (b) -0.7 (c) 6 b What is the nearest to 1/406 in 21, -0.5, -2/19, -0.2? -2/19 Which is the nearest to 2.6? (a) 74 (b) -0.1 (c) -6 b Which is the nearest to 2/5? (a) 12/5 (b) -0.4 (c) 0.2 (d) -0.356 c What is the nearest to -0.2 in 0.3, 1/3, -1, 116? 0.3 What is the closest to 0 in 1/5, 15/37, -0.4, 2/7? 1/5 Which is the nearest to -0.1? (a) 1/2 (b) 1/8 (c) 5.5 (d) -16 (e) -11 b Which is the nearest to 7? (a) 4 (b) -1/6 (c) 2 (d) 13/6 (e) 36 a What is the closest to 0.1 in 0.03, 239, -1/6? 0.03 What is the closest to 0 in -3, -268, -0.48, -2/7, 0.3? -2/7 What is the nearest to -1/17 in 4, 3, 1/6, -676/5? 1/6 Which is the closest to 1424.8? (a) 4 (b) -8 (c) -5 a Which is the nearest to 0.1? (a) 386 (b) 0.09 (c) -1/4 (d) -2/7 b Which is the nearest to -1? (a) -8/7 (b) -4 (c) -3 (d) 8 (e) 36 a Which is the closest to -0.1? (a) -1/8 (b) -39/7 (c) -0.4 (d) -3 a Which is the closest to -2? (a) 3/16 (b) -4 (c) -3 (d) 5 c Which is the closest to -13? (a) 58 (b) 14 (c) -3/2 c Which is the closest to -1/6? (a) 0.5 (b) 3/8 (c) -0.3 (d) 345 (e) -2/11 e What is the nearest to -7 in -3/4, -2/17, 278, 347? -3/4 Which is the nearest to -2/3? (a) -0.4 (b) -59/5 (c) 4820 (d) -1 a What is the closest to -36 in -1/3, -4, 2/15, -0.139? -4 Which is the nearest to 2/21? (a) -1/2 (b) -0.3 (c) -62 (d) -5.4 (e) -1 b Which is the closest to -9? (a) -162 (b) -2/9 (c) 0 (d) -0.3 (e) 3 d Which is the nearest to -240.7? (a) 1 (b) -2 (c) -3/4 (d) -2/9 (e) 5/3 b What is the closest to -658 in 1/4, -4, 3/2? -4 What is the closest to -0.05 in -3, -1/2, 3, 2/9, -0.3? -0.3 Which is the closest to -2? (a) -101 (b) 1/7 (c) 0.03 (d) 5.4 c Which is the closest to -7.06? (a) -0.3 (b) -4 (c) 0.5 (d) 2 b Which	{ "pile_set_name": "DM Mathematics" }
- 7 = -3f - 27 - 5 for i. -5 Solve -2b = -16, -13c - 17 = -3b - 23 - 35 for c. 5 Solve 4w = -5r + 41, 5r + 175w - 177w - 37 - 10 = 0 for r. 9 Solve -10l - 102 = -o - 30l, 5o - 140 = 3l - 42 for o. 22 Solve 28 = 2j + r + 222, -2r - 6798 = -6798 for j. -97 Solve 15 = 5b, -6y + 48 = -10b + 12b for y. 7 Solve -3u + 35 - 12 = -2c + 17, -2u + c = -1 for u. -4 Solve -3k = -n + k + 9, 4562n - 4561n - 1 = 2k for n. -7 Solve 41l - 3b - 1075 = 0, 5l - 142 = 1498b - 1494b for l. 26 Solve 9992u - 155 = -9986u + 19976u + 3r, -4u + 5r + 257 = 0 for u. -2 Solve -263526 = 4p - 4v - 263702, -25 = 5v for p. 39 Solve 6q - 9q + 348 = -18h, -4q + 84 = -4h for q. 2 Solve -8j = -2i + 72, -207i + 6 = -206i - 5j + 4j for i. -4 Solve -1028 - 1029 + 2077 = 4g + 4u, 18g = -4u + 5 + 1 for g. -1 Solve 4h = 1215a - 1216a - 61, 5a - 26 - 14 = 3h for a. -1 Solve -5q + 4n = -n - 40, 4q - 2267859n = -2267863n + 32 for q. 8 Solve -67x + 4p - 26 = -106x + 44x, -3p + 12 = 0 for x. -2 Solve y + 12 = -13, 442 + 3067 = -d - 176y - 892 for d. -1 Solve -1 = 2u - s + 49, 128 = -5u + 4s for u. -24 Solve -222y + 4t = -207y + 25, 2y - 22t - 14 = -18t for y. -3 Solve -x - 52 = -35u + 24u + 8u, 3x - 4u = -61 for x. 5 Solve 34 = f + 26h, -f = h - 88 + 79 for f. 8 Solve -35 = -2l + 7l - 3l - 3w, -2l - 5w = 59 for l. -22 Solve 14u = -7u + 4g + 97 - 187, -u + 58 = 5g for u. -2 Solve -2j + 6j - 4u = 28, -4u - 7008 + 3602 = 20j - 3618 for j. 10 Solve 37c + 2l = 5l - 123, -29c - 2l + 2 = -15c - 12c for c. -3 Solve 44 = -4y, 0 = -5s - 2y - 121773 + 121756 for s. 1 Solve 0 = 12x + 5m - 636 - 432, 7x - 623 = -m for x. 89 Solve 0 = -3k - 2j - 62, -36k + 0 = -37k + 5j - 32 for k. -22 Solve -275f - 24 - 2 = -272f - 2k, -6f - 70 = 5k for f. -10 Solve 3r + 6a - 272 = 8a, 0 = -20r + 24r - a - 2a - 363 for r. 90 Solve -5829o + 11 = -i - 5824o, 2i - 4o + 4 = 0 for i. 4 Solve 2a = 4r + 14 + 50, -33r + 15a - 13a = -9r + 384 for r. -16 Solve 0 = 3y - 6, 55a - 24y = 21a + 17a + 20a - 36 for a. -4 Solve -n - 485 = 5r - 5n - 476, -290n = 4r + 1180 for r. -5 Solve 5o - 3o = -5j + 2, 4o + 4o + 10 - 6 = -14j for o. -4 Solve -84v - 17p - 236 = -88v + 402, 11p = -5v - 428 for v. -2 Solve 4 = -2z - 28w, -5z + w + 2 + 2 = 14 for z. -2 Solve 47x + 32x = 75x + 3k - 16, 0 = -2x + 10k - 110 for x. 5 Solve 0 = 11y + 4m - 223, 18m + 103 = 3y + 21m + 46 for y. 21 Solve 3c = 5n - 0c + 71, 131c = -5n + 263c - 134c + 39 for n. -1 Solve -49h + 29h + 16 = 4q - 21h, h + 1 = -q for q. 3 Solve -4x = -423153l + 423155l - 48, 2l + 102 = 11x for l. 4 Solve 5q + 4988 = 4993, -k - 24 = 2k - 3q - 0q for k. -7 Solve -2c - 3a + 117312 - 117287 = 0, -3a = -4c - 49 for c. -4 Solve -3p + 28 + 25 + 30 - 56 = f, -f + 31 = 5p for p. 2 Solve -2x + 21o = 17o - 16 - 54, -4x - 42412o + 42411o + 158 = 0 for x. 39 Solve 658 - 559 = -4s - 5t, -5s = t - 0t + 24 for s. -1 Solve -6k + 16 = 2d, -3d - 5k + 12 - 9 = -4d - 13 for d. -1 Solve 218 - 96 = c + 5l, 4c - l + 16 = 0 for c. 2 Solve 3f + 12 = f + 5f - 4m, -7m - 43 = -2f - 3f - 8m for f. 8 Solve 3q + 11f + 83 = 0, -f = -2q + 7f + 13367 - 13315 for q. -2 Solve m = -t - 4, -272t + 264t + m = 68 for t. -8 Solve 7c - 2c - 186 - 562 = 68s, -5c + 5 - 54 = 4s - 5 for s. -11 Solve 2260c - 3012 - 12808 = 4t, 3c + c - c - 19 - 2 = -t for c. 7 Solve -7a + 287 = -56w, a - 8a + w - 142 = -10a + 6w for a. 49 Solve -5g = r - 14, -243 = -r + 3r - 50g - 273 + 302 for r. -11 Solve -72 = -3n - 3p, 301990p - 301991p = 56n - 1509 for n. 27 Solve 3f + 551633 = -3s + 551612, -16f + 35 = -5s for s. -7 Solve 27c + 5v - 4v + 115 = 0, 4c - 69v = -71v - 30 for c. -4 Solve 11317u - t = 11319u + 10, 5t + 77 = -u for u. 3 Solve -4g + z - 72 = -48, 2g = -9z - 50 for g. -7 Solve -3124u + 3128u - 4a = 232, -a - 111 = -2u for u. 53 Solve 980 = -35i, 0 = -42x + 83x - 40x - 7i + 4i - 81 for x. -3 Solve -l + 2120y = 2122y + 5, -3y = -l + 20 for l. 5 Solve -8 = 4p - 2p - 158y + 166y - 74, -4y + 19 = 3 for p. 17 Solve -407t + 2788m + 822 = 2784m, 12 = 5t - m for t. 2 Solve 18l - 180 = -3o, -3o - 5l - 1251 + 1392 = 0 for o. 42 Solve 98l + 3i = 383, 1326 = -5l - 2i + 1340 for l. 4 Solve -2c = -4s + 8, -28019s - 13 = 9c - 28014s for c. -2 Solve 2s = 5c, 58s + c - 3 - 11 = 55s + 3 for s. 5 Solve 0 = -13j + 4742h - 4739h - 31, 73 = j - 11h for j. -4 Solve 62i - 21i - 396 = -6a + 55, -i + 55 = 4i + 2a for i. 11 Solve 4w + 4f = -28, -80w + 2817f - 479 = 2816f for w. -6 Solve 39 - 15 = -3q, 62q - 66q = 4y + 16 for y. 4 Solve -382390x - 2v = -382391x - 9, 5x = 3v - 24 for x. -3 Solve 2a - 58 = -5q, -4q + 18 + 15 = 4a - 11 for a. -1 Solve g = h - 0g - 19, 0 = 9h + 3g - 54 - 76 - 17 for h. 17 Solve 4j + 2y = -j - 47 + 17, j + 75 = -9j - y for j. -8 Solve -4f + 100 = -6j, 7210f - 3j = 7213f + 60 for f. -2 Solve 0i + 7l - 12 = i, -l - 441 = 4i - 538 for i. 23 Solve 2184h = 2b + 2179h - 19, 4b = 13h + 47 for b. 2 Solve -5 = 4b - 2m + 1, 61425m = -4b + 61421m + 24 for b. 1 Solve 44 = 3n + 173, -2x - 3n - 24 - 109 = -x for x. -4 Solve 5c - 2815 = 179j - 1015, j - 5j + 16c - 48 = 12c for j. -10 Solve -565x + 2c - 21 = -566x, -2x + 3c = -56 for x. 25 Solve -4v + 5918 - 5854 = 11b, -5b = -3v - 5 for b. 4 Solve -282p = 5g - 276p - 147 + 136, -2g + 8p - 58 = 0 for g. -5 Solve -63u + 3h = 93, 3h = 2121u - 2116u + 151 for u. 1 Solve 4v - 2 = -c - 4, 3c - 11v = 39 + 1 for c. 6 Solve -5g - d + 54 = 0, -2d - 7d = -5g - 12d + 62 for g. 10 Solve 14m - 5a + 37 = 0, 69078a = 2m + 69073a + 1 for m. -3 Solve 6r = -11x + 103, 5r - 64x + 59x - 100 = 0 for r. 19 Solve -15b - 4l = -10b + 103, -4b + 3l = 4l + 89 for b. -23 Solve 4r - 3r = -u + 1, -1210r + 9u = -1209r + 9 for r. 0 Solve -59403t - 2v = -59398t - 4v + 94, 0 = -v + 2 for t. -18 Solve -5i - h - 120 = 0, -11i - h + 1150 = 1414 for i. -24 Solve v + 138d - 137d + 1 = 0, -58d = -v - 278d - 1 for v. -1 Solve -79 - 11 = -2i - 3y + y, -4i - 57y - 22 = 10 for i. 49 Solve -26j + 5w = 349, -223 = 2j - w - 198 for j. -14 Solve 0 = 6r - u - 1 + 16, 6893u + 3 = 6894u for r. -2 Solve 47s - 3253 + 3394 = 5n, -4n - 12 = 4s for s. -3 Solve -18 = 3d + 4s, 0 = -289d - 4s - 20643 + 18909 for d. -6 Solve 5p + 121 = -45a + 41a - 34, 3p + 165 = -4a for p. 5 Solve -l + 2q = 35, -75 = 7985l - 7980l - 5q for l. 5 Solve -14943a - 14 = -14943a + d, 0 = -11a - 4d - 12 for a. 4 Solve 3m = -5a + 76, -19a + 10124m - 10126m + 82 = 0 for a. 2 Solve 0 = m + 21s - 313, -m - 2s = -4s - 1171 + 1203 for m. -2 Solve -3219b = -3217b - 2a + 22, 4b + 2a - 4 = 0 for b. -3 Solve -k = -4d - 6 - 16, -329k + 228d = 223d + 628 for k. -2 Solve -867 = 157l + 5b + 551, 5l - 3b + 203 = 161 for l. -9 Solve 2g - 10 = -3j, 6 = 43008j - 43007j + g for j. -2 Solve 2i - 16 = 319602g - 319604g, 0 = -2g + 3i + 6 for g. 6 Solve 69m + 63u - 48u = 64m + 115, u + 7 = m for m. 11 Solve -4 + 3 = g - 0, -11g = -y + 5g + 12 for y. -4 Solve 4c + 147s + 142s + 148s - 429s + 16 = 0, -s + 3 + 2 = 4c for c. 2 Solve 3u - 52m = 52, -215 = -u - 5m - 220 for u. 0 Solve -5a + 40 = -10s, 0 = a + 6686s - 6687s - 7 for a. 6 Solve -160 = -3c + 4l, 8c - 4975l + 4973l - 470 = 0 for c. 60 Solve -8c = -20c, -8069h + 5c + 48 = -8066h for h. 16 Solve -3899k + 2l = -3869k + 72, k = -5l + 5 - 53 for k. -3 Solve 270o - 229o = 5n + 160, -24o = -23o + 4n - 41 for o. 5 Solve -33x = -4v + 24, 54v - 18v = -2x + 13v + 11v + 10v + 12 for x. 0 Solve -f + 2q = -2f, -4f = -2036q + 2041q - 12 for f. 8 Solve w + 2r = 69, 1016w - 1013w - 251 = 5r for w. 77 Solve 746o - 742o - 5w + 53 = 0, 5o + w + w = 41 for o. 3 Solve 3n + 2s = -146, -2276s + 2281s + 204 = -4n for n. -46 Solve 215o - 4y = 217o + 4, 16 = -o + 5y for o. -6 Solve 283526k - 37 = 283527k + 3v, 0 = k - 13v + 53 for k. -40 Solve 4g - 35 = p, 0 = 407g - 206g - 200g - 59p + 176p + 1281 for g. 6 Solve m + 46	{ "pile_set_name": "DM Mathematics" }
rm of -636, -1445, -2382, -3447? -64c2 - 617c + 45 What is the f'th term of 35744, 64023, 92302, 120581, 148860? 28279f + 7465 What is the c'th term of 320346, 639580, 958814, 1278048, 1597282, 1916516? 319234c + 1112 What is the q'th term of -17216, -18926, -20636, -22346, -24056? -1710q - 15506 What is the y'th term of 656171, 1312273, 1968375, 2624477, 3280579? 656102y + 69 What is the b'th term of 26212, 106064, 241438, 434206, 686240, 999412? 312b3 + 25889b*2 + b + 10 What is the i'th term of 11523, -7263, -38573, -82407, -138765? -6262i*2 + 17785 What is the w'th term of -38806, -38207, -37608, -37009? 599w - 39405 What is the k'th term of -838, -2729, -5888, -10315? -634k2 + 11k - 215 What is the l'th term of 15615, 29892, 44191, 58512, 72855? 11l2 + 14244l + 1360 What is the s'th term of 118048088, 236096174, 354144260, 472192346, 590240432? 118048086s + 2 What is the v'th term of 6160, 12278, 18406, 24550, 30716, 36910, 43138, 49406? v3 - v2 + 6114v + 46 What is the w'th term of -5027, -3651, -2283, -923, 429, 1773? -4w2 + 1388w - 6411 What is the v'th term of 26632882, 26632880, 26632878, 26632876, 26632874? -2v + 26632884 What is the a'th term of -8408, -6834, -5260? 1574a - 9982 What is the t'th term of 1058, 468, -122, -712? -590t + 1648 What is the d'th term of 18018579, 36037157, 54055735, 72074313? 18018578d + 1 What is the a'th term of 365, 1259, 2353, 3323, 3845? -54a3 + 424a*2 - 5 What is the z'th term of -157336, -154850, -152364, -149878? 2486z - 159822 What is the x'th term of -70538, -139526, -208510, -277490, -346466, -415438, -484406? 2x2 - 68994x - 1546 What is the q'th term of 8362, 34113, 77250, 137773, 215682, 310977? 8693q2 - 328q - 3 What is the p'th term of 10327, 18974, 27619, 36262? -p*2 + 8650p + 1678 What is the y'th term of 37145741, 37145742, 37145743, 37145744, 37145745, 37145746? y + 37145740 What is the h'th term of 173257, 692886, 1558943, 2771434, 4330365? h*3 + 173208h*2 - 2h + 50 What is the w'th term of 16473, 16480, 16481, 16476? -3w2 + 16w + 16460 What is the f'th term of 9003, 10637, 13361, 17175, 22079, 28073? 545f2 - f + 8459 What is the p'th term of 141, 715, 2107, 4689, 8833, 14911, 23295, 34357? 62p*3 + 37p*2 + 29p + 13 What is the a'th term of 32843, 130449, 292819, 519953, 811851, 1168513? 32382a2 + 460a + 1 What is the s'th term of -1301675, -1301659, -1301639, -1301621, -1301611, -1301615? -s*3 + 8s*2 - s - 1301681 What is the q'th term of -769, 203, 2719, 7511, 15311, 26851, 42863, 64079? 122q*3 + 40q*2 - 2q - 929 What is the k'th term of 1087993, 1087932, 1087831, 1087690, 1087509? -20k2 - k + 1088014 What is the s'th term of -446, -948, -1486, -2072, -2718, -3436, -4238? -2s*3 - 6s*2 - 470s + 32 What is the h'th term of 41092, 82264, 123514, 164842, 206248, 247732, 289294? 39h2 + 41055h - 2 What is the o'th term of -10299, -10170, -9955, -9654? 43o2 - 10342 What is the n'th term of 3314, 5644, 7950, 10220, 12442, 14604? -2n*3 + 2344n + 972 What is the p'th term of -259461, -251791, -244121? 7670p - 267131 What is the v'th term of 2800, 10837, 24248, 43045, 67240? 2v*3 + 2675v*2 - 2v + 125 What is the u'th term of 21053, 20849, 20645, 20441? -204u + 21257 What is the u'th term of 176889, 176810, 176731? -79u + 176968 What is the d'th term of 303933, 607867, 911801, 1215735? 303934d - 1 What is the o'th term of 842, 1628, 2332, 2918, 3350, 3592? -6o*3 - 5o*2 + 843o + 10 What is the m'th term of 9434, 9079, 8724, 8369? -355m + 9789 What is the p'th term of -2646282, -5292542, -7938802? -2646260p - 22 What is the l'th term of -54242, -53594, -52514, -51002, -49058, -46682, -43874? 216l2 - 54458 What is the u'th term of 211737, 423461, 635185, 846909, 1058633? 211724u + 13 What is the n'th term of -152, -325, -550, -851, -1252, -1777? -4n3 - 2n*2 - 139n - 7 What is the u'th term of 9174722, 9174723, 9174724? u + 9174721 What is the x'th term of 530712900, 1061425799, 1592138698, 2122851597, 2653564496? 530712899x + 1 What is the w'th term of 106180, 849416, 2866762, 6795268, 13271984, 22933960, 36418246? 106175w*3 + 5w*2 - 4w + 4 What is the f'th term of -141886, -291630, -441374, -591118, -740862, -890606? -149744f + 7858 What is the v'th term of 2136, 11472, 27082, 48966, 77124, 111556? 3137v*2 - 75v - 926 What is the o'th term of -708, -904, -34, 2436, 7040? 89o3 - o2 - 816o + 20 What is the v'th term of 108847, 217418, 325989, 434560, 543131? 108571v + 276 What is the b'th term of 1442, 3365, 6488, 10811, 16334, 23057? 600b*2 + 123b + 719 What is the h'th term of -1064065, -1064170, -1064347, -1064596? -36h2 + 3h - 1064032 What is the j'th term of 208072, 208185, 208298, 208411, 208524, 208637? 113j + 207959 What is the r'th term of -234527, -938699, -2112327, -3755417, -5867975, -8450007? -r3 - 234722r*2 + r + 195 What is the z'th term of 117, 137, 281, 609, 1181, 2057, 3297? 10z*3 + 2z*2 - 56z + 161 What is the v'th term of 44303, 178236, 401797, 714986? 44814v2 - 509v - 2 What is the j'th term of 81502, 164801, 248100, 331399, 414698? 83299j - 1797 What is the x'th term of -10673, -10308, -9943? 365x - 11038 What is the v'th term of -14689, -30392, -46091, -61786, -77477, -93164? 2v2 - 15709v + 1018 What is the j'th term of -762, -701, -586, -405, -146, 203? 2j3 + 15j*2 + 2j - 781 What is the q'th term of -8435, -7758, -7081, -6404, -5727? 677q - 9112 What is the q'th term of 107100, 214203, 321306? 107103q - 3 What is the z'th term of 3034, 3372, 4222, 5590, 7482, 9904, 12862, 16362? z*3 + 250z*2 - 419z + 3202 What is the g'th term of -51883041, -51883045, -51883051, -51883059, -51883069? -g*2 - g - 51883039 What is the z'th term of 327573, 327512, 327451? -61z + 327634 What is the s'th term of 423, 4492, 15847, 38136, 75007, 130108, 207087, 309592? 608s3 - 5s*2 - 172s - 8 What is the p'th term of -3262, -8031, -14314, -22111, -31422, -42247, -54586? -757p2 - 2498p - 7 What is the n'th term of -21814, -19789, -16414, -11689, -5614? 675n2 - 22489 What is the h'th term of -3619, -7129, -10421, -13387, -15919, -17909, -19249, -19831? 18h3 + h2 - 3639h + 1 What is the z'th term of -5784, -11853, -18210, -24855, -31788, -39009? -144z*2 - 5637z - 3 What is the u'th term of -4163287, -4163094, -4162889, -4162666, -4162419, -4162142, -4161829? u*3 + 186u - 4163474 What is the w'th term of -118143, -239547, -360951? -121404w + 3261 What is the u'th term of -3956, -7299, -10642? -3343u - 613 What is the g'th term of -177850, -177570, -177102, -176446, -175602? 94g2 - 2g - 177942 What is the a'th term of -751, -1578, -2541, -3652, -4923? -2a3 - 56a*2 - 645a - 48 What is the o'th term of -4073, -31109, -104479, -247349, -482885, -834253, -1324619, -1977149? -3861o3 - o2 - 6o - 205 What is the a'th term of -29584, -59224, -87940, -115270, -140752, -163924, -184324, -201490? 77a3 - 30179a + 518 What is the j'th term of -32933355, -32933348, -32933335, -32933316, -32933291, -32933260, -32933223? 3j2 - 2j - 32933356 What is the l'th term of 1820812, 1820816, 1820822, 1820830, 1820840, 1820852, 1820866? l*2 + l + 1820810 What is the n'th term of 798, 1413, 2022, 2625, 3222? -3n*2 + 624n + 177 What is the w'th term of -4017031, -4016925, -4016819, -4016713? 106w - 4017137 What is the s'th term of 36355485, 36355486, 36355487, 36355488, 36355489? s + 36355484 What is the w'th term of -240119, -240058, -239993, -239924, -239851, -239774? 2w*2 + 55w - 240176 What is the g'th term of 195064377, 195064379, 195064381? 2g + 195064375 What is the y'th term of -773875, -1547625, -2321375? -773750y - 125 What is the g'th term of 3820811, 3820815, 3820819, 3820823? 4g + 3820807 What is the d'th term of -1118790, -1118793, -1118796? -3d - 1118787 What is the g'th term of -26398, -209295, -705738, -1672501, -3266358, -5644083, -8962450? -26129g3 + g2 + 3g - 273 What is the w'th term of -4673, -18806, -42331, -75242, -117533, -169198, -230231, -300626? w*3 - 4702w*2 - 34w + 62 What is the t'th term of 3435, 4479, 6205, 8601, 11655? -2t3 + 353t**2 - t +	{ "pile_set_name": "DM Mathematics" }
+ oh4 and give o. 1 Express -7z*2 - 3 + 34z - 7z2 - 31z*2 - 34z as iz2 + l + dz and give i. -45 Rearrange -14b2 - 1 + 0 + 4 to the form z + db + lb2 and give l. -14 Rearrange (184m - 207m + 1414m)(0 + 5m*2 + 0) to the form km*3 + sm*2 + x + bm and give k. 6955 Rearrange (1 - 2c - 1)((1 - 4 + 5)(3 - 4 + 3) - 2 + 3 + 1 - 3 - 8 + 18 - 3 - 6 + 5)(13 - 7 + 9) + 2c - 2 + 2 to a + yc and give y. -268 Rearrange 0w3 + 7767w*2 - 4w*3 - 7760w2 + w3 to xw + p + iw*3 + fw*2 and give f. 7 Rearrange -339m + 1880 - 1880 to the form qm + o and give q. -339 Express 31x*2 - 5x*2 - 28x*2 + 188 - 3x*2 + 2x*2 + 2x*2 + (-2x + 3x + x)(1 - 2x - 1) as yx + lx2 + b and give l. -5 Express 10236i*4 + 3i*3 - 6i + 3i2 + 26i - 10238i4 as vi*4 + w + ki + ai3 + gi*2 and give g. 3 Express 7b*2 + 37b*2 + 15b*2 + 19b*2 as tb*2 + rb + w and give t. 78 Rearrange 301w + 302w + 3w - 135w + 107w to the form kw + v and give k. 578 Express -2 + 2 + 2q3 + (0q*2 - 2q + q + 2q2)(4 + 0 + 5)(-9q - 4q - 4q) as aq3 + sq + h + rq2 and give r. 153 Express (-12z + 2z + 9z)(3z*2 - 6z2 + z2)(-8z - 6z - 3z) as g + dz3 + xz + hz2 + sz*4 and give s. -34 Express -3 + 3 - 99j*2 - 56j*2 in the form z + uj + hj2 and give h. -155 Express 56m + 2 + 54m - 87m in the form km + d and give k. 23 Rearrange -3 + 34t + 24 - 14t - 19t + 10 to the form w + mt and give w. 31 Rearrange (-1 + 1 + 4t)(-5 - 13 - 1)(2 + 1 - 1) to p + it and give i. -152 Rearrange 7o*2 - 331o + 337o - 10o*2 + 10 to v + go*2 + so and give s. 6 Express 97u3 + 1 - 424u3 - u2 - 27u3 in the form fu*2 + su*3 + pu + v and give s. -354 Rearrange -36c2 - 48 + 2c*4 - 3c*3 + 36c*2 - 5c*3 + 49 to the form pc*2 + dc*3 + y + bc*4 + mc and give b. 2 Express (0i + 4i - i)((-2 + 0 - 2)(0 - 2 + 3) - 2 + 3 + 1) in the form li + z and give l. -6 Express -5y*2 + 2y*4 - 4y*4 + 53y*3 + 3y*2 - 55y*3 - 3y + 14 in the form k + iy + uy*3 + by*4 + wy2 and give w. -2 Rearrange z2 - 588 - 15z + 6z + 4z + 5z to jz2 + c + tz and give j. 1 Rearrange 0a + 1 + 119a*4 - a - 112a*4 to wa*2 + oa + ia4 + u + qa*3 and give i. 7 Rearrange -13j*4 + 23j*4 - 31j + 3j3 + 31j + 2j2 - 1 - 24j*4 to the form bj + kj4 + hj*3 + s + tj*2 and give s. -1 Rearrange (0y + 2y + 0y)(-1 - y + 1 + (3 + 12 - 2)(-2y + y + 4y)) to g + xy + vy*2 and give v. 76 Express 2h - 49h3 - 4 - 3 + 52h*3 + 0h - h - 2h2 as sh*2 + nh*3 + ph + u and give u. -7 Rearrange 255t + 266t - 460t + 2 to qt + v and give v. 2 Express -249 + 129 + 120 + 683i in the form c + ai and give c. 0 Express 0c3 + 3c*3 + 12c - 16c + (5c - 9c + 3c)(39c + 9c2 - 39c) as l + bc3 + kc*2 + fc and give f. -4 Rearrange (-21v + v - 116v)(-3 + 2 + 0) + 6 - 6 + v to hv + x and give h. 137 Express -37y4 - 2 + 3y*2 + 5y + 41y4 - 2y*2 + 2y as fy3 + qy*4 + g + ly*2 + ty and give g. -2 Rearrange -3 + 2p2 + p2 + 0p*2 + (3p - 4p + 0p)(-11p + 18p + 12p) + 3 - 2p2 - 3 to the form yp*2 + ap + s and give y. -18 Express 304r + 48r - 9r + 841r + 3r in the form ur + x and give x. 0 Express 29o + 13 - 4 - 9 - 10o - 10 in the form n + bo and give n. -10 Express -k2 + 0k*2 + 3k*2 + (-6k + 3k + 2k)(2 - 2 - 2k) - 6k2 + k2 + 2k*2 - 8k*2 - 15k2 - k2 in the form mk + xk*2 + d and give x. -23 Rearrange 67c - 123 - 211c + 123 to the form a + oc and give o. -144 Express 2y + 149 + 8 + 141 - 42 in the form f + ty and give t. 2 Express 1098y4 - 1099y4 + 14 - 6 - y + y3 + y*2 in the form gy*2 + dy*4 + by + m + ry3 and give b. -1 Express -2u*3 - 20u - 26u + 2u*4 + 6u*2 - 48u*2 + 45u as vu4 + cu + f + wu3 + ku*2 and give k. -42 Rearrange 42v*2 - 17v*2 - 8 + 9 + (2v*2 - 2v + 2v)(4 - 4 + 3 - 1 + 1 + 2 + (0 + 2 - 3)(-4 + 0 + 2)) to the form u + dv*2 + lv and give d. 39 Rearrange 3j4 - 890j*3 + 889j*3 + 51j + j*2 - 8j*4 to q + xj*3 + aj*2 + zj*4 + mj and give x. -1 Express (1 + 3 + 0)(-38 + 38 - 7y)(2 + 0 + 0)(-1 - 3 + 5)(-2y + 0y + y) as wy*2 + py + n and give w. 56 Rearrange -432401g + 432256g + 0g2 - 3g*2 to k + jg*2 + dg and give d. -145 Express (-200c + 25c - 56c)((0 - 2 + 1)(-3 + 0 + 1) - 3 + 2 + 3 + 4 + 3 - 5 + 1 - 1 + 1) in the form p + oc and give o. -1617 Express -27j4 + j + 17j*4 + 2j*2 + 17j4 + 0 + j3 + 0j2 + 1 as kj*3 + dj + lj4 + fj*2 + s and give d. 1 Express -193n*3 - 1 - 76n + 76n as on*2 + wn + i + un3 and give i. -1 Rearrange (2n - 6n - 4n)(318n*3 + 114n*3 - 237n*3) to the form pn*4 + qn*3 + k + fn*2 + sn and give p. -1560 Express -m - 5m + 0m + (6 + 0 - 4)(4m + m - 3m) + (11 + 10 - 8)(4m - 2m + 0m) - 2m - 3m + 2m in the form tm + f and give t. 21 Rearrange -3y + 3y + 5y*4 + (-26y*3 - 26 + 26)(-3y - 3 + 3) to the form ny + q + wy2 + dy*3 + ly4 and give l. 83 Express o2 + o*3 - 4o + 0 + 0 - 6o4 - o + 6o - 1 as no + so*2 + qo*3 + po4 + w and give n. 1 Rearrange -d4 + d*4 + 2d4 + (-1 + 1 + d3)(-2d + 0 + 0) - 2d4 + 17d*4 + 42d*4 to l + hd*4 + fd + zd2 + pd3 and give h. 57 Rearrange p2 + 31 + 29 - 54 to the form zp + jp*2 + x and give x. 6 Rearrange (2g + g - g)(2 + 0 + 0) + 18 + 10g - 18 + ((3 - 5 - 3)(-3g - g + 2g) - g + 4g - 4g + 2g + 0g - g)(1 + 1 + 0) to j + rg and give r. 34 Express (-16q*2 + 16q*2 - 6q*4)(-4 + 4 - 2) + (2q3 + q3 - q3)(854 - 54q - 854) in the form h + nq*4 + uq*2 + iq*3 + fq and give n. -96 Express 352h - 52347 + 52347 in the form o + sh and give s. 352 Rearrange (9p - 3 + 3)(-11 + p + 2p + 9) - 2p*2 + 0p*2 + 3p*2 to the form rp + l + hp2 and give r. -18 Rearrange 12l*4 - 5l*2 - 4 - 26l*4 + 0l*2 + 12l*4 + 3l*2 - 2l*3 - 2l to n + kl + gl*4 + jl*3 + xl*2 and give x. -2 Express n - n + 2n + (-85 + 85 + 6n)(0 + 1 - 13) as mn + s and give m. -70 Express 2 - 368j*3 - 2j - j4 + j2 - 4j + 363j*3 in the form qj + p + nj3 + rj*2 + aj*4 and give q. -6 Rearrange -3n*4 + 4n - 3n + n2 + 6n*4 + 1 to the form jn*3 + gn*2 + d + mn*4 + rn and give d. 1 Rearrange 717 - 11m - 1434 + 725 to wm + k and give k. 8 Express 15s - 31s - 317 + 20 + 17s in the form r + ds and give r. -297 Rearrange -6m - 28 + 13 + 12 - m3 + 7 to km + bm3 + gm*2 + z and give b. -1 Rearrange (-2v*2 - 1 + 1)(3 + 11 - 21)(3v + v - 3v)(-11 + 4 + 1) to dv2 + uv + iv3 + y and give i. -84 Rearrange 467v - 1431v + 469v + 2 + 471v to i + uv and give i. 2 Express (-3 + 2 + 2 + (-1 + 1 + 4)(1 + 0 - 6))(-2y + 2y - y) in the form n + sy and give s. 19 Rearrange 4p - 4p - p2 - 20p + 20p - 14p*2 + (-2p + 2p - 3p*2)(2 + 3 - 3) - 1 - p*2 + 1 to m + kp + ap2 and give a. -22 Express -5k - 6k - 9 - 9k - 3k as a + fk and give f. -23 Express (3 - 1 + 0)((-1 - o + 1)(-o + o - 2o) + 20 - 20 + 40o*2) in the form vo + zo2 + c and give z. 84 Rearrange (61 - 130 - 5y + 67)(-24y*2 + 13y*2 - 19y*2) + 2y - y*3 - 2y to ly3 + iy*2 + w + qy and give i. 60 Rearrange (1877 - 1877 - 68b)(b + 2 - 2 + (-b - 2 + 2)(4 + 1 - 3) + b + b + 0b - 2b - 3 + 3 + 1 - 1 - 2b) to u + pb2 + jb and give p. 204 Rearrange (-4q - 21 - 2q + 22)(6 - 6 + 5q*3) to the form aq*3 + gq*2 + yq*4 + xq + d and give y. -30 Rearrange (0v + v + 0v)(0v + 3v - 15v + (6 - 2 - 3)(6v - 227 + 227)) to the form uv + w + sv*2 and give s. -6 Rearrange -377a - 396a + 818a - 293a to the form g + ta and give t. -248 Express (-618 - 634 + 643)(3q + q - q) in the form x + iq and give i. -1827 Express -223y*3 + 45y*2 + 73y*2 + 113y*3 + 111y*3 - 31y*2 in the form i + ry*3 + my*2 + qy and give r. 1 Express -9y2 - 18y*3 + 21y*3 + 121y*2 + 0y*2 + 0y2 + y3 + (-2y2 - 1 + 1)(5y - y - 3y) as p + jy + ky*2 + ly*3 and give k. 112 Express (11526m*2 + 785m**	{ "pile_set_name": "DM Mathematics" }
+ 46. What is the remainder when k is divided by ((-18)/(-15))/((-1)/(-10))? 11 Suppose -5j - w - 259 = 0, 3w - 2w + 208 = -4j. Let l = 85 + j. What is the remainder when l is divided by 2/5 + -1 + 930/50? 16 Let o = 1 + -1. Let z be ((-7)/(-21))/((-2)/24)-8. Suppose 2v = -ov + z. Calculate the remainder when 45 is divided by v. 13 Let h(z) = -3z*2 + 15z - 8. Let m be h(4). Suppose -2c = mb - 104, 10b - c - 130 = 5b. Calculate the remainder when b is divided by 14. 12 Let w = -1195 + 1203. What is the remainder when 117 is divided by w? 5 Let z(g) = -5g - 44. Let n(x) = -6x - 43. Let u(s) = 3n(s) - 4z(s). Calculate the remainder when u(10) is divided by 23. 21 Suppose -3360 = -14u + 728. Calculate the remainder when u is divided by 37. 33 Let t(b) = b3 - 8b*2 - 3b + 12. Suppose 4h = 4i - h - 82, 3i = 2h + 58. What is the remainder when t(9) is divided by i? 12 Suppose 1206 + 1464 = 178c. Suppose -3i + 5g + 164 + 250 = 0, -2g - 6 = 0. What is the remainder when i is divided by c? 13 Let s = -12 - -52. Let v = 49 + -48. Calculate the remainder when s is divided by 46/2 - (4 + v + -3). 19 Let t = 25 - 4. Calculate the remainder when t is divided by 222/18 + 32/12 + 0. 6 Suppose 2n + 6j = j + 46, 2n + 4j = 48. Let u = 3 + -2. What is the remainder when n is divided by u/(-2) + 21/2? 8 Suppose 5 = -3f - 7. Let l(d) = -d3 - 6d*2 - 4d - 1. Let s be l(f). Let y = s + 20. What is the remainder when 7 is divided by y? 1 Suppose 9f = 1389 - 417. Calculate the remainder when 858 is divided by f. 102 Let u(b) = 15b - 4b + 11b + 6 - b*2 - 3. Calculate the remainder when 8 is divided by u(22). 2 Suppose -5l + 26 = 3f - 29, -2f - 4l = -36. Let q = f - 11. Suppose -2g + 2k + 3 = -k, -3k + 15 = 4g. Calculate the remainder when q is divided by g. 0 Calculate the remainder when 178 is divided by 371/6 - 20/24. 56 Suppose 4g = -3m + 10 - 43, g = -2m - 12. Let x = g + 27. What is the remainder when 103 is divided by x? 19 Let b be 4 - (2 + 1)/3. Suppose -bi = i - 16. What is the remainder when 18 is divided by i? 2 Suppose 53r = 8r + 4185. What is the remainder when 557 is divided by r? 92 Let v = 934 - -521. Calculate the remainder when v is divided by 54. 51 Suppose d = 5z - 17, 5z - 19 = -5d + 16. Suppose z = -q, -t - q - q + 149 = 0. Calculate the remainder when t is divided by 8. 5 Let x(v) = v*3 + 9v*2 + 4v + 38. What is the remainder when 0 - 3/(6/(-16)) is divided by x(-9)? 0 Let j = -105 - -132. Let y = -11 + 18. What is the remainder when j is divided by y? 6 Suppose 0 = 6x + 17 - 89. Suppose x + 63 = 5o. Calculate the remainder when 44 is divided by o. 14 Suppose 8n = -n + 162. What is the remainder when 214 is divided by n? 16 Let v = 27 + -7. Let p = -2 + v. What is the remainder when 51 is divided by p? 15 Let c(r) = -9 - 28r - 61r + 18r. What is the remainder when c(-1) is divided by 22? 18 Suppose 137 = 3c + u, 22 = -3c + 4u + 179. What is the remainder when 886 is divided by c? 40 Let d = 2951 - 2936. Suppose 0w + w - 42 = 0. Calculate the remainder when w is divided by d. 12 What is the remainder when 0 + 281 + (6 + -5 - 5) is divided by 10? 7 Let k(s) = -s + 30. Calculate the remainder when (3/2)/(24/848) is divided by k(12). 17 Let u be (-2)/5 - (-27)/5. Let b = 249 + -262. What is the remainder when 85(b/u - -3) is divided by 12? 10 Suppose 0 = 4r - 329 + 17. Suppose 2274 = 6x + r. Suppose 8l - x - 346 = 0. What is the remainder when l is divided by 30? 29 Let o = -180 + 301. Let i = -82 + o. What is the remainder when i is divided by 23? 16 Let d(o) = -2o2 - 37o + 31. What is the remainder when 16 is divided by d(-19)? 4 Suppose 0 = -n - 3n - k - 36, -2n - k = 20. Let w(r) = 2r + 3. Let i be w(n). Let l = i - -28. What is the remainder when 43 is divided by l? 13 Let r(u) = -3 + 6u*2 - 10u*2 + 17u*2 + 15u*2. Let h(n) = -27n3 + n2 - n - 1. Calculate the remainder when r(-2) is divided by h(-1). 25 Let m(i) = -5i - 18. Let z be (1/(-2))/(25/300). What is the remainder when 22 is divided by m(z)? 10 Let h = 491 - 461. What is the remainder when 776 is divided by h? 26 Let q = -9 - -93. Let f = 90 + q. What is the remainder when f is divided by 44? 42 Let h(q) = q3 + 55q*2 - 5q - 189. Calculate the remainder when 172 is divided by h(-55). 0 Let o = 3 - -1. What is the remainder when o is divided by 71(6 + (-123)/21)? 0 Suppose 0 = 5u + 2p - 3007, 0p + p + 600 = u. Suppose 779 = 5s - u. Calculate the remainder when s is divided by 31. 28 Suppose 2l - 13d + 16d = 579, 5l - 5d = 1510. Calculate the remainder when l is divided by 50. 47 Let s(c) be the second derivative of -27c5/20 - c4/6 - c3/3 - c2/2 - 16c. Calculate the remainder when s(-1) is divided by 7 - 2(-2)/(-4). 2 Suppose 37r = 45r - 640. What is the remainder when 398 is divided by r? 78 Let t(x) = -x*2 + 3x - 6. Let m be t(2). Let s = 101 - 68. What is the remainder when s is divided by ((-18)/m)/((-5)/(-60)9)? 3 Let j(x) be the second derivative of 0 - 4x + 0x2 + 35/6x*3. What is the remainder when j(1) is divided by 19? 16 Suppose 0c + c = 67. Suppose 11x - c - 318 = 0. Suppose 4i = -0i + 48. What is the remainder when x is divided by i? 11 Calculate the remainder when (-121)/(-484) + 399/4 is divided by 50. 0 Let t(n) = n2 - 12n + 44. Calculate the remainder when 94 is divided by t(6). 6 Let k = 14 + -10. Suppose -41 = -ka + 3. What is the remainder when 43 is divided by a? 10 Suppose -5v = -0 - 20. Let j(x) be the third derivative of x5/60 - x4/8 + x*3/3 - 3x2. Calculate the remainder when 15 is divided by j(v). 3 Calculate the remainder when (-1)/((28/287)/(-4)) is divided by 6. 5 Let r(t) = -t2 - 22t + 33. Calculate the remainder when r(-20) is divided by 25. 23 What is the remainder when (-2)/11 - 35148/(-319) is divided by 16? 14 Let u(x) = -x3 + 8x*2 + 4x + 3. Let w be u(8). Let g = -3 + 16. Calculate the remainder when g is divided by 34/10 - (-21)/w. 1 What is the remainder when (-203)/(-2)(-282)/(-329) is divided by 27? 6 Let y be 23 + (-2 - -3)1. Let o = y + -12. Suppose 2 = 2t - o. What is the remainder when 13 is divided by t? 6 Suppose 5g - 3f = 59, -4g - 2f = -0g - 34. Suppose gd - 18d = -248. What is the remainder when d is divided by 12? 7 Suppose 0w - 4w = 372. Let m = w + 154. Calculate the remainder when m is divided by 33. 28 Suppose -18b + 1482 = -1812. What is the remainder when b is divided by 63? 57 Suppose 0 = -3p - 2p. Let c = 27 + p. Suppose 5g - 3g = 4l - 6, 3l = 15. What is the remainder when c is divided by g? 6 Let v(i) = 2i - 15. What is the remainder when 105 is divided by v(22)? 18 Suppose -7 = -3j + 5j - 3t, t + 38 = -3j. Let a(r) = 6 + 7 - 17 + r - 2r. Calculate the remainder when 11 is divided by a(j). 4 What is the remainder when (23 + 7 + 11)(-6)/(-2) is divided by 62? 61 What is the remainder when (-183)/(3 + 5 + -9) is divided by 23? 22 Let q(a) = 5a2 + 3a - 5. Let k be q(-4). Let y = 170 - k. Calculate the remainder when y is divided by 11. 8 Suppose 0 = 2j - j - 3. Suppose t - 192 = -jt. Let n = 52 + -27. Calculate the remainder when t is divided by n. 23 Let i = 196 - 170. What is the remainder when 64 is divided by i? 12 Let g(n) = -n3 - n2 - 11. Let j be g(0). Let v(k) = -k - 8. Let b be v(j). Suppose -bx + 2x + 18 = 0. Calculate the remainder when 34 is divided by x. 16 Let k(b) = b*2 + 7b - 165. What is the remainder when 78 is divided by k(-18)? 12 What is the remainder when (3/5 - (-11826)/90) + 3 is divided by 47? 41 Suppose 2s - 40 = 4s. Let n = 30 + s. What is the remainder when 17 is divided by n? 7 Let u = 462 + -439. What is the remainder when 35 is divided by u? 12 Let z(n) = -n*2 - 37n - 153. Calculate the remainder when 761 is divided by z(-5). 5 Let i(w) be the second derivative of -2w3 - w2/2 - 20w - 2. What is the remainder when 235 is divided by i(-5)? 58 Suppose 4n + 4t + 8 = n, 4t + 16 = -n. Suppose 5u - i = 31, -nu + 3 + 21 = -i. Calculate the remainder when 12 is divided by u. 5 Let z(t) = -2t + 5. Suppose 15 = 5*a, x + a - 37 = -x. Let n = -10 + x. What is the remainder when z(-4) is divided by n	{ "pile_set_name": "DM Mathematics" }
/66 and -7/44712585? 983676870 Find the common denominator of 79/7997508 and 143/72. 15995016 What is the common denominator of -223/52235820 and 191/2901990? 52235820 Find the common denominator of -31/16522056 and 59/2916. 16522056 What is the common denominator of -64/765 and 11/157560? 8035560 What is the lowest common multiple of 16309026 and 81545130? 81545130 Calculate the common denominator of -19/312650 and -55/676. 625300 What is the lowest common multiple of 27336 and 639132? 85643688 Calculate the common denominator of 187/240 and -103/17547600. 17547600 Calculate the smallest common multiple of 1825624 and 360. 82153080 Calculate the least common multiple of 8983800 and 210. 8983800 What is the common denominator of -34/723 and -25/377532? 90985212 What is the common denominator of 63/2788 and 19/472936? 329636392 What is the smallest common multiple of 382684 and 5740260? 5740260 Calculate the least common multiple of 676704 and 16. 676704 What is the lowest common multiple of 2508 and 8624? 491568 Calculate the smallest common multiple of 20455148 and 204. 61365444 Calculate the common denominator of -85/721804 and -73/52389. 6496236 Calculate the common denominator of 83/154307446 and 137/18. 1388767014 What is the lowest common multiple of 479792 and 305208? 116589456 What is the least common multiple of 15063016 and 10? 75315080 What is the least common multiple of 13566592 and 71424? 244198656 Calculate the common denominator of 121/43284 and 59/25068650. 150411900 Find the common denominator of -50/53779 and -19/860464. 860464 What is the least common multiple of 15949224 and 21? 111644568 Calculate the lowest common multiple of 198 and 20052560. 180473040 Calculate the lowest common multiple of 90 and 1021023. 10210230 Find the common denominator of 29/326228 and -17/2548. 29686748 Calculate the common denominator of 179/360 and -121/5892900. 35357400 What is the common denominator of -143/21280 and -47/54163680? 379145760 Find the common denominator of -49/27 and 46/274347645. 2469128805 Calculate the common denominator of -91/987312 and -69/271388. 218195952 What is the lowest common multiple of 2128302 and 252? 29796228 Calculate the least common multiple of 3770904 and 4359272. 614657352 Find the common denominator of 117/26374520 and 79/3290. 184621640 Calculate the lowest common multiple of 262675 and 229653. 40189275 What is the least common multiple of 29610 and 399770? 169102710 Calculate the common denominator of 25/438483 and 53/45. 6577245 What is the least common multiple of 140340 and 87? 4069860 Calculate the lowest common multiple of 77770 and 61610. 4743970 What is the lowest common multiple of 10380447 and 126? 20760894 Find the common denominator of -49/169709202 and 113/30. 848546010 What is the lowest common multiple of 999502 and 41454? 8995518 What is the lowest common multiple of 16821003 and 168210030? 168210030 What is the common denominator of -14/6646741 and 73/5789097? 179462007 Calculate the common denominator of -49/117725 and 8/2515. 59215675 What is the smallest common multiple of 301680 and 816? 5128560 Calculate the least common multiple of 243837 and 487674. 487674 Calculate the lowest common multiple of 1102413 and 2289627. 29765151 Calculate the least common multiple of 66745298 and 5838. 1401651258 What is the lowest common multiple of 1655160 and 9930960? 9930960 Calculate the common denominator of -37/441440 and -71/485584. 4855840 Calculate the lowest common multiple of 101150 and 3959300. 27715100 What is the common denominator of 41/16 and -45/16342792? 32685584 Find the common denominator of -3/191 and -71/6386685. 1219856835 What is the lowest common multiple of 2618238 and 2702? 2618238 Calculate the common denominator of -25/1954832 and -63/184. 44961136 Calculate the least common multiple of 6262300 and 13200. 75147600 Find the common denominator of 91/9773606 and -89/2. 9773606 Calculate the lowest common multiple of 80616 and 33002175. 264017400 Calculate the common denominator of 169/3239082 and 58/9471. 3239082 What is the common denominator of 23/210 and -59/1823850? 1823850 What is the least common multiple of 62 and 174443? 10815466 Calculate the common denominator of 29/1573108 and -27/649762. 29889052 What is the least common multiple of 5463 and 2280? 4151880 Calculate the least common multiple of 1161853 and 132363. 10456677 Find the common denominator of -16/66099 and -23/336504. 3701544 Calculate the common denominator of -197/6900 and 103/6889800. 158465400 Calculate the lowest common multiple of 14 and 7670453. 15340906 Calculate the smallest common multiple of 158048 and 2694000. 59268000 Calculate the common denominator of -157/2763600 and -73/64680. 30399600 Calculate the least common multiple of 1812 and 5421202. 32527212 Calculate the lowest common multiple of 312 and 25852242. 103408968 Calculate the lowest common multiple of 282 and 30726. 1444122 What is the common denominator of -79/72 and 121/104176416? 312529248 What is the smallest common multiple of 9159009 and 263298? 128226126 What is the lowest common multiple of 134004 and 40350? 901176900 Calculate the common denominator of -101/11570060 and -8/5. 11570060 What is the common denominator of 179/543600 and 119/624000? 282672000 What is the common denominator of 143/969168 and 53/27804? 6784176 What is the lowest common multiple of 57530 and 14641? 76572430 What is the common denominator of -137/579012 and 13/6031375? 72376500 What is the least common multiple of 68223815 and 589754? 1500923930 What is the common denominator of 29/38446844 and -95/1112? 76893688 Calculate the least common multiple of 50 and 764235. 7642350 Calculate the common denominator of 179/23529360 and 83/47058720. 47058720 What is the smallest common multiple of 966105 and 123385410? 863697870 Calculate the lowest common multiple of 4840 and 24783. 10904520 What is the smallest common multiple of 52650 and 2430? 157950 Calculate the common denominator of 73/1561408 and 15/1736. 10929856 Calculate the least common multiple of 1463196 and 1232. 64380624 Find the common denominator of -85/303374916 and -43/10179. 303374916 Calculate the least common multiple of 179866464 and 2356. 179866464 What is the lowest common multiple of 66292002 and 882? 66292002 Find the common denominator of -2/3794123 and -81/14. 53117722 Find the common denominator of 19/41810448 and 143/48. 41810448 Calculate the smallest common multiple of 3741 and 871437. 1086681939 Find the common denominator of 99/380 and 113/8731520. 165898880 Calculate the least common multiple of 34281892 and 124030. 171409460 Calculate the common denominator of -91/24966 and -1/2979276. 8937828 Find the common denominator of -67/27225 and 85/10164. 762300 What is the common denominator of -43/80919 and -55/576? 5178816 What is the lowest common multiple of 106639036 and 6? 319917108 What is the smallest common multiple of 176278608 and 9648? 176278608 What is the common denominator of -52/85 and -93/12179500? 207051500 What is the lowest common multiple of 37260 and 5309550? 10619100 What is the common denominator of -37/738630 and -17/68692590? 68692590 Find the common denominator of -47/51726 and 37/32620. 3620820 Calculate the smallest common multiple of 1661842 and 3195850. 41546050 What is the smallest common multiple of 1050 and 595275? 8333850 Find the common denominator of -95/6394 and -73/5370960. 5370960 Calculate the common denominator of 79/292818 and 117/17081050. 51243150 What is the smallest common multiple of 85848 and 5984321? 143623704 What is the common denominator of 40/3092439 and -25/189? 27831951 What is the least common multiple of 1871870 and 2272985? 31821790 What is the smallest common multiple of 9615204 and 24? 19230408 Calculate the common denominator of -139/126402 and -53/3223251. 6446502 Calculate the common denominator of -101/10844504 and -25/16. 21689008 Find the common denominator of 31/134084264 and -63/65950. 3352106600 What is the smallest common multiple of 16 and 1183072? 1183072 What is the smallest common multiple of 2600 and 520? 2600 Calculate the smallest common multiple of 248 and 85552. 2652112 What is the least commo	{ "pile_set_name": "DM Mathematics" }
be s(5). Let u = v + 8. Let p be ((-4 - u) + -2)-11. Which is smaller: p or 12? p Suppose -131n - 202 = -129n. Which is smaller: n or -100? n Let j = -15/13 + -59/39. Let q be 16/(-2)((-20)/8)/(-5). Which is smaller: q or j? q Let u = -18 - -9. Let h = -60 - -51. Let i be (h/(-2))/(2/(-4)). Does i = u? True Let j = 11 - 10.8. Let w = -0.8 + 0.87. Let m = w + 0.13. Is j less than m? False Suppose 218 - 3 = 5m. Which is smaller: 46 or m? m Let j be 6/(-11) + 0 + 65712/119988. Do j and 0 have the same value? False Suppose -j + 2 + 10 = -v, 2v + 4j + 12 = 0. Let s = 9 + v. Let z be s + 1 + 2/(-1). Is z greater than -1? False Let h = 5 + -8. Suppose 0 = 2c + 4 + 2. Let s = -7 - c. Is s not equal to h? True Suppose 0 = 5o - 2o - 39. Suppose 5x + 4m + 22 = 0, -m + 2m = -5x - o. Let l be 4(x - 20/16). Which is smaller: -0.2 or l? l Let u be (-1706)/(-1560) + (-2)/(-12). Let l = -2/195 + u. Which is smaller: l or 1? 1 Let a = 1.18 + -1.22. Let k = -0.15 + -0.95. Let j = 1 + k. Which is smaller: a or j? j Suppose -3y = -r - 8, 5r - 15 + 19 = -3y. Which is bigger: r or -410? r Let u = 0.756 + 2.244. Which is smaller: u or 11? u Let i be 302/(-190)5/5. Let x = 15/19 + i. Let l be (-6)/(-4)8/(-6). Is x not equal to l? True Let u be ((-1)/(-5))/(2/(-5)). Suppose -14 = 4w + 2d, 0 = w + 2w - 4d + 16. Let k be (w/(-10))/((-4)/(-5)). Which is bigger: k or u? k Let y(x) = -x*2 + 12x + 12. Let v be y(-1). Let i = 4064/19 - 214. Which is bigger: v or i? i Let h = -8.443 + 0.143. Let d = h + 14.3. Is 0 smaller than d? True Let o = 65.93 - -1.07. Let l = -65.67 + o. Let f = l + -0.33. Is f less than 5? True Suppose 5w = -p + 10, -4w + 4p + 8 = p. Suppose 2v + h + 4h + 52 = 0, -h = w. Which is smaller: -22 or v? -22 Let t be 0/((1 - -2)-1 - 1). Which is greater: 17/31 or t? 17/31 Suppose -6 = 4j + 2. Let n be (j/5)/(86/10). Let h = -1501 - -1501. Is n <= h? True Let l = 318 - 318. Is -3/10 <= l? True Let k be 0 + 1 + -5 - -4. Suppose 0 = d - kd. Let v be 9/56 - 2/7. Which is smaller: d or v? v Let w(o) = 272o2 + 538o. Let c be w(-2). Let i be 0 + 13 - (-2 + 3). Is i greater than c? False Let m be 380/(-6288) + (-15)/(-180). Which is greater: m or 0.1? 0.1 Let r(s) = -s*3 + 5s*2 + 11s - 6. Let w be r(5). Let d = w - 53. Which is greater: d or 9? 9 Suppose 4t = 4q - 12, 5q + 2t - 42 = -2t. Let a be -2 - ((-4)/q)/(-1). Let s(o) = 21o + 82. Let l be s(-4). Is a greater than or equal to l? False Let a(j) = j*3 - 34j*2 + 72j + 10. Let l be a(32). Is 266 <= l? True Let b = 2093160/1001 - 27244/13. Let h = -54/11 - b. Which is greater: -0.04 or h? -0.04 Suppose 4h - 9 - 3 = 0. Suppose ho = -3 + 9. Which is greater: 7/5 or o? o Let j(u) = 2u2 + 14u - 4. Let q be j(-6). Let n = -7 + -9. Is q at least n? True Let t = 1689 - 3377/2. Is -2/51 not equal to t? True Let d = 10 + -88. Let u = d - -93. Which is greater: u or 41/3? u Let z = -85.54 + 85.7. Is z equal to -1/6? False Let r = -22 - -15. Let s be (-14)/8 - (r - (0 + -5)). Is -0.44 at most as big as s? True Let u be (-4)/(-22) - 28/154. Suppose -4t - 3x + 72 = u, -3t - t + 2x = -92. Which is smaller: t or 19? 19 Let v(h) = -h*3 - 6h2 - h + 10. Let a(t) = -t3 - 6t2 + 11. Let k(n) = 2a(n) - 3v(n). Let f be k(-5). Are f and 0.04 non-equal? True Let v be -2 + 4/(-8)-4. Let o be (6/(3 - v))/(-2). Which is smaller: 10/21 or o? o Let d = 1254 + -1238. Which is bigger: 28 or d? 28 Suppose -4m - 20 = -5x, 22 = -4x - 5m - 3. Suppose 12n - 17n - 140 = x. Let b be 1 + 4 - n/(-7). Which is smaller: 2 or b? b Let z(c) = -2c2 - 4c + 69. Let v be z(11). Is v equal to -217? True Let r(g) = -g - 22. Let i be r(-23). Which is greater: i or -1/4? i Suppose -9 = -0d - 2d + 3x, -5x - 30 = -5d. Let m = d - 3. Suppose 15a = -35 + 140. Is a less than or equal to m? False Let n be 0 + -5 + -2 + 1. Let a = 8 + n. Let l be (18 - 20) + 10/4. Which is smaller: l or a? l Let f be (-1)/5-10 - 100674/49955. Let m = -2/485 + f. Is -1 <= m? True Suppose 3o - 5b + 42 = 0, 0o + 60 = -5o + 5b. Let c = o - -16. Let s be (1/(-3))/(1/(-21)). Is c greater than s? False Let h = -2093/2 - -1047. Is h <= -4/43? False Let n(m) = m*2 + 86m + 765. Let z be n(-64). Which is bigger: -642 or z? -642 Let w = 2/745 - 1516/9685. Let h = 0.8 + -0.8. Which is smaller: h or w? w Let z(g) = -9g + 11. Let x be z(-5). Let d = -36 + x. Suppose u = 5u + d. Which is smaller: u or -4? u Let t = -3961 - -19866/5. Which is greater: t or 12? t Let m(w) = -w*2 - 4w + 7. Let i be m(4). Let n = -24 - i. Are n and -2/27 unequal? True Let g be -13 + -14 - (1 - 1). Which is smaller: -28 or g? -28 Let h = 7056749/4125759 + 478/4033. Let l = h + -1/93. Is l > 2? False Let f = 5 + -2. Suppose 28 = -fp + 4. Are -31/4 and p unequal? True Let n = -334/3 - -112. Let j = 4.97 - 5. Is n != j? True Suppose -4978 - 1448 = -27z. Which is smaller: 237 or z? 237 Suppose 137 = 3l - 2w, 0 = -3w - w - 4. Let t be -5 + l/10 - (-105)/2. Which is smaller: t or 51? 51 Let r be ((-2)/(-201))/(((-198)/189)/11). Is 1 < r? False Suppose 42w - 4k = 37w - 142, 3w + 4k + 66 = 0. Is w > -35? True Let k be 0/4 + 4 - -65. Let u = 133/2 - k. Suppose -2z - 3a + a - 8 = 0, z = 5a + 8. Which is smaller: z or u? u Let g be 40/1672/(-6). Which is greater: -32 or g? g Let w be (-2220)/(-28) - (-10)/(-35). Let s be w/(-30) - 6/(-45). Let v = 2 - 5. Which is smaller: v or s? v Let s(i) = -9i3 - 2i + 1. Let a be s(1). Let b be (-8)/a(-25)/(-10). Suppose 3k - 2l = l + 18, -k + bl = -11. Which is greater: k or -1/13? k Let u be 4/18 - 235/45. Let g(t) = 3t + 1. Let w be g(-1). Is w > u? True Let r = -16 + 4. Let c be (-114)/4 + (r/(-4))/(-6). Do -28 and c have the same value? False Let s = -18.1 - -18.1. Is 7 > s? True Let r = 21.81 - 21.71. Which is greater: r or -592? r Suppose 126 - 33 = -m. Let c be ((-2)/m)/((-9)/(-54)). Is 0 at most c? True Suppose 3t - 5h = -15, t + 3h = -2t - 15. Let o(y) = -y3 - 7y*2 - 7y - 2. Let d be o(-6). Let r be (d/10)/((-3)/45). Is r >= t? False Let z be (-6)/20 + (-4)/(-10). Let n be (-42)/40 - 13/(-52). Is z equal to n? False Let b be (-215)/278/(-65). Let a = b - 125. Which is bigger: a or 30/7? 30/7 Suppose v - 4 = -2f + 17, 5f + 2v - 50 = 0. Suppose -7r + 1 = f. Which is bigger: -5/12 or r? -5/12 Let d be 658/(-98) - (0 - 2/(-7)). Let m = -12.36 + 12.4. Is d less than m? True Let o be 15/(-9)(144/135)/(-8). Is o greater than or equal to -307? True Let v = -90.6 + 15.6. Let g = v + 75. Which is bigger: g or -0.06? g Let j(w) = w*2 + 11w + 17. Let c(d) = d - 3. Let f be c(-6). Let m be j(f). Let g be 5 + m - (14 - 2). Does -9 = g? False Let v = -17301/7142897 - -5/3403. Is -1 less than v? True Let v(k) = 2k - 2. Let a be v(5). Suppose -2o + a = 0, 31 = 6t - 3t + 4o. Suppose -ti = -1 + 6, -5w + 15 = -5i. Which is smaller: w or 3/4? 3/4 Suppose 4u - 2u = u - 0u. Suppose g + z - 4z - 14 = 0, -18 = -2g + 4z. Let w = g + 0. Which is smaller: w or u? w Let f(t) = -t*2 - 6t - 8. Suppose 4q - 3q = -2x - 13, 22 = -3x - 4q. Let u be f(x). Which is greater: u or -9? u Let n = -289/2 + 1879/13. Is 1 < n? False Let v be 135/(-9) - -8 - -117. Are v and 110 equal? True Let v = -9.9 + 9. Let l = 8/165 - -2/15. Which is bigger: l or v? l Let a(r) = -r + 5. Let y be a(14). Let c = y - -9. Suppose cd + 44 = 3d - 4q, d - 3 = -q. Is 8 less than or equal to d? True Let g = 3912/23 + -170. Are 1 and g nonequal? True Let i be (-130)/40 - 1/(-4). Let b be ((-1)/(-3))/(i/18). Let c be (-1)/((b + 5)/3). Which is smaller: c or -2/9? c Let q = -353 + 325. Which is smaller: -2 or q? q Let n = 9423/17 - 554. Is n <= 0? False Let j(d) be the second derivative of d4/12 - d3/2 - 25d2/2 + 13d. Let q be j(8). Let m(z) = z*2 + 2z. Let n be m(-5). Is n at least q? True Let o = -12.35 + 18.35. Which is smaller: -3/13 or o? -3/13 Let u(s) = s*2 + 11s - 12. Let o be u(-12). Suppose -6p + 5p + 4 = o. Let c be (p/10)/((-3)/5). Is 7 at least as big as c? True Suppose -6l = -l - 125. Let k be (-246)/15 - (-10)/l. Do -16 and k have different values? False Let k = -513 - -358. Let i = k + 2017/13. Suppose 2j - b = 4, 16 = -j - 4j - 4b. Which is smaller: j or i?	{ "pile_set_name": "DM Mathematics" }
- 12r3 - 15r*3)(11 + 0 + 0). -242r3 Expand (y - 3y + y)(-3y + 0y + 4y) + (-2 + 2 + 5y)(-3 - 26y + 3). -131y*2 Expand (-h + 4h - 5h)(0 - 1 + 3)(143h*3 - 3098h + 3098h). -572h*4 Expand (105 + 59 - 224)(-2c3 - c2 + c2) + 0c - 2c3 + 0c + (-2c3 + 0 + 0)(-3 + 3 - 3) + 0c + 2c*3 + 0c. 126c3 Expand (4l - 2l + 0l)(2 - 29 + 4 - 29). -104l Expand -315w5 + 158w*5 + 123w*5 + (6 - 6 + 3w)(9w*4 - 5w*4 - 6w*4). -40w*5 Expand 0s*3 + 38s*3 + 11s3 + (s3 - 2s + 2s)(-1 + 4 + 0) - 3s*3 + 6s3 + 3 - s3. 54s3 + 3 Expand (-30 - 55 + 28)(-q + 0q + 0q)(0 - 5 - 1)(1 - q - 1). 342q2 Expand (l - 2 + 2)(-1 + 6l2 + 14 - 15 - 9l). 6l3 - 9l*2 - 2l Expand ((4d2 - d2 - d2)(1 + 0 + 0) - 1 + 2d2 + 1 - 9 + 5d*2 + 9)(-12 - 2d2 + 12)(4d - 2d + 0d). -36d*5 Expand (-82 + 27 - 49)(3q + 0 + 0) - 2 + 2 - 2q. -314q Expand (-6w - 5w + 7w)(2 + 0 - 4 + (0 - 2 + 1)(1 - 2 + 2) - 5 + 3 + 0 + 2 - 1 - 3). 28w Expand (2c - 2 + 0c + c)(13c - 9c + 23 - 43). 12c2 - 68c + 40 Expand 0 - 2i4 + 0 - 59 + 0i*4 + 8i*4 - 7i*4 + (0i*2 - 2i2 + i2)(-2i + 2i + 2i*2). -3i*4 - 59 Expand (64 + 61 - 64)((0g4 + 0g4 + g4)(5g + 0g - 4g) - 2g5 + 2g*2 - 2g*2). -61g*5 Expand 104v*2 - 52 - 211v*2 + 113v*2 + (-3 + 3 + v)(0v - v + 0v). 5v2 - 52 Expand z5 + 2 - 2 + (-2z*3 + 0z*3 + 3z*3)(-2 + 2 - 4z2) - 7z*5 + 2z*5 - 29z*5. -37z*5 Expand (52u + 9u + 10u)(-5u*2 - 5u + 5u) + (2u*2 + 4u*2 - 4u*2)(-3u - u - u). -365u*3 Expand -4m3 + m3 + 4m3 + (-15m*3 + 21m*3 + 16m*3)(5 - 5 - 2 + 4 + 0 - 3 + (0 + 2 - 1)(3 - 8 + 3)). -65m*3 Expand (4 - 4 + 2f*3)(2 + 2f2 - 2) + 159f*2 - 159f*2 + 5f*5 + (3f*2 - 4f2 - f2)(-2f*3 + 0f*3 + 3f*3). 7f*5 Expand (4 - 1 + 2)(2 + 10b - 2) - b - b + b + (-4b + 4b + 3b)(0 + 3 - 2). 52b Expand (-2o - 4 + 4)(-1 + 3 + 0)(2o - 10o + 2o)(21 + 2 - 4). 456o*2 Expand (-48 - 2a + 6 + 2)(3a*3 - 5a*3 + 4a*3). -4a*4 - 80a*3 Expand (-4v + 3v - 2v)(1 + 18 - 8) + 0v - v + 3v + (4 + 0 - 2)(-3v - 4v + 5v) - 2 + 2 - v. -36v Expand 0j - j + 4j + (0j + j + 0j)(6 - 3 - 2) - 4 + 4j + 4 + 6j - 4j + 22j. 32j Expand (-6c2 + 5c*2 - 6c*2)(-8c - 3c + 4c)(0 + 2 + 1)(-4c + 90 - 90 + (-5 + 3 + 4)(-3c + 2c - c) + 0c + 0c + 2c). -882c4 Expand (88r - 70r - 87r)((0r + 2r + 0r)(4r*2 + 2r*3 - 4r2) - r4 + 0r + 0r). -207r5 Expand -l4 + 2l*4 - 3l4 + (-l + l + l3)(4l - 4l + l) + 3l*3 - 3l*3 + 2l*4 + (-4 + 4 - 3l*3)(2l - 3l - 4l). 16l*4 Expand (2d*2 - 1 + 1)(1 + 1 - 4) - 122d2 - 19d + 121d2 - 7d. -5d2 - 26d Expand (-2 + 7n - 9n - 3)(-n3 + 4n*3 + 0n*3). -6n*4 - 15n*3 Expand 10 - 10 + 6o*4 + (4 - 3 + 0)(7o4 + 7o*4 + 5o*4) - 3o*4 + 8o - o*3 - 8o. 22o4 - o3 Expand 1 + 2y - 1 + (-3 + 3 - 3y)(-1 + 4 - 5) + (-3y + y + 0y)(-2 + 3 + 0). 6y Expand 12b + 44 - 44 + (1 + 0 + 1)(-3b + 0b + b) + 4b - 4b + 6b. 14b Expand (u*2 + 4u*2 - 6u*2)(-17u2 - 100 + 100) - 2u*3 + 2u*3 - 3u*4. 14u*4 Expand (2 - 7 + 2)(356 - 356 - 246t). 738t Expand (190q2 + 15071q - 15071q)(-3q + 5q + 0q) + (3q3 + q3 - 3q3)(-4 + 2 + 3) + 2q - 2q + q*3. 382q*3 Expand (-6f*2 - 2f*2 + 4f*2)(-3f + 4f - 3f + (2 + 0 - 4)(2f - 3f + 3f) + 0f + f + 0f). 20f*3 Expand (-3 + 2 - 3)(11t3 + 3t*3 + 7t*3 + (t + 2t + 0t)(-2t2 - t2 + t2)). -60t*3 Expand ((-t - 3t + 2t)(6 - 1 - 4) - 1 - t + 1 - 2 - t + 2 + 270 - 270 - 38t)(t*2 + 2t3 - t2). -84t4 Expand (-a3 + a3 + a3)(0a2 - a2 + 0a*2) + (-5 + 9 - 13)(-4a5 + 11a*5 - 41a*5). 305a*5 Expand (-32 + 52 - 89)(-7i - 1 + 3i + 3i). 69i + 69 Expand (4 - 2 + 0)(-2x + 4x - x) + 133x + 21x + 52x. 208x Expand (-5v + 5v - v)(2v2 - 3v2 - v2) - 8v3 - 41v*2 + 19v*2 + 26v*2 + v. -6v*3 + 4v*2 + v Expand -2 + 2 - 2s + (s - s - 2s)(-3 + 3 + 2) + 124s - 65s - 69s + 0s - 3s + 6s. -13s Expand -6o*2 + 3o*2 + 0o*2 + (4 + 1 - 3)(5o2 - 6o*2 + 2o*2) + 15o2 - o2 + 0o2. 13o*2 Expand -7y*4 - 6y*4 - 2 + 5y4 + (-y3 + y3 - y3)(5y - 4y + 2y) + 2 - 2y4 - 2. -13y*4 - 2 Expand (b - 4b + 2b - 4b + 3b + 0b + (-2b + 1 - 1)(-4 - 4 + 5) + 45 - 45 + 6b + 2b + 8 - 8)(-2b*2 + 6b*2 - 3b*2)(-b + 0 + 0). -12b4 Expand (2 + 0 - 3)(-11 + 29 + 21)(-3z + z + 0z). 78z Expand (3b2 - 3b*2 - 2b*2 + (0b - b + 9b)(10 - 10 + 7b))(-2 + 9b3 + 2). 486b*5 Expand (-7p + 7p - 8p)(0p - 2p2 + 0p) + 2p3 - p3 - 7p*3 - 2p*3 + 0p*3 + 0p*3 + 0p + 0p + 2p*3. 10p*3 Expand -3m*3 - 2m*3 + 3m*3 + (-2m*3 + 4m*2 - 4m*2)(3 - 1 - 4) - 4m3 + 3m*2 - 3m*2 - 1880 + 1880 + 49m*3. 47m*3 Expand (-d + 1 - 1)(-5d + 2d + 2d) + (-2d*2 + 12d - 12d)(6 - 27 - 46). 135d2 Expand -11 + 11v3 + 11 + v3 - 2v3 + 3v*3 + (v - v + 2v*2 + 1)(6v - 3v + 2v). 23v*3 + 5v Expand (-6v + v2 + 6v)((0 + 0 - v)(-2v2 - 2v + 2v) - 148 + 2v*3 + 148). 4v*5 Expand (-39 - 10 + 68)(-2u2 + u2 + 3u4 - u4). 38u4 - 19u*2 Expand x - x + x + (2 - 3 + 0)(x + 0x - 2x) - 10585 + 10585 + 957x. 959x Expand 10g4 + 14g*4 + 94g*4 + (3g - 5g - g - g - 1 + 1 + (-g + 0g + 3g)(-1 - 5 + 4) - 3g - g + 3g)(-g3 - g3 + 0g*3). 136g*4 Expand -3g + g + 7g + 2 + 16g + 2 - 4 + 4g - 3g + 0g - 4g + 2g + 0g - 1 - g + 1 + (-2g - 2g + 2g)(1 - 2 + 3) - 6g + g + 3g + 0g + g + 0g. 14g Expand (-133x + 174x + 332x)(1 - 3 + 0)(17 - 8 + 2)(0 + 5 - 4). -8206x Expand (-m*2 + 2m3 + m2)(-33 + 33 + 48m)(-2 + 3 - 4). -288m*4 Expand (3i - i + 0i)(-99 + 100 + 82) - 2i - 2i + 7i. 169i Expand (-5l3 + 2l3 - l3)(2l + 96 + 11 + 1). -8l4 - 432l*3 Expand (1 - 3 + 15 + (1 + 4 - 4)(1 - 3 + 1) + 4 - 2 + 0)(47g*3 + 45g*3 - g - 87g*3). 70g*3 - 14g Expand (8c2 + 16c*2 + 0c*2 - 6c*2)(-5 + c + 5)(0c2 + c2 + 2c2). 54c*5 Expand (218a - 176a - 153a + (1 - 1 + 2a)(0 + 1 + 1) - 4a + a + 4a)(-6 + 5a + 6). -530a2 Expand (-1 + 5 - 2)(-3 + 3 - 2h2) + (-2h2 - h2 + h*2 + 2h*2 - 2h + 2h + (2h + 0h - h)(-h - 2h + 4h))(2 - 3 - 3). -8h2 Expand -3 + 3 + m2 + (-4m + m - m)(7m + 4m + 5m). -63m*2 Expand -5z + z + 3z + (-4 - 3 + 5)(4 + z - 4) - 326z - 77z + 201z. -205z Expand (-5i + 9i + 16i)(4 + 2 - 5) + (-i + i - 2i)(-4 + 2 + 3) + i - i + i. 19i Expand (-4l - 3l + 3l)(60l + 134 - 123l + 61l). 8l2 - 536l Expand (15 - 15 + 10o)(-2 + 2 - 2)(0o*3 + 0o*3 + 2o*3). -40o*4 Expand (4 + 113i*2 - 58i*2 - 54i*2)(-i - 3i + 10i)(-4i*2 + 14i - 14i). -24i*5 - 96i*3 Expand (d - 2d - d)(24d*3 + 47d*3 - 16d*3) - 2 + 2 - 2d*4. -112d*4 Expand (1 - 1 - 2)(2t + 4 + 1 - 2 + 0t - 3t + 2t + (2t + 0t + 0t)(1 - 3 + 1) - 6t + 0t + 0t). 14t - 6 Expand (-i*2 + i - i)(i - i + i*2) + 13i*2 + 2i + 2i4 - 7i - 12i2. i4 + i2 - 5i Expand (-2 + 2 - 8)(-179w + 2w2 + 183w + 0w2). -16w*2 - 32w Expand (2z2 + 2z*2 - 2z*2)(537 - 537 - 188z). -376z*3 Expand (2 - 2 + 2)(h + 2 - 2) + h + 5h - 4h - 19 - 12h + 19. -8h Expand (2p3 + 2p*3 - 2p3 + (p2 - 4p2 + 2p*2)(-p + p + 3p))(51p + 72p - 49p). -74p*4 Expand (507b + 430b - 1198b)(b - b - b4). 261b*5 Expand -3u + 3u + 2u - 3u - 3 + 3 + (-8 - 3 + 5)(u + 0u + u). -13u Expand (0 + 0 - f + (0f - f + 2f)(0 - 4 + 5) + 2f + 1 - 1 - f + 10f + 47f)(6f*2 - 4f*2 - 3f*2). -58f*3 Expand (-4g - g + g)(153g + 3g + 551g + 173g). -3520g*2 Expand (n - 28n + 3n)(-3 - 2 + 3)(-7 - 8 - 5). -960n Expand 113j2 - 77j*2 - 86j*2 + (0j*2 + 2j*2 - 4j*2)(3 + 1 - 3) - 3j + 3j + 2j2 + (-j + 4j - 2j)(-3 + j + 3) + 3j2 - j2 - j2. -48j*2 Expand (5m*2 - 7 + 7)(379m - 379m + 55m3). 275m*5 Expand ((-4 + 2 + 0)(-5 - n + 5) - 4n - 5n + 5n)(230n - 230n - 33n4). 66n**5 Expand ((-4	{ "pile_set_name": "DM Mathematics" }
e form yl + n and give y. 502 Rearrange -19i - 6i - i + (-2i + 5i + 2i)(-4 - 3 + 5) to v + ki and give k. -36 Express (2a3 - 4a3 + a3)(-16 + 16 - 9a)(-63 - 55 + 30) as ia*3 + la + da2 + r + fa*4 and give r. 0 Rearrange 55w*2 - 5 - 116w*2 + 2w + 56w2 to aw + u + fw2 and give f. -5 Rearrange (2 + 0 - 1)(-11t + 7t - 5t)(-6 - 9 + 12) - 8 + 8 + 9t to the form it + r and give i. 36 Rearrange (k - 2k + 2k)(-72 - 23 - 86)(-2 - 1 + 2) to ok + l and give o. 181 Express 16 + 12c + 25 - 32 as ic + a and give i. 12 Rearrange -2 + 5h + 0h - 6h + 2h - h4 - 6h*3 - 2h to nh + th*4 + kh*3 + i + bh2 and give t. -1 Express -b3 - 2b3 - 3 + 5b*3 - 719b - 159b3 + 719b + (-2b3 + b - b)(1 - 4 - 4) in the form p + jb + xb*3 + ib*2 and give x. -143 Rearrange -22k*2 + 449k*2 - 9k*2 to the form gk + l + yk2 and give y. 418 Express (-1993b*2 + 993b*2 + 992b*2)(b + 2b - 4b) as vb2 + fb + l + jb3 and give j. 8 Rearrange (-733 + 671 - 411)(-2c2 - c2 + 2c*2) to f + nc*2 + pc and give p. 0 Rearrange (1 - 1 - 3)(11 - 9 - 23 + (0 - 2 + 1)(-3 + 4 + 0))(-1 + 1 + 3)(c + 1 - 1) to dc + b and give d. 198 Express -2o*4 + 0o4 + o4 - 18o4 + o4 + 4o*4 + (4o - 4o + 2o*4)(10 - 1 + 0) as lo4 + fo*3 + ro + qo2 + s and give l. 4 Express -10331a*3 + 5a - 3a + 17a*2 + 10336a*3 as ja*2 + p + qa + xa3 and give q. 2 Express -5294a*2 - 636a - a*3 + 5294a*2 as la*3 + ka*2 + oa + u and give l. -1 Rearrange -12m + 1393 + 1382 - 2795 to the form um + s and give u. -12 Express 0w3 + 3w*4 - 4w*4 - 6w + 7w - 13w*2 - 5w*3 + 1 + 2w*3 as h + iw + xw2 + fw*4 + tw*3 and give h. 1 Express 16r*2 + 109r + r*3 + 84r + 1 - 188r in the form j + dr*3 + ur*2 + or and give u. 16 Rearrange (-5172o + 55 + 94 + 93 - 242)(-2o + o3 + 2o) to u + vo3 + wo*2 + xo*4 + jo and give x. -5172 Rearrange b*3 - 24545b4 - b2 - 3b3 + 24549b*4 + 1 + 2b to fb4 + zb*2 + rb*3 + t + cb and give t. 1 Express -q*3 + 10q + 256q2 - 6q - 4q + 7 - 9 in the form yq + cq2 + i + jq*3 and give j. -1 Rearrange -18n*2 + 1 + 7n*3 + 28n2 + n4 - 7n2 - 6n*2 to rn*3 + yn*2 + ln*4 + zn + w and give y. -3 Express 2n3 - n2 + 136n + 2 + n*2 + 3n*4 + 129n - 268n as a + pn*3 + qn*4 + in + fn2 and give p. 2 Express -122 + 26l + 251 - 129 as cl + g and give c. 26 Rearrange (0 + 0 - 2)(v*2 - 3v2 - v2)(-2 - 1 + 5)(11v - 2v + 2v) to bv*3 + fv + y + ov2 and give b. 132 Express ((0z + 0z + z)(-4 + 2 + 0) - 3z + 16z - 3z)(0z2 - 2z2 + z2) in the form bz3 + iz*2 + uz + d and give u. 0 Rearrange 39 - 3s + 3s - 431s3 + 30 - 71 to the form ps*3 + ks + bs2 + g and give p. -431 Rearrange 0y*3 + 59y - 2y3 + 39y*2 - 73y*2 + 34y*2 to the form b + uy + ty3 + ny*2 and give t. -2 Rearrange -2x - x4 + x3 - 24x2 + 78x*2 - 29x*2 to the form ix + kx4 + qx*2 + f + mx*3 and give q. 25 Rearrange -2b*2 + 17b*3 - 21b*3 + 63 - 39b*3 - 64 to s + qb*2 + lb + ab3 and give a. -43 Express 91s*2 - 2 + 137s + 2s3 - 91s*2 in the form p + zs + ks3 + os*2 and give p. -2 Express 15j + 3j2 - 1832 - 6j*2 + 1834 in the form rj*2 + t + gj and give r. -3 Rearrange 69i3 - 29i*3 - 17i*4 - 21i*3 - 22i*3 + 0 - 1 - 3i*2 to the form ni*4 + ri + k + ji3 + xi2 and give j. -3 Rearrange -2 + y2 + 4y2 + 2y - 7y2 + (-2y + 24y - 5y)(3y - 3y - 4y) to the form ly2 + x + qy and give q. 2 Express 4p - 3p + 0p - 4 + 4 - 2p + (0 + 2 - 4)(-3p + 3p + 2p) + 0p - 2p + p - 5p + 11p + 6p - 12p + 7p - 11p in the form u + op and give o. -10 Rearrange -m - 7m*2 - 1957 + 1958 + 4m to the form sm2 + x + vm and give v. 3 Express 2 + 4h3 + h3 - 15084h*2 + 15085h*2 + 10h + h*4 as p + oh + gh4 + uh*2 + ah*3 and give u. 1 Rearrange 2g + 5g + 142 - 140 to the form fg + y and give f. 7 Express -3 + 14 - 4 - 8 + 74c2 in the form wc*2 + vc + o and give o. -1 Rearrange -91b4 + 4b*2 - 5b*2 + 96b4 - 1 - b3 to the form qb4 + yb*2 + o + kb + xb3 and give y. -1 Rearrange -4 - 2r*3 - 22r*3 - 12r*2 + 11r*3 + 2r - 2r4 + 12r*2 to the form wr*3 + pr*2 + vr + a + fr4 and give p. 0 Express -920c*2 - 300c*2 + 359c*2 in the form nc*2 + bc + m and give n. -861 Rearrange 4215 - 4215 - 1709x to the form fx + t and give f. -1709 Rearrange -5p3 + p2 - 12 + 6 + 3p*4 - 2p*4 + 5 to zp*2 + l + sp + wp3 + ip*4 and give z. 1 Rearrange -892 + 892 - 3c*3 + 3c to the form d + xc2 + jc*3 + gc and give x. 0 Express -3v3 + 2v*2 + 13 - v + 0v + 13 - v*2 - 18 in the form sv*3 + pv + d + rv2 and give p. -1 Rearrange (4p - p + 0p)(23p - 24p + 45 + 31) to mp2 + d + xp and give m. -3 Rearrange -3 + 92t - 7t*3 + 3t*3 - 92t + 2t3 - 46t*2 to the form at + ht2 + ut*3 + k and give h. -46 Rearrange (43m - 43m - 46m*3)(0 + 4 - 2)(m - 6m + 0m) to hm*2 + jm + rm3 + o + fm*4 and give o. 0 Rearrange 17 - 84s*2 - 83s*2 + 174s*2 to f + vs + bs2 and give f. 17 Express 0t*4 - t - 45682t3 - t2 + 45718t3 - t4 in the form p + gt*2 + bt*3 + wt + ft4 and give b. 36 Rearrange -13o*2 - 1 + 2 + 63o*2 to k + vo + ho2 and give k. 1 Rearrange (174 + 415 - 165 - 136 + 375)(-a*2 - 2a*2 - 3a*2) to the form oa*2 + ia + m and give i. 0 Rearrange (7s - 3 - s - 5)(3s - 3s + 2s3) + (3s + 0s - 2s)(-2s*2 + 2s2 + s3 + s*2) to ts*2 + as*4 + ws*3 + y + os and give w. -15 Rearrange 36 - 7 + 2 - 10 + 0 - 13d to the form p + hd and give h. -13 Express 17 + 6o + o + o - 3o as i + po and give p. 5 Rearrange -35v*4 + 31v*4 + 27v - 30v - 3v*2 - 2 to the form mv*2 + av*4 + qv + sv3 + c and give s. 0 Express -z2 - 4z*2 + 2z*2 + (-z - 12z - 10z)(6z - z - 2z) as wz2 + k + dz and give k. 0 Rearrange 2a4 - 4 + 3a*2 + 90a - 88a + 2a*3 + 5 to oa + ka4 + c + la*3 + na*2 and give n. 3 Rearrange (d - 2d + 2d)(46338d - 502d*2 - 23171d - 23167d) to ad*3 + zd*2 + m + ud and give a. -502 Rearrange (-3y2 + 3y2 + y2)(3y - 3y - 6y*2) + 269y*4 - 2y*2 - 63y*4 + 2y*2 to n + uy*3 + py + wy4 + vy*2 and give w. 200 Rearrange 806 - 488 + 0f*2 + 3f*2 to the form wf*2 + z + bf and give z. 318 Express 0 + 0 + 2d2 + (1 - 2d - 1)(-1 - 3d + 1) - 2267d - 2d*2 + 2636d - 3 + 5 in the form id2 + fd + a and give a. 2 Express 91i2 + 2 - 4 + 87i*2 + 17i*3 + 4i*4 - 176i*2 in the form qi*3 + hi*2 + ui + gi4 + p and give q. 17 Express -223 - 90r + 223 + (-4 + 3 + 0)(-2 - r + 2) - r - 4r + 3r - 4r - r + 6r as x + gr and give g. -90 Express -308r2 - 1102r*2 - 498r*2 + 187r*2 in the form p + yr + jr2 and give j. -1721 Rearrange -2 + n + 34n + 26n + 0 to the form j + yn and give y. 61 Express (34 - 34 + 6h)(4h - 5h + 0h)(-1 + 8 + 3)(-1 - 4h + 1) as nh2 + jh*3 + u + rh and give j. 240 Express 2b + 2b - b + 5b + 13b - 4b - 3 + 3 + b + (3b - 3b - 3b)(-3 + 1 + 3) as m + xb and give x. 15 Express -38h2 + h3 + 23h*2 - 95h*2 in the form g + ih + ph2 + yh*3 and give y. 1 Rearrange 9l*3 - 7l*4 - 9l3 - l3 + 68l4 + l3 + (0l*3 - 2l*3 + 0l*3)(l + 2l - 5l) to q + rl4 + il*3 + fl*2 + cl and give r. 65 Rearrange 88u - 118u + 0u2 - 97u + u*2 - 3 to the form qu + p + wu2 and give w. 1 Express -183 + 183 - 20x in the form cx + u and give c. -20 Express (-u2 + 5u - 5u + (2 - 2 + 4u)(-3u + 0u + 4u))(-23u + 7u + 11u) as cu3 + zu*2 + t + wu and give c. -15 Rearrange 76 - 236 + 80 + 79 + 3l4 - 2l - 17l2 to xl*2 + fl + t + hl3 + nl*4 and give n. 3 Rearrange (122s*2 + 437s - 437s)(-s - 2 + 2) to vs2 + x + zs + ys3 and give y. -122 Rearrange (-5 + 5 + 7)(-65 - 121 - 130 - h) to y + bh and give y. -2212 Rearrange (-3l - 2l + 3l)(1845 + 1715 - 83) to zl + d and give z. -6954 Rearrange -6	{ "pile_set_name": "DM Mathematics" }
36) Simplify v(-9/4)/v(-2/31) assuming v is positive. v(-271/124) Simplify (n12/n)/((n*(-14/11)n)/n) assuming n is positive. n(135/11) Simplify ((k/(k/((k2/k)/k)))/(k*(-7)k))/(k/(k/k*(-1/3))kk)16 assuming k is positive. k(-62/3) Simplify (c(9/4)/c)/c(-11/3) assuming c is positive. c(59/12) Simplify t(-5)t*(-5)(t(-2/3)/t)(-3/8) assuming t is positive. t(-75/8) Simplify d(-1/3)/d(2/9) assuming d is positive. d(-5/9) Simplify (i/i(-2/33))(28/9) assuming i is positive. i(980/297) Simplify r(-1)rr/(r/r*(-3))r(r2r)/(rrrr/r(-4/5)) assuming r is positive. r(-19/5) Simplify (j(-11)jj)41 assuming j is positive. j(-369) Simplify ((f2)(-47))16 assuming f is positive. f(-1504) Simplify ((((aa/a3)/a)/a)/a)/(a2/a)a/a(-1/2)a(-6)/a assuming a is positive. a(-21/2) Simplify (o3)(5/12) assuming o is positive. o(5/4) Simplify ((p(2/7))38)(10/13) assuming p is positive. p(760/91) Simplify j(-31)/(jj(1/23)) assuming j is positive. j(-737/23) Simplify f(-8/5)((f(f(-16)f)/f)/f)/f assuming f is positive. f*(-93/5) Simplify (rr/(r/(r/r0)))(4/7)/(r(2/3))30 assuming r is positive. r(-132/7) Simplify y(-9)(((y/(yy/y(3/10)))/y)/y)/y assuming y is positive. y(-127/10) Simplify (v/(vv(2/5)v))(-30)/(v(-2/11)/(v((vvv(-5))/v)/v)) assuming v is positive. v(420/11) Simplify ((s1)(11/2))20 assuming s is positive. s110 Simplify (r/r2)(-8)r*(1/17)r*(-5/4)r assuming r is positive. r*(531/68) Simplify (ww*(2/7)w*(2/9))/((ww*2)/(ww*(-5)w)) assuming w is positive. w*(-283/63) Simplify (nnn33n)/nnnn(1/36) assuming n is positive. n(1333/36) Simplify (l0l*(5/4)l)/(ll/(llll(-2/7)))(-4) assuming l is positive. l(-17/28) Simplify (i(-4)/i)/(i*6i) assuming i is positive. i(-12) Simplify (y/(y/y(1/7))yy*(-1)y)(9/8) assuming y is positive. y(9/7) Simplify rr/(rr*(-7/2))r*(-1/5)r assuming r is positive. r*(53/10) Simplify (u/(u(u*11/u)/u)u)/(uuu(u(u*(2/5)uu)/u)/uuu) assuming u is positive. u(-72/5) Simplify (s/(s/(ss(-4))))/(s/(s3s)s)s(-6)/ssss(-2) assuming s is positive. s(-8) Simplify (v0)18/(((vv6v)/v)/vvv/(v/(vv(2/13)))) assuming v is positive. v(-106/13) Simplify (v(10/9)v)/v(-12/5) assuming v is positive. v(203/45) Simplify ((l(-2))41)(-18) assuming l is positive. l1476 Simplify (i(i5i)/ii)/((ii/(iii*(-9)/ii))/i) assuming i is positive. 1/i Simplify (d(-2/3))(-19)/(d/(d/(d/d*(-1/2)))d*(-1/2)dd) assuming d is positive. d(29/3) Simplify (mm*(-6)/m)/mm*7m(1/2)/(m/m(1/8)) assuming m is positive. m*(-3/8) Simplify (tt*(1/3)t)*(15/2)((t*(2/13)t)/t)/(t/(t*(-1/3)t)t) assuming t is positive. t(1273/78) Simplify a(-1/4)/aaa(3/11)a*10(aaa/(a*(-3/13)/a)a)/a assuming a is positive. a*(8153/572) Simplify ((g/(((g/((gg/(g/(g/((g/(gg/g(-26)))/g)))g)/g))/g)/g))/g)(-32) assuming g is positive. g(-992) Simplify (uu(1/5))(2/187)u/(u/(u*5u))u(2/13) assuming u is positive. u(74956/12155) Simplify tt/((t/t*(-1))/t)t/((t/t(2/43))/t) assuming t is positive. t(88/43) Simplify p*(-6/13)p/(p/p34) assuming p is positive. p(436/13) Simplify rr/r7(r/(r*(6/7)/r))/r(r(1/4))41 assuming r is positive. r*(151/28) Simplify (g/(gg/g*(-2/21)g)g)(-2/11) assuming g is positive. g(46/231) Simplify (p(2/7)p(pp/(p*2/p)p)/p)/(p*(3/5)/pp(-2/15)) assuming p is positive. p(296/105) Simplify (m/(mm3m))/(m/m(-2)) assuming m is positive. m(-7) Simplify (r*(2/29)r)41 assuming r is positive. r(1271/29) Simplify (m*3m4)31 assuming m is positive. m*217 Simplify ((oo/(oo(oo(1/7))/o))/o)/o(-2/5) assuming o is positive. o(-26/35) Simplify ((bbb/((b/b5)/b)b)/bb(-4/7))(-21) assuming b is positive. b(-156) Simplify q/(q/q3)qq(-4/3)q*(-1/9)/(qq6) assuming q is positive. q(-40/9) Simplify (x/(xx/x24))(-17) assuming x is positive. x(-391) Simplify (y/(y2y)y)(1/50) assuming y is positive. y(-1/50) Simplify ((u(u(u(5/3)/u)/uu)/u)/(uuu(-1/12)))(-1/10) assuming u is positive. u(1/40) Simplify f(-2/17)f(4/3) assuming f is positive. f(62/51) Simplify t21/t(-4/3) assuming t is positive. t(67/3) Simplify (((bbb(1/13)b)/b)/b(-6))/(b(2/7))29 assuming b is positive. b(-19/91) Simplify ((tt(-3/4))/(t/t(2/39)))/((t/((tt/(t/t*(-1)))/t)t)/tt)31 assuming t is positive. t(-14617/156) Simplify s/(s/(s/(s/s1)))((ss(4/5))/s)/s((s/(sss1))/s)/(s/s2) assuming s is positive. s*(-6/5) Simplify ((((hh/h*(-1/6))/hh)/h)/h(2/5))(2/71) assuming h is positive. h*(23/1065) Simplify (ss*(-12/11)s)(-34) assuming s is positive. s(-340/11) Simplify ((u/u(1/4))(-24))(-7/3) assuming u is positive. u42 Simplify l(-7/3)/l(-10) assuming l is positive. l(23/3) Simplify ((a0)(-20))(-30) assuming a is positive. 1 Simplify ((p/((p/p*1pp)/p))/p)(-5/18)/(p(2/9)p)(-35) assuming p is positive. p(775/18) Simplify (((m(5/4)/m)/m)/m9)(-2/109) assuming m is positive. m(39/218) Simplify o*6o/(oo(-1/5)oooo)o(oo1)/o(-6) assuming o is positive. o(56/5) Simplify (n6(n/(n(-3)n))/nn)(-32) assuming n is positive. n(-288) Simplify (f(-3/2)f)(-2/149) assuming f is positive. f(1/149) Simplify (s*3s*(-4/3))/(ss(s/((s/(s(-1/2)s))/s))/s)(4/13) assuming s is positive. s(35/39) Simplify (h*(4/7)h)/h(-3) assuming h is positive. h(32/7) Simplify (u(-4)/u)/((u/u(-2))/uu)(uu(4/3))/u(5/4) assuming u is positive. u(-83/12) Simplify (q6q(-2/17))/(((q/q3)/q)/q2) assuming q is positive. q(185/17) Simplify (a/a*5a(2/29)/a)23 assuming a is positive. a*(-3289/29) Simplify (rr/(r/((rrr*(-2/7))/rrr))r)*(-39)r*(3/2)r(2/27) assuming r is positive. r(-68903/378) Simplify ((q/(((q/(q*(-10)qq)q)/q)/q))/(q*(2/5)q))(-3/22) assuming q is positive. q(63/55) Simplify ((c*(-11)c)/c)/cc(2/55) assuming c is positive. c(-658/55) Simplify (c1/c)44 assuming c is positive. 1 Simplify (u(-2/107)/u)/(u/u5) assuming u is positive. u(319/107) Simplify ((v/(v(2/37)/v))/v)/(vv(-5/3)) assuming v is positive. v(179/111) Simplify y*18yyy*(-2/91)y assuming y is positive. y*(1909/91) Simplify ((ddd0/d)(-2/31))(-18) assuming d is positive. d(36/31) Simplify hh/(h/(h/(h/(h*9h))h))hh/h(2/65) assuming h is positive. h(908/65) Simplify l(-29)(ll/(l/l(-29)))/l assuming l is positive. l(-58) Simplify (b0b)*(2/135)(((b/(b/(b(b/((b/(b/(b(1/4)/b)))/b))/b)))/b)/b)/b5 assuming b is positive. b(-2287/540) Simplify zz/(z((z21z)/z)/zzzz)z*(-1)z assuming z is positive. z*(-22) Simplify o/(o(o/o*14)/o)o*(-13/4)oo assuming o is positive. o(51/4) Simplify (u(-11)/(((u/u(-4/7))/u)/u))(6/7) assuming u is positive. u(-444/49) Simplify (vv1)(-2/11)(v(-2/3))(-21) assuming v is positive. v(150/11) Simplify (cc(-6/7))/(c/c6)(cc/(c(2/5)/c))(2/51) assuming c is positive. c(9362/1785) Simplify ((k(-2/3))(-5/2))(-2/41) assuming k is positive. k(-10/123) Simplify (s(-28))(3/11) assuming s is positive. s(-84/11) Simplify ((ooo*(13/2)o)/(o/o(-18)))(-1/37) assuming o is positive. o(19/74) Simplify (g7/gg(-7)/g)/((g(2/7)/g)/(gg(2/5))) assuming g is positive. g(4/35) Simplify (o/(((oo6)/oo)/o))(3/19) assuming o is positive. o(-15/19) Simplify ((x2)5)(-8) assuming x is positive. x(-80) Simplify (g*(-2/35)g(6/7)/g)8 assuming g is positive. g(-8/5) Simplify (y/(y(-13)/y))/(yyy/(y/(y/y*(10/17))y)) assuming y is positive. y(231/17) Simplify p6/(pp2/p) assuming p is positive. p4 Simplify (r(-1/34))48 assuming r is positive. r(-24/17) Simplify (t/(t(-1/4)t))(-49)/(t/((t(-2/5)t)/t))(-4/41) assuming t is positive. t(-9933/820) Simplify (p(8/5)p(5/6)/p)(-17) assuming p is positive. p(-731/30) Simplify (j0)*40 assuming j is positive. 1 Simplify (((u/(uu/u**(9/4)))/u	{ "pile_set_name": "DM Mathematics" }
value in -1/6, 1, -3/7, -3? -3/7 Which is the smallest value? (a) -0.5 (b) 450 (c) -4 (d) 5 c What is the smallest value in 1, -94, -3/4? -94 What is the fourth smallest value in -2, 6/7, -3, 1/6? 6/7 What is the biggest value in 0, -0.5, 19/3, -1/3, 2/7? 19/3 Which is the second biggest value? (a) 261.1 (b) -1 (c) 4 c What is the smallest value in 1/4, 3/4, -377? -377 Which is the fourth biggest value? (a) -0.4 (b) 4/69 (c) -5 (d) 1/4 (e) 0 a Which is the fourth biggest value? (a) -40 (b) 1 (c) 5 (d) 1/3 a Which is the fifth smallest value? (a) 0.27 (b) -5 (c) -2 (d) -0.9 (e) 2/3 e What is the biggest value in -187, 0.4, -3/8? 0.4 Which is the second smallest value? (a) 3 (b) -91 (c) -3 (d) -0.3 c What is the third smallest value in 107, -11/4, 2? 107 Which is the second smallest value? (a) -3/4 (b) -2 (c) -0.5 (d) 0 (e) -10/31 a Which is the smallest value? (a) 2/9 (b) -124 (c) 3/7 b What is the biggest value in 6, -0.3, 22? 22 What is the third smallest value in -2/11, 0.4, -4, -0.4, 3/4? -2/11 What is the biggest value in 0.3, -2/41, 16? 16 Which is the smallest value? (a) 9/4 (b) 1/2 (c) -0.5 (d) 3 (e) -0.6 e What is the second biggest value in 0, -2, -0.8? -0.8 Which is the fourth biggest value? (a) -2 (b) 4 (c) 16 (d) 0.7 a Which is the biggest value? (a) 2/15 (b) -2 (c) 50 c Which is the biggest value? (a) -0.4 (b) -2/15 (c) 0.3 (d) 149 d What is the third biggest value in 4, 11, 0.05? 0.05 Which is the third biggest value? (a) 1/3 (b) 1/6 (c) -15 c What is the biggest value in -4.2, 0.4, 2/9, 0.3? 0.4 Which is the third smallest value? (a) -4 (b) 2 (c) -4920 b What is the biggest value in 3, 32/3, -3, 0.4? 32/3 Which is the third smallest value? (a) 0.01 (b) -3/5 (c) -2 a Which is the third biggest value? (a) -7/4 (b) 1/3 (c) -1/3 (d) 2/5 c What is the biggest value in 5, -5, -1/18? 5 What is the fourth smallest value in -3/2, 5, 2/133, 0.1? 5 What is the third smallest value in -3/7, 35, 4, -1? 4 Which is the second smallest value? (a) 0.2 (b) 1 (c) 0.5 (d) 22 (e) 2 c Which is the second biggest value? (a) 2/7 (b) 6 (c) -4/7 (d) 0.1 a What is the fourth smallest value in 0.11, -7, 0, -2/5? 0.11 What is the second biggest value in 4, -0.3, -2/11? -2/11 What is the third biggest value in 0.2, -119, 0.3? -119 Which is the fourth biggest value? (a) -1/9 (b) 1/43 (c) -2 (d) 2 c What is the third biggest value in 1, 43, -0.1, -0.3? -0.1 Which is the second smallest value? (a) 2/9 (b) 14 (c) -1/6 (d) -2/11 c Which is the second biggest value? (a) 1/2 (b) -2 (c) 20 a Which is the second biggest value? (a) -120 (b) -3/5 (c) 2/3 b What is the third biggest value in 1/3, 0.4, -2/13, 1.02? 1/3 Which is the second biggest value? (a) 11 (b) 0.07 (c) -4 (d) 0.4 (e) 0.06 d What is the smallest value in -0.2, 2/13, -7? -7 What is the second biggest value in -3, 4, -10, 1, -1? 1 What is the third smallest value in -0.16, 0, 7? 7 Which is the second smallest value? (a) -3 (b) -5 (c) 2/9 (d) -1/2 (e) -27 b Which is the fourth smallest value? (a) 30 (b) -0.3 (c) -5/19 (d) -0.2 a Which is the smallest value? (a) 0.5 (b) 0 (c) 123 b What is the smallest value in -23, -0.4, -5, 0.4? -23 Which is the third biggest value? (a) 1 (b) -6/7 (c) 2/9 (d) 0.02 d Which is the second biggest value? (a) 2 (b) 4 (c) 5 (d) 5/4 b What is the biggest value in -2/3, -1, 0, 135? 135 What is the second smallest value in -2, 2/19, -1487? -2 What is the biggest value in -0.05, -2539, 3? 3 What is the third biggest value in 8, 0.2, -1? -1 Which is the second biggest value? (a) -1 (b) -10 (c) -2 c Which is the fourth biggest value? (a) 113 (b) 6 (c) -5 (d) -0.3 c What is the second biggest value in -8, -0.4, -179? -8 What is the second biggest value in -2, -0.03, -5, -8? -2 Which is the fourth biggest value? (a) 0.3 (b) -0.11 (c) -1/22 (d) 5 b Which is the second biggest value? (a) -2 (b) 5 (c) -0.04 (d) -1/2 c Which is the biggest value? (a) 1 (b) -0.027 (c) 0.1 a What is the third biggest value in 24, -19/3, -4? -19/3 Which is the fourth biggest value? (a) 1/2 (b) 2 (c) -3 (d) -1/6 (e) 0.213 d Which is the second smallest value? (a) 18 (b) -2/3 (c) 2/49 c Which is the smallest value? (a) -4 (b) -0.9 (c) -8 (d) -2/5 c Which is the biggest value? (a) -1/4 (b) 0.4 (c) 3 (d) -0.47 c Which is the third biggest value? (a) -0.09 (b) 3 (c) -1/3 (d) -2/31 (e) -1/2 a What is the second biggest value in -0.056, 0.2, -1, -0.4? -0.056 Which is the fourth smallest value? (a) -0.4 (b) -17/11 (c) 5 (d) 0.3 c What is the third smallest value in -0.3, 595, 5? 595 What is the third biggest value in -0.1, -0.3, 3/5, -0.7? -0.3 What is the second biggest value in 2, 4, -2/13, -1, 0.3? 2 Which is the smallest value? (a) -0.2 (b) -2/297 (c) -1/4 c Which is the fourth smallest value? (a) 7/6 (b) 1 (c) -3/5 (d) -2/13 a Which is the third biggest value? (a) 1/33 (b) -0.3 (c) 0.07 b What is the fourth smallest value in -2, 0.57, 5, 3? 5 Which is the second smallest value? (a) 4 (b) -0.12 (c) -554 b Which is the second smallest value? (a) 2/17 (b) -1 (c) -3 (d) -2 d Which is the fourth smallest value? (a) 2/11 (b) 3 (c) 0 (d) 0.3 (e) -116 d What is the third biggest value in 5, 396, -1/6? -1/6 What is the third biggest value in 1, -3/4, 21? -3/4 What is the third biggest value in -96/73, 3, 2/3? -96/73 What is the second biggest value in -7.3, 0.5, 6? 0.5 What is the biggest value in -2, -125, 5? 5 Which is the smallest value? (a) -1 (b) 360 (c) 5 (d) 0.5 (e) 2/7 a Which is the second biggest value? (a) 1/4 (b) 12 (c) 3 (d) 0 (e) -35 c Which is the second biggest value? (a) -4/11 (b) -1 (c) -2/15 (d) 0.19 c Which is the biggest value? (a) -0.07 (b) 3 (c) -1 (d) 1/4 (e) 1/3 b What is the second smallest value in -3/7, 2/23, 5, 2/11? 2/23 What is the third biggest value in 0.2, 718, -4/7? -4/7 What is the third biggest value in 2, -7, -1/30? -7 Which is the third biggest value? (a) 2 (b) 2.3 (c) -1/197 c Which is the third biggest value? (a) -4 (b) -0.2 (c) -1/2 (d) 5 c Which is the fourth smallest value? (a) 6 (b) 2 (c) -1.5 (d) 2/9 a What is the third smallest value in 2, 41, -4/3, -0.2? 2 Which is the second smallest value? (a) -3/5 (b) 0 (c) -1484 a Which is the third biggest value? (a) 2/33 (b) 0.5 (c) -4 c Which is the biggest value? (a) -0.2 (b) 858 (c) -2 b What is the third smallest value in 11, 1/7, -3, 2/9? 2/9 Which is the second smallest value? (a) -5 (b) 1 (c) 1537/4 b What is the biggest value in -0.12, 2, 0, -1/6? 2 Which is the third biggest value? (a) -2/41 (b) -1/18 (c) 3/8 (d) -2 b Which is the biggest value? (a) 5 (b) -3 (c) 1/13 (d) -1 a What is the fifth biggest value in 3, 5, -1, 6, 1? -1 What is the fourth smallest value in -67, -4, -11, 0.2? 0.2 Which is the second smallest value? (a) 4/9 (b) -0.02 (c) 2 a Which is the smallest value? (a) 0.2 (b) 0 (c) 247 (d) 0.1 (e) 3 b Which is the second smallest value? (a) 0.5 (b) -0.23 (c) -31/7 b Which is the second smallest value? (a) 3 (b) 363 (c) 5 (d) 0.5 (e) -1/3 d What is the fourth biggest value in 3, 8/3, 26, -0.3? -0.3 Which is the second smallest value? (a) 3 (b) 341 (c) 1/2 (d) 0.1 (e) -0.2 d What is the second biggest value in -1, 22/7, -0.1, -1/6? -0.1 Which is the biggest value? (a) -2/11 (b) 0 (c) 4 (d) -25 c Which is the biggest value? (a) 3 (b) -2/3 (c) -430 (d) -3 a Which is the second smallest value? (a) 44.7 (b) 5 (c) 0.4 b What is the fourth biggest value in -0.5, -1/3, -4/3, 5? -4/3 What is the third smallest value in -0.2, 5/7, 18.6? 18.6 What is the third smallest value in -4, -321, 5? 5 What is the biggest value in 4, 0.2, 2.7? 4 What is the third smallest value in -0.5, 1/154, 1, -2/11? 1/154 What is the second biggest value in 2, -3, -105, 0.5? 0.5 What is the smallest value in 0.1, -3/8, 0.228, 3? -3/8 Which is the third biggest value? (a) -0.4 (b) 6/5 (c) 4 (d) -3/11 (e) 0 e Which is the biggest value? (a) -0.2 (b) -1/55 (c) 0 c What is the biggest value in 1, -1006, -2? 1 Which is the third biggest value? (a) 0.05 (b) 0.5 (c) -3/2 c Which is th	{ "pile_set_name": "DM Mathematics" }
alculate the remainder when x is divided by p. 0 Calculate the remainder when (-2)/(-5) + 129/15 is divided by 6. 3 Suppose z = 5z - 204. Suppose -4x - z = -7x. Calculate the remainder when x is divided by 6. 5 Let g = 23 - -13. What is the remainder when g is divided by 19? 17 Let q(n) = n3 - 12n*2 + 13n - 15. What is the remainder when 27 is divided by q(11)? 6 Let p(d) = 7d - 1. Let b = 1 + 1. Suppose 28 = bk + 6. Calculate the remainder when k is divided by p(1). 5 Let n(d) = d - 1. Let l be n(1). Suppose m - 19 = -2j, l = 4m - 4j + j - 32. What is the remainder when 30 is divided by m? 8 Let p be 0(-2)/4 - 6. What is the remainder when 93/(-3)(0 - 1) is divided by (p/4)/((-15)/160)? 15 Let g(v) = 2v*2 - v - 6. Let h be g(6). Let a = 123 - h. Let d = a + -28. Calculate the remainder when d is divided by 12. 11 Suppose 0 = 4r + z - 7, 0r + 4r = -2z + 6. Suppose 8 = i + i. What is the remainder when r/(-3)(-174)/i is divided by 15? 14 Suppose -2s = -3o + 94, -3s = -s + 10. Let d = -1 - -11. What is the remainder when o is divided by d? 8 Let f(b) = -61b*3 - 5b - 4. Calculate the remainder when f(-1) is divided by 33. 29 Let x = -15 - -33. Calculate the remainder when 34 is divided by x. 16 Let t = 13 + 7. Suppose 6b = b + t, -10 = o - 3b. Calculate the remainder when o is divided by 2. 0 What is the remainder when 18 is divided by -6 - (3 - (6 + 16))? 5 Let k(d) = 25d2 - d - 1. Calculate the remainder when 45 is divided by k(1). 22 Suppose 3v + 2v = -5a - 95, 2v - 2a = -26. Let l = v - -30. Suppose -r = -3r + 52. What is the remainder when r is divided by l? 12 What is the remainder when 70 is divided by 3/((-1)/36-3)? 34 Calculate the remainder when 6/2-233/(-9) is divided by 6. 5 Let c = 8 - 2. Suppose -2o + 59 = 1. Let z = -13 + o. What is the remainder when z is divided by c? 4 Let k(j) = 7j + 8. What is the remainder when k(11) is divided by 29? 27 Let p(t) = 15t3 + 2t*2 - 1. What is the remainder when (-5)/((-60)/(-8))-931 is divided by p(1)? 14 Let d = 7 + 22. Calculate the remainder when d is divided by 10. 9 Suppose -12 = -l + 4l. Let m(o) = 3o + 2. Let r be m(l). Let g(n) = -3n + 1. Calculate the remainder when g(r) is divided by 11. 9 Suppose -2i + d + 32 + 21 = 0, -4i - 3d + 121 = 0. Calculate the remainder when 55 is divided by i. 27 Let n = 49 - 21. Suppose -3i = 17 - 350. Calculate the remainder when i is divided by n. 27 What is the remainder when 11 is divided by (-18)/(-4) + 2/(-4)? 3 Let j = -7 - -8. Let g be (-59 + -1 - -2)/j. What is the remainder when 7 is divided by g/(-12) - (-3)/18? 2 Suppose -3k = -u - 2u + 3, -5u - 5 = 5k. Suppose u = 2b - b - 14. What is the remainder when 40 is divided by b? 12 Suppose 0u + 5u = -5p + 80, -18 = -3u + 3p. What is the remainder when 20 is divided by u? 9 Let x(a) = 3 - 11a3 + 5 - 4 - 3. Let g be x(-1). Let i = g + 2. What is the remainder when 39 is divided by i? 11 Let w = 2 + -2. Suppose z + 0 + 5 = w, -5u - 2z + 15 = 0. Suppose -k = uf - 24, -3f = -0k + 3k - 24. What is the remainder when 7 is divided by f? 3 Let l(w) = w3 + 7w*2 - w - 6. Let j be l(-7). Let p = j + 33. What is the remainder when p is divided by 12? 10 Suppose 2j - 31 = -3u, 3j - 6 = -0j. What is the remainder when u is divided by 4? 1 Let r(l) = l + 13. Let q = -20 + 13. Suppose 5i - n = 108, -5n + 3 = i - 3. Calculate the remainder when i is divided by r(q). 3 Suppose -4d = -2o - 82, d = -2o - o + 3. Suppose -2j - 17 = -5b - 3j, 0 = -3b + 2j + d. What is the remainder when 10 is divided by b? 2 Let d(b) = b2 - b - 4. Let q be d(-4). Suppose 2z + 2z = -q. What is the remainder when (-2 - -4)/(z/(-54)) is divided by 14? 13 What is the remainder when (-172)/(-10)(-50)/(-20) is divided by 9? 7 Let m = 2 - 7. Let v = m - -4. Calculate the remainder when 20 + v - 0/(-4) is divided by 10. 9 Suppose 0 = -3a + 18 + 6. Suppose 2h = -3x + 7h + 47, 0 = -x - h + 13. Calculate the remainder when x is divided by a. 6 Suppose -a + 74 = 48. What is the remainder when 101 is divided by a? 23 Suppose 5l - t + 6t = 5, 2l - t = 8. Suppose 6j = lj + 24. Suppose 2f - 15 = -3h, 0 = -0h - h - f + 6. What is the remainder when j is divided by h? 2 Let x = -61 - -154. Calculate the remainder when x is divided by 32. 29 Let n(q) = 13q + 14. Let u be n(12). Let m be -2(0 - 1) + 4. Suppose 0 = mh - h - u. Calculate the remainder when h is divided by 18. 16 Let c = -2 + 14. Calculate the remainder when 32 is divided by c. 8 Suppose -5a = 2p - 43, -4a = -16 + 4. Suppose 3o = 2o + 39. Calculate the remainder when o is divided by p. 11 Let t(m) = 3m2 + 5m + 4. What is the remainder when 61 is divided by t(-4)? 29 Let f = 39 - 16. What is the remainder when f is divided by 15? 8 Let y be 2 + -2 + 3 + -14. Let d = 28 + y. What is the remainder when d is divided by 10? 7 Suppose -5h + 42 = -43. Suppose -4l + 15 = l, -h = -2p + l. Calculate the remainder when 38 is divided by p. 8 Suppose -r = -1 - 2. Suppose rd - 287 = -5o, o + d = -d + 56. What is the remainder when o is divided by 20? 18 Suppose 0 = -4k + 4 + 4. Let l = -7 - -10. Calculate the remainder when l is divided by k. 1 Let r = 2 + 0. Suppose 4t + r = -y, -y = -4y - 4t + 18. Let o(w) = -w3 + w2 + 4w + 4. What is the remainder when o(-3) is divided by y? 8 Suppose -3v - 2v + 209 = -3b, -3v = 5b - 139. What is the remainder when v is divided by 11? 10 Let f = 175 - 116. Calculate the remainder when f is divided by 12. 11 Suppose i - 5g - 19 = 2i, -8 = 2i + 4g. Calculate the remainder when 22 is divided by i. 4 Suppose -4a + 2d + 126 = -222, -5a + 448 = 4d. What is the remainder when a is divided by 23? 19 Let r = 7 + 37. What is the remainder when r is divided by 9? 8 Let f = -27 + 45. Calculate the remainder when 1/4 + 283/4 is divided by f. 17 Let b(f) = 2f - 5. Let m(r) = -6r - 1. Let k be m(-1). Let a be b(k). Suppose aw = 4x - 27, -3x + 57 = x + w. What is the remainder when x is divided by 7? 6 Suppose q + 4q = 0. Suppose q = b + 2a + 2, -5a = -6b + 4b + 23. Calculate the remainder when 14 is divided by b. 2 Suppose 3n - 44 = 4d, 2d - 18 = -2n + 16. Suppose 12 + 24 = 6f. What is the remainder when n is divided by f? 4 Let a(k) = -k*2 + 10k - 1. What is the remainder when a(8) is divided by 9? 6 Let u(r) be the second derivative of r*5/20 - 5r*4/12 - 3r*2/2 + r. Let f = 132 - 123. What is the remainder when u(6) is divided by f? 6 Suppose 3z - 16z + 117 = 0. Calculate the remainder when 12 is divided by z. 3 Suppose -2j + 83 = 3z + 2j, j + 48 = 2z. What is the remainder when z is divided by 6? 1 What is the remainder when 1/(-3) - (-70)/3 is divided by 6? 5 Let l = 80 + -46. Let v(a) = -a + 6. What is the remainder when l is divided by v(-6)? 10 Let z = -11 + 21. Let d = -15 - -18. Suppose 4u = 4q + 12, -dq + 24 = 5u - 15. What is the remainder when z is divided by u? 4 Suppose -2y + 31 + 4 = 5v, 2y - v = 5. Suppose 2a + y = 27. Suppose -53 - 52 = -5u - n, 3n - 35 = -u. Calculate the remainder when u is divided by a. 9 Let m(f) = f2 - 3f - 1. Let p = -11 + 20. Calculate the remainder when m(6) is divided by p. 8 Suppose 3c = 4g - 55, -2g + 0c + 47 = 5c. What is the remainder when 37 is divided by 1g + 2 + 1? 18 Suppose -f - 109 = -4j + 362, j + f - 119 = 0. What is the remainder when j is divided by 20? 18 Suppose 10 + 20 = 2b. Calculate the remainder when 41 is divided by b. 11 Let x = -47 + 67. Suppose -2k = -4y + 16 - 0, -2k - 6 = -2y. Suppose -43 = -5h + 2w, -kw = -3h - h + 36. Calculate the remainder when x is divided by h. 6 Let h = -43 + 16. Let z = 35 + h. Calculate the remainder when 55 is divided by z. 7 Suppose -2a - 1 - 85 = 0. Let x = -23 - a. Suppose j - 7 = -5r, 2j + 5r - 17 = -3. Calculate the remainder when x is divided by j. 6 Let i = 97 + -78. What is the remainder when i is divided by 6? 1 Let c be 24/(-9)36/(-16). What is the remainder when 9 is divided by (-3 + c)8/6? 1 Suppose -2r + 93 = -35. Suppose 5a - w = r, -3w = -a + 2w + 32. Suppose -5j - 55 = -225. Calculate the remainder when j is divided by a. 10 Let t(m) = m*2 + 14. Let a = 141	{ "pile_set_name": "DM Mathematics" }
greatest common factor of p and k. 2 Suppose -10z + 5z + 180 = 0. Let r be ((-18)/(6/3))/(z/(-1176)). Calculate the greatest common factor of 6 and r. 6 Let q(l) = -8 + 6 - 9 - 4 - 9l - 1. Let u be q(-7). Calculate the greatest common divisor of u and 1175. 47 Let r(a) = 2a - 18. Let v be r(9). Let p be -5(v + (-170)/(-25)). Let g be (p/51)/((-2)/45). Calculate the highest common factor of g and 3. 3 Suppose -1606 = -4l - c + 791, -5c - 2415 = -4l. Calculate the greatest common factor of l and 1125. 75 Suppose 4l + 5a = 239, 51 = 2l + 4a - 61. Suppose 6r = 42 + l. Calculate the greatest common factor of 18 and r. 18 Let a be -8 + 5 + 1 - -16. What is the highest common factor of 11851 and a? 7 Let a = -6103 + 6133. What is the greatest common factor of a and 7890? 30 Let k be (3016/14)/2 - (-14)/49. Suppose -12x - k + 2352 = 0. Calculate the greatest common divisor of 17 and x. 17 Let t = -408 + 404. Let q be t/(-34) - 14/(-357)4791. Calculate the greatest common factor of 8 and q. 4 Let i = 21552 + -13676. What is the greatest common factor of 88 and i? 44 Let p(f) = -f3 + 8f*2 - 28. Let m = 251 + -244. Let h be p(m). Let b be 12/54 - (-374)/18. Calculate the greatest common factor of h and b. 21 Let c be -3 - (-33)/(2 - 20/16). Suppose -50 = -a - c. Calculate the greatest common divisor of a and 171. 9 Let s = 16 + -13. Suppose -sk + 523 = 73. Suppose -6z = -114 - k. Calculate the greatest common factor of z and 88. 44 Let m be -87((-1875)/45)/1. Calculate the highest common factor of 75 and m. 25 Let g be (-1 - -128) + (11 - 2 - 3). Let v = g + -113. What is the greatest common factor of 580 and v? 20 Suppose -9a - 68 = -3m - 4a, -4m + a + 68 = 0. Suppose 0 = mu - 29u + 143. Calculate the greatest common factor of 506 and u. 11 Let h = 718 - 718. Suppose 3q = -3o + 108, 3q = -4o - ho + 104. What is the highest common factor of q and 24? 8 Let u be 12/(-10)80/32(-1282 + -3). What is the highest common divisor of 45 and u? 15 Let x(m) = 2m*3 - 78m*2 + 77m - 24. Let q be x(38). Let c be (-10)/25 - (-772)/5. What is the highest common divisor of c and q? 14 Let t be (-6)/(-9)(-36)/(-6)1. Let a be 12/(-4)(6 - t)/(-2). Suppose -2g + 3 = 1. What is the greatest common divisor of a and g? 1 Suppose 0 = b - h + 11, 2b + 14h = 18h - 26. Let x(y) = -y3 - 9y*2 - 12y + 7. Let q be x(b). What is the greatest common divisor of 23 and q? 23 Let l(r) = -3r2 + 226r - 274. Let j be l(74). What is the highest common factor of j and 13618? 22 Suppose 5z - 3c + 65 - 166 = 0, 100 = 4z + 4c. Calculate the greatest common factor of z and 2354. 22 Suppose 0 = -6v - 4q + 428, -4q = -2v - 2q + 166. Calculate the highest common factor of v and 95. 19 Suppose 96q - 97q - 418 = 0. Let h = q - -500. Let f(k) = 9k*2 - 4k - 3. Let r be f(-2). What is the highest common divisor of r and h? 41 Let h be 44(-6 + 10 - 1-4). Suppose 0w + 3 = -3w. Let t be -3(w - (23/3 + 2)). Calculate the highest common factor of t and h. 32 Let k(r) = -r3 + 30r - 2 + 6 + 13r2 + 0 + 4. Let w be k(15). What is the greatest common divisor of 40 and w? 8 Let f = -49 + 91. Let x = 39 - f. Let t(i) = 8i*2 + i - 1. Let d be t(x). Calculate the highest common factor of 17 and d. 17 Suppose -64 - 94 = -30n - 68. Calculate the greatest common divisor of 887 and n. 1 Suppose c + 4f - 43 = 50, 0 = 3c - 5f - 228. Let u = c + -53. Calculate the highest common divisor of u and 56. 28 Suppose -6s = -2s - 860. Let i be 83 - (-4 + 8) - -7. What is the greatest common factor of s and i? 43 Let i(a) = a3 + a + 7660. Let v be i(0). Suppose v + 134 = 6p. Suppose p - 3879 = -12b. Calculate the highest common factor of b and 43. 43 Let g(z) = 56z + 3 - 8z - 25z. Let q be g(-2). Let h = 57 + q. Calculate the highest common factor of h and 14. 14 Let d(p) = 264p2 - 5p - 5. Let j be d(-1). Let x = 407 - j. What is the greatest common factor of x and 39? 13 Suppose 417 = -16w + 17w - 3o, -3w = -4o - 1236. What is the highest common factor of w and 36? 12 Let t be (-3 + 10/(-6))-9. Let k = -5467 - -5698. Calculate the greatest common divisor of k and t. 21 Suppose -5v + 40 = 3i + 2i, -3v + 9 = -2i. Let j be 2/i + (-720)/(-54). Let k = 51 - 30. Calculate the greatest common divisor of k and j. 7 Let u(o) = -3o*3 - 43o*2 + 2o - 144. Let k be u(-16). Calculate the highest common factor of k and 624. 48 Let g(l) = -l*3 - 59l*2 - 58l - 3770. Let w be g(-60). What is the highest common divisor of w and 40? 10 Let a be ((-2232)/620)/((-1)/265). What is the greatest common divisor of a and 36? 18 Let s(a) = -2a2 - 10a*2 + 5a*2 + 272a - 2a - 25a*2 + 8. Let n be s(8). Calculate the greatest common factor of n and 200. 40 Suppose -17h + 860 = 157h - 532. Let k(s) = -s3 - 2s*2 + s - 4. Let m be k(-3). Suppose mg + 60 = 5g. What is the highest common divisor of g and h? 4 Let a be (380/(-50) + 6)/(1431/(-1425) + 1). Calculate the highest common factor of 140 and a. 20 Suppose 0 = -9r + 10741 - 2551. Calculate the highest common divisor of 60 and r. 10 Let i = 14855 + -5759. Calculate the greatest common divisor of 48 and i. 24 Suppose 2r + 2w - 13 = 15, 2r - 3w - 33 = 0. Let x be ((858/r)/(-13))/(2/(-20)). Calculate the highest common divisor of 66 and x. 22 Let a be (4 - (2 + 6)) + 12. Suppose 4n = a, 4b + 4 + 14 = n. Let c be 2 + (-8)/b + 6. What is the greatest common divisor of 10 and c? 10 Suppose 4h = 6h - 2318. What is the greatest common divisor of h and 19? 19 Let l(v) = -1. Let s(x) = -73x2 + 2x + 4. Let t(r) = -l(r) - s(r). Let j be t(-1). Suppose 2f - 18 = j. Calculate the highest common divisor of 30 and f. 15 Suppose 462 = 5a + 2r - 184, 4a = -r + 518. Calculate the highest common divisor of a and 18785. 65 Let j be (4 - -2) + (-90)/15 + -17 + 46. Let v = 9 - 7. Suppose -vz + 103 = 2r - 193, -4r = -z + 133. What is the greatest common factor of j and z? 29 Suppose 2 = i + 5l - 4l, 0 = 3l + 9. Suppose 131 + 235 = iv + 2g, -3v + 3g + 207 = 0. Calculate the highest common factor of 18 and v. 18 Suppose -6t + 102 = -4t. Let y = -35 + t. Suppose -y = -b - 2. Calculate the highest common divisor of b and 154. 14 Let j be ((-10472)/(-595))/(2/175). What is the highest common divisor of 3740 and j? 220 Let g = 573 + -525. Let w be (1 - -7)(-2)/(-4). Suppose -wy - g = -10y. What is the highest common divisor of y and 64? 8 Let y(n) = 25n*2 - 83n + 68. Let f be y(4). What is the greatest common divisor of f and 4352? 136 Let o = -854 - -870. What is the highest common factor of o and 4624? 16 Suppose 28 = 5a - 2l, 5l + 9 = 4a - 10. Suppose 4t = 9 - 105. Let i be 18/(3 + 63/t). Calculate the greatest common factor of i and a. 6 Suppose -1514 = -21r - 2r + 1591. What is the greatest common divisor of 185 and r? 5 Let i(n) = -9n - 178. Let c be i(-25). Suppose -ck = -35k - 168. What is the highest common divisor of k and 63? 7 Suppose -3n = -n - 8. Let d(b) = 2b*2 + 14b + 10. Suppose -5w = -2o - 19, -3w = w - 4. Let c be d(o). What is the greatest common divisor of n and c? 2 Let r(v) = v3 - v. Let u be r(1). Let f be (4 - (-12)/(-6))-1 - (-20)/5. Suppose -a - fa + 660 = u. Calculate the highest common factor of a and 88. 44 Suppose 2h + 4d + 504 = 0, 8d = -5h + 4d - 1248. Let y = -227 - h. What is the highest common divisor of 14 and y? 7 Let w(l) = -l*2 + 13l + 70. Let j be w(17). Let i be (-3 + -7)/j + (35 - 0). What is the greatest common divisor of 8 and i? 2 Suppose 16t - 2524 = 12260. Calculate the highest common factor of t and 588. 84 Let l = -390 + 393. Suppose 15 = -lv, -5c + 3v - 1465 = -10c. Calculate the highest common divisor of 37 and c. 37 Let a(x) = 260x*3 + 2x*2 - 3x. Let u be a(1). Let i = 269 - u. Calculate the greatest common divisor of i and 160. 10 Let z = 40 - 4. Suppose -5h - 2g - 14 + 306 = 0, 0 = h - g - 64. What is the greatest common factor of z and h? 12 Let g be (-2 - (-94)/8)/((-462)/(-12320)). What is the highest common factor of g and 62660? 260 Let m = 2407 - 2402. Calculate the greatest common divisor of m and 135. 5 Let t = -2986 + 3166. Calculate the highest common factor of t and	{ "pile_set_name": "DM Mathematics" }
15 - -13121? 12502 In base 10, what is -5 + 673293? 673288 In base 7, what is -5334033 - -5? -5334025 In base 15, what is 1 + 590b? 590c In base 8, what is 161375 - 10? 161365 In base 7, what is -111 + 5455? 5344 In base 15, what is a - 1eb9b? -1eb91 In base 9, what is -571 - 14202? -14773 In base 2, what is 1101101100 - -1111100111? 11101010011 In base 9, what is 1153287 - 2? 1153285 In base 2, what is 1001001101111110 - 1001100? 1001001100110010 In base 14, what is -125c13 - 5? -125c18 In base 14, what is -2 + 20c8? 20c6 In base 4, what is -1011112 - 2331? -1020103 In base 14, what is 6 - -a41? a47 In base 10, what is -23 + -6133? -6156 In base 3, what is -12002222 - -1210? -12001012 In base 5, what is -103313 - -4? -103304 In base 13, what is 14b6 - 56? 1460 In base 9, what is 63672 - -1? 63673 In base 10, what is 176054 - 4? 176050 In base 16, what is 8994 + 6? 899a In base 10, what is 380823 - -4? 380827 In base 11, what is a521 - -3? a524 In base 6, what is -212 - -511? 255 In base 16, what is -17d1 + 7? -17ca In base 15, what is -4 + -d74b? -d750 In base 12, what is -61076 - 25? -6109b In base 9, what is -1266237 + 2? -1266235 In base 4, what is 13 + 1122332? 1123011 In base 16, what is -171f - -4? -171b In base 10, what is -3 + -149214? -149217 In base 16, what is -dae0 + -10? -daf0 In base 6, what is 40 + -13451? -13411 In base 6, what is -255 - 15? -314 In base 10, what is 4 + -1234? -1230 In base 9, what is 4500 + -364? 4125 In base 16, what is -8ba0 + 5? -8b9b In base 5, what is -102 - -322332? 322230 In base 13, what is -6c + 6210? 6171 In base 5, what is 12032 - 212? 11320 In base 6, what is 0 + 5002523? 5002523 In base 9, what is 3 + 75473? 75476 In base 2, what is 1000100100100011 - -10011? 1000100100110110 In base 14, what is -15530 + 3? -1552b In base 14, what is -1a00 + a? -19d4 In base 13, what is -14c7c - 6? -14c85 In base 13, what is 49ba2 + -2? 49ba0 In base 5, what is -204320 - -31? -204234 In base 8, what is 4 + -105424? -105420 In base 5, what is 221404 + -3? 221401 In base 9, what is 352627 + 2? 352630 In base 2, what is 1101011100110011111111 - 10? 1101011100110011111101 In base 14, what is 2db1 - 2? 2dad In base 13, what is 3 + -70111? -7010b In base 10, what is -433 + -67? -500 In base 9, what is -4 + 13170? 13165 In base 13, what is 6ba - -6? 6c3 In base 3, what is 10 - 111221110? -111221100 In base 7, what is 22444 - -41? 22515 In base 5, what is 13443 + -44041? -30043 In base 6, what is 1505332 - -10? 1505342 In base 5, what is -234 + 2111321? 2111032 In base 14, what is 0 + 68559? 68559 In base 14, what is 37b4 - 1? 37b3 In base 15, what is e63 + -24d? c15 In base 9, what is -3600 - 13? -3613 In base 2, what is 10001001001101110011 - 1? 10001001001101110010 In base 15, what is 6714 - -12? 6726 In base 11, what is 36 + -3417? -3391 In base 7, what is 66 + 31325? 31424 In base 8, what is 3 - -10447? 10452 In base 7, what is 0 - -14414420? 14414420 In base 9, what is -111318 - -3? -111315 In base 15, what is 4d + -d6? -88 In base 3, what is -1011122101 - -10? -1011122021 In base 4, what is -23220002 - 10? -23220012 In base 2, what is 11111100010 + 11010111000? 111010011010 In base 16, what is -5 - -2c1c? 2c17 In base 4, what is 22123232031 - 0? 22123232031 In base 12, what is 1bab - a? 1ba1 In base 4, what is -10 + 102210331? 102210321 In base 4, what is 10010 - 101? 3303 In base 7, what is 243 + 36220? 36463 In base 8, what is 11606 - -272? 12100 In base 11, what is -58 - -7311? 7264 In base 3, what is -2 - 1012022002? -1012022011 In base 14, what is 2cc + -3? 2c9 In base 6, what is -1544241 - 0? -1544241 In base 13, what is -38b1473 + 4? -38b146c In base 5, what is -4000 + -100? -4100 In base 14, what is 6 - -5c3? 5c9 In base 10, what is -40 + -864? -904 In base 6, what is -21 + 210? 145 In base 10, what is -551797 - 2? -551799 In base 3, what is -1212220 - -211? -1212002 In base 14, what is -4 + -28129? -2812d In base 2, what is -10010001001011111110 + -11? -10010001001100000001 In base 2, what is 110110001101 + -100000? 110101101101 In base 15, what is -5 + -5511? -5516 In base 11, what is -1940 - 8? -1948 In base 8, what is -3533 - 2730? -6463 In base 14, what is -c4974 + 0? -c4974 In base 6, what is -24340 - -1135? -23201 In base 9, what is 3 + 11365? 11368 In base 14, what is 91 - -68? 119 In base 9, what is -635 - 40? -675 In base 6, what is -3210 - 2002? -5212 In base 3, what is 120 - 101211? -101021 In base 2, what is -11000110101101011 - 1011000? -11000110111000011 In base 16, what is -4 + -25a77? -25a7b In base 10, what is -1207782 - 1? -1207783 In base 13, what is -4 + 1a33a0? 1a3399 In base 15, what is -104 - -63? -91 In base 14, what is -4 + -3a57? -3a5b In base 3, what is -2 + -1000200022220? -1000200022222 In base 9, what is 63122 + 4? 63126 In base 12, what is -6b80 - 64? -7024 In base 4, what is -21231 - -10302? -10323 In base 3, what is -101221002212001 - -12? -101221002211212 In base 5, what is -1143230 + -221? -1144001 In base 13, what is 448 + 1984? 20cc In base 13, what is -85ab0 - 7? -85ab7 In base 5, what is 22200 - 1103? 21042 In base 8, what is 4344 + 45? 4411 In base 9, what is 2703562 - -5? 2703567 In base 14, what is 5 - -d269b? d26a2 In base 12, what is 5321 + 6? 5327 In base 10, what is 3 - -9418? 9421 In base 10, what is -4 - 15364? -15368 In base 16, what is 5e2ee + 0? 5e2ee In base 3, what is -110111 - 22111? -202222 In base 3, what is 1 - -10212200010? 10212200011 In base 12, what is -98 - -2b111? 2b035 In base 5, what is 114 + 1441412? 1442031 In base 15, what is 5 + 13654? 13659 In base 2, what is -1101110001 - 1101011001? -11011001010 In base 4, what is -10103000 - -13320? -10023020 In base 15, what is -5 + a122? a11c In base 7, what is 4553440 - -5? 4553445 In base 10, what is 3 - -6242? 6245 In base 11, what is 5 + -8416? -8411 In base 13, what is 4 - 255c? -2558 In base 11, what is -4 + -6126a? -61273 In base 5, what is 2143 + 1014? 3212 In base 4, what is -312231 - 12? -312303 In base 11, what is 0 - 998? -998 In base 3, what is 11 + 101120100? 101120111 In base 9, what is 1286258 + -3? 1286255 In base 13, what is 2 + -20b25? -20b23 In base 7, what is -36 - -1146? 1110 In base 4, what is 11 - 110212003? -110211332 In base 14, what is -1aadd + -2? -1ab01 In base 14, what is -2 - -123a7b? 123a79 In base 2, what is 11100001000011011 - 100? 11100001000010111 In base 12, what is a834 - 3? a831 In base 14, what is 4 - 9b54? -9b50 In base 11, what is 651 - 23? 629 In base 7, what is -2 + -101064? -101066 In base 9, what is 0 - -242426? 242426 In base 8, what is 37 - 436? -377 In base 16, what is -3a - 1058? -1092 In base 9, what is -2 + 23246? 23244 In base 11, what is 4 + -294274? -294270 In base 8, what is 22 - 34244? -34222 In base 8, what is -4 - -6203011? 6203005 In base 15, what is -4490d - 0? -4490d In base 16, what is 817 - -23? 83a In base 3, what is -20002 - -122212? 102210 In base 9, what is 224 - -427? 652 In base 14, what is -3 - 30992? -30995 In base 14, what is -b - 4c8? -4d5 In base 13, what is c6 - 314a? -3054 In base 11, what is -1aa + -2727? -2926 In base 14, what is 84 + -1d3? -14d In base 16, what is 1 + -30417? -30416 In base 13, what is -89980 + -1? -89981 In base 7, what is 36425 + -205? 36220 In base 7, what is 162 - 11? 151 In base 6, what is 420542 - -23? 421005 In base 9, what is 1144481 - 1? 1144480 In base 2, what is 10011100011111001 - -10110? 10011100100001111 In base 16, what is 3f62 + -2? 3f60 In base 10, what is 1706 - -3? 1709 In base 13, what is 11 + -91c76? -91c65 In base 3, what is -101 + 222201020122? 222201020021 In base 3, what is -10 - -20222011210? 20222011200 In base 8, what is 2 + -13367? -13365 In base 7, what is 1131636 - 5? 1131631 In base 3, what is 101 - 1020212221? -1020212120 In base 15, what is -6 + -30ea? -3101 In base 15, what is d47 + 7? d4e In base 4, what is 11023122 + -202? 11022320 In base 2, what is 10 + -10001111010100010? -10001111010100000 In base 14, what is 4442 - 4? 443c In base 6, what is 4 - -122214? 122222 In base 14, what is -1573 + -534? -1aa7 In base 14, what is 85798 - -5? 8579d In base 13, what is 0 + -c18? -c18 In base 12, what is -1040 + -733? -1773 In base 5, what is 4 + -1303? -1244 In base 6,	{ "pile_set_name": "DM Mathematics" }
or a. 1 Solve -2u = 12 - 4 for u. -4 Solve 0 = 25r - 85r + 240 for r. 4 Solve 162t - 168t = -18 for t. 3 Solve -94y - 174 - 390 = 0 for y. -6 Solve -4s + 18 = 6 for s. 3 Solve 2o + 34 = 38 for o. 2 Solve -18y = -25y + 28 for y. 4 Solve 0 = 4f + 6 - 26 for f. 5 Solve 0 = 25a - 28a - 6 for a. -2 Solve 64k - 49k = 105 for k. 7 Solve -543 = 7p - 578 for p. 5 Solve -15 - 3 = -9i for i. 2 Solve 19 = 3v - 5 for v. 8 Solve -5b - 29 + 19 = 0 for b. -2 Solve 12g = -8 - 28 for g. -3 Solve -2k + 6 = 4k for k. 1 Solve -1124h = -1130h + 36 for h. 6 Solve -4b - b = -20 for b. 4 Solve 4 = 10j - 9j for j. 4 Solve 340 = 73m + 12m for m. 4 Solve -4w + w = -4w for w. 0 Solve 35 = 19p + 111 for p. -4 Solve 6 = 9g - 3 for g. 1 Solve -46x + 45x = 0 for x. 0 Solve 0 = 2t - 17 + 5 for t. 6 Solve 750 = -95k - 105 for k. -9 Solve -9j + j + 32 = 0 for j. 4 Solve -23a + 13a = -30 for a. 3 Solve -4 = 29u - 33 for u. 1 Solve 13q + 414 = 336 for q. -6 Solve -27y + 23y = 20 for y. -5 Solve -205v = -197v for v. 0 Solve -39 = 16g + 9 for g. -3 Solve -9 = -5k - 14 for k. -1 Solve 0 = 8d + 349 - 293 for d. -7 Solve -45d - 5d = -300 for d. 6 Solve 18r + 48 + 42 = 0 for r. -5 Solve 0 = 34s + 10 - 78 for s. 2 Solve -19m + 141 - 46 = 0 for m. 5 Solve 13m - 6m = -7 for m. -1 Solve -9 = -10h + 11 for h. 2 Solve -11k - k = -3k for k. 0 Solve 2q = -2 + 8 for q. 3 Solve 0 = -92r + 83r + 36 for r. 4 Solve 614d - 147 = 593d for d. 7 Solve 58 - 88 = 5b for b. -6 Solve -40 = 4q - 12q for q. 5 Solve 7v = -4v - 11 for v. -1 Solve -56i = -44i + 60 for i. -5 Solve 49 = -5j + 44 for j. -1 Solve 0 = -6i - 0 + 6 for i. 1 Solve -12 = -2r - 20 for r. -4 Solve 21l - 659 = -617 for l. 2 Solve -10v + v = -18 for v. 2 Solve -26u + 23u = 15 for u. -5 Solve -48a = 57 - 249 for a. 4 Solve -399 = -10c - 459 for c. -6 Solve 26d - 33d = -42 for d. 6 Solve -55w = -460 + 75 for w. 7 Solve 5g = -41 + 61 for g. 4 Solve -8h = 43 - 3 for h. -5 Solve 0 = -4d - 0d for d. 0 Solve 16c - 50 + 2 = 0 for c. 3 Solve 12 = -2w + 6 for w. -3 Solve -16 = -10y + 6y for y. 4 Solve 51 = -10b + 11 for b. -4 Solve -415a - 270 = -442a for a. 10 Solve -40 = -35b - 250 for b. -6 Solve 4j + 11 = -5 for j. -4 Solve -13f + 10 = -11f for f. 5 Solve 2o + 2o + 16 = 0 for o. -4 Solve -53w + 39w - 42 = 0 for w. -3 Solve -27y + 70 = -13y for y. 5 Solve 0 = -57c + 68c + 55 for c. -5 Solve 22g + 117 = -17g for g. -3 Solve 18g - 39 = -57 for g. -1 Solve -3c + 7c - 16 = 0 for c. 4 Solve 0 = -71g + 240 + 115 for g. 5 Solve -87h + 92h = 5 for h. 1 Solve 9g - 46 = -64 for g. -2 Solve 11d - 77 = -22 for d. 5 Solve -6t + 4 = -4t for t. 2 Solve 5 - 47 = 21g for g. -2 Solve 496 = 8k - 132k for k. -4 Solve 29u - 37u = 16 for u. -2 Solve 56q = -5q - 427 for q. -7 Solve -1 = -7d - 15 for d. -2 Solve 0 = -10h - 25 - 75 for h. -10 Solve -45q - 94 = -4 for q. -2 Solve -29q + 8 - 8 = 0 for q. 0 Solve -15u - 87 = 3 for u. -6 Solve 0 = 352v - 384v + 256 for v. 8 Solve 73 = 14y + 17 for y. 4 Solve -4 = -74b + 70b for b. 1 Solve 17g = 15g + 6 for g. 3 Solve -130 = -d - 128 for d. 2 Solve -141y = -146y + 45 for y. 9 Solve 11 = -7a + 4 for a. -1 Solve -13f - 41 = -119 for f. 6 Solve -34 + 10 = 24b for b. -1 Solve -8d + 11d - 9 = 0 for d. 3 Solve 5 + 16 = -7f for f. -3 Solve -290 = -23i - 221 for i. 3 Solve 40 = -2i + 10i for i. 5 Solve -5x = 4 + 11 for x. -3 Solve 38k = 39k - 6 for k. 6 Solve 0 = 75h - 66h + 9 for h. -1 Solve -l = 4 - 9 for l. 5 Solve 0 = -6l + l - l for l. 0 Solve -5b = 4b - 36 for b. 4 Solve 1 = t + 2 for t. -1 Solve -37z = 47z + 756 for z. -9 Solve a + a + 6 = 0 for a. -3 Solve -24q - 33 = 9q for q. -1 Solve 391 - 397 = -3j for j. 2 Solve 2k - 1 + 5 = 0 for k. -2 Solve 43w = 45w + 6 for w. -3 Solve 0 = -6v - 13v + 5v for v. 0 Solve 0 = -14t + 2t + 36 for t. 3 Solve d - 20 = -16 for d. 4 Solve j + 7 = -3 for j. -10 Solve 0 = 6n + 45n - 306 for n. 6 Solve 0 = -52k + 84 + 176 for k. 5 Solve -7j - 19j - 130 = 0 for j. -5 Solve 12 = -13h + 90 for h. 6 Solve 3w = 4w + 13w for w. 0 Solve 314 = -65h + 54 for h. -4 Solve -10 = 3a - 5a for a. 5 Solve 914n + 180 = 894n for n. -9 Solve -2 = -5t + 3 for t. 1 Solve 8s + 3s = s for s. 0 Solve -52s = -59s + 14 for s. 2 Solve -31m - 2 = -30m for m. -2 Solve -46u - 36 = -58u for u. 3 Solve 38g + 37 = 265 for g. 6 Solve 10 = -5g + 35 for g. 5 Solve -150 = -4a - 154 for a. -1 Solve 38 = 6c + 62 for c. -4 Solve 0 = -4r + 1 - 13 for r. -3 Solve 76f - 153 = 25f for f. 3 Solve -132x + 127x + 25 = 0 for x. 5 Solve -50 = 64o - 54o for o. -5 Solve -130 = 24a + 14 for a. -6 Solve -51 - 29 = -10y for y. 8 Solve a - 9 = -7 for a. 2 Solve -22u + 6 = 6 for u. 0 Solve -67r - 3 = -66r for r. -3 Solve 3129w - 3137w = 56 for w. -7 Solve -141 = k - 135 for k. -6 Solve 7y + 27 = -2y for y. -3 Solve -15y - 12 = -87 for y. 5 Solve 87s - 93s - 6 = 0 for s. -1 Solve -69c - 12 = -71c for c. 6 Solve 4s - 13 = -17 for s. -1 Solve 0 = -16z - 5 - 11 for z. -1 Solve -110j + 6 = -113j for j. -2 Solve -32h - 24 + 120 = 0 for h. 3 Solve 4a + 161 = 161 for a. 0 Solve 520j = 495j + 125 for j. 5 Solve 61g - 59g = -6 for g. -3 Solve 17u - 23u + 18 = 0 for u. 3 Solve -13 = 6f - 19 for f. 1 Solve 416a - 434a = -36 for a. 2 Solve -13w + 460 - 499 = 0 for w. -3 Solve -47t + 284 = 96 for t. 4 Solve 11g - 19 + 41 = 0 for g. -2 Solve -31a + 12a + 57 = 0 for a. 3 Solve -260 = 69c - 17c for c. -5 Solve 3f = 11f + 16 for f. -2 Solve -12j - 11 = -47 for j. 3 Solve -6s = -20 + 62 for s. -7 Solve -10f + 20 = -14f for f. -5 Solve 0 = -12p - 19 + 67 for p. 4 Solve -37v + 126v = 712 for v. 8 Solve 0 = 5y - 28 + 8 for y. 4 Solve 50 = -44y + 54y for y. 5 Solve -65p = -75p + 60 for p. 6 Solve -48 + 3 = -15g for g. 3 Solve -7p = 13p + 60 for p. -3 Solve 0 = -5m - 10 - 10 for m. -4 Solve -2 = -4b + 2b for b. 1 Solve 9n = 517 - 526 for n. -1 Solve -7a + 4 = -8a for a. -4 Solve 118 = -29u + 350 for u. 8 Solve -42b = -27b - 135 for b. 9 Solve 323v + 28 = 309v for v. -2 Solve 13 = -24r - 35 for r. -2 Solve 11m - m = -60 for m. -6 Solve 2n - 13n + 11 = 0 for n. 1 Solve 42a - 46a = -12 for a. 3 Solve 0 = -348x + 346x - 6 for x. -3 Solve 6 = -n + 11 for n. 5 Solve 115 = -48a - 125 for a. -5 Solve -1319f + 1320f = 0 for f. 0 Solve h - 5 = -0h for h. 5 Solve -7 = -2z + 5 for z. 6 Solve 47y + 279 = -191 for y. -10 Solve 0 = 33y - 111 - 87 for y. 6 Solve 11b - 16 = 72 for b. 8 Solve 0 = -19k - 97 + 2 for k. -5 Solve 1240h - 116 = 1211h for h. 4 Solve -4 = 23h - 19h for h. -1 Solve -15 - 251 = -38b for b. 7 Solve -409 = -33x - 574 for x. -5 Solve 7u + 10 = 5u for u. -5 Solve -40v - 90 = -22v for v. -5 Solve 10y = 18y - 16 for y. 2 Solve -21 + 23 = 2y for y. 1 Solve -51b = -15b - 252 for b. 7 Solve -2i + 6i - 16 = 0 for i. 4 Solve -28v = -24v + 16 for v. -4 Solve 6o - 4o = o for o. 0 Solve -36 + 24 = -6d for d. 2 Solve -18a + 15a = -6 for a. 2 Solve -47l = -91 - 3 for l. 2 Solve 5p = 19 - 9 for p. 2 Solve 14h - 22h = 24 for h. -3 Solve 153 = -150j + 99j for j. -3 Solve 0 = -5m - 132 + 112 for m. -4 Solve -3j = -50 + 41 for j. 3 Solve 9b + 62 = 107 for b. 5 Solve -4 = -7l - 32 for l. -4 Solve -4y - 9y = 39 for y. -3 Solve -l - 17 = -13 for l. -4 Solve 0 = 4l + 8l + 24 for l. -2 Solve 29l = 6l + 46 for l. 2 Solve -19d - 6d = -100 for d. 4 Solve r - 234 = -25r for r. 9 Solve -11 = 9a + 7 for a. -2 Solve 21k + 54 = -6k for k. -2 Solve 26w - 13w = -13 for w. -1 Solve -4f - 54 + 50 = 0 for f. -1 Solve 8c + 21 = c for c. -3 Solve 3j + 7 = -5 for j. -4 Solve -2a + 152 - 154 = 0 for a. -1 Solve 32 - 35 = -r for r. 3 Solve -4l + 44 = 7l for l. 4 Solve 7p + 1 = 8 for p. 1 Solve 149i - 144i + 15 = 0 for i. -3 Solve 3s = -89 + 101 for s. 4 Solve -34n - 39n = 292 for n. -4 Solve -359j + 343j = -32 for j. 2 Solve -9 = 6c + 9 for c. -3 Solve 167n = 172n - 10 for n. 2 Solve 0 = -24i - 1621 + 1453 for i. -7 Solve 1560c = 1545c for c. 0 Solve 5q = q - 20 for q. -5 Solve -7r - 3r = 30 for r. -3 Solve -19y + 12y + 28 = 0 for y. 4 Solve 4z + 1159 = 116	{ "pile_set_name": "DM Mathematics" }
- 90 = -728. What is g(z)? 6 Let d(q) = -2q3 + 4q - 3. Let l(n) = 16n - 164. Let o be l(11). Suppose -t = 4w - 13, 2t + 0 - o = -w. Determine d(w). -11 Suppose -4n - 140c + 9 = -139c, -n + 6 = c. Let o(p) = 10p3 + 9p*2 - 8p. What is o(n)? 11 Let x be (-10)/(-5) + -5 - (-17)/1. Suppose -j = -0j - 5a - x, -4j = -4a + 8. Let d(c) = 6c + 125c*2 - 69c*2 + 9 + c - 61c2 - c3. What is d(j)? 3 Let p(l) = -30 - 55l + 644l - 84 - 584l. Calculate p(16). -34 Let k(h) = 11h - 84. Suppose 13l - 891 = -55l - 31l. Calculate k(l). 15 Let a(y) be the first derivative of y3/3 + 2y*2 - y + 473. Let h = -41 + 37. What is a(h)? -1 Suppose -180 = -38q + 2q. Let z(h) be the first derivative of -h3/3 - 3h*2/2 + 7h - 149. Give z(q). -33 Let n = -173 + 175. Suppose -3w + 4k = -w + n, 0 = 5w + 5k + 65. Let s(l) = l*3 + 9l*2 - 2l - 3. Calculate s(w). 15 Let c(y) = 3y2 + 316y - 21. Let q(v) = -5v2 - 503v + 32. Let w(l) = -8c(l) - 5q(l). Determine w(13). 8 Suppose 4b - 12 = -4y, 3b = 4y - 10 - 2. Let r(g) = -5g3 + 4g*3 + 0g3 + 22 + g2. What is r(b)? 22 Let z(t) = t*3 - 17t*2 + 27t + 52. Let l be -14 + -145 + 164. Calculate z(l). 7 Let q(m) = 5m + 1 + 4 - m - 6m. Suppose 0 = w + 5, -90 = 2v - 4v - 2w. Suppose 0 = 4g - 14g + v. Give q(g). -5 Let t = -64 + 32. Let z = 39 + t. Let n(i) = -z + 15 - i - 8. Give n(-1). 1 Let q(g) = -g*3 - 8g*2 - 5g + 22. Let s be 2/(-70)-10 + (-51)/7. Determine q(s). 8 Let t(m) = -28m. Let o = 76 + -66. Suppose 13 = -5x - 4d, 3x + od - 6d + 11 = 0. Calculate t(x). 28 Let c = 16 - 14. Let p(m) = 7 + m3 + 7m*c - 11m*2 - 7m + 0m. Let l be p(5). Let q(o) = 2o + 3. Give q(l). -3 Suppose 2k = -o + 109, -22o = -19o + 4k - 325. Let m(h) = 204 - o + h*2 - 103 - 3h. What is m(6)? 12 Let j(x) be the first derivative of -x*3/3 + 9x*2/2 - 6x + 11851. Suppose -5a = -0a - 2m - 40, 2a - 16 = -3m. What is j(a)? 2 Let s be 0 + 47 - (1 + -2). Let l(i) = i3 + 100i*2 - 94i + 709. Let p be l(-101). Let w(y) = 4y2 - 2 + 49y*3 - p + 1 - sy3. Give w(-4). -3 Let m(c) = c - 14. Let t = -61 + 60. Let n be ((0/(-4))/(-5))/t. Give m(n). -14 Let w(g) be the third derivative of -g4/24 - g*3/3 - 6g*2. Suppose -2z - 3992 = -3976. Calculate w(z). 6 Let u(z) be the first derivative of z*4/2 + 20z*3/3 - 4z + 3061. Calculate u(-10). -4 Let y(h) be the second derivative of -3 + 1/20h5 + 1/3h*3 - 1/2h*2 + 39h + 1/6h4. What is y(-3)? -16 Let b = 5113 + -5122. Let t(a) = a2 + 7a - 12. Give t(b). 6 Let c = -520 + 522. Let i(r) = 38r + 1. Let o(l) = -77l - 3. Let k(f) = co(f) + 5i(f). What is k(1)? 35 Suppose 0 = f + 3b - 2, -5b - 10 = 5f. Let i(l) = -245145l - 3 + 245148l - 5l*2 - 2l*3 + 2. What is i(f)? 35 Suppose -12r + 30 = -6r. Let j(v) = 4v - 13 + 12v - 20v + rv. Calculate j(10). -3 Let h(o) be the first derivative of -o3/3 + 7o + 1574. Calculate h(-2). 3 Let c = 130 + -62. Let m(h) = 34h + 33h - ch - 2h2 - 5 + h2. Give m(-4). -17 Suppose 5o = 0, p - 2o + 6o = 0. Let g(n) = -n2 - 14n. What is g(p)? 0 Let f(v) = -8v3 - v2 - 4v - 2. Suppose 5m = -5n + 9n - 16, -5n - 5m - 25 = 0. What is f(n)? 9 Let t be (-11/1 + 3)135/(-54). Let h(z) = 13z + 23. Determine h(t). -42 Let h(l) = -26l - 5. Let q(w) = -31w + 196 - 44w - 111 - 99. Let c(s) = 11h(s) - 4q(s). Give c(-2). -27 Let z(q) = 2q*3 + 8q*2 + 7q - 2. Let f be 33/(-15) - 34/(-170). What is z(f)? 0 Let y(q) = -38 + 3q3 - 10q*3 + 2q3 + 17 + q2 + q + 23. Give y(2). -32 Suppose 4l + 36 = 16. Suppose -t - 72 = -10t. Let y(b) = -1 - 1 - 5 - 19b2 + 18b*2 - tb. Calculate y(l). 8 Let l be (1 - 1) + 4 - -542/(-60). Let g(h) be the first derivative of 0h + lh2 - 9. Determine g(7). 7 Let h(l) = l - 7. Let i(u) be the first derivative of -u3/3 + 13u*2/2 + 5u - 4. Let a be i(13). Suppose -25 + 0 = -ag. Calculate h(g). -2 Let x(s) = s2 - 10s + 4. Let k be x(10). Suppose -17 = -5m + 3g, -km + 0 = 3g - 19. Let y(i) = -7i - 5. Give y(m). -33 Let s be 3 + 5/100. Suppose sh = -0h - 3h. Let m(r) be the second derivative of -r5/20 - r4/12 + r3/6 - 6r*2 - 2r. Calculate m(h). -12 Let a(h) = -h + 5. Let r(f) = -3f2 - 2f + 2. Let m be r(-2). Let t = 4104 - 4107. Let i be (-1 - -1)t/m. What is a(i)? 5 Let t be (-15 + 5 - -9)(-1 - 0). Let o(b) = -b - 9. Let f(s) = -3. Let m(x) = to(x) - 2f(x). Determine m(-4). 1 Let f be (-4)/(-3 + 4) - (-7)/1. Let y = f - 2. Let d(n) = 0 - 25n + 26n - y. Give d(-3). -4 Let o(v) be the third derivative of -v*5/30 + 5v*4/8 - 3v*3/2 + 4597v2. Calculate o(6). 9 Let a(j) = j2 + 2j - 2. Let o(w) = -2w*2 + w + 10. Let q be o(3). What is a(q)? 13 Let k(m) = 25m - 49. Let o(b) = -48b + 96. Let w(u) = -13k(u) - 6o(u). Let g be w(2). Let t(n) = -n - 17. Calculate t(g). -4 Let w(z) = 14z - z*3 + 852 + 999 - 1854 - 6z*2. What is w(2)? -7 Let v(w) = 26w + 23 - w - 6w + 7w + 31w + 2w*2. Give v(-28). -5 Let l(k) be the second derivative of -11k4/12 + k2/2 + k. Let z(i) = i*3 - 3i*2 - 11i - 1. Let b be z(-2). Determine l(b). -10 Let f = -12550 - -12558. Let y(q) = q*3 - 10q*2 + 15q - 6. Calculate y(f). -14 Let x(o) = o*3 + 6o*2 + 3o - 4. Let k(g) = 2g + 25. Suppose -50s + 36s = 210. Let b be k(s). What is x(b)? 6 Let k(n) be the first derivative of 17n*2/2 - 259n + 5229. Give k(15). -4 Let a(j) = 2j + 26. Let o(y) = 3y + 53. Let d(r) = 7a(r) - 3o(r). Let z be d(-5). Let x(p) = -12 + 5 - 5p + 1 + 3. What is x(z)? 7 Let b = 105 - 89. Let p be (-11)/2 - (-8)/b. Let r(c) = -2c - 1. Give r(p). 9 Suppose -48v + 760v - 4347 = -649v - 88v. Let b(a) = a + 3 + a - 3a. Calculate b(v). 0 Let f(s) be the third derivative of s6/120 - 7s5/60 + s4/4 + s*3/3 - 25s*2. Let b = -71 - -77. What is f(b)? 2 Let c(y) = 35y*3 + 20y*2 + 11y + 39. Let m(x) = -26x3 - 19x*2 - 11x - 38. Let z(i) = 3c(i) + 4m(i). What is z(17)? 67 Let g = -5414 - -5418. Let r(u) = -30u + 130. Calculate r(g). 10 Let y be 24/3(-1)/(-2). Let q(j) = -j*2 - j - 1. Let k(u) = 6u*2 + 25u - 14u + 6 - u2. Let v(r) = -k(r) - 6q(r). What is v(y)? -4 Let t be 2/8 + (-30)/(-8). Let z be -27(-8)/(-48)(-8)/18. Let l(x) = -80591x + x3 + 3 - 1 - 3x*z + 80589x. Determine l(t). 10 Let g(a) = -a + 9. Suppose -35 - 193 = 12p. Let r = p + 29. Calculate g(r). -1 Let m(y) = -5y - 28. Let s be (-1710)/(-33) - -38/132. Suppose 5r + 27 = 3c + s, 11 = -c + 3r. What is m(c)? -3 Let s(v) = v*2 - 67v + 1027. Let m be s(24). Let k(c) = -6c + 3. What is k(m)? 33 Let p(i) = 6i + 32. Let y(m) = -7m - 22. Let q(b) = 4p(b) + 3y(b). Calculate q(-21). -1 Let c(w) = -2w + w + 7w + 6. Let b(f) = 5f + 5. Let t(x) = 5b(x) - 4c(x). Determine t(9). 10 Let v be -1 + ((-28)/5 + 6)-25. Let f(d) = -d2 - 8d + 28. Give f(v). -5 Let x(t) = -t*2 + 13t + 71. Let u be x(17). Suppose 2j = q + 4j - 8, uq = -3j + 21. Let n(w) = 3w - 3. What is n(q)? 15 Let y(m) = m + 3. Let h(c) = -3c + 5. Let p be h(9). Let g = 18 + p. Let t be (-3)/g - (-93)/(-12). Determine y(t). -4 Let a(m) = m. Suppose 0j - 2j + 67 = 3f, 36 = j + f. Suppose 2c - 37 + j = 0. Let u be (c/((-16)/(-2)))/((-8)/32). Determine a(u). 1 Let f(k) = 6k + 1 + k2 + 8 - 5. Let y(j) = -21j*2 - 34j - 16. Let i(t) = -4t2 - 7t - 3. Let o(b) = 11i(b) - 2y(b). Let a be o(-5). Calculate f(a). 4 Let h(z) be the first derivative of -2z3/3 - 5z*2 - 5z - 12. Let b(j) be the first derivative of h(j). Calculate b(-8). 22 Let k(p) = p*2 + 13p - 14. Let u(b) = -b - 6. Let o be u(-11). Suppose -3s = -3q - 51, 2q - os = 4q + 6. Calculate k(q). -14 Let q(j) = j2 + 5j + 6. Suppose 2s + 387 = -3. Let a = s - -188. Determine q(a). 20 Let n(q) = -34q*2 - 4q + 4. Let t(i) = 7i2 + i - 1. Let g(z) = -2n(z) - 11t(z). Determine g(2). -39 Let d(q) be the third derivative of -q7/720 + q6/360 + q5/12 + q3/3 - 6q2 - 8. Let z(a) be the third derivative of d(a). Calculate z(1). -5 Let l(x) = -x2 + 4. Let b(s) be the third derivative of s*5/20 + 23s*4/24 - 6s*3 - 14s**2. Let a be b(-9). Calculate l(a). 4 Let s = 1043/3210 + 9/1070. Let i(t) be the first der	{ "pile_set_name": "DM Mathematics" }
me number? True Let a(y) = -y*3 - 4y*2 - 6y - 2. Let r(z) = -z - 13. Let m be r(-7). Let j be m/(-21) - 74/14. Is a(j) a prime number? True Let q(m) = -m*3 - 7m*2 + 3m - 3. Suppose 3g + 12 = -0g - 4s, -4g - 20 = 4s. Is q(g) a prime number? True Let g be (-442/2)/(-1). Suppose 0u = -4u + 36. Let z = g + u. Is z composite? False Let r be 2/8 + 44/16. Suppose -s + 308 = 4h + s, 4h = -rs + 304. Is h a prime number? True Suppose -457 = 8o - 7809. Is o a composite number? False Let w(h) = 2h + 3 - 11 + 1 + 10h*2. Is w(-4) prime? False Is 3986123/46 a composite number? False Let r(c) = c3 + 12c*2 - 3c + 3. Is r(-11) composite? False Suppose 2o = -r + 1, -o + 3 = -5r - 14. Suppose op = -24 + 138. Suppose 0 = -3v + 96 + p. Is v composite? True Let j = 1047 - 260. Is j prime? True Let j = -2 - -4. Let p be 3/j(-4)/6. Let w(i) = 13i*2 - i. Is w(p) composite? True Let u(x) = 4x - 2. Let i(c) = -12c + 7. Let f(a) = 2i(a) + 7u(a). Let n be f(-1). Let d = 15 - n. Is d prime? True Suppose 5w - w - 133 = -5h, 0 = -4h + 3w + 94. Suppose 3q = h + 17. Suppose 4d - 38 = q. Is d a prime number? True Let r = -92 - -174. Is r prime? False Suppose 0 = -y - 5w + 734, -w + 0w + 5 = 0. Is y a prime number? True Suppose -4s = 4a - 220, 0a = 5s - 5a - 305. Suppose -j - 455 = 4j. Let n = s - j. Is n a composite number? False Suppose 0 = 39m - 34m - 6995. Is m a prime number? True Let b be (3 - 13)(-3)/5. Is 262/4 - 3/b composite? True Let l = 1832 - 891. Is l a composite number? False Suppose -2s + 0 = -8. Let r(k) = 13k + 5. Is r(s) composite? True Let n = -173 - -123. Let p = 17 - n. Is p a composite number? False Let i = 620 + 172. Suppose -5v + i = 4a - v, a - 4v = 213. Is a prime? False Suppose -49 + 13 = 4h. Let o = 24 + h. Is o prime? False Suppose 5n + 2o - 22 = 0, 2n - o - 4o - 3 = 0. Let v(y) = -y*2 + 4y - 3. Let h be v(3). Suppose 3z - nd = 101, -3z - 2d = -hz - 89. Is z composite? False Let v(i) = i3 + 10i*2 + 10. Let w be v(-11). Suppose -h + 640 = 3h. Let b = h + w. Is b prime? False Suppose -4c - c = -40. Is 214/10 + c/(-20) prime? False Let y(q) = q3 - q2 - 2q - 1. Let b be y(-1). Let p = b - -6. Suppose -pl = -26 - 39. Is l a prime number? True Let s(i) = -4 + 5i*3 - 4i + 1 + i*2 - 4i*3. Let u be s(-2). Is u2(-66)/(-4) a composite number? True Let h = 38 + 78. Let f = h - 3. Is f a prime number? True Let n = -11676 - -19961. Is n composite? True Suppose 0 = -0h - h - 3. Let p be (2/h)/((-16)/(-72)). Is ((-9)/6 - p)22 a prime number? False Suppose 2l - 21 = 69. Suppose -3m = -2m - 18. Suppose -g + m = d, 3d - 4g - 44 = l. Is d prime? True Suppose 2x - 461 = 329. Suppose 73 = -2u + x. Is u a composite number? True Let z = -213 - -424. Is z composite? False Suppose -28x = -22x - 23742. Is x prime? False Let x(n) = -n*2 + 5n + 8. Let b be x(6). Suppose -1 = l, l = -3a - bl + 708. Suppose 5s - a = -2u, 48 = s - 3u + 4u. Is s a prime number? True Suppose 0 = -4u + 7 + 1. Suppose 75 = uz - 11. Is z a composite number? False Suppose 0y + 4k = 5y - 31, 0 = -2y + 2k + 12. Is y composite? False Let k(r) = -15r + 3 + 1 - 1. Let c be k(-3). Suppose -o - o + 101 = 3t, -o + t = -c. Is o composite? True Let y(u) = -13u - 5. Is y(-2) prime? False Suppose -4j = k - 1831, -5k - j + 10579 = 1348. Is k prime? True Let p = -12 + 15. Is (-771)/p(-3 + 2) prime? True Let t = -26 + 217. Is t a composite number? False Let d = 24 - 11. Is 141/d - (-10)/65 composite? False Suppose -2y + 98 + 234 = 0. Is y a composite number? True Let g = 6 + -6. Suppose go + 5o = 175. Is o composite? True Let h(x) = x*3 + 5x*2 + 4x + 5. Let l be h(-4). Let m(d) = -2d + 2. Let a be m(l). Is 60/a(-8)/10 composite? True Let z(v) = 2v2 + 3v + 3. Let r be z(7). Let m = -1 + r. Is m a prime number? False Let z be (-3 - (-13)/3)3. Suppose zn - 106 - 706 = 0. Is n composite? True Suppose 2z = 5l - 30, 0 = 4l - 4z - 4 - 8. Let k(v) = -15v3. Let u be k(-1). Let b = l + u. Is b a composite number? False Let b(a) = a3 + 7a*2 - 10a + 10. Let v be b(-8). Suppose 0 = -4k + 2k - s + 10, 4s = 3k - v. Is k prime? False Suppose -3d + d + 184 = 2i, -i = -5d + 454. Is d prime? False Let w = 51 - -394. Is w composite? True Suppose 15 = -3c, 10 = 2u + 3u - c. Is 140 + (0/1 - u) prime? True Let r(g) = -3 + 4g - 3g + 4g2 + 5. Is r(-3) a composite number? True Suppose -3v - 4v + 4585 = 0. Is v prime? False Suppose v + 326 = -160. Let w = 701 + v. Suppose 3c + 37 = 3y - 113, -c - w = -4y. Is y prime? False Let d(b) = 14b + 2. Let v be d(7). Let z = -65 + v. Is z prime? False Suppose 5a - 3o - 1376 = 86, -2a = 5o - 591. Is a prime? True Suppose -2a = -5a - n + 2043, -2a + 1362 = 2n. Is a a composite number? True Let m(y) = 2y*2 + 3y + 5. Is m(-8) composite? False Suppose 8 = 3w - 7. Suppose 2j - j = 71. Suppose -j = -wh + 84. Is h composite? False Suppose 5m + 19 + 21 = 0. Is (-124)/(-6)(-12)/m a prime number? True Suppose 0 = -3v - v + 4. Is (-993)/3(v + -2) a prime number? True Is ((-1)/2)/(115797/(-38598) + 3) composite? True Suppose -5a + 29 = -c - 0c, 4c + 31 = 3a. Let g = c + 22. Is 9(-3)/g-2 a composite number? False Let d = 3 - 1. Suppose -4c + 2 = -6. Suppose -ci = 2m - 82, 0 = -3m + 8m + di - 199. Is m a prime number? False Is (79/3 + 0)3 a composite number? False Let k(d) = 9d2 + 12d - 11. Is k(-8) a prime number? False Suppose 339 = 3d - 2r, -2d - r + 239 = 2r. Is d a prime number? False Let d(b) = -575b - 2. Let x be d(-2). Let f = -819 + x. Is f a prime number? False Let r be (1 + -18)/1 - 3. Let m = 69 - r. Is m composite? False Suppose 5h = 3o - 625, 4o - 30 = -5h + 780. Is o prime? False Let h = 1159 - 780. Is h composite? False Suppose 0u + u + 3j = -4, -5u + 22 = j. Suppose uo - 48 = 2o. Let q = o - -3. Is q a prime number? True Suppose 5j = 4y + 2, -3j + y = -6j + 8. Is 3 + 2 + j + -3 composite? True Let t(f) = f*2 - 3f - 3. Let g be t(7). Let q = -15 + g. Is q a composite number? True Let w(s) = 9s3 + 4s*2 - 4s - 2. Let z be w(-4). Let f be (-1)/3 + z/(-9). Suppose -f = -3k + 11. Is k a composite number? True Let m be 24((-60)/9)/(-4). Let a = m - 0. Suppose 7 = v - a. Is v prime? True Let l(d) = 5d2 - 3d - 2. Let v(o) = 10o2 - 6o - 3. Let t(z) = -5l(z) + 3v(z). Is t(3) prime? True Suppose 2m + 135 = 5r - 130, 0 = -3m + 4r - 394. Let d = -35 - m. Is d a prime number? False Let o = 28 - 15. Let z(p) = -p*2 - op + 13p - 5 + 13p. Is z(8) prime? False Suppose -3j + 111 + 129 = 0. Suppose -3k - j = -v - 0v, v - 4k = 78. Is v composite? True Is ((-463995)/(-49) - 6/21)1 composite? True Let f be (2/5)/(4/20). Suppose 0h = -fh + 98. Is h a composite number? True Suppose -2p + 0 + 6 = 0. Suppose -2a + 889 = -pq + 4q, -3a = -2q - 1337. Is a prime? False Let a(h) = h3 - 3h*2 - 3h - 1. Let k be a(4). Let n(l) = 7l3 - 4l + 2. Is n(k) a composite number? False Suppose -3n = 4k - 25, 0 = -2n + 4n + k - 10. Suppose nu - 4u + 397 = 0. Is u a composite number? False Let m(q) = 8q3 - 5q*2 - 3q + 6. Let u be m(4). Suppose 5s + u = 2p + s, 3s = 4p - 827. Is p a composite number? True Suppose -3x + 18 = -6. Let c = x + -6. Is (27 - 1) + -1 - c a prime number? True Suppose 0 = 3t + 5v - 55, 3t - 27 = 3v + 36. Is 4/(-10) + 688/t a prime number? False Let t = 3 - -1. Suppose l + 21 = -5i + 2, i + 19 = -tl. Let w = i - -16. Is w composite? False Suppose 4r = -6g + 3g - 96, -4g + 3r = 128. Let b be (30/4)/((-1)/(-18)). Let x = g + b. Is x a composite number? False Let u(c) = -c + 3. Is u(-4) a composite number? False Let t(n) = 2n - 12. Let v be t(8). Suppose -2i + l + 632 = 3i, 520 = vi + 4l. Is i composite? False Is ((-444)/(-8))/34 a composite number? True Suppose 3y = 2d + 929, y - 196 - 103 = -2d. Is y composite? False Suppose -5t + 3z = -25, -t + z = 3z + 8. Let s = 444 + -124. Suppose r - tr = 4u - s, 3r + 383 = 5u. Is u prime? True Suppose 8a = 5a + 6. Let f be a + -2 + 0/(-1). Suppose fv + 5v = 175. Is v a prime number? False Let b be (-354)/(-4) - 3/(-6). Suppose -5a + 2w - 4w + 31 = 0, 0 = 5a - 5	{ "pile_set_name": "DM Mathematics" }
)). -2k + 16 Let g(s) = -2s2 - 1. Let t(y) = y2. Let a(k) = -4k2 - 1. Let f(r) = a(r) + 5t(r). Let c(p) = -4f(p) + 4g(p). Let n(v) = 2v. Give c(n(h)). -48h*2 Let t(h) = 9h. Let a(s) = -10s. Let l(w) = -5a(w) - 6t(w). Let m(k) = 5k - 10. Let v(p) = -p + 1. Let q(z) = m(z) + 10v(z). What is q(l(u))? 20u Let v(y) be the first derivative of -13y2/2 + 1. Let x(b) = -1249 + 626 + b2 + 623. What is v(x(o))? -13o2 Let v(q) = q2 - 5q + 6. Let c be v(4). Let t(m) = m - m + cm. Let b(i) be the first derivative of 4i2 - 30. What is t(b(j))? 16j Let o(i) = 10i - 29i + 18i. Let k(t) = 8t*2 + 4t. What is k(o(x))? 8x2 - 4x Let g(z) = 10z. Let q(j) = -3j. Let s(o) = 2g(o) + 7q(o). Let f(c) = 3c2 + 4c + 12. Let t(n) = 5n + 15. Let r(d) = 5f(d) - 4t(d). Give r(s(i)). 15i*2 Let j(y) = 5y*2. Let f(v) be the first derivative of 2v*3 - 8. Calculate j(f(h)). 180h*4 Let y(c) = 4c + 3. Let i(p) = 9p + 7. Let s(j) = 6i(j) - 13y(j). Let l(t) = 3t*2. Give s(l(k)). 6k*2 + 3 Let h(a) = 2a*2 + 2. Let m(z) = 88z*2. Determine h(m(p)). 15488p*4 + 2 Let c(p) = 11p*2. Let z(l) = 2683l. Determine z(c(d)). 29513d2 Let n(m) = 929m - 910m + 7 - 7. Let x(i) = 4i. Calculate n(x(u)). 76u Let h(y) = -y. Let k(x) = -246x*2 - 246x*2 + 495x*2. Give k(h(p)). 3p*2 Let g(q) = 2q*2 + 2312q. Let r(k) = 91k. Calculate r(g(a)). 182a*2 + 210392a Let h(z) = -5z + 10z - 4z - 10. Let y(p) = -4p. Calculate y(h(f)). -4f + 40 Let x(q) = 7q. Let c(g) be the third derivative of 32g5/15 + 558g*2. What is x(c(j))? 896j*2 Let n(m) = -17m. Let u(f) = f + 7f2 - 5 + 7f - 3f. Let y(t) = 6t*2 + 4t - 4. Let v(c) = -4u(c) + 5y(c). What is v(n(q))? 578q2 Let v(c) be the second derivative of 13c4/4 + c2/2 + 191c. Let a(h) = h. Determine a(v(m)). 39m*2 + 1 Let t(l) = -44l. Let i(v) = -3348v - 2. Determine i(t(z)). 147312z - 2 Let i(d) = 3d2. Let o(s) = 11s*2 - 1 + 12s*2 + 5s*2 - 17s*2. Give o(i(y)). 99y*4 - 1 Let w(i) = -2i*2. Let p(k) = 3k*2 - k - 14592. Calculate p(w(u)). 12u*4 + 2u*2 - 14592 Suppose 3b - 2 = -b - 5a, -b + 5a = -13. Let r(s) = -42s + 48. Let o(u) = -u + 1. Let t(f) = br(f) - 144o(f). Let g(d) = d2. What is t(g(q))? 18q2 Let r(y) be the first derivative of -y2 + 18. Let m(j) = -73j. Give r(m(d)). 146d Let m(o) be the third derivative of o*5/30 - 12o*2. Let u(d) = -4d + 3. Let p(s) = 2s - 2. Let b(c) = -5p(c) - 3u(c). What is m(b(r))? 8r*2 + 8r + 2 Let r(n) = 1389n2 - 10. Let l(d) = -d. Determine r(l(b)). 1389b*2 - 10 Let z(p) = 11p*2. Let a(v) = 71v. Let r(s) = 2759s. Let c(d) = 155a(d) - 4r(d). What is z(c(f))? 10571f2 Let f(g) = g2. Let h(t) be the third derivative of -t*7/2520 + 13t4/24 - t2. Let b(q) be the second derivative of h(q). Determine b(f(s)). -s*4 Let f(q) = 973q*2. Let t(k) = 2k. Calculate f(t(p)). 3892p2 Let d(l) = l2 - l + 197. Let u(r) = 6r. What is d(u(v))? 36v2 - 6v + 197 Let x(z) = 38z2. Let u(a) = 7a*2 - 4a*2 - 2a*2 - 5a*2. Calculate u(x(d)). -5776d*4 Let u(b) = 11b*2 - 20b + 15. Let f(p) = 16p2 - 32p + 24. Let g(c) = -5f(c) + 8u(c). Let h(i) = -109i. Give h(g(l)). -872l*2 Let j(s) = -2s. Let a(r) be the second derivative of 50r3/3 - 3r - 2. Calculate j(a(c)). -200c Let k(f) = 50f*2 + 3. Let h(i) = -2900i*2 - 175. Let o(n) = -3h(n) - 175k(n). Let l(q) = -4q*2. Determine l(o(d)). -10000d*4 Let t(j) be the third derivative of 0 + 0j + 0j3 + 1/6j*5 + 0j*4 + 18j*2. Let c(w) = 3w. Give c(t(u)). 30u2 Let i(f) = -5f + 2. Let o(p) = -9p + 1. Let j(x) = 7i(x) - 4o(x). Let n(s) = -3s*2. Calculate n(j(y)). -3y*2 - 60y - 300 Let o(v) be the third derivative of 11v5/60 + v4/12 - 118v*2. Let t(a) = -3a. Give o(t(c)). 99c2 - 6c Let t(o) = -2o. Let g(x) = -x - 3. Let y(f) = -30f + 15. Let c(b) = 5g(b) + y(b). What is c(t(k))? 70k Let f(p) = -15p - 335. Let n(z) = -70z. Determine f(n(m)). 1050m - 335 Let q(p) = 69p*2. Let h(b) = 14b*2. Let r(s) = 24h(s) - 5q(s). Let f(c) be the first derivative of c3 + 3. Determine f(r(z)). 243z*4 Let b(v) = 261v*2 - 134v*2 - 133v2. Let t(u) = u2 + 7u. Give b(t(s)). -6s*4 - 84s*3 - 294s*2 Let o(r) = 72r*2 + 3r. Let l(w) = -8w. What is l(o(z))? -576z*2 - 24z Let w(c) = 70c2 - c. Let f(r) = 2559r. Calculate w(f(s)). 458393670s2 - 2559s Let u(t) be the third derivative of 7t4/24 + 46t2. Let i(d) be the first derivative of -d2 + 28. Determine i(u(j)). -14j Let t = 37 - 33. Let q(a) be the third derivative of -1/12a*t + 0 + 0a*3 - 6a*2 + 0a. Let z(g) = -11g. Calculate z(q(f)). 22f Let b(p) = p*2. Let q(s) = -7112s + 7112s - 530 - 2s*2. What is q(b(i))? -2i*4 - 530 Let v(o) = 164o*2. Let g(m) = 9m + 41. Give g(v(u)). 1476u2 + 41 Let d(f) be the first derivative of f2/2 + 4264. Let y(a) = -6a - 5 + a - a. Let i(v) = 1. Let m(s) = 5i(s) + y(s). What is m(d(l))? -6l Let b(t) = -195t2 + 107t*2 + 646t*2. Let z(q) = -2q*2. What is z(b(o))? -622728o*4 Let g(q) = q. Suppose -h - 7 = -1. Let k(s) = -3s - 5. Let l(f) = -15f - 2 - 4 + 11f. Let z(o) = hk(o) + 5l(o). Give z(g(r)). -2r Let r = 16 - 14. Let x(z) = 3 - 3 + 0 - rz*2. Let h(i) = 0i*2 - 3i*2 + 2i*2. Give h(x(m)). -4m*4 Let q(s) = -2s. Let k(a) = 4a - 930488. Calculate q(k(w)). -8w + 1860976 Let z(a) = -2a. Let j(n) be the first derivative of -45n*2/2 - 13n - 295. Determine z(j(q)). 90q + 26 Let i(a) = 7a*2 + 6a - 2. Let k(g) = -16g2 - 15g + 5. Let l(j) = 5i(j) + 2k(j). Let c(d) = 290d2. Calculate c(l(n)). 2610n*4 Let b(m) = -16m. Let o be b(-1). Suppose q = -q + o. Let w(f) = 8f - f - qf. Let s(h) = 2h2. Give s(w(y)). 2y*2 Let b(y) = -3y - 5. Let o(k) = -5k - 3. Let j(l) = 3b(l) - 4o(l). Let w(v) be the second derivative of v4/6 - 6v. What is j(w(m))? 22m2 - 3 Let k(c) be the third derivative of 23c*4/8 + 333c*2 + 2. Let v(x) = 0x + x*2 + 0x. What is v(k(g))? 4761g2 Let j(a) = -7a + 4a + a. Let f(b) = 8b*2 - 2b + 18. Let g(v) = -v*2 - v + 9. Let t(s) = f(s) - 2g(s). Determine t(j(h)). 40h2 Let t(a) = -2a*2. Let s(n) = 11n*2 + 3252n + 2. Give s(t(q)). 44q4 - 6504q*2 + 2 Let u(j) = 18j*2. Let k(c) be the third derivative of 5c*5/12 + 162c*2. Determine u(k(z)). 11250z*4 Let g = 6 - 1. Let u(v) = -gv + v - 4v + 6v. Let o(b) = 25b2 - 9b*2 - 9b*2. Give u(o(h)). -14h*2 Let w(r) be the first derivative of 0r - 32 - 2/3r3 + 0r*2. Let o(a) = 4 - 4 + 13a. What is w(o(n))? -338n2 Let a(m) = -m2. Let y(w) = 32w*2 + 287w. Give y(a(j)). 32j4 - 287j*2 Let w = -18 - -20. Let o(a) = -a - 4. Let z be o(-5). Let f(b) = 10b*w + 1 - 12b*2 - z. Let x(v) = 9v. Determine f(x(t)). -162t2 Let k(f) = 17643f. Let z(p) = -2p - 33. Give z(k(j)). -35286j - 33 Let g(l) = -7l2. Let w(i) = -4957i - 1. Calculate g(w(u)). -172002943u2 - 69398u - 7 Let q(f) = 103184f. Let p(b) = b. Calculate q(p(s)). 103184s Let x = 0 - -3. Let k(v) = -xv + 8v - v. Let j(m) = 2m - m2 - 2m. Calculate k(j(b)). -4b2 Let o(a) be the second derivative of 0a*2 + 0a*3 + 0 + 9a - 5/6a4. Let q(t) = -2t. Determine o(q(n)). -40n2 Let l(j) = 2j2. Let f(a) = a2 - 1. Let o(i) = -7i2 - 279i + 6. Let v(d) = 6f(d) + o(d). Give v(l(b)). -4b*4 - 558b*2 Let b(g) = -10g2 - g2 + 17g2 - 8g*2. Let o(k) be the second derivative of -3/2k*3 + 0 + 7k + 0k2. Give o(b(w)). 18w*2 Let y(t) = -3 + 5t + 0t + 3. Let v be (-6)/15 - (-54)/10. Let c(f) = vf - 2 + 2 - 4f. What is y(c(i))? 5i Let c(b) = -26b + 5b + 13b + 10b - 17. Let v(n) = -3n2. What is v(c(d))? -12d*2 + 204d - 867 Let t(j) = -167j2 + 7. Let u(f) = 8f. Determine u(t(k)). -1336k2 + 56 Let k(n) = 4n*2 - 452n - 2. Let c(r) = -41r. What is c(k(v))? -164v*2 + 18532v + 82 Let z(v) = 2v + 2v + 2v - 6v + 5v. Let n(f) be the first derivative of -f4/24 - f2 + 2. Let a(t) be the second derivative of n(t). Determine a(z(h)). -5h Let i(h) = h*2. Let d(l) = -27320l. Give i(d(p)). 746382400p2 Let c(v) = 376v**2 - 3. Let z(i)	{ "pile_set_name": "DM Mathematics" }
+ 33. Suppose 3p - 8 = kj - 3j, -3j = -6. Let r be g(p). Calculate the highest common factor of r and 8. 8 Suppose 0 = -4o - 3c + 2160, 4o - 2160 = 42c - 41c. What is the greatest common factor of 20 and o? 20 Let f(w) = w - 8. Let k be f(12). Suppose ky - 2o = 668, 6o - 805 = -5y + o. Suppose -2p = -73 - y. Calculate the highest common divisor of p and 17. 17 Let m(a) = -a*3 - 26a*2 - 12a + 3. Let y be m(-26). Calculate the highest common divisor of 140 and y. 35 Suppose -7d + 15 = -20. Suppose 4v - 64 = -0p - 2p, -dp = 5v - 80. Calculate the greatest common factor of 176 and v. 16 Suppose 4p - 4q - 24 = 0, -3p + q + 6 = -6. Let a be p/12 + (-54)/(-8). Let w be 500/12 - (-7)/21. Calculate the greatest common divisor of w and a. 7 Let x(j) = j3 - 12j*2 + 23j + 3. Let v be x(10). What is the highest common divisor of 22 and v? 11 Suppose 13g - 619 = 44. What is the greatest common divisor of g and 17? 17 Suppose 2g = g. Suppose g = -s + 2s + 3c, 0 = -3c - 3. Suppose -sh + 137 = -214. Calculate the highest common divisor of h and 13. 13 Let c be 74/26 + 8/52. Suppose -3y + 177 = cw, -5y = 2w - 70 - 57. Suppose -b + 14 = b. Calculate the greatest common factor of w and b. 7 Let p = 21 - 18. Suppose -pl - 4w + 6 = -0, -2 = -l - 4w. Let n = l - -10. What is the highest common factor of 18 and n? 6 Suppose 61q + 17q = 8736. Let h(w) = w + 8. Let y be h(-7). Let f be ((-4)/5)/(y/(-20)). Calculate the greatest common factor of f and q. 16 Let q(z) = 112z + 693. Let h be q(-6). What is the highest common divisor of h and 987? 21 Suppose -53z - 110 = -58z. Suppose -2q = -3v - 14 - 58, -q = -3v - 39. What is the highest common divisor of z and q? 11 Let s be (-2)/21-3. Suppose 1 = -2d - s. Let x be ((-7)/d)/((-4)/(-16)). Calculate the highest common divisor of 112 and x. 14 Let z = -12 - -18. Suppose -h - 5m = 4, 6h = h + 2m + 34. Calculate the greatest common divisor of h and z. 6 Suppose 2r = -s + 6r + 60, -3s = 2r - 138. Suppose t - 207 = -2c + 329, 4t = 3c + 2100. What is the highest common divisor of t and s? 48 Suppose -33 + 1 = 2s. Let y be (-32)/5 - s/40. Let q = 1 - y. Calculate the highest common factor of 77 and q. 7 Let o = -1 + 6. Suppose 459 + 81 = ov. Let u = -74 + v. What is the highest common factor of 374 and u? 34 Let j be (-32768)/160 - (-1 - (-6)/5). Let k = j + 409. Calculate the greatest common factor of 12 and k. 12 Let x(z) = 11z - 36. Let j be x(4). Calculate the highest common divisor of 2 and j. 2 Let k = -16 + 70. Let f be (-6136)/4602 + 211(-1)/(-3). What is the highest common factor of k and f? 6 Let j = 3 + 0. Let g(l) = -l2 + 13l + 1. Let s be g(10). Suppose -4p + 29 + s = 0. What is the highest common divisor of j and p? 3 Let i be (2/6)/(2/18). Suppose 0 = n + 2h - 1 - 4, 85 = 5n - 2h. Suppose 5g = -0 + n. Calculate the greatest common divisor of i and g. 3 Let b(a) = -43a3 - a2 - 7a - 13. Let l be b(-2). What is the greatest common divisor of l and 11? 11 Suppose 10f - 256 = 2f. Calculate the highest common divisor of 1616 and f. 16 Suppose 3q - 1278 = -3z, 26z + 855 = 2q + 27z. Calculate the highest common factor of q and 39. 39 Let q(u) = -u + 61. Let m be q(0). Let g = -4 + m. Suppose -g = -5x + 28. What is the highest common divisor of 34 and x? 17 Let j(w) = 4w*3 - 6w*2 - 2w + 17. Let i be j(3). Let p be (1 + -27)/((-4)/6). What is the highest common divisor of i and p? 13 Suppose -5 = s + 4s. Let m(x) = 17x*2 + x + 1. Let f be m(s). What is the highest common factor of f and 187? 17 Let x be 4(3/(-2))/(-3). Suppose 3 = -xa - 5w + 2, 4w = 3a - 56. Suppose 60 = 3k + 51. Calculate the greatest common factor of k and a. 3 Let h(z) = 66z - 39. Let c be h(6). What is the highest common factor of 21 and c? 21 Let z be ((-5)/5 - 2) + 7. Suppose zj = -3h - j + 104, -h + 4j = -12. Calculate the highest common divisor of h and 4. 4 Let n be 4(0 + 3/(-2)). Let r be (-2)/6 + (-212)/n. Let p be ((-28)/(-18))/((-168)/(-27) - 6). What is the greatest common divisor of p and r? 7 Suppose 15 - 17 = -2p. Suppose 5s = -0s + 40. Suppose sf - 7 = 2w + 3f, 5w = f + 17. Calculate the greatest common divisor of w and p. 1 Let v = 282 - 226. Suppose 3w + w = 56. Calculate the highest common factor of w and v. 14 Let j be (-70)/(-3)(4 + -1). Suppose -3w - 4p + 154 = 0, 0w - w - 5p = -66. Let u = w + -36. What is the greatest common divisor of u and j? 10 Suppose 3u + 51 = -75. Let q = 48 + u. Calculate the highest common factor of 24 and q. 6 Suppose 0 = x + 2, -2y = 2x - 15 - 7. Suppose 0 = -2p + 11 + 15. Calculate the highest common factor of p and y. 13 Let h be (4/(-10))/(2/(-350)). Suppose -o = -l + 6l - 468, 0 = -3l - 3o + 288. Let q = l + -65. What is the greatest common divisor of q and h? 14 Suppose -5o + 137 = 2. Let r = 39 - o. Calculate the greatest common divisor of 12 and r. 12 Let c(k) = -8k + 5 - 137k2 - 10k + 140k2. Let z be c(7). Calculate the highest common factor of z and 26. 26 Let t = -21 - -12. Let f = t + 5. Let a be 14 - 2/f-6. Calculate the greatest common divisor of 88 and a. 11 Let k(z) = -4z + 2. Let h be k(-1). Let t be h/(-2) - (-22 - -4). What is the greatest common factor of t and 60? 15 Let z be 37 - 99/(0 - -11). What is the greatest common divisor of z and 854? 14 Suppose -147 = -t + 49. What is the greatest common factor of 84 and t? 28 Suppose 3a - 34 = 11. Suppose 81s - 87s + 450 = 0. Calculate the highest common factor of s and a. 15 Let z(x) = 111x + 6. Let d be z(4). Suppose -18r + d = -13r. Calculate the greatest common factor of r and 30. 30 Suppose -4c = 4d - 20, 2d + 0c - 3c = 25. Suppose -19f = 10f - 2088. Calculate the greatest common divisor of d and f. 8 Suppose 3g + 52 = 4g. Suppose -11z - g = -13z. Calculate the highest common divisor of 65 and z. 13 Let x be 46 + (-5)/((-15)/6). Suppose 3h - 121 = -5b, 98h - 180 = 93h - 4b. What is the highest common divisor of x and h? 16 Let q = 2200 + -2188. What is the highest common divisor of 1656 and q? 12 Suppose -1892 = -8r + 388. What is the greatest common factor of r and 25? 5 Let f be ((-72)/28)/(3/(-28)). Suppose 0 = -8r + 8 + f. What is the greatest common factor of 10 and r? 2 Let z = 555 - 553. What is the highest common divisor of z and 32? 2 Suppose 21s - 25s = -60. Calculate the greatest common divisor of 5 and s. 5 Suppose 3g - t - 172 = -g, 2g = 2t + 80. Let a(v) = v*3 - 6v*2 - 9v + 80. Let u be a(7). What is the highest common factor of u and g? 22 Let o = -4 + 6. Let m(d) = 1 + 3 - d - 6d2 + 20d*o. Let w be m(-3). Calculate the greatest common divisor of w and 19. 19 Suppose -630a + 632a - 176 = 0. Let o = 10 + -6. Suppose 0 = -2v + oh + 36, 2h = -2h + 8. Calculate the greatest common divisor of v and a. 22 Let m(q) = -4q*2 - 2q + 2. Let x be m(1). Let j(r) = -3r + 2. Let n be j(x). Let s = n + -6. Calculate the highest common divisor of 2 and s. 2 Suppose -3l + 197 + 118 = 0. Let o(h) = h*3 - 46h*2 - 95h - 33. Let c be o(48). Calculate the greatest common divisor of l and c. 15 Let z(c) = -5c + 6c - 13 + 19. Let w be z(2). Suppose -2g - 5h + 53 = 0, -5g + 4h - h + 117 = 0. Calculate the greatest common factor of w and g. 8 Let h = 1641 - 1621. What is the greatest common factor of h and 124? 4 Suppose 0 = 5v - 3b - 92, -2b = 2v - 27 - 13. Suppose 2c + v - 33 = 0. What is the highest common factor of 56 and c? 7 Let d(o) = -o - 5. Let f be d(-7). Let r(k) = k3 - 7k - 4k + 2 + 3kf + k2 + 5k. Let a be r(-5). What is the highest common factor of a and 1? 1 Let r(v) = 6v + 8. Let k be r(-1). Suppose kb - 40 = -4. What is the greatest common divisor of b and 6? 6 Suppose -6w + 5 = -97. Suppose 0 = -5s + 6s - w. Suppose -a - k = -5a + 476, 0 = 4a - 5k - 476. What is the highest common divisor of s and a? 17 Suppose 0 = -3q + 6 + 6. Let j = 10 + q. Let w(p) = -5p - 1. Let d be w(-3). Calculate the highest common divisor of d and j. 14 Let v be (3 - (-3)/3) + 78 + -2. Calculate the greatest common factor of 140 and v. 20 Let z be 6(-12)/144 - (-1218)/4. Calculate the highest common factor of 114 and z. 38 Let	{ "pile_set_name": "DM Mathematics" }
) 3 b Which is the second smallest value? (a) -10535 (b) -0.1 (c) -23944 a Which is the third biggest value? (a) -5 (b) 2/3 (c) 4 (d) -4.24 (e) 756 b What is the second biggest value in -1/8, 1/7, -29, 1/618, -7, 9? 1/7 What is the second smallest value in -2/13, -98, 1880/37? -2/13 Which is the sixth biggest value? (a) 17 (b) 0.3 (c) 5 (d) 3 (e) -1 (f) -5 f Which is the biggest value? (a) -3 (b) 5 (c) 6 (d) 14 (e) -2/87 (f) -0.07 d Which is the seventh smallest value? (a) -5 (b) 0.3 (c) -94/3 (d) 3/2 (e) 9 (f) -0.6 (g) 1 e Which is the biggest value? (a) 0.2 (b) -10 (c) -0.40986 (d) -2 a What is the seventh smallest value in 9, 1, -492, 0.1, 0.2, -2/9, 1/12? 9 Which is the second smallest value? (a) -0.1 (b) -2/3 (c) -2/7 (d) -3 (e) -0.069 (f) 3/5 b Which is the second biggest value? (a) -5 (b) 224 (c) 2/7 (d) -12 (e) -0.489 c What is the second biggest value in 287378, 3/2, 24/13? 24/13 What is the third biggest value in 1/2, 0.4, 6675126? 0.4 What is the fourth biggest value in 1/7, 5/404, 2, -0.2, -12? -0.2 What is the biggest value in 2, 2/123, 2/13, 0.09, 57? 57 Which is the smallest value? (a) 5 (b) 4/51 (c) 1012/9 b What is the fifth smallest value in -2/145, -0.12, -0.3, 5, 0.0383? 5 Which is the second smallest value? (a) 5 (b) -43 (c) -3 (d) 1 (e) -7/11563 (f) 0.3 (g) 0.5 c What is the biggest value in 7.988, -3/2, 268, 0.5? 268 Which is the second smallest value? (a) -293.9 (b) -1/12 (c) 3898 b Which is the smallest value? (a) 1 (b) 3 (c) 11.1875779 a Which is the second biggest value? (a) -4 (b) 2/159 (c) -0.02 (d) -10/3 (e) 1/2 (f) 12 e Which is the fourth smallest value? (a) -1 (b) 0 (c) 0.091 (d) -18 (e) 0.1 (f) -2/11 b Which is the third biggest value? (a) -0.3 (b) -2 (c) 35/424 (d) -1 (e) -101 (f) -2/11 (g) -2/5 a Which is the smallest value? (a) -1/5 (b) -2/3091 (c) -2/11 (d) 244 (e) 0.4 a Which is the seventh smallest value? (a) 0.14 (b) 5 (c) 0.5 (d) 2 (e) 0 (f) -101 (g) -3/31 b What is the third biggest value in 2/13, -3663, -0.2, -19/3, 1/2, -2? -0.2 What is the sixth smallest value in 5/3, -14, -4, -1047, -2, 0.1? 5/3 Which is the seventh biggest value? (a) -4/57 (b) 0.5 (c) 3/2 (d) 16 (e) 6/17 (f) -1 (g) 1 f Which is the second biggest value? (a) 1/16 (b) 1.9 (c) -1 (d) -2530 a What is the fifth biggest value in -0.1, -0.4, -25, -0.24946, 3, -2/19, -1/11? -0.24946 What is the smallest value in 0, -16, 0.0316411? -16 What is the second smallest value in -127, 4, 0.5, 1/3, -0.3786, -18? -18 Which is the third biggest value? (a) 1/93 (b) 14 (c) 0.4 (d) -44 (e) -0.3 a What is the fourth biggest value in 2, 44, -1, 2/129569? -1 Which is the biggest value? (a) 0.03 (b) 0.2 (c) -1002 (d) -1 (e) -0.011 (f) -3 b What is the fifth biggest value in 33, 3, -37, -1/9, -1/24, -0.06? -1/9 Which is the fourth smallest value? (a) -2/11 (b) 5 (c) -15 (d) -3 (e) 1551 b What is the third smallest value in 2/13, 1/386, 9/5, -0.01, -6.2? 1/386 Which is the fourth smallest value? (a) 16 (b) -1712 (c) -2 (d) 7/4 (e) 2 e What is the sixth biggest value in -0.557, 6, -0.1, -3/7, 0.046, 2? -0.557 Which is the sixth biggest value? (a) 4/3 (b) 1 (c) 5 (d) 0.5 (e) -5 (f) 0.018 (g) -7.3 e What is the second biggest value in -1/3, -6, 5/2, 0.1311? 0.1311 What is the biggest value in 3/4, -40, 9/26, -0.0388? 3/4 What is the fifth smallest value in -4, 1/32, 0.18, 2, -8, -50? 0.18 Which is the fifth biggest value? (a) 0.2 (b) -1821 (c) 11899 (d) 5 (e) 3/4 b Which is the third smallest value? (a) 4 (b) -333 (c) 0.4 (d) 3123 a What is the biggest value in 0, -2/5, 14217, 2, -2/11, -8? 14217 Which is the fifth smallest value? (a) 315 (b) 0.4 (c) 3 (d) -0.007 (e) -5 (f) 11 f What is the fifth biggest value in -0.21, 3, 2/12087, -48/5, -2/7? -48/5 What is the second smallest value in 4, -0.3, 16, 2/17, 3.944, 1, 1/3? 2/17 Which is the fourth biggest value? (a) 0 (b) 0.06 (c) -4 (d) 1.6 (e) 58 (f) 2 b What is the second biggest value in 556951.6, 9, -6? 9 What is the third biggest value in -14/15, -2, -2.8, -16, 173? -2 Which is the third biggest value? (a) 1/45 (b) 1/4 (c) -4 (d) 0.27 (e) 3 (f) 0 b What is the biggest value in -2972, 0.05, -3, 0.09? 0.09 What is the second biggest value in -0.3, -0.277, 6316, 3? 3 What is the biggest value in 6, -193339, 0.2, 1? 6 What is the fourth biggest value in -1/154, 3, -87, 0.1? -87 What is the fifth smallest value in -2, 4, 0.2, 11265.167, 3? 11265.167 Which is the second biggest value? (a) -0.3 (b) -962872 (c) 223 a What is the second smallest value in 2, 450725, 3? 3 Which is the second biggest value? (a) 16 (b) 0.4 (c) 12 (d) 2 (e) 3 (f) -1/4 (g) 31 a What is the third smallest value in 1, 3904.5, -2, -0.4, 0.8? 0.8 Which is the third smallest value? (a) 2/19 (b) -2/7 (c) 0.5 (d) -5 (e) -0.13 (f) -1/11 e Which is the second smallest value? (a) 18 (b) 1980 (c) -0.4 (d) 0.2 (e) -11 (f) 0.5 (g) 5 c What is the fourth smallest value in 6, -14355, 0.04, -0.5, 1? 1 Which is the third biggest value? (a) -95.63 (b) -7 (c) 0.02673 a Which is the second smallest value? (a) 0 (b) 0.1 (c) -26/11 (d) 15/4 (e) -674 c Which is the smallest value? (a) 2/35427 (b) 2/15 (c) 0 (d) 1/50 (e) -0.1 e What is the second biggest value in 2/5, -1682819/23, -4? -4 What is the fourth biggest value in 19.187, 0, -2/5, 43, 4/5, -11? 0 Which is the biggest value? (a) 1 (b) 2/13 (c) -2/151009 (d) -4.5 a Which is the third biggest value? (a) -1/7 (b) -0.1 (c) -0.4 (d) 12 (e) -16 (f) 0.1194 b What is the seventh smallest value in -5, -0.04, 2, -3, -1/6, 2066, 5? 2066 What is the sixth biggest value in 3293, 0.3, 7.7, -1/112, 3, 3/2? -1/112 What is the second biggest value in -0.3, 1/11, 8.5, 0.4, 296, 0.5? 8.5 Which is the second biggest value? (a) 2/5 (b) 0.0177 (c) 3/2 (d) 1 (e) -1/3 (f) 0.2 d Which is the third biggest value? (a) -2/7 (b) 202 (c) 5 (d) 3/2 (e) -303 d What is the biggest value in 71, 0, 216/7, 1/88? 71 Which is the second smallest value? (a) -5 (b) 1 (c) -37.52 (d) -6/11 (e) -2 a Which is the seventh biggest value? (a) -11 (b) 1/6 (c) -1/8 (d) -1/2 (e) -125 (f) -5 (g) -3 e Which is the fifth smallest value? (a) 0.19 (b) -5 (c) -0.09 (d) 3 (e) 19 e What is the fifth biggest value in -120/13, -3/8, -16, -0.2, -15, 1/4? -15 Which is the second smallest value? (a) 4/7 (b) 0.1 (c) 1.45 (d) 2 (e) -4 (f) 12.88 (g) -5 e What is the third biggest value in 1/5, 375, 2/15, -0.2, 14/11, 2/9? 2/9 What is the fourth smallest value in -5, -1, -22, -4/3, -82? -4/3 Which is the sixth smallest value? (a) 2/11 (b) -496 (c) -43 (d) 12 (e) 5 (f) -2/7 d Which is the smallest value? (a) 0.2557 (b) -4 (c) 10/3 (d) 4492 b What is the fourth biggest value in -1, 3.2, -10733, 3/4, 0.2, -0.4? -0.4 Which is the fourth smallest value? (a) -2/19 (b) -3 (c) 0.071 (d) 5 (e) 0.01 (f) 4 c Which is the smallest value? (a) 121 (b) 3 (c) 2652 (d) 0.2 (e) 2/7 (f) 0.4 (g) 2 d What is the biggest value in -7, 1/5, 0.0291042, -8? 1/5 What is the second biggest value in 5, -4/17, 4/11, -110, 2/9, 0.5, 19? 5 What is the second smallest value in 777/17, 0.5, -758? 0.5 Which is the second smallest value? (a) 0.2 (b) 70401 (c) -1/19 a What is the fifth biggest value in 32/7, 34, 0, -4, -1, 2, -5? -1 Which is the second smallest value? (a) 0.3 (b) -5 (c) -6516 (d) -0.029 b Which is the fifth smallest value? (a) 0.4 (b) 1518 (c) -0.5 (d) 146 (e) 1/11 b What is the fourth biggest value in -32, 1/4, 7025, 76/11? -32 What is the seventh biggest value in 1, 1/3, 0.4, -3, 18/11, 0.082, -9? -9 What is the fifth smallest value in -0.3, 0.5, 1/5, 9, -1/2, -1/5, -10.3? 1/5 Which is the smallest value? (a) -3/20 (b) 0.43 (c) 74.7 a What is the third smallest value in 1/2, 38, 0.27, 53, 33/4? 33/4 What is the third smallest value in 2/3, -13, 1.59, -3, -4, 604? -3 What is the second biggest value in 13398, 81/17, -1/2? 81/17 Which is the smallest value? (a) -0.1 (b) -55 (c) -5 (d) -3.7 (e) -2/17 (f) -44 (g) -2/13 b What is the third biggest value in -7.8, -1/2, -0.1, 0.096, 1.1, -0.08? -0.08 What is the s	{ "pile_set_name": "DM Mathematics" }
-3)) + sqrt(343) + sqrt(343)-21 + (2 + sqrt(343) + -5)-3)2. -504sqrt(7) + 5569 Simplify -4(sqrt(6292)2 - -2sqrt(208)/sqrt(4))/((6(sqrt(64) + (sqrt(64) - -2sqrt(64)) + sqrt(64)) - sqrt(64)) + sqrt(64)). -4sqrt(13)/5 Simplify -1 + 4 + (6(sqrt(68) + 0 + sqrt(68)) - sqrt(68) - (sqrt(68) - -33sqrt(68))) + 3 + 4. 2sqrt(17) + 10 Simplify (1 + (((sqrt(180) - (sqrt(180) + -1) - sqrt(180))4 - sqrt(180)) + -4)2 + sqrt(20) + sqrt(500) + -1 + 4)-1 + 5. -4499 - 12sqrt(5) Simplify -53(sqrt(119)1)/sqrt(7) - (sqrt(51)/(sqrt(12)/sqrt(4) + sqrt(3)) - sqrt(1377)-3)2. -51425/4 - 15sqrt(17) Simplify 5((sqrt(1377)-11 + 5)-3 + -4)*2-3. -191310 + 15390sqrt(17) Simplify -2 + (-5sqrt(110)/sqrt(5)5)/(-1(sqrt(1584) + (sqrt(1584) - (sqrt(1584) - 3sqrt(1584) - sqrt(1584)) - sqrt(1584)))). -2 + 25sqrt(2)/48 Simplify (5 + -2sqrt(200) + ((sqrt(144) + sqrt(16))6)/sqrt(8) + -3 + (5 + 6sqrt(4)/sqrt(2))2)*2. 384sqrt(2) + 656 Simplify ((-5 + (-5 + sqrt(833) + -1)-3-3 + -1 + 1)1)2. -7434sqrt(17) + 70954 Simplify ((sqrt(4356) + -2sqrt(4356))/(sqrt(50)-3))/((sqrt(90) - -4(sqrt(90)2 - sqrt(90)))/(5(sqrt(30)/sqrt(3) + sqrt(10)))). 22sqrt(2)/15 Simplify -1(((3 + 4 + -1 + sqrt(343))2 + -4)5 + 3). -1878 - 420sqrt(7) Simplify (sqrt(528) - -4sqrt(528) - (sqrt(2673)5 - sqrt(2673)))/(sqrt(539)2 - ((sqrt(11)-1 + sqrt(11))-3 + sqrt(11))). -16sqrt(3)/13 Simplify (sqrt(288) + -3sqrt(288)1 - ((sqrt(288) - 1sqrt(288))-3 + sqrt(288) - sqrt(288)))/((-2sqrt(324))/sqrt(6)). 4sqrt(3)/3 Simplify ((sqrt(17) + (sqrt(17) - sqrt(170)/(sqrt(810) - sqrt(10))) - 3(sqrt(17) + -1)) + -3 + sqrt(1700)-3 + 1)2. -249sqrt(17)/4 + 1054081/64 Simplify (-2sqrt(78)/sqrt(2))/(sqrt(12) - sqrt(108)) + ((-2sqrt(65)-1)/(sqrt(500) + (sqrt(500) + 1sqrt(500) + sqrt(500) - sqrt(500))))*2. 13/225 + sqrt(13)/2 Simplify -4 + (sqrt(150)2)/(sqrt(128) + (sqrt(128)-1 - sqrt(128)) - sqrt(128)) + (sqrt(108)4-3)2. -5sqrt(3)/8 + 15548 Simplify ((5sqrt(3300)1)/((-5sqrt(96))/sqrt(8) - sqrt(12)))2. 6875/36 Simplify (2sqrt(1029) - (sqrt(63)/sqrt(3) + sqrt(21))2)/((sqrt(28) - sqrt(280)/(1sqrt(10))) + sqrt(56)/(2sqrt(2))). 10sqrt(3) Simplify 6(((-2sqrt(49)3 - sqrt(49))/(-3sqrt(7)-2) - (-1 + (sqrt(42)/((sqrt(36)1)/sqrt(6)))*2)) + -1). -42 - 7sqrt(7) Simplify sqrt(13) + -2(0 + sqrt(13)) + sqrt(13) - (sqrt(26)/sqrt(2) + 0)2 - (0 + (-3sqrt(1573) + 4)*2). -14186 + 264sqrt(13) Simplify (2(-3 + -5(sqrt(475)22 - (1 + sqrt(475) + 2 + sqrt(475))))-4)2. -76800sqrt(19) + 3049216 Simplify ((sqrt(320) - -2sqrt(320) - sqrt(320)) + -5)2 - (sqrt(720) + -2 + sqrt(720) + 1) - (4 + (-5 + -1 + sqrt(245))4). -212sqrt(5) + 1326 Simplify ((4(sqrt(1700) - (sqrt(1700)2 + sqrt(1700))2) - (sqrt(1700) + 3)2-2) + 2)-66. -5760sqrt(17) + 2080080 Simplify (sqrt(19) + -2sqrt(19) + 1 - sqrt(19) - (sqrt(19) - (sqrt(19) - -2(sqrt(19) + 1))) - (1 + 4sqrt(304) + 0))*2. -64sqrt(19) + 4868 Simplify (sqrt(170)/(-3sqrt(40))3)*2 + ((1(sqrt(51) + 1sqrt(51)) + sqrt(51))/(sqrt(60)/sqrt(5) + sqrt(3) - sqrt(3)))2. 85/2 Simplify (-6(1(1sqrt(170) + sqrt(170)))/sqrt(10) + -4 + sqrt(85)/(sqrt(180)2) + sqrt(2057) + ((sqrt(2057)-2 + sqrt(2057))2 - sqrt(2057)))2. 814sqrt(17)/3 + 2818337/144 Simplify (sqrt(252)/(sqrt(42)/sqrt(7)) - sqrt(378)/(sqrt(9) + sqrt(54)/sqrt(6) + sqrt(9)))/(-5((-1sqrt(600))/sqrt(10))/sqrt(10)). 2sqrt(7)/15 Simplify (-2sqrt(1425)-1)/((sqrt(3) + (sqrt(6)/(sqrt(4)/sqrt(2) + sqrt(2)) - sqrt(3)))-5)-5. 20sqrt(19) Simplify 2(4 + sqrt(539) + 5sqrt(539) + -5)-12. -168sqrt(11) + 4 Simplify ((sqrt(24)/(sqrt(24)/sqrt(3)) + (sqrt(3) - (5 + sqrt(48))) - (sqrt(48) + 0)-3-3) + 5)2. 4332 Simplify 6-3(-5 + -5(-1sqrt(1053) + 0 + 4)-3). -990 + 2430sqrt(13) Simplify 4((5(5 + sqrt(684)-2))*2 + -1 - (5 + (sqrt(684)14 - -3(sqrt(684) + sqrt(684) + sqrt(684) + 1)))*2). -186544 - 16992sqrt(19) Simplify ((sqrt(128) + -3(1 + sqrt(128)) - sqrt(128)) + (-1 + sqrt(128))2 + -5)*2 - (-1 + ((-1sqrt(128))*2-6 - ((sqrt(128) + 0)3)2)). 160sqrt(2) + 2149 Simplify ((-2sqrt(133)-1 + sqrt(133)-1-6)5)/(2sqrt(700)6 - ((-1sqrt(700) - sqrt(700))4 + sqrt(700) + sqrt(700))). 2sqrt(19)/9 Simplify 0 + (sqrt(125) - (sqrt(125) + -2 + sqrt(125)))*2 - sqrt(125)44 - (-2 + (1sqrt(125))*2 + -2 + -2). -100sqrt(5) + 10 Simplify ((sqrt(7) - 2sqrt(1008) - sqrt(7)) + sqrt(7) - ((-1 + sqrt(7))-2 + sqrt(7)))*2 - (4 + sqrt(56)/(sqrt(8)2 + sqrt(8))1). 263sqrt(7)/3 + 3388 Simplify (422(2sqrt(70) + sqrt(70)))/((sqrt(640) - (sqrt(640) - (sqrt(640) - -2sqrt(640)))) + 1sqrt(640)). 3sqrt(7)/2 Simplify -3 + (sqrt(272) + (-5(sqrt(272) + 0))*2 - (sqrt(272) + (-3(4 + sqrt(272)) - sqrt(272)) + sqrt(272))*2)1. -188sqrt(17) + 5565 Simplify (-2 + ((sqrt(154)-2)/sqrt(7) + sqrt(22) - (sqrt(22) + sqrt(550)-6))/(3(sqrt(2) + 3sqrt(2))-4))*2. 7sqrt(11)/3 + 1115/144 Simplify 11(4-1((-2sqrt(360))/sqrt(12))/sqrt(486)-4)*2. 5120/81 Simplify ((-4 + 5 + sqrt(72) + sqrt(72) + -1 + 0 + 1)3 + 4)*2. 504sqrt(2) + 2641 Simplify ((sqrt(98) + 4sqrt(98))/sqrt(2)-36)/(6(sqrt(7) + (-1sqrt(175) + sqrt(175) - sqrt(175)))-5). -3sqrt(7)/4 Simplify (sqrt(108) + 2 + sqrt(108) + 4 + 3 + -4sqrt(108))*2 - ((sqrt(108) + 2)2 - (sqrt(108) + 0 + 5)). -222sqrt(3) + 514 Simplify ((1-2sqrt(216))/sqrt(12) + 3)2 + ((4 + sqrt(2)1 + sqrt(2))*2 + sqrt(2))-3 + (-1sqrt(2) + 3)1. -88sqrt(2) + 12 Simplify 1 + (-4((-11sqrt(1300) - sqrt(1300)) + (sqrt(1300) - 2sqrt(1300)) + -4) + 3 + sqrt(1300)2 + 5 + 5)*2. 8120sqrt(13) + 255642 Simplify ((-3 + 1sqrt(125)5)-6 - (5sqrt(125)-2 + (sqrt(125) - (sqrt(125) + sqrt(125) + (sqrt(125) + 0 + sqrt(125) - sqrt(125)))-6 - sqrt(125)))-1)2. -3960sqrt(5) + 60824 Simplify (4 + (sqrt(252) - (sqrt(252) - (sqrt(252) + 1)6) - (3(0 + sqrt(252)) - sqrt(252)))3-1)*2. 2016sqrt(7) + 36484 Simplify 5 + (((sqrt(1216) + sqrt(1216) + 0)-2 + sqrt(1216) - sqrt(1216)) + sqrt(1216) + -3 + sqrt(1216) + 1 - -6(-1 + sqrt(1216))1-5). -256sqrt(19) + 33 Simplify (5 + -1 + 6(-1 + sqrt(1539) + 2) + -4((-3(sqrt(1539) + 0) - sqrt(1539)) + sqrt(1539))-1 + -4)2. -648sqrt(19) + 55440 Simplify (sqrt(567)-42)*2 + 1 + -2sqrt(567) - 36(sqrt(49) - (sqrt(588) + sqrt(588) + (sqrt(588) - sqrt(588)2))/sqrt(12))/sqrt(7). -18sqrt(7) + 36289 Simplify (-5(sqrt(1377)21 + 6(-2 + sqrt(1377)) + -63sqrt(1377)-1))2 + 2. -140400sqrt(17) + 23274902 Simplify ((5 + ((sqrt(2299) + sqrt(2299) + sqrt(2299) + sqrt(2299)1)-6 - -4(sqrt(2299) + 0)) + 3 + -1)5 + -3)*2. -70400sqrt(19) + 22991024 Simplify (3-1(2sqrt(1900))2 + 6(-4(-2sqrt(684))*2 + sqrt(684)))4. -353856 + 144sqrt(19) Simplify (sqrt(8) + 4 + 2 + sqrt(2) + sqrt(2)-1 + (2sqrt(242) - (sqrt(2) + -1 + 3 - sqrt(2))) + 3)2. 336sqrt(2) + 1201 Simplify 2sqrt(55)/sqrt(5) + -2 + 5 + 6sqrt(704)-2 + -2. -94sqrt(11) + 1 Simplify ((1sqrt(170)1)/(sqrt(90)/(1sqrt(9))) + 3 + 3sqrt(1700) + -4)*2. -62sqrt(17) + 16338 Simplify (-4(4sqrt(78) + sqrt(78)))/(sqrt(60)/(sqrt(10)-1)) + -5-1(sqrt(637) + -6(sqrt(637) - (0 + sqrt(637))))*2. 20sqrt(13) + 3185 Simplify ((3sqrt(120)-5 - sqrt(120) - sqrt(120))/sqrt(5)-1)/(3sqrt(968)5-4). -17sqrt(3)/660 Simplify (-4 + (3 + 1 + sqrt(396) + -4 - (sqrt(396) + sqrt(396)2 + -4 + sqrt(396) - sqrt(396))-4))2. -3120sqrt(11) + 67324 Simplify (sqrt(325) - sqrt(325)14)1 + -4 + (-2 + sqrt(637) + -2)2. -71sqrt(13) + 649 Simplify 1 + (sqrt(2057) + (sqrt(2057)1)2 + ((4 + sqrt(102)/sqrt(6))2 - sqrt(17)) - ((4 + (-1 + sqrt(612) - sqrt(612)))2 - (1 + sqrt(612))-6)). -18sqrt(17) + 2076 Simplify ((-34sqrt(99)-1-5)/((sqrt(576) + 23sqrt(576))5))*2. 99/196 Simplify (6(-1 + (sqrt(1088) - (2 + sqrt(1088))) + sqrt(1088) + 2 + 0 + -5 + 4))*26. -6912sqrt(17) + 235872 Simplify (5sqrt(7344)1-3)/((sqrt(1323)-1)/(sqrt(900)-1)). -1800sqrt(17)/7 Simplify 3((1 + (-1 + sqrt(2) + -2 - sqrt(2)))*2 - (2sqrt(18) + -1)) + -3 + -1. -18sqrt(2) + 11 Simplify (sqrt(1008) + 2)-4 - (-6(sqrt(1008)-2)*2 - sqrt(1008)) - ((1sqrt(63))/sqrt(9) + sqrt(28)/sqrt(36) - (-3 + -2sqrt(847)))2. -176sqrt(7) + 183275/9 Simplify (55(sqrt(7) + -3)4)2 - 6(-53sqrt(343))*2. -303050 - 60000	{ "pile_set_name": "DM Mathematics" }
2/7)h)/(h2)(2/83))/((hh*(2/7)(hh(h*(1/7)h)/h)/h)/(hh(hh/h(-2/3)h)/h)7) assuming h is positive. h(41665/1743) Simplify (i*(-2/7)i)*(-35/6)(ii(-5))/i(1/10)(i*(-2/3)i)/i*(-8)i/((i*(-5)ii)/i)i/(ii/(i/i3)i)ii assuming i is positive. i(46/15) Simplify (d(-4)/ddd3)(-3)(((dd*4)/d)/ddd(5/7))/((d(1/7)/d)/((dd9/d)/d)) assuming d is positive. d(116/7) Simplify (aa(1/11)a*(1/5)(((a/a*(-2))/aa)/a)/aa/(a/(a(-1/12)a)))/(a(-1/10)/a5a(-4/9)a*(-5)a) assuming a is positive. a(25249/1980) Simplify ((m(4/15)m)/(((mm*(-1/61))/m)/m))/((mm(m(-35)m)/mmmm)/(mm/m(-5/7))) assuming m is positive. m(224158/6405) Simplify (d(-44))(-1/5)/(d(-6/29))(2/21) assuming d is positive. d*(8952/1015) Simplify ((r/(rr/r1))(-17))*(3/26)r/(((r/(rr(1/7)))/r)/r)rr/r(-2/9)(r1)(-30) assuming r is positive. r(-1552/63) Simplify (r(-1/2)r)(3/40)/(r0)14((r*(-2/3)r)(-2))24 assuming r is positive. r*(-1277/80) Simplify (vvv(-2/11)v)/(vvv*5/v)(v(-2/7))(-43)v(-3)/(v(-2/5)v)(v(-3)v)/(v/(v/(v*(1/4)v))) assuming v is positive. v(3471/1540) Simplify (k(2/5)k(1/4))/(k(-2))(-2/57)(k(2/3))(-50)k/((((k(-7)/k)/k)/k)/k)(k(-1)/k)/k assuming k is positive. k(-27079/1140) Simplify (yy/(y/(y/y(-2/23)))y)(2/49)/(y(-2/85)/((y/(yy27)y)/y)) assuming y is positive. y(-2572141/95795) Simplify ((x(2/15)x)/xx(x/(x(-5/4)/x))/x)/(x/x(1/4))(-29/3)x(5/3)/(x/x7)x(1/10)x*(-5)x assuming x is positive. x*(72/5) Simplify ((a/(a/((aa*(-1/8)aaa)/a)))/(aa(-4/7)aa))(-46)((((aa(6/11))/a)/a)/(a(1/13)a))(-1/7) assuming a is positive. a(-81349/4004) Simplify (n*(-1/2)n)*(-50)n*(-1)/nn/n*(1/5)(n*(1/8)n6)47 assuming n is positive. n(10467/40) Simplify ((t(-1)t(-2/11)t*(-3/2)tt(-5/2))(-2/9))17 assuming t is positive. t(1564/99) Simplify ((o/(((oo12)/o)/o))(-44)(o(-1/6))21)50 assuming o is positive. o21825 Simplify (o(-2/3)/(o7o))/(o*(2/7)o*3)(o(1/3))32o/o(-2)oo(2/5) assuming o is positive. o(109/35) Simplify (((s(-2))(-1/10)(s(-1/4))(-46))(2/5))0 assuming s is positive. 1 Simplify ((r/(r/(r*(7/3)/r))r)/((rr/r14)/r))(-13)(rr0/r)(-31)/((((rrr/((rr*(2/9)rrrr)/r)rr)/rr)/r)/r)(-1/3) assuming r is positive. r(-5393/27) Simplify ((o*(8/13)o)/(oo38o))/(o(oo*27)/oo/(oo4)o) assuming o is positive. o(-824/13) Simplify (p(-3)(p7p)/p)/((p*(2/3)p)/p*2)(pp/p0)(2/5)/(p(-7)p(pp((p((pp(p/(p*(4/9)/p))/p)/p)/p)/p)/p)/pp) assuming p is positive. p(431/45) Simplify (y29)*(-13)/((yyy/y(-15/7))/y(7/3)) assuming y is positive. y(-7976/21) Simplify ((y(4/17)/y(3/5))/(yy/y*(-1)y(-2/3)))38 assuming y is positive. y(-26144/255) Simplify ((a(1/3))39/((a/a(-4))/aa)(-28))48 assuming a is positive. a7344 Simplify (((s/(s/((s/s(-1/3))/s)))/s)/(ss*(1/6))(s/(ss/s(-17))ss)/((s/s(-20))/s))(2/31) assuming s is positive. s(-227/93) Simplify (yy*10yy/(y/(y/y(-3/8)))(y/((yy/(y(9/8)/y))/y))/y(-2/3))(-4/5) assuming y is positive. y(-34/3) Simplify ((a/((aa*(-2))/aa))/a*(-4)a/(a*(-3/7)/a)a*5a)/((a/a(-2/15))/a(-2)((aa(-2/7))/a)39) assuming a is positive. a(2356/105) Simplify (n/n(-2/19)nn2)(-12/17)((((n/(n/n(-6)))/n)/n)/n1)/((n/((n(-2/21)n)/n)n)/nn/n(-2/3)) assuming n is positive. n(-99437/6783) Simplify k*7/(kk/(kk/k(1/28)))k*27/kk*(-14)k assuming k is positive. k(559/28) Simplify ((k/k(-2/7))(3/26))30(kkk0k)*5(kk1k)(-5/13) assuming k is positive. k(1665/91) Simplify ((p/p(1/9))(-5/3))(-19)/(((p(4/9)p)/p)/p(-1/6)p*6p/(ppp(p/(p/(p/((pp(pp/(pp(-2/5)))/p)/pp))))/pp)) assuming p is positive. p(5977/270) Simplify (p1/pp)*(6/5)p/p*8p*(-3/8)/p((p/(p6/p))/p4)/((p*8p)/p(-2/19)) assuming p is positive. p(-18453/760) Simplify (((t*(-1)t)/t)(-1/43))(9/10)(t(2/5)t*(-3)/t)/(t/(tt*(1/3)t)tt(-1/7)) assuming t is positive. t(-28019/9030) Simplify (t*(1/3)t*(-8)/tttt*(2/7)t(1/9))/((t(-2))(-4))(-17) assuming t is positive. t(8173/63) Simplify ((f(-21)/f)(-2/39)/(f7/f)(-4))(-5) assuming f is positive. f(-4900/39) Simplify ((t/t2)/t)43/(t3/t*(-3))(t*8t(t/((t/(t10/t))/t))/t)(-2/157) assuming t is positive. t(-14480/157) Simplify (m8mm(-7)mm)(19/5)m*(6/11)m/(m/(mm(-1/9)m))mm*(1/5)(m/(m/(m/m*(3/4))))/mm assuming m is positive. m(37787/1980) Simplify u39/u(uuu(-7)uu)/u(((u/(u/(u/(u/u*(-1/2))u))u)/uu)/u)27 assuming u is positive. u(95/2) Simplify (b*3b/b*(-3/5)((bb(-3/7))/b)/((b/(bbb(-2/5)))/bb))/(((b/(b/(bb(-3/10)bb)))/(bb(-2/9)/b))/(b0)24) assuming b is positive. b(233/126) Simplify ((((y*(-7/4)y)/yy2)(1/2))35)(-8) assuming y is positive. y(-35) Simplify (f/((ffff*1ff)/f))(-12/11)/(f3/f(-2/7))((ff(-9)/f)/(f/(f/(f(4/5)/f))))(-1/54) assuming f is positive. f(12899/10395) Simplify ((p(-7)/pp)/pp/p15)(-35)/((p/(pp/(p*(-1/10)/p))p(-1/5))/(((p0/p)/p)/p)(8/11)) assuming p is positive. p(84713/110) Simplify ((a0)(17/5)/(aa3a(2/7)))/((a/a7)/(a/(aa(2/7)/a))(a/(aa(1/2)))2) assuming a is positive. a(24/7) Simplify ((p(-2/7))(-11))(1/55)(p*(1/2)p(-1/5))/(p0)(-28) assuming p is positive. p(5/14) Simplify (j*(2/5)j(-1/3))24(j(-2/7)/(j/(jj/j*(4/5))j))/(j(2/3))37 assuming j is positive. j(-2536/105) Simplify (k/k(-5/6)k(3/8))(-1/3)/(k5kk2k*(-1)/kk(-1/3)) assuming k is positive. k(-461/72) Simplify ((bb(-5))/(b/(bb/(bb(-2)/b)))b(1/3)/b4)/((b/b*4)/(bbb(-4))b(-2)/(b/b3b)) assuming b is positive. b(-8/3) Simplify (n1n/n0)32n(-4)/n5n(-2/3)/((n/n5nn)/n) assuming n is positive. n*(172/3) Simplify (aa*42aaa(-7))/(a/a(-19/4))26 assuming a is positive. a(-223/2) Simplify (v(2/31)/(v(-1/2)/v))/(v3/v(-3))v2/(vv*(-4)vv)v1/((v7v)/v) assuming v is positive. v(-461/62) Simplify (((ccc(-1/2))/c)(-1/6)c*(1/6)c/(c/c(-5)))/(c(1/4)cc*(5/6)/c((c/(c(cc*0cc)/cc))/c)(4/27)) assuming c is positive. c(-146/27) Simplify ((m/(m/m(1/2)))(-16)(m(-16/7)m)/(m*(-5/12)m))(2/119) assuming m is positive. m(-829/4998) Simplify ((bb(2/3)bb)(-2/43)b*0b(1/4)/b)/((b0)*(-12/11)(b(b/(bb(1/2)))/b)(-9/4)) assuming b is positive. b*(-2111/1032) Simplify (uu(-6))/(u0u)u*5u/((u*(2/5)/u)/uu)((uuu/u(-3/4)u)(-7/6))(-1/31) assuming u is positive. u(2897/3720) Simplify ((b/b(-1)bbb)(3/2)bb/b(2/5)b/(bbb(-3)))/((b/(b6bb))/(b*8b)b(4/3)b(-3/4)) assuming b is positive. b(1591/60) Simplify ((x*(-2)x*(-5)x)/(x(-2/3))(-28))/((x/x*0)/xx*(-2/7)x*(-1/4)xx/(xx/(x/x(-1/2)))) assuming x is positive. x(-2153/84) Simplify ((f*(-3/10)(f/(f/f(2/17)))/f)/(f/f0f)(30/11))/((f(-3/5)/(ff/f(4/5)))/(f(1/4))5) assuming f is positive. f(-2683/748) Simplify (c(-1)/c(1/3))/(c/c*6c*(-1/3)c)(c/(((c/(c(1/3)c))/cc)/c)c)44/(c(1/8)/cc(-7)) assuming c is positive. c(3781/24) Simplify (r(r/(rr/(r(3/2)/rr)))/r((rr(-2/15)/r)/r)/r)(-23)(r(-1)r)16/(r(-2/15)/rrr/r3) assuming r is positive. r(397/10) Simplify (q/(q*(4/3)q)q/q(-2/23))6((q*(2/9)q)/qqq2)11 assuming q is positive. q*(7031/207) Simplify ((hh*(2/13)/hh)*17/(h/((hh/(h*(-3/2)h)hh)/h))(-2/23))(-2/35) assuming h is positive. h(-2320/2093) Simplify ((k/(k/(k/(k/k(2/9)k))))13)(-13/4)/((k/(k/(kk*(2/13)/k))kk/((kkk(-3)k)/k))/(k(-4/7)/k3)) assuming k is positive. k(85621/3276) Simplify m/m(-4/7)mm*2m*2/(mm/m*0)(m*(2/5)/(mm*(2/29)mm))/((m/(m(-1)m))/m)(-35/4) assuming m is positive. m(1931/1015) Simplify (((j/(j(1/11)/j))/j)11(jj(jj(-1/9))/j)(27/7))(-1/9) assuming j is positive. j(-121/63) Simplify ((((xx(1/7))/x)/x)/x*(2/11	{ "pile_set_name": "DM Mathematics" }
-2103a4 - -4c? -210358 In base 2, what is 1000001100011001110010110 + 1? 1000001100011001110010111 In base 2, what is -11 + 10100010000011110000010? 10100010000011101111111 In base 13, what is -4 + -2976280? -2976284 In base 4, what is 10 + 1301012232233? 1301012232303 In base 14, what is -23c2 + -16733? -18b15 In base 4, what is -2120012301 + 2222? -2120010013 In base 7, what is 4 + 30451242? 30451246 In base 5, what is -430421 + 1002? -424414 In base 8, what is 215060 + -525? 214333 In base 11, what is -5 + 4a17a7? 4a17a2 In base 14, what is 3c + -1a5b? -1a1d In base 14, what is d61 - -2652? 35b3 In base 5, what is -32040 + -414324? -1001414 In base 8, what is 6 - -32631556? 32631564 In base 11, what is -32032 - -44? -31a99 In base 5, what is 2043134330 - -10? 2043134340 In base 15, what is 13196 - -2034? 151ca In base 6, what is 1424111 + 532? 1425043 In base 8, what is -47023 + 1043? -45760 In base 11, what is -4 - 2516363? -2516367 In base 11, what is 3436 + -14084? -10749 In base 11, what is -68519 + -78? -68596 In base 12, what is 1 - 681b4b? -681b4a In base 4, what is 122 + -123223332? -123223210 In base 4, what is 113 + -210230122? -210230003 In base 15, what is -21374ee - -4? -21374ea In base 2, what is -1011 + -10101110011100010111010100? -10101110011100010111011111 In base 16, what is 0 - 271c24? -271c24 In base 14, what is -c78 + a965? 9acb In base 7, what is 445646135 + 1? 445646136 In base 5, what is 0 + -2212013242? -2212013242 In base 12, what is -1a026 - -8829? -113b9 In base 3, what is -1002121000200 + 121? -1002121000002 In base 14, what is 1 - 50023? -50022 In base 2, what is -10011100011100 - 10110010? -10011111001110 In base 3, what is 2 + 12001112221012? 12001112221021 In base 14, what is 5 - -12add59? 12add60 In base 16, what is 4a96d + -12? 4a95b In base 12, what is 2366a - 438? 23232 In base 13, what is -91a - -6391? 5774 In base 12, what is -1593 + 67? -1528 In base 12, what is -57a164b62 - -4? -57a164b5a In base 5, what is -10204342 - 4422? -10214314 In base 11, what is -895 + -30a69? -31853 In base 8, what is -1720 - -4000? 2060 In base 3, what is -100011010212201 + 1100? -100011010211101 In base 11, what is 7 + -9585470? -9585464 In base 7, what is 3405261 - -50? 3405341 In base 8, what is 354624 - -11? 354635 In base 2, what is 1111000110110111 + 1111101? 1111001000110100 In base 10, what is -494 + -640212? -640706 In base 8, what is -6735 - 42535? -51472 In base 14, what is -42027459 + 3? -42027456 In base 16, what is 1 + -6c4a5? -6c4a4 In base 4, what is 13 - -202120103? 202120122 In base 16, what is -d - 4a84? -4a91 In base 4, what is 0 + 113233020000011? 113233020000011 In base 6, what is -22540111 + -111? -22540222 In base 5, what is 0 + 24234112422? 24234112422 In base 2, what is -101110001000 - -1101100100? -100000100100 In base 6, what is 55410 - 3524? 51442 In base 11, what is -990578 - -6? -990572 In base 4, what is 30131 + 1312230? 2003021 In base 14, what is 183 - 750d? -736a In base 13, what is 254a1 + -700? 24aa1 In base 8, what is 46005243 - 27? 46005214 In base 8, what is -3 + 1626307? 1626304 In base 11, what is 87 + -21255? -21179 In base 8, what is 2111 + 46251? 50362 In base 10, what is 4232374 - 5? 4232369 In base 12, what is -4 - 14066a5? -14066a9 In base 7, what is -202430123 + 2? -202430121 In base 5, what is -1422113 + -343? -1423011 In base 12, what is -6b2117 + -2? -6b2119 In base 15, what is bb - -1d146? 1d212 In base 10, what is -1254685 - 25? -1254710 In base 12, what is -725b5 - -2b06? -6b6ab In base 9, what is 2 + -27715247? -27715245 In base 2, what is -10000011010110000011001111 + -10100? -10000011010110000011100011 In base 4, what is -12330003132310 + 1? -12330003132303 In base 7, what is 230343333 + -3? 230343330 In base 14, what is -1d2675b1 - -1? -1d2675b0 In base 16, what is -49 - -cc91? cc48 In base 4, what is 310202023010 + 10? 310202023020 In base 9, what is 23158 - 4372? 17676 In base 11, what is -2 - -13747a03? 13747a01 In base 9, what is 654780 + -4? 654775 In base 15, what is 0 + -4ae27b? -4ae27b In base 12, what is -1b32257 - 2? -1b32259 In base 3, what is 1202 + 122102010211202? 122102010220111 In base 4, what is 10210 + 32323312? 33000122 In base 4, what is 3 - 323332323222? -323332323213 In base 16, what is -5 - 35b2726? -35b272b In base 16, what is -74 + -57ce? -5842 In base 9, what is -5224520 - 7? -5224527 In base 15, what is -1 + 9ee81e? 9ee81d In base 14, what is 4 - 946527? -946523 In base 9, what is 2 - 1336737? -1336735 In base 7, what is -2460141 - -13316? -2443522 In base 14, what is 1a842 + -c? 1a834 In base 12, what is a - 1aa8260? -1aa8252 In base 3, what is -10 + -111212111002001? -111212111002011 In base 12, what is 599a + -7b44? -2166 In base 16, what is -65 + -54ba60? -54bac5 In base 6, what is -344515024 - 322? -344515350 In base 3, what is -11020 + 2002010000? 2001221210 In base 15, what is -9 + 117155b? 1171552 In base 9, what is 2 + 71430021? 71430023 In base 3, what is -22102200 + 10020002? -12012121 In base 5, what is -102020342 - -4? -102020333 In base 13, what is -1c + -107b5a? -107b79 In base 16, what is 0 - 78fcf? -78fcf In base 4, what is -302112 - -233? -301213 In base 15, what is 7 - -549e3a? 549e42 In base 10, what is -8 + -9234046? -9234054 In base 3, what is 120002202011 + -210? 120002201101 In base 15, what is -24 - -4eebe? 4ee9a In base 15, what is -b62aa25 - 3? -b62aa28 In base 15, what is 2a + 273cd2e? 273cd59 In base 15, what is 267de44 - 1? 267de43 In base 10, what is 932 - -280? 1212 In base 3, what is 11001001221000 - 2201? 11001001211022 In base 7, what is 534355 + -11? 534344 In base 2, what is 101000110011010 - -1001110000? 101010000001010 In base 3, what is -11200 + 1001221222? 1001210022 In base 11, what is 5a9341a + -7? 5a93413 In base 10, what is 37259 - 3? 37256 In base 14, what is -14d - 12b0d? -12c5c In base 9, what is -352 + -6667? -7130 In base 6, what is -4044355053 + -3? -4044355100 In base 6, what is -211352051 - -4? -211352043 In base 10, what is 2188469 - 5? 2188464 In base 15, what is -1acae - -48c? -1a822 In base 10, what is 18301882 - -5? 18301887 In base 12, what is 81b8 - -326? 8522 In base 14, what is -11ab02 + -3? -11ab05 In base 3, what is -122112202 - -10121212? -111220220 In base 13, what is 4 + -961c05? -961c01 In base 8, what is 211024 - -536? 211562 In base 2, what is -10010001110110100101101 - 101? -10010001110110100110010 In base 12, what is -a - -ba3487? ba3479 In base 10, what is -169804 - 376? -170180 In base 5, what is -2304431 - 1124? -2311110 In base 4, what is -110000030111 - 101? -110000030212 In base 3, what is 1010 - -11001201101? 11001202111 In base 13, what is 453 + a527? a97a In base 16, what is 1c6d830 + 3? 1c6d833 In base 4, what is 1223 - -1302003302? 1302011131 In base 6, what is -3003 + -52421? -55424 In base 8, what is 752745 - 122? 752623 In base 5, what is 3440243 + -110340? 3324403 In base 11, what is 706293 + 22a? 706512 In base 6, what is 15103 + 1215410? 1234513 In base 16, what is -174 + -15d9? -174d In base 16, what is 5 + d81802b? d818030 In base 11, what is 6 - -526813a? 5268145 In base 5, what is -133011140201 - 1? -133011140202 In base 12, what is -349495 + 3bb? -349096 In base 11, what is 874a856 - -3? 874a859 In base 15, what is 13a - 116a? -1030 In base 5, what is -213100224 - 4433? -213110212 In base 4, what is -3332 - -203031302? 203021310 In base 8, what is -310140623 - -5? -310140616 In base 11, what is -341594a - 13? -3415962 In base 10, what is 0 + 7713002? 7713002 In base 11, what is 84a58 + -787? 84281 In base 6, what is 3154 - 154421? -151223 In base 11, what is -217a68261 - 2? -217a68263 In base 13, what is -5c + 9a53b? 9a4ac In base 10, what is -59 + 8776? 8717 In base 16, what is -aea55f5 - 8? -aea55fd In base 4, what is -1 + 11033122103? 11033122102 In base 9, what is -7 + -35018713? -35018721 In base 12, what is -16782b + 3? -167828 In base 4, what is -21 - -1102222030? 1102222003 In base 6, what is -55 + 151320323? 151320224 In base 10, what is -40536 + -12? -40548 In base 10, what is 84 + 900015? 900099 In base 15, what is 3 - -7c58445? 7c58448 In base 8, what is 3 + -4201346? -4201343 In base 8, what is -126 - 371614? -371742 In base 1	{ "pile_set_name": "DM Mathematics" }
rime factors of 916650. 2, 3, 5, 7, 97 List the prime factors of 5884644. 2, 3, 269, 1823 What are the prime factors of 6696? 2, 3, 31 What are the prime factors of 17649630? 2, 3, 5, 131, 499 What are the prime factors of 48875? 5, 17, 23 List the prime factors of 12205229. 12205229 What are the prime factors of 442851? 3, 147617 List the prime factors of 2580284. 2, 7, 92153 What are the prime factors of 1359819? 3, 151091 What are the prime factors of 2993171? 2993171 List the prime factors of 229573. 101, 2273 What are the prime factors of 2669073? 3, 11, 29, 2789 What are the prime factors of 19689462? 2, 3, 13, 84143 List the prime factors of 726875. 5, 1163 List the prime factors of 570911. 11, 17, 43, 71 What are the prime factors of 304651? 304651 What are the prime factors of 45572? 2, 11393 What are the prime factors of 2843717? 2843717 List the prime factors of 4359106. 2, 17, 29, 4421 List the prime factors of 26770091. 23, 1061, 1097 What are the prime factors of 4334859? 3, 481651 List the prime factors of 355587. 3, 118529 What are the prime factors of 114973? 114973 What are the prime factors of 203335? 5, 11, 3697 List the prime factors of 562717. 17, 79, 419 List the prime factors of 174883. 179, 977 What are the prime factors of 964500? 2, 3, 5, 643 List the prime factors of 862358. 2, 7, 31, 1987 What are the prime factors of 349389? 3, 38821 List the prime factors of 2329129. 11, 19249 List the prime factors of 423759. 3, 7, 17, 1187 What are the prime factors of 578399? 578399 What are the prime factors of 143713? 137, 1049 List the prime factors of 150404. 2, 19, 1979 What are the prime factors of 4355555? 5, 311, 2801 What are the prime factors of 1073948? 2, 268487 List the prime factors of 8167541. 8167541 What are the prime factors of 2842937? 2842937 List the prime factors of 725422. 2, 37, 9803 List the prime factors of 760002. 2, 3, 17, 7451 List the prime factors of 32912. 2, 11, 17 What are the prime factors of 663332? 2, 165833 What are the prime factors of 401292? 2, 3, 71, 157 What are the prime factors of 582029? 7, 17, 67, 73 What are the prime factors of 269433? 3, 17, 587 List the prime factors of 8804837. 23, 31, 53, 233 What are the prime factors of 7914505? 5, 1582901 What are the prime factors of 73962? 2, 3, 7, 587 List the prime factors of 734677. 251, 2927 List the prime factors of 187992. 2, 3, 7, 373 What are the prime factors of 36264? 2, 3, 1511 List the prime factors of 3503353. 7, 19, 53, 71 List the prime factors of 79084. 2, 17, 1163 What are the prime factors of 13384117? 17, 419, 1879 List the prime factors of 443588. 2, 43, 2579 List the prime factors of 14126014. 2, 7, 17, 61, 139 List the prime factors of 1089480. 2, 3, 5, 7, 1297 What are the prime factors of 55104? 2, 3, 7, 41 What are the prime factors of 13638132? 2, 3, 1559 List the prime factors of 628920. 2, 3, 5, 1747 List the prime factors of 11318985. 3, 5, 251533 What are the prime factors of 1203110? 2, 5, 31, 3881 What are the prime factors of 31113645? 3, 5, 2074243 What are the prime factors of 22207333? 19, 109, 10723 List the prime factors of 21720863. 31, 700673 What are the prime factors of 278846? 2, 139423 List the prime factors of 1185944. 2, 148243 What are the prime factors of 1225773? 3, 37, 409 What are the prime factors of 23606? 2, 11, 29, 37 What are the prime factors of 178573? 283, 631 What are the prime factors of 315429? 3, 105143 What are the prime factors of 373261? 7, 53323 What are the prime factors of 266072? 2, 79, 421 What are the prime factors of 211153? 211153 List the prime factors of 12484468. 2, 53, 58889 List the prime factors of 790054. 2, 395027 List the prime factors of 1243630. 2, 5, 124363 What are the prime factors of 3610587? 3, 29, 47, 883 What are the prime factors of 3751829? 23, 157, 1039 List the prime factors of 3542179. 73, 48523 List the prime factors of 1187719. 13, 211, 433 List the prime factors of 2515619. 19, 31, 4271 What are the prime factors of 4962280? 2, 5, 131, 947 List the prime factors of 17340818. 2, 11, 257, 3067 List the prime factors of 423199. 7, 60457 What are the prime factors of 5023505? 5, 19, 52879 What are the prime factors of 9795316? 2, 2448829 List the prime factors of 6150946. 2, 19, 157, 1031 List the prime factors of 3681699. 3, 7, 199, 881 What are the prime factors of 110315? 5, 22063 List the prime factors of 2131701. 3, 11, 13, 4969 List the prime factors of 13432873. 17, 790169 List the prime factors of 6298787. 11, 83, 6899 What are the prime factors of 4617308? 2, 1154327 What are the prime factors of 1011384? 2, 3, 11, 1277 What are the prime factors of 11308646? 2, 5654323 What are the prime factors of 13335922? 2, 17, 392233 What are the prime factors of 6267470? 2, 5, 11, 227, 251 List the prime factors of 838790. 2, 5, 37, 2267 List the prime factors of 326665. 5, 79, 827 List the prime factors of 319847. 11, 29077 What are the prime factors of 2377668? 2, 3, 198139 What are the prime factors of 4442888? 2, 555361 List the prime factors of 1353770. 2, 5, 11, 31, 397 What are the prime factors of 14469263? 14469263 List the prime factors of 5055488. 2, 4937 List the prime factors of 4508064. 2, 3, 11, 1423 What are the prime factors of 1898601? 3, 29, 139, 157 List the prime factors of 215431. 211, 1021 What are the prime factors of 343734? 2, 3, 59, 971 What are the prime factors of 390155? 5, 78031 List the prime factors of 6534188. 2, 17, 307, 313 What are the prime factors of 196609? 7, 28087 List the prime factors of 513333. 3, 57037 What are the prime factors of 4316461? 4316461 List the prime factors of 23664790. 2, 5, 41, 57719 List the prime factors of 1336862. 2, 757, 883 List the prime factors of 25147417. 31, 811207 List the prime factors of 36245727. 3, 7, 31, 67, 277 List the prime factors of 3002848. 2, 107, 877 What are the prime factors of 2132347? 7, 37, 8233 List the prime factors of 413274. 2, 3, 68879 List the prime factors of 1091576. 2, 136447 List the prime factors of 84756. 2, 3, 7, 1009 List the prime factors of 33728869. 33728869 What are the prime factors of 229040? 2, 5, 7, 409 What are the prime factors of 1449150? 2, 3, 5, 9661 What are the prime factors of 8045026? 2, 11, 365683 List the prime factors of 6423347. 7, 41, 22381 What are the prime factors of 3066129? 3, 11, 30971 What are the prime factors of 934948? 2, 7, 33391 What are the prime factors of 21969139? 821, 26759 List the prime factors of 269440. 2, 5, 421 List the prime factors of 9319. 9319 List the prime factors of 19046019. 3, 6348673 List the prime factors of 1391678. 2, 695839 What are the prime factors of 789681? 3, 263227 What are the prime factors of 8882559? 3, 7, 277, 509 What are the prime factors of 6346? 2, 19, 167 What are the prime factors of 227517? 3, 181, 419 List the prime factors of 173977. 173977 List the prime factors of 1481637. 3, 23, 109, 197 What are the prime factors of 314340? 2, 3, 5, 13, 31 List the prime factors of 182808. 2, 3, 2539 List the prime factors of 2487612. 2, 3, 207301 What are the prime factors of 324407? 353, 919 List the prime factors of 406708. 2, 17, 5981 List the prime factors of 8343151. 211, 39541 What are the prime factors of 153342? 2, 3, 7, 1217 List the prime factors of 337117. 11, 19, 1613 List the prime factors of 530661. 3, 176887 List the prime factors of 6765088. 2, 11, 19219 List the prime factors of 441936. 2, 3, 11, 31 What are the prime factors of 67547? 67547 List the prime factors of 592497. 3, 43, 1531 List the prime factors of 2790692. 2, 697673 What are the prime factors of 3417110? 2, 5, 23, 83, 179 List the prime factors of 1128773. 1128773 What are the prime factors of 286285? 5, 31, 1847 List the prime factors of 1893874. 2, 29, 32653 List the prime factors of 1083753. 3, 11, 41, 89 What are the prime factors of 4915274? 2, 7, 13, 113, 239 What are the prime factors of 5138346? 2, 3, 856391 What are the prime factors of 6241925? 5, 249677 What are the prime factors of 1859266? 2, 557, 1669 What are the prime factors of 105274? 2, 13, 4049 What are the prime factors of 344898? 2, 3, 2129 List the prime factors of 7068. 2, 3, 19, 31 What are the prime factors of 23	{ "pile_set_name": "DM Mathematics" }
/(-4))/((0 + 2)/(-24)). -6 Evaluate 6-2((-1)/36 - 0). 1/3 What is the value of 5 + 2/1 - 2? 5 0 + -1 + ((-18)/5)/(-6) -2/5 What is the value of 2 + 27/(-15) - 24/70? -1/7 Calculate ((-209)/3)/11 - 4/6. -7 Evaluate ((-15)/75)/((-3)/(-5)). -1/3 Calculate (-7)/28 - 2/(-8). 0 Calculate -4(-18)/(-24) + 34/10. 2/5 37/212/(-4) -1/2 Calculate (-15)/621 + (-7)/(-63). 2/23 Calculate 3/9 + 2/(24/(-100)). -8 What is (-589)/(-1395) + (-2)/10? 2/9 10/50 - (-19)/(-20) -3/4 What is ((-352)/11 - -11) + 12? -9 Calculate (-9)/21 + (-11)/693. -4/9 Calculate ((-2)/(-3))/((-42)/(-63)). 1 What is the value of 45/(-450) - 39/10? -4 Evaluate (4 - 72/16)/(1/4). -2 Evaluate (64/300)/((-7)/35). -2/5 Evaluate 4((-312)/(-880) - (-6)/(-15)). -2/11 Evaluate 8/5135/36. 6 What is (-8)/(-10)(-3)/(-12)? 1/5 What is (4/(-6))/(6/(-9)2)? 1/2 What is the value of 5 + -3 + 100/(-70)? 4/7 What is the value of 9(0 - (5 - 64/12))? 3 What is the value of (6/(-10))/(11 - 531/45)? 3/4 Calculate (-98)/(-24) - (-16)/(-152)38. 1/12 3/12 + 255/180 5/3 ((-1)/4 - (-2)/8) + -4 -4 Calculate (5/((-200)/48))/((-1)/(-5)). -6 Evaluate (-7)/(-6) - 26/39. 1/2 What is the value of (-2)/(-14) - (-315)/(-147)? -2 Evaluate -2(27/(-12) + 1/4). 4 14 - (1 + (-40)/(-3)) -1/3 -1 + 12/14 - (-3)/(-273) -2/13 Calculate -2(6 + 24/(-6)). -4 What is -2(-4)/8 - (-19)/(-17)? -2/17 What is the value of ((-52)/(-273))/(4/3)? 1/7 What is 34288/864? 4 Calculate (-4)/(-10) - (-6 - (-64)/10). 0 Calculate 15/60 + 5/(-100). 1/5 Calculate (17/(85/(-3)))/(1/(-5)). 3 Evaluate -1(-1 - 3)/4. 1 Calculate 5/4 + ((-20)/16)/5. 1 Evaluate 230/(-80)(-1)/2. 3/8 Evaluate 22/1265-5 + 295/(-575). -3/5 Calculate (-15)/93/(-4). 5/4 What is the value of 6/82(-1 + -1)? -3 What is the value of (0 - 1)-745/252? 5/4 ((-6)/(-64))/(72/64) 1/12 What is the value of 34/10 - (-7)/(35/(-2))? 3 What is the value of ((-9)/81)/((-2)/4)? 2/9 Evaluate (9/3 + (-30)/8)1. -3/4 Evaluate (-66)/396 + 70/276. 2/23 Evaluate (-11)/11(6/2)/(-1). 3 8/(-16)(0 - 2 - -10) -4 Evaluate ((-2 - -9) + -2)/((-2)/1). -5/2 What is -2(-42)/12 - 7? 0 Calculate 8 - 9 - (6 + -6). -1 8/(-15) - (-2)/(-15) -2/3 1/55-1 + 24/(-132) -1/5 Calculate 272/64 + (-5)/1. -3/4 What is the value of (-4 - -4)/(-1 - -2)-1? 0 Calculate ((-2)/(-4) - (-4 - -3))2. 3 What is (-12)/52(-4 - (-20)/6)? 2/13 Evaluate ((-18)/(-4))/3 + (-3)/3. 1/2 (0 - -4)/(-1) + 6 2 What is (-2 - (-1 - -8))22/33? -6 Calculate 1 - (50/(-14) + 9/(-21)). 5 -1 + (-22)/(-6) + -2 2/3 What is 22/2 - (-3 + 10)? 4 Evaluate 34/14 + -5 + 2. -4/7 Evaluate ((-6)/10)/((-600)/80). 2/25 Evaluate ((-1)/(-3))/(58/(-174)). -1 Evaluate 41 + (-28)/7. 0 What is the value of (-1)/8 + (6237/968)/21? 2/11 What is the value of -3 + 150/54 + 43/(-9)? -5 Evaluate (-3 + 11)/1 - 130/13. -2 What is the value of (4 + -3 + -3)1? -2 What is the value of -12(-24)/16? 3 Evaluate (192/6)/(-8) + 2. -2 What is the value of ((1320/(-42))/(-5) + -5)/(-3)? -3/7 Evaluate 4/2 - 4/3. 2/3 Evaluate 3/(-24) - 34/(-16). 2 Calculate (-52)/(-14) - (-27 - -31). -2/7 What is the value of 2 + (-5 - -2) + 2/8? -3/4 Evaluate (-5)/(5 + 0)(-2)/(-6). -1/3 What is (4/(-44))/(6 + (-66)/12)? -2/11 What is the value of 11/33 - (-20)/(-6)? -3 Evaluate 13 - (-1 + 351/26). 1/2 (4 - 0)2/28 2/7 What is the value of 2/(-20)(5 + (-25)/(-10))? -3/4 What is the value of (25 + -27)(-10)/(-4)? -5 Calculate (30/(-4))/5 + 1/(-2). -2 55/(-198)2/5 -1/9 Evaluate (20/(-15) - -1)-9. 3 What is (-9 + 4 - -1) + 8? 4 Evaluate 5 - 0/((7 + -5)1). 5 Evaluate (-81)/54(-1)/(-9). -1/6 Evaluate (1/3)/((-50)/(-300)). 2 What is the value of 1 - ((-80)/(-140) - 6/(-14))? 0 Evaluate (-84)/(-30)(-10)/4 + 4. -3 63/(-18) + -9 - -12 -1/2 What is 7/(735/90) + (-136)/126? -2/9 Evaluate (12/(-39))/(-2) - 37/(-13). 3 (6/70)/((36/(-40))/(-9)) 6/7 Evaluate (2 + (-20)/6 + 1)0. 0 Evaluate (-4)/3(1 + 2). -4 What is the value of 1/(2 - 3) - -5? 4 What is (-750/(-140))/((-1)/2)? -5 Calculate 68/136(-4)/(-6). 1/3 6/4((-77)/42)/(-11) 1/4 What is the value of ((-12)/63)/((-22)/3 + 6)? 1/7 (2/(-8))/((100/(-32))/(-5)) -2/5 -59(77/35 - 2) -9 What is ((-9)/61)/((-3)/(-8))? -4 (-16)/28((-24)/(-4) - 5) -4/7 ((-4)/20 - (-12)/(-15)) + 5 4 What is the value of (60/(-24))/((-1)/(-2))? -5 (-1304)/(-184) - (-30)/(-345) 7 Evaluate ((-6)/(-36)-4)/2. -1/3 What is the value of 3(-7)/((-168)/(-40))? -5 What is (2 - -1)/((-14)/8 + 1)? -4 What is the value of (30 - 31)/(2/14) + 3? -4 What is (3/(-6))/(1 + (-10)/8)? 2 What is the value of (-1 + (-55)/(-25))/((-4)/10)? -3 18/784/(-6) -2/13 Evaluate 1 - 22/70 - (-38)/(-133). 2/5 Calculate (-6)/24 - (-4 + 28/7). -1/4 Evaluate (-2)/(-4)29/(1218/28). 1/3 What is (200/(-175))/((-12)/(-14))? -4/3 What is 6(-1)/(-63) + (-496)/(-84)? 6 What is the value of (6/8 + -1)6? -3/2 Evaluate (-248)/(-93) + (-38)/12. -1/2 210/(-24) - 162/(-18) 1/4 (-1 + 1/3)12/32 -1/4 Calculate 3/6(11 - 1). 5 What is the value of 4 - ((-22)/44)/((-3)/6)? 3 ((5 - 3) + 16/(-8))/(-4) 0 Calculate (-1 + 9/8)8. 1 Evaluate (-6)/8 + (-22)/(-72). -4/9 Evaluate ((-220)/(-66))/(5/6). 4 (-15)/201-8 6 (-63)/14(-5)/(225/6) 3/5 Evaluate 0 - (-1 - 1) - 8/6. 2/3 Calculate (12 + -12)/(2 - 1). 0 Evaluate 6/(-36) + (-6 - 438/(-36)). 6 What is (-1469)/(-104) + -12 - (-1)/(-8)? 2 What is the value of (32/120)/((-4)/6)? -2/5 What is ((-9)/18)/((-9)/(-6))? -1/3 What is the value of -5 - (4 - 8 - 6)? 5 Calculate 13/91 - 22/56. -1/4 Calculate (-2)/(-9) + 1900/(-855). -2 What is the value of (4/2)/(18/(-4 - 5))? -1 What is the value of 0 + 1 + -3 + 3? 1 Evaluate 28/(-14) - (-16)/7. 2/7 What is the value of -3 - (93/33)/(-1)? -2/11 Evaluate 64/(-12) - (-11)/(11/6). 2/3 What is the value of 2(10/3)/(4/(-1))? -5/3 What is the value of 0/(-10 - (-2 + -7))? 0 Calculate (-72 + 74)3/10. 3/5 ((-36)/(-120))/((-8)/(-20)) 3/4 (-6)/5 - 2288/(-440) 4 4(2 - (-7)/(-4)) 1 Calculate 0 - -12 - 14 - 8/(-5). -2/5 Evaluate (-48)/(-10) - (-24)/(-30). 4 Calculate 1/(-5) + (5 - (-140)/(-50)). 2 What is the value of (-1)/(329/(-42) - -8)? -6 What is the value of (-4)/2 + (-3 + 6 - 2)? -1 What is ((-30)/40)/((486/96)/3)? -4/9 Calculate 2 - (-32)/(-18) - 117/162. -1/2 Evaluate 5/303 + 2/(-8). 1/4 Evaluate 102/(-119) - (-16)/14. 2/7 What is the value of 10/25 + 1/(-5)? 1/5 What is 4(-12)/72-1? 2/3 Evaluate 53/(-9) + (-192)/1728. -6 Evaluate 5 - 159/30 - 68/40. -2 Evaluate (-56)/(-6) - (12 - 3). 1/3 (-64)/(-40)25/10 4 Calculate (60/135)/(42/(-27)). -2/7 (3 - 28/8) + 3/10 -1/5 What is the value of (0(-4)/(-24)1)/(-1)? 0 What is (-5)/(-40)-118/3? -3/4 Evaluate -6 + 98/21 - (-1)/3. -1 What is (0 + 7)/((-27)/27)? -7 Evaluate ((-3)/(-2))/(16/(-32)). -3 (4 - 141/21) + 3 2/7 What is the value of (8/(6 - 14))/(-1)? 1 -28(6/(-84)-7)/2 -7 Evaluate (7/(-21))/(-2 - (-15)/9). 1 Calculate ((-870)/(-225) - 4)/(2/3). -1/5 What is the value of 28/20 - (1 - 0)? 2/5 Calculate (-3)/(-5)((-9)/(-6) + -4). -3/2 What is ((-6)/4)/((-15)/(-40))? -4 Evaluate ((-70)/(7/1))/(1-2). 5 What is ((-26)/(-24))/(48/128) - 3? -1/9 What is the value of 4/(-22) + 1/((-286)/(-195))? 1/2 -4 - ((-66)/17)/1 -2/17 What is 10/(-26)(-4)/50-5? -2/13 Evaluate -5 - (33/9 + -8). -2/3 What is (-49837)/162260 - (-1 - (-3)/4)? -2/35 What is 3/4 - (-9)/(-12)? 0 Calculate (5 - (-5 + 11))/((-1)/(-2)). -2 What is (-9)/14 + 31/62? -1/7 Calculate 6/(-8)2(-3)/18. 1/4 -18(-20)/54 + 5/(-3) 5 1/(3(-3)/9) -1 What is 5 + -1(-9)/(-3)? 2 Calculate (-2)/3(-96)/(-224). -2/7 What is 216/60 + -9 - -5? -2/5 What is the value of -9 - 0/6 - -2? -7 Calculate -18/41/(-2). 1 What is the value of ((-22)/(-462))/(3/(-9))? -1/7 8/(-2) - (22/(-4) + 1) 1/2 Calculate (9 + -6)/(12/20). 5 What is the value of 3/(-39) + 3 + (-462)/(-91)? 8 What is 0/3(-1)/(-2)? 0 -6 + 5/(-5) + 130/13 3 Evaluate (-192)/231 - (0 + (-48)/88). -2/7 (-2 - 4) + 3/610 -1 54/42 - (-16)/(-112) 8/7 What is ((-26)/(-130))/((-4)/(-35)) + -2? -1/4 What is the value of (13 - 14)/(22/2)? -1/11 What is the value of 1/(-23) - 26562/5359? -5 Evaluate ((-224)/420)/((-144)/20). 2/27 4/5(-40)/(-112) 2/7 Calculate (4 - (-4)/(-16))(-2)/9. -5/6 Calculate ((-12)/9)/((-19)/(684/(-40))). -6/5 Evaluate (-7)/(-30) + 133/42 + -3. 2/5 Calculate -25144/(-420) - 9. -3/7 Evaluate -1(-6)/33 + (-48)/(-220). 2/5 What is the value of (-	{ "pile_set_name": "DM Mathematics" }
(8/(-20)) + 1 1/4 Evaluate (-1672)/165 - (-3 + -4) - -3. -2/15 What is 55/140 + 22/(-154)? 1/4 What is (-25)/110 - ((-5)/(-30))/(-1)? -2/33 What is the value of 104/(-96) + (-6)/(-8)? 1/3 (-13)/507-357 + -9 2/13 (6/28)/(-4 + (-40)/(-7)) 1/8 (-8)/44 - ((-1584)/(-605) - 3) 1/5 What is ((-12)/(-192)-12)/(1/(-8))? 6 Calculate (-6)/(-39) + (-38)/78. -1/3 What is the value of (255/35)/3 - 2? 3/7 Evaluate -4 + 147/70 + 6/4. -2/5 What is 1/(-18)(-36)/(-9)? -2/9 Evaluate ((-4)/(-21))/((-2)/6). -4/7 What is the value of 172/44 + 1/11? 4 What is (14 + (-2574)/182)/(2/21)? -3/2 Calculate ((-48)/32)/(42/(-8) - 0). 2/7 What is (-1)/(56/(-120))? 4 (-6)/126 + (-2)/7 -1/3 What is (0 - -1)/(25 + -8 + -18)? -1 What is the value of 28/(-147)42/12? -2/3 Evaluate (30/(-12))/((-9)/6 - -2). -5 Calculate (-3 - (-1 + -4))6/8. 3/2 Evaluate (2 + -1)((-3)/3)/1. -1 ((-39)/156)/(2/(-8)) 1 Calculate -2 + (2 - (-8)/(-10)). -4/5 Calculate (-10)/25 + (-64)/(-10). 6 (3 - 300/102)/(2/(-4)) -2/17 What is ((-55)/(-66))/(7/(-42))? -5 Evaluate (-5)/100(-17 - -16). 0 (-3)/(-4)216/8 3 What is the value of (-11)/(30 - 8)(-18)/(-15)? -3/5 What is ((-2)/(-1))/(-1 + -6 + 1)? -1/3 Evaluate 63/91 - 3/(-1). 10 What is 1/(-5) + (-12)/(-60)? 0 What is (1 - 1) + (0/(-3) - -4)? 4 Evaluate -28 + 31 + 27/(-11). 6/11 What is ((-126)/(-36) - 4)(0 - -22)? -11 What is the value of (-3)/35(-819)/(-234)? -3/10 Evaluate 3 + (-12)/4 + 2 + 1. 3 Evaluate (-260)/160 - (-20)/16. -3/8 Calculate ((-2)/4 - 0)/((-3)/30). 5 What is the value of ((0 + 1/4)0)/2? 0 Calculate (-7)/(-2)(-4)/(-7). 2 Calculate 9 - 6 - (2 + (-21)/(-15)). -2/5 What is the value of (-3)/6 - (-45)/50? 2/5 What is the value of (-6)/(-15)(-285)/152? -3/4 1 + 2 + -5 + 3 + 0 1 (1(-15)/10)/(4/8) -3 What is (-38)/(-14) - (9 - 6)? -2/7 What is the value of (-32)/(-30) + (-10)/15? 2/5 What is (16/(-14))/(10/(-35))? 4 What is ((-1)/9)/((-1)/(-6))6? -4 Calculate 11 - (11 - (-11)/88). -1/8 What is the value of ((2 - (1 - 1)) + -6)1? -4 What is (-258)/(-63) - -2(-7)/147? 4 Evaluate 10/180/(-200). -4 What is the value of (-2)/315/200? 0 Evaluate ((-18)/513)/(2/(6 + 0)). -2/19 Calculate (-4)/((-2)/(-2)) + 8 + -10. -6 What is (0 - 5) + (-231)/(-45)? 2/15 Calculate 57/15 - 8/10. 3 What is (112 + -113)2/3? -2/3 Evaluate 4/(3/2(-572)/(-39)). 2/11 (175/(-700))/(3/20) -5/3 ((-11)/(-66))/((3/(-8))/3) -4/3 Calculate 2/(-16) - (-3950)/1264. 3 Evaluate 2/448/6-1. -4 Evaluate (-25 + 24)(-14)/(-6). -7/3 4/(-1) - 4 - 3852/(-486) -2/27 What is the value of 0 - 036/(-36)? 0 -1(-1)/(-4) - 11/4 -3 What is the value of (-10)/(-27)64/20? 4/9 (-6 - (-76)/8)(-2)/(-14) 1/2 Calculate -4 + (-35)/(-10) - (-3)/42. -3/7 Calculate ((-33)/(-6))/((-30)/(-4) + -8). -11 Evaluate 1((-2)/1-1 + -1). 1 Calculate (-6)/(-2) + 26(-6)/36. -4/3 What is the value of 3(-6)/18(3 - 0)? -3 Evaluate -12 - -13 - (-3 - -2). 2 Calculate (-10)/(40/(-12)) - (-38)/(-14). 2/7 What is 6/((-1512)/44) + (-2)/18? -2/7 What is the value of (-44)/8 - (-64)/8? 5/2 What is 33/(-22)(-1)/(-6)? -1/4 Calculate (4 - 412/100)-5. 3/5 Evaluate 400/(-120) + 2/6. -3 What is the value of (-28)/7 - 11/(-3)? -1/3 Evaluate (16 - 20)/(12/(-15)). 5 Calculate (-6)/9(-27)/21. 6/7 Evaluate 21/(-3(-2 + 3)). -7 What is the value of (30/21)/(300/350)? 5/3 Calculate 5/(-10)(-2)/9. 1/9 7 + 5 + -19 + 2 -5 What is 76/(-16) - -22/(-16)? -5 Evaluate ((-36)/(-162))/((-8)/12). -1/3 What is (-16)/40 + 0 - 8/5? -2 What is (-8 - -7)(-5)/5-3? -3 -4 + (-3)/(-5)5 -1 What is the value of 3/223/27? 1/3 Evaluate (-3)/(-27) + (-2)/1810. -1 What is the value of (-551)/95 - (-12)/2? 1/5 What is 9(2 + 2)(-3)/18? -6 Calculate ((-4)/6)/((-10)/(-15))1. -1 Evaluate (-5 - (-30)/8) + 1. -1/4 What is the value of (-33 - -36)/(-4 + -1) - 0? -3/5 (-2 - -1)(1/(-2) - -1) -1/2 What is the value of -3 + 6/7837? -2/13 What is the value of -1 + (-6)/((-36)/42)? 6 What is ((-10)/6 - -2)/(31)? 1/9 Calculate 42/(-18) + (-2)/3. -3 What is the value of (10/(-35))/(2/(-14))? 2 Evaluate 2/3 - (-6)/(-9). 0 (-5)/3 + (-2)/(10/(-5)) -2/3 What is the value of -5 + 43/9 + 0? -2/9 (-1)/3 - (40/105 + -1) 2/7 Evaluate 12/(-28) - 4/(-14). -1/7 What is the value of 16/64(1 + -1 + 1)? 1/4 Evaluate 56/(-42) + ((-160)/(-15))/2. 4 What is the value of 8/1 + -2 + -5? 1 (700/(-126) - -6)/(2/(-6)) -4/3 (6/(-27))/(-1) + (-40)/18 -2 (8 - 8) + -22 -4 2/4(0 - 0) + -5 -5 Evaluate 20/(-6)(-144)/96. 5 What is the value of 12 + 36/(-16)4? 3 Calculate (-9)/((-90)/(-8)) - -1. 1/5 What is ((-3)/(49 + 5))/(1/(-8))? 4/9 What is (-481)/185 + -1 + 3? -3/5 Calculate (-2)/3522/(-116). 3 What is 27/(-6) + 25/10 - 4? -6 Evaluate 714/105 + 2/10. 7 Calculate (-44)/10 - 8/(-20). -4 Calculate (-3 - 1)((-54)/9 - -7). -4 What is the value of 225/(-10) + 3? -2 Evaluate (-6)/8 - 350/(-360). 2/9 Evaluate (-63)/(-18)(-8)/(-7). 4 Calculate 2 - 0 - (-70)/(-30). -1/3 What is the value of ((-36)/8 + 7)8/(-10)? -2 Evaluate 5 + (-168)/20 + 3. -2/5 Calculate ((-66)/24 + 3)(-24)/39. -2/13 What is the value of 24/(-144) + 14/12? 1 Evaluate (-5)/28-4 - 1. -2/7 (1/(-4))/(395/(-632)) 2/5 What is the value of 36/96 - (-183)/24? 8 What is 6/(-63)-1-3? -2/7 What is (-2)/(-7) + (-4)/(112/(-76))? 3 (-1)/(1 - (-5)/(-10)) -2 Evaluate (-8)/14 + (-18)/(-105). -2/5 What is (12/(-210))/(3/15)? -2/7 (-31 - -28)(-1 - -2) -3 What is 0 - (-1 - -1)2/(-4)? 0 Evaluate (12/3 - 7)2/2. -3 What is the value of (-96)/10 - (9 - (-432)/(-45))? -9 Evaluate (495/10)/(-9) + 5. -1/2 Calculate 5/1016. 3 Calculate 5/20(-8)/(-14). 1/7 Calculate 2 + (-2)/856/5. -4/5 What is (-98)/(-34) + 0 - 84/(-714)? 3 What is the value of 10 + (-135)/19 + -1 + -2? -2/19 What is the value of 30/(-75) - (-4)/(-40)? -1/2 What is the value of 50/(-1000)(-2 + -26)? 7/5 Calculate -1 - (0 + 3 + -5). 1 13172/(-12816) - 1/((-8)/10) 2/9 Evaluate (-7)/35 - 3/(105/13). -4/7 (10 + -11)8/(-68) 2/17 What is (-232)/(-36) + 4 + (-80)/18? 6 2/53/6 1/5 Evaluate 6 + -1 + (1 - 8) - 0. -2 What is (-3315)/(-1716) + 21/(-12)? 2/11 What is the value of (-2)/(-5) + 6/10 + 1? 2 What is the value of 5/(-30)30? 0 Calculate 3 + 2/(-12) - 3. -1/6 Calculate (-2 - 69/(-45)) + 7/(-35). -2/3 ((-4)/(-16)2)/(21) 1/4 ((-749)/214)/(-1 + (-6)/(-4)) -7 What is the value of (-1 - (-4)/(-8)-6)1? 2 What is (58/464)/(1 - (-2)/(-4))? 1/4 6/(-3) - -5 - (1 + -2) 4 What is -5 + 11 + (-6 - -1)? 1 What is the value of 1/4 - (-76)/16? 5 Evaluate (-2)/7 + 88/210. 2/15 Evaluate 4/(-8)11/(-4). 1/8 ((-28)/(-20) - 1)/((-2)/10) -2 What is the value of (-9)/(-33) - 870/(-319)? 3 What is -6 + (896/147)/1? 2/21 Evaluate 1 - 77/(-99)-9. -6 What is the value of (-1 + 8/40)/((-7)/(-5))? -4/7 What is (-15)/(30/7) - -2? -3/2 Calculate (-6 + 11)/5 - (-16)/(-10). -3/5 What is the value of (66/693)/(3/7)? 2/9 What is the value of -3(3/18 - 0)? -1/2 What is the value of (-9 - -10) + (-14)/12? -1/6 Evaluate (-56)/(-196) - (-74)/(-14). -5 Calculate (-4)/62 - (-816)/(-3689). -2/7 What is 6 + 36/(1 + -7)? 0 What is the value of (8/3)/((-2)/3)? -4 What is the value of 18/21 - 992/651? -2/3 What is (-3)/(-168)-6(-91)/(-26)? -3/8 What is the value of 18392/(-1881) - (-4)/(-18)? -10 What is (-11)/231 + 4/(-42)3? -1/3 Evaluate (6/50)/(3(-12)/(-40)). 2/15 What is 2 + 0 + -7 + 11? 6 What is (-33)/21 + (-3)/7? -2 What is the value of 1 - 2 - 40/(-20)? 1 51/(-18) - 15/(-5) 1/6 What is the value of (-42)/3927 + 2/4? -1/4 What is 2 + (-68)/12 - -3 - 0? -2/3 Calculate 5/(-10)(6 - 4). -1 Calculate 4/(-10) - (161/35 + -5). 0 What is (-25 + 16)2/(-3)? 6 Calculate (-52)/6575/(-10). 6 Calculate ((-48)/(-240))/((-2)/(-90)3). 3 What is the value of (-4)/(-3)(39/(-52) - -3)? 3 Calculate 120/(-50)20/8. -6 Evaluate 81/(-15) + ((-21)/35 - 0). -6 (-515)/7357 - (-2)/(-21) -5 ((16/(-2) - 0) + 6)1 -2 What is the value of (-2)/10 - 28/10? -3 What is -1 + 7/252 - 3/(-4)? -2/9 What is (-6)/15 + 56/(-35)? -2 What is 1 - (-4)/3(4 + -1)? 5 What is (-1 - (-35)/14)(-2)/(-12)? 1/4 What is 3/2(-260)/(-39) - 5? 5 Evaluate (-4)/362 + 58/18. 3 2/(-5)(-1 - 63/(-3)) -8 Evaluate (-8)/(-10) - 8990/13175. 2/17 (120/(-90))/((-5)/(-3) - 1) -2 (16/40)/(10/25) 1 4/(-6) + 32/(-24) -2 What is 190/(-25) - (-18 + 10)? 2/5 What is ((-11)/33)/(2/(-4))? 2/3 What is 6 + 7 - 570/42? -4/7 Evaluate ((	{ "pile_set_name": "DM Mathematics" }
550/(-595) + 5088/51 100 Evaluate 6 + 12 + (17 - (-96)/(-6)). 19 What is the value of (18705/60)/43 - ((-12)/(-15) - (-213)/(-60))? 10 ((-2)/(-9))/((-15)/2430) + 3/(-1) -39 What is 68/(-51) + ((-1)/5)/((-235)/1410)? -2/15 What is the value of 3(2/(-25))/(18 - (-3408)/(-190))? -19/5 What is the value of (329/35 + (-45)/9)/(8/(-240)1)? -132 Evaluate 6/(-5)((-1400)/(-15))/(70 - (29 - -39)). -56 Calculate (-9 + (-952)/(-80))/(8721/190 - 46). -29 What is the value of (26/78)/((-9 + 3)(-10)/(-560))? -28/9 Evaluate (-3154)/(-1650) + (-192)/(-1056) + 7/(-3). -6/25 Calculate (-13 + (29 - (-12 + (-435)/(-15))))-75. 75 What is the value of 32 - 1008051/(-8470) - 151? 1/70 What is the value of (-12 - 1 - (-85554)/6588)/((-340)/204)? 1/122 What is -69 - (-67 + 2132/41)? -54 What is the value of (1146 - 1166)/((-34)/(-6) + -1)? -30/7 (-117)/((-10998)/(-3901)) + ((-1)/2 - 0/1) -42 Evaluate 10 - 69095/4252(-8)/(-14). 5/7 Evaluate (((-3699)/54)/137)/(1/(-4)-46). -1/23 Evaluate ((-2736)/760)/((-20)/(-3000)-5). 108 What is 12/3(-13 + 15 + 4/2)? 16 What is (-4092)/9926/11? -9/4 What is the value of ((-130)/8)/(350415/(-263560))? 110/9 What is the value of (-117)/((-28 + 19)/(-3))? -39 What is 247 + -286 - 165/(-5) - -38? 32 ((-10)/(-25) - 9/10)42/56 -3/8 Evaluate (-675)/(-81) - 2516/204. -4 11/(319/(-1593)) - 836/12122 -55 (-62 + 29 - -8) + 8/(-2 - -3) -17 What is the value of (-2057)/(-6171)(-27)/(-4)? 9/4 Evaluate (44064/270)/(-8)(-200)/60. 68 22 + (-477545)/(-12963)(-24)/40 -3/29 What is ((-59551)/(-124))/17 + (-9)/4 - -12? 38 Evaluate (515/1400(-24 - -32))/(24/8). 1/7 (-65 - -59) + (95 - 204/(-17)) 101 What is (-4 + -4)444/10064? -6/17 What is -27(2340/972)/13? -5 Calculate (40/(-50))/((-6)/(-30)70/(-1365)). 78 Calculate (-18320)/2748 + (8/12)/(-2). -7 (243/108 - 83/(-12))(-40)/(-200) 11/6 Calculate ((-32)/28 - 6) + (-48)/56. -8 6/(-8)45096/9395 -18/5 Calculate (-670225)/184110 + (-8)/(-3) - (-1 + 0). 1/38 Calculate (20646/111)/(64/(-12)). -93 Evaluate 86/(-2) + (-54)/(-369)-41. -49 Calculate ((-6048)/2720)/635. -3/17 Calculate (1/(-3) - 36/54)/(1246/(-252) - -5). -18 (-57)/(798/238) + ((-7488)/440)/(-1) 1/55 Calculate (-430)/(-55) + -8 + (-68)/(-1309)-959. -50 8(2/(-143))/(29920/16456) -4/65 Calculate (-80)/150(-1980)/24. 44 What is -725 - -765 - (-3 + -66)? 109 What is the value of (-4288)/(-96) + (-11165)/957? 33 What is 3449/(-8330) - ((-1)/(-4) + 19019/(-3420))? 46/9 2-28 + (3680 - 3608) 16 What is the value of ((-264)/220)/((-21)/(-28) - (-2376)/(-160))? 4/47 What is the value of 18/5(-29 - 5217/(-333))? -48 Evaluate (141/21 + -3)/(8856/3444). 13/9 What is the value of -265(78/(-30))/13 - (5 + -2 + -5)? 55 Evaluate (-4 - 23 - -23)/46. -2/23 What is 12 + 19212/(-1584) + (-32)/(-128)? 4/33 What is (11 + -1 + 507/(-39) - 238/(-35))15? 57 Evaluate ((-22 - -46) + -6)((-80)/12 + 3). -66 Calculate (8 + 0)(-37)/5921. -1/2 (-7278)/130 - (-3007 + 2951) 1/65 Calculate (2(-686)/784)/(280/32). -1/5 -2 + 42 - 339026/8523 - (0 - 526/(-18)) -29 What is 20057/(-434) + 820/70? -69/2 What is (4/(-14))/((-228404)/13783)64? 12/29 Calculate (-12)/24 + ((-8)/3 + 2)/(1476/(-1134)). 1/82 (-42 - (-11045056)/258456) + -1 + (-18)/(-66) 2/267 Evaluate 22/(-108 + -24)(-3 + 54/(-4)). 11/4 Evaluate 1/((-94)/4) - 2992630/(-47470). 63 Calculate ((-147)/14 + 8)((-21186)/(-3030) - 7). 2/101 Evaluate ((-9120)/1050 + 2/7)/(-7 + 259/35). -21 What is 10/150259786/(-1165)? -14 Calculate ((5 + 2)-1 - 2) + 335216/37376. -1/32 What is (-40576)/4032(-70)/20 - 4/18? 35 What is (-78)/(-15) - (((-380)/(-19))/40 + 20/8)? 11/5 (-17)/323-19(-4512)/48 -94 What is (-40)/(-35) - (-3 + -12(-230)/210)? -9 (-10312)/(-3867) + (-14)/(-6) + -4 1 15 + -19 + (-3 + -4)(16/(-14) - 11) 81 What is -1 - (58 - (-24)/(2 + 10) - 12)? -49 Calculate (-41 - (-38 + 18))(-7)/(-980)-4. 3/5 143 + (-12168)/(-27 - -105) -13 Calculate 24/(-34)12699/(-996). 9 What is the value of (-64790)/(-1349) - (-42)/(-1491)? 48 What is the value of (-1200)/(-125)-121/(-28)? 36/5 What is the value of (-1 - -2)/(524/393 - (-55)/(-39))? -13 Evaluate 39936/(-18720)9/(-1776). 2/185 What is 31 - 30/((-1890)/(-1881))? 8/7 (-72)/(-15)24460/11007 32/3 What is 321/15 + ((-4108)/(-130) - 29) - 75? -51 -210(-16)/(-216)(4/(96/(-159)) + 7) -35/6 (-207740)/(-4512) + -47 + 1 1/24 What is the value of ((-504)/21816)/((-77)/66)? 2/101 Calculate (-11)/(-3)219/(-23) - (133 - 162021/1219). -35 Calculate (-6)/27-93 - 77/(-33). 23 Calculate -25 + 30 + 4 + -5((0 - 2) + 0). 19 Evaluate -1 + 45 - (62/(-372))/((-4)/24). 43 Calculate (3/(-26))/((-2088)/(-1856)(-4)/(-6) + 0). -2/13 What is (2112/1596)/(-27 + 28)? 3/19 What is (602/51471)/(3/9)? 2/57 64645/(-980) + (-161)/4508 -66 Calculate (6 - (-2048)/(-340))/((-1629)/9231). 2/15 What is (-91)/(-2002)(-22 + 20)? -1/11 Evaluate -7 - 9 - (600/102 + ((-64)/68)/(-8)). -22 Evaluate (-51 + (-29187)/(-575))(-1)/((-39)/5). -2/65 Evaluate (31 + 138583/(-4587))-3. -26/11 Evaluate 8225/(-470)((-3)/(240/44) + 2/(-8)). 14 What is the value of 16/(-3)((-4)/6 + -4 + (-90)/(-540))? 24 ((-54)/158433)/(3/(-24)) 9 What is the value of 11/(847/(-14))-332/(-522)? -2/87 What is the value of 52 + -2 - (5 - -53)? -8 9/96 + (-755604)/19328 -39 Evaluate 746/3730 + (-224)/(-5). 45 Evaluate (-86)/(-95) - (-40)/(-50) - (-7052)/(-4902). -4/3 -69 - (-87)/((-6090)/(-6790)) 28 Calculate (1 - 1)/(0 - -1)((-10650)/60 - -177). 0 -1(-74)/14 + (52/(-1196)-989 - 49) -5/7 What is 422258/(-9032)? -2 What is (-43 - 34 - -72) + 75? 70 Evaluate (-5 + 2)((-2)/(-5) - (-74)/(44400/1160)). -7 Evaluate 260/(-22) + (115 - (-26 + 127)). 24/11 Calculate 48 + 9/((-1071)/5695). 1/7 What is the value of ((11088/35)/12)/((-390)/(-975))? 66 What is the value of (10 + 7)/(-9 + (-475)/(-50))? 34 What is (3(-5)/120)/((-10679)/712 - (-39 + 24))? -89 Evaluate -71 + 11 + 37 - 17. -40 9 - -1 - (((-185832)/(-3564) - 42) + (-8)/264) -1/9 Evaluate 0 + -1 - 91/(-39) - (-5586)/(-1368). -11/4 What is (98642/6882)/((-3)/18)? -86 Calculate -1424/16 - (-10920)/504. 2/3 What is -33(426060/(-243))/263? 60 What is the value of ((-23)/1242258 + 2/(-9) - -3)25? -50 Evaluate 10/80984/(32 - 35). -41 Evaluate ((-104)/224)/131/2(-6 + -58). 8/7 45/(-1) + (-1372469)/(-30527) -2/49 Calculate (1 + (-7 - -18))/((-303)/101) - 11. -15 What is the value of ((-4)/21)/((-126)/(-567))? -6/7 What is -25((-32375)/625 + 53)? -30 Calculate ((-1)/(-7) + 8/(-28))(852 - 1034). 26 Calculate (4219600/(-67130))/((-10)/7). 44 What is (9 - 30/4)/((-123)/2706)? -33 Evaluate (-4)/56(12/(-474) + 1720/5530). -1/49 What is the value of (2/(-67))/((-8)/((37 - 33)-1))? -1/67 Evaluate (-232)/(-261)18 + (-9 + 5 - 12). 0 Evaluate 28138/638 + ((-210)/290)/7. 44 1/(195/(-10)) - ((-27180)/702 - -57) -55/3 What is 60291/696696(-4)/9? -1/26 What is (-12 + (-2912)/(-240))/((-1)/(70/49))? -4/21 (122/(-12) - (47/6 + 13 - 21)) + 40 30 What is (8/(-22))/((-3708)/(-103) + -40)? 1/11 Evaluate -10 - ((-10)/35 + 3186/(-413)). -2 (21/(-28))/((-228)/(-190)) -5/8 Evaluate ((((-7)/1 + -1)-4)/3)/((-21088)/126528). -64 ((-6)/(-14))/((-3)/4)(132 + 267 + -406) 4 What is (33732/(-74960))/((-9)/(-6))? -3/10 What is 10262/25655(21/6 - 4)510? -102 (-13 - 2)/(45/(-1275)-17) - -18 -7 What is the value of 60/(-152)780/1289925-63? 2/133 What is ((-143)/141 + 1)21867/(-14578)? 1/47 What is the value of 45(-8)/792-61 - 28? -3/11 Calculate -186(1 + 4/10 + 130/(-75)). 62 Evaluate 57/((-25650)/60)3/(-14). 1/35 Evaluate -261 + 180 + 308/22. -67 632/1672 - (192/(-416) - 1120/(-1976)) 3/11 What is the value of 14(-153)/(-119) + (6 - -31)? 55 What is the value of ((-144)/630(-7 - 248/16))/((-1)/(-7))? 36 What is the value of ((-4460)/(-10035))/(3 - 313/108)? 48/11 Evaluate (-5505)/(-84) - (-17)/(-816)60 - 15/(-21). 65 (144724/(-2134) - -68)/(248/22) 1/62 What is the value of 12546/(-112) - (-308 + (-5312076)/(-17248))? -112 (-1814250)/23895 - 8/108 -76 What is (521/22403)/((-3)/(-12))? 4/43 What is the value of 42/(-27)(64 + 6095/(-92))? 7/2 Calculate (-27 - -26)6 - (-2813)/435. 7/15 Evaluate ((-6)/(-16) + (-496)/640)/((-124)/(-20) + -5). -1/3 What is (-2817)/(-26226) + 205/(-19270)? 3/31 (108/72(-2 - 10) - -37) + -8 11 58/(-928)1 + ((-5435)/80 - 1) -69 What i	{ "pile_set_name": "DM Mathematics" }
8875? 5 What is the tens digit of 233572? 7 What is the hundreds digit of 11190803? 8 What is the ten thousands digit of 1962597? 6 What is the hundred thousands digit of 263722? 2 What is the hundreds digit of 2495230? 2 What is the hundred thousands digit of 5808576? 8 What is the tens digit of 579779? 7 What is the ten thousands digit of 1000561? 0 What is the hundred thousands digit of 11256843? 2 What is the millions digit of 6441931? 6 What is the hundreds digit of 1534305? 3 What is the ten thousands digit of 5728950? 2 What is the hundreds digit of 8050185? 1 What is the units digit of 3139202? 2 What is the ten thousands digit of 3156112? 5 What is the ten thousands digit of 24028145? 2 What is the units digit of 1039152? 2 What is the hundred thousands digit of 33707227? 7 What is the units digit of 485019? 9 What is the tens digit of 5615108? 0 What is the units digit of 394013? 3 What is the ten thousands digit of 1505947? 0 What is the units digit of 892156? 6 What is the thousands digit of 4269244? 9 What is the tens digit of 2031973? 7 What is the millions digit of 12115084? 2 What is the tens digit of 1923281? 8 What is the hundreds digit of 807781? 7 What is the tens digit of 1950068? 6 What is the tens digit of 174334? 3 What is the ten thousands digit of 9328414? 2 What is the millions digit of 9812209? 9 What is the hundreds digit of 3027362? 3 What is the ten thousands digit of 6541558? 4 What is the ten thousands digit of 167789? 6 What is the ten thousands digit of 290686? 9 What is the thousands digit of 36342541? 2 What is the units digit of 622057? 7 What is the hundreds digit of 2792672? 6 What is the ten thousands digit of 3014544? 1 What is the tens digit of 6000? 0 What is the hundreds digit of 3717008? 0 What is the units digit of 408161? 1 What is the thousands digit of 573519? 3 What is the units digit of 165763? 3 What is the thousands digit of 742919? 2 What is the thousands digit of 3582672? 2 What is the ten thousands digit of 67811? 6 What is the tens digit of 5659988? 8 What is the units digit of 1716091? 1 What is the tens digit of 232950? 5 What is the ten thousands digit of 76427? 7 What is the thousands digit of 5200604? 0 What is the ten thousands digit of 8633367? 3 What is the ten millions digit of 23578831? 2 What is the ten thousands digit of 196490? 9 What is the millions digit of 11427007? 1 What is the hundreds digit of 1790333? 3 What is the units digit of 1188109? 9 What is the units digit of 85003? 3 What is the millions digit of 2907453? 2 What is the hundred thousands digit of 27670916? 6 What is the thousands digit of 1750797? 0 What is the ten thousands digit of 365191? 6 What is the ten thousands digit of 89489? 8 What is the units digit of 209125? 5 What is the hundred thousands digit of 161965? 1 What is the tens digit of 6249212? 1 What is the ten thousands digit of 5594861? 9 What is the tens digit of 195670? 7 What is the tens digit of 637504? 0 What is the hundred thousands digit of 810796? 8 What is the thousands digit of 283600? 3 What is the units digit of 979164? 4 What is the hundreds digit of 181390? 3 What is the hundred thousands digit of 19707428? 7 What is the hundreds digit of 5672754? 7 What is the hundreds digit of 631966? 9 What is the tens digit of 40373? 7 What is the hundreds digit of 492722? 7 What is the thousands digit of 226949? 6 What is the ten thousands digit of 8176773? 7 What is the thousands digit of 3339645? 9 What is the hundreds digit of 518439? 4 What is the thousands digit of 81234? 1 What is the hundreds digit of 28672402? 4 What is the thousands digit of 858822? 8 What is the thousands digit of 17671548? 1 What is the hundreds digit of 79342? 3 What is the hundreds digit of 3632590? 5 What is the hundreds digit of 111095? 0 What is the ten millions digit of 22182220? 2 What is the units digit of 168985? 5 What is the ten thousands digit of 766002? 6 What is the millions digit of 5210209? 5 What is the tens digit of 727513? 1 What is the thousands digit of 1214710? 4 What is the units digit of 109683? 3 What is the ten thousands digit of 3661787? 6 What is the units digit of 62174? 4 What is the tens digit of 624581? 8 What is the thousands digit of 1006456? 6 What is the thousands digit of 35960558? 0 What is the millions digit of 39459462? 9 What is the units digit of 20560193? 3 What is the ten thousands digit of 2854574? 5 What is the tens digit of 489745? 4 What is the thousands digit of 592413? 2 What is the hundred thousands digit of 364011? 3 What is the thousands digit of 29963? 9 What is the hundreds digit of 597814? 8 What is the hundred thousands digit of 105786? 1 What is the tens digit of 9834150? 5 What is the hundred thousands digit of 525704? 5 What is the tens digit of 388284? 8 What is the units digit of 373468? 8 What is the hundreds digit of 286783? 7 What is the units digit of 2035591? 1 What is the units digit of 5898377? 7 What is the hundred thousands digit of 2147209? 1 What is the hundred thousands digit of 254275? 2 What is the hundred thousands digit of 1424114? 4 What is the hundreds digit of 5774714? 7 What is the hundred thousands digit of 870541? 8 What is the tens digit of 106115? 1 What is the units digit of 858121? 1 What is the thousands digit of 3299053? 9 What is the units digit of 1032769? 9 What is the units digit of 905? 5 What is the tens digit of 2565592? 9 What is the ten thousands digit of 18466596? 6 What is the units digit of 1991366? 6 What is the ten thousands digit of 885586? 8 What is the units digit of 4030334? 4 What is the thousands digit of 1291895? 1 What is the thousands digit of 423250? 3 What is the units digit of 560340? 0 What is the ten thousands digit of 1439469? 3 What is the hundred thousands digit of 1350527? 3 What is the ten thousands digit of 855079? 5 What is the tens digit of 873317? 1 What is the hundreds digit of 373264? 2 What is the thousands digit of 990556? 0 What is the hundreds digit of 126445? 4 What is the units digit of 5215991? 1 What is the units digit of 3723588? 8 What is the hundreds digit of 7508? 5 What is the hundreds digit of 2106150? 1 What is the hundred thousands digit of 3990891? 9 What is the tens digit of 89191? 9 What is the units digit of 3571556? 6 What is the hundreds digit of 326011? 0 What is the hundred thousands digit of 183977? 1 What is the ten thousands digit of 460869? 6 What is the tens digit of 461859? 5 What is the hundreds digit of 296836? 8 What is the units digit of 1401641? 1 What is the tens digit of 3613960? 6 What is the hundred thousands digit of 875623? 8 What is the ten thousands digit of 189660? 8 What is the millions digit of 3429033? 3 What is the millions digit of 5578809? 5 What is the ten thousands digit of 116069? 1 What is the thousands digit of 254152? 4 What is the thousands digit of 2511? 2 What is the hundred thousands digit of 2574684? 5 What is the units digit of 193412? 2 What is the units digit of 457062? 2 What is the hundred thousands digit of 421481? 4 What is the hundreds digit of 14732496? 4 What is the millions digit of 16130273? 6 What is the ten thousands digit of 176167? 7 What is the ten thousands digit of 873132? 7 What is the ten thousands digit of 675550? 7 What is the ten thousands digit of 1036263? 3 What is the millions digit of 2609152? 2 What is the ten thousands digit of 4164242? 6 What is the tens digit of 1444099? 9 What is the thousands digit of 15976086? 6 What is the ten thousands digit of 149176? 4 What is the ten thousands digit of 66050? 6 What is the hundred thousands digit of 146201? 1 What is the ten thousands digit of 151437? 5 What is the ten thousands digit of 853108? 5 What is the thousands digit of 1526760? 6 What is the units digit of 48738? 8 What is the units digit of 57206? 6 What is the hundred thousands digit of 4552230? 5 What is the hundred thousands digit of 1116787? 1 What is the millions digit of 2855244? 2 What is the tens digit of 1195585? 8 What is the tens digit of 10993582? 8 What is the hundreds digit of 11781269? 2 What is the units digit of 485933? 3 What is the millions digit of 30587357? 0 What is the thousands digit of 28889190? 9 What is the units d	{ "pile_set_name": "DM Mathematics" }
Put 5, 231, 200 in decreasing order. 231, 200, 5 Sort 4, -2, 39823, -4 in descending order. 39823, 4, -2, -4 Put -8/19, -2, -11, -3 in descending order. -8/19, -2, -3, -11 Sort -19, -7, -10, 0, 1, -1 in decreasing order. 1, 0, -1, -7, -10, -19 Sort 1, -239, 2, 44 in descending order. 44, 2, 1, -239 Put -1454, 5, 1 in increasing order. -1454, 1, 5 Sort -3, 1/29, 4, -7, -481, -0.2 in decreasing order. 4, 1/29, -0.2, -3, -7, -481 Sort -2.3, 45/8, -6, 0.9, 5, -0.2 in descending order. 45/8, 5, 0.9, -0.2, -2.3, -6 Sort 5, 4, 9843 in ascending order. 4, 5, 9843 Sort -0.117, -4/21, -1/14 in decreasing order. -1/14, -0.117, -4/21 Sort -3/4, 133/3, 4 in decreasing order. 133/3, 4, -3/4 Put 16, -9, 1, -891, 5 in ascending order. -891, -9, 1, 5, 16 Put -1.614, 0.3, 0.8, -1/7 in increasing order. -1.614, -1/7, 0.3, 0.8 Put -37, -4, 4, 3 in descending order. 4, 3, -4, -37 Sort 0.5, -0.2, 383, -9/4, 7, 2 in increasing order. -9/4, -0.2, 0.5, 2, 7, 383 Put 0.3, 10, -2, 293 in ascending order. -2, 0.3, 10, 293 Put 1/3, -2/7, -17, 3, -8, -1 in decreasing order. 3, 1/3, -2/7, -1, -8, -17 Sort -9, -0.4, -2, 5/6, 0.017, -0.3. -9, -2, -0.4, -0.3, 0.017, 5/6 Sort 504, -4, 147 in descending order. 504, 147, -4 Sort -5, 78, -314, -0.14, 5 in ascending order. -314, -5, -0.14, 5, 78 Sort -5/3, 0.0209, 0.6, 2/39 in decreasing order. 0.6, 2/39, 0.0209, -5/3 Sort 2, 22, -4, -5, -9, 5 in increasing order. -9, -5, -4, 2, 5, 22 Sort -2, -2/5, -0.02, 3/4, 0, -0.5 in descending order. 3/4, 0, -0.02, -2/5, -0.5, -2 Put 1, -18, -2, -4, -2/487 in ascending order. -18, -4, -2, -2/487, 1 Sort -243, 2, 383 in descending order. 383, 2, -243 Put -5, 91, -2/3, 1/160, 1/5, 5 in ascending order. -5, -2/3, 1/160, 1/5, 5, 91 Sort -2/17, -1/3, 7732 in descending order. 7732, -2/17, -1/3 Put 399/4, 1/3, 5, -1.7, 2/13 in ascending order. -1.7, 2/13, 1/3, 5, 399/4 Sort -15, -0.4, 36/7, 15 in descending order. 15, 36/7, -0.4, -15 Put -1, 3, 0, 1237, -4 in increasing order. -4, -1, 0, 3, 1237 Put -3, -17, 11, 6, 12 in increasing order. -17, -3, 6, 11, 12 Put -58, 1, -6, 3, -39, 2 in descending order. 3, 2, 1, -6, -39, -58 Put 151, -5, 0, 1, 25 in increasing order. -5, 0, 1, 25, 151 Put 4, 46, -9, 21 in decreasing order. 46, 21, 4, -9 Sort 0.05, 0.2, 10442, 4. 0.05, 0.2, 4, 10442 Put -206, 0, -2924 in increasing order. -2924, -206, 0 Sort -5, -4, -14446, 1 in descending order. 1, -4, -5, -14446 Sort 101, 0, -1795 in descending order. 101, 0, -1795 Sort 5, 2695, 1, 4 in increasing order. 1, 4, 5, 2695 Sort 5, -4, -5, -3, 4, -830 in ascending order. -830, -5, -4, -3, 4, 5 Put -3, -498, -2, -74 in increasing order. -498, -74, -3, -2 Put 10, 7, -39, 1, -3, -9 in decreasing order. 10, 7, 1, -3, -9, -39 Sort -3/10, 31, 5, -3 in decreasing order. 31, 5, -3/10, -3 Sort 3/4, 65359, -4/5, -5, -12 in increasing order. -12, -5, -4/5, 3/4, 65359 Put -2653, -18, 0 in decreasing order. 0, -18, -2653 Sort -208, 191, -0.3, 5 in increasing order. -208, -0.3, 5, 191 Put -527, -1, -2, 0, 1, -148 in descending order. 1, 0, -1, -2, -148, -527 Sort -4, -1/8, -66, -9, 5 in descending order. 5, -1/8, -4, -9, -66 Sort 10, 155, 0, 5 in descending order. 155, 10, 5, 0 Put 2, 1, 17, 613 in decreasing order. 613, 17, 2, 1 Put 779, -2, 1, -3 in ascending order. -3, -2, 1, 779 Sort 9, 6, -53, -15, 5. -53, -15, 5, 6, 9 Sort 0.052, -45, 2/11, 5, 1, 3 in descending order. 5, 3, 1, 2/11, 0.052, -45 Sort -25263, -1, 0.1, 0.29 in descending order. 0.29, 0.1, -1, -25263 Sort -98, -4, -5, -2, 0 in ascending order. -98, -5, -4, -2, 0 Put 1/6, 0.1, -11/6, 3, -4, -71 in decreasing order. 3, 1/6, 0.1, -11/6, -4, -71 Put -21, -6, -247 in increasing order. -247, -21, -6 Sort 0.1, 2038/23, -0.3, -1/2 in ascending order. -1/2, -0.3, 0.1, 2038/23 Sort -0.2, 1/8, -1/150426. -0.2, -1/150426, 1/8 Put 3, 4, 2573, 0, -1 in descending order. 2573, 4, 3, 0, -1 Sort -3/5, 0.31, -0.1, 4, -41, -0.2 in decreasing order. 4, 0.31, -0.1, -0.2, -3/5, -41 Put -4, 163, -1001 in increasing order. -1001, -4, 163 Put 3, -2, -79539 in ascending order. -79539, -2, 3 Put -1, -0.2, 5, 4, -39/5 in decreasing order. 5, 4, -0.2, -1, -39/5 Sort -2674400, 2, -4. -2674400, -4, 2 Put -165, 1, -75, 0 in decreasing order. 1, 0, -75, -165 Put -11, -2, 1, -5, 37 in increasing order. -11, -5, -2, 1, 37 Sort 5, 2, -702 in descending order. 5, 2, -702 Sort -260, 7, -42, -1 in ascending order. -260, -42, -1, 7 Sort -4, -48, -2, -11 in increasing order. -48, -11, -4, -2 Sort 0.19, -2, 2/59, 1, -0.7 in ascending order. -2, -0.7, 2/59, 0.19, 1 Put 7, 52, -3, 1, -5 in descending order. 52, 7, 1, -3, -5 Put 2/5, -2/13, -0.5, 0.01, 4 in descending order. 4, 2/5, 0.01, -2/13, -0.5 Sort 4, -144, 3, 0, -6, 18. -144, -6, 0, 3, 4, 18 Sort 11, -4, 193, 0 in descending order. 193, 11, 0, -4 Sort 6, 1, -79, 5, -4. -79, -4, 1, 5, 6 Sort 3/4, -0.3, 0.2, -6, -0.2, 6/11. -6, -0.3, -0.2, 0.2, 6/11, 3/4 Put -7, 10900, -4 in ascending order. -7, -4, 10900 Put 3, -1, 14, -7, -414 in decreasing order. 14, 3, -1, -7, -414 Put -12, 0, -2, 3/10, 0.11 in descending order. 3/10, 0.11, 0, -2, -12 Sort 0, -3, 1282, 6 in descending order. 1282, 6, 0, -3 Sort 5, -2, 0, 279 in decreasing order. 279, 5, 0, -2 Put 5, 4, 2/3, -4, -0.08, 2 in decreasing order. 5, 4, 2, 2/3, -0.08, -4 Sort -14, -2, -2/131, -4, -0.3 in ascending order. -14, -4, -2, -0.3, -2/131 Sort 1, -1, 4, -196, -4. -196, -4, -1, 1, 4 Sort -10, 18, 90, 0, 1 in descending order. 90, 18, 1, 0, -10 Sort 0.092, -776, -0.1. -776, -0.1, 0.092 Put 4, 10, 3, 33, -5, 0 in descending order. 33, 10, 4, 3, 0, -5 Put -5, -7117, 3, -1 in decreasing order. 3, -1, -5, -7117 Sort 32, 2, 643 in descending order. 643, 32, 2 Sort 4, 651, -2, -5, 0 in ascending order. -5, -2, 0, 4, 651 Put 2, 6, -12144 in decreasing order. 6, 2, -12144 Put -1239271, -5, -2, 4 in descending order. 4, -2, -5, -1239271 Sort 4, -1, 0, -4, 631 in ascending order. -4, -1, 0, 4, 631 Sort 101, 5, -4, -2, 1 in decreasing order. 101, 5, 1, -2, -4 Put 1/408, -1, -31/4 in ascending order. -31/4, -1, 1/408 Sort -5, 262, 1, 14. -5, 1, 14, 262 Put -1, 139, -2, 5, -87 in decreasing order. 139, 5, -1, -2, -87 Put 5, 2, 0.4, -5, 1, 2/9 in ascending order. -5, 2/9, 0.4, 1, 2, 5 Sort 14/5, 479.6, 0.1, 2 in descending order. 479.6, 14/5, 2, 0.1 Sort -0.3, -3.9, 26811 in increasing order. -3.9, -0.3, 26811 Sort -11, 16391, 2 in descending order. 16391, 2, -11 Sort 0, -1/4, -0.3, -1, -0.5, -1/46 in ascending order. -1, -0.5, -0.3, -1/4, -1/46, 0 Sort 0, -506, 6 in ascending order. -506, 0, 6 Put 2069, -47, -2, 1/2 in decreasing order. 2069, 1/2, -2, -47 Sort 0.2, 2/7, 1/180, 3, -9 in descending order. 3, 2/7, 0.2, 1/180, -9 Sort 1, -150583, -0.2. -150583, -0.2, 1 Put 711, -1, 1, -214 in decreasing order. 711, 1, -1, -214 Put 10, -2.3, 5/7, -2, 2/13 in ascending order. -2.3, -2, 2/13, 5/7, 10 Put -4, 4, -5, -26, -32 in descending order. 4, -4, -5, -26, -32 Put -36, 3, -1, -0.4, -4/103, 2/11 in descending order. 3, 2/11, -4/103, -0.4, -1, -36 Sort -0.01, -1262/39, 5. -1262/39, -0.01, 5 Put -116, -1, -639 in descending order. -1, -116, -639 Sort 49, 32661, -5 in increasing order. -5, 49, 32661 Sort 20, -5, -3, 3, -8, -2. -8, -5, -3, -2, 3, 20 Put -5, -2, 9, 10, 54 in decreasing order. 54, 10, 9, -2, -5 Put 30, 0.082, 2 in decreasing order. 30, 2, 0.082 Sort -2, 7, -3.5. -3.5, -2, 7 Sort -6/13, -42, -1.28 in ascending order. -42, -1.28, -6/13 Put 2/5, 0.2, 13, 6, -0.2, 0.25 in increasing order. -0.2, 0.2, 0.25, 2/5, 6, 13 Put 1.7, -1/3, 3, 5, -4, 0.22 in decreasing order. 5, 3, 1.7, 0.22, -1/3, -4 Sort 438, -2/11, 2/15, -0.2, -2 in decreasing order. 438, 2/15, -2/11, -0.2, -2 Put 5, -1, 1, -1236, -3 in descending order. 5, 1, -1, -3, -1236 Sort -1, 1, 889, 43 in ascending order. -1, 1, 43, 889 Put 74, 12, 0, 3 in decreasing order. 74, 12, 3, 0 Sort -3, 59, -22 in ascending order. -22, -3, 59 Put -3, 0, -2, 2/17, 16662 in ascending order. -3, -2, 0, 2/17, 16662 Put 774, 1, -806 in decreasing order. 774, 1, -806 Sort 172, 3/5, -0.1, 1.2 in increasing order. -0.1, 3/5, 1.2, 172 Sort -2, -7, -3, 25, 4 in decreasing order. 25, 4, -2, -3, -7 Sort 2, -1, 688, -2. -2, -1, 2, 688 Put 9, 18, 0, -2, 1, -75 in descending order. 18, 9, 1, 0, -2, -75 Sort -56, -61, 0, 8, 3 in increasing order. -61, -56, 0, 3, 8 Sort -8, 0.6	{ "pile_set_name": "DM Mathematics" }
(13) + 68913 Simplify 5 + (sqrt(14)4-2 - sqrt(1694)-3)/((-5sqrt(70)1)/(sqrt(10) + sqrt(70)/sqrt(63))). -20sqrt(2)/3 + 5 Simplify -4(4 + ((sqrt(425) + 3)2 - sqrt(425))1)25. -10500 - 2000sqrt(17) Simplify (((sqrt(2448) + -14sqrt(2448))2 - sqrt(2448)) + sqrt(2448) - ((sqrt(17) - (3sqrt(272) + sqrt(272))*2) + -2)) + -2. -sqrt(17) + 26384 Simplify -3 + ((sqrt(320)/sqrt(72))/(-1sqrt(8)))/(((sqrt(144) + sqrt(144)-1)-1 + sqrt(144))-4). -3 + sqrt(5)/144 Simplify (0 + sqrt(272) - sqrt(272)) + -4 - (sqrt(272) + (sqrt(272) - (sqrt(272)-4)*2)-6) - (5 + (sqrt(612)-3 - (sqrt(17)-1 - sqrt(17))-5))2. -39469 + 300sqrt(17) Simplify (-6(-1sqrt(612)1 + 0 - -6(sqrt(612) + (1 + sqrt(612))1))4 + 3)*2. 446688sqrt(17) + 42673833 Simplify ((((-5sqrt(168)/sqrt(3))/(sqrt(128) + sqrt(128)1 + sqrt(128)))*2 - (6(sqrt(7) + 0) - (sqrt(7) + sqrt(343)-6))2) + 1)-3. 2226353/48 Simplify (sqrt(468)/(sqrt(96)/sqrt(8)) + sqrt(39) + -6sqrt(39)3)/((sqrt(588)1)/(3sqrt(8)/sqrt(2))). -48sqrt(13)/7 Simplify sqrt(80)32 + sqrt(80) - (sqrt(80) + (sqrt(80) - (-1 + sqrt(80) + -1))) - ((4 + sqrt(80) + -1)2 + sqrt(80)-2 + 1). -92 + 8sqrt(5) Simplify (sqrt(224)/((sqrt(96)-2)/sqrt(12))3)/(-4(sqrt(4) - sqrt(400)-2 - ((sqrt(36) - sqrt(180)/sqrt(5)) + sqrt(36))/sqrt(9))). 3sqrt(7)/160 Simplify 4(52(-1 + sqrt(343)) + ((2(sqrt(175) + 0))*2 - (sqrt(175) + 2sqrt(175)-2))). 340sqrt(7) + 2760 Simplify 1 + ((2(-2sqrt(22)3 - sqrt(22) - (sqrt(22) - -2-1sqrt(22))))/(4sqrt(22)/(sqrt(22)/sqrt(18))))*2. 12 Simplify (1 + sqrt(1053)-2 + -2 - -2(-3 + sqrt(208) + -1))2 + 1. 180sqrt(13) + 1382 Simplify ((sqrt(864) - 5(sqrt(864) - sqrt(864)-2))4)/(sqrt(108)-3 + sqrt(3) + sqrt(18)/sqrt(150)). 40sqrt(2) Simplify 5(1 + 4 + (-1 + -1 + sqrt(13))*2 + -5 + ((-5sqrt(130)-2 + sqrt(130) + sqrt(130) - sqrt(130))/(2sqrt(10)2))2). -20sqrt(13) + 9225/16 Simplify -1((sqrt(7) + (sqrt(147)/sqrt(3))/sqrt(7))2 + sqrt(7) - sqrt(560)/sqrt(5)) - (sqrt(343)-4 + (2 + sqrt(28))*2). -60 + 23sqrt(7) Simplify 4((-2 + (sqrt(300) - (sqrt(300) + 1)) - (-2 + sqrt(300) + 1))2 + 5(4 + -3sqrt(300))2). -4640sqrt(3) + 55536 Simplify ((1(sqrt(121) - (sqrt(121) + sqrt(121)3)))/(-3(sqrt(891) - sqrt(11))))24 + 1. 27/16 Simplify (-1 + -5 + sqrt(539)4 + 1)23 + 1. -840sqrt(11) + 25948 Simplify (sqrt(2500)4 + sqrt(2500) + (sqrt(50)-2)/sqrt(2))/((sqrt(55)/(2sqrt(11)) + (sqrt(320) - sqrt(320)2))-6). 16sqrt(5)/15 Simplify 1 + 4 + (-2 + sqrt(704) + sqrt(704) + (sqrt(704) + 0)2 + 4 - (-1 + (3sqrt(704) + -5)*2)). -5649 + 256sqrt(11) Simplify (1 + (-3 + (sqrt(304) + -2 - sqrt(304)))3 + (sqrt(76) - -1sqrt(76))1-5 + 5)*2. 360sqrt(19) + 7681 Simplify ((-4 + 6-624(sqrt(80) + -3)1)-4)*2. -31703040sqrt(5) + 118001920 Simplify -4((6sqrt(28)/sqrt(2))/(sqrt(7)1-6) - ((sqrt(8) - sqrt(2))-5 - (sqrt(288) + 2)))2. -2064 - 256sqrt(2) Simplify 3 + (1 + (1 + sqrt(12) + 0 - (sqrt(12) + 1)2) - (sqrt(72)/sqrt(6) + 3 - (sqrt(48) + (sqrt(192) - sqrt(48) - sqrt(48)))/sqrt(4))). -2sqrt(3) Simplify (sqrt(19) - sqrt(38)/(sqrt(18) + sqrt(2)) - (sqrt(19) - 2sqrt(19)-3)) + -5sqrt(76)/((-3sqrt(48))/sqrt(12)). -55sqrt(19)/12 Simplify ((sqrt(588) + sqrt(588) + 1sqrt(588) + (sqrt(432) - sqrt(432)-2))/(sqrt(60)/(sqrt(50)/sqrt(5)2)) + -1)*2. -156sqrt(2) + 12169 Simplify (sqrt(720) + 0 + (sqrt(720) + sqrt(720) + sqrt(720)-2 + sqrt(720) - sqrt(720)))2 + 4 + (sqrt(35) - sqrt(140))/sqrt(7) + (sqrt(405)2)*2. -sqrt(5) + 2344 Simplify 3 + (-4 + sqrt(95)/(-2sqrt(5)) - (sqrt(171) + -1sqrt(171)-1))*23 + 1. 156sqrt(19) + 9841/4 Simplify ((sqrt(11) + sqrt(22)/(sqrt(2) + sqrt(2) + sqrt(10)/sqrt(5)) + -2)2 + 2(-3 + sqrt(539) + 1))2. -800sqrt(11)/3 + 28076/9 Simplify (-4sqrt(216))/(sqrt(64)/(sqrt(8)-5))-3-1. 180sqrt(3) Simplify (4(-4((0 + sqrt(1584))3 + -1) - (sqrt(1584) + (-3 + sqrt(1584)-4 - sqrt(1584)) + sqrt(1584)1 + -3)))*2. -34560sqrt(11) + 2054464 Simplify (((-2(sqrt(432) + sqrt(432)3) + sqrt(432) + sqrt(432) + (sqrt(432) + -2)1)65)2 + -2)3. 648000sqrt(3) + 29170794 Simplify 65(6-6(sqrt(117)-25 + 6(-2 + sqrt(117))))*2. 11197440sqrt(13) + 78382080 Simplify (5 + -5 + sqrt(1100) + 3 + 5 + sqrt(1100)-2 + 4)2-6. -7464 + 1440sqrt(11) Simplify 2sqrt(63)-4 + (sqrt(252) - sqrt(63))2 + -1sqrt(567) + -4(1 + sqrt(343) + 3 - 3sqrt(343)2)2. -34301 + 1087sqrt(7) Simplify (33-6sqrt(117)4)/(5(sqrt(144) - (sqrt(144) - (sqrt(144) + sqrt(144) + -2sqrt(144)-6)))). -27sqrt(13)/35 Simplify 4 + 6((sqrt(270)5)/(sqrt(30)/sqrt(48) - sqrt(10)) - -3(1sqrt(3)1 + sqrt(3))-1)*2. 12172 Simplify ((62(sqrt(176) + 0)-1 + -3((sqrt(176) - ((2 + (sqrt(176) - sqrt(176)-2) - sqrt(176)) + sqrt(176))) + 4))5)2. 7200sqrt(11) + 159300 Simplify 2(4 + -1(-55-2sqrt(500)-4)*2)3. -119999976 Simplify (-5(3 + -5 + sqrt(704)) - sqrt(22)/(sqrt(2) + sqrt(98))-5-1)2. -1625sqrt(11)/2 + 1168275/64 Simplify ((sqrt(48)5 + -4)-2 - (sqrt(243) - (2 + sqrt(243) + 1))-3)2. 80sqrt(3) + 4801 Simplify (sqrt(243) + 3 + 1sqrt(243) - ((sqrt(12) + 0 - sqrt(12) - sqrt(12)) + -5)) + (3(-2 + 5(sqrt(3) - (sqrt(12)/sqrt(4) + -5))))2. 20sqrt(3) + 4769 Simplify 2((sqrt(325)2)*2 + -3 + sqrt(325) + -4)-36 + -5. -46553 - 180sqrt(13) Simplify ((sqrt(400) - sqrt(400)1-1)/((sqrt(110)-2)/sqrt(11)))/((sqrt(512) + (sqrt(512)1 + sqrt(512))-3 + sqrt(512) - sqrt(512))4)-1. -sqrt(5)/160 Simplify (5 + -6(sqrt(98) + 0))*24 + 4 - -6((0 + sqrt(98) + (sqrt(98) - (sqrt(98) + 0)))2 - (4 + -2sqrt(98))). -1596sqrt(2) + 14780 Simplify -4 + 1 + (-3 + (sqrt(720) - (-2 + sqrt(720))) + (-2 + sqrt(720))-3 - -1(sqrt(720) - (1 + 3 + sqrt(720))))2. -72sqrt(5) + 6478 Simplify ((-261(sqrt(114) - (sqrt(114) + (sqrt(114) - (sqrt(114)3 - sqrt(114))))))/(sqrt(1944)/sqrt(4) + sqrt(72)/(sqrt(36)/sqrt(3) + sqrt(12))))*2. 576/19 Simplify ((-4 + ((2sqrt(76))/sqrt(4) - sqrt(19)))1)2-2 + -1((-3sqrt(171))*2 + (-3sqrt(19)-5 - sqrt(19))). -1609 + 2sqrt(19) Simplify 323(2sqrt(56)/sqrt(4))/(sqrt(162) - (sqrt(162) + (sqrt(162)1 - sqrt(162)) + sqrt(162))) + -2. -4sqrt(7) - 2 Simplify (2 + (sqrt(76) + sqrt(76) + -1 + sqrt(76) - sqrt(76))*2 - sqrt(76) - (sqrt(76) - 22sqrt(76))2) + 5 + 2sqrt(76)2 + 3(sqrt(76)-3 + sqrt(76)). -372 - 14sqrt(19) Simplify (sqrt(192)-1 + -3 - (-1 + sqrt(192)-2))*2 + (sqrt(36)/(sqrt(12)1))*2-54. -32sqrt(3) + 136 Simplify (1-4sqrt(190) - 3-4sqrt(190))/(-5sqrt(80)/(sqrt(80)/(sqrt(10)2))) + 0. -4sqrt(19)/5 Simplify -4 + (-5 + sqrt(36)/sqrt(3))4 - ((0 + sqrt(192) + 4)*2 + sqrt(192)-1). -232 - 48sqrt(3) Simplify 2(4(sqrt(980) + (sqrt(980)1 + sqrt(980) - sqrt(980)))3)/(sqrt(4) + sqrt(8)/(1sqrt(2)) + sqrt(64)1). 56sqrt(5) Simplify 3 + (sqrt(252) + 1 - ((-4sqrt(77))/sqrt(11) + 0)) + -4. 10sqrt(7) Simplify ((sqrt(7) - (-5 + 2 + sqrt(7))) + sqrt(112)3 + sqrt(112) - (sqrt(252) + 3 + 3)-4)*2. 2160sqrt(7) + 11929 Simplify ((sqrt(637)2 - sqrt(637)) + sqrt(637) + -4 - (-1 + sqrt(637) + 0)) + ((3sqrt(637) + sqrt(637) - sqrt(637))-1)2 + (0 + sqrt(637))2 + 4 + 4. 7sqrt(13) + 6375 Simplify ((sqrt(117) - (sqrt(117) + ((sqrt(117) + -1)*2 - sqrt(117)))) + 3 + -2sqrt(117) + 1 - (3 + sqrt(117)-5-5)) + -1 + -5. -72sqrt(13) - 123 Simplify 2(-3 + 6(sqrt(425) + sqrt(425) + -2 + 5 + (2 + sqrt(425) + sqrt(425))6)5). 894 + 4200sqrt(17) Simplify (2-2sqrt(12)/(3sqrt(486))5 + 4)3. -20sqrt(2)/9 + 12 Simplify (5 + ((sqrt(152)/sqrt(4) + sqrt(38))-3 - sqrt(38))/(sqrt(200)-1 - sqrt(200)) + -1 + (5sqrt(76)/sqrt(4) - 4(sqrt(19) + -2 + sqrt(19))))*2. -318sqrt(19)/5 + 110971/400 Simplify (((sqrt(675) - (-4(-1 + sqrt(675)) - sqrt(675) - sqrt(675)))-5 - (-5 + -1sqrt(675) - (-4 + (sqrt(675) - (sqrt(675) + sqrt(675)2)))))5)2. -567000sqrt(3) + 21881025 Simplify 2 + (2((1 + sqrt(245))2)*2 + -4)1 + -5 + -1. 112sqrt(5) + 1960 Simplify 5(sqrt(405) + 0)1-6 - (2 + (sqrt(125))*2 + sqrt(40)/(-4sqrt(8)) + 0). -1079sqrt(5)/4 - 127 Simplify 0 + ((sqrt(75) - sqrt(75)4)6 + 1sqrt(75)5 + 4(2sqrt(75) + -3 + 4))2. -200sqrt(3) + 1891 Simplify (sqrt(72)-3 + 5sqrt(72)/sqrt(4))/(((sqrt(54) + sqrt(216)/sqrt(4))*-4)/sqrt(9)) + 1. sqrt(3)/8 + 1 Simplify (-4 +	{ "pile_set_name": "DM Mathematics" }
sor of i and 561. 33 Let f be (-1 - 21/(-24)) + (-1801)/(-8). Calculate the highest common factor of 9 and f. 9 Let c(q) = q*3 - 5q*2 + 3q - 3. Let r be c(5). What is the greatest common factor of 102 and r? 6 Let b be (-21)/6-2 - 3. Calculate the highest common divisor of b and 436. 4 Let i(m) = m2 - 26m + 34. Let n be i(25). Let k be 4 + (-1)/(2/(-4)). What is the greatest common factor of n and k? 3 Let l = -716 + 1271. Calculate the greatest common divisor of l and 60. 15 Let w(k) = -10k3 + k2 + 28k + 41. Let s be w(-3). What is the highest common factor of 649 and s? 59 Suppose -65 = -t - 3z, 10z = -3t + 5z + 183. What is the greatest common divisor of t and 1064? 56 Suppose g = -0g - 5r + 26, 3g - 48 = -5r. Suppose -119z = -120z + 9. Suppose 0 = gs - zs - 26. Calculate the greatest common divisor of s and 104. 13 Let d be 44/3(-3)/(-2). Let k(o) = o2 + 12o + 20. Let v be k(0). Suppose -vm + 19m = -55. Calculate the highest common factor of m and d. 11 Let l be (-31)/(372/(-144)) + 176. Calculate the greatest common divisor of 799 and l. 47 Suppose 589l + 13741 = 596l. What is the greatest common divisor of 13 and l? 13 Suppose 75 = -4u + 5u. Suppose 4j + 5d + 0d = 125, -130 = -5j - d. What is the greatest common factor of j and u? 25 Let x = 119 + 2. Let b(y) = y*3 + 5y*2 + y - 1. Let f be b(-4). What is the highest common factor of x and f? 11 Let h be (1/(-2))/(4/(-80)). Suppose 0p + 50 = 2a - 5p, -4a = -p - 82. Suppose -3u + a = 2u. Calculate the highest common factor of h and u. 2 Let m(r) = -r3 - 6r*2 + 7r - 9. Let p be m(-8). Calculate the greatest common divisor of 168 and p. 21 Let k be ((-2233)/(-33))/(4/12). What is the highest common factor of k and 7? 7 Let y(g) = 11g - 5. Let q be y(1). Suppose -s + a - 2a = 0, 2a + 4 = -s. Suppose 2 = f, sd + d + 4f - 53 = 0. What is the highest common factor of d and q? 3 Let j(r) = -7r + 97. Let a be j(6). What is the greatest common factor of 1375 and a? 55 Let x(i) = i*3 + 19i*2 + 15i - 21. Let g be x(-18). Let k = 174 - 171. Calculate the highest common divisor of k and g. 3 Suppose 16 - 64 = -2p. Let f be ((-210)/56)/((-1)/p). Calculate the greatest common factor of 36 and f. 18 Suppose -4p + 172 = -a - 3a, 2a = -6. Suppose 5w + c = 4, 4c = -3w + 2w - 3. Let u be w/((-2)/(4 + -14)). What is the highest common divisor of p and u? 5 Suppose -a + 115 = 5q, -a + 7 = -5q - 138. Calculate the highest common divisor of a and 1170. 130 Suppose -3o - 5q = 27, -3q + 85 = -5o + 2q. Let u be (-1 - 0)/(2/o). Suppose 11t - 3t = 112. Calculate the highest common factor of u and t. 7 Let d(y) = 3y*2 - 9y - 207. Let p be d(25). Calculate the greatest common divisor of p and 111. 111 Let p(t) = t*3 - 6t*2 - 13. Let a be p(9). What is the highest common factor of a and 46? 46 Suppose 5u - 3t - 1099 - 204 = 0, 4t = -u + 256. What is the greatest common factor of 104 and u? 52 Let m be -21(-27)/18. Let x be (8/(-12))/((-1)/m). Suppose 6 = 2c + xj, 3c + 4j + 2 = 13. What is the highest common divisor of c and 3? 1 Let f be 4/1449/(-21)-6. Suppose -w = -0v - 3v + 137, v + w - 39 = 0. What is the highest common factor of v and f? 4 Suppose 0 = -2o + o + 98. Let c be (174/(-203))/(-64/784). Calculate the greatest common divisor of o and c. 14 Let z be ((-66)/5)/(5/((-1050)/9)). Calculate the highest common divisor of 252 and z. 28 Let x be (2 - 232/(-12))/(2/12). Let g = x + -116. Suppose 132 = -0j + j. Calculate the greatest common factor of j and g. 12 Let z = -13 - -13. Suppose -3p - 2o + 130 = 0, z = -0p + p - 5o - 32. What is the highest common divisor of 6 and p? 6 Let p(g) = -22g - 27. Let s be p(-9). Let u = s + -115. What is the greatest common factor of u and 8? 8 Let m(h) = h*2 - 2h - 549. Let y be m(25). What is the highest common factor of y and 650? 26 Let h be ((-21)/12)/(1/(-8)). Suppose 5o = 5r + 729 - 49, -3o = 5r + 680. Let t = -10 - r. What is the highest common divisor of h and t? 14 Let d = -305 + 461. What is the highest common divisor of 260 and d? 52 Let p = 504 + -496. What is the greatest common divisor of p and 88? 8 Let k(d) = -14d - 329. Let x be k(-43). Calculate the highest common divisor of 26 and x. 13 Suppose -2z - 7 = 5g - 1, 2z + g = 2. Suppose 2k = -0k + 2f + 220, -3k + zf = -328. Calculate the greatest common factor of k and 27. 27 Let k = -44 - -65. Suppose -8y + k = -5y - r, -y - 3r = 3. Calculate the greatest common divisor of y and 54. 6 Let p be (-2)/(-2)18 - 1. Suppose -r + 0r + c + 48 = 0, 0 = 3r - 4c - 141. Calculate the greatest common divisor of r and p. 17 Suppose -k = 2k - 30. Suppose kr = r + 270. Calculate the highest common divisor of r and 90. 30 Suppose x - 10 = -2i, -12x = i - 7x - 14. Calculate the greatest common factor of i and 96. 4 Let b = -275 + 483. Calculate the greatest common divisor of b and 39. 13 Let q = -1794 + 1168. Let y = q + 890. Suppose 0 = -4v + 58v - 1296. Calculate the greatest common divisor of v and y. 24 Suppose 0 = -438w + 453w - 21450. Calculate the greatest common divisor of 220 and w. 110 Suppose -u - 4c + 64 = 0, 0 = -5u - 4c + c + 405. Suppose -12 = -2q + 100. Calculate the highest common factor of q and u. 28 Suppose 0 = 5d - 9 + 59. Let b be (-2 + 1 - d/50)-25. Calculate the greatest common factor of 4 and b. 4 Let g = 106 - 101. Suppose -2 = -r - d, -9r + 20 = -4r - gd. Calculate the greatest common factor of 21 and r. 3 Let k be (2 + 10/(-4))(-1 + -31). Let t = 67 - 3. What is the highest common divisor of t and k? 16 Suppose 3 = 4k - 3a - 22, k - 5a - 2 = 0. What is the highest common factor of k and 49? 7 Suppose 66 = 7o - 4o. Calculate the highest common divisor of 176 and o. 22 Suppose -2n - 52 = -6n. Suppose 10 = -4h + 2, -46 = -4v + 3h. Suppose 0 = 15d - vd - 520. What is the greatest common divisor of n and d? 13 Let d(j) = 5j*3 + 11j*2 - 20j - 3. Let r be d(3). Calculate the highest common divisor of r and 19. 19 Let o be (-135)/(-6)(-136)/(-12). Let l be (24/30)/(6/o). Calculate the greatest common factor of 68 and l. 34 Suppose -11c - 162 = -17c. What is the highest common factor of 1026 and c? 27 Let h(x) = 2x + 30. Let v be h(-13). Suppose -2 = -q + g, g + v = -0q + 2q. Calculate the highest common factor of 2 and q. 2 Let y(o) = 3o. Let i be y(1). Suppose -3s - i = -6. Let v = 8 - s. Calculate the greatest common divisor of 63 and v. 7 Suppose o - 3i - 1223 + 250 = 0, 4o - 3918 = -i. Let v be o/11 + (-3 - -2)-1. Calculate the greatest common divisor of v and 9. 9 Suppose 164k - 50184 = 128k. Calculate the greatest common divisor of k and 34. 34 Let v be (-20)/16 - 702/(-24). Calculate the greatest common divisor of 364 and v. 28 Let c(u) = u - 6 + u + 0u. Let o be c(14). Let n be 1/(-3) - 265/(-3). What is the highest common divisor of n and o? 22 Let g(p) = 5p2 - 2p + 1. Let a be g(1). Suppose -r = -h - 46, -ar = -3h + 1 - 184. What is the highest common divisor of r and 9? 9 Let b = 65 + -33. Suppose 0 = -4t + 3q + 72, 4t - 4q - 108 = -b. What is the greatest common divisor of t and 15? 15 Suppose -3w + 4l = 4, w - 6w + 4l = 4. Let t be (-28)/8 - 2/(-4). Let v be 56 + w/(6/t). What is the greatest common factor of v and 7? 7 Suppose -3m = 2m + 5k - 320, 4m = -5k + 256. Suppose 5s - 3s - 116 = 0. Suppose 4w - 6 = s. Calculate the greatest common divisor of m and w. 16 Suppose 17j - 48 = 9j. Suppose 64 = l - z, 0 = l - 3l - 4z + 104. Calculate the highest common factor of j and l. 6 Suppose -567 = -15c - 162. What is the highest common factor of 225 and c? 9 Suppose 0n - 8 = -4n. Let b(z) be the first derivative of 9z4/4 + z2/2 + z - 80. Let g be b(n). What is the greatest common divisor of 30 and g? 15 Suppose 0 = 38s - 45s + 252. Calculate the greatest common divisor of s and 60. 12 Suppose 0 = 2b - 4o + 14, -b + 5 = o - 0o. Suppose -w + 9 = p, 4p - 3w - b = -0. Suppose 5s = -39 + 239. What is the highest common divisor of s and p? 4 Let f = 99 + -39. Suppose -2o - 11 = h - 28, 3h - 15 = 0. Calculate the greatest common factor of o and f. 6 Let o be (24/2)/(9/6). Let g(m) = -11*m	{ "pile_set_name": "DM Mathematics" }
) in the form yj3 + pj*2 + ij + c + bj4 and give b. -26377 Express 28i - 2 + 102i + 612i + 4 - i*4 - 52i as ri3 + si*2 + ti*4 + yi + m and give t. -1 Express -15419594h + 3h*4 + 3138 + 15419594h + h*3 in the form sh + bh3 + nh*4 + t + kh*2 and give t. 3138 Express (4w - 3w - 3w)(1 + 2 - 1) - w - 3w + 3w - w - w + w - 16w - 23w - 261w + (3 - 2 + 2)(4w + 0w - 5w) + 0w + 3w - 2w as gw + b and give g. -308 Express (5y2 - 5y2 - y3)(3 - 2 + 9 - 7 + (-4 + 1 - 4)(1 - 1 - 1)) as py2 + q + zy*3 + hy and give z. -10 Rearrange (13 - 14b - 13)(-4 + 1 - 4) + 58 - 6b - 58 + 3b - 3b - b + (-1 - 2 + 2)(b - 2 + 2) to h + gb and give h. 0 Express (2 + 7 - 25)(5p - p - 6p + (7p + 10p - 4p)(4 + 4 - 6)) in the form wp + k and give k. 0 Express 984 + 97c*3 - 984 + (5 + 9 - 5)(c*3 - 2c*3 + 4c*3) as pc*2 + l + hc + uc3 and give u. 124 Express (44r - 15r + 3r)(4 + 0 + 0)(-42r + 3r + 7r) in the form gr*2 + ur + m and give m. 0 Express (12h - 8 - 13h - h)(-16h + 28h + 32h + 95h + 131h) as gh2 + qh + s and give g. -540 Express 54z + 69z + 559z2 + 3 - 123z - z3 - z3 in the form bz3 + u + fz + cz2 and give c. 559 Rearrange -329p - 4012p + 7517p to the form v + fp and give f. 3176 Express -87 - 3m - 3m - 104 - 8 as a + om and give a. -199 Express (-8q - 22 + 22)(-10 + 10 - 5) + (1 + 3 - 1)(-6q + 2q + 2q) - 3q - q + 6q as kq + l and give k. 36 Rearrange -293 - 4p*4 + 635 + 5p*2 - 335 to cp*3 + ip*4 + w + xp + up2 and give w. 7 Rearrange (-900g*2 - 774g*2 + 199g*2 - 46g*2 - 157g*2)(-49g2 + 10g*2 - 40g*2) to pg*4 + dg*3 + ng*2 + h + cg and give p. 132562 Express (-2m + m - 4m)(-80m*2 + 80m*2 - 89m*2) - 4m3 - m3 + 3m3 in the form qm*2 + ym*3 + f + pm and give f. 0 Express (-4 + 2 - 18)(0o4 + o4 + 0o4) - 2o*4 + 2o*4 + 2o*4 + 193o + o*4 - 193o as jo2 + ao*3 + po + io4 + w and give i. -17 Express -5752 + 5s*2 + 133s*3 - 3s*2 + 5732 - 2s*2 - s in the form b + ws*3 + os*2 + us and give u. -1 Rearrange -3 - 23n2 + 15 + 7 - 40n*2 + 2 to in + h + wn2 and give w. -63 Express -466n - 5836n + 13844n as d + kn and give k. 7542 Rearrange -27 + 538y*2 + 73y + 19 - 80y + 10 to by*2 + n + wy and give b. 538 Rearrange (-7y2 + 8y*2 + 5y*2)(1 - 1 - 3) - 98y - 1234y*2 + 89y + 9y to by + x + gy2 and give g. -1252 Rearrange -5 - 2a - 130a2 + 147a2 + a4 + a*3 - 2a*4 + 356a*2 to the form ma*2 + ia*4 + ra + na3 + q and give q. -5 Express (-4b*2 - 2b*2 + 2b*2)(0 + 2 + 1) + (-4 + 2 + 3b - 2b)(39b + 12b + b) as db + vb2 + n and give d. -104 Express (-2b + 6b - 2b)(-2b + 0b - 5b)(69 - 247 - 126) + b2 + 3b2 + b2 as jb + ib*2 + o and give i. 4261 Express 21y - 552y2 - 78y*2 - 13y - 7y in the form dy + qy2 + s and give s. 0 Rearrange -577f*4 + 207f*4 - 389f*4 + (10f*3 + 11f*3 - 6f*3)(-2 + 2 + f) to the form p + tf2 + qf*3 + if*4 + af and give i. -744 Rearrange 138b3 - 136b*3 + 1680b*2 - 1680b*2 - 1 - 144b to yb + db*2 + mb*3 + j and give j. -1 Rearrange (-4w - w + 4w)(-195644 + 103178 + 107450) to the form zw + i and give z. -14984 Express 9352 + w2 + 180w + 24w - 9337 in the form yw + v + sw2 and give v. 15 Express 793f*2 + 3438f*2 - 86f*2 in the form c + vf*2 + hf and give v. 4145 Rearrange -2363d - 1 + 2d*4 + 2 + 2364d + d*4 - 5d*2 + 23d*3 to hd*4 + md + xd2 + y + cd*3 and give c. 23 Rearrange 433o + 394o + 112o - 107o + 38o to ao + g and give a. 870 Express -5 + 0b2 + b2 + 4b + 3 + (-2b - 4b - b)(43b - 62b - 44b) as f + tb*2 + ab and give f. -2 Express (-2l + 3l*2 + 2l)(-224 + 9l*2 - 84479l + 84476l + 4l*2) as fl*3 + ul*4 + y + nl*2 + zl and give f. -9 Express -9l4 - 302 - 13l*3 + 6l4 + 158 - l + l2 + 151 in the form pl + u + tl*4 + ol*2 + hl*3 and give p. -1 Express -43v*2 + 21v*2 + 2v + 11v3 + 2 + 26v*2 - 5v*4 + 4v*4 as c + zv*4 + bv*2 + ov + jv3 and give b. 4 Rearrange (-11a + 19a + 37a)(-105a + 813 - 66a - 809 + (-a - 2a + a)(0 + 2 + 0)) to the form xa*2 + ta + c and give x. -7875 Rearrange (116 - 116 - 5a)(-2 - 24 - 7)(2 - 3 + a - 6a) to the form ba + f + sa*2 and give s. -825 Express 2z - 2z + z + 2z + z + 5z + 2z + z - z + (1 - 4 + 2)(0 + 0 - 2z) + 2496z - 1299z - 1458z in the form lz + x and give l. -248 Express -4z3 - 11z2 - 194 + z4 + 4z3 + 195 - 6z*3 + 4z*3 + z in the form wz*3 + p + nz*2 + qz + yz4 and give n. -11 Rearrange -1864557 - 871n + 1864557 + (-3 + 3 - 2n)(0 + 0 - 1) to qn + w and give q. -869 Express 2f3 - f3 - 369 - 2f3 - 96f*2 + 739 - 371 + 8f in the form x + lf2 + qf + vf3 and give l. -96 Rearrange (-3 + 5 - 3)(28v + 2v + 3v) - v + 0v - 3v + (-v + 4v - v)(-1 + 0 - 5) to nv + l and give n. -49 Express -1012d4 - 4d*2 + 6757d - d*3 - 2d*2 - 6758d + 22 + 1011d4 in the form cd*2 + fd*3 + y + od*4 + nd and give n. -1 Rearrange -101z - 571z - 416z - 54z to the form l + dz and give d. -1142 Express (-2940h + 4690h + 12248h)(-3h + 3h2 + 3h) as b + ch + vh*3 + nh*2 and give v. 41994 Express -2b*3 + 6b*4 - 8172b*2 - 8179b*2 + 2 + b - 8181b*2 + 24530b*2 - 8b as pb2 + c + vb*4 + jb*3 + rb and give j. -2 Rearrange -523n - 241n + 688n - 19 to the form mn + t and give t. -19 Express 528o - 1057o + 1125o2 + 529o - 3097o2 as mo + r + vo2 and give v. -1972 Express -1327z - 1314z - 366z + 3z + 2z + 0z + (0z + z + 0z)(-2 + 3 + 0) as vz + j and give v. -3001 Express (55b*2 + 73b*2 - 47b*2)(3 - 3 + 2b + (-2b + 1 - 1)(3 - 3 + 2) + 10b - 20b + 2 + 1) as zb*3 + ob + t + rb2 and give r. 243 Express (-4 + 0 + 5)(-c + 5c - 5c) + c - 2c + 0c + c + c + c + (-8c - 21c - 13c)(0 - 3 - 2) as i + zc and give z. 211 Rearrange 9 + 22m*2 - 36m*2 - 8 + 7m - 101m3 + 14m*2 to the form vm*2 + pm + bm3 + z and give z. 1 Express -28321c - 16805c + 16390c as ac + b and give a. -28736 Express (123 - 149 - 103)(-2y + 2y + y) - 17y - 52y + 20y + (-y + 2y - 3y)(1 + 1 + 0) in the form xy + q and give x. -182 Rearrange 0o*2 - 3o*2 + 2o*2 + (824o + 617o + 62o)(4o + 1 - 1) to the form z + yo2 + no and give y. 6011 Rearrange 557h - 421h - 10h3 + 231h + 3h3 to the form ah*3 + jh*2 + n + ph and give a. -7 Rearrange -106c - 3 - c2 - 100c + 203c + (-6c - 2c + 4c)(2 - 2 + 6c) to ic2 + xc + g and give g. -3 Express (6 + 0 - 2)(-132z*2 + 3z*2 - 36z*2) + 2z*2 + 11z - 11z in the form jz + i + fz2 and give f. -658 Express -13 - 1 + 13 + 2281q as d + tq and give d. -1 Express 261 + 3k*4 + 60 - 42k*3 + 2k - 50k3 + 135k*3 - 41k*3 as jk*3 + ck*4 + ak*2 + u + fk and give u. 321 Rearrange 9i2 + 73i - 3i2 + i2 - 598i to the form ti + fi*2 + r and give f. 7 Rearrange (-2c2 - c2 + c*2)(269 + 182 + 493)(4c + c - 3c - c + 3c + 0c + (0 - 2c + 0)(-4 + 1 + 1)) to zc*3 + rc*2 + v + jc and give z. -15104 Rearrange -6 + 16s3 + 3022170s - 3022149s - 10 to the form ps + gs3 + ts*2 + r and give r. -16 Express 1215 - 71 + 346 + d + 264 - 59 as b + xd and give x. 1 Express (105i2 + 8985i - 8985i)(-33i - 34i*2 + 33i) in the form bi3 + ni*4 + ui*2 + c + wi and give n. -3570 Rearrange (-1 + 3 - 5)(-79 - 13m + 79)(75m - 149m + 1 + 65m) to xm2 + sm + l and give x. -351 Express 37c + 11c - 15 + 35c + 105c as k + zc and give z. 188 Rearrange (-11 - 23 + 4)(70c4 + 18c*4 - 28c*4) + (-1 + 2 + 0)(-3c4 - 2c*4 + 4c*4) to qc*3 + rc*2 + i + lc + nc4 and give n. -1801 Express -2o + 201 - 86 - 63 + 7o2 - o3 in the form bo*2 + ro*3 + yo + i and give i. 52 Rearrange 628c - 341c - 524 - 295c to s + wc and give w. -8 Express -7350 + 7350 - 61u + (-7 + 2 + 3)(-2u + u - u) + (-2 + 5 + 0)(-u - 2u - 1 + 2u) in the form t + ku and give k. -60 Rearrange 3105f**2 - f	{ "pile_set_name": "DM Mathematics" }
17590 to the nearest integer? 698 What is 37826065 to the power of 1/2, to the nearest integer? 6150 What is the eighth root of 913339805 to the nearest integer? 13 What is 9349880 to the power of 1/5, to the nearest integer? 25 What is the third root of 8568290 to the nearest integer? 205 What is the cube root of 1330538818 to the nearest integer? 1100 What is the cube root of 177873039 to the nearest integer? 562 What is the cube root of 138615160 to the nearest integer? 518 What is the sixth root of 176125672 to the nearest integer? 24 What is the eighth root of 854763826 to the nearest integer? 13 What is the fourth root of 65484477 to the nearest integer? 90 What is the cube root of 102693586 to the nearest integer? 468 What is the square root of 788010485 to the nearest integer? 28072 What is 1955943988 to the power of 1/3, to the nearest integer? 1251 What is 24631703 to the power of 1/7, to the nearest integer? 11 What is 23612651 to the power of 1/9, to the nearest integer? 7 What is the cube root of 402267607 to the nearest integer? 738 What is 654302778 to the power of 1/2, to the nearest integer? 25579 What is 352098307 to the power of 1/3, to the nearest integer? 706 What is 74077280 to the power of 1/3, to the nearest integer? 420 What is the fourth root of 191608716 to the nearest integer? 118 What is 413584710 to the power of 1/5, to the nearest integer? 53 What is the sixth root of 31009497 to the nearest integer? 18 What is 46336860 to the power of 1/3, to the nearest integer? 359 What is 280512546 to the power of 1/2, to the nearest integer? 16749 What is the third root of 68499696 to the nearest integer? 409 What is 622797499 to the power of 1/4, to the nearest integer? 158 What is 295125083 to the power of 1/2, to the nearest integer? 17179 What is 175260890 to the power of 1/10, to the nearest integer? 7 What is the third root of 62797407 to the nearest integer? 397 What is the ninth root of 388879561 to the nearest integer? 9 What is 750288164 to the power of 1/2, to the nearest integer? 27391 What is the cube root of 151461728 to the nearest integer? 533 What is 21541922 to the power of 1/8, to the nearest integer? 8 What is the square root of 133488019 to the nearest integer? 11554 What is the square root of 64225543 to the nearest integer? 8014 What is the ninth root of 8312005 to the nearest integer? 6 What is the third root of 504466870 to the nearest integer? 796 What is the eighth root of 33745951 to the nearest integer? 9 What is the third root of 309814161 to the nearest integer? 677 What is 723809508 to the power of 1/2, to the nearest integer? 26904 What is 6881845 to the power of 1/2, to the nearest integer? 2623 What is the cube root of 73007019 to the nearest integer? 418 What is the third root of 44948583 to the nearest integer? 356 What is 771009146 to the power of 1/3, to the nearest integer? 917 What is the ninth root of 4318872207 to the nearest integer? 12 What is 203690146 to the power of 1/10, to the nearest integer? 7 What is 214988110 to the power of 1/7, to the nearest integer? 16 What is 480826138 to the power of 1/3, to the nearest integer? 783 What is 2375015600 to the power of 1/7, to the nearest integer? 22 What is the tenth root of 202044158 to the nearest integer? 7 What is the third root of 6223227 to the nearest integer? 184 What is 110001693 to the power of 1/2, to the nearest integer? 10488 What is the third root of 6062564052 to the nearest integer? 1823 What is the third root of 250442393 to the nearest integer? 630 What is the fifth root of 86636978 to the nearest integer? 39 What is 160571705 to the power of 1/10, to the nearest integer? 7 What is 241923509 to the power of 1/3, to the nearest integer? 623 What is the seventh root of 1795396296 to the nearest integer? 21 What is 3559004 to the power of 1/3, to the nearest integer? 153 What is the third root of 818489002 to the nearest integer? 935 What is 33601073 to the power of 1/3, to the nearest integer? 323 What is the square root of 51362752 to the nearest integer? 7167 What is the ninth root of 2214825418 to the nearest integer? 11 What is 89415573 to the power of 1/3, to the nearest integer? 447 What is the third root of 2177349838 to the nearest integer? 1296 What is the square root of 4159850351 to the nearest integer? 64497 What is the square root of 1594494879 to the nearest integer? 39931 What is the fourth root of 3149227978 to the nearest integer? 237 What is 17872881 to the power of 1/3, to the nearest integer? 261 What is 459605962 to the power of 1/6, to the nearest integer? 28 What is the third root of 1911285106 to the nearest integer? 1241 What is 111256983 to the power of 1/3, to the nearest integer? 481 What is 93139794 to the power of 1/3, to the nearest integer? 453 What is the tenth root of 38467540 to the nearest integer? 6 What is the tenth root of 161668443 to the nearest integer? 7 What is the fifth root of 1613527593 to the nearest integer? 69 What is 624583138 to the power of 1/10, to the nearest integer? 8 What is the square root of 52006066 to the nearest integer? 7212 What is 62499637 to the power of 1/10, to the nearest integer? 6 What is 1577460629 to the power of 1/4, to the nearest integer? 199 What is 695009773 to the power of 1/9, to the nearest integer? 10 What is the third root of 242995529 to the nearest integer? 624 What is the seventh root of 620126375 to the nearest integer? 18 What is the eighth root of 3794296348 to the nearest integer? 16 What is the square root of 2866869319 to the nearest integer? 53543 What is 49679153 to the power of 1/7, to the nearest integer? 13 What is the seventh root of 126122015 to the nearest integer? 14 What is the square root of 3125124736 to the nearest integer? 55903 What is 3151915933 to the power of 1/2, to the nearest integer? 56142 What is the square root of 75287477 to the nearest integer? 8677 What is the fifth root of 40913580 to the nearest integer? 33 What is the cube root of 2264960648 to the nearest integer? 1313 What is the eighth root of 189104556 to the nearest integer? 11 What is the cube root of 415582286 to the nearest integer? 746 What is the square root of 50109770 to the nearest integer? 7079 What is the fourth root of 1334020868 to the nearest integer? 191 What is 813673094 to the power of 1/2, to the nearest integer? 28525 What is the square root of 106999210 to the nearest integer? 10344 What is the cube root of 623609 to the nearest integer? 85 What is the square root of 83567793 to the nearest integer? 9142 What is the square root of 344242974 to the nearest integer? 18554 What is 2781720123 to the power of 1/3, to the nearest integer? 1406 What is the eighth root of 118694775 to the nearest integer? 10 What is 244449518 to the power of 1/5, to the nearest integer? 48 What is 6039293083 to the power of 1/2, to the nearest integer? 77713 What is 124806125 to the power of 1/6, to the nearest integer? 22 What is 4266684 to the power of 1/2, to the nearest integer? 2066 What is the fifth root of 680243898 to the nearest integer? 58 What is 7698445798 to the power of 1/10, to the nearest integer? 10 What is 87827088 to the power of 1/3, to the nearest integer? 445 What is the square root of 311726910 to the nearest integer? 17656 What is the third root of 172946672 to the nearest integer? 557 What is the seventh root of 234650975 to the nearest integer? 16 What is the cube root of 42426652 to the nearest integer? 349 What is the square root of 660356341 to the nearest integer? 25697 What is the third root of 17583884 to the nearest integer? 260 What is the cube root of 4029935905 to the nearest integer? 1591 What is 273732533 to the power of 1/3, to the nearest integer? 649 What is the sixth root of 996489132 to the nearest integer? 32 What is 2343454455 to the power of 1/2, to the nearest integer? 48409 What is the sixth root of 46777482 to the nearest integer? 19 What is 240699172 to the power of 1/2, to the nearest integer? 15514 What is the cube root of 163949553 to the nearest integer? 547 What is the third root of 200808143 to the nearest integer? 586 What is the third root of 726075535 to the nearest integer? 899 What i	{ "pile_set_name": "DM Mathematics" }
8? 1060116 -21bed (base 15) to base 4 -122030323 118547 (base 10) to base 8 347423 Convert 50c8 (base 13) to base 3. 120021221 Convert 4123032 (base 7) to base 12. 1b9549 Convert 2576c (base 15) to base 6. 2322350 What is 2916cac (base 13) in base 16? c6f640 Convert 70e586 (base 16) to base 2. 11100001110010110000110 What is -11110000010001110 (base 2) in base 12? -5b23a 22982 (base 12) to base 2 1011010011110010 What is 312784 (base 9) in base 14? 4ba01 Convert -121485 (base 9) to base 7. -423464 c23d0d (base 14) to base 3 110022100021021 134532 (base 10) to base 8 406604 Convert 1a1170 (base 13) to base 2. 10100000111110100000 387514b (base 12) to base 10 11102603 7e135e (base 16) to base 5 4103344434 What is 10203015 (base 6) in base 16? 484d3 2377133 (base 9) to base 13 36290a What is -14a283 (base 15) in base 8? -3631546 What is -87b044 (base 13) in base 3? -20000022000121 -14041134 (base 5) to base 16 -22fbe What is 110101110001110101011 (base 2) in base 10? 1762219 What is 48edd (base 16) in base 7? 2352616 What is -22021000110 (base 3) in base 2? -100111101100010011 Convert 5031262 (base 7) to base 9. 1107417 Convert 3530504 (base 9) to base 3. 10121000120011 Convert 50164374 (base 8) to base 16. a0e8fc 110111101000101100 (base 2) to base 5 24243014 Convert -5872822 (base 10) to base 16. -599cb6 What is -3332728 (base 10) in base 13? -8c8c39 What is -31102311221 (base 4) in base 3? -20120001120022 -223484 (base 15) to base 8 -6161655 -ad4d7 (base 15) to base 8 -2064473 What is -23150125 (base 9) in base 10? -11252219 -fea8 (base 16) to base 5 -4041232 Convert -12405415 (base 6) to base 15. -80292 Convert -280755 (base 9) to base 15. -35ad8 Convert 10001111010000011000000 (base 2) to base 16. 47a0c0 -143488 (base 10) to base 14 -3a412 What is a141a (base 11) in base 5? 14220441 332200351 (base 6) to base 3 102021012112011 What is 4604015 (base 7) in base 16? 8bd96 5102136 (base 7) to base 11 384180 -9b1b9 (base 12) to base 5 -23042132 What is 14433502 (base 6) in base 16? 7aa6e 20444315 (base 6) to base 8 2216227 -359804 (base 15) to base 14 -4aa2a1 Convert -11100011011001011101111 (base 2) to base 4. -130123023233 53643 (base 10) to base 13 1b555 -21502847 (base 9) to base 13 -21cc46c Convert -1011001111000011001100 (base 2) to base 14. -569496 718147 (base 10) to base 16 af543 What is -3e5e7 (base 15) in base 6? -4144031 What is 8433b (base 14) in base 3? 121012111210 What is -2376a3 (base 11) in base 10? -376181 13717466 (base 8) to base 7 35345660 Convert 31031e (base 15) to base 12. 944092 Convert 121022022210 (base 3) to base 16. 4e5e5 What is -72461375 (base 8) in base 10? -15360765 Convert 11441114 (base 6) to base 9. 613121 Convert 200211210111 (base 3) to base 9. 624714 What is -180184 (base 14) in base 2? -11001110011010011000 -331445052 (base 6) to base 15 -7cbae2 Convert 512342 (base 10) to base 7. 4232465 What is -512305 (base 9) in base 12? -127788 -327074 (base 10) to base 14 -872a6 Convert -3141486 (base 9) to base 8. -6322553 5b7d34 (base 14) to base 6 151054534 What is -658101 (base 11) in base 6? -34302225 Convert 3014724 (base 9) to base 15. 21a594 What is 118d39 (base 14) in base 8? 2225327 Convert 3111234 (base 5) to base 6. 1031135 What is 2e4fa6 (base 16) in base 11? 1793303 Convert -32200433 (base 6) to base 9. -1705503 Convert -8384b5 (base 12) to base 14. -3bb5d7 -11a5b3 (base 14) to base 8 -2235221 What is -44425430 (base 7) in base 14? -71cd50 What is 32034205 (base 6) in base 3? 1202122121212 7435 (base 10) to base 8 16413 Convert 40734 (base 9) to base 14. 9ad4 -160068 (base 10) to base 7 -1234446 What is -163bba (base 13) in base 16? -8695e 25623644 (base 8) to base 14 a897a4 -1144432 (base 7) to base 14 -3b119 107288 (base 13) to base 7 3201431 -1594cc (base 15) to base 8 -3766777 Convert 42b613a (base 12) to base 9. 25766031 2414343112 (base 5) to base 10 5621657 325724 (base 9) to base 16 2f7c7 What is 26fdd4 (base 16) in base 13? 6b6153 11013030303 (base 4) to base 15 1b7176 What is -341dd (base 15) in base 14? -445d6 Convert -11100011001100110 (base 2) to base 12. -5739a 2205874 (base 9) to base 15 18632a -30330151 (base 6) to base 3 -1122001102111 Convert 12220303 (base 5) to base 10. 116953 Convert 11001010220000 (base 3) to base 14. 3dcc8a -8c23b (base 14) to base 10 -340701 103563 (base 14) to base 12 224757 -324004201 (base 6) to base 15 -7946c1 What is -40044411 (base 5) in base 16? -4d0d6 234220234 (base 5) to base 14 203938 Convert -376663 (base 8) to base 3. -20121222201 2505002 (base 6) to base 10 133274 What is -115e893 (base 15) in base 16? -be01d9 Convert 115333440 (base 6) to base 3. 11011211110020 4914a62 (base 11) to base 9 17081827 871203 (base 12) to base 2 1000001001111011100011 What is -1101bb (base 14) in base 2? -10001100110001011001 Convert 4c7aa8 (base 13) to base 12. 74b933 Convert -1d7435 (base 16) to base 11. -10a9292 Convert -221131001123 (base 4) to base 13. -2336261 Convert 437534 (base 14) to base 12. 92344a What is -361763 (base 8) in base 10? -123891 What is 112010210 (base 4) in base 2? 10110000100100100 Convert 32b45 (base 14) to base 3. 20020122211 600628 (base 10) to base 15 bce6d Convert -27304761 (base 8) to base 10. -6130161 What is -12caaa5 (base 13) in base 3? -102011120112222 What is -1011100101100011110001 (base 2) in base 16? -2e58f1 Convert 21312100 (base 5) to base 10. 182150 What is -23340034 (base 5) in base 8? -643753 Convert 2407a (base 14) to base 6. 1515004 Convert -11000000110010011 (base 2) to base 10. -98707 -201025013 (base 6) to base 5 -1333101234 What is -15144143 (base 7) in base 4? -11133132203 Convert -5bdaab (base 14) to base 4. -30000322213 What is ca2c (base 15) in base 16? a728 What is -1987940 (base 13) in base 12? -2999192 What is -442455 (base 6) in base 11? -257a5 What is -347504 (base 8) in base 9? -200613 323421142 (base 5) to base 9 2546216 -135251302 (base 6) to base 13 -762164 What is -21b01b (base 12) in base 5? -114144211 Convert 2476a62 (base 11) to base 13. b76a43 What is -744386 (base 9) in base 13? -126735 Convert 22157 (base 13) to base 6. 1153525 What is -33330 (base 15) in base 12? -7a200 452303 (base 6) to base 9 57263 Convert 6fa7 (base 16) to base 14. a5b9 Convert -bf1e0 (base 16) to base 10. -782816 What is 78322 (base 11) in base 15? 23982 213001110 (base 4) to base 7 1233654 What is 1312122231 (base 4) in base 7? 4060050 Convert -cab8e6 (base 16) to base 2. -110010101011100011100110 Convert 88946 (base 13) to base 14. 6636b -11123211 (base 5) to base 3 -12000012020 -1111001000202 (base 3) to base 14 -1672a9 221872 (base 15) to base 5 404002112 What is -3020344 (base 5) in base 11? -33260 -12420212 (base 7) to base 16 -1141e2 120245234 (base 7) to base 9 15025002 -1010011010212102 (base 3) to base 6 -1331244445 -5583051 (base 10) to base 16 -5530cb What is 6c868 (base 14) in base 3? 111110121221 What is 30aa96 (base 12) in base 16? bad92 -221322133 (base 4) to base 6 -3402451 Convert -971542 (base 12) to base 9. -4437475 Convert a9b0d6 (base 14) to base 7. 66624356 3e0e8 (base 16) to base 11 163a77 Convert 22e14 (base 15) to base 14. 2c729 Convert -1101010010110001111101 (base 2) to base 12. -12007b9 Convert 332041221 (base 6) to base 12. 2003211 What is -56046535 (base 7) in base 15? -657b47 Convert 6dee (base 15) to base 14. 8755 What is 101011101000000110 (base 2) in base 11? 11228a What is a5284 (base 13) in base 7? 2345003 1b6506 (base 13) to base 3 1022112112022 What is -11011001011100101100 (base 2) in base 7? -10366462 Convert 1120217 (base 8) to base 9. 511871 Convert 7b713b (base 12) to base 4. 13203323333 Convert 177953 (base 10) to base 3. 100001002212 11023121 (base 4) to base 7 115556 What is -101040 (base 11) in base 6? -3251550 What is -101a986 (base 11) in base 12? -72a09b 8218cb (base 13) to base 16 2e408e Convert 356500 (base 10) to base 7. 3013234 What is -1034466 (base 7) in base 16? -1ee04 Convert 4682572 (base 9) to base 2. 1001101010110001001010 -1013300131 (base 4) to base 16 -47c1d What is -2440245 (base 6) in base 7? -1050065 What is 310010233 (base 4) in base 7? 1545565 -10100210022 (base 3) to base 7 -363650 Convert -15233150 (base 7) to base 3. -2201212010102 What is -179207 (b	{ "pile_set_name": "DM Mathematics" }
8 Suppose -4324 = 9p - 55p. What is the remainder when p is divided by 33? 28 Suppose 0 = 4m - 4c - 312, -c = -21m + 23m - 141. Suppose -4v + 989 + 166 = a, -a = 5v - 1443. Calculate the remainder when v is divided by m. 69 Suppose 4k + 2z - 148 = -0z, 5z - 160 = -4k. Calculate the remainder when k is divided by 4. 3 Suppose 2c - 24 + 4 = 0. Let i = -4 + c. Calculate the remainder when 48 is divided by (i - 3)1 - -14. 14 Let d(z) = -68z3 + z2 + 2z + 1. Calculate the remainder when d(-1) is divided by 85/17 + ((-1)/(-2))/((-23)/(-598)). 14 Suppose 6 + 30 = -3a. Let f be (1 + -5)(-27)/a. Let j = 39 - f. What is the remainder when j is divided by 17? 14 Let j(n) = -n3 - n2 + 2n - 7. Let r be j(-3). Suppose 0 = l - 1, 3 = -rt - l - 6. What is the remainder when (-3411)/(-54) - t/(-12) is divided by 13? 11 Suppose -4d + 229 = -19. Let f = -38 + d. Suppose 0 = -21i + 1656 - 135 - 51. Calculate the remainder when i is divided by f. 22 Let s(c) = 25c*2 + 3c - 2. Let y be s(2). Let v = y - 81. What is the remainder when 64 is divided by v? 18 Suppose 13u = 5i + 9u - 98, -i - u = -25. Calculate the remainder when 100 is divided by i. 12 Let o(n) = -2n + 16. Let i be o(6). Let a(b) = b*3 - 4b*2 + b + 4. Calculate the remainder when a(i) is divided by 5. 3 Let n(i) = -17i*3 + 2 - 5i*2 + 10i*3 + 8i*3 - 2i - 4i. What is the remainder when n(8) is divided by 37? 35 Let u(t) = t3 + 8t*2 + 4t - 2. Let p(j) = -8j - 3. Let f be p(3). What is the remainder when u(-4) is divided by f/(-2) + (-3)/2? 10 Let a(m) = -12m + 142. Calculate the remainder when 299 is divided by a(0). 15 Suppose x = 6x - 2225. Suppose -3f = 5m - f - x, 2m - f - 169 = 0. Suppose 8y - 3y - 90 = 0. Calculate the remainder when m is divided by y. 15 Let b = 578 + -121. Calculate the remainder when b is divided by 20. 17 Let w be 272/(-9) - 16/(-72). Let v = -13 - w. Suppose c + 0c = v. Calculate the remainder when c is divided by 9. 8 Suppose 0 = -2u + 8 - 6. What is the remainder when (-3)/((u - -1)/(-6)) is divided by 3? 0 What is the remainder when 20 is divided by (-1218)/(-105) - (2 + 7/(-5))? 9 Let k(b) = 10b + 31. Let n(c) = -c3 + c2 + c + 1. Calculate the remainder when k(1) is divided by n(-2). 8 Let n = 161 - 119. Calculate the remainder when 53 is divided by n. 11 Suppose 17l = 240 + 100. Calculate the remainder when l is divided by 8. 4 Suppose 5y = 4h + 4 + 23, 3y + 3 = -4h. Suppose 23 = yx - 280. Calculate the remainder when x is divided by 26. 23 Let g(q) = -q3 - 5q*2 - q - 7. Let z be g(-5). Let j be (-406)/(-49) - z/(-7). Let v = -3 + j. What is the remainder when 13 is divided by v? 3 Suppose 4j - 4h = 192, 0 = -0j - j + 5h + 28. What is the remainder when j is divided by 11? 9 Let z = 129 + -69. What is the remainder when z is divided by 29 + -13 + 120/8? 29 Calculate the remainder when 343 is divided by (-2)/(-23) + (-10920)/(-1380). 7 Suppose 5z - t - 3t - 27 = 0, 5z = t + 18. Let g be ((-78)/(-9))/((-1)/z). What is the remainder when 10 is divided by -10(g/10 + 2)? 4 Let n(c) = -4c - 24. Let a be n(-8). Let l(g) = -g*3 + 9g*2 - 5g + 7. Calculate the remainder when l(a) is divided by 4/(-5)(5 - 25). 15 Let x = 13 + -14. Let l(n) = n + 2. Let z be l(x). Calculate the remainder when 134 is divided by z/1 - 52/(-2). 26 Suppose 4c = -215 + 491. What is the remainder when 758 is divided by c? 68 Suppose 0 = -10x - 313 + 973. Calculate the remainder when x is divided by 14. 10 Suppose 0 = -w + 5o - 13 + 68, -2w = -o - 92. What is the remainder when w is divided by 12? 9 Let m(x) = x + 1. What is the remainder when 97 is divided by m(16)? 12 Let r = 336 - 332. What is the remainder when 19 is divided by r? 3 Let u(z) = -2z*2 - 35z + 13. Calculate the remainder when u(-15) is divided by 24. 16 What is the remainder when 441 is divided by (-886)/(-10) - 2(-2)/10? 85 What is the remainder when 192 is divided by (21/2)/(230/40 + -5)? 10 Suppose 0 = -7v + 4v - 3s + 315, -212 = -2v - 4s. Suppose 0 = -10k + 36 + v. What is the remainder when k is divided by 9? 5 Let n(f) = 9f + 75. Let h = 120 - 120. What is the remainder when n(h) is divided by 38? 37 Suppose 0 = -8n + 1503 - 111. Calculate the remainder when n is divided by 38. 22 Let j(q) = 32q*2 - 27q + 11. Calculate the remainder when j(4) is divided by 70. 65 Let m = 711 + -490. Calculate the remainder when m is divided by 115. 106 Let a = 159 - 148. Suppose -143 = -2x + 1. Let z = x - 51. Calculate the remainder when z is divided by a. 10 Let u(w) = -w + 9. Let z be u(7). Let d(m) = m2 + 11m + 0 - 6 - 2mz. Calculate the remainder when d(7) is divided by 12. 10 Let n(t) be the first derivative of -t4/4 - t3/3 - 2t + 14. Calculate the remainder when 6 is divided by n(-2). 0 Suppose y - 56 = -7y. Suppose 2 = -2q, yd - 4d - 3q - 51 = 0. Let x = -45 - -74. What is the remainder when x is divided by d? 13 Let j(h) = 2h*2 + 40h + 26. Calculate the remainder when 100 is divided by j(-20). 22 Let u = 290 - 223. Calculate the remainder when u is divided by 13. 2 Suppose -h = -3s + 24, -11s - 3h - 30 = -14s. Calculate the remainder when 94 is divided by s. 3 Let a = 1843 - 1058. What is the remainder when a is divided by 33? 26 Suppose -2h - 5l = 2h + 12, 0 = 2l + 8. Let z be (-141)/329 + (76/14 - -1). Suppose hn = zn - 40. What is the remainder when 49 is divided by n? 9 Let k(l) be the third derivative of -1/15l5 + 0 + 0l + 1/3l3 + 1/120l*6 + 2l*2 - 1/12l*4. Calculate the remainder when k(5) is divided by 5. 2 Let a = 6 - 10. Let d = -2 - a. Suppose 5f - 267 = -dt, -5f - t + 110 = -161. What is the remainder when f is divided by 19? 17 Let n = -547 + 774. What is the remainder when n is divided by 46? 43 Suppose 0 = -589k + 583k + 330. Calculate the remainder when 116 is divided by k. 6 Suppose -4 = -3z + 4n - 5, 0 = z + 2n - 13. Let l = 8 - z. Suppose -lk + 17 - 2 = 0. Calculate the remainder when 18 is divided by k. 3 Let p be 153/314. Let x = 34 - 31. Suppose xo = p + 24. What is the remainder when o is divided by 16? 14 Suppose -5o + 2 = 4p, -3o + 2p = -3p + 21. Let z = 29 - o. Calculate the remainder when z is divided by 11. 9 Let z be (-10)/(-15)(1 - -29). Let y(p) = -p2 + 22p - 33. Calculate the remainder when y(z) is divided by 5. 2 Suppose 29q = 27q + 34. Calculate the remainder when 65 is divided by q. 14 Let x(f) = 7f - 21. Let p be x(3). Let r = 22 - -13. Calculate the remainder when r is divided by p + 3 + 5 - (1 - 2). 8 Let p(z) = 2 + 3z*2 - 7z*2 + 7z - 1 + 20z2. Let q(u) = u2 + u. Let v(d) = p(d) - 6q(d). What is the remainder when 18 is divided by v(-1)? 8 Let z(g) = g*3 - 7g*2 - 2g - 3. Calculate the remainder when z(8) is divided by 7/14 - 46/(-4). 9 Suppose 9x - 4x - 40 = 0. Suppose -3h + 9 = 2p, -15 = 3p - xh + 3h. Suppose p = -21d + 24d - 213. What is the remainder when d is divided by 24? 23 Suppose -2c - 25 = -3v, -5c + 53 = 2v + v. Suppose 0 = -2x + x + v. Calculate the remainder when (0 - 5)/(1/(-6)) is divided by x. 8 Suppose -121m + 530 = -111m. Calculate the remainder when m is divided by 17. 2 Suppose -5w - 12 = 3. What is the remainder when 199 is divided by -3(-46)/6 + w? 19 Suppose -5y + 178 + 7 = 0. Suppose -24 = -4z + z. Calculate the remainder when y is divided by z. 5 Let x be (-2 + 1)(-2 - (1 + -4)). What is the remainder when (-6)/((-1)/(15/16) - x) is divided by 32? 26 Suppose 3m = -29 + 185. Let h = 8 + -11. What is the remainder when m is divided by 9/((-4)/36h)? 25 Let v = -7 + 10. Suppose -t + 0t = 3i - v, -5t + i = -79. Suppose -27 = -b + 4y, -81 = -3b + 20y - 17y. Calculate the remainder when b is divided by t. 12 Let v(u) = 4u2 + 26u + 5. Let w(a) = 3a2 + 25a + 5. Let t(n) = -5v(n) + 6w(n). What is the remainder when 29 is divided by t(10)? 4 Let p = -347 - -435. What is the remainder when p is divided by 23? 19 Let a = -5 - -180. Calculate the remainder when a is divided by 44. 43 Let n(k) = k*3 + 10k*2 + 5k - 21. Let p be n(-9). Calculate the remainder when 67 is divided by (-2)/p - 2827/(-165). 16 Suppose 26 = 2*b + 14. Calculate the remainder when	{ "pile_set_name": "DM Mathematics" }
+ 26 = -4g - 4q. Let v be j(g). Is (-2)/v22-10 a multiple of 22? True Suppose 0 = 6l + 4 - 34. Suppose -2s - 3s = lk - 890, 0 = 3s - 3k - 504. Does 20 divide s? False Let b be 4/(16/(-388)) - -2. Let i = -77 - b. Is 12 a factor of i? False Let y(x) = -2x - 18. Let d be y(-9). Suppose d = -5v - 1 - 4, -61 = -5n + v. Is n a multiple of 7? False Suppose -2c = -13c + 16368. Is 16 a factor of c? True Suppose 2t - 6t = 0. Suppose -2q + b = 5b - 72, t = -5q + 2b + 144. Suppose -3v + 0v = -q. Is v a multiple of 8? False Let m = 275 - 80. Is 29 a factor of m? False Is (-1019130)/(-245) - (1 + 18/(-14)) a multiple of 80? True Let t(b) = 2b3 - b2 + 5b - 84. Is t(7) a multiple of 12? True Suppose s + 4r = 69, -5s + 4r = 9r - 330. Does 5 divide s? True Is (-1 - (-1 - 2))/((-32)/(-8304)) a multiple of 20? False Suppose -20 = -4w, w + 1042 = 4v - 5905. Is 11 a factor of v? True Suppose -13a - 1243 + 9082 = 0. Does 8 divide a? False Let j(n) = -2n + 5. Let u = -33 - -39. Let p be j(u). Is -3 - p/1 - -72 a multiple of 19? True Suppose 3c - 6c = -12. Let d(k) be the second derivative of -k4/12 + 5k3/6 + k2 - 72k. Does 3 divide d(c)? True Is 6 a factor of (-5696)/96(-11 + 2)? True Let j(f) = 5f2 - 4f + 2. Let t be j(1). Suppose -tz + 128 = -2z. Is 16 a factor of z? True Suppose -5m = -2m - 48. Let t = m - 26. Does 16 divide 48/t(-80)/6? True Suppose -21y = -2053 + 373. Is 8 a factor of y? True Is (-153006)/(-238) - (144/(-68) + 2) a multiple of 33? False Suppose 0 = 2w + 5i - 13, -3i = -3 - 0. Suppose -v - f + 23 = 4, -3v - wf + 52 = 0. Does 14 divide v? False Suppose -2h + 32 = 4o, 3h - 3o = -0o + 12. Suppose 2n = p + 140, 5n - 337 = 4p - hp. Is 23 a factor of n? True Let r = 784 - 419. Suppose -4g - 3z = g - 405, 5g - 5z - r = 0. Is 26 a factor of g? True Let c = -9 - -15. Suppose -y = -cy + 15. Does 5 divide ((-20)/8)/(y/(-6))? True Let g = 79 - 12. Let n = -73 - -77. Suppose -3m + g = -ns + 5s, 1 = s. Is m a multiple of 11? True Suppose -16w + 5724 + 244 = 0. Is w a multiple of 16? False Suppose g + 3m + 711 = 5g, 5g - 3m - 888 = 0. Is g even? False Suppose 28 = 2a + 4i, -3a + i + 22 = -3i. Suppose 14 = z - a. Does 8 divide z? True Let u(d) = -88d - 116. Is 42 a factor of u(-8)? True Suppose 0 = n - 4n - 2l + 946, 5n - 5l - 1535 = 0. Is 38 a factor of n? False Suppose -60s + 61s = 3450. Is s a multiple of 21? False Let j = -18 + 20. Let c be ((-13)/(-1))/(j - 3). Let k = 23 + c. Is k a multiple of 7? False Suppose 3n = 5g - 854 - 203, 2g - 419 = 5n. Is 3 a factor of g? False Let b(u) = u*2 + 2u + 5. Let j be b(5). Suppose 5y + 3i - 69 = 0, -8i = -4y - 3i + 70. Suppose -y = -5w, 2l - w = j + 47. Is l a multiple of 9? True Suppose -4p + 874 + 3806 = 0. Is p a multiple of 15? True Let l(c) = -c*2 - 19c. Let v be l(-19). Let f(z) = 2z2 - 2z - 1. Let k be f(2). Suppose v = -kh - h + 132. Does 18 divide h? False Suppose -5827 = -3l - 4i, l - 1945 = 8i - 12i. Is l a multiple of 11? False Suppose 0 = 25y - 3y - 11110. Is y a multiple of 3? False Let b = -116 + 197. Suppose 2w - 63 = b. Suppose 0o + 3o - w = 0. Does 13 divide o? False Let t(s) = 3s3 - 76s*2 - 38s + 54. Does 13 divide t(26)? False Let u = -476 + 575. Is 11 a factor of u? True Let j(z) = -2z2 - z + 115. Let x be j(0). Let h = x - 52. Is h a multiple of 21? True Suppose 87 = 2n - 113. Suppose n = 5a + 280. Let f = 94 + a. Does 29 divide f? True Let d be -4 + (-12 - (1 + -3)). Does 12 divide -96(d/(-4) + -4)? True Does 15 divide ((-50)/8)/(31/(-360))? True Let s = -32 - -36. Suppose 0 = w + sn - 21, -5n - 3 = 3w - 4w. Is w a multiple of 2? False Suppose -62p + 2791 = -21265. Is p a multiple of 5? False Let k(y) = 3 + 9y - 17y + 9y + 3y. Is 13 a factor of k(8)? False Suppose 0 = -33f + 2099 + 2059. Is 9 a factor of f? True Let l(i) = -i3 + 11i*2 - 3i - 7. Let c be l(7). Let u = c + -120. Does 8 divide u? True Let h = -50 - -29. Let z be (-6)/428/h. Suppose 47 = zr - 23. Is 9 a factor of r? False Let d = 400 + -274. Is d a multiple of 21? True Let a(l) = l*2 - 66l + 69l + 1 - 2. Let k be a(-8). Suppose 4v - 90 = 2o, v + 0v + 5o - k = 0. Does 8 divide v? True Suppose 11y = 1048 + 11415. Is y a multiple of 12? False Let k(t) = 117t2 - t. Let v be k(1). Suppose 2s + 4g = 6s - 288, -4s - g + 298 = 0. Let b = v - s. Is b a multiple of 14? True Let b(v) = 1 + 12 - 4 - 421v. Let c be b(5). Is (-1)/5 - c/80 a multiple of 7? False Suppose -5c = -0c + 4o - 1127, -3c = -4o - 657. Does 43 divide c? False Let j = -205 - -345. Let z be (-16)/10j/(-7). Suppose -19 = -l + 3p - p, -3l + p + z = 0. Does 4 divide l? False Let p = 89 + 266. Suppose -p = -8f + 445. Is 9 a factor of f? False Suppose -134d = -149d + 58560. Does 16 divide d? True Suppose -3w + 141 = 3j, -w - j = 4j - 39. Let d = w + 4. Is d a multiple of 10? False Suppose -5n = 19z - 24z + 15765, -2z - n + 6294 = 0. Is z a multiple of 118? False Suppose 2w - 10 = 2z, -14 = -2w + 10z - 12z. Let d(a) = 18a + 12. Is d(w) a multiple of 40? True Let h(i) = -i*2 + i + 1. Let c be h(0). Suppose 0 = 14o - 11o. Suppose -r - c + 7 = o. Is 2 a factor of r? True Let b be ((-1)/(-5)5)/((-2)/(-172)). Let s = 329 - b. Is 39 a factor of s? False Let j(k) = k*3 - 3k*2 - 7k + 4. Let v be j(5). Suppose -p = -t + 30, -3p + v = 3t - 47. Let s = 39 - t. Is s a multiple of 8? False Is (7 - 1)/(26/299) a multiple of 23? True Let w = -43 - -90. Let u be ((-7)/28-102)/((-3)/4). Let o = u + w. Is o a multiple of 3? False Is (3 + -9 + 1719)(-1)/(-3) a multiple of 44? False Let i(b) be the first derivative of -b*3/3 + 8b*2 - 13b + 3. Let z be i(13). Suppose -u + 27 = j, 2j = -0u - u + z. Is 7 a factor of u? True Let a(r) = -r*3 - 4r*2 - r - 4. Let t be a(-4). Suppose 6 = -tl + 3l. Suppose -2o - lo = -32. Is o a multiple of 4? True Let u(x) = -x3 - 3x*2 + 3x + 34. Is 29 a factor of u(-9)? True Let h(n) = 6n + 26. Let i be h(-11). Let o = i - -49. Does 9 divide o? True Let f(d) = d3 + 5d*2 + 5d + 9. Let x be f(-4). Suppose -n = -xg + 232, 3g + 6n - 132 = 3n. Is g a multiple of 7? False Let u = 44 - -207. Is u even? False Suppose -g - 11 = 77. Let o = 153 + g. Is o a multiple of 23? False Let l(m) = m - 18. Suppose 0 = 3i + 4q - 18, 5i - 17 - 13 = 2q. Let u be l(i). Let o(w) = w*3 + 11w*2 - 15w - 18. Is 4 a factor of o(u)? False Let n be (-2804)/(-8) - (-2)/4. Let f = -138 + n. Does 37 divide f? False Let x be -8 + 122 + (0 - 0). Suppose 5w + x = 4h, h + h - 54 = w. Is 17 a factor of h? False Suppose -6t - x + 7696 = -t, -5t = -5x - 7720. Is t a multiple of 22? True Let x(l) = -3l - 14. Let v(h) = h*2 + 6h - 11. Let r be v(-6). Is x(r) a multiple of 11? False Suppose 8470 = 29v + 41v. Is v a multiple of 4? False Let g(l) = 2l3 - l2 - 2l - 1. Let p be g(2). Let v = p + -2. Let b(h) = -h*2 + 7h - 4. Does 6 divide b(v)? True Suppose -3t = 3c - 1734, 5t - 7c + 5c - 2911 = 0. Is t a multiple of 48? False Suppose -7l + 3i + 262 = -2l, 0 = -4l + 3i + 212. Suppose y + 2o = l, -26 = -2y + o + 69. Does 12 divide y? True Suppose 2a + 162 = -7a. Let o be ((0 + 0)/(-2))/2. Is (0 - o) + a/(-6) even? False Suppose -21s + 1480 = -13s. Does 37 divide s? True Let k(d) = 1003d2 + 7d - 7. Is 35 a factor of k(1)? False Let h = 1443 + -443. Does 10 divide h? True Suppose -3d + f + 235 = 0, -2d + 0f - 2f = -170. Is 10 a factor of d? True Does 49 divide (160/25 + -6)/(3/735)? True Let j = 231 - 71. Is 13 a factor of j? False Suppose 5l + 4b = 982, l + 5b = 111 + 98. Suppose 0 = 6o - 1538 + l. Is o a multiple of 14? True Let u(d) = d*2 + 8d + 7. Suppose 3q - 4 = -28. Let g be u(q). Suppose 174 = gs - 5s. Does 23 divide s? False Does 19 divide (-3)/(4 - (-98)/(-24))? False Let t be 32/6 + 1/(-3). Suppose -3j + 35 - 5 = 5x, tj = 3x + 16. Suppose p - jp = -16. Is 4 a factor of p? True Let f(m) = 16m2 - m. Let x be (10/15)/((-2)/3). Does 2 divide f(x)? False Suppose 17 = -4x + 169. Suppose 0 = 6g - 5g - x. Suppose 0 = -r + p + g, -5r + 155 = -p - 47. Is r a multiple of 18? False Suppose 2n - 6l + l = -21, -4n - 1	{ "pile_set_name": "DM Mathematics" }
ch is the closest to 3? (a) 0.4 (b) 2/7 (c) -4 (d) -1/2 a Which is the closest to -1/4? (a) 0.13 (b) -0.1 (c) 0 b Which is the closest to 31? (a) -4/7 (b) 1 (c) 1/5 b What is the nearest to 0.2 in -7/2, -1, -4? -1 What is the closest to -47 in -2, -0.4, -5/4, 0? -2 What is the closest to 1 in 2/11, 0.05, 3/17? 2/11 What is the closest to 0.1 in -0.2, -29, 1, 0.7? -0.2 What is the nearest to 0.1 in 1, -25, 5, 2/17? 2/17 What is the closest to 1 in -16.3, 3, 1/4? 1/4 Which is the nearest to -0.25? (a) 3/8 (b) 2/9 (c) 4/3 (d) 0.5 b What is the nearest to -2 in -3, -4, 9, 1? -3 Which is the closest to 2/23? (a) -4 (b) 1 (c) -5 (d) 1/6 d What is the closest to -1/4 in -0.4, -201, 0, 7? -0.4 What is the nearest to -0.1 in -0.04, 0.4, 2, -2/97? -0.04 Which is the nearest to 0? (a) 1.1 (b) -4 (c) -1 (d) -0.1 d Which is the closest to -0.2? (a) -2 (b) -1 (c) -39 b What is the nearest to -0.1 in 0.1, -22, -0.8, -1? 0.1 Which is the nearest to 15? (a) 0.2 (b) 0.5 (c) 2/5 b What is the closest to 2.6 in 3/5, 4, -2, -5/3? 4 What is the nearest to -2/11 in -0.2, 37, -5? -0.2 Which is the nearest to 6? (a) 86 (b) -3 (c) 1 (d) -4 c What is the nearest to -1/2 in 0.09, -1/5, 2.7, -3? -1/5 What is the nearest to -44 in -2, 0.4, 0.3, 4? -2 Which is the closest to -46? (a) -2/13 (b) 2 (c) 2/3 a What is the nearest to 0.07 in -0.4, -0.1, 1/4, 0.21? 0.21 Which is the nearest to 0? (a) 2 (b) -5 (c) -42 a Which is the nearest to 1? (a) 4 (b) -5 (c) -3 a What is the nearest to 1 in -2/5, 15, -0.3, -1? -0.3 Which is the closest to 0.02? (a) 0.34 (b) -4 (c) 1 a What is the nearest to -2/5 in 1, 0.001, -5? 0.001 What is the nearest to 0.2 in 1/3, -8, -2/7? 1/3 Which is the nearest to 3/4? (a) 3 (b) 1/3 (c) -24 (d) 2/7 b What is the nearest to 0.1 in 0, 1.88, 2? 0 Which is the closest to 12? (a) 1 (b) 14 (c) -0.5 b Which is the nearest to 3? (a) -2/11 (b) 19 (c) 1/6 c What is the nearest to 0.1 in -0.1, 5, -40/23? -0.1 What is the nearest to -1/7 in -10, 0.05, 2/3, 0.5? 0.05 Which is the closest to 0? (a) -0.3 (b) 3 (c) 2/7 (d) -6 c What is the closest to -1/4 in 0.2, -0.2, -0.33? -0.2 Which is the closest to 0? (a) 22 (b) -3 (c) -13 b Which is the nearest to 0.1? (a) -3/7 (b) -5 (c) 16/3 a Which is the closest to -7? (a) 0.1 (b) -4 (c) 2/3 (d) 2/15 b What is the closest to 2/7 in -4, 0.5, 541? 0.5 What is the closest to 5 in 19, 0.1, -2/5? 0.1 What is the closest to -0.1 in 2/13, 1, 1.3, 8? 2/13 Which is the nearest to -0.1? (a) 0.3 (b) 1/3 (c) 344 (d) -5 a Which is the closest to 1? (a) 2/17 (b) -0.05 (c) -4 a What is the nearest to 1 in 1, -0.4, 0.04, -1? 1 Which is the closest to -2? (a) 3 (b) -6 (c) -5 (d) 7/4 c Which is the closest to -16/11? (a) -5 (b) 3/2 (c) 0.1 (d) -1/4 d Which is the nearest to -2/3? (a) -3/8 (b) 2/13 (c) 3 a What is the nearest to -3 in -3, 2/17, 0? -3 Which is the nearest to -0.3? (a) 0.6 (b) -4 (c) 2 a What is the nearest to -1.2 in 2, -3, 5? -3 Which is the nearest to -32? (a) -0.3 (b) 0.1 (c) 2 a What is the closest to -1 in -0.2, -3, 0, -5/4? -5/4 Which is the nearest to -0.4? (a) 19 (b) -0.3 (c) 3 b What is the nearest to -1 in -0.3, -11, -0.2, -1? -1 Which is the nearest to 0.1? (a) -2/5 (b) -6 (c) -3 (d) 11.4 a What is the nearest to -21.7 in -5, 4, -8? -8 Which is the nearest to -20? (a) 0.4 (b) -4 (c) -2 (d) 3/5 b Which is the closest to 6? (a) 0.5 (b) 0.2 (c) -0.3 (d) -1 a What is the nearest to 1/4 in 1/9, 2, 3, -1/4? 1/9 Which is the nearest to 0.2? (a) -0.1 (b) 9 (c) 2/9 c What is the closest to -39 in 1/3, -18.6, 0.1? -18.6 What is the closest to -0.1 in -6, -49, 4, -0.2? -0.2 Which is the closest to 1/6? (a) -2 (b) -0.2 (c) -2/17 (d) -1/4 c What is the closest to -7 in -9/2, -0.3, 2/7? -9/2 Which is the nearest to 1? (a) -0.6 (b) 0.03 (c) -5 b What is the closest to -2/7 in 1/3, -2, -0.04, 3? -0.04 Which is the nearest to -2/3? (a) -35.1 (b) 3 (c) -5 b Which is the closest to 0? (a) -4 (b) 3 (c) 0.1 (d) -2 c Which is the closest to -2/7? (a) -0.8 (b) 5 (c) 4 a What is the closest to -39/2 in 57, -5, -3? -5 What is the nearest to 2/5 in -6, 2/19, 1/6, -5? 1/6 Which is the closest to 2? (a) 1 (b) 0 (c) -0.5 (d) -0.1 a What is the closest to -0.1 in -2, 1/5, -24/7? 1/5 Which is the nearest to 10? (a) -5 (b) -1/3 (c) 1/4 c What is the nearest to -0.2 in 1, -1/2, -73? -1/2 What is the closest to -0.1 in -1, 1.2, 106, -2/9? -2/9 Which is the closest to 38? (a) 5 (b) -2 (c) 0 (d) 3 a Which is the closest to 2/5? (a) -4 (b) -12 (c) -6/7 c What is the nearest to 0.1 in 10, 5, 3? 3 What is the closest to 0.1 in -0.02, 3/8, -58? -0.02 Which is the closest to 5/23? (a) 1/6 (b) 0.01 (c) 2/3 a Which is the nearest to 1/3? (a) 1/5 (b) 1 (c) -0.2 (d) 2 a What is the nearest to -1.6 in -2, -0.5, -4/3, 0.3? -4/3 Which is the closest to 1/2? (a) -0.1 (b) -131 (c) -5 a Which is the closest to -0.263? (a) 0.2 (b) -4/5 (c) 4 a Which is the closest to 12? (a) -1 (b) 0.3 (c) 3 (d) -5 c Which is the nearest to 0.4? (a) 0.01 (b) -0.2 (c) -5 a Which is the nearest to -0.1? (a) 0.2 (b) 2 (c) -4 (d) -50 a Which is the nearest to 3? (a) -2 (b) 0.5 (c) 1.1 c What is the nearest to -0.28 in 3/2, 0.5, -7? 0.5 Which is the closest to -2/9? (a) 0.21 (b) 0.2 (c) -2/17 c Which is the closest to -0.1? (a) 1/3 (b) 0 (c) -3 (d) 2 b Which is the nearest to -0.2? (a) 4/5 (b) -1/5 (c) 283 (d) -0.5 b What is the closest to -2/9 in -4, -2, 1, 12? 1 What is the closest to -0.1 in 5, 1/4, 1, -9? 1/4 Which is the closest to -2? (a) 10 (b) -1/6 (c) 1 (d) 0 b What is the nearest to -1 in 2/11, -0.6, -3/4, -2? -3/4 Which is the nearest to 5? (a) 2/3 (b) 4 (c) -3 (d) 11 b What is the closest to 1 in 2.63, 2/3, 3? 2/3 Which is the nearest to 0.2? (a) 4 (b) -0.25 (c) -1 (d) 5 b What is the closest to -0.3 in -122, -0.4, -5? -0.4 Which is the nearest to -2/5? (a) 5 (b) 4/3 (c) -0.9 (d) 4 c Which is the nearest to -2? (a) 0.5 (b) -5 (c) 0.4 c What is the nearest to -5/7 in -3/7, -1/3, 0? -3/7 Which is the nearest to 10? (a) -3 (b) -1/7 (c) 5 (d) -0.1 c What is the nearest to -0.1 in 5, -2/7, 2, -18/11? -2/7 Which is the closest to -1? (a) -7 (b) -6/11 (c) 4 b What is the closest to -1/7 in -3/2, -2, -5, 0? 0 Which is the closest to 1? (a) 0.5 (b) 1/4 (c) -1 (d) -10/3 a Which is the nearest to 0.2? (a) -2/5 (b) -2/7 (c) 90 b What is the nearest to 1/2 in -1, -1.4, -0.5, 1? 1 Which is the closest to -1/4? (a) 2 (b) -4/5 (c) 0.116 c Which is the closest to 0.3? (a) 0.4 (b) 6 (c) 23 (d) -2/5 a What is the closest to -1 in -2/9, -5, 54? -2/9 What is the closest to 2 in -61, -0.1, 5? -0.1 What is the nearest to 1/3 in 962, -0.09, 5? -0.09 What is the closest to -2 in 2, -67/5, -5? -5 What is the closest to -1 in -0.4, 0.05, -0.3, 0.06? -0.4 What is the nearest to -0.2 in 3, 0.4, -14, -0.5? -0.5 What is the closest to -0.01 in 33, -2/21, 5? -2/21 What is the closest to 6.4 in 2, 0.3, -2/17? 2 What is the closest to -0.22 in -5, 2/5, 0.3? 0.3 What is the nearest to -2 in 3, -1/68, 18, -2? -2 Which is the closest to -9? (a) -1 (b) -3/4 (c) 19 a What is the nearest to -1/2 in -0.3, 0.1, -30, 5? -0.3 Which is the nearest to -1/2? (a) -81 (b) 4 (c) 6 b Which is the nearest to -5/8? (a) 0.1 (b) 0 (c) -3 b What is the nearest to -2/7 in 4/7, -0.4, -27? -0.4 What is the nearest to 0.2 in 3/17, -5, -4? 3/17 Which is the closest to -20.2? (a) -5 (b) 2/17 (c) -0.1 (d) -1 a Which is the nearest to 3? (a) -1 (b) -2/7 (c) -28 (d) 3/8 d Which is the closest to 0? (a) -3 (b) 7 (c) -4 (d) -2 d Which is the nearest to 45? (a) -3 (b) -0.5 (c) -5.1 b Which is the nearest to 2? (a) -141/7 (b) 0.5 (c) 0.3 (d) 0.06 b Which is the closest to 1/4? (a) 0.3 (b) -4 (c) -582 a What is the closest to 0.1 in 0.5, -0.2, 0.13, -1/4? 0.13 What is the closest to 0 in 5, 35, 3, 2/9? 2/9 Which is the nearest to 2? (a) -0.5 (b) -0.02 (c) -6/5 b What is the nearest to -2/7 in 0.4, -5, -0.16, -3? -0.16 What is the closest to 2 in 0, -2/11, 1? 1 What is the closest to 1/2 in -3, -2, -4, 0.5? 0.5 Which is the closest to 1? (a) 3 (b) 5 (c) 11 (d) 2 d Which is the nearest to	{ "pile_set_name": "DM Mathematics" }
+ 90d4 + 4d*3 + 65526d*2 + 765d wrt d. 2883600d2 + 2160d + 24 What is the third derivative of -10363747mu*3 + 179314mu2 + 4m wrt u? -62182482m What is the derivative of 844n*3 - 17n*2 + 48n - 27832289? 2532n2 - 34n + 48 Find the third derivative of 93566000j2m*3 - 2j*2 - jm*2 + 16j - 2028m2 + 118m wrt m. 561396000j2 Find the third derivative of 6u*3v*2 + 4u*3v + 91491u3 - 1359u*2v - 4v2 + 4 wrt u. 36v*2 + 24v + 548946 Find the third derivative of -17102x5 - 8393x4 - x3 - 2059x2 - 523x - 4 wrt x. -1026120x2 - 201432x - 6 Find the first derivative of -70857642h - 60346131 wrt h. -70857642 Find the third derivative of 20023246f*4 - 6f*2 - 6183f - 37. 480557904f What is the second derivative of -46113618j*5 - 77622j - 85 wrt j? -922272360j3 Find the third derivative of -9139396b*3 - 137b*2 - 2272. -54836376 What is the third derivative of -12319361x*3 + 15375791x*2 wrt x? -73916166 What is the derivative of 5243742y*3 + 8525699? 15731226y*2 What is the second derivative of 427798761c*2y*2 + 2cy2 + 93cy + 9y*2 - 19069y - 1 wrt c? 855597522y2 Differentiate -2cdr - 24cd + 5377631c - 31dr + 9004d + 16r with respect to d. -2cr - 24c - 31r + 9004 Differentiate -421193966s + 1058872366 wrt s. -421193966 Find the third derivative of 3b4s - 5b3s - 60744b3 + 6b*2s + 7733s + 8 wrt b. 72bs - 30s - 364464 Differentiate -5c2i*3 - 119568181c*2 + 4648467i*3 wrt i. -15c*2i*2 + 13945401i*2 Find the third derivative of 87913141u*3 - 1739588u*2 + 2u + 8 wrt u. 527478846 Find the second derivative of 1092r4 - 78r*3 + 22r*2 - 2814223r + 2 wrt r. 13104r2 - 468r + 44 Find the second derivative of 314b2m*2 - 2b*2m + 8460b2 + 266bm2 + 15bm - m2 + m wrt b. 628m*2 - 4m + 16920 Differentiate -136564244n - 168061630 with respect to n. -136564244 Find the second derivative of 179285s*2t*2 + 4s*2t + 5s2 + 18455516st2 + 2st - 2t*2 wrt s. 358570t*2 + 8t + 10 Find the third derivative of 120456s3 + 60s*2 + 1117s - 1. 722736 What is the second derivative of 409174h5 - 2h*4 + 4452336h - 2 wrt h? 8183480h3 - 24h*2 What is the third derivative of -45377015q*5 + 189q*2 - 86908? -2722620900q*2 What is the second derivative of 45883263s*3 + 18198629s? 275299578s What is the derivative of 5aw2 - 311856aw - 321603640a + 20w2 - 3w wrt w? 10aw - 311856a + 40w - 3 Find the third derivative of 2744430u5 + u4 - u3 + 78u*2 - 1188995u. 164665800u2 + 24u - 6 Find the second derivative of 22631f5 - 872f*2 + 16f + 1646971. 452620f3 - 1744 Find the second derivative of -122219v*3 - 1253v*2 - 9711366v - 1 wrt v. -733314v - 2506 Find the third derivative of -107i*6 + 30129i*3 - 3126i*2 - 1551. -12840i*3 + 180774 Find the third derivative of -23v*6 - 8v*4 + 16647v*3 - 11810064v*2 wrt v. -2760v*3 - 192v + 99882 Differentiate 9ps*2w - ps2 + 4psw + 10ps - 224983pw + 9p + 2s*2 - 527 with respect to w. 9ps2 + 4ps - 224983p Find the first derivative of 32908485ru + 190315484r wrt u. 32908485r Find the third derivative of 23810972d4 + 17d*2 - 73453 wrt d. 571463328d What is the second derivative of 40645h2mu - 5h*2m + 50h2u - 3h2 - 8hm + 12hu - 40072mu wrt h? 81290mu - 10m + 100u - 6 What is the second derivative of -5083062b*2u*2 + 14321543bu2 wrt b? -10166124u*2 Differentiate 35r*4 - 3239r*3 + 10r*2 + 27789150 wrt r. 140r*3 - 9717r*2 + 20r Find the third derivative of -1478823i3jv2 - 39i*3v3 - i2jv*3 + 14220i*2v*2 - 3ijv*2 + 10iv2 - 4v3 - v2 wrt i. -8872938jv*2 - 234v*3 Differentiate -6221138f*3 + 58086042 with respect to f. -18663414f*2 Differentiate 49299gk2 - 33gx - 5g - 108590k2x - 4k2 wrt x. -33g - 108590k2 What is the first derivative of -52224972v*2 + 130946354? -104449944v What is the third derivative of -73997863d4 - 218168134d*2? -1775948712d What is the third derivative of np6 + 128525np3 + 3np + 1745p*2 - 9 wrt p? 120np3 + 771150n What is the first derivative of -10266264y + 235105765? -10266264 What is the second derivative of 41024925u*2 - 31653u - 127 wrt u? 82049850 Find the third derivative of -5809f6l + 804f6 + 3f*2l - 101f2 + 542fl - 3l + 2 wrt f. -697080f3l + 96480f3 Find the second derivative of -60044552u*5 - 10575u - 902 wrt u. -1200891040u3 Find the second derivative of 296680522o*2 - 966169o + 238. 593361044 Find the second derivative of -46w5 + 2w*4 - 752688w*2 - 24422155w + 4 wrt w. -920w3 + 24w*2 - 1505376 What is the second derivative of 48575693g*2 + 166942g - 2? 97151386 Find the third derivative of 54906825x4 - 193603965x*2. 1317763800x What is the third derivative of -260c5 + 3288c*4 - 3c*3 + 331377c*2 + 5c? -15600c2 + 78912c - 18 What is the derivative of 50fo + 89192f + 556o - 2904 wrt f? 50o + 89192 What is the derivative of k3 + 5467k*2 + 440k + 31347173? 3k2 + 10934k + 440 Find the second derivative of -824722f4 - f3 + f2 - 1473870f - 19. -9896664f2 - 6f + 2 Find the second derivative of 6988795d3r*2 + 5d*3r + 25d3 + 627d*2r - 2d - 34r*4 - 15 wrt r. 13977590d*3 - 408r*2 Differentiate -760gv - 103g + 2061v3 + 260886 with respect to v. -760g + 6183v2 Find the third derivative of u3x*3 + 9614u*3x*2 + 51u*3 + 2u*2x*3 - 9u*2x + 12ux*3 - 3x*3 - 109x + 4 wrt u. 6x3 + 57684x*2 + 306 Differentiate -3893352h*4 - 4955178 wrt h. -15573408h*3 Differentiate 2c*2m3 + c2 - 9689254c - 631287m*3 with respect to m. 6c*2m*2 - 1893861m*2 Find the second derivative of 339c*5 + 943c*2 - 7076989c wrt c. 6780c3 + 1886 Find the second derivative of 18695198j*2z*3 - 2jz3 + 2477jz - 2z*3 + 2z*2 + 2 wrt j. 37390396z*3 Differentiate -1367462o*3w + 2754524w - 3 wrt o. -4102386o*2w Find the third derivative of -355106217g4 - 204660999g*2. -8522549208g Find the second derivative of 9461995b4 + b3 - 11519396b. 113543940b2 + 6b Find the second derivative of -2k5 - 2k*4 + 10402k*2 - 403227k. -40k3 - 24k*2 + 20804 Find the third derivative of 16001329g3 - g2 + 613g - 5926. 96007974 Differentiate 104693op - 809377oq - 46o + 13pq + q wrt q. -809377o + 13p + 1 Find the third derivative of -2p4 + 45338727p*3 - 26404p*2 + p + 118. -48p + 272032362 Differentiate 3436xy*2 + 3xy + 5429053x + 60y2 - 2y wrt y. 6872xy + 3x + 120y - 2 What is the derivative of 8l3 - 3l*2 + 54965l + 38554391? 24l2 - 6l + 54965 What is the second derivative of 382668n4 + 2n*3 + 20n*2 - 175881689n? 4592016n2 + 12n + 40 Find the second derivative of 19778815f2 - 14675798f. 39557630 What is the second derivative of -546d2n*2y - 205188d2ny + 3dn2y - dn + 8dy + 2276n*2 + 14ny + 2n + y wrt d? -1092n2y - 410376ny Find the third derivative of -8857148g3 - 3779g*2 + 228g - 1. -53142888 Find the third derivative of l*3o*3 + 2l*3o*2 + 2l*3 - 13953l*2o + l*2 + 8873970o*3 + 18o*2 wrt o. 6l*3 + 53243820 What is the third derivative of 535660544m*4 - 230103293m*2 wrt m? 12855853056m Find the second derivative of -233726363h3 - 611970h + 36. -1402358178h What is the third derivative of 25021916q*4 - 929q*2 - 8q + 1386 wrt q? 600525984q What is the derivative of -24677893s + 48560353? -24677893 What is the third derivative of 3v5 + 59099546v*3 + 8v*2 + 1442v - 78? 180v2 + 354597276 Find the second derivative of 55254kos*2 + 2ko + 5ks2 + ks + 729k + os*2 + os + 17s wrt s. 110508ko + 10k + 2o Find the first derivative of -588616381a - 891251054 wrt a. -588616381 Differentiate -4nsy - 599819ns - n - 275sy + 2881y + 12 with respect to y. -4ns - 275s + 2881 Find the first derivative of 966aj2y - 2aj*2 + ajy + 12379a - 28952j2y + 15j*2 + j + 2 wrt y. 96	{ "pile_set_name": "DM Mathematics" }
-185. Sort -0.3, h, -5, 1. -5, h, -0.3, 1 Let h = -119 - -115. Put -2, h, -3, 6 in decreasing order. 6, -2, -3, h Let d(t) = t*3 - 3t - 2. Let j be d(-2). Let u = 2 - 1.5. Let n = 4.5 - u. Sort 5, n, j in increasing order. j, n, 5 Suppose -13 = 3z + 5a, -3a = 3z - 0a + 3. Suppose -zt = -2c + 20, -c = 2t + c + 10. Sort -4, 5, t in increasing order. t, -4, 5 Let u = -3.08 + 0.08. Let n = 0.9 - -0.1. Let b = u - n. Put 0, 0.1, b in decreasing order. 0.1, 0, b Let d(c) = c*2 - 7c - 6. Let u be d(8). Suppose 5r + 5i = 6r + 23, 2 = -2r - i. Sort r, u, 0.4. r, 0.4, u Let y = -8.12 - -0.12. Let n = y + 7.45. Let a = n - -0.05. Sort a, 2, 0 in decreasing order. 2, 0, a Suppose 5t = 3o + 13, 4o + 0o = 3t - 10. Let m(q) = q3 - q2 + q + 1. Let z be m(o). Put z, 5, 3 in ascending order. z, 3, 5 Let i = 28 + -31. Sort 11, i, -5 in increasing order. -5, i, 11 Let z(w) be the first derivative of -w3/3 + 3w*2 - 2w + 1. Let l be z(5). Sort -4, l, -5 in descending order. l, -4, -5 Let v = 3 + -9. Put 2, 0, v in decreasing order. 2, 0, v Let n be 1/1 + 1/(-2). Let t = -7.531 - 0.069. Let b = t - -8. Sort b, 1/10, n. 1/10, b, n Let t be 0 + 4 + (-25)/6. Put 0, 0.01, t in descending order. 0.01, 0, t Let c(g) = -g*3 + 20g*2 + 21g - 2. Let y be c(21). Sort -1/9, 5, y in decreasing order. 5, -1/9, y Let w = 113/28 + -23/7. Sort 1, w, 3 in increasing order. w, 1, 3 Let r = 11 - 8. Suppose -t + 0t = r. Let z be (-11)/9 - (0 + -1). Put 0.5, t, z in decreasing order. 0.5, z, t Let i be ((-1)/(-3))/(4/24). Let v be (i/(-3))/(6/27). Sort 1, -2, v. v, -2, 1 Suppose c = x + 4x + 17, -4x = -2c + 16. Put c, -4, 4 in increasing order. -4, c, 4 Let t = 1.55 + 0.15. Let q = t + -1.6. Let u = -0.2 + -0.3. Sort u, -1, q in increasing order. -1, u, q Suppose 0h + h + 19 = -4z, -3z + 4h - 19 = 0. Sort z, 1, -3/2, -2. z, -2, -3/2, 1 Let p be 1543/36. Sort 0.5, -4/5, p in decreasing order. p, 0.5, -4/5 Suppose -a - 8 + 28 = 0. Let m be a/6(-30)/(-25). Let i = 9 - 8. Put 3, m, i in descending order. m, 3, i Let o = -2 + 2.5. Let s(z) = -4z - 11. Let g be s(7). Let j = g + 119/3. Sort o, -2/5, j in decreasing order. j, o, -2/5 Let a = -73.7 - -70. Let i = a - -0.7. Put 3/5, i, 6 in decreasing order. 6, 3/5, i Let i be (-3)/1 - 37/13-1. Sort -0.1, i, 0.08. i, -0.1, 0.08 Suppose 14u = 13u. Sort u, 4, 5. u, 4, 5 Suppose 2n = -3n - 10. Let z be 0 - n - 48/18. Sort z, 2/7, 0 in increasing order. z, 0, 2/7 Let z(p) = -58p + 3 + 13 + 59p. Let w be z(-13). Let u be 22/(-4) - 1/(-2). Sort u, -4, w in increasing order. u, -4, w Let t = 64 + -60. Sort 5, t, 1 in decreasing order. 5, t, 1 Let x be (-2 + 2 - 3)/1. Put x, -5, 2 in descending order. 2, x, -5 Let x be ((-15)/5)/(3/(-46)). Put x, 5, -0.4 in increasing order. -0.4, 5, x Suppose 2q - 9 = -1. Suppose -2r + 0r - qo = -20, 26 = 3r + 5o. Suppose -3 + 1 = rz. Sort 5, -5, z in decreasing order. 5, z, -5 Let l = 9.9 + -16. Let s = -19 - -13. Let z = l - s. Put -4, z, 3 in descending order. 3, z, -4 Let f(h) = h3 + h2 - 2h - 2. Let b be f(-2). Let i(p) = p3 + 4p*2 - 2p - 3. Let u = 6 + -10. Let z be i(u). Sort z, -5, b. -5, b, z Let r = 10 - 3. Let x = 11 - r. Put 1/3, x, 7 in descending order. 7, x, 1/3 Let z = 0.1 - 0.6. Let d = 0 - z. Let v = -61 + 303/5. Put v, 2, d in decreasing order. 2, d, v Suppose -2b - 2b - 16 = 3o, 2b = o - 18. Let n = 12 + b. Suppose 4c + 0c = 0. Put c, n, 1 in increasing order. c, 1, n Suppose n + n - 4 = 0. Let c(i) = -i*2 + 6i + 3. Let x be c(6). Sort 4, x, n in increasing order. n, x, 4 Suppose 4w + 5p = 12, 2w + 12 = 3p - p. Sort 2, -12, w in descending order. 2, w, -12 Suppose f - 5x + 5 = -6, 0 = 2f + x - 11. Let d be -5 + 1/(3/(-3)). Let l be (-6)/(d2/(-8)). Put 1, f, l in ascending order. l, 1, f Suppose -2t - 13 = -a - 3, 4a + 20 = -4t. Suppose a = 4n + 4. Sort n, 3, -4. -4, n, 3 Let p = -63 - -67. Sort p, 0.3, 5 in decreasing order. 5, p, 0.3 Let q = -233 - -231. Let y be (-11)/3 + (-2)/(-3). Sort y, 4, q in ascending order. y, q, 4 Suppose -2j + 0j = -12. Let i be 1/j-13 - -2. Let s be 1 + 26/(-8) - -2. Put -3/4, s, i in decreasing order. i, s, -3/4 Let j = -184291/4756 + -1/1189. Let f = -39 - j. Put f, 0.1, -0.5 in descending order. 0.1, f, -0.5 Let q be -3((-3)/(-6) + 0)1. Put -2/3, q, -1/11 in ascending order. q, -2/3, -1/11 Let m = 17 + -12. Suppose -3v + 3y - 4 = -1, 0 = 2y - 2. Sort m, v, 3 in ascending order. v, 3, m Let u(p) = 17p + 1. Let j be u(-3). Sort -3/2, -0.3, j in descending order. -0.3, -3/2, j Let h = -19 - -14. Sort h, 2, 0. h, 0, 2 Let v be (-15)/(-5) + -4 - -2. Sort 3, -5, v in increasing order. -5, v, 3 Let x = 1.2 + -0.6. Let i = 39 + -35. Put 2/7, i, x in ascending order. 2/7, x, i Let f = 8 + -6. Let r be (-2)/(-1)1-2. Sort 5, f, r in decreasing order. 5, f, r Suppose 1 = -3u + 10. Suppose i - 20 = uy, 5i + y - 11 = 9. Put 1, -2, i in descending order. i, 1, -2 Let l = -18 + 35/2. Sort -1, -2/7, l in descending order. -2/7, l, -1 Let y = 3.95 + 0.05. Suppose a - u - 2 = 0, -6u = -u - 15. Put a, -4, y in increasing order. -4, y, a Let s = 85 + -73.1. Let z = -12 + s. Sort -4, z, -1 in descending order. z, -1, -4 Let a = 6 - 5.6. Sort 0.1, 1/5, a in decreasing order. a, 1/5, 0.1 Suppose 4q = 4r - 8, -4q + 3r - 5r - 20 = 0. Sort -3, q, 1, -2 in decreasing order. 1, -2, -3, q Suppose -b = 4b - 35. Let c = 11 - b. Suppose -z = cz. Sort z, -2, 1 in increasing order. -2, z, 1 Let x = 12 - 8. Suppose -5c - 1 = xm, 3m + 2c + 1 = -5. Suppose 4o = -0 - 4. Sort m, o, -5 in decreasing order. o, m, -5 Let o be 6/(-8) - (-3)/(-12). Put 0, 5, o in decreasing order. 5, 0, o Let z = -0.7 + 4.7. Sort z, -4/7, 23. -4/7, z, 23 Suppose 5i = 3w + 17, w - i + 1 + 4 = 0. Sort -2, 0, w, 4 in decreasing order. 4, 0, -2, w Let g(n) = -n*3 - 4n*2 - 4n - 1. Let i be g(-3). Sort -3, i, -4. -4, -3, i Let j = -0.31 - -0.01. Let b = -22 + 16. Let u be b((-15)/(-27))/(-5). Sort u, -5, j in decreasing order. u, j, -5 Let q be (-2)/(-11) + 4/(-22). Suppose -4h - 4 = -2h. Put q, 5, h in decreasing order. 5, q, h Suppose 0 = f - 4f - 2i - 33, i = 0. Let g = -7 - f. Suppose -k + 0k = 0. Put k, -3, g in descending order. g, k, -3 Let m = -155/9 - -17. Let d = m + 5/9. Put d, -0.4, -2 in descending order. d, -0.4, -2 Suppose -z - 7z + 40 = 0. Put 2, z, -11 in decreasing order. z, 2, -11 Let v = -24 - -70/3. Sort 1, v, -3 in decreasing order. 1, v, -3 Suppose -2b = -0b. Put 5, b, -4 in increasing order. -4, b, 5 Let y = -671/5848 + -1/344. Sort y, -0.3, 2/3 in decreasing order. 2/3, y, -0.3 Let a be -2 - -4 - (-45)/(-25). Sort -2, a, -5 in ascending order. -5, -2, a Suppose -4u - 2k + 4 = -2u, 6 = -5u + 3k. Suppose -2h + 7 = -h + w, 0 = 2w - 4. Let n = h - 3. Put n, u, -2 in decreasing order. n, u, -2 Let r = 0 - -0.02. Let l = 0.38 + r. Let o be ((-2)/(-20))/((-4)/10). Put l, -2, o in descending order. l, o, -2 Let c be 0/((-5 - -2)/3). Let m be (-3 + 0)/(-1 + 2). Let b be m/(-4) - 1/(-4). Sort c, b, 3. c, b, 3 Let i = 1678/15 + -112. Let f be (150/251/(-3))/(-1). Sort i, f, -1/5 in decreasing order. f, i, -1/5 Suppose -5x + 7x = 0. Suppose 3g - 2g + 2 = x. Let r be (-3)/(-4)(g + -2). Put 0, r, -5 in ascending order. -5, r, 0 Let v(w) = w*2 + w + 1. Let q be v(-3). Suppose -2y = -qy + 20. Put y, 1, -1 in decreasing order. y, 1, -1 Let m = 20.1 - -2.9. Sort 2/9, -5, m in decreasing order. m, 2/9, -5 Let m = -0.33 - -0.03. Let u = 5715/8 - 43773/56. Let n = -67 - u. Sort 4, m, n. m, n, 4 Let y = -32 - -22. Put 3/7, -1, y in decreasing order. 3/7, -1, y Let t(a) = 3 - 2a*2 + 2 + 4a - 3 - 2a. Let y be t(2). Let m = 9 + -5. Put y, -0.3, m in ascending order. y, -0.3, m Let q = 174/7 + -25. Sort -0.2, q, -1.9 in descending order. q, -0.2, -1.9 Let r(v) = -v2 + 4v - 3. Let o be r(4). Suppose 0 = -m - 0m + 5. Put m, o, -4 in ascending order. -4, o, m Let j = -30 - -632/21. Let z = -9/14 - -1/7. Sort z, 2, j in ascending order. z, j, 2 Let u be 3/9 + 161/(-6). Let p = 27 + u. Sort 0.2, 3, p in descending order. 3, p, 0.2 Let u be (-21)/9 - (-4)/(-6). Let x be 4/14 - (-2)/(-7). Sort -5, u, x in descending order. x, u, -5 Suppose 3k - 4f = -2f - 6, -4f + 12 = 3k. Put -1	{ "pile_set_name": "DM Mathematics" }
/5 - 37482r2/5 + 613152r/5 - 114615 = 0. -849, -25, 1, 9 Solve -5j2 + 4481840j - 8963660 = 0. 2, 896366 Solve -s*5/4 - 11791s*4/2 - 2819271s*3/4 - 44948363s*2/2 - 80969885s - 59194626 = 0. -23462, -58, -3, -1 Solve 4t4 + 3151t*3 - 864024t*2 + 4452689t - 1059220 = 0. -1004, 1/4, 5, 211 What is o in 5o4 + 42970o*3 + 1028485o*2 + 727760o - 5913300 = 0? -8570, -23, -3, 2 What is j in -3j2/4 - 78081j/4 + 15614811/2 = 0? -26421, 394 Find o, given that 3o3/4 - 1125o*2 + 1111029o/4 + 278883 = 0. -1, 313, 1188 Factor -4d3 - 31225440d*2. -4d*2(d + 7806360) Find j such that j*3 - 1005976j*2 + 21125075j - 20119100 = 0. 1, 20, 1005955 Factor 2z3 + 2700691z*2 + 911715809512z - 455858579929. (z + 675173)*2(2z - 1) Suppose -g5 - 113g*4 + 5g*3 + 68605g*2 - 68044g - 136532 = 0. Calculate g. -107, -29, -1, 2, 22 What is q in 2q3/13 + 20109868q*2/13 - 20109874q/13 - 40219740/13 = 0? -10054935, -1, 2 Determine q, given that 3q4 + 15081q*3 - 3281949q*2 + 176513715q - 173246850 = 0. -5238, 1, 105 Factor -3d2/2 + 2910897d/2 - 5821770. -3(d - 970295)(d - 4)/2 Factor 5f2 + 6361580f + 12723140. 5(f + 2)(f + 1272314) Factor -t*4/3 - 1640t*3/3 + 285923t2. -t2(t - 417)(t + 2057)/3 Let -2k2/9 + 6928888k/9 + 5389146 = 0. What is k? -7, 3464451 Suppose 2n5 + 2678n*4 + 21360n*3 - 13663432n*2 + 337249088n = 0. Calculate n. -1327, -88, 0, 38 Factor -2w3/9 + 3514w*2/3 - 1602080w + 1375473536/9. -2(w - 2584)2(w - 103)/9 Find r, given that r*3/10 - 363883r*2/10 - 2911137r/10 + 3275019/10 = 0. -9, 1, 363891 Suppose -2c4/11 + 18002c*3/11 + 26c*2/11 - 234002c/11 - 216024/11 = 0. What is c? -3, -1, 4, 9001 Solve m*2/3 + 523m + 101916 = 0. -1341, -228 Let 51483k3 - 277884012k*2 - 114554169k - 11805426 = 0. What is k? -27/131, 5398 Factor -t*3/4 - 1227343t*2/4 - 66274335t/4 - 894693681/4. -(t + 27)*2(t + 1227289)/4 Suppose -5t3 - 22870t*2 + 208665t + 11136690 = 0. Calculate t. -4583, -18, 27 Suppose 3r5 - 47496r*4 - 237888r*3 + 5271726r*2 + 31593165r + 26131050 = 0. What is r? -10, -5, -1, 11, 15837 Factor 33s2 + 4782s + 71424. 3(s + 128)(11s + 186) Solve -4p*4/9 + 848614p*3/9 + 848650p*2/9 - 6788896p/9 - 3394472/3 = 0 for p. -2, 3, 424309/2 Solve 2a5/5 + 6415614a*4/5 + 5145022498036a*3/5 + 3087004516968a*2 + 10290006502416a/5 = 0 for a. -1603902, -2, -1, 0 Find t, given that -5t3 + 1750790t*2 - 182041600t + 4732730080 = 0. 52, 350054 Suppose 3x4/2 + 7917x*3/2 + 62766x*2 - 487614x + 692472 = 0. Calculate x. -2623, -22, 2, 4 Determine f so that 2f5/5 - 12f*4 + 416f*3/5 + 108f*2 - 418f/5 - 96 = 0. -1, 1, 15, 16 Factor -240695885686082a2/7 + 175525136a/7 - 32/7. -2(10970321a - 4)*2/7 Let 2d*3 - 643148d*2 + 643146d = 0. Calculate d. 0, 1, 321573 Factor -5w3 - 4683w*2 - 138556w + 56172. -(w + 31)(w + 906)(5w - 2) Factor -z5/2 + 1284z*4 - 1164668z*3 + 436996560z*2 - 57915657800z. -z(z - 910)2(z - 374)2/2 Factor -n2/3 - 2414n - 21699. -(n + 9)(n + 7233)/3 Factor 2t3 + 61046t*2 + 452837840t - 199593630600. 2(t - 417)(t + 15470)*2 Let -2t*4 - 368t*3 - 910t*2 + 31376t - 86880 = 0. Calculate t. -181, -12, 4, 5 Factor -2d2 + 42528d + 127602. -2(d - 21267)(d + 3) Factor -4i2 - 3549264i - 787329683856. -4(i + 443658)2 Solve 4g*2 + 255180g - 13791384 = 0 for g. -63849, 54 Suppose -4k3 - 1544k*2 + 3412548k - 3411000 = 0. Calculate k. -1137, 1, 750 Factor 4b2 + 8004880b - 120074100. 4(b - 15)(b + 2001235) Determine u so that 2u5/7 - 1662u*4/7 + 456700u*3/7 - 42198468u*2/7 + 234047106u/7 + 39529134 = 0. -1, 7, 207, 309 Factor -q*2 + 18165q + 1569586. -(q - 18251)(q + 86) Factor -n2 + 3418089n + 6836182. -(n - 3418091)(n + 2) Factor 2z*2 + 8004z + 4817664. 2(z + 738)(z + 3264) Determine a so that 2a3/3 - 49988a*2/3 + 266408a + 599472 = 0. -2, 18, 24978 Factor 2b2 + 82665862b + 82665860. 2(b + 1)(b + 41332930) Let -c*3 - 1746c*2 - 24293c - 77940 = 0. What is c? -1732, -9, -5 Determine s, given that 4s4 - 162424s*3 + 1653385700s*2 - 92080940000s = 0. 0, 56, 20275 Factor -3g3 - 1440774g*2 - 172987250688g - 345968738304. -3(g + 2)(g + 240128)2 Solve -y2 + 10445y + 198816 = 0 for y. -19, 10464 Factor -2r*2 - 106933994r - 213867980. -2(r + 2)(r + 53466995) Factor 2n3 + 317623098n*2 - 317623100n. 2n(n - 1)(n + 158811550) What is r in 5r*2 - 14482005r + 28963990 = 0? 2, 2896399 Factor -i*2/4 - 962235i/4 + 4089571. -(i - 17)(i + 962252)/4 Let -5x*3 - 960x*2 + 13326815x + 39988950 = 0. Calculate x. -1730, -3, 1541 Solve -2c5/5 + 92c*4 - 1774c*3/5 - 7732c*2/5 + 10776c/5 + 16272/5 = 0. -3, -1, 2, 6, 226 Determine g, given that -3g3 + 55476g*2 - 31419180g + 4519197600 = 0. 290, 17912 Solve 7k4/5 - 6708k*3/5 - 60668k*2 - 3279504k/5 + 192384 = 0. -24, -20, 2/7, 1002 Determine x, given that -x*4 - 784659x*3 - 153952641417x*2 - 11849640411041x + 12003593837118 = 0. -392291, -78, 1 What is a in 2a5/9 + 36946a*4/9 - 481454a*3/3 - 7886722a*2/9 - 11292584a/9 - 1629056/3 = 0? -18512, -3, -1, 44 Let -2d4/11 - 74d*3 - 13208d*2/11 + 21624d/11 + 524160/11 = 0. Calculate d. -390, -16, -7, 6 Suppose -227g2/4 + 1080g - 133/4 = 0. Calculate g. 7/227, 19 Determine z, given that -4z5 + 22436z*4/3 + 713948z*3/3 + 1573564z*2/3 + 882064z/3 = 0. -29, -4/3, -1, 0, 1901 Let 3d4 - 13797d*3 + 19851030d*2 - 9120950976d - 27541884960 = 0. What is d? -3, 1156, 2290 Solve 25k5 + 23090k*4 + 5970760k*3 + 277538000k*2 - 3532622000k + 1368260000 = 0. -430, -74, 2/5, 10 Find p such that -3p3/4 + 5661p*2/4 + 12641499p/4 + 12635835/4 = 0. -1315, -1, 3203 Find g, given that -3g4/4 - 22008g*3 - 322328661g*2/2 + 4201437240g - 109334157075/4 = 0. -14685, 13 Solve v*2/4 - 8301v/4 + 107237 = 0 for v. 52, 8249 Factor -f*3/6 + 6100003f*2/2 - 13953765250004f + 41861286600008/3. -(f - 9150004)*2(f - 1)/6 Factor -6p3/7 - 203792520p*2/7 - 1730474837457102p/7 - 3460948859744172/7. -6(p + 2)(p + 16982709)*2/7 Let 6o*3 + 7682361o*2 + 2459109351672o - 1229556596427 = 0. Calculate o. -640197, 1/2 Factor -o*3/7 - 98o*2 + 66176o/7 - 1498464/7. -(o - 44)*2(o + 774)/7 Determine g, given that g*5/3 - 18g*4 + 995g*3/3 - 2462g*2 + 7116g - 4968 = 0. 1, 6, 18, 23 Determine t so that -6t5/5 - 32t*4 - 258t*3/5 + 696t*2 + 11264t/5 + 1536 = 0. -24, -4, -8/3, -1, 5 Determine w so that 2w2/19 - 17166784w/19 + 36837309112832/19 = 0. 4291696 Let d*5/8 - 15d*4 + 799d*3/2 - 11919d*2/4 + 38563d/8 - 8901/4 = 0. What is d? 1, 9, 23, 86 Factor 4i2 + 1211788i + 24234160. 4(i + 20)(i + 302927) Determine d so that -2d4/3 + 98d*3/3 + 5524d*2/3 - 88048d - 89856 = 0. -52, -1, 48, 54 Factor 4f3/9 - 1104200f*2/9 + 25400464684f/3 + 33869249296. 4(f - 138027)2(f + 4)/9 Factor -5f3 - 710510f*2 + 353335520f - 43851736960. -5(f - 248)2(f + 142598) Determine v so that -3v5 + 23502v*4 - 46983v*3 - 70512v*2 + 187980v - 93984 = 0. -2, 1, 2, 7832 Factor l*3/5 + 105676824l*2/5 + 2791897782681744l/5. l(l + 52838412)2/5 Find p such that 3p*4 + 162750p*3 - 651069p*2 - 1139304p + 1627620 = 0. -54254, -2, 1, 5 Solve 630z2 + 173757z - 33948 = 0 for z. -276, 41/210 Determine k, given that 2k2/9 - 1430k/3 - 141328 = 0. -264, 2409 Solve 9m4/4 + 3341m*3/4 + 7393m*2/4 + 4799m/4 + 369/2 = 0. -369, -1, -2/9 Factor -2q2 - 29631336q - 109752009143112. -2(q + 7407834)2 Solve -4i*5 + 1968i*4 - 1788i*3 - 86752i*2 + 164976i = 0. -7, 0, 2, 6, 491 Factor w*4/2 - 374w*3 + 4063w*2 - 7006w + 6633/2. (w - 737)(w - 9)(w - 1)*2/2 Suppose -2d*4/3 - 19858d*3 - 416948d*2/3 - 277952d - 476480/3 = 0. What is d? -29780, -4, -2, -1 Factor -4s3 + 18796s*2 - 1532840s + 1514048. -4(s - 4616)(s - 82)(s - 1) Suppose -29f*5 - 1551f*4 + 1230f*3 + 22180f*2 - 27336f - 18144 = 0. What is f? -54, -4, -14/29, 2, 3 Find l such that l*2/2 - 7542l + 30160 = 0. 4, 15080 Suppose 4u3/7 - 83248u**2/7 +	{ "pile_set_name": "DM Mathematics" }
= 29 - 1. Let t = n + -24. Factor 1/2g3 + t + 6g + 3g2. (g + 2)3/2 Suppose q + 25 = 4y, 14y - 12y - 5q - 35 = 0. Find z, given that 4/5z*4 + 0z*2 + 2/5z*y + 0z + 2/5z3 + 0 = 0. -1, 0 Let t = -7 - -12. Let f be ((-32)/(-60))/(-1)25/(-60). Factor 0z2 + 0z*4 - fz*t + 0z + 0z3 + 0. -2z5/9 Let h(l) be the third derivative of l8/1176 - 8l7/735 + l6/70 + 4l5/105 - l4/12 - l*2 + 5l. Solve h(j) = 0. -1, 0, 1, 7 Let x(p) = p*3 + 6p*2 - 4p - 8. Let o be x(-6). Let l be 15/6o/70. Solve 2/7a + la2 - 2/7a*3 - 4/7 = 0 for a. -1, 1, 2 Suppose 3k + 2b = 7k - 24, -3k = 3b - 9. Let -1/5n3 + 1/5n*4 + 1/5n*k + 0 + 0n - 1/5n2 = 0. What is n? -1, 0, 1 Let a(h) = -h2 - 1. Let z be (-2)/(-4) + (-3)/2. Let x(g) = -g3 + 2g*2 + g + 2. Let q(u) = zx(u) - 2a(u). Solve q(r) = 0 for r. -1, 0, 1 Let d = 54/25 - -967/50. Let m = 22 - d. Factor mv*3 + 0 + 0v + v2. v2(v + 2)/2 Suppose -4o - 2y + 21 = 7, 10 = 5o - 5y. Suppose 5h = ow - 6, -5h + 4 - 2 = w. Solve -1/2k2 + h - 1/2k = 0 for k. -1, 0 Suppose 0 = -4v + 9v - 45. Let c be -9 + 5 - (-138)/v. Let -8/3 + 98/3x5 + 14x*4 - 146/3x*3 + 16x - cx2 = 0. Calculate x. -1, 2/7, 1 Let v(b) be the second derivative of -b5/3 + 3b*4 + 16b*3/3 + 7b*2/2 - 10b. Let f(r) be the first derivative of v(r). Factor f(i). -4(i - 4)(5i + 2) Let h(f) = -7f*5 + 15f*4 + 17f*3 + 5f*2 - 5f + 5. Let z(a) = -4a5 + 8a*4 + 9a*3 + 3a*2 - 3a + 3. Let y(s) = -3h(s) + 5z(s). Factor y(i). i*3(i - 6)(i + 1) Let t(i) = -i3 + 7i*2 - 7i - 13. Let q be t(5). Let -v + 1/2v4 + 5/2v*2 - qv*3 + 0 = 0. What is v? 0, 1, 2 Solve -4/5j + 6/5j3 + 11/5j*2 - 4/5 - 9/5j4 = 0. -2/3, 1 Let a(j) be the first derivative of j6/9 - 6. Let a(m) = 0. Calculate m. 0 Suppose -1 = f - 13. Determine x, given that 11x3 - 2x*2 + 22x*2 + 69x*4 - fx*5 + 4x - 92x4 = 0. -2, -2/3, -1/4, 0, 1 Let p(v) = -v2 + 5v - 4. Let k be p(3). Suppose -3s = -5o + 22, ko + 2o = 4s + 16. What is c in -2c + 2c2 - s + 0c*2 - 3 = 0? -1, 2 Suppose -3m + 20 = 7m. Solve 0 + 2/9u*3 - 2/9u*4 + 4/9u*m + 0u = 0 for u. -1, 0, 2 Let o(t) = 32t2 + 18t - 14. Let y(r) = -11r2 - 6r + 5. Let c(b) = 3o(b) + 8y(b). Factor c(v). 2(v + 1)(4v - 1) Let v = 2 - 7. Let d = 9 + v. Suppose 0q*3 - 3/2q*2 - q + 0 + 1/2q*d = 0. What is q? -1, 0, 2 Factor -8/3l + 0 - 20/3l2 - 8/3l*3. -4l(l + 2)(2l + 1)/3 Let f(p) be the first derivative of -p6/1080 - p5/180 - p4/72 + 4p*3/3 - 4. Let u(y) be the third derivative of f(y). Let u(l) = 0. Calculate l. -1 Let o be 16/4 + -8 - -7. Let d(x) be the third derivative of 1/54x*4 - 1/27xo + 0 + x2 + 0x - 1/270x*5. Suppose d(y) = 0. What is y? 1 Factor -10o*5 + 1 + 32o*2 - 56o*3 + 48o*4 - 3o*5 - 3o*5 - 9o. -(o - 1)(2o - 1)*4 Find q, given that 24q*2 + 16 - q - 15q - 20q2 = 0. 2 Let y be (-44)/(-6) - (1 + (7 - 4)). Factor -2/3t*5 + 0 - 8/3t*4 - 4/3t*2 - yt*3 + 0t. -2t2(t + 1)*2(t + 2)/3 Let 8/7s - 2/7s*2 - 8/7 = 0. Calculate s. 2 Let m be (16/(-24))/((-2)/21). Let n = -2 + m. Determine p, given that -2p*2 + 125/4p*n + 15p*3 + 0 + 0p - 75/2p4 = 0. 0, 2/5 Suppose -6j + 2j + 8 = 0. Solve 9n*3 - 6n*3 + 2nj - n3 = 0. -1, 0 Suppose 12 = -4y - 0. Let r = -19 + 11. Let h(i) = i3 + 4i*2 - 3i + 3. Let s(m) = -3m3 - 11m*2 + 8m - 8. Let d(f) = rh(f) + ys(f). Factor d(w). w*2(w + 1) Let r = 49 + -49. Let r - 2/7b2 + 2/7b = 0. Calculate b. 0, 1 Find f such that 3/5f3 - 1/5f*2 + 1/5f*4 - 1/5f*5 + 0 - 2/5f = 0. -1, 0, 1, 2 Let w(d) = d3 + d2 - d + 1. Let a(q) = 3q3 - q2 - 6q - 2. Let j(v) = -a(v) + 2w(v). Let k be j(4). Factor 3m*4 + 2m*4 - 2m*5 - 2m3 - mk. -2m3(m - 1)*2 Let f(m) = -2m - 7. Let h(c) = -2c - 8. Let g(n) = 4f(n) - 3h(n). Let k be g(-3). Factor 4v - v + 0v + 6v*k + 3v*4 + 3v*2 + 9v*3. 3v(v + 1)3 Let v(a) = 2a - 9. Let l be v(7). Let k be -2(-2)/(-4) + l. Find j, given that 6j - k + 10j3 - 18j*2 - 2j*4 + 2j + 6j = 0. 1, 2 Let f(p) = -3p*2 - 30p + 75. Let i(s) = 5s2 + 60s - 150. Let z(y) = 11f(y) + 6i(y). Factor z(m). -3(m - 5)2 Let p(d) = 16d*3 + 31d*2 + 8d - 1. Let m(w) = -32w3 - 61w*2 - 16w + 3. Let q(i) = -3m(i) - 5p(i). Factor q(y). 4(y + 1)2(4y - 1) Let l(j) be the third derivative of -2j7/315 + j6/60 + j5/30 - j4/18 + 56j2 - 2. Find r, given that l(r) = 0. -1, 0, 1/2, 2 Solve 1/4b + 1/2b2 + 0 + 1/4b*3 = 0 for b. -1, 0 Suppose -2x + 2 = -d + 6, 0 = x. Let k(h) be the first derivative of h*3 - 1 + 0h*2 + 0h - 3/8hd - 3/10h*5. Find y such that k(y) = 0. -2, 0, 1 Let w(i) = -30i*3 + 170i*2 - 175i - 100. Let b(a) = -a3 + a2 + a. Let g(p) = 5b(p) - w(p). Factor g(k). 5(k - 5)(k - 2)(5k + 2) Let v = -10 + 14. Determine z, given that 174 - 174 - 8z + 36z2 - 48z*4 - vz*3 = 0. -1, 0, 1/4, 2/3 Let j(k) be the first derivative of -8k*5/65 - 2k*4/13 + 2k*3/13 + 4k*2/13 + 2k/13 + 35. Find h, given that j(h) = 0. -1, -1/2, 1 Suppose -2/5m5 + 0m + 2/5m3 - 2/5m*2 + 0 + 2/5m4 = 0. Calculate m. -1, 0, 1 Let a(b) = b2 - 9b - 1. Let l be a(8). Let x be (l/(-30))/(6/5). Find t such that -1/4t*5 + 0 + 1/2t*3 + 0t*2 + 0t*4 - xt = 0. -1, 0, 1 Let b(a) be the third derivative of a*6/210 - 4a*5/105 + 2a*4/21 - 2a*2. Factor b(s). 4s(s - 2)2/7 Let l(b) be the third derivative of b7/105 - b5/10 - b4/6 - 4b2. Find j, given that l(j) = 0. -1, 0, 2 Let d(r) be the third derivative of r5/15 - r4/2 + r2 - 3r. Factor d(c). 4c(c - 3) Factor 16/5g - 8/5 + 2g2. 2(g + 2)(5g - 2)/5 Let v = -5 + 8. Let w*3 + 2w*v - 2w*3 = 0. What is w? 0 Suppose 0f + f = 1. Let t be -1(f - (-12)/(-2)). Factor -5h*3 - 3h*t + 2h*3 - 2h*2 + 2h*4 + 6h5. h2(h - 1)(h + 1)(3h + 2) Let i = 5 + 0. Let u(g) = ig - 1 - 4g + 0g. Let h(r) = r3 + r2 + 2r - 2. Let z(q) = h(q) - 2u(q). What is j in z(j) = 0? -1, 0 Let w be (-1)/925 + (-8 - -11). Let o(s) be the first derivative of -1/6s4 + 1/6s*2 + 2 - ws*3 + 1/18s*6 + 1/15s*5 + 1/3s. Factor o(j). (j - 1)*2(j + 1)*3/3 Let s be 70/(-21) + 3 - 2/(-6). Solve 0x + sx3 + 6/5x*4 + 0 - 4/5x*5 - 2/5x*2 = 0. -1/2, 0, 1 Let n(h) be the third derivative of -2h7/105 - h6/30 + 4h5/15 + 2h*4/3 - 9h*2. Let n(k) = 0. Calculate k. -2, -1, 0, 2 Suppose -6r + 24 = 6. Factor 0 + 1/5s4 - 1/5s*2 + 1/5s*r + 0s - 1/5s5. -s2(s - 1)*2(s + 1)/5 Factor 0 + 0z3 - 8/7z*4 + 8/7z*2 - 4/7z*5 + 4/7z. -4z(z - 1)(z + 1)3/7 Let f(a) be the third derivative of a6/240 + a5/40 + a4/24 + 4a*2. Solve f(h) = 0. -2, -1, 0 Let u(o) be the first derivative of -1/10o*5 - 8 - 3/8o*4 + 0o - 1/2o2 + 1/12o*6 + 5/6o3. Determine k, given that u(k) = 0. -2, 0, 1 Let r(i) be the third derivative of i7/210 + i6/60 + i5/60 - 3i2. Factor r(p). p2(p + 1)*2 Let a be 21/108 - (52/(-16) + 3). Factor -a - 2/3z - 2/9z2. -2(z + 1)(z + 2)/9 Find d such that -8d + 8d3 - 4d*5 + 4d4 + d3 + 3d3 - 4d*2 = 0. -1, 0, 1, 2 Let -3/4j + 0j2 - 1/2 + 1/4j*3 = 0. Calculate j. -1, 2 Let y(k) be the second derivative of 0 - 1/20k*6 + 3/40k*5 + 0k*2 - 1/4k*3 - 2k + 1/8k4. Let y(x) = 0. Calculate x. -1, 0, 1 Suppose 6p + 2p - 16 = 0. Suppose 2/7o*p + 4/7 + 6/7o = 0. Calculate o. -2, -1 Let t be (-1 + 17)/(-4) + 4. Let 9x + tx*3 + 0x*3 - 5x2 + x3 - 3 - 2x = 0. Calculate x. 1, 3 Let b(d) = -3d*2 + 13d + 5. Let p(q) = -3q2 + 14q + 4. Let a(j) = -4b(j) + 5p(j). Factor a(y). -3y(y - 6) Let b(g) = 24g - 408. Let y be b(17). What is z in y - 3/5z*2 + 0z*3 - 1/5z + 4/5z4 = 0? -1/2, 0, 1 Let c(n) be the first derivative of -n4/16 + 7n*3/6 - 49n*2/8 + 4. Factor c(i). -i(i - 7)2/4 Let y be 2/(-4 - 36/(-8)). Factor x3 - 7 - 6x3 + 3 - 2x*y - 2x + 6x2 + 7x*3. -2(x - 2)(x - 1)(x + 1)*2 Let c = 1 + 1. Determine i so that ci - 2 + i*2 + 0 + i - 2i = 0. -2, 1 Let h be -8 + 9 + (-238)/240. Let f(z) be the third derivative of 0z - z*2	{ "pile_set_name": "DM Mathematics" }
8t2 + 7t - 4. Let x(d) = d3 + d2 + 1. Let p(w) = o(w) - 2x(w). Is p(b) a multiple of 15? False Let g = -90 - -8. Suppose 5i - 1 = 9. Is 10 a factor of i/(-8) + g/(-8)? True Suppose 0 = -l - 3, -3l = 4d - 4l - 31. Is 2 a factor of d? False Let g = -10 + 7. Does 15 divide 1/((-9)/96)g? False Does 6 divide (12(-2)/10)/(2/(-55))? True Suppose -k + 16 = -0k. Suppose -5 - k = 3y. Is 12 a factor of 332/14 - 2/y? True Let y be 10/(4/2) + -1. Suppose v - y = 20. Suppose -2g = -4g + v. Is 4 a factor of g? True Let m = -122 - -71. Suppose -2w - 2u = 2w + 142, 0 = -2w + 3u - 59. Let q = w - m. Is 17 a factor of q? True Let i be -102(2/4 - 0). Let z be i(20/6)/(-2). Is 14 a factor of z-21/(-5)? False Let g = 73 + -63. Is g a multiple of 2? True Let q = -89 + 178. Does 17 divide q? False Let j = -1 + 1. Suppose -q - 4x + 54 = j, -38 - 40 = -2q - 2x. Does 17 divide q? True Suppose 0 = 5v + m - 57, 3m = 2v - 15 - 1. Suppose -2k + v = -31. Is 6 a factor of k? False Suppose -5y + 32 = -58. Is y a multiple of 7? False Let p(x) = 4 + 2 - 6x - 4x2 + x3 - 1. Let u be p(5). Suppose j + 0z + 2z - 10 = u, -10 = 2z. Is 18 a factor of j? False Suppose -x - 110 = 4x. Let g = -10 - x. Does 3 divide g? True Let w = -16 - -96. Is 16 a factor of w? True Let u = -11 + 30. Is u a multiple of 7? False Suppose 15 = 5w - 0w. Suppose -5 - 73 = -wq. Does 26 divide q? True Let t be 1(-2 - (-3 - 1)). Let q(a) = -1 + 5 - a*t - 1 + 6a - a3. Does 10 divide q(-4)? False Let v(i) = i3 + 7i2 + 4i + 1. Let z be v(-8). Let x = z + 9. Does 15 divide 12/18 - x/6? True Suppose 2o + 4l = -0l + 268, -271 = -2o - 3l. Suppose -7q + o = -5q. Suppose -s + 86 = 5w - 20, -3w = -s - q. Is 12 a factor of w? False Let i = -34 + 154. Is 12 a factor of i? True Suppose m + 35 = 8. Let l be 2/(2 + m/12). Let v(y) = y3 + 9y*2 + 4y - 4. Is v(l) a multiple of 14? True Suppose -7u + 47 + 37 = 0. Is 11 a factor of u? False Let z = 2 + 3. Suppose -51 = -zl + 174. Is 15 a factor of l? True Let u(p) = -3p - 3. Let a be u(-3). Let t be a/27 + 4/(-18). Suppose 2g - 14 = -tg. Is 3 a factor of g? False Let m(c) = -c3 + 25c*2 + c + 19. Is m(25) a multiple of 4? True Is 8 a factor of 8/(-6)(-3 + -3)? True Let u(a) = a + 10. Let y be u(-6). Suppose -3o - 12 = -2s - 5o, -2o - 12 = -ys. Suppose -sz = -3h - 12, -3z + 2z - 4h = -3. Does 3 divide z? True Does 36 divide (2574/77)/(6/28)? False Suppose j - 880 = -4j. Suppose 17i + j = 21i. Is i a multiple of 14? False Let r = -49 - -84. Is r a multiple of 9? False Let a = -48 - -73. Is 20 a factor of a? False Suppose 2v - 24 = 36. Is v a multiple of 6? True Let d = 7 - -293. Is 12 a factor of d? True Let v(h) = 3h. Let u = -3 - -4. Suppose 4g + 4j + u - 53 = 0, -j - 3 = -g. Does 16 divide v(g)? False Suppose 2y - 5c + c - 88 = 0, 0 = 4c + 16. Is y a multiple of 12? True Suppose -5k - 166 = 149. Let w = -21 - k. Is w a multiple of 14? True Suppose -4j - 2h - 5 = 3, 0 = -h. Let f = j - -4. Suppose -5 + 33 = fn. Is n a multiple of 7? True Let m(x) = -5x - 7. Let v(i) = i + 4. Let u = 22 - 31. Let h be v(u). Is m(h) a multiple of 9? True Let w = 229 - 125. Is 37 a factor of w? False Let i(q) = 0q*2 + 1 - 4q + 0 + 3q2 - 4. Suppose 13 = -4v + c, -1 = -c + 4. Is 7 a factor of i(v)? False Let p = 42 + 2. Is p a multiple of 12? False Is 3 a factor of (-9)/(0 + -1) - -3? True Let y(a) = -7a2 + a - 10 + 3a*2 + 5a2. Is 23 a factor of y(-8)? True Let c(d) = d2 + 3d + 3. Let k be c(-3). Suppose k = 3w - 6. Let q(a) = 2a2 - 4a + 1. Does 7 divide q(w)? True Let j(n) = 13n2 - 7n - 14. Is 22 a factor of j(-5)? False Suppose 2p - 12 = 16. Is 14 a factor of p? True Suppose -5 = 2t - 4r - 13, -3r - 11 = -4t. Suppose 5l - 35 - 10 = tu, -3l + 3u + 27 = 0. Is 9 a factor of l? True Let c(o) = 2o*2 + 4o - 17. Is 18 a factor of c(-9)? False Suppose -162 = -2n - 5x, 0n + 4x - 439 = -5n. Suppose 3i - 2d = -97, 4i - d + 6d + n = 0. Let l = 44 + i. Is l a multiple of 13? False Let y(d) = -7d*3 + 2d*2 - 4d + 3. Let j be y(2). Let h = -34 - j. Is 11 a factor of h? False Let s(p) = -p*3 + 5p*2 - 2p - 5. Let q = 0 + 4. Let o be s(q). Suppose 5a + 0a - 226 = -oc, 4a - 3c - 170 = 0. Is a a multiple of 22? True Let d = 143 - 27. Is 10 a factor of d? False Let j = 730 - 327. Is j a multiple of 13? True Let o be ((-246)/22 - 1) + 34/187. Let n be (-1 - -1 - -3)/(-1). Let c = n - o. Does 4 divide c? False Let i(o) = -o3 + 19o*2 - 18o - 10. Is 13 a factor of i(17)? False Let c be 2/8 - 379/(-4). Suppose x + c = 6x. Is x a multiple of 6? False Suppose -3t + 36 = -9. Is 8 a factor of t? False Suppose -q + 3u + 38 = 0, 0q = 5q + u - 110. Is q a multiple of 23? True Suppose 4a = a + 180. Let g be (a/25)/((-2)/(-40)). Let t = g + -28. Is t a multiple of 20? True Let j = 62 + -28. Suppose n = -3h + 5, -3h + 7n = 2n - 11. Let s = j - h. Is s a multiple of 16? True Suppose -16 = 2c - 20. Is 50c/63 a multiple of 15? False Let j(d) = -d3 + 6d*2 - 6. Let k be ((-3)/(-6))/((-2)/(-24)). Let c be j(k). Let p = c - -28. Is p a multiple of 10? False Let h = 11 + 7. Does 3 divide h? True Let n(q) = 5q - q*3 - 4q*2 + 4 - 6q*2 - 4q + 9q. Let v be n(-11). Suppose -h + 2h = v. Does 8 divide h? False Let a(i) = 2i + 4. Does 12 divide a(10)? True Suppose -k = -6k + 5. Let b(y) = y*2 - 2y + 1. Let l be b(k). Suppose 2o + 9 - 63 = l. Is 13 a factor of o? False Let u(p) = 44p - 2. Does 30 divide u(2)? False Let m be 4/(3 + -1) + 1. Suppose 2n - 180 = -mn. Is n a multiple of 18? True Let p = -80 + 194. Is p a multiple of 19? True Suppose -14q = -17q + 6. Suppose -3x = -4r - 29, -4x = r - 0x + 12. Does 6 divide q/4-3r? True Let u(f) = 6f. Suppose 2 + 0 = 2w. Is 3 a factor of u(w)? True Let l(i) = 0i - 3 + 3i - 2i + 6. Let r be l(-10). Let x(n) = -n + 8. Is 15 a factor of x(r)? True Suppose -2r + 5d + 21 = 0, -11 - 8 = -2r + 3d. Is r a multiple of 2? True Let b(m) = -m2 + 9m + 13. Let v(w) = w*2 - 3w - 8. Let x be v(6). Let f be b(x). Suppose fc + 50 = 5c. Does 15 divide c? False Suppose -4j = 2j - 6. Let y(b) = 35b2 + b. Is 18 a factor of y(j)? True Let l(o) be the third derivative of o6/120 + 3o*5/20 + 7o*4/24 + 5o3/6 - o2. Let x be l(-7). Suppose k = -2k + x. Is 10 a factor of k? False Let u be (0 + -15)3/(-9). Let s(l) = l*3 - 6l*2 + 6l - 6. Let d be s(u). Is 176/5 - d/(-5) a multiple of 15? False Let y(x) = -14x3 + 2x*2 - 1. Let g be y(-1). Suppose -3n = -g, -l + 3 = -0l - 4n. Does 13 divide l? False Suppose z + 4z - 150 = 0. Is 111210/z a multiple of 23? False Let s(q) = -6q + 6. Is 16 a factor of s(-7)? True Let u be (-24)/10 + 4/10. Let p = 1 + u. Does 5 divide 21p1/(-3)? False Let g = 14 + 17. Is 10 a factor of g? False Suppose 0 = -y - 3y + 84. Let q = y - 7. Is 3 a factor of q? False Let r(q) = -q3 - 7q*2 - 14q + 5. Does 13 divide r(-9)? False Suppose m - 4q - 22 = -0m, 2q + 102 = 4m. Suppose 0x + 2x - m = 0. Is 11 a factor of x? False Suppose 3r = 3g + 4r - 48, 0 = -3g + 5r + 30. Is 15 a factor of g? True Suppose 10u = 4u - 228. Suppose -28 = 2h + j - 3j, j = 0. Let c = h - u. Is c a multiple of 12? True Suppose -5c - b + 76 = 15, 0 = -2c + b + 23. Let x be (-3)/(29/c). Is x/8 + (-74)/(-8) a multiple of 4? False Let h(a) = -1 - 7a2 - 2a + 2a3 - 3 + a. Let i be h(5). Suppose j - 4b - i = 0, -2j + 56 = -j + b. Is 21 a factor of j? False Let v = -4 + 2. Let x be (-2)/(v3/(-36)). Is (-141)/x + 3/(-4) a multiple of 7? False Let i be (1 - 0)6/2. Suppose 0 = 5t - i - 17. Is 2 a factor of t? True Let i = -276 - -548. Does 43 divide i? False Let z = 54 - 33. Suppose 12 + z = 3s. Does 11 divide s? True Let p(a) = a2 + 7a. Let x be p(-5). Let y be 4/(-10) + (-44)/x. Suppose yl - 10 - 14 = 0. Is l a multiple of 6? True Suppose -3z + 41 = -5q - 0q, -5z + 3q + 63 = 0. Let v be -1932/z. Is 11 a factor of (-1)/4 - 462/v? False Suppose -y - 15 = 2y + 3i, 15 = -3i. Suppose -5t - 5 = -5v, 0v + t = 4*v + 2. Does 13 divide 26 - 0/(y + v)? True Let f be (3/1)/(1/(-1)). Let d = f + 3. Suppose d = v - 20 - 24. Does 16 divide v? False Let a	{ "pile_set_name": "DM Mathematics" }
he third derivative of -3l - 1/6l*3 - 1/24l*4 - 12l*2 + 0. Let w(i) = 4i + 5. Determine -11b(y) - 2w(y). 3y + 1 Let y(d) = -9d - 26. Let n(g) be the first derivative of 7g2 + 39g + 3192. What is -5n(r) - 8y(r)? 2r + 13 Let b(f) = 7f*3 + 64f. Let m(y) = 2y3 - y + 1. Give b(k) - 2m(k). 3k3 + 66k - 2 Let h(i) = 394i - 166. Let v(f) = -79f + 36. Calculate 3h(l) + 14v(l). 76l + 6 Let n be ((-41722)/552 + 76)/(1/12). Let q(m) = m2 - m. Let x be (6/4)/(1/(-2)). Let k(i) = 3i*2 - i. Give nq(j) + xk(j). -4j*2 - 2j Let x(g) = -24g3 - 5g*2 + 5g - 5. Let i(m) = m3 - m2 + m - 1. Let z be (-3 - 120/(-15))/(-1). What is zi(j) + x(j)? -29j*3 Suppose 1291y + 40 = 1301y. Let u(g) = -3g3 - g2 - 2g - 2. Let c(w) = -4w3 - w2 - 3w - 3. Give yc(j) - 6u(j). 2j*3 + 2j*2 Let z(j) = 2j*3 + 3j*2 + 3. Let a(v) = 8v*3 + 11v*2 + 11. Suppose 18h = -8h + 572. Let g = -2 - 9. Let c = g - -5. Determine ca(q) + hz(q). -4q*3 Let r(x) = -22x + 4. Let t(y) = -32 + 43 - 87y + 22y. Give -11r(c) + 4t(c). -18c Let f(h) = -343h + 11 - 418h + 2h*2 + 772h. Let g(v) = -v*2 - 7v - 7. Determine -5f(x) - 8g(x). -2x2 + x + 1 Let n(m) = -41m - 102. Let v(f) = -15f - 37. Let u(h) = 4n(h) - 11v(h). Let w(o) = -2o*2 - 12o + 3. Determine 3u(q) + w(q). -2q*2 - 9q Let i(c) = -3c2 - 55c. Let w(u) = -u - 12. Let g be w(-19). Let n(t) = -2t2 - 37t. What is gn(o) - 5i(o)? o*2 + 16o Let r(p) = 8p2 - 5p - 19. Let g(c) = -3c2 + 3c - 2. Give -6g(m) - 3r(m). -6m2 - 3m + 69 Let a(l) = -3l2. Let d(r) = 4r*2. Suppose 0 = -8g + 81 + 287. Suppose -g = -5p - 1. Suppose -5v + 16 + p = 0. Determine vd(m) + 6a(m). 2m2 Let g(r) = -16r*3 + 4. Let s = 13249 + -13248. Let n(k) = 1. Give sg(p) - 3n(p). -16p*3 + 1 Let t(c) = -295c - 84. Let n(j) = -73j - 19. Give -9n(b) + 2t(b). 67b + 3 Let y(l) = 20l2 + 17l + 11. Let t be 1392/(-36) - (-8)/(-6). Let r = 46 + t. Let a(j) = 7j2 + 6j + 4. Let u = 336 - 353. Give ry(m) + ua(m). m*2 - 2 Let i(x) = -2x + 1. Suppose 0 = 11v - 145 + 90. Let r(s) = -1 - 13 + 3 + v + 5. What is i(g) + 2r(g)? -2g - 1 Let q(c) = 5 + 3 - 4 - 3. Let y(x) = 11 - 26 - 7 - 17 - 5 + 11x. Determine 44q(z) + y(z). 11z Let d(c) = 1749c3 + 2c - 5. Let q(o) = -10490o3 - 13o + 31. What is -13d(n) - 2q(n)? -1757n3 + 3 Let f(o) = -346o + 51. Let g(a) = -169a + 24. Determine 6f(x) - 13g(x). 121x - 6 Let p(s) = 5s2 - 7s + 8. Let q(h) = 4h2 - 8h + 9. Let z = -7687 - -7681. What is zp(y) + 5q(y)? -10y2 + 2y - 3 Let g(n) = -2n + 6n - 2n - 2. Let l(x) = -3x + 3. Let q(h) = -2 - 5h2 - 7 + 6h*2 - 6 - 4h. Let m be q(-2). Give ml(a) - 4g(a). a - 1 Suppose 2m - 16 = -4z + 2, 2m + 6 = 0. Let i(v) = 0 - z + 232v - 231v + 2. Let y(t) = -t + 3. Calculate 5i(w) + 6y(w). -w - 2 Let k(u) = -1056u*3 + 65u*2 + 5u + 10. Let v(x) = 1054x3 - 78x*2 - 6x - 12. Determine 6k(a) + 5v(a). -1066a3 Let x(h) = h + 2. Let u = -27193 + 27194. Let w(s) = 1. Give ux(d) + 3w(d). d + 5 Let p(s) = -2s*3 + 10s*2 - 3s + 2. Let f(k) = -k*2 + k. Let q = -6414 - -6419. What is qf(x) + p(x)? -2x3 + 5x*2 + 2x + 2 Suppose -6 = -3j, -4k - 2j - 18 = -j. Let x(c) = -8c - 22. Suppose 7v + 22 = 106. Let g(r) = -3r - 9. Give kx(q) + vg(q). 4q + 2 Let f(a) = 2a*3 - 46a*2 + 24a + 5. Let v(j) = -6j3 + 92j*2 - 42j - 9. What is 7f(n) + 4v(n)? -10n3 + 46n*2 - 1 Let f(n) = 71n - 7815. Let g be f(110). Let h(r) be the first derivative of r*3 - 10r - 2. Let p(m) = -7m2 - m + 21. What is gh(w) - 2p(w)? -w2 + 2w + 8 Let t(y) = -3090y2 - 3096y*2 + 13y + 27 + 6184y2. Let q(m) = -m2 + 4m + 9. What is 7q(z) - 2t(z)? -3z2 + 2z + 9 Let b(d) = -46d2 - 2d + 2. Let i(r) be the third derivative of -1243r5/60 - 55r*4/24 + 55r*3/6 - 28r*2 - 7r + 6. What is -55b(y) + 2i(y)? 44y2 Let d = 30 - 28. Let s(c) = d + 4c*2 - 3 - c - 5c*2 + 2c. Suppose 0 = -8y + 3y - 5. Let q(u) = -6u + 5. Determine yq(v) - 5s(v). 5v*2 + v Suppose 41 + 74 = -3g - 5u, 0 = -2u + 8. Let i be ((-30)/g)/(3/(-9)). Let k(j) = 2j2 - 2. Let p(a) = -3a*2 + 5. Give ip(n) - 5k(n). -4n2 Let n(k) = k3 + 2k2 + k + 1. Let q(b) = -17b*3 - 9b*2 - 6b - 7. What is 14n(d) + 2q(d)? -20d3 + 10d*2 + 2d Let b(p) = 82p + 13. Let o(n) = 165n + 29. What is -5b(f) + 2o(f)? -80f - 7 Let v(u) = -5u*2 - 7u + 2. Let d(o) = -13o2 - 5o + 13. Let x(m) = -2m2 - m + 2. Let n(h) = -d(h) + 6x(h). Determine 3n(l) + v(l). -2l*2 - 10l - 1 Let m(t) = -3019t3 + 7t*2. Let b(z) = 4528z*3 - 10z*2. What is 5b(f) + 7m(f)? 1507f3 - f2 Let y(r) = -4r2 - 118r - 29. Let h(o) = -8o2 - 236o - 63. Calculate 6h(c) - 13y(c). 4c2 + 118c - 1 Let k(f) = -25f - 4. Let o(p) = 33p - 30. Let c(y) = 19y - 17. Let u(n) = 7c(n) - 4o(n). Calculate k(v) + 3u(v). -22v - 1 Let m(z) = -899z*2 + 2z - 90. Let v(o) = o*2 + o - 23. Calculate m(c) - 4v(c). -903c2 - 2c + 2 Let z(i) = 357i2. Let c(y) = 51y*2. Suppose -4d + 24 = 0, -5s + 5d + 57 + 83 = 0. Determine sc(b) - 5z(b). -51b2 Let i(o) = -o3 - o2 + o. Let c(q) = 5q*2 + 1. Let y(t) = -25t*2 + 3t - 3. Let d(p) = -4c(p) - y(p). Give -d(n) - 4i(n). 4n3 - n2 - n + 1 Let s(h) = -2h*3 + 2. Let b(l) = 19l*3 - 4l*2 - 28l - 18. What is b(k) + 9s(k)? k3 - 4k*2 - 28k Let m(h) = 43. Let l(d) = -408d + 255. Determine l(u) - 6m(u). -408u - 3 Let k(b) = 6b. Let p(j) = 355j - 6. Give -9k(l) + p(l). 301l - 6 Let w(o) = -475o - 9. Let h(x) = -13x + 2. Give -3h(j) - w(j). 514j + 3 Let p(q) = 631q*3 - 3q*2 + 3. Let r(i) = 10724i*3 - 52i*2 + 52. What is 104p(y) - 6r(y)? 1280y3 Let b(h) = -h2 - h. Let c(l) = -17l2 - 3l. Suppose -12w - 138 = -35w. Give wb(d) - c(d). 11d*2 - 3d Let r(y) = -2y - 2. Let h(j) = -j2 - 4. Let f(g) = -h(g) + r(g). Let n = 13 + -9. Let o(a) = 2a*2 - 3a + 3. Give no(s) - 6f(s). 2s2 Let n(m) = 115m + 42. Let i be n(2). Let p(c) = ic - 552c + 275c. Let z(d) = -21d. Give -26p(r) + 6z(r). 4r Let f(l) = 54l*2 + 27. Let n(s) = 2s*2 - 1. Give -f(z) + 4n(z). -46z2 - 31 Let a(w) = -4w*3 + 4w*2 - 4w + 11. Let u(t) = -4t3 + 5t*2 - 5t + 13. Determine 6a(d) - 5u(d). -4d3 - d2 + d + 1 Let r(v) = -85v*2 + 127v - 17. Let u(c) = 20c2 - 31c + 4. Determine -2r(y) - 9u(y). -10y2 + 25y - 2 Let r(t) be the first derivative of 0t + 1/2t*2 + 78. Let h(b) = -12b. Give -4h(l) - 40r(l). 8l Let f(i) = 657i + 5. Let s(p) = -9874p - 76. Determine -92f(d) - 6s(d). -1200d - 4 Let d(y) = -y + 2. Let a(i) = -35i2 - 2i + 2. Determine a(h) - 3d(h). -35h*2 + h - 4 Let l(m) = -7m*3 - 5m*2 + 18m + 230. Let c(v) = 15v3 + 11v*2 - 39v - 460. Give -6c(a) - 13l(a). a3 - a2 - 230 Let u(q) = 2 + 2q3 - 3q*3 + 3q*2 + 2 - 4q. Let s(l) be the first derivative of -1/2l4 - 9/2l*2 + 7/3l*3 + 9l + 71. Calculate 3s(x) - 7u(x). x*3 + x - 1 Let o(v) = -4v + 3. Let i be (6 + 3 + -7)/(78/66 + -1). Let l(h) be the first derivative of h*2 - 2h + 4. What is il(k) + 6o(k)? -2k - 4 Let b(w) = 2w*3 - 56w*2 + 9w - 10. Let y(c) = 2c3 - 27c*2 + 5c - 6. Determine 3b(s) - 5y(s). -4s3 - 33s*2 + 2s Let x(z) = 4z3 - z2 + z - 1. Let o(i) = -9i*3 + 40i*2 - i + 6. Give -o(q) - 3x(q). -3q3 - 37q*2 - 2q - 3 Let r(v) = -24v2 - 3. Let a(z) = -47z*2 - 5. Let l(y) = 3y*2 - 342y + 2240. Let s be l(107). Give sr(m) + 4a(m). -20m2 + 1 Let q(u) = -91u*2 + 35u. Let m(n) = -52n2 - 2n + 12. Let d(r) = 111r2 + 5r - 26. Let l(z) = 6d(z) + 13m(z). What is 35l(j) - 4q(j)? 14j2 Let s(o) = -19o*3 + 170o*2 - 6o. Let t(j) = -3j3 - j. What is -s(d) + 6t(d)? d*3 - 170d*2 Let g(j) = 18j + 2. Let y(d) = -41d - 312. Calculate 2g(w) + y(w). -5w - 308 Let j(r) = 2r*2 - 234r + 21. Let n(k) = k + 9. Determine -j(h) + 2n(h). -2h*2 + 236h - 3 Let r(a) = -20144a3 + 6a + 21. Let w(t) = -60432t3 + 16t + 56. Calculate 8r(c) - 3w(c). 20144c3 Let z(a) be the first derivative of 5a*4 + 2a*3 - 3a**2 -	{ "pile_set_name": "DM Mathematics" }
? 2 What is the hundred thousands digit of 590640153? 6 What is the tens digit of 179389133? 3 What is the millions digit of 443692296? 3 What is the units digit of 452475085? 5 What is the thousands digit of 32439901? 9 What is the units digit of 71512728? 8 What is the hundred thousands digit of 324805400? 8 What is the ten millions digit of 840368845? 4 What is the millions digit of 49449465? 9 What is the hundred millions digit of 926439243? 9 What is the units digit of 47153762? 2 What is the ten millions digit of 203924673? 0 What is the hundred thousands digit of 2358419605? 4 What is the hundreds digit of 4680915? 9 What is the ten millions digit of 919902529? 1 What is the hundred millions digit of 199266281? 1 What is the tens digit of 57121895? 9 What is the millions digit of 259537719? 9 What is the millions digit of 51607301? 1 What is the hundred millions digit of 396116598? 3 What is the thousands digit of 451878209? 8 What is the hundred thousands digit of 358601090? 6 What is the ten millions digit of 199197038? 9 What is the millions digit of 166953276? 6 What is the units digit of 57087220? 0 What is the hundreds digit of 135909273? 2 What is the hundred thousands digit of 55694725? 6 What is the ten thousands digit of 223558757? 5 What is the units digit of 83148040? 0 What is the tens digit of 52830650? 5 What is the hundred thousands digit of 19695852? 6 What is the hundred thousands digit of 5971474862? 4 What is the hundred millions digit of 356837937? 3 What is the ten millions digit of 91223800? 9 What is the hundreds digit of 58295116? 1 What is the ten thousands digit of 25840466? 4 What is the hundred thousands digit of 9492224? 4 What is the units digit of 3579384095? 5 What is the millions digit of 2800199? 2 What is the ten millions digit of 87422811? 8 What is the ten thousands digit of 36833983? 3 What is the ten thousands digit of 32305404? 0 What is the hundred millions digit of 1344512201? 3 What is the hundred thousands digit of 59066778? 0 What is the ten thousands digit of 295385295? 8 What is the units digit of 557559394? 4 What is the hundred thousands digit of 97043007? 0 What is the units digit of 3299904484? 4 What is the millions digit of 2512511165? 2 What is the units digit of 78420455? 5 What is the millions digit of 53024382? 3 What is the millions digit of 251982382? 1 What is the hundred millions digit of 4246363725? 2 What is the millions digit of 49822357? 9 What is the ten thousands digit of 446294592? 9 What is the tens digit of 910867792? 9 What is the hundred millions digit of 2562439999? 5 What is the units digit of 63244123? 3 What is the ten thousands digit of 1262777973? 7 What is the hundred thousands digit of 4225924895? 9 What is the tens digit of 2660293687? 8 What is the ten thousands digit of 35608328? 0 What is the hundred millions digit of 1821114652? 8 What is the hundred millions digit of 723414403? 7 What is the units digit of 348117881? 1 What is the ten millions digit of 11023215? 1 What is the hundred millions digit of 136054342? 1 What is the thousands digit of 99813786? 3 What is the hundred thousands digit of 67139942? 1 What is the units digit of 83092965? 5 What is the units digit of 12510769? 9 What is the hundreds digit of 80124333? 3 What is the thousands digit of 614371959? 1 What is the thousands digit of 469978453? 8 What is the units digit of 11488816? 6 What is the millions digit of 415254374? 5 What is the units digit of 16537350? 0 What is the units digit of 413665993? 3 What is the tens digit of 51709428? 2 What is the tens digit of 166771840? 4 What is the tens digit of 9675016? 1 What is the millions digit of 57568368? 7 What is the ten thousands digit of 7344229? 4 What is the ten millions digit of 348564587? 4 What is the millions digit of 868112498? 8 What is the ten millions digit of 61323042? 6 What is the ten thousands digit of 61573794? 7 What is the ten millions digit of 436717803? 3 What is the ten millions digit of 360957322? 6 What is the hundred millions digit of 334666959? 3 What is the hundreds digit of 274081371? 3 What is the hundreds digit of 38888481? 4 What is the hundred thousands digit of 16940473? 9 What is the hundred thousands digit of 299928906? 9 What is the tens digit of 2013604497? 9 What is the hundred thousands digit of 77621875? 6 What is the thousands digit of 102778429? 8 What is the hundreds digit of 51290598? 5 What is the millions digit of 511603081? 1 What is the ten millions digit of 446367015? 4 What is the millions digit of 52392575? 2 What is the hundred thousands digit of 10652689? 6 What is the ten thousands digit of 152660845? 6 What is the ten thousands digit of 4459194? 5 What is the units digit of 60635708? 8 What is the units digit of 119855716? 6 What is the tens digit of 317755802? 0 What is the hundred thousands digit of 46001806? 0 What is the millions digit of 437218012? 7 What is the ten thousands digit of 38403762? 0 What is the ten millions digit of 174611353? 7 What is the millions digit of 30771437? 0 What is the thousands digit of 10253306? 3 What is the ten thousands digit of 70604293? 0 What is the tens digit of 84807069? 6 What is the units digit of 9149286004? 4 What is the hundred millions digit of 171223131? 1 What is the hundreds digit of 111975887? 8 What is the units digit of 1741577720? 0 What is the hundred thousands digit of 27244008? 2 What is the thousands digit of 28075581? 5 What is the hundred thousands digit of 7043856715? 8 What is the thousands digit of 230890754? 0 What is the ten millions digit of 244831494? 4 What is the tens digit of 545222294? 9 What is the hundreds digit of 10189948? 9 What is the tens digit of 8018954? 5 What is the hundred millions digit of 630757446? 6 What is the units digit of 169411865? 5 What is the hundred thousands digit of 1550619843? 6 What is the hundred thousands digit of 230058763? 0 What is the tens digit of 78766451? 5 What is the thousands digit of 137730194? 0 What is the tens digit of 62407031? 3 What is the thousands digit of 159628929? 8 What is the ten thousands digit of 229099814? 9 What is the thousands digit of 67387744? 7 What is the units digit of 949766820? 0 What is the hundred millions digit of 115804106? 1 What is the ten thousands digit of 191132948? 3 What is the hundreds digit of 49929849? 8 What is the ten millions digit of 311178763? 1 What is the ten millions digit of 6103471287? 0 What is the ten millions digit of 161141435? 6 What is the hundreds digit of 290101146? 1 What is the millions digit of 24740539? 4 What is the billions digit of 8146504102? 8 What is the hundreds digit of 563224285? 2 What is the units digit of 6868418856? 6 What is the hundred thousands digit of 2962741711? 7 What is the hundreds digit of 519082838? 8 What is the hundred millions digit of 332776889? 3 What is the millions digit of 1138917516? 8 What is the hundreds digit of 45491758? 7 What is the units digit of 4112971347? 7 What is the ten millions digit of 54177427? 5 What is the hundred millions digit of 5521730664? 5 What is the hundred millions digit of 875653082? 8 What is the billions digit of 1760508692? 1 What is the thousands digit of 388371311? 1 What is the thousands digit of 287202923? 2 What is the hundred thousands digit of 201893459? 8 What is the billions digit of 1429554852? 1 What is the hundred thousands digit of 850184136? 1 What is the hundred thousands digit of 2649268816? 2 What is the millions digit of 29860192? 9 What is the hundred thousands digit of 547391675? 3 What is the tens digit of 151117080? 8 What is the hundred thousands digit of 318901957? 9 What is the millions digit of 90683006? 0 What is the hundred thousands digit of 645138472? 1 What is the ten millions digit of 159075269? 5 What is the hundreds digit of 49981990? 9 What is the millions digit of 36334021? 6 What is the hundred millions digit of 324710592? 3 What is the hundreds digit of 85093471? 4 What is the hundred millions digit of 3957719741? 9 What is the hundreds digit of 184815054? 0 What is the tens digit of 95856114? 1 What is the ten thousands digit of 1018078543? 7 What is the hundreds digit of 369836956? 9 What is the units	{ "pile_set_name": "DM Mathematics" }
3). -7w4 Expand s2 + s3 - s2 + (7s - 2s - 2s)(s2 + s - s) - 5s*3 - 3s*2 + 7s*3 + 2s*2. 6s3 - s2 Expand (-n + 3n - 5n - n*2 - 2)(-2n2 + 2n - 2n). 2n*4 + 6n*3 + 4n*2 Expand (-1 + 2m*3 + 1)(13 - 15m2 + 9m*2 + 4m*2). -4m*5 + 26m*3 Expand -7f + 15f4 + 7f + (2 - 1 + 1)(f4 - 5f*4 + 3f*4). 13f*4 Expand (18g*2 + 3g*2 + 10g*2)(0g2 + 2g*3 + 0g*2). 62g*5 Expand 1455 - 1455 + 92n + (0n - n + 0n)(-4 - 1 + 4) + 2n + 4 - 4. 95n Expand (-4r3 - r4 + 4r3)(0r - 3r - 2r). 5r5 Expand -t5 + 2t5 - 2t*5 + (t + 2t*2 - t)(-2t3 + t3 - t3) + 6t*2 - 6t*2 - 2t*5 - 29t*3 - 13t*5 + 29t*3. -20t*5 Expand (12u - 2u - u)(4 + 6u3 - 4)(3u + 3u - 4u). 108u*5 Expand (-1 + 3 + 2)(325 - 325 - 13c + (-c + 2 - 2)(-5 + 4 + 0)). -48c Expand 3 - 2o*3 - 3 + (5o*2 - 4o*2 - 2o*2)(-o - o + o) - 6 + 6 + 4o3. 3o*3 Expand ((-2f + 3f + 0f)(1 - 2 - 6) + 0 + 2f + 0)(-1 + 3 - 3). 5f Expand 9 - 4 - 42z2 + 38z*2 + (z + 4z - 3z)(0 + 0 - 2z). -8z*2 + 5 Expand 6j*5 - 3j*5 + 3j5 + (-j2 - 2j2 + 0j*2)(j*3 - 4j*2 + 4j*2). 3j*5 Expand (0w*3 + 2w3 + w3)(3w*2 - 7w*2 - 2w*2). -18w*5 Expand (2o*2 - 5o*2 + 1 - 4)(1 + 0 + 1)(-3o - o + 6o). -12o*3 - 12o Expand -1 - 5x4 + 1 + (6x*3 + 3x*3 - 2x*3)(-x + 3x - 3x). -12x4 Expand (3t + 0t - t)(2t2 - 2t2 + t2) - 12t2 + 26t2 + t3 + 0t3 + (-1 + 1 - 2t)(t2 - 3 + 3). t3 + 14t*2 Expand ((-2 - 1 + 4)(-2u - 3 + 3) - 9 - u + 9)(-u - 5u + 3u) + 3u - 2u*2 - 3u. 7u2 Expand (0 - 2j*2 + 0)(j + 3j - 5j) + (-j*2 + 3 - 3)(j - 2j + 2j) + j - 2j3 - j - 14j + 14j + 6j*3. 5j*3 Expand (-2 + 1 + 0)(0 - 3 + 4)(m - m + m)(4 - 4 + 1). -m Expand (10 - 20 - 15)(3 - 2b*2 - 3). 50b2 Expand (k2 + 0 + 0)(3k - 31k - 20k). -48k3 Expand (-k2 + 4k*2 - 4k*2)(2 - 7 + 2) + (4k - k - 2k)(2k + k - 2k). 4k*2 Expand (4 + 5 - 5)(-b + b + 2b) + 0b + b + b + (-2 - 2 + 3)(0 - b + 0). 11b Expand (5p - 5p + 2p)(-3p - 4p + 5p) - 4 + p2 + 4. -3p2 Expand (t3 + 0t + 0t)(30 + t2 - 30) - 4t*5 + 3t5 - t5. -t*5 Expand (0 + 0 + w)(52 - 111 + 48 + w). w*2 - 11w Expand (-3 + 2 + 4)(m + 3 - 3) + (-1 + 0 + 3)(17 - 8m - 17). -13m Expand (-x*3 - 3x*3 + 2x*3)(0 + 0 - 2x) - 2x*4 - 4 + 4 + 6x*4 - 2x*4 - 3x*4 + (x + x - 3x)(-5x*3 + 0x*3 + 0x*3). 8x*4 Expand (-1 - 2 + 2)(-3n3 - 2 + 2) + (-2n2 - n2 + n*2)(-4 - 2n + 4). 7n*3 Expand (-2 + 2 + 3)(0 + 0 + 3y + (2 + 1 - 1)(y + 0y - 6y)). -21y Expand (9j - 2j - 2j)(2 - 4 + 0 + (-2 - 1 + 4)(0 + 1 - 2)). -15j Expand (2f*2 - 6f*2 + 3f*2)(-11f3 + f2 + 3f*2 - 5f*2). 11f5 + f4 Expand m - 4m + 4m + (1 + 6 - 4)(m - 5m + 7m). 10m Expand g*3 - 4g*5 + 2g*5 + 4g*5 + (3g*2 - 3g*2 + 2g*3)(-g2 + g2 + 3g2). 8g5 + g3 Expand (0 + 0 + 2)(9d*4 - 5d*2 + 5d*2). 18d*4 Expand (w + 0w - 2w)(4w2 + 2w*2 + 3w*2 + (-3 - 2w + 3)(0w + 2w + w)). -3w*3 Expand (q + 4 - 4)(23 - 11 + 2) + 2 - 2 - q. 13q Expand (-3 + 3 + 2 + 2 - 1 + 1 + 2 + 3 - 4 + (3 + 0 - 5)(0 + 3 - 4))(-4w*5 + 4w5 - w5). -7w5 Expand (0 + 0 + p)(0 + 0 + 2p)(-6p3 + 3p*3 + 2p*3). -2p5 Expand (2 - n2 - 35n + 35n)(1 - 3 + 0) - 4n2 + n2 - 4n2. -5n*2 - 4 Expand 10b - 10b2 - 10b + 3b2 + b2 - 3b*2 + (-3 + 3 - b)(b - 4b + b) + 2b*2 - 4b*2 + 4b*2. -5b*2 Expand (5 + 14 - 5)(-a + 4a - 2a) - 6a + 0 + 6 - 4. 8a + 2 Expand (3w3 - w2 + w2)(1 + 26 - 14). 39w3 Expand (-2 - 1 + 2)(-2o + 2o - o) + (-1 + 0 + 2)(o + 3 - 3) - 8 + 8 - 5o. -3o Expand (-4 + 4 - 1)(1 - 1 - 1)(-4 + 4 + 5r). 5r Expand 3 - 3 + 3j*5 - 2j*5 - 1 + 1 + (0j*3 + 2j3 - j3)(-5j*2 - 2j*2 + 5j*2) - 3j*5 + 0j*5 + 2j*5. -2j*5 Expand -3 + 3 + 2a + (0a - a + 3a)(2 + 0 + 0) - 2a + 3a - 2a. 5a Expand 2s*3 - 3s*3 + 0s*3 + (4s - 2s + 0s)(2s - 2s - 3s)(10 - 10 - 5s). 29s3 Expand -2 + 2f*3 + 0f*3 - 3f*3 + (2f - f + f)(4f*2 + 0f*2 - 2f*2). 3f*3 - 2 Expand (2t2 + t2 - t*2)(-2 - 3t + 2t + 0t). -2t*3 - 4t*2 Expand (b - 2b - b)(2 + 2b - 2) + (b + 0b - 7b)(0b + 0b + b). -10b*2 Expand -2o3 + o3 + 3o3 + (3o - 8o + 39o)(3o2 - o2 - o*2) + 3o*3 + 4o*3 - 5o*3. 38o*3 Expand (-53 + 53 + 4x*2)((0x + 3x - 4x)(-1 - 1 + 3) + 3x + 2x - 3x). 4x*3 Expand 0o*2 + 0o*2 + 2o*3 + 2o + (-o*3 + 5o*3 - 3o*3)(0 + 3 - 5) - o*3 + o - o + 3o*3 - 6o*3 + 2o*3 - 5o*3 - 4o*3 + 5o*3. -6o*3 + 2o Expand (-60 + 60 + r)(5 - 5 + 2). 2r Expand (-3w - 2w - 3w)(-4w - 4w*2 + 3w + 3w2). 8w*3 + 8w*2 Expand (0z + 0z - 2z)(-7z*4 + 5z*4 - 7z*4) - 2z*4 + 2z*5 + 2z*4. 20z*5 Expand 0r*3 + 2r*3 - 3r*3 + 3r*3 - 6r*3 + 2r*3 + (3r + 0 + 0)(-r2 - 52r + 3r2 + 41r). 4r3 - 33r*2 Expand -9 + 17 + h + 8 + (-2 - 3 + 3)(0h + 3h - h) - 4 - h + 4 + 3h + 0h - h. -2h + 16 Expand i2 + 2i*2 - 4i*2 + (-1 + 1 - 4i)(-2i + 1 - 1) + 3i2 - 2i*2 + 0i2 + 1 - i2 - 1 + (2i2 + 0i + 0i)(-1 + 2 - 3). 3i2 Expand (5 + 5 - 3)(-5d2 + 5d*2 + 2d*4). 14d*4 Expand (-3 - 1 + 6)(1 - 3 - 5)(1 + 4p - 1). -56p Expand (-9 + 2 - 1)(-2m - 1 + 1) + 4m - 2m + 0m. 18m Expand (0b + 2b + 0b - 3b + 4b - 2b + (3b - 3b - 2b)(0 - 4 + 2) - b + b - 2b)(0b - 4b + 5b + b + 3b - 6b + (1 + 2 - 1)(2 - 2 + 2b)). 9b2 Expand (-1 - 2 - 2)(-3u + 4u - 3u + (1 + 0 + 1)(-3 - 2u + 3) - 3u + u + 3u). 25u Expand (-t - 3t + 0t)(1 + 3 - 3). -4t Expand (5 - 1 - 1)(-2d*3 - 3 + 1 - 10). -6d*3 - 36 Expand -2f - 2f4 + 2f + (-3f + 0f + 6f + (5 - 1 - 5)(-1 + 1 - f))(0f*3 + 0f3 + f3). 2f4 Expand 2k - 3k + 0k + 0 + 0 - k + (4 - 1 + 3)(2k - k + k). 10k Expand (-60 + 60 - 16a*2)(-3a + a2 + 3a). -16a4 Expand 3j4 - j4 - 4j4 + (-2 + 2 + 3)(5j2 - 3j*4 - 5j*2). -11j4 Expand (q3 + q*3 - 3q*3)(-21 - 6 + 2). 25q3 Expand (64y - 31 + 32 + 3y)(-y*4 + 2y - 2y). -67y5 - y4 Expand (2c3 + c - c)(4 - 4 + 2c + (3 - 1 + 0)(1 - 3c - 1)). -8c*4 Expand (l - l + 2l)(0 - 2l + 0) + 3l2 + 3l*2 - 5l*2 + (2l - 2 + 2)(3l - 5l + 0l). -7l2 Expand (3 + 0 - 1)(-s + 6s + 0s)(-s4 + 2s*4 + 0s*4). 10s*5 Expand (-56 + 59 + 6a2 - a2 - 4a3)(1 - a*2 - 1). 4a*5 - 5a*4 - 3a*2 Expand (-13z*2 + 6z*2 - 6z*2)(-2 + 3 + 1). -26z2 Expand (-3f - 2f + 3f)(50 - 14 - 22)(f*3 - 2f*2 + 2f*2). -28f*4 Expand -2z*2 - 4z*3 + 2z*2 + (0z2 - z2 + 2z2)(3z + 0 + 0). -z3 Expand (u2 + u2 + u2)(u*2 - 2u*2 + 2u*2) + (-4u3 + u3 + u*3)(-2u + 4u - u). u4 Expand (-r2 + r*2 - 2r*3 + 2r*3 - 2r3 + r3 + (-4r + 5r + 0r)(0r2 - 5r*2 + 3r*2))(-3r2 + 0r2 - r2). 12r5 Expand (-3l + 3 - 3)(0 + 3 - 2) + (l - 4l + l)(5 + 2 - 4). -9l Expand (0 - 1 - 1)(11w - w - 5w) - 5w + 2w + w. -12w Expand (-2x + 2x - 2x + 2 + (2 + 2 + 1)(-2x - 2x + 3x))(2x4 - 3x*4 + 2x*4). -7x*5 + 2x*4 Expand (-56g - 72 + 72)(-g + 3g - 4g). 112g2 Expand (b4 + 0 - 2 + 3)(3b - b - 3b) + 2b*5 + 4b*5 - 4b5 + (-b5 - 3b5 + 2b*5)(-4 - 1 + 3) - 2b5 + 3 - 3 + 3b - 3b - 2b5. b5 - b Expand -g*3 + 2g5 + g3 + (-4 + g - 1 + 4)(2g*4 + 0g*4 - 3g4). g5 + g*4 Expand 0a - 2a4 + 0a + (1 - 1 + 9a)(-11 - a*3 + 11). -11a*4 Expand -2v*3 + 4 - 4 + ((-1 + 3 - 4)(-5 + v + 5) - v - 4v + 0v)(5v2 - v2 - 3v2). -9v*3 Expand (0 + 0 - 3l)(0l4 - l4 - l*4) + 2l - 39l2 + 39l*2 - 29l*5. -23l*5 + 2l Expand (-4q + 3q + 0q)(-6q + q + 2q) - 4q2 + 11q - 11q. -q2 Expand (q2 - q2 + q2 + (6q - 3q - q)(-5q + 4q + 3q) - q + q - 2q*2 - 3q2 - q2 + 3q2)(-46 + 2 + 1). -86q2 Expand (-2h*2 + 2h2 + h3)(4 - 1 - 2) + (5h*2 - 2h*2 - 2h*2)(h - 226 + 226). 2h3 Expand (0u2 + u2 - 2u + 3u)((0 - u + 0)(-u - 3u + 2u) + 3u2 + 3	{ "pile_set_name": "DM Mathematics" }
28. Let i be ((-3)/(-9))/(1/o). Let s be i/4 + 63/6. What is the greatest common divisor of 8 and s? 4 Suppose -462 = -10n + 338. What is the greatest common factor of 32 and n? 16 Let c be ((-6)/9)/(10/(-2805)). Calculate the greatest common factor of 170 and c. 17 Suppose -55c - 18c = -10439. Calculate the highest common divisor of 77 and c. 11 Suppose 0 = -2b + 3p + 30, -57 + 11 = -4b - p. Calculate the greatest common divisor of 612 and b. 12 Let j(p) = -p + 157. Let h be j(-38). What is the greatest common factor of h and 165? 15 Let d = -243 + 245. Calculate the greatest common divisor of 4 and d. 2 Let x be 35 + 02/(-4). Suppose -x = -t - 4t. Let l = 58 - 57. Calculate the highest common factor of t and l. 1 Suppose 3v - 100 = 5t, 0t + 92 = 2v + 3t. What is the greatest common divisor of 1000 and v? 40 Let g = 42 + -18. Let q = g - 0. Calculate the highest common divisor of q and 24. 24 Let l(g) = -2g*2 - 60g - 49. Let y be l(-29). Calculate the greatest common divisor of y and 18. 9 Let c be (-2)/4 + (-7755)/(-110). Calculate the greatest common factor of 28 and c. 14 Let h(q) = -q*3 - 2q*2 + 35q + 252. Let f be h(-7). What is the highest common factor of 189 and f? 63 Let l = -211 - -295. What is the greatest common factor of l and 224? 28 Let q be (9/3 + -1)/((-18)/(-1287)). What is the highest common factor of q and 221? 13 Suppose 4 = 4x - 252. Let j = x + 146. What is the highest common factor of j and 30? 30 Let l(i) = 29i3 - i2 + 2i - 1. Let q be l(1). Suppose -j + q - 10 = 0. Let v = j + 27. What is the greatest common divisor of v and 115? 23 Suppose 4l + 3a = 183, -3a = 2l - 29 - 70. Calculate the greatest common factor of 105 and l. 21 Let c(w) = 8w*2 + 80. Let z be c(0). Suppose -17 = -3y - 3v + 7, v + 2 = 0. Calculate the highest common divisor of z and y. 10 Let g = -23 + 37. Let j = 34 - g. What is the highest common divisor of j and 30? 10 Let j be ((-165)/(-385))/(2 + (-250)/126). What is the highest common divisor of 51 and j? 3 Let v = 159 - 97. Calculate the highest common divisor of 93 and v. 31 Let x = 59 - 24. Let m be (-5)/((-70)/(-4)) - (-1690)/x. Calculate the highest common factor of 12 and m. 12 Let j(m) = 4m*2 + m - 2. Let b be j(1). Let f be b/(-3)(-3 + -85). Let y be -2(2 + -14)/3. What is the greatest common divisor of f and y? 8 Let s(t) = 108t - 4. Let n be s(4). Let c be n + -1 - (8 + 1 + -11). What is the greatest common divisor of 39 and c? 39 Suppose 32o - 34o = -172. Calculate the highest common divisor of o and 2. 2 Let t = 8 - -1. Suppose 4x = -f + 28, -4f = -4x + t + 39. Let w = x - 6. Calculate the greatest common factor of 2 and w. 2 Suppose 4m - 2x + 2 = -0x, 4x - 18 = m. Suppose mr = -4r. Suppose 3n - 51 + 21 = r. Calculate the greatest common divisor of n and 40. 10 Let b = 3 + -1. Let x(r) = 2r3 - 22r*2 + 2r - 6. Let f be x(11). Let m be (1 + b)/(12/f). What is the highest common factor of m and 6? 2 Let j be (-1365)/(-18) + (-5)/(-30). Let m = 184 - j. Calculate the highest common factor of m and 12. 12 Let s(w) = 22w - 70. Let n be s(4). What is the highest common factor of 1386 and n? 18 Suppose -67q + 50q + 9588 = 0. What is the highest common factor of 108 and q? 12 Let j be (-1)/(1/1)-5. Suppose -jh + 0h + 375 = 0. Let n be (-1442)/(-98) + ((-6)/7)/(-3). What is the highest common divisor of h and n? 15 Let j(l) = 12l + 15. Let h be j(-10). Let i be ((-24)/20)/(2/h). Calculate the highest common divisor of 9 and i. 9 Let d be 2/(10/(-3)) - 6/(-10). Suppose 6a + 2a - 56 = d. What is the greatest common divisor of 49 and a? 7 Let f = -603 - -613. What is the highest common divisor of f and 24? 2 Let t(d) be the third derivative of d5/30 + 7d*4/24 - 4d*3/3 - 9d*2. Let g be t(-6). What is the highest common factor of g and 44? 22 Let t be (-150)/(-5)3/5. Calculate the highest common factor of 81 and t. 9 Suppose 169w + 5456 = 180w. What is the greatest common factor of w and 16? 16 Let p be 9228/66 - (0 - (-2)/(-11)). What is the highest common factor of p and 35? 35 Suppose -147z + 142z = -5f + 620, f = 4z + 109. Calculate the highest common divisor of 1247 and f. 43 Suppose -1473 = -9f - 339. Calculate the highest common divisor of 42 and f. 42 Let m be (192/(-30))/((-4)/10). Suppose r + 2u = m, -3r - 5u + 36 = -7. Calculate the highest common factor of r and 2. 2 Let x be 225/270 + 902/12. What is the greatest common divisor of x and 2356? 76 Let o(d) = -d*2 + 19d - 29. Let p be o(16). What is the highest common divisor of p and 513? 19 Let j be 29/3 + (-208)/312. Let m = 1 + -1. Suppose m = -7z + 4z + 108. What is the highest common factor of j and z? 9 Suppose 5p + 148 + 34 = 3t, -5p - t = 186. Let y = -34 - p. What is the highest common divisor of 3 and y? 3 Suppose -b + 2b = 3. Let f(m) = 2m + 54. Let k be f(-23). Suppose bq - 7 = k. What is the highest common factor of q and 5? 5 Suppose -5f + 218 = -4h, -2h - 5f - 13 = 81. Let u = h + 106. What is the greatest common factor of u and 6? 6 Let o(r) = r*3 - 11r*2 - 9r - 22. Let s = 9 - -3. Let j be o(s). Calculate the highest common factor of 42 and j. 14 Let y = 186 + -54. Let h = 154 - y. What is the highest common divisor of 176 and h? 22 Let g = 46 + -43. Let x be g10/2 + 1. What is the greatest common divisor of x and 144? 16 Let z(m) = -m + 6. Let i be z(-6). Let v = 619 + -402. Let p = -121 + v. What is the highest common divisor of p and i? 12 Suppose -13c + 17c = 104. What is the greatest common divisor of 13 and c? 13 Suppose 2z + 3z = 0. Suppose 0c - 3c + t + 4 = z, 2c - t - 1 = 0. Suppose -cd + 1 = -20. What is the highest common factor of d and 14? 7 Let b be (-2)/2(-28 + 26). Suppose j - 3j - 4 = 0. Let a be j - b - 110/(-5). What is the greatest common factor of a and 27? 9 Let c be -18 - -12 - (-2 + 1). Let g(k) = 15k*2 + 2k - 5. Let n be g(c). Calculate the greatest common factor of n and 40. 40 Let g = 18 + 46. Suppose -g - 26 = -9z. What is the greatest common divisor of z and 25? 5 Let l be -3 + ((-6)/(-2) - 1 - 41). Let b be ((-352)/24)/(4/l). What is the greatest common divisor of b and 14? 14 Let u be (-480)/(-144)156/5. Let l(f) = -31f - 7. Let r be l(-6). Let d = r - u. What is the greatest common factor of d and 30? 15 Let k(g) = -3g - 7. Let d(u) = u + 4. Let i(n) = -5d(n) - 3k(n). Let o be i(3). Let b = o - 1. What is the greatest common factor of 12 and b? 12 Suppose 0 = -2z - 0z - 2, -2l + z = 7. Let n be 1/l - 99/(-12). Let k(b) = 6b - 16. Let u be k(12). What is the highest common divisor of u and n? 8 Let r(o) = -6o2 + 0o*2 + 0o2 + 7 - o2 - o*3 - 5o. Let w be r(-6). Calculate the greatest common divisor of 9 and w. 1 Let j(h) = -4h - 10. Let t be j(-3). Suppose -18 = -a - tq - 1, 48 = 3a + 3q. What is the highest common factor of a and 135? 15 Let y = 25 - 30. Let g be 10/4 + 1/(-2) - y. Calculate the greatest common factor of 21 and g. 7 Let b be -6 - ((-114)/(-152))/((-1)/44). Calculate the highest common divisor of b and 2619. 27 Let c(p) = -p - 8. Let n be c(-6). Let j be n/12 - (-19)/6. Suppose jt + x = 63, -3x + 25 - 67 = -2t. Calculate the greatest common factor of t and 7. 7 Let u(l) = -2l3 + l2. Let k be u(1). Let x(n) = 13n - 1. Let c be x(k). Let y be 7/c + 11/2. What is the greatest common divisor of 5 and y? 5 Let f(y) = -66y - 20. Let h be f(2). Let m be (30/(-8) - -3)h. Calculate the highest common factor of m and 76. 38 Suppose 372q + 504 = 378q. What is the highest common divisor of q and 56? 28 Suppose -5y - 38 = 2. Let g be y/44 + (-354)/(-11). What is the highest common divisor of g and 352? 32 Suppose -4b + 2b = -34. Suppose 0 = -4j + b + 7. Suppose -2n = a - 251, -5n + 3a - ja + 627 = 0. What is the greatest common factor of 14 and n? 14 Suppose -18 = 5n - l, -3n + 2l = 4l + 16. Let u = 8 + n. Suppose -uw = -2w - 12. What is the greatest common factor of w and 6? 6 Let j = 1027 - 998. What is the highest common divisor of 203 and j? 29 Let q = 2971 + -2821. Calculate the greatest common divisor of 210 and q. 30 Suppose -5s + 8s = 4c + 184, -8 = -4*c. Calculate the greatest common factor of 72 and s. 8	{ "pile_set_name": "DM Mathematics" }
3. sqrt(11)/9 + 403 Simplify ((sqrt(76) - (-6((sqrt(76) + sqrt(76) + 0 - sqrt(76)) + sqrt(76)) - sqrt(76))) + -5)2 - (sqrt(304) + (-1sqrt(304) + sqrt(304))5 + 5). -284sqrt(19) + 14916 Simplify (sqrt(693)/(sqrt(176) - sqrt(176)-2))/(sqrt(900)-1-1 + sqrt(900)). sqrt(7)/240 Simplify sqrt(35)/(-2(sqrt(125) + sqrt(5))) + -2sqrt(112)4. -385sqrt(7)/12 Simplify -3(sqrt(500)-1 + -2)2-5. 600sqrt(5) + 7560 Simplify (1-1sqrt(4617))/(((sqrt(108)-2)/sqrt(6))/sqrt(6)). 9sqrt(19)/2 Simplify (((sqrt(91) + (-1sqrt(91) - sqrt(91)) + sqrt(91))2 - sqrt(91))/sqrt(7))2 - (sqrt(13) + -2)4-4. -19 + 16sqrt(13) Simplify 6(sqrt(833) + -1) - (-4 + sqrt(833) + 0) - (6(sqrt(833) + 0) - ((sqrt(833) - (sqrt(833) + 0)-2) + sqrt(833) - sqrt(833)))2. -7499 + 35sqrt(17) Simplify sqrt(110)/((sqrt(120)-3)/sqrt(12)) - (4 + (1sqrt(33)/sqrt(3))*2). -15 - sqrt(11)/3 Simplify 4 + ((sqrt(1008) - (sqrt(1008)1 + -1) - (2 + sqrt(1008)2))2 - (sqrt(1008)-13 + 2(sqrt(1008) + sqrt(1008) + -1 + sqrt(1008)))*2). -5039 + 192sqrt(7) Simplify (-2(2 + sqrt(128)) - ((sqrt(128) - sqrt(128)2) + 0))*23. 192sqrt(2) + 432 Simplify 3 + (sqrt(50) - sqrt(550)/sqrt(704) - sqrt(50))/((-1sqrt(80))/sqrt(8)). sqrt(5)/8 + 3 Simplify (((sqrt(44)/sqrt(4) - sqrt(11))1 - sqrt(22)/(sqrt(10)/sqrt(5)) - (sqrt(132)/sqrt(3) + sqrt(121)/(sqrt(33)/sqrt(3))))6)*2. 6336 Simplify (4(sqrt(77)-4 - sqrt(77)) - sqrt(77))/(sqrt(66)/sqrt(6)-5). 21sqrt(7)/5 Simplify (sqrt(150)/sqrt(3) + -5 + 6(sqrt(2) + (sqrt(4) + sqrt(196))/sqrt(2)) + -2)*2. -826sqrt(2) + 7011 Simplify (sqrt(768) - sqrt(768)-3)/(sqrt(484) - sqrt(484)-1). 16sqrt(3)/11 Simplify (5 + (sqrt(171) + 2(sqrt(171) + sqrt(171)3 + sqrt(171)))/(sqrt(144)-5 + sqrt(144)))*2. -55sqrt(19)/8 + 8699/256 Simplify 4 + ((-5sqrt(242))2 + 1)3 + 4. 18161 Simplify (26(sqrt(133) - sqrt(133)-1))/(sqrt(126)/sqrt(2)-5). -8sqrt(19)/5 Simplify (4 + sqrt(4608) + (-2sqrt(4608) - sqrt(4608)))*2-5. -92240 + 3840sqrt(2) Simplify ((sqrt(1216) + -2)2 + -2 - (1 + sqrt(1216) + -1 + sqrt(1216) + sqrt(1216) - sqrt(1216))) + -3. -48sqrt(19) + 1215 Simplify ((sqrt(112)/(sqrt(16) - -4sqrt(16)))/(-23sqrt(256)))2. 7/230400 Simplify ((((3 + sqrt(11))-3 - sqrt(11) - sqrt(11) - sqrt(11)) + 1 + sqrt(99) + 5)-4)2. 288sqrt(11) + 1728 Simplify (sqrt(42)21)/(sqrt(6)1-5). -2sqrt(7)/5 Simplify -1sqrt(75)4 + (sqrt(18)/(-4sqrt(54)))*2. -20sqrt(3) + 1/48 Simplify (((sqrt(68) - ((sqrt(68) - (sqrt(68) + sqrt(68)-4)) + sqrt(68)))-3)/(sqrt(576)1)-66)2. 22032 Simplify sqrt(512) + 0 + -3(sqrt(18)/(sqrt(9) + sqrt(144)))*2. -6/25 + 16sqrt(2) Simplify (2sqrt(36)1)/(sqrt(300) - 2sqrt(300)) - (5 + sqrt(3)-2 + (sqrt(90)/sqrt(5))/sqrt(6)). -5 + 3sqrt(3)/5 Simplify 3 + ((-2sqrt(153)2)/(4sqrt(36)/sqrt(4)))2 + 5. 25 Simplify (2 + sqrt(684) - ((sqrt(19) - sqrt(304)) + -5))2 + ((sqrt(76) + 1 + 0 + sqrt(19) + 4)6)2. 1206sqrt(19) + 8644 Simplify (((sqrt(176) + 1 - sqrt(11))-2 - (sqrt(176) - (sqrt(176) + 0) - (sqrt(1100) + -1)))3)*2. -216sqrt(11) + 1665 Simplify (2 + sqrt(468) + (sqrt(468) + 1 + sqrt(468))*2)-4 + -2. -7502 - 120sqrt(13) Simplify (-1sqrt(396)-5)2 + ((1 + sqrt(1100))-2)*2. 80sqrt(11) + 14304 Simplify 1 + (0 + sqrt(3) + 1)*2 + 4 + (1((sqrt(300) + 1 + sqrt(300) - sqrt(300)) + sqrt(300)) + 1 + 2sqrt(300))2. 162sqrt(3) + 4813 Simplify ((sqrt(660)/(-3sqrt(11)))/sqrt(2))/((sqrt(384)/sqrt(8))/sqrt(8)5). -sqrt(5)/15 Simplify (1(sqrt(136) - sqrt(136)4))/(-4sqrt(968) + sqrt(968)) + 4. sqrt(17)/11 + 4 Simplify (-1(sqrt(833) + (-2 + sqrt(833) - sqrt(833))) + (sqrt(833) + 2)-1)2. 3332 Simplify 3 + -2sqrt(171)6 + 0. -36sqrt(19) + 3 Simplify (2 + (-3 + sqrt(5) + sqrt(10)/sqrt(2))2 + 4 + (sqrt(605) - (2sqrt(605) + sqrt(605)) - sqrt(605)))*2. 4205 Simplify -2 + (-2(sqrt(432) + 0) + sqrt(432) + -2)*2 + 5 + -3. 48sqrt(3) + 436 Simplify (sqrt(33) + sqrt(33)-1)/sqrt(3) - (sqrt(132)/sqrt(3))/sqrt(4) - (sqrt(704) + 5sqrt(704) + 0 + sqrt(704) + sqrt(704) + sqrt(704)). -73sqrt(11) Simplify (-3 + 3 + sqrt(891)-2 + sqrt(891) + -1)-45. 20 + 180sqrt(11) Simplify (-3(sqrt(99) - 2sqrt(99)))/(sqrt(1296)-2 + sqrt(9) + sqrt(9))6. -9sqrt(11)/11 Simplify 2 + ((sqrt(2736) - (3sqrt(2736) - sqrt(2736))2-2) + 42sqrt(2736))3. 324sqrt(19) + 65666 Simplify -4(sqrt(4752)1 + sqrt(4752))/(-2sqrt(363)). 48sqrt(11)/11 Simplify ((-3sqrt(180)/sqrt(4))/sqrt(5))/(sqrt(36)/((-2sqrt(36))/sqrt(3))). 6sqrt(3) Simplify ((sqrt(76) + 1)2)*2 - (2 + sqrt(76) + 1) - ((sqrt(76) - 1(sqrt(76) + 0)) + 4). 14sqrt(19) + 301 Simplify (sqrt(42) + -4sqrt(1512))/(sqrt(972)/sqrt(2)). -23sqrt(7)/9 Simplify ((-32sqrt(432))2 + -5)3. 46641 Simplify -2(5 + (sqrt(2) - (sqrt(50) + -3)))4. -64 + 32sqrt(2) Simplify (-1 + sqrt(363) + sqrt(363))-4 + -3 + 5. -88sqrt(3) + 6 Simplify ((-1(sqrt(132) + (sqrt(132) - 3sqrt(132)3 - sqrt(132)) + sqrt(132)))/(-3(sqrt(108) - (-3sqrt(108) + sqrt(108) + sqrt(108) - sqrt(108)))))2. 539/729 Simplify (-2 + sqrt(612) + 2 + 5 + 4)2. 108sqrt(17) + 693 Simplify ((sqrt(19) + sqrt(19) + sqrt(57)/(sqrt(3) - sqrt(27)) + sqrt(1216) + -1 + sqrt(1216) + sqrt(19) + sqrt(19) + 0 + -4)5)*2. -4875sqrt(19) + 724975/4 Simplify -3-4(1 + (-2(sqrt(13) + sqrt(117)-1 + sqrt(117) - (sqrt(13) - sqrt(26)/sqrt(8))))*2). 168 Simplify ((sqrt(143) - 5(sqrt(143) + (sqrt(143)1 - sqrt(143)))) + sqrt(143) + 1-1sqrt(143))/(-1(sqrt(1584) + sqrt(1584) + 2sqrt(1584))). sqrt(13)/12 Simplify 2sqrt(1008) + sqrt(56)/sqrt(2) - (sqrt(112)-2 + 4 - sqrt(112)). -4 + 38sqrt(7) Simplify (((sqrt(306)-2)/sqrt(9))/(sqrt(8)/sqrt(36)))2 - (((sqrt(85) - 2sqrt(85))/sqrt(5) - ((sqrt(153) + sqrt(17))4)2) + 4). sqrt(17) + 4960 Simplify (-5 + 2 + sqrt(13)-3 - ((-1sqrt(208))/sqrt(8))/sqrt(2))2. 12sqrt(13) + 61 Simplify (3 + (sqrt(13) - sqrt(117)/(sqrt(27)/sqrt(3))) + sqrt(13)-1 + -5 + sqrt(13))22 + 3. 11 Simplify (sqrt(720)/sqrt(192))/(sqrt(96)/(sqrt(8)-2)) + 6(sqrt(20) + -4)-5. -121sqrt(5)/2 + 120 Simplify (sqrt(45)/(sqrt(1089)-3)-5 + 3)*2. 10sqrt(5)/11 + 9926/1089 Simplify (-6(sqrt(324)-1 - sqrt(324)))/(sqrt(18)/(sqrt(600)1 + sqrt(600))). 1440sqrt(3) Simplify (sqrt(350)/((1sqrt(90))/sqrt(9) + sqrt(10)))/((-3sqrt(30)/sqrt(3))/sqrt(2)). -sqrt(7)/6 Simplify (4(-2 + sqrt(475) + sqrt(475) + 5))24. 3840sqrt(19) + 122176 Simplify (1(-4 + 1sqrt(833) + (sqrt(833) - (sqrt(833) + 0 + 3))))2. -98sqrt(17) + 882 Simplify (sqrt(12) + sqrt(120)/sqrt(90))/(sqrt(150) + -2sqrt(150)) + -2sqrt(16)/((sqrt(512) + sqrt(512)1 + sqrt(512) + sqrt(512) - sqrt(512)) + sqrt(512)). -79sqrt(2)/240 Simplify -5 + ((2sqrt(99)-2 + sqrt(99))/(sqrt(9)-15))*2. -26/25 Simplify ((sqrt(5)1 + -5 + 0 + sqrt(25)/sqrt(5))54)*2. -8000sqrt(5) + 18000 Simplify ((sqrt(11) + 2sqrt(539))1 + -6(-3sqrt(77) - sqrt(77))/sqrt(7))-1. -39sqrt(11) Simplify ((sqrt(121) - -4sqrt(121)-2 - sqrt(121))-2)/((2sqrt(132) + sqrt(132))/sqrt(12) - -1sqrt(22)/sqrt(2)). 4sqrt(11) Simplify 5(3 + 4-1sqrt(200))2 + -3. -1200sqrt(2) + 16042 Simplify (2(sqrt(612) - (sqrt(612) + sqrt(612) + 1))-66)2 + 0. 62208sqrt(17) + 3177792 Simplify -4 + (sqrt(18) - ((sqrt(36)-3)/sqrt(2))2)1 + -1. -167 + 3sqrt(2) Simplify ((sqrt(245)/(sqrt(7) + sqrt(7) + sqrt(63)/sqrt(225)))/(sqrt(77)/(sqrt(11)2) + (sqrt(7) - (sqrt(7) + sqrt(448) + sqrt(448)1))))2. 500/116281 Simplify (sqrt(51) - (sqrt(459)2 - sqrt(51)) - ((sqrt(5100) - (sqrt(5100)-2 - sqrt(5100)) - sqrt(5100)) + sqrt(51)))/(((sqrt(330)1)/sqrt(10))/sqrt(11)). -35sqrt(17) Simplify 0 + 5-4(0 + (-1sqrt(8))/sqrt(4) + sqrt(2)). 0 Simplify 2(-5-2sqrt(121))/(sqrt(396) + sqrt(44)) + -5. -5 + 5sqrt(11)/2 Simplify -4(sqrt(12) + (sqrt(12) - sqrt(192)))/((sqrt(20)/sqrt(5) - sqrt(4))5 - sqrt(4))6. -48sqrt(3) Simplify sqrt(24)/(sqrt(1152)2) + -2(-2 + sqrt(3)) + 5. -47sqrt(3)/24 + 9 Simplify 4-3sqrt(704) + (sqrt(22)-3)/sqrt(2)6. -114sqrt(11) Simplify ((-5 + 1sqrt(832))-5-2)2. -8000sqrt(13) + 85700 Simplify -3((-2 + sqrt(363)-1 - 2sqrt(363)1)4 + 5)2. -156843 - 2376sqrt(3) Simplify ((sqrt(243) + -1 + sqrt(243) + 1 - (-2(sqrt(243) + -1) + sqrt(243)) - 2(-4 + -1sqrt(243))) + 5)2. 990sqrt(3) + 6196 Simplify -4(-5 + (sqrt(1088)-	{ "pile_set_name": "DM Mathematics" }
13. Give gn(i) + 11u(i). 3i2 - 1 Let m(i) = 6i - 2. Let r(f) = 5f - 2. Let z be (-2)/(-7) + (-16)/56. Suppose -3u + 60 = -2u - 4l, z = -l. Let t = 56 - u. Determine tr(v) + 3m(v). -2v + 2 Let b(o) = -3542o + 303. Let k(g) = -835920g + 71509. Let p(i) = 473b(i) - 2k(i). Let m(v) = 47v - 4. What is -301m(q) - 4p(q)? -43q Let g(n) be the second derivative of n4/6 - 2n*3/3 - 3942n. Let x(m) = -m*2 + 2m. Let i = 2 - 4. Let j be (12/2)/(3/i). Determine jg(d) - 7x(d). -d*2 + 2d Let s(r) = r*2 - 2r - 18. Let a(k) = -6k2 + 8k - 321. Calculate a(h) + 4s(h). -2h*2 - 393 Let i(x) = -7x*3 + 2x - 6. Let o(s) = s*3 + 1. Let a(h) = 6h - 2. Let q be a(1). Suppose qu - 5 = 3. Suppose 0 = 5c - 3c + u. Calculate ci(r) - 6o(r). r3 - 2r Let c(y) = 3y2 - 2y - 1. Let w(u) = 4u2 - 3u - 2. Let j = -11614 + 11610. Give jw(i) + 5c(i). -i*2 + 2i + 3 Let x(d) = -d*3 - 1. Let w(l) = -2 - 93l*3 + 110l*3 + 8. Let s be (366/60 + -6)10. Determine sw(p) + 6x(p). 11p3 Let u(g) be the first derivative of -34g3/3 + g2/2 - 3g - 2327. Let t(z) = 17z*2 + 1. Calculate -5t(m) - 2u(m). -17m*2 - 2m + 1 Let t(b) = 9b2 - 6b - 24. Let c(k) = -2k2 + 51687k + 0k2 - 16 + 0k*2 - 51691k + 8k2. What is 7c(g) - 5t(g)? -3g*2 + 2g + 8 Let g(z) = -214z2 - 64z + 14. Let r(q) = 343q2 + 96q - 22. Let f(u) = 8g(u) + 5r(u). Let o(b) = -7b2 + 64b - 5. Give 5f(s) + 2o(s). s*2 - 32s Let a(p) = -132p3 - 12p*2 - 12p - 5. Let r(q) = -132q3 - 15q*2 - 14q - 6. Calculate -6a(k) + 5r(k). 132k3 - 3k*2 + 2k Let m(l) = -32l3 - 9l*2 + 7l + 67. Let a(t) = -6t3 - t2 + 2t - 1. Calculate 5a(w) - m(w). 2w*3 + 4w*2 + 3w - 72 Let i = -168 + 170. Let w(d) = 7d2 - d2 - 10d*2 + 3d*i + 4d - 5. Let q(c) = 2c2 - 9c + 11. What is 4q(f) + 9w(f)? -f2 - 1 Let d(m) = -m3 + 2. Let z(v) = v*3 - 1. Let r be (63/(-6))/((-8)/(32/3)). Suppose ro - 31 = -17. Calculate od(p) + 2z(p). p3 Let p(o) = -o2 - 31o - 2. Let k(t) = 22t*2 + 20t + 10. Calculate -k(j) - 4p(j). -18j*2 + 104j - 2 Let o(z) be the first derivative of 57z2/2 + 33z + 1. Let k be 4 - 38/(-24). Let d(f) = -12f - 4 + 13f - 3f - kf. Give 33d(b) + 4o(b). -3b Let z(v) = -v3 - v2 + v + 1. Let n(x) be the first derivative of -x*4/4 - 2x3/3 + x2/2 + 3x - 5527. Calculate n(g) - 4z(g). 3g3 + 2g*2 - 3g - 1 Let m(w) = -69w + 52. Let g(x) = -10x - 1. Give -14g(h) + 2m(h). 2h + 118 Let q(v) = -33v + 9. Let g(p) = 8p - 2. Suppose 0 = 5k - 5r - 55, -4k - 60r + 55r - 1 = 0. Suppose kf = 4 + 122. Calculate fg(z) + 5q(z). 3z + 3 Let w(s) = -307s + 4. Let o(l) = -868797l + 11322. What is -6o(n) + 16983w(n)? -999n Let j(i) = i2 + 19i + 4. Let g be -5((-1428)/105)/(-17). Let h(s) = s2 + 20s + 3. Determine gh(p) + 3j(p). -p*2 - 23p Let a(r) = -4r2 - 499r - 10. Let t(o) = -18o2 - 2492o - 52. What is 26a(q) - 5t(q)? -14q2 - 514q Let z(d) = 8d3 - 3d*2 + 7d - 4. Let l(i) be the first derivative of -15i4/4 + 5i*3/3 - 13i*2/2 + 7i - 6933. What is -3l(n) - 5z(n)? 5n3 + 4n - 1 Let s(y) be the third derivative of y4/8 - y3/3 + 1585y2. Let u(d) = -3d + 2. Determine 6s(r) + 5u(r). 3r - 2 Let s(k) = -14k + 112. Let d(j) = -8j + 75. Give 7d(q) - 5s(q). 14q - 35 Let j(l) = 4929l3 - 341. Let y(u) be the third derivative of -29u6/120 + u3/3 - 710u2. Calculate 2j(q) + 341y(q). -31q3 Let f(c) = -c3 + c - 1. Let s be 124/12 - 1/3. Suppose 2 + s = 6a. Suppose -4 + 6 = -ad. Let j(z) = 4z3 - 3z + 3. Calculate dj(r) - 3f(r). -r*3 Let p(z) = -40z*2 + 20z - 5. Let q(m) = 27m2 - 13m + 3. Give -5p(a) - 8q(a). -16a2 + 4a + 1 Let p be (0 + -3)1 + 3. Suppose -7j + 218 = -2j + 2q, p = j - 3q - 47. Let y = j - 38. Let k(a) = 3a + 6. Let z(d) = -9d - 17. What is yz(t) + 17k(t)? -3t Let l(o) = 4o3 - 11o*2 + 50. Let t(q) = -9q*3 + 22q*2 - 94. Calculate -5l(h) - 2t(h). -2h*3 + 11h*2 - 62 Let z(q) = -32q*3 - 65q*2 - 9q - 11. Let w(c) = -17c3 - 37c*2 - 4c - 6. Calculate 7w(l) - 4z(l). 9l3 + l2 + 8l + 2 Let a(q) = -6q3 + 15q*2 + 11q - 11. Suppose 3g = 5n - 61, -31g + 34g = n - 17. Let i(o) = -3o3 + 8o*2 + 6o - 6. Determine ni(r) - 6a(r). 3r3 - 2r*2 Let a(u) = -6u*3 - 3u*2 - 1189u. Let s(x) = 7x3 + 4x*2 + 1190x. Give 4a(m) + 3s(m). -3m3 - 1186m Let m(q) = 9q - 1. Let l(g) be the first derivative of -g2/2 - 6129. What is 2l(r) - 2m(r)? -20r + 2 Let b(q) = -4q2 + q + 2. Let p(j) = 3j*2 - j - 1. Let r = -1625 + 1628. Determine rp(h) + 2b(h). h2 - h + 1 Let z(n) = 2n*2 + 2n + 3. Let u(d) = 3d2 - d + 4. Let q(b) = b2 - 4b. Let o(v) = q(v) - u(v). Calculate 4o(s) + 5z(s). 2s2 - 2s - 1 Let b(q) = -7q + 1073. Let w(x) = 12x - 2158. Calculate -5b(u) - 3w(u). -u + 1109 Let s(w) = w - 1. Let c(y) = -2 + 10 + 0y + 9y + 0y - 2. Give -c(d) - 6s(d). -15d Let w(f) = -f3 - 3f*2. Let u(d) = 3d*3 + 6d*2 - d + 144. Calculate u(k) + w(k). 2k*3 + 3k*2 - k + 144 Let o(t) = -5t*2 + 2t. Let m(s) = 7s2 - 3s. Let u(l) = -2m(l) - 3o(l). Let x(f) = 10f. Calculate -u(a) + x(a). -a2 + 10a Let p(b) = -b*2 - 7b - 3. Suppose -9c + 2f + 16 = -7c, 0 = 5c - 2f - 40. Let a(l) = -11l + cl + 3 - 2 + 4l. What is -4a(i) - p(i)? i2 + 3i - 1 Let x(p) = 987p2 + 5. Let f(y) = 4y*2. Determine -11f(b) - x(b). -1031b2 - 5 Let d(h) = -1. Suppose 0 = -8j + 9j - 11j. Let i(b) = 8 + b + 5 + j - 10. Determine 12d(k) + 4i(k). 4k Let s(c) = -3c*3 - 32c*2 - 110c + 6. Let r(d) = 2d3 + 20d*2 + 74d - 4. What is 8r(h) + 5s(h)? h*3 + 42h - 2 Let q(j) = 12j3 - 7j*2 - 3j - 29. Let f(n) = -14n3 + 8n*2 + 4n + 28. Determine 5f(y) + 6q(y). 2y3 - 2y*2 + 2y - 34 Let u(s) = 29s3 + 16s - 9. Let j(h) = 29h3 + 19h - 10. Determine 6j(x) - 7u(x). -29x3 + 2x + 3 Suppose 5w = -m - 25, -9m - 2 = 3w - 11m. Let d be (1/w)/(5/60). Let x(f) = -9f3 - 7f - 11. Let v(l) = 5l3 + 4l + 6. What is dx(r) - 5v(r)? 2r3 + r + 3 Let j(f) = 2f + 10. Let u(i) = 6 - 3 - 5i + 2i + 3i + i. Give 2j(m) - 7u(m). -3m - 1 Let m(p) = -8p + 2. Let t(u) = 12u - 3. Let g = -58 - -95. Let k = g - -75. Suppose 11o + k = -3o. Give om(v) - 5t(v). 4v - 1 Let y(r) = 5r*2 + r + 2. Let u(v) = 36v*2 + 13v + 14. What is 2u(n) - 14y(n)? 2n2 + 12n Let m(k) = 41k + 401 - 183 - 197 - 33k. Let x(p) = 7p + 21. What is -5m(v) + 6x(v)? 2v + 21 Let l(x) = -153737x3 + 235x*2 - 470x + 235. Let c(o) = 1314o3 - 2o*2 + 4o - 2. Determine -470c(s) - 4l(s). -2632s3 Let m(w) = 8w*3 + 6w*2 + 6w + 13. Let s(i) = -7i3 - 5i*2 - 5i - 13. Let g be ((-23)/42 - (-105)/490)/((-1)/(-15)). What is gm(r) - 6s(r)? 2r3 + 13 Let k(i) = -i3 - 1. Suppose y = 5o - 24, -4o = y - 6o + 9. Let b be y/8 - 47/(-8). Let a(r) = r*3 + 2. Calculate bk(z) + 3a(z). -3z*3 Suppose 5g = 30 - 10. Let x(f) = -2 - f + gf - 4f. Let m(q) = -q. Let l(h) = 7h + 3. Let w(i) = -l(i) - 6m(i). Determine -3w(t) + 4x(t). -t + 1 Let t(v) = 4v2 + 7v + 14. Let i(l) = -2l2. Determine -4i(y) - t(y). 4y2 - 7y - 14 Let h(m) = 18m2 + 2m + 5. Let t(k) = -38k2 - 4k - 11. Determine 5h(c) + 2t(c). 14c2 + 2c + 3 Let j = -55 + 56. Let l(s) = -1. Let r(q) = 433q - 4 - 4 - 432q. Calculate jr(u) - 3l(u). u - 5 Let z(f) = 3f2 - 2881f - 4. Let b(m) = -10m2 + 8641m + 14. Determine -4b(c) - 14z(c). -2c2 + 5770c Let c(l) = -5398l - 18. Let j(u) = 10792u + 32. Calculate 7c(d) + 4j(d). 5382d + 2 Let u(f) = -11f*2 + 2f. Let j(b) = 57b2 + 19b + 44. Give j(l) + 5u(l). 2l*2 + 29l + 44 Let n(z) = 11z2 + 2296z + 14. Let h(i) = 8i2 + 1531i + 10. Give -7h(d) + 5n(d). -d*2 + 763d Let q(v) = -2v2 + 2v - 5. Let h(o) = -101. Let p(s) = 253. Let c(n) = 5h(n) + 2p(n). Give -5c(r) - q(r). 2r*2 - 2r Let n(v) be the first derivative of 5v + 2 + 0v*2 - 2/3v*3. Let x(b) = 7b*2 - 21. What is 21n(a) + 5x(a)? -7a*2 Let o(d) = -4d3 - 1. Let p(m) = -m3. Let h be (-57)/76(-16)/(-12). What is ho(y) -	{ "pile_set_name": "DM Mathematics" }
a*4 + 0 + ma*3 + 0a*2 + 2a. Determine n, given that q(n) = 0. -2, 0 Let r(o) be the first derivative of -o*4/3 - 8o*3/3 - 22o*2/3 - 8o + 22. Find g such that r(g) = 0. -3, -2, -1 Let w(x) be the first derivative of -x*4/4 + 3x3/4 - x2/4 - 7. Factor w(q). -q(q - 2)(4q - 1)/4 Solve 2/3k*3 + 16k*4 - 4k*2 + 32/3k*5 + 0 + 2/3k = 0 for k. -1, 0, 1/4 Let l = 5 + -3. Suppose 3 = -b + 2b. Factor 2x*2 - l - bx + 3x. 2(x - 1)(x + 1) Let u = 1 - -7. Let i = u - 5. Let 2y3 + 5 + y2 - 3y2 - 2y - i = 0. What is y? -1, 1 Let l(k) = 3k2 + 24k + 3. Let w be l(-8). What is c in -1/2c + 1/2c4 + cw - 1/2c5 + 1/2 - c2 = 0? -1, 1 Let c(j) be the third derivative of -j6/100 - 2j*5/75 + 13j*4/60 - 2j*3/5 + 37j2. Find b such that c(b) = 0. -3, 2/3, 1 Let t(r) be the second derivative of r6/15 - r5/5 + r4/6 + 7r. Factor t(x). 2x*2(x - 1)*2 Let d(s) be the first derivative of 5s*4/4 - 10s*3/3 - 5s*2/2 + 10s + 11. Factor d(m). 5(m - 2)(m - 1)(m + 1) Let t = -3/1082 + -30257/14066. Let c = -170/91 - t. Factor -cs*2 + 0 + 2s*4 + 8/7s*5 + 4/7s*3 + 0s. 2s2(s + 1)*2(4s - 1)/7 Let c(f) be the second derivative of f7/126 + 2f6/45 + f5/12 + f4/18 + f + 11. Let c(i) = 0. What is i? -2, -1, 0 Let a(m) be the third derivative of m5/120 + m*4/48 + 11m*2. Solve a(z) = 0 for z. -1, 0 Let n = 329/1005 - -2/335. Let k(v) be the second derivative of 0 - 1/36v*4 + v + nv*2 + 1/18v*3. Factor k(z). -(z - 2)(z + 1)/3 Suppose -4o = -4a + 20, 5a + 5 = 2o - 3o. Factor 0j2 + j4 - 1/2j3 + a - 1/2j*5 + 0j. -j*3(j - 1)2/2 Let z(i) be the third derivative of i7/630 - i6/216 + i5/540 + i*4/216 - 22i*2. Factor z(f). f(f - 1)*2(3f + 1)/9 Let k = 32 - 30. Let t(z) be the first derivative of -4/3z*k + 3 - 2/3z*3 + 8/3z. Let t(h) = 0. What is h? -2, 2/3 Let i be 10/(-6) + (-6)/(-9). Let c be (1/i)/((-2)/8). Factor -7/5p2 + 0 - 8/5p*3 - 2/5p - 3/5pc. -p(p + 1)*2(3p + 2)/5 Let p(v) be the third derivative of 2/15v*6 + 1/840v*8 - 32/15v*3 - 8/15v*5 - 2/105v*7 + 4/3v*4 + 0v - 3v2 + 0. Let p(c) = 0. Calculate c. 2 Let o(f) be the first derivative of f8/8400 + f7/4200 - f6/1800 - f5/600 + f3 - 3. Let k(x) be the third derivative of o(x). Factor k(u). u(u - 1)(u + 1)2/5 Let l = -1259/15 - 7/5. Let q = l + 86. Find a such that qa + 2/3a4 - 2/3a*3 - 2a2 + 4/3 = 0. -1, 1, 2 Let l(z) be the first derivative of -z4/18 + 4z3/27 + 7z*2/9 + 8z/9 + 7. Factor l(m). -2(m - 4)(m + 1)2/9 Let v(g) be the first derivative of -g7/42 - g6/40 + g5/30 + g*2 + 3. Let l(d) be the second derivative of v(d). Find n, given that l(n) = 0. -1, 0, 2/5 Let q be -11 - -5 - (-19)/3. Factor -qv*4 + 0 - 8/3v - 4v2 - 2v*3. -v(v + 2)*3/3 Let g(j) = j + 10. Let m be g(-8). Suppose mn - 5c - 11 = 0, 2n + 2c = 3c + 7. Let 6k2 + 14k*n - 8k*4 + 0k*4 + 4 - 14k - 2k4 = 0. Calculate k. -1, 2/5, 1 Let m(x) be the second derivative of x6/660 - x4/44 + 2x3/33 + x2/2 - 3x. Let u(g) be the first derivative of m(g). Determine i, given that u(i) = 0. -2, 1 Let n be (-2 - 1)/((-3)/10). Let q be 2/n - (-38)/10. Factor -6l*2 + 0l*2 - 1 - ql*3 - 2l4 + l4 - 4l. -(l + 1)4 Let a(k) = 4k3 - k2 + k. Let v be a(1). Determine l, given that -4 - 21l3 + 2l + 19l3 + 8l*2 - vl2 = 0. -1, 1, 2 Let b(z) be the second derivative of z7/4200 + z6/900 + z5/600 - z*3/3 - 4z. Let r(i) be the second derivative of b(i). Let r(h) = 0. What is h? -1, 0 Suppose 4b + 5l - 23 = -2, 2l = -b + 3. Let w = -5 + b. What is g in -g5 - 2gw - g5 + 0g4 + 0g*5 = 0? -1, 0 Let d(x) be the third derivative of 0x*3 + 6x*2 - 1/144x*4 + 0x + 0 + 1/360x5. Factor d(t). t(t - 1)/6 Let o = -1 + 5. Let q = 8 - o. Solve -2i5 + 0i5 - i3 + 2i4 + iq = 0. 0, 1/2, 1 Let c(y) = y2 - 5y - 4. Let d be c(6). Solve -4 + 2 + 4z2 - dz*2 = 0 for z. -1, 1 Let i(k) be the second derivative of -1/30k*4 + 1/105k*7 + 0k*2 + 0 - 1/50k*5 + 0k*3 + 1/75k*6 + 8k. Factor i(u). 2u2(u - 1)(u + 1)2/5 Let w(y) = -y2 + 7y + 2. Let c be w(7). Suppose 0k - 6 = -ck. Let 2o3 - 2o5 - o3 + ko3 - 2o = 0. Calculate o. -1, 0, 1 Let m(v) = -5v4 + 7v*3 + 4v*2 + 2v. Let p(n) = 6n4 - 8n*3 - 5n*2 - 3n. Let u(l) = 3m(l) + 2p(l). Factor u(s). -s*2(s - 2)(3s + 1) Let w(g) be the second derivative of -3g + 1/24g*3 - 1/80g*5 - 1/48g*4 + 1/8g*2 + 0. Factor w(t). -(t - 1)(t + 1)*2/4 Let s be 9/42 - (-8)/28. Let d(z) be the first derivative of -sz*2 + 0z*4 + 1 + 0z - 2/5z5 + 1/6z*6 + 2/3z*3. Factor d(q). q(q - 1)*3(q + 1) Let w be ((-11)/44-2)/(14/24). Factor 2/7 - 2/7f*3 + wf*2 - 6/7f. -2(f - 1)3/7 Let x = 49/12 - 23/6. Factor xj*4 - 1/4j - 1/4j2 + 1/4j*3 + 0. j(j - 1)(j + 1)2/4 Find k such that 2/7k*2 + 0 + 2/7k = 0. -1, 0 Suppose p - 13 = -5c, 2c + 5p + 0p = 19. Suppose -q - cq + 9 = 0. Factor -2/5y*q + 2/5y + 0y2 + 0. -2y(y - 1)(y + 1)/5 Let t(v) = -v*3 - 14v*2 + 16v + 20. Let y be t(-15). Let d = 0 - 0. Factor -2h5 + hy + dh3 + h3. -h*3(h - 1)(h + 1) Let b be 6/1 - (9 + -7). Factor g3 - 4g3 - gb + 2g4 - 6g*2 + 2g*4. 3g*2(g - 2)(g + 1) Determine r, given that -6r - 7 + 6 + 4r2 + 3 = 0. 1/2, 1 Let r(d) be the first derivative of -d4/22 - 4d3/33 + d2/11 + 4d/11 + 13. Factor r(t). -2(t - 1)(t + 1)(t + 2)/11 Let o(w) = -4w4 + 25w*3 - 17w*2 - 12w + 21. Let s = 1 + -7. Let t(q) = q*4 - 6q*3 + 4q*2 + 3q - 5. Let a(i) = so(i) - 26t(i). Factor a(v). -2(v - 2)(v - 1)*2(v + 1) Let m be (3 + 44/(-12))/(-4). Let v(a) be the second derivative of -ma3 + 0 - 1/24a*4 + a + 0a*2. Find p such that v(p) = 0. -2, 0 Factor 3j*2 + 6j + j*2 - 36 + 5j2 - j2 - 2j3. -2(j - 3)*2(j + 2) Factor -1058/3 - 2/3x2 + 92/3x. -2(x - 23)2/3 Let h = 12 - 10. Let r(g) be the second derivative of -1/3g*3 + hg + 0 + 1/10g5 + 1/6g4 - g2. Factor r(n). 2(n - 1)(n + 1)2 Let x(j) be the second derivative of -j7/147 + j*6/15 - 19j*5/70 + 25j*4/42 - 16j*3/21 + 4j*2/7 + 29j. Factor x(p). -2(p - 2)2(p - 1)3/7 Let z(j) be the first derivative of j6/420 + j5/210 - j4/84 - j3 - 1. Let n(v) be the third derivative of z(v). Solve n(b) = 0. -1, 1/3 Let k(f) be the second derivative of -f5/30 + f*4/18 - f. Factor k(y). -2y*2(y - 1)/3 Let o(x) be the second derivative of -x*4/90 - 2x3/45 + x2/5 + 7x. Factor o(i). -2(i - 1)(i + 3)/15 Let l(v) be the first derivative of v4/16 + v3/3 + 5v2/8 + v/2 + 4. Let l(p) = 0. Calculate p. -2, -1 Let d(y) be the first derivative of y7/4620 + y6/660 + y5/220 + y4/132 + y3/3 + 3. Let h(g) be the third derivative of d(g). Let h(t) = 0. What is t? -1 Let k(p) be the first derivative of 1/11p2 + 0p*3 - 1/22p*4 + 0p + 7. Factor k(w). -2w(w - 1)(w + 1)/11 Let t be ((-69)/(-92))/((-6)/(-4)). Factor 0 + 0p*2 + 1/4p*4 + 0p - tp3. p3(p - 2)/4 Let k(x) = -2x5 + 8x*4 - 4x*3 - 15x*2 - x - 5. Let h(m) = 3m*5 - 9m*4 + 3m*3 + 15m*2 + 6. Let f(j) = 5h(j) + 6k(j). Factor f(a). 3a(a - 2)(a + 1)*3 Suppose 184 = 4s - 476. Suppose -2n + 7n = s. Factor -nq + 6q + 54q3 + 36q*2 - 81q*4 + 3q. -3q(3q - 2)2(3q + 2) Find z, given that -64/5 + 12/5z*2 + 2/5z*3 + 0z = 0. -4, 2 Suppose 0 = -17c + 41 - 7. Let p(b) be the second derivative of 0b*3 + 0b*c + 0 - 1/36b*4 - 1/60b*5 - 2b. Solve p(j) = 0. -1, 0 Let m(t) = -t - 3 + 0t + 4. Suppose 9s - 4s = -25. Let h(w) = 2w*3 + 6w*2 + 11w - 3. Let n(z) = sm(z) - h(z). Factor n(q). -2(q + 1)3 Let p(y) = -y2 + 2y + 3. Let l(j) = -j2 + 2j + 4. Let s(x) = -4l(x) + 5p(x). Suppose s(a) = 0. Calculate a. 1 Let g(d) = -d*3 - 11d*2 - 9d + 13. Let i be g(-10). Let 1/2li - 1/4l + 1/4l4 + 1/4 - 1/2l*2 - 1/4l5 = 0. Calculate l. -1, 1 Let a(i) be the first derivative of -i3/7 - 3i2/7 + 9i/7 - 15. Find d such that a(d) = 0. -3, 1 Factor -25h2 + 32h2 - h - h5 - 9h3 + 5h*4 - h. -h(h - 2)(h - 1)*3 Let	{ "pile_set_name": "DM Mathematics" }
01, 349, 701 List the prime factors of 19522898. 2, 9761449 What are the prime factors of 829914384? 2, 3, 13, 263, 389 List the prime factors of 1442470991. 13, 29, 43, 101, 881 What are the prime factors of 82894896? 2, 3, 7, 82237 List the prime factors of 434583347. 11, 39507577 List the prime factors of 366124658. 2, 463, 395383 List the prime factors of 41332398. 2, 3, 6888733 What are the prime factors of 71268406? 2, 11, 3239473 List the prime factors of 292727131. 17, 29, 593767 List the prime factors of 31236714. 2, 3, 23, 197, 383 List the prime factors of 19023006. 2, 3, 479, 6619 List the prime factors of 1738011462. 2, 3, 11, 317, 83071 List the prime factors of 151898975. 5, 6075959 List the prime factors of 136160661. 3, 7, 13, 43, 1657 List the prime factors of 630804975. 3, 5, 17, 494749 What are the prime factors of 75687560? 2, 5, 13, 59, 2467 List the prime factors of 123214314. 2, 3, 20535719 What are the prime factors of 159413056? 2, 11, 367, 617 List the prime factors of 2414504308. 2, 599, 1007723 What are the prime factors of 23796351? 3, 2644039 What are the prime factors of 75090962? 2, 397, 94573 List the prime factors of 783291255. 3, 5, 52219417 List the prime factors of 49791377. 43, 47, 71, 347 List the prime factors of 90210344. 2, 7, 1610899 What are the prime factors of 563787? 3, 7, 19, 157 List the prime factors of 354205761. 3, 7, 13, 17, 10903 What are the prime factors of 2178406427? 29, 75117463 What are the prime factors of 4171366457? 19, 23, 9545461 What are the prime factors of 4813230796? 2, 11, 571, 191579 What are the prime factors of 355144269? 3, 118381423 List the prime factors of 161309183. 7, 19, 1212851 What are the prime factors of 985706503? 61, 2383, 6781 What are the prime factors of 29291358? 2, 3, 757, 6449 What are the prime factors of 53412353? 719, 74287 List the prime factors of 4245284462. 2, 79, 103, 260863 What are the prime factors of 47868364? 2, 11967091 What are the prime factors of 136492040? 2, 5, 3412301 List the prime factors of 248872094. 2, 124436047 List the prime factors of 13692093. 3, 409, 11159 What are the prime factors of 631156599? 3, 127, 552193 What are the prime factors of 894679654? 2, 11, 31, 1311847 What are the prime factors of 27122984? 2, 7, 484339 What are the prime factors of 11160858? 2, 3, 1860143 List the prime factors of 20949806. 2, 10474903 List the prime factors of 5629899533. 5629899533 What are the prime factors of 54479780? 2, 5, 2723989 What are the prime factors of 49665408? 2, 3, 13, 9949 List the prime factors of 77954304. 2, 3, 101503 What are the prime factors of 1057256816? 2, 7, 11, 191, 4493 List the prime factors of 4055990034. 2, 3, 79, 8556941 What are the prime factors of 53800400? 2, 5, 19, 7079 List the prime factors of 340637636. 2, 17, 23, 433, 503 What are the prime factors of 27704855? 5, 31, 47, 3803 What are the prime factors of 217830819? 3, 43, 401, 4211 List the prime factors of 101619020. 2, 5, 37, 53, 2591 What are the prime factors of 286689298? 2, 7, 2925401 What are the prime factors of 340482088? 2, 449, 94789 List the prime factors of 268162642. 2, 11, 2309, 5279 List the prime factors of 396699038. 2, 421, 471139 List the prime factors of 184914850. 2, 5, 59, 62683 List the prime factors of 388396262. 2, 23, 8443397 List the prime factors of 2264818384. 2, 103, 563, 2441 What are the prime factors of 1302093549? 3, 23, 698923 What are the prime factors of 59180786? 2, 7, 263, 16073 What are the prime factors of 48467145? 3, 5, 3231143 What are the prime factors of 589775802? 2, 3, 7, 11, 1276571 What are the prime factors of 309857180? 2, 5, 15492859 What are the prime factors of 6197680213? 57791, 107243 What are the prime factors of 23978734? 2, 13, 61, 1163 List the prime factors of 60227148. 2, 3, 5018929 What are the prime factors of 8805124? 2, 2201281 What are the prime factors of 272802579? 3, 7, 1571, 8269 What are the prime factors of 567163? 197, 2879 List the prime factors of 34356581. 7, 89, 55147 What are the prime factors of 296214474? 2, 3, 49369079 List the prime factors of 429123585. 3, 5, 11, 29, 89681 What are the prime factors of 419410531? 419410531 List the prime factors of 3496672983. 3, 67, 727, 23929 List the prime factors of 5127213568. 2, 3109, 3221 List the prime factors of 78337684. 2, 19, 1030759 List the prime factors of 2014082619. 3, 601, 1117073 What are the prime factors of 675233916? 2, 3, 7, 164051 List the prime factors of 1529438. 2, 764719 What are the prime factors of 2990745237? 3, 257, 3879047 What are the prime factors of 219205284? 2, 3, 157, 116351 List the prime factors of 75293033. 257, 292969 What are the prime factors of 17562924? 2, 3, 41, 73, 163 What are the prime factors of 7694567344? 2, 577, 833467 What are the prime factors of 33231769? 33231769 List the prime factors of 6703654667. 34439, 194653 List the prime factors of 587305725. 3, 5, 947, 8269 List the prime factors of 8850812. 2, 17, 73, 1783 What are the prime factors of 1813307582? 2, 643, 1410037 What are the prime factors of 53955504? 2, 3, 124897 What are the prime factors of 5445822121? 223, 3323, 7349 List the prime factors of 76333937. 76333937 List the prime factors of 299429972. 2, 74857493 What are the prime factors of 152081168? 2, 19, 53, 9439 What are the prime factors of 128824791? 3, 47, 347, 2633 List the prime factors of 498209644. 2, 124552411 List the prime factors of 281765139. 3, 193, 486641 List the prime factors of 2533709085. 3, 5, 503, 335813 What are the prime factors of 44700129? 3, 61, 81421 What are the prime factors of 52321123? 53, 987191 List the prime factors of 613370356. 2, 103, 1488763 List the prime factors of 1256728481. 83, 241, 62827 List the prime factors of 67910512. 2, 17, 249671 List the prime factors of 5522390125. 5, 7, 6311303 List the prime factors of 3258757073. 11, 13, 22788511 What are the prime factors of 1356320702? 2, 11, 5604631 List the prime factors of 1203596224. 2, 59, 318749 What are the prime factors of 410299903? 13, 613, 51487 What are the prime factors of 73024396? 2, 83, 219953 List the prime factors of 46881719. 29, 1616611 What are the prime factors of 75902444? 2, 179, 227, 467 List the prime factors of 439763370. 2, 3, 5, 2837, 5167 List the prime factors of 127173828. 2, 3, 1291, 8209 List the prime factors of 41318172. 2, 3, 7, 59, 397 List the prime factors of 95787951. 3, 7, 4561331 List the prime factors of 230081092. 2, 4451, 12923 What are the prime factors of 304081345? 5, 829, 73361 What are the prime factors of 652394464? 2, 2521, 8087 What are the prime factors of 518010081? 3, 172670027 What are the prime factors of 31901010? 2, 3, 5, 17, 71, 881 List the prime factors of 3957657875. 5, 83, 381461 List the prime factors of 113635882. 2, 56817941 What are the prime factors of 101441402? 2, 50720701 What are the prime factors of 269469125? 5, 17, 173, 733 What are the prime factors of 107406866? 2, 7, 227, 33797 List the prime factors of 198382136. 2, 24797767 What are the prime factors of 52004292? 2, 3, 17, 19, 13417 List the prime factors of 6330494311. 149, 42486539 List the prime factors of 79821855. 3, 5, 61, 359 List the prime factors of 5156163961. 13, 396627997 What are the prime factors of 224833943? 224833943 List the prime factors of 35034761. 89, 393649 What are the prime factors of 368345700? 2, 3, 5, 83, 4931 List the prime factors of 392790850. 2, 5, 67, 117251 List the prime factors of 3365181543. 3, 23, 1153, 42299 List the prime factors of 15876374. 2, 43, 184609 List the prime factors of 947163081. 3, 315721027 What are the prime factors of 23317462? 2, 7, 1665533 What are the prime factors of 1345398086? 2, 317, 2122079 List the prime factors of 400596606. 2, 3, 22255367 What are the prime factors of 12391368? 2, 3, 11, 17, 251 What are the prime factors of 4311322257? 3, 11, 73, 233, 7681 List the prime factors of 10297709. 337, 30557 What are the prime factors of 173990422? 2, 61, 1426151 What are the prime factors of 1457550794? 2, 7, 17, 6124163 List the prime factors of 24696362. 2, 43, 287167 List the prime factors of 1205180488. 2, 19, 1753, 4523 What are the prime factors of 613422	{ "pile_set_name": "DM Mathematics" }
, -93689? -110159 What is next in -29755, -59494, -89221, -118930, -148615, -178270, -207889? -237466 What is next in -51642853, -103285703, -154928547, -206571385, -258214217, -309857043, -361499863? -413142677 What comes next: -6700745, -13401522, -20102297, -26803070, -33503841, -40204610? -46905377 What is the next term in -557216, -557290, -557416, -557594, -557824? -558106 What is the next term in 40481, 80991, 121499, 162005, 202509? 243011 What is the next term in -344, -1316, -2866, -4940, -7484, -10444, -13766? -17396 What is the next term in -1932, -3978, -5974, -7908, -9768, -11542, -13218, -14784? -16228 What comes next: 51364, 49644, 47924, 46204? 44484 What is next in 2516, 4925, 7154, 9113, 10712, 11861? 12470 What is next in -109019, -109558, -110097, -110636, -111175, -111714? -112253 What is next in 18275, 36601, 54925, 73247, 91567, 109885? 128201 What is the next term in -345399, -345566, -345733, -345900, -346067, -346234? -346401 What is the next term in -38327075, -76654147, -114981219, -153308291, -191635363? -229962435 What is next in -7217, -16952, -26679, -36398, -46109, -55812, -65507? -75194 What comes next: 103164, 103277, 103388, 103497, 103604, 103709? 103812 What is next in -43845, -39458, -35071, -30684? -26297 What comes next: -4371, -8691, -12981, -17241, -21471, -25671? -29841 What comes next: 219397, 218730, 218063, 217396, 216729, 216062? 215395 What is the next term in 84756, 169160, 253218, 336936, 420320, 503376, 586110, 668528? 750636 What is next in -5857534, -5857535, -5857536? -5857537 What is the next term in -6721, -13684, -20721, -27832? -35017 What comes next: -25113, -50280, -75447, -100614, -125781? -150948 What is next in -9506, -9495, -9482, -9461, -9426, -9371, -9290, -9177? -9026 What is the next term in 4663, 4659, 4659, 4657, 4647, 4623, 4579? 4509 What is the next term in -15938, -18835, -21732, -24629, -27526? -30423 What is next in 122643, 490576, 1103805, 1962336, 3066175, 4415328, 6009801? 7849600 What is the next term in 8111, 16204, 24283, 32348, 40399? 48436 What is next in -607, -1910, -4545, -9160, -16403? -26922 What is next in 43545, 348744, 1177165, 2790420, 5450121, 9417880, 14955309, 22324020? 31785625 What is the next term in -477607, -477826, -478045? -478264 What is next in -16654, -30362, -44070? -57778 What comes next: 4180929, 8361856, 12542783, 16723710? 20904637 What is next in -4928, -19547, -43860, -77867? -121568 What is next in 120325, 120411, 120497, 120583, 120669, 120755? 120841 What comes next: 25774, 53776, 81776, 109774, 137770? 165764 What is next in 99832, 199620, 299408, 399196? 498984 What is the next term in 5029883, 10059762, 15089641, 20119520, 25149399? 30179278 What is next in -2316, -14427, -46122, -107193, -207432, -356631? -564582 What is the next term in 673, 349, -29, -473, -995, -1607? -2321 What is next in 142296434, 284592865, 426889296, 569185727, 711482158? 853778589 What is next in 2764, 10036, 22172, 39184, 61084, 87884, 119596, 156232? 197804 What is next in 272987, 545974, 818961, 1091948, 1364935, 1637922? 1910909 What comes next: 14159671, 56638698, 127437077, 226554808, 353991891, 509748326, 693824113? 906219252 What comes next: 1591, 3110, 4629, 6148? 7667 What comes next: 131041, 131275, 131509, 131743? 131977 What is next in 23789, 21024, 18257, 15488, 12717, 9944? 7169 What is the next term in -4089880, -16359514, -36808904, -65438050, -102246952, -147235610? -200404024 What is next in -3778, -14422, -32112, -56806, -88462? -127038 What comes next: -20715, -41335, -61957, -82587, -103231? -123895 What comes next: -228575, -232811, -237047, -241283, -245519? -249755 What is the next term in 1723495, 1723421, 1723347, 1723273? 1723199 What comes next: -1334, -1424, -270, 2128, 5770, 10656, 16786? 24160 What comes next: -18761, -37504, -56235, -74954? -93661 What is the next term in 1844, 9084, 21748, 39842, 63372? 92344 What is next in 4064663, 4064647, 4064621, 4064585, 4064539, 4064483, 4064417? 4064341 What is the next term in 11349, 20893, 30435, 39975, 49513? 59049 What is next in 37837, 38273, 38695, 39097, 39473, 39817, 40123, 40385? 40597 What comes next: 1986, 2665, 3192, 3561, 3766, 3801? 3660 What is the next term in -132148, -264227, -396208, -528055, -659732? -791203 What is next in 468, 1156, 2084, 3240, 4612, 6188, 7956? 9904 What is next in -5094, -9945, -14782, -19611, -24438, -29269, -34110, -38967? -43846 What is next in 132638821, 265277646, 397916473, 530555302? 663194133 What is the next term in 983645, 983656, 983667? 983678 What comes next: 33615835, 33615836, 33615837, 33615838, 33615839, 33615840? 33615841 What comes next: -349911, -349499, -348813, -347853? -346619 What is the next term in -37215, -37220, -37229, -37242, -37259, -37280? -37305 What is next in 74697, 75167, 75955, 77067, 78509? 80287 What is the next term in 579, 1159, 1719, 2259, 2779, 3279, 3759? 4219 What is the next term in -286, 2625, 5524, 8405, 11262, 14089? 16880 What comes next: -4379569, -4379547, -4379505, -4379437, -4379337, -4379199, -4379017, -4378785? -4378497 What is the next term in 28633, 229077, 773143, 1832641, 3579381, 6185173? 9821827 What comes next: -233825, -233673, -233417, -233057, -232593, -232025, -231353? -230577 What comes next: -85, -275, -367, -169, 511, 1865, 4085? 7363 What comes next: 959, 1796, 2659, 3560, 4511, 5524, 6611, 7784? 9055 What comes next: -10099355, -10099356, -10099357, -10099358? -10099359 What comes next: 2239149, 2239165, 2239181, 2239197, 2239213, 2239229? 2239245 What is the next term in -12047, -47977, -107861, -191699? -299491 What is next in -3496236, -6992506, -10488776, -13985046, -17481316? -20977586 What is the next term in 85767717, 85767716, 85767715? 85767714 What is next in 373850, 370304, 366748, 363176, 359582? 355960 What is next in 107, 333, 735, 1319, 2091, 3057, 4223? 5595 What is the next term in -311116715, -311116716, -311116717, -311116718? -311116719 What comes next: -386, -340, -470, -776, -1258, -1916? -2750 What is the next term in 2089, 4308, 6537, 8776, 11025? 13284 What is the next term in 2786, 5874, 9256, 12932, 16902, 21166, 25724? 30576 What is the next term in 544, 360, -150, -1154, -2820, -5316, -8810, -13470? -19464 What is the next term in 201, 493, 939, 1563, 2389? 3441 What is the next term in -720, -905, -1088, -1269, -1448? -1625 What is next in -3572782, -7145555, -10718328, -14291101, -17863874, -21436647? -25009420 What comes next: -373089412, -746178827, -1119268242, -1492357657, -1865447072, -2238536487? -2611625902 What comes next: 39246, 78448, 117488, 156366, 195082, 233636, 272028? 310258 What comes next: -57721, -57582, -57445, -57310, -57177, -57046? -56917 What is next in 37733, 37538, 37239, 36842, 36353? 35778 What comes next: -81994, -79113, -76232, -73351, -70470? -67589 What comes next: 30940787, 30940786, 30940785, 30940784? 30940783 What is the next term in 67066, 134074, 200962, 267670, 334138, 400306? 466114 What is the next term in -2488, -2766, -3220, -3850, -4656? -5638 What comes next: -8580, 1846, 19220, 43542, 74812? 113030 What is the next term in -49451, -49833, -50209, -50579, -50943, -51301? -51653 What is next in -1470107, -2940257, -4410419, -5880599, -7350803? -8821037 What is next in 431921, 431912, 431903, 431894, 431885, 431876? 431867 What comes next: 1788, 5057, 9814, 16059, 23792, 33013? 43722 What comes next: -289222, -288963, -288532, -287929, -287154, -286207? -285088 What is the next term in -17419189, -17419186, -17419181, -17419174, -17419165, -17419154, -17419141? -17419126 What comes next: 83565, 83071, 82577, 82083, 81589, 81095? 80601 What comes next: 16435321, 16435324, 16435329, 16435336, 16435345, 16435356, 16435369? 16435384 What is the next term in 24990406, 49980819, 74971232, 99961645, 124952058? 149942471 What is next in -5397, -21079, -46321, -80385, -122533? -172027 What comes next: 5888, 24009, 54354, 96917, 151692, 218673? 297854 What is next in 750351185, 750351184, 750351183? 750351182 What is next in -43558, -42866, -42172, -41476, -40778, -40078? -39376 What comes next: -49151, -49175, -49195, -49211? -49223 What is next in 1687, 1813, 1977, 2179, 2419, 2697? 3013 What	{ "pile_set_name": "DM Mathematics" }
f). -5f + 8 Let h(d) = -12d + 1. Let v(w) = -w - 1. Determine -h(q) + v(q). 11q - 2 Let q(t) = 4t - 6. Let w(u) = -3u + 5. Let f = 12 - 7. Let i(v) = fw(v) + 4q(v). Let r(z) = -6z + 3z + 0z - 4. What is 4i(s) + r(s)? s Let j = -4 - -3. Let w(s) = -3s*3 + 4s*2 + 4s + 4. Suppose 4 = -4h + 6h. Let o(p) = hp2 + 1 - 3p2 - p3 + p + 2p2. What is jw(u) + 4o(u)? -u3 Let w(m) = 5m*2 - 2m. Let b(r) = -5r2 + 3r. Determine 2b(k) + 3w(k). 5k2 Let u(c) be the third derivative of 11c*4/24 - 7c*3/3 - 6c*2. Let m = -4 + 7. Let h(q) = 4q + mq - 5 - 3q. Determine 17h(s) - 6u(s). 2s - 1 Let m(n) be the second derivative of n4/24 + n3/6 + 2n*2 - 5n. Let b(i) be the first derivative of m(i). Let w(o) = -o - 1. Give -5b(a) - 4w(a). -a - 1 Let b(w) = -w*3 + 6w*2 - 3w - 4. Let g be b(5). Let c(s) = -14s + 11 - 17s*2 - 15s + 18s. Let q(y) = 9y*2 + 6y - 6. Calculate gc(h) + 11q(h). -3h2 Let d(o) = -o + 30. Let y(h) = h - 1. Give d(w) + 2y(w). w + 28 Let d(z) = 3z3 - 7z - 5. Let f(p) be the second derivative of 2p5/5 - 10p*3/3 - 7p*2 + p + 45. What is -14d(a) + 5f(a)? -2a*3 - 2a Let y(t) = -9t - 3. Let b(z) = 4z + 1. Give -5b(g) - 2y(g). -2g + 1 Let u(p) = -7p - 5. Suppose -8m + 3m - 25 = 0. Let i(o) = 11o + 8. Calculate mi(r) - 8u(r). r Let a(b) = 8b - 62. Let v(i) = 3i - 21. Determine -4a(u) + 11v(u). u + 17 Let p(m) = -2m*3 + 3m*2 - 2m. Let i(u) = -6u3 + 9u*2 - 7u. Give -2i(q) + 7p(q). -2q3 + 3q*2 Let q(n) = n - 1. Let v(g) = -1. What is q(h) - v(h)? h Let w(c) be the first derivative of 10c*2 + 8c - 67. Let p(d) = 7d + 3. What is 8p(m) - 3w(m)? -4m Let t(o) = o - 20. Let j(z) = 1. What is -4j(q) - t(q)? -q + 16 Let b(k) = 3k + 4. Let h(g) be the first derivative of 7g2/2 + 9g + 26. Determine -5b(l) + 2h(l). -l - 2 Let x(i) = -i*3 - 4i*2 - 4. Suppose 0s = 3s - 3. Let u(p) = -5p*2 - 5. Let a(m) = 4m*2 + 4. Let g(z) = -4a(z) - 3u(z). Determine sx(r) - 4g(r). -r3 Let f(k) = -9k*2 - 5k - 5. Let w(h) = 8h2 + 5h + 5. Let i(y) = -3f(y) - 2w(y). Let r(l) = -39l2 - 18l - 18. Determine -18i(s) - 5r(s). -3s2 Let x(v) = 5. Let p(h) = -h + 24. What is -2p(s) + 11x(s)? 2s + 7 Let w(m) = m*2 + m. Let b(p) = 8p*2 + 17p. Calculate b(a) - 6w(a). 2a*2 + 11a Let p(d) = -9d2. Let l(o) = 5o*2. Determine 5l(f) + 3p(f). -2f*2 Let k(z) = -10z*3 + 7z*2 + 7z + 7. Let h(l) = -9l3 + 6l*2 + 6l + 6. Let y(d) = 7h(d) - 6k(d). Let u(n) = 10n3. Calculate -3u(v) - 8y(v). -6v*3 Suppose n = -0n + 2. Suppose -nc = 3t - 2t, -5c - 11 = -3t. Let m(s) = -s2 + s - 1. Let k(b) = -b3 - 5b*2 + 6b - 7. Give ck(o) + 6m(o). o3 - o2 + 1 Let p(h) = 8h - 8. Suppose v - 3v = z - 34, -2 = -2v. Suppose a - 3l = 0, 0 = 4a + 2l + 2l - z. Let s(m) = 7m - 7. Calculate ap(n) - 7s(n). -n + 1 Let g(z) = 3z2 - 3z + 2. Let v(s) = s - 1. Determine -g(y) - 4v(y). -3y*2 - y + 2 Suppose 2c - 16 = 6c. Let k(v) = -v2 - v + 1. Let q(a) = 5a*2 + a - 7. Let g(b) = 6k(b) + q(b). Let u(z) = 2z2 + 6z + 2. What is cg(s) - 3u(s)? -2s2 + 2s - 2 Let d(p) = p + 1. Let w(h) = -2h - 3. Let m be -1(-3)/(-7) + (-418)/(-77). Calculate mw(v) + 15d(v). 5v Let o(t) = -3t*2 + 2t. Suppose 0 = -5d - 40 + 15. Let b(z) = 5z*2 - 5z. Calculate do(s) - 2b(s). 5s2 Suppose -3m + 7m = 12. Suppose 0 = -2y + m + 1. Let d(z) = -3 + 10z + 0 - 13. Let r(x) = -2x + 3. Determine yd(o) + 11r(o). -2o + 1 Suppose 2w + w - 6 = 0, 1 = x + 2w. Let t(q) be the first derivative of -2q + 2 + 1/2q2. Let c(h) = -h + 1. What is xc(n) - 2t(n)? n + 1 Let b(o) be the third derivative of o4/24 - 9o*2. Let h(v) = v. Let m be 5/(-2)4/(-2). Calculate mh(i) - 6b(i). -i Let h(p) = -p*2 + 9p + 7. Suppose 2k + 4 = -6. Let z(f) = -f2 + 27f - 33. Let c be z(26). Let q(i) = i*2 - 13i - 10. Calculate ch(l) + kq(l). 2l2 + 2l + 1 Let g(b) = 5b - 1. Let w = 5 + -18. Let z = w + -1. Let j(p) = -15p + 2. Let s(a) = 14a - 2. Let x(u) = -4j(u) - 6s(u). What is zg(f) - 3x(f)? 2f + 2 Let r(o) = 13o3 + 7o*2 - 7o + 1. Let c(i) = -7i3 - 4i*2 + 4i - 1. What is -7c(l) - 4r(l)? -3l3 + 3 Let a(w) = -7w + 17. Let x(b) be the first derivative of -3b2/2 + 8b + 3. Give -6a(l) + 13x(l). 3l + 2 Let s(r) = -11r*3 - 2r*2 - 2r - 2. Let t(h) = 44h3 + 9h*2 + 9h + 9. Give -9s(b) - 2t(b). 11b3 Let l(h) = -h3 - h2. Let v(g) be the first derivative of g7/210 + g6/72 + 2g*3/3 - 2. Let n(o) be the third derivative of v(o). Give -5l(a) - n(a). a*3 Let f(g) = 2g*2 + 5g - 5. Let z(o) = -12o2 - 22o + 22. Let d(x) = x*2 + 0x + 1 + x - 1 - 1. Let m(b) = -6d(b) - z(b). Determine 16f(r) - 5m(r). 2r2 Let o(w) = w3 + 1. Let d(s) = 56s3 + 42. Give -d(z) + 42o(z). -14z3 Let h(l) = l - 5. Let k(f) = f - 2. Determine -4h(q) + 9k(q). 5q + 2 Let z(q) = -q + 1. Let x(r) = -10r - 5. Determine x(l) + 5z(l). -15l Let c(p) = -17p*2 + 14p + 11. Let d(o) = -8o2 + 7o + 5. Let g(z) = 4c(z) - 9d(z). Let w(x) = -x*2 + 2x. Let r = 7 - 0. Calculate rw(i) + 2g(i). i*2 - 2 Let m(j) be the first derivative of -3/2j*4 + 7/2j*2 - 2 + 0j - 7/3j3. Let r(s) = 5s*3 + 6s*2 - 6s. Let z = 23 + -16. What is zr(u) + 6m(u)? -u*3 Let m(w) = -3w*3 - 5w*2 - 5w. Let i(q) = 3q3 + 6q*2 + 6q. Let p be (-3)/(-9)3 + 6. Suppose ph + 0h + 35 = 0. Determine hi(j) - 6m(j). 3j3 Let d(g) = g2 - 6g. Let i(b) be the second derivative of 5b*4/6 - 55b*3/6 + 15b. Give -55d(h) + 6i(h). 5h2 Suppose -v - 2 = 2y, -y - 1 = 3v - 15. Let x(h) = 4h*3 - 6h*2 + 6h + 7. Let o(m) = -5m3 + 7m*2 - 7m - 8. What is vo(k) + 7x(k)? -2k3 + 1 Let m(h) = 24 + h - 3h2 + 23 - 45. Let a(y) = y2 - 1. What is -4a(s) - 2m(s)? 2s2 - 2s Let t(f) = f*2 - 7f - 1. Let k(o) = -2o2 + 15o + 3. Determine -6k(j) - 13t(j). -j*2 + j - 5 Let m(q) = -10q - 16. Let b(r) = 7r + 11. Give -7b(t) - 5m(t). t + 3 Let k(x) = x2 - x + 2. Let d(b) = -2b*2 + 2b - 3. Suppose -v - 8 + 2 = 0. Let z(w) = -w - 9. Let o be z(v). What is od(q) - 5k(q)? q2 - q - 1 Let n(f) = -f3 + f*2 - f. Suppose 0 = -2d - 0d + 12. Let r(z) = -5z*3 + 4z*2 - 6z. What is dn(y) - r(y)? -y3 + 2y2 Let u(v) = -v2 + 2. Let i(k) = -k*2 + 5. Calculate -2i(n) + 5u(n). -3n*2 Let t(j) = j + 1. Let f(c) = 3c. Give 2f(w) - 4t(w). 2w - 4 Let z(h) = -6h - 114. Let b(i) = 4i + 76. What is 8b(g) + 5z(g)? 2g + 38 Let y(t) = -3t - 20. Let m(h) = h + 7. Let r be 3 + -1(-28)/(-4). Give ry(w) - 11m(w). w + 3 Let w(v) = -2v - 31. Let b(g) = -g + 1. What is 4b(a) - w(a)? -2a + 35 Let h(n) = n3 - 4n - 2. Let w be (-77)/(-6) + (-4)/(-24). Let r(a) = 7 - 3a3 - 20a*2 + 20a*2 + wa. Give -7h(v) - 2r(v). -v*3 + 2v Let f(t) = 2t3 - 2t*2 + 2t. Let s(u) = -u*2 + u - 1. What is -f(k) + 2s(k)? -2k3 - 2 Let z(a) be the first derivative of 4a*4 + 7a*3/3 + 7a + 1. Let v(g) = -5g3 - 2g*2 - 2. Determine 7v(w) + 2z(w). -3w3 Let i(h) = h3 - 2h2 - 5h + 7. Let x(r) = -r*3 + 2r*2 + 4r - 6. Determine 4i(p) + 5x(p). -p*3 + 2p2 - 2 Let w(f) = f3 - f*2. Let o(t) = 3t*3 - 5t*2 + t. Calculate o(j) - 2w(j). j*3 - 3j*2 + j Let r(p) = -2p - 4. Let f(a) = 8a + 17. What is 6f(d) + 26r(d)? -4d - 2 Let w(z) = -3z2 + 2. Suppose -h + 5t = -4, 4 = -t + 5t. Let j(s) = -13s*2 + 9. Determine hw(k) - 2j(k). -k2 Let z(y) = 5y - 2. Let o(c) = -13c + 6. Let h(v) = 53v - 25. Let m(f) = 2h(f) + 9o(f). Determine 6m(b) + 13z(b). -b - 2 Let s(t) = 6t. Let q be ((-48)/(-8))/(1 + -2). Let d(g) be the third derivative of -7g*4/24 + 5g*2. Determine qs(h) - 5d(h). -h Let q(m) = 31m*2 - 5m. Let r(n) = -46n2 + 8n. Give -8q(c) - 5r(c). -18c2 Let f(j) = j3 + 3j*2 + 17j + 3. Let a(p) = 2p3 + 7p*2 + 34p + 7. Calculate -3a(q) + 7f(q). q*3 + 17q Let i = 6 + -4. Suppose ib - 7 = -1. Let c(h) = -2 + 2h - 6h - 2h*2 + 0h2. Let x(w) = w2 + 3w + 1. Determine bc(t) + 4x(t). -2t*2 - 2 Let m(k) = -3k*3 - 5k*2 + 7k - 5. Let h(z) = -z*3 + 15z*2 + 35z - 22.	{ "pile_set_name": "DM Mathematics" }
11.22 - 11.21477. What is k rounded to 3 dps? 0.005 Let n = -46.18 - -0.18. Let k = n - -46.019. Round k to two decimal places. 0.02 Let w(u) = 1003u - 4. Let y be w(-2). What is y rounded to the nearest one hundred? -2000 Let c = -0.35 - -0.1. Let a = c - -0.302. Let x = -0.0557 + a. Round x to three dps. -0.004 Let v = -166 - -101. What is v rounded to the nearest ten? -70 Let p = 33 - 7.9. Round p to zero dps. 25 Let n = -6 - -4. Let t be 0 - n6/4. Suppose -tm - 3k - 117 = 0, -3k - 83 = 4m + 75. Round m to the nearest ten. -40 Let s = -106.00000051 + 106. What is s rounded to 7 dps? -0.0000005 Let y(h) = -32917h2 + 4h. Let i be y(3). Let r be 2/(-3) - (-2823837)/9. Let k = i - r. What is k rounded to the nearest 100000? -600000 Let q = -1411 + 765. Let p = -450 - q. Let n = 856 - p. What is n rounded to the nearest 100? 700 Let g = -0.7 - -0.70000112. Round g to 7 dps. 0.0000011 Let y = -1.8 + -16.6. Let a = -16.23 - y. What is a rounded to one dp? 2.2 Suppose -2a - 669 = -b, 3a - 554 + 1557 = 2b. Let x be (a/(-3))/((-4)/(-240)). What is x rounded to the nearest 1000? 7000 Let q = 29.6 - 34.63. Let h = 0.03 + q. Let d = 5.21 + h. What is d rounded to one dp? 0.2 Let a = 152 + -152.0134. Round a to three dps. -0.013 Let g be -895998 - 6/(3/(-1)). Let o be 2/7 - g/14. What is o rounded to the nearest ten thousand? 60000 Let m = 0.856 - 38.956. Round m to 0 decimal places. -38 Let r = -5999271 - -6000282.5771. Let w = -921.573 + r. Let m = -90 + w. Round m to three dps. 0.004 Let j(g) = -g2 + 6g + 4. Let m be j(6). Let l(p) = -15p2 - 22p*2 - 2p + 5p. Let k be l(m). What is k rounded to the nearest 100? -600 Let q = 3.04 + -3. Let w = -0.042 + q. Round w to two dps. 0 Let d be (-500)/(2/(-1424)2). What is d rounded to the nearest 10000? 180000 Let p(d) = 7d3 - 3d*2 - 4d - 4. Let u(j) = j*2 + 5j - 2. Let s be u(-6). Let a be p(s). Round a to the nearest one hundred. 400 Let q(h) = 2h3 + h2 - 2h + 1. Let l be q(1). Suppose lt + 32341 = -21659. What is t rounded to the nearest 10000? -30000 Let v = 0.7 + -0.6. Let i = v - 0.0944. What is i rounded to 3 decimal places? 0.006 Let i = -391 + 91. What is i rounded to the nearest 100? -300 Suppose -3y - 667618 = 892382. What is y rounded to the nearest one hundred thousand? -500000 Let r = 251 - 250.999155. What is r rounded to four dps? 0.0008 Let t = -0.009 + -152.991. Let m = 14777346236.99999889 + -14777346084. Let y = t + m. What is y rounded to 7 dps? -0.0000011 Let d(a) = -3a + 6. Let o be d(6). Let z be o/20 - (-2610)/(-25). Round z to the nearest 10. -110 Let i = -527048 - -1015937. Let k(d) = d2 - 1 + 2d - 2 + d + id3 - 2d. Let g be k(-3). What is g rounded to the nearest 1000000? -13000000 Let h be -4(-4)/163. Let d be (-1)/h + (-12420006)/(-18). What is d rounded to the nearest one hundred thousand? 700000 Let u(v) = -7v2 + 15v - 2. Let k be u(17). What is k rounded to the nearest 100? -1800 Let p = 10154755.999953 + -10154862. Let q = 177 + -283. Let n = q - p. Round n to five decimal places. 0.00005 Let m = -83.999939 + 84. Round m to five decimal places. 0.00006 Let u = -0.04606 - 0.35402. Let h = 42.6 - 43. Let d = u - h. Round d to five dps. -0.00008 Let n = -141.0000267 + 141. Round n to six dps. -0.000027 Let b = -275.91181 + 312.9116. Let s = b - 37. What is s rounded to five decimal places? -0.00021 Let l = 2 + -1. Suppose 2k = -11 - l. Let z be (-84)/6k/(-7). What is z rounded to the nearest ten? -10 Let j = 919.99579 + -920. What is j rounded to four decimal places? -0.0042 Suppose 0 = 2b + 3b. Suppose -n - 14999993 = -by - 5y, -3y + 8999993 = -2n. Let m be 6/24 - y/(-4). What is m rounded to the nearest one hundred thousand? 800000 Let q = -0.63 - 0.42. Round q to 1 dp. -1.1 Let i = -0.006291 - 48.047709. Let z = 49.19 - 1.19. Let g = z + i. What is g rounded to two dps? -0.05 Let p = 18 + 3. Let b = -15.3 + p. Round b to zero decimal places. 6 Let c = 62.0079 - 62. Round c to three decimal places. 0.008 Let q = 0.82 - -0.4. What is q rounded to 1 decimal place? 1.2 Let x = -20.39 - -19. Let w = x + 1.504. What is w rounded to 2 decimal places? 0.11 Let r = -8.795 - -9.2289. Let y = -0.43 + r. Round y to 3 dps. 0.004 Let u(k) = 2k3 - 4k*2 - 3k + 6. Let y be u(4). Let q be (y/(-4))/((-2)/12). What is q rounded to the nearest 10? 90 Let h = -51 + 50.9728. What is h rounded to three dps? -0.027 Let n = 157 + -69. Let i = n + -47. What is i rounded to the nearest ten? 40 Suppose -5b - 6c + 3229 = -3c, 3c - 641 = -b. Round b to the nearest one hundred. 600 Let k = -64 + 63.999947. What is k rounded to five decimal places? -0.00005 Let w = -3.71 + -4.31. Let j = w + 8. Let x = -0.42 - j. Round x to one decimal place. -0.4 Let w = 14 - 14.21. Let n = w + 0.21144. Round n to four dps. 0.0014 Let s = -54.6 + 45. Let l = s + 0.8. What is l rounded to 0 dps? -9 Let y = -14.19 - -26.06. What is y rounded to the nearest integer? 12 Let y = 3.26696 + -3.207. Let a = 0.06 - y. What is a rounded to 5 dps? 0.00004 Let d = -0.6400195 + 0.64. Round d to 6 decimal places. -0.00002 Let s = 96 - 96.0000249. What is s rounded to 6 dps? -0.000025 Let s = 40.0275 - 40.22750064. Let w = 0.2 + s. What is w rounded to seven decimal places? -0.0000006 Let x = -84.16 + -1.84. Let h = -3.105 - -88.365. Let d = h + x. What is d rounded to 1 dp? -0.7 Let g = 55406077108 + -55406077058.980399789. Let c = g - 0.019592811. Let b = c + -49. Round b to 6 decimal places. 0.000007 Let g = 13 - 8. Let d be g/2 + 1/(-2). Suppose 2h - 3y = -13753165 - 17846844, 0 = -dh + y - 31600003. What is h rounded to the nearest 1000000? -16000000 Let g = -0.056 - 0.006. Let q = 528 + -527.9351. Let y = g + q. Round y to 3 decimal places. 0.003 Suppose 3 = 2o - 5. Suppose -2u - s = os + 17, -25 = 5u - 5s. Let h be 3 + (-2)/(u/8991). What is h rounded to the nearest 1000? 3000 Let d = 36 - 35.999848. Round d to 5 dps. 0.00015 Let m = 18 + -17.98. Let u = -0.02023 + m. Round u to four decimal places. -0.0002 Let m(s) = -1110s - 10. Let j be m(-1). What is j rounded to the nearest one hundred? 1100 Let q = -252.8 - -279.54. Let y = -0.09 + 27.09. Let z = q - y. What is z rounded to 1 dp? -0.3 Let g = -4.5 + 2. Let l = -3.14 - g. Let f = l + 0.6399917. What is f rounded to 6 decimal places? -0.000008 Let x = 0.53 + -0.5005. What is x rounded to 2 decimal places? 0.03 Suppose 188 - 488 = 12h. Round h to the nearest integer. -25 Let z be 7/((-14)/(-130636)) - 3. Suppose -z + 475315 = 5l. What is l rounded to the nearest 10000? 80000 Let c = 0 + 0.243. Round c to 2 decimal places. 0.24 Let p(u) = u + 13480u*3 - 2u - 1 + 42446u3. Let a be p(-3). Round a to the nearest one hundred thousand. -1500000 Let p(v) = v2 - 7v - 12. Let r be p(9). Let u = 9 - r. Suppose 12 = uq + q, 2q = -5t - 40499994. What is t rounded to the nearest 1000000? -8000000 Let b = -73.00155 + 73. Round b to 4 decimal places. -0.0016 Let k = -136011443 - -136034763.9998. Let j = k + -23319. Let u = j - 2. What is u rounded to 4 dps? -0.0002 Let q = 86.9 - 750.9. Let x = -661.9992 - q. Let h = 2 - x. What is h rounded to 3 dps? -0.001 Let n = -141125670.0000132 - -141125636. Let s = 18 - 52. Let o = n - s. Round o to 6 dps. -0.000013 Suppose 5818225 = 3w + 1228225. Round w to the nearest one hundred thousand. 1500000 Let y = 400.50812978 - 17433.94212828. Let l = y + 17039.434. Let j = l - 6. What is j rounded to 6 dps? 0.000002 Suppose -4b = j + 31, -4b - 70 - 30 = 4j. What is j rounded to the nearest 10? -20 Let n = 0.4 - 0.6. Let w = 0.1999 + n. Round w to three decimal places. 0 Let c = -3.1 + 0.1. Let a = c + 3.00000023. Round a to 7 dps. 0.0000002 Let l = 0.02 - 0.32. Let p = 0.19 + l. Let a = p + 0.87. Round a to 1 dp. 0.8 Suppose -u + 4 = 3n, -2 = -5n + 3n - u. Let w be n/80 + 190000. Round w to the nearest 100000. 200000 Let y = -110 - -109.999788. Round y to 5 decimal places. -0.00021 Let i = 3.41443 + -3.393. Let v = i - 0.021. Round v to four decimal places. 0.0004 Let a(v) = 35335v + 7. Let z(k) = 388684k + 76. Let q(p) = 32a(p) - 3z(p). Let u be q(3). What is u rounded to the nearest ten thousand? -110000 Let y = -1 + 3. Suppose -yn - 2r = 3n -	{ "pile_set_name": "DM Mathematics" }
the closest to 2/7? (a) -1/8 (b) -2/9 (c) -44.47 (d) 3 a What is the closest to 0.1 in 5, -11, 1262? 5 Which is the closest to -1? (a) 8 (b) 356 (c) 2 c What is the nearest to -0.2 in 0, -3, -5/2, -12? 0 Which is the closest to -1? (a) -27 (b) -1 (c) 3/5 (d) -4/11 b What is the nearest to -6/13 in -9/2, 0.2, 5, -0.04? -0.04 Which is the closest to -4? (a) 1/10 (b) 1/3 (c) -0.5 (d) 2 (e) 0.09 c Which is the closest to -0.2? (a) 0 (b) 4/7 (c) 9 (d) 1/18 a Which is the nearest to -0.1? (a) 0 (b) 4 (c) -22 a Which is the nearest to 0? (a) -6/31 (b) -0.6 (c) 3.4 a What is the nearest to -15/7 in 0.1, -0.1, -0.0607? -0.1 What is the closest to 1.1 in 3, -2/693, -9? -2/693 What is the closest to 0.4 in -1/2, 0.1, -535, 1/9? 1/9 What is the closest to 2/9 in 140, 2, -2, 2/3? 2/3 What is the nearest to 1 in 3, -5, 894, 0.5, 2/5? 0.5 Which is the closest to 681? (a) -0.01 (b) 4 (c) 0.11 b What is the closest to -1 in 0.3, 5/27, -18/11, -4, 0.2? -18/11 What is the nearest to -0.7 in 0.1, -0.5, 5, -2/11, 317.3? -0.5 What is the nearest to -1779 in 1/3, -0.12, -12? -12 Which is the nearest to -9? (a) 4/15 (b) 0.01 (c) -1 (d) 8 c What is the closest to -1/3 in 6, 4/23, -0.0441? -0.0441 Which is the nearest to -42/5? (a) 131.5 (b) -5 (c) -1 b Which is the nearest to 0? (a) -14.6 (b) -4/7 (c) 1123 b Which is the closest to 0.1? (a) -5/12 (b) -2/11 (c) 80 b Which is the closest to -86? (a) -3 (b) 9.81 (c) -4 (d) -1/2 c What is the closest to 3/5 in -1, -0.0445, -62, 1/4? 1/4 Which is the closest to 1/55981? (a) 4 (b) -4 (c) 1/7 c Which is the nearest to 0? (a) -5/6 (b) 1/9 (c) -88 (d) -2 (e) 0.4 b Which is the closest to -5? (a) -1.4 (b) 1/3 (c) 5 (d) 0 a What is the closest to 7026 in -0.3, 2, 2/13, -2/7, -3? 2 Which is the closest to -0.2? (a) 0.399 (b) -0.2 (c) 1/7 (d) -4 b Which is the closest to 4? (a) 58 (b) -4/5 (c) 3/4 c What is the nearest to -0.07 in 2, -0.32, 5, -0.3, -20? -0.3 What is the nearest to 9 in 1/3, 0.002, 4, -0.3? 4 What is the nearest to -0.2 in -3, 56, -0.5, 12/7? -0.5 What is the closest to 1/6 in -15, -0.051, -0.5, 4, -1? -0.051 Which is the nearest to 1/5? (a) 2 (b) 251 (c) -0.2 (d) 0.11 d Which is the closest to 0.06? (a) -70 (b) 0.09 (c) 0.1 (d) -2/21 b Which is the nearest to -1? (a) -93 (b) -1 (c) -0.3 (d) 0.025 b What is the closest to 752 in -0.4, -3, -2/11? -2/11 Which is the closest to -17? (a) 4 (b) -1/6 (c) 5 (d) -3/17 d What is the nearest to -0.2 in 1/2, -3.5, -5, -2, -6? 1/2 Which is the closest to -40? (a) 0.1 (b) -2 (c) -101.7 b Which is the closest to 193? (a) 0.2 (b) 5/4 (c) 1.5 (d) 2 d Which is the nearest to -69? (a) -3/7 (b) -5 (c) 3 (d) 53 b Which is the nearest to -1/3? (a) -38 (b) -1 (c) -26 b Which is the closest to -20/17? (a) 0.2 (b) -2/13 (c) -3 (d) 3 (e) -6 b What is the nearest to 0.2 in 0.0532, -1/2, 1/2, -3? 0.0532 Which is the closest to -1? (a) 1 (b) 1/11 (c) 19734 b Which is the closest to 1? (a) -1/8 (b) 51 (c) -19 a What is the closest to 24 in -5, 2/37, 7? 7 What is the closest to 2/5 in 0.3, 2.088, -7, -0.4? 0.3 What is the closest to -1 in 0, -25.1613, -2/7, 1/3? -2/7 What is the closest to -6 in 8.3, -4, -1/218? -4 What is the nearest to 9 in -0.34, -0.3, -132/7? -0.3 Which is the closest to 1/2? (a) -2/23 (b) -2/5 (c) -1673 (d) 3 a Which is the closest to -1/307? (a) 0.4 (b) -4/13 (c) -4 (d) -3/2 (e) -0.02 e Which is the closest to 0.1? (a) 1/3 (b) -1 (c) -1/7 (d) 0.06 (e) 306 d Which is the closest to 0.1? (a) -23 (b) 5/8 (c) 2.4 b Which is the closest to -2/9? (a) -0.5 (b) 3 (c) 1 (d) -0.02 d Which is the closest to -1/3? (a) 0.4 (b) -1 (c) 0.5 (d) -503.9 b Which is the closest to -1? (a) -706 (b) -30.8 (c) 2 c Which is the nearest to 0? (a) 4 (b) 0.2 (c) 58/5 b Which is the closest to 14? (a) -1/5 (b) 3 (c) -1/12 b Which is the nearest to -680? (a) 2/23 (b) -231 (c) -2 b Which is the nearest to -2/15? (a) 12 (b) 13 (c) 28 a Which is the closest to 1/4? (a) 4 (b) -54/187 (c) 3 b What is the closest to -19/15 in 1/15, -2/9, 1/4, 3? -2/9 Which is the closest to -9? (a) -0.03 (b) 0.4 (c) 13 (d) 2 a Which is the closest to -3? (a) -0.2 (b) 3 (c) 46475 (d) -2 d What is the closest to 1/9 in 0.5, 0.8, 93, 0.4? 0.4 Which is the nearest to -11? (a) 5 (b) -4 (c) 0.0123 b Which is the closest to -193? (a) 0.02 (b) -0.3 (c) 2/5 b Which is the closest to 149? (a) 1.1 (b) -0.04 (c) 17 c What is the nearest to 292 in -13, 1/8, 0.4? 0.4 What is the nearest to -436 in -3, 1/5, -1, -1.2, -0.5? -3 What is the closest to 16 in -1/7, 1, 29, 1/3, -0.4? 29 Which is the closest to -12475/3? (a) -0.4 (b) 0.4 (c) 1 a What is the closest to -1 in 2, -0.14, 1.01, -0.3? -0.3 Which is the closest to -1/3? (a) -0.4 (b) -1/2 (c) 6/361 a Which is the closest to -1.9? (a) 0.1 (b) 51 (c) 3 a Which is the nearest to -0.05? (a) -5/6 (b) 5 (c) -0.4 (d) -112/11 c What is the closest to -7/4 in -1, 0.5, 8/21, 1? -1 What is the closest to 81 in -1.2, 2/13, -0.5, -0.1, -5? 2/13 What is the nearest to -1 in 2/3, -6/11, -491? -6/11 Which is the nearest to -1? (a) 0.3 (b) -0.5 (c) -2 (d) 21/11 b Which is the nearest to 16? (a) -2/5 (b) -3880 (c) 5 c Which is the nearest to 0.2? (a) -2/11 (b) -0.7 (c) 2 (d) -18/5 a Which is the closest to 2/3? (a) -7 (b) 1/43 (c) -5 (d) 0.02 (e) -0.4 b Which is the nearest to 3? (a) 2 (b) 1/8 (c) 236 a Which is the nearest to -0.3? (a) 0.1 (b) -5 (c) 2.6 a What is the nearest to -0.01 in -5, -22, 5/6, 4? 5/6 Which is the closest to 0? (a) 10/9 (b) 2/7 (c) 0.12 (d) -9 c What is the nearest to -2/129 in 2/9, 254, 2/5, 3? 2/9 What is the closest to -1 in -3/7, -125.1, -4, 2/9? -3/7 What is the nearest to 2 in -0.4, 76, 8, -7? -0.4 Which is the nearest to 3/20? (a) 5/3 (b) -1/2 (c) -0.02 (d) -3 c What is the closest to -4 in -5, -0.049, 0.1, -2/5? -5 Which is the nearest to 2/9? (a) 63 (b) -2 (c) 4.2 b What is the closest to 4 in -0.06, 0.3, -2/33, 0.145? 0.3 Which is the nearest to 0? (a) -21 (b) 1/2 (c) 101/5 (d) -2/3 (e) 2 b What is the closest to -1 in -44, -13, -1? -1 Which is the nearest to -3? (a) -29 (b) -188 (c) -1/6 c What is the nearest to 0.1 in 2/21, -204, 4, 5/3, -9? 2/21 What is the nearest to 18 in 0.1, -833, -5? 0.1 What is the nearest to -5/3 in 13/2, -2, 4? -2 Which is the closest to 1/3? (a) -4 (b) -8/95 (c) 10 b What is the closest to -15 in 0, -0.4, -3/31, 1/2? -0.4 What is the closest to -0.07 in -46, -1/5, 12? -1/5 What is the nearest to 0.2 in 3/2, -4, 128, 1/11? 1/11 What is the nearest to -95/8 in 3, 5, 0.1, -4? -4 Which is the nearest to -1? (a) -0.024 (b) 2/11 (c) -2/7 c Which is the nearest to -0.0066? (a) 0.1 (b) -4 (c) -2/3 (d) 3 a Which is the nearest to -1/7? (a) -0.2 (b) -2 (c) -1041 (d) -3 (e) 1 a What is the nearest to 1 in 0.4, -2, 2/51, 0, 820/11? 0.4 What is the closest to -1 in 1/2057, 2/5, 1? 1/2057 Which is the closest to -1/2? (a) -1 (b) 34301/2 (c) -4 a What is the nearest to 0.1 in -0.07, -2/7, -0.3, 12, 1/9? 1/9 What is the closest to 9 in -1, 3, 2/143, 11? 11 Which is the nearest to -2/9? (a) 4 (b) 0.3 (c) -4/5 (d) 101.5 (e) 3 b What is the closest to -3047 in -10, -5, 0.4? -10 Which is the nearest to 0? (a) -16 (b) 4/7 (c) 0.7 (d) 4 b Which is the nearest to -3/83? (a) 13/6 (b) 5 (c) 2/5 (d) -3/2 (e) -2 c What is the closest to 1 in -1, 16, -13, 0.1? 0.1 What is the closest to -1 in 5.1, 0.5, -7977? 0.5 What is the nearest to 0.2 in 0.12, -1, 7/262, -0.05? 0.12 Which is the closest to -0.6? (a) -0.1 (b) -30 (c) 16 (d) -5 (e) -4 a Which is the closest to 2? (a) 0.26 (b) -1/4 (c) -1 (d) 1/7 a Which is the nearest to 0.1? (a) -0.4 (b) 5 (c) -6289 (d) 10 a What is the closest to 4/5 in -1, -13, -3, 1/3, 2/49? 1/3 Which is the closest to -1? (a) 1 (b) -0.0667 (c) 0.05 (d) -2 b What is the closest to -2 in -111341, -4, -0.1? -0.1 What is the nearest to -10/7 in -4, 1, -2, 24? -2 What is the nearest to -768 in 0, -1/11, 0.04, 1? -1/11 Which is the nearest to -1/4? (a) -6 (b) -26.9 (c) -2/11 c What is the closest to -2 in 0.4, 4, 0.3, 0.0269, 5? 0.0269 Which is the nearest to 1? (a) 1 (b) 0.	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.