Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
r/(r/(r*(-2)/r)))/rrr)5 assuming r is positive. r(-14/15) Simplify ((z(-1/2))33)(-24/11) assuming z is positive. z36 Simplify f(-2/65)/f(-22) assuming f is positive. f(1428/65) Simplify (nn*(-2/3)nn)/n(-8/13) assuming n is positive. n(115/39) Simplify (t(-2/9)t)/((tt(1/6)t)/t)(tt(t(3/2)t)/tt)/(tt*(-1/4)t) assuming t is positive. t(85/36) Simplify (v(-10)v)/(v/v3) assuming v is positive. v(-7) Simplify (xxxx*(-2)xx)(5/2) assuming x is positive. x(15/2) Simplify ((v/v(1/3)v)(-41))(-3/11) assuming v is positive. v(205/11) Simplify (p(2/19)/(p(2/13)/p))(3/8) assuming p is positive. p(705/1976) Simplify n(10/11)(nn(-24))/n assuming n is positive. n(-254/11) Simplify a*(-2)a/(a(-22)/a) assuming a is positive. a22 Simplify q*(-6)q*(4/7)((q/(qq(3/11)q))/q)/((q/q5)/q) assuming q is positive. q(-208/77) Simplify ((aa0/aa)(-5))25 assuming a is positive. a(-125) Simplify (u(-1))*(-6/5)u7/(u(2/11)u) assuming u is positive. u(386/55) Simplify ((z/(zz*(-2/3)/z)z)47)(-2/47) assuming z is positive. z(-16/3) Simplify t5/t(1/11) assuming t is positive. t(54/11) Simplify ((iii(-6))/i)(-4/7) assuming i is positive. i*(20/7) Simplify (nn*(-13/3))/nn15 assuming n is positive. n(32/3) Simplify ((((n/(nn(1/7))nn)/n)/n)/n(-8))(19/3) assuming n is positive. n(1045/21) Simplify (pp*(2/5)p)*(-2/55)/(p/(pp*(-3/8))p/(p(p/((p/(pp3))/p))/p)) assuming p is positive. p(7783/2200) Simplify (pp(2/21))/((p(1/5)/p)/p) assuming p is positive. p(304/105) Simplify f(11/3)/((ff(-15))/f) assuming f is positive. f(56/3) Simplify ((i/(i*3/i)i)/i(((i/((i((ii6i)/i)/i)/i))/ii)/ii)/i)/(i*(-1/10)/(ii4/i)) assuming i is positive. i(-29/10) Simplify ((g/g(2/59))/g)/(g/((g/(g(-1/23)gg))/g)) assuming g is positive. g(-4058/1357) Simplify ((s(-5)/s)/(s/((s*(-3/5)/ss)/s)))/(ss3s(-3)/s) assuming s is positive. s(-43/5) Simplify a*(2/11)a*(-3/5)a(a(a((a2aaa)/a)/a)/a)(3/32) assuming a is positive. a(421/440) Simplify i*7(((iiii(-3/2)iiiiii)/ii)/iii)/ii(-1)i(-1/3)/i assuming i is positive. i(73/6) Simplify n*(7/6)nnnn/n(-41) assuming n is positive. n(277/6) Simplify (l/(l/(l((l/(l/l(-2/5)))/l)/l)))21l(-1/7)l(2/7) assuming l is positive. l(-1024/35) Simplify ((y/(y/(y/y*(2/13))y))/yyy)/(y(-34)/y) assuming y is positive. y(466/13) Simplify (u/(u/(uuu*(-20))))/uuu4 assuming u is positive. u(-14) Simplify (m1)(1/27)m*(-8/3)m(-9) assuming m is positive. m(-314/27) Simplify (dd/d(2/21))(-42) assuming d is positive. d(-80) Simplify (b(-3)bb3)(1/4) assuming b is positive. b(1/4) Simplify ((q(1/11)qq)/q)/(q/(q/(qq27))) assuming q is positive. q(-296/11) Simplify ((x/x*(1/5))/(xxx(-21)))(32/7) assuming x is positive. x(3168/35) Simplify (tt/((tttt/t(-6/11))/t)t(-16))(-47) assuming t is positive. t(9071/11) Simplify q(3/13)/q(-5) assuming q is positive. q(68/13) Simplify (fff(f/f(2/19))/f)/f(-7)((f(1/2)/f)/f)(-5/9) assuming f is positive. f(1223/114) Simplify (v/v0)*(1/23)/((v(v/(v/((v/v*(-1/2))/v)))/v)/((vv(v(-6)/vv)/vv)/v)) assuming v is positive. v(-251/46) Simplify ttt(t*6t)/ttt9 assuming t is positive. t19 Simplify a*(-1/8)aa8 assuming a is positive. a(71/8) Simplify ((z(-2/9)z)(-15))4 assuming z is positive. z(-140/3) Simplify (p2p)/p(4/19) assuming p is positive. p(53/19) Simplify fff9/ff((f(7/4)/f)/f)/f assuming f is positive. f(39/4) Simplify b(5/9)/(bb(-5/9)) assuming b is positive. b(1/9) Simplify (l*(-2)l)(-28) assuming l is positive. l28 Simplify (c*(2/5)c/(cc2c))/(c/(cc/c(-2)))(-10) assuming c is positive. c(-163/5) Simplify n/(n/n(8/7))n(-6) assuming n is positive. n(-34/7) Simplify ((z(-1))7)(-10) assuming z is positive. z70 Simplify f*(-2/51)ff(-17) assuming f is positive. f(-818/51) Simplify (m/m(-1/19))/((mm*(12/11)mm)/mm) assuming m is positive. m*(-635/209) Simplify (kk(-2/81))/k(7/2) assuming k is positive. k*(-409/162) Simplify (ff*(4/11))/(fff/(f(-3/7)/f)f) assuming f is positive. f*(-313/77) Simplify (((cc*(-1/9))/c)/(c/(cc4/c)))(-15) assuming c is positive. c(-130/3) Simplify t(-8)t13 assuming t is positive. t5 Simplify (s(-1)/s)/s1s*(-4)/(sss(3/2)s) assuming s is positive. s(-23/2) Simplify ((u/u2)31)33 assuming u is positive. u*(-1023) Simplify ((pp/(pp2/pp))/p)/(p/(pp/p(-1/8)p)) assuming p is positive. p(1/8) Simplify (d(-1/5)/(d(d/d6)/dd))/(d*(-2/5)/dd/(d/(dd(-5)d))) assuming d is positive. d(41/5) Simplify m(-2/7)m1(((mm/(m(1/4)/m))/m)/m)/((mm(-6))/m) assuming m is positive. m(209/28) Simplify x*(-4)x*(1/4)xx/(x/(xxx/x8)x)x(x/(x*2/x)x)/x assuming x is positive. x*(-31/4) Simplify ((oo/(o/(o/((o*(-1/8)o)/o)))o)/(oooo*(-1)))/((oo0)/(o(1/4)oo)) assuming o is positive. o*(19/8) Simplify (uu*9u)30 assuming u is positive. u330 Simplify (h/h*2(h/(h*(3/5)/hh))/h)/(h/(h*2h)h(h*(-6/5)h)/h) assuming h is positive. h*(3/5) Simplify (xx(-1))(2/19)((x(2/5)x)/x)(11/8) assuming x is positive. x(11/20) Simplify mm(1/6)/mmm(-2/23)m(1/13)/m(-7) assuming m is positive. m*(14633/1794) Simplify (gg(-1/3))(1/20)((g/g(-7))/gg)/(g(2/5)/g) assuming g is positive. g(259/30) Simplify (bb(-44)b)(-5/6) assuming b is positive. b35 Simplify (y(-11))(1/48) assuming y is positive. y(-11/48) Simplify ((a(2/7))(12/11))(-18) assuming a is positive. a(-432/77) Simplify (v(-5)/(v(vv*(-2/13)v)/v))/((v/v*6v)/v(-4/5)) assuming v is positive. v(-237/65) Simplify (rr/(r5rr)r)/(((r(r/(rr*(-6)r))/r)/r)/r)(r/r(-5))/r5 assuming r is positive. r(-6) Simplify ffff*(-2)f/((fff*(-3)f)/ff)f*(-6)f(-3/2)/f assuming f is positive. f(-13/2) Simplify (l/(ll5)l*(-2)l)/(l*1l/(ll(-1))) assuming l is positive. l(-8) Simplify ((ooo(oo/(o/(o(-1/4)/o))o)/oo)(-4/3))19 assuming o is positive. o(-95) Simplify ((f/f2)/f)/(f/((f(ff/(f/(((ff12)/f)/f)))/f)/f)) assuming f is positive. f8 Simplify (d/(d*3d))/(d/d*1)dd(-1/6)d/((d(2/19)/d)/d) assuming d is positive. d(83/114) Simplify (q*(-1)qq(-1/7))/(q/(qq/(q/q*(2/13))q)q1) assuming q is positive. q(1/91) Simplify ((n/(nn*(2/23))n)/n2)(-19) assuming n is positive. n(475/23) Simplify (n/(((n(-6/11)n)/n)/n))/nnn0n/n*(2/13)(n/(n*(1/5)n))/nn assuming n is positive. n(2282/715) Simplify (((c(6/5)c)/c)/ccc)9 assuming c is positive. c(99/5) Simplify (oo0o)(-2/49)/(o(1/7)o(oo/((o/((o/o(-4)oo)/o))/o)o)/o) assuming o is positive. o(-452/49) Simplify ((c3c)/c0)/(c(-5/4)/c2) assuming c is positive. c(29/4) Simplify ((g(-1)g)/g)(-18)/((g/(g/g(-1)))/g)(-2/69) assuming g is positive. g(1238/69) Simplify bb(-2/13)b/(b/(b*(-2/11)bb))b/(b*(-4)/bb)b6 assuming b is positive. b(1954/143) Simplify (h(3/11)/(h/(h/((hh*(1/3))/hh))))(-4/27) assuming h is positive. h(140/891) Simplify l(-17/4)/l(-26) assuming l is positive. l(87/4) Simplify (p(2/25)/(p/((p2/p)/p)))/((p/p(-10))/pp(-8)) assuming p is positive. p(-73/25) Simplify q1/(q/q(-13)q) assuming q is positive. q*(-14) Simplify (l/((l/(ll*(1/7)l))/l)l(3/5))/(l(1/6)/(l/(l(-5)/l))) assuming l is positive. l(2221/210) Simplify l(-26)l(-18) assuming l is positive. l(-44) Simplify (i(2/29))(-11/6) assuming i is positive. i(-11/87) Simplify (a(2/3))(-19) assuming a is positive. a(-38/3) Simplify l*3/(l/((ll*19l)/l)) assuming l is positive. l*22 Simplify (vvv(-3/5)/vvvv/v(-1))(-2/153) assuming v is positive. v(-44/765) Simplify (i16/ii)30 assuming i is positive. i480 Simplify (vvv(4/13))(-40/3) assuming v is positive. v(-400/13) Simplify f(19/2)/((ff/(f/f*(-18))f)/f) assuming f is positive. f**(53/2)	{ "pile_set_name": "DM Mathematics" }
36 Three letters picked without replacement from vjljvjjvljllj. Give prob of sequence ljj. 10/143 What is prob of sequence wh when two letters picked without replacement from {n: 12, h: 5, w: 1}? 5/306 What is prob of sequence nz when two letters picked without replacement from azbtzbbnzzz? 1/22 What is prob of sequence rc when two letters picked without replacement from {t: 1, o: 1, c: 1, b: 1, r: 1}? 1/20 Four letters picked without replacement from lygzc. What is prob of sequence ygzl? 1/120 What is prob of sequence xlqx when four letters picked without replacement from {x: 3, l: 2, h: 6, q: 2}? 1/715 What is prob of sequence voov when four letters picked without replacement from {v: 7, o: 7}? 21/286 Three letters picked without replacement from {i: 1, v: 1, q: 2}. What is prob of sequence qiv? 1/12 Four letters picked without replacement from {z: 5, e: 2}. What is prob of sequence zeez? 1/21 Two letters picked without replacement from thhhhtth. Give prob of sequence hh. 5/14 Calculate prob of sequence hsh when three letters picked without replacement from thhstth. 1/35 Four letters picked without replacement from qtauuuautuuuu. Give prob of sequence uqat. 4/2145 Calculate prob of sequence qqu when three letters picked without replacement from quqqooo. 1/35 Two letters picked without replacement from qqccqqqq. What is prob of sequence cc? 1/28 Two letters picked without replacement from {k: 1, p: 2, r: 1, q: 2, f: 1}. Give prob of sequence kr. 1/42 What is prob of sequence qvqv when four letters picked without replacement from qqxuxqxvvquqqqqu? 1/390 What is prob of sequence elel when four letters picked without replacement from {l: 7, e: 2}? 1/36 Three letters picked without replacement from {m: 3, k: 1, g: 2, z: 7, f: 1, a: 4}. Give prob of sequence kmz. 7/1632 What is prob of sequence lar when three letters picked without replacement from {l: 7, n: 1, o: 2, r: 2, j: 6, a: 1}? 7/2907 Three letters picked without replacement from vozyvyollyfo. Give prob of sequence oyl. 3/220 Three letters picked without replacement from {g: 2, y: 2, s: 4, u: 2}. What is prob of sequence gyu? 1/90 Two letters picked without replacement from {p: 1, h: 1, j: 1}. Give prob of sequence hj. 1/6 Calculate prob of sequence cc when two letters picked without replacement from {u: 5, e: 6, c: 4}. 2/35 Two letters picked without replacement from rhrhezhheeeezrrz. Give prob of sequence rz. 1/20 Calculate prob of sequence ii when two letters picked without replacement from {s: 1, i: 2, x: 9, k: 4}. 1/120 Three letters picked without replacement from hbcbcci. Give prob of sequence cic. 1/35 Two letters picked without replacement from uumlwyuuwwmh. What is prob of sequence um? 2/33 Two letters picked without replacement from {y: 10}. Give prob of sequence yy. 1 Calculate prob of sequence wn when two letters picked without replacement from wwgggggggwswsggn. 1/60 Three letters picked without replacement from cmmccxwjhmwxx. What is prob of sequence jcx? 3/572 What is prob of sequence ss when two letters picked without replacement from {p: 16, s: 2}? 1/153 Four letters picked without replacement from {a: 2, u: 5, t: 7}. Give prob of sequence tuuu. 5/286 Two letters picked without replacement from {a: 1, n: 2, v: 1, x: 2, p: 1, b: 1}. Give prob of sequence xv. 1/28 Calculate prob of sequence tgg when three letters picked without replacement from {x: 10, t: 4, g: 5}. 40/2907 What is prob of sequence rvpv when four letters picked without replacement from {r: 3, v: 3, e: 1, t: 6, p: 2}? 1/910 Calculate prob of sequence jjkj when four letters picked without replacement from kkkjjkjjkkjkjkjjkjj. 45/646 Three letters picked without replacement from tgvcvvvh. What is prob of sequence gcv? 1/84 Calculate prob of sequence vsv when three letters picked without replacement from {s: 2, v: 4}. 1/5 Three letters picked without replacement from {b: 2, y: 10}. Give prob of sequence ybb. 1/66 What is prob of sequence xdvx when four letters picked without replacement from {x: 3, v: 2, d: 3}? 3/140 Three letters picked without replacement from {b: 4, r: 5, x: 6}. What is prob of sequence rbx? 4/91 Four letters picked without replacement from {m: 1, p: 2, w: 5, b: 1}. What is prob of sequence wwbp? 5/378 Calculate prob of sequence ya when two letters picked without replacement from {y: 1, d: 4, a: 2, n: 1, z: 3}. 1/55 Calculate prob of sequence qkz when three letters picked without replacement from ekejqeze. 1/336 Three letters picked without replacement from {u: 3, n: 2, e: 7, f: 7}. What is prob of sequence fue? 49/1938 Two letters picked without replacement from {p: 1, m: 2, z: 3, r: 1}. Give prob of sequence pz. 1/14 What is prob of sequence llol when four letters picked without replacement from {g: 4, o: 7, a: 2, l: 5}? 7/1224 Calculate prob of sequence hb when two letters picked without replacement from vdfbvfh. 1/42 What is prob of sequence kk when two letters picked without replacement from aookkutu? 1/28 What is prob of sequence aeh when three letters picked without replacement from tehatua? 1/105 Three letters picked without replacement from fcc. What is prob of sequence cfc? 1/3 Three letters picked without replacement from {g: 4, a: 6, c: 1, q: 6}. What is prob of sequence aag? 1/34 Four letters picked without replacement from ccccnccccccc. What is prob of sequence cncc? 1/12 Two letters picked without replacement from {v: 4, h: 4, d: 3}. Give prob of sequence vd. 6/55 Calculate prob of sequence oo when two letters picked without replacement from {o: 10}. 1 Three letters picked without replacement from ool. Give prob of sequence olo. 1/3 Two letters picked without replacement from {k: 4, y: 3, n: 4}. Give prob of sequence ny. 6/55 Calculate prob of sequence pv when two letters picked without replacement from pmuvceu. 1/42 Four letters picked without replacement from yyylllllyllylyylllyy. What is prob of sequence lyll? 99/1292 Four letters picked without replacement from zphhgghuhpppvzhppug. What is prob of sequence hhvz? 5/11628 Calculate prob of sequence dld when three letters picked without replacement from ldlvdvvdrvfvl. 3/286 Calculate prob of sequence eede when four letters picked without replacement from eeeeddddedeedddeeeed. 99/1292 Calculate prob of sequence xc when two letters picked without replacement from {c: 2, m: 3, b: 1, x: 1}. 1/21 Four letters picked without replacement from {x: 1, r: 3, p: 11}. Give prob of sequence pxpr. 11/1092 Calculate prob of sequence ahy when three letters picked without replacement from {h: 1, y: 4, a: 2, i: 2}. 1/63 What is prob of sequence oer when three letters picked without replacement from eaaeraaaoeeanrnoa? 1/255 Three letters picked without replacement from rrrroo. What is prob of sequence oor? 1/15 Calculate prob of sequence xixi when four letters picked without replacement from rrirrrxrrrxixrrrirr. 1/2584 Three letters picked without replacement from srqqvsqssqqvsqqv. What is prob of sequence rqr? 0 Four letters picked without replacement from gohuou. Give prob of sequence ghuo. 1/90 Two letters picked without replacement from {q: 3, h: 4, b: 8, f: 1, y: 3}. Give prob of sequence fb. 4/171 Two letters picked without replacement from {i: 1, o: 2, g: 1}. Give prob of sequence oo. 1/6 What is prob of sequence apaj when four letters picked without replacement from aapaj? 1/20 What is prob of sequence jjm when three letters picked without replacement from {j: 3, g: 1, m: 8, q: 1, e: 3, k: 2}? 1/102 Four letters picked without replacement from fgcgcgcccggp. Give prob of sequence cgpf. 5/2376 Calculate prob of sequence iedv when four letters picked without replacement from {u: 2, e: 1, d: 1, v: 7, i: 6}. 1/1360 Two letters picked without replacement from {r: 6, c: 4, q: 5, p: 4}. Give prob of sequence pc. 8/171 Two letters picked without replacement from {z: 1, h: 1, n: 1}. Give prob of sequence zz. 0 Calculate prob of sequence tqq when three letters picked without replacement from {t: 3, q: 3}. 3/20 Four letters picked without replacement from {a: 1, d: 4, q: 4, f: 2, t: 3}. What is prob of sequence ddqd? 4/1001 Two letters picked without replacement from {k: 1, v: 3, o: 4, u: 1, r: 6, x: 5}. Give prob of sequence xr. 3/38 Four lette	{ "pile_set_name": "DM Mathematics" }
e the remainder when 1656 is divided by 934. 722 What is the remainder when 1273 is divided by 172? 69 What is the remainder when 809 is divided by 182? 81 What is the remainder when 1770 is divided by 129? 93 What is the remainder when 35699 is divided by 78? 53 Calculate the remainder when 1086701 is divided by 106. 95 What is the remainder when 2469 is divided by 1984? 485 Calculate the remainder when 19419 is divided by 37. 31 Calculate the remainder when 247445 is divided by 82. 51 Calculate the remainder when 17008 is divided by 116. 72 Calculate the remainder when 28217 is divided by 20. 17 What is the remainder when 79809 is divided by 23? 22 Calculate the remainder when 45640 is divided by 238. 182 What is the remainder when 13707 is divided by 6614? 479 What is the remainder when 503 is divided by 307? 196 What is the remainder when 490908 is divided by 98181? 3 What is the remainder when 690 is divided by 311? 68 What is the remainder when 28250 is divided by 14096? 58 What is the remainder when 6814 is divided by 1359? 19 What is the remainder when 5852 is divided by 90? 2 Calculate the remainder when 124861 is divided by 375. 361 What is the remainder when 1405 is divided by 87? 13 What is the remainder when 3216 is divided by 678? 504 What is the remainder when 56066 is divided by 33? 32 Calculate the remainder when 13594 is divided by 82. 64 What is the remainder when 305727 is divided by 258? 255 What is the remainder when 11545 is divided by 263? 236 What is the remainder when 16023 is divided by 1143? 21 Calculate the remainder when 71246 is divided by 621. 452 What is the remainder when 3098 is divided by 1207? 684 Calculate the remainder when 1806 is divided by 230. 196 Calculate the remainder when 171304 is divided by 119. 63 Calculate the remainder when 7096 is divided by 406. 194 Calculate the remainder when 48342 is divided by 12083. 10 Calculate the remainder when 2053 is divided by 109. 91 What is the remainder when 33635 is divided by 1681? 15 Calculate the remainder when 965 is divided by 579. 386 What is the remainder when 34433 is divided by 5720? 113 Calculate the remainder when 19409 is divided by 182. 117 Calculate the remainder when 80508 is divided by 97. 95 Calculate the remainder when 23756 is divided by 5897. 168 What is the remainder when 175835 is divided by 27? 11 What is the remainder when 2400 is divided by 1191? 18 Calculate the remainder when 21504 is divided by 741. 15 What is the remainder when 36717 is divided by 12146? 279 Calculate the remainder when 3340 is divided by 338. 298 What is the remainder when 2891 is divided by 9? 2 What is the remainder when 42246 is divided by 8444? 26 What is the remainder when 16712 is divided by 16? 8 What is the remainder when 10076 is divided by 60? 56 Calculate the remainder when 2039 is divided by 194. 99 Calculate the remainder when 2936 is divided by 90. 56 Calculate the remainder when 2864797 is divided by 20. 17 What is the remainder when 44184 is divided by 7362? 12 What is the remainder when 3610 is divided by 594? 46 Calculate the remainder when 12810 is divided by 917. 889 What is the remainder when 4539 is divided by 2261? 17 Calculate the remainder when 11679 is divided by 10. 9 What is the remainder when 158671 is divided by 577? 573 Calculate the remainder when 17475 is divided by 191. 94 What is the remainder when 12330 is divided by 202? 8 Calculate the remainder when 49997 is divided by 250. 247 What is the remainder when 90387 is divided by 419? 302 What is the remainder when 75331 is divided by 25110? 1 Calculate the remainder when 6896 is divided by 2283. 47 What is the remainder when 21 is divided by 8? 5 What is the remainder when 638712 is divided by 11? 8 Calculate the remainder when 23286 is divided by 274. 270 What is the remainder when 219586 is divided by 26? 16 Calculate the remainder when 3541 is divided by 589. 7 Calculate the remainder when 1846 is divided by 104. 78 Calculate the remainder when 23349 is divided by 23331. 18 What is the remainder when 25122 is divided by 306? 30 Calculate the remainder when 274 is divided by 106. 62 What is the remainder when 641 is divided by 218? 205 Calculate the remainder when 36846 is divided by 43. 38 What is the remainder when 714 is divided by 651? 63 What is the remainder when 84195 is divided by 8? 3 Calculate the remainder when 5441 is divided by 857. 299 Calculate the remainder when 505 is divided by 123. 13 What is the remainder when 191424 is divided by 325? 324 What is the remainder when 91110 is divided by 6507? 12 Calculate the remainder when 88649 is divided by 587. 12 Calculate the remainder when 12488 is divided by 131. 43 Calculate the remainder when 97192 is divided by 188. 184 What is the remainder when 1627 is divided by 459? 250 Calculate the remainder when 196 is divided by 177. 19 What is the remainder when 352893 is divided by 946? 35 Calculate the remainder when 30988 is divided by 82. 74 Calculate the remainder when 2457 is divided by 523. 365 Calculate the remainder when 277977 is divided by 41. 38 What is the remainder when 88048 is divided by 52? 12 What is the remainder when 20905 is divided by 6924? 133 Calculate the remainder when 788 is divided by 651. 137 Calculate the remainder when 3791 is divided by 708. 251 Calculate the remainder when 3224 is divided by 59. 38 Calculate the remainder when 974697 is divided by 380. 377 Calculate the remainder when 31957 is divided by 1389. 10 What is the remainder when 106513 is divided by 4? 1 Calculate the remainder when 41377 is divided by 5. 2 What is the remainder when 8992 is divided by 4399? 194 What is the remainder when 1559 is divided by 63? 47 Calculate the remainder when 614112 is divided by 27. 24 Calculate the remainder when 14954 is divided by 131. 20 What is the remainder when 58932 is divided by 166? 2 Calculate the remainder when 48571 is divided by 48. 43 What is the remainder when 2499 is divided by 2243? 256 Calculate the remainder when 23543 is divided by 92. 83 What is the remainder when 240 is divided by 102? 36 Calculate the remainder when 55140 is divided by 55. 30 Calculate the remainder when 15103 is divided by 83. 80 Calculate the remainder when 36712 is divided by 120. 112 What is the remainder when 95268 is divided by 2718? 138 What is the remainder when 49724 is divided by 592? 588 What is the remainder when 8985 is divided by 167? 134 Calculate the remainder when 12861 is divided by 82. 69 Calculate the remainder when 43854 is divided by 16. 14 Calculate the remainder when 17007 is divided by 5656. 39 Calculate the remainder when 25165 is divided by 19. 9 Calculate the remainder when 48148 is divided by 6867. 79 Calculate the remainder when 66659 is divided by 30. 29 What is the remainder when 301262 is divided by 41? 35 Calculate the remainder when 25936 is divided by 5187. 1 What is the remainder when 453852 is divided by 65? 22 What is the remainder when 410726 is divided by 29? 28 What is the remainder when 7888 is divided by 2576? 160 What is the remainder when 7281 is divided by 726? 21 What is the remainder when 9044 is divided by 3011? 11 What is the remainder when 622 is divided by 194? 40 What is the remainder when 37196 is divided by 40? 36 Calculate the remainder when 24550 is divided by 764. 102 What is the remainder when 26572 is divided by 2167? 568 Calculate the remainder when 124425 is divided by 41474. 3 Calculate the remainder when 59178 is divided by 623. 616 Calculate the remainder when 6523 is divided by 9. 7 Calculate the remainder when 12308 is divided by 160. 148 What is the remainder when 114033 is divided by 1226? 15 What is the remainder when 72309 is divided by 209? 204 What is the remainder when 13692 is divided by 622? 8 Calculate the remainder when 10516 is divided by 352. 308 Calculate the remainder when 18264 is divided by 4558. 32 Calculate the remainder when 3803 is divided by 3770. 33 What is the remainder when 30677 is divided by 59? 56 What is the remainder when 3760 is divided by 236? 220 What is the remainder when 257 is divided by 29? 25 What is the remainder when 9579 is divided by 673? 157 What is the remainder when 1609658 is divided by 3	{ "pile_set_name": "DM Mathematics" }
y(h). -11h2 Let d(h) = 15h*2 + 3h. Suppose 182 = -35u - 56u. Let f(w) = -15w2 - 4w. Give uf(c) - 3d(c). -15c2 - c Let b(t) = -315t*3 + 142t*2 + 1. Let k(u) = 39u*3 - 18u*2. Calculate 2b(a) + 17k(a). 33a*3 - 22a*2 + 2 Let q be (14/(-4) - -3)4/1. Let i(x) = -x + 2. Let p(a) be the third derivative of -a4/6 + a3 + 300a2. What is qp(w) + 7i(w)? w + 2 Let c(w) = 4w - 6. Suppose -2s + 2i + 20 = 0, 18s - 68 = 14s - 3i. Let u(k) = 9k - 11. What is sc(x) - 6u(x)? 2x - 18 Let w(l) = 2103l*3 - 6l*2 - 15l. Let s(g) = 2105g3 - 5g*2 - 12g. Determine -6s(j) + 5w(j). -2115j3 - 3j Let i(m) = 390 - m*2 + 0m2 - 193 - 196 + m2 - m*2 + m. Let f(o) = 13o*2 - 3o - 3. Let a be (-2)/12 - 76/(-24). Determine ai(j) + f(j). 10j*2 Let h(s) = -16s*2 - 2s - 2. Suppose 0 = -3c, 2p - 66c - 10 + 2 = -62c. Let x(g) = 17g2 + 2g + 3. Calculate px(u) + 5h(u). -12u2 - 2u + 2 Let d(l) = -4l2 + 4l + 5. Let h(t) = t + 2. Let f(r) = -10r - 21. Let k(j) = -f(j) - 11h(j). Calculate -d(m) - 4k(m). 4m*2 - 1 Let m(k) = -2k3 - k2 - k + 1. Let t(x) = 5x3 - 9x*2 + 136x - 1. Give -3m(n) - t(n). n3 + 12n*2 - 133n - 2 Suppose 120 = -2c + j - 3j, -4c = -5j + 195. Let v(o) = 19 - 1 - 1 - 4o - 5o - 6 - 7. Let b(u) = -125u + 55. Calculate cv(p) + 4b(p). -5p Let l = -65 - -69. Suppose -1 - 5 = -2f, 1 = -lx - 5f. Let z(w) = -2 + 47w - 20w - 28w. Let p(o) = -2o - 5. Calculate xp(k) + 10z(k). -2k Let f(t) = -2t3 - 4t*2 - 1. Let s(a) = -106. Let o(c) = -283. Let y(l) = 3o(l) - 8s(l). What is -f(m) + 2y(m)? 2m3 + 4m*2 - 1 Let w(k) = -821108k*2 + 6268. Let j(r) = 1573r*2 - 12. Give 1567j(n) + 3w(n). 1567n*2 Let n(o) = 354o*3 + 4o*2 + 8o - 4. Let f(h) = -713h3 - 9h*2 - 17h + 9. Give -4f(q) - 9n(q). -334q3 - 4q Let a(g) = -31g3 + 3. Let c(i) = -651i*3 + 62. Suppose 2m - 770 = -7m - 212. Give ma(y) - 3c(y). 31y*3 Let l(m) = -2m*2 - 80m - 24. Let i(s) = -2s2 + s + 8. Calculate 2i(g) - l(g). -2g2 + 82g + 40 Let u(o) = -28o. Let i(v) = -9v. Suppose -2164d - 233 = -1674 - 22363. Let h be 30/(-7) - (-2)/7. Determine di(q) + hu(q). 13q Let o(w) = 9w + 62. Let b(x) = -x - 16. Give 3b(k) + o(k). 6k + 14 Let l be (1/(-2))/((-3)/(-6)). Let a(f) be the third derivative of f5/15 + f4/6 - f3/2 + 4442f2. Let z(g) = g2 + g - 1. Calculate la(b) + 6z(b). 2b2 + 2b - 3 Let r(m) = 5m2 - m + 1. Let f(c) = 25c*2 - 8c - 377. Determine -f(i) + 6r(i). 5i*2 + 2i + 383 Let d(y) = 553. Let l(s) = 105. Let u(h) = -4d(h) + 21l(h). Let i(g) = g + 15. Calculate -3i(t) - 7u(t). -3t + 4 Let r(g) = 90g*2 - 94g + 18. Let x(z) = 10z2 - 10z + 2. Let t(a) = 9r(a) - 84x(a). Let y(c) = -c - 1. Determine t(k) - 6y(k). -30k*2 Let w(i) = -782i*2 + 4i - 67. Let b(k) = 783k2 - 3k + 54. Give 5b(f) + 4w(f). 787f2 + f + 2 Let m(t) = -2t*3 - 12t*2 + 55t - 8. Let u(a) = -a*3 - 9a*2 + 56a - 6. Determine 3m(r) - 4u(r). -2r3 - 59r Let a(s) = 9s2 - s - 2. Let o(i) = 5i*2 - i - 1. Suppose -23 - 19 = -7g. Let m be (-6)/5(45/g - 5). Calculate ma(y) + 5o(y). -2y*2 - 2y + 1 Suppose 4y + 512s = 507s - 14, -1 = 5y - 2s. Let u(o) = o. Let q(t) = 3 + 4 - 6 + 4t + 5t. Calculate yq(f) + 6u(f). -3f - 1 Let c(h) = -9h2 + 8h - 8. Let a(v) = v*3 - 9v*2 - 20v + 140. Let d be a(10). Let y(z) = z*2 - z + 1. Calculate dy(q) + 5c(q). -5q*2 Let q(b) = 4b*2 + 4b - 2. Let o be ((-1)/((-2)/(-10)))/(59/(-59)). Suppose 0 = -2p + 3p + o. Let j(l) = 3l2 + 3l - 2. Give pq(d) + 6j(d). -2d2 - 2d - 2 Let a(h) = 90h2 - 49h - 6. Let q(m) = 37m2 - 25m - 3. Calculate 2a(j) - 5q(j). -5j2 + 27j + 3 Let u(q) = -8q2 - 8q + 4. Let y(n) be the third derivative of 10n2 + 2 - 3/20n*5 - 3/8n*4 + 0n + 5/6n3. Determine 7u(k) - 6y(k). -2k*2 - 2k - 2 Let f(q) = 17q2 - 35q - 17. Let z(s) = s*2 - 2s - 1. Determine -f(o) + 11z(o). -6o*2 + 13o + 6 Let n(f) = 10f2 + 4f + 1. Suppose -125x = -63x - 67x + 20. Let i(d) = -9d*2 - 3d - 1. Calculate xi(a) + 3n(a). -6a2 - 1 Let f(a) = 3a*3 - 2a*2 - 5a - 1. Let m(c) be the second derivative of -39c5/20 + 9c*4/4 + 11c*3 + 6c*2 + 602c + 4. What is 27f(r) + 2m(r)? 3r3 - 3r - 3 Let u(z) = 6z. Let k(f) = -82f - 2. Let h(g) = -k(g) - 11u(g). Let b(x) = -x. Give -10b(p) - h(p). -6p - 2 Let z(w) = -34w*2 - 32w + 88. Let r(u) = 14u2 + 15u - 44. Calculate 5r(c) + 2z(c). 2c2 + 11c - 44 Let i(v) = -169v2 - 67v - 7. Let b(u) = -167u2 - 54u - 6. Give 5b(d) - 4i(d). -159d2 - 2d - 2 Let m(i) = -i3 - i2 - i + 1. Let r(u) = -34u3 - 106u + 34u - 2845 + 2917 - 72u*2 - 50u*3. What is 72m(o) - r(o)? 12o3 Let z be (-27)/(5670/60) + (-116)/(-14). Let g(a) = -20a. Let u(w) = -4w + 0w + 11w. What is zu(k) + 3g(k)? -4k Let z(f) = -f*3 - 23f - 3. Let q(v) = 3v3 + 4v*2 + 67v + 10. Give -2q(k) - 7z(k). k*3 - 8k*2 + 27k + 1 Let q(b) = -4197b + 97. Let w(s) = -2099s + 54. Calculate -5q(y) + 9w(y). 2094y + 1 Suppose -3q + 5z = -286, -4q + z + 290 = -q. Let g = q + -103. Let m(y) = -2y - 13. Let x(f) = -f - 6. Determine gm(w) + 13x(w). -w Let b(s) = -4s*2 + 3s - 3. Let d = -18 - -42. Suppose 5i = i - d. Let a(p) = 5p*2 - 4p + 4. Suppose 1071 + 879 = -291k + 495. Determine ib(m) + ka(m). -m2 + 2m - 2 Let u(q) = 8q - 379. Let z(i) = -12i + 554. Give -7u(g) - 5z(g). 4g - 117 Let m(o) = -2o*2 - 12o - 386. Let g(f) = -f*2 - 7f - 192. Give 5g(n) - 3m(n). n*2 + n + 198 Let r(c) be the second derivative of 3c*3/2 + 5c*2/2 - c - 517. Let h(t) = -27t - 14. Give -6h(i) - 17r(i). 9i - 1 Let j(b) = b. Let i be (24 + 9 - 30) + -4 + -1. Let s(f) = -f2 + 20. Determine ij(x) + s(x). -x*2 - 2x + 20 Suppose -4v + q + 2 = -20, -3v = 2q. Let h(m) = 3m. Let l(s) = s*2 - 5s - 1. Determine vh(z) + 3l(z). 3z2 - 3z - 3 Let c(h) = -h*3 - 7h*2 + h + 1. Let w(t) = -806t*3 + 49t*2 - 6t - 6. Calculate -7c(r) - w(r). 813r*3 - r - 1 Let u(k) = 7k*3 + 7k*2 + 2k + 4. Let l(d) = 6d3 + 7d*2 + 3d + 6. Calculate -4l(m) + 5u(m). 11m3 + 7m*2 - 2m - 4 Suppose 2y = -0y + 18. Suppose -2r - y = -3. Let o(f) = -6f - 15. Let p be o(r). Let t(k) = 26k + 6. Let z(v) = 5v + 1. What is pt(n) - 16z(n)? -2n + 2 Let c(q) = -150q - 6. Let y(t) = 98t + 7. Let p(f) = 2c(f) + 3y(f). Let k(m) = m. Calculate -4k(u) - p(u). 2u - 9 Let w(h) = 13h. Let q(s) = 24s. Let u(z) = -6q(z) + 11w(z). Let j(c) = -3c - 9. Calculate -j(x) + 4u(x). -x + 9 Let p(i) = -5i*3 + 3i*2 + 4i + 2. Let t(g) be the second derivative of g*5/2 - 5g*4/12 - 7g*3/6 - 2g*2 - 528g. Calculate -5p(x) - 3t(x). -5x3 + x + 2 Let j be 56/(-196) + (-1852)/(-14). Suppose j = 2o + 128. Let a(i) = i*2 - i. Let m(f) = -f. Give oa(k) - 2m(k). 2k*2 Let q(l) = -7l*3 + 5l - 6. Let n(t) = -2 + 7 + 3t3 + 1 - 8886t + 1 + 5t3 + 8880t. Suppose 4p = -0p - 24. Determine pq(b) - 5n(b). 2b3 + 1 Let d(a) = -4a. Let v(p) = 4p. Suppose 0 = -74u + 71u + 18. Suppose 0 = -3j + u + 9. Let i be -12(-4)/(-40)j. What is iv(k) - 5d(k)? -4k Let p(n) = 44n*2 - 6. Let l(o) = 44o*2 - 5. Calculate -8l(q) + 7p(q). -44q2 - 2 Let t(m) = m3 - 2m2 + 2. Let u = 6 + 34. Let z be u/6 + 2/(-3). Suppose 70x = 126 + 154. Let s(a) = -2a3 + 3a*2 - 3. Give xs(l) + zt(l). -2l*3 Let r(w) = 336w*3 - 34w*2 - 17w + 17. Let j(v) = -5v3 + 2v*2 + v - 1. Determine -102j(b) - 6r(b). -1506b*3 Let q(p) = 2p + 3. Let z(d) = 10d + 10. Let n(m) = -10m - 6 + 5 + 9m. Let j(i) = -18n(i) - 2z(i). What is 6j(w) + 5q(w)? -2w + 3 Suppose -21 = -3v - 5b, 2v - 9 - 30 = 5b. Let q(c) = -12 + 2 + 11c - 5c - vc. Let o(h) = 4h + 7. Determine 8o(m) + 5q(m). 2m + 6 Let h(t) = t. Suppose 5i - 6 = -3l, -5l + 18 - 8 = 3i. Let s(v) = v. Let q(o) = -6o. Let d(n) = -6q(n) - 34s(n). Calculate ld(j) - 5h(j). -j Let g(x) = 3x2 + x - 2. Let d(u) = -33u*2 - 15u + 3. Calculate -d(h) - 2g(h). 27h*2 + 13h + 1 Let o(q) = -53q2 - 14q + 10. Let a(u) = 53u2 + 20u - 10. What is	{ "pile_set_name": "DM Mathematics" }
nits digit of x? 3 Let g(a) = -7a - 7. Let l(h) = -6h - 7. Let k(o) = -5g(o) + 6l(o). Let j be k(5). What is the tens digit of (-4)/((j/10)/3)? 1 Let p(q) = -4q. Let t(z) = -12z + 1. Let a(f) = -8p(f) + 3t(f). Let s be a(3). What is the units digit of (-119)/s + 2/(-9)? 3 Let z(w) = 9w2 - w + 3. What is the units digit of z(4)? 3 Let t(n) = n2 - 2. Let m be t(2). Suppose 2 = mv - 20. What is the units digit of v? 1 Suppose 0 = 4u - 5g + 3, -3u + 0g + 3 = -2g. Suppose 6q - ux = 3q, -4q - x = 5. What is the units digit of (-26)/(-1 + q + 0)? 3 What is the units digit of 3 + 2/(-2) + 3? 5 Let k = 30 + -8. What is the units digit of k? 2 Let n(v) = v + 6. What is the units digit of n(3)? 9 Let x = -17 + 4. Suppose 5q = 2q + 69. Let d = q + x. What is the units digit of d? 0 Suppose 5 = -0y - 4y - 3o, -3y + 2o - 8 = 0. Let g be 2(-1)/(-4)-8. Let h = y - g. What is the units digit of h? 2 Suppose 6b - 786 = -18. What is the units digit of b? 8 Let g(z) be the first derivative of -5z*2/2 - z - 2. Let k be g(-1). Let y = k + 3. What is the units digit of y? 7 Suppose -8f + 3f + 140 = 0. What is the units digit of f? 8 Let y be 1(2 - (-4)/(-2)). Suppose y = 2g - 15 - 43. Suppose -5z = -g - 1. What is the units digit of z? 6 Let i(a) = a + 6. Let s be i(-6). Let u = s - -17. What is the units digit of u? 7 Suppose h + 2v - 30 = 0, 0 = 2h - 3v - v - 36. What is the tens digit of h? 2 Let f(x) = -x3 + 6x*2 + 7x + 4. Let i be f(7). Let u be (-28)/(-5) - i/(-10). Suppose 0 = -4j + 5l + 25, u = 4j + 5l - 9. What is the units digit of j? 5 Suppose 3n + 2u + 304 = 7n, 5n + u = 373. What is the units digit of n? 5 Suppose 3h - 40 = -2h. Let y(q) = -1. Let r(k) = k + 4. Let m(a) = r(a) + 3y(a). What is the units digit of m(h)? 9 Let j(l) = -l2 - l + 3. Let c(h) = h2 + 2h - 3. Let m(o) = -6c(o) - 5j(o). Let q be -3(20/6 - 1). What is the units digit of m(q)? 3 Let f = 47 - 22. Suppose -4y = 4a - 2y - 34, -f = -3a - y. What is the units digit of a? 8 Suppose k + 118 = 2k. What is the hundreds digit of k? 1 Let o(h) = h*3 - 3h*2 - 7h + 4. Let t be o(5). Let i = t - -1. What is the units digit of i? 0 Suppose 3 = 5h - 12. Let l(k) = -k2 + 9k - 14. Let m be l(7). Suppose 4f = -5c + 60, m = hc - 4c + 4. What is the units digit of f? 0 Let u be (9/(-5))/(2/(-20)). Let v = u + -6. What is the units digit of v? 2 Let l be -4 - (1 - 2)2. Let r(m) = -m + 1. What is the units digit of r(l)? 3 Suppose -3s - 82 = -235. What is the tens digit of s? 5 Suppose -1980 = -115m + 110m. What is the units digit of m? 6 Suppose -4u = 9 + 19. Let i = -9 + u. What is the units digit of (-10)/2i/10? 8 Let f(p) = -4p3 - p2 - 2p - 2. What is the tens digit of f(-2)? 3 Let i = 264 + -155. What is the tens digit of i? 0 Suppose 2 = 2n - 4p + 10, 5p - 10 = -n. Suppose no = o. What is the units digit of (-2)/(2 + -4 - o)? 1 Let b = 0 - 0. Suppose bl = l - 6. Suppose 0u + l = u. What is the units digit of u? 6 Suppose -5k = -2i - 16, 5k - 4 = -0k - 2i. Suppose -s + kg = -15 - 3, 0 = 5s + 3g - 51. What is the units digit of s? 2 Let c = -32 + 28. Let r(k) be the second derivative of -k5/20 - k4/3 - k*3/3 + 2k*2 - k. What is the units digit of r(c)? 2 Let g = -62 - -111. What is the units digit of g? 9 Let y = 1 + -5. What is the units digit of (-65)/(-10)y/(-2)? 3 Let b = 1 + 12. Suppose 0 = -4r + b + 15. What is the units digit of r? 7 Let j(t) = 3 - t3 + 1 - 7t - 5t2 + 12t*2 + 0. Let s be j(6). What is the units digit of 2 + 2/(s/(-7))? 9 Suppose 0 = -p + 6p - 25. Let g(v) = -v*3 + 4v*2 + 6v - 4. What is the units digit of g(p)? 1 Let n(c) = -2c2 + 3c - 2. Let z be n(2). Let p = z + 11. What is the units digit of p? 7 Suppose 4d - 8 = 0, 2d + 13 = -3m + d. Let a be (-199)/m - (-1)/5. Suppose 4v - a = -4c, -4v - 14 = -4c - c. What is the units digit of c? 6 Let k(h) = h2 - 4h - 10. Let d be k(6). What is the units digit of (-483)/(-18) - d/(-12)? 7 Let n = 7 + -5. What is the units digit of n? 2 Let k be -2(-15)/(-24)-16. What is the units digit of k - (-2)/(2/(-1))? 9 Let w(v) = v*2 - 3v - 4. Let j = 15 + -9. Let u be w(j). Let i = u - 10. What is the units digit of i? 4 Let z = 4 - -3. Let h = -5 + z. What is the units digit of h? 2 Let q = 116 + -43. What is the tens digit of q? 7 Suppose -3 = -4j - 7. Let b be 2/((-1 - 0)/j). Suppose -s + 5d + 14 = 0, s - bd + 4 = -6d. What is the units digit of s? 4 Suppose -c = j + 4 + 21, 20 = -5j. Let y = 13 + -27. Let m = y - c. What is the units digit of m? 7 Suppose 4m = 0, 2m - 3m - 260 = -5r. What is the tens digit of r? 5 Suppose -184 - 356 = 5a. Let w = a - -158. What is the tens digit of w? 5 What is the hundreds digit of ((640/12)/4)/(4/30)? 1 Suppose 3z - 7z = -280. Suppose 2y + 4h = -1 + 25, z = 4y - 3h. What is the units digit of y? 6 Let y = 2 - -29. Suppose -y = -5v + 39. What is the tens digit of v? 1 Let a(c) be the second derivative of -c5/20 - 5c*4/12 + 5c*3/6 + 2c. Let q be a(-6). Suppose -3r = -6r + q. What is the units digit of r? 2 Let k(t) = 6t - 2 - 2 - t. What is the tens digit of k(3)? 1 Let m be (-3 - 2)6/(-10). Suppose -g - 20 = -4z, -mz - 3g + 4 = -g. Suppose 0 = zx - 2x - 26. What is the tens digit of x? 1 Let i(f) = 6f*2 + 8f + 5. Let g(z) = -2z2 - 3z - 2. Let s(l) = -7g(l) - 2i(l). What is the units digit of s(-4)? 6 Let x(c) = 4c - 1. Let h be x(-2). Let u = -4 - h. What is the units digit of u? 5 Let a(p) = p - 8. Let n be a(10). Let q(i) = i2 - 4i - 1. Let m be q(4). What is the tens digit of (m - 2) + n - -13? 1 Let a = 16 - -45. What is the tens digit of a? 6 Suppose -g = -6g + 30. What is the units digit of g? 6 What is the tens digit of 3/((-76)/(-64) - 1)? 1 Suppose -o - 2o + 4v + 62 = 0, -o + 18 = -2v. What is the units digit of o? 6 Let j(l) = -l - 1. Let r be j(-3). Suppose r = -2t + 8. What is the units digit of t? 3 What is the units digit of (-7728)/(-80) + 3/(-5)? 6 Let a = 1 - -1. Let x(z) = 2z - 3. Let k be x(3). Suppose -k = -y - ay. What is the units digit of y? 1 Let j be (7/(-2))/((-1)/2). Suppose 4f - 816 = -4r, 0f + 3r = -4f + 816. What is the units digit of (-2)/j + f/28? 7 Suppose -52 = 2q - 132. What is the units digit of q? 0 Let i = -2 + -5. Let z = i - -19. What is the units digit of z? 2 Let s(m) = -m3 - 4m*2 + 6m + 4. Let w be s(-5). Let t(g) = -4g - 2g - 6g + 0g. What is the units digit of t(w)? 2 Let a(l) = l + 6. Let z be a(-11). What is the units digit of (4/z)/((-2)/5)? 2 Let d(v) = 45v2 - v. Let q(b) = -b + 2. Let i be q(3). What is the tens digit of d(i)? 4 Let h(s) = s3 - 5s*2 + 4s - 10. What is the tens digit of h(5)? 1 What is the tens digit of (-398)/(-10) + 4/20? 4 Let b(d) = -3d - 1. Let v be b(-2). Suppose 0p = -vp + 10. Suppose 0 = py - 25 - 3. What is the units digit of y? 4 Let d = -10 - -15. What is the units digit of d(1 - 12/(-20))? 8 What is the units digit of 31/646? 3 Let n = 48 - -15. Let o = -22 + n. What is the tens digit of o? 4 What is the units digit of 2/8 + 108/16? 7 Let n(i) = -i2 - 5i + 2. Let p(x) = x - 11. Let k be p(6). Let v be n(k). Suppose v = -2f + 2m, 4f = -f - 4m + 13. What is the units digit of f? 1 Suppose -5j = -v + 47, -4j + 1 = 13. What is the tens digit of v? 3 Let y = 9 - 29. Let k = y - -47. What is the units digit of k? 7 Let x(f) = -f*2 + 4f - 3. Let q be x(2). Suppose -d + 2g + 2 + 1 = 0, -15 = 5g. What is the units digit of (q + d)1 + 8? 6 Let t = 0 - -1. Let q be t/(-2 - (-34)/16). Let n = -3 + q. What is the units digit of n? 5 Let z be (4/5)/((-2)/(-5)). Suppose -4f + 30 = -zo + 2, 2o + 34 = 5f. What is the units digit of f? 6 Suppose -3d = -2 - 4. Suppose -dh + 5h = -2z + 3, 0 = -5z - 4h + 18. What is the units digit of z? 6 Suppose 2 + 0 = 2m. What is the tens digit of m/(-2) + (-86)/(-4)? 2 Let s be 3/6(1 + -1). Suppose z - 2z + 8 = s. What is the units digit of z? 8 Let c(x) = x*2 + 8x - 7. Let n = 5 - 3. Suppose 0 = r + 4, 13 = -no - 4r - 23. What is the units digit of c(o)? 3 Suppose 2h + 4a - 60 = 0, -2h = -a - 0a - 75. What is the tens digit of h? 3 Suppose -66	{ "pile_set_name": "DM Mathematics" }
biggest value in -0.1, 144, 245? -0.1 What is the fifth biggest value in 3, 3/4, -3, -726, 1/5? -726 Which is the smallest value? (a) -9/7 (b) 2 (c) 0.2 (d) -0.24 (e) 3/8 a Which is the second smallest value? (a) 0 (b) -217 (c) -3 (d) 2/15 (e) -0.36 c Which is the second smallest value? (a) 0.5 (b) 0 (c) 8033/2 (d) 6/13 d What is the fourth biggest value in 24, -1, -5, -0.059, -0.3, 0? -0.3 Which is the second smallest value? (a) -5 (b) -246.7 (c) 5 (d) -0.3 a Which is the biggest value? (a) -33 (b) 4 (c) -7 b What is the smallest value in 0.5, 719, 26? 0.5 What is the third biggest value in -17.2, -10, -3, -2/9, 1/2, -0.4? -0.4 Which is the second biggest value? (a) 1/3 (b) -219 (c) 13 (d) 5 (e) -3 (f) -0.4 d Which is the second smallest value? (a) -56 (b) 3/4 (c) 0 (d) -3/8 d Which is the third biggest value? (a) -0.2 (b) -16.6 (c) 1/1926 b What is the second biggest value in 115, 2/5, 2/9, 431, -5? 115 Which is the sixth biggest value? (a) 0.65 (b) -2 (c) -0.3 (d) 3/4 (e) -0.184 (f) 3/7 b What is the second smallest value in -0.1, -5, 2, -1067? -5 Which is the biggest value? (a) -157922 (b) -0.2 (c) -0.1 c Which is the fourth smallest value? (a) 1 (b) -2/15 (c) -1 (d) 0 (e) -847 (f) -5 b What is the third smallest value in -30/61, -2/75, -3/5, 0? -2/75 Which is the second biggest value? (a) 0.698 (b) 0.4 (c) -1/4 (d) 0.2 b Which is the biggest value? (a) 5/12 (b) -3 (c) 28 (d) 0.4 c Which is the third biggest value? (a) -0.08 (b) -6 (c) -258/11 c What is the third smallest value in -0.1, 5, -0.759, -127? -0.1 What is the smallest value in -0.05, 6857/10, 1/3? -0.05 What is the third smallest value in -2/9, 5, -2, 1717, 0? 0 What is the fifth biggest value in 57, -2/17, 0, -138, 2? -138 What is the third smallest value in -0.051106, 3/2, 3, -5? 3/2 What is the third biggest value in 3, -27, 1/4, 2/643? 2/643 Which is the smallest value? (a) -5/4 (b) -4 (c) -2 (d) 2/13 (e) 14670 (f) 4 b What is the third smallest value in -5.1, -10/141, -5? -10/141 What is the third smallest value in 19, 3, 67? 67 What is the fifth smallest value in 2, -7.5, 145.7, 0.3, -5, -4? 2 What is the fourth smallest value in 14, 0, -7, -0.1, -5? 0 Which is the smallest value? (a) -7/16 (b) -3/14 (c) -13/6 c What is the third smallest value in 3, 0.3, -187, -61? 0.3 Which is the fifth smallest value? (a) 37 (b) -5 (c) -72 (d) 0.03 (e) 4 (f) 1/4 e What is the second biggest value in 0.08, 166, 118? 118 Which is the third smallest value? (a) -2 (b) -6 (c) 30761 c What is the sixth biggest value in -4, 0.02, 1, -1, -3, 2/21? -4 What is the smallest value in -0.0415, -0.04, 2/9, 4? -0.0415 Which is the third smallest value? (a) 128 (b) -1/6 (c) -4 (d) 1/5 d Which is the fifth biggest value? (a) -1778 (b) 0 (c) -4 (d) -1/2 (e) -0.2 (f) 2/3 c Which is the biggest value? (a) -1/4 (b) -12 (c) -3750 a Which is the second smallest value? (a) -1/2 (b) -2/27 (c) 0.1 (d) 5 b Which is the third smallest value? (a) -4/9 (b) -0.03 (c) 1 (d) 13 (e) -0.5 (f) -0.08 f What is the biggest value in 5/3, 0.4, -0.064, 1, 2? 2 Which is the smallest value? (a) -4 (b) -93 (c) -13.1 b Which is the biggest value? (a) 0.08 (b) 0.3 (c) 138/233 (d) 3 d What is the third smallest value in -0.2, 32.25, -62? 32.25 What is the second smallest value in 1.1, 0, 2/5, -4/7, 0.31? 0 What is the third biggest value in 1, 0.2, -1/6, -1/3, 1545? 0.2 What is the second smallest value in -2/3, -755/2, 2? -2/3 Which is the smallest value? (a) -1 (b) 0.0353 (c) -0.05 a What is the fifth biggest value in 5/3, 211, 0.1, 0, 5, 1/2? 0.1 What is the third smallest value in -956, 2, -6? 2 What is the biggest value in -3, 92, 3, 2/3, -63? 92 What is the fourth smallest value in 3/2, -4.09, 3/7, -5, 6? 3/2 What is the fourth biggest value in -0.5, -2/1285, 23, -1/4? -0.5 What is the third biggest value in -3/401, -25, 0.1? -25 What is the second smallest value in -0.3, 270, 0.06? 0.06 Which is the smallest value? (a) 1/5 (b) 5 (c) -10 (d) -47 (e) 0 (f) -2 d Which is the biggest value? (a) -1080 (b) 33 (c) -2/93 b What is the second smallest value in 0.7, 4/7, -2, -0.6957? -0.6957 What is the third biggest value in 0.045, -0.3, -122? -122 Which is the biggest value? (a) 4/2217 (b) -1/2 (c) 1 (d) 0.1 c Which is the second biggest value? (a) 2818 (b) 1/2 (c) 1.6 c Which is the fourth smallest value? (a) 0.3 (b) -3 (c) -2/35 (d) -1.58 (e) 1/2 (f) -1 c Which is the biggest value? (a) -106.47 (b) -0.3 (c) -1 (d) -4 b What is the third biggest value in -1, -2, -13, 4/5, 11, 0.04? 0.04 What is the fourth smallest value in -1, 67, -3, -0.5, 0.3? 0.3 What is the fourth biggest value in -2639, 2/57, 0.5, -0.4? -2639 Which is the third smallest value? (a) 464 (b) 1 (c) -0.69 a What is the fifth smallest value in -2, 0.2, 11570, -1/2, -4? 11570 Which is the smallest value? (a) 4337 (b) -4/7 (c) -0.1 b Which is the fifth smallest value? (a) 5 (b) 0.5 (c) -4 (d) 0.2 (e) 845 e What is the fourth biggest value in 4, 1/4, -20, 0, -10? -10 What is the second smallest value in 516, -2, 0.2, 1/7, 5/4? 1/7 Which is the fifth smallest value? (a) -28 (b) -5 (c) -0.9 (d) 3 (e) 4 (f) 0.1 d What is the third smallest value in -0.5, -1, -7869, -4, -1/5? -1 What is the second smallest value in -0.053, -20, 0.4? -0.053 Which is the second biggest value? (a) 1/7 (b) -0.1 (c) -4 (d) -363 (e) 3/7 a What is the third biggest value in -100, -1.83, 12/5? -100 Which is the biggest value? (a) -2.8 (b) 3 (c) -2/47 (d) -16/9 b What is the sixth smallest value in -11, 0, 29/5, -826, 4, 2? 29/5 What is the third biggest value in 5, -364, -769? -769 What is the biggest value in -2.73, 0.3, 1, -4, 0, -2/5? 1 Which is the fifth smallest value? (a) -2 (b) 1/51 (c) -2/9 (d) -0.1 (e) -166 b What is the second biggest value in 1/3, -0.98, 37? 1/3 What is the third smallest value in -0.74, 4, 2, -3/5, -94/15? -3/5 Which is the fifth biggest value? (a) 5 (b) 0.07 (c) -0.1 (d) -24 (e) 16 d What is the third smallest value in 4, 15, -0.1, -2, -2/101? -2/101 Which is the smallest value? (a) 1/9 (b) 1/3 (c) 8/493 (d) 0.05 c What is the third biggest value in 246, 2/5, 1/5? 1/5 What is the second smallest value in -318/13, 0.1, -1/4? -1/4 What is the biggest value in -0.3, 2/5, -7, -3, 182? 182 Which is the second biggest value? (a) 0.2 (b) -88 (c) 4 a Which is the second biggest value? (a) 0.3 (b) 0.5 (c) -2/13 (d) 0.03 (e) -160 (f) 3/8 f Which is the biggest value? (a) -35 (b) -24 (c) -0.3 (d) 4 (e) -4 d Which is the fifth biggest value? (a) -5/2 (b) 0.2 (c) 9 (d) 2/7 (e) 6/5 a What is the fourth smallest value in 2/3, 177, 4, 0.98? 177 What is the smallest value in 5, -0.1, -10, -20/17, -2, -5? -10 Which is the biggest value? (a) -135 (b) 1 (c) -4 (d) 25 (e) -5 (f) -5/3 d Which is the third smallest value? (a) 1/10 (b) -2094 (c) -0.4 a Which is the third smallest value? (a) 1 (b) -0.23 (c) -13/7 a What is the smallest value in -0.5, -2, -3/4, 3/5, 325.55? -2 What is the second smallest value in 30, 13, -3? 13 Which is the biggest value? (a) 393 (b) -0.2 (c) 2 (d) -2 a Which is the fifth biggest value? (a) 5 (b) 0.94 (c) 1/5 (d) 0 (e) -5 (f) -0.3 f What is the fourth biggest value in -18, -0.024, 1, -0.4, 11/6? -0.4 What is the third biggest value in 2, -0.3, -5/221, 0.01, -3, 1/5? 0.01 Which is the second biggest value? (a) -178 (b) 4/5 (c) -2 (d) -5 (e) 0 (f) -4 e What is the fifth biggest value in 2, -9, -10, -0.9, 1/2? -10 What is the second biggest value in -25787, 2, 2/11? 2/11 What is the fourth biggest value in -4, -0.5, -5, 68, 2? -4 Which is the third biggest value? (a) -19 (b) 54 (c) 35 a What is the fourth biggest value in 1/11107, 5, -1/2, -2? -2 Which is the smallest value? (a) -1.3 (b) 0.3 (c) 8 (d) 2/3 (e) 36 a What is the second smallest value in -530, -3/370, 4? -3/370 Which is the second biggest value? (a) 3/47 (b) -0.02 (c) 6 (d) 0.5 d What is the biggest value in 1.7, -1/2, 0.2, 4/3, -5? 1.7 What is the second biggest value in 3, 0.02, -3, 0.6, -72, 12? 3 Which is the smallest value? (a) 11 (b) -15 (c) 2/23 (d) -6	{ "pile_set_name": "DM Mathematics" }
6 + 0y + 0 + 1/30y5 - 18y*2 - 1/6y*3 + 0y*4. Determine f(1). -7 Let a(d) = -d + 1. Let g(t) = 2t + 20. Let w be g(-7). Let z be (-25/w)/((-3)/(-9)). Give a(z). 6 Suppose -13 = -4n + 7. Let c(a) = na + 21 - 27 + a - a2. Calculate c(5). -1 Let x(b) = -554b - 15 + 280b + 272b. Calculate x(-7). -1 Let l = 3 + -4. Let n(o) = -13o3 - o2 - 2o - 1. Determine n(l). 13 Let f(u) be the third derivative of -u*5/60 + 7u4/24 - u3 - 30u2. Let p = 0 - 3. Let z = p + 7. Give f(z). 6 Let o(a) = 2a - 3a + 2a + a*2 + 0a. Let v = 4 - 4. What is o(v)? 0 Let t(r) = -r - 12. Let x be t(-16). Let h be 20/8x/5. Let f(q) = hq - 12 + 12. Calculate f(3). 6 Let h = -11 - -8. Let t(o) = -210 - 3o2 + 110 + o2 + 2o + 0o + 104 - o3. Determine t(h). 7 Suppose -4w + 0w + 6 = l, 0 = -l + 2. Let b(z) = -19z - 7. Let n(x) = -10x - 4. Let h(a) = 4b(a) - 7n(a). Calculate h(w). -6 Let u(f) = -f2 - 23f - 13. Let v(z) = -z*3 + 13z*2 - 5z - 106. Let o be v(12). Determine u(o). 9 Let f(g) be the second derivative of -g*3/3 + 8g*2 + 74g. Give f(11). -6 Let z = 818 - 813. Let n(l) = l*3 - 6l*2 + 6l - 11. What is n(z)? -6 Let x(j) = j + 10. Let q be x(-4). Let g(d) = 6d + 15. Let t(k) = -k - 3. Let l(b) = -2g(b) - 11t(b). Determine l(q). -3 Suppose -10 - 5 = -3m. Suppose ml - 2l = -18. Let w(k) be the third derivative of k6/120 + k5/10 - k4/24 - k3 + 5k2 + 23. What is w(l)? 0 Let d(w) = -w2 + 8w + 6. Let u = -252 + 260. Calculate d(u). 6 Let n(o) = 0o - o3 + 3o + 1 - o + o2. Let c = -562 - -561. What is n(c)? 1 Let m(n) = n3 + n + 1. Let u(c) = 5c3 - 4c*2 + 9c. Let j = 44 - 40. Let r(o) = jm(o) - u(o). What is r(3)? -2 Let p(u) be the third derivative of u6/120 - u5/20 - 11u4/24 + u3/6 - 4u2 + 10u. Give p(5). -4 Let h(g) = g3 - g2 + 1. Let f(i) = 9i2 + 2i - 7. Let m(r) = 10r2 + 3r - 8. Let d(j) = 6f(j) - 5m(j). Let b(x) = d(x) - h(x). Give b(4). 1 Let v(w) = -6w + 2. Let s be v(-4). Let y = s + -23. Let h(g) = -5g + 3. Determine h(y). -12 Let q(v) = -v2 - v - 1. Let u(w) = w3 - 11w2 - 11w + 2. Let b be u(12). Let c = b + -9. Suppose -6 = cf - 1. Give q(f). -1 Let s(b) = -b3 + 5b*2 - b - 4. Let g(p) = -2p*3 + p. Let f be g(-1). Let r = 2 + f. Give s(r). 11 Suppose 0 = 19k - 8 - 11. Let r(w) be the third derivative of -w6/30 + w5/30 - w4/12 + w3/6 - 18w2. Calculate r(k). -3 Let n = 5/8 + -1/8. Let y(a) be the third derivative of 1/12a*4 + 3a*2 + 0 + 0a + na3 - 1/120a*6 + 0a*5. Determine y(-2). 7 Let x(k) = 5k*2 + 4k + 5. Let f(b) = -3b + 3. Let s be f(3). Let r(a) = a2. Let g(o) = sr(o) + x(o). Determine g(4). 5 Let x(k) = 4k + 11. Let t(h) = -4h*2 - 163h + 38. Let z be t(-41). Give x(z). -1 Suppose t - 5t - z + 51 = 0, 0 = -2t + 5z + 9. Suppose -x - 3x + t = 0. Let p(g) = 4g2 - 7g - 1 + 3gx - 2g*3 + 6g. Give p(-4). 3 Suppose 2l = -3u + 35, 6l - 3u = 7l - 25. Let o(m) = m - 3. Determine o(l). 7 Let k(f) be the third derivative of 1/3f*4 + 0f + 1/360f6 - 7/120f5 + f3 + 0 + 4f2. Let a(g) be the first derivative of k(g). What is a(6)? 2 Let n(c) be the first derivative of c2/2 + 15. Give n(5). 5 Let u(p) = 3p*3 + 4p*2 + p - 2. Let m be 4 + (0 - -27) - 5. Suppose 6j = -7j - m. Give u(j). -12 Let w(c) = -1. Let s = 80 - 79. Let o(b) = b2 + 6b - 8. Let q(y) = -y*2 - 6y + 8. Let t(v) = -2o(v) - 3q(v). Let g(l) = st(l) - 3w(l). What is g(-6)? -5 Suppose -4z + 8z + 14 = -2v, -4z + 21 = -5v. Let y(r) = -7r*2 - 2r - 3. Let g(o) = 20o2 + 5o + 8. Let w(u) = -4g(u) - 11y(u). Calculate w(z). -4 Let u be 0 - (0 - (1 + 2)). Let t(h) be the second derivative of h*5/20 - 5h*4/12 + 2h3/3 - h2/2 + 174h + 2. Determine t(u). -7 Let s be (-1 - -3)/(-2) - 5. Let u(n) be the third derivative of 0 + 8n*2 - 1/2n*3 + 0n + 5/24n4 + 1/60n*5. Determine u(s). 3 Let q(t) = -2t - 3. Let v(a) = a + 1. Let r(c) = c*2 - 3c + 4. Let h be r(3). Suppose -8 = hl - 2l. Let b(n) = lv(n) - q(n). What is b(4)? -9 Let v(q) = 4q*2 - 19q*2 - 2 + 14q*2 + q - 4q + q*3. What is v(-3)? -29 Let c(b) = b + 16. Let h(l) = -3l - 51. Let t(q) = -14c(q) - 4h(q). What is t(-11)? 2 Let n(a) = -a*2 + a - 6. Let s be n(6). Let b = -35 - s. Let t(h) = -11h - 1. Give t(b). -12 Suppose -5j = -l - 16, -2l - 3j = 2j + 2. Let x(f) be the second derivative of -f*3/2 - 5f*2/2 - 24f. Calculate x(l). 13 Let l(w) = w + 4. Let i be l(-4). Suppose 4u + 0 - 1 = j, i = u + j + 6. Let t(q) = -4q3 + q2 + q. Calculate t(u). 4 Let b(n) be the first derivative of n*2 - 19n - 398. Give b(6). -7 Let u(z) = 427z - 119z - 6 - 307z. Suppose 36 + 4 = 4j. Give u(j). 4 Let z(i) = 3i2 + 8i + 1. Let n(b) = 5b2 + 14b + 1. Let a(y) = 4n(y) - 7z(y). Calculate a(4). -19 Let m = 293 - 285. Let f(s) = -3s + 4. Calculate f(m). -20 Let q(t) = t2 - 2t - 4. Let n(o) = -o + 38. Let w be n(20). Let p be (42/w)/712. Determine q(p). 4 Let x(d) = -9d*2 - 10d + 53 + 58 + d*3 - 119. Give x(10). -8 Let m(a) = 1 - 4 + 2a - a*2 - 3a. Let t(n) = -3n + 6. Let d be t(2). What is m(d)? -3 Let z(i) = 2i - i + 2i + 0i - 5i + 2i*2. Let a(t) = -2t + 1. Let n be a(2). What is z(n)? 24 Let h(s) = -4s + 25. Let b = -1 - -3. Let c(j) = j - 8. Let o(g) = bh(g) + 7c(g). Suppose 38w - 21w + 85 = 0. Calculate o(w). -1 Let d be 2(-12)/871. Let o = d - -25. Let v(i) = 4i - 4i + i - 8 + 4. Determine v(o). 0 Let r = -40 - -45. Let m(b) = 4b + 17. Let p(l) = -3l - 16. Let f(z) = -4m(z) - 5p(z). What is f(r)? 7 Let d(t) = -4 - t + 2 + 9 - 26t2 - 6. Determine d(1). -26 Suppose a = -4 - 0, -6 = -5g + 4a. Let q be g/8 + 180/(-48). Let h(k) = k2 + 6k + 3. What is h(q)? -5 Let p(x) = x*3 + 7x*2 + 5x + 11. Let w(q) = -2q3 - 14q*2 - 8q - 24. Let c(z) = -5p(z) - 2w(z). What is c(-6)? 11 Let u(w) = w*2 - 2w + 2. Let k = 49 - 80. Let m = 35 + k. Let z be 1/(m5/40). Calculate u(z). 2 Let h(a) be the first derivative of a3/3 + a2 - 5a + 118. Give h(-6). 19 Let u(y) = -y - 6. Let m be u(-15). Suppose m = -0d + 3d. Suppose -2g = dn - 23, -3n - n = -5g. Let q(r) = -r*2 + 7r - 4. Calculate q(n). 6 Let c(v) = -1 + 4v - 13v + 8v. Let i(o) = 6o. Let a be i(0). Determine c(a). -1 Suppose 3i - 5p - 337 = 0, -i + 0i - 3p + 89 = 0. Let h be i/(-24) - (-1)/3. Let f(g) = g - 1. What is f(h)? -5 Let n(l) be the first derivative of l*2/2 - 3l + 8. Determine n(8). 5 Suppose -6d + 0 = -18. Let p(q) = -2q + 0 + 0q + q + d. Let l be -1(1 + 0) + -2. Calculate p(l). 6 Let x(a) be the third derivative of -a6/120 - a5/60 - a*4/24 - 10a*3/3 - 7a*2 + 1. Calculate x(0). -20 Let u(a) = 4a + 0a + 4 + 0a. Let l be 4 + -3 + 0 + 11. Let f = l - 15. What is u(f)? -8 Let g(u) = 30u2 - 3u + 5. Let j(m) = -15m2 + 2m - 3. Let h be 2/7 - 594/(-126). Let a(f) = hj(f) + 3g(f). Give a(-1). 14 Let b(w) be the first derivative of -w3/3 - w2/2 - 5w - 4. Let z(j) be the first derivative of b(j). Let m(c) = -c + 2. Let p be m(5). Calculate z(p). 5 Let y(o) = o3 - 4o*2 + o - 1. Let x(t) = -6t*3 + 20t*2 - 6t + 6. Let v be 1/((-14)/4 - -3). Let l(a) = vx(a) - 11y(a). Give l(-4). -5 Let h = -6 + 2. Let g = h - 0. Let i(r) = -6 + r*3 + 3r*2 - 3r + 3 - 2 + 0. Calculate i(g). -9 Suppose 0 = -4j + 2j + 36. Let g = 23 - j. Suppose 4 + 6 = gk. Let d(c) = 3c3 - c2 - 2c - 1. Give d(k). 15 Let a = 5 + -1. Let q(y) = -8y*2 + 17y - 16. Let x(h) = 7h2 - 15h + 13. Let b(l) = -6q(l) - 7x(l). Give b(a). 1 Let b(q) = -3q - 3. Let f = 3 + -4. Let l be f/2-12 - 2. Suppose s - 2p = -9, -1 = ls + 5p - 4. Calculate b(s). 6 Let a(v) = -2v*3 + 78v*2 + 79v + 37. Let c be a(40). Let q(o) = 5o + 1. Calculate q(c). -14 Let n(v) = -v2 - 1. Let h(m) = 3m*2 - 3m. Let r(a) = -h(a) - n(a). Let z(b) = b*2 + 6b - 4. Let w be z(-6). Let g be -1 + w(-2 + 6)/(-4). Give r(g). -8 Let f(b) be the second derivative of -b4/6 - 4b3/3 + b2/2 + 2b - 26. Give f(-6). -23 Let i = -21 + 22. Suppose 2u = 5w + i - 18, u = -2w + 5. Let j(f) = -7f2 + 1. Give j(u). -6 Let f(l) be the third derivative of -l6/120 - 4l*5/15 + 17l*4/24 - 153l**2	{ "pile_set_name": "DM Mathematics" }
highest common divisor of 14407932 and 84? 84 Calculate the highest common divisor of 25438 and 2370. 158 Calculate the greatest common divisor of 28 and 38332. 28 What is the greatest common divisor of 23986 and 4296? 358 Calculate the highest common factor of 3 and 6448. 1 Calculate the highest common divisor of 55 and 561506. 11 Calculate the highest common factor of 462 and 181797. 231 What is the greatest common factor of 91 and 3269? 7 What is the highest common divisor of 122 and 375943? 61 What is the greatest common divisor of 91135 and 110? 55 What is the highest common divisor of 474 and 108? 6 What is the greatest common factor of 36 and 120444? 12 What is the highest common divisor of 13213 and 18323? 73 What is the highest common divisor of 908892 and 36? 36 What is the highest common divisor of 191760 and 2160? 240 What is the greatest common divisor of 407 and 4699? 37 What is the highest common divisor of 34638 and 10040? 502 Calculate the greatest common factor of 12493 and 39. 13 What is the highest common factor of 14 and 80717? 7 Calculate the greatest common factor of 1705 and 2455. 5 What is the greatest common factor of 409858 and 202? 202 What is the highest common factor of 288252 and 2512? 628 Calculate the greatest common divisor of 244 and 265960. 244 Calculate the greatest common factor of 673552 and 176. 176 What is the highest common factor of 11925 and 8109? 477 What is the greatest common factor of 2128 and 1193276? 532 Calculate the greatest common divisor of 36 and 69084. 36 What is the highest common divisor of 1896 and 1027? 79 What is the greatest common divisor of 26961 and 3? 3 Calculate the greatest common factor of 83159 and 274. 137 What is the greatest common factor of 58557 and 25152? 393 What is the highest common factor of 52969 and 49? 49 What is the highest common divisor of 1752 and 3612? 12 Calculate the highest common divisor of 4002 and 2829. 69 What is the highest common factor of 57227 and 178? 89 Calculate the highest common divisor of 18814 and 322. 46 What is the highest common divisor of 594 and 214974? 54 What is the highest common divisor of 319 and 28188? 29 What is the highest common factor of 12717 and 75831? 471 Calculate the greatest common factor of 5140 and 69647. 257 What is the greatest common divisor of 1002 and 700? 2 Calculate the highest common divisor of 20870 and 355. 5 Calculate the highest common divisor of 86 and 434386. 86 Calculate the greatest common factor of 23406 and 78. 6 Calculate the highest common factor of 3994125 and 225. 75 What is the greatest common factor of 637 and 22841? 91 Calculate the highest common factor of 4979 and 14131. 13 What is the greatest common factor of 34 and 2210068? 34 Calculate the greatest common divisor of 1605 and 915. 15 What is the greatest common divisor of 46128 and 96? 48 Calculate the highest common divisor of 1374120 and 220. 220 Calculate the greatest common divisor of 62 and 354919. 31 What is the highest common divisor of 7333056 and 60? 12 Calculate the greatest common factor of 6357 and 975. 39 Calculate the highest common divisor of 495246 and 590. 118 What is the highest common factor of 46312 and 48? 8 Calculate the highest common factor of 325 and 264550. 325 What is the greatest common factor of 50502 and 456? 114 What is the highest common factor of 38484 and 180? 36 What is the greatest common factor of 59862 and 462? 66 Calculate the highest common factor of 10 and 24677. 1 Calculate the highest common divisor of 6 and 22398. 6 Calculate the highest common divisor of 220188 and 1239. 177 Calculate the highest common divisor of 6432 and 514158. 402 What is the highest common divisor of 6850 and 29850? 50 Calculate the greatest common factor of 19027 and 11488. 359 What is the highest common factor of 198 and 308418? 66 Calculate the greatest common divisor of 73630 and 185. 185 Calculate the highest common divisor of 22348 and 17063. 151 Calculate the greatest common divisor of 2353 and 195. 13 What is the greatest common factor of 84 and 7420? 28 What is the highest common factor of 225 and 1127475? 225 Calculate the highest common factor of 465880 and 40. 40 Calculate the highest common factor of 188055 and 3213. 189 Calculate the greatest common divisor of 550585 and 7. 7 Calculate the greatest common divisor of 2289 and 107256. 327 Calculate the highest common factor of 100 and 431800. 100 What is the highest common factor of 516 and 2830260? 516 What is the highest common factor of 220023 and 1431? 27 Calculate the highest common divisor of 136 and 1365304. 136 Calculate the highest common factor of 98813 and 143. 143 What is the greatest common factor of 6785 and 3876949? 1357 Calculate the greatest common divisor of 1368 and 5149. 19 Calculate the greatest common divisor of 1325508 and 12. 12 What is the greatest common divisor of 1328 and 159609? 83 Calculate the highest common factor of 1736 and 44764. 124 Calculate the highest common divisor of 112500 and 75. 75 What is the greatest common factor of 173802 and 1494? 498 What is the highest common divisor of 194402 and 104? 26 What is the greatest common factor of 23 and 12696? 23 What is the greatest common factor of 1113 and 131705? 371 Calculate the greatest common factor of 1762 and 686. 2 Calculate the highest common factor of 8348 and 1208. 4 Calculate the highest common factor of 27 and 31149. 9 Calculate the greatest common divisor of 597 and 1064451. 597 What is the highest common divisor of 62 and 79422? 62 What is the greatest common factor of 11404832 and 47? 47 Calculate the greatest common divisor of 12904 and 336. 8 What is the greatest common divisor of 1356173 and 1274? 637 What is the greatest common divisor of 30544 and 299? 23 Calculate the highest common divisor of 187 and 657577. 17 What is the highest common factor of 319 and 11506? 11 What is the greatest common divisor of 1396 and 5? 1 What is the highest common divisor of 196651 and 39? 13 What is the greatest common factor of 112590 and 1? 1 Calculate the greatest common factor of 1257 and 264. 3 What is the greatest common factor of 280761 and 253? 23 Calculate the greatest common divisor of 57960 and 18515. 805 Calculate the highest common divisor of 2448 and 10863. 153 Calculate the highest common divisor of 775 and 3460. 5 What is the highest common divisor of 3376 and 685961? 211 What is the highest common factor of 4580 and 500? 20 What is the greatest common factor of 1326 and 144898? 26 What is the greatest common factor of 8240715 and 315? 315 What is the highest common divisor of 21813 and 33? 33 Calculate the highest common divisor of 1017 and 3468083. 113 Calculate the highest common factor of 33370 and 54386. 142 Calculate the highest common divisor of 13212 and 175426. 734 What is the highest common divisor of 705110 and 5880? 490 What is the highest common divisor of 221 and 10647? 13 Calculate the highest common factor of 20 and 762668. 4 Calculate the highest common divisor of 88399 and 1622. 811 Calculate the greatest common factor of 81515 and 5950. 595 What is the highest common divisor of 57 and 47139? 57 What is the greatest common divisor of 265624 and 40? 8 Calculate the greatest common factor of 1020 and 7410. 30 What is the highest common divisor of 256860 and 270? 90 What is the highest common divisor of 78 and 769938? 78 What is the highest common factor of 390 and 1561170? 390 What is the highest common factor of 27 and 758781? 27 Calculate the highest common factor of 1728 and 54. 54 What is the greatest common factor of 1284801 and 1158? 579 What is the greatest common divisor of 320 and 53280? 160 Calculate the greatest common factor of 928 and 33234. 58 What is the greatest common divisor of 473 and 1793? 11 Calculate the greatest common factor of 59344 and 32. 16 What is the greatest common factor of 410 and 19985? 5 Calculate the highest common divisor of 261064 and 96. 8 What is the greatest common factor of 100 and 80175? 25 What is the highest common divisor of 379054 and 478? 478 What is the greatest common divisor of 16192 and 3312? 368 What is the greatest common divisor of 1000 and 8650? 50 Calculate the highest common divis	{ "pile_set_name": "DM Mathematics" }
- 58/13. Let b = r - 5267/255. Calculate the common denominator of 12/(-20) + (-1)/2 and b. 30 Let b(z) = -z*2 - z + 2. Let g(q) = 2q*3 + 20q*2 + 19q + 210. Calculate the lowest common multiple of b(0) and g(-10). 20 Let j = -25 - -29. Let v(t) = -t*2 - 23t + 112. Calculate the smallest common multiple of j and v(-26). 68 Suppose 13f + 218 - 803 = 0. What is the common denominator of -83/21 and 325/(f/6)? 21 Suppose -u + 2h + 2h = -13, 2u - 22 = 4h. Suppose -5r - u = -109. Calculate the lowest common multiple of 32 and r. 160 Suppose 3s + 2w - 5w - 42 = 0, -4w = -5s + 70. What is the smallest common multiple of 12 and 133/(-38)(-48)/s? 12 Let g = 28157/1134 - -2/567. What is the common denominator of g and 149/654? 654 Suppose 0 = 3s - 0 + 3. Let f(j) be the first derivative of -19j4/4 + j2/2 - 9. Calculate the lowest common multiple of f(s) and 16. 144 Let n be ((-4)/(-2))/(32/(-120)). What is the common denominator of 93/136 and (-14)/20 - n/10? 680 Let r be 2 + (-3 - ((-1)/(-1) + -1)). Let x(l) = 12l2 + 2l + 2. What is the least common multiple of x(r) and 21? 84 Suppose 4n = -5b + 108, -12b + 7b = -n - 123. What is the lowest common multiple of b and 20? 120 Let m(d) = 4d - 4. Let f be m(3). Let o = 285 - 288. Let u = f - o. What is the smallest common multiple of u and 7? 77 What is the common denominator of -37/6 and 140/20 + (-1198)/156? 78 Find the common denominator of 97/18 and 225/(-45) - (-1)/(36/286). 18 Suppose 2z + 50 = -2w, 2w - 3z = z - 26. Let p = w - -30. What is the smallest common multiple of (12 + 0)/((-96)/(-64)) and p? 72 Calculate the common denominator of 12/5(3 - 1) and (-455)/50 + (-9)/6 + 0. 5 Let p = -24 + 15. Let v = -1 - p. Calculate the smallest common multiple of v and 20. 40 Let o = 18072 + -18062. Let a(y) = 2y - 3. Calculate the smallest common multiple of o and a(2). 10 Let n = 244 + -1493/6. Calculate the common denominator of n and -47/14. 42 What is the common denominator of 73/42 and (-2)/(-4) - 534/588 - -1? 294 Let v be (46/2 + 2)/1. Let o = -700 - -728. Let l = o - v. Calculate the smallest common multiple of l and 11. 33 Let p = 4228 - 25277/6. What is the common denominator of 61/48 and p? 48 Suppose -2j = -h - 2, 6 = -3h - 5j - 44. Calculate the smallest common multiple of 9 and (8 - 13)44/h. 198 Suppose 5r + 660 = -5y, -5r - 4y - 530 = 133. Calculate the common denominator of -3 + 9/(r/(-192)) and 4/5. 5 Let i(v) = 4v + 6. Let b = -12 - -24. What is the least common multiple of b and i(3)? 36 Let n(i) = 1 + 33i2 - 29i + 14i + 16i. What is the common denominator of n(-1) and -10? 1 Let b = 42 + -3. Calculate the least common multiple of 39 and b. 39 Suppose c + 4c - 70 = 0. Suppose -2x = 5t - 19 - 3, -c = -5t - 4x. Calculate the lowest common multiple of t and 15. 30 Let v be ((-15)/5 + 19)1. What is the smallest common multiple of v + -3 + -1 + -4 and 22? 88 Let g be (1/(-2))/(22/167156). Let x = 110616119/18 + -6149141. Let y = x - g. Find the common denominator of y and -75/38. 342 Let a be (-8)/(-2) - (-3 + 60). Find the common denominator of -2 - a(-5)/60 and -65/18. 36 Suppose 4b - 6b = 0. Suppose -2w + 4 = -bw. Calculate the common denominator of (w - (-21)/(-6))-1 and 19/3. 6 Let j(i) = -5i - 5 + 4i*2 + 0i - 2i2 + 0i. Calculate the lowest common multiple of j(5) and 16. 80 Let w = 230 - 212. What is the smallest common multiple of w and 66? 198 Let r = -665323/70 + 9505. Let m = 254/107 - 22147/1712. Let k = 21/2 + m. Calculate the common denominator of r and k. 560 Let z(a) = 2a2 - 9 + 5a*2 + 8a - 5a2. Calculate the lowest common multiple of z(-5) and 2. 2 Let g = -347 + 753/2. Calculate the common denominator of g and -37/401. 802 Find the common denominator of ((-28)/(-3))/14 - (-89)/12 and -5/22. 132 Let l = 44/29 - 2978/2001. Calculate the common denominator of l and -56/69. 69 What is the common denominator of 29/6 and (18/(-48))/(4 + 471/(-102))? 84 Suppose 3l - 408 = -v, -l + 24 + 120 = 3v. Suppose 4g = -2b + 48, -b + 5g + l = 3b. Calculate the common denominator of -67/12 and (-1)/6b/18. 36 Suppose 4c + 5s - 8s = 125, -c = 3s - 35. Calculate the lowest common multiple of 8 and c. 32 Suppose -x + 3b = -3, 6 = -b + 3b. Let r = 86 + -18. What is the lowest common multiple of 5 and r/6 + 8/x? 60 Suppose -5f + 6k + 171 = 4k, 0 = -2f - 4k + 54. Suppose 0 = -2o + f - 21. What is the least common multiple of 5 and o? 30 Let s = 27 - 18. Let d = 2081 - 2070. Calculate the smallest common multiple of s and d. 99 Let h = -6417993 + 1752106660/273. Let l be (10/91)/(5/(-2) - -3). Let c = h + l. Calculate the common denominator of c and -45/7. 21 Let j = -46 - -87. Let g = j + -32. Calculate the lowest common multiple of 4 and g. 36 Suppose 7a = 2a + 80. Let f = 2 - 7. Let m(s) = -s + 5. Calculate the lowest common multiple of m(f) and a. 80 Find the common denominator of (2/11 + 1521/1980)-6 and -40/19. 190 Let z = -1694 + 1204. What is the common denominator of -5 + (-5 - z/72) and -55/27? 108 Let h = -28290 - -3734303/132. What is the common denominator of 1/22 and h? 132 Suppose 104 = 7v - 4v - 2g, -2v = 2g - 66. Suppose 0n - 4n = -4l - 40, 0 = 5n + 3l - v. Calculate the smallest common multiple of n and 2. 8 Calculate the common denominator of (-24)/18 + 2229/936 and 38/13. 104 Suppose 4l - 2n = 3n - 455, 0 = 5n - 15. Find the common denominator of (21/9 - 0)225/l and 55/14. 154 Suppose 0z = 2z - 10. Suppose -5d + 100 = -zk, 5k - 4d + 90 = -d. What is the common denominator of -67/2 and 54/k(-6)/(-40)? 50 Let k be ((-36)/(-60))/(2/10). Suppose 19 = kn + c, 5c = -n - 7 - 10. Calculate the least common multiple of 9 and n. 72 Let c = 56/19 - 807/190. Find the common denominator of c and 127/2154. 10770 Let t be 95/(15/(-56)). Let f = 1129/7 + t. What is the common denominator of ((-1)/2 + (-1417)/52)/(-3) and f? 28 Let v = -44/35 + -4811/210. Calculate the common denominator of v and (34/(-27))/(1/6). 18 Suppose -236 = -2p + 5r, 2p = -4r + 160 + 76. Let f = p + -104. Calculate the least common multiple of f and 6. 42 Let y = -348/35 - -74/5. Calculate the common denominator of y and ((-33)/4)/((-90)/160). 21 Let o be ((-8)/10)/(22/55). What is the common denominator of (-36)/80 + 4/(-2) and o/4(-202)/(-4)? 20 Let f = -62 - -144. Let j = f - 77. What is the lowest common multiple of j and 1? 5 Let p = 62691/11 + -5703. Calculate the common denominator of p and 36/11. 11 Let t = -569 - -71. Let j = -62269/16880 - -3/2110. What is the common denominator of t/132(3 - 2) and j? 176 Suppose -5x + 10x = 10. Let f be (-25)/3 - 2/3. Calculate the lowest common multiple of (23)/(f/(-6)) and x. 4 Let a = 2069/18 - 616/9. Calculate the common denominator of a and 110/(-16)-2 + 16/32. 4 Let i be (2 + -4)(-30)/12. Suppose 4h - 36 = -n, ih - 2n - 58 = -0n. Calculate the smallest common multiple of h and 14. 70 Let g = 448 - 432. What is the smallest common multiple of g and 144? 144 Let l = 1 + -3. Let k = l + 9. Suppose 12 = 2q + 2w + 4, 0 = -3q + 4w + 47. Calculate the lowest common multiple of q and k. 63 Let r = 225 - 129. Calculate the common denominator of -27/11 and (-481)/(-18) - (r/54)/8. 22 Let v = 2/1881 + -1325/1254. Suppose 3k - 25 = -t, -k + 10 - 45 = -4t. Calculate the common denominator of (t + (-4 - -1))/6 and v. 18 Let j = 171 + -139. Suppose -2c = 3c + 100. Let i = c + j. What is the least common multiple of i and 46? 276 Let n be (-39)/(-11) - -2 - -1. Let j = 657/176 - n. Find the common denominator of -23/6 and j. 48 Let j = 50/9 - -2/45. What is the common denominator of 63/20 and j? 20 Let x = 1/160 - -5557/480. Calculate the common denominator of x and -1/93. 372 Let y(a) = a3 - 6a*2 + 6a - 2. Let b be y(5). Let f(l) = 2l2 - l - 2. What is the lowest common multiple of 6 and f(b)? 78 Let m = 4 + -1. Suppose -mj - 2v = -33, 4j + j = -5v + 50. Suppose s - 1 = j. What is the lowest common multiple of 6 and s? 42 Let g be 2225642/220 + 4/10. Suppose 0 = -4m + 3m - 1, 50601 = -5j + 4*m. Let w = g + j. Find the common denominator of w and 101/10. 110 Let u = 5 - -1. Let g = u - 9. Calculate the lowest common mu	{ "pile_set_name": "DM Mathematics" }
3k2 - 60. Determine s(3). -5 Let i(d) = d + 10. Let y be i(0). Suppose -w - y = -3u, 5w = -4u + 6u - 11. Let p(x) = 4x - 4x - 1 + 0x - x + 5x2. Calculate p(w). 5 Suppose -4z + 3z = -4f - 32, -f + 5z - 27 = 0. Let w(v) = -v - 10. Give w(f). -3 Let b(c) = c3 - 11c*2 + 6c - 23. Let j be b(11). Let h(m) = 2m - 19 + j - 23. What is h(-4)? -7 Let m(k) be the third derivative of -k5/60 - 3k*4/8 - 10k2 - 1. What is m(-8)? 8 Let a be 8/10 + (0 - 32/40). Let t(i) = i3 + i + 5. Calculate t(a). 5 Let k(u) = -7u2 + 10u - 6. Let b = -20 - -15. Let q(g) = -11g2 + 15g - 9. Let d(f) = bq(f) + 8k(f). Give d(5). -3 Let s be 4/(-9) + (938/126 - -4). Let o(v) be the first derivative of 3 - sv - 1/3v*3 - 1/2v2. Give o(0). -11 Let b be 22/(-5) + (-4)/(-10). Let l(p) be the first derivative of -p3/3 - 5p2/2 - 2p - 660. Determine l(b). 2 Let b(f) = 14f3 - 2f*2 + 1. Let i = -21 + 24. Suppose 2p - 25 = -0p + iu, -3u - 10 = p. Suppose -pz + 4 = -1. What is b(z)? 13 Let m(a) = -2a3 + 5a*2 - 4a + 3. Let d = 216 + -213. Determine m(d). -18 Let b(v) be the first derivative of -v*3/3 + 2v*2 + 3v + 1. Suppose j = 6, 1213 = h - 3j + 1227. What is b(h)? 3 Let k(g) = -12g + 23346 - 23350 + 2g. What is k(-3)? 26 Let f(z) = 3z*2 - 33z + 5. Suppose -4p = 2x - 46, -61 + 25 = -3p - 3x. Determine f(p). 5 Let u(t) = 16t2 + 29t*2 - 9t2. What is u(1)? 36 Let i(d) be the first derivative of d3/3 + 7d2/2 + d + 2. Let m(y) = 3y + 11. Let o be m(-6). Calculate i(o). 1 Let m(w) = -2w3 - 2w*2 + 2w. Let x be m(-2). Suppose 4 = 2k - x. Let u(y) = y3 + 4 - 5y + 6y - 5y*2 - 1 + ky. Give u(4). 7 Let x = 14 - 11. Let a(d) = 7 - 3 - 6 - d + x. Determine a(1). 0 Let w be -10/(9/(-5 + 2)). Let m(d) = d2 + d - 10. What is m(w)? -10 Let v(f) be the first derivative of 1/2f*2 - 11f + 1/4f4 - 9 + 1/3f3. Give v(0). -11 Let f(h) = -h3 + 4h2 - 2h - 1. Let l be f(3). Let k(u) = -21 - 3u + 12 + 6 + 5. Determine k(l). -4 Suppose -25y + 1 = -26y. Let f(l) = 43l*2 - l - 2. Give f(y). 42 Let p(j) = 2 - 14 - 9j + j + 7j. Determine p(13). -25 Let g(r) = 13r - 7. Suppose -3p + 62s = 58s + 3, -21 = -2p - 5s. Give g(p). 32 Let c be (4/3)/(-5 - (-51)/9). Let p(f) be the second derivative of -1/3f*3 + 3f + cf2 + 0. Calculate p(5). -6 Let s(z) = -3z3 - z2 - 5. Let b(w) = -13w3 - 3w*2 + w - 21. Let k(c) = -2b(c) + 9s(c). Calculate k(-3). 3 Let z(x) = x3 + 8x*2 + 7x - 1. Let y(a) = a*3 + 7a*2 - 7. Suppose l = 4l - 5w + 1, l - 1 = 2w. Let d be y(l). Give z(d). -1 Let c(i) = -3i + 5. Let z be c(-5). Suppose 8m - z = 3m. Let d be 2((-6)/m - 1). Let h(j) = j*3 + 4j*2 - 7j - 6. Determine h(d). 4 Let w(z) = z*2 + z - 4. Let c(k) = -17k - 23. Let v(b) = c(b) - w(b). Give v(-17). -2 Let m(q) be the first derivative of 2q2 + 3q + 127. Determine m(-3). -9 Let j be 0 + 0 + 0 + -2. Let h(b) be the second derivative of 1/6b4 - 8b - 1/2b3 + 0 - 3/2b*2. Give h(j). 11 Let y(p) = -4p + 4p + 2p + 8 - p. Let z be y(-4). Let s(t) = 3 - 2 + zt - 4. Give s(2). 5 Let i(g) = -16g - 23g + 36g - 8. Let o(j) = j*3 - 11j*2 - 12j - 6. Let u be o(12). Give i(u). 10 Let g(x) be the first derivative of -x4/2 - x3/3 + x*2 + x - 563. What is g(-2)? 9 Let x be (20/6)/((-8)/24). Let p(s) = 2s + 14. Let l be p(x). Let b(o) = o + 6. What is b(l)? 0 Let w be (-2 - (-1 + -13))-1. Let b(q) = 2q + 11. Determine b(w). -13 Suppose -3m + 22 = 5q, 9q + 2m = 13q - 22. Suppose -25 = -3t - 0t + 2k, -qt = -3k - 41. Let s(p) = 2p2 - 7p - 6 - 1 - p*2. What is s(t)? -7 Let j be 114 - (-8 - (-1 - 9)). Suppose 37y + 15 = jy. Let h(n) = -n*3 + 4n*2 + 4n. Give h(y). 21 Suppose 2 + 3 = j. Suppose jq - 56 + 96 = 0. Let c(w) = -w - 1. Determine c(q). 7 Let h(k) = -8k*2 - 21 + 28 - 5k + 2k2 + 4k + 0k3 - k3. Determine h(-6). 13 Let h(a) = a3 - 11a*2 - a. Let r be 4 + (7 - 0) - 0. What is h(r)? -11 Let a(f) = 5f*2 + 7f - 6. Let w(l) = -13l2 - 21l + 17. Let m(v) = -8a(v) - 3w(v). What is m(7)? -3 Let r(w) be the second derivative of 3/2w3 + 3w*2 + 0 - 1/12w*4 - 28w. Determine r(9). 6 Let z(d) = 2d3. Let r(n) = -13n*3 - 7n*2 - 6n + 2. Let c(b) = -r(b) - 6z(b). Let k = -12 + 6. Calculate c(k). -2 Let j(q) be the third derivative of 1/12q*4 - 1/120q*6 - 1/15q*5 + 0q + 1/2q3 + 0 + 3q*2. What is j(-3)? -12 Let f(c) = 1 + 600c - 1 - 605c. Give f(1). -5 Suppose 6i - 1000 = -1072. Let h(o) = -o - 15. Determine h(i). -3 Let s be -65((-30)/25)/3. Let g be (-1)/(-2)-2-3. Suppose -3w - s = g. Let k(p) = p2 + 4p - 6. Calculate k(w). -1 Let h(k) = -k*2 + 7k - 2. Let z = 17 - 15. Suppose -4l + a + 99 = 0, zl - 5a = -2a + 47. Suppose 0 = 5i - 0 - l. Give h(i). 8 Let i(z) = 77z + 10. Let r(p) = 152p + 24. Let u(h) = 5i(h) - 2r(h). Give u(-1). -79 Suppose -5h = -3n - 27, -h = -5n - 8 - 15. Suppose h = m - 5. Let v(q) = -q*3 + 8q*2 + q - 9. Calculate v(m). -1 Let z(j) = -4j3 + j2 - j. Let u(l) = l - 26. Let k be u(10). Let b be ((-2)/(-4))/(1/(-24)). Let h be (4/(k/b))/3. Determine z(h). -4 Let x(c) = -4c3 + 38c*2 - 12c + 21. Let d(w) = w*3 - 12w*2 + 4w - 7. Let i(g) = 7d(g) + 2x(g). Calculate i(-9). 38 Let q(j) be the second derivative of j*3/6 + 6j*2 + 23j + 4. Determine q(-4). 8 Let m(l) = 2l3 - 7l*2 + 18l - 27. Let c(j) = -j*3 + 4j*2 - 9j + 13. Let g(p) = 9c(p) + 4m(p). Let a = 18 + -11. Calculate g(a). -5 Let l(d) be the first derivative of -d*4 - 2d + 4 + 4d - d - 1. Suppose -2h = -2k + 8, 24 + 1 = -5k - 4h. Calculate l(k). 5 Suppose -3b + 11m - 14m + 33 = 0, -5m + 25 = 0. Let k(s) = 5s - 25. Determine k(b). 5 Suppose 4v = 8v + 4g - 8, -4v - 4 = -2g. Let j(a) = -a3 + a - 4. Give j(v). -4 Let q(p) = -20 + 5 - 5p + 10. Let h(n) = -6n - 5. Let f(z) = 2h(z) - 3q(z). What is f(5)? 20 Suppose -4u + u = -18. Let r(i) = u - 7 - 2i + 5i. Let w = -11 - -15. What is r(w)? 11 Suppose -13s = -30s - 17. Let n(h) = -28h2 + h. Determine n(s). -29 Let n(b) = -1 - 1 + b + 3. Suppose 16x + x = -68. Let i = x - -4. Calculate n(i). 1 Let q(a) = -a + 4. Suppose 2w - 7w = -10. Let k(l) = -2l + 5. Let t(m) = wk(m) - 3q(m). Let n = 1 - 4. What is t(n)? 1 Let i(p) = -354p + 25 + 354p - p3 + p2. Determine i(0). 25 Let d(j) = j3 + 5j*2 + 3j + 6. Let x be d(-5). Let v(m) = -4m + 4 - 23m + 12m - 1 + 16m. Calculate v(x). -6 Let t = -263 + 256. Let a(g) = g*3 + 6g*2 - 8g - 5. Calculate a(t). 2 Let n(p) be the first derivative of 6 + 10/3p3 + p + p2. Determine n(-1). 9 Let d be 31/6 - ((-57)/(-18) + -3). Let r(c) be the second derivative of -3c*2 + 0 + 2c + 0c4 + 0c*3 - 1/20cd. What is r(0)? -6 Let o = -6 + 0. Let d(a) be the second derivative of a4/12 + 5a3/6 + a2/2 + 189a - 2. Give d(o). 7 Suppose 56 = 4z + 10z. Suppose 0 = zq - 8, -3q + 1 = -o - 3. Let f(n) = -5n + 1. Determine f(o). -9 Let y(q) = 10q - 17. Let b(j) = -20j + 36. Let p(n) = -6b(n) - 13y(n). Calculate p(3). -25 Suppose 3m = -5w - 35, -3m - 30 = -3w - 3. Suppose 4x = 8t - 3t + 35, -42 = 2t + 4x. Let s = m - t. Let v(a) = 6a2 - 1. Determine v(s). 5 Let k(v) = 2v*2 - 27v + 10. Let j(i) = i*2 - 13i + 5. Let r(o) = -5j(o) + 2k(o). Suppose 7a - 33 = 23. What is r(a)? 19 Let m(c) be the third derivative of c5/30 - c4/24 - c3/6 - 116c2. What is m(3)? 14 Let c(r) = r2 - 13r - 22. Let f(z) = -2z + 25. Let h be f(5). What is c(h)? 8 Let k(z) = 7z. Let d be (-48 - -54) + 1-5. Calculate k(d). 7 Let d be (0 - (1 - 0))/(-1). Let n(f) = f*3 - 4f2 + f + 1. What is n(d)? -1 Let k(z) = -z3 + 2z2 + 3z + 2. Let y be k(3). Let h(r) = -140r + 2r*y + 140r + 1. Give h(-1). 3 Let n(l) = -2l + 2. Let w(h) = -20h + 21h - 3 + 5 + 0. Let a be w(2). Determine n(a). -6 Let y(t) be the first derivative of -9t*2/2 + t + 140. Determine y(-1). 10 Let w(f) = -21f + 1. Let a be w(-2). Let r = a + -50. Let k(p) = -p*3 - 8p*2 - 8p + 3. Calculate k(r). 10 Let h(i) = i. Let r(x) = -x*3 - 5x*2 - 5x - 2. Let u(z) = -4h(z) - r(z). What is u(-4)? 14 Let q(d) = d3 - 10d*2 + d + 3. Let b(f) = -3f*3 + 29f**	{ "pile_set_name": "DM Mathematics" }
and k? 3 Let t(w) = w*2 + 5w - 13. Let n be t(-6). Let o(v) = v*3 + 8v*2 + 2v + 1. Let x be o(n). What is the greatest common divisor of 12 and x? 12 Suppose -3y - y - 16 = 0. Let k be 1/(-2 - 10/y). Suppose b = -2b + 15. Calculate the highest common factor of k and b. 1 Suppose 3p - 10 = 2. Suppose i + 0i - 20 = 0. What is the greatest common divisor of i and p? 4 Let k = 65 - 23. Suppose 5m - 4l = -9l + 70, -5l + k = 3m. What is the highest common divisor of m and 14? 14 Suppose 3t - 114 = -30. Let l(s) be the third derivative of s5/30 - s4/3 + 3s2. Let a be l(7). Calculate the highest common factor of a and t. 14 Let q(o) = o2 - 5o + 6. Let s be q(6). Let k = -3 + -1. Let h(j) = j*3 + 5j*2 + 2j. Let p be h(k). Calculate the greatest common factor of p and s. 4 Let q be (-3 - (0 - 3)) + 6. Calculate the highest common divisor of q and 24. 6 Suppose 0 = 5a - 5. Let w be (14 - 11) + 0 + a. What is the highest common factor of w and 32? 4 Let k(g) = -g2 - 12g + 28. Let x be k(-13). What is the greatest common factor of x and 5? 5 Suppose 2y - 12 = -0y. Let f be (-2)/(-4) - (-27)/y. Calculate the highest common factor of f and 55. 5 Let x be (4/(-4))/(2/46). Let l be 6/(-21) + x/(-7). What is the greatest common factor of 1 and l? 1 Let d be ((-8)/(-3))/(12/18). What is the greatest common factor of d and 6? 2 Let l(g) = g*2 + 6g - 6. Let u be l(7). Calculate the greatest common factor of u and 34. 17 Let w(z) = -z*2 + 6z - 4. Let r be w(4). Suppose 43 = 5p - 4j, -rp + 2j + 20 = -12. Let v = p - 4. Calculate the highest common divisor of v and 15. 3 Let z(r) be the second derivative of r4/6 + r3/6 + 5r2/2 + 5r. Let n be z(5). Calculate the highest common divisor of 12 and n. 12 Suppose -m = -18 - 12. What is the greatest common factor of 45 and m? 15 Suppose -2j - 2 = 2m, -4m + 4j - j + 17 = 0. Suppose 18 = 2s - 2b, -ms - b = s - 39. Calculate the highest common factor of s and 12. 12 Let p = 111 + -78. What is the greatest common divisor of 11 and p? 11 Suppose 0 = 4v + 5u - 332, 3v = -2u - u + 246. What is the greatest common divisor of 26 and v? 26 Suppose 3m = -0m - t + 139, 0 = 4m - 5t - 160. Let u be (-4)/(-18) - (-210)/27. Let j = u + -3. Calculate the highest common factor of m and j. 5 Let n(v) = 2v + 1. Let w be n(2). Suppose -4t = -m - 34, 7t - 3t + wm = 46. Let b be 12/((-1)/((-12)/t)). What is the greatest common divisor of 16 and b? 16 Let t = -42 - -283. Let m be -96 + (-1 - (-1)/(-1)). Let k = m + t. Calculate the greatest common factor of 13 and k. 13 Let p(k) = -3k2 - 5 + k2 + 3k*2 + 0. Suppose 4v + o + 15 = 0, -2v + 2o = o + 15. Let i be p(v). Calculate the greatest common factor of 20 and i. 20 Suppose -3u = -92 + 38. Calculate the highest common divisor of u and 126. 18 Suppose -71 = -3j + 4h, -10j = -5j - h - 90. Calculate the highest common factor of 51 and j. 17 Let g = 14 + -11. Suppose -gl - p = -3p - 83, 113 = 4l - 5p. What is the highest common divisor of 243 and l? 27 Let v(i) be the second derivative of -i3/6 + 5i*2 + i. Let x be v(7). Let b be -1(-11 - (-3)/x). Calculate the highest common divisor of 70 and b. 10 Suppose -4j + 37 = -43. Let a(y) = -y3 + 5y*2 + 5y - 6. Let h be a(4). Calculate the highest common factor of h and j. 10 Let w = -14 - -24. What is the highest common factor of w and 70? 10 Let g be (-57)/(-6) - (-2)/(-4). Suppose -5u - g = -6u + 5q, -5u = 2q + 63. Let s be (-6)/33 + (-266)/u. What is the greatest common divisor of 144 and s? 24 Suppose 82 = a + 2t, 235 = 3a - 0a - 5t. Suppose -230 + a = -3g. What is the greatest common divisor of 10 and g? 10 Let m be (-6)/(-12) - (-14)/4. Suppose b + 36 = mb. What is the highest common divisor of b and 3? 3 Let k(i) = 13i + 3. Let j be k(-6). Let s be 2/3(-423)/6. Let c = s - j. Calculate the highest common divisor of 7 and c. 7 Suppose -3t + 31 + 14 = 0. Suppose -5a + 4n - 7 - 4 = 0, t = -a + 4n. Calculate the greatest common divisor of a and 4. 1 Let h(a) = a3 - 9a*2 + 8a + 9. Let n be h(8). Let y = 9 + n. Calculate the greatest common factor of 6 and y. 6 Let k be (-30)/(-24)((-1)/(-1) + 175). What is the highest common factor of 44 and k? 44 Suppose -5 = -m + 4. Let r be 9 - (20/6 + 2/(-6)). What is the greatest common factor of r and m? 3 Suppose -12 = -3v + 2v + 2p, 3p - 81 = -4v. Let t = -55 - -91. Calculate the highest common factor of t and v. 18 Let s be 1/(-2) + (-217)/(-2). Calculate the highest common divisor of s and 12. 12 Suppose -z + 0s = s - 96, -3z + 2s = -288. Let m = 6 + 6. Calculate the highest common factor of m and z. 12 Suppose -3o = -15, -2m - 540 = -7m - 3o. Suppose 57 = 3z - 3g, -3g + 28 = -2z + 70. What is the highest common factor of z and m? 15 Let d be 6/18(1 - 1). Let f be d - (0 - -2) - -4. Calculate the highest common divisor of f and 10. 2 Let d be 1/(-11/(-7)). Let k be (-16 + 0)/(2/(-3)). Suppose -ky + 20y = -308. Calculate the greatest common divisor of y and d. 7 Let y = -54 + 149. What is the greatest common divisor of y and 19? 19 Let b(d) = -2d*2 - 2d. Let x be b(-2). Let t be (4/8)/((-1)/x). Calculate the greatest common divisor of 1 and t. 1 Let p be 4(-1 + -1 + 18). What is the greatest common divisor of 16 and p? 16 Suppose x + w = 23, 4x - 5w - 75 + 10 = 0. Let g(i) = -i + 19. Let a be g(9). Calculate the greatest common divisor of x and a. 10 Let c(g) = -g3 + 8g*2 + g + 2. Let k be c(8). Let s be 2/(-8) + (-65)/(-4). Let j = s + 4. Calculate the greatest common factor of k and j. 10 Let b be (-5)/(-2)4/5. Let z = b + 1. Let n be 1/z3 + 131. What is the greatest common factor of 12 and n? 12 Let h be (-4)/(-22) + (-150)/(-22). Let l be 834/21 - (-2)/h. What is the highest common factor of 5 and l? 5 Let b be (-7 - -2) + 40 - 5. What is the highest common divisor of 50 and b? 10 Let y be 3/(9/228) + 0. Suppose 0 = 3g - 2g - 1. Let c = y + g. What is the highest common divisor of 7 and c? 7 Let v be (-6)/(-18)(-90)/(-4 + 2). What is the greatest common factor of v and 60? 15 Let b(c) = -c*3 - 6c*2 - 2c - 7. Let t be b(-6). Suppose -3g = -2l + 34, tl - 80 = 3g + 14. What is the highest common factor of l and 5? 5 Suppose 7 = -v + 2v. Suppose -5u + 0u - 5o + 5 = 0, -3o = -2u - 18. Let s = v + u. What is the highest common divisor of s and 32? 4 Let x = -26 + 158. Let u(a) = a + 26. Let v be u(-14). Calculate the highest common factor of x and v. 12 Let q be 5(-52)/40-2. Calculate the greatest common divisor of 65 and q. 13 Let b be -5(3 + (-48)/10). Calculate the greatest common divisor of 63 and b. 9 Let l be ((-117)/(-6))/32. Let c = l + -6. Calculate the greatest common divisor of 28 and c. 7 Let o be (7/4)/(2/8). Suppose 2 = a, oi - 4i = 3a + 12. Suppose 2r - 84 = -0r. What is the greatest common divisor of r and i? 6 Let i(u) = -u2 + 8u - 1. Let x(q) = q*3 + 6q*2 + 4q + 2. Let m be x(-5). Let n be i(m). Calculate the highest common divisor of n and 18. 6 Let c be 62/4 + 5/10. Calculate the greatest common divisor of 144 and c. 16 Suppose 9 + 23 = 2p. What is the greatest common divisor of 112 and p? 16 Let b(j) = -j3 + 9j*2 + 2j - 1. Let u be b(9). What is the highest common divisor of u and 34? 17 Suppose 5j = -3n - 16 + 306, n + 5j - 90 = 0. What is the highest common factor of 20 and n? 20 Let b be (-694)/(-11) + (-32)/352. Calculate the greatest common divisor of b and 9. 9 Let x be ((-8)/(-20))/(1/10). Suppose -4l + 18 = 6. Suppose 0 = ld - 4u - 30, -1 = d + xu + 5. What is the greatest common factor of 12 and d? 6 Let l be (23/3)/(7/21). Calculate the greatest common divisor of l and 69. 23 Suppose 3x - 8 = 4. Suppose -4p - 2l + x + 22 = 0, 55 = 5p - 2l. Calculate the greatest common divisor of p and 1. 1 Let p = 69 - 48. Let k be 14/(-1 + 10/6). Calculate the greatest common divisor of p and k. 21 Suppose 12w - 876 = -156. Calculate the greatest common divisor of 12 and w. 12 Suppose -3b = 2o - 31, -2o + 95 = 3o + 4b. What is the highest common divisor of o and 23? 23 Let z = 20 - 11. Let w(f) = -f*2 + 4f + 30. Let u be w(7). Calculate the greatest common factor of z and u. 9 Let j	{ "pile_set_name": "DM Mathematics" }
times 2.56 -1.4803456 1408924.2 408924.2 35376 -3.76 -133013.76 Product of -0.036 and 0.0909. -0.0032724 What is the product of 781568 and -0.19? -148497.92 20758762-0.4 -8303504.8 -1688.58 -0.0382 64.503756 107 * -466603 -49926521 16-10305422 -164886752 What is -0.1092 times -7568? 826.4256 -0.3 times 2092180 -627654 Product of -3.6515 and -608. 2220.112 -363.6 -109.4 39777.84 150723 * -0.0834 -12570.2982 -0.76291 * 3.03 -2.3116173 -35717.507 times 0.13 -4643.27591 Work out -84596 * 73. -6175508 -105.73769 -81306.37 What is -0.08 times -1565.202? 125.21616 Product of -349.7 and 12531.8. -4382370.46 Product of -5 and 29861377. -149306885 What is the product of -45666237 and 5? -228331185 6330001-0.2 -1266000.2 -1.3 * 771.728 -1003.2464 What is -1120 times 95344? -106785280 What is -17.37908 times -0.4? 6.951632 Multiply -231.5 and 77.74. -17996.81 17.82400.69 7140.2958 Multiply 0.24 and 2160565. 518535.6 Product of -0.2 and 30150147. -6030029.4 Work out -4.4391032 7. -31.0737224 Multiply 11758 and 1101.6. 12952612.8 -0.2337763 times -0.1 0.02337763 What is -2 times -1253326? 2506652 Calculate -1550.8223. -762.3345 What is -5 times -5539.4598? 27697.299 Product of 0 and 730116. 0 Calculate 121023557-5. -605117785 Multiply 0.005 and -3006483. -15032.415 Calculate 54068178.1. 36816174 2-535.184 -1070.368 Work out 0.14174 * -1.16. -0.1644184 Multiply 3 and 28543159. 85629477 0.4-38929532 -15571812.8 -321.06789 -2889.6102 0.50636.917 18.680002 Multiply 75602656 and 0.5. 37801328 Product of -6.241996 and -0.33. 2.05985868 Work out -11 -735.2. 8087.2 -9322470.73 -680540.31 -0.011 429.56 -4.72516 -4-10098261 40393044 -114.717716 -1835.4832 What is 4298 times 54208? 232985984 What is the product of -2.4 and 1071054? -2570529.6 Product of 29257.613 and 4. 117030.452 Work out 28241 * 413. 11663533 0.2044 * -95224 -19463.7856 -0.1685 times 1305 -219.8925 0.32178467 653540.1 -0.1 times 157.9881 -15.79881 1.5-2578675 -3868012.5 -14504.6-219.9 3189561.54 Calculate 0.0132129-0.9. -0.01189161 What is -5.188718 times -0.26? 1.34906668 Product of 179790 and 41. 7371390 -4557 times -103 469371 Product of -0.4021 and -74.497. 29.9552437 0.3 * -324017 -97205.1 Work out 0.81 * 24854.39. 20132.0559 Calculate 0.61470.3585. 882.2151 -0.8203124 times 1.1 -0.90234364 Product of -1546.5 and 1432. -2214588 -17.6622255 -10951688 Work out -0.17783 * 0.992. -0.17640736 What is the product of -65299 and 0.111? -7248.189 69937412 13987482 -43684-1613 70462292 Work out 111 * -40885.49. -4538289.39 Calculate -1557.9-40. 62316 Product of 785694 and 3. 2357082 2805367-0.4 -1122146.8 0.878722 * -5 -4.39361 0 * -204.97853 0 Multiply 1 and 1.0321601. 1.0321601 -194.0974-422 81909.1028 -2320.28725 times 0.5 -1160.143625 Multiply -1566.9 and -243. 380756.7 What is the product of 3810 and 42185? 160724850 Product of 9052680 and -0.2. -1810536 What is the product of -36743 and 0.109? -4004.987 -979 times -3813 3732927 -0.1 times 173323058 -17332305.8 448540 2.1 941934 137368240 * 0 0 Calculate -101018171. -18352710 Multiply 7 and -202906. -1420342 3 1170.8126 3512.4378 32 times 0.305224 9.767168 Product of -5693632 and 0. 0 Product of -264.182828 and -0.3. 79.2548484 5084247811 559267258 0.1 times -2363453 -236345.3 1.91576 times 90.8 173.951008 365167 times 1.4 511233.8 Product of 0.4 and 105861. 42344.4 Work out -0.06 -85897.6. 5153.856 Calculate 4183.982735. 1664.78323 What is the product of -771 and 23095? -17806245 -4-2846387 11385548 Multiply 14.31 and -14775. -211430.25 -4 times 1779.477 -7117.908 Product of -537 and 3.611. -1939.107 -3785.7608 times -0.4 1514.30432 What is -1690624 times 0? 0 What is 18556 times 3323? 61661588 0.2 * 2186.61 437.322 -3.4 times -156507 532123.8 Work out -203 * -277.247. 56281.141 0 times -146.2803 0 Product of -25.48285 and 250. -6370.7125 Calculate 277315010. 41622730 Work out -124728 -0.66. 82320.48 -1.669444 * 0.081 -0.135224964 Calculate -31359407. -11141617 2-1445213 -2890426 Calculate -83138904. -25111232 Multiply 45311 and 36.6. 1658382.6 -893.4 times -0.26088 233.070192 0.34653 -1082 -374.94546 Product of -0.5755747 and -39. 22.4474133 Product of -578393 and -6. 3470358 Calculate -59335843. -19814737 Multiply 40061 and -1576. -63136136 -8 times 42901483 -343211864 What is -2 times -10196009.1? 20392018.2 What is the product of 0.131 and 11.3689? 1.4893259 Multiply 3 and 167064470. 501193410 What is the product of -1.0304 and -2.472? 2.5471488 Work out -123 -13.9638. 1717.5474 3 times 11265478 33796434 What is 17741073 times 0.2? 3548214.6 111239.102 26540.322 Work out 0.005 -4692. -23.46 Work out -83 * 0.1709. -14.1847 -26306-7393 194480258 Calculate 1606048.63. 780997.8 Calculate -2834.29-2. 5668.58 Multiply -3 and 32475506. -97426518 33115538 times -4 -132462152 Multiply -5400572 and 8. -43204576 Product of 3475 and -14619. -50801025 -0.19356 times 185.56 -35.9169936 -546065956 -230329780 -597-5172 3087684 779 -13.5544 -10558.8776 -51863390.3 -1555901.7 1913 -7868 -15051484 -0.1-925.498 92.5498 Multiply -3982 and 26485. -105463270 Product of -4268.273 and -0.5. 2134.1365 0.1 5921449 592144.9 What is -8040285 times 0.028? -225127.98 197838.9575 989194.785 1395 -49.57 -69150.15 What is -5 times 10832990? -54164950 Work out 24525 * 132. 3237300 -2.6389726 times -1 2.6389726 Calculate 5-2733224. -13666120 -0.412.42462 -4.969848 -0.058030.618 -401.5309 What is the product of -75.053 and -0.0043? 0.3227279 Calculate 7854130.0129. 10131.8277 What is the product of -0.1259 and 24899? -3134.7841 7 * 0.50527 3.53689 Multiply 1.9 and -154893. -294296.7 Product of 2 and -0.1342108. -0.2684216 Product of 486 and 40663. 19762218 2.0671101 times -17 -35.1408717 661-9064 -5991304 Product of 27921.0549 and -0.3. -8376.31647 0.057319264.6 18198.0822 What is the product of -0.19515605 and 3? -0.58546815 What is the product of -913499 and 4.2? -3836695.8 Calculate -10.84-44679. 484320.36 Multiply 0.15 and -29.56855. -4.4352825 What is 132791535 times 0.04? 5311661.4 -227 -74532.4 16918854.8 Product of -2.08047 and -2.02. 4.2025494 What is -675 times -8428.4? 5689170 -37 times 211372 -7820764 Calculate 20428783. 17934886 Work out -344823 -0.13. 44826.99 Calculate 0.088168041. 653443.28 -20.002 times 69.14 -1382.93828 -7814772 -5703404 Product of -2750931 and 0.2. -550186.2 2 times 183398 366796 -549.1-0.8512 467.39392 What is -0.33 times 1545487? -510010.71 -0.03363 times 167 -5.61621 What is -304.8706 times 10? -3048.706 Product of 205112 and -0.057. -11691.384 -255398 -204312 Work out -0.5 * 13457.9514. -6728.9757 What is the product of -216 and 475? -102600 -1118 times 0.28463 -318.21634 -0.2 * 22061262 -4412252.4 What is the product of -63 and 1085462? -68384106 Product of -148366.1 and -0.02. 2967.322 0.678-21061 -14279.358 Calculate 0.080.0978938. 0.007831504 What is 3602.81 times -0.141? -507.99621 -138.95003 -116.35039 What is -222294 times 1? -222294 Calculate 185623-0.28. -51974.44 What is the product of 1 and -1776.752? -1776.752 Work out 0.01980279 * 5. 0.09901395 What is the product of 0.5 and 28234920? 14117460 What is -5676696 times 144? -817444224 54 * 2550.319 137717.226 3 * -0.11389074 -0.34167222 What is the product of -23565735 and -2? 47131470 Multiply 0.1491851 and -5. -0.7459255 Multiply -457 and -13182.4. 6024356.8 Product of -55.241 and -70. 3866.87 Multiply -0.21139 and 580. -122.6062 -6 * 5703769 -34222614 -5.4 * -36379 196446.6 Product of 307.1182 and -2. -614.2364 Work out -0.0374092 * -187. 6.9955204 Multiply 44574425 and -3. -133723275 What is 19371735 times 1? 19371735 What is 2.1 times -0.06629371? -0.139216791 104498.7 * 35 3657454.5 Calculate -0.318506760.1. -0.031850676 -494 times 103.978 -51365.132 Product of 1.02740251 and 0.2. 0.205480502 1.7-2858642 -4859691.4 -10198 * 0.4952 -5050.0496 What is 1.72882 times -101? -174.61082 71 times -8.1129 -576.0159 Work out -183.2 * -304.66. 55813.712 Multiply 3.122 and 601.3. 1877.2586 Product of -3746 and -0.0971. 363.7366 157994800-5 -789974000 -0.038 -799792 30392.096 What is 38.39326 times 24? 921.43824 2215 * 2.2705 5029.1575 -377747*414 -156387258 Product of 2426464 and	{ "pile_set_name": "DM Mathematics" }
213 - -3193. What is the remainder when l is divided by 140? 0 Calculate the remainder when 260 is divided by (117/(-12) - (-3 - (-12)/(-3)))-44. 18 Suppose -536j + 531j = -4085. Suppose 813u = ju - 752. Calculate the remainder when u is divided by 64. 60 Let j(o) = 3o - 3o - 2o*2 + 0 + 10. Let b be j(-5). Let u = -6 - b. Calculate the remainder when u is divided by 12. 10 Let x = 215 - -49. Let u = 392 - x. What is the remainder when u is divided by 23? 13 Let h(q) = -7q + 99. Let x(l) = -6l + 97. Let d(o) = 3h(o) - 4x(o). Let m(k) = -10k + 5. Calculate the remainder when m(-5) is divided by d(35). 13 Suppose 0b = -4b + 136. Suppose -3i + 3c = -276, 3i + 24c - 26c - 274 = 0. Suppose iu + 9 = 91u. What is the remainder when b is divided by u? 7 Let w = 197 + 72. Suppose 814 = 42g - 824. What is the remainder when w is divided by g? 35 Calculate the remainder when ((-7248)/(-9))/2 - 4/(-30)-5 is divided by 22. 6 Let t(d) = 23 - d3 + 3d - 19d + 0d*3 - 14d*2 - 6d. Calculate the remainder when t(-13) is divided by 13. 10 Let w = 4 + -25. Suppose -338 = -28h + 15h. What is the remainder when 4/14 - (1653/w - -4) is divided by h? 23 Let a(s) = -3 - 11s2 + 12s*2 - 23s - s*3 - 4s + 15s2. What is the remainder when a(14) is divided by 87/21 - (-12)/(-84)? 3 Suppose 4x = -3p + 166, 2x + 2p - 4p = 90. What is the remainder when 12033/56 - 1 - 2/(-16) is divided by x? 42 Let i = -36 - -44. Let m be (-8)/28 + 2/7i. Suppose -ma + 39 = 35. What is the remainder when 9 is divided by a? 1 What is the remainder when ((-701270)/2760)/(2/(-12)) + (-1)/(-2) is divided by 304? 5 Let t(n) = 68n + 8818. What is the remainder when t(-118) is divided by 378? 38 Suppose 1084 = -4y + 5168. Suppose 4i + 93 - 218 = p, 10i = p + 311. What is the remainder when y is divided by i? 29 Let i(o) = -o*3 + 4o*2 + 23o + 4. Let n be i(7). Calculate the remainder when 66 is divided by (7/(105/n))/((-24)/(-240)). 6 Suppose 3d + 4z = 2559, 34d = 36d - z - 1728. What is the remainder when d is divided by 18? 15 Suppose -3584 = -36n + 24n - 20n. What is the remainder when 412 is divided by n? 76 Let o be (1/(-2)7)/(5/(-70)). Suppose -4b - 36 = -3c - 253, -c + o = b. Calculate the remainder when b is divided by 18. 16 Let b(p) = p*3 - 48p*2 + 46p + 117. Calculate the remainder when 227 is divided by b(47). 17 Let q(g) = 27g - 99. Let v be q(9). Suppose 2d + 90 - v = 0. Let r(k) = 20k. Calculate the remainder when r(4) is divided by d. 26 Let b = 2128 - 2064. What is the remainder when 540 is divided by b? 28 Let g = 742 - 348. What is the remainder when g is divided by (-30)/(-225) - (-978)/90? 9 Let v = -5 - -19. Let r(s) = -4s*2 + 234s + 761. Calculate the remainder when r(-3) is divided by v. 9 Let t be 28/5 - (4/(-5))/2. Let j = 14 + t. Suppose y + 13 = o, -5o + 0y + j = 4y. Calculate the remainder when 37 is divided by o. 5 Suppose -k = 14 - 18. Suppose -kl - 177 - 21 = -2w, 341 = 3w + 5l. Let v = 148 - w. What is the remainder when v is divided by 11? 8 Suppose 443c - 2760 = 428c. Calculate the remainder when c is divided by 18. 4 Calculate the remainder when 3283 is divided by -10325/(-35) + -1 + 9/21. 71 Let g(d) = d*3 - 22d*2 - 839d - 23. Let s(a) = 14a - 19. Calculate the remainder when s(20) is divided by g(42). 14 Let x = 22797 - 8549. Calculate the remainder when x is divided by 95. 93 Let w(j) = -114j + 927. What is the remainder when 57 is divided by w(8)? 12 Let j be (2 - -154)(-36)/108. Suppose -17 = -4q + 19. What is the remainder when -1 + 1 + j/(-7 - -5) is divided by q? 8 Suppose 3a + s = 5s + 28, 2s = a - 6. Let c(t) = -129t + 3416. What is the remainder when c(26) is divided by a? 14 Let k(h) = 14h2 - 151h - 609. Calculate the remainder when k(-4) is divided by 140. 79 Let a(r) = r*3 + 22r*2 + 16r - 194. Suppose 2v + 0v - 4q - 116 = 0, -2q = 4v - 182. Calculate the remainder when a(-20) is divided by v. 46 Let h = 91 - 35. Suppose 5c = 30, -o + 13c = 18c - 191. What is the remainder when o is divided by h? 49 Let f = 81 + -79. Suppose -3u = 2j - 155, -fj + 5u + 137 = 2u. Calculate the remainder when j is divided by 13. 8 Let m be 1/63(-2 - -4). Let s be 1(7 - m)136/12. Suppose 0 = 10f - 14f + s. Calculate the remainder when 31 is divided by f. 14 Let t = 10 - -92. Let n = t - 32. Let j(a) = -3a*2 - 62a + 103. What is the remainder when n is divided by j(-22)? 10 Let z(j) = 2j2 - 2j - 8. Let n be z(6). Let a = 1019 - 1033. Let o = a + n. Calculate the remainder when o is divided by 7. 3 Suppose 78q = 77q + 432. Suppose 7u = 15u - q. What is the remainder when 155 is divided by u? 47 Suppose -4g - 8 = -0g, 4m - 118 = -3g. What is the remainder when 339 is divided by m? 29 Let f(j) = 3j + 7. Let h be f(0). Suppose 104 = ht - 106. What is the remainder when 388 is divided by t? 28 Let c(v) = v*3 - 5v*2 + 3v - 6. Let f(b) = -2b2 + 13b + 23. Let y be f(8). Calculate the remainder when c(6) is divided by (-34(-9)/(-18))/y. 14 Let g(z) = -38z*2 - 317z - 3. What is the remainder when 130 is divided by g(-8)? 29 Let a(h) = -2h - 3. Let p be a(-7). Suppose pk = 3k - 176. Let t = k + 46. Calculate the remainder when 46 is divided by t. 22 Let m(t) = 2t*2 - 50. Let w be 0 + (-32)/6 - 242/363. What is the remainder when 153 is divided by m(w)? 21 Let l(z) = 2z - 16. Suppose 9g + 1339 + 2 = 0. Let f = -126 - g. Calculate the remainder when f is divided by l(12). 7 Suppose -1705 - 8518 = -117b - 2618. Suppose 2m = m + 4. Suppose h = -mh + 110. What is the remainder when b is divided by h? 21 Suppose -7u = -23u - 241u + 149574. Calculate the remainder when u is divided by 40. 22 Let u(a) = a - 7. Let i be u(2). Let o be (i/20)/((-4)/16). Calculate the remainder when 7 is divided by o/(-6) + 361/114. 1 What is the remainder when -23 + (-4807)/(-207) - ((-44845)/9 - -2) is divided by 14? 11 Let r = 3936 - 3782. What is the remainder when 319 is divided by r? 11 Let t(s) = -12s + 12. Let m(b) = b. Let d(v) = -21m(v) - 3t(v). What is the remainder when d(10) is divided by (6/3)/((-2)/(-13))? 10 Let j(h) = h*3 - 9h*2 - 61h + 679. Calculate the remainder when j(9) is divided by 50. 30 Let r(p) = p + 9. Let d = -38 + 20. Let x be r(d). What is the remainder when 117 is divided by (20 + 5)x/(-15)? 12 Let y = -912 - -1092. Calculate the remainder when 783 is divided by y. 63 Let p = 242 - 169. What is the remainder when 826 is divided by -3 + p + (2 - 3)? 67 Let x = 1302 - -497. What is the remainder when x is divided by 10? 9 Suppose 3j = 5i - 1692, 2i - 5i + 992 = 4j. Calculate the remainder when 0 + -3 - i/(-6) is divided by 6. 5 Suppose 0 = 3x - 8a + 11a + 6, 2a = 0. Let q(j) = -9j3 + 3j*2 + 4j - 2. What is the remainder when 147 is divided by q(x)? 73 Suppose -109918 - 65976 = -31j. What is the remainder when j is divided by 167? 163 Suppose -5 = -4c + 7, 15 = 2n - 5c. Suppose -3z = -3h - 117 + 27, 5z - 4h - 148 = 0. Calculate the remainder when z is divided by n. 13 Let q = 366 + -366. Suppose -3l + a + 59 = q, 0l + 2l - 4a = 46. Calculate the remainder when 49 is divided by l. 11 Suppose -3s - 4j = 3 + 7, 3j + 3 = 0. Calculate the remainder when 16/4 + (-1)/s202 is divided by 36. 33 Suppose -110x = f - 108x - 305, 0 = -4f - 4x + 1200. What is the remainder when f is divided by 19? 10 Let m = -583 - -590. What is the remainder when 39 is divided by 16/3121/m? 7 Let u(n) = -21n + 3. Let q be (-80)/(-35) - ((-27)/(-21) - 1). Let z be u(q). Let t = z + 49. Calculate the remainder when t is divided by 8. 2 Let q(t) = 3t - 23. Let v be q(13). Suppose 10l = -vl + 1794. Calculate the remainder when l is divided by 10. 9 Suppose -6k + 518 = -2k + 3r, 3r = -5k + 646. Calculate the remainder when 631 is divided by k. 119 What is the remainder when 850 is divided by 5 - (24/2 - 15)? 2 Let o(v) = v3 + v2 + v + 102. Let r be o(0). Let k = -14 - r. Let t = k - -125. Calculate the remainder when 41 is divided by t. 5 Suppose -4j - 86 = -5r, -7r = -3r - j - 60. Suppose 4p + 44 = 3b - r, 2b = 2*p + 38. Let u = 151 + -100. Calculate the remainder when u is divided	{ "pile_set_name": "DM Mathematics" }
hat is the v'th term of -693, -2659, -5891, -10389, -16153? -633v2 - 67v + 7 What is the i'th term of 547, 340, -211, -1274, -3017? -28i3 - 4i2 + i + 578 What is the v'th term of -883, -4513, -10569, -19057, -29983? -v3 - 1207v2 - 2v + 327 What is the z'th term of -53599, -107203, -160813, -214429, -268051, -321679, -375313? -3z2 - 53595z - 1 What is the l'th term of -2699, -5416, -8135, -10856, -13579, -16304? -l*2 - 2714l + 16 What is the h'th term of -10268, -20536, -30804, -41072, -51340, -61608? -10268h What is the c'th term of -1611, -1679, -1793, -1977, -2255, -2651? -4c3 + c2 - 43c - 1565 What is the v'th term of -55, 190, 403, 578, 709, 790, 815? -v3 - 10v*2 + 282v - 326 What is the w'th term of 4167, 4143, 4119, 4095, 4071, 4047? -24w + 4191 What is the q'th term of -730, -2915, -6550, -11635, -18170, -26155? -725q*2 - 10q + 5 What is the u'th term of -47, -12, 39, 106, 189? 8u2 + 11u - 66 What is the k'th term of 23, 56, 111, 200, 335, 528, 791? 2k3 - k2 + 22k What is the a'th term of 1084, 8623, 29076, 68899, 134548, 232479, 369148, 551011? 1076a3 + a2 + 4a + 3 What is the g'th term of -135836, -271660, -407474, -543272, -679048, -814796, -950510? g3 - g2 - 135828g - 8 What is the z'th term of -59, -727, -1841, -3401, -5407, -7859? -223z*2 + z + 163 What is the p'th term of 343, 723, 1371, 2287, 3471, 4923, 6643? 134p*2 - 22p + 231 What is the o'th term of -7397, -14863, -22329, -29795, -37261? -7466o + 69 What is the g'th term of 250, 347, 442, 535, 626, 715, 802? -g2 + 100g + 151 What is the c'th term of 16, 73, 114, 133, 124? -c*3 - 2c*2 + 70c - 51 What is the l'th term of -9326, -9324, -9322? 2l - 9328 What is the r'th term of 190, 720, 1594, 2812, 4374, 6280, 8530? 172r*2 + 14r + 4 What is the l'th term of -94965, -189915, -284863, -379809? l*2 - 94953l - 13 What is the w'th term of 662, 792, 922? 130w + 532 What is the i'th term of -2917645, -2917647, -2917649? -2i - 2917643 What is the d'th term of 13331, 26659, 39987, 53315, 66643? 13328d + 3 What is the z'th term of 185, 513, 841, 1169, 1497, 1825? 328z - 143 What is the m'th term of 2010, 7750, 17318, 30714, 47938, 68990, 93870? 1914m2 - 2m + 98 What is the k'th term of -4711, -4613, -4349, -3835, -2987, -1721, 47? 14k3 - k2 + 3k - 4727 What is the v'th term of -56, 258, 572, 886, 1200? 314v - 370 What is the y'th term of 4716, 9424, 14134, 18846? y2 + 4705y + 10 What is the n'th term of -4644, -4642, -4640, -4638, -4636? 2n - 4646 What is the l'th term of -20141, -40290, -60439, -80588, -100737? -20149l + 8 What is the l'th term of -182579, -365157, -547735? -182578l - 1 What is the j'th term of 4020, 8019, 12038, 16071, 20112, 24155, 28194? -j3 + 16j*2 + 3958j + 47 What is the u'th term of 95, -109, -451, -931? -69u2 + 3u + 161 What is the q'th term of -8347, -16746, -25145, -33544, -41943? -8399q + 52 What is the j'th term of -47, -182, -445, -866, -1475, -2302, -3377? -5j*3 - 34j*2 + 2j - 10 What is the q'th term of 13606, 13622, 13664, 13744, 13874, 14066, 14332? 2q3 + q2 - q + 13604 What is the w'th term of 617, 436, 255, 74, -107, -288? -181w + 798 What is the z'th term of 3261, 3288, 3309, 3318, 3309, 3276, 3213, 3114? -z*3 + 3z*2 + 25z + 3234 What is the g'th term of -217, -1718, -5869, -13996, -27425, -47482, -75493? -221g3 + g2 + 43g - 40 What is the d'th term of -1906, -1591, -1276, -961, -646, -331? 315d - 2221 What is the k'th term of 39441, 39503, 39563, 39621, 39677? -k2 + 65k + 39377 What is the x'th term of 170850, 170851, 170852? x + 170849 What is the y'th term of 44513, 44487, 44423, 44303, 44109? -3y3 - y2 - 2y + 44519 What is the j'th term of 275, -737, -2423, -4783, -7817, -11525, -15907? -337j2 - j + 613 What is the q'th term of -2214, -4519, -6912, -9393, -11962, -14619, -17364? -44q*2 - 2173q + 3 What is the n'th term of -4132, -8255, -12378, -16501? -4123n - 9 What is the x'th term of -423, -3391, -11449, -27141, -53011? -424x3 - x2 + 3x - 1 What is the h'th term of -13088, -26177, -39264, -52349? h2 - 13092h + 3 What is the k'th term of 214954, 214947, 214936, 214921, 214902, 214879, 214852? -2k2 - k + 214957 What is the t'th term of -8191, -8112, -8033? 79t - 8270 What is the y'th term of 8772, 8746, 8720, 8694, 8668? -26y + 8798 What is the p'th term of 5826, 5832, 5922, 6138, 6522, 7116, 7962? 7p*3 - 43p + 5862 What is the y'th term of 1874, 3771, 5690, 7637, 9618, 11639? y*3 + 5y*2 + 1875y - 7 What is the p'th term of 7359, 14722, 22085? 7363p - 4 What is the z'th term of -261, -351, -511, -747, -1065? -z3 - 29z*2 + 4z - 235 What is the b'th term of -116, -112, -100, -80? 4b2 - 8b - 112 What is the k'th term of 642, 2569, 7066, 15417, 28906, 48817, 76434? 214k3 + k2 + 426k + 1 What is the f'th term of -27468, -27466, -27460, -27450, -27436, -27418, -27396? 2f2 - 4f - 27466 What is the w'th term of -2781, -5569, -8363, -11163, -13969, -16781, -19599? -3w2 - 2779w + 1 What is the y'th term of -2068, -1969, -1872, -1777, -1684, -1593, -1504? -y*2 + 102y - 2169 What is the k'th term of 38, 185, 434, 785, 1238, 1793? 51k2 - 6k - 7 What is the r'th term of 5634, 5277, 4684, 3855, 2790? -118r2 - 3r + 5755 What is the z'th term of 1358, 5324, 11898, 21086, 32894? z*3 + 1298z*2 + 65z - 6 What is the x'th term of -50, -182, -360, -548, -710, -810, -812? 6x3 - 59x*2 + 3x What is the y'th term of -13476, -26954, -40432, -53910, -67388? -13478y + 2 What is the a'th term of 4770, 19218, 43300, 77016? 4817a*2 - 3a - 44 What is the w'th term of -14205, -14208, -14211, -14214, -14217, -14220? -3w - 14202 What is the s'th term of 146824, 293647, 440470, 587293, 734116, 880939? 146823s + 1 What is the k'th term of 15013, 30031, 45051, 60073, 75097, 90123, 105151? k*2 + 15015k - 3 What is the y'th term of 3745, 3756, 3767, 3778, 3789? 11y + 3734 What is the w'th term of -2325, -4664, -7001, -9336, -11669, -14000? w2 - 2342w + 16 What is the s'th term of 1261, 1276, 1301, 1336, 1381, 1436, 1501? 5s2 + 1256 What is the s'th term of -935, -1152, -1367, -1580, -1791, -2000? s2 - 220s - 716 What is the t'th term of 445, 884, 1311, 1726? -6t2 + 457t - 6 What is the g'th term of -49, -128, -201, -268? 3g2 - 88g + 36 What is the l'th term of -619501, -619502, -619503, -619504, -619505? -l - 619500 What is the j'th term of -150172, -300339, -450506, -600673? -150167j - 5 What is the u'th term of 36, 144, 252, 360? 108u - 72 What is the j'th term of 31011, 31010, 31009, 31008, 31007, 31006? -j + 31012 What is the f'th term of 2010, 2007, 1972, 1887, 1734, 1495? -3f3 + 2f*2 + 12f + 1999 What is the d'th term of -9414, -9421, -9432, -9447, -9466? -2d2 - d - 9411 What is the y'th term of -261, -173, -91, -15, 55, 119, 177? -3y*2 + 97y - 355 What is the a'th term of 406, 1227, 2464, 4117, 6186? 208a2 + 197a + 1 What is the g'th term of -3125, -12470, -28037, -49820, -77813, -112010, -152405? g*3 - 3117g*2 - g - 8 What is the k'th term of -47765, -47704, -47603, -47462, -47281, -47060, -46799? 20k*2 + k - 47786 What is the h'th term of -16574, -16564, -16554, -16544, -16534, -16524? 10h - 16584 What is the g'th term of 1722, 6926, 15602, 27750, 43370, 62462? 1736g2 - 4g - 10 What is the p'th term of 26502, 53003, 79504, 106005? 26501p + 1 What is the f'th term of 913, 7260, 24479, 58006, 113277, 195728, 310795, 463914? 906f*3 + 5f + 2 What is the n'th term of -2460, -4850, -7240, -9630? -2390n - 70 What is the m'th term of -1497, -954, -57, 1188, 2775, 4698, 6951? -m3 + 183m*2 + m - 1680 What is the f'th term of -195, -359, -511, -651, -779? 6f*2 - 182f - 19 What is the t'th term of 102289, 204579, 306879, 409195, 511533, 613899? t3 - t2 + 102286t + 3 What is the y'th term of -17488, -34975, -52464, -69955, -87448, -104943? -y2 - 17484y - 3 What is the v'th term of 3677, 3639, 3597, 3545, 3477? -v*3 + 4v*2 - 43v + 3717 What is the p'th term of 15405, 15713, 16021, 16329, 16637, 16945? 308p + 15097 What is the m'th term of 455, 412, 333, 212, 43, -180? -m3 - 12m**2 + 468 What is th	{ "pile_set_name": "DM Mathematics" }
and give t. -640 Rearrange (-2334b2 + 2 + 2074b*2 + 0)(15b - 25 - 20 + 47) to nb*2 + vb + sb3 + m and give s. -3900 Express -2 + 578g*3 - 526g*2 - 531g*2 + 93g*3 - 2g + 1056g2 in the form yg*3 + ug + fg2 + k and give u. -2 Express (0 + 5 - 3)(4250b + 2199b - 8922b) as z + jb and give j. -4946 Express -59 - 60 - 32n + 122 + (-7 + 6 - 2)(2n + 2n - 6n) in the form x + ln and give l. -26 Express (5u + 0u - 4u)(-2u2 + u2 + 2u*2)(14 - 10 + 15)(4 + 0 + 3 + (-11 - 23 + 12)(-1 + 6 - 3)) in the form x + vu3 + tu + iu2 and give i. 0 Rearrange -2h*2 - 23h - 298 + h*3 - 272h + 0h3 + 294h to ch3 + qh + s + th2 and give s. -298 Express -38 + 44i - 23 + 11 - 11i as p + ji and give p. -50 Express (1 - 5 + 8)(-9 - 2794r + 5579r - 2798r) in the form h + dr and give h. -36 Express -h + 2 - h3 + 1 + 2h + (4h - 6h + 0h)(h2 - h2 - 2h2) - 507h*3 - 257h*3 - 784h*3 as zh*2 + f + nh + qh3 and give n. 1 Rearrange 54367m*2 - 2 + 3m - 54383m2 + 8m + (-1 + 2 - 2)(-m2 + 0m + 0m) + 0m2 - m2 - 4m2 to the form vm + u + gm2 and give v. 11 Express 2o - 3o - 6o + (-6o + 4o + 0o)(-4 + 4 + 1) + (1 - o - 1)(0 + 6 - 4)(11 + 11 + 128) as yo + k and give y. -309 Rearrange 7675y + 14192y - 1059y to the form o + ky and give k. 20808 Rearrange (-3 + 3 + 3 + 0 - 1 + 0 + (2 - 5 + 1)(4 - 2 - 4))((1 - 3 - 1)(2t + 1 - 1) + 18t - 32t + 0t - 2 + t + 5 - 1) to k + st and give s. -114 Express -1953f*3 + 3944f*3 - 10f - 8 - 1977f3 - 3f*2 in the form o + nf + jf2 + qf*3 and give q. 14 Rearrange 28c + 24c + 71 + 25c + 20c - 94c to pc + f and give f. 71 Rearrange 13 + 75 - 88 - 21989s to the form n + ws and give n. 0 Express 5187706q*3 - 3q - 3q4 - 5187609q*3 + 1 + 6q*4 as nq*2 + wq*4 + b + vq*3 + zq and give z. -3 Express -33p4 - 35p*4 + 10p - 4 - p*3 - 55 + 66p*4 in the form xp*2 + jp*4 + ip + wp3 + q and give i. 10 Express 1383j*2 + 16279 - 16279 as tj*2 + hj + q and give t. 1383 Rearrange -2 - l*2 + 26 + 229l*3 - 17 - 7 to the form jl*3 + n + ql + il2 and give j. 229 Rearrange -60x*2 + 1 + 8x*3 + 60x*2 + (4 - 3 + 2 + x)(7x2 - 7x*2 + 7x*2) to the form cx*2 + b + rx*3 + tx and give c. 21 Rearrange -88m - 5 - 127m - 82m to the form hm + r and give r. -5 Express -b + 0b + 3b + ((-14 - 55 + 18)((1 - 5 + 2)(2 - 2 - 2b) - b + 0 + 0 + 3 - 3 - b) - 18b + 13b - 15b)(-3 - 1 + 2) in the form cb + n and give n. 0 Express -1 - 2j4 + 1 + (1 - 1 - 2j)(-383j*3 - 34733j*3 + 2622j*3) in the form h + fj*3 + cj*4 + vj + lj2 and give c. 64986 Rearrange -8441p*4 - 4594p*4 - 12855p4 - 1 + p4 + 1 + (-p2 - p2 + p*2)(-4 + 2p2 + 4) to rp + q + tp2 + vp*3 + zp*4 and give z. -25891 Express 826s - 6065s + 14459s + 13965s - 1553s in the form k + ls and give l. 21632 Rearrange -2525 - 7764 - 2084 + 230 - 8387 - l to the form zl + k and give z. -1 Express 8449a + 21619a + 4366a + 1 - 1 + 2a + 0a + 0a - a + (2 - 3 + 0)(4a + 4a - 6a) + 3 - 3 - a in the form wa + h and give w. 34432 Express 21h + 6 + 667h2 - 5 - h3 + 7h - 673h2 + 0h as uh2 + i + yh*3 + dh and give y. -1 Rearrange -3i + 7937508i*4 + i + 600i*3 - 7937501i*4 to the form hi + y + vi4 + ki*2 + wi*3 and give w. 600 Rearrange 1590l - 3294l + 1029l to the form h + ul and give u. -675 Express (92f*3 - 4f*3 - 30f*3)(19f - 31f - 5 + 19f) in the form uf*3 + hf + cf2 + t + mf*4 and give m. 406 Rearrange (0k + 3k - 13k)(0 - 1 + 0) - 3k + 4k - 3k + k + 0k + k - 2 + 2 + k + (-3 + 0 + 2)(-3k + 0k + k) to tk + c and give c. 0 Express 1524x + 1914 - 1916 + 370x3 - 1521x in the form kx3 + n + cx*2 + jx and give j. 3 Express -6l - 6 - 24252l*2 + l + 24272l*2 as ql*2 + al + j and give a. -5 Express (-2 + 7 - 4)(-3640u - 277 - 8 - 3u3 + 3648u) as gu2 + vu*3 + b + zu and give g. 0 Rearrange -5525q4 + 26 - 25 + 5523q*4 + 6229q*3 to z + gq*3 + rq*4 + vq + pq2 and give g. 6229 Express 16n*2 + 0n - 2n - 2n*2 - 5n*3 + 22n - 3n2 in the form pn + sn2 + m + vn*3 and give p. 20 Express -35808 + 17908 + 17900 - 8115y as s + qy and give q. -8115 Rearrange 85n*2 - 421n*2 - 413n*2 - n + 113n*2 to the form rn*2 + v + gn and give v. 0 Express (-5 - 267 + 1990h - 1987h)(3h - h - 4h) in the form vh + m + uh2 and give m. 0 Express -29 + 49b*4 + 2b*2 - 38b*4 - 11b*4 - 17b*4 - 9 - 2b as yb4 + jb + pb2 + n + xb*3 and give y. -17 Rearrange (6309 + 24487 - 8356)(4i - 4i - i) to the form f + wi and give f. 0 Express -809t*2 + 1601t*2 - 10t - 1 - 791t2 + 3t*3 in the form lt*3 + qt*2 + k + ht and give k. -1 Express 130f3 - 2f + 0 + 5 - 1 - 1260339f2 + 1260339f*2 as a + wf*2 + hf*3 + mf and give h. 130 Rearrange 12326 + 53d - 12265 - 44d to the form c + ad and give c. 61 Express 13p + 1926202p2 + 2p*3 + 5 - 1926202p*2 + 17p in the form mp2 + t + xp*3 + ip and give x. 2 Express (2b + 3b - 4b)(0 + 1 + 1)(1 + 1 + 1) - 60b - 657b + 9b + b - 2b - 2b in the form i + yb and give y. -705 Rearrange 24k*2 + 61882k + 437k2 - 61879k - 3138k2 to q + fk*2 + zk and give f. -2677 Express (-6 - 1 - 14)(-11z - 27z + 19z) in the form lz + p and give l. 399 Rearrange -4 - 781f*2 - 473f*2 + 86f*2 + 260f*2 to the form u + df*2 + jf and give d. -908 Rearrange 25886273m4 - 571m*2 - 2 - 25886275m*4 + 5m - 2m3 + m3 to zm*4 + b + dm*3 + nm*2 + hm and give z. -2 Rearrange 47l2 - 30 - 21l*2 - 16l2 + l4 + 2l4 - 12l*2 to the form g + ol + xl3 + ul*4 + bl*2 and give o. 0 Express -1185 + 1005q + 3910q + 596 + 589 in the form r + zq and give z. 4915 Rearrange -1 - 1 - 2v - 99v*2 + 50v*2 - 4v + 41v2 to dv*2 + k + lv and give k. -2 Express -1724l - 157l - 974l + 495l in the form a + xl and give a. 0 Rearrange m - 1 - 2m*2 - 209m*4 + 43m*3 + 211m*4 - 285m*3 to xm*2 + fm*4 + om*3 + u + zm and give u. -1 Express 182f - 8f*3 + 1 - 102f - 80f - 21 as zf + rf2 + m + gf*3 and give z. 0 Rearrange 123s*2 - 63s + 21s3 - 22s*3 - 123s*2 - 10 to the form n + us*3 + ls + is2 and give n. -10 Express c3 - 1589946c*4 - 3c*3 + 2c - 134c2 + 1589947c*4 as u + dc*3 + tc*4 + fc*2 + pc and give f. -134 Rearrange -4848 + 58u2 + 4848 - 78u*2 + 110u*3 to the form au + xu3 + yu*2 + k and give y. -20 Express 13 + 266v - 3 + 0 - 7 in the form y + iv and give i. 266 Express (1915 + 4m - 1672 - 890)(0 + 2 + 0 + 3 - 7 + 2 + (0 - 2 + 3)(-2 + 4 - 4)) as t + hm and give t. 1294 Express ((0m3 - m3 - m*3)(1 - m - 1) + 234m4 + 239m*4 + 77m*4)(3 + 3 - 1) as im + n + wm*3 + rm*4 + jm*2 and give r. 2760 Express -1553x + 7535 - 7535 as l + fx and give f. -1553 Rearrange (9l - 2 + 2)(-2 + 4 + 0 + (-3 + 6 - 2)(-1 - 1 + 1) + 12 + 19 - 36) + 2l + l - 5l to the form k + il and give i. -38 Express 3770c*2 - 136 + 311 + 318c*2 - 175 as mc*2 + a + pc and give m. 4088 Rearrange -36l2 - 64l*2 - 2l*3 - 115 + 3l*3 + 100l*2 - 14l to the form il + o + tl*2 + ml*3 and give i. -14 Express (67 - 29 + 7l + 107)(6l*2 - 7l*2 + 8l*2) in the form zl*2 + ml*3 + o + vl and give z. 1015 Rearrange 3 + 2927c2 - 3 + 10736c*2 to nc + g + zc2 and give z. 13663 Rearrange 25w*2 - w - 2 + 0w - w - 9w2 + 0w*2 to fw*2 + g + sw and give f. 16 Express 949m - 2 - 318m + m*3 - 181m - 104m in the form qm*3 + ym*2 + l + om and give l. -2 Express 1296j - 627j - j*2 - 595j + 32j2 as qj + m + oj2 and give o. 31 Express 2d + 31d3 + 199 - 62d*3 - 2d*2 + 30d*3 as fd*2 + od + ud3 + h and give u. -1 Rearrange -16a*3 - 73a - 2 + 18a3 + 67a - 35a2 - 1 - 3 to ia*2 + p + za + ma3 and give m. 2 Express -33d*3 - 2d*4 - 405449d + 1 - 6 + 405452d in the form fd*4 + sd*2 + vd + cd3 + k and give f. -2 Express -4s - s - 6s + (4s - 3s - 2s)(3 - 1 - 1) - 6s - 2s + 2s +	{ "pile_set_name": "DM Mathematics" }
What is the closest to -2/3 in 1/10, -3, 2, -1/2? -1/2 Which is the nearest to 1? (a) -0.1 (b) -0.02 (c) 9/10 (d) -4 c Which is the closest to -2/7? (a) 2 (b) 1 (c) -0.4 (d) 0.65 c Which is the nearest to -1? (a) -3 (b) 0.05 (c) 0.5 b Which is the nearest to -4? (a) 24 (b) -4 (c) 0.4 (d) 0.3 b What is the nearest to 1/2 in -4/7, -5, -0.3, -106? -0.3 What is the closest to 90 in -4, 0, -3, -0.1? 0 What is the closest to 0.66 in -5, 3/2, -6/7? 3/2 Which is the closest to 1/3? (a) -12 (b) -5 (c) 2/3 (d) -0.3 c Which is the nearest to -1/2? (a) 4/5 (b) -12/17 (c) 4 (d) -2/15 b What is the closest to 2 in -17, -0.1, 5? -0.1 What is the nearest to -394/31 in 1/2, 4, -1/3, -5? -5 Which is the nearest to -2/25? (a) 4/11 (b) 0.02 (c) -3 (d) 5 b What is the closest to 3/8 in 1/3, 0.08, 0.1? 1/3 What is the nearest to 0 in -4, -14/3, 0.2? 0.2 Which is the closest to -0.1? (a) 0.1 (b) 0.03 (c) 16/19 b What is the closest to 0 in 19, -1, 0.1, -1/4? 0.1 Which is the nearest to -0.1? (a) -0.3 (b) 5/6 (c) 5 (d) 2/7 a What is the nearest to -1/3 in 33, 0, -1/9? -1/9 Which is the closest to -2? (a) 0.2 (b) -5 (c) 1/9 (d) 3 c What is the closest to -3/8 in -7.6, 2/9, 0.3? 2/9 Which is the closest to 2? (a) 1/3 (b) -3/7 (c) 2/9 (d) -6 a Which is the nearest to -0.14? (a) 5 (b) -7/2 (c) 0.3 c What is the nearest to -6 in -3, -1, 109? -3 Which is the closest to 0.1? (a) 4/7 (b) -2 (c) -0.1 c Which is the closest to -5? (a) 0.06 (b) 0.1 (c) 5 a What is the closest to 1/2 in 1, -0.1, 123? 1 What is the closest to -2 in 3, 2, -68, -1? -1 Which is the nearest to 0.26? (a) 5 (b) -3/8 (c) 2 b What is the closest to 2/5 in 0.5, 2/589, 1? 0.5 What is the nearest to 64 in 2, -4/5, -2/5? 2 What is the closest to -16 in 1/3, 0.6, -0.1, -1/3? -1/3 What is the nearest to -1/3 in 0.4, 0, -4, 1/2? 0 Which is the closest to -0.04? (a) 3 (b) 0.2 (c) -2/7 b What is the nearest to -0.11 in -5/6, 2/9, 0.5? 2/9 What is the nearest to -0.6 in -12/5, -0.1, 0.5? -0.1 What is the closest to 0.2 in -5, -0.5, 94, 2/7? 2/7 What is the closest to 0 in 15, 9, -0.2, -2/5? -0.2 Which is the closest to 0.1? (a) 7 (b) -0.3 (c) 807 b Which is the nearest to 0.034? (a) -4 (b) -1 (c) 2/5 c Which is the nearest to -4? (a) -16 (b) 0.9 (c) -5 (d) 0 c What is the closest to -0.1 in -0.1, -13, 27? -0.1 What is the nearest to 3 in 1/592, -5, 4? 4 Which is the nearest to 1/4? (a) -4 (b) -0.2 (c) 0.3 (d) 0 c What is the closest to 0 in -278, -4, 0.4? 0.4 What is the closest to -0.1 in -1/8, -5.46, 5? -1/8 What is the nearest to 2/3 in 0.1, 0.5, -0.1, 0.3? 0.5 What is the closest to 1 in -0.1, 0.3, 2/11, -12? 0.3 Which is the nearest to 1/4? (a) -0.3 (b) -0.5 (c) -0.978 a Which is the nearest to -13? (a) 2/13 (b) -0.5 (c) -5 (d) 3 c What is the closest to 2 in -171, -4/7, 4, -5? 4 What is the closest to 2 in -3/7, -4/3, 4/13, -0.11? 4/13 What is the nearest to -1/5 in 1/3, -1, 10? 1/3 What is the nearest to 0 in -4/7, -0.183, 1? -0.183 What is the nearest to 27 in 5, -0.5, 11, -0.4? 11 Which is the closest to 31? (a) 0 (b) -0.5 (c) -0.3 a What is the nearest to -6 in -3, -14, -4? -4 What is the closest to 3 in -3, 1/14, -0.1, -3/2? 1/14 Which is the closest to 2? (a) 7 (b) 4 (c) 2/11 c Which is the closest to 1? (a) -3 (b) 2/5469 (c) -0.4 b What is the closest to 1 in -1/22, -2/5, -0.1? -1/22 What is the nearest to 0.1 in 0.4, 0.2, -5, -83? 0.2 Which is the closest to -1/26? (a) 0 (b) -0.2 (c) -3/5 a Which is the closest to 2/3? (a) -2/5 (b) 0.1 (c) 0.37 (d) 0 c What is the closest to -2/5 in 0.3, -3, 4, 11? 0.3 What is the closest to -7 in 4, 0.1, 2/29? 2/29 Which is the closest to 0? (a) -0.1 (b) -24/5 (c) 0.4 (d) -0.3 a What is the closest to 21 in 1, -3/8, -28? 1 What is the closest to -2 in 3, -2, -5, 0? -2 Which is the nearest to -1? (a) -5 (b) -1 (c) -1/7 b What is the closest to -1 in -0.5, -0.089, 0.2, 3? -0.5 What is the closest to -9/73 in -5, -2/3, 2/3? -2/3 Which is the closest to -1/4? (a) -0.2 (b) -1 (c) 60 (d) 2/5 a What is the closest to -34 in 1/7, 0.7, -0.5, 0.5? -0.5 Which is the closest to -5/2? (a) 2 (b) 0.2 (c) 1/3 b Which is the closest to -0.17? (a) 8 (b) 3 (c) -2 c What is the nearest to -1 in 1, -2/7, -4/3, -4/41? -4/3 Which is the nearest to -3? (a) -2 (b) -3 (c) 0.2 (d) -6/11 b Which is the nearest to -2/11? (a) 460 (b) 0.1 (c) 4 (d) 0.3 b What is the closest to -1 in 0, 5, 0.7? 0 Which is the nearest to 9? (a) 3/73 (b) 0.4 (c) -5 b What is the closest to 0.1 in 1, -25/3, -3/4, 0.1? 0.1 Which is the nearest to 1/3? (a) 1 (b) -3 (c) -0.4 a What is the nearest to -4 in -2/11, -4, -26, 0.3? -4 Which is the nearest to 3? (a) -0.1 (b) 4 (c) 6 (d) 0.3 b What is the closest to 1 in 2, -0.2, -10, -0.1? 2 Which is the closest to 5? (a) 3 (b) 1 (c) 1.1 a What is the nearest to 21 in 4, -3/2, -0.3, -0.1? 4 What is the closest to 0.72 in -5, -1/22, 4/3? 4/3 Which is the closest to 2? (a) -3/2 (b) 0.42 (c) 0 b What is the closest to -1 in -3, 3, 4, -4? -3 Which is the closest to -0.1? (a) 4 (b) 2/9 (c) 2/7 (d) 21 b What is the nearest to 1 in -0.01, -11, -3? -0.01 Which is the closest to 0.2? (a) 0.4 (b) -0.5 (c) 7/25 c What is the nearest to -1 in -2, 2/17, 6/89, 2? -2 What is the closest to -1 in -8, -2/3, 3, -1? -1 What is the closest to 0 in 3/4, 15.3, -0.2, -4? -0.2 What is the nearest to 0.1 in -1, 0.4, 0.5, 1? 0.4 Which is the closest to -1/2? (a) -4/7 (b) -2/7 (c) 1/2 (d) 0.1 a Which is the closest to 6? (a) 0.4 (b) 0.1 (c) 2 (d) -0.2 c Which is the closest to -6? (a) -24 (b) 1 (c) 1/5 (d) 2 c What is the nearest to -0.2 in 1/7, -2, 0, -0.09? -0.09 What is the closest to -0.1 in 7, 2/5, -1, -1/5? -1/5 Which is the closest to 2/7? (a) 4 (b) -1/4 (c) -0.4 (d) 1/13 d Which is the closest to -1/4? (a) 3/7 (b) 0.2 (c) -8/329 (d) -1/2 c Which is the nearest to -1/5? (a) 0.03 (b) -0.2 (c) 2.3 (d) 1/5 b What is the closest to -1 in 1, 4, -2/3, 27/2? -2/3 What is the closest to 14 in -32, 3/4, -2/9? 3/4 Which is the closest to 0.2? (a) -16 (b) -0.5 (c) 0 c What is the nearest to -1/4 in -1/12, 0.61, 4/7, -2? -1/12 What is the closest to 6 in 36/11, -0.1, 2, 4? 4 Which is the nearest to -31? (a) -2 (b) -3/7 (c) -0.2 a Which is the nearest to 0? (a) 0.067 (b) 2/7 (c) 3 a What is the closest to 0.1 in -4, 0.4, 3, -0.122? -0.122 What is the nearest to -1 in -0.3, -1/4, 1.1, 1? -0.3 What is the closest to 1/2 in -0.1, 1/7, -98, 5? 1/7 Which is the nearest to -148/11? (a) -3 (b) -7 (c) -0.3 b What is the nearest to 1/2 in -0.3, 0.109, -1? 0.109 Which is the nearest to 1? (a) 2/7 (b) -0.0216 (c) 0.4 c What is the closest to -0.2 in 1.4, 2, 2/3? 2/3 What is the closest to 2/2969 in 5, -2/17, -0.04? -0.04 Which is the nearest to -1? (a) -50 (b) -5 (c) 14 b What is the nearest to 0.1 in -69, -0.5, 0.2? 0.2 Which is the closest to 1/3? (a) 549 (b) -0.1 (c) 1/5 c Which is the nearest to -0.5? (a) -2/13 (b) -9/2 (c) -0.2 (d) -2/9 d What is the closest to -1 in 100, -3, -1? -1 Which is the nearest to 1? (a) -1/2 (b) 170 (c) -1/4 (d) -4 c What is the closest to -1 in 0.0385, -5/4, -3, -2/5? -5/4 What is the nearest to 12 in -1/2, -5, 2/7, 2? 2 Which is the nearest to 1? (a) 2/49 (b) 0.06 (c) -2/9 b Which is the nearest to -0.1? (a) -1.1 (b) -0.2 (c) -4 (d) -0.3 b Which is the closest to -27? (a) -5 (b) -1 (c) 6 (d) 2/7 a What is the nearest to 3/7 in 2/41, -5, -0.2? 2/41 Which is the closest to -1? (a) 2.24 (b) 2 (c) -1/4 (d) -2 c What is the nearest to -1 in 0.2, -3, 95? 0.2 Which is the nearest to 2/3? (a) -36 (b) -2/23 (c) 0.11 (d) 0 c Which is the nearest to -2? (a) 1/2 (b) -3/7 (c) 18 b What is the nearest to 220 in -1/9, 1, 1/4? 1 What is the closest to 0 in 4, 3.4, 1/3? 1/3 What is the nearest to 8 in -0.5, 0, 0.2, 0.4? 0.4 Which is the nearest to 0? (a) -0.5 (b) 2 (c) -19 (d) 5 a Which is the closest to 0? (a) -59 (b) -0.1 (c) -2/9 (d) 0 d What is the nearest to -21 in -5, -19, -3, 3? -19 What is the nearest to 1/4 in 0, 5, 0.3, -0.4? 0.3 Which is the closest to -10? (a) -2/15 (b) 3/4 (c) 0.11 (d) 3 a What is the nearest to -1/3 in 0.4, 0.5, -2/79, 1/5? -2/79 Which is the	{ "pile_set_name": "DM Mathematics" }
is the fifth biggest value in -0.4, 3, 3/617, 5, -0.02, 1/5? -0.02 What is the second biggest value in -801, -19, 61? -19 Which is the second biggest value? (a) -1 (b) 0.113 (c) 1/3 (d) 0.42 (e) -0.5 c Which is the sixth biggest value? (a) -2/5 (b) 142/5 (c) 51 (d) 5 (e) -0.2 (f) 0.53 a Which is the fifth biggest value? (a) 1 (b) 4 (c) -6736 (d) 4/9 (e) 0.14 (f) -1.7 f What is the fourth biggest value in 9/2, 0.4, 285, 1231? 0.4 Which is the sixth biggest value? (a) -1 (b) -113 (c) 2/5 (d) -1/72 (e) 0.2 (f) -0.3 (g) 213 a What is the smallest value in 0, 372/11, 0.03, -692? -692 What is the sixth biggest value in -0.2, -21, 0.8, -4/5, 3, 7/9, 5? -4/5 Which is the third biggest value? (a) 4.1 (b) 0.223 (c) -0.21 c Which is the sixth smallest value? (a) 0.1 (b) 5 (c) -2/33 (d) 332 (e) -0.5 (f) 1/8 d Which is the third biggest value? (a) 3 (b) -2/15 (c) -0.2 (d) 4/263 (e) 986 (f) 0.4 (g) 0.5 g What is the second smallest value in -1, 2.23, 3, -171, 1/10, -2, 0.5? -2 Which is the second biggest value? (a) 1/9 (b) 14122/3 (c) 0.009 (d) -4 a What is the fourth smallest value in -8, 119, 6936/11, -2/11? 6936/11 What is the second biggest value in 0.4, -2, 144, -1211? 0.4 Which is the fifth biggest value? (a) 1.7 (b) -8/5 (c) 1/187 (d) 2/7 (e) 0.0032 b Which is the sixth biggest value? (a) -2/7 (b) -5/4 (c) 0.02007 (d) -0.5 (e) 1 (f) 0.4 (g) 15 d What is the second smallest value in -389, -2/5, 19/4, -4, -2/3, 0.06? -4 Which is the smallest value? (a) 317 (b) 2/9 (c) 2/10239 c What is the third biggest value in 0.1, 64, -1/4, -5, -1/10, -72, -3/5? -1/10 Which is the biggest value? (a) -82 (b) -4 (c) -2/35 (d) 10.4 (e) -2/3 (f) -5 d Which is the second biggest value? (a) -50 (b) 19/4 (c) -56 a Which is the smallest value? (a) -163849 (b) -0.1 (c) 198 a What is the second smallest value in -2/13, -296/7, -18/11, 7862, -5? -5 What is the fifth smallest value in 2/15, 1/6, 2, -5/6, 32/11, 9/37? 2 Which is the biggest value? (a) 1 (b) 0.3 (c) -2/3 (d) -0.2198 (e) 4 (f) -71 e Which is the third biggest value? (a) -2 (b) 0.3 (c) 15 (d) -0.3 (e) 2150516 b What is the third biggest value in -1/5, -4, 70, -99, 4, 20? 4 What is the second smallest value in -4546, 106, 4, -5/4? -5/4 Which is the smallest value? (a) 4 (b) -4 (c) 95 (d) 42 (e) 0.2 b What is the biggest value in 4, 118, 2/13, -1/106, -0.53? 118 What is the third smallest value in 6, 0.33, -290.8, -0.28? 0.33 What is the third smallest value in 0.3, -266.64, 1/9, -0.5, 6, 68/11, -0.2? -0.2 Which is the second biggest value? (a) 640 (b) -2/5 (c) -0.3 (d) 19653 a Which is the third smallest value? (a) -307 (b) 3.394 (c) 1/6 b Which is the biggest value? (a) 1/12 (b) 2 (c) 17 (d) -1 (e) -12 (f) 3837 f Which is the biggest value? (a) -26 (b) -8 (c) -4 (d) 2/19 (e) 3/4 (f) 4 (g) -17 f What is the second smallest value in -2/1417, -8, -3? -3 What is the sixth smallest value in -0.2, -1, -25.7, -56, 0.069, -5? 0.069 What is the seventh smallest value in -6, 14, -28, -0.02, -3, -9, -0.1? 14 Which is the fifth smallest value? (a) -1 (b) 1/6 (c) 82884 (d) -0.5 (e) -0.04 (f) -5/6 b Which is the fourth smallest value? (a) -2 (b) 2/33 (c) -5 (d) 139 (e) -24 (f) 2 b What is the third smallest value in -22145.3, 7, -1? 7 Which is the fifth biggest value? (a) 11 (b) -0.1 (c) -6 (d) -362 (e) 2/15 d What is the third smallest value in 1/4, -9/2, 4, -0.005? 1/4 Which is the biggest value? (a) -0.099 (b) -12407 (c) 6 c What is the fourth smallest value in 21, -614, 3/14, -48? 21 Which is the second biggest value? (a) -4 (b) -29 (c) -83 (d) -84/179 (e) -0.4 d What is the third biggest value in 0.045, -0.1, -7, 0.3, -983? -0.1 What is the second biggest value in 0.073, -37, -0.5, -1, 0.159? 0.073 What is the third biggest value in -210, -0.4, 0.1, -2, -2195, -0.3, -1? -0.4 What is the smallest value in -3, 4, 157055, -5, -1/15? -5 What is the biggest value in 6463/4, 0.097, -6? 6463/4 Which is the second biggest value? (a) 0.2 (b) 23 (c) 261 (d) 1874 c What is the smallest value in 1, -111/80, 2/7, 26, -3/2? -3/2 What is the seventh biggest value in -144, -1/5, 0.48, 4/7, -2/5, -6, 27? -144 What is the third smallest value in 22, -1, 12, -51349? 12 Which is the third biggest value? (a) 17409 (b) -151 (c) -4 (d) -3 c What is the second biggest value in -0.359, 2/57, 41/2? 2/57 Which is the fifth smallest value? (a) -0.025 (b) -4/5 (c) -1/10 (d) 34 (e) -3.6 d Which is the second biggest value? (a) -1 (b) -2839 (c) 3/7 (d) 21/5 (e) 2 e What is the second smallest value in -0.16, -1/2, -1, 0.24, 4/39? -1/2 Which is the fourth smallest value? (a) -0.5 (b) -5 (c) -2/9 (d) -6/5 (e) -305406 a Which is the second biggest value? (a) -2 (b) 1 (c) 0.7 (d) -3.346 (e) 25 (f) 6 (g) 0 f Which is the third smallest value? (a) 116 (b) -4.08609 (c) -0.5 a Which is the fourth biggest value? (a) -293 (b) -1 (c) 1622 (d) 3 a What is the biggest value in 6, 4, 2104, -3, 2, -0.1, -0.7? 2104 What is the second smallest value in -0.4, 4, 0.5, 1/6, -11, -2/104733? -0.4 Which is the third biggest value? (a) 0 (b) 8984 (c) 3 (d) -2/5 (e) 46 c What is the sixth biggest value in -0.2, 3.2, -4/53, 0, -2, -5? -5 What is the biggest value in 1, -0.0497, -5, -6/13, 3, 0? 3 What is the second smallest value in -1, -4/3, -659590.6? -4/3 What is the sixth smallest value in -12/29, 6/5, 2, 0.2, 270/43, -5? 270/43 What is the fourth biggest value in 2, -4, 0.011176, 2/13? -4 Which is the fifth smallest value? (a) -1 (b) 2 (c) -2 (d) -1741400 (e) 2/13 (f) 0.5 f Which is the third smallest value? (a) -36.68 (b) -7 (c) -2/7 (d) 0.5 (e) -4 (f) 4/7 (g) 1 e Which is the second biggest value? (a) -1/228 (b) -27668 (c) -3 (d) 2/9 (e) -0.3 a Which is the second smallest value? (a) -6 (b) -55 (c) 11 (d) 0.1 (e) 167 (f) -4 a Which is the sixth biggest value? (a) 4/5 (b) -9572 (c) -4 (d) -5 (e) -2/3 (f) 13 b Which is the biggest value? (a) 0.2 (b) -354 (c) 2/39 (d) -4 a What is the third biggest value in -30.3, 18, 194, -4/3? -4/3 What is the second biggest value in -6, -6/19, 1/4, 2/11, 3/4, 37? 3/4 What is the fifth smallest value in -7, -1/8, -198, -373, -4? -1/8 Which is the second smallest value? (a) 2.35581 (b) 26 (c) -1 a Which is the second biggest value? (a) -337 (b) 2 (c) 2/29 (d) 0.3 (e) -3/2 (f) 0.4 f What is the smallest value in -33, 1/6, 0, 0.769? -33 What is the fourth biggest value in 129, 0, 0.4, -2, 0.17731? 0 Which is the third smallest value? (a) 21.3 (b) -6584.1 (c) 0.4 a What is the second biggest value in 1, 2/89, -2454/23? 2/89 Which is the second smallest value? (a) 35 (b) 3 (c) 14 (d) 2/1385 b What is the second biggest value in 0.3, -2/9, -2/13, 3551/5, 1/2, -2/5? 1/2 Which is the smallest value? (a) 3 (b) 6.1 (c) -84 (d) 5 (e) 0.3 (f) -1/161 c Which is the smallest value? (a) -1/20 (b) -27 (c) 1181.6 b Which is the second biggest value? (a) 2.4 (b) -0.12 (c) 2/9 (d) 0.4 (e) -0.4 (f) -114 d What is the third biggest value in -1/2, -69/10, -3/2, 51? -3/2 Which is the second smallest value? (a) -4 (b) 221 (c) -1 (d) -0.4546 (e) -1/3 c What is the seventh biggest value in -3, 23, -1/6, 1, 0.1, -1.1, -0.3? -3 Which is the biggest value? (a) -140/83 (b) -63 (c) -0.3 (d) -3 c What is the second smallest value in 4, -5936, -2, -3/7, -5/2, -1? -5/2 What is the fourth biggest value in 45/19, 9, 179, -6/11? -6/11 What is the biggest value in 1/12687, -0.1, -2, 135, 4? 135 What is the smallest value in 4/5, 7, 2.2, 20/9, 0.1, -2, 0.01? -2 Which is the smallest value? (a) 460 (b) -22490 (c) -3 b What is the second biggest value in 435, 5, -9, -3, 0.08, -0.4? 5 Which is the biggest value? (a) 7185 (b) 233.8 (c) -2 a Which is the biggest value? (a) -5 (b) -20/7 (c) 0.1 (d) 2314 (e) 1 (f) -3 d What is the fourth biggest value in -0.4, -30179, -2/9, 2/5? -30179 What is the third smallest value in -5, -428, 0, -1800? -5 Which is the smallest value? (a) -6/11 (b) 1 (c) -3/5 (d) -10 (e) 105/2 (f) -1/2 d What is the third biggest value in 93, 3, -4/9, 2, 0.4, -3, 0? 2 What is the biggest value in -2	{ "pile_set_name": "DM Mathematics" }
9 = 403g for g. -19 Solve -133p - 33p + 1971 = -3654 - 2841 for p. 51 Solve -23m - 59m + 4140 = -13m - 2760 for m. 100 Solve 1351 = -73c - 1277 for c. -36 Solve 0 = 377n - 8487 - 4653 + 4092 for n. 24 Solve -16490 = -1833o - 9199 + 67862 for o. 41 Solve 1158d - 312d = -86d - 7269 + 34297 for d. 29 Solve -71722 - 13874 = -1879t - 16073 for t. 37 Solve -1989s - 13189 = 6701 for s. -10 Solve -623k + 22013 = 355k - 27865 for k. 51 Solve -328k = 260k - 163k + 20400 for k. -48 Solve 24242 = -75x + 14x + 21375 for x. -47 Solve -150086 = 2390b - 54486 for b. -40 Solve 38686m - 4416 = 38782m for m. -46 Solve 950q + 379q - 526q - 29838 = -930 for q. 36 Solve -1048m + 572m = -528m + 676 for m. 13 Solve 65y - 493 = 75y - 211y - 694 for y. -1 Solve -164u = 2973 - 1005 for u. -12 Solve -467c = -444c + 2069c + 62760 for c. -30 Solve 614t + 2963 - 4545 = 8204 + 4336 for t. 23 Solve -1253l + 1320 - 19437 = 51612 - 7079 for l. -50 Solve -346c - 36c - 145c - 20440 = -1995 for c. -35 Solve -176w + 20w + 471 = -153 for w. 4 Solve -49524b + 49425b - 4158 = 0 for b. -42 Solve -2077l - 769 = -2125l - 49 for l. 15 Solve -1066k - 646 + 87 - 507 = 0 for k. -1 Solve 127937 + 1027240 = 1235p - 11642p for p. -111 Solve 604g + 10758 + 2530 = 0 for g. -22 Solve -161q - 54 + 174 = -201q for q. -3 Solve 66791a - 280 = 66796a for a. -56 Solve 67t + 1590 + 6484 = -60t - 4626 for t. -100 Solve -12114f + 12089f - 121 - 4 = 0 for f. -5 Solve -892g + 1795g + 56 + 208 = 901g for g. -132 Solve 0 = -13a + 1035 - 619 for a. 32 Solve 21g + 14g + 332 - 8 = -376 for g. -20 Solve 47241f = 47277f - 2016 for f. 56 Solve 308c - 132c - 1408 = 0 for c. 8 Solve 1496a - 2436 = 1148a for a. 7 Solve 53l - 9747 - 11833 = -362l for l. 52 Solve 1941 + 3270 = -736l + 2473l for l. 3 Solve -381i + 364 = -147i + 130i for i. 1 Solve -303206g = -300299g + 133091 + 122725 for g. -88 Solve -2028h + 4253h = 2536h - 22703 for h. 73 Solve -3901r - 66045 = -756r for r. -21 Solve 298g = 962g - 5930 + 35810 for g. -45 Solve -14408 = -120r + 7144 - 3552 for r. 150 Solve 0 = 10255c - 11222c + 36746 for c. 38 Solve -8297w = 429468 - 1292356 for w. 104 Solve 243 = -74q - 985 - 1510 + 148 for q. -35 Solve -1134t + 2227 = -41 for t. 2 Solve 390c - 354c = 627c - 13593 for c. 23 Solve 36t + 1731 = 219 for t. -42 Solve 475u - 67u = -45u - 631u + 145u for u. 0 Solve 55m + 2289 = 32m + 61m + 617 for m. 44 Solve -148y = -24y + 1116 for y. -9 Solve 4597 + 1151 - 223 = -67o - 1979 for o. -112 Solve 157o - 8584 = -1048 for o. 48 Solve 1447923p - 1447895p + 163 = 415 for p. 9 Solve -315 - 487 - 2396 = -174u + 2544 for u. 33 Solve -1860d = -5076d + 418080 for d. 130 Solve -115817 + 107941 = -2447c + 327363 for c. 137 Solve -2054 - 13213 = -345c + 18888 for c. 99 Solve 884a = 3888 + 875 + 3114 - 805 for a. 8 Solve 13990380z - 13990415z + 455 = 0 for z. 13 Solve 184k + 336k + 3377 = 130k - 10663 for k. -36 Solve -253o - 2933 - 6909 = 69o + 381o for o. -14 Solve -14094b = 3786b + 199845 + 482373 + 694542 for b. -77 Solve 0 = -6714i + 7052i - 20618 for i. 61 Solve -721f - 680f - 7486 = -1204f for f. -38 Solve 256q + 3815 + 3358 = 33q + 32818 for q. 115 Solve 216b - 2710 + 3593 = -5813 for b. -31 Solve 8255q - 15312 = 7936q for q. 48 Solve 6552p + 148270 - 54373 + 620271 = 0 for p. -109 Solve -55d + 333d + 13727 = -93d for d. -37 Solve 0 = 61444h - 61384h + 3300 for h. -55 Solve 0 = 1589166j - 1589572j + 15022 for j. 37 Solve -96h - 122 = 19h + 108 for h. -2 Solve -17197x + 34790x - 62436 = 17109x for x. 129 Solve 1641g = 1379g - 3406 for g. -13 Solve 7361q - 2459q = 2328q + 2312q + 10480 for q. 40 Solve -14564 + 36241 = -460d - 11903 for d. -73 Solve -5926v + 23360 - 74447 = 245213 for v. -50 Solve -326g + 1716 = -3826 for g. 17 Solve -4563599y + 4563668y = -3381 for y. -49 Solve 343g - 10541 - 29509 = -2327g for g. 15 Solve -635c = -1204c - 36416 for c. -64 Solve -115h - 32022 = -208h - 500h for h. 54 Solve 0 = 305899z - 304487z - 49420 for z. 35 Solve 162w = -117w - 83w - 4806 - 3520 for w. -23 Solve 476d = 949d - 475d - 150 for d. -75 Solve 902x - 2241 - 12387 = 764x for x. 106 Solve -64173 = -1095y + 14667 for y. 72 Solve -3388h + 670h = 4370h - 667h + 128420 for h. -20 Solve 0 = 104n - 995n - 77378 + 124601 for n. 53 Solve 34531 - 15152 = 2247b - 61200 - 25030 for b. 47 Solve -182889j = -91562j - 91476j - 1490 for j. -10 Solve -3920w + 1259 = 5069w - 4129 - 3601 for w. 1 Solve -7t + 8t = -24t + 1027 - 302 for t. 29 Solve 596665 - 596911 = -82z for z. 3 Solve -56553 = 171b - 57066 for b. 3 Solve -143r = -1967 - 9330 for r. 79 Solve -131z + 32z = 27z + 133z - 20202 for z. 78 Solve 115y + 2327 = -507 + 351 - 1887 for y. -38 Solve 0g - 165g = -18g + 370g for g. 0 Solve 745f - 9222 = 586f for f. 58 Solve 314s = -392s + 220s - 21812 - 58 for s. -45 Solve -298g = -254g - 1012 for g. 23 Solve 49u = -133u - 50u - 6728 for u. -29 Solve -137v - 2071 = -21v + 869 - 852 for v. -18 Solve 21413 - 12939 = 1799i - 33135 + 232 for i. 23 Solve 3643 = 19s + 81s - 2657 for s. 63 Solve -3088w - 1548006 = -16667w for w. 114 Solve -579f - 35334 = -155f + 482f for f. -39 Solve -2392j + 2434j = -966 for j. -23 Solve -4869 = 6635q - 11504q for q. 1 Solve 130 + 388 = -73a + 1248 for a. 10 Solve -117c = -10c + 190c - 4c - 6153 for c. 21 Solve 12 - 73 + 373 = -39s for s. -8 Solve -5937 - 4021 = -711k - 4 for k. 14 Solve -229j + 12j + 60306 = 312j for j. 114 Solve 35b - 26b - 4620 = -101b + 40b for b. 66 Solve -1103t + 81884 = -543t + 990t + 311t for t. 44 Solve 5824 = -721w - 23016 for w. -40 Solve -34j - 526 = 7j + 15j - 246 for j. -5 Solve 367x + 511x - 774x = -728 for x. -7 Solve -1502q + 1342q - 160020 = 3396q for q. -45 Solve 0 = 4916w - 8305 - 237495 for w. 50 Solve 2265r - 135486 = 54774 for r. 84 Solve 0 = 38986262p - 38985917p + 41745 for p. -121 Solve 888z + 979z - 650z + 11380 = -3224 for z. -12 Solve -34972s = -35115s + 794 + 779 for s. 11 Solve -16 = 37a + 291 + 293 + 325 for a. -25 Solve -26j = 14j - 132 + 4212 for j. -102 Solve 0 = 317891y - 316585y - 79666 for y. 61 Solve 92a = -121 + 1685 for a. 17 Solve 108g + 56977 = 1008g + 19177 for g. 42 Solve -104j = -26j - 121j - 2279 for j. -53 Solve 6252f - 1614f - 377776 = -2437f + 329f for f. 56 Solve 0 = -26a - 570a + 233a + 143a - 6160 for a. -28 Solve -81n - 115n - 11467 = -2255 for n. -47 Solve -15181z + 461277 = -3941z + 8940z - 204663 for z. 33 Solve -4940 = -432o + 857 + 10619 for o. 38 Solve 192x - 10x = -120x + 13892 for x. 46 Solve -333t + 754t + 5526 = -1421t for t. -3 Solve 324q - 2201 = -359q + 11443 + 14359 for q. 41 Solve 141f = -286795 + 286090 for f. -5 Solve -1927 = 345r - 560r - 128 + 6156 for r. 37 Solve -4473 = -197w - 1458 + 1516 for w. 23 Solve -413k + 199 = -398 - 229 for k. 2 Solve -139h + 871012 = 884356 for h. -96 Solve 587s = -33485 + 68705 for s. 60 Solve -6974n - 4103n - 139127 - 835649 = 0 for n. -88 Solve -180b - 43b - 1144 = -80b for b. -8 Solve -40y - 16182 = 121y + 55y + 45y for y. -62 Solve 3517l - 12051 - 2017 = 0 for l. 4 Solve -3o = 165 - 456 + 140 + 214 for o. -21 Solve 10655d = 10585d - 2660 for d. -38 Solve 74d + 8254 = 49d + 211d + 10300 for d. -11 Solve -112n - 13443 = -6052 - 2687 for n. -42 Solve 76s + 691 = -105s - 158 - 1504 for s. -13 Solve 1754z - 546z = 472z - 1724z - 218940 for z. -89 Solve 94j + 103j = -37j + 24j - 2940 for j. -14 Solve 0 = 31z + 1445z + 41328 for z. -28 Solve -6876h - 259511 - 154704 = 2287h + 447107 for h. -94 Solve 73l - 1564l = -46221 for l. 31 Solve -175m + 38m = 166m + 23937 for m. -79 Solve 9o + 2224 = 2206 for o. -2 Solve -1537t = -3059t + 1533t - 11 - 33 for t. 4 Solve -2296h = 2180h - 119 + 13547 for h. -3 Solve 5427m - 5509m = 4674 for m. -57 Solve 41 - 1742 = -165i + 6549 for i. 50 Solve 3353x - 3356x + 69 = 0 for x. 23 Solve -159n - 740 + 100 = 1745 for n. -15 Solve 1871m + 73866 + 51095 = 18314 for m. -57 Solve 123r - 102 - 5137 = -9298 for r. -33 Solve -4359*d	{ "pile_set_name": "DM Mathematics" }
) assuming m is positive. m(4569/20) Simplify ((l3/(l/(l*(-2/7)l))(ll(-1))(11/4))(-8))(-1/9) assuming l is positive. l(152/63) Simplify (((g/g(-8)g(1/4)g)/(g*4gg(-2/15)))8)(-11) assuming g is positive. g(-7106/15) Simplify (((vv/(v/((vv(9/2))/v))vv)(-1/4))30)(4/29) assuming v is positive. v(-225/29) Simplify ((s7sss(5/3))/(s2/s)(-17))/((s(2/9)s1/sss)/((s/s8s)/s(-1))) assuming s is positive. s(184/9) Simplify (d/(d(dd*(-1)/d)/d)(d/d(-7))/d)/(d(-1))*(-1)(d*(-5/6)((d*(-1/3)d)/d)/d)(-33) assuming d is positive. d(159/2) Simplify ((b*(-2/21)bb12)/(b/((b/b19)/bb)b/(b/(b/(b/(bb*(-2/3)b))))))(-5) assuming b is positive. b(260/7) Simplify (u/(u*14u))/(u*(-3/10)uu)uu17u(3/4) assuming u is positive. u(61/20) Simplify (((b(bb*1b)/b)/b)/b(-1))/(b(1/3)b/(bb*(-4)))(b*(-1/2)(b(b2/b)/b)/b)(-3) assuming b is positive. b(1/6) Simplify ((((i(2/21)/ii)/i)/((i/i(-3/11))/i))/(i(1/7)i5))/(((i(2/27)i)/((i(-1)/i)/i))/((i/i(7/2))/i(2/13))) assuming i is positive. i(-705311/54054) Simplify ((((uu(2/7))/u)/uu)20)(2/55)/(u*(-1/4)u*(2/5)u)(3/4) assuming u is positive. u(-4033/6160) Simplify ((z/(z*(-2/5)z)z)(-15)z*(4/9)z(1/5)/z)/((z(-1))*(-9/2)/(zz(zz/(z/(zzz*(-2)))z)/z)(3/41)) assuming z is positive. z(-94597/3690) Simplify ((((i/i*3i)/(i/(i/((i/(iii*(-1/5)ii))/ii))i))/(i1)(-31))(2/51))(-1) assuming i is positive. i(-106/85) Simplify (m/(m/(mm*(-25)))m)/(mm32)(m(-1/3))19 assuming m is positive. m*(-187/3) Simplify (((fff(-7)f)/f)/(f5/f))/(f(-2/3))*(3/7)f*(-3)f*6(ff0f)/ff/(f/f(-1/4)) assuming f is positive. f(-139/28) Simplify ((c2/c)/(cc*0))/(cc*(2/17)c*(-1/9))c*0cc(-3/4)(c/(c*(-2/5)c)cccc)(-1/2) assuming c is positive. c(-9047/3060) Simplify ((ii(-3))(-1/12))(-1/3)/((i/i(-2/9)iii/i(6/5))/(i(-8)(i/(i(-4/7)i))/i)) assuming i is positive. i(-7249/630) Simplify (((h(-4/7)hh)/h)/hh(1/2)/h)(-4)/((hhh(-6)h)/h*6(hhh*(1/4)hh)(-1/10)) assuming h is positive. h(3839/280) Simplify ((bbb/(b(1/2)b)b)(7/4))(-3/25)(b*4bb(2/3)/bb)27 assuming b is positive. b(6099/40) Simplify (v*(1/4)vvv/(v/((v*(-6)v)/vv)))20/(v/(v/v(-1/3))v*(3/4)/v(v1)(5/11)) assuming v is positive. v*(-7243/132) Simplify ((u/(u/(uu/(u*(-2/7)/u)u)))10)37(u1)(1/6)(((uu1)/u)/u)(-4/39) assuming u is positive. u(66607/42) Simplify (((d(-1)/d)/(d/(d(-6)/d)))/(((d/((d6d)/d))/d)/(d*5d)))/((d/(ddd/(d/d*(-1/4)dd)d))(2/39)/(d/(d(-2/5)d))16) assuming d is positive. d(3271/390) Simplify ((z(z*(-5)zz)/z)/zz/(zz(1/3))z(-12)/z4)(1/15) assuming z is positive. z(-61/45) Simplify ((r(r/r(-2))/rrrr/(r*1r)r/(r(-2/7)/r)r*(-1/6)r)(2/3))(-30) assuming r is positive. r(-2990/21) Simplify ((d(-1/4)/((d*6/d)/d))/((d/((d/(d/(d/(dd/d*(1/4)))))/d))/dd)41)/((d/d3d)(1/24))(2/105) assuming d is positive. d(-147419/1260) Simplify (((i1/i)/i)41i(-4)/i(-6))/(i*(-3)ii13)(-1/6) assuming i is positive. i(-223/6) Simplify y30yy(-4/27)(y*(-29/4)/y)/yy29/y assuming y is positive. y(5357/108) Simplify ((x(x(-1)/x)/x)/x)(2/23)(xx/x3)/x3(x(1/2)/x)(10/13)(xx/(xx/x(-1)x))8 assuming x is positive. x(-6173/299) Simplify ((d*(1/12)/dd)/(d*(-2)d))(-2/63)/(d/d2dd/d*(-2/7)d)(-50) assuming d is positive. d(43187/378) Simplify (nn(-2)/nnnn*4n(n1)(-2/13))/((((nnn/(nn*(4/7)n)n)/n)/n1)/(n(-1/3))43) assuming n is positive. n(-2434/273) Simplify (((a/(aa/a*(4/9))a*(6/11)aa)30)(-4/3))(-20) assuming a is positive. a(157600/99) Simplify (((d/d(1/23))/(dd26))/(d8/(d(-9)/d)))(-37) assuming d is positive. d*(37481/23) Simplify (ss*(-2/11)/ss*1)/((((sss/s(-1)s)/s)/s)/s)*(-2/25)s*(4/7)s*(2/21)((s/(ssss(-2/5)sss)s)/s)(14/11) assuming s is positive. s(-3473/825) Simplify (((i(4/3)/ii)/i)/(i/i(-5)))/(i2)*(3/4)(i2)(-11)/(i1)(-2/121) assuming i is positive. i(-21163/726) Simplify ((a(-8/5)/((a/a*(-21))/a))/(((a(a(aa/(a*(1/4)a)a)/a)/a)/a)/(((a/a20)/a)/a)))(-20) assuming a is positive. a887 Simplify ((k/((k(-29)k)/k))/(k*(1/27)k)(k/(k((k/k2)/k)/k))/(k/k18))11 assuming k is positive. k(14542/27) Simplify ((m/(m(m/m(-1)mmm)/mmmmmmm))/mm)/(mmmm/m*(-2)mm)mmm*(-3/7)m/m*(2/7)(m*(-5)/mm/(mm(-1)/m))28 assuming m is positive. m(-894/7) Simplify ((c(-11)/(c(c/(c/(((c/(((c/(cc/(c2c)))/c)/c))/c)/ccc)cc)c)/ccc)(c(-3))(10/11))(-12/7))(-18) assuming c is positive. c(-37368/77) Simplify ((n(-4/7)/((n(2/9)/n)/n))/(n(-6)nn*(-2/15)))/((n/(n(n/(n*(-1)/n))/nnn))2n*(-1)((n*(-3)n)/nn)/n) assuming n is positive. n(5777/315) Simplify (d(-1/10)d(-7))9/((d*6dd1)/(d/(d/(d(-2/9)/d))d)(-39/7)) assuming d is positive. d(-14839/210) Simplify ((ff/((f/f0)/f))30)(-34)/((ff*(2/5)f)/(f/(f9/f)))(44/3) assuming f is positive. f(-32668/15) Simplify ((((x/(x(-1)x))/x)/x)(1/13))22/(x1x/(xxx(-4/5)))(2/29) assuming x is positive. x*(-3294/1885) Simplify ((ff*(-1/54)f(-4/19))/(f/((f(-12)f)/f)ff/(f/((f/(ff/f*(-1/3)))/f)f)))(-37) assuming f is positive. f(375661/1026) Simplify ((b*(-2/31)b*(-7))/(bb*(-5)b)(2/125))25 assuming b is positive. b(-27189/155) Simplify ((l(-1))(3/2)/(l(5/4)l(-4/3)/l))/((l/l(-3)l(ll/(l*(2/7)/l))/ll)/(l*(-1)l)(-12)) assuming l is positive. l(-683/84) Simplify ((ww5)(-40)/(w(5/9)w(-23)))(-15) assuming w is positive. w(9790/3) Simplify ((t(-1))(15/2)/((t(4/7)/t)/tt5))/((t(1/2))17t*(1/2)/(t/(tttt/t*(-4)tt)t)) assuming t is positive. t(-393/14) Simplify ((n(-1/10)/n(-4/3))/(n/n0)*(-8/3))/((nnnnn(-1/22))/n(-12))(-11/4) assuming n is positive. n(1911/40) Simplify ((h(-3)h)/h*6h*(-2/19)/hh/h*(-1/4)h)/((h/h(2/3))(-11))(-3/10) assuming h is positive. h(-3023/380) Simplify (d(-1))(-3/11)(d/(dd*(-8)dd))/((d/(d(-8)dd))/d)dd0d*(8/5)(d/d(-2))37 assuming d is positive. d(6263/55) Simplify (u(-2)/uu/(u/u5))(-14/3)/((u(1/2))(-28))(-2/17) assuming u is positive. u(-560/51) Simplify (b/(bbb(1/3)))/(bb*(-2)/b)(bbb*(-1/2)b)*38b*(2/9)b(b(bb3)/bb)/bb/b3b/(b/b5) assuming b is positive. b(935/9) Simplify ((f*(-2)ff(-13)ff(-2/17)ffff/(fff/(ff(-1/3))))(-8))(-3/16) assuming f is positive. f(-292/17) Simplify ((o(3/5))36)(-1)/((((o(-2)o)/o)/(o(1/4)o))/(o/(((o/o*(2/5)oo)/o)/o)o)(8/7)) assuming o is positive. o(-67/4) Simplify (((x/(x/(((x*2xx)/x)/xx)))/x)/xx/(x/(x/x(2/7))))/(x(-2/5)x/(x/x*(4/3)x))x(2/7)x*(1/7)x*1x/((x(-5/3)/x)/x) assuming x is positive. x(827/105) Simplify ((r*(4/9)/(rr(r/(r/(r1r)))/r))/((r/r3)/r(-1/2)))/((r/r*7r*(-2/13)r)/(r(-2/5)/r(-2/5))) assuming r is positive. r(959/234) Simplify ((((i/i4)/(i/((((ii6)/i)/i)/i)i))(2/9))(-2))23 assuming i is positive. i(92/9) Simplify j(-5)/(j/(j/j3))(j(-1))(-15/11)((j/j(-4))/j(-6))(1/18) assuming j is positive. j(-1193/198) Simplify (b/b*(-6)(b/((b*(-6/5)/b)/bb))/b)(-42)/((b(-1/2))*40b/(b/b*1)b(b/(b(-5/3)b))/b) assuming b is positive. b*(-5536/15) Simplify ((qq5/q)/(q/q(-6)))*(-39)((q(-1/3))(-24))(-40) assuming q is positive. q(-242) Simplify (((b(-5))(-2/157))(-2/109))5 assuming b is positive. b*(-100/17113) Simplify (hh*(-1/4)hh(-3/10))8(h*(-1)h)*(-4/27)h/h*(2/15)hhh8 assuming h is positive. h(337/15) Simplify (((vv(1/2)v)/v)*(-23)(v/(v/v(1/4)))17)/((v(v(-1)/v)/v)/v(-2))4 assuming v is positive. v(-121/4) Simplify ((l0)(-8)l*4l((((l(lll*3ll)/ll)/ll)/l)/l)/l)/((l(-3)/l6)/(l(-1))(-28)) assuming l is positive. l47 Simplify ((u(u/(uu/u(-2)))/u)33/((uuu6)/(uu*(-13)u)))*	{ "pile_set_name": "DM Mathematics" }
ulate the remainder when 2080 is divided by 1139. 941 Calculate the remainder when 14194 is divided by 710. 704 What is the remainder when 14278 is divided by 4759? 1 Calculate the remainder when 32356 is divided by 40. 36 What is the remainder when 2632 is divided by 2583? 49 What is the remainder when 108819 is divided by 13? 9 What is the remainder when 5097 is divided by 563? 30 Calculate the remainder when 335 is divided by 152. 31 What is the remainder when 23690 is divided by 147? 23 What is the remainder when 1120 is divided by 969? 151 What is the remainder when 15688 is divided by 73? 66 What is the remainder when 15015 is divided by 154? 77 Calculate the remainder when 148222 is divided by 610. 602 What is the remainder when 2608 is divided by 1251? 106 What is the remainder when 5944 is divided by 2947? 50 Calculate the remainder when 14844 is divided by 297. 291 Calculate the remainder when 41797 is divided by 6. 1 What is the remainder when 164918 is divided by 19? 17 Calculate the remainder when 2254971 is divided by 499. 489 Calculate the remainder when 985 is divided by 920. 65 What is the remainder when 510087 is divided by 735? 732 What is the remainder when 72271 is divided by 40? 31 Calculate the remainder when 438356 is divided by 181. 155 Calculate the remainder when 29483 is divided by 7289. 327 What is the remainder when 2372966 is divided by 57? 56 What is the remainder when 1423 is divided by 34? 29 What is the remainder when 2985 is divided by 1715? 1270 Calculate the remainder when 26933 is divided by 657. 653 What is the remainder when 198194 is divided by 429? 425 Calculate the remainder when 3367 is divided by 162. 127 Calculate the remainder when 13207 is divided by 42. 19 What is the remainder when 1784117 is divided by 73? 70 Calculate the remainder when 6454 is divided by 6418. 36 Calculate the remainder when 85260 is divided by 41. 21 Calculate the remainder when 3236 is divided by 2982. 254 Calculate the remainder when 117006 is divided by 32. 14 Calculate the remainder when 2112845 is divided by 43. 40 Calculate the remainder when 52765 is divided by 143. 141 What is the remainder when 714080 is divided by 81? 65 Calculate the remainder when 5599 is divided by 105. 34 Calculate the remainder when 478 is divided by 476. 2 What is the remainder when 145228 is divided by 33? 28 What is the remainder when 7708 is divided by 1101? 1 Calculate the remainder when 3920 is divided by 1711. 498 Calculate the remainder when 328033 is divided by 278. 271 What is the remainder when 2495 is divided by 496? 15 Calculate the remainder when 1536 is divided by 110. 106 Calculate the remainder when 23253 is divided by 11. 10 What is the remainder when 5598 is divided by 2716? 166 Calculate the remainder when 941 is divided by 295. 56 What is the remainder when 852445 is divided by 236? 13 What is the remainder when 168727 is divided by 286? 273 What is the remainder when 2422 is divided by 542? 254 What is the remainder when 1054554 is divided by 16? 10 Calculate the remainder when 529339 is divided by 995. 994 What is the remainder when 41828 is divided by 18? 14 Calculate the remainder when 124302 is divided by 41426. 24 What is the remainder when 17009 is divided by 255? 179 What is the remainder when 1352 is divided by 270? 2 Calculate the remainder when 4442 is divided by 25. 17 Calculate the remainder when 12983 is divided by 2595. 8 What is the remainder when 6315 is divided by 2089? 48 What is the remainder when 13498 is divided by 6735? 28 Calculate the remainder when 7839 is divided by 109. 100 What is the remainder when 9456 is divided by 1171? 88 Calculate the remainder when 1675 is divided by 415. 15 Calculate the remainder when 12278 is divided by 189. 182 Calculate the remainder when 20733 is divided by 6897. 42 What is the remainder when 51222 is divided by 51191? 31 Calculate the remainder when 320 is divided by 28. 12 What is the remainder when 363863 is divided by 12? 11 What is the remainder when 15132 is divided by 170? 2 Calculate the remainder when 4876585 is divided by 649. 648 Calculate the remainder when 58478 is divided by 14586. 134 Calculate the remainder when 1812 is divided by 592. 36 Calculate the remainder when 12985 is divided by 34. 31 What is the remainder when 1155 is divided by 462? 231 Calculate the remainder when 67130 is divided by 67099. 31 What is the remainder when 343 is divided by 87? 82 Calculate the remainder when 1310 is divided by 68. 18 Calculate the remainder when 281 is divided by 57. 53 Calculate the remainder when 340 is divided by 240. 100 What is the remainder when 306 is divided by 95? 21 What is the remainder when 892 is divided by 179? 176 Calculate the remainder when 154378 is divided by 1308. 34 What is the remainder when 346685 is divided by 16? 13 Calculate the remainder when 311023 is divided by 825. 823 What is the remainder when 5946514 is divided by 223? 219 Calculate the remainder when 227070 is divided by 75674. 48 What is the remainder when 1902 is divided by 907? 88 What is the remainder when 609 is divided by 551? 58 Calculate the remainder when 3832 is divided by 83. 14 Calculate the remainder when 81011 is divided by 40505. 1 Calculate the remainder when 5103 is divided by 142. 133 Calculate the remainder when 6656 is divided by 616. 496 Calculate the remainder when 4261 is divided by 51. 28 What is the remainder when 87890 is divided by 6758? 36 What is the remainder when 2677 is divided by 245? 227 Calculate the remainder when 2514 is divided by 412. 42 What is the remainder when 15039 is divided by 307? 303 What is the remainder when 15836 is divided by 7900? 36 What is the remainder when 116412 is divided by 38748? 168 Calculate the remainder when 3681 is divided by 320. 161 Calculate the remainder when 156502 is divided by 24. 22 Calculate the remainder when 3372 is divided by 141. 129 Calculate the remainder when 1123 is divided by 374. 1 Calculate the remainder when 19197 is divided by 2732. 73 Calculate the remainder when 7146 is divided by 2150. 696 What is the remainder when 481 is divided by 23? 21 Calculate the remainder when 1841 is divided by 74. 65 Calculate the remainder when 4869 is divided by 541. 0 Calculate the remainder when 9798 is divided by 363. 360 Calculate the remainder when 5107 is divided by 146. 143 What is the remainder when 11382 is divided by 2765? 322 What is the remainder when 1517 is divided by 405? 302 What is the remainder when 2024 is divided by 487? 76 Calculate the remainder when 1724 is divided by 416. 60 Calculate the remainder when 38595 is divided by 270. 255 What is the remainder when 2898 is divided by 53? 36 What is the remainder when 124061 is divided by 97? 95 Calculate the remainder when 17272 is divided by 959. 10 What is the remainder when 9286 is divided by 4640? 6 Calculate the remainder when 4056 is divided by 54. 6 Calculate the remainder when 241495 is divided by 46. 41 Calculate the remainder when 63041 is divided by 15. 11 Calculate the remainder when 35740 is divided by 111. 109 Calculate the remainder when 59472 is divided by 15. 12 What is the remainder when 3580 is divided by 594? 16 Calculate the remainder when 231573 is divided by 367. 363 Calculate the remainder when 2043703 is divided by 86. 85 What is the remainder when 11114 is divided by 5543? 28 What is the remainder when 402845 is divided by 153? 149 What is the remainder when 765 is divided by 44? 17 Calculate the remainder when 216 is divided by 205. 11 What is the remainder when 615 is divided by 106? 85 What is the remainder when 624 is divided by 237? 150 Calculate the remainder when 2281 is divided by 35. 6 Calculate the remainder when 151349 is divided by 50440. 29 What is the remainder when 776 is divided by 325? 126 Calculate the remainder when 1444 is divided by 471. 31 What is the remainder when 9439 is divided by 1173? 55 What is the remainder when 136706 is divided by 93? 89 Calculate the remainder when 35188 is divided by 1533. 1462 Calculate the remainder when 24434 is divided by 1062. 8 What is the remainder when 9179 is divided by 54? 53 What is the remainder when 145043 is divided by 948? 947 What is the r	{ "pile_set_name": "DM Mathematics" }
i - 3a + 26 = -2a. Let z(q) = -3 - iq - 5 + 0q. Let h be z(-4). Calculate the highest common divisor of h and 8. 4 Let u(b) = -b3 + 12b*2 - 3b + 1. Let j be u(12). Let o = j + 58. Let m = 11 + o. Calculate the highest common divisor of 85 and m. 17 Let n(o) = 2o2 - 4o. Let f be n(-4). Let r(l) = -l*2 + 13l + 14. Let c be r(13). Let y = c - 2. What is the highest common factor of f and y? 12 Suppose 0 = b + 3b. Suppose b = -3s - r + 81, 4s - 76 = -r + 33. Calculate the highest common divisor of s and 70. 14 Suppose 0a = -5a + 1600. Let m(q) = 24q - 304. Let n be m(14). Calculate the greatest common factor of a and n. 32 Suppose 16i - 13i - 9 = 0. What is the highest common factor of i and 813? 3 Let a = -899 - -921. What is the greatest common divisor of a and 682? 22 Suppose -4a = -130 - 34. Suppose 0 = -3m + a + 40. Calculate the greatest common divisor of m and 54. 27 Let p = 1881 - 747. What is the greatest common factor of 27 and p? 27 Suppose -b = 16 - 1. Let c be (1 + -5)/(1/b). Calculate the highest common factor of 20 and c. 20 Let u = -6 + 45. Suppose 8n - 10 = 3n. Suppose 7k - 130 = nk. Calculate the highest common factor of k and u. 13 Let m = -15 + 17. Suppose -168 = -c - mc. Calculate the greatest common factor of 7 and c. 7 Let n be (-252)/(-20) + (-6)/10. What is the highest common factor of n and 852? 12 Let q(p) be the second derivative of -3p*5/20 - 13p*4/12 + 3p*3/2 + 7p*2/2 - p - 26. Let h be q(-7). What is the greatest common divisor of h and 42? 42 Suppose 2f = -0f + 20. Let y be 4/(-24) + 62/12. What is the greatest common divisor of f and y? 5 Let j(x) = x2 + 5x - 3. Let s be j(-6). Let w be 532/s - (-12)/(-9). Suppose -3d = -w - 184. What is the highest common divisor of 24 and d? 24 Suppose 7254c + 10 = 7255c. Let q be (55/3)/16. What is the highest common divisor of c and q? 10 Suppose -40o + 1159 = -601. Calculate the highest common factor of o and 16. 4 Suppose -4y = -19 - 101. Let n = y + 15. What is the highest common factor of n and 9? 9 Suppose -4r + 2r + 16 = -h, -3r + 5h + 17 = 0. Let p(d) = d*2 - 7d - 13. Let u be p(r). What is the highest common divisor of 25 and u? 5 Suppose 12z - 687 = 33. Let k(x) = 4x - 8. Let u be k(7). Calculate the highest common factor of z and u. 20 Let n = -265 - -397. Let f be (-11 + 1 - 0)/(-2). Suppose -51 - 9 = -fr. Calculate the greatest common factor of n and r. 12 Suppose 0 = 260m - 256m - 6984. What is the greatest common factor of m and 18? 18 Let g(c) = 5c*2 + 58c + 237. Let i be g(-5). What is the highest common divisor of i and 40? 8 Let y = -1178 - -1331. What is the greatest common divisor of y and 34? 17 Let l = 23 + -20. Let w be (1 + 21)l/6. Calculate the greatest common divisor of w and 11. 11 Suppose 166 - 6 = 2m. Let f = 63 + -53. Calculate the greatest common divisor of m and f. 10 Suppose 0 = f - u - 542, -47f + 42f = 5u - 2730. Calculate the greatest common factor of 51 and f. 17 Let l(q) = q2 - 2q + 4. Let m be l(-3). Suppose -35d + 33d - 2 = 0. Let t be (-320)/(d + -3) + -4. Calculate the greatest common divisor of m and t. 19 Let b(n) = 55n3 + 0n*2 + 0n*2 - 54n*3 + 8n2 + 11. Let r be b(-8). Calculate the greatest common divisor of 11 and r. 11 Let x(y) = -y2 + 39y - 21. Let r be x(25). Calculate the greatest common divisor of r and 47. 47 Let l = 121 + 119. What is the highest common divisor of l and 15? 15 Let p = -54 + 82. Let j = 8 + -6. Let a be 10(j - 8/5). What is the greatest common factor of a and p? 4 Let d = 37 + -7. Let j be (-5)/((-2)/5 - 1/10). What is the greatest common factor of d and j? 10 Suppose 5q + 3u = 928, -q + u = -4u - 180. Calculate the highest common divisor of 37 and q. 37 Suppose 3q - 15 = 6q. Let x = q - -12. Suppose -5u = v + x, -7v + 2v + 2u = -100. What is the highest common divisor of v and 162? 18 Let o(h) = -h3 - 10h*2 - 9h + 9. Let b be o(-9). Let a = 148 - 49. Calculate the highest common factor of b and a. 9 Suppose 0 = -2t + 2a + 18, 6t - 7t + 21 = -5a. Calculate the greatest common factor of 444 and t. 6 Suppose 0 = -2s - 303 + 327. What is the greatest common divisor of 54 and s? 6 Let x = -789 + 809. Calculate the greatest common divisor of 200 and x. 20 Suppose 106q = 108q - 146. Calculate the highest common factor of q and 876. 73 Let k be -2(4 - (-39)/(-6)). Let u(v) = -v3 + 5v*2 + 7v - 3. Let c be u(k). What is the highest common factor of c and 352? 32 Suppose -7b + 7 = -2u - 2b, u - 3b + 5 = 0. Calculate the greatest common divisor of u and 52. 4 Let h = -250 - -340. What is the greatest common factor of 20 and h? 10 Let j(x) = 4x3 + x2 + 2x - 3. Let k be j(3). Suppose 3t + 2t = k. Calculate the greatest common factor of 72 and t. 24 Let l(v) = v + 19. Let y be l(-14). Let d = 19 + y. Calculate the highest common divisor of 12 and d. 12 Let r(b) = -b*3 - 12b*2 - 22b - 14. Let n be r(-9). Let c = n - -81. Calculate the highest common divisor of 242 and c. 22 Suppose 0 = -7i + 6i + 24. Let s be 13 + (-4 - -16)/4. Calculate the highest common divisor of i and s. 8 Suppose 7u - 11u = -56. Suppose -17d - u = -19d. What is the greatest common factor of 1 and d? 1 Let i be (0 + 36/(-10))/((-14)/(-35)). Let j = 33 + i. Calculate the highest common factor of 60 and j. 12 Suppose 0 = 4r + 5n - 236, -2n = -4r + 183 + 25. What is the highest common factor of r and 72? 18 Suppose -5m + 215 = 2y, -5y + 220 = 5m - 4y. Let b be m/51 + -1 + 1330/34. What is the highest common divisor of b and 429? 39 Let n(c) = c3 + 7c*2 - c - 2. Let w be n(-5). Suppose 4v - 95 = w. Let y be v/1 - (-4 - -2). Calculate the highest common factor of y and 26. 13 Let u be (12 - 4)/1(-91)/(-14). Calculate the greatest common divisor of u and 234. 26 Let v(z) be the first derivative of -z2/2 + 7z + 1. Let i be v(3). Suppose 2s - 1 = -2g + 1, -is = 5g. What is the greatest common factor of s and 5? 5 Let k(r) = -21r + 126. Let a be k(5). Calculate the highest common divisor of a and 168. 21 Suppose -5u + 8 = -u. Let x be 765/10u1. Let d = 165 + -148. Calculate the greatest common factor of x and d. 17 Suppose -4z = -5t + t - 68, 4t = 3z - 52. Suppose -2q = 4h - 194, -147 = -3h - q - 2q. What is the greatest common divisor of z and h? 16 Let x = -4 + 14. Let w = 7 + 33. What is the highest common divisor of x and w? 10 Let s = 164 + -64. Suppose -161 = -3j + 3b - 50, 5j + 4b - 212 = 0. Calculate the highest common factor of s and j. 20 Suppose -5v - p = -636 - 102, 0 = 3v + 3p - 438. What is the greatest common divisor of v and 1406? 74 Suppose 10 = 5f + z, -3z - 4 - 23 = -4f. Let p be 1460/15 + (-2)/f-1. What is the greatest common factor of 147 and p? 49 Suppose 4a - 248 = -5h - 83, -10 = -2h. Calculate the greatest common divisor of a and 5. 5 Suppose -3n + 3l - 9 = -n, 0 = 3n + 4l - 12. Suppose 0 = -b + d, nb - 4d + 21 = 3b. Calculate the highest common factor of b and 9. 3 Suppose 2p + 3h = -36 + 5, -4h = 4p + 68. Let v(f) = f3 + 21f*2 + 21f + 29. Let b be v(p). Calculate the greatest common divisor of b and 99. 9 Suppose -153m + 160m - 770 = 0. Calculate the greatest common divisor of 200 and m. 10 Suppose 7k = -2f + 2k + 30, -2 = -f + 4k. Let h = 28 + 12. Calculate the greatest common factor of h and f. 10 Let z be (55/(-10) + 3)/((-2)/(-4)). Let s = 5 - z. What is the highest common factor of 10 and s? 10 Let h be 4/(-18) + (-3178)/(-126). What is the highest common divisor of 1925 and h? 25 Let j(c) = -17c3 - c2. Let s be j(-1). Suppose 63x - 240 = 60x. What is the highest common factor of s and x? 16 Suppose -4w + 5l = -0l - 504, 3w = 2l + 371. Suppose x - 124 - w = 0. Calculate the highest common divisor of 35 and x. 35 Suppose -80 = -4u + 2r, -24r = 2u - 23r - 32. What is the greatest common factor of 6 and u? 6 Suppose 0 = 17o - 3052 + 196. Calculate the highest common factor of o and 7. 7 Let k(o) = 7o - 82. Let y be k(25). Let x = -73 + y. What is the highest common factor of x and 140? 20 Suppose 0 = 2f - 3u + 9, -4f = -5u + 10 + 13. Let q be (-212)/62/(16/f). What is the greatest common factor of	{ "pile_set_name": "DM Mathematics" }
6a2 + 50a. Let r(l) = 11u(l) + 2v(l). Factor r(x). -5x(x - 2)(x - 1)3 Suppose -5i + 4w + 61 = 0, -2w - 53 = -i - 4i. Factor 5j*4 + ij*3 - 6j*5 - 7j*3 + 3j5. -j3(j - 2)(3j + 1) Let w = 95 - 91. Let x(y) be the first derivative of y + 0y*2 + 4 - 1/4y*3 - 1/16y*w. Suppose x(t) = 0. What is t? -2, 1 Determine t, given that -213 - 3t*3 + 106 - 7t + 105 - 8t2 = 0. -1, -2/3 Let v(s) be the first derivative of -s7/1400 - s6/200 - 3s5/200 - s4/40 - s*3/3 - 4. Let u(z) be the third derivative of v(z). What is h in u(h) = 0? -1 Determine g, given that 0g*2 + 1/5g + 0 + 4/5g5 + 0g4 - g3 = 0. -1, -1/2, 0, 1/2, 1 Let d(c) = -5c2 - 4. Let g(q) = q + 2 - 7q*2 - 5 - 2q*2 - 4. Let b(u) = 5d(u) - 3g(u). Factor b(w). (w - 1)(2w - 1) Let g(l) be the second derivative of 0l*2 + 0 + 0l*3 - 1/12l*4 + 6l - 1/60l6 + 3/40l5. Factor g(n). -n2(n - 2)(n - 1)/2 Let -2m2 - 2/3m - 2/3m4 - 2m*3 + 0 = 0. Calculate m. -1, 0 Let q(h) = 4h - h2 - h3 - 2h2 + 6h2. Let g(m) = m2 - m - 4m2 + 2m*2. Let p(n) = -3g(n) - q(n). Find b such that p(b) = 0. -1, 0, 1 Let j(o) be the second derivative of o7/840 - o5/40 + 3o4/4 - o. Let g(a) be the third derivative of j(a). Factor g(y). 3(y - 1)(y + 1) Let p = 25 + -21. Factor -4j*4 + pj*2 + 3j*4 - 3j2. -j2(j - 1)(j + 1) Let n(c) be the second derivative of -2c7/27 - 41c*6/270 + 11c4/108 - c3/27 + 5c. Determine j, given that n(j) = 0. -1, 0, 1/4, 2/7 Let a(b) = 3b*2 - 6b + 6. Let x(n) = -n - 11. Let p be x(0). Let w(i) = -16i2 + 31i - 31. Let l(r) = pa(r) - 2w(r). What is z in l(z) = 0? 2 Let r = -2/105 + 32/105. Find x, given that -rx + 2/7x2 + 0 = 0. 0, 1 Let j(d) be the second derivative of d9/4536 - d8/840 + d7/630 - d*3/2 - 3d. Let h(k) be the second derivative of j(k). Factor h(b). 2b3(b - 2)(b - 1)/3 Solve 6v*3 + 0v*2 - 27/2v*4 - 15/4v*5 + 0v + 0 = 0 for v. -4, 0, 2/5 Suppose 2h + 10 - 22 = -l, -3h = -l - 8. Factor -z*h - 2z + 2z + 2z*3 - 2z + 1. -(z - 1)*3(z + 1) Let b(l) be the third derivative of -l4/12 + l3/6 + 3l2. Let j be b(-1). What is k in -k3 - k4 - 1 - k5 + k + 2k*2 + jk*3 - 2k = 0? -1, 1 What is x in 20x - 4x*2 - 32x + 0x2 - 144 - 36x = 0? -6 Let v(u) be the second derivative of u6/60 - u5/30 - u4/6 + u2/2 + u. Let d(m) be the first derivative of v(m). Factor d(p). 2p(p - 2)(p + 1) Let s(q) = q2 + 7q + 1. Let v be s(-6). Let a = -1 - v. What is j in -8j5 - 12j*3 + 13j*2 - 12j*4 - 15j*2 - 6j*a = 0? -1, -1/4, 0 Let o(i) = 56i - 1. Let y be o(1). Let z = -13 + y. Factor 0 + zp2 + 4p + 343/2p4 + 147p*3. p(7p + 2)3/2 Let x be (4/(-15))/(21/(-280)) + -3. Let v(z) be the first derivative of -xz*3 + 0z + 1/3z2 - 1 + 1/4z*4. Factor v(y). y(y - 1)(3y - 2)/3 Factor 0 - 2/17f - 6/17f*2 - 2/17f*4 - 6/17f*3. -2f(f + 1)3/17 Let p(d) = -d5 - d3 - d. Let v(h) = 5h*5 + 3h*4 - 13h*3 + 9h*2 + 2h. Let b(k) = 2p(k) + v(k). Solve b(z) = 0. -3, 0, 1 Suppose -5k - 15 = -10k. Let r(d) be the first derivative of 0d*k + 1/2d*4 + 0d - 2 - d*2. Determine h so that r(h) = 0. -1, 0, 1 Let h(i) be the third derivative of 1/18i*3 - 1/360i*6 + 5i*2 - 1/180i*5 + 0i + 0 + 1/72i4. Factor h(b). -(b - 1)(b + 1)*2/3 Let w be (-2)/((-3)/(-15)-2). Suppose -27 = -wq + 28. What is k in 6k*4 + 3k*3 + qk*3 - 12k + 4k + 0k*4 = 0? -2, -1, 0, 2/3 Let t be (-2)/21 - (-26)/39. Factor 0 - 16/7f - 8/7f2 + tf*3 + 2/7f*4. 2f(f - 2)(f + 2)*2/7 Suppose -2k + 3 - 1 = 0. Suppose 3r + k = 7. Suppose ur - u + 3u + u + 2 = 0. What is u? -2, -1 Let q(i) = -7i3 + 24i*2 - 96i + 128. Let f(w) = 6w3 - 24w*2 + 96w - 128. Let v(o) = -5f(o) - 4q(o). Suppose v(s) = 0. What is s? 4 Let d = -2 + 4. Suppose 2b - dc = -6, -5b - c + 24 = 9. Factor -10i + 0i + i - 2 + 7i*4 + 9i*3 - 5i*b. (i - 1)(i + 1)*2(7i + 2) Let z = -1/248 - 429/1240. Let m = z + 3/5. Factor 1/4h*2 + m - 1/2h. (h - 1)2/4 Let d(b) be the second derivative of b6/5 + b*5/10 + 4b. Factor d(a). 2a3(3a + 1) Let g(d) be the third derivative of -d6/660 - d5/330 + 26d*2. Factor g(y). -2y*2(y + 1)/11 Determine h, given that -2h2 + 0 - 1/5h*3 + 11/5h = 0. -11, 0, 1 Suppose 2z - 4 = -j - 0, 0 = z - 1. Determine c, given that 3c*2 - 2c*3 - 2c*3 - 4c*2 - 3cj = 0. -1, 0 Find r such that r4 + 2/3r2 + 0r - 7/3r3 + 0 = 0. 0, 1/3, 2 Factor 5f + 1/2f2 + 25/2. (f + 5)2/2 Let s(d) be the second derivative of 3d + 1/30d6 + 0d*3 + 0d*5 + 0 + 0d*4 + 0d2. Factor s(p). p4 Let o(d) be the first derivative of 2d3/21 + 8d*2/7 + 32d/7 + 6. Solve o(h) = 0 for h. -4 Let v(u) = -10u3 + 3u*2 - 7u + 7. Let m(s) = -3s3 + s2 - 2s + 2. Let a(n) = 14m(n) - 4v(n). Factor a(i). -2i2(i - 1) Let t(q) = 2q5 - 10q*4 - 6q*3 - 2q*2 + 4q + 12. Let a(g) = g5 - g3 + g*2 - 1. Let f(w) = -12a(w) - t(w). Suppose f(b) = 0. What is b? -1, -2/7, 0, 1 Let s(c) be the second derivative of -c4/54 - c3/27 - 12c. Let s(x) = 0. Calculate x. -1, 0 Factor -6/5o*2 + 2/5o + 2/5o4 + 4/5 - 2/5o*3. 2(o - 2)(o - 1)(o + 1)2/5 Let a(y) = -y3 + y. Suppose 0 + 12 = 2j + 2g, -3g = 3. Let f(t) = -4t3 - t2 + 3t. Let c(v) = ja(v) - 2f(v). Determine r so that c(r) = 0. -1, 0 Let g(f) be the third derivative of f9/60480 + f8/20160 + f5/60 + 2f*2. Let l(y) be the third derivative of g(y). Solve l(p) = 0. -1, 0 Let g be (2 - -1)2/2. Factor 24k - 3k*4 - 26k*2 - 10 + 3k*4 + 2 - 2k*4 + 12k*g. -2(k - 2)*2(k - 1)*2 Let r(n) = -7n*2 + 2n + 4. Let i(f) = 3f2 - f - 2. Let q(a) = 10i(a) + 4r(a). Find j such that q(j) = 0. -1, 2 Let q(x) be the second derivative of 0x*3 - 3x + 1/12x4 + 0 + 0x*2 - 7/40x*5. What is i in q(i) = 0? 0, 2/7 Suppose 0 = c + r - 4r - 4, 3c - 3r - 12 = 0. Suppose -2a + 4 = u - 4u, 5a = cu + 10. Factor -1/4i - 1/4i*2 + u. -i(i + 1)/4 Let k(t) be the second derivative of 7t6/30 - t5/4 - t4/6 + 5t. Factor k(p). p*2(p - 1)(7p + 2) Let s(t) be the second derivative of t*4/3 + 8t*3/3 + 6t*2 - 25t. Solve s(v) = 0 for v. -3, -1 Factor 0q2 + 0q*4 + 4/9q*3 + 0 - 2/9q - 2/9q5. -2q(q - 1)2(q + 1)*2/9 Let f(q) = 2q + 3. Let h be f(0). Factor 0t + th + 0 + 1/3t*2 + 1/3t5 + t4. t*2(t + 1)*3/3 Let a = 3107170/9 + -344874. Let x = 368 - a. Factor -8/9c - x - 2/9c2. -2(c + 2)2/9 Let u(v) be the second derivative of v6/75 - 7v5/25 + 49v*4/30 + v. Solve u(w) = 0 for w. 0, 7 Let s(l) be the first derivative of -1/6l*4 + 2l*2 + 1/3l*3 + l - 3. Let p(d) be the first derivative of s(d). Solve p(o) = 0 for o. -1, 2 Let j = 3 - 2. Suppose -2r - j = -5. What is c in -1/3cr - 4/3 - 4/3c = 0? -2 Let l = -5 + 1. Let r be (-14)/(-20)l/(-7). Suppose -4/5i - ri2 - 2/5 = 0. Calculate i. -1 Let y be 4/(-18) + (-25)/9. Let i(z) = 3z*2 - 6z + 3. Let q(l) = 2l2 - 5l + 2. Let h(m) = yi(m) + 4q(m). Factor h(b). -(b + 1)2 Let s(r) = -r5 - r4 + r3 + r. Let l(p) = 20p5 + 22p*4 - 14p*3 + 4p*2 - 28p - 4. Let t(h) = -2l(h) - 44s(h). Factor t(a). 4(a - 2)(a - 1)(a + 1)3 Let h(j) be the second derivative of -2j*7/7 + 19j6/30 + j5/5 - 3j4/2 + 4j3/3 - j2/2 + j. Suppose h(f) = 0. Calculate f. -1, 1/4, 1/3, 1 Let q = 4 + -1. Let 4h3 + 0h*q + 0h*3 - 2h*3 + 2h*2 = 0. What is h? -1, 0 Suppose 12 + 1768j - 2j2 - 1786j + 8 = 0. Calculate j. -10, 1 Factor 0 + 8g3 - 285/8g*4 + 225/8g*5 - 1/2g*2 + 0g. g*2(g - 1)(15g - 2)*2/8 Suppose 2b + 1 - 7 = 0. Let f(p) be the second derivative of 0pb + 0 + 1/6p*4 + 0p*2 + p + 1/10p*5. Factor f(q). 2q*2(q + 1) Let n(g) be the second derivative of -5g4/12 - 20g*3/3 - 40g*2 - 15g. Find d, given that n(d) = 0. -4 Let p(q) be the third derivative of q*6/60 + 2q5/15 + q4/3 - q*2. Determine f, given that p(f) = 0. -2, 0 Let h(i) be the first derivative of 0i*2 + 1/42i*7 + 0i*6 - 1/20i*5 - 1 + i + 0i*4 + 0i**3. Let j(z) be the first derivative of h(z). Solve j(f)	{ "pile_set_name": "DM Mathematics" }
et x(v) = 38v + 7. Let b(r) = -75r - 13. Give -6b(g) - 11x(g). 32g + 1 Let k = -42 + 46. Let l(y) = -4y*3 - 7y*2 - 5. Let s(o) = -6060o*2 - 6055o*2 + 3o*3 + 12121o*2 + 4. Calculate kl(z) + 5s(z). -z3 + 2z*2 Let p(s) = -s + 9. Let t(y) = 12y - 5. What is 2p(c) + 2t(c)? 22c + 8 Let d(v) = -v2 - 3v + 3. Let z(n) = 4n2 + 13n - 13. Let m(h) = 16h + 20. Let x be m(4). Suppose 0s = 14s - x. Determine sz(g) + 26d(g). -2g*2 Let k(q) = -10861q + 125. Let w(y) = 3619y - 44. Give 6k(g) + 17w(g). -3643g + 2 Let p(d) = 434d - 9. Let o(z) = -1297z + 29. What is 4o(i) + 13p(i)? 454i - 1 Let p(b) = 5b - 4. Suppose 3m + 6 = -0. Let t(d) = -d + 1. Let s(f) = 5f*2 + 25f - 11. Let z be s(-5). What is mp(k) + zt(k)? k - 3 Let s(c) = -17c + 575. Let o(x) = 21x - 577. Calculate -4o(h) - 5s(h). h - 567 Let n(o) = 54o2 - o - 1. Let t(v) = -v. What is 2n(d) - 2t(d)? 108d*2 - 2 Let x = 172 - 36. Suppose 13i + x = -4i. Let c(s) = -s + 1. Let j(d) = -4d*3 + 8d - 8. Give ic(t) - j(t). 4t*3 Let j be (-48)/(-9)(-36)/(-6). Suppose -3k + 32 = -c + k, c + k = -j. Let f(q) = -4q*3 - 3. Let p(r) = -44r*3 - 32. Give cf(x) + 3p(x). -4x3 Let t(r) be the third derivative of r4/24 + r3/6 + r2 - 425. Let f(d) = -d*2 - 5d - 11. What is -f(c) - 4t(c)? c2 + c + 7 Let f(c) = -18c + 7 - 7c - 4c + 33c + 13c*2. Let q(n) = 6n*2 + 2n + 3. Determine -4f(b) + 9q(b). 2b2 + 2b - 1 Suppose -35394q + 35375q = -323. Let j(s) = 2 - 3 + 2 - 14s. Let a(g) = -5g. What is qa(b) - 6j(b)? -b - 6 Let m(i) = -49i + 80. Let u(a) = 73a - 113. Determine 7m(n) + 5u(n). 22n - 5 Let z(t) = -7 - 3835t*2 - 6t - 1 + 3830t2. Let h(l) = -4l*2 - 5l - 8. What is 6h(c) - 5z(c)? c*2 - 8 Let v(a) = 5a*2 + 5. Let d(r) = -14r2 - r - 14. Let m(n) = n2 - 175n - 1089. Let x be m(-6). Give xd(y) - 8v(y). 2y*2 + 3y + 2 Let a(c) = 34c3 - 88c*2 - 61c + 8. Let b(m) = 25m3 - 66m*2 - 46m + 6. What is 11a(f) - 15b(f)? -f*3 + 22f*2 + 19f - 2 Let v(u) = u*2 - 493u + 5. Let k(c) = -c*2 + 982c - 9. Give 3k(p) + 5v(p). 2p2 + 481p - 2 Let n(k) = 5k + 3. Let d be (-70)/(-8) - 2/(-8). Suppose 2a - d - 5 = s, -a - 5s - 15 = 0. Let v be (18/a)/3 - 1/5. Let j(q) = -q - 1. Give vn(t) + 3j(t). 2t Let v(o) = -5o - 4. Let z(n) = -9n - 8. Let q(y) = -5v(y) + 2z(y). Suppose 0 = -363w - 121w + 1936. Let g(a) = -3a - 2. Give wq(x) + 10g(x). -2x - 4 Let s(f) = -13f2. Let d(o) = -3o*2. Suppose -t + 10 = -6. Suppose 2k + a + t = 0, 0 = 5a - 15 + 5. Calculate kd(n) + 2s(n). n2 Let t = -24 - -35. Suppose 13b + 22 = tb. Let n(f) = f3 + 6f*2 - 5f + 6. Let p(k) = 2k3 + 11k*2 - 10k + 11. What is bn(o) + 6p(o)? o*3 - 5o Let c(v) = 52v2 + 9v - 126. Let d(t) = 45t2 + 8t - 126. What is -6c(j) + 7d(j)? 3j2 + 2j - 126 Let x(f) = -f - 18. Let c(r) = r - 4. Determine 2c(u) + x(u). u - 26 Let l be ((-4)/12)/((-2)/(-6)). Let g(a) = 6a3. Let c(f) = f3. Let q = -6643 + 6651. Calculate lg(d) + qc(d). 2d3 Let t(j) = -4j*3 + 11j*2 - 2117j - 5. Let a(h) = 2h3 - 7h*2 + 1058h + 3. What is 5a(i) + 3t(i)? -2i3 - 2i*2 - 1061i Let x(h) = 3h + 4 - h + 3h. Let j(o) = -10o - 10. Let v(c) = -3c - 3. Let w(q) = 2j(q) - 7v(q). Let a = 175073 + -175072. What is ax(i) - 6w(i)? -i - 2 Let h(q) = -6q2 + 2q + 2. Let p = -12 + 14. Let r(s) = 16s - 3s*2 - 14s - ps2 + 2. Let o(m) = -m + 24. Let i be o(19). What is ir(f) - 4h(f)? -f2 + 2f + 2 Let y(b) = 5173b - 68. Let x(d) = -3d + 10. Calculate -7x(t) - y(t). -5152t - 2 Let y(c) be the third derivative of -2c5/15 + c3/6 + 160c*2 + 291c. Suppose -5a - 2 = -3a. Let n(s) = s*2 - s - 1. Determine an(b) - y(b). 7b2 + b Let d(c) = -1. Suppose 3t - o = 109, -2t - 2o = -39 - 31. Suppose 34h = -th + 70. Suppose -3z - 36 = -6z. Let g(r) = 2r + 14. Determine hg(v) + zd(v). 2v + 2 Let t(r) = -13r2 + 46r + 659. Let a(k) = 10k2 - 35k - 494. Determine -9a(o) - 7t(o). o*2 - 7o - 167 Let s(u) = -4u - 2. Let n = -4011 - -4016. Let j(r) = 7r + 4. Calculate ns(z) + 3j(z). z + 2 Let p(q) = -4q2 - q + 4. Let j = 6792 - 6789. Let c(d) be the first derivative of jd - d*3 - 18 - 1/2d*2. What is -7c(v) + 5p(v)? v2 + 2v - 1 Let f(z) = 2z + 7. Let j(l) = 52l - 16. Let r(i) = -47i + 17. Let t(q) = -11j(q) - 12r(q). Calculate -9f(k) - 2t(k). -2k - 7 Let j(v) = v*3 + v - 1. Let f(d) = 3d*3 - 2d + 1. Let r be 15 + (-6)/1 - 10. Let p be (0 - r)/(7(-8)/(-56)). Determine pf(x) + j(x). 4x3 - x Let x(v) = 732v*3 + 48v + 48. Let q(z) = -3z3 - 50z*2 + 78z + 60. Let n be q(-18). Let y(b) = 77b3 + 5b + 5. Give ny(i) + 5x(i). -36i3 Let u(w) be the third derivative of -w4/4 - 7w*3/3 - 46w*2. Let j = -401 - -395. Let q(a) = -2a - 5. Give ju(y) + 17q(y). 2y - 1 Let x(t) = -t3 + 18t*2 - 175278 - 18t*2 + 175288. Suppose -19 - 1 = -4m. Let l(s) = s*3 - 15. Calculate ml(n) + 7x(n). -2n*3 - 5 Let h(b) = -5b + 12. Let y(t) = -2t + 6. Let f(d) = -6h(d) + 14y(d). Let r(z) be the second derivative of z2/2 + 11z + 4. What is 2f(o) - 22r(o)? 4o + 2 Let i be (-341)/(-7) + 88/224. Let l = -46 + i. Let u(g) = 11g2 - 2g - 3. Let s(b) = 4b2 - b - 1. Determine lu(v) - 8s(v). v2 + 2v - 1 Let p(d) = 11d - 7. Let g(f) be the third derivative of 2f*4/3 - 11f*3/6 - 22f*2 + 95. Determine 5g(b) - 8p(b). -8b + 1 Let i(a) = 37 - 35a - 149 + 109. Let y(g) = -70g - 5. Determine 10i(s) - 6y(s). 70s Let c(z) = -z2 + 1. Suppose 5f + 39 = 4s + 20, -2f = 2s + 4. Let k(u) = -6u*2 + u - 1. Give sc(n) - k(n). 5n2 - n + 2 Let k(o) = -o2. Let y(f) be the third derivative of -3f*5/4 + 4f*2. What is 12k(b) - y(b)? 33b2 Let m(y) = -12y*2 + 95y - 5013. Let j(o) = -2o2 + 19o - 1. Calculate -5j(l) + m(l). -2l*2 - 5008 Let t(f) = 5372f - 4. Let m(z) = -52z + 1. Determine 8m(d) + 2t(d). 10328d Let l(z) = -z3 + z2 - z. Let m(v) = 8v3 - 5v*2 + 5v. Let s(t) = -13t + 184. Let w be s(18). Let h be 38/171 + w/(-18) + -2. Give hm(j) + 5l(j). 3j*3 Let q(k) = -5k - 4. Let j(a) = -5a - 3. Suppose 6g - 31 = 3t - 37, t = -4g - 16. What is tq(p) + 5j(p)? -5p + 1 Suppose -3m = -0m - 96. Let p(t) = -38 + 38 - 52t*2 - mt. Suppose 55y + 1693 = -67. Let z(w) = -8w*2 - 5w. Calculate yz(d) + 5p(d). -4d2 Suppose -3997k = -4018k - 42. Let v(m) = m - 3. Let a(o) = 1. Determine ka(u) - v(u). -u + 1 Let u(j) = 3j3 - 5j*2 - 3j - 17. Let c(f) be the first derivative of f4/4 - f3 - f*2 - 9f - 8583. What is 5c(w) - 3u(w)? -4w3 - w + 6 Let a(l) = -1. Let o(n) be the first derivative of n3/3 - n2 + 3n + 971. Determine -5a(q) - o(q). -q2 + 2q + 2 Let v(p) = 9p3 + 7p*2 + 19p + 7. Let k(g) = -3g3 - 2g*2 - 6g - 2. Determine -7k(c) - 2v(c). 3c3 + 4c Let y(t) = 4t2 - 8. Let r(v) = 3v*2 - v - 7. Suppose 4c - 15 - 1 = -2o, -5 = -c - o. Give cr(z) - 2y(z). z2 - 3z - 5 Let o(b) = b - 2. Let q(x) = -3x + 4x - 4 + x. Suppose 0 = 8r + 5z + 35, -25z + 20z - 10 = 3r. Determine ro(j) + 2q(j). -j + 2 Let c(b) = -931b*2 - 3b + 3. Let w(n) = 1444912n2 + 4655n - 4655. What is 4655c(o) + 3w(o)? 931o2 Let m(h) be the third derivative of h5/12 + h4/6 - 2h*3/3 + 6h*2. Let w = -480 + 484. Let n(b) = 14b*2 + 11b - 11. Calculate wn(t) - 11m(t). t*2 Let v(f) = 2f. Let i(r) = -3r. Let a be (3 - 3/1) + 3. Let m = 1686 + -1685. Determine av(j) + mi(j). 3j Let j(w) = 13w2 - 3w + 4. Let g(y) = -13y2 + 4y - 5. Let k(o) = -126o + 625. Let t be k(5). Give tj(r) - 4g(r). -13r*2 - r Let g(v) be the second derivative of 0 + 3v*2 - 45v + 5/2v3. Let s(p) = 7p + 3. Determine -6g(b) + 13s(b). b + 3 Let m(v) = 1. Let p(c) = -51c - 149. Let g(h) = -8h - 23. Let s(u) = -39g(u) + 6p(u). Calculate 9m(l) - 3s(l). -18l Let z(u) = 2u*2 + 3u - 27 + 55 - 2u - 22. Let h(f) = 3f*2 + 2f + 5. Calculate 3h(n) - 4z(n). n*2 + 2n - 9 Let m(j) = 2j3 - 27j*2 - 10j - 17. Let n be m(14). Suppose -n = -9t - 3. Let y(f) = 16f - 5. Let b(x) = 15x - 4. Give tb(s) - 3y(s). 12s - 1	{ "pile_set_name": "DM Mathematics" }
Let g = 31767 + -31766. What is the highest common divisor of m and g? 1 Suppose 2j - 1104 = 4w, -6w = -9w - 6. Suppose -2i = j - 656. Calculate the greatest common divisor of i and 2. 2 Suppose -x = -0x - 15x + 1988. Calculate the highest common factor of x and 10366. 142 Let c be 168/4 + (1 - -2). Let o = c + -46. Let a = o + 4. What is the highest common factor of a and 3? 3 Let p be 77/(-7) + 8 - -4. Let g(q) = 7q - 1. Let x(s) = s + 11. Let z be x(-10). Let h be g(z). Calculate the highest common divisor of p and h. 1 Let k = -12220 + 12231. Suppose 5n - s = -8, -3n + 5s - 1 + 5 = 0. Let x = n - -3. What is the highest common divisor of x and k? 1 Suppose 5s - 2o - 3o = 10, 0 = o - 3. Suppose -51r = -4r + 59267. Let h = r + 1346. Calculate the greatest common factor of s and h. 5 Let d = 60 - 43. Let q = -158 + 162. Suppose -y = -3i + 52, -qi - 36 = -6i + 2y. What is the greatest common factor of i and d? 17 Let j be -457 + (3 - 4) + 3. Let z = j + 675. What is the greatest common factor of 80 and z? 20 Let t(z) = -z*3 + 13z*2 - 5z + 30. Let k be t(11). Let i = k - 204. Calculate the greatest common factor of i and 104. 13 Suppose 0 = -3w + 1208 + 3922. Suppose 30i - 40i + w = 0. What is the highest common divisor of 228 and i? 57 Suppose 7198d = 7206d - 2632. Calculate the highest common factor of d and 7. 7 Let k(s) = s3 - 4s*2 + 4s + 6. Suppose -7 = 8h - 31. Let n be k(h). Calculate the highest common factor of n and 36. 9 Let j(p) = -546p - 16372. Let v be j(-30). Calculate the highest common divisor of v and 4252. 4 Let j be (87/12 + -7)-2 + (-1485)/(-6). Calculate the greatest common divisor of 703 and j. 19 Let v be 86 + 1 - 2814/134. Suppose -4x + 4n = -148, 5x - x = n + 136. Calculate the greatest common factor of x and v. 33 Let j be -2 + 6 - (13638/15)/(20/(-50)). Calculate the greatest common factor of 264 and j. 33 Suppose 85g = 41 + 1234. Calculate the highest common factor of g and 405. 15 Let m(q) = -q3 + 13q*2 - 5q - 10. Let j be m(10). Let n = 1427 - 1331. What is the greatest common divisor of n and j? 48 Let s(g) = g*2 + 793g + 4739. Let b be s(-6). Let x(i) = -4i - 3. Let k be x(-5). What is the greatest common divisor of k and b? 17 Let q be ((-1242)/115)/(-18) - 412/(-5). Calculate the greatest common factor of q and 6723. 83 Suppose 0 = -14f + 12f - 28. Let z(q) = -30q + 31. Let a be z(f). What is the highest common divisor of 41 and a? 41 Let z be ((-48)/10)/(-3(12 - 1795/150)). What is the greatest common divisor of z and 3216? 48 Suppose 66 = 3u - 2p + 3p, 2p + 15 = u. Let f be (-51984)/(-360) - (-117)/45. Calculate the greatest common divisor of u and f. 21 Let a be -10(7 - (6 - -13))/1. What is the highest common factor of 2760 and a? 120 Let x be 12(-20)/45(3 - 27615/28). Calculate the greatest common divisor of 152 and x. 76 Suppose -358 = -11q - 50 + 209. Calculate the greatest common factor of 2491 and q. 47 Suppose -5v + 7t = -1748, -4v - 4t + 1509 = 101. Let a be 1/((-1)/(-12 - 1)). Calculate the highest common factor of v and a. 13 Let c = 1118 + -962. Calculate the highest common divisor of c and 663. 39 Let a be (9 + (-3213)/45)/((-182)/45 - -4). Calculate the highest common divisor of a and 1300. 52 Suppose 0 = 9t - 0t - 19845. Suppose -t = 53f - 58f. Calculate the greatest common factor of f and 9. 9 Let l be -24 + (16210 - (-4)/(-2)). What is the highest common factor of 112 and l? 56 Let l be (3060/(-150))/(2/(-25)) + 5. Suppose 800c + l = 804c. What is the highest common factor of c and 65? 65 Let n be ((-1243)/22 - -15)(-2 + 2 + -2). Calculate the greatest common divisor of n and 581. 83 Suppose 3 = -2a - 17. Let k(i) = -i2 - 21i + 8. Let z be k(a). Calculate the greatest common divisor of 295 and z. 59 Let a(u) = u*2 - u - 6. Let b be a(5). Let d = 42 + -19. Suppose -3g + 128 = d. What is the greatest common divisor of b and g? 7 Suppose -1112l + 1114l - 420 = 0. What is the highest common factor of 50 and l? 10 Let t be (-102)/10(-205 - -27 - 22). What is the highest common factor of 270 and t? 30 Suppose -4r - 3k = -360, -2k + 176 = -5r + 626. Calculate the highest common factor of 1510 and r. 10 Let i be ((-30)/(-54))/(12/32292). What is the highest common factor of 20 and i? 5 Suppose 5i - 5t = 61115, 7t - 4t = i - 12205. Calculate the greatest common factor of 33 and i. 11 Let s(a) = 6a - 8. Let w be s(12). Let o = 86 + w. Suppose 4u = -3i + 168, -3i = -4i + 4u + 72. What is the greatest common factor of o and i? 30 Let m(c) = -3c + 288. Let t be m(-12). Calculate the greatest common divisor of t and 288. 36 Suppose 4c + 5g - 4g = 197, -5g + 169 = 3c. Let a = c - -87. Suppose -53 = -12r - 42 + 169. What is the highest common factor of r and a? 15 Let f be (-11 + 14)/(3 + 9/(-4)). Suppose -3a + 3k + 40 = 7k, a = 3k - f. Let m = 6 + 2. What is the highest common factor of a and m? 8 Let y(k) = -k*2 - 5k - 2. Let i be y(-4). Suppose -in + g = -443, 2n + 3g = 418 + 37. Let x = n - 133. What is the greatest common divisor of x and 18? 18 Let m(d) = 6d*2 + 35d - 22. Let f be m(-10). Calculate the greatest common divisor of 1216 and f. 76 Suppose 0 = -2r - 2b + 67 + 193, 4r - 5b = 565. What is the highest common divisor of 60 and r? 15 Let c(v) = 43v2 - 37v + 49. Let r be c(27). Calculate the greatest common factor of 269 and r. 269 Let x(c) = -47c + 21. Suppose 20i = 14i - 30. Let n be x(i). Suppose -16b + 14b = -n. What is the greatest common factor of 32 and b? 32 Let q(c) = 23c*2 - 220c + 1085. Let r be q(5). Suppose -50 = -5j - 4y, -5y = -2j - 5 + 58. Calculate the highest common divisor of j and r. 14 Let x be (9 - 9)/(2 + -3). Suppose -13j + 171 + 882 = x. Calculate the highest common divisor of 12 and j. 3 Let r(c) = 110c + 3820. Let m be r(-33). Calculate the greatest common divisor of 630 and m. 10 Let s(a) = -a*3 + 10a*2 - 16a - 12. Let x be (-4 - -16)3/(-1 - -7). Let n be s(x). Calculate the greatest common factor of n and 156. 12 Let s be (485/(-3))/((-310)/1116). What is the highest common divisor of s and 12? 6 Let r(d) be the second derivative of 11d - 1/3d3 + 1/20d*5 + 2d*2 + 0 + 1/3d*4. Let v be r(-4). What is the greatest common divisor of v and 12? 12 Suppose 5w = -4t + 297 - 82, 125 = 2t - w. What is the greatest common factor of 10380 and t? 60 Suppose -112w + 135w + 225w - 33728 = 0. What is the highest common divisor of w and 17272? 136 Suppose -3o + 322 = -3f + 2f, 2f = 3o - 320. Let d(w) = -450w + 121. Let m be d(2). Let g = m + 791. What is the highest common divisor of o and g? 12 Suppose 0 = 32a - 49a + 544. Calculate the greatest common factor of a and 56. 8 Suppose 1134 = -22k + 29k. Suppose 0 = -5z + q + 2q - 695, 4q = -z - k. Let a = z + 144. Calculate the highest common factor of 2 and a. 2 Let z(w) = w*2 + 100. Let d be z(0). Suppose -317a + 323a + 378 = 0. Let j = a - -83. What is the highest common divisor of d and j? 20 Suppose 3k + 19 = 2w - 3, 0 = -3w - k + 33. Let i(t) = -5t + 23. Let n be i(-11). Let q = -1 + n. Calculate the greatest common divisor of w and q. 11 Suppose d - 4v = 316, -d + 2v = -3v - 323. What is the greatest common divisor of d and 9? 9 Suppose 22w = 28w. Suppose w = -26c + 43c - 952. What is the greatest common divisor of c and 70? 14 Let g(k) = 28k2 - 11k*2 - 12k*2 - 6k*2 - 47 + 28k. Let c be g(23). What is the highest common factor of c and 4? 4 Suppose 0 = 325q - 1452 - 3748. What is the greatest common factor of q and 964? 4 Suppose -5j + 66q + 40 = 68q, 8 = j + 2q. What is the highest common divisor of j and 2344? 8 Let k(g) = -g - 17. Let b be k(7). Let i = -24 - b. Suppose -5l + 9 + 26 = i. Calculate the greatest common divisor of 1 and l. 1 Suppose -35i + 358 = -272. Calculate the highest common factor of i and 24. 6 Let y = 1916 + -584. What is the highest common factor of 96 and y? 12 Suppose 8l = -11l + 475. Let n be (-2)/(-6) - (-406)/42. What is the highest common factor of l and n? 5 Suppose x - 61 = -0b - 4b, -3b + 57 = 3x. Suppose -38n + b = -37n. Let w(s) = -14s - 7. Let c be w(-3). What is the highest commo	{ "pile_set_name": "DM Mathematics" }
PM and 2:12 AM? 525 What is 292 minutes after 2:35 AM? 7:27 AM What is 71 minutes after 7:24 AM? 8:35 AM What is 454 minutes after 9:25 PM? 4:59 AM How many minutes are there between 8:36 AM and 1:27 PM? 291 How many minutes are there between 5:59 AM and 10:05 AM? 246 How many minutes are there between 9:40 AM and 9:22 PM? 702 What is 67 minutes after 10:32 AM? 11:39 AM How many minutes are there between 3:14 PM and 5:22 PM? 128 What is 176 minutes before 8:23 AM? 5:27 AM What is 424 minutes after 11:58 PM? 7:02 AM What is 714 minutes before 5:43 PM? 5:49 AM How many minutes are there between 12:56 PM and 10:32 PM? 576 How many minutes are there between 4:51 AM and 7:47 AM? 176 How many minutes are there between 12:01 PM and 3:07 PM? 186 How many minutes are there between 2:56 PM and 2:55 AM? 719 How many minutes are there between 2:31 AM and 1:34 PM? 663 How many minutes are there between 9:54 AM and 5:04 PM? 430 How many minutes are there between 5:12 AM and 8:27 AM? 195 What is 121 minutes before 2:47 PM? 12:46 PM How many minutes are there between 4:09 AM and 8:12 AM? 243 What is 398 minutes after 1:17 PM? 7:55 PM How many minutes are there between 7:09 PM and 3:49 AM? 520 How many minutes are there between 12:20 AM and 4:16 AM? 236 How many minutes are there between 7:12 PM and 10:34 PM? 202 How many minutes are there between 5:59 AM and 6:41 AM? 42 How many minutes are there between 2:48 AM and 2:09 PM? 681 How many minutes are there between 2:39 PM and 6:01 PM? 202 How many minutes are there between 8:51 PM and 10:22 PM? 91 How many minutes are there between 7:50 PM and 12:14 AM? 264 How many minutes are there between 4:18 AM and 1:27 PM? 549 What is 324 minutes after 11:04 AM? 4:28 PM How many minutes are there between 2:46 PM and 2:28 AM? 702 How many minutes are there between 5:03 AM and 4:34 PM? 691 How many minutes are there between 4:51 PM and 12:38 AM? 467 How many minutes are there between 7:49 AM and 10:11 AM? 142 How many minutes are there between 8:37 PM and 8:19 AM? 702 How many minutes are there between 2:33 AM and 5:39 AM? 186 What is 490 minutes after 4:48 PM? 12:58 AM How many minutes are there between 9:53 AM and 10:49 AM? 56 How many minutes are there between 12:21 AM and 11:49 AM? 688 What is 305 minutes after 9:34 AM? 2:39 PM How many minutes are there between 1:41 PM and 12:28 AM? 647 What is 123 minutes before 10:49 PM? 8:46 PM What is 474 minutes before 9:55 AM? 2:01 AM What is 51 minutes before 10:28 AM? 9:37 AM How many minutes are there between 2:41 PM and 1:05 AM? 624 What is 631 minutes after 6:22 AM? 4:53 PM How many minutes are there between 7:22 AM and 4:58 PM? 576 How many minutes are there between 1:22 AM and 1:11 PM? 709 How many minutes are there between 3:55 PM and 8:51 PM? 296 How many minutes are there between 12:22 AM and 11:32 AM? 670 What is 270 minutes after 7:51 PM? 12:21 AM How many minutes are there between 4:51 PM and 4:12 AM? 681 How many minutes are there between 11:22 AM and 6:16 PM? 414 What is 69 minutes after 12:22 PM? 1:31 PM What is 320 minutes after 1:44 PM? 7:04 PM How many minutes are there between 6:29 AM and 11:49 AM? 320 What is 682 minutes before 12:47 PM? 1:25 AM How many minutes are there between 11:06 AM and 5:34 PM? 388 What is 88 minutes before 8:25 AM? 6:57 AM How many minutes are there between 10:20 AM and 6:03 PM? 463 What is 50 minutes after 12:40 AM? 1:30 AM What is 286 minutes before 1:32 PM? 8:46 AM How many minutes are there between 7:33 PM and 11:48 PM? 255 How many minutes are there between 12:21 AM and 4:41 AM? 260 How many minutes are there between 9:25 AM and 3:07 PM? 342 How many minutes are there between 1:41 AM and 12:50 PM? 669 What is 391 minutes after 5:32 AM? 12:03 PM How many minutes are there between 8:19 PM and 6:42 AM? 623 What is 246 minutes before 2:59 PM? 10:53 AM What is 643 minutes after 6:03 PM? 4:46 AM How many minutes are there between 4:07 PM and 8:19 PM? 252 How many minutes are there between 10:54 AM and 2:54 PM? 240 What is 42 minutes before 11:12 AM? 10:30 AM What is 448 minutes after 2:02 PM? 9:30 PM How many minutes are there between 4:32 AM and 4:19 PM? 707 What is 652 minutes before 7:18 AM? 8:26 PM What is 588 minutes before 3:31 PM? 5:43 AM What is 54 minutes after 6:08 AM? 7:02 AM How many minutes are there between 4:34 PM and 10:45 PM? 371 What is 300 minutes after 2:04 PM? 7:04 PM What is 270 minutes before 2:58 AM? 10:28 PM How many minutes are there between 2:44 PM and 9:34 PM? 410 What is 585 minutes after 2:54 AM? 12:39 PM How many minutes are there between 7:38 AM and 8:16 AM? 38 How many minutes are there between 9:30 AM and 8:37 PM? 667 How many minutes are there between 3:56 PM and 12:09 AM? 493 How many minutes are there between 1:23 AM and 12:18 PM? 655 What is 98 minutes before 7:23 PM? 5:45 PM How many minutes are there between 11:08 AM and 3:34 PM? 266 What is 315 minutes before 9:42 PM? 4:27 PM What is 27 minutes before 1:56 PM? 1:29 PM What is 71 minutes after 8:25 AM? 9:36 AM What is 238 minutes after 9:08 PM? 1:06 AM What is 625 minutes after 9:57 PM? 8:22 AM How many minutes are there between 10:28 AM and 5:56 PM? 448 What is 250 minutes after 8:36 PM? 12:46 AM What is 690 minutes before 2:33 AM? 3:03 PM How many minutes are there between 6:11 AM and 8:58 AM? 167 What is 274 minutes after 10:10 AM? 2:44 PM How many minutes are there between 4:40 AM and 2:35 PM? 595 How many minutes are there between 3:54 AM and 12:31 PM? 517 What is 115 minutes before 10:03 PM? 8:08 PM What is 399 minutes after 3:52 PM? 10:31 PM How many minutes are there between 11:34 PM and 2:21 AM? 167 What is 631 minutes before 11:39 PM? 1:08 PM What is 539 minutes before 6:15 PM? 9:16 AM How many minutes are there between 12:01 AM and 1:45 AM? 104 What is 170 minutes after 5:48 AM? 8:38 AM How many minutes are there between 1:46 PM and 8:11 PM? 385 What is 255 minutes before 9:40 PM? 5:25 PM What is 36 minutes after 3:02 AM? 3:38 AM How many minutes are there between 5:37 PM and 2:17 AM? 520 How many minutes are there between 11:29 AM and 5:41 PM? 372 How many minutes are there between 10:37 AM and 4:21 PM? 344 What is 137 minutes before 5:30 AM? 3:13 AM How many minutes are there between 12:05 AM and 5:37 AM? 332 What is 627 minutes before 1:40 AM? 3:13 PM How many minutes are there between 1:20 AM and 4:42 AM? 202 How many minutes are there between 9:22 PM and 8:42 AM? 680 How many minutes are there between 9:33 PM and 4:43 AM? 430 How many minutes are there between 7:11 AM and 9:12 AM? 121 How many minutes are there between 8:40 AM and 1:33 PM? 293 How many minutes are there between 10:45 PM and 4:59 AM? 374 How many minutes are there between 11:46 PM and 11:14 AM? 688 What is 428 minutes after 11:01 AM? 6:09 PM How many minutes are there between 6:11 AM and 9:15 AM? 184 How many minutes are there between 11:19 AM and 8:28 PM? 549 What is 669 minutes after 6:07 PM? 5:16 AM How many minutes are there between 9:07 AM and 11:40 AM? 153 How many minutes are there between 3:02 PM and 10:06 PM? 424 What is 467 minutes before 4:01 AM? 8:14 PM What is 636 minutes after 2:34 PM? 1:10 AM What is 691 minutes after 8:46 AM? 8:17 PM What is 77 minutes after 12:23 PM? 1:40 PM What is 303 minutes after 11:33 AM? 4:36 PM What is 416 minutes after 8:52 AM? 3:48 PM How many minutes are there between 11:13 PM and 11:17 PM? 4 How many minutes are there between 5:04 PM and 6:36 PM? 92 What is 52 minutes before 12:22 PM? 11:30 AM How many minutes are there between 7:42 PM and 2:32 AM? 410 What is 467 minutes before 11:32 PM? 3:45 PM How many minutes are there between 10:43 PM and 11:32 PM? 49 What is 707 minutes before 8:45 AM? 8:58 PM What is 236 minutes before 7:57 PM? 4:01 PM How many minutes are there between 6:15 AM and 1:40 PM? 445 How many minutes are there between 3:04 PM and 8:35 PM? 331 How many minutes are there between 7:41 AM and 2:25 PM? 404 What is 176 minutes before 10:05 PM? 7:09 PM What is 120 minutes after 4:19 PM? 6:19 PM How many minutes are there between 4:39 PM and 2:22 AM? 583 What is 376 minutes after 5:28 AM? 11:44 AM How many minutes are there between 1:47 AM and 6:49 AM? 302 How many minutes are there between 8:28 AM and 1	{ "pile_set_name": "DM Mathematics" }
(n) = -63n + 1133. Let y(s) = 116s - 2266. Give 6y(h) + 11z(h). 3h - 1133 Let t = 430 - 420. Suppose -6 - 64 = ti. Let s(w) = -6w2 + 3. Let y(g) = 13g*2 - 7. Determine is(q) - 3y(q). 3q2 Let p(x) = x2 - 7x + 4. Let b be p(5). Let q(t) = -1 + t - t2 + 0 + 2t + 0t. Let m(f) = -f2 + 3f - 1. Calculate bm(n) + 5q(n). n*2 - 3n + 1 Let k(n) = -100n. Let b be 5 - 1/1 - (54 - 52). Suppose -9 - 31 = -2z - bw, 4z + 5w = 80. Let a(y) = 10y + 5y + zy - 26y. What is 45a(x) + 4k(x)? 5x Let b(r) = 5r - 4. Let t(s) = -234s*2 - 41s + 37. What is -8b(h) - t(h)? 234h*2 + h - 5 Let j(h) = 2h. Let m(w) = 5w - 1. Suppose -97 - 53 = 10u. Let s be 215/25 - u/(-25). What is sj(o) - 3m(o)? o + 3 Let z(i) = -227i2 + 16i + 40. Let j(m) = -150m2 + 10m + 26. Give 8j(h) - 5z(h). -65h2 + 8 Let z(g) = g2 + g - 1. Let u(p) = p2 - 14p + 47. Let a be u(5). Let x(h) = 1 - 7 + 16h2 - 9h*a + 3h + h. Give -x(q) + 4z(q). -3q*2 + 2 Let q(f) = 4f*3 + 2f*2 + 3f + 3. Let j(p) = -9p3 - 3p*2 - 5p - 5. Suppose -175a - 360a + 2675 = 0. What is aq(l) + 3j(l)? -7l3 + l2 Let z(o) = -103o + 8713 - 4346 - 4350. Let r(k) = 13k - 2. Calculate -51r(l) - 6z(l). -45l Let j(f) = 6f2 - 2f. Let r(h) be the first derivative of 10h3 - 11h*2/2 + 2259. What is 11j(a) - 2r(a)? 6a*2 Let z(j) = -3j*2 + 353j + 3. Let t(a) = 4a2 - 702a - 5. Calculate 3t(q) + 5z(q). -3q2 - 341q Let x(j) = 1565j2 + 28j - 4. Let a(l) = 3132l2 + 71l - 9. Calculate 2a(v) - 5x(v). -1561v2 + 2v + 2 Let s(u) be the first derivative of u*4 + 5u - 65440. Let a(x) be the first derivative of -5x4/2 - 12x + 1. Calculate -5a(v) - 12s(v). 2v3 Let s(v) = -2. Let g = -540 - -538. Let n(j) = 12j - 1. Calculate gs(k) + 2n(k). 24k + 2 Let s(b) = 7b*3 - 12b*2 + 2506b + 6. Let a(i) = -i*3 + 2i*2 - i - 1. What is 6a(k) + s(k)? k*3 + 2500k Let m(u) = -1692045u3 - 665u*2 - 665u + 1330. Let d(s) = -10193s3 - 4s*2 - 4s + 8. Give -665d(n) + 4m(n). 10165n3 Let u(i) = -i2 + 1. Let n(q) = q2 + q - 5. Let o(f) = -13f*2 - 9f + 50. Let b(r) = 36n(r) + 4o(r). Give -4b(h) + 80u(h). -16h2 Let t(v) = -2v + 4. Let n = -22 - -13. Let p(o) = 1418 - 485 - 8o + 16o - 479 - 471. Calculate nt(c) - 2p(c). 2c - 2 Let s(w) = -3w*3 + 20w*2 - 9w - 9. Let i(m) = -m*3 + 5m*2 - 2m - 2. Suppose -16 = -20a - 18a + 46a. What is as(l) + 9i(l)? -3l*3 + 5l2 Let r(p) = p2 + 2p - 1. Let h(f) = 166f*3 + 4f*2 + 8f - 4. Determine -h(x) + 4r(x). -166x*3 Let a(y) = 245y - 1. Let o(k) = -421k + 1. Give 7a(l) + 4o(l). 31l - 3 Let q(a) = -40a2 - 19a - 8. Let c(o) = 160o2 + 84o + 33. Determine 2c(g) + 9q(g). -40g2 - 3g - 6 Let g(v) = v + 1. Let x(o) = -4 - 28 - 5 + 38. Let j be (-1)/((-4)/(6 - -2)). What is jg(u) - 3x(u)? 2u - 1 Let a(u) = -u2. Let r(i) = 4i + 28. Let p be r(-5). Suppose 6n - pn = -6. Suppose l + 4 - n = 0. Let q(d) = -7d2. Give lq(c) + 5a(c). 2c*2 Let a(n) be the third derivative of -5n*4/12 - 2n*3 + 761n*2 - 3. Let i(x) = 5x + 6. Determine 4a(j) + 7i(j). -5j - 6 Let j(f) = 9f - 88. Let b = -331 - -342. Let u be j(b). Let c(g) = 16g + 11. Let a(y) = -8y - 6. Give ua(z) + 6c(z). 8z Let w(c) be the first derivative of -c4/4 - 10c*3/3 - 7c*2/2 - 3945. Let y(o) = -3o*2 - 2o. Determine 2w(p) - 7y(p). -2p3 + p2 Let r(o) = -9o*3 - 12o*2 + 8o - 51. Let s(q) = q*3 + 2q*2 - 2q + 1. Give r(m) + 4s(m). -5m*3 - 4m2 - 47 Let f(t) = -t - 1 - 8 + t3 + 19t2 + 10 - 18t*2 + 0t. Let u(g) = 2g2 - 8g + 3. Calculate -3f(p) + u(p). -3p3 - p2 - 5p Let t(j) = 12j*3 - 4j*2 - 3j - 5. Let d = -1851 + 1846. Let x(u) = -6u3 + 2u*2 + 2u + 3. Calculate dx(z) - 3t(z). -6z3 + 2z*2 - z Let c(u) = -1925u - 3. Let j(x) = 1939x + 6. Calculate -4c(s) - 3j(s). 1883s - 6 Let r(m) be the first derivative of -m3/3 + m2/2 - m + 1. Let t(l) be the third derivative of l5/15 - l4/8 + 27564l2. Determine -3r(q) - t(q). -q2 + 3 Let q be ((8/10)/(-1))/((-12)/270). Let x(v) = -v2 - 5v - 5. Let a(f) be the second derivative of -f4/4 - 3f*3 - 9f*2 + 2f. Calculate qx(b) - 5a(b). -3b2 Let n(t) = t2 + 18t + 494. Let p(v) = -2v2 - 30v - 988. What is 5n(m) + 3p(m)? -m*2 - 494 Let l(k) = -k + 1. Let o(x) be the first derivative of -1/2x*2 + 5x + 51. Determine 6l(q) - o(q). -5q + 1 Let b(r) = r*3 - 7r*2 + 13r - 3. Let a be b(5). Suppose a = y - 15. Let c(p) = -yp + 54p - 28p + 1. Let x(h) = 3h - 4. What is -2c(q) - x(q)? -q + 2 Let x(p) = 4. Suppose -4t = -4h + 8, 2h - 6h = 3t + 6. Let u(o) = -5o - 13. Let n(f) = 6f + 14. Let i(y) = -4n(y) - 5u(y). What is ti(z) + 5x(z)? -2z + 2 Let u(s) = 2s*3 - 8s*2 + 4s + 16. Let y(k) = k*3 + 2k*2 - k - 5. Determine -2u(t) - 7y(t). -11t*3 + 2t*2 - t + 3 Let l(z) = -59z + 5. Let q(m) = -246m + 16 + 135m - 36m - 4. Determine -12l(b) + 5q(b). -27b Let n(w) = 3w - 3. Let z(q) = -12q + 13. Let j be 21 - (-2)/((-12)/(-30)). Suppose d + 0 = -j. Calculate dn(v) - 6z(v). -6v Let f(s) = -6s*2 + 114s + 108s - 340s + 113s. Let u = -16 - -8. Let i(r) = 9r*2 + 8r. Give uf(a) - 5i(a). 3a2 Let t(o) = -4o*2 - 2o - 1. Let z(x) = 43x2 + 8x. Determine -3t(v) - z(v). -31v*2 - 2v + 3 Let u(j) = j3 - j2 - j + 1. Let z(o) = 2o3 - 5o*2 - 6o + 6. Let v(d) = -17d3 - 85d*2 - 3d - 9. Let w be v(-5). Determine wu(t) - z(t). 4t3 - t2 Let h(j) = -8j - 9. Let w = 34 + -52. Let g be w/(1 - -1) - 6/(-2). Let f be 7 + 8/(-2) + 2. Let b(o) = -7o - 8. Determine fh(u) + gb(u). 2u + 3 Let s be 57/(-342) - (-341)/66. Let i(w) = w2 + 4w + 13. Let p(g) = g*2 + 5g + 14. Determine si(h) - 4p(h). h2 + 9 Let c(i) = i3 + i2 + i + 1. Let u = -669 - -670. Let q(k) be the second derivative of -k4/6 - 3k2 - 42k - 3. What is uq(h) + 2c(h)? 2h3 + 2h - 4 Let k(f) = -3f3 - 83f*2 + 3f - 15. Let g(t) = -2t3 - 84t*2 + 2t - 12. Calculate -5g(c) + 4k(c). -2c3 + 88c*2 + 2c Let k(d) be the second derivative of -d5/20 - d3/6 + 46d - 4. Let b(z) = z3 + 4z. What is 2b(w) + 6k(w)? -4w3 + 2w Let p(o) = 98306403o - 98306403o + 5o2 - 4o*3 + 41. Let k(z) = 3z*3 - 4z*2 - 40. What is 5k(q) + 4p(q)? -q3 - 36 Let l(x) = 11x*2 + 3x - 721. Let c(o) = 13o2 + 3o - 716. Calculate -5c(k) + 6l(k). k*2 + 3k - 746 Let w(l) = -1053l + 32. Let c(m) = 3162m - 86. Determine -3c(g) - 8w(g). -1062g + 2 Let v(f) = -9f*2 + 10f + 318. Let g(j) = 8j2 - 8j - 327. Give 4g(w) + 3v(w). 5w2 - 2w - 354 Let w(f) = 2305f3 + 5f*2. Let c(o) = 2303o*3 + 6o*2. Determine 5c(j) - 6w(j). -2315j3 Let u(n) be the second derivative of n5/4 - n4/6 + n3/3 + n*2 + 872n. Let m(l) = -11l3 + 5l*2 - 3l - 5. Calculate -2m(r) - 5u(r). -3r3 - 4r Let i(p) = -9p3 - 2p*2 - 2p - 2. Suppose 287 = -31b + 194. Let g(d) = 3d*2 + 2d*3 + 11d3 + 3 - d3 - 2d3 + 3d. What is bi(y) - 2g(y)? 7y3 Let i(v) = 22v + 15. Let n(c) = 64c + 51. Let r(o) = -13i(o) + 4n(o). Let s(y) = y - 1. Calculate r(a) + 12s(a). -18a - 3 Let x(p) = -5143061p*3 - 7858p*2 - 3929p - 3929. Let z(b) = 3926b3 + 6b*2 + 3b + 3. Determine 3x(j) + 3929z(j). -3929j3 Let p(h) = -h2 - 3h + 2. Let c(i) = -8i - 29. Let t be c(-9). Let a = -44 + t. Let g(f) = f2 + f - 1. What is ap(k) - 3g(k)? -2k*2 + 1 Let g = 259 - 259. Let m(c) = 2c - 4. Let s be m(g). Let b(w) = -13w2 - 9w + 17. Let j(o) = 3o2 + 2o - 4. Determine sb(v) - 18j(v). -2v2 + 4 Let j(u) be the third derivative of -u4/6 - u3/2 + u2 + 139. Let s(m) = 35m + 5 - 3 - 32m. Give -5j(o) - 7s(o). -o + 1 Let x(b) = -884b - 8. Let o(y) = 441y + 5. Give 7o(n) + 4x(n). -449n + 3 Let d(i) = 51i2 + 21. Let r = -7 - -5. Let z(j) = 5j*2 + 2. Suppose -24a = -74a + 25a + 525. Give az(c) + rd(c). 3c2 Let y(v) = 47v + 1729 - 22v - 1727. Let c(x) = -74x - 7. Calculate -2c(w) - 7y(w). -27w Let a(o) = -o2 - 231o + 46. Let i(l) = 44l - 9. Let c(h) = -4a(h) - 21i(h). Let s(n) = -9n**2 + n - 9. Det	{ "pile_set_name": "DM Mathematics" }
lest value? (a) -0.04 (b) -35 (c) 13516/11 b What is the smallest value in -1/370, -61, 0.08, 6? -61 Which is the fifth biggest value? (a) -8/7 (b) 0 (c) -2/61 (d) -35 (e) -3 d What is the biggest value in 0.2, -97/30, 4, 1, 5, -10? 5 What is the third biggest value in 150, 4, -559823? -559823 Which is the second biggest value? (a) -0.2 (b) 3/8 (c) -733.7 (d) 328 b What is the second biggest value in -0.2, -418, 0.1, 2/653, 38/11? 0.1 Which is the third smallest value? (a) -0.4 (b) 458932/5 (c) -1/14 b Which is the third smallest value? (a) 2/11 (b) 0.2 (c) 0.07 (d) -1 (e) 0.5 (f) 16 a What is the second biggest value in 7, 1, -0.3, 0.24, 0.1, -0.2, -9? 1 Which is the second biggest value? (a) 0 (b) 3 (c) 4 (d) 2/17 (e) 10929 (f) -2 (g) -28 c Which is the fourth biggest value? (a) -4136/23 (b) 2 (c) 3/10 (d) -1 a What is the second smallest value in 3.3, -3/7, 143, -67, 5? -3/7 Which is the sixth smallest value? (a) 6/11 (b) -622 (c) -4 (d) 10 (e) -0.3 (f) 97 (g) 1 d Which is the sixth smallest value? (a) -3 (b) -2 (c) 1/7 (d) 0 (e) -0.4 (f) -38/7 (g) 0.27 c What is the fifth smallest value in -2/11, 124, 2/19, 2.245, -26, -2/15? 2.245 What is the second smallest value in -0.2, 2392, -0.5, 2/9, 0? -0.2 What is the smallest value in 1/85, -685, 2, -18? -685 Which is the fifth biggest value? (a) 5 (b) 3 (c) 1 (d) 2235 (e) 18 c What is the fourth biggest value in -123610, -9, -3, -0.5? -123610 What is the fifth biggest value in 0.6, -4, 5, 0.01, 3, -249663? -4 Which is the biggest value? (a) 1/7 (b) 4574603 (c) -5/3 b Which is the fourth smallest value? (a) -1162 (b) -12 (c) 3 (d) -1 (e) 8 (f) 0.3 (g) -0.5 g What is the fourth biggest value in -2/11, 0.05738, -0.9, 3/1567, 5? -2/11 What is the second smallest value in 5, 0, 3/4, 134607? 3/4 What is the third biggest value in 8, -1/4, 3, -0.2, -1/9, 12, -46? 3 Which is the third biggest value? (a) -2/13 (b) 53/7 (c) -3/7 (d) 4 (e) -3/8 (f) -143 a Which is the third smallest value? (a) -2/19 (b) 1/3 (c) 0 (d) 84 (e) 4/7 (f) -0.09 c Which is the second biggest value? (a) 10 (b) -1 (c) -115347 (d) -1/5 d What is the smallest value in 3, -3, 3.8, -3554? -3554 What is the biggest value in -1, 7, 1, 0, -13, -0.2? 7 What is the smallest value in -0.5, 0.355, -0.38586? -0.5 What is the biggest value in -1/3, -82, -2/113, -5, -1/15? -2/113 Which is the smallest value? (a) 1/70 (b) 0.6 (c) 89 (d) -0.4 (e) 2/3 (f) -4 f Which is the third biggest value? (a) -752426/9 (b) 5 (c) -0.3 a Which is the fourth smallest value? (a) -70 (b) -4 (c) 0.3 (d) -1/11 (e) 2/11 (f) 96 e Which is the fourth biggest value? (a) -1 (b) 1 (c) 2 (d) 336590/11 a Which is the sixth biggest value? (a) 11 (b) 3 (c) 8 (d) -26/11 (e) -1/7 (f) -83 (g) -0.1 d Which is the second smallest value? (a) 5 (b) 1 (c) 3/22 (d) -11 (e) -0.0204 (f) -0.15 f What is the third smallest value in -2/3, -0.4, 10, 4, -0.1531, 276? -0.1531 What is the biggest value in -0.08, 4, -0.5, -2/7, 0.1, 151.8? 151.8 Which is the second biggest value? (a) -0.0877 (b) -0.6 (c) -143 b What is the fifth smallest value in -0.5, 1/2, -2, 2/9, -4, -1/149932, 2/15? 2/15 What is the fourth biggest value in 2, 1.5, -3.1, 22662, 4? 1.5 What is the seventh biggest value in 0.5, 13, 5, -0.5, 5/119, 0.1, 27? -0.5 Which is the second biggest value? (a) -2280 (b) 2/17 (c) -0.00806 c Which is the fourth biggest value? (a) -2/13 (b) 15 (c) 0 (d) 190/3 (e) -2 (f) 0.5 (g) -1.7 c What is the biggest value in -144, 4/5, 5/61, 5? 5 Which is the fifth biggest value? (a) -28 (b) -5 (c) 0.1 (d) 3/37 (e) 3 a What is the second smallest value in 141, -4/15, 341/74? 341/74 What is the second biggest value in 5, 0.3, -0.1, -17/134, 1, 3/5, -0.5? 1 What is the fourth biggest value in 2, -72, 2/7, 4/9, 0, 79, -3/7? 2/7 What is the sixth biggest value in -1.3, 10, 0.1, 5, -2/19, 4/11? -1.3 What is the fourth biggest value in 3/5, -18/13, -3, 66, 3, 0, -3/4? 0 Which is the second smallest value? (a) -3/28 (b) -146 (c) -0.2 (d) 36.9 (e) 2 (f) 1 c Which is the second smallest value? (a) 3 (b) 0.3 (c) -5 (d) -1583 (e) 2.3 c What is the third biggest value in -1, -0.5, -2, -2/15, -2/3, -8, 212? -0.5 Which is the biggest value? (a) 4935 (b) -3 (c) 612.64 a What is the third smallest value in -5/2, 5, -0.4, 0.1, -3/5, -5, -1534? -5/2 Which is the fourth biggest value? (a) 4 (b) 5 (c) 49 (d) 2/3 (e) -28968 d Which is the smallest value? (a) -2 (b) 0 (c) -49 (d) 7/1231 (e) 0.4 (f) -0.2 c What is the sixth smallest value in 3, -4/7, 1765, 5, 16, -34? 1765 Which is the sixth smallest value? (a) -72 (b) -2 (c) 2/9 (d) 0.3 (e) -3/11 (f) -1/2 (g) -11/4 c What is the second biggest value in 2, -243, -3, -1, 0.1, 16/65? 16/65 What is the second biggest value in -3, 5/3, 2/9, 1940266, 0.1? 5/3 Which is the sixth smallest value? (a) 4 (b) 2/11 (c) -2/9 (d) 1 (e) -1 (f) -0.4 (g) -24 d Which is the third biggest value? (a) 2/15 (b) 951 (c) -1.273 (d) -2 c What is the smallest value in 2/13, 2.033, -7, -825? -825 Which is the fourth biggest value? (a) 23 (b) -13352 (c) 4 (d) 1/2 b Which is the third biggest value? (a) 14 (b) -0.03892 (c) -17 c What is the smallest value in -9, 42.1, 14, -1.4? -9 Which is the smallest value? (a) -0.1 (b) 31 (c) 127669 a Which is the third biggest value? (a) 445005 (b) 4/5 (c) 20 b What is the smallest value in 2, 2832, 6, 121/3? 2 What is the third biggest value in 23306, 2/15, -0.5, 2/5, 3, -4? 2/5 What is the sixth smallest value in -3, 548, -1/2, -263, -3/4, 4, 0? 4 Which is the fifth smallest value? (a) -0.3 (b) -2 (c) -1 (d) -3 (e) -1/10 (f) 3.12 e What is the biggest value in 6, 60/13, -275, -106? 6 Which is the fifth smallest value? (a) 0.5 (b) -21 (c) -3 (d) -0.2 (e) 488 (f) -8 a What is the fifth biggest value in -0.34, -392, -1, -1/22, 5, -1/2? -1 Which is the second smallest value? (a) -0.5 (b) 587 (c) 0.6 (d) -4.51 a Which is the seventh biggest value? (a) 3 (b) 10 (c) 0.2 (d) 0 (e) 2/3 (f) 0.711 (g) 3/4 d Which is the second smallest value? (a) 4/37 (b) -719 (c) -1337 (d) 2 b Which is the fifth biggest value? (a) 3/5 (b) -2/7 (c) -0.4 (d) 2366 (e) -3/5 (f) 12 c Which is the second smallest value? (a) -164 (b) 2 (c) -2059 a What is the third biggest value in 0.04, 17585, 3, -0.4, -1, -2? 0.04 Which is the biggest value? (a) -1014 (b) -5 (c) 16 (d) -2 (e) -0.5 c What is the fourth smallest value in 5, 52, -1, 0, 1/2186? 5 What is the third biggest value in 149, -2, 0.013, -4, -3? -2 Which is the second smallest value? (a) 2 (b) -2/439541 (c) 0.28 c Which is the second biggest value? (a) 0.3 (b) -10/13 (c) 2/3 (d) 3467 (e) 9 e Which is the fifth biggest value? (a) 0.55 (b) 1.26 (c) 1 (d) -3 (e) 22 d Which is the sixth biggest value? (a) -2/7 (b) 0.4 (c) 1881.39 (d) -1 (e) 5 (f) 1/3 d What is the third biggest value in -0.02, -318/431, 3? -318/431 What is the fourth smallest value in -5, 5, 1/12, -0.12, 4/15? 4/15 Which is the fourth smallest value? (a) -3 (b) 23 (c) 0.4 (d) 15/17162 b Which is the second smallest value? (a) -734 (b) -113 (c) -5 (d) 1593 b What is the sixth smallest value in 0, -1/5, 391, 2/19, -4, -38, -0.1? 2/19 What is the second smallest value in 166, 7.215, 3? 7.215 Which is the fifth biggest value? (a) -0.5 (b) 0.4 (c) -0.042 (d) 2/3 (e) 787449 a Which is the smallest value? (a) -59.9 (b) -0.272 (c) 4 (d) 3 (e) 0 (f) 5/2 a What is the fourth smallest value in 0.5, -84667, -1/3, 1/4? 0.5 Which is the smallest value? (a) 0 (b) -23.8 (c) -12 (d) -1/4 (e) -0.09 b Which is the fourth smallest value? (a) -1/5 (b) -2/7 (c) 28.7 (d) -2/9 (e) 1.3 (f) 3.521 e Which is the third biggest value? (a) -5 (b) 19 (c) -2 (d) -0.909 (e) 2/7 (f) -12 d What is the third biggest value in -503, 0.4, -73179, 1? -503 Which is the third biggest value? (a) -0.5 (b) -0.4 (c) 19651/9 (d) -1/4 (e) 0.5 (f) 1/6 f Which is the smallest value? (a) -10/2679 (b) 0 (c) 4/5 (d) -7 d Which is the second smallest value? (a) 195/7 (b) -1/2 (c) 0 (d) 3/7 (e) 317 c Which is the fifth smallest value? (a)	{ "pile_set_name": "DM Mathematics" }
. -(u + 1)(u + 6)/4 Let f = -31101 + 31113. Factor 3 + fu*2 - 57/2u + 27/2u3. 3(u - 1)(u + 2)(9u - 1)/2 Let c(d) be the second derivative of d6/120 - d4/8 + 23d*3/2 - 2d - 45. Let y(i) be the second derivative of c(i). Factor y(f). 3(f - 1)(f + 1) Let s be 10/(36/12). Let r(a) be the first derivative of 18 + 0a*2 + sa - 1/12a3 - 1/20a*5 + 1/8a4. Factor r(p). -p2(p - 1)2/4 Let y(t) be the third derivative of -t5/120 - 181t*4/48 - 15t*3 + 3t*2 - 2t + 49. What is f in y(f) = 0? -180, -1 Let l(w) = -w*2 + 3w + 4. Let y(u) = 3u2 + 75u - 102. Let h(g) = 4l(g) + y(g). Factor h(d). -(d - 86)(d - 1) Suppose 314v + 219 = 1161. Factor 0m - 1/10mv + 0 - 1/10m*4 + 3/5m2. -m2(m - 2)(m + 3)/10 Let s be (-3 - -3)/4-1. Let p be 20/15((-81)/(-6) + s). Factor -3 + pa2 - 24a + 2 + 4 + 5. 2(3a - 2)*2 Let n(q) = 32q*2 - 2048q - 2392. Let h(j) = -3j2 + 195j + 228. Let i(k) = 52h(k) + 5n(k). Factor i(c). 4(c - 26)(c + 1) Factor -2x4 - 120x*3 - 352x*3 + 56112x - 246x3 - 18812x*2 + 140454x - 44538x2. -2x(x - 3)(x + 181)*2 Let i(n) be the second derivative of 0n*3 + 0 - 23n - 1/3n2 + 1/18n4. Determine m, given that i(m) = 0. -1, 1 Let t(b) = 5 + 2 + 5 + b2 + 5b. Let w be t(-5). Find l, given that -wl + 5l - 2l2 - l = 0. -4, 0 Let b(t) be the third derivative of t5/180 - 5t4/36 - 352t*3/9 - 8t*2 - 10t - 2. Factor b(o). (o - 32)(o + 22)/3 Let j(v) be the second derivative of v6/30 + v5/20 - 7v*4/2 - 39v - 55. Factor j(x). x*2(x - 6)(x + 7) Let b(u) be the first derivative of -71u*4/24 - 4u*3 + 47u*2/4 + u/3 - 594. Factor b(i). -(i - 1)(i + 2)(71i + 1)/6 Suppose -2j = -4j + 122. Let v = -28 + j. Find n such that 42n4 - 18n - 2n5 - 21n2 - n5 + 10n3 - vn4 - n3 = 0. -1, 0, 2, 3 Factor 1286/7z + 1280z*2 + 46/7 - 56z*3. -2(z - 23)(14z + 1)*2/7 Let v(g) be the second derivative of -1/294g*7 - 11/70g*6 - 64/21g*4 + 8 - 72/35g*5 + 3g + 0g2 + 0g*3. Determine a so that v(a) = 0. -16, -1, 0 Let k = -1097 - -1102. Suppose 2n + 90a = 94a - 8, 4n - ka + 7 = 0. Factor 432/5 - 72/5x + 3/5x*n. 3(x - 12)2/5 Let o(v) be the first derivative of v5/35 - v*4/4 - 83v*3/21 - 201v*2/14 - 18v + 3904. Factor o(b). (b - 14)(b + 1)(b + 3)*2/7 What is c in 9493c - 4676c - 4498c + 83c2 + c3 + 237 = 0? -79, -3, -1 Let w be 6/(-4)(60/(-9) - -6). Let r be (-34)/(-8) + 6/(-2) - w. Let rq + 3/4q*3 + 0 + 1/4q*4 + 3/4q*2 = 0. What is q? -1, 0 Let l(r) be the first derivative of 5r*4/8 + 737r*3/6 + 256r*2 + 146r + 8664. Find u, given that l(u) = 0. -146, -1, -2/5 Let g be ((-1)/2)/(13/(-286)). Let f = -7 + g. Determine w so that -4w + 3w*3 - w + 3 + 9w*2 + fw + 10w = 0. -1 Factor -a4 + 3a*4 - 127327a - 66857a + 392a*3 + 27720a + 17544a2. 2a(a - 8)(a + 102)*2 Factor -1480/3c + 2/3c2 + 1478/3. 2(c - 739)(c - 1)/3 Factor 2/11r*3 + 0r*2 - 4/11 - 6/11r. 2(r - 2)(r + 1)*2/11 Let m(p) be the first derivative of -39/2p - 81/4p2 - 15/2p*3 - 3/8p*4 - 227. Factor m(d). -3(d + 1)*2(d + 13)/2 Let r(z) = -188z3 - 5692z*2 + 2140z + 28. Let p(v) = -36v3 - 1035v*2 + 389v + 5. Let w(c) = -28p(c) + 5r(c). Determine m so that w(m) = 0. -8, 0, 6/17 Suppose 2w - 3n = -4, -3n + 18 + 10 = 4w. Let v be (2 - (w - 5)) + 2. Factor -82z3 - z4 + 3z*v + 4z*4 + 82z*3. 3z*4(z + 1) Solve -156 - 8734c - 166c*2 + 2c*2 + 8418c - 4c3 = 0 for c. -39, -1 Let i(v) = -2v*3 + 61v*2 - 81v + 1532. Let l be i(30). Suppose -58/9w4 + 2000/9w + 0 - 60w3 - 2/9w*5 - 1400/9w*l = 0. Calculate w. -10, 0, 1 Suppose -2x + 0x + 658 = -4b, 3x - 9 = 0. Let a = -127 - b. Factor 363/4u*4 + 3u + 0 + 495/4u3 + au*2. 3u(u + 1)(11u + 2)2/4 Let m(v) be the second derivative of 3v*4/20 + 13v*3/15 - 3521v. Factor m(t). t(9t + 26)/5 Let u = 538 - -170. Let l = -694 + u. Solve 32/7 + lz2 + 16z = 0 for z. -4/7 Let c be ((-99)/(-55) + -8)(-6)/(-2). Let s = c + 563/30. Determine r so that 0r*2 + s - 1/6r*4 + 1/3r*3 - 1/3r = 0. -1, 1 Let w(c) be the second derivative of -5c7/42 - 35c*6/2 - 3675c*5/4 - 214375c*4/12 + 386c - 3. Factor w(v). -5v2(v + 35)3 Let c(k) be the third derivative of -k5/150 - 8k4/15 - 31k3/15 + k2 + 520. Determine g, given that c(g) = 0. -31, -1 Let l(c) = 10c2 + 12c - 1. Let h(y) = 0y3 - 4y*3 + 2y*3 + 1. Let w(z) = -2h(z) - 2l(z). Factor w(d). 4d(d - 6)(d + 1) Let p(z) be the first derivative of 4z5/35 - 12z*4/7 + 20z*3/3 - 471. Find m such that p(m) = 0. 0, 5, 7 Suppose 274l - 7414 = -6592. Solve -4/3 + 46/9f - 68/9f*2 + 2/9f*5 + 16/3f*l - 16/9f*4 = 0. 1, 2, 3 Let l = 20227 - 80895/4. Factor 0 - 1/4i*2 - li. -i(i + 13)/4 Let y(h) be the second derivative of -h7/14 - 4h*6/5 - 21h*5/20 + 9h*4 + 18h*3 - 8052h. Determine l, given that y(l) = 0. -6, -3, -1, 0, 2 Let u(n) be the first derivative of 1/13n2 - 1/26n*4 - 37 + 6/13n - 2/13n3. Factor u(k). -2(k - 1)(k + 1)(k + 3)/13 Let i(b) be the first derivative of -2b3/9 - b2/3 + 2387. Suppose i(x) = 0. What is x? -1, 0 Let z(m) be the first derivative of -m4/10 + 278m*3/15 - 544m*2/5 + 216m + 237. Determine u so that z(u) = 0. 2, 135 Suppose m + 2n + 10 = -0m, -5m = n + 5. Let s be (m + -2)(-15)/10. Factor 27j - 25j + 0j4 + 5j*4 + 5j2 - j4 - 11js. j(j - 2)(j - 1)(4j + 1) Let b be (-616)/(-7546)42/4. Factor 0 - bi2 + 4/7i + 2/7i3. 2i(i - 2)(i - 1)/7 Suppose 1816/9x - 140/9 + 52/9x2 = 0. What is x? -35, 1/13 Let l(r) be the first derivative of -r5/20 - r*4/2 - 11r*3/6 - 3r*2 - 9r/4 + 9511. Suppose l(k) = 0. What is k? -3, -1 Let h(j) = 3j2 - 25j + 15. Let c be h(8). Suppose 3f - 4 = -4l, c - 5 = 2l. What is r in -5/4r*3 + 0r*2 + 0r + f + 5/4r4 = 0? 0, 1 Let x(i) = i2 + 2i - 6. Let b(j) = 61j2 - 1801j - 102. Let n(k) = -b(k) + 6x(k). Factor n(y). -(y - 33)(55y + 2) Let r(f) be the first derivative of -2f*3/21 + 19f*2/7 - 156f/7 + 808. Solve r(w) = 0 for w. 6, 13 Let m(t) be the third derivative of 1/10t4 - 4t*2 + 0t*6 + 0 + 0t*3 - t - 7/150t*5 + 1/525t*7. Factor m(l). 2l(l - 2)(l - 1)(l + 3)/5 Let n(x) be the second derivative of -x7/21 - 2x*6/3 - 6x*5/5 + 17x*4/3 + 13x*3/3 - 24x*2 + 911x. Solve n(m) = 0. -8, -3, -1, 1 Let o(b) be the third derivative of 3b5/5 - 53b*4/3 + 150b*3 + 399b*2 + 15. Determine m so that o(m) = 0. 25/9, 9 Let l(q) = 3q*2 - 39q + 70. Let u(g) = -21g2 + 273g - 489. Let z = 453 + -426. Let m(h) = zl(h) + 4u(h). Factor m(b). -3(b - 11)(b - 2) Let a be ((-1)/(-3)-4)/(4/(-6)). Suppose ad = -c + 21, -3d - d - 3 = -c. Factor 0 + 0 - c - 6u + 3u2 + 6. 3(u - 3)(u + 1) Suppose -8y = -9y + 3. Suppose -2s - yl = 3, 15 - 2 = -2s - 5l. Determine m, given that 0m3 - m3 + 4 + 6m3 - 3m*2 - sm*3 = 0. -2, 1 Let y(d) = -18d*4 - 37d*3 + 115d*2 - 54d - 10. Let g(l) = l4 + l3 + 2. Let s(r) = g(r) + y(r). Factor s(p). -(p - 1)*2(p + 4)(17p + 2) Let i(w) be the first derivative of 3w5/5 + 30w*4 + 182w*3 + 372w*2 + 315w - 2400. Let i(v) = 0. Calculate v. -35, -3, -1 Let p(h) = -2h - 1. Let z(q) = -3q*2 + 582q + 3. Let c(l) = 3p(l) + z(l). Let c(n) = 0. What is n? 0, 192 Suppose -2y - 2o = -10, y = -7o + 5o + 4. Determine q so that 7q*2 + 9 - 9q*2 + y + 20q + 7q2 = 0. -3, -1 Let b = -6227 + 6246. Let c(f) be the second derivative of 1/4f*4 - 6f*2 + 3/20f*5 - bf + 0 - 2f3. Solve c(m) = 0 for m. -2, -1, 2 Let l be (-12(-16)/(-864))/((-24)/81). Factor 0 + li - 1/4i*2. -i(i - 3)/4 Let l(r) = -2r2 + 134r + 142. Let i(g) = 8g2 - 670g - 711. Let f(p) = -2i(p) - 11l(p). Suppose f(a) = 0. What is a? -1, 70/3 Let h be 17/34 - (-96)/64. Factor 15b + 3/2b*h + 24. 3(b + 2)(b + 8)/2 Let r = 293 + -290. Determine m so that -m3 + 567m*2 + 4418m - 755m2 + rm*3 = 0. 0, 47 Solve 3470d*2 - 74d*4 - 14d*4 + 2d*5 + 176d*3 - 92d*4 - 3290d*2 - 178d = 0. -1, 0, 1, 89 Let p be 13 + 0 + -6 + 8. Determine u so that -2u -	{ "pile_set_name": "DM Mathematics" }
and give x. 71 Express (-11 - 2 + 1 + 4h)(23h + 32h + 83h) in the form ch*2 + q + lh and give c. 552 Rearrange 375w2 - 189w*2 + 12427w - 183w2 to mw*2 + s + ow and give o. 12427 Rearrange 1 + 2 - 36402k - 6 + 36383k - 10 to the form gk + j and give j. -13 Rearrange 2373x*4 - 2x*2 + 2 + 2x - 2x + 3x*2 - 2x*3 - 2376x*4 to jx*4 + yx + qx3 + ux*2 + i and give q. -2 Rearrange 69 + 187f*2 + 194f*2 - 367f*2 to t + jf*2 + wf and give j. 14 Rearrange (4w - 4w + 2w)(-24 + 23 + 18) + (-9w + 0w + 2w)(2 - 1 + 1) - w + 3w + 3w to lw + a and give l. 25 Express (-2c - 2c + 0c)(-c - c + 0c) + 2c2 - c2 + c2 + 2c - 62 + 3c2 - 64 + 124 in the form oc*2 + r + jc and give o. 13 Rearrange 467u3 + 556u*3 + 7290 - 7289 to qu + h + iu2 + bu*3 and give h. 1 Rearrange -19h*2 + 39h*2 - 5 + 10h*3 - 19h*2 + 16h*3 to y + qh + th3 + mh*2 and give t. 26 Rearrange (-1 - 2 + 1)(2595v - 23 + 2634v - 5270v)(3v - 5v + 2 - 3v) to the form av*2 + ov + y and give a. -410 Express -1 + 1 + 3a + (-2 + 2 + 2)(0 - a + 0) - 285a + 96a + 87a as la + m and give l. -101 Express 1443l - 6l*2 - 7 - 2850l + 1567l + 3l*2 in the form ul*2 + y + jl and give y. -7 Rearrange -85j2 + 3j*3 + 32j*2 + 27j*2 + 19j*2 + 2j - 6j3 - 4j*4 - 1 to ij*4 + lj + fj3 + y + xj*2 and give f. -3 Rearrange 6 + 47p - 15p + 4 + p2 - 26p - 12p to the form bp*2 + d + mp and give m. -6 Express (19q2 + 2q*2 + 4q*2)(-2 + 9 - 2 + 0 - 3 - 4 + 3 + 2 - 6 + (0 - 2 + 1)(-1 - 4 + 6)) in the form f + aq + iq2 and give i. -100 Rearrange (-6 + 6 + 3r)(9 + 15 - 3)(-3r2 + 0r2 + r2) - r2 - r2 - 8411r3 + 8413r*3 - 48 to n + hr + ur2 + tr3 and give t. -124 Rearrange y4 + 41y3 - 10y*3 - 42 - 14y*3 - 3y*2 - 11y*3 + y to the form vy*2 + ny*4 + my*3 + xy + l and give n. 1 Rearrange 2468 + 3l2 - l4 - 3l*3 - 2438 - 8l*2 + 4l*3 + 2l to the form bl4 + sl*3 + il + ul2 + r and give b. -1 Express (447u*2 - 5u*3 - 447u*2)(2u - 5u - 2u)(0 + 2 - 3)(12 - 27 - 3) as ou + wu3 + lu*4 + v + ku*2 and give l. 450 Rearrange -103u*3 + 3u*2 + 218u*3 - 16u*2 + 7u - 110u3 - 31u to the form ru + du*3 + t + cu*2 and give r. -24 Rearrange 596l*3 - 459l*3 + 266l3 + l2 + 0l2 + 3 to the form q + wl*2 + pl*3 + vl and give p. 403 Express -201a + 184 - 2a*3 + 7a*2 - 8a*2 + 11a - 183 in the form wa3 + c + na + ja2 and give c. 1 Rearrange -18f*4 - 9f*2 + 4f*4 + 12f*4 + 2 - 9f*2 - 73f + 19f2 to the form m + cf*3 + af*2 + uf + jf4 and give j. -2 Express -72r - 12r - 18r - 244r2 - 3r*3 - 11r + 111r in the form lr + jr3 + br*2 + p and give j. -3 Express 1 + 1344759r*2 + 1644r*3 - 1344759r*2 in the form or*3 + sr*2 + ar + m and give m. 1 Rearrange (9s - 3s*3 - 9s)(4s + 3s + 9s)(8 - 14 + 1) to the form hs*2 + us*4 + x + ls + ts3 and give u. 240 Express 0 + 21w*3 - 2w*2 + 2 + 11w + 42w3 + 24w*3 - 55w*3 as uw*2 + aw*3 + jw + m and give a. 32 Express (-447r - 28r - 46r)(1 - 1 + 2)(-4 - 3 + 3) in the form lr + t and give l. 4168 Express (-94y + 1166 - 1166)(7 - 9 + 20)(-3 + 5 - 3) as gy + n and give g. 1692 Rearrange -30 + 16h - 32 + 34h - 15h + 52 to the form dh + a and give d. 35 Express (54446h3 + 94h*4 - 54446h*3)(0 + 1 + 1) + (-1 + 1 + 2)(8h - 2h - 7h + 88h4) as nh*2 + lh*4 + vh + ah3 + o and give l. 364 Express -2y + 401 - 13y3 + 0y2 - y3 + 0y2 as hy*3 + m + wy*2 + by and give m. 401 Rearrange 4987v - 2300v + 2777v + 2071v to tv + b and give b. 0 Express -8n*2 - 25n*3 - 13n*2 - 2n + 16n2 - 17n*4 + 18n*4 as h + vn + rn4 + pn*2 + zn*3 and give z. -25 Express 127 - 190 + 101 - 102x in the form d + jx and give d. 38 Express -45o3 - o3 + 46o3 + 14242o*4 + 1441o*4 + (-5 + 6 + 0)(-8o4 - 12o + 12o) as lo*4 + to + do3 + ro*2 + j and give l. 15675 Rearrange (-1741 + 645 - 184 + 36 - 1351)(-5b - 2 + 2) to gb + q and give g. 12975 Rearrange (-20r2 - 88r*2 + 0r*2)(0r - 2r - 4r)(5 + 1 + 5) to wr3 + sr*2 + zr + a and give w. 7128 Rearrange (7 - 7 + 2r)(288 - 601 + 289 + 29r2) to the form jr + tr3 + q + wr*2 and give t. 58 Express (-10 + 1 - 7 + (-2 + 0 + 3)(2 + 0 + 0))((3f - 4f - f)(4 - 5 + 0) + 5f - 9 + 9 + f + 2f - 2f) as nf + a and give n. -112 Express (-84r + 18r + 28r)(-15 - 39 + 5)(-1 + 0 - 4r + 3) in the form qr2 + j + yr and give q. -7448 Express (11873z + 6879184 - 6879184)(-2z3 + 0z3 + z3) + (z - z + z*3)(-z + 0z + 4z) in the form mz2 + j + dz*3 + nz*4 + sz and give n. -11870 Rearrange (g4 + g4 + 0g4)(-3 + 6 - 4) + 885g4 - 57g*3 + 51g*3 + 6g*3 to bg*4 + og*2 + zg + r + sg3 and give b. 883 Rearrange -m + 3m - m + (-59 - 30m + 59)(1 + 2 - 1)(1 + 1 - 1) + (-3 + 5 + 0)(79 - 13 - 199)(2m + 3m - 3m) to j + am and give a. -591 Rearrange (-585 - 646 + 107)(-4 + b + 4) to y + ub and give u. -1124 Rearrange -6q - 56q2 + 3q + 3 - 949183q3 + 949179q*3 to the form t + pq*2 + lq*3 + nq and give n. -3 Express ((35 - 75 + 22)(2 - 10 - 1) - 5 + 0 + 1)(10l + 6l - 24l) as f + bl and give b. -1264 Express 1 + 94q3 + 14q*3 - 2q - 2q2 - 134q*4 - 107q*3 as s + oq*4 + aq*2 + hq*3 + tq and give s. 1 Express (57r + 51r*2 - 57r)(5 + 2 - 2)(-6 - 6 + 3)(3 - 3 + 1) in the form yr + br2 + l and give b. -2295 Rearrange (4z + 3624 - 6z + 1801426567z*2 - 1801426572z*2)(-1 - 4 + 6) to the form qz2 + uz + d and give q. -5 Rearrange 2r3 - 1244r*4 + 2503r4 + r2 + 15 - 1257r4 to the form nr*3 + yr + f + ir4 + or*2 and give f. 15 Express -9 + 8 - 72b + 4 + 10 as k + vb and give v. -72 Express 218g*2 + 19g - 89g2 - 127g*2 - 2 + 15 + 15 in the form wg*2 + sg + q and give s. 19 Express (32p2 - 29p*2 - 18p*2)(8p - 14p + 25p) - 4p*3 + 3p*3 + 3p*3 - 14 as h + vp*3 + rp + zp2 and give v. -283 Express -28 - 2l + 36l2 + 30l*2 - 77l*2 + 5l in the form dl + b + sl*2 and give s. -11 Rearrange -101 + 106 - 110c - 110 + 55c to xc + r and give r. -105 Express -4r - 8r + 24 + 22 - r*2 - 18 + 0r*2 as pr*2 + d + wr and give d. 28 Rearrange -705x + 76 - 662x + 1995x - 684x to px + z and give p. -56 Express (-10 - 35 + 9 + t)(1 + 2t - 1) + (-t + 2t - 4t)(14t + 6t - t) in the form nt + mt*2 + l and give l. 0 Express -8f - 985 - 227f + 983 as wf + c and give c. -2 Express -2t2 + 2436t - 2437t + 2t*2 - 3t*2 + 4547 as bt*2 + u + vt and give b. -3 Express ((2 - o - 2)(-5o - 5o + 3o) + 5o2 - o2 - 5o*2)(246 - 630 - 261 - 358) as io2 + to + q and give i. -6018 Rearrange (3 - 3 - 2)(3 - 4 - 1)(764 - 308 + 78698q + 7754q - 456) to o + uq and give u. 345808 Express -3 + h + 3h + 2h - 6h - h + 376h2 as oh*2 + jh + r and give o. 376 Express -1044g4 - 27g*2 + 6 + 1056g*4 - g + 29g*2 as kg + tg2 + f + jg*3 + ng*4 and give t. 2 Rearrange 2508z - 2z2 - 108z + 384z to cz + q + rz2 and give r. -2 Rearrange (-17w*2 - 14w*2 - 5w*2)(-3 - 3 + 4)(1 - 1 - 1) + (w2 + 0w*2 - 2w*2)(0 + 2 - 27) to ow + lw*2 + v and give v. 0 Express 5q + 21q2 - 33q - 53q2 - 2 - 33q as r + dq + lq*2 and give l. -32 Rearrange -31j*2 + 162j*2 + 5 - 25j*2 - 5j - 42j2 to the form k + aj + sj2 and give k. 5 Rearrange 697n + 1139n + 368n - 83n to cn + f and give c. 2121 Rearrange (-100r - 250r + 474r)(-19r - 14r + 6 + 35r) to the form c + ar*2 + dr and give a. 248 Rearrange 129972 - 64984 - 3704d - 64988 to the form td + r and give t. -3704 Express -46m + 352m*2 - 720m*2 + 370m*2 - 16m*3 + 1 as fm + bm3 + a + sm*2 and give b. -16 Rearrange -14z + 33z - 8525z*3 + 7 + 8507z*3 - 5 + 30z + 2z2 to the form n + dz*2 + gz*3 + oz and give g. -18 Express -3w2 - 167w - 41w - 665w - 630w as tw + vw2 + x and give v. -3 Rearrange -1657g + 539g - 1345g - 479g - 1431	{ "pile_set_name": "DM Mathematics" }
5547dt + 130145d wrt t. -75547d Find the third derivative of -3d5 - 7823d*4 - 9d*2 - 1569. -180d*2 - 187752d Differentiate -7378c3t - c3 - c2 - 2ct - c + 8t - 146209 with respect to t. -7378c*3 - 2c + 8 What is the second derivative of -237174n4 - 27n - 3993? -2846088n2 Find the second derivative of k4 - 298593k*2 + 3967087k - 2. 12k2 - 597186 Find the third derivative of -b6 - b4n + 1780b3 - 7b*2n + 137b2 - 22n wrt b. -120b3 - 24bn + 10680 Find the first derivative of 628095l*3 + 1457090. 1884285l*2 Differentiate -2xy - 141743x - 2894y - 16 wrt x. -2y - 141743 Find the second derivative of 1118827b3 + 1831662b wrt b. 6712962b What is the third derivative of 350466d*2y*3 - 631d*2y - 2d2 - dy + 2y2 wrt y? 2102796d*2 Find the third derivative of 51z*5 - 2587z*3 - 134327z*2 - 4z wrt z. 3060z2 - 15522 What is the first derivative of 579955j*2 + 1112301 wrt j? 1159910j What is the third derivative of -7032u4 - 134u*3 - 29u*2 - 4990u + 2 wrt u? -168768u - 804 What is the third derivative of 56092l*3p*3 - 2l*3p*2 - 460l3 + l2 + 4lp*3 + 6lp2 + 12 wrt p? 336552l*3 + 24l What is the derivative of -g*4 - 1104113g + 109748 wrt g? -4g3 - 1104113 What is the third derivative of 2991o*4 - 49719o*2 wrt o? 71784o What is the third derivative of 751916w4 + w3 - 114w*2 - 3w + 794 wrt w? 18045984w + 6 Find the second derivative of 4y*3 + 756y*2 - 2914y - 5 wrt y. 24y + 1512 Find the second derivative of -348446y*2 - 788281y wrt y. -696892 What is the second derivative of b*3i*3w - 17b3iw + 2b*3i - 2b2i*2w + 2b2w - 4172bi*2 - 8biw wrt i? 6b3iw - 4b*2w - 8344b Differentiate 435n*4 - 14n*3 - 9n - 578573 with respect to n. 1740n3 - 42n*2 - 9 Find the first derivative of -34151y*3 + 37689. -102453y*2 Differentiate -6532jy3 - 4jy2 + 5jy + 2j + 771y3 - 31y + 6 wrt j. -6532y3 - 4y*2 + 5y + 2 What is the third derivative of 2n3o - 1229850n3 + 3024n*2 - 58no wrt n? 12o - 7379100 Find the first derivative of 6688dk + 8d - 4k + 3543 wrt k. 6688d - 4 Differentiate 2ns2 + 3226267n - 217302s2 - 8 wrt n. 2s*2 + 3226267 Find the second derivative of -6a*3 + 11783a*2m*2 + 6047a - 3m2 wrt a. -36a + 23566m2 What is the first derivative of -2g*3j + 86149g3 - 47487g*2j + gj wrt j? -2g*3 - 47487g*2 + g What is the third derivative of 591024g*3 + 548g*2 - 15g + 2? 3546144 Find the first derivative of 49278ru - 30079r + 2 wrt u. 49278r Find the second derivative of -143268d3 + 159773d. -859608d Find the first derivative of 28j*4 - 14060j*2 + 1776618. 112j*3 - 28120j Find the third derivative of 1257407i5y*2 - 52214i*2y*2 - 3i - y*2 wrt i. 75444420i*2y*2 Find the third derivative of -4n*4 - 20832n*3 - 2084n*2 - 30. -96n - 124992 Differentiate -19b4 + 1255b*3 + 122611. -76b*3 + 3765b2 Differentiate -m2z - 76349m*2 - 151214z wrt z. -m*2 - 151214 What is the derivative of 61z*4 + 52z*3 - 3z*2 + 261073? 244z*3 + 156z*2 - 6z What is the derivative of -242946o + 940611? -242946 What is the second derivative of -1074145v*3 + 816187v wrt v? -6444870v Differentiate 201383j*3n4 + j3n3 + 4j*3 + 156j*2 + 61j with respect to n. 805532j3n*3 + 3j*3n*2 Find the second derivative of -697581m*2 - 4369172m wrt m. -1395162 What is the third derivative of 3i3j*2 - 102985i*3jo3 + 21i*2jo3 + 2503io3 + 3j*2o*2 wrt i? 18j*2 - 617910jo3 Find the third derivative of 108s*3z*3 - 2s*3z + sz3 - 27z*3 - 60065z*2 wrt z. 648s*3 + 6s - 162 What is the derivative of -157840q - 60189 wrt q? -157840 Find the third derivative of -10r*5 + 294r*4 - 40r*3 - 1959965r*2. -600r*2 + 7056r - 240 Differentiate -198053y3 - 29374. -594159y*2 Differentiate 769615pq - q - 76207 wrt p. 769615q Find the second derivative of z*5 - 197741z4 + z3 + 1398z + 89. 20z*3 - 2372892z*2 + 6z What is the second derivative of -q4 + q3 + 14973q2 + 15927q? -12q2 + 6q + 29946 Find the second derivative of 182880a2k*5 + 2a*2k*2 + 27a*2k + 2a2 + 509a + 2k - 1 wrt k. 3657600a*2k*3 + 4a*2 Find the first derivative of 14462h*2 - 2hs2 - 19067s*2 wrt h. 28924h - 2s2 What is the derivative of -31576x - 17945? -31576 What is the derivative of -503c3nz - 12c*3z - 650c3 - 2c*2n + cnz wrt z? -503c3n - 12c3 + cn What is the third derivative of -5j6 - 8818j*3 - 91985j*2 - j? -600j*3 - 52908 What is the third derivative of -441b*6c*3 - 481b*6 + 100b*2c*3 - 2b*2c*2 + 3933bc wrt b? -52920b*3c*3 - 57720b*3 Find the second derivative of -2cs3t*2 + 3cs2t + 13178s3t*2 + 35981s*3t - 4st*2 wrt t. -4cs3 + 26356s*3 - 8s Find the third derivative of c*4 + 32045c*3o*2 - 48c*2 - 56co2 wrt c. 24c + 192270o2 What is the derivative of 3bi3s - 42bi*2sv + bisv + 2i3sv + 13389isv wrt b? 3i3s - 42i2sv + isv Find the second derivative of -141121r*4 + 57899r. -1693452r2 What is the third derivative of -3km4x + 34kmx + 3032m*4x + 2m4 - 351m*2x + 2m2 wrt m? -72kmx + 72768mx + 48m What is the first derivative of -27593d + 221064 wrt d? -27593 What is the third derivative of 374897d2r*3 + 2d*2 + 3dr2 - 3d + r - 72 wrt r? 2249382d2 What is the third derivative of 3559123v*5 - 12v*2 - 2v - 7445? 213547380v2 Find the second derivative of -928764d*2fh2 - 6dfh*2 - 1253dfh - fh2 - 8h*2 wrt d. -1857528fh2 Find the first derivative of -51p*2 - 112p + 15486. -102p - 112 What is the third derivative of 106330l*6 - 2l*3 + 75l*2 + 357l? 12759600l3 - 12 Find the second derivative of -61x*3 + 29x*2 - 341514x wrt x. -366x + 58 What is the second derivative of -974665j*2t + 2jt - 183j + t + 242 wrt j? -1949330t Find the first derivative of 100109ad - 643522a wrt d. 100109a What is the third derivative of -4311109s3 - 733737s*2 + s? -25866654 What is the third derivative of 2290hs6 + 2hs4 + 2hsz + 3s3z + 1800s2z - 1 wrt s? 274800hs*3 + 48hs + 18z Find the second derivative of -3h3j*2 - 33h*3 + 2214h*2j + 325hj - 4753j2 wrt h. -18hj2 - 198h + 4428j What is the third derivative of 2do2q*3 + 216do2q*2 + 2dq3 - 8dq2 - 547o*3q*3 - 2o*3 wrt q? 12do2 + 12d - 3282o3 What is the second derivative of 25630m*2 - 25m + 12? 51260 What is the second derivative of -43723v2 + 8v - 1482 wrt v? -87446 Find the second derivative of -2344o5 - o4 + 45o*3 + 5221573o wrt o. -46880o3 - 12o*2 + 270o Find the second derivative of -80aq*3 - 1161aq2 - 3aq - q3 - 2q*2 + 85242 wrt q. -480aq - 2322a - 6q - 4 What is the derivative of -171622x*2 - 44935 wrt x? -343244x What is the derivative of -61c2 - 107c + 6056? -122c - 107 Find the second derivative of 730531c*2 - 191930c wrt c. 1461062 Differentiate 410828n4 + 2n*2 - 5039165. 1643312n*3 + 4n Find the second derivative of 55562y2 - 59830y wrt y. 111124 What is the third derivative of -81k4p*3 - 610k*4 - 6k*2 + kp*3 + 2p*2 wrt k? -1944kp3 - 14640k Find the second derivative of 41555g2 - 22665g + 1 wrt g. 83110 Differentiate 123497s + 120533 with respect to s. 123497 Differentiate 6259b*4 + 52149. 25036b*3 What is the derivative of 2c*2h*2 + 2c*2h - 95691c2 + 5135ch2 wrt h? 4c*2h + 2c2 + 10270ch Find the second derivative of -38969g*2h*2 - 4g*2h + 86526g2 + 10gh2 - 2h*2 wrt h. -77938g*2 + 20g - 4 What is the derivative of -311464d2j + 1083620j wrt d? -622928dj Differentiate 770768w*4 + 3165510 wrt w. 3083072w*3 Differentiate -5z*3 - 1945z*2 + 67398 with respect to z. -15z*2 - 3890z What is the first derivative of -38iy - iz2 + 32iz - 246yz2 - z2 - 3z - 76 wrt i? -38y - z2 + 32z Find the second	{ "pile_set_name": "DM Mathematics" }
v*6v/(v/(v/v*(-2/5)))(v*(1/4)v)22)(2/13) assuming v is positive. v*(359/65) Simplify ((ii/((((i/i*(-12))/ii)/i)/ii))/i)/(i(-7/3)i)(i11i)/(i/(ii/(i(i/((i*(-4)i)/i))/ii))) assuming i is positive. i(-8/3) Simplify (uu*(-2/17))/((uu*(-5/9))/uu)u/(u/u(-6))u((u/(u(u*(-15)/uu)/u))/u)/u assuming u is positive. u(1444/153) Simplify (r(-1/3)r)(-5/4)(rrr*(-2/7)r)(1/3) assuming r is positive. r(1/14) Simplify ((s*(-8)s)(38/3))(-1/11) assuming s is positive. s(266/33) Simplify (t/t(-7)tt*4tt(t/(tttt0))(3/13))(-3/4) assuming t is positive. t(-567/52) Simplify ((m(-2/9))(-12)(m(-1))(-32))19 assuming m is positive. m(1976/3) Simplify (ss/s(1/3)s)*(-11/3)/(ss/s(-1/15))(-12) assuming s is positive. s(676/45) Simplify (y(-2/5)/y)4/(y1)(-43) assuming y is positive. y(187/5) Simplify (((yy/y(-3/8))/(yy/(y*(6/11)y)))/(y(-2))(-18))18 assuming y is positive. y(-26991/44) Simplify k*10k*(-11)kkk(1/11)/(k13k) assuming k is positive. k(-142/11) Simplify (r(2/21)r*0r)/(r(-13)/r(-2/31)) assuming r is positive. r(9134/651) Simplify ((u(1/10)/((u*(-6)uu)/u))/((u(2/5)u)/(((u*0u)/u)/u)))(-24) assuming u is positive. u(-324/5) Simplify (jj5j)*6/(j(j/(jj(-15)))/jj(5/9)) assuming j is positive. j(238/9) Simplify (r*1r((rr/(rrrr(3/5)rr))/r)/r(rr(-1/6))(-24))(2/7) assuming r is positive. r(-236/35) Simplify (a/a(-2/5)aa(-3/2)aa(6/7)aa/(aaa9)aa)(-2/53) assuming a is positive. a(297/1855) Simplify (y/(yy*(-5))yy9)/(y/(((y(-1)yy)/y)/y))(-21) assuming y is positive. y57 Simplify (qqq(-2/23))44/(q(-1/7)qqq*4q) assuming q is positive. q(12448/161) Simplify (z5zz)/((z*12/z)/z)(z(-4))(-3/20) assuming z is positive. z(-12/5) Simplify (((z(6/5)z)/z(3/7))/(z1zz)(7/4))(1/13) assuming z is positive. z(-487/1820) Simplify ((o/(o/(o(-3/13)/o)))/o(-2/15))/(o(4/9)/(ooo0)) assuming o is positive. o(268/585) Simplify k33/(((kk*(-3/14))/k)/k)k*(-1/29)k/((kk21)/k)k assuming k is positive. k(6163/406) Simplify y(3/4)yy*(-16)yy(-2/29)y/(y/(y/y(2/13))) assuming y is positive. y(-18809/1508) Simplify ((((w(w/(ww(-1/3)))/w)/w)/w(2/9))/(w*(-3/4)w(-4)))(-13/5) assuming w is positive. w(-1807/180) Simplify (o12o21o)/(o*(-11)oo(-11)) assuming o is positive. o55 Simplify (v(-3/5))(-7/6)/(v(-4))10 assuming v is positive. v(407/10) Simplify ((y(-10)yy(-15))11)(-27) assuming y is positive. y7128 Simplify (m(-2/39)/(mm/(m(-3/13)/m)))/(m18((m/(mm*24mm))/m)/m) assuming m is positive. m(262/39) Simplify (x7)(1/2)(x(x(8/5)x)/xx)(-4/29) assuming x is positive. x(871/290) Simplify (d(1/5)/d)(-1/4)/(d(-16)d16) assuming d is positive. d(1/5) Simplify (u/u*(1/3)u(3/2))/(u(-1/9)/((u(3/10)/u)/u)) assuming u is positive. u(26/45) Simplify (n(-8)/(n(-24)/n))48 assuming n is positive. n816 Simplify (p(-3/7)/(p(3/11)/pp))/((ppp(1/3))/p)(30/7) assuming p is positive. p(-494/77) Simplify (p/(pp4))(-28/3)p11/(pp(1/3)) assuming p is positive. p47 Simplify (vv/v8v)/(((vv(-4/5))/vv)/v)(vv(3/4)/v)/(((v(1/7)/v)/vv)/v) assuming v is positive. v(-223/140) Simplify (ss1/s)(-31)/(s(s(-2)s)/ss)47 assuming s is positive. s(-31) Simplify (xxx(x*20xx)/x((x/((xxx/x(-3))/x))/x)/x)/(x32/(x/x(5/3))) assuming x is positive. x(-44/3) Simplify ((u17/u)(1/4))(-28/5) assuming u is positive. u(-112/5) Simplify (f(1/4))(3/4)/(f*23f*(-33)f) assuming f is positive. f(147/16) Simplify (w(-10)/(w*(2/13)ww)w(3/8)/w6)31 assuming w is positive. w(-57319/104) Simplify ((w*(-1)ww(-2))/(w0)21)(1/23) assuming w is positive. w(-2/23) Simplify (j(-1/3)jj12j)/(((j/((jj(3/5)j)/jj)j)/j)/jj/j(-2/13)j) assuming j is positive. j*(2752/195) Simplify ((oo*(6/11)(oo(o/(o/o*(-4/7)))/ooo)/o)(10/9))29 assuming o is positive. o(66410/693) Simplify o(6/7)/(oo/o*(-3/10)o)o/(o6/oo)(ooo3)/o assuming o is positive. o(-241/70) Simplify ((ooo(7/2))/(oo(oo*28)/ooo))39 assuming o is positive. o(-2067/2) Simplify q26q*25qqqq(-27)q(-7/9) assuming q is positive. q(236/9) Simplify (ll/(l(-12)l))*(-1/7)(l/l(-3/8))/l(-10) assuming l is positive. l(533/56) Simplify d(-2/25)d/(d(-2/25)/d)((dd/(d(d(-11)/d)/d))/d)/d(-2/35) assuming d is positive. d(527/35) Simplify (b(-2/17)/(((b/b*6)/b)/bb)(b(3/2)/b)/bb*(-1/10)b)6 assuming b is positive. b(3204/85) Simplify (v*(6/7)v31)/(v17/(v(-4/5)/v)) assuming v is positive. v(457/35) Simplify ((ss(4/11)s)(-38))18 assuming s is positive. s(-17784/11) Simplify (k3)*(-5/2)/(k(k*(-1/3)k)/kk)(-14) assuming k is positive. k(95/6) Simplify (hh/h*(-8/9)h((h(4/5)/h)/h)/hh)/(h(2/3)/h)5 assuming h is positive. h*(196/45) Simplify (uu(u12/u)/uuu)/(u/(u/u(-3/4)))(u*(2/5)u)(1/70) assuming u is positive. u(1477/100) Simplify uuu*(-3)uu(-3)u*10u/((((u*3uuuuu)/u)/u)/uu)u assuming u is positive. u3 Simplify ((r(-1)r)2r*(-4/3)r/(r/(r/(r/((r(rr(-3))/r)/r)))))(-24) assuming r is positive. r104 Simplify (l(-1))(4/7)/(l(-9)l)(5/2) assuming l is positive. l(136/7) Simplify w(-33)/(w(-13)ww)((w*(-21/4)/w)/w)/((((w/(ww*29))/w)/ww)/w) assuming w is positive. w(7/4) Simplify (p(3/7)p(pp15ppp)/pp)(-15) assuming p is positive. p(-2145/7) Simplify (w30(www/(w/w*(-10))w)/w)/((((ww/((www/w(-3)w)/ww))/w)/w)/(w/(w8/ww))) assuming w is positive. w22 Simplify (d(-7/6)d)(-3/8)/(d19/d)(-17) assuming d is positive. d(4897/16) Simplify (v(((v((v/v(-1/4))/v)/v)/vv)/v)/v)(-13/7)/(v(2/13)v(-1/3)) assuming v is positive. v(1717/1092) Simplify (b/b(-2)b)/b*(-7/6)(b/(bb(14/9)))/(b(-24)bb) assuming b is positive. b(461/18) Simplify ((l(1/19))48)(8/7) assuming l is positive. l(384/133) Simplify ((rrr11)/(r/(rr*(-1/8))))/(((rr(-2))/r)/r)(-2/3) assuming r is positive. r(87/8) Simplify (c0)(6/11)/((c13c)/((c(-6)/c)/cc)) assuming c is positive. c*(-21) Simplify (g/(gg/g*(7/3)gggg))(-6/5)/(((g/(g(-1/10)/g)g)/g)/gg)(-1/6) assuming g is positive. g(71/20) Simplify (rr/((rr(5/3)r)/rrrr)rr(-8))/(rr/r*(1/9)rrrr(-7)) assuming r is positive. r(-77/9) Simplify (c(-5))(-37)((c(-4)/c)/c)(-34) assuming c is positive. c389 Simplify b/(b/(b(3/11)/b))b18bb(b/(b*(-3/10)/bb))/bb(b*(-25)/b)/bb assuming b is positive. b*(-597/110) Simplify ((kk12)/k8)/(k(-2))(-33) assuming k is positive. k(-61) Simplify (p/((p/p(-2/15)pp)/pp)p(-42))(-2) assuming p is positive. p(1324/15) Simplify (y(-15))(2/25)/(y/((y/(y/y(-1/5)))/y)y)(2/63) assuming y is positive. y(-82/63) Simplify ((n0)6(n/n*(-7))/(nn/n(-3/2)))30 assuming n is positive. n*135 Simplify (uuu(-1/4)uuu/(u/(u/(uu(-3)/uu)))uu*(-6)u(1/4))(27/2) assuming u is positive. u*27 Simplify (u/(uuuu(2/35)))(14/3)u/(u(-21/2)u)u(7/5)u assuming u is positive. u(33/10) Simplify (h/h(3/4))*34(h(h(1/4)/h)/h)(-3/16) assuming h is positive. h(553/64) Simplify (k(-4)/k)/k13k*(4/11)kk/(k(-2/3)/k)k assuming k is positive. k(-428/33) Simplify ((g(-1)(g(-7)/g)/g)/(g(2/3))(-29))49 assuming g is positive. g(1372/3) Simplify (rr/(rrr/r(-3/10)))/(r/(r/r(2/45)))r0rrr/r*(-1/3)r assuming r is positive. r(269/90) Simplify ((h/h12)/h(2/15))/(h(-4/11)/h(-1/3)) assuming h is positive. h(-1832/165) Simplify ((a/a*(1/42))/aa/a*14)/(a/(aa/a*36)a(-14/5)/a) assuming a is positive. a(-9287/210) Simplify (r(1/7)/r)10(r(3/7))2 assuming r is positive. r(-54/7) Simplify (o(-4/5)oo(-7/4)o)/(o/(oo(-2/17)/o))(-20) assuming o is positive. o(7413/340) Simplify (oo(6/11))(-28)(o/(o(-29)o))/(o(((o(-4/17)o	{ "pile_set_name": "DM Mathematics" }
prime factors of 46965. 3, 5, 31, 101 What are the prime factors of 5525? 5, 13, 17 List the prime factors of 23060. 2, 5, 1153 What are the prime factors of 130872? 2, 3, 7, 19, 41 What are the prime factors of 146076? 2, 3, 7, 37, 47 What are the prime factors of 2785? 5, 557 What are the prime factors of 1182? 2, 3, 197 What are the prime factors of 6088? 2, 761 List the prime factors of 7027. 7027 List the prime factors of 34254. 2, 3, 11, 173 List the prime factors of 72811. 17, 4283 List the prime factors of 35436. 2, 3, 2953 What are the prime factors of 6303? 3, 11, 191 List the prime factors of 39948. 2, 3, 3329 List the prime factors of 38848. 2, 607 What are the prime factors of 3260? 2, 5, 163 List the prime factors of 30803. 30803 What are the prime factors of 6737? 6737 What are the prime factors of 14433? 3, 17, 283 List the prime factors of 38425. 5, 29, 53 What are the prime factors of 14703? 3, 13, 29 What are the prime factors of 3389? 3389 List the prime factors of 79960. 2, 5, 1999 List the prime factors of 785. 5, 157 List the prime factors of 5477. 5477 List the prime factors of 314. 2, 157 List the prime factors of 43767. 3, 1621 List the prime factors of 58236. 2, 3, 23, 211 List the prime factors of 4889. 4889 What are the prime factors of 45434? 2, 22717 What are the prime factors of 118166? 2, 59083 List the prime factors of 3212. 2, 11, 73 List the prime factors of 86987. 37, 2351 What are the prime factors of 118364? 2, 127, 233 List the prime factors of 12771. 3, 11, 43 List the prime factors of 7736. 2, 967 List the prime factors of 1057. 7, 151 What are the prime factors of 1115? 5, 223 What are the prime factors of 6437? 41, 157 List the prime factors of 28841. 151, 191 List the prime factors of 1232. 2, 7, 11 What are the prime factors of 53918? 2, 26959 What are the prime factors of 2803? 2803 List the prime factors of 1073. 29, 37 What are the prime factors of 45875? 5, 367 What are the prime factors of 1328? 2, 83 What are the prime factors of 352? 2, 11 List the prime factors of 2073. 3, 691 What are the prime factors of 121104? 2, 3, 29 What are the prime factors of 297? 3, 11 List the prime factors of 1283. 1283 What are the prime factors of 128313? 3, 53, 269 List the prime factors of 3056. 2, 191 List the prime factors of 890. 2, 5, 89 What are the prime factors of 7088? 2, 443 What are the prime factors of 113822? 2, 56911 List the prime factors of 18650. 2, 5, 373 What are the prime factors of 76829? 76829 List the prime factors of 1290. 2, 3, 5, 43 List the prime factors of 380. 2, 5, 19 List the prime factors of 2796. 2, 3, 233 What are the prime factors of 1689? 3, 563 What are the prime factors of 1326? 2, 3, 13, 17 What are the prime factors of 151? 151 List the prime factors of 72412. 2, 43, 421 List the prime factors of 53. 53 What are the prime factors of 4553? 29, 157 What are the prime factors of 7156? 2, 1789 List the prime factors of 107590. 2, 5, 7, 29, 53 List the prime factors of 98. 2, 7 What are the prime factors of 436? 2, 109 What are the prime factors of 2751? 3, 7, 131 List the prime factors of 14926. 2, 17, 439 What are the prime factors of 16702? 2, 7, 1193 List the prime factors of 39880. 2, 5, 997 What are the prime factors of 107713? 107713 What are the prime factors of 5963? 67, 89 List the prime factors of 113507. 223, 509 What are the prime factors of 126733? 126733 List the prime factors of 3487. 11, 317 What are the prime factors of 5483? 5483 What are the prime factors of 34442? 2, 17, 1013 List the prime factors of 18977. 7, 2711 List the prime factors of 1805. 5, 19 What are the prime factors of 23588? 2, 5897 List the prime factors of 14. 2, 7 List the prime factors of 32997. 3, 17, 647 List the prime factors of 42278. 2, 21139 What are the prime factors of 59017? 7, 8431 List the prime factors of 146474. 2, 73237 What are the prime factors of 32582? 2, 11, 1481 What are the prime factors of 6675? 3, 5, 89 What are the prime factors of 8418? 2, 3, 23, 61 What are the prime factors of 214? 2, 107 What are the prime factors of 1764? 2, 3, 7 What are the prime factors of 1960? 2, 5, 7 List the prime factors of 393. 3, 131 What are the prime factors of 16947? 3, 7, 269 What are the prime factors of 3166? 2, 1583 What are the prime factors of 102681? 3, 3803 List the prime factors of 23483. 23, 1021 List the prime factors of 43611. 3, 14537 List the prime factors of 913. 11, 83 What are the prime factors of 1335? 3, 5, 89 List the prime factors of 49930. 2, 5, 4993 List the prime factors of 6120. 2, 3, 5, 17 What are the prime factors of 2957? 2957 List the prime factors of 107270. 2, 5, 17, 631 List the prime factors of 896. 2, 7 List the prime factors of 107860. 2, 5, 5393 What are the prime factors of 115681? 29, 3989 List the prime factors of 5061. 3, 7, 241 What are the prime factors of 6967? 6967 What are the prime factors of 297? 3, 11 What are the prime factors of 5055? 3, 5, 337 List the prime factors of 34283. 34283 What are the prime factors of 8454? 2, 3, 1409 What are the prime factors of 1306? 2, 653 What are the prime factors of 10244? 2, 13, 197 List the prime factors of 4025. 5, 7, 23 What are the prime factors of 42642? 2, 3, 23, 103 List the prime factors of 34600. 2, 5, 173 List the prime factors of 3258. 2, 3, 181 List the prime factors of 8729. 7, 29, 43 List the prime factors of 1673. 7, 239 What are the prime factors of 30945? 3, 5, 2063 List the prime factors of 801. 3, 89 What are the prime factors of 24467? 43, 569 List the prime factors of 12458. 2, 6229 What are the prime factors of 48582? 2, 3, 2699 List the prime factors of 104. 2, 13 What are the prime factors of 6471? 3, 719 List the prime factors of 1897. 7, 271 List the prime factors of 4396. 2, 7, 157 What are the prime factors of 183? 3, 61 What are the prime factors of 745? 5, 149 What are the prime factors of 1538? 2, 769 What are the prime factors of 2248? 2, 281 List the prime factors of 1465. 5, 293 What are the prime factors of 121891? 7, 11, 1583 List the prime factors of 4643. 4643 List the prime factors of 41. 41 What are the prime factors of 96277? 43, 2239 List the prime factors of 2572. 2, 643 What are the prime factors of 1390? 2, 5, 139 What are the prime factors of 14081? 14081 List the prime factors of 48767. 48767 What are the prime factors of 5602? 2, 2801 List the prime factors of 2973. 3, 991 What are the prime factors of 21206? 2, 23, 461 List the prime factors of 16913. 13, 1301 What are the prime factors of 97478? 2, 17, 47, 61 List the prime factors of 12946. 2, 6473 What are the prime factors of 36956? 2, 9239 List the prime factors of 976. 2, 61 What are the prime factors of 12500? 2, 5 What are the prime factors of 1651? 13, 127 What are the prime factors of 2176? 2, 17 List the prime factors of 4545. 3, 5, 101 What are the prime factors of 6813? 3, 757 What are the prime factors of 343? 7 What are the prime factors of 23321? 23321 List the prime factors of 1261. 13, 97 What are the prime factors of 1125? 3, 5 What are the prime factors of 638? 2, 11, 29 List the prime factors of 1572. 2, 3, 131 What are the prime factors of 2193? 3, 17, 43 What are the prime factors of 3774? 2, 3, 17, 37 What are the prime factors of 99962? 2, 151, 331 What are the prime factors of 1072? 2, 67 List the prime factors of 3189. 3, 1063 What are the prime factors of 39247? 13, 3019 What are the prime factors of 16204? 2, 4051 What are the prime factors of 6437? 41, 157 What are the prime factors of 1004? 2, 251 What are the prime factors of 10751? 13, 827 What are the prime factors of 2158? 2, 13, 83 What are the prime factors of 421? 421 What are the prime factors of 7959? 3, 7, 379 What are the prime factors of 2810? 2, 5, 281 List the prime factors of 52824. 2, 3, 31, 71 What are the prime factors of 6905? 5, 1381 List the prime factors of 1005. 3, 5, 67 List the prime factors of 15556. 2, 3889 List the prime factors of 6420. 2, 3, 5, 107 What are the prime factors of 1425? 3, 5, 19 What are the prime factors of 34340? 2, 5, 17, 101 What are the prime factors of 1277? 1277 List the prime factors of 591. 3, 197 List the prime factors of 34523. 19, 23, 79 What are the pr	{ "pile_set_name": "DM Mathematics" }
7 + 1240. Factor -2/7 - ib2 + 20/7b. -2(5b - 1)*2/7 Let o(g) = 4g*4 + 6g*3 - 2g*2 - 6g + 1. Let s(t) = 7t4 + 11t*3 - 3t*2 - 11t + 1. Let m(y) = -5o(y) + 3s(y). What is a in m(a) = 0? -2, -1, 1 Let n be ((-10)/(-15))/(3/(-9)) + 5. Solve 3a - 33/2a*4 + 35/4a*5 - 2 + 37/2a*2 - 47/4a*n = 0. -1, -2/5, 2/7, 1, 2 Let b(t) be the second derivative of 5t*4/24 + 5t*3/6 - 16t. Determine o so that b(o) = 0. -2, 0 Let h(k) be the second derivative of 5k + 0 - 1/4k*2 + 1/48k*4 + 1/24k*3. Find v, given that h(v) = 0. -2, 1 Let d(s) = 38s*4 - 30s*3 - 46s*2 + 28s + 10. Let r(u) = 39u4 - 31u*3 - 47u*2 + 28u + 11. Let c(j) = 3d(j) - 2r(j). What is f in c(f) = 0? -1, -2/9, 1 Let z = 21 + -19. Suppose 8 + 2n2 + 10n - 6n2 + 6n*z = 0. What is n? -4, -1 Factor 3/7p - 1/7 + 4/7p2. (p + 1)(4p - 1)/7 Suppose 7o = 19o - 24. Solve 0 + 1/3s4 + so + 1/3s + s3 = 0 for s. -1, 0 Let m(o) be the first derivative of 1/6o*4 - 2/3o + 3 - 1/3o2 + 2/9o*3. Factor m(r). 2(r - 1)(r + 1)2/3 Let g(p) be the first derivative of 1/3p*3 - 1/1080p*6 + 0p*4 + 0p + 1 + 0p2 + 1/180p*5. Let a(o) be the third derivative of g(o). Factor a(q). -q(q - 2)/3 Suppose -7h = -4h - 15. Suppose 0p = hp + 2t + 6, -3p - 5t = 15. Factor 2/3y*3 + 2/3y*2 + 0 + py. 2y2(y + 1)/3 Suppose 2y + 2 - 6 = 0. Find q such that 3q*2 + 2qy - q3 - q*2 - 3q*2 = 0. 0, 1 Let w = 19 - 15. Let o(d) be the first derivative of -1/3d*2 + 0d + 4/9d3 - 1/6d*4 - w. Factor o(z). -2z(z - 1)2/3 Let o = 35/6 + -11/2. Let t(g) be the second derivative of -og*3 - 1/10g*5 - 1/3g*4 + 0g2 + 0 + g. Let t(x) = 0. What is x? -1, 0 Let m(p) be the third derivative of p7/15 - p*6/2 + 43p*5/30 - 2p*4 + 4p*3/3 - 19p*2. Factor m(z). 2(z - 2)(z - 1)2(7z - 2) Let o(p) = -p4 + p3. Let n(v) = 9v*4 - 17v*3 + 4v*2 + 12v - 8. Let d(q) = n(q) + 5o(q). What is a in d(a) = 0? -1, 1, 2 Suppose 3f = -5g + f + 18, 0 = -5g + 4f + 24. Suppose d - 4 = -d. Let -57/2a*3 - 1 + 3/2a + 14ag + 14a*d = 0. Calculate a. -1/4, 2/7, 1 Let g(c) be the first derivative of -7c6/360 + c5/60 + c*3 - 2. Let x(m) be the third derivative of g(m). Suppose x(h) = 0. Calculate h. 0, 2/7 Let z be 4/(-6) + (-10)/3. Let f(b) = 5b*4 - 4b*3 - 2b2 - 3. Let h(m) = -m4 + m*3 + 1. Let x(w) = zh(w) - f(w). Factor x(j). -(j - 1)*2(j + 1)*2 Suppose -3p - 3m + 9 = 0, 0 = 5p + 4m - 18 + 2. Let 2f*p + 2f*3 + 12f - 2f3 - 6f*3 - 4f = 0. What is f? -1, 0, 2 Suppose -7 = -3y - 4p + 17, 4 = -2y + 4p. Find b, given that -8/7b - 2/7 - 2/7b*y - 12/7b*2 - 8/7b*3 = 0. -1 Let m(i) = -10i - 30. Let z(l) = -2l - 6. Let n(f) = -3m(f) + 16z(f). Let s be n(-5). Factor -3y - y*3 - 3y + sy + 3y. -y(y - 1)(y + 1) Find n, given that -211n2 - 34n*3 - 135n*3 + 2n - 110n - 179n2 - 8 = 0. -2, -2/13 Let l(a) = a3 + a - 22. Let p(r) = 2r3 + r2 + r - 43. Let d(n) = 7l(n) - 4p(n). Factor d(k). -(k - 2)(k + 3)*2 Determine q, given that 32q*2 + 50q - 8 + 20q3 - 14q - 17q - 15q = 0. -1, 2/5 Let t(p) be the first derivative of -1/15p3 + 2 + 13/50p*5 + 3/10p*4 - p - 2/5p*2 + 1/15p*6. Let f(i) be the first derivative of t(i). Factor f(m). 2(m + 1)*3(5m - 2)/5 Suppose -3 + 17 = -3y - 5f, 5y + 2f = 2. What is w in 2w*4 - 4w*4 + 8w*4 - 3w*y - 3w*4 = 0? -1, 0, 1 Suppose 51 - 3 = 16d. Let m(c) be the second derivative of 0 + 1/12cd - 2c - 1/24c4 + 0c*2. Factor m(a). -a(a - 1)/2 Let i(a) be the second derivative of a7/14 - a6/2 + 3a5/2 - 5a*4/2 + 5a*3/2 - 3a*2/2 - 4a. Factor i(x). 3(x - 1)5 Let l(o) be the second derivative of -o5/20 - o4/9 + o3/18 + o2/3 - 2o. Solve l(n) = 0 for n. -1, 2/3 Suppose 2z = 5l + 2, 4l + 2z + 3z - 5 = 0. Let b(y) be the first derivative of 0y*2 - 1/4y*4 + 1/6y*3 - 2 + 1/10y*5 + ly. Factor b(j). j*2(j - 1)*2/2 Let p = 0 - -5. Factor -15 + 3a*2 - 8 - 12a - pa2 + 5. -2(a + 3)*2 Let a(n) be the third derivative of -4n7/105 + n6/20 + n5/6 - n4/4 - n3/3 + n2 + 13n. Let a(p) = 0. Calculate p. -1, -1/4, 1 Suppose 0h + 3h = -2v - 5, -4v + 14 = -2h. Determine r so that -vr2 + r3 - r3 + 0r*3 + 2r*4 = 0. -1, 0, 1 Let v be 12/54 + (-32)/(-18). Let j(h) be the first derivative of 2/5h*5 + 0h - 3/2h4 + 0h*v + 4/3h*3 + 4. Factor j(l). 2l*2(l - 2)(l - 1) Suppose -4q = -s - 16, 7s = 3s - 4q + 16. Let s + 6/7c*2 - 6/7c*4 + 4/7c*5 - 2/7c*3 - 2/7c = 0. What is c? -1, 0, 1/2, 1 Let l(k) = -3k3 - 2k*2 + 3k + 2. Let q(o) = 4o3 + o2 - 4o - 1. Suppose -9v = -5v - 16. Let w(y) = vq(y) + 3l(y). Solve w(t) = 0. -1, 2/7, 1 Factor -16h2 + 16h*2 + 2h*4 + 0h*4 + 2h*3. 2h*3(h + 1) Let s be 6/9(1 + 2). Factor 2o*s + 2o + 7o + o2 + 6. 3(o + 1)(o + 2) Determine h, given that -10h*2 + 21 - 15h + 5h3 - 21 = 0. -1, 0, 3 Suppose 0 = -4v + 3v - 2v. Factor 0j + 0j*2 + 0 - 2/11j*5 + 2/11j*3 + vj*4. -2j*3(j - 1)(j + 1)/11 Let o be (0 - 4) + (-115)/(-25). What is i in -2/5 - i3 - 1/5i*2 + i + oi4 = 0? -1, 2/3, 1 Let t(q) be the first derivative of -q6/360 + q4/72 + q2/2 + 2. Let y(f) be the second derivative of t(f). Determine k so that y(k) = 0. -1, 0, 1 Let v be (-11 + 2)(-7)/21. Suppose 4x = vx. Factor 0 - 3/2f*3 - 3/4f*4 - 3/4f*2 + xf. -3f2(f + 1)2/4 Let x(s) be the third derivative of -s7/3360 - s6/1440 - s3/3 + 2s2. Let z(i) be the first derivative of x(i). Suppose z(g) = 0. What is g? -1, 0 Let z = -1067/65926 - 5/554. Let u = z + 845/476. Factor uh + h*2 - 1/2. (h + 2)(4h - 1)/4 Let w(o) be the third derivative of o5/45 + o4/6 + o2. Find k, given that w(k) = 0. -3, 0 Let k be 12/3 + (3 - -4). Suppose -5r = 1 - k. Suppose 4/9o + 2/9o*r + 2/9 = 0. Calculate o. -1 Let b(p) be the first derivative of 0p*2 - 3/14p*4 - 4/21p*3 + 0p - 2/35p5 - 3. Factor b(m). -2m*2(m + 1)(m + 2)/7 Let t be -2 + -3 + 2 - -6. Suppose -a5 - 2a + a - 2a5 - 18a*t - 2a - 12a4 - 12a*2 = 0. Calculate a. -1, 0 Let r be 3/(-15) - (-15)/25. Factor -r - 12/5d - 18/5d2. -2(3d + 1)2/5 Let n = -2/16033 - -6862130/48099. Determine s so that ns*4 + 0 - 176/3s*2 - 140s*5 + 32/3s + 136/3s3 = 0. -2/3, 0, 2/7, 2/5, 1 Let 4j*2 - 8j + 16/3 - 2/3j3 = 0. Calculate j. 2 Let v = -236/85 - -88/17. What is b in 8b*3 + vb*2 - 2/5 + 38/5b*4 + 12/5b*5 - 4/5b = 0? -1, -1/2, 1/3 Suppose 5k + 5 = -11s + 6s, 0 = k + 5s + 13. Find d, given that -1/6 - 1/6dk - 1/3d = 0. -1 Factor 3/4 - 1/2j2 - 1/4j4 + j3 - j. -(j - 3)(j - 1)2(j + 1)/4 Let f = -6 + 6. Let m(l) be the first derivative of -2 + fl + 1/9l*3 - 1/3l*2. What is i in m(i) = 0? 0, 2 Let m(u) = -6u*2 - 7u - 21. Let y(q) = 5. Let r(t) = -5m(t) - 20y(t). Let r(s) = 0. What is s? -1, -1/6 Factor -205q3 - 7q*2 - 8q - 5q2 + 201q*3. -4q(q + 1)(q + 2) Let r = -29/40 + 9/8. Determine a so that ra - 12/5a*4 + 4/5a*2 + 0 - 2a*3 = 0. -1, -1/3, 0, 1/2 Let s(f) = 3f*2 - 4f. Let d be s(3). Let q = 3 + -1. Solve -r*2 - dr*3 + 4r*2 + qr - 2r2 = 0. -1/3, 0, 2/5 Let b(o) be the second derivative of -o4/42 + 2o3/21 - o2/7 - 5o. Find l, given that b(l) = 0. 1 Let a(b) = 3 - b - 2 - 11. Let s be a(-12). Factor 2/5y*s + 0 - 2/5y. 2y(y - 1)/5 Factor 19 + 3p - 9 - 10 + 3p*2. 3p(p + 1) Let w(y) = y4 - y2 - y. Let c(t) = 3t*5 - 4t*4 + 4t*2 - 5t. Let v be (12/24)/(2/(-8)). Let u(n) = vw(n) + c(n). Factor u(d). 3d(d - 1)3(d + 1) Factor -c*2 - 2c - 1/2c4 + 2c*3 + 3/2. -(c - 3)(c - 1)*2(c + 1)/2 Solve 4/5c4 + 0 + 1/5c + 9/5c3 + 6/5c*2 = 0. -1, -1/4, 0 What is t in -5 + 11t - 63t3 - t2 - 1 - 3t*2 + 62t3 = 0? -6, 1 Let v(t) be the second derivative of t5/90 + t*4/9 + 4t*3/9 + 3t*2/2 + 4t. Let i(r) be the first derivative of v(r). Suppose i(q) = 0. What is q? -2 Let h(d) = -d - 3. Let f be h(-10). Let g be (-2)/(f/((-42)/8)). Suppose -15/2a2 + 0 - 3a - ga4 - 6a*3 = 0. What is a? -2, -1, 0 Let n be (26/6 - 4)(-1 + 16). Let u(m) be the third	{ "pile_set_name": "DM Mathematics" }
be 4 + a/(0 - 2). Calculate the highest common factor of o and 4. 4 Let y be 10/(-4)(-64)/(-80) + 42. Calculate the highest common factor of 10 and y. 10 Suppose -13g + 18g = 90. Suppose -5m = -19 - 26. What is the highest common divisor of m and g? 9 Let l = -135 + 136. What is the highest common divisor of l and 16? 1 Suppose -4k - 5z - 45 = 0, 3k = -2z - 0z - 25. Let p = -2 - k. What is the greatest common divisor of p and 33? 3 Suppose -2 = z + z. Let m be 5((-212)/(-20) + z). What is the greatest common divisor of 24 and m? 24 Let m(d) = d*3 - 9d*2 + 8d + 11. Let n be m(8). Let a(j) = -2j + 3. Let g be a(-3). Suppose -n - g = -k. Calculate the greatest common divisor of k and 10. 10 Let s = -56 - -112. Calculate the greatest common divisor of s and 7. 7 Suppose 0 = 51t - 47t - 120. Calculate the highest common factor of t and 75. 15 Let k be ((-57)/3 + -1)/(-2). Let a be 14/(-35) - (-124)/k. Calculate the greatest common divisor of a and 30. 6 Suppose -6m + 11 = -5m. What is the highest common divisor of m and 44? 11 Let l be 114/14 - (-4)/(-28). Let a be 1(-174)/(-2) + 1. Calculate the highest common factor of l and a. 8 Let u be (3/9)/(2/(-6)). Let g be u/(2 + (-22)/10). Suppose 0y - y - 3n + 21 = 0, -84 = -4y + gn. What is the greatest common factor of y and 7? 7 Let j(h) = -h*2 - 12h + 33. Let p be j(-11). What is the highest common factor of p and 11? 11 Let k = 41 + -83. Let b be (-1 - -3)/((-3)/k). Calculate the highest common divisor of 42 and b. 14 Suppose -4r - 1309 = -3i - 193, 5i = -4r + 1828. What is the greatest common factor of i and 46? 46 Suppose -15c + 660 = 7c. Calculate the greatest common divisor of 42 and c. 6 Let v(q) be the third derivative of -q6/120 + q5/15 + q4/6 - q3/6 + q2. Let d be v(4). Calculate the highest common divisor of d and 75. 15 Let c = 24 - 1. Let l = 28 - c. What is the greatest common divisor of 45 and l? 5 Let k(b) = b2 - 8b + 9. Let m be k(7). What is the greatest common divisor of 10 and m? 2 Suppose -2h + 30 = x, -9h - x + 75 = -4h. What is the greatest common factor of h and 6? 3 Let x(z) = -z*2 + 33. Let l be x(0). Let i be (44/(-5))/(12/(-30)). Calculate the greatest common factor of l and i. 11 Let r be 8/(-10)60/(-8). Calculate the greatest common factor of r and 60. 6 Let p be 2 + 1 + 0 + 2. What is the highest common factor of p and 5? 5 Let r be 1/(-1) - (-50)/2. Suppose 2a + p - 25 = -0a, -4a + 5p = -43. What is the greatest common factor of r and a? 12 Let z = 5 - -7. Let i be (-9)/4 + 3/z. Let c be (104/12)/(i/(-3)). What is the highest common divisor of c and 143? 13 Let x be 21 - (5 - 3). Suppose -i = -xi - 12. Let d(t) = t*3 - 11t*2 + 11t + 2. Let p be d(10). What is the greatest common divisor of i and p? 12 Suppose -32 - 36 = -2v. What is the highest common factor of 306 and v? 34 Let b = -6 + 5. Let y(l) = l3 + 7l*2 + 4l - 4. Let x be y(-4). Let p be b38x/(-8). What is the highest common divisor of 19 and p? 19 Suppose 2z = 5l - 2z - 1595, 0 = -z. Calculate the highest common factor of 29 and l. 29 Let u = -6 - -4. Let c be (u + 4 - -31)1. Let k(v) = -v*2 - 5v - 3. Let x be k(-3). Calculate the greatest common factor of c and x. 3 Suppose -1601 + 89 = -7v. What is the greatest common factor of 24 and v? 24 Suppose -p = 5b + 16, -3b = -2p + 54 - 21. Suppose -l + 0l + p = 0. What is the greatest common factor of 63 and l? 9 Let b = 14 + -26. Let f = b + 33. What is the highest common divisor of 14 and f? 7 Let a = -2 - -4. Suppose 0 = -5r - 10, s + 12 = 5s + ar. Suppose 3c + 2v = 36, -v + 55 = 4c + sv. Calculate the highest common divisor of c and 10. 10 Suppose 2u = 6u + 4. Let h be 5 - (-1 + u + 1). Calculate the greatest common divisor of h and 6. 6 Let m(j) = -j*2 + 6j - 1. Let u be m(5). Suppose u = o + 1. Suppose 5d + 5 = 50. Calculate the highest common factor of d and o. 3 Let c = -81 + 149. Suppose -3m - c = -7m. Let j = m + 91. What is the highest common factor of j and 12? 12 Suppose 4s - 4j - 88 = 0, 4s = 5j + 99 - 14. What is the highest common factor of 275 and s? 25 Let i(t) = 4t - 3. Let p be i(9). What is the highest common divisor of 3 and p? 3 Let f = 54 + -33. Let g(l) = 13l - 36. Let p be g(6). Calculate the greatest common factor of p and f. 21 Let y be (-1 - 1-2)-37. Suppose -j - 61 = -0j. Let c = y - j. What is the greatest common divisor of c and 16? 8 Suppose -q = -3q + 4. Suppose 0o - 16 = -qo. Suppose 3c + 45 = oc. What is the greatest common divisor of 99 and c? 9 Let s = 20 - 8. Suppose 3c - 365 = 70. Let g be c/3 - 4/12. What is the greatest common factor of g and s? 12 Let j(o) = o*3 - 4o*2 - 8o + 2. Let w be j(6). Let n be 2/2 + -3 + w. Let v = -22 + 58. What is the greatest common factor of v and n? 12 Suppose -7f = -2f + 2030. Suppose -3u = -t - 3, 3t + 5u = 2t + 13. Let g be (-1)/3 - f/t. Calculate the highest common factor of g and 15. 15 Let g = -5 + 4. Let c be g/1 - (-146)/2. What is the highest common divisor of 8 and c? 8 Let k = 11 + 14. Let f = -5 + k. What is the greatest common factor of 8 and f? 4 Suppose -2q + 4q = 6. Suppose -3h = -8h + 105. Calculate the highest common divisor of h and q. 3 Let h(b) = b*3 - 10b*2 - 5b + 6. Let n be h(11). Suppose 8u - 3u - 15 = 0. Let a be (u + 0)(10 + -6). Calculate the highest common factor of a and n. 12 Let i(p) = 11p + 1. Let b be i(1). Let m be (-836)/(-14) + 4/14. What is the greatest common factor of b and m? 12 Let v = 15 - 11. Let s be v/(-14) + 58/7. Let j(w) = -2w2 - 21w - 9. Let l be j(-7). Calculate the highest common divisor of s and l. 8 Suppose -23 = -2p + 37. What is the highest common divisor of p and 20? 10 Let w be (56/(-20))/((-2)/10). Calculate the greatest common divisor of 14 and w. 14 Let d(m) = -29m + 3. Let v be d(-9). Calculate the greatest common divisor of v and 24. 24 Let i be (((-128)/(-20))/4)/((-14)/(-105)). Calculate the highest common factor of i and 192. 12 Let j be 1/(-3) + (-20)/(-6). Let l = -37 + 61. Calculate the highest common divisor of l and j. 3 Suppose x = 4v - 0v - 32, 5 = v - x. Calculate the highest common divisor of v and 18. 9 Suppose 3m - 2n = 115, 5m + 2n - 296 = -99. What is the greatest common factor of 13 and m? 13 Suppose 0h + 3h + 6 = 0. Let z be (-2)/111/h. Suppose z = 5w - 24. What is the highest common factor of w and 7? 7 Let q(c) = c*2 + 3c - 2. Let i be 52/(-10) - 4/(-20). Let b be q(i). Calculate the greatest common divisor of 88 and b. 8 Suppose 3u - 3 = -6, -60 = -3x + 3u. Let m = 465 - 275. What is the highest common factor of m and x? 19 Suppose -3u + 78 = 4x - 2x, 2u + 2x = 54. What is the highest common divisor of 40 and u? 8 Let v = 214 - -2. Calculate the greatest common divisor of 27 and v. 27 Let f = 29 - 10. Suppose 0 = 4s + 2b - 2054, 3b + b - 4 = 0. Suppose 3z = -0z + s. What is the greatest common factor of z and f? 19 Let f = 684 - 484. Suppose 0y - f = -5y. Let i = y + -27. What is the greatest common factor of 117 and i? 13 Let a = 54 - 14. Calculate the greatest common factor of a and 16. 8 Let d = 70 + -60. Let a be (-4)/16 + 17/4. What is the highest common divisor of a and d? 2 Suppose -106 - 11 = -2h + g, -2h + 4g = -108. Let c be 270/75(-10)/(-3). What is the greatest common factor of h and c? 12 Let v be (11 + 0 - 1)(-96)/(-60). What is the highest common factor of v and 144? 16 Suppose 2q = -4 - 2. Let x be q/(-5) - (-72)/5. What is the greatest common factor of x and 120? 15 Let o = -7 - -11. Suppose -7i = -3i + 20. Let p(y) = -3y - 7. Let r be p(i). What is the greatest common factor of o and r? 4 Suppose -90 = 2t - 4t. Let w = 41 + -26. Calculate the highest common factor of t and w. 15 Let q(z) = 2z2 - 5z + 5. Let a be q(5). Let r be 15((-2)/1 + 3). What is the greatest common factor of a and r? 15 Suppose 3a - b = 283, 0 = -a - 3a + 5b + 359. What is the greatest common divisor of 12 and a? 12 Let y be (0 + 35)(2 - 0). Let j be -1(-2)/(2/(-17)). Let k = j - -27. What is the highest common divisor of y and k? 10 Suppose -140 - 20 = -5n. Calculate the highest common factor of n and 288. 32 Let t(c) = 2c*2 - 4c +	{ "pile_set_name": "DM Mathematics" }
30j2 - 3 What is the third derivative of 666b*6 - 197b*2 wrt b? 79920b*3 Find the third derivative of 7z*5 - 27z*4 + 2099z*2. 420z*2 - 648z What is the second derivative of 54q3 + q2 + 159q wrt q? 324q + 2 What is the second derivative of 9902dw2 - 10dw + 4d - 11w + 2 wrt w? 19804d What is the third derivative of 2874p2qx3 + 5p*2x - pqx*3 + 3pqx + 61qx + 4x2 wrt x? 17244p*2q - 6pq What is the second derivative of -53w4 + 628w? -636w2 What is the derivative of -19b4 - b3 + 146b - 17777 wrt b? -76b*3 - 3b*2 + 146 Find the first derivative of -172q - 10. -172 Find the second derivative of -720gz*3 - 2gz2 + 5g - z - 23 wrt z. -4320gz - 4g Find the third derivative of 4347m*5 - 2m*2 + 851m + 4 wrt m. 260820m2 Find the second derivative of 27f*2m*3u*2 + 36f*2m*3 - 2f*2m*2u + 38fm*3u2 + m3u - 2u wrt u. 54f2m*3 + 76fm3 What is the third derivative of 3o*5 - 186o*4 + 555o*2? 180o*2 - 4464o Find the second derivative of -68c4 - 142c - 2. -816c2 What is the second derivative of -1297s*2x*2 + 470sx2 wrt s? -2594x*2 Differentiate 14i*2k*2 + 16i*2 - 15ik3 - 2k + 33 with respect to k. 28i2k - 45ik*2 - 2 What is the first derivative of -7559t*2 + 1186? -15118t What is the third derivative of -285r3w3 + r3w - 3rw2 - 3rw wrt w? -1710r*3 Differentiate 67x*4 - 308 with respect to x. 268x*3 Differentiate 2m*4r - 19m4 - 2mr2 - 1020r*2 wrt m. 8m*3r - 76m3 - 2r*2 Differentiate 13086y + 7759. 13086 What is the third derivative of 3075x3 - 10878x*2? 18450 What is the third derivative of 958x*5 - 598x*2 wrt x? 57480x*2 Find the second derivative of 188v5 + v3 - 922v. 3760v*3 + 6v Find the first derivative of 2n4 + 70n*3 - 279. 8n*3 + 210n*2 Differentiate -2bgpz + 511bgz - 2bp*2z + gpz - 3gz - 4p2z - 8pz wrt b. -2gpz + 511gz - 2p*2z Find the second derivative of 4b5 - 87b*4 - 78b + 11. 80b3 - 1044b*2 What is the second derivative of -77b*4 - 2b - 11? -924b2 What is the second derivative of -1713g*3 - 4435g? -10278g What is the second derivative of 7g*3j + 7g3 - g2jz + 2g*2z - 2gj + 68gz + 2jz wrt g? 42gj + 42g - 2jz + 4z Find the third derivative of 6mrs3 - 306ms + 1143rs4 - 16r + s*2 wrt s. 36mr + 27432rs Find the third derivative of 62bi3y*3 - 5bi3y - 12bi*2y*3 - 4by3 wrt i. 372by3 - 30by Find the third derivative of 254p*4 + 113p*2. 6096p Find the third derivative of -35o2z*5 + 43o*2 - oz*2 wrt z. -2100o*2z*2 What is the second derivative of -10016s*5 - 4895s wrt s? -200320s3 Differentiate -b3pv + 10b*3py - b3v - 260b3y + 15pvy wrt p. -b3v + 10b3y + 15vy Find the third derivative of 40i6o*2 - 36i6 + i2o2 + 8i*2 - 7o*2 - 4o wrt i. 4800i3o*2 - 4320i3 Find the third derivative of p3r3z*2 - 2p*3r*2z - 1006p2r*3z*2 + 3pr2 - 2prz*2 + 36pr wrt r. 6p*3z*2 - 6036p*2z2 Find the first derivative of -d2o3 - 931d*2o*2 - 435d*2 wrt o. -3d*2o*2 - 1862d*2o Differentiate -4726r + 1803 wrt r. -4726 Find the second derivative of 64k*3y*2 + 12ky2 - 3y*2 wrt k. 384ky2 Find the third derivative of 1243c*2r*3 - 2c*2r*2 - 2cr2 + 116 wrt r. 7458c*2 Differentiate 2gij + 4giy + 10gy - 2ijy - iy - i - 4j*2y - 7j2 wrt j. 2gi - 2iy - 8jy - 14j Differentiate 187x4 - 94. 748x*3 Differentiate -12743h*2 + 2662 with respect to h. -25486h What is the third derivative of 2933z3 - 69z*2 - 59? 17598 What is the second derivative of -2h*2r*3 + 2h*2r*2 - 3177h*2r + hr2 + 66hr - 4r*3 - 2r wrt h? -4r3 + 4r*2 - 6354r What is the third derivative of -5i5 + 24i*4t2 + i3 + 2i2t*2 + 6t*2 - 4 wrt i? -300i*2 + 576it2 + 6 What is the first derivative of 3778g*3kw + 453g*3k - gk - 3g + 4k wrt w? 3778g*3k Differentiate 9n4 + 5n*3 - 205 wrt n. 36n*3 + 15n*2 Find the third derivative of 3c*3f*3 - 2c*3f*2 - cf*2 + 52f*3 wrt f. 18c*3 + 312 What is the derivative of 52jt + j - 53t wrt j? 52t + 1 Differentiate -35o*2q - 81o2 with respect to q. -35o*2 Find the second derivative of -21o*5p*2 + 9o*3p*2 - 3op + p2 + 1 wrt o. -420o*3p*2 + 54op2 Find the second derivative of 1645c*4 - 559c. 19740c2 Find the first derivative of 2558j - 982. 2558 What is the third derivative of -3jr*2t*3 + 2jr2 + 12jt2 + 3r*2t*2 - 3r - 2t3 wrt t? -18jr2 - 12 Find the first derivative of -64d*2mt2 + 5d*2t - 6dmt2 + 53t*2 wrt m. -64d*2t*2 - 6dt2 Find the second derivative of -c2n*2x + c*2nx2 - c2nx - cn*2x*2 + cn - 28nx*2 wrt c. -2n*2x + 2nx*2 - 2nx What is the third derivative of 4g*3h*3y*2 - 5g*3hy3 + 3g*3y3 + g2h2y*3 - 2g*2hy2 + 21h*3y*3 - 5h*3 wrt h? 24g*3y*2 + 126y3 - 30 Find the third derivative of -d4v + 215d*3v3 - d3v + 155d*2v*3 + 4d*2v + d*2 wrt d. -24dv + 1290v*3 - 6v What is the second derivative of 317v3 + 3v - 137 wrt v? 1902v What is the second derivative of 13534a*2j*2x*2 - aj*2x*2 + 4aj2 + 2ax + a - 73x wrt a? 27068j2x*2 What is the third derivative of -4f*3v*2 + 7f*3v - 6f2v*2 + 2fv2 + 8v*2 wrt f? -24v*2 + 42v Differentiate -3f2j + 68f2 - 612fj3 - 10 with respect to j. -3f*2 - 1836fj2 What is the second derivative of 27r*2u*4 - 77r*2u + 3r2 - 2u*5 wrt u? 324r*2u*2 - 40u3 What is the derivative of a2kq - a*2q*2 - 204kq2 - 207q2 wrt k? a2q - 204q*2 What is the second derivative of 91k*3v*3 + 4k*2v*3 - 2kv2 + 41v*3 wrt k? 546kv3 + 8v*3 Find the third derivative of -5uv4 - uv*3 - uv*2 + 2u - 16v4 + 140v*2 wrt v. -120uv - 6u - 384v What is the third derivative of 6l*6 + 8l*5 - 211l*2 wrt l? 720l*3 + 480l*2 Find the second derivative of 13049bv2 + 43bv - 21v wrt v. 26098b Find the second derivative of -3l*2n + 52l2 - 116ln - n + 3 wrt l. -6n + 104 Find the second derivative of -6f5 + 12f*4 - 3f - 18 wrt f. -120f3 + 144f*2 Differentiate -1084x + 1322 wrt x. -1084 What is the third derivative of -18n4 + 58n*3 - 590n*2 + 4 wrt n? -432n + 348 Find the third derivative of -6dh*2t*2 + 32dht*3 - 8dht*2 - 8dt2 + h2t3 - h2 + 14ht*3 wrt t. 192dh + 6h*2 + 84h Find the third derivative of -4y6 - 21y*5 + 874y*2 wrt y. -480y*3 - 1260y*2 What is the third derivative of -2902m*5 - 56m*2 + 30m wrt m? -174120m2 What is the third derivative of -6l*4q - 2285l3q - 1611l2q + q wrt l? -144lq - 13710q Find the second derivative of -2d*5 + 483d*2w + 2d - 63w wrt d. -40d3 + 966w What is the second derivative of 26l2q*2 + 3l*2q + 5l2 - 7lq2 - 430q*2 + 2 wrt l? 52q*2 + 6q + 10 Find the first derivative of -2619c2 - 13454. -5238c What is the derivative of -7951r3 + 3149 wrt r? -23853r*2 What is the third derivative of 279v*5z + 18v3 + 5177v*2z + v*2 wrt v? 16740v*2z + 108 What is the second derivative of 3h5x*2 + 1271h*5 - 2hx2 - 670h - 3 wrt h? 60h3x*2 + 25420h*3 Find the first derivative of 2l*3 - 119l*2 + 257. 6l*2 - 238l What is the first derivative of -1721z2 - 3z + 5563? -3442z - 3 Find the third derivative of -5667i3 - i2 + i - 92. -34002 Differentiate 211g3 - 272. 633g*2 What is the second derivative of -141g*2i - 2g2y - 2gy + 4i - 8y wrt g? -282i - 4y Find the second derivative of 374d3gx + 2d*2x - dg + 141x wrt d. 2244dgx + 4x Find the second derivative of 139v5 - 292v wrt v. 2780v3 What is the first derivative of 5163f + 11595? 5163 Find the first derivative of 3038k2 + 2561 wrt k. 6076k What is the derivative of -27u3z + 11507u3 - 72u*2z wrt z?	{ "pile_set_name": "DM Mathematics" }
-5 = pk - 4m for k. -1 Let d be (-8 + -61)(-1)/3. Solve -24 = -4w + 3a, 0a = 5w - 2a - d for w. 3 Suppose 0 = m + 5 - 7. Suppose md = -21 + 25. Solve -2y + dv = -6, -2v + 11 = 3y - 3 for y. 4 Suppose -45g = -3d - 47g + 16, d + 3 = g. Solve -2l - 5p = -6l + 21, -dp = -3l + 14 for l. 4 Let g be 2 + 3 + -12 + 5 + 5. Solve 0 = -5h - 2i + 3, -2i - 3i - 2 = gh for h. 1 Let z = 51 + -29. Suppose 2q = z + 34. Suppose -5g = -12 - q. Solve 2h - 5r + g = 29, -r = -4h - 3 for h. -2 Let t(f) = 2f*2 + 3f - 1. Let o = 8 + -7. Let c be t(o). Solve -cg + 3z - 17 = 0, -5z + 19 = -2g - 0 for g. -2 Suppose t - 12t - 143 = 0. Let o = t + 13. Solve -4y + p + 16 = o, -p + 5 = 1 for y. 5 Let z(u) = -u*3 + 12u*2 + 43u + 35. Let s be z(15). Solve 0 = -5x + 3d + 22, -sx + 34 = 3d + 6 for x. 5 Let v(m) = m*3 - 10m*2 - 11m + 5. Let n = 66 - 55. Let b be v(n). Solve -br - 5s = -5, -s - 10 - 9 = -4r for r. 4 Let c be ((105/(-10))/7)/(1/(-2)). Solve -7k - 31 = -3k + cn, -4k = -2n + 6 for k. -4 Let g be -2 - -7 - (12 - 7). Solve -4f = -20, gc - 4f = -5c - 45 for c. -5 Let i(z) = z*2 - 3z + 1. Let t be i(2). Let o be (-2 + -2)6/(-8). Let a be (o/(-9))/(t/6). Solve -2f + 18 = -3h, -af - 15 = 5h - 1 for h. -4 Suppose -4q = -5q. Solve qw = -u - 3w + 9, 4u = -3w for u. -3 Let g(t) = -20t - 10. Let v be g(-1). Solve 2a = -4y + v, 5a + 5y = 12 + 13 for a. 5 Let j(u) = -3u + 41. Let t be j(18). Suppose -8 - 8 = -i. Let g = i + t. Solve -2y + 2l - 4 = 0, -5l = gy + 2y - 40 for y. 3 Let p be -3 - 21/(1 - -2). Let n(b) = -b*2 - 9b + 14. Let a be n(p). Solve v - 5 = 0, k + 2k = -av + 14 for k. -2 Suppose -76 = 3p - 85. Suppose -2u + 5s = -26, -4s - 3 = pu + 4. Solve 4o = -3h - 2, -h - 14 = uo - 5h for o. -2 Suppose -4o = k + 12, 4o + 3k + 11 + 1 = 0. Let i be 10/15 - (-2)/o. Suppose 0 = 4l - 32. Solve i = -3h - h + 8, -4h + l = -3x for x. 0 Suppose 4p + 13 = 61. Suppose 0 = -12m - 42m + 29m + 650. Solve -5h = -3w - m, -2w = 2h + 2h - p for h. 4 Let d be (-4 + 10)/(-48)-40. Solve -2o + 0q - 4 = 2q, q = d for o. -2 Suppose -20g + 28g - 24 = 0. Solve 0 = -gx + 12, 0 = q - 2q + x - 1 for q. 3 Suppose 9a = 4z + 13a - 52, -41 = -3z - a. Solve -6 = -5k - 5x + z, 3x = -5k + 20 for k. 4 Let o be -1(-22 - -1). Let u(p) = -2p2 + 46p + 156. Let g be u(26). Solve a + 11 = 5f - 1, -f - oa + 12 = g for f. 3 Let i = 956 + -953. Solve -3p - 7 = p + 5y, ip - 2y - 12 = 0 for p. 2 Let y(q) = -2q3 + 8q*2 + 8q + 6. Let s(i) = i3 - i2 - 1. Let f(c) = s(c) + y(c). Let b be f(8). Solve -4v = 3x + 23, 3x + 3v = b - 23 for x. -1 Suppose -d - 1 = 5j - 5, 0 = -2j + 2d - 8. Suppose 6 = -n - 0c + 3c, -n + 5c - 12 = j. Solve -3r + nz + 0 = 6, -r + 3z - 6 = 0 for r. 0 Let p = -144 + 164. Solve 0 = -4c + j - 2 - p, j + 18 = -4c for c. -5 Let q be 5/1 - -1 - 2/2. Solve qc + 14 + 5 = -h, -2 = c + 2h for c. -4 Suppose 5v - 5 - 6 = -y, 7 = 2v + 3y. Solve b - 6 = 4b + 5f, -vf - 2 = b for b. -2 Let f be 2/5 + 52/20. Solve -k + 3a = -11, 7 = 3k - 4k - fa for k. 2 Suppose 2o - 7s = -2s + 16, -4s = -4o + 8. Let c(y) = y + 4. Let j be c(o). Solve 4g = -jt, 0g = 4g - 4t - 12 for g. 1 Suppose 2o = -o + 60. Let d = -2560 + 2565. Solve -r + c = -d, -4r = -0r + 3c - o for r. 5 Let l be 4 + -4 + (-13)/1. Let i = -9 - l. Let m(u) = 4u*2 - 3u - 2. Let a be m(-2). Solve -id = -4k - 24, -5k = -d + a - 6 for k. -2 Let x(b) = -1 + 8b - b + 0b. Let f be x(1). Solve -2v = f, -c + 2c - 14 = 4v for c. 2 Suppose 3m = 15, -2b + m = 3m - 10. Let h = 2 - b. Let f(p) = -p3 - 3p*2 + 22p - 10. Let j be f(3). Solve -2d - 3d = 5, 0 = -c + hd + j for c. 0 Let i be (-74)/(-10) - (78/(-30) - -3). Suppose -ia = 6a - 52. Solve s - 13 = 4h, s + ah - 10 = -29 for s. -3 Suppose 2u + 2u - 3o - 17 = 0, 3o = 2u - 13. Solve 3j - 4 = -2p - 9, -4 = up + 2j for p. -1 Suppose 4d + 28 = 2d. Let p be ((-14)/d)/(2/10). Let f(i) = i*2 + 17. Let q be f(0). Solve -b + 4x - q = -2b, -25 = -5b - px for b. 1 Suppose 0 = -4z - y - 7, 0z - z = -3y + 5. Let m = 1 - z. Solve 3r - 5o = -o + 20, 0 = 4r - mo - 22 for r. 4 Let b = 0 - 4. Let o(k) = k + 6. Let r be o(b). Let h(c) = -c*2 - 21c + 50. Let x be h(-23). Solve -xq - 12 = -5p, -5q + rq - 9 = p for q. -3 Let n be 35/5 - (-10)/(-5). Suppose -2z - 15 = -nz. Solve 0 = -2d + zg - 24, -g - 2 = -0d + 3d for d. -2 Let r(i) = -i*2 - 7i - 7. Let x = -9 + 4. Let l = x + 2. Let k be r(l). Solve a - k = -3c - a, 3c + a - 7 = 0 for c. 3 Let n(j) = j*3 + 5j*2 + 2j - 7. Let i be n(-4). Let o be (-1 - i) + (-22)/(-11). Let s be -1 + -1 + 3 + -1. Solve o = p + 3f - 5, sp + 9 = -3p - f for p. -4 Let w be (-2 - -1) + -2 + 3. Suppose 4s = 3y - 34, -6s = 4y - 4s - 16. Let n be 73/15 + y/45. Solve 3a + 13 = z - 2z, w = -2z + na + 7 for z. -4 Let g(o) = -2o2 - 11o + 6. Let r be g(-6). Suppose 20 + 0 = 4z. Solve r = -2v + zu + 5, 4v + 3u - u = -2 for v. 0 Suppose 6m - 4m = -2i + 14, 5i = 10. Solve -4v + 9 = -2v + ml, -30 = 5v - 5l for v. -3 Suppose -3w = 27 - 81. Let z be (-4)/(-10) - (-580)/50. Suppose -z = -j + 3y, 5y + w = 5j - 4j. Solve -4k + 23 = jq, 2k - 29 = -3q - 10 for q. 5 Let n be (-6 - (-640)/112) + 74/14. Solve ns + 5h + 9 = 4s, h - 3 = s for s. -4 Let d be (8/(-12))/((-2)/(-21)). Let g = 7 + d. Suppose 6 = 6w - 24. Solve -wp - r + 15 = 0, -5r = -p - gp - 23 for p. 2 Let d = -82 + 85. Suppose dq = -5z + 91, 4z - 169 = -q - 4q. Let x = -5 - -9. Solve -4y = -4b - 8, 0y - q = -xb - 5y for b. 3 Let g be 2 - (-1 - -1 - 0). Let f(r) = 34r - 6. Let n be f(1). Suppose nz = 20z + 16. Solve -m + zs - 2 = m, -gs = 2 for m. -2 Let p(j) = j*2 + 2j + 1. Suppose -f = -2f - 3. Let c be p(f). Solve -3a = -5v - 14, -5a + 16 = -5v - c for v. -1 Suppose -3b + 4t = -5b + 12, -t = -1. Solve b = -4i - 3h + 21, -4h = -12 for i. 2 Suppose -172c + 164c + 200 = 0. Let h(o) = o2 + 5o - 4. Let s be h(-6). Solve 5j = -c, m - 3j - s = 9 for m. -4 Suppose 2398w = 2404w - 108. Solve -12 = -4j, -j + 6 - w = 5t for t. -3 Let f be 64/14 + (-20)/35. Let w be 6 + -3 + 3 + -3. Suppose h + 5k + 16 = 0, -wk + 0 - f = 2h. Solve 4v + h = -4d, -2d - v - 25 = -7d for d. 4 Let j(v) = v2 - 3v - 1. Let y be -3 - (-2)/(2/7). Let t be j(y). Let m = 18 + -15. Solve 0 = -5w + 5s + 5, -2w - mw + t = -3s for w. 0 Let t = 193 - 189. Solve v + p - 7 = 0, -p - t = -3v + 1 for v. 3 Let q be 1/(35/(-240)). Let d = q - -19. Solve 3m = dc - 12, 0 = -m - 5c + 4c for m. -2 Let p = -41 + 44. Let r be (10 - -2)/(-1 + p). Solve -2l = -4 + r, -5 = -n + 3l for n. 2 Let i(v) = v2 + 28v + 34. Let w be i(-27). Solve wm - 2m + 31 = 2t, 4t + 13 = -5m for t. 3 Suppose -89 = -2l + j, 0l + 184 = 4l + 4j. Suppose -2 = -3a + 2r, -4r = 5a + r - l. Solve -3z = u, au + 4z + z = -7 for u. -3 Suppose 2z - 11 + 3 = -2b, -5z + 20 = -5b. Let o(n) = -n*3 + 4n*2 + 2n - 6. Let h be o(z). Solve 0 = -2c - 0c - 2d - 8, -5c = -4d + h for c. -2 Let c be 3 - (0 - (-1 + 3)). Let n be 4/10 + (-8)/(-5). Suppose 2l + r - 2r = 6, nl + 3r - 14 = 0. Solve l = d - cd, -5 = -a + 5d for a. 0 Let d(n) = 6n*3 + 2n*2 - 6n - 3. Let q be d(-3). Let c = -114 - q. Solve 8h - 25 = 5y + 3h, c = 3h for y. 0 Let k(f) = 4f2 + 5f + 14. Let m be k(-2). Suppose -7s + m = -3s - 4t, -s - 2t - 10 = 0. Solve 3b - 2p = b - 2, 3b + 5p - 21 = s for b. 2 Let l(p) = 9p2 - 3p + 4. Let f be l(1). Suppose -5w + f = -2g, g - 7 = -4w + 14. Solve -wt - 5u - 12 = 0, -3u - 1 = 3t + 5 for t. 2 Let f(c) = -6c - 14. Let g be f(-3). Suppose -26 = -2s + gj, 27 = 3s - 2j + 4. Solve 0m = -2m - sb - 27, 5b + 20 = 5m for m. -1 Let z be 34/24-6 + -10. Let r(u) = -u - 12. Let p be r(z). Solve 5l = -i - 5, 2l = l + 4i - p for l. -1 Suppose 3l = 2l - 11. Let j = 17 + l. Suppose 0 = 3n - 12 - j. Solve -nq = -q - 4r + 1, -r - 5 = 4q for q. -1 Suppose -7n = -20n + 26. Solve 0 = 4j - 4l - 0l + 32, 0 = nj + 2l for j. -4 Let u be 44 + -3 - (23 - 13). Solve 2x + 6 = -2x - 2p, -4x = -3p + u for x. -4 Let b = -276 + 281. Sol	{ "pile_set_name": "DM Mathematics" }
u: 4, e: 4}. What is prob of sequence xxec? 1/340 What is prob of sequence ohzo when four letters picked without replacement from {i: 2, z: 1, o: 2, c: 4, h: 1}? 1/2520 Four letters picked without replacement from ubbuuububuuuub. Give prob of sequence buuu. 15/143 Four letters picked without replacement from jgjggejjjee. Give prob of sequence ggej. 1/88 Three letters picked without replacement from {q: 2, i: 2}. Give prob of sequence qiq. 1/6 Two letters picked without replacement from {n: 7, b: 3, x: 5, d: 1}. Give prob of sequence db. 1/80 Two letters picked without replacement from guggiiuigqhgziuqiqqq. What is prob of sequence qq? 1/19 Two letters picked without replacement from aaanotonnnaon. What is prob of sequence aa? 1/13 Four letters picked without replacement from {t: 4, l: 10, a: 2}. What is prob of sequence ltat? 1/182 What is prob of sequence rn when two letters picked without replacement from {r: 2, n: 16}? 16/153 Three letters picked without replacement from nnoonnnru. What is prob of sequence oun? 5/252 What is prob of sequence oo when two letters picked without replacement from oooo? 1 Calculate prob of sequence pnp when three letters picked without replacement from npppnnppppp. 28/165 Calculate prob of sequence ip when two letters picked without replacement from ppipipipippppppppp. 28/153 Two letters picked without replacement from wkkh. Give prob of sequence wh. 1/12 Calculate prob of sequence hfcl when four letters picked without replacement from ffllcclhhflfl. 2/429 Calculate prob of sequence zb when two letters picked without replacement from {b: 1, e: 1, a: 2, z: 1}. 1/20 Four letters picked without replacement from vjjvjjjjjjjjvjjjjjvv. Give prob of sequence vvjv. 5/646 What is prob of sequence jmu when three letters picked without replacement from {m: 2, r: 6, c: 1, t: 1, j: 1, u: 4}? 4/1365 Two letters picked without replacement from {i: 2, l: 4, s: 3}. Give prob of sequence ss. 1/12 Four letters picked without replacement from {g: 2, z: 6}. Give prob of sequence zzgg. 1/28 Four letters picked without replacement from {b: 3, z: 7, c: 4, s: 1, r: 2}. Give prob of sequence bsrz. 1/1360 Two letters picked without replacement from {i: 2, p: 2, h: 1, o: 1, k: 1, t: 1}. What is prob of sequence ko? 1/56 What is prob of sequence ef when two letters picked without replacement from {e: 2, f: 7}? 7/36 Two letters picked without replacement from uifni. What is prob of sequence iu? 1/10 Calculate prob of sequence kk when two letters picked without replacement from aakk. 1/6 Two letters picked without replacement from pppl. Give prob of sequence lp. 1/4 Four letters picked without replacement from {z: 10, b: 1, n: 8}. Give prob of sequence bznz. 5/646 What is prob of sequence uwaa when four letters picked without replacement from {k: 2, o: 1, u: 1, v: 2, w: 2, a: 4}? 1/495 Three letters picked without replacement from zvzvvth. Give prob of sequence tvz. 1/35 What is prob of sequence tit when three letters picked without replacement from {t: 13, j: 3, i: 1}? 13/340 Calculate prob of sequence ww when two letters picked without replacement from {x: 6, w: 4}. 2/15 What is prob of sequence ef when two letters picked without replacement from {e: 2, f: 1, g: 1, y: 2}? 1/15 Calculate prob of sequence pvvp when four letters picked without replacement from vpphppv. 1/35 What is prob of sequence lt when two letters picked without replacement from {l: 2, t: 2}? 1/3 What is prob of sequence ax when two letters picked without replacement from xaspkpk? 1/42 Four letters picked without replacement from memxampmppp. What is prob of sequence mmpe? 1/165 Three letters picked without replacement from {e: 2, y: 4, u: 2}. Give prob of sequence yeu. 1/21 What is prob of sequence oio when three letters picked without replacement from oeboribe? 1/168 Calculate prob of sequence rkk when three letters picked without replacement from krkkkttkktkr. 7/110 Calculate prob of sequence kv when two letters picked without replacement from {v: 8, p: 1, l: 3, k: 5, u: 3}. 2/19 Two letters picked without replacement from rrrppprrrrpppprpprr. Give prob of sequence rp. 5/19 What is prob of sequence vioi when four letters picked without replacement from {i: 7, o: 4, v: 1, g: 1}? 7/715 What is prob of sequence maaa when four letters picked without replacement from {m: 6, a: 7}? 21/286 What is prob of sequence ylly when four letters picked without replacement from {z: 3, y: 3, l: 2}? 1/140 Three letters picked without replacement from uuouuuuuou. What is prob of sequence uuu? 7/15 Calculate prob of sequence llgg when four letters picked without replacement from lllllllglggllggl. 55/1092 What is prob of sequence zz when two letters picked without replacement from {l: 1, z: 3, v: 11}? 1/35 Three letters picked without replacement from {c: 1, n: 2, t: 2}. Give prob of sequence cnt. 1/15 Two letters picked without replacement from ggggouooug. Give prob of sequence uo. 1/15 What is prob of sequence rz when two letters picked without replacement from rrszh? 1/10 What is prob of sequence bbb when three letters picked without replacement from {b: 7, a: 2, l: 1, g: 4}? 5/52 What is prob of sequence uyw when three letters picked without replacement from {u: 7, y: 2, x: 3, w: 3}? 1/65 What is prob of sequence wewk when four letters picked without replacement from oobwwookbooeeobkbwk? 1/2584 Two letters picked without replacement from {k: 11, b: 3, h: 4}. What is prob of sequence bk? 11/102 Two letters picked without replacement from {r: 4, n: 6, l: 1}. What is prob of sequence rl? 2/55 Three letters picked without replacement from {m: 1, k: 7, x: 4, z: 2}. Give prob of sequence zkk. 1/26 Three letters picked without replacement from vsaswvvssayasv. What is prob of sequence vaa? 1/91 Three letters picked without replacement from {h: 1, z: 2, o: 2, i: 1, d: 4}. What is prob of sequence dhz? 1/90 Calculate prob of sequence tp when two letters picked without replacement from tpieet. 1/15 Three letters picked without replacement from xytrxkxrxekxxx. Give prob of sequence xet. 1/312 What is prob of sequence eg when two letters picked without replacement from mcieege? 1/14 Four letters picked without replacement from {q: 3, c: 1, b: 2, x: 1}. Give prob of sequence bxqb. 1/140 Two letters picked without replacement from uvovssnvssssus. What is prob of sequence ns? 1/26 Four letters picked without replacement from hzzzpxxxpppxhhhx. What is prob of sequence hxxx? 1/182 Four letters picked without replacement from ihhhhchhhhchih. Give prob of sequence ihhh. 60/1001 Two letters picked without replacement from fvanffvnnvf. What is prob of sequence vf? 6/55 Three letters picked without replacement from {y: 4, k: 2, m: 4, d: 4}. What is prob of sequence kyd? 4/273 What is prob of sequence sshh when four letters picked without replacement from {h: 6, s: 2}? 1/28 What is prob of sequence ss when two letters picked without replacement from xsxsxsxx? 3/28 What is prob of sequence xhee when four letters picked without replacement from lexlhxhexhhxxlh? 5/3276 Four letters picked without replacement from {e: 16, j: 2}. What is prob of sequence ejee? 14/153 What is prob of sequence mkm when three letters picked without replacement from {h: 2, z: 3, k: 1, b: 2, m: 8, i: 1}? 7/510 Four letters picked without replacement from {p: 2, y: 2, o: 3, m: 5, z: 3}. Give prob of sequence oyyz. 1/1820 Two letters picked without replacement from {m: 7}. What is prob of sequence mm? 1 Four letters picked without replacement from bwotbnbbb. What is prob of sequence bont? 5/3024 Two letters picked without replacement from {r: 18, n: 2}. What is prob of sequence nr? 9/95 What is prob of sequence in when two letters picked without replacement from {i: 2, n: 3, m: 3}? 3/28 What is prob of sequence rrhn when four letters picked without replacement from {m: 3, n: 2, r: 2, h: 8}? 4/4095 Two letters picked without replacement from agttgvl. Give prob of sequence av. 1/42 Calculate prob of sequence vt when two letters picked without replacement from vvvtvvvvvvvttvvvtvtv. 15/76 Four letters picked without replacement from {j: 4, w: 2, m: 1}. What is prob of sequence jmwj? 1/35 Calculate prob of sequence zc when two letters pic	{ "pile_set_name": "DM Mathematics" }
i'th term of -73, -136, -293, -592, -1081? -8i3 + i2 - 10i - 56 What is the z'th term of -592, -589, -586, -583, -580? 3z - 595 What is the j'th term of -48427, -48426, -48425, -48424, -48423? j - 48428 What is the g'th term of -152, -135, -102, -47, 36, 153? g3 + 2g*2 + 4g - 159 What is the u'th term of -2, -10, -22, -38, -58, -82? -2u2 - 2u + 2 What is the n'th term of -166, -334, -502? -168n + 2 What is the z'th term of 14, 51, 84, 113, 138, 159? -2z*2 + 43z - 27 What is the s'th term of -20, -21, -22, -23? -s - 19 What is the j'th term of 98, 193, 288? 95j + 3 What is the q'th term of -9, 66, 299, 768, 1551, 2726, 4371, 6564? 13q3 + q2 - 19q - 4 What is the s'th term of 154, 307, 460, 613, 766, 919? 153s + 1 What is the m'th term of 470, 493, 516, 539, 562, 585? 23m + 447 What is the q'th term of 3, -19, -71, -165, -313, -527, -819? -2q*3 - 3q2 + q + 7 What is the f'th term of -12, -21, -40, -75, -132, -217? -f3 + f*2 - 5f - 7 What is the w'th term of 384, 385, 386, 387? w + 383 What is the m'th term of -295, -591, -885, -1177? m*2 - 299m + 3 What is the h'th term of -386, -364, -344, -326, -310, -296? -h*2 + 25h - 410 What is the a'th term of 266, 534, 802, 1070, 1338? 268a - 2 What is the i'th term of -1877, -1871, -1861, -1847, -1829, -1807? 2i2 - 1879 What is the w'th term of -265, -256, -235, -196, -133, -40, 89? w3 + 2w - 268 What is the g'th term of -39, -135, -291, -501, -759, -1059? g3 - 36g*2 + 5g - 9 What is the q'th term of 42, 209, 480, 849, 1310? -q*3 + 58q2 - 15 What is the p'th term of -64, -68, -82, -112, -164? -p3 + p*2 - 64 What is the i'th term of 8517, 8516, 8515? -i + 8518 What is the v'th term of -5, -43, -141, -329, -637? -5v*3 - 3v + 3 What is the n'th term of -139, -155, -175, -199? -2n2 - 10n - 127 What is the h'th term of -1515, -3029, -4543? -1514h - 1 What is the y'th term of -96, -189, -274, -351, -420? 4y*2 - 105y + 5 What is the q'th term of 30, 25, 16, 3, -14, -35? -2q2 + q + 31 What is the u'th term of -2289, -2290, -2291, -2292, -2293, -2294? -u - 2288 What is the j'th term of 79, 267, 565, 973, 1491? 55j*2 + 23j + 1 What is the p'th term of -142, -582, -1314, -2338? -146p2 - 2p + 6 What is the z'th term of 20, 41, 64, 89? z*2 + 18z + 1 What is the l'th term of 3, 83, 305, 741, 1463, 2543? 12l3 - l2 - l - 7 What is the u'th term of -16, -36, -44, -34, 0, 64, 164? u3 - 27u + 10 What is the d'th term of -106, -225, -346, -469, -594, -721, -850? -d*2 - 116d + 11 What is the o'th term of -20, -24, -22, -8, 24, 80, 166? o*3 - 3o*2 - 2o - 16 What is the j'th term of -22, -54, -92, -136, -186, -242? -3j2 - 23j + 4 What is the v'th term of -240, -227, -204, -171? 5v2 - 2v - 243 What is the n'th term of 20, 28, 36, 44, 52, 60? 8n + 12 What is the w'th term of 186, 400, 612, 822, 1030? -w2 + 217w - 30 What is the d'th term of 77, 150, 245, 368, 525? d*3 + 5d*2 + 51d + 20 What is the a'th term of -4, 9, 48, 125, 252, 441? 2a3 + a2 - 4a - 3 What is the c'th term of 1225, 2451, 3681, 4915, 6153, 7395, 8641? 2c2 + 1220c + 3 What is the f'th term of 1295, 1278, 1237, 1160, 1035, 850? -2f3 - 3f + 1300 What is the i'th term of -38, -10, 34, 100, 194? i*3 + 2i*2 + 15i - 56 What is the a'th term of 199, 392, 565, 712, 827, 904, 937, 920? -a*3 - 4a*2 + 212a - 8 What is the v'th term of -20, -77, -172, -305, -476? -19v2 - 1 What is the p'th term of -333, -672, -1021, -1386, -1773, -2188, -2637? -p3 + p2 - 335p + 2 What is the g'th term of -594, -1178, -1774, -2388, -3026, -3694, -4398? -g*3 - 577g - 16 What is the s'th term of -734, -714, -694, -674? 20s - 754 What is the m'th term of 48, 36, 8, -42, -120, -232, -384, -582? -m3 - 2m2 + m + 50 What is the j'th term of 0, 0, -2, -6, -12, -20, -30? -j2 + 3j - 2 What is the z'th term of -79, -320, -743, -1366, -2207, -3284, -4615? -3z*3 - 73z2 - z - 2 What is the k'th term of -575, -574, -573, -572? k - 576 What is the x'th term of -3261, -6526, -9793, -13062? -x2 - 3262x + 2 What is the r'th term of -1828, -1838, -1860, -1900, -1964, -2058? -r3 - 3r - 1824 What is the x'th term of 25, 4, -31, -86, -167, -280, -431? -x3 - x2 - 11x + 38 What is the k'th term of -138, -269, -388, -489, -566, -613, -624, -593? k3 - 138k - 1 What is the w'th term of -21, 31, 177, 465, 943, 1659, 2661, 3997? 8w3 - w2 - w - 27 What is the x'th term of 100, 95, 90, 85? -5x + 105 What is the d'th term of -943, -940, -935, -928, -919? d*2 - 944 What is the f'th term of -472, -479, -492, -511? -3f*2 + 2f - 471 What is the n'th term of -102, -97, -90, -81? n*2 + 2n - 105 What is the q'th term of -11432, -11433, -11434, -11435? -q - 11431 What is the q'th term of -5, -25, -67, -137, -241, -385? -q*3 - 5q*2 + 2q - 1 What is the h'th term of 225, 232, 243, 258, 277, 300? 2h2 + h + 222 What is the x'th term of -134, -164, -194, -224, -254, -284? -30x - 104 What is the j'th term of 634, 630, 624, 616, 606, 594, 580? -j*2 - j + 636 What is the t'th term of 7, -1, -13, -29, -49, -73, -101? -2t*2 - 2t + 11 What is the h'th term of 608, 1230, 1852, 2474? 622h - 14 What is the g'th term of 4764, 9527, 14290, 19053, 23816? 4763g + 1 What is the y'th term of 11, -12, -57, -130, -237, -384, -577? -y*3 - 5y*2 - y + 18 What is the k'th term of 26, 43, 54, 59, 58? -3k*2 + 26k + 3 What is the q'th term of 185, 373, 563, 755, 949? q*2 + 185q - 1 What is the s'th term of -2386, -4778, -7174, -9574? -2s2 - 2386s + 2 What is the s'th term of 1878, 3747, 5618, 7491, 9366? s*2 + 1866s + 11 What is the a'th term of 12, 10, 8, 6? -2a + 14 What is the r'th term of -5907, -11816, -17725, -23634, -29543? -5909r + 2 What is the u'th term of 12, 56, 130, 240, 392? u*3 + 9u*2 + 10u - 8 What is the v'th term of 89, 86, 83, 80, 77, 74? -3v + 92 What is the z'th term of -191, -219, -287, -413, -615? -3z*3 - 2z*2 - z - 185 What is the g'th term of 26, 66, 126, 218, 354, 546? 2g*3 - 2g*2 + 32g - 6 What is the n'th term of 878, 1750, 2620, 3488, 4354, 5218, 6080? -n*2 + 875n + 4 What is the q'th term of -3888, -7783, -11682, -15585, -19492, -23403? -2q2 - 3889q + 3 What is the l'th term of 13, 4, 3, 16, 49, 108, 199, 328? l*3 - 2l*2 - 10l + 24 What is the y'th term of -300, -602, -904, -1206, -1508? -302y + 2 What is the j'th term of -201, -204, -205, -204? j2 - 6j - 196 What is the o'th term of -161, -170, -183, -200, -221? -2o2 - 3o - 156 What is the a'th term of 20, 23, 8, -31, -100, -205, -352? -a*3 - 3a*2 + 19a + 5 What is the q'th term of 69, 250, 551, 972? 60q2 + q + 8 What is the k'th term of 27, 50, 85, 132, 191, 262, 345? 6k*2 + 5k + 16 What is the v'th term of 28, 44, 72, 118, 188, 288? v*3 + 9v + 18 What is the f'th term of 15, 19, 23, 27? 4f + 11 What is the z'th term of 2277, 4550, 6821, 9090, 11357, 13622? -z2 + 2276z + 2 What is the i'th term of -8352, -8349, -8344, -8337? i2 - 8353 What is the b'th term of 494, 491, 486, 479, 470, 459? -b2 + 495 What is the d'th term of -84, -77, -66, -51, -32, -9? 2d2 + d - 87 What is the d'th term of 12466, 12467, 12468, 12469, 12470, 12471? d + 12465 What is the q'th term of 34, 26, 22, 28, 50, 94, 166, 272? q3 - 4q*2 - 3q + 40 What is the c'th term of 6, -20, -54, -102, -170, -264, -390? -c*3 + 2c*2 - 25c + 30 What is the i'th term of -21, -27, -55, -117, -225? -2i3 + i2 + 5i - 25 What is the k'th term of -16, -19, -22, -25, -28, -31? -3k - 13 What is the z'th term of -2065, -4132, -6199? -2067z + 2 What is the w'th term of 104, 223, 352, 497, 664, 859, 1088? w3 - w2 + 115w - 11 What is the i'th term of 45, 94, 143, 192, 241, 290? 49i - 4 What is the o'th term of 242, 448, 656, 866, 1078? o*2 + 203o + 38 What is the r'th term of -191, -192, -193, -194, -195, -196? -r - 190 What is the z'th term of 1, -8, -25, -50? -4z2 + 3z + 2 What is the z'th term of 0, -8, -16, -24, -32, -40? -8z + 8 What is the x'th term of -148, -300, -452? -152x + 4 What is the o'th term of -440, -419, -378, -311, -212, -75, 106? o*3 + 4o*2 + 2o - 447 What is the h'th term of 68, 69, 84, 119, 180, 273, 404, 579	{ "pile_set_name": "DM Mathematics" }
0 Solve 612p + 180 = 632p for p. 9 Solve 0 = -89z - 135z - 1846 - 6890 for z. -39 Solve 606k - 505 + 1369 = 552k for k. -16 Solve 409s = -48s + 7s + 10800 for s. 24 Solve -203o - 146o - 119o - 8892 = 0 for o. -19 Solve 763m = 747m - 192 for m. -12 Solve 532 = -4483d + 4407d for d. -7 Solve -349q - 2248 = 1591 for q. -11 Solve -1671r + 70 = -1657r for r. 5 Solve 0 = -75q + 150q + 1125 for q. -15 Solve 18 - 26 = 8i for i. -1 Solve -1051y + 570y + 537y = 280 for y. 5 Solve -24x + 2515 - 2467 = 0 for x. 2 Solve -182l = -42l + 297 + 263 for l. -4 Solve 0 = -20a - 1541 + 1801 for a. 13 Solve 63q + 59q = -21q + 143 for q. 1 Solve 0 = 1337p - 1271p - 858 for p. 13 Solve -49w + w + 113 = -223 for w. 7 Solve 1351n - 1354n + 7 = -5 for n. 4 Solve 0 = 20w - 19w - 34w + 165 for w. 5 Solve 19 = 16289q - 16308q for q. -1 Solve -13337g + 847 + 233 = -13283g for g. 20 Solve 0 = 2m - 16 + 13 + 15 for m. -6 Solve -333012j - 21 = -333019j for j. 3 Solve -644n - 245n + 15461 + 541 = 0 for n. 18 Solve 0 = -381z + 424z + 731 for z. -17 Solve 215g - 1950 = -5390 for g. -16 Solve -62v - 6628 + 1687 = 121v for v. -27 Solve -1542 = -36z - 1182 for z. 10 Solve -19287 + 18357 = -62n for n. 15 Solve -177t + 24 - 2325 = 0 for t. -13 Solve -3723w + 3703w = 140 for w. -7 Solve 7h + 545 + 50 = -78h for h. -7 Solve -43 + 41 + 192 = 19c for c. 10 Solve -10r + 145 = -3r + 180 for r. -5 Solve 61y = 18y + 301 for y. 7 Solve 0 = 28c + 566 - 370 for c. -7 Solve 10w = -2w - 15w - 27 for w. -1 Solve 119k - 1983 = -198 for k. 15 Solve -244 = 8x + 10x - 388 for x. 8 Solve -267q - 661 = 131q + 135 for q. -2 Solve 0 = 24l - 3136 + 2704 for l. 18 Solve -919 = -891p + 700p + 991 for p. 10 Solve -12k - 38 = 41k + 598 for k. -12 Solve -1285 = -45t - 1645 for t. -8 Solve -90 = -20l + 165 - 15 for l. 12 Solve -34f = -44f - 80 for f. -8 Solve -62f + 105 = -205 for f. 5 Solve 0 = 573g - 62 - 511 for g. 1 Solve 4463h - 4443h - 120 = 0 for h. 6 Solve 110i + 2377 = 2817 for i. 4 Solve 3703o - 3735o = -64 for o. 2 Solve 844k + 1280 = 8032 for k. 8 Solve -18j - 9j = -2j - 500 for j. 20 Solve -1669 + 4681 = 251l for l. 12 Solve -74t + 669 + 70 = 147 for t. 8 Solve 36n + 35n + 279 = 80n for n. 31 Solve 80s - 39s + 1092 = 132s for s. 12 Solve 1318l = 1393l + 1125 for l. -15 Solve 110x + 23x + 40 - 971 = 0 for x. 7 Solve -252v + 756v + 1078 = 70 for v. -2 Solve 4z - 4z = 2z + 12z for z. 0 Solve -92 = -78s + 64 for s. 2 Solve 63o - 1192 = -73o + 576 for o. 13 Solve 192x = 157 - 3229 for x. -16 Solve 0 = -8f - 16f - 17 + 305 for f. 12 Solve 0 = -364g - 49g - 116g - 11638 for g. -22 Solve 0 = 339a - 341a for a. 0 Solve 64a - 71a = -14 for a. 2 Solve -24g = 19g - 60 + 232 for g. -4 Solve -4149m - 4197m - 572 = -8302m for m. -13 Solve 291o + 301 = 312o - 371 for o. 32 Solve -923k + 850k = -1241 for k. 17 Solve 18426 + 4962 = -1209b - 792 for b. -20 Solve -130w + 360 = -202w for w. -5 Solve 1862h = 3312h + 44950 for h. -31 Solve 19328 = -17c + 18903 for c. -25 Solve 1251 = -45v + 441 for v. -18 Solve -1028s - 1026s - 3850 = -1944s for s. -35 Solve -17g = 46g + 226g + 2890 for g. -10 Solve 68n - 127n = -413 for n. 7 Solve 3747b = 1456b + 87058 for b. 38 Solve -13 + 171 = -53q - 54 for q. -4 Solve -113461q + 113487q - 650 = 0 for q. 25 Solve -107w + 68w = -351 for w. 9 Solve -618 + 961 + 1631 = -141j for j. -14 Solve 0 = -101h + 208h + 300h - 3663 for h. 9 Solve 16v + 132 + 78 = 37v for v. 10 Solve 178m - 99m = -237 for m. -3 Solve 286 + 54 + 254 = 198w for w. 3 Solve -13w - 340 = 15w + 6w for w. -10 Solve 148z - 235 - 490 = 163 for z. 6 Solve -139m - 2962 = -43 for m. -21 Solve -76q = 131q + 88q - 4720 for q. 16 Solve -39 = 63y - 76y for y. 3 Solve 260x - 930 + 3192 = -2418 for x. -18 Solve 11133 = -994d + 3181 for d. -8 Solve 12038f + 536 = 11930f + 2588 for f. 19 Solve -550o = -476o + 1554 for o. -21 Solve 780 = -1530v + 1470v for v. -13 Solve -816 = 71c + 31c for c. -8 Solve 0 = -472r + 467r - 30 for r. -6 Solve 1514t + 7408 + 1208 + 468 = 0 for t. -6 Solve 1548k - 1596k - 960 = 0 for k. -20 Solve 2l - 1569 = -1559 for l. 5 Solve 0 = -115s - 61s + 4s - 3612 for s. -21 Solve 686 = -16s + 64s + s for s. 14 Solve 108 = 9484i - 9472i for i. 9 Solve 4015 = 194i + 62 - 703 for i. 24 Solve 697q - 116 + 14 = 595q for q. 1 Solve 0 = 220o + 80o - 11889 + 4089 for o. 26 Solve 5u + 196 = -93u for u. -2 Solve 6b + 384 = 13b + 17b for b. 16 Solve 148k - 482 = 542 + 604 for k. 11 Solve 0 = -134h - 136h - 2430 for h. -9 Solve 37j + 22j + 450 = 44j for j. -30 Solve 2294 - 1368 = -24t + 1454 for t. 22 Solve -51x - 1324 + 814 = 0 for x. -10 Solve 5163 = -24z + 4539 for z. -26 Solve 55478x = 55535x + 1710 for x. -30 Solve 45v + 850 = 10v - 50v for v. -10 Solve 112r - 47r = 52r + 182 for r. 14 Solve -484 + 674 = 10i for i. 19 Solve 5l = -58l - 39 - 213 for l. -4 Solve -48f - 25 = -121 for f. 2 Solve 142w - 350w - 40 = -168w for w. -1 Solve 50r + 288 = 66r for r. 18 Solve 44f + 14f - 11 = -69 for f. -1 Solve 192i - 2521 = -793 for i. 9 Solve 76z + 23 = 53z for z. -1 Solve -102f + 161 = 977 for f. -8 Solve -109 + 174 + 351 = 32z for z. 13 Solve 1628n - 471n + 47437 = 0 for n. -41 Solve 0 = -10l - 147l + 3053 + 87 for l. 20 Solve 11388r + 84 = 11374r for r. -6 Solve 0 = -91l - 456 - 1546 for l. -22 Solve -177m - 148m = 233m + 2790 for m. -5 Solve -1427 = -125p + 2698 for p. 33 Solve 0 = -17k + 8331 - 8552 for k. -13 Solve 180 = 43401o - 43392o for o. 20 Solve -2706 + 594 = -56j - 136j for j. 11 Solve -4596 = 694h - 6209 - 10879 for h. 18 Solve -494 = -30379c + 30398c for c. -26 Solve 4460 = 176g + 14g + 33g for g. 20 Solve 0 = 7k - 28k - 2k + 161 for k. 7 Solve -311 - 251 = 23a - 723 for a. 7 Solve 2q - 71q + 1188 = 39q for q. 11 Solve 74 = 85n + 781 - 27 for n. -8 Solve 54w - 98 = 165 + 61 for w. 6 Solve 71x - 116x - 90x - 405 = 0 for x. -3 Solve 44h - 10h - 528 = h for h. 16 Solve -163m + 7m = 14m + 1020 for m. -6 Solve -269p = -493p + 266p + 1344 for p. -32 Solve 8m = -13m - 24m + 585 for m. 13 Solve 13g - 77 = 3g + 53 for g. 13 Solve 745o - 3010 = 530o for o. 14 Solve 793o = 762o + 155 for o. 5 Solve 0 = -10293z + 10325z - 384 for z. 12 Solve 10397 = 27o + 10262 for o. 5 Solve 16c + 188 + 112 = -14c for c. -10 Solve -1767 + 210 = -173k for k. 9 Solve 0 = 75w + 50 - 403 - 22 for w. 5 Solve -846k + 875k + 174 = 0 for k. -6 Solve -1709 = -192u + 19 for u. 9 Solve 25r - 461 = -261 for r. 8 Solve 568o = 590o - 22 for o. 1 Solve -183a + 444 = -220a for a. -12 Solve -1025s = -108s + 13755 for s. -15 Solve 476 = 152u + 215 - 651 for u. 6 Solve -68 + 50 = -6u for u. 3 Solve 298m = -350m + 8424 for m. 13 Solve 276g - 30 - 3558 = 0 for g. 13 Solve 65 = 304l - 1945 - 2246 for l. 14 Solve 46z - 3 = 43 for z. 1 Solve 0 = 21l - 60l + 32l + 56 for l. 8 Solve 0 = -8f + 5f + 158 - 146 for f. 4 Solve 25y = -1713 + 1388 for y. -13 Solve 57s + 103s = -55s + 430 for s. 2 Solve -46b = -19b - 81 for b. 3 Solve -t + 157899 = 157917 for t. -18 Solve 441k = 435k + 12 for k. 2 Solve -292k + 702 = -238k for k. 13 Solve 11917k - 624 = 11869k for k. 13 Solve 644 = 77j + 15j for j. 7 Solve 61g + 146 = 13g - 25g for g. -2 Solve -610u + 14956 = -904 for u. 26 Solve 240v - 1387v - 727v = 0 for v. 0 Solve -216 = -263n + 227n for n. 6 Solve -406x - 171 = -387x for x. -9 Solve 1692 = 60l + 2352 for l. -11 Solve 1267z + 42417 = 10742 for z. -25 Solve 51g - 49g - 2 = -8 for g. -3 Solve 13t = 6t - 5t - 180 for t. -15 Solve 198t = 1361 + 25 for t. 7 Solve -21f = 91f + 274f - 11580 for f. 30 Solve -104k = 146k - 250 for k. 1 Solve 25a + 24 = 37a for a. 2 Solve -33f - 1011 = -1242 for f. 7 Solve 689 - 89 = 75u for u. 8 Solve -4579 + 4535 = -22u for u. 2 Solve -52a = 43a - 116a + 210 for a. 10 Solve 95p = -35p + 23p - 214 for p. -2 Solve 422 = -81y + 1475 for y. 13 Solve -3347 = -824v + 19725 for v. 28 Solve -109g - 38g = 196g + 3773 for g. -11 Solve 0 = 25q - 877 + 252 for q. 25 Solve -35 = 57482	{ "pile_set_name": "DM Mathematics" }
next term in 17, 30, 47, 74, 117, 182, 275? 402 What comes next: 297, 1217, 2751, 4899? 7661 What is next in -282, -567, -852, -1137, -1422? -1707 What is next in 623, 621, 609, 581, 531, 453, 341? 189 What is next in -2639, -2634, -2629, -2624, -2619, -2614? -2609 What is next in -58, -105, -170, -265, -402, -593, -850, -1185? -1610 What is the next term in 984, 1968, 2952, 3936, 4920? 5904 What is the next term in 8, 35, 58, 77, 92, 103? 110 What is the next term in -146, -293, -430, -551, -650, -721? -758 What comes next: 137, 152, 165, 176? 185 What comes next: -36, -170, -400, -726, -1148? -1666 What is the next term in -1528, -1539, -1564, -1609, -1680, -1783, -1924, -2109? -2344 What is the next term in -7, -31, -73, -139, -235, -367, -541, -763? -1039 What is the next term in 48, 101, 198, 339, 524, 753, 1026? 1343 What is next in -1895, -1897, -1901, -1907? -1915 What is the next term in -306, -612, -918, -1224, -1530, -1836? -2142 What comes next: -193, -263, -335, -409, -485, -563? -643 What comes next: 69, 102, 201, 402, 741, 1254, 1977? 2946 What is next in -490, -997, -1504? -2011 What is the next term in -64, -457, -1524, -3601, -7024, -12129, -19252, -28729? -40896 What comes next: -637, -1287, -1935, -2581? -3225 What is next in -73, -305, -697, -1255, -1985? -2893 What is the next term in 81, 160, 243, 330, 421, 516, 615? 718 What comes next: -48, -47, -46, -45, -44? -43 What comes next: 619, 1236, 1853, 2470, 3087? 3704 What is the next term in -91, -78, -61, -40, -15, 14, 47? 84 What is next in 14, 15, 16, 17, 18? 19 What comes next: 16, 6, 4, 16, 48? 106 What is next in 204, 195, 180, 159, 132? 99 What is next in -216, -432, -648? -864 What comes next: 29, 107, 245, 449, 725, 1079, 1517? 2045 What is the next term in -75, 26, 193, 426, 725, 1090? 1521 What comes next: -53, -42, -13, 40, 123, 242, 403? 612 What is the next term in -13618, -27235, -40852? -54469 What is the next term in 190, 390, 592, 796, 1002, 1210? 1420 What comes next: 20, 23, 26, 29? 32 What is the next term in -283, -289, -305, -337, -391? -473 What is the next term in -11, -30, -61, -104, -159, -226, -305? -396 What comes next: 2, 0, 12, 44, 102, 192? 320 What comes next: 29, 148, 345, 620, 973? 1404 What is the next term in -339, -336, -333? -330 What is next in 30, 52, 58, 48, 22, -20, -78? -152 What comes next: -179, -361, -541, -719, -895? -1069 What is next in -47, -23, 3, 31? 61 What comes next: 111, 132, 189, 300, 483, 756, 1137, 1644? 2295 What comes next: 113, 107, 99, 89? 77 What is next in 35, 47, 59? 71 What is next in -9, 13, 35, 57, 79, 101? 123 What is the next term in -97, -379, -847, -1501, -2341? -3367 What comes next: 28, 27, 36, 61, 108, 183? 292 What comes next: -45, -13, 47, 141, 275, 455, 687? 977 What comes next: 280, 268, 252, 232, 208? 180 What is next in 25, -62, -217, -446, -755, -1150? -1637 What is the next term in -15, -18, -13, 0, 21, 50? 87 What is the next term in -1310, -1312, -1314, -1316, -1318, -1320? -1322 What is next in 2707, 5429, 8163, 10915, 13691, 16497? 19339 What comes next: -10, 19, 60, 119, 202, 315, 464? 655 What comes next: -9, -20, -53, -120, -233, -404, -645? -968 What is the next term in 6, 112, 398, 954, 1870, 3236? 5142 What is the next term in -8341, -8340, -8339, -8338? -8337 What is the next term in 777, 1542, 2307, 3072? 3837 What comes next: 461, 909, 1335, 1733, 2097, 2421, 2699, 2925? 3093 What is the next term in -39, -76, -113? -150 What comes next: 12, 25, 14, -33, -128? -283 What is the next term in 340, 1384, 3130, 5578? 8728 What comes next: 832, 826, 810, 778, 724, 642? 526 What is next in 5923, 5924, 5925, 5926, 5927? 5928 What is next in 14, 15, 30, 65, 126, 219, 350, 525? 750 What is the next term in -5232, -5236, -5250, -5280, -5332? -5412 What is the next term in -17, -67, -147, -263, -421? -627 What is the next term in 883, 870, 843, 796, 723? 618 What is the next term in -55, -204, -451, -796, -1239? -1780 What comes next: -101, -107, -127, -167, -233, -331? -467 What is next in -51, -97, -145, -195? -247 What comes next: 158, 638, 1444, 2582, 4058, 5878? 8048 What is the next term in -289, -565, -831, -1081, -1309, -1509, -1675, -1801? -1881 What is next in 7, 23, 49, 85, 131? 187 What is next in 100, 107, 118, 133, 152? 175 What comes next: 80, 83, 96, 125, 176, 255, 368? 521 What is next in -105, -208, -309, -408, -505? -600 What is the next term in -10, -19, -44, -91, -166, -275? -424 What comes next: -35, -51, -67, -83, -99? -115 What is the next term in 32, 27, 22, 17, 12? 7 What comes next: 235, 227, 229, 247, 287, 355, 457, 599? 787 What comes next: -498, -1992, -4482, -7968, -12450, -17928, -24402? -31872 What is next in -8, 10, 36, 70, 112? 162 What is next in 12, 23, 48, 93, 164, 267? 408 What is the next term in 69, 91, 129, 183, 253, 339, 441? 559 What comes next: 56, 194, 414, 716, 1100? 1566 What comes next: -99, -99, -103, -111, -123, -139? -159 What comes next: -99, -192, -285, -378? -471 What is the next term in -139, -286, -433? -580 What comes next: -1353, -1347, -1341, -1335? -1329 What comes next: -675, -681, -689, -699? -711 What is the next term in 33, 97, 203, 351, 541, 773, 1047? 1363 What comes next: 204, 328, 452, 576? 700 What is next in 5469, 5459, 5435, 5391, 5321, 5219, 5079, 4895? 4661 What is the next term in 69, 133, 207, 297, 409, 549, 723, 937? 1197 What comes next: -15, -31, -51, -75? -103 What comes next: -45, -92, -137, -180, -221? -260 What is next in -30, -48, -58, -60, -54? -40 What is the next term in 398, 795, 1192, 1589, 1986, 2383? 2780 What comes next: 12, 19, 30, 51, 88, 147, 234? 355 What comes next: -2, -28, -72, -134, -214, -312, -428? -562 What is next in -379, -382, -385, -388, -391? -394 What comes next: 1, 14, 53, 130, 257, 446, 709, 1058? 1505 What is the next term in 112, 109, 104, 97, 88? 77 What is the next term in -368, -742, -1116, -1490? -1864 What is next in -1618, -3231, -4840, -6439, -8022, -9583, -11116, -12615? -14074 What is next in 39, 137, 297, 519, 803? 1149 What is the next term in -5, 3, 17, 37? 63 What is next in 46, 82, 120, 160, 202, 246? 292 What is the next term in 5, 3, -19, -73, -171, -325? -547 What is next in 717, 724, 745, 786, 853, 952, 1089? 1270 What is the next term in 18, -9, -50, -111, -198, -317, -474, -675? -926 What is the next term in -10965, -21931, -32897? -43863 What is the next term in -270, -278, -286, -294, -302? -310 What is the next term in 469, 879, 1303, 1747, 2217, 2719, 3259, 3843? 4477 What is the next term in -441, -439, -437, -435, -433? -431 What comes next: -173, -176, -171, -152, -113, -48, 49, 184? 363 What is next in -21, -89, -209, -387, -629, -941, -1329, -1799? -2357 What comes next: -195, -388, -581? -774 What is next in 44, 16, -22, -64, -104, -136, -154, -152? -124 What is the next term in 249, 497, 745, 993, 1241? 1489 What is next in -39, -272, -903, -2130, -4151, -7164? -11367 What is next in -4, -9, -32, -85, -180, -329, -544? -837 What comes next: 578, 579, 580, 581? 582 What comes next: -93, -142, -191, -240, -289? -338 What is next in -595, -591, -587, -583? -579 What is the next term in 2016, 2014, 2012? 2010 What comes next: 14, 29, 44, 59? 74 What comes next: -18, -42, -102, -222, -426? -738 What is the next term in 17, 35, 53, 71, 89? 107 What comes next: -95, -186, -277? -368 What is the next term in -4059, -4061, -4063, -4065, -4067? -4069 What is the next term in 157, 304, 445, 580? 709 What is next in -173, -207, -265, -347, -453? -583 What is the next term in -3036, -3042, -3052, -3066, -3084? -3106 What comes next: -527, -526, -525? -524 What is the next term in 42, 127, 254, 423, 634, 887? 1182 What is next in 375, 1450, 3249, 5778, 9043, 13050? 17805 What is the next term in -19, -87, -199, -355, -555, -799? -1087 What comes next: 696, 699, 724, 783, 888, 1051? 1284 What is the next term in -15, -58, -129, -228? -355 What is the next term in -18, -9, -8, -15? -30 What comes next: 162, 344, 560, 828, 1166, 1592, 2124, 2780? 3578 What is next in 504, 496, 488, 480, 472, 464? 456 What comes next: -11971, -23943, -35913, -47881? -59847 What is the next term in 2025, 4049, 6073? 8097 What is next in -108, -112, -118, -126? -136 What is the	{ "pile_set_name": "DM Mathematics" }
What is the second derivative of l*3 - 1909l*2 - 932l? 6l - 3818 Find the third derivative of -91c*4 - 3c*3 - 11c*2 + 13. -2184c - 18 Find the third derivative of 54f3h*3 + 2f*3h*2v + 2f2h*3v + 2f2h3 + f2v - 38fv wrt f. 324h*3 + 12h*2v What is the third derivative of 4r2z3 - r2 + 7rz*2 - 4r + 3z3 wrt z? 24r*2 + 18 What is the third derivative of 623j*5 - 171j*2? 37380j*2 What is the derivative of -68n*3q + 15nq - 3220q wrt n? -204n*2q + 15q What is the derivative of -48d*3 + d + 54? -144d*2 + 1 Differentiate -1327t*2 + 743 with respect to t. -2654t Find the third derivative of 614s3 + 2s*2 - 3709 wrt s. 3684 Find the second derivative of 603f*5 + 2f + 1. 12060f3 What is the third derivative of 529d*3g*3q + d*3 - 2d*2g*3q*3 + 5d*2gq3 - 43dg2q*3 + 2q*3 wrt g? 3174d*3q - 12d2q*3 What is the third derivative of 2bj2 + 73bjz*3 - 161bjz + bz2 + 7j*2z*4 wrt z? 438bj + 168j*2z Find the third derivative of -20f5 - 7f*4 + 16f3 + f2 - 8f - 42. -1200f*2 - 168f + 96 What is the second derivative of 3f3r*2 - 2461f*3r - f*3 - 3fr2 + 4r*3 - 23r*2 wrt r? 6f*3 - 6f + 24r - 46 What is the derivative of 10950k*2 - 733? 21900k What is the second derivative of 63n5 + 14n*4 - 1706n? 1260n3 + 168n*2 Find the second derivative of 23b*2j*3 + 2b*2 - 25j*3 - 70j - 2 wrt j. 138b2j - 150j Find the second derivative of -4568r*2 - 2r + 592. -9136 Differentiate -bsv*4 + 9bsv + 128bs + 28bv with respect to v. -4bsv3 + 9bs + 28b Find the third derivative of 3n3w*4 - 129n*3w*2 - 31nw3 - 3w*2 wrt w. 72n*3w - 186n Find the third derivative of 16c*3n + 18c3 + 2c*2n + 4c2 - 13n wrt c. 96n + 108 What is the third derivative of -4h*2r*4 - 3h*2r - 3h2 - 108hr4 + 73hr2 - hr - r*4 wrt r? -96h*2r - 2592hr - 24r Find the first derivative of 40a*2o + 206o wrt a. 80ao Find the first derivative of 3456v*2 - 6958 wrt v. 6912v What is the third derivative of -17n4 - 7n*3 + 55n*2 - 3n? -408n - 42 What is the third derivative of a3k*3t - 12a3k*2t - 4a3t - a*2gt + a2t + 4gk*3t - k*3t wrt k? 6a3t + 24gt - 6t What is the first derivative of -211cx2 - cx - 321x2 wrt c? -211x*2 - x Find the third derivative of -31q*5 + 47q*2 + 33q wrt q. -1860q2 What is the third derivative of -107w*4 + 3w*3 + 197w*2 + 2? -2568w + 18 Find the first derivative of 1169l3 - 7l - 29917 wrt l. 3507l2 - 7 What is the third derivative of f2q*4 + 362f*2 + 7fq3 + 2fq2 + q4 wrt q? 24f*2q + 42f + 24q What is the third derivative of -24f6 + 3f*5 + 8f*4 + 2f*2 - 11f + 17? -2880f3 + 180f*2 + 192f Find the third derivative of -11194p5 - 1752p*2. -671640p*2 Find the third derivative of -110x5 + x2 + 167. -6600x2 Find the third derivative of -5jx5 - 40jx4 + jx*2 - 2j + 11x2 wrt x. -300jx2 - 960jx What is the third derivative of 7d*3f*3g2 - d3f2g + 7d3f2 + d3fg*3 - 3d*3g*2 - 17f*4g*3 wrt f? 42d*3g*2 - 408fg3 What is the second derivative of 226h*4k + 3h2k - 1645hk wrt h? 2712h2k + 6k What is the third derivative of 13d*2f*3 + 3d*2f*2x*2 - 587d*2x*3 - dx*3 - 3f*5x + 3f3x*3 wrt f? 78d*2 - 180f*2x + 18x3 What is the derivative of -78v*3 - 2v + 61 wrt v? -234v2 - 2 What is the derivative of -6p*2 - 226p - 4783 wrt p? -12p - 226 Find the first derivative of -10ju4 + 3ju3 - 2ju - 5j - 1 wrt u. -40ju*3 + 9ju2 - 2j What is the second derivative of a*2mv2 - 2a*2v + 4amv - 192v*2 wrt v? 2a*2m - 384 What is the derivative of -469bw + 14654b - 14w wrt w? -469b - 14 What is the first derivative of -8b*3 + 315b*2c*2 - 6020c*2 wrt b? -24b*2 + 630bc2 What is the second derivative of 11b*2ju - 79b*2u*2 - 406bju*2 + bju - 2ju2 wrt b? 22ju - 158u2 What is the second derivative of p3v3 + p3 - 5p*2v*3 - 56pv + 4v*3 wrt p? 6pv3 + 6p - 10v3 Find the second derivative of -4574b*3m - 654bm + 5b wrt b. -27444bm What is the derivative of -131d*2i + 60d2 wrt i? -131d*2 What is the third derivative of -7361d*5 + 4d*2 - 2d - 12? -441660d2 What is the second derivative of ht*3 + 38ht2 - 2ht - h + 2t*4 + 29t*3 + 97t - 3 wrt t? 6ht + 76h + 24t*2 + 174t What is the third derivative of 10325a4 - 5a*2 + 537a wrt a? 247800a What is the first derivative of 62m*2r - 777m2 wrt r? 62m*2 Find the third derivative of -56kz4 - kz*3 + 2kz2 + 112k - 100z3 wrt z. -1344kz - 6k - 600 Find the second derivative of -p*2t*2 - 186p*2t + 195t2 wrt t. -2p*2 + 390 Find the third derivative of -7574a*6 - 6616a*2. -908880a*3 What is the second derivative of 247z*4 - 196z? 2964z2 What is the second derivative of 160j*2 + j + 4 wrt j? 320 What is the derivative of -23563t - 9985? -23563 Differentiate -5jlv3 - 2jl + 11jrv*3 + jv - 4lrv3 + 4rv2 + 4v*2 with respect to r. 11jv3 - 4lv3 + 4v*2 What is the second derivative of 6tu2 + 40t + 4u3 + u - 9 wrt u? 12t + 24u Differentiate -8im + 19i + 6m + 2 with respect to i. -8m + 19 What is the third derivative of -10h6m - 560h4m + 2h2m - 2hm + 1271m wrt h? -1200h*3m - 13440hm What is the first derivative of -987cv*2 + 76v*2 - 6 wrt c? -987v*2 Find the second derivative of 41ai3sy + 5ai3y - 82ai*2s*2y - 4i3s2 + i3sy + 2s2y + sy wrt s. -164ai2y - 8i3 + 4y What is the third derivative of 175l3r*3u*3 + 6l*2r*3u2 - l2ru - 7ru*3 wrt l? 1050r*3u*3 What is the derivative of 114wy - 124w + 6y + 3 wrt y? 114w + 6 What is the third derivative of 33h4 + 2h*3l - 15h3 + 1113h*2 + hl + 3h wrt h? 792h + 12l - 90 What is the third derivative of 29x*6 + 3x*5 - 45x*4 - 67x*2 - 2 wrt x? 3480x*3 + 180x*2 - 1080x Find the first derivative of -77p3 + p + 341. -231p*2 + 1 Find the second derivative of -af*5 - 6af - 54a - 5f5 - 2f*3 wrt f. -20af3 - 100f*3 - 12f What is the derivative of -cj + 945cl + 54j*3l - 5j3 wrt j? -c + 162j*2l - 15j2 What is the third derivative of 3398x*3z*6 - 2x*3z*2 - xz*2 - 38z*2 + 2 wrt z? 407760x*3z*3 What is the second derivative of -2c*5n - 1772c2n - 2cn - 11n wrt c? -40c*3n - 3544n What is the second derivative of 3681z*2 - 6176z? 7362 Find the second derivative of 232h2 - 518h. 464 What is the second derivative of 256o2 + 22o + 44 wrt o? 512 Differentiate j*2s*2 + 3j*2 + 2js - 24s*2 - 2s wrt j. 2js*2 + 6j + 2s What is the third derivative of 9lx5 - 2lx - 19x*2 - 2 wrt x? 540lx2 What is the third derivative of 70h*3m3 + h3m2 - 10h*2m + 65m3 wrt h? 420m*3 + 6m*2 What is the third derivative of 57t*4 - 9t*2 - 10t? 1368t Find the second derivative of 1800o*2 + 1012o. 3600 Differentiate -5hj*3 - 1098hq3 + 3126j*3q*3 + 4j*2q*3 wrt h. -5j*3 - 1098q3 Differentiate a3u2 - 186a*3 - 99au2 - 1 wrt u. 2a*3u - 198au What is the second derivative of -286p4v*2 + pv*2 - 88p - v*2 wrt p? -3432p*2v*2 Find the second derivative of 2q*2u*2 + 2018q*2u - 2q2 + 67qu2 + 2q - 3u2 wrt q. 4u*2 + 4036u - 4 What is the third derivative of 2i4 - 31i*3 + 1432i*2 wrt i? 48i - 186 What is the second derivative of -220p4 - 1343p? -2640p2 Find the second derivative of 21bf3 - 2bf2 - bf + 125b + 100f*3 - f - 2 wrt f. 126bf - 4b + 600f Find the second derivative of -6768y*5 - 3538y. -135360y3 What is the second derivative of m3z*2 + 49m*3 + 21m - 2z2 wrt m? 6mz2 + 294m What is the second derivative of kr4 + kr - 5k - 4363r*4 - 8r - 6 wrt r? 12kr*2 - 52356r*2 What is the second derivative of 502q*2 - 2q - 833	{ "pile_set_name": "DM Mathematics" }
a) 127 (b) 0.4 (c) -2/5 a Which is the third biggest value? (a) -0.24 (b) -3 (c) 3/7 b What is the second biggest value in 8, 3/7, 0.3? 3/7 Which is the second biggest value? (a) 1 (b) -5/3 (c) 29 (d) 0.3 (e) 3 e What is the smallest value in 1, -3, -0.1? -3 Which is the smallest value? (a) -0.15 (b) -7 (c) -49 (d) -2 c What is the second smallest value in -4, 2/15, 0.3, -2/3, 6? -2/3 What is the fifth smallest value in 5/6, -0.7, -17, -3, -2? 5/6 Which is the second smallest value? (a) -242 (b) -2/3 (c) -4 (d) 3 c Which is the smallest value? (a) 2/5 (b) 0.3 (c) -42/299 c What is the third smallest value in 1/51, -0.2, 0.4? 0.4 What is the second biggest value in -1/3, -1, -8.377? -1 Which is the smallest value? (a) 3 (b) 1/3 (c) 7 (d) 3/8 b What is the second biggest value in 4, 3/2, -0.5, 0, 2? 2 Which is the smallest value? (a) -5 (b) 2/29 (c) 35/11 (d) 1/2 (e) -3/5 a What is the biggest value in 0.3, -439, -3? 0.3 What is the third smallest value in 0.02, -2/11, 4, 2, 5? 2 What is the second biggest value in 68, -1/8, -2, -5? -1/8 Which is the second smallest value? (a) 607 (b) 0 (c) -1/5 (d) -2/3 c What is the smallest value in -13, -0.5, -0.04? -13 What is the third smallest value in 3, 1/3, 29? 29 What is the third biggest value in 47, -1/3, -0.07? -1/3 What is the second smallest value in 1, -45, -1.3, -1/8, -0.3? -1.3 Which is the smallest value? (a) -2/3 (b) -3/2 (c) -3 c What is the third biggest value in -3/4, 2, 5, 49, -4? 2 What is the third smallest value in 107, 5/2, 0.4? 107 Which is the fifth smallest value? (a) 1/12 (b) -5/3 (c) -3 (d) 3 (e) 1.2 d Which is the third biggest value? (a) -3/8 (b) 0.1 (c) -5 (d) 3 (e) -1/9 e What is the third biggest value in 0.2, -0.2, 0.3, 3/46, 1? 0.2 Which is the biggest value? (a) -2 (b) 4.41 (c) 1/4 b What is the third biggest value in -4/3, 56/9, -0.2, -3.7? -4/3 Which is the third biggest value? (a) 3 (b) 1 (c) 10 (d) 4 a Which is the fourth smallest value? (a) -75 (b) -1/3 (c) 0.03 (d) -0.5 c What is the fourth biggest value in -2/5, 5, 6/13, -1/7? -2/5 What is the third smallest value in 0.7, -5, 5/3, 4, 4/3? 4/3 Which is the fourth smallest value? (a) -1/9 (b) -5 (c) 0.5 (d) 10 d Which is the smallest value? (a) -2/77 (b) 0.6 (c) -4 c Which is the fourth smallest value? (a) -3 (b) -0.8 (c) 4 (d) -9 c What is the second smallest value in -2/99, -2/9, 5? -2/99 What is the third biggest value in 0, -0.3, -0.4, 38, 3/7? 0 Which is the third smallest value? (a) -2 (b) 1313 (c) 4 b What is the third smallest value in 5/2, -40, -1? 5/2 What is the smallest value in 3, -0.22, -4? -4 Which is the smallest value? (a) 3 (b) 0.5 (c) -19.4 (d) -4/7 c Which is the fourth smallest value? (a) 17 (b) -5 (c) -0.07 (d) 4 a Which is the smallest value? (a) -9 (b) 2 (c) -8 a Which is the second smallest value? (a) -2 (b) -4 (c) 4 (d) 1.1 a What is the third smallest value in -30, -12, -2/7? -2/7 What is the smallest value in 6, 0.5, 1, 3, -55? -55 Which is the third smallest value? (a) 5 (b) 12/11 (c) -31 a Which is the third biggest value? (a) -3 (b) 41/2 (c) 108 a Which is the third smallest value? (a) 39 (b) -1/4 (c) -2/9 (d) -1/2 c What is the second biggest value in 1/4, 0.3, 3, 9, 2? 3 Which is the fourth smallest value? (a) -0.014 (b) -8 (c) 2 (d) -0.4 c What is the biggest value in 0.3, 5, 7/13, 1/5? 5 What is the third biggest value in 0.4, -6, -11, -1? -6 Which is the second smallest value? (a) 2/7 (b) -27 (c) 4 a What is the second biggest value in -0.6, 1, 4, -5? 1 Which is the second biggest value? (a) -0.7 (b) -0.1 (c) -8/9 (d) 2 (e) -1 b What is the second smallest value in -2/61, 0.7, -3? -2/61 Which is the second biggest value? (a) 16/5 (b) -3 (c) 1/2 c What is the second smallest value in -1, 149, -0.9, -0.1? -0.9 What is the fifth biggest value in -2/11, 0.055, 1/3, -1, 5? -1 What is the second smallest value in -4, 0.03, 11? 0.03 What is the biggest value in 2/3, 2.2, -9? 2.2 Which is the second smallest value? (a) 0 (b) -27 (c) -0.2 c Which is the third smallest value? (a) 3/14 (b) 38 (c) 0 (d) 3 d What is the second biggest value in 5, 497, -6? 5 Which is the third biggest value? (a) 0.4 (b) -1.3 (c) -0.4 (d) 0 (e) 3 d What is the smallest value in 0.2, -2.4, -2, 1/3? -2.4 Which is the second smallest value? (a) 2/37 (b) 4/5 (c) -1/10 (d) 0.2 a Which is the third biggest value? (a) 0.5 (b) -0.3 (c) -1/2 (d) 0.2 (e) -5 b Which is the third biggest value? (a) -4 (b) -5/3 (c) -315 (d) -0.1 (e) 3/4 b What is the second biggest value in 45, -6/11, -8? -6/11 Which is the fourth biggest value? (a) -1 (b) -0.02 (c) -97 (d) 1 c Which is the biggest value? (a) 4 (b) 1 (c) -2/7 (d) 5 d What is the fourth biggest value in -0.22, -3/2, 0.5, -6, 4? -3/2 What is the third smallest value in 0.3, -1/5, -21/5? 0.3 Which is the fourth smallest value? (a) 1/6 (b) -5 (c) 1 (d) -8/7 c What is the second biggest value in 0.07, -835, 2, -0.4? 0.07 Which is the smallest value? (a) -0.3 (b) 2 (c) -34 c Which is the second biggest value? (a) -5 (b) -2 (c) 41 (d) 0.3 d What is the fifth smallest value in 2, 1/3, -3/4, 26, -4? 26 What is the third smallest value in 1, 2, 0.2, -2/7? 1 Which is the third biggest value? (a) -5/3 (b) -1/19 (c) -3 (d) 2/5 (e) 0.3 b Which is the biggest value? (a) -2 (b) 0.4 (c) 0.5 (d) 1/3 c What is the biggest value in 0.096, -2, -1? 0.096 Which is the second smallest value? (a) 0.5 (b) 3280 (c) 4 c Which is the smallest value? (a) -2/7 (b) 0.168 (c) 3 (d) 5 a What is the smallest value in -0.5, 2/21, -3/7, -22? -22 What is the third biggest value in 0.21, 0.04, -3/5? -3/5 What is the third smallest value in 12/25, -1, 4/41? 12/25 Which is the fourth smallest value? (a) 3 (b) 5 (c) 2/33 (d) -0.02 b Which is the biggest value? (a) -0.4 (b) -57 (c) 4 (d) 6 d Which is the second smallest value? (a) -6/5 (b) 3/2 (c) 0.1 (d) 0.3 (e) 0.09 e What is the biggest value in 0.07, 1/3, -0.8? 1/3 What is the fourth smallest value in 2, -1, 7, 0.2? 7 What is the second biggest value in -13/5, 2, -8, -0.3? -0.3 What is the smallest value in -7, 5/3, -2? -7 Which is the smallest value? (a) 40 (b) 39 (c) -1 c What is the fourth biggest value in -13, 1, 3, 2/3? -13 What is the second smallest value in 18, -5, 2.2? 2.2 What is the third smallest value in 4, -3, -0.035, 2/11? 2/11 What is the smallest value in 7, -1, -7/5, -2? -2 Which is the fourth biggest value? (a) -3/2 (b) 1 (c) 0.7 (d) 4 (e) 3 c Which is the fourth biggest value? (a) 3/4 (b) -4 (c) 4 (d) 1 b Which is the smallest value? (a) 1/5 (b) -1/2 (c) 0.3 (d) -0.01 (e) 1 b What is the second smallest value in -3/4, 0.1, -12? -3/4 What is the smallest value in 5, 0.1, 1/5, 4? 0.1 What is the second smallest value in 5/482, 1/6, 5? 1/6 Which is the second biggest value? (a) -19 (b) 3 (c) 0.4 (d) -3 (e) -10 c Which is the second smallest value? (a) 0.07 (b) 1/3 (c) -3.7 a Which is the fifth smallest value? (a) 0.1 (b) 1/6 (c) -3/7 (d) 2/7 (e) -4 d Which is the second biggest value? (a) 0.83 (b) 3 (c) 5 b Which is the smallest value? (a) -4 (b) -34 (c) -4/5 b What is the second biggest value in -0.5, 0.27, 2/97? 2/97 Which is the third biggest value? (a) 5 (b) -11/2 (c) 0.4 (d) -0.1 d What is the second smallest value in 0.63, 0.38, -1/3, 1/2, -5? -1/3 Which is the third smallest value? (a) 123 (b) -5 (c) 2/19 a What is the third smallest value in -7, -1/5, 0.3, 4, 1/6? 1/6 What is the second smallest value in -2, -4, 201? -2 Which is the smallest value? (a) -0.159 (b) 4 (c) 1 a Which is the smallest value? (a) 1 (b) 24/11 (c) -2/7 (d) -9 d Which is the third biggest value? (a) 2/11 (b) 0.04 (c) -5 c What is the fourth smallest value in -0.3, 0.2, -0.05, 5/7? 5/7 Which is the third smallest value? (a) 0 (b) 0.2 (c) 7 (d) 0.4 d What is the third biggest value in -2, 411, -1/2? -2 Which is the second smallest value? (a) -0.09 (b) 0.5 (c) 1 (d) 3/2 (e) 4 b Which is the third biggest value? (a) -2/11 (b) -2 (c) -1 (d) -0.71 c What is the biggest value in 11, -0.3, -3/5? 11 What is the biggest val	{ "pile_set_name": "DM Mathematics" }
9). Let c be (2 + 5)(48/4228)/(-2). Which is smaller: g or c? c Suppose -7w + 6w = -q + 130, 500 = -4w - q. Let y be (56/w)/((-2)/(-3)). Is 0.36 < y? False Suppose -3 = 4f + 97. Let j(l) = -l3 - 24l*2 + 26l + 27. Let i be j(f). Do -1 and i have different values? True Let z(g) = -g*3 + 8g*2 - 17g + 108. Let a be z(9). Let b = -142 - a. Which is greater: -120/7 or b? b Let w be 3828/8316 - 2/(-18) - 35040/(-77). Which is smaller: w or 456? w Let p = 131.88 - 128. Let z = p - 3.9. Let k = 7.8 - 8. Which is bigger: z or k? z Let j be (9 + 978/(-108))(-4)/34. Which is greater: j or 1? 1 Suppose -h - 252 + 408 = 0. Is h greater than 1251/8? False Suppose y + 3y = -w - 19, 3w = -2y - 17. Let u be (-12)/((-18)/y - (-2 + 5)). Let d be 0/u2/(-8). Which is smaller: -3/28 or d? -3/28 Let f = 1 - -10. Suppose 22 - 10 = 4v. Suppose -x - 2c = 8, 3x + 4c = -f - v. Which is greater: 6 or x? 6 Let p be 12/(21120/140)(-4)/(-10). Is p < 1? True Suppose -4q = -3p - 1041, -4q + q + 780 = -2p. Let m = -272 + q. Which is smaller: -22 or m? -22 Let d = 48 + -44. Suppose 177 = 3l + 5n, l - 261 = -dl + 3n. Let x be -1(2 - 112/l). Which is smaller: -1 or x? -1 Let p = 2611 + -2389. Suppose -w + 892 = 3w. Which is greater: w or p? w Let o = 1031 - 3121. Is -2090 greater than o? False Let n = -786.3 + 781.3. Which is greater: n or -207.5? n Suppose 3c - 2h - 40 = 2c, -4c + 5h + 175 = 0. Suppose 0 = -5w + c - 55. Let k be (-2 + 40/14)/w. Is -2 not equal to k? True Let w = -192 - -277. Let x = -130 + w. Let u = -45.1 - x. Which is greater: u or -0.3? u Let g = 32482 - 32633. Is g greater than -162? True Let n = -556.214 - -3.214. Which is smaller: n or -0.9? n Suppose -8h + 5h - 7 = y, 3h = y - 17. Which is smaller: h or -288/109? h Let t = -11/611 - 589/1222. Which is greater: t or 146.2? 146.2 Let q = -6848 - -6844. Which is smaller: q or 8? q Let v be (7 + -201)/(28/(7 - -21)). Let z = -1 + 1. Which is bigger: z or v? z Let g be 3/15 + 542/(-10). Suppose -11 = -33c - 1760. Is c >= g? True Let h(t) = t*3 - 10t*2 + 14t - 9. Let f be h(9). Let d be 241 - (0 + -8) - 7. Let r = d - 207. Is r at most as big as f? True Suppose -4m + 2w + 44 = 0, 13m + 32 = 16m - w. Let i be m/18(-81)/(-270). Do i and -15 have the same value? False Let w = -50.7691 + -0.2309. Which is smaller: 0.26 or w? w Let r be -10 + 34 - (25 + -3). Which is smaller: r or 158/69? r Let j = 29.95 + 4.05. Let u = j - -6. Which is bigger: 1 or u? u Suppose -12b + 1223 + 1597 = 0. Let u = 118 - b. Which is greater: u or -116? -116 Suppose 74b - 5n = 75b + 279, 0 = -4n + 8. Let s = 316 + b. Which is bigger: 25 or s? s Let b(c) = -2c - 12. Let y be b(-6). Suppose y = 3r + 108 - 63. Suppose -53o = -54o - 16. Which is smaller: o or r? o Let x = 19328 + -5469823/283. Which is greater: x or 5.2? 5.2 Let f = 28282 - 28280.59. Let y = -2 + 1.9. Which is bigger: f or y? f Suppose 3t = 3h - 3, 5t = -h + 4 - 15. Let i be 5/t(-3)/(45/12). Let w be (-250)/60 + i/(-6). Which is bigger: w or -5? w Let c = 3024642764519/733159 + -28878455/7. Let j = c - -2/1717. Is j bigger than 1? False Let h(s) = 48s + 18. Let i be h(2). Let y(l) be the third derivative of -11l*4/24 + 2l3/3 + l2. Let q be y(-10). Is i > q? False Let v = -1113 - -649. Let l = v + 463.8. Is l smaller than -7/13? False Let r(c) = -2c3 - 56c*2 - 105c - 25. Let s be r(-26). Is 2/409 at most s? True Let v be (7176/8740)/(2 + 42/(-20) + 0). Let b be 8/(-2)(-21)/12-1. Which is bigger: v or b? b Let w = 1355678/46805 + -16/2035. Is 29 > w? True Suppose -1416 = -l - 5l. Let h = l - 467. Let f = 4852/21 + h. Is -1 at least as big as f? False Suppose 2u + 10 = 0, -15w + 65 = -19w - u. Is w equal to 39? False Let f be (18/(-15)13180/18)/(2/3). Is f at most as big as -1319? False Let b be 9/((63/56)/((-30)/(-8))). Suppose -15t + b = -5t. Suppose 0 = -h + tm + 27, 3h - 41 - 32 = m. Which is bigger: h or 25? 25 Suppose 4h = -x + 197, 21 = 2h - 5x - 50. Let y = h + -48. Suppose yp = 2p - 4. Is 4/5 bigger than p? False Suppose 0 = 4o - 92 - 36. Let r = o + -18. Suppose -2m + 0m = -30. Which is smaller: r or m? r Let j = -41 - -43. Let t = -34.5246 + -0.5454. Let n = t + 35. Which is smaller: n or j? n Let v be (-40 - 2)(2 - (-21)/(-6)). Let q be (v/(-21))/(0 + 2/(-2)). Suppose -c - 4 = qc. Is c bigger than -1/18? False Let q = -1678 - -1677.309. Let b = q + -0.139. Is 0.2 greater than b? True Let u(f) be the first derivative of f4/4 + 23f*3/3 + 10f*2 - 3f - 44. Let j be u(-22). Is j at least as big as 41? True Let w = 0.37 - 69.37. Let v = w - -69. Let s = 15/2 - 8. Is v at most s? False Suppose 4a - 262 = 3a + 4k, -2k + 958 = 4a. Suppose -5g = -817 + a. Let c(b) = -37b - 402. Let h be c(-14). Which is greater: h or g? h Let s be ((-6176)/24 - 0)((-9)/(144/140) - -8). Let z be (-193)/(-11 - 0). Are s and z unequal? False Let t be (-6)/(-33) + (1512/33 - 1). Let w be (-6)/21(-28)/(-4). Let s be w/(-8) + 179/4. Are s and t nonequal? False Let o(v) = -4v - 23. Let c be (-546)/(-63)32/(-4). Let b be o(c). Let j = 38.1 + -38. Which is bigger: b or j? b Let t = 134213/4 - 33820. Let g = t + 265. Let m(l) = -15l + 239. Let w be m(16). Which is smaller: w or g? g Let b = -34.9 - 280.1. Let r = -583 - b. Is r bigger than 0? False Let d = 4889.259 - 4889. Which is smaller: d or 0.5? d Let t be 13832/(-36) - (6 - (-224)/(-36)). Let x = t - -1153/3. Are x and 8 equal? False Let n be ((-32)/12)/((-5)/360). Let c = n - 114. Let b = c - 59. Do 22 and b have different values? True Suppose -2k - 5u + 77 = -105, -4k + 2u = -388. Let l be (2/k20)/((-5)/(-890)). Is 75 greater than l? True Let c be (379 + -1)/3(-84)/(-36). Let b = c - 298. Which is smaller: b or -55/16? b Suppose 5l = 5d + 35, -1083 + 1064 = -4l + d. Is l less than or equal to 4004? True Suppose 2u + 9 = 5u. Let z(a) = -3a + 3. Let o be z(-6). Suppose -u = 2d - o. Is 9 equal to d? True Let m be (20/(-6))/((-1)/21). Suppose -19d = -11d - 60d + 3588. Is d >= m? False Let a be ((-4)/((-60)/85) - 9)669. Is a at least as big as -2230? True Let a = 74.8 + -11.8. Let m = -214 + 152.3. Let w = m + a. Which is smaller: w or 1/3? 1/3 Let r = 77 - 73. Let j be ((-20)/(-80))/((-1)/r). Which is bigger: -3/8 or j? -3/8 Let x(u) = 22u + 57. Let m be x(15). Suppose -m = 2c + c. Is c < -129? False Let u = 19205 + -19207. Suppose 0 = -3t - 0t + 18. Is u less than or equal to t? True Let y = 5.989 - -85.411. Let x = -141 - -51. Let r = y + x. Which is smaller: -1 or r? -1 Let w = -761/5523 - 4/789. Is w smaller than -1.323? False Let w be (-8 + (-2 - -2))(-105)/28. Let i be 1466/w + (-14)/(-105). Which is greater: i or 46? i Let w be 8(5/94)/(-5). Let s(i) = 12i + 575. Let r be s(-48). Is w smaller than r? False Let c be (12/(-16))/((-13)/52). Suppose 113 = 2v + cq, 28 = v + 3q - 21. Is 61 at most as big as v? True Suppose -5v - 174 + 645 = 236. Let l be (-33)/232/(-12). Is l greater than or equal to v? False Let l = 30255 - 30256. Let w = -6245 + 2635391/422. Which is greater: w or l? w Let v(w) = 4w + 40. Let u be (-24)/96 - (-78)/(-8). Let t be v(u). Suppose tm = 4m + 104. Are -26 and m non-equal? False Suppose 16y - 30y = -y + 6y. Is -2/38613 at least y? False Suppose -503g = -516g + 104. Is g >= 416/45? False Let i = 1443.9401 + -1444. Which is smaller: i or -1/2? -1/2 Let s be 2/11 - 4329/(-693). Suppose -7q = 2p - 2q - 32, -2q = -5p + 22. Is p greater than or equal to s? False Let o = -230 + 227.87. Let c = -2.13 - o. Which is smaller: -0.1 or c? -0.1 Let v(i) = -3i + 19. Let m be 20/(-8)(-56)/20. Let t be v(m). Let n = -3341/5320 - -2/665. Is t > n? False Let m be 855/(-9) + 70/7. Is -108 greater than m? False Let s = -0.0277309 + -209.0652691. Let z = 209 + s. Let k = z + -0.007. Which is smaller: -3/13 or k? -3/13 Suppose 6c - 280 + 76 = 0. Let w(i) = -3i + 32. Let m be w(10). Let g be (m/c)/(27/(-54)). Do g and 1 have the same value? False Let r(k) = -35k2 - k - 2. Let f be r(-1). Suppose -46g = -49g - 114. Let s = g - -1. Are f and s equal? False Suppose 3n - 4l - 25308 = -l, 0 = -4l. Let a be 2 - (2*36706/n - 1). Let y = 108/19 + a. Is -1 bigger than y? False	{ "pile_set_name": "DM Mathematics" }
is 52 + -47 - (7 + (0 - -1))? -3 7 - (12 + (-3 - 3)) 1 1 + 1 + 3 - 1 4 What is the value of -8 + (-3 - (-1 + -7))? -3 Evaluate 2 - 0 - (9 + -8 + 1). 0 4 + -4 + -1 + -3 -4 Calculate -3 - 0 - (3 + -6). 0 Calculate (-2 - -4) + -1 + (-4 - 2). -5 Evaluate -4 - (-1 - -1) - -9. 5 (-2 - -2) + (3 - 5) + 1 -1 Evaluate 0 + 3 + (1 - (-3 + 3)). 4 -3 - (6 - (5 + 3)) -1 Calculate 28 - 21 - (7 - 3). 3 Calculate 58 - 64 - (-2 - (-2 - -5)). -1 Calculate -3 - (5 + (-1 - 7) - 3). 3 What is (-1 - -2) + -1 + (-13 - -12)? -1 Calculate 6 + -7 + (-4 - -6). 1 Calculate 1 + -12 + (51 - 26) + -20. -6 -2 + 5 - (7 + -7) 3 Calculate 2 + 4 + -7 + 2. 1 What is -7 - -1 - (4 - 5)? -5 Evaluate -4 + (7 + 1 - (7 + -1)). -2 What is the value of -17 - -16 - (1 - 4)? 2 Evaluate (6 - 1) + -3 + 6 + -6. 2 Calculate 7 - (3 + 0) - 2. 2 What is (-6 - -7) + 3 + -5? -1 What is (-9 - -10) + 2 + 1? 4 What is the value of (6 - 9 - -13) + -5? 5 6 - (-5 - (-5 + -4)) - 2 0 Calculate -2 + -2 + -3 + 10. 3 What is the value of 1 + (6 - -2) + -12 + 1? -2 Evaluate -4 + (-2 - -4 - 0). -2 Evaluate 0 + (-2 - -1) + 0 + 1. 0 What is -1 + 0 + -12 - -22? 9 2 + -2 - -2 - 1 - -2 3 Calculate (17 - 12) + (-2 - (-3 - -2)). 4 Calculate 2 - (4 - 0 - (18 + -17)). -1 Evaluate -7 + (2 - 0 - 3 - -3). -5 Calculate (13 - 6) + (-4 - 2). 1 What is the value of 4 + -2 + -2 - -5? 5 11 + (0 - 9 - (-8 - -2)) 8 Evaluate (-9 - (2 + -9)) + 0. -2 (4 - 3 - 8) + (-2 - -6) -3 3 + 3 - 2 - (5 - 5) 4 What is the value of (3 - 1) + 13 + -13 + -3? -1 What is the value of -2 + -12 + (4 - 1) + 3? -8 Evaluate (2 + -4 - (-1 - 0)) + -4. -5 -2 - (0 + 2 + 0) -4 What is -4 + 10 + -5 + -3? -2 What is 11 + -1 + (-2 - -3) + -4? 7 -3 + (-1 + 3 - -4) 3 What is (10 - (4 - 3)) + -5? 4 (-3 - (1 - 3)) + -1 -2 -5 + 0 + 6 - 4 -3 Evaluate 0 + -1 + (-5 - -5) - 2. -3 Evaluate -7 - (9 + -16) - 7. -7 0 + 2 + -10 + 8 + -3 -3 Evaluate (6 - (13 - 1)) + (14 - 8). 0 Calculate (7 - 2) + 8 + -13. 0 What is the value of -2 + -4 + 1 + 5? 0 Calculate -1 - (8 - (9 - 1)). -1 What is the value of -10 + (1 - (5 - (9 + -3)))? -8 Calculate 3 - (7 + -6 + (3 - 1)). 0 What is the value of 8 + (0 - 4 - 1 - -1)? 4 Calculate 5 + -1 + (10 - 14) - -4. 4 Evaluate 3 + (-3 - -1) + (4 - 3). 2 What is -2 + -3 - -7 - (0 + 0)? 2 What is -6 - 3 - (1 - 5)? -5 -10 - (9 + -12 + -3) -4 (3 - 1) + (-6 - -4) 0 What is the value of -9 + (11 - 5) - -3? 0 What is -16 - (8 - 15) - -6? -3 Calculate (2 - 0 - 4) + 3 - 2. -1 What is (4 - (-5 + 7)) + -1? 1 -2 + 4 - (0 - 1) 3 (16 - 18) + 1 + 4 + 2 5 -6 + (2 - (-8 - -7)) -3 Calculate 5 + (4 + -3 - 5). 1 What is the value of 0 + -6 + -2 - (-45 + 39)? -2 Calculate 0 + 3 + -5 + -2. -4 What is 5 + -15 + (-2 - -7)? -5 What is the value of -2 - ((0 - 1) + 0) - -3? 2 Evaluate 0 + -2 - (1 + -4 + 0). 1 What is the value of (0 - -5) + (9 - (11 - 6))? 9 What is (13 - (-7 + 7 - -6)) + -1? 6 Calculate -4 - (-6 - (1 + 2)). 5 Evaluate 2 - (1 + (2 - 4)). 3 Evaluate (0 - -1 - -2) + 2. 5 -5 + 11 + -4 - -2 4 Calculate (0 - (5 + -6)) + 0 - 2. -1 What is the value of 6 + -12 + 1 + 1 + 0? -4 Evaluate 14 + -11 - (0 + -1 + 9). -5 Evaluate 1 + -4 + 4 + -1 - 1. -1 What is -2 + 12 + -10 - 4? -4 Calculate (-3 + 1 - 2) + -3 + 7. 0 2 + (-8 - -3) + 6 + 2 5 Calculate 4 + 1 - 3 - (0 + 3). -1 Calculate 40 - 42 - (2 + -1 + -3). 0 What is (-75 - -79) + (-4 - -1)? 1 (5 - (10 + 1)) + -6 + 19 7 Evaluate -2 - ((-1 + -1 - -2) + 3). -5 Calculate 3 - 1 - (-4 + 1). 5 Evaluate (-13 - (-3 - 9)) + -2 + -3. -6 What is the value of -4 + 6 + -5 - (-8 - -4)? 1 What is the value of -2 + -1 + (-53 - -63)? 7 Calculate -5 + 8 + (0 - -2) + -1. 4 Calculate -1 + (3 - 3 - -2) + 3. 4 Evaluate -1 - (7 - 4 - 3). -1 Calculate -6 + (-1 - 2) + 4 - -3. -2 Evaluate -2 + 4 + (3 - 10). -5 Evaluate -7 + -3 + 6 + 1 + 0. -3 What is the value of -4 + 0 + 1 + 3? 0 Evaluate (-5 - -5) + 0 - (2 + 2). -4 What is the value of (4 - 1) + 4 + -12 + 0? -5 What is the value of -9 + 3 + 2 + -1? -5 What is (-5 - 0) + (-2 - -5) - 3? -5 Calculate 1 + 5 + -1 + (9 - 7). 7 What is -1 + 0 + (-4 - 0)? -5 8 + -12 - (2 - (6 - -2)) 2 -11 + (0 - -5) + 13 - 2 5 What is 5 - (2 - 4 - -4) - -2? 5 What is the value of -2 - (2 - (1 - -6))? 3 What is 17 + -19 - (4 - (0 - -3))? -3 What is the value of (9 + -5 - -3) + -6? 1 What is the value of (-6 - -15 - 4) + -1 + -7? -3 Evaluate (-4 - -7 - 5) + 0 + 2. 0 What is the value of (2 - -1) + -95 + 86? -6 3 + -13 + -7 + 15 -2 What is the value of -2 + 3 - (0 + 1 + 4)? -4 What is -11 + 14 - (8 + 0 - -2)? -7 -2 - (-4 + 1 + 7) -6 What is the value of (-1 - -5 - 2) + (0 - 3)? -1 What is the value of 2 + -3 + 2 + -4 - -6? 3 What is the value of (4 - (0 + 5 - 2)) + -4? -3 Calculate 0 + -2 - -1 - (-209 + 202). 6 Calculate 5 - (4 + 11 - 5). -5 Calculate -6 + 6 + -2 + 6 - 4. 0 What is the value of (-11 - -2 - -5) + -2 + 2? -4 What is the value of 2 + 5 + -1 - 2 - -5? 9 What is the value of 2 + (-2 - (-5 + 5)) - -2? 2 6 + -7 - (1 - (-2 - -4)) 0 5 + -1 - (9 - (0 - 1)) -6 -1 + 7 - (-3 - -14) -5 Evaluate -11 + -2 + 2 + 6. -5 2 - (5 - (1 - (4 - 7))) 1 Calculate -4 + -1 + 4 + -4. -5 Evaluate -5 + (12 + -8 - -2). 1 What is the value of 1 - (2 - 1) - (-1 + -1)? 2 Calculate -4 - (1 + (-1 - 3)). -1 0 + (2 - 4) + 0 + 3 1 What is the value of (-4 - -2 - -4) + -3? -1 Calculate 2 + 13 - (-11 + 21). 5 What is 3 + (5 - 3) - (-2 + 0)? 7 -4 + (3 - 1) + 4 2 What is (14 - (4 - 1)) + -12? -1 What is the value of 0 + -3 + -1 + 4? 0 Calculate (1 - -3) + -6 - -5. 3 What is (1 - 0) + 2 + 3 - 2? 4 What is the value of 4 + (-13 - 0) - -5? -4 Calculate 48 - 50 - (-1 - -5). -6 Calculate (3 - 0 - (22 - 16)) + -2. -5 Evaluate (9 - 13) + (-3 - -2) - -1. -4 Evaluate 20 - 11 - (6 + -1). 4 -10 - -16 - (7 + -3) 2 0 + 1 - (-26 - -22) 5 Evaluate 6 + (-18 - -3) + 4. -5 What is -2 + (0 - (-3 + -2)) + -4? -1 Calculate 4 + (10 - 7) + 0 + -3. 4 Calculate -13 + 14 - (-2 - -5). -2 What is 1 - 7 - (-8 + (8 - 3))? -3 Evaluate 0 - (0 - (-8 - -1 - -5)). -2 Calculate -6 - ((4 - -3) + -8). -5 Evaluate -1 - (1 - 4) - -1. 3 Calculate 0 + (2 - 1) - (-46 - -43). 4 What is the value of -33 + 14 - (8 - 19)? -8 0 + 1 + 0 + 2 + -6 -3 -1 - -6 - (-14 - (-3 + -16)) 0 What is the value of -9 - (4 + -9) - 2? -6 Evaluate -3 - (0 - 0 - (7 - 6)). -2 What is -3 + 8 - -9 - 8? 6 Evaluate 7 + (6 - 7 - (1 - -2)). 3 What is 0 - (3 + 0 + -8 + 5)? 0 Calculate (3 + 8 + -5 - 5) + 6. 7 What is the value of 0 - (-5 - (-11 + 4))? -2 What is 1 - (6 - (-3 - -4))? -4 6 + -2 - 10 - -2 -4 What is (-2 - 3 - (-10 + 2)) + 3? 6 What is 8 - (3 - -13) - -6? -2 -2 + 1 - (-3 + 2) 0 -4 - -3 - ((5 - 4) + 2) -4 What is 10 - (12 + -9 + 6)? 1 Calculate 3 + 0 + -3 + 1 + -1. 0 What is the value of -1 + (0 - -3) - (4 + -2)? 0 What is the value of 3 - ((0 - 0) + -5 + 8)? 0 What is 1 + -3 - (0 + -2) - -4? 4 Calculate 1 - 4 - (7 - 11 - 1). 2 Calculate (-2 - -4) + (3 - 4) - 3. -2 What is the value of (0 - -11) + (-4 - (-3 + 4))? 6 Evaluate -3 - (0 + 2 + -2 + -2). -1 What is -1 + (-6 - (-4 - (3 + -9)))? -9 Calculate 0 + -6 - (-2 - -1). -5 What is -3 + 2 + (-4 - (-5 + 3))? -3 Calculate 3 + -5 + 4 - 0. 2 Calculate -3 + (4 - 3) - -1. -1 What is the value of -2 - (1 + (1 - 4) + 0)? 0 What is -4 - (1 - 4) - 1? -2 What is the value of -2 + 0 + (0 + 6 - 2)? 2 Calculate -11 + 14 - (9 - -1). -7 -2 + (-7 - (-13 - -5)) -1 What is the value of 7 - ((9 - 2) + -6)? 6 Calculate 2 + (-2 - -2) - (2 - 0). 0 What is the value of -1 - (6 + -2) - 0? -5 Evaluate 34 + -35 + (1 - 1 - 1). -2 1 - (1 - (-4 + 5 + -3)) -2 What is (-5 - -2 - 2) + 6? 1 Calculate (1 - -9) + (45 - 48). 7 Calculate (-7 - -6) + 4 - (11 + -1). -7 Evaluate -1 - ((2 + -1 - -1) + -4). 1 Calculate (6 - 2) + -5 + 0. -1 Evaluate 2 + (4 - -2 - 3). 5 Evaluate -1 - -4 - (0 - 3) - 4. 2 -5 + -1 + (32 - 29) -3 -3 - (-9 - (-7 + 3 + -1)) 1 What is -3 + (-1 + 2 - 2)? -4 (51 + -43 - (0 - -5)) + -8 -5 4 + -8 + (17 - 14) -1 Evaluate (-10 - -2) + (5 - 1). -4 Calculate -4 + 2 + (-2 - -8) + -2. 2 -1 + 3 + 1 + (-5 - -2) 0 What is the value of -11 - (-10 + (8 - 5))? -4 What is 5 - (7 - 4 - 4) - 4? 2 Evaluate -6 + (-8 - 3) + 10. -7 Calculate 0 + -2 + 1 - (-2 - -2). -1 What is -10 + (4 - (-2 - -2)) + 2? -4 Calculate 7 - ((-18 - -12) + 6 + 1). 6 What is -6 + (-4 + 6 - -4)? 0 What is the value of (27 - 24) + -4 + -1 + 2? 0 What is the value of 3 + (3 - 2 - 6) + 1? -1 What is the value of -5 + -1 + -15 + 28	{ "pile_set_name": "DM Mathematics" }
in increasing order. -4, y, 2 Let l = 12.82 + 0.18. Let i = l + -10. Sort -0.4, i, -1/2 in decreasing order. i, -0.4, -1/2 Let b be ((-18)/(-15))/(6/(-20)). Let j be (-2)/b - (-11)/(-2). Let c be j/26/(-3). Sort 1, c, -2. -2, 1, c Let p = -1/13 - 219/26. Let i(k) = -10k*2 + 1. Let a be i(-1). Let b = a - p. Sort 0.4, 4, b in descending order. 4, 0.4, b Suppose -1 = -g - 0. Let b be g/((-17)/(-2) - 3). Sort 0, 2, b in decreasing order. 2, b, 0 Suppose 34w = 30w. Put w, 1, -2 in decreasing order. 1, w, -2 Let z be 2 + 4/((-12)/15). Sort 2/13, 6, z in increasing order. z, 2/13, 6 Let b(v) = 5v + 14. Let u(d) = 2d + 5. Let w(q) = -3b(q) + 8u(q). Let l be w(3). Let f be l - (1 + (-12)/(-27)). Sort 5, 2, f in ascending order. f, 2, 5 Let c = 0.59 + 0.01. Let w = c + -0.9. Suppose 2o = -4o + 12. Sort -1/5, w, o in descending order. o, -1/5, w Suppose 0z + 5v = 3z - 9, -3z = 2v + 12. Sort z, 3, -4 in increasing order. -4, z, 3 Let r be ((-4)/12 + 0)/(3/27). Put r, -5, -4, 1 in descending order. 1, r, -4, -5 Suppose -2b - 24 = b. Let g be (-12)/(-16) + (-2)/b. Suppose -5i - 3z + 4z - 20 = 0, -z = 5i + 10. Sort g, i, -1 in ascending order. i, -1, g Suppose -17 + 7 = -2n. Suppose a + n = 12. Let k = a - 15/2. Sort 0, k, 1/2 in descending order. 1/2, 0, k Suppose -q - 26 - 4 = 0. Let p be 144/q + 2/(-10). Sort p, 1, -1 in increasing order. p, -1, 1 Let l(i) = -5i3 + i. Let r be l(-1). Put -1, 5, 3, r in ascending order. -1, 3, r, 5 Let x(p) = p2 - 8p + 2. Suppose -4r + 2 = -4i + 42, -4i + r + 34 = 0. Let q be (-12)/(-6)i/2. Let k be x(q). Sort 0, k, 4 in decreasing order. 4, k, 0 Let s be (-50)/75 + (-10)/(-24). Sort 0.2, s, -0.5 in increasing order. -0.5, s, 0.2 Let r = 6 - 7. Sort 5, -0.4, r in increasing order. r, -0.4, 5 Let s = 2 + -1. Let k = 55 + -54.7. Put -1, s, k in descending order. s, k, -1 Let y = -55/4 + 14. Let n = -6938/17 - -408. Sort -3, y, n in decreasing order. y, n, -3 Let s(n) = 3n - 3. Let j be s(2). Let m be 4/(-8) - (-82)/(-4). Let v = -22 - m. Sort v, j, 0. v, 0, j Suppose 2t = 5r - 169, 99 = 2r - t + 32. Suppose 8y - 3y - r = 0. Sort -1, y, -5 in ascending order. -5, -1, y Let l(o) be the third derivative of -o*4/24 - 2o*3 + 5o*2. Let y be l(-12). Sort -4, y, 3 in descending order. 3, y, -4 Let v = -0.3 - -0.1. Let f = 9 + -5. Let o = f - 3.7. Put -1/2, v, o in descending order. o, v, -1/2 Suppose -24 = 2g - 3g. Let c be g/(-14) - 10/35. Sort 0, c, 3/2 in decreasing order. 3/2, 0, c Let h be (-87)/84 - (15/(-4) - -3). Let v = -2 + 2.5. Put 4, h, v in decreasing order. 4, v, h Let h = -20 + 15. Let c be (h/15)/(1/7). Sort c, 2/9, 2 in decreasing order. 2, 2/9, c Let l(d) = d2 - 7d + 3. Let b be l(6). Put 4, 5, b in decreasing order. 5, 4, b Let k = 19.41 - 18.5. Let x = k + 0.09. Sort -4, x, -5/3 in decreasing order. x, -5/3, -4 Let u be -1-425/(-20). Put 6, u, 4 in ascending order. u, 4, 6 Let r = 165 - 165. Let i be 1 + -1 + -2 - 0. Let n be 23/60 + i/8. Put r, n, -5 in descending order. n, r, -5 Suppose -10 = -2l - 0l. Sort l, 0, -1 in ascending order. -1, 0, l Let p be (-6)/2 + 171/54. Sort 3, p, 2/7 in ascending order. p, 2/7, 3 Let o(d) = -d*2 - d + 14. Suppose 0 = 3i - i + 4y - 12, 0 = 4y - 12. Let t be o(i). Sort 4, 2, t in descending order. t, 4, 2 Let i = 0.2 + -1.2. Let d = 2.5 - 2. Sort i, -4, d in ascending order. -4, i, d Let h = -6 - -3. Let y be (-48)/(-15) - h/(-15). Let c = y - -1. Put -2, -5, c in descending order. c, -2, -5 Let l = -0.8 + 0.6. Sort 2/7, 6, l. l, 2/7, 6 Let v(l) = l*2 + 6l + 4. Let m be v(-3). Suppose 1 = 3d + 4. Put m, 3, d in decreasing order. 3, d, m Let p be (-2)/5 - (-2 - (-8)/5). Sort -3/7, -4, p, -9/7 in increasing order. -4, -9/7, -3/7, p Let p(l) = l2 + 4l - 5. Let h be p(-5). Suppose 2y = -hy. Put 1, y, -4 in decreasing order. 1, y, -4 Let h be 1/156 - (-22)/20. Sort -0.41, 4, h in increasing order. -0.41, h, 4 Let m = 23 - 28. Put 1, 3, m in decreasing order. 3, 1, m Let w = -4/23 + 74/161. Let k = -0.12 - -1.12. Suppose -2h - 2m = -3h + 4, -5m - 15 = 0. Put h, k, w in ascending order. h, w, k Let n = 0.03 - 0.23. Sort -3/2, n, -2 in ascending order. -2, -3/2, n Let o be -4(-2 - (-2 - 1)). Let w(x) = x3 + x2 + 4. Let l be w(-2). Sort l, o, 3 in increasing order. o, l, 3 Let a = -14 - -10. Suppose -31 = -3y - 5d, -6y + 2y = -2d + 2. Sort -5, y, a in increasing order. -5, a, y Let t = -18 - -14. Sort -5, -0.2, t in descending order. -0.2, t, -5 Let o = -0.151 - 0.149. Sort 7, 0.1, 0, o. o, 0, 0.1, 7 Suppose 4j - 6 + 0 = -3x, -5j + 13 = x. Let f = 1 - 1. Let c be 1/(-2) + (-117)/(-26). Sort f, c, x in decreasing order. c, f, x Suppose -2k = -b - 2b + 2, 4b - 2k = 6. Let r(h) = -h - 5. Let w be r(-5). Sort b, w, 2. w, 2, b Let r be 1-3(-25)/15. Suppose 15 = -rh, -1 = 2x - 3h - 2. Suppose 4a + 4 + 8 = 0. Put -3/4, a, x in descending order. -3/4, a, x Let v = 11.9 + -6.9. Sort v, -0.06, 1/4 in ascending order. -0.06, 1/4, v Let p = -3 - -2. Sort -5, 5, p in descending order. 5, p, -5 Let d be (-22)/(-4) - (-4)/(-8). Suppose 0 = -j + dj + 12. Let u be (j + (-107)/(-35))-5. Sort u, -1, 4 in increasing order. -1, u, 4 Let i be 3/9 + 22/6. Sort i, 0, 2, -3. -3, 0, 2, i Let p be (21/4)/((-552)/20). Let w = -3/46 - p. Let t be ((-4)/(-10))/(1/(-10)). Sort w, t, 0.5 in decreasing order. 0.5, w, t Let y = 32.2 + -32. Sort -2, -0.1, -1/13, y. -2, -0.1, -1/13, y Let d(z) = -4z3 + 1. Suppose a - 2 = -a. Let j be d(a). Let y = -29 - -28. Sort -2, y, j. j, -2, y Let z = -34 - -13. Let g = z - -20.9. Sort 3, g, 2/3. g, 2/3, 3 Let z be (-297)/(-63) + 6/21. Put z, 0.2, 0.4, -0.1 in decreasing order. z, 0.4, 0.2, -0.1 Let q be (-11)/3 + 3 - (-20)/(-6). Put 0, q, -3, -2 in descending order. 0, -2, -3, q Suppose 40 - 34 = -2f. Put f, 4, -5/2 in increasing order. f, -5/2, 4 Suppose -3b = -6, 0 = 5q - 6b + 3b + 31. Let j be (q2/(-5))/4. Let y = -0.1 + 0.1. Put 2, y, j in descending order. 2, j, y Let a = 33 - 33. Put 3, a, -4 in increasing order. -4, a, 3 Let f = 268/9 - 30. Sort 4/3, 0.02, f in decreasing order. 4/3, 0.02, f Let d(u) = u3 - 6u*2 + 5u + 2. Let b be d(5). Put b, -3, -4 in decreasing order. b, -3, -4 Let b = 10 + -6. Let g(s) = s*2 - 4s + 4. Let p be g(b). Suppose -5v + 13 = 3u - 0u, 3u + 2 = -2v. Sort p, 0, u in ascending order. u, 0, p Let b = 2.012 + -0.012. Sort -2, -2/27, b in descending order. b, -2/27, -2 Let a be 1/331. Suppose 0 = 2g + 5n + 15, g - 3n + 2 - 11 = 0. Sort 0.1, g, a. g, 0.1, a Let g = -3 + 1. Let q be ((-1)/(-2)g)/(-1). Suppose 2j + b - 21 = -4b, 4b = j + 9. Put j, q, -4 in decreasing order. j, q, -4 Let o = -10 - -16. Let m = 1 + o. Let t = 10 - m. Put 4, -0.2, t in descending order. 4, t, -0.2 Let l(y) = -y - 5. Let j be l(-10). Suppose -jx + 10 = -7x. Let g be 8(2/(-4) - 0). Sort -3, g, x. x, g, -3 Suppose 3f - 19 = -f - 3c, -f - c = -5. Put -5, -2, f in increasing order. -5, -2, f Let v = -0.1 - -0.3. Let h = v + 0. Let a = 0.1 - h. Sort -1, a, -5. -5, -1, a Suppose 4b - 3a = 12, 3b = 3a - 6a + 9. Sort 6, b, 1 in ascending order. 1, b, 6 Let b = -114 + 114. Sort -9, 5, b, -5 in decreasing order. 5, b, -5, -9 Let j be 4/(-5)15/6. Let u(p) = p2 - p - 1. Let d be u(-2). Put d, -3, j in increasing order. -3, j, d Let j(a) = -a2 - 10a - 11. Let c be j(-8). Put 2, c, -1 in decreasing order. c, 2, -1 Let q be 4/8 - 10/4. Let w(o) = -1 - 6 + 3 + o. Let l be w(6). Sort l, q, 4 in decreasing order. 4, l, q Let r = -13 - -12.95. Let n = 0.15 - r. Sort 4/5, 2/11, n in decreasing order. 4/5, n, 2/11 Suppose 6 = 3u - 3l, 0 = -2l - 2 + 8. Suppose 3r = -1 - 5. Sort -6, u, r in increasing order. -6, r, u Let b = -65 - -64.97. Sort -0.4, 0.2, b in ascending order. -0.4, b, 0.2 Let f be 18/20 - (-2)/(-5). Let c = -7 + 9. Let w = -1 - c. Sort f, 0.4, w. w, 0.4, f Suppose -2j = 2l - 22, 2j = -5l + 29 + 8. Let n(d) = -d*3 + 7d*2 - 5d - 4. Let s be n(j). Suppose -sw + 4 = -0. Put -1, -3, w in descending order. w, -1, -3 Let j = -27 + 28. Sort 2, 0.3, j in decreasing order. 2, j, 0.3 Let z = -0.07 - 0.23. Let w be (-3)/62 - 2. Let d be 2/(-13)(w + 2). Sort z, d, -0.4 in descending order. d, z, -0.4 Suppose 0 = -5x + 8*x. Sort x, -4,	{ "pile_set_name": "DM Mathematics" }
16 = h, 0 = n for h. -4 Solve 5q + 15 = 0, k + 10 = 6k + 5q for k. 5 Solve 14 = -2o - 4y, -20 = 3o - 4y + 9y for o. -5 Solve -3c + 11w - 15 = 16w, 3c + 12 = -4w for c. 0 Solve -4l + 18 = 2v + 3v, 0 = v + 5l - 12 for v. 2 Solve -4z - 3q = 22 - 3, z + 3q + 16 = 0 for z. -1 Solve 6 = 2c + 5p - 7, -p = -c + 3 for c. 4 Solve 2s - 2 = 3a, a + 7s = 3s + 18 for a. 2 Solve -4r = 0, -5r + 3 = i - 2 for i. 5 Solve -j - 292v = -297v + 2, 0 = -j - v + 4 for j. 3 Solve 4q + 2 = -3d, -10d + 13d = -2q - 4 for d. -2 Solve -11d - 10 = 4p - 13d, 0 = -5p - 4d - 6 for p. -2 Solve -4p - 5f + 15 = 0, -f + 9 + 5 = 3p for p. 5 Solve -h - 4 = -2t, -4t = h - 4h - 8 for h. 0 Solve 3g - 12 = 4h, 14h = 13h + 4g - 16 for h. 0 Solve 0 = 5a - 5h - 25, -25 = -5a + 4h - 7h for a. 5 Solve 5t = -10, b - 9 = 5t + 3 for b. 2 Solve -7s - 1 = -6s - p, -3p = 0 for s. -1 Solve -23 = -5m - 2x - 38, 3m + 3x + 18 = 0 for m. -1 Solve 3m = -5r + 10, -m = 4r + 245 - 246 for r. -1 Solve 0 = 4r - 0r + q + 16, 8 = -2r - 2q for r. -4 Solve 4q - r - 431 + 416 = 0, -18 = -q + 5r for q. 3 Solve 10 = 2a, -3a + a = 4c - 14 for c. 1 Solve -3x + 7z = 9z - 14, -4z = -4x + 12 for x. 4 Solve 5p + 5a = -15, -48a + 44a = 3p + 13 for p. 1 Solve 5k - 9 = -4p + 8p, 2k - 2p - 4 = 0 for k. 1 Solve 10 = -5q + c + 4c, -c + 11 = 2q for q. 3 Solve -4m = 3b + 29, -b + 2b = 2m + 7 for b. -3 Solve 0 = -s - 4, 0 = 8c - 7c - 6s - 20 for c. -4 Solve 25v - 4g = 27v - 10, 4g = 12 for v. -1 Solve 25t - 28t - 18 = -3m, -5m + 3t = -28 for m. 5 Solve 10m - 14m - 3l + 14 = 0, -15 = -m + 5l for m. 5 Solve -4r - 20 = 3f, -5f - 4r = 18 + 10 for f. -4 Solve -26u + h = -27u + 7, u - 4h + 8 = 0 for u. 4 Solve -68m = -3c - 67m - 11, 5c + 45 = -5m for c. -5 Solve 3u + 2k = 10, 4u + 4k = 8k + 20 for u. 4 Solve -15c - 6 = -13c, -r - 10 = 2c for r. -4 Solve u - 4u - 4w = -11, 2w = -3u + 7 for u. 1 Solve 3m = 2v - 19, 3m + 271 = 4v + 242 for v. 5 Solve m - 2 = 4z, 3z + 13m + 11 = 9m for z. -1 Solve 4j = -3o + 2 - 3, -2j + 7 = 3o for o. 5 Solve -2s - 2 = 0, 5x + 6s + 3 = 8s for x. -1 Solve -4j + 6 - 18 = 4l, 2l - 5j + 20 = 0 for l. -5 Solve 0 = -i - 5k - 25, -4k = 4i - 6i + 20 for i. 0 Solve -5s = 5a + 40, 5a + 5s + 28 = 3a for a. -4 Solve 4 = -4o + 3f + f, -2o + 7 = f for o. 2 Solve 4j + 5b + 12 = 37, 15 = -4j + 3b for j. 0 Solve 52r - 17 = 4l + 53r, -5 = -5l + 4r for l. -3 Solve -m - 20 = -132x + 127x, 0 = -2m - 5x + 5 for m. -5 Solve 0 = 5r - y - 10, r - 4y - 2 = -y for r. 2 Solve -11 = t + 3i, 2i = 4i + 6 for t. -2 Solve 0 = -d - 3d + 16, 0 = -4q + 4d + 4 for q. 5 Solve 0 = -d + 2i - 3, -19i + 15i + 34 = 2d for d. 7 Solve 7h - 3h = -2j + 16, j + 5h - 23 = 0 for j. -2 Solve 4j = -4p + j - 27, 5 = -j for p. -3 Solve -28 = 5f - 2v, 1 = 3f + 4v - 3 for f. -4 Solve -4q = -5m - 20, -q + 20 = -6m + m for m. -4 Solve -3d = -5y + 25, 2y - 5d - 11 = -1 for y. 5 Solve -16 = 4f - 2m, -f + m - 7 = -m for f. -3 Solve 4n + 3y = -n - 10, 5n - 4y = -45 for n. -5 Solve 2w + 13 = n, 5w = -10n + 6n for n. 5 Solve -p - 10 = -5x, 3x - 5p = -7p + 6 for x. 2 Solve 4o = 5r - 19, 15 - 4 = r - 2o for r. -1 Solve -3 = -4s - 5q, 4q = 74s - 71s - 10 for s. 2 Solve -20 = -5l - 5s, 5l - 6l + 5s - 8 = 0 for l. 2 Solve 5i - 8 = -r, -7i = 4r - 8i + 10 for r. -2 Solve 0 = 4y - 16, 3y + 20 - 23 = -3q for q. -3 Solve 18 = 4j + 2x - 5x, -j = -5x - 13 for j. 3 Solve -24 = 5x + 3v, 2x + 4v + 15 = v for x. -3 Solve 2i - 2 = -4o, -2o = -4i - 5o - 6 for i. -3 Solve -2b - 17 = 5w, 17b - 16b - 2w = 5 for b. -1 Solve -277j + 280j + 13 = 4q, 5j - 4q + 11 = 0 for j. 1 Solve -g - 5v = -25, 0 = -5g + 3v - 1 - 14 for g. 0 Solve 2p + 20 = -4y, -67y = 3p - 66y + 5 for p. 0 Solve -7y + 4y - 5g = -g, 0 = -2y - 3g for y. 0 Solve 2r - 2i - 3i - 15 = 0, -4i = 4 for r. 5 Solve i = -2q - 10, -3q + 3i + 2i = -11 for q. -3 Solve m - 2r = -11, -m - 4r + 7 = -0r for m. -5 Solve -10 = 6a - 4a, 0 = 2v + 2a + 6 for v. 2 Solve 19 = -3y - 5r, -7y + r - 4 = -5y for y. -3 Solve 33h + 4x = 28h, 5x = -3h - 13 for h. 4 Solve -15n = -20n + 2z + 19, n + 3z = 14 for n. 5 Solve -5o = 5y - 10 - 5, -5y = -3o + 41 for y. -4 Solve 18 = -3s, -4s - 36 = 6u - 2u for u. -3 Solve -4x + 6k = 5k + 10, -5k = -2x - 14 for x. -2 Solve -23m = -18m + 25, 5m = -5h - 50 for h. -5 Solve 2b + 10 = -3x, -3x + 0x - 15 = 3b for b. -5 Solve 5r + 5b = 3r + 5, 1 = b for r. 0 Solve 0 = -4c + 303 - 291, 5y = 2c - 31 for y. -5 Solve -10j - 35 = -8j + 5f, 2j + 30 = -4f for j. -5 Solve -5r - 2p + 4 = 0, -3r = -13p + 10p - 15 for r. 2 Solve -10 = 2r, -d - 2 = r + 2 for d. 1 Solve o + 3s - 8 = 0, 2s - 5 = -2o + 7s for o. 5 Solve -3l - 4p = 10, 0p + 4p - 6 = 5l for l. -2 Solve 3m - 3h + 4h = -11, -5h - 7 = 3m for m. -4 Solve 2d = 8, -4d = -5v + 7 - 38 for v. -3 Solve 0 = 2i + 12 - 6, -4i = 2u + 10 for u. 1 Solve p - 6 = -p - 4y, 0 = 5p + 3y + 6 for p. -3 Solve 3n + 133 - 124 = -y, n = -3y - 11 for y. -3 Solve -3d = 2d + 5m + 45, -3d - 2m - 23 = 0 for d. -5 Solve 3z - i - 3 = -0z, 0 = -5z - 4i + 22 for z. 2 Solve 3m = -4n - 16, 6m - m + 23 = -3n for m. -4 Solve 0 = -4j + 8, -5k + 9k - 2j + 4 = 0 for k. 0 Solve -5d = 2u - 2, -25 = 3u - 3d - 7 for u. -4 Solve -n = -4w + 2, -3n + 2w = -2n + 2 for n. -2 Solve -3y + 12 = 3h, -5h - 14 = -5y - 44 for y. -1 Solve -5c - 4u + 14 = 0, -c - 48 = -4u - 46 for c. 2 Solve -2l + 3v + 5 = 0, 3l + 4v - 16 = -0v for l. 4 Solve -5k - 2y = -12 - 14, k + 5 = 3y for k. 4 Solve -3y + y + 3s - 8 = 0, 3y + 7 = 2s for y. -1 Solve 5c = 7c + 4o - 8, o = -4c + 16 for c. 4 Solve -147k + 145k + 4 = 2w, -k - 1 = 0 for w. 3 Solve 5j + 0 - 20 = 0, -5g + 12 = 3j for g. 0 Solve -5a + 4c - 31 = 0, 0 = -2a - 2c + 2 - 0 for a. -3 Solve 2t - 6 = 3d, 4d = 2t - 7 - 1 for t. 0 Solve 0 = 2b + 3b + 3u - 14, 5b = 2u + 24 for b. 4 Solve -3r = -125g + 120g + 25, 2g = 4r + 24 for r. -5 Solve 0 = 5m + 25, 7g - 2m - 15 = 6g for g. 5 Solve -5p - r + 5 - 30 = 0, -3p - 4r = 32 for p. -4 Solve -12m + 8m - 18 = i, 20 = 5i - 2m for i. 2 Solve -4h - 10 = -2m, -h - 3m = -6 - 2 for h. -1 Solve c = -4t - 3 - 12, -3c + 10 = t for c. 5 Solve -m - 3t = -6, m + 4t - 62 + 53 = 0 for m. -3 Solve -p - 3r + 2r = -4, -p = -5r + 8 for p. 2 Solve -5t + 3g - 23 = 2g, g = -2t - 12 for t. -5 Solve 2c - 17j = -22j - 13, 0 = 3j + 3 for c. -4 Solve -13s + 8s = 4b - 20, -b + 8 = 2s for s. 4 Solve 4j + 4d + 36 = 0, -3d + 5 - 7 = -2j for j. -5 Solve 5h = -5f - 20, 56f = 5h + 60f + 15 for h. 1 Solve 2p + 2p = -o + 2, o - 5p + 7 = 0 for o. -2 Solve -d + r = 6, -8d + 11d = 4r - 22 for d. -2 Solve -2 - 1 = -2o + a, -3a - 5 = -2o for o. 1 Solve -12r + 9r - 5j - 19 = 0, 31 = 3r - 5j for r. 2 Solve -5o + 3k = 8, 4o + 0o - 4k = 0 for o. -4 Solve 5a = m - 15, 4a = -2m + 9a + 15 for m. 0 Solve 0 = -2v - t + 7, 3t - 1 = 4v + 2t for v. 1 Solve 3c + 3t + 18 = 0, 2t = c + 4t + 8 for c. -4 Solve 8 = -2w - 2d, 16 = 3w - 4w - 5d for w. -1 Solve d - 4h = -18, -4d - 2h + 5 = -13 for d. 2 Solve 0 = 5n - 4d + 30, 4n + 0d + 23 = 3d for n. -2 Solve 5u + 3d - 12 = 0, 6u - d - 16 = u for u. 3 Solve -221t = -225t + i - 13, -11 = 3t - 2i for t. -3 Solve -25 = 5c - 5s, -s - 5 = c - 0c for c. -5 Solve b - 9 = -2x, 20 = 3x + 2x for b. 1 Solve 5s - 20 = -3r, -3s - r - r = -13 for s. 1 Solve 16v - 17v - 2c = -3, 4v - 2c = 12 for v. 3 Solve -4z = p + 12 + 13, -20 = 3z + p for z. -5 Solve -4h - 4l + 22 = -2, -4h - 3l = -20 for h. 2 Solve r - 5h = 4r + 5, 0 = -2h + 4 for r. -5 Solve 5y = -5a - 20, -444a + 21 = -4y - 443a for y. -5 Solve -4m + r - 23 = 4r, -r - 15 = 5m for m. -2 Solve 3w + 84j - 81j + 15 = 0, -2 = 2j for w. -4 Solve 5v + 11x = 8x - 8, 0 = v - 2x + 12 for v. -4 Solve -5a = 5f - 20, a - 11 = -2f - 4a for f. 3 Solve 5v = 243b - 244b + 27, 6 = 3b for v. 5 Solve 5h + 7 = 8s - 9s, -3h = 2s for h. -2 Solve -13 = 5*c - 2	{ "pile_set_name": "DM Mathematics" }
e in 41, -6/5, 4? 4 Which is the third biggest value? (a) 27/5 (b) -5 (c) 0 b What is the smallest value in -0.12, -1, -0.83, 3/4? -1 Which is the second biggest value? (a) 28 (b) -1/5 (c) 0.3 (d) 1/2 d Which is the third biggest value? (a) 1/6 (b) 0.081 (c) -4 c Which is the biggest value? (a) 1/2 (b) -10 (c) -4 (d) -0.5 a Which is the smallest value? (a) 3 (b) -7 (c) -2 (d) -5/46 b What is the third smallest value in 2/9, -5, 0.023, 53, 0? 0.023 Which is the second biggest value? (a) -0.5 (b) 2/331 (c) 2/7 b Which is the smallest value? (a) 56 (b) 5 (c) -29 c What is the biggest value in 4, -0.1, 1492, 0.1? 1492 What is the fourth smallest value in -1/3, -0.1, -2/11, 4, -3? -0.1 What is the second biggest value in 30, 2/13, -1/5? 2/13 What is the second biggest value in -199, -3, -1? -3 Which is the biggest value? (a) 1/29 (b) -18 (c) 8 c Which is the fourth smallest value? (a) -4/5 (b) -1 (c) 2 (d) 3/2 c What is the third smallest value in 1/4, -113, -40/3? 1/4 Which is the second smallest value? (a) -5 (b) -1/4 (c) -4 (d) -217 (e) 3 a Which is the smallest value? (a) 2/3 (b) -0.021 (c) -0.1 c Which is the biggest value? (a) 75/17 (b) 1/7 (c) -2 a Which is the smallest value? (a) -3 (b) -4 (c) -3/7 (d) -2/3 (e) -11 e Which is the second biggest value? (a) 8 (b) 0.057 (c) -3 b Which is the third smallest value? (a) 0.4 (b) -2/3 (c) -1/3 (d) 6 a Which is the smallest value? (a) -5 (b) -2 (c) 1/2 (d) 44 a What is the third smallest value in -1, -2.93, -0.5? -0.5 Which is the second smallest value? (a) -2 (b) -1.8 (c) 4 (d) 0 b What is the biggest value in -0.02, 0.31, -1/20? 0.31 What is the third biggest value in -4, 0.6, -2/15? -4 Which is the third biggest value? (a) -0.1 (b) 0.1 (c) -675 (d) -1 d What is the smallest value in -1/5, -2, -31, -1/7? -31 Which is the second smallest value? (a) 6.4 (b) -5 (c) 2/13 c What is the third biggest value in -6/11, 2/9, 0, 0.12? 0 What is the third biggest value in -1/4, -13, -8/5? -13 What is the biggest value in 2, -3/8, 2/19, 5? 5 What is the second smallest value in 30/11, -2/29, -0.5? -2/29 Which is the second biggest value? (a) -4 (b) 3 (c) 8 (d) -1/4 (e) 0.2 b What is the third smallest value in -0.4, 0.13, -10/9? 0.13 What is the biggest value in 0.1, -0.6, 2, 0? 2 Which is the third biggest value? (a) 5 (b) 0.06 (c) 47 b Which is the smallest value? (a) 0.2 (b) -0.3 (c) 41 b What is the biggest value in -7, -3/4, -18? -3/4 What is the biggest value in -10, -0.07, 0.4? 0.4 What is the biggest value in 6, 5, -9? 6 Which is the fifth smallest value? (a) -12 (b) 1/16 (c) 1/6 (d) 1 (e) 3 e Which is the second smallest value? (a) -3/4 (b) 280 (c) 7 (d) -0.4 d Which is the smallest value? (a) 0.1 (b) -0.06 (c) 14/5 (d) -0.4 d Which is the fourth biggest value? (a) 0 (b) -2 (c) 21 (d) 5 (e) -2/17 e What is the third smallest value in -5, -3, 1? 1 Which is the smallest value? (a) 0.4 (b) -12 (c) -27 c What is the third smallest value in 3, -0.04, -12? 3 What is the second biggest value in 0.8, -2/25, 2/7? 2/7 Which is the second biggest value? (a) 11 (b) 49 (c) 0.1 (d) -1/3 (e) -2/9 a Which is the third biggest value? (a) -5 (b) 24/5 (c) 6 a What is the third biggest value in 3, -1/5, -518, 0.2? -1/5 What is the fifth smallest value in 0, -0.1, 4, 2/21, -2? 4 Which is the second smallest value? (a) 2/7 (b) -620 (c) -4 (d) -5 d Which is the fourth biggest value? (a) 8 (b) -2/49 (c) -4 (d) -0.2 c Which is the fourth biggest value? (a) -2/25 (b) 13 (c) -1 (d) 0.3 c What is the third biggest value in -0.6, 0.2, -35? -35 Which is the smallest value? (a) 2 (b) -192 (c) -0.2 (d) -0.3 b What is the second biggest value in -3/2, -13/3, -3/7? -3/2 Which is the fourth biggest value? (a) -4 (b) 1/5 (c) -5 (d) 4/5 c What is the third biggest value in -0.6, -0.2, -2, -5? -2 Which is the second biggest value? (a) -3 (b) -1 (c) 0.26 (d) 16/5 c Which is the second smallest value? (a) -0.4 (b) -1 (c) -277 b What is the second biggest value in -20, -4, 28? -4 Which is the biggest value? (a) 28 (b) 2/13 (c) -0.1 (d) -0.3 (e) -2/21 a Which is the biggest value? (a) 0.11 (b) 11 (c) -0.2 b Which is the biggest value? (a) 10 (b) 5 (c) 0.5 a What is the fourth smallest value in -2/3, -5, 7, -0.2? 7 Which is the fourth biggest value? (a) -0.12 (b) 1 (c) -2 (d) 1/2 c Which is the second smallest value? (a) 5 (b) 0.1 (c) 9 a What is the third smallest value in 11/4, -3, -2/3, 1? 1 Which is the smallest value? (a) 0.02 (b) 5 (c) 0.5 a Which is the fifth biggest value? (a) 0.8 (b) 2/41 (c) -0.05 (d) 3/8 (e) 1 c What is the fourth biggest value in -4, 0.2, -2, 0.0696? -4 What is the fourth smallest value in -1.55, -1/2, 0.5, -0.3? 0.5 Which is the fourth smallest value? (a) -2/5 (b) 4 (c) 0.06 (d) -2 b What is the third biggest value in 3/5, -4, -2, -5, 60.4? -2 Which is the smallest value? (a) -5 (b) -112 (c) -2 (d) -3/2 (e) 6 b Which is the fifth biggest value? (a) 0 (b) 21 (c) -0.005 (d) -1 (e) 2/3 d What is the second smallest value in -0.2, -3/4, 0.1, -3, -186? -3 Which is the third biggest value? (a) 1/13 (b) 21 (c) 0 c What is the third biggest value in 0.2, 4, -4/17, -1? -4/17 What is the smallest value in -22, 0, -1/3, -1? -22 Which is the fourth smallest value? (a) -0.5 (b) 37 (c) 3 (d) 0.4 (e) 0.55 c Which is the second biggest value? (a) -2 (b) 0.2 (c) 2/13 c What is the third smallest value in 16, 1/5, 0.1, 7? 7 Which is the third smallest value? (a) -4 (b) 5 (c) 2/11 (d) -2 c Which is the third biggest value? (a) 0 (b) -31/42 (c) 2/9 b What is the third biggest value in -0.4, 0.284, -4? -4 Which is the fourth biggest value? (a) 8/17 (b) 0.3 (c) 17 (d) 2 b What is the third smallest value in -0.372, 3, 2/19? 3 What is the third smallest value in 1/5, 5, 9, -4? 5 What is the third smallest value in 48, 4, 2, 0.1? 4 Which is the second biggest value? (a) 33.8 (b) -0.2 (c) 1/8 (d) -2/19 c What is the third smallest value in 2, 0, -354? 2 Which is the second smallest value? (a) 0.1 (b) -1/73 (c) 0.2 (d) 45 a What is the fourth biggest value in -0.4, -1, -259, 5? -259 What is the biggest value in 2/7, -0.2, 4/3, -1/3? 4/3 What is the second smallest value in -16, 1/7, 55? 1/7 Which is the second biggest value? (a) 1/4 (b) 386 (c) -0.3 (d) -1 a What is the third biggest value in 2, 0.2, -2/7, 5? 0.2 What is the biggest value in 1/9, -1.7, -4? 1/9 Which is the smallest value? (a) 1 (b) -415 (c) 0 b Which is the fourth biggest value? (a) -4 (b) -1 (c) 10/13 (d) -2 a Which is the biggest value? (a) 233 (b) 1/5 (c) 6/11 a What is the second smallest value in -5/3, 1, -4/5, -2/21? -4/5 What is the third biggest value in -0.4, -5, 2/3? -5 Which is the smallest value? (a) 2/5 (b) -1/5 (c) 3/8 (d) 0.1 b Which is the fourth biggest value? (a) 1/6 (b) 7 (c) -0.2 (d) 29 c What is the biggest value in -3, 1/2, -290, 4? 4 What is the smallest value in 85, 43, 3, -5? -5 What is the smallest value in 3.52, 4, 6? 3.52 Which is the second smallest value? (a) 0.5 (b) 0.07 (c) 0.059 b Which is the third smallest value? (a) 3/4 (b) 10/297 (c) 0.5 (d) -1 (e) -4/5 b Which is the second biggest value? (a) -4/73 (b) -0.4 (c) -6 b What is the third biggest value in -5, -2/3, 42, 0? -2/3 What is the second biggest value in -4, 2/9, -2, 2/13, 18/103? 18/103 Which is the second smallest value? (a) 0.58 (b) 0.2 (c) 3 (d) -0.1 (e) -6 d What is the second smallest value in -2/11, -0.01, 0.4, -0.4? -2/11 Which is the biggest value? (a) 0.5 (b) -7 (c) 1/8 a What is the second biggest value in -3, 0, 5/3, -3/164? 0 Which is the biggest value? (a) 4/7 (b) -0.4 (c) 7.8 (d) -5 c Which is the third smallest value? (a) 4 (b) -5 (c) -12 a Which is the fifth smallest value? (a) 60/7 (b) 0.1 (c) 3 (d) -0.2 (e) -5 a What is the fourth smallest value in 2, -0.4, -404, -3? 2 What is the smallest value in 0.1, 25957, -2/3? -2/3 Which is the smallest value? (a) -0.3 (b) 214 (c) 3/2 a What is the biggest value in -0.4, -964.8, 0? 0 Which is the fourth biggest value? (a) 3 (b) -0.2 (c) -4 (d) 0 c What is the	{ "pile_set_name": "DM Mathematics" }
4)(x - 7x + 3x) + x5 + 1 - 2x*5 + 0. 2x*5 + 1 Expand (-18f - 33 + 33)(-2 + 2 - 3f*2). 54f*3 Expand (1 + 2 - 1)(-2b3 + 2b*3 - 2b*4) + 4b*4 - 2b4 - b4 - 1 - 3b4 + 1. -6b*4 Expand ((-2 + 5 - 1)(0p + 0p - 2p) - 6p - 2p + 0p)(-1 - 2 + 5 + (3 + 4 - 6)(3 + 2 - 3)). -48p Expand (-1 + 3 - 1)(3l - l2 - 3l)(-25 + 17 - 22). 30l*2 Expand (-3r - 1 + 1)(2 + 1 + 2)(2r3 + 4r*3 - r - 5r*3). -15r*4 + 15r*2 Expand (-5 + 5 + g)(-2 - 1 + 4)(-1 - 4 + 3). -2g Expand -p*3 + 2p4 + p3 + (4p2 + p3 - 4p*2)(1 - 1 - 5p). -3p*4 Expand (-6a + 24 - 24)(-1 + 1 - a3 - a). 6a*4 + 6a*2 Expand (c + c - 3c)(-5 - 5 + 5). 5c Expand (30 - 30 - 2f)((-3 + f + 3)(-f + 0f + 3f) + 2f*2 - 1 + 1 + 4f*2 - 6f*2 + 0f2 + f2 + 4 - 4). -6f3 Expand (2 - 1 - 3)(-1 + 2 + 1)(-1 + i + 0i + i). -8i + 4 Expand -3u*2 - 105 + 105 + 3u*2 - 4u*2 + 0u*2 + (5u - 4u + 0u)(2u - u - 2u). -5u*2 Expand (0a - 4a + 2a)(-2 + 0 + 3)(-23 - 3 - 13) + 2a - 3 + 3. 80a Expand (0c4 + 4c*4 - 3c*4)(-c + 3c + 2c)(-1 + 0 + 0). -4c*5 Expand h - 3 + 3 + 1 - 2h - 1 + 0h - h + 0h + (-4 + 2 + 0)(-4h + 0h + 6h) - h + 0h + 2h. -5h Expand (0w - 3 - w + 2w)(1 + 11 + 6). 18w - 54 Expand (-n2 + 5n*2 - 3n*2)(2n - 4 + 5 - 21). 2n*3 - 20n*2 Expand (0d*4 + 4d*4 + 11d*4)(0 + 0 + d). 15d5 Expand (54f - 54f - 17f*2)(2f3 + f3 - f3) + 5f5 - f5 + 0f5. -30f*5 Expand (-2q*2 + 0q2 + q2)((q + 0 + 0)(4 - 1 + 0) + 2q - 3q + 0q). -2q*3 Expand (0 - 2b*2 + 0)(-6 + 2 + 3)((4 - 1 - 4)(2b2 + 2b*2 - 2b*2) + 3b*2 + 6b*2 - 5b*2). 4b*4 Expand (7f - 11 + 2 - 5f)(f + f - f)(2 - 9 + 1). -12f*2 + 54f Expand -w + 4 - w*5 - 4 + (w + 5w - 3w)(-2w4 - w2 + w2). -7w*5 - w Expand 3 - 4h*2 - 3 + 3h*2 + 7h*2 - 9h*2 + (-1 + 1 + 2)(2h2 + 0h*2 + 0h2). h2 Expand (-4h + h + h)(-4h + 4h - 2h2 + (h + 2h - h)(-2h - h + h) + 2h2 + 5h - 5h). 8h*3 Expand (-1 + 2 - 3)(-2s2 - s2 - s2)(3s - s - 5s). -24s3 Expand -c2 + 3c*2 - 4c*2 + (-2c - 2c + 6c)(2c + 0 + 0) + (-1 + 0 - 1)(-c2 - c + c) + (-2 + 2 + 2c)(-2 + 2 + c). 6c*2 Expand 2s + 2s - 2s + (-2 + 2 - 5s)(1 - 2 + 3). -8s Expand (4j + 0j - 3j)(50j*3 - 50j*3 - 3j*4). -3j*5 Expand (-a - 3a + 6a)(58a + 2 + 2a*2 - 3a - 11a). 4a*3 + 88a*2 + 4a Expand (3p - 6p - p*3 + p)(4p - 4p - 3p). 3p*4 + 6p*2 Expand (11p - 3p - 1 + 3)(-2 + p*4 + 2). 8p*5 + 2p*4 Expand 0u + u + 0u + (17 - 29 - 6)(1 - u - 1) + (-4 + 3 + 2)(u + 2 - 2). 20u Expand (5h + 0h - 3h)(4h3 + 2h*3 - 2h*3 + (0h + h + h)(0h + 2h2 + 0h)). 16h4 Expand (2 - 6 + 3 + 2 + 1 - 1 + (-3 + 0 + 4)(3 + 3 - 4))(13 - 20 - 6)(s - s + 3s). -117s Expand (4u - 7u*2 - 4u)(u + 0 + 0)(-3 + 2 + 2). -7u3 Expand (-3w + 6w3 + 3w)(0w*2 + 1 + 0 + 8w*2). 48w*5 + 6w*3 Expand (3 + 1 - 3)(-3d + 6d*2 - 87 + 87). 6d*2 - 3d Expand (0v2 - 3v*2 + 5v*2)(-2 - v + 2) + 2v - 2v + v3 - v. -v3 - v Expand (3 + 1 - 3)(5w - 3w - 3w)(21 - 10 + 7). -18w Expand (-2a4 - 4 + 4)(-5 + 1 + 2 + 1 + 2 - 1 + (5 - 1 - 2)(2 + 1 - 4) - 3 + 4 + 0 + 0 + 1 + 7). -14a*4 Expand 1 + 2m + 278m3 - 251m*3 - 2 + (-2m*2 + 4m*2 - 3m*2)(0m + 4m - 2m). 25m*3 + 2m - 1 Expand (3x - 7 + 7)(-5x + 0x + x). -12x2 Expand (-4 + 2 + 0)(-1 + 3 + 1)(2x - 2x + 4x). -24x Expand 2i*4 + 2i*4 - 3i4 + (-i3 - 3i3 + 3i*3)(-4i + 4i - 2i) + 2i*4 + 4i*4 + 5i*4 + 14 + 3i*4 - 14. 17i*4 Expand (-3z - z + 10z)(-2 + 1 + 3 + (-3 - 2 + 3)(-1 - 3 + 2) + 0 + 0 + 2 - 1 - 1 + 4). 60z Expand (-l + 4l + 4 - 4l)(0 + 0 - 1). l - 4 Expand 4j + 2 + 9j - 9j - j + 4j - j + (-1 + 0 - 1)(-2j + 0j + 0j). 10j + 2 Expand (3l - l + 5l)(-2l3 - l3 + 2l3) + l4 + 0l*4 + 0l*4. -6l4 Expand (-d2 - 2d2 + d2)(d*2 - 2d*2 + 2d*2) - 18d*3 + 5d*4 + 18d*3. 3d*4 Expand -4f + 3f + 0f + (-2 + 1 + 4)((1 + 3 - 2)(-2f + 2 - 2) - 6f + 2f - 3f). -34f Expand ((-p + 4 - 7 + 11)(0 + 1 - 2) + 3p + 1 - 1)(-p*2 - 5p*2 + 4p*2). -8p*3 + 16p*2 Expand (-23 + 23 - 8y)(3y*3 - 2y*3 - 4y*3). 24y*4 Expand ((-3 - 2k + 3)(-2 - 4 + 4) + k - 4 + 4 + (-3k - 2k + 3k)(-1 - 4 + 3))(-5 + 4 - 1). -18k Expand (3j*3 - j - 2j*3 - j)(-2 + 5 - 1). 2j3 - 4j Expand -640u2 - 19u*4 + 640u*2 + (0u + u - 3u)(u*3 - 2u3 - u3) + u - u - u*4. -16u*4 Expand (23z + 0z + 0z)(-3z2 + z2 - z - z). -46z3 - 46z*2 Expand (0 + 2q + 0)(-q4 - 4q*3 + 2q*4 + 2 + 6q*3). 2q*5 + 4q*4 + 4q Expand ((-s + 2s + 2s)(-3 + 3 + 1) + (2 - 2 - 3)(-2s + 6s - 2s))(s*2 + s - 3 + 3). -3s*3 - 3s*2 Expand (-2f - 2f + f)(-3f2 - 2f*2 + 4f*2) + 3f*3 - 3f + 3f. 6f*3 Expand (-3v + 4v2 + 3v)(-v - 4v + 4v) - v3 - v3 + 0v*3 + 2v*3 - 3v*3 + 0v*3. -7v*3 Expand (-4q + 2q - 1 + 0)(4q - q + 0q). -6q2 - 3q Expand (-7w - w + w + (0 + 3 - 2)(-1 + 1 - w))(2w2 + w2 - 5w2). 16w*3 Expand ((2s*2 - 2s*2 - 2s*2)(4 + 0 - 3) + 18s + 15s*2 - 18s)(-s - 2s + 2s). -13s*3 Expand (3 - 1 - 3)(2g + 3g - 3g + 6g - 2g - 3g - 4g + 0g + 3g + (2 + 2g - 2)(-1 + 4 - 4) - 3g + 0g + 2g - 2g - 3 + 3 - 1 + 1 - 2g). 5g Expand -148m*3 - 15m*3 - 4m*2 + 5m*2 + (1 + m - 1)(0m2 + 2m2 - m2). -162m3 + m2 Expand 2s5 + s5 - 5s5 + (0s + 0s - s)(0s4 + 7s*4 - 4s4) - s5 + 0s5 - s5 - 2s*5 + 3s - 3s. -9s*5 Expand (5y*2 + 2y2 - y2)(-14y + 3y + 0y). -66y3 Expand -2g*2 - 5g*2 + 6g*2 + (-2 + 2 - 2g)(-g + 1 - 1) - 9g*2 + 0g*2 - 2g*2. -10g*2 Expand (2m*2 - 2m*2 - 2m*2)(-1 + 2 - 3) - 8 + 2 + 12 - 2m2. 2m*2 + 6 Expand (3x*2 - 3x*2 - 2x*2)(-3 - 2x + 4 - 3)(5 + 2 - 5). 8x3 + 8x*2 Expand -2i*2 + 3i*3 + 2i*2 + (-i - 2i + 4i)(0i2 + 3i2 + i2) + 2i3 - i2 + i2. 9i*3 Expand (-4m + 7m - m)((0m + 3m - 2m)(2m - m + 0m) + 5m2 - 3m*2 + 4m*2). 14m*3 Expand 2b*5 - 2b*4 + 2b*4 + 4b5 + b5 - 3b5 + (0 - 2 + 4)(5b5 - 2b5 - b5) - 7b5 + 4b*5 - 4b5. b5 Expand 2i3 - 16 - 28i*2 + 16 + (3 - 2 - 2)(-i*3 - 3i*3 + 3i*3). 3i*3 - 28i*2 Expand ((3m2 - m2 - m*2)(-2 + 2 + m) + (6m - 2m - 2m)(-2m + 2m - m*2))(-m + 4 - 4). m4 Expand (0 + 0 - n2)(0n*2 - 2n2 + n2) - 3n4 - 29n*4 - 5n*4 + 4n*4 - 3n*4 - 2n*4. -37n*4 Expand (-3 + 6 - 2)(t - 8 + 2t - 4t). -t - 8 Expand (6k - 4k - 4k)(-k - 1 + 1 + 4k - 3k + 0k + (1 + 1 - 4)(-k + 5 - 5) + k + 3k - k + 5k - 4k + 0k). -12k2 Expand (-5b4 - b3 + b*3)(1 - 4 + 5)(0 + 1 + 6). -70b*4 Expand 0h*3 - 4h*3 + 2h*3 + 3h*3 - 4h*3 + 3h3 - 2 + 2 - h3 + (-2 + 2h + 2)(0h2 + 6h*2 - 4h*2) - 3h*3 + 0h*3 + 5h*3. 5h*3 Expand (-2 + 2 - 2)(-5r + 3r + r)(-1 + 1 - 3). -6r Expand 18u5 + 16u*5 - 10u*5 + (5u*3 - 3u*3 + 0u*3)(2u2 - 2 + 2). 28u*5 Expand (-1 - 12p - p*2 + 12p)(3p - 3p - 7p). 7p3 + 7p Expand -2j3 + 6j*3 - 2j*3 + (2j - 3j - j)(4j2 - 3j2 + j2) - j*3 + 2j*3 + 2j*3 + 2j*3 + 0j*3 + 0j*3 + 2j*3 - 1 + 1. 5j*3 Expand (-c + 5c - 3c)(6 - 3 - 2) - 5c + 9c + 3c + 3c - 5c - 5c. c Expand g2 + g - g + g2 - 3 + 3 + (g - 6g + g)(3g - 2g - 3g). 10g*2 Expand -3y*2 + 7y*2 + 0y*2 + (-7y - 7 + 7)(2y - 4y + y). 11y*2 Expand (3c4 + c4 - 5c4)(2c + 0c + 0c) + 2c*5 - 5c*5 + 2c5 + (-c4 + 0c4 + 2c*4)(8c - 15c - 11c). -21c*5 Expand (5a*3 + 4 - 3 - 2a*3)(6 - 1 - 1)(-2 + 2 - 3a). -36a4 - 12a Expand (-10 - 11 - 10)(3d*3 - 3d3 + d5). -31d5 Expand 4g*5 - 3g5 + g5 + (g*5 - 5g*5 + 5g*5)(2 - 2 - 2) - 3g5 - 9g*5 - 5g*5. -17g*5 Expand (-2b - 2b + 2b)(-2 + 7 + 2). -14b Expand -3q2 + 10q*2 + 53q*2 + 12q2 - q2 + 4q2 - q2 + (-3q + 5q + 0q)(-4q + 2q + 0q) + 1 - 1 - q*2. 69q2 Expand (o2 + o2 - o2)(-2o*3 - 3o3 + o3) - o**5 +	{ "pile_set_name": "DM Mathematics" }
ors of b. 2, 3, 5, 7 Let l be (-9217)/(-52) + 1/(-4). Let v = 256 - l. List the prime factors of v. 79 Let i be (-10)/(-6) + -2 - (-414)/27. Let m = 20 - i. What are the prime factors of m? 5 Let s = 369 + -129. Suppose -4r - s = -6r. List the prime factors of r. 2, 3, 5 Let z = -434 - -917. Suppose -n = -8n + z. What are the prime factors of n? 3, 23 Let d be (-1)/(-2)80/(-10). Let f = 16 - d. Suppose 3o - 125 = -f. List the prime factors of o. 5, 7 Let s(v) = v + 11. Let q be s(-8). Let a be 8(q - (3 + -4)). Suppose -a = -2f + 2. List the prime factors of f. 17 Suppose 57p - 50p - 6993 = 0. List the prime factors of p. 3, 37 Let l(q) be the second derivative of 15/2q*2 + 0 + q + 1/6q3. What are the prime factors of l(-7)? 2 Let a(x) = x2 - 5x - 3. Let q be a(5). List the prime factors of 130 - (q - -3 - 3). 7, 19 Suppose 3l - 21 = -6. List the prime factors of (l + -7)(0 + -2). 2 Suppose -3n + 4n - 9 = 0. Suppose 0 = -3k - 0k + 3m + n, -4k = 5m + 24. List the prime factors of (0 + k)1-39. 3, 13 Let u(c) = -c*3 - 4c*2 + 7c - 6. Suppose 5 = -4k - d, 0 = d + 3d + 20. Suppose 6f + 36 = -kf. List the prime factors of u(f). 2, 3 Suppose 0 = -5j + 4j + 2b + 24, 5b + 110 = 5j. Suppose 2a + 4y = 6a - 20, -5y - j = 0. Let m(o) = 30o - 1. What are the prime factors of m(a)? 29 Suppose 3c - 4c = -5. Suppose -cr = 4n - 2 - 146, 0 = -2r - n + 61. Let t = 53 - r. List the prime factors of t. 3, 7 Let w = -37 + 37. Suppose wq - 5q = -260. List the prime factors of q. 2, 13 Let d = 6 - 6. Suppose d = -5q + 25, -156 = -z - 2z + 3q. List the prime factors of z. 3, 19 Suppose 0y = -2y - 14. Let t(p) = -2p - 9. Let i be t(y). Suppose -24 + 69 = ir. List the prime factors of r. 3 Let m(o) = -o - 1. Suppose -2y - 25 = -4x - 7, 0 = -2y - x - 3. Let k be m(y). What are the prime factors of 35/(-4)(-8)/k? 5, 7 Suppose 4p - 3338 = -978. List the prime factors of p. 2, 5, 59 Suppose -4i - 2r = -5r - 3, -i = -r. Suppose 3v = 3g + 279, -v - g + 108 = ig. What are the prime factors of v? 2, 3 Suppose 0 = 3l + j - 0j - 434, 4l - 579 = -j. What are the prime factors of l? 5, 29 Let m be 35/4 - (-4)/16. Let r(i) = -i*3 + 12i*2 - 18i + 9. What are the prime factors of r(m)? 2, 3, 5 List the prime factors of 10270/39(-12)/(-10). 2, 79 Let h(o) = -4o - 1. Let w be h(3). Let c be ((-3)/(-2))/(w/(-52)). List the prime factors of c/24 - (-39)/4. 2, 5 Let u(k) = -13 + 6k2 + 12 + 4k*3 - 2k*2 - 2k. Let o be u(2). Let g = 66 - o. List the prime factors of g. 23 Suppose z + 3z - 8 = 0. Suppose -3y - y + 280 = zc, c + 357 = 5y. List the prime factors of y. 71 Let x(a) = -a3 - a2 - 13a + 3. List the prime factors of x(-9). 2, 3 Let i = 973 + -154. What are the prime factors of i? 3, 7, 13 Let u = 25 + -22. Suppose 6 = ul - 3. List the prime factors of l. 3 Let v(u) = 2u2 + 59u + 23. What are the prime factors of v(11)? 2, 457 Let x be -512/40-2 - -262. Let n = x - -74. What are the prime factors of n? 3, 113 Suppose 5u - 2f - 12 = 3u, u + 3f - 10 = 0. Suppose 297 = ul - 4l. Suppose l = 5i + 24. What are the prime factors of i? 3, 5 Let y be (-3 - (8 + -4)) + -2. Let s = 24 - y. What are the prime factors of s? 3, 11 Suppose 2i + 2i = i. Suppose i = 6y - 189 + 27. What are the prime factors of y? 3 Let u(n) = 4n + 13. Suppose 5g + 0d = -3d + 65, 10 = 2g - 2d. Let v be u(g). Suppose -f - 19 + v = 0. What are the prime factors of f? 2, 17 Suppose l = -40l + 80565. List the prime factors of l. 3, 5, 131 Let j be (-2)/(-2) + (-56)/7. Let k(n) = 2n*2 + 10n - 3. Let g be k(j). What are the prime factors of g - (6/3 - -1)? 2, 11 Let v be (5 + 23/(-5))(128 - -2). Suppose -5q = 5n - q - 179, -2q - 33 = -n. Let b = v - n. List the prime factors of b. 17 Let v(u) = 3u2 - 16u + 12. List the prime factors of v(10). 2, 19 Let g = 77 - 77. Let h(t) = -2t + 87. What are the prime factors of h(g)? 3, 29 Let o = -309 - -626. List the prime factors of o. 317 Let v = 445 - 82. Let w = -247 + v. List the prime factors of w. 2, 29 Let j(z) be the first derivative of 22z3/3 + z2/2 - z + 11. List the prime factors of j(-2). 5, 17 Let j = 630 - 316. Let k = j - 149. What are the prime factors of k? 3, 5, 11 Let l = -6549 - -9554. List the prime factors of l. 5, 601 Let p(j) = -j*2 + 6j - 5. Let b be p(6). Let f = b + 6. Suppose -4u = 5w - f, w = 4u + u - 23. List the prime factors of u. 2 Suppose 64h - 42840 = -21h. List the prime factors of h. 2, 3, 7 Suppose 0 = -65x + 68x - 1476. List the prime factors of x. 2, 3, 41 Suppose 0 = v + 4v + 5x - 40, 2x - 37 = -5v. Let c(f) = f + 12. Let w be c(v). Let s = 32 + w. List the prime factors of s. 3, 17 Suppose 14r = 19r - 2465. What are the prime factors of r? 17, 29 Let h(k) = k2 - 11k - 13. Let o be h(11). Let q = o - -134. What are the prime factors of q? 11 Suppose -p = -5q - 0p - 3, 0 = -5q - 2p - 9. Suppose 0 = -6m + 12m + 6. What are the prime factors of m + 20 - (q - -2)? 2, 3 Suppose -130 = -3l + 881. List the prime factors of l. 337 Suppose 691l - 701l + 11750 = 0. List the prime factors of l. 5, 47 Let g(h) = 2h*2 - 8h - 48. What are the prime factors of g(-8)? 2, 3 Let u(r) = -83r + 48. List the prime factors of u(-8). 2, 89 Let k = 564 + -254. What are the prime factors of k? 2, 5, 31 Let l = -13 + 28. Suppose -5x = 5q, 5q = x - 19 + 25. Let a = q + l. List the prime factors of a. 2 Let v(f) = f*2 - f - 14. Suppose -4s - 3s - 49 = 0. List the prime factors of v(s). 2, 3, 7 Suppose -2520 = -4k - 4o + 2792, o = 5k - 6658. List the prime factors of k. 11 Let a be ((-15)/10 + 1)(-18 - 2). Let h(m) = -m2 + 23m + 5. What are the prime factors of h(a)? 3, 5 Let r = 508 - 275. What are the prime factors of r? 233 Suppose -2j - 8 = -6j. Suppose jq = 4f + 100 + 294, q - 197 = -2f. List the prime factors of q. 197 Let c = -70 - -123. List the prime factors of (-2)/4-2c. 53 Let y(s) = -6s - 18. Let a(t) be the third derivative of -7t4/24 - 19t*3/6 - 4t*2. Let u(h) = -3a(h) + 4y(h). List the prime factors of u(-11). 2, 3 Let a(k) = k + 1. Let q(n) = 16n + 2. Let i(x) = -5a(x) + q(x). Let t be i(7). List the prime factors of (1 + -4)t/(-6). 37 Let p(b) = -6b - 1. Let y be p(-4). Let k = y - 23. Suppose k = 2s + 2s - 44. What are the prime factors of s? 11 List the prime factors of -10 - -8 - -3 - -19. 2, 5 Let r = 3849 + -1760. What are the prime factors of r? 2089 Suppose 3 = -2b - 11o + 14o, 2b - 1 = -o. Let n be (9 - -1)/((-6)/(-3)). Suppose -2t + 6a - 2a + 126 = b, nt - 390 = -5a. List the prime factors of t. 73 List the prime factors of 3 + -11 - -455 - -7. 2, 227 Suppose 4h = -j + 8, 0j = 4j. Suppose 396 = 6b - b - 4w, hb = -2w + 162. List the prime factors of b. 2, 5 Let n be 665/(-6 + 1) - (0 - 3). Let b = -72 - n. What are the prime factors of b? 2, 29 Let r be (-3 - 42/(-12))/((-1)/4). What are the prime factors of ((-6)/12)/(1/r)159? 3, 53 Suppose 14u = 11u + 5385. List the prime factors of u. 5, 359 Suppose 3l + 13 = 70. Let g = 5 - 3. Suppose gy = 4f - 6, -5y + l + 18 = 3f. What are the prime factors of f? 2 Let b be 288/(-80) - 3/(-5). Let x(l) = 8l*2 - 2l - 7. Let z be x(b). Let a = z + -48. List the prime factors of a. 23 Let f be (4/3)/((-12)/324). What are the prime factors of 90/f(-328)/10? 2, 41 Let l = 3006 - 1926. Suppose -2d = 2d - l. What are the prime factors of d? 2, 3, 5 Let u = 235 - 89. What are the prime factors of u? 2, 73 Let x be (-2)/8 - (-57)/4. Let q(w) = 7w + 1. Let u be q(5). What are the prime factors of (u/x)/(21/196)? 2, 3 Suppose 4u + 17 = 101. Let d = 29 - u. Suppose -2r + 2i = -0i - d, 0 = -5r + 3i + 16. List the prime factors of r. 2 Let t(l) = l*2 - l + 1. Let u(p) = -2p - 12 + 3p - 3p. Let f be u(-8). List the prime factors of t(f). 13 Let q = -3 - 3. Let t = 9 + q. Suppose -i = l - 0 - 21, -63 = -4i + tl. List the prime factors of i. 2, 3 Let z be (-1 - 1)408/16. Let f = z - -115. List the prime factors of f. 2 Suppose j + 5j = 0. Suppose 20 = 5a, ja - 3a + 647 = 5g. What are the prime factors of g? 127 Let p(q) = 7q2 + 6q*2 - 15q*2 - 15 + 29q. List the prime	{ "pile_set_name": "DM Mathematics" }
False Let m(g) = g*2 - 47g + 205. Let c be m(44). Is c less than 73? False Let b = -5.3 + 5. Let z be -12 + 9 + 6 - 31. Which is smaller: b or z? z Let c = 24 + -241/10. Suppose 2 - 16 = -d. Suppose -3q - 4 - 1 = 4z, 5z = 3q + d. Which is greater: c or z? z Let b = -2.1 - -2. Let i = 40 - 39.6. Let t = 0.48 - i. Is t less than b? False Let r = -7.72 - -6.92. Is r at least 1/3? False Let d(p) = 35p2 - 35p - 244. Let m be d(-7). Is m != -1/2? True Let b(a) = 11a - 133. Let u be b(12). Which is smaller: 2/107 or u? u Let j be (-29 + 32)3/6-2. Which is smaller: j or -59? -59 Let z be -1 + (423/(-330) - 0). Let f = z + -7/22. Suppose 4d = -5y + 9, 3d = 5y - 4y - 17. Which is smaller: d or f? d Let p = -365/2 + 193. Which is greater: p or 10? p Suppose 2g - g = 2b + 32, 0 = -3b + 5g - 48. Let z be ((-9)/4)/(-3)b. Let t = z + 12. Which is smaller: t or -2/5? -2/5 Let d = 94/3 + -31. Let o be -26 - -27 - (-12)/(-9). Is o greater than or equal to d? False Let z = -151 + 178. Which is bigger: z or 7? z Suppose f = -2f - 18. Let v(k) = -5k + 9. Let j(q) = 4q - 8. Let n(m) = fj(m) - 5v(m). Let y be n(0). Are 3 and y unequal? False Let n = -178 + 110. Is -200/3 smaller than n? False Let d = 572 + -572. Is d > -4/179? True Let d = -394 - -390. Which is smaller: d or -6? -6 Let o be 1 + 0 - (4 - 13). Let u = o - 79/8. Which is bigger: -1 or u? u Let g be (2 + 61/(-31))/((-2)/(-130)). Which is bigger: g or 2? g Let t(i) = -i*3 + 2i*2 + i + 3. Let l be t(-5). Suppose 4n - 4q + 996 = 0, -419 + l = n - 4q. Let r = -2003/8 - n. Which is smaller: r or -1? -1 Let d = 1/98 + -101/294. Let b = -83 - -82. Is d less than b? False Let f be (57/(-76))/(4239/24). Is -1 bigger than f? False Let j be 0 + 128 - (-52)/(-52). Are 129 and j non-equal? True Suppose 4w + 2p + 0 = -4, 4p = -w + 6. Let i be (-3)/(-6)-1w. Which is smaller: i or 2/7? 2/7 Let c = -453.376 - -454. Which is greater: -1/2 or c? c Let h be 7/((-246)/(-42) + -6). Are -49 and h non-equal? False Let f = -1816 - -1854. Is 63 at least f? True Let m be (271)/(7 - 6). Suppose -3h + 2p - 3p + 9 = 0, 5p + m = 3h. Let t be ((-24)/30)/(h/(-30)). Which is bigger: 3/4 or t? t Suppose 5w = 7w. Suppose wm = -m + 8. Let a = 38 + -30. Is m less than a? False Let o = -6.92 + 4.92. Which is greater: o or -151? o Let t be (6/(-27))/(6/9). Is -43 at most as big as t? True Suppose -2l - 22 = -2k, 11k - 33 = 8k - l. Let f = -2 + 12. Is k equal to f? False Let f(w) = -w*2 + 20w + 1. Let d be f(20). Is -3/278 less than d? True Let j(l) = -l - 9. Let d(h) = 2h - 2. Let c be d(-3). Let i be j(c). Let x be (-1 - i)-1 - -1. Is x >= 2? False Let s = -34.7 - -8.7. Let v = s - -32. Is v less than 1? False Let w be (-3 + 3)2/(-4). Let n be -1 + (-46)/42 + 2. Which is smaller: w or n? n Let n = 0.66 - 10.46. Let x = -0.22 - 8.78. Let a = x - n. Which is greater: a or 1? 1 Let d be 0 + (-2 - 1) - -23. Let k be -1 + d/(-4) + 4. Is -8/7 equal to k? False Let v be (-2)/8 - (-102)/88. Let t = -37 + 39. Which is smaller: t or v? v Let v = 0.17 - 0.21. Let p = 0.14 + v. Let n = 21/10 - 127/70. Is n != p? True Let d be 3/3(-2 + 1) - -1. Suppose d = -4k - 17 + 13. Which is smaller: -14/13 or k? -14/13 Let t = 6 + -5. Let l be (-16 - -20)(-1 - -2). Suppose l = 3u + t. Is -3/17 not equal to u? True Let o(w) = -4w - 4. Let t be o(-2). Suppose q + tq - 3j - 20 = 0, q + 3j + 14 = 0. Which is smaller: 4/15 or q? 4/15 Let k = 45/218 - 74243/358610. Is 0 less than k? False Let p(b) = 1. Let n(s) = -s2 - 9s + 8. Let q(i) = -n(i) + 5p(i). Let h be q(-8). Let a be 2 - 20/5035. Which is greater: h or a? h Let q(z) = -z*2 - 8z + 10. Let s be q(-9). Which is smaller: -11/84 or s? -11/84 Let i = -123 - -123.37. Let c = -0.43 + i. Are -6 and c non-equal? True Let l be (40794/24)/(-13) - 3/(-4). Let p be 2/l40/64. Are p and -1 unequal? True Let o = -16 + 16. Suppose 0 = -6q - o + 48. Which is greater: -0.2 or q? q Let x = 0.01 - -0.09. Is -5.8 smaller than x? True Let n = 42 + -30.4. Let z = 13 - n. Let w = z - 1.7. Is 1 equal to w? False Let d be (-54 - (7 - 0)) + 16. Is -57 not equal to d? True Let n be 1272/1792 + (3 - (-48)/(-14)). Which is greater: 1 or n? 1 Let o(v) = -v2 - 8v + 9. Let p(a) = -2a2 - 15a + 17. Let f(u) = -5o(u) + 2p(u). Let z be f(-11). Which is smaller: -9 or z? -9 Let i = -0.07 - -0.17. Let g = 0.2 - i. Let r = 111 - 97. Is r at least as big as g? True Let s be 2/3 + (-112)/132. Let x = 0.098 - 73.098. Let d = 71 + x. Which is smaller: s or d? d Let s = -27 - -28. Is 6/5 smaller than s? False Let r(k) = -k*2 - 6 - 4k - 2k + 0k*2. Let w be r(-5). Let b = -124/91 + 14/13. Which is smaller: w or b? w Suppose 0 = 2f - 4s + 10 + 2, 5s = 3f + 13. Let l(p) = 7p*3 + 3 - 5p*2 - fp*3 - 4 - 2p - 4p3. Let m be l(-4). Is -9 greater than or equal to m? True Let k = -261 + 260. Which is smaller: 1/1007 or k? k Let v = -25/83 + 241/249. Which is smaller: -645/8 or v? -645/8 Let m(q) be the third derivative of q3 + 1/24q*4 + 2q*2 + 0 + 0q. Let s be m(-7). Which is greater: s or -6/11? -6/11 Suppose -110 = 5s - n, -5n - 15 = -8n. Is -22 at least s? False Let x(l) = -25l - 142. Let c be x(-6). Which is smaller: -52 or c? -52 Let f be 3 - 1 - (-9)/844. Is f bigger than 2? True Suppose -4x = 23 - 111. Let w = x + -17. Suppose 10 + w = 3l. Is 0 equal to l? False Let w = 17 + -22. Suppose 5m + 9 = -16. Is m not equal to w? False Let r be (14/(-3))/(2/15). Let f = 24 + r. Suppose -o + 0o = 11. Is o >= f? True Let w be 0 - (40 + 4 - 2). Let v be 4/7w/45. Which is smaller: 0 or v? v Let c = 1.8 - 1.2. Let b = c + -9.6. Let s = 8.9 + b. Is 0.1 at least as big as s? True Suppose -5z + 2r - 188 = 0, -7z + 2r = -10z - 116. Which is greater: -352/9 or z? z Let z be 3 - (-4 - -16) - -3. Let u be 4/z + 6/9. Let h = -212/505 - -2/101. Which is smaller: u or h? h Suppose w + 139 = y, -5w + 3 - 28 = 0. Is 799/6 at most y? True Suppose 5x - 250 = 5z, -z - 42 = -2x + 62. Let m = x + -70. Suppose 0 = -3u - 5b + 28 - 76, 0 = -u + 4b - 16. Is m at most as big as u? True Let x be (109 - -2)/3 + -3. Suppose -5r = -15r + 330. Which is smaller: r or x? r Let y = 344 + -145. Is 199 not equal to y? False Let k = -23 - -22.82. Let q = k - -0.28. Let l = q - 0.11. Which is greater: 2 or l? 2 Suppose 0 = 5n - 3c - 19, -5n + n - 4c + 28 = 0. Suppose 4q + 5u = -0u + 129, -nu = -25. Suppose -14i + 436 = 58. Which is smaller: i or q? q Let w = 18 - 17.955. Let p = 8/11 - 18/55. Which is smaller: w or p? w Suppose -3u - 3y + 21 = -180, -4u + 4y + 268 = 0. Let j = u - 93. Is j at least as big as -25? False Let c = -193562158 - -640884300394/3311. Let u = c + 2/473. Let q = 6 + -7. Is u bigger than q? False Let t = 1778955/211 + -8431. Which is greater: -1 or t? t Let b = 0.5 + -0.5. Let l = 5 - b. Suppose -4m - g - 14 = 3, -28 = m + 5g. Is l != m? True Let d = 2 - 2. Suppose -4w + 5w = 46. Let f = -232/5 + w. Is f < d? True Let k(x) = 3x*2 + 29x + 114. Let w be k(-5). Is w > 45? False Suppose 5o - 4m - 22 = -2, -3o + 12 = 3m. Suppose -3q = -f - 30, 4q + 130 = -of - 54. Is -43 greater than or equal to f? False Let t = 23 + -16. Let a = t + -3. Let r be (-2000)/7506/(-4). Are a and r equal? True Let y(k) = 7k3 + 5k*2 + 6k - 1. Let l be y(-2). Is l equal to -48? False Let r be (-88)/(-8) - (-1 + -2). Let o = r + -13. Let t(f) = -f2 + 1. Let k be t(o). Is -9/7 at most as big as k? True Let x(g) be the third derivative of -g5/60 - g4/12 - g2. Let a be x(-4). Let b(w) = -w*2 - 7w + 17. Let l be b(2). Is l greater than or equal to a? True Let x = 27675/7 + -1606263/406. Let k = x + -1/116. Is k != -3? True Suppose 5q - 1 = 2r, 6q + 43 = -5r + 5q. Let y(v) = -4v + 6. Let k be y(4). Which is greater: k or r? r Let u be 408/36 + (-4)/((-8)/10). Which is bigger: 15 or u? u Suppose 245 = 3h + 5x, 28 = h + 3x - 47. Let q be 120/h((-1)/4)/1. Which is bigger: q or 0? 0 Let y be (-1 + (-2)/(-4))-2. Let g = -1183/8738 + -3/257. Let l = g + 167/442. Which is bigger: y or l? y Let v = 731 - 744. Are 1 and v equal? False Let f(q) = -3q*2 - 12q + 17. Let g be f(-8). Let s = 83 + g. Which is bigger: s or 7? 7 Let m be 33/4	{ "pile_set_name": "DM Mathematics" }
2). Let a = m - -193. What are the prime factors of a? 307 Suppose 163r = 140r + 121624. What are the prime factors of r? 2, 661 Let w = 2107 + -930. Suppose 3567 + w = 8j. List the prime factors of j. 593 Let i(p) = -p2 - 22p + 6. Let s(q) = q*3 + 11q*2 - 9q + 17. Let m be s(-12). What are the prime factors of i(m)? 3, 7 Let c(q) = q*3 + 42q*2 - 5q + 4. Let g = 171 + -213. List the prime factors of c(g). 2, 107 Let v(g) be the third derivative of 55g4/12 - 5g*3/3 + 21g*2 - 2. List the prime factors of v(5). 2, 3, 5 Let p(t) = 32t*2 - 20t + 75. Let j be p(5). Let g = j - 152. What are the prime factors of g? 7, 89 Let u(m) = 83m + 2. Let j be u(1). Suppose 0 = 2l + j - 291. What are the prime factors of l? 103 Let w = 625 - 451. What are the prime factors of 232/w(-2)/(2/(-933))? 2, 311 Let c(i) = -2 - i + 2i + 37i2 - 5 - 27i*2. Let w be c(-3). Suppose -11j = -3j - w. List the prime factors of j. 2, 5 Suppose 7n = 5n - 4i + 10320, 0 = 2n + 2i - 10320. List the prime factors of n. 2, 3, 5, 43 Let k(m) = m*2 + 2m - 3. Let f be k(-3). Suppose 3c = -4i - 10, -4c + i = -fi + 7. Let j(w) = -19w - 10. What are the prime factors of j(c)? 2, 7 Let n(c) = c2 - 2087 - 3c + 21c + 2103 - 2c. Suppose 4o - 3j = -78, -3o = 5j - 0j + 73. What are the prime factors of n(o)? 11 Let b = -7358 + 12281. What are the prime factors of b? 3, 547 Let t(x) = 158x*2 - 2470x - 9. List the prime factors of t(17). 3, 11, 37 Let p = -529 - -2787. What are the prime factors of p? 2, 1129 Let u(j) = -13944j + 521. List the prime factors of u(-1). 5, 11, 263 Let l = -44059 + 72192. What are the prime factors of l? 7, 4019 Suppose -3f - m + 11 = 0, -5f = m + 4m - 15. What are the prime factors of (-9 - -8) + f + 593? 2, 149 Let t be 4/(-18) + -204/(-36). Suppose -4d = tb + 2, -4b + d + 12 = 5d. Suppose bj + 74 = 9j. List the prime factors of j. 37 Let p(o) = -o3 + 7o*2 + 12o + 24. Let d be p(9). What are the prime factors of 2/(d/(-1689)) - 2/(-5)? 113 Let s(y) = 7y2 + 9y + 7. Suppose 161 = 19h - 10. What are the prime factors of s(h)? 5, 131 Suppose 3d = -9, -2d + 68 = 5w + 2d. Suppose -wk + 18 = -13k. What are the prime factors of 82(-9)/k-1? 3, 41 Suppose 0 = -7u + 11u - 156. Suppose 3x - 3z - u = 2z, 0 = -5x - 2z + 96. Let d(k) = 2k - 13. List the prime factors of d(x). 23 Suppose 3n + 175154 - 680810 = -33n. What are the prime factors of n? 2, 3, 2341 Suppose -3c + 2k + 17 = 0, 5c + 3k + 0 = 3. Let u be 3/((c - 0) + -2). Suppose -ui = 48 - 66. List the prime factors of i. 2, 3 Let r(n) = 1672n - 149. What are the prime factors of r(11)? 3, 2027 Suppose 0 = f + 5 - 1. Let b be (405/(-10))/(f/8). Suppose -3o + b = 5h - 35, -3h = o - 36. List the prime factors of o. 2, 3, 7 Suppose -56k = 53k + 8k - 1971450. List the prime factors of k. 2, 5, 337 List the prime factors of (-20102)/(-13) + 220/(-715). 2, 773 Let w(k) = -16k*3 - 10k*2 - 35k - 21. Let o be w(-9). Suppose -318b - o = -324b. List the prime factors of b. 2, 929 Let v be (-1)/6 + 26503/(-102). Let t = v - -367. List the prime factors of t. 107 Let t(o) = -90o3 - 8o*2 - 54o - 163. List the prime factors of t(-5). 3, 3719 Let c(t) = -t*3 - 17t*2 - 110t + 157. What are the prime factors of c(-35)? 71, 367 Let l = 80 + -78. Suppose lh = 4y + 128, -12 = 4y + 5h + 116. What are the prime factors of (y/40)/(2 - 1184/590)? 2, 59 Suppose -4d = -3z, -5 = 3z - 3d - 8. Suppose f - 220 = -l, -7f = -zf - 15. What are the prime factors of l? 5, 43 Let v = 123028 - 59429. What are the prime factors of v? 63599 Suppose 4g - 5m = -10m + 18396, 18396 = 4g + 3m. What are the prime factors of g? 3, 7, 73 Let a(z) = z3 - 111z*2 + 3z - 3379. What are the prime factors of a(112)? 3, 3167 Let m(u) = u + 2. Let k(w) = -w*2 + 9w - 15. Let j be k(6). Let l be m(j). Suppose lh + h - 114 = 0. What are the prime factors of h? 19 Let k be 1 - 1/2-38. Suppose 298 - k = 2j - 4z, -2z = 4j - 586. What are the prime factors of j? 5, 29 Let v(t) be the first derivative of -t3/3 + t2 + 4114t - 30. Let i be v(0). Suppose 12c + 1342 = i. What are the prime factors of c? 3, 7, 11 Suppose m - 56 = 312. Suppose -3s - s = -m. Suppose -2d - d + s = 2y, 4y = -20. List the prime factors of d. 2, 17 Let m(q) = -14q3 - 32q*2 - 8q - 38. List the prime factors of m(-7). 2, 3, 271 Let t(r) = 11r - 3. Let o(d) = 21d - 4. Let w(v) = 2o(v) - 5t(v). Suppose g + 23 = -3a, 5a = 2g - 11 - 42. What are the prime factors of w(a)? 2, 31 Suppose -2400660 - 1625406 = -96v + 1689006. What are the prime factors of v? 2, 3, 11, 41 Let t = -17 - -24. Let d(w) = -1714w + 1738. Let o be d(1). Suppose -11v + tv + o = 0. List the prime factors of v. 2, 3 Let j(i) = 2i*2 - 27i + 1. Let a(k) = 3k - 38. Let w be a(19). What are the prime factors of j(w)? 2, 3, 5, 7 List the prime factors of (3(-24)/(-360))/(2/173960). 2, 4349 Let d = 38907 + -12419. List the prime factors of d. 2, 7, 11, 43 Let i be 54/(-162) + ((-5)/3 - -1). List the prime factors of (0 - 1)/i - (-158)/1. 3, 53 Let t(k) = -k*3 + 16k*2 - 12k - 45. Let p be t(15). Suppose 5j - 6j - 4q + 577 = p, -5j + 2957 = -4q. List the prime factors of j. 19, 31 Suppose -60w + 1610125 = -46w + 473129. What are the prime factors of w? 2, 7, 5801 Suppose u + 13 = -5d + 133, 280 = 2u + 2d. Suppose uj - 1580 = 140j. List the prime factors of j. 2, 79 Let k(t) = -70t + 8389. List the prime factors of k(0). 8389 Let x(u) = 2023u - 7387. List the prime factors of x(16). 3, 11, 757 Suppose 14o = 7901 + 51949. What are the prime factors of o? 3, 5, 19 Let x = 20708 - 5084. What are the prime factors of x? 2, 3, 7, 31 Let o be 6/(-2)-7(-4)/(-12). Suppose ol = 110 - 40. Suppose 1704 = ly - 526. What are the prime factors of y? 223 Let h = 46 + -39. Suppose ho + 1179 = 5428. List the prime factors of o. 607 Let y be 28/36 + -1 - 2/(-9). Suppose u - 146 + 143 = y. What are the prime factors of u? 3 Suppose -5p + 8p = -5p. Suppose 3d - 3 = 3r, p = -3d - 0d + 9. What are the prime factors of 1/r - (-2)/854? 2, 7 Let a(t) = -t*3 + 40t*2 + 542t - 66. List the prime factors of a(28). 2, 13, 23, 41 Suppose 0 = 9v + 11v - 180. Let m(p) = -p*2 + 25p - 37. List the prime factors of m(v). 107 Let j be ((-14)/(-7))/((-2)/(-19)). Let g(f) = -f + 24. Let y be g(j). Suppose yq - 45 = 10. List the prime factors of q. 11 Suppose 9m - 12m = 2826. List the prime factors of (m/(-10))/((-6)/(-30)). 3, 157 Let p(m) = -34m + 7. Let u be p(-11). Suppose -240 = -3v + u. What are the prime factors of v? 3, 23 Suppose -10a + 9a - 2m + 7989 = 0, -7990 = -a - 3m. What are the prime factors of a? 7, 163 Suppose 5o - 6o = -2g - 7, 2g = 5o - 27. What are the prime factors of g/(-3)(18 - -1833)? 617 Let o = -21820 + 31552. What are the prime factors of o? 2, 3, 811 Let r = -11118 + 16022. List the prime factors of r. 2, 613 Let q be 15/(-2)(49 + -143). Suppose 11013 = 7x - q. What are the prime factors of x? 2, 3, 31 Let r(z) = z2 - 2z - 6. Let q be r(4). Suppose -10p + 22 - q = 0. Suppose -5d + 4n = -357, -pn - 57 = -d - 6n. List the prime factors of d. 3, 23 Suppose -9 = -3m, -m - 1 = -j - 0m. Let k(z) = 28z*2 - 11z + 9. List the prime factors of k(j). 7, 59 What are the prime factors of (9/6)/(13 + 1585695/(-121980))? 2, 19, 107 Let g(u) = 3u2 + 40u + 151. What are the prime factors of g(-54)? 23, 293 Let g(s) = s*3 - 3s*2 + 3s. Let b be g(3). Suppose -34 = bu - 7. List the prime factors of (81 + u)3/6. 3, 13 Suppose -14p + 4p - 10 = 0. What are the prime factors of 600 + (-2 - (-7 - p))? 2, 151 Suppose 510 = -58p + 7p. Let g(l) be the second derivative of -11l3/6 - 9l*2 - 2l. What are the prime factors of g(p)? 2, 23 Let h = -68 - -53. Let r = 75 - h. Let u = r + -31. What are the prime factors of u? 59 Let o be (-280)/(-224) + 1(-6)/(-8). Suppose -i + 3 = -0. Suppose 3z - om - 235 = 0, -2z + 413 = iz + 2m. What are the prime factors of z? 3 Let w(k) = 5k2 + 10k + 13. Let l be w(6). Let i = l + -22. List the prime factors of i. 3, 7, 11 Let i(l) = -189*l + 680. List the prime factors of i(-42	{ "pile_set_name": "DM Mathematics" }
= 0 - 0.1. Let g = -0.31 + 0.41. Let f = g - r. What is the second biggest value in -0.5, f, -3/8? -3/8 Let y be (6/15)/(1/2). What is the third biggest value in -4, -0.5, y, -0.3? -0.5 Let g = 0.023 - -0.207. Let i = -0.03 + g. Which is the biggest value? (a) 2 (b) 3 (c) i b Let r be -3(-2)/(-4) - 14/4. Which is the third biggest value? (a) 2/11 (b) -0.07 (c) r c Let w be (1/19)/(4/(-8)). Let g = 41 - 38.9. Let o = g + -2. What is the third biggest value in o, 2/3, w? w Let r = -1.2 + 1. What is the third smallest value in r, 1/4, -1/3? 1/4 Let t = -14 - -14. Which is the smallest value? (a) -5 (b) 4 (c) t a Let p be 2/(55/15 + -3). Which is the second smallest value? (a) p (b) 5 (c) -2 a Suppose 5d + 5o - 4670 = 0, o - 3742 = -4d + 3o. Let n be 544/d + 2/(-11). What is the third biggest value in -0.4, -1/4, n? -0.4 Let q = 7196 + -49775/7. Let l = q - 85. Which is the third biggest value? (a) l (b) 1/2 (c) -1 c Let c be (-1)/(36/20 - 2). Let o be (26/(-65))/((-19)/c). What is the smallest value in -0.5, -3, o? -3 Let m(p) = -p3 - 7p*2 - 5p + 5. Let x be m(-6). Let g be (0 - 2/(-12))-8. Let a = -1 - 3. What is the second smallest value in x, g, a? g Let y = -25 - -24.94. Let r = y + 0.16. Which is the smallest value? (a) r (b) 1 (c) -5 c Let x = -55.6 + 56. Suppose -4o + 3 = -h, 15 = -5h - 7o + 2o. Which is the second biggest value? (a) x (b) h (c) -0.3 c Let d = -18 - -15. Which is the biggest value? (a) -13 (b) -4/5 (c) d b Let i = 3 - 1.07. Let z = -0.07 - i. Which is the third smallest value? (a) z (b) 4 (c) -1/4 b Let y = -0.15 - -0.55. Let h = 3.11 - -0.84. Let g = 0.05 + h. What is the second biggest value in y, 0.3, g? y Let s = -0.08 - 4.92. What is the fourth biggest value in 10, 0.5, 1/4, s? s Let c = -0.1 - -0.3. Let j = -0.2 + c. Let w = 0 - -0.3. What is the third biggest value in j, -0.2, w? -0.2 Let w = 1.2 + -0.2. Let d = -1.2 - -1.2. Which is the second smallest value? (a) w (b) d (c) 2/9 c Let s = 15.9 + -16. Which is the second biggest value? (a) 2 (b) s (c) 0 c Let x = -116 + 111. Which is the second biggest value? (a) x (b) 3/7 (c) 4 (d) 3 d Let p(m) = m2 + 15m + 14. Let t be p(-14). Suppose l - 3l - i - 6 = t, -4l - 5i = 0. Which is the second smallest value? (a) -2/3 (b) 2/3 (c) l a Let b = -0.043 + 0.243. Let j be 3(8/6)/2. Let w be -3(j - 2/6). What is the third smallest value in b, w, -1/8? b Suppose -3w + 9 = 4q, 4q = 3w - w - 6. Let d(v) = -v3 + v - 1. Let k be d(q). What is the third smallest value in k, 3/4, -3? 3/4 Let m = 3 + -2.4. Let r = -0.1 + m. Let t = -2.8 - 0.2. Which is the third biggest value? (a) t (b) -1 (c) r a Let f = 3.09 - 0.09. Which is the second biggest value? (a) -0.03 (b) f (c) 2/9 c Let q be (-15)/(-60) - ((-10)/(-8) + 1). Which is the smallest value? (a) -18 (b) -3 (c) -0.2 (d) q a Let l = -12/5 - -113/45. Which is the fourth smallest value? (a) 3 (b) 2 (c) -0.5 (d) l a Let u = -0.05 - -0.25. What is the smallest value in u, -3, 4? -3 Let x(v) = v3 + 4v*2 - 5v - 1. Let p be x(-5). Let b = p + -3. What is the biggest value in b, -0.1, -2? -0.1 Let d = -0.05 - 0.25. Let j be 155/6 - (-2)/12. Let h = 235/9 - j. Which is the biggest value? (a) -5 (b) d (c) h c Let k be 8 - (2 + 2 - 2). Let b be 2 - (-3 + 39/k). What is the third smallest value in b, 5, -3? 5 Let s = 6 - 7. Let d = -1 + 1.1. Let m = d + -0.3. Which is the second smallest value? (a) s (b) 5 (c) m c Suppose i = 5i - 20. Let q = 4 + -4. What is the smallest value in q, 0.4, i? q Let x(j) = j3 + 8j*2 - j - 5. Let m be x(-8). Suppose -mz = n + 4n - 22, 10 = 3n + 5z. What is the biggest value in n, -2/5, -3? n Let b = -4 + 2. Let o be (6/9)/(2/45). Let g be 11/o - 3/(-5). What is the third smallest value in b, g, 3? 3 Let m = 872/5 - 175. Suppose -4x - 2w = -2x - 20, -3x - 2w + 25 = 0. Suppose s = 2 - x. Which is the smallest value? (a) m (b) s (c) -1 b Let s be 48/160 - 1/5. What is the fourth biggest value in 2/7, 0.11, s, 2? s Let s = 258 + 76. Let q = 5012/15 - s. Which is the second smallest value? (a) 0.3 (b) 1 (c) q a Let x = 0.2 + -0.8. Let q = -1.2 + x. Let h = 0.2 - q. What is the biggest value in -0.3, h, -1/2? h Let r = 9 - 9.4. Which is the second smallest value? (a) 5 (b) -0.2 (c) r (d) 4 b Suppose -4m - 4s = 4, 5m + 2s - 15 = 7s. Let v = -4.06 - -0.06. Let t = v + 2. Which is the second smallest value? (a) t (b) -0.4 (c) m b Let s = -1/2 + 1/4. Let o = 28 + -27. What is the biggest value in o, s, -2/11? o Let p = 46 - 45.6. Let c = -52/3 - -16. What is the third biggest value in c, 0, p? c Let u = 5 - 1. Let k be 1/((36/15)/u). What is the second smallest value in k, 3, 4? 3 Let b = 2 - 6. What is the second smallest value in b, -2, 4? -2 Let t be 1/(-1) - 517/(-495). Which is the fourth biggest value? (a) t (b) -0.1 (c) -2 (d) -4 d Let b = -44 - -43.8. What is the fourth smallest value in 2, 0.1, b, 0.69? 2 Let s = 39 + -36. Let g be (-4)/7 + (-12)/(-42). Which is the biggest value? (a) 0.2 (b) g (c) s c Let d be 18/606/9. Let r = -563/45 - -118/9. What is the biggest value in d, r, -3/7? r Suppose 2i - 3i = 0. Suppose -10 = 3v + 5. Which is the second biggest value? (a) 2 (b) v (c) i c Let h = 0.582 - -0.048. Let w = -0.03 + h. Let v = 0.4 + w. Which is the biggest value? (a) v (b) 2 (c) -0.3 b Let j = -1.9 - -10.9. Let q = 15 - j. Let g = -11 + q. What is the biggest value in 5/4, g, 5? 5 Let u = 6.5 + -0.5. Let k = 5.5 - u. Which is the third smallest value? (a) 1 (b) k (c) 5 c Let i = -39.9 - -40. Suppose 2y = -12 - 0. Let d = y - -8. What is the third smallest value in i, 5, d? 5 Let d = -68 + 114. Let x = -29 + d. Suppose 5l = -5f + 15, -3l + 0f + f = -x. Which is the smallest value? (a) l (b) 2/3 (c) -5 c Let m = 215 + -211. What is the smallest value in 0, 5, m, 0.4? 0 Let l = 18 - 18.9. Let s = -1.3 - l. Let y = -0.4 - -0.2. Which is the smallest value? (a) 0.1 (b) s (c) y b Let p = 5 + -3. Let g = 67 - 70.05. Let v = g - -0.05. What is the third biggest value in 5, v, p? v Let t = 0.03 + 3.97. Let u = 344038/7 - 49240. Let s = u + 92. Which is the second biggest value? (a) s (b) t (c) 5 b Let z = -8 + 8.1. What is the second biggest value in 0.2, 2, z? 0.2 Let k(u) = -u*3 - 5u*2 + 4u + 9. Let x be k(-4). Which is the second smallest value? (a) -0.1 (b) 0.4 (c) x (d) -0.2 d Let u(s) = s*2 + 6s - 1. Suppose -3y = -0y + 18. Let o be u(y). Let g = -8 - -5. Which is the third biggest value? (a) -0.2 (b) g (c) o b Let x = -0.21 - 0.19. Let q = 2 + 2. What is the second biggest value in x, -0.2, q? -0.2 Let s be 2/(-5) - (-54)/(-15). What is the smallest value in -2/5, s, -1? s Let w = 45.64 + 0.56. Let v = 49.21 - w. Let k = v - 0.01. What is the biggest value in 1, 2, k? k Let z = 1375115/1572 - 3499/4. Let l be ((-35)/917)/(513/492). Let p = z + l. Which is the third biggest value? (a) p (b) 2 (c) -0.2 c Let j = 4/49 - -86/147. Which is the third biggest value? (a) j (b) -32 (c) 3 (d) 4 a Let t = 1 - -2. Suppose -5y + 4o = -20, y - 4o - 20 = 4y. Which is the third biggest value? (a) t (b) y (c) 2/11 b Let y = 0.03 - 0.03. Let a be (34/8 + -3)/((-3)/(-4)). What is the third biggest value in a, -2/5, y? -2/5 Let j = 1 + 3. Let k = j - 4.2. Let h = -0.2 - k. Which is the smallest value? (a) 1 (b) h (c) -2/11 c Let q = 9.1 - -1.9. Let t = -10.7 + q. Which is the biggest value? (a) 5/2 (b) 5 (c) t b Let n = -0.15 + -4.85. Which is the second smallest value? (a) -1/9 (b) -4 (c) n b Let h = 0.74 + -0.54. Which is the second smallest value? (a) h (b) 0.3 (c) -0.03 (d) 1 a Let h = 2.78 - 3.2. Let n = h - 0.08. Which is the third biggest value? (a) -3 (b) 4 (c) n a Suppose 4n - 3t - 14 = -4, -2n - t = -10. Suppose -2 = -2u + 3w + 5, 0 = 4u - 4w - n. Which is the second smallest value? (a) 3 (b) -2 (c) u b Let w = 9.3 - 11. Let j = -0.3 + w. Let r = -2.4 - j. Which is the biggest value? (a) -3 (b) 5 (c) r b Let g = -38 + 33. What is the biggest value in g, -1/8, 3? 3 Let x(s) = -s*3 + 16s*2 - 15s + 2. Let f be x(15). Let t = -10 - -10.1. What is the third biggest value in -4, f, t? -4 Let i = 0.95	{ "pile_set_name": "DM Mathematics" }
). -13 Let c(d) = -d*2 - 206d + 1295. Give c(7). -196 Let t(z) = z*3 + 1797z*2 - 130708z - 33597. Give t(-1867). 9 Let q(h) = h*3 - 36h*2 + 6463h + 76773. Give q(-11). -7 Let x(a) = -28a2 - 3521a + 26931. Give x(-133). -68 Let z(p) = 2p2 + 37956p - 912104. Calculate z(24). -8 Let x(v) = -3v2 - 20v + 79. What is x(-9)? 16 Let h(b) = -255890b - 255891. Give h(-1). -1 Let r(z) = -2z*2 - 106z - 1220. Calculate r(-37). -36 Let a(z) = -z*2 - 35z + 1275. Calculate a(0). 1275 Let o(l) = 6l3 + 33l*2 - 29l - 172. Give o(-6). -106 Let n(z) = z*3 + 2z*2 + 77z + 62. Determine n(0). 62 Let c(w) = -344w - 103880. Calculate c(-302). 8 Let p(c) = 6c*2 + 1036c + 4906. Determine p(-167). -772 Let h(s) = -116631s - 116623. Determine h(-1). 8 Let d(c) = -c2 - 234c - 17032. Calculate d(-96). -3784 Let t(f) = 2249f - 56291. Determine t(25). -66 Let o(h) = 360h + 17773. Determine o(-50). -227 Let k(a) = 5389a - 5314. Calculate k(1). 75 Let w(h) = -63h*2 - 19778h + 1168. Determine w(-314). -88 Let h(t) = -t*3 - 42t*2 - 40t + 565. Give h(-41). 524 Let b(c) = 4c2 - 759c - 4954. Give b(196). -54 Let c(k) = -256k - 33308. Give c(-129). -284 Let l(o) = 738o*3 + 12550o*2 + 34o - 579. Determine l(-17). -1 Let m(p) = 13627p + 421949. Give m(-31). -488 Let q(s) = 82s*2 - 109s + 100. Give q(5). 1605 Let b(s) = -450457s - 4504574. Give b(-10). -4 Let i(c) = -935c + 92668. What is i(99)? 103 Let u(o) = -o*2 + 235o - 5530. Give u(188). 3306 Let p(f) = 2f2 - 994f - 39202. Determine p(-37). 314 Let t(z) = -13z3 - 143z*2 - 422z - 232. Give t(-4). 0 Let q(d) = -d*3 - 29d*2 - 82d + 1297. What is q(5)? 37 Let l(q) = 6199q2 - 37194q + 9. Calculate l(6). 9 Let m(j) = 182j + 4894. Determine m(-25). 344 Let s(w) = w3 - 2w*2 - 209w + 2864. Give s(12). 1796 Let l(n) = -4n3 - 8n*2 + 78n + 111. Determine l(-6). 219 Let k(f) = -f*3 - 2425f*2 - 9593f + 367. Give k(-4). 3 Let o(g) = -g*3 + 20g*2 - 26g + 42. Determine o(19). -91 Let b(r) = -8r2 + 1805r + 18124. What is b(235)? 499 Let x(n) = -53n3 - 87n*2 + 10n - 51. What is x(-2)? 5 Let c(q) = q*3 - 30q*2 - 123q + 1992. Calculate c(32). 104 Let m(r) = -5359r + 155277. What is m(29)? -134 Let o(d) = -10d*2 - 89d + 21. Calculate o(-10). -89 Let x(j) = 3j2 - 2800j - 1053713. Determine x(1221). 10 Let w(v) = -254v2 + 59438v - 293. Calculate w(234). 175 Let l(k) = 4k2 + 361k + 3401. Give l(-81). 404 Let n(x) = -x*3 + 38x*2 + 292x - 12233. Determine n(37). -60 Let f(y) = -770y2 - 7592y + 1091. Give f(-10). 11 Let v(z) = 4210z - 1225118. Give v(291). -8 Let w(j) = j3 + 16j*2 + 2j + 3. Calculate w(6). 807 Let h(b) = 2450b + 27447. Give h(-10). 2947 Let s(t) = 9t*2 - 515t - 5360. Determine s(-9). 4 Let a(y) = -28y2 + 322y - 1913. Calculate a(6). -989 Let s(x) = x*3 - 307x*2 - 3x - 1014. Calculate s(307). -1935 Let s(j) = 2025j + 10083. Give s(-5). -42 Let w(n) = -388n + 18123. Determine w(51). -1665 Let h(r) = -32r3 - 115r*2 - 3r - 29. Determine h(-3). -191 Let z(m) = -m*2 + 3578m - 1750929. Calculate z(585). -24 Let r(o) = 590o2 + 2o - 9. Give r(0). -9 Let o(b) = 48b2 + 672b + 43. Calculate o(-14). 43 Let k(b) = -8b2 + 150b - 2033. Determine k(31). -5071 Let p(m) = 19m3 - 162m*2 + 121m - 346. Calculate p(8). -18 Let d(i) = 4i2 + 490i - 710. Give d(-123). -464 Let a(i) = i*3 - 16i*2 + 213i - 1984. Determine a(12). -4 Let y(g) = g*2 - 1189g - 76627. Give y(-61). -377 Let d(s) = 111s - 5330. Give d(48). -2 Let g(w) = 8w*2 - 3185w - 559179. Give g(530). -29 Let d(f) = 41f2 + 366f - 486. Calculate d(-10). -46 Let p(i) = 219i - 14200. Calculate p(48). -3688 Let f(n) = 270795n + 1353961. Determine f(-5). -14 Let j(u) = 147u - 171. Calculate j(4). 417 Let q(a) = 14967a - 2649161. Determine q(177). -2 Let z(i) = i*3 - 454i*2 - 4757i - 1198. Determine z(-10). -28 Let q(s) = 329s + 60515. Calculate q(-184). -21 Let k(n) = -n3 + 150n*2 - 884n - 16731. Determine k(143). 0 Let v(q) = -33q2 + 2357q - 170. What is v(71)? 824 Let u(m) = -410m - 22454. Give u(-55). 96 Let o(p) = -p2 - 16p + 451. Calculate o(-19). 394 Let j(f) = -1761f + 3683. Give j(2). 161 Let c(n) = -77n - 2880. Determine c(-34). -262 Let l(v) = 3991v + 973772. Calculate l(-244). -32 Let p(s) = -2s*2 - 1393s + 17012. Give p(12). 8 Let j(a) = 2884232a + 25958093. Give j(-9). 5 Let c(z) = -71z + 594. What is c(11)? -187 Let u(k) = k*2 - 38626k + 1273559. Determine u(33). -10 Let s(k) = 3k2 + 7965k + 95112. Determine s(-12). -36 Let r(c) = -97c + 7875. Determine r(80). 115 Let b(x) = -861x + 20828. Give b(26). -1558 Let g(f) = 1754f - 91415. Determine g(52). -207 Let u(t) = -13818t + 290120. What is u(21)? -58 Let t(j) = 52j2 - 100j + 6. What is t(2)? 14 Let r(b) = -2734b - 9403. What is r(-3)? -1201 Let x(z) = -61z*3 + 303z*2 - 85z + 478. What is x(5)? 3 Let z(u) = 155u + 7516. Determine z(-58). -1474 Let v(z) = -40z*2 - 445z - 2697. Determine v(-6). -1467 Let d(m) = -3m2 + 194m - 3375. Calculate d(19). -772 Let c(d) = 162003d + 3402064. Give c(-21). 1 Let k(v) = 37v + 3269. Calculate k(-98). -357 Let t(l) = -l*2 + 17l - 58. Determine t(27). -328 Let r(m) = 146m - 7951. Determine r(57). 371 Let h(w) = 6968w + 285745. Determine h(-41). 57 Let q(v) = 719v + 6779. What is q(-11)? -1130 Let m(r) = 38r*3 + 2434r*2 + 459r + 21163. Determine m(-64). -21 Let t(j) = 537j3 - 536j*2 - 354j + 354. Determine t(1). 1 Let k(u) = -9880u + 19736. What is k(2)? -24 Let v(h) = -h3 + 35h*2 - 69h + 2349. Determine v(35). -66 Let o(v) = 1018v + 415396. Give o(-408). 52 Let g(b) = 4b*2 - 1204b - 144. What is g(302)? 1064 Let w(b) = 12898b - 13069. Determine w(1). -171 Let m(b) = 2b*2 + 21b - 3648. What is m(-48)? -48 Let z(v) = 23v2 + 7v - 21. Calculate z(-4). 319 Let v(x) = 1296x2 - 86832x + 12. Give v(67). 12 Let h(k) = -13k2 + 2054k + 772. What is h(158)? 772 Let a(w) = 562w + 62408. Determine a(-112). -536 Let k(l) = -579213l + 2896130. Give k(5). 65 Let d(n) = -75007n - 74969. Determine d(-1). 38 Let a(r) = 73r*2 - 5r - 28. What is a(-4)? 1160 Let j(d) = -d*2 - 4585d + 579082. Give j(123). -2 Let a(t) = -4t3 - 87t*2 - 201t - 1173. Give a(-20). 47 Let c(s) = -12026s - 204486. What is c(-17)? -44 Let k(c) = 353655c - 8134042. What is k(23)? 23 Let i(g) = -6143g - 9067061. What is i(-1476)? 7 Let a(c) = -22c*3 - 85c*2 - 65c - 8. Calculate a(-3). 16 Let g(b) = 9359b + 748724. Give g(-80). 4 Let v(d) = 53d*3 + 149d*2 + 86d + 13. Give v(-5). -3317 Let q(h) = 357h - 338077. Give q(947). 2 Let d(b) = -4b*2 + 67b - 22. Give d(42). -4264 Let o(m) = -63m2 + 53m - 60. Calculate o(5). -1370 Let c(v) = 2v3 - 2v*2 + 472v + 2042. Determine c(-4). -6 Let f(w) = 161w + 452. Determine f(2). 774 Let k(d) = -3d*3 + 11d*2 - 4d + 132. Calculate k(9). -1200 Let u(l) = 4l2 - 474l + 8115. What is u(18)? 879 Let t(a) = 74246a - 74639. What is t(1)? -393 Let f(x) = 2x*2 + 411x + 17098. Calculate f(-58). -12 Let c(p) = 3063328p + 27569952. Determine c(-9). 0 Let v(w) = 285w*2 + 374w - 3692. Calculate v(3). -5 Let n(w) = 31w + 240. What is n(25)? 1015 Let f(y) = -108y + 12680. What is f(126)? -928 Let h(t) = -3t3 - 167t*2 + 128t + 4011. Give h(-56). -21 Let a(g) = 14235g2 - 185056g + 16. Calculate a(13). 3 Let b(f) = 126f + 170. Calculate b(-6). -586 Let j(w) = 727w*2 - 164297w - 1128. Calculate j(226). 2 Let b(i) = -14i2 - 15267i - 83536. What is b(-1085)? 9 Let y(p) = -9p3 - 60p*2 + 87p - 96. Calculate y(-8). -24 Let u(m) = -15m2 + 1093m - 3294. What is u(3)? -150 Let a(n) = 7n2 - 576n - 123664. What is a(-98)? 12 Let n(s) = -659675s + 1319337. Give n(2). -13 Let v(x) = 4637x - 357053. Give v(77). -4 Let i(r) = r*3 - 83r*2 + 328r - 944. Calculate i(79). 4 Let a(n) = 321371n - 1928270. What is a(6)? -44 Let l(h) = 1610h*2 + 495881h + 301. Give l(-308). -7 Let g(s) = 102s2 + 157s - 436. What is g(-3)? 11 Let s(z) = -z*2 + 122z + 2798. Give s(-19). 119 Let f(u) = 194u - 497. What is f(6)? 667 Let i(r) = 22r*2 + 267r - 4776. Giv	{ "pile_set_name": "DM Mathematics" }
= -r2. Determine f(t(a)). -a2 Let d(p) = -3p2. Let n(a) be the third derivative of a5/30 - 54a*2. What is d(n(t))? -12t*4 Let n(r) = -5r*2. Let h be 1/(-4)10-2. Suppose 0 = -4a - hd - 17, -5d - 6 - 25 = -3a. Let z(x) = ax - x*2 - x - x. Determine n(z(u)). -5u*4 Let o(x) = -2x - 9 + 9. Let n(f) = -2f + 0f - 2f. Calculate n(o(u)). 8u Let h(k) = k. Let y(j) = -j*2 + 5j + 5. Let x(w) = -2w2 + 8w + 8. Let z(m) = -5x(m) + 8y(m). Give h(z(t)). 2t2 Let h(v) be the second derivative of 1/3v*3 + 0v*2 + 4v + 0. Let m(n) = n*2. Calculate h(m(k)). 2k*2 Let w(l) = -3l*2. Let n(x) = 382x. What is n(w(o))? -1146o2 Let x(j) = j2. Let u(o) = 334o. Determine x(u(l)). 111556l2 Let a = 7 + 3. Let c(z) = -10z + 6z + az. Let k(j) = 3j2. Calculate c(k(y)). 18y2 Let f(d) be the third derivative of -d4/24 - 2d2. Let u(i) = -6i. Calculate f(u(b)). 6b Let m = 2 + 2. Suppose z - 10 = -2u, 2u - u = mz - 4. Let i(n) = 2 - zn2 - 2. Let g(s) = -s2. Determine g(i(a)). -4a*4 Let w(i) be the third derivative of 0 + 5/24i*4 + 0i*3 + 0i - 4i2. Let m(j) = j2. Determine m(w(t)). 25t*2 Let z(t) = 2t - 10. Let m be z(10). Let b(h) = -mh2 + 11h*2 - 2h*2. Let v(l) = 3l*2. Determine v(b(r)). 3r*4 Let f(x) = -2x. Let u(q) be the second derivative of 1/6q3 + 0 + 0q*2 - q. Calculate u(f(j)). -2j Let v(m) be the second derivative of 19m4/12 + 12m. Let g(s) = -2s. Determine v(g(h)). 76h*2 Suppose -4 - 2 = -3i. Let p(b) = ib - 2b - b + 2b. Let n(d) = 9d*2. Give p(n(g)). 9g*2 Let d(q) = -2q. Suppose 0 = x - 0x - 4. Let w(n) be the third derivative of 0n3 + n2 + 0 - 1/12nx + 0n. Determine d(w(u)). 4u Let q(b) = -1886b*2 - 782b. Let t(w) = -29w2 - 12w. Let v(u) = -6q(u) + 391t(u). Let h(d) = 2d. Calculate h(v(n)). -46n*2 Let o(b) = -3b*2. Let m = 2 - 0. Let s(d) be the second derivative of -2d + 0dm - 1/3d*3 + 0. Determine o(s(t)). -12t*2 Let w(g) = -g + 1. Let r(d) = 2. Let n(m) = r(m) - 2w(m). Let k(b) = -12b. Give k(n(o)). -24o Let z(n) be the second derivative of n*7/504 - 5n*4/12 + 7n. Let g(f) be the third derivative of z(f). Let t(b) = 3b2. Determine g(t(h)). 45h*4 Let x(r) = 3r*2 - 4r + 4. Let w(p) = -3p2 + 3p - 3. Let d(n) = -4w(n) - 3x(n). Let m(l) be the second derivative of -l*4/6 - 2l. Calculate m(d(a)). -18a4 Let g(p) = 2p*2. Let z(j) = 467j*2. Give z(g(a)). 1868a*4 Let b(t) = 3t + 142. Let k(u) = 3u2. Calculate b(k(q)). 9q*2 + 142 Let m(o) = -o - 3. Let g be 24/(-10) + 32/80. Let i(h) = 1. Let p(n) = gm(n) - 6i(n). Let k(w) = 7w*2. Give p(k(x)). 14x*2 Let v(q) = 2q - 3. Let n(x) = -x + 2. Suppose 3g + 2g = 15. Let c(d) = gn(d) + 2v(d). Let p(z) = -z2. Determine p(c(m)). -m2 Let u(a) = -3a2 + a2 + 8a*2 - 2a*2. Let q(t) = -7t. What is u(q(w))? 196w2 Let c(y) = y - 5. Let v(m) = -m + 4. Let t(l) = 4c(l) + 5v(l). Let i = 4 - 2. Let h(z) = z2 + zi - 2z + 2z. Determine t(h(b)). -2b*2 Let s(p) = 4p. Let f(b) be the first derivative of 1/3b3 + 2 + 0b + 0b2. Calculate f(s(t)). 16t*2 Let x(m) be the first derivative of 1 + 0m*2 + 2/3m*3 + 0m. Let l(f) be the third derivative of -f*4/12 - 3f*2. Determine x(l(o)). 8o*2 Let b(t) be the first derivative of 2t3/3 - 2. Let d(a) be the third derivative of a5/30 + 16a2. Calculate b(d(x)). 8x*4 Let i(z) = 298z. Let x(q) = -8q. Determine i(x(y)). -2384y Let b(t) = -32t. Let w(g) = 2g. Give b(w(d)). -64d Let o(v) = 0v*2 + 6v*2 - 2v*2. Let b(t) = -7t. Let r(h) = -8h. Let q(k) = -6b(k) + 5r(k). Give o(q(s)). 16s*2 Let m(s) = s. Let i(w) = -190w*2 - 15. Calculate i(m(n)). -190n*2 - 15 Let b(v) = -3v. Let x(i) be the third derivative of -1/60i5 + 0i + 0i4 + 0i*3 + 0 - 2i*2. Give x(b(a)). -9a*2 Let f(g) = -g. Let h(r) = r + 2. Let o be h(-2). Let c = 1 + o. Let l(z) = -4z + 2z + 1 - c. Determine l(f(y)). 2y Let x(n) = 2n. Let c(k) = 256k*2. Determine x(c(i)). 512i*2 Let r(o) = 6o + 3. Let l(k) = 17k + 8. Let w(b) = 3l(b) - 8r(b). Let n(d) = -81d - 80d + 159d. What is w(n(p))? -6p Let o(c) = -2c*2. Let g(a) = 11a*2 - 5a + 5. Let x(b) = 39b2 - 18b + 18. Let n(f) = -18g(f) + 5x(f). Determine o(n(j)). -18j4 Let n(d) = 17d*2 - 2. Let y(l) = 5l. Determine y(n(f)). 85f2 - 10 Let d(x) be the second derivative of -x3/6 - 2x. Let j(y) = -3y2 + 4y*2 - 3y*2. Calculate d(j(a)). 2a*2 Let c(g) = -g + 4. Let s be c(-5). Suppose -w - 2w = -s. Let n(h) = w - 3 - 2h2. Let v(i) = i2. Give n(v(m)). -2m*4 Let z(j) = -7j*2. Let g(o) = 6o*2 - 5o*2 - 4o*2 + 2o*2. Determine z(g(w)). -7w*4 Let b(d) be the third derivative of 0d + d*2 + 0d*3 + 1/12d*4 + 0. Let v(i) = 4i. Give v(b(x)). 8x Let i(k) = 2k + 85. Let h(l) = -7l2. Calculate i(h(j)). -14j*2 + 85 Let q(p) = -2p*2. Let z(k) be the second derivative of -7k*4/3 + 35k. Determine z(q(b)). -112b4 Let j(h) = 4h. Let v(r) = -3r. Let i(x) = 3j(x) + 2v(x). Let w(z) = z - 2. Let b(f) = -1. Let u(m) = 4b(m) - 2w(m). What is i(u(d))? -12d Let o(y) = y*2 - 3y*2 + 0y2. Let c(a) be the third derivative of -a5/60 + 21a2. What is c(o(k))? -4k*4 Let c(p) = -137p*2. Let f(s) = -s. Give f(c(w)). 137w*2 Let m(t) = -124t + 1. Let f(g) = -g. What is f(m(o))? 124o - 1 Let w(t) = 4t*2 + 2t. Let u(n) = n*2. Let j(y) = 2u(y) + w(y). Let a(q) = -q. What is j(a(h))? 6h2 - 2h Let r(m) be the second derivative of m*3/6 - 2m. Let c be 22/6 - (-1)/3. Let s(t) = -c + 3t2 + 4. What is r(s(a))? 3a*2 Let a(d) = -13d. Let s(j) = 5j2 - 12j2 + j2 + 7j2. Determine s(a(f)). 169f*2 Let j be -1 + (-5)/((-20)/12). Let z(b) = 2 + 3b*2 - j - 2b*2. Let k(h) = -3h*2. Calculate k(z(d)). -3d*4 Let q(u) = 8u + 3. Let r(w) = 5w. Give q(r(l)). 40l + 3 Let s(x) be the second derivative of -x*3/3 + 2x. Let y(a) = -29a2. Give s(y(z)). 58z*2 Let w(l) be the second derivative of -3l*4/4 + 3l. Let c(t) = 8t - 10t + 4t. What is c(w(m))? -18m*2 Let c(t) = -5t*2 + 47. Let i(y) = -7y*2. What is i(c(b))? -175b*4 + 3290b*2 - 15463 Let y(t) = -t. Let g(i) = -5i*2 + 5i + 5. Let o(w) = 2w2 - 3w - 3. Let q(a) = 3g(a) + 5o(a). What is q(y(b))? -5b2 Let r(m) = -14m. Let v(w) = 311w. Determine r(v(s)). -4354s Let q(v) be the third derivative of v*4/24 - 38v*2. Let k(t) = -10t. Give q(k(f)). -10f Let w(u) = -4u - 5. Let i(b) = b + 1. Let x(k) = -5i(k) - w(k). Let l(y) = -22y. Determine x(l(t)). 22t Let u(p) = 20p2 - 1. Let a(t) be the third derivative of -t5/60 + 23t2. Calculate u(a(g)). 20g*4 - 1 Let d(w) = -2w. Let t(b) = -4 + 0b + 2b + 0b + 0b. Let u(x) = 2x - 3. Let s be 2/626. Let n(z) = su(z) - 3t(z). Calculate d(n(l)). -4l Let y(l) = 13l2. Let q(r) be the second derivative of -r4/6 + 14r. Calculate y(q(n)). 52n4 Let m(d) be the second derivative of -d4/6 - d. Let g(z) = 4z2 + z2 - z*2. Calculate m(g(l)). -32l*4 Let v(m) = 5m*2. Let f(l) = -5l. Let n(g) = -10g. Let u(w) = -5f(w) + 3n(w). What is u(v(a))? -25a*2 Let v(o) = 6o*2. Let k(q) = -14q - 23. Determine v(k(g)). 1176g2 + 3864g + 3174 Let b(s) = 2s. Let w(k) = k. Let l(r) = -r - r2 - 4r*2 + 6 + 5r2 - r2. Let u be l(0). Let x(n) = -10n. Let j(c) = uw(c) + x(c). Determine b(j(o)). -8o Let d(v) = -v2 - 6v + 6. Let p(s) = -2s2 - 13s + 13. Let h(m) = 13d(m) - 6p(m). Let i(t) = 45t2. What is i(h(c))? 45c*4 Let a(i) = -7i. Let f(x) = 35x. Give f(a(b)). -245b Let h(m) be the third derivative of m4/24 - m2. Let t(o) = 4o - 4o - 5o2 + o2. Determine h(t(v)). -4v*2 Let c(r) = -r. Let i(d) be the third derivative of -11d*4/24 - 18d*2. What is c(i(g))? 11g Let l(o) = -3o. Let b(m) = 924m*2. Calculate b(l(n)). 8316n*2 Let g(b) = 2b. Let y(m) = -30m2 - 28m*2 - 66m + 56m2. What is y(g(x))? -8x*2 - 132x Let z(t) = 2t2. Let h(r) = -29r + 2. Let l(w) = 115w - 9. Let j(c) = 9h(c) + 2l(c). What is z(j(y))? 1922y*2 Let p(w) = 76w2. Let d(v) be the third derivative of v4/12 + 36v2. Give p(d(a)). 304a*2 Let a(s) = -15	{ "pile_set_name": "DM Mathematics" }
545325660 a multiple of 396? True Is 477725182 a multiple of 14? False Is 12 a factor of 1562277348? True Does 481 divide 95937842? False Is 112637448 a multiple of 18? True Is 11141514 a multiple of 459? False Does 86 divide 32218770? False Is 2073859854 a multiple of 606? False Is 2729 a factor of 2299889674? False Does 50 divide 224379500? True Is 80334090 a multiple of 570? True Does 4 divide 59096404? True Is 2837387 a multiple of 12? False Does 7 divide 116508099? False Is 15738733 a multiple of 5? False Is 418955460 a multiple of 29? True Does 1817 divide 37117676? True Is 236545552 a multiple of 17? False Is 73 a factor of 268982516? True Is 4 a factor of 346291? False Is 151187048 a multiple of 11? False Does 263 divide 184482932? False Is 151390829 a multiple of 628? False Is 33 a factor of 978999198? False Does 472 divide 74755508? False Is 12345129 a multiple of 6? False Is 9 a factor of 60946017? False Is 205704733 a multiple of 151? True Is 3496864 a multiple of 121? False Does 29 divide 21864956? True Is 2782 a factor of 516558015? False Does 19 divide 1035092165? True Is 62871 a multiple of 3? True Is 3 a factor of 21047549? False Is 290 a factor of 536048827? False Is 46389 a multiple of 48? False Does 1186 divide 26861229? False Is 27394395 a multiple of 103? True Does 517 divide 99462853? False Is 7 a factor of 1598687? False Is 49 a factor of 140755685? True Is 62938057 a multiple of 233? False Does 371 divide 46208050? True Is 5148786 a multiple of 694? True Does 1085 divide 116288913? False Is 215490222 a multiple of 18? True Does 128 divide 141591680? True Does 19 divide 869723803? True Is 119097678 a multiple of 159? True Does 6228 divide 77395356? True Is 223 a factor of 7505265200? False Is 26226970 a multiple of 154? True Is 3720865 a multiple of 3? False Is 1107204062 a multiple of 320? False Does 425 divide 412681800? True Does 23 divide 17978569? False Is 409662959 a multiple of 24? False Is 21945366 a multiple of 747? True Is 4067666 a multiple of 261? False Is 3714 a factor of 165930975? False Is 109705297 a multiple of 1034? False Does 7 divide 101549? True Is 24974331 a multiple of 25? False Does 8 divide 5355976? True Does 86 divide 27086388? True Does 555 divide 313375200? True Does 628 divide 609287484? True Is 1500094175 a multiple of 5605? True Is 2420 a factor of 5209190? False Is 49 a factor of 1277136? True Does 398 divide 168513503? False Is 3754157 a multiple of 324? False Does 33 divide 1540916322? True Is 79 a factor of 118747349? True Is 4117056195 a multiple of 3164? False Does 8 divide 2980882? False Is 309 a factor of 16825560? False Does 270 divide 99433050? False Does 12 divide 65865919? False Is 47640313 a multiple of 20? False Is 100 a factor of 111212900? True Is 507982217 a multiple of 51? False Is 1243 a factor of 27662965? True Is 836 a factor of 227583444? True Is 536245738 a multiple of 1799? False Is 338035613 a multiple of 15? False Is 27 a factor of 1477186092? True Is 340 a factor of 73550847? False Is 2254 a factor of 10011802? False Is 159934896 a multiple of 1562? False Does 38 divide 8530611? False Does 1181 divide 44836738? False Does 3374 divide 599799354? True Is 27932500 a multiple of 20? True Does 43 divide 4049998? True Is 895990699 a multiple of 14? False Does 62 divide 96654602? False Does 24 divide 2288498274? False Does 15 divide 5921571850? False Is 2143255589 a multiple of 259? False Is 1455 a factor of 163808265? True Is 7 a factor of 20148404? False Is 816720835 a multiple of 6167? False Is 1800169081 a multiple of 2959? False Is 23997796 a multiple of 3273? False Is 11001928 a multiple of 7? True Does 685 divide 95102278? False Is 2 a factor of 3308599? False Does 691 divide 97869094? True Is 167416070 a multiple of 2651? False Is 3737 a factor of 1315741645? True Is 20495647 a multiple of 550? False Is 21718068 a multiple of 591? True Is 176 a factor of 105248? True Is 10 a factor of 651508832? False Does 415 divide 5538412? False Does 99 divide 878026545? True Is 7134498 a multiple of 21? True Is 2332 a factor of 33268312? True Is 348 a factor of 39474336? True Is 54132824 a multiple of 15? False Does 1169 divide 443596304? False Does 625 divide 198028950? False Is 6643731 a multiple of 56? False Is 956 a factor of 20731959? False Is 18 a factor of 84276? True Is 809 a factor of 37179076? False Is 24884505 a multiple of 1085? False Does 2 divide 11659736? True Is 12 a factor of 559173432? True Is 61 a factor of 1133194771? False Does 28 divide 351472245? False Does 13 divide 2965664? True Does 6819 divide 14278986? True Is 19618236 a multiple of 33? True Is 67 a factor of 56125833? True Is 104065020 a multiple of 412? True Does 3 divide 12516249? True Does 3024 divide 1673055216? True Is 87 a factor of 60389591? False Does 345 divide 213684309? False Is 14 a factor of 62197440? False Is 12 a factor of 270579108? True Does 806 divide 1742549432? True Is 597886484 a multiple of 52? True Is 1320 a factor of 188799600? True Does 763 divide 45002503? True Is 148 a factor of 108303886? False Does 2 divide 19823150? True Is 6301 a factor of 1319542573? False Is 824083590 a multiple of 2989? False Is 6 a factor of 134749908? True Is 2833 a factor of 111071845? False Is 37 a factor of 13142289? True Is 1879 a factor of 2430107772? False Is 10665699 even? False Is 25472013 a multiple of 719? True Does 9 divide 31946544? True Is 200232032 a multiple of 494? True Does 70 divide 13318219? False Is 10744521 a multiple of 195? False Is 2545 a factor of 660087862? False Does 181 divide 41890459? True Is 2 a factor of 42119368? True Is 114183536 a multiple of 1334? False Is 735 a factor of 277830? True Does 4259 divide 1505641680? True Does 284 divide 45607449? False Is 579209584 a multiple of 972? False Is 66 a factor of 217742580? True Is 26047553 a multiple of 223? False Is 972027302 a multiple of 2004? False Is 3 a factor of 88804071? True Is 2658801683 a multiple of 119? False Is 139181860 a multiple of 16? False Is 49 a factor of 5062582? True Does 215 divide 22002025? True Does 8 divide 193049493? False Is 3905 a factor of 455053555? True Does 17 divide 166831234? True Does 134 divide 35918300? False Does 215 divide 46134033? False Does 227 divide 36758791? True Is 248506850 a multiple of 1488? False Is 32 a factor of 23271008? True Does 11 divide 544777200? True Is 272 a factor of 563329728? False Is 136985100 a multiple of 925? True Does 1030 divide 35246929? False Is 1561004 a multiple of 24? False Does 126 divide 92859142? False Is 328 a factor of 1464306800? True Does 2 divide 32877208? True Is 459 a factor of 6661095? False Is 696 a factor of 50959824? False Is 28605336 a multiple of 76? True Is 64897864 a multiple of 3? False Is 1734437268 a multiple of 276? True Is 214836717 a multiple of 20? False Is 51511326 a multiple of 629? True Is 33332598 a multiple of 543? True Is 25 a factor of 1790528939? False Does 113 divide 6106621? False Does 12 divide 3333460? False Is 61 a factor of 41984043? True Is 2571 a factor of 3006609672? True Is 6 a factor of 6294426? True Is 4 a factor of 91682182? False Is 55884526 a multiple of 160? False Is 957 a factor of 61898760? True Does 139 divide 65609529? True Is 121761073 a multiple of 59? True Is 559 a factor of 490043776? False Is 223642467 a multiple of 111? True Is 10391178 a multiple of 42? True Is 1745 a factor of 212708748? False Does 11 divide 112141362? False Does 839 divide 96957742? False Is 86 a factor of 4216097368? True Does 14 divide 1428184212? True Is 1617 a factor of 176428728? False Does 50 divide 2189434500? True Is 109 a factor of 466476618? True Does 16 divide 399825312? True Is 12 a factor of 87376421? False Does 8 divide 17199501? False Does 1974 divide 35498442? True Is 50764776 a multiple of 12? True Does 1278 divide 1523376? True Does 16 divide 20496363? False Is 33 a factor of 22668558? True Is 379408530 a multiple of 10? True Is 169 a factor of 41324800? False Is 131247773 a multiple of 44? False Is 5267268 a multiple of 2? True Is 174071293 a multiple of 31? True Does 88 divide 206880? False Is 3378274679 a multiple of 362? False Is 104770414 a multiple of 849? False Does 58 divide 43391965	{ "pile_set_name": "DM Mathematics" }
pose -25 = -3n + 17. What is the highest common divisor of n and 42? 14 Suppose -2b + 0b + 182 = y, 0 = -3b + 3y + 273. Suppose 0 = -4a + 24 + 28. Calculate the highest common divisor of a and b. 13 Let q = 16 + -7. What is the highest common divisor of 144 and q? 9 Suppose 2q + 64 = 4k - 3q, 0 = -4k + 2q + 76. Calculate the highest common factor of 231 and k. 21 Suppose 2d + 349 = 4d + 5t, -930 = -5d - t. Calculate the highest common factor of 17 and d. 17 Let z be (4 + -2 + -6)-2. Calculate the highest common factor of 8 and z. 8 Suppose 2k - 2 = 2i - 0, 5k = -i + 11. Suppose -4a = -ka. Suppose -2j = -2t - 14, j = -at + 5t + 19. Calculate the highest common factor of j and 8. 4 Let h = 73 - 10. Suppose -3 = a - 0, 3a = -d. Calculate the highest common divisor of d and h. 9 Suppose -4 = -d - f + 1, f = 5d - 7. Let y(v) = v - 2v + v3 + 2 + 0 - vd. Let p be y(3). Calculate the greatest common divisor of p and 187. 17 Suppose 2k - 8 = -2k. What is the highest common divisor of k and 4? 2 Let p(u) = 2u2 - 8u + 12. Let n be p(8). Suppose 4l - n = -4j, 25 = 3j - 2j - 5l. What is the greatest common factor of j and 30? 10 Let x(u) be the first derivative of u4/4 + 10u*3/3 + 2u*2 + 5u + 6. Let t be x(-5). Calculate the greatest common factor of 10 and t. 10 Suppose 0 = -3r - 3i - 3, -5r + 4i - 6i = -4. What is the highest common divisor of 14 and r? 2 Let q = 6 + -7. Let a be (-5)/(5/(-2)) - q. What is the highest common factor of a and 1? 1 Let x = -12 - 6. Let y be 2x/(-8)6. Suppose 3v = y - 6. Calculate the highest common factor of v and 21. 7 Let v(f) = f2. Let k = 2 + -3. Let c be v(k). Let z(s) = s2 + 6s + 5. Let p be z(-6). What is the greatest common factor of p and c? 1 Let q = 7 - 5. Suppose -qg + 350 = 5j, -4j + 97 = -g - 183. What is the greatest common divisor of j and 28? 14 Let n = -49 - -55. What is the greatest common factor of 54 and n? 6 Let u be (-10)/(1/2-1). Let z = -3 - -6. Let j = 47 + z. What is the highest common divisor of u and j? 10 Let v(o) = -o3 - o2 + 4o - 1. Let p be v(-3). Let b be 62/p + (-8)/20. Suppose 5h - 2h = 36. Calculate the greatest common divisor of b and h. 12 Let q(g) = -g*3 + 8g*2 - g - 4. Let r be q(4). Calculate the greatest common divisor of r and 7. 7 Let g(v) = v + 14. Let y be -1 + -8(3 + -2). Let h = y - -2. Let c be g(h). What is the highest common factor of c and 1? 1 Let w(x) = 1 + 3 - 6x + 7x. Let o be w(2). What is the greatest common factor of o and 4? 2 Let t be (-9 + 10)(1 - -2). Suppose -2m + 10 = -2s, ts + 23 = 4m + 2s. Calculate the highest common factor of 66 and m. 6 Suppose -4j = -0j - 240. Let z = 30 + -3. Let x be -2 + (z - 1)/1. What is the highest common factor of x and j? 12 Suppose -4x = -2k + 344, 2k - 2x = 4k - 368. Calculate the highest common divisor of k and 45. 45 Let g(x) = x3 + 7x*2 + 3x. Let m be g(-6). Calculate the highest common divisor of 9 and m. 9 Let v(w) = 84w - 4. Let q be v(3). Suppose 0 = 3c + 2g - q, 135 + 41 = 2c + 4g. What is the highest common divisor of c and 16? 16 Suppose 4t - 46 = -5l, -l = -5l + 5t + 45. Let v = l - 9. Let y(w) = w. Let u be y(2). What is the highest common divisor of v and u? 1 Let k(n) be the third derivative of 3n5/20 - n4/24 - n*3/3 - 4n*2. Let b = 0 + -2. Let a be k(b). What is the greatest common divisor of 12 and a? 12 Suppose 5m = -20, 0 = 2z - 6z - 2m + 152. Suppose 2t = -c + 19, 0 = -0t + 4t - 2c - 42. Calculate the highest common factor of z and t. 10 Let s be (-3)/1 + -5 + 10. Suppose -so + 6o - 36 = 0. Calculate the highest common divisor of o and 72. 9 Let w = 170 + -167. Calculate the highest common factor of 27 and w. 3 Suppose -2o + 4 = -4. Let g(f) = f*3 - 3f*2 - 4f + 4. Let b be g(o). Calculate the highest common factor of b and 32. 4 Let q = -32 + 9. Let k(m) = -19m + 1. Let p be k(-2). Let g = q + p. What is the greatest common factor of 64 and g? 16 Let o(f) = -20f - 3. Let n = -9 + 7. Let s be o(n). Suppose 5u - s - 28 = 0. Calculate the highest common divisor of 26 and u. 13 Suppose 1 = -7d + 8d. Calculate the greatest common divisor of 7 and d. 1 Let k = 27 - 16. Let p = k + 1. Calculate the greatest common factor of p and 120. 12 Let u(h) = 6h + 17. Let z be u(5). Calculate the greatest common factor of 235 and z. 47 Let x(b) = 34 - 10b + 10 + 4b + 7b. Let u be x(0). Calculate the greatest common divisor of 4 and u. 4 Let j = -8 + -10. Let g = 58 + j. Calculate the highest common divisor of g and 5. 5 Let c(f) = -f3 - f2 + 4f + 2. Let g be c(-4). What is the highest common factor of 136 and g? 34 Let q(f) = -f*3 + 9f*2 - 9f + 10. Let b be q(8). Calculate the highest common divisor of b and 10. 2 Suppose 0q - 270 = -4g - q, g = 3q + 74. Calculate the greatest common factor of g and 102. 34 Let q be 22 + 2(-2 + 3). Calculate the greatest common factor of q and 6. 6 Let w(p) be the first derivative of -3 + 5p - 1/4p*4 - 3p*2 - 7/3p*3. Let s be w(-6). What is the greatest common divisor of s and 5? 5 Let w(u) = 2u*2 - 11u + 8. Let t be w(7). Calculate the greatest common factor of 29 and t. 29 Let g(i) = 67i2 - 1. Let s be g(1). Calculate the greatest common factor of s and 44. 22 Let c(l) = 22l*2 - 6l + 4. Let s(j) = 44j2 - 11j + 7. Let f(k) = -7c(k) + 4s(k). Let a be f(2). What is the highest common divisor of 14 and a? 14 Let r(t) = 4t. Let l be r(1). Let p be 15/(-2 - (-10)/l). Let g(n) = -n. Let i be g(-3). Calculate the highest common divisor of i and p. 3 Let i(f) = f2 - 9f - 10. Suppose -2z + 38 = 4t, 55 = 3z + 8t - 3t. Suppose -29 = -4g + z. Let d be i(g). What is the highest common factor of 12 and d? 12 Let f = -429 - -251. Let v = -101 - f. What is the highest common divisor of 11 and v? 11 Let s be (195/6 + -2)2. Let r = 180 - s. Calculate the greatest common factor of 17 and r. 17 Let l be (-58)/51(-5)/2. What is the highest common divisor of 261 and l? 29 Suppose -20 = -9g + 4g. Suppose 4y = b + 123, 20 = 3b + b. Calculate the highest common factor of g and y. 4 Suppose 3s - 39 + 3 = 0. Let z be 23 - (-3)/(-6)-2. Calculate the highest common factor of s and z. 12 Suppose 0 = 2j - 0j. Suppose j = p - 3p + 36. Let a = 412 - 250. What is the highest common factor of p and a? 18 Suppose 0q + 20 = q. Suppose b + 2b = -5z + 37, q = 2b + z. What is the greatest common divisor of 36 and b? 9 Suppose 3z - 17 + 2 = 0. Suppose -2v = -zv + 216. Calculate the highest common divisor of 8 and v. 8 Let t(x) be the first derivative of -x4/4 - x3 - x2/2 + 2x + 1. Let o = 6 - 9. Let c be t(o). Calculate the greatest common divisor of c and 5. 5 Suppose 2j - 7h + 4h - 13 = 0, j = -h + 4. Suppose 4z = jz - 4. Calculate the greatest common divisor of 16 and z. 4 Let c(t) = -t2 - 20t - 18. Let i be c(-14). Calculate the greatest common factor of i and 264. 66 Suppose 0 = 4a - 6a + 4. Suppose o + 0p = 5p + 29, 4o + ap = 50. What is the greatest common divisor of 42 and o? 14 Suppose 3d = -3c + 33, 3c - 50 + 21 = -d. Let t be (-4 + 9)(-3)/(-5). What is the greatest common factor of t and c? 3 Suppose 47 = -5u - 18. Let x = 35 + u. What is the greatest common factor of x and 154? 22 Suppose 4f = -2f + 738. Calculate the greatest common factor of f and 82. 41 Let y be 16/(-12) - 13/(-3). Suppose -3o - w = -39, -6o + yo = -w - 45. What is the highest common factor of 154 and o? 14 Suppose -4s + 2s + 196 = 0. Suppose -2q + 37 - 9 = 0. What is the highest common factor of s and q? 14 Let f(a) = 18a*2 - a - 2. Let y be f(-2). Suppose z + 0z = 2c + 24, 3z = -3c + y. What is the greatest common divisor of z and 3? 3 Let r = 91 - 55. Suppose 5l - 2 = 8. Suppose -2x - lj + 24 = 2, 4x = -5j + 43. Calculate the greatest common divisor of r and x. 12 Let p(h) = h*3 + 4h*2 - h - 2. Let s be p(-4). What is the greatest common factor of 1 and s? 1 Suppose 0 = w - 5, -4i - 27 = -2i - 5w. Let l(b) = -35b3 - 2b**2 - b. Let a be l(i). What is the greatest common divisor of 17 and a? 17 Let s = -105 - -122. Calculate the greatest common divisor of s and 357. 17 Let r be 1740/110 + (-	{ "pile_set_name": "DM Mathematics" }
89, -3s + 5n = 2s - 115. Solve -5i + 20 = 3z, -5i + 3z + s = 5z for i. 4 Suppose -2d = -5a + 1 - 5, -5a = -3d + 6. Solve a = -u + 3z - 1, -3u = 2u - 4z + 16 for u. -4 Suppose -4w + 21 = 5r - 4r, 4w = r - 5. Let u = 1 + 5. Let j = u + -2. Solve jb - 17 = -m, -m = -b + 4b - r for m. 1 Let o = -1 - -4. Let f(z) = z + 1. Let s be f(2). Let c = 8 - s. Solve m - 2 = -ck, m = ok - m + 4 for k. 0 Let i(k) = -k*2 - 8k + 7. Let j be i(-8). Let t = -2 + j. Solve -y - 20 = 3y + 4l, 5l - 5 = ty for y. -3 Let v = -60 - -76. Solve 0 = 3s - 3y, v = -4s - s + y for s. -4 Let v(l) = l2 - 7l + 7. Let h be v(7). Let r = 9 - h. Solve rn + 10 = 2p, p = -n - 2n - 11 for n. -4 Suppose -x + 6x = 5h - 60, 0 = 5h - 3x - 66. Suppose h = -5a + 80. Solve 0f = -3g - 2f - a, 4g - 4f - 16 = 0 for g. -1 Let m be (-78)/4(-2)/3. Let k be (-63)/(1 + 0). Let r be (-2)/(-3)k/(-4). Solve -rq + 4q = -2v - m, -2q - v = 14 for q. -5 Suppose 7 = -4f - 3s - 0s, 4f - 28 = 4s. Solve -h + 2h - 2 = -fi, 17 = 5h + 3i for h. 4 Let r = -5 + 3. Let u be r + -3 + 1 + 0. Let v be (0 - 42)2/u. Solve 3g = 3t + v, 0 = 3t + 3g - 0g - 9 for t. -2 Let x = 1 - -5. Let t = -119 + 122. Solve -4l = 2f + 8, 3f + 6 = -xl + tl for f. 0 Let v = -77 - -77. Solve y + 10 = 2s, v = 5y + 2s + 3 + 11 for y. -4 Let u be ((-2)/4 - -1)4. Suppose -10 = 4z - 5o, -u = -2z - o - 0. Solve r - s + 6s = 3, z = s for r. 3 Let h(o) = 0o - 5o2 + o3 + 5 + 0o. Let d be -102/(-2 + -2). Let k be h(d). Solve kf - 15 = 2m, 0f = -f + 4m + 3 for f. 3 Let d(c) = c + 1. Let t be d(1). Solve -5w = -5q - 20, -q - tq - 12 = 3w for q. -4 Let i be (-2)/(-1 - 12/(-9)). Let q = 12 + i. Let y be (-48)/(-4)q/9. Solve -3b - 18 = 5o, b = 6o - 3o + y for b. -1 Let j(g) = -11g + 4. Let s be j(-3). Solve 2t + 7 = 4h + s, -4h - 35 = -3t for t. 5 Let b be 12/(-9)3/2. Let n = 4 + -2. Let x = b + n. Solve 5j = 0, 5o + xj + 3j = 0 for o. 0 Let a be (12/(-15))/((-4)/10). Solve -4h = -au - h + 4, -u - 3 = -4h for u. 5 Let z = 20 + -14. Let c be (-2)/3 + (-51)/(-9). Let y be (8/10)/(1/c). Solve -yr = -2p - zr + 18, -p + 5r = 15 for p. 5 Let o = 11 - 6. Let c be (-7)/5 + 3/(-5). Let b be c(6/1)/(-3). Solve 18 = 2l + 3p, l = -bl + 5p - o for l. 3 Suppose 2 - 4 = -s. Let c(q) = q + 11. Let i be c(-9). Suppose 3w - 2b + i = -w, -4w + 4b - 12 = 0. Solve -wk = sd + 8, 0k - 11 = 2k + 5d for k. -3 Let w = 9 + -5. Let a be (-14)/(-4) + 2/w. Solve 0 = -o + aq + 16, -o + 6 + 5 = -3q for o. -4 Suppose -6l - 1 = -13. Let c = 11 - -14. Solve -ln + c = -5o, -2n - 4 = -n + 3o for n. 5 Suppose 12m - 8m = 56. Solve -3r + 3a + 0a - 9 = 0, 0 = 3r + 2a + m for r. -4 Let g be (-3 - -3)2/(-4). Suppose -5y - 27 = -r, g = -5r - 6y + 4y. Let s be (4/(-10))/(4/(-40)). Solve 2t - sb = -b, 0 = -rt - 5b + 16 for t. 3 Suppose -2s = -0f + 2f - 16, 5f = 4s - 5. Let j be 4/(-6) - (-871)/(-39). Let y = j + 25. Solve -4w + 3h = -w + 15, fw - yh = -10 for w. 0 Let u = 1 - 0. Solve -3v + 6 = 2h - u, 0 = v - 3h - 17 for v. 5 Suppose -6 = -x - 4. Suppose m + 3n - 9 = 0, 5m + 0n = -n - 25. Let p be (m - -6) + (-2)/(-1). Solve -5 = pa - 5d, -xa + 2 = 5d - 3 for a. 0 Let d be 3/1 + (-18)/(-6). Let g = -7 - -1. Let o be g/10 - 9/(-15). Solve o = -i - 5b + d + 5, 3b = 3i + 21 for i. -4 Let b be (1/(-2))/(3/(-12)). Suppose 3w - bw = 0. Solve 3g + 17 = o + 7g, -2g + 10 = w for o. -3 Let w(v) = 13v3 - v. Let i be w(1). Let p = i - 9. Solve 9 = d - ps - 3, 0 = -4d - 4s for d. 3 Let b(p) = 6p2 + 14p. Let t(x) = -x*2 + 1. Let q(w) = b(w) + 5t(w). Let v be q(-14). Solve -vg + 4j + 32 + 5 = 0, -g + j = -8 for g. 5 Let d = -30 - -38. Suppose 2 - d = -3a. Solve ar = 3u - 10, 2 + 7 = u + 5r for u. 4 Let l = 118 + -67. Let i be l/9 + 2/6. Solve -2r - i = -n, 9 = r - 4r for n. 0 Let f(t) = t*2 - 6t - 6. Let p be f(5). Let s(u) = -u*2 - 11u + 4. Let h be s(p). Solve 3d = -2r + 5, 5 - 1 = hr for d. 1 Let a = 48 + -32. Suppose 5h + w = a, 0 = -4h - 3w - 0 + 4. Solve -hb - 4q = -2q - 6, -5q - 41 = -4b for b. 4 Let w = -6 + 6. Solve -18 = -4m + 2g, 4m - g + 0g - 13 = w for m. 2 Suppose -z + 2y = -0z - 8, y + 3 = 0. Solve 3x - 5 = zr, r = 5r - 3x + 7 for r. -1 Let a(l) = l3 + 4l*2 - l - 4. Let i be a(-4). Suppose i = 3b + 2r - 60, -3r = -8r. Solve 2f - 3c + 8 = -5c, 0 = 5f + 4c + b for f. -4 Suppose 0 = p + 2p - 12. Suppose -1 = -r - 3w + 13, 4w = 4r - 88. Solve -2k - p = 5h - r, 5h - 30 = 5k for h. 4 Let x = 10 + -5. Solve 2b = 5m - 17, 0 = -xb + 7 + 13 for m. 5 Suppose -2y - 2v = -48, -3y + 90 = -5v + 2v. Suppose -l = -4r - 38, 4l - 44 = 4r - 0. Let f = r + y. Solve 4s + 5n + 4 = 0, n - f = -5s - 2 for s. 4 Suppose -4n - v + 3 = 0, -3n + n + 19 = -3v. Solve -4t + 3k = -2t + 6, nt = -3k - 6 for t. -3 Suppose 3m = d + 17, m - 4d + d - 11 = 0. Solve -4t = 5c - 17, 5t + 6c - 3c = m for t. -2 Let k(d) = -d3 - d2 - d. Let u(s) = 3s*3 + 8s*2 - 4s + 7. Let x(p) = 2k(p) + u(p). Let c be x(-7). Solve -4a + i + 0i = 0, c = -4i for a. 0 Let q be ((-60)/48)/((-1)/4). Solve 5m - 2d + q = 0, -3m + 4m = 4d - 1 for m. -1 Let k = -9 - -16. Suppose -kp + 3p = 0. Suppose 0 = -5b - 4x + 27, -3x = -54b + 49b + 41. Solve 2a = 3u + b, p = u + 4a + 2 - 9 for u. -1 Let c = -50 + 50. Solve -i - 3s + 13 = c, 5s + 0s = -5i + 15 for i. -2 Let r be (1-1)/(4/(-12)). Suppose -b + 4 = r. Solve -3u + 6 = 0, 3 - b = 2c - u for c. 2 Let o = -14 - -22. Let p = 5 + -2. Solve 5s + 6 = -pf + 16, -4s + f + o = 0 for s. 2 Let j(x) = -5x - 6. Let d be j(-2). Solve -3u - k + d = -2u, -4u - k = -16 for u. 4 Let k be -9(-3)/(13 - 4). Solve 4f + w = -4, k = -2f - 4w + 1 for f. -1 Let k = 25 - 23. Let l be k + (3 - 4) - 0. Solve -m - 5 - l = 2j, -3j - 22 = -5m for m. 2 Suppose 4q + 2k = 12 + 4, k = 2q. Solve -6r = -qr + 2g - 16, 3g - 6 = 0 for r. 3 Suppose -15h + 6h = -72. Solve -2z - h = 0, 0d - 4z - 12 = d for d. 4 Let d = 10 + 2. Let f = -10 + d. Solve i = -4r - 10, i + 5r + f + 10 = 0 for i. -2 Suppose n = -f - 25, 3n + 2f + 59 = -12. Let g = 23 + n. Solve x + u - 5 = -gu, 5x - 9 = u for x. 2 Let f = 22 - 19. Let l(h) be the third derivative of h4/12 - h3/6 - 2h2. Let m be l(f). Solve i + y - 5 = -3, -my = 2i - 13 for i. -1 Let f be -1 + 2/(2 + -1). Suppose -12 = -4j - n, -3j - 3n = 2j - 15. Let x be 2/j - 4/6. Solve -u = w - x - f, 3w - 5u = -37 for w. -4 Let h(w) = -2w - 10. Let p be h(-7). Solve 0 = pb - 2m - m + 3, -b = -5m + 22 for b. 3 Let r(i) = 3i - 4. Let a be r(3). Let j be (-5)/25 + 11/a. Let y be ((-4)/5)/(10/(-25)). Solve -2l + h = j, -yl - 2h + 5h = 2 for l. -1 Suppose -2c = -5 - 43. Let i be -33/(-27)c. Solve -m + p = 8, -5m - 5p + i = -2 for m. -3 Let m(c) = c2 + 2c - 11. Let u be m(-5). Solve -16 = 2h + 2i, -i = -uh + 2i - 4 for h. -4 Let j be (-13)/(-26) + 1 + (-7)/(-2). Solve c + 2c = 3, -jc = 4m - 5 for m. 0 Suppose -2g + 35 = 5z, -3g = -11 - 4. Solve 0 = -zl + 4i + 36, -8 = -2l - 3l - 3i for l. 4 Suppose -2f = 6w - 2w - 14, 5w - 7 = f. Solve d = -wj - 2j - 3, 0 = 4d + j + 12 for d. -3 Let f(i) = 2i2 - 16i + 16. Let d be f(7). Solve -s - r + 10 = -4s, 4s - dr + 16 = 0 for s. -2 Let r(x) = 2x - 3. Let c be r(4). Suppose -12 = -7n + 4n. Suppose 5o - nl = o + 16, l - 20 = -2o. Solve h + o = -cq, q - 4h - 1 = 10 for q. -1 Let h = 77 + -47. Solve -2p - h = 4y, -4p - 30 = y + p for y. -5 Let k(y) = -3y3 - 18y*2 + 3. Let x be k(-6). Solve 4s + 8r - xr - 17 = 0, s + 1 = 4r for s. 3 Suppose 3o - 4h + 24 = 67, 17 = o - 2h. Solve 0 = -4b + 3g - 21, 2b - 2g + g + o = 0 for b. -3 Suppose -6 = 3a + 3b, 5a + 4b = -1 - 5. Solve 0 = -av + 3f + 1, -5v - f = -6f - 10 for v. 5 Let a be 2 - (4 - 0)/(-2). Let b = 0 + a. Solve 0 = bz - 4j + 11 - 3, -4j = 4z - 8 for z. 0 Let x(c) = -6c - 1. Let q(u) = u + 6. Let a be q(-8). Let j be x(a). Solve 3t - 7 = -5l, -3l - 3t - 2 = -j for l. -1 Let t be (-1 + 2)/(-2 - -3). Let d be ((-16)/(-12))/(t/3). Solve -4v = 4, dy + 3v + 19 = 4 for y. -3 Let l be 46/10 + 9/(-15). Solve g	{ "pile_set_name": "DM Mathematics" }
, -371, -1710? r*3 - 165r*2 + 85r + 1865 What is the j'th term of -7366164, -7366194, -7366274, -7366428, -7366680, -7367054, -7367574? -4j3 - j2 + j - 7366160 What is the i'th term of -46502, -55044, -63586, -72128, -80670, -89212? -8542i - 37960 What is the f'th term of -1048238, -2096475, -3144710, -4192943, -5241174, -6289403? f*2 - 1048240f + 1 What is the c'th term of 35880, 35841, 35798, 35751, 35700, 35645? -2c2 - 33c + 35915 What is the l'th term of 122581, 245180, 367779, 490378? 122599l - 18 What is the g'th term of 4192918, 4192945, 4192958, 4192951, 4192918, 4192853? -g3 - g2 + 37g + 4192883 What is the y'th term of -8840, -68379, -229980, -544673, -1063488, -1837455? -8505y3 - y2 - y - 333 What is the h'th term of -1659, 70, 1799, 3528? 1729h - 3388 What is the o'th term of 20201698, 40403393, 60605090, 80806789, 101008490? o*2 + 20201692o + 5 What is the l'th term of -3399175, -3399154, -3399119, -3399070, -3399007? 7l2 - 3399182 What is the r'th term of 36713, 73499, 110301, 147119, 183953, 220803, 257669? 8r*2 + 36762r - 57 What is the h'th term of -34416, -35432, -36448, -37464? -1016h - 33400 What is the t'th term of -17415, -16638, -15861, -15084, -14307? 777t - 18192 What is the z'th term of 94488, 94482, 94476? -6z + 94494 What is the g'th term of 652072, 1303465, 1954860, 2606257? g2 + 651390g + 681 What is the l'th term of -1215, -1929, -2641, -3351, -4059? l*2 - 717l - 499 What is the y'th term of 27147, 52719, 78291? 25572y + 1575 What is the z'th term of -98079, -392255, -882547, -1568955, -2451479? -98058z*2 - 2z - 19 What is the y'th term of -12785, -13429, -14073? -644y - 12141 What is the z'th term of -5467, -44326, -149799, -355192, -693811, -1198962, -1903951? -5551z3 - z2 + z + 84 What is the r'th term of -116, -863, -2068, -3731, -5852? -229r2 - 60r + 173 What is the u'th term of -2589850, -5179704, -7769560, -10359418, -12949278, -15539140, -18129004? -u*2 - 2589851u + 2 What is the b'th term of -15225259, -15225261, -15225263? -2b - 15225257 What is the x'th term of -1598, -6928, -15986, -28772? -1864x*2 + 262x + 4 What is the f'th term of 46514, 46521, 46526, 46529, 46530, 46529, 46526? -f*2 + 10f + 46505 What is the k'th term of 1323817, 1323975, 1324133, 1324291, 1324449, 1324607? 158k + 1323659 What is the z'th term of 880743, 1761559, 2642375, 3523191, 4404007, 5284823? 880816z - 73 What is the f'th term of -31224652, -31224655, -31224658, -31224661, -31224664, -31224667? -3f - 31224649 What is the o'th term of -238148, -478133, -718118? -239985o + 1837 What is the b'th term of 26829667, 26829658, 26829645, 26829628, 26829607, 26829582? -2b2 - 3b + 26829672 What is the u'th term of -541422, -2165677, -4872768, -8662695, -13535458, -19491057? -541418u2 - u - 3 What is the a'th term of 378938, 757878, 1136818, 1515758, 1894698, 2273638? 378940a - 2 What is the x'th term of 262347037, 262347038, 262347039, 262347040, 262347041, 262347042? x + 262347036 What is the x'th term of -8999891, -17999776, -26999659, -35999540, -44999419, -53999296, -62999171? x*2 - 8999888x - 4 What is the d'th term of 30546, 30524, 30534, 30594, 30722, 30936? 3d3 - 2d*2 - 37d + 30582 What is the w'th term of 72435964, 144871909, 217307852, 289743793, 362179732, 434615669, 507051604? -w*2 + 72435948w + 17 What is the s'th term of -32566832, -32566835, -32566838, -32566841? -3s - 32566829 What is the j'th term of -1930, -7695, -17352, -30943, -48510, -70095, -95740? -7j*3 - 1904j*2 - 4j - 15 What is the y'th term of 5763161, 11526308, 17289429, 23052512, 28815545, 34578516, 40341413? -2y3 - y2 + 5763164y What is the c'th term of 254760, 254904, 255048, 255192, 255336, 255480? 144c + 254616 What is the f'th term of -5777, -5787, -5823, -5885, -5973, -6087, -6227? -13f*2 + 29f - 5793 What is the s'th term of -150702, -301226, -451750? -150524s - 178 What is the p'th term of 498, 2545, 7036, 14859, 26902, 44053, 67200, 97231? 148p*3 + 334p*2 + 9p + 7 What is the t'th term of -658, -1993, -4064, -6871, -10414? -368t2 - 231t - 59 What is the r'th term of 9908547, 19817095, 29725643? 9908548r - 1 What is the c'th term of -15763369, -31526747, -47290139, -63053551, -78816989, -94580459, -110343967, -126107519? -c3 - c2 - 15763368c + 1 What is the q'th term of 412, 3054, 10004, 23344, 45156, 77522, 122524, 182244? 347q3 + 72q*2 - 3q - 4 What is the v'th term of -82, -41, 298, 1079, 2446, 4543? 24v3 + 5v*2 - 142v + 31 What is the m'th term of 467262, 467507, 467750, 467991, 468230, 468467? -m*2 + 248m + 467015 What is the g'th term of 219, 455, 819, 1335, 2027, 2919? 4g3 + 40g*2 + 88g + 87 What is the k'th term of 103515, 207434, 311353, 415272, 519191? 103919k - 404 What is the m'th term of 3087003, 6174077, 9261151, 12348225, 15435299? 3087074m - 71 What is the w'th term of -1384, -4013, -8394, -14527, -22412, -32049? -876w2 - w - 507 What is the i'th term of -32289, -64448, -96607, -128766, -160925? -32159i - 130 What is the k'th term of 1483, 11011, 36897, 87325, 170479, 294543, 467701? 1364k3 - 5k*2 - 5k + 129 What is the u'th term of -51048, -102165, -153282? -51117u + 69 What is the r'th term of -48002, -47444, -46522, -45242, -43610, -41632, -39314? -r3 + 188r*2 + r - 48190 What is the m'th term of -49663, -396276, -1337095, -3169222, -6189759? -49517m3 - m2 + 9m - 154 What is the p'th term of -1971214, -1971203, -1971184, -1971157? 4p*2 - p - 1971217 What is the c'th term of -893370, -1786688, -2680006? -893318c - 52 What is the m'th term of 138, 404, 1218, 2880, 5690, 9948, 15954? 50m3 - 26m*2 - 6m + 120 What is the l'th term of -231827, -230732, -229637, -228542, -227447? 1095l - 232922 What is the u'th term of 798500, 1597012, 2395546, 3194114, 3992728, 4791400? 2u3 - u2 + 798501u - 2 What is the j'th term of 29177, 29207, 29237, 29267? 30j + 29147 What is the q'th term of -16192235, -32384463, -48576691, -64768919? -16192228q - 7 What is the k'th term of -65112, -260410, -585908, -1041606, -1627504, -2343602, -3189900? -65100k*2 + 2k - 14 What is the f'th term of 1190, 2303, 3404, 4493, 5570? -6f2 + 1131f + 65 What is the m'th term of -5058151, -10116299, -15174447? -5058148m - 3 What is the t'th term of 6929, 6937, 6947, 6959, 6973? t2 + 5t + 6923 What is the m'th term of -269391, -269498, -269605, -269712, -269819? -107m - 269284 What is the w'th term of 1424, 1550, -882, -7150, -18532, -36306? -213w3 - w2 + 1620w + 18 What is the g'th term of 262, 443, 794, 1315, 2006, 2867? 85g*2 - 74g + 251 What is the i'th term of 2667651, 5335303, 8002955, 10670607, 13338259? 2667652i - 1 What is the u'th term of 1019435, 2038901, 3058375, 4077863, 5097371, 6116905? u3 - 2u*2 + 1019465u - 29 What is the k'th term of 61913, 61888, 61849, 61796, 61729? -7k2 - 4k + 61924 What is the s'th term of 266927, 266806, 266685, 266564, 266443, 266322? -121s + 267048 What is the j'th term of -53991, -109747, -165513, -221295, -277099? -j3 + j2 - 55752j + 1761 What is the j'th term of -9397971, -9397973, -9397975, -9397977, -9397979, -9397981? -2j - 9397969 What is the c'th term of -14416697, -14416699, -14416701, -14416703? -2c - 14416695 What is the q'th term of 851410408, 851410407, 851410406, 851410405, 851410404, 851410403? -q + 851410409 What is the u'th term of 435, 869, 1749, 3297, 5735, 9285, 14169, 20609? 37u3 + u2 + 172u + 225 What is the b'th term of -74896, -74961, -75012, -75043, -75048, -75021, -74956? b3 + b2 - 75b - 74823 What is the w'th term of -71936539, -143873081, -215809623, -287746165, -359682707, -431619249? -71936542w + 3 What is the k'th term of 4624967, 9249939, 13874911, 18499883, 23124855, 27749827? 4624972k - 5 What is the u'th term of -13377, -13367, -13365, -13371, -13385, -13407? -4u*2 + 22u - 13395 What is the z'th term of 411, 3209, 10817, 25647, 50111? 402z3 - 7z*2 + 5z + 11 What is the w'th term of -6955, -6998, -7049, -7108, -7175? -4w2 - 31w - 6920 What is the d'th term of -80818, -81484, -82150? -666*d - 80152 What is the j'th term of -9670, -9523, -9272, -8911, -	{ "pile_set_name": "DM Mathematics" }
Let g = 76 - 46. Let y = -30.4 + g. Let z = -4.85 + -0.15. Which is the nearest to 0? (a) y (b) z (c) 2/9 c Let l = -0.8 - 2.2. Let b = -4618 + 4617.5. What is the closest to l in -2/5, -4, b? -4 Let t = -0.6 + 0.2. Let o = -15 - -20. Let m(y) = 2y - 5. Let s be m(o). Which is the closest to 0? (a) -0.1 (b) s (c) t a Let y = 52/21 + -15/7. Let g be (18/8)/((-3)/(-8)). Suppose -2j + 4 = g. What is the nearest to y in 1/5, j, 0? 1/5 Let m = -0.0128 - -0.2128. Let a = -0.6 - -0.5. What is the nearest to a in 3, -3/17, m? -3/17 Let n be 32/63 + (-2)/7. Let t(j) = -j*3 + 10j*2 + j + 7. Let u be t(8). Let d = u - 1003/7. What is the closest to 1 in -3, d, n? n Let o = 1 + 2. Let x = -1/853 - -855/1706. Which is the nearest to x? (a) -4 (b) 0 (c) o b Let x = 45.14 + -45. Let b = -0.44 + x. Let k = -0.01 - 0.19. What is the nearest to k in 1, -1/3, b? b Let p = 52 + -33. Let b = p - 18.9. What is the nearest to b in 0, -2/9, 2/3? 0 Let u = -215/4 + 54. Let w = 2.93 + 2.11. Let s = w - 0.04. What is the nearest to -0.2 in s, 2, u? u Suppose 3 + 5 = 4m. Suppose mz + 2h + 2 = 0, -5h - 5 = 3z - 0. Let g be z - ((-12)/9)/(-4). Which is the closest to g? (a) -3/4 (b) -3/11 (c) 2/5 b Let z = 94.7 - 94. What is the closest to 3 in 2/9, 1/3, z? z Let i = 0.51 + -1.39. Let v = -0.12 + i. Which is the closest to -2? (a) 1/8 (b) v (c) -0.1 b Let n = -0.894 - -1.194. Which is the nearest to n? (a) 6 (b) -0.1 (c) -5 b Let u = 3786.99 + -3771. Let x = -16 + u. Let p = 0.01 + x. What is the closest to -0.2 in -5, -2/7, p? -2/7 Let y = 33 - 26. Let s(l) = l*3 - 8l*2 + 8l - 5. Let u be s(y). What is the closest to u in -0.3, -1, 1/4? 1/4 Let t = -105 + 105. Which is the nearest to -0.2? (a) -5 (b) 2/3 (c) t (d) 0.1 c Let m be 3/2(-5)/(-3). Suppose -32 = 54w - 62w. What is the nearest to -2/11 in w, m, 0? 0 Let n be 2/(-3)(0 - -3) + 3. Which is the closest to -0.1? (a) 8 (b) n (c) -0.5 c Let z = -37 + 37.8. What is the nearest to 1 in -4, z, 4, 0? z Let u = 2/29 + -103/232. Which is the closest to 2.9? (a) 0.2 (b) u (c) -4 a Let j = -1312 + 1186. Which is the nearest to -1/4? (a) -0.1 (b) -4 (c) j a Suppose 0 = -12m - 9 - 15. Which is the nearest to m? (a) -6/5 (b) -0.1 (c) 1/6 a Let t = 0.046 + -50.046. Let o = t - -49.3. What is the nearest to o in 2/5, 3, -0.2? -0.2 Let u = 0.017 - -0.283. What is the closest to 1 in u, 2, 1/2? 1/2 Let j be (-15)/(-25) - 4/(-10). Suppose 2p = 4q - 6, 2q - 7q = -2p - 10. Let d = 16 + -18. What is the closest to j in -2/3, p, d? -2/3 Let k be 12/(-102) - 125/(-340). Which is the closest to -0.1? (a) 13 (b) 0.3 (c) 0 (d) k c Let q = 58 - 58.2. Let a = -1 - -3. What is the nearest to a in q, -4, 0? 0 Let k = 97 + -96.7. Which is the closest to 0.4? (a) -0.3 (b) k (c) -5 (d) -0.2 b Let o = -0.11 + 6.11. Let q = o - 11. Let f = -100 - -100.2. Which is the nearest to -1/4? (a) 0 (b) q (c) f a Let q = 0.3478 - 0.0478. Which is the closest to -1? (a) 0.1 (b) q (c) 3/11 a Suppose 2y = -3f + 1, -4y + 6 = -2f - 2y. Let i = 31.87 + -32. Let z be -1(-3)/(-12)(-24)/(-30). Which is the closest to f? (a) -2 (b) z (c) i b Let i = 86 + 5. Let p = 28430 - 170035/6. Let g = i - p. Which is the nearest to -0.2? (a) 3/2 (b) -2 (c) g c Suppose 5n + 5 = -0. Suppose -3o - 23 = l, -l + o = 4l + 99. Let m = l - -23. What is the closest to -1/2 in -2, m, n? n Let j = -2 - -1.9. Let k = 2756 - 2756. Which is the nearest to k? (a) -1/4 (b) -0.4 (c) j c Let f = 6.1 + -6. Let o = 310 - 2169/7. What is the closest to f in 0, -2/25, o? o Suppose -36 = -425z + 416z. Which is the nearest to 2? (a) z (b) -4 (c) -5 (d) -2 a Let t = -700 - -699.92. Which is the closest to t? (a) 0.3 (b) -0.5 (c) 0.1 c Let n = 0.504 - 4.274. Let y = -0.77 - n. Which is the nearest to -1? (a) -1/6 (b) y (c) -1 c Suppose -3i - 6 = 0, 0 = 4k + 4i - 0 + 12. Let j = 29 + -26. What is the nearest to k in 2/5, j, 0.1? 0.1 Let f be (-4 + 1)(-1)/6. Let n = 175 - 175.1. Suppose 6 = -4v - 18. Which is the nearest to f? (a) v (b) n (c) 3/5 c Let z = -44/23 + 65/46. Which is the nearest to z? (a) 2/7 (b) -0.4 (c) 4 b Let q be 98/(-176) + 60/330. Let y = 7 + -7.1. What is the nearest to -1 in y, q, -3? q Let m = 67.4 - 58. Let t = m - 0.4. Let z = -13 + t. What is the nearest to 1 in 3, -5, z? 3 Let r = -0.092 - 5.908. Suppose -3z - 6 = 5w, w + 4z = -4w - 8. Which is the nearest to w? (a) r (b) -4/5 (c) -0.3 c Let o = 927 + -925. Let d = -493/5 - -99. Let r = -0.4 + -0.1. Which is the closest to d? (a) 1/3 (b) o (c) r a Let y = -111.99 + 113. Let d = 0.61 - y. What is the nearest to 1/2 in 4, d, 0? 0 Let g = 0.68 - 0.59. Which is the closest to -0.1? (a) -3 (b) -24 (c) g c Let s = -49 + 109. Let u be ((-4)/s)/(3/9). Let a = -8 + 6. What is the closest to a in -0.3, 2/17, u? -0.3 Let x be -9 + 78(-3)/(-27). Which is the nearest to 5? (a) x (b) 2/3 (c) 0.3 (d) 0 b Let l = 71 - 71. Which is the nearest to l? (a) -0.5 (b) -0.2 (c) -17 b Let j be 2/(-6) + 1 - (-854)/(-183). Which is the closest to 0.03? (a) j (b) 4 (c) 1/4 (d) -5 c Let f = -3235/2 + 1616. What is the nearest to 1 in -2/7, 5, 0, f? 0 Let a(u) = -u*3 + 9u*2 - 4u - 3. Let m(c) = c + 8. Let w be m(0). Let g be a(w). Let r = g + -28. What is the nearest to 2/5 in 2, -4, r? r Let r = -162 - -165. Which is the closest to 2? (a) -0.1 (b) r (c) 15/2 (d) -2/3 b Let m(g) = -6g + 137. Let c be m(24). What is the nearest to 1 in c, -0.4, 5? -0.4 Let h = -854 + 5123/6. Which is the nearest to -1? (a) 3 (b) 0.005 (c) h c Let n be 5 + (-166)/34 + (-6)/51. What is the nearest to 0 in -3/7, n, -2/5? n Let n = -5.75 + 0.75. What is the nearest to 1 in -4, 0.3, -10/7, n? 0.3 Let a be 30/36(-12)/(-20)-1. What is the closest to -1 in 0.2, a, 0.5? a Let j = 0.097 + -6.497. Let n = 81.4 + j. Which is the nearest to 0? (a) -5 (b) n (c) -0.1 c Let n(r) = -2r*2 + 132r - 255. Let f be n(2). Suppose 0 = -2g + g - 155. Let y = g - -623/4. Which is the closest to f? (a) y (b) 0.4 (c) -3 a Let m = 961543057/37870 + -1997/3787. Let y = m - 25368. Let d = y - 22. Which is the nearest to 1? (a) 1/5 (b) -0.5 (c) d a Let o be (-3(3 + 0))/(5/4). Let w = o - -267/35. Which is the nearest to -1? (a) 0 (b) w (c) 4/11 a Let z = -16 + 16. Which is the nearest to z? (a) -6/5 (b) -0.2 (c) -0.3 b Let z = 1350 + -1339. What is the nearest to -2/3 in 0.3, -5, z? 0.3 Let h = -2 - -2. Let p = h + 0.5. Let q = -2.014 - -3.014. Which is the closest to q? (a) -4 (b) p (c) -2 b Let w = 43 + -37.6. Let l = w + -5. Which is the nearest to 2/7? (a) l (b) -2/5 (c) -0.2 a Let y be 2/5 - (-3)/(-45). Let i = 1833/55 - 360/11. Which is the closest to -1/3? (a) y (b) 20 (c) i a Let r = -166.8 - -168.8. Let k = 0 - -0.1. Let q = -0.08 + -4.92. What is the nearest to k in q, r, -4? r Let d = -10.8 - -10.11. Let h = d - -2.69. What is the closest to 0.3 in 1, h, 0.5? 0.5 Suppose 2m - 3p - 15 = 0, 0 = 3m - 0p - 4p - 21. Let k = 3313/3 + -1104. What is the closest to 1/4 in 2, m, k? k Let s = 1879/9 - 209. Let k = 3.1 + -0.4. Let f = k + -2.7. What is the nearest to 0.1 in f, s, -3/5? f Let r = 0.5 - 0.2. Let d = -0.05 + -0.45. Let k = 0.22 + 0.78. What is the closest to 0.1 in d, r, k? r Let w(y) = 6y + 39. Let c(f) = f. Let z(u) = 4c(u) - w(u). Let v be z(-19). Let x = -4 + -1. What is the nearest to -0.1 in x, v, -3? v Let d = 442/11 + -40. Which is the closest to d? (a) 0 (b) 0.3 (c) -0.2 b Let q be ((-21)/8 - -2) + 16/16. What is the nearest to 1 in -4, q, 0.5, -0.3? 0.5 Let g(c) = -c3 + 19c*2 - c + 24. Let l be g(19). Suppose 0 + 20 = lb. What is the nearest to -1 in -0.4, b, -5? -0.4 Let l = -80 - -79. Let j = l - -2. What is the closest to 1 in -4, j, -0.4? j Let v = -0.157 - 0.043. Which is the closest to 2/5? (a) v (b) -5 (c) -4 a Let t = -13.3 - -13.28. Let d = -104.02 - -101. Let s = t - d. What is the nearest to -1 in 2, s, 0.1? 0.1 Let z = -23 - -32. Let x = -10 + z. Which is the nearest to -0.2? (a) -5 (b) x (c) -5/3 b Let o = 0.9 + -4.9. Let h = o - -2. Let s = 0.0143 + -0.0143. What is the nearest to h in s, -3, 2/5? -3 Let s = 222.2 + -222. Let b = -0.9 + 1. Let v = 279/1474 - 1/134. Wha	{ "pile_set_name": "DM Mathematics" }
rs picked without replacement from {x: 2, p: 4, n: 7, b: 2, z: 2}. Give prob of sequence np. 7/68 Four letters picked without replacement from {c: 3, a: 1, q: 1, r: 1, x: 3, u: 5}. What is prob of sequence uxrc? 15/8008 Two letters picked without replacement from {s: 1, m: 2, d: 1, z: 3, e: 4, u: 4}. What is prob of sequence me? 4/105 Four letters picked without replacement from znzzznh. Give prob of sequence znhz. 1/35 What is prob of sequence zzu when three letters picked without replacement from {z: 1, u: 3, b: 2, h: 2, o: 4}? 0 Calculate prob of sequence aas when three letters picked without replacement from {s: 2, d: 1, l: 2, a: 4, n: 5}. 1/91 Three letters picked without replacement from {z: 1, c: 1, q: 2, j: 1, s: 2}. What is prob of sequence zcs? 1/105 Three letters picked without replacement from skkk. What is prob of sequence kkk? 1/4 What is prob of sequence yxyy when four letters picked without replacement from {y: 4, x: 1, i: 3, n: 2}? 1/210 Three letters picked without replacement from {u: 8, z: 6, d: 2, s: 3}. What is prob of sequence zuz? 40/969 Two letters picked without replacement from {t: 1, h: 5, b: 2, j: 1, k: 1}. What is prob of sequence bb? 1/45 Two letters picked without replacement from vdanvvxaanxanmm. What is prob of sequence dx? 1/105 What is prob of sequence oaaa when four letters picked without replacement from oaoaoa? 1/20 Four letters picked without replacement from {e: 5, v: 5, d: 4}. Give prob of sequence eddd. 5/1001 What is prob of sequence hc when two letters picked without replacement from hlccffc? 1/14 Calculate prob of sequence oom when three letters picked without replacement from {m: 5, o: 15}. 35/228 What is prob of sequence cc when two letters picked without replacement from cccc? 1 Three letters picked without replacement from eegmgee. Give prob of sequence ggm. 1/105 What is prob of sequence kee when three letters picked without replacement from keeke? 1/5 What is prob of sequence qq when two letters picked without replacement from qqnnnnqqnqnn? 5/33 Calculate prob of sequence fqvf when four letters picked without replacement from fqjqjvqqqqjjqjqq. 0 What is prob of sequence qt when two letters picked without replacement from ofqottyktoyfyktkqk? 4/153 Four letters picked without replacement from {n: 1, q: 2, x: 1, p: 1, g: 1, k: 1}. Give prob of sequence pqng. 1/420 What is prob of sequence kbaa when four letters picked without replacement from ybbkaxaykakkykb? 1/364 Calculate prob of sequence zf when two letters picked without replacement from {z: 2, j: 3, m: 3, f: 6, y: 3}. 3/68 Two letters picked without replacement from {x: 3}. Give prob of sequence xx. 1 Three letters picked without replacement from geergegee. What is prob of sequence egr? 5/168 Calculate prob of sequence foco when four letters picked without replacement from cofaaflgaaoo. 1/990 Calculate prob of sequence des when three letters picked without replacement from endslqs. 1/105 What is prob of sequence mo when two letters picked without replacement from omz? 1/6 Calculate prob of sequence tddd when four letters picked without replacement from ddndthntnnnnh. 1/1430 Three letters picked without replacement from owfoowow. Give prob of sequence wfo. 1/28 Calculate prob of sequence bv when two letters picked without replacement from fbvvfbrr. 1/14 Calculate prob of sequence kur when three letters picked without replacement from yyyukubrkrgu. 1/110 What is prob of sequence op when two letters picked without replacement from {o: 1, e: 3, p: 3, t: 4}? 3/110 Four letters picked without replacement from {p: 3, k: 2, w: 4}. Give prob of sequence wppw. 1/42 Calculate prob of sequence dw when two letters picked without replacement from {w: 5, d: 1, g: 6, f: 2, m: 2, t: 1}. 5/272 Calculate prob of sequence ndb when three letters picked without replacement from bbbnbdmnbdnbbbbbmnb. 44/2907 What is prob of sequence ccc when three letters picked without replacement from {c: 5, l: 4, k: 10}? 10/969 Two letters picked without replacement from {j: 7, q: 1, d: 4, g: 3, c: 2}. Give prob of sequence qg. 3/272 Four letters picked without replacement from cffyycmylcofmm. What is prob of sequence lfom? 3/8008 Calculate prob of sequence kql when three letters picked without replacement from {k: 1, l: 2, a: 1, q: 5}. 5/252 Calculate prob of sequence gbjl when four letters picked without replacement from bljlygr. 1/420 Calculate prob of sequence hs when two letters picked without replacement from {o: 1, s: 2, n: 2, h: 1}. 1/15 Calculate prob of sequence qb when two letters picked without replacement from bbqbqbbbbbbbqq. 20/91 Two letters picked without replacement from eiiweaeeeh. What is prob of sequence ha? 1/90 What is prob of sequence zr when two letters picked without replacement from krzzl? 1/10 Three letters picked without replacement from {d: 3, r: 5, g: 3, y: 9}. Give prob of sequence yyr. 1/19 Two letters picked without replacement from yyyyy. Give prob of sequence yy. 1 Two letters picked without replacement from {e: 4, t: 1, u: 3, p: 2, n: 1}. Give prob of sequence nt. 1/110 Four letters picked without replacement from ulluuuuuuuuuuuuuuluu. What is prob of sequence lluu? 4/285 Four letters picked without replacement from bbsbbbbbbsbsbbb. What is prob of sequence bsbs? 11/455 Calculate prob of sequence hs when two letters picked without replacement from kkkhssshkhhkkkshhhkh. 8/95 What is prob of sequence sb when two letters picked without replacement from sbbbtyyytbtysabtbatb? 7/190 Two letters picked without replacement from {t: 2, o: 2, b: 2, q: 1, s: 1}. What is prob of sequence oo? 1/28 Two letters picked without replacement from {j: 3, n: 4, a: 1, t: 1, e: 2}. Give prob of sequence et. 1/55 Calculate prob of sequence kbkb when four letters picked without replacement from bbkkbbbbbbbbbkbbbbk. 35/1292 What is prob of sequence ifbn when four letters picked without replacement from zinbf? 1/120 Three letters picked without replacement from {b: 2, h: 1}. What is prob of sequence hbb? 1/3 Two letters picked without replacement from {o: 1, p: 3, l: 1, y: 2, d: 10, a: 2}. What is prob of sequence po? 1/114 What is prob of sequence co when two letters picked without replacement from otooottttootooctoooo? 3/95 Two letters picked without replacement from {i: 4, n: 1, y: 2, o: 1}. What is prob of sequence iy? 1/7 What is prob of sequence wkv when three letters picked without replacement from {w: 2, e: 2, v: 1, u: 4, k: 1, x: 2}? 1/660 Three letters picked without replacement from xixixxxxxxx. Give prob of sequence xii. 1/55 Calculate prob of sequence mm when two letters picked without replacement from wwwiinmmmnimmtmsiwin. 3/38 What is prob of sequence birw when four letters picked without replacement from {i: 1, w: 1, r: 1, q: 1, b: 2, h: 1}? 1/420 Calculate prob of sequence vv when two letters picked without replacement from {f: 7, v: 5}. 5/33 Calculate prob of sequence vo when two letters picked without replacement from onvqq. 1/20 Two letters picked without replacement from cjrcbjjmbcmbcrcm. What is prob of sequence bc? 1/16 Calculate prob of sequence sbn when three letters picked without replacement from {s: 3, n: 1, b: 1}. 1/20 Three letters picked without replacement from {x: 6}. What is prob of sequence xxx? 1 What is prob of sequence xxoo when four letters picked without replacement from {x: 3, o: 3}? 1/10 Calculate prob of sequence sxsx when four letters picked without replacement from {x: 5, s: 7}. 7/99 Two letters picked without replacement from {e: 1, u: 17}. Give prob of sequence uu. 8/9 Three letters picked without replacement from {c: 2, z: 1}. What is prob of sequence zcc? 1/3 What is prob of sequence ii when two letters picked without replacement from {x: 3, i: 9}? 6/11 Four letters picked without replacement from mhmmhhfhhfmmhh. Give prob of sequence mhfh. 5/286 What is prob of sequence ggn when three letters picked without replacement from {n: 2, g: 7}? 1/6 What is prob of sequence mdhd when four letters picked without replacement from dlhmdxdld? 1/252 Two letters picked without replacement from kqgeegsegegeggggggig. Give prob of sequence iq. 1/380 Two letters picked without replacement from {n: 2, c: 17}. Give prob of sequence n	{ "pile_set_name": "DM Mathematics" }
-34)? 0 What is the value of -6 + -13 + (21 - -3)? 5 -10 + (-25 + 70 - (-1 + 3) - 6) 27 Calculate -2 + (-4 - -21) + 98 + -95. 18 What is the value of 4 - (-4 + (24 - 9))? -7 Evaluate -42 + 0 + (-42 + 31 - -21). -32 Calculate 32 + -34 + -31 + 0. -33 What is the value of 23 + 5 + (1 - 37)? -8 What is (-32 - (17 + -57)) + 4? 12 (17 - (26 + 13)) + 12 -10 What is the value of -2 - (-4 - (19 - (-9 - -17)))? 13 -45 - (-39 - (29 + -35)) -12 Evaluate (12 - (-12 + 12) - 13) + -14. -15 What is the value of -4 - (-84 + 81 + -5 + 1)? 3 (-37 - (-3 - 9 - -8) - -3) + 11 -19 Evaluate 4 + -13 + 6 + 20 + 6. 23 What is 12 - ((3 - -1) + -1 + (0 - -5))? 4 What is (-6 + (0 - -2) - 0) + (-1925 - -1940)? 11 What is -1 + (0 - 4 - -3)? -2 What is 18 - ((5 - -10) + -33 - -56)? -20 Evaluate 4 - (-2 + 4) - (-271 + 272). 1 Evaluate 11 + (-21 - -7) + 9 + 7. 13 What is (-6 - (-28 - (-5 - 8))) + 0 + 8? 17 4 + -25 + 11 - (-3 + 3 - 8) -2 What is 7 - (-12 - (7 + 0 - 6))? 20 What is -1 + 8 + (7 - 22) - -6? -2 Calculate (-4 - (-15 + 29)) + 32. 14 -31 + (0 + 2 - -3) - -11 -15 Calculate (-34 - (-20 - 4)) + 18. 8 0 + 6 + 178 + -195 -11 What is 12 + ((5 - -2) + 10 - 16)? 13 What is -2 + 6 + 3 + -8? -1 What is -23 + 4 + -1 + (52 - 46)? -14 What is the value of -1197 + 1183 - (-28 - -1)? 13 Evaluate 2 + -13 - (4 - ((2 - -2) + 6)). -5 Calculate 474 + -499 - (-14 - -1). -12 27 - ((35 - 20) + 12) 0 Evaluate -3 + (-7 - (-2 - 4)) - (-2 + -3). 1 Calculate -1 - 10 - (-2 + -1 + 11 + 0). -19 What is the value of (1 - (7 + -12)) + 4? 10 Evaluate 2 + -8 + 55 + -60. -11 Calculate 3 + -1 + 4 - (1 - -7). -2 What is -16 - ((-12 - (17 - 1)) + 8)? 4 Calculate (33 - 22) + -2 - -10. 19 What is 22 + -3 - (5 - 9 - -13)? 10 What is 33 + (6 - 19) + -6? 14 (12 - (-5 + (10 - 10))) + 12 29 Evaluate -14 - (-25 - (10 - 23)). -2 -14 + 29 - 15 - -26 - 6 20 What is (11 - 1) + -2 + (-5 - -4)? 7 What is 8 + (0 - (8 - 16)) + (-7 - 1)? 8 Evaluate 125 + -126 - ((-1 - 0) + 1 + 12). -13 Calculate -85 + 97 - (4 + 3 + -1). 6 What is (-19 - -2) + 6 + (17 - (9 - -2))? -5 What is (2 - 4) + 2 - (9 - (7 + 8))? 6 Calculate 2 + (8 - ((-8 - -12) + 7) - -5). 4 Evaluate -4 + 9 + (0 - -8) + -6. 7 What is 15 - ((-2 - -4) + (-12 - -8) - 1)? 18 Evaluate 1 + -7 + 8 + -10. -8 What is the value of -2 + (-27 - -32) - (0 + 21)? -18 Calculate 2 + -5 - (-3 - 0) - (63 - 59). -4 What is the value of -4 - (-4 - (11 + -5))? 6 -12 + 12 + -7 + 2 + 7 2 What is the value of -111 + 161 + (-34 - -1)? 17 What is the value of 10 - 1 - (-3 + 3) - (-1 - -1)? 9 Evaluate 28 - (-33 - -22 - -45). -6 Calculate (4 - 0) + 66 + -40 + -8. 22 What is the value of 1 - (-41 - (-5 - 7)) - (-2 + 9)? 23 Evaluate (-5 + 9 - -3) + -8 + 0. -1 Evaluate -639 + 612 + (11 - 2). -18 Calculate 26 - 13 - 9 - (-10 - 14). 28 Calculate -5 + 4 + -7 + 1 + 18. 11 2 + (-15 - (9 + -24)) - (2 + 1) -1 Calculate 9 - (-11 - (0 + -9 + 7)). 18 Calculate -2 + 18 - 42 - -29. 3 -22 - (1 + (9 - 15)) - (6 - 4) -19 What is the value of 0 + 5 + (7 - (29 + -18))? 1 Evaluate -2 - -3 - -2 - -5 - (-64 - -92). -20 Calculate (-4 - 0) + (2 - 11) + 6 - -27. 20 What is the value of -21 + 44 + -29 + (3 - 1)? -4 -15 + (16 - 9 - (-13 + 7)) -2 What is the value of 50 + 2 + (19 - -7 - 37)? 41 Calculate (1 + (-11 - -13) + 8 - 46) + 3. -32 What is (-238 - -243) + (32 - (-2 - -4)) + -9? 26 Calculate 21 + -15 + -21 + 4 + -6 + 0. -17 Calculate 8 + 0 - (-2 - (-9 + 4) - 0). 5 What is -9 - ((8 - 1) + (8 - 22))? -2 What is the value of (19 - (1 + 38)) + 3? -17 (-3 - (2 + 0 - 8) - -5) + -19 -11 Evaluate (-4 - (-5 + (-1 - (1 - -2)))) + -4. 1 -18 + (3 + 4 + -18 - -4) + 6 -19 -8 - ((-26 - -19) + 1 + 0) -2 What is the value of -224 + 225 - ((-6 - -3) + -1 + -8)? 13 What is the value of 12 + (-7 - (17 - 17))? 5 What is 27 + -50 + (-8 - (2 - 2 - 3))? -28 Evaluate 6 - ((-2 - (11 + 2)) + (-20 - -26)). 15 What is the value of 7 + (-3 - (42 + -18))? -20 21 - (28 + (5 - 23)) 11 (-8 + 5 + 9 - -1) + 2 9 Calculate 5 + (-14 - (0 + -5)) + 9. 5 Calculate (9 - 3) + -6 - 9. -9 What is 22 + ((2 - 1) + -12 - 3)? 8 (-57 - -55) + (-3 - (-2 + 2)) + 14 9 Calculate 9 + -26 + (5 - -5). -7 Evaluate 7 + 53 + -61 + (-10 - 0). -11 What is 10 + (1 - (2 - (-4 + 2))) + 3? 10 What is the value of 36 - 21 - (0 + 2 - -3)? 10 Evaluate 13 + -2 + -19 + (1 - 0) + 17. 10 Evaluate 39 + -47 + 10 + (-3 - -2). 1 Evaluate (13 - (13 - (11 + -4))) + -3 - 20. -16 Evaluate -44 - (-18 + (-5 - 3)). -18 Evaluate -8 + (-3 - (-18 - -8) - -1) + 3. 3 Calculate -17 + (-7 - -19) + -6. -11 What is (-2 - (0 + -1 + 8)) + 4 + 9? 4 Evaluate 19 - ((0 - 11) + 25). 5 3 - (9 + -4 - 14) 12 What is 1 + -1 - (69 + -66) - (4 + 1)? -8 What is the value of -2 + 1 + 50 + -1240 + 1221? 30 Evaluate 17 - 6 - (-14 + 15). 10 Evaluate (11 - 4) + -22 + 11 - 1. -5 What is the value of (10 - (8 + 9) - -18) + -47? -36 What is 4 - (7 + (7 - 11) + 6)? -5 (-28 - -40) + (1 - 5) 8 What is the value of 3 + (18 + -4 - (12 - 6))? 11 Calculate -13 + (3 - 1 - (-372 + 328)). 33 What is -4 + -4 + 11 + -4 + -7? -8 What is the value of -12 - (-12 - -34 - (-6 - -16))? -24 Calculate -1 - -2 - 8 - (-27 + (7 - 2)). 15 What is the value of -11 - (-11 + -6 + (7 - 4) + 6)? -3 Evaluate 18 + -17 + (6 - 0). 7 Evaluate -1 + (1 + 0 + 7 - 1). 6 Calculate -15 + (3 - -6) + 0 + 8. 2 What is the value of (-60 - -49) + -1 + -16 + 1 + -7? -34 What is the value of (20 - (-6 + 17)) + 14? 23 -132 + 142 - (18 + -2 + 4) -10 What is the value of -39 + 9 + 2 + 7 + -5? -26 Evaluate -4 - -44 - (42 - 15). 13 What is the value of -33 + (-1 - -7) - (7 - 11)? -23 5 + 12 - ((1 - -1) + (-1 - -6)) 10 Calculate -10 + -1 + -2 + -30 + 42. -1 Calculate 14 + (-10 - -23 - 28) - (-1 + 6). -6 Evaluate (8 - 23) + (3 - -2) + 1. -9 Calculate -6 - (-22 + 15 - -1). 0 What is the value of 1 - (-2 + -1 - (17 - (7 + 2)))? 12 What is the value of 2 + (-17 - (-11 - 0) - 2) + 0? -6 What is the value of 1 - -17 - (21 - 13)? 10 Evaluate -19 - (-17 - -9) - 1. -12 Evaluate (2 - 0) + -2 - -18. 18 What is -3 + (11 - (-9 + 23))? -6 What is the value of 9 - 0 - (-17 - (-47 - -10))? -11 (-2 - 14) + 17 + -8 -7 Calculate 8 + -10 + (9 - (-6 - -6)). 7 What is -13 + -1 + 0 + 9 + -12 + 2? -15 What is (1 - -7 - -12) + 1 + -8? 13 Evaluate -143 - -181 - (-2 - -18). 22 Calculate -6 + (5 - 2) - (-6 - -8) - -2. -3 3 - 1 - (-1 + 11) - (-168 + 159) 1 What is the value of 6 + 1 + 6 + (1 - 1)? 13 Evaluate 12 + (16 - 12) + -20 - (-1 + 5). -8 Evaluate 1 + 1 + (-24 - -18) + 4 - -8. 8 What is the value of -8 - ((-36 - -47) + -11)? -8 6 + (19 - 0) + -13 12 What is -23 - (-1 - 16) - (6 - -1)? -13 Calculate 8 + 0 - 11 - 4 - (4 - 28). 17 What is the value of 6 + -12 + -6 + 5 + -2? -9 What is the value of -7 - (2 + 1 + (2 - (-4 + 0)))? -16 -10 - (-20 - (13 + -26)) -3 Calculate 7 + (30 + -39 - (-13 + 0)). 11 (6 - 1) + (10 - 7) + (1 - 4) 5 4 - (-8 + 15 + -18) 15 What is -39 + 59 + (-11 - 17)? -8 -6 - -11 - (-14 - -9) 10 Calculate 3 - ((-2 + 4 - -8 - 6) + -2). 1 Calculate 24 + -29 + 11 + -21 - (0 + -5). -10 Evaluate -18 + 17 + 4 + 1 - 14 - 1. -11 What is 5 + (15 - 8) - (-4 - (-1 - 1))? 14 59 + -92 + (-3 - -5) -31 Calculate -1027 + 1096 + -37 + -2. 30 What is 19 + (2 - (0 - -1)) + -212 + 207? 15 548 + -509 - (2 - -22) 15 What is (12 + (-6 - 13) - (1 + -7)) + 3? 2 What is the value of 39 + (13 + (3 - 22) - -2)? 35 What is the value of (6 + -51 - -34) + (-1 - -4) + -3? -11 (14 - -6) + -4 + -10 + -1 5 What is the value of -27 + 42 + 27 + -15? 27 What is the value of 9 + -1 - (-4 + 24 + -2 + 6)? -16 What is the value of -3 - (44 - 54) - 44? -37 Calculate -19 + 30 + -8 + -8. -5 What is the value of -305 - -303 - (-4 + -10 + 1 + -2)? 13 Calculate (-5 - -3) + ((3 - 2) + -14 - -2). -13 Evaluate 25 + -37 - (2 + 6 - 33). 13 4 - (3 - (20 - 10) - -9) 2 6 - -11 - (-35 + 86) -34 What is the value of -1 - ((-6 - -6) + 2)? -3 Calculate -10 - (-2 - 2 - (21 + -10) - -12). -7 -24 - (-32 + 15) - (23 - -2) -32 What is the value of -6 + 3 - (4 + -3 + 2)? -6 Calculate -23 + -1 - -14 - (-20 + 1). 9 What is the value of -22 + -1 + 3 + 20 + (-6 - 0)? -6 Calculate -9 + (-2 + 1 - ((-48 - -59) + -4)). -17 Evaluate -32 + 10 + (-2 + 0 - 7) + 9. -22 What is (7 - 0) + -2 - 17? -12 Calculate (-138 - -129) + (-3 - -30). 18 What is the value of (0 - -8) + (-20 - -26 - 17)? -3 7 + (-24 - -4) - -5 - (20 + -13) -15 What is -5 + 12 + (-18 - 7) + 11? -7	{ "pile_set_name": "DM Mathematics" }
)/(-18)) - 6/10? 1/19 336/420(-5)/(-2) 2 Calculate 7 + ((-222)/(-88))/(500/32 - 16). 3/11 Calculate ((-8)/32 - 7) + (5 - -1). -5/4 What is (4/(-10))/((-61)/122) - -2? 14/5 Evaluate ((-616)/(-42) - -6) + -6 + (-4)/6. 14 What is the value of 27/((-8262)/36) - (5 + (-642)/(-34))? -24 What is the value of ((-357)/(-408))/(2/48)? 21 What is the value of 4/(40/(-105)) + (20 - 12)? -5/2 What is the value of (25/(-525))/((-12)/(-18))? -1/14 Calculate (5 - 70/21) + (763/21 - 11). 27 What is ((0/1)/1)/((-41 - -22)/(-19))? 0 Evaluate ((-3)/(-9))/(13583/(-714) - -19). -14 Evaluate (-11)/(-33)9/(-6) - 91/(-26). 3 Evaluate (-38)/(-117)(-3582)/(-22686). 2/39 Evaluate 1/7-5 + (-1915 - -1916). 2/7 What is the value of 63294/(-6713) + (1 - (-14)/2)? -10/7 (7587/495 + -15)-5 -18/11 Evaluate ((-4 - -9) + (324/(-8))/9)-24. -12 What is (-11)/(-44)-44 + 1? -10 What is 45/6(-11)/((-66)/(-8))? -10 What is the value of ((-1505)/27)/(-7) - (-7 + 25 + -10)? -1/27 78/24 - 6(-18)/(-27) -3/4 What is 863/36 - 101/60? 7 (15/(-162))/(-9(-130)/702) -1/18 13/8 + -2 + 482/3856 -1/4 3537/198 - 8/22 - 7 - 6 9/2 What is (-3776)/144 - (-17)/((-459)/(-6))? -26 What is the value of (-2)/6 - 70/(-72)-12? -12 What is (1/1)/(6 + -9 + 15 + -41)? -1/29 What is the value of ((-56)/2394)/(11 + 310/(-30))? -2/57 Evaluate (6/(-45) + (-98)/(-110))/((-15)/(-18)). 10/11 What is the value of 40/(-90) - 546/(-378) - (-45)/(-21)? -8/7 (4/(-18))/(0 - 187/153) 2/11 What is (-2)/4((-10)/(-45) - (-708)/(-27))? 13 Calculate (-1984)/155 - 84/(-7). -4/5 What is (11 + -11 - (2 - -1)/6)8? -4 What is (-3(560/(-42))/(-8))/4? -5/4 What is ((-1)/20)/(2 + 156/(-96))? -2/15 Evaluate ((-174)/(-261))/((-10)/6). -2/5 What is the value of 40/(-630)455/130? -2/9 What is the value of ((-45)/6)/(-3)(-3)/5? -3/2 -10 + (10 - (60/(-138))/(-10)) -1/23 (741/91 - 7)(-42)/(-15) 16/5 What is (48 + 4584/(-96))/(14/(-80))? -10/7 Evaluate (-30)/162243/(-540). 1/12 Evaluate (-516)/3870 - 5/25. -1/3 What is ((-4)/6 - -1)/((-52)/(-156))? 1 What is 2/5 - (-888)/(-555)? -6/5 198/(-528) + 85/(-8) -11 Calculate (-2 + 4)/(7 - (-244)/(-36)). 9 What is (-5)/9(-7272)/(-2020)? -2 Calculate -4 + (-125)/15 + (13/3 - 3). -11 (-57)/11426/10 + (-6)/(-4) 1/5 Calculate 44/9 + (-330)/(-297). 6 13 - (22 - 1) - 471/(-60) -3/20 3770/104-1 + 42 23/4 Evaluate ((-1)/(-2))/(18(-8)/(-3168)). 11 Calculate (((-6)/105)/(-1))/(5/35). 2/5 Calculate (75/9)/((-4550)/(-420))3/(-15). -2/13 (207/92)/((-24)/64) -6 (10 - (-2552)/(-253)) + (-4572)/4554 -12/11 Calculate 54/44555527/1. 18 Calculate ((-168)/64)/((-39)/26)144/12. 21 What is the value of (42/9)/((-177)/(-531))? 14 Calculate ((-20)/5 + 3)/((-4)/(-44)). -11 What is 30 - 203/756112? -2/27 Calculate 224/7041124/(-7). -12 What is 9/(-72)(3 + -5)220? 10 What is 3 - (-7)/((-35)/12) - 493/(-145)? 4 Evaluate 10/52(731 + -729). 5/13 What is 5/3 + (27 - 1044/27)? -10 What is the value of 0 + (22/3 - 19/((-551)/(-87)))? 13/3 Evaluate 8 + 6 + ((-1)/(-1))/(6/(-48)). 6 What is the value of (-4291)/613 - 1715/(-39)? -6/13 (3/((-135)/18))/(10/40) -8/5 What is the value of (-910/(-90))/(1/15)? 15 Evaluate ((-247)/(-26))/19(34/(-18) - -1). -4/9 Evaluate (-464)/(-88) + (4 - (4 + -1)) + -6. 3/11 Calculate 110/(-20) - 1/2 - 180/(-28). 3/7 What is ((-1)/(-7))/(10 + 483/(-46))? -2/7 Calculate (70448/256)/(-17) - -16. -3/16 Evaluate -7 + 6/(-4)820/(-15). 9 Calculate 34/(-28) - ((-12)/(-21) + 2). -3 Calculate (210/75)/(166/(-1245)). -21 (0 + -2)(-4 + 20 - 3178/196) 3/7 What is the value of 75/675 + 166/126? 10/7 What is the value of 42/(-18)238/2499? -2/9 (-40)/(-9) + (9/(-12))/((-3672)/1088) 14/3 What is the value of 144/126147/42? 4 2109/(-76) - -27 - ((-150)/56)/3 1/7 (0 - (-8)/56)/(136/(-238)) -1/4 (5056/(-316))/(4/5) -20 Calculate (49/651)/(8 + (-451)/66). 2/31 Evaluate 1/(-2) - (144/(-168) + 243/(-84)). 13/4 What is -22 + ((-136)/(-8) - 26)? -13 Evaluate 10/6 + -9 + 1165/165. -3/11 Calculate 12/(-8)(20 + -8)(-2)/18. 2 What is the value of (14 - 16)/((-12)/(-7) + -2)? 7 What is 2/8 - (-17 + 2000/64)? -14 What is ((-4)/(-6))/(-1 + (-78)/(-72)) + 7? 15 What is 735/(-504) + ((-158)/16 - -10)? -4/3 What is (-4332)/(-5054) + 664/(-742)? -2/53 (-4)/(-36) - ((-3724)/855)/(-14) -1/5 What is the value of ((-24)/448-7)/((-702)/(-780))? 5/12 Evaluate 18/(-21)(-7 - (-77)/33). 4 What is ((-40)/108)/((-20)/24)? 4/9 What is the value of 11412/(-317)(-1)/3? 12 What is the value of (-24)/(-2)(-74)/(-111) + 3? 11 Evaluate 17/(-7 + (-7 - -13)). -17 Evaluate (-171)/(-10) + 113/(-1130). 17 Calculate 415/498(-80)/(-25). 8/3 What is the value of 3 - ((-5355)/(-187) + -26)? 4/11 Calculate (-115)/(-15) + 15 - 17. 17/3 What is (-108)/378 + (-205)/(-350) + 0? 3/10 (-1197)/228(-5 - -1) 21 Calculate 59/(1180/(-400)) + -2. -22 What is the value of ((-340)/455 - 24/(-52))105? -30 Evaluate 54/(-105) - ((-60)/(-14) - (43 + -39)). -4/5 Calculate (2/(-6))/((1/3)/((-145)/(-87))). -5/3 Calculate (-286)/1001 + 43/126. 1/18 What is (14/385)/((-3787)/420 + 9)? -24/11 4 - 6/(-14)(-1044)/108 -1/7 Calculate (-3 + 37/5)(-15)/6. -11 (36/5 + (28 - 36))/((-2)/(-20)) -8 Evaluate (-30844)/(-24535) - (12/(-10))/(-3). 6/7 Evaluate 36/(-1) - (46 + -87). 5 Evaluate 50/4 + (-369)/738. 12 What is the value of -4 + (-131)/24 - (-28 + (-3122)/(-112))? -28/3 (83447/(-156))/(-49) + -11 -1/12 6 + -25 + 21 + 36/(-10) 1/5 What is the value of ((-12)/(-2))/((-12040)/980 - (0 + -12))? -21 What is the value of (-3 - 266/(-88))/(32/256)? 2/11 Calculate 14(-18)/(-63) - 18. -14 What is the value of 29619/(-12067) + (-2 - -2) + 2? -5/11 What is ((-2)/4)/((-5040)/6048)? 3/5 Calculate ((-9)/6)/(11/(880/795) + -10). 24 (-55)/(-22)((-9)/(45/20) + 0) -10 Evaluate 57/(-490)1/(6/72). -6/7 Calculate ((-24)/35)/((-1428)/2499). 6/5 What is the value of 9/(-12) + -1 + 12/(-176) + 2? 2/11 Evaluate (425/119)/(-13 + (-920)/(-70)). 25 Evaluate 8/(-36) - 110/315 - (-22)/63. -2/9 Evaluate ((-260)/(-1560))/((-14)/12). -1/7 Calculate (7/21)/((4/24)/((-1)/(-62))). 1/31 What is the value of (-2 + (-3 - (-6)/2))/((-6)/(-27))? -9 -4 - (15 + 5)4/(-120)5 -2/3 Evaluate (52/(-8) + 6)(-2 - -2 - 18). 9 What is the value of (32)/(4662/(-444))14/(-20)? 2/5 Evaluate 3/(4 + 2)26. 13 38 + -37 + (-13)/4 - (-14)/4 5/4 Evaluate -1515/(-25) - 2666/310. 2/5 Evaluate 17 - 7 - -1 - 15. -4 Calculate 0/(-20)(-11)/(-22). 0 ((-10)/4)/(-6 - 33/(-6)) 5 What is the value of (-1)/((-3)/14) - (-25)/((-275)/66)? -4/3 Evaluate -1611/(-792)((-32)/(-4) - 4). 8/9 What is (-730)/(-20805) - (-5936)/(-228)? -26 Evaluate (1 - (-15)/6)/(14/28). 7 Evaluate ((-33)/(858/104))/(8/(-14)). 7 0(-12 + 5291/444) 0 (-17812/(-16))/(-6) + (-47)/(-188) -22 What is 3/((-99)/44) + 3520/2280? 4/19 ((-2)/1 + -3)(-10965)/(-3225) -17 Evaluate 147/(-36) + -1 - 111/(-148). -13/3 What is ((-161)/(-138))/((-49)/63)? -3/2 Calculate (189/27)/(6/(1 - -5)). 7 Evaluate (21/4)/(228/304). 7 Evaluate (-312)/(-132)(-9 - 520/(-48)). 13/3 Calculate 3/5(-300)/(-1170). 2/13 What is ((-2)/6)/(16/(-112))(-42)/(-441)? 2/9 What is 14/144 + (-1748)/7866? -1/8 What is (34304/(-120))/16 - -43/(-90)? -18 What is the value of (-30)/27 + (1 - 172/(-900))? 2/25 What is the value of ((4 - 40/5)/10)/((-2)/(-3))? -3/5 What is the value of (-1 - 9)(-38 + 259/7)? 10 What is (-141)/(-21) + (2 - (1 + 8))? -2/7 Calculate -16 + (1/8 - (-25 - (-4563)/216)). -12 What is (13(-17)/(-442))/(2 - 1)? 1/2 (10/8)/(-5)-3 + (-4351)/(-2748) 7/3 Calculate 26/(-39)(4 - 10). 4 What is (-18)/22 - 261261/(-10527)? 24 (-5069)/6028 + 3/33 -3/4 Evaluate (18/(-216))/((-1)/(-10)). -5/6 Calculate -27((-46)/12)/(-23)4. -18 What is -7 - ((-97686)/6075 - (-2 + (-96)/(-50)))? 9 What is ((-40)/(-6))/(79/((-9480)/(-160)))? 5 (-3)/6-2 - ((-1116)/21 + 54) 1/7 Calculate (-30 - -29 - -22) + (-1 - -1). 21 -5 + 2/(52/117)10/3 10 56252/(-2460) + 3 + 20 2/15 What is ((-11 - 27/(-6)) + 6)/((-93)/(-12))? -2/31 Evaluate 25/(-77) + 14/77 + 132/532. 2/19 ((-1)/(-2))/((-180)/120)7 -7/3 What is 1072/(-960) + (-12)/(-10)? 1/12 What is (-263)/3945(-1 - -2)? -1/15 Calculate (308/165)/(16/120). 14 Evaluate 400/(-30) - -13 - 4/3. -5/3 Evaluate (2 - 18/15)/(22/(-77)*-14). 1/5 What is the value of 76/(-210) + (-1054)/(-36890)? -1/3 What is 25 + (-1 - (2 - 5))/(-1)? 23 Eva	{ "pile_set_name": "DM Mathematics" }
- 0)). Calculate w(v). -9 Let l(x) = x + 1. Let z be l(-3). Let j be z/(((-1)/2)/1). Let t = 8 - j. Let q(y) = y*3 - 3y*2 - 3y + 1. Give q(t). 5 Let k(g) = -2g2 - 1. Suppose -f = 5t - 0t - 1, t = -3f - 11. Determine k(t). -3 Let u(h) = h*3 - 4h*2 - 2h + 2. Let t(z) = -2z3 + 8z*2 + 4z - 5. Let i(k) = -3t(k) - 5u(k). Let q(f) = f*2 - 4f + 4. Let n be q(4). What is i(n)? -3 Let w(y) be the second derivative of y*3/6 - 9y*2/2 + 3y. Let f(g) = -1. Let d(x) = 6f(x) - w(x). Determine d(0). 3 Suppose 5v = -6 + 1. Let j(b) = b - 1. Let x(m) = 8m - 6. Let o be (1 - 0) + (0 - 2). Let z(l) = ox(l) + 6j(l). What is z(v)? 2 Let w(f) = f2 - 7f + 4. Suppose 5l = c + 21, -6c + 2c + 31 = 3l. Suppose cg + y - 33 + 10 = 0, -2y + 1 = -g. Give w(g). -6 Let y(o) = -5o - 5. Let g = 0 + -8. Let x(v) = -v - 2v + 0v - 1 - 2. Let c(t) = gx(t) + 5y(t). Calculate c(3). -4 Let z(m) be the first derivative of -m4/2 + m3/3 + m2/2 - 3. Let q be z(-1). Let h(t) = t2 - 4t + 1. Give h(q). -3 Let l(j) = -2j - 1. Suppose -2r = 5f - 33, 0f - 5r + 5 = -3f. What is l(f)? -11 Let m(g) be the first derivative of -g*4/4 + 2g3 - g2 + 3g + 27. Calculate m(6). -9 Let m(s) = -s + 1. Let u(y) = -6y. Let i(d) = -m(d) - u(d). Suppose 2x + 1 + 5 = 2k, 3x + 3 = 0. Let p = -1 + k. What is i(p)? 6 Suppose -10p + p = 0. Let b(t) = -t*2 - t + 3. Give b(p). 3 Let x(f) = 3f + 6. Suppose o = 4o - 6. Suppose -3 = ot - 13. Let r = t - 9. Determine x(r). -6 Let n(y) = -y3 - y2 + y + 1. Let t(j) = -4j - 1. Let u be t(-1). Suppose uo + 10 = -4c - 9, 3o + 11 = 4c. Determine n(c). 0 Let q(p) be the third derivative of -p5/15 - p4/12 - p3/6 + 3p2. Give q(-1). -3 Let w(u) be the second derivative of u4/12 - u*3/2 + 3u*2/2 + 7u. Give w(5). 13 Let q(l) = 3l + 2. Suppose 0 = -4j + 2j - 8, 3z - 5j - 29 = 0. Suppose -6 = zx + 3. Calculate q(x). -7 Let p(j) = j*3 - 11j*2 - j + 15. Let d be p(11). Let c be (1 + 2)(5 - d). Let f(l) = l*3 - 2l*2 - 1. Determine f(c). 8 Suppose 2r = -5n + 14, r - 5r - 5n = -18. Let p(l) be the second derivative of l3/2 - l2/2 + l. Determine p(r). 5 Let c(h) = -h2 - 3h + 4. Let n(g) = g*2 + 5g - 5. Let k = -4 + -2. Let b be n(k). Let d be -5 - (0 - b) - 0. Calculate c(d). 0 Let f(o) = -o*3 - 3o*2 + o + 2. Suppose 0 = -6w + 9w + 9. What is f(w)? -1 Let h(u) be the third derivative of u6/120 - 7u5/60 + u4/4 + 5u3/6 - 2u2. Determine h(6). 5 Let a(t) = -t3 + t*2 + t + 2. Suppose 17 = -5u + 7. Let j be (-2)/u(2 - 4). Give a(j). 12 Suppose 4j = 12, f - 2f + 19 = 5j. Let l(q) = 20 - q*3 + 7q - 18 - fq2 + 8q*2. Determine l(5). 12 Let a(z) = -3z - 5. Let s(k) = 2k + 4. Suppose 16 = 4c - 0. Let x(g) = cs(g) + 3a(g). Give x(4). -3 Let b(w) = -w - 2. Let s = -114 + 121. What is b(s)? -9 Let j(o) = -2o2 + 2o + 2. Let z be j(2). Suppose 5d - 44 = 4m - 15, 3m + 23 = 4d. Let k(q) = -d + 5 + 2q. Calculate k(z). -4 Let h(v) = v2 + 12v + 9. Let m(l) = -l*2 - 11l - 8. Let f(c) = -4h(c) - 5m(c). Calculate f(-5). -6 Let z(h) = h*2 + 5h. Let r = -10 - -14. Suppose -l = 3l + 3b + 8, 2l - rb + 26 = 0. Let c be l/(-1)4/(-5). Give z(c). -4 Let r = 8 - 12. Let l be (-12 - 3)r/10. Let m(o) = -o*3 + 7o*2 - 6o + 8. Give m(l). 8 Let o(a) = -57a2 + 56a*2 - 5a + 3a - 3a. Determine o(-5). 0 Suppose 0 = 6p - 2p + 5x + 2, -3p + 3x - 15 = 0. Let g(t) = 4t. Calculate g(p). -12 Let v(y) = 2y + 7. Let z be v(-5). Let a(p) = -p2 + p - 1. What is a(z)? -13 Let z(b) = b2 - 2b + 2. Suppose -3l - 16 + 58 = 0. Suppose -l = -5w + 1. Let y = 7 - w. Determine z(y). 10 Suppose -4z + 134 + 34 = -5m, -86 = 3m + 5z. Let f = -27 - m. Let s(u) = -u + 3. Calculate s(f). -2 Suppose s = 5s + 8. Let w be -1 + -1 + 3 - s. Let r(v) = 0 + vw + v - 2v*2 + 2 - 6v + 2v. Give r(3). 2 Let p(x) be the second derivative of 2x3/3 - x2/2 + 2x. Let s(o) = o2. Let v be s(0). Let f = v - 2. Give p(f). -9 Let f(g) = 3g*3 - 2g*2 - 6g + 2. Let u(a) = -2a3 + 3a*2 + 6a - 1. Let m(p) = 3f(p) + 4u(p). Give m(-4). 10 Let d(a) = 2a + 4 - a3 - 5 + 2a*2 + 2a2. What is d(4)? 7 Let y(d) be the first derivative of d4/4 - 2d3 + 7d + 16. What is y(6)? 7 Let f(l) be the third derivative of l*4/24 + 4l*3/3 + 4l2. Let z(i) = -i - 5. Let s be z(-7). Let o be -8 + -2 + s + 3. What is f(o)? 3 Let c(g) = -g3 - 2g2 + 5g + 4. Let o(u) = -u*3 + 5u*2 - 6u + 4. Let a be o(4). Give c(a). 16 Let l(k) = -114k - 11 + 116k + 0. Calculate l(8). 5 Let j(u) be the first derivative of -u5/60 + u4/12 + u3/3 + u2/2 + 1. Let v(i) be the second derivative of j(i). Calculate v(3). -1 Let y(i) = -21i + 11. Let w(u) = 14u - 7. Let o be -1 - ((-21)/(-3) + -3). Let c(d) = oy(d) - 8w(d). What is c(-1)? 8 Suppose 3j + 2j = 35. Let z(y) = j - 29y + 30y + 0. Suppose 3u = -w + 1, -3w - 2w = -4u - 5. Calculate z(u). 7 Let r = -1 + 9. Let q = r + -10. Let j(i) = -5 + i + 4 + 3. What is j(q)? 0 Let s(k) = -k*3 - 4k2 + k + 10. Let d(z) = z3 + 4z2 - 11. Let q(f) = 4d(f) + 5s(f). Give q(-5). 6 Let p(f) = -f3 + 10f*2 - 8f - 9. Let t be p(9). Let h be 2/(-5) + 44/10. Suppose t = 3k + 2d - 1, -14 = -hk + 3d + 10. Let g(m) = 3m - 2. Give g(k). 7 Let l(s) = s2 - s + 4. Let z(y) = -y. Let f be z(2). Let j(k) = 4k*2 + 4k + 2. Let t be j(f). Suppose -2u + 2 = 12, 2u = 5p - t. Give l(p). 4 Let m(k) = k2 + 3k - 3. Suppose -40u + 34u - 30 = 0. Determine m(u). 7 Suppose 5y + 4i - 9 = 0, -2i = -3y + i + 27. Let r(b) = b - 7. Calculate r(y). -2 Let q = 14 - 19. Let b(c) = -6 - 8c - 1 + c3 + 5c*2 + 0c2 - c2. What is b(q)? 8 Let o be 2/(-4)40/4. Let v(g) = 3g*2 - 5g + 2. Let r(p) = -7p2 + 9p - 3. Let j(d) = ov(d) - 3r(d). What is j(-1)? 7 Let h(d) = -2d3 - 5d2 + d - 3. Let z(n) = n3 + n - 1. Let f = 7 + -4. Let s(m) = fz(m) + h(m). Let t(b) = -2b - 2. Let a be t(-3). Calculate s(a). -6 Let g = 24 + -8. Suppose -4l = -g - 0. Let y be l/(-12) - 10/(-3). Let q(j) = -j3 + 3j2 + j - 2. Determine q(y). 1 Let d(j) = -j3 + 4j2 + 3j. Let k(x) = -x + 7. Let y be k(7). Suppose yl - 20 = -4l. Give d(l). -10 Let o(a) = 2a - 2. Let v = 33 + -36. Calculate o(v). -8 Suppose s + 5 + 0 = 0. Let y = -1 - s. Let p(g) = -g2 + 3g - 1. Determine p(y). -5 Let t(z) = 0z + 7z - 4z + 3z + 1 - z2. What is t(6)? 1 Let u(z) = z2 - 1. Let q be (2/3)/((-78)/351). Give u(q). 8 Let h(k) = -k*3 - 6k*2 - 6k + 2. Suppose 0 = -l - 3 - 2. Let i = l + 7. Let o = i - 7. Determine h(o). 7 Let j(l) be the third derivative of l*4/24 + 7l3/6 - l2. Let d be j(-5). Suppose 3r = r - d. Let c(a) = 3a + 1. Calculate c(r). -2 Let x(c) = c*2 + 5c + 2. Suppose -3h = -5r + 9, 2h - 3h = 5r + 3. Calculate x(h). -4 Let j(k) = -4k + 2k - 1 - 5k + k*2. Let p(s) = 13s3 - s2 + s - 1. Let h be p(1). Let n = h + -6. Calculate j(n). -7 Let v(o) be the first derivative of -o5/20 + o4/12 + o*3/6 - o - 2. Let j(s) be the first derivative of v(s). Give j(0). 0 Let q = 14 - 21. Let i be q1/((-14)/20). Suppose 2a = -3a + i. Let b(u) = 3u2 - 2u - 2. Give b(a). 6 Let u(b) = -2b + 1. Suppose h - 3w = -0 + 6, w = 5h - 16. Let t(g) = g2 - 7g - 4. Let s be t(8). Let c = s - h. Give u(c). -1 Let d(i) = -3i + 2. Let m(n) = 4n*2. Let t be m(-1). Suppose -u = 3u - t. Let p = 3 - u. Determine d(p). -4 Let o(r) = 6r. Let p be (2/7)/((-16)/(-56)). Calculate o(p). 6 Let m = -18 + 22. Let i(c) be the third derivative of 0c + 2c2 - 1/6c*3 + 1/12c*m + 0 - 1/60c*5. What is i(1)? 0 Let t(a) = 2a + 5. Let g(k) = k - 1. Let d(o) = 6g(o) + t(o). Determine d(2). 15 Let a(j) be the third derivative of -j4/24 - j3/6 - 9j2. Calculate a(4). -5 Let k(x) = -x3 + x2 + 7. Let y(h) = h3 - 2h2 - 8. Let w(u) = 6k(u) + 5y(u). What is w(-3)? -7 Let k(w) = -52w + 1 + 108w - 52w. Determine k(1). 5 Let x(n) = -7n - 3n + 9n + 1. Give x(4). -3 Let a(v) = 3v - 6. Suppose 4i + 18 = 7i. Determine a(i). 12 Let x = 14 + -14. Let j = -5 - x. Let q(w) = 7w - w + 6 + 0w + w2. Calculate q(j). 1 Let u(n) be the first derivative of -n2/2 - n - 19. Let g(q) = -q*3 - 5q	{ "pile_set_name": "DM Mathematics" }
-2 - -1). Solve -3p = 4t - 23, 2p = 4t - 20 + o for t. 5 Suppose -4a + 1 = s, a = 3a - 2. Let t be ((-8)/(-1))/4 - s. Suppose 0 + 3 = y. Solve 0 = yo - 2p + t, 2o = -0p + 3p for o. -3 Let f = 83 - 57. Solve -2h - f = -7t + 3t, 2t - 7 = -h for h. -3 Let a = 22 - 14. Suppose b - 62 = -a. Suppose -b = -n - n. Solve 0 = 5t - 3v + 8, -3v + 11 = t + n for t. -4 Suppose 5b - 30 = 5p, -2b + p = 3b - 14. Solve -9 = 4v + 11, -bw - 3v - 7 = 0 for w. 4 Suppose -56 = -4r + 2r. Solve 4i + 2u + r = 0, -2u + 8 = -4u for i. -5 Suppose 3t - 3r = 30, t + 5r = 4r. Suppose -5c - 4s + 7 = 0, 3s = c - 7 - 2. Solve -tv = o - 24, -9 = -o - cv + v for o. -1 Suppose 3u + 4l = 27, -l + 0 = -3. Suppose ut = -0 + 10. Suppose -2s + 4 = -s + x, -12 = -3s - 5x. Solve -t + 0 = sg - 2z, 4z = -2g + 24 for g. 2 Suppose 3p - 4 = 5. Suppose 3g + 9 = 0, -5g + 5 = -0r + 4r. Suppose -2w + pw - r = 0. Solve 0k + k + w = 0, 4j = 4k + 36 for j. 4 Suppose -4t - 13t = -85. Solve -2w = l - 5, -3l = tw - 0l - 11 for w. 4 Suppose -12 = -4t - 0t - 5b, 0 = 4t + b - 12. Let j be t - 0/(-3 - -2). Suppose -l = jl. Solve -2o + ld = -d - 13, 0 = d + 5 for o. 4 Suppose 2z + 2z = 100. Suppose 2m = 7m - z. Solve -4d - mp - 10 = 0, 3d + 6 = 3p - 15 for d. -5 Suppose -2b - 21 = -5y, 5b - 3y + 7 = 2. Solve -5 = -4d + 2j + 17, -6 = -3d - bj for d. 4 Let q = -13 - -20. Solve -p + 3j + 0j - q = 0, -4p - 3j - 13 = 0 for p. -4 Let t = -4 + 9. Solve tg - 3p + 0 - 14 = 0, 5p + 20 = 5g for g. 1 Let x = -65 + 23. Let k = 96 + x. Let u be (-4)/(-18) + 420/k. Solve n + 1 = -5w, 3w - 17 = -3n + uw for n. 4 Suppose -5z + 12 = -3z. Let b be z/4(-12)/(-9). Solve -4w = -a + 11, -4a + 0w = bw - 8 for a. 3 Suppose 18 = -2o - 2t - 0t, 4o = 2t - 66. Let l = o + 21. Solve -h - 4h - k = -l, -h - 1 = -k for h. 1 Let a be 6/(-51) + 2/17. Solve 2r + n + 3 = 0, -5r - n = -an + 6 for r. -1 Let h be -3(2/3)/(-1). Let f(r) = -4 - 19r2 + 2r + 3 - r*3 + 22r*2. Let u be f(2). Solve -6p + p = 2b + u, -b = p + h for b. -1 Suppose -2h - 5 = -h, 2k = -3h - 27. Let s(z) = z*3 + 7z*2 + 3z - 8. Let q be s(-6). Let v = k + q. Solve 25 = 5y, 5o + 3y - 17 = vo for o. 2 Let a(h) be the third derivative of -5h4/24 + h2. Let v be a(-1). Solve 2m - 9 = -vi, 2m - 4i = -0m for m. 2 Let w be (-1 - -23)/((-2)/(-3)). Suppose 3i - s + w = 2s, -36 = 3i - 4s. Let p = 11 + i. Solve 0 = -3y - 8u + 3u + 22, -2y = pu - 13 for y. -1 Let v(j) = -j3 + 3j*2 - j + 5. Let q be v(3). Solve qp = s + 10, -3p + 11 - 2 = 0 for s. -4 Let h(z) = 2z - 8. Let g(w) = -5w + 17. Let a(d) = 3g(d) + 7h(d). Let n be a(-9). Solve -3p + 10 = 4u - np, 0 = -u + 4p + 10 for u. 2 Suppose 10w + 4 - 14 = 0. Solve 5o + 22 = -4n - w, -9 = -3n + 5o for n. -2 Suppose -4k + d + 5 = -8, 14 = 4k - 2d. Suppose 4c + 8 = -2h, 4h - c + kc - 8 = 0. Solve -3j - h = m, 4j - 2j + 3m = 2 for j. -2 Suppose -h - 2 = -2v - v, 2v - 38 = -3h. Solve -18 = -3w + 3b, 0 = -5w + b - 0b + h for w. 1 Suppose 0 = 2r - r. Suppose -4i - 24 + 0 = r. Let p = 11 + i. Solve -1 = -2h + 5c, -5h + 4h = -pc + 2 for h. 3 Let o = -171 - -175. Solve -a + 13 = -0a + op, 3a + 12 = 5p for a. 1 Suppose -5v + 18 + 2 = 0. Solve -4y - 9 = vm - 3m, -2y = -4m for m. -1 Suppose 0 = 5s - 20 - 30. Solve -4m + 4i = 16, -3i - s - 10 = 5m for m. -4 Let j(p) = -p*3 + 10p*2 + 3. Let y be j(10). Solve 4m - 2m + v + 15 = 0, 0 = -3m + yv for m. -5 Let v be 46/4 - (-10)/(-20). Solve 3y = 5b - v, 13 = b - y + 4y for b. 4 Suppose o + o + 42 = 0. Let w = -13 - o. Suppose -w = -3n + 5f - f, -2f + 22 = 5n. Solve 5u = -3r + 3u + 20, 4r = 5u - n for r. 4 Let d(r) = -2r. Let i be d(-2). Suppose 35 = 2h + 3j, -ih + 0j + 65 = 5j. Solve -h = m - 2a, -5m = a - 6a + 25 for m. 0 Let v(n) = 10n3 + n2 - n. Let g be v(1). Solve -5c - g = 0, -3j = -2c + 4c + 1 for j. 1 Let l be (16/(-10))/(4/20). Let s be (1 + 15/(-4))l. Let a = 3 + -1. Solve ao - 4 = -b + 9, s = 3o + 2b for o. 4 Let i be 3 + (0 - 1) - 2. Solve io = -2a - 2o - 12, -3a + 22 = -5o for a. -1 Let n = 14 + -13. Let y be n/(2/(-1))-6. Solve -4b + 5a = 9, a + 4a - 37 = -yb for b. 4 Let w(d) = -d3 + 5d*2 + 3. Let b be w(5). Solve 5i + 3k + 19 = 0, k = bi - 4k + 25 for i. -5 Let l(k) = -11k*2 + k - 3. Let h(j) = -17j*2 + 2j - 5. Let f(s) = 5h(s) - 8l(s). Let g be f(1). Solve -5c - gv = -15, -8 = -2c - 5v - 2 for c. 3 Suppose 0 = 4j + 13 - 33. Solve -5f = p + 23, f = jp - 12 - 3 for f. -5 Suppose 0 = 4z - 3d + 13, d = -2z - 7 - 2. Let g(v) = v + 7. Let o be g(z). Solve 0 = -3t - oh + 24, 0t + 11 = t + 2h for t. 5 Let w be (-4 - -2)(-5 - -3). Let x be ((-1)/1 - -2)w. Let t be -3x/6 - -4. Solve -2u + 2q + 4 = 3q, tu + 3q = 12 for u. 0 Let w(v) = 7 + 0 + 1 + v*2 - 7v. Let q be w(6). Let r = -4 + 8. Solve -rj = 2b + 6, 0j + qb - 18 = 2j for j. -4 Let z(i) = i + 2. Let c be z(-2). Suppose 6n - 3n - 48 = c. Solve 10 = 5k + 2a, 2a - n = k + 6a for k. 4 Let t = 16 + 1. Solve 5d - 2s - 2s = 22, d - 5s - t = 0 for d. 2 Let s = -5 - -4. Let v be 1 - s - (1 - 0). Let g be 62/(1 - (v - 2)). Solve g = -3b - 4i, 4b = 2i + i - 8 for b. -5 Let f = -4 + 1. Let p be (-12)/(-36) + (-11)/f. Solve b + 5s - p = -23, -3 = b + s for b. 1 Suppose 0q - 5q + 2u = 0, -15 = -3u. Solve -4s - 17 = n, -s = 4n - qs + 17 for n. -5 Let c(d) = -d2 - 5d + 4. Let b be c(-5). Suppose 0 = -z + 1 - 27. Let m be (z/4)/1-4. Solve -2y - m = -bt, 8 = t + 4 for y. -5 Let r = -25 - -27. Let b be 1(0 + 11)/1. Solve 2v - 1 = -rw - 5, -3v = -2w + b for v. -3 Suppose 5l - 2l = -h - 5, -2l = 2h - 2. Solve -y - c + 12 = -hy, 2c - 15 = 3y for y. -3 Let p = 3 - 0. Suppose 5f - pf = 0. Let t = f - -12. Solve -6 = -2g, 5g - 6 - t = -3c for c. 1 Let m(z) = 3z + 5. Let p be m(0). Solve 0 = pr - 3l - 22, 0 = -2r + r - 5l + 10 for r. 5 Suppose 0 = 4a + a + 90. Let t be (-364)/(-18) - (-4)/a. Solve m = -m - 3y + 6, t = 5y for m. -3 Let q(c) = -c3 - c2 - 2. Let j be q(0). Let x = j - -3. Solve 4w + 14 = -2b, -2b + 2w - 3 + x = 0 for b. -3 Let z = 20 - 10. Suppose 1 = -3q + z. Solve qw + 2f + 0f + 4 = 0, 32 = -4w + 4f for w. -4 Let g(s) be the first derivative of 7/2s2 - 1/3s*3 + s - 2. Let o be g(5). Solve -u + 0 = 5p + 16, 3p + 2u = -o for p. -3 Let x = 3 - 3. Let r be (4/(-6))/((-4)/6). Suppose -r = -3h - b - 0, -5b - 25 = x. Solve 4t + h = -5c, t + c - 11 = 4t for t. -3 Let p = 7 + 5. Suppose p = -v + 5v. Solve 2t + 0t + 30 = -4f, 0 = -vt + 4f + 5 for t. -5 Let t = -6 + 26. Suppose 0 = -m - 0m - 4r + 25, 5r = m + t. Solve 2g + 0u + 2u = 0, -3g = -mu for g. 0 Let n be (-1 + -3)(-3)/6. Let t(b) = nb + 1 - 8 - 4. Let f be t(8). Solve 2q + 6 = -4d, -fq + 11 = 2d + 34 for q. -5 Suppose 5h = -5b + 10, -3h + b + 7 + 7 = 0. Let v be 0 + 1 + (-1)/(-1). Suppose vn + 4 = 12. Solve 16 = -i + 4i - hk, 5k - 11 = -ni for i. 4 Let j(u) = u3 + u2 - u + 14. Let y be j(0). Suppose 7c = -5l + 3c + y, 5l = -c + 26. Solve 5t + 7 + 4 = -3d, -l = 5d - 4t for d. -2 Suppose 0 = -l + 23 - 14. Solve -2c = 5m + 20, 3m + 0 = 3c + l for m. -2 Let f = 22 + -12. Let c = -12 + 16. Solve 0 = 3o + 6, 3s = -co - f - 13 for s. -5 Suppose 4o = -v + 13, o + 4o = 3v - 5. Suppose y + 0w + ow = 16, 4y - 64 = 5w. Solve 0 = -4k - t + 24, -3k - k + y = -t for k. 5 Let b = -9 + 14. Solve bv - 27 = 3f, 2v + 1 = -3v - 4f for v. 3 Let u be -4 + 1 - 16/(-2). Let s be (-2)/(-10) - 36/(-20). Solve st = 4g - 6, 7 = ut - 18 for g. 4 Let p = -5 + 7. Suppose -pm - 4 = -14. Let z(v) = -v - 3. Let k be z(-3). Solve 3a = 3d - 3, -3a = -d - kd + m for a. -2 Suppose 3q - 99 - 9 = 0. Suppose -3a - a + q = 0. Solve 3r - a = 3x, -r + 3x + 2 = -5r for r. 1 Suppose 0 = 12p - 7p - 25. Solve 5u = -4y + 28, -3y - 15 + p = -4u for u. 4 Suppose r - 4r = -p - 13, 0 = -r + p + 5. Let i(t) = 2t*2 - 9t - 1. Let g be i(6). Solve 15 = 3y, b - ry + g = -0b for b. 3 Suppose 16 = 3p - 5q, 0 = -2p - 0p - 2q. Let h = 0 + p. Suppose y - 6y = -20. Solve 4s - 4*o = 20, 0 = -h	{ "pile_set_name": "DM Mathematics" }
t replacement from {t: 4, z: 1, m: 3, w: 1, j: 2}. Give prob of sequence tmw. 2/165 Three letters picked without replacement from kzthssa. What is prob of sequence saz? 1/105 Two letters picked without replacement from rvlrlrlvvolllorlleev. What is prob of sequence eo? 1/95 Four letters picked without replacement from {m: 1, u: 4, h: 3, j: 5, r: 5}. Give prob of sequence urmu. 1/1224 Three letters picked without replacement from {l: 1, y: 1, z: 2, d: 2, g: 4}. What is prob of sequence gzz? 1/90 Calculate prob of sequence llli when four letters picked without replacement from {u: 1, l: 16, i: 3}. 28/323 Calculate prob of sequence cu when two letters picked without replacement from muqmqcmujmuummq. 2/105 Two letters picked without replacement from wdllddldlllddflloll. What is prob of sequence do? 1/57 Four letters picked without replacement from {j: 1, z: 2, w: 6, q: 1, x: 5, k: 1}. What is prob of sequence zwwq? 1/728 Four letters picked without replacement from {t: 8, h: 4, s: 1}. What is prob of sequence shht? 4/715 Three letters picked without replacement from fppmtfppppwffptpp. What is prob of sequence mtt? 1/2040 Four letters picked without replacement from ennenennneeereerern. Give prob of sequence rnnr. 7/2584 Calculate prob of sequence xixx when four letters picked without replacement from {i: 1, x: 14}. 1/15 What is prob of sequence tcc when three letters picked without replacement from xddxcxhtxtctxx? 1/364 Calculate prob of sequence gykg when four letters picked without replacement from {b: 1, k: 2, g: 10, y: 4}. 3/238 What is prob of sequence plqv when four letters picked without replacement from {v: 1, l: 2, p: 2, q: 1}? 1/90 Two letters picked without replacement from llllttt. What is prob of sequence lt? 2/7 Three letters picked without replacement from kdcdududkk. What is prob of sequence kdu? 1/30 Calculate prob of sequence bkb when three letters picked without replacement from {b: 3, k: 2, q: 4, o: 1}. 1/60 Four letters picked without replacement from jjjjjjjuujjjjujj. What is prob of sequence ujju? 3/140 What is prob of sequence ymd when three letters picked without replacement from yddmdddmddddmv? 9/728 Two letters picked without replacement from aavlvvmmmlvvl. Give prob of sequence lv. 5/52 What is prob of sequence ssxx when four letters picked without replacement from {s: 1, x: 3}? 0 Calculate prob of sequence npa when three letters picked without replacement from {j: 8, p: 2, u: 2, n: 2, a: 1}. 2/1365 Calculate prob of sequence ssvf when four letters picked without replacement from {f: 1, v: 4, s: 6}. 1/66 Calculate prob of sequence oqk when three letters picked without replacement from ojvvokkvsvkqqoj. 3/455 Four letters picked without replacement from {w: 2, g: 1, b: 1, q: 2, c: 1, j: 1}. Give prob of sequence bwwq. 1/420 Three letters picked without replacement from {r: 6, w: 3, c: 4, a: 2, k: 3}. Give prob of sequence kcr. 1/68 What is prob of sequence crcr when four letters picked without replacement from lcnrrcne? 1/420 What is prob of sequence hk when two letters picked without replacement from lkkxhl? 1/15 Calculate prob of sequence jmf when three letters picked without replacement from fajfjfgsfffamag. 2/455 Three letters picked without replacement from {l: 1, n: 1, p: 2, t: 1, o: 1, u: 1}. What is prob of sequence lto? 1/210 Calculate prob of sequence qz when two letters picked without replacement from qqzl. 1/6 Two letters picked without replacement from {p: 4, r: 4, d: 2, n: 4}. What is prob of sequence dn? 4/91 Calculate prob of sequence hi when two letters picked without replacement from {i: 1, t: 1, p: 1, z: 1, r: 1, h: 2}. 1/21 Two letters picked without replacement from {c: 2, o: 1, g: 1, f: 3}. Give prob of sequence fo. 1/14 What is prob of sequence wr when two letters picked without replacement from {r: 3, w: 4}? 2/7 Calculate prob of sequence vv when two letters picked without replacement from {v: 2, h: 1, e: 2}. 1/10 What is prob of sequence isis when four letters picked without replacement from {y: 7, v: 1, p: 1, s: 4, e: 4, i: 3}? 1/1615 Three letters picked without replacement from {s: 2, p: 18}. Give prob of sequence sps. 1/190 Calculate prob of sequence cr when two letters picked without replacement from {c: 9, r: 2, j: 1, a: 2}. 9/91 Calculate prob of sequence zbx when three letters picked without replacement from xoozxoboxuz. 1/165 Two letters picked without replacement from nsssn. Give prob of sequence sn. 3/10 Three letters picked without replacement from {r: 8, e: 2}. What is prob of sequence rre? 7/45 Three letters picked without replacement from {r: 3, t: 1, x: 3, b: 1, o: 2}. Give prob of sequence otb. 1/360 Calculate prob of sequence npp when three letters picked without replacement from nnpppnppnpppnpnppnp. 154/969 Three letters picked without replacement from {o: 2, a: 4, p: 2, d: 1}. Give prob of sequence dap. 1/63 Three letters picked without replacement from xxwhxihdxxxhp. What is prob of sequence wxx? 5/286 Two letters picked without replacement from {e: 12, p: 3}. Give prob of sequence pe. 6/35 What is prob of sequence uu when two letters picked without replacement from luu? 1/3 Four letters picked without replacement from bbbbbbbbbbbxbbbbbb. What is prob of sequence xbbb? 1/18 Three letters picked without replacement from {e: 1, o: 1, j: 1, z: 1, a: 1}. What is prob of sequence aez? 1/60 Two letters picked without replacement from {i: 2, d: 1, b: 1, x: 1}. What is prob of sequence di? 1/10 What is prob of sequence scs when three letters picked without replacement from cssjjjjjscs? 4/165 What is prob of sequence uc when two letters picked without replacement from cyjfjyyuijuj? 1/66 Two letters picked without replacement from zttzzzzztt. Give prob of sequence tt. 2/15 What is prob of sequence llhc when four letters picked without replacement from lclhlhhclhlxchlhl? 9/680 What is prob of sequence lbl when three letters picked without replacement from alqabl? 1/60 Two letters picked without replacement from qppqqqpqqpq. Give prob of sequence qq. 21/55 What is prob of sequence wll when three letters picked without replacement from {w: 3, a: 1, o: 1, l: 2, y: 4}? 1/165 What is prob of sequence mf when two letters picked without replacement from {y: 2, m: 1, l: 10, f: 1, v: 3}? 1/272 What is prob of sequence yy when two letters picked without replacement from {y: 5}? 1 Three letters picked without replacement from {x: 2, j: 6}. What is prob of sequence xjx? 1/28 Three letters picked without replacement from {u: 1, l: 1, j: 2, b: 1}. Give prob of sequence jjb. 1/30 Two letters picked without replacement from {a: 3, i: 4, m: 1}. Give prob of sequence im. 1/14 What is prob of sequence zttt when four letters picked without replacement from zzzzzzzztzzztt? 1/364 Calculate prob of sequence md when two letters picked without replacement from mnnmdbxdmxmmmxddnm. 14/153 Calculate prob of sequence isw when three letters picked without replacement from seyssiwessiieyys. 3/560 Two letters picked without replacement from {p: 1, q: 1, b: 1, u: 1, d: 1}. Give prob of sequence pb. 1/20 Two letters picked without replacement from vcsvsattzts. What is prob of sequence ss? 3/55 Calculate prob of sequence ff when two letters picked without replacement from {a: 1, f: 3, g: 7, k: 5}. 1/40 What is prob of sequence ennn when four letters picked without replacement from nxeeenneeenneeeene? 11/612 What is prob of sequence wn when two letters picked without replacement from owoooonoowwww? 5/156 Calculate prob of sequence kk when two letters picked without replacement from kkkkookkk. 7/12 What is prob of sequence rixr when four letters picked without replacement from rqrxxiorr? 1/126 Three letters picked without replacement from llsslssshssnlhsnsh. Give prob of sequence lls. 3/136 What is prob of sequence pll when three letters picked without replacement from {o: 2, l: 2, b: 1, p: 5, h: 4}? 5/1092 Three letters picked without replacement from {v: 1, i: 1, k: 1, e: 1, b: 1}. Give prob of sequence kib. 1/60 Three letters picked without replacement from {m: 7, h: 4, n: 4}. Give prob of sequence nnn. 4/455 What is prob of sequence dsq when three letters picked without replacement from qqqdsdsdqqdqsqds? 1/24 Three	{ "pile_set_name": "DM Mathematics" }
b = -2040 + 5252. Let o = b - 25779/8. Find the common denominator of o and 91/6. 24 Suppose 4d - 4 = -t - 3t, 3d - 1 = -5t. Find the common denominator of 0 - -3 - (-93)/(-2) and -1 - (-171)/22 - d. 22 Suppose -6i + i = -80. Suppose -12 = -4n + 4. What is the lowest common multiple of i and n? 16 Let n be (-2)/8 + 283/(-4). Let o = -2/1945 - -124498/17505. Find the common denominator of o and 6/9 - n/6. 18 Find the common denominator of (-4)/14 - (-1536)/(-63) and (-6)/4(4 - 15/(-9)). 6 Suppose -3j - 3p + 90 = -24, -68 = -2j - 4p. Find the common denominator of -26/11 and (-244)/j - (-14)/21. 77 Suppose -5s = -2o - 11, 10 = 2s + 2o - 0. Calculate the least common multiple of (4 + 11)6/15 and s. 6 Suppose -2o - o - 2g = -20, -2o = -2g - 10. What is the least common multiple of o and 566? 1698 Let m(g) = -g*2 - 11g - 7. What is the smallest common multiple of 10 and m(-9)? 110 Suppose 5j + 3n - 2n = 10, 4j = -4n - 8. Suppose -2 = -2g + 2. Suppose -20 = -gz - 3z. What is the smallest common multiple of z and j? 12 What is the common denominator of 97/6 and (-29)/(-3) - (-6)/(-2)? 6 Let p = -8288 - -99355/12. Let l = 701/266 + 20/133. Find the common denominator of l and p. 84 Let r be 8/36 - (-4)/(-18). Suppose -3z = 12, rz - 100 = -5c + 5z. What is the lowest common multiple of c and 2? 16 Suppose -g = 4g - 10. What is the common denominator of g/3 - 94/(-84) and ((-2)/20)/(3/123)? 70 Suppose -6 + 0 = 3s. Let f(n) = -2n3 - n2 + 3n + 2. Calculate the smallest common multiple of f(s) and 22. 88 Calculate the common denominator of 79/10 and 84/245(-90)/4. 70 Calculate the smallest common multiple of 0/(-1) + (-20)/(-5) and 7. 28 Suppose -65 + 25 = -2j. Calculate the smallest common multiple of j and 8. 40 Let b = -9 + 14. Suppose d - 4p + 0 = -b, -5d = 5p - 75. What is the lowest common multiple of 5 and d? 55 Find the common denominator of -99/50 and -3 - 3/(-5)(-568)/144. 150 Let o(g) = -5g - 14. What is the lowest common multiple of 8 and o(-3)? 8 Let n = -503/8 - -16975/264. What is the common denominator of n and 17/18? 198 Suppose -3c - s = -14, 3c + 2s - 13 - 6 = 0. What is the common denominator of ((-46)/8)/((-15)/6) and c-1 + (-808)/(-64)? 40 Let t be -2(6/(-2) + 2). Suppose -ta + 14 = 4. Calculate the smallest common multiple of a and 11. 55 Let i(o) = o - 6. Let d be i(7). What is the lowest common multiple of 2 + 6/(2 + d) and 20? 20 Let r = -29/85 + 10799/510. Find the common denominator of r and 3/2. 6 Suppose 153 = -4z + 3o, -2z - 75 = -5o + 2o. Find the common denominator of z and -33/5. 5 Suppose 0 = 136j - 137j + 6. What is the lowest common multiple of 10 and j? 30 Let u = 1436 + -12904/9. Let f = u - 133/72. What is the common denominator of 31/14 and f? 56 Suppose 0 = 4m + 20, 0 = 2c - 3m - m - 22. Suppose z - c = 10. What is the smallest common multiple of z and 13? 143 Let q = 1741 - 13883/8. Find the common denominator of (-2)/(-3) - (-130)/(-12) and q. 24 What is the common denominator of 103/72 and (-302)/120(-5 + (0 - -3))? 360 Let q(k) = -k*3 + 6k*2 + 5k + 6. Let x be q(7). Let g(d) = d*3 + 8d*2 - 2d + 2. Calculate the smallest common multiple of g(x) and 6. 18 Suppose 0 = -5b - 19 + 59. Calculate the least common multiple of 12 and b. 24 Let q = -4/71 + 4221/568. Find the common denominator of 43/18 and q. 72 Suppose f - 5 = 11. Suppose -3l - 3 = 0, -4l = 4g - 3g - 16. What is the lowest common multiple of f and g? 80 Find the common denominator of 19/9 and 0 - (-5)/((-30)/62). 9 Let v = 619/84 + 50/21. What is the common denominator of v and -71/20? 20 What is the common denominator of 45/(-6)(282/(-330) + 1) and 2/(-3)(-1 - 7)? 33 What is the common denominator of 41/28 and 4/(3960/4857) - 4/30? 308 Let d be 2 + -5(-2162)/2. Let c = d - 26416/5. Let q = c - 123. Calculate the common denominator of -2/5 and q. 5 Let y be 2/(-4) + (-2)/4. Let d be (-10063)/2870 + (y - 1). Let n = d + -28/205. Calculate the common denominator of n and -65/4. 28 Suppose -2b - 26 = -15b. What is the lowest common multiple of 15 and b? 30 Let x = -305/672 - -7/96. What is the common denominator of x and -23? 21 Let g = -1022/99 + 88/9. Find the common denominator of g and -44. 11 Suppose -v + 10 + 4 = 5k, -11 = 2v - 3k. Let w = v - 2. Find the common denominator of -56/3 and 0 - ((-40)/w)/(-4). 3 Let h = -782462240 - 670752449. Let r = 9129094722337/6282 + h. Let i = r + 21/349. What is the common denominator of i and 87/10? 90 Suppose -b + 2b = -8. Suppose -5i - v + 114 = 0, -4i - v + 29 = -63. Let u = b + i. What is the smallest common multiple of u and 18? 126 Let l be (6/10)/(7/35). Let w be (47455/(-780))/((-5)/l). Let z = -1/260 + w. What is the common denominator of 1/5 and z? 10 Let q = 2/12485 + -986327/74910. Calculate the common denominator of q and 4/301245/20. 30 Let o(t) = -t2 - 11t - 13. What is the least common multiple of 5 and o(-8)? 55 Find the common denominator of -87/34 and 1/(-3) + 6669/(-1620). 340 Let i = 2 + -2. Find the common denominator of 4/30204/32 and 354/(-40) + 3 + i. 20 Calculate the common denominator of (-111)/812/21 and 81/10. 70 Let d = 1607/42 - 325/7. Calculate the common denominator of d and 71/80. 240 Let j(l) = 7l2 + 1 + 3l + l*2 + l - 6l. Let i be j(1). Calculate the smallest common multiple of i + 1 + 0/(-1) and 6. 24 Let u = 9 - -36. What is the common denominator of -28/5 and u? 5 Let f(k) = -17k - 1. Suppose -o + 5i = -40, -2i = 2o - 5i - 52. Calculate the lowest common multiple of o and f(-1). 80 Let b(f) = 7f2 + f3 + 3f - f2 + 0f3. Let k(t) = -t2 - 8t - 9. Let v be k(-7). Calculate the smallest common multiple of 12 and b(v). 60 What is the common denominator of (-36)/1540/(-14) and 27/2? 14 Find the common denominator of (-2104)/72 - (8/18)/(-2) and (4/(-6))/((-4)/(-118)). 3 Let n be (-6 - 4)/(-21). Suppose 0 = -0b + 4b + 5w + 2, 4 = nb + 3w. Calculate the common denominator of b/20135/6 and -101/12. 12 Suppose 2l - 22 = 30. Let k = 46 - l. What is the smallest common multiple of 20 and k? 20 Find the common denominator of -109/22 and 5/(-60)(-201)/(-2). 88 Calculate the common denominator of -68/9 and (-100)/(-7) - (-10)/(-35). 9 Let t be (-1170)/24 + 6/8. Find the common denominator of 292/t12 and 67/14. 42 Calculate the common denominator of -4(-4)/12-6 and -42/17. 17 Let p = -29229 + 34285615/1173. Let b = 111439/2346 + p. Find the common denominator of b and -22/7. 14 Let k = 3 + 9. What is the smallest common multiple of k and 22? 132 Suppose 8n = 4n + 20. What is the least common multiple of n and 6? 30 Suppose -2j + 4x = 2j - 2348, 4j = -2x + 2342. Calculate the common denominator of 21 and 1/(-3) + j/12. 2 Suppose -4g + 40 = -0g. Suppose -5a = n - g, 0n + 4 = -5n + 2a. Suppose -4b + nb = -40. Calculate the least common multiple of 2 and b. 10 Suppose 3m + 2m - 22 = c, 3m + 4c - 27 = 0. Suppose 15 = 4n + x, -mx + 6 - 21 = 2n. What is the lowest common multiple of 12/n + (-4)/10 and 8? 8 Suppose 2k = -k + 33. Suppose 0 = -4a + 25 + k. Calculate the smallest common multiple of 12 and a. 36 Let c be ((-6)/(-12))/(2/(-32)). Let l be (5 + c)/(6/(-44)). Suppose -26 = -4r + l. Calculate the lowest common multiple of 4 and r. 12 Suppose 0s = s - o + 57, 5s = o - 297. What is the common denominator of ((-265)/s)/(6/8) and 97/10? 90 Suppose 2x + 5 = 13. Calculate the lowest common multiple of x and (-2)/(-3 - (0 - 2)). 4 Let k(r) = -r + 7. Let i = -53 - -75. Calculate the lowest common multiple of i and k(-5). 132 Calculate the common denominator of -5/146 and (123/(-21))/(30/(-35)). 438 Let d = 15367/15 + -1025. Calculate the common denominator of 67/3 and d. 15 Suppose -6h = -0h + 48. Calculate the smallest common multiple of 3 + (-5)/(5/h) and 1. 11 Let y be 10/45 + (-4)/18. Let i(h) = -h3 + h2 + h + 10. Calculate the smallest common multiple of i(y) and 10. 10 Let k be (-3)/48/(-18399). Let y = k + 453824/55197. What is the common denominator of -4/7 and y? 63 Suppose 4u + 34 = i, 2u + 166 = 4*i + u. What is the least common multiple of i and 10? 210 Let h be ((-213)/(-354))/((-6)/142). Let s = h - 94/59. Find t	{ "pile_set_name": "DM Mathematics" }
What is thirty-seven halves of a century in months? 22200 Convert 5404.528l to millilitres. 5404528 What is 11/2 of a century in years? 550 How many microseconds are there in 60372.47 minutes? 3622348200000 Convert 3519.979 milligrams to grams. 3.519979 How many seconds are there in 4/3 of a hour? 4800 How many litres are there in 0.8988133 millilitres? 0.0008988133 What is 4598.404um in millimeters? 4.598404 Convert 7.129247 decades to years. 71.29247 What is 2906.091 litres in millilitres? 2906091 What is 2.3784996 months in decades? 0.01982083 How many days are there in 0.3403417 weeks? 2.3823919 How many millilitres are there in fifty-one halves of a litre? 25500 What is 540777.8m in nanometers? 540777800000000 How many centimeters are there in 6/5 of a meter? 120 How many months are there in six fifths of a decade? 144 How many nanograms are there in 3/40 of a milligram? 75000 How many weeks are there in 182.09583ns? 0.000000000000301084375 Convert 267.7052 hours to seconds. 963738.72 How many millilitres are there in eleven quarters of a litre? 2750 How many centuries are there in 43/2 of a millennium? 215 How many grams are there in 9600.199 micrograms? 0.009600199 What is twenty-five quarters of a centimeter in micrometers? 62500 What is 9336.789mg in nanograms? 9336789000 Convert 442766.3 millennia to years. 442766300 What is thirteen eighths of a millimeter in micrometers? 1625 How many millilitres are there in 45.57694l? 45576.94 What is 1/20 of a decade in months? 6 How many kilometers are there in 7432.229um? 0.000007432229 How many millimeters are there in 3/8 of a meter? 375 What is 6/25 of a hour in seconds? 864 How many kilograms are there in fifteen quarters of a tonne? 3750 How many years are there in 8.185772 decades? 81.85772 How many nanograms are there in 953991.4 kilograms? 953991400000000000 How many milligrams are there in 42/5 of a gram? 8400 What is fifty-three quarters of a tonne in kilograms? 13250 How many millilitres are there in 38.40932 litres? 38409.32 How many months are there in 73.62991 centuries? 88355.892 How many years are there in 7.674502 millennia? 7674.502 What is 3/5 of a kilogram in grams? 600 What is 8.362888 weeks in seconds? 5057874.6624 How many millilitres are there in six fifths of a litre? 1200 How many years are there in 160.7909 millennia? 160790.9 What is 1/20 of a millennium in years? 50 What is 705173.9 decades in months? 84620868 How many minutes are there in 1306369.2 microseconds? 0.02177282 What is 3/5 of a millimeter in micrometers? 600 What is twenty-seven quarters of a hour in seconds? 24300 What is 13/8 of a meter in millimeters? 1625 How many litres are there in 592776.8ml? 592.7768 How many millimeters are there in 21/2 of a centimeter? 105 Convert 824.3067 meters to kilometers. 0.8243067 What is 7/15 of a millennium in months? 5600 What is 0.7728048ug in kilograms? 0.0000000007728048 What is 25/2 of a kilometer in meters? 12500 How many years are there in 272932.08 months? 22744.34 Convert 0.2747909km to millimeters. 274790.9 What is one sixth of a day in minutes? 240 What is 2378.601 weeks in hours? 399604.968 How many days are there in 715877.64 minutes? 497.13725 What is 23231.268 months in years? 1935.939 How many centimeters are there in one fifth of a meter? 20 How many kilograms are there in 3.82302g? 0.00382302 How many tonnes are there in 9.757946mg? 0.000000009757946 What is three sixteenths of a day in minutes? 270 How many millimeters are there in three tenths of a meter? 300 What is 124687.6 kilometers in centimeters? 12468760000 What is one sixth of a hour in minutes? 10 How many decades are there in 3/10 of a century? 3 How many milligrams are there in 7733.956 micrograms? 7.733956 What is 0.4463355um in meters? 0.0000004463355 What is 556963.6g in nanograms? 556963600000000 How many milliseconds are there in fifty-one halves of a second? 25500 What is 1/5 of a litre in millilitres? 200 Convert 4438.177 nanoseconds to seconds. 0.000004438177 How many litres are there in 0.4832432ml? 0.0004832432 How many millimeters are there in 55203.69um? 55.20369 Convert 0.53381 millilitres to litres. 0.00053381 How many millimeters are there in 2271.594km? 2271594000 How many decades are there in seventeen halves of a century? 85 What is 9/16 of a minute in milliseconds? 33750 How many milligrams are there in 61/2 of a gram? 30500 What is 783657.6 millennia in decades? 78365760 Convert 190.632798 microseconds to days. 0.000000002206398125 Convert 0.5636129ng to micrograms. 0.0005636129 What is 20/9 of a day in minutes? 3200 Convert 0.2304293 milligrams to kilograms. 0.0000002304293 What is nineteen quarters of a decade in months? 570 How many milliseconds are there in 2754.058 weeks? 1665654278400 What is 610364.3 decades in months? 73243716 How many nanometers are there in 42/5 of a micrometer? 8400 How many kilometers are there in 599.6519 centimeters? 0.005996519 How many months are there in 5/24 of a millennium? 2500 What is three tenths of a century in decades? 3 What is three eighths of a meter in millimeters? 375 How many months are there in seven halves of a century? 4200 What is 4719.264 centuries in months? 5663116.8 How many millilitres are there in twenty-seven quarters of a litre? 6750 What is 1/4 of a litre in millilitres? 250 What is 618832.3 centuries in years? 61883230 Convert 825.0189 years to millennia. 0.8250189 How many millilitres are there in 951800.3l? 951800300 How many millimeters are there in eighteen fifths of a meter? 3600 What is 6/5 of a litre in millilitres? 1200 What is 27/4 of a litre in millilitres? 6750 How many micrograms are there in one twentieth of a gram? 50000 How many seconds are there in 8839.853 minutes? 530391.18 What is 3/10 of a milligram in micrograms? 300 What is 5/4 of a litre in millilitres? 1250 What is 778.9689 litres in millilitres? 778968.9 What is 6/5 of a century in months? 1440 Convert 576153.1 litres to millilitres. 576153100 What is 61159.63 grams in kilograms? 61.15963 How many milligrams are there in 55/2 of a gram? 27500 How many nanograms are there in 0.19238 milligrams? 192380 What is 27/2 of a minute in seconds? 810 How many micrometers are there in ninety-three quarters of a millimeter? 23250 What is 89791.794 seconds in days? 1.039256875 Convert 16.739643 months to millennia. 0.00139497025 How many months are there in 3/5 of a millennium? 7200 How many kilograms are there in 0.3876734ng? 0.0000000000003876734 How many millilitres are there in 11/2 of a litre? 5500 What is 1/4 of a millimeter in micrometers? 250 What is 5765.65km in millimeters? 5765650000 What is 0.7717951 decades in millennia? 0.007717951 How many millilitres are there in 13/5 of a litre? 2600 How many millimeters are there in 3/25 of a meter? 120 How many millilitres are there in three eighths of a litre? 375 How many hours are there in 139013.43 minutes? 2316.8905 What is seven sixteenths of a centimeter in micrometers? 4375 What is 83.03385ml in litres? 0.08303385 What is five eighths of a litre in millilitres? 625 How many millimeters are there in 0.1789841cm? 1.789841 Convert 7.731575 decades to millennia. 0.07731575 What is 1.275282 micrograms in milligrams? 0.001275282 What is 0.621246ml in litres? 0.000621246 What is 48/5 of a litre in millilitres? 9600 What is 1307.514 months in decades? 10.89595 How many milliseconds are there in 0.6829491s? 682.9491 What is 1/5 of a litre in millilitres? 200 How many milliseconds are there in twenty-one eighths of a second? 2625 Convert 941.196 milligrams to kilograms. 0.000941196 What is 3/5 of a millimeter in micrometers? 600 How many grams are there in 9/25 of a kilogram? 360 How many tonnes are there in 69224.34kg? 69.22434 Convert 0.2916375l to millilitres. 291.6375 How many kilometers are there in 455301.1 centimeters? 4.553011 How many micrograms are there in 0.7808746t? 780874600000 Convert 826122.5 micrograms to kilograms. 0.0008261225 What is 97.21172 millilitres in litres? 0.09721172 What is 13/8 of a litre in millilitres? 1625 How many decades are there in 1/5 of a century? 2 How many minutes are there in 23/3 of a week? 77280 Convert 57.46697 centimeters to millimeters. 574.6	{ "pile_set_name": "DM Mathematics" }
2? 2, 373 List the prime factors of 20006. 2, 7, 1429 What are the prime factors of 1742? 2, 13, 67 What are the prime factors of 3180? 2, 3, 5, 53 What are the prime factors of 1056? 2, 3, 11 List the prime factors of 5766. 2, 3, 31 What are the prime factors of 108660? 2, 3, 5, 1811 List the prime factors of 21571. 11, 37, 53 What are the prime factors of 10855? 5, 13, 167 List the prime factors of 4610. 2, 5, 461 What are the prime factors of 2132? 2, 13, 41 What are the prime factors of 96? 2, 3 What are the prime factors of 26985? 3, 5, 7, 257 What are the prime factors of 6892? 2, 1723 List the prime factors of 1428. 2, 3, 7, 17 List the prime factors of 34893. 3, 3877 What are the prime factors of 2041? 13, 157 List the prime factors of 296. 2, 37 What are the prime factors of 6087? 3, 2029 What are the prime factors of 556? 2, 139 What are the prime factors of 11467? 11467 What are the prime factors of 35586? 2, 3, 659 List the prime factors of 71967. 3, 7, 23, 149 What are the prime factors of 14391? 3, 13, 41 List the prime factors of 16395. 3, 5, 1093 List the prime factors of 1810. 2, 5, 181 List the prime factors of 640. 2, 5 What are the prime factors of 15244? 2, 37, 103 What are the prime factors of 860? 2, 5, 43 What are the prime factors of 7856? 2, 491 List the prime factors of 2742. 2, 3, 457 What are the prime factors of 976? 2, 61 List the prime factors of 936. 2, 3, 13 What are the prime factors of 67083? 3, 59, 379 What are the prime factors of 2628? 2, 3, 73 List the prime factors of 12709. 71, 179 List the prime factors of 1471. 1471 List the prime factors of 12297. 3, 4099 What are the prime factors of 975? 3, 5, 13 What are the prime factors of 78410? 2, 5, 7841 List the prime factors of 11779. 11779 What are the prime factors of 8958? 2, 3, 1493 What are the prime factors of 899? 29, 31 List the prime factors of 4075. 5, 163 List the prime factors of 600. 2, 3, 5 List the prime factors of 4095. 3, 5, 7, 13 What are the prime factors of 46928? 2, 7, 419 What are the prime factors of 196? 2, 7 List the prime factors of 727. 727 List the prime factors of 987. 3, 7, 47 What are the prime factors of 707? 7, 101 What are the prime factors of 3245? 5, 11, 59 List the prime factors of 185583. 3, 61861 List the prime factors of 62499. 3, 83, 251 What are the prime factors of 7466? 2, 3733 What are the prime factors of 3036? 2, 3, 11, 23 What are the prime factors of 667? 23, 29 What are the prime factors of 3889? 3889 List the prime factors of 451. 11, 41 List the prime factors of 2929. 29, 101 What are the prime factors of 484? 2, 11 What are the prime factors of 27298? 2, 13649 What are the prime factors of 12543? 3, 37, 113 List the prime factors of 319. 11, 29 What are the prime factors of 23045? 5, 11, 419 List the prime factors of 4887. 3, 181 What are the prime factors of 729? 3 List the prime factors of 69100. 2, 5, 691 List the prime factors of 157383. 3, 29, 67 List the prime factors of 4504. 2, 563 What are the prime factors of 102379? 37, 2767 What are the prime factors of 1387? 19, 73 What are the prime factors of 3035? 5, 607 What are the prime factors of 4142? 2, 19, 109 What are the prime factors of 2072? 2, 7, 37 What are the prime factors of 520? 2, 5, 13 What are the prime factors of 144567? 3, 16063 What are the prime factors of 2584? 2, 17, 19 What are the prime factors of 19509? 3, 7, 929 List the prime factors of 2306. 2, 1153 List the prime factors of 50066. 2, 25033 List the prime factors of 1152. 2, 3 What are the prime factors of 6244? 2, 7, 223 What are the prime factors of 1648? 2, 103 What are the prime factors of 58101? 3, 107, 181 What are the prime factors of 744? 2, 3, 31 What are the prime factors of 18581? 17, 1093 List the prime factors of 8610. 2, 3, 5, 7, 41 List the prime factors of 4067. 7, 83 List the prime factors of 632. 2, 79 List the prime factors of 891. 3, 11 What are the prime factors of 2122? 2, 1061 What are the prime factors of 9779? 7, 11, 127 List the prime factors of 88903. 88903 List the prime factors of 22729. 7, 17, 191 What are the prime factors of 13336? 2, 1667 What are the prime factors of 4155? 3, 5, 277 List the prime factors of 854. 2, 7, 61 What are the prime factors of 13546? 2, 13, 521 List the prime factors of 1674. 2, 3, 31 List the prime factors of 3584. 2, 7 What are the prime factors of 10148? 2, 43, 59 What are the prime factors of 699? 3, 233 List the prime factors of 2011. 2011 What are the prime factors of 512? 2 What are the prime factors of 12517? 12517 List the prime factors of 743. 743 What are the prime factors of 314? 2, 157 What are the prime factors of 12706? 2, 6353 List the prime factors of 1876. 2, 7, 67 List the prime factors of 645. 3, 5, 43 List the prime factors of 1156. 2, 17 List the prime factors of 18189. 3, 43, 47 What are the prime factors of 4226? 2, 2113 What are the prime factors of 81603? 3, 9067 What are the prime factors of 8747? 8747 What are the prime factors of 519? 3, 173 What are the prime factors of 5279? 5279 List the prime factors of 1018. 2, 509 List the prime factors of 29452. 2, 37, 199 What are the prime factors of 34667? 34667 List the prime factors of 12457. 12457 List the prime factors of 9294. 2, 3, 1549 List the prime factors of 8976. 2, 3, 11, 17 List the prime factors of 69419. 7, 47, 211 What are the prime factors of 373? 373 What are the prime factors of 953? 953 What are the prime factors of 1543? 1543 List the prime factors of 111497. 111497 List the prime factors of 2280. 2, 3, 5, 19 What are the prime factors of 11863? 11863 List the prime factors of 123894. 2, 3, 6883 List the prime factors of 4173. 3, 13, 107 What are the prime factors of 2932? 2, 733 List the prime factors of 16931. 16931 What are the prime factors of 2934? 2, 3, 163 What are the prime factors of 58103? 97, 599 List the prime factors of 55602. 2, 3, 3089 What are the prime factors of 632? 2, 79 What are the prime factors of 1133? 11, 103 List the prime factors of 1662. 2, 3, 277 What are the prime factors of 5617? 41, 137 What are the prime factors of 993? 3, 331 What are the prime factors of 96959? 96959 List the prime factors of 2183. 37, 59 What are the prime factors of 828? 2, 3, 23 List the prime factors of 33627. 3, 11, 1019 What are the prime factors of 451? 11, 41 List the prime factors of 5806. 2, 2903 What are the prime factors of 2150? 2, 5, 43 What are the prime factors of 2292? 2, 3, 191 List the prime factors of 22319. 11, 2029 What are the prime factors of 17832? 2, 3, 743 What are the prime factors of 45965? 5, 29, 317 What are the prime factors of 6833? 6833 List the prime factors of 8075. 5, 17, 19 What are the prime factors of 337? 337 What are the prime factors of 7770? 2, 3, 5, 7, 37 List the prime factors of 15720. 2, 3, 5, 131 What are the prime factors of 2483? 13, 191 List the prime factors of 17868. 2, 3, 1489 What are the prime factors of 41364? 2, 3, 383 What are the prime factors of 789? 3, 263 What are the prime factors of 14501? 17, 853 What are the prime factors of 3726? 2, 3, 23 What are the prime factors of 2216? 2, 277 What are the prime factors of 2322? 2, 3, 43 What are the prime factors of 333? 3, 37 What are the prime factors of 859? 859 What are the prime factors of 442? 2, 13, 17 What are the prime factors of 4665? 3, 5, 311 List the prime factors of 27636. 2, 3, 7, 47 What are the prime factors of 4966? 2, 13, 191 List the prime factors of 50710. 2, 5, 11, 461 What are the prime factors of 10065? 3, 5, 11, 61 What are the prime factors of 14885? 5, 13, 229 List the prime factors of 4024. 2, 503 List the prime factors of 1237. 1237 List the prime factors of 5917. 61, 97 List the prime factors of 1870. 2, 5, 11, 17 What are the prime factors of 733? 733 What are the prime factors of 1232? 2, 7, 11 What are the prime factors of 897? 3, 13, 23 List the prime factors of 740. 2, 5, 37 What are the prime factors of 102? 2, 3, 17 What are the prime factors of 3638? 2, 17, 107 What are the prime factors of 70295? 5, 17, 827 List the prime factors of 583. 11, 53 What are the prime factors of 14970? 2, 3, 5, 499 What are the prime factors of 17833? 17, 1049 List the prime factors of 80551. 10	{ "pile_set_name": "DM Mathematics" }
30)/(sqrt(5)2) + sqrt(6)). -16sqrt(3) Simplify (4((-1sqrt(108) - sqrt(108))1 - sqrt(108))/(sqrt(16)/sqrt(4)4))*2. 243 Simplify 2 + -1(2((sqrt(44)/sqrt(4))2 + sqrt(11)) + -3). -17 - 2sqrt(11) Simplify -3 + (sqrt(70)/(sqrt(56)/sqrt(8)))/(-1sqrt(12)/sqrt(6)). -3 - sqrt(5) Simplify (2 + sqrt(637) - -1(-1 + sqrt(13))*2) + -3. 13 + 5sqrt(13) Simplify ((33(2sqrt(95) - sqrt(95)))/(sqrt(20)/(sqrt(4) + (2sqrt(44) + sqrt(44) - sqrt(44))/sqrt(11))) + -2)*2. -108sqrt(19) + 13855 Simplify (-1(sqrt(224) + (sqrt(224) + sqrt(224) + sqrt(224) + sqrt(224)1)-5)/(sqrt(1008)2))2. 361/18 Simplify ((sqrt(112)/sqrt(4))/sqrt(4) - (sqrt(175) + 1)2)6-6. 324sqrt(7) + 6336 Simplify -4((sqrt(320) - (5 + 1 + sqrt(320)))*2 + (sqrt(320) - (sqrt(320) + 4sqrt(320)3)2)). -32sqrt(5) + 216176 Simplify (-1 + 3 + 6(1 + sqrt(539)) + 4)2. 1008sqrt(11) + 19548 Simplify (-2(sqrt(720) - (-4 + sqrt(720) + -4)))2 + -1. 255 Simplify (0 + -2 + sqrt(684) + 4(-1 + sqrt(684)) + -4)*2. -600sqrt(19) + 17200 Simplify ((sqrt(18) + sqrt(198)/sqrt(44))5)/(-2sqrt(6)6-2). 5sqrt(3)/16 Simplify ((-4(sqrt(486) - (sqrt(486) + 2sqrt(486))))/((6sqrt(36))/sqrt(3)))*2. 72 Simplify (3sqrt(972)-6)/((sqrt(441)-3-5 - sqrt(441)) + sqrt(441)). -36sqrt(3)/35 Simplify ((sqrt(18)/(sqrt(6)3) - sqrt(3)) + sqrt(21)/(sqrt(42)/sqrt(6)) - ((2sqrt(24) - sqrt(24))3)/(-2sqrt(32)))*2. 169/48 Simplify 42-4(1sqrt(1377) + -5 - sqrt(1377))22. -1600 Simplify (sqrt(16)4)/sqrt(2) + (sqrt(32) + sqrt(32) + (6(sqrt(32) - ((sqrt(32)1 - sqrt(32)) + sqrt(32))) - sqrt(32)))2. 8sqrt(2) + 32 Simplify (sqrt(49)/(sqrt(49)/(sqrt(14)/sqrt(2)) + sqrt(7)) - (-5 + sqrt(7) + sqrt(14)/sqrt(2))*2-6)-2. -636 + 239sqrt(7) Simplify (sqrt(520)/(sqrt(10)-2))/(sqrt(48)/(sqrt(12)1)) + ((-4(-2 + sqrt(13)) - sqrt(13))5 + -1)*2. -3901sqrt(13)/2 + 9646 Simplify 5 + -3 + (1 + sqrt(304) + sqrt(304) + 0 + sqrt(304) + -3)*2. -48sqrt(19) + 2742 Simplify 2 + ((sqrt(320) - sqrt(320)-2)-2 - sqrt(320))/(2sqrt(20)/sqrt(2)). -14sqrt(2) + 2 Simplify (sqrt(110)/sqrt(2)-5 - (sqrt(220) + (sqrt(220) - 2sqrt(220))))/(((sqrt(360)2)/sqrt(12))/sqrt(6)). -5sqrt(11)/2 Simplify -6(3((-1sqrt(121)4 + sqrt(121) - sqrt(121)) + sqrt(121) + sqrt(121))/((1sqrt(66))/sqrt(6)))2. -2376 Simplify ((sqrt(252)/(sqrt(120)/sqrt(10)) + sqrt(21))/sqrt(3) + sqrt(84)/sqrt(3) + sqrt(28)2)*2. 448 Simplify (4sqrt(171)-1 + 4 + (sqrt(171) - (-1 + sqrt(171)) - sqrt(171)))2 + -2. -150sqrt(19) + 4298 Simplify (sqrt(100)/(-1sqrt(160)))/(-4(1sqrt(5) - sqrt(5)) + (sqrt(405)-2 - sqrt(405)) + sqrt(405)). sqrt(2)/72 Simplify -5 + ((-1sqrt(1539) - sqrt(1539))2 + 2 - ((sqrt(1539) + -2 + sqrt(1539))2 + -3)) + 4. 72sqrt(19) Simplify -3 + (-4 + 1sqrt(605))2 + (sqrt(2450) + sqrt(2450)-1)/(sqrt(1210) + (sqrt(1210)2 - sqrt(1210))). -88sqrt(5) + 618 Simplify (-4-2(sqrt(77) - -1sqrt(77)))/(sqrt(77)/(sqrt(343)1)). 112sqrt(7) Simplify (sqrt(114) + ((sqrt(114) - (sqrt(114)1 + sqrt(114))-6) + sqrt(114) - sqrt(114)) + sqrt(114))/((sqrt(6) - sqrt(6)3)-3) + 1. 1 + 5sqrt(19)/2 Simplify (3(3 + (-2sqrt(6292) - sqrt(6292)) + 4))*2. -8316sqrt(13) + 510093 Simplify 3-6-1(sqrt(130)/sqrt(160) - (-2sqrt(13)-1)2)-6. -27sqrt(13) + 5616 Simplify ((sqrt(76) - ((sqrt(76) - -2sqrt(76)) + 2) - sqrt(76)) + (sqrt(76) + 0 + sqrt(76))-3 + sqrt(76))2 + 4. 64sqrt(19) + 4872 Simplify ((-2-1sqrt(85) + sqrt(85))-1)/(2sqrt(500)4 + sqrt(500)). -sqrt(17)/30 Simplify -6(-3 + sqrt(275)) - (((-1sqrt(110))/sqrt(10))2 + -5). -30sqrt(11) + 12 Simplify 1 + (((3sqrt(128) + sqrt(128))3)/(6sqrt(12)/sqrt(3)))2. 129 Simplify sqrt(882) + 4 - 6(sqrt(18) + sqrt(288) + sqrt(18) - sqrt(18)). -69sqrt(2) + 4 Simplify ((sqrt(55)/(sqrt(5)3))*2-6 - sqrt(132)/(1sqrt(1728) + sqrt(1728)))5. -110/3 - 5sqrt(11)/24 Simplify (-4 + -1sqrt(2448) - (sqrt(2448) + (sqrt(2448) - (sqrt(2448) - (sqrt(2448) + sqrt(2448) + -1))-4)))2. -192sqrt(17) + 2512 Simplify 3(1sqrt(108))*2 - (1sqrt(108) + 0 - sqrt(108))*2 - (4 + 2 + sqrt(108))-2. 12sqrt(3) + 336 Simplify sqrt(48)/(sqrt(6) + (sqrt(36) + sqrt(900))/sqrt(6)) + 4. 2sqrt(2)/7 + 4 Simplify (sqrt(119) - (sqrt(119) + -5(sqrt(119) + sqrt(119)3 + sqrt(119))))/(2sqrt(700)). 5sqrt(17)/4 Simplify ((sqrt(343) - (sqrt(343) - 3(sqrt(343) - (1 + sqrt(343))))) + (sqrt(343) - (sqrt(343) + 1sqrt(343))) + 3 + 2(-1 + sqrt(343) - sqrt(343))-5)*2. -140sqrt(7) + 443 Simplify 1 + (sqrt(625)-3)/((sqrt(540) + sqrt(60))/sqrt(12)). -15sqrt(5)/4 + 1 Simplify -4sqrt(22)/sqrt(2)-3 + (0 + (sqrt(11) - (sqrt(704)3 - sqrt(11))))2. 12sqrt(11) + 5324 Simplify (sqrt(190) + sqrt(190) + (sqrt(190) - ((sqrt(190) - (sqrt(190) + -3sqrt(190)))5 + sqrt(190))))/(sqrt(10) - sqrt(60)/(-3sqrt(6))). -39sqrt(19)/4 Simplify -1(sqrt(396) + sqrt(396) + 0 + 1 + sqrt(396) + sqrt(396) + -3sqrt(396) + -2). -6sqrt(11) + 1 Simplify 0 + (sqrt(19) - (sqrt(19) + (sqrt(76)/sqrt(4)2 - sqrt(19)))) - (0 + (sqrt(1539) - (sqrt(1539) + -3)) - sqrt(1539)). -3 + 8sqrt(19) Simplify ((sqrt(180)/(sqrt(10)-2))/sqrt(6) + (sqrt(48) - (1sqrt(192))/sqrt(4)))2. 3/4 Simplify (-5 + -6sqrt(700)-1 + sqrt(700) + 2 + (sqrt(700)2 + 4 - -5(sqrt(700)2 - sqrt(700))))*2. 280sqrt(7) + 137201 Simplify (6(sqrt(76) + 4(sqrt(76)1 - sqrt(76))))/(sqrt(12)/(-5sqrt(12)/sqrt(4))). -30sqrt(19) Simplify ((-1 + 2 + -2sqrt(1008)-1)4 + 0)*2. 768sqrt(7) + 64528 Simplify ((sqrt(76) - (sqrt(76) + sqrt(76)4))-1)/((sqrt(32)2)/sqrt(8)). 2sqrt(19) Simplify (-3-2sqrt(44)/sqrt(4) + (-1 + (sqrt(11) - sqrt(539)))4)2. 144sqrt(11) + 3580 Simplify -5 + ((0 + sqrt(2448) + -1)-15)*2. -600sqrt(17) + 61220 Simplify (-1sqrt(76)2 - (sqrt(76) + (sqrt(76)1 - sqrt(76)))3)/(-2sqrt(28)/sqrt(112)). 10sqrt(19) Simplify ((sqrt(7) + 1sqrt(7) + 5)2 - sqrt(567)-2) + -4 + -4. 45 + 38sqrt(7) Simplify (sqrt(4374)2)/((sqrt(2) - (sqrt(72) + (sqrt(72) - (sqrt(72)-1 - sqrt(72))))) + sqrt(2) + sqrt(24)/(-2sqrt(12))) + 1. -12sqrt(3)/5 + 1 Simplify (1(sqrt(99) + -2sqrt(99) + sqrt(99)) - sqrt(99))/((sqrt(72) + sqrt(72)-2 - sqrt(72))/sqrt(8)) - 5((1 + sqrt(539) + 3)2 + sqrt(539)). -2775 - 629sqrt(11)/2 Simplify ((1sqrt(85)2)/((sqrt(5) - -2sqrt(5))-3))*24. 272/81 Simplify (sqrt(105)/(sqrt(10)/sqrt(2)))/sqrt(3) + 3((sqrt(42)/sqrt(6))2 + 0). sqrt(7) + 21 Simplify (2sqrt(117)-5-5)/(sqrt(27)/(sqrt(243)-1)). -450sqrt(13) Simplify (sqrt(240)/(sqrt(30)/sqrt(5)))/(3sqrt(512)). sqrt(5)/24 Simplify 6-16(sqrt(2736)-1)2-6. 590976 Simplify -4 + (1sqrt(36))/sqrt(12) - ((1sqrt(1089))/sqrt(3))*2. -367 + sqrt(3) Simplify 1 + (-3 + sqrt(80))1 + -1. -3 + 4sqrt(5) Simplify (-1sqrt(576) - sqrt(576))/(sqrt(12)/sqrt(6)-3). 8sqrt(2) Simplify 2 + 3(-5 + (-5(sqrt(891) - (1 + sqrt(891))))*2). 62 Simplify 4((sqrt(13) + 1 + -1 + (-1 + sqrt(13))1)23 + 5). -48sqrt(13) + 656 Simplify (3 + (sqrt(363) - ((1sqrt(363))*2-1 + sqrt(363)))-2)-3-4. -8676 Simplify -5(sqrt(2450) + (sqrt(2450) - ((1 + sqrt(2450) + sqrt(2450))*2 + sqrt(2450) + 1)) + 1)5. 2625sqrt(2) + 245025 Simplify (-2(sqrt(228) - -5-1sqrt(228)))/(-6(-3sqrt(24))/sqrt(2)). 4sqrt(19)/9 Simplify (-5(1 + -2 + (sqrt(847) - (1 + (sqrt(847) - (0 + sqrt(847))))) + 5 + (sqrt(847)2 - sqrt(847) - sqrt(847)) + sqrt(847)))2. 3300sqrt(7) + 84925 Simplify (sqrt(153) - (sqrt(153) + -44sqrt(153)))/((sqrt(216)/sqrt(8))/sqrt(3)). 16sqrt(17) Simplify ((sqrt(84) - 22sqrt(84))3)/(-1sqrt(108)/(sqrt(36)/sqrt(4))). 9sqrt(7) Simplify ((sqrt(42) - ((sqrt(1512) - (sqrt(1512) - sqrt(1512)4 - sqrt(1512))) + sqrt(42)))/sqrt(2))/(sqrt(36)/sqrt(108) + (sqrt(300) - sqrt(300)-1)). -90sqrt(7)/61 Simplify (-1(sqrt(432)-5 + -3 + sqrt(432) + sqrt(432)4-3))2. 1152sqrt(3) + 110601 Simplify 2(-2 + sqrt(10)/(sqrt(2)-16 + sqrt(2)) + -3). -10 - 2sqrt(5)/5 Simplify (((4sqrt(17) - sqrt(17))-2)*2 + sqrt(17)-3 + -1)-45. -12220 + 60sqrt(17) Simplify (5((sqrt(612) - ((3 + sqrt(612))3 - sqrt(612))) + (5 + sqrt(612)1 + sqrt(612) - sqrt(612)))3)2. 3600 Simplify ((4 + sqrt(2))-5 - ((sqrt(2) + 3)4)2) + -1. -197 - 101sqrt(2) Simplify 4 + (-1(sqrt(891)-3 + 1))*2. -54sqrt(11) + 8024 Simplify (4(sqrt(35) + sqrt(35) + sqrt(350)/(4sqrt(10)))/(-3*sqrt	{ "pile_set_name": "DM Mathematics" }
0 to the nearest 10000. 160000 What is 591900 rounded to the nearest one hundred thousand? 600000 What is 186.65 rounded to the nearest integer? 187 What is -6250700 rounded to the nearest 10000? -6250000 What is -175200 rounded to the nearest 10000? -180000 Round -4.74 to 0 dps. -5 Round -20.742 to the nearest integer. -21 Round -0.000002147 to six decimal places. -0.000002 What is 0.000034179 rounded to 6 decimal places? 0.000034 Round -0.3533 to two decimal places. -0.35 Round -48040 to the nearest one thousand. -48000 Round -4872000 to the nearest 100000. -4900000 What is 35.01 rounded to the nearest 10? 40 What is 0.03355 rounded to 3 decimal places? 0.034 Round -76 to the nearest integer. -76 What is -7.05 rounded to the nearest integer? -7 What is -0.04133 rounded to three dps? -0.041 What is 18631000 rounded to the nearest one million? 19000000 Round 0.000618 to five dps. 0.00062 What is -0.17326 rounded to three dps? -0.173 Round 0.0000064606 to 7 dps. 0.0000065 Round -3.63 to zero dps. -4 Round 0.0009342 to 5 dps. 0.00093 What is 0.0012901 rounded to five decimal places? 0.00129 Round -40.58 to the nearest 10. -40 What is 340.8 rounded to the nearest one hundred? 300 Round -0.035357 to two decimal places. -0.04 Round 0.000729 to five dps. 0.00073 What is 5840500 rounded to the nearest 100000? 5800000 Round -412530000 to the nearest one million. -413000000 What is 0.0008852 rounded to 5 decimal places? 0.00089 Round -0.00000014766 to seven decimal places. -0.0000001 Round -0.4098 to one dp. -0.4 What is 32.054 rounded to 0 decimal places? 32 What is 0.1675 rounded to 3 decimal places? 0.168 What is -395000 rounded to the nearest ten thousand? -400000 Round -0.0000354112 to 6 decimal places. -0.000035 What is -0.00067981 rounded to six dps? -0.00068 What is -0.229456 rounded to three decimal places? -0.229 Round -0.00002566 to 6 decimal places. -0.000026 What is 857970 rounded to the nearest 100000? 900000 What is -0.000002621 rounded to five dps? 0 Round 0.00000485542 to 7 dps. 0.0000049 What is 62 rounded to the nearest 100? 100 Round -1032050 to the nearest one hundred thousand. -1000000 What is 0.686 rounded to 2 dps? 0.69 What is -4.1351 rounded to 1 dp? -4.1 Round 0.3992 to one decimal place. 0.4 What is -221.2 rounded to the nearest one hundred? -200 What is 29850 rounded to the nearest ten thousand? 30000 What is 7763100 rounded to the nearest one hundred thousand? 7800000 Round -3805600 to the nearest ten thousand. -3810000 Round -0.0012095 to five decimal places. -0.00121 What is 0.012368 rounded to 4 dps? 0.0124 Round -0.0000277116 to 5 decimal places. -0.00003 What is 2.7239 rounded to 0 dps? 3 What is 0.000004059 rounded to 5 decimal places? 0 What is -55.9 rounded to the nearest ten? -60 What is -3940 rounded to the nearest 10000? 0 What is -0.00023227 rounded to six dps? -0.000232 What is -0.00000768 rounded to 6 dps? -0.000008 Round -2159640 to the nearest ten thousand. -2160000 Round -0.000131752 to six decimal places. -0.000132 What is -1889 rounded to the nearest 1000? -2000 Round 5350 to the nearest one hundred. 5400 What is 0.0001585 rounded to 6 dps? 0.000159 What is -148800 rounded to the nearest ten thousand? -150000 Round -39663 to the nearest 1000. -40000 Round 84.7 to the nearest 10. 80 Round -1.663 to the nearest integer. -2 What is -8226.2 rounded to the nearest one hundred? -8200 Round 612000 to the nearest ten thousand. 610000 What is 34.02 rounded to the nearest ten? 30 What is 2374500 rounded to the nearest ten thousand? 2370000 Round -0.00027033 to six dps. -0.00027 Round 4430000 to the nearest 100000. 4400000 What is -67.57 rounded to the nearest ten? -70 Round 0.05305 to 3 dps. 0.053 Round 0.343 to 1 decimal place. 0.3 Round 36700 to the nearest one hundred thousand. 0 What is 23600 rounded to the nearest one thousand? 24000 Round 627140 to the nearest 10000. 630000 Round -4320600 to the nearest one hundred thousand. -4300000 Round 0.016958 to 2 decimal places. 0.02 What is -0.13996 rounded to 1 dp? -0.1 Round 82067 to the nearest 1000. 82000 What is 5.12 rounded to zero decimal places? 5 What is 21.96 rounded to the nearest integer? 22 Round -0.000040711 to seven dps. -0.0000407 What is 0.2925 rounded to two decimal places? 0.29 Round -8730.7 to the nearest 10. -8730 What is -2570.2 rounded to the nearest 100? -2600 What is 0.000419 rounded to four dps? 0.0004 Round -0.0000003674 to seven dps. -0.0000004 Round -46.6819 to 0 decimal places. -47 Round 60210000 to the nearest 1000000. 60000000 Round -3.7768 to one decimal place. -3.8 What is 6426 rounded to the nearest 100? 6400 Round 28839000 to the nearest 1000000. 29000000 Round -73.1 to the nearest 10. -70 What is 2962140 rounded to the nearest ten thousand? 2960000 Round 2359.8 to the nearest 100. 2400 What is -16449.4 rounded to the nearest one thousand? -16000 Round 0.0015178 to 5 dps. 0.00152 Round -4.53 to one decimal place. -4.5 Round -0.000090472 to six dps. -0.00009 What is 90.3 rounded to the nearest ten? 90 What is -752530 rounded to the nearest ten thousand? -750000 Round 77280 to the nearest ten thousand. 80000 Round 78100 to the nearest 1000. 78000 Round 26120 to the nearest 1000. 26000 What is 7866 rounded to the nearest one thousand? 8000 Round -1023930 to the nearest 10000. -1020000 Round -9.194 to one decimal place. -9.2 Round -0.00003361 to six dps. -0.000034 Round 830380 to the nearest 10000. 830000 What is 0.00004951 rounded to 5 decimal places? 0.00005 What is 113060 rounded to the nearest 100000? 100000 Round 0.00000134257 to seven dps. 0.0000013 Round 0.0006692 to 4 decimal places. 0.0007 Round -31750 to the nearest ten thousand. -30000 Round -918.15 to zero dps. -918 What is 5312000 rounded to the nearest one million? 5000000 Round -16960 to the nearest 1000. -17000 What is -64.749 rounded to zero dps? -65 What is 251.66 rounded to the nearest ten? 250 Round 1.036 to 1 decimal place. 1 What is -6651000 rounded to the nearest one million? -7000000 Round -0.000000256 to seven dps. -0.0000003 Round 445 to the nearest 10. 450 What is 0.000041396 rounded to 6 dps? 0.000041 What is 0.0032132 rounded to three decimal places? 0.003 What is 24445 rounded to the nearest 100? 24400 Round -1145700 to the nearest one hundred thousand. -1100000 What is -22071000 rounded to the nearest 1000000? -22000000 Round -3435.4 to the nearest 1000. -3000 What is -0.004544 rounded to 4 dps? -0.0045 What is 4563000 rounded to the nearest 100000? 4600000 What is -0.0000005286 rounded to 7 dps? -0.0000005 Round -0.6081 to 1 dp. -0.6 Round 0.000153 to 4 dps. 0.0002 Round -0.0000021237 to seven dps. -0.0000021 What is 7.628 rounded to 1 decimal place? 7.6 Round 50926000 to the nearest one million. 51000000 What is 570100 rounded to the nearest ten thousand? 570000 What is 28.34 rounded to zero decimal places? 28 Round -0.000023823 to 7 decimal places. -0.0000238 What is 25700 rounded to the nearest ten thousand? 30000 What is -2.452 rounded to 1 decimal place? -2.5 What is -1157.06 rounded to the nearest ten? -1160 Round 0.000061702 to five dps. 0.00006 Round -0.000263072 to 6 decimal places. -0.000263 Round -2817.31 to the nearest one hundred. -2800 Round 0.02485 to four decimal places. 0.0249 Round 0.00000158223 to 7 decimal places. 0.0000016 What is 0.01141 rounded to 3 decimal places? 0.011 What is 0.909 rounded to 1 decimal place? 0.9 What is -348.8 rounded to the nearest ten? -350 Round -122700 to the nearest ten thousand. -120000 What is 42.9511 rounded to one dp? 43 Round -3747000 to the nearest one million. -4000000 What is 0.042604 rounded to 4 decimal places? 0.0426 What is -0.0062 rounded to 2 decimal places? -0.01 Round 128 to the nearest 10. 130 What is 18238 rounded to the nearest one thousand? 18000 Round -3.035 to 1 decimal place. -3 What is 0.00000414 rounded to six decimal places? 0.000004 Round 0.000026421 to 6 dps. 0.000026 What is -63297 rounded to the nearest one thousand? -63000 Round -0.0244895 to four dps. -0.0245 Round 730.9 to the nearest one hundred. 700 What is -313000 rounded to the nearest one hundred thousand? -300000 Round 0.19827 to 3 dps. 0.198 What is 780560 rounded to the nearest one hundred thousand? 800000 What	{ "pile_set_name": "DM Mathematics" }
85 - 159 for w. 12 Solve 19294 = -1043x - 8867 for x. -27 Solve -160o - 2258 = 142 for o. -15 Solve 177j = -21j + 44j - 80j for j. 0 Solve -24m + 2009 = 2177 for m. -7 Solve 2584 - 401 + 487 = 178d for d. 15 Solve 147t = 104t - 903 for t. -21 Solve 3j + 459 - 408 = -14j for j. -3 Solve -20m + 2198 = -101m + 659 for m. -19 Solve 9406l = 9413l + 140 for l. -20 Solve -44j = 33j + 44j - 2178 for j. 18 Solve 0o + 76o - 2033 + 361 = 0 for o. 22 Solve 160p - 663p = -3018 for p. 6 Solve -1990j = -1821j - 5577 for j. 33 Solve -429a + 441a = 0 for a. 0 Solve 108x = 38x - 1465 + 345 for x. -16 Solve 6 = 17g - 19 - 26 for g. 3 Solve 138b + 1120 = 208b for b. 16 Solve -35x - 322001 = -322281 for x. 8 Solve -35v + 1261 = 26v + 36v for v. 13 Solve -97f - 136f = 66f + 5083 for f. -17 Solve 31062y = 31119y - 1767 for y. 31 Solve 2363f - 2915 = 2946f for f. -5 Solve 6b + 46b = 10b + 1176 for b. 28 Solve 14d - 77d + 1125 = 12d for d. 15 Solve 2631 = -113m + 823 for m. -16 Solve -l - 75 - 9 = 13l for l. -6 Solve -32y + 35 = -11y - 7 for y. 2 Solve 0 = -55r + 227 - 282 for r. -1 Solve 4895y - 65 = 4908y for y. -5 Solve 2156b + 182 = 2143b for b. -14 Solve -1221x + 7513 - 1408 = 0 for x. 5 Solve 21d - 48d - 45d = 288 for d. -4 Solve 409555j + 1232 = 409467j for j. -14 Solve 0 = -3d + 21d - 24d for d. 0 Solve 36s + 627 = -30s - 99 for s. -11 Solve 259o - 4472 = -1226 + 6596 for o. 38 Solve -558 = 77z - 2483 for z. 25 Solve 229 + 9 + 922 = 145t for t. 8 Solve 331f = -83f - 2161 - 10259 for f. -30 Solve 8b = 21b + 22b for b. 0 Solve -2219i - 86 = -2299i + 2474 for i. 32 Solve 3816 - 2184 = -136d for d. -12 Solve -9r + 35 = -6r - 10r for r. -5 Solve -110 - 457 = -68y + 317 for y. 13 Solve -97c - 13 = -96c for c. -13 Solve 29j - 192 + 58 - 98 = 0 for j. 8 Solve 109b + 149b + 1151 = 6053 for b. 19 Solve 0 = -21j - 34j + 31j for j. 0 Solve -148 = 49f - 12f + 37 for f. -5 Solve -13g + 246 = 25g - 210 for g. 12 Solve -18h = 42h - 487 - 293 for h. 13 Solve -761o - 22075 = 122o for o. -25 Solve 97i = -714 + 379 - 441 for i. -8 Solve -76h - 56876 + 56572 = 0 for h. -4 Solve -666p - 819 = -729p for p. 13 Solve -37o = 33o - 5o - 9o for o. 0 Solve -12j + 174211 - 174439 = 0 for j. -19 Solve -402m + 29507 - 10742 = -1097m for m. -27 Solve -282b + 71b - 1450 = 79b for b. -5 Solve -131v = -13v - 4v + 342 for v. -3 Solve 11386 = 103l - 581l + 1348 for l. -21 Solve 0 = -154x - 184x - 8450 for x. -25 Solve -47o + 24o = -18o - 50 for o. 10 Solve 5493f + 264 = 5517f for f. 11 Solve 64 + 74 = 41z + 5z for z. 3 Solve -194g + 212g = 36 for g. 2 Solve 54c + 51 = -13c + 1123 for c. 16 Solve 20y + 85 + 26 = -29 for y. -7 Solve 19a + 306 = -13a - 14 for a. -10 Solve 6j - 44j - 12j + 150 = 0 for j. 3 Solve 19t - 39t + 340 = -80 for t. 21 Solve -17f = 6f + 228 + 186 for f. -18 Solve -687 = 85n - 0n - 92 for n. -7 Solve -9 + 288 = -31c for c. -9 Solve -110w + 863 + 787 = 0 for w. 15 Solve -1380w + 1158w + 6660 = 0 for w. 30 Solve 135 = 25l - 115 for l. 10 Solve 15650z + 2933 + 1963 = 15794z for z. 34 Solve 205a + 182 - 2847 = 0 for a. 13 Solve 88m - 70m = 126 for m. 7 Solve -15v = -28v + 12v + 13 for v. 13 Solve -47s = 41 - 20 + 26 for s. -1 Solve 748 = 7200z - 7156z for z. 17 Solve -7w - 8w + 450 = -40w for w. -18 Solve -4431 - 4298 = -289d - 1215 for d. 26 Solve -23l = -141l + 1770 for l. 15 Solve -125 = 37z + 319 for z. -12 Solve -32f - 20f + 1368 = 24f for f. 18 Solve 362x - 5425 - 1091 = 0 for x. 18 Solve -77k + 92k = -105 for k. -7 Solve 1781 = 361k - 2912 for k. 13 Solve -6l + 7l - 2l - 12 = 0 for l. -12 Solve 29w - 325 = 53w + 11 for w. -14 Solve -333p = -387p + 594 for p. 11 Solve 4666 - 4286 = 95j for j. 4 Solve 0 = 179o - 318o - 15 + 154 for o. 1 Solve -63v = 4386 - 5268 for v. 14 Solve -1928t + 1917t = -8 + 52 for t. -4 Solve 75g - 1710 + 1008 = 1248 for g. 26 Solve 8m - 175 + 127 = 0 for m. 6 Solve -780k + 660k = 480 for k. -4 Solve -1449 - 878 = 129s + 1027 for s. -26 Solve -97a + 152 - 443 = 0 for a. -3 Solve 0 = 12p + 227 - 239 for p. 1 Solve -43f = -308f - 795 for f. -3 Solve 570 = 991h - 961h for h. 19 Solve -282t + 4536 = -66t for t. 21 Solve -181 + 37 = -2685y + 2673y for y. 12 Solve -504 = -158p + 662p for p. -1 Solve -194k = 180k - 4572 - 1038 for k. 15 Solve 241r = -3858 + 966 for r. -12 Solve -7 - 25 = 67z + 35 for z. -1 Solve 449h + 8855 - 324 = 0 for h. -19 Solve 214 = 58q + 156 for q. 1 Solve 64o = -299o - 11o + 5236 for o. 14 Solve -3288p + 3281p - 56 = 0 for p. -8 Solve -639s - 6679 = 315s + 5723 for s. -13 Solve -57a - 96 = 41a - 2a for a. -1 Solve -127t + 3 = -128t for t. -3 Solve -304v + 1146 = -4022 for v. 17 Solve 24g + 66g - 30g + 180 = 0 for g. -3 Solve 0 = t - 1004 + 1035 for t. -31 Solve 255m - 216m - 242 - 148 = 0 for m. 10 Solve 33s + 355 = 33s - 71s for s. -5 Solve 6p = 33p + 7p - 204 for p. 6 Solve -4749 + 3099 = -165v for v. 10 Solve -3317 = 2447t - 2554t for t. 31 Solve -189614 + 189656 = 2q for q. 21 Solve 0 = -105r - 2645 + 4745 for r. 20 Solve 343p + 191p - 228 = 10452 for p. 20 Solve 10045t - 10029t + 144 = 0 for t. -9 Solve 112q + 2242 = 562 for q. -15 Solve 224v + 114v + 4394 = 0 for v. -13 Solve 65b - 818 = -1793 for b. -15 Solve -118a - 1377 - 39 = 0 for a. -12 Solve -106o + 249o + 143 = 0 for o. -1 Solve 53t + 505 = 81 for t. -8 Solve -n + 437 = 454 for n. -17 Solve -37i = -30i + 44i - 255 for i. 5 Solve -494 = -9l - 17l - 182 for l. 12 Solve -482 = 16s - 354 for s. -8 Solve -4z + 1103z + 2136 = 31z for z. -2 Solve 432u + 2225 = -1579 - 84 for u. -9 Solve 107v = -391v + 12948 for v. 26 Solve 113i - 2610 = -32i for i. 18 Solve 14f - 33f = -47f - 308 for f. -11 Solve -79b = -463b + 30b + 1062 for b. 3 Solve -91b - 55b - 1160 = -b for b. -8 Solve 396n - 384n - 132 = 0 for n. 11 Solve 1542 + 138 = 105i for i. 16 Solve -247 = -6a - 67 for a. 30 Solve 1216z - 935 + 553 = 834 for z. 1 Solve 0 = 199l + 255l - 7259 - 6815 for l. 31 Solve -7354i = -7379i - 50 for i. -2 Solve 0 = 48b - 142 - 290 for b. 9 Solve -32j - 26j - 42j - 800 = 0 for j. -8 Solve -18q + 1810 = 1630 for q. 10 Solve 0 = 511f + 3402 + 2421 + 2864 for f. -17 Solve 18h + 3h = 20h + 2 for h. 2 Solve -160 = 387d - 347d for d. -4 Solve 603f - 632f = 87 for f. -3 Solve 4567u - 130 - 200 = 4556u for u. 30 Solve -113w = -1700 - 899 for w. 23 Solve -24f - 24130 = 6f - 23740 for f. -13 Solve -81w + 99 = -71w - 71 for w. 17 Solve -7035p + 7212p = -3186 for p. -18 Solve 35589c = 35608c - 266 for c. 14 Solve 858 = -23d - 1361 + 1506 for d. -31 Solve -21675 = 171l - 1038l for l. 25 Solve -35b + 1728 = -100b + 233 for b. -23 Solve 1430t - 241 = 2619 for t. 2 Solve -489 + 251 = -63u + 392 for u. 10 Solve 42g + 84g + 3341 = 695 for g. -21 Solve 0 = -11r + 4 + 64 + 9 for r. 7 Solve 5469b - 69 = 5446b for b. 3 Solve -674l + 2568 - 632 = -4804 for l. 10 Solve 11s = -115 - 0 - 6 for s. -11 Solve 1230 - 1252 = -11k for k. 2 Solve -118d - 210 = -103d for d. -14 Solve -7b + 1931 - 1945 = 0 for b. -2 Solve 314y + 17255 = -404y - 297y for y. -17 Solve -257s - 560 = -217s for s. -14 Solve -149n = -216n + 536 for n. 8 Solve 373 + 75 = -21l + 217 for l. -11 Solve -z + 50z + 459 - 67 = 0 for z. -8 Solve 195y + 388 + 1089 = -2033 for y. -18 Solve 337 = 27s - 68 for s. 15 Solve -26 + 130 = -17d - 66 for d. -10 Solve 0 = 76869q - 76883q - 336 for q. -24 Solve -209v = -1357 - 942 for v. 11 Solve 13s + 23s + 0s = -432 for s. -12 Solve -129f + 326f = 788 for f. 4 Solve -40l + 559 = 3l for l. 13 Solve -82 = -42c + 31c + 116 for c. 18 Solve -987 = -58u + 298 + 165 for u. 25 Solve -166 = 218o - 98o - 203o for o. 2 Solve 0 = 16h + 181 - 40 + 19 for h. -10 Solve -16i - 47i = -17i - 598 for i. 13 Solve -17q - 75 = -46 + 56 for q. -5 Solve -348 = 15u - 228 for u. -8 Solve -72 = -443a + 425a for a. 4 Solve -y = 1217 - 1215 for y. -2 Solve 1847 = -568i - 2697 for i. -8 Solve 36 = -64y + 43y - 27 for y. -3 Solve 243t = 205*t - 51 - 63 for t. -3 Solve -12034 + 2805 - 385	{ "pile_set_name": "DM Mathematics" }
Sum 200.6 and -7.9. 192.7 -1171 + -2204 -3375 What is -4 take away -0.218122? -3.781878 What is -135 plus -4138? -4273 What is -143.01 less than 3? 146.01 What is -112.109 - 6? -118.109 What is 0.00081 - 0.08? -0.07919 -7656+25 -7631 Total of -74 and -7. -81 What is the distance between -40 and -245? 205 What is -324473 take away 2? -324475 Work out 70 + -7.1111. 62.8889 -222+95500 95278 Put together 4.9 and -43.491. -38.591 What is 97090 + 0.7? 97090.7 What is the difference between 0.17 and 5855? 5854.83 Put together 0.14 and -0.124545. 0.015455 5174 + -7.3 5166.7 What is -109 take away 1401? -1510 -3+384 381 What is -2 take away -2416? 2414 What is 1 + -0.988? 0.012 Calculate 5513 - -2.1. 5515.1 What is the difference between 0.6 and -0.595? 1.195 Work out 47.532 + -0.4. 47.132 What is 0.645 plus -1? -0.355 Work out -12.52 - -63.23. 50.71 Add 42765 and 1.3. 42766.3 -7 - 142.0154 -149.0154 -0.274 + 2 1.726 What is -0.0424919 minus -0.5? 0.4575081 Add together 1216 and -0.339. 1215.661 11.07 - 160 -148.93 What is -390 take away -38? -352 14427 - 1.1 14425.9 Work out 2192940 - -0.1. 2192940.1 Total of -2 and -216267. -216269 What is -735938 plus -0.4? -735938.4 Put together -19576 and -6.3. -19582.3 Work out -0.3 - 67899. -67899.3 Calculate -517924 - -4. -517920 Add together -76 and -0.0547. -76.0547 What is -1 plus 87458? 87457 Work out -0.5 + 4093. 4092.5 What is 347.06 take away 0.3? 346.76 Calculate -7.67 + 0.5. -7.17 Total of -13.6 and -0.0483. -13.6483 Work out -25438 + -3. -25441 0.361 + 4.6 4.961 What is -0.016 less than 484.4? 484.416 What is 3 - 8075? -8072 -0.0183+-789 -789.0183 What is 0.17949 take away -0.4? 0.57949 What is -0.7 + 162.4? 161.7 Calculate 0.1082 - -598. 598.1082 Total of 3.2 and -68094. -68090.8 21+-340 -319 -1 + 30930 30929 Work out 0.2 - 138. -137.8 Add together 3 and 24.17302. 27.17302 What is the difference between 15000 and 0? 15000 -0.1 + -2.1 -2.2 -2598 + -408 -3006 What is 984.91 take away 0.3? 984.61 Put together -0.166 and 22. 21.834 What is the distance between -306.88 and 5? 311.88 Work out -0.06797 - -1. 0.93203 Sum -5568 and 1. -5567 What is -1268 plus -20.23? -1288.23 -61.8 + -0.737 -62.537 Add together 13 and 56.11. 69.11 -0.3+0.169615 -0.130385 Work out 239.6958 - 0.2. 239.4958 18+-1.153 16.847 -41 - 693.1 -734.1 Calculate 19.9 + 6788. 6807.9 Work out -0.05 - -546982. 546981.95 What is 3.6 - -460? 463.6 -5 - -5792 5787 Calculate 0.03 - 132240. -132239.97 Add together 4749 and -0.2. 4748.8 -141+39.2 -101.8 Add -52.31 and -49. -101.31 What is -0.8 minus 120? -120.8 What is -3080 less than 150? 3230 What is the difference between -2426 and 2? 2428 Calculate 2 + -0.523. 1.477 Work out 3 + -0.1373. 2.8627 Subtract 0 from 307334. 307334 What is -8.36231 take away -1? -7.36231 Add -15.43 and -2. -17.43 Work out -61.2 + -0.0139. -61.2139 -2 - 28590 -28592 What is -0.428 less than 0.7118? 1.1398 Calculate -110 + 615. 505 What is the distance between -0.31 and -4.4? 4.09 Work out -1239 + -4. -1243 What is the difference between 0.13 and -54.5? 54.63 4 + 17977 17981 Calculate -5 - 0.0689. -5.0689 -56 + 2569 2513 Subtract 1 from -4.74757. -5.74757 Add 2843.5 and 1. 2844.5 Sum -0.4 and -0.0826. -0.4826 Calculate 9 + 338.81. 347.81 What is 43.3 less than 0.5? -42.8 What is -0.2 less than 1.372543? 1.572543 Calculate 0.09 - 592.7. -592.61 What is -0.4 less than -83.52? -83.12 Calculate -2 - -0.107. -1.893 Add together -0.9462 and -0.1. -1.0462 Work out 7845 - 4. 7841 Work out -0.026 - 0.066. -0.092 What is the difference between -2.268 and -8? 5.732 What is -11 plus 2100? 2089 What is the distance between 47 and 0.024915? 46.975085 What is 41 - 113959? -113918 Calculate -513 + 0.4. -512.6 Calculate 0.2 - 3.666. -3.466 Put together 0 and -2462. -2462 What is the distance between 0.236 and 59? 58.764 Subtract 0.039 from -32. -32.039 What is -0.2 plus 51844? 51843.8 What is 11506378 take away 0.2? 11506377.8 What is -530892 - -3? -530889 What is 16638 minus 4? 16634 Put together -10 and 125. 115 What is 5499.8 plus 9.2? 5509 What is 20.98 plus -0.142? 20.838 Calculate -124 - 0.2. -124.2 What is 9264 less than 0.14? -9263.86 What is the difference between -0.1 and 73868? 73868.1 Total of -1.5 and 209.5. 208 Put together -2 and 0.0234. -1.9766 Calculate -61 - -3229. 3168 Work out 86730 - -4. 86734 What is 0.72 + -0.28? 0.44 Calculate 0 + 118683. 118683 What is the distance between 31681 and 2.1? 31678.9 What is the difference between -5115 and 0.18? 5115.18 Total of 4.3 and 1682. 1686.3 What is the distance between -0.5 and 353512.5? 353513 Calculate 627 + -147. 480 -0.02+0.85 0.83 What is 163 take away 1920? -1757 0.64676 - 0.11 0.53676 What is -41 take away 0.1? -41.1 What is -18130 minus 0.03? -18130.03 What is 90 - 14425? -14335 What is 1080302 less than -0.5? -1080302.5 What is 17 + 2807.08? 2824.08 Calculate 25 - -315. 340 What is -6.11 minus -0.1? -6.01 What is 1.61 minus -17481? 17482.61 What is 4.6621 less than 9? 4.3379 What is 0.2 plus 4.85? 5.05 -13 - 649 -662 What is -4051 - 11? -4062 Calculate -5 + -10696. -10701 0.01 + 134 134.01 Add 529822 and -0.2. 529821.8 What is 2 + -440.63? -438.63 Work out -45057 - -0.5. -45056.5 Sum 3 and 244245. 244248 What is 4 take away 0.154437? 3.845563 Subtract -0.125071 from -1. -0.874929 Subtract -38941 from 0.1. 38941.1 What is 74 - 578.36? -504.36 Put together -4269110 and 0.3. -4269109.7 Total of -44 and -0.5799. -44.5799 -2 - 257 -259 What is the difference between -81 and -0.144? 80.856 What is the distance between -1 and -176021.3? 176020.3 Add together 951 and -93. 858 Calculate -3.85 - 2. -5.85 Calculate -110 - 845. -955 Calculate 30 - -0.0009. 30.0009 What is 1 take away -0.276628? 1.276628 Total of -5206776 and -1. -5206777 What is the distance between -11 and -9.6? 1.4 What is the distance between 30 and -27? 57 Put together -4.25 and 0.23. -4.02 What is -0.07 take away 0.91156? -0.98156 Add -25 and 1.5. -23.5 What is the distance between 7.0176 and 4? 3.0176 What is -5 less than -0.05275? 4.94725 What is -184 - 8.69? -192.69 Calculate 815 + 3. 818 What is 15 plus 1470? 1485 What is -2.7 + -1? -3.7 Sum 92.4 and -0.079. 92.321 What is 471 less than 0.1? -470.9 Total of -19.92725 and -1. -20.92725 Work out -276853 - 1.2. -276854.2 What is -136356 minus -20? -136336 What is -0.007 + 6.6? 6.593 What is the distance between -8.233 and -5? 3.233 Put together 26073 and -0.4. 26072.6 What is -0.4 - -1051.5? 1051.1 Work out 1337 + -67. 1270 Calculate -7044.17 + -0.5. -7044.67 23570.9 - -4 23574.9 Sum 0.74 and 19. 19.74 What is 17.765 less than 2? -15.765 What is -0.78 + -0.151? -0.931 Sum 0.4 and -474294. -474293.6 Add 123.18 and -4. 119.18 Put together -4438 and 1.6. -4436.4 Add together 179 and -789. -610 What is 6537 plus -2? 6535 Calculate 0.2 - 1100088. -1100087.8 -6192 - 11 -6203 Add 2700 and -2. 2698 0.4+-48 -47.6 What is the distance between -0.164 and 0.67? 0.834 What is 23.8305 take away 1? 22.8305 Calculate -74 + -315. -389 Work out 5 + 30458. 30463 Work out 3042.9 + -0.5. 3042.4 What is the distance between 0.25 and -29.9? 30.15 Total of -7.279 and 477. 469.721 Put together 144517 and -0.2. 144516.8 Subtract -2996 from 0.0295. 2996.0295 Add -0.3 and 3.626. 3.326 Work out 4 - 370170. -370166 0.2 + -407 -406.8 What is 1.2 + -48.9? -47.7 0.03208+0.3 0.33208 Add -2 and -159. -161 What is 176 minus -82? 258 Total of -2.8994 and 0.4. -2.4994 467 + -21.2 445.8 What is the difference between 74922 and -0.4? 74922.4 What is the distance between 55 and -24? 79 5+154.3 159.3 What is 5691 + -0.5? 5690.5 Add 104 and -11. 93 What is -1143 take away 64? -1207 Total of 122 and -130. -8 What is 0 - -185228? 185228 What is -0.5 + 971646? 971645.5 Subtract -1.1 from -52. -50.9 What is 0.07 less than 148101? 148100.93 Sum -41 and 1363. 1322 -86.4+0 -86.4 What is 0.01 minus 35807? -35806.99 What is -913.13 - -2? -911.13 Subtract 0.99161 from 0.3. -0.69161 Add together -5 and -2819. -2824 Sum 45 and 14966. 15011 What is the difference between -1.832 and -1.28? 0.552 -83+-1.3 -84.3 What is 0.1 take away 7692? -7691.9 What is -1.031 - 141.3? -142.331 What is 48 + -0.161? 47.839 What is -168954 - -81? -168873 10731 - -0.31 10731.31 Sum -3 and 57870. 57867 What is 19 less than	{ "pile_set_name": "DM Mathematics" }
m: 1, l: 4, g: 2, z: 5, r: 1}. 8/105 Calculate prob of picking 1 v and 1 q when two letters picked without replacement from {v: 5, q: 15}. 15/38 What is prob of picking 1 j and 2 s when three letters picked without replacement from {g: 2, s: 4, j: 2, z: 2}? 1/10 What is prob of picking 1 d and 1 m when two letters picked without replacement from rrmrrdmmdrmhmmmdr? 21/136 Calculate prob of picking 3 r and 1 g when four letters picked without replacement from grrggrrrrgrg. 35/99 What is prob of picking 1 e and 2 n when three letters picked without replacement from {b: 1, e: 7, r: 8, n: 4}? 7/190 What is prob of picking 2 k when two letters picked without replacement from {k: 2, r: 2, u: 2, c: 3}? 1/36 What is prob of picking 1 j and 1 z when two letters picked without replacement from {c: 4, z: 2, j: 3, p: 7, m: 3}? 2/57 What is prob of picking 1 u and 1 w when two letters picked without replacement from wwwwwuwu? 3/7 Calculate prob of picking 1 l and 3 f when four letters picked without replacement from {f: 17, l: 2}. 20/57 What is prob of picking 3 g and 1 s when four letters picked without replacement from gnsgssnsgvqqgpgnsvgv? 20/969 Four letters picked without replacement from {r: 4, x: 4, k: 3, e: 1, m: 2, j: 3}. What is prob of picking 1 j, 2 m, and 1 e? 3/2380 Two letters picked without replacement from {q: 10}. What is prob of picking 2 q? 1 Four letters picked without replacement from sssssssss. What is prob of picking 4 s? 1 What is prob of picking 1 l and 2 k when three letters picked without replacement from {l: 1, o: 6, k: 4}? 2/55 Two letters picked without replacement from {s: 1, n: 1, k: 7, y: 3, v: 2}. Give prob of picking 2 y. 3/91 Calculate prob of picking 1 c, 2 y, and 1 i when four letters picked without replacement from ccycyzfyyyyciyyyyy. 11/153 What is prob of picking 1 u and 1 j when two letters picked without replacement from {u: 2, w: 1, t: 1, b: 1, j: 2}? 4/21 Three letters picked without replacement from oiooooioiooooiioooo. What is prob of picking 3 o? 364/969 What is prob of picking 1 m and 1 x when two letters picked without replacement from {m: 2, x: 2, r: 1, c: 2, e: 1}? 1/7 Calculate prob of picking 1 y and 1 p when two letters picked without replacement from ppyyeyssotpsyeespy. 20/153 Calculate prob of picking 1 p and 1 t when two letters picked without replacement from pppptppp. 1/4 Two letters picked without replacement from {a: 7, x: 2, y: 4}. Give prob of picking 1 y and 1 x. 4/39 Calculate prob of picking 2 t and 1 w when three letters picked without replacement from dwwdddttwdwd. 1/55 Two letters picked without replacement from {j: 1, a: 4, z: 2}. What is prob of picking 1 z and 1 a? 8/21 Two letters picked without replacement from {i: 1, a: 1, e: 1}. What is prob of picking 1 i and 1 a? 1/3 Calculate prob of picking 1 s and 1 y when two letters picked without replacement from {y: 1, s: 1, h: 1}. 1/3 Calculate prob of picking 3 o when three letters picked without replacement from ogwgooog. 1/14 Two letters picked without replacement from {h: 6, u: 4}. Give prob of picking 2 h. 1/3 Calculate prob of picking 4 f when four letters picked without replacement from fffffffff. 1 Calculate prob of picking 4 l when four letters picked without replacement from tttltfttllllltlell. 7/170 What is prob of picking 2 q and 2 t when four letters picked without replacement from {h: 2, v: 1, g: 6, q: 5, t: 2}? 1/182 What is prob of picking 3 l and 1 a when four letters picked without replacement from lllalllala? 1/2 Four letters picked without replacement from lvhhmmmlhmlhs. Give prob of picking 1 s, 1 l, and 2 m. 18/715 What is prob of picking 1 m, 1 i, and 1 v when three letters picked without replacement from {m: 2, g: 1, i: 2, h: 6, l: 3, v: 5}? 20/969 Two letters picked without replacement from {r: 1, u: 2, z: 3, a: 1}. What is prob of picking 2 z? 1/7 Two letters picked without replacement from {p: 4, z: 6, u: 1, c: 3}. What is prob of picking 2 z? 15/91 Calculate prob of picking 2 c when two letters picked without replacement from ccoocrccooo. 2/11 Calculate prob of picking 4 b when four letters picked without replacement from jcjjbjjjcjjjbbbcjj. 1/3060 Three letters picked without replacement from {x: 1, s: 3}. Give prob of picking 3 s. 1/4 What is prob of picking 2 t and 1 y when three letters picked without replacement from ytttyytytyyyy? 40/143 What is prob of picking 1 x and 2 w when three letters picked without replacement from ixxikmmmwwmmiiim? 1/280 Calculate prob of picking 2 t when two letters picked without replacement from tygtgtgtgtgggtyot. 21/136 What is prob of picking 1 g and 1 z when two letters picked without replacement from {g: 1, h: 1, z: 1, o: 2}? 1/10 Calculate prob of picking 1 m, 1 b, and 1 u when three letters picked without replacement from mrbrhsmsu. 1/42 Calculate prob of picking 2 w when two letters picked without replacement from {f: 11, w: 5}. 1/12 Calculate prob of picking 3 j when three letters picked without replacement from {j: 6}. 1 Three letters picked without replacement from aaaa. What is prob of picking 3 a? 1 What is prob of picking 3 q when three letters picked without replacement from {k: 10, q: 9}? 28/323 Four letters picked without replacement from wgwxwfwxhwhvww. Give prob of picking 1 f, 1 g, and 2 w. 3/143 Calculate prob of picking 1 b, 2 l, and 1 g when four letters picked without replacement from {b: 6, l: 3, e: 3, g: 3}. 18/455 Two letters picked without replacement from rwrwqqrttbqttnqqrtrq. Give prob of picking 2 t. 1/19 Two letters picked without replacement from {q: 3, j: 2}. What is prob of picking 2 j? 1/10 What is prob of picking 2 u when two letters picked without replacement from {u: 5, s: 7}? 5/33 Three letters picked without replacement from {w: 9, o: 3}. What is prob of picking 1 w and 2 o? 27/220 Three letters picked without replacement from pwjpyuwq. Give prob of picking 1 u, 1 w, and 1 y. 1/28 Two letters picked without replacement from {h: 3, y: 1, v: 1, i: 2, k: 3, g: 2}. What is prob of picking 1 h and 1 i? 1/11 Two letters picked without replacement from sazaaas. What is prob of picking 1 s and 1 a? 8/21 What is prob of picking 1 n, 1 l, and 2 b when four letters picked without replacement from {l: 1, c: 4, n: 1, b: 3, e: 1, t: 5}? 1/455 Calculate prob of picking 2 x when two letters picked without replacement from {t: 5, f: 1, x: 4, q: 1}. 6/55 Three letters picked without replacement from {k: 4, u: 4, h: 3, i: 3}. What is prob of picking 1 k and 2 u? 6/91 Two letters picked without replacement from {c: 9, a: 5}. Give prob of picking 2 a. 10/91 Calculate prob of picking 1 p, 2 w, and 1 u when four letters picked without replacement from {u: 4, p: 1, b: 1, w: 2}. 2/35 Calculate prob of picking 3 e when three letters picked without replacement from keeeeeekee. 7/15 Calculate prob of picking 2 h when two letters picked without replacement from {h: 4, g: 1, p: 1, z: 2}. 3/14 Two letters picked without replacement from wwewcwccec. What is prob of picking 1 c and 1 e? 8/45 Four letters picked without replacement from elleefeeefeee. What is prob of picking 1 f and 3 e? 168/715 Three letters picked without replacement from {j: 1, a: 1, x: 9}. Give prob of picking 2 x and 1 a. 12/55 Calculate prob of picking 2 b when two letters picked without replacement from {c: 4, m: 1, a: 4, p: 3, y: 1, b: 2}. 1/105 Two letters picked without replacement from {s: 4, t: 1, h: 1, c: 3, e: 1, q: 5}. What is prob of picking 1 e and 1 q? 1/21 Calculate prob of picking 1 x and 1 w when two letters picked without replacement from {x: 1, t: 2, g: 1, d: 5, w: 2, y: 2}. 1/39 Three letters picked without replacement from {e: 2, u: 5, q: 2, b: 1, j: 5, d: 1}. What is prob of picking 1 b, 1 u, and 1 q? 1/56 Four letters picked without replacement from llaslsu. Give prob of picking 1 a, 2 l, and 1 u. 3/35 What is prob of picking 1 c, 1 p, and 1 b when three letters picked without replacement from {p: 3, c: 2, b: 4, o: 2}? 8/55 Calculate prob of picking 1 k and 1 x when two letters picked without replacement from kxixixixiixii. 5/78 Calculate prob of picking 3 n when three letters picked without replacement from {n: 3, d: 2}. 1/10 Two letters picked without replacement from	{ "pile_set_name": "DM Mathematics" }
3) - (-1sqrt(153) - sqrt(153) - sqrt(153))))))-5)/sqrt(9)5)2. 95625 Simplify ((sqrt(112)-1 + sqrt(7))*2 - (sqrt(1008) - (-1 + sqrt(1008)))) + sqrt(56)/(3sqrt(392) - sqrt(392) - sqrt(8)). sqrt(7)/13 + 62 Simplify 4(sqrt(250)-12)/(sqrt(10)/sqrt(2)2 - (sqrt(5) + sqrt(20) + (2sqrt(20) - sqrt(20) - sqrt(20)))). 40sqrt(2) Simplify 5 + (5(0 + sqrt(13) + sqrt(13)) + -2 - ((sqrt(1053) - sqrt(1053)1)*2 + 2)) + 3. 4 + 10sqrt(13) Simplify ((5(sqrt(320) + -1)-5 - (((-1 + sqrt(320))-5 - sqrt(320)) + -4)) + 1)2. -7600sqrt(5) + 116145 Simplify 2(1((-1(sqrt(68) + 1) - sqrt(68)) + sqrt(68)))256. 240sqrt(17) + 4140 Simplify (((0 + sqrt(320) - sqrt(320))-4 - (sqrt(320) + -1 + sqrt(320)-3))2 + 4)2. 384sqrt(5) + 5156 Simplify (3 + -4((sqrt(13) + 3 - sqrt(13)) + sqrt(13) + -1))23. 120sqrt(13) + 699 Simplify ((sqrt(119)/(-1sqrt(7)) - (-1 + sqrt(1377)))-3)2-5. -76545 + 900sqrt(17) Simplify ((1sqrt(76)-15)/((-2sqrt(196) + sqrt(196))6))*2. 475/1764 Simplify (5 + ((sqrt(512) + 3)2 + sqrt(512) - sqrt(512)) + 4)1. 15 + 32sqrt(2) Simplify (((sqrt(360)2 - sqrt(360))-2)/(sqrt(35)/(sqrt(7) - (sqrt(7) + (1sqrt(175) + sqrt(175) + sqrt(175) - sqrt(175))))))2. 28800 Simplify (2sqrt(136)-1 - -3sqrt(136)-1)/(-2sqrt(72) + (1sqrt(968) - sqrt(968))). 5sqrt(17)/6 Simplify -1((-2sqrt(3402))/sqrt(6) - (2 + (2sqrt(252))2)). 18sqrt(7) + 1010 Simplify 5(-2sqrt(512)-3-1 + -1)*2. 960sqrt(2) + 92165 Simplify (-3 + 0 + sqrt(1008) - -1sqrt(448)-1)*25-6. -3630 + 720sqrt(7) Simplify -6(-2sqrt(847)2 + (sqrt(847) - (sqrt(847)-3-4 + sqrt(847) + sqrt(847))))2. -1468698 Simplify (-1(sqrt(4) + sqrt(16)2))/(3sqrt(12)/(sqrt(30)/sqrt(5))). -5sqrt(2)/3 Simplify 5(sqrt(36)/sqrt(6))/sqrt(3) + sqrt(242) + sqrt(242)-1 + 1. 1 + 5sqrt(2) Simplify 5((sqrt(1573) - (sqrt(1573) - (-1sqrt(1573)-5 + sqrt(1573))) - (sqrt(1573)1 - sqrt(1573))3) + (-1 + sqrt(1573))-1-4)2. -4400sqrt(13) + 786580 Simplify ((sqrt(68)4 - (sqrt(17)-1 + -3)) + -2(sqrt(1088)1 + 3))*2. 42sqrt(17) + 842 Simplify sqrt(1440)/sqrt(8) + 4 + 3sqrt(20)/sqrt(4) + -2. 2 + 9sqrt(5) Simplify (sqrt(17) - ((sqrt(102)/sqrt(6) - sqrt(17)) + 0)*2)1 - (3 + (-2sqrt(1088) - sqrt(1088))). -3 + 25sqrt(17) Simplify sqrt(133)/(-4sqrt(63)) - ((sqrt(133)-3)/sqrt(7)-5)2. -4275 - sqrt(19)/12 Simplify ((2sqrt(90)2)/(-1(sqrt(180)/sqrt(9) + sqrt(5))))2. 32 Simplify 5 + ((sqrt(68) - ((-2 + sqrt(68))2 + 1)) + (-2sqrt(68) + sqrt(68) + sqrt(68))2-2)4. -287 + 40sqrt(17) Simplify (sqrt(28) - -3sqrt(252))/(-6sqrt(12)/sqrt(3)) - (-2 + sqrt(175) + sqrt(175) + (-1(sqrt(175) + 0) - sqrt(175))). -5sqrt(7)/3 + 2 Simplify (-2 + (-3 + sqrt(14)/sqrt(2) + sqrt(14)/sqrt(2) + 1)*2)-5 + 0. -150 + 40sqrt(7) Simplify (sqrt(36)/(sqrt(6) - (sqrt(216) + sqrt(216)1)))/((sqrt(162) - (sqrt(162) + sqrt(162)2))-4). -sqrt(3)/792 Simplify (sqrt(624)26)/(sqrt(588) - sqrt(588)-1). 12sqrt(13)/7 Simplify (-3-2sqrt(1715))/(-4sqrt(80)-3). 7sqrt(7)/8 Simplify (sqrt(16)/sqrt(324))/(sqrt(2)-3-6). sqrt(2)/162 Simplify ((sqrt(136) + (sqrt(136) - (sqrt(136) + sqrt(136)6 + sqrt(136))4) + sqrt(136))/(sqrt(88)/(sqrt(11) + sqrt(110)/sqrt(10))))2. 57188 Simplify ((1sqrt(480))/sqrt(2))/((sqrt(500) - 1sqrt(500) - sqrt(5))-4). sqrt(3) Simplify -16(4(-5 + 4 + sqrt(304) + -3))2. -30720 + 3072sqrt(19) Simplify 0 + 2 + 3(sqrt(832) + -2)6. -34 + 144sqrt(13) Simplify ((sqrt(165)/sqrt(3)1)/(sqrt(1617)/sqrt(3)))*2. 5/49 Simplify (-2 + 4 + 2sqrt(1700) + 2 + -3)*2. 40sqrt(17) + 6801 Simplify ((sqrt(100)4 - sqrt(4)) + sqrt(4) - sqrt(4))/(sqrt(20)/sqrt(1000)). 190sqrt(2) Simplify (6((sqrt(130) - sqrt(130)-1) + sqrt(130) + sqrt(130)) - sqrt(130))/(-1sqrt(90) - sqrt(90))-5 + 0. 115sqrt(13)/6 Simplify (sqrt(38) - sqrt(1368)4)/(sqrt(18)4)-1. 23sqrt(19)/12 Simplify (sqrt(187)1-1 + -5(sqrt(187) + -1sqrt(187)))/(-2(sqrt(66)/sqrt(2))/sqrt(3)). sqrt(17)/2 Simplify (((sqrt(405) + 1)44 + 1(sqrt(405) + sqrt(405) + sqrt(405)1 + sqrt(405))-4)-5)*2. 6400 Simplify ((sqrt(132) + ((sqrt(132) - sqrt(132)2 - sqrt(132) - sqrt(132)) + sqrt(132) + sqrt(132) - sqrt(132)))/sqrt(3) - -23sqrt(1100))1. 58sqrt(11) Simplify ((2 + 0 + sqrt(500)-2)2)*2 + 1. -320sqrt(5) + 8017 Simplify (sqrt(171) + 3sqrt(171)-2)/((sqrt(108) + sqrt(108)-4)/sqrt(12)). 5sqrt(19)/3 Simplify (sqrt(168) - (sqrt(168)2-5 - sqrt(168)))/(sqrt(150) + sqrt(150) + sqrt(150)2 + sqrt(150))-1. -24sqrt(7)/25 Simplify (-5 + sqrt(1216) + 0 + sqrt(1216))24-2. -39112 + 1280sqrt(19) Simplify 0 + 0 + (-4(sqrt(104) + (2sqrt(104) - sqrt(104))) + sqrt(104))/sqrt(8). -7sqrt(13) Simplify (5 + -4 + sqrt(539) + 1 + 1 + sqrt(539) + 0 + sqrt(539) + 5)2. 336sqrt(11) + 4915 Simplify sqrt(24)/(sqrt(300)-2 + sqrt(300)) - (-1sqrt(20)-4)/sqrt(10). -21sqrt(2)/5 Simplify (sqrt(133)/(sqrt(1050)/sqrt(6)) + (-53sqrt(228))/sqrt(12))*2. 104044/25 Simplify 6(sqrt(630)/(sqrt(10)2))/sqrt(9) + (sqrt(21)/sqrt(108) - (sqrt(7) - (sqrt(252) - 1sqrt(252)))). 13sqrt(7)/6 Simplify (sqrt(99) + -1 + 3 + -4 + -1sqrt(99) - (-1 + sqrt(99) + sqrt(99)-1 + 3))2. 16 Simplify (1 + (-1 + sqrt(833) + -5 + sqrt(833) - (sqrt(833) + sqrt(833) + sqrt(833) + 3 + -3 + sqrt(833))))2. 140sqrt(17) + 3357 Simplify (5(sqrt(84) + (sqrt(84)-3 - sqrt(84) - sqrt(84)))-6)/(4-2sqrt(588) + sqrt(588)). -120sqrt(7)/49 Simplify (sqrt(180)/(sqrt(144)-2))/(sqrt(800)/sqrt(5) - (-2sqrt(120) + sqrt(120) - sqrt(120))/sqrt(12)). -sqrt(2)/48 Simplify (-16-251sqrt(1088))2. 3916800 Simplify (sqrt(144)/sqrt(36))/sqrt(12) + sqrt(21)/(sqrt(7)-1)5. -14sqrt(3)/3 Simplify -6((-2sqrt(228))/sqrt(12)-3 + -5 + sqrt(171) + sqrt(19) + (sqrt(19) - (sqrt(228)/(sqrt(12)-2) + sqrt(19)))*2 + -2). -60sqrt(19) + 27/2 Simplify (sqrt(21) + ((sqrt(189)-2)/sqrt(9) - sqrt(21)))/(4sqrt(700))6. -3sqrt(3)/10 Simplify ((((sqrt(324) + 1sqrt(324) + sqrt(324))/sqrt(9) - sqrt(36)) + sqrt(1764)1)/(sqrt(1452)1 - (sqrt(108) + 1sqrt(108) + sqrt(12))))*2. 243/16 Simplify (((sqrt(110)3)/sqrt(5))/((4sqrt(121))/sqrt(11)))2. 9/8 Simplify -1((sqrt(20)/sqrt(4)5 - sqrt(5))2 - (2sqrt(405))*2) + -1 + 2sqrt(180) + -3. 12sqrt(5) + 1536 Simplify (sqrt(162) - (-31sqrt(162) + sqrt(162))2) + (1 + (sqrt(162) - -2sqrt(162)) - sqrt(162))*2 + 5 + (sqrt(162)2-6 - sqrt(162)) + -5. -72sqrt(2) + 1 Simplify ((sqrt(288) + sqrt(288)-1 + -5 + sqrt(288) - 2sqrt(288)-1) + -2)2. -504sqrt(2) + 2641 Simplify (-5 + -11sqrt(171) - (3(sqrt(95) - (sqrt(95) - ((-2sqrt(95) - sqrt(95)) + sqrt(95))) - sqrt(95)))/(sqrt(80)1))2. 15sqrt(19)/2 + 571/16 Simplify ((0 + sqrt(80))-6-15-2)*2. 288000 Simplify -1 + ((sqrt(1584)2 + -1 - (sqrt(1584) + 0)4)2 + 2)-6. -38035 - 288sqrt(11) Simplify 4(sqrt(117) - -2sqrt(117))-3 + (2sqrt(117) + 3 - ((1sqrt(117) + sqrt(117))*2 + -4)). -461 - 102sqrt(13) Simplify (-32sqrt(156) + (61sqrt(156) - sqrt(156)))/((sqrt(108) - (-1(2sqrt(108) + sqrt(108)) - sqrt(108)))/sqrt(9)). -sqrt(13)/5 Simplify (6(sqrt(104) + ((sqrt(104) + -1sqrt(104) - sqrt(104)) + sqrt(104) - sqrt(104) - sqrt(104)))6)/(3-2sqrt(968)). 6sqrt(13)/11 Simplify (4 + sqrt(320)1 + 0 - 4(-4 + -2sqrt(320) + sqrt(320))) + 4. 24 + 40sqrt(5) Simplify (4(sqrt(1188) + sqrt(33)))/(sqrt(132)/(sqrt(96)/sqrt(8))). 28sqrt(3) Simplify (12sqrt(84))/(sqrt(12) - (sqrt(12) + sqrt(12) + 4sqrt(84)/sqrt(7))). -2sqrt(7)/5 Simplify 64(-6(0 + sqrt(50) + sqrt(50)-1) + -5). -120 Simplify sqrt(49)/(sqrt(7) + sqrt(343)-3 + sqrt(7)) + (2sqrt(567) + sqrt(7))4. 1443sqrt(7)/19 Simplify -1(sqrt(28) - sqrt(112) - -5sqrt(63))*2 + -3. -1186 Simplify (4 + (2sqrt(11))*2)3 + 5 - ((-3sqrt(110))/sqrt(10) - sqrt(539)-1). -4sqrt(11) + 149 Simplify ((sqrt(2156)2 + sqrt(2156))-6)/((sqrt(36) + sqrt(4))5-3). 21sqrt(11)/10 Simplify 2 + (sqrt(108)/(sqrt(9) - (sqrt(9) + sqrt(27)/sqrt(3)5)))/((sqrt(324) + sqrt(324) + sqrt(324)-1 + sqrt(324) + sqrt(324))6). -sqrt(3)/810 + 2 Simplify (sqrt(170)24 + sqrt(170))/(sqrt(50)/(-4sqrt(5))). -36sqrt(17) Simplify (2 + 5(3 + sqrt(98) + sqrt(98)) + -6(2sqrt(24))/sqrt(12))*2. 1972sqrt(2) + 7017 Simplify -2((-4(-3 + sqrt(891) + (sqrt(891) - (sqrt(891) + -1sqrt(891)))))*2 + -2). -114332 + 3456	{ "pile_set_name": "DM Mathematics" }
ce. -39.4 Let z = -34.3725 - -37. Let s = z + -2.61. What is s rounded to three dps? 0.018 Let b = 33 + -31.01. Let w = b - 1.83. Round w to one dp. 0.2 Suppose -5j + 3f + 9173 = -2122, -2f = -3j + 6777. What is j rounded to the nearest 1000? 2000 Let x = 7442 + -7441.99292. What is x rounded to 5 dps? 0.00708 Let o = 465 + -460. Suppose t = 2s - 455999, -os + t = -765745 - 374254. What is s rounded to the nearest ten thousand? 230000 Let y be 10/(-4) - (-9)/(-6). Let w be (-8886)/4 - 6/y. Let r be 15/(-10)(0 + w/(-9)). Round r to the nearest 100. -400 Let s be (-45)/(-18)(-144)/(-15). Let z be s/84 - 67846/7. Let r = -6792 - z. Round r to the nearest one thousand. 3000 Suppose 3m - 18 = 6m. Let x be (5 - 7455/m)2/5. What is x rounded to the nearest 100? 500 Let j = 68 - 68.039. Let z = -0.039 + j. Let v = 0.07799941 + z. What is v rounded to seven dps? -0.0000006 Let z = -9013196.0901534 - -9013198. Let c = -1.91 + z. What is c rounded to 4 decimal places? -0.0002 Let d = 898114 - 898113.921402592. Let b = 0.0786 - d. Round b to seven dps. 0.0000026 Let b = 322034 + -322037.44881. Let r = b - -2.40898. Let g = 1.04 + r. Round g to four decimal places. 0.0002 Let z = 15731.3 + -17094.91. Let r = z - -1358. Let q = r - -0.71. Round q to the nearest integer. -5 Let n = -0.065 - 0.003. Let i = 38 + -38.04. Let a = n - i. Round a to 2 decimal places. -0.03 Let f = 28199964197.99999739 - 28199964713. Let l = 515 + f. Round l to six dps. -0.000003 Let z = 0.5053 + -0.50558272. Round z to 4 decimal places. -0.0003 Let d = -115910.747 - -115964. Round d to the nearest integer. 53 Suppose -2d = -10, -5u + 16412 = -d - 59933. What is u rounded to the nearest 1000? 15000 Let z = -44797.73 + 44397. Let m = 387 + z. Round m to 0 dps. -14 Let v = 70366.00000035293 - 70366. Round v to 7 decimal places. 0.0000004 Let f = 8871 + -8873.0426. What is f rounded to 1 decimal place? -2 Let u = -530948 - -877778. Round u to the nearest ten thousand. 350000 Suppose -5q - 5207505 = 5o, q - 5207470 = 5o - q. Let u = -4958504 + o. Round u to the nearest one million. -6000000 Let v = 46.64 - 46.0672. What is v rounded to two decimal places? 0.57 Let c = 0.228219613 + -0.228077. Round c to six decimal places. 0.000143 Let q = -15530 + 15529.992245. Round q to 3 dps. -0.008 Let z = -0.75 - -0.719. Let x = z + -0.369. Let o = -0.3998 - x. Round o to four dps. 0.0002 Suppose -3 = -j + 1. Suppose -2u + 4 = -j. Suppose -2w = uc + 18010, -3c + 3w + 13515 = -6c. Round c to the nearest one thousand. -5000 Let r(h) = 7052h2 + 41h + 20. Let a(c) = -3c3 - 17c*2 - 9c - 15. Let k be a(-5). Let p be r(k). Round p to the nearest one million. 3000000 Let f = -131.234 - -128.8. Let d = f + 2.44377. Round d to three decimal places. 0.01 Let y = 4691.3 + -4417. Let j = 272.971 - y. What is j rounded to one decimal place? -1.3 Let l be (24 - 10) + -2 + 31471988. Round l to the nearest 1000000. 31000000 Let k = 0 - -5. Suppose -kd = -3o - 3, -o + 5d = d + 8. Suppose -s - os = x - 864, 5s - 880 = -5x. Round s to the nearest one hundred. 200 Let q = 16608 - 16607.999984022. Round q to 5 dps. 0.00002 Let o = 1238.2504 - 0.2504. Let h = 1238.557 - o. Let c = h - 0.6001. What is c rounded to three dps? -0.043 Let n = 54 - 54. Suppose 9t - 59 - 49 = n. Let v be ((-8000)/t)/((-17283)/(-5760) - 3). What is v rounded to the nearest 100000? -1300000 Suppose -l = -5l + 426856. Suppose -4w + x - 1088566 = w, -2w = 4x + 435444. Let g = l + w. What is g rounded to the nearest ten thousand? -110000 Let f = -114.037 - -114.417011. Let v = 1.52 - 1.9. Let d = v + f. What is d rounded to five decimal places? 0.00001 Let q(j) = -4j*3 - 3j*2 - 2j. Let c be q(-1). Let k(r) = 1600022r - 66. Let l be k(c). Round l to the nearest one million. 5000000 Let p(h) = 4h + 23. Let n(y) = -y + 1. Let a(s) = 2n(s) + p(s). Let b be a(-11). Let m be -249996 - (b - 6 - -7). Round m to the nearest 100000. -300000 Let g = -0.016673 + 3.647973. Round g to two decimal places. 3.63 Let k = -105417.4 + 97268. What is k rounded to the nearest one hundred? -8100 Let y = 14693913.0663 + -14695137. Let z = 1224 + y. Round z to 2 dps. 0.07 Let u = -989.127 - -988. Let c = u + -0.203. Let w = c + 1.476. What is w rounded to two dps? 0.15 Let g = 194.0708 - 194. Let n = -0.0068 + g. Round n to 2 dps. 0.06 Let x be (-2)/(-6) + 9152300/(-114). Let m = -17383 - x. What is m rounded to the nearest one thousand? 63000 Let f = -1401717526055536542.999999416 - -1401717494430114224. Let r = f - -31625422454. Let p = 135 - r. Round p to seven decimal places. -0.0000006 Let o = 546.10003427 - 546.1. Round o to 6 dps. 0.000034 Let x = -297.5 - -297.3321. Round x to two dps. -0.17 Let h = -78365.120057 + 78372.12. Let z = -10 - -17. Let m = h - z. Round m to 5 dps. -0.00006 Suppose -393 + 379 = 2a, -236843993 = 6j - a. What is j rounded to the nearest 1000000? -39000000 Suppose 0 = -7t + 8t - 2. Suppose 3s - tb - 45 = 0, -3b - 28 = -s + 2b. Let h(d) = d2 - 9d + 21. Let a be h(s). Round a to the nearest 10. 70 Let o = 39.9 + -11. Let q = -120.1 - o. Let c = q + 149.268. What is c rounded to 2 dps? 0.27 Let s = -121.6909987 - -121.69. What is s rounded to 3 dps? -0.001 Suppose 15y + 45155943 = 22y. Let i = y + -9450849. What is i rounded to the nearest 100000? -3000000 Let p = -9558.5088 + 9561. What is p rounded to 1 decimal place? 2.5 Let s = 9086.009 + -9017.1. Let v = s + -70. What is v rounded to one decimal place? -1.1 Let o = 0.2392 + -0.2389883. What is o rounded to six decimal places? 0.000212 Let z be 2655/630 - (-9)/(-2) - 307310/14. What is z rounded to the nearest 1000? -22000 Let k = 12.28 - 1.58. Let r = k - 11.444. Round r to 1 dp. -0.7 Let a = -5964.9981196 + 5965. Round a to five dps. 0.00188 Let w = 65128896 + -115048896. Round w to the nearest 1000000. -50000000 Let y = 37670 + -34013.4. Round y to the nearest 10. 3660 Let g = 1399 - -797. Let n = g + -2195.99998661. What is n rounded to six dps? 0.000013 Suppose -391 + 163 = 19t. Let y be 6 + ((-6)/(-36) - (-65474)/t). Round y to the nearest 1000. -5000 Let y(o) = 186828o - 564. Let t be y(-37). Round t to the nearest 10000. -6910000 Suppose -1184634077 = 10f - 182534077. Round f to the nearest 1000000. -100000000 Let t = 1010.3 - 329.8. Let d = t - -150.5. Let r = d - 830.9999549. What is r rounded to 6 dps? 0.000045 Let q(z) = -886512z - 48. Let n be ((-20)/(-25))/(7/(-35)). Let r be q(n). What is r rounded to the nearest one hundred thousand? 3500000 Suppose 1737x + 6260 = 1727x. Round x to the nearest one thousand. -1000 Let k = 11033 + -16628. Let c = k - -5605.044. Let i = c - -0.256. Round i to 0 decimal places. 10 Let a(f) = 2f + 25. Let o be a(3). Let q be (19659 + o)/(2/(-2)1). What is q rounded to the nearest one thousand? -20000 Let j = 2448288.19914 - 2448042.2. Let n = j + -246. What is n rounded to 4 dps? -0.0009 Let i = 1871.467 - 1870. Let b = 0.047 - i. Let g = 2.153 + b. What is g rounded to one dp? 0.7 Suppose 2m - 3w - 35137 = 0, -5w + 87830 = -121m + 126m. Round m to the nearest 100. 17600 Suppose -6285504143 = -117r - 734907143. What is r rounded to the nearest 1000000? 47000000 Let a = 73 + -71. Suppose -3l = -3g - 15, 0 = 2l + al + g + 5. Suppose lk + 3n - 6360003 = 4k, -k - 1589995 = 5n. Round k to the nearest 100000. -1600000 Let b = 7645.672 - 7665. Round b to the nearest ten. -20 Suppose 104m - 105m + 6354285 = 0. Suppose -18k + m = -341715. What is k rounded to the nearest 10000? 370000 Let c be (-5 - -11 - 8) + 111. Suppose 105a - ca - 64 = 0. Round a to zero dps. -16 Let k = 2272.783 - 2272.70519613. Let u = -0.0778 + k. Round u to 6 dps. 0.000004 Let t be -1(1/(-2))/((-7)/(-14)). Let x be (-12)/(20/(-5)) + t. Suppose z - 19 - 19 = -a, -z + xa = -38. Round z to the nearest ten. 40 Let h be (-8)/(-10)345/23. Suppose -640 = hv - 8v. Round v to the nearest 100. -200 Let v = -413 - -424.06. Let l = v - -0.44. Let a = 11.50000167 - l. Round a to 6 dps. 0.000002 Let m = -9.14574595 - -9.146. What is m rounded to 4 decimal places? 0.0003 Let j = -7 - -5. Let s be (-1 - -3)/j*-1420571. Let x = -4520571 + s. Round x to the nearest one million. -3000000 Let o = -	{ "pile_set_name": "DM Mathematics" }
f sequence ahab. 1/1001 Calculate prob of sequence bkb when three letters picked without replacement from wzbkkkzkkwkzbww. 2/455 Two letters picked without replacement from rcfbavc. Give prob of sequence fr. 1/42 Two letters picked without replacement from {n: 2, z: 1, i: 1}. Give prob of sequence nn. 1/6 Two letters picked without replacement from {s: 7, l: 2, h: 1, y: 2}. Give prob of sequence lh. 1/66 Calculate prob of sequence uux when three letters picked without replacement from {w: 7, u: 3, x: 3}. 3/286 Calculate prob of sequence vh when two letters picked without replacement from vkveehvkoehefvv. 1/21 Calculate prob of sequence bkca when four letters picked without replacement from knabnbkcnkkkak. 1/1001 Four letters picked without replacement from {r: 1, t: 7, v: 7, f: 2, p: 1}. Give prob of sequence vvtv. 49/2448 Three letters picked without replacement from {a: 1, n: 1, u: 2, t: 1, m: 1, x: 1}. Give prob of sequence xnu. 1/105 Three letters picked without replacement from {h: 8, s: 2}. Give prob of sequence hhs. 7/45 Two letters picked without replacement from {w: 3, v: 5, g: 1, z: 4, j: 1, s: 6}. Give prob of sequence jw. 3/380 Calculate prob of sequence uf when two letters picked without replacement from igioffoioguufy. 3/91 What is prob of sequence ur when two letters picked without replacement from {r: 2, i: 2, u: 7}? 7/55 Four letters picked without replacement from {e: 6, p: 9, h: 1, a: 1}. What is prob of sequence peph? 9/1190 Four letters picked without replacement from {p: 6, v: 4}. Give prob of sequence pvvp. 1/14 Four letters picked without replacement from mjmmagmpzaapppj. Give prob of sequence pgaz. 1/2730 Calculate prob of sequence yly when three letters picked without replacement from hzzllyyzzy. 1/60 Three letters picked without replacement from {i: 8, e: 5}. What is prob of sequence eee? 5/143 Four letters picked without replacement from kkssssssfssfff. Give prob of sequence sfkf. 8/1001 Three letters picked without replacement from {q: 4, a: 2}. What is prob of sequence qaq? 1/5 Four letters picked without replacement from {k: 9, f: 5}. Give prob of sequence kkkk. 18/143 Two letters picked without replacement from {x: 1, c: 8, p: 3, q: 2, s: 5, t: 1}. What is prob of sequence pp? 3/190 Two letters picked without replacement from {o: 2, z: 1, k: 1, b: 1}. What is prob of sequence bz? 1/20 What is prob of sequence nnt when three letters picked without replacement from nsnsnsnnnsntnnnsnts? 110/2907 What is prob of sequence fppe when four letters picked without replacement from {p: 2, e: 1, f: 2}? 1/30 Calculate prob of sequence shsh when four letters picked without replacement from hssssshshh. 1/14 Two letters picked without replacement from aeaeeaaaaeeea. Give prob of sequence ea. 7/26 Four letters picked without replacement from mfyuyls. Give prob of sequence umsl. 1/840 Calculate prob of sequence ecz when three letters picked without replacement from wzzwczemzmcccm. 2/273 Calculate prob of sequence wuet when four letters picked without replacement from {w: 3, u: 3, t: 6, e: 3}. 9/1820 What is prob of sequence fff when three letters picked without replacement from {y: 3, f: 5, c: 1, e: 9}? 5/408 Three letters picked without replacement from {y: 1, i: 10, f: 3, m: 1, p: 2}. What is prob of sequence ifm? 1/136 What is prob of sequence lclm when four letters picked without replacement from pjpcupppppcpllcpppmp? 1/19380 What is prob of sequence ye when two letters picked without replacement from xjxexxjxjxjsxeyjxjx? 1/171 Calculate prob of sequence hch when three letters picked without replacement from {h: 7, o: 4, c: 7}. 49/816 Calculate prob of sequence xx when two letters picked without replacement from {o: 4, x: 2}. 1/15 Two letters picked without replacement from fmmffmfflmfffffffffm. Give prob of sequence ff. 91/190 Four letters picked without replacement from zzzz. What is prob of sequence zzzz? 1 Calculate prob of sequence xx when two letters picked without replacement from {x: 12, z: 1, j: 3}. 11/20 Calculate prob of sequence mjxq when four letters picked without replacement from {l: 1, m: 1, q: 1, x: 1, j: 1}. 1/120 Three letters picked without replacement from {v: 1, r: 3}. Give prob of sequence rrr. 1/4 Two letters picked without replacement from {w: 3, s: 1, b: 3, e: 1, z: 3, h: 2}. Give prob of sequence ze. 1/52 Calculate prob of sequence llll when four letters picked without replacement from llll. 1 Three letters picked without replacement from {b: 7, k: 1, t: 2, x: 2}. Give prob of sequence ttx. 1/330 What is prob of sequence xjpp when four letters picked without replacement from jpxpjppjjj? 1/84 What is prob of sequence uoqt when four letters picked without replacement from {q: 2, t: 4, o: 3, u: 1}? 1/210 What is prob of sequence jj when two letters picked without replacement from {u: 4, j: 5, t: 3, q: 1, b: 1}? 10/91 What is prob of sequence dcw when three letters picked without replacement from cdywdccyducdyd? 5/546 Four letters picked without replacement from {r: 6, w: 2, p: 11}. What is prob of sequence rpww? 11/7752 Calculate prob of sequence fj when two letters picked without replacement from {j: 5, s: 2, f: 2}. 5/36 Calculate prob of sequence iile when four letters picked without replacement from eieeiielic. 1/105 Calculate prob of sequence hyay when four letters picked without replacement from {h: 9, y: 6, a: 2}. 9/952 Three letters picked without replacement from qqhqhqq. Give prob of sequence hhq. 1/21 What is prob of sequence lswl when four letters picked without replacement from {l: 3, s: 10, w: 3, h: 3}? 5/2584 What is prob of sequence no when two letters picked without replacement from {e: 1, n: 1, o: 3}? 3/20 Three letters picked without replacement from iiihiiiiikikkkikk. Give prob of sequence ihi. 3/136 Three letters picked without replacement from siswwwsqqqwwwih. Give prob of sequence wih. 2/455 Two letters picked without replacement from gakaaglaaxnaak. What is prob of sequence gg? 1/91 What is prob of sequence wwwu when four letters picked without replacement from {u: 7, w: 9}? 21/260 What is prob of sequence jj when two letters picked without replacement from jjjhjjjjjhjjj? 55/78 What is prob of sequence owu when three letters picked without replacement from uowuwuwuwwo? 4/99 Calculate prob of sequence qy when two letters picked without replacement from yuyyyqqn. 1/7 What is prob of sequence tjt when three letters picked without replacement from jjttjt? 3/20 Two letters picked without replacement from byitibntyynbnisni. What is prob of sequence bs? 3/272 Four letters picked without replacement from {i: 3, a: 7, g: 2}. What is prob of sequence igii? 1/990 Four letters picked without replacement from {b: 5, k: 2, u: 4}. Give prob of sequence kubu. 1/66 Three letters picked without replacement from {v: 1, f: 1, x: 3, w: 1, h: 6}. What is prob of sequence xxv? 1/220 Calculate prob of sequence hg when two letters picked without replacement from ghv. 1/6 What is prob of sequence kkgk when four letters picked without replacement from gkpkpppkppkppppgpg? 1/1020 Calculate prob of sequence drr when three letters picked without replacement from {r: 6, d: 4, e: 2}. 1/11 Four letters picked without replacement from ctcuujutjutuuju. What is prob of sequence tctc? 1/2730 Calculate prob of sequence xru when three letters picked without replacement from xrxug. 1/30 What is prob of sequence mv when two letters picked without replacement from vdmvm? 1/5 Two letters picked without replacement from {z: 5, v: 3, c: 1}. What is prob of sequence vv? 1/12 Two letters picked without replacement from gimi. What is prob of sequence mg? 1/12 Three letters picked without replacement from {q: 2, w: 3, h: 5}. What is prob of sequence hqh? 1/18 Calculate prob of sequence ivi when three letters picked without replacement from {v: 6, i: 4, n: 2, l: 1}. 6/143 What is prob of sequence ww when two letters picked without replacement from jjjjjjwjw? 1/36 Calculate prob of sequence nb when two letters picked without replacement from bttn. 1/12 What is prob of sequence ppwp when four letters picked without replacement from {p: 10, w: 9}? 45/646 Three letters picked without replacement from {o: 1, v: 1, e: 2, m: 1}. Gi	{ "pile_set_name": "DM Mathematics" }
3235777? False Is 476455 a multiple of 253? False Is 59 a factor of 139168? False Is 634443 a multiple of 189? False Does 6 divide 22599? False Is 91 a factor of 555555? True Is 410675 a multiple of 6? False Does 223 divide 2233045? False Is 10571040 a multiple of 90? True Is 313537 a multiple of 498? False Does 2 divide 105003? False Is 1307955 a multiple of 152? False Does 32 divide 1488224? True Is 16 a factor of 829035? False Is 101 a factor of 128805? False Is 451731 a multiple of 439? True Is 51 a factor of 1029605? False Does 222 divide 76756? False Is 2254 a factor of 35239036? True Is 246 a factor of 215451? False Is 98 a factor of 178948? True Does 2 divide 2150? True Is 2173 a multiple of 62? False Does 14 divide 103194? True Is 14 a factor of 272748? True Is 2 a factor of 166944? True Is 6029368 a multiple of 54? False Is 54 a factor of 177552? True Does 13 divide 131402? False Is 21 a factor of 148445? False Is 30992 a multiple of 8? True Is 24 a factor of 611928? True Is 434754 a multiple of 52? False Is 8496957 a multiple of 119? True Is 110517 a multiple of 6? False Does 1134 divide 17728848? False Is 270 a factor of 2522070? True Is 51 a factor of 110042? False Is 2837240 a multiple of 70? True Is 844062 a multiple of 13? False Is 212 a factor of 184864? True Is 12325 a multiple of 85? True Is 308574 a multiple of 126? True Is 18 a factor of 3555990? True Does 187 divide 248710? True Is 785539 a multiple of 11? False Does 64 divide 988288? True Is 355186 a multiple of 17? False Is 144704 a multiple of 238? True Is 466 a factor of 1200636? False Is 625 a factor of 5227913? False Is 13 a factor of 4788736? False Is 5921208 a multiple of 108? True Is 550575 a multiple of 25? True Does 5 divide 500995? True Is 117728 a multiple of 50? False Is 673 a factor of 1895651? False Does 70 divide 404088? False Does 13 divide 18237? False Is 175 a factor of 3620575? True Is 5 a factor of 7076062? False Does 40 divide 476800? True Is 236 a factor of 122484? True Is 21 a factor of 2730? True Is 34 a factor of 7559968? True Does 10 divide 1036109? False Does 78 divide 259363? False Is 45 a factor of 1624277? False Does 10 divide 5281532? False Does 6 divide 708952? False Does 21 divide 13458767? False Is 381 a factor of 316583? False Does 637 divide 3947057? False Is 66 a factor of 10804855? False Is 496 a factor of 5110288? True Does 56 divide 354982? False Is 6 a factor of 52179? False Does 214 divide 7350900? True Is 56 a factor of 76675? False Is 235983 a multiple of 75? False Is 4 a factor of 773726? False Is 2740289 a multiple of 23? True Does 87 divide 155556? True Is 3851680 a multiple of 95? True Is 27 a factor of 2544191? False Does 52 divide 325318? False Is 363947 a multiple of 4? False Is 3267570 a multiple of 255? True Is 1027 a multiple of 14? False Is 187540 a multiple of 8? False Does 63 divide 145089? True Does 6 divide 623430? True Is 54459 a multiple of 57? False Is 12332925 a multiple of 55? True Does 159 divide 6678739? False Is 21874 a multiple of 74? False Is 2 a factor of 32887? False Does 6 divide 262538? False Does 18 divide 3095442? True Does 218 divide 86110? True Is 192 a factor of 8068723? False Is 492030 a multiple of 447? False Is 37 a factor of 369191? False Does 8 divide 2105584? True Is 168 a factor of 731136? True Is 35163 a multiple of 6? False Does 4 divide 9952? True Does 6 divide 106794? True Is 1149571 a multiple of 18? False Does 4 divide 175932? True Does 1528 divide 2923589? False Is 10065431 a multiple of 11? False Is 540 a factor of 492997? False Is 97593 a multiple of 185? False Does 358 divide 218663? False Is 35 a factor of 145963? False Is 74980 a multiple of 2? True Does 5 divide 7525? True Is 17 a factor of 49032? False Does 1124 divide 17143248? True Does 96 divide 174208? False Does 45 divide 743535? True Is 11 a factor of 17687? False Is 11 a factor of 133804? True Does 45 divide 57960? True Does 134 divide 1072627? False Is 1886 a multiple of 40? False Is 2155527 a multiple of 11? True Is 32 a factor of 18017408? True Is 94064 a multiple of 15? False Is 124850 a multiple of 11? True Is 10 a factor of 2291921? False Is 110476 a multiple of 47? False Is 1425236 a multiple of 587? True Does 704 divide 1169344? True Is 428298 a multiple of 38? True Is 4 a factor of 33451? False Is 726311 even? False Is 865685 a multiple of 16? False Is 207765 a multiple of 285? True Is 125 a factor of 2554679? False Is 3956030 a multiple of 13? True Is 12 a factor of 308360? False Is 4 a factor of 37090? False Is 80 a factor of 6012743? False Is 8207542 a multiple of 1003? False Is 20 a factor of 32554? False Is 200623 a multiple of 457? True Does 211 divide 427807? False Does 46 divide 220450? False Is 17865672 a multiple of 111? True Does 37 divide 1726700? False Is 6014281 a multiple of 7? True Is 3754850 a multiple of 202? False Is 18 a factor of 354888? True Is 84 a factor of 7370991? False Is 60 a factor of 820260? True Does 44 divide 497068? True Is 13850 a multiple of 10? True Is 1355829 a multiple of 3? True Is 10 a factor of 858604? False Is 26235 a multiple of 11? True Does 13 divide 69485? True Is 18413778 a multiple of 1318? True Is 110790 a multiple of 18? True Is 16 a factor of 1742496? True Does 39 divide 34203? True Does 95 divide 7532550? True Is 35832 a multiple of 6? True Does 373 divide 2699? False Is 441 a factor of 424321? False Is 15 a factor of 4121355? True Is 11257 a multiple of 9? False Is 83 a factor of 1463486? False Is 129 a factor of 1914360? True Is 380354 a multiple of 21? False Is 13 a factor of 81185? True Does 22 divide 351911? False Is 177 a factor of 2520303? True Is 32 a factor of 20478720? True Does 16 divide 2782? False Is 183 a factor of 1816458? True Is 10 a factor of 368400? True Is 286273 even? False Is 199 a factor of 154109? False Does 65 divide 234917? False Is 533589 a multiple of 21? True Is 87353 a multiple of 21? False Is 1642155 a multiple of 20? False Is 1615 a multiple of 3? False Does 29 divide 2841191? False Is 31 a factor of 25069? False Does 4 divide 274224? True Is 94763 a multiple of 4? False Is 5 a factor of 1071390? True Is 617 a factor of 4799173? False Is 665364 a multiple of 14? True Does 9 divide 134449? False Is 25 a factor of 21617? False Is 41 a factor of 290526? True Does 811 divide 3784937? True Is 8178864 a multiple of 695? False Is 75 a factor of 546558? False Is 42 a factor of 179886? True Does 21 divide 6636504? True Does 47 divide 256604? False Is 4498046 a multiple of 70? False Does 815 divide 3767745? True Is 129 a factor of 9285936? True Is 1149000 a multiple of 100? True Does 203 divide 28014? True Is 13 a factor of 6960811? True Is 1316 a factor of 1817391? False Does 294 divide 128478? True Is 17 a factor of 1458482? False Is 311832 a multiple of 426? True Is 204443 even? False Is 17 a factor of 901608? False Is 760306 a multiple of 13? False Is 5203994 a multiple of 258? False Is 822465 a multiple of 7? True Is 9122715 a multiple of 35? True Is 31736 a multiple of 4? True Does 80 divide 328584? False Is 46 a factor of 147338? True Does 15 divide 1297075? False Is 185142 a multiple of 354? True Does 9 divide 248886? True Is 1280720 a multiple of 40? True Is 44625 a multiple of 125? True Does 11 divide 2567628? False Is 51707 a multiple of 135? False Does 610 divide 4682360? True Does 17 divide 2278493? True Is 5338674 a multiple of 33? True Is 703033 a multiple of 20? False Does 13 divide 2986399? True Is 753 a factor of 2659596? True Is 1782744 a multiple of 236? True Is 8698950 a multiple of 15? True Is 69930 a multiple of 15? True Is 74 a factor of 707074? False Is 28 a factor of 11819052? True Is 73796 a multiple of 10? False Does 336 divide 886704? True Is 36 a factor of 803699? False Is 32184 a multiple of 8? True Is 82 a factor of 1006304? True Does 170 divide 6909650? True Does 63 divide 14741629? False Does 159 divide 473025? True Is 1630246 a multiple of 494? False Does 34 divide 2992454? False Is 74 a factor of 128986? False Is 262620 a multiple of 5? True Is 14 a factor of 100928? False Is 42892 even? True Does 8 divide 161552? True Is 488 a factor of 6884704? True Does 39 divide 6457269? True Does 596 divi	{ "pile_set_name": "DM Mathematics" }
162809, 221591, 289399? -c*3 + 4534c*2 - 33c - 1 What is the h'th term of -95981, -95967, -95953, -95939, -95925? 14h - 95995 What is the y'th term of -962, -970, -982, -998, -1018, -1042? -2y*2 - 2y - 958 What is the t'th term of 171, 572, 1165, 1896, 2711, 3556, 4377? -9t3 + 150t*2 + 14t + 16 What is the p'th term of 10119, 20152, 30185, 40218? 10033p + 86 What is the a'th term of 1143, 1101, 1025, 909, 747? -a3 - 11a*2 - 2a + 1157 What is the b'th term of -115, -148, -177, -202? 2b2 - 39b - 78 What is the g'th term of 18, 52, 100, 162, 238, 328? 7g2 + 13g - 2 What is the h'th term of 10736, 10892, 11048, 11204, 11360? 156h + 10580 What is the g'th term of 1701, 3392, 5085, 6780, 8477? g2 + 1688g + 12 What is the g'th term of -155638, -311275, -466910, -622543, -778174, -933803, -1089430? g*2 - 155640g + 1 What is the s'th term of -8, 291, 916, 2029, 3792, 6367, 9916, 14601? 27s3 + s2 + 107s - 143 What is the c'th term of 1001, 1975, 2947, 3917, 4885? -c*2 + 977c + 25 What is the h'th term of 185, 208, 205, 170, 97? -h*3 - 7h*2 + 51h + 142 What is the y'th term of -906, -1210, -1514, -1818, -2122? -304y - 602 What is the c'th term of -161, -621, -1361, -2387, -3705, -5321? -c3 - 134c*2 - 51c + 25 What is the m'th term of -2394, -4816, -7258, -9726, -12226, -14764, -17346, -19978? -m*3 - 4m*2 - 2403m + 14 What is the j'th term of -2810, -2800, -2790, -2780, -2770, -2760? 10j - 2820 What is the a'th term of -557166, -2228671, -5014512, -8914689? -557168a2 - a + 3 What is the a'th term of 1443, 1478, 1499, 1500, 1475, 1418? -a3 - a*2 + 45a + 1400 What is the m'th term of 2046, 8166, 18372, 32670, 51066, 73566, 100176? m*3 + 2037m*2 + 2m + 6 What is the d'th term of -858, -850, -864, -912, -1006, -1158, -1380? -2d3 + d2 + 19d - 876 What is the k'th term of 146, 1635, 5680, 13559, 26550? 213k3 - 2k - 65 What is the m'th term of -33745, -33855, -33965, -34075, -34185? -110m - 33635 What is the d'th term of 23, 152, 519, 1244, 2447, 4248, 6767? 20d3 - d2 - 8d + 12 What is the c'th term of -3808, -7631, -11454, -15277, -19100? -3823c + 15 What is the a'th term of 24, 30, -84, -408, -1032, -2046? -15a3 + 30a*2 + 21a - 12 What is the n'th term of 15, -412, -839, -1266, -1693, -2120? -427n + 442 What is the t'th term of -41300, -41304, -41308, -41312? -4t - 41296 What is the o'th term of 1664, 1694, 1786, 1970, 2276, 2734, 3374, 4226? 5o3 + o2 - 8o + 1666 What is the q'th term of 4697, 9409, 14113, 18803, 23473, 28117, 32729, 37303? -q*3 + 2q*2 + 4713q - 17 What is the w'th term of -26503, -53005, -79507? -26502w - 1 What is the x'th term of -157395, -157380, -157355, -157320, -157275? 5x*2 - 157400 What is the y'th term of 200, 821, 1852, 3293, 5144, 7405, 10076? 205y*2 + 6y - 11 What is the k'th term of 199567, 199568, 199569, 199570, 199571, 199572? k + 199566 What is the d'th term of 393957, 393958, 393959, 393960? d + 393956 What is the o'th term of -122000, -122001, -122002, -122003? -o - 121999 What is the y'th term of -591, -1200, -1815, -2436? -3y2 - 600y + 12 What is the h'th term of 7548, 7499, 7448, 7395? -h*2 - 46h + 7595 What is the i'th term of 35978, 71953, 107922, 143885, 179842, 215793? -3i2 + 35984i - 3 What is the c'th term of 393, 409, 437, 477, 529, 593? 6c2 - 2c + 389 What is the n'th term of -4156, -4449, -4742, -5035, -5328? -293n - 3863 What is the n'th term of -983, -1959, -2935, -3911, -4887? -976n - 7 What is the v'th term of 59, 89, 137, 209, 311, 449? v*3 + 3v*2 + 14v + 41 What is the i'th term of 62793, 62792, 62791? -i + 62794 What is the s'th term of -817, -1660, -2503, -3346, -4189, -5032? -843s + 26 What is the l'th term of 480, 956, 1442, 1944, 2468, 3020, 3606? l3 - l2 + 472l + 8 What is the l'th term of -4075, -8138, -12201, -16264? -4063l - 12 What is the t'th term of 408, 769, 1012, 1077, 904? -10t3 + t2 + 428t - 11 What is the i'th term of 5869, 11735, 17601, 23467, 29333, 35199? 5866i + 3 What is the x'th term of 205, 641, 1349, 2329, 3581, 5105, 6901? 136x2 + 28x + 41 What is the x'th term of 1520, 6126, 13800, 24536, 38328, 55170, 75056? -x*3 + 1540x*2 - 7x - 12 What is the m'th term of 263, 791, 1565, 2585? 123m2 + 159m - 19 What is the x'th term of -57781, -115551, -173321, -231091? -57770x - 11 What is the a'th term of 84714, 84712, 84710, 84708, 84706, 84704? -2a + 84716 What is the j'th term of -1158, -4623, -10398, -18483, -28878, -41583? -1155j2 - 3 What is the l'th term of -1317, -2494, -3671, -4848, -6025, -7202? -1177l - 140 What is the f'th term of 122, 257, 384, 503, 614, 717, 812? -4f2 + 147f - 21 What is the b'th term of 322, 566, 782, 964, 1106? -b*3 - 8b*2 + 275b + 56 What is the y'th term of 53, 162, 339, 584, 897, 1278, 1727? 34y2 + 7y + 12 What is the s'th term of 1003, 3988, 8969, 15952, 24943? s*3 + 992s*2 + 2s + 8 What is the v'th term of -17642, -35286, -52930, -70574, -88218, -105862? -17644v + 2 What is the z'th term of -44, -106, -184, -278? -8z*2 - 38z + 2 What is the g'th term of -677718, -677713, -677708, -677703, -677698? 5g - 677723 What is the g'th term of 1463, 1477, 1491, 1505, 1519, 1533? 14g + 1449 What is the i'th term of -3841, -4137, -4431, -4723, -5013, -5301? i*2 - 299i - 3543 What is the t'th term of 906, 1816, 2728, 3642, 4558? t*2 + 907t - 2 What is the s'th term of 714, 926, 1122, 1296, 1442, 1554, 1626, 1652? -s*3 - 2s*2 + 225s + 492 What is the r'th term of 19425, 77671, 174757, 310689, 485473, 699115, 951621, 1242997? r*3 + 19414r*2 - 3r + 13 What is the v'th term of 204, 327, 450, 573? 123v + 81 What is the h'th term of 340525, 681044, 1021559, 1362070, 1702577? -2h*2 + 340525h + 2 What is the o'th term of -1423, -2850, -4275, -5698, -7119, -8538, -9955? o*2 - 1430o + 6 What is the c'th term of 13527, 13542, 13557? 15c + 13512 What is the t'th term of -606336, -606337, -606338? -t - 606335 What is the f'th term of 8754, 8747, 8718, 8655, 8546, 8379, 8142, 7823? -2f3 + f2 + 4f + 8751 What is the q'th term of 3637, 7250, 10863, 14476? 3613q + 24 What is the f'th term of 3456, 3469, 3482, 3495? 13f + 3443 What is the v'th term of -354, -384, -440, -528, -654, -824, -1044, -1320? -v3 - 7v*2 - 2v - 344 What is the t'th term of -437, 593, 1623? 1030t - 1467 What is the f'th term of -2995, -3003, -3021, -3055, -3111, -3195? -f3 + f2 - 4f - 2991 What is the c'th term of 133, 159, 203, 265, 345, 443, 559? 9c2 - c + 125 What is the l'th term of -864976, -864977, -864978, -864979, -864980? -l - 864975 What is the p'th term of -648, -1143, -1486, -1677, -1716? 76p*2 - 723p - 1 What is the s'th term of 1394, 1465, 1674, 2099, 2818, 3909, 5450, 7519? 13s3 - 9s*2 + 7s + 1383 What is the s'th term of 4312, 8184, 12056, 15928? 3872s + 440 What is the w'th term of 56654, 113309, 169966, 226625, 283286, 339949? w2 + 56652w + 1 What is the s'th term of 22431, 22433, 22435, 22437? 2s + 22429 What is the t'th term of 40, 113, 288, 607, 1112, 1845? 7t*3 + 9t*2 - 3t + 27 What is the o'th term of -3226, -3067, -2642, -1819, -466, 1549, 4358? 22o3 + o2 + 2o - 3251 What is the o'th term of -10094, -10097, -10100, -10103, -10106? -3o - 10091 What is the x'th term of -2286, -4494, -6702? -2208x - 78 What is the v'th term of -2130, -2139, -2152, -2169, -2190, -2215, -2244? -2v2 - 3v - 2125 What is the c'th term of 120, 137, 166, 207, 260, 325, 402? 6c2 - c + 115 What is the w'th term of -1041, -1857, -2673, -3489, -4305, -5121? -816w - 225 What is the h'th term of 200, 656, 1382, 2384, 3668, 5240, 7106, 9272? h*3 + 129h*2 + 62h + 8 What is the a'th term of 10162, 10175, 10188? 13a + 10149 What is the p'th term of 37731, 150922, 339573, 603684, 943255? 37730p*2 + p What is the z'th term of 2245, 16442, 54977, 130018, 253733, 438290, 695857? 2028z3 + z2 - 2z + 218 What is the u'th term of 15147, 15118, 15089, 15060, 15031? -29u + 15176 What is the j'th term of 59547, 59559, 59585, 59631, 59703, 59807, 59949? j3 + j2 + 2*j + 59543 What is the p'th term of -4025, -15935, -35791, -63599, -99365, -143095, -194795, -2	{ "pile_set_name": "DM Mathematics" }
ive. x(171/10) Simplify ((o/(o1/o))/((oo(1/4))/oo))(-2/81) assuming o is positive. o(1/162) Simplify (c*(4/15)c*(7/4))/((c(c/(c/(c((cc/c*(-1))/c)/c)))/c)/(cc/(c*(-17)c)ccc)) assuming c is positive. c(1261/60) Simplify (vvvv*(-23))/(vv/(v*(5/2)vv)v)v/(vvv/v(-1/23)vv)v/((vv(v*(-16)v)/v)/v) assuming v is positive. v(-301/46) Simplify (h(2/23))(-6/13)/(h38hh(2/145)) assuming h is positive. h(-1693183/43355) Simplify r(1/2)/(r/r(-1))(r/(r(2/7)r))(-7) assuming r is positive. sqrt(r) Simplify (z8)*6(zz(11/5)z)/(zz(z/(z/((zz23zz)/z)))/zz) assuming z is positive. z(126/5) Simplify ((l(1/8))50)(-3/5) assuming l is positive. l(-15/4) Simplify l(-1)/(l*(1/11)/ll)l(20/7)/(l12/l) assuming l is positive. l(-711/77) Simplify ((rr*(1/2)r)(-14)/(r1)(7/6))(-41) assuming r is positive. r*(8897/6) Simplify (xx*(-2/5)/xxx)3/(xx*(-3/2)xx(((xx(-13)x)/xx)/x)/x) assuming x is positive. x(163/10) Simplify g(10/3)g*18(g8/g)/g13 assuming g is positive. g*(46/3) Simplify ll*(2/59)(l(ll*(-2/9)l)/l)/ll/l(2/5)l(-13) assuming l is positive. l(-28112/2655) Simplify ((pp/p10pp/p(1/2)ppp)/(p/p*(1/6)p(3/2)))(-1/15) assuming p is positive. p(7/18) Simplify ((k/((k/(k(3/7)k)k)/k))/k)/(k*6/k)k(-10/9)/k(1/4) assuming k is positive. k(-1495/252) Simplify ((y1/y)*(-1/11)y/(y(y/(y/(y(4/3)/y))y)/y)y/(y/y1)y)3 assuming y is positive. y5 Simplify (((((s/s*36)/s)/s)/ss)/(ss/(s(-13)/ss)ss))40 assuming s is positive. s(-2160) Simplify ((p*(-13)/p)/pp*(-2/15))/(pp*4p/(((p/(((p/(p/(p*(9/4)/p)))/p)/pp))/p)/pp)) assuming p is positive. p(-1283/60) Simplify ((q4qq)/q(2/7))/(q(2/21)/q4) assuming q is positive. q(202/21) Simplify (x(-17)/x)(17/4)(x/(x/x27))/x21 assuming x is positive. x(-141/2) Simplify (s(-3)((((((s(3/5)/s)/s)/s)/s)/ss)/s)/s)/(((s*(-3/8)s)/s)/s(s/s(-1/9))/s) assuming s is positive. s(-2569/360) Simplify (w(2/53)/((w(-4/13)w)/w))(-35) assuming w is positive. w(-8330/689) Simplify (bbb(2/3))(-4/7)((b(bbbb(3/5)b)/b)/b)3 assuming b is positive. b(974/105) Simplify ((t*(-12)t)/(t/(t/(tt/(t/(tttt*(-2/49)/tt)))t)))/(t1)(-16/3) assuming t is positive. t(-1268/147) Simplify w(-28/9)/ww*24/w(ww(3/8)w)36 assuming w is positive. w(1879/18) Simplify (r(1/11)/r(-23))(-26/5) assuming r is positive. r(-6604/55) Simplify ((u/u*(1/3))/u)/uu(u/(u/((u4u)/u)))/u(u/u(-1))(12/5) assuming u is positive. u(112/15) Simplify ((vv/v*(-5/4)v)/v(vv*5)/vv)/((v/((v(-10)/v)/v))/(v2/v)) assuming v is positive. v(-11/4) Simplify p(-10/11)p(3/2)pp(p/(pp/p(1/4)p))/p17 assuming p is positive. p(-711/44) Simplify (c/c*(-2/93)cc(2/21))(2/3) assuming c is positive. c(2756/1953) Simplify (t/(t/(t/t24)))(-4/5)/((tttt*(2/9))/(ttt30)) assuming t is positive. t(2123/45) Simplify ((gg(-4/7))/(g/((g(-2/51)/g)/g)g))(-12/7) assuming g is positive. g(5156/833) Simplify (l(7/6))(-50)(l(-1/8))(-1/53) assuming l is positive. l*(-74197/1272) Simplify (mm*(3/16)m)/m*(8/7)(mm(2/7))(-14) assuming m is positive. m(-1899/112) Simplify l(-3)/(((ll/l*13l)/l)/l)l(-6)/l(-3) assuming l is positive. l6 Simplify hh/(((h/h*(-1)h)/hh)/h)hh(-28/3)(h/(hh28))(-5/2) assuming h is positive. h(185/3) Simplify (a(-2/41)/(a(a/(aa/a(2/45)))/a))(4/19) assuming a is positive. a(6692/35055) Simplify (z(-18)/((zz*(-8)z)/zz))/(z/((zz*(-2/17)/z)/z)z4) assuming z is positive. z(-308/17) Simplify (n(4/3)/n(4/7)(n(-5)n)/((nn/(nn/(nn(5/4))))/n))(-5) assuming n is positive. n(1885/84) Simplify ((ii/i*14i)(1/9))(-4/5) assuming i is positive. i(44/45) Simplify (a(-2/29))*1(a*4/aa)(-43) assuming a is positive. a(-4990/29) Simplify ((dd(-1/4))/(d/d9)(d/(dd(1/4)d))(-5/2))(-26) assuming d is positive. d(-1235/4) Simplify (m(-3/4)m)34/(mm(-2/7))14 assuming m is positive. m(-3/2) Simplify (u(-5/3))(-15)/(u(-10/11)/(u/(u/(u*(-1)uu)))) assuming u is positive. u(296/11) Simplify (i/((iii(-4)i)/i))(-4/7)/(i(-13)i(i*12i)/i) assuming i is positive. i(-12/7) Simplify ((f/(f(-2)/fff)(f(4/5)/f)/ff)(-5/3))1 assuming f is positive. f(-3) Simplify (l(-3))(2/103)/(l(1/11)l4) assuming l is positive. l(-4701/1133) Simplify (h/h(4/5)hh7)/(h(4/5)h(2/53)/h) assuming h is positive. h(2216/265) Simplify ((bb(1/5)(b*2bbb)/b)/(b*(-2/9)b(2/7)/b))(-11/6) assuming b is positive. b(-21263/1890) Simplify ((b3b)(-48/7)(bb/(b/b7))/bb/(bb/(bb/((b*(-2/17)b)/b)b))b)(6/19) assuming b is positive. b(-12360/2261) Simplify (kk5)(1/23)/(k(-21/8)k/(k/k*(1/31)k)) assuming k is positive. k(21981/5704) Simplify (p/p(1/5))0/((p(-4/3)/p)/pp(9/8)p) assuming p is positive. p(29/24) Simplify ((x(3/2)/x4)/(x7x(x/(x/x(-1/4)))/x))14 assuming x is positive. x(-259/2) Simplify (b(-5/12)/(bb(-3/23)))/((bb(bb3)/b)/(b(-25)/b)) assuming b is positive. b*(-8911/276) Simplify (m/(mm/(mm(m/(mmm/(mm(1/6))))/mmmm)))(-38)/(m(-10)/(mm(-2/9))) assuming m is positive. m(-644/9) Simplify (w(-23/2)/ww(1/6)/w)/(w(-15/4)w(3/17)) assuming w is positive. w(-1991/204) Simplify ((nn*(-2/7)nn(-6))3)(4/7) assuming n is positive. n(-360/49) Simplify ff*(2/13)ff(-3)(f/((f/(ff(-2/37))f)/f))/f(ff(-7))/f assuming f is positive. f(-3800/481) Simplify ((w/(w/(w(w/(wwww/(ww/w6)ww)w)/www)w))/(w(-19)w))/((w*(8/3)w)/w15) assuming w is positive. w(67/3) Simplify ((pp/p0p)*(18/5)p*(-5/3)p(p(p(-7/3)/p)/p)/p)(-13) assuming p is positive. p(-377/5) Simplify (a/(a/(a/(((a/a(1/2))/a)/a)a))(a*(-3/2)a)/aa(-6/5)aa3a)(-23/3) assuming a is positive. a(-667/15) Simplify (o(-2/21))(-2)o(3/7)oo(-10) assuming o is positive. o(-176/21) Simplify (u/(uu*(-19)u)uu(u(u(uu/(u*19u))/u)/u)/u)/((u(-9)/u)/u)(-1) assuming u is positive. u*(-10) Simplify (ll(2/17)/l)/l(-2/5)l(1/5)/(lll(2/5)) assuming l is positive. l(-143/85) Simplify p(-3/19)/pp*0(p*(-2)p)(-26) assuming p is positive. p(472/19) Simplify (i(i/(i(-14)/ii))/i)/i*(-2/33)i(6/7)/i(-13) assuming i is positive. i(6680/231) Simplify (t0/((t*(1/10)/t)/t)t*(-5)t11)(1/19) assuming t is positive. t(79/190) Simplify (q(-3/2)q(-14/9))/(q28/qq/(qq(-5)qq)) assuming q is positive. q(-595/18) Simplify ((z(-1/4))(-30)(z(-2/3))(5/3))(-11/2) assuming z is positive. z(-1265/36) Simplify ((t(2/93)/t)/t(-36))/(t*(8/5)/((tttt/t*(4/35)tt)/t)) assuming t is positive. t(24938/651) Simplify nn*6n*(-2/7)/n((n*1/n)/n)/(n/((nn*(5/6)/n)/n)n) assuming n is positive. n(107/42) Simplify (o(-4)oo(3/7))(27/5) assuming o is positive. o*(-486/35) Simplify ((vvv/v(-4)vvv)/vvv/v*(3/13)v)/(vv/(v/v(-1/3)))(-1/36) assuming v is positive. v(8275/702) Simplify (v(2/9)/v(2/31)v*4vvv(1/4))(-39) assuming v is positive. v(-92963/372) Simplify k(3/19)/k*(1/5)(k(1/3))18 assuming k is positive. k(566/95) Simplify f/f(-10)ff*(7/4)f(ff/(f*10f))/(ff5) assuming f is positive. f(-1/4) Simplify (h/(hh*(-1)hh))/((hh*(-14/5))/h)h*(-19)/(hhhh(19/5)) assuming h is positive. h(-24) Simplify (x*16/((x/(xx(x(-6/7)/x)/x))/x))/(xx*22xx)(-11) assuming x is positive. x(2031/7) Simplify (rr(-2/25))(2/15)r(-9/4)/(r(1/10)r) assuming r is positive. r(-4841/1500) Simplify x(-1/5)/(xx(4/3)/x)(xx(2/23))(9/14) assuming x is positive. x(-4031/4830) Simplify pp*(-8)p/(p/(p/p*(3/4)))(p/p(-4/13))/(p/(p/p(-3))p) assuming p is positive. p(-179/52) Simplify k(1/7)(k/k*(-4/13)k)/kk/k(14/9)k29 assuming k is positive. k(24484/819) Simplify ((zz(-3))/zz)(-1/19)/(z(-9/7)/z2) assuming z is positive. z(451/133) Simplify (x((x*(	{ "pile_set_name": "DM Mathematics" }
s -31322 - 1021? -33003 In base 11, what is -2680 + 129? -2552 In base 9, what is 2385427 + 0? 2385427 In base 5, what is 42133404 - -3? 42133412 In base 8, what is -322160 - 5? -322165 In base 10, what is 19242 - -50? 19292 In base 3, what is 12000102 + 10? 12000112 In base 3, what is -12002212122 + -100? -12002212222 In base 16, what is -7 + 18a4? 189d In base 13, what is -71 + -241? -2b2 In base 12, what is -5 + -2808? -2811 In base 6, what is 405 - -220? 1025 In base 3, what is 21100122102 + 11? 21100122120 In base 16, what is -8 + -eaa7? -eaaf In base 9, what is -85 - -304? 208 In base 14, what is b - 27208? -271db In base 14, what is -34538 - 4? -3453c In base 16, what is 2134a4 + 1? 2134a5 In base 8, what is 153 - -51? 224 In base 12, what is 49 + 150a? 1557 In base 16, what is -3 + 68dfd? 68dfa In base 7, what is -235 - 3336? -3604 In base 11, what is -2 + -7226? -7228 In base 13, what is -1 + -28596? -28597 In base 7, what is -2 - -44341? 44336 In base 11, what is 948a7 + 8? 94904 In base 3, what is -10220 + 1112? -2101 In base 3, what is 11 + 1011220120121? 1011220120202 In base 10, what is 4867 + 40? 4907 In base 4, what is 2 + 200211302? 200211310 In base 7, what is -452 + 242? -210 In base 8, what is -315273 + 5? -315266 In base 9, what is -2 + 482750? 482747 In base 14, what is 7 - ad1a? -ad13 In base 7, what is 13 + 36232? 36245 In base 5, what is -412210 - 10? -412220 In base 3, what is 0 - -12220122222? 12220122222 In base 15, what is -1 + -13881d? -13881e In base 16, what is 69 - a9? -40 In base 4, what is 2 + 13130011? 13130013 In base 12, what is 53a9a + -18? 53a82 In base 15, what is -3535 + -12? -3547 In base 10, what is 5130 - -16? 5146 In base 12, what is -1137 - -1122? -15 In base 11, what is -47495 + 4? -47491 In base 3, what is 1210022222 - 11? 1210022211 In base 6, what is -1054413 - -31? -1054342 In base 6, what is -2 + -202013? -202015 In base 3, what is -1 + 1012011200? 1012011122 In base 16, what is -1b - 737? -752 In base 3, what is 1022 + -110022210? -110021111 In base 7, what is -55 + -4651? -5036 In base 2, what is -100 + -111010111? -111011011 In base 3, what is 10221011 - -22001? 11020012 In base 7, what is 2056 + -4132? -2043 In base 3, what is 12012022 + 1? 12012100 In base 12, what is 2690 + a? 269a In base 11, what is -183755 - 4? -183759 In base 4, what is 320133 - 31? 320102 In base 16, what is -89e2 - -4a? -8998 In base 16, what is 9e - -6c? 10a In base 9, what is -68705 + -5? -68711 In base 15, what is -3 - 3da22? -3da25 In base 6, what is -42100 - -203? -41453 In base 7, what is 42555 + 2? 42560 In base 3, what is -10 - -10211222201? 10211222121 In base 11, what is 11 + 25049? 2505a In base 16, what is 49261 + -1? 49260 In base 7, what is -124 - 15616? -16043 In base 16, what is 7 - 144b? -1444 In base 11, what is -25705 - -3? -25702 In base 15, what is 12e81 - -2? 12e83 In base 3, what is -12 - -120120110? 120120021 In base 12, what is -5 + 3346? 3341 In base 2, what is -1 - 110000110010100001? -110000110010100010 In base 10, what is -8 + 52662? 52654 In base 4, what is -30112113 - -20? -30112033 In base 11, what is -3a307 - -41? -3a276 In base 2, what is 110000101010 + 100100? 110001001110 In base 3, what is 101 + 222120? 222221 In base 3, what is 2 - -20211002? 20211011 In base 8, what is -131351 + 5? -131344 In base 13, what is 75 + 91? 136 In base 2, what is 11101110101 - -111011110? 100101010011 In base 12, what is 13 - -b5a? b71 In base 11, what is -4 - aaa3? -aaa7 In base 2, what is 1000111100110111010 + 1? 1000111100110111011 In base 12, what is 9 + -a988? -a97b In base 10, what is 8119 - -5? 8124 In base 15, what is -37d5b + 9? -37d52 In base 7, what is 62013 + -4? 62006 In base 10, what is -2 - -30606? 30604 In base 7, what is -6262 + -2013? -11305 In base 13, what is -5885 - 4? -5889 In base 12, what is 86 + 1353? 1419 In base 3, what is 10 + 121201012220? 121201020000 In base 14, what is 5312a - -2? 5312c In base 3, what is 10111 - 22110? -11222 In base 16, what is 15 + -272a? -2715 In base 16, what is -488 - 22? -4aa In base 7, what is 1 + -264320? -264316 In base 13, what is 53a9a + -13? 53a87 In base 8, what is -14 + 1027237? 1027223 In base 15, what is 1d4 - 5a? 179 In base 6, what is -3404 - 1203? -5011 In base 6, what is -1 - 2300154? -2300155 In base 9, what is -3 - 6131? -6134 In base 3, what is -2200220100 - 1? -2200220101 In base 10, what is -5 + -102049? -102054 In base 13, what is -463c + 4? -4638 In base 7, what is -2313 - -45? -2235 In base 12, what is -9518 - 20? -9538 In base 6, what is 2132305 + -4? 2132301 In base 11, what is -21 - 66033? -66054 In base 16, what is -2 - 1aa3d? -1aa3f In base 4, what is -12 - 2123230? -2123302 In base 4, what is -110 + -3002313? -3003023 In base 10, what is -17786 + -52? -17838 In base 14, what is -893d4 + -1? -893d5 In base 9, what is -423 + 23? -400 In base 10, what is 88567 - 1? 88566 In base 11, what is -5 - -7629? 7624 In base 14, what is da + -232? -136 In base 11, what is -33779 + -1? -3377a In base 12, what is 240 - -85? 305 In base 12, what is -7 + 1852a? 18523 In base 8, what is -326221 - 17? -326240 In base 8, what is 21073 - 47? 21024 In base 8, what is -57 - -56213? 56134 In base 8, what is -477 + 21033? 20334 In base 6, what is 5 - 5214501? -5214452 In base 8, what is 53 - -21565? 21640 In base 2, what is -101 - 1001001111001000? -1001001111001101 In base 9, what is -5 + 37530? 37524 In base 5, what is 23213 - -1301? 30014 In base 9, what is 3 - -12541? 12544 In base 9, what is -3234 - -28? -3205 In base 13, what is 8bacc9 - -1? 8bacca In base 6, what is 14 - -104301? 104315 In base 16, what is 274f - 242? 250d In base 10, what is -1049 - -990? -59 In base 12, what is -b - -341? 332 In base 15, what is 1 + -ca47? -ca46 In base 11, what is 0 + 203025? 203025 In base 5, what is 312434223 + 4? 312434232 In base 16, what is 18 + 15? 2d In base 11, what is 0 + -475aa9? -475aa9 In base 10, what is 19 - 2141? -2122 In base 3, what is -1112 - 12210? -21022 In base 7, what is -2 + 644235? 644233 In base 8, what is -115231 + -11? -115242 In base 2, what is 10101001000001000 - 10? 10101001000000110 In base 14, what is 6 + 55ad? 55b5 In base 9, what is 1648311 + 3? 1648314 In base 2, what is 11010 + 111111101001011? 111111101100101 In base 13, what is 4 - -23449c? 2344a3 In base 9, what is -53 + -757? -821 In base 2, what is -1010101100 + 1001010? -1001100010 In base 6, what is 10012234 + -5? 10012225 In base 4, what is 10 - -111123332? 111130002 In base 6, what is -1 - 220535? -220540 In base 12, what is -631 + -1193? -1804 In base 2, what is -1 + 100100010111110? 100100010111101 In base 15, what is a - -280d6? 280e1 In base 14, what is -a9 + b52? a87 In base 10, what is 9752 + 95? 9847 In base 4, what is 13 - -221230103? 221230122 In base 5, what is 102400 + -41? 102304 In base 16, what is -74ad + 6? -74a7 In base 13, what is -11 - -6706? 66c5 In base 9, what is -2438162 - 0? -2438162 In base 9, what is -350 + 2728? 2368 In base 4, what is -2 - 100001311? -100001313 In base 7, what is 24 + 121135? 121162 In base 6, what is -1335 - -1014? -321 In base 11, what is -11 - 3512? -3523 In base 9, what is 4 + 487117? 487122 In base 6, what is 3 + 2035334? 2035341 In base 14, what is 5 - -c1d14? c1d19 In base 3, what is -11221122 + -12022? -12010221 In base 16, what is -1fc02 + -5? -1fc07 In base 3, what is -111212 + -2122? -121111 In base 7, what is -106 + -445? -554 In base 12, what is 1 + -306430? -30642b In base 13, what is 159a + b? 15a8 In base 13, what is -485 - -312? -173 In base 5, what is 10304002 + -4? 10303443 In base 3, what is 10102 + -210020? -122211 In base 5, what is 2 - -40204020? 40204022 In base 16, what is -461 - -9? -458 In base 14, what is 1 - 5cd4? -5cd3 In base 4, what is -11 + -1012300033? -1012300110 In base 8, what is 520 - -6236? 6756 In base 8, what is 7 + -1101750? -1101741 In base 9, what is 36217 + -2? 36215 In base 13, what is -28752 - 63? -287b5 In base 14, what is -15b60 - 4? -15b64 In base 4, what is 102221303320 - 1? 102221303313 In base 15, what is 1542 - 2? 1540 In base 13, what is 43534b - 4? 435347 In base 11, what is -3 - 107299? -1072a1 In base 12, what is 4 + 20452? 20456 In base 6, what i	{ "pile_set_name": "DM Mathematics" }
millions digit of 805770965? 8 What is the hundreds digit of 323066367? 3 What is the thousands digit of 47424876? 4 What is the thousands digit of 1725790413? 0 What is the hundreds digit of 2274501311? 3 What is the thousands digit of 6364758? 4 What is the hundreds digit of 28711888? 8 What is the units digit of 14383573? 3 What is the ten thousands digit of 2938974133? 7 What is the hundred thousands digit of 417680507? 6 What is the tens digit of 128611847? 4 What is the tens digit of 82845913? 1 What is the ten millions digit of 564383241? 6 What is the millions digit of 72901979? 2 What is the billions digit of 2838258157? 2 What is the hundred thousands digit of 83492265? 4 What is the hundred thousands digit of 5028733881? 7 What is the hundred millions digit of 496572094? 4 What is the ten millions digit of 4076390804? 7 What is the units digit of 5088902? 2 What is the millions digit of 5048972? 5 What is the ten thousands digit of 48778599? 7 What is the millions digit of 7138166? 7 What is the thousands digit of 18213706? 3 What is the hundred millions digit of 691638645? 6 What is the thousands digit of 15504753? 4 What is the thousands digit of 5182596998? 6 What is the tens digit of 2367088059? 5 What is the ten millions digit of 1277861444? 7 What is the ten thousands digit of 121644928? 4 What is the hundred thousands digit of 5833835171? 8 What is the hundred thousands digit of 28870601? 8 What is the ten millions digit of 82091968? 8 What is the units digit of 324428335? 5 What is the millions digit of 2374378706? 4 What is the hundreds digit of 1375033407? 4 What is the hundreds digit of 267303213? 2 What is the units digit of 62634818? 8 What is the tens digit of 803889488? 8 What is the hundreds digit of 78577266? 2 What is the billions digit of 2264140572? 2 What is the hundred thousands digit of 845676224? 6 What is the ten millions digit of 31719360? 3 What is the ten thousands digit of 2212342932? 4 What is the hundred thousands digit of 1084884592? 8 What is the tens digit of 89317326? 2 What is the ten thousands digit of 2801030029? 3 What is the thousands digit of 725258600? 8 What is the thousands digit of 555888431? 8 What is the hundred millions digit of 4034362802? 0 What is the tens digit of 78667908? 0 What is the thousands digit of 1612721047? 1 What is the hundreds digit of 86974594? 5 What is the thousands digit of 27564919? 4 What is the millions digit of 123016741? 3 What is the billions digit of 6621431322? 6 What is the millions digit of 89974972? 9 What is the hundred millions digit of 339297977? 3 What is the tens digit of 37251126? 2 What is the ten millions digit of 671913367? 7 What is the thousands digit of 288491452? 1 What is the ten thousands digit of 154260679? 6 What is the thousands digit of 258125249? 5 What is the ten millions digit of 28280598? 2 What is the thousands digit of 511334453? 4 What is the units digit of 461425046? 6 What is the tens digit of 70197137? 3 What is the units digit of 196741629? 9 What is the ten millions digit of 47573831? 4 What is the units digit of 117172670? 0 What is the hundred thousands digit of 407900510? 9 What is the ten thousands digit of 3499833201? 3 What is the hundred thousands digit of 146951680? 9 What is the ten thousands digit of 2561696094? 9 What is the hundred millions digit of 2144919222? 1 What is the units digit of 452532143? 3 What is the tens digit of 410681849? 4 What is the ten thousands digit of 145652433? 5 What is the ten millions digit of 1139097445? 3 What is the units digit of 676430449? 9 What is the hundreds digit of 93938227? 2 What is the hundreds digit of 79781268? 2 What is the hundred millions digit of 147880307? 1 What is the ten thousands digit of 1059179338? 7 What is the hundreds digit of 399016729? 7 What is the hundred thousands digit of 1821976006? 9 What is the units digit of 39476310? 0 What is the thousands digit of 110574922? 4 What is the units digit of 27333089? 9 What is the hundreds digit of 81585077? 0 What is the ten thousands digit of 4779858431? 5 What is the hundred millions digit of 816512247? 8 What is the thousands digit of 2786122894? 2 What is the thousands digit of 12718378? 8 What is the hundreds digit of 570858322? 3 What is the thousands digit of 4845187727? 7 What is the units digit of 133060054? 4 What is the millions digit of 170363888? 0 What is the ten thousands digit of 2145410271? 1 What is the units digit of 2416346633? 3 What is the ten thousands digit of 10304385? 0 What is the ten thousands digit of 240567276? 6 What is the hundred thousands digit of 4371006118? 0 What is the hundreds digit of 4403559570? 5 What is the ten millions digit of 53673886? 5 What is the hundred millions digit of 799389955? 7 What is the ten thousands digit of 1495347600? 4 What is the ten thousands digit of 529246221? 4 What is the hundred thousands digit of 595710489? 7 What is the millions digit of 1379273169? 9 What is the hundred thousands digit of 48942732? 9 What is the tens digit of 265087854? 5 What is the units digit of 55295059? 9 What is the millions digit of 840939138? 0 What is the millions digit of 116207001? 6 What is the ten thousands digit of 201195829? 9 What is the billions digit of 1104240213? 1 What is the hundred millions digit of 635704755? 6 What is the hundreds digit of 96119662? 6 What is the hundreds digit of 3871460692? 6 What is the tens digit of 161327549? 4 What is the ten thousands digit of 2251136537? 3 What is the thousands digit of 4217630462? 0 What is the ten thousands digit of 961081873? 8 What is the ten thousands digit of 129246584? 4 What is the hundreds digit of 1236312099? 0 What is the thousands digit of 118500205? 0 What is the ten thousands digit of 265929436? 2 What is the ten thousands digit of 43162756? 6 What is the millions digit of 1292182159? 2 What is the millions digit of 1339711384? 9 What is the thousands digit of 535739189? 9 What is the tens digit of 359417792? 9 What is the millions digit of 34441693? 4 What is the units digit of 1055631315? 5 What is the ten thousands digit of 58875710? 7 What is the tens digit of 76603707? 0 What is the tens digit of 83179743? 4 What is the billions digit of 1106755177? 1 What is the millions digit of 335890505? 5 What is the millions digit of 144952301? 4 What is the ten thousands digit of 2326104718? 0 What is the billions digit of 7528676882? 7 What is the hundred millions digit of 920896292? 9 What is the hundred thousands digit of 271153910? 1 What is the millions digit of 4331996257? 1 What is the hundred millions digit of 712543868? 7 What is the hundred thousands digit of 197215890? 2 What is the units digit of 121250578? 8 What is the ten thousands digit of 1028137536? 3 What is the millions digit of 143687085? 3 What is the millions digit of 71366781? 1 What is the hundred thousands digit of 805762371? 7 What is the hundreds digit of 432513125? 1 What is the ten thousands digit of 672388241? 8 What is the billions digit of 2529917033? 2 What is the units digit of 141313120? 0 What is the hundred thousands digit of 560474596? 4 What is the ten thousands digit of 172530472? 3 What is the hundred thousands digit of 39006813? 0 What is the billions digit of 2836251427? 2 What is the ten thousands digit of 493607154? 0 What is the hundred thousands digit of 82200263? 2 What is the units digit of 59994624? 4 What is the units digit of 1596178168? 8 What is the billions digit of 5509262076? 5 What is the hundred thousands digit of 98642959? 6 What is the tens digit of 854013352? 5 What is the units digit of 947418715? 5 What is the hundreds digit of 3082481118? 1 What is the ten thousands digit of 40526966? 2 What is the billions digit of 1626160471? 1 What is the thousands digit of 105192200? 2 What is the tens digit of 36639326? 2 What is the thousands digit of 57304380? 4 What is the ten millions digit of 19293854? 1 What is the tens digit of 31149370? 7 What is the ten millions digit of 82122485? 8 What is the thousands digit of 34910573? 0 What is the ten millions digit of 657472409? 5 What is the ten millions digit of 70321453? 7 What is the ten thousands digit of 28181215? 8 What is the million	{ "pile_set_name": "DM Mathematics" }
rounded to the nearest one hundred thousand? 1300000 Suppose 6x = x + 4b + 148, 3x - 90 = 3b. Let g = -4 + x. Let k be 64792/g - 1/(-3). What is k rounded to the nearest one thousand? 3000 Let z = -0.63 + -24.37. Let p = 24.9999918 + z. Round p to six dps. -0.000008 Let f = 46.0661009 + -0.0752009. Let z = -29 + -17. Let o = z + f. Round o to 3 decimal places. -0.009 Let f = 55.3000301 - 55.3. What is f rounded to 6 decimal places? 0.00003 Let r = -37244871 - 141317305. Let x = -178562206.9999981 - r. Let p = x - -31. What is p rounded to 6 dps? 0.000002 Let g = 34 - 33.99999945. What is g rounded to 7 dps? 0.0000006 Let u = 1.08821 - -112785.91179. Let q = 112786.9880079 - u. Let c = -0.012 - q. Round c to 6 dps. -0.000008 Let t be (-8)/40 + (-11)/(-5). Suppose 0 = -3n - 3a - 42899985, -tn - 3a = 35050298 - 6450313. Round n to the nearest one million. -14000000 Let d = -42775409366380340.70000094 + 42775409986082979. Let x = -619702645 + d. Let k = x + 6.7. What is k rounded to 7 decimal places? -0.0000009 Let p = 224435561.94123 - 224430757. Let b = 4784.04 - p. Let g = -20.9 - b. Round g to 4 decimal places. 0.0012 Let p = -473791.90163 - -473846.9. Let b = 55.063 + -0.063. Let a = b - p. Round a to 4 decimal places. 0.0016 Suppose 2z - 2x + 7 + 21 = 0, -3x = -z - 10. Let q = z - 58. Round q to the nearest 10. -70 Let v = 5.9 + 0.1. Let g = v - 6.00003. What is g rounded to five dps? -0.00003 Let g = -2 + 2. Suppose r + 3r = g. Suppose r = 2f - 0f + 148000. Round f to the nearest 10000. -70000 Let b = 470 - -1539. Suppose -q + b = -g, q = 2g + g + 2007. Suppose 0 = -7o + 4o - q. Round o to the nearest 100. -700 Let c = 67433103.99999955 - 67433106. Let o = -2 - c. What is o rounded to 7 dps? 0.0000005 Let f = -40.91 - 0.09. Let l = 40.99885 + f. Round l to 4 dps. -0.0012 Let a = 16 + -16. Round a to 1 dp. 0 Suppose 3h = 2281939 + 10812644. Let o be 2874863 - 6/(-1 + 4). Let w = o - h. Round w to the nearest one hundred thousand. -1500000 Suppose -m + 5o - 13550 = 0, -57977 = 4m - 5o - 3822. Let p = m - -7635. Round p to the nearest 1000. -6000 Suppose -20 = 4v, 5l - 3v = -2v + 1050005. Round l to the nearest ten thousand. 210000 Suppose 3u = -5a - 142693 + 742684, -5a + 600012 = -4u. Round a to the nearest 1000000. 0 Let h = -90 + 94.1. Let z = 4.0981 - h. What is z rounded to three decimal places? -0.002 Let r = 9536365 + -9536364.88100047. Let a = -2.36 - -2.241. Let j = r + a. Round j to seven dps. -0.0000005 Let x(s) = -878570s - 20. Let c be x(14). What is c rounded to the nearest one million? -12000000 Let s = -20 - -20.88. Let x = -0.98734 + 1.8682. Let v = x - s. Round v to 4 decimal places. 0.0009 Let o = -23.0808 - -10.9914. Let k = 12.1 + o. Round k to three dps. 0.011 Let t = 5373 + -5373.16926. Let v = -24 + 23.83. Let z = t - v. What is z rounded to four decimal places? 0.0007 Let q = -18.99999987 + 19. Round q to 7 decimal places. 0.0000001 Let r(p) be the third derivative of 53p4/2 - p3/3 + 3p*2. Let o be r(-2). Let m = 784 + o. Round m to the nearest one hundred. -500 Suppose -647 = 5y - 4q - 211, -q + 87 = -y. Let l = y - -52. Round l to the nearest ten. -40 Let n = -29 - -29.00256. What is n rounded to four dps? 0.0026 Let c(m) = 423m*2 - 12m - 11. Let i be c(-7). What is i rounded to the nearest 1000? 21000 Let m = -21819.253 + 36.253. Let i = 21779.1966 + m. Let y = 3.8 + i. What is y rounded to 3 decimal places? -0.003 Let r = -1.02 - 23.48. Let k = r - 84.5. Let l = k - -108.9893. What is l rounded to three decimal places? -0.011 Let n = -0.21 - -0.2. Let s = -0.01012 - n. Round s to four dps. -0.0001 Suppose 0 = -15g + 18g - 3270. What is g rounded to the nearest 100? 1100 Let h = -8 + 14. Let i = 6.0066 - h. What is i rounded to 3 dps? 0.007 Suppose 0f + 5f - 20 = 0. Let b be ((-124)/(-5))/(f/(-20)). What is b rounded to the nearest ten? -120 Suppose -5q = -0q - 350. Let f = q + -34. What is f rounded to the nearest 10? 40 Let m = 7.86 + 0.14. Let y = 42424 + -42431.9994. Let i = m + y. What is i rounded to 3 decimal places? 0.001 Let f = 0.3999981 + -0.4. What is f rounded to 6 dps? -0.000002 Let d(j) = -217495j + 14. Let h(i) = i + 1. Let q(w) = -d(w) + 6h(w). Let z be q(8). Round z to the nearest 100000. 1700000 Let l = -7314.565 + 7307.965114. Let z = l - -6.6. Round z to five decimal places. 0.00011 Let o = -33 - -48. Let j = o + 11. Let n = j - 39.5. What is n rounded to 0 dps? -14 Let b = 9.28 + -0.128. Let x = b - 9.3. What is x rounded to 2 decimal places? -0.15 Suppose z = -5c + 27467106 + 40532893, -4c + 3z = -54400003. Round c to the nearest 1000000. 14000000 Let w = -8060236 - -8060232.9999995. Let q = 27 - 30. Let n = q - w. Round n to six dps. 0.000001 Let i = 2 + -1. Let b = i - 0.95. Let f = b + -0.050112. Round f to five decimal places. -0.00011 Let h = 283.6 - 246. What is h rounded to the nearest integer? 38 Suppose 5b - 2b - 4d = -539980, 2d + 360010 = -2b. What is b rounded to the nearest 100000? -200000 Let v = 47368 - 47361.0007. Let k = 24 + -17. Let n = k - v. What is n rounded to three decimal places? 0.001 Let f = -9876651 + 23276651. What is f rounded to the nearest one million? 13000000 Let z = -85 + 142. Round z to the nearest 10. 60 Suppose 0o - 5r = -4o + 254395, -3o + 190795 = -5r. Let b be o/18(16 - 1). What is b rounded to the nearest ten thousand? 50000 Let s = 31689034268 + -31689034460.00000123. Let u = 231 - 39. Let q = s + u. Round q to 7 dps. -0.0000012 Let t be -1 - 18/4-9377778. Round t to the nearest one million. 42000000 Let p = 0.14 - -0.04. Let f = 0.1799963 - p. Round f to six decimal places. -0.000004 Let k = -9.447 - -9.88. What is k rounded to two dps? 0.43 Let r = 2871498.01985 - 2871220. Let c = -278 + r. Let u = -0.02 + c. Round u to four dps. -0.0002 Let k = 72 + -95.6. Let n = k - -23. What is n rounded to the nearest integer? -1 Let w = -0.120068 + 0.12. Round w to 5 dps. -0.00007 Let h(m) = -m3 + 5m*2 + 6m + 4. Let q be h(6). Let b = 20059 + -12267. Suppose -r + f = 2598, 3r - qf = -0f - b. Round r to the nearest one thousand. -3000 Let j = 0.37 - 0. Let w = -0.36943 + j. Round w to four dps. 0.0006 Let g = -1.876 + 0.136. Round g to 1 dp. -1.7 Let f = 93 + -93.61. Let s = 0.09 - f. Let r = 0.688 - s. Round r to 3 decimal places. -0.012 Suppose -p - 23093 = -g - 3998, -19085 = -g + 3p. Round g to the nearest one thousand. 19000 Let j = 0.3 + -0.25. Round j to 2 decimal places. 0.05 Let i = 1.21 - 0.39. Let g = -0.08 - i. Let s = g + 0.90000056. Round s to seven dps. 0.0000006 Let x = -2.6 - -3. Let o = x + -0.312. Round o to two decimal places. 0.09 Let i = -72.1228 - -0.0228. Let g = i + 14.1. Let l = g + 57.999977. What is l rounded to 5 dps? -0.00002 Let a = 1413042.47080157 + 511.52814843. Let w = -1413521 + a. Let g = 33 - w. What is g rounded to four decimal places? 0.0011 Let c = -11.5 + 15. Let p = c + -109.5. Let t = p + 106.106. Round t to 2 dps. 0.11 Let l be ((-1449)/(-12))/((-2)/48). Let m be (-3)/(-3) - l - -1. Round m to the nearest 1000. 3000 Let v = 2.91 + 3.45. Let t = 5.84 - 6. Let p = t + v. What is p rounded to zero dps? 6 Let k = 9513.8 - 11215. Let t = k + 1701.000112. Let p = 0.2 + t. Round p to 5 decimal places. 0.00011 Let s = 264 + -264.00000282. Round s to 7 decimal places. -0.0000028 Let t(a) = 34a2 - 2a + 4. Let g(p) = -p + 12. Suppose 27 = 3f + 3. Let w be g(f). Let m be t(w). What is m rounded to the nearest 100? 500 Let z = 152 + -151.9947. Round z to three decimal places. 0.005 Let c = -0.080384 + 0.08. Round c to five decimal places. -0.00038 Let g = 26 - 28. Let b = -1.99952 - g. What is b rounded to four dps? 0.0005 Let q = -0.16 - 65.84. Let r = 65.695 + q. Let a = r + 0.24. What is a rounded to 2 dps? -0.07 Let f = 41.000088 - 41. What is f rounded to five decimal places? 0.00009 Let r = 446.347 + -448. Let y = 0.027 - r. What is y rounded to one dp? 1.7 Let q = 13.37 - 13. Let f = 0.34 - -0.06. Let t = q - f. Round t to 2 dps. -0.03 Let f = -43.999945 + 44. What is f rounded to 5 dps? 0.00006 Suppose 575052 = 3p + 660. Let a = 82464 - p. Round a to the nearest ten thousand. -110000 Let h be -3 + (-2)/(2/(-85133747)). Suppose -5*k = -4	{ "pile_set_name": "DM Mathematics" }
113p3 - 7p*2 wrt p? 6np2 + 339p*2 - 14p What is the second derivative of -2b4 + 57b*2 + b + 1? -24b*2 + 114 Differentiate 22cg2 + 182cx + 2g*2x - 2g2 - 2gx - 28x wrt c. 22g2 + 182x What is the second derivative of 39k2v*2 - 23kv2 wrt k? 78v*2 Find the third derivative of 536s*3 + 305s*2. 3216 Find the second derivative of -911s*4 - s + 80 wrt s. -10932s*2 Differentiate -295il3 - 5il2 + 2il + 3908l*3 wrt i. -295l*3 - 5l*2 + 2l What is the second derivative of -u*4y - 276u3y - 3uy - 18y wrt u? -12u*2y - 1656uy What is the second derivative of -b*5o - 98b3do2 - 418bd - bo*2 wrt b? -20b*3o - 588bdo2 What is the third derivative of 58h*3p*2q - 2h3p*2 - 3h*2pq + hq + 3p2q - 4p wrt h? 348p*2q - 12p2 What is the second derivative of -3k*4 - 33k*2 + 59k? -36k2 - 66 What is the derivative of 2s*2 + 595s + 5859 wrt s? 4s + 595 Find the third derivative of -498m*6 + 2m*4 - 371m*2. -59760m*3 + 48m Find the first derivative of 16717t3u - 427t3 - 3t - 3 wrt u. 16717t3 Find the second derivative of 135m*3 + 10m*2 - 2m - 95. 810m + 20 What is the first derivative of 5gi2 - 102gi + 11i*2 - 2i wrt g? 5i2 - 102i What is the second derivative of -722a3 - 7973a wrt a? -4332a What is the second derivative of 276u*5 + 2u*4 - u - 4526? 5520u*3 + 24u2 What is the third derivative of -p6 - 21p4 - p2 - 2p + 454? -120p3 - 504p What is the second derivative of 4s5u + 235s5 - 2913su wrt s? 80s*3u + 4700s3 Find the second derivative of -619u*2 + 455u. -1238 Find the first derivative of -2965g - 11063. -2965 What is the first derivative of -346r*2 + 272? -692r Find the third derivative of 2k3n*3 + 5k*3n + 2k2n*2 + 135kn4 + 2n*2 wrt n. 12k*3 + 3240kn What is the third derivative of 1341o*6 - 136o*2 + 1 wrt o? 160920o*3 Find the third derivative of -5kmq*4 - 21kmq*3 + 3kmq + 2kq*4 + k + 78mq2 + 2mq wrt q. -120kmq - 126km + 48kq Differentiate -4157m3 - 2973 wrt m. -12471m*2 What is the first derivative of -630w + 4398? -630 Differentiate -819h - 1387 with respect to h. -819 Find the second derivative of -36v*4 - 305v wrt v. -432v2 What is the third derivative of -3j*2s*6 - 329j*2s4 + j2s2 + 46j*2s + 2j wrt s? -360j*2s*3 - 7896j*2s What is the first derivative of 234a3s + 99a3 - 2a wrt s? 234a3 Find the third derivative of -5w*6 - 2w*4 + 413w*3 + 6663w*2 + 2w + 1. -600w3 - 48w + 2478 What is the third derivative of -3nw*6 - 174nw4 + 5nw2 - 2nw - 10n + w*2 wrt w? -360nw3 - 4176nw What is the third derivative of 50b*5 - 19b*3 - 6753b*2? 3000b*2 - 114 Find the third derivative of -17357b*4 + 12792b*2. -416568b Find the third derivative of -72f6 + 18f*2. -8640f*3 Differentiate 77x*4 + 133 wrt x. 308x*3 Differentiate 30asu*3y + 3asu + 2au + 91ay - a + sy - 2u3 wrt s. 30au3y + 3au + y Find the second derivative of -212n3 + 346n. -1272n Find the second derivative of -h3 + 48h*2 - 3h - 71 wrt h. -6h + 96 Find the second derivative of 2j*2l*3 + 1186j*2l*2 - 8j*2l - jl - 21l wrt l. 12j2l + 2372j2 What is the second derivative of 78n*2t*3v4 - n2tv + 2nv*4 - 228t*3 wrt v? 936n*2t*3v*2 + 24nv2 What is the second derivative of 699t*2 + t - 847 wrt t? 1398 Differentiate 220a*3k + 297a3 wrt k. 220a*3 Find the third derivative of -14487p*6 - 147p*2 + 6p + 3. -1738440p3 What is the second derivative of 253l*2v + lv + 3v wrt l? 506v Find the third derivative of 11n*5 - 3n*4 + 13n*3 - 14698n*2 wrt n. 660n*2 - 72n + 78 Find the third derivative of 581d4 - d3m - 2d2m + d*2 - 790dm + 2d wrt d. 13944d - 6m What is the third derivative of -n*4 - 159n*3 - 113n*2? -24n - 954 Find the third derivative of -7s6 - 2s*3 - 131s*2. -840s*3 - 12 What is the second derivative of 24k*5 - 2k*3r - 3kr + 4k + r wrt k? 480k*3 - 12kr What is the first derivative of 60f*2 + 15 wrt f? 120f Find the second derivative of 24f3o*3 + 3f*3o - f*2o*4 - 198f*2o - 10o2 wrt o. 144f*3o - 12f2o*2 - 20 Find the third derivative of 1123os3 - 3os2 + 2os + 897o - 5s3 wrt s. 6738o - 30 What is the second derivative of -175u3 + 254u? -1050u What is the second derivative of 22224m*2s*3 + 54ms3 - 36ms wrt m? 44448s3 What is the third derivative of c3hx*3z + 192c3hx + 2chx*2 - chxz + 21hx*3z + 2hxz + 5x*3z wrt x? 6c3hz + 126hz + 30z Find the third derivative of 175w6 + 8w*2 - 49w. 21000w3 What is the first derivative of 658u*4x*3 + 4u*4 + 466x*3 + 3x*2 wrt u? 2632u*3x*3 + 16u*3 What is the second derivative of 5q5 + q4 + 12q2 + 157q + 2? 100q3 + 12q*2 + 24 Find the second derivative of -72q*3t*2 + 2q3 + t2 + 54t wrt t. -144q*3 + 2 What is the derivative of -294p*4 + 90 wrt p? -1176p*3 What is the second derivative of -85d5 - d2 + 2d - 98? -1700d*3 - 2 Find the third derivative of -15q*4 - 131q*2. -360q What is the first derivative of 321q - 468 wrt q? 321 What is the second derivative of -9l*3 - 91l*2 - 59l - 14 wrt l? -54l - 182 What is the second derivative of 13p*4 - 13p*3 - 224p? 156p2 - 78p What is the derivative of 3i3 + 382i*2 - 3i + 4302 wrt i? 9i2 + 764i - 3 Find the second derivative of -19d5 + 2d*3p*3 - 2d*2p - 4dp*3 + 101p*3 wrt d. -380d*3 + 12dp3 - 4p Differentiate 2m2x*2 - 3538m*2 - 4802mx3 + 2 with respect to x. 4m*2x - 14406mx*2 Find the second derivative of -4d*3r*2 + 14d*3r - 82r4 - 4r wrt r. -8d3 - 984r*2 What is the derivative of -4iqt*2 + iq - 16it + i + 2q2t*2 + 6qt + 12t*2 wrt q? -4it2 + i + 4qt2 + 6t Find the third derivative of -990h4 - 819h*2. -23760h What is the first derivative of 314t2z3 + t2 - tz3 - 63z*3 - 4 wrt t? 628tz3 + 2t - z*3 Differentiate 928cn2q*2 - cq - 2n2q*2 - 28n*2q - 2nq*2 with respect to c. 928n*2q*2 - q Differentiate -br*3v*2 - 253bv3 + 5r*3v*3 - 97r3 wrt b. -r3v2 - 253v*3 Find the first derivative of -4429d*2 + 4393. -8858d Find the third derivative of -12b5 + 4b*4 - 173b*2 wrt b. -720b*2 + 96b What is the third derivative of -63a5b + 30a4b*3 + 2a*2b*3 - 4ab3 - 3ab2 - 146b*2 wrt a? -3780a*2b + 720ab*3 What is the second derivative of 12t*5 - 10t*3 - 720t? 240t3 - 60t Find the second derivative of c*3y2 - c3y - 3c*3 + 145cy2 + 3c wrt y. 2c3 + 290c What is the derivative of -5005s - 260 wrt s? -5005 Find the second derivative of 25bg4 - 7bg3 - 7bg + 2g*2 + 201g wrt g. 300bg*2 - 42bg + 4 What is the second derivative of 69v*5 - 263v wrt v? 1380v3 What is the second derivative of s4 - 113s*3 - 8196s wrt s? 12s2 - 678s What is the third derivative of -10h5 + 15h*4 - 99h*2 wrt h? -600h*2 + 360h What is the second derivative of 3b3c*2n - b*3n + 5b2 - 2bcn - bc + 4c*2n - 2c2u - 7cu wrt c? 6b3n + 8n - 4u Differentiate -336d4 + 48 with respect to d. -1344d*3 What is the first derivative of 2d*3 + 2d*2 + 179 wrt d? 6d*2 + 4d Find the first derivative of -94h3o - 4h3 - 7o - 10 wrt h. -282h2o - 12h2 Find the first derivative of 1208o*4 + 3204 wrt o. 4832o*3 What is the third derivative of -4v*5 - 9v*4 + 49v*3 + 5v*2 - 853v + 2? -240v2 - 216v + 294 What is the derivative of 1359f3 - 998? 4077f*2 What is the second derivative of 4o*4w*2 - 20o*4 + 2ow2 - 27o wrt o? 48o2w*2 - 240o*2 What is the second derivative of 2p*5q - 6p3q + 2pq + 7q - 139 wrt p? 40p*3q - 36pq What is the third derivative of 59a6 + 5a*4 + 310a*2? 7080a*3 + 120a Differentiate -14q2w*2 + 2qw2 - q + 279w**2 with respect t	{ "pile_set_name": "DM Mathematics" }
13y3 + 3799211y*2 + 265152573y? 78y + 7598422 What is the third derivative of 2322809k*3 + 38k*2 + 105k + 236 wrt k? 13936854 What is the third derivative of 1242810p4 - 5p*3 + 8382p*2 + 491p wrt p? 29827440p - 30 Differentiate -23915071o*4 + 25970708. -95660284o*3 Find the first derivative of -73333026k - 218757639 wrt k. -73333026 What is the second derivative of -9350n4 + 2047n*2 - n - 42762066? -112200n*2 + 4094 What is the third derivative of 46758041l*5 + 167l*2 - 2107l + 3 wrt l? 2805482460l2 What is the third derivative of 31aw3 + 10aw - 96a - 1029w3 + 666w*2 + 1 wrt w? 186a - 6174 Find the third derivative of -129938181x4 + 1355242x*2 + 2x - 4 wrt x. -3118516344x Find the first derivative of -45377594m - 33574742. -45377594 What is the second derivative of -8z4 - 1503862z*2 - 11601049z? -96z2 - 3007724 What is the second derivative of 361837kn3 - kn*2 - 2kn + 69566k + 136n3 + 4n - 2 wrt n? 2171022kn - 2k + 816n What is the first derivative of 87913757b2 - 62154725 wrt b? 175827514b What is the third derivative of -84d5 - 3d*4 - 6d*3 - 3812361d*2 wrt d? -5040d*2 - 72d - 36 Differentiate -12782722c3m + 2644244c3 - 24 wrt m. -12782722c*3 What is the first derivative of 36038537q + 1098059084? 36038537 Find the first derivative of 281i2l + 46i2 - 68il - 3i + 9314614l wrt i. 562il + 92i - 68l - 3 What is the third derivative of -18349655n*4 + 4n*2 + 781660n? -440391720n What is the third derivative of -595962158i*4 + 57197814i*2 + i? -14303091792i Find the third derivative of -g*5 + 44g*4 + 156169g*3 - 186474g*2 - 113. -60g*2 + 1056g + 937014 Find the second derivative of 121516492k2 - 41549622k. 243032984 Find the second derivative of -71016k3u*4y + 20k3u + k*3y - 125k3 + 2k*2uy + 9kuy - 37ku - 18u4 + 1 wrt u. -852192k*3u*2y - 216u2 Find the third derivative of -u4x*3 - 4u*3x*3 - 7206u*3 + 5946556u*2x*3 - ux*3 + 2x wrt u. -24ux*3 - 24x*3 - 43236 Find the third derivative of 155q*5 - 37977q*3 + 13463308q*2. 9300q*2 - 227862 Find the second derivative of 2235174n*2 - 7950041n wrt n. 4470348 What is the derivative of -581h3r*2 + 751h*3 - 18hr2 + 23r*2 + 479 wrt r? -1162h*3r - 36hr + 46r Find the second derivative of -475240029x*3 + 246940267x wrt x. -2851440174x Find the third derivative of 4x*4 + 1618182x*3 + 8871454x*2 + 3 wrt x. 96x + 9709092 What is the third derivative of 429578b4p - 6b3p*3 - 455b*2p - 749p3 wrt b? 10309872bp - 36p*3 Differentiate -40132463r*4 - 13051345. -160529852r*3 Find the third derivative of 2j*5 + 4j*4 - 125236j*3 + 1673903j*2 + 2j + 2. 120j2 + 96j - 751416 Find the third derivative of -725b6 + 2773b*3 + 14644b*2 - 3b + 1199 wrt b. -87000b3 + 16638 What is the first derivative of -27589746n - 338616 wrt n? -27589746 What is the third derivative of -1279516927p3 + 1237362153p*2? -7677101562 Find the second derivative of -3d*2l*3 + 6873d*2lq - 129d*2l - 8559dlq + 12dq + 2l*3q - 15q - 2 wrt d. -6l*3 + 13746lq - 258l Find the second derivative of -64556996m2 + 36645279m. -129113992 Find the second derivative of -155836026i2 + 230879671i wrt i. -311672052 What is the second derivative of 94668588i5 - 4809077i - 5? 1893371760i3 What is the derivative of 482936q*3 - 6q*2 + q + 1941432 wrt q? 1448808q*2 - 12q + 1 Find the first derivative of 1135d2h*2 + 42d*2 - 109dh - 179d + 2h2 - 110 wrt h. 2270d*2h - 109d + 4h What is the second derivative of 376805261n2 - 1376305841n? 753610522 What is the second derivative of 2797341mw*2 + mw - 6m + 2w*2 - 14w + 1549 wrt w? 5594682m + 4 Find the second derivative of -o4 - o3 + 309o*2w - 115o2 + ow + 3682o + 2w - 582 wrt o. -12o2 - 6o + 618w - 230 Find the third derivative of 19a*3f*4 + 2a*3f*3 + 20a*3f*2 - 2a*3 - 2a*2f*2 - 994af2 - 4759f*3 wrt f. 456a*3f + 12a3 - 28554 Find the second derivative of -86387o*2x*3 - 17o*2x*2 - 2o*2x + 72o2 - 5895ox + 13o + x*3 wrt x. -518322o*2x - 34o2 + 6x Differentiate ov2 - 352732ov + 274o + 6529 wrt v. 2ov - 352732o What is the derivative of 93962383a*2 - a + 54908394? 187924766a - 1 What is the second derivative of -3619751b2x*2 - 22b*2x - 3b2 + 3bx + 25b wrt x? -7239502b2 Find the third derivative of -574100391s*6 - 3s*2 + 19635s + 210. -68892046920s3 Find the first derivative of 57779747d + 21332716. 57779747 Find the first derivative of -28964146c3 - 32587508. -86892438c*2 What is the third derivative of 4j*6z - 35798841j4z - 2j2z - 2j2 - jz - 123j + z + 274 wrt j? 480j*3z - 859172184jz Differentiate 373499x3 + 8x*2 - x + 63212438 with respect to x. 1120497x*2 + 16x - 1 Find the first derivative of -19200754m3 + 36121764 wrt m. -57602262m*2 Find the second derivative of -972441n*3o*5 + 3n*3o + 7n2o + 3n2 - 635no - 3n - 3o5 - 2o wrt o. -19448820n3o*3 - 60o*3 Differentiate 10081p*2x + 504552996p2 - 3776x wrt x. 10081p2 - 3776 What is the second derivative of n4s - 154n3s + 3081n2 - 50ns - 1373s + 10 wrt n? 12n2s - 924ns + 6162 What is the third derivative of 60882226u4 - 1578316u*2 - 18u wrt u? 1461173424u What is the third derivative of 2k*2o*3 + 1136k*2o*2 - 6818k*2o + 118ko*3 + ko*2 + 2ko + 572777o3 - o2 + 2 wrt o? 12k2 + 708k + 3436662 What is the third derivative of 3r6 + 2836332r*5 - 938r*2 + 1434r + 25 wrt r? 360r3 + 170179920r*2 What is the third derivative of -42390416x*4 + 7139091x*2? -1017369984x Find the second derivative of 10021192s3 - 5s*2 - 84393697s. 60127152s - 10 What is the derivative of -3w*2 - 248874w + 15979892? -6w - 248874 What is the derivative of -12a*2n + 4a2 + 716694an4 - 4906093 wrt n? -12a*2 + 2866776an3 Find the second derivative of 1051s*3 + 232457s*2 + 103573s + 770. 6306s + 464914 Find the first derivative of -34244960v + 48410547. -34244960 What is the second derivative of 33412889w3 + 70097875w wrt w? 200477334w Find the third derivative of -g5 - 11784418g3 + g2 + 7905768. -60g2 - 70706508 Find the first derivative of -1020273203g*2 + 1003884308 wrt g. -2040546406g Differentiate -359hrx3 + hx*3 - 436hx2 + 8rx3 + 897rx - 2x*3 + 2x*2 + 6 with respect to r. -359hx3 + 8x*3 + 897x What is the second derivative of -13791934x5 + 535x - 19080 wrt x? -275838680x3 What is the derivative of 13107941h - 11877240 wrt h? 13107941 What is the third derivative of 25j2n*3u + 998j2n*2u*2 - 1695j*2u3 + j2u2 - jn*2u - 11862n3u*3 wrt u? -10170j*2 - 71172n*3 Differentiate 2j*4 - 224964083j*3 - jo*2 - 1070518o*2 + o + 10 with respect to j. 8j*3 - 674892249j2 - o2 Find the third derivative of 32155600b6 - 7934957b*2 wrt b. 3858672000b*3 Find the first derivative of 44f*3 - 33726f - 11295520 wrt f. 132f2 - 33726 What is the second derivative of 4c*2n*2 + 658c*2n - 87035c2 + 163cn2 + 26cn + 448n*2 + 8 wrt c? 8n*2 + 1316n - 174070 What is the second derivative of -102j4 + 194051j*3 + 2j*2 + 36512859j? -1224j2 + 1164306j + 4 Find the second derivative of -380g5 + 71946g*4 + 1095053g + 22. -7600g3 + 863352g*2 What is the second derivative of 306c*3q - 5c3 + 2c*2q + 22c2 + 87cq - 81c + 2q + 1 wrt c? 1836cq - 30c + 4q + 44 What is the derivative of 387725899m*3 - 18706224 wrt m? 1163177697m*2 Find the second derivative of -5l*5n - 21740058l4n + 2876ln + 3l - 87n + 53 wrt l. -100l3n - 260880696l2n Find the third derivative of 15568374g3 - 30g*2 - 111877. 93410244 What is the derivative of -203228gmx - 42040605gm - 34gx + 3g wrt x? -203228gm - 34g Find the first derivative of -27a3fgj - 3a3fj + a3f - 6a3 + 38a*2 - 53597afgj - 6afj +	{ "pile_set_name": "DM Mathematics" }
b - 9, 3 = 3f + b - m. Differentiate 2 + 4d - d - 3d - 7d*f wrt d. -14d Let o(d) be the second derivative of 0 - 8/3d3 + 17d + 1/6d4 + 0d*2. Find the second derivative of o(c) wrt c. 4 Let a(j) = -3j*2 - 5j + 1. Let i(y) = y*2. Let m(l) = a(l) + 6i(l). Let r(h) be the first derivative of m(h). What is the derivative of r(g) wrt g? 6 Differentiate 161 + 35z4 - 94z*4 + 33z*4 - 34z*4 + 58 with respect to z. -240z*3 Let u(b) = 17b - 3. Let o = -3 - -6. Let n(t) = -ot + 3t + 2 - 8t - t. Let x(h) = -7n(h) - 4u(h). Find the first derivative of x(c) wrt c. -5 Let k be (-1)/2 - (-2)/(8/22). What is the first derivative of -kr*3 - 10r*4 + 3 + 11 + 5r*3 wrt r? -40r*3 Let l(y) = -15y + 5 + 25 - 8. Let g(b) = -8b + 11. Let v(t) = -5g(t) + 3l(t). What is the first derivative of v(c) wrt c? -5 Let i be (0 + (4 - 2))/1. What is the third derivative of 18b*i - 2b*3 - 3b*3 - 26b*2 wrt b? -30 Let d be 344/7749/2. Let r(v) be the second derivative of 0v4 + 0 + 0v*3 + 10v - 2vd + 11/20v*5. What is the first derivative of r(g) wrt g? 33g2 Let a(m) be the first derivative of m6/3 - 35m5 - 169m*3/3 - 124. What is the third derivative of a(n) wrt n? 120n*2 - 4200n Let w(o) be the first derivative of -o*5/5 + 17o*2 - 20o + 49. Find the first derivative of w(y) wrt y. -4y3 + 34 Let l(n) be the second derivative of 37n6/30 + n4/4 + 257n3/6 - 3n - 38. Find the second derivative of l(g) wrt g. 444g2 + 6 Let t(x) be the second derivative of x7/42 - 69x5/20 + x4/4 + 7x2 + 6x + 14. What is the third derivative of t(r) wrt r? 60r2 - 414 Let b be (-2)/1(-8 + 7). What is the third derivative of 2n2 - bn*2 - 6n*2 - 5n*4 wrt n? -120n Let q be 3158/3 - 2/(-6). What is the second derivative of 4f + 9f*5 + 1053f*3 - qf*3 wrt f? 180f*3 Suppose 2z = -5v - 0z + 58, 3v - 2z = 38. Find the first derivative of -3f - vf - 6 - 13 - f wrt f. -16 Let h(b) = -b. Let c(w) = w*2 - 8. Let a(r) = c(r) + 3h(r). Let j(g) be the first derivative of a(g). What is the first derivative of j(n) wrt n? 2 Let i(d) = -d*2 - 9d + 4. Let g be i(-9). Differentiate 12 + 7 - 7xg - 22 with respect to x. -28x3 Let v(w) be the first derivative of -w7/7 + 17w5/5 + 10w*3/3 + 3w*2/2 - 118. What is the third derivative of v(g) wrt g? -120g*3 + 408g Suppose -6y + 16 = -2y. Suppose 4 = 2l - 4k - 4, 3l - 12 = 2k. Find the second derivative of c*4 + 4c*l - 5c*y - 6c*5 + 5c wrt c. -120c3 Find the first derivative of -40 - 112 - 137o + 11 + 14 wrt o. -137 Let a be ((-76)/(-57))/(4/18) - 4. Let b(o) be the first derivative of 0oa - 3 + 5/3o*3 + 2o. What is the first derivative of b(w) wrt w? 10w Let r(s) = -s3. Let c(n) = -7n*3 - 4n*2. Let i = 5 + -9. Let z be (2 - 0/i)/1. Let p(l) = zr(l) - c(l). Find the third derivative of p(k) wrt k. 30 What is the third derivative of 16 - 25 + 57p4 + 9 - p3 + 20p*2 wrt p? 1368p - 6 Let z(k) = 2k2 - 5k - 11. Let l be z(5). Find the third derivative of -9t3 - 2t*2 + 8t*2 - lt2 wrt t. -54 Let w(o) be the first derivative of -o3/3 - 46o2 - 387o + 70. What is the derivative of w(u) wrt u? -2u - 92 Let c = -26 + 29. Let g = 3 - 3. Find the first derivative of q - cq + g - 2 wrt q. -2 What is the third derivative of 19l2 - 183108l + 8l6 + 2l*5 + 183108l - 1 wrt l? 960l3 + 120l*2 Let q(d) be the third derivative of 23d5/20 - d4/24 + 22d3 - 417d*2. Find the first derivative of q(i) wrt i. 138i - 1 Let l(s) = 11s4 - 8s. Let d(w) = -32w4 + 23w. Let y be -6(-5)/(-25)5. Let v(c) = yd(c) - 17l(c). What is the second derivative of v(q) wrt q? 60q2 Let w(r) = -r + 35. Let f be w(-19). Find the second derivative of -38c - 103c2 + 49c*2 + fc*2 - 34c*4 wrt c. -408c*2 Suppose -3v + 8 = v. Find the second derivative of 0c2 - 10c + c*2 + vc*2 - 2c*2 wrt c. 2 Let m(i) = 122i*3 - 145i*2 - 7i - 7. Let f(l) = l3 - l2 - l - 1. Let z(d) = 42f(d) - 6m(d). Find the third derivative of z(x) wrt x. -4140 Let f(l) be the first derivative of -225l4/4 + 70l + 228. What is the derivative of f(h) wrt h? -675h2 Suppose -c - 2 = 2x, 0c = -4x - c - 2. Suppose 2z - u - 9 = x, 5z + 4u + 3 + 7 = 0. Find the second derivative of zo*4 + 0o - 5o - 2o wrt o. 24o2 Let n(q) be the third derivative of q7/35 - 7q*4/24 - 17q*3/6 + 3q*2 - 4q. Differentiate n(r) with respect to r. 24r3 - 7 Let s be (-56)/(-12) - 2/3. Suppose sa = a. What is the second derivative of 2h2 - 3 + 3 - 2h + ah2 wrt h? 4 Let j be ((-1)/2)/(((-55)/30)/11). Find the second derivative of -7h + 23h4 - 10h + h + jh wrt h. 276h*2 Let s(z) = 63z*3 + 2z + 40. Let u(l) = -188l3 - 6l - 119. Let n(r) = -17s(r) - 6u(r). Find the second derivative of n(k) wrt k. 342k Let d(m) be the second derivative of 449m*5/10 - 653m*3/6 - 7m + 7. What is the second derivative of d(w) wrt w? 5388w Let h(n) be the first derivative of n3/3 + 46n*2 - 142n + 359. Differentiate h(t) with respect to t. 2t + 92 Let v = 0 + -4. Let h = 7 + v. What is the second derivative of 0t + 5t5 - t5 + ht wrt t? 80t3 Let s(j) be the first derivative of 510j*2 + 374j - 911. What is the derivative of s(q) wrt q? 1020 Let f(t) = -t*2 + 4t + 2. Let m be f(4). What is the third derivative of 10c5 + 4c*3 - 29c*m + 24c*2 - 4c*3 wrt c? 600c*2 Let j(r) be the first derivative of 9r*2/2 + 174r - 148. What is the derivative of j(q) wrt q? 9 Suppose 6 = 3t - 0. Let g(v) be the first derivative of -4 + 2v*3 + 0v*3 - 3v - t - v*3. Differentiate g(n) wrt n. 6n Let k = -39 + 42. Suppose 0h = 3h. What is the third derivative of c2 - c3 + 0c - 4c*k + hc wrt c? -30 Let c(t) be the third derivative of -t*5/60 + 29t4/8 + t2 + 31t. Find the second derivative of c(l) wrt l. -2 Let w(q) be the first derivative of 133q6/6 + q2 - 8q - 168. Find the second derivative of w(h) wrt h. 2660h*3 Suppose -10 = 6d - 10. Let v be 27/6 - 1/2. Find the third derivative of 8o2 - 4o*2 - 10o*v + do*2 wrt o. -240o Let g(c) be the second derivative of -8/21c7 + 5/2c*3 + 0 + 0c*5 + 0c*2 - 11c + 0c6 + 0c*4. What is the second derivative of g(j) wrt j? -320j*3 Let q(f) = -7f*2 - 4f + 5. Let d be q(2). Let v = -26 - d. What is the second derivative of o*2 + 3o*2 + 4o - 4o2 + 3o*v wrt o? 60o*3 Let x(c) = c + 7. Let q(w) = -358w + 111. Let n(l) = -q(l) + 4x(l). What is the first derivative of n(o) wrt o? 362 Let n be (5/2)/(6/12). Let j = 8 - n. What is the first derivative of -3k*j - 7k3 - k3 + 1 + 4k3 wrt k? -21k*2 Let c(r) = -104r*2 - 7r + 1. Let n(w) = 104w2 + 7w. Let q(g) = 6c(g) + 7n(g). What is the second derivative of q(v) wrt v? 208 Let a(j) be the third derivative of 7j6/24 + 19j5/60 + j3/3 - 2j2 + 4. What is the third derivative of a(h) wrt h? 210 Suppose -76 + 19 = -3a. What is the second derivative of -aj + 9j + 0 + 2j4 + 0 wrt j? 24j*2 Find the third derivative of 4 - 2 + 0k*5 + 3k*5 + 3 + 85k*4 - 15k*2 - 111k*4 wrt k. 180k*2 - 624k Let p(c) be the third derivative of 11/60c5 - 5/112c*8 + 0c*3 + 9c*2 + 0c*7 + 0c*4 + 0c + 0c6 + 0. Find the third derivative of p(j) wrt j. -900j2 Let u(t) = -t2 + 10t - 11. Let b be u(11). Let q be 15 - b/(-11). Find the second derivative of 3a + 0a*3 - 4a - qa3 + 8a*3 wrt a. 30a Let p(l) = -l*2 - 11l - 14. Let b be p(-8). What is the second derivative of 19n - 32n - bn4 + 26n wrt n? -120n2 Let w(z) be the third derivative of 0z*4 + 0z + 41/6z3 + 38z*2 + 11/120z*6 + 0 + 0z*5. Differentiate w(o) with respect to o. 33o*2 Let h(m) = -9m - 14. Let x(f) = 1 - 4 - f - 4 - 4f. Let v(l) = -3h(l) + 5x(l). Find the first derivative of v(b) wrt b. 2 Let l(y) = -91y*3 - 12y*2 - 21. Let i(d) = 365d*3 + 50d*2 + 85. Let s(g) = -6i(g) - 25l(g). What is the first derivative of s(w) wrt w? 255w2 Let a(d) be the first derivative of -d7/70 + 3d4/8 - 19d**2/2 + 22. Let l(g) be the second derivative of a(g). Find the second derivat	{ "pile_set_name": "DM Mathematics" }
27a + b = -17a. Is 14 a factor of a? False Let a = 18374 - -5182. Is 14 a factor of a? False Let v(k) be the first derivative of 17k2/2 + 2k + 14. Let c be v(2). Suppose c = 6l - 4l. Is l a multiple of 15? False Let g(l) = 54l - 5. Let b be g(-4). Let f(j) = -j3 - 20j*2 + 7j + 79. Let i be f(-21). Let p = b + i. Does 38 divide p? True Let z = -823 - -1723. Is z a multiple of 20? True Let q(k) = 3k2 - 7k - 666. Is q(64) a multiple of 74? True Suppose -7l - 286 = -6. Suppose 0 = -12w + 18w - 354. Let c = w + l. Does 2 divide c? False Let v(a) = -a2 + 3a + 59. Let c be v(-6). Suppose -cj + 20j - 5415 = 0. Is 19 a factor of j? True Does 7 divide (14/(-3))/(204/(-204714))? True Let c(g) = -3238g + 4792. Is c(-13) a multiple of 89? False Let z = 1429 - 1426. Let d be 27/6 + (-1)/2. Is 676/d - 1/(z/12) a multiple of 33? True Let s = 16 - 16. Suppose s = -c + 5v + 3 + 2, 2c = 5v + 10. Suppose 3o + 10 = -2r + 36, 5o - 50 = -cr. Does 6 divide o? True Suppose 5n + 60 = 75. Suppose 3u = o + n - 110, -u + 583 = 5o. Is o a multiple of 3? False Suppose 24y - 817655 = -99575. Is 55 a factor of y? True Is 7 a factor of ((-38224)/(-20))/((-14)/(-35))? False Let a(d) = -5d + 20. Let h be a(3). Suppose 0p - hp = 25, -j - 62 = 4p. Let m = 172 + j. Is m a multiple of 7? False Suppose -9a + 7a + 105 = 3o, -2o = -2a + 90. Let j be (-8)/20 + (-1551)/(-15). Let n = j - a. Is n a multiple of 6? False Suppose -y + 22m + 13 = 25m, -5m = -y + 29. Suppose -yo = -7o - 6984. Does 48 divide o? False Let x be 2/13 + 52832/(-676). Is 37 a factor of (x/5)/((8/10)/(-4))? False Suppose 5l - 12373 = 5w + 18637, 6w = -3l + 18678. Is 216 a factor of l? False Let o be (40/(-12))/(52/15). Let d be (12 - 7)(-2)/o. Suppose ds = -s + 252. Does 14 divide s? True Does 3 divide 22344/51 - 22/187? True Let o(j) = -21j + 42j - 19j + 20. Let q be (1 - 1) + 1 + -1. Is o(q) a multiple of 4? True Suppose -s - 15 + 25 = 0. Let g be (166 - s)2/4. Suppose 70 = 3t - 5q - g, -q = -2t + 94. Is 23 a factor of t? True Suppose 9996 = 3g - 3o, 212g + 5o + 6658 = 214g. Does 11 divide g? False Let c be (0 - (-4)/12)(1 + -52). Is 43 - c/((-51)/(-18)) a multiple of 7? True Let q be (-390)/(-91)(1 - -6). Let m be 0/1 + q/10. Suppose 54 = 2i + 4b, -2b = -5i + mb + 180. Does 11 divide i? True Suppose 3x - 5d = 12948, 2x - 8889 + 225 = -2d. Is x a multiple of 7? True Let y(u) = 11u2 + 222u - 79. Does 10 divide y(-35)? False Let q(o) = -3o3 + 49o*2 - 64o - 17. Let w(v) = 2v3 - 33v*2 + 42v + 11. Let c(h) = 5q(h) + 7w(h). Is 17 a factor of c(10)? False Suppose 7h - 8h = -5. Is 8/h + -1 + (-7272)/(-30) a multiple of 27? True Suppose -4t - 5r = -87420, -123t - 5r + 65570 = -120t. Does 95 divide t? True Suppose -3428 = -2a + a + 3u, -5a = -5u - 17170. Is a a multiple of 28? False Let r(i) = 4i*3 - 4i*2 - 12i + 5. Let b be r(7). Let p = b - 597. Is 30 a factor of p? False Let k = -6758 + 55219. Is 12 a factor of k? False Suppose 134y - 270028 = 66y. Is y a multiple of 69? False Let f(m) = 998m - 4417. Is f(39) a multiple of 82? False Let x = 84 - 143. Let h = x + 71. Suppose p + s - 55 = -h, 16 = 4s. Is 8 a factor of p? False Let q = 27763 - 4123. Is q a multiple of 17? False Suppose -528i = -2a - 533i + 46870, 4a - i = 93806. Is 14 a factor of a? True Suppose -19h + 5516 + 1378 = -63482. Is 15 a factor of h? False Suppose -27655 = -5c - 5w, -c - 3w + 532 = -5013. Is c a multiple of 41? False Let f(r) = r + 15. Let t = -2 - 18. Let z = -16 - t. Is f(z) a multiple of 19? True Let d = -14 - -14. Let x = d + 2. Does 23 divide x/(-3)5586/(-28)? False Let d = -112 - -114. Let w be 10 + -1 - (-2)/d. Suppose 0 = wv - 1859 - 571. Is v a multiple of 40? False Let n(l) = l*3 - 8l*2 + 7l - 11. Let p be n(8). Let h = -39 + p. Suppose hg - 112 = 2g. Is 21 a factor of g? False Let j = -11574 + 17079. Is j a multiple of 83? False Let t be 105/(-10) + (-1)/(-2). Let n be 4/t(-6 + -954). Let q = n - 224. Is 24 a factor of q? False Suppose 0 = -268t + 263t - 55. Let c = t + 243. Let q = c + 65. Does 12 divide q? False Let o(f) = -60f - 5. Suppose 72 = -4c + 68. Does 25 divide o(c)? False Suppose -12 = 4a, 5922 + 1236 = 3h + 3a. Suppose 3m = h + 671. Is 34 a factor of m? True Let g = 63 + -21. Let h = g + 12. Does 21 divide h? False Suppose 5v - 616 = -4k, 5v + 462 = 11k - 8k. Suppose -5t + k = -10b + 8b, -2b = 4. Is t a multiple of 15? True Suppose -32a + 11278 = -125a + 2296288. Is 130 a factor of a? True Does 4 divide -5 + -847-5(-12)/(-30)? False Suppose 2a - 28 = -12. Let l(x) be the second derivative of -x5/20 + 11x*4/12 - 5x*3/6 + 4x*2 - 62x. Does 52 divide l(a)? False Let n(k) = -16885k3 - 3k*2 - 9k - 7. Is n(-1) a multiple of 42? True Let t(f) = 218f - 290. Is 55 a factor of t(54)? False Let k = 23 + -19. Suppose c + 5z + 25 = 0, 6 = -3c - kz - 14. Is 28 a factor of -12(c - (124/16 + 0))? False Let a(m) be the third derivative of 2m*4/3 - 4m*3/3 + 50m2. Is a(17) a multiple of 12? True Let f(z) = -z2 + 7z + 21. Let h be f(9). Let b = 9 + -4. Is (-3)/(-2)(b - h/9) a multiple of 7? True Suppose -2h = h - 4o - 35, 3h + 5 = -4o. Suppose -3d = 3k + 12 + 120, 0 = 2k - hd + 67. Let c = k + 155. Is 19 a factor of c? True Let p be 2(0 + (-2 - -6)). Let i be 3/2 + (-10)/(-4). Suppose in - 340 = -p. Is 18 a factor of n? False Let g(p) = -3p - 39. Let z be g(-14). Suppose 0 = 2u + 2t - 426, -zu + 2t = t - 647. Is 43 a factor of u? True Suppose 25 = -5i, 4i = 5w + 7i + 5. Suppose 2x - 742 = wm, x + 5m - 386 = m. Is 17 a factor of x? True Let h(a) = a*2 - 7a + 3. Let o be (3/2)/(4/8). Suppose -p - f = 7, -6p - 21 = -op - 4f. Is 17 a factor of h(p)? False Let x = -6079 - -8599. Suppose x = -5k + 26k. Does 10 divide k? True Suppose 13160 = 2t - 2o, -5t + o + 13440 + 19488 = 0. Is 12 a factor of t? False Let h = -582 - -1542. Suppose 0 = 50j - 10j - h. Is 24 a factor of j? True Suppose 9t - 3t - 7t = 0. Suppose t = 2d - 4p - p - 174, -d + 3p + 88 = 0. Does 82 divide d? True Suppose 180 + 3003 = 22h - 359. Is 23 a factor of h? True Let g = 225 - 200. Is 17 a factor of ((-15)/g-5)/(3/357)? True Suppose 4j + j + 10 = -2d, 4d - 36 = 4j. Suppose 5b - 105 = dp, -15 = -2b - 4p + 9. Is 12 a factor of (b/15)/(((-9)/(-220))/3)? False Does 11 divide (-20 - -27)(-4464)/(-56)? False Let k(a) = -158a + 4711. Does 28 divide k(21)? False Let j be (14/28)/(1/(-2)). Does 3 divide 75 + j(0 - 0 - 0)? True Suppose 9d = 12d + 21. Let j be ((-3)/2130)/(1/d). Is (75 + 3)/(9/j) a multiple of 13? True Let v be 8 - ((-6)/(-3) + -3). Let q(w) = -14w2 - 96w - 26. Let c be q(-6). Let y = v + c. Is y a multiple of 11? True Let f = 3392 + -1069. Is 23 a factor of f? True Suppose -4l + 16 = -4k, -3k + 15 = l + 3. Let i be 24/(-8)10/l. Is 18 a factor of 1 + 81/(-2)(3 + i)? False Let a(b) = 35b*2 - 29b - 156. Is a(-6) even? True Suppose -5m = -4m + 4n + 230, -238 = m - 4n. Let g = 281 + m. Is 9 a factor of g? False Suppose -8m + 28 = -4m - 2p, 4p + 26 = 2m. Suppose -4i + 162 = 2f, -mf - 253 = -8f - 4i. Is 21 a factor of f? False Let v(x) = 49x2 + 56x + 70. Is 2 a factor of v(-7)? False Let y(u) be the second derivative of u*4/6 - 2u*3 - 4u*2 + 96u - 5. Let s(d) = -4d. Let v be s(2). Is y(v) a multiple of 12? True Suppose 5b = -7158 + 898. Let s be b/(-36) + (-4)/(-18). Let d = s - 19. Is 16 a factor of d? True Let w(j) be the first derivative of j*3/3 - 15j*2/2 - 32j + 31. Let c be w(17). Suppose -2v + 5t = -83, t + t + c = 0. Is 19 a factor of v? False Let p(i) = -1319i + 836. Is p(-5) a multiple of 10? False Is (-2 - (-8 - (-29696)/24))(1 + -4) a multiple of 11? False Let x = 74 + -143. Let u be (x/(-4))/(-4 + (-68)/(-16)). Suppose -4c - 3n + 57 + u = 0, -4c + 128 = 4n. Does 6 divide c? True Let p = 1544 + -1493. Let b(c) = -2c2 - 8c - 4. Let w be b(-5). Let s = p - w. Is 13 a factor of s? True Suppose 5x - t - 21532 - 102464 = 0, 0 = 3x + 4t - 74416. Does 115 divide x? False Let a = 218 - -127. Is 21 a factor of a? False Let l be (1 - -1)(1 + (-1)/(-2)). Let q(d) = 47 + 10 + l*d	{ "pile_set_name": "DM Mathematics" }
5s2 - 4s - 36s2 + 4s. Let i(g) = -g + 4g - 5g. What is i(r(t))? 2t2 Let h(j) = j2. Let k(m) = 15m*2 - 18m - 18. Let l(x) = x*2 - x - 1. Suppose 0 = 5n + 34 + 56. Let f(v) = nl(v) + k(v). Determine h(f(r)). 9r4 Let f(q) = -q2. Let m(z) = -3z2 - 1202. Give m(f(a)). -3a4 - 1202 Let p = 7 + -3. Let w(c) = c2 + 2. Let d(r) = 5r2 + 9. Let a(t) = pd(t) - 18w(t). Let n(y) be the third derivative of -y5/15 - y2. What is a(n(v))? 32v*4 Let v(h) = 5h*2. Let p(x) be the third derivative of 0x - 3x2 + 1/60x*5 + 0 + 0x*3 + 0x*4. What is p(v(w))? 25w4 Let g be (4/(-10))/(3/(-15)). Let w(a) = -a2 - a*g + 5a*2. Let x(k) = 4k. Let i(m) = -m. Let v(b) = 6i(b) + x(b). Calculate w(v(n)). 12n*2 Let t(q) = -63q + 2. Let m(s) = -33s2. What is m(t(f))? -130977f*2 + 8316f - 132 Let k(c) = -c. Let s(x) = -3x - 1. Let o be s(-1). Let r(y) = y - 2y - oy. Give k(r(a)). 3a Let g(d) = 3d2 + 0d*2 - 4d*2 - 9d*2. Let x(q) = -2q*2. Give g(x(f)). -40f*4 Let b(l) = -2l. Let d(v) = 3502v. What is d(b(y))? -7004y Let f(j) = 0j - j + 2j - 3j. Let r(v) be the third derivative of v5/5 + 4v*2. Calculate f(r(g)). -24g2 Let i(x) be the first derivative of -x2/2 - 1. Let k(t) = -3t2. What is k(i(m))? -3m*2 Let y(c) be the first derivative of 20c*3/3 + 8. Let p(x) = 2x*2. Determine p(y(q)). 800q*4 Let s(i) = 165i - 27. Let r(k) = k*2. Determine s(r(a)). 165a*2 - 27 Let k(s) = -4s. Let i(n) = -3n - 68 + 68. Calculate k(i(c)). 12c Let k(d) = -10d2 + 9d*2 + 5d*2. Let b(g) be the first derivative of -2 - 2/3g*3 + 0g + 0g2. Determine b(k(v)). -32v*4 Let c(g) = 2g. Let t(b) = -9b2 + 4. Let u(o) = -10o*2 + 5. Let k(y) = 5t(y) - 4u(y). Calculate c(k(m)). -10m*2 Let l(b) = 2b*2 + 0b*2 - 4b*2. Let a(h) be the third derivative of 1/60h*5 - 2h*2 + 0 + 0h*3 + 0h*4 + 0h. What is l(a(w))? -2w4 Let t(q) = q + 7. Let z(m) = -m - 6. Let j(p) = -6t(p) - 7z(p). Let o(c) = c2. Let w(f) = -2f*2. Let s(b) = -3o(b) - 2w(b). Calculate s(j(n)). n2 Let l(q) = -2q*2. Let c(x) = -17x + 2. Determine c(l(z)). 34z2 + 2 Let b = -1 - -3. Let u(v) = -3vb + v2 + 1 - 1. Let z(y) be the first derivative of y*3/3 - 1. Calculate z(u(j)). 4j4 Let f(r) be the first derivative of r5/30 - 4r3/3 - 3. Let q(u) be the third derivative of f(u). Let b(l) = -l2. Give b(q(i)). -16i*2 Let a(p) = -205p*2. Let j(o) = 2o*2. Determine j(a(q)). 84050q*4 Let v(r) = r. Suppose 9 = 5a - 3a + u, a + 4u = -13. Let z(o) = 7 - a + 3o. Calculate z(v(f)). 3f Let q(c) = -2c. Suppose s = 4s - 6. Let n(j) be the second derivative of 0 + j + 1/3j3 + 0j*s. What is n(q(b))? -4b Let m(p) be the first derivative of p*3/3 + 10. Let t(z) = 2z + 4. Calculate t(m(x)). 2x2 + 4 Let x(j) = -7j. Let c(y) be the third derivative of y*4/4 - 25y*2. What is c(x(a))? -42a Let b(k) = -2 + 2 + 2k. Let u(z) be the second derivative of 0z*2 + 0 + 1/6z*3 - 3z. What is u(b(n))? 2n Let p(y) = 30y*2. Let h(i) = -15i. What is h(p(b))? -450b2 Let x(d) = 2d*2 + 10 - 10. Let y(f) = -5f. Determine y(x(c)). -10c2 Let v(i) = 3i. Let d(t) be the third derivative of 0 + 0t4 - 1/20t*5 + 4t*2 + 0t*3 + 0t. Calculate v(d(f)). -9f2 Let h(x) = -4x*2. Let d(m) = 7m + 5. What is d(h(w))? -28w2 + 5 Let w(k) = 11k - 5. Suppose 5u + 4z + 24 = 0, -4u + 8 = -7u - 4z. Let j(f) = 17f - 8. Let g(l) = uw(l) + 5j(l). Let o(p) = -2p. Calculate o(g(t)). 6t Let l(a) = 72a - 45a - 37a. Let y(g) = -5g*2. Give l(y(k)). 50k*2 Let f(n) = 6n. Let s(o) be the second derivative of -o*3/6 + 3o. Calculate f(s(z)). -6z Let s(q) = 3q. Let f(b) be the second derivative of 17b3/6 + 17b. Give f(s(m)). 51m Let j(u) be the first derivative of u4/12 - u2/2 - 4. Let w(p) be the second derivative of j(p). Let z(l) = -6l*2. Determine z(w(h)). -24h2 Let p(j) = j2. Let c be -2 + (0 - -2)/1. Let t be -1 + c - (-6)/2. Let v(g) = g*2 + 2g*2 - 2gt. What is p(v(m))? m4 Let x(m) = 2m - 19. Let r(h) = 15h*2. Calculate r(x(j)). 60j*2 - 1140j + 5415 Let u(d) = -151d2. Let r(o) = -7o. What is u(r(f))? -7399f2 Let s(c) = 3c - 5. Suppose -2n = n - 18. Let b(r) = -2r + 3. Let i = -3 + 13. Let u(p) = ib(p) + ns(p). Let y(q) = -2q2. Determine y(u(h)). -8h*2 Let h(r) = -2r2. Let i(x) be the second derivative of x3/3 + 10x. Calculate i(h(j)). -4j*2 Let n(d) = 3d*2. Let u(m) = -338m. Give n(u(j)). 342732j2 Let u(p) = -19p. Let z(y) = -241y2. Determine u(z(m)). 4579m2 Let o(x) = x2 - 14x. Let u(j) = -23j. Determine o(u(y)). 529y2 + 322y Let v(r) = -2r2. Let c be 12/5 - 2/5. Let h(t) = -4t - 2. Let p = 2 - 5. Let d(q) = -5q - 3. Let u(m) = cd(m) + ph(m). What is v(u(a))? -8a*2 Let v(w) = 2w*2. Let f(l) = -245l + 1. Calculate f(v(i)). -490i2 + 1 Let b(z) = 4z. Let m(f) = -27f - 2f*2 + 27f. What is b(m(g))? -8g2 Let v(t) = -t. Let r(h) = -177h*2. Calculate r(v(l)). -177l2 Let q(v) be the second derivative of -v3/3 - 4v. Let u(c) = -c + 9 - 9. Calculate q(u(g)). 2g Let z(l) = -l - 8l2 + l - 3l2. Let n(f) be the first derivative of f3/3 + 3. Determine n(z(a)). 121a4 Let w(g) = -2g. Suppose -4 - 4 = -4t. Let h(x) be the second derivative of 0x*t + 1/6x*3 + 0 - 3x. Calculate h(w(k)). -2k Let r(u) = 10u*2. Let w(l) = -5l*2 - 3l. Calculate r(w(z)). 250z4 + 300z*3 + 90z*2 Let l(p) = -6p*2 + p + p - 2p. Let r(c) = 4c. What is l(r(w))? -96w*2 Let d(p) = 1305p - 1305p + 13p*2. Let a(j) = 2j. Determine a(d(z)). 26z2 Suppose 2b = 4b - 6. Suppose 6 = -2p - 3a + 19, -bp + 3a = -12. Let g(f) = p - f - 5. Let w(j) = 3j*2. Give w(g(t)). 3t*2 Let a(m) = -6m + 4m + m. Suppose 0x + 2 = x. Let y(i) = -i + 2i + 0i - xi. Determine a(y(s)). s Let q(l) = -2. Let h(m) = -m + 1. Let f(d) = -2h(d) - q(d). Let u(a) be the third derivative of 1/24a4 + 0a + a*2 + 0a*3 + 0. Calculate f(u(x)). 2x Suppose i = 2s + 9, -3i - s = i - 9. Let w(j) = ij + 4j - 1 + 1. Let h(f) = -2f. Calculate h(w(t)). -14t Let h(w) = 616w. Let s(m) = 5m. Determine s(h(k)). 3080k Let n(c) = -3 + 3 - 10c*2 + 12c*2. Let s(u) = 16u. Calculate n(s(d)). 512d2 Let o(b) = b2 + b2 - b2. Let y(l) = -3l*2 - 3l*2 + 8l*2. Give o(y(g)). 4g*4 Let m(i) = -4i*2. Suppose 0s - 2b = -3s + 6, 0 = -3s + 4b. Suppose -5t - 5g + 10 = 0, t + s + 0 = -3g. Let o(n) = -t + 5 - 2n. Calculate m(o(l)). -16l2 Let s(u) = -2u - 5. Let p(b) = 2b. What is s(p(t))? -4t - 5 Let d(o) = -2o. Let s(x) = -4x + 811. What is s(d(m))? 8m + 811 Let g(u) = -7u2. Let h(l) be the second derivative of -l4/3 + 4l. Give h(g(s)). -196s*4 Let c(q) = 2q. Let x(w) be the second derivative of -11w5/60 - w2/2 + 3w. Let l(p) be the first derivative of x(p). What is c(l(a))? -22a2 Let j(o) = 145o2. Let y(t) = -t2. Determine y(j(u)). -21025u4 Let t(q) = q. Let o be 4/10 - (-39)/15. Suppose of + 3h - 9 = 0, h = -3f - 3h + 7. Let c(s) = -6s + s - fs + 6s. What is t(c(p))? -4p Let b(z) = 4z*2. Let p(o) = -4o - 4. Let q be p(-2). Let f(i) = -10i + 10i + qi2. What is b(f(g))? 64g*4 Let z(m) = 19m + 7. Let v(t) = 9t + 3. Let i(b) = 7v(b) - 3z(b). Let u(l) = l. Determine u(i(y)). 6y Let u(q) = 2q2. Let x(b) = -1465b. Give u(x(m)). 4292450m2 Let u(f) = -5f*2. Let s(l) = 103l. What is s(u(c))? -515c2 Let u(i) be the third derivative of i5/60 + 9i*2. Let g(h) = 2h*2. What is u(g(p))? 4p*4 Let t(m) = 15m. Let h(o) = -8o + 3. What is t(h(w))? -120w + 45 Let m(p) = -29p2 + 2. Let z(f) be the third derivative of -f4/24 - 15f*2. What is z(m(g))? 29g*2 - 2 Let r(w) = -2w. Suppose 4f = s + 4s - 35, 3s + 3f = -6. Let p(k) be the second derivative of -2k + 1/6k*s + 0 + 0k*2. Determine r(p(q)). -2q Let a(v) = -15v. Let u(z) = -7z. What is a(u(w))? 105w Let z(y) be the second derivative of -13y*4/12 + 3y. Let n(c) = -c2 + 2. Let g(l) = l2 - 1. Let i(u) = 2g(u) + n(u). What is z(i(t))? -13t*4 Let m(x) = -2x*2. Suppose 2o + 2o - 12 = 0. Suppose 2b - 5g = 13, -4b - o*g	{ "pile_set_name": "DM Mathematics" }
) = 3r - 9. Let f(q) = -2q + 8. Let c(m) = -6f(m) - 5t(m). Let d be c(6). What are the prime factors of (d/(-2) + -1)2? 19 Let z = -94 + 81. Let c(y) = -y - 2 - 16y - 4 - y*3 - 14y*2 - 4. What are the prime factors of c(z)? 2, 3, 7 Let s = 116 + -68. What are the prime factors of s? 2, 3 Suppose 3j + 7 = 13. Suppose 3t = 3, -2a - jt + 0t + 28 = 0. Suppose 153 - a = 2g. What are the prime factors of g? 2, 5, 7 Let v(z) = 16z - 39. Let n be v(9). Suppose -n - 125 = -5t. List the prime factors of t. 2, 23 Let r be (1 + 121)/(4 + -2). Let l = -12 - -49. Let o = r - l. What are the prime factors of o? 2, 3 Let i = -6 - -21. List the prime factors of (-13)/(i/6 - 3). 2, 13 Suppose g + 28 = 5c, c - g + 1 = -3g. Suppose cy - 293 = -4f, y + y - 4f = 106. Let u = -25 + y. List the prime factors of u. 2 List the prime factors of (((-37)/3)/(-1))/((-9)/(-54)). 2, 37 Suppose -380 = -2g + 5d, -3g + 4d + 596 = 3d. Suppose 0 = -3q + 8q - g. List the prime factors of q. 2, 5 Suppose 0 = 4y - 9y - 175. Let u = 5 + y. Let g = -23 - u. What are the prime factors of g? 7 Let s = 579 - 115. List the prime factors of s. 2, 29 Let y be (0/1 - -108) + -3. Let j be ((-8)/3)/((-6)/9). Suppose -y = z - jz. What are the prime factors of z? 5, 7 Let i(q) = 202q2 - 15q - 34. List the prime factors of i(-3). 31, 59 List the prime factors of 2001(-12)/(-28) + 16/(-28). 857 Let n = -29 - -36. Suppose -3t = -nt - 4r + 280, -r = -4t + 300. What are the prime factors of t? 2, 37 Let p(j) = -35j + 697. What are the prime factors of p(0)? 17, 41 Suppose -89j = i - 84j - 1676, -i = -j - 1646. What are the prime factors of i? 13, 127 Suppose f + 0f = -3t + 58, 0 = -5f - t + 234. Let u(w) = -w3 + 3w*2 + 14w - 2. Let h be u(6). Let m = h + f. What are the prime factors of m? 2, 5 Let y(l) = 30l + 518. List the prime factors of y(7). 2, 7, 13 Suppose -14q = -116 - 24. Suppose qd - 2d - 1376 = 0. List the prime factors of d. 2, 43 Let l be 1/4 + ((-325)/20)/5. What are the prime factors of (-62)/(l - (-3 + 2))1? 31 Let b = 1 + -1. Let h be ((-10)/4)/(-5)b. Let y = h - -10. What are the prime factors of y? 2, 5 Let b be (-23)/((-2)/603). Suppose 3c = -29 + b. List the prime factors of c. 67 Let m(x) = x + 11. Let v be m(-2). Suppose 0 = vz - 604 - 467. List the prime factors of z. 7, 17 List the prime factors of 117/((-2)/10 + 12/30). 3, 5, 13 Let s = 24 - 20. Suppose 4u - 25 = -4g + 67, -3u - 92 = -sg. Suppose -57 = -4b + g. What are the prime factors of b? 2, 5 Let p = -17 + 21. Suppose -m - 3n - 3 = 0, -18 = 2m - 3m + pn. Suppose 58 = t + m. List the prime factors of t. 2, 13 Let f(t) = -7t2 + 59t + 3. List the prime factors of f(6). 3, 5, 7 Let n be 6/4 - (-15)/(-10). Suppose n = 5u + 47 + 3. List the prime factors of ((-52)/u)/(8/20). 13 Suppose p - 6 = -2. Suppose 15 = -5y, 3r - 6 = 2y - py. Suppose rh - 6 - 22 = 0. List the prime factors of h. 7 Let x(h) = -4h2 - 8. Let p(c) = -c2 + c2 + 6c*2 - 5c*2 + 1. Let u(k) = 6p(k) + x(k). What are the prime factors of u(-2)? 2, 3 Let l(z) = 1 - 22z + 12z - 48z - 16z. List the prime factors of l(-2). 149 Let f(u) = 52u + 216. List the prime factors of f(20). 2, 157 Suppose 4u = d + 12350, 0 = -2u + 5d + 3355 + 2829. What are the prime factors of u? 3, 7 Suppose -2u - 33 = -81. Let x = 28 - u. List the prime factors of 324/(-8)x/(-6). 3 Suppose 5k = -t + 3262, -4k + 2309 = -5t + 18590. List the prime factors of t. 3257 Let x(v) = -67v + 25. Let g(d) = 69d - 24. Let j(z) = -4g(z) - 3x(z). List the prime factors of j(-3). 2, 3, 41 Let y(j) = j2 + 3j + 3. Let r be y(3). Let t = -444 + 416. What are the prime factors of (-12)/t - (-348)/r? 17 Let p(h) = -2h - 5. Let n be p(-2). Let d = 98 + n. List the prime factors of d. 97 List the prime factors of (539 - -5) + (-9 - -3). 2, 269 Let z be (9 - (-30)/(-5))/((-1)/3). Let k(u) = -u - 24 + u2 + u + 8 + 2u. List the prime factors of k(z). 47 Suppose 16t + 6t = 2002. Let p = t - -161. List the prime factors of p. 2, 3, 7 Let f(p) = p*2 - 8p + 10. Let q be f(7). Suppose -114 = -3u + qg + 51, 0 = 5u + 2g - 247. List the prime factors of u. 3, 17 Let q be 3 + (-2 - (-3 - -8)). Let p be (q/6)/(1/3). List the prime factors of 71/4 + p/(-8). 2, 3 List the prime factors of (1 - 2/((-2)/103)) + -3. 101 Let z = -1975 - -3084. What are the prime factors of z? 1109 Let r be (-3 + 1)(6 + 16/(-2)). Suppose rs - 497 = -81. List the prime factors of s. 2, 13 Suppose 4y = 3v + 4, -v - 2y = -3v. Suppose -l + vl = 0. Suppose l = -4b + 2b + 34. List the prime factors of b. 17 Suppose 3r - 73 = -m, 161 = 2m - 0r + r. Suppose 30 - m = -g. Suppose 0 = -5j + g + 63. What are the prime factors of j? 23 Suppose 31r = 39r - 8448. List the prime factors of r. 2, 3, 11 Suppose -v - 3v + 31 = -5t, 5v - 4t = 32. Let o(i) = 1 - 1 + vi - 1. What are the prime factors of o(4)? 3, 5 Let g = 432 + -459. Let l be (1-1)/((-1)/(-25)). Let v = l - g. What are the prime factors of v? 2 Let p(t) = -2t - 1. Let l = 16 + -11. Suppose lv = -5n + n - 24, 5v - 2n + 18 = 0. List the prime factors of p(v). 7 Let c(p) = 7p - 6. Let q be c(15). Let f = 247 - q. List the prime factors of f. 2, 37 Suppose 41220 = 7d + 5p + 13094, 0 = -4d + 3p + 16072. What are the prime factors of d? 2, 7, 41 Let q(x) = 161x - 20. What are the prime factors of q(9)? 1429 Let a(c) be the third derivative of -c6/120 - c5/60 - c*4/24 - 2c*2. Let b be a(-4). Let g = b - 18. List the prime factors of g. 2, 17 Let p(n) = -13 + 12 + 28 - 3n. What are the prime factors of p(-10)? 3, 19 Let y(d) = 4d3 - 9d*2 + 18d + 7. What are the prime factors of y(4)? 191 Let k be 3/(((-12)/(-5))/4). Suppose -232 = -ky + 4b - 5b, b + 44 = y. Suppose 0 = s + 3f - 62, -s + f = -4f - y. List the prime factors of s. 2, 7 Suppose 0u - 5u = -10. Suppose -ux + 5 = -3, 4v = -2x + 188. List the prime factors of v. 3, 5 Suppose 0 = -5i - 15, m + 54 = 5i + 161. List the prime factors of m. 2, 23 Let r(w) be the second derivative of -w4/12 + w3 + 6w. Let u be r(6). What are the prime factors of (-6)/(-10)(15 + u)? 3 Suppose 3u - 94 = -n - n, 2u - 257 = -5n. Let p = n + -29. What are the prime factors of p? 2, 3 Let h = -159 + 249. Suppose -3f + 38 = 2g + 4, 0 = -4g + 5f + h. Let b = g - 9. What are the prime factors of b? 11 Suppose 8m - 2p = 9m - 796, 0 = -m - 5p + 808. What are the prime factors of m? 2, 197 Let y = -1418 - -2466. List the prime factors of y. 2, 131 Suppose -y = 2y - 5d - 540, 0 = 2d. Let o = -51 + y. List the prime factors of o. 3, 43 Let d(a) = -a - 1. Let i(s) = 6s + 5. Let z(h) = -4d(h) - i(h). Let t be z(-2). Suppose 0 = -tn + 38 + 7. List the prime factors of n. 3, 5 Suppose 0 = 2f - 50 - 8. Suppose 10j = 6j - 36. Let o = f + j. List the prime factors of o. 2, 5 Suppose 4d - 656 = -4j, 5d = 4j - 178 - 442. Suppose 4a - 6h - 222 = -3h, 3a - j = -h. List the prime factors of a. 2, 3 Suppose 0i = -i + 20. Suppose 2g - i = -2p - 0, -5 = -5p. Suppose -5d = -gd + 24. List the prime factors of d. 2, 3 Let s(v) = 43v + 301. List the prime factors of s(19). 2, 13, 43 Suppose 4s = -3a - 15, 0 = -2s + 4a + 2 - 4. What are the prime factors of s - (-13 - (1 + -2))? 3 What are the prime factors of (-18216)/(-45) + 6 - 3/(-15)? 3, 137 Let k = -1968 + 3940. What are the prime factors of k? 2, 17, 29 Let d(z) = 19z + 41. Let o(y) = -10y - 21. Let r(j) = -6d(j) - 11o(j). Let k(h) = 3h + 14. Let g(v) = -2k(v) - 3r(v). What are the prime factors of g(5)? 47 Let l = -21 - -340. What are the prime factors of l? 11, 29 Let k(d) = 1 + 0d + 6d + 7 - d. List the prime factors of k(5). 3, 11 Let u be (0 + 6/7)-7. Let q(j) = -j3 - 6j*2 - 3j - 9. Let f be q(u). Suppose -z = 2h - f, -6z + z + 25 = 0. What are the prime factors of h? 2 Let w(s) = -s*3 - 5s*2 + 4s - 11. Let p be w(-6). Suppose 3b + 18 = -6. List the prime factors of (-122)/b - p/4. 3, 5 Let w(v) = 16v*2 - v + 11. Let n be w(3). Let g = 258 - n. What are the prime factors of g? 2, 53 Let v(z) = -29z + 200. What are the prime factors of v(-18)? 2, 19 Let o = 157 - -1487. What are the prime fac	{ "pile_set_name": "DM Mathematics" }
i = 5s + 15, -9 = -i + s + 2s. Let u(m) be the third derivative of -1/120m6 + im + 4m2 - 1/60m*5 + 0m*4 + 0 + 0m3. Factor u(o). -o2(o + 1) Let x(f) = 6f*2 - 2f2 + 31 + f3 - f - 35. Let q be x(-3). Determine v so that -2 + 0v3 + 5v*3 - 4v*2 - 2v*3 - v + qv*2 = 0. -1, 2/3 Let v = -10670/3 + 3468. Let h = v + 90. Factor -2/3m*5 + 0m + 2m3 - hm*2 + 0 + 0m*4. -2m*2(m - 1)*2(m + 2)/3 Let a = -533/30 + 133/6. Factor 8/5 + as2 - 24/5s - 6/5s3. -2(s - 2)(s - 1)(3s - 2)/5 Let v(s) be the first derivative of 10/3s*3 + 8s - 11 + 1/2s4 + 8s*2. What is j in v(j) = 0? -2, -1 Let i(w) be the second derivative of 5w*4/12 + 5w*3 - 40w*2 - 4w + 2. What is a in i(a) = 0? -8, 2 Let h = 12 + -11. Let v be h + (20/4 - 0). Solve -w3 - 8 + w4 + 6w3 - 4w + 0w4 + vw*2 = 0. -2, 1 Let t = -872 + 876. Let x(u) be the third derivative of 0u*3 + 0 + 1/60u*5 - 7u*2 - 1/30u*6 + 0u + 0ut. Suppose x(h) = 0. What is h? 0, 1/4 Let p(d) be the first derivative of 5d*4/4 - 130d*3/3 - 275d*2/2 - 140d + 255. What is u in p(u) = 0? -1, 28 Let m(g) be the third derivative of 5g3 + 0 - 5/24g*4 + 0g - 1/3g5 - 1/24g*6 + 29g*2. Factor m(f). -5(f - 1)(f + 2)(f + 3) Suppose 0 + 3/4z2 + 3z - 3/4z4 - 3z3 = 0. Calculate z. -4, -1, 0, 1 Let y(p) be the second derivative of -p6/80 - 27p5/160 - 21p*4/32 - 19p*3/16 - 9p*2/8 - 2p - 2. What is d in y(d) = 0? -6, -1 Suppose 0 = -0u + 2u - 5q - 27, 0 = 5u - 2q - 36. Solve -2p*4 - u + 17p*2 - 51p*2 - 14p*3 - 34p - 6 = 0 for p. -3, -2, -1 Let z(i) be the second derivative of i10/41580 - i9/9240 + i*8/18480 + 5i*4/6 - 10i. Let d(h) be the third derivative of z(h). Solve d(l) = 0 for l. 0, 1/4, 2 Let c = -349/2107 - -8/43. Let d(x) be the second derivative of -1/105x6 - cx*7 + 0 - 2/21x*3 + 1/14x*5 + 1/42x*4 + 0x*2 - 4x. Solve d(w) = 0. -1, 0, 2/3, 1 Let j = -133921/3 + 44655. Determine f so that -242/3 + jf - 2/3f*2 = 0. 11 Let x(w) be the first derivative of 10 + 0w + w*2 - 2/3w*3. Let x(j) = 0. What is j? 0, 1 Let q = -9/32 - -137/480. Let a(g) be the third derivative of 0 - 1/24g*3 - qg*6 - 1/48g*5 - 1/24g*4 + 0g + g2. Find j such that a(j) = 0. -1, -1/2 Let v(f) be the first derivative of f6/21 - 22f5/35 + 20f*4/7 - 32f*3/7 + 275. Let v(o) = 0. Calculate o. 0, 3, 4 Let x(c) be the first derivative of -5c*3/9 - 11c*2/2 + 14c/3 + 105. Determine a, given that x(a) = 0. -7, 2/5 Let l = -20291/22 - -1845/2. Factor 0 - 4/11k - 2/11k*2 + lk*3. 2k(k - 2)(k + 1)/11 Let q(m) be the first derivative of m*4/18 - 14m*3/27 - 8m*2/9 + 2. Factor q(w). 2w(w - 8)(w + 1)/9 Let i(h) be the second derivative of h*5/110 + 4h*4/33 + 7h*3/33 - 373h. Factor i(j). 2j(j + 1)(j + 7)/11 Suppose -2o + 12 = -5f, 5f - 28 = 7o - 70. Factor 3/4l*4 + f + 0l*3 + 0l - 3/4l2. 3l*2(l - 1)(l + 1)/4 Let t(i) be the second derivative of -i5/5 - 6i*4 + 134i*3/3 + 168i*2 - i - 441. Factor t(f). -4(f - 4)(f + 1)(f + 21) Let z(c) be the third derivative of 7c6/15 - 139c*5/15 + 170c*4/3 + 50c*3/3 - 97c*2. Factor z(l). 4(l - 5)*2(14l + 1) Let j(z) be the third derivative of -z5/30 - z4 - 12z*3 + 41z*2. Suppose j(o) = 0. What is o? -6 Let f = 161/80 - -6829/240. Let z = -149/5 + f. Determine m so that -4/3m*4 - 5/3m*3 - 1/3m*5 - zm*2 + 0 + 0m = 0. -2, -1, 0 Let q be (-13)/(-39)((-821)/(-34) + -2). Let y = q - -2/17. Let -31g*4 - 36g*2 - 49g*3 - yg*5 - 1 - 23/2g = 0. What is g? -1, -2/15 Let l be 3 - (-3 + 2) - 60. Let i be ((-48)/l)/(4/14). Suppose -2vi + 10v*2 - 11v*2 + 3v*3 = 0. What is v? 0, 1 Suppose 2c = -0c. Let p(b) = -b + 3. Let t be p(c). Factor -2l + tl2 + 4l*4 - 7l*4 - 4l + 8l3 - 2l*3. -3l(l - 2)(l - 1)(l + 1) Let j be (-2)/(-5) - (-36)/10. Let k(y) = -y2 + y + 1. Let z(u) = u2 - 2. Suppose 2 = 2l - n, -2l + 3n = l. Let q(c) = jk(c) + lz(c). Factor q(f). -2f(f - 2) Suppose -3a + 6 = 0, 7f - 10f + 7 = 2a. Let d(b) = -5b2 - 20b + 29. Let i(v) = -1. Let p(g) = fd(g) + 4i(g). Let p(t) = 0. What is t? -5, 1 Suppose 11s - 25s = -924. Let r = s + -61. Factor 3/4or + 0 + 3/4o*2 + 9/4o*4 + 0o + 9/4o3. 3o*2(o + 1)3/4 Let m(c) be the second derivative of -c7/56 + c*6/40 + 27c*5/80 - 5c*4/16 - 2c*3 + 9c*2/2 - 37c. Determine r, given that m(r) = 0. -2, 1, 3 Let u(a) be the second derivative of a*4/42 - 8a*3/21 - 20a*2/7 - 345a. Factor u(k). 2(k - 10)(k + 2)/7 Solve -h*4 + 5h*2 + 6h*3 - 13h*3 - 4 + 7h*3 = 0 for h. -2, -1, 1, 2 Suppose 5z - 20 = -0z. Let t(q) = -q2 + 4q + 3. Let p be t(z). Suppose 2l - 2lp + 4 - l4 - 2 + 0l4 - 1 = 0. What is l? -1, 1 Let m(o) be the third derivative of -o7/490 - 3o*6/20 - 577o*5/140 - 51o*4 - 2312o*3/7 + 3o*2 - 33o. Factor m(x). -3(x + 4)2(x + 17)*2/7 Let d(w) be the third derivative of -5w*8/336 + 2w7/21 - w6/4 + w*5/3 - 5w4/24 - w2 + 201w. Solve d(y) = 0. 0, 1 Let g(n) be the second derivative of -n7/63 - 2n*6/15 - 2n5/15 + n4/3 + 5n3/9 - 60n. Suppose g(d) = 0. Calculate d. -5, -1, 0, 1 Let q(m) be the third derivative of m*4/6 + 13m*3/3 - 2m*2 + 4m. Let x be q(-6). Factor -2/9v + 0 + 4/9v*x + 2/3v*3. 2v(v + 1)(3v - 1)/9 Let k(b) be the first derivative of b6/24 + b5/20 - b4/4 - b3/3 - 59. Factor k(m). m2(m - 2)(m + 1)(m + 2)/4 Let h = 15 - 44. Let k = 34 + h. Factor -14r + 4r*3 - 2 + kr*2 - 2r*3 + 15r. (r + 1)(r + 2)(2r - 1) Let z(l) be the second derivative of -4/3l*3 + 1/3l*4 - 10l + 0l2 + 0. Factor z(f). 4f(f - 2) Find m such that 22m*2 + 27m*2 + 8m*4 - 2m*5 - 66m*2 + 25m*2 - 15m*3 + 3m*3 - 2m = 0. 0, 1 Let r(p) = p*2 - 40p + 47. Let q be r(35). Let v = -255/2 - q. Suppose 0 + vd + 3/2d*3 - 1/2d*4 - 3/2d2 = 0. What is d? 0, 1 Let s(v) be the first derivative of v4/26 - 20v3/39 - 24v*2/13 - 233. Solve s(i) = 0. -2, 0, 12 Suppose 138/13 + 2/13g*3 - 138/13g*2 - 2/13g = 0. Calculate g. -1, 1, 69 Let q(f) be the first derivative of -12f - 8 + 8/3f*3 - 10f*2. Let q(k) = 0. What is k? -1/2, 3 Suppose -o + 1 = -6. Suppose 3c = 2r - or + 17, 3r + 5 = 2c. Determine g so that 2g3 - g5 + cg4 + g5 - 14g4 + 8g*5 = 0. 0, 1/4, 1 Let w(v) be the third derivative of 0v*3 - 15v*2 + 0v + 0v4 - 1/1890v*7 + 0v*5 + 0 + 0v6. Factor w(h). -h4/9 Factor -20d3 - 24d*4 + 16d*3 - 5d*5 + 96d2 + d5 - 64d. -4d(d - 1)2(d + 4)*2 Let f(y) be the third derivative of -2y*2 + 0y + 0y3 + 1/108y*4 + 0 + 1/270y*5. Factor f(q). 2q(q + 1)/9 Let i(p) be the second derivative of -p7/84 - 13p*6/60 - 8p*5/5 - 37p*4/6 - 40p*3/3 - 16p*2 + 76p. Suppose i(o) = 0. Calculate o. -4, -2, -1 Let h(s) be the first derivative of -2s4/15 + s3/15 - 31s + 9. Let q(x) be the first derivative of h(x). Suppose q(l) = 0. Calculate l. 0, 1/4 Let a(k) be the second derivative of -k*5/10 - 5k*4/6 + 8k*3/3 + 48k*2 - 173k. Factor a(b). -2(b - 3)(b + 4)*2 Suppose -g - 11 = -4n, -6g + 9g + 3 = -3n. Factor -63l + 37l2 - 305 + 101 - 3l3 - ln - 90. -3(l - 7)2(l + 2) Let x(l) be the first derivative of l*6/12 - 3l*5/2 + 37l*4/4 - 82l*3/3 + 42l*2 - 32l - 72. Factor x(s). (s - 8)(s - 2)3(s - 1)/2 Find o such that -22o - 32/3 - 12o*2 - 2/3o*3 = 0. -16, -1 Determine p so that -6/5p*3 - 4/5p*2 + 2/5p*4 + 24/5p - 16/5 = 0. -2, 1, 2 Let w = 2/1699 - -3380/15291. Let a = 2690/99 - 294/11. Suppose -2/9x2 - 2/3x*3 + a - wx*4 + 2/3x = 0. What is x? -2, -1, 1 Suppose 0 = 4y + 5f - 23, -3y + 252f + 9 = 253f. Factor 1/8l*y + 0 - 3/8l. l(l - 3)/8 Let n(o) be the third derivative of o4/6 + o3/3 - 5o*2. Let s be n(0). Find x, given that 3/5x - x*s + 1/5x3 + 9/5 = 0. -1, 3 Let u(w) be the second derivative of -w5/110 + 7w4/66 + 5w*3/33 - 75w*2/11 + 21w - 2. Suppose u(g) = 0. Calculate g. -3, 5 Let c be (-48)/(-32) - (-58)/4. Let i be (-2)/(-4)c/2. Factor 36z - 64z2 + iz*5 - 1 - 24z*4 - 15z*3 - 7 + 71z*3. 4(z - 2)	{ "pile_set_name": "DM Mathematics" }
-j*3 - 20j*2 - 33j + 49. Let d be b(-18). Let i(w) = -6w3 - 5w + 1. Let t(r) = -r*3 - r + 1. Calculate dt(g) + i(g). -g*3 - 4 Let g(v) = -11v + 9. Let d(a) = 3a - 4. Let m(z) be the second derivative of -z3/3 + 2z*2 + 15z. Let s(j) = -3d(j) - 2m(j). What is -3g(k) + 7s(k)? -2k + 1 Let v(x) = 6x*2 - 14x + 6. Let n(g) = 0g + 4 + 8g*2 - 4g - 5g - 4g2. Let l(t) = t2 - 5t - 5. Let m be l(5). Determine mv(q) + 8n(q). 2q*2 - 2q + 2 Let f(n) = -60n + 21. Let p(j) = -j. Let z(d) = -11d + 2. Let x(y) = -5p(y) + z(y). What is -2f(l) + 21x(l)? -6l Let k(v) = -30v - 21. Let f = -200 + 202. Let j(s) = 3s + 2. What is fk(g) + 21j(g)? 3g Let m(o) = 3o*3 + 5o*2 + 32o - 13. Let f(z) = -z*2 + 3. Calculate -5f(s) - m(s). -3s3 - 32s - 2 Let b(h) = -6h - 5. Let n(z) = -19z - 22. Let j(p) = -10p - 12. Let d(y) = 5j(y) - 3n(y). Give -5b(u) - 4d(u). 2u + 1 Let a(h) = -11h + 7. Let p(x) = -12x + 8. Determine -3a(k) + 2p(k). 9k - 5 Let f(o) = -5 + 5 + 3o*3 - 2o*2. Let t(g) = 11g + 119. Let p be t(-11). Let j(q) = -12q3 + 9q*2. What is pj(b) - 9f(b)? -3b*3 Suppose -j + 11 = -5y, -5y - 19 = -3j + 4j. Let x(u) = -11u - 1. Let c(n) = -6n. What is yx(v) + 5c(v)? 3v + 3 Let j(z) = -7z2 - 7z - 7. Let s(b) = -b - 1. Suppose 0 = -126r + 130r - 4. Give rj(w) - 7s(w). -7w2 Let h(v) = -v2 - v. Let f(w) = -3w*2 - 2w - 58. What is -f(j) + 2h(j)? j2 + 58 Let c(s) = -2s*2 - s + 1. Let a(n) = -13n*2 - 7n + 5. Calculate -a(w) + 6c(w). w2 + w + 1 Let m(k) = -6k - 6. Let f(i) = 12i + 11. Suppose 9p + 8p = 102. Determine pf(w) + 11m(w). 6w Let q(t) = 3t + 310. Let f(z) = 4z + 313. What is 5f(r) - 6q(r)? 2r - 295 Let f(l) = l2. Let v(i) = -26i*2 + 0i*3 + 11i*2 - i - 2i*3 + 24i*2. Suppose -8 = -4a, -5h + 2a = -2h - 2. What is hv(z) - 18f(z)? -4z*3 - 2z Let d(l) = 2l2 - 3. Let b(p) = -p2 + 6p + 1. Let c be b(3). Let q = -10 - -12. Let v(u) = 0u + 10 + qu - 2u - 6u*2. Calculate cd(f) + 3v(f). 2f*2 Let c(o) = -2o - 14. Let w be c(-8). Let k(y) = -7yw + 9y3 + y2 + 24 + 6y2. Let h(a) = 2a*3 + 5. Give -24h(p) + 5k(p). -3p*3 Let x(n) = -273n - 4. Let q(s) = -335244s - 4914. Calculate -2q(h) + 2457x(h). -273h Let r(k) = 2k + 5. Suppose 0 = -5j + 25. Let v(a) = a - 3. Let d be v(j). Let f(m) be the first derivative of -m*2/2 - 2m - 1. What is dr(w) + 5f(w)? -w Let j(y) = -480y. Let r(s) = -2400s. What is 16j(k) - 3r(k)? -480k Suppose -o - s = 9, -5o - 3s + 4s = 21. Let t(c) = -8c2 - 4c. Let q(v) be the first derivative of -3v3 - 5v*2/2 - 7. Calculate ot(x) + 4q(x). 4x2 Let u(n) = n3 + n*2 + 13. Let b be u(-3). Let w(y) = -8y*3 - 3y*2 - 3y - 3. Let a(j) = 15j3 + 5j*2 + 5j + 5. Give bw(f) - 3a(f). -5f3 Let u = 61 + -50. Let l(j) = 5 + 0 - 4 - 4 + 7j + uj2. Let w(k) be the first derivative of 5k*3/3 + 3k*2/2 - k + 3. Determine 3l(o) - 7w(o). -2o2 - 2 Let m(d) = 16 - d3 + 10d2 + 6d - 4d2 - 22. Let q(r) be the first derivative of r4/4 - 11r*3/3 - 11r*2/2 + 11r + 20. What is 11m(z) + 6q(z)? -5z3 Let i(p) = 8p*2 - 6p - 25. Let k(u) = -3u2 + 2u + 9. What is 4i(v) + 11k(v)? -v*2 - 2v - 1 Let i(f) = 5f2 - 10f - 4. Let g(d) be the second derivative of 11d4/12 - 7d*3/2 - 9d*2/2 - 64d. Calculate -6g(h) + 13i(h). -h*2 - 4h + 2 Let i(k) = -4k3 + 3k*2 - 3k. Let r(q) = 16q + 1808q*2 - 1852q*2 + 60q*3 + 28q. Give 88i(v) + 6r(v). 8v3 Let f(c) = -6c - 10. Let m(y) = y + 3. Let v be 5 + (8/(-10))/(30/75). Let w(r) = -r - 4. Let x(h) = vm(h) + 2w(h). Determine -f(d) - 8x(d). -2d + 2 Let i(j) = j + 2. Let z(m) = -1090m2 - 436m - 872. What is -436i(o) - z(o)? 1090o*2 Let l(m) = -18m*3 - 80m*2 - 26m + 26. Let b(i) = 9i3 + 40i*2 + 12i - 12. Calculate -13b(k) - 6l(k). -9k3 - 40k*2 Let i(o) = 4o*3 - 18o*2 - 12o - 6. Let b(l) = -4l3 + 18l*2 + 14l + 7. Give 6b(j) + 7i(j). 4j3 - 18j*2 Let o = 277 - 272. Let z(t) = t. Let p(g) = g. Give op(b) - 10z(b). -5b Let w(z) = 7z2 - 6z + 14. Let k(v) = -13v2 + 11v - 27. Let g(l) = 6k(l) + 11w(l). Let s = -8 + 9. Let d(r) = -3 + 4 + 0. What is sg(x) + 6d(x)? -x*2 - 2 Suppose -137i = -117i - 40. Suppose -2 = t - 1. Let r(q) = -7q + 1. Let o(l) = -l + 1. What is io(n) + tr(n)? 5n + 1 Let h(n) = -16n*2 + 6n + 5. Let x(l) = -31l2 + 13l + 11. Give -9h(q) + 4x(q). 20q2 - 2q - 1 Let y(h) = -h*3 + 6h. Let c(s) = -700s3 + 1008s. What is c(t) - 168y(t)? -532t*3 Let q(f) = -2f*2 - 989f - 3. Let y(k) = -k*2 + k - 1. Calculate -q(p) + 3y(p). -p*2 + 992p Let c = 0 - 6. Let o(f) = -17f - 6. Let g(h) = -11h - 5. Let l(j) = 5g(j) - 3o(j). Let p(w) = 4w + 6. Determine cl(t) - 7p(t). -4t Let m(k) = 13k + 187. Let t(b) = 10b + 185. Calculate -3m(u) + 4t(u). u + 179 Let n(o) = -8o3 + 17o2. Let l(x) = x3 - 2x2. Let v be (-3)/(-7) + ((-1406)/(-133) - 5). Determine vn(p) + 51l(p). 3p*3 Let t be 40/(-12)(-9)/6. Let j(p) = 4p - 6. Let d(m) = 2m - 3. Let z be (-21)/2 - (-7)/14. Let l = z - -8. Determine lj(g) + td(g). 2g - 3 Let h(g) = 4g*2 - 10. Let c(r) = -3r*2 + 10. Give 3c(p) + 2h(p). -p2 + 10 Let k(t) = -17t + 9. Let u = 66 + -57. Let a(v) = -uv - 20 - 23 + 48. What is 11a(n) - 6k(n)? 3n + 1 Suppose -2q + 3 - 1 = 2c, -2c + 3 = 3q. Let t(a) = 4 - 4 + 0 + q. Let x be (-28)/6 + 2/3. Let f(g) = g - 3. Calculate xt(d) - f(d). -d - 1 Let p = 249 + -250. Let n(i) = -i. Let l(t) = t - 3. What is pn(o) + l(o)? 2o - 3 Let p(s) = 3s*3 + 2s*2 + 4s + 2. Let k(x) = 8x3 + 7x*2 + 13x + 7. Let l(z) = z*3 + 5z*2 + 4z + 1. Let w be l(-3). Determine wp(u) - 2k(u). 5u3 + 2u Let m(l) = 60l + 7. Let f(u) = 61u + 9. What is 5f(v) - 6m(v)? -55v + 3 Let d(o) = 4o - 26. Let t(x) = -5. Let m(k) = d(k) - 5t(k). Let g(q) = q - 1. What is 2g(u) - m(u)? -2u - 1 Let y(v) = 2v*2 - 1. Let i(f) = 133 - 263 + 129. What is 6i(b) - y(b)? -2b2 - 5 Let f(t) = -41554t*3 + 1027t*2 - 1027. Let n(j) = -243j*3 + 6j*2 - 6. What is -6f(x) + 1027n(x)? -237x3 Let v(w) = -w3 + w*2 + w. Let d(b) = -16b*3 - 42b + 122b3 - 10b*3 - 42b*2 - 47b*3. Give d(h) + 42v(h). 7h3 Let n(r) = -91r + 39. Let o(g) = 62g - 26. Determine -5n(t) - 7o(t). 21t - 13 Let g(k) = 3k3 - 2k*2 + k - 42. Let c(q) = -5q*3 + 3q*2 - 2q + 85. What is -4c(h) - 7g(h)? -h*3 + 2h*2 + h - 46 Let q(i) = i. Let p(b) = -47b. Let o(y) = -55y. Let f(x) = -6o(x) + 7p(x). Give 4f(m) + q(m). 5m Let u(t) = t3 + 116t*2 + 5t. Let v(s) = s*3 + 117s*2 + 4s. What is -4u(a) + 5v(a)? a*3 + 121a2 Let g = -5 + 6. Let t(h) be the first derivative of h2/2 + 10. Let m(q) = 3q + 2. What is gm(y) - 2t(y)? y + 2 Let f(v) = -v + 1. Let d be f(-2). Let a = 144 - 148. Let o(p) = 2p - 1. Let w(h) = h. What is aw(j) + do(j)? 2j - 3 Let q(j) = -70j*2 - 2j. Let v(m) = -282m2 - 9m. Determine 18q(z) - 4v(z). -132z2 Let c(y) = 3y + 1. Let l(f) be the third derivative of -f*4/24 - 78f*2 + 1. What is c(m) + 5l(m)? -2m + 1 Let w(z) = 16z*2 - 218z + 10. Let y(u) = 5u2 - 73u + 3. Calculate -3w(t) + 10y(t). 2t2 - 76t Let y(k) = -1. Suppose 2w + 0w - 2 = 0. Let v(l) = -3l + 2. Let j(t) = 2t - 3. Suppose 3s + 5 = 14. Let d(u) = sv(u) + 4j(u). Calculate wd(x) - 6y(x). -x Let w(g) = -34g*2 - 16g + 20. Let f(t) = -11t2 - 5t + 6. Calculate 10f(k) - 3w(k). -8k2 - 2k Let i(k) = 3654k2. Let q(z) = 170z*2. Calculate -5i(h) + 108q(h). 90h2 Let v(x) = x2 + 3x + 3. Let z(t) be the second derivative of t4/4 + 5t*3/6 + 5t*2/2 + 13t + 2. Calculate 5v(h) - 3z(h). -4h2 Let h(j) = 7j*2 + 8j - 3. Let n(s) = 6s2 + 7s - 2. Let i be 1/4144/455. Determine ih(f) - 5n(f). -2f2 - 3f - 2 Let a(i) = -13i3 + 3i + 3. Let f(t) be the first derivative of 7t4/2 - t2 - 2t - 502. Give -2a(m) - 3f(m). -16m3 Let u(o) = -3o*2 + 31o + 6. Let m(s) = 3s2 - 30s - 7. Determine -4m(a) - 5u(a). 3a2 - 35a - 2 Let v(j) = -j - 2. Let n(d) = -2 + 6 - 6 + 3. Determine -8n(p) - 3v(p).	{ "pile_set_name": "DM Mathematics" }
p + 0w - q = -w. Which is the closest to 1/3? (a) g (b) 3 (c) p a Suppose 27p + 427 = -1000 - 490. What is the closest to 2 in -5, p, 5? 5 Let w be (2 - -1)(-44)/(-33). Let q = -0.026 + 2.726. Let h = q - 2.5. Which is the closest to w? (a) 3 (b) h (c) -3/5 a Let d be -8 - (3/((-135)/774) + 10). What is the nearest to -0.71 in -2, 2/3, d? d Let o = -3447 + 3447.1. What is the closest to o in 0.44, 4, -6? 0.44 Let z be 3 - 4-1 - (-56 - -63). Which is the nearest to 1/3? (a) -0.2 (b) 5 (c) z c Let h be (135 - 137)2/4. Which is the closest to -2/7? (a) -24 (b) h (c) 1 (d) -5/17 d Let g be 3/(-2)20/(-15). Suppose -4d - 2q = 2q + 4, gq = -5d + 10. Let o = 6/281 + 263/843. Which is the closest to -13? (a) -4 (b) d (c) o a Let k be (75/10 + -5)(-48)/420. Which is the closest to k? (a) -1/11 (b) -0.06 (c) 2/13 a Let w = 4.545 - 0.545. Let u = 179.5 + -179. Which is the nearest to 0? (a) w (b) 0.8 (c) u c Let s = -2.404 + -0.166. Let i = 3.57 + s. Let l = -4.5 + 4. What is the nearest to i in l, 3/2, 1? 1 Let m = -0.34 + 0.3. Let u = m + 2.04. Let f be (-6)/(-4)(-3207)/(-28863). What is the closest to 2 in u, 4, f? u Suppose -v + 5 = k, -3k + 19 = 2v + 2v. What is the nearest to 62 in -5, -4, k? k Let u = 3076 - 3077. Let y = -25 + 74/3. What is the nearest to -1 in u, 2/3, y? u Let y = 220.93 + -219.93. What is the closest to -0.1 in -6, -3, 2.5, y? y Let g = 2351 + -7057/3. What is the nearest to -5 in g, -0.1, -0.5, -2? -2 Let q = 61/14 + -48/7. Let c = -148 + 154.9. Let r = -5.9 + c. What is the nearest to r in q, 2/19, 0.3? 0.3 Let q be 52/312 - (-4)/(-6). Let c be ((-8)/(-12))/(32/(-396)). What is the nearest to -1 in c, -3, q? q Let w = -2 - -4. Let a = 2264/9 + -252. Let u = -92.2 - -92.5. What is the closest to 3 in w, a, u? w Let x = -2112 - -2116. Which is the closest to 0.04? (a) x (b) 5 (c) -35 a Let p = 0.038 + -0.098. Let f = -663/7 - -1333/14. Which is the nearest to f? (a) -0.1 (b) p (c) 2 (d) -2/3 b Let f = 49.88 + -49.78. Which is the closest to -1? (a) f (b) -5 (c) -4 a Suppose 2u = -0u - 20. Let f(v) = v3 + 10v*2 - v - 7. Let d be f(u). Suppose 9j + 2 = 10j. Which is the closest to -0.1? (a) j (b) 4 (c) d a Let v be 1661/(-6795) - (-10)/(-18). What is the nearest to -2/9 in v, 3/7, -2, 24? v Let h = 3253/13 + -13025/52. Let r = -15 + 15.18. Which is the nearest to h? (a) -0.1 (b) 3 (c) r a Let q = -0.1072 - -0.1032. Which is the closest to -1/2? (a) q (b) 0.4 (c) 3 (d) 1/3 a Let l(v) = v2 - 4v - 4. Let y be l(-3). Let b = y + -88/5. Let x = 0.017 - 5.017. What is the closest to 0 in x, 2, b? b Let k = -536.915 + 541. Let m = k - 0.085. Which is the nearest to m? (a) 1/8 (b) -0.3 (c) -2 a Suppose 51 = -86o - 35. Let f = -94 - -95. Which is the nearest to f? (a) -14 (b) -1/3 (c) o b Let d = -36738 + 36737.7. Let c = -5 + 4.95. What is the closest to -0.1 in 2/3, d, -1/2, c? c Suppose 4k - 175 = -199. Let u be k/(-16) + (4 - (-230)/(-80)). What is the nearest to 0 in 0.06, u, -5? 0.06 Let y = 281 - 280. Which is the nearest to -1? (a) 0 (b) -5 (c) y (d) -0.04 d Let o = 74 + -74. Suppose -8 = -r - r + 4j, 2r - 5j = 9. Let i(w) = -w3 + w2 + 3w - 5. Let k be i(r). Which is the closest to 0? (a) k (b) 5 (c) o c Let l = -3249 - -3200. What is the nearest to l in 3/5, 2/13, -11? -11 Let h = -202 - -120. Let p = -82.67 - h. Let d = 0.37 + p. Which is the nearest to -0.1? (a) d (b) 0 (c) 6 b Let u(o) = o*3 - 7o*2 + 16o - 63. Let h be u(6). Suppose 2p + 11 = 6p + 5z, 11 = 2p - 3z. Which is the nearest to -1/4? (a) p (b) h (c) -2/11 c Let d = -42.14 - -41.64. Let v be 3/12 + 0/(-2). Which is the closest to -8? (a) d (b) v (c) -4/7 c Let w = -3.766 + -0.992. Let p = w - 0.242. What is the closest to 1/6 in -4, 0.4, p? 0.4 Let u be (2149/77 - 28) + (-8)/33. What is the closest to u in 3, 1, -0.5, 37? -0.5 Suppose -10l + 14l - 4 = 0. Let d be (-1 - -2)-3 - (-2)/l. Let o be d2/(-26)-2. Which is the closest to 0.1? (a) 0.3 (b) 0.2 (c) o b Let m = 14679/13 - 1129. Let v = 5 - 4. What is the nearest to v in m, 6, -0.1? m Let p = 519.95 + 6.05. Let z = -514 + p. What is the nearest to 1 in 5/3, -1, z? 5/3 Let f = -64.8 + 97.1. Let w = 29.3 - f. Which is the nearest to 0? (a) 4/9 (b) w (c) 45 (d) -4 a Suppose 2z + 3h = -13, -62h + 8 = -5z - 66h. Which is the closest to 1/4? (a) 0 (b) z (c) 5 (d) 4/7 a Suppose -3h = h + 8. Let p(d) = d*3 - 35d*2 - 61d - 475. Let u be p(37). Let q be (-4)/(-6)uh/12. Which is the closest to 2/5? (a) q (b) 0.2 (c) 2 b Let p = 11813 + -177197/15. Which is the closest to p? (a) 5 (b) -5 (c) -4 c Let f = -3 - -3. Let q = 9432/23 - 410. What is the closest to f in q, 3, 3/5? q Let i = 2/1059 + 9509/11649. Let y = -103/99 + i. Let f = 13 - 18. What is the nearest to -1/4 in 0.5, y, f? y Let z = 4.3 - 0.3. Suppose -16q = 88 - 24. Let m be ((-2)/q)/(11 - (-470)/(-40)). What is the nearest to 0.1 in m, 0.1, z? 0.1 Let b = 7721 + -7720.7. What is the closest to -9 in 0.06, -0.16, b, 1/4? -0.16 Let i = 85 + -83.1. Let l = 1.4 - i. Which is the nearest to 1/3? (a) 4 (b) -1/42 (c) l b Let l = -552881 - -4975931/9. Let z = 8 + -6. Let o = z - 2. What is the closest to l in 3/5, o, 4/3? o Let y be (-2)/(-4)(-105)/(-70). Which is the closest to y? (a) -0.5 (b) -3 (c) -12 a Let u be 13 + 2 - (-5200)/(-350). Suppose -468 = -5r - r. What is the nearest to 0.1 in -3, r, -2, u? u Let z be (-12)/(-1720)(-4)/(-3). Let k = -68230 + 68232. What is the closest to k in 0, z, -0.1? z Let g = -9 + -266. Let j = -272 - g. Which is the closest to 3? (a) j (b) -2/13 (c) 4/7 a Let l = -2236.09 + 2235.9. What is the closest to 1 in l, 3/2, -1, 0.4? 3/2 Let y = -51 + 75. Suppose -y = -10l + 4l. Suppose -l = -d - 5. What is the nearest to -2/7 in d, 4, -1/2? -1/2 Let o = -2.737 + 2.537. Which is the closest to o? (a) 5/8 (b) 0.3 (c) 32 b Let w = 13.408 - 13. Let t = w - 0.358. What is the nearest to 2 in 3, -4, t? 3 Let i = 18.1434 - -0.0566. Let o = i - 18. What is the nearest to 3 in 2, o, 0? 2 Let v = 0.1737 - -2.8263. Which is the closest to -0.1? (a) -0.2 (b) 3/2 (c) 11 (d) v a Let w = 9.7 - 0.7. Let i = 9 - w. Let g(y) = 30y + 117. Let r be g(-4). What is the closest to r in 0.01, i, -0.5? -0.5 Suppose 928y = 918y - 10. Which is the nearest to y? (a) -0.4 (b) -78 (c) 1/3 a Let y = -19.26 + -754.74. Let j = y + 773.9. Which is the closest to j? (a) 15 (b) -0.2 (c) 8 b Let s = -549.2 + 549.4. What is the nearest to -23/5 in 6, s, 0.1? 0.1 Let t = -9 + 9.1. Let f = -5792 + 5795. What is the closest to t in -2/3, 5, f, -5? -2/3 Let y = -7.56 - -8.1. Let i = y + -0.74. Let b = 0.03 - 0.13. What is the nearest to b in -2/3, i, 0.3? i Suppose -24p + 20p + 27 = -3v, 0 = -4v + p - 23. Let w = -0.18 + 1.78. Let g = 1.4 - w. Which is the closest to g? (a) 0 (b) -2 (c) v a Let n be (-2)/(-15)100/(-16). Suppose 2i + w + 3 = 3i, 0 = -5i - 5w - 25. Let x = -0.013 + 0.313. Which is the nearest to x? (a) n (b) 0.2 (c) i b Let i = 2 - 3. Let u = 685 - 8907/13. Which is the closest to i? (a) u (b) -1/10 (c) -2 a Suppose -3102 = -11a + 17a. Let t = a - -518. What is the nearest to t in 18, 3/2, 3/7? 3/2 Let h = 97.003 + -97. Let u = 0.103 - h. Let x = 0.2 - 0.6. Which is the nearest to 4? (a) u (b) 4 (c) x b Let b = 4.095 + -3.89. Let y = 0.205 - b. What is the closest to y in 0.4, 0.5, 1/9? 1/9 Let n(s) = 9s3 + 2s*2 - s - 1. Let q be n(1). Let d be (q/2)/((-4)/88 + 0). Let x be (-4)/(-3(-12)/d). What is the closest to -1/4 in 0, -5, x? 0 Let w = 3.03 + -4.03. Let u = 9 + -5. Let r be (7 - u - 4)0. Which is the closest to w? (a) 7 (b) r (c) -3/5 c Let f(u) = 11u + 5. Let k be f(-19). Let p = -205 - k. Which is the closest to 8/3? (a) -3 (b) p (c) 0.5 c Let s = 8.574 - 8.674. Which is the nearest to -27/2? (a) 3/7 (b) -2/17 (c) s b Let k(m) = 10m + 41. Let n be k(-6). Let s be n/(-5) + -4 + 0. Let f = 4 - 3. Which is the closest to 2/7? (a) f (b) -4 (c) s c Let q be ((-16)/(-6))/(-4)-2. What is the closest to 0.3 in -3/7, q, -7/5, -1/4? -1/4 Let a be (-16)/653705/20. Let l = a + 32180/9. What is the closest to 1 in -3, 0.1, l? 0.1 Let a = 3.248 + 0.	{ "pile_set_name": "DM Mathematics" }
.0505 (c) 3/19 c Which is the closest to 1/2? (a) -24/13 (b) -0.4 (c) 2/409 (d) 0.2 d Which is the closest to 0? (a) -4/5 (b) -0.2 (c) 6 (d) -4/7 b Which is the nearest to 2/5? (a) -2 (b) 15 (c) 20.8 a What is the nearest to 0.1 in 0.72, -5, -2/7, 136.3? -2/7 What is the closest to -0.1 in 8, -1, 24, 0.2? 0.2 What is the closest to -1 in -0.01, 1/14, -21? -0.01 Which is the nearest to -10? (a) -32 (b) 0.1 (c) 0.071 c Which is the closest to 0? (a) 10 (b) -2/3 (c) -13.28 (d) -0.3 d Which is the closest to 2/5? (a) -1/8 (b) -1/3 (c) -3/4 (d) -12/5 a What is the nearest to -1/4 in -3.2, -38, -2/7, 0.5? -2/7 What is the closest to 29 in -2.06, -0.2, 0.3? 0.3 Which is the closest to 0.2? (a) 4 (b) 0.29 (c) -3/7 b What is the closest to 0 in -237, 1, -3/2, 0.2? 0.2 What is the closest to 1/2 in -2/9, 3/4, 0.3, 72, -221.7? 0.3 Which is the nearest to -708? (a) 4/5 (b) -3 (c) -95 c What is the closest to 0.1 in -5, 6/11, -3, -94? 6/11 Which is the closest to 0? (a) -3 (b) 0.048 (c) -0.1 (d) -5 b Which is the closest to 2/11? (a) -25 (b) 0.1 (c) 3 (d) -0.4 b What is the nearest to -4 in 3, 5, 3933? 3 What is the nearest to 0 in -2, -19.8, 6? -2 What is the closest to 210 in -5, 5, 1787, 1? 5 Which is the closest to 1? (a) 5 (b) 1/14 (c) -2/187 b What is the nearest to -1/975 in -7/3, -5/3, -4, -3, -2/19? -2/19 What is the closest to -0.3 in 2, 124, -11? 2 Which is the nearest to -1963? (a) 2/7 (b) 0 (c) 1/3 (d) -0.03 (e) 0.4 d Which is the closest to -0.3? (a) 2 (b) -1.1 (c) -1/7 (d) -41 c Which is the nearest to -5.85? (a) 2/21 (b) 1 (c) -5 (d) 5 c What is the nearest to -1 in -4, -51/7, 21/5, 1.4? 1.4 Which is the closest to 2/35? (a) -1/4 (b) -3 (c) 2 a What is the closest to -4 in 51, 4, -2.2? -2.2 What is the nearest to -17292 in -1, -0.1, -5/4, 0.2, 0.5? -5/4 Which is the closest to -2.1? (a) 1/3 (b) 1/6 (c) 4 (d) 4/3 b What is the closest to -3 in 3, 2, 6/5, 1/2, -93? 1/2 Which is the nearest to -0.4? (a) 3/8 (b) -1938 (c) -1/6 c What is the closest to 2/18043 in 0.2, -2/3, -0.11? -0.11 What is the nearest to 2 in 5, -1.4, -3/68, 8? -3/68 What is the closest to 0 in 5/7, -2/5, -1/3, 2/45? 2/45 Which is the nearest to -0.6? (a) -144/11 (b) -3 (c) 0 c What is the nearest to 1 in 240, -3, -1, 0.2, 0? 0.2 Which is the closest to 10? (a) 1/6 (b) -2/3 (c) -3128 a What is the nearest to 0.2 in -0.4, -23283, -56? -0.4 Which is the nearest to 21? (a) -3 (b) -2 (c) -1/7 (d) -0.0353 d Which is the closest to 0.06? (a) 34 (b) 1/4 (c) -1 (d) 0.02 (e) -2/3 d What is the nearest to -0.1 in 42, -3/7, 3/7, -1/2? -3/7 What is the closest to 0 in 0.023, -140/13, -1/3, -5? 0.023 What is the closest to 4.8 in -1, -0.03, -4, -0.2, -6? -0.03 What is the nearest to -1/3 in 0.2, -7/6, -18/11, -0.5, -2? -0.5 What is the closest to 109.09 in 0.1, 3, 0, -2/7, 2/7? 3 Which is the nearest to 3? (a) 2/9 (b) 4/7 (c) -0.1 (d) 0.7 (e) -842 d What is the closest to 2/5 in -1, 17, 1/3, 1/26? 1/3 Which is the closest to 2/9? (a) -0.1 (b) -1 (c) 2/7 (d) -1.4 c Which is the closest to -0.4? (a) 3 (b) -0.03 (c) 4 (d) 44 b What is the closest to -1/3 in 13/2, 0.8, 0.15, 1/7, -42? 1/7 Which is the nearest to -1/4? (a) -0.9518 (b) -3/10 (c) 0.4 (d) -4 b What is the nearest to 6 in -3/7, -2/3, 1/5, -31/3, 0? 1/5 Which is the nearest to -14? (a) 0 (b) 0.452 (c) 0.1 a What is the closest to 3.86 in 1/2, 2/7, 2/3? 2/3 What is the closest to 1/4 in 0, 2/11, 33695? 2/11 What is the closest to -37.8 in 2/3, 3/70, 0.3? 3/70 Which is the nearest to 0.1? (a) 677 (b) 5 (c) 4/13 c Which is the closest to -2? (a) -1/32 (b) 4.2 (c) -88 a Which is the closest to -0.2? (a) -3144 (b) -0.2 (c) 2/3 b Which is the nearest to 0? (a) -5 (b) 21 (c) 7/5 (d) 4 (e) -2/3 e What is the closest to -155 in 3, 1/4, 4? 1/4 Which is the closest to -0.3? (a) -1 (b) 2 (c) 166 (d) 0.2 d What is the closest to -38 in 3, -0.5, 2/27, 0.5? -0.5 Which is the nearest to 0.1918? (a) 0.2 (b) -4 (c) -7 (d) 4 (e) -1/9 a Which is the closest to 0.0304? (a) -2/5 (b) -5 (c) -2 a Which is the closest to 1.8? (a) -3 (b) -1.9 (c) -2/3 c Which is the closest to -2/3? (a) 5 (b) 1888 (c) 0 (d) -0.1 (e) 15 d What is the nearest to -2/3 in 0.1, -1/2, 3, 4/9? -1/2 Which is the closest to -30? (a) -2 (b) 4/9 (c) -9 (d) 0.1 c What is the nearest to -130 in -0.4, 5, 409? -0.4 What is the nearest to -12 in -1/2, -1/3, -84, -0.3? -1/2 Which is the nearest to 1? (a) -4/3 (b) -0.3 (c) 652 (d) 4/7 d Which is the nearest to 2? (a) 0.8 (b) -3/2 (c) -1011 a Which is the nearest to -5? (a) 1 (b) -0.005 (c) -31 b What is the closest to 12 in 4, -0.12, -1? 4 Which is the nearest to 2? (a) 103 (b) 4 (c) 1.33 (d) 4/3 (e) -3 d Which is the closest to -2? (a) 12 (b) -2/15 (c) 92 b What is the nearest to -17 in 6/11, -1/3, -3/293, 3/2, -5? -5 Which is the closest to 1? (a) -2/13 (b) -3/5 (c) 7 (d) 0.3 (e) 3/67 d What is the closest to 38.6 in 10, 0, 3/4? 10 What is the nearest to 0 in 0.1, 6, 48.4, -2, -7? 0.1 Which is the nearest to -1? (a) 1/7 (b) 0.011 (c) 2 (d) 1/4 (e) 224 b What is the closest to 1.9 in 0.4, -8/5, -0.5? 0.4 Which is the nearest to -193? (a) 0.03 (b) -4 (c) -2/7 b What is the nearest to -2/43 in 515, -0.4, 2/13? 2/13 What is the nearest to -4 in -24, 4, 0.4, -4/5, 237? -4/5 What is the nearest to -4 in 4, 0.2, -420, 5, 3/5? 0.2 What is the closest to -22 in -2, -0.1, 1/96, 0.1? -2 What is the nearest to -30/7 in -4, 4, 5? -4 Which is the closest to -2? (a) 2/5 (b) -1.2 (c) 1/3 (d) 2 b What is the closest to -13 in -3, -1/9, 3/5, 1, -18? -18 What is the nearest to -2/7 in 4/7, -8/11, -8/395? -8/395 Which is the closest to 67? (a) 2/7 (b) -66 (c) 0.4 (d) -5 (e) -0.5 c Which is the nearest to -2? (a) 18 (b) -2/3 (c) 3/43 (d) -0.1 b Which is the nearest to 0.1? (a) 0 (b) 11 (c) -2/273 (d) -3 a Which is the closest to 0? (a) 25/16 (b) -2/17 (c) 1/24 c What is the nearest to -135 in 2, -3/8, 4, 0? -3/8 What is the closest to 1 in -65.1, -7, 0.2, -2/7? 0.2 What is the closest to -48 in -1/5, 4, 0.2, 14/9? -1/5 What is the closest to 1/3 in 220, -1/2, -1/9, -15, 5? -1/9 Which is the closest to -4/7? (a) 1/3 (b) -0.02 (c) 2/5 (d) -9 b What is the closest to -1 in 2/9, -0.1, -0.075, -1/8, 213? -1/8 What is the closest to 0.5 in 347, 6, 3, 0.3? 0.3 Which is the closest to -2? (a) -252/11 (b) -42 (c) -1/4 c Which is the nearest to 1? (a) -1 (b) -39 (c) -0.4 (d) 3/11 d Which is the closest to 3/95? (a) 2/5 (b) -1/3 (c) -2 (d) -3/5 b What is the closest to -3 in 2, 5, -6/19, -1, 2/9? -1 Which is the nearest to -0.3? (a) 3.7 (b) -1/5 (c) -1.4 b What is the closest to -78 in -508, -14, -0.5? -14 Which is the nearest to 5/26? (a) -1/3 (b) -0.5 (c) 1/2 c Which is the closest to -5/7? (a) -7 (b) 41 (c) -1/5 (d) -1 d What is the nearest to -8 in -3/8, 3/8, 0.2, 0.002? -3/8 What is the nearest to -2/7 in -108, 1, 0.295? 0.295 Which is the closest to -1/3? (a) 54/13 (b) -14 (c) -19 a Which is the closest to -7? (a) 1 (b) 117/4 (c) 6 a What is the nearest to 30.5 in -2/7, -2/11, 7? 7 What is the nearest to 3.5 in 3/2, 2/11, 0.4, -0.4? 3/2 What is the nearest to 1 in -0.01, 0.3, 2/15, 1, -23234? 1 What is the nearest to -5/3 in -251, 199, 2/19? 2/19 Which is the closest to 9? (a) 1/7 (b) 0.5 (c) -1 (d) -8403 (e) -2 b Which is the closest to -5? (a) 1/4 (b) -1/5 (c) -1.4 (d) 18 c What is the closest to 9 in -1746, -1, 0? 0 Which is the nearest to 13? (a) -1.1 (b) 821 (c) 3 c What is the nearest to 9 in -120, 8, 9? 9 What is the closest to 5 in 5, -2/11, -7, -24/13? 5 What is the closest to -0.24 in 0.3, 2/17, -0.1, 0.1, -76? -0.1 What is the closest to 10 in -0.1, 2/147, 0.17? 0.17 Which is the nearest to -0.6? (a) 5 (b) 3 (c) 9/5 (d) 1.13 d What is the closest to 3/8 in -1661/4, -2/7, 5? -2/7 What is the nearest to 1 in -8/7, -5, 0.08, 0.6, -0.02? 0.6 Which is the closest to -17? (a) -3 (b) 2555 (c) 2/13 a Which is the nearest to 0.263? (a) -1 (b) 0 (c) -3 (d) -0.1 (e) 5 b What is the nearest to 1/2 in 1/6, 0, 103? 1/6 What is the closest to 2/3 in -81, 2, -0.104, 0, -1/2? 0 Which is the closest to 1/2? (a) -0.07 (b) -0.1	{ "pile_set_name": "DM Mathematics" }
closest to 645994 in -4/7, -4, -3? -4/7 Which is the closest to 3? (a) 5 (b) 2.53 (c) -1/6 (d) 4 b Which is the closest to -2/5? (a) -2 (b) -0.8 (c) 38 (d) -0.03 (e) 6 d What is the closest to 1 in -4/7, 1, -20, 3/2, -4? 1 What is the nearest to 0 in 2, 1/9, -0.3, -1/122? -1/122 Which is the closest to 0? (a) 0 (b) -409 (c) 2 (d) 1 a Which is the nearest to 1.525? (a) 3 (b) 0.1 (c) 0 b Which is the closest to -1? (a) 6.09 (b) 1.9 (c) 1 (d) -0.2 d Which is the nearest to 0? (a) -1 (b) 3.7 (c) -3 (d) -2/3 (e) -29/5 d Which is the closest to 0.2? (a) -30 (b) 2/3 (c) 4795 (d) -4 b Which is the closest to -7? (a) 514 (b) 1/7 (c) -6 (d) 0 (e) -4 c Which is the closest to 0? (a) -0.36 (b) -0.5 (c) -0.1 (d) -1039 c Which is the nearest to -1? (a) 2 (b) 272.5 (c) 12/11 c Which is the closest to 48? (a) -10 (b) 0.02 (c) 0.2 (d) -1/3 (e) -4/5 c What is the closest to -0.1 in -1, 1185, 0.4, -2/7? -2/7 Which is the nearest to 1? (a) -181 (b) -0.044 (c) -3/5 (d) -0.1 b What is the nearest to 0.3 in -2/11, 6/7, -1.405, 2? -2/11 Which is the closest to -7? (a) 5 (b) -70 (c) 20 (d) 21 a Which is the nearest to 1/2? (a) 9 (b) 0.7 (c) 2/3 (d) -1/5 (e) -3 c Which is the closest to 0.4? (a) 117.3 (b) 1/4 (c) -1/6 (d) -2/11 b Which is the closest to 2/5? (a) 29 (b) 5 (c) -1/38 c What is the closest to -0.1 in -0.1, 27.6, -5, -2, 2? -0.1 What is the closest to 8863 in 3, -1, -0.3, -0.01? 3 What is the closest to -1 in -13, -0.16, 0.09, -2, 1? -0.16 What is the nearest to 0.64 in -1, 0, 1, -0.13? 1 What is the nearest to 0.10146 in 0.4, 3, -11, -2? 0.4 What is the nearest to 0.64 in 5, 0.17, -0.12? 0.17 What is the nearest to 5 in -18/53, -2, 4? 4 What is the nearest to 0.3 in -2, -39, -4, -0.8? -0.8 What is the nearest to 13 in -1.5, 0.5, 1/5, -115, 0.1? 0.5 Which is the closest to -1/2? (a) -0.13 (b) 4/5 (c) -1 (d) 3/7 a Which is the nearest to 0.03? (a) 1 (b) -7/12 (c) 0.4 (d) 3/4 c Which is the nearest to -24? (a) -0.19 (b) -20 (c) 0.5 b What is the closest to -225 in -5/4, 3/16, -2/3, -2? -2 Which is the closest to -11? (a) -5 (b) -12 (c) 0.4 (d) -3/7 (e) 3/7 b What is the nearest to 2 in 3, 1/12, 2/21, -284.4? 3 What is the closest to -1/3 in -0.5, 19, 121, -2/3? -0.5 Which is the nearest to 2/9? (a) -5.63 (b) -4/5 (c) 82 b Which is the closest to 2/9? (a) -26 (b) -1/2 (c) 0.01 (d) 6/65 (e) -3/7 d Which is the closest to -0.2? (a) 12 (b) -3 (c) 7 (d) 1/7 d What is the closest to -8065 in -9, 0.5, 0.6? -9 What is the closest to 0.1 in 3263, 5, 2/3, -3? 2/3 Which is the closest to 1/46? (a) 13 (b) 4 (c) -2 (d) 0.3 d Which is the nearest to -7/3? (a) -387 (b) 0 (c) -0.5 c What is the nearest to 1 in 1/3, 1/14, 2, -1/8, 11? 1/3 Which is the nearest to 1? (a) -1/16 (b) 2/9 (c) 21 (d) -0.037 b Which is the closest to -1? (a) -7 (b) -8/367 (c) -4/3 (d) -1/8 c What is the closest to 1/5 in -1.2, -2/119, -6, 2/3? -2/119 Which is the nearest to -0.3? (a) -60 (b) 0.5 (c) 46 (d) -0.1 d Which is the nearest to 0? (a) 0.06 (b) -144 (c) -0.8 (d) 0 d What is the closest to -35 in -37, -0.2, -3? -37 What is the nearest to -1 in 5, -5, 0.76, 1/5? 1/5 What is the closest to 1/3 in -4, 0.2, 0.1, -494? 0.2 Which is the nearest to 1? (a) 2/535 (b) 4 (c) -4 (d) -5 a Which is the closest to -0.3? (a) -7 (b) 15 (c) -1/76 c What is the nearest to -2/1339 in -4, 9, -0.4, 3? -0.4 What is the nearest to -17.2 in 1/3, 0.1, -10, 4? -10 What is the closest to -8 in -907, -2/7, -1/2? -1/2 What is the nearest to 0 in 2, 8, -687? 2 What is the nearest to -1 in -2954, -25, -4? -4 What is the nearest to -0.1 in -1, -2, -326? -1 Which is the nearest to 0.2? (a) -0.5 (b) -1/23 (c) 0.6 (d) -1/6 (e) 0.3 e What is the closest to -2/149 in -0.5, -2, -0.04, -1/24? -0.04 Which is the nearest to 1? (a) 3/733 (b) 0.8 (c) 11 b What is the nearest to 589 in -227, 3, -2? 3 Which is the closest to -0.01? (a) -0.5 (b) -409.9 (c) 5 a What is the closest to 0 in -0.4, -291.6, 0, 2? 0 What is the closest to 0 in -0.2, 10, -1, -0.3, 18? -0.2 What is the nearest to 26 in -3/11, 0, 14, -5? 14 What is the closest to 1 in 20, -0.02, 2/9, 3/4? 3/4 Which is the closest to 0.1? (a) 2/9 (b) 1.9 (c) -2/7 (d) -8/5 a What is the nearest to -0.2 in -0.1, -1/8, 0, 12, 1/6? -1/8 What is the closest to 2/3 in -866, 3, 0, -13? 0 What is the nearest to -2 in 9311, 1, 2/29? 2/29 What is the nearest to -22 in -5, 11, -1, 0, -4? -5 Which is the nearest to 1/185? (a) -25 (b) -2/7 (c) 5 b What is the nearest to 8 in 63, 4/3, 0.4, -2/9, -0.8? 4/3 What is the closest to -3 in 2/13, 47/3, -16, 0, 2? 0 What is the closest to 2/9 in 1/7, 18, -4/3, 37? 1/7 Which is the nearest to 18? (a) -1 (b) -0.92 (c) 16 (d) -1/7 c What is the nearest to -3/5 in 0.3, 1/3, 2/23, 1/4, 0.2? 2/23 What is the nearest to -0.1 in 9, -2/13, -9? -2/13 Which is the closest to 2/7? (a) -2/45 (b) 33 (c) -1/9 (d) 2/11 (e) 7 d Which is the closest to 0.1? (a) -3 (b) 10423/4 (c) 0.5 c Which is the closest to -0.073? (a) 10 (b) 1/2 (c) 0.2 (d) -0.02 (e) -5 d What is the closest to -1/3 in 4, -5, -0.3, 5/14009? -0.3 What is the closest to -2.4361 in -2, -4, -2/3? -2 Which is the nearest to 0? (a) -58044 (b) 5 (c) 1 c Which is the closest to 284? (a) 0 (b) 2 (c) 3 (d) -3 (e) 0.2 c What is the closest to -0.263 in -0.1, -1, -1/5, 0.12? -1/5 What is the nearest to 1 in -5, -2, 1051, 0.1, -5/6? 0.1 Which is the nearest to -0.03? (a) 1/8 (b) -6 (c) -0.1199 c Which is the closest to -0.04? (a) 30 (b) 2 (c) 2/11 (d) 3 c Which is the nearest to -10? (a) 1/5 (b) -12 (c) -3 (d) 0.34 b What is the closest to 12 in 3, -3, 2/3, -3/2? 3 What is the nearest to -0.06 in 29, 4, -4? -4 What is the closest to 19 in -2, 8, -1, 1/17? 8 Which is the nearest to 1/25? (a) 1 (b) 0.2 (c) 10/993 c What is the nearest to -6952 in 1, 4, 2? 1 Which is the nearest to -7396? (a) 1/3 (b) 0 (c) -0.1 c What is the nearest to 1/2 in -2/7, -1, 82, 16? -2/7 Which is the nearest to -7/3? (a) 1/10 (b) -1/180 (c) 2/5 (d) 2 b Which is the closest to 0? (a) -5/3 (b) -46 (c) -2 (d) -0.172 (e) -5 d What is the closest to -36 in -0.5, 65, 4, -2/11? -0.5 What is the closest to 0.3 in 0.16, 0.4, -3/2, 1/3, -1/2? 1/3 Which is the nearest to -59? (a) -4 (b) 0.2 (c) -5 (d) 1/24 c What is the nearest to -2 in 1.4, 0.03, 15, -2/7? -2/7 Which is the nearest to -0.2? (a) -186 (b) 1/5 (c) 5/6 b Which is the closest to 0.1? (a) 0.5 (b) -1 (c) -80/81 (d) 0.2 d What is the nearest to 1 in 3, 0.4, 5, -3/4, -9? 0.4 What is the nearest to -8 in 14/3, 9, 0, 0.5? 0 What is the closest to 14747 in -1/3, -5, 0.4? 0.4 Which is the nearest to 0? (a) 4 (b) 2 (c) -24/25 (d) -6 c What is the nearest to 42976 in -3, -5, 3? 3 Which is the closest to 3? (a) 0.2 (b) -1/4 (c) -83.1 (d) -0.33 a Which is the nearest to 3/7? (a) 1/2 (b) 10612 (c) 4 a Which is the nearest to -1260? (a) 6 (b) -5 (c) 0.3 (d) 0.04 b What is the closest to -2/83 in -0.05, 0.5, 9? -0.05 Which is the closest to 3? (a) 0.02 (b) -0.9 (c) 5 (d) -1/6 c Which is the nearest to 2/5? (a) -0.32 (b) -10 (c) -0.5 (d) 6 (e) -2/19 e Which is the nearest to 0? (a) -0.01 (b) 1.7 (c) -56 a What is the closest to -1 in -5, -4, 10, 3.2? -4 What is the closest to 5/12 in 25, 0, 5, -1/3, -52? 0 What is the closest to -0.1 in 980, 12, -2, -12, -5? -2 Which is the closest to -0.46? (a) 0.1 (b) 0.2 (c) 107 a Which is the nearest to -0.2? (a) 4 (b) 1/8 (c) -3656 (d) 2/5 b Which is the nearest to -0.14? (a) -0.3 (b) 1/8 (c) 2 (d) -269 a Which is the nearest to -0.08? (a) 3/2 (b) -41 (c) 26 (d) -0.3 (e) 0.5 d Which is the nearest to 1? (a) 9 (b) 0.2 (c) 0.1 (d) -243/5 b Which is the nearest to 0.1? (a) -3 (b) 7 (c) -2/163 c What is the closest to 0 in 3, 14, -3/16, 1, 0.04? 0.04 What is the closest to 0.1 in 5, -1/5, -2.9092, -4, -0.3? -1/5 What is the nearest to -7/8 in -5, 5, 2/5, 9? 2/5 What is the closest to 2 in -3, 4/7, -0.4, -991? 4/7 What is the nearest to 1/20 in -1/445, 1/2, 4? -1/445 Which is the nearest to 1/3? (a) -368 (b) 0.5 (c) -2/5 (d) -2/3 b What is the nearest to -26 in -3, 2/11, -5, -3/29, -1? -5 Which is the nearest to 3	{ "pile_set_name": "DM Mathematics" }
ters picked without replacement from {r: 1, a: 5, i: 1, o: 1, j: 6}? 6/1001 Two letters picked without replacement from ggqfqafaqfgqqfxqfa. Give prob of picking 1 g and 1 q. 2/17 Three letters picked without replacement from errjjzejizzjregjjz. What is prob of picking 2 r and 1 z? 1/68 Calculate prob of picking 3 h when three letters picked without replacement from {h: 3, z: 3, f: 1}. 1/35 What is prob of picking 1 k, 1 b, and 2 q when four letters picked without replacement from kkkklqqb? 2/35 Four letters picked without replacement from nrrnrrnnnr. What is prob of picking 2 n and 2 r? 10/21 Three letters picked without replacement from {x: 5, y: 2, s: 1, g: 5, f: 3, u: 4}. Give prob of picking 1 s and 2 g. 1/114 Calculate prob of picking 1 h and 1 f when two letters picked without replacement from {h: 1, g: 1, f: 2}. 1/3 Two letters picked without replacement from {b: 1, e: 3, n: 2, z: 4}. What is prob of picking 1 z and 1 n? 8/45 Calculate prob of picking 1 t, 1 n, and 1 y when three letters picked without replacement from tnynyyyntnm. 32/165 Calculate prob of picking 1 w and 1 o when two letters picked without replacement from {o: 1, p: 2, w: 2}. 1/5 What is prob of picking 2 e and 1 v when three letters picked without replacement from rvaevjg? 0 Four letters picked without replacement from {c: 2, n: 6}. Give prob of picking 4 n. 3/14 Calculate prob of picking 1 a and 1 v when two letters picked without replacement from {a: 4, v: 2}. 8/15 Calculate prob of picking 2 k, 1 o, and 1 h when four letters picked without replacement from {o: 1, h: 2, k: 14}. 13/170 Calculate prob of picking 1 b and 1 g when two letters picked without replacement from {b: 1, f: 7, g: 6}. 6/91 What is prob of picking 1 n and 3 m when four letters picked without replacement from mnnnnmmmnnmn? 14/99 Four letters picked without replacement from {f: 6, l: 1, i: 7}. What is prob of picking 4 i? 5/143 Two letters picked without replacement from bbznz. Give prob of picking 1 z and 1 n. 1/5 What is prob of picking 2 d when two letters picked without replacement from {t: 11, d: 2}? 1/78 Three letters picked without replacement from {y: 1, z: 1, q: 2}. What is prob of picking 2 q and 1 y? 1/4 Four letters picked without replacement from {s: 1, l: 1, t: 1, q: 3, e: 1}. Give prob of picking 1 s, 2 q, and 1 l. 3/35 What is prob of picking 2 q when two letters picked without replacement from {q: 2, c: 1, l: 2}? 1/10 Three letters picked without replacement from mjmmljmmjl. Give prob of picking 1 l and 2 j. 1/20 Four letters picked without replacement from {r: 6, w: 2, f: 1, j: 3, g: 3}. What is prob of picking 3 j and 1 r? 2/455 Calculate prob of picking 2 k when two letters picked without replacement from {a: 3, w: 6, h: 3, k: 3}. 1/35 Three letters picked without replacement from {v: 3, h: 4, i: 1, l: 10}. What is prob of picking 1 i and 2 l? 15/272 Three letters picked without replacement from bbbbwwbbwwwb. What is prob of picking 1 b and 2 w? 7/22 Three letters picked without replacement from {c: 8, k: 3}. Give prob of picking 3 k. 1/165 Four letters picked without replacement from ytety. What is prob of picking 1 e, 2 y, and 1 t? 2/5 Two letters picked without replacement from {g: 5, s: 5}. Give prob of picking 2 s. 2/9 Three letters picked without replacement from zqzuzzeszrerre. Give prob of picking 1 e, 1 u, and 1 z. 15/364 Two letters picked without replacement from {k: 4, v: 1, o: 2, x: 3, f: 6, g: 3}. What is prob of picking 2 k? 2/57 What is prob of picking 3 n and 1 a when four letters picked without replacement from {a: 3, n: 4}? 12/35 What is prob of picking 1 g and 1 e when two letters picked without replacement from {f: 1, e: 5, g: 4, l: 1}? 4/11 Two letters picked without replacement from gkaggqgk. What is prob of picking 1 q and 1 a? 1/28 Two letters picked without replacement from {o: 4, j: 10}. Give prob of picking 2 j. 45/91 What is prob of picking 2 s and 1 n when three letters picked without replacement from {f: 4, v: 5, s: 2, n: 2}? 1/143 Two letters picked without replacement from pzznjezpped. Give prob of picking 1 z and 1 p. 9/55 Four letters picked without replacement from {g: 2, h: 2, n: 7, j: 4, d: 3}. Give prob of picking 2 n, 1 d, and 1 h. 7/170 Two letters picked without replacement from {j: 3, o: 1, a: 3}. What is prob of picking 2 a? 1/7 What is prob of picking 2 y when two letters picked without replacement from ylllllylyyyly? 5/26 Calculate prob of picking 4 l when four letters picked without replacement from lllll. 1 Three letters picked without replacement from nntn. What is prob of picking 2 n and 1 t? 3/4 Two letters picked without replacement from cggggcggcccgggcgggg. What is prob of picking 2 g? 26/57 Calculate prob of picking 1 i, 1 o, and 1 d when three letters picked without replacement from {o: 1, i: 1, c: 1, f: 1, d: 1}. 1/10 Two letters picked without replacement from {c: 15, l: 3}. Give prob of picking 2 l. 1/51 Four letters picked without replacement from ijnijijiij. What is prob of picking 1 n, 1 j, and 2 i? 4/21 Three letters picked without replacement from pcbpcaacuupusb. What is prob of picking 2 b and 1 s? 1/364 Two letters picked without replacement from okbookzbjozoooobzjk. Give prob of picking 2 k. 1/57 Calculate prob of picking 2 e when two letters picked without replacement from {e: 7, u: 4, t: 4}. 1/5 What is prob of picking 2 x when two letters picked without replacement from {z: 4, x: 2, w: 4, m: 6, c: 4}? 1/190 Calculate prob of picking 1 e and 2 z when three letters picked without replacement from {h: 2, z: 2, e: 5, u: 4}. 5/286 Calculate prob of picking 2 q and 1 u when three letters picked without replacement from {l: 1, e: 4, u: 2, q: 4}. 4/55 Three letters picked without replacement from {s: 3, n: 3, g: 6, f: 3}. What is prob of picking 3 f? 1/455 Calculate prob of picking 4 m when four letters picked without replacement from {d: 2, m: 5}. 1/7 Calculate prob of picking 4 o when four letters picked without replacement from ooavaoaavoao. 1/99 Calculate prob of picking 1 o and 2 i when three letters picked without replacement from {s: 1, m: 4, o: 6, i: 3}. 9/182 What is prob of picking 1 m and 2 q when three letters picked without replacement from {q: 9, m: 5, t: 2}? 9/28 Two letters picked without replacement from mmmiimtimtt. What is prob of picking 1 i and 1 t? 9/55 Three letters picked without replacement from {t: 6, v: 7}. What is prob of picking 1 v and 2 t? 105/286 Three letters picked without replacement from skkskkkkkk. What is prob of picking 3 k? 7/15 Calculate prob of picking 2 u, 1 t, and 1 n when four letters picked without replacement from nfufncddtuun. 1/55 Two letters picked without replacement from {e: 10}. Give prob of picking 2 e. 1 Two letters picked without replacement from bmmmqrmfmmmqfgfmmm. What is prob of picking 1 g and 1 r? 1/153 Three letters picked without replacement from thyyyyhhhysyy. Give prob of picking 1 h, 1 s, and 1 t. 2/143 What is prob of picking 2 v when two letters picked without replacement from kfkvvkff? 1/28 Four letters picked without replacement from wicelfc. Give prob of picking 1 i, 1 w, and 2 c. 1/35 Four letters picked without replacement from {k: 4, h: 1, j: 9}. What is prob of picking 4 j? 18/143 Four letters picked without replacement from {c: 3, t: 13, b: 1, s: 2}. What is prob of picking 1 b and 3 t? 143/1938 Four letters picked without replacement from {f: 4, g: 15}. Give prob of picking 2 g and 2 f. 105/646 Four letters picked without replacement from jwmssnl. What is prob of picking 2 m and 2 w? 0 Three letters picked without replacement from {d: 2, p: 1, b: 1, a: 2, r: 2}. Give prob of picking 1 a and 2 d. 1/28 Two letters picked without replacement from brqrqbrrbbqdb. Give prob of picking 1 b and 1 r. 10/39 Two letters picked without replacement from {u: 5, g: 3, m: 3}. What is prob of picking 1 u and 1 g? 3/11 What is prob of picking 1 b and 1 e when two letters picked without replacement from {g: 3, b: 4, e: 6}? 4/13 Two letters picked without replacement from tttxttxxxxxmttpt. What is prob of picking 1 m and 1 x? 1/20 Calculate prob of picking 1 m and 1 d when two letters picked without replacement from {d: 1, m: 2}. 2/3 What is prob of picking	{ "pile_set_name": "DM Mathematics" }
8)/x(xx/(x/(x*(-1)/x))x)(-2/5) assuming x is positive. x(-367/56) Simplify (w(w5/w)/ww/w*4)/(ww/(w*(1/5)/w)ww(w*(-1/10)ww)/w)(www*3/ww*6)/(www(2/7)w/(w*1w)) assuming w is positive. w(281/70) Simplify (((v0)*5((v/v*(-8))/v)/((v/((vv(5/2))/v))/v))(-3/4))28 assuming v is positive. v(-441/2) Simplify ((x*(3/4)x(-2/5))/(x1)*(-1/55))/(x/(xx*(2/13))xx(1/5)x)(-36) assuming x is positive. x(42345/572) Simplify (((k*4k*(-2/9))/((kk*(-3/7))/(kk(3/7))))(-22))(-13/2) assuming k is positive. k(41756/63) Simplify ((w/(w/w*20w))(-6)/(((w/(w(2/29)w))/ww)/((w/(wwww/w(-38)wwww))/w)))(-1/8) assuming w is positive. w(2319/116) Simplify (l/(l2l)ll*(-1/9)l)*(-14)(l*(-3/7)/(ll(3/4)))/((l(1/6)/ll)/(ll/l*(1/7)l)) assuming l is positive. l*(521/252) Simplify ((rr(-3/4))(-17))*(-50)(r/((r(r/(r(r/r*(-1/6))/r))/r)/r)(rr2r)/r)(-13) assuming r is positive. r(436/3) Simplify (((f(-3))(3/31)(f(-2/5)/f)(-3/37))(2/7))(-32) assuming f is positive. f(64896/40145) Simplify ((d8)(-17)dd/d(1/9)d*(-6)ddd)30 assuming d is positive. d(-12340/3) Simplify (((((l/l(1/5))/l)(3/4))(-38))(-30))(11/6) assuming l is positive. l(-627/2) Simplify ((i*(-2/5)i)(2/13))38/((i/(i/(i/i*(-3/5)))i)/i*(1/3)(ii/((ii/(i/(((ii(2/3))/i)/i)))/i)i)(-2/53)) assuming i is positive. i(14126/10335) Simplify (x(2/7))10/(x/(x/x1))45x2/x(-1/4)x*(-7/5)x(2/15) assuming x is positive. x(-17287/420) Simplify (((xx/(xx/x*(-1))x)/xx/((x/x(-1/2))/x))/(x(-2/3)x)(-1/78))/(x(-4/9)x(-5/3)xxx/x*(-2/13)x(-8)) assuming x is positive. x(84/13) Simplify ((sss*(-2)ss(2/5))/((ss*(-1/6))/(s(s/s(-2/7))/s)))/(s(4/5)s5)(-1/18) assuming s is positive. s(137/63) Simplify ((b/(b(2/3)/b))(-2/69)(b/((b*(2/13)b)/b))/(b*(-8)b))/((b2/(b/(b/b3)))/(b1)50) assuming b is positive. b*(158251/2691) Simplify (((vv*0v)/v)/v)*(2/63)v*(-2)v/(v/(v/v*(3/2)))(vv(-2/3))/(v2vvv)(v(-1/2))6 assuming v is positive. v(-61/6) Simplify s/((s(15/8)/ss)/s)sss/(sss/(sss/(ss*(-2/43))))(ss26)/(s/s(-2/69)) assuming s is positive. s(667991/23736) Simplify ((i(1/2))(-18))(-49)ii/(i(-4)/i)(i*(-2/25)/i)/i(i(-2/3)/i)(-23/2) assuming i is positive. i(69763/150) Simplify ((((k/(k10k))/k)/k)20(k(2/75))(-36))(3/10) assuming k is positive. k(-9036/125) Simplify (((y/y*(2/13))/y)/yyy(1/38)y*17(y/(yyy/(y/(y/(y/(y/((y/y*(2/3))/y))y)y))y))/y)(6/11) assuming y is positive. y(18089/2717) Simplify (((((p/p*20)/pp)2)(-11/7))(-5/6))(-2/19) assuming p is positive. p(110/21) Simplify (o9o5)/(oo(-2/103))26 assuming o is positive. o*(-1184/103) Simplify ((k/((k/((k/(k(k/k*5)/kk))/k))/k))(6/19))0(k(-2))(-3/31)/(((k/(k/(kk*7kk)))/k)/(k/k(-1))) assuming k is positive. k(-211/31) Simplify o(-2)oo1o/(o/(o*(-3/2)oo))ooo*(2/17)(o(-2)/o)(-4)/((o*(-7)/o)/((o/(o(oo6)/o))/o)) assuming o is positive. o(531/34) Simplify (((j(-1/9)jj)/(jj*(2/19))j/((j/(j/(j/j*(-1/7)))j)/j)j(-2))40)(-35) assuming j is positive. j(325400/171) Simplify (((b(-32)/b)/(bb(-3/19)/b))/((b(-10/13)/b)/bbb(2/147)))(-1/15) assuming b is positive. b*(1128719/544635) Simplify ((v/(vv*5))/(v/(vv*(-9))vvv))/(v(-35/2))42 assuming v is positive. v718 Simplify ((h/(h/((h16/h)/h))h/(hh(2/67)/h))/((h/h(-2/7))/(h(h/h(2/33))/hh)))34 assuming h is positive. h(8221540/15477) Simplify (((((p/(p/((p/(p/(p*(2/9)p))p)/p)pp))/p)29)(2/25))(-8/9))(-2/91) assuming p is positive. p(-14848/184275) Simplify (vvv/(((v/v39)/v)/v)v)*(4/15)((v/v*(-24))/v)/vvvvv((v*(-8/7)v)/v)/vv assuming v is positive. v(3947/105) Simplify (p(2/11)pppp10(p(-4))(2/23))(-2/11) assuming p is positive. p(-6494/2783) Simplify (z/(z/(zz/(z/(z15/z))))z/z*16z*(-4)zzz/(z*(1/9)z))22 assuming z is positive. z(-418/9) Simplify (j*(-2)/(jj*5)(jj1/jj)/jj(-7))/((jj*(3/4)j)/j*(2/29)(jj(-2/7))/(j(2/3)j)) assuming j is positive. j*(-38315/2436) Simplify ((tttt/(t/t*(-1)))/ttt(-2/5))(-5/4)/((t(-6)/((t/t(-1))/t))/(t/((t/(t/t5))/t)tt/t(2/5))) assuming t is positive. t(18/5) Simplify (((j(jj/((j(-2/9)/j)/j))/jj)/jj)40)13/((j/j(-4/7)jj(-7/2)j)/(j*(2/13)j*(-2)j)) assuming j is positive. j(4446577/1638) Simplify (((d(1/5)ddd1)/(dd/d(2/7))(-3/20))(6/25))(-46) assuming d is positive. d*(-33396/875) Simplify (rr/r(-3))42(r/r(-39))/rr(23/4) assuming r is positive. r(1019/4) Simplify d*(-7)/(d((d/((d/(d/(d*0/d)))/d))/d)/d)(d1)34(d(-2/5)/d(3/8))/(d(-1/4)/(d(dd/(dd*(1/10)d))/ddd)) assuming d is positive. d(211/8) Simplify ((w/w0)/(w/w*(-4))((ww(-2/7)/w)/ww)(-2/145))/((w0)*(-2/9)/((w/(wwww*(-6)w))/(w(1/4)/w))) assuming w is positive. w(-999/4060) Simplify (((w(-1/4))(-2/91)(w(-2/23)w)/w(-6))(-1/28))47 assuming w is positive. w(-1361167/117208) Simplify (g*(4/9)/(gggg/(g/g*11)g))(-1/27)/(((g0/g)/((ggg(g/(g/g(-2/19)))/ggg)/g))/(g9(g(g(-7)gg)/gg)/g)) assuming g is positive. g*(38939/4617) Simplify (((m/(mm(-1/3)))/(m/(m9m)))/(m9m*(-3/5)/mm))/(m7/m(2/15))(-2/37) assuming m is positive. m(724/555) Simplify ((s((s(-3/11)/s)/ss)/ss)/(s/(ss*28)s)s(sss/(ss(3/5)s))/ss/s15)(-14/5) assuming s is positive. s(-10108/275) Simplify ((aa(1/4))(-2/21)/(a*(2/3)/a(a*(1/2)/a)/a))/(aa*(-3/2)aa(-8))(-3) assuming a is positive. a(-291/14) Simplify (g/g(-1/3))49/(gg*5/gg/(g/(g/g*(1/4)))gg)((g/((g*(3/7)g)/gg))/(ggg(4/7)))12 assuming g is positive. g(259/12) Simplify (m/(mm*(2/5))m*(-1/4)(mm/m1)/((m(m/m*5m)/m)/m))/((m/(m/m8))/m(-1/6))(3/11) assuming m is positive. m(467/220) Simplify ((d(2/35)/(d/d13))/(d*(-4/9)d)(-14/3))(1/26) assuming d is positive. d*(6922/12285) Simplify (w(www/(w*(-3/7)w)w)/ww(ww/w(2/13))/w)30/(w(-3/2)/w(-4/5)(w(1/2)/ww)(-3)) assuming w is positive. w(73001/455) Simplify ((x18)(2/21)x(-5)/((((x/(x/(x/x(9/2))x))/xx)/x)/xx))(3/2) assuming x is positive. x(93/28) Simplify (((pp(-1/5))/pp*(2/13)((p/(((p*0p)/p)/p)p)/p)(-49))19)(-44) assuming p is positive. p(5327828/65) Simplify (yy/((y*(-20)yy)/y)y((yyy/(y(-10)/y)y)/y)/yy(y(-2)/y)(1/8))14 assuming y is positive. y(1995/4) Simplify (b*(-3/2)/bb)/(b/(bb31))b*(-33)b(6/13) assuming b is positive. b(-79/26) Simplify ((f(1/2))(-17/3))*(-13/6)(((ff/((f0f)/f)f)/f)(-2/29))40 assuming f is positive. f(649/1044) Simplify ((b/b(-2/63))/((((bb*(13/4))/b)/b)/b)((bb32)/b)/b(-28))(-9) assuming b is positive. b(-15065/28) Simplify (((k0/k)/(kk(-7/6)))/(k(-2/7))*(-1/19))/((kk2/k)(3/8)/(k*(1/4)k(2/3))) assuming k is positive. k(-272/399) Simplify g(1/4)/g(-1/3)g(-1)gg(-3)g(g/g(-4)g(-1/6))44 assuming g is positive. g(845/4) Simplify ((j/j(-4/7))/(jj(-12)j)(jj(j/(j/(jj*2j)j))/j)41)29 assuming j is positive. j(35641/7) Simplify ((v(-4)v7)/(v2)*(-5/7))/((vvv/(v1v))*(7/8)v(-7)/v7) assuming v is positive. v*(983/56) Simplify ((y/(yy*(-2)/yyy)y)(3/2))(3/20)/((y1)(-4/23)/((y*6/yy)/(y/y(-3)))) assuming y is positive. y(1207/460) Simplify pp(1/3)p*(2/17)(p(-2/3)/p)12p(-2/19)/pp*(-8)(pp/(p(-1/3)/p)p)(2/67) assuming p is positive. p(-595667/21641) Simplify (((tt(4/13))/t(-5))/((tt31)/t)5)(2/29) assuming t is positive. t(-3866/377) Simplify (d*(4/5)d*5)/(((d(dd0)/dd)/d)/(d/d*(-1/5)))((d/(d/d*(2/7)))/d)/dd*(-2)dddd0dd(3/5) assuming d is positive. d(241/35) Simplify (d(-2/11)d*6/d)/(dd*(2/3)dd(11/2)/dd) assuming d is positive. d(-221/66) Simplify ((w(-2/5))(20/3))(-24)/(((w(1/4)/w)/(w(4/3)w))/(w0)(-44)) assuming w is positive. w*(8	{ "pile_set_name": "DM Mathematics" }
is the thousands digit of 123362? 3 What is the thousands digit of 9287? 9 What is the thousands digit of 27121? 7 What is the thousands digit of 29737? 9 What is the hundreds digit of 1872? 8 What is the ten thousands digit of 11164? 1 What is the units digit of 899? 9 What is the tens digit of 6307? 0 What is the hundreds digit of 475? 4 What is the ten thousands digit of 25112? 2 What is the thousands digit of 2565? 2 What is the tens digit of 1522? 2 What is the thousands digit of 9791? 9 What is the hundreds digit of 8623? 6 What is the units digit of 13031? 1 What is the thousands digit of 12579? 2 What is the ten thousands digit of 10352? 1 What is the hundreds digit of 1901? 9 What is the tens digit of 13810? 1 What is the tens digit of 8964? 6 What is the units digit of 1530? 0 What is the units digit of 113424? 4 What is the tens digit of 728? 2 What is the thousands digit of 50082? 0 What is the hundreds digit of 10267? 2 What is the tens digit of 522? 2 What is the units digit of 178767? 7 What is the units digit of 2200? 0 What is the units digit of 117? 7 What is the thousands digit of 75763? 5 What is the hundreds digit of 674? 6 What is the thousands digit of 31592? 1 What is the hundreds digit of 43939? 9 What is the hundreds digit of 421? 4 What is the tens digit of 559? 5 What is the ten thousands digit of 22998? 2 What is the thousands digit of 1835? 1 What is the thousands digit of 9372? 9 What is the hundred thousands digit of 113071? 1 What is the tens digit of 1780? 8 What is the thousands digit of 3418? 3 What is the units digit of 7188? 8 What is the units digit of 11528? 8 What is the hundreds digit of 22827? 8 What is the ten thousands digit of 36469? 3 What is the units digit of 19193? 3 What is the units digit of 1916? 6 What is the ten thousands digit of 20883? 2 What is the units digit of 858? 8 What is the thousands digit of 2716? 2 What is the units digit of 407? 7 What is the thousands digit of 37248? 7 What is the hundreds digit of 12998? 9 What is the units digit of 9333? 3 What is the hundreds digit of 18290? 2 What is the tens digit of 356? 5 What is the hundreds digit of 7487? 4 What is the units digit of 39924? 4 What is the hundreds digit of 2544? 5 What is the units digit of 16105? 5 What is the thousands digit of 7979? 7 What is the ten thousands digit of 61015? 6 What is the thousands digit of 85557? 5 What is the hundreds digit of 732? 7 What is the units digit of 67437? 7 What is the ten thousands digit of 91815? 9 What is the units digit of 80? 0 What is the hundreds digit of 3143? 1 What is the tens digit of 84720? 2 What is the units digit of 298? 8 What is the units digit of 20838? 8 What is the tens digit of 796? 9 What is the hundreds digit of 1079? 0 What is the thousands digit of 2356? 2 What is the tens digit of 72? 7 What is the thousands digit of 14856? 4 What is the units digit of 26255? 5 What is the units digit of 809? 9 What is the tens digit of 2250? 5 What is the thousands digit of 2833? 2 What is the tens digit of 361? 6 What is the thousands digit of 23090? 3 What is the tens digit of 51305? 0 What is the units digit of 14718? 8 What is the tens digit of 26018? 1 What is the tens digit of 3079? 7 What is the hundreds digit of 1274? 2 What is the units digit of 158? 8 What is the hundreds digit of 32151? 1 What is the hundreds digit of 20159? 1 What is the hundreds digit of 559? 5 What is the thousands digit of 5665? 5 What is the thousands digit of 24071? 4 What is the units digit of 489? 9 What is the units digit of 1881? 1 What is the thousands digit of 3527? 3 What is the thousands digit of 1429? 1 What is the hundreds digit of 1999? 9 What is the thousands digit of 1015? 1 What is the units digit of 1208? 8 What is the tens digit of 49051? 5 What is the units digit of 9? 9 What is the tens digit of 83? 8 What is the thousands digit of 1199? 1 What is the tens digit of 324? 2 What is the thousands digit of 83641? 3 What is the tens digit of 55097? 9 What is the thousands digit of 8343? 8 What is the ten thousands digit of 41700? 4 What is the thousands digit of 21279? 1 What is the hundreds digit of 1459? 4 What is the units digit of 382? 2 What is the ten thousands digit of 154512? 5 What is the thousands digit of 61135? 1 What is the hundreds digit of 89857? 8 What is the hundreds digit of 8558? 5 What is the tens digit of 58103? 0 What is the units digit of 775? 5 What is the tens digit of 2134? 3 What is the thousands digit of 2476? 2 What is the hundreds digit of 3521? 5 What is the hundreds digit of 8071? 0 What is the ten thousands digit of 30579? 3 What is the tens digit of 41191? 9 What is the units digit of 8489? 9 What is the units digit of 2713? 3 What is the ten thousands digit of 13521? 1 What is the units digit of 659? 9 What is the units digit of 603? 3 What is the hundreds digit of 393? 3 What is the hundreds digit of 1043? 0 What is the ten thousands digit of 76036? 7 What is the tens digit of 6234? 3 What is the hundreds digit of 4202? 2 What is the thousands digit of 20359? 0 What is the hundreds digit of 3500? 5 What is the tens digit of 35393? 9 What is the hundreds digit of 3571? 5 What is the hundreds digit of 356? 3 What is the tens digit of 2091? 9 What is the hundreds digit of 61448? 4 What is the hundreds digit of 2744? 7 What is the units digit of 1486? 6 What is the tens digit of 8200? 0 What is the ten thousands digit of 10136? 1 What is the tens digit of 1155? 5 What is the hundreds digit of 2561? 5 What is the ten thousands digit of 54479? 5 What is the units digit of 10209? 9 What is the hundreds digit of 1647? 6 What is the hundreds digit of 84543? 5 What is the thousands digit of 36658? 6 What is the units digit of 50382? 2 What is the units digit of 5451? 1 What is the hundreds digit of 124? 1 What is the tens digit of 15739? 3 What is the tens digit of 2239? 3 What is the units digit of 12? 2 What is the tens digit of 73? 7 What is the hundreds digit of 32038? 0 What is the units digit of 42290? 0 What is the ten thousands digit of 22029? 2 What is the hundreds digit of 13392? 3 What is the ten thousands digit of 16064? 1 What is the hundreds digit of 17998? 9 What is the thousands digit of 1250? 1 What is the ten thousands digit of 14073? 1 What is the hundreds digit of 226? 2 What is the units digit of 475? 5 What is the tens digit of 1459? 5 What is the units digit of 9255? 5 What is the tens digit of 36517? 1 What is the tens digit of 7976? 7 What is the units digit of 706? 6 What is the units digit of 254? 4 What is the tens digit of 2674? 7 What is the tens digit of 3279? 7 What is the units digit of 2443? 3 What is the hundreds digit of 20340? 3 What is the tens digit of 69741? 4 What is the hundreds digit of 23733? 7 What is the hundreds digit of 1185? 1 What is the units digit of 534? 4 What is the tens digit of 16856? 5 What is the tens digit of 48? 4 What is the hundreds digit of 434? 4 What is the tens digit of 2483? 8 What is the units digit of 48429? 9 What is the hundreds digit of 960? 9 What is the thousands digit of 17210? 7 What is the hundreds digit of 965? 9 What is the ten thousands digit of 31289? 3 What is the thousands digit of 6281? 6 What is the units digit of 2594? 4 What is the ten thousands digit of 20607? 2 What is the units digit of 1138? 8 What is the tens digit of 74? 7 What is the units digit of 2656? 6 What is the units digit of 839? 9 What is the units digit of 5589? 9 What is the hundreds digit of 2963? 9 What is the ten thousands digit of 31054? 3 What is the ten thousands digit of 68220? 6 What is the tens digit of 912? 1 What is the thousands digit of 16205? 6 What is the tens digit of 1936? 3 What is the thousands digit of 24455? 4 What is the tens digit of 1498? 9 What is the tens digit of 906? 0 What is the hundreds digit of 26848? 8 What is the units digit of 935? 5 What is the units digit of 793? 3 What is the hundreds digit of 1727? 7 What is the hundreds digit of 156? 1 What is the tens digit of 3423? 2 What is the ten thousands digit of 104720? 0 What is the thousands digit of 32077? 2 What is the units digit of 56288? 8 What is the units digit of 1462? 2 What is the thousands digit of	{ "pile_set_name": "DM Mathematics" }
4/9 + -84. Let r = -362 - -1443/4. Which is the second biggest value? (a) r (b) 1 (c) -3 (d) w d Let f = 7.9 + -8. Let k = 8 - 9.7. Which is the biggest value? (a) k (b) -2/9 (c) f c Let k be (219/12 + -18)/(10/(-8)). What is the smallest value in -2.6, 5, k? -2.6 Let v = -1 - 0.3. Let q = v - -5.3. Let u = q - 4.2. Which is the third smallest value? (a) u (b) -2/3 (c) -5 a Suppose -10k = 42 - 62. Which is the second biggest value? (a) 1/8 (b) 0.01 (c) k a Suppose 6 = -2y, -5z - 5y - 3 = -z. Let h = 561 + -1669/3. Let r = 59/12 - h. Which is the biggest value? (a) z (b) -2/17 (c) r a Let t = 270 - 295.2. Let r = 25 + t. Let v be (-2)/7 - (-18)/(-63). What is the third biggest value in r, v, -3? -3 Let k = 30 - 32. What is the biggest value in 2, k, -0.1? 2 Let l = 27 + -17. Let x(v) = v + 1. Let f be x(3). Suppose -5 = -fo + 11. What is the biggest value in -0.1, o, l? l Let h be (-4)/(-6)(-12 - -18). Which is the second smallest value? (a) -5 (b) -0.033 (c) 1 (d) h b Let y = 3 - 7. Let w = -12.1 - -12.5. What is the smallest value in 2/3, w, y? y Suppose 3 = -3g - 2p, 5g + p + 0 = -12. Which is the biggest value? (a) g (b) 2/483 (c) 0.3 c Let p = -3.4 + 3.2. Let v be 3/(1/2 + -2). Let o be (v/(-9))/((-4)/6). What is the second smallest value in p, o, -4/5? o Let u = 99 + -113.3. Let z = -15.3 - u. Suppose 4p + 6 = 14. What is the smallest value in 2/21, z, p? z Let d = 299 - 301. Let l = 3.7 + -0.7. Which is the second smallest value? (a) d (b) l (c) 2 c Let z = 85 + -37. Let w be (-20)/z2-2. Which is the biggest value? (a) -4/3 (b) w (c) -2/11 b Suppose 6 = 3k - 6k. Which is the second smallest value? (a) -5 (b) 0.2 (c) k (d) -74 a Let j(p) = -2p + 32. Let w be j(13). Let i be w/(-33) - (-210)/(-55). Which is the second biggest value? (a) -2.4 (b) i (c) -1 a Let f = -8 + 14. Let t = 11 - f. Suppose 17l = -2l + 2l. Which is the third biggest value? (a) -9 (b) t (c) l a Suppose -4x = -9x - 80. Let b = x - -10. Let a = -3263 + 3264. What is the second biggest value in b, a, -4? -4 Let p = -1.1 + 1.7. Let l = -1.8 + p. Let a = 1.8 - l. What is the third smallest value in a, 2/3, -2? a Suppose -10v = -16v - 18. What is the biggest value in v, -1/4, 2.6? 2.6 Let l = 4.9 + 0.1. Let z = -2 + l. Let g = -2669/10 - -267. What is the third smallest value in g, -0.2, z? z Let k = -2 + 4. Let q be (-58)/116 - (-14)/20. What is the smallest value in k, q, 0? 0 Let z be 5(-1 + (-2 - -4)). Let u = z + -14/3. Which is the second biggest value? (a) u (b) 4 (c) -1/2 a Let t = -4 + 3.6. Let f = 0.046 - -53.954. Let q = f - 53.5. What is the second smallest value in t, -0.3, q? -0.3 Let g = 131.4 - 103. Let r = -28 + g. Which is the smallest value? (a) 0.3 (b) -5 (c) r b Let z = 1 - -2. Let l be (1/33)/((-7)/(-9)). Let q = l + 139/385. What is the second smallest value in q, z, -4? q Let d = 309 + -305.7. Which is the smallest value? (a) d (b) -2/17 (c) 0.3 b Let r be 1 + 0 - (15 - (-695)/(-50)). Which is the third smallest value? (a) -17 (b) r (c) -3 b Let y = 155 + -154. Let i = 21 + -35. Let a = 9 + i. What is the smallest value in a, 3, y? a Suppose 7t + 48 = t. Let g be (10/35)/(t/14). What is the biggest value in g, 0.5, 2? 2 Let n = -1169/3 + 384. Let s = n - -46/9. Let l = -19/18 - s. Which is the third biggest value? (a) l (b) -4 (c) 2 b Let o = 100759/32802 - 203/66. What is the third smallest value in o, 4, -0.5? 4 Suppose f + 0f - 3 = 0. Suppose -33d = -36d - f. Let i be d/6 + (-125)/(-30). Which is the smallest value? (a) i (b) -1.4 (c) -1/4 b Suppose 2z - 5s + 6 = 1, -3s + 7 = -2z. Let p be ((-10)/z)/(-2 - -3). Let b be (-3)/(p/(2/(-5))). What is the second biggest value in b, -1/3, 5? b Suppose -3d - 9 = -f, -4d + 8f - 23 = 3f. Let y = -3.89 - 0.11. What is the smallest value in d, -1/23, y? y Let x be 8/4(-5 + 6). Which is the second biggest value? (a) -2/19 (b) x (c) -0.4 (d) 0.2 d Let x = 7.3 + -11.3. Let n = -2/79 - -95/632. Which is the third smallest value? (a) n (b) x (c) -1 a Let k = -3.625 + 0.025. Let f = k - -4.6. What is the smallest value in 27, f, 5? f Suppose -3o = -3r - 8 + 2, -4o + 5r + 9 = 0. Let m = -86 - -88. Which is the third smallest value? (a) m (b) o (c) 4/7 (d) 0 b Let d be 14/77 + 48/(-22). Let t = 259 + -258. Which is the smallest value? (a) 3 (b) d (c) t b Let t = 137.7 + -137. Which is the third biggest value? (a) 5 (b) t (c) -0.3 c Let y = -1238 + 1244. Let m = -0.08 + -3.92. What is the second biggest value in m, y, 3? 3 Let j(i) = 5i - 60. Let k be j(12). Which is the smallest value? (a) k (b) 1/15 (c) 1 a Let x = 87 - 36. Let i = -31 + x. Suppose -16m + im - 8 = 0. Which is the second biggest value? (a) m (b) 2/3 (c) -2 b Let m = -91 + 90.97. Let w = m + 0.13. Let h = -1.1 - -0.1. What is the second smallest value in -5, h, w? h Let h = -21 - -29. Let q be 4/h + 3/(-24). Let u = -10 - -9.5. Which is the biggest value? (a) u (b) q (c) -4 b Let t = -7 - -6.7. Let p be (1 + -3)1/(-5). Let g be (1230/164)/(6/(-4) - -3). What is the biggest value in g, p, t? g Let u = -7.7 - -11.7. Which is the third biggest value? (a) u (b) -1/2 (c) 5 (d) 1 d Let l = 1/524 + 521/1572. What is the third biggest value in l, -2/5, -0.02? -2/5 Let t be ((-26)/8)/((-1)/4). Let o be (6/16)/(3 + 147/(-28)). Which is the third smallest value? (a) o (b) t (c) 5 b Let s = -0.82 + 1.01. What is the third smallest value in 0.5, -3/7, s? 0.5 Let w be (-3)/2((-40)/(-12))/5. Let f be w(2 - 0) + -5. Which is the third biggest value? (a) -3 (b) 1/3 (c) f c Suppose -2z - 2v + 2 = 6, z - 2v = -2. Which is the second biggest value? (a) 0.4 (b) z (c) -0.5 (d) 0.02 d Let p = 59.4 + -59.5. What is the fourth biggest value in 5, p, -2, -1? -2 Suppose 0 = 2t - 111 + 9. Which is the third biggest value? (a) 2 (b) t (c) -3 c Let c be -1 - 0 - (-11)/7. Let t = -2 - -3. What is the biggest value in -2, c, t? t Let g = 211 - 1687/8. What is the third smallest value in 5/2, g, -0.1? 5/2 Let u = -2.385 - -2.585. Let y = 6 - 11. Which is the biggest value? (a) 1 (b) u (c) y (d) 0.4 a Let i(u) be the first derivative of -u*3 - 6u*2 - 2u + 7. Let w be i(-4). Let o be (w/3)/(64/120). Which is the third smallest value? (a) -2 (b) -5 (c) o c Let p be (-1)/3(-21)/(-14). Let v = -13 - -12.8. Let x = 7.7 - 8. What is the second biggest value in v, p, x? x Let f = -1/11 - 9/22. Let n(x) = 1. Let d(h) = 6h*2 + 2. Let k(l) = -d(l) + 3n(l). Let o be k(1). What is the second smallest value in o, f, 3? f Let m = -0.142 - 6.218. Let u = 1.26 + m. Let v = -0.1 - u. Which is the second smallest value? (a) v (b) -5 (c) -2 c Suppose 0d - d + 4 = -o, -5d = -3o - 12. Let q = 797 + -392. Let k be 2/9 + (-144)/q. Which is the second biggest value? (a) 1/4 (b) k (c) d c Let q = -839/5 - -168. Which is the second biggest value? (a) q (b) -0.05 (c) 0.4 a Suppose -19c = 7c + 130. What is the second smallest value in 5, 8, c? 5 Suppose 0 = -2m + y - 2, 32y = m + 31y - 1. Which is the third smallest value? (a) -1/4 (b) 2/25 (c) m b Let l = -665 + 668. Let u be 12/(-6)1. What is the fourth smallest value in u, 5, -4, l? 5 Let y be 21/49 - 19/28. Let m = -2 + 5. What is the biggest value in y, m, 8, -0.2? 8 Let v be (-3 + 11/3)81/36. Let d = -3.5 - 0.5. Which is the biggest value? (a) -0.2 (b) d (c) v c Let g = -15.7 - -11.7. Which is the fourth smallest value? (a) -0.3 (b) -3 (c) g (d) -2 a Let n = -49.46 - -49. Let m = 0.26 + n. Let l = -6 - -10. What is the biggest value in m, -3, l? l Let v = 553/5 - 111. Let q = -57 - -56.5. Let c = q - 1.5. What is the smallest value in v, c, 11? c Suppose -10 = 5m - 10m. Suppose j + 0w - 11 = -w, 0 = -mj + w + 16. Let l be (j/(-3))/(-1)-1. Which is the third biggest value? (a) 1 (b) 2/5 (c) l c Let x be (-1 + 2)222/518. What is the biggest value in 5, -11, x, 0.3? 5 Suppose 5g - 9 = -2i - i, 0 = 5i - 15. Let n = 67/2 - 35. Which is the third smallest value? (a) n (b) g (c) 1 c Let l = -159/469 - 6/67. Let w = -3.5268 + -0.4732. Which is the second biggest value? (a) l (b) 1 (c) w a Let v = 1239/10 - 247/2. Which is the biggest value? (a) 5/3	{ "pile_set_name": "DM Mathematics" }
-6)/410/p is divided by z? 1 Suppose 0 = -0k + 4k + y + 24, -4k = 2y + 28. Calculate the remainder when 59 is divided by -7 - (-15 + k + -2). 14 Suppose -533j = v - 531j - 150, 5v = -4j + 732. What is the remainder when v is divided by 75? 69 Let a(p) = -p - 6. What is the remainder when 38 is divided by a(-15)? 2 Let b be -52/(-30)1147. Let f = b - 17. Suppose -2j + 2i + 14 = 0, 1 = 2j - 5i + 2. Calculate the remainder when f is divided by j. 8 Suppose 3972y + 93 = 3975y - 3v, y + 5v = 43. Calculate the remainder when 1401 is divided by y. 15 Suppose 0 = -1850h + 1867h - 663. Calculate the remainder when 2074 is divided by h. 7 Suppose 3k - 15 = -4f, -k - 11f = -9f - 3. Calculate the remainder when 109 is divided by -1 + k/6 + (-81)/(-6). 11 Suppose 5f - 5 = 5w, -4f = 5w - 0w - 31. Suppose -f = -4l + 28. What is the remainder when (-4 + (-13)/(-3))/((-31)/(-3441)) is divided by l? 5 Suppose -670n = -1030n + 30600. Calculate the remainder when 830 is divided by n. 65 Calculate the remainder when 743 is divided by (-2712)/(-2)(-70)/(-840). 65 Let l be (-1515)/150 - 2/(-20). Let d(a) = a3 + 11a*2 + 5a - 28. Calculate the remainder when 56 is divided by d(l). 12 Let u be 3/(-4) + (-1017)/(-12). Suppose -1650 = -99c + uc. What is the remainder when c is divided by 7? 5 Suppose 168 = -6y - 2y. What is the remainder when 54 is divided by -1 - -4 - (y - -13)? 10 Calculate the remainder when ((-1)/2)/(11/(-6094)) is divided by 0 + (-1 - 139)/(-2). 67 Let x(m) = -2m - 17. Let v be x(-9). Calculate the remainder when 130 is divided by ((-27)/(-12))/(v1/12). 22 Let n be (-20)/(-7)28/8. Let p(z) = z3 - 8z*2 - 12z - 8. Let q be p(n). Suppose -180 = -a - q. Calculate the remainder when a is divided by 22. 20 Suppose 2769 = m + 465. Suppose t - 25t = -m. Calculate the remainder when t is divided by 51. 45 Let q(p) = 641p - 1. Let d be q(1). Let l = d - 566. Calculate the remainder when l is divided by 7. 4 Let b(x) = -105x - 3657. What is the remainder when b(-43) is divided by 164? 38 Let r(a) = -a2 - a + 278. Suppose -3g + 16 = 4j, -3j + 4 + 8 = 0. Calculate the remainder when r(g) is divided by 14. 12 Let z = 790 + 480. Suppose -8a = -z - 146. What is the remainder when a is divided by 4/(12/135) - 0? 42 Suppose 2c + 1869 = k, 5k + 6c = -1621 + 10886. What is the remainder when k is divided by 14? 11 Suppose 3s = n - 4n + 162, -3s + 5n + 186 = 0. What is the remainder when s is divided by (-2 - (-5 + 3)/2) + 26? 7 Let x = 111 - 193. Let a = -78 - x. Suppose 2n + 266 = ah, 3n - 182 = -3h + n. Calculate the remainder when h is divided by 17. 13 Let l = 11829 + -11822. What is the remainder when 257/5 - (-30)/50 is divided by l? 3 Suppose 4p = 2h - 118, 71h - 74h + 213 = -12p. Calculate the remainder when h is divided by 18. 11 Suppose -2g - 3 = -9. Let t(v) = 2v2 + v. Let u = 178 - 96. What is the remainder when u is divided by t(g)? 19 Let o = 11 + 17. Suppose -k = -2k + 7k. Suppose k = 14r + 98 - 840. Calculate the remainder when r is divided by o. 25 Let v = 7335 + -6152. What is the remainder when v is divided by 15? 13 Let f(s) = -9s3 + 54s*2 + 17s - 21. What is the remainder when 668 is divided by f(6)? 20 Let a be (-196)/10(-8 + -7). Suppose -274 = -4x + 2w, -5x - 3w + 54 = -a. Calculate the remainder when x is divided by 22/66 - 35/(-3). 9 Let g(d) = 3 - 2d2 - 11 - d3 + 151d - 157d. What is the remainder when 121 is divided by g(-3)? 7 Suppose -495 = -2286p + 2271p. Suppose 2u = 2d - 7d + 269, 2d - 6 = 0. Calculate the remainder when u is divided by p. 28 Suppose -2620 = -27u + 1484. Suppose u = o - 4t, -440 = -2o + 3t - 136. Calculate the remainder when o is divided by 14. 12 Let r(c) = c*3 + 61. Let x be r(0). Let w be (-6)/(-4)-32/(-1). Let z = x - w. Calculate the remainder when z is divided by 14. 10 Suppose -6g - 243 = -4g + 5x, 3x = -g - 122. Let t = 39 - g. What is the remainder when t is divided by 16? 14 Let n be (156/(-7))/(0 + 12/(-462)). Let y = 903 - n. What is the remainder when 130 is divided by y? 40 Let q = 3 - -6. Suppose -3f + 36 = -144. What is the remainder when q is divided by ((-9)/(-5))/(18/f)? 3 Let o = 56 - 57. Let k(v) = 14v2 - 1. Let p = 311 - 276. Calculate the remainder when p is divided by k(o). 9 Let l = 9 - -66. Let u = l + -12. Let p = u + -40. Calculate the remainder when p is divided by 6. 5 Let b(c) = c3 + c2 + 3. Suppose -4w + 2v + 362 = 0, -3w - 3v = -8v - 282. Calculate the remainder when w is divided by b(2). 14 Let w = 5342 - 5291. What is the remainder when 226 is divided by w? 22 Let h be 7 + -1 + (-108)/12. Let r(f) = -27f3 - 7f*2 - 3f + 25. Calculate the remainder when r(h) is divided by 26. 24 Suppose -926v - 30250 = -948v. Calculate the remainder when v is divided by 32. 31 Let z(o) = o*2 + 10o - 96. Let x be z(6). Suppose x = -5c - 3k + 406, -5c + 4k + 117 + 275 = 0. What is the remainder when c is divided by 24? 8 Let h be ((-2541)/(-99))/(1/(-3)). Let o = h + 67. Calculate the remainder when 253 is divided by (-9)/(315/14) - 514/o. 49 Suppose 0 = -3b - 8y + 11y + 30, 0 = b + y. Suppose -6a - 2k = -10a + 1796, 1808 = 4a - bk. Calculate the remainder when a is divided by 75. 72 Let h be (1/(-3))/((-2)/24). Suppose -hg + 8 = -3g. Let w = 9159 - 9105. What is the remainder when w is divided by g? 6 Let l(h) = -447h - 666. What is the remainder when l(-9) is divided by 80? 77 Suppose -20b = 16b - 1944. What is the remainder when 55 is divided by (-16 - -19) + b(-2)/(-4)? 25 Suppose 4m = 4g + 6m - 12, -5g + 37 = -3m. Calculate the remainder when 150 is divided by 5 - (-14 + 25/g). 10 Let w(c) = c2 + 7c + 2. Let t be w(-1). Let d = t + 27. What is the remainder when 216 is divided by d? 9 Let t(m) be the third derivative of -7m4/24 - 7m*3/3 + 39m2. Calculate the remainder when 79 is divided by t(-4). 9 Let a(q) = -21 - 82 - q2 - 1 - 24q. What is the remainder when 194 is divided by a(-11)? 38 Let r(k) = 7k - 60. Let b be r(10). Suppose -2j = -b, 5w = 4j + 9 + 166. Calculate the remainder when 77 is divided by w. 38 Let y(z) = z2 + 7z + 263. Calculate the remainder when y(0) is divided by 92. 79 Let v(g) = 161g3 + g2 - g - 1. Let p be v(-1). Let s = p - -156. Let x = s + 10. What is the remainder when 13 is divided by x? 1 Let w(j) = j3 - j2 + 82. Let y be w(0). Suppose -3b + 4f + y = 0, -2b - 17 = -2f - 75. What is the remainder when 96 is divided by b? 28 Let y(l) = l3 + 29l*2 - 9l - 851. What is the remainder when y(-28) is divided by 5? 0 Let i = 884 + -761. Calculate the remainder when (i - 0) + 42/(-7) + 1 is divided by 12. 10 Let v = 67 + 348. Suppose 2s + 4d - 64 = 0, -11s + d - 35 = -12s. Calculate the remainder when v is divided by s. 35 Let z(h) = 382h - 2454. Calculate the remainder when z(10) is divided by 57. 55 Suppose -4y + 2o = -o - 1552, 3y = 2o + 1163. Calculate the remainder when 173 is divided by (-7)/(y/10) + 486/11. 41 Suppose 5u - 4z - 487 = 0, -u + z = -3u + 200. Suppose -5f - 83 + 283 = -5a, 5f = 4a + 207. What is the remainder when u is divided by f? 5 Let a = 7857 + -7833. Calculate the remainder when 5206 is divided by a. 22 Suppose j + 2j - 639 = 0. Calculate the remainder when j is divided by (-18)/(7 - 1)(114/(-18) - 4). 27 Let a = 13 + -7. Suppose 0 = -2k + ak - 12. Suppose 3r - 65 - 25 = 0. What is the remainder when r is divided by k? 0 Let o(h) = 31h + 382. Calculate the remainder when 15661 is divided by o(-11). 40 Let b(a) = a*2 + 13a - 11. Let c be ((-8)/2 - 6) + -4. Let x be b(c). Calculate the remainder when (26/(-6) + x)/((-2)/105) is divided by 9. 7 What is the remainder when (-464 - -270)/((-2)/3) is divided by 45? 21 Let m = 40 + 13. What is the remainder when m is divided by (-3)/(20 + -2) + (-2635)/(-510)? 3 Let k(j) be the first derivative of j*3 - 29j*2/2 + 39j - 34. Let s(o) be the first derivative of k(o). Calculate the remainder when s(12) is divided by 22. 21 Let o = -71 + 115. What is the remainder when 4/(-3) - (-6831)/81 is divided by o? 39 Let t = -7 + 10. Suppose tm - 4m + r + 38 = 0, -5m + 162 = 2r. Let p = 487	{ "pile_set_name": "DM Mathematics" }
an -381329? -3504861 What is the difference between -0.7307 and 1111.75913? 1112.48983 What is 0.2 take away 71074168.4203? -71074168.2203 Calculate -7977530 + -3005.7. -7980535.7 Sum 1557.4 and -26411047.7. -26409490.3 0.07626 + -68460.49 -68460.41374 What is 486.51 minus 2701696? -2701209.49 What is 111786593172 minus 2? 111786593170 Add together 967235282 and 0.03955. 967235282.03955 Subtract -0.9 from -19070704756547. -19070704756546.1 Calculate 0.03142 - 93038.005. -93037.97358 What is -64846212.37 - -0.0487? -64846212.3213 -0.052459144567+-8 -8.052459144567 What is -1479581 take away 1495043? -2974624 -49865.8 - -5225537 5175671.2 Subtract 13132100.35772 from -4.5. -13132104.85772 What is the difference between -771004284728 and -7? 771004284721 Total of -0.737 and -9616209938. -9616209938.737 Subtract -0.01929 from -18447784. -18447783.98071 What is the distance between 46.16 and 23668684510? 23668684463.84 What is -1.0494007063 plus -155? -156.0494007063 Calculate -23901962 - -7873. -23894089 What is -614811 less than -29433316? -28818505 What is the difference between -16 and -0.14639150107? 15.85360849893 Add -12.244 and -592612.2382. -592624.4822 Work out -1242233.455 - -877.02. -1241356.435 What is the distance between -198449675.35 and -4567? 198445108.35 -226057 + -708003736 -708229793 What is 17.4321763 take away 66.4748? -49.0426237 What is 71.28205097048 plus 0.2? 71.48205097048 What is -6327023 - 298.37? -6327321.37 Add -44.7 and 0.266934947. -44.433065053 0.07992095+-1525366 -1525365.92007905 Work out -2 - -2961998319.57. 2961998317.57 What is -3 - 55012639417? -55012639420 Work out 2.8066049261 + -0.2803. 2.5263049261 Calculate 77436660 + -7.7763. 77436652.2237 What is -59488630.21 take away -0.42? -59488629.79 Add together -28596603.28 and -0.08414. -28596603.36414 -461734.7811 + -72 -461806.7811 What is -0.18 less than -2736224858281? -2736224858280.82 Sum -56 and 0.1783902674. -55.8216097326 What is 415788 take away 272928.69? 142859.31 What is 18931885752 minus -2.5? 18931885754.5 What is 20 + -9569412.143? -9569392.143 Add together -4796326295 and -15. -4796326310 What is 70 plus -30535930540? -30535930470 Put together -15 and 9692.33382393. 9677.33382393 -210185+990697 780512 Work out 112.53 + -267.299199. -154.769199 What is -2 minus 31272555719084? -31272555719086 6550183.044722+1.1 6550184.144722 Calculate 35457272662 + 154. 35457272816 Calculate -2394 + 0.066753333. -2393.933246667 -0.02796503580303+0.9 0.87203496419697 Calculate 0.00035245 + -509. -508.99964755 Work out 0 - 3295579961. -3295579961 12.372082369+0.05658 12.428662369 Add together 29749.2084597 and -4. 29745.2084597 Total of 0 and -89101817867140. -89101817867140 What is the difference between 5187 and -196957.194? 202144.194 What is -319.5045 minus 23.8327? -343.3372 Calculate -0.43 - -10261612742505. 10261612742504.57 Put together 1504816212 and -5208. 1504811004 What is -224554284.488 minus 31? -224554315.488 What is -82.143 + -994694? -994776.143 Total of 2723.152 and 0.2261754. 2723.3781754 Work out -8223036.64 + 0.0071. -8223036.6329 Subtract 294315 from 0.8244129. -294314.1755871 What is 1868.1 take away 774540656? -774538787.9 What is -90.68048 less than -14035753? -14035662.31952 What is the difference between -69320.561928 and 11? 69331.561928 What is 0.00492857 take away -68940? 68940.00492857 What is -1050.0682512 minus -0.6943? -1049.3739512 What is 76.892007418 minus -55? 131.892007418 What is the difference between 4.195257359 and 0.031? 4.164257359 Total of -221145 and 777848301. 777627156 What is 476475077 + 0.019455? 476475077.019455 274463924420 + 114 274463924534 Put together -1313226 and 4247107. 2933881 What is 6398348285379 - 5? 6398348285374 Work out 4 + 110948071483684. 110948071483688 What is the distance between 22 and -0.04563182435? 22.04563182435 What is 137 - 5809123442? -5809123305 Work out -4.7996972393 + -1. -5.7996972393 Work out -810900650851 + -525. -810900651376 What is 5 minus 1076273178193? -1076273178188 57243350 - -17057 57260407 What is -39028 plus 2336858? 2297830 What is -265630 plus -184544.454? -450174.454 Add -3 and 6137379647074. 6137379647071 Work out -204.31 - -4551.48735. 4347.17735 1697257710212+0.1 1697257710212.1 What is -1131.09675 minus 26.4547? -1157.55145 1.0970026 - 276.3 -275.2029974 What is the distance between 75875580759953 and -0.06? 75875580759953.06 What is -0.07838591425 + -122971? -122971.07838591425 What is -167056 + 430877? 263821 What is the difference between 2.0361 and -53012.353? 53014.3891 Add -8574315527 and 17.819. -8574315509.181 Add 156.7 and -945484395. -945484238.3 What is -0.000987714447 plus 1.2003? 1.199312285553 Calculate -254140307 + -158.3. -254140465.3 Sum -0.159636848892 and -3. -3.159636848892 Calculate -2507 + 0.344889967. -2506.655110033 Calculate -0.068 - -0.15959173565. 0.09159173565 Work out -3579063339019 + 21. -3579063338998 What is the difference between -608033080353 and -6? 608033080347 What is 1 less than -3025192643064? -3025192643065 What is -492871.942 less than 9368? 502239.942 Calculate -5231702312 - 1.74. -5231702313.74 Sum -998.46824 and 4448. 3449.53176 Work out 0.70358 + -29004138. -29004137.29642 What is the difference between 6334507018194 and 4? 6334507018190 What is -0.4 + -11326963463086? -11326963463086.4 2985810247+44 2985810291 Work out -127299597868 + 2.1. -127299597865.9 What is 241194616534 minus 5? 241194616529 Add together 0.81048154 and -0.12721. 0.68327154 What is -69780157319 minus 0.4643? -69780157319.4643 Subtract -8 from -920362913821.8. -920362913813.8 Calculate 5 - -160691485972. 160691485977 108+-0.49407680743 107.50592319257 Subtract 0 from 18921445573. 18921445573 Work out -27633203324 + 0.46. -27633203323.54 13197.0953388+-2324 10873.0953388 What is -1.8187 + 38984078.5? 38984076.6813 What is 10769 plus -8782205407? -8782194638 1549.96886987 - 124 1425.96886987 Work out 119722378224312 + 0.3. 119722378224312.3 Work out -0.08 + -0.011817183447834. -0.091817183447834 What is -3 - 10372315830768? -10372315830771 Add together 8922444156811 and -0.06. 8922444156810.94 Calculate -117349834811 - 12. -117349834823 Work out 71438654151 - 11. 71438654140 Add together 0.1 and 16215894922. 16215894922.1 What is -235.27893 - 0.3037362? -235.5826662 What is the distance between 3996532 and 45539? 3950993 Work out -412752 + -66.189. -412818.189 Put together -1460.059699 and 0.04091. -1460.018789 Total of 62.046 and -51135210. -51135147.954 -59890700 + -1421 -59892121 Sum 2245.524765 and 136289. 138534.524765 What is 8199008608 less than 393? -8199008215 Work out 668.77322181 - -0.0507. 668.82392181 What is 134045912932 - 449? 134045912483 Sum 462048.7012551 and 0.5. 462049.2012551 Put together 2.4544 and 76276.7. 76279.1544 What is -3 - 12379802289.1? -12379802292.1 Work out -206.5898 - -18.162794. -188.427006 Subtract 608128.68 from -11.23284. -608139.91284 What is -5 take away -99.2062751021? 94.2062751021 What is 0.520895 - -10917080? 10917080.520895 What is -0.43 take away -718846.62? 718846.19 Add together -4916.98427126 and -1.07. -4918.05427126 Add -0.8 and -4168243806475. -4168243806475.8 What is 3296502.9 plus -20594641? -17298138.1 Add together 65062.948 and 234.74. 65297.688 What is -3.676 less than -5537353609? -5537353605.324 Put together 82 and -527776717345. -527776717263 What is -0.6 less than 30535040286? 30535040286.6 Total of 0.02 and 7898706102334. 7898706102334.02 -0.1 + -716199298186 -716199298186.1 Sum -33 and -5290923936800. -5290923936833 Calculate -301927700 + 6667. -301921033 6521 - -16436711 16443232 What is the difference between 0.57 and -8024493426? 8024493426.57 What is the difference between -15683453883830 and 0.5? 15683453883830.5 Subtract -0.1975 from 0.5423173305. 0.7398173305 Add together 745401 and -21161.1. 724239.9 What is 878513 less than 67.50127? -878445.49873 Put together 992195920 and -1456. 992194464 What is the distance between 0.0246 and -449828207? 449828207.0246 Calculate -427231417.044 - 21.6. -427231438.644 Total of 79806685846 and 0.12. 79806685846.12 What is the difference between 1648966579337 and 2? 1648966579335 1141322.726 + 586005 1727327.726 Calculate 71264 + -976805	{ "pile_set_name": "DM Mathematics" }
/7 b Which is the closest to -0.72? (a) 0.4 (b) 3/2 (c) 1/5 (d) 2 c What is the nearest to 0.07 in -2/19, -3, 4, -0.05? -0.05 Which is the closest to 0? (a) -11 (b) -1/6 (c) -2 (d) -2/9 b What is the nearest to 4 in -3/8, -4, -5, 9? -3/8 What is the nearest to 3 in 3, 1/5, -4, 0.1? 3 Which is the closest to -0.2? (a) -8 (b) -14 (c) -1 c What is the nearest to 8 in 1/8, 0.3, 1/5? 0.3 Which is the nearest to 0.1? (a) -2/13 (b) 2/5 (c) 13 a Which is the closest to -1/9? (a) -1/11 (b) 2 (c) 1 (d) 4 a What is the closest to 0 in 2, -0.4, 0.1, -19? 0.1 Which is the closest to -23/2? (a) 8/5 (b) 2/5 (c) -4 (d) -2 c Which is the closest to 0.1? (a) -3 (b) -0.2 (c) 3/5 (d) -0.6 b What is the closest to 2 in -1, -1/4, -3, -0.4? -1/4 What is the nearest to 11/2 in 0.5, -1/4, 2/35, -4? 0.5 What is the closest to 0 in -4, -2, -31, -0.5? -0.5 Which is the nearest to 1? (a) -0.3 (b) 0.4 (c) -0.1 (d) 1/3 b Which is the closest to -4? (a) -0.5 (b) 1/8 (c) -222 (d) -0.2 a What is the nearest to -4 in 9, 39, 0.5? 0.5 Which is the nearest to -1? (a) 1/4 (b) -8 (c) -3/4 (d) 4 c Which is the nearest to -0.02? (a) 2/3 (b) 0 (c) 2/127 b Which is the closest to -2? (a) -2 (b) 28 (c) -4 a What is the nearest to -8 in -4, 20, 1/4? -4 What is the closest to 2/7 in -2/3, 2/7, 9, -0.5? 2/7 What is the nearest to -2/7 in 2, 6, 2/7, 4? 2/7 Which is the nearest to 1? (a) -7 (b) -5 (c) -18 b What is the nearest to -2 in -32, -4, -0.1? -0.1 What is the nearest to 4 in -3/2, -0.1, -3/4, -3/13? -0.1 What is the nearest to -1/4 in -100, -1, 0.4? 0.4 What is the nearest to 0 in -0.4, -1/8, 2? -1/8 Which is the closest to -0.4? (a) 0.2 (b) 12/5 (c) -0.1 c Which is the nearest to -1? (a) -4 (b) -2 (c) 4/7 (d) 1/4 b Which is the closest to 0.1? (a) -2/9 (b) -5 (c) -73 (d) 2 a What is the closest to 1 in 1, -30/73, -5? 1 What is the closest to 0 in 6, 1/9, 3, -0.4? 1/9 What is the nearest to 0.1 in 4, 0.1, -36/7? 0.1 Which is the nearest to -1/7? (a) -3/4 (b) -37 (c) -0.2 (d) 0.3 c What is the nearest to -0.3 in 0.15, -4, 0.2, -1/3? -1/3 Which is the closest to -0.1? (a) 0.01 (b) -35 (c) 4 a Which is the nearest to 0.2? (a) 260 (b) -2 (c) -6 b Which is the closest to 1? (a) -0.5 (b) -7 (c) -4/3 a What is the closest to 0.6 in 0, -2/5, -3, -3/5? 0 What is the nearest to 1/2 in -4, 2, 0, 1/6? 1/6 Which is the closest to -1.2? (a) 1/7 (b) 4 (c) -2 (d) -2/15 c What is the closest to 2 in 13/5, 2, -0.4? 2 Which is the nearest to 7? (a) 4 (b) -0.33 (c) 5 (d) 1 c Which is the nearest to -1/5? (a) 0.1 (b) -141 (c) -1/7 c Which is the closest to 2? (a) -0.5 (b) -0.4 (c) 2/79 (d) -16 c What is the closest to 2/9 in 21/8, -0.2, 0.5? 0.5 What is the closest to -1.3 in 106, -1/8, -2, -4? -2 What is the closest to -2/5 in -1, -10, 2/21, 2/3? 2/21 Which is the closest to 2/11? (a) -5 (b) -21.4 (c) 1/5 (d) 4 c What is the nearest to 1.3 in 0.3, 17, 0.1, 3? 0.3 What is the nearest to -0.49 in -3, 14, -0.3? -0.3 What is the nearest to -8 in -5, 2/3, -2, -4? -5 What is the closest to -0.1 in -2, 18, -2/11? -2/11 Which is the closest to 1? (a) 10 (b) -0.04 (c) -1 (d) -2 b What is the nearest to 0.1 in -32, -3, -2/5, 38? -2/5 What is the nearest to 5 in -5, -0.11, 0.1? 0.1 Which is the nearest to -1/2? (a) 0.4 (b) -4 (c) -3 (d) 4 a Which is the nearest to -0.06? (a) 2/5 (b) -3 (c) -2 a Which is the closest to -1? (a) -5 (b) 0.1 (c) 1/2 (d) 4 b Which is the nearest to 2? (a) -0.5 (b) -1/4 (c) 2/217 (d) -2/23 c Which is the closest to 0? (a) 29 (b) -1/2 (c) -1 b What is the closest to 0 in 1, 3/4, 0.5, 0.01? 0.01 What is the nearest to 1 in -1, 359, -1/3, -0.3? -0.3 Which is the closest to -29? (a) -4 (b) 1/6 (c) -1 (d) 5/7 a What is the nearest to 0.1 in 59, 0, -2, 9? 0 Which is the nearest to 0.1? (a) 3 (b) -0.3 (c) 10.5 b Which is the closest to 0.1? (a) -6/11 (b) 0.2 (c) -4 b What is the closest to -5 in 15, 1/6, -5/2, -6? -6 What is the nearest to -1 in -12, -5, -4? -4 What is the closest to -1 in -0.2, -5, 0.4, 5? -0.2 What is the closest to 0 in 53, -7, 4? 4 What is the closest to -0.3 in 5, 1, -1, -0.8? -0.8 Which is the closest to -1/4? (a) 0.046 (b) 3/5 (c) 2 a What is the closest to -5 in -5, -1, 0? -5 What is the closest to 4 in -5, -1, 72, 3/5? 3/5 Which is the nearest to 1/3? (a) -22 (b) 1 (c) -1 (d) -0.1 d What is the nearest to 2/3 in 1/4, 51/4, 0.5? 0.5 Which is the nearest to 0? (a) 0.43 (b) -3/7 (c) 0.2 (d) 5/6 c What is the closest to 2/5 in 0.4, -2, 0.016, 7? 0.4 Which is the nearest to 0.5? (a) 7/6 (b) 1 (c) -36 b Which is the closest to -1? (a) 0.1 (b) 2/9 (c) 165.88 a What is the closest to 4 in 0.02, 2, -0.1? 2 Which is the closest to 17? (a) -0.3 (b) 1 (c) -3/4 (d) 0.4 b Which is the closest to 2? (a) 30 (b) 0.1 (c) 1/3 (d) -3 c What is the closest to -260 in -0.2, -3, -5? -5 What is the nearest to 0.1 in -2, -2/7, -8/5? -2/7 Which is the closest to 0? (a) -2.5 (b) 1/6 (c) 4 b What is the closest to -1 in 1/2, 5, 2/7, -11? 2/7 What is the closest to -0.1 in 2/9, 4/7, -2, -4? 2/9 What is the closest to -1/4 in 1/3, 4, 1/98? 1/98 Which is the closest to 9.3? (a) 0.1 (b) 0.3 (c) 4 c Which is the nearest to 0? (a) 2 (b) 0.1 (c) -1/23 c What is the closest to 2/3 in -0.4, 113, -4/7, 0.5? 0.5 What is the closest to 7/9 in 0.4, -0.3, -0.4, -3/11? 0.4 What is the nearest to 1 in -3/4, 7, 0.3, -0.3? 0.3 Which is the closest to 0? (a) 5 (b) -6 (c) -2/5 (d) -4 c Which is the nearest to 129? (a) 0.058 (b) 4 (c) -2/3 b What is the nearest to -0.2 in -0.11, -5, -2, 0.3? -0.11 Which is the closest to 0.19? (a) 0.2 (b) -1 (c) -0.4 a What is the nearest to -1/4 in -0.1, -0.3, 2/1887? -0.3 Which is the nearest to 1? (a) -2/9 (b) -2 (c) 2 (d) -15 c Which is the nearest to -0.33? (a) 0 (b) 0.3 (c) -0.14 c Which is the nearest to 2/21? (a) 2 (b) 0.4 (c) -42 (d) -2/9 b What is the nearest to -1 in -3, -25/12, 5? -25/12 What is the closest to 0 in -2, 86, -0.5, -0.4? -0.4 What is the nearest to -5 in -0.4, 3, -1/23, -0.1? -0.4 Which is the nearest to 2? (a) -2 (b) 0.3 (c) 0.4 c What is the closest to 0 in 1/2, -2/7, 0.6? -2/7 Which is the nearest to 1? (a) 3 (b) 2 (c) -1/4 b Which is the nearest to -0.2? (a) -2.2 (b) -1 (c) 24 (d) 1 b What is the closest to -1 in 139, 1/7, 1/5? 1/7 Which is the closest to 0? (a) -5 (b) -112 (c) 0.5 c What is the nearest to 0.1 in 7, 0.4, -27, -5? 0.4 Which is the closest to 0? (a) -1 (b) 3/5 (c) -2 (d) -58 b What is the closest to -2/7 in -5, 1/6, 0.5, -251? 1/6 Which is the closest to -1? (a) -3.5 (b) 1 (c) -4 b What is the nearest to -0.1 in 2/3, -0.4, -0.5, -3.82? -0.4 What is the closest to 1 in 3, 0.2, -48? 0.2 Which is the nearest to -13? (a) 0 (b) -2/9 (c) -1 (d) 20 c Which is the nearest to 16/7? (a) 2 (b) -0.2 (c) 1/3 a Which is the closest to -0.9? (a) 0.5 (b) -3 (c) 3 (d) -0.4 d Which is the nearest to 5? (a) -0.2 (b) -4.8 (c) 0.5 c Which is the nearest to -0.1? (a) -3 (b) -0.3 (c) 4 (d) 3/2 b What is the closest to -6 in 0.2, -0.4, 5, -47.2? -0.4 What is the closest to 0.08 in 2, -2/11, 0.02, -3? 0.02 Which is the nearest to 70? (a) -0.4 (b) -5 (c) -1/50 c Which is the closest to -1? (a) -3/2 (b) -2/7 (c) 2/7 (d) -11 a What is the closest to 5 in 10/3, 4, -0.5? 4 What is the nearest to 0.1 in -1.701, -2/9, 1/4, 1/5? 1/5 What is the closest to 9 in 0, -2, 1/4, -1/9? 1/4 What is the nearest to -0.1 in 1, 0.3, -3/2, -4? 0.3 What is the nearest to -1 in 0.09, 0, -1.2? -1.2 Which is the nearest to -1/3? (a) 5 (b) -13 (c) -1/29 c What is the nearest to 4/3 in -89, 0.2, -1/10? 0.2 What is the closest to -0.4 in -3/2, 2, 1, -8? -3/2 What is the closest to 4/5 in -0.4, 1/4, 0.5, -0.076? 0.5 What is the closest to -0.09 in -5, 5, 8, 3? 3 What is the nearest to -1/2 in -0.3, -3, -1/8, 0.4? -0.3 Which is the nearest to 4/5? (a) 1 (b) 2/5 (c) 0.01 a Which is the closest to -17.9? (a) 4 (b) -1/2 (c) -6 c What is the closest to 1 in 5, -1, 984? -1 What is the nearest to -0.1 in -3/7, -4, 2, 6? -3/7 Which is the nearest to 0.1? (a) 3/5 (b) 0.1 (c) -9 (d) 1/3 b What is the nearest to -34 in 2, 0.5, -2/11? -2/11 What is the closest to 2/5 in	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.