Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
(6/(-4))/(6/224). Let n = -31 - o. What is the remainder when n is divided by w? 4 Suppose -5p + 2n = -3p + 12, 0 = 4p + 2n + 12. Let f be ((-2)/p)/(4/(-200)). Let h = f + 39. Calculate the remainder when h is divided by 8. 6 Let h = 2170 + -2095. What is the remainder when 347 is divided by h? 47 Suppose 14p - 11p + 129 = 0. Let q = p + 60. Calculate the remainder when 65 is divided by q. 14 Calculate the remainder when 119 is divided by (-29)/145 - (-622)/10. 57 Let o = 1122 - -763. Calculate the remainder when o is divided by 51. 49 Let y(j) = -j3 - 15j*2 - 57j - 19. Suppose 3g + 7 = 91. Calculate the remainder when g is divided by y(-9). 4 Let c(a) = 15a3 - a2 - 4a + 4. Calculate the remainder when 222 is divided by c(1). 12 Let l be -11 - (0 + 6/3). Let z(f) = -3f - 28. What is the remainder when z(l) is divided by 5? 1 Suppose 0 = 12z - 13z + 24. Let i(w) = 5w2. Let y be i(-1). Suppose -yn + 47 = -18. What is the remainder when z is divided by n? 11 Suppose -6f = -60 + 12. Suppose f = 5t - 22. Calculate the remainder when 11 is divided by t. 5 Let w(j) = -9j + 19. Let o be (-2)/(-4) - (-133)/(-14). Suppose -108 = -3l + 2r, -4r + 93 + 65 = 5l. Calculate the remainder when w(o) is divided by l. 32 Suppose -346 - 4178 = -29l. Calculate the remainder when l is divided by 47. 15 Let v be ((-30)/(-5))/(3/2). What is the remainder when 19 is divided by v/22 - 375/(-55)? 5 Let f(d) = -d*2 + 8d - 10. Suppose 0 = 3x + 4o - 32, 0x - 5o = -2x + 6. What is the remainder when x is divided by f(3)? 3 Let n(r) = r2 - 3r - 7. Let j be n(5). Suppose -ji + 4i + 173 = 3z, -i - 291 = -5z. Calculate the remainder when z is divided by 15. 14 Let m = -362 + 373. What is the remainder when 26 is divided by m? 4 Let z(v) = -v*3 - 23v*2 - 50v - 18. Calculate the remainder when z(-21) is divided by 31. 26 Suppose -348 = -0v - 3v. Calculate the remainder when v is divided by 30. 26 Let v = -15 - -3. Let y = v + 24. Calculate the remainder when 35 is divided by y. 11 What is the remainder when (-15(-8)/(-36))/((-26)/1833) is divided by 12? 7 Calculate the remainder when (18 - 13)/(5/1) is divided by 1. 0 Suppose p - 31 = -3j, -p + 9 - 14 = 0. Calculate the remainder when 405 is divided by j. 9 Let b(q) = -2q2 + 30q + 22. What is the remainder when 84 is divided by b(15)? 18 Let h(o) = -28o - 22. What is the remainder when 617 is divided by h(-3)? 59 Suppose 3r - 87 = -4y, 2y + 4r + 6 = 62. Let u(j) = j2 + 6j. Let g be u(-5). What is the remainder when y is divided by g/(2/1 - 3)? 3 Let l = 1796 + -823. What is the remainder when l is divided by 65? 63 Let i(t) = -t*2 + 4t + 3. Let n be i(4). Suppose -4u = u - 220. Calculate the remainder when u is divided by n/((-6)/(-32)) - 1. 14 Let v(d) = d3 + 17d*2 + 32d + 51. Calculate the remainder when 78 is divided by v(-15). 15 Suppose -5f = 2x + 9, 2x = 4x - 6. Let v(j) = -j*3 - 2j*2 + 2j. Suppose -2l - 31 = -35. What is the remainder when v(f) is divided by l? 1 Let s(l) = -11 - 16l - 18 + l + 38 - 9l2 - l3. Calculate the remainder when s(-7) is divided by 2. 0 Suppose 43 + 53 = 4c. Suppose -5z = -94 + c. What is the remainder when 41 is divided by z? 13 Let n(f) = -f3 + 8f*2 - 6f - 4. Let x be n(7). Let l be (x/2)/((-3)/(-16)). Suppose 0 = -d + 36 - l. Calculate the remainder when d is divided by 10. 8 Let l = -12 + 17. Suppose -lk = z - 37, 2k + 4z = 6k - 44. What is the remainder when 30((-33)/(-6) + -5) is divided by k? 7 Suppose -l + 6l - 2h = 693, 4l + 3h - 536 = 0. Calculate the remainder when l is divided by 40. 17 Suppose 49 = -6o + 61. Suppose -424 = or - 10r. Suppose 22 = 3z - z. What is the remainder when r is divided by z? 9 Let d(h) = 4h - 34. Let j(a) = a*3 + 8a*2 + 15. Let s be j(-8). Suppose 5x = 5r - 405, -3x = -5x - 8. Calculate the remainder when r is divided by d(s). 25 Let a(g) = -22g + 19. What is the remainder when 110 is divided by a(0)? 15 Let p(g) = -g*3 + 20g*2 + 14g. Calculate the remainder when p(6) is divided by 119. 112 Let h(g) = 4g2 - 43g - 95. What is the remainder when h(15) is divided by 83? 77 Let y be (-96)/15 - 10/(-25). Calculate the remainder when 4/y + 693/27 is divided by 14. 11 Suppose -2a + 26 = -2j - 2j, 0 = 5j + 2a + 19. Let g be 5/((-10)/(-6)) + 9. Let y = g + j. Calculate the remainder when 33 is divided by y. 5 Suppose 5c = 5u + 580, 2c - 4c + 3u + 234 = 0. Suppose 9i + 273 = 16i. Calculate the remainder when c is divided by i. 36 Let r(l) = -l*3 + 6l*2 - 4l. Let n be r(5). Suppose 6a - 2a + 295 = nx, 3x = 4a + 185. What is the remainder when x is divided by 20? 15 Suppose 4 = 2v + 4l, 4v + 0l = 5l + 21. Let s(x) = 2x2 - 4x - 6. Calculate the remainder when 17 is divided by s(v). 7 Suppose -5c + 130 = -2l, 4l = -5c - 5 + 135. Let g be 4/(-6)(-207)/(-6). Let w = g - -125. Calculate the remainder when w is divided by c. 24 Suppose -n = -3n + 8. Let s(l) = l*3 - 4l*2 + 4l + 3. What is the remainder when 446/8 - 11/(-44) is divided by s(n)? 18 Let x = -161 - -224. Let f = 30 - -32. Suppose 0 = -2u + 2t + 28, 0 = -3u - 2t - 10 + f. Calculate the remainder when x is divided by u. 15 Let b = 442 - 327. What is the remainder when b is divided by 21? 10 Suppose 11v - 222 = 559. Suppose -2f + 18 = -0f. Calculate the remainder when v is divided by f. 8 Let h = -77 + 114. Calculate the remainder when 516 is divided by h. 35 Let w = -287 + 306. Calculate the remainder when w is divided by 9. 1 Let o(x) = -x3 + 6x*2 + 4x - 12. Suppose 4f - 20 = -4i, 0i = 3f - i - 19. What is the remainder when 33 is divided by o(f)? 9 Calculate the remainder when 110 + -115 - (-1956 + -1) is divided by 21. 20 Let d = -2 + 7. Suppose 4y - 33 = -df, y + 5f - 21 = 3y. Suppose 7n + 18 = 10n. Calculate the remainder when n is divided by y. 0 Let f = -685 + 740. Calculate the remainder when 80 is divided by f. 25 Let f = -19 - 60. Let h = f + 86. Calculate the remainder when 40 is divided by h. 5 Calculate the remainder when 1013/5 + 2/5 is divided by 52. 47 Let u be 261/(-36) - (-3)/(-4). Let r = u + -12. What is the remainder when 7 is divided by (9/(-12))/(5/r)? 1 Suppose -314 - 206 = -13z. Calculate the remainder when 197 is divided by z. 37 Let i(x) = 4x*2 + 4x + 4. Let w(r) = -r*2 + 14r - 11. Suppose 29m - 26m = 33. Calculate the remainder when i(-5) is divided by w(m). 18 Let r(a) = a*3 + 13a*2 + 6a - 17. Let t be -10(-1 + (-11)/(-5)). Calculate the remainder when r(t) is divided by 20. 15 Let l(q) = q3 + 3q*2 + 2. Let a be l(-3). Suppose -y + 4p = p - 33, -ay - 2p = -106. Let r = 927 - 902. Calculate the remainder when y is divided by r. 23 Let t be 3/(-27) + (32648/(-18))/(-7). Suppose 291 = 2a + t. What is the remainder when a is divided by 6? 4 Suppose 0 = -j - 2x + 47, 4x + 61 - 296 = -5j. What is the remainder when 141 is divided by j? 0 Let c = -101 + 105. What is the remainder when 4/2 + -6 + 8 is divided by c? 0 Let v be (3 - (2 - 0))-1. What is the remainder when 12 is divided by (0 + v)(-4 + -3)? 5 Let x = 64 + -56. What is the remainder when 16 is divided by 3 - (-4 - x)/2? 7 Let t = 148 - 99. Let y = 140 - t. Calculate the remainder when (-2)/10 - y/(-5) is divided by 5. 3 Let s = 29 - 24. Suppose 0 = f - sf + 148. Suppose 0 = 4y - 25 - 15. What is the remainder when f is divided by y? 7 Let g be -1(-1)/2-2. Let i be (1 - 1)g/(-2). Suppose i = -4z + 18 + 46. What is the remainder when 29 is divided by z? 13 Let o(y) = y*2 - 4y. Let h be o(-3). Suppose -h + 57 = 3l. Let c = 1 + l. Calculate the remainder when 25 is divided by c. 12 Suppose 5k - 177 = 4n, 8 = -n + 5. Suppose 0 = -2m + 2c + 18, -8m + 3m - 5c + 15 = 0. What is the remainder when k is divided by m? 3 Let h be (690/(-20))/((-2)/4). Let s = 75 - h. What is the remainder when 11 is divided by s? 5 Let g(i) = i + 6 + 0 + 1. Let l = -15 + 21. Calculate the remainder when 23 is divided by g(l). 10 Suppose 870 = -98n + 108n. What is the remainder when 427 is divided by n? 79 What is the remainder when 1/((-5)/3702/(-3)) is divided by 24? 15 Suppose 5w - 17 = -4s, 0 = w + 3s - 7 + 8. What is the r	{ "pile_set_name": "DM Mathematics" }
o*2 - 7o + 9. Let v be i(4). Let g(p) = 2p2 - p - 3. Give vn(h) - 2g(h). -h2 - h Let c(r) = 2r*2 - 4r + 2. Let b = 12 - 6. Let w(v) = 13v2 - 17v + 4. Let m(u) = 3u2 - 4u + 1. Let h(p) = -9m(p) + 2w(p). Give bc(d) + 11h(d). d*2 - 2d + 1 Let a(i) = 14i2 - 3i. Let b(d) = 84d2 - 17d. Give -34a(l) + 6b(l). 28l2 Let x(z) = -4z*2 - 4z + 3. Let w(m) = 5m2 + 5m - 4. Let c = 25 - 23. Give cw(y) + 3x(y). -2y2 - 2y + 1 Let w(p) = 8p + 2. Let d(o) = 9o + 2. Let i be (-182)/(-9) + 8/(-36). Let f = i + -15. Determine fd(r) - 6w(r). -3r - 2 Let s(v) = 3v - 1. Let b(r) = -r + 1. Calculate 5b(x) + 2s(x). x + 3 Let p(s) = -4s2 - 7s + 1. Let y(k) = 9k2 + 14k - 3. Determine 5p(a) + 2y(a). -2a2 - 7a - 1 Let q(s) = -s*2 - 6s + 20. Let i(w) = -2w + 7. Calculate 11i(p) - 4q(p). 4p*2 + 2p - 3 Let d(r) = r*2 + 5r - 2. Let v(z) = -z*2 - 3z + 1. Suppose c = 2k - 7, 0 = 4c + 4k - 2k + 8. Determine cd(q) - 5v(q). 2q2 + 1 Suppose 2s - 11 = -9s. Let b(g) = g3 + 6g*2 - 8g - 7. Let y(p) = -p*2 + p + 1. Calculate sb(q) + 6y(q). q3 - 2q - 1 Let i(u) = -3. Let c(g) = g + 6. Give -4c(r) - 7i(r). -4r - 3 Let c(j) be the first derivative of j3 - 3j*2 - 2j + 1. Suppose -7h + 2h + 10 = 0. Let v(z) = -z*h - z - 3 + 5z*2 - 6z. Determine 5c(k) - 4v(k). -k*2 - 2k + 2 Let p(k) = 5 - 12 + 9 + 7k. Let b(x) = -x - 1. Calculate 2b(n) + p(n). 5n Let k(h) = 5h*2 + 2h + 2. Suppose 4a + 3i + 28 = 0, a + 10 = -2i - 2. Let l(d) = -9d*2 - 4d - 4. Give al(t) - 7k(t). t*2 + 2t + 2 Let u(f) = -3f2 + 5f - 5. Let p(h) = -5h - 13. Let w(c) = c + 3. Let v(t) = 2p(t) + 9w(t). Determine -u(z) - 5v(z). 3z2 Let b(c) = -26c - 3. Let a(t) = 9t + 1. Calculate 8a(j) + 3b(j). -6j - 1 Let z(n) = n. Let a(c) = -2c3 - 4c*2. What is a(v) + 5z(v)? -2v3 - 4v*2 + 5v Let l(c) = c + 1. Let i(h) = 7h + 4. What is i(x) - 3l(x)? 4x + 1 Let y = -8 - 0. Let v(a) = 2a*3 - 8a*2 - 6a - 8. Let c(l) = -2l - 2l2 - l2 - 3 - 2l3 + 3l*3. Determine yc(x) + 3v(x). -2x*3 - 2x Let f(r) = r*2 - 1. Let k(h) = 6h*2 - 6. Give 15f(c) - 3k(c). -3c2 + 3 Let c(p) = -p2 + 2p2 - 2p*2 - p + 0p*2. Let r(o) = 2o*3 + 6o*2 + 5o + 1. What is 6c(l) + r(l)? 2l*3 - l + 1 Let s(k) = -5k - 27. Let r(f) = -2f - 13. Determine 9r(h) - 4s(h). 2h - 9 Let v(f) = 14f3 - 4f. Let g(l) = -27l3 + 7l. Determine -3g(c) - 5v(c). 11c3 - c Let m(q) = 1 - 2 - 7q + 4. Let n(v) = 3 - 4v - 4 + 3. Suppose -k + 2z + 3z = -5, 18 = -4k + z. What is kn(l) + 3m(l)? -l - 1 Let t(a) = 12a - 16. Let z(m) = m - 1. What is 3t(b) - 48z(b)? -12b Let r(s) = -15s3 + 3s*2 - 3s + 3. Let p(g) = 14g3 - 4g*2 + 4g - 4. Determine 3p(m) + 4r(m). -18m3 Let g(z) = -3z*3 - 2z*2 + 4z + 1. Let y(r) = 2r3 + r2 - 3r - 1. Give 3g(m) + 4y(m). -m*3 - 2m*2 - 1 Let x(c) = 12c - 4. Let n(m) = 7m - 2. Calculate -5n(h) + 2x(h). -11h + 2 Let v(r) = -1 - 2 - 6r + r - 1. Let u(p) = -4p - 3. Determine 4u(h) - 3v(h). -h Let u(b) = 21b + 6. Let w(o) = 4o + 1. Let l be (-7)/((-105)/(-10))99/6. Give lw(g) + 2u(g). -2g + 1 Let l(j) = -450j2 - 99j - 99. Let z(b) = -18b2 - 4b - 4. What is 4l(u) - 99z(u)? -18u2 Let h(a) = 5a3 - a2. Let s(n) = 4n3 - n2. Calculate 6h(j) - 5s(j). 10j3 - j2 Let i(s) be the second derivative of 3s5/20 - 2s*4/3 + 5s*3/6 + 2s*2 + 23s. Let t(k) = -2k3 + 7k*2 - 4k - 3. What is 3i(a) + 4t(a)? a*3 + 4a*2 - a Let h(r) = 5r3 - r2 + 3r. Let i(q) = q3 + q. Suppose -5x - 5 = 10. Let l be 0 - 2 - (-6 - x). Determine lh(s) - 4i(s). s3 - s2 - s Let d(z) be the third derivative of -z*4/12 + 7z3/3 - z2. Let w(v) be the second derivative of v*3/6 - 9v*2/2 + 3v - 1. Determine 5d(b) + 8w(b). -2b - 2 Let k(a) = -4a*3 + 2a - 8. Let h(g) = 9g3 - 5g + 15. Calculate 2h(o) + 5k(o). -2o3 - 10 Let l(g) = -g + 1. Let h(q) = -7. Determine -2h(j) + 2l(j). -2j + 16 Let q(c) = 3c + 11. Let k(j) = 0j - 2 + 6 + j. Let h be ((-12)/10)/(2/(-10)). Determine hq(z) - 17k(z). z - 2 Let t(x) = 3x3 - 13x2. Let c(l) = l3 - 6l2. What is 13c(i) - 6t(i)? -5i*3 Let v(q) = 6q2. Let f(u) be the first derivative of -u4/12 - 3u - 4. Let l(g) be the first derivative of f(g). Determine 22l(t) + 4v(t). 2t*2 Let g(q) = 13q*3 + 3q*2 - 7. Let j(b) = 7b*3 + 2b*2 - 4. Let o = 0 + 7. What is oj(k) - 4g(k)? -3k*3 + 2k2 Let b(h) = h3 + 6h2 - 3h - 2. Let r(i) = -i*3 - 11i*2 + 5i + 4. What is 5b(v) + 3r(v)? 2v3 - 3v*2 + 2 Let c(i) = 5i - 3. Let o(h) = 9h - 6. Suppose 15n - 14n + 6 = 0. What is no(s) + 11c(s)? s + 3 Let h(k) = -4k*2 + 2k. Let w(a) = 3a + 8. Let n be w(-4). Let s(p) = 3p*2 - 2p. Calculate nh(z) - 5s(z). z*2 + 2z Suppose -2y - 11 + 1 = 0. Let w(f) = -2f + 4. Let b(i) = 2i + 9. Let n(d) = -5d - 26. Let u(c) = -11b(c) - 4n(c). What is yw(m) + 4u(m)? 2m Let m(r) = -r3 - r2 - r. Let i(j) = -20j*3 - 22j*2 - 22j. Let g(h) = 3h2 - 11h + 2. Let o be g(6). Give om(n) - 2i(n). -4n3 Let g(c) = -3c*2 + 2c - 2. Let w(a) = 3a2 + 5a - 6a2 - 5 + 0a - 4a2. Calculate 15g(l) - 6w(l). -3l*2 Let s(l) = -20l*3 + 17l*2 - 20l + 3. Let i = 142 - 136. Let d(y) = -7y3 + 6y*2 - 7y + 1. Determine is(r) - 17d(r). -r*3 - r + 1 Let d(i) = 6i*3 - 5i2 + 4. Let r(b) = b2 + 3b. Let n be r(-3). Suppose 19c - 15c + 16 = n. Let u(f) = 5f*3 - 4f*2 + 3. Give cd(z) + 5u(z). z3 - 1 Let n(u) = u2 - 6u + 1. Let t(c) = -c*2 + 5c - 2. Calculate 3n(x) + 4t(x). -x*2 + 2x - 5 Let h(s) = s + 3. Let o = 35 + -31. Let g(c) = -1. What is og(v) + h(v)? v - 1 Let q(j) be the second derivative of -j3/2 - j2/2 + 14j. Let i(w) = 10w + 4. Calculate 2i(f) + 7q(f). -f + 1 Let w(s) be the second derivative of -s3/6 - s2/2 + 2s. Suppose m + 16 = -k, 3k - 3m + 56 = 2m. Let r(l) = -3l - 3. What is kw(v) + 6r(v)? -v - 1 Let a(l) = l - 1. Let m(s) = 52s - 3. Determine -3a(n) + m(n). 49n Let h(p) = 5p*2 - 62p - 4. Let d(a) = a*2 - 1. Calculate -4d(v) + h(v). v*2 - 62v Let v = 2 + 2. Let y(h) be the second derivative of 0h2 - 2h + 1/6h3 + 1/12h*4 + 0. Let z(a) = -3a*2 - 2a - 2. What is vy(i) + z(i)? i2 + 2i - 2 Let r(p) = -2p + 2. Let w(n) = n3 - 5n*2 + 2n + 7. Let t be w(3). Let y(s) = -4s + 3. What is tr(k) + 3y(k)? -2k - 1 Let i(h) = -h - 11. Let w(m) = -11. Determine -2i(n) + 3w(n). 2n - 11 Let r(v) = 2v2 - v - 2. Let g = 7 + -10. Let q(j) = -j2 + j + 1. Calculate gr(m) - 5q(m). -m*2 - 2m + 1 Let y(i) = 19. Let p(l) = -l*3 + 20. What is 2p(a) - 3y(a)? -2a*3 - 17 Let n(r) = 7r*2 + 7r - 1. Let z(a) = 8a2 + 8a - 1. Suppose 0 = -3d + 4d - 2. Let f = -3 - d. What is fz(p) + 6n(p)? 2p2 + 2p - 1 Let k(h) = -10h - 1. Let u(i) = 39i + 4. Calculate 9k(a) + 2u(a). -12a - 1 Let y(r) be the second derivative of r4/12 + r3/6 + r2/2 + 32r. Let v(n) = -3n3 - 2n*2 - 2n - 2. Give -v(f) - 2y(f). 3f3 Let b(n) = n3 + 4n2 + n - 2. Let p(v) = 9 - 5v*2 - 2v + 2 - 8. What is 3b(y) + 2p(y)? 3y3 + 2y*2 - y Let c(w) = -2w + 3. Suppose 35 = 5a + 5z, -6z + 3z = 4a - 26. Let y(j) = -j - 2 + aj + 1 - 3j. Determine -c(m) - 3y(m). -m Let y = 1 - 0. Let k(l) = -5l2 - 6l + 1. Suppose 10j - 7j + 12 = 0. Let t(x) = -x*2 - x. Give jt(p) + yk(p). -p2 - 2p + 1 Let v(l) = l + 1. Let i(a) = -15a2 + 35a + 35. What is -5i(m) + 175v(m)? 75m2 Let u(r) = -5r - 3. Let t(l) be the first derivative of 2l2 + 3l*2 - 1 - 3l*2 + 2l - 5. What is 3t(q) + 2u(q)? 2q Let z(c) = -6c*2 + 5c + 14. Let p(d) = -2d - 57. Let m be p(-27). Let b(o) = 2o*2 - 2o - 5. What is mz(q) - 8b(q)? 2q2 + q - 2 Let t(d) = 3 - 2d3 - d2 + 4d + 3d2 + d2. Let i(h) = h*2 - 4 + 2 - 5h - 5h2 - 2 + 2h*3. Determine -3i(r) - 4t(r). 2r*3 - r Let j(m) = 7m + 4. Let z(w) = -2w - 1. What is 6j(q) + 22z(q)? -2q + 2 Let g(m) = m*3 - 7m*2 + 6m + 4. Let t be g(6). Let q = 0 - -5. Let n(r) = qr - 5r - t - 3r. Let f(l) = -4l - 5. Calculate -4f(z) + 5n(z).	{ "pile_set_name": "DM Mathematics" }
8226hp - 228hy*3 wrt h? -341274290p*2 - 2py3 What is the second derivative of 118219735a*2 + 276592834a wrt a? 236439470 Find the first derivative of -2a3 + 1426a*2 - 1861a - 554297114 wrt a. -6a2 + 2852a - 1861 What is the third derivative of 811368340q3 + 639631031q*2 + q? 4868210040 What is the first derivative of 60382269k - 77782746? 60382269 What is the second derivative of -8276600o4 + 19o + 59736? -99319200o2 Find the second derivative of -45951649n*2 - 61105913n wrt n. -91903298 Find the third derivative of -137709215r4 - 9139062r*2 - 9r wrt r. -3305021160r Find the third derivative of -14p*2t*3 - 3p*2t - 353p2 - 869962pt4 + 157t*2 wrt t. -84p*2 - 20879088pt What is the third derivative of 348g*3n*3 - 11g*3n*2 - 25g*3 - 28g*2n*3 - 76g*2 + 10gn + 9n*3 + 5n*2 wrt g? 2088n*3 - 66n*2 - 150 Find the first derivative of 3774910q + 3600405. 3774910 What is the second derivative of -58780m3 - m2 + 15049640m wrt m? -352680m - 2 What is the third derivative of 30h*4j - 398h4 + 2h*3j + 99h3 + 3h*2j + 7412h2 + 28hj - h wrt h? 720hj - 9552h + 12j + 594 What is the third derivative of 95622n*6 - 10n*5 + 73n*2 + 2280n + 4 wrt n? 11474640n3 - 600n*2 Find the third derivative of -1506173g*3p2 + g3 - 2g2p*2 + 2809241 wrt g. -9037038p*2 + 6 What is the derivative of 248s*2 + 14134s - 8616882? 496s + 14134 Find the first derivative of 432925154n - 279134423. 432925154 What is the third derivative of 32509444d4p*2 + 5d*4 + 3d*2p*2 - 4d*2 - 2dp - p2 + 1600p - 3 wrt d? 780226656dp*2 + 120d What is the third derivative of -5342834pu*3 + 4278pu2 - p + 35u*3 + 3u*2 + u + 348 wrt u? -32057004p + 210 What is the second derivative of d*2j*2 + 15d*2j - 320d2 - 3dj2 + 95dj + 4190251j*2 - 10j - 2 wrt j? 2d2 - 6d + 8380502 What is the second derivative of -3t4 - 3050t*3 + 5301t*2 + 362404890t wrt t? -36t2 - 18300t + 10602 What is the derivative of -748p3 + 46p*2 - 336p - 176685466? -2244p2 + 92p - 336 Find the third derivative of 23k5 + 5k*4 + 7208k*3 + 55489k*2 - 132. 1380k*2 + 120k + 43248 Find the third derivative of -2d5 - 82039d*4 + 518d*3 - 763d*2 + 208532. -120d*2 - 1968936d + 3108 What is the second derivative of -24942158c5 + 140c - 29404 wrt c? -498843160c3 Find the second derivative of 33058j*2s*2 - 11602j*2s + 137j2 - 24js2 - 3j - 3s2 - 4s wrt s. 66116j2 - 48j - 6 What is the derivative of 966v2 - 387v - 5501170? 1932v - 387 What is the third derivative of 947o*2u*3 + 3o*2u*2 - 12o - 838u3 + 37861u*2 wrt u? 5682o2 - 5028 Find the first derivative of f2l - 30653f*2 - 653032fl3 - fl2 + 595 wrt l. f2 - 1959096fl*2 - 2fl What is the third derivative of 708479731t*3 + 174272t*2 - 156t + 3 wrt t? 4250878386 Find the first derivative of -9336i3 - 5i*2 - 2337i - 927089006 wrt i. -28008i2 - 10i - 2337 What is the third derivative of 33491892q3v + q3 - q2v + 4469q*2 + 96q + v wrt q? 200951352v + 6 What is the second derivative of -44483813d*3 + 3d + 9541483? -266902878d Find the second derivative of 6861340b*3 - 2b*2 - 25178664b wrt b. 41168040b - 4 What is the derivative of 37x*2y + 2067x2 - 16xy - 74614y + 10 wrt x? 74xy + 4134x - 16y Find the third derivative of -6006a5 - 70a*3 + 1873a*2 + a + 82 wrt a. -360360a*2 - 420 Find the second derivative of -88880403nr2 + 1419323nr + 70r wrt r. -177760806n What is the third derivative of -3j*2n3 - j2n2 - 9581jn3 + 52jn + 325n*3 + 25656n*2 wrt n? -18j*2 - 57486j + 1950 What is the second derivative of 583050g2 - 192g - 5508? 1166100 Find the second derivative of 25f2i*2 + 25f*2i + 20926f2 - 5fi2 - 74fi - 3f + 25i - 2 wrt f. 50i*2 + 50i + 41852 What is the second derivative of 74768763f2 - 1243191f - 219? 149537526 Find the third derivative of 95756625g4y - g*2y - 658g2 - 757gy + 2g - y + 1 wrt g. 2298159000gy Differentiate 3266k2m*3o + 2k2m*3 - 35k*2m - 3k2 - 2km + 4702m*3o + 38798m3 + 2m*2 with respect to o. 3266k*2m*3 + 4702m*3 Find the second derivative of 28510053k*2u*2 - 626k*2 + 278ku - 6u wrt u. 57020106k2 What is the third derivative of 7388626b*3 + 2023b*2 - 6 wrt b? 44331756 Find the third derivative of -3v*5 + 35025v*4 - 2v*3 - 385v*2 - 2v + 16 wrt v. -180v2 + 840600v - 12 What is the second derivative of -76814f5l + 103f2l*2 - 13809fl2 - 2fl - l2 - 10 wrt f? -1536280f*3l + 206l2 Find the third derivative of -7294850o*3 + 7616o*2 - 75o + 3. -43769100 Differentiate -28748177m2 + 58237102 wrt m. -57496354m What is the second derivative of 7486954a2 + 2999132a - 2? 14973908 Find the first derivative of 61262872w + 51284201 wrt w. 61262872 Find the second derivative of 457c*3f*3 - 9c*3f*2 - 33c*2 - cf*3 - 6cf2 - 2412cf + 9f*2 wrt c. 2742cf3 - 54cf2 - 66 What is the second derivative of -10048510bu2 + 6bu + 2u*2 - 759229u wrt u? -20097020b + 4 Find the first derivative of 16634674i*4 - 3065754 wrt i. 66538696i*3 Find the second derivative of 2352c*4 - 191c*3 - 15c*2 - 83398c + 126. 28224c2 - 1146c - 30 Differentiate -vw3 + 846561vw + 8372825w3 with respect to v. -w3 + 846561w Find the third derivative of 2014in3r - 4623in*2r*3 + 4in2r + 4n3r*3 - 67n*3 + 14n*2r*3 wrt n. 12084ir + 24r*3 - 402 What is the second derivative of -13660jm2t*2 + 2jmt - 43jt*2 - 42468j - 2m3t*2 + 4m*3 + mt wrt t? -27320jm*2 - 86j - 4m3 What is the second derivative of -23957949f*5 - 69480946f? -479158980f3 Find the first derivative of -68966045r*2 - 112793518. -137932090r What is the third derivative of -2r4 - 69162r*3 - 103248r*2 + 8r + 6 wrt r? -48r - 414972 Find the third derivative of -50046436k*4q + 11825k2 - 267q wrt k. -1201114464kq Find the third derivative of -51245q3y + 1853q3 + 21q*2y + 2652344q2 + 2y wrt q. -307470y + 11118 What is the second derivative of -159617979t*4 + 27079199t + 2 wrt t? -1915415748t2 Find the third derivative of -24244k*5 - 9501607k*2 wrt k. -1454640k*2 What is the third derivative of 2d*6 + 2035762d*4 + 4d*2 - 7586d - 7? 240d3 + 48858288d Differentiate -196n2u*3 + 5773106n*2 + 4236u*3 with respect to u. -588n*2u*2 + 12708u*2 Find the third derivative of 8199191a*3k*3 + 9519893a*3k2 + a3 + 7a2k*2 + 19k*4 wrt k. 49195146a*3 + 456k What is the third derivative of 3782340i2uv3 - 37i*2uv2 - i2v*2 + 7i*2 - 41iuv*3 + 3iv - i + 16v wrt v? 22694040i2u - 246iu What is the third derivative of -1303050315t3 + 890t*2 + 1493t + 67 wrt t? -7818301890 Differentiate 234t4 - 15750t - 13844430 wrt t. 936t3 - 15750 What is the second derivative of -2qw2 + 382qw - 2q + 44783w3 + 5992 wrt w? -4q + 268698w Find the second derivative of -140007u*5 + 7u*3 - 3u*2 + 17675u + 66. -2800140u3 + 42u - 6 What is the first derivative of -129d3 - 34d*2 + 26377d + 219350706 wrt d? -387d2 - 68d + 26377 What is the second derivative of -22971845z2 - 47673962z? -45943690 Find the third derivative of -57401146d5t*2 - 2d*2t - 601d2 + 14dt - 13t*2 + 33t wrt d. -3444068760d2t*2 What is the third derivative of -1097786269h*6 - 171480154h*2? -131734352280h*3 What is the second derivative of 404151691n*2 + 318921695n wrt n? 808303382 Find the first derivative of -11o2 + 296023o - 147291743. -22o + 296023 Differentiate -36933323p*3 + 10840165 wrt p. -110799969p*2 Differentiate -147r*3 + 79r*2 - 1834r - 371542563 with respect to r. -441r2 + 158r - 1834 Differentiate 2y3 + 10925041y*2 - 2y + 36248143. 6y2 + 21850082y - 2 Find the third derivative of 6g4 + 163667g*3 + 35584g*2 + g - 100 wrt g. 144g + 982002 Find the second derivativ	{ "pile_set_name": "DM Mathematics" }
m(u) = 5u + 2. Let q(o) = -6o - 3. Suppose 5w + 3y + 3 = 0, y - 5 = -1. Give wm(r) - 2q(r). -3r Let u(i) = 8i - 7. Let x(b) = -b*3 - 4b*2 + 2b + 3. Let s be x(-4). Let a(p) = -7p + 6. What is su(f) - 6a(f)? 2f - 1 Let d(m) = -m*3 - m. Let v(h) = 19h*3 + 7h. Calculate -6d(l) - v(l). -13l*3 - l Let u(l) = 4l + 2. Let z(n) = -17n - 8. Suppose -4b + 6 + 14 = 0, 0 = -3p + b - 32. Determine pu(g) - 2z(g). -2g - 2 Suppose -5d = -0d - 30. Let g(i) = -5i + 4i + 8 + 0i. Let w(h) = 0h - 2h + 5h - 23. Give dw(y) + 17g(y). y - 2 Let i(c) = -5c2 + 9c - 8. Let a = 5 + -7. Let x = a - -4. Let d(k) = k*x + 8 + 2k - 4k - 6. Calculate -9d(f) - 2i(f). f2 - 2 Let m(f) = 16f*3 - 2f + 2. Let u(b) = -783b3 + 99b - 99. Calculate -99m(j) - 2u(j). -18j3 Let t(v) = 39v + 117. Let s(x) = -3x - 9. Determine 27s(u) + 2t(u). -3u - 9 Let v(m) be the first derivative of m*2 - m + 10. Let g(b) = 4b - 2. What is -3g(r) + 5v(r)? -2r + 1 Let p be (-2)/12 + (-407)/(-66). Let m(s) = -s3 - 6s*2 + 6s + 4. Let x(b) = b*3 + 5b*2 - 5b - 3. Determine px(l) + 5m(l). l*3 + 2 Let m(j) = 124j - 59j - 3j*2 - 61j. Let s(f) = -f*2 + 3f - 4. Let t(n) = 2n2 - 4n + 3. Let u(w) = 3s(w) + 4t(w). What is -7m(p) - 4u(p)? p*2 Let k(u) = -u + 1. Let y(c) = c - 3. Calculate 6k(g) + 2y(g). -4g Let q(i) = 61i3 - 6. Let k(v) = 60v*3 - 7. What is -6k(o) + 7q(o)? 67o*3 Suppose 4 = y - 1. Let n(j) = 3 - 3 + 3j + y. Let o be 61 - 2/(-1). Let x(h) = h + 2. Give ox(g) - 3n(g). -g + 1 Let t(y) = -2y*3 + 3y*2 - y. Let q(v) = 8v*2 + 3v - v - 9v2 - v. Calculate -2q(r) - t(r). 2r3 - r2 - r Let z(c) = 2c - 5 - 1 - 2 + 2. Let l(o) = -8. Let i(f) = -f + 1. Let m(r) = 3i(r) - l(r). Calculate -4m(v) - 7z(v). -2v - 2 Let t(s) = s*3 + 6s*2 + 11s + 27. Let a be t(-5). Let w(c) = -4c - 11. Let r(i) = 2i + 5. Determine aw(k) - 7r(k). -2k - 2 Let n(x) = 6x*2 - 11x + 7. Let y(b) = 5b2 - 9b + 6. Let i(o) = -4n(o) + 5y(o). Let l(f) = 2f2 + f + 1 - 3f + 4. Give 9i(j) - 4l(j). j*2 - j - 2 Let k(o) = -2o - 2. Let f(x) be the third derivative of -5x4/24 - 2x*3/3 - 6x*2. Calculate -3f(q) + 7k(q). q - 2 Let z(y) = 2y*3 - 3y*3 + 2 + 2 + 6y*2 + 1. Let r(u) = -5u*2 - 2 + 1 + 4u*2. What is -6r(s) - z(s)? s*3 + 1 Let z(m) = 32m + 3. Let b(c) = 16c + 2. Let r(y) = -5b(y) + 3z(y). Let p = -15 - -17. Let w(d) = -2d + d - pd. Calculate 2r(u) + 11w(u). -u - 2 Let h(j) = -3j3 + j2 - 11j + 4. Let g(t) = -5t*3 + 2t*2 - 17t + 6. Calculate 5g(m) - 8h(m). -m*3 + 2m*2 + 3m - 2 Let w(q) = 13 + q - 3 - 9 - 8q. Let z(g) = 8g - 1. Calculate 4w(t) + 3z(t). -4t + 1 Let p(x) = x3 + 3x*2 - 5x + 3. Let c be p(-4). Let y(u) = u. Let i be y(c). Let k(g) = 2g + 3. Let n(l) = -1 + 3l - 9l + 5l. Calculate in(s) + 3k(s). -s + 2 Let g(l) = 22l - 4l - 20l. Let q(r) = -r. Give -3g(v) + 5q(v). v Let w(k) = -5k*2. Let g(u) = -16u*2. Calculate -3g(f) + 8w(f). 8f2 Let k(w) = -w + 1. Let f(z) be the third derivative of z4/3 - 2z3 + 2z*2. Suppose 3q - 8 - 43 = 0. Let b = 18 - q. Calculate bf(y) + 10k(y). -2y - 2 Let f be (-7 - -4) + 3 + -4. Let t(o) = o + 1. Let c(h) = -h2 + 3h + 2. Give ft(i) + 2c(i). -2i2 + 2i Let k(w) = w + 16. Let b(c) = -1. Let j = -10 + 13. Let d(f) = 3. Let i(v) = jd(v) + 12b(v). Determine 11i(u) + 2k(u). 2u - 1 Let s(w) = -21w*3 + 16w*2 + 5w. Let i(g) = -4g3 + 3g*2 + g. Give -11i(m) + 2s(m). 2m3 - m2 - m Suppose 2h + 5o = -0h + 23, 15 = 5o. Let r(a) = -5a2 + a + 5. Let p(w) = -6w*2 + w + 6. What is hr(k) - 3p(k)? -2k*2 + k + 2 Let t(r) = -5r*2 + 4r. Let o = 6 + -5. Let c = -2 - 2. Let g(d) = -d*2 - d. Let x(k) = -k. Let y(v) = g(v) - 2x(v). Determine cy(p) + ot(p). -p*2 Let b(o) = -4o + 1. Let d(g) = g - 1. Suppose -3i - 2q = 14, 3i + 32 = -2i + q. Give id(c) - 2b(c). 2c + 4 Let m(q) = -11q + 15q3 - 5q2 - q2 + 15 - 5q2 - 4. Let w(x) = 4x*3 - 3x*2 - 3x + 3. Let d be 9(0 - (-2)/(-3)). Give dm(k) + 22w(k). -2k*3 Let a(x) = 6x*3 + 2x*2 - 5x - 2. Let j(z) = -13z3 - 5z*2 + 11z + 5. Determine 5a(t) + 2j(t). 4t3 - 3t Let c(u) = -2u + 4. Let r(t) = 2t - 3. Let y be ((-4)/(-10))/((-2)/(-10)). Let d = 185 - 182. Give dr(l) + yc(l). 2l - 1 Let q(x) = 5x*3 - 3x*2 - 8. Let k(n) = -4n*3 + 2n*2 + 8. What is -3k(p) - 2q(p)? 2p3 - 8 Let c(g) = -g2 - 4g + 2. Let l(m) = m2 + 7m - 3. Determine 7c(s) + 4l(s). -3s2 + 2 Let y(k) = -5k*3 + 4k*2 - 3k - 3. Let b(g) = g3 - g2 + g + 1. Determine -3b(f) - y(f). 2f3 - f2 Let c(u) = u*3 - u. Let n(y) = -4y3 - y2 + 6y. Suppose 0 = -13r + 8r + 30. Calculate rc(v) + n(v). 2v3 - v2 Let m(f) = 5f + 5. Let o(i) = 5i + 5. What is 6m(d) - 5o(d)? 5d + 5 Let w(m) = -1. Let j(p) = 3p3 - 2p*2 - 3p - 4. Determine -j(a) + 3w(a). -3a*3 + 2a*2 + 3a + 1 Let q(p) = p*3 - 2p*2 - 2p. Let c(b) = 36b + 3b*3 + 39b + 38b - 118b - 5b2. Suppose x = -3 + 5. Let l be (-4 + x - 0)-1. What is lc(h) - 5q(h)? h*3 Let n(p) = -96p*2 - 11. Let o(g) = -64g*2 - 7. Determine -5n(u) + 8o(u). -32u*2 - 1 Let w(l) = 198l - 22. Let m(b) = -44b + 5. What is -22m(p) - 5w(p)? -22p Let d(m) = m*2 - 3m. Let a be 3/2 + 3/2. Let y = a - -2. Suppose -yo - 26 = 4l, 0 = 2o - 0o - 5l + 17. Let z(k) = k. Determine oz(v) - 2d(v). -2v*2 Let j(x) = -3x3 + x2 - 4x + 1. Let p(b) = -b3 - b. Calculate -j(c) + 4p(c). -c3 - c2 - 1 Let l(r) = 11 + 7 - 3r - 15. Let v(p) = -p2 - p + 1. What is -l(z) + 3v(z)? -3z2 Let z(t) = -2t - 4. Let o(q) = -4q - 7. Determine 3o(c) - 5z(c). -2c - 1 Let k = -131 + 126. Let l(h) = 7h - 7. Let r(d) = 6d - 6. Calculate kr(u) + 4l(u). -2u + 2 Let x(v) = -v3 - v2 + v + 1. Let g(i) = -6i*3 - 5i*2 + 7i + 2. What is -g(t) + 5x(t)? t3 - 2t + 3 Let u(g) = g3 + g2 - 1. Let m(r) = r*3 + 2r*2 - 3r - 2. Give -m(k) + 2u(k). k3 + 3k Let u(j) = j. Let w be 58/(-4) + (-2)/4. Let y(m) = 16m. Let s(b) = -53b. Let g(r) = -4s(r) - 14y(r). What is wu(v) - g(v)? -3v Let z(c) = 15. Let i(j) = j*2 - 74. Determine 2i(y) + 11z(y). 2y2 + 17 Let z(l) = l3 - 6l2 - 6l - 10. Let p be z(7). Let j(i) = i + 2. Let f(o) = -2o - 2. Calculate pj(u) - 2f(u). u - 2 Let a(h) = h + 4. Let k(w) = 48 - 3w + 2w - 49. Calculate a(y) + 2k(y). -y + 2 Let u(r) = 3r + 2. Let x be (-12)/7 + 4/(-14). Let k(j) = 13j + 16. Let z(l) = -7l - 9. Let m(n) = 3k(n) + 5z(n). Determine xm(f) + 3u(f). f Let l(q) = -1. Let t(k) = 4k*2. Calculate -l(m) - t(m). -4m*2 + 1 Let p(o) = -6o*3 + 4o*2 - 4o + 2. Let y(q) = 7q3 - 5q*2 + 5q - 3. Suppose 0 = -8c - 7c - 75. Give cp(b) - 4y(b). 2b3 + 2 Let f(p) be the second derivative of p6/720 + p4/4 - 3p. Let l(k) be the third derivative of f(k). Let g(o) = 4o - 1. Give -2g(z) + 7l(z). -z + 2 Let m(v) = -17v*3 - 11v*2 + 11v + 4. Let o(l) = -6l3 - 4l*2 + 4l + 1. Give 4m(q) - 11o(q). -2q3 + 5 Let f(a) = 2a*3 + 4a + 2. Let c(t) = 3t3 + 5t + 3. Let x(l) = 10 - 5 + 9l2 + 2l*3 - 3l*3. Let k be x(9). Give kf(h) - 4c(h). -2h*3 - 2 Suppose -4 = q - 0q. Let w(s) = -4s - 13. Let z(r) = 2r. Let v(j) = 3j + 1. Let h(a) = -3v(a) + 4z(a). Calculate qw(y) + 18h(y). -2y - 2 Let k(l) = 8l2 - 6l + 9. Let u(r) = r*2 - r + 1. Give -k(i) + 6u(i). -2i2 - 3 Let d(x) = 4x*2 - 5x + 5. Let y = -49 - -48. Let t(j) = -j*2 + j - 1. Calculate yd(l) - 5t(l). l2 Let m(i) = -36i3 - 22. Let g(c) = -c3 - 1. Determine 88g(v) - 4m(v). 56v3 Let b(u) = -2u*3 + 5u*2 + 5u + 5. Let t(q) = q3 - q2 - q - 1. Calculate b(x) + 5t(x). 3x*3 Let j(z) be the first derivative of -3z*2 - 8. Let a(u) = -17u. Calculate -4a(b) + 11j(b). 2b Let n(r) = -1. Let a(f) = -f + 1. Calculate -4a(z) - 4n(z). 4z Let c(n) = -3n3 - 5n - 2. Let s(g) = -13g3 - 20g - 8. Determine 9c(w) - 2s(w). -w*3 - 5w - 2 Let u(h) = 3 + 6 - 4 - 3h. Let g(m) be the first derivative of m2 - 4m - 7. Let a(o) = -o*2 + 3o + 3. Let j be a(3). What is ju(n) + 4g(n)? -n - 1 Let a(c) = c**2 + c. Let	{ "pile_set_name": "DM Mathematics" }
513 rounded to four dps? -0.1265 What is -234840 rounded to the nearest ten thousand? -230000 Round -0.00035171 to five decimal places. -0.00035 Round 654.44 to the nearest 100. 700 Round -1893 to the nearest one thousand. -2000 Round -434 to the nearest one hundred. -400 Round -143670 to the nearest one thousand. -144000 Round -0.011117 to three decimal places. -0.011 Round 2.528 to the nearest integer. 3 What is -18259000 rounded to the nearest 100000? -18300000 Round 0.016725 to 4 dps. 0.0167 What is 462190 rounded to the nearest 10000? 460000 Round 194.42 to zero dps. 194 Round 22690000 to the nearest one million. 23000000 What is -868 rounded to the nearest one hundred? -900 Round -77410 to the nearest 10000. -80000 Round 967920 to the nearest one thousand. 968000 What is 2320000 rounded to the nearest one million? 2000000 What is -0.000133965 rounded to 6 decimal places? -0.000134 What is 1669.8 rounded to the nearest ten? 1670 Round -6250 to the nearest ten thousand. -10000 Round 0.00000072568 to 7 decimal places. 0.0000007 Round -4.2388 to 0 dps. -4 What is -0.00137725 rounded to four dps? -0.0014 Round 0.0058 to 4 decimal places. 0.0058 Round -2503.4 to the nearest 10. -2500 What is -19.7 rounded to 0 decimal places? -20 Round 30.25 to the nearest integer. 30 Round 0.00002805 to 5 dps. 0.00003 Round -0.043221 to 4 dps. -0.0432 Round 57248 to the nearest ten thousand. 60000 Round 0.00955 to four decimal places. 0.0096 Round -12900000 to the nearest 1000000. -13000000 What is 527000 rounded to the nearest 100000? 500000 What is 415800 rounded to the nearest 10000? 420000 What is 0.00002305 rounded to five dps? 0.00002 Round -1805 to the nearest 100. -1800 Round -28.615 to 1 dp. -28.6 Round -1.871 to 1 decimal place. -1.9 Round -721900 to the nearest ten thousand. -720000 Round -657.24 to the nearest 100. -700 What is -64850000 rounded to the nearest 1000000? -65000000 What is -3128200 rounded to the nearest one hundred thousand? -3100000 Round -0.194655 to 3 dps. -0.195 What is 117.3 rounded to the nearest 10? 120 What is 533.4 rounded to the nearest 100? 500 Round -0.000000217 to seven dps. -0.0000002 Round -0.065664 to 2 dps. -0.07 What is 2175.8 rounded to the nearest one hundred? 2200 Round -1050 to the nearest one hundred. -1100 What is -0.000022969 rounded to 5 decimal places? -0.00002 Round 42.74 to the nearest integer. 43 Round -13430 to the nearest one hundred. -13400 What is -1.065 rounded to the nearest integer? -1 What is 14.1353 rounded to 2 dps? 14.14 What is -0.0000000409 rounded to seven dps? 0 What is -0.77349 rounded to three dps? -0.773 Round 564470 to the nearest one thousand. 564000 What is 1108920 rounded to the nearest ten thousand? 1110000 Round 16834000 to the nearest 100000. 16800000 What is -83.9 rounded to the nearest integer? -84 Round 0.01203 to three dps. 0.012 What is 0.71113 rounded to two dps? 0.71 What is -0.017329 rounded to 4 decimal places? -0.0173 What is -252080 rounded to the nearest one thousand? -252000 What is -284.6 rounded to the nearest 10? -280 Round 0.0087983 to 3 dps. 0.009 What is 0.00009037 rounded to five decimal places? 0.00009 What is -0.000267 rounded to 3 dps? 0 Round -0.000000602 to 7 decimal places. -0.0000006 Round -0.47771 to 2 dps. -0.48 What is -974.27 rounded to the nearest ten? -970 What is 1993000 rounded to the nearest 100000? 2000000 Round -0.003679 to four dps. -0.0037 What is 265400000 rounded to the nearest one million? 265000000 What is 1.88791 rounded to two dps? 1.89 Round 89.9 to the nearest ten. 90 Round -0.4215 to one decimal place. -0.4 Round -3505000 to the nearest one million. -4000000 Round 0.015328 to four dps. 0.0153 Round 26203 to the nearest ten thousand. 30000 What is -0.00000054577 rounded to seven decimal places? -0.0000005 Round 11990000 to the nearest 100000. 12000000 What is 19700 rounded to the nearest 10000? 20000 What is 248 rounded to the nearest 100? 200 What is 0.002475 rounded to 4 dps? 0.0025 What is -0.01065 rounded to three dps? -0.011 Round -0.00012043 to 6 dps. -0.00012 Round -0.00026487 to six dps. -0.000265 What is 0.000026038 rounded to seven dps? 0.000026 Round -131.8 to the nearest ten. -130 Round -0.9727 to one dp. -1 Round 0.0000009937 to 7 dps. 0.000001 What is 1305.71 rounded to the nearest ten? 1310 Round -109.42 to the nearest ten. -110 What is 125300000 rounded to the nearest one million? 125000000 Round 47.138 to one dp. 47.1 Round -3959.6 to the nearest 10000. 0 Round -4920 to the nearest 100. -4900 Round 0.000010832 to 6 dps. 0.000011 Round -33.06 to the nearest 10. -30 What is 260.555 rounded to the nearest 10? 260 What is 21.63 rounded to the nearest integer? 22 What is 5.41 rounded to one dp? 5.4 Round 239.24 to the nearest 10. 240 What is 0.005682 rounded to 3 dps? 0.006 What is -57360 rounded to the nearest 1000? -57000 What is 0.001846 rounded to 4 dps? 0.0018 Round -466.6 to the nearest 10. -470 Round -2427000 to the nearest one hundred thousand. -2400000 What is -13.319 rounded to 0 dps? -13 What is 0.00000102649 rounded to 7 dps? 0.000001 Round -7315 to the nearest one thousand. -7000 Round -357.3 to the nearest 100. -400 Round -0.5142 to 1 dp. -0.5 Round 0.00000331 to seven dps. 0.0000033 Round 0.00007956 to 6 decimal places. 0.00008 Round -34.095 to one decimal place. -34.1 What is 0.0000258687 rounded to seven dps? 0.0000259 Round 1740000 to the nearest 100000. 1700000 Round -370100 to the nearest 10000. -370000 Round 0.0000013394 to 7 decimal places. 0.0000013 Round -7.2551 to the nearest integer. -7 Round -0.00001864 to 6 dps. -0.000019 Round -0.00005148 to five decimal places. -0.00005 Round -261760 to the nearest 10000. -260000 Round -0.000008027 to 6 dps. -0.000008 What is 357520000 rounded to the nearest one million? 358000000 What is 0.04691 rounded to 2 dps? 0.05 What is 0.015132 rounded to three dps? 0.015 Round 1338.5 to the nearest 100. 1300 What is -0.001447 rounded to 4 decimal places? -0.0014 What is 4772 rounded to the nearest one hundred? 4800 Round 0.008247 to three dps. 0.008 What is 125.063 rounded to the nearest 10? 130 What is -0.0000020979 rounded to seven dps? -0.0000021 What is -1.10069 rounded to two decimal places? -1.1 What is 0.000002755 rounded to 6 decimal places? 0.000003 Round -0.0015556 to 5 dps. -0.00156 Round 787.64 to the nearest one hundred. 800 Round -0.00002015 to six decimal places. -0.00002 What is -0.0001858 rounded to 5 dps? -0.00019 Round -9778 to the nearest 1000. -10000 What is -0.000035629 rounded to six dps? -0.000036 Round 688000 to the nearest 10000. 690000 Round 0.00021897 to five decimal places. 0.00022 Round -0.002285 to 3 decimal places. -0.002 What is -386.3 rounded to the nearest 10? -390 What is -42.67 rounded to the nearest integer? -43 What is -0.0000006355 rounded to 7 dps? -0.0000006 What is -0.00023954 rounded to four dps? -0.0002 Round -0.0012703 to five decimal places. -0.00127 What is -124.49 rounded to the nearest ten? -120 What is -10553000 rounded to the nearest 100000? -10600000 Round -14070 to the nearest 1000. -14000 What is -1.058 rounded to two decimal places? -1.06 What is 9.79 rounded to 0 decimal places? 10 Round 0.0141192 to five decimal places. 0.01412 Round -0.0000010882 to seven decimal places. -0.0000011 Round 2156 to the nearest 100. 2200 What is -73540000 rounded to the nearest 1000000? -74000000 What is 1.2258 rounded to 1 decimal place? 1.2 What is -592220000 rounded to the nearest 1000000? -592000000 Round -5041 to the nearest 100. -5000 Round -199819 to the nearest 1000. -200000 What is -1215200 rounded to the nearest one hundred thousand? -1200000 Round 23180000 to the nearest 1000000. 23000000 What is 3391000 rounded to the nearest 100000? 3400000 Round -97390 to the nearest 10000. -100000 What is -2264 rounded to the nearest one hundred? -2300 Round 0.0101 to two decimal places. 0.01 Round 0.0004285 to five dps. 0.00043 What is -179.45 rounded to the nearest ten? -180 What is -0.00235639 rounded to four dps? -0.0024 Round 0.06925 to 2 decimal places. 0.07 Round 11.43 to the nearest integer. 11 Round 7.0411 to two dps. 7.04 Round -0.0030034 to 3 dps. -0.003 What is 0.357 rounded to the nearest integer? 0 Round -0.000	{ "pile_set_name": "DM Mathematics" }
thout replacement from dddddydyd? 1/36 Two letters picked without replacement from erqrrereryqr. What is prob of sequence ye? 1/44 Calculate prob of sequence rz when two letters picked without replacement from {z: 7, d: 9, r: 3}. 7/114 Two letters picked without replacement from swwwooiwwowhnonhowo. What is prob of sequence nw? 7/171 Two letters picked without replacement from {a: 2, n: 2, v: 1, u: 1, h: 2}. What is prob of sequence aa? 1/28 Three letters picked without replacement from ryyeosn. What is prob of sequence rsy? 1/105 What is prob of sequence pi when two letters picked without replacement from iiiidpddpip? 3/22 Calculate prob of sequence ttst when four letters picked without replacement from {t: 6, s: 5, x: 2}. 5/143 Calculate prob of sequence coc when three letters picked without replacement from ccccccccoccoc. 5/39 Three letters picked without replacement from eoxxxsssdooxoeoxoosx. Give prob of sequence ees. 1/855 Two letters picked without replacement from {i: 2, g: 1, v: 4}. What is prob of sequence ig? 1/21 Calculate prob of sequence lll when three letters picked without replacement from lltl. 1/4 Four letters picked without replacement from kukrykrk. Give prob of sequence rkry. 1/210 Calculate prob of sequence nkkk when four letters picked without replacement from {k: 5, s: 2, n: 3}. 1/28 Four letters picked without replacement from wiwwswwwipiw. What is prob of sequence wips? 7/3960 Calculate prob of sequence bbx when three letters picked without replacement from {x: 9, b: 10}. 45/323 Calculate prob of sequence coc when three letters picked without replacement from {o: 3, c: 3}. 3/20 Calculate prob of sequence ee when two letters picked without replacement from eie. 1/3 Three letters picked without replacement from {y: 2, u: 2, c: 1, m: 1}. What is prob of sequence myu? 1/30 What is prob of sequence kd when two letters picked without replacement from drkrrpprd? 1/36 Calculate prob of sequence jlhj when four letters picked without replacement from {l: 8, h: 3, j: 5}. 1/91 Calculate prob of sequence ck when two letters picked without replacement from cckkkckckcccc. 10/39 Four letters picked without replacement from {q: 10, t: 1, w: 6}. What is prob of sequence wqqt? 9/952 Calculate prob of sequence zw when two letters picked without replacement from uiimuzw. 1/42 Four letters picked without replacement from {z: 1, w: 2, h: 1, d: 1, v: 2, r: 2}. Give prob of sequence zwvh. 1/756 What is prob of sequence jv when two letters picked without replacement from nvjvv? 3/20 Two letters picked without replacement from {z: 4, l: 2, v: 1, h: 1, c: 2}. Give prob of sequence zv. 2/45 Calculate prob of sequence ett when three letters picked without replacement from ett. 1/3 Calculate prob of sequence wwe when three letters picked without replacement from {f: 1, u: 3, j: 3, e: 3, a: 4, w: 2}. 1/560 Three letters picked without replacement from {d: 2, i: 7, a: 1, w: 7}. What is prob of sequence wwa? 7/680 Four letters picked without replacement from {r: 4, k: 3, u: 2}. What is prob of sequence krku? 1/63 Two letters picked without replacement from mgygacy. What is prob of sequence ym? 1/21 What is prob of sequence uq when two letters picked without replacement from {p: 2, q: 4, e: 7, u: 2, d: 1}? 1/30 Three letters picked without replacement from fmhmfdmfffbbff. Give prob of sequence mfb. 1/52 Two letters picked without replacement from hhhhhhhhhhhhhhhhhs. What is prob of sequence hs? 1/18 Three letters picked without replacement from ammma. Give prob of sequence amm. 1/5 Four letters picked without replacement from {w: 4, p: 7, n: 2}. What is prob of sequence ppnn? 7/1430 Calculate prob of sequence ve when two letters picked without replacement from {v: 1, a: 2, e: 1, c: 1}. 1/20 Two letters picked without replacement from uul. Give prob of sequence lu. 1/3 Calculate prob of sequence vvc when three letters picked without replacement from vvvvvvvvvvvvvvvvccvv. 17/190 Two letters picked without replacement from baaayfpfa. Give prob of sequence yf. 1/36 Three letters picked without replacement from iiiiepiippiiiii. What is prob of sequence iep? 11/910 What is prob of sequence wgd when three letters picked without replacement from ggdggggggwddd? 8/429 Two letters picked without replacement from fgauujw. What is prob of sequence aj? 1/42 Three letters picked without replacement from ztuuuzzzutuu. What is prob of sequence tzz? 1/55 Calculate prob of sequence td when two letters picked without replacement from {d: 4, t: 10}. 20/91 Three letters picked without replacement from avvavvvavvavvvvvvav. Give prob of sequence aaa. 10/969 Three letters picked without replacement from {a: 2, o: 1, l: 1, v: 2, e: 4, g: 2}. Give prob of sequence aol. 1/660 Two letters picked without replacement from viivvzvxvvvii. What is prob of sequence iz? 1/39 Two letters picked without replacement from {m: 3, z: 1, h: 1, i: 1, f: 1}. What is prob of sequence mi? 1/14 Calculate prob of sequence rxrg when four letters picked without replacement from {x: 4, r: 2, g: 2}. 1/105 What is prob of sequence lzzz when four letters picked without replacement from {z: 1, w: 2, l: 4, p: 9}? 0 Four letters picked without replacement from {y: 13, c: 5}. Give prob of sequence ccyy. 13/306 Three letters picked without replacement from bbkbkbbbbeek. Give prob of sequence beb. 7/110 Three letters picked without replacement from kknnnnkn. Give prob of sequence nkn. 5/28 Three letters picked without replacement from {h: 3, v: 2}. Give prob of sequence hvh. 1/5 Two letters picked without replacement from klkllllkkllklllkll. What is prob of sequence kl? 4/17 Two letters picked without replacement from {s: 2, e: 2}. What is prob of sequence ss? 1/6 Two letters picked without replacement from {v: 7, e: 2, b: 1}. Give prob of sequence ve. 7/45 Two letters picked without replacement from {l: 1, a: 2, j: 3, b: 5, d: 7}. Give prob of sequence dj. 7/102 Three letters picked without replacement from {q: 1, v: 2, c: 1, g: 2, m: 1, l: 1}. What is prob of sequence gmg? 1/168 What is prob of sequence yeoe when four letters picked without replacement from yepopdfeppepopdep? 1/2380 Calculate prob of sequence skbk when four letters picked without replacement from {s: 1, b: 2, k: 2}. 1/30 Three letters picked without replacement from iiiiiiittiittiiiiti. Give prob of sequence tit. 140/2907 What is prob of sequence ee when two letters picked without replacement from hezzezhhzdzzzzzdzze? 1/57 Three letters picked without replacement from cdcpttttm. Give prob of sequence mtt. 1/42 Calculate prob of sequence om when two letters picked without replacement from pemppoopoaomaoeoapp. 2/57 Two letters picked without replacement from {r: 1, w: 1, d: 3, k: 1, e: 1}. What is prob of sequence re? 1/42 Two letters picked without replacement from {y: 3, f: 2, l: 3, k: 1, b: 4, w: 2}. What is prob of sequence lw? 1/35 Three letters picked without replacement from {q: 1, p: 3, j: 1, u: 1, k: 1}. What is prob of sequence kpu? 1/70 What is prob of sequence qr when two letters picked without replacement from {a: 1, e: 1, t: 1, q: 1, r: 3}? 1/14 Four letters picked without replacement from uvuvuvvvvvvfvvvvv. Give prob of sequence uvuv. 39/2380 Three letters picked without replacement from yabsbbsbsyxa. What is prob of sequence xsb? 1/110 Two letters picked without replacement from {c: 3, u: 6, p: 3, f: 1}. What is prob of sequence cf? 1/52 Two letters picked without replacement from sffffffffssffs. What is prob of sequence sf? 20/91 What is prob of sequence nnn when three letters picked without replacement from {t: 5, n: 3}? 1/56 Three letters picked without replacement from xgmkgjxm. What is prob of sequence kgm? 1/84 What is prob of sequence svs when three letters picked without replacement from ssvsccssvcvc? 1/22 Four letters picked without replacement from {v: 4}. Give prob of sequence vvvv. 1 Calculate prob of sequence fj when two letters picked without replacement from dffrfujuf. 1/18 Calculate prob of sequence kwk when three letters picked without replacement from {p: 6, k: 5, w: 2}. 10/429 Two letters picked without replacement from {i: 1, c: 2, f: 3, r: 1, u: 6}. What is prob of sequence uu? 5/26 Two letters picked wi	{ "pile_set_name": "DM Mathematics" }
st common multiple of 84111 and 33258? 40541502 What is the common denominator of 51/989 and 16/31567375? 726049625 Calculate the common denominator of 87/265156 and 19/2913092. 1278847388 Find the common denominator of 59/8 and 43/27535850. 110143400 What is the smallest common multiple of 177021 and 918? 1062126 Calculate the least common multiple of 5039570 and 238514. 156226670 Calculate the smallest common multiple of 723885 and 75. 3619425 What is the common denominator of 191/18480 and 109/20202? 8888880 Calculate the lowest common multiple of 36045160 and 200. 180225800 What is the smallest common multiple of 722462 and 1703? 94642522 What is the smallest common multiple of 1990086 and 1176? 7960344 Calculate the common denominator of -29/15786528 and -101/1973316. 15786528 Calculate the common denominator of -59/13178 and 69/19514222. 214656442 What is the smallest common multiple of 1176254 and 21172572? 21172572 What is the common denominator of -113/280 and -62/935025? 7480200 Find the common denominator of -61/35766630 and -113/18280722. 822632490 Calculate the lowest common multiple of 42 and 420. 420 Find the common denominator of -31/102144 and -151/3618048. 68742912 What is the lowest common multiple of 12609771 and 214366107? 214366107 What is the lowest common multiple of 324 and 427032? 427032 What is the common denominator of 1/79130121 and -5/158260242? 158260242 Calculate the least common multiple of 696208 and 5088. 4177248 Calculate the least common multiple of 84 and 10367. 124404 What is the common denominator of 44/87 and -133/16405764? 16405764 What is the least common multiple of 28506 and 31480126? 94440378 What is the smallest common multiple of 600642 and 882? 600642 What is the least common multiple of 612 and 56664162? 113328324 Calculate the common denominator of 151/3536808 and 4/99. 10610424 Calculate the common denominator of -72/175 and -95/3715348. 92883700 What is the lowest common multiple of 19444660 and 6? 58333980 What is the least common multiple of 61440 and 8133? 166563840 Calculate the lowest common multiple of 3145506 and 14814. 9436518 Calculate the smallest common multiple of 22360473 and 14906982. 44720946 What is the common denominator of -10/15630563 and 64/8005? 78152815 What is the common denominator of -163/22610 and 9/326116? 27719860 Find the common denominator of -109/12 and 61/580936958. 3485621748 What is the common denominator of 101/1579572 and -25/14003172? 1246282308 What is the common denominator of -91/1010000 and -43/16160? 2020000 Calculate the lowest common multiple of 5897316 and 20. 29486580 Calculate the common denominator of -13/44044350 and -17/3500. 440443500 What is the least common multiple of 46433372 and 84? 975100812 Find the common denominator of 59/333 and -25/12302241. 36906723 Calculate the smallest common multiple of 45419400 and 93600. 181677600 What is the common denominator of -93/4 and -115/7132062? 14264124 Find the common denominator of 43/450 and -17/5812425. 11624850 Calculate the common denominator of 1/215237 and -62/3355165. 57037805 What is the common denominator of -93/6748738 and -37/433? 6748738 What is the common denominator of -117/89110 and 53/236075? 31634050 Calculate the common denominator of -83/60710 and -76/675. 8195850 What is the common denominator of 69/10 and -97/37292732? 186463660 What is the common denominator of 11/136 and -47/2073751? 282030136 What is the smallest common multiple of 35 and 4357535? 4357535 Find the common denominator of 35/40296 and -77/22776. 523848 Calculate the common denominator of 19/704718 and -193/7854. 7751898 What is the common denominator of 37/2101840 and -73/80920840? 161841680 What is the smallest common multiple of 42 and 1622982? 11360874 Calculate the least common multiple of 913 and 19414. 17724982 Find the common denominator of 35/1206272 and -91/1116. 10856448 Calculate the smallest common multiple of 1803080 and 15. 5409240 What is the common denominator of -5/18 and 101/516816? 516816 Find the common denominator of 63/53105 and 35/424. 22516520 Calculate the least common multiple of 1029330 and 2367459. 23674590 What is the smallest common multiple of 41977680 and 228? 797575920 Find the common denominator of -91/41889030 and 49/3. 41889030 What is the common denominator of 139/39240 and 29/17916330? 214995960 Find the common denominator of -9/712 and 97/72. 6408 What is the smallest common multiple of 513796 and 44? 5651756 What is the smallest common multiple of 8 and 10032244? 20064488 Find the common denominator of 125/261804 and -73/99921860. 299765580 What is the smallest common multiple of 2624319 and 8145? 13121595 What is the common denominator of -169/990 and -155/6174? 339570 What is the common denominator of 113/40 and -143/44970768? 224853840 What is the lowest common multiple of 150 and 138204720? 691023600 What is the smallest common multiple of 1898171 and 1553049? 17083539 What is the common denominator of -7/126368 and 53/18874? 1192534816 Calculate the least common multiple of 751564 and 1860. 11273460 Calculate the least common multiple of 47901 and 1134. 2586654 What is the smallest common multiple of 4295160 and 6642? 12885480 What is the common denominator of -91/1208 and 163/6371898? 25487592 Calculate the least common multiple of 80326 and 30294. 1216697922 What is the least common multiple of 21450 and 27950? 922350 What is the lowest common multiple of 22159959 and 199439631? 199439631 Calculate the least common multiple of 10275608 and 41102432. 41102432 What is the common denominator of -31/5539620 and 107/2215848? 11079240 What is the lowest common multiple of 4902 and 106320? 86863440 What is the common denominator of 25/114 and -37/611913? 23252694 Find the common denominator of 7/15 and -143/1170174. 5850870 What is the common denominator of 101/2253966 and 83/57720? 45079320 What is the smallest common multiple of 4454 and 17405446? 295892582 Calculate the least common multiple of 59480 and 790. 4698920 What is the lowest common multiple of 6090 and 1389540? 282076620 What is the lowest common multiple of 8021800 and 28076300? 56152600 What is the common denominator of 1/8154918 and 37/162? 8154918 Calculate the smallest common multiple of 21 and 4445868. 4445868 Calculate the smallest common multiple of 1864746 and 78. 1864746 Calculate the common denominator of 58/1881 and 34/119491. 11829609 Calculate the common denominator of 39/2660707 and 107/12. 31928484 Find the common denominator of -38/757 and 37/2271. 2271 What is the least common multiple of 69766 and 3772? 131578676 What is the common denominator of 9/208803010 and 7/10? 208803010 Calculate the common denominator of 109/20174 and -79/1456. 2098096 What is the common denominator of -11/27 and -53/237660? 2138940 Calculate the common denominator of -49/4521330 and -16/675. 67819950 Find the common denominator of 33/168316 and 125/144768. 210058368 What is the least common multiple of 80484 and 246187142? 1477122852 Calculate the smallest common multiple of 3745238 and 51. 191007138 Calculate the least common multiple of 10183040 and 15680. 71281280 Find the common denominator of -49/398112 and 167/1255584. 16322592 What is the common denominator of 15/8499904 and -5/25499712? 25499712 What is the common denominator of 47/376454 and 11/1872? 27104688 What is the common denominator of 137/48 and -7/1582512? 1582512 Find the common denominator of 29/8 and -33/11900716. 23801432 Calculate the smallest common multiple of 2888 and 658084. 25007192 Calculate the common denominator of 49/3328 and -47/843440. 13495040 What is the common denominator of 23/184068 and 77/240? 3681360 Calculate the common denominator of -71/55400 and -103/72560150. 290240600 Calculate the common denominator of 13/20688203 and 59/344. 165505624 Calculate the least common multiple of 4989 and 104937. 174510231 Find the common denominator of -61/47840 and -1/3430128. 34301280 What is the least common multiple of 88636 and 48480? 1074268320 Calculate the common denominator of 27/658 and 89/55452. 18243708 What is the common denominator of 31/11340 and -167/58140? 3662820 Calculate the lowest common multiple of 12 and 73	{ "pile_set_name": "DM Mathematics" }
2 - 55u. Determine -3q(x) - 165w(x). 33x2 Let x(b) = b2 - 2b - 40. Let g be x(-5). Let z(h) = -h2 - 2h + 2. Suppose u - 3 = -1. Let f(j) = -3j2 - 5j + 5. What is gz(q) + uf(q)? -q2 Let s(u) = -u2 + u + 2. Let n(q) = 2q2 + 7q + 9. Give n(b) - 4s(b). 6b*2 + 3b + 1 Let q(j) = -j*3 + 1147j*2 + 11j - 7. Let g(a) = 382a2 + 3a - 2. What is -7g(h) + 2q(h)? -2h3 - 380h*2 + h Let l(z) = 2z + 3. Let p(i) = 326i - 38. Give 12l(f) + p(f). 350f - 2 Let p(l) = l - 4. Let c(k) = 1. Let g(w) = -4c(w) - p(w). Let v(s) = -3s3 - 2s*2 - 5s + 1. Calculate -5g(b) + v(b). -3b*3 - 2b*2 + 1 Let v(j) = 4j*3 + 4. Let r be (6/(41/(-2)))/(-3). Let z(n) = -n*3 - 1. Calculate rv(d) + 3z(d). d3 + 1 Let r(b) = -79b + 2. Let g(i) = 41i - 2. Let c(t) = -4g(t) - 2r(t). Let u(x) = -5 - 6x + 0x + 8. Calculate 3c(p) - 4u(p). 6p Let b(c) be the third derivative of c5/30 + c4/8 - c*3/2 - 178c*2. Let k(v) = 3v*2 + 4v - 4. Determine -5b(n) + 4k(n). 2n2 + n - 1 Let a(z) = 3z*2 - 4z + 4. Let u(v) = 3v2 - 5v + 5. Suppose -51m - 248 = -44. Give ma(o) + 3u(o). -3o*2 + o - 1 Let q(d) = 162620d*3 - 1903d*2 - 1903d - 1903. Let c(v) = -171v3 + 2v*2 + 2v + 2. Determine -1903c(z) - 2q(z). 173z3 Let y(h) = 7h*2 - 2h - 4. Let v(x) be the first derivative of x*3/3 - x + 459. What is 6v(d) - y(d)? -d*2 + 2d - 2 Let v(r) be the first derivative of -r*2/2 + 295. Let m(g) = 4g - 1. Determine -m(l) - 2v(l). -2l + 1 Let u(c) = -7c - 11. Let d(s) = -3s - 5. Suppose -6x + 12 = -2x. Let j(g) = -4 - g + xg - g - 2g. Let t be j(0). Calculate tu(q) + 9d(q). q - 1 Let x(v) = -4v2. Let n(u) = 5u - 5u + 3u*2. Let h = 8306 + -8304. Determine hx(i) + 3n(i). i2 Let c(b) = -b2 - 2b - 2. Let s(o) be the first derivative of -2o3/3 - 3o*2 - 5o + 714. What is 11c(a) - 4s(a)? -3a2 + 2a - 2 Let o be 7 + (-1 + 4 - 4). Suppose 0 = -5u + ou - 5. Let m(h) = -6h3 - 7h*2 + 3. Let t(x) = -5x*3 - 6x*2 + 2. Give ut(r) - 4m(r). -r3 - 2r*2 - 2 Let t(q) = -44q*3 - 4q*2 - 19q - 8. Let n(p) = 43p3 + 3p*2 + 16p + 6. Calculate 4n(w) + 3t(w). 40w3 + 7w Let u(y) be the third derivative of -y6/60 - y5/30 + y4/8 - y3/2 + 31y2 + y. Let l(t) = t3 + 2t*2 - 3t + 2. Give -3l(i) - 2u(i). i*3 - 2i*2 + 3i Let t(i) = 16i + 19. Let k(o) = 9o + 11. Let r(x) = -7k(x) + 4t(x). Let f(v) = 2v2 - 5v + 6. Calculate -f(d) - 6r(d). -2d*2 - d Let j(r) = 11r*2 + 6r - 17. Let u(p) = -17p2 - 9p + 26. Calculate 8j(b) + 5u(b). 3b2 + 3b - 6 Let l(k) = -47k3 + 2k*2 - 4k - 10. Let r(a) = -71a3 + 2a*2 - 6a - 16. Determine -8l(x) + 5r(x). 21x3 - 6x*2 + 2x Suppose 0 = 4g - 1 - 7. Let h(s) = -4s + 29 + s*g - 22 - 7s*2 - 8s*3. Let d(f) = 7f*3 + 5f*2 + 3f - 6. What is 6d(q) + 5h(q)? 2q3 - 2q - 1 Let j(o) = -o - 22. Let g(n) = n - 21. Determine -3g(k) + 2j(k). -5k + 19 Let y(m) = -m3 - 5m*2 + 1. Let i(o) = -5o*3 - 26o*2 + 4. Suppose 0 = -3s + 4n - 53, 0 = s - 14n + 13n + 16. Give sy(j) + 2i(j). j3 + 3j*2 - 3 Let n(t) = 6t*3 - 3. Let k be 63/28 + 3/4. Let v be ((-3)/6)/(k/(-6)). Let b(y) = 3y*2 - v - 2y*3 + 3y*3 - 3y*2. What is -3b(p) + n(p)? 3p3 Let j(h) = h3 - h + 1. Let y(n) be the first derivative of 2n*4 - 5n*2/2 + 5n + 95. Give -15j(l) + 3y(l). 9l3 Let u(p) = 265p*3 - 3p*2 + 11p + 24. Let y(c) = -88c3 + c2 - 4c - 9. Give -3u(q) - 8y(q). -91q3 + q2 - q Let f(i) = 26i. Let q(z) = 27z + 2. Determine -6f(b) + 5q(b). -21b + 10 Let y(z) = z. Let n(f) = -f*2 + f - 1. Let x(c) = 7c*2 + 3c + 2. Let j(i) = 3n(i) + x(i). Calculate j(o) - 6y(o). 4o2 - 1 Let c = -108 + 108. Let j(w) = 0 - 50w + c + 49w. Let u(y) = 2y3 + y2 + 9y. Determine 18j(d) + 2u(d). 4d*3 + 2d*2 Let z be (2 - 1)(1 + 0). Let g(u) = 6u - 1. Let w(s) = -6s + 1. Let c(v) = -37v + 6. Let n(b) = -c(b) + 6w(b). Determine zg(a) - 5n(a). a - 1 Let u(d) = d*2 - 10d - 2. Suppose 5b + 635 = 590. Let r(s) = -5s*2 + 41s + 9. Calculate bu(j) - 2r(j). j*2 + 8j Let t(h) = -1 + 2h - 2h - h - 2h + 3h*2. Let b(z) = 2z*2 - 4z*3 + 0z*2 + 2z*3 + 3z*3 - 2z. Calculate 3b(q) - 2t(q). 3q3 + 2 Let w(n) = -9n - 139. Let x(q) = 11q + 140. Calculate -6w(t) - 5x(t). -t + 134 Let i(p) = 37p*3 + 7p*2. Let a(l) = 18l*3 + 4l*2. What is 9a(q) - 5i(q)? -23q3 + q2 Let c(k) = -3k + 7. Let a(z) = -z + 1. Let o(d) = -10a(d) + 2c(d). Suppose h - 10 = 4j, 3h - h = -3j - 13. Let b(g) = -4g - 5. Determine jb(m) - 4o(m). -4m - 1 Let r(y) = 28y + 3. Let x(p) = -140p - 17. Give 11r(i) + 2x(i). 28i - 1 Let g(n) be the second derivative of 0n*3 + 1/2n*2 - 50n + 0 + 1/12n4 + 1/20n5. Let d(a) = -a3 + 5a2 + 5. Calculate -d(i) + 5g(i). 6i3 Suppose -o + 5q = -6 - 4, 4q + 37 = -5o. Let a(r) = 7r + 6. Let v(l) = -9 - 8l - 10 + 35 - 10 - 13. Give ov(s) - 6a(s). -2s - 1 Let i(h) = -h3 - 5h*2 + 2h. Let j(d) = -3d3 - 10d*2 + 4d + 1. Calculate -5i(v) + 2j(v). -v*3 + 5v*2 - 2v + 2 Let r(b) = -17b2 + 3b - 2. Suppose 29t - 12t = -17. Let a(u) = -u. Calculate tr(v) - 3a(v). 17v2 + 2 Let j(l) = l - 1. Let x(n) = 5n + 6n + 12 + 0n - 5 - 16n. Suppose 3 = -3z - 9. Determine zj(c) - x(c). c - 3 Let r(y) = 5y. Suppose 15 + 0 = 5z. Let u(o) be the third derivative of o4/4 - o2. Let j(x) = 12x + 574. Let w be j(-48). What is wu(f) + zr(f)? 3f Let y(s) = s + 4. Let l(z) = -1. Let k = -3 + 6. Suppose 2v + 13 = 3h, -4v + 5 = -2h + 11. Suppose v = ka + 4. Determine ay(r) - 2l(r). -r - 2 Let b(t) = -7t3 - 3t + 3. Let j(f) = 30f + 19f + 76f3 + 28f - 15 - 17 - 45f. Suppose 3u = -2v - 92, 11 = 4v + 3. Calculate ub(s) - 3j(s). -4s3 Let i(u) = -7u*2 + 7u + 10. Let n(k) = -25k + 0k*2 + 26k - k*2 + 1 + 0k*2. Give i(p) - 6n(p). -p*2 + p + 4 Let q(j) = 227j + 12. Let a(t) = 142103t + 7514. Calculate -6a(y) + 3757q(y). 221y Suppose -3f = 2l - 49, 45 = -0l + 3l - 5f. Let z(t) = -10 - 1 - 10t*2 + 9t - lt. Let q(h) = -2h*2 - 2h - 2. Determine -22q(w) + 4z(w). 4w2 Let y(q) = -13q*2 + 28q + 125. Let u(w) = 3w2 - 6w - 31. Calculate 18u(d) + 4y(d). 2d2 + 4d - 58 Let c(h) = -h. Let o = 91 - 96. Suppose -4q - 4v = -12, 4q + 3 = q + 3v. Let n(w) = -3w - 1. What is oc(z) + qn(z)? 2z - 1 Let p(x) = 8x3 - 5x*2. Let i(m) = 2m3 - m2 + m. What is -10i(h) + 2p(h)? -4h3 - 10h Let l(c) = 25c2 - 24c + 1. Let z(b) = -2b2 - 3b. Determine -3l(g) + 24z(g). -123g2 - 3 Let n(d) = 4d + 22. Let u(m) = -5m - 19. Determine 3n(i) + 2u(i). 2i + 28 Let i(s) = s*3 - 3. Let c(w) = -3w*3 - 2w2 + w + 1. Let f(l) = l3 + l*2 - l + 2. Let t(p) = -c(p) - 2f(p). Give -5i(m) + 3t(m). -2m3 + 3m Let r(x) = -x*3 + 35x*2 + 34x + 44. Let c(o) = 16o2 + 17o + 23. Let p(k) = 5c(k) - 3r(k). Let n(i) = -i*3 + 8i*2 + 6i + 6. Give -17n(f) - 6p(f). -f*3 + 14f*2 Let i(q) = 5q + 11. Let t(g) be the first derivative of 13g2 + 56g + 166. Give -16i(s) + 3t(s). -2s - 8 Let s(t) = t2 + 7t + 2. Let q be s(-7). Let z(d) = 2 - 6 - 4d2 - 4d - d*q + 1. Let i(v) = -14v*2 - 11v - 8. Give -4i(c) + 11z(c). c2 - 1 Let n(s) = -s3 - 2. Let x(b) = -b*2 - 13b + 16. Let r be x(-12). Suppose -r = -3y - y. Let q(l) = 3l3 - l2 + l + 7. Give yn(h) + 2q(h). -h*3 - 2h*2 + 2h Let t(a) be the second derivative of 0 + 3/20a5 - 26a + 4/3a3 - 2/3a*4 + 5/2a2. Let q(b) = -b3 + 3b2 - 3b - 2. Calculate 8q(r) + 3t(r). r3 - 1 Let m = 2497 + -2501. Let b(i) = i3 - 4i - 4. Let j(w) = w3 + w2 - 3w - 3. What is mj(v) + 3b(v)? -v*3 - 4v2 Let x(j) = -j2. Suppose 5p - 16 = -4m - 6, 3p = -2m + 4. Let n(u) = u. Calculate px(r) + n(r). 2r2 + r Let o(z) = -z2 - 2z - 5. Let l(j) = -j2 - 20 - 6j*2 + 2j*2 - 10j - 4 - 2. What is 2l(n) - 11o(n)? n*2 + 2n + 3 Let w be (-2)/6 + (-4)/6. Let d(k) = k. Let t = 57 + -37. Let b(v) = -v*2 + 18v + 34. Let x be b(t). Let s(i) = -3i. What is ws(q) + xd(q)? -3q Let f(l) = 3l2 - l + 5. Let c(t) = -2t**2 +	{ "pile_set_name": "DM Mathematics" }
Let v be i(21). Determine vd(z) - 2b(z). z*2 + 2z - 1 Let x(z) = -2z + 2. Let o = 5633 - 5631. Let m(u) = 2u - 2. Determine om(t) + 3x(t). -2t + 2 Let n(j) = j3 - j2 + j - 6. Let x(c) = 2c*3 - 7c*2 + 7c + 11. Determine 14n(z) - 2x(z). 10z3 - 106 Let s(v) be the first derivative of v3/3 + 2v*2 - 17v + 27. Let c be s(-7). Let n(o) = -2o - 2. Let h(t) = 2t + 3. Calculate ch(i) + 6n(i). -4i Let q(g) = -g3 - 13g. Let h(v) = 36v3 + 36v*2 + 117v. Give -h(z) - 9q(z). -27z*3 - 36z*2 Let n(c) = 5c - 4. Suppose 0 = -2v + 45w - 41w + 62, -3w + 181 = 5v. Let i(b) = -45b + 35. Determine vn(f) + 4i(f). -5f Let q(d) = d2 + 2. Let a(c) = 130 - 16 + 90 - 11 - 15 + 15c. Let h be a(-12). Let k(s) = -3s2 - 3. Give hk(v) - 5q(v). v2 - 4 Let n(a) = -a + 4. Let q be (-157)/(-4) - 1/4. Let t(x) = -217x + 261. Let d be t(1). Let y = q - d. Let z(p) = -3p + 9. Calculate yn(c) + 2z(c). -c - 2 Suppose 0 = -b + 5u + 50, 80 - 87 = 4b + 3u. Let l(w) = 0w - 2w + 4 + 0w. Let g(d) = -d + 2. What is bg(f) - 2l(f)? -f + 2 Let q be (-1)/(-2) - 21/(-6). Let f(z) = -6z*2 - z + 3. Let n(v) = -7v*2 - 2v + 4. Let o be (-14 + -17 + 30)9/3. Determine on(d) + qf(d). -3d*2 + 2d Let s(w) = -w*3 + 5w*2 - 7. Suppose 2c + 4p - 6 = 0, 3c - 9 = -0c - 3p. Let r(y) = -89y + 4y*2 - 107y - 7y2 + 196y + 4. What is cs(u) + 5r(u)? -3u3 - 1 Let n(z) = -38z - 1. Let l(i) = -i. Let j = 13663 - 13661. Give jl(f) + n(f). -40f - 1 Let s(h) = 0 - 4 + 5 - 12h + 3 - 11h. Let t(y) = 47y - 9. Determine 9s(x) + 4t(x). -19x Let q(y) = -13y - 4407. Let k(l) = 2l + 2. Give 6k(h) + q(h). -h - 4395 Let s(v) = 315v. Let w(b) = 2b - 5. Let m(p) = 18p + 180. Let o(d) = -m(d) - 36w(d). What is 18o(f) + 5s(f)? -45f Let p(z) = 2z + 1. Let a(f) = 5f*3 - 64f*2 - 16f + 32. Let b be a(13). Suppose 3l = -2l. Let y(c) = -c + l - 8c + 3 + 14c. What is bp(v) + 3y(v)? v + 2 Let l(i) = -7i2 - 5i + 1. Let z(f) = 19f2 - 19f - 5. Let p(h) = -62h2 + 60h + 16. Let n(g) = 5p(g) + 16z(g). What is 5l(u) - 6n(u)? u*2 - u + 5 Let t(j) = -j - 1. Let b(o) = o + 2. Suppose 0 = 29r + 26 - 142. Suppose -8k - r = -10k. Determine kb(q) + 3t(q). -q + 1 Let k = 116925 + -116917. Let g(t) be the second derivative of 5t3/3 - 7t*2 + 2t. Let p(a) = 7a - 9. What is kp(r) - 5g(r)? 6r - 2 Let b(y) = -3y3 + 5y - 5. Let t(i) = 3i3 - 6i + 6. Let h = 283 - 429. Let r = -151 - h. Give rt(d) - 6b(d). 3d3 Let m(n) = 4n + 2. Let t(c) = -7c - 4. Let a(f) = f + 37. Let o be a(-27). Suppose 5w - ow - 25 = 0. What is wm(g) - 3t(g)? g + 2 Let k(s) = -18 + 30 + 1 + 4s - 5s. Let c(g) be the second derivative of -3g*2/2 + 9g. Suppose 2n = -n - a + 8, 5n - a - 8 = 0. What is nk(o) + 9c(o)? -2o - 1 Let g(r) = -16r*3 + 12r*2 + 12r - 12. Let j(s) = -s3 + s2 + s - 1. Let y be ((-4259)/(-88) - (-120)/(-440)) + 2/(-16). Calculate yj(o) - 4g(o). 16o3 Let w(h) be the third derivative of -111h*4/8 - 12h*3 - 28h*2. Suppose 347 = -11p - 445. Let r(l) = -23l - 5. What is pr(o) + 5w(o)? -9o Let f(j) = -2j3 + 4j*2 - 4j - 2. Let z(o) = -1 + 2o2 - 36o + 2o2 - 2 - 2o*3 + 33o - o*2. Determine -3f(h) + 4z(h). -2h*3 - 6 Suppose w - 3o - 7 = 0, -6w - 496 + 475 = 3o. Suppose 3h + h = 20. Let p(q) = h + 3q + 0q + 0 - q. Let y(m) = -1. Give wp(a) - 10y(a). -4a Let k(s) = 1662s - 429. Let i(j) = -554j + 134. What is 16i(n) + 5k(n)? -554n - 1 Let y(a) = -5 + 4 - 2 - 11a. Let c(t) = 23t + 7. Let w be 2/(((-24)/30)/((-54)/(-15))). Calculate wy(l) - 4c(l). 7l - 1 Let z(t) = -80t3 + 8t*2 + 6t - 2. Let q(h) = -82h3 + 9h*2 + 7h - 2. Determine -6q(g) + 7z(g). -68g3 + 2g*2 - 2 Let g(n) = -44n - 141. Let m(v) = -15v - 45. What is 2g(f) - 7m(f)? 17f + 33 Let g(x) = -2x + 2. Let y(f) = -1. Let a(w) = -g(w) - 3y(w). Suppose 20b = 22b - 76. Let r(h) = -2 - 82h + 40h + bh. Calculate -9a(q) - 4r(q). -2q - 1 Let s(p) = 42p2 - 30p - 6. Let k(t) = 41t2 - 37t - 6. Determine 4k(w) - 5s(w). -46w2 + 2w + 6 Let k(j) = 73j2 - 11j - 8. Let l(g) = 25g2 - 4g - 3. Determine 3k(x) - 8l(x). 19x2 - x Let a(d) = d - 13. Suppose 3z + 2 = 5u, -z - 2 = 6u - 7u. Let b be (0 - 1) + -1 - 0/z. Let r be b/4 + 2 + 63/(-6). Let m(q) = -3. Give rm(p) + 2a(p). 2p + 1 Let x(a) = -3a2 - 2a - 11. Suppose -15j + 48 = 93. Let l(q) = 4q*2 + 2q + 10. Calculate jx(c) - 2l(c). c*2 + 2c + 13 Let c(n) = -3n - 4. Let p(o) = -2o - 5. Suppose -3u - 15t + 14t - 11 = 0, 0 = -5u + 5t - 5. Calculate up(j) + 4c(j). -6j - 1 Let x(y) = -679y2 + 970. Let w(p) = p2 - 2. What is 1455w(o) + 3x(o)? -582o*2 Let y(l) = -5l*3 + 5l*2. Let k(s) = 7818s*2 + 370s*3 - 7813s*2 - 376s*3. Give 4k(w) - 5y(w). w3 - 5w2 Let y(i) = i2 - 1. Let f be 98/140 - ((-65)/50 - -1). Let x(c) = 11c2 - 17c + 58 + 17c - 56. Calculate fx(d) + 2y(d). 13d*2 Let k(t) = -12t - 1. Let r(q) = 101758q + 8582. What is 17164k(p) + 2r(p)? -2452p Let n(y) be the second derivative of 1/2y3 + 0 + 0y*2 + 5/4y*4 - 1/5y*5 + 26y. Let x(a) = 6a3 - 22a*2 - 4a. Give 7n(w) + 5x(w). 2w3 - 5w*2 + w Let l(q) = 5q*3 - 9q*2 + 7q - 55. Let x(k) = -k*3 + 2k*2 - 3k. Give -l(n) - 3x(n). -2n*3 + 3n*2 + 2n + 55 Let q(z) = 20z3 - 78z*2 + 881. Let s(x) = 13x*3 - 49x*2 + 587. What is 5q(v) - 8s(v)? -4v*3 + 2v*2 - 291 Let x(w) = 143w*3 + 135w*2 + 7w + 7. Let d(s) = 21s2 + s + 1. Determine 7d(b) - x(b). -143b3 + 12b2 Let n = -42 - -36. Let b = 8 + n. Let c(a) = -a3 - 3a2 + 2a + 2. Let x(m) = 3m3 + 7m*2 - 4m - 5. Calculate bx(w) + 5c(w). w3 - w2 + 2w Let u(v) = 4v - 1. Let h(f) be the first derivative of -3/2f2 - 86 + f. What is 6h(q) + 5u(q)? 2q + 1 Let m be 2/(-8) - 6/8. Let z(n) be the first derivative of -7n2/2 + 2n - 11703. Let d(a) = a. Determine mz(r) - 3d(r). 4r - 2 Let i = -18 - -12. Let l(g) = 4g2 - 21. Let b(y) be the third derivative of -y5/60 + 5y3/6 + 36645y*2. Let c = -46 - -20. What is cb(f) + il(f)? 2f2 - 4 Let v(k) = -k - 1. Let y = 3 - 4. Let d(u) = u3 - 12u + 7. Let m be d(-4). Let x be 15/60 + -2 + m/(-12). Let p(n) = 5n + 1. Give xv(l) + yp(l). -4l Let t(o) = -5o - 2560. Let d(v) = -2v + 29. Give 2d(c) - t(c). c + 2618 Let b(v) be the first derivative of -v*2/2 - 4v + 10387. Let c(x) = -x*2 - x - 3. Give -5b(j) + 6c(j). -6j*2 - j + 2 Let h(l) = -14l*3 - 7l*2 + 5l + 1. Let g(p) = -7p3 - 4p*2 + 3p + 1. Suppose -5c = -4d - 3, -247d - 8 = -248d. Calculate cg(i) - 4h(i). 7i3 + i + 3 Let v(a) = 5a*3 - 7a - 17. Let m be (-13)/(39/(-12)) - 1. Let j(d) = -15 - 4d - 6 + 27 + md*3 - 6 - 9. Determine 7j(w) - 4v(w). w3 + 5 Let p(a) = -11a - 35. Let u(g) = -10g - 43. Determine 6p(l) - 7u(l). 4l + 91 Let p(y) be the second derivative of -y4/2 + y3/2 + 5y2/2 + y. Let w be ((-10)/12)/(53/(-159))2. Let j(m) = -m*2 + m + 1. What is wj(x) - p(x)? x*2 + 2x Let z(y) = 376y - 7. Let w(a) = 64a - 1. Determine 26w(h) - 4z(h). 160h + 2 Suppose 214 = -7w + 228. Let g(s) = s. Let f(m) = -28m. Calculate wf(n) + 14g(n). -42n Let p(f) = -47f. Let z(j) = -805j - 5. Let g(h) = 34p(h) - 2z(h). Let k(i) = 4i + 3. Give 3g(s) - 8k(s). 4s + 6 Let k(d) = 1915d - 9569. Let o be k(5). Let b(z) = -7z + 6. Let l(a) be the second derivative of -4a3/3 + 7a*2/2 - a. What is ol(m) - 7b(m)? m Let a(f) = 431140941f*2 - 53592f - 53592. Let n(i) = -40224i2 + 5i + 5. Give -5a(j) - 53592n(j). -20097j2 Let g(a) = -3a. Suppose 2i = -i - 2w - 5, -5w = -2i - 16. Let p(n) = 1. Calculate ig(m) - 3p(m). 9m - 3 Let o(j) = 5j. Let p be 2/23 + 489/(-69). Let d be 0 + 1 - (-4)/(-2)2. Let a(m) = -10m. Give da(h) + po(h). -5h Suppose 72 = 5l + 52. Let o(s) = -s - 1. Let q(v) = -6v - 9. Let w(i) = lq(i) - 20o(i). Let y(d) = -7d - 16d + 3 + 24d. Calculate 3w(t) + 16y(t). 4t Let j be (36/144)/(2/24). Let d(t) = -jt - 18 - 23 + 61 - 21. Let p(l) = -10l - 2. Give 14d(w) - 4p(w). -2w - 6 Let p(m) = 6m + 1. Let l(y) = 2255y + 99. Determine	{ "pile_set_name": "DM Mathematics" }
d) = -d*2 - 9d + 2. Let f be k(-9). Suppose -fn + 74 = -192. Is n a prime number? False Let v = -164 + 259. Is v composite? True Let n = 42 + -27. Suppose -15 + 2 = 2p - 5l, 5p - l = 25. Is p/n - (-8)/5 a prime number? True Let t = -411 - -721. Suppose -3b - b = -2f + t, 4f + b - 629 = 0. Is f a prime number? True Let r = 9 + -8. Let f be (-28)/6(r - 43). Let n = -35 + f. Is n prime? False Let m be 1/3 - (-7)/(-3). Let x be (-30)/(-5)(-5)/m. Let z = 62 - x. Is z prime? True Let x(p) = 7p*2 - 2. Is x(7) composite? True Let n(f) = -69f - 2. Let z be n(-2). Let s be -48 - -63/(-6). Let m = s + z. Is m composite? True Let n = 11 + -15. Is ((-154)/4)/(n/8) prime? False Let b = 15 - -31. Is b prime? False Suppose 3o + 5j = 240, -o - 3j + 70 = -10. Let t = 95 - 10. Suppose -t = -3r + o. Is r a composite number? True Suppose -9 = d - 0d. Let b = 16 + d. Is b a prime number? True Let m = -15 + 23. Let v = 5 - m. Let y = -1 - v. Is y a prime number? True Let k = 75 - 8. Is k a prime number? True Suppose 0 = 3n - 2h - 2041, -4n + 0h = -3h - 2723. Is n a composite number? False Suppose -173 = -4k - 45. Let u = 67 - k. Is u prime? False Suppose 1396 = 3h - 5w, 4h - 1833 = -2w + 3w. Is h a composite number? False Suppose 0 = -3v + 12, g - 2g + 3v + 1427 = 0. Is g prime? True Let c(i) = 24i + 43. Is c(11) a prime number? True Let s(j) = 57j*2 + 6j + 64. Is s(-7) a prime number? False Is 4 + (-4 - 1) + 920/1 prime? True Suppose x = 13 - 19. Is (94/x)/((-4)/36) a composite number? True Let k(f) be the third derivative of f9/30240 - f8/4032 - f7/2520 - f6/240 + f*5/30 - 2f*2. Let s(d) be the third derivative of k(d). Is s(4) prime? True Let d = 109 - 39. Suppose -3u + 10 = -0u - 5v, 5 = 5v. Suppose 0r - d = -ur. Is r composite? True Let f(b) = 8b*2 - 15b + 42. Is f(-17) prime? True Let d(l) = l*2 - 2l + 2. Is d(9) prime? False Is 2 + (0 - 1) - -481 prime? False Suppose -s + r + 11 = 0, -r - 2 = -3r. Suppose 10q - sq + 524 = 0. Is q composite? True Suppose -51 = -2a + a. Is a composite? True Suppose -6b + 542 = -112. Is b prime? True Let i = 0 - 0. Suppose ig - 3g + 153 = 0. Is g prime? False Let l(k) = -10 - 17k + 10k2 - 22k2 - 3 + k3. Is l(14) composite? True Suppose -2 - 2 = -3s - 4h, 29 = 3s - h. Is (-4)/s + (-407)/(-2) a prime number? False Let q(d) = -d2 + d + 1. Let x(m) = -6m*2 - 2m - 5. Let n(j) = -10q(j) - 2x(j). Let v be n(-5). Suppose -s + 5s - v = 0. Is s composite? True Suppose 2t = -650 + 2248. Is t a composite number? True Let q be (-659)/(-3) - 4/6. Is q/7 + (-2)/7 a composite number? False Let m(a) = a*3 - 5a*2 - 3a - 3. Let u(h) = -2h + 2. Let b be u(-2). Is m(b) a prime number? False Let d(w) = 3w*3 - 7w*2 + w + 7. Let l(x) = -4x*3 + 6x*2 - x - 7. Let o(y) = -3d(y) - 2l(y). Let j be ((-1)/2)/(3/(-36)). Is o(j) composite? True Let q(r) = 46r*2 - 4. Let g be q(-5). Suppose 4s = 2m + 2s - 576, 4m - g = -2s. Is m prime? False Suppose 3i - 2i = 26. Let k be (0 - -8)/(16/(-24)). Let h = i + k. Is h composite? True Suppose -6u + 4u - 2p = -10, 2p - 6 = -u. Let q be u2(-3)/(-6). Is (-384)/(-10) - q/10 prime? False Suppose -34s + 1270 = -32s. Is s a prime number? False Let c(a) = a2 + a. Let s(v) = v3 + 5v2 - 10v + 3. Let i(d) = 2c(d) + s(d). Is i(5) a prime number? True Let j = 3 - 1. Suppose 412 = jl + 42. Is l a composite number? True Let y(r) = 4r2 + 17r + 5. Is y(-7) prime? False Is 2 - -131(0 - -1) prime? False Let c = -856 - -1443. Is c prime? True Let t = -7 - -11. Is 13(t - 4 - -1) composite? False Suppose 0 = -2x + 2b, x + b = 3b - 4. Let y = -14 + 14. Suppose yo - k - 106 = -2o, -5o = -xk - 259. Is o prime? False Suppose -4i - 22 + 654 = 0. Is i a composite number? True Let f(n) = -5 + 2 + 11n2 + 5n - 2n. Is f(2) a composite number? False Let p(h) = -12h*3 - 6h*2 + h - 8. Is p(-5) prime? False Suppose 74w - 69w = 5755. Is w a prime number? True Suppose 6l = 7l - 5c - 2492, 3l - 7546 = c. Is l a composite number? True Let h be 168/(-5) + 2/(-5). Is (h/(-6))/((-1)/(-6)) prime? False Let f(q) = -2q + 31. Is f(0) composite? False Is -2 + 3 + -1 + 223 a prime number? True Let j = 148 - -13. Let k = j + -4. Is k composite? False Suppose -2f = -5f - 3c - 54, -54 = 3f + c. Let b = f - -31. Is b a composite number? False Suppose 0 = 3h + 2g - 2287, 4h - 3g + 2g - 3053 = 0. Is h prime? False Let r = -795 - -1226. Is r a composite number? False Let f(s) = 33s*3 + 2s*2 - s. Is f(1) a composite number? True Let v be (6/3)/(2/4). Suppose -vi = -2 + 6, 37 = 3t - i. Is 2263/t a prime number? True Suppose -4g - 5n = -0 + 2, 2g - 4n = 12. Suppose -gf = -3u - 4f + 159, 3u - 5f - 180 = 0. Is u a composite number? True Let i(n) = -253n + 56. Is i(-9) a prime number? True Let l(i) = 2 - 7i + 0i2 + i2 + 3i. Let a be l(4). Suppose -z = b - 62, -5z - b - ab = -320. Is z prime? True Suppose 0 = -w + 3i + 214, -2w - 3i + 423 = -4i. Is w a prime number? True Let o be 0 - 8/123. Is 2 + 1/(o/(-598)) a composite number? True Let h(r) = r2 - r + 127. Is h(0) a prime number? True Let n = 111 + -283. Let j = n + 339. Is j a composite number? False Let n be 1/2 + 111/6. Let i be 6/9 + n/3. Suppose 0s - 2p + i = s, 0 = 3s - p - 21. Is s composite? False Suppose -390 = -3g + 2j, -2g + 0g + 2j + 260 = 0. Let m(a) = a2 + 7a + 7. Let q be m(-5). Is ((q - 0) + g)1 a prime number? True Suppose 0 = 2c + 2s - 10, 0 = 5c - 2s - 8 - 10. Suppose 0j - 2f - 56 = -j, -3j + 152 = -2f. Suppose 0 = cn - 356 + j. Is n prime? False Let n = 229 + -151. Let x = n - 41. Is x prime? True Let q(l) = 11l - 4. Let g(d) = 17d - 6. Let v(b) = 5g(b) - 8q(b). Is v(-3) prime? True Let k(h) = 23h + 9. Let o(a) = -a + 1. Let c(y) = -k(y) + 6o(y). Is c(-4) a composite number? False Suppose 3h = -5r + 6, r = -r + 5h - 10. Suppose -3p + rk + 233 = 4k, -411 = -5p - k. Is p prime? True Let b = 7 + -7. Suppose -u = 1 - b. Is (u/1)/((-4)/508) a prime number? True Let b(o) = 67o. Is b(13) a composite number? True Let c = -146 - -363. Is c a prime number? False Suppose 5i - 1214 = 51. Is i prime? False Let s be (-24)/(-16)8/6. Suppose 4q + sb - 239 = 5b, 2q - b = 119. Is q a prime number? True Suppose 0z = 2z + 44. Let c = z - -75. Is c composite? False Let f = 0 - -8. Is (-6)/(-4) + 460/f composite? False Let b(h) be the third derivative of 1/6h3 + 0h + 0 - 3h2 + 1/4h*4. Is b(2) composite? False Suppose 0 = 5a - 16430 - 10185. Is a composite? False Let f(c) = 10c3 + c - 1. Let n be f(1). Let w = 4 - n. Is 21 + (-3)/w0 a prime number? False Let l = -4 - -4. Let t(k) = -k + 89. Is t(l) a composite number? False Let f(d) = 19d2 + 5d + 5. Let o be f(-6). Let g = o - 468. Is g prime? True Is (-7)/((-7)/124) - -3 a prime number? True Let h(q) = q*2 - 4q - 5. Let o be h(-7). Let r = 55 - 106. Let v = r + o. Is v a composite number? True Let h(s) = 40s2 - 4s - 11. Is h(-5) prime? True Is 3 + 782 + 0/2 prime? False Suppose d - 6d + 15 = -3t, 3 = -2t + d. Suppose t = 3r - 348 + 63. Is r composite? True Suppose -9k = -2328 - 6654. Is k composite? True Let h be 3/((-9)/(-6)) - -2. Suppose -3l = 4p - 35, -hp + 5l - 4 = 1. Suppose -3y + py - 238 = 0. Is y a prime number? False Let h(d) = d2 + d - 2. Let b be h(3). Let f = -5 + b. Suppose -18 - 42 = -5p + 5a, 6 = p + fa. Is p composite? False Let n = 7830 + -5559. Is n a composite number? True Suppose 151 = c + 5n, 0n - 3n + 149 = c. Is c composite? True Let y(v) = 25v*2 + 13v + 17. Is y(-7) a prime number? True Let o(n) = -n*3 + 5n2 - n + 8. Let z be o(5). Let d(r) = r3 + 3r2 + 4r + 1. Is d(z) composite? False Let x be 12/(-10) - 2/(-10). Let q = x + 3. Suppose 5c = -4f + 365, c + 102 = qc - 5f. Is c a composite number? True Suppose 4x = -3r + 413, -2r + 3r = -4x + 151. Is r a prime number? True Let m(q) = 2q*2 + 6q + 7. Let z be m(-5). Suppose a - z = -2a. Let p(l) = l3 - 9l*2 + 10l - 11. Is p(a) composite? False Suppose -2g = -1194 - 164. Is g composite? True Let q = -185 + 7. Let c = q + 305. Is c a composite number? False Let m = 8 + -7. Is 11/(m2/22) com	{ "pile_set_name": "DM Mathematics" }
k. 0 Rearrange 107q - 44q + 24 - 69q to the form l + kq and give k. -6 Rearrange 4464 - 3f2 + 2f*2 - 4464 + 59f*3 to the form wf*3 + bf*2 + zf + u and give w. 59 Rearrange (3l + 0l - 2l)(-1908 - 366 - 2280) to the form p + hl and give h. -4554 Rearrange n2 - 3n*3 - 2 + 20n + 19n3 - 15n*3 to wn*3 + un + yn2 + m and give m. -2 Express (-x - x + 3x)(2x + 4 - 4) - 23x2 - 745x*2 - 13x*2 in the form v + qx*2 + gx and give q. -779 Rearrange (888 + 59f - 888)(3f2 + 2f*2 + 2f*2) to lf*2 + nf + y + zf3 and give z. 413 Express -4 - 13546a*2 + 2 + 10636a*2 + 2 in the form pa*2 + l + fa and give p. -2910 Rearrange 19l4 + 342l + 2l3 - 2l*3 - 341l - 4l2 - 2l*3 to tl*3 + kl + nl2 + r + vl*4 and give v. 19 Express ((0g + 5g - 4g)(g + 5 - 5) + 3 + 2g*2 - 3)(-243 + 81 - 83)(-3 - 2 + 7) as sg + b + ng2 and give n. -1470 Express (13 - 17 - 27)((1 - 1 + t)(0 + 1 - 2) + 1 - 1 + 2t) in the form ft + r and give f. -31 Rearrange 5404 - 67i*2 - 42i*2 + 29i*2 - 5405 to z + pi + wi2 and give z. -1 Express 4b + 39951 - 39951 + 5b3 - 7b*2 as n + ob*3 + yb + mb2 and give y. 4 Express (-3 - 4 + 8)(28g - 1 - g2 - 28g) + 3g2 + 0g2 - g2 as fg2 + lg + h and give h. -1 Express ((2 + 1 - 1)(-1 + 5 + 3) + 5 + 1 - 2 - 4 - 5 + 3)(-3 + 3 - 2f) as rf + v and give r. -24 Express -h2 - h2 - 120h4 + 2h + 31h4 - 25h*4 as k + dh*3 + wh*4 + uh*2 + nh and give n. 2 Express -77p - 2p*2 - 11 + 3p*4 + 71p + 12 + p*2 in the form np + op4 + jp*3 + f + rp*2 and give o. 3 Express 7j - 5j + 3 - 5 + (-1 + 2 + 1)(0j - j + 2j) - 5j - 17j - 13j in the form m + cj and give m. -2 Express (34j + 45j - 28j)(3j2 - 3j2 - j2) + j*3 + 0j*3 - 3j*3 as l + nj*2 + ij*3 + wj and give i. -53 Express 1 - 1 + 57v3 - 54v*3 - 44v*2 as q + lv + gv2 + fv*3 and give f. 3 Rearrange (-811d - 79d + 76d)(3 - 3 - d) - 3d + 3d - d2 to r + yd + zd2 and give r. 0 Express (75n - 1 + 84n - 152n)(-22n + 22n + 6n*2) in the form xn*2 + rn + s + tn3 and give t. 42 Rearrange 34 + 5w*2 - 3w*3 + 40 - 112 + 39 + 2w to the form z + tw + sw*2 + fw*3 and give z. 1 Rearrange (3 - 6 + 4)(83 - 42m - 83) + 2 - 2 + 4m + 2m - 2m + 2m - m + 0m - m + (-2m - m + m)(-4 + 1 + 5) - 1 + 1 - 2m to the form j + wm and give w. -44 Rearrange (-2 + 1 + 3)(51d4 - 326 + 326) + 1 - 1 - d4 to q + rd2 + jd*3 + ad*4 + yd and give a. 101 Rearrange (36 + 8 - 1)(6j*2 + 7j*2 + 5j*2) to rj + hj2 + d and give h. 774 Express -2y*2 + 2y*3 + 45 - 13 - 8y2 + y2 - 7 as m + xy + by*2 + ay*3 and give b. -9 Rearrange -354 + 712 - 348 + 3z*2 to the form az + uz2 + i and give i. 10 Express 3108 + 109p*2 - 3108 as sp*2 + cp + g and give s. 109 Rearrange (2x + 6x - 10x)(-44x + 103 - 103) to the form w + vx + fx2 and give f. 88 Rearrange (-62w - 70w + 139w)(4w + 0w - 3w)(w - 12w + 0w) to the form bw*3 + fw + aw2 + s and give s. 0 Express -302z - 160z + 2z - 31z in the form mz + q and give m. -491 Express -39r2 + 1 + r3 - 3r + 24r2 + 18r*2 as lr + q + or2 + kr*3 and give o. 3 Rearrange 313 - 39 + 21c + 13c - 37c to the form vc + b and give b. 274 Express -82o*2 - 72o*2 + 21o*2 - 38o*2 as so*2 + b + mo and give s. -171 Express 10188 + 483a - 10188 in the form ja + i and give j. 483 Express -531p - 679p - 200p - 488p + 407p in the form w + mp and give m. -1491 Express (-18k - 1 + 12k - 4k)(0k3 + k3 - 4k*3) in the form b + lk*4 + tk + ak2 + mk*3 and give l. 30 Express -3m*3 - 2m*4 + 3m - m*2 + 1 + 0 + 0m*3 in the form am*3 + pm + w + xm4 + im*2 and give i. -1 Rearrange (2 + 3 - 7 + 3i)(i + 3i*3 - 11i*3 - 25i3) - i4 + i3 - i3 to the form yi3 + ai + ci4 + wi*2 + q and give c. -100 Express -12m - 20m - 20m + (1 - 2 + 0)(1 + 3 + 2)(5m - 3m - 4m) as b + vm and give v. -40 Rearrange (-o - o + 4o)(330 - 480 - 1257) to p + lo and give l. -2814 Rearrange (7 - 7 - 2o)(-4 - 4 + 5)(-1 + 2 + 1) + 2o + 0o + 39o to the form u + ro and give r. 53 Rearrange (638x - 6 - 647x + 0)(2 + 2 - 6) + (-x + 0x + 0x)(2 + 15 - 6) - 2 + 2 + 2x to the form hx + z and give z. 12 Express -491j2 + 492j*2 - 51 - 16 as vj*2 + o + qj and give o. -67 Rearrange -37 + 75 - 89c - 38 - c3 to lc*2 + sc + x + tc3 and give s. -89 Rearrange -3k*4 - 11k*3 + 5k*4 + 158 - 2k*4 - 3k*4 + 2k - 156 - 2k2 to the form mk*3 + tk*2 + uk + n + lk4 and give n. 2 Rearrange 58 + 5t - 6t + 1 + 44 + 5t to the form ft + x and give f. 4 Express 15w - 11w - 6w4 - w2 + w*4 + 0 - 4w*3 - 1 - 6w as sw2 + t + rw*4 + uw*3 + yw and give t. -1 Express (-3g - 4 - 2 + 8)(42 + 7g3 - 42) as kg*4 + og*3 + y + wg*2 + tg and give y. 0 Express x*2 - 12x*4 + 2x*3 + 0x*2 + 5x*3 + 5x + 14x4 + 1 - 4x as n + fx3 + ix*2 + mx*4 + hx and give i. 1 Express 15r - 28r + 0 + 0 - 3 in the form yr + w and give w. -3 Express (337 + c + c - 94)(2c2 - 5c2 + c2) + 3c - 3c - 2c3 in the form ic*3 + s + nc*2 + uc and give n. -486 Rearrange 85n2 - n3 + 84n*2 + 2 - 170n*2 to the form sn*2 + wn*3 + j + tn and give s. -1 Express (28 - 29 + 24)(-98 - 7q*4 + 98) in the form kq*4 + pq*3 + hq*2 + r + fq and give k. -161 Express (r + 0r - 2r)(-4 + 4 - 2)(-3 - 1 - 5 + (4 - 1 - 1)(1 - 3 + 0) + 3 + 1 - 2) as x + hr and give h. -22 Rearrange -2r2 - 45 + 45 + (-r - 1 + 4r - r)(2r - r + r) + (11r - 17r*2 - 11r)(0 - 4 + 5) to pr*2 + or + g and give p. -15 Rearrange 2x + 31x*3 - 8x + 24x3 - 54x*3 + 10x*2 to ax + k + fx2 + dx3 and give d. 1 Rearrange (l2 + 0l2 - 8l*2)(-369l + 2 - 8 + 6) to the form p + cl*2 + al + vl3 and give v. 2583 Express -41o*2 - 19o*2 - 269o*2 in the form yo + po2 + d and give p. -329 Rearrange 2n + 32 + 4n2 - 10n*2 + 47 - 76 to the form vn*2 + m + on and give m. 3 Rearrange -150v3 - 157v*3 + 2v*2 - 4v*4 - 163v*3 + 458v*3 to o + lv*2 + pv*4 + jv*3 + gv and give j. -12 Rearrange (-398v3 + 164v*3 + 136v*3)(0 + 1 - 2)(1 - 1 - 2v) to bv3 + nv + x + qv4 + lv*2 and give n. 0 Rearrange -33f - 4f2 + 17f*2 - 9f*2 - 11f to the form kf2 + l + tf and give k. 4 Rearrange 24c3 + 0c*4 + 2c*2 - 4c*4 + 11c*4 - 26c*3 to the form yc*2 + hc*3 + wc*4 + g + ic and give w. 7 Express 19a + 22a + 125a + 50a as w + ra and give r. 216 Express -13889c*3 + 29c + 0 + 1 + 13891c3 in the form lc + tc2 + g + wc*3 and give t. 0 Rearrange 1 + 5 + 402a + 3 + 9 - 17 to oa + b and give b. 1 Express -75z*3 + 97 + 74z*3 - z + 0z as qz2 + x + iz + sz3 and give x. 97 Express (0g*2 - 4g*2 + 3g*2)(2 + 3 - 6) + (-6 + 3 - 2)(g - g + 2g*2)(0 - 8 - 12) as m + zg + ug*2 and give u. 201 Rearrange -174u + 112u + 638u to the form ju + z and give j. 576 Rearrange x2 - 97x*3 - 2x*4 - 144 - 2x + 95x3 + 147 to the form nx*3 + qx*4 + ox + px2 + r and give o. -2 Rearrange -73j*4 + 205j*4 - 398j - 134j4 + (2j*3 + 2j*2 - 2j*2)(-7j + 2j + 3j) to kj*2 + hj + rj3 + sj*4 + w and give h. -398 Rearrange -34l*3 - 51l*3 - 1 + 16l*3 - 22l*3 to gl*2 + wl + ql3 + x and give x. -1 Rearrange 99u*3 + 16u*2 - 91u*3 + 2 - 24u + 22u to the form xu*3 + ou*2 + gu + c and give x. 8 Rearrange (-2 + 2 - 1)(-t - 2t + t) + (0t - 2t + 0t)(-2 + 1 + 2) + 15 - 7t - 15 to at + h and give a. -7 Rearrange -780y + 1565y + 191 - 783y to the form a + dy and give d. 2 Rearrange (11d - 2d - 3d)(-1 - 4 + 0) - d - 6d + 0d to b + rd and give r. -37 Express 10863 - 96f - 10863 in the form z + vf and give v. -96 Express 223t*3 + 0 + 2t*2 + 1 - 116t*3 + t - 110t*3 as vt*2 + pt*3 + at + r and give r. 1 Rearrange 5 - v*4 - 5 + (107v - 107v - 13v*4)(9 + 51 + 1) to fv + pv*3 + g + qv*2 + xv*4 and give x. -794 Rearrange 97 - 97 + 729a - 164a to the form ga + i and	{ "pile_set_name": "DM Mathematics" }
ppgup? 1/280 Calculate prob of sequence vm when two letters picked without replacement from {m: 1, v: 2, k: 2, n: 4, o: 3, h: 2}. 1/91 What is prob of sequence qwq when three letters picked without replacement from {b: 3, g: 1, q: 2, w: 1}? 1/105 Calculate prob of sequence ssd when three letters picked without replacement from {d: 2, s: 9}. 8/55 Three letters picked without replacement from morrszsc. Give prob of sequence mss. 1/168 Three letters picked without replacement from rwjwjjjwjv. Give prob of sequence vrv. 0 Three letters picked without replacement from {o: 1, f: 8, n: 1, b: 8, u: 2}. Give prob of sequence ufo. 2/855 What is prob of sequence mu when two letters picked without replacement from {i: 8, m: 2, u: 2}? 1/33 Two letters picked without replacement from {k: 2, a: 1, b: 1, t: 1}. What is prob of sequence bt? 1/20 Four letters picked without replacement from {o: 6, b: 2}. What is prob of sequence oooo? 3/14 Calculate prob of sequence zxr when three letters picked without replacement from {x: 2, r: 7, z: 11}. 77/3420 Two letters picked without replacement from {k: 5, x: 2, n: 8}. Give prob of sequence nk. 4/21 Calculate prob of sequence lx when two letters picked without replacement from {x: 1, l: 2, y: 1, f: 5}. 1/36 What is prob of sequence joj when three letters picked without replacement from {r: 1, t: 5, o: 1, j: 12}? 22/969 Three letters picked without replacement from ydygdyrdlvr. Give prob of sequence ydv. 1/110 Three letters picked without replacement from {t: 5, z: 4, h: 3, u: 4}. What is prob of sequence zzu? 1/70 Calculate prob of sequence zzy when three letters picked without replacement from llyllwzzlylll. 1/429 What is prob of sequence mfgm when four letters picked without replacement from {f: 3, g: 1, m: 3}? 3/140 What is prob of sequence ua when two letters picked without replacement from {u: 2, a: 11}? 11/78 Two letters picked without replacement from rggggrdrrrdr. What is prob of sequence rr? 5/22 Three letters picked without replacement from {v: 2, y: 6, q: 1, t: 4, j: 2}. What is prob of sequence jyv? 4/455 Two letters picked without replacement from vsxkv. Give prob of sequence vk. 1/10 What is prob of sequence ifpi when four letters picked without replacement from {w: 4, p: 1, i: 12, f: 3}? 11/3230 Three letters picked without replacement from mtaxmavs. Give prob of sequence vax. 1/168 Three letters picked without replacement from qqxuquqeeqeeq. Give prob of sequence uqq. 5/143 Three letters picked without replacement from {b: 1, o: 2, w: 1, j: 2, l: 2}. Give prob of sequence jjw. 1/168 What is prob of sequence vaaa when four letters picked without replacement from {a: 4, p: 2, v: 8}? 8/1001 Two letters picked without replacement from {o: 5, s: 1, n: 6, c: 4}. What is prob of sequence oo? 1/12 Calculate prob of sequence fsf when three letters picked without replacement from {f: 3, s: 7}. 7/120 Calculate prob of sequence xxt when three letters picked without replacement from xtxxt. 1/5 Four letters picked without replacement from {r: 1, k: 2, m: 1, b: 1, c: 2}. Give prob of sequence mbcc. 1/420 Calculate prob of sequence eye when three letters picked without replacement from neneyeneenn. 2/99 Three letters picked without replacement from ooodxoooo. What is prob of sequence oxd? 1/72 Calculate prob of sequence ccdf when four letters picked without replacement from {w: 3, f: 2, v: 1, x: 2, c: 1, d: 3}. 0 Four letters picked without replacement from wrgggpwpppg. Give prob of sequence pgpg. 1/55 Four letters picked without replacement from {t: 5}. Give prob of sequence tttt. 1 Calculate prob of sequence rw when two letters picked without replacement from {w: 1, e: 7, s: 5, r: 5}. 5/306 What is prob of sequence qje when three letters picked without replacement from {q: 1, j: 1, e: 1}? 1/6 What is prob of sequence saaa when four letters picked without replacement from dadsdsaasda? 1/110 What is prob of sequence kkk when three letters picked without replacement from kkjjrkykkkrkk? 28/143 Four letters picked without replacement from vveovvee. Give prob of sequence evvo. 3/140 What is prob of sequence zfz when three letters picked without replacement from fzffkfzffzzzffffff? 5/102 Three letters picked without replacement from {b: 2, f: 5}. What is prob of sequence ffb? 4/21 Three letters picked without replacement from {s: 2, g: 1, c: 1, k: 2, f: 2, v: 1}. Give prob of sequence sfg. 1/126 Three letters picked without replacement from {g: 1, l: 1, z: 2, e: 1, o: 1, t: 1}. What is prob of sequence elo? 1/210 Two letters picked without replacement from cddedddcded. What is prob of sequence dd? 21/55 Four letters picked without replacement from {t: 1, n: 1, c: 1, g: 1, f: 2, d: 1}. What is prob of sequence fftd? 1/420 Four letters picked without replacement from {t: 9, r: 2}. Give prob of sequence trtt. 7/55 Calculate prob of sequence pg when two letters picked without replacement from pghgpgggphgggggggg. 13/102 Calculate prob of sequence jx when two letters picked without replacement from {f: 9, d: 4, i: 1, j: 2, x: 1}. 1/136 Calculate prob of sequence xx when two letters picked without replacement from {k: 1, m: 1, x: 4, z: 1, w: 1}. 3/14 What is prob of sequence bebk when four letters picked without replacement from {k: 2, b: 2, e: 1, i: 1}? 1/90 What is prob of sequence oyo when three letters picked without replacement from {y: 5, o: 2}? 1/21 Four letters picked without replacement from {k: 3, x: 2, c: 11, f: 3}. Give prob of sequence kcxx. 11/15504 What is prob of sequence sjsj when four letters picked without replacement from jjjjjsjsjjjsjjjjsjjj? 8/323 Calculate prob of sequence pm when two letters picked without replacement from mmmpmmpmpmmmmmm. 6/35 Calculate prob of sequence bhh when three letters picked without replacement from rhbhhwih. 1/28 Two letters picked without replacement from {x: 1, s: 1, o: 1, j: 1, n: 2, e: 2}. What is prob of sequence xs? 1/56 What is prob of sequence ggg when three letters picked without replacement from {l: 4, g: 6}? 1/6 Two letters picked without replacement from ppjxppxxxxp. Give prob of sequence pp. 2/11 Calculate prob of sequence ttn when three letters picked without replacement from ottoonoootonot. 1/91 What is prob of sequence thn when three letters picked without replacement from htnywhoyywywwhynyy? 1/816 What is prob of sequence rdrd when four letters picked without replacement from {r: 6, d: 2}? 1/28 Calculate prob of sequence hj when two letters picked without replacement from {j: 7, h: 5, x: 1, n: 3}. 7/48 Four letters picked without replacement from vyyvgr. Give prob of sequence rrvv. 0 Calculate prob of sequence udnw when four letters picked without replacement from dadnnwdnndauddaaadad. 4/14535 Three letters picked without replacement from ffqb. What is prob of sequence bqf? 1/12 Calculate prob of sequence zw when two letters picked without replacement from {z: 1, w: 2}. 1/3 What is prob of sequence ggx when three letters picked without replacement from {m: 9, g: 2, x: 5, c: 3}? 5/2907 Calculate prob of sequence wwh when three letters picked without replacement from wwhw. 1/4 Three letters picked without replacement from {v: 2, x: 1, n: 1, q: 1, w: 1, b: 1}. Give prob of sequence bwx. 1/210 Four letters picked without replacement from dddsddsddsdddddddd. Give prob of sequence sdss. 1/816 Four letters picked without replacement from {y: 5, w: 7}. What is prob of sequence yyyw? 7/198 Two letters picked without replacement from {x: 3, p: 2, f: 1, i: 1, s: 1, d: 3}. What is prob of sequence xi? 3/110 Calculate prob of sequence ll when two letters picked without replacement from dlalddadd. 1/36 Calculate prob of sequence spps when four letters picked without replacement from {s: 2, p: 2}. 1/6 Calculate prob of sequence ddtv when four letters picked without replacement from {v: 2, d: 4, l: 2, t: 1}. 1/126 Two letters picked without replacement from ctkfqifck. What is prob of sequence cq? 1/36 Three letters picked without replacement from {i: 2, q: 2, u: 3, w: 3, r: 4, m: 2}. What is prob of sequence qum? 1/280 Two letters picked without replacement from {t: 1, r: 1, u: 6, b: 2, h: 2, c: 3}. Give prob of sequence hr. 1/105 Two letters picked without replacement from	{ "pile_set_name": "DM Mathematics" }
ed by 3? 0 What is the remainder when 65 is divided by 29? 7 What is the remainder when 1248 is divided by 66? 60 What is the remainder when 778 is divided by 29? 24 What is the remainder when 735 is divided by 18? 15 What is the remainder when 341 is divided by 51? 35 Calculate the remainder when 395 is divided by 39. 5 Calculate the remainder when 101 is divided by 34. 33 What is the remainder when 8812 is divided by 20? 12 What is the remainder when 10708 is divided by 188? 180 Calculate the remainder when 1975 is divided by 653. 16 What is the remainder when 167 is divided by 13? 11 What is the remainder when 126 is divided by 16? 14 Calculate the remainder when 140 is divided by 13. 10 Calculate the remainder when 106 is divided by 18. 16 What is the remainder when 210 is divided by 58? 36 What is the remainder when 606 is divided by 21? 18 What is the remainder when 131 is divided by 27? 23 Calculate the remainder when 161 is divided by 9. 8 What is the remainder when 111 is divided by 57? 54 What is the remainder when 60 is divided by 13? 8 Calculate the remainder when 1150 is divided by 357. 79 What is the remainder when 1415 is divided by 131? 105 Calculate the remainder when 221 is divided by 48. 29 What is the remainder when 311 is divided by 7? 3 What is the remainder when 31 is divided by 3? 1 Calculate the remainder when 26 is divided by 3. 2 Calculate the remainder when 336 is divided by 134. 68 What is the remainder when 374 is divided by 42? 38 Calculate the remainder when 1691 is divided by 113. 109 Calculate the remainder when 117 is divided by 8. 5 What is the remainder when 6399 is divided by 33? 30 Calculate the remainder when 438 is divided by 10. 8 Calculate the remainder when 161 is divided by 34. 25 Calculate the remainder when 11550 is divided by 304. 302 What is the remainder when 1576 is divided by 66? 58 What is the remainder when 495 is divided by 25? 20 What is the remainder when 927 is divided by 93? 90 What is the remainder when 723 is divided by 106? 87 Calculate the remainder when 298 is divided by 47. 16 What is the remainder when 1531 is divided by 507? 10 Calculate the remainder when 59 is divided by 12. 11 What is the remainder when 387 is divided by 97? 96 Calculate the remainder when 844 is divided by 26. 12 Calculate the remainder when 412 is divided by 32. 28 Calculate the remainder when 336 is divided by 85. 81 What is the remainder when 3163 is divided by 30? 13 Calculate the remainder when 1748 is divided by 122. 40 Calculate the remainder when 15 is divided by 3. 0 Calculate the remainder when 376 is divided by 58. 28 What is the remainder when 99 is divided by 18? 9 Calculate the remainder when 126 is divided by 64. 62 What is the remainder when 1148 is divided by 23? 21 Calculate the remainder when 2205 is divided by 23. 20 Calculate the remainder when 588 is divided by 121. 104 Calculate the remainder when 315 is divided by 36. 27 Calculate the remainder when 123 is divided by 44. 35 Calculate the remainder when 218 is divided by 22. 20 Calculate the remainder when 222 is divided by 45. 42 What is the remainder when 3125 is divided by 136? 133 What is the remainder when 165 is divided by 21? 18 Calculate the remainder when 2178 is divided by 422. 68 What is the remainder when 693 is divided by 25? 18 Calculate the remainder when 414 is divided by 13. 11 What is the remainder when 90 is divided by 20? 10 What is the remainder when 2247 is divided by 30? 27 Calculate the remainder when 273 is divided by 12. 9 What is the remainder when 256 is divided by 38? 28 Calculate the remainder when 2499 is divided by 125. 124 Calculate the remainder when 154 is divided by 85. 69 Calculate the remainder when 973 is divided by 39. 37 Calculate the remainder when 69 is divided by 27. 15 Calculate the remainder when 2740 is divided by 48. 4 Calculate the remainder when 86 is divided by 15. 11 What is the remainder when 29 is divided by 18? 11 What is the remainder when 453 is divided by 51? 45 Calculate the remainder when 11661 is divided by 17. 16 Calculate the remainder when 58 is divided by 29. 0 Calculate the remainder when 1217 is divided by 20. 17 Calculate the remainder when 6497 is divided by 10. 7 What is the remainder when 1332 is divided by 661? 10 Calculate the remainder when 293 is divided by 97. 2 Calculate the remainder when 10084 is divided by 194. 190 What is the remainder when 481 is divided by 122? 115 Calculate the remainder when 43 is divided by 23. 20 What is the remainder when 2060 is divided by 9? 8 What is the remainder when 434 is divided by 154? 126 What is the remainder when 514 is divided by 89? 69 Calculate the remainder when 340 is divided by 113. 1 Calculate the remainder when 453 is divided by 60. 33 Calculate the remainder when 72 is divided by 45. 27 Calculate the remainder when 889 is divided by 228. 205 Calculate the remainder when 1509 is divided by 12. 9 What is the remainder when 299 is divided by 120? 59 Calculate the remainder when 676 is divided by 114. 106 Calculate the remainder when 885 is divided by 125. 10 Calculate the remainder when 205 is divided by 26. 23 What is the remainder when 130 is divided by 27? 22 What is the remainder when 225 is divided by 6? 3 What is the remainder when 148 is divided by 34? 12 Calculate the remainder when 83 is divided by 29. 25 Calculate the remainder when 577 is divided by 9. 1 Calculate the remainder when 871 is divided by 40. 31 What is the remainder when 61 is divided by 15? 1 Calculate the remainder when 646 is divided by 10. 6 What is the remainder when 290 is divided by 77? 59 Calculate the remainder when 1198 is divided by 109. 108 What is the remainder when 21364 is divided by 23? 20 Calculate the remainder when 3126 is divided by 33. 24 Calculate the remainder when 176 is divided by 81. 14 What is the remainder when 4289 is divided by 30? 29 Calculate the remainder when 388 is divided by 49. 45 What is the remainder when 264 is divided by 213? 51 What is the remainder when 1015 is divided by 8? 7 Calculate the remainder when 441 is divided by 234. 207 Calculate the remainder when 1411 is divided by 206. 175 What is the remainder when 221 is divided by 65? 26 What is the remainder when 368 is divided by 41? 40 Calculate the remainder when 186 is divided by 3. 0 Calculate the remainder when 1149 is divided by 117. 96 Calculate the remainder when 1238 is divided by 59. 58 What is the remainder when 6273 is divided by 7? 1 What is the remainder when 2115 is divided by 36? 27 What is the remainder when 115 is divided by 47? 21 What is the remainder when 106 is divided by 18? 16 What is the remainder when 162 is divided by 19? 10 What is the remainder when 611 is divided by 18? 17 What is the remainder when 2038 is divided by 107? 5 Calculate the remainder when 259 is divided by 68. 55 What is the remainder when 6294 is divided by 3142? 10 What is the remainder when 87 is divided by 30? 27 What is the remainder when 118 is divided by 20? 18 What is the remainder when 516 is divided by 152? 60 What is the remainder when 438 is divided by 5? 3 Calculate the remainder when 38 is divided by 13. 12 What is the remainder when 156 is divided by 42? 30 Calculate the remainder when 240 is divided by 28. 16 Calculate the remainder when 196 is divided by 6. 4 What is the remainder when 299 is divided by 41? 12 Calculate the remainder when 341 is divided by 27. 17 What is the remainder when 4792 is divided by 109? 105 Calculate the remainder when 95 is divided by 35. 25 Calculate the remainder when 346 is divided by 25. 21 What is the remainder when 84 is divided by 30? 24 What is the remainder when 92 is divided by 16? 12 Calculate the remainder when 2534 is divided by 65. 64 What is the remainder when 333 is divided by 81? 9 What is the remainder when 1444 is divided by 78? 40 Calculate the remainder when 2629 is divided by 94. 91 Calculate the remainder when 61 is divided by 34. 27 What is the remainder when 375 is divided by 47? 46 What is the remainder when 560 is divided by 141? 137 Calculate the remainder when 131 is divided by 45. 41 Calculate the remainder when 244 is divided by 134. 110 What is the remainder when 497 is	{ "pile_set_name": "DM Mathematics" }
as bp + u + vp*2 + zp*3 and give v. 2 Express -105j*4 + 14j*4 + 2j + 3j2 + j3 + 95j*4 as oj*3 + yj + gj2 + lj*4 + a and give o. 1 Express (63570 + 3222o*2 - 63570)(0o2 + 0o2 + o2) in the form ho + io*2 + vo*3 + jo*4 + q and give q. 0 Express (2 - 2 - 6)(2t - 2t + 2t) - 75t + 279t + 198t as nt + v and give n. 390 Rearrange (o2 - o2 + o2)(7835 + 66353 + 44242 - 24998 + 33928 + 28929) to the form ao2 + g + jo and give a. 156289 Express 4 - 2148o4 - o3 + 5o + 4268o4 - 2119o*4 + 4o*2 + 0o*3 as uo*4 + s + fo + co2 + po*3 and give c. 4 Express 28x*3 + 25x*3 - 51x*3 + 36x - 34x2 + 45x*2 in the form dx*2 + j + tx*3 + ox and give t. 2 Rearrange (11b + b - 3b)(214 - 123 + 307)(2 - 2 - 2b) to ib*2 + vb + f and give i. -7164 Express (0 + 1 + 4)(0 - 5 + 3)((-2j - 2j + 2j)(1 - 1 + 2j) + 7518 - 7518 + 2448j*2) as u + ij*2 + kj and give i. -24440 Rearrange 3p - 8p + 5p + 3611 + 10p - 8p to fp + w and give f. 2 Express (-77h - 29h*2 + 77h)(-6h - 191h - 107h) as uh3 + vh + ch2 + j and give u. 8816 Rearrange (1 + 6 + 11)(-8f2 + 3f*2 - 2f*2) - 3f*2 + 3f - 3 + 4 - f to z + if + rf*2 and give z. 1 Express 103 + 1323r*2 - 121 + 19 in the form ur*2 + kr + g and give u. 1323 Rearrange 2 - 7m3 - 3744881m*4 + 3744864m4 - m3 + 0m3 - 2m*2 - 2m to the form km + tm*2 + lm*4 + sm*3 + a and give a. 2 Rearrange (-10g - 2g + 6g - 3g - 5 + 5 + (3g - g - 3g)(4 - 5 + 3) - 4g + 4g - g)(-1 + 0 - 1 - 3g) to the form og + ag*2 + w and give o. 24 Express (-17u - 319 + 319)(-u + u - 2u) + (-1 + 2u + 1)(-30u + 883 - 883) as fu*2 + a + qu and give f. -26 Rearrange -239 + 48q3 - 45q*3 + 41 - 2q*2 to dq*2 + gq + bq3 + w and give b. 3 Rearrange -15 - 664g + 16 + 155g to the form ug + l and give u. -509 Rearrange (185 + 129 - 6 + (0 - 2 + 0)(2 - 2 + 1) - 4 + 0 + 2 + (5 - 4 + 2)(-2 + 2 + 1))(-4p + 2p + 3p) to the form ip + q and give i. 307 Rearrange (-220 + 179 - 78z + 76z)(3 + z - 5 + z - 2z2) to jz*3 + uz*2 + nz + h and give h. 82 Express 5f2 - 433 - 4653 - 4f*2 - 447 in the form n + qf*2 + of and give q. 1 Express -5153 + 893980r2 - r3 - 893980r*2 as ur + dr2 + jr*3 + l and give l. -5153 Express 3 - 7 - 6c*4 + 4c + 6 - 23c4 - 2c3 + 6 - c2 in the form n + rc3 + dc*4 + pc*2 + tc and give n. 8 Express 49o - 236o + 10o + 0 + 0 + o + (-3 + 2 + 0)(2o + o - 5o) + (141 - 242 + 150)(0o + 0o - 2o) as d + mo and give m. -272 Rearrange -16f - 77f - 537791f*2 + 537874f*2 to the form xf + n + wf2 and give n. 0 Express 216q + 438q - 208q in the form oq + f and give o. 446 Rearrange (3 + 7 - 4)(-361s - 393s + 207s) to xs + m and give x. -3282 Express -3 - 13j3 + 582997j*2 - 2j - 582995j2 + 6 - 161j as cj2 + pj + lj3 + q and give p. -163 Rearrange 2 - 2 + 3l + 7l - 5l - 8l + 3l - 3l - 7l + (0l - 2l - l)(0 + 0 + 1) to the form ul + h and give u. -13 Express 254 - 22 - 3v2 - 13v + 0v2 - 212 in the form lv*2 + i + mv and give i. 20 Express (-3604 + 153 + 705 - 4807)(8r*2 - 1 + 1) as ur + v + jr2 and give j. -60424 Rearrange (7 - 6 - 2)(2 - 2 - 4)(-11w + 55w - 31w)(1 + 2 - 5)(5 - 4 - 2) to the form hw + n and give h. 104 Rearrange 2s*2 + 1325 + 1162 + 2s - 2663 to the form q + us2 + ws and give u. 2 Rearrange 205f2 + 9 + 5f*2 - 7 + 82f*2 + 83f*2 to the form qf*2 + y + pf and give y. 2 Express 28417g2 - 28417g*2 - 4g*3 - 25 - 5g + 2g4 as n + wg*4 + yg*3 + vg*2 + hg and give h. -5 Rearrange (-3 - 3 + 4)(1 + y2 - 1) + y + 713y*2 - 2 + 199y*2 + 2y*2 to dy + p + ty2 and give d. 1 Rearrange (0s*2 + 4s*2 - 3s*2)(919s - 3 - 454s - 432s) + (-s + 0 + 0)(s*2 + 2s*2 - 4s*2) to gs + ps2 + ws*3 + z and give w. 34 Express (12 - 7a - 12)(19 + 943 + 44) as y + qa and give q. -7042 Express -47r3 + 6r*4 - 110r*2 + 1 - 7r*4 + 108r*2 in the form kr*3 + sr*2 + mr*4 + lr + p and give p. 1 Express (0z2 + 5z2 - z2)(111 + 76 + 128 - 36) in the form hz*2 + tz + x and give h. 1116 Rearrange (6 - 6m - 2 - 2)(7317 - 2765 + 2126 + 5437) to k + lm and give l. -72690 Express (61q*2 - 1735q + 1735q)(-16 + 21 + 2q + 3q) as jq3 + wq*2 + a + yq and give w. 305 Express 13m - 2m*2 - 2m - 34m3 - 729 + 732 as nm*3 + xm*2 + f + sm and give x. -2 Express ((2 - 3 + 0)(-2s + s + 2s) + 2 + s - 2 + (0s - s - 4s)(-36 + 11 + 151))(s3 - 2s*3 - 2s*3) as k + rs + ys3 + fs*2 + ls*4 and give l. 1890 Express -8165v*3 + 8165v*3 + 2v*4 + 3 + 125v + v*2 in the form sv*3 + hv + ov2 + dv*4 + i and give i. 3 Rearrange -689j*2 + 597j - 597j + (2j + 2j - 5j)(2j - 5j + 5j) to the form dj + b + lj*2 and give l. -691 Express (6a + 2a + 3a)(-4582 + 2293 - 5a + 2287 + 3a - 2567a*2) as wa + c + la3 + ka*2 and give k. -22 Rearrange (-2g - g + 6g)(4g2 - 75 + 3017111g*3 - 3017112g*3 - 6g - 20) to yg + wg*4 + hg*2 + ng*3 + x and give w. -3 Rearrange 462t*2 - 553t*2 - 214t*2 + 4 - 5 to bt*2 + y + kt and give b. -305 Rearrange 528 - 537 + f*2 + 631 - f to the form gf + z + df2 and give z. 622 Express (-2u + 0 + 0)(-459 - 18u + 459) - u*2 + 4u2 - u2 + (-2u2 - 3u2 + u2)(0 - 21 + 6) as ju*2 + pu + k and give j. 98 Express 115379 + 929m2 - 115379 + (-4m + 2m + m)(1 + 2m - 1) in the form bm + lm2 + y and give l. 927 Express (-23t - 70t - 193t)(3t - 2t - 3t)(3 - 3 - 2t) as c + ot2 + wt + pt3 and give p. -1144 Rearrange (g3 + g3 + 0g - 3g)(-487 - 428 + 12g - 11g) to qg2 + dg*4 + rg + xg3 + w and give q. -3 Express 279g*2 - 7g - 285g2 + 8g - g*3 + 63 - g in the form sg + p + cg3 + zg*2 and give p. 63 Rearrange (5 - 1 - 1)(-4 + 1 + 4)(0 + 0 - 6)((-25b - 264b - 64b)(2 + 2 - 6) + 4 - 4 - 3b) to the form u + tb and give t. -12654 Express -751q - 376q - 759q + 529q - 240q as zq + y and give z. -1597 Rearrange 5c - 2c*2 - 5c + (11c - 1295 + 626 + 622)(-2c + 1 - 1) to the form v + pc + dc2 and give p. 94 Rearrange (1 - 1 - 2n*2)(-1661n2 + 3441n*2 - 1679n*2) + 2n2 - n2 - 2n4 - 5n*2 to the form rn + on3 + qn*4 + u + yn*2 and give u. 0 Express -53l*2 + 2l - 10l3 + 174l*2 + 8l*4 - 61l*2 - 65l*2 in the form pl + bl2 + u + vl*3 + kl*4 and give k. 8 Rearrange (-5 - 2i + 5 + (1 + 0 + 0)(5i + 3i - 4i) + (4 + 1 - 2)(i - 3i - 3i))(1 - 4 - 4) + 4i + 5i - 2i to the form fi + b and give f. 98 Rearrange (-3 + 5 - 1)(-o - 3288 + 153o*2 + 9799o*3 - 9802o*3 + 3286) to p + ro*2 + bo*3 + do and give p. -2 Rearrange (3j - j - 3j)((-117 + 223 + 49)(-3 + 5 - 1) + (13 + 10 - 10)(-3 + 6 - 2)) to bj + f and give b. -168 Rearrange -13v + 1185v + 1447v - 534v + 792v to zv + m and give z. 2877 Express 180011 + 3o - 2o - 180005 - 4o2 - 12o*2 as a + do*2 + uo and give d. -16 Rearrange 2 + 1877x2 + 2x + 106x3 - 109x*3 - 2448x*2 to the form vx + ax2 + y + dx*3 and give d. -3 Rearrange 3y - 187y3 + 370y*2 - 334y*2 + 185y*3 - 2 to ly*3 + uy*2 + d + by and give u. 36 Express -484312c2 + 5c*3 + 3c + 0c4 + 15 + 2c*4 + 484312c*2 as zc + lc4 + fc*2 + q + nc*3 and give l. 2 Express 24 - 39 + 278 + 31t*2 + 167 - 33t*2 as m + st*2 + wt and give s. -2 Rearrange (-2j - 2j - 1 + 6j)(-4 + 2 + 0)(-65j - 57j + 120j - 34) to the form c + tj2 + dj and give d. 132 Rearrange 17f - 7 - 35f*3 - 6f - 13f to the form xf + cf3 + sf*2 + i and give c. -35 Rearrange (6 - 1 - 3)(501 + 5256 - 60)(-x2 + 2x*2 + 0x*2) to gx*2 + y + jx and give g. 11394 Rearrange 3 + 42w2 - 1 - 43w*2 + (-7 + 5 - 3)(3w2 - 4w + 4w) to v + mw*2 + aw and give m. -16 Rearrange (-v - 4v + 4v)(0 + 4 - 5) + (-2 + 2 - 2v)(2 + 0 + 5)(0 - 4 + 5) + 16v - 84v - 49v to i + ov and give o. -130 Rearrange (125 - 125 - 5i)(-12579 - 2i3 + 12645 + 4i*3) to the form si + ui2 + bi**3 + y	{ "pile_set_name": "DM Mathematics" }
b: 2, j: 2}. What is prob of picking 1 b, 1 j, and 2 a? 8/165 Three letters picked without replacement from ossiisi. Give prob of picking 2 i and 1 s. 9/35 What is prob of picking 1 t and 2 q when three letters picked without replacement from {q: 11, z: 7, t: 2}? 11/114 Three letters picked without replacement from {m: 9}. Give prob of picking 3 m. 1 What is prob of picking 1 f and 1 i when two letters picked without replacement from {a: 1, z: 2, i: 7, k: 2, f: 2, y: 2}? 7/60 Four letters picked without replacement from acaahhvhhcopva. What is prob of picking 2 h and 2 c? 6/1001 Three letters picked without replacement from {d: 2, s: 13, j: 5}. What is prob of picking 2 d and 1 j? 1/228 Three letters picked without replacement from {s: 5, i: 3, y: 3, f: 1, u: 8}. What is prob of picking 3 i? 1/1140 Calculate prob of picking 1 o, 1 e, and 1 i when three letters picked without replacement from {i: 1, e: 4, o: 3}. 3/14 Calculate prob of picking 2 e when two letters picked without replacement from nerenne. 1/7 Four letters picked without replacement from jfebfe. Give prob of picking 1 j, 1 e, and 2 f. 2/15 Calculate prob of picking 1 a, 2 h, and 1 n when four letters picked without replacement from ahsnsxnsxnahsxs. 2/455 Four letters picked without replacement from {l: 1, s: 4, p: 2, w: 2}. Give prob of picking 3 s and 1 p. 4/63 Four letters picked without replacement from {d: 6, v: 4, s: 9}. Give prob of picking 3 v and 1 s. 3/323 What is prob of picking 2 b and 1 v when three letters picked without replacement from {r: 3, v: 7, b: 7, y: 2, n: 1}? 49/380 Three letters picked without replacement from wwwwvwww. What is prob of picking 3 w? 5/8 Calculate prob of picking 1 d and 2 e when three letters picked without replacement from ttttwewtetwtttwwwd. 1/816 Calculate prob of picking 1 q and 1 h when two letters picked without replacement from {o: 1, q: 4, h: 1, w: 1, m: 2}. 1/9 Three letters picked without replacement from qlzzlzqlqylzyvztqz. What is prob of picking 1 l, 1 y, and 1 z? 1/17 Calculate prob of picking 1 c and 1 e when two letters picked without replacement from {e: 2, c: 2}. 2/3 Three letters picked without replacement from gzznzczznncezzzcezgz. Give prob of picking 1 n and 2 e. 1/380 Three letters picked without replacement from ssfsfsffsfsfssssss. What is prob of picking 3 s? 55/204 Three letters picked without replacement from {d: 7, x: 9}. Give prob of picking 3 x. 3/20 Two letters picked without replacement from wncnp. What is prob of picking 1 n and 1 c? 1/5 Two letters picked without replacement from tby. What is prob of picking 1 t and 1 y? 1/3 Two letters picked without replacement from {f: 1, v: 1, p: 1, a: 2, n: 1, m: 1}. What is prob of picking 1 a and 1 v? 2/21 Calculate prob of picking 2 j and 1 s when three letters picked without replacement from jjsjjiijsjjjjsj. 27/91 Two letters picked without replacement from rhffrffh. Give prob of picking 1 r and 1 h. 1/7 Two letters picked without replacement from kkruuuu. Give prob of picking 2 u. 2/7 Calculate prob of picking 1 x and 1 e when two letters picked without replacement from {x: 2, e: 5}. 10/21 Calculate prob of picking 1 t and 1 m when two letters picked without replacement from {a: 1, q: 11, m: 4, v: 1, t: 1}. 4/153 Calculate prob of picking 2 b when two letters picked without replacement from cbbcbbbcbbbcbb. 45/91 What is prob of picking 2 m and 1 p when three letters picked without replacement from {e: 1, p: 2, i: 5, m: 8}? 1/10 What is prob of picking 2 h when two letters picked without replacement from hhgg? 1/6 Three letters picked without replacement from {w: 3, o: 5}. What is prob of picking 3 o? 5/28 Two letters picked without replacement from aakkwwwa. Give prob of picking 2 w. 3/28 Four letters picked without replacement from nernrgr. What is prob of picking 2 r and 2 n? 3/35 What is prob of picking 2 c, 1 s, and 1 p when four letters picked without replacement from {c: 5, p: 2, s: 7, u: 3}? 1/17 What is prob of picking 2 a when two letters picked without replacement from {a: 5, c: 2}? 10/21 Three letters picked without replacement from zhrte. Give prob of picking 1 r, 1 e, and 1 z. 1/10 Three letters picked without replacement from pykkpiknpinp. Give prob of picking 1 k, 1 y, and 1 p. 3/55 Two letters picked without replacement from {n: 1, d: 2, l: 3, o: 1, s: 2, z: 3}. What is prob of picking 1 n and 1 z? 1/22 Three letters picked without replacement from {b: 12, n: 3}. Give prob of picking 1 n and 2 b. 198/455 Calculate prob of picking 2 w when two letters picked without replacement from {e: 9, w: 3}. 1/22 Four letters picked without replacement from {k: 6, q: 7}. Give prob of picking 1 q and 3 k. 28/143 Calculate prob of picking 1 i and 1 b when two letters picked without replacement from {c: 2, b: 7, y: 1, i: 2, p: 3, f: 3}. 14/153 Two letters picked without replacement from xxxiixix. What is prob of picking 2 x? 5/14 Calculate prob of picking 4 r when four letters picked without replacement from {r: 9, d: 2}. 21/55 What is prob of picking 1 s and 3 u when four letters picked without replacement from ususuuuuu? 5/9 Three letters picked without replacement from wyyifis. What is prob of picking 1 s, 1 w, and 1 f? 1/35 Two letters picked without replacement from {l: 1, h: 2, e: 2, g: 4}. What is prob of picking 1 l and 1 h? 1/18 Three letters picked without replacement from {k: 9, m: 3, f: 4, n: 4}. What is prob of picking 1 n, 1 k, and 1 m? 9/95 Calculate prob of picking 2 h when two letters picked without replacement from {h: 3, e: 1}. 1/2 What is prob of picking 2 h and 2 y when four letters picked without replacement from {h: 1, u: 4, y: 6}? 0 Calculate prob of picking 1 z and 1 v when two letters picked without replacement from bvbppvzvzv. 8/45 Two letters picked without replacement from xxfxfx. Give prob of picking 2 f. 1/15 Four letters picked without replacement from kjjokhjlloooopj. What is prob of picking 2 o and 2 k? 2/273 Calculate prob of picking 3 o and 1 b when four letters picked without replacement from {o: 5, b: 2, s: 13}. 4/969 Calculate prob of picking 1 i and 1 d when two letters picked without replacement from {n: 5, d: 5, a: 6, i: 4}. 2/19 Four letters picked without replacement from iabaagbbab. Give prob of picking 4 b. 1/210 What is prob of picking 1 l and 1 q when two letters picked without replacement from qxxqqxxxlqxxqqqqx? 1/17 Two letters picked without replacement from {s: 1, j: 1, n: 1}. Give prob of picking 1 n and 1 j. 1/3 Three letters picked without replacement from {g: 5, p: 8}. What is prob of picking 3 p? 28/143 What is prob of picking 1 a and 1 l when two letters picked without replacement from {x: 7, j: 3, q: 1, l: 1, a: 7}? 7/171 Three letters picked without replacement from mwwmwwwmmmmmmwwm. Give prob of picking 3 m. 3/20 Four letters picked without replacement from {t: 3, g: 8}. Give prob of picking 1 t and 3 g. 28/55 Calculate prob of picking 2 n when two letters picked without replacement from nnbnnnnnbbn. 28/55 Calculate prob of picking 1 x, 1 e, and 1 l when three letters picked without replacement from ugxel. 1/10 Calculate prob of picking 2 x, 1 j, and 1 o when four letters picked without replacement from {w: 3, o: 3, x: 1, u: 3, j: 1}. 0 Three letters picked without replacement from lpalllampllllmlalpmm. Give prob of picking 3 a. 1/1140 Three letters picked without replacement from ijajacaia. Give prob of picking 1 i, 1 c, and 1 j. 1/21 What is prob of picking 1 r, 1 t, and 1 m when three letters picked without replacement from {r: 1, t: 5, h: 1, m: 4}? 4/33 Three letters picked without replacement from {c: 2, h: 1, p: 2}. What is prob of picking 2 p and 1 h? 1/10 What is prob of picking 1 t, 2 d, and 1 c when four letters picked without replacement from vdchdtttdtt? 1/22 Two letters picked without replacement from lyzoh. What is prob of picking 1 l and 1 h? 1/10 Two letters picked without replacement from {t: 7, m: 12}. Give prob of picking 2 t. 7/57 Three letters picked without replacement from {d: 2, h: 1, s: 1, c: 3, n: 5, i: 1}. Give prob of picking 1 s, 1 i, and 1 n. 5/286 What is prob of picking 2 f and 2 a when four letters picked without replacement from mdmfdfioffmomomadfaf? 1/323 What is pr	{ "pile_set_name": "DM Mathematics" }
6/91 Calculate prob of sequence pzfw when four letters picked without replacement from qpqppfppzqqjwqpjpzzz. 7/29070 What is prob of sequence jjvl when four letters picked without replacement from {j: 2, i: 1, l: 1, v: 1}? 1/60 What is prob of sequence xxcc when four letters picked without replacement from cxcxxcxxxx? 1/20 Two letters picked without replacement from zatpaanpzkaakzaatpaa. What is prob of sequence nt? 1/190 What is prob of sequence hvhg when four letters picked without replacement from izghaviiihihg? 1/1430 Four letters picked without replacement from {f: 1, s: 3, d: 4, o: 4, b: 2}. What is prob of sequence ddbf? 1/1001 Calculate prob of sequence ev when two letters picked without replacement from {v: 3, e: 5}. 15/56 Three letters picked without replacement from {g: 5, h: 3, u: 1, j: 3, n: 7}. What is prob of sequence jgj? 5/969 Calculate prob of sequence tx when two letters picked without replacement from {x: 6, h: 2, y: 9, t: 1}. 1/51 What is prob of sequence ne when two letters picked without replacement from wbwwnnennbs? 2/55 What is prob of sequence oyyv when four letters picked without replacement from yvovovovvvyvyyvo? 4/455 What is prob of sequence pc when two letters picked without replacement from {o: 1, l: 5, s: 1, c: 1, d: 11, p: 1}? 1/380 Calculate prob of sequence akm when three letters picked without replacement from mkkakkkaaaa. 5/198 Calculate prob of sequence xpxc when four letters picked without replacement from pdpdxpxdcppxdcdxddd. 5/3876 Three letters picked without replacement from {v: 2, z: 4, h: 8}. What is prob of sequence hzv? 8/273 Three letters picked without replacement from {f: 4, b: 2, v: 6}. Give prob of sequence vfb. 2/55 What is prob of sequence hj when two letters picked without replacement from jhjahajjj? 5/36 What is prob of sequence iii when three letters picked without replacement from iii? 1 Three letters picked without replacement from {b: 8, v: 3, o: 2, w: 1, s: 5}. What is prob of sequence vbw? 4/969 Three letters picked without replacement from {z: 2, q: 6, k: 2, e: 4, h: 4, l: 2}. What is prob of sequence lhk? 2/855 What is prob of sequence hh when two letters picked without replacement from sxxssxshxxsxsshrshxh? 3/95 Calculate prob of sequence xrxk when four letters picked without replacement from {x: 2, r: 4, i: 3, k: 1, j: 4, h: 1}. 1/4095 What is prob of sequence ryyr when four letters picked without replacement from xrrryyrryy? 1/21 What is prob of sequence cnc when three letters picked without replacement from nnc? 0 What is prob of sequence lkkl when four letters picked without replacement from {k: 2, l: 7}? 1/36 Two letters picked without replacement from {m: 1, g: 8, v: 2, b: 2, r: 1, t: 1}. What is prob of sequence vt? 1/105 Calculate prob of sequence jw when two letters picked without replacement from wjee. 1/12 What is prob of sequence jjv when three letters picked without replacement from {j: 3, v: 5}? 5/56 Two letters picked without replacement from {d: 10}. What is prob of sequence dd? 1 What is prob of sequence po when two letters picked without replacement from {p: 1, e: 1, b: 1, o: 1, j: 1}? 1/20 Calculate prob of sequence kkf when three letters picked without replacement from {f: 3, k: 2}. 1/10 Four letters picked without replacement from {p: 1, j: 3, u: 1}. Give prob of sequence jjuj. 1/20 Two letters picked without replacement from cwwcwwcfswc. Give prob of sequence sw. 1/22 Four letters picked without replacement from {m: 9, s: 2, o: 1, f: 2}. What is prob of sequence fofm? 3/4004 Three letters picked without replacement from lldldllllllldll. What is prob of sequence ddl? 12/455 What is prob of sequence uee when three letters picked without replacement from {u: 2, e: 7}? 1/6 Calculate prob of sequence kzk when three letters picked without replacement from {z: 2, k: 5, y: 4}. 4/99 Calculate prob of sequence kt when two letters picked without replacement from {h: 1, k: 1, r: 2, i: 6, t: 3}. 1/52 Two letters picked without replacement from {v: 1, y: 11, m: 1, s: 4}. What is prob of sequence sm? 1/68 Three letters picked without replacement from sssssvss. What is prob of sequence ssv? 1/8 Calculate prob of sequence sksr when four letters picked without replacement from rrkrrrrrsrr. 0 Four letters picked without replacement from {b: 9, c: 2, o: 3, d: 3}. Give prob of sequence bdbd. 9/1190 Four letters picked without replacement from {k: 3, c: 1, l: 6, x: 3, o: 2}. Give prob of sequence kxoc. 1/1820 Two letters picked without replacement from jyyzz. Give prob of sequence zy. 1/5 What is prob of sequence md when two letters picked without replacement from mmmdmmmmmmmmmmmmmm? 1/18 Calculate prob of sequence cc when two letters picked without replacement from cununyuyyycu. 1/66 Two letters picked without replacement from {x: 1, z: 4, n: 3, t: 4, b: 5, w: 1}. What is prob of sequence wz? 2/153 Four letters picked without replacement from xuxu. Give prob of sequence uuuu. 0 Calculate prob of sequence ppd when three letters picked without replacement from {p: 2, d: 8}. 1/45 Three letters picked without replacement from {r: 4, q: 10}. Give prob of sequence rqr. 5/91 Two letters picked without replacement from vhvvzhzhzzz. Give prob of sequence hv. 9/110 Calculate prob of sequence ffll when four letters picked without replacement from {l: 6, f: 2}. 1/28 Calculate prob of sequence qj when two letters picked without replacement from {q: 4, s: 4, j: 3}. 6/55 What is prob of sequence fe when two letters picked without replacement from {s: 4, f: 2, e: 4, g: 2}? 2/33 Four letters picked without replacement from {q: 2, k: 5, n: 8}. Give prob of sequence knkk. 4/273 What is prob of sequence hdy when three letters picked without replacement from {d: 2, i: 1, j: 1, k: 1, h: 1, y: 1}? 1/105 What is prob of sequence ukr when three letters picked without replacement from urrpprkpurpurrup? 1/140 Calculate prob of sequence ada when three letters picked without replacement from saaudss. 1/105 Three letters picked without replacement from {o: 8, g: 5, u: 3}. What is prob of sequence ugu? 1/112 What is prob of sequence rr when two letters picked without replacement from rurrrur? 10/21 Three letters picked without replacement from xxxxxjxxjxxxjxxxjxx. Give prob of sequence xxx. 455/969 Calculate prob of sequence qqgq when four letters picked without replacement from {q: 7, g: 7}. 35/572 Three letters picked without replacement from tzhiizstg. Give prob of sequence zhz. 1/252 Calculate prob of sequence hljl when four letters picked without replacement from hhlhlljllhl. 1/66 Calculate prob of sequence hd when two letters picked without replacement from {p: 1, f: 2, d: 2, u: 1, h: 1, l: 1}. 1/28 Two letters picked without replacement from yyysykykkyyl. What is prob of sequence kk? 1/22 Three letters picked without replacement from taaaaataaaaaa. Give prob of sequence tat. 1/78 Four letters picked without replacement from nnnnudnunnnunulunnn. Give prob of sequence dlnu. 5/7752 Two letters picked without replacement from qbhvbabsvssvbhhvb. What is prob of sequence qb? 5/272 Three letters picked without replacement from uwduttoudud. What is prob of sequence utw? 4/495 Calculate prob of sequence sff when three letters picked without replacement from {v: 2, s: 2, l: 4, f: 3}. 2/165 Four letters picked without replacement from mttemtmmetmtttmet. Give prob of sequence meet. 3/595 Two letters picked without replacement from ememkemeqen. What is prob of sequence nq? 1/110 What is prob of sequence eq when two letters picked without replacement from qeqqeeq? 2/7 Two letters picked without replacement from mcmmmmmmmmmm. What is prob of sequence cm? 1/12 What is prob of sequence ii when two letters picked without replacement from {l: 4, q: 1, s: 1, p: 4, i: 3}? 1/26 What is prob of sequence uupp when four letters picked without replacement from pllu? 0 What is prob of sequence iddx when four letters picked without replacement from {u: 3, j: 2, x: 1, d: 3, i: 2, t: 3}? 1/2002 Four letters picked without replacement from fyykymcfmfn. What is prob of sequence nmfk? 1/1320 Four letters picked without replacement from azzasp. Give prob of sequence szap. 1/90 Three letters picked without replacement from {h: 1,	{ "pile_set_name": "DM Mathematics" }
/n*11n*(-10)/nn(4/5) assuming n is positive. n(-151/5) Simplify q*(-2/11)/((qq*(3/5)q)/q) assuming q is positive. q*(-98/55) Simplify (t/((tt(-2/13))/t))(-7/8) assuming t is positive. t(-105/104) Simplify (h/h(1/2))/(hh/(hh(-1/18))) assuming h is positive. h(-5/9) Simplify (j/j(-2/3))(20/9)j5j/j(1/6) assuming j is positive. j(515/54) Simplify (d(-1/13))38 assuming d is positive. d(-38/13) Simplify ((m/(((((m/m(-1/3))/mm)/m)/m)/m))/mm*2m)/((m/m*1)/(mm1)) assuming m is positive. m(20/3) Simplify (r*(3/8)/rrr(6/11))(1/55) assuming r is positive. r(81/4840) Simplify ((r/r(-3))(-13))44 assuming r is positive. r(-2288) Simplify (d(1/8)/d)(-38) assuming d is positive. d(133/4) Simplify (x(-41)x)/((xx(-7/2))/x) assuming x is positive. x(-73/2) Simplify l(2/27)l(1/22) assuming l is positive. l(71/594) Simplify (c(-1))40 assuming c is positive. c(-40) Simplify (h/h(-25))/hhh(-27)/h assuming h is positive. h(-2) Simplify (w/(w/(www(-2/29))))14 assuming w is positive. w(784/29) Simplify (s(2/17)ss5)34 assuming s is positive. s*208 Simplify (b/(bb/(b/b*(-6)))b)(-19) assuming b is positive. b(-133) Simplify c(-2/5)/c9 assuming c is positive. c(-47/5) Simplify y(-4)/yyyy(4/11)/y(y/((yy/y1)/y))(1/25) assuming y is positive. y(-989/275) Simplify ss/(s/s*(-2/15)s)ss(-24) assuming s is positive. s(-347/15) Simplify n*(-2)n*4(nn(-1))(7/4) assuming n is positive. n2 Simplify (q(2/49)/q(2/7))8 assuming q is positive. q(-96/49) Simplify (z(9/2)z(-4/3)/z)(-43) assuming z is positive. z(-559/6) Simplify (l(-8))16 assuming l is positive. l(-128) Simplify (f/((f*(-9)f)/f))/(f/f*(-5/7))(f(-8/7)/f)/f(-4/5) assuming f is positive. f(243/35) Simplify ((a/a(-2))/(a/(aa(-1/3))))/(((aa*(-5)/a)/a)/(a/(aa/(a(-1/4)/a)))) assuming a is positive. a(77/12) Simplify (j(j/j(-1/10)j)/jjj*(-2/3)/jj)(-5/2) assuming j is positive. j(-73/12) Simplify (gg(1/3)g/g(-2))(3/5) assuming g is positive. g(13/5) Simplify (((j(-20)j)/j)/j)(-46) assuming j is positive. j966 Simplify (c/c0)(11/8)(((c*2c)/c)/cc)/((cccc*(-3/5))/cc) assuming c is positive. c(39/40) Simplify f(-19/3)/ff13 assuming f is positive. f(17/3) Simplify (mmm/(((m/(m/m(2/7)))/m)/m)m)*(-35)m1/m0 assuming m is positive. m*(-199) Simplify (qq(2/29))(30/11) assuming q is positive. q(930/319) Simplify (c12/c)/c(-2) assuming c is positive. c13 Simplify (cc14)/(c/(c/(c(-1/57)c))) assuming c is positive. c*(799/57) Simplify h/(h/(h/(hh*(-9))))hhhh/(h/(h/h2))h(hhh/(hh*(-1/5)))/(hh(2/3)) assuming h is positive. h(188/15) Simplify x*(-4)/(xx/x(-6/25)) assuming x is positive. x(-156/25) Simplify (j(-1/2))(35/6) assuming j is positive. j(-35/12) Simplify ((n/n5)/n4)/((n(-1/9)/n)/(nnn(1/8))) assuming n is positive. n(-343/72) Simplify (d(-2/27)/d)/d(-29) assuming d is positive. d(754/27) Simplify (k(2/9))(3/4) assuming k is positive. k(1/6) Simplify n*(-4/5)nnnn(1/12)n assuming n is positive. n(197/60) Simplify z(-2/5)z6/zz(2/11)/(z/(z(-1/4)z)) assuming z is positive. z(997/220) Simplify p(-5)/(p(-3/5)p)(pp*9p)/ppp/(ppp*(-2/15)p)pp assuming p is positive. p(86/15) Simplify c28/c3 assuming c is positive. c25 Simplify (g/(g*(-4)gg))/(gg*(-24)g) assuming g is positive. g*25 Simplify ((fff(-2/17)/f)/(ff(-5)))(4/3) assuming f is positive. f*(332/51) Simplify ((f(f*(-2)f)/ffff)/f(-5/3))(-1) assuming f is positive. f(-11/3) Simplify (b/(b(1/3)b))5 assuming b is positive. b(-5/3) Simplify (rrr*(-5)r(4/9))/((r/r4r)/r6) assuming r is positive. r(49/9) Simplify ((oo5)/o)(-3/5) assuming o is positive. o*(-3) Simplify pp(p(-1/6)p)/pp/p13 assuming p is positive. p(-61/6) Simplify ((g/g(11/5))/g)/(g/(g(-27)/g)g) assuming g is positive. g*(-161/5) Simplify ((vv(2/7))/(v/v(3/2)))/(v*(-1/3)v5) assuming v is positive. v(-121/42) Simplify (ttt(-6))/t(-2/45) assuming t is positive. t(-178/45) Simplify (v/v(-8))/v*(-3/4)(vv(-1)vv)27 assuming v is positive. v(255/4) Simplify (((w/(w2w))/ww)/w)(-1/9)/(w(3/7)/(ww/(ww(-4)/w))) assuming w is positive. w(124/21) Simplify (x0x)(-35)/(x(2/15)/(x/((x/(x/(xx2/xx)))/x))) assuming x is positive. x(-542/15) Simplify (t4/(t/t*(2/5)))/(tt*4t/((t*1t)/t)) assuming t is positive. t(-8/5) Simplify (d/((d7/d)/dd))/(ddd11/d) assuming d is positive. d(-17) Simplify (((b/(b(1/15)/bb))/b)/(b(((b(bbbb9)/b)/bb)/b)/b))/(b(-2/7))13 assuming b is positive. b(-772/105) Simplify (z/z0)*(-20)z*5z(-6) assuming z is positive. z(-21) Simplify (pp(4/7))(-4) assuming p is positive. p(-44/7) Simplify u(-6)u18 assuming u is positive. u12 Simplify (d*(-3)d(-4))(-43) assuming d is positive. d301 Simplify ((d(-1/4)d)/d)24ddd*(2/9)d(-2) assuming d is positive. d(-52/9) Simplify (f/(ff(-5/4)))(3/4) assuming f is positive. f(15/16) Simplify (fff(2/9))/(fff(-24)) assuming f is positive. f(218/9) Simplify (v/(vv*(1/3)v)v)(1/82)/(v(2/13)/v(-4)) assuming v is positive. v(-13297/3198) Simplify ww*26ww25 assuming w is positive. w53 Simplify (m/m13)(6/13) assuming m is positive. m(-72/13) Simplify (u(-3)u0)/(u(-5/3)uu(-9)) assuming u is positive. u(20/3) Simplify (d/((d/d(-15))/d))/d(-16) assuming d is positive. d*2 Simplify (n(n/(n/((nn5)/n)))/nn)/(nn(2/11))(nn1)/n(-4/9) assuming n is positive. n(719/99) Simplify (i(-8)/ii)/(((i*(-8/7)i)/i)/i) assuming i is positive. i(-41/7) Simplify (x6/x1)/((x/(x(2/3)x))/xxx(-2/15)) assuming x is positive. x(29/5) Simplify ((p(2/7))(2/19))(2/3) assuming p is positive. p(8/399) Simplify (m(-2/13)m(-5))40 assuming m is positive. m*(-2680/13) Simplify r/(r/(r/(rr*(1/5))))rr(-1/3)r(r/((rr(1/12))/r))/(r/(r(-2/5)r)) assuming r is positive. r(119/60) Simplify (dd*(2/25)d)/(dd(-19)) assuming d is positive. d(502/25) Simplify (t(-22)t)15 assuming t is positive. t(-315) Simplify (l/l(2/5))(-6/11)((ll*(1/9))/l)/ll(-1/2) assuming l is positive. l(-1699/990) Simplify (c/c*(-4/11)c)/(cc(3/8)) assuming c is positive. c(87/88) Simplify (((r(1/3)r)/rr)6)(-45) assuming r is positive. r(-360) Simplify (i/(ii(15/8)))/i(-33) assuming i is positive. i(249/8) Simplify (p0p)(-6/5)/((p/(pp/(p/(p*(-8)/pp)p)))/p(-1/4)) assuming p is positive. p(-209/20) Simplify (v/(v/((vv/v*(-2/7))/v))v)19/(v/v(-3))(-3/29) assuming v is positive. v(8900/203) Simplify k*(-1/55)kk/(k/(k(1/3)k)) assuming k is positive. k*(382/165) Simplify (x/(x/(xx/(x/(x/(x*(-2/5)x))x))))(-34)x/(x*1/x)x/x(2/9) assuming x is positive. x(-532/45) Simplify (o*(-6/11)ooo(2/11)/o)27 assuming o is positive. o(189/11) Simplify (((j/j(-1/8))/jj)/(j6j))/(j*(-3/8)j1) assuming j is positive. j(-13/2) Simplify (m(-3/28))22 assuming m is positive. m(-33/14) Simplify (p/p0)*35(p/(p/p5))/(p3pp) assuming p is positive. p35 Simplify x(2/17)/x3 assuming x is positive. x(-49/17) Simplify ((bb(-1))/bbbb/b*(-1/14)bbb)/(b1)(42/5) assuming b is positive. b(-233/70) Simplify p10/(pp(-29)) assuming p is positive. p38 Simplify ((x/(xx*(-5)x))(-44))(-16) assuming x is positive. x*2816 Simplify ((h/((hh*(-2/9))/h))/hh)*32(h/h*(2/5)h)/hh/(h/(h(hh(1/7))/hhh)) assuming h is positive. h(13499/315) Simplify (p(1/4)p)/(p*(-1/2)/pp)(p(pp/(p/p(-1)))/p)(12/11) assuming p is positive. p(7/4) Simplify a(-10)a(-2/49) assuming a is positive. a(-492/49) Simplify www(w/w(1/4))/www(ww/(w(-3/4)w))/w(w1/w)/w0 assuming w is positive. w(11/2) Simplify j9jj(6/7)jj assuming j is positive. j(90/7) Simplify (z(-18))(-16/5) assuming z is positive. z*(288/5) Simplify	{ "pile_set_name": "DM Mathematics" }
/((j*8jj(jj1/j)/j)/(j6/(j/j(-4)))) assuming j is positive. j(-4672/273) Simplify ((v2)19v*(-3/2)/vv3)/(v/(v/v(-9/7))vvvv(2/49))(-17) assuming v is positive. v*(6697/98) Simplify (((tt*(-13))/t)/(tt(-8)))(-9/11)/(t/t*(-3/8)t*(-5)tt(-7)t(-1/7)) assuming t is positive. t(9041/616) Simplify (a/(a(-29)/a))/(a(-42/5)a)a(2/79)/(a/a15) assuming a is positive. a(20708/395) Simplify (l(-1)ll)(5/3)/(l(-1/2))*38(ll0l)*(-16)/(ll*(2/7)l)(-33/2) assuming l is positive. l(554/21) Simplify ((nn(6/5))/nn/n*(1/7)n)(-27)/((((n/(n(-1/3)/n))/nn)/(nn*(-3/2)))/(nn*(1/2)n)46) assuming n is positive. n(6221/210) Simplify ((aa(1/5))(-18))(-1/4)((a*(-10)a)/a9)(1/77) assuming a is positive. a(1989/385) Simplify (d10d(5/7))(-35)(d*(-4/11)d/d(1/6))/(d(-1/6)d(-6)d) assuming d is positive. d(-4063/11) Simplify ((v1/v)(29/5))(-43)v(-5)/(v(-2/13)/v)v*(-2/3)vvv4 assuming v is positive. v(58/39) Simplify ((g0)(-43))*(-21/2)((gg(g/(g/((gggg(-1/3)/g)/g)))/ggg)/g(1/9))(8/7) assuming g is positive. g(256/63) Simplify ((j(-5)j)/((j(j/j(-2/5))/jj)/j))(9/7)/((j/j(-1/3))/jj(j*(-1/14)/j)/jjj)(2/23) assuming j is positive. j(-17032/2415) Simplify ((ss(-4))31/(s/((s*0/s)/ss)s27))(-24) assuming s is positive. s2928 Simplify ((b0)44b(-6)/b0)/(bb15((b(5/4)/b)/b)/b)47 assuming b is positive. b(-2703/4) Simplify (((g/(g2/ggg)gg)/(g/(g/g*6)g))/(gg(1/4)g)*19)/((gg(-6))/((g/g5g)/g)g*(1/2)g(2/3)) assuming g is positive. g(-599/12) Simplify ((b(-2/3))44)*(1/38)(bb(b*2b)/bbbb(((bb/(bb/b*2b))/b)/b)/b)(2/25) assuming b is positive. b(-106/285) Simplify ((vv(-1/38))/v32(v*19v)48)(-2/9) assuming v is positive. v(-11767/57) Simplify (j(-1/4)/j)*33(jj(-4/9))/(j18j) assuming j is positive. j*(-2149/36) Simplify ((ff(2/33))(-5/3)(ff*(-21))/(fff2))(2/99) assuming f is positive. f(-5102/9801) Simplify (jj/(jj(-1/11)/jj)j)(-25)j/(j*(2/47)j)jj(29/4) assuming j is positive. j(-91127/2068) Simplify ((((x/((x/(x/x*4))/x))/xx)/x)*(-30)/((xxx(-15/2)xxx)/xx(4/13)/xx))35 assuming x is positive. x(84805/26) Simplify (rr/r(1/6)rr(-2/17)/r)/(r(2/5))(2/15)((rr(-1/2))(-2/11))(3/17) assuming r is positive. r(15393/9350) Simplify (d(-4/7)/d3)(3/44)(d/(d*(-4/9)/d)d(2/5))/(d3/dd1) assuming d is positive. d(-5531/13860) Simplify ((((jj*(-6/19)jj)/(jjj/(jj*(-1/10))j))31)(-9/2))(-35) assuming j is positive. j(-154287/76) Simplify (b(2/7))(-17/4)(b/(b(1/2)b)b)/(bb*2/b)(b(-2))23/((b/b(1/2))/b(-2)) assuming b is positive. b(-717/14) Simplify (n(2/3))(-21/8)/((n0/n)/(n*(-7)/n))n*(-6/5)n*(5/3)(n/n2)(4/23) assuming n is positive. n(-11671/1380) Simplify (c(-2/27)/cc/c(-5/2))(-1/7)/(c(-2)/c(1/9))(1/20) assuming c is positive. c(-911/3780) Simplify (s/((s/(s(-15)s))/s)s(-1/3)(s(-1))(-1/4))(-5/8) assuming s is positive. s(785/96) Simplify ((p1)(-5/2))*(15/8)(((pp/(pp/(pp(2/7))))/p)28)(1/16) assuming p is positive. p(-67/16) Simplify (sss(3/4)ss)(-26)((ss(1/6)/s)/s)(1/4) assuming s is positive. s(-2969/24) Simplify ((j(-23/5)j(4/7))/(j/(((j/j(1/6)j)/j)/j))(-1/12))(3/7) assuming j is positive. j(-9907/5880) Simplify o/o(8/13)o(oo*23)/oo(o(-16)/o)(-19) assuming o is positive. o(4529/13) Simplify ((ww/(w*(-1/8)w))*13(w(-2/9))(-3))(-3/28) assuming w is positive. w(-367/224) Simplify (((h*(4/11)h)/(h*(-15)/hh))/(hh/(h(3/7)h)hh/h(-3/10)))32 assuming h is positive. h(166224/385) Simplify ((r(-8/11))*(-3)(r(((rr(-15))/r)/r)/r)(-41))(-5/2) assuming r is positive. r(-18100/11) Simplify ((f/f(-6))(2/57)(f/((f/((ffff*(1/7)ff)/f))/f))/fff13)(-1/61) assuming f is positive. f(-7337/24339) Simplify (o/(o/(oo*(-3/7)/o))oooo(-2/9))(1/50)((o/o(-2/5))(-30))(-4/15) assuming o is positive. o(17714/1575) Simplify ((h*(-3)hhh(3/8))/(h(-1/5)h6))/((hhh6)/hh(-8))(-11/5) assuming h is positive. h*(-69/8) Simplify ((z/(zz/(z(-7/5)/z)))/(z(-2/123)z)(zzz*(-10/7))/((zz(-18))/z))44 assuming z is positive. z*(2687432/4305) Simplify qq*(4/5)/qq*(-1/2)(q/(qq(-2)q))*43((qq/q1)/q(-3))46 assuming q is positive. q(2273/10) Simplify (r4rr1)37((r(1/9)/r)/((r(-2/5)r)/r))/(r(-2/5)/(r((rr3/rrr)/r)/rr)) assuming r is positive. r(10211/45) Simplify (((q1q12)/(q(-2/15)/qq(-2)))(-7/9))35 assuming q is positive. q(-11858/27) Simplify (((g*5g)/(g/(g/(g*(-1/12)g))gg))/(g17)23)42 assuming g is positive. g(-32585/2) Simplify (t*(-3/4)t/(tt(1/6)tt)(t*(-1/16)t)/(t*(-1)t))/((t*1/(t(tt(-7))/t))/(t(-1/4)t/(t*0t))) assuming t is positive. t(-443/48) Simplify ((((k/k1k)/kk((kkk(3/4)kk)/k)/k)/(k(-1/2)/(k4k)))(-36))(-6/17) assuming k is positive. k(1998/17) Simplify ((d/d(-2/5))/(dd(-3)d))*(-47)(d(dd/(d/(dd(-1)))ddd)/d)(-2/95)/(((d/(d/d(-2/15)d))/d)/d(-5)) assuming d is positive. d(-32989/285) Simplify ((xx/((x*(-1)/x)/x))/((xx*11xx)/xx)(x(-2)x)47)(2/5) assuming x is positive. x(-112/5) Simplify (b(3/8)b/(b/((bb*(2/7)b)/b))(b/b(-2/5))(-3/8))/((b2b)/(bb(-1/2)b)bb*0b3) assuming b is positive. b(-611/140) Simplify (a*2a)/a*(-2/7)(a/(a(-1)/a))/(a1aa)(aa*3(a/a(-2))/a)/(a(-2/5))35 assuming a is positive. a(163/7) Simplify ((j/j*2j)32)34/(j3/(j/(j/j(-5)))(j(1/2))(-2/13)) assuming j is positive. j(-103/13) Simplify l(34/3)l*(-5/8)l*9(ll(-9))/l assuming l is positive. l(257/24) Simplify ((ss/s(-11))(4/11)/(ss/(ss/s(-2/81)))(-6))13 assuming s is positive. s(17680/297) Simplify ((w/(ww(-21/4)/ww)w)/(ww*(2/5))w/w*(-39)ww(-24/7))(10/17) assuming w is positive. w(5939/238) Simplify ((h(2/3))(1/24)(h/((h/(h/(h/h*0)h))/h))(-11/4))/(h(3/2)hhh(1/10)hhh(1/4)/(h/(h(-3/5)/hh)h)) assuming h is positive. h*(-157/18) Simplify ((((rr/(r/(rrr*(-2/7)))rrr)/r)(-2/19)/(r6rr*0r))(-1/20))(-24) assuming r is positive. r*(-1356/133) Simplify (u(u*33u)/u)(1/30)/(u21)(3/23) assuming u is positive. u(-554/345) Simplify ((bb/b(-6)b)/bb(1/2)b*3/(bb/(b/(bb/((bb*(-1/3)b)/b)))))/((b*(-2)bb(-4/7)/bbb)/(b(2/3)b)(15/2)) assuming b is positive. b(467/21) Simplify (((((c/(cc/(c/c0c)c))/c)(28/9))13)3)13 assuming c is positive. c(-4732/3) Simplify (jj(-1))(2/23)j/(j(-3)j)j/(j/(j/((j5j)/j)j))(jj3/j)/(jj*(-6))(jj(-1/3))(10/7) assuming j is positive. j(188/21) Simplify z(3/5)zz/(z/z41)((z/(zzz*(-15)))/zz)(-2/17) assuming z is positive. z(3481/85) Simplify (((n/(nn/(n/(n(1/8)nn))nn))/(n((n(-1/6)/n)/n)/n))/(((n/(n/(n/n(-3))))/n)/n(-8)))/(n(1/4)n(-1/11))(-42) assuming n is positive. n(-1657/264) Simplify (a(-1/24)a*(2/37)a(-2/61)/a(-13))(-23) assuming a is positive. a(-16170817/54168) Simplify ((ss(-1))/(s/s(2/55))s*14ss(5/3)/s)30 assuming s is positive. s(4852/11) Simplify ((a(-1/25)a/a*30a)/(a(5/3)/a)(4/3))(-6/7) assuming a is positive. a(13018/525) Simplify pp/p(-2/15)p*(-7)(p/(p/((pp/(p((p/(((pp6)/p)/p))/p)/p))/p)p))/((ppp*3pp)/p)(p0/p(-1/2))/(p0)(-1/11) assuming p is positive. p(-161/30) Simplify ((p7p)(2/23)/(p(7/6)/pp(-4/19)))(-6/13) assuming p is positive. p(-1939/5681) Simplify (((d8d/(((d/d0)/dd)/d))/((((dd(1/4))/d)/dd)/d)(-23/5))(-18/7))(4/39) assuming d is positive. d(-666/455) Simplify ((mmm(-9))/((m6mmm)/m))(-1/13)m/m*(-5/4)m*3mm1mm(2/9) assuming m is positive. m(4505/468) Simplify ((h(1/3))(1/20)/(((h(h/h*(-2/5))/h)/hh)/hh(-1)))/((((h(-2/5)hh)/h)/h)(-46))(-16) assuming h is positive. h(17701/60) Simplify (((s*(	{ "pile_set_name": "DM Mathematics" }
44. Give g(-2). -650 Let t(c) = 115c - 537. Calculate t(5). 38 Let f(l) = -l3 - 12l*2 + 222l - 387. Determine f(2). 1 Let f(h) = -h*3 + 30h*2 - 26h + 5. What is f(29)? 92 Let x(a) = a*2 + 46a + 211. Determine x(-38). -93 Let r(i) = 2i2 + 7i + 25. Determine r(-8). 97 Let s(u) = u*3 - 12u*2 + 47u - 123. Give s(7). -39 Let f(g) = 48g - 4083. What is f(89)? 189 Let q(j) = -69j - 835. Determine q(-12). -7 Let i(j) = j*3 - 87j*2 + 169j + 83. What is i(85)? -2 Let v(j) = -j*2 + 24j - 47. What is v(4)? 33 Let l(t) = -303t + 5953. Calculate l(20). -107 Let v(j) = -124j + 1338. Give v(8). 346 Let t(x) = x*2 + 4x + 12. Give t(-10). 72 Let c(d) = -2d3 - 17d*2 - 30d - 139. Determine c(-8). 37 Let b(a) = -2a2 - 210a + 13116. Give b(44). 4 Let k(r) = -r*2 + 1035r + 5179. Determine k(-5). -21 Let y(g) = -g*2 + 24g + 454. Give y(-15). -131 Let k(w) = 53w2 + 751w + 106. Give k(-14). -20 Let g(a) = -3a3 - 19a*2 - 3a + 11. Calculate g(-3). -70 Let x(b) = -23b + 1860. Give x(81). -3 Let w(v) = 9866v + 9846. What is w(-1)? -20 Let s(k) = 49k - 707. What is s(15)? 28 Let a(w) = -302w - 1509. What is a(-7)? 605 Let n(b) = -5b3 - 50b*2 + 15b + 19. Calculate n(-10). -131 Let f(x) = -x*3 - 22x*2 - 85x - 38. Give f(-17). -38 Let u(p) = -p*3 + 16p*2 - 21p + 124. What is u(16)? -212 Let l(z) = -213z - 2564. Give l(-12). -8 Let l(n) = 901n + 7. What is l(0)? 7 Let n(d) = -19d - 102. Give n(-5). -7 Let x(d) = -d3 - 2d*2 - 60d - 498. What is x(-6)? 6 Let c(q) = -q*2 + 48q - 423. Give c(12). 9 Let n(b) = b*2 - 304b + 2090. Determine n(7). 11 Let s(i) = 3i3 - 15i*2 + 26i - 109. Determine s(5). 21 Let f(w) = w*3 - 5w*2 + 8w + 50. Calculate f(-3). -46 Let p(m) = 2m2 + 14m - 27. Give p(2). 9 Let d(g) = -2g2 - 132g - 1695. Give d(-49). -29 Let o(n) = 3n3 + 81n*2 - 53n - 1435. Determine o(-27). -4 Let i(s) = -68s - 5985. Calculate i(-88). -1 Let m(x) = -65x*2 - 977x - 46. What is m(-15)? -16 Let g(p) = p*2 - 233p + 3317. Determine g(218). 47 Let j(l) = -39l - 408. Give j(-10). -18 Let i(k) = 1164k + 2383. Calculate i(-2). 55 Let q(h) = -8h2 - 543h + 3280. Determine q(6). -266 Let p(t) = -t*3 - 9t*2 - 16t - 77. Determine p(-8). -13 Let r(z) = -z*3 + 64z*2 + 20z + 2959. Calculate r(65). 34 Let l(t) = -942t - 6602. Calculate l(-7). -8 Let q(c) = -2c*3 - 8c*2 - 84c - 245. Determine q(-3). -11 Let b(z) = -1447z - 23093. Calculate b(-16). 59 Let g(v) = 22v*2 + 176v - 2819. Determine g(-16). -3 Let n(b) = 3b2 + 102b + 147. Give n(-32). -45 Let n(j) = -515j + 2054. Calculate n(4). -6 Let s(w) = w3 + 24w*2 + 367w + 7906. Determine s(-23). -6 Let d(k) = k*3 - 8k*2 + 2k + 1. Give d(5). -64 Let w(m) = 2m3 + 35m*2 + 13m - 43. Give w(-17). 25 Let q(z) = 160z + 77. Give q(-1). -83 Let c(u) = -u3 - 43u*2 - 83u + 49. What is c(-41)? 90 Let b(y) = -136y - 301. Determine b(-3). 107 Let s(c) = -c2 - 9c + 76. Give s(-15). -14 Let j(d) = 16d - 70. Calculate j(-9). -214 Let h(x) = 16x - 151. Determine h(10). 9 Let q(z) = -330z - 5. Give q(0). -5 Let o(a) = a3 - 18a*2 - 18a + 627. What is o(18)? 303 Let l(u) = 7u3 - 3u*2 - 6u + 2. What is l(3)? 146 Let z(x) = -27x2 - 122x + 258. Calculate z(-6). 18 Let v(i) = i*2 - 654i - 3949. What is v(-6)? 11 Let s(l) = -76l3 + 3l*2 - 7l + 3. Give s(1). -77 Let d(t) = t*2 + 11t - 373. What is d(-26)? 17 Let z(n) = -3n3 + 218n*2 + 75n - 145. Calculate z(73). 1 Let d(l) = l*2 - 140l - 998. Determine d(-7). 31 Let t(n) = 6n3 + 146n*2 + 46n - 36. Determine t(-24). 12 Let w(d) = -d*3 + 11d*2 + 8d - 77. Calculate w(11). 11 Let g(n) = -7n + 93. What is g(10)? 23 Let b(a) = -30a*3 + 5a*2 + 150a + 144. What is b(-1)? 29 Let g(w) = -231w - 686. Give g(-3). 7 Let h(i) = 54i*3 - 32i*2 + 37i - 7. Calculate h(1). 52 Let s(u) = 2u2 - 235u - 620. Determine s(120). -20 Let k(a) = 3a3 - 18a*2 - 5a + 18. Determine k(8). 362 Let x(k) = k*2 + 75k + 902. What is x(-60)? 2 Let l(x) = 80x - 27. Calculate l(-6). -507 Let h(l) = l3 - 5l*2 + 17l - 6. Determine h(9). 471 Let q(f) = f*3 - 6f*2 + 3f + 13. Calculate q(3). -5 Let i(c) = -c*2 - 14c - 5. Give i(-11). 28 Let i(d) = -d*3 - 96d*2 - 92d - 8. Calculate i(-95). -293 Let v(k) = k*2 + 77k - 3210. Determine v(30). 0 Let u(o) = -5o2 + 26o + 9. Calculate u(5). 14 Let r(i) = -5i3 - 6i*2 - 45i + 144. Calculate r(3). -180 Let l(g) = 95g - 3783. Determine l(40). 17 Let i(w) = -112w + 132. Give i(5). -428 Let x(r) = r*2 - 51r + 650. Determine x(24). 2 Let i(d) = -49d + 3959. Calculate i(84). -157 Let c(s) = -s2 + 237s + 3010. Calculate c(-12). 22 Let w(p) = 4p2 + 9p - 14. Calculate w(5). 131 Let p(a) = -21a + 731. Determine p(18). 353 Let t(z) = -337z - 4925. Give t(-15). 130 Let l(k) = -k*3 + 23k*2 + 78k - 29. Calculate l(25). 671 Let p(g) = 3g3 + 8g*2 + 10g - 4. Give p(-5). -229 Let x(h) = 88h2 - h + 11. Determine x(-1). 100 Let t(p) = -p2 + 152. Determine t(0). 152 Let a(d) = -d3 + 15d*2 - 60d + 994. Calculate a(15). 94 Let k(v) = v*3 - 36v*2 + 9v - 1393. Determine k(37). 309 Let f(i) = -i*3 - 20i*2 + 90i + 478. Give f(-23). -5 Let q(c) = -108c + 39. What is q(1)? -69 Let c(d) = 2d*3 + 23d*2 + 11d - 18. What is c(-11)? -18 Let c(v) = -138v2 - 545v + 16. What is c(-4)? -12 Let c(f) = -38f + 861. Give c(24). -51 Let h(u) = -2u*2 + 519u - 1032. What is h(2)? -2 Let i(g) = -2g3 - 5g*2 + 8g - 5. Calculate i(2). -25 Let x(p) = 8p - 51. What is x(25)? 149 Let l(c) = -18c - 1786. Calculate l(-97). -40 Let z(h) = -86h + 193. Determine z(6). -323 Let h(d) = -d2 - 179d + 7. Determine h(0). 7 Let t(o) = 2o2 + 144o - 13. What is t(-74)? 283 Let g(n) = 3n3 - 94n*2 - 70n + 197. Calculate g(32). 5 Let d(p) = -2p2 + 14p + 4. Give d(8). -12 Let a(u) = -2u3 - u2 + 58u + 127. Calculate a(-3). -2 Let u(v) = -2v2 + 4v + 598. Determine u(-26). -858 Let j(a) = 34a - 27. Calculate j(-4). -163 Let x(g) = -2g*3 - 210g*2 - g - 116. What is x(-105)? -11 Let f(z) = 193z - 2760. Determine f(14). -58 Let f(u) = 47u - 15. Determine f(8). 361 Let c(i) = -594i + 594. Determine c(1). 0 Let v(f) = -f*2 + 6f + 18. Calculate v(-5). -37 Let m(v) = 3v3 + 83v*2 + 53v + 120. Give m(-27). 147 Let v(r) = 2r2 - 407r + 10978. What is v(32)? 2 Let m(z) = 2z2 - 216z + 826. Calculate m(104). -6 Let w(i) = 7i2 + 31i + 22. Calculate w(-3). -8 Let j(p) = -5p + 768. Calculate j(8). 728 Let j(x) = -x3 - 16x*2 + 313x - 163. Calculate j(11). 13 Let r(k) = 3k2 - 2030k + 25890. Determine r(13). 7 Let w(d) = -3864d + 11651. Give w(3). 59 Let a(g) = 3140g + 9384. What is a(-3)? -36 Let c(z) = -z*3 - 3z*2 + 8z - 62. Calculate c(5). -222 Let s(z) = -z*2 + 57z + 177. What is s(60)? -3 Let u(a) = -10a2 + 194a + 949. Give u(23). 121 Let v(s) = -s*2 - 110s - 2871. Determine v(-67). 10 Let c(n) = 24n - 1951. Determine c(82). 17 Let f(w) = -w3 + 10w*2 + w - 140. Determine f(8). -4 Let p(v) = -29v*2 - 866v + 137. Determine p(-30). 17 Let f(o) = -16o2 + 46o + 6. Calculate f(4). -66 Let u(d) = d*2 - 209d + 2172. Give u(11). -6 Let r(u) = 8u2 + 3u + 5. Calculate r(0). 5 Let z(s) = -s*2 - 8s + 588. Determine z(-30). -72 Let m(w) = 6w3 + 5w*2 - 12w + 1. Give m(2). 45 Let k(x) = x*2 - 140x - 1048. Calculate k(-7). -19 Let h(k) = k*2 - 162k - 26575. Determine h(263). -12 Let k(n) = -9n + 594. Give k(65). 9 Let i(f) = -35f*2 + 141f + 723. Determine i(7). -5 Let p(g) = g*2 + 132g + 2688. What is p(-108)? 96 Let o(q) = 6q - 132. What is o(-37)? -354 Let z(t) = 12t + 66. Determine z(-5). 6 Let f(g) = -97g3 + 2g*2 - 211g + 210. What is f(1)? -96 Let y(n) = n*3 - 23n*2 - 37n + 89. What is y(24)? -223 Let u(k) = -k*3 + 15k*2 - 50k - 3. What is u(13)? -315 Let z(m) = -m*2 + 491m - 5758. What is z(12)? -10 Let r(q) = -q*3 + 3q*2 - 74q + 233. Give r(3). 11 Let t(r) = -r*2 - 25r + 31. Determine t(-26). 5 Let y(q) = 7q2 + 91q + 5. Determine y(-14). 103 Let q(p) = -p*3 - 4p*2 + 20p + 13. Determine q(-7). 20 Let m(c) = -45c2 + 15c. Give m(-1). -60 Let i(h) =	{ "pile_set_name": "DM Mathematics" }
(3/(-2))/((-3)/(-20)). Let z be 1 + 8/l - 1. Which is the second biggest value? (a) -2/7 (b) z (c) p b Let c = 0.28 - -3.72. Let q = 3/32 + 13/32. Let f = -101/140 + -1/35. What is the second smallest value in q, c, f? q Let m = -18 - -24. Suppose 2k = -h - 3h - 10, 0 = -2h - m. Which is the smallest value? (a) 1/4 (b) 3/7 (c) k a Let g = -18 + 20. What is the second biggest value in g, -4, 0.13? 0.13 Let a = -1/2 - 1. What is the second biggest value in a, 7, -1? -1 Let r = 4.5 + -4. Let m = r - 0. Let h = 9/7 + -8/7. Which is the second smallest value? (a) h (b) -5 (c) m a Let z = 36.5 - 37. Which is the second smallest value? (a) 3.3 (b) z (c) -1/6 c Let h = -6 + 7. Suppose 0 = 5x - 0x + l - 10, -4l - 29 = -3x. Let o = 2 + 3. Which is the second biggest value? (a) h (b) x (c) o b Let d = -0.4 + -1.6. Let x = 3 + -6. Let t = -2.7 - x. What is the second biggest value in d, t, 0? 0 Let t = 0 + -2.5. Let k = -3 - t. Let f = k + 0. Which is the biggest value? (a) -1 (b) -3/2 (c) f c Let q = 2.78 - 0.18. Let r = q + -3. Which is the third biggest value? (a) r (b) 1 (c) 0.1 a Let t = 6 - 6. Let w(c) = -3c - 33. Let g be w(-10). What is the second smallest value in g, 1/6, t? t Let l = -21 + 25. Which is the third biggest value? (a) -5 (b) l (c) 0.4 a Let n = -8.6 + 9. Let g = 1.4 - n. What is the smallest value in g, -2, -1? -2 Let h be (-5)/10 + (-2)/(-5). Which is the third smallest value? (a) h (b) -5 (c) -1 a Let h = -15 + 14. Which is the second biggest value? (a) 0.1 (b) -2 (c) h (d) -0.2 d Let n be 15/(-13) - (-7 + 1 + 5). What is the fourth biggest value in -1/3, -1, n, -2? -2 Let i = 0.54 + -0.7. Which is the third biggest value? (a) i (b) 1 (c) -5 c Let h = -32 - -35.2. Let k = h + -3. Which is the biggest value? (a) k (b) -2/3 (c) -1/9 a Let z = -10 + 14. Let k = z - 4. Which is the biggest value? (a) k (b) 2/5 (c) 3 c Let f = -25 + 29. Which is the third biggest value? (a) 0.3 (b) -0.3 (c) f (d) -12 b Suppose 4v - 107 - 101 = 0. Let s be v/(-14) + 8/(-28). Let y = 5 - 5.2. Which is the third smallest value? (a) 2/15 (b) s (c) y a Let f = 0.08 + -0.08. Let d = 17 - 17.7. Let g = d + 1. Which is the smallest value? (a) 3 (b) f (c) g b Let m be 5/10(3 - -31). Let y = m - 16. What is the second smallest value in 0.1, y, 1/6? 1/6 Let g = -2/49 - 45/98. Let p = -0.112 - -0.012. Which is the third biggest value? (a) 2 (b) g (c) p b Let p = 1 - 4. Let f(v) = v - 1. Let l(w) = -w*2 + 6w - 3. Let d(j) = -3f(j) - l(j). Let z be d(8). What is the second smallest value in z, -0.4, p? z Let p be (96/(-28))/((-3)/(-21)). Let u be 16/p6/(-20). Which is the second smallest value? (a) 0.4 (b) 1 (c) u a Let i(t) = -3 - 2t2 + t + 4 - 3t*3 + 2t*3. Let r be i(-1). What is the second biggest value in 0.4, r, 5? 0.4 Let m = -0.05 - -0.55. What is the biggest value in m, 1/5, 1? 1 Suppose 8l + 84 + 60 = 0. Let j be 8/110(-45)/l. Let m = -13 - -25/2. Which is the second biggest value? (a) j (b) m (c) 2 a Let r be ((-4)/6)/((-4)/54). Which is the second smallest value? (a) 0.2 (b) r (c) 0.3 c Suppose -w + 18 - 32 = 0. What is the third biggest value in w, 0.5, -2? w Let r = 27359029/28805 + -8/5761. Let j = -969 + r. Let l = 94/5 + j. What is the second biggest value in 1, -4, l? l Let r be 2/1216/(-6). Let k = -23/36 + 5/12. Which is the second smallest value? (a) r (b) 2 (c) k c Let i = -0.02 - 2.98. Let y = -172 + 2923/17. Let m = 24/119 + y. Which is the third smallest value? (a) m (b) i (c) 1 c Suppose -4y + 1 = 9. Let h be 5 + -2 + 3 + y. Suppose -1 = 3v - h. Which is the biggest value? (a) v (b) -5 (c) -4 a Let x be -1(-3)/((-42)/(-4)). Let r = -6.6 + 6. Let d = -0.4 + r. Which is the third smallest value? (a) d (b) 2/9 (c) x c Let c(t) = -t3 - 8t*2 + 10t + 7. Let o be (2/4)/(4/(-72)). Let m be c(o). What is the second smallest value in -0.04, 1/6, m? -0.04 Let l = -27 + 26. Let k = 5 - 8. Let g = l - k. Which is the smallest value? (a) -3/4 (b) -1 (c) g b Let p = -0.4 + 0.2. What is the biggest value in 4, p, -5? 4 Let r = -4 + 14.6. Let t = -11 + r. Which is the second biggest value? (a) -0.5 (b) t (c) 1/2 b Suppose c = 3c - 20. Let v be ((-2)/c)/(6/10). What is the third smallest value in 0.2, v, -1/4? 0.2 Let b = -0.87 + -1.13. Let c(z) = z2 - 5z - 3. Let j be c(6). What is the third smallest value in b, 0.3, j? j Let p = 335791/36 + -9326. Let h = p + -7/9. Which is the third smallest value? (a) 0.4 (b) h (c) -0.5 b Let m(q) = -12q - 44. Let l be m(-4). Which is the fourth smallest value? (a) l (b) 2/13 (c) -4 (d) -7 a Let z = 1.1 + 1.96. Let x = 0.06 - z. Let k = x - -2.5. Which is the third biggest value? (a) k (b) 2 (c) 1 a Let r = 27 + -20. Which is the smallest value? (a) 0.4 (b) 5 (c) -0.2 (d) r c Let p = 0.0579 - -0.4421. Let l = -3.1 + 3. Which is the third biggest value? (a) l (b) p (c) -0.4 c Let h = -2.1 - -1.6. Which is the second biggest value? (a) h (b) 4 (c) -3 a Let y = -0.04 + 2.04. Let o(d) = d2 - 8d + 16. Let g be o(4). Which is the third biggest value? (a) y (b) g (c) 0.4 b Let h be (3/(-20))/((-24)/(-16)). Let n = 17/39 - 10/13. Let o = 0.6 - 5.6. Which is the third smallest value? (a) h (b) n (c) o a Suppose -10k = -9k + 1. Which is the second biggest value? (a) k (b) 0.5 (c) -0.4 c Let n = 86 + -256/3. What is the third smallest value in n, 0.4, 3, -0.2? n Suppose -4r + 3q + 16 = 0, -3r + 1 = 4q + 14. Let y = r - 4. What is the third biggest value in 0, -0.4, y? y Let y = 0.145 - 0.045. Which is the third smallest value? (a) 2 (b) y (c) -4 a Let x = -2/17 + -11/51. What is the biggest value in 0, -0.2, 4, x? 4 Let l(g) = -g*2 - g - 1. Let z be l(-1). What is the third biggest value in 0, z, -2/9? z Let y be 6/21 - 54/(-56). Which is the third smallest value? (a) 1/6 (b) y (c) -3 b Let m = -3 - -1. Let n = -107/5 + 21. Which is the biggest value? (a) n (b) 1/8 (c) m b Let f = -0.19 + 3.19. Let q = -1 - -2. Which is the third smallest value? (a) -1/5 (b) q (c) f c Let r = 27 - 26. Which is the biggest value? (a) -5 (b) 2/15 (c) r c Let q be (-153)/(-135) - (-4)/(-30). Let r = 0.31 + -0.3. Let m = -4.01 + r. Which is the second biggest value? (a) q (b) -0.1 (c) m b Let t = -1.2 + 1. Let i = 0.25 - 0.65. Which is the third smallest value? (a) -3 (b) i (c) t c Let w = -0.29 + -0.01. Let l = 17 - 15. Which is the third biggest value? (a) 0.2 (b) w (c) l b Let w be ((-2)/(-2) - 0)-1. Let q be w/4 + 85/180. Which is the biggest value? (a) q (b) -1/4 (c) 0 a Let r = -98 - -100. Which is the biggest value? (a) 5 (b) 2/7 (c) -1/6 (d) r a Suppose 3o - 2o = -2. Let x be (-1 - 2 - o)/3. Let g(j) = 2j + 13. Let u be g(-8). Which is the smallest value? (a) x (b) u (c) 2 b Let j = 3.4 - 4.12. Let r = -0.08 + j. Let f = r - 3.2. Which is the second smallest value? (a) -2/19 (b) f (c) -0.2 c Let f = -0.42 + 0.02. Let w be 24/(-32) + 18/16. Let m = -6 - -1. Which is the second smallest value? (a) w (b) m (c) f c Let i = 11/3 - 3. Which is the second biggest value? (a) i (b) -6 (c) 5 a Let f be 2/11 + 714/187. Which is the third smallest value? (a) f (b) 1/11 (c) -3 a Let q be 4/10(-85)/221. Which is the third biggest value? (a) -4 (b) q (c) 2/11 a Let y be (-140)/24 + (17/6 - 3). What is the second smallest value in -5, -0.2, y, 5/3? -5 Let m = -6893/35 - -197. Let o = m + 29/105. Which is the biggest value? (a) o (b) 1/4 (c) 2/11 a Suppose -h = -6 - 0. What is the second smallest value in -2, h, -0.3? -0.3 Let t be 2/1 + 72. Suppose -5v - t = -4w + w, -5w = 2v + 25. Let g = -0.45 - 0.05. Which is the third smallest value? (a) -0.2 (b) v (c) g a Let b = 71/116 - -4/29. What is the second smallest value in 4, -0.2, b? b Let b = -2 + -3. Let v = -0.03 + 5.03. What is the biggest value in 0.5, b, v? v Let d be ((-2)/4)/((-2)/8). Suppose -5b + 7 = -2t, -t + d - 3 = 0. Let q = 6.9 - 7. What is the second biggest value in 2/5, b, q? 2/5 Let u = -19.2 - -19. Which is the biggest value? (a) u (b) 5 (c) 3 b Let q be 3/5(-120)/(-2484). What is the second biggest value in q, -3, 2? q Let p = 0.145 - -0.055. Let g be 2 + (-36)/17	{ "pile_set_name": "DM Mathematics" }
(j) wrt j. -78840j3 Let l(z) be the first derivative of -z7/84 - z6/60 + 23z*4/8 - 2z*3/3 - 142z - 207. Let h(k) be the third derivative of l(k). Differentiate h(o) wrt o. -30o2 - 12o Let d be ((3 - 4) + 4)/((-4)/52). Let v = d + 42. Differentiate h*v + 6 - 20h*3 + 3 with respect to h. -57h*2 Let u = 16 + -11. Suppose -4f + 2l = -14, 4f - u = 3f + l. Find the first derivative of 45 - 6rf - 39 - r2 wrt r. -14r Suppose -12 = -3c, 6a + 172 = 2a - 4c. Let x = -43 - a. What is the second derivative of -12b - 5b - 4b4 + bx wrt b? -36b2 Let p(r) = 7r*3 - 9r*2 + 2338r - 3719. Let t(y) = -3y3 + 4y*2 - 1168y + 1860. Let f(v) = 4p(v) + 9t(v). Differentiate f(z) with respect to z. 3z2 - 1160 Let h(y) be the third derivative of -29y8/84 + y7/105 + y*5/12 + 269y4/12 - y3/2 - 2y2 + y + 4772. Find the second derivative of h(a) wrt a. -2320a*3 + 24a*2 + 10 Let d(l) = -1000l3 + l2 + 5624l + 12. Let f(t) = 1000t3 - t2 - 5625t - 9. Let y(z) = 3d(z) + 4f(z). What is the second derivative of y(c) wrt c? 6000c - 2 Let c = 16 - 15. Let v be (7 + -11)/(c/(-25)). What is the second derivative of 10l - 131l*2 + vl*2 - 7l - 34l wrt l? -62 Let w(b) be the third derivative of -457b*9/168 - 134b*5/15 + 987b*2. What is the third derivative of w(l) wrt l? -164520l*3 Let u = 1850 - 1719. Let x = -5 - -10. Find the second derivative of -8h - uh5 + 111h*x - 2h wrt h. -400h3 Let p(m) be the third derivative of -m8/168 + 11m7/210 - m6/60 + 179m5/15 + m4/24 - 75m*2 - 3m. What is the third derivative of p(n) wrt n? -120n2 + 264n - 12 Let x(m) be the second derivative of 337m5/20 - 373m*4/12 + 247m. What is the third derivative of x(h) wrt h? 2022 Let z(v) be the second derivative of v*7/42 + 391v*5/20 + 85v4/3 + v2/2 + 317v + 1. What is the third derivative of z(m) wrt m? 60m*2 + 2346 Let z(v) = 1435v*2 + 17v + 2517. Let j(a) = -478a2 - 6a - 839. Let c(b) = -17j(b) - 6z(b). What is the first derivative of c(d) wrt d? -968d Let x(r) = 30r*4 - 5r - 442. Let a = 506 + -511. Let c(i) = -14i4 + 3i + 221. Let z(g) = ac(g) - 3x(g). Differentiate z(b) with respect to b. -80b3 Let l(b) be the first derivative of -9/2b*2 + 0b - 11 + 4/3b3 - 73/4b*4. Find the third derivative of l(o) wrt o. -438 Let j(u) be the third derivative of -37u*6/40 + 17u*5 - 100u*2 + 2. Find the third derivative of j(t) wrt t. -666 Let u be (-3)/((-9)/15) - 2. Suppose s = -5t + 29, -5s + 2 + 3 = -ut. Find the first derivative of r3 + rs - 480 + 491 - r*3 wrt r. 4r*3 Let c(n) be the first derivative of -5971n*3/3 - 1139n + 6746. Differentiate c(s) with respect to s. -11942s Let h(x) be the first derivative of 3x*4/2 + 15x*3 + 191x*2/2 - 769. Find the second derivative of h(j) wrt j. 36j + 90 Let k(o) be the third derivative of -o*8/168 - 226o*7/105 + 13o*5/12 + 1809o*2. Find the third derivative of k(g) wrt g. -120g*2 - 10848g Let y(i) be the first derivative of -5i3/3 - 65i*2/2 - 160i - 1122. Find the first derivative of y(h) wrt h. -10h - 65 Let h be (6(-12)/(-252))/((-2)/(-175)). Let n(q) = -2q - 2. Let a be n(-4). Find the third derivative of -43s*2 - as*2 + s + hs*4 - s wrt s. 600s Suppose 2i + 7t - 2t = 64, -5i + t = -106. What is the third derivative of 22l3 - 4l*2 + 87l*3 + 9l*3 + il*3 - 10 + 8l*2 wrt l? 840 Let c be ((-100)/(-6))/(((-6)/(-3))/6). Let s = -48 + c. Find the second derivative of -84 + 8f*s + 84 + 15f wrt f. 16 Let l be 588/16 - 3/(-12). Let v = l + -23. Differentiate y - 2y - 16 + y - vy*4 wrt y. -56y*3 Let n(u) be the third derivative of -19u5/5 - u4/6 - 1315u3/2 + 7u*2 - u - 92. What is the derivative of n(t) wrt t? -456t - 4 Suppose -2a - 4u + 14 = 0, -u - 1 = 3. What is the second derivative of ap - 24 + 21p - 55p + 2p*5 + 17p wrt p? 40p3 Suppose -4l = 3l - 2l. Suppose -1 = x + 4w - 15, 4w - 12 = l. What is the derivative of -xp2 + 3p*2 - 10 + 4p*2 wrt p? 10p Suppose 69x - 7063 = -577. What is the second derivative of 118u - 287u - xu*3 - 18u*3 - 139u*3 wrt u? -1506u Let y(d) = d*2 - 20d + 37. Let x be y(18). What is the second derivative of x - 256j + 291j - 1 - 17j5 wrt j? -340j*3 Let k(g) = -17g - 31. Let p be k(-3). Find the first derivative of -67 - 8y2 - py2 - y2 wrt y. -58y Let d be (-19)/(-9) + (-3)/27. What is the first derivative of -135 - 390y*d + 219y*2 + 221y*2 wrt y? 100y Let k(a) be the third derivative of 37a9/60480 - 101a*6/720 - 6a*5/5 + 58a*2 - 2. Let r(d) be the third derivative of k(d). Differentiate r(i) wrt i. 111i*2 Let n = -318 + 381. What is the derivative of 93g*2 + n + 50 - 61g*2 wrt g? 64g Let l(w) = -87w + 3481. Let v(g) = g2 + 703g - 27847. Let q(r) = 17l(r) + 2v(r). What is the first derivative of q(u) wrt u? 4u - 73 Let h = -401 + 458. What is the second derivative of -hp - 55p - 129 + 9p*2 + 111p wrt p? 18 Find the first derivative of 5410s - 2445s - 2074s + 148 wrt s. 891 Let h(y) = 1154y*3 + 3y*2 + 1490y + 6. Let w(v) = 1147v3 + 4v*2 + 1491v + 9. Let u(d) = 3h(d) - 2w(d). What is the third derivative of u(a) wrt a? 7008 Suppose -8 + 8 = -23m. Find the second derivative of 76j + mj3 + j3 + 51j*2 - 25j*2 + 0j*3 wrt j. 6j + 52 Let m(u) = u*2 - 9u + 12. Let g be m(14). Differentiate 8d + 3d - 11d - g + 93d*3 wrt d. 279d2 Let r(i) be the first derivative of i4/4 - 3i3 + 27i*2/2 - 2970i - 3507. What is the first derivative of r(d) wrt d? 3d2 - 18d + 27 Let v(m) be the third derivative of 7m7/15 - 3m6/40 + m5/20 + 589m3/6 - 752m*2. Find the third derivative of v(a) wrt a. 2352a - 54 Let v(j) be the third derivative of 1951j6/120 + 3229j*5/60 - 42j*2 + 10j. Find the third derivative of v(h) wrt h. 11706 Suppose -2a - f + 10 = -1, -4f + 12 = 0. What is the second derivative of 6d - 8d*3 - 5 + 0d*4 - 11d + 3d + 2d*a wrt d? 24d*2 - 48d Let p(t) = 14710t + 9828. Let z(a) = 7430a + 4914. Let g(u) = -3p(u) + 5z(u). What is the derivative of g(w) wrt w? -6980 Suppose -5688 = -15z + 7z. Find the third derivative of 1499q2 - 33q*3 - zq*2 - 755q*2 wrt q. -198 Let f(x) = -1475x4 + x2 + 44x - 18. Let t(g) = -2950g*4 + 2g*2 + 85g - 30. Let d(w) = -5f(w) + 3t(w). What is the third derivative of d(i) wrt i? -35400i Let a(x) be the first derivative of 11x*4/6 - 52x*3/3 + 112x + 59. Let v(j) be the first derivative of a(j). Find the second derivative of v(w) wrt w. 44 What is the derivative of -2742 + 4202 - 7822 - 6014 - 4805h wrt h? -4805 Let k(r) be the third derivative of -53r9/504 + r6/24 + r*5/20 + 97r*4/4 + 598r*2 + 2. What is the third derivative of k(w) wrt w? -6360w*3 + 30 Let u(d) = -3d - 11. Let y = -28 - -19. Let z be u(y). Differentiate 22v3 - 2v*3 - 3v*3 - z with respect to v. 51v*2 Suppose -4i + c = -41, c = 3i - 0c - 32. What is the second derivative of n*3 - 15 + 11n + 3n2 - in + 0n wrt n? 6n + 6 Let w = -11 + 15. Suppose -2 - w = -4y + s, s = -y + 4. Differentiate 9 - 3m*4 + 0 + ym*4 wrt m. -4m*3 Differentiate -262l + 101l + 642l - 1278 + 19 with respect to l. 481 Let z(j) be the third derivative of 383j6/120 + j5/20 - 5j*4/24 - 2j3/3 + j2 + 404j. What is the second derivative of z(u) wrt u? 2298u + 6 Let i(k) be the first derivative of -k*4/2 + 667k*3/3 + 1390k*2 + 1056. Find the second derivative of i(b) wrt b. -12b + 1334 Let b be (-7 + 6/3)-1. Suppose -23 = -3f - b. Differentiate 2 - 13 - 10x - f + 4 with respect to x. -10 Suppose 2q - 2g = -7g + 12, -2g = -q + 24. Suppose -ql = -11l - 3955. Find the second derivative of -10j + l - 791 + j*5 wrt j. 20j*3 Let y = 141 - 137. What is the third derivative of -90a*2 + 10a*y + 13a*4 + 17a*4 + 108a*2 wrt a? 960a Let o(n) be the first derivative of -131/2n2 + 19n*5 + 0n + 0n4 - 104 + 0n*3. What is the second derivative of o(s) wrt s? 1140s*2 Let w(q) = -2q - 13. Let n be w(-7). Suppose -s - d + 3 = -n, -3*s - d = -10. Find the third deri	{ "pile_set_name": "DM Mathematics" }
. Let p be f(2). Differentiate -2d + 1 + 4d + p wrt d. 2 Let f(o) be the first derivative of 0o6 - 1/7o*7 + 1/3o*3 + 0o*2 + 0o + 2 + 0o5 + 0o*4. Find the third derivative of f(b) wrt b. -120b*3 Let k = 25 + -22. Let r(b) be the second derivative of -1/20b*5 - 1/6b*k + 0b*4 - 3b + 0b2 + 0. What is the second derivative of r(x) wrt x? -6x Let m(j) be the first derivative of -19j5/5 - j2 + j + 50. What is the second derivative of m(w) wrt w? -228w*2 Let n(r) be the second derivative of 0 + 0r*3 - 1/2r*2 + 1/20r*5 + 0r*4 - 3r. What is the derivative of n(v) wrt v? 3v2 Find the third derivative of 4l*2 + 12l*2 - 27l*6 + 26l*6 wrt l. -120l3 Let b(l) = l2 - 5l + 2. Let x be b(5). Suppose 3 = -3y + 3f, 0y + 2y + 4f - 4 = 0. Find the third derivative of 3j2 - j2 - xj*3 + yj*2 wrt j. -12 Let m be (2 - 11/4)8/(-36). Let v(i) be the second derivative of 2i - mi*3 + 0i*2 + 0 + 0i*4 - 1/10i*5. What is the second derivative of v(g) wrt g? -12g Let p(a) be the third derivative of 1/3a3 + 0 + 0a - 1/30a6 + 0a*4 - 2a*2 + 0a*5. Differentiate p(h) with respect to h. -12h*2 Let k(t) = -35t*3 + 11t*2 + 105t + 11. Let g(q) = 7q3 - 2q*2 - 21q - 2. Let o(s) = 11g(s) + 2k(s). What is the second derivative of o(m) wrt m? 42m Let m(o) be the first derivative of 11o*3/3 - 23o*2 - 4. Find the second derivative of m(s) wrt s. 22 What is the derivative of 1 + 8 - 3 + 15f*2 wrt f? 30f Let j(f) be the second derivative of -3/10f5 + 7/2f*2 + 4f + 0 + 0f3 + 0f*4. What is the first derivative of j(s) wrt s? -18s*2 Let m = -40 - -45. Let s(t) be the first derivative of 0t*2 + 0t*3 - 1/5t*m + 0t*4 + 1 + 3t. What is the first derivative of s(x) wrt x? -4x3 Suppose 17 = 5i - 4d - 0, -2 = -2i + 4d. Suppose ik - 6 = 2k. Find the first derivative of -3l*4 - k + 0l*4 + 2l*4 wrt l. -4l*3 What is the third derivative of -4l*6 - 21 - 9l*2 + 10 + 11 wrt l? -480l*3 Let r = -4 - -4. Suppose 4g - 11 - 5 = r. Differentiate 2 - 4 - d + g with respect to d. -1 Let v(b) = 29b + 35. Let k(y) = -145y - 175. Let f(p) = -2k(p) - 11v(p). Differentiate f(g) wrt g. -29 Suppose 2y + 8 = 0, 0c + 2c - 16 = 2y. Find the second derivative of -q + 15 - 15 - cq2 wrt q. -8 Let d(o) = 8o3 + 1. Let l(i) = -i3 - 1. Let p(g) = d(g) + 5l(g). Differentiate p(c) wrt c. 9c*2 Let z(d) = -6d*2 + 11. Let x(f) = -30f*2 + 56. Let n(q) = 3x(q) - 16z(q). Differentiate n(w) wrt w. 12w Let c(g) = 3g - 4. Let y be c(2). Find the second derivative of 2a*2 - 5a*2 - ya - 4a2 + 5a*2 wrt a. -4 Suppose -201 + 197 = -2u. Let p(t) be the second derivative of 0t4 + 0 - 1/30t*6 - ut*2 + 0t*3 + 0t*5 + 3t. Differentiate p(f) with respect to f. -4f3 Suppose 0p - 2p = -4d + 14, -5d + p = -13. Find the second derivative of 11o*4 + do*4 - 4o - 14o4 wrt o. -12o*2 Let l = 10 + -8. What is the second derivative of 4a - a*2 + 11a*2 - 6a*l wrt a? 8 Let o = -6 + 10. Suppose -oh = -2h - 6. What is the derivative of l - hl - 2 + 3 wrt l? -2 Let j(w) = 9w4 - 9w. Suppose 5l = 14 + 16. Let u(i) = -5i*4 + 5i. Let p(s) = lj(s) + 10u(s). Find the second derivative of p(f) wrt f. 48f2 Let y(c) be the second derivative of 0 + 0c*3 + 3/20c*5 + 2c + 2c2 + 0c*4. Differentiate y(g) with respect to g. 9g*2 Let s(a) be the first derivative of -16a*3/3 + 25a + 25. What is the derivative of s(d) wrt d? -32d Let n(m) = -m3 + m - 1. Let j(z) = -2z*4 - 6z*3 + 6z + 1. Let l(c) = -j(c) + 6n(c). Differentiate l(q) with respect to q. 8q*3 Let a(f) be the third derivative of 11f8/168 + f4/4 - 26f2. Find the second derivative of a(b) wrt b. 440b*3 Let v(n) be the first derivative of 3/5n*5 + 0n*3 + 0n*2 - 4n + 3 + 0n4. Differentiate v(p) wrt p. 12p*3 What is the third derivative of -8s*3 + 6s - 6s + 5s2 - s2 wrt s? -48 Let l(i) be the third derivative of 17i4/24 - 3i*3/2 + 7i*2. What is the first derivative of l(a) wrt a? 17 Let l(s) = -55s*3 + 6s*2 - 6s + 33. Let k(x) = 110x3 - 13x*2 + 13x - 66. Let c(u) = 6k(u) + 13l(u). Differentiate c(w) with respect to w. -165w2 Find the second derivative of -2c*2 + 12c*2 + 3c + 12c wrt c. 20 Let m(z) = -67z*6 + 5z*5 + 49z*2. Let c(h) = 34h*6 - 3h*5 - 24h*2. Let t(u) = 5c(u) + 3m(u). Find the third derivative of t(r) wrt r. -3720r*3 What is the second derivative of 39k - 13k + 34k - 24k4 - 15k wrt k? -288k2 Let p(n) be the third derivative of -1/120n*6 - 1/2n*3 + 0n*4 + 0 + 2n*2 + 0n*5 + 0n. What is the derivative of p(l) wrt l? -3l2 Let a(m) = m2 + m - 1. Let l(p) = -25p*2 - 7p - 4. Let w(s) = -4a(s) + l(s). What is the second derivative of w(b) wrt b? -58 Let j be 26/6 + 1/(-3). Suppose -2h - 4u + j = 0, 5h + 2u = -u + 10. Find the second derivative of 4n - 6n + n - hn*2 + 5n*2 wrt n. 6 Find the third derivative of 83x*6 + 37x*2 + 3x*3 - 96x*6 - 3x*3 wrt x. -1560x*3 What is the first derivative of -3768u*2 + 6u*3 + 1 + 3768u*2 wrt u? 18u*2 Let h(x) = 21x*3 + 8x*2 - 8x - 89. Let s(u) = -7u3 - 3u*2 + 3u + 30. Let g(k) = 3h(k) + 8s(k). Differentiate g(t) with respect to t. 21t2 Suppose -6x = -8x + 4. Let z(l) be the second derivative of 1/3l*3 - 2l + 0lx + 0 - 1/12l4. Find the second derivative of z(y) wrt y. -2 Let o(b) be the second derivative of b6/360 - b5/24 - b4/6 + 2b. Let s(r) be the third derivative of o(r). Differentiate s(u) wrt u. 2 Find the first derivative of -5f + 10 - 1 - 3f wrt f. -8 Suppose b - 4b + 3q = -9, 4q = -2b + 6. What is the third derivative of -4c*3 - 4c*3 + bc*3 - 7c*2 + 0c*3 wrt c? -30 Let a(b) = 27b*5 - 9b*4 + 9b*3 + 7b. Let p(g) = 14g5 - 4g*4 + 4g*3 + 4g. Let c(r) = 4a(r) - 9p(r). What is the second derivative of c(v) wrt v? -360v3 Let u(j) be the first derivative of -j8/1680 + j5/40 + 2j*3/3 + 3. Let f(b) be the third derivative of u(b). Find the second derivative of f(g) wrt g. -12g*2 Suppose -l = 4l - 10. What is the first derivative of -w*4 + lw*4 + 0w*4 - 4 wrt w? 4w*3 Let n(y) be the second derivative of 0y*2 - 1/4y*4 + 1/30y*6 - 2y + 0y5 + 0y*3 + 0. What is the third derivative of n(v) wrt v? 24v Let n(z) = 2z2 + z + 2. Let o be (-26)/12 + 2/12. Let u(l) = l3 + l2 - l + 1. Let p(q) = ou(q) + n(q). Find the second derivative of p(g) wrt g. -12g Let g = -2 - -2. Let w = 2 - g. What is the derivative of 0sw + 1 + 1 + s2 wrt s? 2s Let q(n) = n2 - 6n + 3. Let d be q(6). Suppose 8 = 4v - 12. Find the second derivative of -11 + xv + 11 - dx wrt x. 20x3 What is the second derivative of 78r - 85r + 2r*5 + 2r*5 wrt r? 80r3 Let r(c) = -c3 - c + 1. Let w(n) = -10n3 - 5n + 2. Let f(o) = 5r(o) - w(o). Find the first derivative of f(i) wrt i. 15i*2 Suppose 0t - 10 = -5t. Find the first derivative of 4c*2 + 6 + tc*2 - 7c*2 wrt c. -2c Let x(w) be the first derivative of -w8/560 - w5/120 - w*3 + 1. Let y(h) be the third derivative of x(h). Find the second derivative of y(j) wrt j. -36j*2 Let x be (32/12)/(-2)3. Let l(c) = -13c3 - 4c*2 - 3. Let u(q) = 25q*3 + 7q*2 + 7. Let p(j) = xu(j) - 7l(j). Differentiate p(y) with respect to y. -27y2 Let i = -7 + 9. What is the third derivative of x2 + 3xi - x2 - 5x*3 wrt x? -30 Let w(t) = 7t*2 + 9t. Let s(u) = -15u2 - 19u. Let l(o) = 3s(o) + 5w(o). What is the second derivative of l(d) wrt d? -20 Let v(m) be the first derivative of 31m4/2 - 2m3/3 + 61. Find the third derivative of v(p) wrt p. 372 Let h(r) be the second derivative of r8/14 + 29r4/12 - 12r. Find the third derivative of h(c) wrt c. 480c3 Let a(l) = 5l2 - l + 1. Let f(u) = -u2 + u - 1. Let v be f(1). Let s(i) = -i. Let m(n) = va(n) + s(n). What is the first derivative of m(b) wrt b? -10b Let z = 22 + -15. Let q(k) = k - 5. Let a be q(z). What is the third derivative of 0p2 + pa + p4 - 2p*2 wrt p? 24p Let p(o) = -60o + 60. Let k(r) = -5r + 5. Suppose j - 5t - 5 - 2 = 0, -2t + 6 = 4	{ "pile_set_name": "DM Mathematics" }
39, 0 = -m - 5. Let z = -8 + f. Solve -h*2 + 5hz - h3 + 3h3 = 0 for h. -2, 0 Factor 0 + 2/9w*2 + 0w - 2/9w3. -2w*2(w - 1)/9 Let p(h) = h - 6. Let w be p(8). Suppose -9 = -2d + 5l, 4d + 2l - w = 2d. Solve 2i2 + 6 - i4 - 6 - di3 - 3i2 = 0. -1, 0 Let c(x) be the second derivative of -x6/30 + x5/10 + x4/12 - x*3/3 + 46x. Determine n so that c(n) = 0. -1, 0, 1, 2 Suppose -4k = 2t - 30, -3k + 5 = 4t - 6t. Suppose 3z + 6 + 5 = 5i, 3 = -3i + kz. Factor 11 + 3o*3 - io2 - o2 + 1 - 4o2. 3(o - 2)*2(o + 1) Let o(f) be the second derivative of f*5/80 - 7f*4/48 - 7f*3/8 + 27f*2/8 - 209f. Find k, given that o(k) = 0. -3, 1, 9 Let q = -56327/13 + 4333. Solve -4/13 - qo2 - 6/13o = 0 for o. -2, -1 Let b(f) be the first derivative of -f5/105 + f4/21 - 2f3/21 - 9f*2/2 - 7. Let w(k) be the second derivative of b(k). Factor w(h). -4(h - 1)2/7 Let w(h) be the third derivative of h6/24 - 5h5/12 - 5h*4/24 + 25h*3/6 - 345h*2. Factor w(m). 5(m - 5)(m - 1)(m + 1) Suppose 4h - 1 = 3h. Let j be (h/(-9))/(4 - (-50)/(-12)). Determine k, given that 0 - k*2 - jk + 1/3k4 + 0k*3 = 0. -1, 0, 2 Determine k, given that -23 - 3k*2 - 2k*2 + 4 + 39 = 0. -2, 2 Suppose 0 = -m + 4c + 15, 527c - 528c = -4m + 15. Determine d, given that 1/3d*m + 0d2 - 2/3 - d = 0. -1, 2 Let d(u) = -u3 - 62u2 + 408u + 4. Let o be d(6). Factor -594/7g3 + 243/7g*o + 12/7 + 471/7g*2 - 132/7g. 3(g - 1)2(9g - 2)2/7 Suppose 17 + 1 = 9q. Let x(s) be the second derivative of 0 + s*3 + 4s - 3/10s5 + 0s*q + 1/4s*4 - 1/10s*6. Factor x(m). -3m(m - 1)(m + 1)(m + 2) Let l(u) = -u2 - 1. Let f(m) = m4 + m3 - 2m*2 - 2. Let r(d) = 3f(d) - 6l(d). Determine h so that r(h) = 0. -1, 0 Let u(v) be the second derivative of 3v5/40 - v4 + 3v3 + 72v. Factor u(c). 3c(c - 6)(c - 2)/2 Let v(h) be the first derivative of 6h5/115 + h4/46 - 6h3/23 + 3h*2/23 + 4h/23 + 19. Suppose v(x) = 0. What is x? -2, -1/3, 1 Let b(g) be the first derivative of 0g - 5/6g*6 + 5/2g*2 - 11 + 10/3g*3 - 2g*5 + 0g*4. Find z such that b(z) = 0. -1, 0, 1 Let v = 22151/2 + -11074. Factor vb*2 - 6b + 6. 3(b - 2)2/2 Let q(d) be the second derivative of 0 + 9/13d*2 - 2/13d*3 + 3d + 1/78d4. Factor q(h). 2(h - 3)2/13 Let b(g) be the first derivative of g7/70 - 3g6/40 + g5/10 + 13g*2/2 + 12. Let j(z) be the second derivative of b(z). Find n, given that j(n) = 0. 0, 1, 2 Let d(m) be the first derivative of -1/5m*5 - 1/2m*4 + 11/3m*3 + 6m*2 - 36m + 19. What is v in d(v) = 0? -3, 2 Factor -5492f - 1350f + 1702f + 28 + 46947f*2 + 283298f*2 - 8. 5(257f - 2)2 Suppose 0 = 2t + 4k - 22, 0 = 8t - 11t - 5k + 29. Find y, given that 4/5y - 2/5y*4 + 8/5y*t + 0 - 2y*2 = 0. 0, 1, 2 Let y(m) be the second derivative of -10/3m*3 - 11m + 5/12m4 + 10m*2 + 0. Factor y(w). 5(w - 2)*2 Let l = 13345 + -4257051/319. Let f = 2532/1595 + l. What is r in 8/5r + 4/5r2 - fr*3 + 2/5 - 6/5r*4 = 0? -1, -1/3, 1 Suppose 846 = 204j - 49j + 268j. Find g, given that -4/3g - 1/3g*j + 1/3g*3 + 4/3 = 0. -2, 1, 2 Let a(o) = 3o + 4 - 2o - 4o. Let g be a(0). Determine x so that 0 + 4/3x2 + 5/3x*4 - gx*3 + 0x = 0. 0, 2/5, 2 Suppose -3o + 43 = -4t - 4o, -2t = 2o + 14. Let u be 322/392 - -1t/21. Find v such that uv2 + 0 + 3/4v = 0. -3, 0 Solve 1/7o2 - 40/7 + 39/7o = 0 for o. -40, 1 Let b(y) = -y*3 - 5y*2 + 5y - 1. Suppose 3q + 6 = 0, -3q = 3m + q + 26. Let h be b(m). Let 2w*2 - 4w + 6 - hw2 + 4w + 3w = 0. What is w? -1, 2 Factor -237/5p*2 + 1/5p*3 + 18723/5p - 493039/5. (p - 79)*3/5 Suppose b - 3m = -15, -5 = -3b + 3m - 4m. Let o = 6 + -1. Let 2u - ou2 + bu3 + u2 + 2u3 = 0. Calculate u. 0, 1 Let q = -16 - -31. Let s be (-2 + 40/q)/(20/18). Find k such that -sk2 - 2/5 + k = 0. 2/3, 1 Let k(u) = -u4 - 20u3 + 62u*2 + 2. Let j(i) = -4i*4 - 62i*3 + 185i*2 + 7. Let l(b) = -2j(b) + 7k(b). What is r in l(r) = 0? 0, 8 Factor -52/5t + 18/5 - 8/5t3 - 78/5t*2. -2(t + 1)(t + 9)(4t - 1)/5 Suppose -3p - 13 = k, 3p + 19 = -2p + k. Let h be 1 + (-9)/((-54)/p). Factor -ht2 + 1/3t + 0. -t(t - 1)/3 Let p(g) = -g2 + 6. Let k be p(0). Suppose -d + k = d. Factor 2n5 + n4 - n5 + n5 - dn4. 2n*4(n - 1) Solve -1/7o3 + 0o*2 - 16/7 + 12/7o = 0 for o. -4, 2 Let y = -52545/4 - -13152. Find f such that -3 + yf3 - 111/4f*2 + 18f - 3f4 = 0. 1/4, 1, 2 Let n(m) be the third derivative of -m5/30 - 8m*4/3 - 31m*3/3 - 2m*2 + 13m. Factor n(z). -2(z + 1)(z + 31) Let i = -25/9 + 3. Let z(b) be the first derivative of 4 - 2/27b3 + 1/9b*2 - 1/18b*4 + ib. Factor z(s). -2(s - 1)(s + 1)2/9 Let w be 18/3 - (-3 + 0). Let x = w - 6. Factor -s3 - 4s - 2s*x - 6 + 13s. -3(s - 1)2(s + 2) Let s = 40835 + -122503/3. Find r such that -1/2r - 1/6r*3 - sr*2 + 0 = 0. -3, -1, 0 Solve -16/9s + 20/9s2 + 0 + 2/3s*3 = 0 for s. -4, 0, 2/3 Let j(r) be the first derivative of 3r4/4 + r3 - 15r2 + 24r - 100. Let j(o) = 0. What is o? -4, 1, 2 Factor 4/7u2 - 32/7 - 4u. 4(u - 8)(u + 1)/7 Let g(u) = -u. Let i be g(-4). Let r = -1907 - -1911. Factor 20a + 24a*2 + 16a*3 + r - 4a - 19a4 + 23a*i. 4(a + 1)*4 Let i(k) be the third derivative of -5k7/42 + k6/2 + 3k5 - 10k*4/3 + 196k*2. Let i(y) = 0. Calculate y. -2, 0, 2/5, 4 Factor -c - 6 - 6c*2 + 12 + 8c*3 + 5c - 12c. 2(c - 1)(c + 1)(4c - 3) Let d(o) be the first derivative of -o6/2160 + o4/36 + 2o*3/3 + 7. Let f(m) be the third derivative of d(m). Suppose f(i) = 0. What is i? -2, 2 Factor 18/7 + 38/7c + 22/7c2 + 2/7c*3. 2(c + 1)*2(c + 9)/7 Factor 32/3 - 16/3y2 + 32/3y - 32/3y3 - 2/3y*5 - 14/3y*4. -2(y - 1)(y + 2)4/3 Let l(m) be the third derivative of -m6/60 + 3m*5/10 - 2m*4/3 - 254m*2 - 1. Factor l(c). -2c(c - 8)(c - 1) Let q(g) = 12g + 3. Let z be q(0). Let t(o) be the third derivative of 0o - 1/21o4 + 0 - 8/21o*z - 1/420o*5 + 4o2. Factor t(d). -(d + 4)2/7 Let i(q) be the third derivative of -3q2 - 1/30q*6 + 1/8q*4 + 0q + 1/3q3 - 1/30q*5 + 0q*7 + 1/336q*8 + 0. Factor i(v). (v - 2)(v - 1)(v + 1)3 What is t in -16/3t*4 - 2/3t*5 + 16/3t*2 + 32/3t + 0 - 10t3 = 0? -4, -1, 0, 1 Let q(c) be the third derivative of c6/60 + 2c5/15 + c4/4 + 3c2 - 2. Factor q(v). 2v(v + 1)(v + 3) Let i(c) be the second derivative of c*5/110 - 2c4/33 - c3/3 + 30c2/11 - 323c. Factor i(y). 2(y - 5)(y - 2)(y + 3)/11 Let i be 15/(-20) - 253/(-92). Factor 9/4l*i + 1/4l*4 + 1/2 + 7/4l + 5/4l3. (l + 1)3(l + 2)/4 Let y(j) be the second derivative of 3j + 0 + 1/5j*5 - 2/3j*3 + 1/3j*6 + 0j*2 - 5/6j*4. Factor y(z). 2z(z - 1)(z + 1)(5z + 2) Let h(n) be the first derivative of 3n5/10 + 15n4/8 - n3/2 - 15n2/4 - 136. Let h(d) = 0. Calculate d. -5, -1, 0, 1 Let h be ((-104)/80 + 17 + -16)2-1. Factor 17/10t - h - 3/2t2 + 1/10t*4 + 3/10t3. (t - 1)3(t + 6)/10 Let m = 7954/4965 + -2/993. Solve 2/5x*2 + mx + 8/5 = 0. -2 Factor -7/2r3 + 15/2r*2 - 13/2r + 1/2r4 + 2. (r - 4)(r - 1)*3/2 Suppose 0 = -c + 2d + 12, 2d = -4c - 2d + 24. Let o be (-6 - -1)(-8)/c. Factor 4j3 - 10 - 4j*o + 10 + 2j*5 - 2j. -2j(j - 1)*2(j + 1)2 Factor -229 + 277 + i2 - 6i2 + 2i*2 - 45i. -3(i - 1)(i + 16) Factor 3/7v5 + 6/7v*3 - 9/7v*4 + 0v*2 + 0 + 0v. 3v3(v - 2)(v - 1)/7 Let c(g) be the first derivative of -g6/12 + g5/4 - 5g*4/24 - 14g - 26. Let w(p) be the first derivative of c(p). Factor w(s). -5s2(s - 1)2/2 Let v = -2 - 21. Let c = -21 - v. Factor s3 - s*3 + cs*2 - 8s*5 + 2s*3 - 6s*3 - 14s*4. -2s*2(s + 1)*2(4s - 1) Let h(k) be the third derivative of -k7/105 + 29k*6/60 - 9k*5/10 - 29k*4/12 + 28k*3/3 + 21k*2. Find j, given that h(j) = 0. -1, 1, 28 Let r = -2433 - -2433. Let w(o) be the second derivative of r - 3/2o*3 - 3/20o*5 + 0o2 + o4 + 9o. Factor w(x). -3x(x - 3)(x - 1) Let f(k) be the third derivative of 0 - 1/6k4 - 1/30k**5 +	{ "pile_set_name": "DM Mathematics" }
. 1097717 Simplify (sqrt(396) + (sqrt(396) - (sqrt(396) - (sqrt(396) + 2))) + 2 + 2 + 1)*2 + 0. 168sqrt(11) + 1633 Simplify -2-2(3 + ((sqrt(1900)3)2 + sqrt(1900) - sqrt(1900))). 68412 Simplify -5(-2 + (sqrt(2) - -61sqrt(2))) - ((1 + sqrt(200))2 + -3 + (sqrt(2) - sqrt(6)/sqrt(3))2). -188 - 55sqrt(2) Simplify (-3(-1 + ((-3sqrt(80))/sqrt(8) - sqrt(10))/((sqrt(45)3)/sqrt(9))))*2. 24sqrt(2) + 41 Simplify -4sqrt(96)/sqrt(8)212. -32sqrt(3) Simplify -1((-4 + sqrt(288))*2-6 + -5(sqrt(288) + -3)). -516sqrt(2) + 1809 Simplify (1(sqrt(275) - (sqrt(275)-1)2) - (-4 + (sqrt(176) + 0)2))1. -447 + 5sqrt(11) Simplify (3(sqrt(99) + -1sqrt(99) + sqrt(99))-4)/(sqrt(324)1-1). 2sqrt(11) Simplify (-5sqrt(1584))/(sqrt(4) - sqrt(32)/(sqrt(8) + sqrt(72))). -40sqrt(11) Simplify ((sqrt(1377) + 1)3 - sqrt(1377)12)2 + (1sqrt(68)1 + sqrt(68))/(sqrt(400) - (sqrt(400) - sqrt(400)-2 - sqrt(400))). 269sqrt(17)/5 + 1386 Simplify ((-5(sqrt(120) + -1sqrt(120)))/(sqrt(10) + sqrt(250)3))*2-5. 0 Simplify 6(5 + 2(sqrt(1900) + 0 + 0)). 30 + 120sqrt(19) Simplify -1((-1 + sqrt(1331))*2 + sqrt(1331)) + 3 - (sqrt(77)/(1sqrt(7)) - (-4 + sqrt(66)/sqrt(6) - sqrt(11))). -1333 + 10sqrt(11) Simplify ((-2(sqrt(72)-2 + sqrt(72)))/sqrt(8))/(sqrt(18)/(sqrt(6) + sqrt(24) - sqrt(6)) + sqrt(12)-5). -4sqrt(3)/19 Simplify ((-1sqrt(270))/(sqrt(96)-3))2 + -2 + sqrt(45)/((-1sqrt(27) - sqrt(27))/sqrt(3)). -27/16 - sqrt(5)/2 Simplify -2(6((sqrt(80) + 1 - sqrt(80)) + sqrt(80) - sqrt(80) - sqrt(80) - sqrt(80))*2 - (2 + sqrt(80))3) + -1. -3841 + 216sqrt(5) Simplify ((sqrt(72) - (sqrt(72) + sqrt(72) + -5 + (sqrt(72)2 - sqrt(72)) + sqrt(72) + sqrt(72))) + -4 + -1sqrt(72) + -5)2. 240sqrt(2) + 1816 Simplify (-2 + (3sqrt(2057) + 5 - sqrt(2057) - (sqrt(2057) + 2)1) + 0)*2. 22sqrt(17) + 2058 Simplify 3 + (sqrt(68) + sqrt(68) + 2 - sqrt(68))*2 + -5(-2 + sqrt(68)) + -4. -2sqrt(17) + 81 Simplify 23(1sqrt(75))*2 - (sqrt(75)23 + sqrt(75) + sqrt(75) + (sqrt(75) - sqrt(75)1)-4). -40sqrt(3) + 450 Simplify (-2sqrt(2057))25 - ((sqrt(1700) + 1)*2 + -5). -20sqrt(17) + 39444 Simplify 2(sqrt(180) + -2) + ((-2sqrt(5000))/sqrt(10))*2. 12sqrt(5) + 1996 Simplify ((sqrt(40) - (sqrt(40) - sqrt(280)/(sqrt(28)/sqrt(4))))/(sqrt(288) + sqrt(288)-6))2. 1/180 Simplify 3(sqrt(88)4)/sqrt(8) - -6(sqrt(396) + -5)*2. -348sqrt(11) + 2526 Simplify (-2(4 + sqrt(171) + (sqrt(171) + 0)-6 + sqrt(171)))*22. -768sqrt(19) + 22016 Simplify (sqrt(76) + (sqrt(76) - (sqrt(76) + sqrt(76) + 1 + sqrt(76) + 5)) - sqrt(76) - (-4 + 1sqrt(76)) - (-5 + (sqrt(95) + sqrt(95)-1)/sqrt(5)-4))*2. -36sqrt(19) + 693 Simplify ((sqrt(567)-2)/sqrt(9) - -1sqrt(2268))/((sqrt(108)/sqrt(4)-4)/sqrt(3)). -sqrt(7) Simplify ((sqrt(13) + sqrt(65)/(sqrt(5) - sqrt(5)-2))-2)2 - ((sqrt(13) - (1sqrt(156))/sqrt(12)) + -2 + (sqrt(13)-1)2 + sqrt(13)). -sqrt(13) + 733/9 Simplify -4 + 3(sqrt(5) - ((-1sqrt(30) - sqrt(30))/sqrt(6))2) - (sqrt(15)/(sqrt(3) + -3sqrt(3)) + sqrt(25)/sqrt(5)-4). -64 + 15sqrt(5)/2 Simplify (sqrt(342)/(2sqrt(9)-5))/((sqrt(14)-1)/sqrt(7) - (sqrt(242) + 1sqrt(242))). sqrt(19)/230 Simplify -1 + ((6(sqrt(450) + sqrt(18)))/(sqrt(54)/(sqrt(6) - (-2sqrt(6) + sqrt(6)))))*2. 10367 Simplify ((sqrt(66)2 - sqrt(66))-3 + (sqrt(66) + -2sqrt(66))-2)/(sqrt(294) + (sqrt(294)-1-4 - sqrt(294)) + sqrt(294)). -sqrt(11)/35 Simplify -4 + 3 + sqrt(136)/(sqrt(64)/(sqrt(8)2)). -1 + 2sqrt(17) Simplify (-4 + -2 + -4sqrt(68) + 3)*2. 48sqrt(17) + 1097 Simplify 4((0 + -4 + sqrt(343)2)-2)2-6. -133248 + 10752sqrt(7) Simplify -2 + -3-1sqrt(1053) + 4. 2 + 27sqrt(13) Simplify ((4 + sqrt(1300) + 1 - (sqrt(1300)2 + -2))-3)*2. -1260sqrt(13) + 12141 Simplify ((-5-2sqrt(104) + sqrt(104))4)/((sqrt(128) - (sqrt(128) - sqrt(128)-2))-1). 11sqrt(13)/2 Simplify (1(3 + 0 + 3(0 + sqrt(72)) + 4))*2. 252sqrt(2) + 697 Simplify (32sqrt(152) - (sqrt(152) + sqrt(152) + sqrt(152) + sqrt(152)1)-5)/(1sqrt(392)-1)-4. 104sqrt(19)/7 Simplify -32(sqrt(1900) - (sqrt(1900)-1 - sqrt(1900))2 - (4sqrt(152))/sqrt(8)). -36sqrt(19) + 45600 Simplify (((sqrt(1000) - ((sqrt(1000) + sqrt(1000)3 - sqrt(1000)) + sqrt(1000)))3 + sqrt(1000))/(sqrt(12)/(sqrt(42)/(3sqrt(7)) - sqrt(6))))2. 128000/9 Simplify (sqrt(76) + 1 - (-1 + sqrt(304)) - (-3 + sqrt(931) + -2))2. -126sqrt(19) + 1588 Simplify -5 + (2 + sqrt(11)2 - sqrt(77)/(sqrt(7)2 - sqrt(7))) + 5. 2 + sqrt(11) Simplify ((sqrt(504) + 31sqrt(504) + sqrt(504))/sqrt(12))/(sqrt(96) + (sqrt(96)-3 + sqrt(96))-1 + sqrt(96) + sqrt(96)). sqrt(7)/4 Simplify ((5sqrt(63))*2 - (sqrt(1008) + sqrt(1008)-1 + sqrt(1008))*2 - 1(sqrt(1008) + -2 + sqrt(1008))) + -5. -24sqrt(7) + 564 Simplify (sqrt(99)22 + 3(sqrt(99) + -2sqrt(99)) + sqrt(99))/(sqrt(72)/(sqrt(24)/(sqrt(3)3))). 2sqrt(11)/3 Simplify (-2 + ((sqrt(135) - (sqrt(135)-1 - sqrt(135)) - sqrt(135))/sqrt(9))/(1sqrt(3)3))*2. -8sqrt(5)/3 + 56/9 Simplify (sqrt(130) + sqrt(130)32)/sqrt(10) - (2 + (sqrt(91)3)/sqrt(7))2. -121 - 5sqrt(13) Simplify ((1sqrt(240))/sqrt(10) + (sqrt(264)/(2sqrt(11)) - sqrt(24)))/(sqrt(24)/(sqrt(6)/sqrt(2)) + sqrt(8) + -4sqrt(128) + sqrt(8)). -sqrt(3)/26 Simplify ((-5(-2sqrt(153) + sqrt(153))3)/(sqrt(1089) - (12sqrt(1089) - sqrt(1089)) - sqrt(1089)))*2. 3825/121 Simplify 6(sqrt(5) + -2sqrt(5) + sqrt(5) + 5 + sqrt(5) + sqrt(605) + 3)2. 1152sqrt(5) + 4704 Simplify ((-3sqrt(50)2)/(sqrt(70)/sqrt(7)6))2. 5 Simplify sqrt(1100) + 0 + sqrt(1100) + -3 + sqrt(1100) - sqrt(1100) - sqrt(110)/(-2sqrt(1440) + sqrt(10)). -3 + 461sqrt(11)/23 Simplify (sqrt(12)/(sqrt(33)/(1sqrt(11))))/(-3-1sqrt(2)-6). -sqrt(2)/18 Simplify ((sqrt(504) + (sqrt(504) - -1sqrt(504) - sqrt(504)))-3)/(4sqrt(2)4-6). 3sqrt(7)/8 Simplify 3 + (((sqrt(85)1 - sqrt(85))-6 - sqrt(85))-4)/(sqrt(405) - (sqrt(405)1-3 - sqrt(405))). 4sqrt(17)/45 + 3 Simplify (3 + sqrt(4212)-2 + 4 + (sqrt(4212) - (1 + sqrt(4212))) + -2)*25. -1440sqrt(13) + 84320 Simplify (-5 + (sqrt(605) - -2sqrt(605)-3 - 3sqrt(45)-2))2. 370sqrt(5) + 6870 Simplify sqrt(209)/(sqrt(110)/(sqrt(10) - (sqrt(10) - sqrt(20)/sqrt(2)))) + -52sqrt(19) + (-4 + (sqrt(19) - sqrt(19)3))2. 7sqrt(19) + 92 Simplify (sqrt(539) + sqrt(539) + (sqrt(539) + -2)-6)2 + 2 - (-5(sqrt(539) - sqrt(539)2) + (sqrt(539) - (2 + (sqrt(539) + 0)2))). -714sqrt(11) + 9311 Simplify -4((sqrt(28) + sqrt(84)/sqrt(3) + 4 + sqrt(28) - sqrt(28) - sqrt(28)) + 4 + 4(-4 + (sqrt(28) - sqrt(56)/sqrt(2))))*2. -368 + 128sqrt(7) Simplify (((sqrt(76) + sqrt(76)1)4)/(sqrt(4)14) - (5 + (sqrt(133)-1)/sqrt(7) + 2))2. -42sqrt(19) + 220 Simplify ((-3 + 2 + sqrt(325))*2 + sqrt(325) - -5(sqrt(325) + -1))3. 60sqrt(13) + 963 Simplify ((sqrt(832) - -4(sqrt(832)-1 - sqrt(832)) - 2(sqrt(832) + -1)) + -5 + (sqrt(832) - -1sqrt(832)) + -1)*2 + 2. 448sqrt(13) + 40786 Simplify 1(-1 + sqrt(252))2 - (-4sqrt(343)1 - (-1 + -2sqrt(343) + sqrt(343)))*2. -2835 + 30sqrt(7) Simplify -2 + 0 + (1sqrt(1573))2 + (-6sqrt(1573)2 + -2 + 0 + sqrt(1573))2. 484sqrt(13) + 191908 Simplify 2(sqrt(242) + 1) - (sqrt(242) + -2 + sqrt(242) + -5)2 - (5 + 1sqrt(242))3. -1030 + 297sqrt(2) Simplify -4 + 0 + sqrt(208) - (1 + (3sqrt(26)/sqrt(2))2). -122 + 4sqrt(13) Simplify (-4 + 1 + sqrt(242)-1 + -1sqrt(8))*2. 78sqrt(2) + 347 Simplify -4 + ((4 + sqrt(17) + 1 - sqrt(17))*2 - sqrt(816)/sqrt(3)). -4sqrt(17) + 21 Simplify ((sqrt(528) - 4sqrt(528))-3)/(4(sqrt(12) + sqrt(12) + 3sqrt(12)))3. 27sqrt(11)/10 Simplify -3-3((5sqrt(99)1)/(sqrt(9)-1-3))*2. 275 Simplify 5 + ((1sqrt(72) - sqrt(72))/sqrt(4))/(sqrt(6) - -5sqrt(294)). 5 Simplify (-3 + -2sqrt(13))*233 - ((sqrt(13) - 1sqrt(117)) + -2 + sqrt(468))*2. 337 + 124sqrt(13) Simplify (((sqrt(336) - (sqrt(336) - (sqrt(336) - (sqrt(336) - sqrt(336)-1))))/sqrt(8)6)/(5-2sqrt(96)))*2. 63/400 Simplify (-1sqrt(190)-1-1)/(((sqrt(10) - sqrt(40))-3 + sqrt(10) - sqrt(10)) + sqrt(360)2). -sqrt(19)/15 Simplify (-3(sqrt(17) + 0)4 + -3 + -2sqrt(17) + -1)2. 112sqrt(17) + 3348 Simplify 1((sqrt(44) + -5 + sqrt(132)/sqrt(3))2 + sqrt(132)/(1sqrt(12)) + -1 + (sqrt(11) + 2 - sqrt(11))). -39sqrt(11) + 202 Simplify -4sq	{ "pile_set_name": "DM Mathematics" }
- 2p)(-1 + 0 + 3) + 48p - 71p + 2 + 0. -26p + 2 Expand (2j + 2j3 - 2j)(-1 - 3j + 1 + 12j - 2 + 2 + (3j + 0j - 2j)(-1 - 2 + 2) + j + 0 + 0)(0 + 5 + 0). 90j4 Expand (2 - 15p*2 + 9p*2 - 3)(10 - 27 - 26). 258p2 + 43 Expand (-8q*2 - 6q*2 + 8q*2)(-2q - q + q)(-29 - 23 + 28). -288q3 Expand (13 - 28 + 7)(4 - 4 - 3j2) + (0j + 0j - j)(0j + 0j - 2j). 26j*2 Expand 2k + 0k - k + 1 + 20k - 5k - 8k - 2k + 3k - 2k + 2k + 2 - 2 + 4k - 6k + 0k + (k + 0k + k)(1 - 2 + 0) - 4k + k + k + 3k + 3k - 5k. 4k + 1 Expand (8 + 1 + 10)(0 + 2 - 4)(3n - n + n) + 2n - 4n + 3n. -113n Expand (14t2 - t4 - 13t2 - 3t*2)(12 + t - 12). -t*5 - 2t*3 Expand (-2 + 5a*2 - 3a*2 + 3)(2 - 1 - 2) - 7a2 + 21a*2 + 13a*2. 25a*2 - 1 Expand (-2p*4 + 2p4 + p4)(-184 + 293 + 200) - 3 + 3 + 2p*4. 311p*4 Expand (-g + 6g - 3g - 5g + g + 2g + (-2g + g - g)(7 - 3 - 2) - 2 + 2 - g - 2 + 2 - g)(4512 - 4512 + 81g). -486g*2 Expand (3b - 2b - 2b)(0b - 5b + 4b) - 4b2 + 0b*2 - 1 + 8b*2. 5b*2 - 1 Expand 0y + 0y - y2 + (-4 - 2y*2 + 4)(-25 - 15 + 146). -213y2 Expand (0 - 1 - 3c + 2c)(-88c2 + 159c*2 - 90c*2). 19c*3 + 19c*2 Expand (-302y - 972y + 296y)(5 - 3 + 0). -1956y Expand -1 - y*2 + 1 + (4y + y - 3y)(-y - y + y) + 119y2 + 278y - 278y + y2 + 3y*2 - 2y2 - y2 - 4y2 + 4y*2. 117y*2 Expand -31c + 31c + 12c4 + c - c4 - c + (c + 4 - 4)(-2c*3 - 3c + 3c) + 0c + 0c + 8c*4. 17c*4 Expand (n + 3n - n + (5n - 2n - 2n)(1 + 1 - 1))(7n*2 - 4n*2 - 2n*2) + 14n*2 + 6n*3 - 14n*2. 10n*3 Expand 4p2 + p3 - 4p2 + (-2p*2 - 2p*2 + 5p*2)(-4 + 4 + p) + 2p3 - 1201p + 7p2 + 1202p + 0p3. 4p*3 + 7p*2 + p Expand (27p*3 + 4p - 6p - 34p*3)(2p + 0p - 5p). 21p*4 + 6p2 Expand (n3 - 3n3 + 0n*3)(242 - 489 + 248). -2n3 Expand (1 - 1 + 2b*3)(-121b2 + 104b*2 + 304b*2). 574b*5 Expand (9l + 14l - 4l)(2l*4 - 3l*4 + l - 2l). -19l5 - 19l2 Expand (-h2 + h*2 - 2h*3 + (2h*2 - 2 + 2)(-2h - h + 5h))((3 + 1 + 11)(0h + 4h - 5h) + 0h + h + 0h). -28h*4 Expand (920x*2 - 1536x*2 + 1194x*2)(-4x3 + 2x3 + x3). -578x5 Expand (2x - 2x - 5x*2)(2x - 26x + 4x). 100x*3 Expand (-2i + 6i - 2i)(25 - i - 25) + 2731i + 54i2 - 2731i + i*2 - 3i2 + i2. 51i2 Expand (-1 + 0 - 2x + 3)(621 - 328 - 340)(x + 0x - 3x). -188x2 + 188x Expand (-n - 2n + 4n)(-4n + 0n + 5n)(25 - 19 - 19 + 1 - 4 - 1 + (-1 + 5 - 2)(2 - 1 + 0) + 0 - 5 + 4). -16n2 Expand (-u4 - 3u4 - u4)(1 - 3 - 1)(5 - 5 + 20)(2 - 2 - 2). -600u*4 Expand (-2l*3 - 5l*3 + 2l*3)(0l + l + l)(0 + 1 + 2). -30l4 Expand (-1 + 3 + 1)(-3a2 + 7a*2 + 2a2) - a2 + a*2 + 7a*2. 25a*2 Expand ((2 + 0 - 1)(5b - 4b + b) + 3b - b - 4b + (0b - b + 3b)(3 - 2 - 2) + 761b - 376b - 517b)(2 - 4 - 9). 1474b Expand 139 - 139 + 12l3 + (-3l + 3l - 3l)(l2 - 5l*2 + 2l*2). 18l*3 Expand (1 - 3z - 1)(z - 3 + 3) - 60 - 66z*2 + 121 - 60. -69z*2 + 1 Expand (-4c*3 + 3c*3 + 2c*3 - 3c3 + c3 + 3c3 + 3c3 - c3 - 3c3 + (-5c - c + 3c)(3c2 + 0c2 - c2))(-19 + 20c + 19). -100c4 Expand (3 - 21 - 1)(189s3 - 52s*3 - 73s*3). -1216s*3 Expand (-75 - 78 + 19)(w5 + w5 - w*5). -134w*5 Expand ((4 - 1 - 5)(b - 3b + b) + 4 + 17b - 7b - 9b)(-4 + 3 + 3)(b + 2 - 2). 6b2 + 8b Expand (r + 2r - r)(0 + 1 + 1) - 4473r + 3070r + 2974r. 1575r Expand (1 + 1 - 7)(-3h - 2h + 2h) + (4 + 0 + 10)(2 + 0 - 3)(-h + 2h + h). -13h Expand (-2j + 6j + 2j2 + j)(4j3 + 796j - 796j). 8j*5 + 20j*4 Expand (-19 - 68 + 21)(-6c2 + 2c2 + c2)(0c + c - 3c). -396c*3 Expand (-2n + 2n + n)(-7n + 6n + 11n) - n2 + 2n2 + n2. 12n2 Expand (8l - 39l - 3l)(-7l*2 + 7l*2 + 5l*3 + (5l - 3l - l)(-1 - 2l2 + 1) + l3 - l3 - 2l*3). -34l*4 Expand (2v + v + v)((0 + 2v + 0)(-2 - 1 + 2) + 0v + 5v - 2v + (v - 6v + 2v)(2 + 1 - 5))(0 + 0 - 2). -56v2 Expand 2q*3 + 0q*3 - 3q*3 + (2q + 2q - 2q)(-q + q + q2) + (-5 + 1 - 2)(3q2 - 3q*2 - 2q*3). 13q*3 Expand (-70m + 27m + 27m)((-3m*3 + 3m3 - m4)(3 - 2 - 2) - 2m*4 + 3m*4 - 4m*4). 32m*5 Expand (-7 + 2 + 2)(5 - 9 + 2)(2n + 2n - 5n)(-2 - 1 + 2). 6n Expand (6t - 14 + 14)(-2 - 2 + 2)(0 + 0 - 3). 36t Expand (-6104k - 6095k + 12188k - 2)(-k*2 + 0k*2 + 2k2 + k2 - 3 + 3 + (2k + 3 - 3)(k - 2k + 2k) - 4k + 4k - k*2). -33k*3 - 6k*2 Expand ((-6z*3 + 2z3 - z3)(3 + 1 - 5) + 0z*3 + 0z*3 + 2z*3)(-z - 540z2 + 534z*2 + 5z). -42z5 + 28z*4 Expand -17d*2 + 23d*2 - 4d*2 + 25d*3 + (3d*2 - 3d*2 + 2d*3)(4 - 4 + 2). 29d3 + 2d*2 Expand (-13h*2 + 10h*2 + 22h*2)(2 - 3h - 2)(0 + 1 + 0h2 - 2h*2). 114h*5 - 57h*3 Expand 14o*2 + 4o*2 + 13o*2 + (0o - o + 2o)(4o - 4o - o) + 6o2 - 5o*2 - 2o*2 + (-2o - 3o + 4o)(0o - 4o + o). 32o*2 Expand (-8z + 1175 - 1175)(10z*4 + 8z*4 - 3z*4). -120z*5 Expand 3 + 9y*2 + 3 - 9 + (-y - y + 0y)(-4y - 3y + 5y) + y*2 - 3y + 3y. 14y*2 - 3 Expand (0x + 6x - 4x)(-6x - 2x + 5x)((2x*2 + 2x*2 - 2x*2)(0x + x + x) + 13x*3 - 14x*3 + 20x*3). -138x*5 Expand (7n*4 + 2n4 - n4)(-n + n + n)(3 - 2 - 6). -40n5 Expand (0s + 3s - 2s)(8 - 11 + 18)(2 - 2 + s*2). 15s*3 Expand -7o + 4o + 4o + (-1 + 2 - 3)(-1 + o + 1) + 2o - 1 + 1 + 43o + 13o + 8o. 65o Expand (0h2 + 5 + h2 - 6)(174h2 + 130h*2 - 247h*2). 57h*4 - 57h*2 Expand -8m*5 - 9m*4 + 9m4 + (1 - m4 - 1)(-51m - 19m - 27m). 89m5 Expand (-3f + f + 8f)(98f - 29f*3 - 98f). -174f4 Expand (-2p*2 - 4390 + 4463 + 3p*2)(-3p + 0p + p)(-3p + p + p). 2p4 + 146p*2 Expand (-1422 + 1675 + 1793 + 161)(1 - 1 - 2f2). -4414f*2 Expand 0n*4 + 2n*5 - 9n*2 + 8n*4 - 7n*4 + (3n2 + n4 - 3n2)(n - 3n - n). -n5 + n4 - 9n*2 Expand -123u + 51u - 69u + (0 + 2u + 0)(5 - 3 - 4). -145u Expand (2 + 4d - 2)(4 + 1 - 2) + (-2d + 9d - d)(2 + 1 + 0). 30d Expand 32r*3 - 22r*2 - 35r3 + r4 - 2r2 + (-2r - 5r + 5r)(-r2 + r2 + r3). -r4 - 3r*3 - 24r*2 Expand (-169 - 155 + 191)(-18s - 14s + 37s) + 2 + 2s - 2. -663s Expand (-15 + 4q3 - q3 + 32)(-1 - 5q*2 + 1). -15q*5 - 85q*2 Expand 0y*3 + 3y3 - y3 + (-2y2 + 0y*2 + 0y*2)(0y + 4y - 6y) + y3 - 2y3 - y3 - 126y3 - 197y*3 - 65y*3. -384y*3 Expand 5 - 5 + 15g - 1 + 1 - 2g + (-5g + 4g - g)(-2 + 2 + 2) - 2 + 2g + 2 + 4g - 2g - 4g + 96g - 99g + 81g. 87g Expand (-13k + 2 - 1 - 2)(7 - 40 - 8) + (2k - k + 0k)(-3 - 3 + 4). 531k + 41 Expand (91 - 435q + 437q + 93)(2q - 2q - 4q*3). -8q*4 - 736q*3 Expand (-3 + 1 + 0 + 0 + 1 + 1 + (-5 - 4 + 2)(2 + 0 + 0) + 1 + 1 - 1)(2 + 2m - 2)(2 - 2 - m). 26m*2 Expand -8c*5 - 7c*5 - 3c*5 + (2c*2 - 3c*3 - 2c*2)(-c*2 - 2c2 + c2) + (c*4 - 2c*2 + 2c*2)(c - 3c + 4c). -10c5 Expand (1 + 0 + 1)(-1 + 0 - 7)(4h + 2 + 0 - 4). -64h + 32 Expand h4 - 2 + 0 + h4 + (-28h*2 - 21h*2 + 9h*2)(h*2 + 4h*2 - 6h*2 + (-2 + 2 - h)(-3h - h + 6h)). 122h4 - 2 Expand -25q*3 + 5q*3 + 4q*3 + (-2q*2 - 2q*2 + 3q*2)(-4 + 4 - 4q). -12q*3 Expand -5x*5 - 10x*5 - 14x*5 + (1 - 6x - 1)(-5x*4 + 2x*4 + 0x*4). -11x5 Expand (-j3 - 4j3 + 3j*3)(-2 + 2j + 2 + (-1 + 4 - 5)(-2j + 2j + 2j) + 0j - j - j)(36 - 52 - 33) - 3j - 2j4 + 3j. -394j4 Expand (4i + 2i - 4i)(57 + 38 - 2) - 4i + 0i + i + (0 + 0 + 2)(-1 + 1 + 2i) + 7i - 2i - 3i. 189i Expand w4 - w5 - w4 + (-4w*3 + 4w3 + w3)(w2 + w2 - 5w*2) - 95w*2 - 148727w - 4w5 + 148727w. -8w5 - 95w*2 Expand (1 + 8 - 1 + (-1 - 2 + 1)(-4 + 6 + 1) + 0 - 1 + 0)(45y - 12 - 9 + 22). 45y + 1 Expand (200 + 504 - 352 + 213)(2a4 - 3a*4 - 3a*4). -2260a*4 Expand -160u - 1 - 480u - 89u - 3u + (u + 0u - 2u)(-3 + 0 + 2). -731*u - 1 Expand h + 1	{ "pile_set_name": "DM Mathematics" }
c What is the third biggest value in 0.1, 51.5, -0.4? -0.4 Which is the fourth smallest value? (a) -3 (b) -5 (c) 9 (d) 48 (e) -1/2 c What is the fifth smallest value in 2, -25, 7, 1/2, -0.4? 7 What is the third smallest value in -15/2, -0.18, -2/5, -0.3? -0.3 Which is the biggest value? (a) 1 (b) -5 (c) -85/7 (d) -1/2 a What is the smallest value in 3, -0.72, 5, -0.5, -0.02? -0.72 What is the third smallest value in -5, 5, 1/11, -0.2? 1/11 What is the third smallest value in 2, 2.3, -18? 2.3 Which is the second smallest value? (a) -7 (b) -4 (c) -0.7 (d) 2/9 (e) -0.06 b What is the third biggest value in 21, -9, 0.017, -5? -5 What is the second smallest value in 0, 364/25, 5? 5 What is the second biggest value in -1/4, -18, -2? -2 What is the third biggest value in 71, 16, 1/4? 1/4 What is the fourth smallest value in 333, 5, 4/7, 1? 333 What is the second smallest value in -1, 2, 4/47, 17? 4/47 What is the third smallest value in 114, 0.1, -15? 114 What is the second biggest value in -5, 4, -0.4? -0.4 Which is the third biggest value? (a) -173 (b) 0 (c) -0.2 a Which is the second biggest value? (a) 1/3 (b) 4 (c) -151 (d) 0 a Which is the biggest value? (a) 4/3 (b) 1/2 (c) 0.03 (d) 4 d Which is the fifth biggest value? (a) -0.3 (b) 3 (c) -3 (d) 0 (e) -4 e Which is the second biggest value? (a) 0.2 (b) 73/15 (c) 1 c Which is the smallest value? (a) -16/7 (b) 4 (c) -16 (d) 2/13 c Which is the fourth biggest value? (a) 2 (b) 10 (c) -1/9 (d) 0.4 c Which is the fourth biggest value? (a) 4 (b) 2/11 (c) 11 (d) -3.5 d Which is the biggest value? (a) -1/15 (b) 0.3 (c) -4 b What is the biggest value in -3, -111/2, -0.3, -0.4? -0.3 Which is the biggest value? (a) -3 (b) 3/7 (c) 2/15 (d) 1/4 (e) -3/8 b What is the third smallest value in -2/5, -5, 0? 0 Which is the biggest value? (a) 2/21 (b) -9/5 (c) -2/3 (d) -35 a What is the biggest value in 0, -3/7, -2? 0 Which is the biggest value? (a) -4 (b) 0.35 (c) 8 c Which is the smallest value? (a) -1 (b) 2/9 (c) -5 (d) -3 c Which is the second biggest value? (a) -4.38 (b) 4 (c) 11 b What is the second smallest value in 1/5, -5, -0.17? -0.17 Which is the third smallest value? (a) -2 (b) 27 (c) -0.02 (d) 0.1 d What is the biggest value in 1842, 5, -0.5? 1842 What is the smallest value in -0.4, -1, 27? -1 What is the third smallest value in 1/5, 1/11, -383? 1/5 Which is the biggest value? (a) 0.839 (b) 5 (c) -2/7 b What is the fifth smallest value in 0.5, -3, 0.3, 0.6, -4? 0.6 Which is the fourth biggest value? (a) -105.7 (b) -3 (c) -5/3 (d) -0.5 a What is the fifth biggest value in 4, -4, -0.3, -3, 4/7? -4 Which is the second smallest value? (a) -2/17 (b) 0.09 (c) -3 a Which is the smallest value? (a) 4/7 (b) -10 (c) -1 (d) -0.14 b What is the fourth smallest value in -3, -3/4, -0.4, 45? 45 What is the second smallest value in 1/4, 1, -18, -17? -17 What is the biggest value in 4, 1.6, -17, 0, -1/7? 4 Which is the second smallest value? (a) 3 (b) -1/4 (c) 0.09 (d) -0.5 b Which is the smallest value? (a) 5 (b) -266 (c) 14 b What is the second smallest value in -6, -2/5, 1? -2/5 What is the third biggest value in 0.5, 1/6, 0.3, -2, 0.65? 0.3 What is the third biggest value in 19, 0.3, 1/5, 6? 0.3 What is the smallest value in -0.2, -3, 8? -3 Which is the fifth smallest value? (a) -0.1 (b) -30 (c) -2 (d) 6/13 (e) -3 d What is the fourth biggest value in 3, -0.1, 0.2, -6, 1/43? -0.1 Which is the third biggest value? (a) -43 (b) -3 (c) 7/5 a What is the second smallest value in -3/2, -407, -0.3? -3/2 Which is the second smallest value? (a) -2/41 (b) -5 (c) 5 a What is the fifth smallest value in 10/7, -5, -0.4, -1, 1/6? 10/7 What is the second biggest value in -2/5, 243, -2/9, 4? 4 What is the second biggest value in -1, 59, -2? -1 What is the biggest value in -0.136, 1/3, 3, 5, -3? 5 Which is the second smallest value? (a) 1.25 (b) 1 (c) -5 b What is the smallest value in 0.122, 3, 7/2? 0.122 Which is the second smallest value? (a) 1 (b) 2/11 (c) 0.2 c What is the third biggest value in 4, -1, 0.1, -1/29? -1/29 What is the smallest value in 3, 33, 0.2? 0.2 What is the second biggest value in -2/9, 0.2, -556? -2/9 What is the third biggest value in -640, 4, -0.3, -4, 0.02? -0.3 Which is the smallest value? (a) 5 (b) -1086 (c) -2/13 b Which is the fourth biggest value? (a) 2/5 (b) 6/7 (c) -5 (d) -0.073 (e) 3/8 d Which is the second biggest value? (a) 1 (b) 1125/7 (c) -0.5 a What is the fourth smallest value in 6, 1/2, 2/5, -4? 6 Which is the third smallest value? (a) 8 (b) 0 (c) 3/2 (d) 5 d Which is the second biggest value? (a) -4 (b) 1/29 (c) 0.06 (d) 2 (e) -2/7 c What is the second biggest value in -33.2, 0.1, -0.5? -0.5 Which is the fourth smallest value? (a) -1 (b) 2/9 (c) -4 (d) -150/11 b Which is the third smallest value? (a) 1/8 (b) -2/97 (c) 4 (d) 0.3 d What is the biggest value in 3, 0, 461? 461 What is the second biggest value in 1/4, 0.4, 0.5, -0.3? 0.4 Which is the second smallest value? (a) -0.3 (b) -1/6 (c) 71 b What is the fifth biggest value in -0.3, 1.6, -1, -0.02, 3? -1 What is the fourth biggest value in -32, 1/12, 3, -1/3, -0.2? -1/3 What is the second smallest value in 1, 99, -3? 1 Which is the second smallest value? (a) -5 (b) -315 (c) -4 a Which is the smallest value? (a) 2 (b) -101 (c) -5 (d) -2 (e) 0.3 b Which is the fifth biggest value? (a) -1 (b) 1/4 (c) -92 (d) 7 (e) -2/21 c Which is the smallest value? (a) -10 (b) 3 (c) 3/2 a What is the third biggest value in 0.21, 0, -2, -2/3, 5? 0 Which is the third smallest value? (a) 2/11 (b) 0.5 (c) -0.5 (d) -5/3 a What is the smallest value in -4, 4, 1.6, -1? -4 Which is the smallest value? (a) 85 (b) 8 (c) -1/4 (d) 0.3 c Which is the biggest value? (a) -12 (b) 4 (c) -2 b What is the fourth smallest value in 2/9, 0.4, -0.21, -0.3? 0.4 What is the biggest value in -0.3, 20, -0.1, -2? 20 What is the smallest value in -0.3, 2, 1.13? -0.3 Which is the third smallest value? (a) 3 (b) 0 (c) -362 (d) -5 b What is the biggest value in -1/4, 0.01, -1/2? 0.01 Which is the fourth smallest value? (a) 1 (b) -3 (c) -1 (d) -5 (e) 0.3 e Which is the second smallest value? (a) -2/31 (b) 2/3 (c) 0.2 c What is the third smallest value in -4/11, 5, 0? 5 What is the fourth biggest value in 3/4, 6, -1/2, 31? -1/2 What is the biggest value in -3/2, -1, -0.1, 0, -0.4? 0 What is the fourth biggest value in 0.1, 0.5, 0.28, -2/9? -2/9 Which is the second biggest value? (a) 1/16 (b) -0.031 (c) 2 a Which is the third biggest value? (a) -0.3 (b) -2/9 (c) 0.61 (d) -7 a Which is the second biggest value? (a) -3/7 (b) 271 (c) -0.2 c Which is the second smallest value? (a) -2 (b) 3/4 (c) 4/5 b Which is the biggest value? (a) -4 (b) 0.2 (c) 3 (d) -44 c Which is the third smallest value? (a) 4 (b) 0.1 (c) -19 a What is the fourth biggest value in 0.5, -0.1, -16/7, 4? -16/7 What is the biggest value in 0, 0.1, 0.3, -2/259? 0.3 What is the third biggest value in 0.5, 27, 1/8? 1/8 Which is the second biggest value? (a) 882 (b) -4 (c) -3 c What is the third biggest value in 4/5, 1, 2433/4, 0.4? 4/5 What is the third biggest value in -4/3, 0.21, 4, 1.5? 0.21 Which is the third smallest value? (a) -3 (b) 4 (c) 3 (d) -0.3 c What is the second biggest value in -1, -2/13, 20, 2, 5? 5 What is the third smallest value in 0.4, 0, 0.033, 3? 0.4 What is the third biggest value in 3/4, -23, 5, -4? -4 What is the fourth biggest value in -0.1, 2/21, -1/2, -12/13? -12/13 What is the third biggest value in 4, 16, 1/307? 1/307 What is the second smallest value in 2/5, -4, -341? -4 What is the fourth biggest value in -2/19, 3/5, -81, -6? -81 What is the third biggest value in 3/4, 15, 5/3, -2/3, 4? 5/3 What is the second biggest value in -5, -15, 5? -5 Which is the third biggest value? (a) 3 (b) -5 (c) -4/5 (d) 2.76 c Which is the third smallest value? (a) -0.3 (b) -1/5 (c) 1 (d) -2 b What is the fourth biggest value in -152, -6, -0.5, -4? -152 What is the third smallest value in -6, 5/2, -0.4? 5/2 What is the smallest value in -0.4, 2/7, 2/11? -0.4 What is the fourth smallest value in -3,	{ "pile_set_name": "DM Mathematics" }
Evaluate 71/(-710) + 4/40. 0 (-19608)/(-688)(-3)/(9/2) -19 Calculate 66/(-11)(130/(-380))/(-13). -3/19 What is 908/(-1589)(567/6)/(-3)? 18 What is 380 - 381 - 18/2? -10 Evaluate ((-66)/275)/(1(-4 - (-88)/20)). -3/5 Evaluate -1 - (-1 - 12/88). 3/22 Calculate ((-9 + 13)/12)/(8 + 2235/(-279)). -31 ((-11832)/850 - -14) + (-233)/100 -9/4 What is (-5984)/308 + -26 + 42? -24/7 Evaluate 14 + -4 - 3 - (-2295)/(-330). 1/22 What is the value of 212599/(-1069926)-26 - (-2)/(-11) - 5? -2/129 Calculate (((-18)/(-21))/3)/(436/763). 1/2 What is -6 - (170288/(-27608) - 2/17)? 2/7 Calculate (40/(-160))/(10/25). -5/8 What is (-7)/10(-582)/679? 3/5 Evaluate (-16 + -2)/((-4)/26 + 1540/715). -9 Evaluate 0 - 18/144-2. 1/4 What is the value of (13/13)/(26/598)? 23 What is the value of 45/21 + 4884/(-8316)? 14/9 What is the value of ((-14)/168)/(13/26)? -1/6 Calculate (-60)/(-50)(-15)/(-8). 9/4 What is 107/8 + (-6)/5 + (-5544)/(-6720)? 13 What is the value of (25/650)/(3/(-6))? -1/13 Evaluate (2/(-1))/((-75)/((-49725)/(-102))). 13 Calculate ((21 - 16) + (-3)/((-9)/(-11)))3. 4 What is ((-4)/(-18))/((-4)/96) + (-180)/(-36)? -1/3 (58/232)/((-22)/48) -6/11 What is (16/(-272))/(24/(-68))? 1/6 What is (99/(-594))/((-1)/(-3))122? -12 What is the value of 18 + 0 + -20 - 15/(-21)? -9/7 What is the value of -13 - (834/(-36) - -10)? 1/6 What is the value of (-24)/96(15/20 - 82/152)? -1/19 Calculate (-4)/22 + (-2489)/(-77) + 474/553. 33 What is -1(11 + -27)/256? 1/16 Evaluate ((-1)/(-2))/(-28 + 837/30). -5 Calculate (-166180)/(-4620) + 5/165 + 0. 36 Calculate 25/35 + ((222/56)/(-1) - -2). -5/4 What is -8 + 0 - (-1872)/117? 8 What is (-1836)/189 + (-4)/14? -10 What is the value of ((-18)/351)/((-14)/1183)? 13/3 Evaluate 2 - (54/15)/((-4)/(-40)4). -7 What is the value of (18(-110)/528)/(3/2)? -5/2 Calculate (-1020)/(-136) + 1/2. 8 (((-4)/(-8))/((-8)/368))/(2 + -1) -23 What is (11 + 654/(-60))(-3 + 15)? 6/5 What is (-40)/(-200) + 83/(-15) - -5? -1/3 Calculate (3/(-2) - 14/(-8)) + 52/(-104). -1/4 Calculate 25/(-6) - (-140)/3014/56. -3 Evaluate (198/(-77))/((-108)/(-42) + -3). 6 (-8)/48 + (-350)/(-588) 3/7 Calculate (-4)/24 + (-21)/(-1512)39. 3/8 What is the value of (-37 - -31)/((2/(-4))/((-259)/111))? -28 Calculate (-27 - 1764/(-72))/((-1)/(-4)). -10 Calculate 12 - 10729/630. 3/7 What is the value of (-10)/45 + (-37)/(-1665)? -1/5 What is 6-1 + (-19 - (-29632)/1184)? 1/37 What is (((-64)/(-260))/(-8))/(1518/110 + -13)? -1/26 What is the value of ((-39)/52)/(198/48)(-1)/2? 1/11 (0 + -3)/(40 + -9 - 9) -3/22 What is the value of 54/(-1593) - (-1551)/(-1239)? -9/7 Calculate ((-176)/77)/162/(48/(-126)). 3/4 Evaluate (-2555)/3212 + (-30)/66. -5/4 Calculate -6 + 91/((-3367)/444). -18 ((-21)/(-35))/((-135)/(-1275)) 17/3 What is ((-3)/4 + 1)/(882/392)? 1/9 Evaluate 26 - (12 - -10 - 8). 12 Evaluate (-180)/54 - ((-55)/66 + 2/(-4)). -2 What is the value of -28 - -40 - (-316)/(-26)? -2/13 What is 4-6(-9)/(-54) - -8? 4 13(-6 + -10 + 17)/(-11) -13 What is 0 - (2/(-30) + 56/240)? -1/6 What is the value of 88/6942/1727? 8 What is the value of (-7314)/4081 + 12/33? -10/7 Calculate (-124)/(-144) + 20/(-180). 3/4 What is 432/(-44) - (105/33 - 3)? -10 What is (-382 - -389) + 2/2-2? 5 (-363)/(-24) - (-1)/(-8) 15 Evaluate 43/6149-26(-6)/(-4). -3/11 Evaluate (-528)/220(-15)/63. 4/7 Evaluate (-54)/21 + 198/(-462). -3 ((-4)/12)/(2 + (-770)/390) -13 ((-360)/(-156))/(51/(-442)) -20 What is the value of (5/4 - 0)(-972)/4860? -1/4 Evaluate (52/(-117))/(7/((-5)/((-300)/(-54)))). 2/35 Calculate ((-5600)/84)/40 - 335/(-195). 2/39 What is the value of 19/91 + (18/63)/2-2? -1/13 What is the value of (7 - (-2 - -3)) + 1624/(-261)? -2/9 Calculate ((-12)/18)/(7/((-420)/48)). 5/6 Calculate 66/15(37/36 + 182/819). 11/2 7/(-4) - 4453/(-1708) 6/7 Calculate -53 + 3360/63 + 4/(24/(-26)). -4 What is (6/12 - -4)35/2205? 1/14 (-3 + -65)21/42(-1)/(-2) -17 Calculate (-159)/(-212) + (66/(-8))/(-3). 7/2 Calculate 10/15-3 - (35 - 11)/8. -5 What is (165/(-3795))/(1/(-69))? 3 Evaluate (((-8)/(-10))/((-18)/30))/((-1770)/59). 2/45 What is the value of 1/(15 - 496/32)? -2 What is the value of (1 - ((-455)/21)/(-5))/((-2)/3)? 5 Calculate (7/((-294)/(-24)))/((-1)/(-7)). 4 Evaluate (-266)/(-266) + 3/(-2)-2 + -2. 2 ((-220)/(-33) + -7)/((-5)/1) 1/15 -1146/(-63) - 11 -1/7 Evaluate ((-132)/(-4))/(39/26). 22 Evaluate -18 - (-1027)/52 - (-62)/(-24). -5/6 ((-676)/(-1014))/(-4 - (114/(-27))/1) 3 (-24)/(-195) + (6336/(-180) - -35) -1/13 What is the value of (-13 - -1 - (59 - 62)) + 5? -4 What is the value of (2 + 5)-1 - (-7 + 2) - -22? 20 Calculate (-864)/(-63) - 546/39. -2/7 Calculate 4 - 5/5 - (-31 + 33). 1 What is (-3 - -1) + -4 + (-5)/(300/(-369))? 3/20 476/44 + -3 - ((-909)/99 - -9) 8 7/8(-120)/140 -3/4 (11/(1716/30))/((-10)/8) -2/13 What is the value of (-8 - 275/(-44))(-4)/142? 1 Evaluate (-5(-4)/35)/(88/2772). 18 Evaluate ((-100)/50)/(4/(-34)). 17 -24(3504/(-3285) + (-1)/(-15)) 24 13554/675 - (45 + -25) 2/25 Calculate (4851/378)/((-91)/(-156)). 22 What is (-2)/(-6) - ((-14)/3-1)/26? 2/13 What is (-2)/((-8)/228-19)? -3 Evaluate (-1)/(-9) + (24448/(-1008) - -24). -1/7 What is 7/(-3) + 296/(-444)? -3 -8 - -3 - 1591/(-301) 2/7 Calculate 1/(-22)(14 - 2). -6/11 Evaluate 3/10 + (-1809)/(-270). 7 -63 + 63 + ((-10)/(-30) - (-10)/42) 4/7 Evaluate (-15)/33(9 + -1 - (-4452)/(-530)). 2/11 Evaluate 207/(-391)(-1)/24-8. -3/17 Calculate -4304/(-48) - (753/18 + -42). 36 What is 4/17 - 11500/12750? -2/3 Calculate 20/2 + (28 - (-156876)/(-4131)). 2/81 What is the value of 0 + 172/20 - 18/(-270)6? 9 (11/(-4))/(3/(-4)) - 1023/341 2/3 What is the value of (-13)/((-117)/84) - (-17 - -27) - -9? 25/3 Calculate (-5739)/9565(-1 + 23/3). -4 What is the value of (-28)/20 - (144 + -145 + 38/5)? -8 What is 38/10 + (-101321)/26840? 1/40 (8/(-6))/(-24/(-90)) -15 Evaluate (-25)/((-91000)/1008) - (-1)/(-13)1. 1/5 Calculate (-103)/(-7) - (-1656 + 1671). -2/7 What is the value of 2/3 - (5 + 10/6)? -6 Calculate 2/6 + ((-5012)/168 - -30). 1/2 (-44)/(-234) + (-60)/540 1/13 (0 - -1)/((-1738)/(-110) - 16) - -8 3 What is the value of -11(-24)/3432 - 3110/(-26)? 12 Calculate 15/(1260/(-489)) - 3(-3)/(-21). -25/4 What is the value of -40 + 192/3636/16? -28 Calculate 6 + -57 + 46 + (13 - -1). 9 Evaluate 294/245(-5)/21. -2/7 What is the value of (-15)/(-50) + ((-945)/150 - 9)? -15 What is the value of (-55)/(-11) - (-5 + (-212)/(-20))? -3/5 What is ((-23)/(20240/(-48)))/(9/30)? 2/11 What is the value of (-1566)/(-2106) + (-4)/52? 2/3 What is (-2 + (-14)/8)(-2568)/1070? 9 -1175 + 1173 + 26/(-24)-2 1/6 Calculate 2 + 40/(-4) + (-6878)/(-874). -3/23 Calculate (-3)/(84/(-5))(0 + (-4)/(-10)). 1/14 What is (6/(-18)6/(-15))/(7/(-5))? -2/21 Calculate (4/10)/((-14)/(-182) + 104/845). 2 Calculate (-1968)/492 + 9/(-6)-2. -1 Evaluate (4/8 - (-102)/(-60))/((-48)/(-30)). -3/4 Evaluate (-1)/(-55)(367 - 372). -1/11 What is 12/105 + (138/15)/(-2)? 7/5 Evaluate (-22)/(-28) + 287/(-490) + 30/100. 1/2 Calculate ((-4)/(-44))/((-219)/(-2409)). 1 Calculate (-2)/((-2)/17 - (-189)/(-2295)). 10 What is -3 - (-28)/4 - (-100)/(-10)? -6 What is the value of 8/44(-1 - 6 - 1) - -2? 6/11 ((-12)/(-10))/((-546)/(-10010)) 22 Evaluate (128/70 - 749/535)/(3/(-189)). -27 What is 46/(-920)(-15)/(-6)? -1/8 Calculate (-222)/222(-2)/(-29). -2/29 What is -27 + (-23681)/(-765) + -4? -2/45 (-68)/(-102) + (-20)/(-6) 4 What is (357/68)/(-7)(-35)/21? 5/4 Evaluate 8/(-8 + 24/4). -4 Calculate 35/21(-12 + 1408/110). 4/3 (((-28)/1)/(-4))/(-6 - -7) 7 Evaluate 56/280 - 267/(-15). 18 What is ((-5751)/126)/(-9) + 9/(-378)3? 5 What is the value of 3360/(-2695) - 44/242? -10/7 (8/16)/(3/(96/2)) 8 Calculate (1 + 4)/((-290)/696). -12 (-21)/14(-3808)/336 17 What is 167/(-33) + -6(-25)/(-120)-4? -2/33 What is -12 - (2940/(-36))/7? -1/3 What is (21 - (-1548)/(-60))*3/(18/(-15))? 12 What is ((2 - -1) + 1)/(-10)? -2/5 Evaluate (-3572)/(-282) + (-16)/6. 10 What is the value of 6/(-51) - (4/26 - 2491/221)? 11 (9/(-21 + 30))/((-1)/(-13)) 13 What is -6 + ((-5192)/(-80))/11? -1/10 Calculate (((-120)/(-750))/(1/(-5)))/((-3)/45). 12 What is (-71)/3 + 5 - 43/129? -19 What is the value of (120/418 - 4/38)/(4/(-12))? -6/11 Evaluate (((-568)/355)/(84/30))/(1/1). -4/7 What is the va	{ "pile_set_name": "DM Mathematics" }
i + 12. Let t be (702/a)/(-13)(1 + 0). Determine g(t). 1 Let x(l) = 2l - 1. Let j(s) = -s + 1. Let o(h) = -5j(h) - 6x(h). Let g be (15/25)/(60/100). Determine o(g). -6 Let y = -667 - -661. Let z(o) = -o*3 - 3o*2 + 21o + 12. Give z(y). -6 Suppose 5g + 3p = 12, -g - 15 = -5g + 3p. Suppose -go - 2v = -5v - 18, -3v = 2o - 22. Let f(z) = z3 - 8z*2 + 2z - 4. What is f(o)? 12 Let g(k) = -k*2 + 6k - 1. Suppose -5w + w + 68 = 0. Suppose -c - w = b - 4b, -2b + 4c = -8. Let u be ((-1)/b)/((-9)/(-27))-12. What is g(u)? -1 Suppose -7s - 96 = -13s. Suppose -d + 4 = 0, -31 = 4q - 5q - 5d. Let i(u) = su + u3 - 3u - 3 + qu2 - 4u. Determine i(-10). 7 Let u = 12433 - 12432. Let x(p) = 37p3 + 2p*2 - 2. What is x(u)? 37 Let x(s) = 60s*2 + 2s. Let m = -3526 - -3525. Determine x(m). 58 Let g(r) = -2r - 1. Let s = -2372 + 2374. Calculate g(s). -5 Suppose 48 + 23 = -x. Let z be (690/(-45))/(6/27). Let l = x - z. Let a(g) = -2g + 1. Give a(l). 5 Let l(i) = -74i + 8 - 23i*2 - 31i*3 - 38i*3 + 68i*3 + 41. Give l(-19). 11 Let b(g) = -5 - 16 - 1 - 50 + 12g - 42. What is b(9)? -6 Let h = 1 + -6. Let p = -311 - -334. Let l(v) = 40 - 56 + p - 3v - v2. Give l(h). -3 Let f(w) = w3 + 19w*2 + 25w + 34. Let n be 22/(418/(-171)) + -9. Determine f(n). -92 Let r(z) = 2z2 - 5z + 18. Let t = 1495 + -1491. Give r(t). 30 Let d(t) = 2t - 4. Let c = 472 - 675. Let x = -207 - c. What is d(x)? -12 Let i(r) = r3 - r2 - 23r - 9. Let c(w) = 4w2 + 104w - 4. Let l be c(-26). Calculate i(l). 3 Let i(o) = 50o2 - o. Suppose -418p = -351p - 134. Determine i(p). 198 Let n(p) be the first derivative of 128 + 1/4p*4 + 5p + 7/3p3 + 1/2p*2. Determine n(-7). -2 Suppose -c = 3c - 20. Let p(j) be the third derivative of -j6/120 + j5/10 + j4/12 - j3/2 - 296j2 - 3. Calculate p(c). 32 Suppose 0 = 5i - 0i - 30. Let a(k) be the third derivative of -k6/120 + k5/12 + 5k4/24 + k3/6 - 1418k2. Determine a(i). -5 Let l(o) = o2. Let d be 3(-4)/24-36. Let g(c) = -8c*2 - 2c. Let n(p) = dl(p) + 2g(p). Suppose 2s - 4 = k, -k = 4s + 3k - 20. Give n(s). 6 Let v(r) = -47r*3 - 9r*2 + r - 17. Let m(c) = -31c*3 - 8c*2 + c - 16. Let i(h) = 3m(h) - 2v(h). Give i(6). -8 Let l(t) = -3t*3 + 18t*2 + 32t - 46. Let c(y) = -4y3 + 18y*2 + 41y - 39. Let i(h) = 4c(h) - 5l(h). Calculate i(-18). 2 Let i be (-8)/(1(-2 + 1)). Let j(a) = -6 - 2a + 3 + 2 + 12. Calculate j(i). -5 Let v(z) be the third derivative of -z5/60 - z4/3 - z*3/2 - 966z*2. What is v(-10)? -23 Let x(s) = 54 + 7s + 13s + 6s - 16s. What is x(-7)? -16 Let v(p) = 2p*2 - 13p. Let g(t) = -t*2 + 6t. Let j(q) = q*3 + 8q*2 + 13q + 6. Let d be j(-6). Let y = d + -4. Let z(c) = yv(c) - 9g(c). Give z(-2). 8 Let b(v) = 6v. Let m = 287 + -283. Suppose -16x + m = -12. Calculate b(x). 6 Let x = 7 + -10. Let o(h) = -1854 - 1853 - 9h + 5571 - 1859 + 10h. Give o(x). 2 Let k(u) = 5u - 167 - 22u + 34u + 7u + 17u. Let v be k(4). Let h(t) be the first derivative of -t4/4 - 5t*3/3 - 2t2 + 1. What is h(v)? -6 Let m(o) = -o3 - 4o2 + 7o - 23. Suppose -2g + 3z = 12, 5g = -17z + 20z - 30. What is m(g)? 7 Let r(q) = -871q + 1 - 10 - q*2 - 1 + 849q. Calculate r(-20). 30 Let b(t) = -126t + 30t + 33t - 12t + 387 + 8t. Determine b(6). -15 Suppose 0h = 3h - 2l + 2, -63 = -3h + 15l. Let p(t) = -2t3 - 7t2 - 12. Calculate p(h). 4 Let t(h) = h3 - 17h2 + 17h - 15. Let y(c) = -55 + 4c3 - c + 61 - 2c*3 - 3c*3 + 10c*2 + 2c*3. Let f be y(-10). What is t(f)? 1 Let d(g) = 7g2 + g3 + 16g - 55g + 11g + 6 + 0g*2. Give d(-10). -14 Suppose 17 + 10 = 3m. Let i(t) = 18t2 + 2t - 8 + mt2 + 7 - 26t2. Determine i(-3). 2 Let y(i) = i3 + i*2 + 9. Let g(s) = 31s*2 + 3s + 3. Let v(c) = -c*2 + c + 1. Let f(o) = g(o) - 4v(o). Let u be f(-1). Let b = -35 + u. What is y(b)? 9 Let w(u) = -2u + 13. Suppose 2n - 3c = -2c + 146, 2n - 152 = 4c. Suppose -16m + 72 + n = 0. Determine w(m). -5 Let o(w) = -w2 - 24w - 74. Let z = 5334 - 5354. Calculate o(z). 6 Let s(b) = b*3 + 11b*2 + 11b + 5. Let r = -42 + -8. Let d be (-4)/20 + 5/(r/98). Let v be s(d). Let a(z) = z*2 + 2z + 7. Calculate a(v). 22 Suppose -r + 5 = 7o, 0o + 15 = 3o + 3r. Let u(x) be the third derivative of 1/4x4 + 1/60x*5 + 0 + ox + 1/2x3 - 14x*2. Calculate u(-5). -2 Let h be 2-248 + (3 - 23)/4. Let f = h + 493. Let y(s) = 4 + 7s - 3 + s2 + 0s. Calculate y(f). 9 Let f(u) = 2u2 - 3. Suppose -i + 3 = 0, 5i - 105 = 3r + 27. Let q be (-156)/r - (0 - -2). What is f(q)? 5 Suppose 5w = -5, -4q + 18 - 1 = -5w. Let d(s) = -s*2 + 2s - 3. Let n(x) = -6x2 + 13x - 19. Let b(c) = -5d(c) + n(c). What is b(q)? -4 Let k(x) = x3 + 5x*2 - 2. Suppose -8p + 54 = 22. Let y be 8/(-12)6 - (p - 3). Determine k(y). -2 Let q(z) = -5z - 231. Let h be 756/(-1386) + 1022/(-22). What is q(h)? 4 Let j(f) = 6f2 - 103f. Let q(k) = 18k2 - 275k + 1. Let u(n) = 8j(n) - 3q(n). Determine u(-4). -103 Suppose -95 = -75d + 55. Let j(v) = -27v. Calculate j(d). -54 Let j(w) be the first derivative of -28 - 1/4w4 + 1/2w*2 - 30w + 0w3. Give j(0). -30 Let m = 586 - 545. Suppose 0 = -5i - s - 26 + m, -3i = s - 7. Let j(h) = -h3 + 5h*2 - 3h + 2. Determine j(i). 6 Let z(u) = 2u3 + 28u*2 + 56u - 26. Let q(p) = -3p3 - 42p*2 - 83p + 40. Let k(n) = -5q(n) - 8z(n). What is k(-11)? 8 Let u(r) = 2 + 52r + 2r2 + r2 + r*3 - 51r - 2r3. Let s(z) = z + 13. Let c be s(16). Suppose -p - c = -32. Determine u(p). 5 Let p(f) = -f3 + 9f*2 - 15f + 14. Let i = -3832 - -3839. Determine p(i). 7 Let v(w) be the first derivative of w*2/2 - 7w + 683. Let q be (-66)/14 + (-4)/14. Let r = 1 - q. What is v(r)? -1 Suppose 26 = 41t - 15. Let v(m) = -5m*3 + 2m*2 + 2m - 3. Determine v(t). -4 Let s(a) = a*2 - 28a + 28. Suppose -f - 2n + 3 + 13 = 0, 4f - 3n = 119. What is s(f)? -24 Let p(t) = -124t*3 + 18t*2 + 7t + 17. Let x(h) = -41h3 + 5h*2 + 2h + 5. Let k(f) = -2p(f) + 7x(f). Calculate k(1). -39 Suppose -4h + 47283 = -449. Let v(f) = -f2 + 2 + f3 - 11931f + hf - 3. Calculate v(2). 7 Let b(u) be the third derivative of 4/3u*3 + 0u - 13/24u4 - 32 + u2 + 1/60u5. Give b(12). -4 Let u = 46 + -36. Let l be (-18)/12 + 35/u + -5. Let d(n) = -n3 - 2n2 + 4n + 2. Calculate d(l). -1 Let c(p) = p3 + p2 + 4. Let v = 46 + -62. Let j(l) = -2l + 29. Let f(q) = q - 29. Let b(d) = -4f(d) - 3j(d). Let g be b(v). Give c(g). -14 Let a(j) = j - 1. Let x(l) = -36l + 441. Let v(q) = -5q + 59. Let o(r) = -30v(r) + 4x(r). Suppose 3w = 6 - 21. Let d(c) = wa(c) + o(c). What is d(0)? -1 Let m(r) be the third derivative of 0r + 147r2 - 1/2r*3 + 11/60r*5 + 1/120r*6 - 13/24r*4 + 0. What is m(-12)? 9 Let y(s) = -2s*2 - 13s - 2. Let o(f) be the third derivative of -f*5/30 - 3f4/8 - f3/6 + 2f2 + 126. Let d(q) = 4o(q) - 3y(q). What is d(4)? -18 Let b(d) = d2 - 30d + 5. Suppose 4s - 125 = 5h, -12h = 2s - 17h - 65. Give b(s). 5 Suppose -4b + 7 = -33. Let r(l) be the first derivative of -1/2l2 + 13l + 159. Calculate r(b). 3 Suppose 0 = -0r + 3r + 12. Let s(l) = l*2 + 12l - 62. Let q be s(4). Let u(c) = 335c2 - 671c*q + 341c*2 + 6c + c*3. What is u(r)? -8 Let c(o) be the first derivative of 31o*2/2 - 315o + 8235. Give c(10). -5 Let x(m) = m*3 - 16m*2 + 6m + 7. Let k be x(5). Let n = k + 240. Let u(c) = -6c2 - c3 + 3c2 - c2 + 3c2 + 2. What is u(n)? -10 Let z(a) = a3 + 4a*2 + 11a + 18. Let n(p) = 4p3 + 9p*2 + 34p + 58. Let b(c) = -2n(c) + 7z(c). Determine b(11). -12 Let s(f) = f + 1. Let b(i) = -2i2 - 48i + 219. Let n be b(-28). Determine s(n). -4 Let n(k) = -23k + 1208k*2 - 37 - 2433k*2 - 4 + 1224k*2. Determine n(-21). 1 Let u(q) = 2q - 1. Let b(a) = -5a2 - 26a + 8. Let l(i) = 4i2 + 25i - 10. Let j(n) = -5b(n) - 6l(n). Let v(r) = -j(r) - 2u(r). Calculate v(15). -3 Suppose -6 = g, 3p + 11 - 5 = -3g. Let r(b) = b3 - 3b*2 + 10b + 9. Determine r(p). 65 Let v(b) = 9b*2 - b - 1. Let m be v(-1). Let u be 2/6 - (-235)/15. Let o(n) = -u + m - n - 1. W	{ "pile_set_name": "DM Mathematics" }
25 Calculate the highest common divisor of 344 and 301. 43 What is the highest common divisor of 4707 and 117? 9 What is the highest common divisor of 946 and 154? 22 What is the greatest common divisor of 155 and 31? 31 What is the greatest common factor of 42 and 609? 21 Calculate the highest common divisor of 3139 and 73. 73 What is the highest common factor of 6 and 142? 2 Calculate the highest common divisor of 4186 and 92. 46 Calculate the highest common factor of 5124 and 21. 21 What is the highest common divisor of 1809 and 27? 27 Calculate the highest common factor of 11 and 1980. 11 What is the highest common factor of 8 and 344? 8 What is the greatest common factor of 1250 and 200? 50 Calculate the highest common divisor of 1113 and 57. 3 Calculate the highest common factor of 68353 and 29. 29 Calculate the highest common divisor of 570 and 90. 30 Calculate the greatest common factor of 65 and 52. 13 Calculate the highest common factor of 119782 and 17. 17 Calculate the highest common divisor of 86 and 43. 43 Calculate the greatest common divisor of 35 and 250. 5 What is the highest common factor of 30058 and 226? 226 What is the greatest common divisor of 5952 and 279? 93 What is the highest common factor of 43 and 129? 43 What is the highest common factor of 18 and 114? 6 What is the greatest common factor of 6888 and 8? 8 What is the greatest common factor of 2043 and 9? 9 What is the greatest common divisor of 42 and 462? 42 Calculate the greatest common divisor of 330 and 60. 30 What is the greatest common divisor of 63 and 39? 3 What is the highest common factor of 372 and 12772? 124 What is the highest common factor of 26 and 4303? 13 What is the greatest common divisor of 105 and 4215? 15 Calculate the highest common factor of 1508 and 130. 26 Calculate the highest common divisor of 13051 and 31. 31 Calculate the greatest common factor of 425 and 17. 17 Calculate the greatest common factor of 35 and 1043. 7 What is the highest common divisor of 32 and 248? 8 Calculate the highest common factor of 4 and 4. 4 Calculate the greatest common divisor of 24 and 3. 3 What is the greatest common divisor of 63 and 36? 9 Calculate the greatest common factor of 100 and 25. 25 Calculate the greatest common factor of 5 and 215. 5 Calculate the greatest common factor of 675 and 600. 75 Calculate the greatest common divisor of 634 and 42161. 317 Calculate the highest common factor of 24 and 160. 8 Calculate the greatest common divisor of 83 and 9. 1 What is the highest common factor of 12 and 12384? 12 What is the highest common divisor of 9 and 723? 3 Calculate the greatest common divisor of 62 and 8. 2 Calculate the highest common divisor of 26 and 1066. 26 Calculate the highest common factor of 35 and 35. 35 What is the highest common divisor of 162 and 5913? 81 What is the greatest common divisor of 79739 and 121? 121 What is the greatest common divisor of 86 and 6106? 86 What is the highest common factor of 168 and 357? 21 What is the greatest common divisor of 3155 and 40? 5 What is the greatest common factor of 9 and 8? 1 What is the greatest common divisor of 3655 and 170? 85 Calculate the greatest common factor of 3860 and 20. 20 Calculate the greatest common factor of 1552 and 291. 97 What is the greatest common divisor of 392 and 40? 8 Calculate the greatest common divisor of 3483 and 3. 3 Calculate the greatest common divisor of 7 and 3087. 7 Calculate the highest common divisor of 2450 and 50. 50 What is the greatest common divisor of 8991 and 37? 37 What is the highest common divisor of 1273 and 57? 19 Calculate the greatest common factor of 292 and 36. 4 Calculate the highest common divisor of 72 and 192. 24 Calculate the highest common divisor of 325 and 13. 13 Calculate the greatest common divisor of 4260 and 120. 60 What is the highest common factor of 113 and 1243? 113 Calculate the greatest common factor of 1255 and 6777. 251 What is the highest common factor of 304 and 20368? 304 Calculate the highest common factor of 6 and 1224. 6 What is the highest common divisor of 1155 and 140? 35 What is the greatest common divisor of 721 and 1751? 103 Calculate the greatest common factor of 972 and 96. 12 Calculate the greatest common divisor of 25 and 1. 1 Calculate the highest common divisor of 1748 and 184. 92 What is the greatest common divisor of 20 and 37780? 20 What is the greatest common factor of 126 and 434? 14 Calculate the greatest common factor of 552 and 18. 6 Calculate the highest common factor of 880 and 330. 110 Calculate the greatest common divisor of 110 and 902. 22 What is the highest common divisor of 476 and 29750? 238 What is the greatest common factor of 200 and 3075? 25 Calculate the greatest common divisor of 1032 and 430. 86 What is the highest common factor of 236 and 17818? 118 Calculate the highest common divisor of 222 and 962. 74 What is the highest common factor of 240 and 16? 16 Calculate the highest common factor of 100 and 140. 20 Calculate the greatest common factor of 80 and 64. 16 What is the highest common factor of 79 and 1343? 79 What is the greatest common divisor of 198 and 36? 18 Calculate the highest common divisor of 81 and 1377. 81 Calculate the highest common divisor of 39 and 403. 13 Calculate the highest common divisor of 22 and 374. 22 What is the highest common divisor of 3210 and 330? 30 What is the highest common divisor of 13 and 24037? 13 Calculate the highest common divisor of 400 and 2192. 16 What is the greatest common factor of 72 and 2358? 18 Calculate the highest common factor of 11776 and 46. 46 Calculate the highest common divisor of 10 and 1. 1 Calculate the highest common factor of 108 and 4. 4 Calculate the greatest common divisor of 100 and 12100. 100 What is the highest common factor of 12551 and 11? 11 Calculate the greatest common factor of 1377 and 243. 81 Calculate the highest common factor of 1586 and 26. 26 Calculate the highest common divisor of 7 and 49. 7 What is the highest common factor of 76 and 1588? 4 What is the greatest common factor of 1672 and 1232? 88 Calculate the highest common divisor of 19 and 190. 19 What is the greatest common divisor of 118 and 51094? 118 Calculate the highest common divisor of 511 and 14. 7 What is the greatest common divisor of 2288 and 143? 143 Calculate the highest common divisor of 988 and 228. 76 What is the highest common factor of 147 and 189? 21 Calculate the greatest common divisor of 13 and 637. 13 Calculate the highest common factor of 110 and 66. 22 Calculate the greatest common divisor of 644 and 4025. 161 What is the greatest common factor of 10409 and 35? 7 What is the greatest common factor of 55 and 3025? 55 What is the highest common divisor of 736 and 23? 23 What is the greatest common divisor of 96 and 372? 12 Calculate the greatest common divisor of 10 and 10050. 10 Calculate the highest common factor of 49 and 784. 49 Calculate the greatest common divisor of 91 and 481. 13 Calculate the greatest common divisor of 55 and 5445. 55 What is the highest common factor of 21 and 96? 3 What is the highest common factor of 5 and 730? 5 Calculate the greatest common factor of 936 and 72. 72 What is the greatest common divisor of 268 and 4? 4 Calculate the highest common factor of 28 and 20. 4 Calculate the highest common factor of 432 and 108. 108 Calculate the highest common divisor of 30 and 13290. 30 Calculate the greatest common factor of 57 and 3515. 19 What is the highest common divisor of 225 and 100? 25 What is the greatest common divisor of 11 and 7? 1 What is the greatest common factor of 8604 and 612? 36 Calculate the highest common divisor of 59 and 118. 59 What is the highest common factor of 72 and 6624? 72 What is the highest common factor of 407 and 22? 11 What is the highest common factor of 166 and 8383? 83 Calculate the greatest common divisor of 30 and 570. 30 Calculate the greatest common factor of 5 and 13355. 5 Calculate the greatest common factor of 370 and 74. 74 What is the highest common divisor of 21 and 399? 21 Calculate the highest common factor of 56 and 1624. 56 Calculate the greatest common divisor of 400 and 88. 8 Calculate the highest common divisor of 180 and 72. 36	{ "pile_set_name": "DM Mathematics" }
024? 0 What is the thousands digit of 7850? 7 What is the units digit of 3905? 5 What is the tens digit of 619? 1 What is the hundreds digit of 1299? 2 What is the hundreds digit of 10440? 4 What is the hundreds digit of 7835? 8 What is the tens digit of 4468? 6 What is the units digit of 119345? 5 What is the hundred thousands digit of 130624? 1 What is the thousands digit of 22215? 2 What is the thousands digit of 1379? 1 What is the hundreds digit of 15148? 1 What is the tens digit of 719? 1 What is the thousands digit of 94843? 4 What is the tens digit of 600? 0 What is the units digit of 4564? 4 What is the hundreds digit of 5320? 3 What is the thousands digit of 2732? 2 What is the units digit of 4065? 5 What is the tens digit of 15139? 3 What is the units digit of 10217? 7 What is the hundreds digit of 37226? 2 What is the thousands digit of 17376? 7 What is the tens digit of 12980? 8 What is the units digit of 9420? 0 What is the hundreds digit of 16106? 1 What is the thousands digit of 4986? 4 What is the tens digit of 23800? 0 What is the tens digit of 1586? 8 What is the tens digit of 276? 7 What is the tens digit of 1086? 8 What is the thousands digit of 3170? 3 What is the hundreds digit of 6144? 1 What is the hundreds digit of 36078? 0 What is the units digit of 2446? 6 What is the hundreds digit of 297? 2 What is the thousands digit of 5879? 5 What is the thousands digit of 2125? 2 What is the hundreds digit of 523? 5 What is the units digit of 3747? 7 What is the thousands digit of 15506? 5 What is the units digit of 157249? 9 What is the tens digit of 1575? 7 What is the thousands digit of 29268? 9 What is the hundreds digit of 70462? 4 What is the thousands digit of 5025? 5 What is the ten thousands digit of 153588? 5 What is the tens digit of 27006? 0 What is the hundreds digit of 176? 1 What is the hundreds digit of 16167? 1 What is the tens digit of 5615? 1 What is the tens digit of 28798? 9 What is the units digit of 1795? 5 What is the units digit of 1035? 5 What is the hundreds digit of 499? 4 What is the tens digit of 3384? 8 What is the thousands digit of 14449? 4 What is the hundreds digit of 10147? 1 What is the tens digit of 29494? 9 What is the ten thousands digit of 35343? 3 What is the tens digit of 56764? 6 What is the thousands digit of 18544? 8 What is the hundreds digit of 945? 9 What is the tens digit of 46657? 5 What is the tens digit of 891? 9 What is the tens digit of 12706? 0 What is the hundreds digit of 1827? 8 What is the tens digit of 820? 2 What is the thousands digit of 1793? 1 What is the units digit of 433? 3 What is the units digit of 7018? 8 What is the tens digit of 392? 9 What is the units digit of 27402? 2 What is the thousands digit of 6499? 6 What is the tens digit of 12? 1 What is the hundreds digit of 2364? 3 What is the tens digit of 99714? 1 What is the tens digit of 72109? 0 What is the units digit of 161? 1 What is the units digit of 5463? 3 What is the tens digit of 548? 4 What is the tens digit of 2950? 5 What is the hundreds digit of 13151? 1 What is the hundreds digit of 1668? 6 What is the units digit of 2548? 8 What is the ten thousands digit of 14632? 1 What is the tens digit of 11317? 1 What is the units digit of 98883? 3 What is the hundreds digit of 85070? 0 What is the thousands digit of 1793? 1 What is the hundreds digit of 3714? 7 What is the hundreds digit of 5177? 1 What is the tens digit of 1906? 0 What is the hundreds digit of 12969? 9 What is the hundreds digit of 16100? 1 What is the units digit of 11968? 8 What is the thousands digit of 69193? 9 What is the tens digit of 174258? 5 What is the thousands digit of 15647? 5 What is the thousands digit of 84911? 4 What is the tens digit of 1315? 1 What is the units digit of 5230? 0 What is the thousands digit of 13986? 3 What is the units digit of 239? 9 What is the tens digit of 999? 9 What is the tens digit of 3659? 5 What is the ten thousands digit of 14981? 1 What is the hundreds digit of 18632? 6 What is the thousands digit of 20884? 0 What is the hundreds digit of 7303? 3 What is the hundreds digit of 3912? 9 What is the thousands digit of 3084? 3 What is the ten thousands digit of 82386? 8 What is the units digit of 31659? 9 What is the thousands digit of 1004? 1 What is the tens digit of 3543? 4 What is the units digit of 1232? 2 What is the hundreds digit of 3192? 1 What is the thousands digit of 8927? 8 What is the thousands digit of 1195? 1 What is the units digit of 4879? 9 What is the thousands digit of 23945? 3 What is the units digit of 712? 2 What is the thousands digit of 16701? 6 What is the thousands digit of 1276? 1 What is the hundreds digit of 1204? 2 What is the ten thousands digit of 15013? 1 What is the hundreds digit of 68962? 9 What is the tens digit of 5422? 2 What is the hundreds digit of 1415? 4 What is the tens digit of 726? 2 What is the hundreds digit of 1506? 5 What is the hundreds digit of 4598? 5 What is the thousands digit of 6030? 6 What is the units digit of 2634? 4 What is the hundreds digit of 1042? 0 What is the tens digit of 177961? 6 What is the thousands digit of 17401? 7 What is the tens digit of 1020? 2 What is the hundreds digit of 6554? 5 What is the units digit of 51657? 7 What is the hundreds digit of 4036? 0 What is the tens digit of 7105? 0 What is the units digit of 3786? 6 What is the hundreds digit of 19325? 3 What is the hundreds digit of 34078? 0 What is the thousands digit of 135176? 5 What is the tens digit of 3508? 0 What is the tens digit of 1497? 9 What is the hundreds digit of 5776? 7 What is the tens digit of 39923? 2 What is the hundreds digit of 1304? 3 What is the hundreds digit of 92129? 1 What is the tens digit of 2807? 0 What is the hundreds digit of 42091? 0 What is the hundreds digit of 1694? 6 What is the units digit of 69366? 6 What is the tens digit of 945? 4 What is the units digit of 945? 5 What is the ten thousands digit of 126696? 2 What is the hundreds digit of 75281? 2 What is the hundreds digit of 1022? 0 What is the tens digit of 2188? 8 What is the hundreds digit of 3614? 6 What is the hundreds digit of 8649? 6 What is the tens digit of 1171? 7 What is the thousands digit of 29995? 9 What is the units digit of 320? 0 What is the ten thousands digit of 85736? 8 What is the units digit of 470? 0 What is the tens digit of 6281? 8 What is the ten thousands digit of 25808? 2 What is the tens digit of 3569? 6 What is the units digit of 1345? 5 What is the hundreds digit of 18643? 6 What is the thousands digit of 3193? 3 What is the tens digit of 1032? 3 What is the tens digit of 413? 1 What is the thousands digit of 4486? 4 What is the hundreds digit of 1517? 5 What is the tens digit of 2783? 8 What is the hundreds digit of 446? 4 What is the hundreds digit of 25442? 4 What is the ten thousands digit of 12710? 1 What is the units digit of 545? 5 What is the ten thousands digit of 53226? 5 What is the tens digit of 81979? 7 What is the thousands digit of 14750? 4 What is the hundreds digit of 167? 1 What is the thousands digit of 1547? 1 What is the units digit of 12190? 0 What is the thousands digit of 1561? 1 What is the thousands digit of 5247? 5 What is the tens digit of 1514? 1 What is the units digit of 3734? 4 What is the hundreds digit of 37520? 5 What is the ten thousands digit of 11031? 1 What is the tens digit of 9152? 5 What is the units digit of 5202? 2 What is the hundreds digit of 7406? 4 What is the tens digit of 37814? 1 What is the hundreds digit of 3018? 0 What is the hundreds digit of 66361? 3 What is the hundreds digit of 15175? 1 What is the tens digit of 3352? 5 What is the units digit of 585? 5 What is the tens digit of 166765? 6 What is the hundreds digit of 647? 6 What is the units digit of 35033? 3 What is the thousands digit of 3431? 3 What is the thousands digit of 46290? 6 What is the tens digit of 117? 1 What is the hundreds digit of 93987? 9 What is the tens digit of 13579? 7 What is the hundreds digit of 1847? 8 What is the units digit of 1337? 7 What is the hundreds digit of 29830? 8 What is the units digit of 2015? 5 What is the thousands digit of 17616? 7 What is the tens digit of 39669? 6 What is the	{ "pile_set_name": "DM Mathematics" }
d - 21d + 5d) as s + zd*2 + jd + pd3 and give p. -27 Express 2a + 14a - a + (5 - 4 + 0 + (0 + 0 + 2)(4 - 1 - 1))(2a - 3a + 3a) as c + ma and give m. 25 Express 3w - 1 - 23w + 1 in the form tw + c and give c. 0 Rearrange v + 2v3 - v + (-13v - 7 + 7)(-2v*2 + 4v*2 - 4v*2) to the form ov*2 + av + tv3 + j and give t. 28 Express 169i + 3i4 - 3i2 + i2 - 167i as gi*2 + si*4 + fi + j + ui3 and give s. 3 Rearrange 3 - k4 - 3k*2 + 4k*3 + 2k*3 - 8k*3 to sk*3 + ok*2 + vk + tk4 + z and give z. 3 Rearrange -8o - 3o + 9o - 16 to go + s and give g. -2 Rearrange -5f*2 - 3f - 1 + 3f + 4f*2 - f to the form xf + y + zf2 and give x. -1 Express (-21 + 21 + 6f*2)(2f + 50 - 50) as df*2 + q + nf*3 + gf and give n. 12 Rearrange -39o3 + o2 - 33o*3 - 35o*3 + 3 + 108o*3 to fo*2 + co*3 + ko + n and give f. 1 Express 2q2 - 4q*2 + 4q*2 - 5 - q + 3q*2 + q + (q + 2q - q)(4q - 2q - 3q) as mq2 + p + xq and give m. 3 Express 2z + 2z*4 + 3z*3 - 5z*3 + 5z*3 + 5 - 4z*3 in the form p + hz + vz2 + az*3 + wz*4 and give a. -1 Rearrange (2x*2 - 14x2 - x2)(-2 - 4 + 3)(2x - 4x + 3x) to the form dx*3 + z + lx*2 + ux and give d. 39 Express (-5o + 5o + 5o2)(0o + 4o - o)(o + 0o - 2o) as v + mo*2 + yo + go4 + ho*3 and give g. -15 Express -7y + 0y + 5y*2 + 5y in the form jy + iy*2 + n and give i. 5 Express (c + 10 - 3c - 5 - 3c2)(2 - 2 + 2c2) in the form nc*2 + fc + hc4 + x + kc*3 and give f. 0 Rearrange 5d - 6d + 23d to the form g + ad and give a. 22 Rearrange 7g*2 - 5 - 6g*2 + 4 to the form og + u + ag2 and give u. -1 Express d2 + d2 + 0 - 2 + (d + 2d - d)(-d + 0d - d) - 2d2 - 3d*2 + 6d*2 - 2 - 8d*2 + 2 as ad*2 + k + yd and give k. -2 Express (5z - 3z + 0z)(2z2 - 137z + 138z + 3z*2 + (-3z + 5z - z)(3z - 3z + 2z) + z2 + 2 - 2) as p + az*2 + wz*3 + uz and give a. 2 Express -f3 + f4 - 2 - 2f3 - 6f + 9f as n + df*4 + af*3 + tf + uf2 and give a. -3 Express -34 + 15g + 34 in the form q + sg and give s. 15 Express 26 - 2a*3 - 29 - 2a*2 + 3a2 + a2 as g + pa2 + ya + da3 and give d. -2 Express (-2p*4 - 3p*4 + 3p*4)(-94 + 2 - 70) as kp4 + tp + up2 + j + np*3 and give k. 324 Rearrange (-14 + 35g - 51g + 13)(4 - 4 - 2g) to jg + c + ng2 and give n. 32 Express -4f + 5f + 0f as uf + x and give u. 1 Express 0 - 2 - 34r*2 + 25r*2 - 36r*2 in the form cr + wr2 + i and give w. -45 Rearrange -50p - 35p - 230 + 230 to the form q + jp and give j. -85 Rearrange 58h - 7 + 51h - 114h to t + uh and give u. -5 Rearrange ((2 - 3 + 0)(-2 + 3 + 1) + 10 - 11 - 11 - 2 + 5 - 4)(0 + 3b - 2b - 1) to mb + r and give r. 15 Rearrange (2s*3 - 3s*2 + 3s*2)(-24s + 17s - 14s) to the form ps*3 + f + rs*4 + ls*2 + us and give r. -42 Rearrange 0z4 - z4 - 2z*2 + 3z4 + z3 + 2z - z2 to oz*3 + r + lz + bz2 + uz*4 and give b. -3 Rearrange 4t*2 + 14t*3 - 2t*4 - 13t*3 + 2 - 3t*4 + 3t*4 + 2t to xt2 + it*3 + nt + u + dt4 and give u. 2 Express 2 - 2 - 2a + (-31a + 24 - 24)(-3 + 1 + 3) + 0 + 2a + 0 in the form m + pa and give p. -31 Express -5f + 16f*2 - 2f*2 - 5f*2 - 2 - 7f*2 as wf + p + qf2 and give p. -2 Rearrange 2o*2 + 3o*2 - 3o*2 + (2 - o - 2)(-o - 10 + 10) to z + so + xo*2 and give x. 3 Express -5o*3 + 0o*2 + 6o*3 + 0o*3 + 6o*2 in the form to*3 + g + fo*2 + ko and give t. 1 Rearrange -3 + 5 - 7 + v*2 to rv*2 + h + nv and give h. -5 Rearrange (-2i2 - i2 + i2)(4 + 12 - 6) to the form w + ji2 + si and give j. -20 Rearrange (2 - 4t - 2)(-t2 + t2 - 2t2 + (-2 - 4 + 2)(2t2 - 3 + 3)) to the form ut + f + nt2 + ot3 and give o. 40 Express -q3 + q + 0 + 0q3 - 2q*3 + 2 as jq*2 + d + yq + sq3 and give y. 1 Express (-3l*4 - 3l*2 - 1 + 3l*2)(1 + 1 + 3) in the form r + tl + ol*2 + vl*3 + al*4 and give a. -15 Rearrange 4o*3 - 105o*2 + 103o*2 - 32o*3 to the form fo + ko2 + b + po*3 and give k. -2 Express (0 + 2 - 1 + (3 - 3 - 1)(4 + 1 - 3) - 2 + 1 + 0 + (-2 - 3 + 0)(1 - 2 + 2))(2u - u - 3u) as au + o and give a. 14 Rearrange 5k + 0k + 3k - 10k to the form i + qk and give q. -2 Rearrange -2b2 - 306b + 306b - 15 to pb + qb2 + z and give q. -2 Rearrange (-m2 + m2 + 2m*2)(-2m - 1 + 1) + (-1 + 2m*3 + 1)(2 - 2 - 3) to the form om + g + um*3 + am*2 and give a. 0 Rearrange -3b*4 - 2b*2 - 4b*3 + 3b*2 + 5b*4 - 56b + 45b to the form v + lb*2 + ib*4 + yb + xb3 and give i. 2 Rearrange 0z3 + z3 + 1 - 2z3 + 4z*2 to dz + iz2 + g + qz*3 and give g. 1 Rearrange -14l + 14l + 27l*2 to rl + ol2 + z and give o. 27 Rearrange (2o2 - o - o2 + 6o)(2 - 2 - 2) to uo + ro*2 + l and give u. -10 Express 955 - 955 - 45g as c + dg and give d. -45 Express (-6 + 3 - 1)(3a - 5a + 0a) + (4a - 2a + 0a)(-2 + 3 - 2)(-5 + 0 + 2) as ja + y and give j. 14 Express (1 - 1 + 2g + (2g + g - g)(3 - 4 + 0) + 2 - 2 - 2g)(-7g2 + 14g - 14g) in the form yg*3 + l + mg + cg2 and give y. 14 Express (4l*2 + 8l - 8l)(-1 + 2 - 5)(0 + 3 - 2) in the form c + xl*2 + jl and give x. -16 Express 9a - 17a - 2a as ma + s and give m. -10 Rearrange 3t - t + t + (-2 + 3 + 2)(-1 + t + 1) - t + 5t - 2t + (2 + 0 - 1)(0t - 4t + 5t) - t + 2t + 0t + 2t - 2t - t to dt + q and give d. 9 Express -2k*3 - 4k - k + 2 - 2k as s + wk + rk2 + bk*3 and give w. -7 Rearrange 2x*2 + 14 + 2x + x*3 - 15 + 2x to tx2 + d + sx*3 + bx and give b. 4 Express (-4f - f + 6f)(-1 + 6 - 2)(-1 - 4 + 3)(0 + 2 - 5) in the form wf + y and give w. 18 Rearrange -5 + 2 + n*2 + 4 - 4 to the form w + gn + un2 and give u. 1 Rearrange 314o*2 - 5 + o - 317o*2 - 2o to qo2 + i + jo and give j. -1 Express 4n4 - 1 + 12n - 10n + 3n*4 as pn*3 + sn*4 + hn + g + rn2 and give h. 2 Express -f4 + 2 - 11f + 0f3 + 6f - 2f3 as tf*2 + yf*4 + if*3 + lf + x and give y. -1 Rearrange 3o3 - 6o3 - o4 + 9o2 - 4o*2 to the form yo + wo4 + to*2 + go*3 + x and give g. -3 Rearrange (1 + 3 - 6)(-6m3 + 2m*3 + 2m*3) - 2m3 + m3 - 2m3 to bm + lm2 + g + pm*3 and give p. 1 Rearrange (2 + 0 - 4 + 2 - 3 + 0 + (4 - 4 - 1)(-3 - 3 + 4) + 4 + 0 - 6 + 1 + 0 + 0 - 55 + 17 + 16)(-1 - 2w + 1) to the form qw + b and give q. 48 Rearrange 17m*3 - 45m*3 + 15m*4 - 4m*2 + 26m*3 to the form i + ym + lm4 + xm*3 + jm*2 and give x. -2 Express -2c + 2c - c in the form nc + o and give n. -1 Express -2l4 - 3l + 3l + (6l*2 + 64l + 1 - 64l)(-l - 2l2 + l2 + 2l) in the form v + cl3 + rl*4 + sl*2 + ul and give s. -1 Express (2 - 2 - l)(3 - 5 + 1) + (3l - 2 + 2)(2 + 1 - 2) as k + bl and give k. 0 Rearrange 22t - 5t + 6t + 48t + t + 1 - 1 - t - t + 0t + (1 - 4 + 1)(-2t + t - t) + 0t + t + t to the form k + xt and give x. 76 Rearrange -2v4 - v2 + 4v3 - 3 - 5v*3 + 3v*4 + 0v - v to iv4 + fv + tv2 + l + dv*3 and give i. 1 Express 6 - 11 + 2o*2 + 0 as z + ko*2 + go and give k. 2 Express -a*3 - 2a*4 - 43a - 14 - 2a2 + a4 + 42a in the form ha3 + x + ka*4 + oa + va2 and give v. -2 Express 8j - j - 7j - 6 - j as n + hj and give h. -1 Express -151 + 151 + 37x as m + fx and give f. 37 Rearrange (3i4 + i4 - 6i*4)(0 + 1 - 2 + 0 - 1 + 0 + (-6 + 0 + 4)(-4 + 3 + 3))(-5 + 4 + 4) to y + ji2 + di*4 + qi + hi3 and give d. 36 Rearrange 45 + 48 - 91 + 13z to xz + s and give x. 13 Express -z2 - 2z*2 + 4z*2 + (z - 2z + 3z)(-3z - z + 2z) + 6z2 + 170z + 2 - 170z as qz*2 + x + vz and give x. 2 Express 3 - 3 + 7j2 + (5j + 0j + 0j)(0j + 2j - j) in the form n + bj*2 + mj and give b. 12 Express (3 - 3 - 2t)(-3t3 + 6t3 - t3) + 46 - 41 - 4t + 5t - t*4 in the form nt + w + ot2 + xt*3 + ut*4 and give x. 0 Rearrange (3z + 4z - 5z + (-6 + 2 + 2)(0 + 0 - 2z))(-25 - 8 + 17) to the form r + vz and give v.	{ "pile_set_name": "DM Mathematics" }
075525 to the nearest integer? 182 What is the third root of 762255 to the nearest integer? 91 What is 17698133 to the power of 1/2, to the nearest integer? 4207 What is the square root of 693372 to the nearest integer? 833 What is the cube root of 5477298 to the nearest integer? 176 What is 2132801 to the power of 1/2, to the nearest integer? 1460 What is 262781 to the power of 1/5, to the nearest integer? 12 What is 2063294 to the power of 1/5, to the nearest integer? 18 What is the fourth root of 103716 to the nearest integer? 18 What is the square root of 1776428 to the nearest integer? 1333 What is the third root of 7330 to the nearest integer? 19 What is the ninth root of 4470435 to the nearest integer? 5 What is the tenth root of 518942 to the nearest integer? 4 What is 240596 to the power of 1/3, to the nearest integer? 62 What is the eighth root of 1390868 to the nearest integer? 6 What is the seventh root of 5517694 to the nearest integer? 9 What is 765181 to the power of 1/9, to the nearest integer? 5 What is the cube root of 5700825 to the nearest integer? 179 What is the fourth root of 11732084 to the nearest integer? 59 What is the square root of 2464465 to the nearest integer? 1570 What is the third root of 261122 to the nearest integer? 64 What is the third root of 2158485 to the nearest integer? 129 What is the eighth root of 8568461 to the nearest integer? 7 What is 166215 to the power of 1/2, to the nearest integer? 408 What is the square root of 23751 to the nearest integer? 154 What is 1223122 to the power of 1/2, to the nearest integer? 1106 What is 5987495 to the power of 1/2, to the nearest integer? 2447 What is the third root of 115265 to the nearest integer? 49 What is 283798 to the power of 1/8, to the nearest integer? 5 What is the third root of 18960382 to the nearest integer? 267 What is 235458 to the power of 1/3, to the nearest integer? 62 What is 6009417 to the power of 1/2, to the nearest integer? 2451 What is 180079 to the power of 1/7, to the nearest integer? 6 What is the square root of 40631 to the nearest integer? 202 What is the ninth root of 7883298 to the nearest integer? 6 What is 2356739 to the power of 1/7, to the nearest integer? 8 What is 10662073 to the power of 1/5, to the nearest integer? 25 What is the fourth root of 695103 to the nearest integer? 29 What is the sixth root of 315498 to the nearest integer? 8 What is the cube root of 13425618 to the nearest integer? 238 What is the tenth root of 355403 to the nearest integer? 4 What is 3992891 to the power of 1/3, to the nearest integer? 159 What is the tenth root of 1512362 to the nearest integer? 4 What is the third root of 302995 to the nearest integer? 67 What is the square root of 232792 to the nearest integer? 482 What is 417548 to the power of 1/3, to the nearest integer? 75 What is 133770 to the power of 1/2, to the nearest integer? 366 What is the square root of 40851 to the nearest integer? 202 What is 81871 to the power of 1/6, to the nearest integer? 7 What is 121658 to the power of 1/7, to the nearest integer? 5 What is the cube root of 19377564 to the nearest integer? 269 What is the third root of 915850 to the nearest integer? 97 What is the third root of 485597 to the nearest integer? 79 What is 444970 to the power of 1/3, to the nearest integer? 76 What is 1111737 to the power of 1/3, to the nearest integer? 104 What is 1494057 to the power of 1/3, to the nearest integer? 114 What is 11911203 to the power of 1/2, to the nearest integer? 3451 What is the ninth root of 222563 to the nearest integer? 4 What is 6117230 to the power of 1/2, to the nearest integer? 2473 What is the cube root of 2098124 to the nearest integer? 128 What is 1373966 to the power of 1/8, to the nearest integer? 6 What is 465301 to the power of 1/2, to the nearest integer? 682 What is the third root of 17869166 to the nearest integer? 261 What is 2158970 to the power of 1/5, to the nearest integer? 18 What is the seventh root of 10526807 to the nearest integer? 10 What is 1864317 to the power of 1/2, to the nearest integer? 1365 What is the eighth root of 1212597 to the nearest integer? 6 What is the sixth root of 14412434 to the nearest integer? 16 What is the eighth root of 6885959 to the nearest integer? 7 What is 223740 to the power of 1/3, to the nearest integer? 61 What is 2698839 to the power of 1/2, to the nearest integer? 1643 What is the third root of 13233677 to the nearest integer? 237 What is 698233 to the power of 1/3, to the nearest integer? 89 What is 645645 to the power of 1/3, to the nearest integer? 86 What is 44395 to the power of 1/3, to the nearest integer? 35 What is 252814 to the power of 1/5, to the nearest integer? 12 What is the square root of 1969496 to the nearest integer? 1403 What is 249225 to the power of 1/2, to the nearest integer? 499 What is the eighth root of 213967 to the nearest integer? 5 What is the cube root of 17976484 to the nearest integer? 262 What is the cube root of 2831659 to the nearest integer? 141 What is the tenth root of 4247343 to the nearest integer? 5 What is the square root of 7148296 to the nearest integer? 2674 What is 610787 to the power of 1/7, to the nearest integer? 7 What is 668801 to the power of 1/8, to the nearest integer? 5 What is 733772 to the power of 1/3, to the nearest integer? 90 What is 1523793 to the power of 1/2, to the nearest integer? 1234 What is 304117 to the power of 1/2, to the nearest integer? 551 What is the fifth root of 80557 to the nearest integer? 10 What is the ninth root of 708260 to the nearest integer? 4 What is 281870 to the power of 1/2, to the nearest integer? 531 What is the fourth root of 534750 to the nearest integer? 27 What is the square root of 5863929 to the nearest integer? 2422 What is 2263970 to the power of 1/10, to the nearest integer? 4 What is 382304 to the power of 1/3, to the nearest integer? 73 What is 299989 to the power of 1/10, to the nearest integer? 4 What is the fifth root of 1392049 to the nearest integer? 17 What is 355567 to the power of 1/2, to the nearest integer? 596 What is 581674 to the power of 1/2, to the nearest integer? 763 What is the fourth root of 15575090 to the nearest integer? 63 What is the square root of 2496371 to the nearest integer? 1580 What is the eighth root of 799310 to the nearest integer? 5 What is 252035 to the power of 1/3, to the nearest integer? 63 What is the square root of 12725835 to the nearest integer? 3567 What is 3776688 to the power of 1/3, to the nearest integer? 156 What is the square root of 1378542 to the nearest integer? 1174 What is 44796 to the power of 1/3, to the nearest integer? 36 What is the cube root of 5206459 to the nearest integer? 173 What is 434825 to the power of 1/2, to the nearest integer? 659 What is the cube root of 3044310 to the nearest integer? 145 What is 62743 to the power of 1/8, to the nearest integer? 4 What is 1208601 to the power of 1/8, to the nearest integer? 6 What is the square root of 405398 to the nearest integer? 637 What is 7469255 to the power of 1/3, to the nearest integer? 195 What is the square root of 14195698 to the nearest integer? 3768 What is 430853 to the power of 1/2, to the nearest integer? 656 What is 159137 to the power of 1/5, to the nearest integer? 11 What is the square root of 3038167 to the nearest integer? 1743 What is the third root of 1278836 to the nearest integer? 109 What is the sixth root of 691212 to the nearest integer? 9 What is the square root of 328389 to the nearest integer? 573 What is the square root of 2100798 to the nearest integer? 1449 What is the square root of 7348267 to the nearest integer? 2711 What is 60803 to the power of 1/8, to the nearest integer? 4 What is the cube root of 963070 to the nearest integer? 99 What is 639901 to the power of 1/7, to the nearest integer? 7 What is 14157431 to the power of 1/3, to the nearest integer? 242 What is the square root of 2544576 to the nearest integer? 1595 What is 370718 to the power of 1/10, to the nearest integer? 4 What is 22520956 to the power of 1/3, to the nearest integer? 282 What is 17402497 to the power of 1/8, to the nearest integer? 8 What is 131289 to the	{ "pile_set_name": "DM Mathematics" }
prob of sequence by. 1/13 Two letters picked without replacement from igcpggovvopi. What is prob of sequence pc? 1/66 Four letters picked without replacement from {l: 1, a: 1, j: 1, t: 1, b: 1}. What is prob of sequence ablt? 1/120 What is prob of sequence zz when two letters picked without replacement from hdhhdhzhddzh? 1/66 Two letters picked without replacement from mssaxaaampaapaaxm. Give prob of sequence xs. 1/68 Four letters picked without replacement from kqknmmkkmnmmn. Give prob of sequence nnnm. 1/572 Calculate prob of sequence np when two letters picked without replacement from {d: 1, i: 2, u: 1, b: 2, p: 3, n: 3}. 3/44 Calculate prob of sequence dkdk when four letters picked without replacement from dddddkddddddddkdkd. 7/408 Four letters picked without replacement from {s: 3, o: 5}. What is prob of sequence osso? 1/14 What is prob of sequence xx when two letters picked without replacement from {x: 3, e: 8}? 3/55 Two letters picked without replacement from uuffufkkkfk. What is prob of sequence kf? 8/55 What is prob of sequence kkkk when four letters picked without replacement from {g: 5, k: 7}? 7/99 Two letters picked without replacement from {c: 4, x: 2, m: 3}. What is prob of sequence cc? 1/6 Calculate prob of sequence iiy when three letters picked without replacement from yiyiyyyiiy. 1/10 Two letters picked without replacement from {e: 9, c: 10}. What is prob of sequence cc? 5/19 Four letters picked without replacement from {l: 1, w: 5, u: 6, y: 1, o: 2}. What is prob of sequence loow? 1/3276 Two letters picked without replacement from {e: 2, z: 1, p: 3, h: 4}. Give prob of sequence ez. 1/45 What is prob of sequence aaa when three letters picked without replacement from {r: 9, a: 11}? 11/76 Four letters picked without replacement from thkthwkhw. What is prob of sequence hwhh? 1/252 What is prob of sequence if when two letters picked without replacement from iiifiiiifiifiiii? 13/80 Three letters picked without replacement from ddhezdldzdz. Give prob of sequence hze. 1/330 Two letters picked without replacement from {h: 1, f: 9, p: 1, a: 5}. Give prob of sequence ph. 1/240 Four letters picked without replacement from scaxccamcxca. Give prob of sequence xccs. 1/297 Two letters picked without replacement from uqbbbtbutbbq. Give prob of sequence qq. 1/66 Calculate prob of sequence dk when two letters picked without replacement from bgbgbbkkaggakdafa. 3/272 Two letters picked without replacement from {j: 5, e: 4, p: 2, u: 2, y: 1, f: 1}. What is prob of sequence up? 2/105 What is prob of sequence sp when two letters picked without replacement from ppsppks? 4/21 What is prob of sequence sm when two letters picked without replacement from mmsmmmmmmmmmmmmsmmmm? 9/95 Calculate prob of sequence rjrj when four letters picked without replacement from {t: 2, v: 1, o: 1, r: 4, j: 3, b: 1}. 1/165 Three letters picked without replacement from avaavaaavvvaedaaeve. Give prob of sequence eed. 1/969 What is prob of sequence mtu when three letters picked without replacement from {f: 2, w: 1, e: 1, u: 1, m: 1, t: 1}? 1/210 Two letters picked without replacement from {t: 2, i: 1, y: 4}. What is prob of sequence yt? 4/21 Two letters picked without replacement from oozxooas. Give prob of sequence az. 1/56 What is prob of sequence hx when two letters picked without replacement from {k: 1, x: 2, r: 3, e: 3, h: 1}? 1/45 What is prob of sequence jjf when three letters picked without replacement from dfrjorfffjjjfrfrfjr? 70/2907 Four letters picked without replacement from uurruuuuuuuuuuur. What is prob of sequence uuru? 33/280 Calculate prob of sequence yys when three letters picked without replacement from {s: 4, y: 1, e: 8}. 0 Three letters picked without replacement from iii. Give prob of sequence iii. 1 Four letters picked without replacement from {a: 2, r: 2, z: 1}. Give prob of sequence arrz. 1/30 Four letters picked without replacement from {k: 2, d: 4, n: 11, f: 2}. What is prob of sequence ndnf? 55/5814 Three letters picked without replacement from {s: 2, y: 8, k: 4}. What is prob of sequence syy? 2/39 Calculate prob of sequence dd when two letters picked without replacement from {d: 4, u: 4, j: 4, m: 6, b: 2}. 3/95 Four letters picked without replacement from {f: 12, m: 1, s: 2, e: 3, x: 1}. What is prob of sequence fefm? 11/2584 Calculate prob of sequence ac when two letters picked without replacement from aaaaacaaaca. 9/55 Calculate prob of sequence qhh when three letters picked without replacement from hhhhqhhhhhhhhhhhhhh. 1/19 Two letters picked without replacement from {u: 1, g: 4, c: 5, e: 1}. Give prob of sequence gu. 2/55 Two letters picked without replacement from {n: 1, g: 1, u: 3, k: 1, t: 1}. What is prob of sequence tk? 1/42 What is prob of sequence mm when two letters picked without replacement from {m: 3, o: 10, p: 2, q: 1}? 1/40 What is prob of sequence oo when two letters picked without replacement from {o: 2, g: 9}? 1/55 Three letters picked without replacement from httxxttxjxx. Give prob of sequence hjt. 2/495 Four letters picked without replacement from {x: 6, i: 3, w: 1, c: 8}. What is prob of sequence cxii? 1/255 What is prob of sequence avat when four letters picked without replacement from vtaat? 1/30 Two letters picked without replacement from {f: 5, o: 1, j: 6, d: 3}. What is prob of sequence fo? 1/42 What is prob of sequence aaj when three letters picked without replacement from {y: 6, a: 2, j: 11}? 11/2907 Three letters picked without replacement from {z: 6, t: 2, m: 10}. Give prob of sequence tzt. 1/408 What is prob of sequence nan when three letters picked without replacement from annnnamnnnnnmnnmma? 55/816 Calculate prob of sequence vjjj when four letters picked without replacement from {f: 5, z: 2, j: 5, v: 7}. 35/7752 Calculate prob of sequence ee when two letters picked without replacement from {g: 8, e: 2, z: 5}. 1/105 Three letters picked without replacement from {q: 1, m: 1, a: 3, j: 1, t: 1}. Give prob of sequence maq. 1/70 Calculate prob of sequence kwa when three letters picked without replacement from wkkfa. 1/30 Three letters picked without replacement from aaqqqqnnno. What is prob of sequence aon? 1/120 Four letters picked without replacement from zzzzzzz. What is prob of sequence zzzz? 1 Calculate prob of sequence iriv when four letters picked without replacement from {i: 2, r: 1, x: 1, v: 2}. 1/90 What is prob of sequence pgx when three letters picked without replacement from pxxpppgpxppppxggppg? 88/2907 Four letters picked without replacement from fufuffffuuf. Give prob of sequence uuuu. 1/330 What is prob of sequence oo when two letters picked without replacement from {k: 3, j: 1, s: 2, w: 3, f: 2, o: 9}? 18/95 Calculate prob of sequence tkut when four letters picked without replacement from ktkdtttttukkktc. 1/156 Two letters picked without replacement from qfffffffqf. Give prob of sequence qf. 8/45 Calculate prob of sequence qbq when three letters picked without replacement from {u: 1, q: 4, b: 6, h: 1, k: 2, x: 1}. 12/455 What is prob of sequence pkkf when four letters picked without replacement from pfggkjkfgpkggpppgkk? 25/11628 Calculate prob of sequence iari when four letters picked without replacement from {r: 4, i: 2, a: 1, m: 1}. 1/210 Four letters picked without replacement from {x: 8, e: 5}. Give prob of sequence xxex. 14/143 What is prob of sequence xx when two letters picked without replacement from {r: 2, h: 1, x: 4}? 2/7 Calculate prob of sequence rp when two letters picked without replacement from ppoppppprpppopo. 11/210 Three letters picked without replacement from xrlnu. Give prob of sequence ulr. 1/60 Calculate prob of sequence xhxh when four letters picked without replacement from xhhxxxhhhx. 5/63 Calculate prob of sequence aaq when three letters picked without replacement from aaaqaaaaaaaa. 1/12 What is prob of sequence oooc when four letters picked without replacement from oooocceoocooc? 56/715 Two letters picked without replacement from {t: 4}. Give prob of sequence tt. 1 Calculate prob of sequence ir when two letters picked without replacement from zrikgrrzrzrb. 5/132 Four letters picked without replacement from evevzvzpevpvedveepd. What is prob of sequence ezpp? 1/1292 Calcul	{ "pile_set_name": "DM Mathematics" }
. -4 Let p(w) = -6w + 179. Let o be p(29). Solve -ob + 10 = -2j, 0 = -3j + 4j - b + 2 for j. 0 Let k = -178 + 182. Solve 0n = 5n - 4u + 14, 0 = -kn + 5u - 13 for n. -2 Let x = -236 + 236. Solve 3 = -p + 3k, -p + 4k + 0 - 4 = x for p. 0 Suppose -c = w - 10, -14 = 3w - 2w - 5c. Suppose -w = -r - 3v, r = -4r - v + 86. Solve -3 = -3p + 3m - r, -3p = 2m + 10 for p. -4 Let j = 337 - 333. Solve -4y + y = -3o + 21, 0 = -jo + 16 for y. -3 Let v = 1947 - 1942. Solve -4z + 4a = 28, -vz + 4a - 23 = 2a for z. -3 Let h(l) = 35l*2 - 9 + 32l*2 - 14l - 81l2 + l3. Let d be h(15). Solve 4j + 9 = -x, 0j = j + 4x + d for j. -2 Let x = -184 - -184. Suppose 0 = -xk - 4k - 5f + 32, -4k + 5f = -32. Suppose -3u = u. Solve -2n + 5g = -7, u = 3g + k + 1 for n. -4 Let p(s) = s2 + 4s + 10. Let i be p(-3). Suppose -5g + b = 6b - 25, -g - i = -3b. Solve 6y = y - 5r - 5, 3r + 5 = -gy for y. 2 Let m be 26/(-6) - (-9)/27. Let d(f) = -f - 1. Let o be d(m). Solve 2s - 26 = -4n, 5s = -on + 5n + 17 for s. 5 Let y = -35 + 67. Suppose 10m - y = 9m. Suppose -2 = 5h - 5i - m, h - 2 = 2i. Solve -2g = -h, 2g - 1 = -4f - 3 for f. -3 Suppose -4x + 2x + 28 = -2i, 5i - 10 = 0. Let t = x - 14. Solve -f + d - 3 = 0, 2f = 6f + td + 6 for f. -2 Suppose 0 = 3h + 4h - 28. Solve -3j = -hs + 3 - 4, 5s = -j - 6 for j. -1 Suppose 0 = -2t - 4x - 2, t + 14 = 3t - 4x. Let r(j) = -3j - 18. Let v be r(-7). Suppose 4o - 9 = vo. Solve 4l = 4u + 2 + 2, o = tl - 5u for l. -2 Suppose 0 = 3b + 2a - 4, 0b = -4b - 4a + 4. Solve 5s = 5n - 1 - 4, -bn - 5s - 19 = 0 for n. -2 Let w(n) = -2n3 - 17n*2 - 8n. Let s be w(-8). Solve -x + s = -3b + 5, 5x + 4b - 13 = 0 for x. 1 Suppose 93 - 90 = p. Solve -h = pl + 12, -5l - h - 20 = 2h for l. -4 Suppose 12 = 3w - 3. Suppose -wv = -3v - 6. Suppose vf - 9f = -24. Solve q = 2r + 7, 3q - 19 = fr - 0q for r. -1 Let k = 5 - 4. Let t = 3876 - 3871. Solve 3j - 3a + k = 4, 2a = -tj - 23 for j. -3 Let v(p) = -p - 20. Let b be (-142)/6 - (-3)/(-9). Let z be v(b). Solve -zq = 3t + 20, -15 = 3q - 2t + 3t for q. -5 Let l = -5 + 9. Let b be 160/30(30/8)/5. Solve 19 = 6i - i - lc, 0 = bi + 3c - 9 for i. 3 Suppose 12 = -42n + 45n. Solve -5w = 4z - 5, -nw - 3z = w for w. -3 Suppose -2r + 8 = -88. Suppose -2k = -0k - r. Let z be (-2)/(3(-4)/k). Solve 4c + 2 = 2b, 3b + 9 = -2c - z for b. -3 Suppose -4f = 5f - 144. Suppose -fr = -29r + 78. Solve -18 = o + 5b, 2o - r = -o + 5b for o. -3 Let g(n) = -n*2 - 5n. Let f be g(-4). Suppose -r - 2 = 3. Let y = 10 + r. Solve -fp + 12 = -0p, -y = -5z + 5p for z. 4 Let b = 25 + -20. Suppose t = -2i + 11, 17 = bt - 8. Suppose -in - 9 = 0, -5n = -5a + 4 + 11. Solve w + 8 = -aw + 2y, 8 = 2y for w. 0 Let m be 4(4 - (-33)/(-12)). Solve 4o = 4z, m = -5o + z + 13 for o. 2 Let v = 65 + -63. Suppose -5y = 15 - 0, 0 = x - vy - 9. Suppose 4s = -k + 42, -14 = -s - s + 3k. Solve 6l - 5o + 12 = xl, l + 3o = s for l. 1 Let h(d) = -d*2 + 5d + 16. Let c(u) = -u*2 + 8u - 9. Let g be c(4). Let s be h(g). Solve sf + 4k - 12 = 0, -3f + f + 5k = 24 for f. -2 Let g(s) = -7s + 23. Let w be g(3). Solve 6z - 20 = 4v + z, 0 = -wv - 3z + 12 for v. 0 Let a = 6 - 1. Suppose 6j + 5r = j, 0 = -4j + ar. Suppose -5h + j + 20 = 0. Solve hg = u + 2u + 11, -5g + 14 = -4u for g. 2 Let g(z) = -z - 40. Let n(c) = 2c + 39. Let v(r) = -4g(r) - 5n(r). Let k be v(-6). Solve 4j - q = 4, 2j = q + 5 - k for j. 0 Suppose -37 + 19 = -6s. Solve 3m - 17 = -g, -4m + 18 = -4g + sg for m. 5 Let d(a) = 3a - 32. Let r be d(12). Solve rm - 3y = 5, 2y + 2 + 3 = m for m. -1 Suppose -u + 33 = 4x + x, -5u - 5x + 65 = 0. Solve -q = 5h - h + u, -3 = h for q. 4 Let n = -93 + 96. Let i(c) = 11c - 17. Let g be i(n). Solve -8x + 10 = -3x, -2r = -4x + g for r. -4 Let f(p) be the first derivative of -p4/4 + 4p*3/3 - 6p - 1. Let h be f(3). Solve -3n - ho = -2o + 13, -n = -5o - 17 for n. -3 Suppose 0 = -4x + 6x + 10, -x = -5p + 115. Solve -5i + 3f = -p, 2i + 4 = 4f + 10 for i. 5 Let f(m) = 5m - 4. Let n = -9 - -5. Let r be ((-3)/n)/((-7)/(-28)). Let b be f(r). Solve 3v + 2u + 9 = -b, 0 = 5v + 2u + 28 for v. -4 Let a(f) = -f*2 - 11f + 2. Let y be a(-11). Let j(k) = -k*2 - 53k - 658. Let c be j(-20). Solve yg - 2n + 5n - 5 = 0, -cn = 2 for g. 4 Let o = 676 - 648. Solve 16 = 5d - 4d + 5b, 3d - 4b + o = 0 for d. -4 Suppose -4c - c - 28 = -4x, 24 = 4x - 4c. Let a = 120 - 222. Let b be ((-10)/(-85) + 46/a)0. Solve -5u - 2r + 6 = x, b = u - 2r + 4 for u. 0 Let m = 13 - 8. Suppose 3f = -0f + ms + 48, 3s = 3f - 42. Suppose f = -4t + 31. Solve q - w - 5 = -0, -3q + tw = -25 for q. 0 Let x = -120 - -128. Suppose -10 = -r - x. Solve 0 = 4v - 5l + 41, -3v - rl + 13 = 3l for v. -4 Let d(g) = -g*3 - 7g*2 - 12g + 7. Let a be d(-5). Solve -2c - a = -5l, -12 = 4c - 3l + 1 for c. -1 Let o(v) = -v*3 + 17v*2 + 19v - 8. Let k be o(18). Suppose 11w = 13w - k. Solve -c - wq + 25 = 0, c = 6c + 4q - 41 for c. 5 Suppose 6 = -f - 7. Let i be 111/39 + (-2)/f. Solve ib - 10 = 4m, 2 = -3m + 4m - 3b for m. -4 Let i = 122 - 121. Solve -3f + 2n = i - 8, 4n + 17 = 3f for f. -1 Suppose 16h = 14h. Let v(x) = x*3 - 2x*2 + 20. Let r be v(h). Solve -5g - r = -s + 3s, 8 = -2s + g for s. -5 Let y(a) = a*2 - 2a - 3. Let w be y(3). Suppose -4c + w = -4. Suppose c - 4 = -o. Solve 0 = -3p + 3, 0s - os = -5p - 10 for s. 5 Let b(z) = z3 - 7z*2 + 11. Let f be b(8). Suppose t + 2t = f. Solve 0 = 2h - 2l + 14, -t + 1 = 4h - 2l for h. -5 Let w = -1379 - -1379. Solve -y + 4n + 6 = w, 0 = y + 2n + 3n + 12 for y. -2 Suppose 1 = p - 11. Suppose -57 = -4v + w, -4w + 2w - 58 = -4v. Suppose f - 2i = -f + v, -p = 4i. Solve 5h - 13 = -fr, 0r = -r - 3 for h. 5 Let r = 566 - 544. Solve 0b + 5b = -2h - 24, -3b = 5h + r for h. -2 Suppose 2u = -2c - 14, -c - u + 6u = -5. Let t = c - -5. Solve -2y + 4q + 10 = t, -q + 3 = -4q for y. 3 Suppose 23 = 8s - 17. Solve -sh + 2l = -30, 0 = h + 3l - 2l + 1 for h. 4 Let y be (-6)/12-32. Suppose -ys = 4z - 24, -s + 10 = 2z + 2. Solve -5r + 5v + 2 + 3 = 0, 3r = 4v + s for r. -4 Let o = 10 - 10. Suppose oh = 4h - 20. Suppose hq - 12 - 8 = 0. Solve -qf + 4i = -1 + 17, 2f - 4i + 8 = 0 for f. -4 Let n(m) = -m - 6. Let i be n(-11). Suppose 5y = ih - 25, 10h - 23 = 5h + 4y. Solve z - 4u + 1 = 0, 2z + 11 = 2u + h for z. -5 Let i(p) = -p - 2. Let j be i(-2). Let y be (-23)/(-6) + 1/6. Solve -4t + 0b = yb + 20, j = 5t - 4b + 25 for t. -5 Let p be (-213)/(-18) + 14/84. Solve 0g + p = g + 5j, -2g - 4j + 12 = 0 for g. 2 Let l(v) = 71v + 8. Let n be l(0). Solve y - 2y = 2r + n, -r = 5y - 5 for r. -5 Suppose -4p + 9 = 2m - 13, 4m - 29 = -3p. Suppose -ph - 2h - 20 = 0. Let j = h - -6. Solve 0 = 5d + w - 30, 3d - w = jw for d. 5 Let l = -206 + 208. Solve 3h = -5t - 13, -lt - 4 = -3h + 18 for h. 4 Let b(f) = -f*2 + 8f - 1. Let n(d) = -d - 1. Let v(k) = -b(k) - 2n(k). Let x be v(6). Solve 2y = 3i - 12, -xy + 4 = i - 0 for i. 4 Let a be 6/((-1)/((-3)/6)). Suppose -x = -ax - 4. Let j = x + 6. Solve 5i + 8 = i + jo, 2i + 13 = 5o for i. 1 Let w = -84 + 91. Solve j + g = 3j + w, 0 = -5j + 2g - 15 for j. -1 Suppose -3v - 22 = -16. Let i be ((-2)/(-1))/((-1)/v). Solve iy = -k + y + 3, -5 = -3k - 5y for k. 0 Let z = -1006 - -1010. Solve -2p + 7 = 2p + 3q, -4p - zq = -4 for p. 4 Let d = 92 + -89. Solve -r - 2t = 3t - 3, 0 = r + 3t - d for r. 3 Suppose 134 - 142 = -4t. Solve -o + t = -0v - 4v, -5o = -2v - 10 for v. 0 Let w = 78 + -30. Let f = w - 46. Solve -x - y - 8 = 0, 6y + 37 = -5x + fy for x. -5 Let z(x) = x*3 + 14x*2 + 12x - 11. Let b be z(-13). Suppose -bh = -0h - 8. Solve -hl + 4j = -l + 12, 2l - 5j + 8 = 0 for l. -4 Let t(b) = 9b + 22. Let v(s) = 4s + 11. Let l(r) = -3t(r) + 7v(r). Let k be l(-7). Suppose -6 = -2d - 0d. Solve 5p - 10 = ko, 2p + d = -4o + 7 for p. 2 Let r = -1870 + 1885. Solve 0j - 2 = -j, 5m = -5j + r for m. 1 Suppose 4t = 3k - 46, -28 = -2k + 5t - t. Solve -s - 4 = -2s, -k = 2g - 3s	{ "pile_set_name": "DM Mathematics" }
nearest to 0.1 in -0.2, f, a? -0.2 Let g be (12/(-8) - (-7)/28) + (-15)/(-10). Which is the nearest to -0.2? (a) -2/11 (b) -73 (c) g a Let j = -0.1 + -0.3. Let p = 258.53 - 259.03. What is the closest to -2/5 in 0.3, 1/9, p, j? j Let a = -2821 + 2820.6. What is the closest to 0.2 in 383, a, 1/5? 1/5 Let s = -0.01 - 0.29. Let v = -0.003686 - -1.003686. Let l = 50 - 452/9. What is the closest to v in -0.22, l, s? -0.22 Let s = 32.566 - 32.966. Let i = 16 + -14.9. Which is the closest to i? (a) s (b) -1 (c) -1/5 c Let n = 2 - -2. Let q = -672 + 242. Let u = -428 - q. Which is the closest to n? (a) 0 (b) u (c) -4 b Let q = -12.08 + 12.38. What is the closest to 0 in 1162, q, -1? q Let v = -529 + 208. Let k = v - -319. What is the nearest to 2 in k, 1, -4? 1 Let s = 25799 - 25799.1. Which is the nearest to 1? (a) s (b) -2 (c) 0.09 (d) 11/3 c Let l = 28613/11 - 2601. What is the closest to -79 in -2, l, 4? -2 Let x = -634763/2 - -300243291/946. Let y be (20/(-86))/(0 + -1). Let l = x - y. Which is the nearest to 0.1? (a) -5 (b) 0.4 (c) l c Let d be 1/(-6) - (-15 - (-3 + 834/(-72))). Suppose -2w - 2 = 2. What is the nearest to -1/4 in 2, d, w, -3? d Let p be 9/28 - (-21)/49. Let i = 493 + -495.23. Let r = -0.23 - i. Which is the nearest to -0.12? (a) r (b) 1/4 (c) p b Suppose -4i + 5f = i - 260, -4f = -3i + 152. Let j be (i/(-245))/(3/15-2). What is the closest to 1 in j, 1/4, 2/7, -30? j Let o = -640 + 400. Let d = o - -222. Which is the closest to -1? (a) 0.2 (b) 1/2 (c) d a Let z = -4.86815 + -0.00985. Let m = -0.122 + z. What is the nearest to 3 in m, 4, -1/3? 4 Let f(n) be the first derivative of -n*2/2 + 21n - 4. Let i be f(21). Suppose 2q - 7 = -5. What is the closest to q in -0.2, i, -7? i Let u be (-12 - -1)/(-4). Let c = -486 + 243. Let b = c - -241. What is the nearest to 1 in 1/7, u, b? u Let i = 26.3 + -29. Let g = i + 2.7. Let l = 0.2 + -0.1. Which is the closest to g? (a) l (b) -5 (c) -1 a Let h = 2136 + -2118. What is the nearest to -2 in -0.2, h, 3/4? -0.2 Let v = 405.7 + -406.1. What is the closest to 6/5 in 0, 5, 1, v? 1 Let b = -0.5068 + -18.4932. Let w = -16 + 19. Let f = w + -2. What is the nearest to 2/7 in b, -4, f? f Suppose -784 + 3817 = -9u. Let h = 337 + u. Which is the nearest to h? (a) -1/4 (b) -9 (c) 2 a Let w = 105.72 - -2.28. Let o = w - 108.2. Suppose -2u - 28 = 2j, -3j + 5 - 3 = -u. Which is the nearest to u? (a) o (b) -1/9 (c) -0.5 c Let x = -4.09 + 4.19. What is the nearest to x in -2/13, 9, -68? -2/13 Let g = -1783/9867 + -1/897. Let m be 1/(-5)2/1. Let d = -1 + 1. Which is the closest to d? (a) m (b) 0 (c) g b Let o be 1(10 + (-155)/15). Let d = 9 - 8.9. Let i = -1.3 + 0.3. Which is the nearest to i? (a) d (b) o (c) -0.4 c Let i = -0.024 - 78.976. Let t = i + 79.15. Let r = -42 - -81/2. Which is the nearest to 1/3? (a) r (b) t (c) 4/5 b Let k = -1.8 - 7.2. Let g = -14 - k. Let t = 1235.065 - 1239.065. Which is the nearest to g? (a) t (b) 3/5 (c) -1 a Suppose 4j - 44 = -3k, -2k - 5j = -3j - 26. Let q be -8 + k + (-8)/(-28). Which is the closest to q? (a) 0 (b) 23/3 (c) 0.4 c Let n = -164 - -163.9. Let g = 7.2 - 9.2. Which is the nearest to 129? (a) -5 (b) g (c) n c Let k = 5 + -6. Let d = -32899/65 + 2533/5. What is the closest to -0.1 in -5, k, -2/9, d? -2/9 Let a be 4(162/(-20) - -8). What is the closest to -0.1 in 5, 34, a? a Let m = -4114 - -4112.2. What is the nearest to 0 in 19, -2/15, m, -5? -2/15 Suppose h + 0d + 15 = 5d, -4h - 5d = -40. Suppose 30 + 19 = 7i. Let w be -1 - (1 - i/3). What is the closest to 0.2 in h, w, -1? w Let x be (99/(-297))/(0 - 3/(-9)). What is the nearest to -4 in x, -3, -3/4, -2? -3 Let i = 21 - 20.67. Let r = i + 0.06. Let o = -1.61 - r. What is the closest to 1 in -3, o, -0.1? -0.1 Let z = 50.5839 + 0.0161. Let i = 52.6 - z. What is the closest to -0.2 in i, 0.2, -1/5, -1/11? -1/5 Let z = 1.513 - 1.913. Let m = -0.18 - 1.82. Which is the nearest to m? (a) -2 (b) z (c) -4 a Let l = -0.2902 + -0.1098. Which is the nearest to -1? (a) 1/6 (b) 0 (c) l c Let d be (-1022)/3652/2-5. Let v = 3.1 - -0.9. What is the closest to d in v, 2/15, 0.1? v Let t = 10359 + -10360.995. Which is the nearest to t? (a) -0.5 (b) -0.4 (c) -2 c Let v be (-56)/(-102) - 6/9. Let r = -388 + 383. Which is the closest to -3? (a) -1/7 (b) v (c) r c Let m = 72.94 + -68.94. What is the closest to 1/14 in m, 1/3, -4, 0.2? 0.2 Let g = 11 + 0. Let y = g + -11.2. Let a = -0.011 - 0.489. What is the nearest to -2 in 4, a, y? a Let a = 1.364 + -1.4. Let i = 1.09 + -0.654. Let f = a + i. What is the nearest to 2/13 in 0.5, f, -0.1? f Let a = -0.09358 + -0.30642. Let u = 1 - 2. What is the closest to a in u, 4, -0.5? -0.5 Let i = -7855.7 + 7855.5. Let g be (1/(-2))/(2/(-4)). What is the nearest to g in 2, i, 2/9? 2/9 Let k = 3748 + -3750. What is the nearest to k in -2/7, -4, -378, -2/13? -2/7 Let x = -814.5 + 813.1. Which is the nearest to x? (a) -1/7 (b) 2/9 (c) -4 a Let g = 17.366 - 0.266. Let p = g - 17.5. What is the nearest to 3 in 5, -0.5, p? 5 Let v(q) = -q3 + q2 + q - 1. Let k be v(1). Suppose k = -9t + 8t - 1. Which is the nearest to -0.2? (a) -3 (b) 2 (c) t c Let a = 1.877 + -1.7841. Let f = 9.9071 + a. What is the closest to -1 in 3, 2/11, f, 1/4? 2/11 Let m = -0.17068 + 0.23068. Let y = 30651/1015 - 8/145. Let l = 30 - y. Which is the nearest to l? (a) m (b) -4 (c) -5 a Let u = 1284 - 1269. Let o = 0.42 + -18.42. Let q = u + o. Which is the nearest to -2? (a) 0.3 (b) -0.1 (c) q c Let p(f) = -21f. Let q be p(4). Suppose -3u = -4h - 319, -2h + u - 122 = 41. Let v = h - q. Which is the closest to 1? (a) v (b) 2 (c) 1/2 c Let f be (-241)/292 - 20/(-80). Let o = -8966/657 + f. Let s = o - -586/45. What is the nearest to 2 in s, -1/8, -5? -1/8 Let p = 54 - 215/4. Let r = 727 + -619.4. Let z = -108 + r. What is the nearest to -1 in p, -1.1, z? -1.1 Let v = -92 - -95.025. Let m = -0.025 + v. Let i = m + -4. Which is the nearest to -2? (a) -1/4 (b) -1.1 (c) i b Let q = 3321 + -3315. Which is the nearest to 2? (a) q (b) -1 (c) -3/4 (d) 1/7 d Let f = -14.93 - -13.93. What is the closest to -4.7 in -3, 4, 2/11, f? -3 Let p = 80.177 - 80.077. Let m be ((-32)/14 - -2)2. What is the nearest to 0.3 in -0.3, p, m, -3/2? p Let f be (-32)/66 + (-4)/(-6). Let s = -25.7999 + 28.726. Let a = s + 0.0739. What is the closest to -1 in f, a, -2/13? -2/13 Let s = 1525 - 1586. Which is the nearest to 1/4? (a) 0.4 (b) s (c) 2 (d) -2/5 a Let y(u) = u*2 + u - 34. Let t be y(18). Let j be (0 + -1)/(t/(-56)). What is the nearest to 1 in j, -3/8, 0.2, 4? 0.2 Let d = 47110.7 - 47111. Let u = 1 + 6. Let m = 5 - u. Which is the nearest to -0.04? (a) m (b) 2 (c) d c Let c = -1.536 + 3. Let d = c + 0.536. What is the closest to 2/3 in 4/5, 0.3, d? 4/5 Let t = 0.3 + -0.1. Let d = t + -0.5. Let q = -16365 + 16366. Which is the closest to 0? (a) 4/9 (b) d (c) q b Let p = 247 + -248. Let x = p - -4. What is the closest to -3 in x, -1/3, -0.4? -0.4 Let k = 2.16719 - 0.16719. What is the closest to -1 in -2/11, -8, k? -2/11 Let q = 2456.2 + -2456. What is the closest to q in 5/2, 10, 2/5, 0.04? 0.04 Let r = 8501 + -8494. Which is the closest to -19? (a) 1 (b) r (c) -4 c Let n = 21611/445 + 16/445. Let g = 48 - n. Let c(d) = -d - 1. Let w be c(0). What is the nearest to 0 in w, -0.1, g? -0.1 Let m = -2.67 + 19.17. Let w = m - 14.5. What is the closest to w in 1/2, -5, -2? 1/2 Suppose 308f - 5312 = 225f. What is the closest to -2 in f, 1, 3? 1 Let m = -27.8 - -26.14. Let q = m + 1.56. Which is the nearest to 0.3? (a) 2/5 (b) 3 (c) q a Suppose 78n - 81n = -57. Suppose 2p - 30 = 5s - 3p, 4s - 3p = -n. Let v be (s/(-5))/(-1) + (-98)/210. Which is the closest to v? (a) -6 (b) 0.1 (c) -5 b Let j = -10.116 + 4.116. What is the closest to 2/33 in 0.06, 2/9, j? 0.06 Let i = -105646935/562807 - -3/80401. Let o = -188 - i. Let r = -4.1 + 4. Which is the closest to r? (a) 5 (b) o (c) 2/7 b Suppose -2f + 0f = 752 - 796. Which is the closest to f? (a) -1 (b) -13 (c) -5 a Let d = 15964/11 + -590756/407. What is the closest to 0 in d, -4, -0.03? -0.03 Let u = -1497/2 + 749. Which is the nearest to -4? (a)	{ "pile_set_name": "DM Mathematics" }
et z(q) be the first derivative of -2q3/3 + q - 1161. Let w(j) = -2j*2. What is z(w(o))? -8o*4 + 1 Let h(w) = 975w*2. Let v(q) = -6060q*2. Give h(v(t)). 35805510000t4 Let d(c) be the first derivative of c3/3 - 1. Let n be ((-28)/14)/(24/(-3756)). Let a(l) = -1864l + 946l + nl. Give d(a(u)). 441u2 Let w(q) = q. Let y(b) be the third derivative of 0 - 5/3b*3 + 2b + 1/8b4 + 41b*2. Determine y(w(l)). 3l - 10 Let i(h) = 136h - 2. Let m(d) = -d. Let p(t) = 12t. Let s(v) = -6m(v) - p(v). Let b(a) = 2i(a) + 44s(a). Let q(r) = -r. Give b(q(y)). -8y - 4 Let p(f) = 8f + 9f - 21f + 6f. Let k = 127 - 257. Let z(g) = -220g2 + 65. Let d(y) = 10y*2 - 3. Let j(h) = kd(h) - 6z(h). Calculate p(j(s)). 40s*2 Let x(q) = -135q. Let m(t) = 4t - 3. Let g(s) = -31s + 16s + 16 - 7s. Let u(v) = -3g(v) - 16m(v). Calculate u(x(a)). -270a Let n be 2166 + (-1)/(5/(-10)). Let s(t) = 2t2 - nt + 334t. Let d(z) = -z - 5z + 0z + 0z. Determine d(s(o)). -12o2 Let n(t) = -138t. Let i(g) = 253g - 8. Let j(z) = 158z - 5. Let u(o) = -5i(o) + 8j(o). Give n(u(p)). 138p Let p(f) = -8f - 1 + 1. Let o(w) = -3 + 14330w2 - 14326w*2 + 3. Give p(o(q)). -32q*2 Let r(t) be the first derivative of 3t*2/2 + t - 4. Let s(v) be the first derivative of 3v + v*2 - 4v + v + 44. What is s(r(w))? 6w + 2 Let h(k) be the third derivative of -181k*5/60 - 347k*2 + 3k - 1. Let j(d) = -30d2. Determine j(h(z)). -982830z4 Let r(p) = p3 + 7p2 - 9p - 3. Let z be r(-8). Let k(s) = 2s + 0s + 2s - zs. Let g(n) = 3n2. What is k(g(b))? -3b2 Let u(x) be the third derivative of -x4/12 + 78x2. Let o(w) = -1. Let q(y) = y - 10. Let d(h) = -2o(h) + q(h). Determine u(d(b)). -2b + 16 Let k(l) = -29l + 40. Suppose -6u + 8 + 28 = 0. Let p(m) = 16m - 20. Let c(o) = uk(o) + 11p(o). Let n(f) = -2f. What is c(n(i))? -4i + 20 Let y(i) = 2i2. Suppose h = 4h - 21. Let m(p) = p*3 - 6p*2 - 3p - 15. Let n be m(h). Let w(a) = -15a - na + 36a - 11a. Calculate w(y(d)). -6d2 Suppose -36 - 6 = 3x. Let r(w) = -w*2 - 14w + 4. Let l be r(x). Let c(q) = 10q2 - 6q*2 + 4 - l. Let d(j) = j. Give d(c(a)). 4a*2 Let j(a) = -3873126a*2. Let y(m) = -7m. Determine j(y(r)). -189783174r2 Let j(p) = -8p + 2. Let u(x) be the third derivative of 0x3 + 1/12x*4 - 54x*2 + 0x + 0. Calculate j(u(f)). -16f + 2 Let a(r) = 36r - 1. Let h(u) = 11u2 + 12673. Give h(a(c)). 14256c*2 - 792c + 12684 Let a(n) = 7n. Let g(q) = 51q*2 + q - 13132. Give a(g(y)). 357y*2 + 7y - 91924 Let l(q) be the first derivative of -11q3 - 70 + 9 + 0. Let u(p) = 2p. What is l(u(a))? -132a2 Let t(s) be the third derivative of s4/8 - s2 + 15s + 4. Let v(d) = -194d - 3. Let r(h) = -31428h - 485. Let c(x) = 3r(x) - 485v(x). What is t(c(z))? -582z Let m(k) = -15k*2. Let s(o) be the first derivative of 7o*2 - 17o + 15. Let b(q) = -q + 3q + 0q - 6 + 3q. Let z(w) = 17b(w) - 6s(w). What is m(z(x))? -15x*2 Let n(x) = 1833792x2 + x - 2. Let v(c) = -c2. Calculate n(v(p)). 1833792p4 - p2 - 2 Let m(y) = 8y*2 + 6y. Let s(n) = 3n - 114. Let d(o) = 91o - 3591. Let l(p) = -2d(p) + 63s(p). What is m(l(q))? 392q2 + 42q Let t(k) = 21520k2. Let i(w) = 2w - 24. Calculate i(t(r)). 43040r2 - 24 Let x(b) = -1. Let g(k) = k2 - 6. Let s(p) = -g(p) + 6x(p). Let d(m) be the second derivative of 1 + 0m2 + 0m*3 + 7/12m*4 + 19m. Give d(s(q)). 7q4 Let s(y) = 14y. Let k(c) = -136082c2 + 7c. Calculate k(s(q)). -26672072q2 + 98q Let z(j) = -197578613j. Let u(h) = 2h*2. Give u(z(n)). 78074616630007538n*2 Let l(j) = 690503j. Let b(x) = -9x. Determine b(l(a)). -6214527a Let t(k) = -2k2 - 2296. Let u(d) = -6d*2 - 2d + 1. Let f(z) = -23z2 - 8z + 4. Let h(y) = -f(y) + 4u(y). Determine t(h(m)). -2m*4 - 2296 Let r(u) = -14u2. Let z(k) be the second derivative of -k4/6 - 55k2 - 2k - 4520. Calculate z(r(i)). -392i4 - 110 Let a(g) be the second derivative of g4/2 - 2264g. Let p(k) = -65k. Determine p(a(n)). -390n*2 Let q(v) = -112908v + 873. Let b(t) = -259t + 2. Let m(y) = -873b(y) + 2q(y). Let s(f) = -f2. Give s(m(p)). -84681p*2 Let a(s) = -2s. Let q(h) = 29h - 94684. Determine a(q(r)). -58r + 189368 Let i(j) = 0j + 246j*2 + 0j - 102j2 - 175j*2 + 1. Let q(d) = -24d. What is q(i(f))? 744f2 - 24 Let m(d) = 30035d*2. Let o(i) = -314i. Calculate o(m(u)). -9430990u2 Let s(o) = 31o*2 + 5o. Let q(x) = 392769x. Determine s(q(h)). 4782292108191h*2 + 1963845h Let m(j) = 192923j. Let k(b) = -2559b. Determine m(k(x)). -493689957x Let b(s) = 511s. Let w(v) = 12660v. Determine w(b(d)). 6469260d Let t(l) be the third derivative of -l*5/5 + 2620l*2. Let c(v) = 26v*2 - 2. Determine t(c(m)). -8112m*4 + 1248m*2 - 48 Let p(u) = -33u*2. Let f(c) = 4c*2 + 14c + 21. Let i(n) = 4n + 8n - 3n - 7n + 9 + 4n + 2n*2. Let a(m) = 6f(m) - 14i(m). Determine p(a(o)). -528o*4 Let x(u) = -3u*2 - 85u + 288. Let z(h) = h*2 + 30h - 97. Let d(m) = -6x(m) - 17z(m). Let f(r) = -5r. What is d(f(i))? 25i*2 - 79 Let y(n) = 47n + 3. Let h(o) = 4o - 73. Let f be h(19). Let p(z) = 236z + 16. Let k(x) = fp(x) - 16y(x). Let m(i) = 2i2. What is m(k(a))? 3872a*2 Let k(t) = 7t + 5. Let c(b) = 12104b2 + 534b - 9345. Let x(v) = -91v2 - 4v + 70. Let m(d) = 2c(d) + 267x(d). What is k(m(n))? -623n2 + 5 Let l(c) = -120 - 1181 - 2c - 238. Let x(s) = -2s2. What is l(x(u))? 4u*2 - 1539 Let p(u) = 265u*2 - 2. Let m(w) = -5w*2 - 1. Let d(h) = 4m(h) - p(h). Let y(g) = -2g2. Determine d(y(c)). -1140c*4 - 2 Let c(j) be the first derivative of 2j*3/3 + 6925. Let i(l) = 7l*2 - 5l + 5. Let a(p) = p*2 + p - 1. Let q(x) = -20a(x) - 4i(x). What is c(q(y))? 4608y*4 Let o(p) be the second derivative of -23p3/6 + p2 + 14p - 19. Let b(w) = -15w*2. Calculate b(o(f)). -7935f*2 + 1380f - 60 Let y(z) = -z*2. Let p = -26 + 12. Let h = p - -17. Let q(r) = hr - 2r + 4r. Determine y(q(i)). -25i2 Let o(l) = -2482l. Let g(x) = 40x - 11. What is g(o(j))? -99280j - 11 Let o(n) = -6430n2 - 80n - 320. Let d(i) = 714i2 + 9i + 36. Let m(b) = -80d(b) - 9o(b). Let g(q) = q*2. Determine g(m(h)). 562500h*4 Let f(y) = 274438y*2 - 3. Let o(b) = -10b. Determine o(f(j)). -2744380j2 + 30 Let g(p) = p2 - 6176p. Let f(q) = -5123q. Give g(f(y)). 26245129y*2 + 31639648y Let h(o) = 2o2. Let c(m) be the third derivative of -1579m5/60 - m3/3 + 53m2 - 2. Give h(c(f)). 4986482f*4 + 12632f*2 + 8 Let m(s) = -16752s. Let i(w) = -3w2 - 32w - 24. Let h(p) = p*2 + 12p + 9. Let z(n) = 8h(n) + 3i(n). Give m(z(b)). 16752b2 Suppose -163 = 3r - 598. Let i(g) = -rg + 289g - 147g. Let d(c) = -10c*2. What is d(i(b))? -90b*2 Let z(q) = 1929q + 2626q + 493q + 229q. Let l(t) = -2t. What is l(z(w))? -10554w Let v(g) = g3 + 10g*2 - 3g - 19. Let m be v(-9). Let o = m - 65. Let f(h) = 72h - 27h - 22h - oh. Let k(a) = 9a2. Calculate f(k(s)). -9s*2 Let t(d) = 118d - 117d - 5d*2 + 4d*2 - 8d*2. Let o(k) = 2k*2. What is o(t(b))? 162b*4 - 36b*3 + 2b2 Let g(u) be the third derivative of -u4/24 + 17u3/3 - u2. Let c(z) = 9z + 104z - 154z + 40z. Determine g(c(b)). b + 34 Let b(u) = -10u. Let n(w) = 2124647w. What is n(b(d))? -21246470d Let j(t) = 6869t. Let h(c) = -2653c*2. Calculate h(j(q)). -125176926133q2 Let p(o) be the third derivative of -o5/20 + o*2 - 2o - 610. Let k(g) be the third derivative of 13g5/20 - 5g*2. Calculate p(k(b)). -4563b*4 Let u(g) be the second derivative of -5g*4/12 - 5g*3 - 38g + 2. Let x(r) = -5r2 - 25r. Let t(k) = 5u(k) - 6x(k). Let l(v) = -6v - 1. Give l(t(z)). -30z*2 - 1 Let l(h) = -5h*2. Let u(j) = -649776j. What is l(u(x))? -2111044250880x2 Let b(x) = -6x*2. Let l(w) = -758w*2 + 6w. Let f(v) = 20464v2 - 160v. Let g(s) = 3f(s) + 80l(s). Give b(g(q)). -3393024q4 Let h(j) = 2j*2. Let f(i) = -210i - 23i - 579i. Calculate h(f(y)). 1318688y2 Let l(p) = 2p. Suppose -4a + 146 = 2u, 0 = -a - 5u + 40 + 10. Let d(t) = 2t + 12 + 31 - a	{ "pile_set_name": "DM Mathematics" }
-257 in 2, -17/4, 1/4? -17/4 Which is the nearest to 2/11? (a) 1/5 (b) 57 (c) 0.4 a What is the closest to 0 in -1, 2/23, 1283, 5? 2/23 What is the nearest to 0 in -266, -1, -4/5, 0.1? 0.1 Which is the closest to 2/9? (a) -8/5 (b) 452 (c) 0.5 (d) 5 (e) 2 c Which is the nearest to -2? (a) -1/37 (b) 5 (c) 92 (d) 1 a What is the nearest to -2/9 in 0, 0.1001, -1/3? -1/3 What is the closest to -4 in 0.1, -2/5, 5613? -2/5 Which is the closest to -1/4? (a) 447 (b) 0.02 (c) -4 b What is the closest to 6 in 22, -0.2, -8.6? -0.2 What is the closest to 232 in 6, 0, -4/5, 64, -2/13? 64 What is the closest to 0.1 in 0.4, 0.2, 1/7, -23.1? 1/7 What is the nearest to 0.2842 in 3, 1, -1, 0.5, 14? 0.5 What is the nearest to -2 in -9/8, 5, 16, -0.11, -2/13? -9/8 Which is the closest to 2? (a) 24 (b) 3/8 (c) -7/3 (d) -108 b Which is the closest to -1/5? (a) 2 (b) -3 (c) 2.24 (d) 3 (e) 0.08 e Which is the nearest to -0.064? (a) 0.2 (b) -2 (c) -164/3 a Which is the nearest to 1? (a) -4 (b) 0 (c) 68 (d) 1/36 d What is the nearest to -63 in 0.3, -9, 3/4, -3, 1.6? -9 Which is the closest to 0.1? (a) 3 (b) -2 (c) -42/103 c What is the closest to -292 in -0.1, 0.4, 29, -3? -3 Which is the closest to -0.01? (a) 1/11 (b) 96 (c) -3/100 c Which is the closest to 0.1? (a) -0.83 (b) -0.01953 (c) -0.5 b What is the closest to -2/5 in 2/39, -2, -2/533, -3? -2/533 Which is the closest to 0.1? (a) -0.3 (b) 696471 (c) -1/5 c What is the nearest to -0.15 in -4, -14, 3, -5, -1? -1 Which is the closest to -0.1? (a) -2/49 (b) -9 (c) -1 (d) 0.2 a Which is the nearest to 1/2? (a) 1/8 (b) -8 (c) -1/13 (d) -3 a Which is the nearest to -0.1? (a) -179 (b) -0.5 (c) -11 (d) -4 b Which is the nearest to -2/9? (a) 270 (b) 43 (c) 0 c Which is the closest to 0.1? (a) -2/5 (b) 5 (c) -0.5 (d) 846 a What is the closest to 1 in -2/39, 5/4, 0.2, 2? 5/4 What is the nearest to -2 in 0.3, 0.2, -0.4, -12.8? -0.4 Which is the closest to -1? (a) 5.3 (b) 0.1 (c) 0.044 c What is the nearest to 713 in 0.4, -35, 2/9, -5? 0.4 Which is the nearest to -2/3? (a) 28 (b) -2/377 (c) -0.2 (d) -6 c What is the closest to -2 in -4, -2.7, 0.4, 19? -2.7 What is the nearest to 0 in 1/4, -2/9, -1/2, 37907? -2/9 What is the nearest to -4 in 11, -1, 0.4, 1, -28? -1 What is the nearest to -0.101 in -3/10, 1.7, -1? -3/10 Which is the nearest to -1? (a) -0.49 (b) 8 (c) -1/4 (d) -2 a What is the nearest to 0 in 97, 38, -5? -5 What is the closest to -201 in -0.4, 972, -0.3? -0.4 What is the closest to -2 in 0.2, -5, -0.2, -2, 10.8? -2 Which is the closest to -0.1? (a) -0.32 (b) 3/2 (c) 11 (d) 12 a What is the closest to 0.1 in -7, 2, -78/7? 2 What is the nearest to -1 in -2, 4, 75, -0.16? -0.16 What is the closest to -2/3 in -570/17, -0.06, 19? -0.06 What is the nearest to -0.18629 in 1/11, -4, -1, -14? 1/11 Which is the nearest to 3? (a) -0.12 (b) -1/27 (c) 0.2 c Which is the nearest to -1/2? (a) 0.045 (b) -4 (c) 2/13 (d) 3/4 a What is the closest to 2 in 12, 1, -0.9, 22, 5? 1 Which is the nearest to -2/9? (a) 5 (b) 3 (c) -0.3 (d) 2/7 (e) -0.04 c What is the closest to 1 in 666, -9, 4, 2, 2/11? 2/11 Which is the nearest to 4102? (a) -0.1 (b) -5 (c) 2/5 (d) -1/12 c Which is the nearest to 0? (a) -4 (b) -1964 (c) 1 (d) 0.3 d What is the closest to -2/7 in 2, 16, 74.47? 2 What is the nearest to -58 in 7, 33, -1, -5, 1/3? -5 What is the closest to 2/21 in 3/10, -9, 0, -0.03? 0 Which is the nearest to 0.2? (a) -0.3 (b) -6/743 (c) -35 (d) -1/12 b Which is the nearest to -11? (a) 37.83 (b) 21 (c) -4 c What is the nearest to 325 in -5, -1, 3, 0.2? 3 Which is the nearest to 23? (a) -68 (b) 2/3 (c) -5 (d) -1/4 b Which is the closest to 1? (a) -16 (b) -2/19 (c) 1 (d) 15 c Which is the nearest to -2/15? (a) 0.2 (b) -5 (c) 2/3 (d) 6/13 (e) 1/27 e Which is the nearest to -2/3? (a) 23.7 (b) 3 (c) 0.5 (d) 3/7 d Which is the nearest to 2? (a) -3 (b) 0 (c) 4768 (d) 5 b What is the closest to -2/5 in 8, 77.7, 2/7? 2/7 Which is the nearest to -0.2? (a) 2/7 (b) -0.14 (c) -8 b Which is the nearest to -2? (a) -3363/5 (b) -0.4 (c) 4 (d) 0.3 b What is the closest to -14229 in 1/6, 1, 1/4, -2/5? -2/5 What is the closest to 6 in 3.5, 12/19, -1/4? 3.5 What is the closest to -97.7 in 0.2, 4, -5/2? -5/2 What is the closest to 2/7 in 22, -14/5, -2/3, -0.2, -1/3? -0.2 Which is the nearest to -1? (a) -3935 (b) 7 (c) 1 c What is the nearest to -1 in 2, 1/2, -245? 1/2 Which is the closest to 0.2? (a) 2/37 (b) 3 (c) 99 (d) 0.5 a Which is the nearest to 1? (a) -2/17 (b) -4 (c) -252/209 a What is the closest to 4 in 0.102, 48, 5? 5 What is the nearest to -3 in 1/4, -4, 3, 722? -4 Which is the closest to 183? (a) 4 (b) 0.4 (c) 3 (d) 56 d What is the closest to 1 in -9.4, 2, -94, -0.4? 2 What is the nearest to -3/5 in 3, -9/11, 2, 5, 0? -9/11 Which is the nearest to 1/3? (a) 3 (b) 2697/7 (c) -1/5 (d) -4 c What is the nearest to -1 in -10, 4, 0.5, 188? 0.5 Which is the nearest to 2089? (a) -0.2 (b) 7 (c) 0 (d) 2 b What is the nearest to -1/4 in 31, -1.7, -0.024, 3? -0.024 Which is the closest to 3? (a) -2/11 (b) -145 (c) 3/10 (d) 3 d What is the nearest to -0.1 in 7/4, 1, -780, -0.1? -0.1 Which is the nearest to 0.1? (a) -1/63 (b) -83 (c) 0.4 (d) -0.3 a What is the closest to 82 in 7, -1.4, -0.2? 7 What is the closest to -0.2 in -0.01, 2/11, 0.4, -0.13? -0.13 Which is the closest to 4? (a) 7 (b) 4 (c) 11 (d) 1/2 b What is the closest to -1/5 in 11, 180, 5? 5 Which is the closest to -30/7? (a) 136 (b) -2 (c) -1/7 (d) -4 d What is the closest to 6 in 16, 4/115, 1? 1 What is the closest to 0.16 in -2/21, 5, 39, -2/7? -2/21 What is the closest to -25/3 in 4/9, 0, 19, -1? -1 Which is the closest to 1? (a) -0.2 (b) 84/37 (c) 1 c Which is the nearest to -1? (a) -1 (b) 3 (c) -16/15 (d) -571 (e) 3/4 a Which is the closest to -8? (a) 2/7 (b) 2/21 (c) -26/41 c What is the nearest to 0.1 in 3/7, -5, -3/25, 126, 1? -3/25 What is the closest to 0 in 2, -1/2, 4, 0.209, 0.02? 0.02 What is the nearest to 564 in 5, 0, 0.3, -3? 5 What is the nearest to 0 in -5, 1/4, 166, -11, -2/11? -2/11 Which is the closest to -0.03? (a) 1/11 (b) -3 (c) 6 (d) 4 (e) 1/4 a Which is the closest to 14? (a) 10/13 (b) 1/5 (c) -4 a Which is the closest to -25? (a) -2 (b) -4/3 (c) 4 (d) -0.2 (e) 5 a What is the nearest to 1 in -6, -1746, 0.056? 0.056 Which is the closest to 35/3? (a) -14 (b) 8/5 (c) 0.1 b Which is the nearest to -131? (a) -2 (b) 2 (c) -0.02 a What is the nearest to -3/2 in 2/9, -0.2, -1288, 0.3, 0.6? -0.2 Which is the closest to -0.097? (a) 20/7 (b) -3 (c) 1/3 c What is the closest to 0.1 in 0.54, 2/5, 4, 2, 15? 2/5 Which is the nearest to -4/9? (a) -40 (b) 1 (c) 2/19 (d) -1/8 (e) 2/13 d Which is the nearest to 4/9? (a) -0.031 (b) 2/9 (c) -2 b What is the nearest to -0.1 in 49, -103, -2/17, 6/7? -2/17 Which is the nearest to -3? (a) -3 (b) -0.05 (c) 1.6 (d) 2.6 a What is the closest to -22 in -7, -3/5, 19/3, -0.1? -7 Which is the closest to -3? (a) -12 (b) -13/14 (c) -3/5 b What is the nearest to 3/5 in 0, -5.4, 2, 2/7, 5/4? 2/7 Which is the closest to -2/11? (a) -3/40 (b) -3.1 (c) 4 (d) -2/9 d Which is the closest to -2? (a) -6 (b) 0.3 (c) -3 (d) -4 (e) -1/61 c What is the nearest to -1 in -2336, 4, -0.9, 2/13? -0.9 What is the nearest to 0 in -1, -2/3, 34/763, -4, 3/8? 34/763 Which is the nearest to -2? (a) 3 (b) -6 (c) -2 (d) -0.39 (e) -5 c What is the closest to -2/7 in -4, -3.824, 5, 1? 1 What is the nearest to -1 in -1/45, -0.0704, -0.3, -3? -0.3 What is the closest to 41 in -0.05, 2/7, 3/8? 3/8 Which is the closest to 0.1? (a) -7 (b) -38/9 (c) 9/8 (d) 0.5 d Which is the nearest to 0? (a) 10/11 (b) 0.4 (c) -0.1 (d) -1138 (e) 3 c Which is the closest to 14/23? (a) 5 (b) -4 (c) -0.2 (d) -0.4 (e) -8 c What is the closest to -30 in -6, 2, 2/7, -13, -5? -13 Which is the closest to 0.05? (a) -27 (b) -1 (c) 2/5 (d) 21 c Which is the nearest to -1/2? (a) 4 (b) -2/7 (c) 160 (d) 5 b Which is the closest to -0.1? (a) 1 (b) -21 (c) 5 (d) -66/5 (e) -2/3 e What is the nearest to -1 in -0.4, -17, -491? -0.4 Which is the nearest to 0.2? (a) 0	{ "pile_set_name": "DM Mathematics" }
112342949. 112342949 List the prime factors of 72209177. 19, 61, 62303 List the prime factors of 1783177199. 337, 5291327 What are the prime factors of 94789977? 3, 17, 109331 What are the prime factors of 105584329? 23, 439, 10457 List the prime factors of 5320025. 5, 212801 What are the prime factors of 4435152224? 2, 138598507 List the prime factors of 79925630. 2, 5, 1109, 7207 List the prime factors of 111794955. 3, 5, 19, 392263 List the prime factors of 485000180. 2, 5, 7, 1297, 2671 List the prime factors of 35603458. 2, 11, 179, 9041 What are the prime factors of 234548218? 2, 17, 509, 13553 What are the prime factors of 863245867? 11, 19, 23, 179581 List the prime factors of 93033194. 2, 46516597 List the prime factors of 2897413542. 2, 3, 160967419 What are the prime factors of 20574643? 977, 21059 List the prime factors of 1430094689. 17, 139, 769, 787 What are the prime factors of 19630253? 163, 120431 List the prime factors of 86449734. 2, 3, 7, 19, 12037 What are the prime factors of 167027763? 3, 7, 1613, 4931 List the prime factors of 333521992. 2, 41690249 List the prime factors of 605615586. 2, 3, 47, 1031, 2083 What are the prime factors of 2188516258? 2, 157, 601, 11597 List the prime factors of 79138135. 5, 19, 833033 List the prime factors of 2020094867. 7, 288584981 List the prime factors of 1379681576. 2, 7, 13, 1895167 List the prime factors of 52414996. 2, 19, 283, 2437 What are the prime factors of 604885607? 604885607 What are the prime factors of 40008908? 2, 19, 103, 269 What are the prime factors of 1801818487? 7, 31, 101, 229, 359 What are the prime factors of 2187505411? 7, 13, 53, 139, 251 What are the prime factors of 19216592? 2, 23, 79, 661 List the prime factors of 2155186843. 269, 8011847 List the prime factors of 844955394. 2, 3, 233, 313, 1931 What are the prime factors of 117708721? 13, 593, 15269 What are the prime factors of 24432252? 2, 3, 13, 19, 8243 What are the prime factors of 383417015? 5, 23, 257, 12973 List the prime factors of 13020191. 13020191 What are the prime factors of 122884671? 3, 7, 13, 450127 What are the prime factors of 2252012886? 2, 3, 19, 6584833 List the prime factors of 1450691956. 2, 7, 51810427 List the prime factors of 255806474. 2, 7, 11, 103, 16127 What are the prime factors of 41435354? 2, 20717677 What are the prime factors of 422949475? 5, 13, 47, 27689 What are the prime factors of 25427025? 3, 5, 13, 8693 List the prime factors of 7845964. 2, 7, 79, 3547 List the prime factors of 178349294. 2, 43, 79, 26251 What are the prime factors of 408230702? 2, 11, 443, 41887 List the prime factors of 55355537. 79, 700703 List the prime factors of 478681562. 2, 137, 1747013 List the prime factors of 272456719. 2161, 126079 List the prime factors of 45414809. 11, 79, 4751 What are the prime factors of 5676253? 11, 516023 What are the prime factors of 194331142? 2, 5273, 18427 List the prime factors of 169207094. 2, 7, 1726603 List the prime factors of 894906779. 13, 269, 255907 List the prime factors of 159430690. 2, 5, 29, 79, 6959 What are the prime factors of 581136450? 2, 3, 5, 3874243 What are the prime factors of 236894236? 2, 151, 392209 List the prime factors of 1659488103. 3, 7, 13, 59, 61, 563 List the prime factors of 1381086963. 3, 47, 193, 5639 What are the prime factors of 117602574? 2, 3, 593, 33053 What are the prime factors of 30121055? 5, 1459, 4129 List the prime factors of 138372342. 2, 3, 113, 127, 1607 What are the prime factors of 24298385? 5, 397, 12241 List the prime factors of 32852759. 32852759 What are the prime factors of 38493501? 3, 61, 210347 List the prime factors of 78436710. 2, 3, 5, 11, 79229 What are the prime factors of 98416098? 2, 3, 11, 497051 What are the prime factors of 42803486? 2, 11, 67, 71, 409 What are the prime factors of 402051541? 1613, 249257 List the prime factors of 42063414. 2, 3, 7010569 What are the prime factors of 1853219713? 6469, 286477 List the prime factors of 9767515. 5, 1953503 What are the prime factors of 335465213? 335465213 What are the prime factors of 68083289? 19, 23, 155797 List the prime factors of 48773280. 2, 3, 5, 101611 What are the prime factors of 29041148? 2, 7260287 What are the prime factors of 51800456? 2, 6475057 What are the prime factors of 5152632937? 23, 3271, 68489 List the prime factors of 7667506. 2, 7, 11, 49789 What are the prime factors of 2229145435? 5, 11, 40529917 List the prime factors of 76272904. 2, 9534113 List the prime factors of 12896424. 2, 3, 37, 47, 103 What are the prime factors of 66518416? 2, 17, 244553 What are the prime factors of 41291694? 2, 3, 254887 List the prime factors of 887960828. 2, 221990207 What are the prime factors of 117216292? 2, 17, 1723769 List the prime factors of 1625795641. 23, 70686767 What are the prime factors of 340188644? 2, 41, 2074321 What are the prime factors of 593333269? 17, 73, 179, 2671 What are the prime factors of 110687454? 2, 3, 23, 41, 6521 List the prime factors of 261822814. 2, 11, 17, 311, 2251 What are the prime factors of 3075962684? 2, 23, 2441, 13697 List the prime factors of 6003405. 3, 5, 71, 1879 What are the prime factors of 30430009? 47, 409, 1583 What are the prime factors of 50536300? 2, 5, 79, 6397 What are the prime factors of 233444125? 5, 1867553 List the prime factors of 222662173. 149, 1494377 What are the prime factors of 8182412148? 2, 3, 41, 16630919 What are the prime factors of 61364345? 5, 7, 23, 31, 2459 What are the prime factors of 5768782160? 2, 5, 557, 129461 What are the prime factors of 12023522? 2, 7, 17, 1031 What are the prime factors of 34806191? 7, 17, 292489 What are the prime factors of 15616967? 15616967 List the prime factors of 312589327. 312589327 List the prime factors of 64119496. 2, 7, 241, 4751 List the prime factors of 1523315548. 2, 97, 109, 181, 199 List the prime factors of 340814986. 2, 8009, 21277 What are the prime factors of 22838578? 2, 7, 821, 1987 List the prime factors of 145447851. 3, 37, 61, 21481 List the prime factors of 151803304. 2, 37, 512849 What are the prime factors of 24104561? 13, 47, 39451 List the prime factors of 136451934. 2, 3, 7580663 List the prime factors of 52406304. 2, 3, 545899 What are the prime factors of 4349241353? 2957, 1470829 List the prime factors of 1477807. 1477807 List the prime factors of 41848518. 2, 3, 47, 148399 List the prime factors of 159874563. 3, 53291521 List the prime factors of 4214891243. 17, 23, 109, 98897 What are the prime factors of 560686771? 560686771 What are the prime factors of 1762344? 2, 3, 41, 199 What are the prime factors of 449137686? 2, 3, 74856281 What are the prime factors of 4148089852? 2, 163, 941, 6761 List the prime factors of 1124338357. 19, 3673, 16111 What are the prime factors of 726327076? 2, 97, 293, 6389 What are the prime factors of 59968627? 59968627 List the prime factors of 154614213. 3, 13, 101653 List the prime factors of 270802436. 2, 89, 173, 4397 List the prime factors of 906834356. 2, 19, 47, 127, 1999 List the prime factors of 43769857. 43769857 List the prime factors of 349939426. 2, 174969713 What are the prime factors of 1484659048? 2, 1303, 142427 List the prime factors of 495154925. 5, 23, 861139 List the prime factors of 905458344. 2, 3, 7, 619, 8707 What are the prime factors of 660718197? 3, 73413133 List the prime factors of 53147322. 2, 3, 2952629 List the prime factors of 25628508. 2, 3, 237301 List the prime factors of 51204791. 11, 19, 337, 727 List the prime factors of 69785134. 2, 2089, 16703 List the prime factors of 807250059. 3, 7, 11, 166409 What are the prime factors of 156890966? 2, 78445483 List the prime factors of 572273209. 409, 1399201 List the prime factors of 420286354. 2, 7573, 27749 List the prime factors of 286365514. 2, 143182757 What are the prime factors of 514746778? 2, 7, 13, 79, 35801 List the prime factors of 368101678. 2, 7, 37, 710621 What are the prime factors of 264999357? 3, 7, 467371 List the prime factors of 282549079. 282549079 List the prime factors of 214186098. 2, 3, 7, 5099669 List the prime factors of 3823343032. 2, 477917879 What are the prime factors of 234047908? 2, 17, 23, 263, 569 What are the prime factors of 112604026?	{ "pile_set_name": "DM Mathematics" }
remainder when 475863 is divided by 302. 213 What is the remainder when 1931280 is divided by 1472? 16 What is the remainder when 358473 is divided by 358214? 259 What is the remainder when 77254167 is divided by 930? 927 What is the remainder when 885498 is divided by 442731? 36 Calculate the remainder when 3844513 is divided by 320376. 1 Calculate the remainder when 469627 is divided by 14. 11 What is the remainder when 318176 is divided by 242? 188 What is the remainder when 654912 is divided by 2009? 1987 Calculate the remainder when 2231513 is divided by 243. 44 What is the remainder when 72784823 is divided by 367600? 23 What is the remainder when 10824082 is divided by 3814? 3764 Calculate the remainder when 131070 is divided by 14461. 921 What is the remainder when 373960 is divided by 46394? 2808 Calculate the remainder when 780405 is divided by 65028. 69 Calculate the remainder when 123380 is divided by 4717. 738 Calculate the remainder when 315805 is divided by 6570. 445 What is the remainder when 1844744 is divided by 1990? 14 Calculate the remainder when 3700 is divided by 1722. 256 Calculate the remainder when 3373360 is divided by 54408. 64 Calculate the remainder when 10722041 is divided by 517. 495 Calculate the remainder when 25141774 is divided by 1472. 14 What is the remainder when 365941 is divided by 85? 16 Calculate the remainder when 147132 is divided by 121. 117 Calculate the remainder when 41402 is divided by 30. 2 Calculate the remainder when 660067 is divided by 632. 259 What is the remainder when 5571969 is divided by 1369? 139 Calculate the remainder when 563160 is divided by 3146. 26 Calculate the remainder when 395718 is divided by 98851. 314 Calculate the remainder when 10480012 is divided by 5239998. 16 What is the remainder when 4599633 is divided by 34582? 227 Calculate the remainder when 38402 is divided by 9466. 538 Calculate the remainder when 655618 is divided by 1. 0 Calculate the remainder when 439761 is divided by 146571. 48 Calculate the remainder when 782668267 is divided by 386. 385 What is the remainder when 1966927 is divided by 1966335? 592 Calculate the remainder when 616545 is divided by 154130. 25 What is the remainder when 3677617 is divided by 34? 7 What is the remainder when 1941080 is divided by 603? 23 What is the remainder when 251531 is divided by 1463? 1358 Calculate the remainder when 174026 is divided by 6841. 3001 What is the remainder when 20724435 is divided by 431759? 3 What is the remainder when 133661 is divided by 644? 353 Calculate the remainder when 197121 is divided by 688. 353 What is the remainder when 41836 is divided by 20692? 452 What is the remainder when 323530 is divided by 7702? 46 Calculate the remainder when 27589 is divided by 3922. 135 Calculate the remainder when 7383980 is divided by 7383977. 3 What is the remainder when 8719026 is divided by 2137? 66 Calculate the remainder when 153806557 is divided by 10986182. 9 Calculate the remainder when 28049141 is divided by 185. 181 Calculate the remainder when 23502 is divided by 2643. 2358 Calculate the remainder when 193118268 is divided by 970. 968 Calculate the remainder when 1401166 is divided by 1481. 140 What is the remainder when 561428 is divided by 40101? 14 Calculate the remainder when 108625 is divided by 19814. 9555 What is the remainder when 124076 is divided by 7031? 4549 What is the remainder when 22658 is divided by 686? 20 What is the remainder when 113337 is divided by 1741? 172 What is the remainder when 1180425 is divided by 531? 12 Calculate the remainder when 1303975 is divided by 36221. 19 Calculate the remainder when 16018962 is divided by 77014. 50 Calculate the remainder when 39914358 is divided by 369. 366 What is the remainder when 269263 is divided by 1360? 1343 What is the remainder when 583548 is divided by 10603? 383 Calculate the remainder when 10044442 is divided by 5. 2 Calculate the remainder when 23279054 is divided by 21920. 14 Calculate the remainder when 6861 is divided by 817. 325 What is the remainder when 67788 is divided by 1189? 15 Calculate the remainder when 2968204 is divided by 6187. 4631 Calculate the remainder when 28811784 is divided by 4738. 6 What is the remainder when 5000481 is divided by 941? 7 Calculate the remainder when 2079466 is divided by 94. 92 What is the remainder when 87477639 is divided by 98? 95 Calculate the remainder when 45479938 is divided by 389. 3 What is the remainder when 623648 is divided by 207840? 128 Calculate the remainder when 546017 is divided by 303. 11 What is the remainder when 322178348 is divided by 3658? 3656 What is the remainder when 295717 is divided by 295227? 490 What is the remainder when 16065500 is divided by 168? 164 Calculate the remainder when 297299 is divided by 341. 288 What is the remainder when 1826815 is divided by 138? 109 Calculate the remainder when 187603916 is divided by 15950. 16 What is the remainder when 2642152 is divided by 2641835? 317 Calculate the remainder when 10568 is divided by 1917. 983 What is the remainder when 11522966 is divided by 344? 342 What is the remainder when 5507247 is divided by 1694? 53 What is the remainder when 883937 is divided by 6225? 6212 What is the remainder when 952741 is divided by 158790? 1 What is the remainder when 2982846 is divided by 4255? 91 What is the remainder when 62544 is divided by 15136? 2000 Calculate the remainder when 342921 is divided by 6593. 85 Calculate the remainder when 2325400 is divided by 218. 212 Calculate the remainder when 413649 is divided by 137840. 129 What is the remainder when 241604 is divided by 80525? 29 Calculate the remainder when 876089 is divided by 318. 317 Calculate the remainder when 30166 is divided by 26679. 3487 What is the remainder when 34747527 is divided by 34747523? 4 Calculate the remainder when 631580 is divided by 156. 92 Calculate the remainder when 21831008 is divided by 145540. 8 Calculate the remainder when 30677 is divided by 17. 9 What is the remainder when 8438288 is divided by 7? 5 What is the remainder when 69774 is divided by 150? 24 What is the remainder when 18216147 is divided by 2165? 2002 Calculate the remainder when 151859 is divided by 6983. 5216 What is the remainder when 5748513 is divided by 289? 14 What is the remainder when 4657661 is divided by 197? 187 What is the remainder when 30881868 is divided by 45? 33 What is the remainder when 100935131 is divided by 35? 31 What is the remainder when 87998 is divided by 8797? 28 Calculate the remainder when 5288434 is divided by 438. 22 What is the remainder when 1791276 is divided by 39806? 6 What is the remainder when 2879 is divided by 448? 191 What is the remainder when 331174 is divided by 2985? 2824 What is the remainder when 1166925 is divided by 123? 24 What is the remainder when 5499 is divided by 1524? 927 What is the remainder when 150242 is divided by 34? 30 Calculate the remainder when 1999369 is divided by 17538. 37 What is the remainder when 39066611 is divided by 4340733? 14 What is the remainder when 380888 is divided by 53745? 4673 Calculate the remainder when 177004 is divided by 177000. 4 What is the remainder when 280661 is divided by 512? 85 Calculate the remainder when 2693182 is divided by 112215. 22 Calculate the remainder when 7606877 is divided by 2535623. 8 Calculate the remainder when 291695 is divided by 219. 206 Calculate the remainder when 205740073 is divided by 95. 93 Calculate the remainder when 8923636 is divided by 13. 7 Calculate the remainder when 11444105 is divided by 468. 101 Calculate the remainder when 646354 is divided by 80793. 10 Calculate the remainder when 107615 is divided by 17935. 5 What is the remainder when 1905013 is divided by 2046? 187 What is the remainder when 151545 is divided by 151534? 11 Calculate the remainder when 994787 is divided by 211. 133 What is the remainder when 653417 is divided by 478? 469 What is the remainder when 18366341 is divided by 3061055? 11 What is the remainder when 460482805 is divided by 269? 266 What is the remainder when 13834510 is divided by 108082? 14 Calculate the remainder when 3251574 is divided by 1083856. 6 Calculate the remainder when 834120 is	{ "pile_set_name": "DM Mathematics" }
rder. 624, 80, -2, -18 Sort -11733, -14, -4, 5, 4. -11733, -14, -4, 4, 5 Sort -2, -6, 123, 2 in ascending order. -6, -2, 2, 123 Sort 0.5, -12, 61279 in decreasing order. 61279, 0.5, -12 Put 1, -16, 4, 65, 34, 3 in increasing order. -16, 1, 3, 4, 34, 65 Put -21, -4/5, -73 in decreasing order. -4/5, -21, -73 Put 69, 0, -57, 4 in decreasing order. 69, 4, 0, -57 Put 4, -14, -3, 5, -4 in increasing order. -14, -4, -3, 4, 5 Put 8, 0.2, -157, 1 in descending order. 8, 1, 0.2, -157 Put -1, -5, -33, -2, -7 in decreasing order. -1, -2, -5, -7, -33 Sort -13, -12, -4, 8, 2, 1 in ascending order. -13, -12, -4, 1, 2, 8 Sort -1, 4, -2120, -2 in increasing order. -2120, -2, -1, 4 Put 191, 7, 1, 4, -1 in descending order. 191, 7, 4, 1, -1 Sort 702, -215, -5, 2 in descending order. 702, 2, -5, -215 Put -6, 0, 3, -51, 1, -5 in decreasing order. 3, 1, 0, -5, -6, -51 Put 3, -24, -31/4, -2/3 in descending order. 3, -2/3, -31/4, -24 Put 0.1, 0.18, 4, 2, 8/7 in ascending order. 0.1, 0.18, 8/7, 2, 4 Sort -11, -613, -6, -5, 5, -1 in ascending order. -613, -11, -6, -5, -1, 5 Put -0.017, -6, -3, 1, -0.04 in descending order. 1, -0.017, -0.04, -3, -6 Sort -26, 5, 12, -181. -181, -26, 5, 12 Sort 3/4, -5, -0.19, -37 in descending order. 3/4, -0.19, -5, -37 Put 2, 260, -1, -11, 9 in decreasing order. 260, 9, 2, -1, -11 Sort -0.1, 2/5, -2/9, 38, -1.3. -1.3, -2/9, -0.1, 2/5, 38 Put -105, 2/2889, -0.2 in decreasing order. 2/2889, -0.2, -105 Put -203, 419, 1 in increasing order. -203, 1, 419 Put 11, -11, 215, 2, -1 in decreasing order. 215, 11, 2, -1, -11 Sort 0.2, 1652, 59 in descending order. 1652, 59, 0.2 Sort -5, -41, 13 in ascending order. -41, -5, 13 Sort -0.1, -836/9, -61, 0.2, 0.1 in ascending order. -836/9, -61, -0.1, 0.1, 0.2 Put 2, 4, 30986 in decreasing order. 30986, 4, 2 Sort -3, 169, -2, 4, -104 in decreasing order. 169, 4, -2, -3, -104 Sort 1, -3/4, 1/8, 408 in decreasing order. 408, 1, 1/8, -3/4 Put -5/58, 3, -0.0522, 2/3 in descending order. 3, 2/3, -0.0522, -5/58 Put -7/3, -3/4, 3/4, 0.05, -1/70 in descending order. 3/4, 0.05, -1/70, -3/4, -7/3 Sort -10860, -20, -5 in descending order. -5, -20, -10860 Put 198/7, -2/11, 6, 11/4, 2/5 in increasing order. -2/11, 2/5, 11/4, 6, 198/7 Sort -770, -2, -5, 35 in descending order. 35, -2, -5, -770 Sort -0.4, 1, 0.5, -117/4, 0.24 in descending order. 1, 0.5, 0.24, -0.4, -117/4 Put 226, 2, 139 in increasing order. 2, 139, 226 Put -88, 0, -2, -22, 18 in descending order. 18, 0, -2, -22, -88 Put -337, -2, -3, -4, 7 in decreasing order. 7, -2, -3, -4, -337 Sort -8485, -4/7, -0.5, 0.5, 2 in descending order. 2, 0.5, -0.5, -4/7, -8485 Sort 101, -2, -5, 5. -5, -2, 5, 101 Put 4, -70, 1, 0, -2, -10 in increasing order. -70, -10, -2, 0, 1, 4 Sort -0.06, -1/2, 5, 13, -12, -2.7. -12, -2.7, -1/2, -0.06, 5, 13 Sort 1/3, 1/77, -19, -0.7 in ascending order. -19, -0.7, 1/77, 1/3 Put -0.0368, -0.5, -85, -2 in increasing order. -85, -2, -0.5, -0.0368 Sort 5, -13, 9, -11. -13, -11, 5, 9 Sort -2/13, 0.2, 0.3, 1/11, 3/92 in ascending order. -2/13, 3/92, 1/11, 0.2, 0.3 Sort -7, -2, 0, -16, -8, 14. -16, -8, -7, -2, 0, 14 Sort 4, -0.004, 269 in increasing order. -0.004, 4, 269 Sort 18, 0, -3, 11608. -3, 0, 18, 11608 Put 1, 5, -132, 0, -4, -2 in descending order. 5, 1, 0, -2, -4, -132 Sort -3, -1, 2/5, -0.13, 1.4 in decreasing order. 1.4, 2/5, -0.13, -1, -3 Put -1, 28, 400 in ascending order. -1, 28, 400 Put -1, 0, -4, 66132, 3 in descending order. 66132, 3, 0, -1, -4 Sort -4, 4, 154856 in descending order. 154856, 4, -4 Sort 4, -54, -85 in descending order. 4, -54, -85 Sort 0.31, -0.2, -2/5, -1.07, -0.3 in descending order. 0.31, -0.2, -0.3, -2/5, -1.07 Put -4, 3560, 22, 0, 4 in descending order. 3560, 22, 4, 0, -4 Put 58, -0.1, 2/29, -6/5 in ascending order. -6/5, -0.1, 2/29, 58 Put 3, -1, -21, -3 in increasing order. -21, -3, -1, 3 Put 3, -1713, -5 in descending order. 3, -5, -1713 Sort 0.12, -0.02, 8, 0.2, -101 in ascending order. -101, -0.02, 0.12, 0.2, 8 Sort 6, 30, 0.1, -44, 3/4 in descending order. 30, 6, 3/4, 0.1, -44 Sort 1, -608, -34 in descending order. 1, -34, -608 Put 22181, 13, 0 in increasing order. 0, 13, 22181 Sort -206, 1, 2, 3 in increasing order. -206, 1, 2, 3 Sort -3, -3/4, 141.2 in ascending order. -3, -3/4, 141.2 Put 34, 3, -13, -4, 10 in decreasing order. 34, 10, 3, -4, -13 Put 8, 289, 2, 1, 1/6 in decreasing order. 289, 8, 2, 1, 1/6 Sort -0.4, 56, -316, -4, -3. -316, -4, -3, -0.4, 56 Put 2/3, 23, 0.158 in decreasing order. 23, 2/3, 0.158 Sort -1, 3, 8, 0, 1327 in decreasing order. 1327, 8, 3, 0, -1 Put -4, -5, -1005, 9 in decreasing order. 9, -4, -5, -1005 Put 86, -3, -4 in increasing order. -4, -3, 86 Sort 0.2, -0.2, 0.38, 1275, 0.5. -0.2, 0.2, 0.38, 0.5, 1275 Put -1118, -2, 7, 3, 0 in increasing order. -1118, -2, 0, 3, 7 Put 3, -154, -2, 2 in ascending order. -154, -2, 2, 3 Sort -2, -1, -4, 335, -3, 0 in descending order. 335, 0, -1, -2, -3, -4 Sort 582, -5, 7, -3 in ascending order. -5, -3, 7, 582 Sort -1, 4, -7, 14, -4, 5 in descending order. 14, 5, 4, -1, -4, -7 Sort 0.2, 3/41, 4/3, -1, -0.1, 2/27 in decreasing order. 4/3, 0.2, 2/27, 3/41, -0.1, -1 Sort 889, 2, 67, 3. 2, 3, 67, 889 Sort 1, -1144, -53 in increasing order. -1144, -53, 1 Sort 7496, -6, -5 in descending order. 7496, -5, -6 Put 0.79, -0.35, -2 in ascending order. -2, -0.35, 0.79 Put -1/2, -1, 5, 0.1, 212, 3/7 in descending order. 212, 5, 3/7, 0.1, -1/2, -1 Put 6, -545, -1/9, 0.3, 1/8 in descending order. 6, 0.3, 1/8, -1/9, -545 Sort -2, -13, 17, -4. -13, -4, -2, 17 Put -2/93, 2688, -2 in increasing order. -2, -2/93, 2688 Sort 37, -16, -2, 2, -4 in ascending order. -16, -4, -2, 2, 37 Sort -8, -23, -30 in increasing order. -30, -23, -8 Sort 6, 862, -38 in decreasing order. 862, 6, -38 Sort -7, -3, -58, -189 in decreasing order. -3, -7, -58, -189 Sort -3, -9, 1, 2, -40. -40, -9, -3, 1, 2 Put 3/8, -7/8, -7/2, 5/12, 5 in descending order. 5, 5/12, 3/8, -7/8, -7/2 Put 2/19, -0.0584, 0.5 in decreasing order. 0.5, 2/19, -0.0584 Sort -3707, -8, -2. -3707, -8, -2 Put 4/5, 4, 5/6, -18, -0.5, -2/3 in increasing order. -18, -2/3, -0.5, 4/5, 5/6, 4 Sort 5, -242, -1, -67, -2. -242, -67, -2, -1, 5 Put -5, 6, 4, -7, 106, -2 in ascending order. -7, -5, -2, 4, 6, 106 Sort 17/4, -0.1087, -5. -5, -0.1087, 17/4 Put -0.19, -3, 0.719, 32 in descending order. 32, 0.719, -0.19, -3 Sort -1035, -3, 8 in decreasing order. 8, -3, -1035 Sort -6, -1/17, -0.09, -0.5. -6, -0.5, -0.09, -1/17 Put 36, 7, 2, 1, 5 in descending order. 36, 7, 5, 2, 1 Put 3, 421, -3 in ascending order. -3, 3, 421 Put -134, 2, 4, -4, -1, 3 in decreasing order. 4, 3, 2, -1, -4, -134 Put 2/87, 0.3, 5 in ascending order. 2/87, 0.3, 5 Put -34, 1, 62, 92, -4 in ascending order. -34, -4, 1, 62, 92 Put 1, -3, -2718 in increasing order. -2718, -3, 1 Put -147, -2, -286 in increasing order. -286, -147, -2 Sort 0, -1, 0.07, 0.1406, -0.2 in descending order. 0.1406, 0.07, 0, -0.2, -1 Sort -1, 4, 81, 181. -1, 4, 81, 181 Put -5, 315, -4, -1 in decreasing order. 315, -1, -4, -5 Sort 9, 1/8, 2/5, 3, 0.07, -293 in descending order. 9, 3, 2/5, 1/8, 0.07, -293 Put 166, -5, 1/4, 1990 in increasing order. -5, 1/4, 166, 1990 Put -5, -144, -523 in descending order. -5, -144, -523 Sort 29, 5, 4, 36, -6 in descending order. 36, 29, 5, 4, -6 Sort 2, -112, 55/7, -9 in decreasing order. 55/7, 2, -9, -112 Sort 0.197113, 3, 6 in decreasing order. 6, 3, 0.197113 Put -40, -5, -0.236, -4/7, 0 in increasing order. -40, -5, -4/7, -0.236, 0 Put 9, -0.1, 1/5, 2, -3, 0.29 in descending order. 9, 2, 0.29, 1/5, -0.1, -3 Put 1/7, 3, 4, 8, 1/9, -4 in ascending order. -4, 1/9, 1/7, 3, 4, 8 Put 11, 778, 6 in descending order. 778, 11, 6 Sort -2/5, -0.5, -153364. -153364, -0.5, -2/5 Sort 0.115, 8, 5 in ascending order. 0.115, 5, 8 Sort 5, -1, 2, 246, -4, -8. -8, -4, -1, 2, 5, 246 Sort -4158, -105, -2 in ascending order. -4158, -105, -2 Put 0.25, -2, 5, -3/4, 0.2, 602/25 in decreasing order. 602/25, 5, 0.25, 0.2, -3/4, -2 Put 5, -3, 33, -39, 2 in decreasing order. 33, 5, 2, -3, -39 Put 4, 29, -2042, -4 in decreasing order. 29, 4, -4, -2042 Sort 16, -263, -2, -4 in descending order. 16, -2, -4, -263 Sort 20, 0.19, -3, -19, 1/2 in increasing order. -19, -3, 0.19, 1/2, 20 Sort 3/16, -3/4, 0.1, 0.3, 131, 3 in increasing order. -3/4, 0.1, 3/16, 0.3, 3, 131 S	{ "pile_set_name": "DM Mathematics" }
2 - 17a - 6725. Determine b(64). 379 Let h(p) = -72562p - 653032. Give h(-9). 26 Let k(l) = -16l2 + 2382l - 33890. What is k(16)? 126 Let a(n) = -8921n2 + 214118n - 330. Determine a(24). 6 Let s(l) = -3l3 + 37l*2 + 317l - 3827. What is s(11)? 144 Let z(p) = -p*3 + 30p*2 - 316p + 1166. What is z(16)? -306 Let o(v) = v*3 + 141v*2 - 15357v - 2142667. Give o(-145). -2 Let d(a) = -147a2 + 7721a - 38601. Give d(5). -3671 Let x(u) = u*3 + 38u*2 - 17u + 682. What is x(-39)? -176 Let f(z) = -1685z - 20213. Determine f(-12). 7 Let n(m) = -2m*3 + 169m*2 + 422m + 1053. Determine n(87). -78 Let s(a) = -29a3 - 8346a*2 + 1688a - 11529. Calculate s(-288). -9 Let a(n) = -n3 + n2 + 5851n - 86. Give a(-76). -10 Let s(z) = 7z*3 - 499z*2 + 4755z - 907. What is s(60)? -7 Let a(g) = g*2 - 3513452g + 7026904. Give a(2). 4 Let b(c) = 24c3 - 4c*2 + 559c - 2192. Determine b(4). 1516 Let t(u) = -90u2 - 82u + 26. Calculate t(-1). 18 Let r(k) = k*2 + 423k + 23894. Determine r(-67). 42 Let k(a) = 23a2 + 10339a + 5471. Give k(-449). 83 Let t(j) = 49j3 + 2056j*2 + 1698j + 74851. Determine t(-42). 7 Let d(x) = x*3 + 13x*2 + 60x + 16. Calculate d(-7). -110 Let d(a) = -9a2 - 213a + 61. What is d(-18)? 979 Let x(t) = -3072t + 76799. Give x(25). -1 Let j(n) = -n3 + 22n*2 + 130n + 21. Determine j(-5). 46 Let w(p) = 8p2 - 56p - 57. Give w(-4). 295 Let f(u) = -1975u - 1973. Determine f(-1). 2 Let a(s) = -s3 - 109s*2 - 519s - 204. Determine a(-104). -308 Let g(b) = b*3 - 17b*2 - 395b + 6147. Give g(15). -228 Let n(v) = 3354v - 1217500. Determine n(363). 2 Let b(p) = -89p*3 - 4p*2 - 204p - 201. Give b(-1). 88 Let x(b) = -b*2 - 350928b + 1403742. What is x(4)? 14 Let j(g) = 66g + 20735. Calculate j(-314). 11 Let w(h) = 31h*3 + 11h*2 + 22930h - 22940. Determine w(1). 32 Let q(s) = -s*2 + 1866s - 69460. Calculate q(38). 4 Let k(t) = 26632t - 159874. What is k(6)? -82 Let m(c) = 10856c - 6774210. Give m(624). -66 Let r(v) = -270v2 - 4062v - 181. What is r(-15)? -1 Let h(f) = -11f + 746. Give h(64). 42 Let n(m) = 6m*2 - 930m + 24720. Calculate n(34). 36 Let y(g) = -4g3 - 305g*2 + 554g + 47851. Calculate y(-76). -29 Let x(p) = -p*3 - 48p*2 + 266p + 12774. Determine x(-48). 6 Let f(y) = -15y2 + 171y + 1129. Calculate f(16). 25 Let h(u) = 424u2 + 1259u - 67. Calculate h(-3). -28 Let n(k) = -k*3 - 14k*2 + 215k + 884. Calculate n(-22). 26 Let z(y) = 9y3 - 5y*2 - 63y + 332. What is z(8)? 4116 Let y(z) = -4034z + 129076. What is y(32)? -12 Let h(s) = -467s + 3679. Determine h(8). -57 Let v(a) = 437a + 108786. Calculate v(-249). -27 Let c(h) = 1453h - 4091. Determine c(3). 268 Let t(r) = -1042r + 245356. Calculate t(236). -556 Let p(g) = -g3 + 18g*2 + 121g - 2512. What is p(16)? -64 Let a(w) = 6w2 + 448w + 2766. Calculate a(-6). 294 Let g(n) = 5n2 - 1364n + 9354. Give g(7). 51 Let h(u) = 12u2 - 2361u - 7096. Calculate h(-3). 95 Let k(m) = -1383m2 - 2658m. Calculate k(-2). -216 Let p(s) = 1767s + 1390638. What is p(-787)? 9 Let y(s) = 4078s + 17580. Give y(-6). -6888 Let c(s) = -1748s + 129337. Give c(74). -15 Let y(i) = -7i*2 - 3026i + 6044. Give y(2). -36 Let c(v) = 251597v - 2264368. Determine c(9). 5 Let u(d) = 17d*3 - 70d*2 + 24d + 82. Give u(-4). -2222 Let o(p) = 8829p + 1050646. Calculate o(-119). -5 Let a(q) = 26q*3 + 20q*2 - 48q - 2. Calculate a(2). 190 Let b(g) = -7711g + 130949. Determine b(17). -138 Let d(i) = i2 + 597i - 32177. What is d(50)? 173 Let t(v) = -v*3 + 59v*2 + 98v + 1387. Calculate t(61). -77 Let c(b) = -5b3 + 153b*2 + 2047b + 136. Calculate c(-10). -34 Let c(w) = -4w3 - 348w*2 - 3601w - 157. Give c(-75). -82 Let y(x) = 2562x2 + 3133x + 3134. Determine y(-1). 2563 Let n(r) = -4r2 - 16085r - 463105. Calculate n(-29). -4 Let f(y) = -25y3 - 49y - 50. What is f(-1)? 24 Let z(n) = -38692n + 178. What is z(0)? 178 Let x(u) = 5u*3 + 125u*2 + 689u + 2433. What is x(-19)? 172 Let a(p) = -211982p - 3603696. Give a(-17). -2 Let k(d) = -12d*3 - 7794d*2 + 3918d + 11705. What is k(-650)? 5 Let t(f) = 7600f + 357175. What is t(-47)? -25 Let m(q) = 2q*2 - 1556q - 12545. Determine m(-8). 31 Let l(s) = -s*3 - 11s*2 + 51s - 73. What is l(-14)? -199 Let w(s) = -8436s + 41955. Give w(5). -225 Let c(g) = -4g*3 + 56g*2 - 212g + 258. Calculate c(9). -30 Let m(v) = -v*3 + 9v*2 + 618v - 7077. Determine m(12). -93 Let u(g) = g*2 + 47g - 1293. What is u(-61)? -439 Let l(f) = -f*2 - 172f - 2150. Give l(-157). 205 Let v(p) = 27187p + 27222. Give v(-1). 35 Let z(c) = -c3 - 9c*2 - 13c - 104. Determine z(-8). -64 Let c(q) = 619q + 229041. Give c(-370). 11 Let h(o) = -9o*2 - 13306o + 66510. Calculate h(5). -245 Let c(j) = j*2 - 747j + 37656. What is c(54)? 234 Let g(u) = -14159u + 1269. What is g(0)? 1269 Let s(t) = 146t - 5592. Calculate s(54). 2292 Let u(p) = p*2 + 1252p - 646416. Give u(393). 69 Let i(p) = -1992p2 + 6p + 22. Give i(1). -1964 Let f(j) = 6845j + 3935865. Give f(-575). -10 Let m(r) = -2082r + 6658. What is m(2)? 2494 Let l(b) = -2683b + 810258. What is l(302)? -8 Let p(i) = 10i*2 - 1013i + 23296. Give p(66). -2 Let h(u) = -u*3 + 10u*2 + 1013u + 3401. What is h(-25)? -49 Let i(h) = 163064h - 1956774. Calculate i(12). -6 Let p(d) = -25d3 - d2 - 42d + 127. Give p(3). -683 Let o(l) = 3192l + 5789. What is o(-3)? -3787 Let z(v) = 175997v - 352007. Calculate z(2). -13 Let k(v) = 501v3 + v2 + 404v - 404. Determine k(1). 502 Let x(r) = r2 - 4173r + 2378048. Give x(681). -4 Let q(w) = 653w - 5481. Give q(7). -910 Let j(n) = -126811n + 1141311. Determine j(9). 12 Let c(t) = 531t - 57396. Calculate c(108). -48 Let v(l) = 2l*2 - 6315l + 37830. Calculate v(6). 12 Let t(x) = 6x2 - 50860x - 254453. Give t(-5). -3 Let z(y) = 40y2 + 7360y + 156. Determine z(-184). 156 Let q(v) = -v*2 + 5230v + 109879. What is q(-21)? -392 Let t(w) = 1453w + 21812. Determine t(-15). 17 Let r(z) = z3 + 105z*2 - 5053z - 822. Give r(36). 6 Let r(s) = 6s2 - 743s + 12135. What is r(19)? 184 Let f(b) = 26b2 - 224b + 27. Give f(10). 387 Let w(a) = 279a + 328. Give w(-4). -788 Let u(j) = 7j*3 + 1567j*2 + 1343j + 1206. Give u(-223). 91 Let v(t) = 414370t - 1657492. What is v(4)? -12 Let d(o) = 380o*2 + 12o + 16. Determine d(-1). 384 Let d(t) = t*3 - 139t*2 + 50t + 12185. Determine d(138). 41 Let o(s) = 20747s - 145243. What is o(7)? -14 Let s(m) = -494m - 268. Calculate s(-2). 720 Let d(x) = -75x2 - 3139x + 364. Calculate d(-42). -98 Let u(k) = k*2 - 646k - 133843. Give u(-165). -28 Let w(y) = -96y2 + 1977y - 2917. Calculate w(19). -10 Let y(f) = f*3 - 83f*2 - 415f + 13478. What is y(86)? -24 Let q(w) = 37w2 - 504w + 474. Give q(1). 7 Let h(u) = -2757u + 10981. Give h(4). -47 Let k(j) = -1683j - 62611. What is k(-37)? -340 Let m(b) = -3b3 + 106b*2 - 475b + 496. Give m(3). -56 Let h(o) = 35732o - 142930. Determine h(4). -2 Let t(c) = 11c + 1405. Give t(-30). 1075 Let q(l) = l*2 - 160l + 4443. What is q(138)? 1407 Let p(v) = -96v2 - 502v - 1520. What is p(-3)? -878 Let c(h) = -11h2 + 692h - 1982. Give c(3). -5 Let h(j) = 80621j + 241868. What is h(-3)? 5 Let d(w) = 8w*3 + 60w + 127. Give d(-5). -1173 Let u(f) = f*2 + 16491f + 1443468. Determine u(-88). 4 Let m(p) = 219p + 2396. Give m(-12). -232 Let f(s) = -2s*2 + 537s - 27717. Calculate f(70). 73 Let r(x) = -x*3 + 33x*2 + 25866x - 778674. What is r(30)? 6 Let t(i) = -i*3 + 12i*2 - 127i + 1840. Calculate t(13). 20 Let z(w) = 7w2 + 46337w + 831786. Calculate z(-18). -12 Let j(m) = -m*3 - 13m*2 + 1288m - 46. Determine j(-43). 40 Let l(z) = z*2 + 76013z + 152023. Calculate l(-2). 1 Let p(d) = 239d2 + 1204d + 61. Calculate p(-5). 16 Let x(m) = -m*3 + 17m*2 + 430m + 429. What is x(-13)? -91 Let t(c) = -6c3 - 34c*2 - 306c - 1865. Calculate t(-6). 43 Let n(d) = -596d - 4155. Calculate n(-7). 17 Let q(f) = -6f*2 - 8177f - 512309. Calculate q(-1297). 6 Let x(c) = 632c - 347693. What is x(550)? -93 Let x(r) = 105r*2 - 12r + 16. Give x(3). 925 Let t	{ "pile_set_name": "DM Mathematics" }
e? False Is 25247 prime? True Is 123341 prime? True Is 8219 a prime number? True Is 4553 prime? False Is 139879 a prime number? False Is 147685 a composite number? True Is 223207 prime? True Is 38431 a composite number? False Is 118619 a composite number? False Is 562269 a prime number? False Is 88463 a composite number? False Is 20249 a composite number? False Is 75817 a composite number? True Is 4754 a composite number? True Is 15541 composite? False Is 10211 composite? False Is 721 prime? False Is 38089 composite? True Is 240299 a prime number? False Is 34027 composite? True Is 4631017 a composite number? False Is 1531743 a prime number? False Is 58021 a prime number? False Is 3983 a prime number? False Is 744493 a composite number? False Is 11915 prime? False Is 1045081 a prime number? True Is 54515 a prime number? False Is 133583 a composite number? False Is 1931 prime? True Is 11791 prime? False Is 1343053 composite? True Is 126163 composite? True Is 7379 a prime number? False Is 145303 prime? True Is 489194 composite? True Is 9511 composite? False Is 1699001 a composite number? False Is 397483 prime? False Is 104903 a prime number? False Is 1283 a prime number? True Is 21367 composite? True Is 216093 a composite number? True Is 4783 a composite number? False Is 6122 a composite number? True Is 217409 prime? True Is 42869 a prime number? False Is 7151 composite? False Is 17691 prime? False Is 3793921 prime? True Is 70607 a prime number? True Is 3048703 a composite number? True Is 3694 a prime number? False Is 6583 a prime number? False Is 61441 prime? True Is 108581 prime? False Is 57461 a prime number? False Is 552659 composite? False Is 44399 composite? True Is 16249 a prime number? True Is 17077 prime? True Is 93851 prime? True Is 1979 a prime number? True Is 5306737 a prime number? False Is 14621 a prime number? True Is 1475365 prime? False Is 78301 a prime number? True Is 1361 prime? True Is 228829 composite? False Is 127481 prime? True Is 159533 prime? False Is 8339 prime? False Is 2627 prime? False Is 104459 a prime number? True Is 220541 a composite number? True Is 15493 a composite number? False Is 1522 prime? False Is 511889 prime? False Is 50363 prime? True Is 49079 prime? False Is 68533 a composite number? True Is 253 a composite number? True Is 1373521 composite? False Is 1261253 composite? True Is 97771 composite? False Is 16301 a prime number? True Is 701 a composite number? False Is 2435 a prime number? False Is 10481 a composite number? True Is 126253 a composite number? True Is 31991 prime? True Is 15634 a composite number? True Is 221393 composite? False Is 3859 a prime number? False Is 4453349 a prime number? True Is 9647 composite? True Is 139543 a prime number? False Is 2741 a prime number? True Is 5583 prime? False Is 3518 composite? True Is 1369 a prime number? False Is 120011 a prime number? True Is 4609 a composite number? True Is 47777 prime? True Is 2159 prime? False Is 6606335 prime? False Is 13027 prime? False Is 6863 a prime number? True Is 27527 a prime number? True Is 2028127 a composite number? True Is 17957 a composite number? False Is 13309 prime? True Is 3763 composite? True Is 5939 prime? True Is 379 a composite number? False Is 2204753 composite? True Is 4357 a composite number? False Is 107171 prime? True Is 831293 a composite number? True Is 82021 composite? False Is 3746 prime? False Is 52373 prime? False Is 266909 prime? True Is 126653 composite? False Is 238573 composite? False Is 1361 a composite number? False Is 39313 a composite number? False Is 17833 prime? False Is 4886501 a prime number? True Is 218359 a prime number? False Is 34157 prime? True Is 69593 a prime number? True Is 46597 composite? True Is 23447 a prime number? True Is 46327 prime? True Is 60563 a prime number? False Is 402637 a composite number? True Is 21 a prime number? False Is 15397 prime? False Is 112699 a composite number? True Is 72211 a composite number? False Is 716249 prime? True Is 619933 prime? False Is 397473 a composite number? True Is 3847 composite? False Is 160933 composite? False Is 229399 prime? True Is 1847 a composite number? False Is 14233 composite? True Is 16411 a composite number? False Is 11401 composite? True Is 26293 a prime number? True Is 526151 a prime number? False Is 44927 composite? False Is 947167 composite? True Is 18323 prime? False Is 14621 a prime number? True Is 62817 prime? False Is 4493 a composite number? False Is 449 composite? False Is 169 prime? False Is 8663 composite? False Is 769 prime? True Is 23323 prime? False Is 482722 a prime number? False Is 7063 composite? True Is 16273 composite? False Is 32869 composite? False Is 24163 a prime number? False Is 16657 a prime number? True Is 134267 composite? True Is 75373 composite? True Is 1411 prime? False Is 408607 a composite number? False Is 52807 a prime number? True Is 838667 a composite number? False Is 457 prime? True Is 15685 a prime number? False Is 2043467 prime? True Is 31051 a composite number? False Is 1896407 prime? True Is 77819 a composite number? True Is 119359 a prime number? True Is 30931 composite? False Is 3389 composite? False Is 57871 a composite number? True Is 104087 prime? True Is 25549 composite? True Is 226934 prime? False Is 11369 a prime number? True Is 1009 a prime number? True Is 4578211 prime? False Is 10513 prime? True Is 9517 a prime number? False Is 125167 composite? True Is 11699 prime? True Is 110017 a composite number? False Is 24829 a prime number? False Is 20759 composite? False Is 919337 a prime number? True Is 882541 composite? True Is 858563 composite? False Is 12841 a prime number? True Is 30047 composite? False Is 32919 a prime number? False Is 94889 a prime number? True Is 1023163 composite? False Is 667649 a prime number? True Is 7613 composite? True Is 24394 composite? True Is 257639 prime? True Is 2018 a composite number? True Is 105613 prime? True Is 17203 a composite number? False Is 243833 a prime number? False Is 22771 a composite number? True Is 728881 composite? False Is 7067 composite? True Is 1677103 a composite number? True Is 1941 a composite number? True Is 15559 composite? False Is 209921 prime? False Is 8663 composite? False Is 94099 prime? True Is 9871 a composite number? False Is 19181 a composite number? False Is 755473 a composite number? False Is 30869 composite? False Is 168619 composite? True Is 1847 composite? False Is 950809 a composite number? False Is 445 a prime number? False Is 263 a composite number? False Is 156311 a prime number? False Is 161201 a composite number? False Is 515621 a prime number? True Is 15613 a composite number? True Is 676501 a prime number? False Is 57842 a composite number? True Is 149953 composite? False Is 272249 composite? False Is 23971 a composite number? False Is 7985 prime? False Is 30454 a prime number? False Is 1251287 prime? True Is 6761 a prime number? True Is 1226 a prime number? False Is 529097 a prime number? True Is 1595701 a prime number? True Is 70402 a composite number? True Is 50831 a prime number? False Is 455071 a composite number? True Is 546293 a prime number? False Is 843214 a composite number? True Is 418193 a composite number? True Is 20089 composite? False Is 17087 prime? False Is 151531 a prime number? True Is 24901 prime? False Is 669847 a prime number? True Is 74071 composite? False Is 143371 prime? False Is 10129 a prime number? False Is 74797 a composite number? False Is 60373 composite? False Is 437 a prime number? False Is 122123 a composite number? True Is 9917 composite? True Is 135559 composite? False Is 9649 composite? False Is 2933547 composite? True Is 122633 composite? True Is 325661 a composite number? True Is 95971 a prime number? True Is 4327 a prime number? True Is 63809 prime? True Is 627197 a prime number? True Is 19121 composite? False Is 31007 a prime number? False Is 6995 composite? True Is 1969 composite? True Is 2371 a composite number? False Is 11449 a composite number? True Is 14659 prime? False Is 449821 a prime number? True Is 1345 a composite number? True Is 18586 composite? True Is 4139 a composite number? False Is 1775261 composite? False Is 569651 a prime number? False Is	{ "pile_set_name": "DM Mathematics" }
he closest to 0 in 1, 0.2, v? 0.2 Let i = -6630 - -6625. Which is the nearest to -15? (a) -4 (b) i (c) -0.2 b Let y = -0.0808 + 358.5808. Let z = y + -294. Let p = -65 + z. What is the nearest to 2 in p, 0.1, 0? 0.1 Suppose 2n - 3n = 0. Let c = 71994 + -143989/2. What is the closest to c in 5, 1, n? n Let m = 3101 - 3102. Which is the closest to -9? (a) 5 (b) 0.1 (c) -0.2 (d) m d Let i = -258.56 - -255.56. What is the closest to 3 in -69, -4/3, i? -4/3 Let t = -1843 + 1843.04. Let d = -0.06 - -0.56. Which is the closest to -2/3? (a) t (b) 3 (c) d a Let f = 25918 - 25915.36. What is the closest to 4/13 in -0.4, 0.3, f? 0.3 Let w be ((-15)/35)/((-20)/70). What is the nearest to -1/3 in w, 1/253, 4? 1/253 Let x = 80 - -154. Let u = x + -236. What is the nearest to -2/3 in -4, u, -0.1? -0.1 Let o = -112.576 + 113. Let x = o + -0.424. Let l = 2 + -3. What is the closest to l in x, 4, -2/9? -2/9 Let f = 1113.6 + -1112.3. Which is the nearest to -0.1? (a) -11 (b) 4 (c) -0.5 (d) f c Let z = 71/7 + -10. Let w be (0 - 1)/((-4)/((-7408)/12)). Let j = w - -154. Which is the nearest to -2? (a) j (b) z (c) 0.3 a Let t = 4284 + -4287. What is the nearest to 88 in t, -4, 2/5, -1? 2/5 Let r = -0.474 - -0.237. Let z = 0.237 + r. What is the nearest to 0.1 in 0.02, -1/4, z? 0.02 Suppose -20 + 24 = 4i - 4f, -2i - f + 17 = 0. Let p be ((-8)/i)/((-20)/(-6)). Which is the nearest to p? (a) 2 (b) 1 (c) 5 b Let d = 2 + -1.5. Let y = -92 - -87. Let q = -2.132 - -2.232. Which is the nearest to q? (a) d (b) y (c) -8 a Let d = -29.2 - -26.2. Let u = 4 - 4.4. Let j = 0.224 + -0.314. What is the nearest to j in -0.3, d, u? -0.3 Let p = -170413/7 - -24345. Let r = 1.99 + 0.01. Let l = -0.1 - -0.3. Which is the nearest to p? (a) 1/4 (b) l (c) r a Let g = -25/4 + 27/4. Let d(v) = -v - 1. Let h be d(-1). Let q = -65.8 + 70.8. What is the nearest to g in -0.4, h, q? h Let h = 552.5 - 549.5. Which is the nearest to 2/5? (a) h (b) 0.07 (c) 4 (d) 0.5 d Let j = -0.047 + 0.147. Let v be 0/11 + (2 - 0). Let d be (v/(-20))/(16/40). What is the closest to j in 5, d, -5? d Let d = -236.96 - -240. Let t = d + -2.84. What is the nearest to 3 in t, -0.3, 2? 2 Let t = -9947.8 + 9951. What is the closest to 1 in -0.5, -3, -0.2, t? -0.2 Let t = 6.3 - 0.3. Suppose -z = -3z - 10. Let x be 1 - ((-130)/(-14) + (-192)/24). What is the closest to x in 1, z, t? 1 Let n = 21411.11 + -21410. What is the nearest to 9 in n, 0.2, 1? n Let z = 7747 - 7747. What is the nearest to z in 5, 8/5, 1/6? 1/6 Let g = -13045 + 13044.9. Which is the nearest to -5? (a) 0.3 (b) g (c) 9 (d) -0.02 b Let h = -1613/7 - -12897/56. Which is the closest to -2/7? (a) -0.5 (b) 13/509 (c) h c Let i be (4/24-4)/((-10)/15). Let w = -27.69 + 28. Let z = 0.01 - w. Which is the nearest to i? (a) z (b) -9 (c) -0.5 a Let w be -1 + (-25)/5 + 0 + 2. Let h = -0.1 - 2.9. Let j = -0.0019 - 1.9981. Which is the nearest to j? (a) w (b) h (c) 1/5 b Suppose 0 = -4f - y + 19, 32y = -2f + 36y + 14. Suppose 2b + 1324 = -b + 2h, 3b + fh = -1331. What is the nearest to 0 in b, 0.4, 0? 0 Let l(j) = -j3 + 2j2 + j - 6. Let s be l(3). Let w = -9 - s. Let a = 177/4 - 44. What is the closest to a in -1/5, w, 1? -1/5 Let p(c) = -c3 - 197c2 + 14c + 2760. Let r be p(-197). Let l = -51/5 - -11. What is the nearest to 1 in 1, l, r? 1 Let r = -2694 - -2690.9. Which is the nearest to r? (a) -5 (b) 1 (c) 9/13 a Let b be 11/((-33)/9) - (-42 - -38). What is the closest to b in 0.89, -7, -0.2? 0.89 Suppose -19682 = -2s - 19684. Which is the nearest to 0.4? (a) 4 (b) 0.2 (c) s (d) 4/5 b Let a = 947/66 + -85/6. Let g = -10 + 22. What is the closest to g in a, -0.5, 0.4? 0.4 Let j = 31 + -94/3. Let o(v) = -v3 - 6v2 - v - 3. Let s be o(-6). Let g = -0.179 + 0.109. What is the closest to j in -3, g, s? g Let q = -17174 - -17176. Which is the nearest to -0.1? (a) q (b) -52 (c) 1 (d) 78 c Let c = -5.9 - -0.9. Let r = -0.096 - -0.426. Let s = -0.07 - r. What is the closest to 0.1 in c, -3, s? s Let f = 0.1023 + -0.1023. What is the closest to f in -26, -2/11, 4? -2/11 Let d = 8/7 - 23/14. Let j = -7.69 + 5.49. What is the closest to -1 in -5, j, d, -2? d Let i(l) = l3 - 22l2 + 62l - 91. Let u be i(19). What is the closest to 3 in u, 0.5, -7/3? u Suppose -6u + 573 = -21u + 363. What is the closest to -1/4 in u, 0.5, 3, 2/7? 2/7 Let w be (3/(-7))/(-3)(-609)/(-174). Let s = -265 + 541/2. Which is the nearest to 1? (a) 0.8 (b) w (c) s a Let y = -849 - -477. Let o = y - -363. What is the nearest to -1 in -3, o, 0, -2/7? -2/7 Let r = 23934 + -2896013/121. Which is the closest to -0.1? (a) r (b) -2 (c) 17 a Let s = -27.1 + 27.1149. Let w = 0.1149 - s. Which is the closest to w? (a) 1/7 (b) 0.3 (c) 2 a Let r = 59529/10 - 5953. Which is the nearest to -5? (a) -1 (b) r (c) 1/2 a Suppose -z = 3z - 5w + 1, 0 = -5w + 5. Suppose 4p - z - 8 = 5d, d = -5p + 4. Let u be p + (-44)/12 + 3. What is the closest to 0 in 0, -0.5, u? 0 Let h = 28 - 27. Suppose 5n - 16 = -3k, 2n - 3k = -h + 20. Suppose 4v - n = -17. Which is the closest to 0.1? (a) -27 (b) -0.5 (c) v b Let o = 3396 - 3395.8. Which is the nearest to -0.3? (a) o (b) 0.5 (c) 461 a Let k be (-57)/42 - (-2)/4. Let a be 105/(-30) - (3 + -5)2. What is the closest to -1/5 in k, -0.5, a? -0.5 Let v = -2885 + 2885.06. What is the closest to v in 6, 3, 4/5? 4/5 Let g = 7990.61 + -7991. What is the closest to 2/9 in -4, g, 1/3? 1/3 Let n = 2981 + -2978. Let m = 3766/11 + -342. Which is the nearest to -3? (a) m (b) 1 (c) 0.1 (d) n c Let k = -0.9994 + 0.9994. What is the nearest to k in -2/13, -23, -48, -4/7? -2/13 Let b = 4.747 + 0.253. Suppose 0f + f = -5. Let t = -2 - f. What is the closest to t in b, -0.5, -0.1? b Let s = -3152/9 - -72658/207. Let a = s - 239/276. Let l(o) = 763o - 12207. Let r be l(16). What is the nearest to r in 0, 3, a? 0 Let n = -105.1 - -120.1. Let w be 3/4(-77)/21 - -3. What is the closest to -1/7 in w, -5, n? w Suppose -4k = 5n - 3 + 6, 0 = -5k + 5n + 30. Which is the closest to -0.2? (a) -61 (b) 3/2 (c) k (d) 0.4 d Let l = -1.861 + 15.861. What is the closest to -30 in -5, l, -1? -5 Let i be (-1 + -1)/(1 + -10). Suppose -6f - 144 = -4g - 3f, 4g + f - 128 = 0. Let l be g/(-22) - (-27)/14. What is the closest to i in -3, l, -4? l Suppose 5r = 2r + 12, -5 = 3z - 2r. Let h = 66299/264 + -2019/8. Let j = h - 1/132. Which is the closest to z? (a) -4 (b) -2/23 (c) j b Suppose 5f + 4i + 115 = 0, 104 = -2f - 5i + 41. Let x be (-23)/38 + (-2)/f. What is the nearest to x in -24, 3/8, -0.4, -3/8? -0.4 Let s = 9.4 + -11. Let y = s + 0.6. Let o = -23.2 + 21.2. Which is the closest to 0.2? (a) o (b) 3 (c) y c Let b = 43.31 - 43.51. What is the closest to 0 in b, -1, -3? b Let q(z) = 5z2 - 99z + 158. Let y be q(18). Which is the nearest to -2? (a) -0.1 (b) -1204 (c) -1/3 (d) y c Let z be -1 + (6 - 4) + -8. Let i be (-3)/7 + (-10)/z. Let x = 0.03 + -5.03. What is the closest to 0.3 in x, 3, i? i Let v = -5 + 3. Suppose 1801l + 2041 + 2479 = 671l. Which is the closest to -13? (a) 0.3 (b) l (c) v b Let x = 21637/28860 - -2/7215. Suppose -3w = 2 + 4. Which is the closest to w? (a) x (b) 2 (c) -15/8 c Let m = 1.9 + -2. Let q = 857 - 4553/5. Let l = 2978/55 + q. What is the nearest to l in 0.4, m, 5? 0.4 Let p = -61.26 + 77.9. Let z = p + -17. Let c = z + 0.26. What is the closest to c in 0.3, -2/5, 3? -2/5 Let y = -4025 + 4024.6. Let b = -2 - -2. What is the closest to b in -0.09, y, 0? 0 Let r = -18 + 17. Let t = -13749/2522 - -13/194. Let f = t - -223/39. Which is the nearest to f? (a) 0.3 (b) r (c) 0 a Let o be -3 + -2 + -17. Let n(t) = 6t + 71. Let p be n(o). Let q = 1 + -5. What is the nearest to 2/3 in 4, q, p? p Let h = -14.924 - -14.724. What is the nearest to h in 4, -1, -3, -0.1? -0.1 Let y = -102.8 - -102.3. Which is the nearest to -11? (a) -3 (b) -9 (c) y b Let t = -1459 + 1456. Let h = 13.5 - -0.5. Which is the closest to 0.1? (a) h (b) -2/11 (c) t b Let l = -23.46 + 19.46. Let r = 15 + -12. Suppose 4q - 5k - 29 = 0, -5k - 26 = -rq + 2. What is the closest to -4/9 in -1/2, q, l? -1/2 Let h be (522/244 - 2)26/(-3). Let s = 219365/20	{ "pile_set_name": "DM Mathematics" }
)) and d(0 + 3)-1. 8 Let g be (-3 - 1) + 47787/(-18). Let n = g + 2667. Let c = -2/14671 + 836287/293420. Calculate the common denominator of c and n. 60 Let r = 92745 + -51937169/560. What is the common denominator of r and -101/14? 560 Suppose 0d + 2145 = 13d. Calculate the least common multiple of d and 231. 1155 Calculate the lowest common multiple of (36/(-14))/(2/(-14)) and (-225)/(-12) + (-21)/28. 18 Let v(j) = j*2 - 2j + j2 + 1 - j2 + 4j3. Let k = -12 - -19. Calculate the least common multiple of v(1) and k. 28 Let t = 3 - 9. What is the least common multiple of 8/24 - 10/t and (4 - (-3 + 12))/(-1)? 10 Suppose -3o + 44 = -o. Calculate the least common multiple of (((-8)/(-3))/2)/(146/5913) and o. 594 Let h = 1/23766 - 199381/253504. What is the common denominator of h and -47/16? 192 Let x(y) = -4y + 5. Let v be x(-7). Suppose 2p = -p + v. Let o = -235 - -244. What is the least common multiple of p and o? 99 Let w = 1315 - 2709/2. Calculate the common denominator of w and -2103/18 - -3. 18 Let s = 14 + -29. Calculate the common denominator of s/(-8)28/21 and -47/10. 10 What is the common denominator of (60/(-8))/(((-108)/11)/6) and -33/4? 12 Let u = -1/203 + 3863/1218. What is the common denominator of u and 41/478? 1434 What is the common denominator of 37/80 and 194/(-10)((-250)/(-28))/25? 560 Let i be ((61438 - -5) + -2)/(38 - -1). Let f = i - 1575. What is the common denominator of f and -35/18? 234 Suppose -2v - 4c + 2c + 2 = 0, -v + 6 = -4c. Suppose -a - vl = -1 - 4, 0 = -a - l. Calculate the smallest common multiple of 39 + a + -6 + 2 and 3. 30 Let j = 1073 - 65. Let m = -5093/5 + j. Find the common denominator of -7/3 and m. 15 Let h = 1474 + -29601/20. Find the common denominator of 95/388 and h. 1940 Let z(c) = 34c + 5. Let t be z(1). Suppose -3o + 4k + 76 = 0, -4k - 61 = -4o + t. What is the lowest common multiple of o and 24? 24 Let g be (898/27)/((-8)/(-84)). Let x = g - 139147/396. Find the common denominator of 41/18 and x. 396 Let l = -387 + 409. Calculate the smallest common multiple of l and 22. 22 Let q be (-2 - 2764) + -7 + -21. Let c = q - -102648/37. Calculate the common denominator of 35/2 and c. 74 Suppose -17u + 221 = -204. What is the lowest common multiple of 13 and u? 325 Let u = -9913/8 - -1241. Find the common denominator of 13/8 and u. 8 Let j = -107 + 165. Suppose 5w - 2b - j = 2w, 2b = -2w + 32. What is the common denominator of -103/22 and (-4)/w - (-1354)/(-144)? 88 Let z = -8 - -4. Calculate the smallest common multiple of 8 and z/(2 + 4/(-1)). 8 Let r be 2/(-4)(-2 - -4)-90. Find the common denominator of ((-2)/3)/(r/(-75)) and 41/4. 36 Let h = 18 + -12. Suppose 3g - 3 = -l, 3l - 7g + 6g - 49 = 0. What is the least common multiple of h and l? 30 Let z = 86 - 84. Let i(a) = 2a + 16. What is the lowest common multiple of 12 and i(z)? 60 Suppose -75 = -9s + 240. Suppose 6l = -l + s. Calculate the smallest common multiple of 4 and l. 20 Let a = -84 - -252. Suppose -3m + 6m - a = 0. What is the smallest common multiple of 10/4m/10 and 18? 126 Suppose -29 = -4i + 3. Calculate the least common multiple of i and 5 - (1 + (-6)/(-3)). 8 Let b = 128 - 547. Let h = 2915/7 + b. Find the common denominator of h and (-5)/(4(-18)/264). 21 Let z = -62761/780808 + -101/2674. Calculate the common denominator of -139/6 and z. 1752 Let k = 6 - -4. Let f be 0/k - 45. Find the common denominator of -57/2 and (-15)/f(-46)/9. 6 Calculate the common denominator of 137/24 and ((-10)/(-25))/(11/(9471/(-56))). 120 Let h = -10 - -13. Let c = h - -6. Calculate the lowest common multiple of c and 8. 72 Let u(z) = -z + 17. What is the smallest common multiple of 7 and u(-18)? 35 Let a be ((-2)/(-474))/(21/(-63)). Let d = a + 2773/632. Find the common denominator of d and 85/6. 24 Let g = 316557/35 - 9046. Calculate the common denominator of g and 33/28. 140 Calculate the common denominator of 45/26 and 801/(-21)(91/42 - 2). 182 Let y be (-129)/2 + 4/8. Find the common denominator of 19/22 and 30/y(-4)/(-6). 176 Let g = 4273 - 85457/20. Let t = -138801/61240 + -13/1531. What is the common denominator of g and t? 40 Suppose 72 + 824 = 5g - t, 4g + t - 724 = 0. What is the least common multiple of g and 4? 180 Calculate the common denominator of ((-3)/((-12)/(-22)))/(-5) and (-76)/874 - 503/(-230). 10 Let b(a) = 12a + 44. Calculate the smallest common multiple of 8 and b(1). 56 Let k be (-2)/3 - (-99918)/(-54). What is the common denominator of (-8)/20 - (-1)/((-90)/k) and -26/27? 54 Let p = 2805 - 28083/10. Find the common denominator of 547/30 - (-30)/(-75) and p. 30 Suppose -3u - 250 = 17. Calculate the common denominator of 43/12 and 25/(-30)u/5. 12 Calculate the common denominator of (8 - (-12)/(-6)) + 83/(-7) and -9/196. 196 Let c(s) = s + 15. Let w(l) = 10l2 + l3 + 7l - 8 - 3l + 5l. Let r be w(-9). Calculate the least common multiple of c(r) and 9. 63 Let y be (-504)/(5 - -2)4/6. Calculate the common denominator of -67/36 and 10/(-80) - 442/y. 36 Suppose j - 5 = -5p, 0 = 31p - 28p - 4j - 26. What is the smallest common multiple of p and 1232? 1232 Let t = 15941/18 + -676/9. Let z = t + -839. Calculate the common denominator of z and -29/22. 22 Let o = 4 - -8. What is the common denominator of 9/7 and 5/((-4 - -3) + o)? 77 Let i = 704 - 703. Calculate the lowest common multiple of ((-2)/4)/(1/(-20)) and i. 10 Suppose 26 = -5h + 146. Suppose -7 = -4w + 3c - 3, 3c = -3w + h. Suppose -j + 90 = wj. What is the least common multiple of j and 14? 126 Let p = 54601/5410 + 4/541. Let i = -467 - -9323/20. Find the common denominator of p and i. 20 Suppose 424 = 111o - 107o. Calculate the least common multiple of 6 and o. 318 Suppose 697d - 700d + 108 = 0. What is the least common multiple of 4 and d? 36 What is the common denominator of 699/81 + -6 - 2/2 and -79/120? 1080 Find the common denominator of 145/66 and (1159/165 - (-11 - -18))40. 66 Suppose 3j + 300 = 3h, 3j = -4h + j + 412. Calculate the lowest common multiple of h and 9. 306 Let i = 1032 - 10403/10. Suppose 2q + 0q = 3d + 113, -4d - 5q - 189 = 0. Find the common denominator of i and d. 10 Suppose -3b = 5q - 17, 5q + 1 = -2b + 19. Suppose -38 + 2 = -qo. Calculate the lowest common multiple of o and 3. 9 Let c = -405/124 + -65927/620. Let d be (9981/27)/((-10)/3). Let i = c - d. What is the common denominator of -145/18 and i? 90 Suppose 3f + 4w - 35 = 35, -4f = -3w - 60. Calculate the lowest common multiple of 9 and f. 18 Let s = 5 - -2. Suppose -100x - 54 = -109x. What is the least common multiple of s and x? 42 Let x = -666 - -677. What is the smallest common multiple of x and 342? 3762 What is the least common multiple of 12(2 + (-80)/(-15)) and 11? 88 What is the common denominator of -47/108 and 6/(-150)145/6? 540 Let j = 28 - 12. Suppose -5b - 3g = -92, -3b + 96 = 2b - g. Let x = b - 3. Calculate the least common multiple of x and j. 16 Let v be (515/25)/(-11). Calculate the common denominator of -4 + 1 + 232/128 - v and -99/62. 496 Suppose 5y - 1314 = -2q, 4q = 7y - 12y + 1308. What is the lowest common multiple of y and 18? 792 Let r = 18671 - 448183/24. Find the common denominator of -59/57 and r. 456 Suppose 4s + 178 = 2d, 4s + 280 + 165 = 5d. Calculate the common denominator of (-105)/84106/10 and d/16 + 1/2. 16 Suppose h = -h - n + 29, 3h - 60 = 4n. Let b = 20 - h. Suppose -bx + 5x = 4. Calculate the least common multiple of x and 10. 20 Suppose i + 308 = 3g, -3i = 5g - i - 506. Let y = g - 66. Calculate the lowest common multiple of 4 and y. 36 Suppose -3 = 4t + 1. What is the common denominator of (t/(-2)142)/10 and 5/5 - 43/(-6)? 30 Suppose -2z = 3s + 16, 5z = -6s + 2s - 33. Find the common denominator of -97/14 and (-4 - s) + 603/180. 140 Let p = -2171/3 + 733. Calculate the common denominator of 89/12 and p. 12 Suppose -o - 4 = 12. Let z be 12/o - 6589/(-8796). Let s = 41797/17592 + z. Calculate the common denominator of 95/2 and s. 8 Let v = 16109/20 - 808. What is the common denominator of v and 121/100? 100 Calculate the common denominator of -75/16 and 2345/(-280) + 1 - 0. 112 Suppose -16 = w - 34. Let i = w + -9. Cal	{ "pile_set_name": "DM Mathematics" }
der. 185, 41, 0, -75 Sort -2/13, 35, 0.5, 0.9, 6/13 in increasing order. -2/13, 6/13, 0.5, 0.9, 35 Sort 5, 3/2881, -1, 0.27 in decreasing order. 5, 0.27, 3/2881, -1 Put -9, -34, 1, -11 in ascending order. -34, -11, -9, 1 Sort -3402, 26, 3 in decreasing order. 26, 3, -3402 Put -11, -97, 1 in increasing order. -97, -11, 1 Sort -132, -5, 228. -132, -5, 228 Put -4, 1, 271, -22, -5 in decreasing order. 271, 1, -4, -5, -22 Put 1, -0.05, 168/11, 5, -2, -1/2 in descending order. 168/11, 5, 1, -0.05, -1/2, -2 Put -5, 0, 2214 in decreasing order. 2214, 0, -5 Sort 4, 5, -5, -270, 1, -2 in increasing order. -270, -5, -2, 1, 4, 5 Put -2, -21.1, -1, 3, -0.08 in increasing order. -21.1, -2, -1, -0.08, 3 Sort 5, 0, -4, -5, -2806, 3. -2806, -5, -4, 0, 3, 5 Put 4, -3, 3, -591 in ascending order. -591, -3, 3, 4 Sort 49685, 2, -4 in increasing order. -4, 2, 49685 Sort 3724, -4, 3. -4, 3, 3724 Sort -8/3, 1/46, 0.5, 71 in increasing order. -8/3, 1/46, 0.5, 71 Put 0.3, -4, -1/2, 26, 0.1, -5 in descending order. 26, 0.3, 0.1, -1/2, -4, -5 Put -2607, 3, -56, 5 in descending order. 5, 3, -56, -2607 Put 4, 14301, 0 in decreasing order. 14301, 4, 0 Sort 9, 25, 4, -3/7, 0.03 in ascending order. -3/7, 0.03, 4, 9, 25 Sort -4, 0, 4, -5, -850. -850, -5, -4, 0, 4 Sort 9, 4, 16468, 2 in decreasing order. 16468, 9, 4, 2 Sort -2, -1, -26, -382 in decreasing order. -1, -2, -26, -382 Sort 0.2, -17, -2, 44, -43 in increasing order. -43, -17, -2, 0.2, 44 Sort 3/4, -4623, -0.03. -4623, -0.03, 3/4 Sort 0.5, 0.68, 0, -0.1, 3/8, -1 in increasing order. -1, -0.1, 0, 3/8, 0.5, 0.68 Put 0.1, -2/19, 1001.5, 0.4 in decreasing order. 1001.5, 0.4, 0.1, -2/19 Sort -4, -357, -7, -8. -357, -8, -7, -4 Sort 0, 8, -0.3, 2/465, -4, -18. -18, -4, -0.3, 0, 2/465, 8 Sort 1844, -56, -19, -1 in decreasing order. 1844, -1, -19, -56 Sort 2, 0, -5, 1479, -4 in increasing order. -5, -4, 0, 2, 1479 Sort 0, 7, -715 in increasing order. -715, 0, 7 Sort 47, 111, 5, 78. 5, 47, 78, 111 Sort 0.1, 2/7, -46, -4, -0.3, 1/4 in ascending order. -46, -4, -0.3, 0.1, 1/4, 2/7 Sort 0.4, 3.1, 0.2, 56/5. 0.2, 0.4, 3.1, 56/5 Put -2/7, 66, -0.2, 0.4, 1/5 in decreasing order. 66, 0.4, 1/5, -0.2, -2/7 Put -2, -0.06494, 28 in descending order. 28, -0.06494, -2 Put -3, 33, 1, -591 in decreasing order. 33, 1, -3, -591 Put -1, 8.1, -1/10, -1/3, -1/5 in ascending order. -1, -1/3, -1/5, -1/10, 8.1 Put 14, 4, -8, -7, 5, 3 in ascending order. -8, -7, 3, 4, 5, 14 Sort 37, 3, 4, -50, -1 in descending order. 37, 4, 3, -1, -50 Sort 0, 0.03, -2, -70/9, 2, 0.5 in descending order. 2, 0.5, 0.03, 0, -2, -70/9 Sort 3, -495, -7, -3. -495, -7, -3, 3 Sort -3010, -28, -2 in descending order. -2, -28, -3010 Sort -52, -1008, -4 in ascending order. -1008, -52, -4 Sort 5, 864, -3, 12 in descending order. 864, 12, 5, -3 Sort -1/3, 1285, 2, -2/11, -2. -2, -1/3, -2/11, 2, 1285 Sort 611/2, -45, 1 in decreasing order. 611/2, 1, -45 Put -23, -3, -27, 100, -4, 0 in decreasing order. 100, 0, -3, -4, -23, -27 Sort -11, 2, 237, -2, 0. -11, -2, 0, 2, 237 Sort 109385, 1, -1 in decreasing order. 109385, 1, -1 Sort 1.4, 0.5, 36659 in descending order. 36659, 1.4, 0.5 Put -1, -9806, 4, 2 in descending order. 4, 2, -1, -9806 Put 5, 23, -167, 3, 4 in descending order. 23, 5, 4, 3, -167 Sort 6.0494, -1/2, -1/11. -1/2, -1/11, 6.0494 Sort 1786, 16, 2 in decreasing order. 1786, 16, 2 Sort 9, -33, -0.1, 2/5. -33, -0.1, 2/5, 9 Sort -4, 4, -3, 92, -5, 47 in decreasing order. 92, 47, 4, -3, -4, -5 Put -1/3, 0.0057, 1/2, -1, -4, -5 in decreasing order. 1/2, 0.0057, -1/3, -1, -4, -5 Put 1, 413, -116 in descending order. 413, 1, -116 Put 6/7, -3/2, 1, -276 in decreasing order. 1, 6/7, -3/2, -276 Sort -3, 1, -11, -8, -2 in descending order. 1, -2, -3, -8, -11 Sort 26, 20298, 4. 4, 26, 20298 Sort 3, 1, -2, -5, 1519 in increasing order. -5, -2, 1, 3, 1519 Sort -5/4, 3, -1714, -3/5. -1714, -5/4, -3/5, 3 Put -1/30, 3653, 12 in descending order. 3653, 12, -1/30 Sort 5, 0, 18, -5, -269 in descending order. 18, 5, 0, -5, -269 Put 1420, 3, -2, -1, 14 in descending order. 1420, 14, 3, -1, -2 Put -2, 0, 5, 30, -5 in increasing order. -5, -2, 0, 5, 30 Sort -1, -4, 1, -7, -22, 7 in descending order. 7, 1, -1, -4, -7, -22 Sort 2, 7, -178, -3, -11 in increasing order. -178, -11, -3, 2, 7 Sort 101, 7, -5, 4 in decreasing order. 101, 7, 4, -5 Sort -19, -2597, 5 in decreasing order. 5, -19, -2597 Put -7, 0, -3, 1, 2 in descending order. 2, 1, 0, -3, -7 Sort 3, -0.17, -4, 846 in decreasing order. 846, 3, -0.17, -4 Sort 3, -53, -1, 12. -53, -1, 3, 12 Sort -2, 3, -3, 6, -252, -6 in decreasing order. 6, 3, -2, -3, -6, -252 Put -161, 24, -13, -4, -5 in descending order. 24, -4, -5, -13, -161 Sort 0.5, 972, 67.3 in decreasing order. 972, 67.3, 0.5 Put -189/10, 2/7, 2, 0.3 in descending order. 2, 0.3, 2/7, -189/10 Put 6, -12, -20363 in descending order. 6, -12, -20363 Put -2273, -20/11, 4 in decreasing order. 4, -20/11, -2273 Put -10, -63, -3, -3/4, 5 in increasing order. -63, -10, -3, -3/4, 5 Put -14, 0.4, 73, 0 in increasing order. -14, 0, 0.4, 73 Put -1, 2, 73, -30, 26, -6 in descending order. 73, 26, 2, -1, -6, -30 Sort 2, 272/5, 3, 5, -0.064, -1/4. -1/4, -0.064, 2, 3, 5, 272/5 Sort 2, -4, 3, 0.3, -399 in descending order. 3, 2, 0.3, -4, -399 Put -0.8, 1/6, 437.3, 1 in increasing order. -0.8, 1/6, 1, 437.3 Put 4, -14/5, 1.1, 9, -0.12 in ascending order. -14/5, -0.12, 1.1, 4, 9 Put 2285, -1, 3, -4 in descending order. 2285, 3, -1, -4 Put 5, 0, -525, -4, 6 in descending order. 6, 5, 0, -4, -525 Sort 1/5, -0.4, -50/3, -0.031, -5 in ascending order. -50/3, -5, -0.4, -0.031, 1/5 Put 1, -105, -4, -5, 0, 72 in ascending order. -105, -5, -4, 0, 1, 72 Sort -0.01, 7, 24/7, 0, -1/3, 0.04 in ascending order. -1/3, -0.01, 0, 0.04, 24/7, 7 Sort -21, -3, -8, 2 in ascending order. -21, -8, -3, 2 Put 0.2, -79, -0.011 in increasing order. -79, -0.011, 0.2 Put 4, -2/21, -0.5, -49, -4 in ascending order. -49, -4, -0.5, -2/21, 4 Put 3, 1, -2/5, -6/5, -6 in ascending order. -6, -6/5, -2/5, 1, 3 Sort 328, -9, -5, 0. -9, -5, 0, 328 Sort 5/3, -2/13, -0.107, 2, -1/7 in ascending order. -2/13, -1/7, -0.107, 5/3, 2 Put 0, -2, -7, 35 in increasing order. -7, -2, 0, 35 Put 795, -7, 14, -5, -1 in decreasing order. 795, 14, -1, -5, -7 Put 5, 4, -0.2, -5010 in decreasing order. 5, 4, -0.2, -5010 Put 4, -221, 193 in increasing order. -221, 4, 193 Put -4, 5, -645, 33 in decreasing order. 33, 5, -4, -645 Put -4, 3, 608, -26 in decreasing order. 608, 3, -4, -26 Put -5.2, 4, 0.11, -6/13 in increasing order. -5.2, -6/13, 0.11, 4 Sort 11, 1114, -11. -11, 11, 1114 Sort 40, -1, -43443 in increasing order. -43443, -1, 40 Sort 0.1, -0.599, -16, -4, 1/4 in decreasing order. 1/4, 0.1, -0.599, -4, -16 Put 4, -1, -7, -4, 18, 306 in decreasing order. 306, 18, 4, -1, -4, -7 Sort 785, 0, -1, -5 in ascending order. -5, -1, 0, 785 Put 4, 68, -5, -544 in descending order. 68, 4, -5, -544 Sort 0.5, 2/7, -0.078, 2/77 in increasing order. -0.078, 2/77, 2/7, 0.5 Sort -2/13, -8, -7/4, 2, 1. -8, -7/4, -2/13, 1, 2 Sort 2, -39, -4, -5, 0. -39, -5, -4, 0, 2 Sort -0.5, 3/2, -418, 127 in descending order. 127, 3/2, -0.5, -418 Sort -4, -589, 722, 1 in ascending order. -589, -4, 1, 722 Sort -3482, 0, -5, -4 in ascending order. -3482, -5, -4, 0 Sort -10, 5, 313, 4 in ascending order. -10, 4, 5, 313 Sort -3.66, 0.4, 0.57, 4 in descending order. 4, 0.57, 0.4, -3.66 Sort 3, -71, -5, -295 in increasing order. -295, -71, -5, 3 Sort 1, -2, 39, -7/6. -2, -7/6, 1, 39 Sort -4/3, -5, -1/9, -3, 0.1, 0.31 in descending order. 0.31, 0.1, -1/9, -4/3, -3, -5 Put -1.42, -2, 442 in decreasing order. 442, -1.42, -2 Sort -3, 16, 0.011, 6, 1. -3, 0.011, 1, 6, 16 Sort -2, 6.19, 2/5, -9. -9, -2, 2/5, 6.19 Sort -6018, 10, 4 in increasing order. -6018, 4, 10 Sort 0.1, 1, 55, 0.5, -0.07 in decreasing order. 55, 1, 0.5, 0.1, -0.07 Put 182, -2, -1/2, 5, -0.2 in ascending order. -2, -1/2, -0.2, 5, 182 Sort -1/2, 11, 1/11, -2, 0.3. -2, -1/2, 1/11, 0.3, 11 Put 0.5, -1.01, -45 in descending order. 0.5, -1.01, -45 Put -0.02, 0.2, -0.1, 5, -3, -148 in descending order. 5, 0.2, -0.02, -0.1, -3, -148 Put -2, -0.1, -21, -1, -134 in increasing order. -134, -21, -2, -1, -0.1 Sort -0.2, -1/8, 1884. -0.2, -1/8, 1884 Put -10, -22, -45, -1 in descending order. -1, -10, -22, -45 Put -41/4, 0.4, 6, 3, 5 in in	{ "pile_set_name": "DM Mathematics" }
tters picked without replacement from utzutuuuzzuuzzuuzz. 7/306 Two letters picked without replacement from {t: 2, f: 8, z: 9, l: 1}. Give prob of picking 2 t. 1/190 Four letters picked without replacement from {a: 6, p: 1, v: 4, b: 2, x: 3}. Give prob of picking 1 b and 3 x. 1/910 Calculate prob of picking 1 s and 2 w when three letters picked without replacement from {b: 6, h: 2, s: 1, w: 2, d: 3}. 1/364 Four letters picked without replacement from xzxndxzxnnzdzd. Give prob of picking 3 d and 1 n. 3/1001 Calculate prob of picking 1 p and 1 h when two letters picked without replacement from {l: 3, h: 4, p: 1}. 1/7 Calculate prob of picking 2 r and 2 n when four letters picked without replacement from rrbnnnnnr. 5/21 Four letters picked without replacement from {y: 6, i: 1, r: 8, g: 1, c: 3}. Give prob of picking 3 r and 1 y. 28/323 Four letters picked without replacement from aftnttlafftt. What is prob of picking 1 a, 1 f, 1 t, and 1 n? 2/33 What is prob of picking 2 e when two letters picked without replacement from {s: 7, e: 6}? 5/26 Three letters picked without replacement from {g: 7, i: 5}. What is prob of picking 1 i and 2 g? 21/44 Two letters picked without replacement from qdzhiyd. What is prob of picking 1 d and 1 z? 2/21 Two letters picked without replacement from {u: 1, q: 2, y: 12, t: 1, g: 2}. What is prob of picking 1 y and 1 q? 8/51 Four letters picked without replacement from bfbryqbbeerbqqb. What is prob of picking 1 y, 2 q, and 1 e? 2/455 Three letters picked without replacement from {y: 4, q: 5, a: 5}. What is prob of picking 3 q? 5/182 Four letters picked without replacement from {k: 8, z: 1, w: 5, h: 5}. Give prob of picking 3 k and 1 w. 70/969 What is prob of picking 1 g, 1 k, and 1 v when three letters picked without replacement from kvvgkvgvkhkhvgvhgvvv? 12/95 Calculate prob of picking 1 v and 1 j when two letters picked without replacement from {j: 3, v: 2}. 3/5 What is prob of picking 1 a and 1 x when two letters picked without replacement from {x: 11, a: 2}? 11/39 Two letters picked without replacement from {y: 5, r: 6, u: 4, t: 4}. Give prob of picking 1 y and 1 r. 10/57 Four letters picked without replacement from {l: 1, t: 1, b: 5, e: 3}. Give prob of picking 4 e. 0 Two letters picked without replacement from vvhhvvhvhvhhvvvhhvhv. What is prob of picking 2 v? 11/38 Three letters picked without replacement from {x: 5, v: 2}. Give prob of picking 3 x. 2/7 What is prob of picking 2 h, 1 w, and 1 k when four letters picked without replacement from {w: 5, k: 2, e: 3, h: 3, t: 1, j: 1}? 2/91 Three letters picked without replacement from nnnfhnfffnfnnhn. What is prob of picking 2 n and 1 h? 8/65 What is prob of picking 2 p and 2 y when four letters picked without replacement from {y: 2, p: 10, q: 5, f: 3}? 3/323 Three letters picked without replacement from pjqjzmmmqmmqmpjq. Give prob of picking 2 m and 1 z. 3/112 Calculate prob of picking 2 j and 2 s when four letters picked without replacement from {j: 2, v: 2, s: 2, p: 8}. 1/1001 Calculate prob of picking 1 t and 3 b when four letters picked without replacement from {t: 2, x: 1, b: 6, i: 2}. 4/33 What is prob of picking 1 w and 2 e when three letters picked without replacement from aaeweh? 1/20 Two letters picked without replacement from nffjd. Give prob of picking 2 n. 0 Three letters picked without replacement from pxttxyypxyyxxtpp. Give prob of picking 1 x, 1 p, and 1 t. 3/28 What is prob of picking 1 a and 1 x when two letters picked without replacement from cccxaqcccxqxxqaqaa? 16/153 Calculate prob of picking 2 u when two letters picked without replacement from {u: 9, e: 5}. 36/91 What is prob of picking 4 s when four letters picked without replacement from zsszbzsbzzbs? 1/495 Calculate prob of picking 1 w and 1 r when two letters picked without replacement from kpwxpwwwrwkre. 5/39 Calculate prob of picking 2 i, 1 f, and 1 s when four letters picked without replacement from ssisisissisifssiss. 11/204 What is prob of picking 2 u when two letters picked without replacement from {n: 1, o: 1, u: 2, h: 5}? 1/36 Two letters picked without replacement from yyvyvqyvhyhhvvy. Give prob of picking 2 y. 1/7 Calculate prob of picking 2 b when two letters picked without replacement from {i: 7, b: 2}. 1/36 Three letters picked without replacement from kmkggkgkgk. What is prob of picking 1 k, 1 m, and 1 g? 1/6 What is prob of picking 2 k when two letters picked without replacement from kkkkkkkkk? 1 Three letters picked without replacement from {w: 4, u: 4, b: 3}. Give prob of picking 2 w and 1 u. 8/55 Three letters picked without replacement from {a: 1, c: 10, o: 6}. Give prob of picking 3 c. 3/17 Two letters picked without replacement from vhvnvnntvnkivniv. Give prob of picking 2 i. 1/120 Two letters picked without replacement from {r: 2, a: 1, v: 4, d: 7}. What is prob of picking 1 a and 1 d? 1/13 What is prob of picking 1 t, 1 n, and 1 b when three letters picked without replacement from ttttbtttbtnttt? 11/182 Two letters picked without replacement from aga. Give prob of picking 2 a. 1/3 Four letters picked without replacement from mmttttmmmmmrrmmmmtm. What is prob of picking 2 r and 2 m? 11/646 What is prob of picking 2 r when two letters picked without replacement from ryry? 1/6 What is prob of picking 3 t when three letters picked without replacement from ttnntnn? 1/35 What is prob of picking 4 w when four letters picked without replacement from {i: 2, w: 4, a: 2, j: 4}? 1/495 What is prob of picking 1 e and 2 n when three letters picked without replacement from nxmeenreme? 1/30 Three letters picked without replacement from {d: 4, o: 16}. Give prob of picking 1 o and 2 d. 8/95 Calculate prob of picking 1 a, 1 s, and 1 x when three letters picked without replacement from xraarsaraaaar. 7/286 Four letters picked without replacement from {n: 1, u: 2, v: 1, e: 1, t: 4}. Give prob of picking 1 n, 2 e, and 1 v. 0 Calculate prob of picking 2 x when two letters picked without replacement from xxxxxxxxx. 1 What is prob of picking 4 g when four letters picked without replacement from {i: 1, x: 1, g: 9, o: 4}? 6/65 What is prob of picking 1 d, 1 u, and 1 f when three letters picked without replacement from {u: 3, l: 1, r: 3, f: 2, c: 1, d: 2}? 3/55 Two letters picked without replacement from {m: 2, q: 2, b: 1}. Give prob of picking 2 q. 1/10 Two letters picked without replacement from mxb. What is prob of picking 1 b and 1 m? 1/3 Four letters picked without replacement from {d: 1, k: 4, c: 7, j: 4, a: 2}. Give prob of picking 1 c, 1 k, 1 d, and 1 a. 14/765 Calculate prob of picking 1 b, 1 t, and 2 j when four letters picked without replacement from {j: 2, o: 2, b: 2, t: 1, c: 1}. 1/35 Calculate prob of picking 1 s and 1 c when two letters picked without replacement from {c: 1, s: 1, k: 1, t: 6}. 1/36 Calculate prob of picking 2 q and 1 n when three letters picked without replacement from jjjjnejqjeqjjqqqnqjj. 1/38 What is prob of picking 1 s and 1 x when two letters picked without replacement from {x: 6, s: 13}? 26/57 Four letters picked without replacement from mmmmmmmmmmvvmmv. Give prob of picking 4 v. 0 What is prob of picking 2 g when two letters picked without replacement from togggjjtttoqttjjjj? 1/51 Calculate prob of picking 1 b and 1 m when two letters picked without replacement from {b: 3, m: 13}. 13/40 Two letters picked without replacement from {e: 5, u: 1, z: 4, q: 1}. What is prob of picking 2 z? 6/55 Three letters picked without replacement from zyyzqyyz. Give prob of picking 2 y and 1 z. 9/28 Two letters picked without replacement from eceoeocece. What is prob of picking 2 o? 1/45 Calculate prob of picking 1 k and 1 c when two letters picked without replacement from buckj. 1/10 What is prob of picking 2 r when two letters picked without replacement from rllllrllllr? 3/55 What is prob of picking 2 x and 1 f when three letters picked without replacement from xxfx? 3/4 What is prob of picking 2 r and 1 o when three letters picked without replacement from ulllolhlohluolrlllfr? 1/380 What is prob of picking 3 u and 1 x when four letters picked without replacement from iihixuxixxx? 0 Calculate prob of picking 1 t and 2 c when three letters picked without replacement fro	{ "pile_set_name": "DM Mathematics" }
6)/9)/(50/525). Let o(v) = v*3 + 6v*2 - 7v. Calculate o(z). 0 Let l = 1 - 1. Let a(v) = 5 + 5021v + 5020v - v3 + v2 - 10042v + 0v2. Calculate a(l). 5 Let y(s) = s3 + 11s2 - 26s - 2. Suppose 4m - 3m + 3 = -2u, -20 = -4u. What is y(m)? -2 Let i(k) = 2k2 + 4k2 - k3 + 8k2 + 2k*3 + 6 + 0k*2 + 6k. What is i(-14)? -78 Let c(x) = -x*2 - 6. Let l be 36/91/(-4). Let g(v) = -16v. Let z be g(l). Let p = -16 + z. Give c(p). -6 Suppose 20v - 31v = 22. Let g(l) = 7l*3 + 7l*2 - 2l + 1. Let y(k) = -8k3 - 8k*2 + 2k - 1. Let p(a) = 7g(a) + 6y(a). Give p(v). 1 Let o(d) = -d*3 + 7d - 5. Suppose -154v = -152v - 4. Give o(v). 1 Let u(z) = 252 - 241 - 6z2 + z3 + z2 - 5z. What is u(6)? 17 Suppose -4q + 3b + 18 = -7q, -5b = 5. Let g(h) = h*2 + 1. Let i(v) = -11v*2 + 3v - 6. Let u(f) = qg(f) - i(f). Calculate u(2). 19 Let v be (-22)/(-5) + (-26)/65. Let o be (v/8)/(3/(-12)). Let p(m) = 2 - m - 1 + 0 + 1. Give p(o). 4 Suppose -17o - 41o + 754 = 0. Let g(l) = l3 - 12l*2 - 10l - 30. Calculate g(o). 9 Let a(l) = -l + 9. Suppose -t = 4k - 19, 3t + 2k - 6k - 9 = 0. What is a(t)? 2 Let m(a) = 2a2 + a - 1. Let w(o) = 2o*2 + o - 2. Let p(f) = -2m(f) + w(f). Determine p(-2). -6 Let q(n) = 2n3 + 2n - 4 - 2 + 5n2 - 3n*3 + 0. Suppose -2h - 8 = 5l, 0 = -2l - 2h + 3h + 4. Suppose 3p - 15 = -lp. What is q(p)? 4 Let o be (2/(-4))/(1/(-30)). Let p be 6/o - (-46)/10. Suppose -pc - 30 = c. Let h(i) = -i + 4. Calculate h(c). 9 Let m(r) = r2 + 5r + 8. Let k be m(-3). Let w(y) = 2y2 - 4. Give w(k). 4 Let a = -26 - -40. Suppose 4b + a = -3t, -t + 2t = b + 7. Let k(o) = -o*2 - 5o - 4. Give k(b). -4 Let u be (-282)/90 - (-1)/304. Let v(i) = 2i + 4. Determine v(u). -2 Let x(p) = -5p2 - 11. Let l(u) = u2 + 2. Let s(b) = 11l(b) + 2x(b). Suppose h = 3w + 4h + 72, -5w + h = 120. Let f = w + 21. Determine s(f). 9 Let w be (-342)/1528/(-6). Let q(g) be the third derivative of 1/12g*4 + 0g*w + 0g - 9g2 + 1/60g*5 + 0. Give q(3). 15 Let m(s) = 7s + 12. Let t(x) = 3x + 6. Let o(f) = 2m(f) - 5t(f). Let p be o(-8). Let u(g) = p + 4g*2 - 5 + 3g - 5g2. Determine u(4). -7 Let u(i) = 29i*3 + 10i - 91i3 - 4i*2 - 8i*2 - 9 + 30i*3 + 33i*3. What is u(11)? -20 Let m(v) = 4v - 3. Let b be 2 - (-3 + 21/3). Give m(b). -11 Suppose 2y - 8 + 0 = 0. Suppose t = -t - 8, -8 = 2n + 3t. Let i(x) = nx - 9 - 1 - 2 + 10. Determine i(y). 6 Suppose -3g + m + 19 = 0, -3g - g = 4m - 36. Suppose -6 = -i + u, -4i + 2u - g + 33 = 0. Let y(d) = -d3 + 8d*2 - 6d - 2. Determine y(i). 5 Let v be 1/5 + 56/20. Let h be (-4)/3 - 2/v. Let q(m) = m - 7m + 8m. Give q(h). -4 Suppose 3z = -4n - 18, 0 = 4n - z + 4 + 6. Let q = 38 + -36. Let m(w) = 3 - w - qw + w + 4w. Calculate m(n). -3 Let n(a) = a2 - 7a + 12. Let x be n(6). Suppose 7y = 5y + 10. Let v(k) = 9k3 + y + k - 10 + k2 + x. Give v(-1). -8 Let r = 823/36 - 202/9. Let n(u) be the third derivative of -1/6u*3 + 0u - 7u2 + 0 - ru*4. What is n(-1)? 9 Let p(j) = j + 0j + 5 - j*2 + 6j. What is p(6)? 11 Let a(v) = 3 + v + v + 4v2 + v3 + 0v*3. Let z be (-10)/(-1((-25)/(-10) + -3)). Let s = -22 - z. Calculate a(s). 7 Suppose 59 = 16b + 27. Let p(i) be the first derivative of -1/4i*4 + 0i*3 - bi + 3 + 1/2i2. Calculate p(0). -2 Suppose -4p = 3g - 31, 4p - 2g - 55 = 3g. Suppose p = -4u + 6u. Suppose -uc + 3c + 4x = 0, -5c + 4x = 6. Let q(i) = i2 + 2i + 3. Calculate q(c). 3 Let w(z) = -533z + 1596z - 525z - 2z*2 - 530z. Give w(6). -24 Let r(s) = s*3 - 11s2 + 5. Let z be r(11). Let m(h) be the first derivative of -h4/4 + 2h3 - 5h*2/2 - 2h - 2. Give m(z). -2 Suppose -5u - 202 = -152. Let l(v) = v3 + 11v*2 + 7v - 4. Calculate l(u). 26 Let d(y) be the second derivative of 7y4/24 + 5y*2/2 - y. Let p(g) be the first derivative of d(g). Suppose 2x + 16 = 14. Determine p(x). -7 Let d(p) = p*3 + 4p. Let z(l) = -l*3. Let s(r) = -d(r) - 2z(r). Give s(-3). -15 Suppose -12 = 2h + 4x, 2h + 5x + 12 = -0h. Let p be (30/3)/((-4)/h). Let l(a) = -1 - 10a + a*2 - 5a + pa. Determine l(2). 3 Let h = -13 - 28. Let a = 44 + h. Let d(k) = -3k*a - 2 - 5k*2 - 3k + 3k2 + 4k. What is d(-2)? 12 Suppose 1 = 2m - 13. Let o = -7 + m. Let w(h) = h2 - 4 + 2h + 0 + oh. Give w(3). 11 Let o(l) be the second derivative of -l6/720 - l5/60 - 7l*4/4 - 17l. Let f(p) be the third derivative of o(p). Calculate f(5). -7 Let f(d) = 82 - d*2 - 45 - 54. Suppose 4o = -a + 23, -2o - 5a + 7 = -0a. Suppose r = or. Give f(r). -17 Let k(n) = n*3 - 3n*2 - 4n + 2. Let u be k(4). Let y(t) = 0 + 12t2 + 0 - 3t - 5t2. Give y(u). 22 Let j be ((-24)/(-30))/(4/(-10)). Let m(a) = -a3 + 2a*2 - a - 1. Give m(j). 17 Let l be (-8)/(4/2) - (1 + -10). Suppose -f = -3z - z + 4, 4z - lf = -12. Let v(p) = -3p2 + 1. Calculate v(z). -11 Let d(s) = -2s*2 + 6s. Let g(w) = -w*3 - 13w*2 - 13w - 11. Suppose -m + 3z = 6, 0z = 2z + 4. Let c be g(m). Let j be 3 - (c - 6/3). Determine d(j). -8 Let i(j) = -j3 + j2 + j - 1. Let m(h) = -5h*3 + 12h*2 - 4. Let t(c) = -6i(c) + m(c). Give t(-7). -5 Let y(j) = 2j + 6. Let s be y(-4). Let d(p) = -p. Let i be d(-4). Let q(k) = -k2 + 1 + 5 + 7k - 4k - i. Give q(s). -8 Let r = -74 - -79. Let q(w) be the third derivative of -w5/60 + 7w4/24 - w3/6 - 23w2. What is q(r)? 9 Suppose 4o - 5k + 3k = 12, -5k = 0. Let t(x) = x - 2. Give t(o). 1 Let d = 1861 + -1858. Let w(m) be the second derivative of 5/6m*d - 7m + 0m2 + 0. Determine w(-2). -10 Let q(c) be the second derivative of c5/20 - 3c*4/4 - 5c*3/3 + 7c*2 - 104c. Determine q(10). 14 Let p be -2(-4 - (-1 - -2 - 4)). Suppose -5a = -3a + p. Let k(g) = 1 + 9g2 - g2 + 3g2. Give k(a). 12 Let f(v) = 2v + 1. Let j = -22 + 15. Let n(z) = 3z + 1. Let c(d) = jf(d) + 6n(d). Let o(s) = -s + 7. Let r be o(5). Determine c(r). 7 Let z(l) be the third derivative of -l6/120 + l5/10 + l3/3 + 4l2. Let w be 7 - (-3 + 2 - -2). What is z(w)? 2 Let j(b) be the third derivative of -b5/10 + b4/12 + b3/6 + 2b2. Suppose 2g - 3n - 3 = g, 4g - n - 1 = 0. Suppose -3 = -gz + 3z. What is j(z)? -7 Let v(u) = -3u3 + 5u*2 - 9u - 36. Let z(h) = h*3 - h + 1. Let q(f) = v(f) + 4z(f). Determine q(-6). 10 Let j(u) = -u*3 - 6u*2 + 7u - 3. Suppose -2c + 1 + 9 = 0. Suppose 0 = 4x + 3a + 13, x + 32 = -0x + ca. What is j(x)? -3 Let o = 24 + -22. Suppose 4c + 3s = 17, c - 4c + os + 17 = 0. Let p(y) = -3 + y3 + 2y + 4y2 - 2 + c - 3. Calculate p(-3). 0 Suppose 2s + 11 = j, -5s + 2s - 12 = 0. Let h(z) = z*3 - 5z*2 + 3z. Let b be h(j). Let y be 4/(-6) + (-24)/b. Let d(k) = -5k + 1. Calculate d(y). -9 Let n(z) be the third derivative of 11z5/120 - z4/24 - 19z3/6 + 30z*2. Let l(f) be the first derivative of n(f). Determine l(2). 21 Let h(b) = 12 + 5 - 4 + 2b + 2. What is h(-11)? -7 Let c = -1 - -6. Suppose 3z = -2n - 23, n + 5z + 17 = -c. Let w(g) = -g2 - 6g - 1. Calculate w(n). -8 Let c(o) be the third derivative of 2o2 + 1/10o*5 - 5/6o*3 + 0 - 1/12o*4 + 0o + 1/120o6. Let g(n) = -6n. Let h be g(1). What is c(h)? 7 Suppose z + h + 14 = 4z, -2 = -2h. Suppose -5g - 17 = -3t - 53, -zg + t + 42 = 0. Let k(o) = -o2 + 8o + 13. Calculate k(g). 4 Let c = 20 + -14. Suppose -r + 2u = -0 - c, 0 = 2u + 4. Suppose 3k + 4 = 2s, 0s = -3s - rk + 19. Let j(w) = -2w - 2. What is j(s)? -12 Let q(i) = -8i - 7. Let f(h) = 8h + 6. Let r(s) = 6f(s) + 5q(s). Determine r(-2). -15 Let k(j) be the first derivative of -j*5/24 + 20j3 - 17. Let b(g) be the third derivative of k(g). What is b(1)? -5 Let v(k) be the second derivative of k5/2 - k*4/4 + 2k*3/3 + 6k - 11. Give v(1). 11 Let v(l) = l + 10. Let w(o) = -2o - 20. Let z(x) = -5v(x) - 3w(x). Give z(-8). 2 Let r(p) = 4p - 28. Let s(o) = 10o - 87. Let b(q) = 8r(q) - 3s(q). What is b(-17)? 3 Suppose -25 = -2j - 31. Let c(o) = -o + 5. Let k be c(5). Let b(w) = 2w - 1 - w + k. Give b(j). -4 Let q(c) = 4c*2 + 3. Let t(d) be the second derivative of 5d4/12 + d3/6 + 3d2/2 - 9d. Let m(a) = -3*q(a) +	{ "pile_set_name": "DM Mathematics" }
)/(-6). Suppose 0 = -r - 2g + 22, -3g + 0g = 5r - y. Solve 2 - r = 2j for j. -5 Let l = -8910 - -8925. Solve 195h - l = 192h for h. 5 Let s(m) = m2 + 113m + 112. Let t be s(-112). Solve t = -59d + 36d + 69 for d. 3 Let n(g) = 1616g - 11275. Let j be n(7). Solve 106z = -69 - j for z. -1 Let x(f) = -f*3 - 2f - 8. Let a be x(-2). Let k be 4 - (3 - a - 2-2). Solve 0 = q - 2q - k for q. -1 Let a(l) = -1 + 5 - 450l + 441l + 1. Let b be a(-1). Solve n + 12 = b for n. 2 Let k be (-4)/(-20) + 57/15. Suppose -20f + 24f + 10 = 2s, 4f = ks - 16. Solve -sl + l = -9l for l. 0 Let x = 75 + -36. Let s = -37 + x. Suppose 0 = -b + s. Solve -bq - 2q = -12 for q. 3 Suppose -2m - 580 = 18. Let h = m + 302. Solve 0 = -hu - 9 for u. -3 Suppose 723z + 252 = 741z. Solve 77 = zm + 21 for m. 4 Let p = 284 - 482. Let i = 203 + p. Solve io = 8 + 2 for o. 2 Suppose -78 = -4n - 3q + 99, 5n - 4q = 229. Solve 18s + 63 = -n for s. -6 Let b be ((-4867)/(-93))/(2/6). Let q = b - 157. Solve -1 = -r - qr for r. 1 Let x be (5/4)/(1/(-64))(-165)/220. Solve 7s = -3s + x for s. 6 Let w = 693 - 693. Let o(q) = -q*2 - 57q + 10. Let h be o(w). Solve 44v = 39v + h for v. 2 Let j(p) = -p*2 + 32p - 185. Let q be j(10). Solve 26 = 48m - qm for m. 2 Let p(d) = -d*3 + 21d*2 - 14d - 268. Let s be p(19). Solve -sj + 186j + 6 = 0 for j. 3 Let d(v) = v*2 - 118v + 1183. Let l be d(11). Let j be (-15)/(-12) + 6/8. Solve -m = jm + l for m. -2 Let k be (3/9)/((-6)/342). Let c = k + 23. Suppose 0 = y + 1, 31y = -2l + 23y + 4. Solve -cq = -lq + 8 for q. 4 Let m(n) = n*3 + 12n*2 - 3n - 3. Suppose -3t - 37 = -g, -3 = 2t - 3g + 24. Let h be m(t). Solve -13 = -4p - h for p. -5 Let x(d) = 41d3 + 4d*2 + 9d + 11. Let z be x(-2). Let t = z + 321. Solve th + 69 = 61 for h. -4 Let k = 10175 - 10151. Solve kj + 27 - 123 = 0 for j. 4 Let m(z) = z*3 + 48z*2 + 96z + 306. Let f be m(-46). Solve f = 19a + 27 for a. 5 Let z be 2 + (-15 + 15)/(1-3). Suppose -n + 5n - 4o - 24 = 0, -o = -2n + 9. Suppose 2j + 5c = 26, -18c = -16c - 8. Solve 0 = -za - j - n for a. -3 Let m(u) = u*2 - 87u - 361. Let y be m(-4). Let d be 5 - (-3)/(3 + 0). Solve yt + 3 = d for t. 1 Let s(m) = m + 58. Let k be s(-16). Let t = k + -37. Let l(x) = -x2 + 8x - 12. Let o be l(4). Solve -td = -od - 1 for d. 1 Let g(x) = 6x2 + 2x. Let s(v) = 3v2 + v. Let o(a) = -2g(a) + 5s(a). Let u be o(1). Solve uh = -0h + 16 for h. 4 Suppose l - 4l + 2 = -w, 14 = -3l + 5w. Suppose -89 + 86 = -r. Suppose -4c - rb = lb - 32, 4 = b. Solve 3 + 6 = -cg for g. -3 Let m(n) = 6n + 24. Let q be m(-4). Let w = -67 - -71. Suppose -12 = -7o + 4o. Solve qs - os = -w for s. 1 Suppose -3t + 2c = 12, 5t + 2c - 8 - 4 = 0. Solve t = -95d - 434 - 326 for d. -8 Let f = 58 + -55. Suppose -113 + 137 = fm. Solve 4n - 8 = mn for n. -2 Let t = -3841 - -3926. Solve 91 - t = 6i for i. 1 Let d be (39 - (-1344)/(-228)) + (-2)/19. Solve -d = 9g - 15 for g. -2 Let w be 2/1 - 6 - -14. Suppose 4d + 23 = g, -d - w = 4d. Suppose 5 = -5s + 30. Solve sm + 0m = g for m. 3 Let o(h) = 3h - 11. Suppose 3m + 5f = 3f + 11, -2m - 2f + 4 = 0. Let s be o(m). Let a be 25/108/s. Solve 0 = -2w + a for w. 1 Let d = -28 - -455. Suppose 4i = -155 + d. Let m = 72 - i. Solve -8 - 12 = mw for w. -5 Let n(d) = 36d2 - 137d - 20. Let l be n(4). Solve -ls - 128 = -80 for s. -6 Let t = 1543 - 997. Let g = 552 - t. Solve 3d = 3 - g for d. -1 Let z(m) = 8m2 + 77m - 6. Let s be z(-11). Solve sk - 124k = -45 for k. 5 Suppose 5t - 2q - 425 = 703, t + 2q = 240. Solve -t = -7k - 235 for k. -1 Let y be 12/(-1 - -3)3/(-9). Let q be 126/184/y. Let g be (-11)/(-4) + q/(-32) + 2. Solve gp + 3 = -12 for p. -3 Let d be (345/(-207))/((-20)/1296). Solve -dx - 25 = -103x for x. -5 Suppose 336 = 23y - 7y. Suppose 31 - y = 10k. Solve -d - k = 3 for d. -4 Suppose -5y - 152 = -3t, 4t - 5y - 208 = -y. Let i = -46 + t. Solve 0 = -38n + 34n + i for n. 2 Suppose 0 = -2929d + 2919d + 760. Solve 5b + d = 96 for b. 4 Suppose 0 = -2s - 12, -3s = -2v - 8s + 26. Solve 340q + v = 333q for q. -4 Suppose -w + 22 = 4j - 174, -2j + 5w = -120. Let n(m) = -m3 - 13m*2 + 13m + 41. Let y be n(-14). Let p = y - j. Solve -pg = 1 + 9 for g. -2 Let w(l) = -22l - 202. Let g be w(-10). Solve 95a - 89a - g = 0 for a. 3 Let r be 98 - (-11 + 17)/(2-1). Suppose 6b = 7b - r. Let w = 104 - b. Solve m + 4 = w for m. -1 Suppose 12n - 13n - 2t = -4, 0 = -4n - 2t + 34. Solve 0 = -nd - 19d + 174 for d. 6 Suppose 26a - 22a + 2c - 158 = 0, 5a - 5c - 175 = 0. Let z(r) = -4r*2 + 2. Let g be z(-3). Let n = a + g. Solve 13 + 7 = -nf for f. -5 Suppose -4w = -6w + 6. Let v be 0 - w - (8 + -32). Suppose -3k = 4u - v, -2u + 3k - 3 + 0 = 0. Solve -up + 8 = p for p. 2 Suppose 245f - 8010 - 169 = -829. Solve -24 + f = 6s for s. 1 Suppose 3x + 1 = -2q + 4x, -3q - 2x + 2 = 0. Suppose 2u + 4c - 4 - 18 = q, u = c - 1. Solve -10 = ub + 2b for b. -2 Let k(g) = -2g2 + 50g + 7. Let w be k(25). Let d be ((-14)/(-6))/w + 76/6. Solve -14y = -dy + 3 for y. -3 Suppose -33 = -219z + 208z. Suppose 3n - 61 = 4m, 2m - 7 = z. Solve u - n = -32 for u. -5 Let c(y) = y3 + 12y*2 + 2. Let w be c(-12). Suppose 5f = -wd, f + 0f = 2d. Suppose -4v - 6 = 4k - 50, -5k + v = -37. Solve -2s + d = k for s. -4 Let f = 69 + -52. Let w = f - 4. Suppose 0 = -3p + 2c + w + 4, 2p + 4c = -10. Solve -ph - 2h = -20 for h. 4 Let k(h) = h3 + 15h*2 + h + 22. Let n = 147 - 162. Let g be k(n). Solve -gr + 10 = -18 for r. 4 Let i be (-342)/(-3)6/9. Let n = 81 - i. Let c(r) = -r3 - 2r*2 + 4r + 3. Let a be c(-3). Solve -nm + 2m + 12 = a for m. 4 Let u = -564 + 37. Let y = -518 - u. Solve -11l = -yl - 10 for l. 5 Let u(p) = 4p2 + 6p + 12. Let s be u(-3). Suppose sn - 24 = 27n. Suppose 14q - 6q = n. Solve d + 3 + q = 0 for d. -4 Let j be -84 - (5 - 1)/1. Let i = 90 + j. Suppose 3f + s - 2 = 9, -2s + 4 = -3f. Solve iu + fu = 20 for u. 5 Let p = -8060 - -8082. Solve 8j = -2 - p for j. -3 Let l = -5 + 21. Suppose 4z - 25 = -3y, l = -y + 5z - 1. Solve -yi + 6 = -5i for i. -3 Suppose -37b + 40b = -190b + 965. Let c be 0((-1)/2 + 1). Solve -b = k - c for k. -5 Suppose 5o - 8x - 56 = -10x, -5o + 53 = x. Let v be (15 - 15)/(2/(-2)). Suppose v = 2y - 6y + 8. Solve 0j + o = -yj for j. -5 Suppose -j + 22w - 24w + 3 = 0, -5j + 2 = -3w. Suppose -g + 10 = 8. Solve -gl = -l + j for l. -1 Let h be 3/624/65. Suppose 3u - f - h + 6 = 0, -3f + 12 = 3u. Let l = 0 + 1. Solve us = 3s + l for s. -1 Let m(n) = n2 + 15n + 18. Let f be m(-14). Suppose u - 75 = -fu. Let v be (u + -5)(-4)/(-10). Solve -vs - 12 = -0s for s. -3 Suppose -26 = 5i + 24. Let a be ((-16)/i)/((-10)/(-75)). Let z = -29 + 32. Solve -z + a = 3y for y. 3 Let w(k) = 3k3 + 2k*2 - 5k + 7. Let d = 117 - 115. Let p be w(d). Solve 0 = -pq + 25q for q. 0 Suppose 540 = 2t - 4c, -5t - 2c = -1517 + 107. Let w = 283 - t. Solve 0 = -2i + w - 7 for i. -2 Let k be ((-98)/(-4))/7 + (-45)/(-30). Suppose 5t = kj - 25, -15j + 12j - 4t = -15. Solve jh = 2h - 3 for h. -1 Let k(o) = -8o2 - o + 4. Let g(z) = -23z*2 - 2z + 11. Let p(d) = 6g(d) - 17k(d). Let b be p(3). Let s be (-4 - 1)/(b/10). Solve 0 = 7j - 2j - s for j. 2 Suppose 0 = 4t - 3a - 67, 7a - 2a - 59 = -4t. Solve 126 - 78 = -tz for z. -3 Suppose -5k = -u + 4, -u + k = 8u - 300. Solve -34 + u = 9l for l. 0 Suppose -7i = -6i + 5p + 10, 0 = -2p - 4. Suppose -45g + 38g + 28 = i. Solve -gz + 11z = 35 for z. 5 Suppose 17 = 4l - q, 11 + 15 = 2l - 4q. Suppose 4 - 7 = lp - 3n, 4n = -3p + 32. Solve -4b = 8 + p for b. -3 Suppose -2x = -10 + 2. Suppose -3s - xk = -37 - 1, 2k = 10. Let l be 19/5 + s/30. Solve o + 3o = l for o. 1 Let x(p) = p*2 + 10p + 14. Let m be x(-9). Suppose 0n - n = 4v + 4, 5n - 10 = -mv. Solve nb = 6 - 10 for b. -1 Suppose 4t - 304 = 12j, 4j = -3t + 9j + 204. Solve 70y = ty for y. 0 Let k = -41 + 44. Suppose kx - 71 = v, 2v = -x + 6v + 9. Solve 3z - x = 8z for z. -5 Suppose h - 407 = 2p - 4281, 2p - 5h - 3890 = 0. Solve pw = 1937w - 6	{ "pile_set_name": "DM Mathematics" }
12d + 2. Suppose 63h - 44 = 5n + 61h, 3n + 2h + 4 = 0. Calculate i(n). 6 Let o(t) = 3t2 - 92t - 29. Let h(x) = 2x2 - 46x - 15. Let z(a) = -7h(a) + 4o(a). Let w be z(-23). Let j(r) = -r*2 - 11r - 4. Calculate j(w). -4 Let y(w) be the second derivative of -5w3/6 - 12w*2 - 1938w. Give y(-5). 1 Suppose 9 + 11 = -4s. Let d(p) = -p3 - 5p*2 - p - 6. Let m be d(s). Let i(f) = -21f + 1. Give i(m). 22 Suppose 3g - 4p - 14 = 0, -g - 2p + p = 0. Suppose -d - 25 = -5v, 3 = gd - v + 8. Let a(w) = -w2 - w + 5. Give a(d). 5 Let t(u) = 3 + 1642u*2 - 812u*2 - 4 - 828u*2 - 2u. Suppose -2k + 2 = -0. Suppose 3 = p - k. Calculate t(p). 23 Let u(r) = -r + 9. Let q(o) = -o2 + 8o - 8. Let m be (4/(-5))/(6/(-60)). Let s be q(m). Let p be 119/28 + 2/s. Give u(p). 5 Suppose 0x - 2x - 4u = -4, -3u + 12 = 3x. Let y(h) = 6h + 7. Let r(f) = 7f + 9. Let k(p) = xy(p) - 5r(p). Calculate k(5). 2 Let v(y) = 13y*2 - 3y + 25. Let j(q) = -8q2 + 2q - 13. Let l(t) = -7j(t) - 4v(t). Let m be l(0). Let g(k) = k*3 + 10k*2 + 11k + 10. Determine g(m). -8 Let s(t) = 2t - 52. Let u be (((-238)/98)/(-17))/((-2)/(-154)). What is s(u)? -30 Let t(x) = 74x*2 - 42x*2 - 39x*2 - 1. Suppose -16 = -1982j + 1990j. What is t(j)? -29 Let o(x) = x3 - 98x*2 - 201x + 98. Let l be o(100). Let r(d) = -5d2 + 6d - 1. Calculate r(l). -33 Let g be ((-220)/15)/((-9)/54). Let z(j) = -93j - 2j*2 + gj + j2 + 1. Give z(-7). -13 Let y(b) = -b3 + b*2 + b. Let m = 209 + -206. Let d = 3 - 0. Suppose -i = dz + 2 - m, -5z + 4i = -30. Calculate y(z). -2 Let a(x) be the first derivative of x*3/3 - 41x*2/2 + 3x + 3195. Determine a(41). 3 Let f be ((-10)/(-4))/(2/4). Suppose -168t - 321t - 23t + 5120 = 0. Let d = f - t. Let u(a) = a2 + 4a - 2. Calculate u(d). 3 Suppose -34h - 221 + 17 = 0. Let l(r) = 3r + 4. Let b(w) = -w + 1. Let y(d) = 2b(d) + l(d). Determine y(h). 0 Suppose 0 = -y + 2y - 72. Let t be (1 + 0)(-16)/y-9. Let i(w) = -w - 4 + 2w + 8 + 2wt - 3 + w3. What is i(-1)? 1 Let t be -18(-21 - -22)(-1)/(-3). Let j be (-2)/t - 899/87. Let k(i) = -i*2 - 13i - 35. Give k(j). -5 Let b = -111/7 - -13327/840. Let p(q) be the third derivative of 17q2 - bq*6 + 0q - 1/8q4 - 1/6q*3 + 0 - 1/30q*5. What is p(-2)? 5 Suppose r - 12 = -r. Suppose 0n + 4n - 2u + r = 0, -4n = 4u + 12. Let i(y) = 130y + 1. Let z(s) = -19s. Let w(k) = -i(k) - 7z(k). Determine w(n). -7 Let x(d) = -55d + 10. Let s be -18 + (-1725)/(-92) + (9/(-12))/(-3). Give x(s). -45 Let g be (-1)/(4/(-44)) + -5. Let z(i) = g + 578i + 14i*2 + 15 - 592i + i3. Calculate z(-15). 6 Let m(n) = -n3 + 8n2 - 13n + 40. Let s be 21/(-9)(-33)/11. Give m(s). -2 Let x be -8(-6)/(-26) + 76/(-494). Let r = -32 + 35. Let c(a) = -ra2 - 3a - a*3 - 9a*2 - 1 + 8a*2. What is c(x)? -3 Let c(q) be the second derivative of 1/6q*3 - 5/12q*4 + 1/2q*2 - 5q - 1/20q5 - 19. Calculate c(-5). -4 Let w(o) = -o + 42. Suppose -60q = 533 - 173. Calculate w(q). 48 Let q(f) be the second derivative of -f5/20 - f4/12 - f*3/2 - 5f*2 - 1922f + 2. Calculate q(-3). 17 Let w(n) be the first derivative of 2n3/3 + 9n*2/2 + 4n - 3081. Suppose -9 = 3y - 0r + 4r, 4y = -4r - 16. What is w(y)? 39 Let z(g) = g2 + 4g + 7. Suppose -115 = 40t - 45t. Let r = t - 48. Let u be 0 + 1r/5. Determine z(u). 12 Let i be (-74)/(-10) + ((-16)/(-10) - 2). Let y(z) = -iz - 13z - z2 + 23z - 6. Give y(6). -24 Let i(q) = -72q2 - 2. Let r be i(2). Let m = 285 + r. Let w(z) = -z3 - 5z*2 + 3z + 0z + 0z*2 - 3. Give w(m). -18 Suppose -33x = -68x + 5x - 1020. Let d(z) = -7z - 254. Determine d(x). -16 Let u = 225 - 209. Suppose -12s + 4s = u. Let o(l) be the third derivative of l5/30 + l4/6 + l3/3 - 2l2. Calculate o(s). 2 Let d(m) be the second derivative of m3/3 + 9m2/2 + m. Let w = 635 - 343. Let f = w - 299. What is d(f)? -5 Let x = 10 + -7. Let w(o) = o2 + 7o*3 - 3o*3 - xo*3 - 10 + 0o*3. Let l be 2 + (-24)/6 - (0 - 2). Calculate w(l). -10 Suppose -2a - 21 = -5s, 4s - 8 = 4a + 4. Let l(u) = -9 + 8u + 156u2 - 148u2 + u3 - au3. Determine l(9). -18 Let t(q) = -30 + 2q*2 - 36q - 16q3 - 28q + 3q2 + 58q + 17q3. Give t(-4). 10 Let b(s) be the first derivative of -s5/60 + 11s4/24 - s3/3 - 8s2 - 90. Let a(x) be the second derivative of b(x). Calculate a(11). -2 Let p(z) = z2 - 17z - 1. Suppose -2f = 5h - 28, 4h - 27 + 97 = 5f. Give p(f). -43 Let z(d) = d3 - d2 - 11d - 12. Suppose q + h = -9, -2q - 4h - 46 = -16. Determine z(q). -15 Let a(s) = 4s*3 - 1. Let x = -59 - -57. Let k be (-4 - 5 - -5)4/x. Suppose -b = -9 + k. What is a(b)? 3 Suppose -288 = 101h - 197h. Let i(k) = 3k - 7. Let a(q) = 6q - 13. Let p(t) = -6a(t) + 11i(t). What is p(h)? -8 Suppose 3b + 2b - 92 = 3z, -4b + 84 = -5z. Suppose -t - b = 2m, -m + 3t - 1 = 14. Let p(s) = s3 + 8s*2 - 8s + 1. Give p(m). -8 Let h(u) = 2u - 3. Let g(r) = r - 29 + 2 - 7r. Suppose 0 = 18j + 5j - 30j - 35. Let y be g(j). Calculate h(y). 3 Let f(l) = -2l*3 - 23l + 108. Let x(d) = -5d3 - 2d*2 - 58d + 271. Let w(j) = -13f(j) + 5x(j). Calculate w(10). 41 Let i(y) = -y*3 - 4y - 4. Let g(q) = -q - 1. Let d(r) = -5g(r) + i(r). Suppose -n - 2j - 3 = 2, 5n - 2j = 23. Suppose 0 = nw + 4w. Determine d(w). 1 Let y(x) = 15x3 + 3x*2 - 7x + 4. Suppose -10o + 30 = 5o. Calculate y(o). 122 Let d = -6 + 8. Let t(k) = k*3 - 6k2 + 4. Let p(u) be the first derivative of u4/2 - 2u3 + 3u + 64. Let s(v) = dp(v) - 3t(v). Give s(-6). -6 Let w(p) = 2p + 3p*3 - 4 - 2p*3 + 17 + 9p*2. Suppose -4r = -5i - 117, 578r = 573r + 134 - 44. Calculate w(i). -5 Let t(f) = -1521f - 10640. Let l be t(-7). Let c(x) = x2 + 18. Calculate c(l). 67 Let d(h) = h3 + 82h2 + 311h - 76. Let r be d(-78). Let g(p) = -16p3 + 3p*2 + 2p - 8. Give g(r). -120 Let p(q) = -q*3 - q + 1. Suppose 22z - 26 = -4. Let y(a) = 4a3 + 7a*2 + 7a - 12. Let t(s) = zy(s) + 5p(s). What is t(7)? 7 Let r(a) = -a*3 + 4a*2 - 2a - 2. Let j be 7(-2)/(-105) - (-206)/30. Suppose -jv + 16v = 54. Suppose vp - 13 = -1. Give r(p). 2 Suppose -2t + 31 = 15. Let w(y) = 6 - 150y + 7y2 + 2y*3 - 3y*3 + 157y. Give w(t). -2 Let b = 128 - 120. Suppose 0 = q - 3v + 1, 4 = -4q + bq - 4v. Let w(t) = -t + 4. What is w(q)? 2 Let w(h) = h*2 + 8h + 6. Let s be w(-4). Let y(k) = 5k - 10k + 2 + 7 - 2k - 7431k*2 + 3714k*2 + 3716k2. What is y(s)? -21 Let q(d) = d3 - 6d2 + d - 2. Let f(a) = 13a - 3. Let p be f(9). Let n = -108 + p. Calculate q(n). 4 Let z(l) = -20704076 - l*2 + 0l*2 + 19l + 20704049. What is z(22)? -93 Let a(g) = g*2 - 8g - 7. Suppose -55w = -65w + 1580. Suppose -4y + w - 126 = 0. Determine a(y). -7 Let t(h) = h2 + 5h - 7. Let m be 4 + ((-16)/8)/((-4)/(-14)). Determine t(m). -13 Let p(q) be the second derivative of -q*6/360 + 9q*4/8 - 2q*3/3 - 39q*2/2 - 4q + 5. Let s(x) be the second derivative of p(x). What is s(0)? 27 Let y(u) = 5u + 11. Let z(s) = s + 2. Suppose 5f + 0l + 15 = 5l, -4f + 5l - 11 = 0. Let x(n) = fy(n) + 22z(n). What is x(0)? 0 Let v(t) = 23t - 167. Let r be 294/(-98)(-7)/3. Give v(r). -6 Let l(u) = 3u - 4. Suppose -11r + 134 = -42. Suppose 0 = -0f - rf + 160. Let a(y) = y*2 - 9y - 7. Let o be a(f). Determine l(o). 5 Let q(t) = 3281 - 120t + 115t - 3039. Determine q(47). 7 Let z(v) = v*3 - 3v*2 + 6v - 6. Suppose -22a - 1458 = 5a. Let t be ((-7)/((-42)/(-16)))/(36/a). Give z(t). 34 Let u(a) = -4a2 + 23a + 40. Let d be u(7). Let g(z) = -z*3 + 5z*2 + 2z + 3. Determine g(d). 13 Let k(p) be the second derivative of -p*2 - 2/3p*4 - 45p + 0 - 1/20p5 - 1/6p3. Determine k(-8). 6 Let v(j) = -1. Let b(i) = i3 - 4i - 9. Let r(f) = b(f) - 5v(f). Suppose -327 + 311 = 4y + 2c, -20 = 5c. What is r(y)? -4 Suppose -3 = -85q + 88q. Let s be 1/(-3) + q/(-3). Let d(f) = f2 - f + 3. What is d(s)? 3 Let c(t) be the second derivative of -1/20t*5 - 2t*2 - 7/12t*4 + 3 - 8t + 1/3t3. Give c(-7). -18 Suppose 2v + 5t = -1, -t - 4t - 15 = 0. Let b(w) = -8w3 + 2w + 4. Let p(s) = 18s*3 +	{ "pile_set_name": "DM Mathematics" }
ose kw = 44w + 10. What is the remainder when 7 is divided by w? 2 What is the remainder when 1466(390/20 - 19) is divided by 11? 7 Suppose 159h + 145 + 9 = 173h. Calculate the remainder when 527 is divided by h. 10 Let p(l) = -l3 - 4l*2 - 5. Let n be p(-4). Let u be 16 - (10-1)/n. Suppose us - 9s = 20. Calculate the remainder when 5 is divided by s. 1 Suppose 2r - 552 = -76. Let u be r/22 - 20/(-110). What is the remainder when 495/u - (1 + 1) is divided by 23? 20 Let s = 151 - 306. Let j = s + 159. Calculate the remainder when 9 is divided by j. 1 Let o = 19 - 14. Suppose -2p - 2r = p + o, -8 = -4p + r. Calculate the remainder when 158 is divided by (176/(-110))/(p/(-25)). 38 Suppose -3g + 360 = 4y, -5g - 13y = 127 - 708. Calculate the remainder when 612 is divided by g. 116 Let n(x) = x*2 - 26x - 712. Calculate the remainder when 109 is divided by n(-18). 29 Suppose 0 = -34o + 3797 + 2867. Suppose -x - 5q + 56 = 0, 3x + 2 = -2q + o. What is the remainder when x is divided by 17? 15 Suppose 43v - 143v = -36v - 83584. Calculate the remainder when v is divided by 32. 26 What is the remainder when (-65840)/(-64)192/120 is divided by 163? 16 Suppose 5z + 2v = v + 100, -2z = -5v - 67. Suppose -18u + 4968 = 36u. What is the remainder when u is divided by z? 8 Let d = 3146 + -3134. What is the remainder when 112 is divided by d? 4 Let q(p) = p*3 + 8p*2 + 7p + 5. Let t be q(-7). Calculate the remainder when (0 - -60) + t + -5 is divided by (4/3018)/((-9)/(-60)). 12 Let p = 2 - -22. Let t = 2495 - 982. Let h = t - 1373. Calculate the remainder when h is divided by p. 20 Suppose 201 = 4g - 3v + 2v, 5g - 4v = 254. Suppose 9q + 1423 = 451. What is the remainder when g is divided by 42/4144/q-1? 8 Let w = 10 - 5. Suppose -2l = -w - 37. Calculate the remainder when l is divided by (-4)/(-10) - (-2030)/175. 9 Let h(j) = -340j + 4199. Calculate the remainder when 23559 is divided by h(12). 116 Let p = 1648 - 1645. Let m = 31 - 3. Let v = m - p. What is the remainder when v is divided by 9? 7 Suppose 0 = 4071b - 3942b - 1548. Suppose -4a + 141 + 47 = -i, 0 = 5a - 2i - 238. Calculate the remainder when a is divided by b. 10 Let s(v) = 18v2 + 6v + 28. Let l be s(6). Calculate the remainder when 2/((4/10)/(l/40)) is divided by 15. 14 Calculate the remainder when (-1874 - -8)/(-6) - (0 - 3) is divided by 160. 154 Let q = -4169 - -4702. What is the remainder when 1621 is divided by q? 22 Let q be (-5 - (3 + 0))-5. Suppose -q = 27l - 17l. Calculate the remainder when 88 is divided by ((-20)/l - 1) + 20. 16 Let n(u) = -u3 + 25u*2 - 23u + 5. Suppose -2i = -2p + 138, -20i = -3p - 22i + 187. Calculate the remainder when p is divided by n(24). 7 Let j be -4 + 5 + (-1 - -2). Suppose ja = 2n - 3n + 133, -5a = 2n - 266. Calculate the remainder when n is divided by 34. 31 Let c(j) = j*3 + 40j*2 - 156j + 941. What is the remainder when 187 is divided by c(-44)? 4 Let l = 21194 - 21091. Calculate the remainder when 1649 is divided by l. 1 Let a be (-96)/(-16) + 3/((-6)/4). Suppose 0q - 2t = 5q - 32, -4t + 28 = aq. Suppose -r - 115 = -qr. Calculate the remainder when r is divided by 6. 5 Let t be 6/12(-3 + 195). Let v = t + -39. Suppose 0x - i = -3x + 94, -i - 4 = 0. What is the remainder when v is divided by x? 27 Let c(y) = y2 - 4y - 18. Let s be c(7). Let i(b) = 3 + b + sb + 1 - 3b. Calculate the remainder when 50 is divided by i(9). 11 Suppose 202o - 200o = 3a - 423, 0 = -3a + o + 423. Calculate the remainder when 980 is divided by a. 134 Suppose 431 = -11s + 3951. Calculate the remainder when 108 is divided by (s/(-6))/536/(-16). 12 What is the remainder when 454 is divided by 36273/219? 22 Let z = 343 + -347. What is the remainder when z - -6 - (-2 - (2 + 73)) is divided by 22? 13 Let q(k) = 31k2 + 7k - 192. What is the remainder when q(16) is divided by 262? 258 Let j = -15178 - -15378. What is the remainder when 734 is divided by j? 134 Suppose 910 + 1894 - 19 = 5h. Calculate the remainder when h is divided by 21. 11 Suppose l + 3l = 20. What is the remainder when 1 is divided by (2/l)/((-6)/150-10)? 0 Let m = -38 + 90. Let c(d) = 68d - 134. What is the remainder when c(5) is divided by m? 50 Let c(g) = 6 + 78g2 - 24g*2 + 8g - 24g2 - 29g*2. Calculate the remainder when 353 is divided by c(5). 69 Let d = 20 + -7. Let t(u) = -2u - 10. Let z be t(0). Let k = 59 + z. What is the remainder when k is divided by d? 10 Let m be (203/28 + -7)0. What is the remainder when 108 is divided by (144/(-6))/(-3) - m? 4 Suppose -937v + 2112 = -873v. Let d = -61 - -185. Calculate the remainder when d is divided by v. 25 Let y = -1797 - -1859. What is the remainder when 2415 is divided by y? 59 Suppose -2543234 = 177q - 8212367. What is the remainder when q is divided by 364? 361 Suppose 3o = h - 1127, -o = -5 + 3. Suppose -10r - h = -3803. What is the remainder when r is divided by 15? 12 Suppose -4f = -36 + 12. Suppose 3h = t + 2t - f, -4t + 5 = -5h. Suppose -tl = 2 - 42. What is the remainder when l is divided by 3? 2 Let k = 504 + -365. Calculate the remainder when k is divided by (5 + -33)(-1)/1. 27 Suppose s = 22 - 2. Suppose 0 = -k - sk + 168. What is the remainder when 37 is divided by k? 5 What is the remainder when 6/9(-1)/(10/(-96690)) is divided by 16? 14 Let g(y) = -y2 + 81. Let n be g(0). Let k be n - (3 - (-2 + 1)). What is the remainder when (-1)/7 - (-1628)/k is divided by 12? 9 Suppose -124c = -126c - 3q + 106, 2c = 4q + 78. What is the remainder when 134 is divided by c? 40 Let n(j) = -4j2 + 31j - 43. Let c(t) = -2t2 + 15t - 22. Let w(u) = -5c(u) + 2n(u). What is the remainder when w(7) is divided by 16? 15 Suppose s - 48 = -2s. Suppose -6t + 3t = -5t + 50. Calculate the remainder when t is divided by s. 9 Let y(a) = -3a3 - 2a*2 + 4a + 3. Let k be y(2). What is the remainder when 5/(-35) - 2733/k is divided by 71? 59 Suppose -389 = -u - 4u + 301. Calculate the remainder when 821 is divided by u. 131 Let f = -363 + 374. Let l(j) = 11j - 9. What is the remainder when l(3) is divided by f? 2 Let j be (5 - 3) + (-2)/(-1). Suppose -jw + 38 + 6 = 0. What is the remainder when w is divided by -5 - (46/(-69))/(2/24)? 2 Let o(f) = f3 - 22f*2 - 23f - 24. Let b be o(23). Let r = 35 + b. Calculate the remainder when 85 is divided by r. 8 Let o(w) = -2w3 + 52w*2 - 4w + 47. Let i be o(26). Calculate the remainder when (132/10)/(i/10 + 6) is divided by 15. 14 Let r(v) = v + 8. Let y be -2 + -1 + 0 + (-8)/4. Let q be r(y). Suppose -qi - b = -0b - 26, 5i + 3b = 38. What is the remainder when 58 is divided by i? 8 Let o = -60 - -102. Suppose 64g = 4m + 67g - 75, -4m + 5g + 35 = 0. Calculate the remainder when o is divided by m. 12 Suppose 5q + 4k - 11 - 24 = 0, -5q + k = -10. Suppose 4r + 176 = qr. Calculate the remainder when 39 is divided by 2/(-4)r/(6 + 2). 6 Let w(j) = -j3 + 5j*2 - j - 15. Let d be w(4). What is the remainder when (24/(-40))/(d(-1)/(-435)) is divided by 51? 36 Let g(m) = m*3 + 8m*2 + m + 7. Let i be g(-7). Let k = 2002 + -1963. Let y = i - k. Calculate the remainder when 24 is divided by y. 4 Let v = 8445 - 8413. What is the remainder when 78 is divided by v? 14 Suppose 0 = 132j - 187j + 22000. What is the remainder when j is divided by 103? 91 Suppose -3q - 5u + 2617 = 183, q + 5u - 828 = 0. What is the remainder when q is divided by 199? 7 Let g = -95 + 99. Suppose 5j + 435 = gm, -2m = -m + 4j - 135. Let d = 20 - -19. Calculate the remainder when m is divided by d. 37 Suppose -6i + 204 = -3i. Let k = i - 47. What is the remainder when 70 is divided by k? 7 Let j(i) = -362i - 141. Let l be j(-3). Suppose 756 = 4a + 2f, 0f = 5a - 3f - l. Calculate the remainder when a is divided by 40. 29 Let o(j) = -j + 70. Let s(k) = -2k - 2. Let m(u) = o(u) + 5s(u). Calculate the remainder when m(-7) is divided by 39. 20 Suppose -77r - 4y = -73r - 4784, 0 = -r - 3y + 1194. Calculate the remainder when r is divided by 25. 22 Let o(g) = -g*2 + 35g - 99. Let p be o(30). Let x = -8 + 11. Suppose -p - x = -6*s. What is the remainder when 43 is divided by s	{ "pile_set_name": "DM Mathematics" }
many minutes are there between 5:08 PM and 4:50 AM? 702 What is 154 minutes after 9:21 AM? 11:55 AM How many minutes are there between 4:25 PM and 12:41 AM? 496 What is 703 minutes before 10:35 AM? 10:52 PM What is 402 minutes before 3:40 AM? 8:58 PM How many minutes are there between 3:49 PM and 3:58 PM? 9 What is 505 minutes after 11:29 PM? 7:54 AM How many minutes are there between 7:03 PM and 4:33 AM? 570 What is 710 minutes after 7:40 PM? 7:30 AM How many minutes are there between 4:07 AM and 3:27 PM? 680 What is 331 minutes before 8:46 PM? 3:15 PM How many minutes are there between 3:36 AM and 9:21 AM? 345 How many minutes are there between 1:22 AM and 11:21 AM? 599 What is 543 minutes before 4:39 AM? 7:36 PM What is 244 minutes after 2:25 AM? 6:29 AM What is 359 minutes after 10:00 PM? 3:59 AM How many minutes are there between 2:41 PM and 11:31 PM? 530 What is 456 minutes before 2:53 PM? 7:17 AM How many minutes are there between 4:42 PM and 7:22 PM? 160 How many minutes are there between 4:52 AM and 5:51 AM? 59 How many minutes are there between 8:02 PM and 10:17 PM? 135 What is 238 minutes before 4:11 PM? 12:13 PM How many minutes are there between 12:06 AM and 10:13 AM? 607 What is 296 minutes after 11:56 PM? 4:52 AM What is 410 minutes after 11:30 PM? 6:20 AM How many minutes are there between 10:36 AM and 6:49 PM? 493 What is 667 minutes after 4:58 AM? 4:05 PM How many minutes are there between 10:25 PM and 6:49 AM? 504 How many minutes are there between 5:03 AM and 2:36 PM? 573 What is 223 minutes before 2:26 PM? 10:43 AM How many minutes are there between 8:31 PM and 6:36 AM? 605 How many minutes are there between 1:56 PM and 6:49 PM? 293 How many minutes are there between 3:14 PM and 1:32 AM? 618 What is 657 minutes after 1:00 AM? 11:57 AM What is 50 minutes after 3:22 AM? 4:12 AM How many minutes are there between 12:29 PM and 3:07 PM? 158 How many minutes are there between 12:47 PM and 3:37 PM? 170 How many minutes are there between 1:10 AM and 3:00 AM? 110 What is 277 minutes after 7:36 AM? 12:13 PM What is 14 minutes after 11:46 PM? 12:00 AM What is 289 minutes after 3:39 AM? 8:28 AM What is 63 minutes after 10:20 PM? 11:23 PM How many minutes are there between 1:57 PM and 1:51 AM? 714 What is 410 minutes after 11:00 AM? 5:50 PM How many minutes are there between 8:53 AM and 4:41 PM? 468 How many minutes are there between 4:26 PM and 6:21 PM? 115 What is 132 minutes before 4:40 PM? 2:28 PM How many minutes are there between 10:44 PM and 1:19 AM? 155 How many minutes are there between 6:46 PM and 12:03 AM? 317 How many minutes are there between 3:16 AM and 8:26 AM? 310 How many minutes are there between 1:55 AM and 7:37 AM? 342 How many minutes are there between 8:27 AM and 12:10 PM? 223 How many minutes are there between 1:13 PM and 5:33 PM? 260 What is 41 minutes before 11:35 AM? 10:54 AM How many minutes are there between 12:37 PM and 1:21 PM? 44 What is 419 minutes after 1:15 AM? 8:14 AM How many minutes are there between 9:46 AM and 10:37 AM? 51 How many minutes are there between 8:47 AM and 2:53 PM? 366 How many minutes are there between 12:26 AM and 4:36 AM? 250 How many minutes are there between 1:03 PM and 10:59 PM? 596 What is 202 minutes before 9:40 AM? 6:18 AM What is 291 minutes before 8:08 PM? 3:17 PM How many minutes are there between 8:23 AM and 11:02 AM? 159 How many minutes are there between 9:04 AM and 9:40 AM? 36 What is 670 minutes after 11:22 PM? 10:32 AM What is 41 minutes before 3:10 PM? 2:29 PM How many minutes are there between 9:10 PM and 10:00 PM? 50 How many minutes are there between 3:05 PM and 8:29 PM? 324 How many minutes are there between 1:09 PM and 4:31 PM? 202 What is 678 minutes after 11:20 AM? 10:38 PM How many minutes are there between 12:29 PM and 7:17 PM? 408 How many minutes are there between 4:26 PM and 12:27 AM? 481 What is 466 minutes after 11:24 PM? 7:10 AM How many minutes are there between 10:50 AM and 11:49 AM? 59 What is 12 minutes after 6:43 PM? 6:55 PM How many minutes are there between 7:09 AM and 11:39 AM? 270 What is 366 minutes after 9:26 AM? 3:32 PM What is 141 minutes after 5:46 PM? 8:07 PM How many minutes are there between 2:37 AM and 1:29 PM? 652 What is 160 minutes before 12:28 PM? 9:48 AM How many minutes are there between 8:59 AM and 5:49 PM? 530 How many minutes are there between 10:35 PM and 3:18 AM? 283 What is 166 minutes before 7:08 PM? 4:22 PM What is 591 minutes before 1:55 PM? 4:04 AM What is 710 minutes before 10:30 PM? 10:40 AM What is 514 minutes after 8:41 AM? 5:15 PM What is 459 minutes before 5:58 PM? 10:19 AM How many minutes are there between 6:35 AM and 4:03 PM? 568 What is 110 minutes before 9:22 AM? 7:32 AM How many minutes are there between 8:26 PM and 4:28 AM? 482 How many minutes are there between 8:13 PM and 7:50 AM? 697 What is 643 minutes before 2:53 AM? 4:10 PM What is 689 minutes before 11:45 PM? 12:16 PM How many minutes are there between 8:15 AM and 8:27 AM? 12 What is 166 minutes after 8:40 AM? 11:26 AM What is 44 minutes before 9:20 PM? 8:36 PM How many minutes are there between 10:23 PM and 3:54 AM? 331 What is 321 minutes after 9:39 PM? 3:00 AM How many minutes are there between 5:55 PM and 8:29 PM? 154 How many minutes are there between 1:50 PM and 10:57 PM? 547 How many minutes are there between 11:13 AM and 6:41 PM? 448 What is 160 minutes after 2:59 AM? 5:39 AM What is 404 minutes after 5:12 PM? 11:56 PM What is 473 minutes before 10:12 PM? 2:19 PM What is 69 minutes before 3:43 PM? 2:34 PM What is 186 minutes after 11:20 PM? 2:26 AM How many minutes are there between 9:00 AM and 11:45 AM? 165 What is 171 minutes after 9:32 PM? 12:23 AM How many minutes are there between 5:53 PM and 2:45 AM? 532 What is 641 minutes after 11:10 AM? 9:51 PM How many minutes are there between 4:40 AM and 9:42 AM? 302 How many minutes are there between 2:58 AM and 5:59 AM? 181 What is 568 minutes after 9:35 AM? 7:03 PM How many minutes are there between 10:34 PM and 4:46 AM? 372 How many minutes are there between 3:39 AM and 2:46 PM? 667 What is 611 minutes before 1:10 AM? 2:59 PM How many minutes are there between 6:14 AM and 8:09 AM? 115 How many minutes are there between 12:39 AM and 2:21 AM? 102 How many minutes are there between 8:05 PM and 10:40 PM? 155 What is 707 minutes before 11:32 AM? 11:45 PM How many minutes are there between 6:59 AM and 10:54 AM? 235 What is 424 minutes before 1:53 AM? 6:49 PM What is 704 minutes after 1:35 PM? 1:19 AM How many minutes are there between 7:23 AM and 1:51 PM? 388 What is 708 minutes before 6:28 AM? 6:40 PM How many minutes are there between 7:52 AM and 1:36 PM? 344 How many minutes are there between 5:28 PM and 4:46 AM? 678 How many minutes are there between 7:31 AM and 6:46 PM? 675 How many minutes are there between 4:30 AM and 5:11 AM? 41 What is 98 minutes before 12:05 PM? 10:27 AM What is 322 minutes after 5:47 PM? 11:09 PM What is 664 minutes after 1:52 PM? 12:56 AM What is 289 minutes after 7:18 AM? 12:07 PM What is 430 minutes after 11:51 PM? 7:01 AM What is 454 minutes before 9:49 PM? 2:15 PM How many minutes are there between 7:47 PM and 5:30 AM? 583 How many minutes are there between 12:54 PM and 12:37 AM? 703 How many minutes are there between 8:48 AM and 2:15 PM? 327 How many minutes are there between 9:35 AM and 10:42 AM? 67 What is 504 minutes after 7:29 AM? 3:53 PM How many minutes are there between 1:11 AM and 3:33 AM? 142 How many minutes are there between 7:10 AM and 8:01 AM? 51 How many minutes are there between 1:49 AM and 3:05 AM? 76 How many minutes are there between 4:57 AM and 7:21 AM? 144 What is 82 minutes after 10:49 AM? 12:11 PM What is 252 minutes after 7:13 PM? 11:25 PM What is 679 minutes before 10:30 AM? 11:11 PM What is 597 minutes before 5:29 PM? 7:32 AM What is 609 minutes after 3:34 AM? 1:43 PM What is 264 minutes before 10:00 AM? 5:36 AM What is 238 minutes after 7:07 PM? 11:05 PM What is 627 minutes after 9:35 PM? 8:02 AM What is 126 minutes after 11:10 PM? 1:16 AM How many minutes are there between 5:45 AM and 8:41 AM? 176 How many minutes are there between 8:43 PM and 11:34 PM? 171 How many minutes are there between 4:42 AM and 3:18 PM? 636 How many minutes	{ "pile_set_name": "DM Mathematics" }
(b) -3/2 (c) 105 c Which is the second smallest value? (a) -0.5 (b) -0.1 (c) 0.9 (d) 69 b Which is the biggest value? (a) -2/15 (b) -8 (c) -0.5 a What is the fourth biggest value in 0.28, -1/4, -0.5, 2? -0.5 Which is the smallest value? (a) 6 (b) -0.4 (c) 3 (d) 1/2 b What is the second smallest value in 2/3, 0.13, -2/3, 1/2? 0.13 What is the smallest value in -5, 9, 2/7, -2/3? -5 Which is the third biggest value? (a) -3 (b) 1/8 (c) -0.02 (d) -100 a Which is the fourth biggest value? (a) -0.5 (b) 0.1 (c) 0 (d) -5 (e) 0.4 a What is the smallest value in 21, 0.2, 1/2, -1? -1 Which is the fourth smallest value? (a) -0.06 (b) 4 (c) 1/5 (d) 2/13 b What is the third smallest value in 1/5, 4, -60? 4 Which is the second smallest value? (a) -2 (b) -12/37 (c) 1/7 (d) -1 (e) -0.5 d What is the biggest value in -2/11, 1/32, -1, -6? 1/32 Which is the second smallest value? (a) -0.142 (b) 2/3 (c) -1/6 a What is the second smallest value in 0.13, 4/3, -1/3, -6? -1/3 Which is the second smallest value? (a) -2/3 (b) -1/2 (c) -2/167 (d) 5 (e) 0.4 b Which is the fourth biggest value? (a) -1/6 (b) -98 (c) -1 (d) 0.4 b Which is the second smallest value? (a) -3 (b) 0.4 (c) 6/13 (d) -1/13 (e) 0 d Which is the biggest value? (a) -0.2 (b) 4/51 (c) 0 b What is the third biggest value in -3, 64, -0.3, -1/5? -0.3 Which is the second biggest value? (a) -0.5 (b) -27 (c) 1 (d) -1.5 a Which is the biggest value? (a) -4/13 (b) 0.8 (c) -0.6 b Which is the fifth smallest value? (a) -8 (b) 2/11 (c) 0 (d) -3 (e) 1 e What is the third smallest value in 4/107, -3, -2, 2/9? 4/107 Which is the smallest value? (a) 0.4 (b) -6.7 (c) -4 (d) -5 (e) -0.2 b What is the smallest value in 0.07, 3/8, -571? -571 What is the second biggest value in -0.7, 0.07, 4? 0.07 Which is the second smallest value? (a) -89 (b) 0.06 (c) -5 (d) 5 c Which is the third biggest value? (a) -4/3 (b) -0.07 (c) -11 c Which is the biggest value? (a) 3 (b) 6 (c) 210 c What is the second smallest value in 0.4, -0.3, 0.5, 3/2? 0.4 Which is the second biggest value? (a) -168 (b) -3 (c) 3/4 b Which is the second biggest value? (a) -3 (b) -0.3 (c) 0.2 (d) -3/4 (e) -438 b What is the third smallest value in 0, -2, 0.03? 0.03 What is the second biggest value in -1/3, -2/55, 2, -1/6? -2/55 What is the second smallest value in 2/3, 4/9, -1/6? 4/9 Which is the third smallest value? (a) 23 (b) -0.5 (c) 4/5 a What is the biggest value in -5/16, -0.1, 2? 2 What is the third smallest value in 3, 5, 1/9, -1? 3 What is the second biggest value in 2, 3, -0.1494? 2 Which is the third biggest value? (a) -1/3 (b) 1 (c) 1/85 a Which is the biggest value? (a) -4/7 (b) -2 (c) 1 (d) -1/3 (e) 0.3 c Which is the second biggest value? (a) 0 (b) 2 (c) -3/5 (d) 162 b Which is the third smallest value? (a) -1/5 (b) 4 (c) 1/10 (d) -13 (e) -2 a What is the fourth smallest value in -0.2, 5, 3.5, -9? 5 What is the third biggest value in 1/18, -6, 0.3? -6 Which is the smallest value? (a) 2/11 (b) -1/8 (c) 10 (d) -10 d Which is the smallest value? (a) 25 (b) -3 (c) 2 (d) -2 b Which is the third smallest value? (a) 2 (b) -0.9 (c) 614 (d) 0 (e) -0.4 d What is the second smallest value in -0.06, -6/13, 1, 2, -2? -6/13 Which is the smallest value? (a) 1/9 (b) 77 (c) 3/7 a What is the third smallest value in -99, 0.5, 4, -5, -0.02? -0.02 What is the third biggest value in 0.23, -0.14, 5, -4? -0.14 Which is the second biggest value? (a) 2/3 (b) -2 (c) -0.15 c What is the second biggest value in -73, -1/3, 0.4? -1/3 What is the second biggest value in 13, -2, -0.5, 2? 2 Which is the second biggest value? (a) 0.2 (b) -1 (c) -2 (d) 111 a What is the fourth smallest value in 0.18, 4, 2, -0.4? 4 Which is the biggest value? (a) -0.1 (b) 2/9 (c) -3/8 (d) 3 d Which is the second biggest value? (a) -5 (b) 31 (c) -2 (d) 2/21 d Which is the smallest value? (a) -2.7 (b) -6 (c) 0.2 (d) 4 b What is the third biggest value in 32/5, 5, 47? 5 What is the second smallest value in 0, -18, 12, 1/7? 0 Which is the biggest value? (a) -1/5 (b) -3 (c) 2 (d) 5 (e) 104 e Which is the biggest value? (a) 1 (b) -1 (c) 101 c What is the fifth smallest value in 0.4, -3, 0.6, 4/5, 2/7? 4/5 Which is the second biggest value? (a) -0.02 (b) -1 (c) 4.53 a What is the biggest value in -1, -24, 1.7? 1.7 Which is the third smallest value? (a) 0.3 (b) -10 (c) -3 (d) 2 (e) -1/7 e What is the third smallest value in 2/19, -8, 0.4? 0.4 What is the third smallest value in -3/4, -1/2, -0.2, -1, 2/7? -1/2 What is the third smallest value in -5/6, 6, 1/6, 3? 3 Which is the third smallest value? (a) -4/7 (b) -321 (c) -0.16 c What is the smallest value in -5, 2/7, -3/52? -5 What is the second smallest value in 0.2, 10/7, -2/9? 0.2 Which is the second smallest value? (a) -3 (b) 32 (c) 1/5 c Which is the smallest value? (a) -0.2 (b) -1/483 (c) -5 c What is the smallest value in 2/29, -9/2, 3, 5? -9/2 Which is the biggest value? (a) 15.29 (b) 2 (c) 2/7 a What is the biggest value in -1.8, -1/7, -3? -1/7 What is the second biggest value in 630, 0, -4? 0 What is the second smallest value in 14, 5, -0.05? 5 Which is the second smallest value? (a) 4/7 (b) 2 (c) -4 (d) 0.9 (e) 5 a Which is the second biggest value? (a) 9 (b) 0.4 (c) -0.1 (d) 0.2 (e) 1 e What is the second biggest value in 5, 1/4, -38? 1/4 What is the second biggest value in -29, 0.5, -2? -2 What is the smallest value in -12, -2/113, -3? -12 Which is the third smallest value? (a) -2/19 (b) 10 (c) 4 (d) 15 b What is the fourth smallest value in -5, 12, 1, -1? 12 What is the fourth smallest value in 4, -0.47, 3, -4? 4 Which is the biggest value? (a) 236 (b) 2 (c) 0.01 a What is the smallest value in -3, -34, -0.07? -34 Which is the fourth smallest value? (a) 2 (b) 15 (c) -0.3 (d) -2 b Which is the fourth smallest value? (a) -2 (b) 35/4 (c) 0.5 (d) 2 b Which is the fifth smallest value? (a) -0.1 (b) 2/29 (c) -0.7 (d) -5 (e) -3 b What is the fourth smallest value in 23, -0.5, 6/11, 4? 23 What is the biggest value in -2/29, 0.2, -23, 0? 0.2 What is the fourth biggest value in -4, 1/4, -2032, -1/6? -2032 Which is the fourth smallest value? (a) 0.02 (b) -11/3 (c) -4 (d) 0.1 d Which is the smallest value? (a) 10 (b) 3 (c) 0.04 c Which is the third biggest value? (a) 4 (b) 2 (c) 113 (d) -4/3 b What is the second smallest value in -0.5, -148, 5? -0.5 What is the second smallest value in 2, 22/7, -5? 2 What is the fifth biggest value in 49, 10, 2, -0.3, -2/5? -2/5 Which is the third smallest value? (a) 5 (b) 93 (c) -1 b What is the third biggest value in 5, -4, -28/71? -4 What is the second biggest value in 22, 0, 20/3? 20/3 What is the smallest value in -4, 5, -0.06, -0.04? -4 What is the smallest value in 3/7, -2/5, -0.3, 0.23? -2/5 What is the third biggest value in 0.2, 0.3, 18.9, -2/5? 0.2 Which is the third biggest value? (a) 1/4 (b) 5 (c) -4 c What is the biggest value in -0.07, 2, 3, 7? 7 Which is the third biggest value? (a) -1 (b) 2/5 (c) -1/5 (d) -17/6 (e) 1/5 c What is the third biggest value in -0.6, -5, -12, -4? -5 Which is the second biggest value? (a) -9 (b) -3/4 (c) 13 b What is the smallest value in 1, -2/15, 0.6, -2/13? -2/13 What is the second biggest value in -4, 2.6, -1/2, -24? -1/2 What is the third biggest value in 3, -0.0614, -2/15? -2/15 Which is the third biggest value? (a) -0.3 (b) -4/3 (c) -0.4 (d) 1/4 c What is the third biggest value in -1/4, 2/197, 1? -1/4 Which is the fourth biggest value? (a) -0.3 (b) -4/9 (c) 0 (d) 2 (e) 0.053 a Which is the second biggest value? (a) 3/4 (b) -496 (c) -4 c Which is the fifth biggest value? (a) -0.5 (b) 1/21 (c) 0 (d) 1/4 (e) 2 a What is the second biggest value in 4/5, -3, -2/5, 3? 4/5 What is the fourth biggest value in 2, -3, 3, -22/7? -22/7 What is the second smallest value in -1/4, 20, -0.1? -0.1 Which is the second smallest value? (a) 22 (b) 17 (c) -1/9 b What is the third smallest value in -8, -2/9, 3/4? 3/4 What is the second smallest value in -2/3, -4, -2, -52, -5? -5 Which is the second smallest value? (a) -1/679 (b) -16 (c) -1/3 c What i	{ "pile_set_name": "DM Mathematics" }
+ 36 - 44 = 3v, -4u = -4v for u. -2 Solve -2k = 4a - 10, 7 = 4a - 2k - 23 for a. 5 Solve -2x = 2a + 18, -42x = -2a - 38x + 12 for a. -4 Solve -11 = 4r + 5, 5s + 3r + 27 = 0 for s. -3 Solve -3w - 7 = q, -2q = -5w - 38 + 8 for q. 5 Solve 0 = -12j - 4i - 64, 11i = -5j + 14i - 22 for j. -5 Solve 2j + 0 = 3o - 11, 21 = 5o - 2j for o. 5 Solve 3d - 2d + 2 = -2m, m = -3d - 1 for m. -1 Solve i = -5, -9 = 2h + 3i + 2 for h. 2 Solve a - 22 = 3g - 13, -2g - 16 = -4a for a. 3 Solve -l - 78h - 2 = -74h, -4h + 8 = -4l for l. -2 Solve -4a + 2u - 10 = 6, -4a + u = 18 for a. -5 Solve -3t = -2k + 4, 0 = -t - 2t + 4k - 2 for t. -2 Solve -4x + m = 3m - 8, 0 = -2m + 8 for x. 0 Solve 4l = -20, -5q + 5l = -0l - 45 for q. 4 Solve 0c + 2c - 3g + 7 = 0, 7 = -c - 2g for c. -5 Solve 4m = -3t + 2t + 19, 0 = -3m - 2t + 18 for m. 4 Solve 2 = i + 3p, 7p - 2p + 2 = -3i for i. -4 Solve -3j = -2c + 1 - 15, 7 = 2j + c for j. 4 Solve 40l - 6 = 38l, 2v - 4l = -12 for v. 0 Solve -21 = s + 3v, 9s - 5s - 1 = 5v for s. -6 Solve 2p = 3p - 3i - 5, 2p + 2i = -6 for p. -1 Solve -3j - 11 = 5r + 1, 3r + 4 = -j for r. 0 Solve 5o = o + 2h + 2, -4h + 4 = 0 for o. 1 Solve -37x + 38x - 3 = -j, 3x = -5j + 11 for j. 1 Solve -38 = 2c - 5u - 10, c - 4 = -2u for c. -4 Solve -10f = -3l - 12f - 3, -4l - 5f - 11 = 0 for l. 1 Solve -2s - 3s = -f - 21, -4s = -2f - 12 for s. 5 Solve m + 30 = s + 4s, 4m - 2s = -30 for m. -5 Solve 0 = j - 3t - 16, j - 8 = -t - 12 for j. 1 Solve -i + 2 + 9 = -5b, 0 = b - i - 1 for b. -3 Solve -5i - 24 = 4f, 0i - 5i - 16 = -4f for i. -4 Solve 3j = -5a + 2, 7j - 14 = 6j + 5a for j. 4 Solve 2j = -4l - 10, 0 = -j + 5l + 11 - 2 for j. -1 Solve 0n + 2z - 16 = -4n, -3n + 5z = -25 for n. 5 Solve -5x + 2w = -18, -2x + 2w + 3 + 9 = 0 for x. 2 Solve -9b + 2l = -5b + 4, 5b - l = -11 for b. -3 Solve 0 = 3s + 272 - 269, -5s - 3 = -r for r. -2 Solve 5x = 16a - 12a - 13, -4x - 4 = 0 for a. 2 Solve 12 = -4x + 2f + 18, -3x - f - 8 = 0 for x. -1 Solve -4 = 3h + 4w, 12h - 14h + 5 = -5w for h. 0 Solve 5v = -4f + 17, -7 = -5f + 3v + 5 for f. 3 Solve 2n = 2k + 4, -2k + 1 = 2n + 13 for n. -2 Solve 2g - 8 = -5q - 6, -3q - 2 = 2g for g. -4 Solve 37 = 4h + s + 20, 13 = -4h + 5s for h. 3 Solve -5o + 57 = -5z + 27, 18 = -4z + o for z. -4 Solve -p + 3k + 2k - 25 = 0, -3k = 4p - 15 for p. 0 Solve -3k = -2h - 6k - 16, 6 = -k for h. 1 Solve -3r - 3 = -0r, 3f = -4r + 11 for f. 5 Solve 0 = -p - 10l + 15l - 13, -3p - 3l = -15 for p. 2 Solve 5i = 5k - 10, -3i - 5k + 29 = -k for i. 3 Solve 2 = 2h - w, 3h + 5w - 1 = 2h for h. 1 Solve 2z + 4i - 2i = 18, -20 = -5i for z. 5 Solve -n + f + 3 = 2n, n + 15 = -5f for n. 0 Solve -6q - 24 = -4q + 4f, -3q - 4f - 28 = 0 for q. -4 Solve -r + 8 = -g, 4r - 5r + 3g + 16 = 0 for r. 4 Solve -9 = -4p - 2v + 11, 2p = -5v + 26 for p. 3 Solve 2z + 12 = -4h, 2z + z + h + 8 = 0 for z. -2 Solve -4l = 4w - 8, -13l + 15l - 6 = 0 for w. -1 Solve -11 = -5h + 4j, -3h - 2j = -7h + 4 for h. -1 Solve q + 10 = 3h, -h + 24 - 9 = 2q for q. 5 Solve 3i + 2c = 3c + 9, -5c = -2i + 6 for i. 3 Solve 10v = -3m + 7v + 3, 2v + 1 = -3m for m. -3 Solve 4x = -n - 20, n + 3n - 5x = 25 for n. 0 Solve -3u - 4m + 19 - 11 = 0, -5m + 11 = 4u for u. 4 Solve 3f + 9 = -0f + 4d, 0 = 5f - 5d + 10 for f. 1 Solve 0 = o - 2o + 4, 2o - 10 = -2j for j. 1 Solve 42z - 40z - 13 = -3j, 3z + 3j - 12 = 0 for z. -1 Solve 5x = -3b, -b = 4b - x for b. 0 Solve 4q - a = 4 - 7, -2a + 6 = 0 for q. 0 Solve -6 = 2q, -5q + 9q = -5d - 27 for d. -3 Solve -3d - 3b - 1 = d, -2d + 4b = 28 for d. -4 Solve 5k - 1 + 3 = -d, -2k = -5d - 10 for d. -2 Solve -5g - 2 + 43 = 4k, 0 = -5g + 5k + 5 for g. 5 Solve -b - 32y = -28y + 9, 3b = 2y - 13 for b. -5 Solve 19 = -4m + x, 0 = m - x + 4 for m. -5 Solve -4w = 4l - 36, 4w - 71 = -5l - 30 for l. 5 Solve 2t + 2g - 10 = 0, -5g = -0t - 2t + 10 for t. 5 Solve -4l = -4f + 20, f = -4f + 4l + 21 for f. 1 Solve -4p + 2q = -10, q = 2p + 4q - 17 for p. 4 Solve -2r + 5r - 9 = 0, 3l + r - 6 = 0 for l. 1 Solve r = 5n - 6n, 0 = -2r + n for r. 0 Solve -18 = -3x + 3s, -34 = -4x + 22s - 8s for x. 5 Solve 5f + 5h = -30, -37f - 18 = -32f + 2h for f. -2 Solve 4h = -4s + s + 22, 0 = s - 5h + 18 for s. 2 Solve -4r + 8 = 2m, -3m = -3r - 0m - 12 for r. 0 Solve -5j - 3t = 3 + 8, t + 9 = -3j for j. -4 Solve -j = 3l + 10, 0j + 3l + 8 = j for j. -1 Solve 2q + u - 5 = 0, 5q + 207u + 1 = 209u for q. 1 Solve -4u + 9 = -f, -5f + 12 - 11 = 3u for u. 2 Solve -35y + 30y + 30 = 3w, 3y = -w + 14 for y. 3 Solve -6 - 1 = -2y + 5u, 0 = 4y + 5u + 1 for y. 1 Solve 5 = j - s, 25 = 5j - 0s + 5s for j. 5 Solve t + 3 = 2t + 4p, -2t - 4p + 2 = 0 for t. -1 Solve 14 = 5u + 4f + 38, 4f = -2u - 12 for u. -4 Solve 4d + 2 = 2f, 4d + 12 = 2f + 2f for d. 2 Solve -4s = -3w - 30, -2 = -4s + 22 for w. -2 Solve 18 = 3y, -38a - 4y = -39a - 29 for a. -5 Solve -16 = 4p + z, 0 = 4p + 13z - 15z + 4 for p. -3 Solve 5j + 9 = 16w - 18w, -4j - 15 = -w for w. 3 Solve 0 = i + 3v - 19, 14i = 13i - 5v + 29 for i. 4 Solve 0 = -4t - 2b - 22, 2b - 7b = -5t + 10 for t. -3 Solve -5q + 4m + 16 = 0, -5m + 4 = -4q - 6m for q. 0 Solve -2o + 26 = 4y, 4y - 3o = 19 - 8 for y. 5 Solve 0 = -3t + 6i - i + 20, 0 = -3t + i + 4 for t. 0 Solve -5o + 4j = -3 + 28, 4o + 2j = 6 for o. -1 Solve -5q = -3l - 17, -2 + 16 = 3q + 2l for q. 4 Solve -3p + 5s = -4p - 11, -5p = -3s - 1 for p. -1 Solve 0 = -2i + 2j - 2, 3i + 2j = -46 + 23 for i. -5 Solve -15p + 3f - 29 = -11p, -2p - 2f - 4 = 0 for p. -5 Solve 3d = 5k + 30, -k = 2k - 4d + 29 for k. -3 Solve 2c - c = -i, -5i + 20 = 0 for c. -4 Solve 0 = 2x + 4q - 6, 21q - 19q + 2 = 4x for x. 1 Solve 25 = -5z - 24n + 28n, -z - 5 = -2n for z. -5 Solve 5i + o = -13, 3i = -o - 4 - 5 for i. -2 Solve -10d = -4r - 7d - 25, -3d + 13 = -r for r. -4 Solve -5b + 2f = 9 + 3, -b - 4f = -2 for b. -2 Solve -2o - 2d + 8 = -0d, -d = -2 for o. 2 Solve 96s - 4 = 3i + 95s, 3s - 3 = 0 for i. -1 Solve 3f = -3h + 18, 2h - h = 2f - 6 for h. 2 Solve 3x + 1 = -q, -3q - 11 = 2x - 1 for q. -4 Solve -4q + 5b - 12 = 0, -5q - 3b = -11 + 26 for q. -3 Solve -j - 10 = 4j + 5l, l = 3j + 14 for j. -4 Solve 0g = -2g - 4a - 20, -5a = -2g + 7 for g. -4 Solve 10 = -5c, 3o - c + 17 = -2c for o. -5 Solve 4j - 8 = 0, 6x + 2j - 16 = 3x for x. 4 Solve 0 = -y - 5, 2a + 17 = -3y for a. -1 Solve -3i + 0i + 2w - 4 = 0, -2i = -5w - 12 for i. -4 Solve -3w - 5g - 6 = -0g, 4w = 3g - 8 for w. -2 Solve -3z - 11 = 5f, 62f - 65f = z + 5 for f. -1 Solve 2p + 5l = 4, -34p - 29 = -39p - 3l for p. 7 Solve -5h + 4h = c - 6, -5c - 2h + 27 = 0 for c. 5 Solve 3j = -15, 5 - 1 = 3f + j for f. 3 Solve 4b - 3f - 9 = 0, 0 = 4f + 12 for b. 0 Solve -3v + 3t = -t - 14, 4v = -5t - 33 for v. -2 Solve 0 = -4u - 4h - 4, 2h = 4u + 35 - 7 for u. -5 Solve 3t - 19 = 5z, 0t - 13 = -t + 3z for t. -2 Solve 3n - 3 = 4g - 2, n - 4g - 3 = 0 for n. -1 Solve -3y + 3j - 9 = -0y, 3j - 9 = -3y for y. 0 Solve 2j = 2y + 2y - 4, 6 = 5y - 3j for y. 0 Solve -3x - 23 = -5o + x, -15 = -3o + 3x for o. 3 Solve -l = 4w + 11, -5l = -8l - 2w + 7 for l. 5 Solve b + 8 = -2b - 4z, -4z - 24 = -b for b. 4 Solve 3w + 3v - 12 = 0, -2w + 6 = -4v + 22 for w. 0 Solve 42 = 6t + 4k, 21t = 26t - 5k - 10 for t. 5 Solve -c + 5a + 16 = 0, -3a + 7a = -5c - 7 for c. 1 Solve z - 14 = -3v, 15v + 5 = 16v for z. -1 Solve -5x + 3c + 2 = -2, -3x = 2c - 10 for x. 2 Solve m + 5 = 3, -10 = 2x + 5m for x. 0 Solve i - 1 = 4s, -i - 5s + 41 = 31 for i. 5 Solve 7l - 4l - 4n = -5, -n - 3 = -5l for l. 1 Solve w - 6 = -0w - 2j, 0 = w - 3j + 4 for w. 2 Solve 6 = -4x + 5a, 0 = -3x - 0x - a - 14 for x. -4 Solve -2s - 5p = -7p, -2s + 4p + 8 = 0 for s. -4 Solve 4 = -5o + 4g, 37o + 5 = 38o + 5g for o. 0 Solve -3g + 3a = 2g - 17, 0 = 5a - 5 for g. 4 Solve -16 = -4h - 3o, -2o + 6o - 11 = 5h for h. 1 Solve -4t - 8 = -22*r	{ "pile_set_name": "DM Mathematics" }
order. k, 3, c, -0.1 Let m = -61/6 - -409/42. Put -0.8, m, -3 in decreasing order. m, -0.8, -3 Let x be (-2 - 0)/((30/(-147))/(-5)). Let b = -44 - x. Sort b, 4, -15 in decreasing order. b, 4, -15 Let d = -6.32 - -1.32. Sort d, 0.3, -3. d, -3, 0.3 Suppose 3t = -2t. Let s(x) = x*2 - 5x - 2x - 13 + 14. Let y be s(7). Put 4, t, y in descending order. 4, y, t Let f = 11 - 10.3. Let z = f + 3.3. Let d = -20.4 - -19.4. Put 1/4, z, d in decreasing order. z, 1/4, d Let j = 18223/5 - 3656. Let l(w) = -w2 + 2w + 23. Let m be l(7). Let t = m - j. Sort t, -0.4, 4. t, -0.4, 4 Let c = 0.03 + 0.27. Let t = -0.37 + -4.63. Sort t, c, 1/5. t, 1/5, c Let a = -28 - -31. Suppose -3u = -4r - 8u + 5, 0 = r + au - 10. Sort r, -3, 5 in increasing order. r, -3, 5 Let i = 24 + -45. Let q = -1.7 + -17.3. Let j = q - i. Put j, -4/3, 1 in descending order. j, 1, -4/3 Suppose 4t + 2 = -14. Let v(k) = -9k*3 - 2k - 2. Let h be ((-14)/(-42))/((-1)/(-3)-1). Let n be v(h). Put n, t, 3 in descending order. n, 3, t Let u = 0.19 + 1.81. Let w = 0.002 - -0.998. Sort 1/5, w, u in increasing order. 1/5, w, u Suppose -269a + 231a = 76. Sort 3, -18, a in descending order. 3, a, -18 Let l(a) = -a3 + 11a*2 + 147a - 36. Let n be l(-8). Let u = 4/11 - 42/55. Put 0.2, u, n, -0.03 in descending order. n, 0.2, -0.03, u Suppose -4p - 15 = -p. Suppose 6 = 125x - 122x. Sort p, x, -3, -4 in ascending order. p, -4, -3, x Let t(m) be the third derivative of -m4/6 - 5m*3/3 - 5m2. Let c be t(-8). Let r be (-4)/(-8) - 15/c. Put 1/2, -4, r in decreasing order. 1/2, r, -4 Let t(a) = a3 + 21a2 - a + 4. Let g be t(-21). Suppose -15s = -10s - g. Sort 4, s, 3 in increasing order. 3, 4, s Let w = 173 + -168. Sort 1, w, 12 in decreasing order. 12, w, 1 Let s be (8/(-6))/((-9)/(-27)). Let c = 89 + -90. Sort s, 5, c. s, c, 5 Let t = 54/83 - 461/581. Sort t, -0.035, 1, -2/7 in increasing order. -2/7, t, -0.035, 1 Let g = 30514.039 + -30486. Let j = -0.039 + g. Let v = -32 + j. Sort v, -2, -5 in descending order. -2, v, -5 Let f = -19 - -14. Let w(k) = k3 - 8k*2 + 8k - 3. Suppose -3h - 9 = 2g - 30, 14 = 2h + 3g. Let n be w(h). Put n, f, -1 in increasing order. f, -1, n Let l(u) = -2u2 - 17u - 12. Let v be l(-8). Sort -17, v, 4 in ascending order. -17, v, 4 Suppose -9 = 4f - 1. Suppose -3s + 6 = 3z, 2z + 5 = -3z - 2s. Put f, 4, z in descending order. 4, f, z Suppose x - 20 = -5f, -4f + 41 - 29 = 0. Sort -1, x, -12, 4 in ascending order. -12, -1, 4, x Let r(o) = o*2 - 14o - 18. Let s be r(15). Let j = -110 + 109. Sort 7, j, s. s, j, 7 Let v(y) = -y - 1. Let w be v(-5). Suppose 5b + k = -0k - 19, 2b + 22 = -wk. Suppose -3t + 2t = 3o, 3o = -3t. Sort 1, o, b in increasing order. b, o, 1 Let q = -4 - -3.9. Let k = 0.0848 - 1.5848. Sort k, q, -5 in decreasing order. q, k, -5 Let n(o) = o3 + 4o*2 - 6o - 6. Let u be n(-5). Put 1, u, -13, 5 in decreasing order. 5, 1, u, -13 Let i be -1 + 0 - 26/(-22). Let j = 0.022 + 0.378. Sort -4, i, 4, j in descending order. 4, j, i, -4 Let j(f) = f*3 + 104 + 3f + f - 3f - 107 + 4f2. Let z be j(-2). Sort -5, -8, z. -8, -5, z Let d = 3.665 + -0.065. Let m = -0.03 - -0.63. Let c = d - m. Put c, 0.3, -2 in descending order. c, 0.3, -2 Let f = -829/22 + 75/2. Put 1, f, 12, -5/7 in ascending order. -5/7, f, 1, 12 Let x(m) = m3 - 8m2 + 6m + 9. Let q be x(7). Let k be 6/(-1 - -4)q. Put -4, k, -3, -2 in decreasing order. k, -2, -3, -4 Let s be (1 + (-28)/(-20))(-71 + 1). Let h be 3(-8)/s - 0/(-2). Sort 2/33, h, -1 in decreasing order. h, 2/33, -1 Let f = 0 - 1. Let i(t) = -t - 1. Let o be i(4). Suppose 5v = -2p + 4p - 14, -4v = -3p + 14. Sort v, f, o in decreasing order. f, v, o Let x be (4(-1)/(-3))/(27/(-81)). Put 3/5, x, 3/4 in decreasing order. 3/4, 3/5, x Let a(w) = 3w*2 - 74w - 26. Let c be a(25). Sort -4, c, 3. -4, c, 3 Let c be 2/10 + (-26)/5. Suppose -4 = -2m + 5h + 17, -5m + 4h + 10 = 0. Sort m, -4, c in decreasing order. m, -4, c Let k be ((-1582)/(-133) - (-10)/95) + -8. Let a(m) = -23m2 + m + 1. Let q be a(-1). Sort q, k, -2 in increasing order. q, -2, k Let o = 546 - 542. Put 1, o, -2, 16 in increasing order. -2, 1, o, 16 Let f = -137 + 142. Put 0, f, -2, 53 in ascending order. -2, 0, f, 53 Let a(w) = -2w*2 - 22w + 89. Let c be a(-14). Put -2, 3, 6, c in descending order. 6, c, 3, -2 Let b be (-2 - (-10)/8)/(30/120). Let i(x) = 2x + 14. Let g be i(-7). Suppose v + 6 - 7 = g. Put b, v, 2 in increasing order. b, v, 2 Suppose a + 0 - 1 = 2n, 3n - 6 = -a. Suppose 5f + a + 2 = 0. Suppose 12 = 3y, 0 = 5u + y - 3y + 33. Sort f, u, 3. u, f, 3 Let d = -6146.3 - -6146. Let t be (-2)/(-15)(-6)/(-4). Let b = 0 + 2. Sort b, t, d in descending order. b, t, d Let k = 0.477 - 0.477. Let g = -4.812 - -0.012. Let h = -0.8 - g. Sort 0.1, h, k in descending order. h, 0.1, k Let x be ((-18)/14)/((-5)/((-15)/(-9))). Sort x, 0.08, 0.2 in increasing order. 0.08, 0.2, x Let q(u) = -u + 1. Let j(a) = -2a - 1. Let s be j(-2). Suppose -h + s = -0h. Let l be q(h). Sort 0, l, 8. l, 0, 8 Let r be 2(2 + (-87)/6). Let a = 20 + r. Sort a, 1, -1, 3 in ascending order. a, -1, 1, 3 Let l = 105.8 + -19.8. Let b = l - 85.7. Let q be 10/12(-2)/(-10). Put 4, q, b in decreasing order. 4, b, q Let a = 1544 + -1544.2. Sort 5, a, -2/5, 1 in ascending order. -2/5, a, 1, 5 Suppose -3 + 17 = -7h. Sort 4, 12, h, -3. -3, h, 4, 12 Let q be -52/(-30)3. Let y = 21 + -26.5. Let n = y + 1.5. Put -1, n, q in descending order. q, -1, n Let t = 4.1 + -21.1. Let p = t - -14. Suppose -5y - 1 = k, 0 = -4y + k - 2k. Put p, y, -0.2 in descending order. -0.2, y, p Suppose i - 3 = -2i. Suppose -7 - 105 = -4z + 2y, -3z + 5y + 77 = 0. Suppose -z + 14 = -3t. Sort 4, i, t in ascending order. i, 4, t Let i be (0/17)/(2/2). Put 5, 10, i in descending order. 10, 5, i Let m be 0/(-4(-3)/(-6)). Suppose -3r + 1 - 7 = m. Let o = 3 + -3. Put 1, r, o in descending order. 1, o, r Let c(w) = -w - 22. Suppose -14 = j + 3. Let l be c(j). Sort 3, 0, l in descending order. 3, 0, l Let a = 41.067 - 0.067. Let v = -6 + a. Let o = v + -39. Sort 4, o, -3/2. o, -3/2, 4 Let b(j) = -j*3 - 15j*2 - 51j - 13. Let v be b(-10). Suppose -2g + 30 = 3g. Sort -2, g, v. v, -2, g Let k(g) = g*2 + 7g - 14. Let w be k(2). Sort -12, w, 5 in increasing order. -12, w, 5 Suppose 3i - 5u = -54, 2i - 3i - u - 10 = 0. Let b = -11 - i. Suppose d + 4 = 2d. Sort d, 3, b in decreasing order. d, 3, b Suppose -4j = 2l + 12, 2l + 11 = -3j + 1. Let u = 10 - 13.8. Let g = u + 0.8. Put -1/5, g, j in decreasing order. -1/5, j, g Let j = 20/187 - -2/187. Put j, -4/5, -0.5 in decreasing order. j, -0.5, -4/5 Let u = 71 - 74. Let j = 4 - 2. Let i be 12/21 - 108/140. Put i, u, j in decreasing order. j, i, u Let z = -295 + -25. Let v = z + 4162/13. Let s = 0 + -0.1. Put -5, s, v in descending order. v, s, -5 Suppose -29p - 13 = 16. Sort p, 2, 0, 3 in increasing order. p, 0, 2, 3 Let l(g) = -g*2 + 7g - 6. Let b be l(6). Suppose -28i = -4i + 16i - 120. Put b, i, 2 in increasing order. b, 2, i Suppose -3v - 12 = -9v. Let j be ((-16)/6)/(v/(-3)). Put j, -2, 3 in decreasing order. j, 3, -2 Let s be (-3)/((-159)/52) + (-25 - -24). Let v = s - 51/106. Sort 2/21, v, -1/4, -0.4 in decreasing order. 2/21, -1/4, -0.4, v Let r be 4/(-12) - 1/(-3). Suppose g - 3 = -4. Let k(l) = -2l*2. Let b be k(g). Sort -1, r, b. b, -1, r Suppose -4p + c = p - 147, 4p - 123 = -c. Let o = p + -101/3. Put 1, o, -4 in ascending order. -4, o, 1 Let d(n) = n + 4. Let w be d(-2). Let f = -2497 + 2493. Sort w, f, 5 in increasing order. f, w, 5 Let x(b) = -b - 3. Let n be x(-6). Let l be (-412)/84 + 82/21 + -4. Put l, n, 1 in ascending order. l, 1, n Let l = 115 + -129. Sort l, -5, -1/3. l, -5, -1/3 Suppose 3u - 11 = 1, -4g - u + 16 = 0. Let z(q) = -q + 3. Let f be z(3). Put 5, g, f in increasing order. f, g, 5 Suppose 5p = -4r - 50, p = -r + 6r + 19. Let q be 4 + 15/p*4. Put 5, q, 1 in decreasing order. 5, 1, q Let q = -502 - -558. Let x = 0.1 - 0. Put x, 0.3, q in decreasing order. q, 0.3, x Let s = 1458 - 2487. Sort -1, s, 5. s, -1, 5 Let s = 72.26 - 69. Let t = s + -16.36. Let r = t - -13. Sort 3, -1/7, r in decreasing order. 3, r, -1/7 Let l be 2 - 0 - 10/6. Let g	{ "pile_set_name": "DM Mathematics" }
of (-7 - (-66)/12) + (-5122)/(-4). 1279 Let i be (-2)/6 - (-178)/3 - 2. Let w = i + 22. List the prime factors of w. 79 Let w be 9/45 - 1/5. What are the prime factors of 71 + w + 4/(-1)? 67 Let i(q) = q*2 + 3q - 18. Let w(f) = 5f3 - 4 - 3f - 7f2 + 4f - 6f3. Let j be w(-7). List the prime factors of i(j). 2, 5, 7 List the prime factors of 11(-16)/(-20)5. 2, 11 Let x(h) = h - 2. Let z be x(5). Suppose zu + 5d = 182, 2d + 2 = -2. What are the prime factors of u? 2 Suppose 5k = 72 - 17. Suppose 0 = kf - 10f - 105. List the prime factors of f. 3, 5, 7 Suppose -4i + 577 = 4y - 863, 5i + 2y = 1797. What are the prime factors of i? 359 Suppose 5k - 5l - 2910 = 0, l - 1745 = -3k + 5l. List the prime factors of k. 11, 53 Suppose 0 = -3t + 4y - 2, 3t - 2t = -2y + 6. Let q be (t - 1)/(1/4). Suppose 3o + qw = 43, -45 = -3o - w - 2w. List the prime factors of o. 17 Suppose -4z = -12, 10v = 11v - 5z - 590. List the prime factors of v. 5, 11 What are the prime factors of 1113 + (4/(-14) - (-96)/42)? 5, 223 Let j(t) = -t*3 + 11t*2 - 15t - 10. Let c be j(9). Suppose -cb + 12b = -1370. List the prime factors of b. 2, 137 Let h = -2 + 98. Suppose -4y + 7y = h. List the prime factors of y. 2 Let d(v) = -v + 5. Let u(p) = -p + 7. Let g(l) = -7d(l) + 5u(l). Let a be g(4). Suppose -h + a = 2. List the prime factors of h. 2, 3 Suppose 2m = 3g + 8, -5g + 2g - 3m = -12. Suppose -4v + 279 + 201 = g. What are the prime factors of v? 2, 3, 5 Suppose -r = 4r - 340. Suppose -6a + r = -4a. Let d = a - 5. List the prime factors of d. 29 List the prime factors of (-5274)/(-33) + 1 - 160/(-880). 7, 23 Let f be 40 - 11 - 2/(-2). Let u = -34 - -16. Let a = f + u. List the prime factors of a. 2, 3 Let k = 29 - -1. Suppose -d + k = -16. Suppose -3n - 2w = w - 33, 4w = 2n - d. List the prime factors of n. 3, 5 Let m = -129 + 281. Let q = m + -77. List the prime factors of q. 3, 5 Let r(j) = j3 + 14j*2 - 4j - 29. Let f be r(-13). Suppose 0w = -4p - 2w + f, -3p + 149 = 4w. List the prime factors of p. 47 Let w = -101 + 223. List the prime factors of w. 2, 61 Suppose -32j = 5r - 35j - 241, -2r + 2j + 94 = 0. List the prime factors of r. 2, 5 Let k(h) = 15h2 - 8h - 2. Let r(y) = -14y2 + 7y + 2. Let d(c) = -3k(c) - 4r(c). What are the prime factors of d(-2)? 2, 5 What are the prime factors of (16338/210)/(2/10)? 389 Let n = -1349 + 2380. List the prime factors of n. 1031 Let c = 150 + -149. Let m(j) = -54j. Let z(y) = -675y. Let l(t) = -63m(t) + 5z(t). List the prime factors of l(c). 3 Let c(z) = 2z2 - 3z + 27. Suppose -6f + 30 = -11f. What are the prime factors of c(f)? 3, 13 Suppose -a + 6 = 2s, -5s + 4a + 17 = 2. Let i(c) = -c3 + 7c*2 + 5c - 21. Let o be i(7). Let m = s + o. What are the prime factors of m? 17 Let o = 5190 - 2027. List the prime factors of o. 3163 Let q(l) = 48l - 106. What are the prime factors of q(18)? 2, 379 Let o be 6((-130)/25)/(1/(-25)). Let p = o - 542. What are the prime factors of p? 2, 7, 17 Let t = -7 + 4. Let b(z) = z*2 + 2z - 1. Let j be b(t). Suppose ju - 26 = -0u. List the prime factors of u. 13 Let q = 152 + 1140. What are the prime factors of q? 2, 17, 19 What are the prime factors of (-10945)/(-5) + (-12 + 5 - -2)? 2, 3, 7, 13 Suppose -3i = -5x + 1, 3 = -x + 2i + 6. What are the prime factors of 1/x2 - -4? 2 Let t(n) = -n - 2. Let w be t(-6). Suppose 4q - 712 = -wg, g - 4 = -3g. List the prime factors of q. 3, 59 Suppose 78u = 45u + 66924. List the prime factors of u. 2, 3, 13 Let t be 7/(-6) - -1 - 8225/(-282). Suppose -30x + tx = -181. What are the prime factors of x? 181 Suppose 11n - 35 = 4n. Suppose -5y = -2a - 685, 3y - na - 425 = -a. What are the prime factors of y? 3, 5 Let l = -3713 + 6091. What are the prime factors of l? 2, 29, 41 Let g(y) = -4y + 10. What are the prime factors of g(-33)? 2, 71 Suppose 2y - 167 - 827 = -2m, 4m = -2y + 1998. What are the prime factors of m? 2, 251 Let y be ((-17)/(-7) - 1)35. Suppose 2m + 5z - z = 20, -y = -3m + 4z. What are the prime factors of m? 2, 7 Let b(c) = -c2 - 16c + 19. Let r(s) = s*2 + 9s - 1. Let x be r(-7). List the prime factors of b(x). 2, 17 Let c(t) = -t*3 + 5t*2 + 3t - 13. Let n be c(6). Let z = 144 - n. What are the prime factors of z? 5, 7 Let s(g) = 1735g2 - 1722g*2 - 7g + 11 - 3 - g*3. What are the prime factors of s(6)? 2, 109 Suppose -5d + 2d = 3. Let i be (-8)/(d/2 - 0). Let l = -13 + i. List the prime factors of l. 3 Let l(o) = -6o - 16. Let r be l(-4). Let f(h) = 5h2 - 2h + 19. What are the prime factors of f(r)? 17, 19 Let d(f) = -f*3 - 6f*2 - f + 6. Suppose -t + 0l - l = 3, 0 = -5l + 15. Let u be d(t). Let q = 19 - u. What are the prime factors of q? 7 Let d(y) be the first derivative of -41y4/4 - y2/2 - y - 36. Suppose -v + 3 = -4v. What are the prime factors of d(v)? 41 Let a(n) = -11n - 7. Suppose 10 = 5w + 4m + 25, 2m + 18 = -4w. List the prime factors of a(w). 2, 5, 7 Let k(n) = -n*3 + 7n*2 + 2n + 8. Let h(c) = -6c3 + 35c*2 + 9c + 41. Let j(i) = -2h(i) + 11k(i). Let q = -6 - 0. What are the prime factors of j(q)? 2, 3 Suppose -72 - 12 = 7t. List the prime factors of (8000/15)/4 + 4/t. 7, 19 Suppose -8i = -5i - 9. Suppose ic + 7 = 19. Suppose -ck - 8 = -0k, 0 = -4h + 3k + 218. What are the prime factors of h? 53 Let t(b) = b*3 - 23b*2 + 66b + 27. What are the prime factors of t(20)? 3, 7 Suppose 3o - 2349 + 492 = 0. Let r = -422 + o. Suppose 3d + 2j + 142 = 5d, -r = -3d - j. What are the prime factors of d? 67 Let y(n) = 184n*2 + 8n + 9. What are the prime factors of y(2)? 761 Suppose -a - 12 = -3n, a - 2a - 9 = -2n. Suppose -4p + 549 = nq, 0 = -p + 2q + 28 + 112. What are the prime factors of p? 2, 3, 23 Let r be 60/186/(-4). Let x be (-74)/3 - (-3)/(-9). List the prime factors of (-510)/xr/(-2). 3, 17 Suppose -s = 17 - 71. Suppose -s = -7h + 5h. List the prime factors of h. 3 Suppose -5s - s = 0. Suppose -5i - 3n + 238 = s, 2i - 4n = 3i - 51. What are the prime factors of i? 47 List the prime factors of (-3)/8 + 5 + (-97775)/(-40). 31, 79 Suppose 1180 = 3u + 14o - 19o, -2 = -2o. What are the prime factors of u? 5, 79 Let n(o) = -71o - 237. What are the prime factors of n(-11)? 2, 17 Let i = 1 - -2. Suppose a - if = -4, 0a + 23 = -3a - 2f. Let m(t) = t3 + 8t*2 + 2t + 6. List the prime factors of m(a). 41 Let a = 2913 - 1849. What are the prime factors of a? 2, 7, 19 Let w be (4/6)/(8/60). Let y(d) = 96d2 - 9d + 7. Let g(s) = 144s2 - 13s + 10. Let h(m) = wg(m) - 7y(m). List the prime factors of h(1). 47 Let t = 3217 - 810. List the prime factors of t. 29, 83 Let m = 23 - 21. Suppose 191 + 94 = 3l + 3w, -195 = -ml - 3w. What are the prime factors of l? 2, 3, 5 Let m be -32/12-358. Suppose -d - 3r + m = -0d, 4r - 179 = -d. Let x = d + -122. What are the prime factors of x? 3, 19 Suppose -25c + 3211 = -27614. List the prime factors of c. 3, 137 Let h(s) be the first derivative of 2s2 - s + 5. Let p be h(5). Suppose 23 = k + 2i, 5k + i = 123 + p. List the prime factors of k. 29 What are the prime factors of ((-762)/9)/((-10)/165)? 11, 127 Suppose -3j - 123 = t - 400, 0 = 2t - 3j - 536. List the prime factors of t. 271 Suppose -4v - 14324 = -3t, 148t + 14326 = 151t - 5v. List the prime factors of t. 2, 1193 Let j = 16 - -44. Let a be -1 + (2 - -1) + j. Suppose -2i = -160 + a. What are the prime factors of i? 7 Let l = 5 - 7. Let z be l/(176/92 + -2). Suppose -g + z = 2i - 50, -3i + 2g + 106 = 0. List the prime factors of i. 2, 3 Suppose k + 2k = -2i + 20, 0 = i - 5k + 16. Suppose 2o + iy - 120 = 302, -2o + 5y + 458 = 0. List the prime factors of o. 3, 73 Let j = -17 + 27. Let k be 42/4 - 15/j. Suppose kb + 6 = 11b. What are the prime factors of b? 3 List the prime factors of (-2996)/(-6) + (-3)/9 + 1. 2, 5 Let m(g) = -1 + 1 - 21g - 25g + 15. List the prime factors of m(-3). 3, 17 Suppose -5h + 10h + 5t - 795 = 0, -h = 4t - 174. Let j = -50 + h. List the prime factors of j. 2, 13 Suppose -5w = -2f + 7, -3f + f + 6 = -4w. Let m be 2 + (-1)/w3. Let o(h) = -h3 + 8h*2 - 3h - 2. Wh	{ "pile_set_name": "DM Mathematics" }
-12, 3l + n = 0. What is the highest common divisor of m and j? 12 Let b be (-357)/(-33) + 4/22. Let z = b - 3. Let h be -2 + 87 + 1 + 2. What is the highest common factor of h and z? 8 Suppose j = 2j - 6. Suppose -4n + 3b = -165, n + 3b - 6b - 39 = 0. Calculate the greatest common factor of n and j. 6 Let i(g) = -2g3 - 6g*2 - 2g. Let m be i(-4). Calculate the greatest common factor of 16 and m. 8 Suppose -5f = 2o + 2o - 437, -4f + 334 = -2o. Suppose -2l = -10 - 24. What is the greatest common factor of l and f? 17 Let n be 116/10 + (-12)/(-30). Suppose 13t - 10t = n. What is the highest common factor of t and 40? 4 Let y(g) = -g + 13. Suppose 11 = 3i - 2i. Let o be y(i). What is the greatest common divisor of 8 and o? 2 Let r(n) = n*3 - 4n*2 + 4n - 2. Let q be r(3). Calculate the greatest common divisor of 8 and q. 1 Suppose 4z - r - r - 4 = 0, -16 = -4z - r. Suppose 0 = -s - zp - 8, s - 4p - 26 = -6. Calculate the highest common divisor of 12 and s. 4 Let t(q) = q*3 - 10q*2 + q - 8. Let w be t(10). Suppose c + c - 3d = -w, c - d = 0. Calculate the greatest common divisor of c and 2. 2 Suppose 5t + p + 1 = 0, -21 = -t + 6t - 4p. Let h be (-2 - t)/((-4)/(-132)). Let q = h + 46. What is the highest common factor of 13 and q? 13 Let d(l) = 6l + 7. Let w be d(5). What is the highest common divisor of 148 and w? 37 Let g be 172(-1)/(-2). Suppose b + 9 = -g. Let u = b - -37. What is the highest common factor of 11 and u? 11 Suppose 2j = 7j + 20. Let w be j/(-14) + 66/14. Calculate the greatest common factor of 5 and w. 5 Suppose 3q - 3y = 300, 3y + y - 75 = -q. Suppose 2o + 2f = 3o - q, -10 = -5f. Calculate the greatest common divisor of 9 and o. 9 Let r = -33 + 120. Suppose j = 2j - 4. Suppose 0 = ju + 5t - 20 - 153, -r = -2u - 3t. Calculate the greatest common factor of 6 and u. 6 Let t = -21 + 105. Suppose 0 = 5q - 4o - t, -2o = 2q + 2 - 50. Let x(l) = l*2 + 10l + 4. Let r be x(-10). What is the greatest common factor of r and q? 4 Let q(p) = p*3 - 3p*2 - 8p + 6. Let b be (-1)/(0 + 3/(-15)). Let y be q(b). Calculate the highest common divisor of y and 80. 16 Let b = 77 + -41. Let t = -17 + 29. Calculate the highest common divisor of b and t. 12 Let r be -9(-3)/(2 - -1). Let u = -95 + 176. Calculate the highest common factor of r and u. 9 Let w = -27 + 38. Suppose 0 = -a + 4l + 13, -4l + 0l - 11 = a. What is the greatest common divisor of w and a? 1 Let b be 11/7 - (-30)/70. Suppose -3t = -z - 4, 7z - bz + 2t = 48. What is the greatest common factor of z and 80? 8 Let h = 67 + -15. What is the highest common factor of 130 and h? 26 Suppose -a + 2a - 2m - 64 = 0, -5a - 4m + 250 = 0. What is the greatest common factor of a and 18? 18 Suppose -11 = 5u - 76. Suppose u = 2y - 3. What is the greatest common divisor of y and 12? 4 Suppose 0 = t - 62 + 14. What is the greatest common factor of 16 and t? 16 Let h(w) = -6w + 7 - w2 - 2w + 0. Let u be h(-9). Let o be (u/(-2))/(2/60). What is the greatest common divisor of 12 and o? 6 Let i be -5((-568)/5 + 0). Suppose 4z - 3j - 1459 = -z, i = 2z + 4j. Let d be z/14 + 4/14. Calculate the highest common divisor of 14 and d. 7 Let q = -1 + 0. Suppose 0z + 64 = 8z. Let w = z + q. Calculate the highest common divisor of 1 and w. 1 Let w(q) = 2q - 2. Let t be w(2). What is the greatest common factor of t and 3? 1 Let t(y) = -y*2 - y - 109. Let w be t(0). Let x = 16 - 37. Let d = x - w. Calculate the greatest common divisor of d and 8. 8 Let c(l) = 2l*2 - 2 + 0l*2 - 1 + 16l - 5l. Suppose -3y - 9 = 18. Let n be c(y). What is the highest common divisor of n and 12? 12 Let i(y) = 84y + 1 - 5 - 107y. Let b = 3 + -7. Let x be i(b). Calculate the greatest common factor of 8 and x. 8 Let v = -21 + 23. Suppose 3f = -4j + 495, -5j - vf + 621 = f. Calculate the greatest common divisor of 18 and j. 18 Suppose -11u + 16u - 60 = 0. What is the greatest common factor of 2 and u? 2 Suppose 72 = 2g + 2f, 4g + 2f - 6f = 168. What is the highest common factor of 13 and g? 13 Let u = -5 + 150. What is the greatest common divisor of 58 and u? 29 Suppose -182 = 3s + 73. Let j = 157 + s. What is the greatest common divisor of 9 and j? 9 Suppose 2 - 34 = -3r - 4x, 0 = r + 5x - 29. Calculate the greatest common divisor of r and 1. 1 Suppose 4t = 12, -3n + 0t + 3t + 60 = 0. Suppose 6q - n - 61 = 0. What is the greatest common divisor of 7 and q? 7 Let j(h) be the second derivative of h*4/12 + 2h*3/3 - 4h*2 + 4h. Let b be j(-6). What is the highest common divisor of b and 20? 4 Let q(p) = p + 3. Let h be q(5). What is the greatest common factor of h and 4? 4 Suppose -a = -23 - 16. Calculate the greatest common factor of a and 13. 13 Let z = 162 - 108. Calculate the greatest common factor of z and 135. 27 Let u = 58 - 51. Calculate the greatest common factor of u and 42. 7 Suppose -2h - 5a = -23, -2a = -4h - a + 13. What is the greatest common divisor of h and 3? 1 Suppose -4z - 2 + 10 = 0. Suppose -4 = zv - 24. Suppose -k = s - 112, 3s - s + 106 = k. Calculate the greatest common divisor of k and v. 10 Suppose a = 4a - 285. Let y = 37 + a. Calculate the highest common divisor of y and 12. 12 Let g = -80 + -101. Let q = g + 293. Calculate the greatest common factor of 16 and q. 16 Let k be 18/(-12)12/(-9). What is the highest common divisor of 14 and k? 2 Suppose -2y - 2z = z - 20, 0 = -2y - 4z + 18. Suppose -2a + y = 1. Let c be -1 + 14/2 - 0. Calculate the highest common factor of c and a. 6 Let r(f) = f*2 + 2f + 1. Let t be r(-3). Let p = -1 + 3. Let b be -16(-2 - 0/p). Calculate the greatest common factor of b and t. 4 Let k = 11 + -10. Calculate the greatest common factor of k and 7. 1 Let a(j) = j2 - 5j + 3. Let q be a(6). Let x = 15 + -10. Suppose y + 6 = -4u, -2y + 21 = -xu - 6. Calculate the highest common factor of y and q. 3 Let x be 1/2(0 + -38). Let l = -12 - x. Calculate the highest common factor of 1 and l. 1 Let v be (3 + -1 - 3) + -1. Let w be (3/v)/((-4)/16). Calculate the highest common divisor of w and 15. 3 Suppose 0 = -4l + 3l + 7. Let w be (1 - 1) + l - 2. Calculate the greatest common factor of 10 and w. 5 Let l(c) = -6c3 - c2 + 4c. Let d be l(-2). Calculate the highest common divisor of d and 54. 18 Let w = 7 - 4. Suppose 0 = wo - 188 - 148. Suppose 2c + 5b - 66 = -14, 0 = -2c + 2b + 24. Calculate the greatest common divisor of o and c. 16 Suppose 0 = o + 15 - 80. Suppose 39 - 117 = -3x. Calculate the highest common divisor of x and o. 13 Suppose -2j + 279 = c, 3j - 100 = 2c - 672. Suppose 4n - c = -4u - u, -4u = 4. Calculate the greatest common factor of n and 8. 8 Suppose -5t + 3f + 77 = f, -2t - 4f = -26. Suppose -52 = 4d - 3c, -5c = d - 4 - 6. Let l be 15/(-4)2d. Calculate the greatest common factor of t and l. 15 Let b be (-2)/1-9 - 0. Let u(m) = m*2 - 2m - 1. Let g be u(-1). What is the greatest common divisor of b and g? 2 Let t be (-7)/(21/9) + 27. Calculate the highest common factor of t and 3. 3 Let s be 1/(-1)3-3. Let a = s + -7. Calculate the highest common divisor of a and 1. 1 Let x = -23 - -27. Suppose -3l - 2s = -41, -16 = -2l + xs + 6. Calculate the highest common factor of 91 and l. 13 Let y(f) = -3f3 - 3f*2. Let h be (-1)/1-1-2. Let d be y(h). Let v be 34 + ((-2)/(-5))/(16/(-160)). What is the greatest common factor of v and d? 6 Let w(s) = s2 + s - 6. Let h be w(0). Let p be 2/h + (-3)/(-9). Let x = p + 8. What is the greatest common divisor of x and 64? 8 Let t(v) = v2 + v. Let p be t(-4). Suppose -y - 38 = -5h + p, -3h - y + 30 = 0. What is the greatest common divisor of 10 and h? 10 Suppose 4i - 5 = -3b, -5 = i - b - 1. Let y be ((-8)/i)/((-1)/(-6)). Calculate the highest common factor of y and 6. 6 Suppose -5c + 21 = 2s - 13, -4c + 17 = s. Calculate the greatest common divisor of 34 and s. 17 Let c = -18 - -34. Let l = -5 - -7. Suppose lw + 0 = c. Calculate the highest common factor of 40 and w. 8 Let o = -101 - -125. What is the highest common factor of 120 and o? 24 Let g = 22 + 20. Calculate the highest common divisor of 6 and g. 6 Let h = 470 + -295. Suppose 0 = 3x - 2*r - h, 0	{ "pile_set_name": "DM Mathematics" }
89. What is the tens digit of i? 7 Let n be (-328)/(-18) + (-8)/36. Let l be 90/21 + (-4)/14. Let u = n - l. What is the tens digit of u? 1 Suppose 3t + v = 101, 3t - 37 = 2v + 49. Suppose 0 = u + 2, 3g + 3u = g + 2. Suppose t = 3i - 4n, -n = gi - 4 - 7. What is the units digit of i? 4 Let l(o) be the second derivative of o4/6 - o3/3 - 3o2 - 5o. What is the units digit of l(6)? 4 Suppose 0 = -2w + 4 + 8. Suppose -2o + w = o. What is the units digit of (-3)/(-6) + 15/o? 8 Let s(n) = 2n - 3. Let h be 0/8 + 2 + 0. Suppose -5f + 22 = -f + hl, -5f + 22 = -3l. What is the units digit of s(f)? 7 Suppose 774 = -4d + 10d. What is the hundreds digit of d? 1 Suppose 3p + 1 = -2. Let l(d) = -11d3 + d2 + 2d + 1. What is the tens digit of l(p)? 1 What is the hundreds digit of ((2 - -1) + 62)2? 1 Suppose 0 = -3y - 5j + 57, -4y + 3y + 5j = -39. Suppose 3w + y = -3r + 69, -5 = 5w. What is the units digit of r? 6 Suppose 270 = -0p + 3p. What is the tens digit of p? 9 Let w be (-55)/(-3 - (-1 - 1)). Suppose 5k - 2g = 92, -g - w = -2k - k. What is the units digit of k? 8 Let h = 8 + 32. Suppose 0 = -2z + 5t - h + 114, -z + 51 = t. What is the tens digit of z? 4 Suppose -3j + 28 = 1. Suppose 0 + j = i. What is the units digit of i? 9 Let d(x) = -x + 5. Let g be d(0). Suppose gt = -3n + 47, 3n - n + t = 36. What is the units digit of n? 9 Suppose -n = -3n - 4. What is the units digit of -2 - n/446? 1 Suppose 4b + b - 4p - 180 = 0, -5p + 71 = 3b. What is the tens digit of b? 3 Suppose p = -4t + 18, 0p - 33 = -p + t. What is the tens digit of p? 3 What is the units digit of (-3 - -6 - 2) + 11? 2 Let m = 134 + -8. What is the tens digit of m? 2 Let j = 58 + -38. Let g = 11 - 6. Suppose j = go - 5. What is the units digit of o? 5 Let k(b) = -b3 - 9b*2 + 4b - 13. What is the tens digit of k(-10)? 4 Suppose -4b + 0b + 96 = 0. Suppose -j + 27 = 4l, -j + b = -0j + 3l. What is the tens digit of j? 1 Let v = -4 + 24. Let n be 179/5 + (-3)/(-15). Let z = n - v. What is the tens digit of z? 1 Let h = -8 - -17. What is the units digit of h? 9 Let z(q) = q3 - q2 + 1. Let h = 11 - 9. What is the units digit of z(h)? 5 Let t be 7/(-1) + (-14)/7. Let c = t - -35. What is the units digit of c? 6 Let y(g) = 3g - 9. Let t be y(10). Let m = t - -13. What is the tens digit of m? 3 Let u(h) = -h*3 + 13h*2 - 15h + 44. What is the units digit of u(10)? 4 Suppose -x = 3x - 28. Let h = -4 + x. What is the units digit of h? 3 Let g = 5 - 13. Let j(s) = s3 + 7s*2 - 10s + 10. What is the tens digit of j(g)? 2 Suppose 3v = -2v + 65. Suppose -4t + 45 = v. What is the units digit of t? 8 Suppose 2i = i + 8. What is the units digit of 2/(-8) + 266/i? 3 Let j be 87/(-6)(-2 - 0). Suppose 3k - j = 3x - 5, -x + 57 = 4k. Suppose -5b + k = -2. What is the units digit of b? 3 Suppose 2y - 21 = -a + 12, 2y + 3a = 27. What is the tens digit of y? 1 Suppose 4g - 8 = -0g. Suppose 4p - 3z = 120, gp + z = p + 23. What is the tens digit of p? 2 Let x = 97 - 87. What is the tens digit of x? 1 Let c = 0 - -1. What is the units digit of 6c + 8/(-4)? 4 Let g(x) = -3x + 2. Let v be g(-3). Suppose 7t = vt. Suppose 3m + 24 = 3r, -5m + 5 + 5 = t. What is the units digit of r? 0 Let m(o) = o*3 - 8o*2 - 3o + 2. Let k(d) = 6d3 - 41d*2 - 14d + 10. Let p(x) = 2k(x) - 11m(x). What is the units digit of p(-4)? 0 Suppose 2z - 566 = -2x, 0 = 4x - 2x + 4z - 568. What is the hundreds digit of x? 2 Suppose 11r - 7r + 607 = 5t, 3t = -2r + 351. What is the units digit of t? 9 Suppose 0 = 5p - 13 - 37. What is the units digit of 4/p - 174/(-15)? 2 Let x be (5 + -4)(0 - -2). Let h(r) = r*2 + 6r + 6. Let d be h(-8). Suppose 10 = xq - d. What is the tens digit of q? 1 What is the units digit of 1/(-6)-3472? 6 Let n(k) = -k2 + 10k + 6. What is the units digit of n(9)? 5 Suppose -d = -2d - 6. Let g be (0 - 3)/(2/d). Let r = 0 + g. What is the units digit of r? 9 What is the units digit of (0 - 3) + -6 + 14? 5 What is the units digit of ((-3)/((-18)/4))/((-4)/(-138))? 3 Let a(g) = -2g - 12. Suppose -s = -1, -s + 14 = -b + 4s. What is the units digit of a(b)? 6 Let y = 43 + -39. Let t = -7 - 8. What is the units digit of 1/4 - t/y? 4 Suppose t - 266 = -4g, 3g = -8t + 5t + 816. What is the hundreds digit of t? 2 Let i(y) be the third derivative of -y4/24 - y3/3 + y2. Let h(m) = m + 4. Let n be h(-8). What is the units digit of i(n)? 2 Let x be 6/9 + (-13)/(-3). Suppose xt - 47 = 13. What is the tens digit of t? 1 Suppose 4y = 4d - 28 + 4, 0 = -2d - 2y - 8. Suppose 3f - d - 11 = 0. Suppose 4o - fc - 36 = 0, -3c + 2c - 16 = -2o. What is the units digit of o? 7 Suppose 0 = -g + 6g - 3a - 282, 4g - 5a - 236 = 0. What is the tens digit of g? 5 Let l = 15 - 5. Suppose u + m + 3m = -l, -4u - m = -20. What is the units digit of u? 6 Let k be (1 - -1)/(-2 + 0). Let r(q) = -6q3 - q - 1. What is the units digit of r(k)? 6 Suppose d - 5 + 1 = 0. Let j(g) = -g3 + 4g*2 + 7g - 7. Let w be j(5). Suppose -wq = f + f - 15, 4f - dq = 20. What is the units digit of f? 6 Let k(j) = 4j + 8j + 8j. Suppose 0r = -o + 2r + 9, 4o = 3r + 16. What is the units digit of k(o)? 0 Let b = -48 + 98. Suppose -2m + b = 3m. What is the units digit of m? 0 Suppose 8i = 7i + 2. Suppose -5g + 80 = if + 3f, 110 = 5g - 5f. What is the units digit of g? 9 Suppose 4r = -0r. Suppose 3j - 2j - 4c = 83, r = -5j + 4c + 351. Suppose -16 + j = 3o. What is the tens digit of o? 1 Let v be (-3)/(2/(2 - -10)). Let w = v - -38. What is the tens digit of w? 2 Suppose -12h - 240 = -1224. What is the tens digit of h? 8 Let j = 220 + -150. Let f = j + -34. What is the units digit of f? 6 Let y(g) = 6g3 - g2 - 3g + 2. What is the tens digit of y(2)? 4 What is the units digit of (-3)/2 + (-338)/(-4)? 3 Suppose 0 = q - 5, -3m = -5q + 3q - 2. Let i = 5 - 23. What is the units digit of m/18 - 32/i? 2 What is the hundreds digit of (-12614)/(-98) - (-2)/7? 1 Let r = 5 - -6. What is the units digit of r - -1 - (-6)/3? 4 Suppose 2i + 2c = -3i + 158, 4c = i - 36. What is the units digit of i? 2 Let c(g) = g3 + 7g*2 - 8g + 6. What is the units digit of c(-8)? 6 Let w = -6 - -1. Let v = w + 1. Let s(b) = -3b - 4. What is the units digit of s(v)? 8 Let x(m) = -m3 + m2 - 4m + 6. What is the tens digit of x(-3)? 5 Let a(d) = 18d2 + d. Suppose 0h = 2h - 2. What is the tens digit of a(h)? 1 Let m(h) = h + 1. Let u(d) = -7d - 16. Let g(l) = -6m(l) - u(l). Let f(w) = -w2 - 7w - 6. Let s be f(-6). What is the tens digit of g(s)? 1 Suppose -4s = 3l + 7, 4l - 17 = 5s + 15. Suppose -5v = -v - 2d + 18, -ld = v + 15. What is the units digit of 4 - 1/((-3)/v)? 2 Let p(s) be the first derivative of -s4/4 + 4s*3/3 - 3s*2/2 + 3s - 2. What is the units digit of p(3)? 3 Let i(a) = -a2 - a - 1. Let d(n) = -n3 + 4n2 + 5n - 5. Let g(o) = -d(o) - 4i(o). Let m be g(0). What is the units digit of (0 + 24/m)3? 8 Let h be (-2 + 6)/(-3 - -1). Let r(v) = -11v - 3. What is the tens digit of r(h)? 1 Let i be ((-12)/14)/(4/(-112)). Suppose 2o - i = -t, t = -o - 3t + 19. What is the tens digit of o? 1 Suppose -8a = -3a. Let k(d) = d2 - d - 5. Let n be k(4). Suppose j = -aj + n. What is the units digit of j? 7 Let g = 22 - 15. Let b = 16 - g. What is the units digit of b? 9 Let q = -8 + 12. Suppose -qm = -21 - 3. What is the units digit of m? 6 Let v(y) = 3 - 6 + 5y + y*3 + 1. What is the units digit of v(3)? 0 Let r(j) = 10j + 9. Let l(h) = -15h - 13. Let k(c) = -5l(c) - 7r(c). What is the tens digit of k(4)? 2 Suppose -4n = o - 363 + 119, 2o + n = 509. What is the hundreds digit of o? 2 Suppose -9n = -1719 + 108. What is the tens digit of n? 7 Let n(i) = -i*3 - 3i*2 - i - 3. Let w be n(-3). Suppose -4v = -2k - 54, wv - 3v = k - 48. Let u = v - 10. What is the units digit of u? 5 Let x(d) = 49d + 1. What is the units digit of x(2)? 9 Suppose -557 = -8k + 835. What is the tens digit of k? 7 Let g(y) = y2 - y. Let p be g(1). Suppose 3t + 4x - 21 = 0, 0t + 4t - x - 28 = p. What is the units digit of t? 7 Suppose 5l - 16 = -3z + 13, 4 = 4l - 4*z.	{ "pile_set_name": "DM Mathematics" }
f(a)). -8a Let s(v) = 46v. Let k(c) = -3c2. Calculate k(s(h)). -6348h*2 Let y(u) be the first derivative of 17u3/3 + 4. Let d(g) = g2. What is d(y(q))? 289q4 Let d(k) = k - 4k + 11k - 5k. Let o(r) = -6r2. Give d(o(z)). -18z*2 Let y(n) = n. Let h = -45 + 45. Let u(s) be the third derivative of 2s*2 + 0 + 1/24s*4 + hs + 0s3. What is y(u(l))? l Let w(b) = b. Let y(t) = -4t*2 + 4t - 119. What is w(y(f))? -4f2 + 4f - 119 Let d(w) = -2w + 6. Let v(p) = p - 5. Let s(q) = 5d(q) + 6v(q). Let o(x) = 2x*2. Give s(o(b)). -8b*2 Let k(m) = -m - 98. Let f(u) = -11u*2. What is k(f(r))? 11r*2 - 98 Let r(s) = -26s. Let v(p) = 2p + 409. Calculate v(r(b)). -52b + 409 Let h(s) = -2s2 - s + s. Let d(x) = 434x - 436x + 0 + 0. Determine d(h(p)). 4p*2 Let g(p) = p + 1. Suppose n + 2n - 40 = -5f, 4f + 32 = 4n. Let d(z) = 15z + 10. Let k(s) = ng(s) - d(s). Let i(l) = 0l + 0l + l. Determine i(k(j)). -5j Let f(u) be the first derivative of 0u + 0u*2 - 2/3u*3 + 4. Let s(a) = -12a. Determine f(s(x)). -288x2 Let k(j) = -4j*2. Let x(i) = -115i*2. Give x(k(h)). -1840h*4 Let y(l) = 3l + 4 - 5 + 1. Let p(o) = -7o + 6. Let b(s) = -s + 1. Let h(d) = 6b(d) - p(d). Give h(y(q)). 3q Let x(t) = t3 + 3t*2 - 2t. Let y be x(-2). Suppose -5k + y = -2. Let q(f) = f2 + 3f*2 - kf*2 - 3f2. Let l(i) = i2. What is l(q(n))? n*4 Suppose 0 = -2t - 3q + 18, 6t = 3t + 5q - 11. Let s(f) be the second derivative of 3f + 0 + 0f*2 - 1/2f*t. Let u(y) = y. Give u(s(v)). -3v Suppose 5j = -0j + 2z + 8, -j - 2 = -4z. Suppose l + 1 = j. Let c(w) = -27w + l + 30w - 1. Let t(h) = -4h2. What is t(c(i))? -36i*2 Let f(d) = d. Let s(z) = 2z. Let v(w) = 4f(w) + 5s(w). Let x(b) = 5b - 3b - b. What is v(x(r))? 14r Let p(m) = m. Let s(c) = c. Let b(q) = 5p(q) - 4s(q). Let g(k) be the second derivative of -k4/6 + k. What is g(b(h))? -2h*2 Let o(u) = -2007u - 2. Let l(j) = 3j. Give o(l(h)). -6021h - 2 Let x(y) = -7y + 3. Let a(t) = -8t + 4. Let r(i) = -3a(i) + 4x(i). Let j(v) be the second derivative of -v*3/6 - 4v. What is j(r(g))? 4g Let o(s) = -s. Let p(g) = 4g. Let x(f) = -14o(f) - 4p(f). Suppose 3n + 0n = 3. Let b(m) = n - 4m - 1. Calculate x(b(a)). 8a Let w(z) = -4z - z + 8 - 11. Let t(c) = -2c*2. What is w(t(d))? 10d*2 - 3 Let q(b) = -3b + 8. Let u(y) = 11y. What is q(u(r))? -33r + 8 Let o(b) = 2b - 2b + 2b. Let y(k) = -k2. Determine y(o(p)). -4p2 Let z(t) = t2. Let v(o) = 3o - 5 + 3 + 2. Give v(z(l)). 3l2 Let l(s) be the third derivative of s4/12 - 2s2. Let v(x) be the second derivative of 2x*3/3 + 10x. Calculate v(l(o)). 8o Let x(q) = 2q*2 - 6q + 7. Let j be x(2). Let t(l) be the third derivative of 0l3 - jl*2 + 0 + 0l - 1/24l4. Let k(n) = 5n. Give t(k(h)). -5h Suppose 0 = -j + 6j - 35. Let i = j - 3. Let b(p) = 4 - p - i. Let r(s) = -4s. Give b(r(o)). 4o Let f(q) be the third derivative of 0q + 0 + 0q*3 + 1/24q*4 + 2q*2. Let v(l) = 3l + 9 - 9. What is f(v(b))? 3b Let u(n) = -2n. Let i(q) be the second derivative of q7/2520 - q4/3 - 3q. Let l(f) be the third derivative of i(f). What is l(u(h))? 4h2 Let t(u) = u2 + u. Let c(r) = -4r2. Give c(t(l)). -4l*4 - 8l*3 - 4l*2 Let y(f) = 2f. Let p(m) be the first derivative of 7/24m4 + 0m - 3/2m2 + 0m*3 - 4. Let s(t) be the second derivative of p(t). Give s(y(d)). 14d Let a(z) = z*2 + 3z*2 - 6z*2. Let y(b) be the first derivative of 3/2b*2 + 0b - 1. Calculate y(a(n)). -6n2 Let h(a) = 2a*2 - 117a. Let r(j) = -56j. What is r(h(z))? -112z*2 + 6552z Let b(v) = -14v - 4. Let j(x) = -110x - 33. Let h(w) = -33b(w) + 4j(w). Let l(t) = -4t. What is h(l(f))? -88f Suppose d + 5l - 9 = 4d, 3l = -3d + 15. Let s(a) = 6a - 2a - da. Let i(v) = -11 - 8v + 11. Determine i(s(p)). -16p Let g(y) = 3y - 3y - y2. Let f(b) be the third derivative of -b5/10 - 19b*2. What is f(g(z))? -6z*4 Let h(z) = -3z*2. Let m(l) = -300l. What is h(m(g))? -270000g2 Let z be 7 + (0/(-3) - 1). Let s(x) = -zx*2 - 3x*2 + 8x*2. Let u(v) = -4v*2. Calculate s(u(i)). -16i*4 Let a(s) = -3s. Suppose 0 = -7v + 4v. Let g(c) = 4c - 2c - 3c + vc. Determine a(g(d)). 3d Let p(l) = -2l. Let o(n) = n*3 + 11n*2 - 10n - 9. Let r be o(-12). Let u(y) = -3y + 2. Let g(i) = 16i - 11. Let d(b) = ru(b) - 6g(b). Give d(p(q)). -6q Let o(k) = -18k2. Let v(p) be the second derivative of -p3/2 - 34p. Calculate o(v(h)). -162h2 Let n(h) be the third derivative of h6/360 + h3/6 + h2. Let y(v) be the first derivative of n(v). Let g(z) = -4z + 3z - 5z. Determine y(g(q)). 36q*2 Let v(s) = s. Let g(k) = 225k*2. Let h(z) = 7z*2. Let p(d) = 6g(d) - 195h(d). Give v(p(x)). -15x*2 Let i(b) = 2b*2. Let z(s) = 188s. What is i(z(f))? 70688f2 Let r(t) = 7t. Let o(i) = -5i2 - 4i. Calculate o(r(n)). -245n2 - 28n Let m(u) = u. Let k(f) = -2f. Calculate m(k(o)). -2o Let r(a) = -a*2 - 2a + 2. Let y be r(0). Let s(k) be the first derivative of -2 + 0ky + 0k + 2/3k3. Let o(g) = g. Determine s(o(p)). 2p*2 Let f(y) = 3y - 6. Let x(n) = -7 + 13n - 30n + 14 + 14n. Let t be 112/(-12). Let w(c) = tx(c) - 7f(c). Let i(s) = 2s*2. Determine i(w(k)). 18k*2 Let w(u) = u. Let j(x) = 176x - 6. What is w(j(t))? 176t - 6 Let m be 3/(-9) + 2/6. Let u(f) = 3f + 0f - 2f + mf. Let j(d) = 0 + 0 + d. Calculate u(j(l)). l Let m(k) = 5k. Let a(c) = -30c + 35. Let n(p) = -p + 1. Let l(r) = 2a(r) - 70n(r). Let u(x) = -3l(x) + 5m(x). Let w(b) = b. Give u(w(z)). -5z Let p be -5(0 + -1) - 5. Let m(r) be the second derivative of 0r*2 + pr*3 - 3r + 1/4r4 + 0. Let f(h) = -h. Determine f(m(c)). -3c*2 Let o(i) = -7i. Suppose -4p - 40 = -4. Let c(x) = 17x*2. Let v(u) = 4u*2. Let g(t) = pv(t) + 2c(t). Determine o(g(m)). 14m*2 Let u(a) = -6a - 5. Let j(g) = -g. Let k(c) = -1. Let h(t) = 7j(t) + 6k(t). Let z(x) = -5h(x) + 6u(x). Let f(l) = -2l. Determine f(z(v)). 2v Let p(x) = -375x2. Let h(l) = -2l*2. What is p(h(k))? -1500k*4 Let h(w) = -17w. Let q(t) = 409t. Determine q(h(k)). -6953k Let w(t) = -7t. Let o(y) = 6y*2 + 2y - 2. Let s(j) = -19j2 - 7j + 7. Let h(m) = -7o(m) - 2s(m). What is w(h(v))? 28v2 Let m(u) = -u2. Let f(d) = d3 - 5d*2 + d - 2. Let s be f(5). Let i(h) = -7h2 + h2 + 4h2 + sh2. Calculate i(m(n)). n4 Let w(j) be the first derivative of -17j2/2 - 6. Let p(c) = 2c*2. Determine w(p(x)). -34x*2 Let h(c) = 2c*2. Let d(q) = -3682q. Give d(h(x)). -7364x2 Let x(y) = -2y. Let q(j) = 122j + 5. Let h(m) = 1160m + 48. Let v(o) = -5h(o) + 48q(o). Calculate x(v(t)). -112t Let a(u) = 33u*2 + 4u. Let z(r) = r*2. Calculate z(a(s)). 1089s*4 + 264s*3 + 16s*2 Let y(t) = 2t*2. Let p(o) be the second derivative of -7o*4/12 - 46o. Give p(y(c)). -28c4 Let x(o) = 3o. Let i(t) = 637t2. Give i(x(q)). 5733q*2 Let p(z) = -7z. Let w(q) = 21q - 22. Let k(y) = -4y + 4. Let b(n) = -11k(n) - 2w(n). Calculate p(b(c)). -14c Let g(u) = -10u*2. Let a(l) = l - 5. Let r(s) = s - 6. Let w(i) = -6a(i) + 5r(i). Give w(g(q)). 10q2 Let g(v) be the second derivative of v4/2 - 2v. Let f(j) = -6j. Let d(s) = 0s - 2s + 0s. Let k(q) = 17d(q) - 6f(q). Determine g(k(l)). 24l*2 Let u = 5 + -1. Let l(h) = h - uh + 2h. Let z(y) = 2y*2. Give l(z(a)). -2a*2 Let i(o) = 4o2. Let w(l) be the third derivative of l4/8 - 6l2. Calculate i(w(z)). 36z*2 Let r(n) = -2n*2. Let v(d) be the first derivative of 10d*3/3 + 11. Determine v(r(t)). 40t*4 Let j(o) = 5o*2. Let f(t) = -3t*2 - 3 - 4 + 7. Give j(f(s)). 45s*4 Let f(m) = -3m*2. Let s(w) = -59 + 2w + 120 - 68. Determine f(s(o)). -12o2 + 84o - 147 Let p(x) = -10x2 + 16x. Let t(z) = 2z2 - 3z. Let v(a) = -3p(a) - 16t(a). Let y(n) = 2n2. Determine y(v(g)). 8g*4 Let o(r) = 3r. Let y(v) = 11v2 - 9v. Determine y(o(h)). 99h2 - 27h Let y(r) be the first derivative of -2 - 2r2 - 1/10r*5 + 0r*3 + 0r*4 + 0r. Let p(u) be the second derivative of y(u). Let l(h) = h. Determine p(l(d)). -6d2 Let r(n) = 2n**2.	{ "pile_set_name": "DM Mathematics" }
- -36. Is 16 a factor of r? True Let u be (-4)/(12/5)-3. Let l = u - 0. Is 2 a factor of l? False Let v = 1 + 5. Does 3 divide v? True Let f be 18 + (0 - 0). Suppose -24p + 22p = 0. Suppose 5v - 4i - 59 - 26 = p, -i + f = v. Is 12 a factor of v? False Let t(y) = -3 + 5y + y2 - 4y - y. Suppose a - 2 - 1 = 0, -2z - 2a = 4. Is 22 a factor of t(z)? True Suppose 40 = -3q - q. Let p = 6 - q. Suppose r - 3k = 35 - 2, -2r = 4k - p. Is r a multiple of 13? False Suppose 3g + 7 - 1 = -2o, -3o + g = -13. Let f(a) = a2 + a - 3. Is 9 a factor of f(o)? True Suppose -3d = -6, -v - 5d + 14 = -0d. Let o = 29 + -38. Does 8 divide o/(-6) + 38/v? False Let h(p) be the second derivative of -p5/10 - p4/4 - p*3/3 - 3p*2/2 + p. Let k be h(-2). Does 3 divide (1 + 1)(k + -1)? False Is 8/(3/(241)) a multiple of 19? False Let n(t) = -t3 + 5t*2 + 12t - 1. Is n(6) a multiple of 7? True Suppose 23 = a + 3n, 2a + 2n = 4a - 62. Is a a multiple of 13? False Let z = -2 + 17. Is z a multiple of 3? True Suppose -3 = -3x + 6. Suppose 0 = -xl + 6. Suppose -3 = lh - 71. Is 18 a factor of h? False Let w(a) = 7a*2 + 1. Is 16 a factor of w(3)? True Suppose 3n - n - 18 = -5p, 4p = 5n - 12. Let a = p + 6. Is 4 a factor of a? True Suppose -m + 0m = -x + 5, -4x - 5m = -29. Suppose xd - 4d = 6. Suppose -di = -33 + 3. Is 3 a factor of i? False Suppose 8 = o + 2. Suppose h + 30 = o. Does 2 divide 2/(-5) + h/(-10)? True Let u(i) = 2i*2 - 4i - 14. Is 28 a factor of u(7)? True Let c(o) = o*3 + 9o*2 - 3o - 6. Let m be c(-4). Let g = m + -35. Does 13 divide g? False Let d = -189 - -324. Is d a multiple of 27? True Let h be 2/(-6) + (-5)/(-15). Suppose -5o + 0k + 4k + 134 = h, -4k + 22 = o. Is o a multiple of 13? True Suppose 16 = -24g + 26g. Is 4 a factor of g? True Suppose 0p + 15 = p - 3a, -3p + 3a + 15 = 0. Suppose d + pd = 3m - 131, 2m = -d + 84. Does 23 divide m? False Suppose 4j = -5q + 45, 3q + 5j - 2j - 30 = 0. Suppose 3h + 38 = qh. Suppose -h = -z - s, 39 = z - s - 2s. Does 12 divide z? True Let g = 91 + -3. Suppose -2m + g = 2p, -2p - 42 = -m - p. Is 20 a factor of m? False Let y(o) be the third derivative of o5/60 + o3/3 + o*2. Let k be y(3). Suppose -w + k = -0w. Does 11 divide w? True Let t = 205 + -111. Does 12 divide t? False Suppose 0 = 8z - 2z - 894. Is z a multiple of 10? False Let g = -23 + 26. Suppose l + f + 276 = 0, 3l - 6f + f + 796 = 0. Is l/(-12) + g/9 a multiple of 10? False Suppose -4a = 2z - 10, -2a - 3 = -3z - 4. Let t be 501/18 + a/12. Let v = t - -8. Is v a multiple of 12? True Let f = 73 + -37. Is 4 a factor of f? True Is 13 a factor of (-1)/((-9)/2) - (-1060)/9? False Let z(i) = -i*3 + 8i*2 - 4i - 7. Let s be (-2 - 1) + 4 - -5. Is z(s) a multiple of 17? False Let k(g) = 25g2 + 2g + 6. Is k(-2) a multiple of 34? True Let b = -49 - -209. Does 20 divide b? True Let k(b) = 39b2 + 2b - 1. Is k(2) a multiple of 53? True Let n = -10 - -7. Suppose -5g + 3g = 0. Let p = g - n. Does 2 divide p? False Let q = -23 - -128. Is q/2 + (-6)/12 a multiple of 20? False Let a(l) = -l + 12. Is a(-7) a multiple of 11? False Let w = 45 + -5. Is w a multiple of 25? False Does 33 divide -3(-4 + 5) + 326? False Let t be 1/6 + 946/12. Suppose 0 = 5u - 4f - 15 - 128, 0 = -3u - f + t. Is 13 a factor of u? False Suppose -w - 3w = 0. Let q be (15/(-6))/((-2)/60). Suppose 0v = -4l - v + 51, 5l + 5v - q = w. Does 6 divide l? True Let q = -3 - -23. Does 2 divide q? True Let x = -80 + -2. Let z = 164 - x. Does 13 divide z/9 - (-3)/(-9)? False Let n = 0 + 31. Is (-3 - -5 - 1) + n a multiple of 16? True Suppose 0 = 27m - 25m - 160. Is 13 a factor of m? False Suppose 6u - 286 = 62. Is 31 a factor of u? False Suppose -5d = -64 - 111. Let q = 62 - d. Does 9 divide q? True Let b = -175 + 179. Does 4 divide b? True Let u(k) = -k3 - 4k*2 - k. Let o be u(-4). Suppose 0n + 40 = 4n. Let i = n + o. Is 14 a factor of i? True Suppose 5i - 600 = -i. Is i a multiple of 20? True Let p(q) = -18q2 - 7q - 4. Let y(h) = -9h2 - 4h - 2. Let c(m) = -6p(m) + 11y(m). Is c(2) a multiple of 17? True Suppose -15 = 3p, p = 5i - 65 - 10. Is i a multiple of 10? False Let s(i) = -5i2 + 4i - 9. Let g(j) = -9j2 + 8j - 17. Let t(w) = 6g(w) - 11s(w). Let f be ((-1)/2)/(3/36). Does 9 divide t(f)? True Suppose -d = 31 - 85. Does 25 divide d? False Suppose 4w + 8 = 0, 0 = 2q + 2q + 3w - 18. Suppose q = -14p + 15p. Is p a multiple of 3? True Let y = 41 + -31. Does 10 divide y? True Suppose -4d + 153 - 65 = 0. Is 11 a factor of d? True Let r(t) = -t3 - 4t*2 + t + 4. Does 8 divide r(-5)? True Let n(v) = -247v2 - v. Let z be n(1). Is 6 a factor of 16/24 - z/6? True Let x = 41 + -10. Does 8 divide x? False Let g = -130 + 183. Is g a multiple of 18? False Let o = 39 - 21. Is 9 a factor of o? True Let k(h) = h3 - 3h2 - 7. Is 11 a factor of k(5)? False Let y = 119 - 11. Is 18 a factor of y? True Let j(p) = 18p*2 - 3p + 3. Is j(3) a multiple of 43? False Suppose 0t + 4t = 24. Is t a multiple of 6? True Let b = 14 + 56. Does 29 divide b? False Is ((-342)/27)/((-2)/3) a multiple of 19? True Suppose -14o + 99 = -13o. Does 13 divide o? False Let h = -109 + 75. Let p = h - -67. Is p a multiple of 14? False Let n(z) = z*2 - 10z - 4. Is n(12) a multiple of 20? True Let a(d) = 15d2 + 10d - 1. Let i(z) = 8z2 + 5z - 1. Let p(b) = 6a(b) - 11i(b). Let y be 504/(-81) + 2/9. Is p(y) a multiple of 19? False Let b(k) = -3k - 8. Let z(d) = -3d - 7. Let s(r) = 4b(r) - 3z(r). Does 12 divide s(-14)? False Let p = 7 + -17. Let q = 10 - p. Is 10 a factor of q? True Let m be 4/(159/(-165) + 1). Suppose y - m = -41. Suppose -j + 5g - 11 = -2j, 0 = 4j - 5g - y. Is 6 a factor of j? False Suppose -3w + 88 = 19. Is w a multiple of 17? False Let r(k) = -4k*2 + 2k3 - k2 + 4 - 5k3 + 4k*3. Let l be r(6). Suppose l = h + h. Does 17 divide h? False Suppose 0x + x - 14 = 0. Suppose 0g + 4f - x = -2g, 5g = 2f + 47. Does 4 divide g? False Let s(v) = -9v - 3. Let j be s(-2). Let t = 1 + j. Is t a multiple of 8? True Does 6 divide 6 - ((-4)/(-4) - 2)? False Let x be -35 - 0/1. Let o = x + 27. Is 6 a factor of o? True Suppose -3q - s + 83 = 0, -4q + 23 = -3q + 5s. Suppose -3f + 46 = -4x, 2f - 3x - q = x. Is f a multiple of 9? True Is (-25)/(10/(-2))13 a multiple of 13? True Let h(z) = -z*2 + 1 - 3z*3 + 1 - 2z - 3. Let u be h(-1). Let b(f) = f*3 - 2f - 2. Does 19 divide b(u)? True Let p = 75 - 20. Is p a multiple of 5? True Let p = 162 + -43. Let l = -70 + p. Is l a multiple of 20? False Suppose -4y + 2y = 0. Let n(b) = b + 16. Is 16 a factor of n(y)? True Suppose 8v - 15 = 3v. Suppose -vn = -2f, 0n - 4f = -2n - 8. Suppose nq - 51 - 9 = 0. Is q a multiple of 15? True Is ((-192)/20)/(-8)(-2670)/(-9) a multiple of 36? False Suppose -12 = -3b, -t + 5b = b + 9. Let u = t + -4. Suppose 4v - 5o - 115 = 0, -uo - 147 = -v - 4v. Does 10 divide v? True Let m(s) = s3 + 7s*2 + 8s + 28. Let z be m(-7). Let l be (40/6)/((-4)/(-30)). Let j = l + z. Is 11 a factor of j? True Let i(v) = -v*2 + 15v + 9. Let n(c) = c*2 - 5c + 9. Let x be n(6). Does 2 divide i(x)? False Suppose 0 = -2a - 4d - 22, 4a + 3d + 54 = 5d. Let r = 7 + a. Is (-3)/r-2-7 a multiple of 7? True Let z(g) = 3g + 4g - 9 + 8 + g. Is z(2) a multiple of 7? False Let a(y) be the third derivative of -y5/60 - 5y4/24 - y3/3 + 2y2. Let d be a(-4). Suppose -2o - o - 3 = -3q, -dq = 4o - 32. Does 4 divide q? False Let t be 1/5 + 18/10. Suppose 3i - ta + 14 = 0, 2a + 4 = -4i + a. Is 11 a factor of (-33)/((-7)/2 - i)? True Let u = -5 + 0. Let c be ((-12)/(-15))/((-2)/u). Suppose 28 = cj - 5b, -j + 1 = -2b - 13. Is j a multiple of 14? True Let h(k) = k*2 + 4k - 57. Is h(-13) a multiple of 4? True Let a = 143 - 106. Is 15 a factor of a? False Suppose h + 2h - 6 = 0. Suppose 132 = 3b - 3f, -6f + 12 = -hf. Is b a multiple of 12? False Let u be (2 + -1)-2 - -2. Suppose 64 = -uw + 4w. Does 8 divide w? True Let j(d) = -28d + 4. Does 15 divide j(-2)? True Let f(m) = m3 + 5m*2 + 2m + 3. Let p be (-1)/(1(-2)/22). Suppose -i = -2, -5z + 4 = 4*i + p.	{ "pile_set_name": "DM Mathematics" }
-2/33)cc/c2)(-1/5) assuming c is positive. c*(-64/165) Simplify (aa0)(-48)/((((a/a*1)/a)/a)/(a/(a/(aa*1))))a*(1/6)/(a/(aaa4))((aaaa(-1))/a)/((a(-1/3)a)/a) assuming a is positive. a(-75/2) Simplify (y/(y(-3/20)/y))/((y(y/y(-2))/yy)/y)((y/(y/(yyy(-38)y)))/y)/(yy(1/46)) assuming y is positive. y(-17421/460) Simplify ((((zzz/(z14z))/z)/z(-2/7))27)16 assuming z is positive. z(-38448/7) Simplify ((k/(k*(-4)kk))/k)/k(-4)k*(-1/3)kk/k(1/2)k7/(k(2/19)k)k/(k/(kk(-5)/k)kkk)k3 assuming k is positive. k(919/114) Simplify (((h/(h/(h/(((h2h)/h)/hh)))h)/hhhh/h(-5))/(h(1/10)/h(-2/15)))/((h/h(4/3))/h(-1/3)h/(hh(-2)/h)h(-2/17)) assuming h is positive. h(1981/510) Simplify (x/(x*12/xx)x(7/2)((xx0x)/x)/(x/(x(-12)/x)))(-2/89) assuming x is positive. x*(41/89) Simplify (tt*7t*(-5)t*2/t(t/t(-2/5))/t)/(t(-8)/(t/(t/(t/(t/(t/t(-5)))))))(-2/3) assuming t is positive. t(-74/15) Simplify (o(3/11)oo/(oo/(oo/(o/o*(-2/9)o))o))/(o(1/2)/o)(-41)(o/(oo(-2)oo)o)*(-5/4)o*(-4)o(-1/9)/o assuming o is positive. o(-3671/132) Simplify ((p(-2/23)/((p(-4)/p)/p))/((p*1p)/p3))/(p(3/8)pp*(-2/11)p/p*(-1/4)pp(2/5)) assuming p is positive. p(31067/10120) Simplify ((n/(n/(nn*12)n)n)/n(-2/33))(-38)/(nn/(nn(2/7)nn)n(3/7)/n)27 assuming n is positive. n(-103063/231) Simplify (((y(-42)yy)/y)/y)/yy(-5/16)y*(-44)/(y/(y/((yy/(y(y/y(-1/21))/y)y)/y))) assuming y is positive. y(-29657/336) Simplify (c(-1/11)c(-7/3))/(c(1/10)/c4)(c*(-1/5)c)*(2/89)(c*(-2)/cccc)(-6/13) assuming c is positive. c(43871/29370) Simplify ((((rr(-1/2))/(r(-2)/r))/((r/((r(-5)/r)/rr))/(r(rrr0r)/r)))(-2/43))(-44/3) assuming r is positive. r*(-44/129) Simplify ((kk/((k/(k*(1/3)k))/k))*(-33)(k*(16/3)/k)/kk/(kk(-7)/k))(-1/5) assuming k is positive. k(296/15) Simplify (k6k/k*1(kk/(k1kk))(-36))/(((k/k(-2/15))/k)/k(-4)k*(-5/6)k0) assuming k is positive. k(387/10) Simplify (((k*8(k*(-7/3)k)/k)37)30)39 assuming k is positive. k245310 Simplify (((bb(b/b6)/b)/b0)/(b/(b*1/bbb))(-17/3))/((bb/b0)3/(bb(-1/5)b(-1))) assuming b is positive. b(-238/15) Simplify ((d(-1/2))(23/4)/(d(-1))(13/6))/((dd(-2)d)(-1/69))(-35) assuming d is positive. d(-17/24) Simplify (((u/((u/u(-4))/u))/(u*11/uu))/(u8)(-19))38 assuming u is positive. u5244 Simplify ((q/((qq/(q/(q/(qq*(11/2)qqqq))))/q)q/((qqq(13/3))/q))/(q4qq(9/5)))(11/7) assuming q is positive. q*(-209/210) Simplify (((dd*21)/dd(d/d(-3/5))/d)/(d(-6))28)(-11/8) assuming d is positive. d(-10483/40) Simplify ((p/(pp*(-3/5)ppppp))(-1/2))(-21)/(p16/p(4/7))(-4/17) assuming p is positive. p(-25329/595) Simplify ((z(-6/23)/z)/(z/(z/((z/(z/(z(-3/7)z))z)/z)z)zz))/(z41zz6/z) assuming z is positive. z(-8023/161) Simplify ((o(-1)/o)/o(2/9)(((ooo/(((oo(-2/3))/o)/oo)o)/o)/oo)*40)/((oooo0)8/(oo/(o0/o)o)(-47)) assuming o is positive. o(-608/9) Simplify ((((x(1/6))(-12/13))(-44))(-14))(-27) assuming x is positive. x(33264/13) Simplify ((f*(-4/13)f*(-1/7))/((f(f/(f/(ff(12/11))))/ff)/f(f/(f(f/(ff8f))/ffff))/f))(-13/4) assuming f is positive. f(4275/154) Simplify ((c(9/2)/(c/c3)c(-3/5)/c(-4/11))32)(4/17) assuming c is positive. c(44096/935) Simplify ((w/w19w)/w(-13)(w(6/11))(-50))40 assuming w is positive. w(-13760/11) Simplify (v/v*7v*(-1/2)v(v/(v/(v(-5)vvv)))34)(9/5) assuming v is positive. v(-1323/10) Simplify (((v(-4)v)/(vvv/(v4/v)))/(v(2/7))(18/7))/((vv(2/21))/v(1/4)v2v*(-4)v) assuming v is positive. v(-2105/588) Simplify (((s2/ss/(s/s(6/5)))/(s(-1/4)s(-5/3)))26)(-8) assuming s is positive. s(-12844/15) Simplify (l(-5)/l(-8))*(2/17)/((ll/(l*(-2/13)l))/(l/((ll2l)/l)l)l(3/4)/(l/(l(-1/8)ll))) assuming l is positive. l*(-6057/1768) Simplify ((o/(ooo/o(2/13)))(-1/45)(o(-25))(-28))(-9/2) assuming o is positive. o(-204762/65) Simplify ((h*(-4)/(h/(hh*0))(h/(hh(-1/5)))/h(3/7))30)48 assuming h is positive. h(-42624/7) Simplify ((p/p(2/11))(-15))(-2/99)/(p1p/p(1/6))(1/5) assuming p is positive. p(-431/3630) Simplify ((q/(q(-2)q))/(q(-8/7)/qq))*(-44)/((qq/q*4)/(qq3))(-42) assuming q is positive. q(-2732/7) Simplify (s(4/5)/((s(ss*(2/21))/ss)/s))/((ss(1/6))/s(-6))(s*(-3/5)s*(-4)sss)/(ss0)(3/8) assuming s is positive. s(-7927/840) Simplify (z7z)/z*1(z/z(8/11))14 assuming z is positive. z(119/11) Simplify (z(-2/13)/z)/z*(8/5)(z/z16)/z(1/32) assuming z is positive. z(-36993/2080) Simplify ((a/(a2/a)aa*(-1/6)/a(((aaa*(3/7)a)/a)/a)/(a/a(-2/3)))(-11/3))44 assuming a is positive. a(4114/63) Simplify (z(-4)/(((z(2/7)/z)/z)/z))*10(((z/(z*(-3/5)/z))/zzz)/(z/((z/(z(-1/10)/z))/z)z))/(((zz(1/2))/z)/z1) assuming z is positive. z(-338/35) Simplify b0b/(b/(b(b/b(-6))/bb))bbb(-2/11)/(b3b)((bb*2b)/(bbb/(b(1/8)/b)))48 assuming b is positive. b*(130/11) Simplify ((kk*(1/2)kk/k(6/7))/((kk*5k)/k(1/6)))/(k6kkk/(k/k(-10/3)))(-8/7) assuming k is positive. k(8/7) Simplify (i(-33)/i(6/17)i*38i(1/23)/i)29 assuming i is positive. i(41847/391) Simplify (i/(i(-8)/i)i/(i/(ii*(-8)/ii))i/(i/(i/i(2/29)))i/(i*(-1)i))/(i(3/4)/(i(2/9)/ii)i*0/(ii(-2/5))) assuming i is positive. i(26117/5220) Simplify (((ff/(((ff*(-1/4))/f)/f)f)/f*0(f(-1))(-5/3))(-1/26))(-7/6) assuming f is positive. f*(497/1872) Simplify (((((w/((ww*(-7)/w)/w))/www)/ww)/ww(-1/3))/(((w/(w/(w/w(-6)w)))/ww)/w4))/((ww*3/ww)34)(2/75) assuming w is positive. w(26/25) Simplify (k(-1/3)/(k/(k*21/k))k*(-6/11)/kk/k*(5/6)k)(-31) assuming k is positive. k(-37417/66) Simplify ((j/(j*(-4/7)jj))/j21)/((j(2/27)j)/jjj/(j*42j)) assuming j is positive. j(3685/189) Simplify ((b/b(1/7)bbb2)/(b(4/3))43)18 assuming b is positive. b(-6612/7) Simplify ((u/u2)/(uu(-2/13)))45/(u*(-6)/(u(uu(-6)uu)/u)(u(-1/2))11) assuming u is positive. u*(-1939/26) Simplify ((ww*22w)*39/((w/(ww/(w/w*(2/5)w)w))/w(-15)))(5/18) assuming w is positive. w(4607/18) Simplify (((f(4/7)/f)/(f/(f(-1)/f)))/((ff(1/3))/(f(-1/4)f)))/(f/f(2/13)f(1/15))(-2/13) assuming f is positive. f(-91599/23660) Simplify ((i(2/7)/(ii/i11))/((i/(i(-22)i))/i(-7)))(-48) assuming i is positive. i(6624/7) Simplify (s(-27)/s)(-42)/((s(12/11)s)/s)(40/7) assuming s is positive. s(90072/77) Simplify (n/n2n3)/(n/n1)*(-48)(n(-1/4))(-18)/(n(n(3/5)/n)/nnn(-2)) assuming n is positive. n(79/10) Simplify (r/r(2/5)r)*(-4/5)(r*(-3)r)/r*1((rr(-4/3)/rr)/rr(-4/7))/((r(1/4)/r)/(r((r/(rr(-3/2)r))/r)/r)) assuming r is positive. r(-12463/2100) Simplify (x(-2/5)xx)(4/23)/(x7/(x*4/xx))x/(x/(x4/xx))x/x(-6)x/(x/((x/(xxx/x*(2/17)))/x))x0/x assuming x is positive. x(8594/1955) Simplify ((r*36rr(-19))/(r/((r/r(9/5))/r))(-1/9))(-6/7) assuming r is positive. r(-1648/105) Simplify (((ii/i*(4/5)i)/(ii/(ii1)))/(i7i5i))/((ii(-10))/ii/(ii(-4))i)(1/37) assuming i is positive. i(-1973/185) Simplify (g*(-1/4)(g/g(-7))/g)/((g(-2/13)/g)/g*(-3))(g/g1)/g3g6g/g(3/5) assuming g is positive. g(2159/260) Simplify (h(h14/h)/h)(-13/5)/(h(-40)hh/h(3/23)) assuming h is positive. h(498/115) Simplify ((q0)20)(-38)((q(-3))(12/17))(2/29) assuming q is positive. q(-72/493) Simplify ((v/v(-1))/v)3/(((v*(3/2)v)/vv)/(v1v))(vv(-2/7))(-31)/(v/v*6vvv/((vv7)/v)v) assuming v is positive. v(-163/14) Simplify ((v(1/3))(-3/16)/(v0)(-47))/(v1vv/v(-7))23 assuming v is positive. v*(-3681/16) Simplify (((l((ll/(l3/l)l)/l)/l)/l)/(l/((l/l(-3/8))/l)))(-2)/((l**	{ "pile_set_name": "DM Mathematics" }
1) + -4. Let h(c) = 36c + 1. Let i(w) = -37w. Let n(l) = pi(l) - 4h(l). What is the remainder when n(3) is divided by 30? 29 Suppose 0 = -42i + 40i + 26. Let y = 3 + -1. Suppose 0 = yu - 141 + 15. What is the remainder when u is divided by i? 11 Let t be 7/((3/(-33))/1). Let q = -56 - t. Calculate the remainder when 83 is divided by q. 20 Let p = 156 + -91. Calculate the remainder when p is divided by 17/(-2)(10 - 12). 14 Suppose 0x + 2x = -f - 15, 3f = 5x - 56. Let q = f - -20. Calculate the remainder when -1q(3 - 12) is divided by 10. 7 Let w be 4/(-18) - (-76)/18. Suppose -wo + 6 = -6. Suppose 3t = 5t - 4j - 24, 5t - 3j = 53. Calculate the remainder when t is divided by o. 1 Let i = -53 - 26. Let h = -61 - i. What is the remainder when ((-3)/2)/(2/(-68)) is divided by h? 15 Suppose -14 = i - 49. Suppose 3z - 31 = i. Calculate the remainder when z is divided by 12. 10 Suppose 3v + 147 = m, 427 = 12m - 9m - 2v. What is the remainder when m is divided by 21? 15 What is the remainder when 69 is divided by (-2)/(2-1(-5)/(-165))? 3 Let y be 3/(-3)(-4 - 27). Let j = y + -1. Suppose 0 = 2f - t - j, -2f + 4t + 8 + 10 = 0. What is the remainder when f is divided by 9? 8 Suppose -23f - 600 = -4924. What is the remainder when f is divided by 99? 89 Let y = 74 - 73. Calculate the remainder when 8 is divided by y. 0 Suppose 4u = -76c + 75c + 399, u = 3c + 103. What is the remainder when 796 is divided by u? 96 Suppose 6t = 4t, -3f + 3t = -750. Calculate the remainder when f is divided by 52. 42 Let z be ((-96)/40)/((-4)/50). Let b = 4 + z. Let h = 53 - b. Calculate the remainder when 74 is divided by h. 17 Suppose 0 = 3m - 45 - 294. What is the remainder when m is divided by 39? 35 Let d = -2208 - -2307. Suppose 4p - 112 = 4v, -v + 22 = p - 0v. What is the remainder when d is divided by p? 24 Suppose 0 = 7q - 50 - 34. Suppose qj = 10j + 46. Let v(l) = -l. What is the remainder when j is divided by v(-6)? 5 Let a(z) = z3 - 5z*2 + 5z + 1. Let s be a(4). Suppose -105 = -0q - sq. Let g = 115 - 107. Calculate the remainder when q is divided by g. 5 Let a be ((-5)/3)/(65/(-15) + 4). Calculate the remainder when 95 - (8/(-10))/(2/a) is divided by 11. 9 Let w be (-2 - (5 + 1))26/(-104). Suppose 5m - 3u = 680, 3m - 3u + wu = 412. What is the remainder when m is divided by 35? 34 Suppose 7r = 234 - 24. Calculate the remainder when 419 is divided by r. 29 Let l = -633 + 898. Suppose l = 2y + 3y. What is the remainder when y is divided by 7? 4 Let p(m) = 44m + 327. Calculate the remainder when p(-6) is divided by 44. 19 Let h be (-4)/(-2) - (-12 - 5). Let q = h - 10. Let c(l) = 3l2 - 4l - 8. Calculate the remainder when c(4) is divided by q. 6 Calculate the remainder when (18120/(-16))/(-15) - 2/4 is divided by 10. 5 Suppose -140 = -q + 5v, -6q + 8q - 4v - 262 = 0. Calculate the remainder when 258 is divided by q. 8 Calculate the remainder when 162/5330/132 is divided by 27. 0 Suppose 2j = -2r + 52, -7j + 4j - r + 70 = 0. What is the remainder when 60 is divided by j? 16 Let p(w) = w3 + 7w*2 - 8w + 18. Let y be (14/3 + -2)24/(-8). What is the remainder when 33 is divided by p(y)? 15 Suppose 4d - 3d = 3, -5n - 3d = -69. Let o(g) = 14g + 116. Calculate the remainder when o(-5) is divided by n. 10 Let b(z) = z*3 + 9z*2 + 13z + 61. Calculate the remainder when 77 is divided by b(-8). 14 Suppose -5v + 86 = -3v. Let u(t) = -t*2 + 5t + 29. Calculate the remainder when v is divided by u(7). 13 Let u be (-20)/16 + (-2)/(-8). Let g(k) = 63k2 - k - 1. What is the remainder when g(u) is divided by 16? 15 Let z = 524 + -44. Suppose 9a = -7a + z. What is the remainder when 209 is divided by a? 29 Let k = 625 - 591. Calculate the remainder when 79 is divided by k. 11 Suppose -8 + 22 = 2j. Calculate the remainder when j(66/21 - -4) is divided by 13. 11 Let j(i) = -2i + 1. Let b be j(-1). What is the remainder when 59 is divided by (3 + b)/(1/5)? 29 Suppose 0 = -m - 3r + 37, m + r - 33 = -0m. Suppose 5u + 5f = 1095, -u - 207 = -2u + 3f. Calculate the remainder when u is divided by m. 30 Suppose -18x + 208 = -14x. Let z = x + -32. What is the remainder when 77 is divided by z? 17 Let g(t) = 4t - 36. Let m(x) = 2x - 11. Let u be m(15). What is the remainder when g(u) is divided by 9? 4 What is the remainder when 107 is divided by (-3 - (0 - -3)) + 33? 26 Let b(m) = -m*3 - 13m*2 + 17m + 13. Let i be b(-14). Let u = -25 - i. What is the remainder when 14 is divided by u? 2 Let u be (-10)/45 + 79/(-9). Let q be u/(-2) + 1/(-2). Suppose -5 - q = -3z + f, -4z - 3f = -12. What is the remainder when 15 is divided by z? 0 Suppose 4t = -t + 35. Let d = -51 + 54. Calculate the remainder when t is divided by d. 1 Let t(o) = -3o + 73. Calculate the remainder when t(7) is divided by 8/(-6)(-84)/8. 10 What is the remainder when 17 is divided by (-32)/(-28)126/18? 1 Let c(h) = -2h*2 + 58h + 27. Calculate the remainder when 97 is divided by c(29). 16 Let u(b) = 5b2 + 2b. Suppose 29n - 26n - 12 = 0. Suppose 0 = -np + 4j - 0j + 80, 5p + 4j = 109. What is the remainder when u(-3) is divided by p? 18 Suppose 2r - 17 = -3n - 6, -23 = -4n - r. Let z(p) = -p - p*3 + 15p*2 - 8 - 8p*2 + 6p. What is the remainder when z(n) is divided by 14? 13 What is the remainder when (-427)/(-13) + (3 - 37/13) is divided by 14? 5 Suppose 0 = 8a - 75 - 325. Suppose a = 3p + 32. What is the remainder when 13 is divided by p? 1 Let a(p) = 3p3 + 2p*2 + 2p - 3. Let n(b) = b*3 - b + 1. Let k(g) = -a(g) + 4n(g). Calculate the remainder when 89 is divided by k(4). 14 Suppose -3m + 2b + 125 = 28, -4b - 32 = 0. Let j(f) = 14f*2 + 1. What is the remainder when m is divided by j(1)? 12 Let u = 997 - 765. What is the remainder when u is divided by 56? 8 Suppose -5h = -3k + 119, -2k + 3h + 80 + 0 = 0. Calculate the remainder when k is divided by 13. 4 Let p be 2/(-16) - (-3)/24. Suppose -2r + r + 38 = p. Suppose 0 = 3x - 41 + r. What is the remainder when 1 is divided by x? 0 Let q(u) = -u3 + 11u*2 - 8u - 12. Let v be q(10). Let k(m) = m*3 - 7m*2 - 2m + 5. What is the remainder when k(v) is divided by 14? 11 Let j = -29 + 86. What is the remainder when 182 is divided by j? 11 Suppose -15 = -5s + 6p - p, 12 = 4s - p. Suppose -su - 5d + 207 = 0, -5u - 4d + 301 = -57. Calculate the remainder when u is divided by 285/20 - 6/(-8). 14 Suppose 0 = -t + 3n + 17, 13 + 27 = 4t + 2n. Suppose -i + 305 = -41z + 46z, z - 80 = -4i. Calculate the remainder when z is divided by t. 5 Let j(o) = o2 - 2o - 4. Let l be j(3). Calculate the remainder when -17(0/l + -1) is divided by 5. 2 Let a(h) = -4h + 3. Let g(p) = 8p - 18. Let o be g(13). Suppose 12b = 14b - o. What is the remainder when b is divided by a(-5)? 20 Suppose -12n - 2385 = -65n. What is the remainder when 356 is divided by n? 41 Let w(q) = 4q*2 + 2q - 3. Suppose 120 = -15s + 27s. Calculate the remainder when w(3) is divided by s. 9 Let j(l) = 6l - 16. Let w be j(10). Let h = w - 11. What is the remainder when 129 is divided by h? 30 Suppose -4z + 7n - 2n = -361, 0 = -5z - 3n + 442. Calculate the remainder when z is divided by 45/28/6. 29 Let y = -4 + 24. Calculate the remainder when ((-2)/4)/(16/(-1824)) is divided by y. 17 Let q(l) = -5l + 11. Let g = -51 + 89. Suppose b = 3b - g. What is the remainder when q(-9) is divided by b? 18 Suppose 4t - 4a - 270 = -t, 4a = -2t + 136. Let r be -1(-2 - (-1)/(-1)). Suppose rc = t - 10. Calculate the remainder when 45 is divided by c. 13 Let u(m) = -13m - 481. What is the remainder when u(-41) is divided by 28? 24 Let r(f) = f*3 + 8f*2 + 3. Let k be r(-8). Calculate the remainder when 95/2 - 4/8 is divided by 14 - k/64. 11 Let m(t) = 2t2 - 3t - 11. Let d be m(-2). Suppose -dz + 106 = -z. Calculate the remainder when z is divided by 14. 11 Let i(b) = -4b*2 - 21b + 1. Let d be i(-5). Let m(y) = 7y - 32. Calculate the remainder when 29 is divided by m(d). 9 Suppose 3a = 35a - 2720. Calculate the remainder when 147 is divided by a. 62 Let k(n) = 2n - 20. Let r be k(12). Suppose -4g + 5z = -r + 2, -4z = -4g + 4. What	{ "pile_set_name": "DM Mathematics" }
28 - 14) in the form gm2 + d + am and give d. -152 Express 4 - 1222f - 4 + 1258f in the form of + a and give o. 36 Express -10343o + 18629o - 10023o in the form z + go and give g. -1737 Rearrange (-704h*2 + 93 - 93)(h + 2h - 5h) to the form v + yh2 + mh*3 + dh and give m. 1408 Express ((-2 + 2 - 3)(2t*2 + 4t*2 - 2t*2) - 4t*2 + 10t2 + t2)(4t - 4t - 1 + 2t*2) as ht*3 + ct*2 + n + lt + ot4 and give o. -10 Express (-19q - 3q - 4q)(9q - 7 + 7) in the form zq + s + cq*2 and give c. -234 Rearrange -48a*2 - 1488a + 100a2 - 54a*2 to the form wa + za2 + v and give w. -1488 Express -3j + 5j - 19j + (-2 - 2 + 2)(-j + 2j + j) - 2j + j + 3j + j + 0 + 0 as kj + b and give k. -18 Express -9 + 7 - 32o*2 + 851o - 847o as a + fo + xo2 and give f. 4 Rearrange (3x - 3x - x + (2 - 3x - 2)(7 + 22 - 1))(x*3 + 4x*3 - 7x*3) to q + px*4 + zx + yx2 + cx*3 and give c. 0 Express -14k*3 + 35k*3 - 13k*3 - 10k*3 - 4k4 + 13 + k4 as ak3 + pk + zk2 + gk*4 + r and give r. 13 Rearrange (15y - 7y - 49y)(-2 - y + 2)(-3y + 4y - 4y) to the form ly + p + my2 + ky*3 and give k. -123 Express -109f + 106f + 2 + 21 - 2f*2 - 4 in the form rf + a + mf2 and give a. 19 Rearrange 17q*2 - 28q*2 + 15 + 6q*2 to the form jq + a + pq2 and give p. -5 Express -3o*3 - 166o + 163o - 4o*2 + 2o*2 + 3o*4 + 1 + 5o*2 in the form f + so*4 + io + ro2 + wo*3 and give s. 3 Rearrange 152q*3 + 14q - 65q3 + 10q - 23q to the form pq + jq3 + kq*2 + w and give p. 1 Rearrange 3u*3 + 42u - 42u + (u3 - 2u*3 + 2u*3)(-4 + 1 + 5) - 105u3 + 2622u*2 - 2622u*2 to the form wu*3 + p + tu + hu2 and give w. -100 Express (-j3 + 23j - 23j)(4j + 0j - j) + (-122 + 122 - 14j)(-j*3 + 0j*3 - 2j*3) as zj + lj3 + xj*2 + c + fj*4 and give f. 39 Rearrange (4 - 6 + 3)(-4r - 73r + 20r) - 8r - 2r - r to h + ir and give i. -68 Express ((-3 + 6 - 5)(-1 + 2o + 1) - o + 2o - 2o - 2 + 2 + 2o + (-71 + 71 + 22o)(-2 + 2 + 1))(0 - 3 + 11)(3 - 5 + 0) as vo + x and give v. -304 Rearrange 2p4 + 3p*2 - 9p*3 + 4p3 - p3 - 4p2 - 12 + 5p*3 to the form zp + sp2 + vp*3 + yp*4 + i and give y. 2 Rearrange -23 - 4i3 - 6 - i2 + 28 - 2i to mi + ui2 + t + fi*3 and give m. -2 Express 142q + 58q + 31q - 31q + q as sq + r and give s. 201 Rearrange 5421 + 3n2 - 13n*2 - 5422 to rn*2 + vn + x and give r. -10 Express 22o - 2o*2 + 45o - 37 + 17o + 37 as fo*2 + wo + m and give m. 0 Express -3s2 + 44s - 62s + 5s - s*2 + 2s*2 as x + us*2 + is and give i. -13 Express 49 + 3v - 4 - 3 + 24 as sv + c and give c. 66 Rearrange (25i2 + 7i*2 + 48i*2)(-i + 5i - 3i) to the form ni + gi*3 + r + fi*2 and give g. 80 Express 7a*2 - 247a - 2 + 3 + 247a - 2a*4 in the form ya*3 + j + ma + ua4 + ca*2 and give c. 7 Rearrange -18f*3 - 2f2 + f2 - f*2 to the form kf*2 + bf*3 + s + xf and give b. -18 Express (-3 + 7 - 3)(6 - 2 - 2 + (3 - 2 - 2)(-6 - 10 + 7) - 1 - 1 - 1 + (2 - 2 - 2)(1 - 2 - 1))(-1 - 3f - 3f + 5f) in the form t + vf and give v. -12 Rearrange -11w2 + 2w*4 - 1 + 0w*2 + 2w*3 + 1429w - 1426w to the form f + kw*4 + jw + tw3 + cw*2 and give f. -1 Rearrange -2b*2 + 0b2 + b2 + (3 + 2 - 1)(-23b*2 + 7b*2 - 7b*2)(2 - 4 + 0) to the form yb + v + gb*2 and give g. 183 Rearrange 10023 - 9955 + 2w*2 - 4w*2 to gw + dw2 + f and give d. -2 Rearrange (2 + 1 - 2)(-1 + h + 1) + 66h + 111h + 141h + (2h - 5 + 5)(-2 + 3 - 3) - 4h + 3h + 2h to sh + g and give s. 316 Express 2782 - 2782 - 1560l in the form wl + b and give w. -1560 Express -110u3 + u4 - 11u2 + 213u*3 - 3u*4 - 106u*3 in the form j + gu*4 + du*3 + su*2 + ku and give g. -2 Express -43 - 55w2 - 3w - 57w2 + 114w*2 as nw*2 + v + jw and give n. 2 Express 2f3 + 3f*2 - 14f - 2f2 - 7f*3 + 5f*4 + 6f*3 as wf + nf2 + xf*3 + cf*4 + b and give x. 1 Express (3l*2 + 0l*2 + l - 4l*2)(182 + 137 - 426) in the form sl2 + j + zl and give s. 107 Rearrange 5j2 + 2j*4 + 1 - 2j4 + j4 + 52j3 - 2j - 4j2 to dj*2 + bj + i + mj4 + hj*3 and give i. 1 Express -11x*3 - 13x*3 - x + 34x*3 - x + 88x*4 - 2x*2 - 12x*3 in the form a + mx*2 + rx*3 + qx + yx4 and give a. 0 Express -22t + 4 - 10 + 13t - 5 in the form k + xt and give k. -11 Express (-k - k + 4k)(-k - 2 + 2) - 11 - 8k2 + 11 - 6 + 8k*2 - 9k*2 + 2 as bk*2 + u + wk and give b. -11 Express 8292j4 - 8302j*4 - 3j + 4 - 3 as wj + h + aj*3 + kj*2 + ij*4 and give i. -10 Express 4 - 44b + 33b - 10b + 5 as mb + g and give g. 9 Express ((5 - 4 - 3)(0 - 4 + 3) - 4 + 2 - 5)(19 + 11t - 19)(0 + 3 - 2)(-t*2 + 3t*2 + 0t*2) as it*3 + ht*2 + rt + g and give i. -110 Rearrange -1217k2 + 1392 - 692 - 700 to the form rk*2 + ik + p and give r. -1217 Express -2y2 + 2y2 - y2 + (3y - 5y + 4y)(-2y - 2 + 2) + 9y + 0y2 - 11y - y*2 - 15 in the form zy*2 + o + hy and give z. -6 Rearrange -7f + 8f + 7f + (1 - 3 - 5)(-2f - f + 0f) + 3 + 2f - 3 to the form q + cf and give c. 31 Rearrange (170j2 + 147j*3 - 170j2 + (j3 + j3 - j3)(-1 + 1 + 2))(2 + 3 - 2) to aj + o + vj*2 + bj*3 and give b. 447 Rearrange -1 + 0 - 6p*2 + 3p - p - 4p3 + 10p*2 to the form x + tp + wp2 + cp*3 and give c. -4 Express 3w*2 - 185 + 88 + 2w*4 - 3w*2 + 61 - w as uw + dw3 + cw*2 + m + lw*4 and give u. -1 Express 181w*2 - 13w + w + 22w - 8w in the form n + gw2 + dw and give g. 181 Express 85q2 - q3 - 1 - 22q*2 + 1 in the form jq*3 + y + vq*2 + aq and give j. -1 Rearrange -90o3 + 38o - 2o4 - 14o - 11o - 14o to the form p + zo3 + so*4 + io + yo2 and give s. -2 Rearrange (-2 + 5w - 1 + 7)(3w2 - w2 - w*2) + (4 - 2 - 3)(-w*3 - 2w3 - w3) to the form hw + qw*3 + fw*2 + o and give q. 9 Express 855 - 853 + 2o + 12o as so + r and give s. 14 Rearrange 1046j - 527672 + 527672 to the form xj + y and give x. 1046 Rearrange 45 - 236l2 + 37 + 48 - 130 to j + nl*2 + rl and give r. 0 Express 11 + 168v + 171v - 1 - 339v + 25v*2 in the form uv + pv2 + t and give t. 10 Express -59001j + 58988j - j2 + 2j*3 - 1 + 0j*3 as sj + p + tj3 + ij*2 and give i. -1 Express 431x*3 + 431x*3 - 125 + 2x - 865x3 as sx*2 + m + cx + gx3 and give g. -3 Express -1098k - 216k2 + 548k + 550k as r + nk*2 + gk and give n. -216 Express 267o3 + 2o + 287o3 - 553o*3 - 55o*2 + 2o*4 in the form qo*2 + d + ho + bo3 + ro*4 and give r. 2 Rearrange 1266x*2 - 4 + 4 + 826x*2 - 510x*2 to the form y + px*2 + ax and give p. 1582 Rearrange 39r - 55r + 620r to a + cr and give c. 604 Express 280603 + 2h4 - 280604 - 50h2 - h4 as fh2 + bh + d + wh3 + th*4 and give d. -1 Rearrange 20j*3 - 40j*3 + 2j*4 + 0j + 22j3 - 6j - 4 to the form rj3 + kj*2 + bj*4 + l + nj and give n. -6 Express (s*2 + s - s)(-2 + 5 - 1) + 11s - 2s*2 - 11s + (-1 + 0 - 4)(-46 + 46 + 11s*2) as ks + ws2 + j and give w. -55 Rearrange (-9 + 11i*2 + 11 - 48i + 48i)(5i + 29 - 29) to qi*3 + ui + p + hi2 and give q. 55 Express 0h + 3 + 8 - 8 + 2h2 + 0h as mh + c + ph*2 and give c. 3 Express -56 + 3f + f*2 + 7f + 142 - 75 in the form rf + c + vf*2 and give r. 10 Express 732 - 732 + 1091o in the form vo + m and give v. 1091 Rearrange -2 + 159d + 88d - 164d to p + ld and give l. 83 Rearrange (20 - 59 + 294)(-13 + g*2 + 13) to the form yg + c + bg2 and give b. 255 Express (-2 - k + 2)(-482 - 132 - 154 + 20) as qk + a and give q. 748 Express -7v*3 - v + 3v*2 + 44v*4 + v - 46v*4 - 3v as t + av2 + dv*3 + lv + gv4 and give d. -7 Rearrange (2 - 2 - k3)(-13 + 55 - 171) to the form ak3 + ok + i + sk2 and give a. 129 Express -20143t - 6t2 + 10055t - 4t3 + 10062t + (-2 - 1 + 5)(-5t2 + t3 + 5t2) as n + qt + ot3 + dt*2 and give o. -2 Rearrange 127j**3 +	{ "pile_set_name": "DM Mathematics" }
number? False Is 19823575417 a composite number? True Is 4351563847 prime? False Is 52707071 a composite number? True Is 1614437 composite? True Is 3065451107 a composite number? False Is 22075152419 prime? True Is 1130217697 prime? False Is 622433681 composite? True Is 59239019963 a prime number? True Is 3124014515 a composite number? True Is 5752713479 a composite number? False Is 19831838245 a prime number? False Is 502951117 a composite number? False Is 252512089 a composite number? False Is 359618591 composite? True Is 20610506201 prime? True Is 8753371751 prime? True Is 344484901 prime? True Is 2669211547 composite? True Is 1971433183 prime? True Is 48368643251 prime? True Is 99261472493 a prime number? True Is 49197377101 composite? False Is 13677070853 composite? False Is 4603066943 a composite number? False Is 1231436867 composite? False Is 2244741845 prime? False Is 297590443 composite? False Is 4072666133 a prime number? True Is 314284513 a prime number? False Is 311807981 a prime number? True Is 7261306909 prime? False Is 6005527301 a prime number? True Is 195060221 a composite number? True Is 79061622349 prime? False Is 142946051 prime? True Is 10310024161 composite? True Is 1363207103 composite? True Is 177530413 a composite number? False Is 1965573901 a composite number? False Is 259233343 prime? False Is 1227066323 a composite number? True Is 58446318913 a composite number? False Is 2301045959 prime? False Is 44567341257 prime? False Is 1514051867 composite? False Is 11074496689 composite? True Is 27805321241 composite? True Is 292305273034 composite? True Is 626155043 a prime number? True Is 30821566649 composite? False Is 121574185129 a prime number? True Is 5921767169 a prime number? False Is 797032091 composite? True Is 842020331 prime? True Is 3742034759 composite? True Is 9932999 a composite number? False Is 135728473 composite? True Is 9189281363 a prime number? True Is 2353569287 a prime number? True Is 19745961103 a composite number? True Is 11384440027 composite? False Is 11253931463 a prime number? True Is 13574882203 a composite number? False Is 10344770879 a prime number? True Is 221380651991 prime? False Is 761917273 composite? True Is 2938539613 a composite number? False Is 527799109 a prime number? False Is 2302750633 a composite number? True Is 6114156901 prime? True Is 17572078529 a prime number? True Is 207960373 a composite number? True Is 1723598293 a prime number? True Is 9504343421 a prime number? False Is 193187749 a prime number? False Is 3024706781 prime? True Is 30357800131 a composite number? True Is 10020118391 composite? True Is 303886903 prime? False Is 162343059 composite? True Is 799509017 prime? False Is 10328607277 a composite number? False Is 18591680083 a composite number? False Is 315016787 a prime number? True Is 62992185791 composite? False Is 4203762421 composite? True Is 460009105 composite? True Is 15450203859 a composite number? True Is 993730187 composite? False Is 868231039 prime? False Is 1639190717 a composite number? False Is 901619963 a prime number? False Is 784858727 prime? True Is 10953608998 composite? True Is 15200262373 prime? False Is 396547469 a prime number? True Is 11270826347 prime? False Is 499547047 a composite number? False Is 2145992657 prime? True Is 60767746239 composite? True Is 41761581061 prime? True Is 18273458527 prime? True Is 10130708509 a composite number? False Is 144593875103 composite? True Is 2565574709 a composite number? True Is 903746099 a composite number? False Is 347979529 composite? True Is 5549487443 composite? False Is 64637672233 a composite number? False Is 13182038011 a composite number? False Is 22471304293 prime? False Is 7987299357 a prime number? False Is 87638588951 a prime number? True Is 4490046833 a prime number? False Is 22059852493 a composite number? True Is 520102579 a prime number? False Is 4134400103 composite? False Is 11331062313 a prime number? False Is 2281056421 a prime number? False Is 1089661261 a composite number? True Is 3243189317 composite? False Is 4336100141 a prime number? True Is 304357399 prime? False Is 478828313 prime? True Is 697317693 prime? False Is 57711626207 prime? True Is 263876581 a composite number? False Is 234730065607 a composite number? False Is 4033883899 prime? False Is 67220097071 composite? True Is 20002262093 composite? True Is 7132466707 a prime number? True Is 11654118197 a prime number? True Is 770652941 a composite number? False Is 8489788667 a composite number? False Is 31288153669 a composite number? True Is 155727029 prime? True Is 87524777503 prime? False Is 1572322589 a composite number? False Is 81936086 a composite number? True Is 1636674019 prime? False Is 766710139 composite? True Is 862480093 a prime number? False Is 119670781 a prime number? True Is 121277249921 a composite number? True Is 2727515617 a prime number? True Is 4773572203 composite? False Is 26497520311 composite? False Is 1286415407 a prime number? True Is 518457217 a composite number? False Is 11649811157 composite? True Is 4515737 composite? False Is 3306536983 composite? False Is 13795615363 a composite number? False Is 6123879691 prime? False Is 4706754401 prime? True Is 1054897741 prime? True Is 3886950271 a composite number? True Is 135925553 prime? False Is 2607565657 composite? False Is 1063629131 a prime number? True Is 23838636361 a composite number? False Is 6105681311 a prime number? False Is 1658625214 composite? True Is 3561739591 composite? True Is 34113018991 composite? True Is 63187365827 composite? True Is 3938702531 a prime number? True Is 256908521 composite? False Is 6088711919 a composite number? False Is 16761567601 composite? True Is 3298795229 prime? True Is 4781355133 a prime number? True Is 10701489061 prime? True Is 1881094913 prime? False Is 4393967221 composite? True Is 1400350747 a prime number? True Is 80698238 a composite number? True Is 635778229 composite? True Is 6001483717 composite? True Is 758205109 composite? True Is 5489460671 composite? False Is 32586485273 composite? False Is 1552027406 a prime number? False Is 24469293929 a composite number? False Is 156471802327 a composite number? True Is 23613011689 composite? False Is 706823483 composite? True Is 8293627541 composite? False Is 100440212047 composite? True Is 486303569 composite? True Is 647162071 composite? False Is 5105416405 a prime number? False Is 10028861477 a prime number? False Is 23955087643 composite? False Is 553116485 a composite number? True Is 78909881 a composite number? True Is 6038968409 composite? False Is 276245369 composite? False Is 31192244111 prime? False Is 31501097107 a composite number? False Is 1304762971 prime? False Is 985355467 a composite number? False Is 4642690037 composite? False Is 800531821 prime? True Is 35045933647 prime? True Is 357693109 prime? True Is 26145201659 composite? False Is 2288650859 prime? False Is 383709569 a prime number? True Is 7827715939 a composite number? True Is 485574139 prime? False Is 1559915921 a composite number? False Is 331752469 a prime number? False Is 4317830431 a composite number? False Is 490488962 a composite number? True Is 16553830727 a composite number? True Is 170604921359 a composite number? True Is 6757374059 composite? True Is 30772663 a prime number? True Is 5523088723 prime? False Is 19495151 a prime number? False Is 976576789 a prime number? True Is 67235653 a prime number? True Is 17757015971 a composite number? False Is 2748103537 a composite number? False Is 15339928753 composite? True Is 7061115947 a prime number? True Is 6875815783 a composite number? True Is 1273202569 a composite number? False Is 10406064189 a prime number? False Is 19826644651 a composite number? True Is 12973173602 a composite number? True Is 1933703841 a composite number? True Is 12262008673 prime? True Is 45058371659 prime? False Is 196266889769 prime? True Is 6013810181 prime? True Is 875850697 prime? True Is 9757108169 a prime number? True Is 55285396459 a composite number? False Is 3404720861 prime? True Is 8310658297 prime? True Is 17105082119 prime? True Is 5684394323 prime? False Is 1291102249 a composite number? True Is 23032729609 prime? Fals	{ "pile_set_name": "DM Mathematics" }
u(l) = -1160698l2 - 14 + 0l + 11l + 1160697l*2. Suppose 4d - 39 = -5s, 36 = 3d - 2s - s. Determine u(d). -14 Let l(t) = t3 - 3t*2 - t - 1. Let z be l(5). Let s = -45 + z. Let v be (-8)/(-2) + s2. Let x(m) = 2m3 + m2 - 2m + 3. Give x(v). 19 Suppose -29 - 519 = -4l. Let y = l + -140. Let o(j) = j2 + 4j2 + j3 - j*2 + 3. What is o(y)? 12 Let g(w) = -37w*2 - 3w - 32w2 - 33w*2 - 2 + 96w*2 + 2w. What is g(3)? -59 Let a be ((-154)/(-66))/(14/18). Let t(o) = -3o2 - 3o + 1. Let j(n) = -4n2 - 3n + 2. Let g(s) = 4j(s) - 5t(s). Determine g(a). 3 Let z(h) = -h*3 + 3h*2 + 8h. Let x be z(-3). Let g(a) = -30a - xa - 39a + 87a - a*2 - 12. What is g(-10)? 8 Let s = -2 + 3. Let x(l) = 6l - 18544l2 + 9l + s + 18547l2. Give x(-5). 1 Let s(w) be the first derivative of -19w4/2 - w3/3 + w*2/2 + w - 1. Suppose -90q - 52 = 87 - 49. Calculate s(q). 37 Let r(x) = 2x + 2. Let c(t) = t + 14. Let w = -83 - -137. Suppose -5j + 1 = h + w, 5j = -2h - 51. Let o be c(j). Give r(o). 8 Let d(i) be the second derivative of 0 + 6i2 - 1/6i*3 + 94i. Give d(5). 7 Let j = -149 - -153. Let c(q) = 2 + 1 + 9q + jq*2 + 5 - 3q2. Determine c(-8). 0 Let k(n) = n3 + 83n2 + 78n - 322. Let a be k(-82). Let w(g) = g*2 - 17g + 18. Determine w(a). -48 Let m = 10 - 21. Let f = m + 5. Let d(h) be the third derivative of h*6/120 + 7h5/60 + h4/4 - h3/2 - h2 - 6390h - 1. Calculate d(f). -3 Let g(a) be the first derivative of -a4/12 - 4a*3/3 + 53a2 - 195. Let x(b) be the second derivative of g(b). Give x(-7). 6 Let z(c) = -c3 + 5c2 + c. Let w be 6/39 - 60/52. Let m be (-3)/w - (-23 - -14). Let y be m/32 + 37/8. Determine z(y). 5 Let k(l) be the third derivative of l6/120 - 13l*5/60 + 3l*4/4 + 13l*3/2 - 3l*2 + 342l + 3. Determine k(11). -5 Let m(g) = -g*2 + 1. Let n be m(-2). Suppose 3f + 29 = 5r, 5f + 5r = 2r - 3. Let h = f - n. Let d(u) = -u*2 + 3. Give d(h). 3 Suppose 67q - 202 = -135q. Let k(o) be the first derivative of 18o*2 - 11. Calculate k(q). 36 Let d(k) = -2k*2 + 6k + k*2 - 7k + 15k - 2k - 12. Let p = 19 - 8. Let r be d(p). Let h(g) = -7g3 - 2g*2 - g. Give h(r). 6 Suppose -3m = -2g + 215, -2g = -2m - 102 - 108. Let a = -97 + g. Let n(s) = -10 + 12 + sa + s + 0s*2 - 9s2. Determine n(9). 11 Let r(l) = l - 11. Let h(d) = d2 - 46d - 125. Let n(k) = -h(k) - r(k). What is n(48)? -8 Suppose 11w + 23w - 884 = 0. Let n(t) = t3 - 27t*2 + 25t + 20. Let p be n(w). Let j(s) = -s*2 - 8s - 18. What is j(p)? -6 Let s(y) = -1326 + 10y2 + 37y - 2y2 - 6y*2 - 3y*2 + 1142. Calculate s(30). 26 Suppose 5a = 71 - 1. Let o(t) = 13t - at + 18t3 - 34t*3. What is o(-1)? 17 Suppose 119v + 149 = 982. Let b(s) = -6s + 10. Give b(v). -32 Let d(k) = 5k - 11. Let t(x) = -55x - 2086. Let n be t(-38). Calculate d(n). 9 Let r = -730 + 736. Let g be ((-10)/r)/(280/(-504)). Let n(o) = -3o - 3. What is n(g)? -12 Suppose 98y + 98y - 208y - 132 = 0. Let d(b) = 8b + 71. Give d(y). -17 Let n(r) = 20 + 3r + 196138r*2 - 392266r*2 + 196130r*2. Give n(-7). 97 Let w = 468 - 456. Let i be (-5)/((-18)/w + 2). Let d(r) = -r - 24. What is d(i)? -14 Let s(q) = 16q - 12. Let r(f) = 4f2 - 55f + 152. Let a be r(10). Determine s(a). 20 Let u(i) be the second derivative of i5/20 - i4/12 - i3/3 + i2 - 10i + 54. Give u(2). 2 Let l(o) = -12o*2. Let x be 0 + 2 + (2 + -3)0. Suppose 3s - xs = a, 0 = a + 3s + 8. Let j be ((-2)/a - -1)(-10)/20. Calculate l(j). -12 Let g be (560/70)/(-2 - (1 + -1)). Let z(o) = -3 - 7o - 3 - 3 - 2o*2 + 4. What is z(g)? -9 Let h(u) = 5u*3 - 6u*2 - 3u. Let l(g) = -2g3 + 3g*2 + g. Let s(b) = 3h(b) + 8l(b). Let r be -2 - 82/(-2). Give s(r). -6 Let p(x) be the first derivative of 6 + 0x - 3/2x*2. Calculate p(-5). 15 Let s be 5/1 - (-5)/(-5). Suppose -8a + 4a = k - 11, -5 = k - sa. Let x(w) be the second derivative of -w3/3 - w2/2 - 172w + 17. Determine x(k). -7 Let j(v) be the second derivative of v4/12 - 7v3/3 - v2/2 - 306v. Calculate j(15). 14 Let x(b) = -3b*3 + 3b*3 + 5b2 + b3 + 6b. Let h = 41313 - 41318. Determine x(h). -30 Let l(j) = -j3 + 5j*2 + 6j - 2. Let w(u) = -u - 5. Let t(g) = -10g + 2. Let v be t(1). Let m be w(v). Let n be m + (-1 + 4)/1. Determine l(n). -2 Let x(r) = -r2 - 14r - 18. Suppose 444 = 3h + 480. Calculate x(h). 6 Let d(t) = 6t + 83. Suppose -87 = 5f - 3q, -5f - q - 133 = -62. What is d(f)? -7 Let q(s) = -16s - 20. Let r(p) = -8p - 11. Let z(n) = 3q(n) - 7r(n). Let t(m) = -m - 1. Let o(a) = 5t(a) + z(a). Calculate o(-8). -12 Let u(y) = 3y3 - 7y*2 + 178y - 4y3 - 162y - 35. Calculate u(-9). -17 Let q(k) = -4k2 + 11k + 22. Let z be q(-7). Let i = -256 - z. Let m(t) = t*2 + 6t + 5. Give m(i). 0 Let a(g) = 43g3 + 2g*2 + 9g + 50. Let f(k) = -45k3 - 2k*2 - 10k - 54. Let s(h) = -13a(h) - 12f(h). Determine s(1). -20 Let z(u) = 4u + 5. Let c(t) = -12t + 91. Suppose -10i + 7i + 24 = 0. Let g be c(i). Calculate z(g). -15 Let w = -491 + 327. Let c = w - -158. Let t(v) = 5v - 5. Let a(m) = 4m - 4. Let y(p) = 4a(p) - 3t(p). Calculate y(c). -7 Let k(q) = -11246 - 11246 + 22458 - 8q. What is k(-12)? 62 Let p(r) = 3r + 5. Let a(t) = -2t - 36. Let b be a(-19). Suppose -bm = -3x - 16 - 3, 17 = m - 4x. Suppose 0 = -mv + 12v + 35. Calculate p(v). -10 Let k(w) = 26 - 2832w + 2831w - 3. Suppose -5n + n = 0. Calculate k(n). 23 Let l(d) = -d2 + 4d + 12. Let q(w) = w*2 - 186w + 901. Let p be q(5). Give l(p). -20 Let a(m) = m*2 - 16m - 7. Let c be a(17). Let w(f) = -19 + f + 11 + c. Determine w(3). 5 Let o(g) = -2g2 + 69g + 999. Let z be o(-11). Let h(v) = -34v - 51. Calculate h(z). 17 Let p(t) = t3 + 6t*2 + 5t - 5. Suppose 3n + 6 = 0, 3x - 29 + 6 = 4n. Suppose -71 = xc - 46. What is p(c)? -5 Let d(r) = 21r - 62r + 32r + 12r + 46. Calculate d(-23). -23 Let t = 399 + -384. Suppose 27i + 630 = -ti. Let g(y) = -y*3 - 15y*2 + y + 9. Determine g(i). -6 Let j(a) = 13a + 327. Let s be (60/90)/((-15)/585). What is j(s)? -11 Let m(j) = -j*2 + 16j + 17. Let z be (1 + 6 - 8) + 18. Determine m(z). 0 Let v(f) = -f*2 - 2f + 5. Let o be v(-3). Let m(z) = 2z2 - 5 - 16z + 15z - zo - z3 + 2z3. What is m(0)? -5 Let q(y) be the second derivative of -y5/20 + 5y4/12 + y3/2 + 3186y. What is q(3)? 27 Let f(g) be the third derivative of g5/12 + g4/24 - g*2. Suppose -4h = 5w - 1558 - 140, 3h - 675 = -2w. Let o = w - 341. Give f(o). 6 Let h(q) be the first derivative of 3q*2 + 28q + 3828. Give h(-5). -2 Let q(g) = -g*2 - 89g - 1964. Let f be q(-48). Let a(w) = -8w + 13. What is a(f)? -19 Let m(o) = -2o*3 - 50o*2 + 53o - 16. Let i(k) = -141k + 4063. Let n be i(29). Give m(n). -42 Let g(q) = -4q*2 - 218q + 336. Let c be g(-56). Let m(p) = -7p2 + 7. Calculate m(c). 7 Let u = 332 - 771. Let c = u + 445. Let d(k) = -k2 + 8k - 9. Calculate d(c). 3 Let y(q) = -q + 32. Let z be y(-23). Suppose -49i - 36 = -zi. Let f(b) = -b*2 + 9b - 4. Determine f(i). 14 Suppose 25 = 18i - 231 - 68. Let y(b) = b2 - 19b + 25. What is y(i)? 7 Let n(x) be the third derivative of -x*4/8 - 89x*3/6 + 126x2 - 3. Determine n(-27). -8 Let u(c) = c3 - 18c2 - 19c - 13. Suppose -221 = -33m + 406. What is u(m)? -13 Let i(b) = -2b3 + b2 - 2b. Let n = -81 - -125. Let r = 46 - n. Give i(r). -16 Suppose 6v = -2104 - 1826. Let p = -652 - v. Let u(b) = -b*3 + 5b - 2. What is u(p)? -14 Suppose -5y - 4t = 406, y + 95 = -3t + 16. Let b = y + 92. Let g(c) = -c + 16. Let x be g(b). Let w(r) = -r2 + 7r - 3. Determine w(x). 3 Let h(t) = 3t - 2. Suppose -33 + 9 = -i. Suppose -11a = a + i. Give h(a). -8 Let x(c) = 65c3 - 2c*2 - 15c - 14. Let u(m) = -54m3 + 16m + 14. Let k(i) = -6u(i) - 5x(i). What is k(7)? -14 Let r(m) = 1. Let y(x) = -3x + 9. Let q = 108 - 103. Let k be 4/4(2 - 3). Let h(c) = ky(c) + qr(c). Give h(-3). -13 Let w(t) be the third derivative of -t*5/60 + 17t*4/24 - 16t*3/3 + 1586t*2. Calculate w(17). -32 Suppose 0 = -5x - 0x + 30. Let m(z) be the second derivative of 5z*3/6 - 13z*2 + 523z. What is m(x)?	{ "pile_set_name": "DM Mathematics" }
er when 588 is divided by 31? 30 What is the remainder when 121 is divided by 45? 31 Calculate the remainder when 1162 is divided by 71. 26 What is the remainder when 3873 is divided by 5? 3 What is the remainder when 52 is divided by 39? 13 Calculate the remainder when 1433 is divided by 290. 273 What is the remainder when 240 is divided by 111? 18 Calculate the remainder when 482 is divided by 475. 7 What is the remainder when 745 is divided by 251? 243 Calculate the remainder when 154 is divided by 59. 36 Calculate the remainder when 440 is divided by 74. 70 Calculate the remainder when 436 is divided by 25. 11 What is the remainder when 1242 is divided by 413? 3 Calculate the remainder when 10632 is divided by 217. 216 Calculate the remainder when 45 is divided by 23. 22 Calculate the remainder when 1228 is divided by 82. 80 Calculate the remainder when 23 is divided by 5. 3 Calculate the remainder when 59 is divided by 17. 8 What is the remainder when 359 is divided by 90? 89 What is the remainder when 767 is divided by 128? 127 What is the remainder when 196 is divided by 44? 20 Calculate the remainder when 16 is divided by 6. 4 Calculate the remainder when 17402 is divided by 169. 164 Calculate the remainder when 1698 is divided by 122. 112 What is the remainder when 551 is divided by 111? 107 What is the remainder when 51 is divided by 29? 22 Calculate the remainder when 390 is divided by 63. 12 Calculate the remainder when 708 is divided by 79. 76 What is the remainder when 3857 is divided by 143? 139 What is the remainder when 311 is divided by 7? 3 What is the remainder when 393 is divided by 24? 9 What is the remainder when 1304 is divided by 406? 86 What is the remainder when 622 is divided by 69? 1 What is the remainder when 1240 is divided by 527? 186 Calculate the remainder when 107 is divided by 45. 17 What is the remainder when 15716 is divided by 271? 269 Calculate the remainder when 112 is divided by 7. 0 What is the remainder when 115 is divided by 33? 16 What is the remainder when 119 is divided by 36? 11 What is the remainder when 8381 is divided by 364? 9 Calculate the remainder when 852 is divided by 14. 12 Calculate the remainder when 59 is divided by 22. 15 Calculate the remainder when 304 is divided by 157. 147 Calculate the remainder when 2853 is divided by 24. 21 What is the remainder when 161 is divided by 9? 8 What is the remainder when 102 is divided by 37? 28 Calculate the remainder when 102 is divided by 67. 35 What is the remainder when 848 is divided by 424? 0 What is the remainder when 82 is divided by 41? 0 What is the remainder when 1976 is divided by 33? 29 What is the remainder when 45 is divided by 13? 6 What is the remainder when 924 is divided by 199? 128 What is the remainder when 271 is divided by 139? 132 What is the remainder when 256 is divided by 222? 34 What is the remainder when 69 is divided by 15? 9 Calculate the remainder when 71 is divided by 19. 14 What is the remainder when 191 is divided by 8? 7 Calculate the remainder when 1642 is divided by 31. 30 What is the remainder when 1295 is divided by 203? 77 What is the remainder when 30 is divided by 7? 2 Calculate the remainder when 957 is divided by 116. 29 Calculate the remainder when 130 is divided by 54. 22 What is the remainder when 472 is divided by 24? 16 What is the remainder when 546 is divided by 25? 21 Calculate the remainder when 62283 is divided by 23. 22 What is the remainder when 109 is divided by 4? 1 Calculate the remainder when 359 is divided by 353. 6 Calculate the remainder when 795 is divided by 48. 27 What is the remainder when 228 is divided by 47? 40 Calculate the remainder when 1432 is divided by 708. 16 Calculate the remainder when 761 is divided by 199. 164 Calculate the remainder when 1007 is divided by 1005. 2 Calculate the remainder when 1014 is divided by 7. 6 Calculate the remainder when 1787 is divided by 16. 11 What is the remainder when 281 is divided by 4? 1 Calculate the remainder when 260 is divided by 36. 8 Calculate the remainder when 28982 is divided by 11. 8 What is the remainder when 86 is divided by 37? 12 What is the remainder when 31 is divided by 6? 1 What is the remainder when 113 is divided by 85? 28 What is the remainder when 62 is divided by 32? 30 Calculate the remainder when 486 is divided by 122. 120 What is the remainder when 174 is divided by 118? 56 What is the remainder when 45 is divided by 19? 7 What is the remainder when 130 is divided by 20? 10 Calculate the remainder when 965 is divided by 22. 19 Calculate the remainder when 1548 is divided by 1543. 5 Calculate the remainder when 581 is divided by 258. 65 Calculate the remainder when 276 is divided by 130. 16 Calculate the remainder when 4010 is divided by 13. 6 Calculate the remainder when 139 is divided by 74. 65 Calculate the remainder when 3606 is divided by 190. 186 Calculate the remainder when 569 is divided by 187. 8 What is the remainder when 1822 is divided by 300? 22 Calculate the remainder when 583 is divided by 96. 7 What is the remainder when 62 is divided by 37? 25 Calculate the remainder when 161 is divided by 30. 11 What is the remainder when 5115 is divided by 22? 11 What is the remainder when 8045 is divided by 2670? 35 What is the remainder when 374 is divided by 69? 29 Calculate the remainder when 1736 is divided by 5. 1 What is the remainder when 2330 is divided by 774? 8 What is the remainder when 130 is divided by 61? 8 What is the remainder when 619 is divided by 69? 67 What is the remainder when 123 is divided by 45? 33 What is the remainder when 838 is divided by 838? 0 Calculate the remainder when 30215 is divided by 67. 65 What is the remainder when 82 is divided by 21? 19 What is the remainder when 243 is divided by 61? 60 Calculate the remainder when 2488 is divided by 13. 5 What is the remainder when 5829 is divided by 830? 19 What is the remainder when 1116 is divided by 34? 28 What is the remainder when 3888 is divided by 205? 198 Calculate the remainder when 212 is divided by 101. 10 What is the remainder when 137 is divided by 43? 8 Calculate the remainder when 3203 is divided by 229. 226 What is the remainder when 35 is divided by 6? 5 What is the remainder when 12990 is divided by 16? 14 Calculate the remainder when 314 is divided by 29. 24 Calculate the remainder when 154 is divided by 6. 4 Calculate the remainder when 1129 is divided by 74. 19 What is the remainder when 969 is divided by 21? 3 What is the remainder when 1300 is divided by 425? 25 What is the remainder when 2011 is divided by 33? 31 What is the remainder when 1471 is divided by 238? 43 Calculate the remainder when 591 is divided by 9. 6 Calculate the remainder when 202 is divided by 41. 38 Calculate the remainder when 462 is divided by 459. 3 What is the remainder when 647 is divided by 162? 161 Calculate the remainder when 51 is divided by 18. 15 What is the remainder when 62 is divided by 17? 11 What is the remainder when 259 is divided by 202? 57 Calculate the remainder when 1089 is divided by 348. 45 What is the remainder when 8475 is divided by 163? 162 What is the remainder when 831 is divided by 136? 15 Calculate the remainder when 1558 is divided by 12. 10 What is the remainder when 197 is divided by 96? 5 What is the remainder when 3850 is divided by 962? 2 What is the remainder when 29 is divided by 17? 12 What is the remainder when 656 is divided by 32? 16 Calculate the remainder when 4928 is divided by 352. 0 Calculate the remainder when 1961 is divided by 198. 179 What is the remainder when 1423 is divided by 75? 73 Calculate the remainder when 4114 is divided by 4101. 13 What is the remainder when 136 is divided by 26? 6 What is the remainder when 445 is divided by 54? 13 Calculate the remainder when 2067 is divided by 9. 6 What is the remainder when 104 is divided by 3? 2 Calculate the remainder when 3821 is divided by 426. 413 Calculate the remainder when 391 is divided by 60. 31 Calculate the remainder when 602 is divided by 19. 13 What is the remainder when 70 is divided by 20? 10 What is the remainder when 394 is divided by 33? 31 Calculate the remainder when 97 is divided by 46. 5 What is the remai	{ "pile_set_name": "DM Mathematics" }
of -2635, -1958, -1293, -640, 1, 630, 1247? -6i2 + 695i - 3324 What is the k'th term of 10286715, 10286714, 10286711, 10286706? -k*2 + 2k + 10286714 What is the u'th term of -13684, -13516, -13348? 168u - 13852 What is the q'th term of 49718, 99461, 149212, 198971, 248738, 298513, 348296? 4q*2 + 49731q - 17 What is the y'th term of 1789, 12910, 24031, 35152, 46273? 11121y - 9332 What is the g'th term of -45323, -42485, -39647, -36809? 2838g - 48161 What is the s'th term of -46589, -45896, -45203, -44510, -43817? 693s - 47282 What is the v'th term of 6457, 28802, 66045, 118186? 7449v*2 - 2v - 990 What is the o'th term of -5935, -9884, -13803, -17686, -21527, -25320, -29059? o*3 + 9o*2 - 3983o - 1962 What is the t'th term of 2622, 10635, 23986, 42675, 66702? 2669t2 + 6t - 53 What is the u'th term of -2696623, -5393233, -8089841, -10786447? u*2 - 2696613u - 11 What is the o'th term of -7422128, -14844253, -22266378, -29688503, -37110628? -7422125o - 3 What is the h'th term of 10245, 15538, 20831? 5293h + 4952 What is the s'th term of 583988, 1167945, 1751888, 2335811, 2919708? -s3 - s2 + 583967s + 23 What is the n'th term of -4698, -9228, -13754, -18276, -22794, -27308? 2n*2 - 4536n - 164 What is the q'th term of 293025, 292935, 292845? -90q + 293115 What is the x'th term of -11813, -11798, -11773, -11738, -11693? 5x*2 - 11818 What is the w'th term of -2104, -3706, -5956, -9178, -13696? -54w*3 - 1224w - 826 What is the m'th term of -462734, -462693, -462610, -462473, -462270, -461989, -461618? 2m3 + 9m*2 - 462745 What is the a'th term of -19287, -154274, -520659, -1234140, -2410415, -4165182? -19283a3 - a2 - 3a What is the u'th term of 209174, 209266, 209358, 209450, 209542? 92u + 209082 What is the n'th term of -247891, -247877, -247863, -247849? 14n - 247905 What is the j'th term of -29273, -41202, -53131, -65060, -76989, -88918? -11929j - 17344 What is the p'th term of -33407, -67616, -101825? -34209p + 802 What is the b'th term of -154, -565, -1242, -2179, -3370? b3 - 139b*2 - b - 15 What is the g'th term of 97846, 97850, 97850, 97846, 97838, 97826? -2g*2 + 10g + 97838 What is the a'th term of -970, -937, -906, -877? -a*2 + 36a - 1005 What is the d'th term of -544071, -543568, -543065? 503d - 544574 What is the v'th term of 157553, 161419, 165287, 169157, 173029? v2 + 3863v + 153689 What is the r'th term of -39190, -76388, -113586, -150784, -187982? -37198r - 1992 What is the n'th term of 218, 296, 496, 878, 1502, 2428? 10n3 + n2 + 5n + 202 What is the y'th term of -470944, -470934, -470920, -470902, -470880? 2y*2 + 4y - 470950 What is the d'th term of -6617, -14130, -21643, -29156, -36669? -7513d + 896 What is the w'th term of -584630, -584644, -584658? -14w - 584616 What is the g'th term of -1774, -6285, -10796? -4511g + 2737 What is the o'th term of -4738201, -18952828, -42643877, -75811348, -118455241? -4738211o*2 + 6o + 4 What is the b'th term of 11126, 9517, 6836, 3083, -1742? -536b2 - b + 11663 What is the z'th term of -7159774, -7159763, -7159748, -7159729, -7159706, -7159679, -7159648? 2z*2 + 5z - 7159781 What is the g'th term of 166949, 333897, 500845, 667793? 166948g + 1 What is the b'th term of -27798, -28975, -30152, -31329, -32506, -33683? -1177b - 26621 What is the m'th term of -589, -1150, -1625, -2014? 43m2 - 690m + 58 What is the i'th term of 204404, 1635152, 5518566, 13080980, 25548728, 44148144, 70105562, 104647316? 204389i3 - i2 + 28i - 12 What is the s'th term of -10065292, -20130577, -30195862, -40261147? -10065285s - 7 What is the v'th term of -130082, -118309, -106536, -94763, -82990? 11773v - 141855 What is the w'th term of 5785, 13554, 21263, 28882, 36381, 43730, 50899, 57858? -5w3 + 7804w - 2014 What is the v'th term of -9564561, -9564531, -9564499, -9564465, -9564429, -9564391? v*2 + 27v - 9564589 What is the s'th term of -32790, -32771, -32712, -32589, -32378, -32055, -31596? 4s3 - 4s*2 + 3s - 32793 What is the o'th term of -5576, -11559, -21526, -35477, -53412, -75331? -1992o2 - 7o - 3577 What is the v'th term of 3773, 3721, 3517, 3065, 2269, 1033? -16v3 + 20v*2 + 3769 What is the r'th term of 421558, 421828, 422098? 270r + 421288 What is the a'th term of -3712, -13786, -30582, -54100, -84340, -121302, -164986? -3361a2 + 9a - 360 What is the d'th term of -55871, -111740, -167609? -55869d - 2 What is the l'th term of -163986, -327946, -491894, -655824, -819730, -983606? l3 - 163967l - 20 What is the l'th term of -5531, -3386, -1241, 904, 3049, 5194? 2145l - 7676 What is the j'th term of -339635, -339000, -338365, -337730, -337095? 635j - 340270 What is the x'th term of -4665, -18204, -40613, -71892, -112041? -4435x2 - 234x + 4 What is the x'th term of -8982, -18240, -27498? -9258x + 276 What is the w'th term of 23823, 53646, 83469? 29823w - 6000 What is the n'th term of -181398, -362895, -544388, -725877, -907362, -1088843? 2n2 - 181503n + 103 What is the z'th term of 2079798, 2079814, 2079832, 2079852, 2079874, 2079898, 2079924? z*2 + 13z + 2079784 What is the b'th term of 22793, 45870, 68947, 92024, 115101? 23077b - 284 What is the l'th term of 7606, 7290, 6974, 6658, 6342, 6026? -316l + 7922 What is the g'th term of -1323, -618, 87? 705g - 2028 What is the v'th term of -3496, -3541, -3600, -3679, -3784, -3921, -4096, -4315? -v3 - v2 - 35v - 3459 What is the n'th term of 8978, 18526, 28080, 37640? 3n2 + 9539n - 564 What is the m'th term of -116331, -118974, -121617, -124260? -2643m - 113688 What is the o'th term of 1147874, 1147822, 1147734, 1147610, 1147450? -18o*2 + 2o + 1147890 What is the q'th term of -56820, -227260, -511304, -908952, -1420204, -2045060? -56802q2 - 34q + 16 What is the w'th term of -194421, -194788, -195155, -195522, -195889? -367w - 194054 What is the w'th term of 378, 685, 862, 849, 586? -10w*3 - 5w*2 + 392w + 1 What is the r'th term of -327332, -1309363, -2946084, -5237495, -8183596? -327345r2 + 4r + 9 What is the f'th term of 3546, 7169, 10884, 14733, 18758, 23001? 7f3 + 4f*2 + 3562f - 27 What is the h'th term of -570, -2324, -5260, -9384, -14702, -21220? -h*3 - 585h*2 + 8h + 8 What is the f'th term of -185865, -743491, -1672869, -2973999, -4646881, -6691515? -185876f2 + 2f + 9 What is the p'th term of 946838, 1893626, 2840412, 3787196, 4733978, 5680758, 6627536? -p*2 + 946791p + 48 What is the u'th term of 80271, 80339, 80453, 80613, 80819, 81071, 81369? 23u2 - u + 80249 What is the k'th term of 41031, 81836, 122643, 163452, 204263, 245076, 285891? k2 + 40802k + 228 What is the h'th term of -2618348, -2618338, -2618328, -2618318? 10h - 2618358 What is the k'th term of 2824328, 2824235, 2824146, 2824061, 2823980, 2823903, 2823830? 2k*2 - 99k + 2824425 What is the l'th term of 1204, 3455, 6732, 11017, 16292, 22539, 29740? -3l3 + 531l*2 + 679l - 3 What is the j'th term of -74456850, -74456855, -74456860? -5j - 74456845 What is the h'th term of -28896973, -28896975, -28896977, -28896979? -2h - 28896971 What is the y'th term of -7198, -14393, -21580, -28759, -35930, -43093? 4y2 - 7207y + 5 What is the h'th term of -1660788, -3321575, -4982360, -6643143, -8303924? h*2 - 1660790h + 1 What is the l'th term of 4342024, 4342057, 4342090, 4342123, 4342156, 4342189? 33l + 4341991 What is the u'th term of -32864639, -65729254, -98593869? -32864615u - 24 What is the d'th term of 6992, 4191, 1396, -1393, -4176? 3d2 - 2810d + 9799 What is the p'th term of 26639966, 26639967, 26639968, 26639969, 26639970, 26639971? p + 26639965 What is the t'th term of -9423, -8760, -7655, -6108, -4119, -1688? 221t2 - 9644 What is the a'th term of 3041727, 3041732, 3041735, 3041736, 3041735, 3041732, 3041727? -a2 + 8a + 3041720 What is the x'th term of 6279, 50863, 172035, 408087, 797311, 1377999, 2188443, 3266935? 6382x3 + 2x*2 - 96x - 9 What is the u'th term of -319116, -319017, -318908, -318783, -318636, -318461? u3 - u2 + 95u - 319211 What is the r'th term of -8173638, -8173635, -8173632, -8173629, -8173626? 3r - 8173641 What is the a'th term of 708229, 1416439, 2124631	{ "pile_set_name": "DM Mathematics" }
be (-793)/652 - -24. Which is the fourth smallest value? (a) -2/7 (b) -0.085 (c) u (d) 3 d Let x = 84 + -60. Suppose -4p - 128 = -x. Let o be (-16)/(-40) + p/(-10). What is the third biggest value in o, 0.2, 0.3? 0.2 Let k = -75.5 - -76. Let f = 30.2 - 21.9. Which is the biggest value? (a) -1/3 (b) f (c) k b Suppose -l = 4l - 4a - 1469, a + 1 = 0. Let q = l - 296. What is the second biggest value in 2, q, -3/2? -3/2 Let q be (0 - 0)/(6/2 + 196 + -207). Let t = 2.1 + 0.9. What is the fourth biggest value in q, 0.2, t, 1? q Let d = -798.416 + 798. Let p = -24.916 + 25. Let g = p - d. Which is the third smallest value? (a) 2 (b) g (c) -0.4 a Suppose n + 4 - 8 = 0. Suppose 0 = -nz + 3z. Let i be z/1 - (-2 + 33/18). Which is the biggest value? (a) 3 (b) 1 (c) i (d) -5 a Suppose -3g = -6g - 141. Let o = g - -84. Let y = 2946 - 2941. What is the biggest value in y, o, 0.2? o Suppose 2l + 3d - 12 = 0, -l - 2 = 4d - 13. What is the second biggest value in l, 301, 5? 5 Let g = -8 + 9. Let k = -0.21 + 0.01. Let z be 1/(-2)(7 + 22 - 30). Which is the biggest value? (a) k (b) z (c) -1/3 (d) g d Let b = 1.22354 + -0.22354. What is the smallest value in -2, b, -1, 0.17? -2 Suppose 2g - 5f = -11, -g + 3g + 4f = 16. Let h be (275/500 - g/(-10))1. Let s = 50 - 48. Which is the second biggest value? (a) s (b) -2 (c) h (d) 0 c Let n = -0.22968 - -0.02968. Let p be -1 + (-2)/(12/(-21)). Which is the biggest value? (a) 3/4 (b) n (c) p c Let y = -9461 + 9490. Which is the third biggest value? (a) -0.4 (b) -2/15 (c) 0.3 (d) 1/2 (e) y c Let w = 1.672 - -0.328. What is the biggest value in 0.2, 2/11, -2/7, w? w Let v = 332 - 333. Which is the smallest value? (a) -2/5 (b) v (c) 53/6 b Let x be (-146)/(-44) + 1246/(-356). Which is the second biggest value? (a) x (b) 1/4 (c) 10/9 b Let z(u) = -u3 - 13u*2 - 40u - 31. Let y be z(-3). Which is the third smallest value? (a) y (b) 3 (c) -39/2 b Let u = 54 + -92. Let m = -0.0537 + 33.0537. Let b = u + m. What is the third smallest value in b, -4, -0.5? -0.5 Let h = -4081 + 4081.5. Let y = 0.6 - 0.43. What is the second smallest value in y, 5, h? h Let x = -14179/6 + 2363. Let v = -56 - -56.1. What is the biggest value in x, v, 0.8, -4? 0.8 Let x = 0.6039 + -0.5839. What is the second biggest value in x, 0.01, 3, -3, 2? 2 Let m = 4.92481 - -0.07519. What is the second smallest value in -0.3, -2, -256, m? -2 Let t be 5 + ((-290)/20 - -9) - -1. What is the smallest value in 4, -0.1, t, 2, 0.01? -0.1 Let g = -199/22 - -203/22. Which is the smallest value? (a) 2 (b) 21/17 (c) g c Suppose 4t - 18 = t. Suppose -t = r - 1. Let f = 452/7 - 1829/28. Which is the fourth biggest value? (a) 1/5 (b) f (c) -0.1 (d) r d Suppose -3b - 2t + t = -15, 4t = 12. Suppose 20 = bn + 4. Let h = 3690/13 + -284. What is the smallest value in -0.2, n, h? -0.2 Let q = 1 - 0.1. Let v = q - -4.1. Let m = -767.9 + 768. Which is the second biggest value? (a) -3/17 (b) v (c) m (d) 0 c Let b be -15 + (-4 - -4) + 12. Let i = -125 + 126. What is the third biggest value in b, i, -0.1? b Let t = 271 + -268.45. Let n = -0.45 - t. Which is the fourth biggest value? (a) 2.2 (b) 4 (c) n (d) -0.4 c Let r = -2/523 + -1028/4707. Let p = 1/5072 - 1903/5072. Which is the second biggest value? (a) p (b) r (c) -1/3 c Let q = 2633.36 - 2633. What is the smallest value in 1, q, 0.16? 0.16 Let w(y) = 2y*2 + 3y - 1. Let k be w(-2). Let m be (-2)/8 - (-3)/(-20). Let t = -806 - -804. What is the second biggest value in m, k, -3, t? m Let j = -1.0822 + 1.3822. Let i = -339.89 + 330. Let f = i - 0.11. What is the third smallest value in j, -4, -0.4, f? -0.4 Let g = 847.57 - 822. Let o = g + -26. Let r = o - -1.43. Which is the fourth biggest value? (a) -0.4 (b) 4 (c) 0.02 (d) r a Let t(g) = g + 11. Let j be t(-7). Suppose 8z - 12z + j = 0. Which is the second biggest value? (a) z (b) -1 (c) 2 (d) -0.5 a Suppose 17 = 4n + 5l, -5n + 3n = 5l - 21. Let h = 17.24 + -58. Let i = -1.24 + h. Which is the second biggest value? (a) -3/5 (b) i (c) n c Let x = 763 - 759. Let t = 1 - 4. Let s = -0.48 + -0.52. Which is the biggest value? (a) x (b) s (c) t (d) 0.1 a Let f = 34323 + -34322.9. Suppose -1 + 0 = t. Which is the third biggest value? (a) -1/2 (b) f (c) 5 (d) t a Let l be (-9)/(-6) + (-85)/(-10). Suppose 6 = ls + 16. Which is the biggest value? (a) 2/9 (b) 4/19 (c) s a Let u = -109 + 110. Let i = -45 - u. Let b = 42 + i. What is the second smallest value in -3/8, -2/9, b? -3/8 Let q(f) = -f*3 + 6f*2 + 2f - 31. Let h be q(5). What is the smallest value in h, 0, 0.345? 0 Let q be -2 + (2 - 1) + -2. Let l(o) = -89o + 267. Let z be l(3). Suppose z = 40h - 7h + 66. Which is the smallest value? (a) q (b) 5/6 (c) h a Suppose -620v - 2592 = 244v. Let g = 0.07 - -3.93. What is the smallest value in g, 0, v, 11? v Let t = -0.0605 + 181.0605. Which is the third biggest value? (a) -2 (b) t (c) 0.5 a Suppose v = 4l - 6l + 15, 5l - 40 = -3v. Which is the biggest value? (a) l (b) -1/3 (c) 204 c Let t = -343/790 - -58/79. What is the smallest value in 0.5, -127, t? -127 Let s(z) = 118z + 10428. Let r be s(-90). What is the smallest value in 1, r, -2, 3/2, -0.5? r Let t = 82 + 15. Let j = -12554.3 + 12554. Which is the smallest value? (a) j (b) t (c) -2 c Suppose 0 = 3p + 17z - 21z + 14, 3p + 17 = z. Let r be 1606/(-231) - p - (-4)/14. What is the third smallest value in r, 5, -2/7, 0.1? 0.1 Let m = 424 - 412.11. Let j = 5.89 - m. Which is the second smallest value? (a) j (b) 1 (c) -0.5 c Let z = -2291 + 2366. Which is the third biggest value? (a) z (b) -2 (c) 0 (d) -3 b Let r = 12.918 + -13. Let y = -1.218 + r. Which is the second smallest value? (a) y (b) -0.4 (c) 3 b Let g = -2617 - -2614. What is the third smallest value in 4/5, 0.4, -4.4, g? 0.4 Suppose 0 = -5s - 20, 3s = -4n - 5 + 1. Let x = 1025 - 546. Let r = x - 478.9. Which is the third smallest value? (a) n (b) r (c) -0.3 (d) -1 b Let t = 20822 - 20820. Let x = 0.27 - -0.03. Which is the second biggest value? (a) -5/4 (b) t (c) x (d) 0.4 d Let p be 6/(1 - (3 - 4)). Let n be (-1)/(-5)(1 + p). Let w = 9850/3723 - 196/73. What is the second smallest value in w, n, -2? w Let h = -0.9152 - -0.864. What is the biggest value in h, 1/4, 1? 1 Let s = -247.4 + 247.1. Which is the third biggest value? (a) 1.33 (b) 4 (c) -3 (d) s (e) -1/7 e Let x = -133997 - -2006413/15. Let w = x - -236. Let s(k) = k - 9. Let q be s(10). Which is the second smallest value? (a) q (b) -1/3 (c) w c Let z = 2746 - 2746.3. Suppose 7w = -11 + 46. Which is the third smallest value? (a) -0.4 (b) 2 (c) w (d) z b Suppose 0 = -98q + 103q + 325. Let u be 20/2(-7 - 416/q). Let n = -0.3 - -0.4. Which is the biggest value? (a) -1 (b) 1 (c) n (d) u b Let q = 9/13 + 33/65. Let r = 26507/14 - 13250/7. Which is the second biggest value? (a) 0.4 (b) q (c) -2/33 (d) r d Let n = -13.7 - -29.4. Let j = 16.5 + -0.5. Let y = j - n. Which is the third biggest value? (a) 6 (b) 0 (c) y (d) -2/11 b Let y be (15/(-120))/(5/(-10)). Which is the second biggest value? (a) 0.18 (b) 1 (c) 2/43 (d) 4 (e) y b Let j be ((-4)/3 + 0)/(2/(-6)). Let b = 1/2 + -3/14. Let o = -0.7 + 0.5. What is the fourth biggest value in j, o, 0.2, b? o Let c = 1.3465 - 1.2865. What is the fourth biggest value in 0.4, c, -1/4, 0.106? -1/4 Let x(t) = -2t + 2. Let m be x(5). Let p be m/(-30) + 4/10. Let g be (-12 + 13)((-42)/(-10) + 8/(-2)). What is the third smallest value in p, g, -1/5? p Let z be 0/(-4 + 0) - -47. Let k = -46 + z. Let a = -9.16 - -9. What is the third biggest value in a, 1/4, k? a Let p be 0 + (0 + 3 - 1). Let t be p/(-2) + 10 + -4. Let o = -77025.1 + 77024. What is the second biggest value in t, o, -0.2? -0.2 Let a = -37.51 + 39.9. Let g = a - 1.39. What is the second biggest value in 30, g, 0? g Let z = 1262.7 + -1264.7. What is the fourth smallest value in z, 15, -5, 1.15? 15 Let d(o) = 7o3 - 3o + 3. Suppose y - 5 = -4*y. Let i be d(y). Which is the third smallest value? (a) 1/5 (b) i (c) -0.1 b Let r = -17 + 17.8. Let j = r - -4.2. Which is the fourth smallest value? (a) 4 (b) -0.2 (c) 1 (d) j	{ "pile_set_name": "DM Mathematics" }
4.95725 - 2.16165. Let d = 19.79513 - s. Let h = 53 + d. What is h rounded to 4 decimal places? -0.0005 Let h = 1302 - 1291.03. Let x = -15 + 4. Let y = x + h. Round y to 1 dp. 0 Let y = 1278 - 1277.9143. Let o = y - 0.087. Round o to four decimal places. -0.0013 Suppose -644 = -9h + 1354. Let w = -79 + h. Round w to the nearest ten. 140 Suppose 2o = -4, -q = -6q + 4o - 22. Let l be 3096613/39 + 2/q. Round l to the nearest 10000. 80000 Let f = -5.49 + -87.91. Let c = 57 - -17. Let a = f + c. What is a rounded to 0 decimal places? -19 Let d = -49499468.82 - -49499438.81999903. Let o = 30 + d. Round o to 7 decimal places. -0.000001 Let v(g) = -3g2 - g + 3 + 2 + 4g. Let f = 33 - 39. Let a be v(f). Round a to the nearest 10. -120 Let o(p) be the second derivative of -20p4/3 + 13p*3/6 - 2p*2 - 43p. Let m be o(-12). Round m to the nearest one thousand. -12000 Let w = -0.0202 - -0.3692. What is w rounded to two decimal places? 0.35 Let a = 5.9 + 23.1. Let b = a - 29.071. What is b rounded to 2 decimal places? -0.07 Suppose 0i + 5j = -5i + 40, 2i = 5j - 19. Suppose -5g + 301 = im, 2m - m = -4g + 238. Round g to the nearest 10. 60 Let s = 0.24 - 0.23999721. Round s to 6 dps. 0.000003 Let f = 2.53 - 2.3. Let w = -23.640594 + 23.4107. Let a = w + f. Round a to 5 decimal places. 0.00011 Let y = -160.10000706 - -160.1. Round y to five decimal places. -0.00001 Let z be 24/(-18) + 932/6. Round z to the nearest 10. 150 Let n = -409.99975 - -410. Round n to five dps. 0.00025 Let y be 5 + 01/(-6) + 3665. What is y rounded to the nearest 10000? 0 Let x = 95 - 36. Let u = x + -58.981. Round u to 3 decimal places. 0.019 Let l = -1408.59 - -1417. Let o = l - -1.19. Let i = o + -8.82. What is i rounded to 1 decimal place? 0.8 Suppose g + 3g = -4. Let v be ((-18)/4)/(g/60). Suppose -v = -n - 30. Round n to the nearest one hundred. 200 Suppose 3s = -s + 5y + 32, -y = 3s - 5. Let i be ((-12500)/s)/(-2)-3504. Round i to the nearest one million. -7000000 Let b = 668.66602 - 0.06602. What is b rounded to the nearest 10? 670 Let n = -58 - -58.011. Let q = -8509 + 8514.189. Let r = q + n. What is r rounded to zero dps? 5 Let o = -31.7149 - -31.7. What is o rounded to three decimal places? -0.015 Let f be (-4)/(-6)6/(-1). Let o be 2615265/f. Let k = o - -73815. Round k to the nearest 100000. -100000 Let u = -9.9 - -63.9. Let f = u - 54.0054. Round f to 3 dps. -0.005 Let b = 19 - 19. Suppose bk = -4k + 56. Let w = -34 - k. Round w to the nearest 10. -50 Let v = 35 - 38.25. Let y = v - -3. Let h = y + 0.2528. Round h to three dps. 0.003 Let y = 16.4149974 + -16.495. Let q = -0.08 - y. Round q to 6 decimal places. 0.000003 Let x be ((-25)/2)/(6/(-3886752)). Let q = 14097400 - x. Round q to the nearest one million. 6000000 Suppose -2a = 6, 0 = -3b - 3a - 0 + 6. Suppose 0 = -bp - p - 17460000. Round p to the nearest 100000. -2900000 Let s = -570293 + 570447.0001. Let k = 154 - s. Round k to 3 decimal places. 0 Let s be (-38270)/(-4)8/5. Suppose 5q - q + s = 3h, 5h - 25510 = 5q. What is h rounded to the nearest one thousand? 5000 Suppose y - 19 = 1. Let d = y + -20. Suppose -4g - 5t - 100 = d, -g - 4g - 4t = 116. Round g to the nearest ten. -20 Suppose 3k + 23302 = 185716. Suppose p - 3p - k = 0. Let z = p - -15769. What is z rounded to the nearest 1000? -11000 Suppose 2c + 3 = -4n + 7c, n + 4c - 15 = 0. Suppose -4m + 5x = 53724 + 114691, -5m - 210491 = nx. What is m rounded to the nearest 10000? -40000 Suppose 3n - 10176 = 9n. Let f = -486 - n. What is f rounded to the nearest one hundred? 1200 Let i = -49 + 48.99574. What is i rounded to three decimal places? -0.004 Let d = 2 - -100. Let u = 102.265 - d. What is u rounded to 2 decimal places? 0.27 Let h(i) = 6492i + 168. Let t be h(-4). What is t rounded to the nearest 10000? -30000 Let d = -194.16 - -190. Let z = -4.3 - -0.3. Let k = d - z. Round k to one decimal place. -0.2 Let l = -1047 + 1046.98043. Let k = -0.019 - l. What is k rounded to 4 decimal places? 0.0006 Let g = 160.9899 - 161. Round g to three decimal places. -0.01 Let v = -244019644.04779923 - 1316627.95201977. Let p = -245336575 - v. Let s = 303 + p. Round s to five dps. -0.00018 Let t(p) = 150375p - 16. Let x be t(-6). Let r = 191377 + x. Let j = r + 1510889. What is j rounded to the nearest one million? 1000000 Let w(c) = 1753c*2 + 66c + 5. Let d be w(-5). Round d to the nearest ten thousand. 40000 Let d = -37 + 37.086. Let q = -0.07 + d. Let v = -0.079 + q. What is v rounded to two decimal places? -0.06 Let l = 72.28 - 1.28. Let r = l - 70.9999961. What is r rounded to 6 dps? 0.000004 Let v = 1107 + -1106.9998917. Round v to five decimal places. 0.00011 Let l = -2.125767 - 17.677573. Let p = l - -19.8. What is p rounded to 3 decimal places? -0.003 Let b = -9.279 + 7.6322. Let j = 1.7 + b. Round j to two dps. 0.05 Let s = 12 + 5. Let v = s - 35. Let j = v - -17.98. What is j rounded to one dp? 0 Suppose 0 = 3k + 15, 5f + 28 = 7f - 4k. Suppose -5b = -5g + 89999990, g + 90000002 = -b - fb. Round b to the nearest 1000000. -18000000 Suppose -k - 5k + 198719676 = 0. Let h be k/(-144) + (-3)/8. What is h rounded to the nearest 100000? -200000 Let z = 0.126 - -2.874. Let n = 2.66932085 + 0.33067385. Let d = n - z. What is d rounded to six decimal places? -0.000005 Let l = 2198.592 + -2207. Let k = l + 0.008. Round k to the nearest integer. -8 Let h = 12557 + -12021.9. Let a = -174 + h. Let b = 339 - a. What is b rounded to the nearest integer? -22 Let m(c) = -196692c2 + 7c + 15. Let w(s) = 196693s2 - 7s - 16. Let o(i) = -2m(i) - 3w(i). Let d be o(11). Round d to the nearest one million. -24000000 Let p = 1029.52 - 1016. Round p to one dp. 13.5 Let i = 1.086 + -0.93. Let x = 1.104 + i. What is x rounded to one dp? 1.3 Let g = -54 - -54.108. Let w = g + 57.892. Let k = 58.0053 - w. Round k to 3 dps. 0.005 Let m = -2.54 + 2.539999948. Round m to seven decimal places. -0.0000001 Let n = -0.57846 + 0.9835122. Let s = n + -0.405. Round s to five decimal places. 0.00005 Let r = 125 - 519. What is r rounded to the nearest 10? -390 Let b = -2.12 + 0.104. Let u = 0.066 + b. Let d = u + 1.94999817. What is d rounded to 7 dps? -0.0000018 Let x = -237.73 - -238. Round x to one dp. 0.3 Let c(j) = 11j + 68. Let w be c(-7). Let v be (2/w)/((-16)/72). Round v to one dp. 1 Let n(c) = c2 + 4c - 4. Let o be n(-4). Let b(g) be the first derivative of 237499g3/3 - 2g*2 - 27. Let h be b(o). Round h to the nearest 1000000. 4000000 Suppose -23s = 1922433165 - 595793165. Round s to the nearest 1000000. -58000000 Let b = 1757 + -851. Let d = -1002 - 1044. Let c = b + d. Round c to the nearest 100. -1100 Suppose 0 = 4s - 6 - 14, -17 = -4t - 5s. Let p be t/7 - (-5)/((-210)/(-222)). Round p to 0 decimal places. 5 Let i = 1.26 + 51.74. Let t = -52.952 + i. Round t to one dp. 0 Let z = 0.081 + 243.919. Let b = z + -244.0000121. What is b rounded to 6 dps? -0.000012 Let c = 645392732 - 645391906.999503. Let m = c + -825. What is m rounded to 4 dps? 0.0005 Let w = -59.78345 - -59.8. Let b = w - 0.018. Round b to 4 dps. -0.0015 Let k = 0.88612 - 0.366748. Let i = -0.52 + k. What is i rounded to four dps? -0.0006 Let k be ((-20)/(-10))/((-2)/(-3)). Suppose kw - 5w + 8 = 0, 4a = -3w + 12. What is a rounded to the nearest ten thousand? 0 Let q = -13 - 0.2. Let i = 14.4 + -11. Let o = i + q. Round o to the nearest integer. -10 Let g(j) = -j2 + 11j + 4. Let v be g(11). Suppose 3i = -vs + 368, i + s - 121 = -0s. Let k = i - -54. Round k to the nearest one hundred. 200 Let t = -75.02 + 73. Let a = t + 0.8. Round a to 1 decimal place. -1.2 Let v = 221.99812 + -222. What is v rounded to four decimal places? -0.0019 Suppose -28n = -26n - 140840000. Round n to the nearest one million. 70000000 Let h = -879 - -1585. Let u = h - 1008. Let o = u + 302.00000137. What is o rounded to 7 dps? 0.0000014 Let u = -193.0462 + 192.8. What is u rounded to two dps? -0.25 Let q = -302.236 - -309.7. Round q to the nearest integer. 7 Let i = -0.916 + 38.266. Round i to 0 dps. 37 Suppose -3y = -y - 1382. Suppose b + y = 2*b. Let h = b - 1391. Round h to the nearest one thousand. -1000 Let j = 5.839 - 5.9. Let m = -0.	{ "pile_set_name": "DM Mathematics" }
is divided by 9. 6 Suppose -13 = 4u - 89. Calculate the remainder when u is divided by 8. 3 Let d(y) = -y2 - 10y - 4. Let g be d(-9). Suppose -gz = -11 + 26. Calculate the remainder when 29 is divided by 91 - z/3. 9 Let t(c) = -c*3 + 6c*2 + 5c - 4. Let d be t(6). Let a = 15 - d. Let i(p) = -3p - 3. Calculate the remainder when i(a) is divided by 16. 14 Suppose 0w = -2w. Suppose w = -5t + s - 3, -5 + 0 = -t + 3s. Let b = t + 24. What is the remainder when b is divided by 8? 7 Suppose -3c + 6c + 27 = 0. What is the remainder when 9 is divided by (-14)/63 - 47/c? 4 Let a be -214(-3)/12. Suppose 0 = -2w + aw. Suppose 3x = -wx + 3. What is the remainder when 2 is divided by x? 0 Suppose -n + 4n = 123. Let o = 28 - 17. What is the remainder when n is divided by o? 8 Suppose -7 + 2 = c. Let v(r) = -r*3 - 3r*2 + 6r - 4. Let w = 7 - -2. Calculate the remainder when v(c) is divided by w. 7 Let v(h) = h*3 + 6h*2 + h - 3. Calculate the remainder when 46 is divided by v(-4). 21 Let w = -84 + 119. What is the remainder when w is divided by 9? 8 Let p = -8 - -18. Suppose -g - 2 = -3n - 0, -5g = 5n + p. Suppose n = r + 3 - 12. Calculate the remainder when 34 is divided by r. 7 Let y(k) = -2k2 - 3k - 3. Let z be y(-5). Let n = z - -66. Calculate the remainder when n is divided by 15. 13 Let a = 12 - 8. What is the remainder when (-42)/(-8) + (-3)/12 is divided by a? 1 Suppose -j + 6 + 3 = 0. Suppose -i + j - 2 = 0. What is the remainder when i is divided by 4? 3 Let y = -2 - -3. Let k be y/6 + 263/6. Suppose 0 = -4r + 12 + k. Calculate the remainder when 41 is divided by r. 13 Suppose 3d = 36 + 33. Calculate the remainder when 1/1 + 0 + 88 is divided by d. 20 Suppose -40m = -41m + 11. Let i = -5 - -37. Calculate the remainder when i is divided by m. 10 Suppose -2l + 4l - 22 = 0. Let z = l + 4. What is the remainder when 482/11 + (-4)/(-22) is divided by z? 14 Suppose -x = -0x - 5. Suppose -2l - 1 = 3, -4c - 2l + 72 = 0. What is the remainder when c is divided by x? 4 Let i(b) = -b*2 - 9b - 3. Calculate the remainder when 40 is divided by i(-6). 10 Suppose -6u + 56 = -u - 4b, u - b - 12 = 0. Let r = 21 - u. Suppose -2n = -0n - 74. Calculate the remainder when n is divided by r. 11 What is the remainder when (4 + -3)/((-3)/(-435)) is divided by 37? 34 Suppose -280 + 97 = -3d + 4q, -4d + 244 = 5q. Calculate the remainder when d is divided by 11. 6 Let q(v) = 2v3 + 3v2 - 1. Let s be q(-2). Let h(n) = -n3 - 6n2 - 5n - 5. Let r be h(s). What is the remainder when 8 is divided by (r + 1 - -1)-1? 2 Suppose t = 4u - 30 - 27, 0 = 3u + 2t - 29. Calculate the remainder when u is divided by 3. 1 Suppose 4o - 5i - 150 = 7, 3o + 4i - 110 = 0. What is the remainder when o is divided by 20? 18 Calculate the remainder when (-18)/162 + (-559)/(-9) is divided by 21. 20 Let g = -2 - -1. Let c = 11 + g. Suppose 4w = 4d + 88, 2w - 2d - 26 = w. Calculate the remainder when w is divided by c. 8 Suppose -i + 4k + 29 = 0, 13 + 35 = 4i + k. Let l = 43 - i. Suppose p - 7 - 1 = 0. What is the remainder when l is divided by p? 6 Let z be 2/2 + (-6)/(-1). Let l(s) = -s + 4. Let f be l(6). What is the remainder when 23 is divided by 1/(-1 - f) + z? 7 Let x(u) = u + 13. Let y(j) = j*3 - 7j*2 + 5j + 8. Suppose 0 = 2o - 17 + 5. What is the remainder when x(-11) is divided by y(o)? 0 Let i(m) = 10m - 7. Let b be i(2). Let c = b + -5. Calculate the remainder when c is divided by 5. 3 Let a = 43 + 12. Calculate the remainder when a is divided by 8. 7 Let c = 15 + 34. What is the remainder when c is divided by 13? 10 What is the remainder when 42 is divided by (333/5)/3 + 11/(-55)? 20 Suppose -10d = -9d - 68. What is the remainder when d is divided by 24? 20 Suppose 3q + q = 300. Suppose 3v - q = -2v. What is the remainder when v is divided by 4? 3 Let s(a) = 40a*2 + 10a + 11. What is the remainder when 120 is divided by s(-1)? 38 Let p(d) = 41d3 - 1. Suppose c = -2c, 5c = 2x - 2. Let i be p(x). What is the remainder when 18 is divided by (2 - -1)i/12? 8 Suppose -27 = -4a + 9. Calculate the remainder when a is divided by 3. 0 Let g(h) = 2h2 + 4h + 1. Suppose 2p = -a - 2, 0 = 4a - 8a - 5p - 2. What is the remainder when a - (0 - 8 - 2) is divided by g(-3)? 5 Suppose 22 = -z + 3j, 2z + 0z + 29 = j. Let v = z + 29. Calculate the remainder when 61 is divided by v. 13 Let a(l) = -l2 + 6l + 8. What is the remainder when 2 is divided by a(7)? 0 Let t(c) = 7 - c + 2c + 3. Let o be t(-8). Calculate the remainder when (o + -3)2-4 is divided by 3. 2 Let b = -14 - -26. Suppose n + b = 2j, j - 5n + 1 = -11. Calculate the remainder when 22 is divided by j. 6 Suppose -62 = -2a + 68. Calculate the remainder when a is divided by 23. 19 Calculate the remainder when 9 is divided by 5 + ((-2)/3)/(10/15). 1 Let q = -9 - -8. Let y(z) = 2z2 - 3 + 2 + 3z*2. Calculate the remainder when 11 is divided by y(q). 3 Suppose 0 = 4m + 4q - 12, -3m + 0m + 2q = -19. Suppose mf + 25 = 0, -t + 2f = 4f - 58. What is the remainder when t is divided by 18? 14 Let c(l) = -l2 + 13l - 21. Calculate the remainder when 42 is divided by c(10). 6 Let y(t) = 8t2 + 1. Let c be y(-1). Suppose -5o + 1 = -c. What is the remainder when 3/(30/16) - (-18)/45 is divided by o? 0 Suppose 3c + 5i = 23, 0c + 3i = -2c + 14. Suppose 3x = -c + 7. Calculate the remainder when 2 is divided by x. 0 Suppose 2g - 50 = 5i, -2g - 5i + 12 = 2. Calculate the remainder when 27 is divided by g. 12 What is the remainder when 12 is divided by 3 + (1 - (1 + -2) - 0)? 2 Let c = -4 - -6. Suppose 0 = x + 7 - 6. Calculate the remainder when 2x/2 - -3 is divided by c. 0 Let l be 1/((-5)/3 + 2). Suppose -o - 4 = -lw + 7, 5w - 45 = -5o. Suppose -114 = -wz - 14. What is the remainder when z is divided by 11? 9 Let z(u) = -3u - 13. Calculate the remainder when 39 is divided by z(-9). 11 Let i(v) = 5v - 7. Calculate the remainder when 37 is divided by i(4). 11 What is the remainder when (-1)/(-3) + 770/21 is divided by 13? 11 Let o be ((-4)/(-12))/(2/36). Let q = o + 8. What is the remainder when 27 is divided by q? 13 Suppose -o + 5l + 36 = 0, -2o + 4l = -o - 33. What is the remainder when o is divided by 8? 5 Suppose 87 = -4o - 5u, -4o - 4u - 84 = -0o. Suppose 0 = -4c - c + 20, 4h + 2c = 56. What is the remainder when (-1045)/(-45) + 4/o is divided by h? 11 Calculate the remainder when 41 is divided by 98/(-21)(-3)/2. 6 Suppose 8r - 157 = 11. Calculate the remainder when 2(-2 - -1) + 64 is divided by r. 20 Calculate the remainder when 257/183 is divided by 5. 4 Let h = 35 - 12. What is the remainder when 91 is divided by h? 22 Let g be (-1 + -1)/((-4)/6). Suppose -2i = gi - 280. Calculate the remainder when i is divided by 19. 18 Calculate the remainder when 3 is divided by 2(9 - 7 - 1/2). 0 Suppose 102 = -5o + 247. Suppose -2j + 6j - 26 = -2b, j - o = -2b. Suppose -3w + 2w + b = 0. What is the remainder when 44 is divided by w? 14 Let p = -65 + 119. Calculate the remainder when p is divided by 14. 12 Let t(m) = 3m2 + m - 5. Calculate the remainder when t(4) is divided by 12. 11 Let d(o) = -o3 + 10o2 - 16o + 3. Let p = -4 - -7. Calculate the remainder when p is divided by d(8). 0 Let l(p) = -p*3 - 2p2 - p + 5. What is the remainder when l(-3) is divided by 9? 8 Let x(w) = w3 + w2 - 6. Let t be x(0). Let a(j) = j2 - 3. What is the remainder when a(t) is divided by 17? 16 Let q(f) = -f*3 - 9f*2 - 10f - 7. Calculate the remainder when 44 is divided by q(-8). 8 Let l(y) = 17y + 25. What is the remainder when l(14) is divided by 14? 11 Let k be ((-20)/8)/((-2)/100). Suppose -8 = -3f + f. Calculate the remainder when k/f - 2/8 is divided by 11. 9 What is the remainder when 5/(-15) - (-31)/3 is divided by 4? 2 Let s be (-6)/4 + 12/8. Suppose 3d - 3 = s, -2p + 21 = -0p - d. What is the remainder when 21 is divided by p? 10 Let r be 6(15/(-6) + 3). Suppose -h + 9 = 2n, -rh - 46 = -3n + 2h. What is the remainder when 17 is divided by n? 3 Let n(o) = o*3 + 6o*2 - 8o - 7. Calculate the remainder when 78 is divided by n(-6). 37 Suppose 0 = 5n - 3p + 106, -2*n - 60 =	{ "pile_set_name": "DM Mathematics" }
00. -490000 What is -1441.5107695 rounded to the nearest integer? -1442 What is 446012.4 rounded to the nearest ten thousand? 450000 Round -30300684300 to the nearest 1000000. -30301000000 What is 222463.782 rounded to the nearest ten thousand? 220000 What is -2014642.5681 rounded to the nearest one hundred thousand? -2000000 Round -60.88209 to the nearest 100. -100 What is -3065.48263 rounded to the nearest ten? -3070 Round 0.5004138821 to five dps. 0.50041 Round 0.0324748728 to 4 decimal places. 0.0325 What is 103.6731606 rounded to 1 decimal place? 103.7 Round -0.0003063563 to 5 dps. -0.00031 Round -10408906.2 to the nearest one million. -10000000 What is 373415.28 rounded to the nearest one hundred thousand? 400000 Round -218651.122 to the nearest 100. -218700 What is 0.01656149 rounded to four decimal places? 0.0166 What is 78.841603 rounded to 1 dp? 78.8 Round 0.0528073528 to 2 dps. 0.05 What is -1.53120965 rounded to four decimal places? -1.5312 Round 5464384800 to the nearest one million. 5464000000 Round -32.48426438 to 2 decimal places. -32.48 What is -0.0041184311 rounded to five dps? -0.00412 What is 64394050 rounded to the nearest one million? 64000000 Round 216554209 to the nearest one million. 217000000 Round -141003639 to the nearest 1000000. -141000000 Round 607.278491 to the nearest 10. 610 What is 2730.07763 rounded to the nearest integer? 2730 What is -1131830280 rounded to the nearest one million? -1132000000 Round 0.001309911921 to 6 decimal places. 0.00131 What is -0.000129089311 rounded to 5 dps? -0.00013 Round -0.000270665255 to six decimal places. -0.000271 What is 2.46442184 rounded to three decimal places? 2.464 What is -1899915.92 rounded to the nearest 1000? -1900000 What is -9339199.35 rounded to the nearest 100? -9339200 What is -264480102 rounded to the nearest one million? -264000000 Round 3043508.5 to the nearest one hundred thousand. 3000000 What is -0.00183697 rounded to five dps? -0.00184 Round 0.00130226632 to 6 dps. 0.001302 Round -26517330.95 to the nearest one million. -27000000 Round 789631.919 to the nearest one hundred thousand. 800000 Round 312531.4225 to the nearest 1000. 313000 What is -2247648 rounded to the nearest 1000000? -2000000 Round -30.90968017 to one decimal place. -30.9 Round -0.00419021328 to five dps. -0.00419 What is -0.0000002261232 rounded to seven decimal places? -0.0000002 Round -0.00018072925 to 6 decimal places. -0.000181 Round 69311.41976 to zero decimal places. 69311 Round -531610434.3 to the nearest 10000. -531610000 Round -16718.7545 to the nearest 1000. -17000 Round -494718137 to the nearest one hundred thousand. -494700000 What is 46528.652 rounded to the nearest 1000? 47000 Round 11.608649864 to the nearest integer. 12 Round 0.007265191 to four dps. 0.0073 Round 0.197391973 to five decimal places. 0.19739 Round 538.6879401 to two decimal places. 538.69 What is -6693787.659 rounded to the nearest 1000000? -7000000 Round -0.00000039829723 to seven decimal places. -0.0000004 What is 0.786916539 rounded to two dps? 0.79 Round -0.000000152074444 to seven dps. -0.0000002 Round -0.0012154361772 to 5 decimal places. -0.00122 Round -17251.7108 to the nearest 100. -17300 Round -163.2610708 to the nearest 10. -160 What is -0.0567359008 rounded to 2 dps? -0.06 Round 1837.92031 to 1 dp. 1837.9 What is -0.0232668962 rounded to five decimal places? -0.02327 Round -0.000009152498 to 6 decimal places. -0.000009 What is -1.521803613 rounded to 2 decimal places? -1.52 What is -0.00063684588 rounded to 7 dps? -0.0006368 Round -1759.855753 to one dp. -1759.9 Round -6294.992023 to zero dps. -6295 Round 307.9563637 to the nearest integer. 308 Round -11.01463612 to 3 dps. -11.015 What is -420.0622987 rounded to one decimal place? -420.1 What is -0.000091287043 rounded to 6 dps? -0.000091 What is -0.002422173759 rounded to 6 dps? -0.002422 Round 5661033.861 to the nearest 10000. 5660000 Round 192.925443 to the nearest integer. 193 What is 0.0000065294614 rounded to 7 dps? 0.0000065 What is -562.01708 rounded to 1 dp? -562 Round -26569.5503 to 0 decimal places. -26570 What is 343965.523 rounded to the nearest 10? 343970 Round -994.773608 to the nearest 100. -1000 What is 257.90724 rounded to the nearest one hundred? 300 Round 32525548 to the nearest 10000. 32530000 What is 862467.35 rounded to the nearest 1000? 862000 Round 542.84413 to the nearest ten. 540 What is 7.814275 rounded to one decimal place? 7.8 Round -4.07324064 to four decimal places. -4.0732 What is -0.0007475604616 rounded to 4 decimal places? -0.0007 Round -2514.89415 to the nearest 100. -2500 What is -0.0000021366459 rounded to seven dps? -0.0000021 Round -0.00051659078 to seven decimal places. -0.0005166 What is 7104523.401 rounded to the nearest 1000000? 7000000 Round 8238390460 to the nearest 100000. 8238400000 What is 4747.5259 rounded to 0 dps? 4748 What is -638.417605 rounded to the nearest one hundred? -600 Round -0.522353643 to 3 decimal places. -0.522 What is 381821.417 rounded to the nearest 100? 381800 What is 0.0000117643117 rounded to seven dps? 0.0000118 Round -9945445.5 to the nearest one thousand. -9945000 Round 189756653.3 to the nearest ten thousand. 189760000 Round 0.071136921 to two decimal places. 0.07 Round -26274.6601 to the nearest ten thousand. -30000 Round -0.057273233 to five decimal places. -0.05727 What is -0.00063188894 rounded to 6 decimal places? -0.000632 Round 849152990 to the nearest one million. 849000000 Round -89514465 to the nearest 1000000. -90000000 What is -8618549.6 rounded to the nearest 1000000? -9000000 What is -21.28257093 rounded to 1 decimal place? -21.3 Round 471.319023 to zero dps. 471 What is 0.0125092785 rounded to three dps? 0.013 What is -0.00001081030486 rounded to 7 dps? -0.0000108 Round -23224586590 to the nearest one million. -23225000000 Round 0.0025273013 to four decimal places. 0.0025 What is 0.0006437406 rounded to six decimal places? 0.000644 What is -0.01027353806 rounded to four decimal places? -0.0103 Round -326.283217 to the nearest one hundred. -300 What is -0.00005948461 rounded to 6 decimal places? -0.000059 What is 2.31388546 rounded to 1 decimal place? 2.3 Round 1601271.812 to the nearest one thousand. 1601000 What is 0.0634302441 rounded to 2 dps? 0.06 What is 41339.5104 rounded to the nearest 100000? 0 What is 0.078134165 rounded to 5 decimal places? 0.07813 Round 51046.6103 to the nearest 10. 51050 What is 12.9499998 rounded to one decimal place? 12.9 Round -51063068.4 to the nearest one million. -51000000 What is 3322447.99 rounded to the nearest 1000000? 3000000 Round 0.0000239351934 to 6 dps. 0.000024 Round 0.00000675555464 to seven dps. 0.0000068 What is 0.000593328655 rounded to 6 decimal places? 0.000593 What is 1317141.971 rounded to the nearest 1000? 1317000 What is -14.1456261 rounded to 2 dps? -14.15 Round -18.7557505 to zero dps. -19 What is -0.42881213 rounded to two decimal places? -0.43 Round -214.790795 to zero decimal places. -215 What is 0.0000836093504 rounded to 6 dps? 0.000084 What is -0.00659411383 rounded to 7 dps? -0.0065941 What is -1115986.727 rounded to the nearest one hundred? -1116000 What is -0.00279491306 rounded to seven decimal places? -0.0027949 Round -290131.4695 to the nearest one thousand. -290000 What is 4970021.14 rounded to the nearest one hundred thousand? 5000000 Round -7681.61 to the nearest 10000. -10000 What is 0.09149385 rounded to four decimal places? 0.0915 Round -0.35359357 to four decimal places. -0.3536 What is -0.0011480546424 rounded to 4 decimal places? -0.0011 Round 29683.75691 to zero dps. 29684 Round 66670296.7 to the nearest 1000. 66670000 What is -9145.7776 rounded to zero dps? -9146 Round -15669147610 to the nearest 1000000. -15669000000 What is 21763.89644 rounded to the nearest one hundred? 21800 Round 72575.818 to the nearest one thousand. 73000 What is 2419027.621 rounded to the nearest ten thousand? 2420000 What is -153168920 rounded to the nearest 100000? -153200000 What is -0.00004620924 rounded to four dps? 0 What is 4075337.8 rounded to the nearest ten thousand? 4080000 What is -295.296412 rounded to the nearest one hundred? -300 Round -7580680800 to the nearest 1000000. -758100000	{ "pile_set_name": "DM Mathematics" }
3? 1 What is the thousands digit of 9659? 9 What is the hundreds digit of 1461? 4 What is the hundreds digit of 2319? 3 What is the ten thousands digit of 10780? 1 What is the hundreds digit of 3477? 4 What is the thousands digit of 5493? 5 What is the tens digit of 13773? 7 What is the units digit of 2524? 4 What is the tens digit of 2297? 9 What is the thousands digit of 58023? 8 What is the hundreds digit of 158316? 3 What is the tens digit of 220? 2 What is the tens digit of 6263? 6 What is the tens digit of 4195? 9 What is the units digit of 6469? 9 What is the units digit of 276? 6 What is the hundreds digit of 1309? 3 What is the ten thousands digit of 10481? 1 What is the tens digit of 4766? 6 What is the tens digit of 5178? 7 What is the thousands digit of 3410? 3 What is the tens digit of 17204? 0 What is the hundreds digit of 629? 6 What is the units digit of 4235? 5 What is the tens digit of 728? 2 What is the tens digit of 2708? 0 What is the thousands digit of 1210? 1 What is the tens digit of 24939? 3 What is the units digit of 6507? 7 What is the hundreds digit of 1044? 0 What is the tens digit of 10564? 6 What is the hundreds digit of 3549? 5 What is the hundreds digit of 4143? 1 What is the tens digit of 2341? 4 What is the ten thousands digit of 12957? 1 What is the units digit of 258? 8 What is the tens digit of 8986? 8 What is the tens digit of 1309? 0 What is the units digit of 40113? 3 What is the hundreds digit of 578? 5 What is the hundreds digit of 355? 3 What is the units digit of 526? 6 What is the ten thousands digit of 10401? 1 What is the thousands digit of 1849? 1 What is the units digit of 85334? 4 What is the ten thousands digit of 26272? 2 What is the ten thousands digit of 12544? 1 What is the thousands digit of 21405? 1 What is the tens digit of 795? 9 What is the hundreds digit of 36785? 7 What is the hundreds digit of 8478? 4 What is the tens digit of 9540? 4 What is the hundreds digit of 14768? 7 What is the units digit of 49160? 0 What is the tens digit of 473? 7 What is the ten thousands digit of 137728? 3 What is the hundreds digit of 17523? 5 What is the hundreds digit of 4970? 9 What is the tens digit of 139309? 0 What is the hundreds digit of 1181? 1 What is the thousands digit of 2401? 2 What is the tens digit of 8305? 0 What is the units digit of 10001? 1 What is the tens digit of 3963? 6 What is the units digit of 2942? 2 What is the units digit of 50182? 2 What is the tens digit of 36154? 5 What is the units digit of 2028? 8 What is the hundreds digit of 51977? 9 What is the thousands digit of 26451? 6 What is the units digit of 657? 7 What is the tens digit of 2668? 6 What is the thousands digit of 1479? 1 What is the thousands digit of 3355? 3 What is the ten thousands digit of 56076? 5 What is the hundreds digit of 438? 4 What is the hundreds digit of 539? 5 What is the thousands digit of 140847? 0 What is the units digit of 1577? 7 What is the units digit of 742? 2 What is the hundred thousands digit of 142318? 1 What is the ten thousands digit of 28105? 2 What is the tens digit of 970? 7 What is the hundreds digit of 8679? 6 What is the hundreds digit of 2787? 7 What is the tens digit of 1467? 6 What is the thousands digit of 42353? 2 What is the units digit of 3604? 4 What is the hundreds digit of 12693? 6 What is the hundreds digit of 1163? 1 What is the units digit of 2328? 8 What is the units digit of 1910? 0 What is the units digit of 772? 2 What is the tens digit of 422? 2 What is the tens digit of 5530? 3 What is the hundreds digit of 987? 9 What is the thousands digit of 52950? 2 What is the tens digit of 31511? 1 What is the hundreds digit of 133288? 2 What is the units digit of 586? 6 What is the hundreds digit of 9773? 7 What is the hundreds digit of 7992? 9 What is the tens digit of 867? 6 What is the units digit of 5127? 7 What is the units digit of 4314? 4 What is the thousands digit of 1793? 1 What is the thousands digit of 4318? 4 What is the units digit of 3694? 4 What is the units digit of 3303? 3 What is the units digit of 757? 7 What is the ten thousands digit of 30640? 3 What is the tens digit of 517? 1 What is the ten thousands digit of 45953? 4 What is the units digit of 3332? 2 What is the hundreds digit of 942? 9 What is the tens digit of 15169? 6 What is the units digit of 760? 0 What is the tens digit of 4064? 6 What is the thousands digit of 69101? 9 What is the thousands digit of 3021? 3 What is the thousands digit of 65157? 5 What is the units digit of 4180? 0 What is the units digit of 64863? 3 What is the thousands digit of 22081? 2 What is the tens digit of 6406? 0 What is the ten thousands digit of 51576? 5 What is the tens digit of 8341? 4 What is the thousands digit of 133414? 3 What is the units digit of 531? 1 What is the tens digit of 2203? 0 What is the units digit of 12075? 5 What is the hundreds digit of 16243? 2 What is the thousands digit of 4566? 4 What is the hundreds digit of 5761? 7 What is the units digit of 2395? 5 What is the ten thousands digit of 13811? 1 What is the hundred thousands digit of 114958? 1 What is the tens digit of 2996? 9 What is the hundreds digit of 12955? 9 What is the units digit of 4798? 8 What is the tens digit of 11070? 7 What is the ten thousands digit of 52794? 5 What is the hundreds digit of 944? 9 What is the hundreds digit of 1882? 8 What is the units digit of 45337? 7 What is the thousands digit of 6258? 6 What is the tens digit of 13896? 9 What is the thousands digit of 6630? 6 What is the ten thousands digit of 11474? 1 What is the units digit of 7605? 5 What is the tens digit of 3981? 8 What is the units digit of 103? 3 What is the tens digit of 10289? 8 What is the tens digit of 2435? 3 What is the hundreds digit of 1023? 0 What is the hundreds digit of 3004? 0 What is the units digit of 385? 5 What is the tens digit of 738? 3 What is the thousands digit of 23136? 3 What is the thousands digit of 3473? 3 What is the tens digit of 87269? 6 What is the thousands digit of 38392? 8 What is the thousands digit of 3698? 3 What is the hundred thousands digit of 146619? 1 What is the hundreds digit of 735? 7 What is the hundreds digit of 57539? 5 What is the units digit of 308? 8 What is the hundreds digit of 1702? 7 What is the thousands digit of 198658? 8 What is the units digit of 343? 3 What is the units digit of 308? 8 What is the ten thousands digit of 17355? 1 What is the hundreds digit of 4275? 2 What is the thousands digit of 7923? 7 What is the hundreds digit of 639? 6 What is the tens digit of 78? 7 What is the hundreds digit of 79045? 0 What is the ten thousands digit of 54095? 5 What is the hundreds digit of 5493? 4 What is the hundreds digit of 38399? 3 What is the tens digit of 15701? 0 What is the tens digit of 4960? 6 What is the hundreds digit of 571? 5 What is the ten thousands digit of 14755? 1 What is the hundreds digit of 5126? 1 What is the units digit of 36659? 9 What is the ten thousands digit of 21736? 2 What is the thousands digit of 32902? 2 What is the tens digit of 9443? 4 What is the hundreds digit of 1622? 6 What is the units digit of 37673? 3 What is the tens digit of 4050? 5 What is the tens digit of 94? 9 What is the thousands digit of 1460? 1 What is the units digit of 8391? 1 What is the hundred thousands digit of 129329? 1 What is the units digit of 774? 4 What is the tens digit of 15904? 0 What is the hundreds digit of 970? 9 What is the tens digit of 40819? 1 What is the hundreds digit of 42312? 3 What is the ten thousands digit of 16861? 1 What is the thousands digit of 2237? 2 What is the hundreds digit of 13088? 0 What is the thousands digit of 7368? 7 What is the units digit of 4776? 6 What is the thousands digit of 9477? 9 What is the thousands digit of 5752? 5 What is the units digit of 684? 4 What is the units digit of 1861? 1 What is the ten thousands digit of 16797? 1 What is the units digit of 18774? 4 What is the ten thousands digit of 129984? 2 What is the units digit of 20231? 1 What is the thousands digit of 6210? 6 What is the tens digit of 1080? 8 What is the tens digit of 810? 1 What is the units digit of 79224? 4 What is the tens digit of 328? 2 What i	{ "pile_set_name": "DM Mathematics" }
) = -7b + 6. Let l(n) = -6a(n) - 17s(n). Let q(j) = -8j + 7. Calculate 6l(m) - 5q(m). -2m + 1 Let d(o) = o2 - 6o + 3. Let t be d(5). Let a(f) = f - 1. Let g(k) be the second derivative of 2k3 - 11k*2/2 + 110k. Give tg(l) + 22a(l). -2l Let k(u) = u - 10. Let p(a) be the first derivative of -a - 400. Calculate -k(f) + 6p(f). -f + 4 Let c(t) = -t*2 - t - 2. Let h(f) = 106f*3 + 5f*2 + 5f + 12. What is 5c(u) + h(u)? 106u*3 + 2 Let q = -20 + 22. Let f(s) = 6s*3. Let b be -73(-2 - -3)-1. Suppose 0 = -5x - 6z + 3z + b, -x + 18 = 4z. Let h(r) = -r3. Calculate qf(c) + xh(c). -2c*3 Let m(x) be the first derivative of -3x + 1 - x*2 + 1 + 3x*2. Let t(r) = -23r + 17. Let z be (-1024)/(-30) - 38/598521. Calculate zm(u) + 6t(u). -2u Let x(o) = -13o + 90. Let f(y) = 3y - 23. Calculate 23f(z) + 6x(z). -9z + 11 Suppose 5z - 28 = 3p, -z + 2p + 2 = -5. Let k(n) = 2n2 - 4n + 1. Let r(a) = 4a2 - 8a + 3. Give zk(t) - 2r(t). 2t2 - 4t - 1 Let z = 35 - 34. Let y(j) = j*3 - 1. Let c(f) = 8f*3 - f - 5. Determine zc(g) - 6y(g). 2g*3 - g + 1 Let i(d) be the second derivative of 1/12d*4 - 1/6d*3 + 0 + 15d + 1/2d2. Let k(l) = -7l*2 + 6l - 4. Determine 5i(q) + k(q). -2q2 + q + 1 Let w(s) = s3 - 6s2 - 7s + 2. Let i be w(7). Let t(k) = i - 1 + 3 + 3k. Let p(m) be the first derivative of 2m*2 + 5m - 1. What is -2p(h) + 3t(h)? h + 2 Let z(x) = -x*3 - 11x*2 + 8x - 11. Let d(n) = n*2 + n + 1. Calculate 22d(k) + 2z(k). -2k*3 + 38k Let s(z) = -z3 - 5. Let g(q) be the second derivative of q5/20 + 3q2 - 139q + 1. Suppose 0 = 2x + x - 12. Give xg(h) + 5s(h). -h3 - 1 Let r be (-12)/24 - (-9)/(-6). Let u(m) be the first derivative of -3m*2 - 6m + 3. Let g(b) = b + 1. Give ru(j) - 10g(j). 2j + 2 Let t(j) = 12j. Let g(o) = -o + 1276 + 9o - 1276. Calculate -8g(y) + 5t(y). -4y Let p(n) = n*2 + n - 1. Let s(w) = 2w*3 + 4w*2 + 7w + 6. Calculate 4p(u) - s(u). -2u*3 - 3u - 10 Let k(f) = 7 - 4 + f*2 - 7 + 4. Let o(c) = -9c*2 + 3c. Give -6k(b) - o(b). 3b*2 - 3b Let k(g) be the second derivative of 0g3 + 0 - 1/12g*4 + 0g*2 + 22g. Let f(w) = w*3 + 6w*2. What is -f(x) - 6k(x)? -x*3 Let f(n) = 4n*3 - 3n*2 - 8. Let x(r) = -4r*3 + 4r*2 + 10. What is -4f(l) - 3x(l)? -4l*3 + 2 Suppose -5t = -14t + 63. Let g(v) = 2 - 5v + v - 3 + t. Let c(m) be the second derivative of m*3/2 - 2m*2 + 6m. Calculate -7c(l) - 5g(l). -l - 2 Let y(p) be the third derivative of -47p4/24 - 219p*2 - 2. Let n(u) = -31u. Give -8n(i) + 5y(i). 13i Suppose -4p = -k + 181, 0p - 3k = -5p - 228. Let n(o) = -5o. Let f(a) = -110a. Give pn(r) + 2f(r). 5r Let o(m) = m + 1. Let l(c) = -14c - 7. Suppose -7 = -3f + 8. What is fo(i) + l(i)? -9i - 2 Let n(x) = -x*3 + 3x*2 + x - 1. Let t(o) be the second derivative of 5/12o*4 - 46o + 0 - 1/10o5 - 1/2o*2 + 1/3o*3. Determine 5n(g) - 3t(g). g3 - g - 2 Let p(j) = 5j3 + j2 + 9j. Let a(v) = v3 - 3v. Let m(h) = -h*3 + 7h. Let y(b) = -2a(b) - m(b). Determine -p(f) - 3y(f). -2f3 - f2 - 6f Let n(c) = -23c2 - 8c + 4. Let o(y) = -25y2 - 8y + 6. Calculate 3n(z) - 2o(z). -19z2 - 8z Let g(b) be the first derivative of b3/3 + b2/2 - 22. Let s(o) = 6o2 + 10o. Suppose 0 = -2t - 6 - 0, -2t = -2w - 14. Give wg(r) + s(r). -4r2 Let w be (1 + 3)/(2/(-4)). Let p be (4/8)/(2/12). Let g(r) = 51r*2 - 143r*2 + 43r*2 + 50r*2 - 3. Let k(f) = 2f*2 - 8. Determine pk(z) + wg(z). -2z*2 Let h(x) = 5x*2 + 5x + 59. Let k(p) = 2p2 + 2p + 22. Let a(m) = 3h(m) - 8k(m). Let q = -2 - -4. Let t(l) = -6l2 + 4. Determine qa(b) - t(b). 4b2 - 2b - 2 Let a(r) be the first derivative of -r2/2 - 5540. Let q = 7 + -14. Let d(u) = -u2 - 3u. Give qa(w) + 2d(w). -2w*2 + w Let f(x) = 2x + 1. Let k(m) = -9m + 10. Give 2f(o) - k(o). 13o - 8 Let x(q) = 3q*2 + 2q - 2. Suppose 3s + 2s + 29 = 3l, 2s - l = -11. Let w(d) = -1. Give sw(z) + x(z). 3z*2 + 2z + 2 Let k(x) = 16 - 4x + x + 2x + 11x. Let y(w) = 3w + 5. Let a = 33 - 26. What is ay(t) - 2k(t)? t + 3 Let t(g) = 5g2 - 2g - 1. Let b(j) = -6j2 + 3j + 1. Suppose 0u + u + 51 = 0. Let d be (-3 - u/15)5. What is db(m) + 3t(m)? 3m2 - 1 Let r(s) = -s - 5 + 2s + 2 + 4. Let k(o) = 2o - 6. Let v(t) = -3t + 7. Let z(a) = -5k(a) - 4v(a). Determine -3r(c) + 2z(c). c + 1 Let y(u) = -u*2 - 53u + 421. Let t(w) = 12w - 105. Determine -9t(o) - 2y(o). 2o*2 - 2o + 103 Let a(q) = -1 + 14q - 31q + 16q. Let r(b) = 3b*2 - 6b - 5. Determine 4a(o) - r(o). -3o*2 + 2o + 1 Let u(w) be the second derivative of 8w3/3 - 5w*2/2 + 328w. Let x(r) = -8r + 3. Give 4u(d) + 7x(d). 8d + 1 Let m(o) = -15o2 + 32o + 194. Let f(v) = -3v2 + 6v + 39. Calculate -11f(p) + 2m(p). 3p2 - 2p - 41 Let z be (-10 + 8)/((-4)/(-12)). Let f(x) = -7x3 + 6x*2 - 3x + 2. Let m(r) = r3 - r2. Calculate zm(k) - f(k). k3 + 3k - 2 Let j(v) = -7v2 + 36v - 4. Let i(a) = 2a2 + a + 2. What is -2i(x) - j(x)? 3x2 - 38x Let g(d) be the first derivative of -2d2 + 3d - 264. Let y(i) = -5i + 2. What is 6g(b) - 5y(b)? b + 8 Let p(k) = 59k - 63k + 7k. Let i(r) = r - 1. Suppose 2o = -4t + o - 9, -2o = -5t - 8. Calculate ti(q) + p(q). q + 2 Let l(z) = -340z - 10. Let n(v) = -339v - 13. Give -5l(b) + 4n(b). 344b - 2 Let w(y) = 5y - 3. Suppose 17o - 39 = 29. Let x(a) be the second derivative of -a3/6 + a2/2 + 4a. What is ox(z) + w(z)? z + 1 Let j(x) = -137x2 + 6x + 3 + 67x2 + 74x*2 - 3x - 4x. Let r(f) = 17f*2 - 5f + 12. Calculate 9j(d) - 2r(d). 2d2 + d + 3 Let o(p) = -11p*2. Let i(m) = -75m*2. Determine 2i(l) - 15o(l). 15l2 Let g(a) = a2 - a. Let n be 3 - ((-1)/3 - (-19)/3). Let r(s) = -4s. Calculate ng(b) + r(b). -3b2 - b Let n(a) = -3a + 2. Let i(m) = 20m - 16. Let h(x) = -2i(x) - 14n(x). Let c be (-4 - (-6)/2)1. Let u(r) = 1. Calculate cu(p) + h(p). 2p + 3 Let b(s) = -3s3 + 2s + 2. Let k(d) be the first derivative of -2 + 0d3 - 7d + 5/2d4 - 7/2d*2. Suppose -18 + 14 = -u. Give uk(c) + 14b(c). -2c*3 Let c(o) = -8o*2 + 8o + 7. Let f be (-15)/(-10) - (-5)/10. Let d(w) = -w*2 + w + 1. Determine fc(n) - 14d(n). -2n*2 + 2n Let y(l) = 6l - 5. Let k(z) be the second derivative of 10z - 3z2 + 0 + 7/6z*3. Give -3k(a) + 4y(a). 3a - 2 Let i be 2 + 4/(-1) + (-72 - 0). Let d = i - -79. Let b(y) = -6y2 - 6y + 7. Let h(l) = -l*2 - l + 1. Determine dh(j) - b(j). j*2 + j - 2 Let h(y) = -4y*2 + 7y - 7. Let g = 1464 - 1470. Let f(k) = 3k2 - 6k + 6. Determine gf(o) - 5h(o). 2o2 + o - 1 Let o(w) = -w3 - 9w*2 - 15w + 20. Let g be o(-6). Let m(a) = -13a2 - 2a + 2. Let c(f) = -52f2 - 9f + 9. Give gc(d) - 9m(d). 13d2 Let p(d) = -29d*2 + 3. Let z(a) = 173a*2 - 17. What is -34p(g) - 6z(g)? -52g*2 Let i(s) = 0s3 + s3 + 1 - 3. Let u(o) = o*3 - 1. Let q = -1916 + 1914. Give qi(m) + 4u(m). 2m*3 Let m(t) = -6t - 17. Let n(q) = 6q + 1. What is m(k) + 6n(k)? 30k - 11 Let w(u) = -36u*2 + 10u - 16. Let x(i) = -10i - 16i - 7i2 - 3 + 28i. What is -3w(k) + 16x(k)? -4k2 + 2k Let o(h) = -h*2 - 1. Let k(g) = -7g*2 + 3g*2 - g + 2g2. Let p(j) = j2 - 8j - 1. Let v be p(8). Calculate vk(y) + o(y). y2 + y - 1 Let d(i) = -i2 - i. Suppose y = -s + 6y + 4, 4 = -s - 3y. Let p(h) = -7h2 - 6h + 3. What is sp(g) + 6d(g)? g*2 - 3 Suppose 11 = 3s - 7. Let p(h) = h + 1. Let q(o) = o + 19. Let r be q(20). Let z(j) = 21j - rj + 15j - 6. Give sp(l) + z(l). 3l Let n(u) = 2u*2 + 2u + 2. Let s(g) = -g*3 + 3g*2 + 3g + 3. Let f = 8 + -11. Let k(v) = 11v + 24. Let h be k(-2). Determine fn(z) + hs(z). -2z3 Let r(l) = l3 - 2l2 - 2l + 3. Let a(g) = 3g2 - 33g + 31. Let b be a(10). Let x(t) = -t3 + t2 + t - 1. Determine br(i) + 3x(i). -2i3 + i2 + i Let i(k) = 18 - 33k - 6 - 13 - 4. Let o(l) = 8l + 1. Determine 2i(w) + 9o(w). 6w - 1 Let j(x) = -592x3 - 4x*2 - 4x. Let r(z) = -65121z3 - 441z*2 - 441z. What is -441j(s) + 4r(s)? 588s3 Let d(a) = 3938725a - 17750. Let z(w	{ "pile_set_name": "DM Mathematics" }
= -1/32 - 47/32. Sort a, l, -5 in descending order. l, a, -5 Let i(u) = -u*3 + 9u*2 - 8u + 2. Let z be i(8). Let y be ((-1)/2)/(z/(-16)). Suppose 0 = -2k + 6k - y. Put 5, -5, k in descending order. 5, k, -5 Suppose -15 = -2y + 85. Let g = 352/7 - y. Let w = 11 + -16. Sort w, 2, g in increasing order. w, g, 2 Suppose 1 = i + 4. Let m(u) = -u3 + 7u*2 - 7u + 7. Let z be m(6). Let b = z + i. Sort -4, b, 2. -4, b, 2 Let u(f) = 0f + 2f + f - 2f. Let y be u(0). Suppose yn = 3n + 9. Sort -2, 5, n in increasing order. n, -2, 5 Suppose 9 = s + 2s + 3z, 4z - 8 = -2s. Sort s, -3, 0.02. -3, 0.02, s Let p = -30 + 33. Sort -5, p, -3, 0 in descending order. p, 0, -3, -5 Let r = -34 + 23. Let w = r - -18. Sort -1/3, 2/15, w. -1/3, 2/15, w Let z(d) = d2 - 17d. Let o be z(17). Let w(t) = -t*2 + 5t - 1. Let l be w(4). Put o, 2, l in descending order. l, 2, o Let m = 6 - 8. Let v be 0 - ((-6)/3 + 7). Put m, 1, v in decreasing order. 1, m, v Suppose 42r - 38r = -148. Sort r, 3/5, 2 in descending order. 2, 3/5, r Let x = 0 + 0. Put x, -9, 3 in descending order. 3, x, -9 Let p = 113 - 102. Put p, -1, -1/8, 0 in ascending order. -1, -1/8, 0, p Let f = -203 + 203. Put f, 9, 1/5 in descending order. 9, 1/5, f Suppose -2r - 4j = 8, 3j = -3r - 2r + 8. Suppose -h + r = 3l, -3h = -5h + 3l - 1. Put h, -11, -2 in ascending order. -11, -2, h Suppose 0 = 3i + 4l - 22, -3l = i - l - 10. Suppose -ij = -0j + 22. Let q = j - -7. Put -1, -2/7, q in descending order. -2/7, -1, q Let s = 0 + 2. Sort s, -0.2, 2/9 in ascending order. -0.2, 2/9, s Let t = -17 + 21. Put -4, t, 0, -2 in increasing order. -4, -2, 0, t Suppose -29h = -33h. Sort -5, h, 6, 1 in increasing order. -5, h, 1, 6 Let l = 84 + -141. Put l, 4, -4 in ascending order. l, -4, 4 Let d(h) = -6 - 9 + 1 + 5 - h. Let g be d(-4). Sort -3, -2/7, g in increasing order. g, -3, -2/7 Let z = 6 - 8. Let w be 0 + (-24)/10 - -2. Put 2, w, z in decreasing order. 2, w, z Suppose -4 = -4z - 12, 0 = 4c + 3z + 34. Sort -0.4, c, 1/3 in ascending order. c, -0.4, 1/3 Suppose 0 = 4r + 4n - 3n + 6, -3r = -5n + 16. Put 1, r, 0.4 in increasing order. r, 0.4, 1 Let z = -71 - -69. Sort 1, -5, -0.06, z in descending order. 1, -0.06, z, -5 Suppose -8 = 9u - 7u. Put -2, -5, u in increasing order. -5, u, -2 Suppose -5d + 4w = 22, -3d + 3w - 12 = -0w. Let k = 9 + d. Sort 4, -6, k in increasing order. -6, k, 4 Let y = -5.5 + 6. Let c be 3 + (-51)/9 - -2. Put 0.04, y, c in decreasing order. y, 0.04, c Let a = -67 - -403/6. Sort -0.2, -5, -1/4, a. -5, -1/4, -0.2, a Let u(j) = j3 - j2 - 4. Let q be u(0). Let w = -2.5 + 2. Sort w, q, 4 in increasing order. q, w, 4 Suppose -4 = 5l - 5p + 11, -6 = -3l - 2p. Suppose 2j = 3u - 21, l = 4u + 2j - 20 + 6. Put 0, 2, u in increasing order. 0, 2, u Let z(s) = -s2 - 8s + 2. Let w be z(9). Let l = w + 82. Let c = -757/11 - l. Put -1/3, c, -0.2 in ascending order. -1/3, -0.2, c Let o(l) be the third derivative of -l*5/60 - 5l4/24 + l3 + l*2. Let c be o(-6). Suppose c = 2p - p. Put p, -2/21, -4 in ascending order. -4, -2/21, p Let y be (0 - 1)/(2/(-6)). Suppose -4m - 3 = -yr, -4r + 3r = 4m - 1. Let v = -2 + 0. Put v, m, 1 in increasing order. v, m, 1 Suppose 0 = -2d + 4z + 14, -2d - z = 3d + 20. Let g = 2 + d. Sort 0, -2, g in ascending order. -2, g, 0 Suppose 5w + 5o = 10, 2w - 6 = -2w - 2o. Let c(t) = t*3 + 4t*2 - 1. Let n be c(-4). Put 5, n, w in descending order. 5, w, n Let m be (-266)/228 + 2/12. Put -4, 4, -2, m in descending order. 4, m, -2, -4 Suppose 0 = 4q - 5x - 22, 4q + 3x = 8 - 2. Let o = 1/185 + 177/1480. Sort o, q, 4. o, q, 4 Let g be 7 - ((-1)/1 - -3). Let r = g + -8. Sort 5, r, -1 in decreasing order. 5, -1, r Let j = -82 - -79. Put -2, 0, j, 4 in increasing order. j, -2, 0, 4 Let c = -194.8 + 178. Let h = c + 19. Let t = h - 2. Sort -4, -1/4, t in descending order. t, -1/4, -4 Suppose -5w = 0, 3t - 2w + 3 = -6w. Sort t, -2/7, 0.13 in descending order. 0.13, -2/7, t Suppose 2z + w - 1 = -2w, 2z + w - 3 = 0. Suppose 14 = -2r - zf - 0f, 4r = -f - 13. Sort -5, r, 1. -5, r, 1 Let y(d) = d*3 + 8d*2 - d - 9. Let b be y(-8). Let f = 21.7 + -22. Put 0.3, b, f in descending order. 0.3, f, b Let i = -22 - -15. Let s = 24 + -12. Let u = i + s. Sort 4, -1, u in descending order. u, 4, -1 Let f be (-30)/(-20)(-16)/(-6). Suppose -5k - 12 = -2y, -fk - 7 = y - 0k. Sort 4, y, 2 in ascending order. y, 2, 4 Let b(r) = r*2 - 6r + 4. Let v be b(6). Let a(d) = d*2 + 10d + 19. Let w be a(-8). Sort 1, v, w in ascending order. 1, w, v Let u = 5 - 5. Suppose uq = 4q - 4. Suppose -5l - 3 = -4c, 3c = -3l - 2 - 16. Put 4, q, l in decreasing order. 4, q, l Let w = 4231/4 - 23687/20. Let z = w + 127. Sort z, 4/5, 0.2 in increasing order. 0.2, z, 4/5 Suppose -4u - 12 = -0u. Let r be (4/(-6))/((-20)/90). Sort -4, r, u in ascending order. -4, u, r Suppose -5v = 18 + 2. Let j(r) = -r2 - 3r - 5. Let w be j(-3). Sort w, v, 0 in decreasing order. 0, v, w Suppose 4 = -4h - 0. Let k be (-3 - h)/(2/(-4)). Let a be 28/(-15) - (-4)/(-30). Sort k, a, 0. a, 0, k Let l = -3.035 - 0.065. Let q = -2.1 - l. Put 2/7, q, -0.01 in increasing order. -0.01, 2/7, q Let m = 29 - 36. Let l = m + 2. Sort 3, 5, l in descending order. 5, 3, l Let h = -44 - -95. Let m = h - 105/2. Sort 1/4, -6, m in ascending order. -6, m, 1/4 Let a = -13 + 28. Suppose -6z + a = -z. Put -1, z, -3 in decreasing order. z, -1, -3 Suppose -5w + 1 = -4i + 14, 5i + 2w = -25. Suppose 4u + 1 = 5. Sort u, i, -2. i, -2, u Let z = -3 - -2.8. Suppose 4j - 14b = -15b + 19, -2 = 2b. Sort j, z, -0.4 in ascending order. -0.4, z, j Suppose -2t = -3t - 3. Let o be (3 + -1 + -1)12. Suppose -2j + o = 2b, -3j = -3b + 2j - 6. Sort b, t, 5 in increasing order. t, b, 5 Let s = 13 - 17. Put -5, s, 0 in ascending order. -5, s, 0 Let h(b) = -25b3 + b2. Let t be h(-1). Let u = 11 - 7. Suppose -uo - 6 = -t. Sort -2, -5, o. -5, -2, o Suppose -3x = 2s - 7, 6 - 2 = -s + x. Sort 1, -2, s in descending order. 1, s, -2 Let c be 54/24(-16)/6. Let m be (-2)/(-7)c/6. Let d = 1816/9 + -202. Put d, m, 2/9 in descending order. 2/9, d, m Let h = 40.4 + -40. Let i(o) = -o2 + 8o - 9. Let l be i(7). Put -5, l, h in decreasing order. h, l, -5 Let r = 3.7 + -2.1. Let t = -2 + r. Let l = -11 - -13. Put t, 0.4, l in ascending order. t, 0.4, l Suppose -6q - 4 = -2q. Let u be -6 + 9 + (0 - 1). Put u, -5, q in descending order. u, q, -5 Let y = -2 - -2. Suppose -4h + 12 = -yh. Sort -1, 5, h in increasing order. -1, h, 5 Let n(l) = 2l + 16. Let t be n(-10). Sort 1/9, t, 0. t, 0, 1/9 Suppose 2s = -2t + 4, -2t = -4s - 0s - 4. Let l = -1 - s. Let r(y) = 3y - 1. Let z be r(2). Sort z, 2, l in increasing order. l, 2, z Let w = -2 - -6. Suppose 0 = -2b + 3b + 10. Let q be (-2)/2 - 14/b. Sort w, -2/17, q in descending order. w, q, -2/17 Let j(w) = -w2 - w - 4. Let u be j(0). Let k be 2/(-4) + 18/12. Let x(n) = 4n*2 + 1. Let b be x(k). Sort b, -5, u in descending order. b, u, -5 Suppose o = -4o + 60. Suppose 6r = 3r - o. Suppose k - 20 = -3k. Sort -3, k, r. r, -3, k Let j = -1 - -1. Suppose -4a - 17 = a + 3g, -2a - 3g - 5 = j. Let x(s) = s2 - 2s + 2. Let z be x(3). Put a, z, -3 in descending order. z, -3, a Suppose 0z = 2z. Let q be 7 + (z - 1/1). Let t(y) = -y + 4. Let m be t(q). Sort m, -4, 0 in decreasing order. 0, m, -4 Let d = 19 - 19. Put 1, d, -2 in increasing order. -2, d, 1 Let h(x) be the second derivative of -x*3/6 - 3x*2 - 5x. Let m be h(-4). Suppose 2 = -3s - 1. Sort s, m, 3 in decreasing order. 3, s, m Let n = 45 + -42. Put -3, 5, 6, n in decreasing order. 6, 5, n, -3 Let a = -44 + 44.46. Let w = 0.16 - a. Put 4/9, -0.2, w in ascending order. w, -0.2, 4/9 Let o = 5.3 + -6. Let s = 1.1 + o. Sort 4, s, -2/7. -2/7, s, 4 Let y be (-50)/14 + (-6)/14. Sort 3, y, -3 in increasing order. y, -3, 3 Let c be (3 - 1)(7 + -19 - -8). Sort -1, c, 5. c, -1, 5 Let l be (4/5)/((-18)/(-10)). Let m = 141 + -141.2. Sort m, 1, l in decreasing order. 1, l, m Let k = 4.89 - -0.11. Let m = 9 - k. Let a = -3.5 + 0.5. Sort m, -4, a. -4, a, m Let q = 10.8 + -11. Let v be -3 - 03/6. Let d be -4(v + 34/12). Put -2, q, d in increasing order. -2, q	{ "pile_set_name": "DM Mathematics" }
, 3/49, 1, 5, 130 What is l in l*3/6 + 5981l*2/3 + 1851076l/3 - 3726080/3 = 0? -11644, -320, 2 Factor -5p2 + 3029930p + 3029935. -5(p - 605987)(p + 1) Suppose -5x4 + 404520x*3 - 8183843690x*2 + 81793541280x + 89977789495 = 0. Calculate x. -1, 11, 40447 Factor -n*2 + 35638n - 1886005. -(n - 35585)(n - 53) Find w such that -37249w*4/7 + 507590w*3/7 - 1631953w*2/7 - 94680w - 9072 = 0. -36/193, 7 Factor -3y3 + 5727642y*2 + 22910616y. -3y(y - 1909218)(y + 4) Let 5w*3 - 680w*2 - 47920w - 180480 = 0. Calculate w. -48, -4, 188 Determine h, given that 2h2 - 636300h - 24818742 = 0. -39, 318189 Solve 186f3/7 - 193680f*2/7 - 1167102f/7 - 250452 = 0 for f. -3, 32466/31 Determine w so that 2w4/7 + 150w*3/7 + 866w*2/7 - 72078w/7 + 71060/7 = 0. -55, -38, 1, 17 Factor 2j2/5 + 13237772j/5 - 13237782. 2(j - 5)(j + 6618891)/5 Suppose -3p3 - 15480p*2 + 186096p - 496512 = 0. Calculate p. -5172, 4, 8 Determine o, given that -2o4 - 28o*3 + 9576o*2 - 55652o - 65254 = 0. -79, -1, 7, 59 Factor -4g2 - 138120296g - 1192326010445476. -4(g + 17265037)2 Suppose -2f*5/7 - 1038f*4 - 9314250f*3/7 - 4759509494f*2/7 - 708022286988f/7 = 0. Calculate f. -1129, -246, 0 Let -5p5 - 13035p*4 + 154837370p*3 - 315126795680p*2 + 193922832268800p + 194238113914880 = 0. Calculate p. -7742, -1, 1712 Solve 15p4 + 350937p*3 + 1333377p*2 + 771927p - 210528 = 0. -23392, -3, -1, 1/5 Factor -2l2 - 5298452l + 15895374. -2(l - 3)(l + 2649229) Suppose 3g4 - 105540g*3 + 24639675g*2 - 120560250g = 0. What is g? 0, 5, 230, 34945 Suppose 2i2/7 + 468375062i/7 - 468375064/7 = 0. What is i? -234187532, 1 Factor t*4 - 6203t*3 - 43487t*2 + 105579t - 55890. (t - 6210)(t - 1)2(t + 9) Let 2c2/3 - 2587004c + 2509721136006 = 0. Calculate c. 1940253 Factor -15041907t2/5 - 15041909t/5 - 2/5. -(t + 1)(15041907t + 2)/5 Solve -r*2/2 + 481286r - 10588171/2 = 0 for r. 11, 962561 Determine o so that -o*3/2 - 1215939o*2/2 + 14591484o - 87549336 = 0. -1215963, 12 Suppose -b*5/5 + 43427b*4/5 - 2602857b*3/5 + 36301581b*2/5 - 147534534b/5 = 0. Calculate b. 0, 9, 42, 43367 Suppose 2y2/7 - 14738y/7 + 1739760/7 = 0. Calculate y. 120, 7249 Factor -7761a2 - 217168296a + 167892. -3(a + 27982)(2587a - 2) Factor 4p*2 - 59368p + 18019680. 4(p - 14532)(p - 310) Factor 115d3/7 + 1591d*2/7 + 5254d/7 - 912/7. (d + 6)(d + 8)(115d - 19)/7 Find j, given that j3 - 643j*2 + 31270j = 0. 0, 53, 590 Find s such that -75s2/8 + 83096415s/2 - 92066855811363/2 = 0. 11079522/5 Factor -3n2/8 + 47877n/8 - 525921/4. -3(n - 15937)(n - 22)/8 Find b, given that -4b5 - 23212b*4 - 531844b*3 - 485428b*2 + 531848b + 508640 = 0. -5780, -22, -1, 1 Let -5s2 - 11303260s - 6388184331380 = 0. Calculate s. -1130326 Find n, given that n*4/7 - 3522n*3/7 + 354843n*2 + 1109389252n/7 + 52100873028/7 = 0. -262, -54, 1919 Factor 5m2 - 26290625m + 52581230. 5(m - 5258123)(m - 2) Suppose 2r2 - 37910r + 10347612 = 0. Calculate r. 277, 18678 Factor -2t2 + 33652t + 8122464. -2(t - 17064)(t + 238) Factor -2n2 - 63902n + 14284812. -2(n - 222)(n + 32173) Solve -2f2 + 478700f - 5265458 = 0. 11, 239339 Solve -o*5/5 + 326o*4/5 + 83084o*3/5 - 691224o*2/5 - 342432o = 0. -174, -2, 0, 10, 492 Find c, given that 4c5 - 5368c*4 - 27016c*3 + 102112c*2 + 350820c - 808200 = 0. -5, 2, 3, 1347 Factor 3f3 - 59746176f*2. 3f*2(f - 19915392) Suppose -430016n4 + 7095296n*3/11 - 2660772n*2/11 + 295654n/11 - 2/11 = 0. Calculate n. 1/147818, 1/4, 1 Factor n*4/3 + 4271402n*3/3 + 4561346901661n*2/3 + 91223093807420n + 1368327186072300. (n + 30)*2(n + 2135671)2/3 Solve -l4/3 - 81l3 - 3709l*2/3 - 5859l - 22246/3 = 0. -227, -7, -2 Solve -5u2 - 2352518880u - 276717254037822720 = 0. -235251888 Suppose w*4 - 154078w*3 + 1232576w*2 - 2465120w = 0. What is w? 0, 4, 154070 Let g*4/5 + 3521g*3 + 76784156g*2/5 - 6172264204g/5 + 17825259792/5 = 0. Calculate g. -8842, 3, 76 Factor r*4/3 + 3380r*3 + 20248004r2/3. r2(r + 2734)(r + 7406)/3 Factor 5f3 - 5530f*2 - 499385f - 493850. 5(f - 1190)(f + 1)(f + 83) Let 10y*4 - 24846y*3 + 3199580y*2 - 33669312y - 13981248 = 0. What is y? -2/5, 12, 124, 2349 Factor -2u2 + 2060u + 446752. -2(u - 1214)(u + 184) Determine l so that 4l2 + 108168l + 4104608 = 0. -27004, -38 Let -2k3 - 672k*2 + 270662k - 538620 = 0. Calculate k. -573, 2, 235 Let -6w5/5 + 12258w*4/5 + 7210038w*3/5 - 18594259002w*2/5 + 406391631888w/5 - 2230177675176/5 = 0. Calculate w. -1191, 11, 1606 Find p such that -70p2 + 29275p - 150745 = 0. 73/14, 413 What is w in w*5/3 + 53w*4 + 8542w*3/3 + 55564w*2 + 639160w/3 = 0? -58, -38, -5, 0 Suppose 2x2 + 2532290x + 63306000 = 0. Calculate x. -1266120, -25 Solve -2p4/13 + 7694p*3/13 - 84462p*2/13 + 268570p/13 - 191800/13 = 0 for p. 1, 5, 3836 Factor 4k2/7 + 93086876k/7. 4k(k + 23271719)/7 Determine m so that -3m4 - 24m*3 + 56289m*2 - 112494m + 56232 = 0. -142, 1, 132 Factor -h*3/3 + 266141h*2 - 53122076256h - 478120243968. -(h - 399216)*2(h + 9)/3 Suppose 5s3 + 24940s*2 - 884912720s + 3336127150400 = 0. What is s? -17380, 6196 Factor r*3/5 - 1462r*2/5 + 47219r/5 - 88598/5. (r - 1429)(r - 31)(r - 2)/5 Let 3a4/7 + 10111851a*3/7 - 10111854a*2/7 = 0. Calculate a. -3370618, 0, 1 Solve 2c*4 - 1266c*3 + 13720c*2 - 22392c = 0. 0, 2, 9, 622 Factor 3q2/4 + 23964030q - 95856123/4. 3(q - 1)(q + 31952041)/4 Solve 4b4 - 40616b*3 - 2122444b*2 - 4123024b - 2041200 = 0 for b. -50, -1, 10206 Suppose 5b5/4 + 1660b*4 + 936595b*3/2 - 1414865b*2 + 5672765b/4 - 473285 = 0. Calculate b. -919, -412, 1 Let 2c3 + 30828c*2/5 + 24654c/5 - 6164/5 = 0. Calculate c. -3082, -1, 1/5 Factor 6b3 + 268b*2 - 4032b - 12544. 2(b - 14)(b + 56)(3b + 8) Factor -2p2 + 3487296p + 31385826. -2(p - 1743657)(p + 9) Factor -d*2/8 - 787d/2 + 138720. -(d - 320)(d + 3468)/8 Let y4/2 - 16179y*3 + 130799088y*2 + 1309609280y = 0. What is y? -10, 0, 16184 Factor -49i2 + 1563616i - 829660. -(i - 31910)(49i - 26) Factor 113699739123x3/5 + 341101553517x*2/5 + 7008456x/5 + 36/5. 3(x + 3)(194679x + 2)2/5 Factor -17t*2/2 + 7576t + 2269536. -(t - 1128)(17t + 4024)/2 Find j such that -j*4/5 - 952j*3/5 + 62869j*2/5 + 952j/5 - 62868/5 = 0. -1014, -1, 1, 62 Find v such that v*2 - 10751v - 1535772 = 0. -141, 10892 Determine g so that 59g5 - 2890g*4 + 2193g*3 + 27886g*2 + 23128g + 384 = 0. -2, -1, -1/59, 4, 48 Suppose -465a5 - 18800a*4 - 91235a*3 - 100900a*2 - 28000a = 0. What is a? -35, -4, -1, -40/93, 0 What is m in -345m4 - 32425m*3 - 456655m*2 - 418415m + 6160 = 0? -77, -16, -1, 1/69 Solve -4p5 + 8791280p*4 - 4830280881268p*3 - 144914650724152p*2 - 927469068716800p + 2473238846720000 = 0 for p. -16, 2, 1098925 Find d such that -4d3/5 + 336923d*2/5 + 84231d/5 = 0. -1/4, 0, 84231 Factor 4v2 + 119784v - 13948768. 4(v - 116)(v + 30062) Solve z*5 + 1109z*4 - 181496z*3 - 271376684z*2 + 59636263520z + 59907457600 = 0 for z. -844, -1, 290 Factor 5z3 - 125z*2 - 2646500z - 26447500. 5(z - 745)(z + 10)(z + 710) Let 50c*5 + 181690c*4 - 28718122c*3 + 1099594454c*2 + 893506768c + 179624984 = 0. Calculate c. -3787, -2/5, 77 Determine m so that -m*4/4 - 12837m*3/2 + 25682m*2 + 102696m - 410848 = 0. -25678, -4, 4 Find i such that i*5 - 4343137i*4 - 4343141i*3 + 13029409i*2 + 21715688i + 8686276 = 0. -1, 2, 4343138 Let -y*2 - 104952y + 4724865 = 0. Calculate y. -104997, 45 What is p in -4p4 + 1008p*3 + 145144p*2 - 897648p + 1359756 = 0? -107, 3, 353 Suppose -k*3/3 - 13k*2 + 109354k/3 - 254408 = 0. Calculate k. -354, 7, 308 Find m such that 2m4 + 38m*3 - 7414m*2 - 168054m + 1521828 = 0. -54, -33, 7, 61 Find t such that 2t2/5 + 273576268t/5 + 9355496801600978/5 = 0. -68394067 Factor -2f3 - 54410f*2 - 380792f - 543960. -2(f + 2)(f + 5)(f + 27198) Suppose -2z*4 - 40892z*3 - 231536162z*2 - 230188264992z - 633752	{ "pile_set_name": "DM Mathematics" }
eplacement from hhhhhhhhnhhhhohho. 1/2040 Four letters picked without replacement from {y: 5, l: 3, e: 2, p: 5}. Give prob of sequence eeel. 0 Three letters picked without replacement from {j: 19, t: 1}. Give prob of sequence jjj. 17/20 Calculate prob of sequence kf when two letters picked without replacement from {h: 1, g: 1, b: 2, k: 1, d: 1, f: 1}. 1/42 Two letters picked without replacement from tsstsis. Give prob of sequence is. 2/21 Three letters picked without replacement from {g: 3, p: 5, v: 1, r: 3, n: 6}. Give prob of sequence rnp. 5/272 Two letters picked without replacement from {a: 2, r: 7, o: 1, h: 1, e: 4}. Give prob of sequence ar. 1/15 Two letters picked without replacement from {v: 2, y: 1, x: 1, t: 1, r: 4}. What is prob of sequence ty? 1/72 Three letters picked without replacement from {f: 4, r: 2, u: 2, h: 2, d: 4}. What is prob of sequence dhd? 1/91 Two letters picked without replacement from zzgggz. What is prob of sequence gg? 1/5 Two letters picked without replacement from ggpgpggggp. Give prob of sequence gg. 7/15 Three letters picked without replacement from ycqqccqyyqccccycycy. Give prob of sequence qcy. 12/323 What is prob of sequence btn when three letters picked without replacement from {b: 4, n: 1, t: 3}? 1/28 What is prob of sequence kck when three letters picked without replacement from {k: 4, c: 1, e: 2, l: 3}? 1/60 Two letters picked without replacement from lllffllflllllf. What is prob of sequence lf? 20/91 What is prob of sequence skdt when four letters picked without replacement from sltdqkl? 1/840 Two letters picked without replacement from {k: 2, f: 11}. What is prob of sequence kf? 11/78 Two letters picked without replacement from {k: 4, x: 1, n: 2}. Give prob of sequence xk. 2/21 Calculate prob of sequence vz when two letters picked without replacement from zzeeezddddevdeeede. 1/102 What is prob of sequence ilo when three letters picked without replacement from iwfxolf? 1/210 What is prob of sequence iqth when four letters picked without replacement from {t: 1, c: 1, q: 1, i: 1, m: 1, h: 2}? 1/420 Calculate prob of sequence ipi when three letters picked without replacement from qllqlivvvpniq. 1/858 Four letters picked without replacement from soyytswtytwjystjj. Give prob of sequence osjo. 0 Four letters picked without replacement from pjjdpjjjddpppjjpj. Give prob of sequence dddj. 1/1190 Three letters picked without replacement from {u: 5, v: 1, a: 10, l: 2, k: 2}. Give prob of sequence vlu. 1/684 What is prob of sequence jvuv when four letters picked without replacement from {v: 4, j: 2, u: 5}? 1/66 What is prob of sequence dq when two letters picked without replacement from {f: 2, d: 4, q: 7}? 7/39 Calculate prob of sequence mm when two letters picked without replacement from {i: 7, m: 3}. 1/15 Four letters picked without replacement from iggggggiiggg. Give prob of sequence iigg. 2/55 Two letters picked without replacement from omoouim. Give prob of sequence oo. 1/7 Calculate prob of sequence ofb when three letters picked without replacement from {d: 1, b: 4, f: 6, w: 2, o: 4}. 2/85 What is prob of sequence rurr when four letters picked without replacement from rooorouruor? 1/165 Four letters picked without replacement from {h: 1, l: 1, f: 4, j: 2, m: 2}. Give prob of sequence flfj. 1/210 What is prob of sequence doo when three letters picked without replacement from yosydodss? 1/126 Two letters picked without replacement from {t: 8, v: 1, p: 5, w: 3, i: 3}. What is prob of sequence tv? 2/95 Calculate prob of sequence nt when two letters picked without replacement from ntnz. 1/6 What is prob of sequence iiiz when four letters picked without replacement from {i: 18, z: 1}? 1/19 Calculate prob of sequence lhv when three letters picked without replacement from {l: 5, h: 2, j: 4, v: 2, c: 1}. 5/546 What is prob of sequence yynn when four letters picked without replacement from {y: 7, n: 3}? 1/20 Three letters picked without replacement from etettteteeeet. What is prob of sequence ett? 35/286 What is prob of sequence oko when three letters picked without replacement from dddddkdodo? 1/360 Calculate prob of sequence xlxv when four letters picked without replacement from {v: 1, j: 2, x: 6, l: 2}. 1/132 Three letters picked without replacement from ygffffyffyyyfcfuyfyf. What is prob of sequence yyy? 7/228 Calculate prob of sequence gh when two letters picked without replacement from xccxhxhxxchcccgxcxg. 1/57 Two letters picked without replacement from msssjvjxvdjvvs. What is prob of sequence vm? 2/91 Two letters picked without replacement from ibgxixixbizixxxxiivx. What is prob of sequence xi? 14/95 Three letters picked without replacement from {k: 2, a: 4, j: 2, l: 4}. Give prob of sequence alj. 4/165 Calculate prob of sequence ete when three letters picked without replacement from {v: 1, t: 5, e: 3}. 5/84 Four letters picked without replacement from cccrcrcccrkkccc. What is prob of sequence rcrr? 1/546 Calculate prob of sequence ff when two letters picked without replacement from fff. 1 Calculate prob of sequence ig when two letters picked without replacement from {g: 4, f: 2, i: 4}. 8/45 Two letters picked without replacement from {i: 5, g: 4, o: 1, k: 1, d: 1}. Give prob of sequence id. 5/132 What is prob of sequence xb when two letters picked without replacement from {i: 3, x: 4, b: 1, t: 2, z: 1}? 2/55 Three letters picked without replacement from {g: 1, n: 2, o: 7, w: 1, y: 1, j: 5}. What is prob of sequence oow? 7/680 Two letters picked without replacement from {r: 2, n: 1, z: 2, b: 1, m: 1, k: 2}. Give prob of sequence bz. 1/36 Four letters picked without replacement from {e: 1, l: 3}. Give prob of sequence lell. 1/4 Calculate prob of sequence xexe when four letters picked without replacement from eexowxkhkwee. 1/495 Three letters picked without replacement from gcrwzpgrwwwwgr. What is prob of sequence rwg? 15/728 What is prob of sequence mzo when three letters picked without replacement from moohmohoozooo? 4/429 Calculate prob of sequence rrr when three letters picked without replacement from {h: 2, r: 5}. 2/7 What is prob of sequence aje when three letters picked without replacement from ceaaqaajajccaj? 3/364 Calculate prob of sequence lh when two letters picked without replacement from hhiiffhfhlhl. 5/66 Three letters picked without replacement from ssswssswsss. Give prob of sequence wss. 8/55 Four letters picked without replacement from {w: 3, u: 5, g: 2}. What is prob of sequence wggw? 1/420 Two letters picked without replacement from {r: 7, z: 2, h: 9}. Give prob of sequence hz. 1/17 Calculate prob of sequence ee when two letters picked without replacement from noeeoeoooooooon. 1/35 Calculate prob of sequence ggq when three letters picked without replacement from {u: 3, f: 1, q: 6, w: 2, g: 7}. 14/323 What is prob of sequence ttff when four letters picked without replacement from taataffaataatsa? 1/1365 Two letters picked without replacement from {o: 7, z: 1}. Give prob of sequence oz. 1/8 Two letters picked without replacement from secesxw. Give prob of sequence ew. 1/21 Four letters picked without replacement from zzmmz. What is prob of sequence mmzz? 1/10 What is prob of sequence sqs when three letters picked without replacement from xxqfxfxfqsxskx? 1/546 Two letters picked without replacement from ccucdncnncddw. Give prob of sequence dw. 1/52 What is prob of sequence bggg when four letters picked without replacement from {b: 2, g: 9, q: 2}? 42/715 What is prob of sequence ykpf when four letters picked without replacement from pfffkgfpfpffkffpy? 3/2380 What is prob of sequence ese when three letters picked without replacement from ssjjesjejsssj? 1/143 Four letters picked without replacement from {g: 8, v: 2, r: 1, a: 1, s: 5}. Give prob of sequence rssa. 1/2856 What is prob of sequence nva when three letters picked without replacement from vnnaw? 1/30 What is prob of sequence rrx when three letters picked without replacement from {r: 9, x: 5}? 15/91 Three letters picked without replacement from dbvdaadauaadauaa. Give prob of sequence bvd. 1/840 Two letters picked without replacement from {r: 2, f: 1, o: 2, u: 7, y: 2, b: 2}. Give prob of sequence yb. 1/60 What is prob of sequence cx w	{ "pile_set_name": "DM Mathematics" }
2)(3z + 0z - 5z) + (3z4 - 4z*4 + 0z*4)(3z - z - z). -5z*5 Expand 4t*2 - 6t*2 + 4t*2 + (-4t - 2t + 3t)(-10t + 14 - 14). 32t2 Expand (n - 2n*3 - n + (-4n + 5n - 2n)(-8n2 - n2 + 0n2))(3n + n - 2n). 14n4 Expand 0n*5 - 4n5 + n5 + 2n5 + n3 - n3 + (-n + n + 2n*2)(0n3 + n3 - 3n3) + n5 + 2 - 2 + (-2n2 + n2 - n2)(-3n - n3 + 3n). -2n5 Expand (-2b + 3b - 2b)(3b*2 - 6b2 + b2) + 225 - 225 - 30b3 + (1 - 1 - 2b)(3b*2 - 4b*2 + 3b*2). -32b*3 Expand (2 - 2 + u)(-u + 0u - u) + u2 - 2u*2 + 2u*2 + (-u - u + 3u)(-3u - 3 + 3). -4u2 Expand (-2k + 0 + 0)((-3 + 4 - 3)(-4k - k + 3k) - 4 + 4 + 3k). -14k*2 Expand (2 + 1 - 1)(0g4 + 5g*4 - 3g*4) - 8g*4 + 3g*2 - 3g*2. -4g*4 Expand (-4m + 3m + 0m)(m2 + 2 - 2)((5m - 4m - 3m)(1 + 4 - 3) + m - 3m + 0m). 6m4 Expand (1 + 2 - 5)(-1 - 2 + 5)(4o + 3o - 3o). -16o Expand -2s*4 - 3s*4 + 6s*4 + (3s - 3s3 - 3s)(-4 + 4 + 2s) + (4s - 3s*2 - 4s)(5s*2 - 2s*2 - 2s*2). -8s*4 Expand (-2 - 1 + 1)(-i + 0 + 0)(45i*3 - 45i*3 + 13i*4). 26i*5 Expand -2f*2 - 5f*3 + 6f*4 + 5f*3 + (0 + 0 + 2f)(0f*3 - 2f*3 + 4f*3). 10f*4 - 2f*2 Expand 2d + 4d4 - 6d4 - d4 + d4 - d4 - 2d4 + (3 + 0 - 4)(3d3 - 3d3 + d4) - d*4 + 0d4 - d4. -8d4 + 2d Expand (-2x + 4x - x)((3 + 0 - 1)(5 - 1 - 6) + 0 + 0 - 2)(x4 - 2x*4 + 0x*4). 6x*5 Expand (-2 + 0g + 2g - g - 4g + 3g - g + g + g - 3g + (-1 - 4 + 4)(2 - 2 + 2g) + 5g + 3g - 6g)(-3g2 + 3g2 - g2). 2g3 + 2g*2 Expand 6y*5 - 4y*5 + 4y*5 + (0 + 5 - 1)(-2y4 + 2 - 2)(4y - 3y - 2y). 14y*5 Expand (-33 + 3 - 9)(4z - 4z - z)(z + 1 - 1)(0z - 2z + 3z). 39z*3 Expand (0 + 2 + 1)(-4 - 2l + 4 + (-3l + 4l - 3l)(0 - 4 + 5) + l + 0l + 2l + (-4 + 4 - 1)(-3l + 2l - l)). 3l Expand (-k2 + 2 - k2 - 2k*3 - 5)(0 + 0 + 2k). -4k*4 - 4k*3 - 6k Expand (4s + 5s - 2s)(3s + 2s - 4s) - 2 - s2 + 2. 6s*2 Expand (3w + w - w)(-8w + 3w - w). -18w*2 Expand (2f + f*3 - 2f)(-2f + 3 - 3)(-46f - 19f + 32f) - 3f5 + f5 + 0f*5. 64f*5 Expand (3l*3 - 4l3 - l3)(-l2 + 0l2 - l2 + 2l2 - 6l*2 + 2l*2 + (2l + 4 - 4)(-6l + 4l - l)). 20l*5 Expand (4 + 0o*2 - 2o*2 - 1)(-3 + 2 + 3)(6 - 3 - 2). -4o*2 + 6 Expand ((-2 + 2 + 2)(-2 - 1 + 1) + 2 + 6 - 7)(6l - 2l - l). -9l Expand (-s*4 + 3s4 - s4)(0s + 3s + 3s) + 3s5 + 3s*5 - 5s*5. 7s*5 Expand (-1 - 1 + 3)(-g*2 + 5g2 - g2)(4 - 4 + g). 3g*3 Expand 2 - 2t*3 - 2 - 3t*3 + 10t3 - t3 + (-t3 - t3 + 0t3)(2 - 11 - 4). 30t3 Expand (-3 - 1 + 2)(2d2 - 6d*2 + 20d*2). -32d*2 Expand 1 - 2l*3 - 1 + (-6l*3 + 2l*3 + 2l*3)(6 - 5 + 1) - 3l3 - l3 + 2l*3 - 3l*3 - 6l*3 + 0l*3 + (-2 + 5 - 1)(-3l3 + 3l3 - l3). -19l3 Expand (-f3 - 2f*3 + 4f*3)(-1 - 1 - 4) + (-f + 0 + 0)(3f*2 - 3f*2 - 2f*2). -4f*3 Expand 5v - v - 3v + (3v + 0v - 2v)(-5 - 2 + 4) - 2v + 0v + v - 6 + 6 + 2v. -v Expand (4g - g3 - 4g)(0 - 1 + 6 + 6g). -6g4 - 5g*3 Expand (2i - 2i + 3i*4)(2 - 7i - 2). -21i*5 Expand (2v*4 - 2v + 2v)(-1 + 1 - 2)(-8 + 7 + 5). -16v*4 Expand (-2r - r + 4r)(-2 - 1 + 1). -2r Expand (3r*3 - 2r*3 + 0r*3)(-r + 5r - r)(3 + 0 - 2). 3r4 Expand (-138o + 46 - 46)(3o3 - o3 - o*3). -138o*4 Expand (-2i - i*2 + 2i + (-2i + 3 - 3)(6i - 2i - 2i) - 1 - i2 + 1 - 2i + 2i2 + 2i)(22i*3 - 11i*3 + 6i*3). -68i*5 Expand (18 - 18 + 3v*2)(6 + 2 - 4). 12v2 Expand (-8y + 8y + 4y*2 + (5 + 0 - 3)(-5y + 5y + 2y2))(y + 3y - 3y)(-y - y + 0y). -16y4 Expand (0k*2 - 2k*2 + 4k*2)(-11 + 0 + 0). -22k2 Expand (-4 - 2p + 4)(-2p*3 - 2p*2 + 2p*2) + (-7p + 0p - p)(p*3 - 4p3 + p3). 20p4 Expand (-4 + 5 + 0)(-2 - 1 + 2)(f5 + 2f*5 - 5f*5). 2f*5 Expand -2w*5 + 5 - 5 + (-4w + 4w - w3)(4 + 0 - 5)(-3w2 - w2 + 3w2). -3w*5 Expand (2 + 4 - 5)(88z4 - 1010 + 1010). 88z*4 Expand (-6g3 - g3 + 4g3)(-2 + 4 - 1)(11g*2 - 2g + 8g2 + 6g*2). -75g*5 + 6g*4 Expand (2 + 5 - 5)(-3t - 2t + 2t) + t + 3t - 6t + 6t - 2t + 8t. 4t Expand (0q*2 + 0q*2 + 2q*3)(3 - 4 - 1) + 0q3 + 7q*3 + 8q*3. 11q*3 Expand (2d + d - d)(0 + 1 + 2)(0d - 2d + 3d). 6d*2 Expand (-3i*2 + 2i*2 - 2i*2)(2i + i - i) + 10 - 10 + 2i*3. -4i*3 Expand 38v + 14v - 6v + (2 + 4 - 5)(-1 + 1 + v). 47v Expand (1 - 2y4 - 1)(-4 + 13 - 11 - 2y). 4y*5 + 4y*4 Expand -2q3 - 7 + 7 + q3 - 3q3 + 0q*3 + (0q*2 - 6q*2 + 4q*2)(-1 - q + 1) + 1 + 2q3 - 1 - 2 + 2 + q3 - 1 + 2q*3 + 1. 3q*3 Expand -2 + 2q*3 + 2 + (-q + 2q - 2q)(5q2 + 6q*2 - 3q2) - q3 - 2q3 - q3. -10q*3 Expand (4d*4 + 7d*4 - 4d*4)(-2d - d + 5d). 14d5 Expand (-3 + 7 - 3)(5r + 2r - 4r)(-4r + 6r + 4r)(-1 + 2r - 4 + 4). 36r*3 - 18r*2 Expand (c - 6c + 3c)(-15c2 + 15c*2 + 6c*3). -12c*4 Expand ((h - 5h + 3h)(-3 + 3 + h) - 3h2 + 2h2 - h2 - 2h2 + 0 + 0 + h2 + 0h + 0h - 2 + 2 + 2h*2)(53h3 - 2h3 - h3). -100h5 Expand 13f*2 + 3f*3 - 13f2 + (-3 - f2 + 3)(f - 6f + 4f) + 0 + 0 + f3 + (0f + 0f - f3)(4 - 4 - 2). 7f3 Expand -5 + 5 - 4o*2 + (-4 + 4 - 2o)(-o - 2o + o) + 5o2 - 4o*2 - 7o*2. -6o*2 Expand (o + o + 0o + (9 - 2 + 0)(-3o + 2o + 2o) - 2o + 4o - o)(-o2 + 2o2 + o2). 20o3 Expand -10 + 10 - 9j*2 + (2j - j + j)(-j - 4j + 3j) + 3j*2 - 3j*2 - 2j*2 + 3j*2 - 5j*2 + 0j*2. -17j*2 Expand -4h + 0h - 2h2 + h2 - 15h2 + 28h - 28h + (2h - 2h - h2)(-3 + 5 - 4). -14h2 - 4h Expand (0 + 0 + 4)(3f + 0f - 5f)(-2f - 4 + 4)(-5 + 3 + 0). -32f*2 Expand (4s - 3s + 0s)(-3 + 4 - 5)(-25 + 28 - 16). 52s Expand (2i + 1 - 1)(0 + 2i*2 + 1 + 2i + 1). 4i3 + 4i*2 + 4i Expand 2 - 2 - 2m + (4m - m - m)(2 - 2 + 2). 2m Expand (p4 - p4 - p*4)(0p + p + 9 + 0p). -p*5 - 9p*4 Expand -31x*2 + 4x + 3x4 + 31x*2 + (-4 - 2x*2 + 4)(2x2 + 1 - 1) + 5x4 - x4 - 2x4 - x4 - 3x*4 + 5x*4 + 3x*4 - x + x. 5x*4 + 4x Expand (-t + t - 4t2)(t + 0t - 2t)(-2 - 2 + 3). -4t*3 Expand -3y - 1 + 1 + (-2y - 2 + 2)(-1 - 1 + 4). -7y Expand (-n + 5n + 0n)(-4n3 + 2n*3 + 4n3) - n4 - 4n4 + 3n*4 + 3 + 2n*4 - 3 + (0 - n + 0)(3n3 - 5n3 + n3) + 3 + 2n4 - 3. 11n*4 Expand 1 + 2t*3 - 1 + (-t + t + 2t*2)(-t - 2t + t) - 269t*2 + 269t*2 - 48t*3. -50t*3 Expand (3u - 3u + u5)(4 - 9 - 1). -6u5 Expand (-2q - 2q4 + 2q)(0 + 2q + 0) + 11q5 - 2q*3 - 9q + 7q - 10q*5. -3q*5 - 2q*3 - 2q Expand (k*2 - 7k*2 + 4k*2)(-2 + 2 - 2k) + (k2 - 3k2 + k2)(2k - 4k + 4k) + k*3 + 3k*2 - 3k*2. 3k3 Expand (1 + f2 - 1)(2 + 14 - 9). 7f*2 Expand (4 - 2 - 4)(5a + 2a - 6a)(-245 + 6a + 245). -12a*2 Expand (-10g - 16 + 16)(g4 + 4g - 4g + (-2 - g + 2)(-5 + 5 + 2g3)). 10g*5 Expand (4k2 + k2 + 2k2 - 1)(5k2 + 2k*2 - 4k*2). 21k*4 - 3k*2 Expand (2v*4 + 0v*4 + 3v*4)(2 - 3 - 2)(1 - 3 + 1)(-5v + v + 2v). -30v5 Expand (0s*2 + 3s*2 - 5s*2)(1 + 75s - 42s - 35s). 4s*3 - 2s*2 Expand (3 + 2 - 6)(-27c + 33c - 18c) + c + c - 3c + 2c + c - 4c. 10c Expand ((6 + 0 - 3)(2 + 1 - 5) - 4 + 0 + 2)(-3z*2 - 2z*2 + 4z*2). 8z*2 Expand (-n + n - n + 3 - 3 - 2n - 3n - 2n + 3n + (3 + 2 - 4)(n + 1 - 1) - 5 + 5 - 3n + 2n + 4n - 7n - 2n + 2n - 2n)(-2n - 2 + 2). 20n*2 Expand (-c + 0c + 3c)(3 + 4 - 4) - 2c + 3c + c + 8 - 3c - 8. 5c Expand (3h - h + 0h)(1 - 3 + 1) - h + 4h - 5h + 2 - 2 + 2h. -2h Expand (-3q*2 - 4q*2 + 5q*2)(-4q - 3q + 0q) + (-4q2 + q2 + 2q2)(-2q - 4q + 4q). 16q*3 Expand (0o*4 + 0o4 - o4 + (-3o2 + o2 + 7o*2)(-3o2 + 3o*2 + 4o*2) + 4o*4 - 4o4 + o4)(-o + 3o - 3o). -20o*5 Expand (2i*2 + 2i*2 - 2i*2)(-92i + 92i + 10 + 2i2). 4i*4 + 20i**2 Expand (-2 -	{ "pile_set_name": "DM Mathematics" }
he prime factors of a? 2, 3, 29 Let n(u) = u*3 + 2u*2 + 3u - 9. Let w(t) be the first derivative of -2t3/3 - 11t*2 + 3t - 13. Let k be w(-11). List the prime factors of n(k). 3, 5 Let q(f) = -15 + 4f2 + f2 + 0f*2 - 4f*2 + 6f. List the prime factors of q(5). 2, 5 What are the prime factors of -6 + 2/3 + 2144116/144? 2377 Suppose 5 = 5w - 4x, -w - 2x - 5 = -6w. Let f be (w/(-3))/(-1 - (-12)/9). What are the prime factors of (2 - f) + (0 - (4 - 62))? 61 Let c = -152 - -157. Suppose -5r - 5 - 25 = 5t, 4t = cr - 6. List the prime factors of 318(-84)/(-99) - r/11. 2, 3, 5 Let i = 148 + -161. Let l(v) = -v*3 - 6v*2 + 17v + 36. List the prime factors of l(i). 2, 499 What are the prime factors of (-25196)/8(-12)/305? 6299 Suppose 0 = -16g + 267 - 59. Let u be (g + -12)(2 + 1 - 0). Suppose 453 = 5p - uw, 2w + 2w + 454 = 5p. What are the prime factors of p? 2, 3, 5 Let s(q) be the third derivative of 7q6/120 - q5/30 + 3q3 + 52q*2. What are the prime factors of s(4)? 2, 7, 31 Suppose w = -3x + 48, -2w + 3x + 86 = -28. Suppose -o = -w + 11. List the prime factors of o. 43 Let y(n) = -n*2 + 17n - 3. Let s be y(7). Let o = 169 + s. Let u = o + -139. List the prime factors of u. 97 Let l = 176 + -174. Suppose -s - 4g = -6g - 3, 0 = -4s - lg + 62. What are the prime factors of s? 13 Suppose 3k - 364 = -4q - 1225, 4k + 4q = -1148. Let a = 199 + k. What are the prime factors of -2 - ((-2)/(-2) - 1) - a? 2, 43 Suppose c - 14c + 427840 = 19c. List the prime factors of c. 2, 5, 7, 191 Let n = -5731 + 19615. List the prime factors of n. 2, 3, 13, 89 Suppose r + 3r + 4 = -4s, 3r = 4s + 18. Let v(o) = -4o3 - 5o*2 + 5o - 1. Let u be v(r). Let w = u + 115. List the prime factors of w. 2, 3 Let o = -156 - -160. Let l(i) = 174i - 69. List the prime factors of l(o). 3, 11, 19 Let w = 34134 + -3644. What are the prime factors of w? 2, 5, 3049 Let w(r) = 2r*2 + 25r - 17. Let t be w(-14). Let q be t(-1)/2 + 12/24. What are the prime factors of 3/q - (-3750)/24? 2, 3, 13 Let i(o) = o2 - 6o - 30. Suppose -4l + 36 = -3r - 3l, -3r - 2l = 27. List the prime factors of i(r). 157 Let v(u) be the first derivative of u4/4 + 5u3/3 - u2 - u + 56. Let c(o) = o + 1. Let n be c(-4). List the prime factors of v(n). 23 Let j be (-1)/4 + (-45)/12. Suppose 0 = -4w + v + 22, -3v + 23 - 11 = w. List the prime factors of 348/w - (j - 0). 2, 31 Let v = -151 - -160. Suppose -2574 - 468 = -vt. What are the prime factors of t? 2, 13 Suppose 3o - 16 = -2w, -14o - w = -13o - 6. Suppose -q = -2f + 4, 13 = of + 1. What are the prime factors of q - (-4 + -75 + -1)? 2, 41 Suppose 3967q = 3966q + 12439. List the prime factors of q. 7, 1777 Let l = -194 + 192. Let g(j) = 3j. Let i be g(9). List the prime factors of i((-28)/(-6) + l). 2, 3 Suppose -2a + 6 = 0, n - 11a - 10 = -13a. Suppose 4s + 2379 = 3w - s, w + ns = 810. List the prime factors of w. 2, 3, 7, 19 Suppose -5y = -a + 95, 8y + 218 = 2a + 12y. Let i = a + -8. What are the prime factors of i? 97 Suppose -28x = -248 + 80. What are the prime factors of 8502/9 + 4 + (-22)/x? 3, 5, 7 Let s be (14)/((14 - 12)1). Suppose -si = -3h + 864, -2h + 5i + 1435 = 3h. List the prime factors of h. 2, 5, 29 Let n be (24/(-14))/(10/105). List the prime factors of ((-4)/6)/(n/4887). 181 Let t be (0 - 1)(0/(-2) + -3). Suppose th = -3h + 1080. Suppose -3n + 486 + h = 0. List the prime factors of n. 2, 3, 37 Suppose -3b + 9b - 7022 = 6712. What are the prime factors of b? 3, 7, 109 Suppose -2o = -m - 33738, 17538 = o + 2m + 664. List the prime factors of o. 2, 5, 7, 241 Suppose 25h + 182 = 18h. Let t(s) = s2 - 29s - 116. List the prime factors of t(h). 2, 3, 73 List the prime factors of 44709/(-2)(-28 + 26). 3, 7, 2129 Suppose -2i = 2b - 2, -2b = -5b - 12. Suppose 4k = -ih + 2292, -581 = -2h + 2k + 343. Suppose 2d = -3d + h. List the prime factors of d. 2, 23 Let t be 76(2/5)/((-6)/30). Let v be (-41)/(5 - 12/3). Let h = v - t. List the prime factors of h. 3, 37 Suppose -24910 = -5o - 5s, 4o - 3s - 23394 = -3459. List the prime factors of o. 3, 11, 151 Let t = 604 + 184. Suppose -17m + t = 108. What are the prime factors of m? 2, 5 Let p(u) = -150u + 1197. List the prime factors of p(-38). 3, 11, 19 Let i = 12588 - 7401. What are the prime factors of i? 3, 7, 13, 19 Let y be 35/7 - -719 - 2/2. Let s = y - 174. What are the prime factors of s? 3, 61 What are the prime factors of (5842031/3180 + (-4)/(-30))24? 2, 3, 7349 Suppose -73z = -64z. Suppose 153c - 151c - 54 = z. What are the prime factors of c? 3 Let g(f) = -2f*3 - 47f*2 - 596f - 20. List the prime factors of g(-19). 3, 5, 179 Let y(u) = 1710u - 9912. List the prime factors of y(13). 2, 3, 2053 Let g = 1134 - 776. List the prime factors of g((-3)/(-14) - 8/(-28)). 179 Suppose 38j + 98136 = 80j + 190j. What are the prime factors of j? 3, 47 List the prime factors of -1235/840 + (66190/4 - -1). 2, 3, 7, 197 Let f = -35 - -155. Let s = f - 81. What are the prime factors of s? 3, 13 Suppose 2b - 545 = -r, r - 2r = -b + 277. Suppose 978 - b = 4l. Let k = l + -82. List the prime factors of k. 2, 47 List the prime factors of 25134/10 + ((-2825)/(-125) - 22). 2, 3, 419 Suppose -25v + 97520 = -121792 + 24712. List the prime factors of v. 2, 7, 139 Suppose 5l + 2167 = 2l - m, -2l - 1436 = 5m. Let c = l + 1058. List the prime factors of c. 5, 67 Let d(z) = 9z + 49z - 19 - 23 + 10 + 112z. What are the prime factors of d(6)? 2, 13, 19 Let s(w) = -2w*2 - 14w + 9. Let p be s(-7). Suppose pf - 13 = 23. Suppose -3y + 8y = fx + 88, 2x = -5y + 76. List the prime factors of y. 2 Suppose -9o = -5o - 3w - 28, 3o + 2w - 4 = 0. Suppose 2j + 2u - 1436 = 0, 2837 = oj + 2u - 5u. What are the prime factors of j? 23, 31 Let h(i) = -i*3 + 26i*2 + i - 53. Let z be h(26). List the prime factors of 3/z + (-5187)/(-27). 2, 3 Let u(l) = 2l*2 - 53l - 22. Let t be u(27). Suppose -800 = -th + 5z, -5h + 3z + 75 = -731. List the prime factors of h. 163 Let r(x) = -x3 + x2 + 11x + 18. Let h be r(-2). List the prime factors of (-51243)/(-124) - ((-6)/h - -1). 7, 59 Suppose -2m + 3f = 361, 24m - 546 = 27m - 3f. List the prime factors of -1 + 1 - m/1. 5, 37 Suppose 13 = -6v + 5v. Let k(l) = -2l - 26. Let b be k(v). Suppose 8r - 12r + 308 = b. What are the prime factors of r? 7, 11 Let w(s) = -9s*2 + 13s + 145. Let k(v) = -47v2 + 64v + 724. Let h(c) = 2k(c) - 11w(c). What are the prime factors of h(-9)? 3, 131 Let g(x) = x*3 - 16x*2 - 10x + 7. Let v be g(17). What are the prime factors of 3412/10 + v/(-105)? 2, 5, 17 Let b = 100 - 104. Let f = 8 + b. What are the prime factors of 3 - ((8 - 16/f) + -204)? 7, 29 Let d(v) = -3v - 1. Let w be d(-3). Let r be (-2)/4(w - 94). Let z = 96 - r. What are the prime factors of z? 53 What are the prime factors of -35356((-36)/24 + -1)? 2, 5, 8839 Let d(j) = -j - 9. Let g be d(-7). Let m be g/(-6) - 45/(-27). Suppose 0 = mv + 17 - 189. List the prime factors of v. 2, 43 What are the prime factors of (-144604)/(-2)((-90)/(-12) - 7)? 36151 Let n be -4 - ((-85)/25 + 3)-95. What are the prime factors of 56/n(-873)/6? 2, 97 Let w(c) = -60c3 - c2 - 1. Let n(z) = -62z3 - z2 - 1. Let o(l) = -5n(l) + 4w(l). List the prime factors of o(2). 5, 113 Suppose -2l - 9 = -5l. Suppose 4d - 30 = lr - 162, -2d = 2r - 88. List the prime factors of r/(-3)(-10)/(120/18). 2, 11 Let b be (3/4)/((-2)/(-8)). Suppose -6z + b = -3. List the prime factors of -1 + z + -3 + 79. 2, 19 Let m(w) be the second derivative of -w4/6 - w3/2 - w2/2 - 20w. Let c be m(3). Let x = 61 - c. List the prime factors of x. 89 Let z(t) be the first derivative of -t*4/4 + 7t*3/3 + 19t*2/2 - 12t + 13. Let o be z(9). List the prime factors of (-404)/82/3o. 101 What are the prime factors of (-1 + 66536/(-22))(-54 + 43)? 3, 11093 Let o be 0 + (3 - -2) + -3. Let v be o/(-1) - (-1 - (-3)/(-1)). Suppose -3w = -vc - 397, -320 = -4w - 3c + 181. List the prime factors of w. 3, 43 Suppose -18r = -30569 + 5. Let z = r - 803. List the prime factors of z. 5, 179 Let p(v) = v*3 + 74v*2 + 65v	{ "pile_set_name": "DM Mathematics" }
- 230u2 wrt u. -4bi + 6b - 190i - 460 What is the third derivative of -4458175m*3 - 5267109m*2 + 2 wrt m? -26749050 What is the third derivative of -124v*5 - 46v*4 - 9636v*2? -7440v*2 - 1104v What is the second derivative of 5419096t2 + 16t - 156172 wrt t? 10838192 Find the second derivative of -310b2t*2 + 5b*2t + 3b2 + bt2 - t2 + 25609t wrt b. -620t*2 + 10t + 6 Find the third derivative of -3965d4i*3s - 231d3is2 + 23d*2i*3s*2 + 13d*2i*3 + 83i*2s*2 wrt d. -95160di3s - 1386is*2 Find the third derivative of -80hq3 + 103hq2 - 3h - q*5 - 2q wrt q. -480h - 60q*2 What is the derivative of -79841f*4 - 189995? -319364f*3 Differentiate -13i*2q*2 - 742i*2q + 4q2 - 1217q + 2 wrt i. -26iq*2 - 1484iq Differentiate -16p*2t - 3301022p2 + 100890pt3 wrt t. -16p*2 + 302670pt2 Find the first derivative of -260212v - 11542 wrt v. -260212 Find the first derivative of -4119dq*3 + dq*2 + 48950d + q*3 wrt q. -12357dq2 + 2dq + 3q*2 Find the third derivative of 34622z*4 - 2538z*2 - z. 830928z What is the second derivative of -2933a3 + 129a*2 + 3a + 34535 wrt a? -17598a + 258 Find the second derivative of 9s*3u2 - s3u - 16s*3 - 2768s*2u*2 + 6su2 + 14su - u2 - 4u wrt u. 18s3 - 5536s*2 + 12s - 2 Differentiate 154338y - 50471 wrt y. 154338 Differentiate -25k*3t*3 + 6k*3 - 312k*2 + 1246t*3 - 2 wrt t. -75k*3t*2 + 3738t*2 What is the third derivative of -2052670j*3 + 70j*2 - 12939j? -12316020 Differentiate 2745q4 + q3 + 93q*2 - 1003058 with respect to q. 10980q*3 + 3q*2 + 186q What is the first derivative of 256527g - 379805? 256527 What is the first derivative of 5w*4 - 800w*3 + 30222? 20w*3 - 2400w*2 Find the second derivative of 3i*4 - 10i*3 + 2393i*2 - 430979i. 36i2 - 60i + 4786 Find the second derivative of 124390d2r + 2d2 - dr - 526d + 66r wrt d. 248780r + 4 What is the second derivative of -120937g*3u2 - g3 + gu - 20g + u*2 - 75 wrt u? -241874g*3 + 2 What is the second derivative of 4nq4 + 4nq3 + 509nq2 - 28nq + n + 10q wrt q? 48nq*2 + 24nq + 1018n What is the first derivative of h*2jx - 21h*2jz + 1687h*2x + 15hjx + 3hz - 2x wrt j? h*2x - 21h2z + 15hx Find the second derivative of -68224s3 - 2s*2 - 44499s - 1 wrt s. -409344s - 4 What is the first derivative of 2by3 - 7by2 + 597b + y*3 - 32y + 23 wrt b? 2y3 - 7y*2 + 597 Find the third derivative of 11b*2w*3 - 166b*2w*2 + 5b*2 - bw*4z + 2bw*2 - 24w*4z - 5z - 2 wrt w. 66b*2 - 24bwz - 576wz What is the third derivative of -1521776d3 + 24d2 - 10451 wrt d? -9130656 Find the second derivative of r5 - 2001r4 + 3r*3 + 72779r wrt r. 20r3 - 24012r*2 + 18r Find the first derivative of -d*4 + 2635d*3 + 12d*2 - 5d + 2490299. -4d3 + 7905d*2 + 24d - 5 Differentiate -fr3 - 294746fr2 + 263072r3 with respect to f. -r3 - 294746r2 What is the derivative of -25dl3m + 1308dl*2 - 85dm - 55d - 5m + 1 wrt l? -75dl2m + 2616dl Find the second derivative of -15i3q*2v3 - i3qv2 - i2qv - 13i2q - 247i2v*3 - 2iqv*3 - 67147q*2v wrt q. -30i3v*3 - 134294v What is the third derivative of 62322i4 + 2i*3 + 51883i*2? 1495728i + 12 What is the first derivative of 9r3u*2 - 35374r*3u - 101980u2 + 3u wrt r? 27r2u*2 - 106122r*2u What is the derivative of 180264v3 + 1080453? 540792v*2 Find the second derivative of 3o*5 - 88o*3 - 91o*2 + 4o - 1842 wrt o. 60o3 - 528o - 182 What is the second derivative of 10752i5 + 3i*2 - 21053i? 215040i3 + 6 Find the second derivative of -4518212km2 - 15km + k + m + 43 wrt m. -9036424k What is the second derivative of -2m3s*4v + 13358m3s*2v - 174m3s + m*3 - 2m*2sv + 3sv - 2s wrt s? -24m3s*2v + 26716m3v What is the third derivative of -78961s6 + 6s*2 + 6504? -9475320s*3 Find the first derivative of -52552lw + 2l + 153919w wrt l. -52552w + 2 Find the second derivative of 174011l2 + 403l + 15. 348022 Find the first derivative of 72816o3t*4 - 4836o*3 + 2o*2t - o*2 + 2o wrt t. 291264o3t*3 + 2o2 Find the third derivative of -s6 + 732565s4 - 32570s*2 + 11s wrt s. -120s3 + 17581560s Differentiate 56m2 + 86m + 47711. 112m + 86 What is the third derivative of -823g*5 + 27g*4 + 5g*3 - 3870876g*2 wrt g? -49380g*2 + 648g + 30 What is the second derivative of -3cj*3rx - 267863cj3x*2 + 3cj2r + 3cjx2 + 3031cjx - 2crx2 + 8jr wrt x? -535726cj3 + 6cj - 4cr What is the third derivative of 1711791p*3t - 286p2t - p*2 + 2pt - 409t wrt p? 10270746t Find the second derivative of -426247n*2 + 27n + 1154 wrt n. -852494 What is the second derivative of -2n3q2 - n3q + 49n*2q*2 + 4746n + 2q2 wrt n? -12nq2 - 6nq + 98q*2 What is the third derivative of -34188b*3h*2q*2 - 184b*2h*2q*2 + 8b*2hq2 + 2q*2 wrt b? -205128h*2q2 Find the second derivative of -l3 - 2704l2 + 60l + 27. -6l - 5408 Find the third derivative of -p5 - 7766p4 - p3 - 5p2 - 4p - 82 wrt p. -60p2 - 186384p - 6 Find the third derivative of -53735n4 - 2n*2 - 3665n - 2. -1289640n Find the second derivative of 2n*2x*2 + 2n*2x - 22908n2 + nx*2 - 20722x*2 + 1 wrt x. 4n*2 + 2n - 41444 What is the third derivative of 752105m3z*2 - 146m*2z*2 + 309m*2z + 2m - 2z wrt m? 4512630z2 Find the third derivative of 20v*5 - 336v*4 - 7v*3 - 129241v*2. 1200v*2 - 8064v - 42 What is the second derivative of -3p3t*2 - 370p*2t2 + p2t + 26735pt2 - 4p wrt p? -18pt*2 - 740t*2 + 2t What is the third derivative of g*3j*3 - 34341g*3j*2 + 2g*3j - 7g2j*3 + 2g*2j + 79gj*3 - 3j*3 wrt g? 6j*3 - 206046j*2 + 12j Find the second derivative of 646103dy*3 - 3dy + 2d - y*5 - 9y - 831 wrt y. 3876618dy - 20y3 What is the third derivative of 229247o*6 - 2o*2 - 4512o - 2 wrt o? 27509640o3 What is the second derivative of -1006539a*2 - 1286068a? -2013078 Find the third derivative of -49i6y + 166i3y*3 + 3i*2y*2 - 9i*2y - 649i2 + 6y*3 wrt i. -5880i*3y + 996y3 What is the second derivative of 726hp2qt - 3hp2q + hp2t - 6hpqt - 4hpq - hpt + 2hqt + pt + 6t wrt p? 1452hqt - 6hq + 2ht What is the third derivative of -197f*2q*3 + 2453f*2q + 3f2 + fq*2 + 119q*3 wrt q? -1182f*2 + 714 Find the second derivative of 11h*2x*2 + 2h*2 + 97hx5 - x3 + 20283x wrt x. 22h2 + 1940hx3 - 6x Find the second derivative of 1473508p2s - 2277ps + 288p wrt p. 2947016s Differentiate -2y3 + 2019y*2 + 49774 wrt y. -6y*2 + 4038y What is the third derivative of 306y6 - y5 + y4 + 2y*2 - 6656y? 36720y3 - 60y*2 + 24y Differentiate -2hr*2 + 2hr + 70066h + 282r2 wrt r. -4hr + 2h + 564r What is the second derivative of -3936j*3n + 20j3 - jn - 410j - 38n wrt j? -23616jn + 120j What is the derivative of 7515gj3 - 9gjn + 8j3n - 5889n wrt g? 7515j*3 - 9jn Find the third derivative of 747160k*3 + 626705k2 + k wrt k. 4482960 What is the first derivative of -h2 - 3369h + 47424 wrt h? -2h - 3369 What is the second derivative of -165c4f + 1027c3 + 3764cf - 86f wrt c? -1980c2f + 6162c What is the second derivative of -68698d*5 - 2d + 21023 wrt d? -1373960d3 What is the third derivative of 249o*4 + 277o*3 + 19810o*2 wrt o? 5976o + 1662 Find the second derivative of 971or*2u*3 - 13or2z*2 - 2oru*3 + 2oruz - 2orz*2 + ouz - 5oz2 + 302u*3z*2 wrt r. 1942ou3 - 26oz2 Find the second derivative of -145c*4 - 35c*3 + 2c*2 + 15c + 6812 wrt c. -1740c2 - 210c + 4 Find the third derivative of 5725p4 - 5p*3 - 10p*2 - 2p + 224. 137400p - 30 Find the third derivative of -3u*5 - 1306082	{ "pile_set_name": "DM Mathematics" }
8 = -2b - 394 for b. 4 Solve -77l - 5l + 671 = -1461 for l. 26 Solve 0 = -411w - 561 - 437 - 235 for w. -3 Solve 19f + 125 + 171 = -8 for f. -16 Solve -136x - 279 = -107x + 185 for x. -16 Solve -78k - 57 + 681 = 0 for k. 8 Solve -12y - 272 = -21y - 8y for y. 16 Solve 0 = 42z + 322z + 5152 + 2128 for z. -20 Solve 41n - 616 = -47n for n. 7 Solve -39o - 26o = -31o + 272 for o. -8 Solve 0 = -33b - 295b - 218 + 1530 for b. 4 Solve 641 = -112a - 664 - 151 for a. -13 Solve -329z - 1869 = 4382 for z. -19 Solve 23m - 7 - 131 - 161 = 0 for m. 13 Solve -343h + 6057 + 4576 = 0 for h. 31 Solve 1211g - 1271g + 540 = 0 for g. 9 Solve 14u + 244 = -66u + 19u for u. -4 Solve 6y + 103 - 29 - 8 = 0 for y. -11 Solve -193c = -117c - 988 for c. 13 Solve -372c - 2411 = -10595 for c. 22 Solve 83f + 19f + 49f = 3775 for f. 25 Solve 759 - 615 = 18m for m. 8 Solve 52272 = 111x - 1095x - 1194x for x. -24 Solve 0x + 8x + 88 = 0 for x. -11 Solve -34s - 438 = -132 for s. -9 Solve -284t + 177 = -107 for t. 1 Solve -13r + 9903 = 9656 for r. 19 Solve 419n + 153 - 153 = 0 for n. 0 Solve 0 = 53z + 64 - 488 for z. 8 Solve 100y = 2309 - 509 for y. 18 Solve -9841d + 9896d = -495 for d. -9 Solve -34a + 10a = -72 for a. 3 Solve 2128 = -184x + 317x for x. 16 Solve 138 = 10c + 48 for c. 9 Solve 20x = x - 27x - 276 for x. -6 Solve 341 + 3234 = -325d for d. -11 Solve 180b - 339 = -3579 for b. -18 Solve 14491 = 55i + 14546 for i. -1 Solve -80c - 516c - 1124 - 3048 = 0 for c. -7 Solve 14y - 85967 = -86163 for y. -14 Solve 23g = -48g + 7g + 1664 for g. 26 Solve 350j + 11858 = -189j for j. -22 Solve 325 = 327q - 656 for q. 3 Solve -451s - 56 + 46 = 441 for s. -1 Solve 67j + 88j = 0 for j. 0 Solve 224y = -60y + 3692 for y. 13 Solve -59 = 475w - 75 + 491 for w. -1 Solve 681q - 674q + 98 = 0 for q. -14 Solve 2517 = -155f - 738 for f. -21 Solve -79u - 207 - 425 = 0 for u. -8 Solve 107b = -574b - 357b for b. 0 Solve 11q - 14406 + 14417 = 0 for q. -1 Solve -362i - 44i = 55i - 2305 for i. 5 Solve -24g = -50g - 24 - 28 for g. -2 Solve -2316 = -118m + 162 for m. 21 Solve 26542v = 26494v + 528 for v. 11 Solve 61p + 519 - 214 = 0 for p. -5 Solve -93 = -23584w + 23553w for w. 3 Solve 161 + 940 = -224g - 143g for g. -3 Solve 1265v - 1394v + 3096 = 0 for v. 24 Solve -132v + 82 = -17v - 1298 for v. 12 Solve 0 = -93673t + 93627t + 460 for t. 10 Solve -500m - 10244 = 7756 for m. -36 Solve 20h + 9757 = 9877 for h. 6 Solve -49q + 3588 = 3539 for q. 1 Solve -1343 + 1553 = -10b for b. -21 Solve 11n - 62n = 255 for n. -5 Solve 924p = -55p - 7240 - 9403 for p. -17 Solve -6y + 1 = -18y - 107 for y. -9 Solve 5h + 146 - 2726 = 134h for h. -20 Solve -223t = 3287 - 10646 for t. 33 Solve 96n + 137n = 2n - 1155 for n. -5 Solve 108 = 41o - 56 for o. 4 Solve -620u - 1 = -616u + 3 for u. -1 Solve -238w + 3366 = 510 for w. 12 Solve -51t + 7t + 303 = -577 for t. 20 Solve -7g = 43g + 78g for g. 0 Solve 820 + 1533 = 60y + 121y for y. 13 Solve -28r - 2r + 2r = 28 for r. -1 Solve 226x = 127x - 231x - 330 for x. -1 Solve 21y = 21y - 42y - 462 for y. -11 Solve -59v + 145v = 516 for v. 6 Solve -10b - 21b = -4b - 351 for b. 13 Solve -3b + 7 + 9 = 19 for b. -1 Solve -8p - 40 - 100 = -60 for p. -10 Solve -616 - 1736 = 147y for y. -16 Solve 4y + 1992 = 1952 for y. -10 Solve 108u = 52u - 672 for u. -12 Solve -110q + 294 = -131q for q. -14 Solve 0 = -80o + 41o - 351 for o. -9 Solve -693s + 101s = -230 - 954 for s. 2 Solve -144r - 24r - 828 = -2508 for r. 10 Solve -38p - 4p - 11p + 53 = 0 for p. 1 Solve -599x = -1203x - 963x for x. 0 Solve -100y + 121 + 2579 = 0 for y. 27 Solve -26q = -139703 + 139651 for q. 2 Solve -815 = 43f - 643 for f. -4 Solve -550r - 7 = -551r for r. 7 Solve 0 = 7424m - 7387m + 407 for m. -11 Solve 72227x = 72219x - 72 for x. -9 Solve 819i - 2366 - 642 = 1007i for i. -16 Solve 1581x = 1584x + 39 for x. -13 Solve 14311y - 14814y - 19114 = 0 for y. -38 Solve 2w - 2049 + 2067 = 0 for w. -9 Solve 19h - 25h + 63 = -3 for h. 11 Solve -40v - 53v = -10v + 996 for v. -12 Solve 273d - 139d = 144d + 30 for d. -3 Solve -12856y = -12841y - 285 for y. 19 Solve 58o - 1503 - 576 = -803 for o. 22 Solve 42b - 825 + 392 - 1121 = 0 for b. 37 Solve 1723m - 2006 = 1605m for m. 17 Solve -48 = 43i - 59i for i. 3 Solve -3689 + 3663 = -y + 27y for y. -1 Solve -810 = -147o + 66o for o. 10 Solve 83p + 378p + 5039 = -3259 for p. -18 Solve -313n = 598 + 1280 for n. -6 Solve -218a = -107a + 175a - 1430 for a. 5 Solve -263w + 11840 = -442w - 413w for w. -20 Solve -240u = 2210 + 910 for u. -13 Solve 101c = -291c + 3920 for c. 10 Solve -1349 = -62r + 697 for r. 33 Solve 835w - 816w + 247 = 0 for w. -13 Solve 0 = -3569h + 4314h + 10430 for h. -14 Solve 0 = -636o + 572o + 128 for o. 2 Solve 241t + 844 = -1807 for t. -11 Solve 222x - 6958 = -275x for x. 14 Solve -23r + 27r + 29 = -7 for r. -9 Solve -64s - 8s + 101 = -1123 for s. 17 Solve 11575u - 11423u - 4256 = 0 for u. 28 Solve 296891 = -9m + 296702 for m. -21 Solve -29u - 720 = 19u for u. -15 Solve 45o + 6o + 8o = 472 for o. 8 Solve 3o - 3o - 4 = 4o for o. -1 Solve -29473x + 1248 = -29434x for x. 32 Solve 265v - 829 = 231 for v. 4 Solve -3v + 4522 = 4606 for v. -28 Solve -o + o - 30 = 2o for o. -15 Solve -1565q + 87 = -1574q - 48 for q. -15 Solve -202d - 191d - 133 = -412d for d. 7 Solve -261q + 3404 + 4282 = -810q for q. -14 Solve -32637 = -1920a + 11523 for a. 23 Solve 486s - 34s = 10396 for s. 23 Solve -40n = -118n + 48n - 690 for n. -23 Solve 0 = -21z - 61777 + 61756 for z. -1 Solve -74y + 1651 = 763 for y. 12 Solve -123x + 625x + 4274 = 258 for x. -8 Solve 15 - 60 = -15q for q. 3 Solve -215b - 2380 = 168b - 145b for b. -10 Solve 3375 - 197 = 323x + 131x for x. 7 Solve -1463m + 1596 = -1387m for m. 21 Solve 233 + 293 + 34 = 70j for j. 8 Solve 37v - 12v - 72 = 19v for v. 12 Solve 65q + 43q + 864 = 0 for q. -8 Solve 5827 = 507j + 16786 + 4758 for j. -31 Solve 0 = -32f + 1354 - 1322 for f. 1 Solve -745 = 192f - 1321 for f. 3 Solve 202o - 161o - 266 = 267 for o. 13 Solve 0 = -8165a + 8206a - 1271 for a. 31 Solve -17p - 17p - 96 = -18p for p. -6 Solve 364z - 317z = -94 for z. -2 Solve -2x = -55 + 61 for x. -3 Solve -214w = -71w + 1144 for w. -8 Solve -215t + 1485 + 1063 = 149t for t. 7 Solve -40296 = 11l + 12l - 40158 for l. -6 Solve 112 = -68o + 9 - 577 for o. -10 Solve 570h - 611h = 246 for h. -6 Solve 107v + 1518 = -80v + 49v for v. -11 Solve -259g + g - 7998 = 0 for g. -31 Solve 82 = -13p - 92p - 1178 for p. -12 Solve 1171 = 168o + 1675 for o. -3 Solve 20f = -231 + 31 for f. -10 Solve 8i - 3i + 19i + 24 = 0 for i. -1 Solve 281 + 269 = 55x for x. 10 Solve -29y - 1527 = -1672 for y. 5 Solve 0 = -38067w + 38017w + 150 for w. 3 Solve -21p - 884 = 14p - p for p. -26 Solve -702f + 499f = 812 for f. -4 Solve 261n - 131n - 171 = 111n for n. 9 Solve 28 = 50m + 7 - 79 for m. 2 Solve -97b - 295 - 384 = 0 for b. -7 Solve -38x - 572 = 198 - 200 for x. -15 Solve 6h + 7h - 3h = 20 for h. 2 Solve 0 = -14t - 288848 + 288400 for t. -32 Solve 0 = -34c - 32c - 198 for c. -3 Solve 18k - 41608 = -42148 for k. -30 Solve -5856 = 1686r + 38539 + 2813 for r. -28 Solve -381t - 214 = -229t + 90 for t. -2 Solve -3225 - 735 = 180q for q. -22 Solve -313 = 11h - 522 for h. 19 Solve 9534 = 16b + 9582 for b. -3 Solve -23z = -90z + 28z - 819 for z. -21 Solve 226l - 746l - 6240 = 0 for l. -12 Solve -385f - 7944 = 141 for f. -21 Solve 384214m + 276 = 384191m for m. -12 Solve 13038 + 7304 = -1714k + 6630 for k. -8 Solve -642 = -204n - 30 for n. 3 Solve -6u + 1251 = -17u + 1130 for u. -11 Solve 2709 = 142k + 1005 for k. 12 Solve 310 + 82 = -14z + 126 for z. -19 Solve 6u + 4u = -31u + 164 for u. 4 Solve -121c - 32 - 694 = 0 for c. -6 Solve -472v = -126v - 4152 for v. 12 Solve -757v + 69 = -780v for v. -3 Solve 0 = 9n + 13n + 116 - 138 for n. 1 Solve -3717 = 151c + 1266 for c. -33 Solve 511f - 531f = 140 for f. -7 Solve 32m + 701 = 1085 for m. 12 Solve 0 = -28m + 607 - 607 for m.	{ "pile_set_name": "DM Mathematics" }
- 2 + 4)(-1 - 2 + 4). -12z + 1 Expand -3r4 + 3r*4 - 2r*4 + (91 - 91 - 5r*3)(-3r + 0r + 2r). 3r*4 Expand (4g + 0g - 2g)(3 - 6 + 2)(-2 + 1 + 3)(-65 - 189 + 72). 728g Expand (0 + 0 + 1)(-1 - 4w + 1)(1 - 49 - 36). 336w Expand (256y + 256y - 5 - 491y)(2y3 + 0y3 + y3)(-y - 2 + 2). -63y*5 + 15y*4 Expand 2n*2 - 6n*2 + 3n*2 + (0n*2 - 2n*2 + 3n*2)(20 - 33 + 19). 5n2 Expand (2y*3 + 2y*4 - 2y*3)(-2y - y + 2y) - 2y5 + 5y*5 + 3y*5 + (-3y*2 + 2y*2 + 3y*2)(1 + 2y3 - 1) + 0y*5 - 2y*5 - 2y*5. 4y*5 Expand 0t - 2t + t + (t + 2t - 5t)(10 + 4 - 7) + 0t - 2t - t. -18t Expand (z + z + 3z)(-535z + 521z + 2 - 4). -70z*2 - 10z Expand (-11 + 20 - 12)(-z + 5z + z). -15z Expand (-3q*3 + 2q*3 + 6q*3)(121q - 359q + 34 + 126q + 121q). 45q4 + 170q*3 Expand (g - 1 + 1)(176g + 153g - 318g + 16). 11g*2 + 16g Expand 2z4 - 3z*4 - 3z*4 + (3z3 - z3 + z*3)(-50z + 51z - 2 + 3). -z*4 + 3z*3 Expand (-3 - 2 + 3)(2 - 6 + 3)(-6q*2 + 0q*2 + 4q*2) - 2 + 2 + 2q2 + q2 + 3q2 - 6q*2 + (q - 3q + 0q)(0 + 0 + q) - 4q2 + 2q2 + q2. -7q2 Expand 0y3 + y3 + 0y3 + (-3y*2 - 10y + 10y)(2y - 2y + y) + (-3 - 2y + 3)(2y2 - 9y*2 - 4y*2). 20y*3 Expand (-8497x*3 + 4x + 8525x3 + 0x)(x + 2x - 4x). -28x*4 - 4x*2 Expand (0 + 0 - 1)(15s - 44s + 6s) - 1 - s + 1. 22s Expand (-2 + 0 + 0 + (4 - 3 + 1)(1 + 0 + 0) - 64 + 22 + 31 + 0 - 4 + 2)(2m - 2m + 3m). -39m Expand ((1 - 1 + 1)(5 + 2 - 3) + (4 - 1 - 4)(0 - 5 + 4))(-102 + 102 - 21i). -105i Expand -19x*4 + 3x*4 + 0x*4 - 3x*4 - 2x*4 + 4x4 + (x - x - x2)(-4x*2 + 2x*2 + 3x*2). -18x4 Expand -x5 - 4 + 4 - x + x5 + x + (x - x + x2)(2x*3 + 3x*3 - 4x*3) + 0x*5 + 15x*5 + 7x - 8x. 16x*5 - x Expand (658n + 80 + 103n - 80)(4n - 2n*2 - 4n). -1522n3 Expand (-1 + 1 - x)((3 + 3 - 4)(-2 + 2 + 1) - 3 - 1 + 1)(77x - 48x - 43x) + 0 + x2 + 0. -13x*2 Expand 2c2 - c2 - 3c2 + (-11c + 11c - 16c)(-8 + 8 + 3c). -50c2 Expand -129h*4 + 725h*4 - 84h*4 + (-3h + 0h + 4h)(-h + h + 2h*3). 514h*4 Expand (5u*3 - 4u3 + u3)(43 - 14 + 17). 92u*3 Expand (-d + 0d + 2d)(-d + 2 - 2) + 0d2 - 2d*2 + 0d*2 + 5586 - 5586 - 59d*2. -62d*2 Expand (-l - 2 + 4 + 0l)(0 - 2 - 3) + 2l - 5l + 2l + 2l - 6l + 2l + (0 - 1 + 0)(-l - 3l + 3l). 3l - 10 Expand (9 - 6 + 1 + c)(1789 + 41c - 1789)(-7 - c*2 + 7). -41c*4 - 164c*3 Expand 4a + 3a3 - 2a*3 - 2a*3 + (-4a*3 + 4a*3 - 2a*3)(-5 + 3 + 0) + 1 - 1 + 2a3 - 3a*3 + 3a3 - a3. 4a3 + 4a Expand -35n2 - 10n*2 - 128n*2 + (0 + n + 0)(-n + n + 2n). -171n*2 Expand (-8a + 5a + 6a + 1)(44 - 12 - 17). 45a + 15 Expand (-2b + b2 + 2b)(2b - 2b - 3b*2) + (5b - 5 + 5)(-3b*3 + 0b3 + b + b3). -13b4 + 5b*2 Expand (107m - 120m + 132m)(m3 + m - m + (-1 - 2 + 5)(2m3 - 2m3 - m3)). -119m4 Expand -67n*2 - 6 - 3n*5 + 67n*2 + (-2n*4 + 3n - 3n)(-62 + 62 + 8n). -19n*5 - 6 Expand (2l + 2 - 2)(1527l*4 - 148l*4 - 46l*4). 2666l*5 Expand (-7 + 12 + 36a - 4)(5a*3 - 5 + 5). 180a*4 + 5a*3 Expand (-334 + 159 + 155)(-4p5 + 8p*5 + 8p*5). -240p*5 Expand (6q*3 + 15q - 15q)(-2q2 + 3q*2 - 4q2 + q2 + q - q + (-q - 3q + 2q)(0q - q + 3q) - 3q*2 + 2q*2 + 3q*2). -24q*5 Expand (-7 - 2 - 6)(2q - 3q + 2q)(6q + 3q - 5q). -60q*2 Expand -2 + 2 - 6q*3 + (-2q*3 + 2q3 - q3)(2 + 2 - 6) + (31 + 89 - 78)(5q3 - 5q*3 - 3q*3). -130q3 Expand 0 + v2 + 0 + (-2v + 0v + 4v)(-8v + 8v - 4v) + (v + 4 - 4)(5 + 2v - 5) + v2 + 4v - 4v - v2 - 2v*2 + 5v*2. -2v*2 Expand -781y*2 + 781y*2 + 27y*3 + 2y*2 - 2y*2 - 2y*3 + (4 - 6 + 3)(-1 + 1 - y3) - y3 + y2 - y2. 23y3 Expand (3p + 0p - 2p)((0p + p + 4p)(4p + 18 - 18) + 0p*2 - 2p*2 + 3p*2). 21p*3 Expand (-5j2 + j2 + 0j2)(4 - 4 - 4)(2 - 3 + 3). 32j2 Expand t3 + 0t + 0t + (2t - 8t - 5t)(t2 + t2 - t*2) + (-2t + 2t - t)(-2t - t + 2t)(-2 - t + 2). -11t*3 Expand (-5b + 296b + 343b)(-2b + 4b + 0b). 1268b2 Expand (6 - 4 + 0 + (1 + 0 + 5)(-2 + 1 + 3))(-12z + 2z - 2z). -168z Expand (-l3 - l3 + 4l*3)(2 + 2 - 1) + 2l3 - 1 + 1 + (-2l*2 + l - l)(2l + 1 - 1) - 5l*3 + 5l3 - l3 + l*3 + 0l*3 + 0l*3. 4l*3 Expand (4t*4 - 6t*4 + 3t*4)(31 - 330 - 519 - 98). -916t4 Expand (2f - 25 + 25)(3 + 1 + 0)(-2 + 0 + 0)(0 + 2f + 0). -32f2 Expand (1 - 4 + 4)(-3 + 3 + p) + (-183 + 183 - 66p)(2 + 0 - 3) + (-5p + 2p + 2p)(3 - 1 - 1). 66p Expand -23 + 12x - 27 + 52 + (-x - 2x + 5x)(3 - 1 + 0). 16x + 2 Expand (11 + 11 - 19)(p - p + 2p*2) + (-6p*2 - 4p*2 + 3p*2)(-5 + 4 + 3). -8p2 Expand (1 + 1 + 1)(-330c - 2c*2 + 0c*2 + 354c). -6c2 + 72c Expand -3l + 4l - 6l + 0 + 2l + 0 + (-1 + 2l + 1)(5 - 16 - 4). -33l Expand (-18j - 5j4 + 18j + j4 - j4 - j*4 + (2j*3 + 5j*2 - 5j*2)(3j - 2j + 0j) - j + j4 + j)(-9 + 9 - 6j). 18j*5 Expand (-1 - 4 + 7)(0l + l + 0l) + 5l - 3l - l + (4 - 2 - 4)(2 + l - 2) + (3 - 5l + 21l - 2)(-6 - 15 + 14). -111l - 7 Expand (17 - 11 + 2n - 15)(0n*3 - 6n*3 - 3n3) + n - n - n4. -19n4 + 81n*3 Expand (-3r*3 + 3r*3 + 4r*4)(8r - 59r - 21r - 294r). -1464r5 Expand 2b2 - b2 + b*2 + (-3b + 5b - 3b)(-3b - 2b + 4b) + (-3b - 1 + 1)(-7b - 5b - 2b)(-3 - 2 + 3). -81b2 Expand 5r*2 + r - r + (-1 - 3r + 1)(-4r - 2r + 4r). 11r2 Expand (0k - 4k + 3k)(-2 - 2 + 3)(4 - 60 + 25) - 3 - 2k + 3 + (-2k - k + k)(1 - 2 - 1) + 5 + 2k - 5. -27k Expand 0y - 8y + 6y + 3y2 + 7y4 + (y2 - 3 + 3)(-2y*2 + 2y*2 - 2y*2). 5y*4 + 3y*2 - 2y Expand 2176 - 4350 - 3n5 + 62n*4 + 2175 + (2n*2 - 5n2 + n2)(-n3 + 5n*3 - 2n*3). -7n*5 + 62n*4 + 1 Expand (-1 - 1 + 5)(2 + 0 - 1)(-21 - 12 - 10)(-p*3 + 0p*3 + 0p*3). 129p*3 Expand (14m - m*2 + 2 - 5m - 40m)(5m + 2m + 0m). -7m*3 - 217m*2 + 14m Expand (4k - 6k + k + (2k - k + 4k)(2 - 2 + 3))(4k - 6k - 2k)(-4 + 0 + 2). 112k2 Expand (4 - 2 + 0)(-2g - 1 + 1)(1600 - 819 - 4689). 15632g Expand (-3 + 5 + 4)(0 + 2 - 3)(0s + 0s + s2). -6s*2 Expand (-l + 4l + 0l)(32l4 + 3l*4 + 3l*4). 114l*5 Expand ((0 - 2 + 3)(0 - 1 + 0) - 5 + 3 + 1)(6130 + 279w*5 - 6130). -558w*5 Expand (0 + 1 + 3)(1 + 0 + 1)(-3 + 4 + 0)(0h + 3h - 5h). -16h Expand (-4 + 4 - v - 4)(-10 - 1 - 67v + 11). 67v2 + 268v Expand (36u + 15u*2 - 36u)(-3u + u + 0u) + (u3 - 2u3 - u3)(6 - 4 + 0). -34u3 Expand -g5 + 0g + 0g + 3g5 - g5 - 4g*5 + (2g*2 - 4g*2 + 3g*2)(-5g2 + 5g2 - g3) + 0 + 2g5 + 0 - 1642g*3 + 1642g*3 - 57g*5. -59g*5 Expand -3r*4 + 0r*4 - 14r*4 + (-5r2 + r2 + 3r2)(-4r2 - 2r*2 + 4r*2). -15r*4 Expand (-4u*2 - 2u + 2u)((0 + 0 + u)(4 - 1 - 1) - 61 + 5u + 61). -28u3 Expand (722d*2 - 50d*3 - 722d*2)(1 - 4 - 1)(1 - 1 + d). 200d*4 Expand (3a*4 - 3a*3 + 3a*3)(2a + 5a - a)((5 - 2 - 1)(0 + 1 - 2) + 1 - 6 + 4). -54a5 Expand (-r + 3r + 0r)(-3r + 4r - 3r) - 3r*2 + 0r2 + r2 - 3r2 + 6r*2 - 4r*2 + 2r*2 - 3r*2 + 0r*2 + 3r - 879r2 + 918r*2 - 4r. 31r2 - r Expand (-3a - a + a)(1 - 2 + 2) - 59 + 20a + 59. 17a Expand (b + 7b - 3b)(-2 + b*4 - 4b*4 + 2b*4). -5b*5 - 10b Expand (-1 + 1 - 4k)(2 - 2 - 2) + (0 - 4 + 2)(-3k + 3k + 5k). -2k Expand (-2j - j + 2j + (5 - 2 - 1)(j + 2 - 2) - 2j - j + 4j + j + 3j - 5j)((1 - 1 - 2j)(-3 + 7 + 12) - j - j + 5j). -29j2 Expand -4k3 + k2 - k*2 + (116k*2 + 6k*2 + 28k*2)(-5 + 5 - 2k). -304k*3 Expand (-10u + 2u - 7u)(-8 - 4u + 8)(0 + 0 - 2). -120u*2 Expand (151 - 58h*2 - 151)(5h + 0h - 4h). -58h3 Expand (-t2 + 0t + 0t)(-14 - 10t*2 + 15 - 280t*2). 290t4 - t2 Expand 0k5 - k5 + k4 + 3k5 - k5 - 3 + 3 + (79k + 57k - 44k)(-k4 + k4 + 2k4). 185k5 + k4 Expand (	{ "pile_set_name": "DM Mathematics" }
43 = -3i. What is the tens digit of a? 1 Let t be -2(-3)/183. Suppose v - 2 = -t. What is the units digit of v? 1 Suppose -87 = -g - 4b - 9, -3g + 4b + 298 = 0. What is the tens digit of g? 9 Suppose 5x - 2x = 141. What is the tens digit of x? 4 Suppose y + 2y + 15 = 4l, -11 = -2l + 5y. Suppose -3f + 7f - 92 = -3w, -3w + 72 = lf. What is the units digit of f? 0 Let m = 62 + -50. What is the tens digit of m? 1 Let p(f) = -f2 + f + 1. Let t(m) = 3m*2 + 3m - 1. Let s(g) = 2p(g) + t(g). Let l be s(-4). What is the units digit of 1l(-3 - -1)? 6 Suppose -6 = 3t - 5f, -3f - 18 = -2t - 7f. Suppose -4a + 464 = 2b, -1090 = -8b + tb + 4a. What is the units digit of b/27 - (-4)/(-18)? 8 Let x = 25 + -8. Let m = x - 3. What is the units digit of m? 4 Let r(n) = 2n*2 + 2n - 2. Let p be r(-2). Suppose a = pa - 4. What is the units digit of a? 4 What is the units digit of 300/(-45)(1 + -2)15? 0 Suppose 0 = -5g - 2b - 25, 3b = 4g + 5b + 20. Let y(q) = q*3 + 5q*2 - 6q - 7. What is the units digit of y(g)? 3 Suppose h + 3h = 20. Suppose hw - c - 253 = 0, -2w = -0w + 5c - 112. What is the tens digit of w? 5 Suppose 5s - 31 = -4b - 0, -3 = -s. Suppose 0 = -2w + 3w. What is the units digit of 2 - (1 - b - w)? 5 Suppose -5f - y + 1821 = 0, 28y = 4f + 27y - 1455. What is the hundreds digit of f? 3 Let v be -8 + 6/(-9)-3. Let n(f) = 2f. Let t(b) = -b - 1. Let y(h) = n(h) + 4t(h). What is the units digit of y(v)? 8 What is the hundreds digit of (-1055)/(-2)-12(-8)/120? 4 Let g be (1 + -3)6/(-4). Suppose c - g = 2t, -3t = c - 0t + 2. What is the units digit of c? 1 Let k(s) = 2s + 5. Let z(p) = 2p + 4. Let f(x) = 5k(x) - 6z(x). What is the units digit of f(-4)? 9 Suppose 0w + w = -12. Let i = w - -18. What is the units digit of i? 6 Let v be (-860)/(-15) - 2/(-3). Let u = v + -25. What is the tens digit of u? 3 Suppose -r - 4r + 300 = 0. Suppose 3p = y + 47, 3y = 4p - 1 - r. What is the units digit of p/3 + 3/(-9)? 5 Let i = 18 - 3. Suppose i = f - 17. What is the tens digit of f? 3 Suppose 0 = 5u + 6 - 36. What is the units digit of u/(-9) - 154/(-6)? 5 Let a(p) be the second derivative of p4/12 - p3/2 + 3p2/2 + 4p. What is the tens digit of a(-3)? 2 Let v(h) = 10h3 - h2 - 2h + 3. Let y be v(2). Suppose 3i - y = -z, -i + 5z = -0z - 9. What is the units digit of i? 4 Suppose 0 = 2a - p + 6, 2a = 3p + 2 - 16. Let b be (1-9 + 2)a. Let g(k) = k + 2. What is the units digit of g(b)? 9 Suppose 10n - 5814 = -8n. What is the hundreds digit of n? 3 Let b = 52 - 22. Suppose 5s = 5m - b, -3s = -4m - 7 + 27. Let t = s + 10. What is the units digit of t? 6 Let i be (-3 - (-18)/4)38. Suppose 5s - 12 = n - i, 0 = -s. What is the units digit of (1 - -1)/(10/n)? 9 Suppose 336 = 13o - 10o. What is the units digit of o? 2 Let s = -40 - -16. Let w = -5 - s. What is the units digit of w? 9 Let b(z) = -z + 4. What is the tens digit of b(-8)? 1 Suppose s + 0s = 1. Let m(d) = -4d - s + d*3 - 2d*3 + 6d*2 + 0. What is the units digit of m(5)? 4 Suppose 2z + 5 = 17. Let t be 4/z - (-20)/6. Suppose 3d - 4 = -4i, i = -3i - 4d + t. What is the units digit of i? 1 Let u be 3 + (6 - (-7 + 4)). Let i be 0/(-3) - (-31 + -1). What is the tens digit of i/3 + 4/u? 1 Suppose -5n + 28 = 4a, 3a - 18 - 3 = 2n. Let w(r) = -ar3 + 6r*3 + 4 - 13 - 9r*2 - 10r. What is the units digit of w(-8)? 7 Let x(d) = 3d + 2. Let s = -3 - 0. Let h be x(s). What is the units digit of (-16)/h + (-6)/21? 2 Let a be (-4)/(-10) - (-260)/(-25). What is the units digit of 132/a10/(-3)? 4 Suppose -5c = z - 60, 0c - 4c = -2z - 34. Let f = c + 29. What is the units digit of f? 0 Let z(j) = -10 - 11j + 7j + 3j + 0. Let v be z(-12). What is the units digit of (v-2)/2 + 10? 8 Let h = 25 - 13. What is the units digit of (-4)/(h/19)-3? 9 Let u(b) = b - 5. Let v be u(7). Let x(g) = -g3 + 2g*2 + 2g - 3. What is the units digit of x(v)? 1 What is the units digit of (-138)/9(-6)/4? 3 Let r = -16 - -10. Suppose -6v + 10v = -16. Let s = v - r. What is the units digit of s? 2 Let m(x) = -x - 2. Let b be ((-18)/(-21))/((-2)/14). Let t be m(b). Suppose -td + 20 = 0, 0 = -4v - 3d - 0d + 39. What is the units digit of v? 6 Let l = -12 - -18. Let d(w) = -w3 + 7w*2 - 4w. Let u be d(l). Suppose 5s + 4 = -4c, -3s = -c - s + u. What is the units digit of c? 4 Let s be (2 + 2)/2 + 128. Suppose s - 45 = 5h. What is the units digit of h? 7 What is the units digit of (((-276)/15)/2)/((-1)/5)? 6 Let k(z) = 6z - 3. Let m be k(6). Let h = m + -5. Suppose 2q - h = -0q. What is the tens digit of q? 1 Suppose 0 = -2x + 4 - 0. Let o be 24/x + (-2 - -1). What is the tens digit of -1o/1-1? 1 Suppose -2j + 9 + 11 = 0. What is the units digit of (-4)/j - (-114)/10? 1 Let k(g) = g3 - g + 1. Let m = 9 - 4. Suppose 0 = mb - b. What is the units digit of k(b)? 1 Suppose 0 = 4u + 3n - 69, -2 = n + 3. What is the tens digit of u? 2 Let o = 5 + 0. Suppose or = 3q + 62 + 51, 104 = 4r + q. What is the units digit of r? 5 Let z(c) = 0 + 3c - 28c - 5 + 0. What is the tens digit of z(-2)? 4 Suppose 4b - 3i = -1, 5b - 13 = -4i + 3i. What is the units digit of 6 + 0 + b - 3? 5 Let y(c) be the third derivative of -c*4/6 - 5c*3/3 - 2c*2. What is the tens digit of y(-7)? 1 Let z(f) = -4f. Let q be z(-1). Suppose -13 = qt + 15. Let l = t - -11. What is the units digit of l? 4 Suppose 20 = -4p, -p - 225 = -4w - 16. What is the units digit of w? 1 Let p be (-101)/(-4) - (-48)/64. Let q = p + -10. What is the tens digit of q? 1 Let r(c) = -c + 6. Let f be r(6). Suppose 3x - 18 - 6 = f. What is the units digit of x? 8 Suppose 12 = -x + 2x + 2q, -2q + 28 = 3x. Let w(r) = -xr + 0 + 1 + r. What is the units digit of w(-1)? 8 Suppose -24 = 2f + 5n - 177, f = 5n + 54. What is the tens digit of f? 6 Let r = 11 - 11. Suppose -2q + 5q - 12 = r. What is the units digit of q? 4 Let i = -72 - -142. What is the tens digit of i? 7 Suppose 0 = 3j - 5j + 4g + 40, 0 = -3j + 3g + 66. What is the units digit of j? 4 Let x(g) = 6g - 3. Let r(u) = -4u + 2. Let v(a) = 7r(a) + 5x(a). Let f(o) = -o2 + 1. Let z be f(0). What is the units digit of v(z)? 1 Let t be 2 - (3 - 11 - -2). Let r = -3 + 6. What is the units digit of r/(1 + (-2)/t)? 4 Suppose 61 = -5w + 156. Suppose 0s - 47 = 3v - s, 3s = -v - w. Let u = 30 + v. What is the units digit of u? 4 Suppose 0 = -2l - 10, -l - 170 = -3a - 3l. What is the units digit of a? 0 Suppose -3u = -9, 17 - 44 = -2c - 5u. Let t = c - 1. Suppose -tf + 4x + 35 = -0, 21 = 3f - 3x. What is the units digit of f? 7 Let i be (0 - -2)(-14)/(-4). Let u(v) = iv2 + 2 - v3 - 3 - 4v*2. What is the units digit of u(1)? 1 Let a(r) be the second derivative of -3/2r*2 + r + 0r*3 + 0 + 1/12r*4. What is the units digit of a(-3)? 6 Let s be (-9)/6(-8)/6. Let c be (-3)/s24/(-18). Suppose -9 = -3o, -3v = -v - co - 10. What is the units digit of v? 8 Let o = 8 + -4. Suppose 2t + 12 = 5t - 3b, -ob + 40 = 4t. Suppose -5w + 5v + 55 = 0, 4w = tw - 4v - 28. What is the tens digit of w? 1 Let q(o) = -3o3 - 3o*2 - o - 1. What is the hundreds digit of q(-4)? 1 Let t be (-1)/2 - 205/(-10). Suppose 6x - t = x. What is the units digit of x? 4 Let f = 4 - 7. What is the units digit of f/(3/2-1)? 2 Suppose -16 = -5t - 3r, -r + 7 = 3t - 1. Suppose 0z + 29 = 5u - z, 26 = tu - 4z. What is the units digit of u? 5 Suppose 0y - 150 = -5y. Let u = y + -12. What is the tens digit of u? 1 Suppose -4w + 7 = -3w. Let z(h) = h - 3. Let b be z(4). Suppose -b = 3o - w. What is the units digit of o? 2 Suppose 4i = 5x + 81, 0 = -2i + x - 4x + 13. What is the tens digit of i? 1 Let v(q) = -q2 - 7q - 5. Let y be v(-5). Suppose -3 = yo - 8. What is the units digit of o? 1 Suppose 4d + 3 = 11. Suppose j + dj = 93. What is the tens digit of j? 3 What is the units digit of 112 - 7/(7/(-3))? 5 Let i(q) = 27q*2 + 5q + 6. What is the hundreds digit of i(-2)? 1 Suppose -2w - 2w = -132. What is the tens digit of w? 3 Let v = -126 - -262. Suppose -z = -5i - 18, -2z - 3z = -2i - v. Let q = -18 + z. What is the tens digit of q? 1 Suppose	{ "pile_set_name": "DM Mathematics" }
5 + 575 + 24q)(q + q - 3q) + 4 + 2q*2 - 135q - 128q + 231q to the form jq + gq*2 + d and give j. -32 Rearrange (a - 2a + 4a)(92 + 5a3 - 92) + (19 + 53 + 40)(-2a4 + 3a4 + a4) to the form z + oa + ba*3 + ma*2 + ga*4 and give g. 239 Express -17i*3 - 1032i + 509i + 478i + (-2i2 + 1 - 1)(0i - 2i + 3i) - 2i*3 - 3i*3 + 4i*3 in the form hi + gi2 + bi*3 + z and give b. -20 Express -4i*4 + 6i*3 + 3i*4 - 6i*3 + 2i*2 + 4i*4 + 1 - 5i as gi4 + zi*3 + ti*2 + ci + o and give o. 1 Rearrange (k + 4k - 7k)(825 - 457 - 444) to x + vk and give v. 152 Express (-2b - 2b + 2b)(-4 - 2 + 5 + (-4 + 0 + 0)(11 + 6 - 7))(2 + 3 - 2)(4 - 3b - 4) in the form hb + nb*2 + a and give a. 0 Express 1185d*2 - 625d*2 - 554d*2 + 60d as ud + f + rd*2 and give r. 6 Express -9x - 599 + 54x - 14x - 22x - 5x as yx + i and give i. -599 Express (4182g*2 + 3g - 5473g2 - 1802g*2)(g + 3 + 2g - 4g) in the form zg + og*2 + cg*3 + q and give q. 0 Express (3l - 4l + 3l)(3l - l + 468 - 2516) in the form v + xl2 + rl and give r. -4096 Rearrange (o + 0o - 2o)((-3 - 3 + 1)(22 - 11 - 6) + 3 - 3 + 2 + (-6 + 2 + 3)(6 - 2 - 2)) to x + zo and give z. 25 Express -3 + 3 - 3t + (2t - 3 + 3)(3 - 1 - 5) + (-5 - 1 + 0)(-4t - 3t + 3t) in the form c + ot and give o. 15 Rearrange 605l - 1387l + 645l - 5 to t + rl and give r. -137 Express (0i - 4i*3 + 0i)(-2 + 2i + 2) + (-5 + 5 - 8i)(-2240i2 + 96i*3 + 2240i*2) as zi + oi3 + fi*2 + li*4 + k and give l. -776 Express -117 - 14s*2 - 128 - 163s*3 + 162s*3 in the form ds*2 + a + gs + js3 and give j. -1 Rearrange 556f - 1718f - 188541f*4 + 2 + 188540f*4 to u + jf + rf4 + wf*3 + qf*2 and give r. -1 Rearrange -10l*2 + 290l4 - l2 - 5 - 141l4 - 148l*4 to u + rl*3 + sl*4 + tl*2 + yl and give t. -11 Express 1276y - 286y - 322y + 545y + 1322y as gy + u and give g. 2535 Rearrange 5 - 15 + g - 8g2 - 50 + 13g*2 to og*2 + fg + x and give f. 1 Rearrange -1 + 9 + 2039i2 - 1869i*2 to the form o + gi*2 + xi and give g. 170 Express (35 - 35 + 77c)(10c - c + 14c) in the form gc2 + xc + k and give g. 1771 Express -336f2 - 1064f*2 - 1134f*2 - 1852f*2 as af*2 + j + bf and give a. -4386 Rearrange 195h2 + 1196h*4 - 2387h4 + h3 - 3 + 1 + h + 1192h4 to vh*4 + u + jh*2 + ph + th3 and give t. 1 Rearrange 3c + 12 - 7c + 2660397c*2 - 2660389c*2 + (2c - 2 + 2)(2c + c - 4c) to t + fc + zc2 and give f. -4 Rearrange (3 - 3 + y)(-8 + 32698y + 3 + 5 - 70265y) to by2 + a + jy and give b. -37567 Rearrange 107r3 + 194r*3 + 2r*2 - 300r*3 - 479 to zr + ir2 + l + ar*3 and give i. 2 Express (-447160x - 13439x2 + 447160x)(2 + 4 - 4) as l + ux + vx2 and give v. -26878 Express 1585h*2 + 5617h*2 + 7033h*2 - 1337h*2 in the form sh + lh2 + r and give l. 12898 Express -86s - 142s + 48s + (-s - 5s + 4s)(10 - 7 - 4) in the form d + os and give o. -178 Rearrange (5 - 5 - 5u)(392u2 - 198u*2 + 51 - 202u*2) to ju*2 + nu*3 + i + cu and give n. 40 Rearrange (-1 + 1 - 13)(4 + 4 - 1)(0 - 5 + 4v + 1) to dv + x and give d. -364 Express 0y2 + 3063022y - 3063024y - 2y*2 - 18 in the form hy*2 + fy + r and give h. -2 Express (6 - 6 + 2b)(-2 + 2 - 1)(-532 + 532 + 29b*3) in the form kb*3 + gb*4 + a + qb*2 + zb and give g. -58 Rearrange 44048p - 66 - 88058p + 44055p to k + xp and give k. -66 Rearrange -4f2 - 37f*3 + 21953f - 43895f - 9f*3 + 21943f + 7 to the form sf + i + tf*2 + hf*3 and give h. -46 Express -107l*2 - 44l*2 + 262l*2 in the form jl + c + xl2 and give x. 111 Express (5t - 2t - t)(4 + 2t - 4 - 1 + 1 + 2t + 2t + 0t - 6t + (-2t + 2t - t)(-1 + 1 + 3)) as jt2 + c + zt and give j. -6 Express (223m + 30m - 68m)(1 - 4 - 2) in the form z + xm and give x. -925 Rearrange (-445 + 3324 + 797 + 621)(3 + i - 3)((1 - 2 + 2)(-4 - 1 + 3) - 3 - 2 + 6) to the form n + ui and give u. -4297 Express -95n + 193n - 76n - 4n2 + 3n*2 + 10n*4 - 2n*3 as q + bn*4 + an + kn3 + jn*2 and give a. 22 Rearrange (-63p*4 + 0p*4 + 26p*4)((0 + 0 - 2)(10 + 11 + 4) + 0 - 3 + 0) to the form kp*3 + tp + j + np2 + up*4 and give u. 1961 Express -1438k + 240k + 596k - 1652k - 381k in the form i + bk and give b. -2635 Express 5636v + 108v + 6043v + 1680v as wv + g and give w. 13467 Express 3 + 2d + 1927356d*2 + 20d*4 - 2d - 1927364d2 as hd*2 + md*3 + r + yd*4 + ld and give h. -8 Rearrange -t2 + t2 - 2t3 + (-5 + t2 + 5 - t)(-11534t + 30466243 - 30466243) to b + ft*3 + ct*2 + qt and give f. -11536 Rearrange -3a4 + 269a*2 - 2a - 441a2 + 210a*2 - 3 to the form l + sa + ya4 + za*2 + ba*3 and give y. -3 Express (570408 - 570408 - 569y)(2 - 6 + 0) + (y + y - y)(-1 + 5 - 3) in the form gy + k and give g. 2277 Express -4 + 5 + 28c*2 - 13c*2 - 21c - 18c2 - 8c*4 in the form mc + dc2 + zc*3 + g + bc*4 and give m. -21 Rearrange -18632p + 26 + 9 - 32 - 3 to the form t + wp and give w. -18632 Express (11w - 13w + 3w*3 - 9w*2 + 0w*3)(2 + 3 - 1)(6w - 91w - 45w) in the form pw4 + lw + vw3 + j + dw*2 and give p. -1560 Rearrange (20n*3 + 22n*3 + 13n*3)(430 + 265 - 316) to the form fn2 + rn*3 + tn + v and give r. 20845 Express -357 - 121 - 2m - 754m*2 + 756m*2 - m in the form rm*2 + u + wm and give w. -3 Rearrange (236 + 14a - 236)(-224 - 106 - 189 - 91) to ua + j and give u. -8540 Express 0r*4 - 13952r*3 + r + 1156 - r + 2r*4 + 13954r*3 + 2r + r*2 as or*3 + cr*2 + vr + br4 + t and give b. 2 Rearrange -195j*3 - 224j3 + j2 - 212j3 + 4j*4 - 2j + 797j3 - 2 - 210j*3 to bj*4 + yj*3 + nj + a + oj2 and give n. -2 Express 224 + 3394x - 109 - 113 as lx + n and give l. 3394 Express -12b - 11b - 2b - 8b + 288b*2 + 7b + 1 in the form xb + mb*2 + l and give m. 288 Express 697 + 340t - 754 - 236t as lt + g and give l. 104 Express -156r2 + 76r*2 - r + 56r*2 + 22 - 18 as mr + nr2 + y and give y. 4 Express 190448q - 92966q - 93890q as cq + o and give o. 0 Express (-2661 - 1700 + 2409 + 5451 + 3385 + 8067)(5 - 5 - 4h3) in the form yh*2 + uh*3 + b + ph and give u. -59804 Rearrange -86q4 + 36q*4 + 22q*4 + 15q*4 + 172q + 16q4 + 7 to iq*3 + o + kq*4 + vq*2 + rq and give k. 3 Express 16 - 26682a + 11835a - 16 as ia + o and give i. -14847 Rearrange -9539g + 23765g + 26750g to w + pg and give p. 40976 Rearrange -4 + 4 - 2j - 160j + 1025791 - 1025791 + (3 + 0 - 4)(1 + j - 1) to the form f + hj and give h. -163 Express 128d*2 - 39d*3 + 123d*3 + 4 - 43d*3 - 5 - 42d*3 in the form bd*3 + cd + fd2 + o and give o. -1 Express -21p2 + p3 - 4p - 612 + 1217 - 607 + p in the form xp*2 + dp*3 + wp + y and give d. 1 Express -1 - 27c3 + 2c + 47c3 + 139c*2 - 6c - 140c2 in the form hc*3 + pc + wc2 + f and give w. -1 Express 28628 - 227c - 57260 + 28627 - 1059c as y + qc and give y. -5 Rearrange -r + 28143r3 + 3 + 4r*2 - 28133r*3 + 0r*2 to the form cr*3 + nr + yr2 + f and give n. -1 Express -z - z3 + 587z*4 + 135 - z - 589z*4 + 9z*2 - 80 as f + rz*4 + sz + hz3 + dz*2 and give s. -2 Rearrange 469 + 3q*2 + 478 - 1427 + 478 + 141q*4 to wq + bq2 + a + oq*4 + vq*3 and give o. 141 Express 41f*2 - 25f*4 - 41f*2 + (2f + 242 - 242)(0f*2 + 0f2 + f3) as uf4 + zf + m + df3 + if*2 and give u. -23 Rearrange -316 - 4q + 160 + q*3 + 4q*2 + 155 + 23q*2 + 3q to the form mq2 + bq + rq3 + z and give z. -1 Rearrange (o + 3o - 6o)(o*2 - 3o + 3o) + (-4 + 14 + 28)(-3o - 2o - 5o)(0 + o*2 + 0) to the form qo*3 + yo + h + io2 and give q. -382 Rearrange -2q - 17 + 20q2 + 2q - 5q + 2q - 18q2 + 34q*3 to the form dq + o + aq3 + vq*2 and give d. -3 Rearrange -102j + 306j - 104j + 1 - 100j + 2548j*3 to yj*3 + pj*2 + x + oj and give y. 2548 Express (-4q3 + 2q*3 + 2q*2 + 11	{ "pile_set_name": "DM Mathematics" }
= -x - 13. Let a be h(-6). Let g(f) = -f*2 - 7f - 3. Let w be g(a). Let r = w - -6. Give c(r). -4 Let t(l) = -l*3 - 5l*2 - 2l + 3. Let f(a) = -11a2 - a3 - 3 - 3a2 - a2 + 6a2. Let n be f(-9). What is t(n)? -9 Let b(d) = d2 - 8d + 6. Let j(w) = -2w2 + 7w - 5. Let q(t) = -t*2 - 10t - 10. Let p be q(-8). Let k(n) = pb(n) + 7j(n). Determine k(-1). -8 Let i(z) be the first derivative of z*2 + 2z + 8. What is i(-2)? -2 Suppose 2b - 9 = -b. Let r = b + 2. Let v(o) = o3 - 4o*2 - 5o - 4. Give v(r). -4 Let b(z) = 1 + 5 + z - 2. Let a be b(-2). Let h(x) = -x - 4x - 2 - 3x*a + 2x2. What is h(-4)? 2 Let k = 56 + -52. Let j(w) = w3 - 3w2 - 3w + 2. What is j(k)? 6 Let o(j) be the second derivative of -j*4/6 + 7j*3/6 - 3j*2 - 8j. Calculate o(4). -10 Let c(u) = -u. Let o be c(2). Let v(j) = j*3 + 4j*2 + 3j. Let b(x) = -2x3 - 8x*2 - 6x + 1. Let d(m) = 3b(m) + 7v(m). Give d(o). 5 Let v(t) = -4t2 - 3t + 6. Let f(b) = -5b2 - 2b + 7. Let x(i) = 3f(i) - 4v(i). Calculate x(-5). -8 Let u be ((-6)/3)/(-1) - 6. Let s(f) = f + f - 3 - 4f. Determine s(u). 5 Let i(z) be the third derivative of 0 - 1/24z6 + z2 + 0z + 1/60z*5 + 1/12z*4 + 1/6z*3. Let d be i(-1). Let t(q) = -2q. Determine t(d). -10 Let x(y) be the first derivative of -12y - 1/2y*2 - 3. Let k = 9 + -14. Determine x(k). -7 Let c(q) = -q. Let i be c(2). Let z(n) = 8n*2 + 17n + 8. Let j(t) = t*2 + 2t + 1. Let g(k) = 18j(k) - 2z(k). Calculate g(i). 6 Let j(i) be the second derivative of -i3/6 + i2/2 - i. Let p(s) = -4s + 4. Let d(v) = -3j(v) + p(v). Determine d(3). -2 Let c(q) = -2 + q + 2 - 4 + 1. What is c(5)? 2 Let k(s) = 17s3 - 3s*2 + 3s*2 - 16s3 + s2 - 6. What is k(0)? -6 Suppose -n = -4n. Let f(a) = a + 13. Let p(m) = -3m - 5m - 12 + 7m. Let j(g) = 5f(g) + 6p(g). Determine j(n). -7 Let i(g) = 5g2 + 9g + 5. Let k(a) = a*2 + a + 1. Let h(j) = i(j) - 4k(j). What is h(-4)? -3 Let k(i) = -i*2 - 16i. Let r(u) = 3u2 + 46u - 1. Let p(b) = -17k(b) - 6r(b). Calculate p(-6). -6 Let p(j) be the third derivative of j5/60 + j4/24 - 2j2. Calculate p(-2). 2 Let y = -5 - -10. Suppose -5d = 2u + 3 + 2, 5d + y = 2u. Let w(a) = a + 9. Determine w(u). 9 Let z(l) be the second derivative of -l4/12 - 5l*3/6 + 6l*2 + 4l. Calculate z(-6). 6 Let p(h) = 2h + 4. Let g(j) = j2 - 7j + 2. Let a be g(7). Suppose -af + 1 + 3 = 0. Let s = -6 + f. Give p(s). -4 Let o(g) = 1 - g + 2g - 3g + 4. Let z = 3 - -2. What is o(z)? -5 Let k(m) be the second derivative of -m3/6 - m2/2 + 5m. Suppose -4d + 4 = 3z, 7z - 2z = -2d - 12. Give k(z). 3 Let t(u) = 3u + 10. Let o(d) = -2d - 6. Let g(r) = 5o(r) + 3t(r). What is g(-4)? 4 Suppose -4m + 0q = 4q, -2m = 4q - 2. Let u(p) = -p*3 + 5p*2 - 5p - 5. Let f(h) = -3h2 + 3h + 3. Let a(g) = -7f(g) - 4u(g). Calculate a(m). -3 Let a = 178 - 176. Let c(k) = -k - 5k + 4k + 2. Give c(a). -2 Let v(m) = 2 + 2m2 - m3 + 3m - 3m + 4m. Suppose -q + 3w = 2w - 3, -5q + 8 = 2w. Let o = 0 - q. Determine v(o). 10 Let w(k) = -8k3 + k2 + 5k*3 + 13k*3. Suppose -57s + 56s = 1. What is w(s)? -9 Suppose -5h + 11 = -9. Let p(g) = g - 2. Give p(h). 2 Let j(u) be the first derivative of -u6/360 + u5/40 + u4/8 + u3/3 + 1. Let p(x) be the third derivative of j(x). Give p(-2). -7 Let x(m) be the second derivative of m4/12 + m3/2 + m*2/2 - 24m. Calculate x(-3). 1 Suppose -y = -2f, -8f + 12 = -4f + y. Let z(r) = r2 + 2r - 3. Give z(f). 5 Let f(o) = o*3 - 2o2 - o + 2. Let i be f(-2). Let d = 17 + i. Let x(a) = -a2 + 4a - 2. Determine x(d). -7 Let r = 6 - 4. Let a(c) = 0c*2 - 2 - 3c - c*r - 4c. Suppose 10f - 119 + 179 = 0. Calculate a(f). 4 Let r(c) = 7c - c*2 - 2 + 0c2 + 7. Let h be r(7). Let l(p) = -p3 + 6p2 - 5p + 5. What is l(h)? 5 Let b be -1 + 1/(0 - -1). Suppose -5x - 7 - 13 = b. Let f(s) = -s3 - 5s*2 - 4s - 6. Determine f(x). -6 Let r(v) = v*2 - 6v + 2. Suppose 0 + 9 = -y - 5i, -3y - 8 = -4i. Let l be (4/(-6))/(y/30). Determine r(l). -3 Let x(d) = d - 2. Let h be (-2 - 1) + 0 - -1. Give x(h). -4 Let r(w) be the second derivative of -1/20w*5 + 0 - 1/2w*3 + 0w*2 - 5w - 1/4w4. Determine r(-3). 9 Suppose 5n = -0n. Suppose n = 2g - g + 5. Let p(i) = -i*3 - 4i*2 + 6i. Give p(g). -5 Let v(x) = -14x3 + 3x + 13x3 + 5x*2 + 2x*3. Give v(-2). 6 Let b(p) = -2p + 5. Let q = 21 + -26. Determine b(q). 15 Let k(b) = -3b + 2. Let y(l) = -2l + 2. Let t(g) = 5k(g) - 6y(g). Let o = 3 + -5. Calculate t(o). 4 Let h(o) = -48o2 + 0o + 28o2 + o3 + 5 + 2o + 24o2. Determine h(-4). -3 Let l(g) = -2g + 6. Let d be 3 + 32/(6 - 0). Give l(d). -2 Let u(c) be the third derivative of 1/4c*4 + 0c + 0 + 1/60c5 + 7/6c*3 + 2c*2. Give u(-5). 2 Let c(q) = -2q. Let p(a) = -a*2 + 6a - 7. Let g be p(6). Let y(t) = t*3 + 8t*2 + 5t - 10. Let b be y(g). Calculate c(b). -8 Suppose b + 3b - 108 = -4h, -75 = -3b + 3h. Suppose 0 = -3n - 4k - 20, 5n - b + 1 = 5k. Let u(v) = v3 - v2 + 8. Give u(n). 8 Let b(h) = -5h - 8. Let u(r) = -10 - 7 - 3r + 13. Let n = -6 - -12. Let l(s) = nb(s) - 11u(s). Determine l(3). 5 Suppose 4h + 3b + 13 = 4b, -b = -2h - 5. Let d be (h + 12)(-1)/(-2). Let k(w) = 2w + 4 - 3w + 5. What is k(d)? 5 Let w(i) = i3 - 2i*2 - 5i + 6. Let b(c) = c*3 - 30c*2 + 56c + 4. Let a be b(28). What is w(a)? 18 Let k be 2/515/(-3). Let h(x) = 2 + 2x*2 - 4x2 - x2. Determine h(k). -10 Let h(i) = -3i2 + 8i - 3. Let n(k) = k*2 - k - 1. Let w(d) = -h(d) - 4n(d). Determine w(-6). -5 Suppose 0 = -b + 3b + 6. Let o(u) = -u + 1. Let s(g) = 5g - 4. Let l(w) = 18o(w) + 4s(w). What is l(b)? -4 Let w(t) be the first derivative of 1 + 5/3t3 + 0t - 1/2t2. Suppose 0 = -0v + 5v - 2k + 5, 0 = 5k. Give w(v). 6 Suppose p - 8 = 3i, 4i = 5p + i - 52. Suppose p = -3t - 1. Let v(l) = 5l + 8. Let y(n) = -14n - 23. Let b(o) = -11v(o) - 4y(o). Determine b(t). 0 Let w(r) = -r - 3. Let y be w(-5). Let u(j) = 5 + yj + 1 - j. Suppose 13m - 25m = 72. What is u(m)? 0 Suppose -3r + 6r = 9. Let k(y) = -y3 + y2 - 4y - 1. Let j(w) = -w - 1. Let h(x) = 5j(x) - k(x). What is h(r)? 11 Let q(i) = i3 - 1 + i2 - 2 + 4i + 6. Let g = -8 + 6. Give q(g). -9 Let b(m) be the second derivative of m3/6 - m2 - 12m. Determine b(6). 4 Let n(j) be the third derivative of -j4/12 - j3/6 - j*2. Suppose 0 = -5z - 4h - 9, -6h + 41 = -5z - 2h. Let y = z + 3. Calculate n(y). 3 Suppose 3w + 6 = 3r, -r + 3r - 5w = 10. Let p(c) = -c3 - c2 - 9. Determine p(r). -9 Let m(p) = 2p2 - 6p + 4. Let g(x) = -3x2 + 7x - 5. Let s(z) = -3g(z) - 4m(z). Suppose 0 = 5a - 17 - 13. Suppose 0 = ab - 8b - 6. Give s(b). -1 Let c(t) be the first derivative of -t4/2 - t3/3 + 3t*2/2 + t - 2. Calculate c(-2). 7 Suppose 4t = -4u + 3t + 12, -2t = 0. Let d = 5 + -3. Let y(o) = 3o*d + 0o - 1 - o + o*u - 4o. Give y(-4). 3 Let c(b) = -b*3 - 4b*2 + 3b - 2. Let s(p) = p*3 + 4p*2 - 2p + 1. Let i be 3/(-12) + (-38)/8. Let q(u) = ic(u) - 6s(u). What is q(-3)? 4 Let g(i) = -3i + 1. Let t = -5 - -13. Suppose 2 = 2u + t. Determine g(u). 10 Let r(d) = 0d2 - d2 + 10d - 5 + 9. Give r(8). 20 Let v be 12 + -7 + (-3 - 1). Let z(i) = -4i2 + 3i. Let c(j) = -92j2 + 68j. Let o(g) = 6c(g) - 136z(g). Calculate o(v). -8 Let i(g) = 2g3 + 7g*2 - 2g - 9. Let q(z) = 3z3 + 7z*2 - z - 10. Let h(j) = 4i(j) - 3q(j). What is h(6)? 0 Let m be 3/(6/(-10)-1). Let b(g) = -g*3 + 5g*2 + 2g - 7. Give b(m). 3 Let g(h) = -3h3 - h2. Let l(i) = 2i - 14. Let x be l(10). Let c be ((-2)/8)/(x/24). Give g(c). 2 Let o(q) = q*2 + q + 1. Let l(y) = 3y*2 + 6y - 4. Let p(t) = l(t) - 2o(t). What is p(-6)? 6 Let d = 1 - 6. Let q be (d - -5)1/3. Let j(v) = v3 + v2 + 4. What is j(q)? 4 Let v(i) = i + 11. Let x be (-8)/(-20) + (-64)/10. Let m be v(x). Let f(k) = -2k + 6. Determine f(m). -4 Let o(h) be the first derivative of 4h*2 + h + 1. Suppose 7 = -j - 4y, 3j = -0j - 5y - 7. Calculate o(j). 9 Let g(t) = -3t + 3. Let w be g(4). Let v be (-3)/9 - 39/w. Let h(y) = -y*2 - y + 2y + 4*y - 1.	{ "pile_set_name": "DM Mathematics" }
y - 3b + 0b = 10 for y. -2 Suppose -177 = -5f + 4n + 179, n = -4. Suppose -64a + fa = 64. Solve 2y + 0y = -4h + a, -y - 7 = -h for y. -2 Let p(l) = l3 + 6. Let r be p(0). Suppose 35c - rc - 116 = 0. Solve 0 = 5x - 5n + 10, -cx - n - n = -16 for x. 2 Let l be 5 - (6/(-21) - 37/(-7)). Let v be (l + 0)/((-1)/(-1)1). Solve -4d - 3z + 16 = v, z - 6z + 20 = 0 for d. 1 Let y be -122/(-56) - (8/(-14) + -3). Solve -4z - 5 = a - 5z, 5a - 11 = -yz for a. -1 Suppose -153s + 184s - 186 = 0. Solve 2v - 7d + 5d = 0, v = -5d - s for v. -1 Suppose 3o + 15 = -t + 26, -3o + 4t = -31. Solve -5m - 23 = 4j, -om - 19 = 6j - 4j for m. -3 Let o = -503 + 507. Let m be (-3)/220/(-3). Suppose h - m = -oh. Solve -5s + hk - 15 = 0, -5s + 0k - 3k - 40 = 0 for s. -5 Suppose 0 = -26g + 62 + 68. Solve -2b - 10 = 5c, -2b + c + g = -3b for b. -5 Suppose 15o - 38 = 22. Solve 4q - 2w = 12, -oq + 0q = -w - 14 for q. 4 Suppose -8b + 3b = -4u - 265, -3u = 5b - 300. Let a be b/30 + 53/150. Solve 2n + 15 = 6n - 5g, 5g - 15 = -an for n. 5 Let p = -130 - -89. Let u = 44 + p. Suppose 0 = ut, 4t + 33 = 3a - 0t. Solve -2f - 14 = -5k + 2f, -5k + a = -f for k. 2 Suppose 573v - 252 = 489v. Solve -s + 15 = 4x, 9s + vx - 15 = 7s for s. 3 Suppose 0 = -2s - 0g + 5g + 67, -43 = 2s + 5g. Suppose -3d = -q, -5 = -2q + q - 2d. Solve -4a = qm - sm + 5, -3a = 3m + 9 for m. -1 Let d(z) = -2z3 - 44z*2 - 18z - 28. Let o be d(-22). Suppose -14g - 88 = -o. Solve -2f - 3n - 1 = 0, -6f = -4f - 4n - g for f. 4 Let q be 15/(-20) + 38/8. Suppose -ql = -l. Let v(r) = r2 - 10r - 9. Let i be v(11). Solve lm = im - 4o + 30, 4m + o = -15 for m. -5 Suppose -5z = -3i + 42, z - 2 = 3i - 20. Solve ij = 3p - 10, 2j = 4j - 4p for j. -4 Let t(b) = -b*2 + 1034b. Let g be t(0). Solve -5x - 28o = -31o - 6, g = -o - 2 for x. 0 Suppose 2b + 12 = 8b. Suppose br - 5h = 43, -32 = 3r - 4h - 114. Let x = 36 - r. Solve 4c = -3m + 2m + 1, -2 = -xc - 2m for c. 0 Suppose 5y = l + 53, 73l - 75l = -3y + 36. Solve -3a - 5 = 2c - y, 4c = 5a - 1 for a. 1 Let j = -2438 - -2442. Solve 2l = 4v + 6 + 2, j = 4v + 4l for v. -1 Suppose 7v = 2v + 25. Suppose 3m - v = 4. Suppose -5s = -2k - s - 8, -s = mk - 9. Solve k = 3c - x, 5c - 3x = 3c + 6 for c. 0 Let d = 8 - 5. Let f = -132265 + 132268. Solve -dp - i - 2 = 0, 0p - fi + 8 = -5p for p. -1 Let g be (-15)/(-3)(-352)/(-110). Solve -5f + g = 5u + 1, 3f = 4u + 9 for u. 0 Let t(u) = -6u - 16. Let m be t(-6). Suppose -c + m = -51. Suppose c - 350 = -9f. Solve 5p + 2j = 0, f = -p + 5j + 4 for p. -2 Suppose 5u = 3u + 2w + 12, -4u = 2w - 18. Solve -ug - 4h - 31 = 0, -6 = 2h + 2 for g. -3 Let t(b) = b*2 + 9b - 2. Suppose -2j + 50 = -7j. Let x be t(j). Suppose -3h + x = -37. Solve -5p - 3k + 7k = -45, 2p = k + h for p. 5 Let h be (-3 - -11) + (7 - -11). Suppose -165 = -hy - 35. Solve 0 = -2f + yr + 27, -8 = 5f + 5r + 12 for f. 1 Let n(y) = 3y - 8. Let a be n(7). Suppose 11k = 6k - 15. Let w be 15/(-45) + (-13)/k. Solve -wf - a = -p, 0p = 5p + 3f + 27 for p. -3 Let s(m) be the first derivative of -m3/3 + 3m*2/2 + 44m + 34. Let k be s(8). Solve 0l + l + 1 = -t, -kt = -l + 14 for l. 2 Let l = -5 - -8. Suppose -20b + 892 = -5b + 727. Solve 3n - 9 = 0, b = u - lu + 5n for u. 2 Let g be -1 + 9(55/(-15) - -4). Solve 4j - 22 = m, 0m + 4j - 16 = -gm for m. -2 Suppose 0 = r - 3p, -88 = 2r - p - 93. Solve 35h - 34h - 5 = 4x, -rx = 3h - 15 for h. 5 Suppose -4w + 24 = -n, 5n = w - 16 + 10. Solve n = -4s + 4b + 32, s - b - 23 = 3b for s. 3 Suppose -3a - 3q = 2a + 1, -4a - 11 = -q. Let z be ((-8)/(-32))/(a/8). Let d be ((-18)/(-4))/z(-26)/39. Solve 0 = o + 2h - 3, 4o + dh = -0h + 7 for o. 1 Let k = 22359 + -22356. Solve -20 = -3c + 4f, 2c = kf + 13 + 1 for c. 4 Let s(y) = y2 - 3. Let f(x) = 4x*2 + x - 14. Let v(g) = -2f(g) + 11s(g). Let z be v(3). Let u = -14 + z. Solve 8l - 4l = -3j - 21, 9 = -uj - l for j. -3 Suppose -4r - 187 = -151, 8r = -5v - 72. Solve v = -5n - 5p - 15, 5p + 46 = 2n + 59 for n. -4 Let r be (0 - 1)(-1 + 2). Suppose -2l = -j + 6, 2j = 3l + 32 - 24. Let m be 3 - (j/r + -3). Solve 0 = 3h - 3p - 3, 0p + mp - 20 = -2h for h. 4 Suppose -2n - 3l + 281 = 296, 10 = -2n - 2l. Solve n = 5f + 3a + 7, -2f - 1 = -4a + 7a for f. -2 Suppose 0 = 2z - 3s + 2, 30s + 22 = 2z + 33s. Let x(q) = -q3 + 3q*2 - 1. Let w be x(2). Solve zj + 22 = -4b, 4b = -4j + wj - 14 for j. -2 Let j = -202 + 209. Let z(u) = -u*3 + 5u*2 + 14u + 4. Let y be z(j). Solve -i = yl - 1, l - 4 - 20 = -5i for i. 5 Let l(q) = -4q - 28. Let v be l(-8). Let r be 14/35(1/1 + v). Let j be 570/40 + (-1 - r)/12. Solve -j = p + 4w, 4p - 2w = 1 - 3 for p. -2 Suppose -1589 = 2j + 3z, 2j - 27 = -5z - 1606. Let t = j - -809. Solve t = 2r + 2y - 3, -3r = -5y - 7 for r. 4 Let c be 5/(715/26 - 25). Solve -cf = 2y - 4f + 8, -21 = 5y - 4f for y. -5 Let t be (-94)/(-3) + 5 + (-39)/9. Suppose t = 3v - 28. Let g be ((-10)/4)/((-10)/v). Solve 4n = -3c - 13, c + 0n = -gn - 19 for c. 1 Let b be (3/212)/(7/49). Let o be -1(b - 10/(-5)) + 19. Solve -j - y = y + 1, -3j = -3y - o for j. 3 Suppose -3v + 4 = 4c + 31, 3v + 27 = -2c. Let z = 105 + v. Let p = z - 93. Solve 20 = -0s - 4s, 0 = -2b + ps + 25 for b. 5 Let q(k) = 123k + 740. Let j be q(-6). Solve -2o - 4y = -6y - 2, -y = -4o - j for o. -1 Suppose -8 = -5b + 342w - 341w, -14 = -4b - 3w. Solve -12h - 4x = -7h - 40, -bh = -4x + 12 for h. 4 Let i = -1597 + 1599. Solve 0 = -5p + 3y - 11, -2p = -0y + 2y - i for p. -1 Let g be (20/(-70) + 246/(-21))(-24)/72. Solve 5y = gz - 45, -8y = 4z - 3y + 5 for z. 5 Suppose 77t + 63 = 41t + 45t. Solve -4 = -4i + 4, i = -n + t for n. 5 Let g(j) = j3 + j2 + 3j - 3. Let v be g(2). Let n = 964 - 969. Let o be (0 - n) + (-10)/(20/6). Solve 0 = -4u + 5l - 5, -v = -4u + ol - l for u. 5 Let y(p) = -13 + 40 + 13 - 2p. Let s be y(10). Let k = s + -20. Solve 2c + kb = -b - 1, 0 = 2c - 2b + 10 for c. -2 Suppose 111h - 21 - 534 = 0. Solve p = -3l + 7, 8p - hp = -4l + 6 for p. -2 Let t = 26 - 21. Let v(p) = p*3 - 7p*2 + 12p - 5. Let i be v(t). Solve -4r + 4h = 1 - 5, 4h = r + i for r. 3 Suppose 4u = 16, 3i + 5u + 18 - 44 = 0. Suppose 0 = -o + 3, io - 19 = -10j + 9j. Solve -3f = 3g + 21, 5g + 10 = -f - j for g. -4 Let n(c) = -c*3 + 5c*2 - 6c + 2. Let o be n(3). Solve 2s - 4 = 0, 0 = -k - os + 12 - 8 for k. 0 Suppose 0 = -396t + 172t + 448. Suppose -o + 4 = s, 4s - 4o = -9o + 17. Solve sx - 3 = -ti - 5, -x = 3i - 4 for x. -2 Let q(w) = 4w2 - 11w + 8. Let s be q(2). Suppose 0 = si - 374 + 366. Solve 0 = -ia + 5l + 35, -21 = -2a + 2l - 5 for a. 5 Let q(f) = 1781 + 0f - 9f + 2f - 1944. Let j be q(-27). Solve 2r = -5a - j, 2a - 7 + 3 = 4r for r. -3 Suppose 5n - 3i + 4 = 59, -n - 3i = -11. Suppose 388 = -4h - 3t, -3t = -5h - 5t - 485. Let d = 99 + h. Solve -2b - n = 2j - 3, -db + 27 = -5j for b. 1 Suppose 291 + 129 = 70d. Let y = -5 - -5. Suppose yi = 2i. Solve -a = -4f - if + 7, 2a + d = 0 for f. 1 Suppose -26w - 141 = -245. Suppose 0a - a = -wn + 4, 2n - 4 = 0. Solve t = -l - 1, -5l + 0 = -at + 5 for t. 0 Suppose 68o - 660 = 768. Solve -4g = -3h + 32, 0g - g + 4h - o = 0 for g. -5 Suppose 18y - 468 = -21y. Suppose -20c = -yc - 16. Solve -5o = -2r + 10, -co - 5 = -8r + 7r for o. 0 Let l(h) be the second derivative of -h5/20 - h4/6 + 4h3/3 + 4h*2 - 19h. Let u be l(-3). Let c = u + 11. Solve 1 = w, -4j - w - c = -5w for j. 0 Let j(a) = a*3 - 14a*2 + 16a - 55. Let p be j(13). Let q be 2 + ((-2)/4)/(p/448). Solve 2h + h = 2y, -2h = 4y - q for y. 3 Suppose -3h - 44h = -104h + 684. Solve q = 4d + h - 29, -5d = -2q - 25 for q. -5 Let s be (3 - 12/4)/(-1 - 0). Suppose sd = -5d + 10. Solve 4g + 5 = -dt - 5, t + 5g + 11 = 0 for t. -1 Let r be (-4 - -5 - -6) + -3. Let p(c) = -c2 + 20. Let x(l) = -l - 9. Let w be x(-5). Let s be p(w). Solve 2k - 3 = d, -sk + 5k = -r*d + 15 for d. 3 Let t = 28 + -1. Let k = 5 - t. Let m = k	{ "pile_set_name": "DM Mathematics" }
t + 2rt wrt c? -120cr + 6ct + 60c Find the second derivative of 5955m3 - 3443m. 35730m Differentiate -218h*2p + 212h2 + p3 - 1 wrt p. -218h*2 + 3p2 Find the third derivative of j5 - 249j3 - 1630j*2 wrt j. 60j*2 - 1494 Find the first derivative of -3s*3 + 224s*2 - 5048. -9s*2 + 448s Find the third derivative of -3c3 - 14c*2 - 5c. -18 What is the second derivative of 4h2m*3o*3 + 2223h*2m*3o + 83hm*3 - 3hm2o*3 - 2hm2o wrt h? 8m3o*3 + 4446m*3o What is the second derivative of -3q2y*4 - 883q*2y - 149qy*5 - 2qy wrt y? -36q*2y*2 - 2980qy3 What is the derivative of -z4 + 1972z*3 + 40? -4z*3 + 5916z*2 What is the second derivative of -173c*3 - 196c? -1038c What is the third derivative of 134t*3 - 205t*2 - 2t? 804 Find the third derivative of 6f3j*3 + 15f*3x + 14f2 + j3 - 3j*2x wrt f. 36j3 + 90x Find the third derivative of 556s2v*3 - 223s*2v*2 - 2s*2 wrt v. 3336s2 What is the first derivative of -p3 - 13p2z*3 + 36z*3 wrt p? -3p*2 - 26pz3 Find the first derivative of -2n*2p*2 + 2n*2 - 2p*2r - 36p + 495r wrt p. -4n2p - 4pr - 36 Find the first derivative of -2358a - 18435. -2358 Differentiate -61n*4v - 3n2v*3 + 340v*3 - 2v wrt n. -244n3v - 6nv*3 Find the second derivative of 121x*5 + 2x*4 - 15x*3 - 19060x wrt x. 2420x3 + 24x*2 - 90x What is the third derivative of 409cu*6 + 3cu3 + 4cu2 - 82cu + 4u*2 wrt u? 49080cu3 + 18c Find the second derivative of 1148u5 + 2u*4 + 1711u wrt u. 22960u3 + 24u*2 What is the first derivative of -139cl2 + 2cl - 299c - 2 wrt l? -278cl + 2c What is the second derivative of -56c*2j*3w - 6c2j*2w*3 + 6cjw*3 - 3cw3 + 2j*3w wrt c? -112j3w - 12j2w*3 What is the third derivative of 2g*5 - 580g*4 - 109g*2 - g wrt g? 120g*2 - 13920g Find the third derivative of 146o3v*5 + 24o*3v*2 - 31o*3v + 2ov*5 wrt v. 8760o*3v*2 + 120ov2 Find the second derivative of 3s*3 + 128s*2 + 2s + 6 wrt s. 18s + 256 Find the first derivative of 9ntz*3 + 5ntz*2 + n - 285z*3 - 4z wrt t. 9nz*3 + 5nz2 Differentiate -k3o*2 - 191ko3 + 8o*3 - 10 wrt k. -3k*2o*2 - 191o*3 Find the third derivative of 32o*5 - 7o*4 - 13o*2 + 16. 1920o*2 - 168o What is the derivative of 510jy*2 - 20y*2 - 3 wrt j? 510y*2 What is the second derivative of -294m*4 + 146m + 2? -3528m2 Find the third derivative of 17mu3 + 43mu2 + m + 5u*3 wrt u. 102m + 30 Find the second derivative of 167oy*2 + 11oy - 10y*5 - 136y wrt y. 334o - 200y*3 What is the third derivative of -5b*3g*3r + b*3g*2 + 4b*3r*3 + 17b*2g*2r + bg3r*3 - 2bg3r wrt b? -30g3r + 6g2 + 24r*3 Find the third derivative of 48a*4 + 2a*3cd + 11a*3d + 1017a2 - 2acd - 2ac wrt a. 1152a + 12cd + 66d What is the second derivative of -1474o3 - 4o*2 + 8463o? -8844o - 8 Find the third derivative of -116o*3q*2rx + 2o*3q*2x - 4o2q*2r + 6o2r + 2oq*2x + 7oq*2 wrt o. -696q*2rx + 12q*2x What is the second derivative of 1036z4 - 31z - 14? 12432z2 Differentiate -f3 - 22f*2 - 254 wrt f. -3f*2 - 44f What is the third derivative of 74k3p*3 - 64k*3p*2 - 2p*3 wrt p? 444k3 - 12 What is the derivative of l4 + 31l + 60? 4l*3 + 31 What is the second derivative of -54g*3rt + 2g*3t - 2g2rt3 + grt3 + 233gr + 2gt wrt g? -324grt + 12gt - 4rt*3 What is the third derivative of -ls*5 + 71ls3 - 1748ls2 - 9s*6 wrt s? -60ls2 + 426l - 1080s3 What is the first derivative of 2ay3 - 47ay2 - 32a - 10162y3 wrt a? 2y*3 - 47y*2 - 32 What is the third derivative of -3750bi3 - 2bi2 + 2bi + 45i*2 wrt i? -22500b Find the second derivative of l*2oq3 - 1235l*2oy - 2l*2o - 2loq3 - lqy + 2oy + 7q*3 - 3qy wrt l. 2oq3 - 2470oy - 4o Differentiate 1790u4 - 65. 7160u*3 What is the third derivative of 95r*5 + 217r*2 wrt r? 5700r*2 What is the first derivative of 179q4 + q3 + 22q2 + 12317? 716q*3 + 3q*2 + 44q What is the third derivative of -6513d3q*6 + 44d*3 - 2d*2 - 2q*4 - 95q*2 wrt q? -781560d*3q*3 - 48q Find the third derivative of -4n2o*3 - 2n*2o*2u - n*2ou2 + 14no3u*2 + 9nou*2 - 2o*2 wrt o. -24n*2 + 84nu2 Find the second derivative of -4742v*4 - 297v - 12. -56904v2 Find the first derivative of 10y*2 - 105y - 11039. 20y - 105 What is the second derivative of -3b*5 + 265b*4 - 5b*2 + 4b + 343 wrt b? -60b3 + 3180b*2 - 10 Find the third derivative of 19i*2o*3 + 2i*2 + 7io3 + 5o*2 - 2 wrt o. 114i*2 + 42i Find the second derivative of 3759m3 + 5m + 192 wrt m. 22554m Find the third derivative of 243h*3 + 166h*2 - 2h. 1458 What is the derivative of -4073w4 + 6291 wrt w? -16292w*3 Find the third derivative of -6am4 + am*2y + 6am*2 - 64ay - 46m*3y wrt m. -144am - 276y Find the third derivative of 347b*6o + 3b5o*3 + 7b*2o*3 - bo*2 + 2o*3 + 87 wrt b. 41640b*3o + 180b2o*3 Find the third derivative of -2033u*6 + 2594u*2. -243960u*3 Find the first derivative of 2m*4u - 20m3u + 2m3 - 338u wrt m. 8m3u - 60m2u + 6m2 What is the first derivative of t2y*2 + 44t*2y + 143t2 wrt y? 2t*2y + 44t2 Find the third derivative of 720t*4 - 230t*2 wrt t. 17280t Differentiate -2f3v - 26f3 - 857v*3 with respect to v. -2f*3 - 2571v*2 Find the second derivative of -8736w*4 + 1277w. -104832w2 What is the first derivative of 3i*3y + 56i3 + 11iy wrt y? 3i*3 + 11i What is the third derivative of -fgm*3 + 479fgm*2 + fm*3 + 2fm2 - f + 17gm3 - 3gm2 - gm - 97m3 wrt m? -6fg + 6f + 102g - 582 Find the second derivative of -2c*3 - 463c*2 + 4c + 132 wrt c. -12c - 926 What is the second derivative of -2b*3r*2z + b*3ru + 2b*3uz + 2b*3z + 4r2u - 4r2 - 4r wrt r? -4b3z + 8u - 8 Find the first derivative of -3026c - 3775. -3026 What is the second derivative of 27h2w2 - h2w + 56h*2 wrt w? 54h*2 Differentiate 548l*2t*4 + 2l*2 - 5lt4 + 23l - 6 with respect to t. 2192l2t*3 - 20lt3 Find the third derivative of -2q*6 - 3q4 - q3 - 2q2 + 128 wrt q. -240q*3 - 72q - 6 What is the first derivative of -231g4 - 1885 wrt g? -924g*3 Differentiate -4cn4 - 16cn3 + 6c + 2 wrt n. -16cn*3 - 48cn2 What is the third derivative of -2198kr3 - 270kr2 - 4kr wrt r? -13188k What is the second derivative of -a*4b + 37a2b*2 + 2ab2 + 514b*2 wrt a? -12a*2b + 74b2 Find the first derivative of 3i*3j + 5474i3 + 358j wrt j. 3i3 + 358 What is the third derivative of 2o*5q - 2o5 + 357o*3q - 7o2q - 2oq + 71q wrt o? 120o*2q - 120o2 + 2142q Differentiate 509uw*3 - 8u - 2w3 - 89w + 1 with respect to u. 509w3 - 8 What is the third derivative of f4o*2 - 2f*3o*2s*3 - 6f*2o*2s*3 + 4f*2s*3 + 10o*2 wrt f? 24fo2 - 12o*2s*3 Find the third derivative of 11hz4 - 2hz + 34z*6 + 1700z*2 wrt z. 264hz + 4080z*3 Differentiate 996g - 1554 wrt g. 996 What is the third derivative of -n*5 + 2816n4 - n3 - 21n2 - 2n + 211? -60n2 + 67584n - 6 Find the second derivative of 619y4 - 3y + 34 wrt y. 7428y2 Find the first derivative of 11fgku + fgk + 2fku - 7fu + 2gu + g - 2u wrt k. 11fgu + fg + 2fu Find the second derivative of -340p*2t*2 + 2pt2 - 129p - t*2 wrt p. -680t*2 Find the third derivative of 1105g*3 - 2g*2 - 243g wrt g. 6630 What is the derivative of d*3lrz - 3d3z + 4d2rz + d2r + 3741dlrz + lrz + 3z wrt l? d3rz + 3741drz + rz Find the second derivative of -3f*4 + 52f*2u + 6f - 5u + 10 wrt f. -36f2 + 104u Find the first derivative of -2sv*2 + 195s - 46v3 wrt v. -4s*v -	{ "pile_set_name": "DM Mathematics" }
a - a + 3a)(2a + 0a - 4a) + 5a*2 - 3a3 - a2 - 3a2. 41a3 + a2 Expand (-110s2 + 32s*2 - 7s*2)(4s - s - 4s)(3 - s - 3). -85s*4 Expand (9 + 19 + 1)(2 - 7 + 1)(3q3 - q4 - 3q3). 116q*4 Expand (2s - 3s - s)(4s4 + 190s - 188s + 3s*4). -14s*5 - 4s*2 Expand (-111j*2 - 78j*2 + 162j*2)(-2j2 + 4j*2 - 3j*2). 27j*4 Expand (-6k*5 + 0 - 8k*5 + 2)(-6 + 1 - 3). 112k5 - 16 Expand (-859 - 743 - 17 + 6)(2k - 1 + 1). -3226k Expand ((-1 + 1 - 3)(-3 - 2z + 3) + (-5 + 2 + 2)(1 - 1 + z) + 0z - 4z + 2z + 0z - 9z + 16z)(0z - z + 2z). 10z2 Expand (4i - 3i + i)(4i + 0i - 2i) + 5i2 - i2 - 2i2 + (-2i*2 - i + i)(-2 - 1 + 1) + 2i + 0i*2 - 2i2 - i2. 7i2 + 2i Expand -2 + f*2 + 2 + (3 + 1 - 3)(-13f2 - 50f*2 + 17f2) - f2 + f + f2 + f2. -44f2 + f Expand (2 + h - 2)(-2h2 - 3h*2 + 2h*2) + 7h*3 + 78h - 78h. 4h3 Expand (m - m2 - m)(-4m*2 + 48m*2 + 4m*2) + 3m*2 - 3m2 - m4. -49m4 Expand (-53q*2 - 7q*4 - 26q*4 + 51q*2)(4 + q - 4). -33q5 - 2q*3 Expand (3u + 0u - 2u)(-7 - 110 - 55) + (-2 + 0 + 1)(2u - 3 + 3). -174u Expand (-2o - 1 - 3o + 2o)(-15o2 + 2o*2 - 18o*2). 93o*3 + 31o*2 Expand (-3r - 13 + 13)(r - 2 + 2) + 21r - 34r + 18r*2 + 12r. 15r2 - r Expand -202h*2 + 202h*2 + 16h*4 + (0h*3 + 3h3 - h3)(0h + 0h - h) + 2h*4 - 2h*4 - 2h4 - h4 - h*4 - 3h*4. 7h*4 Expand (8g*2 + 4g*2 - 2g*2)(g - 5g + 5g) + 0g3 - 3g*3 + 7g*3. 14g3 Expand (-m2 + m*2 - 2m + 2m3)(178m2 - 15 + 15). 356m*5 - 356m*3 Expand (2y2 - y2 - 3y2)(26 + 27 - 16). -74y2 Expand (-1 + 2 + 0)(4w2 - 2w*2 + 0w*2) + (3 - 2w - 3)(-w + 1 - 1) + 0w - w*2 + 0w + 2w2 - 5w*2 - 12w*2. -12w*2 Expand (4g*3 - 5g*3 + 3g*3)(1 - 3 - 5 + (10 + 1 - 3)(-2 - 1 + 4) + 3 + 0 - 5). -2g*3 Expand ((4 - 3 - 2)(0 + 0 + 2) - 1 - 1 + 3)(214i*2 - 4523i + 4523i). -214i*2 Expand 14 - 6l - 7l + 12l + (4l - l + 4l)(3 - 2 - 3). -15l + 14 Expand (-3w - 8w + 2w)(-2 - 4 + 5) + (w + w + 0w)(-7 - 9 + 8). -7w Expand 4y - 5y - y + (-y + 2 - 2)(-2 - 1 + 1) - 3y + 20y + 7y. 24y Expand -g*2 + 0g + 0g + (-11g + g - 13g)(g + 3g - g) + (3 + 1 - 2)(-g*2 + 2g - 2g) - 3g*2 - 3g*2 + 7g*2. -71g*2 Expand (2a2 + 2 - 2 + (-a2 + 3a2 - a2)(0 + 2 - 3))(-3a - 7a - 2a). -12a3 Expand (-2t*3 + 0 + 0 + (4t*2 - 2t*2 - 3t*2)(4t + 5t - 3t))(20 - 4 + 66). -656t3 Expand -b2 - 2b*2 + 2b*2 + 3b*2 - 4b*2 + 3b*2 + (-4b + 4b + b)(-b + 2b + b) + 18b*2 - 2 - 21b*2 + 7b*2. 7b*2 - 2 Expand (1 - t - 1 + (5 - 5 + t)(3 + 3 - 5) + 0t + 2t - 5t)(4t4 - 2t*4 + 0t*4 - 9t*4 + 0t*4 - 9t*4 + (5t - t - 3t)(t2 - t3 - t*2)). 51t*5 Expand -3h5 - h5 + 11h5 + (h - h + h2)(h*3 + 5h - 5h) + (-2 + 3h*2 + 2)(h2 + h3 - h*2) + 0 + 0 - 2h*5. 9h*5 Expand (238r + 28668 - 28668)(-r + 3r - r + 2 - r*2). -238r*3 + 238r*2 + 476r Expand 0q + 5q - q - 4q + 3q + 3q + (-1 + 0 + 3)(q - 4 + 4) + 0q + q + q + 26 - 26 - 9q. q Expand (i + i + 4i)(-3i - 4i + 6i) + 3 + 2i*2 - 3 + 5i - 14i2 - 5i. -18i2 Expand (2 - 7 + 3)(-7r + 0r + r)(r + 3 - 3)(0r2 + r2 + r2). 24r*4 Expand (-5 - 3 + 1)(22 + 2 - 8)((0 + 1 + 0)(-3j - j + 3j) - 3j + 3j - j). 224j Expand (1 - 2q - 1)(2 - 4 + 1) - 6q - 5q - q + q - 5q + 6q - q - 3 + 2 + 3. -9q + 2 Expand 2015 - 1114 - 2l2 - 1276 + (-2l*2 + 0 + 0)(-1 - 2 + 1). 2l2 - 375 Expand 4z*2 - 5z*2 + 7z*2 + ((3z + 0z - z)(2z - z - 2z) + 4z2 - 6z2 - z2)(4 - 1 - 2). z2 Expand (-68q - 65q + 140q)(7 - 2 + 3). 56q Expand (7b - 2b - 4b)(505 + 8b3 - 214 - 190). 8b*4 + 101b Expand (-6 - 80l + 4 - 247l*2 + 246l*2)(-3 - 2l + 3). 2l*3 + 160l*2 + 4l Expand (-508 + 33h + 508)(3h - 2 + 2)(1 + 2h - 1). 198h*3 Expand (16x*2 - 21x*2 + 10x*2)(2x + 4x*3 - 5x*3 - 9x*3). -50x*5 + 10x3 Expand -f5 + 9f5 - f5 + (-f + 4f - 6f)(f4 - f2 + f*2). 4f*5 Expand (0 + 1 + 5)(-3v + 4v - 2v) + (7v + 3v - 2v)(-2 + 2 - 3). -30v Expand 1713h5 - h4 - 830h*5 - 844h*5 + 1 + 2h5 - 1 + h5 + 3h5 - 3h*5 + (2h*4 + 3h*4 - 4h*4)(-3h - 3h + 4h). 40h5 - h4 Expand (5z2 + 11z - 11z)(-1 + 4 - 4 + (2 + 0 + 0)(1 - 2 + 0) + 5 - 2 - 4)(3z + 4z + z + 3z + z - 3z + (-3 + 2 - 1)(2z - 3z + 2z)). -140z3 Expand (4 - 2f*2 - 4)(-5f + 3f + 3 + 3f) + (-1 + 1 + 2f)(0f*2 + 3f2 - f2) + f*3 - 2f*3 + 0f3 - f3 + 3f3 - 4f3. -f3 - 6f2 Expand -f + 2f*2 + f + 2 - 2 + 11f*2 - 5f*2 + 3f2 - f2 + (4f2 - f2 - f2)(-4 + 6 + 0). 14f2 Expand 7p + 26p - 59p + (-3 + p + 3)(5 - 3 - 3) + 0p + 2p - 3p. -28p Expand (-9t - 17 - 26t + 16)(-2t2 + 3t*2 + 0t*2). -35t3 - t2 Expand (-r + 3r - r)(-2r2 + 5r*2 - 4r*2) + (-4r + r*3 + 4r)(-2 + 2 - 2) + (-3 + 2 + 7)(2r3 - 3r*3 + 2r*3). 3r*3 Expand (19 - 19 - 9q + 2)(-8q*2 + 2q*2 + 1 + 2q*2). 36q*3 - 8q*2 - 9q + 2 Expand (0p - 13p + p + 2 + 2p - 2 + 2p + 0 + 0 + (5 - 3 - 4)(2p - p - 3p) - 2p + 0p + 0p)(-3 - 55 - 16). 444p Expand (-148 + 2 + 39)(5t - 2t - 4t)(-3 + 5 - 1). 107t Expand (0p - 4p + 2p + (-5p + 5p + 5p)(-1 + 0 + 2))(-3 + 1 - 2). -12p Expand r5 + 59 + 1686r*3 - 1685r*3 - 2r*5 + (-r + 6r - 3r)(0 - 2r4 + 0). -5r5 + r3 + 59 Expand 5 - 5 - 5v4 + (32v - 32v - 18v*2)(-2v2 + 2v - 2v). 31v*4 Expand (27w*2 - 3w*2 - 10w*2)(2 - 2 + 3w)(-6w + 35w*2 + w - 33w*2). 84w*5 - 210w*4 Expand (166 - 84 - 89 + 35u*2)(0 + 0 + 3). 105u2 - 21 Expand (-3 + 3 + 2r*2)(383r2 - 383r*2 + 24r*3) - 3r*5 - 3r*5 + 5r*5. 47r*5 Expand (-2n - 3n + n)((-2n + n + 0n)(-3 + 3 + 1) - 3n + n + n). 8n2 Expand -3m*5 + 2m5 - m5 - m*5 + 2m*3 - 2m*3 + (2m*2 + 0 + 0)(20m3 - m3 + 0m3) + m5 + 0m5 - 2m*5. 34m*5 Expand (-4r + 2r + r)(2r + 2r - 6r)(r*2 - 2r*2 + 3r2) - r4 + 2r2 - 2r*2 - 3r*4 - 3r*4 + 4r*4 + (4 - 1 + 1)(-r*4 - 3r*4 + 5r*4). 5r*4 Expand (z + 9z - z + (-2 + 4 - 1)(2z + 2 - 2) + z + 1 - 1 + 0z + 4z - z)(-5z*2 + 2z2 + z2). -30z3 Expand x5 + 2x*5 - 4x5 + x5 + x4 - x4 + (0x - 3x + 4x)(-5x4 + 2x*4 + 4x*4) - 49x*2 + 49x*2 + 31x*5 - 5x*5 - 11x*4 + 11x*4. 27x*5 Expand -5g + 3g + 0g + (11g + 2g + 10g)(3 - 4 + 5). 90g Expand -287y - y*2 + 287y + (3y + 2y - 6y)(3y - 2y + 3y). -5y*2 Expand (3g - 2g + 0g)(-198 - 173 - 498). -869g Expand v + v*5 - v + (-218 + 329 - 190)(2v5 - 4v + 4v) - v5 + v4 - v4. -158v*5 Expand (5 + 4 + 0)(26 + 13g - 11g + 6). 18g + 288 Expand (895t*4 + 166t*4 + 80t*4 - 15t*4)(0 + 0 + t). 1126t5 Expand (20020d - 324d2 - 20020d)(2 - 1 - 2) + 4 - 4 + 6d*2. 330d*2 Expand (-9 + 356r + 346r - 704r)(-3 + 1 + 4). -4r - 18 Expand -4 - 2l + 4 + (3 - l - 3)(-4 - 1 - 1) + 1 + 2l - 1 + (0 + 1 - 2)(0l - l + 0l). 7l Expand (j + 8j - j)(3j*4 - 4j*4 + 3j*4) - 316j*2 - 8j*5 + 317j*2 + 37j*5. 45j5 + j2 Expand (36 - 19 - 16)(13021 - 13021 - 333f). -333f Expand (7 - 469z*2 - 27z + 933z2 - 463z*2)(-1 - 2 + 4). z*2 - 27z + 7 Expand (-2n + 5 - 5)(8n2 - 5n + 5n)(0n + n - 9n). 128n4 Expand (-2 + 2 - 2)(-34 + 86 - 43)(5i - 4i + i). -36i Expand (-2d + 3d + 0d)(51 - 51 - 35 + (-1 - 2 + 2)(5 - 5 - 1) + 4 - 2 + 0). -32d Expand -7 + 213m3 - 213m3 + m5 + (3m3 - 3m*3 + 3m*3)(-5m2 - 4m*2 + 3m*2). -17m*5 - 7 Expand (-24i + 3i - 8i)((-5i + 0i + 3i)(3 + 1 - 2) + 3 - 4i - 3 - 2i + i + 0i). 261i2 Expand (3a - 2a - 3a)(-4a*2 + 3a*2 + 3a*2) + 0a - 2a3 + 0a + 54a2 - a3 - 64a*2 + 75a*2. -7a*3 + 65a*2 Expand (-119n + 93n - 479n)(2 - 4 + 3). -505n Expand (4 + 4 - 4)(1 + 3 - 6)((2 + 1 - 1)(5u + u - 5u) - 4u - u + 2u). 8u Expand (4 - 4 - 14l)(-11 + 9 + 7) - l + 4l - 2l. -69l Expand 0w**2 - 4	{ "pile_set_name": "DM Mathematics" }
(-3)/(-15)? 616 Suppose -36 + 10 = -q. Suppose 750 = qm - 16m. Calculate the least common multiple of m and 12. 300 What is the common denominator of (-66 - -63) + (-169)/(-33) and -46/303? 3333 Let b be (13/(-4))/((-1)/4). Suppose -7a + 5 = -6a. Let m = a + b. What is the lowest common multiple of m and 2? 18 Let a = -1/33902 - 30113450/50853. Let f = a + 590. Find the common denominator of f and (-1)/(-1 - (-74)/71). 6 Let h be -2(0 + (-62)/4). Let w = h - 21. Let o = 15 - w. What is the smallest common multiple of 10 and o? 10 Let p = 142826/25 + -5712. What is the common denominator of p and -107/6? 150 Suppose -493 = -2o - t, -o + 3o - t = 503. What is the least common multiple of o and 30? 2490 Let w = -34 + 36. Suppose -5 = -wf + 25. What is the least common multiple of 6 and f? 30 Let z = -697 - -699. Suppose 4o - 36 - 32 = 0. What is the smallest common multiple of z and o? 34 Let g = 182 - 173. Let i(p) = -p3 - 16p*2 + 1. What is the lowest common multiple of i(-16) and g? 9 What is the common denominator of 9 - (-990)/(-20) - -4 and 101/4? 4 Let o be (-2)/1(-9)/3. Let q = 7 - o. What is the common denominator of (57/2)/(q + -19) and 101/18? 36 Let y = -8 + 12. Let h = 84 + -49. Suppose 2l = -19 + h. What is the lowest common multiple of l and y? 8 Suppose -5f = 3j - 4, 4f - 5f - 5j = 8. Suppose -k - fk = 12. Find the common denominator of (-1)/k + (-159)/84 and 41/14. 14 Let a(k) = -14k + 4. Suppose 1 = -c + 19. What is the lowest common multiple of c and a(-1)? 18 What is the common denominator of 71/14 and (-64)/70 + 2 - (15 + -16)? 70 Let c be 1-1 + (-3)/2. Suppose -3k - 4s = -5s + 1, -4k = -2s + 4. Let o = k + c. Find the common denominator of -11/2 and o. 2 Suppose 0 = x - 10 - 3. Suppose -xh + 15h + 4 = 0. What is the common denominator of h(-2)/((-48)/111) and -19/4? 4 Suppose -2n - 2 = -24. Let l(p) = -6p - 8. Let b be l(3). Let f = -18 - b. Calculate the least common multiple of n and f. 88 Let s(a) = a. Let f be s(8). What is the common denominator of ((-5265)/(-50))/13 + -3 and f/(-12)162/40? 10 Let x = 9031/4 - 1706791/756. Calculate the common denominator of x and -21/11. 2079 Let u(v) = -v*2 + 6v - 2. Let b(o) = -o. Let c(s) = -3b(s) - u(s). Calculate the lowest common multiple of c(6) and 14. 140 Let w(l) be the third derivative of 7l6/120 + l5/60 - l*3/6 - 2l*2. Let q be w(1). What is the smallest common multiple of q/3 + (-10)/30 and 4? 4 Let l = 5 + -4. Suppose 0 = x + 3 + 6. Let i(a) = -a + 1. Calculate the lowest common multiple of l and i(x). 10 Let b = -341 + 343. What is the least common multiple of 14 and b? 14 Let h = 3615 + -10841/3. Calculate the common denominator of h and 1130/(-48)(-8)/(-40). 24 Let v = 33959/4242 - -20/303. What is the common denominator of v and 454/(-120) - (-22)/(-33)? 140 Let j = 546 + -321. What is the common denominator of (-2)/(-3 + j/71) and 69/73/(-9)? 42 Let t = -271/52 + 431/117. Find the common denominator of -95/108 and t. 108 Find the common denominator of -25/36 and -3 + 33/18 + 10. 36 Let h = -175/22 + -7/33. Let y be ((-8)/2408)/((-1)/3). Let g = y - 15059/903. Find the common denominator of g and h. 6 Let a be 54/8-70 + (-76)/19. Let b be (1 - 8)(-63 - 1). Let t = b + a. What is the common denominator of t and -87/16? 16 Let h = 45569 + -4921385/108. Calculate the common denominator of 73/10 and h. 540 Let m = 10591/13380 + 1/8920. What is the common denominator of m and 5/84? 168 Suppose -5l - f = -3f + 1882, -3l = 5f + 1154. Let v(m) = m + 3. What is the least common multiple of v(8) and (-2)/(-7) - l/49? 88 Let z(j) = -3j*3 - 3j2 - 4. What is the least common multiple of 224 and z(-2)? 224 Let b(u) = -u2 - 33u - 14. Calculate the least common multiple of 9 and b(-32). 18 Let u = -18288 - -54826/3. Let z = 19/44 + -1723/220. What is the common denominator of u and z? 15 Let h = -12 + 16. Suppose -20 = hl - 420. Suppose -14v + l = -9v. What is the smallest common multiple of v and 6? 60 Let w = 0 + 8. Let y(v) = v*2 + 6v - 2. Let b be y(-6). Calculate the smallest common multiple of 21/9 + b/6 and w. 8 Suppose -q + 1 = -0q. Let j be q/(-2 - -1) + 5. Suppose -3z - j + 18 = 5v, 2v + 2z - 4 = 0. What is the least common multiple of v and 1? 4 Let f be 16/(-10)300/(-40). Calculate the common denominator of 1(-61)/f-1 and -97/24. 24 Let u be 4/14 + 136/14. What is the common denominator of ((-2590)/(-72))/(-7)10/25 and u/(-9)3/(-8)? 36 Suppose -2010 = -5l - 3z + 8z, 2z = -3l + 1221. Calculate the lowest common multiple of l and 6. 810 What is the common denominator of -52/9 and 1953/(-360) + 2 + 5? 360 Suppose -4r + k = 3k - 96, 3r + 3k = 72. Find the common denominator of -26/5 and (5/(-148))/(6/r). 185 Let u = 2/245 + 2432/2205. What is the common denominator of u and 35/326? 2934 Let f(a) be the first derivative of -a2 + 2. Let v(x) = x3 + 2x*2 - 34x - 2. What is the least common multiple of f(-1) and v(5)? 6 Suppose 4m - 34 - 95 = d, 4m = -d + 127. What is the lowest common multiple of 260 and m? 2080 Suppose 0 = w - 5w + 3h + 637, 0 = 4w - 5h - 635. What is the lowest common multiple of 100 and w? 800 Suppose 352 + 488 = 20p. What is the lowest common multiple of p and 18? 126 Let c = -121263/20 - -6057. What is the common denominator of c and -89/36? 180 Let q = -10915 + 687677/63. What is the common denominator of 35/18 and q? 126 Let t(q) = 3 + 4q + q*3 + 2 + 1 + 3q*2 + 2q*2. Calculate the lowest common multiple of 22 and t(-4). 66 What is the least common multiple of 21(-24)/(-2268) - 2878/(-9) and 48? 960 Suppose 2m + 3h + 8 = 0, -8h - 20 = -2m - 4h. What is the least common multiple of 670 and m? 670 Let u(c) = c2 - 10c + 13. What is the smallest common multiple of u(10) and 117? 117 Suppose 4m = 5l - 1293, -591 = -2l - 4m - 57. What is the least common multiple of l and 6? 522 Let h = -89/468 - 1/468. Find the common denominator of h and -87/34. 442 Suppose -3k - 5c - 4 + 603 = 0, -4c + 598 = 3k. What is the smallest common multiple of 180 and k? 1980 Let i = -14763/4 + 3666. Let c be -2 - (1 - 1)/(-3). What is the common denominator of i and c - (2 + 131/(-10))? 20 Let l = 10 - 17. Let n(o) = -o*2 - 8o + 2. Let i = 34 - 19. Calculate the smallest common multiple of n(l) and i. 45 Let z(j) = -41j + 6. Let o be z(-6). Let g be -3 + 1 + 510/o. Let w = g - 110/63. Find the common denominator of -69/2 and w. 18 Suppose -2c - 13 - 1 = -4i, 3c + 4i = 9. Calculate the common denominator of (14/16)/(-10c/(-4)) and 59/4. 20 Calculate the least common multiple of 36/(-10)3/((-3)/10) and 132. 396 Let u = 377 + -329. Calculate the lowest common multiple of u and 6. 48 Let s = -1/555 + -3143/1110. Calculate the common denominator of s and 2 - 0 - 46/(-8). 12 Let t(y) = -y2 + 5y - 4. Let w(h) = h + 9. Let v be w(-5). Let m be t(v). Suppose -3o + 4o - 8 = m. Calculate the smallest common multiple of 6 and o. 24 Let k be (-1)/2 + 124/(-8). Let y(d) = d + 20. Calculate the least common multiple of y(k) and 2. 4 Find the common denominator of (-7)/1540 + (-2)/(-15) and -47/264. 264 Let n = 1541/28 + -310/7. Find the common denominator of n and ((-20)/(-2))/(28/(-13)). 28 Let p be (8/(-3))/((-16)/24). Suppose 2i + i = -3k + 24, 2i + 8 = pk. Suppose -5q = -10q + 45. What is the least common multiple of k and q? 36 Let w(a) = 3a2 - 3a. Let x be w(-2). Suppose 34j + x = 37j. What is the lowest common multiple of j and 10? 30 Suppose 6n - q - 293 = 2n, -77 = -n - q. Suppose 2x - 10 = 0, 14x - 20 = -5s + 16x. Calculate the smallest common multiple of s and n. 222 Suppose -12x + 1 = -11x. Find the common denominator of -17/24 and (-2 + 13)x/(-3). 24 Let v = 5080 - 30401/6. Let y = -5924/24981 - 4/757. Find the common denominator of v and y. 66 Let y = -989/5 + 11113/60. Find the common denominator of y and -133/144. 144 Suppose -15h = -8758 - 1862. Calculate the least common multiple of 11 and h. 7788 Let t = -53 + 55. Suppose -3k + tk - 5w = -25, -2k + 3*w - 2 = 0. What is the least common multiple of k and 5? 5 Let o = -24499/238 - -1722/17. Let u = -2339 + 37501/16. Find the common denominator of o and u. 112 Let g b	{ "pile_set_name": "DM Mathematics" }
-2/5, b? b Suppose 0 = 3w - 5a + 19, w - 2 = 3a - 11. Suppose 57m - 255 = 6m. What is the second biggest value in -0.4, w, m? -0.4 Let p be (7/175)/(2/(-15))-2. Which is the third biggest value? (a) 29 (b) 4 (c) p (d) -1/5 c Let o = 1378 + -1375. What is the smallest value in o, -0.33, -5? -5 Let f = 33.07 - 33. Let x = f + 0.33. What is the third smallest value in 1/2, x, -3/4? 1/2 Let d = -0.29 - -0.55. Let j = d - -4.74. What is the smallest value in j, -4, -1/2? -4 Let r be -2 + (19 - -2) + -1. Let a = 0.04194 + 0.95806. What is the second biggest value in r, a, -1? a Let m = 0.074 - 0.154. Let q = -0.08 - m. Which is the second smallest value? (a) q (b) 2/17 (c) -1 a Let s = -1.3 + 1.274. Let o = s + 0.046. Let y = 3.3 + 0.7. Which is the third biggest value? (a) o (b) y (c) 1 a Let m = 3 + -4. Let o = -0.041 - 0.759. Let c = o - 3.2. What is the third smallest value in m, 4, c? 4 Let c(w) = -w*2 + 5w + 2. Let g = 20 + -15. Let a be c(g). Let s = 363/7 - 52. What is the smallest value in s, 1/3, a? s Let r = -133 - -133.1. Which is the second smallest value? (a) r (b) 3/7 (c) 8 b Let y(b) be the first derivative of -b*4/4 + 3b*3 - 13b*2/2 - 11b - 15. Let p be y(7). What is the fourth smallest value in 4, 1, p, -3? 4 Let c = 878 - 878.5. Let v = -9 - -4. What is the fourth biggest value in -2, -0.1, c, v? v Let f = 1.137 + -1.039. What is the third smallest value in -5/4, f, -4? f Let a = 32.5 - 36. Let q = -3.9 - a. What is the smallest value in q, 1/4, 5? q Let w = 39 + -38.92. Let q = 228 - 2962/13. Let y = 9 + -8. Which is the third smallest value? (a) q (b) y (c) w b Let r = -0.06 + 0.46. Let d = 10 + -10.8. What is the smallest value in d, r, 1/4? d Let p = -169 + 101. Let x = -66 - p. Which is the biggest value? (a) -0.3 (b) x (c) 0.1 (d) 4 d Let j = 1124.71 + -1099. Let d = -0.71 + j. Which is the smallest value? (a) d (b) -1/5 (c) -1/4 c Suppose 2n - 54 = -3l, l + 28 - 146 = -4n. Let s be 6/(-40) + ((-168)/n - -6). What is the fourth biggest value in 2/9, 3/4, s, -5? -5 Suppose -2t = 4h - 48, 28 = 2t + 3h - 17. Let u be t/(-9) + (-4)/2. Which is the third smallest value? (a) -2/3 (b) -8 (c) u (d) 4 a Let j = 191.4 - 191. Let z be (-34)/(-40) + 3/(-5). Which is the second biggest value? (a) j (b) 1 (c) -0.5 (d) z a Let h = 1315 - 1299. Let t = 0.5 + -0.3. Which is the fourth biggest value? (a) t (b) -1 (c) h (d) 2/7 b Let g be 640/420(27/(-6))/3. What is the biggest value in -0.4, g, 4? 4 Let h = 0.0318 - 0.0918. Let z = -0.5 + 1. Which is the third smallest value? (a) h (b) 1 (c) z b Suppose -4x - 2r + 421 = 55, 3x - 3r = 252. Let d = -90 + x. Let q = -0.02 + 3.02. What is the biggest value in q, d, 1? q Let n be 222/216 - 2/(-9) - 1. Which is the fourth smallest value? (a) -3/13 (b) 2 (c) 5 (d) n c Let q = -274 + 279. Which is the second smallest value? (a) q (b) -1/22 (c) 0.1 c Let v = 0.01 + 1.32. Let w = -0.43 + v. What is the second biggest value in 0, -2/13, w? 0 Suppose -3n - 2m + 18 = 3m, 5m = -2n + 17. Let w be (1 - 4)/(-45) - n/(-3). Which is the third biggest value? (a) w (b) 6 (c) -4 (d) -2 d Let x = -102 - -103. Let u be -1 - (-16)/5 - 2. What is the second smallest value in -2/15, u, x? u Let w = -5.1 - -0.5. Let y = -7.4 - -7. Let d = y + w. What is the smallest value in d, -0.2, -0.1? d Let p = -1.81 - -7.81. What is the third smallest value in p, 8, -5, 2? p Let w(k) = k + 17. Let g be w(-13). Let h be (g/84)/(4/14). Let r = 4.3 - 4. What is the biggest value in h, -4, r? r Let z = 0.36 + -0.26. Which is the third biggest value? (a) -3/4 (b) z (c) -0.4 (d) 4/41 c Let p = 3522 + -95092/27. Let h = 3 + -2.9. Let w = 0.1 - h. Which is the second smallest value? (a) p (b) w (c) -5 b Suppose -169 = -3q - 1135. Let z be (-5)/(-3) + q/168. Which is the second smallest value? (a) z (b) -2/21 (c) 2/19 b Let i be 1/(-7) - 448/(-49). Let q be i/451/1. Which is the third smallest value? (a) 3/5 (b) q (c) -2 a Let y = -5.9 + 6. Let s = y - 0.6. Let w = -49/20 - -9/4. What is the smallest value in w, s, 0.4? s Let t = 47 + -44. What is the smallest value in t, -2/9, 0? -2/9 Let h = 55.9 - 56. Let d = -9.5 + 9.8. Which is the smallest value? (a) 5 (b) h (c) d b Let g = -0.1 + -0.4. Let r = 82.7 + -78. Let s = r + -7.7. Which is the third smallest value? (a) g (b) 0 (c) s b Let l(y) = -y2 - 2y + 3. Let f be l(-4). Let d = 0.047 + -0.1. Let q = -0.753 - d. Which is the second smallest value? (a) 0.1 (b) f (c) q c Let u = -47/20 + 779/140. Let v = u - 26/7. Which is the second smallest value? (a) -1/3 (b) v (c) 0.6 a Let q = 312179/8 - 39315. Let g = -293 - q. Which is the smallest value? (a) 1/3 (b) g (c) -2/13 b Let q be 12/(-10) + 1 + 42/910. Which is the fourth biggest value? (a) 3 (b) q (c) -3/4 (d) 1 c Suppose y - 35 = 4l, -62y + 59y - 2l + 35 = 0. What is the biggest value in y, -3, 3? y Let p = 835/8943 - 2/813. Let s = 0 - 0.1. Which is the biggest value? (a) s (b) -0.2 (c) p c Let r = -105/8228 - -49263241/172788. Let b = r + -285. What is the third smallest value in -0.05, -1/2, b, 0.3? b Let p = 6491 - 129937/20. Let u = p - -28/5. Let y = 0.1 - 0.4. Which is the biggest value? (a) -4 (b) y (c) u c Let o = 842.88 + -843. What is the second smallest value in 3, -0.8, o? o Let x = 180 - 179. Let u be -3 + (42/(-4))/(x/2). What is the biggest value in -2, u, -0.4? -0.4 Let k = 0.4779 + -43.8879. Let h = -43 - k. Let o = -0.09 - h. Which is the biggest value? (a) 0 (b) 4 (c) o b Let t(c) = -c*3 + 11c*2 - 30c + 13. Let d be t(7). What is the second biggest value in -0.2, 1/3, 39, d? 1/3 Let n(x) = x*2 + 8x - 117. Let o be n(-16). What is the second smallest value in -5, o, -1/2? -1/2 Suppose 40 - 36 = 2n. Let w = 3.1 - 3. Let r = w - 0.5. What is the third smallest value in n, 0.4, r? n Let m = 7 - 9. Suppose v = -v + 2. Let u be -2(3/(-57))/v. What is the third smallest value in m, -5, u? u Let h = 33 + -32. Let q = -0.12 + 1.42. Let w = h - q. What is the second biggest value in -5, -2, w? -2 Let q = -0.03 + 0.13. Let f = -0.6 + 0.9. Let r = f - q. Which is the third biggest value? (a) -2/9 (b) r (c) 0.5 a Let z = 0.83 + 45.17. Let k = z - 45.5. Which is the biggest value? (a) -0.3 (b) k (c) 30 (d) -2/5 c Let x = 1.4 + -5.4. Let j = -3 - x. Let a = -1 + -1. What is the second smallest value in a, 2/7, j? 2/7 Let t be (-3)/(-15) + (-48)/(-120). Which is the second smallest value? (a) -7 (b) -4 (c) t (d) 0.2 b Let b = -0.21 + 8.21. Let a = 3 - b. Let v = -165 + 327/2. What is the third biggest value in v, a, 2? a Let r = 14 + -13.66. Let q = r + 12.66. Let m = q + -8. Which is the biggest value? (a) -2/7 (b) m (c) 4 b Let o = -5 - -4.7. Let z be 4 - (-2 - 0) - -1. Suppose 6j = -j - z. Which is the third smallest value? (a) o (b) j (c) 2/5 c Let x be (-1)/(-5) + (-429)/(-1155). Let k(v) = v + 7. Let l be k(-7). What is the biggest value in 2, x, l? 2 Let d = -40 + 71. Let f = d - 31.29. Let u = f - 0.11. Which is the third smallest value? (a) -5 (b) -3 (c) u c Let t = 2/915 + -632/10065. Which is the smallest value? (a) -3/16 (b) 1 (c) t (d) -5 d Let o = -0.27 + 0.29. Let k = -0.18 - o. Which is the second biggest value? (a) -5 (b) -0.4 (c) k b Let p = 0.1 + 4.9. Let l = -16.55 - -17. Let t = 0.65 - l. What is the second smallest value in p, 0.5, t? 0.5 Let k = -2.1 - -3.1. Which is the second smallest value? (a) 20 (b) 0 (c) k c Let z = -347 - -347.1. Let d = 0.5 + 2.5. What is the third biggest value in z, 22, d? z Let z = 0.0228 - -2.9772. What is the biggest value in 0.1, 1/2, z? z Let m = 349/845 - 36/169. Which is the second smallest value? (a) m (b) -0.089 (c) -3 b Suppose -5c + m + 10 = -0c, c - 5m - 26 = 0. Let u = -1328 - -1327. What is the second biggest value in -0.5, 3, u, c? c Let g = 197.17 + -197. What is the third smallest value in g, -0.2, 5, -0.3? g Let f = -113 - -113. Which is the second smallest value? (a) -1/5 (b) -5 (c) 2/5 (d) f a Let j be 3 + (-3)/(-7)475/(-75). Which is the fourth biggest value? (a) 4 (b) -3 (c) j (d) -5 d Suppose 11 - 55 = -22h. Let j = 13 + -15.2. Let k = 0.2 + j. Which is the biggest value? (	{ "pile_set_name": "DM Mathematics" }
- 76a. Let w(r) = -282r*3 + 3r*2 + 3r. Give 3s(o) + 76w(o). -285o3 Let z(w) = -4w + 2. Suppose 5r + 4g = 0, -4r - 46 + 15 = -3g. Let u be (r/(-16))/(2/(-8)). Let y(m) = m. Determine uz(s) - 3y(s). s - 2 Let b(k) = -94k2 - 6. Let c(t) = 95t*2 - t + 4. Calculate -2b(n) - 3c(n). -97n*2 + 3n Let x be ((-3)/6)/((-6)/12). Let c(s) = s3. Let o(a) = -3 + 7 + a2 + 0 - 3. What is xo(j) + c(j)? j3 + j2 + 1 Let o(f) = -10f*3 - 91f - 3. Let m(d) = -7d3 - 61d - 2. Calculate 7m(n) - 5o(n). n*3 + 28n + 1 Let m(f) = -12f - 9. Let l(u) = -12u - 9. Let c(a) = -6l(a) + 5m(a). Let g(o) = 3o + 2. Suppose 9d + 207 = 32d. Give dg(b) - 2c(b). 3b Let w(t) = 5t2. Let f(g) = 2g*3 + 11g*2 + 9g. Let v be f(-5). Let y = v - -9. Let x(u) = -9u2. What is yw(n) - 6x(n)? -n2 Let z(f) = 3f + 1. Let h(n) = -4n. Let s be 612/216 + (-3)/(-18). Give sz(l) + 2h(l). l + 3 Let d(j) = -3j + 14. Let p(g) = 2g - 10. Let s(a) = 5d(a) + 7p(a). Let f(k) = 3k - 3. Calculate -f(z) - 4s(z). z + 3 Let h(p) = p2 - p - 4. Let a be h(-2). Let y be 3(a/7)/((-33)/(-77)). Let r(g) = g*2 + 2g + 2. Let b(f) = 4f2 + 11f + 11. Determine yb(j) - 11r(j). -3j2 Let f(q) be the third derivative of -q4/24 + q2. Let u(i) = -i - 1. Suppose -29x + 32x + 6 = 0. What is xf(n) - u(n)? 3n + 1 Let l(k) = 31k*2 - 8k + 5. Let z(i) = -13i2 + 4i - 2. Calculate 2l(y) + 5z(y). -3y2 + 4y Let f(p) = -4p3 + p2 + 5p + 4. Let g be (-1)/4 - -822/16. Let a(u) = -2u*3 - 2u + gu2 + 2 - 20u*2 + 11u*2 + 5u. Calculate -5a(j) + 3f(j). -2j3 - 2j*2 + 2 Let t(k) = -8k - 5. Let j(i) = -1. Give -6j(h) + t(h). -8h + 1 Let a(o) = o*3 + 2o*2 - 4o - 1. Suppose 2p = -4b + 18, -p + 6 + 5 = 4b. Let n(h) = 3h*3 + 7h*2 - 12h - 3. Calculate pa(d) - 2n(d). d*3 - 4d - 1 Let a(b) = 23b - 29. Let l(u) be the second derivative of 2u*3/3 - 5u*2/2 + 2u - 9. Calculate 6a(f) - 34l(f). 2f - 4 Let o be 5 - (18/(-3) + 36/6). Let b(g) = 7g + 1. Suppose 4h + h = 30. Let q(d) be the third derivative of -d4/4 - d3/6 + d2. What is hq(f) + ob(f)? -f - 1 Let v = 285 - 279. Let d(t) = 2t + 3. Let o(r) = 9r + 11. What is vo(z) - 22d(z)? 10z Let d(l) = 2l2 + 1. Let v be d(-2). Let i(r) = -5r. Let o(x) = 20. Let p(j) = -11j - 120. Let b(c) = -6o(c) - p(c). Determine vi(g) + 4b(g). -g Let r = 20 + -19. Let n(g) = -g - 1. Let s(z) = -26z + 10z + 11z. Calculate rs(l) - 3n(l). -2l + 3 Let a(t) = -101t2 + t - 1. Let c(d) = 102d*2 - d + 1. What is 3a(v) + 4c(v)? 105v*2 - v + 1 Let y(k) = k. Let x(r) = -917r - 1. What is x(n) - 4y(n)? -921n - 1 Let i(g) = -5g3 - g2 + g + 1. Suppose 4q - 11p = -6p - 14, 6 = 2q + 4p. Let y(f) = f3 + f2 - f - 1. What is qi(a) - y(a)? 4a*3 Let w(a) = -7a*2 + 8a - 5. Let x(j) be the first derivative of -j3/3 + j2/2 - j + 25. Give w(k) - 6x(k). -k2 + 2k + 1 Let i(s) = -s*2. Let d = 2085 - 2086. Let x(p) = -7p*2 + 6. Give dx(n) + 5i(n). 2n*2 - 6 Let q(y) = -7y + 3. Let m = 6 + -12. Let f(r) = -4r + 29. Let n(l) = 5l - 35. Let v(u) = 6f(u) + 5n(u). Give mv(i) - q(i). i + 3 Let l(q) = 2q - 1. Let f(d) = -4d3 - 3d - 2. Determine f(i) - 4l(i). -4i*3 - 11i + 2 Let q(g) = -9g2 - 5g - 9. Let t(c) = -5c2 - 3c - 5. Let p(i) = 2i3 + i2 - 14i - 20. Let b be p(-2). Calculate bq(w) + 7t(w). w*2 - w + 1 Let r(a) = 8a + 5. Let o(v) = -2v + 24542 - 3v + 12v - 24537. Give 7o(p) - 6r(p). p + 5 Let q(d) = -123d*2 + 9d + 1. Let t(y) = -3y. Determine -q(g) - 3t(g). 123g2 - 1 Let i(o) = -4o*2 + o - 1. Suppose -27j + 35j + 16 = 0. Let m(t) = 5t*2 - 2t + 1. Determine jm(r) - 3i(r). 2r2 + r + 1 Let m(s) = 17s*2 - 5s + 23. Let b(t) = -3t2 + 2t - 2. Determine -3b(j) - m(j). -8j2 - j - 17 Let f(t) = t3. Let w = 101 + -95. Let a(r) = r*3. Determine wf(o) - a(o). 5o3 Let m(q) = 3q - 33. Let n(y) = -y + 1. Give m(r) + 5n(r). -2r - 28 Let p(y) = 20y - 31. Let j(g) = -61g + 90. Calculate 6j(w) + 17p(w). -26w + 13 Let h(p) = 7p*2 + 11p - 6. Let g = -1 - 2. Let y(t) = t. Let j(b) = gy(b) + h(b). Let r(w) = 15w*2 + 17w - 13. Determine -13j(s) + 6r(s). -s*2 - 2s Let x(w) = w*2 - 5w + 7. Let t be (-2 - 8/5)/(12/(-30)). Suppose -1 + t = 4k. Let d(s) = s2 - 2s + 3. Calculate kx(r) - 5d(r). -3r2 - 1 Let z(i) = i + 1. Let s(b) = -b - 2. Let n be s(-2). Suppose -h + 3 - 4 = n. Let u(o) = 2o. Let f = -51 - -52. Calculate fz(k) + hu(k). -k + 1 Let q(n) = 16n + 11. Suppose -4o = 3i + 44, -3o + i = -0i + 33. Let c(h) = 5h + 4. Determine oc(b) + 4q(b). 9b Let h = -4 + 6. Let i(j) = -4j + j2 - h + j2 - j*3 - 3j*3. Let w(s) = 3 - 2 + 5s*3 - 7s*2 + 8s*3 + 13s + 6. What is 7i(y) + 2w(y)? -2y3 - 2y Let d(g) = -5g3 - 134g*2 - 8. Let v(m) = 2m*3 + 45m*2 + 3. Determine -3d(t) - 8v(t). -t3 + 42t*2 Let a(u) = -2. Let f(j) = 82j - 5. Give 3a(w) - f(w). -82w - 1 Let q(v) = v. Suppose -4w - 18 = -2s + s, 0 = s - 5w - 23. Let r(b) = 51b - 356. Let x be r(7). Let j(o) = 4o + 1. What is sq(z) + xj(z)? 2z + 1 Let v(f) = 22f3 - 6f*2 - 13f + 7. Let s(x) = -41x3 + 11x*2 + 25x - 13. Determine -6s(b) - 11v(b). 4b3 - 7b + 1 Let o(q) = 4q3 - 8q*2 + 5. Let z(d) be the first derivative of -3d*4/4 + 7d*3/3 - 4d - 386. Give -5o(n) - 6z(n). -2n3 - 2n*2 - 1 Let n(o) = -5o*2 - 4o - 1. Let y(h) = 11h2 + 7h + 3. What is 5n(k) + 2y(k)? -3k2 - 6k + 1 Let x(y) = -3y3 - 5y*2 - 7. Let c(s) = -2s*3 - 2s*2 - 3. Suppose 12 = f + 5m + 10, -3f = m - 6. Give fx(a) - 5c(a). 4a*3 + 1 Let m(q) be the second derivative of 7q4/12 + q2 + 181q + 3. Let a(y) = 8y*2 + 3. Calculate 4a(x) - 6m(x). -10x*2 Let o = -8 + -4. Let f(b) = -2b + 5. Let w(l) = -9l + 21. Let x(a) = -4f(a) + w(a). Let d(h) = -10h + 12. Calculate ox(g) + d(g). 2g Let k(b) = b + 1. Let c(a) = -24 + 24 + a. Let x(j) = j + 3. Let o(y) = 4c(y) + x(y). What is 3k(s) - o(s)? -2s Let u(v) be the first derivative of -v3/3 + v2/2 - v - 64. Let k(q) = -2q2 + q - 1. Determine 3k(d) - 4u(d). -2d*2 - d + 1 Let f(q) = 1. Suppose 2b + 49 = 2p + 5b, -5p - 5b + 130 = 0. Let s = p + -23. Let j(w) = w + 4. Give sf(o) - j(o). -o + 2 Let x(j) = -7j3 - j2 + 5j. Let i(p) = -6p3 - p2 + 4p. Let a(b) = 2b*2 + 2b - 184. Let h be a(-10). Calculate hx(s) + 5i(s). -2s3 - s2 Let x(y) = y2 + 10y - 90. Let z be x(-16). Let c(p) = 5p3 + 6p*2 + 5p - 5. Let f(s) = 4s3 + 7s*2 + 6s - 6. What is zc(m) - 5f(m)? 10m3 + m2 Let k(a) = 2a - 9. Let v(b) = -b + 3. Let q = 1388 - 1396. What is qv(x) - 3k(x)? 2x + 3 Let f(g) = -2g*2 - 9g + 1. Let o(z) = 4z2 + 17z - 2. Give -5f(x) - 2o(x). 2x2 + 11x - 1 Let n(x) = -2. Let a(o) = -539o - 70. Calculate a(q) - 35n(q). -539q Suppose -j = 4k + 3, -12j - 5 = 2k - 15j. Let d(n) = 3n. Let y(c) = -c + 1. Calculate kd(i) - 2y(i). -i - 2 Let o(n) = 1. Let s(k) = 2. Let b(r) = -3o(r) + 2s(r). Suppose 7h = 5h + 2. Let y(m) = 2 - 3 - 3 - m*2 + 2. What is hy(p) + 4b(p)? -p2 + 2 Let v(q) = -2q + 5. Let i(h) be the first derivative of -3h2/2 + 9h - 231. Calculate -3i(o) + 5v(o). -o - 2 Suppose -5 + 4 = t + n, -4n = -5t + 40. Let y(b) = -20b + 9. Let x(p) = 5p - 2. Determine ty(s) + 18x(s). 10s Let m(a) = -664a*3 - 10a*2 + 5a + 5. Let n(x) = x*3 + 2x*2 - x - 1. What is -m(r) - 5n(r)? 659r3 Let n(d) = 0d*2 + 2 + 2d2 - 1. Let w(m) = -m. Let k(c) = -c3 + 8c2 - 2c + 16. Let z be k(8). Suppose t + 9 - 10 = z. Calculate tw(q) - n(q). -2q*2 - q - 1 Suppose 30h = 678 - 588. Let t(k) = k*2 - 4k + 5. Let u(d) = -3d2 + 7d - 11. Calculate hu(g) + 7t(g). -2g2 - 7g + 2 Let g(v) = -934v - 8. Let s(w) = w - 2. Calculate -g(j) + 4s(j). 938j Let o(p) = -27p*3 + 28 - 5p - 13p2 - 56 + 15 - 8p. Let d(v) = 13v3 + 6v*2 + 6v + 6. Determine 13d(g) + 6o(g). 7g3 Let n(c) = c + 6. Let s(y) = -y2 + y + 7. Let u(t) = -6n(t) + 5s(t). Let g(m) = 14m*2 + 2m + 3. Let p be (3/(-9) - (-2)/3)24. Calculate pu(w) + 3g(w). 2w*2 - 2w + 1 Let t(g) = g*3 + 7g*2 - 9g	{ "pile_set_name": "DM Mathematics" }
/f)(-2/11)/(f8)(-5/6) assuming f is positive. f(190/33) Simplify (z(1/4)/z)(15/8)/(z(-1/3)/z(-2/41)) assuming z is positive. z(-4415/3936) Simplify (((g/g11)/g)(2/45))34 assuming g is positive. g(-748/45) Simplify h(-24)/h*(-4/9)h*19/hh(-2/41) assuming h is positive. h(-2068/369) Simplify (b*(-2)b/b(-1/3))/(b4/b)(-20) assuming b is positive. b(178/3) Simplify ((((ii(ii(-7/3))/i)/i)/i)/i)/i(9/4)(ii(4/5))/(i(-3/29)i) assuming i is positive. i(-8143/1740) Simplify (((b(-1/4)/b)(2/53))(1/20))2 assuming b is positive. b(-1/212) Simplify p*(-15)p*(-1/4)p*(3/2)/(p/(p/(pp/(p/(((p/p*17p)/p)/p))p))p) assuming p is positive. p*(1/4) Simplify ((ffffffff*(-1/5)ff)/f)4/(f17/(ff6)) assuming f is positive. f(106/5) Simplify ((((o/(o/o6))/o)/(o/((o(-6)oo)/ooo)))(-1/21))(-29) assuming o is positive. o(29/21) Simplify (t/t(9/4)t(-10/13))/(t(-19)/t(-25)) assuming t is positive. t(-417/52) Simplify (((s/s5)/s)/sss(1/12)s/s*2ss(-2/5)s)(1/9) assuming s is positive. s(-259/540) Simplify u(7/4)/((((u/(u/(u/u(-19/4))))/u)/u)/u)(u(-1/5)u)/u(-12) assuming u is positive. u(59/5) Simplify ((jj(j*(1/3)j)/jjjj)/(j(-1/22)/j))42 assuming j is positive. j(2947/11) Simplify (((uu*21)/uuu/u(-5/7))(-38))5 assuming u is positive. u(-31540/7) Simplify (((s/(s/(s(2/17)sssss)))/s*(-2/13))/(s((ss/(s(-1/4)/s))/ss)/s)(-22/3))23 assuming s is positive. s(887639/1326) Simplify (t1t)(3/16)/((tt(1/14))/t)(-2/7) assuming t is positive. t(155/392) Simplify ((k(-3/4)/k)/k)/(kk/(k(-10/9)k))k(6/17)k/(k*17k) assuming k is positive. k(-13163/612) Simplify (q10)(-41)/(q(14/3)/q(2/3)) assuming q is positive. q(-414) Simplify (a*(1/5)a)20/(a/(a/(a/(a/(a/a(-10)))a)))(4/23) assuming a is positive. a(504/23) Simplify ((r8/rr)/r)*(-1/15)(r(-5/2))(2/11) assuming r is positive. r(-152/165) Simplify (r/r(1/3))*(-39)r*(2/49)r*(1/6)r assuming r is positive. r(-7289/294) Simplify (i(-3/7)i15)/(i(1/4)i)(-8/11) assuming i is positive. i(1192/77) Simplify ((v/v(-2/9))/v(1/2))(-41) assuming v is positive. v(-533/18) Simplify (u(13/2))25/(u*(13/4)uuu(-36)) assuming u is positive. u(773/4) Simplify (r/r*(-2/7)rr)43r/r*(-9)(r/(rrr(-18)))/r assuming r is positive. r(1171/7) Simplify ((oo12)7)(-2/81) assuming o is positive. o(-182/81) Simplify (i(-1))41/((i(-5)/i)/iiii/i(19/4)) assuming i is positive. i(-129/4) Simplify (((y26/y)/(y/y(5/6)))(5/7))(-4/7) assuming y is positive. y(-1490/147) Simplify ((o(-3)oo)34)(-2/5) assuming o is positive. o(68/5) Simplify ((t9ttt/(tt*3/tt))(1/4))16 assuming t is positive. t32 Simplify ((v/(v/(v/(v/v6v))))/(v(4/3)v))(3/4) assuming v is positive. v2 Simplify (t(2/3)/(t(-2/45)/t))/(t/((t4/t)/t))(-29/2) assuming t is positive. t(-1151/90) Simplify (q(-6)/q)/(qq(qq/(q/(q(-1/3)q)))/qq)q/(q*(-25)q)q12 assuming q is positive. q(79/3) Simplify (z/z10)/z(-11)((z2/z)/z)(-43) assuming z is positive. z*2 Simplify rrr(-2/11)(rr12/rr)/r(r(-1/3))(-20/7) assuming r is positive. r(3412/231) Simplify (v/((vv1)/v))(-5/11)/(v*(2/19)vv/v(-18)) assuming v is positive. v(-382/19) Simplify ((r(-15/7)r)/(r/r*(-2)r))/(r(r(2/13)r)/r)45 assuming r is positive. r(-5193/91) Simplify ((t/t*19)/(tttt/t*21t))/(tt(16/9)tt(-8/3)) assuming t is positive. t(-28/9) Simplify o(-1)/(o9/oo)((o(oo(-1))/o)/o)(-3/10) assuming o is positive. o(-97/10) Simplify (((u(-4/7))3)(3/7))(-5/13) assuming u is positive. u(180/637) Simplify (ii/(i(-3)/i))(-11)(i(-1/7)i)19 assuming i is positive. i(-348/7) Simplify ((g(-5)/g(-3/4))(-3/11))4 assuming g is positive. g*(51/11) Simplify (oo*9)/oo/(o/(oo(((oo10oo)/o)/o)/o))o(-3/5)/(o(2/13)/o) assuming o is positive. o*(1381/65) Simplify (hh(1/27))16h24/hh(-7) assuming h is positive. h(880/27) Simplify (p*26/p)/((p(p/p*(2/3))/pp)/p)(p(-2/19)/p)(-3) assuming p is positive. p(1595/57) Simplify (x(-1/7)x(5/7))/(x3)31 assuming x is positive. x(-647/7) Simplify (d/((((d*(3/2)d)/d)/dd)/d))(5/2)(d/(dd0))20 assuming d is positive. d(5/4) Simplify (q4)5(qqq(-2/5))0 assuming q is positive. q*20 Simplify ((gg/g*(6/5)gg)/((g(g/(g/(gg(-1/27)gg)))/g)/g))/(g7/(g(1/16)g)) assuming g is positive. g(-11017/2160) Simplify (k(-4))(2/31)/(k(-1/16)/k)(-8/7) assuming k is positive. k(-639/434) Simplify k*8/(k/(kk*(-11)))(k/((kk(-4))/k)k)/((kk(2/17)/k)/k) assuming k is positive. k(66/17) Simplify (r(2/13)/r)6/((r(-21)r)/(r*(-8/5)r)) assuming r is positive. r*(931/65) Simplify ((h/(hh(5/2)))/((h21/h)/h))/((h/(hh0))/h(-14)) assuming h is positive. h(-71/2) Simplify (((f(f/f(14/3))/f)(-5))(-1/6))(-1/4) assuming f is positive. f(55/72) Simplify (r10/r(-13/4))17 assuming r is positive. r(901/4) Simplify ((q(-3/7)qq*(-2/9))/(((q(((qq(-2/3))/q)/q)/q)/q)/(q(-1/4)q)))6 assuming q is positive. q(949/42) Simplify ((v*(2/7)v)(-4/5)/(v0)(2/49))7 assuming v is positive. v(-36/5) Simplify ((h(-4))(12/7))(2/7) assuming h is positive. h(-96/49) Simplify (x/x(-1)xx)/(xxxx5/xx)((x(x/(x/x*7))/x)/x)/(xx/x(7/6)) assuming x is positive. x(7/6) Simplify ((y/(y(-3/4)/y))/y)(-1/11)((y/(y/y(1/8)))/y)/y(-7/4) assuming y is positive. y(63/88) Simplify (m(-18)m)/mm(5/6)(m/(m(m/(m(m*(7/2)m)/mm))/mm)m)36 assuming m is positive. m(1085/6) Simplify (b/(bbb/b(-9))b)(1/72)/(b(-19))12 assuming b is positive. b(8203/36) Simplify (((tt(-2/13)/t)/(ttt(-3/5)))/((t(-7)t)/((t/t*(1/4))/tttt)))(-2/61) assuming t is positive. t(-1871/7930) Simplify ((w/w*18)/(wwww(-21)))/((w(1/11)/w)/((ww(2/23))/w)) assuming w is positive. w(505/253) Simplify (nn/n*(1/16)nn(2/29))(-4/9) assuming n is positive. n(-155/116) Simplify (q/((q(q*(-3)/q)/q)/q)qq(1/6)/q((qq1q)/q)(-3/14))(-1/6) assuming q is positive. q(-241/252) Simplify n3n/(n/(n18/nn))(nn*(-12)n)/(nn/n(-19)) assuming n is positive. n(-10) Simplify (f(-5))2(f(-2))(-8/5) assuming f is positive. f(-34/5) Simplify f4/ff(-15/7)ff(-2/7)f1 assuming f is positive. f(18/7) Simplify (l(-15)/l)35(l(-2/21)l)(-31/2) assuming l is positive. l(-24109/42) Simplify ((v(v/(v(5/4)/v))/v)/(v(((v/v*(-1/4))/v)/v)/v))/(vv(2/13))1 assuming v is positive. v*(9/26) Simplify (d/(d(d/(ddd*12))/dd)d)/((d(-14)d)/d)(d(-2))(-1/6) assuming d is positive. d(85/3) Simplify (n(-1/11)nn)44/((n/(n/(nn(3/4))))/n)39 assuming n is positive. n(219/4) Simplify ((n5(n/(n/n(-4))n)/n)/((nn(-3/4))/nn(((nnn6n)/n)/n)/n))30 assuming n is positive. n(-315/2) Simplify ((nn(-1/5)/nnnn)(3/43)/(n(2/19)/(n/((n/n*(-1/3))/n)nnn)))(-13/6) assuming n is positive. n(-598507/73530) Simplify ((z*(-1)/zz)/(z/(z1/z)))/(z(1/6))(4/5) assuming z is positive. z(-32/15) Simplify ((ff(-9)/f)/(f/f15))/((f(5/2)f)/(ff(-9)/f)) assuming f is positive. f(-15/2) Simplify (s/s(-1/2))25/((s(-12)s)/((sss*(-2)/ss)/s)) assuming s is positive. s(95/2) Simplify j12j(-7)j*(-15)/((jj/(jj((j/((jj/j(-8/7))/j))/j)/jj))/j) assuming j is positive. j(-78/7) Simplify y(4/5)((y/(y/(y(-8)/y)y))/y)/yyy(y/(y(2/5)y))(-14/9) assuming y is positive. y(-386/45) Simplify (i*(-4)/ii*(2/7))/(i(i*(-2)/i)/ii)(2/147) assuming i is positive. i(-689/147) Simplify (j/(jj1j)jjjjjj(-1/5)/j)/(j/((j/j14)/j)j(j/(((jj6)/j)/j))/j) assuming j is positive. j(-46/5) Simplify (r(22/5)r(rrr(-5/3)rr)/r)(1/2) assuming r is positive. r(101/30) Simplify ((g/(g/(gg*(5/4))))/(ggg(1/44)/ggg))/((g/g(2/15))/g)(-36) assuming g is positive. g(-613/110) Simplify ((a(aa/a*(-13))/a	{ "pile_set_name": "DM Mathematics" }
suming z is positive. z(-43/6) Simplify ((((o(-3)/o)/o)/o)(-2/3))(-14) assuming o is positive. o*(-56) Simplify (ww*0w)*(-1/12)(w(-6)/w)(-47) assuming w is positive. w(1973/6) Simplify (((x1)(-8))(-32))32 assuming x is positive. x8192 Simplify (l(-10/3))(-20)(l(l/(l/(l(-23)/l)))/l)/(l7l) assuming l is positive. l(104/3) Simplify (((s(-1)/s)/s)/ss/(s*(-11)s))/(s(-3))(-17/7) assuming s is positive. s(-2/7) Simplify q(-1/9)/q*(-5/3)(q12)(1/42) assuming q is positive. q(116/63) Simplify ((w(-1/5)w)(-38)/(ww/w(-2/7))(18/11))(-27) assuming w is positive. w(354888/385) Simplify ((q*7q/(q/q*(8/5)q))/(qq(2/27)qq(-10)))33 assuming q is positive. q(23056/45) Simplify (n(-1/6)nnnnn*(-10)(nn(-2/3)n)(-49))(-1/44) assuming n is positive. n*(13/8) Simplify (qq*23)/(qq/q*(-19)qq)qq13qq/q(-1/21)q assuming q is positive. q*(379/21) Simplify ((oo(oooo(-16))/o)/((o/o(-12))/o))/(((o/((oo/o(-2/31))/o)oo)/o)/oo7) assuming o is positive. o(-959/31) Simplify ((rrr/(r*(-12/7)/r)r)/(r(-3)/r))/((r(-1)/r)/r)(-19) assuming r is positive. r(-324/7) Simplify (((pp(-9)/p)/ppp)/p(6/5))/((p/p(-1/14))/p(-8)) assuming p is positive. p(-1279/70) Simplify (b/(bb/(b/b(-12))))/b2(b(-3))18 assuming b is positive. b(-44) Simplify (((iii14)/ii)/i(-4))/(i(-5/3)/i(1/38)) assuming i is positive. i(2473/114) Simplify (qqqq/q(1/3)q)/(q/(q(q/((q/(q/q(-3/2)q))/q)q)/q))(q/(q/(qq(-11)q)q))/qqqq(-9) assuming q is positive. q(-53/6) Simplify (h/h(2/13))20h(-5)hh(h(5/6)/h)/h assuming h is positive. h(995/78) Simplify ((y*(-9/2)y)(1/64))(-18) assuming y is positive. y(63/64) Simplify w(-9/7)/w*(2/29)(ww23)/((www/((w/(www/(w/w(-5/2))www))/w)w)/w) assuming w is positive. w(6961/406) Simplify (m/(m/m12))(-4/29)m/(m*24/mm)mm(8/3) assuming m is positive. m(-1826/87) Simplify ((((g/(gg(-14)))/g)/g)/(g/g0))/(g(1/5)((g*(-24)g)/g)/g) assuming g is positive. g*(179/5) Simplify (h/(hh/(h/(hh2/h))h))*45h*(8/3)/h(hh(-2/11)hh)/h assuming h is positive. h(-4340/33) Simplify f(-12/11)/f15f(f(-1/5)/f)/ff(-2/3) assuming f is positive. f(-2963/165) Simplify (((z(-14)/z)/z)/z(18/11))/(z*9z)(1/27) assuming z is positive. z(-5348/297) Simplify ((ggg*14/g)/((g/(g((g/(g/((gg/(g((gg4)/g)/g))/g)))/g)/g))/gg))/(g/(gg/(g/(g/g(-3)))))(2/95) assuming g is positive. g(958/95) Simplify (z/z(-5/6)z/z(1/5))/(z(-3/5)/z)(1/7) assuming z is positive. z(601/210) Simplify b/(b/b*3)b/(bb(-1/34))(((bb(-2/25))/b)/b)/b(1/11) assuming b is positive. b(17377/9350) Simplify (((p(-16)p)/p(-2/9))(-31))(1/5) assuming p is positive. p(4123/45) Simplify ((s/(ss(3/7)))/(s(s*(-1/14)ss)/ss))(8/5) assuming s is positive. s(-188/35) Simplify ((rrr*14)/(rrr(3/4)rrr))/(r/r*(-2/17)(r(r/(r/(r/(rr/(rr(-3))))))/r)/rr) assuming r is positive. r(825/68) Simplify (x(-6/7))*(-2/77)x(-2/7)/(x(-10/3)/x) assuming x is positive. x*(6581/1617) Simplify (fff/(f(f*5/ff)/ff)ff)(2/131)/(ff(-2/11))(12/19) assuming f is positive. f(-14566/27379) Simplify (u(23/2)u(3/8)uu)(-12) assuming u is positive. u(-333/2) Simplify (g(-2/5)g)*(-45)g*(-1/29)/ggg(g(-4)/g)/g assuming g is positive. g(-929/29) Simplify k*0/(kk*1k)k8/k(-2/7) assuming k is positive. k(37/7) Simplify uu*(1/2)/uuu(2/13)(u(u/(u/(u/(u/u(-22)))))/u)/u(-1/5) assuming u is positive. u(-2619/130) Simplify (((t/t4)/tt/t*(2/13))/(tt(-2))(2/13))*0 assuming t is positive. 1 Simplify (xxx(1/4))(4/21)/(x/(xxx(-3)xxx))4 assuming x is positive. x(31/7) Simplify (i*(1/4)i(-18)/i)/(i10(i/(i/(i/i(2/21))))/i) assuming i is positive. i(-2407/84) Simplify (u(-13/4)/(u/(((uuu(2/11)u)/uu)/u)))/(u/((u/(uu*4u))/u)uu/(uu(-1/20))) assuming u is positive. u(-1113/110) Simplify (l(-19))(-24)l(-2/23)/l(-10) assuming l is positive. l(10716/23) Simplify (p/(p(-12/11)p)p)/((p/p*13)/p)p*(-20)p(10/9)/p assuming p is positive. p(-475/99) Simplify ((d/d*0)/d)/ddd(-7)(dd1/d)/(((d/d(7/4))/d)/d) assuming d is positive. d(-13/4) Simplify (((b(b(bb*(-7))/bb)/bb)33)(5/7))(-23) assuming b is positive. b(15180/7) Simplify ((u(-13)u)/(uuu/((uu(-3)u)/u)))/((uu(1/3))/((uuu/(u(u/u8)/u))/u)) assuming u is positive. u(-28/3) Simplify (((jj(2/11))/j)(6/11)/(j(((jj(jj(-2))/j)/j)/jj)/j)(-35))(-29/5) assuming j is positive. j(122467/605) Simplify (l(1/7)/l(l/(l/l(-3/8)lll))/l)/(l3/l)17 assuming l is positive. l(-2197/56) Simplify (((l4)(1/7))(-1/2))(-22) assuming l is positive. l(44/7) Simplify ((f/(f*5/f)f*(-4))/((ff/(f*(3/2)f)f)/(ff(-2/5))))(-6) assuming f is positive. f*(207/5) Simplify i((iii(i(i*(-3/2)i)/iii)/iii)/i)/iii/i*(2/3)ii1ii(i/(ii(-4/5)))/iiii assuming i is positive. i(379/30) Simplify (s/s(-5))*(-46)(s(s(-6/7)/s)/s)(-2/35) assuming s is positive. s(-67594/245) Simplify ((ff/(ff21))/ff(-4/9))(2/19) assuming f is positive. f(-386/171) Simplify (q(3/13)/qq(-4/3))/((qqq/(q/(q/q(-19))))/q)45 assuming q is positive. q(-36937/39) Simplify (aa*(1/15))/(((a/(a/(a/(a/((aa*(-11))/a)))))/aaa)/a)aa/(a/((aa*(-9))/a))aaa18 assuming a is positive. a(361/15) Simplify i(-9/2)/(i/i3)(i(4/3)/i)/((i(1/15)ii)/i) assuming i is positive. i(-97/30) Simplify ((j/j(-24)j(8/7))(-32))(-2/21) assuming j is positive. j(3904/49) Simplify ((r*5r)/(rr(-2/29)r))/(r(-2/9))(-35/2) assuming r is positive. r*(47/261) Simplify (((hhh14)/((h/(hhhh(-12)))/h))(1/75))(-2/9) assuming h is positive. h(-14/675) Simplify (((j0)(-19))45)(-13) assuming j is positive. 1 Simplify (j*19j(-16))/(j(-2/37)/j(jj/j(1/14))/j) assuming j is positive. j(1619/518) Simplify (o(-4/19))(-28)/(oo25o/o(-7/6)) assuming o is positive. o(-2539/114) Simplify w*(-9/2)/(ww*(2/11))(w/w(-2/19))(-36) assuming w is positive. w*(-19007/418) Simplify (uuu(-1)uu(-1/6))/(((u/(u(-15)/u))/u)/u(-19)) assuming u is positive. u(-199/6) Simplify ((n6n/n*(-4)n)/(n/(n0/n))(-4/17))(-1/39) assuming n is positive. n(-212/663) Simplify ((d/d5)/(d(-24)/d))/(d*(4/5)((d/(((d*(-13)/d)/d)/dddd))/d)/d) assuming d is positive. d(41/5) Simplify (((h/((h(-3)/hh)/h))/h(-1/10))/((h/(h/(h3/h)))/(h/(hh3))))(8/11) assuming h is positive. h*(4/55) Simplify (tt(2/19))/((t3t)/t)((t/(tt13))/t)/(tt(2/13)) assuming t is positive. t(-4211/247) Simplify (k(1/6))33k(5/7)/(k(-3/13)k) assuming k is positive. k(991/182) Simplify ((h/(h/(h/(h(-11)/h))))/hh)/hh/(h*(-2/25)/h)(h(-1/2))29 assuming h is positive. h*(-21/50) Simplify y/(yy*(5/6))yyy/(y*(-37)y)(y(-3/23))18 assuming y is positive. y(4943/138) Simplify (t(4/5)t)(2/23)/((((((t(-4/7)/t)/tt)/t)/tt)/t)/(tt17t)) assuming t is positive. t(18296/805) Simplify g(-2/73)/g*(-4)(g(-9/4))(1/10) assuming g is positive. g*(10943/2920) Simplify (zz*(7/2)z(5/6))(10/13) assuming z is positive. z*(160/39) Simplify (((pp((ppp(-5)/p)/p)/ppp)13)(-1/11))(-15) assuming p is positive. p(-390/11) Simplify (u(-2/17)/u)(-2/5)(uu(-1/4))(-22) assuming u is positive. u(-2729/170) Simplify (j(-28)j18)/(j(-2/5)jj19) assuming j is positive. j(-148/5) Simplify z*(-5/6)z/((z*5/z)/z)z(zz/(z/z*(1/7)z))/z(-3) assuming z is positive. z(55/42) Simplify (((z*7z)/(zzz*(-2/3)z))/(zz/(zz*(-5/3))z/(z((((((z/z6z)/z)/z)/zz)/z)/z)/z)z))(6/13) assuming z is positive. z(-42/13) Simplify ((t(-1/8)/t(-5/4))/(t0/(t(-1/6)/tt)))(20/7) assuming t is positive. t(115/42) Simplify ((u(2/69)u)/((uuu(-17)/u)/u))/(u(-2/33)/u(2/5)) assuming u is positive. u(70168/3795) Simplify (((cc(-1/5))/c(-4))/(c/(cc/((c(c*	{ "pile_set_name": "DM Mathematics" }
hat is the w'th term of -17053, -17028, -16971, -16870, -16713? 2w3 + 4w*2 - w - 17058 What is the l'th term of 31259222, 31259204, 31259190, 31259180, 31259174, 31259172, 31259174? 2l*2 - 24l + 31259244 What is the p'th term of 1961100, 3921645, 5882190, 7842735, 9803280, 11763825? 1960545p + 555 What is the o'th term of 114262, 228585, 342908, 457231? 114323o - 61 What is the z'th term of 113685142, 227370290, 341055442, 454740598, 568425758, 682110922, 795796090? 2z2 + 113685142z - 2 What is the m'th term of -4647, -8360, -12071, -15780, -19487, -23192, -26895? m*2 - 3716m - 932 What is the w'th term of -2206987, -8827918, -19862789, -35311594, -55174327? w*3 - 2206976w*2 - 10w - 2 What is the d'th term of 114694, 229394, 344092, 458788, 573482? -d*2 + 114703d - 8 What is the s'th term of -778, -3454, -8178, -15166, -24634, -36798? -36s3 - 808s*2 + 66 What is the d'th term of -1544, -3035, -5418, -8693, -12860, -17919? -446d*2 - 153d - 945 What is the t'th term of -294466518, -294466519, -294466520? -t - 294466517 What is the z'th term of -3859, -3896, -3949, -4018, -4103, -4204? -8z2 - 13z - 3838 What is the c'th term of 5915533, 23662135, 53239805, 94648543, 147888349? 5915534c2 - 1 What is the v'th term of -2275, -11989, -28159, -50791, -79891, -115465? -v3 - 3222v*2 - 41v + 989 What is the g'th term of -2021, -3064, -4785, -7184, -10261, -14016, -18449? -339g2 - 26g - 1656 What is the y'th term of -30765455, -30765454, -30765453, -30765452, -30765451, -30765450? y - 30765456 What is the f'th term of -9151951, -18303904, -27455857, -36607810? -9151953f + 2 What is the x'th term of -1166296, -1166298, -1166300, -1166302, -1166304, -1166306? -2x - 1166294 What is the h'th term of 13754, 54892, 123316, 218912, 341566? -19h3 + 13757h*2 + 16 What is the n'th term of -458, -1420, -3058, -5372, -8362, -12028, -16370? -338n*2 + 52n - 172 What is the q'th term of 3066254, 12264982, 27596188, 49059866, 76656010, 110384614, 150245672? -q*3 + 3066245q2 + 10 What is the j'th term of -1156346, -1156337, -1156342, -1156367, -1156418? -j3 - j*2 + 19j - 1156363 What is the w'th term of -3038, -6024, -9042, -12098, -15198, -18348, -21554, -24822? -w*3 - 10w*2 - 2949w - 78 What is the h'th term of 279, 2180, 7321, 17322, 33803, 58384, 92685? 270h3 + 11h - 2 What is the c'th term of -13540, -29068, -44614, -60178, -75760, -91360, -106978? -9c2 - 15501c + 1970 What is the a'th term of 125560, 251202, 376840, 502474, 628104, 753730, 879352? -2a2 + 125648a - 86 What is the r'th term of -76703, -76668, -76613, -76538, -76443? 10r2 + 5r - 76718 What is the q'th term of 3293, 3379, 3519, 3719, 3985, 4323? q*3 + 21q*2 + 16q + 3255 What is the m'th term of -47933, -47427, -46921, -46415, -45909? 506m - 48439 What is the a'th term of 10321795, 10321801, 10321795, 10321771, 10321723? -a3 + 13a + 10321783 What is the w'th term of 70155, 280652, 631483, 1122648, 1754147? 70167w2 - 4w - 8 What is the o'th term of -1590190, -1590244, -1590298, -1590352, -1590406? -54o - 1590136 What is the h'th term of -895, -1951, -3243, -4771, -6535? -118h*2 - 702h - 75 What is the q'th term of 9306, 9382, 9470, 9570? 6q2 + 58q + 9242 What is the s'th term of 2445, 18125, 60263, 142089, 276833, 477725? 2205s3 - s2 + 248s - 7 What is the y'th term of 156598, 156562, 156526, 156490, 156454? -36y + 156634 What is the m'th term of 30693, 61132, 91597, 122100, 152653, 183268? 2m3 + m2 + 30422m + 268 What is the m'th term of -9121, -73584, -248699, -589792, -1152189, -1991216? -9221m*3 + 84m + 16 What is the q'th term of 317266, 317993, 318720? 727q + 316539 What is the a'th term of -29014, -28334, -27654, -26974, -26294? 680a - 29694 What is the q'th term of 166244, 664970, 1496180, 2659874? 166242q2 + 2 What is the b'th term of 32120965, 64241921, 96362877? 32120956b + 9 What is the g'th term of -9780, -18511, -27244, -35979, -44716, -53455? -g*2 - 8728g - 1051 What is the v'th term of 834549, 1669121, 2503689, 3338253, 4172813, 5007369, 5841921? -2v2 + 834578v - 27 What is the w'th term of 3207, 12779, 28743, 51099, 79847? 3196w2 - 16w + 27 What is the u'th term of -1103202960, -1103202961, -1103202962, -1103202963, -1103202964? -u - 1103202959 What is the d'th term of 612562554, 612562553, 612562552, 612562551, 612562550, 612562549? -d + 612562555 What is the r'th term of -13494, -23614, -33734, -43854, -53974, -64094? -10120r - 3374 What is the d'th term of 41280, 82423, 123482, 164457, 205348, 246155? -42d*2 + 41269d + 53 What is the p'th term of -15964, -1859, 12232, 26303, 40348? -p3 - p2 + 14115p - 30077 What is the f'th term of 12942, 19581, 26220, 32859? 6639f + 6303 What is the a'th term of 35, 87, 119, 131, 123, 95? -10a2 + 82a - 37 What is the r'th term of -12936, -49910, -110922, -195972, -305060, -438186, -595350? -12019r2 - 917r What is the j'th term of -60860, -244041, -549552, -977399, -1527588, -2200125? -j*3 - 61159j*2 + 303j - 3 What is the l'th term of -86988, -347226, -780954, -1388166, -2168856, -3123018, -4250646? l*3 - 86751l*2 + 8l - 246 What is the t'th term of -26995, -27011, -27027? -16t - 26979 What is the y'th term of 49785, 49775, 49761, 49743? -2y*2 - 4y + 49791 What is the m'th term of 2105122, 4210247, 6315372, 8420497? 2105125m - 3 What is the v'th term of -567124531, -567124526, -567124519, -567124510? v2 + 2v - 567124534 What is the y'th term of 335, 4, -837, -2440, -5057? -42y3 - 3y*2 - 28y + 408 What is the m'th term of -1362, 2546, 17016, 47334, 98786? 881m3 - 5m*2 - 2244m + 6 What is the j'th term of 4958, 4972, 5010, 5084, 5206, 5388, 5642? 2j3 + 4956 What is the w'th term of -6508141, -13016296, -19524451? -6508155w + 14 What is the u'th term of 431, 749, 1105, 1493, 1907, 2341, 2789? -u*3 + 25u*2 + 250u + 157 What is the z'th term of 44831, 44820, 44805, 44786, 44763? -2z2 - 5z + 44838 What is the r'th term of 22686, 86412, 192624, 341322, 532506? 21243r2 - 3r + 1446 What is the d'th term of -47595, -47493, -47391? 102d - 47697 What is the r'th term of -18736762, -37473524, -56210286? -18736762r What is the o'th term of -415, -3487, -11853, -28171, -55099, -95295? -443o3 + 11o*2 - 4o + 21 What is the a'th term of 381308, 381382, 381454, 381524? -a*2 + 77a + 381232 What is the f'th term of -47500722, -47500725, -47500728? -3f - 47500719 What is the s'th term of 6049, 4609, 3169, 1729? -1440s + 7489 What is the g'th term of 4835, 19399, 43659, 77603, 121219, 174495, 237419, 309979? -2g3 + 4860g*2 - 2g - 21 What is the f'th term of 288, 49, -182, -405? 4f2 - 251f + 535 What is the i'th term of -6654, -38587, -70522, -102459? -i*2 - 31930i + 25277 What is the p'th term of -739703, -1479306, -2218801, -2958188, -3697467? 54p2 - 739765p + 8 What is the n'th term of -24085, -47606, -70555, -92932, -114737, -135970, -156631? 286n2 - 24379n + 8 What is the c'th term of -28954855, -28954857, -28954859, -28954861, -28954863, -28954865? -2c - 28954853 What is the y'th term of -98395, -98433, -98475, -98521, -98571, -98625, -98683? -2y*2 - 32y - 98361 What is the b'th term of -1713216, -6852832, -15418852, -27411276, -42830104, -61675336? -1713202b2 - 10b - 4 What is the n'th term of -573, -1315, -2113, -2967, -3877? -28n2 - 658n + 113 What is the f'th term of 810283, 810264, 810245? -19f + 810302 What is the z'th term of 1594156, 3188274, 4782392, 6376510? 1594118z + 38 What is the d'th term of -18113375, -18113379, -18113383, -18113387, -18113391? -4d - 18113371 What is the c'th term of 7950, 7683, 7240, 6621, 5826, 4855, 3708? -88c*2 - 3c + 8041 What is the k'th term of -195020, -194833, -194520, -194081, -193516? 63k2 - 2k - 195081 What is the i'th term of 3483, 11887, 25899, 45525, 70771, 101643? i*3 + 2798i*2 + 3i + 681 What is the h'th term of 23375, 40996, 52857, 58958, 59299, 53880? -2880h2 + 26261h - 6 What is the n'th term of 30961, 61879, 92709, 123403, 153913, 184191, 214189? -8n3 + 4n*2 + 30962n + 3 What is the l'th term of -831851, -1663711, -2495571? -831860*l + 9 What is the	{ "pile_set_name": "DM Mathematics" }
nding order. 5, 4, -5, -178, -413 Sort 7, 0, -4249 in increasing order. -4249, 0, 7 Sort -96, 1515, 5 in increasing order. -96, 5, 1515 Sort 5, 0.2, 7/8, 159, 5/4 in descending order. 159, 5, 5/4, 7/8, 0.2 Sort 0.2, 4, -0.048805 in decreasing order. 4, 0.2, -0.048805 Put 2, 0.11, 2/87 in ascending order. 2/87, 0.11, 2 Sort 19, -36, -16, 5 in decreasing order. 19, 5, -16, -36 Sort 396, -3, 15, 16. -3, 15, 16, 396 Sort 2/5, 3.41, -3/7, -0.5, -6 in decreasing order. 3.41, 2/5, -3/7, -0.5, -6 Sort 110, -1/3, -628, -2 in descending order. 110, -1/3, -2, -628 Put 0, -3, 2, -22660 in descending order. 2, 0, -3, -22660 Put 2/3, 4, -2/1809, -0.2, 3 in increasing order. -0.2, -2/1809, 2/3, 3, 4 Put -5, 725, -2 in increasing order. -5, -2, 725 Sort 236, -2, -3, 6 in increasing order. -3, -2, 6, 236 Put -1/8, 1/2, 0.04, -27/205 in ascending order. -27/205, -1/8, 0.04, 1/2 Put -1712, 3, 2, -4 in increasing order. -1712, -4, 2, 3 Sort -49, -1, 0, 4, 2 in descending order. 4, 2, 0, -1, -49 Put 1, -168, -20, -6 in ascending order. -168, -20, -6, 1 Sort 0.034, 0.2, -5 in descending order. 0.2, 0.034, -5 Sort 1, -263/3, 2 in ascending order. -263/3, 1, 2 Sort -254, 0, 1/12 in decreasing order. 1/12, 0, -254 Sort 3768, 0, 10 in decreasing order. 3768, 10, 0 Sort -123, -1, 23, 0, -2, -5 in ascending order. -123, -5, -2, -1, 0, 23 Put 0, 452, -17, 3 in decreasing order. 452, 3, 0, -17 Sort -392, -5, 5, -8, -1 in increasing order. -392, -8, -5, -1, 5 Put 9, -473, -16 in decreasing order. 9, -16, -473 Put -2, -14, 0.03, 9, 1, 0 in ascending order. -14, -2, 0, 0.03, 1, 9 Sort 0.45, -53, -3, -0.1, 1.4. -53, -3, -0.1, 0.45, 1.4 Put 5, 1031, 3, 0 in decreasing order. 1031, 5, 3, 0 Sort 3, 40, -51 in ascending order. -51, 3, 40 Put 5, -114, -186, -2 in descending order. 5, -2, -114, -186 Put -4, 82, 0, 103 in decreasing order. 103, 82, 0, -4 Sort 4, -861, -4 in ascending order. -861, -4, 4 Sort -0.3, -975372, -5. -975372, -5, -0.3 Sort -18, -1, -5, 121446 in descending order. 121446, -1, -5, -18 Sort 0.101, -4, -3, -0.26. -4, -3, -0.26, 0.101 Put 0.4, 0.5, 0.53, -4, 1 in descending order. 1, 0.53, 0.5, 0.4, -4 Sort 4050, -3, -4 in descending order. 4050, -3, -4 Put 1, 0.3, 1/4, -0.5, -5, 0.0016 in increasing order. -5, -0.5, 0.0016, 1/4, 0.3, 1 Sort 181, -7, -8, 1 in increasing order. -8, -7, 1, 181 Put -70, 4, 300, -9 in decreasing order. 300, 4, -9, -70 Sort 1, -7, 13563 in descending order. 13563, 1, -7 Sort 5, -1, 4, 8847, 2 in descending order. 8847, 5, 4, 2, -1 Put 3/5, 2.05, -9, 4, -0.5, 6 in descending order. 6, 4, 2.05, 3/5, -0.5, -9 Sort -3, -19, -1, 345, -4, -5 in increasing order. -19, -5, -4, -3, -1, 345 Sort -5, -3, 5, 0, -845, 3 in decreasing order. 5, 3, 0, -3, -5, -845 Sort 709003, -0.3, 2 in descending order. 709003, 2, -0.3 Sort -11, 25500, 5 in ascending order. -11, 5, 25500 Sort 1, -3, -9, -1, 11.2 in descending order. 11.2, 1, -1, -3, -9 Put -2, 250067, 3 in descending order. 250067, 3, -2 Put -84, 0, 60, -2, -9 in ascending order. -84, -9, -2, 0, 60 Put 0, -1, 64, -41 in increasing order. -41, -1, 0, 64 Sort 2/3, -52, -1/65 in decreasing order. 2/3, -1/65, -52 Sort -1, -11, -46021. -46021, -11, -1 Put 2/5, -0.52, -1/2, -0.46 in descending order. 2/5, -0.46, -1/2, -0.52 Sort 92, -12, 130. -12, 92, 130 Put -0.2, -2.586, -0.1 in ascending order. -2.586, -0.2, -0.1 Put -0.4, 1, -1, 0, -5202 in decreasing order. 1, 0, -0.4, -1, -5202 Sort -2257, -1/2, -2, -0.1, 0.11 in increasing order. -2257, -2, -1/2, -0.1, 0.11 Put 2, 3, -4, 3/2, -16/41, 1.8 in descending order. 3, 2, 1.8, 3/2, -16/41, -4 Sort -3, 186/13, -2/3, 2, -0.2, -4 in decreasing order. 186/13, 2, -0.2, -2/3, -3, -4 Sort 35, -0.45, -3, 1/14, -14 in increasing order. -14, -3, -0.45, 1/14, 35 Put -37, -0.111, -0.1, -0.08 in ascending order. -37, -0.111, -0.1, -0.08 Sort 1/4, -0.4, 1, 3/16, 22 in decreasing order. 22, 1, 1/4, 3/16, -0.4 Sort 19, -10/111, 3/8, 0.2 in descending order. 19, 3/8, 0.2, -10/111 Put 44, -1, 0, -35, -6, 5 in descending order. 44, 5, 0, -1, -6, -35 Sort -12, 5/7, 13, -0.4, 2 in increasing order. -12, -0.4, 5/7, 2, 13 Put -4, 5, 5358, -1 in decreasing order. 5358, 5, -1, -4 Sort -12, 4, 2, 75 in increasing order. -12, 2, 4, 75 Put -1/5, -2, 1/3, -7, 3, 0.3 in ascending order. -7, -2, -1/5, 0.3, 1/3, 3 Sort -7/2, 0.5, 0.1, 11, 1/45. -7/2, 1/45, 0.1, 0.5, 11 Put -29, -0.3, 0, 1 in decreasing order. 1, 0, -0.3, -29 Sort -37, -4, 2, -99 in descending order. 2, -4, -37, -99 Sort 0, 7, -15, 20, 5. -15, 0, 5, 7, 20 Sort -0.06, -1/6, -3, 0.6, -26 in descending order. 0.6, -0.06, -1/6, -3, -26 Put 0.6, -1, 19, -0.4, -0.3 in increasing order. -1, -0.4, -0.3, 0.6, 19 Put 27, -2, 181, 2, 0, 4 in ascending order. -2, 0, 2, 4, 27, 181 Sort 23155, 14, 4 in decreasing order. 23155, 14, 4 Sort -4, 1, 4, -31, 3 in ascending order. -31, -4, 1, 3, 4 Put 3, 5, -2, -380, -5, 2 in increasing order. -380, -5, -2, 2, 3, 5 Sort 5, 10697, 1 in descending order. 10697, 5, 1 Put -2, 4860, 14 in increasing order. -2, 14, 4860 Sort -9820, -2, 0 in descending order. 0, -2, -9820 Put 19878, -3, 0 in descending order. 19878, 0, -3 Put -179, -272, 0 in decreasing order. 0, -179, -272 Put 2/17, -3, -1868, 1/2, 4 in descending order. 4, 1/2, 2/17, -3, -1868 Put -699, -5, 4 in decreasing order. 4, -5, -699 Put -4, 4, 3, 14, -2 in increasing order. -4, -2, 3, 4, 14 Put -10, -2, 0, -3, 1, 48 in ascending order. -10, -3, -2, 0, 1, 48 Sort -7, -8, 5208. -8, -7, 5208 Sort 4, -57, -70. -70, -57, 4 Put 447, 0.5, 11, -4, 1/3 in ascending order. -4, 1/3, 0.5, 11, 447 Put -36, 0, -1911, 5 in decreasing order. 5, 0, -36, -1911 Sort -1515/4, 1, -2/5 in descending order. 1, -2/5, -1515/4 Sort 12, -82.14, -10 in descending order. 12, -10, -82.14 Sort -3, -1, 1094, 4 in decreasing order. 1094, 4, -1, -3 Sort -1, 23073, -98 in increasing order. -98, -1, 23073 Put -12, 13794, -4 in descending order. 13794, -4, -12 Put 2/3, 26385, -1, -3/7 in decreasing order. 26385, 2/3, -3/7, -1 Put 4160, 6, 3, -3 in descending order. 4160, 6, 3, -3 Sort -2, -13, -5, -60, 2, -30. -60, -30, -13, -5, -2, 2 Sort 9/160, 26, 2, -3/8, 0 in increasing order. -3/8, 0, 9/160, 2, 26 Put -5, 5/3, -4, 2, 329 in ascending order. -5, -4, 5/3, 2, 329 Put 20, -5, 1463, -2, -3, 2 in ascending order. -5, -3, -2, 2, 20, 1463 Sort 0.05, 2, 0.3, -2/3, 5606. -2/3, 0.05, 0.3, 2, 5606 Put 2/13, -249, 0.7 in ascending order. -249, 2/13, 0.7 Sort 3, 6, 4, -0.1, 0. -0.1, 0, 3, 4, 6 Put 15, -10, 3, 292 in decreasing order. 292, 15, 3, -10 Put 0, -142526, -2 in descending order. 0, -2, -142526 Sort 11, 3, 0, 1, -19 in increasing order. -19, 0, 1, 3, 11 Sort -497, 8, 5.7 in increasing order. -497, 5.7, 8 Sort 3, 5, -68, -7, 9 in descending order. 9, 5, 3, -7, -68 Put 7, 3586, 5 in decreasing order. 3586, 7, 5 Sort -4, 54, -3, 2, -1, 657 in ascending order. -4, -3, -1, 2, 54, 657 Put 3, 0, -354 in ascending order. -354, 0, 3 Put -2, 7, -32, -59 in ascending order. -59, -32, -2, 7 Sort 4, 2/3, -6, 98, 5, 139 in ascending order. -6, 2/3, 4, 5, 98, 139 Put 1, -3, -1/2, -0.028, 3/5, 219 in increasing order. -3, -1/2, -0.028, 3/5, 1, 219 Sort -2/15, -5, 1, 3/5, -19, -2/39. -19, -5, -2/15, -2/39, 3/5, 1 Sort 5, 207, 587 in increasing order. 5, 207, 587 Put 0, -7, -5, 40170 in ascending order. -7, -5, 0, 40170 Sort 0.5, -6, 10.6, 2, 4. -6, 0.5, 2, 4, 10.6 Sort 0, -1, -7, 5, -19 in increasing order. -19, -7, -1, 0, 5 Sort -3, 0.1, -0.4, -619, 0, 5 in descending order. 5, 0.1, 0, -0.4, -3, -619 Put -1, 1410, -89 in decreasing order. 1410, -1, -89 Put 4, 8, -113 in increasing order. -113, 4, 8 Sort 2, -4, 2/9, -13.41, -0.1 in decreasing order. 2, 2/9, -0.1, -4, -13.41 Put 1, 8, -0.152, -38 in increasing order. -38, -0.152, 1, 8 Put 3, 119, 0, 14, -10 in descending order. 119, 14, 3, 0, -10 Sort 161, 1, -13, -1/4, -2/9, -3 in descending order. 161, 1, -2/9, -1/4, -3, -13 Sort -4, -3, -5, 2117. -5, -4, -3, 2117 Sort 5, -1, -4563 in decreasing order. 5, -1, -4563 Sort -0.2, -1.6, 2, 323 in decreasing order. 323, 2, -0.2, -1.6 Put -10, 16, 1, -13, 9 in descending order. 16, 9, 1, -10, -13 Put 5, -6, -5, -4, -2, -14 in descending order. 5, -2, -4, -5, -6, -14 Sort 5, -2, -9, 482 in decreasing order. 482, 5, -2, -9 Put 3, -173.4, 3.82 in ascending order. -173.4, 3, 3.82 Put 108, -2,	{ "pile_set_name": "DM Mathematics" }
+ 62208/5 = 0. -36, 4 Factor -3r2 + 75r - 138. -3(r - 23)(r - 2) Find t, given that -5t2 + 755t + 760 = 0. -1, 152 Suppose 5a4 + 565a*3 + 2200a*2 + 2180a = 0. What is a? -109, -2, 0 Solve -21g2/2 - 89g/2 + 16 = 0. -32/7, 1/3 Factor 3j2/4 + 1419j/4. 3j(j + 473)/4 Factor -4f2 + 16f - 12. -4(f - 3)(f - 1) Determine k, given that -2k5 + 6k*4 + 22k*3 - 6k*2 - 20k = 0. -2, -1, 0, 1, 5 Find q such that 3q3 - 33q*2 = 0. 0, 11 Let -2o*4/9 + 8o*3/3 + 2o*2/3 - 68o/9 - 16/3 = 0. Calculate o. -1, 2, 12 Factor m*5/2 + 3m*4 - 3m*3/2 - 8m*2 + 6m. m(m - 1)2(m + 2)(m + 6)/2 Factor -2k*2/9 - 4k/9. -2k(k + 2)/9 Factor -j*2/2 + 5j/6 + 11/3. -(j + 2)(3j - 11)/6 Solve 3h3 - 2028h*2 + 344751h - 681414 = 0 for h. 2, 337 Factor -u*3 + 22u*2 + 116u - 312. -(u - 26)(u - 2)(u + 6) Find k such that -10k4/7 + 362k*3/7 - 1026k*2/7 + 1006k/7 - 332/7 = 0. 1, 166/5 Determine m so that -5m4 - 1550m*3 - 120125m*2 = 0. -155, 0 Factor 5f*4 + 90f*3 + 385f*2. 5f*2(f + 7)(f + 11) Find v, given that v5/3 - 2v4 - v3/3 + 2v2 = 0. -1, 0, 1, 6 Solve -16h*5 - 232h*4 + 791h*3 + 1825h*2 - 1046h + 136 = 0. -17, -2, 1/4, 4 Factor z*2 - 3z + 2. (z - 2)(z - 1) Factor -r2/2 + 2r + 5/2. -(r - 5)(r + 1)/2 Determine d, given that -4d*3 - 596d*2 - 2336d - 2320 = 0. -145, -2 Find d, given that 69d4/4 - 489d*3/4 + 525d*2/4 + 993d/4 - 45/2 = 0. -1, 2/23, 3, 5 Factor 4o3 + 144o*2 - 2748o + 2600. 4(o - 13)(o - 1)(o + 50) Factor v2/2 - 25v + 48. (v - 48)(v - 2)/2 Suppose -3v*5 - 21v*4 - 15v*3 + 21v*2 + 18v = 0. What is v? -6, -1, 0, 1 Let -3r5/4 - 69r*4/4 + 159r*3/4 + 225r*2/4 = 0. What is r? -25, -1, 0, 3 Solve -5k*2 - 105k = 0 for k. -21, 0 Factor -2m2 + 994m + 996. -2(m - 498)(m + 1) Solve 12g4/5 - 28g*3 + 508g*2/5 - 116g + 40 = 0. 2/3, 1, 5 Factor 4t3 + 104t*2 - 464t + 480. 4(t - 2)2(t + 30) Let 7h5/4 - 27h*4/4 - 23h*3/2 + 11h*2/2 + 39h/4 + 5/4 = 0. Calculate h. -1, -1/7, 1, 5 What is j in -10j3 - 88j*2 + 118j - 20 = 0? -10, 1/5, 1 Factor g*2/5 + 3866g/5 + 3736489/5. (g + 1933)2/5 Suppose -t5 - 13t4 - 23t*3 - 11t*2 = 0. Calculate t. -11, -1, 0 Suppose -2g*2/7 + 372g/7 + 374/7 = 0. Calculate g. -1, 187 Factor 8o2/5 + 769o/5 + 96/5. (o + 96)(8o + 1)/5 What is y in -4y3 - 80y*2 + 176y = 0? -22, 0, 2 Factor 4u3 + 56u*2 - 11040u. 4u(u - 46)(u + 60) Suppose 4w*4/5 + 100w*3 - 1012w*2/5 + 508w/5 = 0. Calculate w. -127, 0, 1 Factor -2x2 + 278x - 276. -2(x - 138)(x - 1) Let b*5/4 - 3b3/4 - b2/2 = 0. What is b? -1, 0, 2 Find b such that 12b4 - 308b*3 + 2216b*2 - 3072b + 1152 = 0. 2/3, 1, 12 Factor -4x3 - 988x*2 - 3904x - 3888. -4(x + 2)2(x + 243) Let 4p4/5 - 142p*3/5 - 316p*2/5 + 568p/5 + 240 = 0. Calculate p. -2, 2, 75/2 Solve -2o5/3 + 2o*4 + 26o*3/3 - 34o*2 + 24o = 0. -4, 0, 1, 3 Factor 4h2 - 381h + 95. (h - 95)(4h - 1) Find r, given that -r*4/2 + 9r*3 - 73r*2/2 + 54r - 26 = 0. 1, 2, 13 Factor -9z4/4 + 17z*3/2 - 19z*2/4 - 3z/2. -z(z - 3)(z - 1)(9z + 2)/4 Factor -v*2 + 37v + 38. -(v - 38)(v + 1) Suppose 2z*4 - 4528z*3/3 - 18136z*2/9 - 672z = 0. What is z? -2/3, 0, 756 Factor i*3/7 - 19i*2/7 + 18i/7. i(i - 18)(i - 1)/7 Let -45i5 + 195i*4 + 70i*3 - 660i*2 + 600i - 160 = 0. Calculate i. -2, 2/3, 1, 4 Suppose -55d4 - 100d*3 - 35d*2 + 10d = 0. Calculate d. -1, 0, 2/11 Factor 12b5/7 - 3b*4 + 6b*3/7 + 3b*2/7. 3b*2(b - 1)*2(4b + 1)/7 Factor -i3/2 + 24i*2 + 216i + 448. -(i - 56)(i + 4)2/2 Factor -2n*2/5 + 8n - 102/5. -2(n - 17)(n - 3)/5 Solve -10a4 - 64a*3 - 74a*2 - 20a = 0. -5, -1, -2/5, 0 Factor 2j4 - 80j*3 + 1100j*2 - 6000j + 11250. 2(j - 15)2(j - 5)*2 Factor 2a*2 + 58a + 56. 2(a + 1)(a + 28) Let 12j4/7 + 123j*3/7 - 594j*2/7 + 516j/7 + 24 = 0. Calculate j. -14, -1/4, 2 Solve -2n2/3 - 148n/3 - 1856/3 = 0. -58, -16 Solve -n*2 - 424n - 44944 = 0. -212 Factor 2n5/3 - 40n*4/3 + 52n*3 + 440n*2/3 + 242n/3. 2n(n - 11)*2(n + 1)2/3 Factor -r5/4 - 5r4/4 - 2r3 - r2. -r*2(r + 1)(r + 2)2/4 Find k such that -2k*2/15 - 12k/5 = 0. -18, 0 Factor -98j3 + 28j*2 - 2j. -2j(7j - 1)2 Let g2/2 + 7g - 15/2 = 0. What is g? -15, 1 Let -b*3 + 106b*2 + 436b + 440 = 0. What is b? -2, 110 Factor -a*3 + 468a*2 + 469a. -a(a - 469)(a + 1) Solve 9s3/5 + 15s*2 - 54s/5 = 0 for s. -9, 0, 2/3 Factor -2q2/3 + 20q/3 - 50/3. -2(q - 5)2/3 Solve -3d*2/7 - 1896d/7 - 299568/7 = 0. -316 Suppose -5t4 - 90t*3 + 115t*2 + 4680t - 13520 = 0. Calculate t. -13, 4 Factor -2y2/13 - 830y/13 + 64. -2(y - 1)(y + 416)/13 Let -5w5 + 75w*3 - 50w*2 - 120w = 0. What is w? -4, -1, 0, 2, 3 Solve -8h3 + 268h*2 + 732h - 432 = 0. -3, 1/2, 36 Determine v so that -3v5 - 13v*4 + 6v*3 + 48v*2 + 32v = 0. -4, -4/3, -1, 0, 2 What is k in -5k4 + 20k*3 - 10k*2 - 20k + 15 = 0? -1, 1, 3 Factor -3k4 + 3k*3 + 36k*2 + 12k - 48. -3(k - 4)(k - 1)(k + 2)2 Factor t2/11 - 494t + 671099. (t - 2717)*2/11 Factor 4x*3 + 1308x*2 + 103584x - 551120. 4(x - 5)(x + 166)*2 Let 2w*2/3 + 10w/3 + 8/3 = 0. Calculate w. -4, -1 Solve -2w2/23 + 1060w/23 - 140450/23 = 0. 265 Solve -16l4/3 + 204l*3 + 156l2 = 0 for l. -3/4, 0, 39 Solve -b4/3 + 176b3/3 - 2460b*2 - 10800b = 0 for b. -4, 0, 90 Factor -m*5 - 6m*4 - 8m*3 + 6m*2 + 9m. -m(m - 1)(m + 1)(m + 3)2 Factor -h3 - 3h*2 + 33h + 35. -(h - 5)(h + 1)(h + 7) Find m, given that 5m5 - 75m*4 + 195m*3 - 185m*2 + 60m = 0. 0, 1, 12 Factor -3u2/5 - 36u - 300. -3(u + 10)(u + 50)/5 Factor 3d2 + 162d + 459. 3(d + 3)(d + 51) Determine z so that 96z5 - 536z*4 + 964z*3 - 496z*2 - 112z = 0. -1/6, 0, 7/4, 2 Determine a, given that 2a5/7 + 12a*4/7 + 10a*3/7 = 0. -5, -1, 0 Determine n so that -28n*5 + 356n*4 + 1364n*3 + 1676n*2 + 824n + 128 = 0. -1, -2/7, 16 Factor o*5/5 + 552o*4/5 - 2776o*3/5 + 5006o*2/5 - 3897o/5 + 1114/5. (o - 2)(o - 1)3(o + 557)/5 What is c in -4c4 - 8c*3 + 4c*2 + 8c = 0? -2, -1, 0, 1 Suppose 3y4 - 36y*3 - 180y*2 - 192y = 0. What is y? -2, 0, 16 Factor -2k2/3 + 902k/3 - 1192. -2(k - 447)(k - 4)/3 Factor -u*4/2 + 38u*3 + 77u2/2. -u2(u - 77)(u + 1)/2 Determine g so that -2g3/9 + 50g*2/3 + 3164g/9 - 368 = 0. -18, 1, 92 Factor -2r2/7 + 60r/7. -2r(r - 30)/7 Factor 3r4 - 258r*3 + 5280r*2 + 11616r. 3r(r - 44)*2(r + 2) Factor 2j4/23 - 134j*3/23 - 204j*2/23 + 164152j/23 - 2751280/23. 2(j - 34)3(j + 35)/23 What is o in 5o2 + 1240o - 2500 = 0? -250, 2 Factor -1069156t2/9 + 8272t - 144. -4(517t - 18)*2/9 Find g such that -4g*3/5 + 144g*2/5 - 228g - 2888/5 = 0. -2, 19 Find m such that 2m2 + 16m - 18 = 0. -9, 1 Find l such that -3l3/5 - 3l*2 - 18l/5 = 0. -3, -2, 0 Let t*3 - 301t*2 + 23095t - 66603 = 0. What is t? 3, 149 Let -2i4/3 - 2i*3 - 2i*2/3 + 2i + 4/3 = 0. What is i? -2, -1, 1 Factor 33a3 + 306a*2 + 705a. 3a(a + 5)(11a + 47) Factor 128h3 + 378h*2 + 238h - 12. 2(h + 1)(h + 2)(64h - 3) Let -t*2 - 4t + 5 = 0. What is t? -5, 1 Determine l, given that -3l4 - 27l*3 - 45l*2 + 75l = 0. -5, 0, 1 Let -2m5/7 - 222m*4/7 - 214m*3/7 + 662m*2/7 + 216m/7 - 440/7 = 0. What is m? -110, -2, -1, 1 Solve 20i2/3 + 16i/3 - 256/3 = 0. -4, 16/5 Factor 60v4 - 2875v*3 - 965v*2. 5v*2(3v + 1)(4v - 193) Factor -b4 + 7b*3 - 18b*2 + 20b - 8. -(b - 2)*3(b - 1) What is i in 4i3 + 344i*2 + 5164i + 4824 = 0? -67, -18, -1 Suppose -3y2 + 3y + 216 = 0. What is y? -8, 9 Factor -2y2 - 1160y - 3462. -2(y + 3)(y + 577) What is d in 9d4/7 - 78d*3/7 - 5d*2 + 68d/7 + 36/7 = 0? -2/3, 1, 9 Determine a, given that -a*3/4 + 6a*2 = 0. 0, 24 Factor -3g*4 + 66g*3 - 63g*2. -3g*2(g - 21)(g - 1) Factor -l2 + 165l + 166. -(l - 166)(l + 1) Suppose 2x*3/7 - 76x*2 + 5054x = 0. Calculate x. 0, 133 What is t in -4t5/3 + 136t*4/3 + 8t**3/3	{ "pile_set_name": "DM Mathematics" }
+ 89z + 8. Let q be k(-45). Calculate the greatest common divisor of q and 53. 53 Let t(o) = 3o*2 - 22o - 333. Let b be t(-15). What is the greatest common factor of 546 and b? 42 Let o = 331 - 326. Suppose -g = -26d + 21d - 53, -og - 5d = -115. Let t be (1 + 3)21/6. What is the highest common divisor of t and g? 14 Suppose -75t + 8t + 77280 = 3t. Calculate the highest common factor of 1242 and t. 138 Suppose 9z - 6z + 754 = 4n, 0 = 5n - 5z - 945. Let v = 257 + n. Calculate the greatest common divisor of v and 12. 12 Suppose o - 5 = 0, -m + o - 223 = -252. Calculate the greatest common divisor of m and 7242. 34 Suppose -3v + 2813 = -5d, v - 679 = -2d + 255. What is the greatest common divisor of 99 and v? 9 Let d = 5462 + -5150. What is the greatest common factor of 96 and d? 24 Let q(h) = 42h + 598. Let c be q(-13). Calculate the highest common factor of c and 1157. 13 Suppose -102x - 5x = -11984. What is the greatest common divisor of 64 and x? 16 Suppose -3q = -g - 80, 0 = 79q - 80q + 2g + 25. Calculate the greatest common divisor of q and 459. 27 Let t be (1188/(-30))/(6/(-285)). What is the highest common factor of 1026 and t? 171 Let k(h) = 20h*3 - 2h*2 + 14h - 13. Let x be k(1). What is the greatest common factor of x and 304? 19 Let i = 7579 - 7569. Calculate the highest common divisor of 1810 and i. 10 Let z(p) = -7p2 + 28p + 70. Let l(m) = 13m2 - 55m - 140. Let a(o) = 6l(o) + 11z(o). Let r be a(28). What is the highest common factor of r and 7? 7 Let r be 0 - (8 - 10)(-3)/6. Let d be (-3)/(-3)r - (-159 - -33). What is the highest common factor of 50 and d? 25 Let x be -1 + -15(-1 + 0). Suppose 392s - 112s = 560. Calculate the highest common factor of s and x. 2 Suppose -61z + 14850 = -50z. What is the greatest common factor of 1050 and z? 150 Let b(j) = 2j*2 + 7j + 1. Let i be b(-5). Suppose 0 = 3a - i - 164. Let p = -16 + a. Calculate the greatest common factor of 484 and p. 44 Let v(r) = 181r + 155. Let p be v(0). Let j be (186/(-15))/((-1)/5). Calculate the highest common factor of j and p. 31 Let x(v) = -v*2 + 25v - 16. Let p(i) = -3i + 149. Let c be p(43). Let w be x(c). Calculate the highest common divisor of w and 378. 42 Let u(x) = -x3 - 33x*2 + 35x + 112. Let k be u(-34). Let a be (-9)/(-18)(0 - -234). Calculate the highest common factor of a and k. 39 Let v be 40/(-180) + (-12)/(-54) - -69. Suppose 4r - 27 = -3. Let h be ((-207)/(-6))/(r/8). Calculate the highest common factor of h and v. 23 Let u(x) = 7x3 + 3x - 2. Let c be u(3). Let f = 1699 - 1559. Calculate the greatest common divisor of c and f. 28 Suppose -57511 + 183155 = 311u. Calculate the highest common divisor of u and 3434. 202 Let q(u) = 806u*3 + 9u*2 - 34u + 9. Let a be q(3). Calculate the highest common divisor of a and 60. 30 Suppose 0 = 14t - 10t + 184. Let f = t + 76. Suppose -14q = -17q + f. What is the greatest common divisor of q and 25? 5 Let j be (-552)/(-14) + (-12)/(-21). Let f = j - 13. Let m = f + -24. Calculate the greatest common factor of m and 1. 1 Suppose -24g = -16g - 504. Let w be (-1)/(-2 - 15/(-10))18. What is the greatest common divisor of g and w? 9 Suppose 0 = s - 1 + 3. Suppose 2i = 2a + 32, -4a + 8i - 3i = 68. Let d be ((-222)/a)/(s/(-4)). What is the highest common divisor of d and 185? 37 Let p = 54 - 38. Let g = -4 + 34. Let d = g - 26. What is the greatest common factor of p and d? 4 Let c(s) = s*2 - 17s - 17. Suppose -19 = 2r - 3r. Let g be c(r). Suppose -f = -10 - g. Calculate the greatest common factor of f and 248. 31 Let l(h) = -12h3 - 23h*2 - 73h - 12. Let b be l(-4). What is the highest common divisor of 952 and b? 136 Let v(w) = -38w + 316. Let g be v(8). Let u(r) = r2 - 4r - 9. Let k be u(-11). What is the highest common factor of g and k? 12 Suppose -9c - 16327 + 26121 = -49174. What is the greatest common factor of 189 and c? 63 Suppose -5m - 25 = -25. Let b(x) = -x*2 - 2x + 99. Let q be b(m). What is the highest common factor of q and 22? 11 Suppose 74v + 81v = 158v - 36. What is the highest common divisor of 2060 and v? 4 Let u(s) = 2s*2 + 9s - 9. Let c be u(-7). Let w(i) = -27i - 24 + 17i - i*2 + c. Let b be w(-10). Calculate the greatest common factor of b and 4. 2 Suppose 0 = -14i + 28i + 42. Let l = i + 19. What is the highest common factor of 4 and l? 4 Let n = -2546 + 3768. What is the highest common factor of n and 26? 26 Let q(s) = 683s3 - s2 + 41s - 83. Let t be q(2). Calculate the highest common divisor of t and 206. 103 Suppose -27k + 132441 = -60252 + 31287. What is the greatest common divisor of 122 and k? 122 Let m = -5168 - -5864. What is the greatest common factor of 1102 and m? 58 Let f = 17909 - 16856. Suppose o - 2 = 79. What is the greatest common divisor of f and o? 81 Suppose -7a + 70 - 49 = 0. Let i be 1 + -6 - (a - (14 - 2)). Suppose -5b + 32 + 18 = 0. What is the greatest common factor of b and i? 2 Let a(g) = 16g2 - 158g + 1232. Let o be a(8). Calculate the greatest common factor of 7688 and o. 248 Let a(b) = b*2 - 46b + 876. Let t be a(77). Calculate the highest common factor of t and 52. 13 Let c(i) = 3i3 + i + 4. Let u be c(2). Suppose -ul - 110 = -35l. Calculate the highest common divisor of 176 and l. 22 Suppose 333m = 166m + 163m + 96. What is the highest common factor of 2136 and m? 24 Let j = -45 - -75. Suppose 111 = v + 3v + b, 2v = 4b + 60. Suppose v = 2n + x - 3x, 3x + 18 = n. What is the highest common divisor of j and n? 6 Let n be (5/10)/((-8)/192). Let t be n/4 - 5/(-1). Let v(h) = -h + 8. Let d be v(0). What is the highest common factor of d and t? 2 Let n = 2440 + -976. What is the greatest common factor of 8 and n? 8 Let h = 24 - 12. Suppose 4g = -3g - 231. Let z = -27 - g. What is the greatest common divisor of z and h? 6 Let j = 9588 + -9324. Suppose y - 25 = -1. Calculate the greatest common factor of y and j. 24 Let v(a) = a*3 - 5a*2 + 2a - 13. Suppose -7h = -4h - 18. Let z be v(h). Suppose 16j - 192 = 32. What is the greatest common divisor of j and z? 7 Let j be -13 + 368/28 - 82/(-14). Let f = 292 + -190. What is the highest common factor of j and f? 6 Let x = -40150 + 40152. Suppose -2f + 4q + 3 = f, -5q = 0. Suppose u = -a, 0u - f = -2u - a. What is the highest common factor of x and u? 1 Let v be 8/32 + 14/8. Suppose 6c - 4c - v = 0. Let i(q) = 7q2 - 8q + 7. Let w be i(c). Calculate the highest common factor of w and 12. 6 Let y(s) = 11s + 53. Let w be y(-5). Let b be 22 + w + 8 + -4 - 2. What is the highest common divisor of b and 55? 11 Suppose 4g + 2v = -450, -14v = -5g - 18v - 567. Let s be 6/(660/g - -6). What is the greatest common factor of s and 148? 37 Let s = -135 - -147. Let j be (1 - (0 + 1))/(-1). Suppose j = o + 5h - 13, -o + 2h = 2 - 1. What is the highest common factor of o and s? 3 Suppose -2t - 5x = -89, 3t + 4x - 9x = 146. Suppose 5 = -7u + t. Suppose uz = 3z + 504. Calculate the greatest common factor of z and 21. 21 Suppose m = -3s + 11, 3m - 4m + 36 = -2s. Let f = 26 - m. Let k be 0 - (f - 4) - -3. What is the greatest common divisor of 77 and k? 7 Let h(v) = v*2 + 33v + 227. Let a be h(-9). What is the highest common divisor of a and 880? 11 Suppose 2h - 3c - c = 0, 3h - c = 10. Let p be (-3)/12 + 129/h. Let y be -1 + (4 - p) - -19. What is the highest common factor of y and 6? 3 Suppose 7l - 13l + 18l = 4224. What is the highest common divisor of 1888 and l? 32 Let s(m) = 2m*2 - 19m - 25. Let p be s(16). Suppose -4k + 4t + 252 = -0k, 2k = 3t + 128. What is the highest common factor of p and k? 61 Let d = 192 - 104. Let n(f) = -5f + 19. Let p be n(-5). Suppose -2x + p = 2x. What is the greatest common factor of x and d? 11 Let w(p) = p*3 - 6p*2 + 31p - 334. Let f be w(8). What is the greatest common factor of 19950 and f? 42 Let n be ((-650)/39 + 2/(-6))(1 - 8). Calculate the highest common divisor of 7 and n. 7 Let n(c) = 6c*2 + 101c + 114. Let a be n(-18). Calculate the highest common divisor of 10 and a. 10 Let k be 2/2 - (-7)/(6 + -13). Let u be 1 + k + -16 + 57. Let m be 333/7 + ((-108)/u - -3). What is the highest common f	{ "pile_set_name": "DM Mathematics" }
mmon denominator of c and -49/195. 390 Let x = -4752/5 - -958. Calculate the common denominator of x and 1/2 - (-549)/(-27). 30 Let d(c) = -c*3 - 4c*2 + 3c - 11. Let k be d(-5). What is the lowest common multiple of 39 and (1/1)/(k/(-28 - -1))? 351 Let q = -45299/10 - -4524. Let z(p) = -p*3 + 16p*2 - 64p. Let d(j) = 12j - 111. Let n be d(10). Calculate the common denominator of q and z(n). 10 Let m(h) = 8h - 28 + 0h3 + 5h*2 + 22h*2 + 4h*3 - 3h*3. Calculate the lowest common multiple of 4 and m(-25). 2044 Let r = 11708 + -257525/22. What is the common denominator of -51/22 and r? 22 What is the common denominator of (-108)/(-9) + 2540/(-400) and 19/1784? 8920 Let j be 10/25 + 107154/(-87440). Let a = j + 1/2186. Find the common denominator of a and -41/6. 120 Let f = 62969 - 37379. What is the smallest common multiple of f and 8? 102360 Let v = 887/4 + -238. Suppose 0 = 42s - 31s + 451. Calculate the common denominator of v and ((-12)/(-8))/((-9)/s). 12 Suppose 3w + 642 = k, 10 = 3w + 4. Suppose 0 = 3g - 12, 2y + 38 = -y - g. What is the smallest common multiple of y/4k/(-126) and 24? 72 Suppose -3c + 7c = -x + 132, -255 = -2x - 5c. Calculate the least common multiple of 320 and x. 960 Suppose 35 = 10x - 95. Let m(v) = v2 - 9v - 23. Let n be m(12). Suppose -nf - 8 = -34. Calculate the lowest common multiple of f and x. 26 Let z(o) = -o3 - 11o*2 + 14o - 11. Let h be z(-12). Let u = -41 - h. What is the common denominator of u/60(0 + 63) and 31/20? 20 Let d(c) = -45c3 - c2 - 4c - 4. Calculate the least common multiple of 40 and d(-2). 360 Suppose o - 7o + 228 = 0. Suppose 30q - oq = -112. Calculate the least common multiple of q and 22. 154 Let u = 3 + 0. Find the common denominator of 107/48 and u - (3535/882 + 9/(-21)). 1008 Let i(x) be the third derivative of x5/15 - x4/12 + x*3/3 + 44x*2. Let g be i(2). What is the least common multiple of 8/(-10)(-735)/g and 3? 42 What is the common denominator of ((-2)/(-5))/(((-510)/(-425))/((-97)/24)) and 35/152? 1368 Let i be (-10)/(-35) - 180/(-7). Suppose 0 = 5c, -5w - c - 64 = i. What is the common denominator of (-1595)/(-150) - 12/w and 99/8? 40 Suppose 4m + 2526 = -5c + 7201, 0 = 4c - m - 3761. Calculate the smallest common multiple of c and 2817. 2817 Let t = 68501 + -114054151/1665. Calculate the common denominator of 123/740 and t. 6660 Let w(z) = -z3 - 47z*2 + 7z + 55. Let m be w(-20). Let u = -587711/54 - m. What is the common denominator of 44/57 and u? 1026 Let w be 6/8 - (-4049)/(-1080). Let l = -193/54 - w. Let z = 6391 + -255597/40. Calculate the common denominator of z and l. 40 Let p = 2/9691 - -610513/96910. Let z be (2 + -1)-1 + 2. What is the common denominator of p and z + ((-208)/(-14))/2? 70 Let x = -1021 + 1004. Let h be (-372)/8 - (-2)/(-1). Let t = h - x. Find the common denominator of -151/12 and t. 12 Suppose -1699 = -78y + 860 - 687. Calculate the least common multiple of 1182 and y. 4728 Suppose 108 = 239t - 257t. Let z(c) = c*3 + 3c*2 - 6c + 2. Let s be z(-5). What is the least common multiple of t/(-9) + (-2112)/s and 10? 590 What is the common denominator of (4/528)/(1 + (24565/1450)/(-17)) and 70/171? 3762 What is the common denominator of (3/9)/((-128)/474) and -9 + 3 + (0 - 37/2)? 64 Suppose 577 - 297 = 4c. Suppose 6y - 134 - 76 = 0. What is the lowest common multiple of c and y? 70 Suppose -11t = -12t + 302. Let g = -293 + t. Let j = 20 - 12. What is the smallest common multiple of j and g? 72 Suppose 1119 = -13s + 1704. What is the least common multiple of 1233 and s? 6165 Let t(n) = 40n*2 - 951n + 3788. What is the smallest common multiple of t(4) and 104? 624 Let n = -18693545/176 - -106213. What is the common denominator of -41/1936 and n? 1936 Let j = 4004965/24 + -166869. What is the common denominator of (-636)/(-1215) + 4/(-10) and j? 648 Suppose 9o = 541 - 2395. Let j = -192 - o. What is the lowest common multiple of j and (-87)/(-9) + (-1)/(-3)? 70 Let i = -16 - -58. Let o be 93/2(-14)/(-21). Let b = -15 + o. Calculate the smallest common multiple of i and b. 336 Let m(c) = 25c2 - 141c - 224. Let n(a) = 2a2 + 9a + 2. Calculate the lowest common multiple of m(7) and n(-6). 140 Suppose 0 = 5y - 8903 + 25613. Let z = -25401 - y. Let a = z - -397193/18. Calculate the common denominator of -101/18 and a. 18 Let r be (-15508775994)/(-18)(-27)/3. Let x = r + 1320215572885929/170254. Let u = -1/12161 - x. Calculate the common denominator of -11/6 and u. 42 Suppose -36k + 212912 = 25k + 32962. What is the least common multiple of k and 14? 20650 Let c be 2/10 - (-451008)/(-2254240). Let o = c + -873503/211335. Calculate the common denominator of o and 37/54. 270 Suppose 4g = 2m - 293 + 297, -9m = 3g - 87. Calculate the least common multiple of m and 176. 176 Suppose -2u + 5r = 4 - 8, 0 = 3u + 2r - 6. Let x be 9 - 9 - (95239/(-18732) + u). Let j = x + -3/3122. What is the common denominator of 41/24 and j? 24 Suppose 7f - 16f = -9. Let l be f - (-4)/(2/2). Suppose 0 = 4q + 2v - 18, -lq - v = -3v - 36. What is the smallest common multiple of 8 and q? 24 Suppose 5m = -3q + 3m + 39, -2q - 2m = -26. Let y be (q - 1)23/69. Calculate the common denominator of 149/78 and ((-10)/(-16))/((18/y)/9). 156 Let z = 15088837/258 + -58484. What is the common denominator of -35/86 and z? 258 Let z(r) = 3r3 - 2r*2 + 9r - 38. Calculate the smallest common multiple of z(3) and 4. 52 Let w(h) = -h*3 - 12h*2 + 15. Let k be w(-9). Let t = k - -248. Calculate the smallest common multiple of t and (-2)/(-3) - (-28)/3. 20 Let s(m) = m - 10. Let d be s(-7). Let x = 46 + d. What is the common denominator of (3/(3/x))/15 and -77/18? 90 Let n = 14121 + -11014387/780. Find the common denominator of 25/8 and n. 1560 Let y = 37 + -34. Suppose yq - 12 = -3o, 5o + 10 = -4q + 21. Suppose 5j = qj - 12. Calculate the least common multiple of 6 and j. 6 Suppose -2i + 343 = -173. Find the common denominator of -139/54 and (-559)/i - (-1 - 5). 54 Let r(h) = -h*2 + 13h + 276. Let f(s) = -7s. Suppose 7x + 24 = 3x - 4m, 3x = 5m + 14. Calculate the least common multiple of r(24) and f(x). 84 Let u be (1-1)/(-2 - -1). Let a(l) = -4290l + 8583l + 122l*2 - 4297l. What is the smallest common multiple of a(u) and 4? 236 Suppose 2k + 14 = 3w + w, -9 = k - 3w. Calculate the smallest common multiple of 15 and (k/(-2))/(-4 + 34/8). 30 Let z = 5981/187660 - 1/18766. What is the common denominator of z and 17/66? 660 Suppose -k - 3 = 0, -3b + 2k + 78 = -78. Suppose 5j - 3h - 412 = 0, -4j + 153 = 4h - 151. Calculate the smallest common multiple of j and b. 400 Suppose -63o = 262 - 829. Let r(b) = b*3 - 11b*2 + 2b + 8. Let z be r(10). What is the smallest common multiple of o and 0 - (0 - z/(-4))? 18 Suppose 82m - 8910 = 243m - 431m. What is the least common multiple of (17 - 0/1) + 1 and m? 198 Suppose -t = 3q - 23, -4q - 5t = -31 - 7. Let k = -97 - -272. What is the lowest common multiple of (-25)/k + 22/q and 11? 33 Let l = 2/19441 + 1652441/427702. Suppose 0 = -v - 3n + 26408, -v + 9043 = 5n - 17355. Let g = 845449/32 - v. Find the common denominator of l and g. 352 Suppose 0 = p + 7 - 8. Suppose 4x - 318 = 2k + 26, 0 = -5x - 2k + 421. Let i = x + -56. Calculate the least common multiple of i and p. 29 Let p = 96 - 94. Calculate the common denominator of 69/16 and 5085/(-5670) + 1(p + -1). 1008 Let l = -421 - -426. Let m(d) = d3 - 22d*2 - 21d + 37. What is the least common multiple of l and m(23)? 415 Suppose -5m - 90 = 5g, 0m = -m. Find the common denominator of (-549)/g1/(-7) and (-273)/927/180. 140 Let g(j) = 3j*3 + 4j*2 - 8. Let q be g(2). Suppose -q = -89h + 73h. What is the least common multiple of h and 26? 26 Let s = -6 + 9. Suppose -781u = -773u - 768. Suppose 0 = 5m + 2p - 3p - 166, -3m + u = sp. What is the least common multiple of 39 and m? 429 Suppose -5w + 5 = -15. Suppose 0 = 2o - f + 15, 2o - 9 = 3f - 14. Let q(d) = -4d2 - 39d + 18. Calculate the smallest common multiple of w and q(o). 8 Let d be (-12 + -3)1(-4)/10. Find the common denominator of ((-89)/d)/(12/(-36)) and 93/4. 4 Suppose 133*q	{ "pile_set_name": "DM Mathematics" }
81, -5114357, -7671633, -10228909, -12786185, -15343461? -2557276g + 195 What is the j'th term of 9511, 8946, 7419, 4450, -441, -7734, -17909? -80j3 - j2 - 2j + 9594 What is the w'th term of 212493, 425000, 637507, 850014, 1062521? 212507w - 14 What is the l'th term of -19172, -132601, -440502, -1040111, -2028664? -16206l3 + 13l - 2979 What is the q'th term of -85633, -171397, -257161, -342925, -428689? -85764q + 131 What is the x'th term of 1684894, 3369786, 5054678, 6739570? 1684892x + 2 What is the t'th term of -1851, -347, 1159, 2667? t*2 + 1501t - 3353 What is the d'th term of 58431, 58755, 59079? 324d + 58107 What is the w'th term of -272, -1186, -2292, -3686, -5464? -16w*3 - 802w + 546 What is the y'th term of -2016488, -2016532, -2016576? -44y - 2016444 What is the q'th term of 961924, 962512, 963100? 588q + 961336 What is the f'th term of -896, -282, 3366, 11566, 25836, 47694, 78658? 253f3 - f2 - 1154f + 6 What is the s'th term of 279846, 279846, 279844, 279840, 279834, 279826, 279816? -s*2 + 3s + 279844 What is the m'th term of -2233373, -2233355, -2233337, -2233319, -2233301? 18m - 2233391 What is the i'th term of 388154, 388075, 388004, 387947, 387910? i3 - 2i*2 - 80i + 388235 What is the b'th term of -4507548, -9015101, -13522654? -4507553b + 5 What is the n'th term of 78147, 312731, 703705, 1251069? 78195n*2 - n - 47 What is the q'th term of 34503, 138819, 312679, 556083, 869031? 34772q*2 - 269 What is the y'th term of -11216658, -22433305, -33649952, -44866599? -11216647y - 11 What is the b'th term of 1649, 2733, 4563, 7157, 10533? 3b3 + 355b*2 - 2b + 1293 What is the m'th term of -201973, -201832, -201691, -201550, -201409? 141m - 202114 What is the i'th term of 469432, 1877772, 4225004, 7511128, 11736144, 16900052? 469446i*2 + 2i - 16 What is the l'th term of 396996, 397015, 397058, 397137, 397264, 397451, 397710, 398053? 2l3 + 5l + 396989 What is the c'th term of -48058, -96099, -144106, -192073, -239994, -287863, -335674, -383421? c*3 + 11c*2 - 48081c + 11 What is the a'th term of 18450815, 36901631, 55352447, 73803263? 18450816a - 1 What is the a'th term of 3482, 6101, 7880, 8819, 8918, 8177? -420a*2 + 3879a + 23 What is the a'th term of -366, -584, -838, -1140, -1502? -2a3 - 6a*2 - 186a - 172 What is the z'th term of -732445, -1464895, -2197341, -2929783, -3662221, -4394655, -5127085? 2z2 - 732456z + 9 What is the x'th term of 14682, 58678, 131996, 234636? 14661x2 + 13x + 8 What is the j'th term of 1181270, 1181284, 1181306, 1181336, 1181374, 1181420, 1181474? 4j2 + 2j + 1181264 What is the p'th term of -2539, -2527, -2323, -1831, -955, 401, 2333? 16p3 - 100p - 2455 What is the d'th term of 34765, 34829, 34891, 34951, 35009? -d*2 + 67d + 34699 What is the u'th term of 32344409, 32344413, 32344419, 32344427? u*2 + u + 32344407 What is the z'th term of -62266, -62337, -62408, -62479? -71z - 62195 What is the b'th term of 39191, 39382, 39573, 39764? 191b + 39000 What is the g'th term of 24166, 24658, 25484, 26650, 28162, 30026, 32248? g3 + 161g*2 + 2g + 24002 What is the u'th term of -30348, -57138, -83928, -110718, -137508, -164298? -26790u - 3558 What is the l'th term of 92330, 371164, 835888, 1486502? 92945l*2 - l - 614 What is the g'th term of 68672, 137319, 205988, 274691, 343440, 412247? 2g3 - g2 + 68636g + 35 What is the w'th term of -965559, -965603, -965647, -965691, -965735, -965779? -44w - 965515 What is the z'th term of -10452664, -10452658, -10452648, -10452634, -10452616, -10452594? 2z2 - 10452666 What is the b'th term of -786, -1622, -2506, -3438, -4418, -5446, -6522? -24b*2 - 764b + 2 What is the b'th term of -182572, -730289, -1643158, -2921185, -4564376, -6572737, -8946274? -b*3 - 182570b*2 - 1 What is the z'th term of 34878, 68008, 101138? 33130z + 1748 What is the c'th term of -5500003, -5500026, -5500065, -5500120, -5500191, -5500278? -8c2 + c - 5499996 What is the s'th term of 2368049, 2368068, 2368097, 2368142, 2368209? s3 - s2 + 15s + 2368034 What is the a'th term of -360331, -360344, -360357, -360370, -360383, -360396? -13a - 360318 What is the v'th term of -113485, -454627, -1023197, -1819195? -113714v2 + 229 What is the s'th term of 40057, 80117, 120179, 160243, 200309, 240377? s2 + 40057s - 1 What is the p'th term of -38934587, -38934580, -38934569, -38934554? 2p*2 + p - 38934590 What is the w'th term of -4776, -13459, -22136, -30807, -39472? 3w*2 - 8692w + 3913 What is the m'th term of 1056, 4213, 9444, 16749, 26128, 37581? 1037m2 + 46m - 27 What is the g'th term of 628, 1153, 2184, 3847, 6268, 9573, 13888, 19339? 21g3 + 127g*2 - 3g + 483 What is the y'th term of 493, -58, -953, -2192, -3775, -5702, -7973? -172y2 - 35y + 700 What is the j'th term of -235, -179, -55, 161, 493, 965, 1601? 4j3 + 10j*2 - 2j - 247 What is the d'th term of 16332, 16402, 16468, 16530, 16588, 16642? -2d2 + 76d + 16258 What is the n'th term of 29217, 58439, 87661, 116883? 29222n - 5 What is the i'th term of -242260, -242223, -242186, -242149? 37i - 242297 What is the o'th term of 2999, 2857, 2461, 1685, 403, -1511? -21o3 - o2 + 8o + 3013 What is the o'th term of -6495, -6699, -6899, -7101, -7311, -7535, -7779? -o*3 + 8o*2 - 221o - 6281 What is the n'th term of 208774528, 417549058, 626323588, 835098118, 1043872648, 1252647178? 208774530n - 2 What is the c'th term of -625, -1243, -1849, -2431, -2977? 2c*3 - 6c*2 - 614c - 7 What is the i'th term of -12144739, -12144735, -12144729, -12144721, -12144711, -12144699, -12144685? i*2 + i - 12144741 What is the r'th term of -763, -1359, -1871, -2257, -2475, -2483, -2239? 7r*3 - 645r - 125 What is the w'th term of -37498692, -37498690, -37498688, -37498686? 2w - 37498694 What is the r'th term of -1138, 460, 7564, 22928, 49306, 89452? 459r3 - r2 - 1612r + 16 What is the f'th term of -12322, -24449, -36550, -48613, -60626? 2f3 + f2 - 12144f - 181 What is the s'th term of 903, 1749, 2537, 3237, 3819? -5s3 + s2 + 878s + 29 What is the t'th term of 320121335, 320121339, 320121345, 320121353, 320121363? t2 + t + 320121333 What is the v'th term of 16804, 16734, 16616, 16450, 16236, 15974? -24v*2 + 2v + 16826 What is the u'th term of -45670, -91231, -136774, -182299, -227806? 9u2 - 45588u - 91 What is the l'th term of -86, 477, 2204, 5677, 11478, 20189? 97l3 - 116l - 67 What is the l'th term of -2306633, -2306587, -2306457, -2306201, -2305777, -2305143? 7l3 - 3l - 2306637 What is the t'th term of -1268, -5136, -11560, -20522, -32004, -45988, -62456, -81390? 3t3 - 1296t*2 - t + 26 What is the i'th term of -7443, -12961, -18479, -23997, -29515, -35033? -5518i - 1925 What is the n'th term of 6423601, 6423608, 6423627, 6423664, 6423725, 6423816, 6423943? n*3 + 6423600 What is the s'th term of 110654, 433137, 970608, 1723067? 107494s*2 + s + 3159 What is the l'th term of 1260509, 1260459, 1260375, 1260257, 1260105, 1259919, 1259699? -17l*2 + l + 1260525 What is the f'th term of -87478262, -87478256, -87478246, -87478232? 2f*2 - 87478264 What is the c'th term of 13706, 27868, 42488, 57566, 73102, 89096? 229c*2 + 13475c + 2 What is the i'th term of 2349040, 4698074, 7047106, 9396136, 11745164, 14094190? -i*2 + 2349037i + 4 What is the w'th term of -6298, -11580, -16830, -22048, -27234, -32388? 16w2 - 5330w - 984 What is the f'th term of -85502, -86593, -87684? -1091f - 84411 What is the j'th term of -73, -158, -285, -454, -665? -21j*2 - 22j - 30 What is the a'th term of 23736, 23384, 23016, 22632, 22232, 21816? -8a2 - 328a + 24072 What is the i'th term of -2380268, -2380112, -2379956, -2379800? 156i - 2380424 What is the o'th term of 33053, 47926, 62799, 77672, 92545, 107418? 14873o + 18180 What is the s'th term of 1527, 4349, 7171, 9993, 12815, 15637? 2822s - 1295 What is the l'th term of 556, 5423, 18692, 44563, 87236? 700l3 + l2 - 36l - 109 What is the h'th term of 67, 487, 1309, 2563, 4279, 6487? 5h*3 + 171h*2 - 128h + 19 What is the z'th term of -1060, 7359, 21390, 41033, 66288, 97155? 2806z*2 + z - 3867 What is the f'th term of	{ "pile_set_name": "DM Mathematics" }
)) assuming f is positive. f*(-148/21) Simplify ((b/(bb/(bb(1/4)b)b))/bb/((b*(2/7)b)/b))/(b(2/3)/b)(-22) assuming b is positive. b(-619/84) Simplify (g0g((gg5)/g)/ggg)/(gg*(8/3)/gg(-10)) assuming g is positive. g(43/3) Simplify (ccc/c*(2/11)c)/cc(-2)(c/c*(-1))/(ccc(-11)) assuming c is positive. c(130/11) Simplify ((y(3/7)/(yy*(2/19)yyy))44)17 assuming y is positive. y*(-365772/133) Simplify (zz*(-9)/zz*(-4))/((zz/(z*(-1/6)z))/z)(-43) assuming z is positive. z(-35/6) Simplify (c/c2)33/(c/c13)(14/13) assuming c is positive. c(-261/13) Simplify ((a(3/2)/(a/a*(5/4)))/((a/((a/((aaa(1/4)a)/a))/aaa))/a)(-1))9 assuming a is positive. a18 Simplify (f8)*(-23)ff(-8)f(-1/12) assuming f is positive. f(-2293/12) Simplify (k/(k(-2/17)/k))36(kk(-16))/k(1/4) assuming k is positive. k*(4147/68) Simplify ((m/(m/(mm*(1/21)))m)/m*(34/5))/(mm(-1/7)/m)(-49) assuming m is positive. m(-1234/105) Simplify ((y1/(y/((y((y/(y((y1/y)/y)/y))/y)/y)/y)))32)(46/3) assuming y is positive. 1 Simplify ((b(-11)/b)/(b/b(-10)))/(b(-20)/(b/(bb(-24)))) assuming b is positive. b21 Simplify (r/(r/(rr/(r*(2/9)/rr))))10/(r9)(-2/65) assuming r is positive. r(10562/585) Simplify (j/(jj(2/47))jj/(j(-5/7)/j))16 assuming j is positive. j(19328/329) Simplify (((x(xx6)/x)(1/5))1)(-4/5) assuming x is positive. x(-28/25) Simplify ((f/(ff*(-2/25)f))/((ff(1/5)ff)/f))/(f18f(1/9)) assuming f is positive. f(-4777/225) Simplify (((j/(j(jj7)/j))/(j/j9))/(j*10j(-3/13)))42 assuming j is positive. j*(-4788/13) Simplify ((qqq/(q/q(2/9)))/(q(-3/4)q))/((q/(q*3q))/qqqq(-4)) assuming q is positive. q(287/36) Simplify (m15)(-17/2)(mm/((m/(mm*(-3)m)m)/m))26 assuming m is positive. m(-255/2) Simplify (rr*(-2)rr)(-34)r*(-4/5)r(-2/3) assuming r is positive. r(-532/15) Simplify (((c*(-3/7)c)/c)/c)*31(c*5/cc)18 assuming c is positive. c(320/7) Simplify ((i(-1/4))(-7/3)/((i*5i)/(i/i(3/4))))(-4/21) assuming i is positive. i*(62/63) Simplify (cc*(4/9))/(cc*11)((cc(-13))/c)/((cc*5ccc)/c) assuming c is positive. c*(-284/9) Simplify ((uu/(u/(u/(uu(-11))))u)/(u8/u))/(u(-2)/((uu(3/8)uu)/u)) assuming u is positive. u(83/8) Simplify (w/(w(ww((w/w(3/2))/w)/w)/w))/(w(-4/7)w)(w/(ww/w1))(3/13) assuming w is positive. w(15/14) Simplify p(-2/27)ppp*(-1/20)p/(p/p*4)p(-1/4) assuming p is positive. p(1519/270) Simplify (p*(-7)p/p*0(pp/((pp*(1/3))/p)p)/pp(-5)pp)(-35) assuming p is positive. p(770/3) Simplify (j/(j(-2/15)j)jjjj/j(-5/2))50 assuming j is positive. j*(995/3) Simplify (kk/k*3k)*1/((kk/(k/k*20k))/kkkkk)(-5/4) assuming k is positive. k(115/4) Simplify (g/g(1/5))/(g/(g(1/14)g)g)(g/(g/(((gg/(gg(-1)g))/g)/g)))/(gg(-20)) assuming g is positive. g(1251/70) Simplify (z/z(-1/13)zz)(-32)/(z/(z/z(2/63)z)z36z) assuming z is positive. z(-110150/819) Simplify (((r2/r)(-47))(-2/5))(2/67) assuming r is positive. r(188/335) Simplify (q12)(2/203)q(-19)/(q/(qq/(q(9/4)/q))) assuming q is positive. q(-15535/812) Simplify v6/v9((v/v(-2/3))/vv)/v(1/4) assuming v is positive. v(-19/12) Simplify (p*(3/8)p)/(p*9p)(p14pp)/(ppp(-3/4)) assuming p is positive. p(49/8) Simplify ((i27)21)(18/5) assuming i is positive. i(10206/5) Simplify (l(-1/6)l)*(-9/5)/(ll/l*(-8)l/(ll16)) assuming l is positive. l(9/2) Simplify (o(-1/3))(-46)(o(-2/7))3 assuming o is positive. o*(304/21) Simplify ((kk(-6)/k)/k)/((k(2/15)/k)/k)kk*9k/(k*(-4/5)k)k assuming k is positive. k(20/3) Simplify (g/g(5/4)g(-14/5))/(g(-6)gg(-1/24)) assuming g is positive. g(239/120) Simplify (((u/(u/u*10))/(u/((uuuu/(uuu/(u(uu*(-17)u)/u)uu)uuu)/uu)))38)(26/3) assuming u is positive. u(-3952/3) Simplify ((d/(d(2/5)d)dd)26/(d(dd(-1))/dd)15)19 assuming d is positive. d(2527/5) Simplify (r5)*(11/2)/(rr*12r(-17)) assuming r is positive. r(63/2) Simplify ((u*5/(((u/(uu/((u/u*(1/3))/u))u)/u)/uuu))(-5/4))(-8/3) assuming u is positive. u(160/9) Simplify (c/((((c/c(-8))/c)/c)/c)c)14(c8)(-26) assuming c is positive. c(-264) Simplify (r(-14))*(2/141)r(-2/61)/r(-2/61) assuming r is positive. r*(-28/141) Simplify ss/s*(-26)s*25(s(3/4))(-1/11) assuming s is positive. s(2329/44) Simplify (r(1/2)/r)(-7/2)/(((r3rrr)/r)/(rr/(r((rr/(r/(r*(-14)r)))/r)/r))) assuming r is positive. r(47/4) Simplify (d5d)/d1((d/d*(1/3))/d)/(dd*(-4)d) assuming d is positive. d*(20/3) Simplify ((u/(u/(uuuu/(u/u(-1/7)))))(-44))(-1/19) assuming u is positive. u(880/133) Simplify (m*(-20)mm/(((mmm9)/mm)/m))/((mm(-2/9))/m(-9)) assuming m is positive. m(-340/9) Simplify (((n/n(-2/11))/(n(nn/(nn*(-1/3))n)/n))/((n/n*(1/3))/(nnn/((nn/n*(-4)n)/n))))(2/23) assuming n is positive. n(-106/253) Simplify (a/(a/a(-5)))(-1/4)/(a(4/5)/(a(3/5)a)) assuming a is positive. a(41/20) Simplify (n(-8)/(n/((n/(((nn*(-20)n)/n)/n))/n)))/(nn(-9)nn)(-3/20) assuming n is positive. n(101/10) Simplify (kk*1k)(-7/11)/(k/k(1/2))(-18) assuming k is positive. k(78/11) Simplify (q/((q/q*(2/11)q)/q)q)(-33)(q/(qq(2/3)))(-1/42) assuming q is positive. q(-2456/63) Simplify (z3)6/(z(-3/10)z(-3)) assuming z is positive. z(213/10) Simplify (((rr(-2)rrr)/r)*(-4/5)/(rr*(-12/5)r*9r))(-30) assuming r is positive. r282 Simplify ((gg(-2)g)/gggg(-4/3)(g(-2/7))38)41 assuming g is positive. g(-9635/21) Simplify (x/(((xx/(xx*5x)x)/x)/x))/xxx(-11)x*(10/7)x/((x(1/6)/x)/x) assuming x is positive. x(11/42) Simplify (g/g*(-3/13)g)/g*(-1)(g*(2/5)/gg)(-1/23) assuming g is positive. g(4804/1495) Simplify (r(1/7))19r/r(-3)r(-1/5) assuming r is positive. r(228/35) Simplify (((zzzz/(z(1/6)/z))/z)(-14)(z/z*(-6/5)z)/((z/(z/z(-4)))/z))15 assuming z is positive. z(-682) Simplify (m(-21)/(m(15/11)/m))3 assuming m is positive. m(-705/11) Simplify (l22l(-2/11))/(l(-24)/l(-4)) assuming l is positive. l(460/11) Simplify (s4s)*(-29/5)s*4sss/s(-9/7) assuming s is positive. s(-145/7) Simplify ((mm(-5/6))/mmm)(44/7)/(m(-2/3)/(((m/(m(-33)/m))/m)/m)) assuming m is positive. m41 Simplify (y(-11/4)/y)/(y(2/75)y)(y/(y/y(2/59)))(-2/5) assuming y is positive. y(-84787/17700) Simplify ((r2rr(-7))36)(2/59) assuming r is positive. r(-288/59) Simplify (((a(-1/2)/a)/aa)/a)(2/51)/(a(-3/8)aa*(1/35)a) assuming a is positive. a(-25013/14280) Simplify f/((f/(f/f(-24)))/f)fff(1/10)(f/f23)28 assuming f is positive. f*(-5879/10) Simplify (j/(jjj(1/5)jj))/((j/(jj*(1/7)))/j)j2/j(-2) assuming j is positive. j*(68/35) Simplify (rrr/(r(1/8)r))*(2/23)r(-4/5)/(r(-10)/rr) assuming r is positive. r(4307/460) Simplify (t(-2/49)t/((t/t(-28))/t))(-38) assuming t is positive. t(50350/49) Simplify (k3)(9/2)/(k(4/7)/k(-4/9)) assuming k is positive. k(1573/126) Simplify z/z*(-2/13)((z*(-9)/z)/z)/zz/(z/(zz(2/11)z))(z/(zz(-1/7)))/z assuming z is positive. z(-9531/1001) Simplify ((n*(1/8)nn(-1/2)n)/((n*(-5)nn)/nn*(-4/7)n))(-1/14) assuming n is positive. n(-291/784) Simplify (o2)(-30)o/o(4/11)o(-3) assuming o is positive. o(-686/11) Simplify (u(-22)/u(-1/9))/(u(-1/19)/u)(-2/119) assuming u is positive. u(-445777/20349) Simplify ((o24o)/(oooo(14/5)))/(o(2/25)o(-3/17)) assuming o is positive. o(8201/425) Simplify (f(-1/7)fff*3ff(f*0ff)/((ff*(4/3)f)/f))(-5/2) assuming f is positive. f(-685/42) Simplify (t*0t/t*(-4/11))/(tt*8tt(-14)) assuming t is positive. t(59/11) Simplify ((sss(1/6)s)/s)1/(s(6/11)s)49 assuming s is positive. s(-4855/66) Simplify ((o/((oo*(-7/4))/ooo))/(o/o(2/83)o))**47 a	{ "pile_set_name": "DM Mathematics" }
-14. Let i = j - 0.1. Is i at least as big as 0.03? False Let w(f) = -f*3 + 7f*2 - 7f + 3. Let x = 3 + -3. Suppose xy = 2y - 12. Let t be w(y). Which is smaller: 1 or t? t Suppose b - 2 + 4 = 0, -2x = 3b + 22. Let j be (-21)/(-12) - (-6)/x. Is 5/7 not equal to j? True Let f = -20/107 - -3564/749. Which is greater: 5 or f? 5 Let d = -6 - -10. Suppose -4w + dr - 72 = 0, 0 = -0w + 5w + 5r + 80. Let b be (-5)/(-20) + w/4. Is b > -3? False Let y be (1 - 2) + 2/(-4). Let f(g) = -g3 - 39g*2 - 40g - 79. Let h be f(-38). Does y = h? False Suppose -8j - 6 = -11j. Suppose -2r - 20 = 2u, ju + u - 2r = -25. Is -10 smaller than u? True Suppose -5c = -5l - 30, -l - 24 = -4c - 2l. Suppose c + 3 = 3s. Is 3 greater than s? False Let k(v) = -v3 - 11v*2 - 10v - 8. Suppose -d - 3d = 40. Let g be k(d). Let l be 7/(1 + (-1 - 1)). Is l not equal to g? True Let t(z) = -z3 - 2z*2 + 3z - 1. Let s be t(-3). Let i be s/(-6) + (-4)/6. Let o(a) = -a*3 - 8a*2 - 9a - 12. Let u be o(-7). Which is bigger: u or i? u Suppose -3g - b = -0b - 45, -b = -3. Is g equal to 15? False Let o be -4 - (1 + 0)/((-2)/(-6)). Let m be (-1 + 5)(-1 - 1). Is m <= o? True Let y = -659/36 - -55/3. Do 0 and y have the same value? False Let g = -789/2 + 11863/30. Which is greater: g or 1? 1 Let m(h) = h3 + 2h*2 + 2h + 1. Let k be m(-2). Which is greater: -4 or k? k Let k be ((-1)/(-3))/(391/102). Is 1 greater than k? True Let p = -27 - -39. Is p greater than or equal to 13? False Suppose 85 = -5w - 3l, 3l = -2l - 25. Is -9 at most w? False Let h = 0.3 - 0.2. Let o = 0 - h. Let n = 169 - 1185/7. Which is greater: o or n? o Suppose 16 = 4l + 4s, 3l - 5s - 10 = -2l. Let c = 3 - -1. Which is smaller: l or c? l Let a(h) = h2 + 6h - 6. Let v be a(-7). Is -1 <= v? True Let h be 217/(-43) - (-55)/11. Is 1 at least as big as h? True Suppose d - 3d + 4c = -20, -5d - 2c + 14 = 0. Suppose 1 = 5a - d. Let s = -353/5 - -71. Is a less than or equal to s? False Let r be (-4)/(1 - -1) - -3. Is -1 at least as big as r? False Let r = 2 - 4. Let j = r - -2. Let o = -1.1 - -0.1. Do o and j have different values? True Let u = 166.3 - 166. Is u smaller than -1/12? False Let z be (-22)/(-8) + 2/8. Suppose 0 = -zm + 4c - 1, 4m - 3 = -0m + c. Is m greater than 2/5? True Let s = -1 - -20. Do 20 and s have different values? True Let f be (1 - 5)/(104/(-12)). Let l(p) = p + 4. Let d be l(-5). Which is smaller: d or f? d Suppose 2w + 2s + 2 = 3w, 2w - 1 = s. Suppose 4u - 32 - 8 = w. Which is smaller: 11 or u? u Suppose 7 = j + 5f, -3f - 22 = 4j - 8f. Which is smaller: -2 or j? j Let v = -0.11 - -0.11. Is 13 equal to v? False Suppose 3u - 660 = 4d, 0 = -2d - u - 380 + 50. Let j be (-3 - d/51)/2. Are j and 0 equal? False Let d = 2 - 9. Which is smaller: d or 1/3? d Suppose 2f - 5g = -24, 0 = -4f + g - 62 + 14. Let o = 12 + f. Is 0 > o? False Let u = 3 - 3. Suppose 5c - 6 = 3m - 18, u = 5m + 4c + 17. Which is smaller: m or -1/5? m Let y be (10/(-24))/((-4)/(-12)). Which is smaller: 0 or y? y Let l be ((-2)/3)/(0 + 10/(-15)). Let y = -15 - -23. Suppose -l = 2a + 3v - y, 0 = 3a - 2v + 9. Is a not equal to 0? True Let s be ((-94)/8 - -2)-2. Let r = 511/26 - s. Is r at least as big as -0.1? True Suppose b - 2b = 2, 0 = -3x + 5b + 31. Let m = -4 + x. Suppose -mg + 3w = 4w - 5, 1 = -g - 3w. Is 3 greater than g? True Let w(o) = -o - 2. Let j be w(-9). Let h = j + -4. Suppose f - t - 4 = -7, 9 = f + ht. Is f < -1? False Let r be (-183)/1065 - 1/(-5). Which is bigger: r or -1? r Suppose -2z - 5 = -3m, -m = -z + 6z - 30. Let j = z + -5. Let g = 2 + -2. Is j smaller than g? False Suppose 9q - 129 = 4q + 3m, 3m - 6 = 0. Let r be ((-4)/(-10))/(q/15). Which is bigger: r or 4? 4 Let m be (-4)/(-18) + 15910/63. Let v = -3034/7 + m. Let y = -7048/39 - v. Which is smaller: 1 or y? y Suppose 0 = 3o - 4 - 11. Suppose 3k + 13 = -4d - 2k, -d - 7 = ok. Is d > -13/4? True Let g(v) = v2 + 5v + 2. Let u be g(-5). Let b be (1/2)/(12/24). Suppose -3c - b = u. Which is greater: 1 or c? 1 Let l = 7 + -4. Suppose -j + 5m = -26, 3m = lj + 5m + 7. Is j < 1? False Let n = 0 - -0.1. Let p = n + -0.07. Let s = 2.03 - p. Is -1 < s? True Let a = -58 + 49. Which is smaller: a or -2? a Let h = 0 + 2. Let s(b) = -3b*2 + 3b. Let y be s(h). Let u = y - -7. Which is bigger: 0 or u? u Suppose 144w - 143w - 56 = 0. Which is greater: w or 55? w Let n = 13 + -12. Is n less than or equal to 1/7? False Let t(w) = w*3 - 6w*2 + w - 5. Let c be t(6). Which is smaller: -4/11 or c? -4/11 Let l(t) = 3t - 5. Let n be l(2). Is n < -4/11? False Let l = 2.01 - 0.01. Suppose 0 = 6f - 4f - 4. Let a be (-11)/44 + f/(-56). Which is smaller: a or l? a Let o be (6/(-14))/((-6)/(-4)). Which is greater: 1 or o? 1 Let j(h) = 3h - 3. Let t be j(4). Let r be (-29)/t + 6/27. Let m(c) = -c. Let k be m(4). Are r and k unequal? True Suppose -14c - 23 - 5 = 0. Is -2 bigger than c? False Let x = -2097 - -4035/2. Let r = x - -78. Which is smaller: r or -2? -2 Let d = -2 + 2.2. Let p = 0.3 - d. Is -1 <= p? True Suppose -2o = -o - 1. Let p(m) = -m3 - 4m*2. Let r = 9 + -13. Let l be p(r). Is l greater than or equal to o? False Let w be (-288)/160(-2)/3. Are 0 and w non-equal? True Let l(y) = -y + 6. Let v be l(0). Let a(x) = -x + 4. Let u be a(v). Suppose -2h + q - 1 = 5, q - 15 = 5h. Which is smaller: h or u? h Let r = 65 - 64.53. Let t = 0.5 - r. Let y = t - -1.97. Is 2/7 <= y? True Let q(i) = -i*2 + 3i. Suppose 4d - 10 = 2. Let p be q(d). Let v = -23/84 - -1/42. Which is smaller: v or p? v Let r(w) be the third derivative of -w5/60 + 5w4/24 - w3/2 + 3w2. Let n be r(4). Which is smaller: n or 0? 0 Let z(t) = t2 + 10t + 2. Let d be z(-9). Which is smaller: -1 or d? d Let l be -4(-3 - (-15)/6). Let u be (-357)/(-39) + l/(-13). Which is smaller: 10 or u? u Let u be 3(-5)/((-25)/(-5)). Is u at least -3/2? False Suppose -2g + 4 = -2. Let o be (-2)/g + (-2)/(-6). Which is smaller: -1 or o? -1 Let k = -8 + 13. Suppose -7 = 2n - ky, 2n + 1 = 4y - 3. Is 4 less than n? False Let k = 8 - -1. Let v = k + -9. Which is greater: -1 or v? v Let y(s) = s3 - 3s*2 + s + 3. Let m be y(3). Let g = 35 - 12. Let f = g - 17. Are f and m equal? True Let o be -50(0 + (-1 - 0)). Let x = o - 17. Let f = x + -100/3. Is 0 at most as big as f? False Let y = 30 + -51. Which is smaller: -19 or y? y Let x(c) = c*3 - 6c*2 - 3c - 1. Let g be x(7). Let f = g - 18. Which is bigger: -1 or f? f Let b = 61 + -40. Let p = b + -43/2. Which is smaller: 0 or p? p Let i = -5/6 + 1/3. Is -16 bigger than i? False Let i be ((3064/14)/(-4))/(-15). Let s = i + -44/15. Which is bigger: 1 or s? 1 Let g be ((-2)/(-6))/(-13/(-126)). Which is greater: g or 9? g Let x be (-2)/4 - 2/4. Let o = -117 - -116. Is o not equal to x? False Let p = 7 - 11. Let n be 22/6 - p/(-6). Is n < 4? True Suppose -i = 2i - 60. Suppose 0 = -5o - 3d + 1 + 16, -4o + i = -4d. Is 3 <= o? True Let d = 0.3 - -0.7. Is 4/9 < d? True Suppose -5l + 0 + 10 = 0. Suppose lb = 5b + 39. Let c = -9 - b. Is c greater than or equal to 4? True Let q = -4465030075 + 196474973445/44. Let y = -310206 + q. Let h = 99/4 - y. Is -1 equal to h? False Suppose x = -x + 10. Let m = x - 7. Which is smaller: -3/2 or m? m Let m be 12 + (2 - 3). Let d be m/16 + -2. Suppose d = -4z - 2j, 4z - 3z = -2j - 1. Are z and 2/5 non-equal? True Suppose 0 = -2y - y. Let u = 105.91 + -106. Is u greater than y? False Let t = -769/2 - -1904/5. Let j = t + 353/90. Which is greater: j or -0.2? j Let a(w) = -w2 - 8w + 5. Let h be a(-8). Suppose 0 = -4f + 3f + 4k + h, -5k = -2f + 10. Is 5 bigger than f? False Let o = 6 - 2. Suppose -4q + 2k + 35 = -k, -ok - 25 = -q. Is q less than 6? True Let x(a) = -a*3 + 13a2 - a + 9. Let z be x(13). Let j be (-63)/135 - z/(-30). Let r = -1 - -0.9. Do j and r have the same value? False Let m = 2.03 - 0.03. Let q = -4 + m. Let s = 84 - 83. Which is smaller: s or q? q Let m(u) = u3 - 6u2 - 7u - 11. Let k be m(8). Let c = 185/3 - k. Is -0.2 greater than c? False Let v(o) = o*2 - 6o + 4. Let j be v(5). Which is smaller: -1/26 or j? j Let a(c) = 2 + 0 - 5c + 4c - c3 - c2 + 0. Let u	{ "pile_set_name": "DM Mathematics" }
t s = 8 - 4. Let c = 2 + s. Let j = c - 4. Solve j = -b - 3 for b. -5 Let f(y) = y*3 + 7y*2 - 5. Let h be f(-5). Let z be (4/(-6))/((-10)/h). Solve -zp + 18 - 3 = 0 for p. 5 Let i be 2(1 - 0)1. Solve z - 1 + i = 0 for z. -1 Let z = 5 + -2. Let d(y) = 2y + zy - 8 - y - 5y. Let r be d(-8). Solve -4v + rv - 8 = 0 for v. -2 Let k = 17 + -11. Solve 0 = -3b - 3 - k for b. -3 Let o(a) = a*2 + 5a + 7. Let x be o(-3). Solve 2d + x = -5 for d. -3 Let s = -30 + 34. Let a be ((-6)/(-4))/(6/8). Let f be (-1)/a(-24)/s. Solve f = -p + 2 for p. -1 Let k be (-46)/12 + 8 + 1/(-6). Suppose -11 = -2g - 2g - 3x, -5g + 31 = -2x. Suppose gr - 3p - 63 = 0, 2r + r - 57 = -3p. Solve -v = kv - r for v. 3 Let y = 4 + -1. Suppose 8a = 4a + 8. Let z = 0 + a. Solve -zl + y = l for l. 1 Suppose 6x = 4x + 8. Solve -2 = 3w + x for w. -2 Let s(g) = g*2 + 5g - 4. Let z be s(-6). Solve 0 = -zf + 2 for f. 1 Let m(l) = l3 - 4l*2 + 4l - 3. Let b be m(3). Suppose b = 5s - 65 + 5. Solve 0y = -3y + s for y. 4 Let p(l) = -l - 2. Let i(r) = -2r. Let d be i(5). Let q be p(d). Suppose 6g - q = 4g. Solve gt - 7 + 3 = 0 for t. 1 Suppose 0 = -2p - 2o + 2, p + 2p - o - 3 = 0. Solve 4k + p + 7 = 0 for k. -2 Suppose -5c + 4c = -2. Suppose -g + 3 = -c. Solve -3j - g + 2 = 0 for j. -1 Let o(z) be the second derivative of z5/20 + z4/4 - z*3 - 3z*2 + z. Let x be o(-4). Solve x - 6 = 4r for r. -1 Let a = 116 + -108. Solve z + a = 3 for z. -5 Suppose -4 = 4x + 3t, -4x - t = 1 - 5. Suppose -v + xi - 6 = -2, -v = 4i - 14. Solve -h + vh + 2 = 0 for h. -2 Let m = 47 - 33. Suppose 5a - 4f - 42 = 0, 2f - 4 = -4a + m. Solve x - 4x = -a for x. 2 Let q be 7/21 - (-5)/3. Solve 0 = qw + 4 for w. -2 Suppose -b + 3b + 10 = 0. Let p be (b - -5)(-2)/(-6). Solve pg + 4 = 2g for g. 2 Let w(t) = t*2 + t - 3. Let v be w(-3). Let b be -1 + v(-1)/(-3). Solve -6u + 4u = b for u. 0 Let h(l) = 13l + 0l2 - l2 - 2 - 6l. Let u be h(5). Suppose -5d - 2b - 10 = 3b, -5d + 5b = -40. Solve 0 = -do + uo for o. 0 Suppose 0 = -i + 1 + 2. Suppose -ic = -v - 4, -2v = 3v - 10. Let g(o) = o3 - o2 - 3o + 2. Let q be g(2). Solve 0 = -qs + cs + 10 for s. -5 Let t be ((-324)/(-48))/((-1)/(-4)). Solve -11 = 4w - t for w. 4 Let o be 28/8 + (-3)/6. Suppose y - 16 = 4f, -3y + of + 8 = f. Solve yk - 2k = 10 for k. -5 Let u be 3/(9 + -3)0. Solve u - 4 = 2c for c. -2 Let n = 17 + -11. Solve -n = 2i + i for i. -2 Let z(a) = a3 - 11a*2 + 2. Let w be z(11). Solve 0n = wn - 10 for n. 5 Suppose -2h = -3y - h + 39, 0 = 4h - 12. Solve -y - 6 = 4c for c. -5 Let h(l) = -l2 - 4l - 3. Let y be h(-2). Solve 3w - 7 = -y for w. 2 Let w = -5 - -10. Suppose q = -wz - 14, -5z + 0z = -5. Let t = -7 - q. Solve 0 = 3v - 7v + t for v. 3 Let o(a) = a*2 + 7a + 9. Let f be o(-6). Solve -fj + 3 = -2j for j. 3 Let v(n) = 2n. Let d be v(5). Suppose -d = -b - 5. Solve 3q - 1 = b for q. 2 Let z(w) = w3 + w2 - 9w + 9. Let b be z(2). Solve bj = -j - 12 for j. -3 Let u = 9 + -6. Suppose 3o - 5 = -2l, 4o + 2l - 5l = 1. Solve o + u = -c for c. -4 Let c = 16 - 12. Suppose s - 2 = m, -9 = -m - cs + 14. Solve m + 1 = -g for g. -4 Let l be (-2)/(-3) - (-20)/15. Solve 2 = lz + 4 for z. -1 Let t = 26 - 15. Suppose 3w = -2q + 3q - t, 4q + 5w + 7 = 0. Solve -qa - 4 = -0a for a. -2 Let w be ((-6)/44)/(-2). Suppose ws + 3i - 14 = 13, 4s = 4i - 4. Suppose -s - 2 = -2f. Solve 0 = -4k - f - 9 for k. -3 Suppose 0 = 6u - 3u + 6. Let b be 0/(2u/(-4)). Solve b = d - 4d for d. 0 Let q(u) = 2u + 22. Let z be q(-10). Solve -zr = -0 + 6 for r. -3 Let c(j) be the first derivative of j3/3 + 4j*2 - 4j - 6. Let f be c(-9). Solve f + 5 = 2n for n. 5 Suppose 9 = 2u + 23. Let f = u + 7. Solve f = 2z + 1 + 3 for z. -2 Suppose 0 = -2p + 3p - 4v + 1, 0 = 2p + 5v - 11. Suppose 0 = -g - 4d + 2 + p, -5g + 7 = 2d. Let s be 110/42. Solve -g = -2m + s for m. 3 Suppose v + 9 = -2y - y, -3v + 25 = -4y. Solve 7 = vx + 22 for x. -5 Let k(t) = t*2 - 13t + 24. Let x be k(11). Solve 0 = -xg - 1 - 1 for g. -1 Let k be 2/14 + (-13)/(-7). Solve kh + 0h = 6 for h. 3 Let f be (-18)/4 - (-2)/(-4). Let m = 10 + f. Solve 1 - m = -s for s. 4 Suppose -3t + 16 - 4 = 0. Let j(w) = -w*3 - 8w*2 + 9w + 1. Let o be j(-9). Let i be o/((-2)/(-10)) - 0. Solve 15 = -tb - i for b. -5 Let b(a) = -a3 - 9a*2 - 9a - 6. Let h be b(-8). Let l = 6 - h. Solve 3c - l = 5c for c. -2 Let l be (-2)/(12/2). Let a(s) = s3 + 4s*2 - s - 2. Let x be a(-4). Let o = l + x. Solve 0 = -k - o - 4 for k. -4 Let v be 6/15 + 28/5. Suppose -2a + v = -0a. Solve -3k - a = -0 for k. -1 Let k = -34 + 46. Solve 5u - u = -k for u. -3 Suppose -17 = 3w - 4q - 45, 4q + 24 = 2w. Solve -wb + 15 = b for b. 3 Let q = 4 + 1. Suppose -2y - 4 = 0, -11 = 2o - qo + y. Let c be ((-21)/(-14))/(3/2). Solve -p = o + c for p. -4 Let u(l) = l3 + 3l*2 - 5l + 2. Let y be u(-4). Suppose 0 = d - yd + 115. Solve -4w + 7 = d for w. -4 Suppose 5 = -10i + 25. Solve 5 = -iy + 7y for y. 1 Let t be (-15)/(-2) - (-6)/(-4). Solve -15 = q - tq for q. 3 Suppose 5r = -2s + 29, 4r - 14 - 6 = 0. Let f(n) = -sn + 2 - 11 + 4n + 0n. Let d be f(7). Solve -q + 0 = d for q. -5 Let d be (-1)/((-2)/(-1))-8. Suppose -a - da = -50. Solve -5r = -a - 15 for r. 5 Suppose -6l - 9 = -21. Solve -3u = -lu + 4 for u. -4 Suppose 0 = o + 2, 0 = -3j + 3o + 5 + 4. Let r be (-30)/(-18)3j. Solve 4z = -1 + r for z. 1 Let l = -31 + 33. Solve -lf - f = -3 for f. 1 Let q(a) = 2a2 + a. Let g = 6 + -5. Let m be q(g). Suppose -mv - 10 = -8v. Solve -vp = -0 + 2 for p. -1 Let u = 0 + 6. Let p = -6 + u. Solve p = -b - 4 for b. -4 Let k = 4 + -2. Suppose -kq = -q. Solve 0h - 4h = q for h. 0 Let i = -3 - -4. Let q = i + 3. Solve p = -qp - 15 for p. -3 Let a(z) = 5z2 + 1. Let v be a(1). Let p = 15 - 11. Solve -pl = -vl for l. 0 Let q be (-6)/(-27) + (-2)/9. Suppose q = -4o - 12 - 0. Let s be -1(-3 - (o - 0)). Solve 3y + 12 + 3 = s for y. -5 Let f(l) = l*3 + 4l*2 + 3l + 2. Let b be f(-2). Solve -t - bt - 20 = 0 for t. -4 Let h(p) = p3 - p2 - 2p. Suppose -4 = 3t - 10. Let u be h(t). Solve uc - 12 = 3c for c. -4 Let k = 26 + -20. Suppose -5c = -0c - 20. Solve -cp + 26 = k for p. 5 Let r = -1 + 4. Let c be (-1)/(-3) - 28/(-6). Solve 2g - cg = -r for g. 1 Suppose 7 = -2h + 31. Solve -j + 4j = h for j. 4 Suppose -3b - 3q + 27 = 0, -4b + 5b - q - 3 = 0. Let i = -16 - -18. Solve 4o - b = io for o. 3 Let l(w) = -5w2 - 2w - 1. Let f be l(-1). Let v be -1 + 10/f-2. Let r(a) = a2 - a - 2. Let i be r(2). Solve -z - v + 2 = i for z. -2 Let c(g) = 5g*2 + 3g + 2. Let r be c(-3). Let n = 3 - -2. Let h = 5 + -5. Solve h = -nz + r - 13 for z. 5 Let d(j) = j3 - 12j*2 + j - 11. Let z be d(12). Let k be (0 + z)(-2)/(-1). Solve 0 = -kg - 5 + 13 for g. 4 Suppose 0 = 5d - u - 97, -5d + 77 = -d - u. Solve -f - d = 3f for f. -5 Suppose -4l + 3l = -2. Solve -ld - 8 - 2 = 0 for d. -5 Let z be -1(-3 + 2)(-2 + 6). Solve zy = y - 15 for y. -5 Suppose 3m = 4m - 5. Suppose i = mi - 5k, 4k = 0. Solve i = 3j - 0j for j. 0 Suppose -2c = -0c. Suppose -12a = -6 - 30. Solve -ad = -cd for d. 0 Suppose r = -5, -2z - 4r = -3r + 11. Let f = -2 - z. Solve -4c - 13 = -f for c. -3 Let y(g) = -g*2 + 7g - 3. Suppose -5r + c + 3c + 35 = 0, -5 = c. Let q be 2/r - (-32)/6. Let f be y(q). Solve fn + 2n = -15 for n. -3 Let b(f) = f - 1. Let j(a) = a*2 + 11a + 6. Let q(c) = 4b(c) + j(c). Let d be q(-15). Solve -ds + 4s = 2 for s. 1 Suppose 0 = 2r + 10, -2f - r + 4r = -45. Solve -3z = -f - 0 for z. 5 Let c(x) = 12x3 + x2 - x. Let o be c(1). Let l = 22 + -20. Let y be ((-6)/(-12))/(l/12). Solve -yd - o = d for d. -3 Let z be 5 - ((-16)/120 - 2/(-15)). Solve -z = 2d + 5 for d. -5 Let d be -21 + 2 + 26 + -26. Let c be -7((-1)/(-1) - 2). Suppose 4n - 3f - 14 = 0, 0 = 4n - f - f - 12. Solve d = -cx + nx - 10 for x. -2 Let o(b) = b + 1. Let d(a) = 3a*2 + a. Let v be d(1). Let r(p) = -3p + 6. Let m(c) = vo(c) + r(c). Let n be m(-7). Solve -5i + ni = 8 for i. -4 Let t(d) = -d - 13. Let c be t(-15). Solve 4w - c = 2*w for w. 1 Suppose	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.