Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
-5). 23 Let h = 5 - 0. Let o(f) = -f*3 + 5f*2 - 2f + 4. Determine o(h). -6 Let f(j) = 2j2 + 4j + 3. Let s = -29 - -26. Determine f(s). 9 Let x(i) be the second derivative of i*5/20 + 7i*4/12 + 2i*3/3 - 3i*2 + 37i. What is x(-6)? 6 Let i(j) be the second derivative of -j*3/6 - 2j*2 - j. Let r be i(-6). Let t(x) = 0x*2 - 6x - 2x2 + 4x*2 + r. Determine t(4). 10 Suppose -15 = -5a + 5y, -6a + 2a + 20 = 4y. Let b(h) = h*2 - 4h + 2. Give b(a). 2 Let q(i) = -i*2 + i. Let a(h) = -6h*2 + 4h. Let l(w) = -a(w) + 5q(w). Give l(1). 2 Let j(s) = s - 3. Let k be j(5). Let u(n) = -n2 - n2 + 1 - kn*2 + 3n*2. Calculate u(2). -3 Let v(l) = -l - 8l - 5l2 - 6l*2 + 2 + 10l*2. Calculate v(-9). 2 Let x = 8 + -1. Let y = -12 + x. Let k(c) = c + 2. Determine k(y). -3 Suppose 0 = 2m - 2d + 12, 5d = -4m + 2 + 10. Let i(o) be the third derivative of -o6/120 - o5/30 + o4/12 + o3/2 - 2o*2. What is i(m)? -1 Suppose -3i + 1 = 5t, -5i + 2t = -0t - 43. Let m(o) = 5 + 5o2 - 5o*2 - 7o + io2 - o3. Determine m(6). -1 Let h(c) = c + 1. Let b(j) = 2j + 1. Let m(a) = -3b(a) + 7h(a). Calculate m(-8). -4 Let w(c) = -c*3 + 4c*2 + 6c - 2. Suppose 2j + 5x - 11 = 0, -3j - 2x = -32 + 10. Let v be j/(-28) + (-37)/(-7). Give w(v). 3 Let o(c) be the first derivative of -c*2 - 9c + 4. What is o(-6)? 3 Let o(i) = -3i3 - i2 - i. Let c(r) = r3 + 1. Let p(x) = -c(x) - o(x). Suppose -8 - 2 = -5u. Suppose 0 = ut - 4t + 2. What is p(t)? 3 Suppose 0 = -3d + 5h - 1, 5h - 3 = 6d - 2d. Let b(q) be the first derivative of q2/2 + 4q + 7. Determine b(d). 2 Let j = 8 - 3. Suppose 4x + 1 = 4v + 5, -j = 4v - 3x. Let n = v - -1. Let a(z) = -10z3 + z2 - z - 1. What is a(n)? 11 Let f(x) = x3 - 4x*2 - 3x - 3. Let q = -143 - -148. Calculate f(q). 7 Let c(p) = -5p - 1. Let i(h) = -h2 + 3h + 2. Let k be i(-1). Give c(k). 9 Let d be ((-4)/2)/(2/4). Let z(o) = o - 3. Determine z(d). -7 Let l(u) = 3u2 - u + 3. Let c(i) = i2 + i + 1. Let z(d) = 4c(d) - l(d). Let k(h) be the first derivative of z(h). Calculate k(-5). -5 Let u be (-6)/(-14) - 12/(-21). Suppose -f = 5a - 19, 2f - 2a - a + u = 0. Let t(o) = o - 2. Let j(s) = 1. Let r(m) = -6j(m) + t(m). Determine r(f). -4 Let o(p) = -2p2 + 2p - 2. Let k(l) = l*2 - l + 1. Let s(n) = -3k(n) - 2o(n). Let q = -1 + 0. Let t be q/(22/(-12)). What is s(t)? 7 Suppose 3z - 2y + 3y - 10 = 0, 5z = 2y + 13. Let b = 5 - z. Let n(f) = 2f*3 - 3f*2 + 4f - 2. Give n(b). 10 Let f(k) = k - 2. Let u(c) = -2c + 11. Let q(i) = 4f(i) + u(i). Let s be ((-1)/2)/(3/30). Let z = s - -1. Calculate q(z). -5 Let u(k) = 2k - 2k*3 + 0k + 28k2 - 5k - 32k2. What is u(-2)? 6 Let o(y) = 3y + 8. Let j be o(-4). Let i(l) = l*2 + 3l - 4. Give i(j). 0 Let n(m) = -m + 4. Let r be -8(11/6 + 44/(-33)). Calculate n(r). 8 Let t(l) be the first derivative of -l4/24 + 2l*2 - 2. Let c(k) be the second derivative of t(k). What is c(2)? -2 Let n(z) = -3z*3 + 3z*2 - 12z - 3. Let t(w) = 4w3 - 5w*2 + 18w + 5. Let i be (-8 - -5)(-5)/(-3). Let g(q) = it(q) - 7n(q). Determine g(-5). 1 Let c(j) = -1. Let t(f) = 4f - 2. Let w(s) = 2c(s) + t(s). Calculate w(-3). -16 Suppose 0q = q + 4. Let f(h) = 2h2 + 5h + 4. Determine f(q). 16 Let n = -8 - -16. Suppose -3d - 2 + n = 0. Let h(g) = 3 - dg + 4g - 6. Determine h(-3). -9 Let f(u) = -u2 + 2u + 6. Let h = 10 - 10. Let x be f(h). Let r(v) be the first derivative of v*4/4 - 7v*3/3 + 2v*2 + 7v - 1. Calculate r(x). -5 Let c = 8 - 4. Let l(s) be the second derivative of -1/2s3 + 1/12s*4 + 0 + 5/2s*2 + 6s. What is l(c)? 9 Let x(c) = -3c - 3. Let n(y) = y3 + 5y*2 - 3. Let p be n(-5). Determine x(p). 6 Suppose 3 - 5 = -z. Let j(q) = 3q*3 - 4q - 2. Let i(c) = 3c3 + c3 - 1 + c2 - 1 - 5c. Let d(l) = zi(l) - 3j(l). What is d(3)? -1 Let o = -1 + 3. Suppose 5s - j + 16 = 0, -os + 7s + 36 = -4j. Let b = -8 - s. Let w(t) = -t*2 - 4t + 1. What is w(b)? 1 Suppose -3d - 21 = -3l, -8 + 31 = l - 5d. Let z(w) be the first derivative of -w4/4 + 2w*3/3 + 3w2/2 - 1. Determine z(l). 0 Let d(c) = -c2 + 4c. Let q(m) = m3 - 3m*2 - 2m - 5. Let h be -412/(-8) + -2. Let z be q(h). Calculate d(z). 3 Suppose 4z - 33 + 13 = 0. Suppose 1 = zb + 6. Let u(x) = -3x + 1. Give u(b). 4 Let f be (6/(-4))/(6(-10)/(-80)). Let t(u) = -2u2 + u3 + 2 + 2u2 + 2u. Give t(f). -10 Let p(z) be the second derivative of -z4/12 + z3/3 - 2z - 2. Give p(3). -3 Let d(f) = -f2 - 3f - 2. Suppose 20 = 14m - 19m. Give d(m). -6 Suppose -7j + 2j - 10 = 0. Let n(m) = -8m + 2. What is n(j)? 18 Let p be (-2)/((-4)/(8/(-1))). Let v(s) = -2s - 1. Determine v(p). 7 Let a be (-4)/30 - (-34)/30. Let j(f) = a + 2f2 - f3 - 4f2 - f3. Give j(-1). 1 Let h(j) be the second derivative of -1/20j5 + 2j + 0 - 3/2j2 + 1/2j*3 + 1/3j*4. What is h(4)? 9 Let k(h) = 6h - h + 0h - 4 - 4h. What is k(0)? -4 Let f(a) = -a*3 + 5a*2 - 6a. Let b = 0 + 2. Let y(m) = m*3 - 2m. Let q be y(b). Determine f(q). -8 Suppose 0 = 2i - 0i. Suppose io + 5 = -o. Let u(x) = x2 + 6x + 6. Calculate u(o). 1 Let o(g) = 4g2 - g3 - 19 - 3g - 5g2 + 20 + 2g. Suppose 3h - 10 = 2. Let p(z) = -z + 4. Let r be p(h). What is o(r)? 1 Let g(i) = 23708 - 6i - 23708. Let s(u) = u*2 + 6u + 2. Let t be s(-6). Calculate g(t). -12 Let r(w) = 2w2 - 4w - 1. Suppose 3f - 7 = 5. Give r(f). 15 Let m be 4/2 + -3 - 4/(-2). Let v(o) be the first derivative of -1/3o*3 + m + 3/2o*2 + 3o. Determine v(5). -7 Let d(r) = -r*3 - 7r*2 - r - 5. Let h be d(-7). Suppose 3i - 1 = h. Let a(l) = -5 + 5 - 7l2. Calculate a(i). -7 Let h(z) = 2z + 3 - 6z - 5 + 0. Give h(-2). 6 Let j = 61 + -54. Let b(u) = -u + 6. Calculate b(j). -1 Let r be 15/(-2)4/(-6). Let u(d) = d*3 - 6d*2 + 5d + 2. Let n be u(r). Let c(i) = i*3 - 3i*2 + 2i + 1. Give c(n). 1 Let g(x) = 2x + 6. Let p(d) = d2 - 7d + 6. Let j be p(4). What is g(j)? -6 Let h(a) = -a*3 + 13a*2 + 16a - 21. Let d be h(14). Let r(n) = -n*2 + 6n + 9. What is r(d)? 2 Let f(c) be the first derivative of 4/3c3 - 1/4c*4 + 2 + 5c - c2. What is f(4)? -3 Let i(j) = j2 - 9j + 20. Let g be i(8). Suppose -7p + 4p = g. Let a(w) = w3 + 3w*2 - 2w + 4. Give a(p). -4 Let b(o) = -846 + 846 + 6o. What is b(-1)? -6 Let x(j) be the first derivative of 3j2/2 + j + 3. Give x(-1). -2 Let v(h) be the third derivative of -h5/120 - h4/6 - h3/2 - 2h2. Let l(c) be the first derivative of v(c). Calculate l(0). -4 Let z(m) = m + 6. Let l = 9 - 15. Calculate z(l). 0 Let o be 40/6 - (-4)/(-6). Suppose -t = -m + o, -m + 15 = -4t - 3. Let c(y) = 2y3 - 3y*2 + 2y + 2. Determine c(m). 10 Let y(v) = -1. Let k(h) = 3h - 7. Let i(n) = -k(n) + 2y(n). Let t = -9 + 0. Let z be ((-24)/9)/(6/t). What is i(z)? -7 Let w(g) be the second derivative of -5g3/3 + 11g. Suppose 0 = -5o + 2p + 13, 0o + p = 4o - 8. Calculate w(o). -10 Let t(i) = -3i2 - 3i - 1. Let p be t(-2). Let m(v) = -v + 2. Give m(p). 9 Let t(k) = k*3 + 8k*2 + 15k + 14. Let v be t(-6). Let c(d) = -4d - 2. Let i(l) = -l. Let n(r) = -c(r) + 6i(r). Give n(v). 10 Let k(h) = -3 - 2h2 + h3 + 5h + 2 - 8h. What is k(-2)? -11 Let p(l) = l3 - 2l*2 - l + 2 + 2 + 3l2. What is p(0)? 4 Let s(r) be the first derivative of r4/4 + 5r3/3 - 7r*2/2 - 3r - 17. Determine s(-6). 3 Let z be ((-2)/(-12)-4)/((-3)/27). Let c(j) = -j + 2. Let m be c(1). Let q(t) = t - m + 0 - 2. Determine q(z). 3 Let h(q) = q2 - q - 1. Suppose -3c = 15 - 3. Let r(z) = z + 7. Let p be r(c). Calculate h(p). 5 Let u(t) = -4t + 4. Let f(w) = -w + 1. Let z(g) = -g + 1. Let y(o) = 6f(o) - 3z(o). Suppose -2a + 7 = -3. Let b(v) = au(v) - 6y(v). Determine b(-2). 6 Let y(a) = -6a - a + 8 + a2 + 0 + 0a*2. Let n be y(6). Let b be 0/((-2)/n-2). Let v(q) = q3 + q2 + 9. Give v(b). 9 Suppose -3r = -4r. Let l be 0 - (6/1 + r). Let a(o) = o + 3. Give a(l). -3 Let p(m) be the first derivative of m*2/2 + m + 1. Let a(z) = 4z + 9. Let r(i) = a(i) - 3p(i). Calculate r(0). 6 Let q(g) = -4g - 2. Let k(p) = -3p + 0 + 12p + 3. Suppose 5a - 15 = 4x, -3a - 2x + 9 =	{ "pile_set_name": "DM Mathematics" }
4, 746 Let -11c3 - 78c*2 - 73c - 6 = 0. Calculate c. -6, -1, -1/11 Let -2f4/9 + 2f*3 - 26f*2/9 - 10f + 100/9 = 0. What is f? -2, 1, 5 Factor w*3/2 + 3w*2 + 11w/2 + 3. (w + 1)(w + 2)(w + 3)/2 Factor 3m5 + 3m*4 - 9m*3 - 3m*2 + 6m. 3m(m - 1)*2(m + 1)(m + 2) Find v, given that 4v*5/7 + 24v*4/7 - 80v*3/7 - 120v*2/7 + 76v/7 + 96/7 = 0. -8, -1, 1, 3 What is t in -3t4/5 + 123t*3/5 - 696t*2/5 - 13248t/5 + 13824/5 = 0? -8, 1, 24 Find w such that w*2/3 + 23w/3 - 8 = 0. -24, 1 Suppose -17l3 - 15l*2/2 + 26l - 3/2 = 0. Calculate l. -3/2, 1/17, 1 Factor 6g2/5 - 1752g/5. 6g(g - 292)/5 Factor -p*4/2 - 82p3. -p3(p + 164)/2 Factor 2u*2 - 92u. 2u(u - 46) Determine a, given that -2a3 - 3708a*2 - 2291544a - 472058064 = 0. -618 Factor -4l3 + 788l*2 + 800l - 1584. -4(l - 198)(l - 1)(l + 2) Solve 5a*5 - 1010a*4 + 44645a*3 + 635900a*2 + 2679280a + 3663680 = 0. -4, 107 Let -2y3 - 6y*2 + 2y + 6 = 0. Calculate y. -3, -1, 1 Factor -5n3 + 65n*2 - 115n + 55. -5(n - 11)(n - 1)*2 Factor -3t*4 + 2487t*3 + 4986t*2. -3t*2(t - 831)(t + 2) Factor -u4/5 + 2u*3/5 + 7u*2/5 + 4u/5. -u(u - 4)(u + 1)*2/5 Determine f so that 5f*4/2 - 20f*3 - 55f*2/2 + 45f = 0. -2, 0, 1, 9 Factor 3s4 + 216s*3 + 3186s*2 - 25272s + 41067. 3(s - 3)2(s + 39)2 Find g such that g4/4 - 113g3/4 + 3357g*2/4 - 9295g/4 + 3025/2 = 0. 1, 2, 55 Factor 4z4 - 92z*3 - 300z*2 - 308z - 104. 4(z - 26)(z + 1)*3 Let 153l*2/5 + 147l/5 - 6/5 = 0. What is l? -1, 2/51 Find l such that l*3 + 2l*2/3 - l/3 = 0. -1, 0, 1/3 Solve -722p*2 + 76p - 2 = 0. 1/19 Let -57s2 + 51s + 6 = 0. Calculate s. -2/19, 1 Factor 3u2/2 + 15u + 24. 3(u + 2)(u + 8)/2 Solve -5i3 + 455i*2 - 450i = 0 for i. 0, 1, 90 Factor -s*2/4 - 5s/2 + 6. -(s - 2)(s + 12)/4 Factor -4a*2 - 34a + 18. -2(a + 9)(2a - 1) Factor 3j*3/7 - 6j*2/7 - 72j/7. 3j(j - 6)(j + 4)/7 Factor 4o*2/5 + 4o + 24/5. 4(o + 2)(o + 3)/5 What is x in x*2/3 + 324x + 78732 = 0? -486 Determine l so that l*4/6 - 3l3/2 + l2/2 + 89l/6 - 14 = 0. -3, 1, 4, 7 Factor 4z*5 + 8z*4 - 16z*3 - 8z*2 + 12z. 4z(z - 1)*2(z + 1)(z + 3) Factor -60p*2 - 123p - 6. -3(p + 2)(20p + 1) Find j, given that 14j*5/5 - 128j*4/5 + 118j*3/5 + 92j*2/5 - 96j/5 = 0. -6/7, 0, 1, 8 Solve g*3 - 345g*2 = 0 for g. 0, 345 Determine w so that 48w*4 + 72w*3 - 45w*2 + 6w = 0. -2, 0, 1/4 Suppose 2o4 + 66o*3 - 296o*2 = 0. What is o? -37, 0, 4 Find y, given that 4y*5/3 + 28y*4/3 + 20y*3 + 12y*2 = 0. -3, -1, 0 Factor 3t*3 - 213t*2 + 210t. 3t(t - 70)(t - 1) Solve g3/5 - 13g*2/5 - 52g/5 + 64/5 = 0 for g. -4, 1, 16 Suppose 2t4/7 - 678t*3/7 + 2022t*2/7 - 2018t/7 + 96 = 0. Calculate t. 1, 336 Let 3d3/7 + 54d*2 + 1476d/7 + 1464/7 = 0. Calculate d. -122, -2 Factor m*2/5 + 68m/5 + 67/5. (m + 1)(m + 67)/5 Find f such that -8f*5/3 + 26f*4/3 + 386f*3/3 + 358f*2/3 - 326f + 72 = 0. -4, -3, 1/4, 1, 9 Find s, given that -5s5 + 545s*4 - 11495s*3 - 186645s*2 - 336600s - 162000 = 0. -9, -1, 60 Factor 2c3/17 - 104c*2/17 + 1352c/17. 2c(c - 26)*2/17 Solve 243a*2/4 + 4509a/2 + 83667/4 = 0. -167/9 Solve 64o3 + 192o*2 - 196o - 60 = 0 for o. -15/4, -1/4, 1 Factor 3t3 + 72t*2 - 327t + 252. 3(t - 3)(t - 1)(t + 28) Determine j, given that -2j*4 + 29j*3/4 - 3j*2 - 9j/4 = 0. -3/8, 0, 1, 3 Factor -2o2/9 + 2o. -2o(o - 9)/9 Factor 5m2 + 915m - 920. 5(m - 1)(m + 184) Factor -9o3 - 1392o*2 - 924o. -3o(o + 154)(3o + 2) Factor -3t2 - 1140t - 2268. -3(t + 2)(t + 378) Solve 2h3/11 - 8h*2 + 466h/11 - 380/11 = 0. 1, 5, 38 Determine t, given that t*4 + 35t*3/4 - 73t*2/4 - 56t + 15 = 0. -10, -2, 1/4, 3 Let -i*5 - 21i*4 = 0. Calculate i. -21, 0 Let 180f*5 + 485f*4 + 1135f*3/3 + 25f*2 - 45f + 10/3 = 0. Calculate f. -1, 1/12, 2/9 Factor x*3 - 185x*2 - 188x + 372. (x - 186)(x - 1)(x + 2) Factor -3p4/2 + 13p3/2 - p2 - 4p. -p(p - 4)(p - 1)(3p + 2)/2 Suppose -30u*2/11 - 12u/11 = 0. What is u? -2/5, 0 Suppose b*2/4 - 15b/4 - 225/2 = 0. What is b? -15, 30 Determine o so that -2o4 - 4o*3 + 6o*2 + 16o + 8 = 0. -2, -1, 2 Determine b, given that 5b4 + 5b*3 - 60b*2 - 140b - 80 = 0. -2, -1, 4 Suppose -4u4 - 84u*3 + 188u*2 + 84u - 184 = 0. Calculate u. -23, -1, 1, 2 Factor 2v3/13 + 2v*2/13 - 20v/13 + 16/13. 2(v - 2)(v - 1)(v + 4)/13 Determine t, given that -64t*2/3 + 496t/3 - 961/3 = 0. 31/8 Let -6t2/11 + 156t/11 - 150/11 = 0. Calculate t. 1, 25 Let -3v4/2 - 3v*3/2 + 33v*2/2 + 27v/2 - 27 = 0. Calculate v. -3, -2, 1, 3 Determine y so that 5y5 + 830y*4 + 32740y*3 - 141950y*2 + 108375y = 0. -85, 0, 1, 3 Find n, given that 42n4 + 165n*3/2 - 6n*2 - 6n = 0. -2, -1/4, 0, 2/7 Solve -h*4/6 + 2h*3/3 + 9h*2/2 + 19h/3 + 8/3 = 0 for h. -2, -1, 8 Solve 5n2/4 + 295n + 17405 = 0 for n. -118 Factor 2a3/3 + 304a*2/3 + 602a/3 + 100. 2(a + 1)2(a + 150)/3 Solve -f*3/3 - 500f*2 - 250000f - 125000000/3 = 0. -500 Let -4k4 - 50304k*3 - 237233664k*2 - 497241759744k - 390832023158784 = 0. Calculate k. -3144 Factor o*3 + 8o*2 + 17o + 10. (o + 1)(o + 2)(o + 5) Let 2b5/3 + 38b*4/3 - 83b*3/6 - 28b*2/3 + 79b/6 - 10/3 = 0. Calculate b. -20, -1, 1/2, 1 Factor 6h2/5 - 9048h/5 + 3411096/5. 6(h - 754)2/5 Solve 50y*5/3 - 590y*4/3 - 1513y*3/2 - 1936y*2/3 - 643y/6 - 5 = 0. -2, -1, -1/10, 15 Suppose g*4/2 - 21g*3/4 + 69g*2/4 - 14g - 12 = 0. What is g? -1/2, 3, 4 Factor 3q2 + 147q. 3q(q + 49) Determine r, given that -3r3 + 48r*2 - 123r + 78 = 0. 1, 2, 13 Factor -2o3 - 14o*2 - 20o. -2o(o + 2)(o + 5) Find s, given that 4s*3 - 8s*2 - 4s + 8 = 0. -1, 1, 2 Factor -a*4/5 - 778a*3/5 - 40248a*2 - 3434080a + 7030400. -(a - 2)(a + 260)3/5 Solve -4k*3 + 464k*2 + 2928k = 0. -6, 0, 122 Suppose -o*4/3 + 149o*3/3 + 301o*2/3 + 151o/3 = 0. What is o? -1, 0, 151 Find t such that 3t4/2 + 78t*3 + 246t*2 - 1968t + 2304 = 0. -48, -8, 2 Factor 3b2/5 + 732b/5 + 1452/5. 3(b + 2)(b + 242)/5 Factor -5w2 + 14380w - 10339220. -5(w - 1438)2 Find j, given that j2 + 193j + 1830 = 0. -183, -10 Factor -q*4/7 + 24q*3/7 - 198q*2/7 + 648q/7 - 729/7. -(q - 9)*2(q - 3)2/7 Factor -s2/5 + 2264s/5 - 1281424/5. -(s - 1132)2/5 Factor -189u*3/5 - 3408u*2/5 - 15417u/5 - 486/5. -3(u + 9)2(63u + 2)/5 Suppose -3o*2 + 78o - 507 = 0. Calculate o. 13 Suppose n*2/8 + 15n - 61/2 = 0. Calculate n. -122, 2 Factor -5w4 - 425w*3 + 1755w*2 - 2215w + 890. -5(w - 2)(w - 1)*2(w + 89) Determine s, given that -s*5 + 13s*4 + 17s*3 - 37s*2 - 68s - 28 = 0. -1, 2, 14 Factor -2h4/7 + 14h*3 - 282h*2/7 + 278h/7 - 92/7. -2(h - 46)(h - 1)3/7 Determine k so that k4 + 65k3 + 1086k*2 + 896k - 2048 = 0. -32, -2, 1 Determine h, given that 2h4 + 46h*3 - 156h*2 = 0. -26, 0, 3 Find u, given that 11325u*3 - 22660u*2 + 11345u - 10 = 0. 2/2265, 1 Solve 8q4 - 138q*3 + 34q*2 = 0. 0, 1/4, 17 Factor -2m*3/5 - 36m*2/5 - 162m/5. -2m(m + 9)*2/5 Factor 3p*4 - 21p*3 + 39p*2 + 9p - 54. 3(p - 3)2(p - 2)(p + 1) Solve -114q*4/5 + 297q*3/5 - 87q*2/5 - 108q/5 + 12/5 = 0 for q. -1/2, 2/19, 1, 2 Factor -3a3 - 738a*2 - 45387a. -3a(a + 123)*2 Let -16f*5 - 172f*4 + 696f*3 - 476f*2 - 368f + 336 = 0. What is f? -14, -3/4, 1, 2 Determine o so that o*2/7 - 284o/7 - 572/7 = 0. -2, 286 Solve -h*3 - 34h*2 - 33h = 0. -33, -1, 0 Suppose -2b2 + 228b - 6498 = 0. Calculate b. 57 Factor -z*5/5 - 2z*4/5 + 2z*2/5 + z/5. -z(z - 1)(z + 1)3/5 Factor 5m*2 - 80m. 5m(m - 16) Let 2p5/9 - 14p*3/9 + 4p*2/3 = 0. Calculate p. -3, 0, 1, 2 Solve 20h*2 - 48h = 0. 0, 12/5 Factor -k*3/7 - 12k*2/7 - 41k/7 - 6. -(k + 2)(k + 3)(k + 7)/7 Let 2g4 + 2014g*3 + 2002g*2 - 10054g + 6036 = 0. What is g? -1006, -3, 1 Find u such that u*3/9 + 8u*2/3 + 59u/9 - 28/3 = 0. -21, -4, 1 Find b such that -2b4/7 - 2258b*3/7 = 0. -1129, 0 Suppose 12y*5 + 8y*4 - 228y**	{ "pile_set_name": "DM Mathematics" }
1/2 b Which is the smallest value? (a) 3 (b) -3 (c) -0.31 b Which is the second smallest value? (a) -1.3 (b) 1 (c) -3 (d) -5 c What is the third smallest value in -29, -0.071, 2? 2 What is the smallest value in -2/9, -1/21, 3/4, -3/4? -3/4 What is the smallest value in -0.7, -5, 1? -5 Which is the fifth biggest value? (a) 2 (b) 0.3 (c) -83 (d) 1 (e) -4 c Which is the fourth biggest value? (a) -0.4 (b) -0.2 (c) -8 (d) 2/13 c Which is the third smallest value? (a) 1 (b) -0.24 (c) 7 c Which is the third smallest value? (a) 1/2 (b) 28 (c) 2/5 (d) 0 a Which is the fourth biggest value? (a) 2/9 (b) 4 (c) -0.1 (d) -0.23 d What is the second smallest value in 1/11, -11/4, 9? 1/11 What is the third biggest value in 1/2, -4, 0.4, 1? 0.4 What is the third smallest value in 2.2, -2/17, -5, 3, -2/21? -2/21 Which is the smallest value? (a) -0.2 (b) 2/5 (c) 3/10 a What is the smallest value in -21/82, 4, 2? -21/82 Which is the fourth smallest value? (a) 2/31 (b) 0.013 (c) 2/3 (d) -2/13 (e) 2/15 e What is the second biggest value in -3/7, -5, -52, -0.1? -3/7 Which is the second smallest value? (a) 5 (b) -0.02 (c) -2.8 (d) -0.4 d Which is the second biggest value? (a) 3/2 (b) -0.04 (c) -1.1 b What is the second smallest value in 2/7, -1, -4, -1/195? -1 Which is the second biggest value? (a) 0.8 (b) 393/4 (c) 3/5 a Which is the biggest value? (a) -0.18 (b) 3/8 (c) 2/9 (d) -3 (e) 0 b Which is the biggest value? (a) -62 (b) -0.2 (c) 1 (d) -5 (e) -6/5 c Which is the smallest value? (a) -9 (b) 2 (c) 3/416 a What is the third biggest value in -5/2, -2.3, -3/2, -25? -5/2 Which is the third smallest value? (a) 3/4 (b) -31.6 (c) 1 (d) 3 c Which is the fourth smallest value? (a) -0.2 (b) -2 (c) -1/7 (d) -5 (e) 4/19 c Which is the smallest value? (a) 2/13 (b) 3/17 (c) -0.1 (d) 0.28 c What is the second smallest value in 2, 4/51, -5.5? 4/51 Which is the third biggest value? (a) 2/7 (b) 1/42 (c) 0.3 b Which is the biggest value? (a) -2 (b) 0.24 (c) -0.07 (d) 1 d What is the third smallest value in 3, 154.4, 4? 154.4 Which is the fourth smallest value? (a) -19 (b) -3 (c) -12 (d) 3 (e) 0 e What is the third smallest value in -2, 2/9, 3.8, 0.3? 0.3 Which is the fourth biggest value? (a) 29 (b) 3/2 (c) 3/5 (d) 4/7 d What is the third smallest value in 1, -0.2, -5.2, 2? 1 Which is the second biggest value? (a) -689 (b) -0.1 (c) -5 c Which is the biggest value? (a) 27 (b) -2/15 (c) -1/2 (d) -0.8 a Which is the second biggest value? (a) -0.2 (b) 5/6 (c) 1/3 (d) 1 b What is the biggest value in -0.2, 29, 2, 4/5? 29 What is the biggest value in -3, -1/2, -81? -1/2 What is the second smallest value in -0.048, -5, 2? -0.048 Which is the second biggest value? (a) 5 (b) -2.3 (c) 74 (d) -2/3 a What is the second biggest value in -17, 5/4, 0.2, 7? 5/4 What is the smallest value in 1/2, -15/13, 3, -0.3, -0.6? -15/13 What is the third smallest value in -1/2, -4, -10? -1/2 What is the third biggest value in -0.1, -2/3, 4, -13? -2/3 Which is the third smallest value? (a) -1 (b) 1.63 (c) -3/7 b Which is the biggest value? (a) 4 (b) -0.4 (c) 0 (d) 2/5 (e) -0.61 a What is the second smallest value in 0.7, 3, 2/5? 0.7 Which is the fourth smallest value? (a) -8 (b) 0.054 (c) 0.5 (d) -5/3 c Which is the biggest value? (a) 5 (b) -0.1 (c) 437 c What is the biggest value in -1/2, -0.3, 21? 21 Which is the biggest value? (a) -5/3 (b) -13 (c) 3/5 c Which is the third smallest value? (a) 0.3 (b) -0.04 (c) 165 (d) -0.3 a What is the third biggest value in 0.13, -8, 5, -0.1, 2/7? 0.13 What is the third biggest value in 16257, 2, -0.5? -0.5 Which is the smallest value? (a) 3/13 (b) 2 (c) 3 (d) 0.2 d Which is the second biggest value? (a) 0.2 (b) -0.5 (c) 30 a What is the second biggest value in 0.5, 2/329, -4? 2/329 What is the third biggest value in 2, -18.8, 0.4? -18.8 What is the third smallest value in -0.3, 1, -0.2, 0.3, 14? 0.3 Which is the fourth biggest value? (a) -0.3 (b) 4 (c) -0.5 (d) 5 c What is the fourth smallest value in 0.6, -2/5, 4, -5.33? 4 What is the second smallest value in -2/7, 0.07, -2/13, -25, -3/7? -3/7 What is the smallest value in -1/2, -2/5, 6, 8? -1/2 Which is the smallest value? (a) 0.2 (b) 195 (c) 37 a Which is the third biggest value? (a) -1/4 (b) 3/7 (c) -233 c What is the fourth smallest value in -0.03, 0.4, -3, 0.1? 0.4 What is the third biggest value in -0.2, 0.005, 3? -0.2 What is the second smallest value in -10, -2, -8, 4, 1/4? -8 Which is the biggest value? (a) -2 (b) 6 (c) 4/3 (d) 0.2 b Which is the second smallest value? (a) -1 (b) -4 (c) 2/209 (d) -0.5 a Which is the biggest value? (a) -58 (b) 0.5 (c) 45 c What is the second smallest value in -2.26, 5, -2? -2 Which is the third smallest value? (a) 5 (b) 62 (c) 1/5 b What is the second biggest value in -243, -2, 2, -0.4? -0.4 What is the biggest value in 0.5, 141, -3/5? 141 Which is the biggest value? (a) -2/11 (b) 2.6 (c) 2/17 b What is the biggest value in 1/5, 3, 6/59? 3 What is the smallest value in -2/19, -6, -4, 75? -6 What is the third biggest value in 0, -0.4, -53? -53 Which is the fifth smallest value? (a) 0.3 (b) 2/3 (c) -2 (d) -0.6 (e) 5 e Which is the second smallest value? (a) -3/13 (b) 4 (c) 1/10 c What is the smallest value in -22, 2, -2/9? -22 What is the second biggest value in -2/9, 1/22, 0.2? 1/22 What is the third smallest value in -0.3, 1.12, -4, 1? 1 What is the biggest value in 573, -5, -2? 573 What is the biggest value in 0.07, -4/5, 4, 0.3? 4 Which is the second biggest value? (a) -10/11 (b) 5 (c) 0.2 c What is the fourth smallest value in -5, 1/11, 0.11, -4, -3/5? 1/11 What is the second biggest value in -9, -7, 82? -7 What is the second smallest value in 378, 3, -2, -0.2? -0.2 Which is the second biggest value? (a) -3 (b) -1.32 (c) 0 b What is the second biggest value in -1, 0.4, 0, -6? 0 Which is the third smallest value? (a) 5 (b) -4/3 (c) 0.3 (d) 2/9 c What is the third smallest value in 0, 4/29, 1? 1 What is the third biggest value in 3, -2/7, -1/5, -3/5? -2/7 What is the second biggest value in 3, 5, 5.7? 5 Which is the third biggest value? (a) -1/5 (b) 2/5 (c) 9 (d) 2 b Which is the third biggest value? (a) 5/78 (b) 2/3 (c) 2 a What is the smallest value in -4/5, 2/9, 1633? -4/5 Which is the second smallest value? (a) -4 (b) -2 (c) 5/3 (d) -87/2 a Which is the third biggest value? (a) -13 (b) -6 (c) 1/9 (d) 0.01 b Which is the fourth smallest value? (a) 3/7 (b) 2/23 (c) -0.1 (d) -3/2 (e) 3/11 e What is the biggest value in -1, 1, 1/1571? 1 What is the biggest value in -0.7, -2059, -5? -0.7 What is the smallest value in 0.3, -182, 5? -182 Which is the second biggest value? (a) -1/27 (b) 3/4 (c) -4 (d) 21 b Which is the second smallest value? (a) -1041 (b) -2 (c) 5 b What is the smallest value in 0.1, -1/6, -4/7? -4/7 Which is the fifth biggest value? (a) -1/5 (b) 1 (c) -63 (d) -4 (e) 0 c Which is the second smallest value? (a) 0.3 (b) -0.1 (c) 0.61 a Which is the third biggest value? (a) 1/4 (b) 1/10 (c) -7 (d) -3 d What is the smallest value in 30, 2, -6? -6 What is the smallest value in 0, 1.5, 13/4? 0 Which is the third biggest value? (a) 0.3 (b) 1/2 (c) 4 (d) -249 (e) 2/17 a What is the second biggest value in 4, -2, 2/3, -2.5? 2/3 Which is the third biggest value? (a) -1/3 (b) 4 (c) -1 (d) -10 c What is the smallest value in 0.6, -5, -0.31? -5 Which is the third smallest value? (a) 0 (b) -5 (c) -0.124 a Which is the third smallest value? (a) -12 (b) -2 (c) 0.4 (d) -0.3 d What is the smallest value in 0.5, 0.1, -7, 9, 0.4? -7 What is the biggest value in -119, 1, 3/5, 0? 1 Which is the smallest value? (a) -1/7 (b) -4 (c) 24.9 b What is the third biggest value in 0.034, 3, 1/2? 0.034 What is the third smallest value in 1, -571, 0, -1/5? 0 What is the third smallest value in -15, 2/13, -7/3, -0.2, 5/3? -0.2 Which is the smallest value? (a) 4 (b) 137 (c) -2 c Which is the second smallest value? (a) -5 (b) -857 (c) 0.2 a Which is the second smallest value? (a) 0.5 (b) -3/5 (c) 1/4 (d) 50 c What is the second smallest value in 1/4, -15/38,	{ "pile_set_name": "DM Mathematics" }
n(v) + 6t(v)? -5v2 Let i(q) = 5q*3 - 4q*2 - 9q. Let j(l) = l3 - l2 - 2l. Let k be 36(-1 + 8/16). Give kj(h) + 4i(h). 2h3 + 2h*2 Let n(o) = -o + 5o + 2o - 2o - 6o3. Suppose 2w + 5t - 25 = 0, -3w + 11 = 3t - 13. Let y(b) = -3b*3 - wb + 8b3 + 2b*3. What is 6n(i) + 5y(i)? -i3 - i Let a(q) = q3 + q2 + q + 1. Let b(x) = 23x3 + x2 + x + 4. Calculate -a(n) + b(n). 22n3 + 3 Let d(v) = -v - 1. Suppose 4o - 57 - 35 = -3b, 4b - 2o = 108. Suppose 0 = 2i + 32 - b. Let g(p) = p*2 + 3p + 2. Determine ig(h) - 7d(h). -2h2 + h + 3 Let m(x) = 5x - 15. Let q(f) = -6f + 17. Let i(c) = -7m(c) - 6q(c). Let k(u) = 2u + 5. Give 10i(n) - 6k(n). -2n Let u(s) = -30s*2 - 19s + 24. Let w(a) = 17a2 + 9a - 13. Determine 6u(r) + 11w(r). 7r2 - 15r + 1 Suppose 0 = -3x - 8 - 43. Let y(l) be the third derivative of 7l*4/12 + 11l*3/6 + 1288l*2. Let h(z) = 5z + 4. Calculate xh(c) + 6y(c). -c - 2 Let m be ((-6)/(-3))/(2/(-4)). Let s(g) = -g. Let v(h) = h3 + h2 - 4h - 3. Determine ms(k) + v(k). k3 + k2 - 3 Let x(z) = 7z3 - 5. Let t(a) = 7a3 - a3 - 2a3 - 3. Suppose -7j = -6 - 1100. Let u = -163 + j. Give ut(q) + 3x(q). q*3 Let w(c) = 3c2 + c. Let x(t) = -t2 + 16t. Calculate 3w(h) - x(h). 10h2 - 13h Let j(g) = -7g3 - 3g*2 + 3. Suppose 5 + 13 = 6s. Suppose 3p - 36 + 12 = 0. Let w(o) = 20o*3 + 8o*2 - 8. Calculate pj(a) + sw(a). 4a*3 Let r be 37(5/1 + -2). Let g be r/(-21) - 2/(-7). Let i(w) = -7w2 - w + 3. Let l(s) = -10s*2 - s + 4. Calculate gl(t) + 7i(t). t2 - 2t + 1 Let q(x) = -2. Let h(a) = 21 - 15 - 2a + a - 9. Suppose 0 = 5g + 4y - 35, g - 4y + 11 + 6 = 0. Give gq(i) - 2h(i). 2i Let g(v) be the first derivative of -15v - 35/2v2 - 9. Let d(m) = 9m + 4. What is 15d(w) + 4g(w)? -5w Let m(w) = -28w - 5. Let f(d) = -d + 1. Calculate -2f(t) - m(t). 30t + 3 Let a(t) = 9t + 5. Suppose -5d + 5i + 21 + 14 = 0, -4d + 14 = 3i. Let z(k) be the first derivative of -5k*2 - 6k + 1. Give dz(s) + 6a(s). 4s Let d(w) = 2w + 14. Let n(x) = 3x3 - x2 - x. Let h be n(-1). Let r(k) = k + 7. Let f(j) = hd(j) + 7r(j). Let p(o) = -2o - 13. What is 7f(v) + 4p(v)? -v - 3 Let q be 19/(-5) - 6/30. Let p be (-4 - q)/(4 - 2). Let s(d) = 4 + 3d2 + 4d*2 + 4d + pd2. Let v(z) = -20z*2 - 11z - 11. Calculate 17s(n) + 6v(n). -n*2 + 2n + 2 Let a(d) = -d*2 - 2d + 7. Let y(b) = -b*2 + 10. Determine -4a(k) + 3y(k). k2 + 8k + 2 Let f(r) = -114r - 148r - 3r3 - 1 + 261r + 2r3. Let d(c) = 8c*3 + 2c - 1. Determine -d(x) - 2f(x). -6x3 + 3 Let l(k) = k2 - 3k + 2. Let q(x) = -6x*2 + 16x - 11. Let s = -74 + 42. Let n = s - -30. What is nq(a) - 11l(a)? a*2 + a Let f(j) = 7j*3 - 5j2 + 5. Let b(a) = a2 - 1. Let u be -5 - (-1 - 2) - (1 + 2). Give ub(k) - f(k). -7k*3 Let c(a) = 21a + 5. Let f(o) = 2o + 1. Give -c(i) + 4f(i). -13i - 1 Let m = 90 + -74. Let d(h) = -mh + 274 - 274. Let j(z) = z. Determine -d(w) - 12j(w). 4w Let n(f) = f*2 - 7f - 7. Let j(l) = 0 - 64l + 201l - 65l + 2 - 70l. Determine -7j(q) - 2n(q). -2q2 Let f(y) = -5125y. Let k(l) = -394l. What is 3f(j) - 40k(j)? 385j Suppose -12r + 232 = 268. Let h(w) = -5w. Let o(v) = 11v + 1. Let c be (-1)/(-2) + (-15)/2. Give ch(m) + ro(m). 2m - 3 Let k(b) = -72b3 - 2b. Let i(r) = -r*3. What is 2i(q) + k(q)? -74q3 - 2q Let j(z) = z*2 - z - 1. Let k(h) = 5h*2 - 13h - 1. Give 2j(m) - k(m). -3m*2 + 11m - 1 Let o(b) = -7b + 4. Let f(g) = g - 1. Let k(z) = 6f(z) + o(z). Let j = 813 - 816. Let t(n) = n + 1. Determine jt(u) - k(u). -2u - 1 Let s(u) = 17u3 + 6u*2 - 6u + 10. Let f(j) = 34j3 + 14j*2 - 14j + 22. What is -3f(x) + 7s(x)? 17x3 + 4 Let q(c) = 5c*3 + 2c*2 - 3c + 18. Let d(u) = 11u3 + 5u*2 - 7u + 36. Give -6d(r) + 14q(r). 4r3 - 2r*2 + 36 Let t(v) = v - 1. Let l(k) = -2k + 1. Let u be l(2). Let p(q) = q - 2. Suppose 4981r = 4971r + 10. What is rp(y) + ut(y)? -2y + 1 Let j be 1/(-4)(-6 + -2). Suppose -jr = -2 + 12. Let f(y) = -6y. Let d(w) be the third derivative of w*4/8 + 9w*2. Give rf(h) - 9d(h). 3h Let j(y) = 10y3 - 3y2 - 4. Let l(v) = v3 + 2. Let c(t) = -j(t) - 2l(t). Let i(x) = 84x*3 - 20x*2. Determine 20c(u) + 3i(u). 12u*3 Let w(x) = -7x*2 - x + 5. Let d(a) = -14a*2 - 2a + 9. Give 3d(h) - 5w(h). -7h2 - h + 2 Suppose -17r + 13r + 12 = 0. Let n(c) = -c + 4c - 4c. Let w(t) = -2t. Determine rn(o) - 2w(o). o Let d(y) = 7y2 - 6y. Let s(k) = -8k2 + 7k. Let v = -97 - -97. Let h(m) = -m*2 - 2m - 6. Let g be h(v). Calculate gs(j) - 7d(j). -j*2 Let x(z) = -1. Let l(v) = -36v + 13v + 20v - 2 - 1 + 14v. Give l(b) - 3x(b). 11b Suppose -7i - 82 = -131. Let m(x) = -x*2 + x - 2. Let v(f) = -3f*2 + 4f - 7. Determine im(n) - 2v(n). -n*2 - n Let m(d) = 2d*3 - 5d*2 - 5d - 6. Let k(y) = -y3 + y2 + y - 1. Give -5k(w) - m(w). 3w*3 + 11 Let z = -25 - -47. Suppose 0 = g + 2, -2l - l + z = g. Suppose 5a - 21 = la. Let r(k) = 2k2 - 3k. Let h(v) = 4v2 - 7v. Determine ar(d) + 3h(d). -2d2 Let t be (-20)/(-90) - (-2)/(-9). Let v(y) = y + ty - 4 + 0 + 3. Let r(i) = 1 + 1 + 0i - 6i + 4i. Determine 3r(n) + 8v(n). 2n - 2 Let a(j) = -4j3 - j2 + 6j - 2. Let v(q) = -11q3 - 3q*2 + 18q - 7. Determine -8a(z) + 3v(z). -z3 - z2 + 6z - 5 Let q(h) = 7h*2 - 3h - 3. Let y(u) = -6u2 + 4u + 1. Calculate 4q(d) + 3y(d). 10d2 - 9 Let l(t) = -t2 - 7. Let u be -4 + (-7)/7 + 3. Let g(y) = 6y*2 + 35. Give ug(k) - 11l(k). -k2 + 7 Let k(t) = t - 1. Let y(w) = -w2 + 6w - 4. Let r(d) = -2d + 1. Let i(f) = 5r(f) + y(f). Give -i(m) - 2k(m). m2 + 2m + 1 Suppose -4 = -4o + 12. Suppose -3s + s + o = 0. Let f(t) = -4t - 2. Let w(m) = m + 1. Give sf(n) + 4w(n). -4n Let b(h) = 10h + 1. Let s(o) be the first derivative of -9o*2/2 - 207. Calculate 2b(z) + 3s(z). -7z + 2 Let c(h) = 2h + 6. Let k(a) = 1. Give -2c(s) + 14k(s). -4s + 2 Let k(x) = -2x3 + x2 - x - 1. Let z(c) = 8c*3 - 6c*2 + 3c + 40. What is 5k(b) + z(b)? -2b3 - b2 - 2b + 35 Let m(h) = 15h - 5. Let l(u) = -1. Let t(f) = -2l(f) + m(f). Let w(o) = 14o - 2. What is -3t(x) + 4w(x)? 11x + 1 Let a(l) = -2l*3 - 13l*2 + 4l. Let b(q) = -4q3 - 26q*2 + 7q. Give -11a(f) + 6b(f). -2f3 - 13f*2 - 2f Let n(o) = 4o2 + 7o + 6. Suppose v = 3b + 3, -5v + 3b + 25 + 2 = 0. Let z(g) = -g2 - 1 + 6 - v - g. Calculate n(c) + 6z(c). -2c2 + c Let h(m) = -4m*3 - m - 1. Let o(t) = t + 12. Let a be o(-9). Let n(x) = -3x*3 - x - 1. Let z = -21 - -19. Calculate an(v) + zh(v). -v3 - v - 1 Let p(i) = 6i3 - i2 + 4i + 2. Let d(g) = 2g3 + g2 + g. Calculate -2d(j) + p(j). 2j*3 - 3j*2 + 2j + 2 Let d(t) = -28t + 728. Let v(a) = 11a - 364. Calculate -2d(w) - 5v(w). w + 364 Let u(q) = 6q2 - 1. Let f(o) = -o - 11. Let i be f(-6). Let x(y) be the second derivative of -y4/3 + y2/2 - 126y + 4. Determine iu(m) - 8x(m). 2m2 - 3 Let u(z) = -3z3 - z2 + 2z - 1. Let m(w) = -w3 + w. Let k = 6 - 4. Let i be 8/(-3 + 11 - 10). Calculate im(y) + ku(y). -2y*3 - 2y*2 - 2 Suppose 6k + 5t = 4k + 25, 5k = 2t + 19. Let i(a) = -4a2 + 6a + 2. Let o(l) = -3l2 + 5l + 2. What is ko(z) - 4i(z)? z2 + z + 2 Let j(r) = r3 + r + 1. Let a(c) = -4c3 - 3c - 5. Give 2a(b) + 6j(b). -2b3 - 4 Let s(v) = 1 - 3 - 2v + 0. Suppose 5o + 2k + 0 - 15 = 0, -o + 3 = 4k. Let n(j) = -2j - 3. Calculate on(f) - 4s(f). 2f - 1 Suppose 5m - 4a - 28 = 0, 4 = 2m - 0m + 2a. Let r(i) = i3 + i2 + i. Let y(q) = 4q2 + 21q + 4 - 4 - 17q + 6q*3. Determine mr(k) - y(k). -2k3 Let d(o) = o2 - o. Let t(s) = 2s*2 - 2s + 1. Suppose 53 - 104 = 17x. What is xd(c) + 2t(c)? c2 - c + 2 Let i(c) = -c2. Let h(b) = 28b*2 - b - 2. Determine -h(p) - 5i(p). -23p2 + p + 2 Let k(a) = -a2 - 2a - 2. Let p(x) = 2x2 + 2x + 7. Give -4k(d) - p(d). 2d*2 + 6d + 1 Let l(g) = 12g - 112. Let o(n) = 2n - 17. Let f(s) = 3l(s) - 20o(s). Let c(j) = 9j - 9. Let b be (-2)/((-10)/6 + 1). Determine bc(a) + 7*f(a). -a +	{ "pile_set_name": "DM Mathematics" }
a prime number? True Suppose 0 = -2n - 3n + 5, -z + n = -2002. Is z a composite number? False Is (-57)/(-76)449556/9 prime? True Is ((-7469)/(-22) + -3)/((-1)/(-22)) a prime number? False Let h = 7 - 1. Suppose 2y = -0y + z + h, 5z + 15 = -5y. Is (y-1)/(5/(-665)) a composite number? True Let v = 3064 - -893. Is v prime? False Let l(n) = 8878n + 53. Is l(2) a composite number? True Is 162363(456/855 + 1/(-5)) a composite number? False Suppose -5t + 20 = 5y, 5t - 18 = -y - 3y. Suppose yh - 758 = 904. Is h prime? False Is (-3 + (-481 - -3))/(-1) composite? True Let w be 74/14 + 12/(-42). Suppose 792 = wj - m - m, -4m = 5j - 786. Let v = j - -33. Is v prime? True Suppose -13242 = -2x - 4d, x - 5d - 26471 = -3x. Is x a composite number? False Let v(p) = -22p - 34p - 2 + 25 - 6. Let i be v(7). Let w = i - -580. Is w prime? False Let h(p) = 48p2 + 3p - 22. Let s be h(6). Let m = -8 + 15. Suppose -s = mk - 4321. Is k prime? False Let f(b) = -177b - 29. Is f(-12) composite? True Is ((4 - 0)/(-4))/((-3)/32847) a prime number? True Let b be 1 + -12 + 790 + 6. Let h = b - -292. Is h a composite number? False Let u(i) = 11i*2 + 3i - 2. Let m(w) = 9w2 + 2w - 1. Let h(v) = 6m(v) - 5u(v). Let k = 4 - 7. Is h(k) prime? False Suppose 14 = 2a - 60. Let f = 51 - a. Is f a composite number? True Let s(f) = 2f*2 - 1. Let d be s(-2). Let z be d1 + 9 + -12. Suppose 111 = -4o + zc + 1131, -239 = -o + 5c. Is o composite? True Let y be 6632/(-20) + 6/(-15). Let g = -229 - y. Is g composite? False Let g = 5 - 3. Suppose go - 6o + 24 = 4n, -3n = -2o + 2. Suppose nb = 4b - 86. Is b composite? False Let f = 4 + 1. Suppose fa - 3a = 4. Suppose -al + 3l = 97. Is l a composite number? False Let t(z) be the third derivative of 257z6/120 + z5/60 - z4/12 + z3/6 + 19z*2. Is t(1) a prime number? True Let i(w) = 124w*2 - 2w - 3. Let n be i(-5). Suppose 7864 = 9o - n. Is o a composite number? True Let v = -6 + 8. Suppose -vl - 11 = -t, 10 = -t - 4l + 3. Suppose 0 = -2z - 2u + 102 + 52, tz + 3u = 389. Is z a prime number? True Let i = -93 + 101. Suppose -iu + 2215 = -3u. Is u a composite number? False Let j(z) = 107z*3 - 11z*2 + 2z - 17. Is j(5) prime? True Let q(h) = -h*3 + 7h*2 + 5h - 5. Let c be q(7). Let u be (-6)/4c/9. Let j(z) = -2z*3 - 2z2 - z - 4. Is j(u) a prime number? False Let q(v) = -v3 - 26v2 - 14v - 57. Let a be q(-24). Let i = a - -3232. Is i prime? False Suppose f = -f - 4, 0 = -4l - f + 17394. Is l a composite number? False Let c = -36090 + 52705. Is c a composite number? True Suppose 17c + 0c = 27863. Is c a prime number? False Let d(h) = -13h*3 - 4h*2 - 6h + 4. Suppose 4b - 4a = 0, 5b = -2a - 42 + 7. Is d(b) a prime number? True Let m(c) be the first derivative of 239c3/3 - c2 + 2c + 6. Is m(1) a prime number? True Let a(l) = -2393l - 3. Is a(-2) a composite number? False Let g(z) = 2z*3 - 34z*2 - 9z - 41. Is g(20) composite? False Let q be (-11)/(-2)6/3. Suppose -3g + 3a = -24, 4a = 5g + q - 49. Suppose -go = -o - 245. Is o composite? True Suppose -4v + 22926 + 12766 = 0. Is v a prime number? True Let n(v) = -v3 + 5v*2 + 4v + 8. Let c be n(6). Let s be (-8)/3(-822)/c. Let b = 87 - s. Is b a prime number? False Suppose -852 = -4i + 3752. Is i a composite number? False Let x(p) = -24p2. Let y be x(1). Let n = -19 - y. Suppose -4h = -5m + 1 + 204, -nh - 25 = 0. Is m a prime number? True Let l = -10 + 15. Suppose -lr - 101 - 1790 = -3o, -2o = -4r - 1262. Suppose 4x - o = x. Is x prime? False Let i be (-89)/(-1) - (-3 - 0 - 1). Suppose 2q = i + 145. Is q composite? True Suppose 0 = -9g + 161 - 17. Suppose 5w + 3r - 2 = 28, 2w + 2r - g = 0. Suppose wt - 1525 = 2702. Is t a composite number? False Let r be (2 + -2)/3 - -3. Suppose -2o + 0v + 33 = -5v, 0 = ro + 3v + 3. Is o prime? False Let g = 978 + 281. Is g a prime number? True Is 1115/223 - (4541 - -1)/(-1) a prime number? True Let q be 134979/(-65) + (-2)/5. Is q/(-2) + 4/8 prime? True Let x(f) = -143f - 4. Let t be x(3). Let b = 701 + t. Suppose -5h + h + b = 0. Is h prime? True Suppose 0 = -4y + 16, -5l + 5y = -8l + 4181. Is l a composite number? True Suppose 3z - 4395 = 3807. Is z a prime number? False Is 7 - (-108)/(-16) - 58035/(-4) a prime number? False Suppose 4j = 4, 2776 = 3u + 4j - 3j. Suppose 3n + 122 = 3m - 811, 3m - n = u. Is m a composite number? False Suppose -3b + 2t + 1 = -8, -5b + 19 = -2t. Suppose -2284 = -4n + p, n + bp + 2855 = 6n. Is n composite? False Let d = 78683 + -48672. Is d a composite number? False Let b(g) = 23g2 - 5g - 7. Let a(l) = -l*3 - 18l*2 - 16l + 2. Let h be a(-17). Let t be 5/h-3-2. Is b(t) composite? True Let d = 44556 - 20485. Let r = d + -12668. Suppose -q - 8q = -r. Is q composite? True Let f be (4/12)/((-1)/(-9)). Suppose 0p - p = fh - 16, -5h = -25. Let z(s) = 149s2 - s + 1. Is z(p) composite? False Let c be 8/(-44) - 48/(-22). Suppose 4h = 2z + 9446, ch - 3z + 536 - 5257 = 0. Is h prime? False Let s(h) = 385h*3 - 6h*2 + 4h - 2. Let m(n) = -386n3 + 5n*2 - 3n + 2. Let p(q) = 6m(q) + 5s(q). Is p(-1) prime? False Suppose 5 = 3y - 10, 0 = -i - 4y + 2187. Is i a prime number? False Let o = 15 + -17. Let c(x) = 0 - 4 - 167x + 1. Is c(o) prime? True Let f be 4/(-6)(0 - 3). Let a(z) = 2z3 - 4z*2 + 2z + 1. Let b be a(f). Suppose -o - 2u = o - 268, 394 = 3o - bu. Is o a composite number? True Is (-10)/(-4)17/((-595)/(-6846)) prime? False Suppose -3z + 84006 + 35856 = 5i, 5i - 79903 = -2z. Is z prime? False Let o be (-4)/(-18) + (-3725)/(-45). Suppose f - 58 = o. Is f prime? False Let b = 18 - 15. Suppose -8u + 4u + 42 = 2o, -bu + o = -29. Suppose 6q = uq - 212. Is q prime? True Suppose -5b + 330 = -90. Suppose -3u - 4d + b + 185 = 0, 0 = -u - d + 88. Is u a prime number? True Let i = 411 + -613. Let n = 1981 - i. Is n prime? False Let p be 2/10 + 95/25. Suppose -z + 41 = -pb, 4z = 5z - b - 29. Is z a composite number? True Let r(t) = 5013t2 + 12t - 17. Is r(2) a prime number? False Suppose 5q = -0d + 3d + 8, -5d + 40 = 5q. Suppose -qh - 439 = -w - 4w, 4h = 16. Is w a prime number? False Is (12 - -6831)(-1)/(-3) a prime number? True Let k(q) = -9q*2 - 2q + 1. Let m be k(1). Let n = 42 + m. Let o = -18 + n. Is o a composite number? True Suppose 12x + 459 = 9x. Suppose 0 = -2r + 483 + 65. Let u = x + r. Is u a composite number? True Let i = 5 - 11. Let y be i/(-4)18/(-27). Is (375 - y) + 13 + -10 a prime number? True Let x = -370 - -624. Is x a prime number? False Let s = 13273 + 23956. Is s composite? True Is 8/(24/(-226971))(-2)/6 a composite number? False Let v = -9 - -15. Let t be 0(2 + v/(-4)). Let n = t + 13. Is n composite? False Suppose -4u + 2i - 14 = 0, u + 3i + 5 = -16. Let p(v) = 2 + 5 - 5v - 8 + 9. Is p(u) composite? True Suppose r = -2r - 6. Let t(k) = -3k*3 - 12k*2 + 18k + 2. Let w(q) = 7q3 + 24q*2 - 37q - 3. Let i(p) = rw(p) - 5t(p). Is i(-7) a prime number? True Suppose -5l = n - 236, 2n - l + 266 - 683 = 0. Is n composite? False Let x be 5 - (-2 - 6/(-3)). Let w(s) = 1205s - 18. Is w(x) a prime number? True Suppose 3t = t + 206. Suppose 2h - t = 265. Is (-20)/(-2)h/16 a composite number? True Suppose -2 = -2c, -6z - c + 3317 = -2z. Let k = z + -350. Is k composite? False Suppose 0 = -3k + 2i - 0i - 8, -5k + 5i - 10 = 0. Let m(o) = -o*2 + 3 + 15o*2 + o + 0o*2. Is m(k) composite? False Suppose -5p = -10p - 50. Let r = 12 + p. Suppose 377 = 3u - 2f, 233 = ru - 5f - 11. Is u composite? False Let h(s) = -36s*3 - 6s - 37. Is h(-4) composite? True Let t = 18951 + -9424. Is t prime? False Let y(v) = -v*3 - 15v*2 - 20v + 7. Suppose -2q + q = 3, -q = n + 17. Is y(n) a prime number? False Let o = -498 + 6548. Suppose 5j + o = -14930. Is ((-4)/(-16))/((-1)/j) prime? True Suppose -991 = -4j + 1225. Let r = -388 + j. Is r composite? True Suppose 0 = -19l + 14l + 55565. Is l composite? False Let y(o) = 1259o*3 + 2o*2 - 18o + 40. Is y(3) a composite number? False Suppose -h + 5969 = -3s, 3h - 6609 = 3*s + 11322. Is h a composite number? False Let p(a)	{ "pile_set_name": "DM Mathematics" }
posite? True Is 34457 prime? True Is 7789 composite? False Is 99859 a composite number? False Is 12790949 a prime number? True Is 743549 composite? False Is 227719 composite? False Is 145066 prime? False Is 32087 composite? True Is 16743 composite? True Is 1151 a composite number? False Is 49109 a prime number? True Is 11677 a composite number? False Is 247183 a composite number? False Is 861797 composite? False Is 41729 composite? False Is 68763 a composite number? True Is 2839 prime? False Is 3043 prime? False Is 12185 a composite number? True Is 211 a prime number? True Is 5249 a prime number? False Is 118211 a prime number? True Is 497449 prime? True Is 1293787 composite? True Is 3599 a composite number? True Is 23434 composite? True Is 229427 composite? True Is 915797 prime? False Is 26149 prime? False Is 757 a composite number? False Is 123787 composite? False Is 594889 a prime number? True Is 51931 a composite number? True Is 3079 a composite number? False Is 112549 a composite number? True Is 197674 prime? False Is 19523 prime? False Is 1052797 a prime number? True Is 764399 composite? False Is 7057 prime? True Is 32603 composite? False Is 41467 a composite number? False Is 31777 a composite number? True Is 8191 a prime number? True Is 391901 prime? False Is 54869 a prime number? True Is 226871 a composite number? False Is 797773 a composite number? False Is 149803 a prime number? True Is 32773 composite? True Is 16873 a prime number? False Is 128099 a composite number? False Is 62459 prime? True Is 7601 a prime number? False Is 80309 a prime number? True Is 12235 a composite number? True Is 135371 a prime number? False Is 30593 a composite number? False Is 34973 composite? True Is 6898 a composite number? True Is 48437 a prime number? True Is 430243 composite? True Is 151447 composite? True Is 15245 a prime number? False Is 93077 a composite number? False Is 40231 a prime number? True Is 10834 prime? False Is 34123 composite? False Is 146737 a prime number? False Is 9094 a composite number? True Is 2039 a prime number? True Is 56807 a prime number? True Is 572597 a prime number? True Is 10871 prime? False Is 121229 a composite number? False Is 14227 composite? True Is 19843 composite? False Is 40693 a composite number? False Is 16411 a composite number? False Is 757495 composite? True Is 27883 prime? True Is 21137 a composite number? True Is 24317 a prime number? True Is 347289 prime? False Is 57149 prime? True Is 72269 a prime number? True Is 1618621 a prime number? False Is 769843 a prime number? False Is 2775403 prime? False Is 1259 composite? False Is 2159 a prime number? False Is 7647 a composite number? True Is 806177 composite? False Is 171181 a prime number? False Is 12057 composite? True Is 307015 prime? False Is 1236701 a composite number? False Is 1657 composite? False Is 834869 a prime number? False Is 214 composite? True Is 7321 a prime number? True Is 1029103 prime? True Is 12763 composite? False Is 26337 prime? False Is 2579 composite? False Is 581891 a composite number? False Is 2627 prime? False Is 131861 composite? False Is 38587 composite? True Is 130387 composite? True Is 71945 a prime number? False Is 3371 a composite number? False Is 85 a composite number? True Is 45699 composite? True Is 9533 prime? True Is 3163 a prime number? True Is 50453 a prime number? False Is 38989 a composite number? True Is 136237 prime? True Is 86543 a prime number? False Is 431097 composite? True Is 1723789 prime? False Is 22094 a prime number? False Is 62597 prime? True Is 20849 composite? False Is 26661 a composite number? True Is 84937 composite? True Is 58177 a composite number? True Is 115979 a prime number? True Is 158113 composite? False Is 12659 a composite number? False Is 385603 a composite number? True Is 203741 a prime number? False Is 73345 a composite number? True Is 6521 a prime number? True Is 400763 prime? False Is 13157 a prime number? False Is 37039 a composite number? False Is 159917 a composite number? True Is 175957 prime? False Is 5095 composite? True Is 923107 a prime number? True Is 82067 a composite number? False Is 532913 prime? False Is 96893 composite? False Is 1088081 prime? True Is 13649 prime? True Is 68767 a composite number? False Is 1331089 a composite number? True Is 16057 prime? True Is 267959 prime? True Is 146 a prime number? False Is 3611 a prime number? False Is 39803 a prime number? False Is 446353 a composite number? False Is 403289 a prime number? True Is 59617 composite? False Is 325297 a prime number? False Is 27113 a prime number? False Is 728509 a prime number? False Is 11261 a prime number? True Is 20321 a composite number? True Is 547271 a prime number? True Is 1695589 a composite number? True Is 185161 a composite number? False Is 535697 a prime number? True Is 108577 a composite number? True Is 261691 a composite number? True Is 349627 a prime number? False Is 24611 prime? True Is 5381 prime? True Is 34039 composite? False Is 5007341 prime? True Is 154097 composite? False Is 29461 a prime number? False Is 860447 a prime number? False Is 958729 a composite number? False Is 44071 a prime number? True Is 178739 a composite number? True Is 160133 composite? True Is 12421 prime? True Is 750089 prime? False Is 28387 a composite number? False Is 3629 a composite number? True Is 341947 composite? False Is 879262 a composite number? True Is 185695 prime? False Is 21743 a composite number? True Is 48403 a prime number? False Is 642049 a prime number? True Is 144758 a composite number? True Is 283907 composite? True Is 3977 prime? False Is 2456423 a prime number? False Is 55849 prime? True Is 445579 prime? False Is 332407 a prime number? False Is 19207 a prime number? True Is 1945 a composite number? True Is 7317253 a prime number? True Is 4667 a prime number? False Is 576113 composite? True Is 1100219 prime? True Is 101737 a composite number? False Is 1894345 a composite number? True Is 80777 composite? False Is 6317 prime? True Is 128287 a composite number? False Is 7069 composite? False Is 23194 a prime number? False Is 7283 composite? False Is 1255 a prime number? False Is 224527 composite? False Is 18946 prime? False Is 2159 prime? False Is 456655 prime? False Is 629315 prime? False Is 174569 a prime number? True Is 569333 a prime number? False Is 2045 composite? True Is 3207745 a composite number? True Is 9661 prime? True Is 1563 composite? True Is 547249 a prime number? True Is 536806 a composite number? True Is 1853 a composite number? True Is 18119 prime? True Is 473509 prime? False Is 27239 composite? False Is 305062 prime? False Is 179 a composite number? False Is 7853 composite? False Is 390509 a prime number? False Is 41669 a composite number? False Is 64151 prime? True Is 7835 composite? True Is 11183 composite? True Is 1339259 prime? True Is 12459 prime? False Is 48283 a prime number? False Is 8101 a prime number? True Is 37039 prime? True Is 6407 a composite number? True Is 129697 a composite number? True Is 440007 a composite number? True Is 984667 composite? False Is 109987 a composite number? False Is 1637 composite? False Is 9155 prime? False Is 103451 a composite number? False Is 28429 a composite number? False Is 32603 prime? True Is 1114 prime? False Is 23531 a composite number? False Is 165079 composite? False Is 721355 composite? True Is 5207 prime? False Is 9029 prime? True Is 1471 a prime number? True Is 2053 composite? False Is 51549 a composite number? True Is 12323 a composite number? False Is 409939 composite? True Is 1008809 a prime number? True Is 38345 composite? True Is 1161137 composite? False Is 4783 prime? True Is 15809 prime? True Is 1069 composite? False Is 383739 a composite number? True Is 1137973 composite? False Is 11707 prime? False Is 49451 a composite number? False Is 81241 a prime number? False Is 1135259 a composite number? True Is 24239 a prime number? True Is 25433 a composite number? True Is 31637 composite? True Is 51443 a prime number? False Is 337 prime? True Is 5669 prime? True Is 36689 a prime number? False Is 5731 prime? False Is 165989 a prime number? False Is 10057 a prime number? False Is 33207 a prime number? False Is 513731 pri	{ "pile_set_name": "DM Mathematics" }
Factor q(z). -(z + 53)*2 Let y(f) be the second derivative of 7f*5/80 - 13f*4/24 - 23f*3/6 - 3f*2 + 8209f. Find c such that y(c) = 0. -2, -2/7, 6 Let n = 1345/4 + -336. Let f(y) be the first derivative of -ny2 - 11/12y*3 + 0y + 11. Factor f(w). -w(11w + 2)/4 Let a(k) be the second derivative of k*6/50 - 9k*5/20 + 33k*4/10 - 8k*3 + 260k - 2. Suppose a(o) = 0. Calculate o. 0, 2, 5, 8 Let o(c) = -9c3 - 304c*2 - 522c + 2240. Let g(r) = -200r3 - 6695r*2 - 11485r + 49280. Let h(a) = 2g(a) - 45o(a). Suppose h(s) = 0. Calculate s. -56, -4, 2 Suppose 0 = 3j - 3l - 15, 3l = -2j - 2l - 11. Let c be 25/3 + (-20)/(-30) + -1. Factor 4 - cg*2 + 4g*2 - 2g*3 + jg*3 - 4g + 4g3. 4(g - 1)*2(g + 1) Suppose 0 = -l + 5i - 8, -5l = -3l - 13i + 40. Let -l + 7/4g3 + 55/2g*2 + 104g = 0. Calculate g. -8, 2/7 Let j(r) be the third derivative of r7/1050 + r6/450 - 17r5/150 + r4/2 + 17r*3/2 + 44r*2. Let o(t) be the first derivative of j(t). Factor o(b). 4(b - 3)(b - 1)(b + 5)/5 Let m(k) be the third derivative of k*5/100 + 7k*4/8 - 20k*3 + 3k*2 - 238. Factor m(l). 3(l - 5)(l + 40)/5 Suppose 399k = -5k + 835 - 344 + 721. Factor -1/5h*k - 4 + 2/5h*2 + 19/5h. -(h - 5)(h - 1)(h + 4)/5 Let q(f) be the third derivative of 4f2 + 1/72f*6 - 1/630f*7 + 7/72f*4 - 1/9f*3 + 0 - 4f - 1/20f5. Factor q(y). -(y - 2)(y - 1)*3/3 Suppose 7354 = 2c - 1352. Let -c - 3b2 + 822 - 338 - 1423 - 252b = 0. Calculate b. -42 Let i(w) be the second derivative of w*5/4 - 35w*4/6 - 85w*3/6 + 75w*2 + 476w. Factor i(o). 5(o - 15)(o - 1)(o + 2) Let t(r) be the second derivative of r6/360 + r5/30 + r4/8 - 4r3/3 + r2 - 2r. Let l(o) be the second derivative of t(o). Factor l(g). (g + 1)(g + 3) Let c = -624 - -626. Let x be (-1)/c(-17 - -17). Factor -6/17v*4 - 6/17v*3 + x + 0v - 2/17v2 - 2/17v*5. -2v*2(v + 1)*3/17 Let j = 96817 - 871351/9. Factor -2r*5 - 44/9r*3 - jr - 16/3r4 + 0 - 16/9r*2. -2r(r + 1)2(3r + 1)2/9 Let z be (-26)/65 + 24/10. Suppose z = -0j + j. Factor 23y4 - 40y - 7y4 - 8y*2 - 20 + 10y*3 - 7y*j - 11y*4. 5(y - 2)(y + 1)2(y + 2) Let o(k) = k*2 + 3k + 8. Let d(p) = p*2 + 3p + 11. Let x(y) = 4d(y) - 5o(y). Solve x(w) = 0. -4, 1 Let b(r) be the second derivative of -r7/14 + r6/10 + 27r5/10 - 7r*4 - 28r*3 + 144r*2 - 71r - 5. Find c such that b(c) = 0. -4, -2, 2, 3 Find x such that -4x5 + 97x*2 - 3556x*4 - 248x*3 + 27x*2 + 48x - 3606x4 + 7241x4 + x2 = 0. -1/4, 0, 1, 3, 16 Let g(u) = 98 - 180u + 46u*2 + 0u*2 - 26 + 62u*2. Let h(q) = -324q*2 + 540q - 217. Let v(m) = -8g(m) - 3h(m). Factor v(s). 3(6s - 5)2 Let u(n) = -n2 - 2n - 24. Let i be u(0). Let l = -21 - i. Let -3z*4 - 4z*l + 6z + 14z5 + 3z*2 - 11z*5 - 5z3 = 0. Calculate z. -1, 0, 1, 2 Let f(g) be the third derivative of -g7/315 + 43g6/6 + 646g*5/15 + 1939g*4/18 + 431g*3/3 - 3g*2 - g + 21. Factor f(l). -2(l - 1293)(l + 1)3/3 Let n(i) be the third derivative of -i6/120 + i5/3 + i4/24 - 10i3/3 + i2 + 129. Let n(p) = 0. What is p? -1, 1, 20 Let b(g) be the first derivative of 1/120g6 + 3/20g*5 + 0g*2 + 5 - 32/3g*3 - 7/8g*4 + 0g. Let o(r) be the third derivative of b(r). Factor o(a). 3(a - 1)(a + 7) Let y(c) = 32c3 - 2c*2 - 2c + 3. Let j be y(1). Solve -45v3 + j + 46 - 37 - 220v + 190v2 = 0 for v. 2/9, 2 Suppose 44y - 99y = -52y - 15. Let q(f) be the first derivative of -2f2 + 0f + 4/5f5 + 4f*3 - y - 3f*4. Suppose q(c) = 0. What is c? 0, 1 Let v = 75 - -53. Factor -17d - d*2 + 54 + 44 - v. -(d + 2)(d + 15) Let j(v) be the first derivative of -v*3/3 - 7v*2/2 - 8v + 13. Let x be j(-5). Factor 72u + 2u*3 + 3u*2 - 25u*2 + 0u*2 - xu*2. 2u(u - 6)2 Let b(y) be the third derivative of 0 + 8/3y*3 + 162y*2 - 1/5y*5 + 47/12y*4 + 0y. Find r such that b(r) = 0. -1/6, 8 Let o(g) = -23g + 117. Suppose 32c - 145 = 3c. Let p be o(c). Let 4/3y*p - 2y - 4/3 = 0. Calculate y. -1/2, 2 Suppose -5a + 4n + 411 = 0, -27n = -2a - 29n + 150. Factor -4t - 128t2 - 7t*3 + at*2 + 65t*2. -t(t - 2)(7t - 2) Let o(k) be the second derivative of -k*4/4 - 197k*3/3 - 131k*2/2 - 2k + 1299. Find j, given that o(j) = 0. -131, -1/3 Let k(w) be the third derivative of -7w5/8 - 103w*4/8 + 6w*3 + 7035w*2. Factor k(t). -3(t + 6)(35t - 4)/2 Find u, given that 0 + 19u - 1/3u*2 = 0. 0, 57 Let t = 224 - 222. Suppose 4h + 2i = 4, 5 = th - 3i - 5. Solve -2/5q*h + 2/5q*3 - 4/5q + 0 = 0. -1, 0, 2 Let m = 37 - 14. Suppose 21h = mh - 6. Factor -2/3 + 1/3f + 2/3f*2 - 1/3f*h. -(f - 2)(f - 1)(f + 1)/3 Let m(p) be the second derivative of p4/66 - 10p*3/11 + 77p + 2. Find o, given that m(o) = 0. 0, 30 Let t(r) be the first derivative of 2r5/5 + 191r*4/22 + 1060r*3/33 + 168r*2/11 - 6323. Let t(z) = 0. What is z? -14, -3, -4/11, 0 Factor 0 - 21/2v*4 - 38v*2 + 39v*3 + 1/4v*5 + 0v. v*2(v - 38)(v - 2)2/4 Let a be (-7 + (-117)/(-18))/((-2)/96). Let d be 243/a - 6 - 4. Factor -1/4l*3 + 1/8l*4 - dl*2 + 0 + 1/4l. l(l - 2)(l - 1)(l + 1)/8 Let j(s) be the third derivative of s5/240 + 41s*4/48 + 30s*3 - 546s*2 - 2s + 1. Factor j(d). (d + 10)(d + 72)/4 Let d = -54 - -56. Suppose 0 = -v - 2v + 6. Let 5f3 - vf*d - 3 + 2f*2 + 13 - 15f = 0. What is f? -2, 1 Let o(a) = -37a3 + 80a*2 + 99a + 33. Let c(j) = 12j3 - 27j*2 - 33j - 12. Let p(z) = -17c(z) - 6o(z). Factor p(b). 3(b - 2)(b + 1)(6b - 1) Let k be 21/7(-51 - 9424/(-1860)). Factor 2/5w + kw*2 + 0. w(w + 2)/5 Let g(d) = 4d2 - 4d - 5. Let k be g(3). Suppose 17 = 2h - 3a, -h + a + k = h. Determine t so that 11t3 - 2t*4 - 18t*3 - t + ht*3 = 0. -1/2, 0, 1 Suppose 0 - 120 = -5b. Factor -bk + 21k*2 - 14k*2 - 4k*2. 3k(k - 8) Let o(b) be the second derivative of 122b + 13/14b3 + 0 - 1/28b*4 + 0b*2. Let o(r) = 0. Calculate r. 0, 13 Determine z so that 4992z + 5120 - 156/5z3 + 5764/5z*2 + 1/5z*4 = 0. -2, 80 Let u = 1453/6 + -653/3. Let g = 185 - 369/2. Factor -u + 7a - ga2. -(a - 7)2/2 Let y(o) be the first derivative of -1/2o*2 - 3/2o - 53 - 1/24o3. Factor y(x). -(x + 2)(x + 6)/8 Let o be (-128)/10 + 2 + (-21)/105. Let k be ((-495)/(-21))/o - -9. Determine g so that -4/7g2 - kg - 144/7 = 0. -6 Let i(q) be the second derivative of -29/8q4 - q - 1 + 9/80q*5 - 5/2q*2 - 119/24q*3. Factor i(p). (p - 20)(3p + 1)2/4 Let z(g) be the third derivative of 0g*4 - 67g*2 + 0 - 1/2g*5 + 5/336g*8 + 0g*3 + 0g - 10/63g7 + 13/24g*6. What is f in z(f) = 0? 0, 2/3, 3 Let x be (-14)/(1190/(-3349)) + -37. Factor 2/5b*2 + 2/5b*4 + 0 - 8/5b*3 + xb. 2b(b - 3)(b - 2)(b + 1)/5 Let p = 646852 + -4527959/7. Factor 6/7c2 + 1/7c*3 + 0 + pc. c(c + 1)(c + 5)/7 Find q such that -6q4 + 8/3q + 38/3q3 + 136/9q*2 + 0 = 0. -2/3, -2/9, 0, 3 Let l = -374365/4 - -93592. Factor 1/4a*3 - 5/4a*2 + 7/4a - l. (a - 3)(a - 1)2/4 Let p(m) = -5m*2 + 10m + 38. Let z(w) = 9w2 - 19w - 21 + 2w2 - 56. Let l(o) = -5p(o) - 2z(o). Suppose l(f) = 0. What is f? -2, 6 Suppose -21 + 201 = 18c. Determine g so that 124g2 - 60g*2 - 63g*2 + 3g - c = 0. -5, 2 Factor -20f2 + 1/3f*4 + 59/3 - 58/3f*3 + 58/3f. (f - 59)(f - 1)(f + 1)*2/3 Let u(k) be the third derivative of -105k*2 + 0k - 6250/3k3 + 1 + 125/6k*4 - 1/12k*5. What is y in u(y) = 0? 50 Let t(v) be the third derivative of -4v*4 - 11/2v*3 - 1/5v*6 + 1/70v*7 - 29v*2 + 0 + 0v - 3/2v5. Factor t(q). 3(q - 11)(q + 1)3 Let x be 716/70 - (-770)/55020/(-35). Factor xt + 0 + 9t*2 - 3/7t*3. -3t(t - 22)(t + 1)/7 Find r, given that 0 + 252/5r2 + 2/5r*3 - 254/5r = 0. -127, 0, 1 Suppose 3g + 188 = 38. Let t be (g/15 + 3)1-15. Determine m, given that 32m*2 - 60m*3 - 4m + 64mt - 75 + 75 - 32m4 = 0. -1, 0, 1/4, 1 Let f(h) be the first derivative of h4/18 + 598h3/27 + 589h*2/3 + 586h + 748. Factor f(i). 2(i + 3)2(i + 293)/9 Factor 46/11t - 252/11 - 2/11t*2. -2(t - 14)*(t - 9)/1	{ "pile_set_name": "DM Mathematics" }
328 = -8c. Does 19 divide c? False Let n(r) = -r3 + 19r*2 - 6r + 17. Is 7 a factor of n(18)? False Let n(z) = 204z + 14. Let h be n(-3). Is (-20)/(-70) - h/14 a multiple of 43? True Let o = 6 - 0. Let y(t) = -5t*3 + 4t*2 + 6. Let i(c) = -9c*3 + 8c*2 + 13. Let b(n) = -4i(n) + 7y(n). Is 19 a factor of b(o)? False Let r(b) = -b3 - 10b*2 - 19b - 10. Let q be r(-8). Suppose 2g + q - 38 = 0. Is g a multiple of 12? True Suppose 2r + a = 2 + 20, -r - a + 13 = 0. Suppose -rt + 34 = -695. Does 34 divide t? False Suppose 17z + 3819 = 23352. Does 8 divide z? False Suppose -11k + 1927 = -768. Is 28 a factor of k? False Let a = -2 + 7. Suppose -5m = -4n + 5n - 515, 4m - 441 = an. Is m a multiple of 15? False Suppose 4p - 2p - 6 = 0. Suppose -176 + 626 = pw. Is 16 a factor of w? False Is (4/8-1)/(6/(-6984)) a multiple of 14? False Let h = -2 + 7. Suppose 10 = hd - 5. Suppose -dg + 110 = -4. Is 19 a factor of g? True Let y = -85 - -83. Let q = -4 + -22. Let o = y - q. Is 8 a factor of o? True Let c(z) = -2z - 4. Let u be (-2)/(-8) - (-9)/(-4). Let j be c(u). Suppose -2l + 9 = 4d - 17, j = -4l + 4d + 64. Is l a multiple of 15? True Let j be (-3)/9 + 8/24. Let d(h) = h3 + h2 + 56. Does 8 divide d(j)? True Suppose 0 = -15o + 14o. Suppose 6v - 3v - 9 = 0. Suppose -42 = -vm - o. Is m a multiple of 7? True Let i be (-10)/75 - 0 - (-32)/15. Suppose b = ib - 3. Is b a multiple of 3? True Let w(o) = -o3 - 17o*2 - 4o + 13. Is 34 a factor of w(-19)? False Suppose -1710 = 341k - 343k. Is 45 a factor of k? True Suppose -3n + 4c - 6c - 4 = 0, -n = 4c + 8. Suppose -6p + 7 + 5 = n. Suppose 5s - 5f - 132 = -p, 38 = s - 5f. Does 4 divide s? False Does 32 divide (557/(-3))/(15/(3 + -93))? False Let f(v) = -v*2 + 9v - 3. Let s be f(6). Let h = -25 + s. Let t = 37 + h. Is 9 a factor of t? True Let g = 467 + -248. Is 13 a factor of g? False Is 8 a factor of 1393 - 5((-126)/(-30) - 4)? True Suppose -95 = -3g + 37. Suppose -w - 2w + 5l - 33 = 0, -w = 3l + 25. Let i = g + w. Does 14 divide i? True Suppose -216j + 213j = -150. Is j a multiple of 5? True Let v(w) = w + 8. Let f(i) = 2i + 15. Let u(j) = 4f(j) - 7v(j). Let x be ((-14)/(-5))/((-12)/(-30)). Is u(x) a multiple of 3? False Let h be -1 - 3 - (-426)/30-5. Let u = h + 161. Does 13 divide u? False Does 10 divide (6 + (-22 - 9))176/(-10)? True Let m = -38 + 196. Is m a multiple of 15? False Suppose -3p - 404 = -5p. Suppose 5c = 15, 3c - p = -h + c. Is 14 a factor of h? True Let l = 245 + -27. Does 18 divide l? False Suppose 0 = 3g + 4v - 8, -g - v = 4g + 15. Is 11 a factor of 47/5(1 - g)? False Let k be (45/6)/((-6)/(-16)). Let p be (45/k)/((-6)/(-16)). Is 13 a factor of 97/p + 6/(-36)? False Suppose 3m - 30 = m. Let q(r) = -r + 20. Let s be q(m). Suppose 3i = h - sh + 274, 4h - 258 = 5i. Is h a multiple of 18? False Let h(k) be the second derivative of k5/20 + 3k4/4 + k3/2 - 6k2 - 12k. Is h(-7) a multiple of 17? False Let j(q) be the first derivative of 5q2/2 + 7q + 6. Let v(o) = -5o - 8. Let l(n) = 2j(n) + 3v(n). Does 20 divide l(-14)? True Let b(g) = g - 1. Let l(t) = 11t + 37. Let i(y) = 5b(y) - l(y). Does 25 divide i(-13)? False Suppose 636 + 132 = 5p - 2a, -2p - 2a = -296. Is 6 a factor of p? False Suppose -2i + 2x = -54, 0i - 3x = 5i - 127. Suppose 5y + 45 + i = -2b, b = -2y - 28. Does 10 divide 13/(y/(-6) + -2)? False Suppose -5d + 18 = 118. Is 11 a factor of 8/d(-6)/440? False Suppose 3u - 3 = 5t, -5 = 4u - 3t + 2. Let h(p) = -p*2 - 5p + 1. Let z be h(u). Suppose zv - 27 = 28. Does 11 divide v? True Suppose 0 = -3h + h - 4f + 16, -5f = 3h - 20. Let i = h + 6. Suppose -it + 3t = -51. Is t a multiple of 3? False Suppose 0 = 4f - 3169 - 4639. Does 16 divide f? True Let h(b) = b*3 - 5b*2 + 6b - 4. Let y be h(4). Let o = 44 - y. Is 8 a factor of o? True Suppose 7d - 1566 = -376. Is 17 a factor of d? True Suppose -6n = -11n. Suppose v = 0, -3i + 4v + 6 + 18 = n. Is i a multiple of 4? True Let p(z) = z2 - 2z + 28. Let s be 4/6 - (2/(-6) + 1). Does 7 divide p(s)? True Suppose -7g + 3g - 32 = -5j, -2j + 4g = -8. Let r(q) = 25q - 18. Is 55 a factor of r(j)? False Let j = 11 + -3. Let n(t) = -t*2 + 8t + 10. Let i be n(j). Suppose -3s + 2s = -i. Does 3 divide s? False Is (286/153)/((-24)/(-1920)) a multiple of 22? True Does 67 divide 0 - -3288 - (2 + 1 + 3)? False Suppose -20g - 25 = -25g. Let t(d) be the second derivative of d4/6 + 7d*3/6 - 5d*2/2 + 14d. Does 16 divide t(g)? True Suppose -5f = -35 - 10. Suppose ft + 1276 = 20t. Is 16 a factor of t? False Let m = 13 - 10. Suppose -4h + 13 = d - 3, -mh + 5d - 11 = 0. Is 11(-3 + 2 + h) a multiple of 18? False Let w(t) = t2 + 8t. Let b be w(-4). Suppose 0 = 5n + 96 + 44. Let h = b - n. Does 4 divide h? True Let k be 6054/54 - 1/9. Let u = k - 72. Does 4 divide u? True Suppose 2o - 566 = -0o. Is o a multiple of 31? False Let y(j) = 3j*2 + 10j + 35. Is y(-5) a multiple of 15? True Let g(n) = 2n2 - 21n - 49. Is 57 a factor of g(-6)? False Let n = -1394 - -2077. Is n a multiple of 24? False Suppose 56 = -3o - 4t + 178, 3o - 2t - 146 = 0. Let z = o + -44. Is z even? True Let d(r) = 3r3 - 4r*2 - 3r + 19. Does 9 divide d(4)? True Let j(v) = 7v - 8 - v3 - 4 - 20v + 7v2 - 17v*2. Is j(-9) a multiple of 6? True Is 1930/(-280)-7 + (-2)/8 a multiple of 4? True Let c(j) = j + 7. Let x be c(-7). Let z be (-19)/(-2) + (-10)/(-20). Let t = x + z. Is 10 a factor of t? True Let v = 150 + 218. Is 16 a factor of v? True Does 7 divide 617/4 + (-5)/20? True Suppose -6x + 10x - 36 = 0. Let g = 36 - x. Does 27 divide g? True Let i(v) = -2v + 5. Let s be i(-3). Let x = 23 - s. Does 11 divide x? False Let z = -35 + 35. Suppose z = -2k - 2i + 118, -k - i = -3i - 44. Does 7 divide k? False Suppose b + 20 = 6b. Suppose bk + k = 50. Suppose -kl + 7l = -75. Does 12 divide l? False Let m be (-4)/(-43/9). Suppose 4y = j + 450, 2y + mj - 256 = -38. Is 14 a factor of y? True Let b(t) = t*3 - 11t*2 + 19. Let f be b(10). Let p = f + 117. Is p a multiple of 18? True Let p = -24 - -37. Let b = 18 - p. Suppose 5c = -5h + 250, -5c - b - 15 = 0. Does 13 divide h? False Is 14 a factor of (-1 + 7/(-3))2520/(-25)? True Let h = -264 + 498. Does 26 divide h? True Suppose 0 = -2q - 3s + 126 + 30, -5q - 3s = -372. Does 6 divide q? True Let g be (16/(-6))/((-16)/24). Suppose -gs + 149 = 45. Let j = 41 - s. Is 6 a factor of j? False Suppose b + 2k - k = -121, -5b = 3k + 597. Let u = -67 - b. Is 5 a factor of u? True Let s(d) = -d + 1. Let a be s(1). Let y(u) = -u2 + 13. Does 2 divide y(a)? False Let f(c) = -c3 + 11c*2 + 11c + 9. Let d be f(12). Let p be (-3)/(-2 - d) + -5. Does 7 divide ((-23)/(-4))/(p/(-32))? False Does 27 divide 1(-8)/(-6) - 1970/(-3)? False Suppose 647i = 656i - 20799. Does 25 divide i? False Let z(j) = 1. Let n(l) = -3l - 8. Let a(s) = n(s) - 3z(s). Let f be a(-7). Let u(c) = 11c - 24. Is u(f) a multiple of 20? False Let i(x) = -x. Let n be i(-2). Suppose -nq + 235 = 3q. Does 8 divide q? False Let q be (-3)/12 - (-57)/(-12)-11. Is 15 a factor of (1 - (5 - 0)) + q + 0? False Let o be ((-6)/9)/(4/(-12)). Suppose of - 5 = -1. Suppose 5n = 5s + 190, 0 = 5n - n + fs - 182. Is 14 a factor of n? False Suppose -2d = -4, 5j = 10j + d - 302. Suppose 0 = -3y - y + j. Does 2 divide y? False Let a(d) = d*3 + 8d*2 + 3d - 8. Suppose 0 = 3c + 5g - 263, 3c + 3g = -g + 268. Let j be c/(-15) + (-4)/(-10). Is 28 a factor of a(j)? False Let s(j) = -3j - 6. Let o be s(-3). Suppose -oc + 577 = 2c - g, -c + 122 = 2g. Does 23 divide c? False Let t be (30/40)/(2/216). Suppose -2d + 2z + t = z, d = z + 41. Is 6 a factor of d? False Suppose 9 - 1 = 5l - 2z, 12 = 4l + 4z. Suppose 0 = 4d + 3j + 40, ld + d = 3j - 30. Is ((-32)/d)/(8/140) a multiple of 23? False Let d(l) = -l*3 - 2l*2 + 1. Let a be d(1). Let g be 4/(8/(-27))a. Let c = g - -24. Is c a multiple of 17? True Let g be (0 + 1)/(8/40). Suppose gc = c + 2d + 344, 0 = 4c - 4d - 352. Is 21 a factor of c? True Let m = -9 - -12. Suppose -2t = mj - 191, j = 5t + 6j - 490. Suppose 4u + 3r	{ "pile_set_name": "DM Mathematics" }
o be y(2). Suppose 3g - 5a = -3, -5a + fa - 5 = -og. List the prime factors of g. 2 Let t(g) = g. Let q be t(4). Suppose -qx + m = -109, 225 = 5x - 3m + 80. Suppose 6 - x = -5i. What are the prime factors of i? 2 Suppose 11 = 5s + g, -2s - 5g + 6 + 3 = 0. Suppose 6i = si + 36. Suppose 2f - i = -f. What are the prime factors of f? 3 Suppose 2b = -0l + 3l - 9, -5l + 5b + 10 = 0. Let t(r) = -6 + 1 + 0 + 4r. List the prime factors of t(l). 3, 5 Suppose 0 = -3j + 9. Suppose -jc + 4u = -6c + 121, -3c + 3u = -93. Suppose c = 5y - 0y. What are the prime factors of y? 7 Let m = -6 - -25. What are the prime factors of m? 19 Let m(p) = -p3 + 3p*2 + 4p - 1. What are the prime factors of m(3)? 11 List the prime factors of 54/2 + (-24)/(-12). 29 Suppose d - 12 = -3d. Suppose -du + 14 = -7. List the prime factors of u. 7 Let l(u) = -u*3 + 5u*2 - 3u - 4. Let c be l(4). Suppose s - 3 = -cs. List the prime factors of (15/(-2))/(s/(-4)). 2, 5 Let q(a) = a3 + 7a*2 + 7a + 9. Let n be q(-6). Let p = 8 - n. Suppose 52 = pv - 53. What are the prime factors of v? 3, 7 Let d(p) = 2p*2 + p + 89. What are the prime factors of d(0)? 89 Let l(c) = c - 16. List the prime factors of l(18). 2 Let a(r) = -r + 10. Let y be a(7). Suppose -3t = -yw - 2 - 1, 2w - 1 = t. What are the prime factors of w? 2 Let f(u) = u*3 - 2u*2 + 7u + 1. Let y(a) = -a*2 + a + 1. Let b(m) = -f(m) + 6y(m). List the prime factors of b(-4). 3 Let d(g) = 2g3 - 4g*2 + 4. Let l be d(3). Suppose -4x + x = b - l, -5b + 8 = -2x. List the prime factors of x. 2, 3 Suppose 0 = -m + 5m - 2i - 166, 0 = -3m - 4i + 152. What are the prime factors of m? 2, 11 Let y(u) = 8u + 1. List the prime factors of y(14). 113 List the prime factors of 10 - 2(-3 + 5). 2, 3 Let x = 0 - 11. Let z = x - -15. Let m = z - -7. What are the prime factors of m? 11 Let h(b) = -4b - 17. List the prime factors of h(-11). 3 Suppose 2i = -c + 270, -1744 = -5c - 4i - 364. List the prime factors of c. 2, 5, 7 Suppose -3j - 2f + 853 = 0, f - 1144 = -4j + 5f. What are the prime factors of j? 3, 5, 19 Let d = 14 - 10. Suppose -dc - 78 = -7c. What are the prime factors of c? 2, 13 Let p(d) = -d*2 - 10d + 6. Let h be p(-11). Let i(t) = -t*3 - 2t*2 + 5t + 4. List the prime factors of i(h). 2, 3 Let v be (-24)/(-2) + 1 - 3. List the prime factors of (60/(-25))/((-2)/v). 2, 3 Let w be (2 - (4 - 2)) + 20. Suppose -w = 3y - 62. What are the prime factors of y? 2, 7 Suppose 133x - 128x = 20. What are the prime factors of x? 2 Let n(b) = -4b + 2. What are the prime factors of n(-3)? 2, 7 Let o(u) = -5u - 2. Let c be o(-3). Let a = c - 23. What are the prime factors of (-2)/(4/a) - 2? 3 Let d(m) = -m2 - 20m + 9. What are the prime factors of d(-19)? 2, 7 Let x(z) = z*2 - 4z - 1. Let f be x(3). Let a(q) = -q*3 - 2q*2 + 5q - 2. List the prime factors of a(f). 2, 5 Suppose 0 = 6q - 2q - 104. Let p = -14 + q. Suppose -4y = -y - p. List the prime factors of y. 2 Let f be 21/((-4)/(-14)). What are the prime factors of 4f - 3/(-1)? 31 Suppose -p + 92 = p. List the prime factors of p. 2, 23 Suppose 4x + 16 = 0, -2i + 65 = 5x - 3. List the prime factors of i. 2, 11 What are the prime factors of (-44 + 0)(-1 - (-6)/(-4))? 2, 5, 11 Suppose -330 = -5x + 2m + 121, m = 2. List the prime factors of x. 7, 13 Let d be 260/(-4) + 0 + 0. Let y = -44 - d. List the prime factors of y. 3, 7 Suppose n = h + 72, 6h - 2h - 16 = 0. List the prime factors of n. 2, 19 Let g = 158 - 317. Let f = -113 - g. What are the prime factors of f? 2, 23 What are the prime factors of (1 + -25)(-1 + 0)? 2, 3 Let c(z) = -4 + 2 + z + 4 + 0. Let v be c(0). List the prime factors of v/(1 + 3)26. 13 Let p(m) = m - 6. Let w(r) = r2. Let a be w(2). Suppose o - 4 - a = 0. What are the prime factors of p(o)? 2 Suppose 12 = 3c + 3l, -c + 2l = -2c + 5. Suppose -cx + 5 = -1. Suppose 0 = 4o + i - 84, -3o - 2i = xo - 102. List the prime factors of o. 2, 11 Let j(h) = -h - 4. Let w(p) = p*3 - 6p*2 - 8p + 4. Let k be w(7). Let n be j(k). Let g = 2 - n. What are the prime factors of g? 3 Let x(o) = -o + 13. Let t be x(8). Suppose 4d + 12 - 3 = f, 5f + td = -30. Let i(h) = h2 + h - 3. List the prime factors of i(f). 3 Let b(d) = d - 6. Let i be b(7). Let z be 2 + (2 + 0 - i). Suppose -j = -zj + 8. What are the prime factors of j? 2 Let m(j) = 4j2 - 4j - 4. Let q be m(-3). Suppose -5d + d - q = -4n, -n - d + 17 = 0. List the prime factors of n. 2, 7 Let l = 101 + -58. Suppose -z + 0z = -l. List the prime factors of z. 43 Suppose 5z + 4j = -3 + 19, 14 = 4z + 2j. Suppose 6s - s = 3b + 45, -36 = -zs - 4b. List the prime factors of s. 3 Suppose 0 = -b - 4b + 5, 4b - 53 = -l. List the prime factors of l. 7 Let o(s) = -3s + 22. Let k(j) = 4j - 21. Let v(a) = 2k(a) + 3o(a). What are the prime factors of v(0)? 2, 3 Suppose 3 - 12 = -3r. Suppose -3m = -4p + 44, -rp = 7m - 2m - 4. List the prime factors of p. 2 Let w = -1 - -3. Suppose wd = -3d + 20. What are the prime factors of d? 2 Suppose -12 + 4 = -4r. Suppose -rz = 4 - 0. List the prime factors of z/2 + 2 + 6. 7 Suppose 6 = 3n - 6. Suppose nz - 4i - 60 = 0, -i + 7 = -2z + 3z. What are the prime factors of z? 11 Suppose -b + 4m = 7m - 116, 4m = -5b + 569. What are the prime factors of b? 113 Let i(u) = -u - 2. Let a be i(-11). Let h(y) = 3y + 3. List the prime factors of h(a). 2, 3, 5 Suppose 2z = 5z - 171. Suppose 0a - z = -3a. List the prime factors of a. 19 Suppose -3c = -2c - 3t - 12, -101 = -3c - 4t. List the prime factors of c. 3 Suppose -f + 5 + 7 = 0. Let d be f/9 - 4/(-6). Suppose dt = -0t + 8. List the prime factors of t. 2 Suppose 2r = -0r + 42. Suppose 2k - r = k. Suppose -2i + k = l, -2i - 2l + 13 = -7. List the prime factors of i. 11 Suppose -2z - z - 2p = -354, -3z + 2p + 354 = 0. Let a = 168 - z. Suppose -7k + a = -2k. What are the prime factors of k? 2, 5 Suppose 2a + 2a - 20 = 0. Let i be -2 + a/(15/12). Suppose 7 = iv + c, 2c - 4 = -2v + 2. List the prime factors of v. 2 Suppose -k + 9 + 2 = 0. Suppose -k = -2p + 3. What are the prime factors of p? 7 Suppose 5l = -x - 0x + 48, 5x = 3l + 128. Let q = x + -6. What are the prime factors of q? 2, 11 Let f = 0 + 3. Suppose d + 2z + 83 = -2d, 78 = -fd + 3z. Let x = d - -42. What are the prime factors of x? 3, 5 Let o(n) = n*2 - 15n + 17. Let g be 15 - (3 - (-2)/(-1)). Let b be o(g). Suppose -y = -bh + h - 15, 5y - 93 = h. List the prime factors of y. 19 Suppose 1 + 6 = t + 2h, 0 = -4h + 4. Suppose -j - 2v + 31 = 3v, v = t. List the prime factors of j. 2, 3 Suppose 4y + 2z = 272, 0z = 5z - 10. What are the prime factors of y? 67 Let r be -3 + (-3 + 9)/1. List the prime factors of ((-406)/21)/((-2)/r). 29 List the prime factors of -6 + 57 + 1-3. 2, 3 Let m(p) = -p3 - 7p*2 - 7p - 2. Let b be m(-6). Suppose 0 = x + bx - 50. What are the prime factors of x? 2, 5 Let o be (-2)/(-11) - 136/22. Let v(a) be the third derivative of -a4/12 + a3/3 - a2. What are the prime factors of v(o)? 2, 7 Suppose 57 = -3x + 159. Let m = x + -11. What are the prime factors of m? 23 Let q(l) = 5l2 + l. Let d be q(-1). Let u(w) be the first derivative of 2w*2 - 4w - 3. What are the prime factors of u(d)? 2, 3 Suppose 4b = 13 + 3. Suppose v + 3h + 6 = 0, bv - 2h = 1 + 3. Let y = 11 - v. What are the prime factors of y? 11 Suppose n - 5a = 8, 0n + n - 1 = -2a. Suppose -2m + 1 = -nm. Let b(w) = 5w2. List the prime factors of b(m). 5 What are the prime factors of (-18844)/(-70) - (-1)/(-5)? 269 Let p(j) = j3 + 4j2 + 1. Let a be p(-4). Let d = 3 - a. List the prime factors of d. 2 Let k(v) = v2 - v + 16 + 0v + 7 + 2. List the prime factors of k(0). 5 What are the prime factors of ((-6)/(-4))/(15/210)? 3, 7 Let i(v) = v*3 - 15v*2 + 17v - 19. List the prime factors of i(14). 23 Let g = -73 - -204. What are the prime factors of g? 131 Let a = 20 + -8. Let w = 40 - a. What are the prime factors of w? 2, 7 Let l(p) = p*2 - 12p + 12. Let b(m) = 5m2 - 61m + 61. Let r(c) = -2b(c) + 11l(c). What are the prime factors of r(10)? 2, 5 Let j = 1 + 4. Suppose -j*f + 25 = -2	{ "pile_set_name": "DM Mathematics" }
Which is the nearest to l? (a) 4 (b) u (c) -0.3 c Let y = 0.135 + -5.135. Which is the closest to -1? (a) -3/2 (b) -2/17 (c) y a Let x = 1 - 0. Let c = -27 + 11.7. Let y = c + 15. What is the closest to x in -5, -2, y? y Let p = 2 + -5. Which is the closest to 5? (a) p (b) 1/6 (c) 0.2 c Let f = -4 - -3.8. Let j = -2 + 1. Let l = -8.1 - -8. What is the nearest to j in f, -2, l? f Let s = 0.1 + 0.2. Let t = s - 0.4. Let b = -0.8 + 0.3. What is the closest to t in 1, b, -4? b Let k = -1/728 + -89/104. Let y = 2 - 3. What is the closest to 0.1 in k, 2/13, y? 2/13 Let s = 3.02 - 0.02. Let n = 6 - s. Let u = -0.13 - -5.13. What is the closest to -2/3 in n, u, 4? n Let z = 24 + -73/3. Let q = -31/4 + 8. Which is the nearest to q? (a) -1 (b) 2 (c) z c Let l = 477 + -330. Let s = -1027/7 + l. Let n = 7 + -12. What is the closest to 0 in s, 1, n? s Let f = -12 + 7. Let j be (28 - 28)/(1 + -4). Let s = -3.1 + 0.1. Which is the nearest to j? (a) f (b) s (c) -1 c Let j = -1.1 - -0.1. Suppose 5t - 3l = -23, 4t - 4l + 10 + 10 = 0. Let w = t + 1. Which is the nearest to 0.1? (a) 2 (b) w (c) j c Let c be ((-1578)/(-4))/(21/6). Let t = -113 + c. Let k = 0.3 - 0.7. What is the nearest to t in k, -1, 0? k Let p be 1/(1 - (-1 - -3)). Let j = -5.08 + 0.08. Let t = -6 - -5.6. Which is the closest to 0.1? (a) j (b) t (c) p b Let p = -0.12 - 4.88. Let j be (-15)/4 + 3 + 0. Which is the nearest to 1? (a) -4 (b) p (c) j c Let n = -13 + 12.9. Which is the nearest to -0.5? (a) 2 (b) 1/5 (c) n c Let f = 24 - 27. Which is the closest to f? (a) -1 (b) 3 (c) 4 a Let z = -0.06 - -0.82. Let v = 0.26 - z. What is the nearest to 3 in 0.2, v, 5? 5 Let d(p) = -p*3 - 5p*2 + 5p - 2. Let z be d(-6). Let h = -3 + 3.1. What is the closest to h in 1/8, 0.4, z? 1/8 Let m = -1/63 - 313/126. Which is the closest to -2/7? (a) m (b) 3 (c) 3/7 c Suppose -p - 5d + 14 = -12, -5d = -2p - 23. Which is the closest to 0? (a) -1/5 (b) p (c) 1/2 a Let j = 5.4 + 0.6. Let b = 5.12 + -0.12. Let y = b - j. What is the closest to -0.2 in y, -4, -3/8? -3/8 Let t = -0.63 - -0.53. Let o = 0.4 + -0.3. Which is the nearest to t? (a) o (b) 1 (c) 1/3 a Suppose -3w - 27 = -375. Let v = -814/7 + w. Let p = 7 + -7.3. Which is the nearest to v? (a) -4/3 (b) p (c) -2 b Let u = 35/96 + -1/32. What is the nearest to -0.3 in u, -4, -6? u Let p = 8 + -20. Let m = 17 + p. Let g = -8 + m. What is the closest to -0.1 in g, -5, -0.5? -0.5 Let k = 0.63 + -0.03. Let c = k - 2.6. Let h = 0 - -1. What is the nearest to h in c, 3, -5/2? 3 Let r be (2/(-6))/((-30)/(-18)). What is the closest to 1/4 in -5, -1, r? r Let h = 11 - 12. Let x = -3 - 0. What is the nearest to -1 in h, x, -4? h Let z = 6 - 6.5. Let a = 1.05 + -1. Let w = 1.95 + a. What is the closest to w in z, -5, -0.3? -0.3 Let a = 1/4 + -11/12. What is the nearest to 1 in -4, a, -3? a Let g = 0 - 2. Let l = -28 + 53/2. Suppose 0 = -6t + 7t. Which is the closest to t? (a) 2/5 (b) g (c) l a Let r be 184/(-1150)10/(-4). Let q = 2.1 + -2. What is the nearest to q in -0.4, r, -0.1? -0.1 Let u = -118/3 - -39. Which is the closest to -2/3? (a) -4 (b) 1 (c) u c Let f = 0 + 0.1. Let v = -25 - -28.8. Let y = v + 0.2. What is the closest to f in y, -5, 3? 3 Let r be (10 - (1 - 1))/2. Suppose -2w + 3 = -r. Let o = -5.08 - -0.08. What is the closest to 2/3 in 2, o, w? 2 Let y = 0 + -0.2. Let v(x) = -3x + 12. Let n be v(4). What is the nearest to y in 0.3, -0.2, n? -0.2 Let c(u) = u2 - 6u + 1 - 2 + 13u - 7. Let h be c(-8). What is the nearest to 2 in 5, h, -1/4? h Let a = -10 + 15. Suppose 5k - 7 + 17 = 0. Let s be (2/(-8))/((-1)/k). What is the closest to s in -0.2, a, 0? -0.2 Let l = 64/69 + -6/23. Which is the closest to 2? (a) l (b) 0.1 (c) 5 a Suppose 0 = -d + 4, 4s - 3d = -0d - 48. Let w be (42/(-112))/(s/2). What is the closest to -2 in 1/5, 4, w? w Let q be (11/(-1002))/(3/64). Let g = -2/167 - q. Suppose 5y + 8 = 7y - 4v, 6 = -3v. What is the closest to y in -0.2, g, 1? -0.2 Suppose -4t = -7t + 12. What is the closest to -0.02 in 2/9, 1, t? 2/9 Let y = -1.2 + 0.2. Suppose 0 = -0m + 4m - 2d + 314, -m - 92 = 4d. Let n = m - -1038/13. Which is the closest to -2/5? (a) 1/4 (b) n (c) y b Let k = 3.1 - 3. Let t = -51 - -51. Which is the closest to k? (a) 0.3 (b) t (c) 0.5 b Let s(l) = -l2 + 2. Let r be s(1). Which is the closest to 0? (a) -0.1 (b) 2 (c) r a Suppose 0 = 3q - o - 1, 2q + 21 = 5q + 3o. Let x be -1 - 1(-1 - 0). Let z = 0.2 + -3.2. What is the closest to q in 1, z, x? 1 Let n = 0 - -0.5. Let m be 99/36 + 6/(-2). What is the nearest to -1 in n, m, -0.4? -0.4 Let y be 1/1 - (-2 - 1). What is the closest to -24/11 in -2/5, -5, y? -2/5 Let v = -1.15 - -0.15. Which is the nearest to v? (a) -2/9 (b) -0.2 (c) 2 a Let l(y) = y*2 + 2y + 2. Let x be l(-2). Let u = -117323/4284 - -646/63. Let a = -69/4 - u. What is the nearest to x in 1, -0.5, a? 1 Let p be 1/((-7)/4-2). Let d = 0.8 - 8.8. Let i = d - -8.4. What is the closest to p in i, -1, -4? i Let x = -60 + 63.3. Let k = x - 0.3. Let i be 5/(-7)15/25. Which is the closest to 2/7? (a) i (b) -5 (c) k a Let o = -0.316 + -15.784. Let x = -16 - o. What is the nearest to -0.1 in x, -1, 0? 0 Let v = -0.5 + -2.5. Which is the closest to -0.1? (a) 3 (b) v (c) 3/7 c Let s = 38 - 21. Suppose w = -5j + 33, s = -2j - 4w + 41. Suppose -2m = -2y - m - j, 2y + 5m - 6 = 0. What is the closest to 0.1 in 0.5, -4, y? 0.5 Let j = 45/4 - 11. Let o(p) = p - 8. Let c be o(12). Suppose -c = -v - 5. What is the nearest to v in 3, j, 0? 0 Let r = 41 - 25. Let f = 16.3 - r. Which is the closest to -0.1? (a) -1/7 (b) 0.1 (c) f a Let l = 18 - 19. What is the nearest to l in -0.4, 2/11, -1/5? -0.4 Let o = 11 + -9. What is the closest to 0.1 in -4, -3, o? o Suppose -2s + 3q + 18 = s, q = -2s + 18. Let d be 4/(-14) - s/(-14). Which is the closest to d? (a) 0.5 (b) -5 (c) 1 a Let k = -118 - -475/4. Let w be (-1)/((-7)/2 + 4). Which is the closest to w? (a) -1 (b) 0.3 (c) k a Let z be 6/(-16)4/6. Let d = -0.1 - -1.1. Let n = -4 - -4. What is the closest to -0.2 in z, n, d? z Let y = -5 - -7. Which is the nearest to -0.1? (a) -0.5 (b) -0.1 (c) y b Let t = 0.32 + -0.02. Let h = 0.4 - t. Let w = -166 + 1828/11. Which is the closest to h? (a) -1/2 (b) -1 (c) w c Suppose 4n - 1 = 15. Let t be 1/n - 10/8. Let x = 21 + -20. Which is the closest to x? (a) t (b) 0.1 (c) -0.5 b Let w = -1/38 + 79/114. Let j be 392/(-830) - 8/(-20). Let t = j - 100/913. Which is the nearest to w? (a) 2/15 (b) t (c) -2/5 a Suppose 4n + 0r + r = 15, r + 12 = 5n. Let c = -0.4 + 0.2. Let y = 0.3 + c. What is the nearest to -1 in y, 3/2, n? y Let n = 14 + -21. Which is the nearest to -1/2? (a) n (b) 3 (c) 2 c Let z = 301 + -3309/11. Let m = -0.3 + 0.1. Let l = -0.3 - m. What is the closest to 1 in l, 4, z? z Let s = 1 + -1.5. Let x = -0.12 - -0.82. Let r = x - -1.3. Which is the nearest to 1? (a) r (b) s (c) 0.4 c Let z be (24/9 - 3) + (-89)/21. What is the closest to 0 in z, 1, 2/15? 2/15 Let p = -3.07 + -0.93. Which is the nearest to 1? (a) -1 (b) p (c) -3 a Let q = 22.7 - 23. What is the nearest to -0.1 in q, -1, -5? q Let t = -51 + 155/3. Which is the closest to 0? (a) 1/2 (b) -3 (c) t a Let v = -1/185 + 377/1295. Let x = -1/4 + 7/12. What is the closest to x in -2/11, v, -1? v Let t be (3/7)/((-18)/12). Let u = -59/3 - -20. What is the closest to u in t, -2, -5? t Let h = -277/5 + 55. Which is the nearest to -1? (a) 5 (b) -4 (c) h c Let l = 14 - 19. Which is the closest to -1? (a) -2/7 (b) 2/11 (c) l a Let o = 0 - 0.2. Let m = -12.4 - 0.1. Let n = m - -12. Which is the closest to 0.3? (a) o (b) -2 (c) n a Let l be 0 - 2 - 2-1. Suppose m = -lm + 2. Suppose -3s - 3 = -3w, -5w + 0w = 3s - 13. Which is the nearest to s? (a) 4 (b) m (c) -5 b Let o = -0.59 - -0.5. Let s = 0.19 + o. Which is the closest to -2? (a) 2/11 (b) s (c) -3 c Let b = -93/130 + 3/26. Let a = -3 - -5. Let d be (3/(-7))/(3/a). What is the nearest to -1/3 in b, -5, d? d Let a = 0.5 + -17.5. Let f = a - -14. What is the closest to 0.1 in f, -5, -4? f Let i(k) = 21k3 + 2k*2 + 2k + 2. Let h be i(-2). Let z = h + 813/5. Let l = 0.9 + -	{ "pile_set_name": "DM Mathematics" }
icrometers are there in 5/4 of a centimeter? 12500 How many millilitres are there in fifty-four fifths of a litre? 10800 What is 36694.06um in millimeters? 36.69406 How many litres are there in 0.6025951ml? 0.0006025951 Convert 8.136678kg to micrograms. 8136678000 What is 51577.57nm in millimeters? 0.05157757 What is 1/20 of a litre in millilitres? 50 Convert 5.593214nm to meters. 0.000000005593214 Convert 0.2052612 microseconds to nanoseconds. 205.2612 What is 837622.7 litres in millilitres? 837622700 What is seven halves of a kilogram in grams? 3500 What is five quarters of a gram in milligrams? 1250 What is 3/50 of a meter in millimeters? 60 What is fifteen quarters of a microgram in nanograms? 3750 What is 3/5 of a milligram in micrograms? 600 Convert 81.92936 millilitres to litres. 0.08192936 How many decades are there in 3/25 of a millennium? 12 How many millilitres are there in 85.7498l? 85749.8 What is 1/10 of a micrometer in nanometers? 100 How many millilitres are there in thirteen quarters of a litre? 3250 How many years are there in twenty-one fifths of a century? 420 Convert 1.596933l to millilitres. 1596.933 How many micrometers are there in 401.5068nm? 0.4015068 What is 21/4 of a litre in millilitres? 5250 How many seconds are there in two fifteenths of a minute? 8 How many litres are there in 57.01442 millilitres? 0.05701442 How many micrometers are there in 21/4 of a millimeter? 5250 How many kilograms are there in 18/5 of a tonne? 3600 How many seconds are there in 654.396 days? 56539814.4 Convert 21.7354 days to hours. 521.6496 What is four thirds of a millennium in months? 16000 How many millilitres are there in 8/25 of a litre? 320 What is 42/5 of a day in minutes? 12096 Convert 0.8083603 kilometers to centimeters. 80836.03 How many decades are there in 97295.76 millennia? 9729576 What is 3/5 of a litre in millilitres? 600 How many litres are there in 108.3644 millilitres? 0.1083644 Convert 8.212656 days to minutes. 11826.22464 How many grams are there in 26/5 of a kilogram? 5200 What is 752252.6 years in decades? 75225.26 How many kilograms are there in 65316.18 grams? 65.31618 How many millennia are there in 36493.18 years? 36.49318 Convert 36.79553 decades to years. 367.9553 What is 1/10 of a tonne in grams? 100000 Convert 0.0530749 kilograms to nanograms. 53074900000 Convert 6.872502 microseconds to nanoseconds. 6872.502 What is 7/2 of a millimeter in micrometers? 3500 Convert 1.726983 micrometers to centimeters. 0.0001726983 What is fifty-one halves of a microgram in nanograms? 25500 What is 5950.4 years in centuries? 59.504 Convert 0.0814605mm to centimeters. 0.00814605 What is 5/4 of a kilometer in meters? 1250 What is 8245.708l in millilitres? 8245708 What is 11/2 of a microgram in nanograms? 5500 What is 3.275963 years in millennia? 0.003275963 How many micrometers are there in 3/32 of a meter? 93750 What is seven sixths of a century in months? 1400 Convert 202.8578ml to litres. 0.2028578 How many minutes are there in 13.285026 seconds? 0.2214171 What is 3/50 of a kilometer in millimeters? 60000 What is 45/2 of a week in hours? 3780 What is 3/40 of a litre in millilitres? 75 What is 65794.3965 milliseconds in weeks? 0.00010878703125 Convert 627.2466ng to tonnes. 0.0000000000006272466 What is 0.2887735 milligrams in micrograms? 288.7735 How many micrometers are there in 5/8 of a centimeter? 6250 What is 1/9 of a hour in seconds? 400 What is 43/4 of a decade in months? 1290 How many microseconds are there in 2471.007s? 2471007000 What is 69/2 of a year in months? 414 How many millilitres are there in 6/5 of a litre? 1200 What is 29/5 of a litre in millilitres? 5800 What is 19292.84ml in litres? 19.29284 How many grams are there in 3.59165 milligrams? 0.00359165 Convert 531.5863 minutes to milliseconds. 31895178 What is 255697.2 meters in centimeters? 25569720 Convert 6287.752l to millilitres. 6287752 How many days are there in 70392.294 minutes? 48.8835375 How many nanometers are there in three tenths of a micrometer? 300 How many months are there in 17/4 of a millennium? 51000 What is 3725.2229 days in weeks? 532.1747 What is nine tenths of a millennium in months? 10800 Convert 9493.308 centimeters to kilometers. 0.09493308 Convert 50474.9 hours to milliseconds. 181709640000 What is 0.1489576nm in meters? 0.0000000001489576 What is 1/5 of a litre in millilitres? 200 What is 44.408403 microseconds in hours? 0.0000000123356675 Convert 6.021469ng to micrograms. 0.006021469 How many microseconds are there in 8.145181ns? 0.008145181 Convert 818.9563 millennia to decades. 81895.63 What is 31/2 of a centimeter in millimeters? 155 How many kilograms are there in 11/4 of a tonne? 2750 How many millilitres are there in 3/10 of a litre? 300 What is thirteen fifths of a microsecond in nanoseconds? 2600 How many months are there in fourty-three thirds of a year? 172 How many seconds are there in 4/15 of a day? 23040 Convert 0.75812ng to milligrams. 0.00000075812 How many kilograms are there in 25.0483mg? 0.0000250483 How many meters are there in 9447.849 kilometers? 9447849 What is 69286.11 decades in centuries? 6928.611 How many meters are there in 8092.534 millimeters? 8.092534 How many millilitres are there in 5/4 of a litre? 1250 How many meters are there in 5/4 of a kilometer? 1250 How many minutes are there in 250123.14s? 4168.719 What is 277.347 centuries in decades? 2773.47 What is 900.3175 millennia in months? 10803810 What is 13/4 of a day in hours? 78 How many months are there in 0.1592932 centuries? 191.15184 How many kilograms are there in 46334.92 grams? 46.33492 How many nanograms are there in 72/5 of a microgram? 14400 What is 7025.66kg in milligrams? 7025660000 What is 792.9325 millennia in years? 792932.5 Convert 23743.125 hours to weeks. 141.328125 What is 1/10 of a microsecond in nanoseconds? 100 How many micrometers are there in three fifths of a centimeter? 6000 What is 1/10 of a litre in millilitres? 100 How many months are there in 8/15 of a decade? 64 What is two fifteenths of a week in seconds? 80640 What is 342746.8nm in centimeters? 0.03427468 What is twenty-one fifths of a litre in millilitres? 4200 What is fourty-five halves of a meter in millimeters? 22500 How many kilometers are there in 0.2490859 centimeters? 0.000002490859 How many decades are there in seven quarters of a millennium? 175 Convert 3676.997 tonnes to milligrams. 3676997000000 How many years are there in 974.9808 centuries? 97498.08 How many millilitres are there in 12/25 of a litre? 480 How many millilitres are there in 27/5 of a litre? 5400 Convert 5509.24 millilitres to litres. 5.50924 What is 4.32066 minutes in hours? 0.072011 What is 0.0507339ml in litres? 0.0000507339 How many millilitres are there in 7/2 of a litre? 3500 What is fifty-five halves of a kilogram in grams? 27500 How many micrometers are there in 1/5 of a centimeter? 2000 What is five quarters of a century in years? 125 What is 3/5 of a litre in millilitres? 600 Convert 227.024 centuries to months. 272428.8 Convert 277194.54s to minutes. 4619.909 Convert 9279.757 hours to nanoseconds. 33407125200000000 Convert 12.367263 months to years. 1.03060525 How many microseconds are there in 2.297556 seconds? 2297556 What is 5/4 of a meter in millimeters? 1250 What is 2056.625 millilitres in litres? 2.056625 How many millimeters are there in 1/20 of a kilometer? 50000 How many kilograms are there in eleven tenths of a tonne? 1100 What is 31/2 of a kilometer in meters? 15500 What is 71.68725 months in decades? 0.59739375 Convert 16.121889 hours to weeks. 0.095963625 Convert 9.050744kg to micrograms. 9050744000 What is 1559.441 centimeters in micrometers? 15594410 What is 1/10 of a meter in centimeters? 10 What is seventy-one fifths of a kilogram in grams? 14200 How many grams are there in 13/4 of a kilogram? 3250 What is 0.4398789 decades in months? 52.785468 How many nanograms are there in 3/32 of a milligram? 93750 How many millennia are there in 11244.05 years? 11.24405 What is 93501.9 kilometers in millimeters? 93501900000 How many grams are there in fourty-two fifths of a kilogram? 8400 What is 57/5 of a kilometer in meters? 11400 What is 71/5 of a century in yea	{ "pile_set_name": "DM Mathematics" }
of 64 and -4.14? -264.96 Product of 21 and -46095. -967995 Multiply -0.0290577 and 0.06. -0.001743462 125456 * -1.5 -188184 -7.55 * 0.2085 -1.574175 0.285-745 -212.325 2 -136984 -273968 38-9006 -342228 What is -46581 times -0.3? 13974.3 2091 0.374 782.034 What is 1860 times -9? -16740 Calculate -5078-10.9. 55350.2 15653199 5006435 Work out 20.8 * 4.288. 89.1904 What is 7.49 times 1.7? 12.733 Calculate 0-67727. 0 Calculate 4-0.28033. -1.12132 What is the product of 0.8 and 89679? 71743.2 Multiply -0.08101 and 2. -0.16202 Work out 403 * 196. 78988 Multiply -0.52 and -44882. 23338.64 Work out -0.18 * -0.07134. 0.0128412 What is the product of 0.02 and 119.686? 2.39372 Work out -13167 * 6. -79002 What is the product of 0.12 and 327501? 39300.12 What is 0.7808 times -14.7? -11.47776 What is the product of -0.0458 and -3648? 167.0784 Multiply 0.094 and 1. 0.094 0.0358371 * -4 -0.1433484 What is the product of 0.5099 and -5.8? -2.95742 Multiply -0.101374 and -0.3. 0.0304122 15295 times 0.4 6118 02.23064 0 Work out 2.16 311. 671.76 Work out -163442 * -0.17. 27785.14 0.393-0.04682 -0.01840026 Multiply 5.906824 and -0.3. -1.7720472 What is -37.42 times 0.09? -3.3678 Product of 2 and 1.09402. 2.18804 Multiply -52 and 37.35. -1942.2 Multiply -0.32 and 40040. -12812.8 Multiply -4.43 and -13.3. 58.919 3 times -15352 -46056 Calculate 10.006621. 0.006621 -240-0.063 15.12 -13529 times 13 -175877 Work out 0.5 14688.61. 7344.305 Multiply 0.052794 and -3. -0.158382 2-9.7221 -19.4442 -1757-2308 4055156 Multiply -1 and 442218. -442218 42 * 0.09 3.78 Work out 143 * 292.5. 41827.5 Calculate -19831.80.4. -7932.72 Multiply 25.68965 and 0.1. 2.568965 Product of -3 and -1566. 4698 -0.5 times -76117 38058.5 What is -1.88 times -40? 75.2 What is the product of 143420 and -0.2? -28684 What is 72765 times -2? -145530 What is -0.04 times 44.9? -1.796 42.873760.2 8.574752 What is the product of -6184 and -2.65? 16387.6 What is -0.3 times 66404? -19921.2 Calculate 9.4-10. -94 Calculate 11.5-0.49. -5.635 Work out 0.7 * 1251.9. 876.33 What is 47 times 0.047556? 2.235132 4.10.41 1.681 What is the product of 657693 and -0.5? -328846.5 Product of 0.3 and -0.037634. -0.0112902 Work out -59.8265 0.1. -5.98265 Multiply 0.14 and 0.5351. 0.074914 Product of 186 and -0.1587. -29.5182 What is the product of 1303742 and 0.4? 521496.8 77.940.5 38.97 What is the product of 0.64214 and -0.3? -0.192642 -3080-201 619080 0.02 * 10885 217.7 -1.634 times -13 21.242 Multiply 9.926 and 1. 9.926 -6204 times 1.9 -11787.6 Product of -3.034 and -32. 97.088 -0.1 * 3898 -389.8 Calculate 62.646-0.06. -3.75876 Work out -28.48 5.7. -162.336 Multiply 0.452 and 0.048. 0.021696 0.3 * -3709 -1112.7 Calculate -1452822. -739508 Product of 41083 and 0.2. 8216.6 -0.12 5342 -641.04 Work out -191.1 * -10. 1911 0.56 * -6 -3.36 Calculate 1.38195. 269.1 Work out 1063733 -3. -3191199 Multiply -25 and 0.2915. -7.2875 Multiply 10 and -51130. -511300 Product of 0.04 and -5629. -225.16 -2519 * 105 -264495 Calculate 0.355872. 16761.6 Work out -25.697 0.4. -10.2788 Multiply 0.1 and -0.027133. -0.0027133 0.60.22376 0.134256 What is -5 times -0.09451? 0.47255 19.8 times 0.0325 0.6435 -176094 times -0.2 35218.8 What is -4.83 times 47? -227.01 -761.10.5 -380.55 What is 0.041 times -0.0569? -0.0023329 -0.3181 times 12 -3.8172 Work out 1 * -1338.6. -1338.6 What is the product of 0.04 and -0.051942? -0.00207768 Calculate -0.195587-3. 0.586761 7510.16 120.16 Product of 841 and -2.4. -2018.4 0 * -14723 0 Work out -170408 * -15. 2556120 -16 times -133.92 2142.72 -6295 times 4 -25180 35.513.2 468.6 -4.929120.3 -1.478736 2 times -5985 -11970 147 times 3597 528759 Calculate 4130.0413. 17.0569 Calculate -0.1-197061. 19706.1 1.028141 1.02814 What is 3.09 times -69? -213.21 -39.6 -5462 216295.2 Work out 0.2 * 107.4. 21.48 Work out 3.963 * 0. 0 Product of 9 and 0.495043. 4.455387 What is the product of 3812 and 85? 324020 Work out -0.005039 * -0.1. 0.0005039 Multiply 3 and -1537.8. -4613.4 -309.2790.4 -123.7116 8632613 2804718 -0.493330 -37332 22291 times -0.2 -4458.2 -236 -1051 248036 Multiply 2119 and -0.25. -529.75 Work out -4.423 * 0.195. -0.862485 What is 5 times -31.04? -155.2 What is the product of 3.3 and -28859? -95234.7 Calculate -0.0857197-2. 0.1714394 Multiply 3 and 10.15198. 30.45594 What is the product of 0.5 and 8.32992? 4.16496 Work out 11757 15. 176355 What is the product of -829.9 and 0.6? -497.94 1-4.855 -4.855 Calculate 821746-0.2. -164349.2 1189 * -91 -108199 73.7 * -265 -19530.5 Calculate -4-0.124663. 0.498652 4.71 357 1681.47 Product of -10680 and -2. 21360 Multiply 7931 and 62. 491722 Work out 33939 * -22. -746658 -418 times -611 255398 What is -3566 times -0.21? 748.86 What is the product of 4 and 0.876? 3.504 -61.19811 -7.18866 0.4-13621 -5448.4 What is the product of -6 and 55676? -334056 -0.08 * 106090 -8487.2 -1609555 -804775 -40030 0 What is the product of -9.8943 and 2? -19.7886 Product of -610752 and 0. 0 12.62149 27077.4 Product of -30410 and 0.13. -3953.3 What is -251093 times -2? 502186 Calculate -1320.851. -1320.85 Multiply -0.4 and -0.1124. 0.04496 What is the product of -116 and 818? -94888 Product of 8606 and -29. -249574 Calculate -20030.42. -841.26 -2 23343 -46686 What is -0.3 times 1930? -579 0.02281.418 0.0323304 Product of 0.3 and 173.9. 52.17 Calculate 0.4131.9. 52.76 -15900843 -4770252 -3762-0.1 376.2 3708-45 -166860 What is the product of -0.3 and -181.7? 54.51 Work out 22 0.01322. 0.29084 1128.6-39 -44015.4 What is 17 times 1430? 24310 -47.8 times 82 -3919.6 Product of 13 and 468.6. 6091.8 2-952 -1904 -0.11.9485 -0.19485 Multiply 0.62916 and -33. -20.76228 What is the product of -0.5 and -11135? 5567.5 -0.4 times -65172.9 26069.16 Calculate 17655. 11135 -10 times -2255 22550 What is 0.068394 times 26? 1.778244 What is the product of -36.6663 and -0.4? 14.66652 What is the product of 401498 and -0.06? -24089.88 Multiply -0.08941 and 0.7. -0.062587 Multiply -751 and 15.09. -11332.59 Multiply 69 and 626. 43194 Multiply 0 and -222794. 0 Product of 3790 and -3.94. -14932.6 Multiply 885 and 1546. 1368210 What is 3842 times 2? 7684 3417-2 -6834 Work out 1 -259341. -259341 Product of 192 and 125. 24000 10 * -9195 -91950 Multiply 1762 and 0.13. 229.06 -1 times -1443279 1443279 Multiply -0.7 and -0.0226824. 0.01587768 0.4-5666 -2266.4 What is the product of 0.21 and 48063? 10093.23 0.1 times -0.109969 -0.0109969 What is the product of 0.1920034 and -5? -0.960017 Calculate 190.1407. 77370.7 -0.2-389717 77943.4 What is 9.7213 times 0.5? 4.86065 Work out 1 -4774.5. -4774.5 84 times 0 0 What is the product of -5711042 and 0.1? -571104.2 Calculate -0.0924.28. -0.39376 271 -475 -128725 Calculate 291819. 55442 What is the product of -0.6 and -0.81864? 0.491184 Product of -70.6088 and 0.05. -3.53044 Multiply 1723771 and 0. 0 What is 0.05 times 9.9829? 0.499145 Multiply -1.6629 and 21. -34.9209 Work out -14 0.92259. -12.91626 Work out 10195 * -0.06. -611.7 -132 * -33.5 4422 9910.2-3 -29730.6 19314 -42 -811188 -525 times -4.4 2310 Product of -5 and -0.0373. 0.1865 Product of -0.17 and -31.05. 5.2785 Work out -948 * 6.89. -6531.72 -402.6122 -805.224 1.21981-1.8 -2.195658 Product of 210 and -0.156. -32.76 Multiply 12.37 and 483. 5974.71 0.5 * -18875 -9437.5 -0.0086-2.7 0.02322 -4335422 times 4 -17341688 Product of -0.4 and -2435. 974 Calculate -118.567. -18.567 Product of -0.6 and 0.040099. -0.0240594 0 * 669309 0 What is -0.13 times 840? -109.2 Multiply -270 and -256. 69120 What is 0.5 times -901468? -450734 Calculate 2380.0019. 0.4522 What is 3 times 66973? 200919 Product of 0.123578 and -0.2. -0.0247156 Multiply -3786 and -0.4. 1514.4 Calculate 313364. 125344 -23227-0.08 1858.16 What is 2.2283 times -5? -11.1415 Work out -19.4 42.33. -821.202 Multiply 304.5 and -6.94. -2113.23 -0.4-5003 2001.2 Work out 35 3.054. 106.89 Multiply 0.02636 and 7. 0.18452 0 times -582 0 Multiply -0.402 and -183. 73.566 What is 111.8 times -2.54? -283.972 What is -125710 times 0.5? -62855 What is the product of 157525 and 1? 157525 Multiply -0.5 and 401434. -200717 68.329 times -2 -136.658 What is -0.5 times -12578? 6289	{ "pile_set_name": "DM Mathematics" }
et x be t(-5). What is the greatest common factor of x and l? 4 Let w = -14 + 25. Let f = w - -5. Suppose 2 = m - f. Calculate the greatest common factor of m and 126. 18 Suppose -16 = -4k - 4. Suppose -a = -ka + 120. Suppose -5l - m = -98, 8l - 3l - 104 = 2m. What is the greatest common divisor of a and l? 20 Suppose 0r = 3r - 27. Let i be (-48)/r-3 - 1. What is the highest common factor of 105 and i? 15 Suppose -l + 2 = 24. Let u = 43 + l. What is the highest common factor of u and 21? 21 Let x(s) = -s + 6. Let z be x(-6). Let v = z + -7. Suppose vd - 1540 = d. Calculate the highest common divisor of 35 and d. 35 Suppose 44 = s - 5z - 40, 0 = -z. Let l(o) = o3 + 8o*2 - 3o + 7. Let y be l(-8). Suppose 5g - y = 74. What is the greatest common divisor of g and s? 21 Let t = 276 + -188. Suppose 0 = 5b - 4b - t. Calculate the highest common divisor of b and 11. 11 Let p = 6 - 3. Suppose -pc = v - 47, -3v + 51 = 2c + c. Let f = 65 + c. Calculate the highest common divisor of f and 10. 10 Let s be (-3 + 4)215. Let z be -4 + -4 + 11 + -3. Let j be (z - -18)/(39/26). Calculate the greatest common divisor of j and s. 6 Suppose -5j - 4g + 3 = 0, 0g - 5g + 10 = 0. Let l = -4 + j. Let m be (l - (3 + -5))/(-1). What is the highest common factor of m and 24? 3 Suppose 0 = -4m + 4v + 396, 15m - 20m + 2v + 495 = 0. What is the greatest common divisor of m and 171? 9 Let d(z) = -z3 - 2z*2 + 5z + 38. Let x be d(-5). What is the greatest common factor of 209 and x? 11 Let n = 185 + 148. Let j = n - 186. What is the highest common divisor of j and 21? 21 Let v = 470 + -301. What is the greatest common factor of 65 and v? 13 Let a = -9 + 11. Suppose 11n - 2n = 36. What is the greatest common divisor of a and n? 2 Suppose 0 = 4b + 5w - 219, 6w = 2b + 3w - 93. Suppose 0u = 2u - 34. Calculate the highest common factor of u and b. 17 Suppose 60 = 2p - 0p + 4d, 2d - 90 = -4p. Suppose -a + 5v - 20 - 4 = 0, 4v - p = 0. Let i = 12 + a. Calculate the highest common factor of 117 and i. 13 Suppose 102 = 4f - 198. Calculate the greatest common divisor of f and 250. 25 Let k be 1/(-2)-554. Let l be 1140/(-1520) + -1 + (-94)/(-8). What is the greatest common factor of k and l? 10 Let b = -16 - 0. Let q = b - -27. What is the greatest common divisor of 154 and q? 11 Let d = 27 - -50. Let s = d - 2. Calculate the greatest common factor of s and 30. 15 Suppose 0 = 3s - 5s + 8. Suppose -3n - 1 = -4p, -4n = 5p - 8p - 1. What is the highest common factor of n and s? 1 Let m(i) = 4i2 - 2i + 7. Let f be m(-3). Suppose -g + 4g - 4x = 36, 5x = 4g - f. What is the highest common factor of g and 176? 16 Let x(s) = 11s2 - 9s - 8 + 14 + 8. Let h be x(4). What is the greatest common divisor of h and 14? 14 Suppose 6j + 2474 - 7550 = 0. Calculate the highest common factor of 36 and j. 18 Let m(b) = -70b3 + b2 - b - 1. Let z be m(-1). Suppose -z - 167 = -2k. Let o = 175 + -158. Calculate the greatest common factor of k and o. 17 Suppose 3w - 48 = 3a, -4w = 2a + 11 - 45. Let p = w - 7. Let t be 5/(1/36p). What is the highest common factor of t and 15? 15 Let i be (-4)/26/(-4). Let b be (0(-3)/6)/(-1). Suppose -2t + 31 = 2n + t, -5n + it + 67 = b. Calculate the highest common factor of n and 14. 14 Let h(w) = 3w - 1. Let p be h(5). Suppose -4j - 2n - 38 + 168 = 0, 2j - 75 = -3n. Let y = j + 12. Calculate the highest common divisor of y and p. 14 Let w be 3 + (1 - 4) - 0. Let t be 123 - -4 - (3 - w). Suppose -s = -t + 3. What is the highest common factor of s and 11? 11 Suppose 2r + 2q = -2r - 394, -5q = r + 76. Let u = -30 - r. Let p = u - 51. What is the highest common factor of p and 5? 5 Let c = 192 + -159. Calculate the greatest common factor of c and 33. 33 Let g = -3 + 11. Suppose g = 2h - h. Suppose h = -4k, u - 4k + 1 = 12. What is the highest common divisor of 24 and u? 3 Let i(c) = -6c - 21. Let n be i(-5). Calculate the highest common factor of 171 and n. 9 Let f be 19/5(80 + -35). What is the highest common factor of 9 and f? 9 Let o = 200 + -188. Let d be 36/(2(2 - 14/8)). Calculate the greatest common factor of o and d. 12 Let b be (-9)/(-6) - (-3)/(-2). Suppose 2k + o - 24 = b, 5o + 2 + 18 = 4k. Let m be (-10)/8 + (-13505)/(-148). What is the highest common factor of k and m? 10 Let g be (-2046)/(-9) + (10/3)/5. Calculate the greatest common factor of g and 84. 12 Suppose -3n = -3j - 21, 6 = -3j - 3. Let c = 56 + 32. Let t = c + -48. Calculate the greatest common divisor of t and n. 4 Let u(f) = 24f + 10 - 50f + 25f + 8. Let b be u(10). Calculate the highest common factor of b and 64. 8 Suppose s - 2k + 3 = -5, 4s = -4k + 28. Suppose 5j = 4y + 46, 2j + 4y - 8 = -sj. Calculate the highest common divisor of j and 24. 6 Suppose 1 = -h + 4q, -9 - 38 = -3h + 2q. What is the highest common factor of h and 437? 19 Suppose 0k + 5k = 95. Let h = 80 - 156. Let u be (h/5)/((-2)/10). Calculate the greatest common divisor of k and u. 19 Let f be 254/4 - -1. Suppose 24 = h + 3h. Suppose a - ha = -2v - 6, -3v + 41 = 5a. What is the greatest common divisor of v and f? 7 Let y(q) = -q2 + 42q - 206. Let k be y(36). What is the greatest common divisor of 210 and k? 10 Let h = -1235 - -1235. Let f(q) = 4q + 57. Let w(z) = -4z - 58. Let k(u) = -2f(u) - 3w(u). Let j be k(h). Calculate the greatest common factor of j and 12. 12 Let l be 105/230/9. Calculate the highest common divisor of l and 140. 35 Let g = 545 + -509. What is the highest common divisor of 8 and g? 4 Let m = -14 - -14. Suppose -d = -h - 18, d + h - 4 - 6 = m. Let o(a) = a3 + 6a*2 - 5a + 5. Let y be o(-6). Calculate the highest common factor of y and d. 7 Let a(j) be the first derivative of 3j2 + 2j - 40. Let i be a(4). Calculate the greatest common divisor of 286 and i. 26 Suppose -4b + 85 = 5v - 253, v - 5b - 56 = 0. Calculate the greatest common divisor of v and 108. 6 Let a(o) = -5o - 4 + 6o2 + 4o - 5o2. Let u be a(3). Let y = 2 + u. Calculate the highest common factor of 8 and y. 4 Suppose -3a + 2a = -16. Let x(h) = h3 - 15h*2 - 14h + 34. Let j be x(a). What is the greatest common factor of 22 and j? 22 Let f(s) = s*2 + 7. Let y be f(0). Let u = y - 6. Let z be (18/(-9))/((-3)/((-6)/(-4))). What is the highest common divisor of u and z? 1 Suppose 0 = -8h + 4h + 3i + 96, -5i - 125 = -5h. What is the highest common factor of 399 and h? 21 Suppose i - 1235 = -18i. Let j be (116/(-16) - -7) + i/4. What is the greatest common divisor of j and 64? 16 Suppose -3v = -7v + 496. Calculate the highest common divisor of 93 and v. 31 Let w be 4/(-12)0 - -10. Let j = -441 - -641. Suppose 0 = s + 3s - j. What is the greatest common factor of w and s? 10 Let m(x) = 2x + 12. Let r be m(-7). Let j(l) = 127l - 3. Let k be j(r). Let i = -180 - k. What is the greatest common divisor of 7 and i? 7 Let p = 145 + -97. Calculate the greatest common factor of p and 60. 12 Let u(s) = -7s*3 + 4s*2 + 6s - 2. Let w be u(-4). Calculate the highest common factor of 108 and w. 54 Let g(k) = 48k2 - 18k + 19. Let j be g(4). What is the highest common factor of 20 and j? 5 Suppose 0i - 4i = -16. Let a be 3/(i/((-20)/(-3))). Suppose 230 = 7g - ag. Calculate the greatest common divisor of 46 and g. 23 Let k = -45 + 84. Calculate the greatest common divisor of k and 13. 13 Suppose 2x - x = 4. Let o be 2 - x/(3 - -1). Let h(g) = 82g - 1. Let v be h(o). What is the highest common factor of v and 9? 9 Let i(x) = -72x. Let f be i(-3). Calculate the highest common divisor of f and 1368. 72 Let a(o) = 2o*3 - 9o*2 - 8o - 9. Let w be a(7). What is the highest common factor of w and 240? 60 Suppose -5r - 101 = -111. Suppose -3j + 30 = 2d + d, 2d - rj = 24. Calculate the greatest common factor of d and 176. 11 Let b(y) = 347y - 49. Let c be b(2). What is the greatest common factor of 30 and c? 15 Suppose -3u + 0u = -9. Let c(m) = -2m + 5. Let s be ((-2)/3)/(((-8)/6)/(-4)). Let k be c(s). Calculate the highest common divisor of k and u. 3 Suppose 6x + 36x - 168 = 0. Suppose -3b + 0*b = -180. Let a = -40 + b. Calculate the greatest common factor of a and x. 4 Le	{ "pile_set_name": "DM Mathematics" }
uppose 84 = 255i - 276i. Give im(n) - 3k(n). 3n - 8 Suppose 24 = x + 3x - d, -5x + 3d = -30. Let p(i) = 69i - 9. Let z(y) = 34y - 5. Calculate xp(b) - 11z(b). 40b + 1 Let p(q) = -q - 1. Let i(u) = -67u + 34 + 157u + 38. Determine i(k) + 72p(k). 18k Let g(a) = -473a*3 - 11. Let i(u) = 1890u*3 + 42. Calculate -11g(d) - 3i(d). -467d*3 - 5 Let r(y) be the second derivative of -7/6y*3 - 28y - y*2 + 1/12y*4 + 0. Let n(q) = 3q*2 - 8 + 6q + q*2 - 5q*2 + 10. What is -7n(d) - 6r(d)? d2 - 2 Let c(f) be the third derivative of f4/24 - 922f*2. Let d(g) = -33. Calculate 2c(n) - d(n). 2n + 33 Let w(r) = -2. Let o(z) = -100 + 65 + 25 + 10 + z. Let f(a) = -a3 - a2 + a + 2. Let q be f(0). Give qo(t) - w(t). 2t + 2 Let u(o) = -38o*2 - 2o + 2. Let s(x) be the first derivative of 215x3 + 35x*2/2 - 35x + 1585. Calculate 2s(k) + 35u(k). -40k2 Let u(t) = -15t + 21. Let l(n) = 12n - 15. Let q(v) = -4l(v) - 3u(v). Let s(y) = y2. Let g be s(2). Let x(o) = 2o + 2. Give gq(i) + 5x(i). -2i - 2 Let t(w) = -37w*3 - 23w - 179. Let v(q) = 11q3 + 7q + 60. Give 2t(p) + 7v(p). 3p3 + 3p + 62 Suppose -3h + 0h - w - 11 = 0, -6 = 4h - 3w. Let q(k) = -9k3 + k. Let j(t) = -8t*3 + t. What is hj(x) + 2q(x)? 6x*3 - x Let k(j) = 19j*2 - 5j - 5. Let u(v) = -9v2 + 2v + 2. Let o = 125 + -115. Suppose -oy = -14y - 4w - 40, 4y = -2w - 30. Determine yu(h) - 2k(h). 7h*2 Let p(l) = 2l*2 + 8l + 11. Let v(k) = 2k2 + 14k + 15. Calculate -3p(x) + 2v(x). -2x2 + 4x - 3 Let x(y) be the third derivative of 43y5/60 + y4/24 - 18y*2 - 7. Let v(p) = -14p*2. What is 8v(g) + 3x(g)? 17g*2 + 3g Let s(n) = 2. Suppose -5r + 333 = 323. Let j = -132 - -127. Let y(i) = i + 4. Give js(z) + ry(z). 2z - 2 Let a = 2299 + -2304. Let g(s) = 5s2 + 2s. Let m(t) = -5t2 + 0t*2 + 204t - 207t. What is ag(w) - 4m(w)? -5w*2 + 2w Suppose -60 = -5s - 2y, s - 3y = 19 - 7. Let g(p) = sp - 4p + 2 + 2p - 11p. Let a(i) = 2i - 2. Determine -2a(c) - 3g(c). -c - 2 Let l(n) = -62792n - 1410. Let q(w) = -1610w - 36. Calculate 6l(m) - 235q(m). 1598m Let w(t) = 285t*3 - 2t*2 + 63. Let g(n) = 287n*3 - 3n*2 + 78. Give 4g(b) - 5w(b). -277b*3 - 2b2 - 3 Let q(j) = -j2 - j - 1. Let r(p) = 16p3 + 128p*2 + 128p + 128. Suppose 7 = -13w - 32. Determine wr(i) - 384q(i). -48i*3 Let d(h) be the third derivative of -5h4/12 - h3 - h*2 - 2h + 1735. Let p(i) = i*3 + i + 1. Give -d(g) - 6p(g). -6g3 + 4g Let z = 81 - 79. Let h = -1 - -3. Suppose zn - s - 9 = 0, -s + h = s. Let f(l) = -2l. Let o(m) = -m*2 + 4m - 1. Give nf(c) + 2o(c). -2c2 - 2c - 2 Let n(t) = 3210t2 - 1612t*2 - 1 + 5t - 1599t2 - 4t. Let p(r) = 16r2 + 8r - 9. Determine -18n(g) + 2p(g). 50g2 - 2g Let r(m) = 1941m - 3930m + 1991m + 1 + 2. Let j(q) = 3q + 3. Calculate 4j(l) - 5r(l). 2l - 3 Let j(b) = 3b*2 + 5b - 5. Let z = 59 + -29. Suppose 5o = 45 + z. Suppose -36f = -33f - o. Let u(m) = 4m*2 + 8m - 8. Give fu(t) - 8j(t). -4t2 Let r(u) = 4u3 - u2 + 6u - 9. Let o(c) = -12c*2 - c - 17c*2 + 27c*2 + 12c - 13 + 6c3 - 2c. Calculate -5o(x) + 7r(x). -2x3 + 3x*2 - 3x + 2 Let b(z) = -z - 4. Let c(o) = -7o - 264. Give -2b(u) + c(u). -5u - 256 Let d = 203 + -57. Suppose 26m + d = -10. Let f(x) = -4x - 4. Let p(a) = a + 1. Calculate mf(q) - 26p(q). -2q - 2 Let b(g) be the first derivative of g + 2117. Let a(y) = -14y - 2. Calculate -a(l) - 2b(l). 14l Let v be 2/(-4) + (-63)/(-42). Let b(d) = -3d + 24. Let w be b(7). Let t(k) = 3k + k - 2k - wk. Let p(g) = -6g + 2. Calculate vp(m) - 5t(m). -m + 2 Let x(m) = 2m2 + 2. Let o(h) = -h2 + h - 1. Suppose -2u = 3z + 5, 0 = -3z - 7u + 2u - 17. Let v be (-1 - (-4)/(-3 - -1)) + 4. What is vo(s) + zx(s)? s*2 + s + 1 Let v(t) = 1. Let h(d) = 8d + 10. Suppose 2c + 18 = 2y, 0 = 4y - 7y - 6c - 45. Determine yh(i) - 6v(i). 8i + 4 Let c(p) = -92p - 193. Let q(u) = 92u + 233. Calculate 6c(b) + 5q(b). -92b + 7 Let o(k) = 28k*3 - 6k*2 - 57k - 3. Let h(p) = -82p3 + 20p*2 + 173p + 10. Determine -3h(f) - 10o(f). -34f3 + 51f Let g(p) = 37p2 + 2033p + 271. Let m(b) = 6b2 + 339b + 42. Give -2g(z) + 13m(z). 4z2 + 341z + 4 Let r(q) = 298q3 + 6q*2. Let v(m) = 199m*3 + 3m*2. Determine 5r(k) - 8v(k). -102k*3 + 6k*2 Let q(v) = -4v2 - 494. Let f(t) = -t2 - 1. Determine -6f(z) + 2q(z). -2z2 - 982 Let n(c) = -14c + 38. Let u(w) = -5w + 13. Let a(x) = 6n(x) - 17u(x). Let o(f) = 2f + 8. Let k be 24 - (-112)/(-8) - (4 + 0). What is ko(p) - 7a(p)? 5p - 1 Let o(c) = 5c + 3. Let i(z) = -9768z - 5772. Calculate -6i(f) - 11544o(f). 888f Suppose -3 = -2w + 1. Let p(f) = f - 11. Let r(v) = -13v + 146. Let y(u) = 53p(u) + 4r(u). Let i(n) = n - 4. Calculate wy(x) - i(x). x + 6 Let b(m) = -3m*3 + 6m*2 + 16m. Let d(a) = 5a2 + 8a - 7. Let v be d(1). Let u(i) = -3i3 + 5i*2 + 15i. Give vu(o) - 5b(o). -3o3 + 10o Let a(j) = 39j3 + 4j*2 + 7j + 9. Let l(m) = 157m3 + 18m*2 + 34m + 36. Determine -9a(x) + 2l(x). -37x3 + 5x - 9 Suppose 2z = 4d - 2, -4z - 11 + 14 = -d. Let h(w) = w2 + w - 1. Let t(n) = -4n*2 + n - 2. Calculate dt(a) + 2h(a). -2a*2 + 3a - 4 Let s = 322 - 320. Let g(w) = -46w - 23w + 72w - s + 1 + 2w*2. Let j(t) = 10t*2 - 4 + 3 - 3 + 14t. What is -14g(p) + 3j(p)? 2p2 + 2 Let q(d) = d + 1. Let k(o) be the second derivative of o3/2 + 3o*2/2 - 12o. Let r = 1100 - 1111. What is rq(p) + 4k(p)? p + 1 Let f(l) = l*3 + 78l*2 + 2l + 1. Let r(p) = 2p3 + 137p*2 + 5p + 1. Give 7f(w) - 4r(w). -w*3 - 2w*2 - 6w + 3 Let b(i) = 2i3 - i2 - 6i + 4. Let y(h) = 2h3 - h2 - 5h + 3. Suppose 4n = -10j + 13j, -j - 5 = -3n. What is nb(x) - 4y(x)? -2x3 + x2 + 2x Let f(r) = 2r - 1. Let n(v) = -175. Let k(j) = -29. Let s(i) = 6k(i) - n(i). Give -2f(u) + 2s(u). -4u + 4 Let z(h) = -16h*3 + 11h*2 - 45h + 22. Let a(t) = 3t3 - 2t*2 + 9t - 4. Give 11a(u) + 2z(u). u*3 + 9u Let u be (-1)/(2 - (-7)/(-3)). Let n(y) = 0y - y - yu + 18 - 17. Let v(d) = 496d + 6 - 1 - 499d - 4d*3. Determine 6n(r) - v(r). -2r3 - 3r + 1 Let a(p) be the first derivative of -7p3/3 + 5p*2 + 5. Let n(r) = 6r*2 - 9r. Suppose 81 = 51w - 225. Give wn(m) + 5a(m). m2 - 4m Suppose 5q = -3w + 1853, q - 1226 = 31w - 33w. Let v(l) = -2l + w - 611. Let p(g) = -5g. Determine 3p(i) - 8v(i). i Suppose -8v + 42 = -50v. Let t(d) = -9d2 - 6. Let i(p) = p2 + 1. Let a(h) = 0h - 2h + 4h + 2. Let w be a(-4). What is vt(g) + wi(g)? 3g2 Let m(s) = -3s + 989. Let y(f) = -8f + 2970. What is -11m(l) + 4y(l)? l + 1001 Let o(k) = -29k + 1839. Let d(p) = -48p + 3679. Give -3d(c) + 5o(c). -c - 1842 Let h(z) = -407z*2 - 4z - 8. Let u(y) = -y*2 + y + 2. Calculate -h(d) - 3u(d). 410d2 + d + 2 Let g(x) = -5x*2 - 10x + 5. Let p(f) = -f*2 - 2f + 1. Let s = 4 - -7. Let i = 1227 + -1229. Give ig(j) + sp(j). -j*2 - 2j + 1 Let a(j) = -j3 + j2 - 5. Let o(n) = n*2 + 5n - 2 + 14 - 8. Let w be o(-2). Let v(d) = -2. Let h be -1 + (8 - 0) - (13 - 11). Give hv(c) + wa(c). 2c3 - 2c*2 Let u(d) = 6d. Let f(j) = j*3 - 32j*2 + 272j - 3015. Let m be f(26). Let k be 12/5 - (-4)/(-10). Let r(g) = 2g + g - kg. Give mr(p) - u(p). -5p Let k(n) = 3n3 - 2n*2 - n. Let v be 168/(-14) - -13 - (-3 - -6). Let w(z) = 13z*3 - 9z*2 - 3z. Determine vw(r) + 9k(r). r*3 - 3r Let b(a) = 3a + 2. Let n = -2121 + 2119. Let g(d) = -d - 1. Let l(p) = p + 1. Let v(m) = -5g(m) - 2l(m). Calculate nv(q) + 3b(q). 3q Let g(t) = 30t2 - 2t + 13. Let v(q) = 239q2 - 17q + 109. Determine 17g(n) - 2v(n). 32n2 + 3 Let q(x) = 16 - 14x + 1 + x. Let g(j) = 9j + 16. Let y(h) = -7h - 14. Suppose 75a - 26 = 424. Let z(k) = ay(k) + 5g(k). Give 2q(p) + 9z(p). p - 2 Let w(p) = 7p - 20986. Let m(s) = -9s + 20970. Determine 3m(t) + 4w(t). t - 21034 Let y(m) = m2 - m. Let l(p) = -162p*3 - 9p*2 + 6p. Determine -l(f) - 9y(f). 162f*3 + 3f Let j(x) = 92x - 745. Let c(h) = -29h + 248. Gi	{ "pile_set_name": "DM Mathematics" }
ate the smallest common multiple of m and -11 + -506/(-8) - (-6)/4. 280 Let y = -9961369/192 - -51882. Calculate the common denominator of 89/8 and y. 192 Let x = -9373/2 + 4684. What is the common denominator of 23/91 and x? 182 Suppose -139i = -227i + 117i - 3828. What is the least common multiple of 120 and i? 1320 Suppose -5t - 3j + 118 = -t, -3t = -j - 82. Let i = 77041/14 + -5495. What is the common denominator of i and ((-8)/t)/(36/(-497))? 126 Suppose -3c - 2c = 5y + 50, 14 = -3c + y. What is the least common multiple of 46/c(-96)/32 and 1? 23 Let r(w) = w + 4. Suppose -28 = 22i - 18i. Let f be r(i). What is the least common multiple of (2 + f + -9)10/(-25) and 2? 4 Let a(w) = w3 + w + 18. What is the least common multiple of a(0) and 444/52 - (-600)/1300? 18 Suppose 15g + 1515 = 20732 + 21673. What is the lowest common multiple of 141 and g? 8178 Let z be 4/(-10) + (-3)/((-15)/482). Let i = z - 86. Let c = 21 - 5. Calculate the least common multiple of i and c. 80 Let h = -111269839/33 - -9265225789/2706. Let f = h - 52144. Find the common denominator of -35/8 and f. 328 Calculate the lowest common multiple of (-1685440)/(-800) + (-3)/(-15) and 3311. 23177 Suppose 0 = 3i + k - 19, 20 = 4i + 4k - 0k. Let l(m) = m*2 - 4m. Calculate the lowest common multiple of l(i) and ((-2)/(-14))/((-12)/(-714)) + (-2)/(-4). 63 Let f be (711527035/(-2546250))/(-31) - 8. Let n = 2/36375 + f. What is the common denominator of -151/6 and n? 210 Suppose -4r = 2x - 504, 3r + 1302 = -3x + 2064. What is the smallest common multiple of x and 68? 4352 Let p = 2119/4656 + 7/291. Calculate the common denominator of p and -59/18. 144 Suppose 857 = -32n + 9753. Calculate the smallest common multiple of 1251 and n. 2502 Let b(g) be the second derivative of g5/20 - 13g*4/12 + 19g3/3 + g2/2 - 60g. What is the smallest common multiple of b(9) and 1? 19 Calculate the common denominator of 79/1533 and (-6)/(-18) + (-10885)/31755. 44457 Let u(h) = -h - 163 + 164 + 3h + 3h2 + h3. Let a be u(-2). What is the common denominator of (a/(2/2))/(8/(-6)) and 11/4? 4 Let w be ((-1275)/(-9) + 10)(-12)/(-14). Let p be 6/(-2 + 316/154). Let f = p - w. Find the common denominator of f and 27/16. 16 Calculate the common denominator of 2/(-13872)(-196 + 6/(-21)-21) and 64/1445. 17340 Calculate the common denominator of 95/36 and (-6)/2 - 1355(-17)/12750. 900 Suppose 0 = -4m + m - 9. Let t be (-1 - 0)/(m/186). Calculate the lowest common multiple of 10 and ((-93)/t)/((-6)/8). 10 Let m(k) = -1 - 1 + 21k - 4k - 19k. What is the least common multiple of m(-2) and 9? 18 Suppose 3i = -4t + 1954, 26t = 29t + 3i - 1464. What is the least common multiple of t and 91? 6370 Let z = -197675/66 + 2995. Find the common denominator of (-135)/55 + 0 + 3 and z. 66 Calculate the common denominator of (((-242)/5)/2)/(-25 + 29) and -26/51. 1020 Suppose -3o + 56 = -7o. Find the common denominator of 71/24 and o/(-21) - (-77)/90. 360 Let f = -192477763/18 + 10681786. Let p = 11431 + f. Find the common denominator of 23/38 and p. 342 Suppose 0 = -3z + z + 108. Suppose 98q - 95q + 47 = 4i, -6q + 2 = 4i. What is the lowest common multiple of z and i? 216 Suppose b = 37 + 29. Calculate the common denominator of 3/b-81 + -1 and ((-66)/208)/(-10 + (-1182)/(-120)). 286 Let v = 102 + -101. Suppose -v = 3g - 10. Calculate the common denominator of ((-128)/(-40) - g) + 174/55 and 5/76. 836 Suppose 0 = -q + 4o - 17, -2q - 4 = o - 3o. Let p be (-242)/(-7) - 78/(-182). Suppose 0 = -25b + 160 - p. Calculate the least common multiple of b and q. 15 Let c be (2 - 0)-7(-4 - 18). Suppose 2i - 4i - 5q = -295, -603 = -4i + 3q. What is the smallest common multiple of i and 20/(-24)-3c/35? 1650 Let w = 16 - -3. Let t(v) = -wv + 4v - 4 - 8v - 5. Calculate the lowest common multiple of t(-1) and 66. 462 Suppose g = 4c - 400, -5g = -1 + 21. Let k(b) = b*2 + 19b - 132. What is the smallest common multiple of k(6) and c? 198 Let m = 3/5 - 41/55. Find the common denominator of m and 7/11. 55 Let z = -92 - -826/9. Let f = 4079/95 - 201/5. Calculate the common denominator of z and f. 171 Find the common denominator of 1/2 - (-11305)/(-3740) and 44/7. 308 Calculate the common denominator of 3/(-14) + (-5568)/2436 and 263/(-231) + 6/(-21). 66 Let y = -318326161/23170136 - -1/263297. Let j = -1/88 + y. Calculate the common denominator of j and 38/73. 292 Suppose 0 = -4h + 6k + 20, 15h = 17h + 3k - 46. What is the lowest common multiple of h and 7182? 7182 Let a be (-1)/(-5553)(-42)/42. Let v = 294557/1377144 + a. What is the common denominator of -3/10 and v? 1240 Suppose 4r - 5r + 48 = 0. Suppose 2m + 2b - 17 = 65 - 2, 4b = 16. What is the least common multiple of m and r? 144 Let f = 68 + -53. Suppose -a + 26 = -3d + 7, -3d = f. Suppose -u + 4 = -5b - 21, -5b = -3u + 85. Calculate the lowest common multiple of a and u. 60 Suppose -53i + 2943 = -10307. Calculate the lowest common multiple of 8 and i. 1000 Let t(p) = 205p + 438. Calculate the lowest common multiple of t(-2) and 164. 1148 Let q = 174761443/396 + -441317. Calculate the common denominator of q and 10/(-16)(-18)/(-10). 792 Suppose -1240 = 18w - 22w. Find the common denominator of (w/42 - 2)119/204 and 131/48. 144 Suppose -r = 1 - 4. Suppose rv - 13 - 2 = 0. Let n = v - -5. What is the smallest common multiple of 10 and n? 10 Let z(m) be the second derivative of 0 + 1/3m*3 + 16m - 4/3m4 + 1/10m*5 + 11/2m*2. What is the lowest common multiple of 15 and z(8)? 135 What is the lowest common multiple of 348 and (-4)/886 + 376/88? 348 Let v = 10171 + -6499294/639. What is the common denominator of 157/2130 and v? 6390 Suppose -3s + 13 = -11. Suppose 0 = -5j - 15, -u + 4j = -17 + 4. What is the smallest common multiple of s and (-182)/(-5) + u + 4/(-10)? 296 Let a be -3(0 + (-40)/12). Calculate the smallest common multiple of 20 and 8/a + 0 - (-6319)/445. 60 Let u(a) = -207a - 63. Let l be u(-23). Let c = -122129/26 + l. What is the common denominator of c and -5/18? 234 Find the common denominator of 76/2664228/576 and -121/20. 360 Suppose -18n - 10592 = 14n. Let o = -313 - n. What is the smallest common multiple of 1522 and o? 13698 What is the common denominator of -25/329 and (15 - (0 + 4))/(-101 + -1544)? 1645 Let k = -1150 + -190. Let z be k/(-25) + (-6)/(-15). Suppose -45 = -3v + z. What is the smallest common multiple of v and 24? 264 Suppose 5n = 2i + 140, -5n = -8 - 12. Let h = -58 - i. What is the lowest common multiple of 3141/9 - (h - -2) and 8? 344 Suppose -3n = -8n + 2r - 11730, -r - 5 = 0. Let g = -25796/11 - n. Calculate the common denominator of -16/5 and g. 55 Let d = 6824421 + -81845699/12. Let r = 3957 - d. What is the common denominator of 45/46 and r? 276 Let z be (-5)/(-2)(-1 - -3). Let q = -65759/9 - -7313. What is the common denominator of 27(1 - 0)/z and q? 45 Let c = -45 + 72. Let u(q) = q*2 + 3q - 2. What is the lowest common multiple of u(-7) and -5 - (4 - c) - 4? 182 Let v = 2127 - 2121. What is the smallest common multiple of 750 and v? 750 Suppose -k + 4 = -12. Suppose 20q - kq + 8 = 0. Find the common denominator of -15/2 and 0/q + 2224/(-576). 36 Calculate the smallest common multiple of 6 and (-189)/28((31 - 36) + (0 - -1)). 54 Let f be -9 + (-7 - -8) - 2. What is the least common multiple of (-1485)/f(-16)/(-24) and 72? 792 Suppose 79v + z - 6 = 78v, -z = -4. Suppose 0 = -3b - b + 128. What is the lowest common multiple of v and b? 32 Let g = 6 + -3. Suppose -2j + 3p - 27 = -21, -3j + 67 = 5p. Calculate the lowest common multiple of j and g. 9 Let i = -13 + 12. Let t be -12 - -26 - i/(1 - 2). Suppose 1 = k - 1, -5n - 4k = -t. What is the lowest common multiple of 14 and n? 14 Let w be (-2)/(-2 + (-22)/(-12)). Let o = -9/4 + w. What is the common denominator of 4170/112 - (-2 - 0) and o? 28 Let p = -4698/5 + 61136/65. Find the common denominator of -36/145 and p. 1885 Calculate the least common multiple of ((-25)/15)/(5/(-1050)) and 490. 2450 Let r = 1104 + -960. Let v = 1 + 3. What is the smallest common multiple of r and v? 144 Let k(v) = -2v3 - 46v*2 - 55v - 146. Calculate the least	{ "pile_set_name": "DM Mathematics" }
-4sqrt(187)-2)/(sqrt(110)/(-1sqrt(10)) - sqrt(11)) + 3((sqrt(612) + 1 + 5)*2 - -3(sqrt(612) - sqrt(612)2)). 178sqrt(17) + 1944 Simplify (sqrt(204) - sqrt(204)33 - (sqrt(204) + 6sqrt(204)-1))/(((-1sqrt(360))/sqrt(10))/(sqrt(30)/(sqrt(90) - sqrt(10)))). 3sqrt(17)/2 Simplify ((sqrt(132)/sqrt(4))/sqrt(11) + sqrt(1296)/sqrt(12))*2 + (-5(1sqrt(75) - sqrt(75)) - (sqrt(75) - (-1sqrt(75) + 0))). -10sqrt(3) + 147 Simplify -4(0 + -1(sqrt(1700) + (sqrt(1700) + 2)5) - (-1 + 5 + 0 + 1 + sqrt(1700)))*2. -334100 - 8400sqrt(17) Simplify -3 + (sqrt(13)-1 + 3 + -4 - (((sqrt(117)2 - sqrt(117))/sqrt(9))2 + (sqrt(78)/sqrt(24))2))-6. 6sqrt(13) + 201/2 Simplify 2(4(sqrt(891) - -1(sqrt(891) + 3 + sqrt(891))) - (((0 + sqrt(891))2 - sqrt(891)) + 5 + 2))3. -5316 + 702sqrt(11) Simplify (((sqrt(84) - 1sqrt(84))-2-2)/(sqrt(12) - (sqrt(84)1 - sqrt(84) - sqrt(84))/sqrt(7) - sqrt(36)/sqrt(3)4))*2. 0 Simplify ((sqrt(360)-3)/sqrt(9))/(sqrt(8) + (sqrt(64)/sqrt(4))/sqrt(2)) + (sqrt(4235) + 1sqrt(4235) - sqrt(35) - sqrt(35))/sqrt(7) + 3 + sqrt(5) + -1 + 0. 2 + 39sqrt(5)/2 Simplify ((sqrt(1176) - 1sqrt(1176)3 - sqrt(1176) - 2sqrt(1176)-2)-1)/((4-3sqrt(512) - sqrt(512)) + sqrt(512) + (-2sqrt(512)1 - sqrt(512))). 7sqrt(3)/120 Simplify ((sqrt(132) + sqrt(132)2-1)/(3sqrt(6)/sqrt(2)))/(-2(-3(sqrt(4) - (sqrt(16) - sqrt(4))) - -4-2sqrt(4))). -sqrt(11)/48 Simplify (-3 + -5 + (((sqrt(396) - (sqrt(396) - (3 + sqrt(396)1))) + sqrt(396) - sqrt(396)) + 1 - (0 + 3(sqrt(396) + 1))))2. 168sqrt(11) + 1633 Simplify (sqrt(18) + -3sqrt(648) - sqrt(54)/sqrt(3)-3)/(2sqrt(150)-1-1). -7sqrt(3)/5 Simplify (-3sqrt(640)-1-2)/(((sqrt(75)/sqrt(5) + sqrt(15))1)/(4(sqrt(3) + -2sqrt(3)) + sqrt(3))). 72sqrt(2) Simplify -2(sqrt(405) + 0 + 5 + -4 + -1 + 0). -18sqrt(5) Simplify (-1sqrt(2057)1 - sqrt(2057) - (1 + sqrt(2057))-3)*2 + (-4 + sqrt(17)2-4)-5 + -1. 106sqrt(17) + 2085 Simplify (3 + sqrt(11) + 0)2-2 + ((sqrt(11) + 0)1)2 + 3 - (5 + (5(0 + sqrt(704) - sqrt(704)) - sqrt(704)) + (sqrt(704) - (-3 + -1 + sqrt(704))))*2. -811 + 132sqrt(11) Simplify 5 + (-1(-4sqrt(208))*2 + 0 - 1(sqrt(832)2)2-2). 3333 Simplify (((sqrt(720) - 2sqrt(720)-4) + -1)1 + 66((2sqrt(720) + 4 - sqrt(720)) + sqrt(720) + sqrt(720)))*2. 401544sqrt(5) + 9876529 Simplify ((3-1sqrt(153) - sqrt(153))-3)2 - (((2 + sqrt(17))6 + 1sqrt(425))-1)*2. -264sqrt(17) + 19831 Simplify sqrt(500) + (sqrt(500) + 1 - sqrt(500)) + (sqrt(80)2)2 + (3 + ((sqrt(20))2 - sqrt(5)))1 + 4 + -5 + (sqrt(125)1 + -1)2. -sqrt(5) + 469 Simplify ((3 + sqrt(448)-2 + sqrt(448) + -1 + sqrt(448) + -2)6 - (-2 + -5 + ((sqrt(448) - 5sqrt(448)) + sqrt(448) - sqrt(448)) + 2))*2. 320sqrt(7) + 7193 Simplify -3(-3 + (-4 + (-1sqrt(833))*2 + -2 + sqrt(833) + sqrt(833) - (-6(sqrt(833) + 0 + sqrt(833)))*23) + -3). -42sqrt(17) + 1077105 Simplify (4 + (sqrt(189)-24)/sqrt(3))2 - (sqrt(1008)2 + -2 + sqrt(126)/sqrt(2)). -219sqrt(7) + 4050 Simplify (4(-5 + -1(sqrt(15)/sqrt(5)-4 + sqrt(3) - (0 + sqrt(3) + 1) - (sqrt(21) - sqrt(105)/sqrt(5)-3)/sqrt(7))))2. -1024sqrt(3) + 3328 Simplify (4 + -5 + -5((sqrt(500)1 + 5 - sqrt(500)) + 0))*2 + 4. 680 Simplify (6((sqrt(125) - ((sqrt(125) - (1sqrt(125) + -3)) + sqrt(125))) + sqrt(125)) + 3 - (1 + -2sqrt(125)3 + -5))2. -1320sqrt(5) + 18121 Simplify ((-32sqrt(147) - sqrt(147)14) + 2)*2 + ((-4sqrt(147)-2)2 - sqrt(147)) + (2sqrt(147))*21. -287sqrt(3) + 24700 Simplify (4((sqrt(240) + sqrt(240)25 + sqrt(240) + sqrt(240))/sqrt(10))/(sqrt(144)/sqrt(3) + (sqrt(432)2 - sqrt(432))))2. 169/2 Simplify ((-4(5sqrt(5) - sqrt(5))-4 - sqrt(45)/(sqrt(36)/(-2sqrt(4)))) + -3)-2-4. -24 + 528sqrt(5) Simplify 6(-1(-3sqrt(4)3)/sqrt(2) + 0) + 0. 54sqrt(2) Simplify ((sqrt(132) - (sqrt(132) + sqrt(132) + (sqrt(132)1 - sqrt(132)))-1 - sqrt(132))/(sqrt(6)/(sqrt(288)-2 - sqrt(288)))-1)2. 228096 Simplify ((((sqrt(117) + -2sqrt(117) + sqrt(117))6 + sqrt(117))/(sqrt(576)2 + sqrt(576)) + (sqrt(39)/(sqrt(27) + sqrt(3)) - (sqrt(39)3)/sqrt(3)))4)*2. 54925/36 Simplify -3 + sqrt(60)/sqrt(48) + (sqrt(180)/sqrt(3))/sqrt(12) + ((sqrt(50) + (sqrt(100)2)/sqrt(2))/(sqrt(810) + sqrt(810) + (-2sqrt(810) - sqrt(810))))2. -22/9 + 3sqrt(5)/2 Simplify 3sqrt(16)/(sqrt(40)/sqrt(5)) + 5 - ((sqrt(100)/(-2sqrt(5)))/(sqrt(30)/(-2sqrt(3))))2. 3 + 3sqrt(2) Simplify (sqrt(99) + 2)*2-3-3 - (5 + 0 + (4sqrt(176) + sqrt(176))*2). -3478 + 108sqrt(11) Simplify -2 + -2(5 + (sqrt(75) + -4 + sqrt(75))2 + (4(4sqrt(75) + sqrt(75)))2)6 + 3. -363851 + 960sqrt(3) Simplify 3(4((sqrt(1539) + -1 - sqrt(1539)) + sqrt(1539)) + 5 + (sqrt(1539) - sqrt(1539)1-3 - (sqrt(1539) - (sqrt(1539) + 1 + 0))))2-2. -591000 - 1728sqrt(19) Simplify -4(3(sqrt(1584) + 0 + sqrt(1584)) + -5) + ((sqrt(704) - 5-2sqrt(704) - (4 + sqrt(704)1)) + -1)*2. -1088sqrt(11) + 70445 Simplify ((6(sqrt(35) + (sqrt(245)-2)/sqrt(7) + (sqrt(35) - 3sqrt(315))))/(sqrt(49)/((sqrt(84) + sqrt(84)1)/sqrt(12))1))2. 58320 Simplify (2 + 36-3sqrt(1700))*2 + -62(sqrt(1700) + 1)-2. -1920sqrt(17) + 4957228 Simplify (-34(sqrt(100)4 - sqrt(100)))/(sqrt(405) + (sqrt(405) - (sqrt(405) + (3sqrt(405) - sqrt(405))))4 - -1sqrt(405)3). 2sqrt(5) Simplify 1 + (-1 + sqrt(315)/(sqrt(5) + sqrt(5) + sqrt(180)) + 0 + sqrt(63) + -4 + (0 + sqrt(63))6)*2. -855sqrt(7)/4 + 206351/64 Simplify (-6(5 + (sqrt(1300)2 + -4 - (3 + (sqrt(1300) + 0 - sqrt(1300))))3))2. -69120sqrt(13) + 1694016 Simplify (22sqrt(637))*2 - sqrt(78)/((sqrt(12)/sqrt(2) - sqrt(6))-4 - sqrt(6)) - (-2 + (sqrt(468) + -1)3)4. -71sqrt(13) + 10212 Simplify (1 + (0 + sqrt(20)/(sqrt(288)/sqrt(8)))-1)-1 + 1. sqrt(5)/3 Simplify -4(1-1(sqrt(114) + 1sqrt(114)))/(sqrt(600) - (sqrt(600) + sqrt(600) + 2sqrt(600)) - (sqrt(120) + sqrt(30))/sqrt(5)). -8sqrt(19)/33 Simplify (sqrt(190)-12 + -6((sqrt(190) + 2sqrt(190) - sqrt(190)) + sqrt(190)) + sqrt(190))/((-2sqrt(100)-3 - sqrt(100))/(sqrt(40)-5)). 38sqrt(19) Simplify 2 + (sqrt(324)/(-4sqrt(6)))/(sqrt(1323)/sqrt(9)) + -1. -3sqrt(2)/28 + 1 Simplify ((-2sqrt(100)4)/(sqrt(40)/(sqrt(50)/sqrt(5))))/(6(sqrt(405) + -2sqrt(405))-3). -4sqrt(5)/81 Simplify -3 + ((1sqrt(1900))2 - sqrt(1900)) + (sqrt(19) + sqrt(76)/sqrt(4))2 + -2 + (sqrt(19) - (sqrt(152)/(sqrt(48)/sqrt(6)))*2) + 3 + 5 + -4. -9sqrt(19) + 1956 Simplify 4 + (sqrt(171) - (sqrt(171) - -4(1sqrt(171) - sqrt(171) - sqrt(171))))*2 + ((sqrt(171) + -1)6)*2 - ((-4-5sqrt(171))2 - 6(2 + sqrt(171))). -59456 - 198sqrt(19) Simplify (-2-2(-1 + -2 + sqrt(192)) - (sqrt(192) + -1 + 1 - (0 + sqrt(192) - sqrt(192))3)*2)-6. -192sqrt(3) + 1224 Simplify ((sqrt(99) + (sqrt(99)-1 + sqrt(99))5)-25)/(4sqrt(324)/(1sqrt(9))). -5sqrt(11)/4 Simplify (-3-2sqrt(1620)-1)/(sqrt(576)2 - (sqrt(4) - sqrt(144)-3)). -54sqrt(5)/5 Simplify 4 + (0 + sqrt(112) + -4 - sqrt(112) - (sqrt(252)/(-1sqrt(9)))2) + 5. -23 Simplify ((sqrt(16) - sqrt(16)2-2)/(sqrt(256) + sqrt(256)1))/(sqrt(162) + sqrt(162) + (1sqrt(162) - sqrt(162)) + sqrt(16)/(2sqrt(8))). 5sqrt(2)/296 Simplify -3-2-1sqrt(180) + sqrt(60)/((4sqrt(120) + sqrt(120))/sqrt(10)) + -3. -179sqrt(5)/5 - 3 Simplify ((sqrt(55) - sqrt(110)/sqrt(2))6)/sqrt(11) + -2 + 5(2-1sqrt(405) - sqrt(405)). -135sqrt(5) - 2 Simplify 2 + 4(5 + ((sqrt(208) + ((1 + sqrt(208))3)2)6 - ((sqrt(208) - (-2 + sqrt(208) + 0)) + (sqrt(208) - (sqrt(208)2 - sqrt(208) - sqrt(208))-2)))). 1808sqrt(13) + 45158 Simplify -4-5(-43(0 + 1 + sqrt(242))2)*2. 253440sqrt(2) + 2799360 Simplify 22-6(-162(sqrt(112) - (sqrt(112) + 5)))*2. -86400 Simplify (-1 + (-4(sqrt(128) + -2) + 1 - -3(4(2 + sqrt(128)))*2))-3. -19032 - 4512sqrt(2) Simplify (-5((sqrt(1008) - (sqrt(1008) + 1)-2) + (sqrt(1008) - (sqrt(1008)-1 - sqrt(1008))1))-4-2)2 + -3. 460800sqrt(7) + 58067197 Simplify (26(sqrt(84) - (1sqrt(84)1 + sqrt(84) - sqrt(84))))/((sqrt(120)-3 + sqrt(120))/sqrt(10) + sqrt(972)3)2. 0 Simplify -5(-3 + (1 + sqrt(98))*2 + 3 + (sqrt(98) - -1sqrt(98)-4 - sqrt(98)) + (-2sqrt(98) + sqrt(98))*2 + sqrt(98) + 4 + 0). -1005 + 35sqrt(2) Simplify (3((-2 + sqrt(7))3 - (sqrt(7) + 1)*4 - (((sqrt(252) + sqrt(	{ "pile_set_name": "DM Mathematics" }
7 AM and 12:59 PM? 492 How many minutes are there between 10:39 AM and 3:32 PM? 293 How many minutes are there between 12:30 PM and 5:52 PM? 322 How many minutes are there between 7:16 AM and 2:25 PM? 429 What is 628 minutes before 2:16 PM? 3:48 AM What is 252 minutes before 8:12 PM? 4:00 PM What is 700 minutes before 7:22 AM? 7:42 PM How many minutes are there between 7:30 PM and 3:31 AM? 481 What is 186 minutes after 12:19 PM? 3:25 PM What is 429 minutes after 9:04 PM? 4:13 AM What is 186 minutes before 3:39 AM? 12:33 AM How many minutes are there between 9:20 PM and 3:34 AM? 374 How many minutes are there between 11:49 PM and 11:38 AM? 709 What is 67 minutes after 1:23 PM? 2:30 PM What is 672 minutes after 2:46 PM? 1:58 AM What is 309 minutes before 1:40 AM? 8:31 PM How many minutes are there between 5:11 PM and 6:03 PM? 52 What is 217 minutes before 3:16 AM? 11:39 PM How many minutes are there between 5:42 PM and 12:22 AM? 400 How many minutes are there between 2:53 PM and 8:10 PM? 317 What is 115 minutes after 5:08 PM? 7:03 PM What is 493 minutes after 5:38 PM? 1:51 AM How many minutes are there between 12:22 PM and 2:39 PM? 137 How many minutes are there between 11:04 AM and 11:40 AM? 36 What is 644 minutes after 9:34 PM? 8:18 AM How many minutes are there between 1:37 PM and 1:39 PM? 2 How many minutes are there between 1:44 PM and 1:30 AM? 706 How many minutes are there between 1:39 PM and 11:31 PM? 592 How many minutes are there between 10:09 AM and 10:04 PM? 715 How many minutes are there between 6:11 PM and 5:59 AM? 708 How many minutes are there between 10:56 PM and 8:34 AM? 578 What is 38 minutes after 2:03 AM? 2:41 AM What is 568 minutes after 7:13 PM? 4:41 AM How many minutes are there between 10:19 AM and 6:11 PM? 472 What is 142 minutes after 7:18 AM? 9:40 AM What is 111 minutes before 12:44 PM? 10:53 AM What is 581 minutes before 8:20 PM? 10:39 AM What is 298 minutes before 6:40 AM? 1:42 AM How many minutes are there between 7:21 PM and 6:54 AM? 693 What is 96 minutes after 7:55 AM? 9:31 AM How many minutes are there between 3:04 PM and 3:39 PM? 35 What is 570 minutes after 8:02 AM? 5:32 PM How many minutes are there between 10:01 AM and 1:23 PM? 202 What is 82 minutes before 8:27 PM? 7:05 PM How many minutes are there between 2:04 PM and 7:48 PM? 344 How many minutes are there between 4:37 AM and 3:16 PM? 639 How many minutes are there between 11:19 PM and 1:26 AM? 127 How many minutes are there between 9:41 PM and 1:10 AM? 209 What is 355 minutes before 9:03 PM? 3:08 PM How many minutes are there between 7:44 PM and 5:51 AM? 607 How many minutes are there between 8:11 PM and 8:22 PM? 11 What is 680 minutes after 8:00 AM? 7:20 PM How many minutes are there between 8:10 AM and 2:54 PM? 404 What is 254 minutes after 9:23 PM? 1:37 AM How many minutes are there between 1:54 PM and 11:30 PM? 576 What is 237 minutes after 11:51 PM? 3:48 AM How many minutes are there between 1:06 PM and 2:38 PM? 92 How many minutes are there between 7:50 AM and 1:14 PM? 324 What is 137 minutes after 11:15 PM? 1:32 AM How many minutes are there between 4:07 PM and 5:36 PM? 89 What is 52 minutes before 5:26 AM? 4:34 AM How many minutes are there between 2:10 AM and 1:50 PM? 700 What is 420 minutes after 7:38 PM? 2:38 AM How many minutes are there between 7:59 AM and 3:33 PM? 454 How many minutes are there between 3:01 AM and 7:35 AM? 274 What is 135 minutes after 7:55 PM? 10:10 PM How many minutes are there between 6:52 AM and 12:09 PM? 317 How many minutes are there between 3:30 PM and 7:42 PM? 252 How many minutes are there between 1:32 AM and 10:30 AM? 538 What is 6 minutes before 11:51 AM? 11:45 AM How many minutes are there between 4:42 AM and 4:54 AM? 12 What is 159 minutes before 10:44 AM? 8:05 AM How many minutes are there between 3:38 AM and 4:17 AM? 39 What is 321 minutes after 5:38 AM? 10:59 AM How many minutes are there between 8:25 PM and 12:31 AM? 246 What is 485 minutes before 5:52 AM? 9:47 PM How many minutes are there between 5:05 PM and 7:06 PM? 121 What is 692 minutes before 9:19 PM? 9:47 AM What is 652 minutes after 1:25 AM? 12:17 PM How many minutes are there between 9:24 AM and 7:19 PM? 595 What is 320 minutes before 7:35 PM? 2:15 PM What is 251 minutes before 12:02 AM? 7:51 PM What is 399 minutes before 10:52 AM? 4:13 AM How many minutes are there between 12:33 AM and 9:53 AM? 560 What is 572 minutes before 9:51 AM? 12:19 AM How many minutes are there between 11:56 PM and 7:24 AM? 448 What is 172 minutes before 12:20 AM? 9:28 PM How many minutes are there between 6:14 AM and 7:10 AM? 56 What is 176 minutes before 3:26 PM? 12:30 PM What is 96 minutes before 10:01 AM? 8:25 AM What is 14 minutes after 1:27 AM? 1:41 AM What is 496 minutes after 2:38 AM? 10:54 AM How many minutes are there between 9:30 PM and 6:20 AM? 530 What is 344 minutes after 11:15 AM? 4:59 PM How many minutes are there between 2:23 AM and 3:51 AM? 88 What is 501 minutes after 4:39 PM? 1:00 AM What is 344 minutes after 5:12 PM? 10:56 PM How many minutes are there between 2:32 PM and 3:22 PM? 50 What is 556 minutes after 7:06 AM? 4:22 PM How many minutes are there between 2:00 AM and 6:24 AM? 264 How many minutes are there between 4:40 PM and 1:03 AM? 503 How many minutes are there between 3:30 AM and 5:31 AM? 121 What is 296 minutes before 8:09 AM? 3:13 AM What is 160 minutes before 1:42 AM? 11:02 PM What is 302 minutes after 4:53 AM? 9:55 AM What is 532 minutes before 2:47 PM? 5:55 AM What is 481 minutes after 6:11 AM? 2:12 PM What is 145 minutes before 12:53 AM? 10:28 PM How many minutes are there between 8:57 PM and 11:05 PM? 128 How many minutes are there between 5:31 AM and 9:46 AM? 255 How many minutes are there between 6:39 AM and 9:54 AM? 195 How many minutes are there between 6:08 PM and 8:30 PM? 142 What is 693 minutes before 1:47 PM? 2:14 AM What is 492 minutes before 9:46 AM? 1:34 AM What is 423 minutes after 4:28 PM? 11:31 PM What is 235 minutes after 6:42 AM? 10:37 AM How many minutes are there between 10:10 AM and 8:57 PM? 647 What is 252 minutes before 3:41 AM? 11:29 PM What is 553 minutes after 4:54 AM? 2:07 PM How many minutes are there between 6:03 PM and 6:56 PM? 53 How many minutes are there between 2:12 AM and 3:53 AM? 101 What is 252 minutes after 10:05 AM? 2:17 PM What is 250 minutes after 8:32 AM? 12:42 PM What is 462 minutes after 11:50 AM? 7:32 PM How many minutes are there between 8:26 PM and 4:08 AM? 462 What is 345 minutes before 10:40 AM? 4:55 AM What is 354 minutes before 9:23 AM? 3:29 AM What is 305 minutes before 2:15 AM? 9:10 PM What is 166 minutes before 4:37 AM? 1:51 AM How many minutes are there between 1:38 PM and 5:09 PM? 211 How many minutes are there between 10:20 PM and 3:43 AM? 323 How many minutes are there between 11:46 PM and 6:31 AM? 405 How many minutes are there between 10:10 PM and 7:19 AM? 549 How many minutes are there between 1:36 PM and 5:46 PM? 250 How many minutes are there between 5:28 AM and 12:22 PM? 414 How many minutes are there between 9:05 AM and 10:07 AM? 62 What is 508 minutes after 2:37 AM? 11:05 AM How many minutes are there between 3:58 AM and 6:13 AM? 135 How many minutes are there between 1:22 AM and 1:49 AM? 27 What is 704 minutes before 7:01 PM? 7:17 AM How many minutes are there between 1:44 AM and 7:25 AM? 341 What is 446 minutes before 12:30 PM? 5:04 AM What is 251 minutes after 8:12 AM? 12:23 PM What is 702 minutes after 2:00 AM? 1:42 PM How many minutes are there between 7:43 PM and 5:02 AM? 559 How many minutes are there between 4:03 AM and 11:50 AM? 467 What is 530 minutes after 6:48 AM? 3:38 PM What is 424 minutes before 6:38 AM? 11:34 PM What is 636 minutes after 8:02 PM? 6:38 AM How many minutes are there between 5:44 PM and 9:13 PM? 209 How many minutes are there between 5:59 AM and 8:09 AM? 130 What is 597 minutes before 7:26 PM? 9:29 AM How many minutes are there between 12:32 AM and 9:17 AM? 525 What is 623 minutes after 12:53 PM? 11:16 PM What is 578 minutes after 2:27 PM? 12:05 AM How many minutes are there between 12:40 PM and 9:25 PM? 525 What is 641 minutes after 2:18 AM? 12:59 PM What is 132 minutes before 4:26 PM? 2:14 PM How many minutes are there between 5:53 AM	{ "pile_set_name": "DM Mathematics" }
s of g. 2 Let r(z) = -z*2 - 5. Let p be r(0). Let o = p - -8. Suppose oy = y + 22. List the prime factors of y. 11 Let s be (-140)/(-6)(-24)/(-5). Suppose -4z = 4d - s, 4 = z - 0. Suppose -h + d = 3n, n + 11 = 4h - 4n. List the prime factors of h. 3 Let s = 26 + -21. What are the prime factors of s? 5 Let o = 32 - 22. Suppose 4f = x + 9, 3x = x + f + o. Suppose -5u + 18 = p - x, -3p = u + 9. What are the prime factors of u? 2, 3 Let g = -7 + 5. Let x = 2 - g. Suppose 4i - 27 = 5f, -3i + xf = 5f - 6. What are the prime factors of i? 3 Let f(r) = 2r - r - 3r + 3r - 1. What are the prime factors of f(10)? 3 Let w be (-4)/8 + 45/6. Let d(k) = -k*2 - k. Let u(a) = -4a*2 + 7a - 9. Let o(r) = -3d(r) + u(r). What are the prime factors of o(w)? 2, 3 Let r be 25/(-10)-21. Let x = r + -3. Let g = 5 - x. What are the prime factors of g? 3 Suppose -4d - 5q + 327 = 0, 0 = -0d - 3d - 5q + 239. What are the prime factors of d? 2, 11 Let n(x) = 5x3 + x - 1. What are the prime factors of n(1)? 5 Let w be (-1 - -1)(-4)/(-8). List the prime factors of 18/(w - -2)1. 3 Suppose m - 3m + 50 = 0. What are the prime factors of m? 5 Let i = 124 + -65. List the prime factors of i. 59 Let l = -17 + 22. What are the prime factors of l? 5 Suppose 2d = 3d - 129. List the prime factors of d. 3, 43 Suppose -3n = -5n - 4. Let g be (-1)/(n - -3) - -2. Suppose 7 = 4q - g. List the prime factors of q. 2 Let z be (-2 - 0) + 2 - -1. Suppose 0 = 3a + z - 13. What are the prime factors of a? 2 Suppose -v + 15 = 4c, 2c = -v + 1 + 4. Let p(i) be the third derivative of -i4/24 - i3/6 - 2i2. What are the prime factors of p(v)? 2 List the prime factors of 24 - (1 - (1 + 3)). 3 Let s = -21 - -34. Suppose -s = -k + 13. List the prime factors of k. 2, 13 Suppose 7g + 108 = 11g. List the prime factors of g. 3 Let c(y) = -14y + 34. What are the prime factors of c(-7)? 2, 3, 11 Let v = 58 - 6. What are the prime factors of ((-1)/2)/((-1)/v)? 2, 13 Let x(u) be the second derivative of -u3/6 - u2 + u. What are the prime factors of x(-8)? 2, 3 Suppose 0 = j - 40 - 7. What are the prime factors of j? 47 Let p = 11 - 4. What are the prime factors of p? 7 Let o(g) be the third derivative of g6/120 - g5/12 + 5g4/24 - g3/2 + g2. What are the prime factors of o(5)? 2, 11 Let a(p) = -p2 - 11p - 2. Let f be a(-7). Let h = f - -1. List the prime factors of 6/(-27) + 249/h. 3 Suppose 2u + 2f - 7 = -u, 0 = -2u + 2f + 18. Let l(q) = q*3 - 8q*2 + 9q + 10. Let d be l(7). Suppose -uy + 2y + d = 0. List the prime factors of y. 2 Let q(w) = -w - 7w2 - 5 + 2 - w3 + 1. Let i be q(-7). Suppose 4n - in + 11 = 0. List the prime factors of n. 11 Suppose 6b = b. Let n be b2/(6 + -2). What are the prime factors of 12 + (-1 + n)0? 2, 3 Suppose -82 = -4x - 2g, 0 = x + x + 2g - 40. What are the prime factors of x? 3, 7 List the prime factors of (-4)/(-3(-1)/(-9)). 2, 3 Let l(y) = 2y3 - 6y*2 + 5y + 2. Let b be l(4). Suppose 0 = 5o + 5d - 76 - b, 110 = 5o - 5d. What are the prime factors of o? 2, 3 Let o = 13 + 2. Let r = -6 + o. What are the prime factors of r? 3 Let p be 6 + 2 + -3 + -2. Suppose m = -pm + 60. What are the prime factors of m? 3, 5 Suppose -2l = -5z - 19, 2l = l - 2z + 14. Suppose -x + 2s = -6x + 83, -l = -3s. What are the prime factors of x? 3, 5 Let w = 3 + -5. Let z = 1 + 23. List the prime factors of (w/(-6))/(2/z). 2 Let p be (48/30)/((-1)/10). Suppose v = -0v - 10. Let g = v - p. What are the prime factors of g? 2, 3 Let v = 45 + -25. What are the prime factors of ((-72)/(-45))/(1/v)? 2 Suppose -x - 6 = 1. List the prime factors of 2/x + (-51)/(-7). 7 Suppose j - 4 = 1. Suppose 5w = 3g + 2w, 4g = -jw + 36. Suppose 3h - gh + 13 = 0. List the prime factors of h. 13 Let z be 2/5 - 72/5. Let q = z + 45. What are the prime factors of q? 31 Let x be (-2 - (-4)/3)18. List the prime factors of x(-3)/3 - -3. 3, 5 Let k = -36 - -186. What are the prime factors of k? 2, 3, 5 Let o(g) = g*2 - 2g + 3. Let r be o(0). Let c(p) = -p*3 - 4p*2 - 4p - 6. Let i be c(-4). Let n = r + i. List the prime factors of n. 13 Suppose 2s = -3k + 35, 9k - 4k = 3s + 33. List the prime factors of k. 3 Let p(x) = -6x - 27. List the prime factors of p(-18). 3 Let t = 18 + 130. What are the prime factors of t? 2, 37 Let s be 4/(3(-2)/(-6)). Suppose -s - 5 = 3b. Let h(q) = -q*2 - 5q - 2. List the prime factors of h(b). 2 Let z = 2 - -2. Suppose zf - 23 + 7 = 0. Suppose -f = 2u - 26. What are the prime factors of u? 11 Let p = 21 - 22. What are the prime factors of p/((-66)/16 + 4)? 2 Let i(w) = w*3 + 6w*2 + 2w - 5. Let m be i(-5). Suppose -3f - m = -2f. Let b = 17 + f. List the prime factors of b. 7 Let d(p) = -p + 5. Let l be d(0). Suppose 2o + t + l = 0, -o + 2t + 5 = t. Suppose -r + 26 = 5i - o, -4i - r + 20 = 0. List the prime factors of i. 2, 3 Suppose 0 = -t + 2f - 0f + 8, 3t - 38 = -f. Suppose 2b - 8 = -l, 5l = 8 + t. Suppose -3x - 19 = -bo + 1, 3x = -2o + 20. List the prime factors of o. 2, 5 Let i(l) = -l2 + 3l - 1. Let b be i(2). List the prime factors of -4 - -7 - -46 - b. 2, 3 Let p = 45 - 9. What are the prime factors of p? 2, 3 Suppose 20z + 213 = 23z. List the prime factors of z. 71 Suppose -3q = -0l + 3l - 12, 12 = q + 3l. Suppose 3w + 3b - 47 = b, -25 = 5b. Suppose qn = n - w. List the prime factors of n. 19 Let r(t) = -t*2 - 13t - 6. Let x = -24 + 14. List the prime factors of r(x). 2, 3 Suppose -4m = 12, -4j - 2m + 178 = -0j. What are the prime factors of j? 2, 23 Suppose -5z + 1486 = -99. List the prime factors of z. 317 Suppose 24 = 3z + 4d - d, 3z - 3d = 0. Suppose zp + 2w - 36 = 5w, 4w = 3p - 34. What are the prime factors of p? 2, 3 Suppose -4u + 0x + 82 = 2x, -3u + 3x + 39 = 0. Suppose 7l = 2l + 5m + 20, 0 = 4l - 5m - u. Suppose -lc + 10 = -c. What are the prime factors of c? 2, 5 Let k = 98 - 192. Let m = k + 139. Suppose -m = -2w - 3w. What are the prime factors of w? 3 Let k(t) be the second derivative of t5/60 + t4/12 + t3/3 - 3t*2/2 - t. Let u(n) be the first derivative of k(n). List the prime factors of u(-2). 2 Suppose d - 3v - 15 = 4, -3v = 2d - 11. List the prime factors of d. 2, 5 Suppose 0v - 3l - 16 = -v, 2l = 5v - 15. Let c be -8v2/4. What are the prime factors of (c3)/(-1) - -2? 2, 7 Let f be 1(-1)/(3/(-15)). Suppose -fz = -26 - 9. Suppose b = -w + 20, z = 5w - b - 81. What are the prime factors of w? 2, 3 List the prime factors of 1 - (-8 - 7)126. 17, 23 Let v(q) = -q*2 - 7q - 3. List the prime factors of v(-3). 3 Let y = -15 - -52. What are the prime factors of y? 37 Suppose 5a = 0, 2g = -g + a + 297. What are the prime factors of g? 3, 11 Let v be 1-3(-4 + 3). Suppose -2m + vq + 28 = -3m, m = -q - 20. What are the prime factors of (-4)/(-1) - 3 - m? 17 Let x be (-54 + 0)(-4)/6. Let l be x/8 + (-1)/(-2). Suppose s = -5, -3s + 6s + 75 = lz. What are the prime factors of z? 2, 3 Let i = -9 - -42. Let a = -19 + i. What are the prime factors of a? 2, 7 Let p = 21 + -6. Suppose 2a - p = -3a. What are the prime factors of a? 3 Let n(z) be the third derivative of -z5/60 - z4/24 + 17z*3/6 + 3z2. What are the prime factors of n(0)? 17 Let c(p) = p3 - 2p2 - p - 2. Let q be c(3). Suppose 0 = -j - 5l - q, 2l = -4j - j + 26. Suppose 4n + 6 = jn. What are the prime factors of n? 3 Let n be (-1 - 0)/(1/(-3)). Suppose -2o = 4v + 30, -8o - 36 = -3o - nv. Let p = 1 - o. What are the prime factors of p? 2, 5 Let z = 3 - 3. Suppose -3y + 2p - 8 = z, -p + 2 + 2 = 0. Suppose -3m - m + 8 = y. List the prime factors of m. 2 Suppose 1 = -3t + 7. Let b(l) = -l2 - 10l - 13. Let u be b(-8). Suppose -m = -x - t, 0 = 5m + ux - 11 - 7. List the prime factors of m. 3 Suppose 7n = 10n - 105. List the prime factors of n. 5, 7 Let o(g) = -2g2 + g + 28. Let c(l) = -l + 4. Let s be c(4). What are the prime factors of o(s)? 2, 7 Suppose k + 17 = -5u, k + 3k - 3u - 1 = 0. List the prime factors of 4 - 0 - (k - 26). 2 Let z = 9 + -8. What are the prime factors of -3 - (-31 - (3 - z))? 2, 3, 5 Suppose 63 = 4*w - 749. What are the prime factors of w? 7, 29 Su	{ "pile_set_name": "DM Mathematics" }
k = -20 - -32. Suppose 2n - k = -2n. Solve 2i - n = -i for i. 1 Let l = 64 - 62. Solve -lg = 4g + 30 for g. -5 Let k(t) be the first derivative of 3 + 0t - 1/3t3 + 0t*2 - 3/4t*4. Let p be k(-1). Solve pw = -0w - 10 for w. -5 Let v = -99 + 110. Let i be (-17)/(-4) - ((-132)/16)/v. Solve 12 = ik + 2 for k. 2 Suppose 64 + 6 = 2b. Suppose -4a + 36 = 5f, -3f = 5a + 3 - b. Suppose -36 = -2x - 4q, -3x + 8x = fq + 20. Solve -g + x = g for g. 4 Suppose -4d + 14 = i, -4d = -5i + 1 - 3. Suppose -2r = -r - i. Solve -6 = 4g - r for g. -1 Let l(g) be the first derivative of g4/4 - g3 - 5g*2 + 4g + 9. Let q be l(4). Let a = q + 24. Solve 0 = h - ah for h. 0 Let d = -17 + 19. Let v = d - -8. Suppose 5f + 22 = 3i, 0 = 2i - f - 0 - v. Solve 2g + i = 6g for g. 1 Let u be -31-2 - (-119 + 123). Solve 6c = uc for c. 0 Suppose 17r - 7 = 18r. Let x be (-603)/(-21) - 2/r. Suppose -4s + x = 3q, -2q + 22 = 2s + s. Solve 0h = -4h - s for h. -2 Suppose -5p + 5r = 75, r + 82 = -5p - 17. Let m = 20 + p. Solve -3w + 11 + m = 0 for w. 4 Suppose 0 = 3x - 2x. Let t(y) = y*3 - 2y*2 + 5y + 4. Let n be t(0). Solve s + x - n = 0 for s. 4 Let i(n) = 2n2 + 8n. Let t be i(3). Solve -8b = -29b - t for b. -2 Suppose -4c - 3w = 2w - 2, 14 = 4c - w. Let s(v) = 2v + 2. Let a be s(c). Solve l + a = 5l for l. 2 Suppose -2t = 2u - 22, 8u - 5u = 3t + 15. Solve -un = -13n for n. 0 Suppose -2k = -60 + 62. Suppose 0 = 2q - 1 - 1. Let w = q + k. Solve 0 = 3z + 9 - w for z. -3 Let o(c) = c*3 + 15c*2 - 16c - 22. Let s be o(-16). Let d be (6 - (-64)/(-11)) + (-260)/s. Solve 0a - d = -4a for a. 3 Let v = 84 + -81. Suppose 5z - 10 = -f, -3 + 30 = 4z - vf. Solve 16 - 7 = zn for n. 3 Let z(y) = -y*3 - 16y*2 - 14y + 17. Let s be z(-15). Suppose -4r - sf + 5f = 0, -2r - 5f + 26 = 0. Solve -4j - r + 7 = 0 for j. 1 Let a = 1134 - 1120. Solve -115 = -ao - 9o for o. 5 Suppose 4n - l + 26 - 90 = 0, -2n + 10 = 5l. Solve 10 = nv - 13v for v. 5 Suppose -13v - 6 = -14v. Solve 0 = 5s - v - 9 for s. 3 Let t be (-1)/3 + 19/3. Let w(m) = -m*3 + 5m*2 + 5m + 8. Let l be w(t). Let g be ((-2)/(-8))/((-22)/(-176)). Solve -lo + 3o + g = 0 for o. -2 Let h = -598 - -598. Solve 0 = -4p - h + 16 for p. 4 Suppose 4l - 3g - 236 = 0, 9l - 4l - 326 = -4g. Suppose -s = -l + 57. Let w(t) = -t. Let k be w(-5). Solve s = 5o - k for o. 2 Suppose -4a = -0a - 2x + 2, 1 = x. Suppose 0 = -ah + h. Solve h = -r - 4r - 5 for r. -1 Let l(t) = -t*2 + 7t + 7. Let p be l(7). Let w = -7279 + 7281. Solve -wd + pd = 0 for d. 0 Let k = 0 - -5. Let i = -5 - -38. Suppose -2t + i = kn, -n + 18 = t + 2n. Solve 11 = 4y - t for y. 5 Let u(y) = -y*3 - 8y2 + y + 8. Let f be u(-8). Let w(s) = s3 - s*2 - s + 2. Let m be w(0). Let z be -2 + -1 + 6 + m. Solve f = p - z + 1 for p. 4 Let j = -117 + 121. Let b be (-1)/(4/(-2))0. Solve w + jw = b for w. 0 Suppose -8 = 3t - 2k, 3t + 5k - 23 + 3 = 0. Suppose -4x - 4 = -0x, t = -3h + 2x + 8. Suppose 0 = hs + s. Solve s = -0p + 5p + 10 for p. -2 Let f(s) be the second derivative of 0s2 + 0 + 1/6s*3 - 1/6s*4 - 5s + 1/20s5. Let q be f(3). Solve b = 5b - q for b. 3 Let x be (424/12 - 2)/(4/6). Suppose -x = 21v - 26v. Solve -vy + 12y = -10 for y. -5 Let r be -1(-1)/(-2)-6. Let s be -1 - 0 - (-2 + 2 + -2). Suppose s = 6g - 53. Solve rx - 3 - g = 0 for x. 4 Suppose 2n - 5y = -168, 0 = -5n + 5y - 456 + 66. Let d = -68 - n. Solve 0j + 2j = -d for j. -3 Let n be (-42)/(-9)(-54)/(-63). Let s(b) = 3b*2 - 3b - 3. Let j be s(-2). Solve 0 = -z - nz - j for z. -3 Let l(c) = c - 1. Let j be l(9). Suppose 2d + 29 = x + 41, -d - 3 = 4x. Solve dk - j = k for k. 2 Suppose 5t - 2 = -o, -4t = o + 1 - 3. Let v be -2 + (1 + -1 - 0). Let c be 0/(2 - (o - v)). Solve c = p + p for p. 0 Let b be (9 + (-225)/27)/(2/12). Solve b - 2 = -a for a. -2 Let o = -4 + 0. Let n be 4/o + 10 - 4. Solve nj = -0 + 5 for j. 1 Suppose 14n + 1558 = 4190. Solve -16 = -nd + 184d for d. 4 Let f = -373 - -543. Suppose -3l = 2l - f. Suppose 3d - l = -5u, -13 = -u + 3d + 1. Solve u = -s - 3s for s. -2 Let v(x) = x*3 - 4x*2 + 3. Let m be v(3). Let p = 3 - m. Let a = p - 3. Solve -ao = -o - 5 for o. 1 Suppose -13j + 36 = -19j. Let o be (-33)/j - (-4 - 9/(-2)). Solve -oy + 1 = -4y for y. 1 Let s = 45 - 45. Let q(y) = -5y + 7. Let t be q(s). Let i(m) = -4m + 1. Let f be i(-6). Solve tp - 2p + f = 0 for p. -5 Suppose 0 = 8j - 22 - 18. Suppose 80 = 3x - jg, 2x = 5g + 19 + 36. Solve 9z + x = 4z for z. -5 Let q(b) = b3 + 5b*2 + 2b - 5. Let w = 37 - 64. Let p be ((-6)/2)/(w/(-36)). Let z be q(p). Solve 3 = -zy - 0y for y. -1 Let f = 38 + -5. Suppose -2l + 4 = 3u, -2l + 2u = -f + 9. Let g = l - 3. Solve 0c = gc for c. 0 Let q(t) = t*3 + 3t*2 - t - 1. Let r be q(-2). Suppose -3u - 14 = rc, 4c + 0c + 24 = 4u. Suppose us - 5s + 9 = 0. Solve 8 = -so + 5o for o. 4 Suppose 19 = -3a - 2u, -a + 0a - 4u = 23. Let b = 8 + a. Solve 2s + 12 = bs for s. 4 Let t = -9 + 11. Suppose 7p - tp - 35 = 0. Solve 0 = 3b - 1 + p for b. -2 Let a = 31 + -22. Suppose -13k = -ak - 20. Suppose -3b = 3i + 6, 2i - kb - 31 = -0i. Solve n + 16 = -in for n. -4 Suppose -5x + 2h = -11, 4x + 6h - 5h = 14. Solve d - 7d = xd for d. 0 Suppose 4u - 24 = -4m, -2u - 2u = 0. Suppose -4k + 15 = k. Let b = 6 - k. Solve -bv - m = -3 for v. -1 Let q = 487 + -483. Solve 0 = 55f - 59f + q for f. 1 Suppose 4i = -f + 24, -4i - 1 = -13. Solve -5a = 27 - f for a. -3 Suppose -12w + 5w = -21. Solve 2z + 9 = w for z. -3 Suppose 0 = -21r + 19r + 32. Suppose -5w = -12 + 2. Let q = 4 + w. Solve q - r = -5n for n. 2 Suppose 1 = -2i + 47. Let a = -20 + i. Solve s = as for s. 0 Suppose 3b = -4g + 15, 4b - 23 = g - 3. Solve b = 5m - 10m for m. -1 Suppose 2f - 6f + 20 = 0, 4f + 22 = 3p. Suppose 35y + p = 42y. Solve 0 = 6a - ya for a. 0 Let c = 65 - 64. Let a be (-250)/(-20) - c/2. Solve -8 = -5b + a for b. 4 Suppose 39 = -5l + 3b, -5l - 2 = -b + 31. Let a be (32/(-6))/(4/l). Solve 0 = 3k + 1 + a for k. -3 Suppose -22z + 364 = -8z. Solve -zr = -22r - 16 for r. 4 Let b(u) = u*3 - 7u*2 + 2u - 6. Let h be b(7). Let w be ((-3)/(-4))/(3/h - 0). Solve a = -wa + 12 for a. 4 Let c = 981 + -955. Solve -38f = -cf - 36 for f. 3 Suppose 3u - 3 = -c + 4u, -c - 2u + 3 = 0. Suppose -5 = -co + 2o, 2y - 15 = -o. Solve 0 = -yj - 4 - 21 for j. -5 Let u(o) = o*3 - 8o*2 + o - 4. Let h be u(8). Let v(l) = -3l*2 + 7l + 7l2 + l3 - 1 - 9l*2 - 5. Let x be v(4). Solve 0 = -z + hz + x for z. -2 Let w be (4/(-2))/(1 + (-45)/27). Solve wc = 2c + 3c for c. 0 Let t be (-22)/(-10) - (-2)/(-10). Let b = 17 + -15. Suppose 0 = 2h - b - t. Solve 20 = hv - 7v for v. -4 Suppose 4n - 1536 = -60n. Solve -n = -12v + 12 for v. 3 Let f(s) be the first derivative of 2s*3/3 + 3s*2/2 - 3s - 7. Let r be f(-3). Solve -4y - 14 + r = 0 for y. -2 Let l be (-56 - -57)-42/(-4). Solve -f = -lf for f. 0 Let o(l) = l*2 - 5l + 6. Let n be o(7). Suppose -21x = -nx - 6. Solve 5y - 26 = -x for y. 4 Let p(q) = q + 4. Let k(o) = o + 5. Let x(i) = -6k(i) + 5p(i). Let t be x(-11). Solve 0 = -b - 1 - t for b. -2 Let m be 2/(-5) - (185/25)/(-1). Solve -7c + m = -14c for c. -1 Suppose -3h - 1 + 13 = 0. Let q = -19 + 27. Suppose 4v + 10n = qn + 2, v = n + 5. Solve 8 = -ha + va for a. -4 Let l(h) = h + 17. Let v be l(-13). Suppose 0 = -vx - 4o + 4, x - 7o - 25 = -2o. Solve -4t + x = -7 for t. 3 Let m be -35 + (-3)/(-1) + -2 + -3. Let f = 40 + m. Solve 2h - f = 3h for h. -3 Let l = -5 - -7. Let n be 2 - -1(5 + -2). Solve ng = lg for g. 0 Let l(w) = 2w - 1. Let f be l(7). Let g = f - 13. Let d be 3/(-3) + g + 3. Solve 4i - 2 = d for i. 1 Let c = -91 + 95. Solve 0 = -4d - 16 + c for d. -3 Let v(y) = -y*3 - 8y*2 - 9y - 9. Let o be 2/742/12. Let n be (o - 4 - -5) + -9. Let z be v(n). Solve 2 - z = -i for i. 3 Suppose 0 = 4r + 26 - 2. Let k(m) = -12m - 70. Let h be k(r). Solve hx = -x + 12 for x. 4 Let w be (9/(-5))/(-3) - (-385)/25. Solve -9b - w = -b for b. -2 Let y(p) = p3 - 10p*2 + 11p + 5. Let s be y(10). Let f	{ "pile_set_name": "DM Mathematics" }
5)(-1 + 4 - 4) + 4b*5 - 3b*5 - 2b*5. -3b*5 - 5b*4 Expand (0h - 3h + 0h)(4h + 0h - h - 2 + 2h + 2 + (-h - 4h + 4h)(1 - 1 - 1)). -18h*2 Expand (-5m + 3m + 0m)(-39m - 37 + 37). 78m2 Expand (3 - 1 + 1)(0 + 0 + v) - 4 + 27v - 11v + 6. 19v + 2 Expand (-2h + 1 - 1)(2h + 1028h2 - 1018h*2 + 0h). -20h3 - 4h*2 Expand -2i - 13i + 2i + (-2 + 0 + 3)(0i + 0i + i). -12i Expand -z*3 - 367z - 2z2 + 367z + (-2 + 2 - z)(z2 + 0 + 0) - 7 - 5z*3 + 7. -7z*3 - 2z*2 Expand (2 + 2 - 1)(-4g3 - 9g*3 - 3g*3). -48g*3 Expand (4t + 8 - 8)(-t2 - 2t + 2 - 2)(5 - 3 - 1). -4t*3 - 8t*2 Expand 2h*2 + 0 + 0 + 0h2 + h2 - 2h2 + (-h2 - 2h2 + h2)(-2 - 3 + 4) - 5h*2 + 2h2 + h2. h*2 Expand (0 + 1 - 3)(0p - p + 3p) - 11 - 3p + 2 + 2p. -5p - 9 Expand 5u*2 - 5u2 - u3 + 4u3 - 2u3 - u3 + (2u2 + u2 - 5u*2)(u - 2u + 0u) + (-16u2 - 2u + 15u2 - 3 + 4u)(-2u + 0u + 3u). u*3 + 2u*2 - 3u Expand (4i4 + 2i*4 - 4i*4)(3 + 4 - 6) + (2i2 + i2 - i2)(-1 + i*2 + 1). 4i4 Expand (-10 + 7 + 10 + c2)(0c - 2c + c). -c3 - 7c Expand (3q - 6q + q)(-24 - 1 - 18). 86q Expand (-2 - 3 + 21)(2l*4 + 2l - 2l) - 2l*4 + 6l*4 - 2l*4. 34l*4 Expand (-2x*3 - 3x + 3x)(0 + x + 0)(-1 + 1 + 5). -10x*4 Expand (-3t + 2t - t)(29t + 33t - 60t) + 3t*2 - 2t*2 + 2t2. -t2 Expand (3n5 + n5 - 5n*5)(-6 + 4 + 27). -25n5 Expand -2 + 2 - 3w + (1 - 4 + 4)(-6w + 4w + 0w) - w + 0w + 0w + 3w - 2w + w + (3 + 0 - 2)(3w - 2w + 0w). -3w Expand (j3 - j3 - 2j*4)(-3j + 4j + 4j) + j5 + 3j*3 - 3j*3 + (0j3 - j3 + 0j3)(4j - 2j*2 - 4j) - 3j5 + 5j*5 - 3j*5. -8j*5 Expand 4b + b + 0b + (-2b - 4 + 4)(-1 - 2 + 1) + 4 - 4 - 2b. 7b Expand -2m5 + m5 + 2m5 + (-2 - 2 + 1)(0m5 + 7m*5 - 9m*5). 7m*5 Expand (4 - 5 + 6)(2p4 + 15 - 15 + 9p*3). 10p*4 + 45p*3 Expand (-1 + 1 - 1)(3n - 20 + 34 - 5). -3n - 9 Expand (-k + k - 3k)(1 - 4 - 5). 24k Expand (-4z + 5z + z)(-5 + 1 + 2) + 0z - 2z + 0z - 3z + 4z + 6z + (5z - 4z - 2z)(-5 + 0 + 3). 3z Expand -2 - t + 2 + (2t - 4t + t)(-1 - 2 + 1) + (2 + 0 + 2)(t - 2t + 0t). -3t Expand (3w - 3w - 3w)(4w4 - 4w4 - w4 - 2w4 - w4 + 0w4 + 2 - w4 - 2 + (-2w + 0w + w)(-4w3 + w3 + w*3)). 9w*5 Expand (1 - 3 + 3)(197 + 24h - 197). 24h Expand (-2h3 + 0 - 2 + 3h*3)(14h2 + 70h - 70h). 14h*5 - 28h*2 Expand (11h - 4 - 7h + h4 + 2)(-1 + 1 - h). -h*5 - 4h*2 + 2h Expand -2q2 + 2q - 5q2 + 0q + 2q - q2 - 2q + (-q + 4q - 2q)(3 - 3 + 2q) + q - q + 2q2. -4q*2 + 2q Expand (-3h2 + h2 + 0h*2)(-4 + 4 + 1) - 3h2 + 2h*2 + 2h*2 + (3h - 3h - h)(-3h + h + 0h) + 2h2 + 2h - 2h. 3h*2 Expand (3x - 2x3 - x + 0x*3)(0 + 1 + 2)(2 - 2 - 3x). 18x4 - 18x*2 Expand (-2 + l + 4 + 0l)(-6l*3 + 3l3 + l3). -2l4 - 4l*3 Expand (3j*4 - 2j4 + j4)((-6 + 3 + 1)(2j - 3j + 3j) + 0j - j + 0j + (j + 3j - 2j)(4 + 1 + 1)). 14j5 Expand (1 + g - 1)(0g - g + 0g + (2g + g - 2g)(-1 - 3 + 2)). -3g*2 Expand (p + 0p - 2p)(0 + 3 + 1). -4p Expand (2z*3 + 5z - 1 - 1 - 4z3)(-2z + z + 9z). -16z4 + 40z*2 - 16z Expand (-4 + 6 - 1)((3 - 4 - 1)(-2 - 1 + 2) + 1 + 0 + 0)(3 - q - 3)(-q2 - q2 - q*2). 9q*3 Expand (-4 - 2 - 3)(-3 + 2f + 3). -18f Expand (4f + 2f - 3f)(-1 + 1 - 1)(-3 + 3 + 1)(4 + 2 - 1). -15f Expand (0 + 0 + 2)(-2h - 6h - 3h) - h - h + 3h. -21h Expand (3 - 4 + 0)(0c3 + 0c*3 - 2c*5) + 6c5 - c5 - 4c5 + 3c - 7c + 2c + 4c5 + 2c*5 - 2c*5 - 2c*5. 5c*5 - 2c Expand (2 + 0 + 3)(-a + 2a + 0a) + 6a - 3a - 2a. 6a Expand (3u*3 - 2u*3 - 3u*3)(u + 1 - 1) + 3 - 3 - 2u4 + (3u3 - u3 - u*3)(u - 3u + 0u). -6u4 Expand (-v2 + 3v*2 - 4v*2)(2v - 3v + 0v) - 2 - 2v*3 + 2 + (3 - 5 + 1)(3v3 - 7v*3 + 2v3) + v3 - v + v. 3v3 Expand (5y - y - 3y + (y + 0 + 0)(1 - 1 - 3) + 2y - y - 4y)(-2 + 4 - 4). 10y Expand (-6z + 3 - 3)(0 + 1 + 1 + (-1 + 0 - 1)(0 + 3 - 1) - 5 + 1 + 2). 24z Expand (2m + m + 0m)(3m + 2m - 3m). 6m2 Expand (-5 + 0 + 4)(v + 1 - 1) - 3v + v - v + 0v - 3v + 2v + (4 - 2 - 1)(0 + 2v + 0) + 4v + 0v - 2v. -v Expand l - l + l5 + (-l + l2 + l)(2 - 2 + 2l3) + 7l*5 + 3l*5 - 9l*5. 4l*5 Expand (-27f*5 + 30f*2 - 30f*2)(-1 + 4 - 1)(1 + 2 - 2). -54f*5 Expand (-2 - 2f + 0 + 4)(-f - 4f + f). 8f2 - 8f Expand u + 1 - 1 + (-u - 2u + 4u)(-18 - 47 + 4). -60u Expand 4p4 + p2 - 5p*2 + 3p3 + p2 + (-2 + p + 2)(-p3 + 4p*3 - 4p*3). 3p*4 + 3p*3 - 3p2 Expand (s5 - 5s5 + 5s*5)(-3 + 1 + 4) + 3s5 - 4s*4 + 4 + 4s*4. 5s*5 + 4 Expand (1 + 2 - 2)(2 - 4 + 6)(3d - 3d + d). 4d Expand b*5 - 3b*5 + 3b*5 - 1 + 2b*5 + 1 + (-3 + 0 + 2)(-2b5 + 4b*4 - 4b*4) + 3b5 - b5 - 6b5. b5 Expand 1 + f - 1 + (2 - 4 + 1)(-3f + 5f - f) + 4f - f - 5f + f + 5f - 5f - f + 2 - 2 + (-2f - f + 5f)(-1 + 1 - 10). -22f Expand (-4 + 5 - 3)(2n*4 + 4n4 - n4)(-3 - 2 + 3). 20n*4 Expand (2x3 + x3 - 2x3)(-4x2 + 2x*2 + 2 + 0). -2x*5 + 2x3 Expand (-u3 + u3 - u3)(39u - 41u + 0 + 1 - 2u*2). 2u*5 + 2u4 - u3 Expand (4 - 1 - 1)(10u + 63 - 63)(4u - 4u - 2u*4). -40u*5 Expand 0 - 3h + 0 + 0h - h - h + 3 - 3 + h + (-1 + 0 + 0)(-2h + 3h - 3h) + 8 - 3 + 0 - 2h + h - 3h + 3h. -3h + 5 Expand (-v2 + 5v*2 - 3v*2)(0v - v + 2v) - 5v3 + v3 + 5v*3 + (v - v - 2v)(-2v*2 + 0v + 0v) - v3 + v3 + 2v*3. 8v*3 Expand (2 - 1 - 2)(-3l + 0l + 2l - 4 + 2l + 4 + (0 + 0 + 2)(-l - l + 3l) - 3 + 3 + l + 6l - 2l - 3l). -5l Expand (2k2 + k2 - k2 + (2k2 + k2 - 5k2)(1 - 4 + 1) - k2 - k2 - k*2)(-4k3 + 2k3 - k3). -9k5 Expand -2h*2 + 2h*2 + 4h*2 + (-h + 3h - h)(-h + 2h - 2h) - 2h*2 + 5h*2 + 0h*2 + 6h*2 + 0h*2 - 4h*2. 8h*2 Expand (-9l - 6l3 + 9l)(4l - 3l - 4l). 18l4 Expand (4 - b2 - 4)(2 - 3 + 3)(-2b - b - b). 8b3 Expand (w + 2w - 2w)(0 + 0 + 2)(-16w*3 + 30w*3 - 18w*3). -8w*4 Expand (14 + 5g - 14)(-9 - 2 + 6)((1 - 2 - 1)(-1 + 1 + 1) - 4 - 3 + 5). 100g Expand -z - 3z + 6z + (-2 + 0 + 3)(-4z + 2z + z) - 10z + 7z - 9z. -11z Expand -l5 + 6l - 6l + l3 + 4l5 - l3 + (2l - 5l + l)(-l4 + 4 - 4) - 2l*5 + 0l*2 + 0l*2. 3l*5 Expand -5l*2 + 4l*2 + 3l*2 + (2 + 0 - 1)(-5l2 + l2 + 0l*2) - l - 3l*2 + l + 0l*2 + 2l2 - l2 + (-l2 + l2 + 2l2)(4 - 5 + 2). -2l2 Expand (-5 + 1 - 7f + 6)(2f + 2f - 3f). -7f2 + 2f Expand z*2 - 8z*2 - 34z*3 + 33z3 - z5 + (-2z4 + 2z*2 - 2z*2)(2z + 0 + 0). -5z5 - z3 - 7z2 Expand (-3h*3 + 3h3 - h4)(-2h + 0h + h) - 74h*5 + 30h*4 - 30h*4. -73h*5 Expand (2b*2 + b + 1 - 1 - 1)(3 - 3 + b*3). 2b5 + b4 - b*3 Expand -q + q + 5q + 3q - 2q + q - 2q + 4q - q + (q - 3q + 0q)(0 - 2 + 3) - 5q + q + 0q. 2q Expand (-4 - 2k4 + 4)(2 - 1 - 3) + 2k4 - 5k4 + k4 - k*4 - 2k*4 + 12k*4 - 2k2 - k4 + 2k2 + (-k3 + 3k*3 - 6k*3)(-2k + 2k - 3k). 22k*4 Expand (-2 + 3 - 2)(z - z - 7z) - 2z + 0z + 0z. 5z Expand -3k*4 - 2k*4 + 6k4 - 3 + 3 + k4 + (-3k4 + 0k*4 + 5k*4)(1 + 0 + 0) + k*4 + 3k*2 - 3k*2. 5k*4 Expand (0l - 3l + l)(-1 + 3 - 6) + (-1 + 1 - 2l)(-4 + 3 + 3) + 2 - l - 2 + 0l + 3l - 2l. 4l Expand (2 - 3 + 3)(-u - 3 + 3) + 3u - u + u. u Expand (o - 2o + 3o)(-2 - 2o + 2)((-1 - 3 + 5)(-1 + 2 - 6) - 2 + 1 - 1). 28o2 Expand (4y*4 - 14y*4 + 20y*4)(-3y + 0y + 4y). 10y*5 Expand (-2a - 2a + 2a)(-2a - 3a - 2a). 14a2 Expand (-4b + 2b + 6b)(2 - 2 - 2b) + (0b2 - 2b*2 + 3b*2)(-2 - 3 + 4). -9b2 Expand (-3h*2 + 2h*3 + 3h*2)(3h - 10h - 17h). -48h*4 Expand (-2p + 4p + 9p)(p2 - 2p*2 - 3p*2) - 2 + 2p*3 + 2. -42p*3 Expand (2l - 2l + 2l)(-2l*2 + 8l*2 + 5l*2) + (-2l + 5l - 4l)(3l*2 - 2l*2 - 2l*2) - 3l**3 +	{ "pile_set_name": "DM Mathematics" }
= 4w + 18. Calculate ia(m) + g(m). m*3 - 2 Let b(q) = 8025q*3 - 13q*2 - 13q + 39. Let h(u) = 4013u3 - 6u*2 - 6u + 18. Calculate -6b(a) + 13h(a). 4019a3 Let j(y) = 3y*2 + y - 6. Let o(t) = 13t*2 + 650t - 36. What is 6j(i) - o(i)? 5i*2 - 644i Let z(b) = 49b2 - 234b + 38. Let h(j) = -22j2 + 104j - 17. Determine -20h(r) - 9z(r). -r*2 + 26r - 2 Let q(y) = -y*2 + 2y - 3. Suppose -28b + 3l - 8 = -23b, 2l - 2 = 0. Let m(p) = p + 3. Let j be m(-6). Let h(o) = -o + 1. Determine bq(v) + jh(v). v*2 + v Let a(x) = 13x - 229. Let u be a(18). Let b(l) = 6l - 1. Let y(i) = 4i - 1. Give ub(d) - 7y(d). 2d + 2 Let k(b) = 26b + 33. Let o(h) = -173h - 220. Let p(j) = 20k(j) + 3o(j). Let c(n) = 7n*3 - 28n. Let v = -1 + 2. Give vc(i) + 28p(i). 7i3 Let j(u) = -4u*2 - 5u - 4. Let m(b) be the first derivative of b*3 + 2b*2 + 5b + 8232. Give 2j(k) + 3m(k). k*2 + 2k + 7 Let l(r) = -5r2 - 2r + 1. Let g(z) = -9z2 + 15z + 2. Let s(x) = 27x2 - 48x - 6. Let n(f) = 19g(f) + 6s(f). Give 5l(y) - 3n(y). 2y2 - y - 1 Let v(t) = -5t - 3. Suppose 4f + 122 = 5z, -5f + 2f = 2z + 80. Let x(j) = 12 + 24j + 5 - 3. Calculate fv(d) - 6x(d). -4d Let j(g) = 1. Suppose -16i + 5l - 2696 = -12i, -3l = -3i - 2025. Let z = i - -658. Let k(q) = -3q - 7. What is zj(r) - 3k(r)? 9r Let f(p) = -2p - 4 + 2p - 3p3 - 6p*3 + 4p2. Let c(b) = -b3 + b*2 - 1. Suppose -8k + 5k = -57. Suppose 7y = ky - 12. Calculate yf(x) - 4c(x). -5x*3 Let h(i) = -32i + 14. Let u(a) = 418 - 207 - 206 - 169a + 158a. Give -6h(t) + 17u(t). 5t + 1 Let d(a) = 22a + 6. Let b(j) be the second derivative of -7j3/6 - j2 + 423j. Give -7b(x) - 2d(x). 5x + 2 Let i(f) = -6f*3 + 4f*2 + 3f + 3. Let p(q) = 5q3 - 5q*2 - 3q - 4. Let v = 4253 + -4257. Calculate vi(r) - 3p(r). 9r3 - r2 - 3r Let h(q) be the third derivative of -q4/24 - q3/6 + 1117q2 - q. Let l(u) = 2u*2 + 3u. What is 2h(f) - l(f)? -2f*2 - 5f - 2 Let g(f) be the first derivative of f3/3 - f2/2 + f + 11. Let k(o) = 6 - 5 - 5o2 - 2o*2 + 7o*2 - 7o + 4o2. Calculate 2g(i) - k(i). -2i2 + 5i + 1 Let m(q) = q*2 - 824q - 8. Let p(s) = -3s2 + 1647s + 20. What is 5m(v) + 2p(v)? -v*2 - 826v Let k(y) = 2y2 + 2y - 4. Let b(c) = -4c2 + 8c + 19. Calculate -b(f) + 6k(f). 16f*2 + 4f - 43 Let y(g) = 6g2 + g + 1. Let o(r) = 1947r*2 + r + 1. Determine o(x) - y(x). 1941x2 Let u(z) = z3 + z*2 - z - 3. Let s be u(-2). Let c(w) = -33w - 3. Let p(x) = 98x + 10. What is sp(h) - 16c(h)? 38h - 2 Let s(l) = -l + 1. Let n(k) = -79k + 8. Let q(w) = 34w - 4. Let f(o) = -2n(o) - 5q(o). Give f(c) - 3s(c). -9c + 1 Let y(s) be the third derivative of -7s4/6 - 7s*3/6 - 274s*2. Let r(k) = -k - 8k + 0k - 2. Calculate 7r(p) - 2y(p). -7p Let o(m) = 1. Let x(s) = 3s - 16 - 37 - 29 + 64 + 3s. Calculate -72o(t) - 4x(t). -24t Let m(t) = 13t*2 + 15t - 16. Let o = -16315 - -16313. Let x(d) = 4d2 + 5d - 5. Determine om(p) + 7x(p). 2p2 + 5p - 3 Let t = -85 - -147. Let l = t - 67. Let h(p) = -5p. Let r(c) = 3c. Give lr(v) - 2h(v). -5v Let x(l) be the second derivative of l2/2 + 60289l. Let h(k) = -k + 1. Suppose 2a + 6 - 2 = 0. Give ah(v) + 2x(v). 2v Let g(o) = -7o - 5. Let z(i) = -10i - 7. Suppose b = -19b + 180. Suppose -ba - 48 = 15. Calculate ag(k) + 5z(k). -k Let b(z) = -3z2 - 4z + 5. Let n(g) = 3g2 + 3g - 4. Suppose 136 = 24p - 16p. Suppose 2x + 4i - 8 + 12 = 0, 3x - 5i = -p. What is xb(v) - 5n(v)? -3v2 + v Let y(p) = 1642742p - 35364. Let f(z) = 836z - 18. What is 5894f(k) - 3y(k)? -842k Let j(l) = l - 3. Let z be j(2). Let n = -471 - -474. Let p(d) = -6dn - 8 + 2d*3 + 3159d - 3152d. Let c(f) = -f3 + f - 1. Determine zp(o) + 6c(o). -2o3 - o + 2 Let k(j) = j3 + j - 1. Let u(g) = -2g3 - 4g + 4. Let s be (20-4)/4(-13 + 5 + 9). Give sk(a) - 5u(a). -10a3 Let p(u) = -u3 + u - 2. Let l(f) = 14f*3 - 3f*2 + 2f - 10. Let i(a) = l(a) - 5p(a). Let y(q) = 96q*3 - 16q*2 - 16q. What is 16i(b) - 3y(b)? 16b3 Suppose 7i = 13 - 27. Let c(a) = 3a3 + 4a*2 - 19a - 35. Let s be c(i). Let d(z) = -7z. Let x(l) = -7l - 3l - 8l. What is sx(r) + 12d(r)? 6r Let y(b) = 3b + 1190. Let x(g) = -2g - 1115. Calculate -6x(t) - 5y(t). -3t + 740 Let z(n) = 4n2 + 3n + 1. Let v(a) = -1 - 2019839a - 2 - 11a*2 + 2019831a - a*3. Let q(o) = 9o*3 + 1. Let x be q(-1). Give xz(b) - 3v(b). 3b3 + b2 + 1 Let q(l) = -5l + 2. Let a(o) be the third derivative of 3o4/8 - o3/2 - 22o2 + 12o. Let k(i) = i + 4. Let m be k(-7). Determine ma(v) - 5q(v). -2v - 1 Let b(v) = 5v*2 - 4v + 2. Suppose 0 = -7x - 1 + 8. Let s be b(x). Let u = -413 - -414. Let l(q) = -q - 1. Let t(f) = 4f + 4. Determine sl(m) + ut(m). m + 1 Let t be 4 + 4/(-8) + 91/14. Suppose 29h - 31h + t = 0. Let i(l) = 5l2 + l + 5. Let b(g) = 9g*2 + g + 9. Give hi(f) - 3b(f). -2f*2 + 2f - 2 Let g(m) = -123m - 3. Let h be g(1). Let v = -142 - h. Let w(f) = 7f. Let x(t) = 22t. Let a = -5 + 10. Give ax(z) + vw(z). -2z Let i(y) = 7y - 8. Let b(v) = -3v + 1. Let u(k) = 2b(k) + i(k). Let m(l) = 3l - 18. Determine 3m(c) - 8u(c). c - 6 Let i(w) = 1037w + 85. Let x(b) = -157b - 21. Let c(n) = -78n - 10. Let a(k) = -9c(k) + 4x(k). Calculate -85a(d) + 6i(d). -68d Let l(g) = g - 6g3 - 8 + 2g*2 - 5g*3 + 4 + 3g + 14g3. Let c(k) = -3k3 - k2 - 3k + 3. Give 4c(i) + 3l(i). -3i*3 + 2i*2 Let n(l) = 6l*3 + 7l*2 - 7. Suppose -2j = -j - 3. Let y(q) = 3q3 + 0q*3 - j + 0 + 3q*2. Suppose -811 = 92d - 535. Give dn(i) + 7y(i). 3i3 Let l(m) = 4m*2 + 13m + 6. Let x(c) = 2c2 + 7c + 2. Give 3l(r) - 5x(r). 2r2 + 4r + 8 Let d(b) = 5b3 + 7b*2 + 6b + 3. Let t(c) be the third derivative of c6/120 + c5/60 + c4/24 + c3/6 + 2c2 - 795c. Give -d(i) + 3t(i). -2i*3 - 4i*2 - 3i Let b(u) = 2u + 21. Let t(v) = 284 - 878 + 293 + 280 - 2v + v. What is 3b(z) + 4t(z)? 2z - 21 Let j = -13450 + 13463. Let a(p) = -24p + 11. Let t(o) = -12o + 5. Calculate jt(f) - 6a(f). -12f - 1 Let z(x) = 169x3 - 11x*2 + 11x - 16. Let b(c) = 34c3 - 2c*2 + 2c - 3. Let d(l) = l*2 + 19l - 512. Let a be d(15). What is az(j) + 11b(j)? 36j3 - 1 Let s = 1 - 7. Let r(h) = 6h - 11. Let p(l) = -5l - 38. Let y(t) = -5t - 30. Let c(a) = 5p(a) - 6y(a). Determine sr(w) + 7c(w). -w - 4 Let v(c) = -15c2 - 23c - 14. Suppose 398s - 799s + 255 = -416s. Let z(h) = -5h*2 - 8h - 5. Determine sz(g) + 6v(g). -5g2 - 2g + 1 Let t(b) = b*2 - 29b + 48. Let p be t(27). Let x(w) = 7w2 + w + 2. Let u(q) = 8q - 6q2 + q - 2 - 10q. Let z = 10 - 15. What is pu(a) + zx(a)? a*2 + a + 2 Let p(u) = -3u*2 - 5u + 2. Let h = 2994 - 3001. Let f(t) = 5t2 + 10t - 4. Determine hp(d) - 4f(d). d*2 - 5d + 2 Let l(j) = -j*3 + j. Let f(u) = 6u*3 - 2u*2 - 3u - 2. Suppose 7y + 16 = -5d + 8y, -2d = 2y + 4. Calculate dl(n) - f(n). -3n3 + 2n*2 + 2 Let w(a) = 10a*2 - a + 71. Let u(j) = 15j*2 - j + 107. Calculate 5u(s) - 8w(s). -5s*2 + 3s - 33 Let j(s) = -10241s - 44. Let z(r) = 1464r + 6. Determine 2j(h) + 15z(h). 1478h + 2 Let b(u) = -u2 + 1. Let y(a) = -11a*2 - 18a - 3. Let c(l) = -38l2 - 60l - 8. Let g(s) = 3c(s) - 10y(s). What is 3b(v) - g(v)? v2 - 3 Let n(z) = 18859010z*2 - 18420. Let p(v) = -9213v*2 + 9. Calculate -3n(w) - 6140p(w). -9210w*2 Let j(w) = 8w*3 + 9w*2 - 14w - 124. Let y(z) = 5z3 + 6z*2 - 10z - 83. Determine 5j(a) - 7y(a). 5a3 + 3a*2 - 39 Let y(i) = 11i*3 + 4i*2 - 6. Let j(f) = 11f*3 + 5f*2 - 7. Let x = -881 + 874. Determine xy(v) + 6j(v). -11v*3 + 2v*2 Let n(k) = -2k*3 + 37k*2 + 3k - 105. Let j(o) = -14o2 - o + 1. Give -2j(s) - n(s). 2s3 - 9s*2 - s + 103 Suppose 2g - 7 = -3. Suppose gw = -2w + 20, 23 = h + 4w. Let j(i) = 3i*2 + 2. Let t(y) = 2y*2 + 1. What is hj(n) - 5t(n)? -n2 + 1 Suppose 14t = 24t - 200. Let v(p) = -6p*3 + 5p*2 - 5p - 5. Suppose -7q = -30 + 2. Let i(x) = x3 - x2 + x + 1. What is qv(j) +	{ "pile_set_name": "DM Mathematics" }
r j. 3 Let i = -3 + -5. Let r = i + 10. Solve c = 3 + r for c. 5 Suppose 4 = -5h + 9. Let c(b) = b + 1. Let w be c(0). Solve -2v - h = w for v. -1 Suppose -z = -0z - 12. Suppose v = -0v + 8. Suppose 3x - 3o = x + v, -3x + 2o = -z. Solve -15 = xf - f for f. -5 Let m be 0 + -2 - (-15 + 13). Solve 0 = -mw - 2w - 4 for w. -2 Suppose g = -3z + 19, 3g + 4z - 76 = -g. Let d = g - 15. Solve -7 = dt + 13 for t. -5 Let v(h) = h2 - 9h + 10. Suppose -o - 3o + 8 = 0, 4x = 2o + 28. Let z be v(x). Solve 15 = -zj - j for j. -5 Suppose 0 = -z + 4r - 4, -5z - r + 3 = 2r. Let g = z + 2. Let d = 5 - g. Solve 0o = o + d for o. -3 Suppose r - 12 = -2c, -5c + 0r = -2r - 12. Solve -3x + c = -2 for x. 2 Suppose -3s = s + 40. Let i be (-8)/s10/4. Solve in = n for n. 0 Suppose g = -3g - 8. Suppose -6p - 2 = -p + 4k, -2p + 5k = -19. Let w be g/(-4) - p/4. Solve -a + 5a = w for a. 0 Let x = -31 + 37. Solve -xa = -7a + 3 for a. 3 Let j(s) = 6s + 1. Let u be j(3). Let r(a) = -5a - 5. Let b be r(-2). Suppose -bq = -u - 6. Solve -5p + q = -0 for p. 1 Suppose 4c + 10 = -x + 8c, 5c - 44 = -4x. Solve 2n - 2 = x for n. 4 Let g = -2 - 4. Let w be (-3)/66 - g. Solve w = -d + 2 for d. -1 Let d(p) be the second derivative of -p5/20 - p4/12 - p3/6 + p2 - 3p. Let i be d(0). Solve 6w - 12 = iw for w. 3 Let h be 3/(2 - (-2)/(-2)). Solve -x = -hx for x. 0 Let y = -101 + 103. Solve yo = -o - 6 for o. -2 Suppose -3r - r = -f - 31, 0 = -4r - 4f + 16. Let t(o) = -o*3 + 7o*2 + 5. Let h be t(r). Solve i = 6i - h for i. 1 Let a(p) = p*3 - 5p*2 + 4p. Let w be a(3). Suppose -3 = -u - 2, -2k - u - 3 = 0. Let h = k - w. Solve 0 = -3y + 2y + h for y. 4 Let s(b) = b + 11. Let t be s(-10). Let r be 25/(-20)(t + -5). Suppose rh + 5 = 6h. Solve 3o - 7 = h for o. 4 Suppose -2o + 7 - 1 = -r, 2r = 0. Let u be 35/3 + (-3)/(-9). Let t = u + -8. Solve th + 1 = oh for h. -1 Suppose -5j - 10 = 10. Let o(w) = w*2 + 4w + 5. Let h be o(j). Solve -4m - m - h = 0 for m. -1 Suppose -3u - 3 = -y, 0 = -5y + u + 2u - 9. Let d = y - -8. Solve -k + 16 = -dk for k. -4 Suppose -10 = -10m + 8m. Solve mg - 18 = 7 for g. 5 Let m(n) = 2n. Suppose -3 = -2v - 13. Let u be m(v). Let y = -6 - u. Solve -y = -3c + 2 for c. 2 Let b(a) be the first derivative of -a4/4 - 14a*3/3 + 7a*2 - a - 1. Let s be b(-15). Solve -1 = 3r + s for r. -5 Suppose 0p - 3p = -12. Suppose -m + p = m. Suppose 3j = -0j + 12. Solve -2u - m - j = 0 for u. -3 Suppose -4t - k + 17 = -2k, 0 = 4k + 20. Solve -t = u + 2u for u. -1 Let y = 61 - 58. Solve 1 = 2l - yl for l. -1 Let q = 6 + -3. Let a(k) = 0k*2 + qk*2 - 7k - 2k2 + 4. Let b be a(7). Solve -bt = -0t for t. 0 Let i(u) be the third derivative of -u5/60 + 11u*4/24 + 2u*3 - 4u*2. Let z be i(12). Solve c - 5c = z for c. 0 Let p be -2 + 1 + -15. Let v(g) = g3 + 5g*2 - 5g + 8. Let b be v(p). Let d = -4 - -11. Solve -bf - d = -1 for f. -3 Let r(s) = -s - 5. Let f be r(-9). Solve fm = m for m. 0 Suppose 0 = 4z - 0z - 8. Let t(g) = g*2 + 13g + 5. Let n be t(-13). Let a be -17((-3 - 0) + 2). Solve z = nj + a for j. -3 Suppose -c - 4 = -9. Solve cd - d + 20 = 0 for d. -5 Let c be (-3)/(9/(-33)) + -3. Suppose -c - 20 = 2g. Let t be (g/21)/(1/(-3)). Solve -tk + 20 = -6k for k. -5 Let n be -2(-3)/(-24) - (-10)/8. Solve d = -0d - n for d. -1 Let w(f) = -f - 6. Let a be w(12). Let j be (1 - 3)a/9. Let g be ((-14)/8 + 2)j. Solve 3 = s - g for s. 4 Suppose -2t + t = j, -5t = j + 8. Let n(r) = 3r2 - 3r + 1 + 0r - r2. Let u be n(2). Solve -j - u = f for f. -5 Let x(u) = 2u*2 - 2u - 1. Let t be x(-1). Let p be 1/(t/9) - -22. Solve 5s + 0s = -p for s. -5 Suppose 0 = 3m - 70 + 58. Solve mw - w - 3 = 0 for w. 1 Let h be 75/45 + (-1)/(-3). Solve 4c + 14 = h for c. -3 Let n = 0 - 0. Let y be -1n/(-1 + 2). Suppose 0 = -yq + 3q. Solve 0a + a + 3 = q for a. -3 Let b(k) = -k3 - 7k*2 - 3k - 19. Let c be b(-7). Suppose -i = 4v - 0v - 17, -3i - 4v + 27 = 0. Suppose u - c = i. Solve -5g - u - 13 = 0 for g. -4 Let i(x) = -x2 - 3x - 1. Let n be i(-2). Let m be (n - -2)2/3. Suppose 3q - 5h = 21, 0h + m = -2q - 2h. Solve ql = 3l - 3 for l. 3 Suppose 0 = 5p - 0p - 25. Let n be (-2)/(p/(60/(-8))). Suppose 3v + 102 = 4u, -2u + 0 = -4v - 56. Solve 9 - u = -nm for m. 5 Let q(u) = -2u. Let d be q(3). Let h = d - -11. Solve -4 - h = -3w for w. 3 Let g(m) = -2m - 9. Let a be g(-6). Solve -8v + av = 15 for v. -3 Let y(p) = -p + 10. Let s be y(8). Suppose 2f = -sf. Let x = 5 + -2. Solve fg - 12 = -xg for g. 4 Let k(p) = p*3 - 5p*2 + 6p - 5. Let s be k(4). Suppose -5a = -4n - 65, 0 = -2a - sn - 2n - 7. Let d = -4 + 6. Solve 1 = dl - a for l. 5 Let h = -111 + 113. Solve 3n = -hn for n. 0 Let i = -30 + 30. Solve ip + 4 = 2p for p. 2 Suppose 5x - 2j + 6 - 24 = 0, -2j = -3x + 14. Let z = 4 - x. Solve -zi + 9 = i for i. 3 Suppose -11v + 2v + 54 = 0. Solve 0 = -3j + 5j + v for j. -3 Let s(v) = v - 1. Let z be s(0). Let u be 26 + (1 - 0)z. Suppose 2o = -3o + u. Solve 0y + oy - 5 = 0 for y. 1 Suppose -27 = 2o + 5d, o + d + 16 = 1. Let s = -8 - o. Solve 8 = 4n - sn for n. -2 Suppose 0 = -2n - 6, 0 = k - 2k - n - 8. Let q be 2/(3 + k)-20. Solve -6p = -p - q for p. 4 Let a be -4 + 12/3 - -5. Solve 3 = ao - 2o for o. 1 Suppose -5x + 0x = p - 10, 0 = 3x + 4p + 11. Solve -l - 2l = x for l. -1 Suppose 0f - 2f - 12 = 0. Let b be (f/11)/(-2). Let p(s) = s3 - s2 + 1. Let g be p(0). Solve b = -2r - g for r. -2 Let p(f) = -3f*2 + 2f - 4f - 2f + f*3 + 5. Let n be p(4). Solve -z + n = -0z for z. 5 Suppose 0k - 20 = -2k - 4s, 16 = 4s. Solve kf = 4f + 4 for f. -2 Suppose 96 = -2i - 2i. Let y be 47/7 - i/84. Solve y + 13 = -5k for k. -4 Suppose 0 = -3j + j + 8. Solve c = -jc - 20 for c. -4 Let k be (-15)/(-4) - (-2)/8. Let o(x) = -x3 + 3x*2 + 6x - 4. Let t be o(k). Solve 1 = -n - t for n. -5 Let k(w) = 6w2 + 2w. Let f be k(-1). Solve -z + f = z for z. 2 Let b = -1 + -1. Let d be 16/(-12) + b/3. Let q = 4 + d. Solve -g + q = -1 for g. 3 Suppose -13 = 7j - 2j - 3v, 0 = 3j + 3v + 3. Let b = j - -4. Suppose -y + 20 = -m + 5, -5y + 2m + 66 = 0. Solve -b = -2z - y for z. -5 Let j = 4 - 4. Let l = 72 + -69. Solve -m + 0m + l = j for m. 3 Let k = 71 - 123. Let m = k + 79. Solve -m = -5r - 2 for r. 5 Let s be (-2 - 2)6/(-12). Solve 4l - 6l - s = 0 for l. -1 Let p(z) = z. Let b(d) = 4d - 1. Let x(r) = 1. Let y(l) = -b(l) - 6x(l). Let s(q) = -5p(q) - y(q). Let j be s(0). Solve -jv - 23 + 8 = 0 for v. -3 Let t(p) = p3 + 6p*2 + 5p + 1. Suppose 2h = 4h + 10. Let g be t(h). Solve 0 = -k - g + 6 for k. 5 Suppose -5j + q + 13 + 12 = 0, 2j = -3q - 7. Let d be (-30)/6j/(-10). Suppose -2h - g = -2, -3h - g = -6h + 13. Solve w + h = -dw for w. -1 Let n(d) = -6d - 1. Let a be n(-1). Solve -6g = -g - a for g. 1 Let h = 1 + 0. Let q = 3 + h. Solve qx = 8 + 4 for x. 3 Suppose 6 = -j + 5. Let z be j/(-2) + (-22)/(-4). Solve s - z = 3s for s. -3 Let k be (2 - (4 + -5)) + -1. Suppose 0 = km - 10 - 6. Solve 5i - m = 2 for i. 2 Let o(k) = -5 + 3k - k + k. Let b(g) = g3 - 3g*2 + 3g - 5. Let n be b(3). Let p be o(n). Solve -4q = -pq - 9 for q. -3 Let t be 0 - 3/(1-3). Let d be 2/t - (0 - 0). Suppose -f = -d - 0. Solve -fj = -3j - 1 for j. -1 Let c be ((-4)/12)/(1/(-18)). Let d = c + -5. Solve -4 = 3p - d for p. -1 Suppose 0g - g + 5 = 0. Solve -2z - 15 = -gz for z. 5 Let m(o) = o3 - 10o*2 - 2o + 1. Let t be m(10). Let y be -4(t/4 + 4). Solve 5a - y - 7 = 0 for a. 2 Let h be ((-3)/2)/((-3)/6). Suppose -k + 4q - h = 3, -10 = -4k - q. Solve -9 + 1 = kl for l. -4 Let a(s) be the first derivative of -s4/4 - 8s3/3 - s2/2 - 6s + 1. Let k be a(-8). Solve kh - 1 = 3h for h. -1 Suppose -4a = -7a - 27. Let o be 5 + a/3 + 2. Solve ox - 9 = x for x. 3 Let j = 29 + -27. Solve -g + 0g = j for g. -2 Let m = 93 - 86. Suppose 0 = 2d + 6c - c + 20, 16 = -4c. Solve 4r + 5 + m = d for r. -3 Let q(h) = -8h - 5h2 + 2 + 3h2 + h2. Let y be q(-7). Solve -11 = -5c + y for c. 4 Let a = 53 + -48. Solve at - 6 = -31 for t. -5 Let w be (0 + -1)/(2/(-4)). S	{ "pile_set_name": "DM Mathematics" }
t k be i(0). Let x(t) = t*2 + 2t - 3. Let p be x(2). Solve -kb + 2b = -p for b. 5 Let g be (-2 + 3 - 1) + 6. Let c be g/510/3. Solve -o = -2o - c for o. -4 Suppose -3d + 4d = 0. Let u(o) = o*2. Let i be u(d). Solve -h = -ih for h. 0 Let b(d) = -d*2 + d. Let l be b(0). Let n be (-60)/(-36)(l + 3). Solve -k + 16 = -nk for k. -4 Let c be (6 - (4 - 1)) + 4. Let u = -5 + c. Solve 4w - 6 = uw for w. 3 Suppose 3d - 1 = -5l - 2, 0 = 4d + l - 10. Solve 3 + d = -2m for m. -3 Suppose 2x = -3 + 13. Let v be 3/x - (-6)/(-10). Solve 2j = -vj + 10 for j. 5 Suppose 11 = -2f - s + 1, -2s = -f - 15. Suppose -p - 3x = -20, p = -0p - 4x + 22. Let q be (-12)/pf1. Solve v + v - q = 0 for v. 3 Let p be 6-18/6. Let w = p - -13. Suppose -15 = -wj - 0. Solve 0 = -0x + jx - 6 for x. 2 Suppose -4s + 13 - 1 = 0. Solve -12 - s = -3l for l. 5 Suppose 4s + 2 = a, 2s + 0 = -5a + 10. Solve -q - q = s for q. 0 Suppose 24 - 9 = 3c. Suppose -u = -4u - i + 11, 4i = u + c. Suppose 0 = 2n + l - 1, -un - 3 = 2l + l. Solve -3a = n + 13 for a. -5 Let i = -14 + 20. Suppose 0f + i = 3f. Suppose 5p - 20 = fj, 4p + j = -2j + 16. Solve 4d = -0 - p for d. -1 Suppose 3z - 10z = -28. Solve -zx + 2x = 0 for x. 0 Let r(g) = 2g*3 + 2g*2 - 3g + 2. Let a be r(1). Let p(h) = 3h - 7. Let x be p(a). Solve -x = 2n - 6 for n. 2 Suppose 2z + 34 = -5t, -5t + 2z - 9 = 37. Let v = t + 12. Solve -17 = vc - 5 for c. -3 Suppose -70 = i + 4i. Let d be 7/(i/(-48)) + 1. Solve -g + d = -6g for g. -5 Suppose 0 = 3v - 7v. Let j(b) = -b3 - 3b*2 + 1. Let r be j(-2). Let f = v - r. Solve -5t + ft = 0 for t. 0 Suppose 2y = 4y. Suppose 3i - 11 = 1. Solve y = -2t - 0t + i for t. 2 Let p be (7 + -1)(-8)/(-6). Suppose 5b - 3m = 12, -5m + 5 - 25 = -4b. Solve -3y + 7y - p = b for y. 2 Let g be 0/(-12)-1. Suppose 2h = -0m + 4m - 10, -5h + 5 = -4m. Solve g = -mk + 3k + 2 for k. 1 Let h = -51 + 58. Solve 0 = 3a - 2 - h for a. 3 Suppose 20 = -3h + 4h. Suppose -3f + h = -8f + 5u, -5f + u = 16. Let p = 8 + f. Solve -10 = pl - 0 for l. -2 Suppose 34 - 6 = 4g. Let l(t) be the third derivative of -t6/120 + t5/10 + 7t4/24 + t3/2 + 3t2. Let s be l(g). Solve s + 2 = 5u for u. 1 Let k(u) = -u*2 - 7u + 34. Let h be k(-10). Solve 0j = -4j + h for j. 1 Suppose 3b - 37 = 4j, -b = -4j - 3b - 42. Let p = -1 - j. Solve 0d - p = 3d for d. -3 Suppose 19 - 3 = 4l. Suppose ln + 4 - 24 = -2o, 2o = n - 5. Solve 0 = -nj + 4j - 3 for j. -3 Suppose 0 = 6m - 0 - 30. Solve -10 = -3h + mh for h. -5 Suppose 0 = -5p, -s - 3s + 8 = 4p. Let c be ((-1)/(-2))/(2/16). Suppose -cq - 7k - 17 = -2k, -k - 7 = -q. Solve -q + 12 = -sy for y. -5 Let h be 2/10 - 96/(-20). Suppose -v + h + 0 = 0. Solve 0 = -4d + 3d - v for d. -5 Let j(k) = -k - 3. Let h be j(-3). Suppose ho - 12 = -2o. Solve -p - 2p + o = 0 for p. 2 Let u(n) = 3n*2 - 2n + 1. Let g be u(2). Suppose 5i = 11 + g. Solve -iv - 8 = 4 for v. -3 Let r(v) be the third derivative of -v*5/60 + 3v4/8 - v3/2 + v2. Let n be r(8). Let g(f) = f3 - f*2. Let j be g(2). Solve -11 - n = -jz for z. 4 Let o = 14 + -9. Solve -13 = on + 12 for n. -5 Suppose -9i = -4i - q - 52, 2q = -2i + 28. Suppose 7d - 4d = -2g - 11, 3g - i = d. Suppose -3t + 3 = -3. Solve -g - t = n for n. -4 Let f be 10/410/5. Suppose -fu = -3u - 50. Suppose -2o + u = 3o. Solve -a + 20 = -oa for a. -5 Let t = -3 + 11. Let k = -5 + t. Let c(a) = a*3 - 4a*2 + 5a - 4. Let z be c(k). Solve 0 = i - z for i. 2 Let i(k) = -k*3 - 4k*2 - 2k + 5. Let v be i(-3). Solve -3u - 4 - v = 0 for u. -2 Let x(o) = o + 8. Suppose -3y = 4q + 9, y + 14 - 1 = -3q. Let v be x(q). Solve vd - 3d = 0 for d. 0 Suppose -3v - 2v = 35. Let t(o) = o*2 - 3o. Let w(q) = q*2 - 3q. Let m(n) = vt(n) + 6w(n). Let x be m(2). Solve -xu = 3u for u. 0 Let d be (-35)/11 + 10/55. Let q be 0/(((-3)/d)/(-1)). Solve -5h - 14 - 6 = q for h. -4 Let q = -8 + 18. Suppose -2g + q = -7g. Let c be (1 - g)(-6)/(-9). Solve r - cr = -1 for r. 1 Let w = -6 + 11. Solve 3 = 6i - wi for i. 3 Let l(s) = 4s3 + s2 - 2s + 1. Let i be l(1). Solve 0y - 4 = -iy for y. 1 Let h(z) = z3 + 4z*2 - 6z - 3. Let f be h(-5). Suppose 0 = 5w + 4a - 8, -2w + 2a - 3a = -f. Solve 8v - 3v = w for v. 0 Let i = 4 + 0. Suppose -4s + 6 = -2s. Suppose 3z - 19 - 17 = -4x, 0 = sz + 5x - 39. Solve 8 = -zm + im for m. -2 Suppose -6q + 9 + 51 = 0. Let h(j) = -j + 8. Let b be h(8). Solve 5n + q = -bn for n. -2 Suppose -7h + 12h = 0. Solve 2i + h = -4 for i. -2 Let h = 23 + -21. Solve -14 = 4z + h for z. -4 Let f(w) = 2w2 - 3 - w2 + 2w - 1 + 1. Let a be f(2). Solve -aj = -j for j. 0 Let t be 4/4 + -2 - -6. Solve 0 = -f + tf for f. 0 Suppose -3s = -5b + 12, 0 = 5b - s + 6s + 20. Suppose 2v + v - 30 = b. Solve -4d - v = -2d for d. -5 Let s(y) = y3 - 14y*2 - 17y + 35. Let h be s(15). Solve -a = -ha + 20 for a. 5 Let g be -14 - (2 + 9/(-3)). Let k = g - -26. Suppose 3t + 2t - 8 = q, -t = -4q - k. Solve -f - 4 - t = 0 for f. -5 Suppose 0l - 2l = -m + 5, -2l + 2m = 8. Let c be (l/(-3))/((-7)/(-63)). Suppose -2v + h = -cv, 5h + 8 = -3v. Solve -2i + 0i + v = 0 for i. 2 Let g(t) = -t + 12. Let j = 20 - 14. Let y be g(j). Solve 2v = -v + y for v. 2 Let a(y) = 31y - 2. Let g be a(2). Suppose -17 = -4q - 1, 2q - 20 = -2r. Suppose rd = d + g. Solve 2f - d = -f for f. 4 Let j(m) = m2 + 2m - 2. Let d be j(2). Let h be ((-4)/d)/(4/(-30)). Solve 0 = -l + hl - 20 for l. 5 Suppose 4 = -a - 7. Let x(q) = q3 + 11q*2 - q - 11. Let i be x(a). Solve -v + iv = -3 for v. 3 Suppose 33 = 12r - 87. Solve -2g = 3g + r for g. -2 Suppose -5l = 3c + 5, 0c + 5c = 5l - 35. Let t(x) = -5x - 11x*2 - 2x*3 + 8 + 5x2 + x3 - 5. Let v be t(c). Solve -2f - vf = 5 for f. -1 Let u(n) be the first derivative of n4/4 + n3 - 2n2 - 1. Let h be u(-4). Solve 3f = -hf - 9 for f. -3 Suppose 3u + 3w = 2u + 27, -5w = -5u + 235. Let m = u + -27. Solve 0r - m = 3r for r. -5 Let p(t) = -2t3 - 3t*2 - 3t - 1. Let k be p(-2). Suppose 0 = 2o + o - k. Solve -q + o = -2q for q. -3 Let b(h) be the third derivative of 0 - 3h2 + 0h - 7/24h4 - 1/3h*3 - 1/60h*5. Let i be b(-5). Solve 0d + i = 2d for d. 4 Suppose 0 = -5w - 3i + 27, 2w - 5w + 17 = 2i. Solve -ws + 13 = 4 for s. 3 Let a be 2 + (-6 - (-2)/2). Let w = a + 10. Suppose -4i + w = -1. Solve 3d - i = -8 for d. -2 Let u(z) = 2z - 8. Suppose 2s + b - 7 = 0, -2s + b + 8 = -s. Let o be u(s). Solve -o = -0l - l for l. 2 Let b = 49 - 46. Solve r + b = -2 for r. -5 Suppose -5c + 5t + 3 = -7, -5t = -3c - 2. Let f(i) = -6i2 + 2 + 1 - 1 + i3 - 17i + 20i. Let z be f(c). Solve -s + z = 3s for s. 5 Suppose 4u - 26 = -6. Solve 7p - 6p = u for p. 5 Let l(u) = u*3 + 20. Let n be l(0). Solve -3m = 2m - n for m. 4 Let y be 1/(-4(-3)/60). Solve -yp = -4 - 6 for p. 2 Let m(f) = -f3 + 4f*2 - 2f - 3. Let a = -2 - -5. Let h be m(a). Solve -3o - o - 8 = h for o. -2 Suppose -3d = d + 2l + 6, 0 = -5l - 5. Let f = d + 11. Solve -b = -3b - f for b. -5 Let x(p) = -p - 4. Let s be x(-6). Solve 4m = sm - 2 for m. -1 Let r(d) = d3 + 9d*2 + d + 7. Let s be r(-9). Let l be 0/((0 - -2)/s). Solve l = -3v + 4 + 11 for v. 5 Let a(f) = 4f - 3. Let m = -5 + 8. Let b be a(m). Let x = b + -5. Solve x = -n - 1 for n. -5 Suppose 2g + 16 = 4l - 0g, -2l + 2g = -10. Suppose w + 2 = lw. Solve 2o + 7 = w for o. -3 Let m(y) = y3 - y2 + y + 5. Let a be m(0). Solve 5h - a - 20 = 0 for h. 5 Let i(f) = f2 - 2f - 2. Let r be (-1(0 + 5))/(-1). Let l = -2 + r. Let y be i(l). Solve 3g + 11 = -y for g. -4 Let p(j) = -j + 15. Let q(o) = -8. Let k(x) = -4p(x) - 7q(x). Let i be k(7). Suppose -2d + i = 2d. Solve 0 = 3u - 5u + d for u. 3 Let j be 18/(-135) - 3/(45/(-302)). Solve 4l = -l - j for l. -4 Suppose -3w + 0w = -63. Solve 3d - w + 6 = 0 for d. 5 Let n = -34 + 23. Let m = 17 + n. Suppose -b = 2b - m. Solve -ba + 4a - 4 = 0 for a. 2 Suppose 0 = 5s - 3h + 101, -3h = -2s - 25 - 10. Let a = 39 + s. Let c = -12 + a. Solve cb = b + 20 for b. 5 Suppose -4z = 3j - 3, 5z + 6j = j + 5.	{ "pile_set_name": "DM Mathematics" }
m be h(4). What is the least common multiple of (1 - 392/(-20)) + (-4)/m and 153? 1071 Suppose 0 = 7p - 0p - 43p + 2016. What is the least common multiple of 1736 and p? 1736 What is the common denominator of (504/(-32))/(-21) - ((-44807)/(-1848))/37 and (8/(-12))/((-4)/146)? 264 Let l = -24 - -36. Suppose s + 3u - 407 = 1077, 2s = -3u + 2950. Calculate the lowest common multiple of l and s. 8796 Let i = 95/648 + 32/81. What is the common denominator of 0 - -1 - (430/(-96) - -7) and i? 48 Let p be 25/(-20) - 196/(-16). Let g be 6/18 - 14/(-3). Suppose -3b - g = -p. What is the lowest common multiple of 12 and b? 12 Suppose 0 = 2d + 5f - 928, -4f - 152 - 740 = -2d. Let m = d + -446. What is the smallest common multiple of ((-18)/(-5))/(3/10) and m? 24 Let o = -3105 - -18685/6. Find the common denominator of o and 103/42 + -510/175. 6 Suppose -44 + 60 = -2v. Calculate the lowest common multiple of (v/1)/(-2)(-40 - -44) and (-1)/3 - 13/(-3). 16 Let m = -5/3974 + -82453/5961. What is the common denominator of -49/660 and m? 660 What is the common denominator of ((-12)/(-231))/(18/546 - 0) and -8/1309? 3927 Suppose -16 - 16 = 16n. Find the common denominator of (-995)/(-975) + (-1)/(-10)n and 48/5. 195 Calculate the common denominator of 51/152 and 13361/2586-26/40. 760 Calculate the lowest common multiple of (-1320)/(-70) + 200/175 and 560. 560 Suppose -84v = -80v - 28. Suppose 221c + v = 228c. Let q(l) = -l + 2. What is the lowest common multiple of q(-8) and c? 10 Let k = 23 - 909/38. Let z = 93529/6132 + -4/1533. Calculate the common denominator of k and z. 76 Let v = 437 + -437. Find the common denominator of -79/32 and v + (1 - 553/(-28)). 32 Let d = 2653/6 + -8408/19. Calculate the common denominator of d and -8/399. 798 Suppose -25q - 33q = -109 + 15 - 138. Suppose w + 155 = 6w. Let c = w - 9. Calculate the smallest common multiple of q and c. 44 Let w = -20832 + 32768730/1573. Find the common denominator of w and 41/2. 3146 Let a = 11975 - 11927. Calculate the smallest common multiple of a and 2656. 7968 Calculate the common denominator of 50/(-24)(120/(-75) + -10) and -7/1842. 1842 Suppose -4p = 4i - 20, -i + 16 = 3p - 3. Suppose 2s = -4k + 36, 12s - ps - 4k = 90. What is the smallest common multiple of 21 and s? 126 Let b = 276 - 9606/35. Calculate the common denominator of -57/91 and b. 455 Let c = -306 + 62. Let z = -241 - c. Calculate the lowest common multiple of 39 and z. 39 Suppose -3o + 5o = 312. Let i = -449070 - -449126. Calculate the least common multiple of i and o. 2184 Suppose 4 = 2p, -p + 6 = -h - 3h. Let n(o) = -o + 1 + 0o - o - 3o. Calculate the least common multiple of n(h) and 3. 6 Suppose 0 = -4h + 5d + 49, h - 13 = -0h + d. Let o = -44668 - -44678. What is the least common multiple of o and h? 80 What is the common denominator of (6 + 1 + 303/(-45))/(3/120) and -7/858? 858 Suppose 0 = j - 49 - 54. Let b = j - 101. Let r(o) = o2 - 10o + 3. What is the lowest common multiple of b and r(10)? 6 Suppose -3c + 5k + 12911 = 2653, c - 5k - 3426 = 0. Calculate the least common multiple of 36 and c. 30744 Let w = 1806638807/156120016 + 2/9757501. Let j = w + -109/13. Calculate the common denominator of 37/202 and j. 1616 What is the common denominator of 40/33 and 4 + 59410/(-3300) + 14? 330 Let t = 65015/298356 - 195/529. Find the common denominator of t and -11/18. 1692 Suppose r = 5r - 24. Suppose -87q + 11q = -6080. What is the lowest common multiple of q and r? 240 Let g be 0((-7)/(-2) - (-8 + 12)). Suppose 4m - 4w = g, -2w = -m - 2 - 0. What is the least common multiple of 12 and 2 - (m/(-10) - 297/15)? 132 Find the common denominator of 107/100 and -7 - ((-2836)/1320 - -1) - -6. 3300 What is the common denominator of -51/2 and (66/551265)/(2/(-110) + 0)? 6682 Let o = 6488/5 - 350827/270. Find the common denominator of o and 95/12. 108 Let l = -337 - -397. Calculate the common denominator of 1917/36(-5)/l and (0 - (-73)/(-22)) + 2. 176 Suppose -124m = -128m + 23520. Suppose 24n = -25n + m. Calculate the least common multiple of n and 135. 1080 Let u = -412 + 424. Let p(w) = 4w + 10. Let k = 35 + -26. What is the least common multiple of p(k) and u? 276 Let s(k) = -761k - 8365. What is the smallest common multiple of 1604 and s(-11)? 4812 Let v = 4561263767/2896 - 1575022. Calculate the common denominator of v and -27/3620. 14480 Let i be (6 - 20/(10 - 5))-1. Let w(q) = 4q2 + 2q - 3. What is the lowest common multiple of (-8)/68 + ((-1625)/(-85) - i) and w(-3)? 189 Suppose 3t = 4d + 93, -2d + 102 = 7t - 3t. Let g = t + -25. Suppose 34 = gf + 22. What is the lowest common multiple of 3 and f? 6 Let i = 298 + -208. What is the common denominator of (-3 - (-55)/25) + (-123)/i and 33/16? 48 Let o(i) = i*2 + 7i - 20. Let s be o(-9). Calculate the common denominator of s/5 - -3(-89)/(-480) and 69/2. 32 Let f = 2190277043/60 - 36516289. Let c = f - -11672. What is the common denominator of -47/30 and c? 60 Suppose -20 = -4b, -5b + b + 44 = -2u. Let i = -1743/2 + 903. Find the common denominator of -3 + 0 - (-50)/u and i. 6 Calculate the common denominator of (3/(-16))/(43953/14924) and -91/2. 644 Let y = -80497/12 - -6701. What is the common denominator of y and 83/1974? 3948 Calculate the least common multiple of 231 and (-9)/6 + 182/4. 924 Let p = 105577/60 + -1760. Calculate the common denominator of -93/20 and p. 60 Let c(y) = y + 6. What is the least common multiple of c(-3) and 13420/427 - (-40)/(-28)? 30 Let q(i) = -i*3 + i + 6. Let m be (-4)/((-12)/9) + -3. Let g = -41 - -44. What is the least common multiple of g and q(m)? 6 Let u = 52340 + -3454591/66. Find the common denominator of -97/336 and u. 3696 Let g = 2/491 + 19109/9820. Calculate the common denominator of g and -97/3088. 15440 Let q(o) = 7o + 129. Let r be q(4). Let x = r - 151. Calculate the lowest common multiple of 76 and x. 228 What is the least common multiple of 1728 and 662 + (13 - 36) + 9? 5184 What is the least common multiple of -5(-48 + 19 - 26) and 4200? 46200 Find the common denominator of -97/105 and (-24)/(-117)(23 - 19 - 93/15). 1365 Let m be (39/26)/((-6)/4). Find the common denominator of -33/40 and ((-3827)/(-344))/(7(m + 0)). 280 Suppose 2v = -41s + 46s + 355, v = -5s + 140. Calculate the least common multiple of 10 and v. 330 Suppose -80 = 4y + x - 336, 0 = -4y + x + 256. What is the common denominator of -17/6 and (-264)/y12/(-135)? 30 Suppose 9i = 5i + 96. Suppose 7s - 186s + 23968 = 35s. Calculate the smallest common multiple of i and s. 336 Let p = -27099923/120 + 225834. Find the common denominator of 42 + (40 - 86) + 1191/198 and p. 1320 Let n = -13884 - -14719. What is the least common multiple of 10 and n? 1670 Let r be ((-136)/204)/((-1)/(-3)). What is the lowest common multiple of (-5)/(20/16)(-4 - r) and 44? 88 Suppose 4f + 628 = 5a, 4a - 515 = 68f - 63f. Calculate the least common multiple of a and 900. 1800 Let g be (-16964)/168 - (-14 - -11). Let t = -848/7 - g. What is the common denominator of t and 87/50? 150 Let a = -6351 - -4248. Let r be (4/(-10))/(190/950). Find the common denominator of (a/(-132) - 4/22)/r and 85/4. 8 Let d = -217/15 + 5669/405. Calculate the common denominator of d and (-219)/81(-2)/(-6). 81 What is the common denominator of 71/134 and (51/48)/((-123)/(-328))? 402 What is the common denominator of (-45563)/5635 - -7(-2)/(-2) and 79/555? 3885 Find the common denominator of 93/8 and (12/(-50))/(5/((-5525)/8908)). 5240 Let v = 1/259874 - -18840799/17151684. What is the common denominator of v and ((-2129)/912)/(-1) + 18847/(-893) + 21? 528 Let p = -176229 - -85999833/488. Calculate the common denominator of -7/183 and p. 1464 What is the smallest common multiple of -2(77/(-14) - -7) - (-25 - 1) and 2? 46 Let g(f) = 3f2 + 4f + 5. Suppose -3a = -4x - 84, -4a + 62 = -396x + 399x. What is the smallest common multiple of a and g(-5)? 60 What is the common denominator of -31 + 37 + (-1504)/360 and -23/290? 2610 Let s(c) = -52c**2 - c + 1. Let x be s(3). Let u be x/(-40) + 1/4. Find the common denominator of (u/72)/((-1)/(-3)) and -151/18. 18 Let i be (0 - 1) + 4 - 246955/160. Let y = i - -	{ "pile_set_name": "DM Mathematics" }
be u(5). Suppose 4q = py - q - d, -4y + 23 = -3q. What is the units digit of y? 8 Let u(a) = -a*2. Let r be u(0). What is the units digit of (-1)/(r - (-3)/(-15))? 5 Let i = 409 - 182. What is the units digit of i? 7 Let i(g) = -g - 2. Let t be i(-3). Suppose t = a - 0a. What is the units digit of a? 1 Suppose -6 = -4z + 2. Suppose 2u = -5b + 51, -2u + 4u = -3b + 29. Suppose -b = -3q - z. What is the units digit of q? 3 Let h = 4 - 3. Let l be (-10)/h - 2 - 1. Let c = 19 + l. What is the units digit of c? 6 Suppose 13z = 11z + 52. Let n = z + -4. What is the units digit of n? 2 Let d = 75 - 50. What is the tens digit of d? 2 Let t(r) = r2 - 7r + 11. What is the units digit of t(6)? 5 Let i be -545/((-45)/6). Suppose -i = -b - b. What is the units digit of 14/b - 2/(-9)? 1 Suppose 0 = -0j + j + 2. Let d(x) = -21x + 2. What is the units digit of d(j)? 4 Suppose 5a - 17 = -4f, 0 = a + 3f - 0f - 10. What is the units digit of 6/a4/6? 4 Let o(x) = 5x2 + 6x - 2. Let g(k) = 9k2 + 11k - 3. Let v(u) = 3g(u) - 5o(u). Let s be v(-2). Suppose 29 = sf + 11. What is the units digit of f? 6 What is the tens digit of 24/(-36) + (-160)/(-6)? 2 Let x be ((-12)/(-18))/((-4)/534). Let c = 132 + x. What is the units digit of c? 3 What is the units digit of -14((-100)/(-8))/(-5)? 5 Suppose -55 = -s - 5f, -s - 5f + 90 = s. Suppose -3v + s = -31. What is the units digit of v? 2 Let b(d) = -2d3 + d2 - 2d + 2. Let n be b(2). Let s = n + 28. What is the units digit of s? 4 Let h = 56 + -28. Suppose 2u - h = -z, z - 2z = 4u - 18. What is the tens digit of (-1)/(3/(2 - z))? 1 Suppose l - 8 = 3l. Let g(f) = -2f + 1. What is the units digit of g(l)? 9 Let h be 1 - (2 - (2 + 2)). What is the units digit of h/(-2)20/(-3)? 0 Suppose -6j + 40 = -j. What is the units digit of (-25)/(-1) - j/4? 3 Suppose 0 = h - 10 + 3. Let p(q) = 2q2 - 8q - 1. What is the units digit of p(h)? 1 Let f(r) = 6r - 9. Let x(d) = 6d - 5. Let y(v) = -v + 1. Let m(a) = -x(a) - 5y(a). Let t(z) = f(z) + 4m(z). What is the units digit of t(8)? 7 Suppose l - 31 = 14. What is the tens digit of l? 4 Let l = 62 + -40. What is the tens digit of l? 2 Let x(p) = -3p3 - 3p*2 - p - 3. What is the units digit of x(-3)? 4 Suppose -k - 5k = -336. What is the tens digit of k? 5 Let t(l) be the first derivative of l*3/3 + 9l*2/2 + 12l + 6. What is the units digit of t(-11)? 4 Suppose -w = 2c + 3w + 22, 3w = -2c - 18. Let m(b) be the first derivative of -b*2/2 - 2b - 17. What is the units digit of m(c)? 1 Let a(o) = -2o3 + 4. Let l be a(3). What is the units digit of 4/(-6) + l/(-30)? 1 Suppose -3x = -9 - 6. Let a be 3/(-18)-3-4. Let b = x - a. What is the units digit of b? 7 What is the tens digit of 7/((-14)/(-102))(1 - 0)? 5 Let d(u) = u3 + 7u*2 - 10u + 8. What is the tens digit of d(-8)? 2 Let z be (-1 + 3)/(6/9). Let o(q) = q*3 + 7q - 3 - 5q + 5q*2 - zq. What is the units digit of o(-5)? 2 Let y = 39 - -3. What is the tens digit of y? 4 Let f = -11 + -47. Let y = f + 135. What is the units digit of (-26)/(-22) - 14/y? 1 Let o = 1 + 1. Suppose 5d - t + 33 = -3t, od - 2t + 2 = 0. Let s(h) = -h + 1. What is the units digit of s(d)? 6 Suppose 0 + 4 = h. What is the units digit of 2/(h/10 + 0)? 5 Suppose -3r = -a - 14, 3a + 7 = 3r - r. Let w = 17 + a. What is the tens digit of ((-66)/w)/(1/(-3))? 1 Suppose 11z + 498 = 14z. What is the units digit of z? 6 Let a be ((-6)/12)/(2/52). Let i = 9 + a. Let g = i - -12. What is the units digit of g? 8 Suppose -2y + 99 = -141. Suppose 0 = 4k, -2n + 0k - 5k + y = 0. Suppose 0d = 4d - n. What is the units digit of d? 5 Let b(t) = -t + 21. Let l be b(12). Suppose 3z - 30 - l = 0. What is the units digit of z? 3 Let v(n) = -4n + 1. Let b be ((-42)/(-12))/((-2)/(-4)). Let k(d) = -d + 6. Let r be k(b). What is the units digit of v(r)? 5 Suppose 3f = -6 + 27. Let r be 1(-2 + 0) + -3. Let t = f + r. What is the units digit of t? 2 Let o = -91 - -131. What is the units digit of o? 0 Let w(f) = f - 7f2 + 5 + 5f + 0 + f*3 + 0. Suppose 0 = -t - 5c - 0 - 4, t = -3c. What is the units digit of w(t)? 5 Let v(k) = -k3 + 5k*2 - 2k + 2. Suppose -3p - 10 = -22. Suppose -ph = h - 20. What is the units digit of v(h)? 0 Let j(t) = -t + 1. Let c be j(1). Suppose 7 = 4n - o - 20, c = -2o + 10. What is the units digit of n? 8 Suppose -3a = -3 - 0. What is the units digit of a? 1 Let r = -5 - -18. Let b(d) = 3d - 7. What is the units digit of b(r)? 2 Let z(p) = p*2 + 6p + 7. Suppose 2i - 20 = 6i. Let d be z(i). Suppose n = -d + 3. What is the units digit of n? 1 Let a(u) = 25u + 1. Let o be a(2). Let r = o - 31. Suppose -3m = 2m - r. What is the units digit of m? 4 Suppose -5b = -k - 203, 2b - k = 3b - 37. What is the units digit of b? 0 Suppose -30 = -5g - 10. Suppose gn - 16 = -4c, 5c = c - 20. What is the units digit of n? 9 Let s = 507 - 284. What is the hundreds digit of s? 2 Let g(q) = -q - 1. Let n be g(2). Let r be ((-12)/n)/((-2)/3). What is the units digit of 4/r - (-22)/6? 3 Let a(s) = s3 - s2 - 2s + 391. What is the units digit of a(0)? 1 Let r = -6 - -10. What is the units digit of 12/1010/r? 3 Let d = 34 - -5. What is the tens digit of d? 3 Let s = -115 - -195. Suppose 4q + s = 6q. What is the tens digit of q? 4 What is the units digit of (-3)/1 - 134/(-2)? 3 Let j = -9 + 20. What is the tens digit of j? 1 Let u(q) = q3 + 12q*2 - 13q + 12. Let n be u(-13). Suppose -2b - n = 4. Let y = b - -29. What is the units digit of y? 1 Let o(d) = -d3 - 9d*2 + 2d - 20. What is the tens digit of o(-10)? 6 Suppose -2n = -2 - 0. Suppose 20 = r - n. What is the units digit of r? 1 Suppose -h + 0 = 2, 2c = 5h + 14. Let u be -110(-3 + c). Suppose 4j = 6 + u. What is the units digit of j? 4 Let x(h) = -h*3 + 19h*2 - 11h + 26. Let i be x(18). Suppose 2s + 4o = 80, -5s - 2o = -4o - i. What is the tens digit of s? 3 Let p(c) = c3 + 9c*2 - 2c - 2. Let j be p(-9). Suppose 4v = 5v - j. What is the tens digit of v? 1 Let l(i) = -i*3 + 14i*2 + 2. Suppose b - 4 + 5 = 0, 4d - 4b - 60 = 0. What is the units digit of l(d)? 2 Suppose 2z + 142 = 4n - 0z, 3n = -z + 119. What is the tens digit of n? 3 Suppose -q - 4q = -165. What is the tens digit of q? 3 Let j(v) = -v*2 - 11v - 6. Let c = -35 - -25. Let m be j(c). Suppose 0 = 5y + n - 31, -my + 7y - 3n = 15. What is the units digit of y? 6 Let f(m) = -m*2 - 7m + 3. Let s be f(-7). Suppose 2d - sh = h + 4, d - 7 = -3h. Suppose 5q + 20 = db - 26, b = 3q + 15. What is the units digit of b? 9 Let k be (-1)/2 - (-54)/12. Suppose -3j + 5 + 4 = 0. Suppose -jl = 5f - 33, 4l - k - 6 = -f. What is the units digit of f? 6 Let d(v) be the second derivative of v*4/12 + 5v*3/6 + 3v. What is the units digit of d(-6)? 6 Suppose 14 = -5q - 21. Let j = q - -15. What is the units digit of j? 8 Let z(q) = -q + 1. Let u(m) = -5m + 11. Let f(w) = u(w) - 6z(w). What is the tens digit of f(7)? 1 Let h be 10/(-1 + 0). Let p be -5(h - (-2 - -3)). Suppose 5n - 3n + 2 = 4y, 0 = -3n - py + 19. What is the units digit of n? 3 Let c = 9 - 6. Suppose -5s + s = cp - 27, -2s - 2p = -16. Suppose -2d - sd + 2t = -46, d - 4t - 2 = 0. What is the tens digit of d? 1 Let u = 388 - 229. What is the tens digit of u? 5 Let v = -121 + 217. What is the units digit of v? 6 Let q be 82 + (-6)/6. Let r be 10 + 5/(q/6). Let c = 18 - r. What is the units digit of c? 6 Let u(h) = -h3 + h2 - h - 4. What is the tens digit of u(-3)? 3 Let j be (-1 - 3)(-10)/8. Let g be 5/(-25) + 106/j. Suppose 0z = -2z + m + g, 0 = 3z - 5m - 35. What is the tens digit of z? 1 Let s = -227 + 398. What is the units digit of s/(-3)(-1)/3? 9 Let x(j) = j2 + 5j + 5. Let c be x(-5). Suppose -4n = cs - 37, 3s - 3n - 5 = 1. Suppose -40 = -sl + l. What is the tens digit of l? 1 Suppose 3b + 22 = -5. Let z = -7 - b. What is the units digit of z? 2 Let a(c) = 3c. Let v be a(4). Let g be (-2 - -5)52/v. Suppose -4l - 25 = -3n + g, 3n - 2l = 46. What is the units digit of n? 8 Let d(r) = r + 3. Let f(u) = -u - 3. Let b(y) = 3d(y) + 2f(y). Let w be b(8). Suppose 5*n = 36 - w. What is the uni	{ "pile_set_name": "DM Mathematics" }
of a week in minutes? 36288 Convert 0.9193357 days to minutes. 1323.843408 How many months are there in 8.050082 centuries? 9660.0984 How many grams are there in 0.233676t? 233676 Convert 40.24073 nanograms to micrograms. 0.04024073 Convert 81893.88 millilitres to litres. 81.89388 What is 1/4 of a litre in millilitres? 250 Convert 75.11718 days to nanoseconds. 6490124352000000 How many milliseconds are there in 9.83363 minutes? 590017.8 Convert 896427.5kg to micrograms. 896427500000000 How many millilitres are there in 5/8 of a litre? 625 What is 901.6933 grams in nanograms? 901693300000 Convert 123176.457ms to days. 0.0014256534375 How many micrograms are there in 3/32 of a gram? 93750 What is thirteen fifths of a millennium in years? 2600 What is five eighths of a hour in seconds? 2250 How many millennia are there in 1212.504 centuries? 121.2504 What is 67.49239l in millilitres? 67492.39 Convert 0.8063627ml to litres. 0.0008063627 How many micrometers are there in 3/10 of a millimeter? 300 What is 3.995438g in tonnes? 0.000003995438 Convert 22913088.3 milliseconds to days. 0.26519778125 Convert 14796452.79 milliseconds to weeks. 0.024465034375 What is 88.78071ml in litres? 0.08878071 Convert 4824.099 centimeters to nanometers. 48240990000 What is one tenth of a kilogram in grams? 100 What is 816.3799 litres in millilitres? 816379.9 What is 58.6302cm in kilometers? 0.000586302 How many nanometers are there in 17/4 of a micrometer? 4250 Convert 468374.6cm to nanometers. 4683746000000 What is 1/10 of a millennium in months? 1200 How many hours are there in 29/2 of a day? 348 What is 3/32 of a week in minutes? 945 How many nanoseconds are there in 8/25 of a microsecond? 320 What is eighteen fifths of a litre in millilitres? 3600 What is twenty-one quarters of a litre in millilitres? 5250 How many years are there in 37856.64 months? 3154.72 Convert 746.2367 centuries to years. 74623.67 What is 8/25 of a millennium in months? 3840 What is 1/20 of a week in minutes? 504 How many grams are there in 0.2007323 nanograms? 0.0000000002007323 How many months are there in 0.8643597 decades? 103.723164 What is one twentieth of a meter in micrometers? 50000 What is 7/4 of a kilometer in meters? 1750 How many meters are there in 4754.098um? 0.004754098 What is 6/25 of a microsecond in nanoseconds? 240 Convert 297622.9l to millilitres. 297622900 What is 34.38567l in millilitres? 34385.67 What is eighty-one halves of a milligram in micrograms? 40500 How many centimeters are there in 622.3147m? 62231.47 What is 45.6582 decades in millennia? 0.456582 Convert 291262.6 weeks to milliseconds. 176155620480000 How many micrograms are there in 31/5 of a milligram? 6200 What is 3/8 of a litre in millilitres? 375 Convert 9887.014 centuries to years. 988701.4 Convert 8.062911 nanograms to tonnes. 0.000000000000008062911 How many nanograms are there in one quarter of a microgram? 250 How many kilograms are there in three fifths of a tonne? 600 How many kilograms are there in 504.3627t? 504362.7 What is fourty-seven quarters of a decade in months? 1410 What is 155.4391944 nanoseconds in weeks? 0.00000000000025700925 What is fourty-eight fifths of a kilometer in meters? 9600 Convert 0.0669954nm to millimeters. 0.0000000669954 How many millilitres are there in 3/10 of a litre? 300 How many millilitres are there in three fifths of a litre? 600 What is ten thirds of a hour in seconds? 12000 What is thirty-two fifths of a kilometer in meters? 6400 Convert 345.3605 millimeters to micrometers. 345360.5 What is 0.695km in micrometers? 695000000 Convert 2035.605ml to litres. 2.035605 What is 9444.677 milligrams in micrograms? 9444677 What is 15/4 of a century in months? 4500 Convert 0.7821939 litres to millilitres. 782.1939 What is 2.56493 kilograms in tonnes? 0.00256493 What is 25/2 of a century in years? 1250 What is 0.938132 decades in centuries? 0.0938132 Convert 21.632865ms to minutes. 0.00036054775 What is 3/8 of a gram in milligrams? 375 How many nanoseconds are there in 3/5 of a microsecond? 600 What is thirty-three fifths of a centimeter in micrometers? 66000 How many centuries are there in 67917.7 millennia? 679177 What is five quarters of a litre in millilitres? 1250 Convert 10441.074 months to years. 870.0895 Convert 3746.016 weeks to minutes. 37759841.28 How many millilitres are there in eleven quarters of a litre? 2750 How many centuries are there in 5.172924 millennia? 51.72924 What is 93.0831 years in centuries? 0.930831 What is 23827.99mm in meters? 23.82799 How many nanograms are there in 0.3184963 grams? 318496300 What is eighteen fifths of a microgram in nanograms? 3600 Convert 84.47727ml to litres. 0.08447727 How many millennia are there in 5.548446 months? 0.0004623705 Convert 22.925871 months to centuries. 0.0191048925 What is 4132.855 millennia in months? 49594260 How many millilitres are there in 2566.184l? 2566184 How many nanometers are there in 4528.593km? 4528593000000000 What is 7/2 of a kilogram in grams? 3500 What is 13004555.13ns in weeks? 0.000000021502240625 How many microseconds are there in 3/50 of a second? 60000 How many millilitres are there in 313.5093l? 313509.3 What is 7/4 of a litre in millilitres? 1750 What is 11/10 of a hour in seconds? 3960 What is one quarter of a century in years? 25 What is 3/50 of a litre in millilitres? 60 How many nanometers are there in 48/5 of a micrometer? 9600 Convert 0.9468173 meters to micrometers. 946817.3 How many seconds are there in fifty-one halves of a hour? 91800 Convert 75.19473us to hours. 0.000000020887425 How many grams are there in 3/32 of a tonne? 93750 What is 0.2460214ml in litres? 0.0002460214 What is 0.7411069 days in milliseconds? 64031636.16 How many millilitres are there in fifty-nine fifths of a litre? 11800 What is fourty-seven quarters of a day in hours? 282 How many weeks are there in 94180.695 hours? 560.599375 What is 7/8 of a microgram in nanograms? 875 What is 72.81143 decades in months? 8737.3716 What is fourty-seven quarters of a tonne in kilograms? 11750 How many months are there in 5/6 of a decade? 100 Convert 6.530743um to kilometers. 0.000000006530743 How many micrometers are there in 49/4 of a millimeter? 12250 What is three tenths of a kilogram in grams? 300 What is 27/5 of a decade in months? 648 Convert 7.62881g to milligrams. 7628.81 Convert 62161.65ml to litres. 62.16165 What is 1/10 of a millimeter in nanometers? 100000 How many months are there in one fifth of a century? 240 How many millilitres are there in 7/8 of a litre? 875 What is 873.1162 millennia in months? 10477394.4 How many litres are there in 42.07882ml? 0.04207882 What is 79943.02g in kilograms? 79.94302 Convert 735995.2 millilitres to litres. 735.9952 How many grams are there in 0.4707585 milligrams? 0.0004707585 How many kilograms are there in 76.8565 milligrams? 0.0000768565 How many millennia are there in 9.566001 years? 0.009566001 Convert 6499.136 days to seconds. 561525350.4 What is 14.16465l in millilitres? 14164.65 How many kilograms are there in 7.39421g? 0.00739421 Convert 0.8590818l to millilitres. 859.0818 What is six fifths of a litre in millilitres? 1200 Convert 31.8981ml to litres. 0.0318981 How many millennia are there in 0.18523 decades? 0.0018523 What is 27/2 of a litre in millilitres? 13500 How many micrometers are there in 25/4 of a millimeter? 6250 How many millilitres are there in 0.8487154l? 848.7154 How many centimeters are there in 1/5 of a kilometer? 20000 Convert 786808.1 days to seconds. 67980219840 Convert 0.9493422 nanoseconds to minutes. 0.00000000001582237 What is 4.912035 hours in nanoseconds? 17683326000000 Convert 0.0920948 nanoseconds to microseconds. 0.0000920948 Convert 5730.278 micrometers to centimeters. 0.5730278 What is 1/64 of a kilometer in millimeters? 15625 What is seventeen halves of a millennium in decades? 850 Convert 74.98771 litres to millilitres. 74987.71 How many millilitres are there in thirteen quarters of a litre? 3250 What is thirteen quarters of a milligram in micrograms? 3250 What is 33/5 of a kilogram in grams? 6600 Convert 882842.9 meters to centimeters. 88284290 How many millilitres are there in sixty-four fifths of a litre? 12800 Conv	{ "pile_set_name": "DM Mathematics" }
e 5) to base 10 -1744 What is -58e (base 15) in base 16? -4eb Convert 33111 (base 6) to base 12. 2797 What is 16695 (base 10) in base 3? 211220100 Convert 655 (base 13) to base 14. 576 What is -41916 (base 10) in base 12? -20310 What is -2051 (base 6) in base 4? -13033 423a (base 12) to base 13 33b5 1100011001 (base 3) to base 7 136555 1002221 (base 3) to base 9 1087 What is 2522a (base 12) in base 5? 3103214 What is -9898 (base 11) in base 3? -122220111 Convert -1230322 (base 4) to base 15. -20ea What is 2a30 (base 13) in base 9? 8353 b18 (base 12) to base 2 11001000100 Convert 3f35 (base 16) to base 15. 4bdb -114175 (base 9) to base 3 -10111012112 Convert ca4 (base 14) to base 15. b16 What is 1032013 (base 5) in base 3? 220100201 What is 340422 (base 5) in base 16? 2ed3 -56a8 (base 14) to base 11 -10337 What is 121544 (base 8) in base 2? 1010001101100100 -816f (base 16) to base 15 -9c40 1c3 (base 16) to base 4 13003 What is 5674 (base 12) in base 9? 14137 Convert 187 (base 13) to base 3. 101101 Convert 3eb (base 15) to base 11. 745 25403 (base 7) to base 10 6716 Convert -111 (base 4) to base 8. -25 Convert 93 (base 11) to base 10. 102 1acab (base 14) to base 13 25165 What is -1002101 (base 3) in base 6? -3401 1403 (base 9) to base 10 1056 What is 11310031 (base 4) in base 11? 16996 What is -32 (base 4) in base 16? -e 12b (base 14) to base 3 22201 1118 (base 9) to base 5 11302 What is -67 (base 15) in base 11? -89 Convert -5ba (base 16) to base 6. -10442 What is 37d9 (base 16) in base 12? 8335 What is -14211 (base 6) in base 4? -202333 What is 3121213 (base 5) in base 15? 1038d What is -624a (base 12) in base 10? -10714 Convert 22 (base 15) to base 8. 40 Convert 658 (base 13) to base 10. 1087 What is 503 (base 13) in base 8? 1520 Convert -1600 (base 14) to base 10. -3920 What is 22003 (base 4) in base 13? 3a6 Convert 54504 (base 7) to base 11. a268 Convert 1000101111010 (base 2) to base 15. 14d4 Convert 7378 (base 9) to base 7. 21536 What is -33331 (base 4) in base 3? -1101211 Convert -199 (base 16) to base 15. -1c4 Convert -3112023 (base 4) to base 14. -4dd1 What is -1951 (base 10) in base 12? -1167 Convert -272 (base 14) to base 15. -22c What is 1a2 (base 12) in base 4? 10022 What is 30102 (base 9) in base 4? 10310312 27136 (base 11) to base 2 1001011101100111 -4b60 (base 12) to base 15 -2813 What is 2098 (base 11) in base 13? 1350 -10221211 (base 3) to base 12 -1804 What is 1513 (base 10) in base 15? 6ad 223231 (base 4) to base 2 101011101101 Convert 14404 (base 5) to base 8. 2315 -21bc (base 14) to base 7 -23025 -f3e (base 16) to base 9 -5315 Convert 35100 (base 8) to base 12. 8768 Convert 11323 (base 7) to base 13. 1429 What is 1100020000 (base 3) in base 4? 12130212 200 (base 13) to base 10 338 Convert -231333 (base 4) to base 14. -1103 756 (base 12) to base 2 10000110010 55660 (base 7) to base 12 8174 Convert 370 (base 8) to base 11. 206 Convert 206 (base 14) to base 2. 110001110 What is -40 (base 6) in base 16? -18 Convert 10113 (base 5) to base 16. 292 10d07 (base 15) to base 9 81417 Convert 22210323 (base 4) to base 9. 65376 -443150 (base 6) to base 2 -1001000010001010 Convert -a141 (base 16) to base 14. -11089 What is -2227 (base 10) in base 12? -1357 Convert -110111010000000 (base 2) to base 10. -28288 Convert 912 (base 14) to base 12. 1044 4226 (base 8) to base 16 896 Convert 34123 (base 9) to base 10. 22701 What is -111021 (base 3) in base 12? -25a 10730 (base 10) to base 9 15642 c191 (base 14) to base 16 81e3 What is 14242 (base 7) in base 4? 330331 What is b83 (base 16) in base 5? 43242 Convert -215 (base 6) to base 3. -10002 Convert -5336 (base 7) to base 13. -b24 -3731 (base 14) to base 4 -2112233 -14968 (base 10) to base 16 -3a78 6a75 (base 15) to base 9 34012 Convert 1121303 (base 4) to base 16. 1673 64 (base 13) to base 11 75 What is -11010120 (base 3) in base 14? -1152 What is 1722b (base 15) in base 11? 51177 12141 (base 5) to base 13 55b What is -112b (base 12) in base 15? -872 Convert 1163 (base 12) to base 6. 13003 1110102020 (base 3) to base 11 1a652 100200313 (base 4) to base 6 1241051 What is -130a (base 15) in base 12? -2424 What is -2041 (base 10) in base 3? -2210121 What is -10222 (base 7) in base 10? -2515 What is 613 (base 14) in base 12? 835 Convert -1021222 (base 3) to base 14. -4b6 What is -11033103 (base 4) in base 12? -10503 Convert 341 (base 5) to base 11. 88 -650b (base 12) to base 3 -120020002 Convert 24585 (base 9) to base 6. 204252 Convert -100211 (base 4) to base 16. -425 What is 28a3 (base 16) in base 9? 15238 2660 (base 10) to base 14 d80 What is -45434 (base 6) in base 8? -14436 Convert -3256 (base 7) to base 10. -1168 -530 (base 10) to base 3 -201122 Convert -2722 (base 14) to base 12. -3ba2 What is 3111 (base 4) in base 16? d5 -1001100220 (base 3) to base 7 -114201 112021 (base 5) to base 10 4011 What is -2558 (base 14) in base 6? -50150 What is 23111 (base 4) in base 12? 505 What is a93 (base 13) in base 14? 934 1289 (base 10) to base 12 8b5 13fc6 (base 16) to base 7 460444 What is -48b3 (base 15) in base 16? -3c6c Convert 1120121 (base 3) to base 10. 1150 Convert -4d66 (base 15) to base 5. -1012041 -50200 (base 6) to base 2 -1100110011000 Convert 49bd (base 15) to base 3. 210112121 -244522 (base 6) to base 9 -32805 -24005 (base 6) to base 3 -11202012 1038 (base 13) to base 12 1370 -322a (base 13) to base 6 -52125 What is 10342 (base 6) in base 9? 1858 Convert -442 (base 7) to base 15. -101 -182a7 (base 12) to base 8 -104237 Convert -101003 (base 5) to base 3. -11110111 -5775 (base 10) to base 13 -2823 -15045 (base 7) to base 6 -31113 Convert -2d52 (base 15) to base 3. -111101012 What is 3222 (base 4) in base 6? 1030 -211110222 (base 3) to base 8 -40004 42640 (base 9) to base 15 8569 2434 (base 13) to base 2 1001111111001 -233202 (base 4) to base 15 -d7c -157 (base 13) to base 10 -241 Convert -313303 (base 6) to base 3. -1021211010 Convert -24213 (base 5) to base 15. -808 What is -1110000001 (base 2) in base 3? -1020020 What is 1020120 (base 3) in base 12? 636 What is 534 (base 15) in base 7? 3265 What is -2373 (base 8) in base 11? -a5a What is d0 (base 14) in base 4? 2312 Convert 45c (base 15) to base 14. 507 What is -2132 (base 5) in base 9? -354 What is -82c6 (base 13) in base 12? -a564 35b4 (base 14) to base 2 10010010011010 What is -280a (base 11) in base 6? -24504 Convert 1109 (base 10) to base 4. 101111 -14530 (base 9) to base 6 -113513 -8893 (base 11) to base 2 -10110111000110 What is 723 (base 11) in base 10? 872 -4f (base 16) to base 2 -1001111 What is 30322 (base 5) in base 14? a02 -7733 (base 15) to base 11 -17a73 What is -12b2 (base 15) in base 9? -5425 What is -10000110101110 (base 2) in base 10? -8622 What is -302001 (base 4) in base 12? -1a29 What is 3231 (base 7) in base 2? 10001111101 What is -2463 (base 16) in base 15? -2b60 Convert 3111020 (base 4) to base 2. 11010101001000 17178 (base 9) to base 8 27050 Convert 2032 (base 10) to base 16. 7f0 d3 (base 15) to base 8 306 Convert 432 (base 9) to base 15. 188 Convert -35211 (base 6) to base 16. -13b7 863 (base 15) to base 14 993 What is 2486 (base 16) in base 7? 36155 What is -4c6 (base 13) in base 8? -1506 Convert 32 (base 15) to base 11. 43 -250 (base 14) to base 4 -13032 2105 (base 10) to base 9 2788 -23635 (base 10) to base 9 -35371 57 (base 12) to base 11 61 Convert 184 (base 9) to base 11. 133 Convert 88a6 (base 13) to base 3. 222011002 What is -221111 (base 3) in base 14? -372 What is -3223 (base 5) in base 6? -2010 Convert -3c9 (base 15) to base 5. -11424 What is -10110 (base 6) in base 10? -1338 -3007 (base 14) to base 4 -2000233 What is -86 (base 16) in base 4? -2012 Convert 12376 (base 11) to base 4. 10111111 Convert 114 (base 8) to base 2. 1001100 692 (base 13) to base 11 940 What is 1130201 (base 4) in base 2? 1011100100001 -32359 (base 10) to base 4 -13321213 -4073 (base 8) to base 7 -6100 Convert -19aa1 (base 12) to base 3. -1220220211 -210212 (base 4) to base 7 -6554 Convert 8c9a (base 14) to base 3. 1020112012 144304 (base 5) to base 9 8453 -20042 (base 8) to base 16 -2022 What is -222212 (base 3) in base 2? -1011010101 3547 (base 13) to base 7 30565 Convert -10235 (base 7) to base 9. -3415 What is 7399 (	{ "pile_set_name": "DM Mathematics" }
-24 - 6w2 - 3w*2 + 40 + 2w*3 in the form pw + uw3 + y + qw*2 and give y. 16 Express -2z*2 + 2z2 - z2 - 2z2 - 5z*2 + 3z*2 + (-3z + 4z + 0z)(2 - z - 2) - 30z - 6z2 + 30z in the form xz + w + tz*2 and give t. -12 Rearrange 10 - 22 - 94l*2 - l + l + 11 to the form d + jl + tl2 and give d. -1 Rearrange -d + 12d4 + d3 - 1 + 14d2 - 15d*2 - d - 1 to the form cd + vd3 + p + yd*4 + jd*2 and give p. -2 Express (-3t*4 + 3t4 - t4)(-2 + 3 + 0) + (4t*2 - 3t*2 + 0t*2)(3t2 - t2 - 3t*2) as dt*4 + it*3 + ut + pt2 + j and give d. -2 Express -2w*3 + 0w*3 - 2w*2 - 3w*3 + 3w*2 + 57 - 63 in the form jw*3 + n + vw + rw2 and give n. -6 Express 62r - 26r3 + 130r*3 + 14r*3 - 65r as jr + s + xr*3 + pr*2 and give x. 118 Express (81 - 81 - 32m)(22m - 34 + 34 + (0 + 3 - 4)(2 + m - 2) - m + m + 2m) in the form y + wm2 + xm and give w. -736 Rearrange -u*4 + 6 + 0 - 3u*4 + 11 + 9u - 11 to lu3 + w + fu*4 + pu*2 + nu and give n. 9 Express -2d2 - 99 + 102 + d + 2d*3 + 4d*2 - 6d*3 as h + td + yd2 + qd*3 and give t. 1 Express 20p + 35p - 179p - 2p2 + 2 as kp*2 + q + ip and give k. -2 Express -2a - 8a*2 + 57 + 75 - 132 in the form ma*2 + ta + f and give t. -2 Express ((n - 5n + 2n)(-n - n + 3n) - 2n + 2n + 9n2)(7 + 1 + 3) as mn2 + un + x and give m. 77 Express 11p + p2 + 15p*3 + 1 - 3p2 + p2 + p*2 as hp*2 + m + jp*3 + xp and give m. 1 Rearrange a - 36a2 - 3a*4 + 4a*3 - 35a*2 + 74a*2 to the form ia*4 + na + p + ma3 + ja*2 and give n. 1 Rearrange ((m - 5 + 5)(0m + 7m - m) + 3m2 + 4 - 4)(-m - 3m + 2m) + 19 + 3m3 - 19 to the form rm*2 + sm*3 + qm + t and give s. -15 Rearrange -9z3 - 32z*3 - 5z*4 + 2 - 2192z*2 + 2196z*2 + 8z*4 to the form hz + mz4 + dz*3 + y + sz*2 and give d. -41 Express 6 + 146s*2 - s + 2s*4 - 3s*3 - 147s*2 + 4s*3 + 3s in the form bs2 + xs + zs4 + v + as*3 and give v. 6 Express (-4 + 0 + 5 + (6 - 1 - 3)(-2 + 3 - 3) + 1 + 2 - 5 + 27 + 93 + 27)(s3 + 0s + 0s) as ds + ms2 + y + hs*3 and give h. 142 Express 11 + 20 + 2q - 4q - 32 - 96q*3 in the form cq + v + tq2 + wq*3 and give v. -1 Express -9 - 16 - 55u + 60u - 11 + 23 as p + hu and give h. 5 Express 10x + 16x + 0x + 45x as qx + f and give q. 71 Rearrange (-4j - 3j - 4j)(-2 + 1 - 5)(-27j + 7j + 3 + 6j) to bj*2 + pj + m and give p. 198 Express 8j2 + 503j*3 + 16j*2 - 2 - 24j*2 as oj + s + pj3 + qj*2 and give s. -2 Rearrange 65n*3 - 36n*3 + 4n*2 - 28n*3 + 11n to pn3 + y + dn*2 + ln and give p. 1 Express -11v2 + 10 + v3 + v + 10v*2 - 11 in the form uv + jv2 + o + gv*3 and give o. -1 Express (-23 + 2k + 48 - 28)(-3k - 2k + 0k) in the form mk2 + b + dk and give m. -10 Express (-2b + 2 - 2)(3 - 5 - 4)(-1 + 2 - 6 + 1 + 0 - 2 + (-3 - 2 + 4)(3 - 6 + 2)) in the form i + mb and give m. -60 Rearrange -539r*2 + 2 - 2r - 31r3 + 2r + 539r2 to the form s + jr*3 + yr + zr2 and give s. 2 Rearrange 8a*2 - 12a*2 + 43 - 60 + 2a*2 - 59 to the form m + fa*2 + ra and give f. -2 Express -17t2 + 67t*2 - 16t*2 + 5t*3 - 17t*2 + 1 - 16t*2 in the form z + gt*3 + ht*2 + at and give a. 0 Rearrange 238 + 7j - 238 - 7j*2 - j to tj + xj2 + n and give t. 6 Express 66z + 4 - 4 + 5 - 2 - 3z in the form j + lz and give l. 63 Rearrange (-a*2 - 3a*2 - 12a*2)(6a2 - 9a*2 - 5a*2) to ka*3 + ra + pa2 + v + da*4 and give p. 0 Rearrange -165r*2 - 32r*4 - 2r + 5r + 11r*4 - r + 17r*4 to the form pr*3 + mr + gr2 + ir*4 + t and give g. -165 Express -45u - 60u - 19u as pu + w and give p. -124 Express 51 + 200o*2 - 201o*2 - o - 14 + 2o as v + do + zo*2 and give d. 1 Express (-3h*2 + 3h*2 - 2h*2)((4 - 2 - 3)(2h - 3h + 3h) + 64 - 22h - 64) in the form lh*3 + sh + o + uh2 and give l. 48 Express 21214m + 38m2 - 2 - 10606m - 2m3 - 10610m in the form ym + bm*2 + o + nm*3 and give o. -2 Rearrange -5w - 3w + 5w*2 - 4w*2 - 2w*2 + 2 to the form qw + tw2 + p and give q. -8 Rearrange -5d - 1243d + 306d to the form w + ad and give w. 0 Express (-13n*2 + 5 - 4 - 69n*2)(3n2 + 2n*2 - 3n*2) in the form on + ln4 + y + dn*3 + kn*2 and give k. 2 Rearrange -14 - 16 + 7 + l + 7 - 20 to the form ml + i and give i. -36 Express -18x3 + 3x*4 + 19x*3 - 7x*3 - 6x*2 as cx*3 + m + bx*4 + ox + wx2 and give w. -6 Rearrange 6v*3 + 77 - 4v*3 + 75 - 150 - 3v*2 - v to cv + jv3 + l + xv*2 and give c. -1 Express -126s*3 + 252s*3 - 132s3 - s4 - 6s as u + cs*2 + ts*4 + fs*3 + os and give t. -1 Rearrange -155j + 1 - 148j + 362j - 1 to s + pj and give p. 59 Rearrange (2y - 88 + 88)(37 - 55 - 29) + 0 + 0 - 2y to j + iy and give i. -96 Rearrange 1470j3 + 3j*4 - 2j2 + j4 + 21j - 1472j*3 - 7j*4 to kj + u + xj3 + lj*4 + mj2 and give x. -2 Rearrange (-g2 - 3g2 + 2g*2)(g + g*2 - g) + 238g - 199g - 751g*4 + 752g*4 to ug*2 + ng*3 + t + ag + fg4 and give a. 39 Rearrange (-5 + 3 + 3)(23j - 10 + 6 + 1 + (-3 + 1 + 1)(-2j - j + 2j) + 4j - 2j + 0j) - 1 - 6j + 1 to the form yj + h and give h. -3 Express -25w - 20w + w + 18w - 2w2 in the form rw*2 + q + xw and give x. -26 Express -21r + 231r + 47r + 4 - 4 - r + (-4 + 2 + 0)(-r - r + 4r) as zr + d and give z. 252 Express (-1515t - 130t*2 - 132t*2 + 260t*2)(-1 + 1 + 2t) as pt*2 + at + g + ht3 and give p. -3030 Rearrange 12x*2 - 10x - 21x2 - x4 + 11x*2 - 2x*4 + 2x*4 + 2 to rx*3 + j + ux*4 + ox + kx2 and give j. 2 Express (34h*2 - 18h*2 + 34h*2)(0h2 - 5h*2 + 4h*2) - 19h*2 + 19h*2 - 1 + 7h*4 in the form dh*2 + mh*3 + rh + i + ph4 and give p. -43 Express (-237k + 13 - k*2 + 237k)(0k*2 - 8k*2 + 2k*2) + (-4 + 2k + 4)(-2k*3 + 3k3 + k3) as ok3 + wk*2 + dk*4 + xk + a and give w. -78 Rearrange (-776 + 146 - 577 + 38)(j2 - 4j*2 + 4j*2) to the form ij + t + bj2 and give i. 0 Express -2d*4 + 2d*3 - 192d*2 + 12d*3 + 195d*2 + 2 - 4d*3 in the form a + nd + jd4 + hd*2 + fd*3 and give j. -2 Rearrange 57a*4 - 31a*4 + 3a*3 + 46a*2 - 29a*4 + (-2a + 2a - a3)(2a + a - a) to na + ya4 + w + fa*3 + ga*2 and give g. 46 Rearrange 46f - 52f + 101f to kf + d and give k. 95 Rearrange -3z*4 - 3z*4 - 3 - 3z*3 + 0z*4 - 2z*4 to the form rz*2 + az*3 + tz*4 + nz + v and give r. 0 Rearrange (0g + 6g + g)(-1 + 3 + 1)(-31 - 29 + 60 + 213g) to the form fg + n + cg2 and give c. 4473 Express (6 + 6 + 6)(-2k - 5 + 5)(-4 + 3 + 8) in the form p + ok and give o. -252 Express -5b*2 - 2b*3 + b + 3b*4 - 7b*2 + 10b*2 - 5b*4 in the form i + vb*4 + hb*3 + lb*2 + ab and give a. 1 Rearrange 2254q + 4 - 3 + 3q*2 - 2252q to the form lq + sq*2 + t and give t. 1 Rearrange (-2 - 3 + 3 + 2a)(-2 - a - 6 + 5) to va + o + xa2 and give x. -2 Express 7 + 26 + 14 - 14 + 2k*3 as jk + ak2 + o + rk*3 and give a. 0 Express 102 - 12h + 13 - 10 - 31h + 40h as sh + g and give g. 105 Rearrange 4c4 - c4 - 2c4 + (5 + 3c - 5)(-22c + 22c - 6c*3) - 3c2 - c4 + 3c2 to the form nc*3 + pc*2 + i + dc + uc4 and give u. -18 Rearrange (0y + y - 4y)(-4 + 0 + 6)(2y + 0y - 3y) to the form h + ky2 + by and give b. 0 Rearrange -67f - 33f - 75f + 2f to xf + g and give x. -173 Express 18c*2 - 17c*2 + 184c - 96c + 1 - 11c*3 - 87c in the form t + yc2 + jc*3 + zc and give y. 1 Rearrange (22 - 22 + m)(-m2 + m2 - 2m*3) - 40m*3 + 10m3 + m4 + 19m3 to the form qm*3 + b + jm*2 + om*4 + sm and give o. -1 Rearrange (-171 - 169 - 310 - 2034 - 457)(-3w - 4w + 5w) to q + kw and give k. 6282 Express -21 + 20 + 865n - 50 - 895n as f + vn and give f. -51 Rearrange -9m3 + 0m*3 + 1 - 4m*3 + (-m - 2m + 4m)(-m + m - m*2) to ym*2 + fm*3 + cm + l and give f. -14 Rearrange 37k - 464k*2 - 39k + 457k	{ "pile_set_name": "DM Mathematics" }
76 What is the common denominator of 46/245037 and 31/23072? 54888288 Calculate the smallest common multiple of 208845 and 496314. 42186690 Calculate the common denominator of -71/35776 and -7/4584320. 197125760 Calculate the lowest common multiple of 1170 and 4333500. 56335500 Calculate the common denominator of -75/7984 and 75/136022. 542999824 Find the common denominator of -129/546650 and 81/3498560. 17492800 What is the smallest common multiple of 726117 and 261519? 129974943 Calculate the smallest common multiple of 985230 and 6896610. 6896610 Calculate the least common multiple of 291950070 and 175170042. 875850210 Calculate the smallest common multiple of 126960 and 40690680. 81381360 What is the least common multiple of 33000336 and 40? 165001680 Calculate the common denominator of 103/270384 and 17/28638. 30012624 What is the least common multiple of 11 and 133474? 133474 Calculate the least common multiple of 2027866 and 3. 6083598 What is the lowest common multiple of 33 and 1312335? 14435685 Calculate the common denominator of -73/8442 and 111/1909768. 17187912 Find the common denominator of 25/100277 and 47/34717. 23364541 What is the smallest common multiple of 752 and 436348? 1745392 Calculate the smallest common multiple of 1186383 and 539265. 5931915 Calculate the common denominator of 131/94272 and 23/7274656. 43647936 Calculate the smallest common multiple of 63 and 434217. 1302651 What is the common denominator of 25/2134 and -169/3894? 377718 What is the least common multiple of 2314465 and 85? 2314465 What is the least common multiple of 1567785 and 1215721? 346480485 What is the smallest common multiple of 5171584 and 1454508? 46544256 What is the smallest common multiple of 6449408 and 4130? 32247040 Calculate the lowest common multiple of 59079009 and 316878321. 3485661531 What is the common denominator of -99/3296482 and -31/10332? 59336676 What is the lowest common multiple of 21999104 and 515604? 65997312 Calculate the lowest common multiple of 20052 and 4352. 21816576 Calculate the common denominator of -53/19855737 and 37/6618579. 19855737 Calculate the smallest common multiple of 16 and 15715980. 62863920 Find the common denominator of -1/110483 and 89/272085. 18229695 Find the common denominator of 53/3762792 and -32/2351745. 18813960 Calculate the lowest common multiple of 869728 and 3044048. 6088096 Calculate the common denominator of 37/5028361 and -27/18824. 40226888 What is the least common multiple of 771640 and 10802960? 10802960 Calculate the common denominator of -131/3012 and 65/4738. 7135428 Calculate the lowest common multiple of 154 and 4982652. 383664204 What is the smallest common multiple of 156080 and 15139760? 15139760 What is the least common multiple of 738756 and 84? 5171292 What is the lowest common multiple of 2611518 and 4536? 282043944 What is the least common multiple of 72 and 4794? 57528 What is the least common multiple of 335868 and 27? 3022812 What is the least common multiple of 4685562 and 4016196? 28113372 What is the lowest common multiple of 10 and 2444205? 4888410 What is the common denominator of -29/271827488 and -7/101935308? 815482464 Calculate the least common multiple of 41225765 and 683536. 659612240 What is the common denominator of 25/48 and -139/1164924? 4659696 What is the least common multiple of 110 and 1081263? 118938930 Calculate the smallest common multiple of 128 and 1626816. 3253632 Find the common denominator of 62/633093 and -47/11085. 2339278635 What is the lowest common multiple of 4212864 and 37398? 1141686144 What is the least common multiple of 64673332 and 20? 323366660 What is the common denominator of 143/1026186 and 59/25361454? 177530178 What is the least common multiple of 56 and 3192952? 3192952 Calculate the lowest common multiple of 9832226 and 4867022. 3411782422 What is the least common multiple of 182574 and 15397074? 46191222 What is the smallest common multiple of 5541056 and 64? 5541056 Calculate the smallest common multiple of 710622 and 72039. 41926698 What is the lowest common multiple of 16884540 and 228? 16884540 What is the least common multiple of 2130525 and 1657075? 14913675 Calculate the common denominator of 49/680 and -11/1992808. 9964040 What is the least common multiple of 105541216 and 7100? 2638530400 Find the common denominator of 31/12 and 1/2114804. 6344412 Calculate the common denominator of 56/26560885 and 53/650. 265608850 What is the least common multiple of 62342 and 209546? 6531758366 Calculate the lowest common multiple of 2189055 and 132. 8756220 Calculate the common denominator of -109/18 and 25/68463363. 410780178 Calculate the common denominator of 27/322712 and -14/2813. 31303064 Find the common denominator of -89/12210492 and 1/47097612. 329683284 Find the common denominator of -55/23708151 and -31/1179510. 237081510 Calculate the smallest common multiple of 678 and 1662898. 563722422 Find the common denominator of -37/85475670 and -13/7174965. 1965940410 Calculate the common denominator of -53/233810 and 19/28840. 6546680 Calculate the least common multiple of 666858 and 444572. 1333716 Calculate the least common multiple of 107968 and 21566608. 86266432 What is the lowest common multiple of 6392828 and 952? 1521493064 Find the common denominator of -40/489879 and -11/7021599. 21064797 What is the common denominator of -18/9245 and -64/39775? 1710325 Calculate the common denominator of -89/529000 and 71/40. 529000 Calculate the common denominator of -37/80 and 67/117918. 4716720 Calculate the common denominator of 49/164109080 and 67/3620. 164109080 What is the smallest common multiple of 187 and 30899? 525283 What is the common denominator of -64/16769085 and -19/21? 117383595 What is the smallest common multiple of 3 and 94013721? 94013721 Find the common denominator of -43/242220 and 115/636. 12837660 Find the common denominator of -193/12159378 and 47/252153. 109434402 What is the smallest common multiple of 7936400 and 1587280? 7936400 What is the common denominator of 71/998322 and -59/575955? 14974830 Find the common denominator of -155/1632 and 37/134645712. 269291424 What is the lowest common multiple of 392 and 110691? 885528 Calculate the lowest common multiple of 16820520 and 10. 16820520 What is the lowest common multiple of 3360 and 408147936? 2040739680 Calculate the common denominator of -29/21840 and 48/325. 109200 What is the smallest common multiple of 648 and 9156? 494424 Calculate the common denominator of 47/12 and 97/117233648. 351700944 Find the common denominator of 133/733752 and 70/711. 733752 What is the smallest common multiple of 3560 and 660780? 117618840 What is the smallest common multiple of 11527 and 2939385? 2939385 Find the common denominator of 8/28971 and -85/22929048. 664942392 What is the smallest common multiple of 179392200 and 170040? 179392200 Find the common denominator of 53/5472 and 149/69720. 15896160 What is the common denominator of 37/330 and -1/2822490? 2822490 What is the smallest common multiple of 189 and 4549377? 40944393 Calculate the lowest common multiple of 1189 and 1738318. 1738318 Calculate the lowest common multiple of 3378308 and 7601193. 30404772 What is the smallest common multiple of 81012 and 61458? 829805916 What is the smallest common multiple of 7152 and 109212? 65090352 Find the common denominator of 85/2381596 and 37/1078. 26197556 Find the common denominator of -1/34380 and 67/300. 171900 Calculate the smallest common multiple of 9709 and 166047. 230307189 What is the lowest common multiple of 237352 and 83132538? 332530152 Calculate the common denominator of -31/1611771 and -40/639. 4835313 What is the common denominator of 163/3960 and 97/14189520? 468254160 Calculate the common denominator of 1/20110 and 19/80440. 80440 Calculate the common denominator of -107/492 and -49/42302775. 169211100 Find the common denominator of -11/30576 and -61/109746. 6145776 Calculate the common denominator of 145/1861164 and 86/5643. 20472804 What is the smallest common multiple of 2388 and 24037608? 24037608 What is the common denominator of 131/70 and -52/3351397? 33513970 Calculate the common denominator of 99/206825650 and 51/14338. 206	{ "pile_set_name": "DM Mathematics" }
-2. Let c be (-534)/(-27) - (-2)/d. Suppose -c = g - 5g. Solve -3p + 2x = -17, gp + 0p - x - 26 = 0 for p. 5 Let n(b) = -b2 + 7. Let t be n(-3). Let q(x) = -2x*3 - 2x*2 - x - 2. Let j be q(t). Solve -3w + 9 = 0, -jp - w = -3p + 17 for p. -4 Suppose -17h = -22h + 65. Suppose 125 = hs - 18. Solve -4y = -b - s + 2, b = -y + 1 for y. 2 Suppose -5y = -4b - 21, -y + 8b - 12b = -9. Solve 2 - 19 = 3k + 2f, -k = -2f - y for k. -3 Let j(t) = t3 + 22t*2 + 21t + 2. Let l be j(-21). Solve 0 = -lz + 3k - 12, 5z = -k - 2k - 9 for z. -3 Let o be (12/10 - 0)455/182. Solve -on + 6 = h, -h + 6n - 4n + 1 = 0 for h. 3 Let a(t) = t*2 - 6t - 50. Let c be a(11). Solve -40 = cl - 2z + 5z, -4z = -2l + 10 for l. -5 Suppose 30 = 113p - 103p. Solve 4m - 3n + p = -0, -3m - 3n = -24 for m. 3 Let o = -31 - -61. Let r be (-63)/42 - o/(-4). Solve -1 + r = -i + 5z, 10 = -2i - 5z for i. -5 Suppose -2s + 11 = 3. Suppose -4t - s = -12. Solve td - 18 = 3f, 0f + 10 = 2d - f for d. 3 Suppose 4t = j + 9, -j + 4 = 2t - 5. Solve -4h + 7 = -a, -a = -2h - 0a + t for h. 2 Suppose -22u - 106 = -75u. Solve t = -5, -6m + um + 25 = -t for m. 5 Suppose 24r = 91 + 77. Solve r = 4g + 2y - 11, 2g = y + 7 for g. 4 Suppose 0 = -47v + 51v + 136. Let w = v + 39. Solve -q - ws + 23 = 0, -3q - 4s + 19 = s for q. -2 Suppose 0 = -4q + 6q - 10. Suppose 0 = -t + 2w + w - 1, t = 4w - 6. Suppose -n = -0 - t. Solve 3r + i = 5i - n, -4r - 17 = -qi for r. 2 Suppose -5f - z + 2 = 0, 5f - 2f - 6 = z. Solve -5x + 5d = 21 - 56, -x - f = d for x. 3 Suppose -78h - 15 = -83h. Solve -ha - 5y = 22, -4 = y + y for a. -4 Suppose n = -0 + 5. Suppose 0 = -5j - 0j - 220. Let b = -42 - j. Solve n = 5m - 5u, -2m + 3u = bu - 2 for m. 1 Let y(q) = q*3 - 7q*2 + 2q - 9. Let j be y(7). Suppose -5i + d - 3 = -6i, i - d = j. Solve -5a = -m - 8, -8 = -ia - 0 for m. 2 Let q(c) = -c*3 - 15c*2 - 13c + 19. Let w be q(-14). Suppose -y = wi - 76 - 3, -i = 4y - 12. Solve 0 = -3h - 2o + i - 4, 0 = h - o - 4 for h. 4 Suppose -13u + 2 = -12u. Suppose 0 = -4r + ur + 2m, -4m = 4r. Solve r = -4h - s + 14, -3h = 2h - 4s - 28 for h. 4 Suppose t - 2y - 3y - 14 = 0, t + 5y + 6 = 0. Suppose -2k = -7k + 85. Solve -4z + 3z - tq + k = 0, 0 = -4z + 2q + 14 for z. 5 Let c = -42 + 78. Let d be 2/8 + 135/c. Solve g + 1 = 2i + 6, 0 = -4i - d for g. 3 Suppose -2p + 3h = -16, 39p - 36p = -3h + 9. Suppose 2a - a = 0. Suppose -3g + 21 = -0g. Solve py + 3n - 2 - 1 = a, 5y + 2n - g = 0 for y. 3 Let l be 116/285 + 4/14. Solve 0 = 3s - v - 10, -3 - l = -5s - 2v for s. 4 Suppose 0 = 2q - 6n + 4n + 2, -32 = -4q - 5n. Suppose -4d + 5 = -qd. Solve -z + 7 = -2u, -z + 4 = -dz for u. -4 Let s = -14 - -13. Let p = s + 7. Solve 5k = -4b - 16, 2k - b = -2 + p for k. 0 Suppose a + 6 = 2d, 95d = 100d + 4a - 2. Solve -2i - 3y = d, -5y = -i + 13 + 12 for i. 5 Let v be 125(-8)/(-20) - 6. Let m be 22/6 + (-2)/3. Let d(f) = f - 5. Let r be d(5). Solve -p + vw - m = r, -5p = 5w - 5 - 5 for p. 1 Suppose 4u - 5q = -89, -3q - 102 = -0u + 5u. Let f = 23 + u. Suppose -5 = -fd - 1. Solve -5y - 22 = -j, -dj = y - 0y for y. -4 Let d = -46 + 50. Suppose 2i = -3h + 12, -dh - h + 21 = 3i. Solve 4j = 5s - 2, 4j - h = 2j - s for j. 2 Let p = -33 - -41. Let c be p/(-12)(-6)/1 + -2. Solve 5h - 3b - 5 = 0, 5h = 4b + 3 + c for h. 1 Suppose -57 = -5l + 3s, l + 5s + 43 = 5l. Let k = l - 9. Suppose -4m = m. Solve -3w + m - 3 = kp, 4w = 4p + 36 for p. -5 Let t = 524 + -556. Let f be 0(-2)/(-4) + -1. Let i be 3f - (t + 9). Solve -5x + i = 3w, -2x - 16 = -6x + 2w for x. 4 Suppose -95g + 3 = -92g. Let m be (g - (-16)/(-12))(-3 - 63). Suppose 5y = -4z + 25, y - 11 = -2z - 0y. Solve -15 = -d - 5l + 7, -3l = zd - m for d. 2 Let z = 0 - -17. Suppose -4c - 99 = -37c. Let i be 0 - -3 - -1 - -5. Solve q = -0s + cs + z, 2q - i = s for s. -5 Suppose -5g - 3x = -50, -2x - 7 - 4 = -3g. Let l(q) = -q*2 + 7q + 5. Let o be l(g). Solve -a = -5d + a + 22, -od + 19 = a for d. 4 Let w = -256 - -260. Suppose 20 = -3l + 2. Let b be 2/l + w/12. Solve -j + 5j - 5n - 33 = b, -5j + 15 = -n for j. 2 Suppose 16 = 2f + 6f. Suppose -fr + 30 = 4r. Solve rs = -c + 5, 0 = -2c + 5c + 4s + 7 for c. -5 Let l(i) = -20i + 63. Let r be l(3). Solve -3q + 34 = 5t, -7 = -rt + 8 for q. 3 Suppose -4r + 44 = 4p, -5r - 2p + 25 = -7p. Suppose -r = -15u + 13u. Solve -2s + s + 3 = 0, u = 4f - 4s for f. 4 Suppose -49v + 19 + 128 = 0. Solve r - 5o = 15, -vo + 2o + 6 = -2r for r. -5 Let f be 532/36 - (-4)/18. Let y(g) = -g3 + 16g*2 - 15g + 3. Let r be y(f). Solve l - 5u = -29, rl = 7l + u + 11 for l. -4 Suppose 0 = a + 5w + 17, -118a - 36 = -120a + 4w. Solve -u = as - 5s - 12, -3u = 5s - 16 for u. -3 Suppose -3r - 9 = 2v, -4r - 21 - 11 = -4v. Solve vi + 18 = -2f, -3i - 2i = 4f + 32 for f. -3 Let o = 35 - 18. Let p = -10 + o. Suppose x + 3 + 17 = 4j, -x + 4 = 0. Solve 3v - j = 4t + v, p = -5t + 2v for t. -1 Suppose 261 = -3n + 48. Let m = n + 72. Solve -5l - m = 2q, -q + 3l - 6 + 0 = 0 for q. -3 Let t = 17 - 11. Suppose -1 = -2y + 5, 3j + t = 4y. Solve 2m + 2 = d, 4 = 3m + jd - 0 for m. 0 Let k be (-26)/(-10) + 8/20. Let y(t) = -t2 - 8t - 13. Let j be y(-4). Solve -23 = i + ks - 8, 0 = -js - 15 for i. 0 Let t be 1 + 0 - 1 - -4. Suppose 0 = 5b + 3d - 34 - 29, 4d - 40 = -3b. Solve -4k - k + 3j - 9 = 0, b = 5k + tj for k. 0 Let h be (-4)/14 + 240/105 - -3. Solve w = 4w - 4n + h, -10 = 3w - 5n for w. 5 Suppose 0 = -5k + 4h + 23, 4k - 4h = -2h + 16. Solve -kp - 2p - c + 29 = 0, -3p + 3 = -3c for p. 5 Suppose 4m - 4i - 8 = 0, 2m - 2i = 2i + 2. Let j(y) = -y + 5. Let t be j(9). Let f be (-45)/6t/6. Solve -5 = -3g - b + 7, fg - mb = 6 for g. 3 Let c(m) = m*2 - 2m2 + 2 - m2 - 2m + 5m*2. Let a = 9 - 8. Let v be c(a). Solve 3f + v = 0, z - 5 + 2 = f for z. 2 Let f(c) = -c*2 - 11c + 14. Let o be f(-12). Let y(p) = p*2 + p - 7. Let w be y(3). Solve -5a + a = -oi - 10, wa + 2i - 35 = 0 for a. 5 Let c be (-129)/(-27) + (-2)/(-9). Solve 0 = -3z - 6, -11 = ci - z + 7 for i. -4 Let b(v) = 2v*3 - 2v*2 + 2v - 3. Let q be b(2). Let w be 34/q + (-6)/(-27). Solve 0 = -j + 5g + 30, 18 + 27 = wj - 5g for j. 5 Suppose 5y - 20 = -k, 4y = 5k - 3 + 19. Solve k = 2l - 2f, 0l = -2l - 2f for l. 0 Let i = 1 - 1. Let w(x) = 24x*2 - 12x + 12. Let a be w(1). Suppose -2j = -ij - a. Solve 2d + j = -0f + 2f, -3f + 2 = 5d for f. 4 Let w(d) = 28d + 105. Let a be w(-3). Solve 0 = -5u - 2q - 12 - a, -u - 13 = 2q for u. -5 Suppose 9 + 7 = 4i, a - 13 = -2i. Suppose -k = -0t + 3t - 38, -at + 5k + 50 = 0. Suppose 13 + t = 5r. Solve -3l = 9, rv + l - 9 = -l for v. 3 Suppose -c + 2r + 12 = 0, -r - 12 - 3 = -5c. Suppose -7z = -8z + c. Suppose 5p = -15, 5p + 73 = 2w + 22. Solve -6o + o - 27 = zt, 2t - 4o = w for t. -1 Suppose -2p + 12 = -0. Suppose -y - py + 28 = 0. Solve q + 3t = -2t - 8, 8 = -yq + 4t for q. -3 Let x be 68 + 5/1515. Let a = 74 - x. Solve f - 4 = 3u, -3f + 3u = 5 + a for f. -5 Let c be -2 - 1 - (-6 - -2). Let y be 1/2 - (c + 3/(-6)). Solve y = 4i - i - 4h - 11, 23 = 4i + 3h for i. 5 Let c(w) = -2w - 6. Let p be c(-5). Suppose -8 - 12 = -4m. Let y be 2/m + 6/(-15). Solve -2a - d = y, 18 = 5a - pd - 8 for a. 2 Let o = 202 - 198. Solve -ob - 13 = -3m, b + 4m = 4b + 15 for b. -1 Suppose -4c - 15 = -7c. Suppose cu + 2t + 2 = u, -5u - 9 = -4t. Let b be 0 + (u - (-3 - 0)). Solve 5r - 5 = 5z, -5z - 2 - 3 = -br for r. 0 Let p(o) = -o*3 + 8o + 6. Let g be p(3). Solve -c + 4c + gi - 9 = 0, c + 5i - 19 = 0 for c. -1 Suppose 5n = -2t + 55, 2n - 4 = -3t + 18. Solve 0 = 2x + 5v - n, -4x + 7v - 17 = 4v for x. -2 Let l(g) = g + 30. Let z be l(0). Let c = 34 - z. Solve 2d - 11 = d + 3n, 0 = 4d + cn + 4 for d. 2 Let r(t) = -t*2 - 16t + 5. Let w be r(-16). Suppose -x + 10 = wy, y + 4x - 2 + 0 = 0. Solve 0 = yk - 3a + 6, -15 = 5k + 3a - 0a for k. -3 Let z = 38 - 32. Solve 0 = 4h - 3t, zh - 2h - 20 = -2t for h. 3 Let c(q) = -6*q - 41. L	{ "pile_set_name": "DM Mathematics" }
-33? 5 Evaluate 7 - (1 + (-1 - 2) + 7 - 1). 3 Evaluate 5 + (22 - (2 + 15)). 10 Evaluate 16 - (-25 - (-36 + 21)). 26 Calculate -16 + -10 + 96 - 36. 34 Evaluate 0 + 6 + (-36 - -35) - 3 - -2. 4 What is 76 - 77 - (-1 - -2) - (-15 - 1)? 14 Calculate 15 + -11 + -36 + 17. -15 -3 - -4 - (-9 + 0 - 8) 18 What is 17 - (-15 - (9 - (19 - 6)))? 28 Evaluate 1 + -3 + (0 - 0) + -14. -16 Calculate 17 + (-25 - (10 - 21)). 3 Calculate -3 + -11 - -24 - 3 - -3. 10 Calculate (64 - -3) + -57 + 22. 32 -7 - 4 - (-7 + -14) - 9 1 What is the value of (-11 - (-11 + 5)) + 18? 13 1 + 4 + 2 + -4 + 4 + 0 7 What is the value of 197 + -242 + (1 - -26)? -18 What is -10 + 5 + (20 + -38 - -30)? 7 10 - 2 - (4 - (6 + -6 - -5)) 9 What is -2 + 12 + -2 + -3 + (-2 - 4)? -1 (-19 + 7 - -6) + 21 15 What is -97 + 107 - (0 + -5)? 15 What is the value of 2 - (-16 - -14 - (-1 - -13))? 16 43 + -46 + 0 + -1 -4 Calculate (1 - -6) + ((-5 - -1) + 10 - 11). 2 (-9 - 5) + 18 + -13 -9 Evaluate 18 - (-11 - -9 - -9). 11 Calculate -4 + 6 + 9 + -14 + 9 + -8. -2 (6 - 1) + (-10 - -1 - (-11 + -5)) 12 What is the value of 12 + -28 + -10 + 39? 13 Evaluate -2 + (-6 + (-5 - -1) - -17). 5 -12 - -1 - (-1153 - -1126) 16 What is (0 - -2 - (-63 + 53)) + -2 + 3? 13 What is 0 + (12 - (-12 + 8)) + -10? 6 What is the value of -9 + 0 - (18 + -8 + -12)? -7 What is (12 - 1) + (-41 - -81) + -38? 13 Calculate 33 - 25 - (19 + -7). -4 What is the value of 26 - ((-9 - -76) + -27)? -14 What is the value of (0 - -12) + 2 + (15 - 8 - 32)? -11 Calculate (10 - (13 + 5)) + 9 - (-18 + 0). 19 What is 3 + -4 - 0 - (12 + -16 + -6)? 9 What is the value of -2 + 16 - (79 + -58)? -7 Evaluate 1 + 3 + (-3 - 8). -7 What is -58 + 51 - (-15 + -6)? 14 Calculate (9 - 1 - 29 - -11) + 0. -10 Evaluate 10 + 3 + (-1 + 1 - 9). 4 Calculate 1 - -18 - (-447 + 465). 1 Evaluate -7 + (2 - 3) + 26 + -12 + 4. 10 What is (1 + (25 - 10) - 9) + (19 - -3)? 29 What is 3 - (-7 - -8) - (21 - 6)? -13 -3 + (-2 - -5 - 1) - (-4 - -15) -12 What is 8 + 3 + 5 - (-11 - -18)? 9 (1 + 0 + -3 - 3) + -140 + 133 -12 Calculate -4 + -1 + -11 + -12 + 32. 4 What is -10 + 2 + 2 + -8 + 4 + 2? -8 What is the value of 5 + (4 + -4 - 1 - 9) + -5? -10 What is the value of -33 + (11 - (-10 - -4))? -16 Calculate (-16 - -56) + -19 + (-8 - -2). 15 2 + -11 + 22 + 4 17 Evaluate 11 - 6 - 32 - -18. -9 Calculate (-1430 - -1389) + (22 - -2). -17 (1 - (2 + 0)) + (-2189 - -2186) -4 What is the value of 47 - 45 - (-6 - 7)? 15 Evaluate -8 + 10 + 1 + -2 + 11 + -11. 1 Evaluate 9 - (24 + (-13 - -29)). -31 (9 - 16 - (3 - (6 - 1))) + 1 -4 Evaluate (-12 - -11) + -25 + 24. -2 What is -7 - (8 - (8 - 8) - 24)? 9 What is the value of 8 - (31 - 6 - 9) - 7? -15 26 + (-48 - -18) - (6 - (2 + -3)) -11 Evaluate (-13 - (-28 - (1 - 5))) + 20. 31 What is (6 - (-8 + 12)) + -3? -1 Calculate 2 - 4 - -1 - (384 - 378). -7 What is -14 + 19 + (-19 - -17)? 3 What is the value of (-20 - (-8 - -15)) + 38? 11 What is 44 + 0 - (159 + -148)? 33 What is the value of -35 + 49 - (3 + 2 + -18)? 27 Evaluate 0 - 32 - ((-9 - -15) + -21 - -7). -24 What is the value of 0 + -18 - (-5 + (9 - 12))? -10 What is the value of 17 - 0 - 14 - 10? -7 What is the value of -16 + (4 - (3 - 25))? 10 (46 - 55) + 6 + 2 -1 Evaluate (4 + -37 - -4) + 28. -1 Calculate (12 - 28 - -29) + 1. 14 What is the value of 25 + -18 + -14 - (-4 - 0)? -3 Evaluate -94 + 86 - (-19 + -1). 12 Evaluate 1 + (-2 - -6) + -10 + 1 + 2. -2 -2 + 13 + (33 - 41) + 1 4 What is the value of -9 + 1 + (-5 - 3) + -59 + 71? -4 -4 + 4 + 9 + -7 + -4 - -3 1 Evaluate -639 + 656 - (10 - 3). 10 Evaluate (1 - -7) + -102 + 90. -4 What is the value of 21 + 0 + (1 + 10 - 0) + 0? 32 Calculate (13 + -1 - 5) + 41 + -53. -5 Calculate (5 - (4 + -1 + -2)) + (64 - 66). 2 What is the value of (9 - (1 - 6)) + -6 + 15 - 7? 16 Evaluate (2 - (17 - 9)) + 17 - (1 + 0). 10 Evaluate -4 + 3 - 3 - (-13 + 0). 9 What is the value of -9 - (4 + 9 + -21)? -1 Calculate 1 + 1 + 16 + -9 + 11. 20 Evaluate -7 + -3 + -2 - (12 + 0 + -5). -19 Evaluate 4 - (15 + -3) - (-9 + -1 - 6). 8 5 + 1 - (-181 + 191) -4 Evaluate -3 - (0 + 5 + 1 + (-10 - 9)). 10 Evaluate -100 + 88 + (0 - (-5 - -8)) + 48. 33 What is -15 + 31 + -24 + -2? -10 What is the value of 44 - (-23 + 18 + 24)? 25 7 - (-2 + (-5 - -6) + -1 + -2) 11 Evaluate -35 + 49 + -5 + -7. 2 What is the value of -1 - (-39 + 15 + 1)? 22 Calculate 7 + (-29 - -3 - (-1 - 15)). -3 What is (-12 - (-44 - -11)) + 2 + 7? 30 1 + (-2 - -8) - 13 - -2 -4 Evaluate -9 + (-1 - -3) + (4 - 1) + -10. -14 Calculate 211 - 210 - (-3 + 3 + -1). 2 What is the value of 71 + -55 + -31 + (-1 - 5) + 2? -19 What is 0 - ((0 - -9) + -13)? 4 What is -10 + -8 + (63 - 40)? 5 Evaluate (2 - -1 - 0) + -10 - (95 - 94). -8 Evaluate (-2 + 1 - -8) + (54 + -90 - -42). 13 What is -2 - (3 + 9) - -8? -6 Calculate -9 + 1 - (31 + -34). -5 Evaluate -6 + 13 + -8 + 20 + -8. 11 Calculate -114 + 115 - (-3 + -2 + 8). -2 What is the value of 21 + 15 - 28 - (34 - -1)? -27 -21 + 36 + 10 - (0 + 2) 23 What is (-55 - -51) + (-2 - -13)? 7 What is -1 + -9 + (-10 - (0 + -10))? -10 What is the value of -7 + (-19 - (-14 - 5))? -7 What is 6 - ((5 - 16 - -8) + (-2 - 5))? 16 Evaluate -1 - (-8 + 12 + (0 - 9) + 7). -3 What is the value of (-1 - 5) + (-2 - (28 + -23))? -13 What is the value of 1 + -1 + (17 - (4 + 6))? 7 -13 + 1 - (26 - (-22 + 60)) 0 Calculate 1 - -3 - ((14 - 6) + 0 + 10). -14 What is 384 + -404 - ((-1 - -21) + -1)? -39 Calculate 34 + -2 - (4 - -25 - 16). 19 What is the value of 12 + (-33 - (-26 - -12))? -7 What is -6 + 2 + 4 + 6 + -7 - -16? 15 What is the value of -18 - 11 - -65 - 23? 13 What is -27 - (-4 + -12 + -13)? 2 Evaluate 1 + 12 + -24 + 18 + -19. -12 Evaluate -10 + -7 + (-1 + -4 - -17). -5 Evaluate (-3 + -13 - -20) + -15. -11 Evaluate 18 + 3 + -10 + 2. 13 What is 10 + -3 - 26 - -33? 14 Calculate (-25 - -11) + (49 - 48). -13 Calculate 8 - (-3 - -15) - -6. 2 Calculate 10 + (-30 - -5) + -4 + 5 + 0. -14 What is 15 - (33 - 18 - -11)? -11 Evaluate -7 + 0 - (17 - 18) - -15. 9 Evaluate -9 - (8 - ((-5 - -2) + (1 - 6))). -25 Evaluate -1 + (9 - 0) + 898 + -907 - 12. -13 Evaluate 2 - (5 - 1) - (18 + -11). -9 What is the value of 0 + (-4 - 2) + 3 + -2 + 8? 3 What is the value of (3 - -6) + -13 + -14 + 8? -10 9 - (7 + (-6 + 1 - 1)) 8 Calculate 11 + 9 + -15 + -1 + 6. 10 What is the value of -49 + (23 - -2) + -8? -32 Calculate (-6 - (-11 - 10)) + (-8 - -18). 25 6 + (1 - 42) - (-28 - -21) -28 What is the value of 17 - 16 - (30 - 12 - 10)? -7 Calculate 1 + 12 - (-380 + 384). 9 What is -15 + 15 + 1 + (-34 - -32)? -1 Evaluate 4 - ((5 - -2) + -20). 17 What is the value of -146 + 137 + (1 - (-2 - -1 - 1))? -6 Calculate (-9 + 4 - 1) + 8 + -11. -9 -6 + -4 + 19 + -21 -12 Calculate -35 + 59 + 31 + -40. 15 What is the value of (18 - 7) + -8 + 11? 14 Calculate -35 + -2 - (36 + (15 - 51)). -37 Calculate (-3 - (-6 + 15)) + 30 + -6. 12 32 + 8 + (-7 - 32) 1 What is -3 + (-3 - 2) + -20 + 12 + -2? -18 Evaluate (3 + -13 - 13) + 17. -6 What is 17 + (5 - (-1 + 5)) - 3 - 1? 14 Calculate (-6 - 4) + (3 - (12 - (1 - -14))). -4 Evaluate 3 - 5 - (1 + -2 - (1 - 11)). -11 What is 2493 + -2455 - (0 + 0)? 38 What is the value of 5 - ((-50 - -56) + 1 + -19)? 17 What is 5 + 0 - (-291 - -291 - (1 - 36))? -30 What is 2 + (-4 - (0 + -8 - (-4 + -4)))? -2 Calculate -60 - -50 - (-2 - -15). -23 Evaluate (-21 - (21 - 33)) + -3. -12 What is -10 - -13 - 2 - (-6 - -6)? 1 Evaluate (11 - (3 - (1 + -9) - -12)) + 15. 3 Calculate -18 + 33 + -9 - 15. -9 Evaluate -7 - (13 - (-1 + 41 + 7)). 27 What is -281 - -275 - ((5 - 16) + 0 + 3)? 2 Evaluate 20 + -43 - (-1 - 32). 10 Evaluate 11 + 15 - (70 - 74). 30 Calculate -3 + 7 + (60 - 79). -15 Calculate 20 + -7 - ((-4 - -6) + -6). 17 Calculate (-27 - -23) + 2 + -3 + 26. 21 Evaluate (-13 - -5 - 12) + 24. 4 (-10 - ((8 - -19) + -8)) + (-4 - -3) -30 7 + -11 + -9 + 4 + 10 1 What is the value of 4 + (-39 - -35) + 1 + 4? 5 What is -17 + 9 + 3 + (-10 - 3)? -18 Evaluate 5 + -7 - -10 - 9 - 22. -23 2 + 2 + -3 + 9 + (-3 - 0) 7 What is the value of 15 + -14 + -6 - -13? 8 What is the value of -21 + 18 + (2 - 5) - -11? 5 What is 18 + (25 - 7) + -21? 15 What is the value of 14 + (10 - 3 - 10) + 1 + -1? 11 Calculate 36 + -66 + (3 - -28). 1 What is -18 - (1 + -2 - (-21 - (-15 - 3)))? -20 Evaluate -3 + (-14 - -5) + 12 + (17 - -1). 18 What is the value of -3 + (0 - 1) + (1 - (-12	{ "pile_set_name": "DM Mathematics" }
= 3c + 4l - 839, -4c + 0c = l - 1123. Let o = c - 1970/7. What is the closest to 1 in t, 0.1, o? 0.1 Let g = -219 + 219. Let t = 3 + -2. Which is the nearest to -1? (a) 0.3 (b) g (c) t b Let d be 5(1 + 2 + -2). Let p = 0.6 + -1.5. Let l = -0.9 - p. Which is the nearest to l? (a) 4 (b) 0 (c) d b Let p = 81 - 327/4. What is the nearest to 2 in -0.5, p, 4? 4 Let v = -3/61 - -149/549. Let q = -23.1 + 23. Which is the nearest to q? (a) v (b) 0.5 (c) -2/19 c Let r = 3/14 + -41/28. Let l = -1.37 + 1.4. Let m = l - -0.97. Which is the nearest to m? (a) r (b) -2/17 (c) -1 b Let h be (-36)/9(-15)/(-28) + 2. Which is the closest to 3? (a) 2/17 (b) h (c) -5 a Suppose -2t = -10, -x = 2x - 4t + 35. Let u be (-13)/x + (-2 - 0). Which is the nearest to 2/3? (a) 0 (b) u (c) 3 b Let t = -1.8 - -1.93. Let i = t - -4.87. Which is the closest to -2/9? (a) i (b) -5 (c) -2 c Let h = -5 - -9. Let i = h + -3.6. Let p = i + -0.2. What is the nearest to 1 in 3/7, p, -0.1? 3/7 Let k be 1/(-4)(-3 + 4). Let s be 69/23. Let w = s - 403/5. What is the nearest to w in k, -2, -0.4? k Let v = -6.7 + 6.5. Let p = -3 - -4. Which is the closest to v? (a) -0.7 (b) -0.3 (c) p b Let p = 23/66 - 2/11. Let d = -1143/7 - -163. Which is the nearest to d? (a) 5 (b) p (c) 1/5 b Let m = 1/6 - -1/2. What is the nearest to -1 in 0.5, 3, m? 0.5 Let s = 8.1 - 8.3. Which is the closest to -0.07? (a) s (b) 3 (c) -2 a Let g be ((-12)/(-9))/((-2)/(-3)). Suppose -2x - 11 = 5f - 3x, -gx = 8. Let z = 6.1 + -1.1. Which is the nearest to 0.1? (a) 3 (b) f (c) z a Let t = -0.2 + -1.8. Let f = -4 - t. Which is the nearest to f? (a) -0.4 (b) -1/4 (c) 1 a Let l be 4/(-6)(0 + 3). Let o = -9961/9 - -1107. What is the closest to o in 0.3, -1, l? 0.3 Let f be -105(-1)/1 - 0. Let d be (-6)/(-21) - (-12)/f. Which is the nearest to 0? (a) -1 (b) d (c) -3 b Let n = -0.08 + 0.3. Let w = -0.08 - n. Which is the nearest to 0.1? (a) w (b) 0.3 (c) 0.4 b Let p = 0.1 + -3.1. Which is the closest to 0? (a) 0.3 (b) 1 (c) p a Let q = -12 - -14. Which is the nearest to q? (a) 3/7 (b) -1/4 (c) -5 a Let k = 59 - 74. Let s = -18 - -7. Let u = k - s. Which is the nearest to 1/3? (a) -3 (b) -0.1 (c) u b Let v = -9 + 8. What is the nearest to v in -2, -4, 0.4? -2 Suppose 0 = -20s + 19s. Which is the closest to 0? (a) -0.4 (b) s (c) 2 b Let n be (6/(-4) - -2)6. Suppose -6b + nb = 0. What is the closest to b in -2, 6, -0.5? -0.5 Let f = 0.08 + -4.08. Let v(l) = l - 8. Let h be v(8). Which is the nearest to -1? (a) 4 (b) f (c) h c Let x = 3.14 + 0.86. Which is the nearest to 1/2? (a) 0 (b) 5 (c) x a Let p be (-16)/2166/4. What is the nearest to -0.1 in 0.4, p, 0.1? p Let y be -7 + 2 + (-15)/(-5). Let q = 0 + -2.5. Let d = -2 - q. Which is the nearest to 0.1? (a) -1/4 (b) y (c) d a Let m = 3 - 2.95. Let d = 0.48 + -0.03. Let v = m - d. Which is the nearest to -0.1? (a) -0.1 (b) 2 (c) v a Let j = -27/8 + 259/72. Let c be (-3)/(-12) - 34/8. What is the nearest to -1 in j, 1, c? j Suppose -z + 17 = -4m, -3z + 2z - 5m = 19. What is the nearest to -21 in z, -4/7, 2/5? -4/7 Let z = 6.8 - 7. Let i = z - 0.3. What is the closest to -1 in 1/9, -4, i? i Let i = -1991/17 - -117. Let n be (-2)/(-3) - (33/(-9))/(-11). Which is the nearest to 0.1? (a) -0.5 (b) n (c) i c Let v = -1 + 1. Let f = -29/22 - -9/11. Which is the closest to 1? (a) f (b) v (c) -0.1 b Let w be (-18)/(-27)(0 + (-6)/16). What is the nearest to w in 5, -0.05, 3/2? -0.05 Let s = 3 + -3.3. Let m be (-4 - -4)/((-8)/(-4)). Which is the closest to m? (a) s (b) 4/5 (c) 0.1 c Let r = -1 + 4. Let s = 4 - r. Let v = 0.2 - 0.3. Which is the closest to v? (a) 4 (b) s (c) -1 c Let l = -16 - -6. Let n = l + 15. Let u = 0.2 - 0.3. Which is the closest to 0? (a) n (b) 2/23 (c) u b Let r(j) = -j + 4. Let z be r(2). Suppose -4q - 24 = zq. What is the nearest to 0 in q, 1/10, 3? 1/10 Let p = -0.3 + 0.3. Let y be (-2)/1224/9. What is the nearest to p in -0.1, y, -0.2? -0.1 Let k = -4.6 + -0.4. Let l = 3 + k. Which is the nearest to -0.1? (a) l (b) 0.4 (c) 0.1 c Let k = -78 + 392/5. Let v = 72 - 359/5. What is the closest to -1 in -0.3, v, k? -0.3 Let s be (-1)/7(2 - 1). Let u = -0.1 - 4.9. Let k = u - -7. Which is the nearest to k? (a) s (b) 5 (c) 2/11 c Let r = -23.4 + 23. What is the nearest to 1/3 in 0.3, 0.1, r? 0.3 Let t = -18 + 17.9. Which is the nearest to t? (a) 0.2 (b) 0.1 (c) -1 b Let p = 0.03 + 6.97. Let w = 23 + -32. Let q = w + p. Which is the closest to 0? (a) q (b) -0.5 (c) -5 b Let x = -1.5 + -2.1. Let g = -4 - x. What is the closest to -0.1 in 3, 1, g? g Let h(r) = r2 - 2r - 3. Let d be h(5). Suppose d = 2w - 2. Suppose -a - 2q = 8, -2 = 3q + w. What is the closest to 1 in 0.4, 5, a? 0.4 Suppose -2h + 136 = -5o, -3o + 4h = -6o - 92. Let w be ((-6)/(-7))/((-16)/o). Let g = 2 + -5. What is the closest to 1/5 in 0.3, w, g? 0.3 Let w = 0.06 - 3.06. Let f = -1.47 + 1.17. What is the nearest to 3 in f, w, 0.4? 0.4 Let s = -78.9 + 79. What is the nearest to s in 8, 1, 5? 1 Let k be (-2)/(3 - 57/18). Let s be (k/(-15))/(2/5). Which is the closest to 0? (a) -4 (b) -1/4 (c) s b Let t = 3.5 - 2. Let s = t - 0.5. Let o = -5 + 5.4. Which is the closest to 2/3? (a) s (b) o (c) 1/5 b Let p be (-4)/6 - (-20)/120. Suppose 2d - 2q - 3q = 29, -d + 12 = -2q. Which is the closest to 1? (a) d (b) p (c) 5 a Let u be 3/(-12) + (-2)/(-4). Let q = -5.4 + 5. Let i = 0.2 + q. Which is the closest to i? (a) u (b) -3 (c) 4 a Let m = -0.42 + 0.52. What is the closest to m in -4, 0, -5? 0 Let j = -11 + 9. What is the nearest to 0 in -0.2, -0.04, j? -0.04 Let m be 2/(-3)(-6)/(-10). Let x = -3 + 2. Which is the nearest to 2/5? (a) 3 (b) x (c) m c Let v = -56 - -80. Let z = 20 - v. Which is the closest to 1/3? (a) z (b) 2/7 (c) -2/9 b Suppose 3q - 26 = -2x, 0 = -q - 9x + 6x + 18. What is the closest to 2 in -2/3, 0.1, q? 0.1 Let j be 0 - (-3)/(-24)0. Let v = 0.3 - 0.4. Suppose -g = -4g + 15. Which is the closest to v? (a) j (b) g (c) -5 a Let m = 9 - 7. Let z be (m/1)/((-3)/(-15)). Let d be 3/12 - z/(-8). Which is the nearest to 0.1? (a) d (b) -5 (c) 3 a Let m = -2 - -2. Let w = -24.1 - -25. Let j = 0.6 - w. Which is the nearest to m? (a) j (b) -3 (c) 0.1 c Suppose 0 = -u + 3u - 8. Let p(l) = l*2 + 11l - 17. Let a be p(-12). Let x = -0.02 - 1.98. What is the closest to x in a, -1, u? -1 Let y = -3.2 - 0.8. Let o(l) = l3 - l2 - l + 2. Let x be o(0). What is the closest to x in -2, y, -0.5? -0.5 Let r(v) = -v*3 - 14v*2 - 13v. Let j be r(-13). What is the nearest to 1 in j, -4, -6? j Let u = -26.3 - -5.3. Let g = u - -26. Which is the nearest to 2/9? (a) 2/11 (b) g (c) 1/8 a Let n be -4(-5)/(-100)2. What is the nearest to -1 in -0.1, n, 19? n Let z = 2.29 + -1.99. What is the closest to 2/5 in 1, -0.02, z? z Let o = 217/5 - 43. Let p be -5 + -3 + (2 - -2). Let d be (1 - 2)(p - -4). What is the closest to d in o, 0.5, -0.3? -0.3 Suppose -6r + 10 = -4r. Suppose -6 = 3k, rs - 11 = 4s + 4k. Which is the nearest to 0? (a) s (b) -0.4 (c) -0.1 c Let h be ((-33)/44)/(1/12). Let o be 1 + -4(-3)/h. Suppose 0 = -u - w, 4u + 32 = 2w + 2w. Which is the closest to o? (a) -0.5 (b) 1/3 (c) u a Let z = -2.3 - -2.3. Suppose 0 = 6r - 10r. Which is the nearest to z? (a) -2 (b) r (c) -11 b Let p = 1 - 2. Let t = 41/21 - 9/7. Which is the closest to p? (a) t (b) -2/13 (c) 2 b Let m = -3/28 + 1/4. Which is the nearest to 0.1? (a) 4 (b) m (c) 3/8 b Suppose 0 = 5n - 2n - 90. Let v be (6/n)/((-8)/(-10)). Let q be 3 + -1 + (-8)/6. Which is the closest to 1? (a) q (b) v (c) 5 a Let g = 0 - -0.1. Which is the closest to g? (a) -0.1 (b) -86 (c) -2/7 a Let z(o) = -4o + 4o - 6o - 3o - 4 - o2. Let y be z(-8). Let s = -7 + y. What is the nearest to 2 in -5, s, -4? s Let r = -0.9 - 0.1. Let k = -38/15 - -508/165. Which is the closest to r? (a) 5 (b) k (c) 1/2 c Let x = -13/30 + 1/10. Let m = 15 - 14.98. Let d = -0.28 - m. What is the closest to -1/2 in x, 0, d? x Let j(s) = 27s*2 + 3s + 2. Let u be j(-3). Let m = -1655/7 + u. Let q be (-3)/6 - (-3)/4. Which is the nearest to 1/4? (a) -1/2 (b) q (c) m b Let m =	{ "pile_set_name": "DM Mathematics" }
third derivative of -26o6 + 36o - 36o - 18o*2 wrt o? -3120o*3 Let w(x) be the first derivative of 7x*6/6 - 4x*3/3 - 4. What is the third derivative of w(h) wrt h? 420h2 Let q(x) be the third derivative of x8/112 + 31x4/24 + x2. Find the second derivative of q(y) wrt y. 60y*3 Let c = -5 + 6. What is the derivative of -5 + 5z - c - 1 - 2z wrt z? 3 Let o(p) be the third derivative of p6/120 + p5/20 + 4p*2. Find the third derivative of o(k) wrt k. 6 Find the first derivative of -7s2 + 0 + s2 + 1 - 8 wrt s. -12s Find the third derivative of -184q*6 + 195q*6 - 10q*2 - 17q*2 wrt q. 1320q*3 Let x = 5 + -3. What is the first derivative of -2 + 2 + 5c + 0 + x wrt c? 5 Let z(w) be the first derivative of 0w5 + 0w*3 + 0w*4 + 5/2w*2 + 1/6w*6 + 0w + 3. What is the second derivative of z(q) wrt q? 20q3 What is the second derivative of 0i*4 + 0i*4 - 6i - 4i4 wrt i? -48i*2 Suppose -2i + 0 + 14 = 0. Find the second derivative of 5p5 - 2p*5 + ip - 6p5 wrt p. -60p*3 Let u(t) = 62t*4 + 175t*2 + 11t + 11. Let c(i) = -21i4 - 58i*2 - 4i - 4. Let h(f) = 11c(f) + 4u(f). What is the third derivative of h(a) wrt a? 408a Suppose 4w = 5w. What is the derivative of -2k*2 + w + 11k*2 - 5 - 3k*2 wrt k? 12k Let a be (1 - -1) + (-1)/1. Suppose -3u - a = 3m - 2u, 4 = m - 4u. Find the second derivative of -i*5 + mi + 0i5 + 2i wrt i. -20i3 Let s(y) = -6y*5 - 9y*4 - 9y*3 - 11y. Let r(x) = 3x5 + 4x*4 + 4x*3 + 5x. Let q(h) = 9r(h) + 4s(h). What is the second derivative of q(c) wrt c? 60c3 What is the third derivative of 2h - 28h2 - 2h - 7h2 + 56h*3 wrt h? 336 Let d(g) be the first derivative of -7g*3 + 2g*2 + 44. Find the second derivative of d(x) wrt x. -42 Suppose -35 + 7 = -4j. Find the first derivative of -4 + 0 + j + w*4 wrt w. 4w*3 Let u(g) be the third derivative of 23g*6/120 + 19g*5/60 - 10g*2. What is the third derivative of u(d) wrt d? 138 Suppose -4d - 3v - 16 = -6v, -2v = 0. Let b = d - -7. Find the first derivative of 2n*b - 5n3 + n3 + 1 wrt n. -6n2 Let u(h) = 4h*4 + 3h*2 - h + 1. Suppose a - 2 = -a. Let j(t) = -t + 1. Let f(g) = au(g) - j(g). Find the third derivative of f(m) wrt m. 96m Let s(f) be the first derivative of -1 + 2f + 0f2 + 0f*3 - 3/5f*5 + 0f*4. What is the derivative of s(h) wrt h? -12h3 Let y(k) be the third derivative of -k7/420 - k6/180 - k3/3 + k*2. Let f(n) be the first derivative of y(n). What is the third derivative of f(z) wrt z? -12 Let f(l) be the second derivative of 0l*3 + 0l*2 - 1/5l*5 - 3l + 0 - 1/2l4. What is the third derivative of f(i) wrt i? -24 What is the derivative of 2r*3 - 6 - 3r*3 - 1 - 7r*3 wrt r? -24r*2 Let t(v) = 9v*2 - 5v. Let b(q) = -q*2 - q. Let x(z) = 6b(z) + t(z). What is the second derivative of x(k) wrt k? 6 Let j(u) be the third derivative of -u6/20 + u4/12 - 2u2. Find the second derivative of j(z) wrt z. -36z Let l(a) be the third derivative of 3a6/40 + a5/15 - a2. What is the third derivative of l(g) wrt g? 54 Let j(p) be the first derivative of 22p*7/7 - 11p*3/3 + 1. What is the third derivative of j(u) wrt u? 2640u*3 Let u = -10 + 10. Find the first derivative of 4f + 2 - 5f + u - 6f wrt f. -7 Find the third derivative of 18z3 - 36z*3 + 41z*3 - 6z2 wrt z. 138 Let f(h) be the first derivative of h3/3 + h*2/2 - 2h - 4. Let s be f(2). What is the third derivative of 2v2 + vs - 3 + 3 wrt v? 24v Suppose d = 4 - 1. Find the third derivative of -6y6 + y2 + 0y*3 + 3y*3 - 3y*d wrt y. -720y*3 Let b = -9 - -5. Let c be (-1)/2(-2 + b). What is the third derivative of w*c - 3w3 + w2 + w2 wrt w? -12 Let u(c) be the second derivative of c7/14 - c*3/2 + 19c. Find the second derivative of u(d) wrt d. 60d3 Find the second derivative of f4 - f2 - 24f + 0f2 - f2 - 1 wrt f. 12f*2 - 4 Find the third derivative of 3k*5 + 4k*2 + 0k*5 - 4k*5 - 2k*5 wrt k. -180k2 Let v = -20 - -25. What is the third derivative of f5 + 8f2 - 9f*v + 0 + 0 wrt f? -480f2 Let h(v) = v3 - 6v2 + 4. Let k be h(6). What is the third derivative of t4 - 5t*4 + 3tk + t2 - 6t4 wrt t? -168t Let p = -9 - -14. Find the third derivative of -pn6 - n2 + 2n*6 + 0n*6 wrt n. -360n*3 Let v(n) = -3n*4 + 6n*3 + 6n - 16. Let p(x) = 4x4 - 7x*3 - 7x + 17. Let w(b) = -6p(b) - 7v(b). Differentiate w(j) with respect to j. -12j3 Find the third derivative of 6s*5 - 7s2 - s5 - 4 + 4 wrt s. 300s2 Let o = -3 + 6. Differentiate 0b*o + 6b*4 + 6b*3 - 6b*3 - 3 with respect to b. 24b*3 Let u(t) be the first derivative of 5t9/3024 + t6/180 + 2t3/3 + 3. Let c(z) be the third derivative of u(z). What is the third derivative of c(x) wrt x? 300x*2 Let t(d) = -d - 5d - 2d2 - 5d + 2d + 4. Let k(u) = -u2 - 4u + 2. Let a(b) = 9k(b) - 4t(b). What is the first derivative of a(v) wrt v? -2v Let d(b) = -3b*3 - 3b2. Let w(g) = g3 + 2g2. Let a(c) = 3d(c) + 5w(c). Find the third derivative of a(l) wrt l. -24 Let v be (4/6)/((-6)/9). Let o be 0/(3/(-2 + v)). What is the derivative of 3w*3 - 5 + o + 1 wrt w? 9w*2 Differentiate -2p + 218 - 3p2 - 216 + 2p with respect to p. -6p Let p(f) be the second derivative of 1/6f*3 + f + 0f*4 - 3/20f*5 + 0 + 0f*2. What is the second derivative of p(v) wrt v? -18v Let k be (-4)/(-3)(-27)/(-6). Let a(n) = n2 - 6n + 5. Let v be a(k). What is the derivative of -p*2 + 4p*2 - 6 + v + 5 wrt p? 6p Let d(y) = 10y2 + 11y - 6. Let i(x) = 9x2 + 10x - 5. Let w(l) = 5d(l) - 6i(l). Find the second derivative of w(q) wrt q. -8 Differentiate -7 + 39 - 8o - 40o + 8o wrt o. -40 Let z(u) = -13u*4 - 2u*2 - 2u + 2. Let m(x) = -14x4 - 3x*2 - x + 3. Let t(a) = -2m(a) + 3z(a). What is the second derivative of t(n) wrt n? -132n*2 Let m(p) be the third derivative of 0p + 0 + 1/24p6 - 5p*2 + 0p*3 + 1/60p*5 + 0p*4. What is the third derivative of m(o) wrt o? 30 Let y(i) = -4i + 0i + 5i - 4i. Let l(g) = -g - 1. Let b(s) = -2l(s) - y(s). What is the derivative of b(u) wrt u? 5 Let t(r) be the third derivative of -7r6/120 - 13r*3/6 + 5r*2. What is the first derivative of t(u) wrt u? -21u*2 Let q = 3 - -15. Suppose 8 = 3a - 3t + 4t, 4a + 5t - q = 0. Find the third derivative of 3o2 - 3o*6 - ao*2 + 2o*2 wrt o. -360o*3 Differentiate -21 - 26i*2 - 4i*4 + 39i*2 - 20i*2 - 14 wrt i. -16i*3 - 14i Let z = 14 - 14. Let w(l) be the first derivative of -1 + l*2 - 2/3l*3 + zl. Find the second derivative of w(i) wrt i. -4 Let u = -2 + 4. What is the first derivative of -2g - 2g - ug + 3 + 4g wrt g? -2 Let k(x) = 3x3 - x2 - 3x + 3. Let m(a) = 6a3 - a2 - 7a + 7. Let z(h) = -14k(h) + 6m(h). What is the third derivative of z(d) wrt d? -36 Find the second derivative of -72r2 + 17r*2 - 4r - 1 - 5r + 3r wrt r. -110 Suppose 0 = -n - 5f + 12, -n - n - 3f + 10 = 0. Find the second derivative of 7o - 9o - 2on + 4o*2 wrt o. 4 Let u be 14 - (-2 - (0 - -1)). What is the third derivative of u + 3l*2 - 17 - 4l*3 wrt l? -24 Let o = -14 + 16. What is the derivative of -3f*2 - 6f3 - 7 - fo + 4f2 wrt f? -18f*2 Find the third derivative of 16r*2 + 148r*6 + 4r*2 - 151r*6 wrt r. -360r*3 What is the derivative of -7 - 158r + 76r + 82r - 40r4 wrt r? -160r*3 Let x(g) = 15g*3 - 3g*2 - 3g + 1. Let r(p) = 14p3 - 2p*2 - 2p + 1. Let d(w) = -3r(w) + 2x(w). What is the first derivative of d(q) wrt q? -36q2 Let f(s) = -2s*3 + 12s*2 + 7s + 7. Let r(y) = 6y3 - 36y*2 - 22y - 20. Let b(t) = 14f(t) + 5r(t). Find the second derivative of b(j) wrt j. 12j - 24 Let d(q) = -6q + 9. Let l(y) = -18y + 28. Let h(i) = -7d(i) + 2l(i). Differentiate h(m) wrt m. 6 Let i(j) be the third derivative of -4j7/105 + j4/3 - j*2. Find the second derivative of i(t) wrt t. -96t*2 Suppose -2m = -32 - 20. Find the third derivative of -mq + 5q*2 + 4q*4 + 26q wrt q. 96q Find the second derivative of 9m*5 + 8m*5 + 7m**5 - 17	{ "pile_set_name": "DM Mathematics" }
156 - u. Is i a multiple of 21? True Let g = -139 + -121. Let h = g - -465. Does 14 divide h? False Let w(g) be the first derivative of g*2/2 + 2g - 3. Let h be w(0). Suppose -2u + 6u + hz = 100, -2u + 58 = 3z. Is u a multiple of 15? False Let a = 853 - 543. Is 21 a factor of a? False Let w = -48 - -79. Suppose w = 3f - 230. Is f a multiple of 10? False Suppose 0 = 121k - 133k + 3516. Does 5 divide k? False Suppose 3 + 3 = -2p. Let i be p/(1/1-1). Suppose -3b + o + 25 = 0, -io = -4b - 0b + 25. Is b a multiple of 10? True Suppose 0o + 3o = -5y + 22, -5y = o - 14. Suppose -yp + 110 = g, -3g + 7g - 110 = -2p. Is p a multiple of 18? False Let h(d) = 10d - 5. Let q be h(16). Let v = -107 + q. Is v a multiple of 12? True Suppose -2k + 5v = -2, -18 = 4k + 5v - 82. Suppose 0 = 2a - y - 11 - k, -4a = y - 38. Does 3 divide a? False Let g = 2261 + -1253. Is g a multiple of 50? False Suppose -5o - 75 = 4i, -4i - 4o = -9o + 125. Is (-10)/i - -1719/5 a multiple of 16? False Suppose 4h - 2h + 5 = -5t, 3t = 2h - 35. Let s be 15/(-3)(-16)/h. Let n = s + 26. Is 17 a factor of n? True Let d be (3/2)/34. Suppose 4l - 2h - 16 = 0, 2l - dh + 7h - 20 = 0. Suppose lu = 2u + 33. Is 3 a factor of u? False Suppose 21y + 33540 = 64y. Is y a multiple of 60? True Let a be (4 + -4 - 90)-2. Suppose 3s - a = -s. Is s a multiple of 15? True Let n = -76 + 166. Let w = n + -39. Is w a multiple of 17? True Let p = -2 - -6. Is (p - (-47 - 4))/1 a multiple of 10? False Let r be (-2)/(-7) + 2196/7. Suppose -3y + 29 + 169 = 2z, -r = -5y + 2z. Is 16 a factor of (9/(-3))/((-6)/y)? True Let s(o) = -5o + 66. Let n be s(14). Is ((-117)/45)/((-8)/(-150))n a multiple of 33? False Let f be ((-1)/2 + 1)-92. Let b = -30 - f. Is 21 a factor of (-3 - -11)84/b? True Let a(f) = 316f*2 - 8f - 3. Is 103 a factor of a(-3)? False Let b = -426 - -474. Is b a multiple of 2? True Let r = 0 - 0. Suppose r = v - 4v + 30. Suppose -v = s - 4z, 3z + 0z - 6 = s. Is s even? True Let r(w) = 9w3 + 3w*2 + 4w - 2. Let m be r(3). Suppose -g - 815 = -3o, 0 = 4o - 5o + 2g + m. Does 18 divide o? True Let o = 19 + -16. Suppose ow - 9 = -0. Suppose -4u = -wx + 172, 2x = -x - u + 182. Does 13 divide x? False Is (-14)/21 + 1880/12 a multiple of 6? True Let h(d) = 5 - 2 - 2 + 80d + 12d. Is 5 a factor of h(1)? False Let j(z) = z*3 - 15z*2 + 13z + 9. Let c be j(14). Let y(i) = -i + 7. Let l be y(c). Suppose 20 = 2d - l. Does 6 divide d? False Let c = 1086 + -592. Is 23 a factor of c? False Let s = 335 - 351. Let r(a) = 15a*2 - 22a - 3 + a*3 - 10 + 1. Is r(s) a multiple of 28? True Let n(p) = 21p - 4p - 1 - 10p + p*2. Is n(-8) even? False Let c(a) = -6a + 20 - 67 + 32. Let f be c(-11). Is 21/7 + f + 2 a multiple of 10? False Let q be -9 - (-1 - (4 - 3)). Let s = -3 - q. Suppose 2 = n - s. Is 6 a factor of n? True Suppose -g - c - 128 = -2c, 0 = -3g + 2c - 385. Let l = 13 - g. Suppose -86 = -2k - 4d, 8k - 4k + 2d - l = 0. Is 22 a factor of k? False Let u = 17 - 12. Suppose -ul + 6 = -94. Is l a multiple of 15? False Suppose 0 = 10d - 4d - 1794. Does 6 divide d? False Let j be -1 - (3 + (1 - 5)). Suppose j = 4z - b + 2b - 11, 0 = z - 3b + 7. Let d = z - 0. Is d a multiple of 2? True Let f(x) = -4x - 3. Let u be f(-4). Suppose -4q + 5c - u = 0, 14 = -q + 4c - 3. Suppose 0 = 3v - 15, -z - qv + 33 = z. Is 3 a factor of z? True Suppose -2w + 45 + 175 = 0. Suppose 0 = -5a - 3d + 37 + w, -2d - 92 = -3a. Does 20 divide a? False Is (-957)/(-5) + (-3)/(-5) a multiple of 12? True Suppose 3v - 645 - 82 = -4o, -732 = -4o - 4v. Let w = o - 26. Is 8 a factor of w? True Let q be 0/((-3)/(12/16)). Suppose q = -2h - 3h + 5g + 25, -3g - 27 = -5h. Suppose hb = b + 70. Is 8 a factor of b? False Suppose 724n - 731n + 840 = 0. Is n a multiple of 5? True Let d = -164 - -347. Let i = -46 + 46. Suppose i = -2z - z + d. Does 22 divide z? False Suppose 3i - 63 = 87. Let u = 57 + -26. Let k = i - u. Is k a multiple of 6? False Suppose -4721 = -5k - 2l + 1783, -2k - 2l = -2598. Is k a multiple of 62? True Suppose 5u - 6371 = 4p - 0p, 2u - p - 2549 = 0. Is u a multiple of 51? True Let i(n) = n + 6. Let p be i(-6). Suppose -3f + f - 196 = p. Let a = f + 170. Is 24 a factor of a? True Is (-2)/(-14/272) a multiple of 34? True Let a(z) = -21z*3 + 11z*2 + z + 4. Let c(k) = -4k*3 + 2k*2 + 1. Let x be (-5)/((-15)/39) - 2. Let t(j) = xc(j) - 2a(j). Is t(-3) a multiple of 21? True Let c = 2085 - 1734. Does 27 divide c? True Let u = 85 + -87. Is 44 a factor of u/(-5) - 1756/(-10)? True Suppose c + 784 = 8c. Suppose -2 = -i + 2, 0 = -2n + 4i - 150. Let g = c + n. Does 13 divide g? False Does 20 divide (6/15)/((-7)/(-6440))? False Is -53/(-10)1202 a multiple of 17? False Suppose 80 = -22v + 30v. Does 2 divide v? True Suppose -16i - 2902 = -19974. Does 6 divide i? False Let w = 7 + -1. Let k = 15 + w. Let m = 0 + k. Is 7 a factor of m? True Let r = -655 + 659. Does 2 divide r? True Suppose 9 = 4a - 5r + 2r, 2a - 3r = 3. Suppose -4m - 5s = -325, 0s - 163 = -2m - as. Is 40 a factor of m? True Suppose -6 + 2 = -4w. Let j be -3 + -1 + 8/w. Suppose -3h - 18 - 14 = -5l, 0 = -jh + 4. Is 2 a factor of l? False Suppose -16 = -4h - 5r, -h + 4 = -4r + 7r. Let k(p) be the third derivative of p5/20 - 5p*4/24 + 5p*3/3 + 6p*2. Does 11 divide k(h)? False Let w(x) = 5x*3 - 13x*2 - 6x + 16. Is 37 a factor of w(6)? True Let r(b) = b*3 - 3b*2 - 7b + 2. Let z be -7(-1 + 2 - 4 - -2). Is r(z) a multiple of 29? False Let j(q) = -q3 + 11q*2 - 9q - 8. Let g be j(10). Suppose 8 = 3z - 7z + gk, 3k - 12 = z. Suppose z = -2o - 5o + 56. Is o even? True Let l(x) = 22x - 156. Is l(10) a multiple of 16? True Let f(x) = x3 + 2x - 2x - 4x*2 + 6 + x - 7. Is 29 a factor of f(5)? True Suppose -3p + 323 = -244. Is p a multiple of 3? True Let b = 20 - 20. Suppose -n + 44 + 38 = b. Suppose w = -w + n. Does 7 divide w? False Suppose 0 = 25g + 12956 - 76306. Is g a multiple of 53? False Let w(a) = -a3 - a2 + a + 14. Let t be w(0). Let q = 56 + t. Does 14 divide q? True Suppose -5v = 4k - 1364, 3k + 17 = 2v - 524. Does 11 divide v? False Suppose -2u = 4d - 4186, -4d + 4u = -4995 + 779. Suppose 6r = 65 - d. Is ((-9)/(-6) - 2)r a multiple of 27? False Is 164/((18/30)/((-15)/(-50))) a multiple of 17? False Suppose -3p - 3z + 0z = -1242, 0 = -p - 5z + 422. Does 90 divide p? False Let p(d) = d2 - 8d + 4. Let i = 24 - 16. Let u be p(i). Let k(s) = s*2 - 4s + 2. Is k(u) even? True Let f = -28 + 33. Suppose 63 = 8y - fy. Does 11 divide y? False Let i = 16 - 6. Suppose ip = 7p + 318. Is p a multiple of 12? False Suppose -4h + 3h + 38 = 0. Suppose 7o + 4 = -h. Let z(n) = 3n*2 + 15n + 3. Does 7 divide z(o)? True Suppose -3q + 2 + 4 = 0. Let l be (-28)/16(-1 - -4 - 7). Does 5 divide 10 + (2 + q - l)? False Is 53 a factor of (-826)/(-4) - (-3)/6? False Let z(i) = 18i2 + 28i - 222. Is z(8) a multiple of 27? False Suppose -f + 0g = -g - 21, -4f = 3g - 84. Let m be (2 + -1 + 18)/1. Suppose m = 4j - f. Does 5 divide j? True Is 9 a factor of (-28)/(-14)333? True Suppose 0r = r + 3n - 11, -5n = 15. Is 27 a factor of (-30)/r54/(-1)? True Let k be (3 - -5 - 2)13. Suppose 2n = 2t - 10, 4n - 3n + 1 = -t. Suppose -tm = -0m - k. Does 8 divide m? False Suppose 5q + 42 = u, 4u + 5q = u + 166. Suppose -u = -2x + 32. Let s = x - 26. Is s a multiple of 5? False Let q be (-6 + -73 + 6)(0 + -20). Suppose 0 = 31m - 27m - q. Is 54 a factor of m? False Let l(w) = 134w2 + 23w - 79. Does 7 divide l(3)? False Suppose 4c + 7u - 428 = 3u, 4u = 2c - 184. Is 51 a factor of c? True Let l(r) = 5r*2 - 2185r + 2 + 2185r. Does 3 divide l(1)? False Suppose 2b + 163 = 5i - 190, 0 = -4i - 2b + 268. Is 13 a factor of 2/24i8? False Let l(b) = 0 - b - 4b*2 + 5b*2 - 4. Let o be l(3). Is o - -85 - (2 + 1) a multiple of 21? True Suppose 0 = -c + 5, -3q + 8q - 2c = 2720. Does 14 divide q? True Let g(o) = 81o2 - 4o - 16. Is 25 a factor of g(-5)? False Suppose b + 5q = -5, 5q - 2 = -4b + 8. Let d = 3 + b. Suppose 7 = -5w - d, -4j = 2w - 34. Does 4 div	{ "pile_set_name": "DM Mathematics" }
+ (-3)/4. Suppose 0 = -2t - 0t + 2. Are d and t unequal? True Let t = -457/4 - -115. Which is bigger: 1 or t? 1 Let r = -2 - 0. Let i be -5(-2)/(1 + -3). Let x = i - -2. Which is smaller: r or x? x Let v(a) = 5a*2 + a - 1. Let x be v(-2). Is 0.1 equal to x? False Let p be (-1)/(3/(-4) - -1). Let v = 7 + p. Suppose -3r + 5o - 6 = -34, 2o + 13 = 3r. Which is greater: v or r? v Let q be -144 - 2(-3)/(-2). Let w be 427/q - 3-1. Which is bigger: 1 or w? 1 Suppose 25 = 2u + 7. Let g be ((-60)/35)/6 + 58/7. Is g greater than or equal to u? False Let d = -8 + 39. Suppose -4f + 1 = -d. Which is smaller: f or 7? 7 Let c be 78/10 - 9/(-45). Suppose -3d + 0d - 4 = -2b, -4b = -5d - c. Which is smaller: -3/7 or d? -3/7 Let q be 5/((-34)/4 + 0). Let n = 64/51 + q. Which is smaller: 2 or n? n Let g = 521387/5442 + 23/907. Let b = 63 + 32. Let o = b - g. Is -2 greater than or equal to o? False Let k(p) = 5p + 2. Let j be k(-1). Let g be 2/j24/32. Which is smaller: g or 0? g Let w(c) = -4 + c*2 + 2c*2 + 9 + 5c - 2c2. Let a be w(-4). Which is greater: -2/9 or a? a Let o = 52 - 51. Does o = -0.1? False Let t = -1.3 - -8.3. Let c = -14 + t. Let n = c - -9. Which is bigger: n or 1? n Let a(v) = -9v + 1. Let k be a(-1). Let l be 23/k - (-3)/15. Which is smaller: 3 or l? l Suppose -5a + q - 5q = -16, -8 = -2q. Suppose j + 1 = -aj. Is -1 at most j? True Suppose 4s + 8 + 2 = 3q, 0 = 5s + 4q - 3. Let u = s - -8/5. Which is bigger: u or 2? 2 Suppose -2n = -1 - 3. Suppose 0 = -4o + no. Which is greater: 5/6 or o? 5/6 Let o = 1.24 + 2.79. Let x = o + -0.03. Let t = 0 - x. Are 1/2 and t equal? False Let x be (-2)/3 + (-96)/(-90). Is -1/6 greater than or equal to x? False Let x be (6/(-10))/((-24)/16). Which is smaller: 16 or x? x Let v = 5.5 + -1.5. Let u = -7 + 11. Let x = v - u. Which is bigger: x or 2/3? 2/3 Suppose -a - 3a - j + 13 = 0, 3a = -3j + 12. Suppose -av = -6v. Let m = v - -1. Is 1 not equal to m? False Let g(x) be the first derivative of -x*4/4 + 5x*3/3 + 7x*2/2 - 5x - 2. Let j = 0 - -6. Let u be g(j). Which is smaller: u or -1? -1 Suppose 2b = -4p + 20, 3p = -6b + 3b + 15. Suppose 7c = 4c. Is b greater than c? False Suppose v - 7 = 5. Let o(j) = 2j*3 + 20j*2 + 5j + 63. Let x be o(-10). Which is smaller: x or v? v Let j = -0.0111 + -401.9889. Let b = j + 412.01. Let z = 10 - b. Is 1/4 not equal to z? True Suppose 0 = -21p + 17p - 4. Let j(g) = -g*3 - 5g*2 + 7g + 7. Let m be j(-6). Is p greater than m? False Let r be (10 - 12)/(4/(-2)). Is r greater than 4/25? True Suppose -54c + 67c = 13. Is 2/29 > c? False Suppose -20 = -112y + 110y. Is 9 greater than or equal to y? False Suppose -29 = -4o - 5. Do o and 6 have different values? False Let l be (-2)/((12/(-9))/(-4)). Which is greater: -8 or l? l Let b(j) = j3 - 2j*2 - 6j + 1. Let l be b(4). Suppose 0 = -lm + 4m - 85. Which is smaller: -16 or m? m Suppose -p + 5z = -15, -6z - 12 = -2p - 5z. Suppose 0 = m + 4, -pn - 27 = m - 3. Which is smaller: -3 or n? n Let m(o) = -6o*3 + 5o*2 + 5o*3 - 5o*2 + 4o*2 + 4o. Let b be m(5). Let c be -3 + 0 + (-13)/b. Is c < 1? True Let d = 4 - 6. Let z be -3 + 5 + 5/d. Suppose -5v - 10 = -3q, -2v + q - 1 = 3. Which is smaller: v or z? v Let z be (-1)/2(-321)/(-143). Let d = z + 15/26. Let k(h) = -2h + 3. Let i be k(2). Is d at least i? True Let i(o) = 4o*2 + o + 1. Let p be i(-1). Suppose 0 = g + pg - 15, 4g + 2 = -2z. Which is greater: -6 or z? -6 Let m(r) = 6r + 7. Let g be m(-5). Is -23 at most g? True Let m(j) = -4j + 0j - j - j2 - 2. Let g be m(-3). Suppose gk = k. Is k equal to -2/5? False Let b(c) = c*2 + 4c - 21. Let p be b(-7). Is p equal to 3/4? False Suppose 3m = -x - 17, x = 4m + 2 + 16. Let h be 1/4 - ((-15)/12)/(-5). Which is smaller: h or x? x Let j = -83 + 83. Is j not equal to 38? True Suppose -x + 5x + 9 = 5k, 5x + 6 = k. Let y = -6 + 7. Let v be y - (4/(-3) + 2). Which is smaller: v or x? x Let y(h) = h3 + 13h*2 + 12h + 1. Let m be y(-12). Which is bigger: 0 or m? m Let m = 15 + -16.5. Let b = m + -1.5. Which is smaller: b or 0.1? b Let w(g) = -g*3 + 6g*2 + 8g - 3. Let k be w(7). Let c = 1/116 - -217/58. Do k and c have the same value? False Let j be (4/8)/((-4)/82). Let g be 0 - -1 - 2/4. Which is smaller: g or j? j Suppose -4j = j. Do j and 1/14 have the same value? False Let b(s) = -s*2. Suppose a - 3a - 3 = 5g, 5g = 4a - 9. Let c be b(g). Is c at most 4/11? True Let v(f) = f3 + 4f*2 + 3f + 2. Let s be v(-3). Suppose -so - o = -3. Let g = 0 - o. Is -1 not equal to g? False Suppose -16 = 3g - 5s, 3g + 2s = -2s - 25. Let o = 7 + g. Which is smaller: -2/11 or o? -2/11 Let p = -1.1 + 6.1. Let q = p - 4. Is q less than -1? False Let a = 0.19 - -4.71. Let j = a + -5. Which is smaller: 1 or j? j Let x(o) = o*3 + 2o*2 - 3o - 2. Let k be x(2). Which is bigger: k or 7? k Suppose 0 = 5f + 2n - 4, -2f + 3n - 8n + 10 = 0. Is 2/9 less than f? False Let n be (-4)/63 + (-4)/(-14). Let d be 1 - 0 - (-2 + 4). Which is smaller: d or n? d Let q(w) = -5w*2 + 0w*2 - 3w*2 - 3w - w*3 - 3w + 3. Let i be q(-7). Let u be -2(i/14 - 0). Is 0 < u? True Let z = 113/9 + -38/3. Let a = -18 + 13. Let o = a + 4. Are o and z unequal? True Let a = 0 + 30. Let r be (-51)/a-2 + -3. Which is greater: -1 or r? r Let a = 1229 - 11084/9. Let w be (22/(-28))/(99/286). Let y = w - a. Which is smaller: -1 or y? -1 Let b = 31 - 32. Let y be (-1 - -1) + (-3 - -4). Let q = -2 + y. Is q at least b? True Suppose 4w + w = -4x + 47, 27 = 3x + w. Suppose -3u + 7u + x = 0. Is -2 less than or equal to u? True Let u = -15 - -15.7. Let o = -1.5 - u. Let m = o - -2. Is -0.1 less than m? False Let q(i) = 260i*2 + 5i + 6. Let s be q(5). Let k = s - 38849/6. Let f = -56 + k. Is 0 not equal to f? True Let c = 3 - -6. Let h(b) = -b*2 + 9b + 1. Let u be h(c). Which is smaller: 2/21 or u? 2/21 Suppose m + 4 = 2m. Let b(q) = 3q - 4 - q*2 + 0q + 9. Let w be b(m). Is -3 bigger than w? False Let y = 14/121 - -151/121. Which is smaller: 1 or y? 1 Let s = 3.2 + -3.3. Which is smaller: 22 or s? s Let j = 3 - -9. Suppose -5h + 15 = -5. Suppose 1 = -5x + 16, hx - j = 5g. Is g <= -1/4? False Let m(u) = u*3 + 2u*2 - 5u - 4. Let w be m(-3). Suppose -n = n - wt + 4, 3n + t - 2 = 0. Does 0 = n? True Let o be -1 - 5/((-20)/104). Let c = 36 - o. Do 10 and c have the same value? False Let a = -2 - -20. Let q be (-27)/a(-8)/(-3). Let n(t) = -t2 + 3t + 7. Let w be n(5). Which is smaller: w or q? q Let u be 1 + (-42)/(-4) - (-1)/6. Is 12 smaller than u? False Let r = -20 - -28. Suppose 5d - 3d = r. Let x(l) = l*3 - 5l*2 + 3l + 4. Let u be x(d). Is u < 2/13? True Let s(y) = -y + 2. Let d be s(-4). Suppose -1 + d = 5r. Let l = 9/7 + -88/63. Are l and r equal? False Let a = -15 - -4. Let d = 3 + a. Which is smaller: d or -7? d Let a = -1.45 - 0.05. Let t = 0.9 + a. Let d = t - -0.7. Are -1/2 and d equal? False Suppose -2u - 5 = 5s, -3s + 2s - 1 = 5u. Suppose 5v - 2v = u. Which is smaller: v or 1? v Let z be 904/(-2448) - 2(-1)/9. Which is smaller: -1 or z? -1 Let d(t) = t2 + 12t + 1. Let o be d(-12). Suppose -2v - 9 = v, -5v - 13 = y. Which is greater: y or o? y Let j(l) = -l*3 + 13l*2 - 7l - 23. Let k be j(12). Which is greater: 36 or k? k Let c = -347.01 + 353. Let v = c + 0.01. Let u = 8 - v. Which is smaller: u or 0? 0 Suppose -2 = -2q + 2. Suppose 0 = -3u + qu + 3. Let f be (2/(-4))/((-2)/16). Are f and u non-equal? True Let l = -23 + 16. Let w(t) = -t - 6. Let h be w(l). Which is greater: 3/7 or h? h Let f be 2/(-3)-61. Suppose 5a - 3j + j = 79, fj + 23 = a. Let x be 1/a + 6/(-15). Which is greater: 0 or x? 0 Suppose 4g = -h + 3, 0 = 4h + 2g + g - 12. Suppose hl = -0l - 6. Let z = 13 + -15. Is l greater than or equal to z? True Suppose 0 = 5r - 3w - 18, 0r - 4w + 4 = -2r. Suppose 0y + 5i = -2y - 10, -3i = r. Which is smaller: y or 1/2? y Suppose -709 = -2c - c - l, l - 239 = -c. Let m = c - 2117/9. Let k be (0 - 1)/(2 + -3). Is k less than m? False Let s(d) = d2 - 7d + 3. Let o be (-4 - 3)12/(-14). Let q be s(o). Do -4 and q have different values? True Let l be 8/(-270)(-3)/(-2). Is l bigger than	{ "pile_set_name": "DM Mathematics" }
532a for a. -22 Solve 0 = 8a + 71039 - 71023 for a. -2 Solve -544r - 540r - 12 = -1086r for r. 6 Solve -144m = -1640 + 56 for m. 11 Solve -399j - 2 = 239 - 1438 for j. 3 Solve -492 = -373g + 496g for g. -4 Solve 0 = -11a + 62 - 41 + 34 for a. 5 Solve -658 + 430 = -19d for d. 12 Solve 508v - 567v = -649 for v. 11 Solve 47z - 1273 + 1696 = 0 for z. -9 Solve 168 = 22y - 118 for y. 13 Solve -178k + 55k + 462 = -90k for k. 14 Solve 22c + 101 - 50 - 139 = 0 for c. 4 Solve 183j + 31074 = 35283 for j. 23 Solve 71k - 471 = -107k - 115 for k. 2 Solve -19t - 10t + 5t = 168 for t. -7 Solve -20w - 70w + 1350 = 0 for w. 15 Solve -188d = -3490 + 3866 for d. -2 Solve 18i = 5i - 19i + 416 for i. 13 Solve 60 + 251 = -36n - 265 for n. -16 Solve 372 = -17g + 13g + 66g for g. 6 Solve 518 - 1114 = -39p - 518 for p. 2 Solve -61l + 69l = -206l + 2996 for l. 14 Solve 0 = 212s - 1602 - 1154 for s. 13 Solve 665y - 504y - 966 = 0 for y. 6 Solve -30r - 616 = -226 for r. -13 Solve 428j - 442j = -196 for j. 14 Solve -887q - 560 = -915q for q. 20 Solve 0 = -161u + 44u - 56u + 173 for u. 1 Solve -4245p + 4243p = -38 for p. 19 Solve -26578 + 26650 = 12x for x. 6 Solve -6559 = -194p + 1131p for p. -7 Solve 373a + 873 + 418 = -947 for a. -6 Solve -10f - 201f - 2f + 2130 = 0 for f. 10 Solve -74a + 2415 = 12a - 17a for a. 35 Solve 1284 = -62r + 416 for r. -14 Solve 944c = -4164 - 556 for c. -5 Solve -10v - 17v + 204 = 7v for v. 6 Solve 0 = 183y + 4550 + 25 for y. -25 Solve -891 = -242u + 161u for u. 11 Solve -20v + 5 + 4 = -21v for v. -9 Solve -531 = -25y - 481 for y. 2 Solve -83x + 4368 = -65x + 294x for x. 14 Solve 205 - 547 - 118 = -230i for i. 2 Solve -51a - 1080 = -213 for a. -17 Solve -211w = -232w + 126 for w. 6 Solve 5192 = 70i - 719i for i. -8 Solve 9441f - 9697f - 2560 = 0 for f. -10 Solve 9577p - 9560p + 374 = 0 for p. -22 Solve -804i - 108 = -813i for i. 12 Solve 45d + 13d + 546 = 16d for d. -13 Solve -1265 + 42 = -446n + 1007 for n. 5 Solve -40928b + 75 = -40933b for b. -15 Solve -41 = 18j + 84 + 109 for j. -13 Solve -17x = -12x + 10x + 150 for x. -10 Solve -69m = -77m + 8 for m. 1 Solve -22m = 76m + 980 for m. -10 Solve 344r - 1925 = 519r for r. -11 Solve 88s - 38s = 52s - 28 for s. 14 Solve -3k - 900 = -50k - 28k for k. 12 Solve -14s = -201 - 23 for s. 16 Solve 1066s = 1091s + 125 for s. -5 Solve -245o + 33 = -503o + 247o for o. -3 Solve 83b + 870 + 65 = -2053 for b. -36 Solve 99 + 337 = -238v - 754 for v. -5 Solve -139g = 108g - 225g + 396 for g. -18 Solve 0 = -960v + 1258v - 4768 for v. 16 Solve -238 = 344h - 307h + 95 for h. -9 Solve 2408 = -41c + 1916 for c. -12 Solve -45p - 240 = -4 - 56 for p. -4 Solve 0 = 86g - 720g - 8330 + 1990 for g. -10 Solve 768z = 918z - 3450 for z. 23 Solve -3670f + 3674f + 96 = 0 for f. -24 Solve 25y + 25y + 28 = 64y for y. 2 Solve -7w - 5w = -85 + 1 for w. 7 Solve -177v + 40v = 59v + 4900 for v. -25 Solve 209z - 201z + 8 = 0 for z. -1 Solve 8 = -64n + 68n for n. 2 Solve -3504 = -83j - 136j for j. 16 Solve -1427o + 1441o = 154 for o. 11 Solve 128h + 10 = 133h for h. 2 Solve 29 = -1193u + 1164u for u. -1 Solve -248 + 473 + 554 = 41c for c. 19 Solve -380 - 250 = -17c + 87c for c. -9 Solve 0 = -266g - 577 - 1019 for g. -6 Solve 500z + 1470 = 5970 for z. 9 Solve 0 = -47w + 5570 - 5523 for w. 1 Solve 27 = -29q - 60 for q. -3 Solve 1215 = 4733s - 4814s for s. -15 Solve 303s + 588 = -220s + 439s for s. -7 Solve -480 = 245063d - 245079d for d. 30 Solve 903c + 5530 = 350c for c. -10 Solve 11506 - 12570 = 76u for u. -14 Solve 41g = 54g - 156 for g. 12 Solve -32103w - 72 = -32115w for w. 6 Solve 10136 = 992r - 8430 - 5242 for r. 24 Solve 30v = 1739 - 1127 - 1032 for v. -14 Solve -83q + 312q - 2519 = 0 for q. 11 Solve 23o = -34o + 15o - 210 for o. -5 Solve 67 = -88j - 532 - 193 for j. -9 Solve -5172 = -306b - 1806 for b. 11 Solve -9t + 30t = 15t for t. 0 Solve 23314 + 4910 = -169y + 1177y for y. 28 Solve 24t = -95t - 57t + 3168 for t. 18 Solve 107w + 3692 = 7w - 184w for w. -13 Solve 0 = 2555y - 2605y - 300 for y. -6 Solve 759 = 12i + 687 for i. 6 Solve -202 = -21k - 412 for k. -10 Solve -462p + 1098 - 565 = -853 for p. 3 Solve -15b + 1330 = 65b - 10b for b. 19 Solve 15o - 384 = -81o for o. 4 Solve 346a + 117 = 337a for a. -13 Solve 0 = 2y + y + 11y - 28 for y. 2 Solve 263b = 168b - 760 for b. -8 Solve -717t + 12412 = -4796 for t. 24 Solve 306n - 138n = -735 - 777 for n. -9 Solve -7 = 38y - 6 - 1 for y. 0 Solve 4582 = -476g - 1379 - 1655 for g. -16 Solve -80b - 8696 = -9736 for b. 13 Solve 1294b - 1117b = -4956 for b. -28 Solve -a - 44 - 16 = -6a for a. 12 Solve 5j = 15 - 30 for j. -3 Solve -528 = 110w + 109 + 1453 for w. -19 Solve -680 = -8313z + 8177z for z. 5 Solve -243d + 233d = -40 for d. 4 Solve -114l - l = -25l - 1980 for l. 22 Solve -221n - 260 = 1522 + 870 for n. -12 Solve -24 = -20j - 84 for j. -3 Solve 106v + 1362 + 916 = -28v for v. -17 Solve 6268 - 6925 = -219h for h. 3 Solve 458a = 903a + 15575 for a. -35 Solve 13w - 21w + 660 = 58w for w. 10 Solve 497a + 45 - 7997 = 0 for a. 16 Solve -2528n + 2525n = -27 for n. 9 Solve s - 18 = 2s - 3s for s. 9 Solve 3l + 24l + 919 + 53 = 0 for l. -36 Solve 84r - 40 - 50 = -6 for r. 1 Solve -95i - 86i - 247 = -162i for i. -13 Solve -194v + 78 = -42v + 2814 for v. -18 Solve 389l - 2562 = 47l + 1542 for l. 12 Solve 0 = 2k + 87k - 14 - 253 for k. 3 Solve -161b + 45 = 850 for b. -5 Solve 0 = 115t - 430 - 1180 for t. 14 Solve -18r - 82 = 39 - 157 for r. 2 Solve -42t + 132t + 135t - 2475 = 0 for t. 11 Solve 0 = 344k - 11676 + 4796 for k. 20 Solve 176d - 752 = 218 + 1142 for d. 12 Solve 4777 = -80w - 201w for w. -17 Solve 418l = 606 - 16072 for l. -37 Solve 55x + 39x = 110x - 64 for x. 4 Solve -106f + 109f = 57 for f. 19 Solve 5419 - 2037 = 321b - 7853 for b. 35 Solve 442 - 148 = -76z - 162 for z. -6 Solve -195d + 283d - 2552 = 0 for d. 29 Solve 15x - 14502 + 14652 = 0 for x. -10 Solve 103r - 304 = 27r for r. 4 Solve 1065 = 88k + 1297 + 1616 for k. -21 Solve -13u - 436 + 352 = -u for u. -7 Solve -15d = 6d - 27 - 225 for d. 12 Solve -206 = 47w - 262 - 273 for w. 7 Solve 0 = -11p - 5891 + 5902 for p. 1 Solve 84 = 27k + 516 for k. -16 Solve 140 = -22692w + 22682w for w. -14 Solve b + 159 = -51b - 829 for b. -19 Solve 3l - 24l - 30l + 510 = 0 for l. 10 Solve 2260 + 1682 = 557q - 119q for q. 9 Solve 10j = 78 - 58 for j. 2 Solve -78r - 29r - 96r + 2030 = 0 for r. 10 Solve 0 = 9a - 45a - 45 - 279 for a. -9 Solve 545 = -118y - 517 for y. -9 Solve -114d = -152 - 2304 - 52 for d. 22 Solve -23k = -197 - 10 for k. 9 Solve -264j = 204j - 509j + 902 for j. 22 Solve -58o + 876 = -34o - 316o for o. -3 Solve 70v = 249v - 537 for v. 3 Solve 1444w = 1428w + 80 for w. 5 Solve -269n + 1270 = -1420 for n. 10 Solve 912 = -361o + 133o for o. -4 Solve 55v - 826 = 468v for v. -2 Solve -27 - 94 = -11c for c. 11 Solve -27z + 660 = 17z for z. 15 Solve 0 = -22130m + 22102m + 308 for m. 11 Solve -83q = -77q + 22 + 56 for q. -13 Solve 4h + 2299 = 108h + 17h for h. 19 Solve -166l = 150l - 106l + 6720 for l. -32 Solve -414 = -875m + 737m for m. 3 Solve -485 = 43m + 289 for m. -18 Solve -8099t = -8093t - 150 for t. 25 Solve 5168 = -61t - 897t - 580 for t. -6 Solve 1937 = -711w + 64w - 4533 for w. -10 Solve -3377s = -3357s + 140 for s. -7 Solve 10v = -2v - 221v - 1165 for v. -5 Solve 32n + 14n = -276 - 138 for n. -9 Solve -15 = -107k + 110k for k. -5 Solve 8x - 40x - 103 = 249 for x. -11 Solve -2668x = -2646x - 198 for x. 9 Solve 101332q - 101349q - 612 = 0 for q. -36 Solve -3x = 5x + 177 - 241 for x. 8 Solve 30x - 13x + 43x + 2040 = 0 for x. -34 Solve 6899 + 7552 = 495z + 2076 for z. 25 Solve -391 + 1061 = -194w - 1658 for w. -12 Solve 0 = 11h + 69 + 17 - 9 for h. -7 Solve 0 = 319k + 3384 + 1401 for k. -15 Solve 0 = -59s + 55s + 24 for s. 6 Solve -u - 358 - 353 = -724 for u. 13 Solve -27o - 520 = o - 16 for o. -18 Solve 49j - 80j - 372 = 0 for j. -12 Solve -248p + 703*p = 5	{ "pile_set_name": "DM Mathematics" }
0.1 in -11, -20, 95? -11 Which is the closest to 0.07? (a) 2/3 (b) 25 (c) -0.78 (d) -0.3 d What is the nearest to 32 in -5, -3/178, -0.4, 5, -3? 5 What is the nearest to 1 in -294, -2, -0.02, 0.5, 140? 0.5 Which is the nearest to 2/41? (a) 40.3 (b) -0.2 (c) 4 b What is the closest to 4 in -1, 6/17, 3, 0.3, -2/23? 3 Which is the closest to -0.1? (a) 44 (b) 2/15 (c) -2.6 (d) -0.3 d Which is the nearest to 4? (a) -2 (b) -0.3 (c) 3/4 (d) -370.7 c What is the closest to 6 in 2/17, 0, -1, -2, -0.37? 2/17 What is the nearest to 0 in 6/7, 17, -0.09, -0.04, -5/6? -0.04 What is the nearest to 4 in 1.9, -0.4, -1, -4, 50? 1.9 What is the closest to 3/5 in 26, -12/5, -1? -1 What is the closest to 0 in 2, -1, 6, 108.6, -2/3? -2/3 What is the nearest to 140 in -0.9, 0.3, 4, 2/9? 4 Which is the closest to 2/7? (a) 3/8 (b) 0.1 (c) -2/3 (d) 724 a What is the nearest to 0 in -2, 189, 0, -3/4, 1/5? 0 What is the nearest to 1 in 1348, -0.5, 4, 11? -0.5 Which is the nearest to -1? (a) 15 (b) -0.2 (c) -3 (d) 3 (e) 3/16 b Which is the nearest to -2/5? (a) -14 (b) -5/8 (c) 13/8 b What is the nearest to -0.3 in -160, -2, -8? -2 What is the closest to 0.037 in 229, -2/13, -5? -2/13 What is the closest to -0.5 in -1/9, 9/4, -0.8, 4/7? -0.8 Which is the closest to 4/7? (a) 2 (b) -0.8 (c) 3 b Which is the closest to -1? (a) -0.4 (b) 0 (c) -244.6 (d) -0.5 d Which is the closest to -2/5? (a) -19 (b) -0.03 (c) -11 (d) 1 b What is the nearest to -1 in 1/77, 5, -1.34, -1/4, 3? -1.34 Which is the nearest to 1/3? (a) 87 (b) 14 (c) 0.4 (d) 1 (e) -3 c Which is the nearest to 23? (a) 2/11 (b) 1.7 (c) -2/81 (d) 4 d What is the closest to -7 in 2/19, -0.0563, -2? -2 What is the nearest to -0.3 in 33, -5, 3, -1/5, 0.047? -1/5 What is the closest to 1 in -0.5, -1366, 1, -0.3, -2? 1 Which is the closest to -4? (a) 38 (b) 2/3 (c) -6/245 (d) -0.1 (e) -0.3 e What is the closest to -1/6 in -2/11, -7/4, -71? -2/11 What is the nearest to 5 in 0.3, 0, -17, 1/4? 0.3 What is the nearest to 80 in 0, 1097, 1, -4? 1 What is the nearest to 10 in -1842, -2/7, -3? -2/7 What is the nearest to 2 in 5, 4, 1/3, 1/6? 1/3 Which is the closest to -0.1? (a) 9 (b) -1 (c) -2 (d) 1/3 d Which is the nearest to 0.4? (a) 7 (b) 2/9 (c) 1/31 (d) -4 (e) 14 b Which is the closest to 22? (a) 16 (b) -16 (c) -3 a Which is the closest to 2/5? (a) 0.5 (b) -2 (c) 4 (d) 0.08 a Which is the nearest to -0.3? (a) 5 (b) -15/29 (c) 0 b Which is the closest to -0.3? (a) 0.3 (b) -13 (c) 1/47 (d) -4 c Which is the nearest to 1? (a) -2081 (b) -3 (c) 3 (d) -10 c Which is the nearest to -2? (a) 3617 (b) -2/11 (c) 0.01 b Which is the nearest to 0? (a) -18/1111 (b) -0.5 (c) 0.2 (d) -3/5 a Which is the closest to 382/37? (a) -1/2 (b) 12 (c) -0.2 (d) 0.5 b What is the closest to 5/3 in -4, -3, 0.5, -0.137? 0.5 Which is the closest to -1? (a) -0.4 (b) -1928 (c) -0.11 (d) -1 d What is the nearest to -8018/5 in -5, -1, -1/2, 5? -5 Which is the closest to 0? (a) 103 (b) -1/2 (c) 0.075 (d) -2 c What is the closest to -4 in 0, 2, 1/7, -2? -2 Which is the closest to -1/11? (a) -4/9 (b) 4 (c) -4780 a Which is the nearest to 385? (a) -4 (b) -0.1 (c) -0.06 c What is the nearest to 0.1945 in 3.3, 2, 2.4? 2 What is the nearest to -13 in -0.6, 5/7, 2/9, 3, -3? -3 Which is the closest to 40? (a) -1/7 (b) 3/8 (c) 17 (d) 2 c Which is the closest to 0.1? (a) 45.2 (b) 4 (c) -2/3 (d) 12 c Which is the closest to 7? (a) -490 (b) -1/7 (c) 0.1 c Which is the nearest to -5.2? (a) -3 (b) 2 (c) 5 (d) 1 a Which is the nearest to -1? (a) 3 (b) 2 (c) 0.3 (d) 13395 c What is the nearest to 27 in 17.5, 0.3, -19, 4? 17.5 What is the closest to 0 in 0.09, 0.156, -4, -1/11, 0.3? 0.09 What is the nearest to -0.1 in 1.4, 3, 1.1, -1/3, -64? -1/3 Which is the nearest to 1/23? (a) 3 (b) -251 (c) 1.8 c Which is the nearest to 0.5? (a) 42 (b) 11 (c) 0.2 c Which is the closest to -4? (a) 15/28 (b) -5 (c) 1 (d) -1/5 b What is the closest to -1494 in -3, 57, 4? -3 What is the nearest to -9 in -10/83, 3, 0, 4? -10/83 Which is the closest to -2/33? (a) -1 (b) 0.2 (c) 2 (d) -38/3 (e) 4 b Which is the nearest to 1? (a) 2/5 (b) 1 (c) 51 (d) -3/2 b What is the nearest to 5 in -4, -15, 250/11? -4 What is the closest to 2/7 in -3, -1, -8, 0.05? 0.05 Which is the nearest to 0.11? (a) -15 (b) 0 (c) 1/6 (d) 3 c What is the closest to 0.1 in -1/7, -8, 2/5, 31.3? -1/7 Which is the nearest to -4? (a) 32 (b) -1/8 (c) 4 (d) -0.03 b Which is the closest to 2? (a) 0.5 (b) 3/4 (c) 1 c What is the nearest to -0.1 in 18, -1, -416? -1 What is the closest to -1 in -5/2, 5925, -2/7? -2/7 Which is the nearest to 1/6? (a) 1 (b) -27 (c) -51 a Which is the nearest to 2/3? (a) -80/11 (b) 22 (c) -1/2 (d) 0 (e) 1 e What is the nearest to -0.002 in 2, 39, 4, -1/5? -1/5 Which is the nearest to 1? (a) -5 (b) -0.5 (c) 92/9 (d) -25 (e) 2/3 e Which is the nearest to 2? (a) -0.3 (b) 1.6 (c) 0.11 (d) 5 b What is the closest to -2 in -0.1, 29, 0.4, 50? -0.1 What is the closest to 172 in -65, 3, -2? 3 What is the nearest to 4/55 in -0.8, -5/13, -0.4, 0.1, -3/7? 0.1 What is the closest to 6 in -101, 0, 0.4? 0.4 What is the nearest to 2/3 in 1/2, 4, -24? 1/2 Which is the closest to 1/3? (a) 1/4 (b) 3/5 (c) 0 (d) 11/492 (e) -0.2 a What is the nearest to 0 in 2, -15, 0.4, 0.11, -16? 0.11 What is the nearest to -17 in 6/5, -0.5, -2/67? -0.5 What is the closest to -38/23 in 23, 4/3, -2/11, -0.2? -0.2 Which is the closest to 0.2? (a) -1 (b) -3 (c) 1/2 (d) -52 (e) -7 c Which is the nearest to 2? (a) -8 (b) -4 (c) -0.806 (d) -3/2 c What is the closest to 2 in 2, -79, 14? 2 Which is the closest to 160/3? (a) -17 (b) -1.1 (c) -2 b Which is the nearest to -25/6? (a) 5 (b) -20.4 (c) -4 c What is the closest to 5/5557 in -0.3, 3, 2/17, 1, 4? 2/17 Which is the closest to -2/5? (a) -64 (b) -1 (c) 130 (d) 3 b Which is the closest to 1? (a) -0.4 (b) 2/47 (c) 2/7 (d) -7/4 (e) 4/7 e Which is the nearest to 1? (a) -5 (b) -17 (c) 216 (d) -4 (e) -0.5 e What is the nearest to 0 in 0.3, -0.87, -56, -0.17? -0.17 Which is the closest to 7658? (a) 1/4 (b) 0.1 (c) 3 c What is the nearest to -2 in 0, 2/15, -0.02, 5, -5? -0.02 What is the closest to -0.408 in 2/9, -4/9, -5, -2/15? -4/9 Which is the nearest to 0.1? (a) 229/2 (b) 2/13 (c) -25 b Which is the nearest to -2/3? (a) 29 (b) 4 (c) 0 (d) -5/222 (e) -4 d Which is the nearest to -1/6? (a) 5 (b) 2236 (c) 0 (d) 8 c What is the nearest to -0.2 in -1, -0.3, 0.665, 1? -0.3 What is the closest to -3 in 7/2, 2/19, -2, -318? -2 What is the closest to 6620 in -3/8, 4, 1/7? 4 Which is the nearest to -15/4? (a) -16/9 (b) -3 (c) 2 (d) 4 b What is the nearest to 1 in -0.06, 1/3, -1, -369/5, 5/4? 5/4 Which is the closest to -351? (a) 0.4 (b) 0.058 (c) -16 (d) -4 c Which is the closest to 1/2? (a) 0.03 (b) 9/25 (c) -2/15 (d) 3/32 b Which is the nearest to 2? (a) -1/5 (b) -0.16 (c) -1/20 (d) -3/2 c Which is the closest to 0.1? (a) -0.2 (b) 79558 (c) -2/7 (d) -1 a What is the nearest to 0.8 in -487, 5, -4? 5 What is the closest to 8.4 in -2, 0.385, -2/7? 0.385 What is the nearest to 0.4 in 3, 0.2, 2/5, 3/2? 2/5 Which is the nearest to 1? (a) 0.01 (b) 0 (c) -8.1 (d) -2/3 a Which is the nearest to -3625? (a) 5 (b) 1/7 (c) 0.1 c What is the closest to -0.2 in 0.153, 0.08, -3, -2/5? -2/5 What is the nearest to 125 in -1, 0.1, -0.05, 0, -146? 0.1 Which is the nearest to 2/21? (a) 0 (b) 0.066 (c) -0.9 b What is the nearest to -30 in 3, -3, -5, 5? -5 Which is the closest to 3.6? (a) 9256 (b) 0 (c) -1/5 b What is the closest to -0.2 in 76/33, 4, 2/21, -1, -1/3? -1/3 What is the closest to -0.1 in 5/4, -0.4, 1/891, -0.05? -0.05 What is the nearest to 3 in -0.4, -5/2, 1, -1632, 4? 4 Which is the closest to 6? (a) 1/20 (b) -2 (c) -5 (d) -1 a Which is the nearest to -0.2? (a) 0.4 (b) 1/2 (c) 169 (d) 9 a What is the nearest to 1 in -1087, -0.4, 1/6, -8/9? 1/6 Which is the closest to -7/12? (a) -1/9 (b) -4 (c) 1/2 (d) -23 a Which is the closest to 3? (a) -1.11 (b) -0.01 (c) 4/7 (d) 3 d Which is the nearest to 1/3? (a) -120 (b) -5 (c) -6/11 (d) 2/9 d What is	{ "pile_set_name": "DM Mathematics" }
(-1/3))/(f/(fff*(-5)))f*0fff/(ff/(f0/ff)f)f assuming f is positive. f(-6868/21) Simplify ((h0)*2(hh(1/3))(-33))/((h/(((h/(h(hhhhh*(2/3)h)/h))/h)/h)h)(3/11)h(-6/7)/h5) assuming h is positive. h(-3119/77) Simplify ((s(1/5)s)/s39)/(s4)21 assuming s is positive. s(-609/5) Simplify ((((w6www)/w)/ww)/wwww0/w)7/((w((w/w0)/w)/w)(5/2)/(w0)47) assuming w is positive. w56 Simplify ((k/(k/(kkk(-2/11))k)kk)/(((k(kk/(kk/k(-7/6)))/k)/k)/k))(2/77)(k*(-4/5)kk(3/2)/k)(-24) assuming k is positive. k(-211469/12705) Simplify ((l(l*(-1)l)/llll/(l(-2/7)/l))/((l/l(-8))/(l/(l/((ll((l(3/8)/l)/l)/l)/l)))))(-10) assuming l is positive. l(1775/28) Simplify (((i(-13)/i(-1/2))13)(28/3))42 assuming i is positive. i(-63700) Simplify ((v16vv(8/3))/(v(-1/5)v17))(-9/8) assuming v is positive. v(-129/40) Simplify o2/(o*0o)((((o/o(-1))/o)/o)/oo)*(-6)((oo/((o/o7)/oo))/(o/(o(-5)/o)))/(o/(o/(o(-2/5)/o)))(-22/3) assuming o is positive. o(-124/15) Simplify ((r*(1/2)r(-11))/(r5r)4)(4/27) assuming r is positive. r(-46/9) Simplify ((q/q(-6)q/q*(-2/17)q)/((qqq*6)/(qq5)))/((q(-1/4))(-1/47))(3/5) assuming q is positive. q(113689/15980) Simplify (((r/(r20r))/(r/(r/(r/(r12/r)))))/((r(-11)r)/r14))(4/25) assuming r is positive. r*(56/25) Simplify (((tttt*44)/tt(-34)/t)/(t/(((t(-24/11)/t)/t)/ttt)tt44))(-31) assuming t is positive. t(13020/11) Simplify ((((r(4/3)r)/r)/(r/(r/(r/(r/r(-2/9))r))))/(r0)(-1/31))/(r*(-5/4)/(r/(rr*(3/4)))r5/(r1r)) assuming r is positive. r(-35/18) Simplify (((i4/i)/i(1/2))/(i(-1))(-35))/((i0)38/(i/(ii/i*0)i)4) assuming i is positive. i(-65/2) Simplify (y*11y8)(-1/46)/((y0)13(y(-2/9)/y)(-35)) assuming y is positive. y(-17881/414) Simplify ((((n/(n/n(-11)))/nn/n(1/7))(1/40))(-12))(2/17) assuming n is positive. n(234/595) Simplify ((s1s/(s/(ss*(5/6)/s)))/(ss*(-1/5)s(ss1/s)/s))/(s6s(s/(ss(-3)/s))/ss/(s/s*6s)s(-6)/s) assuming s is positive. s(-239/30) Simplify ((u/u(6/7))/(u/(u(-7)u))(uu(-7/4)/u)(-3/10))(-11) assuming u is positive. u(19503/280) Simplify ((v(2/5))(-1/3))*(-41)/((((vvvv/(vv(-4/5)v))/v)/((vv(-2)v)/vv))/((vv*(1/9)v)/v(1/9))) assuming v is positive. v(17/3) Simplify ((n(-2)/n)(-42))11/(n(1/6)/n*1(nn(-1/10)n)/n(-4/3)) assuming n is positive. n(6918/5) Simplify (v3/(v/v(-2/13))((v/(vv*0))/vv)16)/((v(-1))(-25))(-7/3) assuming v is positive. v*(2347/39) Simplify (uu*(2/5)/uu/(uu(2/21))u)*(6/7)((u/u*4u)(-1/16))1 assuming u is positive. u(2437/1960) Simplify (b(4/7)/((b*(3/4)b)/b))*43b*(-1/7)bb(-3/2)bb2bbb(-5) assuming b is positive. b(-233/28) Simplify ((yyy/(y/(y*(1/2)/y)y)yyy/(y/(y(2/7)/y)))/(y(2/11)y*5y))/((y(y0y)/y)/(y/(y/(((y/y*2)/y)/y)))(y0)(-5/2)) assuming y is positive. y(-1293/154) Simplify (((w(-1))(-44)/(w5/(w(-4)/w)))(-1))(-1) assuming w is positive. w34 Simplify ((((d*(-1/3)dd)/(d/d(-1/2)))/((dd(dd*8)/d)/((dd*(6/11)d)/d)))(-8))12 assuming d is positive. d(8752/11) Simplify j/(j(-8/9)j)j*(-14/5)/jj(j/(jjj(1/44)))/j(-24/11) assuming j is positive. j(-1489/1980) Simplify (t(1/8)/t5)/(((t(-6)t)/t)/(t/((t/(t/t*(-3/4)))/t)))((t/t(3/10))/t)/t(1/2)(t(-1))7 assuming t is positive. t(-157/40) Simplify (((u(3/5)u(-10))/(u(-5/3)u/u5))(2/63))(1/44) assuming u is positive. u(-4/1485) Simplify ((k(1/4)/k)(-44)/((kkkk/(k*(-1/2)k)kk)/k)*(9/8))/(k/(k/(kk(k(-11)kk)/k))k(3/8)/k)(-9) assuming k is positive. k(-795/16) Simplify (k25/(k*(23/2)/k)(((k*6/kk)/k)/k)/(k((kk*(-3/7))/kk)/k))(25/2) assuming k is positive. k(6275/28) Simplify (t(2/25))36/((t(tt*(19/2)t)/t)/tt(15/8)) assuming t is positive. t(-1899/200) Simplify (m(-2)/(((mmm(2/21)m)/m)/m)(m/(mm(-27)))(-9/4))(-7/5) assuming m is positive. m(5363/60) Simplify (((((n*(-3/4)n)/n)/nn)/(n(n/n26)/n))/(n/n(3/8))(-44))(-17/2) assuming n is positive. n*(-3519/8) Simplify ((cccc*(-2/5)cc)(29/3))0/(c(-1/2)/((c/c(-2/3))/c)(c2)12) assuming c is positive. c(-137/6) Simplify ((r/((r(-3)/r)/r))/(r/(r/(r/r1))))/(r/r(-1))*(8/3)((r1/r)28)41 assuming r is positive. r(2/3) Simplify (a*(-5/3)(a(-1/9)/a)/a)/(a/a(1/3))*50((a(a(-1/5)/a)/aa)(-22))(-7/8) assuming a is positive. a(-7373/180) Simplify (r3)*(4/9)r*(-4/27)r((r/(rr(23/2)))/r)/r assuming r is positive. r(-611/54) Simplify (a*(-8)a/(aa0)a)/(a(1/12)/(a(-3/10)/a))(a2/(a(a*(-6)/a)/a))/(((aa*(-7)a)/aa)/(aa*(1/3)aa)) assuming a is positive. a(179/20) Simplify (qq/q0)(1/10)q(-3)/(q/q7)(q/q*(-5))/(qq/(q/(qq(-3/2))q))(qq2)/q(1/14) assuming q is positive. q(442/35) Simplify ((y/y(-3/4)y(-5))/(yyy(-2/7)/y)(-46))/((y/y(-2/17))/(y/(((yy*(-2/7)/y)/y)/y))y(-8/7)/y(-2/13)) assuming y is positive. y(202745/6188) Simplify c(-11)/c*(9/7)c*(-2)c13 assuming c is positive. c(-9/7) Simplify ((o/(oo(3/11)o))/o)*(2/37)(o(-39)/o)/(o/o(-12/5)o) assuming o is positive. o(-90604/2035) Simplify (((zz/(z/(z/z0)))/z)/z(-7))*(-2/25)(z/z2)(-3)(z1/z)/z(zz/(zz(-3/10)))/z assuming z is positive. z(83/50) Simplify (kk6(k/((k/k8)/k))/k)(-6/11)/((k*(1/7)kk(-6)/k)/(k7k(-2/3))) assuming k is positive. k(926/231) Simplify ((z/(z/(z/(z/(z/(z*(2/55)z)))z)))/(z(-35)/z)(z(-5)/z)/z(1/23))(-38) assuming z is positive. z(-1486332/1265) Simplify (((s(-3/4)/(s(1/10)s))41)(-6/5))43 assuming s is positive. s(195693/50) Simplify (((x(2/7)x)/x)*(-2/141)(x0/x)43)/((xxx(-1))(-8)(xxx(-6/5))/((x/(x(2/15)x))/xx)) assuming x is positive. x(-59117/1645) Simplify ((uu(uu/((uu(-3/5))/u))/uu)/((u(-3/8)/u)/u))(-13/5)/((u((uu/u*(-3/2))/u)/uu*(-2/11))/((uu*(-1/11)u)/u4)) assuming u is positive. u(-49597/2200) Simplify ((y2)(-49/4))*(-13)/(y(y/(y*(2/7)y))/yy/(y/((y/(y(1/10)y))/y)))(2/167) assuming y is positive. y(3723459/11690) Simplify (f(4/5)/(f/(f(-15)/f)))*49/((f/(f(ff/(f/f(-1/2))f)/ff))(-6/19)/(f/f(-2))(-12)) assuming f is positive. f(-78876/95) Simplify ((u5uu/(u/(u/(uu*(-11)))u))/((u/((u*(4/3)u)/u))/u)(-2/31))(27/4) assuming u is positive. u(3330/31) Simplify (d(5/7)d(-1)(dd(7/6)/ddd)/(d(-37)/d))(-3) assuming d is positive. d(-1717/14) Simplify ((g/g(-11))/(g/((g/(gg0))/g)))(-27)(g(-2))(5/7)(g0)(-34) assuming g is positive. g(-1900/7) Simplify (q(-24))*(5/11)(q/(q(q/(q/((q/q(-2/91)q)/q)))/qq))/((qq(-42))/q) assuming q is positive. q(30099/1001) Simplify (k*4kk/((kkk(-2)k)/k)k)(-2/71)((kk/((((k(-1)/kkk)/k)/k)/k))10)36 assuming k is positive. k(127786/71) Simplify (z/(z/(z/(zz*(-1)z))))*(-1/53)(z*(-2/7)/zz)*(2/17)((z(-2/9))(-42))(-38) assuming z is positive. z(-126628/357) Simplify (((r/(r/(r/(r/(rr(r/r*(1/4))/r)r))r))/r)(-21)rr20((r/r(-1))/r)/r)42 assuming r is positive. r(3969/2) Simplify (y7/yyyyy*(-4)y)*(-13/6)/((yy*(1/3)/yy)(-2/19)/(y/y(1/4))(1/37)) assuming y is positive. y(-108313/8436) Simplify ((z/z*0z)20)(-13)/((z0)(-3))35 assuming z is positive. z(-520) Simplify (y*5y0)/(y0)*(6/11)((y/(y*6/y))/yy(1/2)/y)/(y0/yyy6) assuming y is positive. y(-13/2) Simplify (((dd(-1/12)d/(dd(-1/11)))23)(3/5))(-3/28) assuming d is positive. d(-1311/880) Simplify (aa(1/2))(-20)/(a*(-5/2)a*(2/11))((a0/a)(8/15))(-3/11) assuming a is positive. a(-3029/110) Simplify ((g/(gg0ggg)gg)1)(-1/10)(gg(-4))/((g/(g/g(-4)))/g)(gg/g(1/4))(11/5) assuming g is positive. g*(119/20) Simplify (((tt(-2/13))/t)/t(2/9)t(1/2)/(t(t/(t/(ttt/t*(-2/17))t))/t))/((tt5)/(tt*(3/5))(t*3/tt)/(tt*2)) assuming	{ "pile_set_name": "DM Mathematics" }
(h) = 8h - 6. Let l(b) = 6i(b) + 11x(b). Let n(r) = r - 4. Let c be n(6). Let g(u) = 3u*2 + 2u*c - 3u*2. What is g(l(d))? 8d*2 Let o(s) = 39s - 39s + s2. Let t(n) = -5n*2. Give o(t(x)). 25x*4 Let q(j) = -2j*2. Let u(z) = -4z*2 + 16z*2 - 3z*2 - 4z*2. Give q(u(v)). -50v*4 Let n(f) = 4f*2 + 0f*2 + 0f*2. Let a(l) be the second derivative of 0l*2 + 1/6l*3 + 0 - l. Calculate n(a(q)). 4q2 Let g(c) = -c2. Let b(l) = 4l2 - 68l + 8. Calculate b(g(y)). 4y4 + 68y*2 + 8 Let f(y) = -3 + 3y*2 + 3. Let b(s) be the first derivative of 2s*2 - 1. Calculate b(f(p)). 12p*2 Let x(h) = -7h. Let l(q) = 51q. Let m(n) = -5n. Let w(a) = 2l(a) + 21m(a). Calculate w(x(s)). 21s Let g(a) = 22a. Let s(j) = 6j + 2j - 5j - j. Give g(s(t)). 44t Let o(z) = -4z. Let c = -17 - -20. Let s(p) = 3p + 3p2 - 2p*2 - cp. What is s(o(y))? 16y2 Let c(v) = 2v*2. Suppose 0 = 5u + 2r - 31, -4r + 12 = -0. Let z(n) be the third derivative of 1/20nu + 0n*4 + 0n*3 + 0 + 3n*2 + 0n. Give c(z(p)). 18p4 Let z(m) = m2. Let u(q) be the first derivative of 7/2q*2 - 1 + 0q. Give u(z(h)). 7h2 Let z(h) = -2h*2 - 2h + 2. Let l(r) = 6r2 + 7r - 7. Let n(u) = 2l(u) + 7z(u). Let a(t) = -5t + 7t - t. What is a(n(k))? -2k2 Let u(i) = i. Let x(v) = -336v + 17. Give x(u(d)). -336d + 17 Let k(f) = -7f. Let m(h) = -h + 8. Give k(m(b)). 7b - 56 Let h(l) = 2l*2 - 6l*2 + 5l*2 + 4l*2. Let u(f) = 35f*2 - 69f*2 + 32f*2. Determine u(h(v)). -50v*4 Let c(m) = -455m2. Let w(h) = -h2. Give c(w(a)). -455a4 Let d(b) = 6b. Let r = 12 + -2. Suppose -o = 2y + 4, -4o + 4y - r = -54. Let z(c) = oc - 6c - c2. Give d(z(j)). -6j2 Let x(y) = -y2. Let h be -101/4. Let f(s) = -23s + h + 7 - 7. Give f(x(d)). 23d*2 Let h(w) = 2w*2. Suppose 6m - 2m - 8 = 0. Let o(g) = g3 - 23g*2. Let k be o(23). Let l(b) = kb - 3b + 3b - mb. Give h(l(q)). 8q2 Let f(u) be the first derivative of -u3/3 + 3. Let z(o) = 7o2. What is z(f(v))? 7v4 Let x(u) = -u2 - 17u2 + 22u*2 + 27u*2. Let z(s) = -s. Calculate z(x(b)). -31b*2 Let p(g) = 22g*2. Let o(c) = 26c*2. Calculate o(p(d)). 12584d*4 Let v(a) = a. Let n(d) = 6d. Suppose -7t + 2g - 64 = -4t, -4g + 40 = -2t. Let k(r) = tv(r) + 4n(r). Let z(o) = 3o. Calculate z(k(x)). 6x Let c(d) = 7d*2. Let p(i) = -3196i*2. Calculate p(c(z)). -156604z*4 Suppose g - 7 = -3. Let l(r) = gr - 4r2 + 3r*2 - 4r. Let x(z) = -6z. Give x(l(y)). 6y*2 Let s(c) = 4c + 6. Let w(r) = -2r + 3. Let l(u) = -u + 1. Let h(y) = 5l(y) - 2w(y). Let q(v) = 6h(v) + s(v). Let p(x) = -4x. Give q(p(k)). 8k Let b(t) be the third derivative of t6/360 - t4/4 - 5t2. Let k(s) be the second derivative of b(s). Let f(h) = -4h*2. What is f(k(m))? -16m2 Let g(f) = f. Let y(t) be the third derivative of t5/20 + t3/2 - t2. Let s = 1 + 2. Let r(v) = -1. Let u(h) = sr(h) + y(h). Determine u(g(a)). 3a*2 Let j(b) = -3b2. Let f(g) = g2 - 2g + 2. Let r(t) = -t2 - t + 1. Let c(v) = -f(v) + 2r(v). Give j(c(q)). -27q4 Let i(g) = -10g. Let q(n) = 420n2. Give q(i(l)). 42000l*2 Let o(j) be the third derivative of 1/8j*4 + 0j + 0 + 0j3 + j2. Let u(f) = 3f*2 - 4f*2 + 0f*2. Determine o(u(m)). -3m*2 Let c(l) = -2210l. Let k(s) = 2s2. Calculate k(c(u)). 9768200u2 Let g(o) = -o2. Let v(t) = t*2. Let x(i) = -4i*2 + 3. Let u(z) = -5v(z) - x(z). Let h(b) = 2b2 + 5. Let m(c) = -3h(c) - 5u(c). Determine m(g(f)). -f4 Let m(h) = -11h*2 + 6h*2 - 3h*2. Let g(n) = -2n. Give g(m(c)). 16c2 Let d(p) = -1578p2. Let i(t) = t2. What is i(d(h))? 2490084h4 Let f(g) = -g2. Let o = -10 - -18. Let d(r) = -or*2 + 7r*2 + 0r2. What is f(d(q))? -q4 Let d(s) be the first derivative of s*2/2 - 13. Let q(y) = 2y - 2y - 3y. Determine q(d(o)). -3o Let h(s) be the second derivative of 9s*3 - 5s - 10s3 + 0s. Let y(f) = f*2. Calculate h(y(q)). -6q*2 Let h(d) = -2345d*2. Let q(p) = 2p. Determine h(q(f)). -9380f2 Let j(l) = 7l*2 + 21. Let q(x) = 37x*2. Determine q(j(w)). 1813w*4 + 10878w*2 + 16317 Let i(c) = -8c*2. Let u(l) = -6l. Calculate i(u(k)). -288k2 Let q(v) = 4536v. Let k(w) = -2w. Determine k(q(m)). -9072m Let u(m) = -17m2 + 4m*2 + 4m*2 + 12m*2. Let y(n) = 2n*2. Determine y(u(t)). 18t*4 Let d(f) be the first derivative of 0f*3 + 1/6f*4 + f - 2 + 0f2. Let x(o) be the first derivative of d(o). Let r(b) = -b2. What is r(x(t))? -4t4 Let o(h) = 10h - 7. Let i(n) = 3n - 2. Let j(s) = 7i(s) - 2o(s). Let y(w) = -39w*2. Determine j(y(r)). -39r*2 Let i(d) = -57d2. Let h(p) = p2 + 1403p - 1403p. Calculate h(i(z)). 3249z4 Let g(n) = -4n2. Let u(c) = c2 + 188. Determine g(u(f)). -4f4 - 1504f*2 - 141376 Let m(v) = 35v*2 - 2. Let q(z) = 4z. Give q(m(r)). 140r2 - 8 Let l(o) = -3o*2. Let z(c) = -c + 5. Let v be z(3). Suppose -2u + 2d = -2, vd = -2u + 6d - 4. Let q(w) = w*2 - 4w + uw. Calculate l(q(b)). -3b*4 Let p(g) = 7 - 5 - 3g - 2. Let h(s) be the third derivative of -s4/12 - s2. Determine h(p(o)). 6o Let i(h) be the third derivative of -h5/120 + h3/2 + h2. Let s(g) be the first derivative of i(g). Let p(k) = -4k. What is p(s(r))? 4r Let h(g) = 4g. Let r(f) = -7f2 - 23f. Give h(r(u)). -28u2 - 92u Let l(m) = -m*2 + 254. Let j(v) = 2v. Determine j(l(x)). -2x2 + 508 Let p = 8 - 4. Let x(d) = -6d + pd - d. Let q(a) = -a. Give x(q(j)). 3j Let p(k) = -2k2. Let l = -18 + 22. Let h(c) be the third derivative of 0c + 1/12cl + c2 + 0 + 0c*3. Calculate h(p(v)). -4v*2 Let h(n) = 615n*2. Let s(w) = 2w*2. Calculate s(h(f)). 756450f*4 Let y(s) = -5s*2 - 3s*2 + 6s*2. Let c(a) = -7a. Let x(i) = -i. Let u(f) = 2c(f) - 18x(f). Give y(u(g)). -32g2 Let u(j) be the second derivative of j4/3 - 2j - 6. Let f(w) = -7w2. Calculate f(u(r)). -112r*4 Let h(v) be the second derivative of -v + 0v*2 - 1/2v3 + 0. Let b(x) = -x2. Calculate h(b(d)). 3d2 Let h(a) = 13a + 40. Let l(f) = -2f2. Give l(h(y)). -338y*2 - 2080y - 3200 Let w(y) = 2y2. Let d = -1 + 1. Let t be -1(-3)/(-6)d. Let b(c) = tc*2 + 0c*2 + 2c*2. Determine b(w(n)). 8n*4 Let r(o) be the first derivative of 4o3/3 - 1. Let b(p) be the first derivative of -p2/2 - 38. Calculate r(b(y)). 4y2 Let y(t) = -2t*2 - 147t. Let a(x) = x. Determine y(a(r)). -2r2 - 147r Let o(y) = 3y. Let d(h) = 0 + 6h + 3 - 5h. Let m(v) = v + 4. Let f(u) = -4d(u) + 3m(u). Determine f(o(k)). -3k Let l(c) = -2c2. Let p(q) = -q2 + 2q + 3. Let w be p(0). Let y(s) = 3 - 3 - 3s - ws. Calculate l(y(v)). -72v2 Let z(w) be the first derivative of 5w*3/3 - 18. Let l(q) = 2q*2 + 2q - 2q. What is z(l(r))? 20r*4 Let x(j) = 8j*2. Let g(q) = 15q*2 - 2q. What is g(x(h))? 960h4 - 16h2 Let z(l) be the second derivative of l4/3 + 7l. Let q(g) = -17g - 11. Let w(u) = 9u + 6. Let y(s) = -6q(s) - 11w(s). Calculate y(z(c)). 12c*2 Let z(c) be the second derivative of 2c + 0c2 + 0 + 0c*3 - 1/4c*4. Let w(m) = -3m. Calculate w(z(i)). 9i2 Let z(t) = 3t*2. Suppose 0 = -5u - 5o + 25, 0o + 6 = 4u - 3o. Let r(p) be the third derivative of -1/8p4 + up*2 + 0p*3 + 0p + 0. Give r(z(k)). -9k2 Let g(n) = -8n. Let o(s) = 15s. Let y(l) = -11g(l) - 6o(l). Let v be 9/6 + 1/2. Let h(d) = -4d*2 - v + 2. Give y(h(b)). 8b2 Let j(m) be the first derivative of m3/3 - 1. Let q(k) = -2k + 6. Let h(x) = -5x + 3x + 17 + 0x - 4x. Let p(l) = -6h(l) + 17q(l). Calculate j(p(s)). 4s*2 Let j(w) = -26w*2. Let y(c) = -2c - 3. Give y(j(u)). 52u2 - 3 Let u(z) = z - 4z*2 - 2z + z. Suppose 46 = 4i + 5f, 7i + f - 38 = 3i. Let n(w) = iw - 6w - w. What is u(n(s))? -16s2 Suppose -8x = -3x. Let i(v) be the third derivative of -1/30v*5 + x + 0v*4 + 0v*3 + 0v + v*2. Let u(d) = 2d. Calculate u(i(j)). -4j2 Let s(y) = 90y. Let i(o) = -o + 23. Calculate i(s(m)). -90m + 23 Let o(v) = 213v + 2. Let c(f) = -f*2. Determine o(c(x)). -213x2 + 2 Let p(x) = x2 - 11x. Let r(c) = c. Determine r(p(j)). j*2 - 11	{ "pile_set_name": "DM Mathematics" }
p. Does 5 divide x? False Suppose -25 = -u - 117. Let y = u + 100. Suppose 392 = 4p - yx + 4x, 2x = 3p - 295. Is p a multiple of 11? True Let j(v) = v3 + 13v*2 - 3v + 4. Suppose 3n = 9, k - 4n + 9 = -0k. Suppose -3t + 4b - 23 = 0, -t = kt + 2b + 60. Does 15 divide j(t)? False Suppose 4m + 22 = 152i - 151i, -2i + m = -72. Does 19 divide i? True Let y(o) = 37o3 - o2 - 2o + 2. Let u be y(1). Let f = 38 - u. Suppose 4t = -fk + k - 4, k - t = 16. Does 3 divide k? True Does 11 divide (78894/(-30) + 3)/(3 - 136/40)? True Suppose -16y + 13y = -33. Suppose 15x = yx - 892. Let w = -114 - x. Is 12 a factor of w? False Suppose -3p = 3q - 7002 - 16317, -5q - 15 = 0. Is 108 a factor of p? True Let q be (-3 - -5)/(4/18). Let h(y) = y*3 - 10y*2 + 15y + 18. Is h(q) a multiple of 9? True Suppose -16s = -12s - 280. Is s/((70/11)/2 - 3) a multiple of 18? False Let w be (0 + 1)1030/4. Let o = 81 - w. Suppose -28 = -4x - 4l, 4l + o = 2x - 2. Does 3 divide x? True Suppose -71720 = -4k - 36k. Is 11 a factor of k? True Suppose 5 = 5d - 3t + 4, d - 11 = -3t. Suppose du + 46 = -5a + 3a, a = 5u - 11. Is 8 a factor of 7/(a/2) + 52/6? True Suppose 0 = -17n + 1341 + 1260. Suppose -no + 158o = 1000. Does 25 divide o? True Suppose 322a = 388a - 22440. Is 7 a factor of a? False Does 77 divide 12/(-14) + 1 + (-350018)/(-266)? False Let q(p) = p*3 - 59p*2 + 75p - 378. Does 11 divide q(60)? True Let b(d) = 1 - 5d + 3 + 3d + 173d2 - 2. Is 58 a factor of b(2)? False Is (6/4 + 15113/14)/(1 + 0) a multiple of 47? True Is 32/(-2) + 11 - (-8411 + 0) a multiple of 120? False Let p(c) = 3c*2 - 141c + 152. Let h be p(48). Let u = h + -9. Is u a multiple of 7? True Let v(x) = 41 + 103x + 121x + 62x - 98x. Does 88 divide v(9)? False Let j(c) = 171c2 + 28c + 10. Suppose 20a + 4a + 72 = 0. Is j(a) a multiple of 55? False Let u(h) be the second derivative of h*4/2 + 21h*3/2 - 9h*2/2 - 37h. Is 9 a factor of u(-15)? True Suppose 350m = 435m - 1595620. Is 19 a factor of m? True Let t(g) = 16g - 5g + 15 - 12g - 3g - 7g. Let x(c) = -c2 + c + 1. Let f be x(3). Does 35 divide t(f)? True Let x(s) = -s3 + 9s*2 - 4s - 5. Let f be x(8). Let y be 6/f + (-1850)/(-18). Let c = 157 - y. Does 21 divide c? False Let y(v) = -v*3 + 8v*2 + 13v - 3. Let t be y(10). Let g = t + 89. Is 16 a factor of g? True Let o(u) = -76u3 - 63u*2 - 345u - 25. Does 175 divide o(-5)? True Suppose -2y - 1125 = -7y. Suppose 63 = 2z + y. Let h = -43 - z. Is h a multiple of 19? True Let c(y) = -y3 + y. Let x(n) = n3 + 12n*2 + 14n - 19. Let o(v) = 2c(v) + x(v). Let a be o(13). Let g = -6 + a. Is g a multiple of 3? False Let q(n) = -n3 - 8n*2 + 7n - 18. Let c be q(-9). Suppose 79 = t + 5j, c = -t + 17j - 20j + 79. Is 3 a factor of t? False Suppose -16v + 1264 = -24v. Let s = 209 + v. Is 3 a factor of s? True Let u = 1356 - -1257. Suppose -4360 = -5j - 5v, 4v = 21j - 24j + u. Is 25 a factor of j? True Let w be ((-142)/10)/((-17 - -6)/(-55)). Let z(v) = 27v2 - v + 1. Let x be z(-2). Let j = w + x. Is 8 a factor of j? True Let u = 38 - 36. Let y(i) = i3 - i2 - i - 1. Let m(w) = -3w*3 + 4w - 6. Let g(o) = uy(o) + m(o). Is 38 a factor of g(-7)? False Suppose 38 = -7s + 227. Let q = 312 - s. Is 19 a factor of q? True Let m = -120 - -126. Let w be 2860/m - (-19)/57. Suppose -w = -5s - y, 4s + 7y - 3y - 372 = 0. Does 43 divide s? False Is 2480 - (14 + -38 + 15) a multiple of 76? False Suppose -m + 3m = -3f + 73, 0 = -m + 5f + 69. Suppose -3w + 19 = -m. Is 21 a factor of w? True Let y be (2/(-4))/(4/(-376)). Let u = y - 17. Let a = -20 + u. Does 5 divide a? True Suppose 18p = 7352 + 38368. Is 71 a factor of p? False Does 34 divide (-4)/10 - (5/(25/(-8352)) + 3)? False Let g(c) be the first derivative of -20c*2 + 105c + 52. Is 55 a factor of g(-18)? True Suppose 27r - 100 = 89. Suppose 3d = -s + 3426, 4s + 2277 = 2d + rs. Does 84 divide d? False Let c be 1/6 - 295/(-30). Let i(q) = -4q - 9 - q - c. Is i(-17) a multiple of 16? False Let u(w) = 6w2 + 21w + 210. Is u(-10) a multiple of 15? True Let w(z) = -z*3 + 20z*2 - 14z - 63. Suppose -6m - 14 = -7m + q, -m - 2q = -29. Is 4 a factor of w(m)? True Let l(r) = -28 + r - 31 + 12r*2 + 56 - 5r*2. Let q be l(2). Suppose -q = a - 156. Is a a multiple of 20? False Let q = 220572 - 151873. Is q a multiple of 225? False Let j(p) = -11p + 63. Let i(k) = -3k3 + 2k*2 - 2k + 5. Let o be i(2). Does 38 divide j(o)? True Let q be 3/9(-17 - (3 - 8)). Let f(u) = -u2 + 3u - 4. Let d be f(3). Is 13/q-10d/(-5) a multiple of 4? False Suppose d - 3d = 6d - 688. Does 4 divide d? False Let s = 22 - 62. Suppose 24 = 5z + 2v, 10z - 6z + 4v = 24. Is (-3296)/s - z/10 a multiple of 12? False Suppose -16 = 43g - 47g. Suppose -x + 1283 = 3z - 2x, -x = -g. Does 13 divide z? True Let h be -4(45/(-10))/(-3). Let x be 237 + h + 5 - -1. Let o = 15 + x. Is o a multiple of 18? True Let w = 15973 - 2796. Is w a multiple of 68? False Suppose 16g - 15g - 10 = 0. Let c be ((-141)/(-6))/(5/g). Suppose 5y - c = 688. Is 26 a factor of y? False Suppose 9r + 3z - 1330 = r, 0 = 2r + 4z - 352. Is 41 a factor of r? True Let o(n) = -9n*3 + 2n*2 + 2n + 5. Let l be o(3). Does 3 divide (-136)/136 - (l - (1 - 2))? False Let h be (-5226)/24 + (-8)/32. Let b = -31 - h. Does 22 divide b? False Let l(m) = m*3 + 19m*2 + 63m - 5. Suppose -47 - 1 = 6u. Is l(u) a multiple of 13? True Let s = -10 + 12. Let g be (s - -4)(7 + 7). Let a = g - 36. Is 6 a factor of a? True Let s(g) = -847g - 365. Is 43 a factor of s(-3)? False Let o(j) = -22 + 5j + 6 + 7 + 2. Let m = -10 - -21. Is 12 a factor of o(m)? True Suppose 14w + 12w = -17576. Let r = w - -849. Is r a multiple of 25? False Let y(n) be the second derivative of n*5/10 + 4n*4/3 - 4n*3/3 + 19n*2/2 - 3n + 6. Is y(-8) a multiple of 2? False Let m be (14 - 14 - 0) + 5752. Suppose 3a = -2a + 5g + 1150, 4g - m = -5a. Is a a multiple of 16? False Suppose -2y + 1632 = -2t, y + 2t = -0t + 825. Let h = y + -492. Does 12 divide h? False Let x = -1836 + 2364. Is x a multiple of 48? True Suppose 3n - 11 = -4y + 3, 5y + 4n - 18 = 0. Suppose 7k - 4821 = 2k + 3g, yk = 4g + 1920. Is 42 a factor of k? True Suppose -3080 - 2785 = -15p. Let n = 92 + p. Does 69 divide n? True Let w(i) = -2i - 2. Let f be w(-3). Let g be ((-2)/f)/(1/(-8)). Let k(a) = -a3 + 6a*2 - a - 3. Does 25 divide k(g)? True Is 42 a factor of (49975/(-125) + -25)(-140)/2? True Let k = -660 + 1368. Let r = -460 + k. Does 31 divide r? True Let w(j) = -5j + 60. Let s be w(12). Suppose s = 7n - 477 - 27. Is 5 a factor of n? False Suppose 882 = 143o - 149o. Let j = o - -865. Is 9 a factor of j? False Let p(s) = -s. Let o be (-3)/(-1) + (-4 - 0). Let y(b) = -5b + 21. Let j(n) = oy(n) - 5p(n). Is j(6) a multiple of 39? True Is ((-443916)/(-4))/9 + 15 a multiple of 152? False Suppose -45j + 43j = -28j + 29952. Is 8 a factor of j? True Let n(b) = -22b + 21. Let o be n(1). Let w(v) = 1240v*2 - 5v - 8. Is 53 a factor of w(o)? False Suppose 152 = 18z - 136. Let t(m) = -m3 + 17m*2 - 13m + 6. Is t(z) a multiple of 4? False Let b(h) = -358h + 3395. Does 20 divide b(7)? False Suppose 3d + 5d = -9d. Suppose 2r = -2w - 2r + 614, d = -4w + 3r + 1239. Is w a multiple of 25? False Let w(c) = -1465c + 1251. Does 61 divide w(-3)? False Let w be ((-3)/(-9))/((-3)/(-1710)). Let v = w - -40. Is 46 a factor of v? True Suppose 0 = 3g - o - 22, g + 9o - 11o + 1 = 0. Is g/45 + 1557/15 a multiple of 3? False Suppose 1425 = 4z + 5c, 3z - 1417 = -z + 3c. Suppose z = -2l - l - f, -4l - 464 = -f. Is 18 a factor of l/(-3) + 2/2? False Let a(y) = -6y + 13. Suppose -4 - 8 = t + 2c, -3t - 4c - 28 = 0. Let i be a(t). Let b = 32 + i. Does 15 divide b? False Does 35 divide ((-7280)/4)/(6(-8)/144)? True Suppose 9a - 10 = 3g + 4a, -3g = -3a. Let q be (-134)/(-4)(g + 7). Suppose q = 3j + 3b, j - 130 = 4b - 9b. Is j a multiple of 27? True Let y(q) = q3 + q2 - 1. Let t be y(1). Is 3568/20*((-1)/t + 6) a multiple of 28? False Let k = -2209 + 4215. Is k a multiple of 157? False Let i be 2/	{ "pile_set_name": "DM Mathematics" }
hat are the prime factors of (-1 - (-42)/15)5? 3 Let s(r) be the third derivative of r5/60 - r4/6 - r3 + 25r*2. Let v be 2 - 1 - 2 - -7. List the prime factors of s(v). 2, 3 Let c be ((-50)/(-3))/(2/6). Suppose -4s = -c + 14. Suppose 3y - s = 2y. List the prime factors of y. 3 Let t be (4/(-6))/((-1)/3). Let q(d) = d + 0d + td*2 + 9 + 0d*2 - 3d*2. What are the prime factors of q(0)? 3 Let t be 2/(15/(-6) + 2). Suppose r = 2s - 1, 2s + 3r - 6 = -25. Let q = s - t. What are the prime factors of q? 2 Let h = -3 + 8. Suppose -ht = 2r - 4 - 52, t = 2r + 16. Suppose -2o + 10 = -t. List the prime factors of o. 11 Let r(y) = 36y + 29. What are the prime factors of r(5)? 11, 19 Let j = 79 + -75. List the prime factors of j. 2 Let k(u) be the second derivative of -u5/60 - 7u4/24 - u3/3 + u*2/2 - u. Let c(t) be the first derivative of k(t). What are the prime factors of c(-6)? 2 Let u(r) = 5r + 6. Let k be u(-4). Let f be (-111)/(-21) - (-4)/k. List the prime factors of f/(-4)-22. 5 List the prime factors of ((-630)/(-28))/(1/2). 3, 5 List the prime factors of (-393)/(-12) + 2/8. 3, 11 Let q(w) be the first derivative of -w4/2 + w2/2 - w - 3. What are the prime factors of q(-2)? 13 Suppose 10 + 11 = 3p. Let l(c) = -c3 + 6c*2 + 9c - 5. What are the prime factors of l(p)? 3 Suppose -6y - 25 = -2q - 3y, -30 = -4q + 2y. What are the prime factors of q? 5 Let u be (-8)/(-6)(-45)/(-6). Let y(h) = h*3 - 4h*2 - 2h + 4. Let k be y(5). Let m = k - u. What are the prime factors of m? 3 Let x = -103 - -182. List the prime factors of x. 79 Let n(j) be the second derivative of -j6/360 - j5/24 - j4/12 + j3/3 - j. Let w(c) be the second derivative of n(c). What are the prime factors of w(-4)? 2 Suppose 4g = 2r + 60, 0r - 54 = -2g - 5r. Let t = g - 8. Suppose -5o = -t - 6. What are the prime factors of o? 3 Let x(h) = -13h3 + h2 + 1 - 5h*3 + 2h + 0h2. List the prime factors of x(-1). 2, 3 Suppose 0 = -2v - 3v + 505. What are the prime factors of v? 101 Let q = -224 - -399. List the prime factors of q. 5, 7 Suppose 4o - 996 = -3g, -4o + 5g = g - 996. What are the prime factors of o? 3, 83 Let k = 33 - 24. What are the prime factors of k? 3 Suppose -3l - 2x = -94, 4l + 29 = 4x + 181. List the prime factors of l. 2, 17 What are the prime factors of 1(-1 + 4 + 40)? 43 Let k(t) = -t*3 - 5t*2 + 6t + 2. Let u be k(-6). Suppose 0 = -x - ux + 21. What are the prime factors of x? 7 Suppose -2k = -4 - 4. List the prime factors of k(-1 + (-60)/(-16)). 11 Let h = -22 - -16. Let g = h + 8. What are the prime factors of g? 2 Suppose -5v = -4j - 538, -4v + 5j + 432 = j. List the prime factors of v. 2, 53 Suppose -4h + 8 = -6h. List the prime factors of h/(-6) - 57/(-9). 7 Suppose -2l = 3z + 8, 4l + 0 = -4z - 8. Suppose lh - 6 = -0. List the prime factors of h. 3 Suppose 4m + 0m = 3h + 197, -5m + 251 = h. List the prime factors of m. 2, 5 Let j(x) = -x*3 + 4x*2 + 2. Let l be j(4). Let z = -2 - l. Let p = z - -11. What are the prime factors of p? 7 Let p be (-22)/(2/(-3)). Let o = p + 12. List the prime factors of 45/o - (-2)/(-4). 2 Let l be ((-2)/3)/(4/(-54)). Suppose -3 = 3p - 4p, 4u - p = l. What are the prime factors of u? 3 Let i = -15 - -35. Suppose 3j + j = i. Suppose ja - 9 = 31. List the prime factors of a. 2 Let y(f) = -f + 5. Let c be y(11). Let l = 12 + c. List the prime factors of l. 2, 3 Let r = 27 - -293. What are the prime factors of r? 2, 5 Let j(p) = -p + 3. Let s be j(0). Suppose w = 5c + sw - 24, -3c + 4w = -4. Suppose 4u - 24 = -2v, -4u + 55 = cv + 19. What are the prime factors of v? 2, 3 Suppose 13 = 2g + g - 4w, -w = 5g + 9. Let f = 3 + g. Let d(q) = q3 - q2 - 2q + 2. What are the prime factors of d(f)? 2 Let h be (-268)/(-3) + 2/3. What are the prime factors of h/14 + (-3)/7? 2, 3 Let t(y) = -y3 - 3y*3 + 3y3 + y + 12 + y2. What are the prime factors of t(0)? 2, 3 Let w(m) = 2m - 11. Let s be w(8). Suppose 30 = -5d - sl, 2l = -0d + 3d + 8. List the prime factors of (2/d)/(5/(-100)). 2, 5 Suppose 16 = f + 1. What are the prime factors of f? 3, 5 Let m be 2(-4)/(-4) - 3. List the prime factors of 3/2(13 + m). 2, 3 Let y be -11(-35)/7. Suppose 2n = -2z + 15 + 15, -10 = -yn. What are the prime factors of z? 13 Let k(n) = -n3 + 4n*2 - 4n + 3. Let a be k(2). Suppose -5h = u - 38, -3h = -2h - au - 14. List the prime factors of h. 2 Suppose -2u + 1 = -9. Suppose ui = 61 + 54. Let g = i + -8. What are the prime factors of g? 3, 5 Let h(w) = w*3 - 5w*2 + 5w. Let i be h(4). Let g = i + 1. Suppose -d + 7 = gu - 19, -4 = -u. What are the prime factors of d? 2, 3 Let r be 1 + 0/1 + 3. Suppose 25 = 5d + 3u - 105, -rd + 97 = u. What are the prime factors of d? 23 List the prime factors of (16/10)/(5/50 - 0). 2 Suppose 613 = 3y + 2c - 108, -3c + 960 = 4y. List the prime factors of y. 3 Let z be 1/5 - (-70)/25. Suppose -3m - 7q + 9 = -zq, 0 = 4m - 4q - 12. What are the prime factors of m? 3 Suppose 5a - 20 = -2r, 2a - 5r - 11 = -32. List the prime factors of 43/a + (-11)/(-22). 2, 11 Let r(u) = -28u. Let g be r(-4). Suppose 5s - g = -12. List the prime factors of s. 2, 5 Let l(i) = 3i + 2. Suppose -12 = -5q + 3q. Let g be l(q). Suppose 5a - a = g. List the prime factors of a. 5 Suppose -2c + 170 = -b, -3c + c + 4b = -158. List the prime factors of c. 3, 29 Suppose -117 = -3m - 42. Let o = m + -4. List the prime factors of o. 3, 7 Let v = -11 - -15. Suppose 0 = -5h + 25, 0 = -2k + 7k - 3h - 5. Suppose 0 = kj - vr + 2r - 12, -4r + 6 = -2j. List the prime factors of j. 5 Suppose -4d - 3n = -15 - 350, 0 = -3n + 9. What are the prime factors of d? 89 Let u(j) = -3j + 5. Suppose o = 0, 2o + 0o + 39 = 3m. Suppose -4q + 14 = -3h + 46, 2h = q + m. List the prime factors of u(q). 2, 5 Suppose 3x - 2x - 375 = 0. Suppose 120 = -5c + x. List the prime factors of c. 3, 17 Let r = 8 + -5. Suppose 0 = -ri + 3. What are the prime factors of 9/i + 1 + 1? 11 Let o be (-88)/(-6)-3 - 1. What are the prime factors of 16/5o/(-18)? 2 Let h = -7 - -7. Suppose 3q - q - 4 = h. What are the prime factors of q? 2 List the prime factors of 21/147 - (-2)/((-14)/(-531)). 2, 19 Let f(o) = -o3 - o2 + 3o + 3. Let q be f(-3). Suppose -5u + q = -u. Suppose uh + h + 2r - 74 = 0, -r + 85 = 5h. What are the prime factors of h? 2 Suppose -2u + 5r = -28, 6u - 2u + 4r = 28. Let w = 28 - u. List the prime factors of w. 19 Let t = -5 - -7. Suppose 0 = tk + 4o - 3o + 7, 2k + 32 = 4o. What are the prime factors of 30/(-9)k/4? 5 Let a(p) = 2p*2 - 8p + 9. Let o(c) = 6c2 + 2c - 1. Let m be o(1). Let i be a(m). Suppose -7 + i = 4n. What are the prime factors of n? 11 Let b be ((-21)/12)/((-1)/4). Let z(o) = 10o - 1. Let d be z(b). Suppose -2c + 17 = r, c - d = -3c + 5r. List the prime factors of c. 11 Let k = 10 + -6. Suppose -kw = 24 - 144. What are the prime factors of w? 2, 3, 5 Let c = -23 + 25. Suppose -5x - j + cj = -201, x = j + 37. List the prime factors of x. 41 Let q(v) = v*3 - 5v*2 + 8v + 3. Let k be q(6). Suppose -4j + k + 5 = 0. What are the prime factors of j? 23 Let a(d) = d2 - 10d - 8. Let s be a(9). Let v(m) = m*3 + 17m*2 - m + 19. List the prime factors of v(s). 2, 3 Let c = -1 - 0. Let m(h) = -5h + 1. Let y be m(-2). Let l = c + y. List the prime factors of l. 2, 5 Suppose 0 = 4s - 5s + 51. List the prime factors of s. 3, 17 Suppose -4a + 1 = 3s, -5a - 7 + 2 = 5s. Let d = a - -10. Suppose -d = 5n - 79. What are the prime factors of n? 13 Let o be (3/4)/((-4)/(-80)). Suppose 7p = 4p + o. What are the prime factors of p? 5 Let r be (-2 - 1)/(-6)2. Let v be (1/r)/((-2)/(-6)). Let h = -1 + v. List the prime factors of h. 2 Let c(a) = -a*3 + 7a*2 + 6a + 8. Let t be c(8). List the prime factors of (59 + t)(-1)/(-3). 17 Let y = 6 - -9. Let k = y - 9. List the prime factors of k. 2, 3 Let h(d) = -d3 + 6d*2 + 10d - 16. List the prime factors of h(7). 5 Let s = 275 + -150. List the prime factors of s. 5 Let x = -3 - -4. Let u(n) = 4n2 - 3n2 - n3 - 2n + 1 + 5n*3. What are the prime factors of u(x)? 2 Suppose 0v = -	{ "pile_set_name": "DM Mathematics" }
+ s + s - 2 - 2s + 2 + s + 2 - 2 + (-3s + 0s + 5s)(4 - 1 - 4) + 2s + 3s - 9s). 52s2 Expand 2o*4 - 3o4 - o4 + (3o3 - 3o3 + o3)(-1 + 1 - o) + o4 + o4 + 0o*4 + (656o + 29622 - 29622)(-o3 + 2o*3 - 2o*3). -657o*4 Expand 21j*2 + 18j*2 + 4j2 - j2 - j*2 + 11j*2 + (0j + 0j + 2j)(-3j - 2j + 19j). 80j2 Expand ((j - 4j + j)(1 + 1 + 1) + 2j + j + 0j - 6j + 4j - 7j)(-225 + 16j + 225). -192j2 Expand o3 + 8o*3 - 3o*3 - 17o*2 - 3678o*3 + 3679o*3 - 3o*2 + (-2o*2 + 3o*2 - 3o*2)(-2 + 3o + 2) - 4o*2 + 2o*3 + 4o*2. 3o*3 - 20o*2 Expand -158g*2 - 124g*2 + 219g*2 + (g + 3 - 2 - 2)(2g - g - 7g) + (g - 4g + 0g)(-g - 3g + 2g). -63g*2 + 6g Expand -195b3 - 7784b + 7784b + (2b + 4 - 4)(-2b2 - b2 + 0b2). -201b*3 Expand (3u + u - 5u)(248u - 366u - 233u). 351u*2 Expand (0h + 2h - 3h)(-2h*2 + 0h2 + h2) - 3h3 + 4h3 + h3 - 3h + 1623h*3 + 2h - 1331h3. 295h*3 - h Expand (-4q*2 + 3q*2 + 2q*2)(36q + 20q - 811 - 61q). -5q*3 - 811q*2 Expand (4j - 2j - 6j)(9j - 40j + 30 + 42j). -44j2 - 120j Expand 52p2 - 18 - 21p*2 - 32p2 + (p2 + 0p2 - 2p*2)(-1 + 2 + 2) + (6p - 3p - p)(-5p - p - 10p). -36p*2 - 18 Expand (-6a + 0a - 2a)(3 - 3 - 4a)(-3a*3 - 2a*3 - 6a*3). -352a*5 Expand (-3 + 6 - 1)(2 - 2 - 4y)(-y - 27y + 13y)(-y2 + y2 - 2y*2 + (-y - 1 + 1)(-2y + 2y + y) + y*2 - 6y*2 + 4y*2). -480y*4 Expand (v + 2v - 5v)(-4 + 1 + 1)((-3 + 4 - 2)(0 + 0 + 1) + (-43 + 106 + 19)(3 - 4 + 0)). -332v Expand -154t + 32t + 4t + (-47 + 12 + 0)(t - 2t - t). -48t Expand (98 + 310 - 787 - 1607)(-1 + 1 - 2o - 4o + 3o + 3o - 2 + 2o + 2 + (3o - o - 4o)(-5 + 4 + 0) + 0 + 0 - o - 6o + 2o + 5o + o + 2o - 2o). -9930o Expand (8 - 5 + 0 - 2 + 1 + 0 + (-2 + 1 - 1)(1 - 6 + 3) + 2 + 1 - 2 + (-3 + 2 - 3)(1 - 3 + 7))(-3j + 2j + 3j)(0j - 3j + 2j). 26j*2 Expand (-8 + 17 + 9)(-11652m + 11565m + 12m2 - 8m*2). 72m*2 - 1566m Expand (3 - 5r - 3)(-2 - 2 + 2) + (-6 + 2 + 3)(-1 - 2 - 3)((4r - 5r - r)(0 - 3 + 2) + 2r + 0 + 0)(1 - 4 + 5)(1 + 3 + 1). 250r Expand -3z*5 - 8z5 + z5 + (0z3 + 2z*3 + 2z*3)(4 - 4 - 2z2) - 16z*5 - 16z*5 + 6z*5. -44z*5 Expand (-4v + 5v + 0v)(0v*3 - 2v*3 + 3v*3) + (191v*2 - 191v*2 + 294v*4)(2 + 0 + 1) + (-2v3 + 2v*3 - 2v*3)(v + 4 - 4). 881v4 Expand (25w*2 - 2 - 797w + 403w + 397w + (-2w + 2w - w)(-2 + 2 + w) + w2 + 2w*2 + 2w*2)(2w + 0w - 3w). -29w*3 - 3w*2 + 2w Expand 3v - 5v - v + (-1 + 2 + 0 + (-1 - 1 + 3)(3 - 3 - 2))(7920 + 72v - 7920). -75v Expand (4 + 5404t - 28 + 1308t + 24)(t2 + 4t2 - t2). 26848t3 Expand (167 - 327 - 6i + 161)((-3 + 3 - 2)(-3i - i + 2i) + 5i - 2i - 4i - 3 + 3 + i - 2i + 12i - 11i + i - 3i + i). -12i*2 + 2i Expand w*3 + 2w*3 - 5w*3 + (3 - 3 - 2w)(-w2 + w2 - 2w2) - w3 + 2w3 + w3 - 3w3 - w3 + 2w3 + 15w*3 - 49w*3 + 33w3 + 1464. w3 + 1464 Expand (-8r - 2r + 20r)(-241 - 247 + 505). 170r Expand (-2g + 2g + g2)(1538g3 - 32281g*3 + 11108g*3 - 45311g*3). -64946g*5 Expand (-7 - 5y + 7)(-y2 - 2y2 + y2) - 362 - 2y3 + 0y - y + 402 + 4y2. 8y*3 + 4y*2 - y + 40 Expand (2537h + 1958h + 1448h - 1825h - 372h + 2907h)(-3h2 + h2 + 5h*2). 19959h*3 Expand (3 - 3 + 2n)(-451 + 205 + 199). -94n Expand -2p - 2p*2 - 105 + 107 + 4p + (3 + 4 - 5)(4654 - 4654 - 233p*2). -468p*2 + 2p + 2 Expand -4b2 - b2 + 2b*2 + (-2 + 0 - 1)(14b2 + 14b*2 + 0b2) - b2 + b*2 - 2b*2. -89b*2 Expand (-178 + 260 + 1825)(4 - 4 + n)(2n - n - 4n). -5721n*2 Expand (4163 - 412o*4 - 4163)(0o + 3o + 0o) - 4o*4 + 4o4 - o5. -1237o5 Expand 1017f + 1910f + 18 - 49 + 16 + 14 + (0f - 2f + 3f)(2 - 2 + 2). 2929f - 1 Expand (v - 3v - 3v)((-2v*2 + 2 - 2)(-1 + 2v + 1) + 5v*3 - 2v3 - v3 + 4v3 - 2 + 2) + (-2v2 + v2 - 2v2)(45v2 - 17v*2 + 33v*2). -193v*4 Expand (-1 + 1 - 2 - 2 + 1 - 1 + (4 - 6 + 18)(-1 + 4 - 4))(r + 1 - 1 + (-3 - 4 + 5)(2r + 2r - 2r) - 2r + 0 + 0 + 3r + 8r + r). -140r Expand (g + 1 - 1)(176 + 148 + 1530) + 2g + 4 - 4. 1856g Expand ((2u - u - 4u)(3 - 3 + 1) - u - 3 + 3)(119476 - 119476 - 382u)(0 + 0 - 4u2). -6112u*4 Expand (2b*2 - 1 + 1)(3 - 3 + 3)(2 + 1 - 4) + (-358 + 382b + 358)(0b - 3b + 4b). 376b2 Expand (2d*2 - 4d*2 - 5d*2)(-14 - 25 + 23) - 3d2 + 0d2 + d2 + d*2 - 3d*2 + 2d - d. 108d2 + d Expand ((0 - 2d + 0)(-1 + 3 - 1) - 5d + 2d + 4d + (-d + 0 + 0)(-2 - 4 + 5) + 6d - 2d - 2d)(26 - 5d*3 - 26)(-49d + 234d + 17d). -2020d*5 Expand (-2q*3 - 2q*3 + 3q*3 + (-3 + 6 - 2)(-2q + 2q*3 + 2q) + 0q3 + q3 + 0q*3 + 2q*3 + 3q*3 - 6q*3)(5952 - 6q - 11598 + 7257). -6q*4 + 1611q*3 Expand (53451595 - 53451595 - 5949v*2 + (2 - 2 - 2v*2)(-2 - 2 + 2))(v2 + 1 - 2 + 2v*2) + 0v*4 - 2v*4 + 4v*4. -17833v*4 + 5945v*2 Expand (2x + 8 - 8 + (-x + 3x + 0x)(1 - 2 - 2) - 3 + 3 - 2x)(-x2 - 3x*2 - 10x*2). 84x*3 Expand 24 - 24 + 6p + (0 - 3 + 4)(0 + 0 - p) + (13 - 7 + 6)(15 - 15 + 7p). 89p Expand (-1 + m*4 + 1)(-m + 4m - 39m) + 14m5 + 18m*5 + 5m5. m5 Expand 0q5 - 4q*5 + 3q*5 + (-4q*2 + 0q2 + q2)(14q*2 + 4q*2 - 1 - 2q*2)(23q - 114 + 114). -1105q*5 + 69q*3 Expand (-5 + 4 + 0)(4 - 6 + 1)(-189579 + 211b + 189579). 211b Expand (2h + 0 + 0)(4 - 2 + 0) + (h - 3 + 9 - 7 + 1 + 3h - 1 - 2h + 0h + 3h + (0h + 0h + h)(0 - 2 + 4) - 2h + 2h - h + 1 - 1 - h)(-120 + 144 - 69). -221h + 45 Expand 3s3 + 0s3 - s3 + (-6s + 14s - 5s)(s*2 + 8s*2 + 3s*2) + 0s*3 + 0s3 + s3. 39s3 Expand (0 - 3 + 2)(60u2 - 50u*2 - 79u*2) + 510 - 55u*2 - 510. 14u2 Expand v4 + 2v5 - v4 + (3 - 10195v*2 - 3 + 7992v*2)(-3v - 2v*3 + 3v + (v*3 - 3v + 3v)(-3 + 6 - 2) + 4 - 8v3 - 4). 19829v*5 Expand ((-4k - 6k + 3k)(-k - 2k + k) - 5k + 5k - 3k2)(-5 + 0 - 2)(42k + 35k - 80k). 231k3 Expand (9j*3 + 3j*3 - 9j*3)(64j - 39j - 38j)(-4j + j + 4j). -39j5 Expand (-69 - 89312g3 - g4 + 89312g3)(-2 - 3 + 2). 3g4 + 207 Expand (173985y*3 + 58y + y*2 - 56y - 173464y3)(-y + y + 2y). 1042y*4 + 2y*3 + 4y*2 Expand (103l - 103l - 7l*3)(5l2 - 5l*2 - 33l*2)(1 + 3 + 0). 924l5 Expand 15l*3 + 16l*3 + 3l*3 - l - 2l*3 + l - 4l3 + l3 + 2l3 + (l2 - 3l*2 + 0l*2)(3l - 2l + 0l) + 9028l*2 + 10l*3 - 9028l*2 - 1. 39l*3 - 1 Expand (-48r*2 + 81r*2 + 85r*2)((-2 + 2 - r)(3r + 0r - 5r) + 15r2 + 216r - 216r). 2006r*4 Expand (a + 3 - 7 + 2)(-5a - 6 - 7a + 18a). 6a*2 - 18a + 12 Expand (-2n + 4n - n)(2 - 2 - 3n*4) + (9n + 10n - 3n)(-24n*3 - 9n*4 + 24n*3) + (-3n*5 + 4n*5 + 0n*5)(1 - 1 + 1). -146n5 Expand (3t*2 + 0 - 2 + 0)(4067t2 + 4851t*2 + 7602t*2). 49560t*4 - 33040t*2 Expand -3p*2 + 8p*2 - 7p*2 + (22p - 15p + 3p)(-p + 2p - 2p) - 2p2 - p2 + 2p2. -13p2 Expand -1 + 1 - t4 + (0 + 1 + 0)(-11t*4 + 2t*4 + 3t*4). -7t*4 Expand (1061y - 439y - 453y + 3y4)(-4y - y + 4y + y + 2 - 2 + (0 + 2 - 1)(-2y + 3y + 0y) + y - 3y + 3y). 6y5 + 338y*2 Expand (-3 + 6 - 4)(0s - s + 3s)((2s - 1 + 1)(1 + 0 + 0) - 2s + 4s - 5s)(-11s - 31675s2 + 3s + 31693s2). 36s*4 - 16s*3 Expand (-2b*3 + 0b3 + b3)((-5 + 5 + 5)(b2 + b2 + 2b2) - 9 - 6b*2 + 9). -14b*5 Expand 75d + 68d - 14d + (-4 + 19 - 5)(5d - 5d + 2d) + 0d - 2d + 4d + (1 + 0 + 1)(3d - 2d + 0d). 153d Expand (3 + 0 - 2)(-2 + q + 2)(3189 - 156 + 793). 3826q Expand u + u4 - u + (5u*2 - 2u*2 - 5u*2)(4u - 3u*2 - 4u) - 2u4 + 5u*4 - 5u*4 + (0u*2 + 0u*2 + 2u*3)(-21u - 56 + 56). -37u*4 Expand (1 - 4 + 0)(269n2 - 811n*2 + 339n*2). 609n*2 Expand (-1 + 55 + 18)(1 - 158p + 82p - 158p). -16848p + 72 Expand (-4 - 7 + 6)((-4m - m*4 + 4m)(-m - m + 0m) + 118m*4 +	{ "pile_set_name": "DM Mathematics" }
t a be 2/(4(-2)/(-44)). Let u(n) = n3 + 10n*2 - 24n - 12. Let z be u(6). Suppose -z = -ag + 4g. Does 12 divide g? True Let j(x) = -255x. Let o be j(-5). Let k = 2896 + -2405. Suppose 14b = -k + o. Does 14 divide b? True Let x(a) = 3a + 56. Let w be 198/(-45) + 5 - 404/(-10). Does 6 divide x(w)? False Let f(q) = -2q*3 + 118q*2 + 168q + 71. Does 67 divide f(59)? True Suppose 5d + 1018 = 1033. Suppose 20 - 15 = o, -1385 = -4i + do. Is 14 a factor of i? True Suppose 4r = -0 - 4, r = -4n - 329. Let d = -78 - n. Does 6 divide (d/(-8))/((-1)/66)? False Suppose 2x - 1970 = -3l, 985 = x - 0x - 2l. Let w = 1396 - x. Is 22 a factor of w? False Let k = 756 - 748. Is 5 a factor of ((-90)/k)/((-7)/(-56)-3)? True Is 25 a factor of ((-10)/(-70)-6 - 1/7) + 4526? True Let c be -3(-33)/(-9) + 1 + 1. Let s be (-176)/(-24) + (-6)/c. Suppose -612 = -su - 4u. Is 17 a factor of u? True Suppose 2m + 10 = 2v, -2v = -m + 6 - 14. Suppose g - 5g + 30 = b, -g = vb - 90. Suppose u = a + 46, -u = 6a - 3a - b. Is u a multiple of 7? True Suppose 14852 = 2p + 5g, 0 = -4p - 13g + 10g + 29690. Does 11 divide p? False Let p = -36 + 40. Suppose 0 = -2h - pw + 48, 118 = 4h - 3w - 0w. Is 11 a factor of 3-1 + h/(6 - 4)? True Let p = -178 + 186. Is (-40)/p + 354 + (-4)/1 a multiple of 23? True Suppose 2z - 14 = -2j, 4j + 2z = -j + 29. Let n = -2 + j. Suppose no - 61 = -10. Does 17 divide o? True Let t = -198 - -206. Suppose 2y + v - 137 = 0, y - 3v - 73 = -tv. Is y a multiple of 14? False Let x(y) = -65y - 105. Let j(o) = -16o - 26. Let a(k) = 25j(k) - 6x(k). Let d be 24/(9 - (-12 - -24)). Does 18 divide a(d)? False Let p(a) = a*3 - 14a*2 + 2a - 15. Let y be p(14). Suppose 0 = -b + 4s + 46, -151 + y = -3b - 5s. Is 9 a factor of b? False Is 41 a factor of (-23)/(184/(-48192)) + (12 - 9)? True Let y(g) = 2 - 29 - 41 - 24g + 4. Does 8 divide y(-9)? True Is 7 a factor of 20/2588/10(-410)/(-40)? True Suppose -5y = -5o - 385, 4o + 9y + 317 = 4y. Let j = -70 - o. Suppose -10p + jp = -50. Is 19 a factor of p? False Let q = -233 + -20. Let h = q - -373. Is h a multiple of 23? False Let w = 255 - 140. Suppose 3h - 2h - w = 0. Suppose -z - 4z = -h. Is 5 a factor of z? False Let g(v) = 65v2 - 37v - 93. Let x(o) = -66o2 + 36o + 92. Let k(h) = -2g(h) - 3x(h). Is k(-3) a multiple of 29? False Let l = -38 + 78. Suppose -15n - 271 = 14. Let o = n + l. Does 21 divide o? True Let f(q) = 6q + 33. Let m be f(-5). Is 5 a factor of -4 + (5 - -73 - m)? False Let s be (72/60)/((-2)/10). Let b be 3 + -2(-1 - s/4). Suppose -l - 132 = -bl. Is 17 a factor of l? False Suppose -q + 23 = -6. Is 16 a factor of (11 - q)44/(-6)? False Let k = 715 - 668. Suppose 42p = 5n + kp - 5150, -n + 1045 = -2p. Is n a multiple of 45? True Suppose -3r + 507 = g, -3g - 789 = -5r + 42. Is 14 a factor of r? True Let n = -15625 - -36593. Is 42 a factor of n? False Let g(c) = 121c2 + 43c - 104. Is 39 a factor of g(7)? False Let n(w) = -18w + 44. Let y be n(2). Suppose -yp - 92 + 2084 = 0. Is 6 a factor of p? False Let n(s) = 97s2 - 30s + 198. Does 124 divide n(7)? False Let i(p) = p*3 - 11p*2 - 43p + 18. Let q be i(14). Suppose 0g = -qg - 3d + 1662, -g = -d - 412. Suppose -9h + g + 675 = 0. Is 11 a factor of h? True Let a(u) = -u*3 + 9u*2 - 9u + 3. Let f be a(8). Let w(r) = -r*3 - 4r*2 + 5r + 5. Let t be w(f). Suppose q = -t, -3v + 79 = -v + q. Is 14 a factor of v? True Let p(q) = -1040q - 2013. Does 90 divide p(-21)? False Let t = -501 + 603. Let i = 94 + t. Is i a multiple of 4? True Suppose 4q - 28 = 180n - 182n, -n - 10 = -4q. Suppose -2f - 3f = 0. Does 45 divide (f/1 + 2)/(n/609)? False Is 33 a factor of ((-18)/4)/(5/(-6345)) + 6/(-4)? True Let g = -41522 - -68116. Does 11 divide g? False Let j(g) = -6g + 2 - 48g - 37g + 4 - 5. Does 20 divide j(-10)? False Suppose -2m - 5n + 13283 = 0, -5m + 4n = -21805 - 11320. Is m a multiple of 25? False Let d(m) = m3 - m + 36. Does 156 divide d(5)? True Let j be (-6)/(-4)(0 - 2). Let a(t) be the first derivative of -t*3/3 - 7t*2/2 - 4t - 402. Does 5 divide a(j)? False Let x(a) be the third derivative of 11a6/120 + a5/60 - a4/6 - 4a*3/3 - 11a*2 + 5. Is x(3) a multiple of 4? False Let a = -993 - -2185. Does 8 divide a? True Suppose g + 4i = 2190, -3467 = -2g - i + 948. Is 26 a factor of g? True Suppose y - 3y - 18 = -4m, -6 = -3m + 4y. Is (-16 + 4)(512/m)/(-4) a multiple of 16? True Let u be (4/18)/((-4)/(-17406)). Let n = u - 372. Does 7 divide n? True Suppose 142 - 206 = -16v. Let c = -148 - -270. Suppose 9l = c + v. Is l a multiple of 5? False Let r(v) = -2v3 + 18v*2 - 10v + 15. Let g be r(8). Does 13 divide (164/(-42) + g/(-147))-270? True Suppose 2220 = 4o - 51w + 50w, -2o + 1110 = 5w. Let f = -14 - -25. Suppose 4 = -t, -8b - o = -fb - 3t. Does 21 divide b? True Does 31 divide (-508100)/(-110) - 5/(-5 + 60)? True Suppose 2 + 7 = 3k, -5k = -3d - 6. Let c(t) = 502t + 1990. Let z be c(-5). Does 13 divide (12/10)/(1554/z + d)? True Let p(g) = -g3 - 23g*2 - 61g - 43. Let z be p(-19). Is 17 a factor of z/20(-595)/14? True Let c(a) = 3a*3 + 6a*2 + 13a - 12. Let k(v) = 2v3 + 23v*2 + 10v - 5. Let p be k(-11). Does 30 divide c(p)? True Let d be 38 + -43 + 2 + 1759. Let a = -420 + d. Is 41 a factor of a? False Let y(o) = 30o - 3. Suppose 0u = 8u - 496. Let q = u + -61. Does 27 divide y(q)? True Suppose -5u + 9u + 5w = -5, -2w = 3u - 5. Suppose 1316 + 1169 = ud. Does 71 divide d? True Let b be 2/(-15) - ((-1114)/30 + -3). Suppose -bs = -45s + 2585. Is 47 a factor of s? True Suppose 32n - 2 = 31n. Suppose -3x + x = n. Does 9 divide x2 - (-52 + -15)? False Let c be 2/(-24)-93-12. Let m = c + 103. Suppose -4q - 12 = -3t, -2 = -11t + mt + 2q. Is t even? True Suppose 3k + 3p - 40 = -k, -2k + 20 = -5p. Is 24 a factor of 15/k - 49/(-2)? False Let q(w) be the second derivative of -13w3/2 + 213w*2/2 - 7w + 2. Is 43 a factor of q(-21)? True Does 30 divide (-81)/(-15)65750/25? False Let m = 3917 - -3749. Does 10 divide m? False Let q be -7 + (-3)/1 + 14. Suppose -31 = -5d + 4k + 1352, qk - 1128 = -4d. Does 31 divide d? True Suppose 0 = 2r + 4c - 196, 3r + 0c - 349 = 5c. Suppose 3i - 3w + 15 = 1494, -2 = -w. Does 18 divide ((i/10)/9)/(3/r)? True Let z(f) = 5f - 3. Let l(r) = -11r + 6. Let t(i) = -4l(i) - 9z(i). Let d be t(0). Is 11 a factor of 175/d - (-4)/(-12)? False Let s be ((-196)/21)/(1/(-918)). Suppose -26h = -s - 116. Is h a multiple of 22? False Suppose -3v + j = -v, -5v = j. Let z = -67 - 8. Is 30/z + (v - 102/(-5)) a multiple of 5? True Suppose 0 = 25u + 195 + 80. Let q(m) = m*3 + 15m*2 + 6m + 19. Is 19 a factor of q(u)? True Suppose -13d - 129974 = -3g, -d + 173262 = -13g + 17g. Is 68 a factor of g? True Let r = 37 - 35. Suppose d = -rd + 12. Let g(c) = 6c + 13. Is 11 a factor of g(d)? False Suppose 0 = -250u + 850978 + 802311 + 8246711. Is u a multiple of 72? True Let v be ((-2)/5)/(236/40 - 6). Suppose -va + 4668 = 4b, 0 = -5a + 10a + 15. Is b a multiple of 31? False Let f be 31 + (3 - (1 + 1)). Let s(n) = 44n - 6n - 24n - f. Is 10 a factor of s(16)? True Let s be 7/(84/8)12. Suppose s = 3i - i. Suppose 2v + 2a - 3a = 49, 0 = 4a + i. Is v a multiple of 3? True Let n = -911 - -1937. Let f = -74 + n. Is f a multiple of 14? True Suppose -801z + 10740530 = -101z - 5281070. Is z a multiple of 14? False Suppose -4i + 14 + 1 = -1. Let t = -1 + 6. Suppose -th - ig = -112, -5h + 30 = -4h - 3g. Does 4 divide h? True Does 9 divide 3/4(-220500)/(-189)? False Let m(f) be the first derivative of 21f2/2 - 97f + 13. Is 4 a factor of m(5)? True Let b(a) be the second derivative of a5/20 - a4/3 + 13a2/2 + 22a. Let u(y) = y*2 + 14y + 19. Let q be u(-13). Is 17 a factor of b(q)? True Let g = 548 - -343. Suppose 21n = 10n + g. Is 29 a factor of n? False Suppose 9036 = 4b - 3z - 4066, -3b - 2z = -9852. Is 328 a factor of b? True Suppose 5j - 3g - 29 = 4, -j + 7 = -g. Let a be j/4 + 2603/(-38). Let c = -3 - a. Is 16 a factor of c? True Is (-36)/(9 + 16935/(-1880)) a multiple of 91? False Suppose -8118 = -13*x +	{ "pile_set_name": "DM Mathematics" }
r) = 3r + 4. Let v be k(-4). Let i = v + 14. Suppose 0 = 3454m - 3879m + 850. Solve md - 2x = i - 0, -3d + 4x + 13 = 0 for d. -1 Let m(k) = k3 - 15k*2 + 15k - 14. Let d be m(14). Let r = 606 + -596. Solve 0 = 5h - 4s - s + r, -2s + 2 = d for h. -1 Suppose -64m - 68 = -66m. Let v = m + -29. Solve 6r - 3r = vd - 17, -r = -2d + 7 for d. 4 Suppose 15j + 12j = -19008. Let k = j - -704. Solve -3b - 4s + 14 = 6, -4b - s + 2 = k for b. 0 Let y(m) = -m*3 + 3m*2 + 39m + 14. Let t be y(8). Solve -2z = -5x + 16, tx + 4 = 2z + 11x for z. -3 Suppose 219 = -3q + 285. Suppose -4f = 2b - q, b + 3f = 13 + 2. Let l be (4/5)/(-2) + 242/55. Solve lk = -2t + t - 10, -bt - 4k = 14 for t. -2 Let u = -78 - -36. Let q = 0 - -46. Let x = u + q. Solve -2f + 2w - x = -f, -2w = f - 12 for f. 4 Let q be (-80)/(-100) + (-96)/(-5). Solve -4d + 4u + q = 0, -17d = -16d - 4u - 11 for d. 3 Suppose -1 = 19y - 58. Solve yb - 5b - 5 = -v, 4v - 12 = 0 for b. -1 Let m(f) = 2f*3 + 14f*2 + 39f + 162. Let n be m(-6). Solve n = -l + 5x - 14, -4l = 5x + 1 + 5 for l. -4 Let m(v) = v3 - 7v*2 - 93v + 651. Let x be m(7). Solve -13o - 2u = -8o + 12, 4u - 16 = x for o. -4 Let j be 463/(-5) - 6/(-10). Let i be 798/(-9) - (-40)/(-30). Let y = i - j. Solve 0c + 2l - 4 = yc, 2c = l - 6 for c. -4 Let s = -61 + 78. Suppose -15c = -sc + 10. Suppose 1 = 4a + ch + 2, 0 = a - 3h - 4. Solve 3 = i - 5d - a, 12 = 3i - 3d for i. 4 Suppose 12f - 126 = 5f. Let d = 57 - f. Let r = d - 36. Solve -3k - k = 3y + 4, 4y + 22 = rk for k. 2 Suppose -16z + 14z + 4q = 16, -9 = -2z - q. Solve -5h + 1 = -3k - 7h, zh + 5 = k for k. 1 Let h(g) = -4g3 + g2 + 273g + 273. Let k be h(-1). Solve -u + 2x = -5, -18x = ku - 19x + 20 for u. -5 Suppose -r + 111 - 38 = 0. Suppose -5z + r = -82. Let p = 8 + -4. Solve -4q - 3v - z = 0, -3v = -pq + 2v + 9 for q. -4 Let a = 4080 + -4078. Solve -16b + 11 = -15b + 2s, -4 = -ab + 2s for b. 5 Suppose -17p + 5p + 36 = 0. Suppose 2y - 2g + 93 = -g, -4y - 183 = -pg. Let j = y + 53. Solve 0 = 2i - 2n + 3 - 5, -ji = 4n + 22 for i. -2 Let p(k) = -66k - 7323. Let m be p(-111). Solve 3z + 9 = -4o + 12, -mo = 2z - 2 for o. 0 Suppose -68 = -2l + t, -22l + t = -24l + 64. Solve -2s = -4i + 10, 5 = -s + 31i - li for s. -5 Suppose 4a + 0a - 68 = 0. Let g be 13/91 + 320/14 + -1. Let t = g - a. Solve t = n, 5n - 9 = 5p + 41 for p. -5 Suppose -61b + 5176 - 1176 = 64b. Solve -l + 5i + b = -5l, 2l + i = -10 for l. -3 Let x = 2743 - 2727. Solve -3v - 12 = n, 2n + xv - 21v - 31 = 0 for n. 3 Let f = -20 + 17. Let g = 3 - f. Let o be 36/8(0 - g/(-9)). Solve o = 2w + j, 3w + j - 22 = 3j for w. 4 Let g be -1 - (7 - (4 + 7)). Solve -18 = -3t - 3z, 0 = gt + 5z - z - 23 for t. 1 Let d = 143 - 126. Suppose 2z + 15 = dz. Solve -3n + a = -2a + 6, -2a + z = n for n. -1 Suppose d + d + d = 0. Let r(o) = o2 - 2o + 2. Let v be r(d). Suppose 2 = q + i - v, -10 = -4q + 2i. Solve -qp - 2a = -1, 3p - 6p - 3a = 0 for p. 1 Suppose -21s = -46s + 300. Solve 0 = -5b - 20, 5c - 4b - s = -b for c. 0 Let i(b) = -4b2 + 3b + 1. Let p be (-8)/618/(-12). Let q be i(p). Let g be (8/20 - q/15) + 7. Solve -d + 3u - g = u, 10 = -2d + 2u for d. -2 Let i(w) = -9w3 - 2w*2 + 11w + 14. Let v be i(-1). Solve r - h = v, -4h = -5r + 21 + 24 for r. 5 Let w be 1 - -111 - 36/((-36)/(-6)). Suppose -75r + wr = 713. Solve 3d + r = 5l, -3d - 2d = l + 1 for d. -1 Let u(y) = y + 5. Suppose 3r - 5q = -347, -357 = 3r - 2q - q. Let s = r + 119. Let w be u(s). Solve 1 - 2 = -b + 3a, w = -3a for b. 1 Suppose 0 = -4n - 50 - 950. Let q = -245 - n. Solve 0 = -qd - 3v + 5, d = -0v + v + 9 for d. 4 Let n(u) = -69u + 3800. Let w be n(55). Solve -5b + 22 = -p, 5b - 5p - w = 5 for b. 5 Suppose 0c - 9c = 0. Suppose 48o - 357 + 117 = c. Solve 4l + 0j - 31 = oj, 5l - 11 = -3j for l. 4 Let b(f) = -f*2 + f + 24. Suppose 17 = -7i - 11. Let h be b(i). Solve w + hu + 14 = 0, w = -0u - u - 5 for w. -2 Let a = 40 + -40. Suppose a = -4x + 15x - 55. Suppose 7 + 8 = xo. Solve -2u + 2z + 8 = 0, -oz + 8 = -4u + 5u for u. 5 Suppose -4i + 6i = 4a + 180, 3a = -5i + 411. Suppose -i = 47p - 61p. Solve p + 11 = 5g - h, 5h = g + 11 for g. 4 Let f = -39 + 41. Let x(l) = -10l*2 + 12l*2 - 2l*3 - 3l*3 + fl + l*3. Let v be x(-1). Solve b - 14 = -3k, vk - b - 10 = 2b for k. 4 Suppose 0 = 3z + 3q - 18, -3q = -18. Solve -5i + 11 = 2m, 3i + z = 3m - 6 for m. 3 Let z be ((-153)/(-68))/(6/(-16)). Let p be (z/(-5))/(18/45). Solve 3g + 12 = -3j, pj + 4 = -j for g. -3 Let p = 22 + -11. Suppose 9d + 14 = pd. Suppose 0 = 4w + 3q - 5, -8 - d = -5w - 2q. Solve y = -y - t - 4, -5y - 40 = -wt for y. -4 Suppose s = -2 + 4. Let t = -32512 + 32518. Solve -3w + t = 4x + 15, sw = 5x + 17 for w. 1 Suppose 0 = -n + 10n - 27. Let u(v) = -3v*3 - 1 + 3 + 2v - 4 + 2v2 + 2v*n. Let m be u(2). Solve 5j + 2b = 3, mb = -3j + 4j - 3 for j. 1 Suppose -22m + 2000 = -2972. Let y = m + -224. Solve 16 = 3l + 5k, -2l + 5k = yk + 2 for l. 2 Suppose -b - x + 54 = 0, -5b - 4x = -3b - 116. Let q = -55 + b. Let h be q/(-2)6/5. Solve -hl + 7 = -a, 4a = -l - 2l + 32 for l. 4 Let f(c) = 0c - c - 41c3 - 11 - c2 + 0c + 42c3. Let p be f(3). Solve 0 = -0o - po - 3i + 11, 0 = -5i + 5 for o. 2 Suppose b + 6y + 894 = 4y, 0 = 2b + 3y + 1786. Let m = 892 + b. Solve 3p - 7p = -2f, mp - 4f + 6 = 0 for p. 1 Suppose 4r = 5l - 301, -4r = -0r + 2l + 294. Let o be (-3159)/56728/(-2). Let n = o + r. Solve 0 = -k - ng - 2, 2k - 3g - 8 + 1 = 0 for k. 2 Suppose f + s + 0 = -3, f + 3s + 9 = 0. Suppose b - 4r + 6 = f, 5r = 2b + 3b. Solve -c + 11 = -5o - 5c, 0 = bo + 3c + 3 for o. -3 Let t(q) = 3q3 - 8q*2 - 5q + 44. Let v be t(7). Let b = -643 + v. Solve 5l - b = -4z, -7z = -3z - 2l + 18 for z. -3 Suppose -5y + 282 - 172 = 0. Let s be -5 + (y/(-3) + 5)-3. Solve -sa - t + 9 = -4t, 5 = -5t for a. 3 Let k = 23051 + -23027. Solve t = -x + k - 23, -5t + 11 = 3x for t. 4 Let i be (18 - 1)(-6 + (-21)/(-3)). Suppose -o + 10 = 5d, o - i = -2o - 2d. Solve -4c + x = -2x - 3, -5c = 5x + o for c. 0 Let w(q) = -1 + 0 - 241q + 242q + 4. Let f(d) = 2d + 2. Let i(m) = -2f(m) + 3w(m). Let b be i(-1). Solve 3a + 3s + b = -3, -a = -s - 7 for a. 2 Let s be (2/(-4) + 3)/((-3)/(-6)). Let p be 4/2 + -1 + 9. Suppose 15r - 149 = 256. Solve n - r = sd, 5d = -4n - p - 7 for d. -5 Let u = 49 - 51. Let m be (-1)/(((-1)/u)/(11/(-2))). Let w(h) = -h2 + 12h - 7. Let r be w(m). Solve -2c - rn = -6c, 0 = 5c + 5n - 40 for c. 4 Suppose -5y + 67 = q, 10q - 6q - 30 = -3y. Solve -3o = 5r - 32, -r + 4o - y + 2 = 0 for r. 4 Let a be (-266)/(-1463) + (-20)/(-11). Solve t = -4l + 5, -at + 34 = 2l + 30 for l. 1 Suppose -6a - 10a = 224. Let i be ((-693)/a)/11 - (-2)/(-4). Solve -f = -if + k + 12, 8 = 2f + k for f. 4 Let r(q) = 167q - 1000. Let s be r(6). Solve -30 = -sp + 5m, -44m - 9 = -5p - 48m for p. 5 Suppose -p + 6 = 2i, -4p + 167 = 5i + 149. Solve 0 = 4d + 16, 3d = -ij + 6j - 20 for j. 2 Let z(o) = -271o + 40. Let q be z(1). Let v be q/(-49) - (-12)/42. Solve -vu + s = 29, 5u - 7u - 3s + 2 = 0 for u. -5 Let d(j) = -j + j - 138 - 13j + 9j + 10. Let a be d(-32). Solve 0s - 2u + 7 = -s, a = 4s - 3u + 18 for s. -3 Suppose 2m + 3 = 5v, 2v - 5m + 8m = 24. Solve 4z + 4w - 4 = 3z, 0 = -3w + v for z. 0 Let g = 125 - 95. Suppose 6x - g - 24 = 0. Solve m + 3d = -16, 5m + 2d + 6 = -x for m. -1 Let y = -10675 - -10677. Solve -3p + 7j = 9j + 6, 5p + yj + 10 = 0 for p. -2 Suppose -3z = 3p - 2p + 201, 0 = 2p - z + 395. Let q = -140 - p. Suppose 4c - q = 3a, 5a - 52 = -5c + 3. Solve 6b - b + l - c = 0, b + 5 = -4l for b. 3 Let n(m) = -m3 + 6m*2 + 13m + 26. Let b be n(-6). Let y = -376 + b. Solve c - 11 = -4c - 2x, -yc + 13 = 3x for c. 1 Suppose 0 = 2k + 3c - 10, 2k + 4c - 20 = -2k. Solve 4z = -i - 20, kz + 5i = z - 36 for z. -4 Suppose 18r + 15328 = 4852. Let o = -578 - r. Solve 0m + 3m = -4d - 15, -od - 14 = 2m for d. -3 Let m = -1807 + 1811. Sol	{ "pile_set_name": "DM Mathematics" }
ming a is positive. a(-21/4) Simplify o(-4)/oo(-7/4) assuming o is positive. o(-27/4) Simplify (c(2/9))13/(cc(-1/3)/c)(-1/11) assuming c is positive. c(283/99) Simplify ((n/(n(-2/11)/n))/n)/(n/(n/(n*(-1/11)n)))(n(1/4))(-1) assuming n is positive. n(1/44) Simplify (z(-6)z*4)/((zz*(-1/3)z)/(zz(-2))) assuming z is positive. z(-14/3) Simplify (x(x*9x)/x)/((x*(-4/5)/xx)/x) assuming x is positive. x(59/5) Simplify (j(-21))(-1/14) assuming j is positive. j(3/2) Simplify a2/(a/((a(-3)/a)/a)) assuming a is positive. a(-4) Simplify (t(-2/21)/t)/(((t(tt*4tt)/ttt)/t)/t)(ttt*0)/ttt(2/9) assuming t is positive. t(-370/63) Simplify (k(1/10)kkk*3)/(k((k/(k/k0))/k)/k)(-1/31) assuming k is positive. k(1571/310) Simplify ((w/w2)/w)(-29)/(w/(w/(w/((w/w(1/2))/w)w)))(-26) assuming w is positive. w123 Simplify (g(-3)gg(-1/14))/(g/((gg*(-1)g)/g)g)(1/8) assuming g is positive. g(-65/28) Simplify ((l/((l/l(1/3))/l))/l)/(ll/l*(2/3))(l*(2/3)l)/l(1/7) assuming l is positive. l(11/21) Simplify (dd(3/5))43 assuming d is positive. d(344/5) Simplify (r(rr3)/r)/(r/(r/r(3/14))) assuming r is positive. r(53/14) Simplify (f(-4))(-16) assuming f is positive. f64 Simplify (gg/(g/(g/g*(-4)))gg5)/(g(1/2))(-6/13) assuming g is positive. g(159/13) Simplify (u(-1/11))17 assuming u is positive. u(-17/11) Simplify (q/(q/(qq/(q((qq*(-1/6)q)/qqq)/q))))/qq(-9)(q(-2/3)/q)(-30) assuming q is positive. q*(235/6) Simplify u/(uu*19)u(2/5)/u assuming u is positive. u(-98/5) Simplify (i/i0)(-15) assuming i is positive. i(-15) Simplify ((o/((o(1/6)/o)/o))/o)/o(-10) assuming o is positive. o(71/6) Simplify (vv/(vv/(vv19)))(-7/6) assuming v is positive. v(-70/3) Simplify (b/b0)3 assuming b is positive. b3 Simplify (c3(cc/c(-8))/c)36 assuming c is positive. c432 Simplify (t5t)/(t/(t/(t/(t/t*19)t))) assuming t is positive. t(-14) Simplify (((((b1/b)/b)/b)/b)(3/29))(-13) assuming b is positive. b(117/29) Simplify ((n/(((n2/n)/n)/nn))/(n/(n/n(-2/19))))/(nn*(-1)nn)(-23/3) assuming n is positive. n(937/57) Simplify mm/((m/m*(-3/4))/m)m(-2/33)/m assuming m is positive. m(25/132) Simplify s*11/(s/(ss*26ss)) assuming s is positive. s39 Simplify ((ii*(-2/33))/i)/ii(2/97) assuming i is positive. i(-3329/3201) Simplify (d(-13)/(d(-1/5)d))(-14) assuming d is positive. d(966/5) Simplify (p/(p4p))/(p*(-2)p)p((p/p*(2/13))/p)/ppp(-1)/p assuming p is positive. p(-54/13) Simplify ((j/(j0j))(-32))(5/4) assuming j is positive. 1 Simplify a*(-1/16)/aa/(((a/((a/((a/a*(-1/12)a)/a)a)/a))/aa)/a)a assuming a is positive. a(41/48) Simplify y4y(-2/17) assuming y is positive. y(66/17) Simplify (t/(t/(t*(-2/7)/t)t))*(2/23)((t/(t/(tt/(t/t(-3/4)))))/t)/((tt(4/7)/t)/t) assuming t is positive. t(-335/644) Simplify (l((l/l(6/5))/l)/ll)/((l/((l/(l(l/l(-26))/l))/l))/l) assuming l is positive. l(-136/5) Simplify (((mmm6m)/m)/((mm(-2/31)m)/m))(38/7) assuming m is positive. m(8322/217) Simplify r*(-15)rr(-11)/r assuming r is positive. r(-26) Simplify (h(2/3)/h(1/5))11 assuming h is positive. h(77/15) Simplify f(-28)/fff(4/7) assuming f is positive. f(-192/7) Simplify k(1/24)kk(2/3) assuming k is positive. k(41/24) Simplify (w/(w(w/w(1/9))/w))(-1) assuming w is positive. w(-1/9) Simplify (t(-1/4))(-32)/(t(-2/5))(1/27) assuming t is positive. t(1082/135) Simplify (mm/m7m)/m*(-1/7)mm/(mm*(-1/10))m*(-4)m assuming m is positive. m(-403/70) Simplify ((w/((w/(w/((w/w(-4))/w)))/w))/w)(-28) assuming w is positive. w84 Simplify (a/a(-2/53))24 assuming a is positive. a(1320/53) Simplify (a(1/4)aa)*21a*5(a(a(-2)a)/a)/aa assuming a is positive. a(205/4) Simplify s(2/7)s*0ss(-1/3)ssss(-3) assuming s is positive. s(20/21) Simplify ((vv*(4/5))/(vvv1v))(-24) assuming v is positive. v(264/5) Simplify (f(1/6)/f)43 assuming f is positive. f(-215/6) Simplify (a(-6)/a)(-21/5) assuming a is positive. a(147/5) Simplify (u(-1/3))(-11/6)/(((u/(uuu*4u))/u)/u6) assuming u is positive. u(245/18) Simplify ((pp(-3/8))/p4)/(p(1/15)/(pp/(ppp8))) assuming p is positive. p(-1373/120) Simplify (l*(-3)ll(2/3))(-38) assuming l is positive. l(152/3) Simplify (tt*(-1/2)(t*(-4)/t)/tt)16 assuming t is positive. t(-72) Simplify (c2)(-1/2) assuming c is positive. 1/c Simplify (b*(-1/6)b2)(-1/7) assuming b is positive. b(-11/42) Simplify p(-5/4)p17 assuming p is positive. p(63/4) Simplify (s(s/(s*4/s))/ss(s(4/11)/ss)/s)/(s(-9)/(s/s(2/9))) assuming s is positive. s*(806/99) Simplify ((gg/(g*(-3)g)g)/(g/(g(1/6)/g)))/(g(2/13)/gg(-2/5)) assuming g is positive. g(1721/390) Simplify (s(ss/s*4)/ss)/s*(-2/7)(s(-1))(-3/10) assuming s is positive. s(-29/70) Simplify (j/j(2/19))/(j(-5/8)/j) assuming j is positive. j(383/152) Simplify (m(2/17))(8/7) assuming m is positive. m(16/119) Simplify ((f/f3)/(f/f*(1/2)f))/(f(-2/3))(-2/3) assuming f is positive. f*(-71/18) Simplify gg*(-1/9)g(1/7)/g assuming g is positive. g(2/63) Simplify (t*(-15)t)/t(-5) assuming t is positive. t(-9) Simplify (p*4p2)(-25/2) assuming p is positive. p(-75) Simplify ((y(1/3)y)/((yy/(y*(-4)/y)y)/y))(-3/38) assuming y is positive. y(17/38) Simplify (j(-1))(8/7)/(j*(1/8)jj/j(-1)) assuming j is positive. j(-239/56) Simplify (g(-6))(-2/61) assuming g is positive. g(12/61) Simplify (l/(ll*1/ll)ll)*(6/7)l*(-8)ll4ll assuming l is positive. l(-1/7) Simplify n/(n/n(-16))nn(-17) assuming n is positive. n(-32) Simplify (r11)15 assuming r is positive. r165 Simplify ((zz/(z/z*(2/13))z)(2/41))(-42) assuming z is positive. z(-2352/533) Simplify (y(2/7)/y(-3))(-41) assuming y is positive. y(-943/7) Simplify (s(-1)s)(3/7)(s*(2/9)s)/(s(s(3/10)ss)/sss) assuming s is positive. s(-277/90) Simplify (n2n(-2/5))(-2/5) assuming n is positive. n*(-16/25) Simplify (k(k/(k/((k*0/kk)/k)k))/k)/(k/k(-1/10))k/(k/((k*(2/9)k)/k))k(-2) assuming k is positive. k(-439/90) Simplify ((ww*7w)/w)/w(-8) assuming w is positive. w16 Simplify (y/(y/(yy(3/23))))/((y(1/12)/yy)/y) assuming y is positive. y(565/276) Simplify (p(2/7)p(-10))(8/7) assuming p is positive. p(-544/49) Simplify (y/(y/(yy/(yy1))y))(-34/5)/(y/((y/(y/y(-2/9)y))/y)yyyy/y0y) assuming y is positive. y(-64/45) Simplify ((q/q(-5))/q)(-1/48) assuming q is positive. q(-5/48) Simplify o*1o(-20) assuming o is positive. o(-19) Simplify ((((z/(zz/z(5/4))z)/zz)/z)/(zz(z/(z9/z))/z))/((zzz/(zz*(3/10)/z)zz)/z(-1)) assuming z is positive. z(11/20) Simplify (xxxx0)/x0x/((x/(x/x(-1/7)x))/xx)x*6x assuming x is positive. x(85/7) Simplify (n(1/7)/nn(3/5)/nn)/(((nn(-8))/nn)/nn(-2/13)/n) assuming n is positive. n(4048/455) Simplify (((x(4/21)/x)/x)/x)/((x27x)/x) assuming x is positive. x(-626/21) Simplify l(-10)l((l(-40)/l)/l)/l assuming l is positive. l(-52) Simplify w*(3/13)/ww/w1 assuming w is positive. w(-10/13) Simplify o/o*(-1/3)o*(-6)/o((o/((o/o(-2/9))/o))/o)(-2/41) assuming o is positive. o(-2087/369) Simplify l(-1/3)ll/(ll(5/6))l/l*(-6)ll4 assuming l is positive. l(71/6) Simplify ((p/(pp/(p/p*3)p))/p*5)/(pp1)(-10/17) assuming p is positive. p*(-133/17) Simplify (qq*(-13)q)18 assuming q is positive. q(-198) Simplify p15/(p/(p(-1/6)p)) assuming p is positive. p(89/6) Simplify (k(-1/3)k*(2/3))/((k/(kk(-6)))/k1) assuming k is positive. k(-14/3) Simplify h(2/13)h(h(h/((hh/((h*0h)/hhh)h)/h))/hhh)/h(h/(h/((h/(h(-2/5)/h))/h)))/(h(5/4)/h) assuming h is positive. h*(1119/260) Simplify (a(aaa*(-1/4)aa)/aa)(-37) assuming a is positive. a(-703/4) Simplify v(-14)/(v(-9)/v) assumi	{ "pile_set_name": "DM Mathematics" }
Expand (q*2 + 2q2 - q2)(0 + 1 + 0 + (2 + 0 + 1)(2 + 0 + 0) + 0 - 4 + 2). 10q2 Expand 12s*3 - 23s*2 + 23s*2 + (1 - 1 + 1)(0s2 + 0s*2 + 2s*3). 14s*3 Expand (-4k + 2k + 0k)(-2k - 3k + 6k) + k*2 + 2 - 2 + 1 + 2k*2 - 1 - 4k*2 + k + 6k*2 + 2 - 5k*2. -2k*2 + k + 2 Expand (2n - 5n + 0n)((-2 - 4 + 4)(2 + 5 - 6) - 2 + 4 - 1 + 2 + 0 - 3). 6n Expand (0 + 0 + 2)(1 - 1 + 9q2) + (-5q + 4q + 3q)(-4q + 4q + 2q). 22q2 Expand (-4 + 4 + 1)(0 + 0 - 2u2) - 2u*2 + 0u + 0u2 + 3u. -4u2 + 3u Expand (22j2 - 4j*2 + 7j*2)(2j - 2j - j3) + j5 - j5 - j5. -26j5 Expand (2d - d*3 - 2d)(-2d + d + 3d) + 2d*4 - 2d4 + d4 - 26d3 - 8d*4 + 26d*3 + (-2d*2 - 2d*2 + 2d*2)(-d*2 - 2d2 + d2). -5d4 Expand k5 + 0k*3 + 0k*3 + 2k*5 + 2k*5 - 3k*5 + (-4 + 4 - 1)(-k*5 + 3 - 3) + (0k*5 - 3k5 + k5)(2 + 2 - 6). 7k*5 Expand (-9 + 9 - 3z)(5 - 2 + 0)(2 - 2 - 1). 9z Expand (-3 + 3 - r)(8 + 20 - 11). -17r Expand ((2 - 6 + 3)(-t + 3t - t) - t + 2 - 2 - t + 2 - 2)(8t3 - 11t*3 + 25t*3). -66t*4 Expand (2q*3 + 2q*3 - 3q*3 + (-3q2 + q2 + 0q2)(0 + 0 + q))(1 + 3q - 10 - 4q). q4 + 9q*3 Expand (4b*2 + 3b*2 - 5b*2)(5b - 3b - b) + 0b2 + 0b*2 + 2b*3 - 18b*3 + 17b*3 + 79b3 + b - b - b3. 81b3 Expand (5i*3 - 2i*3 - 2i*3)(-4 + 1 + 2). -i*3 Expand (2 - 2 + g)(3 + 1 - 5)(-12g + 4g2 + 12g). -4g3 Expand (9 + 4 + 2c - 14)(1 - 1 - c3 - 1). -2c4 + c3 - 2c + 1 Expand -2r + 0r + r + (4r - 20 + 20)(2 + 3 - 6). -5r Expand (-n + n - 4n)(-13 + 2n + 13). -8n*2 Expand ((2f + 1 - 1)(2 - 1 + 1) + 6f - 3f - 4f + 4f - 4f + 2f)(2f + 6f - 7f). 5f*2 Expand 156s*5 - 92s*5 - 146s*5 + (0s2 - s2 + 0s2)(-4s3 - s3 + 4s*3). -81s*5 Expand (-3d - 1 + 1)(-1 + 0 - 3)(3d - d2 - 3d). -12d3 Expand (3q - 4q + 3q)(0q + q + q) + (q + q - q)(0q + 3q - 4q). 3q2 Expand (2o*3 - 4o*3 + 3o*3)(-4 - 2 + 7 + (-2 - 4 + 4)(-2 + 5 - 2))(-11 + 11 + 4o). -4o4 Expand -s5 + 0s5 + 3s*5 + (0 + 0 - 2)(-3s5 - 2s*5 + 3s*5) + 2s*5 + 1 - 4s*4 + 2s*5 + 6s*4. 10s*5 + 2s*4 + 1 Expand 4 - i - 4 + (-1 + 4 - 1)(-3i + 6 - 6). -7i Expand 4m - 4m + m*4 + (4 - 3 + 0)(m*4 + 2m4 + m4). 5m4 Expand 188 - 188 + 29a + a + 1 - 1 + (-3a + 4a + a)(-2 - 2 + 2) - a - a + 3a. 27a Expand (o + 2o + 0o)(-2o3 - 2o + 3o + 0o*3). -6o*4 + 3o*2 Expand (2 + 2 - 3)(4q + 0q - 2q) + 1 - 2 + 4 + 3q. 5q + 3 Expand -w4 + 4w4 - 2 - w4 + 2w4 - 3w + 3w + (-2w*3 - 2w*3 + 6w*3)(0w + 4w - 6w) - w4 - 4w*2 + 4w2. -w4 - 2 Expand (-3 + 1 + 4)(3 + 2 - 2)(-16 - 20q + 16). -120q Expand 3 + 2s - 3 + (-4 - 2s + 4)(2 + 0 - 3) + 3s + 4s - 3s. 8s Expand (-5r*4 + 6r*3 - 6r*3)(-2 - 3r + 2 + r - 4 + 4 - 4 + 2r + 4 + (0 - 2 + 3)(4r + 2r - 4r) + 2r - 3r + 2r). -15r*5 Expand ((0r - 3r + 4r)(2 - 6 + 3) + 185 - 185 - 35r)(0r3 + r3 - 3r3). 72r*4 Expand (-2y2 + y2 + 2y2)(-2y - 2y + 2y) + (-4 + y3 + 4)(1 - 1 - 1). -3y3 Expand (-176c*2 + c + 1 + 179c*2 - 2)(-2 - 1 + 4). 3c2 + c - 1 Expand 2 - 2 - 2d + (5 - 3 + 0)(3d + d - 3d)(3 + 1 - 2). 2d Expand (-4 + 1 + 1)(12k - 86 + 12k - 25k). 2k + 172 Expand (0j - 2j + j)(3j + j - 3j) + 0j2 - j2 - 1 - 19j + j. -2j*2 - 18j - 1 Expand (4 + 4 - 6)((0 - f + 0)(-2 - 2 + 5) - f - 1 + 1). -4f Expand (-2i - 4i + 5i)(-2i - i*2 + 2i) + 33i3 + 8i*3 + 21i*3. 63i*3 Expand (-2 + 4 + 0 - 1 + 4 + 0 + (1 - 3 + 4)(-3 + 1 + 1) + 1 + 0 - 3 + 1 - 1 + 1)(2f + 0f - 4f). -4f Expand (-2p3 - p3 - 3p3)(-2p2 + 3p - 3p). 12p*5 Expand (-b + 0b + 3b)(1 + 4 - 3) + 2 + b - 2. 5b Expand -10b*5 + 42b*5 - 22b*5 + 4b5 + b5 - 3b5 + (b4 - 2b4 - b4)(-b + b + 3b). 6b5 Expand (-1 + 2 - 3)(19 - 19 + 8x2). -16x*2 Expand 3p*5 - 2p*4 + 2p*4 - 2p*5 - 3 + 3 + (2p - p + 0p)(2p2 - 2p*2 - 3p*4). -2p5 Expand -r3 - 3r2 + 3r2 + r3 - r + r - 4r3 + r3 + 2r*3 + (-2r + 2r - 2r*3)(-2 - 2 + 2) - 2r3 + 0r + 0r + 3r3 + r3 - 6r3. -r3 Expand 0 - w5 + 0 + 1 - 2w*5 - 1 + (2 - 2 + 2w)(-3w4 - w4 + 2w4) - 3w*3 - 11w*5 + 3w*3. -18w*5 Expand (-2q + 5q - q)(-19 - 19 - 7)(-1 - 1 + 3). -90q Expand (3p2 - 6 + 6)(-16 - 3p3 + 0p*3 + 12). -9p*5 - 12p*2 Expand -2i5 + i2 - i*2 + (6i*2 - 3i2 - i2)(i2 - i2 + 2i*3) + 2i3 + i5 - 2i3. 3i*5 Expand (-2 + 8 + 14)(-2 + 2 + 2)(-h + 3h - 3h). -40h Expand (2r2 - 36r*3 + 0r*2 + 59r*3)(-1 + 1 + r*2). 23r*5 + 2r*4 Expand (-2 + 0 + 0)(-4j2 + 5 - 5). 8j*2 Expand (-2m + 4m + 0m)(1 - 2 + 2) + 27 - 7m - 27. -5m Expand (3f + 3f + 0f)(-3f*4 + 0f*4 + 4f*4). 6f*5 Expand (2 - 3b*2 + 3b2 + b2)(-12b + 10b - 9b). -11b3 - 22b Expand (3t3 - t3 - 5t*3)(0 + 0 + 1) + 0t3 - t3 + 2t3 + (-t2 - 1 + 1)(0t + 4t - t). -5t3 Expand -k4 + k4 + k4 + (2k2 - k2 - 2k*2)(4 - 4 + k)(0k + 2k + 0k + (1 + 0 + 2)(-17 - 7k + 17)). 20k4 Expand (4h - 6h + 3h)(0h2 + h3 + 0h2) + 3h*2 - 2h*4 - 3h*2 + 286h*2 + 1 - 16h*4 - 286h*2. -17h4 + 1 Expand (d2 + 0d2 + d2)(-2 - d2 + 2) + (d2 + 3d2 - d2)(7d2 - 3d*2 + 0d*2 + 2d) + 10d2 - 3d*4 - 10d*2. 7d*4 + 6d*3 Expand t + 3t*4 - t + (-2 + 2 - 2t*3)(4t - 2t + 0t) - 4t*4 + 4t*3 - 4t*3. -5t*4 Expand (14k*2 + 17k*2 - 25k*2)(-2k + 0k + k + (-3 + 3 + k)(0 + 0 - 2) - 4k - 3k + 5k). -30k3 Expand (m4 + 3m*4 - 2m*4)(-4m + 5m + m - 1 + 2m + 1 + (m - 3 + 3)(-4 + 3 - 1) + 2m + 0m - m). 6m5 Expand -2h - 2h + 3h + (0h + 2h - h)(-4 + 0 + 6) - 3h - h + 2h + 157 - 157 - 19h. -20h Expand (-4 - 4 + 5)(-9a - 31 + 31)(-4 + 1 + 4)(5a - 2a - 2a). 27a2 Expand -b + b - 2b*5 + (-3b*3 - 3b*5 + 3b*3)(-4 + 1 + 2). b*5 Expand (15 - 3w*3 - 15)(5 - 2 - 1). -6w3 Expand (-2 + 0 + 3)(-2m - 8 + 0m + 9)(-4 + 0 + 0). 8m - 4 Expand -2t4 + 4t4 + t4 + (-1 - t + 1)(-2t3 - t3 + 0t3). 6t*4 Expand (-2 + g + 2)(0g - g + 2g) + (-2g + g - 3g)(2 - 5 + 7g - 2g). -19g*2 + 12g Expand 29o4 - 8o4 - o4 + (-2o - o + 2o)(2o*3 + 3o*3 - 3o*3). 18o*4 Expand 46h*4 + 47h*4 - 91h*4 - 69h5 + (-h2 - 2h3 + h2)(h*2 + 2h - 2h). -71h*5 + 2h*4 Expand 54i*2 + 55i*2 - 111i2 - i4 + 36i + i4 - i4 - 2i*4 + (5 - 2 - 2)(-i + i - i*4) + 0 + 0 + 2i*4. -2i*4 - 2i*2 + 36i Expand -2 - w + 2 + (-2 + 5 - 1)(6w - 3w - w) - 4w + 3w + 2w - 5w + w + 2w + 4w - w - 2w + 0 + 0 - 3w + (-3 + 7 - 3)(4w - 4w - 2w). -2w Expand (-26q3 + 4q*2 - 9q*2 + 2q*2)(-2q - 1 + 1). 52q*4 + 6q*3 Expand 2g3 + g3 - 2g3 + ((6 - 4g*2 - 6)(-2 + 2 + g) - 3g3 + g3 + 0g*3)(0 + 0 + 1). -5g3 Expand (0 + 0 + 2b)(3b*2 - 5b*2 + 3b*2 + (3b - 4b - b)(b + 0 + 0) - 29b2 + 9b*2 - 18b*2). -78b*3 Expand (-2 + 4 - 1)(t + 30t + 4t). 35t Expand (0 + 0 - r2)(10 - 9r2 - 10 + (-r - 2 + 2)(2 + 2r - 2) + 2r - 2r + r2). 10r*4 Expand ((-2m + 0 + 0)(-3 + 2 - 1) + 0 + 0 - 2m)(-8m - 9m + 7m). -20m2 Expand (3 + 2 + 1)(-3l5 + l5 + l5) + l5 + l5 + 0l*5 - 5l3 + l5 + 5l3. -3l5 Expand -a5 + a*5 - 2a*5 + (3 - 4 + 6)(2a2 + 5 + 2a*5 + 9a*4 - 5). 8a*5 + 45a*4 + 10a*2 Expand (-4j*3 + 5j*2 + 5j*2 - 8j*2)(-3 + 5 - 3)(2j + 0j + 2 - 3). 8j*4 - 8j*3 + 2j2 Expand (-j4 + 3j4 - 3j*4)(2j + 2j - 2j) + (-j3 + j3 - j3)(18j2 - 1279j + 1279j). -20j*5 Expand y - y + 3y*2 + (1 + y + 4 + 0y)(0 + 0 - y). 2y*2 - 5y Expand ((0d - 4d + 0d)(3 - 4 - 1) - 3d - d + 5d + (5 - 3 - 1)(-2d + 5d - d) + 4d - 3d + 0d)(-2 - 3 + 3). -24d Expand (5 - 5 + 6g)(0 + 2 + 1)(0 + 0 + g). 18g*2 Expand 3c*3 - 100 + 100 - 2c*2 + (0c - 2c + 4c)(-c + c - c2). c3 - 2c*2 Expand (0 + 0 + 2m)(1 + m - 1) - 30m*2 + 36m*2 + 35m*2. 43m**2 Expand (	{ "pile_set_name": "DM Mathematics" }
an -0.573? False Does 46/29 = 3? False Is -217 bigger than -217? False Is 2.96 at least as big as -5/4? True Is 6 greater than or equal to 0? True Is 343 smaller than 344? True Is 5470 at most 5470? True Is 8025 greater than 8024? True Is -44 less than -467? False Do -0.09 and -15 have the same value? False Does -138 = -139? False Which is bigger: 0.3 or -2271? 0.3 Do -67 and -63 have different values? True Which is greater: -20/407 or -1? -20/407 Which is smaller: -11162 or -11160? -11162 Do -2/5387 and 1 have different values? True Which is bigger: 88/7 or -1? 88/7 Is 16 != -15? True Which is smaller: 126 or 123? 123 Is -5.74 bigger than 0.01? False Is -2/11941 < -1? False Is -1757 < 4? True Is -0.4 at least as big as 204? False Is 24188 less than or equal to 24187? False Is 1651 <= 1653? True Is -2.2 < -4? False Which is greater: 647 or 643? 647 Is 469 smaller than 471? True Is -29 at least as big as -660/23? False Which is bigger: 4 or -1901? 4 Which is bigger: -1166 or -1162? -1162 Are -195 and -197 non-equal? True Are 9088 and 9087 non-equal? True Which is smaller: 0.1 or 0.0136? 0.0136 Which is bigger: -506 or -507? -506 Which is smaller: -2/289 or 0? -2/289 Which is smaller: 1 or 7/2143? 7/2143 Is 24 < -7.3? False Which is greater: -6807 or 1? 1 Are 763 and 762 non-equal? True Is 47119 < 47119? False Which is greater: 1 or -1/265? 1 Which is smaller: -46/313 or -1? -1 Is -26 >= -1.1? False Which is smaller: 1/2 or 0.78? 1/2 Which is smaller: -2/17 or 11? -2/17 Is -8/4131 >= 1? False Which is smaller: 30 or 745/24? 30 Does 19/6 = 3? False Which is smaller: -33 or -24? -33 Is 1/45 <= -8? False Is -0.6 less than or equal to -1220? False Which is bigger: 2/287 or 0? 2/287 Which is smaller: -100 or 0.1? -100 Is 170 at least as big as 169? True Which is smaller: 400 or 403? 400 Is -1907/2 less than -955? False Is -32469 not equal to -32469? False Which is smaller: 4374 or 2/7? 2/7 Is 395 < 395? False Which is smaller: 6 or 374/61? 6 Are -22286 and -22284 nonequal? True Is -207/4 less than -52? False Which is bigger: 1 or 5/4? 5/4 Is 1169 not equal to 1168? True Which is greater: -15/7 or -2? -2 Do -29 and -117/4 have the same value? False Is 334 at least 336? False Which is bigger: 1/414 or 1? 1 Is 0 less than -9/2989? False Do 2645 and 2646 have the same value? False Is 87 greater than 90? False Which is smaller: 0 or 1/359? 0 Is 0.1 != 810? True Does -3/1483 = 0? False Which is smaller: -1/652 or -1? -1 Which is bigger: -0.45 or 10? 10 Is -0.018 less than 3/29? True Is 125 at least as big as 124? True Which is smaller: -20256/5 or -4051? -20256/5 Are -44 and -474/11 unequal? True Is -56 equal to -56? True Is -39 at most 3? True Which is smaller: -2/1217 or -1? -1 Do 0 and 192/445 have the same value? False Is -6/17 greater than 0.2? False Is 350 at most 350? True Is 93 bigger than 95? False Which is smaller: 3.4 or 4/3? 4/3 Is 11066 at least as big as 11066? True Which is bigger: 0.1 or 0.2527? 0.2527 Is 40 at most 6? False Which is smaller: 187 or -1/3? -1/3 Is -43 at least 0.18? False Is 2134 bigger than 2135? False Is 0.1 <= 1110/7? True Are 1 and -4/151 equal? False Is -7 at most 23? True Is 0 greater than -12/4813? True Is 372/89 at most 4? False Which is bigger: -247 or -302? -247 Which is bigger: 142.1 or 2? 142.1 Which is greater: -2 or 2/11? 2/11 Is -0.16 > 47? False Are -303 and -303 equal? True Is 1098 at most as big as 1098? True Is -10 smaller than -0.04? True Is 1542 bigger than 1538? True Is -16883 less than or equal to 1/2? True Does -2444 = -2443? False Is 0 at least -3/2080? True Which is smaller: 2/68715 or 1? 2/68715 Which is smaller: 4 or 105/41? 105/41 Which is smaller: 301 or 284? 284 Which is greater: -1 or 2/235? 2/235 Is -5/822 at most 0? True Is -511/3 != -169? True Is -2/7 less than -1/3? False Is -1047 >= -1055? True Which is bigger: 1 or -1/4602? 1 Which is greater: -70 or 1.7? 1.7 Is 7/4 equal to -238? False Is 4668 at least 4669? False Which is bigger: -3/7 or -174/17? -3/7 Which is bigger: 22 or -8? 22 Which is bigger: -1/694 or 1? 1 Which is bigger: 1 or 2/30987? 1 Is 3/316 at least 1? False Is 2282 greater than -2/5? True Which is smaller: 0 or 14/377? 0 Are -12 and 0 non-equal? True Which is bigger: -30223/4 or -7556? -30223/4 Which is smaller: 3/7 or -45? -45 Which is smaller: -2 or -44/29? -2 Which is smaller: -8 or 0.5? -8 Is 2029 less than 2026? False Which is smaller: -1270 or 0? -1270 Is 0 < 10/117? True Is -383/6 at most -64? False Is -5773 at most -5772? True Which is smaller: -2.4 or 84? -2.4 Which is smaller: -2 or -41/22? -2 Is -0.2 <= -712? False Which is greater: 4431 or 4430? 4431 Is 299.9 != -1? True Which is greater: -76/71 or 0? 0 Do 6/55 and 8 have the same value? False Is 35080 smaller than 35080? False Does 51/92 = 2? False Which is smaller: -1 or -3/949? -1 Is 4 != 31/7? True Is 0 less than 3/11? True Which is smaller: 12 or -32? -32 Is 79 at least 562/7? False Are 1189 and 1188 equal? False Which is bigger: -0.2 or -42/11? -0.2 Is 2/7 greater than or equal to 372? False Is 1605 smaller than 1602? False Is -1214 at most as big as -1217? False Which is bigger: -0.48 or -2/5? -2/5 Do 157 and 162 have different values? True Is -99 bigger than -896/9? True Which is smaller: -537 or -538? -538 Is -11/2798 at most as big as 0? True Is -294 > -1? False Which is smaller: 1/2 or 1/364? 1/364 Which is smaller: 0.85 or 2/37? 2/37 Which is smaller: 0 or 9/1285? 0 Is -73 greater than -78? True Is -106 at most -105? True Which is bigger: 28 or 141/5? 141/5 Do 174 and 1049/6 have different values? True Is 27/23 at most as big as 1? False Which is smaller: -7.6 or 38? -7.6 Which is bigger: -5 or 6.1? 6.1 Which is bigger: 3/116 or -1? 3/116 Is 0 smaller than 6/511? True Which is bigger: 133 or 132? 133 Which is smaller: 5338 or 5336? 5336 Do 239 and 268 have different values? True Which is smaller: -22793/4 or -5697? -22793/4 Is -4/9035 at least as big as -1? True Is 48427 at least as big as 0? True Which is smaller: 17/44 or 1? 17/44 Is -122 greater than -0.8? False Is 4 > 725? False Which is bigger: -1 or 7/713? 7/713 Are 106 and 116 unequal? True Which is smaller: -386 or -382? -386 Is 2.4 <= -52? False Which is bigger: -86 or -5? -5 Which is smaller: 0 or 12/55? 0 Which is bigger: -0.05 or -1/6? -0.05 Is 3 not equal to 3? False Which is smaller: 1 or -1/4534? -1/4534 Is 29 smaller than -2/13? False Is -0.005 > -26/7? True Is -3 at most as big as -0.14? True Which is smaller: -3560 or -3561? -3561 Is 201 smaller than 210? True Which is bigger: 0.25 or 1/13? 0.25 Which is greater: 16 or 19? 19 Which is smaller: -179 or -535/3? -179 Is -2 greater than or equal to -42/13? True Which is smaller: -1 or -3/16? -1 Is 885 greater than 883? True Which is smaller: 29 or 13? 13 Which is smaller: 70 or 8? 8 Which is smaller: 291 or -2/7? -2/7 Is -0.1 smaller than -0.07709? True Is -23 at least as big as -23? True Which is smaller: 14/3 or 6? 14/3 Which is greater: 170 or 171? 171 Which is smaller: 4825 or 4826? 4825 Does 1 = 17/19? False Is 0 bigger than 19/629? False Which is greater: -27 or 0.83? 0.83 Is 1/242 bigger than -1? True Which is greater: -254 or -256? -254 Which is bigger: 0 or 54? 54 Is 69 < 71? True Which is greater: 3/22 or -209? 3/22 Is -776 greater than -775? False Which is smaller: -119 or -120? -120 Do 1970/7 and -2/7 have different values? True Which is smaller: -242 or -243? -243 Which is smaller: 766 or 763? 763 Is 1/282 at least as big as 1? False Are -1 and -37/380 nonequal? True Which is bigger: 2 or 14/23? 2 Do -900 and -898 have the same value? False Is -13/1177 at least as big as -1? True Is 12/13 != 2? True Is -263/6 at most as big as -43? True Which is greater: -2103/5 or -422? -2103/5 Which is smaller: 2 or 240/169? 240/169 Which is smaller: 1 or -166? -166 Is 65 > 64? True Is 201 at most as big as -2? False Is -2 less than or equal to 177? True Are 145/306 and 1 equal? False Are 888 and 888 non-equal? False Which is smaller: -2.7 or 266? -2.7 Which is bigger: -12122 or -12121? -12121 Which is smaller: -2 or 171? -2 Are -67 and -525/8 non-equal? True Is 501 less than 475? False Which is smaller: -2/877 or -2/7? -2/7 Which is greater: 10642 or 10641? 10642 Which is smaller:	{ "pile_set_name": "DM Mathematics" }
eplacement from {s: 3, j: 5, g: 5, y: 1, r: 2}. What is prob of sequence ggg? 1/56 Calculate prob of sequence eeqr when four letters picked without replacement from {e: 4, q: 4, p: 3, r: 2, i: 3}. 1/455 Two letters picked without replacement from {w: 2, v: 2, s: 4, z: 2}. What is prob of sequence sw? 4/45 What is prob of sequence qt when two letters picked without replacement from tthhtqrtth? 1/18 What is prob of sequence ajyi when four letters picked without replacement from iyaainjs? 1/420 Four letters picked without replacement from {d: 1, z: 1, w: 1, t: 1, v: 1}. What is prob of sequence dwzt? 1/120 Two letters picked without replacement from zzzzqdddqzzqz. What is prob of sequence qq? 1/26 Two letters picked without replacement from oqzznzzzzzzoz. What is prob of sequence nz? 3/52 What is prob of sequence zzzz when four letters picked without replacement from {z: 9}? 1 What is prob of sequence tsnz when four letters picked without replacement from {t: 1, v: 1, n: 1, z: 5, s: 2}? 1/504 Four letters picked without replacement from {l: 4, o: 2}. What is prob of sequence llll? 1/15 Four letters picked without replacement from fpvffppvvpvvevjpp. What is prob of sequence pvpe? 3/952 What is prob of sequence ax when two letters picked without replacement from bzbapadpxpza? 1/44 Two letters picked without replacement from {b: 4, d: 2}. What is prob of sequence db? 4/15 What is prob of sequence gv when two letters picked without replacement from wvvuwwgucwwvu? 1/52 What is prob of sequence kk when two letters picked without replacement from vkkvkkkkkk? 28/45 Three letters picked without replacement from {m: 2, i: 11}. Give prob of sequence mmi. 1/78 What is prob of sequence so when two letters picked without replacement from ssosx? 3/20 Calculate prob of sequence ozy when three letters picked without replacement from xznioyn. 1/210 Calculate prob of sequence tut when three letters picked without replacement from {s: 1, u: 4, t: 1, y: 3, f: 2}. 0 Four letters picked without replacement from {g: 2, s: 5, q: 2, e: 1, j: 1, w: 5}. What is prob of sequence wqsw? 5/1092 Four letters picked without replacement from {c: 9, u: 3, f: 7}. What is prob of sequence ucuf? 21/5168 What is prob of sequence ppp when three letters picked without replacement from lplpphllpp? 1/12 What is prob of sequence oo when two letters picked without replacement from {l: 4, o: 14}? 91/153 Three letters picked without replacement from zbczcqlbh. Give prob of sequence hzb. 1/126 Four letters picked without replacement from {x: 1, d: 2, n: 2, l: 4, q: 3, g: 3}. Give prob of sequence lngx. 1/1365 Three letters picked without replacement from zlxz. What is prob of sequence zxz? 1/12 Calculate prob of sequence ts when two letters picked without replacement from ssstt. 3/10 Calculate prob of sequence yz when two letters picked without replacement from nozyppoono. 1/90 What is prob of sequence ww when two letters picked without replacement from mmmmmwmmmmmw? 1/66 Three letters picked without replacement from {c: 5, i: 3}. What is prob of sequence ccc? 5/28 Two letters picked without replacement from oboububbueleww. Give prob of sequence wb. 4/91 Three letters picked without replacement from kakkkggkdkgkkggkkdk. Give prob of sequence gag. 10/2907 Three letters picked without replacement from oawawcaawoaooww. Give prob of sequence wwc. 2/273 What is prob of sequence ldln when four letters picked without replacement from {l: 6, n: 5, c: 3, d: 1, z: 5}? 5/3876 Two letters picked without replacement from {d: 2, b: 4}. What is prob of sequence db? 4/15 Calculate prob of sequence nnc when three letters picked without replacement from nnnnnnnnnncnnnn. 1/15 What is prob of sequence ioff when four letters picked without replacement from {i: 3, f: 2, g: 6, e: 5, o: 1}? 1/9520 Three letters picked without replacement from eeeeeejeeejejejeeej. What is prob of sequence eee? 364/969 Calculate prob of sequence kk when two letters picked without replacement from kmdnc. 0 What is prob of sequence lz when two letters picked without replacement from mmqmzmllymlmmmllmlll? 2/95 Calculate prob of sequence pppv when four letters picked without replacement from {p: 2, v: 4, z: 1, o: 2}. 0 What is prob of sequence dyed when four letters picked without replacement from {u: 1, d: 2, e: 1, q: 5, s: 2, y: 2}? 1/4290 Three letters picked without replacement from btbbtbbtttbbbtpbbpb. What is prob of sequence tpt? 10/969 Two letters picked without replacement from {w: 1, b: 6, c: 4, g: 3, t: 2, d: 2}. Give prob of sequence gb. 1/17 Calculate prob of sequence wl when two letters picked without replacement from {l: 3, r: 5, w: 5}. 5/52 Two letters picked without replacement from {p: 1, m: 1, z: 1, l: 1, g: 1}. Give prob of sequence lg. 1/20 What is prob of sequence rxx when three letters picked without replacement from rxxxxrxrxrxrx? 70/429 Three letters picked without replacement from mrmll. What is prob of sequence rlm? 1/15 What is prob of sequence smb when three letters picked without replacement from lmbsclco? 1/336 Three letters picked without replacement from vvvtkvvtvvtvtttukvu. Give prob of sequence vuu. 1/323 Four letters picked without replacement from afcfcpc. Give prob of sequence capc. 1/140 Calculate prob of sequence dd when two letters picked without replacement from {l: 4, d: 14}. 91/153 Two letters picked without replacement from qnncn. What is prob of sequence nc? 3/20 Calculate prob of sequence jmm when three letters picked without replacement from jjsuomsuujmi. 1/220 What is prob of sequence kb when two letters picked without replacement from buubxxxubuxxxbbuxubk? 3/190 Calculate prob of sequence jn when two letters picked without replacement from iniijjj. 1/14 Three letters picked without replacement from {o: 4, k: 4, p: 2, r: 4}. What is prob of sequence rpp? 1/273 What is prob of sequence bg when two letters picked without replacement from gebgmugg? 1/14 Calculate prob of sequence bvv when three letters picked without replacement from {t: 4, v: 5, l: 7, b: 1, u: 2, i: 1}. 1/342 What is prob of sequence ut when two letters picked without replacement from {s: 1, w: 1, e: 2, t: 4, u: 1}? 1/18 Two letters picked without replacement from {q: 1, v: 4, m: 6, i: 1, k: 3, g: 4}. What is prob of sequence mv? 4/57 Three letters picked without replacement from {x: 4, r: 2, t: 2, u: 2, j: 1, f: 4}. Give prob of sequence rxf. 16/1365 What is prob of sequence rvvv when four letters picked without replacement from {r: 2, v: 6}? 1/7 Two letters picked without replacement from {o: 2, n: 1}. Give prob of sequence no. 1/3 Two letters picked without replacement from {x: 2, z: 1, v: 1, n: 1, e: 3, r: 3}. What is prob of sequence xr? 3/55 Four letters picked without replacement from {u: 12, a: 7}. Give prob of sequence uuaa. 77/1292 What is prob of sequence mmhv when four letters picked without replacement from {j: 3, h: 4, i: 1, m: 2, v: 1, s: 1}? 1/1485 Three letters picked without replacement from {f: 1, x: 2, t: 7}. Give prob of sequence xtf. 7/360 What is prob of sequence jj when two letters picked without replacement from {g: 1, l: 3, q: 1, j: 3, f: 1, m: 2}? 3/55 Two letters picked without replacement from {y: 4, v: 2, c: 8}. What is prob of sequence vv? 1/91 Three letters picked without replacement from fgefgeeeegrgdfef. Give prob of sequence efg. 1/35 Four letters picked without replacement from ojjjjojoojjjoj. What is prob of sequence ojjo? 60/1001 What is prob of sequence zu when two letters picked without replacement from aouozaaa? 1/56 Three letters picked without replacement from {y: 7, g: 5}. What is prob of sequence ygg? 7/66 Four letters picked without replacement from kvkrkvmrmvvamm. Give prob of sequence amrv. 4/3003 Two letters picked without replacement from {f: 1, a: 3}. What is prob of sequence af? 1/4 Two letters picked without replacement from ewuwequwwq. Give prob of sequence qe. 2/45 What is prob of sequence lh when two letters picked without replacement from hlllhhhhlhhlh? 10/39 Calculate prob of sequence yz when two letters picked without replacement from {d: 7, z: 1, j: 1, l: 1, e: 4, y: 5}. 5/342 What is prob of sequence glg when three letters picked without replacement from glgl? 1/	{ "pile_set_name": "DM Mathematics" }
M and 6:59 AM? 139 What is 62 minutes after 3:15 PM? 4:17 PM What is 148 minutes after 1:22 PM? 3:50 PM How many minutes are there between 5:14 AM and 7:49 AM? 155 What is 265 minutes after 11:19 AM? 3:44 PM How many minutes are there between 1:21 PM and 4:43 PM? 202 How many minutes are there between 9:50 PM and 2:01 AM? 251 How many minutes are there between 10:42 AM and 6:01 PM? 439 What is 292 minutes before 6:15 PM? 1:23 PM What is 691 minutes before 9:23 AM? 9:52 PM What is 235 minutes after 4:32 PM? 8:27 PM What is 104 minutes before 11:54 PM? 10:10 PM What is 175 minutes before 12:52 AM? 9:57 PM How many minutes are there between 5:34 AM and 7:06 AM? 92 What is 152 minutes before 10:09 PM? 7:37 PM How many minutes are there between 10:20 AM and 4:36 PM? 376 How many minutes are there between 3:25 AM and 4:01 AM? 36 What is 136 minutes before 10:24 PM? 8:08 PM What is 82 minutes after 6:08 PM? 7:30 PM What is 631 minutes after 6:27 AM? 4:58 PM How many minutes are there between 10:02 PM and 11:43 PM? 101 What is 444 minutes after 1:51 PM? 9:15 PM What is 91 minutes before 1:05 PM? 11:34 AM What is 394 minutes before 10:46 PM? 4:12 PM What is 646 minutes before 8:00 AM? 9:14 PM What is 689 minutes before 3:59 PM? 4:30 AM What is 240 minutes before 12:34 PM? 8:34 AM How many minutes are there between 7:25 PM and 8:05 PM? 40 What is 33 minutes after 8:55 AM? 9:28 AM How many minutes are there between 5:26 AM and 5:09 PM? 703 What is 453 minutes before 12:25 AM? 4:52 PM How many minutes are there between 7:50 PM and 4:00 AM? 490 How many minutes are there between 6:32 AM and 10:36 AM? 244 How many minutes are there between 12:08 AM and 11:36 AM? 688 How many minutes are there between 2:41 AM and 2:31 PM? 710 What is 568 minutes before 8:58 AM? 11:30 PM What is 685 minutes before 12:41 AM? 1:16 PM What is 244 minutes after 3:22 AM? 7:26 AM How many minutes are there between 1:33 PM and 5:29 PM? 236 How many minutes are there between 1:32 AM and 7:48 AM? 376 What is 142 minutes after 2:35 PM? 4:57 PM What is 304 minutes before 6:29 AM? 1:25 AM What is 191 minutes before 9:19 PM? 6:08 PM How many minutes are there between 1:18 AM and 1:00 PM? 702 How many minutes are there between 3:49 PM and 3:06 AM? 677 How many minutes are there between 12:27 PM and 12:22 AM? 715 How many minutes are there between 5:23 AM and 12:35 PM? 432 What is 546 minutes before 11:36 PM? 2:30 PM What is 310 minutes after 10:48 AM? 3:58 PM How many minutes are there between 1:08 AM and 6:30 AM? 322 What is 315 minutes before 1:45 PM? 8:30 AM How many minutes are there between 5:23 AM and 8:19 AM? 176 How many minutes are there between 3:54 AM and 11:06 AM? 432 What is 325 minutes after 5:24 AM? 10:49 AM How many minutes are there between 11:36 AM and 8:26 PM? 530 What is 399 minutes before 12:46 PM? 6:07 AM How many minutes are there between 8:50 AM and 3:32 PM? 402 How many minutes are there between 12:35 PM and 12:05 AM? 690 What is 117 minutes after 4:01 AM? 5:58 AM How many minutes are there between 3:37 AM and 8:46 AM? 309 How many minutes are there between 1:14 PM and 6:18 PM? 304 How many minutes are there between 9:28 AM and 4:28 PM? 420 How many minutes are there between 5:07 AM and 5:32 AM? 25 How many minutes are there between 11:46 PM and 8:23 AM? 517 How many minutes are there between 1:28 PM and 11:37 PM? 609 What is 385 minutes before 11:33 PM? 5:08 PM How many minutes are there between 7:01 AM and 4:34 PM? 573 How many minutes are there between 10:56 AM and 7:33 PM? 517 How many minutes are there between 8:56 PM and 8:29 AM? 693 What is 62 minutes after 1:13 AM? 2:15 AM What is 320 minutes before 7:53 PM? 2:33 PM How many minutes are there between 10:26 PM and 1:27 AM? 181 What is 158 minutes after 10:36 AM? 1:14 PM How many minutes are there between 9:57 AM and 1:53 PM? 236 What is 539 minutes after 7:02 PM? 4:01 AM How many minutes are there between 4:18 AM and 4:00 PM? 702 What is 359 minutes after 3:35 PM? 9:34 PM How many minutes are there between 9:02 AM and 4:55 PM? 473 What is 501 minutes before 3:14 AM? 6:53 PM How many minutes are there between 1:36 PM and 6:59 PM? 323 What is 549 minutes before 10:40 PM? 1:31 PM How many minutes are there between 3:52 AM and 9:58 AM? 366 What is 260 minutes before 6:53 PM? 2:33 PM What is 458 minutes before 4:50 PM? 9:12 AM What is 454 minutes before 10:56 AM? 3:22 AM What is 270 minutes after 10:18 PM? 2:48 AM What is 399 minutes after 12:40 PM? 7:19 PM How many minutes are there between 4:27 AM and 3:06 PM? 639 How many minutes are there between 7:02 PM and 7:42 PM? 40 How many minutes are there between 1:16 AM and 8:02 AM? 406 How many minutes are there between 11:20 AM and 10:57 PM? 697 What is 678 minutes before 3:01 PM? 3:43 AM What is 145 minutes after 4:26 AM? 6:51 AM What is 317 minutes before 8:43 PM? 3:26 PM How many minutes are there between 4:02 PM and 10:15 PM? 373 How many minutes are there between 9:23 PM and 9:12 AM? 709 What is 576 minutes after 3:53 PM? 1:29 AM How many minutes are there between 5:54 AM and 6:04 AM? 10 How many minutes are there between 9:26 PM and 4:49 AM? 443 What is 277 minutes before 5:03 PM? 12:26 PM How many minutes are there between 5:50 PM and 12:03 AM? 373 How many minutes are there between 12:09 PM and 11:14 PM? 665 What is 291 minutes before 6:19 AM? 1:28 AM How many minutes are there between 1:05 AM and 10:53 AM? 588 What is 663 minutes before 1:55 AM? 2:52 PM What is 583 minutes after 11:45 PM? 9:28 AM What is 587 minutes after 5:29 PM? 3:16 AM How many minutes are there between 11:30 AM and 4:23 PM? 293 How many minutes are there between 9:23 PM and 9:22 AM? 719 How many minutes are there between 11:45 AM and 9:37 PM? 592 How many minutes are there between 10:17 AM and 8:27 PM? 610 What is 20 minutes after 5:23 AM? 5:43 AM How many minutes are there between 7:34 AM and 5:33 PM? 599 How many minutes are there between 1:46 PM and 1:13 AM? 687 How many minutes are there between 5:02 PM and 7:17 PM? 135 What is 599 minutes after 5:16 PM? 3:15 AM What is 104 minutes before 6:51 AM? 5:07 AM How many minutes are there between 8:02 AM and 7:02 PM? 660 What is 685 minutes after 8:58 PM? 8:23 AM How many minutes are there between 1:58 PM and 4:51 PM? 173 How many minutes are there between 8:34 AM and 4:08 PM? 454 How many minutes are there between 2:56 AM and 6:00 AM? 184 What is 652 minutes before 2:53 AM? 4:01 PM How many minutes are there between 6:27 AM and 7:27 AM? 60 How many minutes are there between 7:53 PM and 3:47 AM? 474 What is 103 minutes after 2:26 PM? 4:09 PM What is 480 minutes after 5:34 AM? 1:34 PM What is 665 minutes before 12:28 AM? 1:23 PM What is 121 minutes before 5:33 PM? 3:32 PM How many minutes are there between 3:34 AM and 11:46 AM? 492 How many minutes are there between 2:57 PM and 5:00 PM? 123 What is 517 minutes before 5:17 AM? 8:40 PM How many minutes are there between 11:56 AM and 4:52 PM? 296 What is 286 minutes before 4:08 AM? 11:22 PM How many minutes are there between 6:38 PM and 6:42 PM? 4 How many minutes are there between 10:13 AM and 3:30 PM? 317 How many minutes are there between 11:50 AM and 9:07 PM? 557 What is 197 minutes before 4:13 AM? 12:56 AM How many minutes are there between 3:25 AM and 5:35 AM? 130 How many minutes are there between 4:34 PM and 5:37 PM? 63 How many minutes are there between 1:39 PM and 3:47 PM? 128 How many minutes are there between 8:49 PM and 9:27 PM? 38 What is 458 minutes before 2:37 PM? 6:59 AM How many minutes are there between 2:16 PM and 8:50 PM? 394 How many minutes are there between 10:48 AM and 3:48 PM? 300 How many minutes are there between 6:57 PM and 12:57 AM? 360 How many minutes are there between 2:04 PM and 11:50 PM? 586 What is 472 minutes before 12:42 PM? 4:50 AM How many minutes are there between 12:33 AM and 9:51 AM? 558 How many minutes are there between 10:22 PM and 2:19 AM? 237 How many minutes are there between 1:25 AM and 5:35 AM? 250 What is 710 minutes before 12:07 AM? 12:17 PM What is 53 minutes after 9:54 AM? 10:47 AM How many minutes are there between 12:44 PM and 4:21 PM? 217 What is 360 minutes after 10:34 AM? 4:34 PM What is 238 minutes before 3:57 PM? 11:59 AM What	{ "pile_set_name": "DM Mathematics" }
0.2 have the same value? False Is -39 smaller than -35? True Which is greater: 11/9 or 1? 11/9 Which is smaller: -0.09 or -12? -12 Does -55 = -115? False Which is bigger: 369 or 372? 372 Which is bigger: -1180/3 or -393? -393 Which is bigger: 13 or 96? 96 Is -21.2 at most as big as 2? True Which is smaller: -0.1 or 654? -0.1 Is -2 <= -2/9? True Do 1 and -2/7695 have different values? True Is 6/17 less than or equal to -1? False Do -8 and -225/34 have different values? True Is -228 bigger than -230? True Which is smaller: -2 or 7/5? -2 Which is smaller: 4/5117 or 0? 0 Do 3996 and 3995 have the same value? False Do 579/7 and 83 have different values? True Which is smaller: 7/1198 or -1? -1 Which is bigger: 5/3516 or 1? 1 Is 105 equal to 99? False Which is bigger: 0 or -5/78? 0 Which is bigger: 679 or 680? 680 Are 2088 and 2089 non-equal? True Is -387 > -387? False Is 33 at least 28? True Is -1/2 at most as big as 212/3? True Is 2/679 equal to 0? False Which is greater: 1 or -2/2419? 1 Which is smaller: 64 or -1/4? -1/4 Is -3241 <= -3245? False Is 1 bigger than 18/193? True Which is bigger: 820/51 or 17? 17 Does 89 = 94? False Which is smaller: -1 or -10/131? -1 Is 62 > 66? False Which is smaller: 17 or 649? 17 Are 2.9 and 41 non-equal? True Is -7 greater than or equal to -75/13? False Do 12 and -3/5 have the same value? False Which is smaller: -2981 or -5963/2? -5963/2 Which is smaller: -208/3 or 2/11? -208/3 Is 0 equal to 0.373? False Which is bigger: -5/2728 or 0? 0 Does -242 = -240? False Which is bigger: 0.1 or 937? 937 Is -13 > -5? False Does 10945 = 10945? True Which is smaller: 52/7 or 6? 6 Is -1 <= 1/4905? True Which is bigger: -2/8333 or -1? -2/8333 Which is smaller: 0 or -1/41144? -1/41144 Which is smaller: 0 or 1/149? 0 Does -2/101 = 9? False Is 1 not equal to 14? True Do 1/4 and -1275 have the same value? False Are 101 and 95 non-equal? True Which is bigger: 134 or -31? 134 Which is bigger: -2/213 or 0? 0 Is 121 > 82? True Which is smaller: 4/1551 or -1? -1 Which is bigger: 0.31 or 0? 0.31 Which is smaller: -48 or -803/17? -48 Which is bigger: 0 or 677? 677 Is 5/5538 greater than or equal to -1? True Which is smaller: -2005 or -2004? -2005 Which is bigger: -1/3 or 1175? 1175 Which is smaller: 224 or 225? 224 Which is bigger: -8 or -13? -8 Which is smaller: 1927 or -3? -3 Which is smaller: -16 or -52/3? -52/3 Which is smaller: -90 or 1? -90 Which is greater: 327 or -4? 327 Is -208 smaller than -208? False Does 0.133 = 19? False Is -963 != -962? True Is 635 >= -1/3? True Is 0.1 equal to 342? False Does -0.3 = 188.7? False Is -3/979 != -1? True Which is bigger: 1/3 or 1/671? 1/3 Are -70 and -69 unequal? True Is -14254 >= -14256? True Which is smaller: 1/91 or 55? 1/91 Is -2/56613 bigger than -1? True Which is greater: 4/2243 or -1? 4/2243 Are -3/2 and -600 non-equal? True Which is smaller: -112 or -113? -113 Which is bigger: 702 or 701? 702 Which is smaller: 447 or 449? 447 Is 3 greater than -6410? True Do 1546/37 and 41 have different values? True Which is bigger: -883 or 2/3? 2/3 Which is greater: -1 or -50/821? -50/821 Is -790 less than or equal to -785? True Which is smaller: -1 or -1/4519? -1 Which is smaller: -4077 or -4076? -4077 Which is smaller: -674/3 or -225? -225 Are -1/4914 and 0 non-equal? True Which is greater: 378 or 379? 379 Which is smaller: 2/25347 or -1? -1 Does -211/76 = -4? False Is -539 < -540? False Is -553 >= -550? False Is 57 at most as big as 750/13? True Does -74 = -1102/15? False Which is bigger: 953/8 or 118? 953/8 Which is smaller: 2/22329 or 0? 0 Are 9 and 179 non-equal? True Which is smaller: -7 or 1189? -7 Which is smaller: 61 or -119? -119 Is -2/9 greater than -2/45? False Which is smaller: -1661 or -1662? -1662 Which is bigger: -474 or -475? -474 Which is smaller: 269 or 1888/7? 269 Does -0.4 = 43/11? False Are -0.0527 and -2 equal? False Which is bigger: 0.2 or 502? 502 Is 1 less than 12/577? False Is 114 greater than 124? False Is -25 at least -24? False Is 133/27 greater than 4? True Which is smaller: -0.06 or -10? -10 Are -775 and -775 equal? True Are -336 and -448 non-equal? True Which is greater: 4/39 or 0.6? 0.6 Is -2 != 210? True Is 4092/5 less than or equal to 819? True Is -55 equal to -33? False Are 1756 and 1 equal? False Is -1 != 13/46? True Is -45597 smaller than -45597? False Do -4/5 and -58 have the same value? False Which is greater: -10708 or 2/5? 2/5 Which is smaller: -19 or -13/4? -19 Which is bigger: -18 or 33? 33 Is 101 at most as big as 132? True Which is bigger: -7 or -264/41? -264/41 Is 0.07216 at least as big as 3? False Which is smaller: 644 or 607? 607 Is 89 at least as big as 1435/16? False Is 48/11 at most 5? True Is -2159 at most as big as -4/5? True Is 1839/7 at most -0.1? False Are -2 and 49 equal? False Which is smaller: -418 or -3349/8? -3349/8 Are 3/3929 and -1 equal? False Which is bigger: 608 or -2/9? 608 Is 138/5 > 29? False Which is greater: -1/4034 or -1? -1/4034 Is -8732 greater than -8732? False Is 6 equal to 29/5? False Are 0.5299 and -0.3 equal? False Which is bigger: -2/281 or 1? 1 Is 5403 < 5405? True Is 694 less than or equal to 2086/3? True Is -23.88 at most as big as -1? True Which is greater: 1729/2 or 866? 866 Which is smaller: 23 or 24? 23 Are 4/7 and -1020 non-equal? True Are 3/28040 and -1 nonequal? True Which is greater: -4 or -330/109? -330/109 Which is smaller: 152 or 151? 151 Is -7/1784 less than -1? False Which is bigger: 2538/7 or 363? 363 Is -14 less than or equal to -15? False Do -3 and 3 have the same value? False Is -1284 not equal to -1284? False Is 154/23 greater than or equal to 7? False Which is smaller: 64 or 138? 64 Which is bigger: 1418 or 1416? 1418 Which is greater: 2351 or 2347? 2351 Is -1966 at most as big as 1/2? True Is -134 greater than -137? True Is 3331 greater than 3335? False Which is greater: 14592 or 14594? 14594 Which is smaller: -5276 or -5275? -5276 Which is bigger: -248 or -288? -248 Which is smaller: -102 or -114? -114 Which is smaller: -41 or -367/9? -41 Is -420 at most 1? True Do 1 and 9/64 have different values? True Is 289 at most as big as 291? True Is 0 > -4/69? True Which is smaller: 18 or 164/5? 18 Is 1 at most -1/11293? False Which is smaller: -6 or -1/2? -6 Is 327 at most 327? True Which is smaller: 2565 or 2566? 2565 Which is greater: -32/7 or -6? -32/7 Which is bigger: 2 or 0.963? 2 Which is smaller: -1.208 or -0.2? -1.208 Is -2 <= -153? False Is -3/19 >= 1? False Is -36 bigger than -38? True Which is smaller: -7093 or -7091? -7093 Are 45 and 98 nonequal? True Is -348 smaller than -2791/8? False Is 64 smaller than 847/13? True Which is smaller: 255 or 1/6? 1/6 Is 83 greater than or equal to -0.2? True Which is greater: 38 or 35? 38 Which is bigger: -0.2 or -54.3? -0.2 Is -990 equal to -989? False Is 0.1 bigger than 2349? False Is 45 greater than 218/5? True Are 1234 and 1234 equal? True Which is bigger: -1873 or -1875? -1873 Which is bigger: 1 or 11/162? 1 Is 75 smaller than 89? True Which is greater: -887 or -886? -886 Which is smaller: -1 or 1/1170? -1 Are 0 and -11/29 unequal? True Which is smaller: -493 or -3448/7? -493 Is 278 > -0.2? True Is 169/3 smaller than 55? False Which is smaller: -1 or -23/2426? -1 Is 87 > 87? False Is -502 at least as big as -42? False Is 112 at least as big as 114? False Which is greater: -191 or -0.024? -0.024 Which is greater: 0 or -48/251? 0 Which is bigger: -205 or -197? -197 Does 603 = 604? False Is -1 at least as big as -5.69? True Which is smaller: -8814 or -8812? -8814 Which is greater: 6 or 3422? 3422 Which is bigger: -0.41 or -2/3? -0.41 Which is greater: 1 or 4127? 4127 Is 1/30 not equal to -2/11? True Is -46947 at most -46947? True Which is smaller: 501 or 500? 500 Which is smaller: 103 or 104? 103 Is -1200 less than or equal to 0.04? True Is 8/17 at most -1? False Which is greater: 4188 or -1? 4188 Which is greater: 21/34 or 7? 7 Is 0 less than 13/309? True Which is smaller: 0.045 or 0.0638? 0.045 Which is greater: -398 or -397? -397 Is -1787 < -1787? False Are -1/9 and 11 unequal? True Which is greater: 2/5 or 16? 16 Are 1545 and 1546 equal? False Which is greater: 510 or 511? 511 Is 114 equal to 115? False Which is bigger: 37 or 36? 37 Is -17/524 < -1	{ "pile_set_name": "DM Mathematics" }
h = -44, -c + g = 3w. Does 13 divide w? False Let w be (15 - 10)(2844/10 + -4). Let v = w + 361. Is 43 a factor of v? True Suppose 3y + 3c = 1729 + 1430, 3y - 3191 = 5c. Suppose -1705 + y = -6n. Is n a multiple of 9? True Let m be (-1)/(2/(-12)2). Let x be (m - 18/3) + 1 - -1. Is 6 a factor of 28/4 - ((-2)/(-1) + x)? True Let i(l) = 90l2 - 60l + 6. Is 27 a factor of i(3)? False Let b be (459/18)/176. Suppose 6237 = bn + 18n. Is 7 a factor of n? True Let b be 4708/(-107)2/(-4). Suppose 0 = 5p - 223 - 107. Let d = p - b. Is d a multiple of 10? False Does 23 divide (4 - 9)/((-21990)/(-7335) - 3)? False Suppose 16o - 10o - 1056673 = -23o. Is o a multiple of 27? False Suppose 2s = -2r + 4448, 0 = 2r - 3r - 4s + 2215. Does 4 divide r? False Let g = 128 + -122. Let q be (g/(-15))/(6/(-10))-3. Does 9 divide ((-12)/18)/(q/750 - 0)? False Suppose 56u = -59u + u + 1838592. Is u a multiple of 14? True Let b(s) = 18s - 15 - s2 - 8 - 6 + 6s. Let p be b(23). Is 1((-8)/p - 114/(-9)) a multiple of 14? True Let g = -204 - -206. Suppose -2x - 143 = -j, gj = -2j - 4x + 560. Is j a multiple of 47? True Suppose 5f - 4o + 555 = 4540, 3o = 2f - 1594. Suppose p = 1, 7g - 3g + 5p - f = 0. Suppose -5v - g = -8v. Is 13 a factor of v? False Let l be 4 - (3 - (-2 + 3)). Let v = 32 - 37. Is (2 + (-6 - v))166/l a multiple of 31? False Is ((-1225322)/(-91) - -5) + 12/(-156) a multiple of 18? False Does 13 divide (59/(-531))/((-12)/1898532)? False Let x be -1(1 - (5 + -1)). Let l be x/(18/1564) - (-1)/3. Suppose -l = -9r + 396. Is r a multiple of 13? False Let y = -6 - -11. Suppose p = 2p - y. Suppose -74 = -3h + pq + 54, 0 = -3h + 4q + 127. Is h a multiple of 22? False Let y(i) = 240i - 605. Let v be y(2). Suppose 0a - 960 = -4a. Let f = v + a. Is f a multiple of 31? False Suppose 0 = -2f - z + 2, -4f - 2 - 2 = 4z. Suppose -13 + 7 = -fb. Is (-7)/(2b/(-96)) a multiple of 12? True Let a be 20/(-5) - -3 - -9. Suppose 4s = 7s + 6, 2s = -r - a. Does 42 divide (16 - -68)((-6)/r + -1)? True Let m = -21453 - -9637. Does 30 divide ((-12)/(-21))/(5 + 59064/m)? False Let g = -14500 + 21430. Does 34 divide g? False Suppose -17y + 88 = -388. Suppose -4o = -ya + 31a - 4973, -o + 1241 = 3a. Does 25 divide o? False Suppose 0 = -5s - 0s + 10. Suppose 1228 = 4d + sg, d - 2g - 226 - 86 = 0. Let t = 506 - d. Does 22 divide t? True Let g be -2 + 7 + 2 + -5. Suppose 163 + 5 = gl. Suppose 225 = 5c - b, -b - l - 97 = -4c. Is 3 a factor of c? False Let v be (0 + -77)/((-4)/24). Suppose 0 = 9u + 5u - v. Does 33 divide u? True Suppose 361d - 8 = 359d. Suppose 4y + 2t - 1614 = 0, t + 1608 = dy - 3t. Is y a multiple of 9? False Let j(t) be the first derivative of -2t + 11 - 45/2t2. Is 37 a factor of j(-1)? False Suppose -n = -2, 20 = -2y + 4y + 4n. Let u(v) = 53v - 48. Does 7 divide u(y)? False Let b be -1 + 4(-2)/(-4) + 2. Suppose 0 = -n + 5z + 50, -bn = -2z - z - 174. Let m = n - -20. Is m a multiple of 7? False Let h(x) = x3 - x2 - 24x + 131. Let p be h(6). Suppose r + p = 865. Does 12 divide r? False Let f be ((-8)/12)/((-4)/30). Suppose -fo + 3u - 102 = 23, -117 = 4o + u. Let d = o + 44. Does 4 divide d? True Suppose -3k = -37b + 35b - 19832, -12k - 5b = -79354. Is k a multiple of 76? True Let a(w) = 15w3 + w2 + w. Let m be a(-1). Let b be (-18)/m75/(-6). Let n(s) = -10s - 6. Does 8 divide n(b)? True Is ((-236)/(-236))/((-1)/(-34168)) a multiple of 17? False Let x(q) = 35q*3 + 12q*2 + 12q + 39. Is x(8) a multiple of 18? False Let p(s) = 7s2 - 5s + 2. Let z be p(2). Suppose zh - 2692 = 368. Is 51 a factor of h? True Suppose -5b + 64650 = 5t, -2b - 719t = -722t - 25890. Does 24 divide b? True Let q = 17878 - 12178. Does 15 divide q? True Suppose -5h - 56 - 74 = 0. Let y = 37 - h. Let p = y + -60. Does 3 divide p? True Let d(v) = 45v*2 - 2v - 131. Let l be d(-7). Let h = -1439 + l. Is h a multiple of 15? False Let l(o) = -o*2 + 44o - 261. Let z be l(37). Is (-2 - (-4596)/9)/(z/(-3)) a multiple of 22? False Let w(f) = f*3 - 44f*2 + 79f*2 - 8f - 44f2 + 2. Let q = -1 + 11. Is w(q) a multiple of 11? True Suppose -85k + 47k + 97546 = 0. Does 59 divide k? False Suppose -u + 1076 = 2a, 5u = -4a + 2781 + 2581. Does 13 divide u? False Let f = -147 - -285. Let d = 141 - f. Suppose -h + 5t + 140 = 0, -137 - 3 = -h - dt. Is h a multiple of 8? False Is (-135)/675 - 5/(25/(-15106)) a multiple of 14? False Suppose -y - 2 = 0, -13y + 17y - 1082 = -2z. Suppose -n - z = -l, -2n + 1090 = -10l + 12l. Is 36 a factor of l? False Suppose 236u + 722304 = 293u. Is u a multiple of 36? True Let n(r) = 3r3 - 3r*2 - 7r + 19210. Is n(0) a multiple of 25? False Suppose -4m - 8024 = -4b, 2m - 9 = -m. Suppose 0 = 19d - b + 660. Is d a multiple of 4? False Suppose -8 = -i - 4, 2l + i = 580. Let x = l + -108. Is x a multiple of 3? True Let g(c) = 27c*2 + 23c - 58. Is g(-14) a multiple of 30? False Suppose 8 = 4i, i = 4l - 4i + 702. Let u = l - -249. Let q = u - -8. Is q a multiple of 12? True Let b(g) = -2g*3 + 11g*2 - 7g + 9. Let t be b(5). Let z be (t - -1) + 382 + (5 - 3). Suppose -9y = -z - 300. Does 38 divide y? True Let s = -51 + 525. Let d = s + -107. Is d a multiple of 10? False Let f(q) = 3q - 102. Let a be f(0). Does 3 divide (a/(-9))/((-2)/(-6))? False Let m(c) = 2c - 11. Let s be m(8). Suppose -33 = sa - 1473. Let b = a + -112. Does 44 divide b? True Let o(m) = -m*2 + 7m - 12. Let s be o(5). Does 7 divide s/(-15) - 7552/(-60)? True Suppose -2l - 264 = 2l + 4p, 0 = 4l + p + 255. Let w = l - -24. Let n = w - -66. Does 5 divide n? False Let m(k) = 630k3 - 3k*2 + 7k - 4. Suppose -11 = -21f + 10f. Does 30 divide m(f)? True Suppose 433901 + 753995 = 218s - 52s. Does 29 divide s? False Let k(i) = 2i - 10. Let s be k(5). Suppose 2x + 667 = 5f, s = -0f - f + 5. Is 3/((-9)/x) - -1 a multiple of 18? True Let s(r) = -674r3 - 5r*2 + 3r + 1. Let m be s(1). Let p = m + 736. Is 3 a factor of p? False Let m(t) = t*3 + 16t*2 - 3t - 26. Let i(q) = -8q + 205. Let g be i(27). Does 15 divide m(g)? False Let l = 32 + -82. Let a be ((-120)/l + (-4)/10)-2. Is (-17)/(-68) + (-119)/a a multiple of 6? True Is 12 a factor of (-8 + 28008/(-32))/((-13)/728)? False Let f be (4/((-84)/(-7)))/((-2)/(-12)). Suppose -o = -f, -g - 4o + 65 + 13 = 0. Does 35 divide g? True Let j = -37946 - -56326. Is j a multiple of 20? True Let m be 28 + (-2 + 6)/(-2). Let l = m - 26. Suppose u + 4s - 3s - 22 = 0, -2s + 10 = l. Is 2 a factor of u? False Let w(m) = -237m + 9. Let b be w(1). Let s = b + 436. Is 16 a factor of s? True Suppose 45 = -22b + 25b. Let z(q) = q2 - 16q + 28. Does 8 divide z(b)? False Let d(n) = 2n2 - 161n + 7365. Is 28 a factor of d(126)? False Suppose 53 = x + 40. Suppose -14w + xw = -992. Does 23 divide w? False Suppose -159j + 115406 + 1550596 = 0. Does 81 divide j? False Let f = 187 - 191. Let m(x) = -x3 - 2x*2 - 2x + 2. Is 6 a factor of m(f)? True Let m be 30/75 + 23/5. Suppose -mz + 24 = -1. Is 27 a factor of z/(-15) + (-650)/(-6)? True Let j(v) = -v2 - 8v - 18. Let o be j(-4). Let y be ((1 + -287)/o)/1 + 1. Suppose -3w - w = 3m - y, 3w = 4m - 167. Is m a multiple of 22? True Let i be (-2)/(-7) - 6/21. Let l be 11 - i/(4 - 7). Suppose -l - 27 = -r. Does 19 divide r? True Let o = 208 - 202. Suppose -10w = ow - 9984. Is 20 a factor of w? False Let t(w) = 95w3 + 27w*2 + w - 19. Is t(5) a multiple of 8? True Let j be 12/(-20) - (1 + 188/(-5)). Let n be (16/(-36))/2 - (-224)/j. Let h = 12 + n. Is 3 a factor of h? True Let u be 3/6 + 20/8-5. Let j = 10 - u. Let k = j - -36. Is 29 a factor of k? True Let z(h) = -h*2 - 239h - 3358. Does 10 divide z(-63)? True Let m be 261/(-2 + 1) - (-25 + 28). Let p = 198 - m. Is 25 a factor of p? False Let u(z) = -15z - 129. Let s be u(-20). Is (-2)/(-19) + (-3 - (-170127)/s) a multiple of 10? False Let h = -9554 + 14823. Is 11 a factor of h? True Let p(s) = -2309s + 609. Is 138 a factor of p(-9)? True Let n(c) = c*2 - 9c + 5. Let f be n(3). Let z(g) = 6g2 - 31. Is 19 a factor of z(f)? False Let v = 11081 - 4525. Does 149 divide v? True Let p(s) = -22s	{ "pile_set_name": "DM Mathematics" }
tive of -d*4/8 - 2d*3/3 + 4d*2. Let f(c) = c + 1. Determine qf(j) + h(j). j Let a(q) = q. Let n(l) = 4l - 7. Let s(r) = 4a(r) + n(r). Let g(x) = -9x + 8. Give 5g(z) + 6s(z). 3z - 2 Let k(v) = -2v - 1. Let s(j) = -2j - 1 + 3j + 0 - 2j. Calculate 3k(w) - 4s(w). -2w + 1 Let y(v) = 9v - 11. Let u be (-40)/16(-1 - 1). Let c = u - 11. Let k(b) = -4b + 5. Let s(l) = 12l - 15. Let r(p) = 7k(p) + 2s(p). Give cy(t) - 13r(t). -2t + 1 Let m(q) = -5q + 2. Let p(v) = -36v + 15. Let a(n) = -15m(n) + 2p(n). Let u(s) be the third derivative of s*4/6 + 4s*2. Determine -6a(x) + 4u(x). -2x Let f(h) = 10 - 15 - 2h + 4 + 4. Let p(v) = -v + 0v - 3v + 5. Determine -7f(x) + 4p(x). -2x - 1 Let n(g) = -g3 - g2 - g. Let b(m) = -m*3 - 4m*2 - 2m - 1. Let w(u) = u*2 + 2u - 3. Let i be w(-3). Suppose -3a + 3 = -ia. What is ab(k) - 2n(k)? k*3 - 2k*2 - 1 Let a(z) = 3z*3 + 3z*2 - 3z. Let h(u) = -u*2 - 5u - 3. Let o be h(-5). Let d = -5 - 0. Let j(y) = -6y3 - 5y*2 + 5y. Determine da(v) + oj(v). 3v3 Let h(g) = 2g2 - 91 + 91 + g3. Let n(w) = -6w3 - 13w*2. What is -39h(f) - 6n(f)? -3f3 Let v(f) = -f3 + f*2 + f - 1. Let g(k) = -5k*3 + 6k*2 - 8k + 2. Let p(z) = -g(z) - 2v(z). Let t(y) = -13y*3 + 15y*2 - 11y. Give -11p(s) - 6t(s). s*3 - 2s2 Let z(q) = -q2 + 2. Let f(r) = -12r2 + 27. Calculate 2f(u) - 27z(u). 3u*2 Let u(y) = -y + 0y + 2 + 2. Let b(x) = 3x - 9. Let w = -21 + 23. What is wb(d) + 5u(d)? d + 2 Let d(a) = -3a*3 - 5a - 5. Let c(p) be the third derivative of -p*6/30 - 7p*4/24 - 7p*3/6 + 2p*2. Let r = 18 + -23. Determine rc(f) + 7d(f). -f3 Let r(b) = -47b*2 + 4b. Let f(c) = 48c2 - 5c. Determine 6f(w) + 7r(w). -41w2 - 2w Let i(z) = -3z - 5. Let j(p) = p + 1. What is i(h) + 4j(h)? h - 1 Let a(q) be the second derivative of -13q3/6 - q. Let l(u) be the third derivative of -u4/8 + 2u*2 + 21u. Determine 4a(t) - 18l(t). 2t Let d(y) = 7y*3 - 6y2. Let z(f) be the third derivative of f6/20 - f*5/12 + 3f*2. Calculate 5d(t) - 6z(t). -t3 Let c(v) = -v2 - 5v + 7. Let r(b) = -3b - 13. Let s(q) = 2q + 11. Let w(t) = 4r(t) + 5s(t). Give -3c(h) + 7w(h). 3h2 + h Let n = 8 - 8. Let c(s) be the first derivative of n + 0s3 - s3 + 4s2 - 1. Let v(q) = 2q*2 - 5q. Calculate -5c(b) - 8v(b). -b*2 Let n(f) = 2f + 4. Let a(p) = p + 1. Let x = 14 - 7. Suppose m + 1 = x. Let t be -8(3/m)/(-1). Give ta(u) - n(u). 2u Let x(t) = -13t*2 + 3t - 6. Let i(g) = -12g2 + 2g - 5. What is -5i(s) + 4x(s)? 8s2 + 2s + 1 Let o(q) = 2q2 - 15q + 11. Let s(v) = -v*2 + 8v - 6. Give 4o(g) + 7s(g). g*2 - 4g + 2 Suppose -2q - 6 = -0q. Let h(g) be the first derivative of -g*2/2 + g + 3. Let z(a) = -a + 2. Determine qh(l) + z(l). 2l - 1 Let f = 6 - 1. Let g(b) = -14b + 2 - f - 2. Let m(l) = l*2 + 10l + 16. Let j be m(-7). Let u(r) = 9r + 3. Give jg(z) - 8u(z). -2z + 1 Let j(y) be the first derivative of -4y2 - 6y + 166. Let s(o) = 7o + 7 + 0 - 2. Give 5j(i) + 6s(i). 2i Let f(k) = -68k3 + 4k*2 - 4k. Let n(d) = -68d3 + 3d*2 - 3d. Calculate 3f(j) - 4n(j). 68j3 Let s(v) = 6v - 1. Let n(r) = -5r. Determine 5n(b) + 4s(b). -b - 4 Let d(y) = -165y*3 + 65y - 65. Let g(z) = 15z3 - 6z + 6. Calculate 6d(u) + 65g(u). -15u3 Let p(d) be the third derivative of d5/10 + d4/12 + d3/2 - 29d*2. Let h(s) = 7s*2 + 2s + 3. Calculate -5h(u) + 6p(u). u*2 + 2u + 3 Let u(y) = -y + 2. Let x = -62 + 69. Let d(r) = -3r + 7. Calculate xu(i) - 2d(i). -i Let n(l) = 7l*3 - 9l*2 + 7. Let m(i) = 4i*3 - 5i*2 + 4. Determine -5m(f) + 3n(f). f3 - 2f2 + 1 Let q(r) = r - 1. Let s(y) be the third derivative of -y4/12 + y*3/3 + 5y*2. What is -3q(k) - 2s(k)? k - 1 Let u(i) = 8i - 1. Let s(g) = 7g. Let t(p) = 2s(p) - 3u(p). Suppose 0 = 3o - 5 - 10. Let z(d) = -7d + 2. Determine ot(j) - 7z(j). -j + 1 Let o(l) = -8l - 7. Suppose 13 = 5r + 23. Let y(j) = 3j + 2. Calculate ro(t) - 7y(t). -5t Suppose 5x = 1 + 4. Let s(n) = n2 - n + 1. Let m(l) = -l3 + 4l2 - 4l + 4. What is xm(f) - 4s(f)? -f*3 Let k(j) = -2j*2 - 5. Let p(c) = -2c*2 + 0c*2 - 10 + 4. Let o = -9 + 40. Suppose 0 = 4d + 7 - o. Determine dk(m) - 5p(m). -2m2 Let w(y) = 2 + 2y - y - 11 + 3y. Let i = -25 - -21. Let r(f) = -f + 2. Give iw(q) - 18r(q). 2q Let u(r) = r*2 + 6r + 1. Let m(i) = i*2 - 1. Calculate -m(y) - u(y). -2y*2 - 6y Let t(m) = 4. Let k(z) be the second derivative of -z*3/6 + 3z*2/2 + 6z. Calculate -4k(j) + 3t(j). 4j Let v(z) = -63z*2 - 7z. Let j(f) = -32f2 - 3f. Determine -7j(c) + 3v(c). 35c2 Let x(j) be the second derivative of -3j*5/20 + 5j*4/12 + 11j*3/6 + 5j*2/2 - 16j. Let y(s) = -s*3 + 2s*2 + 4s + 2. Give -4x(i) + 11y(i). i*3 + 2i*2 + 2 Let z be -2 + -1 + (14 - 1). Let r = z - 8. Let l(d) = 10d - 6. Let k(s) = 3s - 2. What is rl(f) - 7k(f)? -f + 2 Let w(o) = -3o*2 - 5o - 1. Let c(m) = -3m2 - 6m - 2. Determine 3c(v) - 4w(v). 3v2 + 2v - 2 Let r be ((-6)/(-18))/(1/(-3)). Let q(h) = -h. Let m(g) = -3g - 2. Give rm(i) + 4q(i). -i + 2 Let f = -120 - -115. Let d(k) = 2k - 3. Let z(t) = 4t - 7. Give fd(o) + 2z(o). -2o + 1 Let q be ((-5)/(-4))/(5/20). Let p(v) = -v + 1. Let i(x) = 2x - 2. Let k(z) = -2i(z) - 10p(z). Let d(c) = 5c - 5. What is qd(a) - 4k(a)? a - 1 Let u(j) = -2j2 - 5j + 5. Let p be (0 + 1 + 0)/((-1)/3). Let o(f) = -f*2 - 3f + 3. Calculate pu(s) + 5o(s). s*2 Let n(z) = 7z + 4. Suppose 3i - 6 + 3 = 0. Suppose 6h - 20 = h. Let s(r) = -r - 1. Determine hs(q) + in(q). 3q Let a(y) = -3y*3 + 3y*2 - 3y - 3. Suppose 0g - 5j + 6 = g, 4j - 4 = 0. Let z(h) = h2 - h - 1. Determine ga(r) - 3z(r). -3r3 Let a(q) = -q3 - 1. Let p(f) = 13f3 + 6f*2 + 8f - 2. Let s(i) = -12i3 - 5i*2 - 7i + 1. Let t(u) = 5p(u) + 6s(u). What is -6a(z) + t(z)? -z3 - 2z + 2 Let a(l) = 9l3 - 3l + 3. Let s(u) = u*3 + 9u*2 + 5u - 23. Let h be s(-8). Let w(o) = o*3 - o + 1. What is ha(k) - 3w(k)? 6k*3 Let o(s) = -3s*2 - 2s - 19. Let c(r) = -16r2 - 11r - 96. Calculate 4c(w) - 22o(w). 2w2 + 34 Let h(f) = -17f*3 + 15f*2 - 2f. Let v(l) = 8l3 - 7l*2 + l. Let n(u) = u + 11. Let m be n(-5). Determine mh(q) + 13v(q). 2q3 - q2 + q Let d(p) = 2p2 + 5p + 5. Let v(r) = -3r2 - 5r - 5. Let i(b) = -16b2 - 26b - 26. Let y(t) = -2i(t) + 11v(t). Give -3d(x) - 5y(x). -x*2 Let z = -7 + 11. Let k(f) = -5f - 5. Let d(q) = q + 1. Let p(a) = zd(a) + k(a). Let o(h) = -2h3 - h2 + 3h + 1. Calculate o(n) + p(n). -2n3 - n2 + 2n Let n(w) = 2w - 4. Let d be 4/18 + 94/(-18). Suppose -1 = -p + 6. Let a(q) = -5q + pq - 6 + 1. Determine dn(y) + 4a(y). -2y Let f(s) = -3. Let y(c) = -10. Let u(t) = -7f(t) + 2y(t). Let z(r) = r2 + 1. Determine 3u(l) - 3z(l). -3l*2 Suppose 4x = -x - 15. Let n(r) = r + 1. Let h(t) = 0 + 2t + 1 + 4. Give xn(o) + h(o). -o + 2 Let j(r) = -11r3 + 10r*2 - 9r - 11. Let d(x) = -5x3 + 5x*2 - 4x - 5. Determine 9d(i) - 4j(i). -i*3 + 5i*2 - 1 Let n(u) = 3u*2 + u + 3. Suppose -3i - 2 = -2i. Suppose 0 = -p + 5 + 2. Let x(a) = a2 + 1. Determine in(t) + px(t). t2 - 2t + 1 Let h be (4/3)/((-1)/(-12)). Let r = 9 - h. Let b(j) = -8j + 8. Let s(f) = -7f + 7. Give rs(m) + 6b(m). m - 1 Suppose -3n = -4h - 31, 0 = 2n + 2n - 3h - 32. Let o(u) = -3u + 3. Let w be (0 + (-8)/10)5. Let d(m) = -2m + 2. Determine nd(r) + wo(r). 2r - 2 Suppose -10 = -3r + b, 10 = 5r - 3b - 0b. Let l(v) = -2v*2 + 3v + 2. Let f(u) be the first derivative of -u3/3 + u2 + u + 9. Give rf(o) - 3l(o). o2 + o - 1 Let x(j) = -j2 - j. Let c = 7 - 2. Suppose c = 5y + 4v, 4y + 28 = 5v + 73. Let h(i) = 2i3 + 5i*2 + 10 + 5i - 10. Give yx(u) + h(u). 2u3 Let o(r) = r3 - r2 - r - 3. Let s(c) = -c2 + c - 1. Let f(u) = -o(u) + 2s(u). Let x(p) = p2 - 5p + 2p3 - 3 + 0 + 1. Determine -5f(d) - 3x(d). -d3 + 2d2 + 1 Let o(k) be the third derivative of k3/6 - 12k2. Let s(g) = -2g - 10. What is 30o(a) + 3s(a)? -6a Let w(x) = 4x + 9. Let n(z	{ "pile_set_name": "DM Mathematics" }
u + 52 Let q(o) be the first derivative of 15o*7/7 - 5o*6/6 - 2o*5 - 8o*3/3 + 9o*2/2 - 8o - 4285. Find the third derivative of q(x) wrt x. 1800x3 - 300x*2 - 240x What is the second derivative of -4r + 135 + 167 + 29 + 2406r*3 - 47 wrt r? 14436r Suppose -2r + 4 = 0, 7 = 5k - 4r - 15. Find the third derivative of kx*6 - 2x*2 + 2x*6 + 38x*6 + 65x*2 wrt x. 5520x*3 Let t(c) be the third derivative of -971c*6/30 - 2947c*3/3 + 2210c*2. Differentiate t(i) with respect to i. -11652i*2 Find the second derivative of 88x - 2735 + 10x3 - 9x*2 + 91x - 180x wrt x. 60x - 18 Let w(r) = -r*2 - r - 89. Let l(m) = -3393m*2 + 6238m + 267. Let s(f) = l(f) + 3w(f). What is the second derivative of s(i) wrt i? -6792 Let q(f) = -60f*3 - 5614. Let l(r) = 31r*3 + 2808. Let p(u) = -5l(u) - 2q(u). What is the derivative of p(m) wrt m? -105m*2 Let b(l) = 86l*2 + 156. Let x(p) be the third derivative of 43p*5/60 + 13p*3 + 2p*2 + 2. Let g(i) = 2b(i) - 5x(i). Differentiate g(m) wrt m. -86m Suppose -l + 9 = -2g, -4g = g - l + 18. Let p be g/(12/16) - -6. What is the third derivative of 2r2 + pr*3 + 15r*2 - 38r*3 wrt r? -216 Let q(m) = -566m*5 + 2m*3 - 15m + 70. Let u(w) = 1134w5 - 3w*3 + 32w - 140. Let h(p) = -7q(p) - 4u(p). Find the second derivative of h(i) wrt i. -11480i3 - 12i What is the first derivative of 24 - 229 - 6v3 + 5v*3 - 237 - 202v*4 - 779 wrt v? -808v*3 - 3v*2 Let m(d) = 29d*2 + d. Let y(k) = 9469k*2 - 1351k + 1. Let x(v) = -2m(v) + y(v). What is the second derivative of x(j) wrt j? 18822 What is the second derivative of 2y*3 + 57y*4 + 4144y + 42 - 79 + 37 - 2y5 - 4y*3 wrt y? -40y*3 + 684y*2 - 12y What is the second derivative of -446f - 27f*3 + 108f*3 + 375f*3 wrt f? 2736f Let v(k) be the second derivative of -409k3/2 - 227k*2/2 - 1389k. What is the first derivative of v(z) wrt z? -1227 What is the third derivative of 6o + 18093o*4 - 4o - 18525o4 - 534o*2 + 43o*2 wrt o? -10368o Let w(m) = -12115m2 + 6834m + 2. Let v(z) = 12113z2 - 6836z - 3. Let y(c) = -2v(c) - 3w(c). What is the second derivative of y(h) wrt h? 24238 Let z(u) = 65u2 + 5u + 145. Let o(n) = 64n2 + 5n + 145. Let w(c) = 9o(c) - 8z(c). Find the second derivative of w(k) wrt k. 112 Let x(p) be the first derivative of 171p4/4 - 3p*2 - 113p - 44. What is the second derivative of x(u) wrt u? 1026u Let j(p) = -p3 + p2 - 3p - 4. Let x be j(-2). Let u = 25 - 23. Find the second derivative of xm - 10m*u + 4m2 + m2 wrt m. -10 Let o(n) be the third derivative of -17/2n3 - 1/12n*5 + 0 + 33n*2 - 2n + 1/40n6 + 0n*4. Find the first derivative of o(b) wrt b. 9b*2 - 10b Find the second derivative of 9a2 + 4 + 217a2 - a3 - 4 - 17a2 - 400a wrt a. -6a + 418 Let b(u) be the first derivative of 466u*6/3 + 607u*2 - 306. Find the second derivative of b(h) wrt h. 18640h*3 Suppose 0 = b + 2p - 141, p - 44 + 191 = b. Let v be (b/(-58))/(1(-1)/2). What is the second derivative of -2z*v + 4z - 17z + 6z wrt z? -40z3 Let m(v) be the first derivative of -353v*6/2 - 175v*3/3 + 3v + 848. Find the third derivative of m(q) wrt q. -63540q2 Let i(j) = j2 + 17j + 18. Let g be i(-12). Let d be -14(-4)/g-15. What is the first derivative of -7 + 28h3 + 1 - dh*3 wrt h? 24h*2 Let k(w) = -7337w + 260. Let f(b) = 13b - 1. Let c(t) = 2f(t) - k(t). What is the first derivative of c(h) wrt h? 7363 Find the second derivative of -481f5 - 36015f*2 + 36015f*2 + 2f*4 - 980f wrt f. -9620f3 + 24f*2 Find the second derivative of -1066h*3 + 622h + 1106h + 17h - 65h - 2340h*3 wrt h. -20436h Let y(f) = -329f3 - f2 - 4216f + 3. Let r(j) = -329j3 - 4214j + 2. Let a(t) = -3r(t) + 2y(t). Find the second derivative of a(m) wrt m. 1974m - 4 Let u(t) = -1415t*2 - 5t + 289. Let i(m) = -4245m2 - 17m + 865. Let k(n) = -2i(n) + 7u(n). Find the second derivative of k(w) wrt w. -2830 Let s(c) be the third derivative of 0c5 - 11/120c*6 - 1/30c*7 + 0c*3 + 0 + 145c*2 + 0c + 49/12c4. Find the second derivative of s(n) wrt n. -84n*2 - 66n Let j(c) be the second derivative of -3c5/20 - 113c*4/4 + 203c*3/6 - 11c*2/2 + 596c + 2. What is the second derivative of j(t) wrt t? -18t - 678 Let y(i) = -2i*2 + 40i - 33. Let o be y(19). Find the third derivative of -11a3 - 72a*o - 31 + 5a*2 + 31 - 86a - 4a2 + 10a*3 wrt a. -4320a*2 - 6 Let a(d) be the third derivative of -1297d*8/56 - 563d5/60 - d4/4 - 26d2 - 13d + 2. Find the third derivative of a(y) wrt y. -466920y2 Suppose 0 = -0k + k - 3. Suppose 7 = 3y - 2. Find the second derivative of m + 0m + ymk + 3m + 0m wrt m. 18m Find the third derivative of 5425i2 + 1493i*4 - 21i*2 + 2788i*2 wrt i. 35832i Let l(p) = 15p - 582. Let s be l(39). Let a(f) be the second derivative of 0f*2 - 5/12f4 + 0 - f + fs. What is the second derivative of a(r) wrt r? -10 Let i(w) be the third derivative of 5/24w4 + 102w*2 + 0w + 2 + 41/3w3 + 0w*5 + 1/40w*6. What is the derivative of i(h) wrt h? 9h*2 + 5 What is the derivative of -1592 + 62u*3 - 9u - 2u3 - 11u*3 + 17u*3 wrt u? 198u2 - 9 Let o = -237 - -241. Let s(g) = -g3 + g + 27. Let l be s(0). What is the second derivative of -5d4 - 14d*o + 0d + ld + d4 wrt d? -216d*2 Suppose -6b - 2b + 32 = 0. What is the third derivative of -11w*4 + 24w*4 + 0w*5 - 15w*b + 53w*2 - 2w*5 wrt w? -120w*2 - 48w What is the first derivative of -2i4 - i + 569i*2 + 1971 + 1415 + 1244 + 0i wrt i? -8i3 + 1138i - 1 Let h = -50 - -54. Let z be h((-8)/(-12))/(8/6). What is the first derivative of 6 + 1 + 8 - z - 4q wrt q? -4 Let i(r) be the second derivative of -151r3/3 - 1671r*2/2 - 302r + 1. Differentiate i(b) wrt b. -302 Let o(a) be the first derivative of 23a4/4 + 4a*3/3 + 44a + 34. Let m(q) be the first derivative of o(q). Find the second derivative of m(j) wrt j. 138 What is the third derivative of -4j - 9561j*6 - 1 + 2j - 1170j2 + 2j + 4290j6 wrt j? -632520j*3 Suppose 0 = 4x + 34 - 42. What is the third derivative of 102wx - 18w*5 + 20024w + 3w3 - 20024w wrt w? -1080w2 + 18 Let n(v) = 4v*2 - 2v + 3. Let m(a) = -30a2 + 1086a - 65. Let u(j) = -m(j) - 8n(j). Differentiate u(z) with respect to z. -4z - 1070 Suppose 4 = 151b - 150b. What is the third derivative of 6h4 - 2h*b + 19h*2 - 4h*4 - 170h*5 - 87h*5 wrt h? -15420h*2 Find the second derivative of 156l*2 + 103l*3 - 57l*3 - 45l*3 - 554l*2 - 1137l wrt l. 6l - 796 Let t(l) = 5 - 34 + 10 + 10 - 6l. Let c be t(-10). Find the second derivative of -co2 + 53o*2 + 25o - 6o wrt o. 4 Let u(l) be the first derivative of -115l*6/3 + 5l4/4 - l3 + 2l2 + 6l - 94. Find the third derivative of u(c) wrt c. -13800c2 + 30 Find the second derivative of -4 + 4 - 595s*4 + 1005s + 595s4 - 698s*5 wrt s. -13960s*3 Let v(r) = -6r - 40. Let x be v(-7). Find the second derivative of -31d3 - 15d*2 + 33d + 20dx + 33d*3 - 54d*2 - 2 wrt d. 12d - 98 Suppose 0 = 4a + 5g - 8, 4g + 30 = 2a - 0g. Suppose 9k = -ak + 32. Find the second derivative of 125u*2 - 125u*k - 22u*4 + 7u + 20u wrt u. -264u*2 Let a(l) = 15l*2 - 875l + 193. Let t(r) = -4r2 + 292r - 64. Let h(q) = -2a(q) - 7t(q). What is the derivative of h(x) wrt x? -4x - 294 Let o(m) be the second derivative of -m7/42 - m6/30 - 4m*4 + 277m*3 + 3174m. What is the second derivative of o(j) wrt j? -20j3 - 12j*2 - 96 Let x(v) be the second derivative of -23v*6/2 + 204v*2 + 1208v. Differentiate x(f) wrt f. -1380f3 Suppose 0 = -2i + 14 - 8. What is the third derivative of 10g2 - 99g*2 + 2g*4 - 8g*3 - 82g*i - 23g*2 wrt g? 48g - 540 Let x(w) = -2w3 - w2 - 2w - 1. Let o(h) = -202h3 + 5h*2 - 3870h + 14. Let p(v) = -o(v) - 14x(v). What is the second derivative of p(f) wrt f? 1380f + 18 Let w(z) = -1021z4 + 8z*2 + 131z - 3. Let t(h) = 1021h4 - 6h*2 - 133h + 3. Let x(y) = 4t(y) + 3w(y). F	{ "pile_set_name": "DM Mathematics" }
-187, -219, -273, -355, -471? -j3 + j2 - 2j - 163 What is the q'th term of 21, 31, 41, 51, 61, 71? 10q + 11 What is the q'th term of -432, -433, -434, -435, -436, -437? -q - 431 What is the d'th term of -9, -22, -33, -42, -49? d*2 - 16d + 6 What is the p'th term of 12, 30, 62, 108, 168, 242, 330? 7p2 - 3p + 8 What is the m'th term of 387, 380, 371, 360, 347, 332? -m*2 - 4m + 392 What is the p'th term of 193, 387, 581? 194p - 1 What is the o'th term of -224, -446, -668? -222o - 2 What is the y'th term of -92, -185, -272, -353, -428? 3y2 - 102y + 7 What is the t'th term of 127, 119, 111? -8t + 135 What is the t'th term of -93, -109, -139, -189, -265, -373, -519? -t3 - t2 - 6t - 85 What is the g'th term of -119, -235, -351, -467? -116g - 3 What is the y'th term of -520, -1039, -1560, -2083, -2608, -3135, -3664? -y2 - 516y - 3 What is the u'th term of -185, -384, -581, -776, -969? u*2 - 202u + 16 What is the t'th term of 207, 205, 203? -2t + 209 What is the u'th term of 6, -2, -38, -114, -242? -2u*3 - 2u*2 + 12u - 2 What is the d'th term of 86, 141, 196? 55d + 31 What is the x'th term of -11, -8, -3, 4, 13? x2 - 12 What is the w'th term of -384, -377, -358, -321, -260, -169? w3 - 385 What is the f'th term of 19, 24, 17, -8, -57? -f3 + 12f + 8 What is the b'th term of 414, 1627, 3642, 6453, 10054, 14439, 19602, 25537? -b*3 + 407b2 - b + 9 What is the i'th term of -55, -117, -181, -247? -i2 - 59i + 5 What is the u'th term of -67, -90, -105, -106, -87, -42? u3 - 2u*2 - 24u - 42 What is the n'th term of -94, 151, 382, 593, 778, 931? -n3 - n2 + 255n - 347 What is the n'th term of -267, -271, -279, -291, -307, -327, -351? -2n*2 + 2n - 267 What is the t'th term of 256, 511, 766? 255t + 1 What is the c'th term of 601, 2373, 5325, 9457, 14769, 21261? 590c*2 + 2c + 9 What is the m'th term of 82, 73, 64, 55, 46, 37? -9m + 91 What is the y'th term of -78, -146, -198, -228, -230, -198? y3 + 2y*2 - 81y What is the q'th term of 0, 9, 26, 51? 4q2 - 3q - 1 What is the s'th term of -1711, -1715, -1719? -4s - 1707 What is the u'th term of -55, -65, -81, -103? -3u2 - u - 51 What is the s'th term of -817, -818, -821, -826, -833, -842? -s2 + 2s - 818 What is the l'th term of -20, -27, -48, -83? -7l*2 + 14l - 27 What is the g'th term of -2143, -2141, -2139, -2137, -2135? 2g - 2145 What is the s'th term of -882, -883, -884? -s - 881 What is the n'th term of 6622, 6626, 6632, 6640? n2 + n + 6620 What is the i'th term of 125, 256, 393, 536? 3i*2 + 122i What is the u'th term of -44, -81, -114, -143? 2u2 - 43u - 3 What is the s'th term of -615, -620, -637, -672, -731, -820, -945? -s*3 + 2s - 616 What is the t'th term of 160, 180, 200? 20t + 140 What is the a'th term of -29, -84, -165, -272, -405? -13a*2 - 16a What is the z'th term of 412, 690, 980, 1288, 1620, 1982, 2380? z*3 + 271z + 140 What is the o'th term of 167, 331, 495, 659, 823, 987? 164o + 3 What is the g'th term of -187, -728, -1633, -2908, -4559, -6592, -9013, -11828? -g3 - 176g*2 - 6g - 4 What is the c'th term of -78, -81, -90, -105, -126, -153? -3c2 + 6c - 81 What is the k'th term of 110, 109, 108, 107, 106? -k + 111 What is the y'th term of -16, -41, -80, -133, -200, -281? -7y2 - 4y - 5 What is the y'th term of 239, 218, 197, 176? -21y + 260 What is the d'th term of -5, -56, -201, -488, -965, -1680? -8d3 + d2 + 2d What is the n'th term of 927, 922, 907, 876, 823? -n3 + n2 - n + 928 What is the z'th term of 52, 106, 160, 214, 268, 322? 54z - 2 What is the q'th term of -201, -209, -227, -261, -317, -401? -q3 + q2 - 4q - 197 What is the u'th term of 67, 147, 227? 80u - 13 What is the g'th term of -395, -403, -415, -431, -451, -475? -2g2 - 2g - 391 What is the v'th term of 18, 51, 108, 195, 318, 483, 696, 963? v*3 + 6v*2 + 8v + 3 What is the b'th term of -1474, -2946, -4418, -5890, -7362? -1472b - 2 What is the t'th term of 51, 46, 29, -6, -65, -154, -279? -t3 + 2t + 50 What is the i'th term of 76, 70, 58, 34, -8, -74, -170, -302? -i*3 + 3i*2 - 8i + 82 What is the b'th term of 169, 174, 183, 196? 2b2 - b + 168 What is the a'th term of 19217, 19219, 19223, 19229? a2 - a + 19217 What is the f'th term of 39, 35, 29, 21, 11, -1? -f2 - f + 41 What is the w'th term of 1, -2, -5, -8? -3w + 4 What is the r'th term of 3570, 7139, 10708? 3569r + 1 What is the z'th term of -5, -57, -139, -251, -393, -565, -767? -15z*2 - 7z + 17 What is the b'th term of 177, 184, 207, 252, 325, 432, 579? b*3 + 2b*2 - 6b + 180 What is the b'th term of -106, -214, -322? -108b + 2 What is the r'th term of -125, -248, -371, -494? -123r - 2 What is the m'th term of -49, -79, -137, -229, -361, -539, -769? -m*3 - 8m2 + m - 41 What is the j'th term of 730, 1451, 2170, 2887? -j2 + 724j + 7 What is the y'th term of -114, -118, -122? -4y - 110 What is the l'th term of -60, -64, -66, -66, -64, -60, -54? l*2 - 7l - 54 What is the o'th term of -13682, -27364, -41048, -54734, -68422, -82112, -95804? -o*2 - 13679o - 2 What is the w'th term of -33, -56, -115, -228, -413? -3w3 - 2w - 28 What is the s'th term of 248, 493, 738, 983, 1228? 245s + 3 What is the u'th term of 66, 121, 164, 189, 190? -u3 + 62u + 5 What is the j'th term of 1, 63, 165, 307, 489? 20j2 + 2j - 21 What is the q'th term of -3527, -3523, -3507, -3473, -3415, -3327, -3203, -3037? q*3 - 3q - 3525 What is the v'th term of -126, -192, -292, -420, -570, -736, -912? v*3 - 23v*2 - 4v - 100 What is the q'th term of 4, 0, -6, -14, -24? -q2 - q + 6 What is the l'th term of -7, -7, -23, -61, -127, -227, -367, -553? -l3 - 2l2 + 13l - 17 What is the b'th term of -76, -613, -2080, -4945, -9676? -78b3 + 3b*2 - 1 What is the s'th term of 14, 22, 38, 74, 142, 254, 422, 658? 2s*3 - 8s*2 + 18s + 2 What is the y'th term of -399, -1617, -3649, -6495? -407y2 + 3y + 5 What is the f'th term of -50, -66, -84, -104, -126, -150? -f*2 - 13f - 36 What is the n'th term of 19, 49, 91, 151, 235, 349, 499, 691? n*3 + 23n - 5 What is the c'th term of -66, -71, -86, -117, -170? -c3 + c2 - c - 65 What is the u'th term of 803, 1624, 2447, 3272, 4099? u*2 + 818u - 16 What is the q'th term of -27, 60, 149, 240, 333, 428? q*2 + 84q - 112 What is the u'th term of 27, 63, 125, 225, 375? 2u3 + u2 + 19u + 5 What is the q'th term of 31, 61, 91, 121? 30q + 1 What is the b'th term of -123, -257, -403, -567, -755, -973, -1227? -b3 - 127b + 5 What is the n'th term of -1599, -3198, -4797, -6396, -7995, -9594? -1599n What is the j'th term of 1293, 2577, 3859, 5139, 6417, 7693, 8967? -j2 + 1287j + 7 What is the y'th term of -54, -54, -52, -48, -42, -34? y*2 - 3y - 52 What is the w'th term of 53, 82, 125, 182, 253, 338, 437? 7w2 + 8w + 38 What is the r'th term of -37, -70, -99, -124, -145, -162? 2r2 - 39r What is the g'th term of 7, 10, 11, 10? -g*2 + 6g + 2 What is the x'th term of 59, 83, 107? 24x + 35 What is the z'th term of 58061, 58062, 58063, 58064? z + 58060 What is the i'th term of -245, -235, -209, -161, -85, 25, 175? i3 + 2i*2 - 3i - 245 What is the o'th term of 21, 29, 35, 39, 41? -o*2 + 11o + 11 What is the v'th term of -338, -344, -350? -6v - 332 What is the y'th term of 80, 198, 324, 464, 624, 810, 1028? y3 - 2y*2 + 117y - 36 What is the b'th term of -224, -226, -228? -2b - 222 What is the i'th term of 14, 69, 168, 311, 498, 729, 1004? 22i*2 - 11i + 3 What is the t'th term of 5, 15, 49, 119, 237? 2t3 - 4t + 7 What is the q'th term of 17, 9, -3, -19, -39, -63? -2q2 - 2q + 21 What is the q'th term of -150, -143, -136, -129, -122, -115? 7q - 157 What is the r'th term of 85, 136, 201, 286, 397, 540, 721, 946? r3 + r2 + 41r + 42 What is the l'th term of 834, 1663, 2486, 3303? -3l2 + 838l - 1 What is the c'th term of -2989, -5976, -8963, -11950? -2987c - 2 What is the l'th term of -168, -184, -216, -270, -352? -l3 - 2l*2 - 3l - 162 What is the z'th term of 564, 1119, 1674, 2229? 555z + 9 What is the z'th term of -30, -108, -320, -732, -1410, -2420, -3828, -5700? -11z3 - z2 + 2*z - 20 What is the a'th term of -41, -58, -91,	{ "pile_set_name": "DM Mathematics" }
m*4t + m*4 - 34m*3 - 162310m*2t wrt m. 26472mt + 24m - 204 Find the third derivative of 453112w3 + w2 - 15w + 157. 2718672 What is the third derivative of -134303r*3 - 5r*2 - 16r - 8 wrt r? -805818 What is the derivative of -2j2k*3 - 2653jk3 - 149k*3 + 4k + 2 wrt j? -4jk*3 - 2653k*3 What is the second derivative of -64016j5 - j3 - 36245j + 2? -1280320j*3 - 6j What is the second derivative of -139491lu*2 - lu - 2l - 116u + 81 wrt u? -278982l Find the second derivative of v4 - 355v*3 + 5v*2 - 3680v + 5. 12v2 - 2130v + 10 Find the third derivative of a*6 - 22028a*4 + 3171a*2 + 1. 120a*3 - 528672a What is the second derivative of -4n2q*3 - 22n*2q*2 + 140n*2q + 3nq*3 + 36nq2 - 57q*2 wrt n? -8q*3 - 44q*2 + 280q Find the third derivative of -2b3z*4 + 374b*3z*2 - 6b*3 - 18040b*2z*4 + 5bz2 + z wrt z. -48b*3z - 432960b2z What is the first derivative of 9p4 - p3 + 6p - 13429 wrt p? 36p3 - 3p*2 + 6 What is the second derivative of -4a*2s*2x + 69166a2sx3 + 2as2x*3 + as*2 - 33as + 3s*2x*3 - 11x wrt a? -8s2x + 138332sx*3 What is the derivative of -1458n*3 - 10n*2 - 7n - 1376460? -4374n2 - 20n - 7 What is the third derivative of -34a5 + 36a*3 - 37465a*2 wrt a? -2040a*2 + 216 What is the second derivative of 2320999t*3 - 194832t? 13925994t What is the second derivative of 10d*3g*2 - 3d*3g + 3454d2g + 1248g4 wrt g? 20d*3 + 14976g*2 Find the third derivative of -62138z*3 + 10901z*2 - 5 wrt z. -372828 Find the second derivative of -24701g*2 + 9874g. -49402 What is the second derivative of -g*3tu + 2g*3t + g*3u*2 + 7g*3u - 465g2tu2 + 592g*2t - 466gtu2 + gu wrt u? 2g3 - 930g*2t - 932gt Find the second derivative of 116b2t*2 + 11825b*2t - 1922bt*2 - 4b wrt t. 232b2 - 3844b Find the third derivative of d*3u*3 + 109d*3u - 2d3 + 13949d*2u*3 + 3d*2 wrt d. 6u*3 + 654u - 12 Find the first derivative of -2h2i - 103441h2 + 8452hi wrt i. -2h*2 + 8452h What is the derivative of -1001l4q - 23lq*2 - 20q*2 + 162q wrt l? -4004l3q - 23q2 What is the derivative of -26458r*2 - 161070 wrt r? -52916r Find the second derivative of -1252740r3 - 2740176r. -7516440r Find the second derivative of -f4 - 34871f*3t - 3f2t + 80ft - 17888t wrt f. -12f*2 - 209226ft - 6t What is the first derivative of 4b2t + b*2 - 2b + 1172t + 242 wrt t? 4b*2 + 1172 Differentiate -5610hoz*3 + 19hoz + 6oz*3 + 60926oz with respect to h. -5610oz3 + 19oz Find the second derivative of -36873z*4 + 618135z. -442476z2 What is the second derivative of 9982n*2u*3 - 2n*2u*2 + 17n*2u - 5686nu wrt u? 59892n2u - 4n2 Find the third derivative of -6o*3u*3 - 10037o*3u*2 + 2o*2u*3 + 2o*2 - 52u*2 + 726u wrt o. -36u3 - 60222u*2 Find the third derivative of 521b*4o - 14b4 - b3 + 2b*2o - b*2 + 1815 wrt b. 12504bo - 336b - 6 What is the first derivative of k*4 + 50k*2 - 963k + 54794 wrt k? 4k3 + 100k - 963 What is the third derivative of 3m6 - 691m*4 - 2m*3 - 584m*2 - 27? 360m*3 - 16584m - 12 Find the first derivative of 3327r3u + 4r3 + 22r*2 + 7r - 2u wrt u. 3327r*3 - 2 Differentiate -gv*2 - 696369g + 257v4 - 93v*3 wrt v. -2gv + 1028v*3 - 279v*2 Find the third derivative of 978599k*3 - 32k*2 + 15216k wrt k. 5871594 What is the third derivative of 284470i6 + 6i*2 + i - 41866 wrt i? 34136400i*3 What is the second derivative of -178i*3j*2v + 4i3sv + ij*2s - 3ijs2v + 3ijs2 - j2s*2v - 229js*2 + 2j wrt j? -356i3v + 2is - 2s2v What is the derivative of 30068w - 2645? 30068 Differentiate -255510n*2 + 2n + 923971 wrt n. -511020n + 2 What is the first derivative of -2a*3 - 138a*2 - 309a + 93811? -6a2 - 276a - 309 Find the third derivative of -561b2w*3 + 1898b*2w*2 - 4b*2w - 9bw*4 - 2bw - 3b - 12w4 wrt w. -3366b*2 - 216bw - 288w Find the second derivative of 3bclt*2 - 2bcl - 2036bct2 - 2bc + 2blt*2 - 582blt - bl + 2cl + 3lt wrt t. 6bcl - 4072bc + 4bl What is the first derivative of 133485k3 + k2 + 2k - 775726 wrt k? 400455k2 + 2k + 2 What is the derivative of -32941g - 14850 wrt g? -32941 Differentiate -m2t - 284640m2 - 23mt2 - 1199mt with respect to t. -m2 - 46mt - 1199m What is the second derivative of 10w3x*2 + 52w*3x - 720w3 + 2wx2 + wx - 10102x2 wrt x? 20w*3 + 4w - 20204 Find the first derivative of 5c3k + 3c3 + 18c*2k*2 - 6c*2k - 167c - 14 wrt k. 5c*3 + 36c*2k - 6c2 Differentiate 2f*2s*2 + 509577fs3 + 2f + s*3 + 53480s*2 + 1 with respect to f. 4fs2 + 509577s*3 + 2 Find the second derivative of -217j*2o*2 - 14j*2o - 46jo*2 + 145jo + 2j wrt o. -434j2 - 92j What is the first derivative of -13j2 + 1246j + 59349 wrt j? -26j + 1246 Find the third derivative of -324r*2u4 - r2u - 284ru4 - 18144u*2 wrt u. -7776r*2u - 6816ru Find the second derivative of 978400l4 + 4366l + 62 wrt l. 11740800l2 Differentiate 1657773ip2 - 2p*2 + 3p + 1542 with respect to i. 1657773p2 What is the derivative of 241916j - 177039 wrt j? 241916 Differentiate 1035c3ks3 + 2c*3s + 69c2s*3 + 57c*2 + 306cks*3 - cs*2 + 34s*3 wrt k. 1035c*3s*3 + 306cs3 Differentiate -185434s*3t*2 + 5s*3t + 21s3 + 86s*2 - 27s wrt t. -370868s3t + 5s3 Differentiate -1497j + 49643 wrt j. -1497 Find the second derivative of 1892o4 - 6o*3 + 2o*2 + o + 42381 wrt o. 22704o*2 - 36o + 4 Find the third derivative of -3a6 - 8a*5 + 1105a*3 - 10a*2 + 19802. -360a*3 - 480a*2 + 6630 Differentiate 8644ox2y - 3ox*2 - 3o - x*2y + 2007y wrt x. 17288oxy - 6ox - 2xy What is the derivative of 203h2x*2 - 14h*2x - 6h - 643833x*2 wrt h? 406hx2 - 28hx - 6 What is the second derivative of -1105w*5 + 5w*3 + 41w*2 + 19177w + 12? -22100w3 + 30w + 82 What is the third derivative of 392506m3o + 5m2o + 3m2 + 766mo + 3o wrt m? 2355036o Find the second derivative of 9104a*4o*2 - 205a*2o*2 + 2ao2 - 11ao + 6o*2 - o + 101 wrt a. 109248a*2o*2 - 410o*2 Differentiate -23o*4 + 19962o*2 - 879383 with respect to o. -92o*3 + 39924o Differentiate 7c2u - 43c2v - 8cuv - c + 61uv + 8u + v with respect to c. 14cu - 86cv - 8uv - 1 Differentiate -35n2q + 5n2 - nq - 21n - 30261q wrt n. -70nq + 10n - q - 21 Find the first derivative of -292447l - 139368. -292447 Differentiate -7157y4 + 2y*2 - 131010 wrt y. -28628y*3 + 4y Find the third derivative of 5d4h - 7345d3h + 13d2 + 16dh + d + 2h wrt d. 120dh - 44070h What is the second derivative of -2k*5 + 123476k*3p*3 - 383kp3 + 176kp - k + p2 wrt k? -40k*3 + 740856kp3 What is the third derivative of -529h*4 + 367h*3 - 104557h*2 wrt h? -12696h + 2202 What is the third derivative of -885380s4 - 75s*2 - 494 wrt s? -21249120s What is the second derivative of -11148t3 + 3t*2 - 2t - 2683? -66888t + 6 Find the third derivative of 1179723f*3 + 4093624f*2 wrt f. 7078338 What is the third derivative of 22052c*4 - 9439c*2 wrt c? 529248c What is the derivative of a*3x*3 - 7460a*2x*3 - 3878x*3 - 2x - 2 wrt a? 3a2x*3 - 14920ax3 Find the third derivative of 6i*5 + 36i*4 - 1067i*3 + 16i*2 + 10i + 569 wrt i. 360i2 + 864i - 6402 What is the third derivative of 788644im*3 - 20im + 8m*2 + 45m wrt m? 4731864i Find the second derivative of -484650b*4 - 27b + 2305. -5815800b2 What is the derivative of 166t*2 + 465t + 401? 332t + 465 Find the second derivative of -2071836d*3 + 2525945d. -12431016d Find the first derivative of 76062m*2 - 83252. 152124m Find the second derivative of -106091p2t + p*2 - 13pt - 40t - 2 wrt p. -212182*t + 2 What is th	{ "pile_set_name": "DM Mathematics" }
k(m) = 2m + 6. Suppose -a + 5o + 2 = 1, 23 = 3a + 5o. List the prime factors of k(a). 2, 3 Suppose 0 = -7m + 2m + 100. What are the prime factors of m? 2, 5 Suppose -2y - 4 = -16. Suppose 12s - 36 = ys. List the prime factors of s. 2, 3 Suppose 0x = -4x + 956. What are the prime factors of x? 239 Suppose 7h - 4h - 432 = 0. What are the prime factors of h? 2, 3 Let o(r) = 2r - 1. Suppose 4w = -2m - 24, -m = -4m - 2w - 16. Let p be o(m). Let k = 8 - p. What are the prime factors of k? 13 Let h be -14(-1 + (-9)/(-2)). Let d = h - -19. What are the prime factors of (4/6)/((-2)/d)? 2, 5 Let f(o) = -o3 - 2o2 + 53. What are the prime factors of f(0)? 53 Let h(f) = f2 + 5f. Let l be h(-6). Let i = 12 - l. What are the prime factors of i? 2, 3 Suppose -5j - 118 = -3x, -2j + 232 - 56 = 5x. Suppose 2n = 1 - 7, -3d + 4n + x = 0. List the prime factors of d. 2 Suppose 0 = -2i - 1 + 5. What are the prime factors of i? 2 Let z(v) = -v2 + 9v + 2. Let d be z(7). Suppose l - 3l = -d. What are the prime factors of (-2)/l + 37/4? 3 List the prime factors of 22 + -3 + 41. 2, 3, 7 Let i(s) = 2s2 + 2s + 1. Let b be i(-1). What are the prime factors of (-1)/2(-3 - b)? 2 Let h be 8/63/2. Suppose -5w = -17 + 2. Suppose hl - 3l = -w. List the prime factors of l. 3 Let x = 36 + -17. Suppose -214 = -5v - x. List the prime factors of v. 3, 13 Suppose 17p - 44 = 16p. What are the prime factors of p? 2, 11 Let o = 17 - -53. List the prime factors of o. 2, 5, 7 Suppose 5c - 237 = 3d, 2c - 22 = 4d + 70. What are the prime factors of c? 2, 3 Let t(l) = 0 + 5l - 2l - 2 + 3l2. What are the prime factors of t(-3)? 2 Suppose -q = -4q + 9. What are the prime factors of q? 3 Let n(j) = 2j + 2. Let d be n(-2). Let u = d - -13. What are the prime factors of u? 11 Let v(x) = x2 + 6x + 3. Let z be v(-5). Let i be (z/(-6)3)/(-1). Let n(u) = -u + 1. What are the prime factors of n(i)? 2 Suppose 3p - 619 - 110 = 0. List the prime factors of p. 3 Suppose -2a + 2l = -28, -2a + 4l = -45 + 17. Let r = 2 + a. List the prime factors of r. 2 Let y = 8 + -3. Suppose -20 = 3v + yx - 7, 5v + 4x = 0. List the prime factors of v. 2 Suppose -2s - 8 = 0, 3s + s = -3a - 4. Suppose ac - 5t = 79, -37 = -5c + 3c + 3t. What are the prime factors of c? 2, 13 Let q be (-1)/(((-3)/48)/1). Suppose 10 = -2w - 2. Let o = w + q. What are the prime factors of o? 2, 5 Let x(y) = -y3 + 10y*2 - 6y - 2. List the prime factors of x(7). 103 Let t(r) = -6r - 1. Let j be t(-1). Suppose jh - 44 = -14. What are the prime factors of h? 2, 3 Let c be 4/34 - 1848/102. Let q = c + 70. What are the prime factors of q? 2, 13 Suppose 0 = -3q + 12 + 6. Suppose 0 = 4n + 4a - 36, -qn + 2a + 10 = -4n. What are the prime factors of n? 7 Let c(b) = -b*3 + 12b*2 - 10b + 12. What are the prime factors of c(11)? 23 Let x = 872 + -480. What are the prime factors of x? 2, 7 Let y(o) = -o*2 + 14o - 13. Let x be y(10). Suppose 0 = -v + 3q + x, v - 5 - 7 = -2q. What are the prime factors of v? 2, 3 Let h be (1 - 2 - 0)-17. Let g = -7 + h. List the prime factors of g. 2, 5 Let n(x) = 3x*2 - 4x + 5. Let b be n(5). Suppose -5z - 5r + b = 0, -3z - 2r - 2r + 35 = 0. What are the prime factors of z? 13 Let k = 0 + 7. Suppose -3n - k = -4n. What are the prime factors of n? 7 Let d be 4/1 + (-1 - -2). Suppose 2 = u - 2z + 6, 5u - dz = 0. Suppose 1 = c - u. What are the prime factors of c? 5 Suppose 5i = 5z - 105, -2z - 4i = -51 + 9. Suppose 6n + 3c - z = 4n, -15 = -3n + c. List the prime factors of n. 2, 3 Let k(z) = 151z + 1. What are the prime factors of k(1)? 2, 19 Suppose -25 + 75 = 5z. Suppose 0 = -w + z - 0. What are the prime factors of w? 2, 5 Suppose m + 3z = -10, -2z - z = -4m + 20. Suppose ma = -3i + 16, -4i + 5a - 15 = i. Suppose 0f + if - 12 = 0. List the prime factors of f. 2, 3 Let g(i) = 47i*2 - 6i - 14. Let c(d) = 16d2 - 2d - 5. Let u(t) = -11c(t) + 4g(t). List the prime factors of u(-1). 13 Suppose 137 = 2c + 3w, 5w - 41 = -c + 10. List the prime factors of c. 2, 19 Let y(c) be the third derivative of 13c*4/24 + 3c2. What are the prime factors of y(1)? 13 Let h(f) be the second derivative of f3/6 - 9f2/2 - 2f. Let n be h(6). What are the prime factors of (-7 + 1)/n - -5? 7 Suppose -3w + 99 = 2a, w - 3w = 2a - 64. What are the prime factors of w? 5, 7 Let v = 4 + -1. Let b be ((-10)/(-3))/(6/261). List the prime factors of b/15 - 2/v. 3 Suppose 4h - 4 = -4k - 0, 2k + 5h + 7 = 0. Suppose u + 33 = 3t - 119, kt = -u + 191. What are the prime factors of t? 7 Let u(i) = -i + 9. What are the prime factors of u(-7)? 2 Suppose -2l + 13 + 93 = 0. What are the prime factors of l? 53 Let g be (-1)/2 - 15/(-6). Let l(h) = -h - 6 + 0h2 - hg + 17. List the prime factors of l(0). 11 Suppose 2y = -3u + 17, y + 3u + 1 - 8 = 0. What are the prime factors of y? 2, 5 Suppose -o = 4d - 122, 143 = o - 0o - 3d. List the prime factors of o. 2, 67 Suppose 0 = -3y - 5f + 1 + 8, 4y + 2f = 12. Let q = -2 + y. List the prime factors of 16/3 - q/3. 5 Let k = 9 + -5. Suppose 0 = o - 3m - k - 8, 0 = -2o - 5m + 2. Suppose -2v + o = 0, y + 3v + 2v - 17 = 0. What are the prime factors of y? 2 Let f be -8(3 - (-28)/(-8)). Suppose -3j - 2g - 1 = -2j, -fg = 16. What are the prime factors of j? 7 Let q(z) = -z3 - 5z*2 - z + 5. Let d be q(-5). List the prime factors of -1d(-6)/12. 5 Let f(j) = 3j - 3. Let p = 14 - 8. Let t = p + -3. What are the prime factors of f(t)? 2, 3 Suppose -l - 44 = 4b - 6, -5b - 39 = -3l. Let s = -6 - b. What are the prime factors of s? 3 Let v(f) = 8f*3 + 2f*2 - f. Suppose 4d + 15 = 3d - 4z, 5z + 25 = 5d. What are the prime factors of v(d)? 3 Let d(o) = o*3 - 2o - 1. Let v(w) = w + 12. Let a be v(-10). Let h be d(a). Suppose -2x + 40 = hx. What are the prime factors of x? 2 Suppose -3b = -9 - 6. Suppose -5s - 5j + 25 = -0j, 0 = 5j + 15. Let t = s - b. List the prime factors of t. 3 Suppose -2r = -5j + 9, -r + 3r = 3j - 7. Let f be (-54)/(-4)2 + r. Let i = 46 - f. List the prime factors of i. 3, 7 Suppose -4o - 20 = 3h, -4h + h + 3o = 27. Let f = h - 1. List the prime factors of 12/f9/(-2). 2, 3 Let r = 29 + 13. What are the prime factors of r? 2, 3, 7 List the prime factors of 556/(3 - 3/3). 2, 139 Suppose -l + z - 2 = 0, -z + 3 = -0. Let y be l - (2/(-2) - -28). Let p = -7 - y. What are the prime factors of p? 19 Suppose 2i - 133 = -5r, r = 5i + 5r - 290. List the prime factors of i. 2, 3 Suppose -106 = 4f + 5w, -56 = 2f - 0f + 4w. Let u be f + 4/(4/(-3)). Let a = -18 - u. What are the prime factors of a? 3 Suppose -7f + 3f = -28. Suppose -3s + 4n + 1 = -f, -3 = -3n. Suppose -2z + 4 = 4g, 0 = -2z - 3z - sg + 28. What are the prime factors of z? 2 Let k(x) = x*2 + 1. Let y be k(1). Let t be y/(-3) + 2/(-6). List the prime factors of 0 + 1 + (12 - t). 2, 7 Let k(o) = -2o. Let h be k(-2). Let f(c) be the third derivative of c*4/12 + 5c*3/6 + 7c*2. List the prime factors of f(h). 13 Let g = 34 - 76. Let a be g/(-2)(-8)/(-6). Suppose 4 = -2w, -w = 2l - 5w - a. What are the prime factors of l? 2, 5 Let z(o) = -o3 - 4o*2 - 3o. Let x be z(-2). Let p = x - -6. Suppose 2u = p + 16. What are the prime factors of u? 2, 5 Suppose x - 4x = -105. List the prime factors of x. 5, 7 Let r(u) = 3u - 1. Suppose -2x + 16 = 4. What are the prime factors of r(x)? 17 Let c(z) = 4z - 1. Suppose 0 = 2y - 5y - i + 5, 5y + i = 11. Suppose v + v + yb = 7, 1 = v - b. What are the prime factors of c(v)? 7 Suppose 4 = 5b - 4b. Suppose -bn = -2 - 10. What are the prime factors of n? 3 Suppose 5c + 26 = 4p - 3p, -36 = -4p + 3c. Let u(h) = 4h - 5. What are the prime factors of u(p)? 19 List the prime factors of (-12)/6 - (-645)/3. 3, 71 Let z(t) be the first derivative of 13/2t2 - t + 2. List the prime factors of z(1). 2, 3 Suppose 0f = -4f + 288. Let k = f + -27. Let n = k - 25. List the prime factors of n. 2, 5 Let g(o) = 13o*2 + 2. What are the prime factors of g(2)? 2, 3 Suppose 4 = 2r - 3w - 3, 5w + 9 = 2r. Suppose 2 - 94 = -4x - rd, -5x = 4*d - 115. List the prime factors of	{ "pile_set_name": "DM Mathematics" }
r = a + 9. Let n = 3784/8813 - 1/1259. What is the second biggest value in r, 3, n? n Let w = 0.06 + -1.76. Let l = w + 1.6. Let u = l - 3.9. What is the second smallest value in 0.2, u, 2/13? 2/13 Let z = -0.01 - -15.01. Let s = -33 - -483. Let v = -452 + s. Which is the third smallest value? (a) 5 (b) z (c) 0 (d) v a Let p = -1043.09 - -1043. Let j = -31.7 - -32. What is the smallest value in 0.2, j, p? p Let p = 45.3949 - 2.3949. What is the fourth smallest value in -0.1, -4, -0.5, p, -8? -0.1 Let y = 14459 + -14459. Which is the fourth smallest value? (a) -10 (b) 0.3 (c) y (d) 7 d Let z = -7726 - -7723. Which is the second biggest value? (a) -10 (b) -1 (c) z (d) 1/2 b Let n = -0.12 - -5.12. Let g = n - 9. Let y be 1175310/348242/(-15). What is the third biggest value in g, -1, y? y Let m = -0.4 + -1.5. Let r = -1321 + 1323.1. Let x = m + r. What is the third biggest value in 3, -0.1, x? -0.1 Let g(h) = 119h + 5. Let q be g(0). What is the third smallest value in 1/7, q, -0.4, -3, 38? 1/7 Let x = -54.45 - -54.15. What is the second biggest value in -3, x, 1, 1/7, -2/53? 1/7 Let x = -0.7648 - -20.7648. What is the third smallest value in 0.07, 5, x, 3? 5 Let t = 108 + -334. Let x = 225.9 + t. Which is the third smallest value? (a) -0.5 (b) 2 (c) -0.2 (d) x d Let s = -185 + 185. Let l be s/(-3) - (6 + (-45)/6). Which is the second biggest value? (a) -11/5 (b) 6 (c) l c Let w be (-10)/(-20)2/(-4). Let u be (-93)/(-62)(-28)/3. Which is the biggest value? (a) 0 (b) u (c) w a Let h = 20.6 - 67.5. Let t = -47.1 - h. What is the biggest value in t, -5, -11? t Suppose 4 = -r + 3r. Suppose 5j + 3q - 250 = -rq, -j = -3q - 30. Let b = j - 50. What is the third biggest value in -4, 2/5, b, 0.2? -4 Let v = 200.4 + -32.4. Let o = v + -172. Which is the second biggest value? (a) o (b) -0.3 (c) -2/7 b Let m = 69 + -75. Let l = -145/2 - -75. Which is the smallest value? (a) -0.5 (b) m (c) 1 (d) l b Let s = -143/3 + 46. Let r = -71 - -95. Let k = r - 18. Which is the second biggest value? (a) k (b) s (c) 2 (d) 0 c Let h = 1059/7 - 1061/7. Which is the third smallest value? (a) h (b) -0.178 (c) -0.5 (d) 1/2 b Let f = 150.54 - 150.04. What is the third biggest value in -1, 5, 37, f? f Suppose 62s = 5232 - 5046. Which is the third smallest value? (a) -1/5 (b) -1.7 (c) s (d) 0.03 d Suppose 0 = 2p - 4x - 13 - 5, -x = 5p - 1. Let f be -4(p + (1 - 1)). Let l = 2679.5 - 2680. What is the second smallest value in l, f, -1/7? l Let w = 125.25 - 125. Let f = -849 - -837. Which is the smallest value? (a) f (b) -0.1 (c) w a Let d = 6.01 + -2.17. Let j = d - -0.06. Let t = j - 3.95. Which is the smallest value? (a) t (b) -2 (c) -4/3 b Let q = -2637/13 - -203. Let o = -548 + 543. What is the second smallest value in 3, q, o, 2? q Let w = 1 + -0.9. Let g(f) = -8f2 + 333f + 479. Let k be g(43). Which is the second smallest value? (a) k (b) -2/9 (c) w c Let m = 1152.2 + -1146.2. Suppose d - 4 = -4k, 0k = 2k - d - 8. Suppose -r = -k + 4. Which is the third biggest value? (a) -2/13 (b) r (c) m b Let q = 60.861 - -0.139. Let h = 102 - q. Let x = h + -41.3. What is the third smallest value in 2, -4/3, x? 2 Let s = -1.1 + 1.5. Let x = 768.16 + -768. Which is the smallest value? (a) s (b) 1/9 (c) x b Let z be (-17)/(-68) - (-111)/4. Let t be 1/(-2) - 0/z. Which is the second biggest value? (a) 2 (b) -2 (c) 2/5 (d) t c Let k = 0.15937 - 0.55937. Which is the fourth biggest value? (a) k (b) 2/57 (c) 0.5 (d) -3 (e) 4/5 a Let t = -3.7 - 0.3. Let o be 3404/13616(1 - (-2)/6). What is the fourth smallest value in t, o, 5/3, 4.9? 4.9 Let d = -182.8 + 182.8. What is the fourth biggest value in -5/4, -65.5, d, -0.5? -65.5 Let q = 5 + -2. Suppose 20 = 2z + p, -z + 4z - 21 = qp. Suppose -4t - 5 = -zt. What is the biggest value in 5, -3, 0.1, t? 5 Let z = -8094 - -8094.4. Which is the second smallest value? (a) 9 (b) 0.2 (c) z (d) 4 (e) 0.3 e Let g = 84 - 134. Let z = -611.4 + 561. Let v = g - z. Which is the second biggest value? (a) v (b) 0.1 (c) -5 b Let t = -1.3 - -0.3. Let h be 2 - ((-204)/(-144) - (-7)/(-42)). Which is the fourth biggest value? (a) 16 (b) t (c) 1/4 (d) h b Let c = -34471/6 + 5745. What is the fourth biggest value in -1, -175, 0.5, c? -175 Suppose -2y = 154 + 456. Let b = y + 3963/13. Let h = -0.088 + -2.912. What is the smallest value in -4, b, h? -4 Suppose 4o - 32 = 28. Let l(v) = -2v - 1. Let r be l(-2). Suppose 3i = r - o. Which is the third smallest value? (a) i (b) 1/3 (c) 5 (d) 1 d Let t = 1037 + -1010.56. Let r = t + -26. Let w = r + -3.44. Which is the third biggest value? (a) -0.3 (b) w (c) 0.2 b Let w = 4375/3 + -1458. Which is the third smallest value? (a) -0.3 (b) -1/9 (c) -2/5 (d) -3 (e) w a Let u = -2467 + 2462. What is the smallest value in 3, -0.073, u, 4? u Let j = -159 + 155. Let l be (j/(-3))/((-572)/66). What is the second smallest value in -2, l, -5, 0.04? -2 Let r(q) = -q2 - 24q - 39. Let s be r(-20). Let f = s + -45. Let o be f + 24/4 + 3. Which is the second biggest value? (a) o (b) -0.05 (c) 1 c Let i be 8/22(-44)/72. What is the third biggest value in -0.009, i, -3, 5, 0.2? -0.009 Let k be 1148/5084(-2)/7. Which is the biggest value? (a) k (b) -0.3 (c) -4/5 (d) 3 (e) 1.2 d Let h = -7565/47671 + 2/2509. Which is the third biggest value? (a) 0.2 (b) h (c) -1/20 b Let q = 7982/3 + -2661. Let c = 11 - 10. What is the second biggest value in q, c, 3? c Let l = 18.138 + -1389.138. Which is the second biggest value? (a) -2/9 (b) 3/4 (c) l a Let o = 63 - 24. Suppose -5m = 16 + o. Let u = 10538 + -10535. Which is the fourth smallest value? (a) -0.3 (b) m (c) u (d) 2 c Let l = -82.2 - -81.9. Which is the third smallest value? (a) 3 (b) 1 (c) l (d) 2/15 (e) -134 d Let j = -14.3 + 15. Let k = 3.7 - j. Let f be ((-12)/(-15))/(11/5)(910/(-28))/13. Which is the second smallest value? (a) f (b) k (c) -0.3 c Let t = 0.4 + -1.4. Let a = 10.98657 + 0.01343. What is the fourth biggest value in 2/7, 2, a, t? t Let b = -2.9 - 0.1. Let l be ((-2)/(-2312))/((-61)/(-6) - 10). Let p = l - -4615/1734. What is the third smallest value in p, b, 5? 5 Let b = 107/3 + -35. Let r be -3 - (-341)/90 - 755/906. What is the second smallest value in r, 0, 4, b? 0 Let z = -5.6 + -32.4. Let d = -71 - z. Let w = 484/4305 + 6/287. What is the third biggest value in 5, w, d? d Let k = -160795/13 - -12369. Which is the third biggest value? (a) -2.3 (b) 36 (c) k a Let d = 27 - -161. Let r = -193 + d. Which is the third smallest value? (a) 0.5 (b) -4 (c) r a Let j = 126 - 117. Let b be (4 - 39/j)0. What is the fourth smallest value in -7, b, -2, -0.5? b Let s = -0.028 - 2.672. Let q = -2.08 - s. Let g = q - 0.62. What is the second biggest value in -0.3, g, -2/3, -1/8? -1/8 Let q = 0.017 + 14.983. Let w = -1 + -2. Let s = 2.193 - 0.193. What is the biggest value in w, q, s? q Let m be 261/135 + -6 + 6 - 2. What is the fourth smallest value in -2, m, -3/2, 1, 4/9? 4/9 Let q = 17501.8 + -17502. What is the fifth biggest value in -0.5, -5, 76/9, q, -1? -5 Let w = -9.4 - -9. Let c = 0.032 - -23.968. Let o = 23.8 - c. What is the third smallest value in -4, w, o? o Let w = -14528 + 14532. Which is the third smallest value? (a) 2 (b) 3 (c) w (d) -3/5 (e) -0.044 a Let s = 4.4 - 3. Let a be (-1)/(-2)(12 + (-1856)/145). What is the fourth biggest value in 5, s, a, 0.3? a Let l be (3/15)/(1/7). Let f = 641/35 + -93/5. Let r = -543 + 8143/15. Which is the fourth biggest value? (a) f (b) r (c) 0.1 (d) l a Let j be (-45/50)/5. What is the fifth smallest value in 8, j, 1, 0.1, 5? 8 Let x = -2016 + 2020. Let m = 0 - -5. Suppose mu + xu = -u. Which is the second biggest value? (a) -5 (b) u (c) -2 (d) -0.2 d Let l = 538/5 - 108. Let x be ((-10)/(-8))/(7/(-4)). Let s be (-52)/(-39)(-3)/2. Which is the biggest value? (a) s (b) x (c) l c Let q be (9612/42)/(-8 - 2104/(-224)). Which is the second smallest value? (a) -3 (b) 2 (c) q b Let j = -5542.9 + 5543. What is the fifth biggest value in -4, -4/3, 19, j, -1? -4 Let f = 44.5 - 44.818. Let t = 2.318 + f. What is the biggest value in -3/2, t, -1/2, -0.04? t Let l = -2.677 - -4	{ "pile_set_name": "DM Mathematics" }
the second derivative of m(f) wrt f. -114 Let j(c) = 25c3 - 15c*2. Let w(u) = -26u*3 + 16u*2. Let v(f) = 3j(f) + 4w(f). Find the third derivative of v(h) wrt h. -174 Find the second derivative of 1653 + 25i - 7i2 - 1653 wrt i. -14 Suppose 2y - m - 2 = -0, -3y - 2m - 4 = 0. Suppose 2p + 3i = 11, 4i + 0i - 4 = y. Find the second derivative of h - ph4 - 3h + h*4 wrt h. -36h*2 Let m = 7 - 4. Let b = 0 + 4. What is the third derivative of 8 - 8 + mg*4 - bg*2 wrt g? 72g Let t(u) be the second derivative of u*3/6 + 3u*2 + 3u. Let w be t(0). What is the first derivative of 6l + 3l*2 + 3 - wl + 0l wrt l? 6l Let x(h) = -7h2 - 3h. Let q(c) = -14c2 - 6c. Let i(f) = 3q(f) - 5x(f). What is the second derivative of i(k) wrt k? -14 Suppose -7j + 23 = 9. What is the second derivative of 9m*j - 8m - 3 + 2 + 1 wrt m? 18 Let t(l) = 27l4 - 5l*3 - 27l*2 - 5. Let r(p) = 14p*4 - 3p*3 - 13p*2 - 3. Let c(h) = 5r(h) - 3t(h). Find the third derivative of c(a) wrt a. -264a Let v(p) = -31p2 + 53. Let g(q) = -16q*2 + 27. Let o(x) = 5g(x) - 3v(x). What is the first derivative of o(d) wrt d? 26d Let i(r) = 3r - 9. Let c be i(6). What is the derivative of 3u - 3u + 8 + cu*4 wrt u? 36u*3 Let b(p) be the second derivative of 3p + 1/3p3 - 1/2p*2 + 0. What is the first derivative of b(s) wrt s? 2 Let t be -3(-1 + (-3)/(-9)). What is the third derivative of tr2 + r6 - r2 - 2r*6 wrt r? -120r*3 Let m be 5 + -3 + -2 + 3. What is the third derivative of 2g*2 + 3 - 3 + 5g*m - 3g3 wrt g? 12 Let r(n) = -n4 - 1. Let a(p) = 2p4 - 18. Let d(h) = a(h) + 4r(h). What is the derivative of d(o) wrt o? -8o3 Let v = 5 + -3. Let w be (0 + 1 - 0) + 6. Find the third derivative of -7h + vh6 + wh + 3h2 wrt h. 240h*3 Suppose -5n + 90 = 15. Suppose -3y + n = 2y. Differentiate -5s3 + s4 + 2 + 3s*y + 2s*3 with respect to s. 4s*3 Find the third derivative of -11v*6 + 19v*5 - 19v*5 + 3v*2 + 7v*2 wrt v. -1320v*3 Let a(v) be the first derivative of 20v*3/3 - 10v + 28. Differentiate a(r) with respect to r. 40r Suppose 4c - 4z + 16 = 3c, -3z = 4c - 31. Differentiate -2x4 - xc - 2x*4 - 8 + 12 with respect to x. -20x3 Let z(l) = -l2 - 2. Let s(h) = -3 + 3 - h - 7. Let f be s(-8). Let b(k) = -k*2. Let j(p) = fb(p) + z(p). What is the derivative of j(y) wrt y? -4y Let v(f) = 26f*3 - 17f*2 + 15. Let h(k) = 9k*3 - 6k*2 + 5. Let m(p) = -17h(p) + 6v(p). Differentiate m(t) with respect to t. 9t2 Let j(l) be the third derivative of -l7/210 - 7l3/6 - 6l*2. Differentiate j(r) wrt r. -4r*3 Let d(c) be the second derivative of 0 + 0c*2 - 3/56c*8 + 3c + 1/4c4 + 0c*3 + 0c*7 + 0c*5 + 0c*6. Find the third derivative of d(j) wrt j. -360j*3 Let u(x) be the third derivative of 0x*4 + 0x*6 + 0x - 4x2 + 0x*3 + 2/105x*7 - 1/12x*5 + 0. Find the third derivative of u(h) wrt h. 96h What is the second derivative of 0k5 - 2k*5 - 9k + 5k5 + 3k wrt k? 60k3 What is the third derivative of -q + 149q*4 - 141q*4 + q - 13q*2 wrt q? 192q Let w(q) be the second derivative of q5/20 - q2 - 3q. Differentiate w(d) with respect to d. 3d2 Let s(t) = -t3 - 6t2 + t + 8. Suppose -2g - 5m - 33 = g, -3m - 27 = 3g. Let r be s(g). Find the third derivative of 2q2 + q5 + q5 - qr wrt q. 120q2 What is the third derivative of -2l*2 + 20l*3 + 3l*2 - 6l*2 wrt l? 120 Let l(k) = -14k*2 + 21k. Let x(t) = -t*2 - t. Let v(h) = l(h) - 2x(h). Find the second derivative of v(g) wrt g. -24 Let d(n) be the third derivative of 17n7/70 - n6/120 - 5n*4/24 - 2n*2 + 6. Find the second derivative of d(h) wrt h. 612h*2 - 6h Let v(l) be the third derivative of 29l4/24 + l3/3 + 35l*2. Find the first derivative of v(n) wrt n. 29 Suppose 3l = -3i - 9, 3 + 10 = -3i - 4l. Suppose m - 5 = -i. Find the first derivative of m - 3 + 1 - 3h*3 wrt h. -9h2 Let h(x) be the third derivative of -x6/24 + x*5/20 - 5x*2. What is the third derivative of h(v) wrt v? -30 Let g = 5 - 1. Suppose -16 = -gy - 0. Differentiate 1 - 2 - 3a4 + 2a*y with respect to a. -4a*3 Let y(m) be the first derivative of 2m + 0m2 - 4 + 0m*3 + 0m*4 - 2/5m*5. What is the first derivative of y(z) wrt z? -8z*3 Suppose -2a = 2q + 2a + 24, -4a = -2q. Let v = q - -11. What is the second derivative of -vb5 + 3b - 5b + 3b*5 wrt b? -40b*3 Suppose 0 = -s - 2z + 15, 2s - 5z + 45 = 6s. Let o be (-4)/18 - (-29)/9. What is the second derivative of -od + 3d + 2d*s - d wrt d? 40d*3 Let z(p) be the first derivative of -23p*4/4 - 25p*3/3 - 30. Find the third derivative of z(g) wrt g. -138 Suppose -5f = -4n - 0f - 9, 2f = -5n + 30. Find the third derivative of i*6 + ni - 4i + 2i2 - i2 wrt i. 120i3 Find the third derivative of -2v*5 + 2v*5 - 10v*5 - 21v*2 wrt v. -600v*2 Let j(o) be the first derivative of 0o*3 - 1/2o*4 - 1/2o*2 + 1 + 0o. Find the second derivative of j(t) wrt t. -12t Let c(l) be the first derivative of 3l*4 + 5l*2 + 23. Find the second derivative of c(b) wrt b. 72b Let r = -815 + 48901/60. Let g(t) be the third derivative of t*2 + 0t*3 + 0t*5 + rt*6 - 1/12t*4 + 0 + 0t. Find the second derivative of g(a) wrt a. 12a What is the derivative of 2o*4 - 9 - 6o*4 + 5 wrt o? -16o*3 Differentiate 0 + 1 + 6l*3 + 0 wrt l. 18l2 Let r(h) = h2 + h. Let m(k) = 11k2 + 3k. Let f(l) = -m(l) + 6r(l). What is the second derivative of f(t) wrt t? -10 Let h(c) = -c2 + 2c - 2. Let g(v) = -4v2 + 10v - 11. Suppose 24 = -5j - 31. Let n(w) = jh(w) + 2g(w). Find the second derivative of n(s) wrt s. 6 Let b(c) = 48c*4 - 5c*3 - 47c*2 - 5. Let i(f) = 24f*4 - 3f*3 - 24f*2 - 3. Let s(a) = 3b(a) - 5i(a). What is the third derivative of s(o) wrt o? 576o Let m(d) = -6d2 + d + 3. Let h(g) be the first derivative of 7g*3/3 - 4g + 2. Let k(c) = -3h(c) - 4m(c). What is the second derivative of k(r) wrt r? 6 Let w(m) be the first derivative of -11m5/5 + 3m*2 - 21. What is the second derivative of w(s) wrt s? -132s*2 Let u be 16/6 - (-4)/12. What is the third derivative of -3w + w*2 + uw - 4w3 wrt w? -24 Find the third derivative of -22u*6 + 23u*2 + 28u*6 + 9u*2 wrt u. 720u*3 Let w(n) = -7n*2 - 8n - 4. Let i(k) = 14k2 + 15k + 7. Let x(f) = -4i(f) - 7w(f). What is the second derivative of x(s) wrt s? -14 Let b(a) = 12a4 - 8a*2 - 5a. Let p(m) = -12m4 + 9m*2 + 4m. Let u(q) = 4b(q) + 5p(q). Find the third derivative of u(x) wrt x. -288x Let y(c) be the third derivative of -c8/1344 - c5/24 + c4/6 + 2c*2. Let p(h) be the second derivative of y(h). Differentiate p(f) wrt f. -15f*2 Let w(i) = -9i - 21. Let n(v) = 2v + 4. Suppose q + 55 = 6q. Let s(u) = qn(u) + 2w(u). Differentiate s(b) wrt b. 4 Let b(n) be the first derivative of 9n3 + 45n + 56. Find the first derivative of b(o) wrt o. 54o Let v(y) = y2 - 6y + 7. Let a = 4 + 1. Let r be v(a). Find the second derivative of rh4 + 3h - h*3 + 3h*3 - 2h*3 wrt h. 24h*2 Suppose 0 = -p - 2p. Differentiate 2 + ps2 + 0s*2 - 3s*4 - 1 wrt s. -12s*3 Suppose 12 + 10 = 5h + 2w, 3w = -2h. What is the third derivative of -2y*6 - 3yh - y6 + y*2 + 3y*6 wrt y? -360y3 Let t = 2 + -2. Find the third derivative of a6 - a*2 + ta*2 - 2a*2 wrt a. 120a*3 Let h(i) be the first derivative of 2i*3 + 5i*2/2 + 6. What is the second derivative of h(u) wrt u? 12 Let x(o) = -29o*2 - 59o + 11. Let y(v) = 7v2 + 15v - 3. Let z(r) = -6x(r) - 22y(r). What is the second derivative of z(d) wrt d? 40 Let q(k) = -4k2. Let x(o) = -8o*2 + o. Let r(j) = -7q(j) + 3x(j). What is the second derivative of r(h) wrt h? 8 Let j(x) = 2x + 1. Let h be j(1). Find the third derivative of -2i2 - hi*2 + 9i*2 - 3i*6 wrt i. -360i3 Let j(u) = u2. Let g(z) = -z*2 - 5z - 6. Let f(q) = -g(q) - 2j(q). Let y(l) be the first derivative of f(l). What is the derivative of y(o) wrt o? -2 Suppose 0 = -2g - 0g. Let v = g - -3. Find the third derivative of 2m*6 - 12m + 1	{ "pile_set_name": "DM Mathematics" }
in -4h + 17h - 3h - 11h - 16h. -17h Collect the terms in -42k3 + 2k*2 - 6k*2 - 11k*3 - 5k*3. -58k*3 - 4k*2 Collect the terms in 5 - 51d - 5. -51d Collect the terms in -80x*3 + 665x*3 - 23x*3. 562x*3 Collect the terms in 100p*2 + 238p + 237p - 473p. 100p2 + 2p Collect the terms in 1839l + 4l*3 - 1839l. 4l3 Collect the terms in 171549 - 515f + 514f - 171549. -f Collect the terms in -61i*2 - 8i*3 + 33i*2 + 28i*2. -8i*3 Collect the terms in -2g*2 - 3g*2 + 0g*2. -5g*2 Collect the terms in -2151f*3 - 2148f*3 + 4300f3. f3 Collect the terms in -2t + 12t + 9t. 19t Collect the terms in -35a + 2 - 3 + 1. -35a Collect the terms in -361t2 - 368t*2 + 722t*2. -7t*2 Collect the terms in -170447l + 170447l + l2. l2 Collect the terms in 14s*3 + 14s*3 - 40s*3 + 15s*3. 3s*3 Collect the terms in -12z - 520 + 520. -12z Collect the terms in -b + 7 - 11 + 1 + 7. -b + 4 Collect the terms in -22 + 2 - k2 + 20. -k2 Collect the terms in -4r + 9 + 7 - 23 + 11. -4r + 4 Collect the terms in -16c - 8c - c + 30c. 5c Collect the terms in 710x*3 + 20 - 705x*3 - 20. 5x*3 Collect the terms in -1598i*2 + 1598i*2 - 2i*3. -2i*3 Collect the terms in 0l*3 + 5l*3 - 14l*3 + 4l*3. -5l*3 Collect the terms in 20a2 + a2 - 34a2 + 17a*2. 4a*2 Collect the terms in -5q*2 + 28 - 28. -5q*2 Collect the terms in -3r*2 + 8r + r*2 + 0r*2. -2r*2 + 8r Collect the terms in -5294 + 2u + 5294. 2u Collect the terms in -32j2 + 6j2 + j2 - 7j2 - 2j. -32j2 - 2j Collect the terms in 78r + 62r*2 - 78r. 62r2 Collect the terms in -971 - 970 - 2n*3 + 1941. -2n*3 Collect the terms in 9m + 5m + 6m - 19m + m. 2m Collect the terms in 93k - 295k + 91k + 102k. -9k Collect the terms in 121x*3 - 247x*3 + 129x*3. 3x*3 Collect the terms in 2z*2 - 14z*2 - 16z*2 - 6z*2. -34z*2 Collect the terms in -1 - a + 3a + 1 - 162a2. -162a*2 + 2a Collect the terms in -30 + 30 + 422p3. 422p*3 Collect the terms in -12l*3 + 16l*3 + 18l*3. 22l*3 Collect the terms in -5k + 4k - k + 6k. 4k Collect the terms in -27c*2 - 45c*2 + 93c*2. 21c*2 Collect the terms in 19v*2 + 19v*2 - 52v*2 + 11v*2. -3v2 Collect the terms in 5101 - 5101 + t2. t*2 Collect the terms in y - y - 4y. -4y Collect the terms in -32x*2 - 410x + 410x. -32x*2 Collect the terms in 2g - 6g + 5g. g Collect the terms in 2 - 8 + 0 - p - 8. -p - 14 Collect the terms in -2k2 - 6k*2 - 3k*2. -11k*2 Collect the terms in 28 - 22 - 5g - 6. -5g Collect the terms in 11h + 1397 - 1397. 11h Collect the terms in 617b - 2450b + 615b + 609b + 610b. b Collect the terms in 15j2 + 35j*2 - 18j + 18j. 50j*2 Collect the terms in -5 + 8j + 0 - 12j + 5. -4j Collect the terms in 1 - 25h3 + h3 - 1. -24h*3 Collect the terms in -6f*2 - 7f*2 + 7f*2. -6f*2 Collect the terms in -2z*2 - 24z + 53z - 29z. -2z2 Collect the terms in -64q*2 - 115q*2 + 0 + 181q*2 + 0. 2q*2 Collect the terms in -2t + t - 8t3 + 26t*3. 18t*3 - t Collect the terms in 18o*3 - 24 + 24. 18o*3 Collect the terms in -1976 - 9412f*2 + 1976 + 9412f*2 - 2f*3. -2f*3 Collect the terms in -3h3 + h3 + h3. -h3 Collect the terms in 8a3 + 7a3 - a3. 14a3 Collect the terms in 22d - 30d + 8 - 8. -8d Collect the terms in 10i2 + 8i*2 - 11i*2. 7i*2 Collect the terms in 200x - 53x + 25x. 172x Collect the terms in -9 + 9 + 6j - 7j. -j Collect the terms in 2j*3 + 7j*3 + 13j*3 - 22j*3 + 4j*3. 4j*3 Collect the terms in 5a*2 - 10a*2 + 3a + 11a2 - 3a. 6a2 Collect the terms in -8i + 8i - 269i*2. -269i*2 Collect the terms in 35i - 5i - 9i - 24i. -3i Collect the terms in 22 - 88i - 22 + 0i. -88i Collect the terms in 31t - 119t + 40t + 47t. -t Collect the terms in 19o*2 - 2o*2 + 2o*2. 19o*2 Collect the terms in -249y + 249y + 2y*3. 2y*3 Collect the terms in 5 + 12 + 35 - 5 - 3c*2. -3c*2 + 47 Collect the terms in -18c - 10c + 29c. c Collect the terms in 0c3 + c3 + 36c*2 - 2c3. -c3 + 36c2 Collect the terms in 11p + 10p2 - 2p - 4p2 - p. 6p*2 + 8p Collect the terms in -6r - 5 + 9r + 0. 3r - 5 Collect the terms in -65f*2 - 114f*2 + 14f*2. -165f*2 Collect the terms in -5t*2 + 8t*2 - t + 12t*2 + 2t. 15t2 + t Collect the terms in 43h*2 + 0h - 137h2 + 0h + 98h2. 4h*2 Collect the terms in 27 + 25 + 4y*2 - 52. 4y*2 Collect the terms in 77g + 10g + 26g. 113g Collect the terms in 238v2 - v2 + 89v2. 326v*2 Collect the terms in -4p3 + p3 + 9p3 + 3p*3. 9p*3 Collect the terms in 606b + 607b + 603b - 1820b. -4b Collect the terms in 4 - q*3 + 0q*3 - 6q*3 - 4. -7q*3 Collect the terms in 50o - 28o - o3 - 22o. -o*3 Collect the terms in -47d*2 + 47d*2 - 27d*3. -27d*3 Collect the terms in 93 + 69u*2 + 3u*3 - 93 - 69u*2. 3u*3 Collect the terms in -8j - 8j - 5j - 2j. -23j Collect the terms in -36d + 7 - 7. -36d Collect the terms in -39n + 142n - 36n - 32n - 36n. -n Collect the terms in 475 + 14l - 475. 14l Collect the terms in -3a - 4a - 6a + 7a. -6a Collect the terms in -32t - 4 + 1 + 5 - 24t. -56t + 2 Collect the terms in -3b*3 - 2b*3 + 10b*3 - 7b*3. -2b*3 Collect the terms in 383327 + 10q - 383327 + 4q. 14q Collect the terms in l*2 - 4l*2 - 9l*2. -12l*2 Collect the terms in -24q*2 - 15q*2 + 62q*2 - 21q*2. 2q*2 Collect the terms in -3f - 14f + 26f - 6f. 3f Collect the terms in 70l2 - 146l*2 + 60l*2. -16l*2 Collect the terms in 2j2 + j2 + j*3 - 6j*2 - 6j*3. -5j*3 - 3j*2 Collect the terms in 900 - 900 - 2i*2. -2i*2 Collect the terms in 401 + 5k - 223 - 178. 5k Collect the terms in -2o - 399 - o + 399. -3o Collect the terms in -4x + 2x - x - 5x. -8x Collect the terms in 19q - 38q - 63q. -82q Collect the terms in 5f*2 + 8 - 8. 5f*2 Collect the terms in -5l + 10l - l. 4l Collect the terms in 148v2 + 7v*3 - 148v*2. 7v*3 Collect the terms in -14122 - 4h*3 + 14122. -4h*3 Collect the terms in 3g + 95g2 - 99g*2 + 3 - 3g. -4g2 + 3 Collect the terms in 53w*2 + 53w*2 - 18w - 31w - 108w*2. -2w*2 - 49w Collect the terms in 5p2 - 6p*2 + 3p2 - p2. p2 Collect the terms in h2 - 141h + 141h. h*2 Collect the terms in -165h - 3955 + 3955. -165h Collect the terms in -132 + 132 + 3s*2 - 6816s + 6816s. 3s*2 Collect the terms in 90m*3 - 46m*3 - 46m*3. -2m*3 Collect the terms in -106c - 5 + 5. -106c Collect the terms in 207u*2 - 226u*2 - 1 - 318u*2. -337u*2 - 1 Collect the terms in 541f - 13 + 13. 541f Collect the terms in 5h - 18h - 2h. -15h Collect the terms in -1361d*2 + 1359d*2 + 4d - 3d - d. -2d*2 Collect the terms in -15r - 10r + 28r - 6r. -3r Collect the terms in 792l - 771l + 2 - 2. 21l Collect the terms in 380 + 3h*3 - 380. 3h*3 Collect the terms in 65g - 196g - 147g. -278g Collect the terms in -1 + 0 + 2 - 330i - 2. -330i - 1 Collect the terms in 13r + 9r + 2r - 3r. 21r Collect the terms in 55403 - 55403 - 13y3. -13y*3 Collect the terms in -4h + 1 - 3 - 56h. -60h - 2 Collect the terms in -6 + 4 + 2 - 16j. -16j Collect the terms in -19u3 - 10u*3 + 9u*3. -20u*3 Collect the terms in 2z2 + 1637 + z2 - 345. 3z2 + 1292 Collect the terms in -3145h*2 + 2 - 2. -3145h*2 Collect the terms in -13 - 161m - 28m + 13. -189m Collect the terms in 201h - 67h - 64h - 67h. 3h Collect the terms in -5v - 12v + v + 17v. v Collect the terms in -16 - 293b2 + 16. -293b*2 Collect the terms in 1202 + 7k - 1202. 7k Collect the terms in 4 - 4g*2 + 29g*2 - 4. 25g*2 Collect the terms in -7n*2 + 199n*2 - 2 + 4 + 132n*2. 324n*2 + 2 Collect the terms in 6q*2 - 4q*2 + 154q - 154q. 2q*2 Collect the terms in -38t - 8t + 0t + 23t. -23t Collect the terms in 1458r2 - 1458r2 - r3. -r*3 Collect the terms in -7b*3 + 4b3 - b3. -4b3 Collect the terms in 19m*3 + 4m - 4*	{ "pile_set_name": "DM Mathematics" }
25598i - 16102388. What is w(-4)? 4 Let o(p) = 51866p - 15611677. Give o(301). -11 Let g(i) = 2i3 - 330i*2 + 358i - 4927. Determine g(164). -7 Let g(n) = n*2 + 59n - 13268. Give g(-149). 142 Let p(v) = -3v2 - 7167v + 403386. Determine p(55). 126 Let n(u) = u*2 + 1300u + 73088. Determine n(-59). -131 Let q(v) = v*3 + 46v*2 - 1621v + 787. What is q(23)? 5 Let l(r) = -3r3 + 36r*2 + 42r - 53. Give l(13). -14 Let o(z) = -34z3 - 683z*2 + 2367z + 48545. What is o(-20)? 5 Let m(c) = -1098c + 41175. Calculate m(38). -549 Let b(p) = -4934p*2 + 251640p - 312. Determine b(51). -6 Let m(w) = 2w3 - 57w*2 + 126w - 133. What is m(26)? -237 Let m(z) = 5z2 + 28z - 271. What is m(10)? 509 Let q(o) = 15923o2 + 47745o - 17. What is q(-3)? 55 Let y(c) = -3c2 - 41988c + 293939. Calculate y(7). -124 Let y(t) = -9t2 - 1215t - 9949. Determine y(-126). 257 Let p(g) = -g*3 + 110g*2 - 2579g - 4528. Determine p(37). -14 Let v(g) = 377g2 + 16989g + 1002. What is v(-45)? -78 Let m(z) = -735z - 44810. Give m(-61). 25 Let r(f) = 5336f - 485582. Calculate r(91). -6 Let d(f) = f*3 - 150f*2 + 60f - 31864. Give d(151). -3 Let j(l) = -11l2 + 9823l - 19644. Give j(2). -42 Let u(q) = -3q2 + 26q + 810. What is u(-14)? -142 Let a(c) = -c*3 + 32c*2 - 213c + 6725. Determine a(32). -91 Let g(s) = -4415s - 17624. Determine g(-4). 36 Let r(g) = -14g*2 - 321g - 172. What is r(-23)? -195 Let h(p) = 4462p + 249905. Calculate h(-56). 33 Let f(k) = 10k*2 + 85015k - 85017. Give f(1). 8 Let a(h) = -h*3 - 23h*2 - 159h - 2559. Give a(-21). -102 Let t(s) = -19276s - 597568. Determine t(-31). -12 Let z(k) = -1767k*2 + 164309k + 2044. Give z(93). -2 Let f(o) = -10189o + 71318. Give f(7). -5 Let s(q) = -q3 - 44q*2 - 194q - 613. Calculate s(-39). -652 Let s(n) = 14545n + 203639. Determine s(-14). 9 Let n(y) = -2y*2 - 304y - 10217. Give n(-50). -17 Let z(x) = -14x2 - 160x - 20. What is z(-8)? 364 Let p(h) = -6h2 + 105h - 153. Calculate p(19). -324 Let u(z) = 13855z - 734287. Give u(53). 28 Let h(m) = -2m*3 + 101m*2 - 103m - 10249. What is h(47)? 373 Let j(m) = -3m2 - 139m - 1161. Determine j(-35). 29 Let t(f) = 2f2 + 1127f + 117670. What is t(-138)? 232 Let q(z) = -1761z2 + 102134z + 240. What is q(58)? 8 Let w(c) = 4c2 - 186c + 1181. Give w(39). 11 Let r(c) = -15437c - 30866. What is r(-2)? 8 Let t(k) = -k2 - 28214k - 1183219. What is t(-42)? 5 Let l(f) = -16f3 + 241f*2 + 657f - 10072. Give l(15). 8 Let w(a) = 2a3 + 18a*2 - 193a + 355. What is w(5)? 90 Let x(i) = -2i3 - 5i*2 + 30i + 91. Calculate x(4). 3 Let b(v) = -1134v + 95333. Calculate b(84). 77 Let n(k) = 8k*3 + 111k*2 + 692k - 39. Calculate n(-6). -1923 Let l(z) = -308z - 4123. Calculate l(-17). 1113 Let p(t) = -58t - 6571. Give p(-112). -75 Let m(g) = -3g3 + 169g*2 - 2143g + 7312. What is m(40)? -8 Let p(x) = -x*3 + 2x*2 + 638x - 4608. What is p(8)? 112 Let y(j) = 7j2 - 4850j + 29131. Give y(6). 283 Let d(b) = -b*2 - 12057b + 265749. Give d(22). 11 Let k(w) = -4w2 - 597w + 1697. What is k(-152)? 25 Let w(u) = -17u3 - 2463u*2 + 260u - 372. Determine w(-145). 3978 Let o(z) = -z*3 + 19z*2 - 92z + 628. Give o(16). -76 Let m(y) = 16y2 - 3776y - 21. What is m(236)? -21 Let k(z) = 1575z - 173239. Determine k(110). 11 Let k(g) = g3 + 44g*2 + 470g + 2075. Determine k(-31). -2 Let u(a) = -17642a + 405769. Determine u(23). 3 Let a(r) = -26r*2 + 2479r - 579. Calculate a(95). 276 Let z(m) = 3m3 + 16m*2 - 1494m - 510. Determine z(-25). -35 Let u(s) = -73507s - 7644712. Determine u(-104). 16 Let d(x) = x3 - 114x*2 + 3199x - 388. What is d(64)? -452 Let k(l) = -171l2 + 10771l + 468. Determine k(63). 342 Let o(r) = 3r2 - 132r - 404. Determine o(47). 19 Let g(i) = -i*3 - 7077i - 14154. Determine g(-2). 8 Let z(f) = f*3 + 37f*2 + 231f + 4. Calculate z(-7). -143 Let c(p) = -2p3 - 37p*2 - 20p + 1605. Give c(-11). 10 Let g(p) = -p*2 - 34148p - 2351482. Give g(-69). -31 Let w(q) = q*3 + 15q*2 + 393q + 5196. Calculate w(-14). -110 Let n(m) = 445m + 71475. Determine n(-161). -170 Let c(p) = 208134p + 3538270. What is c(-17)? -8 Let c(u) = -u*3 - 30u*2 - 289u - 1276. Give c(-18). 38 Let i(v) = 2670v + 21382. Determine i(-8). 22 Let x(f) = 38069f + 1294382. Calculate x(-34). 36 Let b(h) = -565h + 34309. Calculate b(61). -156 Let y(o) = -5555o + 438853. Determine y(79). 8 Let c(q) = 9330q - 1959284. Calculate c(210). 16 Let d(q) = -285q - 5307. Determine d(-7). -3312 Let t(f) = -3f3 - 14f*2 - 9f - 144. What is t(-6)? 54 Let a(k) = -62k + 4929. Determine a(76). 217 Let q(z) = 13601z + 4746748. Calculate q(-349). -1 Let g(p) = 11642p - 151514. Determine g(13). -168 Let d(i) = -206247i - 5. Calculate d(0). -5 Let j(y) = 124y2 + 956y - 2. Give j(-5). -1682 Let x(j) = 42j + 3099. Give x(-44). 1251 Let l(a) = 153615a + 2457884. Give l(-16). 44 Let i(m) = m*3 - 427m*2 - 10m + 4899. What is i(427)? 629 Let y(n) = -670n - 12971. Determine y(-16). -2251 Let z(c) = 3c*3 + 65c*2 + 122c. What is z(-2)? -8 Let a(o) = 4228o - 21135. Give a(5). 5 Let f(v) = v3 + 19v*2 - 715v - 90. Calculate f(19). 43 Let j(n) = -3n2 - 320n + 2516. Calculate j(9). -607 Let l(u) = -21u2 + 2268u - 592. Calculate l(108). -592 Let h(t) = 15t3 + 16t*2 + 33t + 143. Determine h(-4). -693 Let b(c) = 390c + 39663. Calculate b(-100). 663 Let d(u) = -u3 + 25u*2 + 2925u - 174. What is d(68)? -106 Let a(v) = 11v2 - 433v - 156. Calculate a(39). -312 Let t(w) = 13924w - 14. Determine t(0). -14 Let k(v) = v2 - 265v + 8680. Give k(40). -320 Let a(s) = -2306s + 260573. Calculate a(113). -5 Let w(c) = 2c*2 - 1610c + 15939. What is w(10)? 39 Let m(g) = 13g2 - 2275g + 4061. Give m(173). -437 Let c(b) = -b*3 - 429b*2 + 1167b - 55248. What is c(-432)? 480 Let j(b) = -b*2 + 586b + 116805. What is j(-157)? 154 Let c(p) = -10581p + 127036. Give c(12). 64 Let k(c) = -5c*2 + 475c + 170180. What is k(-143)? 10 Let c(l) = -7402l + 161. Determine c(0). 161 Let b(d) = -257349d + 11838043. What is b(46)? -11 Let k(u) = -u*2 + 131u + 982. What is k(-9)? -278 Let r(t) = t*2 + 7891t + 3626513. What is r(-490)? 23 Let n(k) = -k*3 + 39k*2 + 181k - 2315. What is n(42)? -5 Let j(t) = -2t2 + 183t - 1497. What is j(85)? -392 Let s(h) = -2h2 - 291h - 8183. Determine s(-108). -83 Let q(d) = d*3 - 8d*2 - 80d + 652. Calculate q(6). 100 Let k(n) = 6n2 - 5847n + 23265. Give k(4). -27 Let r(j) = -615j2 - 152519j + 218. What is r(-248)? -30 Let n(h) = -h*2 - 53h + 2844. Determine n(-83). 354 Let w(g) = g*2 - 198g + 9178. Calculate w(86). -454 Let s(m) = -4420m - 8796. Calculate s(-2). 44 Let c(m) = m2 + 117m - 2799. Calculate c(-129). -1251 Let d(v) = -v*3 - 34v*2 + 1788v - 7842. What is d(25)? -17 Let r(m) = -3420m + 13212. Determine r(4). -468 Let h(s) = 1523s + 15249. Give h(-10). 19 Let n(h) = -1803h + 16791. What is n(9)? 564 Let d(q) = q3 - 664q*2 - 1227q - 69923. Give d(666). 7 Let n(b) = -b*3 - 154b*2 + 970b - 1174. What is n(-160)? -2774 Let j(v) = -5v2 - 103v - 141. Calculate j(-18). 93 Let l(r) = -4874r - 287565. Calculate l(-59). 1 Let w(d) = 32023d - 8165843. Determine w(255). 22 Let i(f) = -921f + 77385. Give i(84). 21 Let c(a) = 63a + 5631. Calculate c(-76). 843 Let j(a) = -4a2 + 1135a - 3404. Determine j(3). -35 Let n(a) = a*3 - 18a*2 + 76a + 6. Calculate n(6). 30 Let j(f) = f*3 + 232f*2 - 1005f - 14369. Determine j(-236). 27 Let r(h) = 68h3 - 30260h*2 + 88h - 39158. What is r(445)? 2 Let n(f) = 306f2 + 23869f - 189. Determine n(-78). -267 Let j(n) = 332n + 12484. What is j(-38)? -132 Let c(q) = -95q*2 + 3360q - 1245. What is c(35)? -20 Let m(d) = 7d3 + 45d*2 - 421d - 97. Give m(8). 2999 Let w(z) = -182z + 5271. What is w(29)? -7 Let u(d) = -2386d - 31082. Give u(-13). -64 Let k(a) = 286a2 - 1735a + 57. Give k(6). -57 Let i(b) = -265b2 - 271b - 270. What is i(-1)? -264 Let o(t) = 190992t - 954943. Calculate o(5). 17 Let w(t) = 38t*2 - 2689t - 633. What is w(71)? 6 Let z(a) = a*3 - 65a**2 - 20	{ "pile_set_name": "DM Mathematics" }
smallest value? (a) -11 (b) s (c) -0.3 c Let i be 2/15 - ((-3586)/30)/11. Let h = -1.8 + -0.2. Which is the smallest value? (a) i (b) h (c) 0 b Let h be (20/(-35) - 0)/2. Which is the smallest value? (a) h (b) 29 (c) 2 (d) -1 d Let i = -0.151 + -95.849. Let t = i + 95.8. What is the third biggest value in -4, t, -2/7, 0.03? -2/7 Let s(z) = -20z - 408. Let g be s(-20). Which is the smallest value? (a) 2/21 (b) g (c) 4 (d) 1/4 b Suppose -6p - 8 = -170. Let g be 8/p9/(-12). Which is the second smallest value? (a) 1 (b) 4/9 (c) g b Let p be 138/(-54)-1 - 3. What is the biggest value in -2/3, p, 3, -5? 3 Suppose -9 = -6y + 5y. Let w be ((-6)/(-18))/(2/y). What is the smallest value in w, -10, 0.5, -5? -10 Let u be ((-2)/(-4))/(9/2). Let h = -16.1 - -16. Let a = h - 0.1. What is the third biggest value in 0.1, a, u? a Let i = -2125 - -2111. What is the smallest value in 0, i, 0.16? i Let j = -19 - -15. Let y be 12/(-16)j/(-6). Let p be 12/171(-3)/2. What is the second biggest value in 1/5, p, y? p Suppose -4r - 2 = 2. Let v = r - 2. Suppose 5w + 20 = -5n - 0, -12 = 5w + 3n. Which is the second biggest value? (a) w (b) -1/3 (c) v b Suppose h + p - 3 = 2p, 0 = 3p - 3. Let l = 553 + -2767/5. Let s = -0.05 - -0.05. What is the third biggest value in h, l, s? l Let y = -12.1 - -12.222. Let k = y - 0.022. Let w = 1 - -1. What is the biggest value in k, w, 0? w Let w = 0.1345 - 0.0945. What is the smallest value in -3, 56, w? -3 Let w = 4 - 3.9. Let r = w - -3.9. Let z = 20 - 21. Which is the third biggest value? (a) z (b) -2 (c) r b Let m = -779/7 + 111. Let g be (-1223)/7 + -5 + 6. Let o = g - -174. Which is the biggest value? (a) o (b) 1/9 (c) m a Let n be 72/20 + (-4)/(-40)4. Let y = -70/51 - -12/17. Which is the third biggest value? (a) -4 (b) y (c) -0.6 (d) n b Let d = -141 + 149. What is the biggest value in d, 5/4, 1/8, 3? d Let y = -3 + 0. Let q = -23 - y. Let s = -368 + 368.2. Which is the third biggest value? (a) q (b) -0.4 (c) s a Let h be (-4048)/(-72) - (4/(-9))/(-2). Let i = 53 - h. Which is the fourth biggest value? (a) 1/3 (b) -0.1 (c) -1 (d) i d Suppose -442 + 598 = 13p. Which is the biggest value? (a) 0 (b) 0.3 (c) 1 (d) p d Let q = -136.3 - -136.4. Which is the smallest value? (a) 0.39 (b) -2/3 (c) 4 (d) q b Let p = 1 + 1. Suppose 3 = -3x + y + 5, -3y - 6 = x. Suppose -4d + 4 = 0, 4l + d - 13 = -xd. Which is the third biggest value? (a) p (b) l (c) 0 c Let c = 0.6 - 26.6. Let f = c - -25.7. What is the smallest value in 1, f, -3? -3 Let k = -0.5 - -0.3. Let v(z) = -z*3 + 20z*2 - 2z - 20. Let l be v(20). Let x be (-10)/6 + 1 + 5/l. What is the second smallest value in -0.3, k, x? -0.3 Let y be 2/694/((-8)/(-3)). Let k = 25/46 - y. Let j = -3 + 2.5. Which is the smallest value? (a) k (b) j (c) -2/17 b Let v = 2/21 - -59/42. Let o = -672/4537 + -2/349. Which is the second smallest value? (a) o (b) -2/9 (c) v a Let v = 1.51 - -0.49. Let k = 316/815 - -2/163. Which is the second smallest value? (a) -6 (b) v (c) k c Let l = -12.3 - 0.7. Let t = -16 - l. Let d = 61/165 + -2/55. Which is the biggest value? (a) t (b) -0.3 (c) d c Let a = -0.91 + 47.91. Let q = a - 45. What is the second biggest value in q, 2/7, -0.05, -3? 2/7 Let q = 5.983 + 0.017. What is the second smallest value in -3/5, 4/7, q? 4/7 Suppose -2h - 3s = 17, 4 = -3h - s - 4. Which is the biggest value? (a) -72 (b) h (c) -3/4 (d) -4 c Let m be 2/13 - (6628/156 + -5). Let t = m + 37. Which is the second biggest value? (a) 0.4 (b) -34 (c) t c Let w be (-4)/20 - 34/(-20). Let l = -3.96 - 0.04. Let s(x) = -2x - 17. Let n be s(-7). Which is the third biggest value? (a) n (b) l (c) w b Let z(x) = -x3 - 6x*2 + 4x + 40. Let m be z(-5). Which is the fourth smallest value? (a) 4 (b) 2 (c) m (d) -4 a Let f = 11.4 + -11. Let q = 0 + 0. Let x = 3 - 6. Which is the second biggest value? (a) f (b) q (c) x b Let u = 1321 - 2717/2. Let x = u - -36. What is the second smallest value in x, -0.3, -1/2? -1/2 Let t = -729 + 2188/3. What is the smallest value in -3/5, 368, 3/2, t? -3/5 Let l = -0.032 + 5.332. Let y = -5.7 + l. Let h = -0.03 + 0.33. What is the second biggest value in h, 5, y? h Let m = 125 - 128. Let s = 3.2 + m. What is the smallest value in -0.16, -2/13, s? -0.16 Let i = 338 + -361. Let n = 12 - -6. Let z = i + n. Which is the third biggest value? (a) z (b) 0.1 (c) -1/2 a Let c be (-2)/4(-4)/(-11). What is the smallest value in -23, c, 0.1, -5? -23 Let s = 588 - 592.49. Let h = 0.19 + s. Let t = -4 - h. Which is the biggest value? (a) 3/5 (b) t (c) 0.5 a Suppose 0 = 2o + 4f + 14, 2o - 4f - 17 = 1. Let n = 530 - 530. Which is the third biggest value? (a) o (b) 6 (c) n c Let i = -7/11222 - 396085/3680816. Let o = 24251/45264 + i. Let z = 6/23 - o. Which is the second smallest value? (a) z (b) -4 (c) 0.4 a Let t(w) = -w2 + 2w + 88. Let q be t(-9). What is the third biggest value in 0, 10, q, -3? -3 Let h = -1112 + 2225/2. Let j = 2 + -2.4. Let s = j - -0.7. What is the smallest value in h, s, -2? -2 Let v = -0.01 - -0.05. Let t = v - 0.07. Let o = 21 - 22. Which is the third biggest value? (a) t (b) o (c) 2 b Let i = 0.3 + 0.1. Suppose -2h - 12q + 11q = 4, -4q + 32 = -4h. What is the fourth biggest value in 3, 0.5, i, h? h Let w = 29 - 3. Let l = w - 29. Which is the biggest value? (a) -1 (b) l (c) 0.2 c Let v = 152 + -152.3. Which is the third smallest value? (a) 4 (b) v (c) -1/3 (d) 1/10 d Let u = -98 + 103. Let g = -0.9 - -3.9. Which is the third smallest value? (a) g (b) -2 (c) u c Let y = 678 + -714.7. Let t = -37 - y. What is the second smallest value in -1, 4, t? t Let w = -180 + 188.9. Let x = 5.9 - w. What is the second smallest value in 0.2, 1, x? 0.2 Let y = -2638 - -2637. Let w = 1 + -6. Which is the fourth biggest value? (a) -1/3 (b) w (c) y (d) -3 b Let d be 207/2900 + (312/300)/(-13). Which is the third biggest value? (a) d (b) -0.2 (c) 1/4 b Let o = -1662 - -41552/25. Which is the third biggest value? (a) o (b) -24 (c) 2/9 b Suppose 6z - 32 = 70. Let j = 0.03 - 0.43. Which is the third smallest value? (a) z (b) -0.2 (c) j a Let z = -5.2 - -4. Let n = 0.9 + z. Let r = 2.8 + -2.4. Which is the second smallest value? (a) r (b) -4 (c) n c Let x = -3.4 - -3. Let p = 1719/2 + -29397/26. Let k = p - -271. Which is the second biggest value? (a) k (b) x (c) -1 b Let a = -250156/153 + 1635. Let n = a + 317/1683. What is the biggest value in n, 1, -6? 1 Let z = 589/3 + -196. Which is the biggest value? (a) z (b) -2 (c) 0.3 (d) -2/23 a Let y = -6.84 + 2.81. Let j = 21 + -21.03. Let l = j - y. Which is the second smallest value? (a) l (b) -5 (c) -2 c Suppose 6 = -4f + 30. Suppose 0 = 2j + j + f. Let n be 1 + j - 25/(-20). Which is the second biggest value? (a) n (b) 1 (c) -5 a Let g = -1.27 + 4.27. What is the second biggest value in -0.01, -0.1, g? -0.01 Let f = -267 + 387. Let r = f + -120.03. Let p = 1 + 0. What is the second smallest value in -1/5, p, r? r Let i = 31 + -47. Let n = i + 20. What is the biggest value in 2/5, -0.2, n? n Let f = -0.072 + 0.272. Let p = 13 - 13.1. Let w = -0.8 + 0.4. What is the second biggest value in p, w, f? p Let q = 367/168 + -38/21. Let f be 1/(-84)(-1405)/(-60). Let d = 1/144 - f. Which is the second biggest value? (a) d (b) q (c) 0 a Let n = 3308.2 + -3308. Let t = 0.1 - -0.4. What is the smallest value in n, -1, t, 3/2? -1 Let o = 641/3 - 214. What is the third smallest value in o, -2/9, -5, -0.2? -2/9 Let l be (-97 + 96)/((-1)/(-9)). Let y = -1 + 0.9. What is the biggest value in y, l, -3? y Let i be (-60)/453/5. What is the biggest value in 0.2, i, -1? 0.2 Let v = 9.03 - -1.97. What is the third biggest value in 4/5, v, -4, -1? -1 Let r = 1507/14 + -215/2. Which is the second smallest value? (a) r (b) 4 (c) 3/8 (d) -2/3 a Let l = 101.3 + -112. Let o = 2.3 - l. Which is the second biggest value? (a) -0.1 (b) 5 (c) o b Suppose -2d - 4 + 0 = -i, -20 = -2i - 2d. Let z be i/18 + (-1)/3. What is the fourth biggest value in 4, 1, 2/9, z? z Let v = -31.1 + 31.2. Let j be (-10)/18(-4)/(-5). What is the second smallest value in j, v, -1? j Suppose -5	{ "pile_set_name": "DM Mathematics" }
-3. Solve ml + l + 3 = 0 for l. -3 Suppose 6 = -5q - 2b, b + 3 = 420q - 423q. Let u = -4 + 8. Suppose -3i = -0i. Solve -2t + it - u = q for t. -2 Let v(l) = l2 - 7l - 10. Let t be v(9). Suppose -17 = -tc + 7. Solve 0 = -5n + 8 - c for n. 1 Let m(f) = -2 + 11f + 6 - 13f. Let c be m(1). Solve 0 = -3y + y + c for y. 1 Let y be -7-3(-2)/(-21). Solve -y = -10x + 12x for x. -1 Let n(f) = -f2 + 13f - 8. Let a be n(12). Solve -o - 3o - a = 0 for o. -1 Let w(t) be the second derivative of t4/12 - 5t*3/3 - 11t*2/2 - 2t. Let d = 74 + -63. Let l be w(d). Solve lz + 2z = 2 for z. 1 Let y be ((-80)/24)/(2/9). Let n(o) = o*3 + 14o*2 - 15o + 15. Let b be n(y). Solve a - 4a = b for a. -5 Let r = 45 - 36. Suppose -5d = -2d - r. Solve 2 = -5f - d for f. -1 Suppose h - 52 = -15. Suppose 8s = -13 + h. Solve sc + 15 = 3 for c. -4 Suppose v = 4v - 6. Let m be (275/10)/(-5)(-1 - 1). Let f be 68/m + -44/88. Solve -fj = -vj for j. 0 Let b be 35/(-10)(0 - -2). Let q(k) = -k - 1. Let r be q(b). Solve -r = -4a + 14 for a. 5 Suppose -4k + 46g + 4 = 48g, g = 3k + 2. Solve 2l + 6 - 4 = k for l. -1 Suppose 2t - 11 = -5x, 3t - x = -6x + 14. Let i = t + -1. Suppose -a - ia = 0. Solve a = 5f - 2 - 8 for f. 2 Let b be 0/(-7 - (-10)/2). Solve 3g + bg = -12 for g. -4 Let q(i) = i*2 - 16i - 36. Let u be q(18). Solve u = -5g - 7 + 17 for g. 2 Let t(a) = 49a*3 + 5a*2 - a - 4. Let g be t(1). Solve -9b + g - 13 = 0 for b. 4 Let q = -5 + 15. Let k = 12 - q. Suppose -4m + m = -9. Solve kx + m = 1 for x. -1 Let g be (2 + (-60)/5)-1. Let p be ((-4)/(-14))/(g/70). Solve 0 = -3l - pl - 10 for l. -2 Suppose 34 = 5h - 16. Suppose -3l - h = -8l. Solve -lf = 2f - 16 for f. 4 Suppose 5n = -n. Let f be 168/30 - (-4)/10. Solve -2w + f = -nw for w. 3 Let m(y) = -y2 + 18y - 52. Let u be m(4). Solve uj = -3 - 1 for j. -1 Let y(s) = -16s - 150. Let l be y(-13). Solve 0 = 59x - lx + 4 for x. -4 Let w(m) = -2m - 7. Let r be w(-5). Suppose o + 8 = -3x + ro, x + 4o - 16 = 0. Suppose -5v - 13 - 7 = -h, 20 = -4h - 5v. Solve -d - 2 + h = x for d. -2 Suppose -4o - 2 + 6 = 0. Let d be o - (-121 - 3)/4. Solve -12 + d = -5j for j. -4 Let h be 18/(-6) + (4 - 2) - -17. Let f be h/((3 - 2)1). Solve 3c = -c - f for c. -4 Let f be (32/6)/(36/54) + 4. Solve f = d + 11 for d. 1 Let p be -1((-4)/(-28) + 116/(-28)). Solve pw - 1 = 3w for w. 1 Let w = 57 + -50. Let q = 6 + -9. Let t = w - q. Solve -4x - t - 6 = 0 for x. -4 Suppose 15q - 6 = 12q. Suppose -5p - qu + 18 = 0, 9 = -2p + 5u - 7. Solve -pz = 3z - 15 for z. 3 Let y(l) = l3 - 4l*2 + 6l + 3. Let x be y(3). Solve -x - 20 = -8z for z. 4 Let l = -935 + 987. Solve lm - 53m = 2 for m. -2 Suppose 0 = 14k - 7k. Suppose -q - 4q = -15. Let f = 1 + q. Solve w + 0 + f = k for w. -4 Let u(p) = 2p - 60. Let m be u(32). Solve 0 = 4y - m - 4 for y. 2 Let w = 13 + -7. Suppose -2d + 0d + w = 0. Let h be (-4 + 1)/(-1d). Solve -2f - h = -f for f. -1 Let s = -26 + 27. Suppose -5z + w = 12, -3z = w + 5 - s. Let r be 3/(-6)(0 + z). Solve 4l - 5 = -r for l. 1 Let u(y) be the first derivative of y4/4 - y3 - y*2/2 - 3y - 7. Let p be u(4). Solve 1 = -2c - p for c. -5 Suppose -4x = -4b + 40, -43x + 2 = b - 42x. Solve bp - 52 = -7p for p. 4 Let q = -47 + 50. Suppose qt = 7t - 20. Solve -t = w - 0 for w. -5 Let g be 5 + (1 + -1)/1. Suppose -gv = 4m - 37, -2v + 11 = 3m - 15. Solve 3c + m = -c for c. -2 Let b(j) = -6j - 84. Let w be b(-15). Solve 4c = wc + 10 for c. -5 Let h = -329 - -331. Suppose 5u = u + 16. Solve u = hb - b for b. 4 Suppose 17g = -a + 15g + 16, 5a = g + 25. Solve 0 = -ax + 6 for x. 1 Suppose 84 = -514d + 521d. Solve d = 10i - 6i for i. 3 Suppose 0 = -13i + 6i + 7. Let o = -3 - -6. Solve -i = 2c - o for c. 1 Suppose -4c = 2j, 5j - 8 = -c + 1. Solve 3a - 11 = -j for a. 3 Let n be 1 - 1 - (4 - (0 + 1)). Let u(m) = m*2 + 6m + 11. Let i be u(n). Solve -3a - 5 + i = 0 for a. -1 Let l(i) = -i3 - 5i*2 - i - 2. Let o be l(-5). Let h(c) = 5c - 19. Let p be ((-69)/15)/(-1) - 6/(-15). Let t be h(p). Solve -6 = ov - tv for v. 2 Let b be 62/10 - ((-6)/15)/(-2). Solve 8a = -ba - 42 for a. -3 Let c(b) = -b*3 + 6b*2 + 10b - 42. Let h be c(4). Solve -h = 10k + 20 for k. -5 Let f = 0 + 3. Let p = -512 + 524. Solve -p = fy - 0y for y. -4 Suppose -162 = -10u + u. Suppose -z + 10z = u. Solve zl = 7l + 10 for l. -2 Let q = 1192 - 1183. Solve 7y + 5 + q = 0 for y. -2 Let w = -432 - -437. Solve -wh - 2 - 23 = 0 for h. -5 Let u be ((-8)/(-7))/((-122)/(-427)). Solve -2x - 2x - u = 0 for x. -1 Suppose 3z + 0h + 2h - 7 = 0, -14 = -4z + 2h. Solve -z + 9 = 3j for j. 2 Let k be (-3)/((-2)/7 - (-37)/56). Let j(c) = c2 + 9c + 9. Let m be j(k). Solve m = 2s + 9 for s. -4 Let z = -159 + 408. Solve 247c - 6 = zc for c. -3 Suppose 5z - 24 = 21. Let d be 5/1(16 - 15). Solve -da + 2a = -z for a. 3 Let t be ((-1022)/(-38) - 1) + 56/532. Solve 5a - 1 = -t for a. -5 Let f = -12 - -19. Let g(q) = 4q - 7. Let t be g(2). Solve 2p = f - t for p. 3 Let v = -9 - -17. Let f(p) = 0p - 3 + 2p + 2p2 + vp + 9. Let b be f(-6). Solve 2 + b = -5i for i. -4 Let i be (4 - 3) + -1 - 24. Let u = i - -28. Solve u = o - 1 for o. 5 Let n(h) = -16h - 12. Let q be n(-1). Solve 0 = i + qi - 15 for i. 3 Let d = 18 + 1. Let w = d - 14. Solve -2 = -wn - 7 for n. -1 Let k(v) = -5v2 - 76v - 5. Let s be k(-15). Solve 3b = 5 + s for b. 5 Let j be (-217)/(-77) - 2/(-11). Let l be 0(j + 40/(-15)). Solve o + l = -3 for o. -3 Suppose -318 = 6u + 450. Let t be 12/42 - u/(-7). Let s = -17 - t. Solve -q - s = -5 for q. 4 Let z = 8 - -1. Solve -5t + zt + 16 = 0 for t. -4 Let t = 41 + -44. Suppose -4i - 17 - 7 = 4p, i - p = 0. Let j = t - i. Solve 5x - x - 16 = j for x. 4 Let m = 10 + -8. Suppose ms - 6 + 0 = 0. Suppose s = 2q - 3n, -3n + n + 14 = 4q. Solve q = -5t + 2t for t. -1 Let j be 8/16 + 9/(-2). Let a be j/(-14) - 76/(-28). Solve 22 = 5r - a for r. 5 Let j(u) = -u*3 + 7u*2 + 13u - 109. Let z be j(6). Solve 5k + 40 = -zk for k. -4 Suppose -10x = -212 + 82. Solve 10a + 9 = xa for a. 3 Let u = -1347 + 1354. Solve -11 = 4y - u for y. -1 Let o(f) = f*2 + f + 1. Let d be o(-4). Suppose 4v - 19v + 60 = 0. Suppose 7h - 5h - x = 1, vh + 3x = -3. Solve h = -3m - 4 + d for m. 3 Let k be 1/((-6)/(-162)1/(-1)). Let r = 29 + k. Solve 14 = rc + 4 for c. 5 Let i(n) = 5n2 - 11n + 11. Let k(v) = 14v2 - 32v + 34. Let a(r) = -17i(r) + 6k(r). Let g be a(-7). Solve -5y + 2 + g = 0 for y. 1 Let g(f) = -f3 - 7f*2 - 8f - 53. Let u be g(-7). Solve 2o - u = o for o. 3 Let b = -320 + 330. Solve -b = 4i - 26 for i. 4 Suppose -7u + 60 = -3u. Let i = u - 13. Solve -i = 4c - 3c for c. -2 Suppose 5i - 56 = -3o, -15i + 64 = 5o - 14i. Suppose -g - 7 = 3n, -5n = -2g + 13 + 6. Solve -gx = x + o for x. -4 Let o = 1 - -3. Suppose 0 = l - 6l - 5d - 20, -o = 2d. Let f be 8 + 4/(l/(-1)). Solve n = 3n - f for n. 5 Suppose 3 + 3 = -2z, 0 = d + 2z - 8. Solve -da = -63 + 21 for a. 3 Suppose 610 - 2110 = 5c. Let q = 500 + c. Let y be (6/10)/(8/q). Solve k + y = -2k for k. -5 Let q(m) = m - 7. Let u be q(9). Let t be u/4 - 60/(-24). Suppose -2r - tb = b - 8, b = 5r - 64. Solve -4j = -j - r for j. 4 Let z = 27 + -20. Let p(s) = 1 - 14s + 9s - 2 + 0. Let v be p(-2). Solve -4n - z = v for n. -4 Suppose 2q = -i + 8, 3 - 11 = -i - 3q. Let y be (9 + -6)/(1 + (-16)/28). Solve 0 = 3m - y - i for m. 5 Let l be (-1)/(-7)0 - -18. Solve 12p - 78 = -l for p. 5 Suppose 54 = -9v + 6v. Let a(g) = -g*3 - 17g*2 + 19g + 24. Let d be a(v). Solve y - 3y = d for y. -3 Let i(a) = 3a. Let x be i(-1). Let p(d) = -d*2 - 3d. Let v be p(x). Suppose 10j - 5j = 60. Solve v = 3u + j for u. -4 Let k be (25/(600/16))/((-2)/(-18)). Solve -110 = -km - 128 for m. -3 Let k be (-1)/((-1)/2) + 1. Suppose -2p - 3d = 3, 3p - 3d + d - 15 = 0. Solve p = kc - 0c for c. 1 Suppose 2h - 2 = -4f, 19f = 22f + 2h - 2. Solve 0 = -n + 4 - f for n. 4 Suppose -3u + r = -17, -u - 2r + 43 = 4u. Suppose -5 = -4j + u. Suppose k - 16 = -4p, -p + 0p + 3k = -4. Solve -jy - p = -y for y. -2 Suppose 4l	{ "pile_set_name": "DM Mathematics" }
1365o for o. -14 Solve -372a - 23758 = -25990 for a. 6 Solve 704736z - 704869z - 8778 = 0 for z. -66 Solve -2426u = 3306u + 2687u + 976604 for u. -116 Solve 322 = 590r + 600r - 1204r for r. -23 Solve 2557u = -5017 - 1377 - 44746 for u. -20 Solve 250u + 66u + 397u = 42780 for u. 60 Solve -11c = -291c + 3710 - 2391 + 3441 for c. 17 Solve 16632 = 272f + 232f for f. 33 Solve -76456 + 76323 = 7k for k. -19 Solve 553o - 2945 = 978o + 1730 for o. -11 Solve 1855p + 34117 = -964p - 646p + 207367 for p. 50 Solve 0 = 219y + 277y + 14384 for y. -29 Solve 112f + 381 - 4973 = 0 for f. 41 Solve -135o - 353o - 98o = -30472 for o. 52 Solve -133x - 712 - 3017 + 686 = 3341 for x. -48 Solve 0 = 2091u - 840u + 12510 for u. -10 Solve 7493 = 885t - 107074 - 4908 for t. 135 Solve 10577p - 10512p = -1820 for p. -28 Solve 57z + 12090 = -253z for z. -39 Solve -39u - 2394411 = -2395191 for u. 20 Solve 16618t + 16667t = 33318t + 1386 for t. -42 Solve 280l - 393l - 2686 - 2286 = 0 for l. -44 Solve 0 = -3659d + 3294d + 22630 for d. 62 Solve 916f = 3657 + 37563 for f. 45 Solve 3145 + 326 = -230d - 3429 for d. -30 Solve -1781q + 3659q + 1338 = 1738q + 4558 for q. 23 Solve -455657k - 60 = -455652k for k. -12 Solve 0 = -317d - 15176228 + 15219340 for d. 136 Solve -3522 = 174u - 1084 + 7480 for u. -57 Solve 3270c + 90630 = 214890 for c. 38 Solve 132x - 49500 = -63492 for x. -106 Solve 13315 + 17296 = -849r - 6373 - 42822 for r. -94 Solve 9305a = 9378a - 4964 for a. 68 Solve -82z + 125z - 13833 = -52z - 166z for z. 53 Solve 358n = 512n + 462 for n. -3 Solve -263292 - 1277689 = 13637s for s. -113 Solve 1074 = -119w + 68w - 4791 for w. -115 Solve -134a - 31a + 4860 = -57a for a. 45 Solve -629v = -810v + 6335 for v. 35 Solve -775g - 132g = -77095 for g. 85 Solve -18120 + 116400 = -871r + 2383r for r. 65 Solve 3560 + 3660 = 480h - 290h for h. 38 Solve -13625 + 3487 = 1052k + 5642 for k. -15 Solve 351r = 4663 + 1384 - 1063 + 4142 for r. 26 Solve -13309m + 13207m + 1122 = 0 for m. 11 Solve -12173 - 59558 = -2066t + 37767 for t. 53 Solve -117f - 1540 - 601 - 836 - 1469 = 0 for f. -38 Solve -331k - 326k - 82k = 223k + 66378 for k. -69 Solve -303860 + 267184 = -692i for i. 53 Solve 395062 - 61437 = 12407z + 938z for z. 25 Solve -1061y + 18517 = 1746y - 46044 for y. 23 Solve 161917f - 161687f + 6670 = 0 for f. -29 Solve 2516809 = -3r + 2516773 for r. -12 Solve 1060y + 55y + 11998 = -158y - 5824 for y. -14 Solve -1072h + 1095 = -2494h - 1749 for h. -2 Solve 746815 = 1250g + 889315 for g. -114 Solve 297960u - 297717u + 3402 = 0 for u. -14 Solve -1378c + 1176c = -14424 - 5574 for c. 99 Solve 227l + 31l = -17l - 9350 for l. -34 Solve -117m - 2837374 + 2827780 = 0 for m. -82 Solve 0 = 86q + 563 - 3274 - 986 - 259 for q. 46 Solve -1425h = 2708h + 90926 for h. -22 Solve -2382n = 388982 - 148400 for n. -101 Solve 0 = -5021g + 4319g + 37206 for g. 53 Solve -302b - 10448 - 1934 = 0 for b. -41 Solve 116f - 16645 = -45269 + 17256 for f. -98 Solve -584403 = -22566b + 15525b for b. 83 Solve 0 = -77o + 46496 - 49961 for o. -45 Solve -6873372p - 420 = -6873330p for p. -10 Solve 23o = -232 - 291 - 374 for o. -39 Solve -27910f - 3262579 - 2891 = 0 for f. -117 Solve 4609p + 9900 = 4909p for p. 33 Solve 524s - 3168 + 1843 = -204 + 3071 for s. 8 Solve -7142 - 3047 - 5855 = -507j - 66j for j. 28 Solve 531150y - 531241y + 2548 = 0 for y. 28 Solve 2q + 2549 - 16931 = -196q - 108q for q. 47 Solve -819b - 187 = -805b + 93 for b. -20 Solve -32j + 81 + 101 = 353 + 405 for j. -18 Solve 1217 - 237 = 387b - 208b - 207b for b. -35 Solve -77m + 3381 - 392 = -3213 + 1274 for m. 64 Solve 794d + 7692 = 747d + 5436 for d. -48 Solve 99n + 378 + 247 = 922 for n. 3 Solve -2272 + 420 = -135m + 585 + 398 for m. 21 Solve 90 = 258461c - 258452c for c. 10 Solve 10131t - 569 = 10942t - 6255 - 93256 for t. 122 Solve -15728z - 835251 = 249981 for z. -69 Solve -141624u = -142942u + 25042 for u. 19 Solve 5569 + 13414 = -750f - 17017 for f. -48 Solve -8n - 8n - 39n = 9n + 1408 for n. -22 Solve 0 = -131i - 16864 + 20008 for i. 24 Solve 42c - 40c = -25c - 44c - 2201 for c. -31 Solve 1172v + 19216 = -8912 for v. -24 Solve 0 = 208i + 11062 - 20006 for i. 43 Solve -74j - 2402 + 1786 - 2862 = 0 for j. -47 Solve 0 = -303h + 169h + 1711 + 497 + 472 for h. 20 Solve -232i - 13187 - 10300 = 256i - 8847 for i. -30 Solve -151w - 189345 + 194479 = 0 for w. 34 Solve 200u = 168u + 947u + 30195 for u. -33 Solve -4b - 140918 = -140662 for b. -64 Solve 0 = 458b - 678b + 7260 for b. 33 Solve -328f = -659f + 754f + 8460 for f. -20 Solve -5423 + 2939 + 4521 = 97z for z. 21 Solve 944b + 17364 - 37912 - 20988 = 0 for b. 44 Solve 394 = 105s - 461 - 90 for s. 9 Solve 45317 - 139198 = 2135v - 545v + 30139 for v. -78 Solve 2385n + 2535n = 1589n + 84910 + 21682 for n. 32 Solve 1839 = -264798x + 264757x - 580 for x. -59 Solve -153i = -183i + 330 for i. 11 Solve 201018 = 64f + 199354 for f. 26 Solve -106 = -7x - 21 - 323 for x. -34 Solve 541s - 4886 = 12955 + 4340 for s. 41 Solve -238g = 68g - 64g + 64g + 9180 for g. -30 Solve 663p + 57708 = -1758p - 15894 + 972 for p. -30 Solve 1134 = -17379n + 17460n for n. 14 Solve -90n = -260n - 5045 + 1886 - 5341 for n. -50 Solve -35s + 92s = -1011s - 426s - 119520 for s. -80 Solve 98y - 3401 = -8497 for y. -52 Solve -1380 - 817 = -4h - 1713 for h. 121 Solve -2450833x + 5220 = -2450743x for x. 58 Solve 6158 = -993l - 7300 + 2535 for l. -11 Solve -3919u + 151326 - 37675 = 0 for u. 29 Solve -344s - 6372 - 4912 = 2820 for s. -41 Solve 27a - 351284 + 352877 = 0 for a. -59 Solve 169j - 1523 - 132 = 1048 - 337 for j. 14 Solve 142y + 50y - 19680 = -218y for y. 48 Solve -552r + 428 = -124 for r. 1 Solve 24788t - 3354 = 24702t for t. 39 Solve 7769v - 11284 = 8133v for v. -31 Solve -1412 - 1646 - 1296 = 2177y for y. -2 Solve 0 = -33x - 197 - 955 - 169 + 265 for x. -32 Solve -775l - 15933 = -284l - 16497 - 23495 for l. 49 Solve 1346 = -99459x - 99496x + 198888x - 865 for x. -33 Solve -550j = 566j - 1091j + 825 for j. -33 Solve 0 = 1786301k - 1786683k + 17190 for k. 45 Solve -874 = -277m - 2844 - 4020 + 450 for m. -20 Solve 1302784 - 1297376 = -416g for g. -13 Solve 33c - 45c = -72c + 180 for c. 3 Solve 21i + 344 = 92 for i. -12 Solve 188879o = 188934o - 1815 for o. 33 Solve 824c - 1762c + 1445 = -853c for c. 17 Solve -2926 + 2686 = 186u + 4224 for u. -24 Solve 816034o - 217470 = 819329o for o. -66 Solve 1779z - 35612 - 29241 - 28370 = 466z for z. 71 Solve -62y + 1283 = 1105 + 1363 + 1915 for y. -50 Solve -29r - 49r + 158r - 960 = 0 for r. 12 Solve 0 = -49b - 21371 + 23723 for b. 48 Solve -1867 - 14679 + 3818 = -534h + 12370 for h. 47 Solve -3377d - 25080 = -1556d - 1536d for d. -88 Solve 27946s = 28042s - 384 for s. 4 Solve 67x - 335 = 7x - 1715 for x. -23 Solve -15275 = -109n - 12114 for n. 29 Solve -59 = 4v - 115 - 76 - 20 for v. 38 Solve -12c + 32c - 1767 = -2247 for c. -24 Solve -1155 = 126g - 40g - 31g for g. -21 Solve 210 + 57 + 176 = 8x + 83 for x. 45 Solve -3283 - 2857 = 549u - 242u for u. -20 Solve 419h = -282h + 25937 for h. 37 Solve 2569w - 2903w + 44340 - 5262 = 0 for w. 117 Solve 126140629j - 25272 = 126140953j for j. -78 Solve 56275 = -635j + 77865 for j. 34 Solve 113y + 552y - 13708 = 367y for y. 46 Solve -422u = -99u - 1615 for u. 5 Solve -917m - 80152 = 947m for m. -43 Solve 727363r = 727465r - 10302 for r. 101 Solve 9143p + 3082p - 348595 = 937441 + 401014 for p. 138 Solve 30o - 538o = 896o + 18252 for o. -13 Solve -7936s - 502675 = 100461 for s. -76 Solve -12324h = -12350h + 2184 for h. 84 Solve 1051n - 6 + 13 - 7 = 0 for n. 0 Solve 643n + 610 = -5820 for n. -10 Solve 6510832t - 2793 - 36 = 6510791t for t. 69 Solve -15767q = -16769q - 50100 for q. -50 Solve -5285g + 173929 = -11046 for g. 35 Solve -145h + 2082 - 10804 = 8823 + 290 for h. -123 Solve -5738 = 106t - 190t - 110 for t. 67 Solve 621w + 644w - 418w = 21175 for w. 25 Solve 99545s - 49759s + 2695 = 49751s for s. -77 Solve 54m - 1041 + 459 = 1571 +	{ "pile_set_name": "DM Mathematics" }
1/153 Three letters picked without replacement from jmbjbmbmmbmyymyqb. Give prob of sequence qjy. 1/680 Calculate prob of sequence qp when two letters picked without replacement from {w: 2, u: 5, q: 11, p: 2}. 11/190 Two letters picked without replacement from {y: 1, v: 2, k: 2}. What is prob of sequence kk? 1/10 Calculate prob of sequence iib when three letters picked without replacement from iililiiibiiiii. 55/1092 Calculate prob of sequence sfsn when four letters picked without replacement from nsnsrnnnnfnr. 7/5940 Three letters picked without replacement from eatpaeteaaadeetae. What is prob of sequence dpt? 1/1360 Two letters picked without replacement from {y: 1, n: 1, w: 1, v: 1, q: 1}. Give prob of sequence vy. 1/20 Three letters picked without replacement from {e: 2, g: 1, d: 3, q: 4, y: 1, n: 7}. What is prob of sequence neq? 7/612 What is prob of sequence pz when two letters picked without replacement from aatpapzaap? 1/30 What is prob of sequence wwww when four letters picked without replacement from wwwwwwwww? 1 Two letters picked without replacement from {m: 1, r: 2, l: 1}. Give prob of sequence rr. 1/6 Calculate prob of sequence knrk when four letters picked without replacement from ekgkrin. 1/420 Calculate prob of sequence wubb when four letters picked without replacement from {w: 7, b: 4, e: 2, h: 1, u: 1}. 1/390 Three letters picked without replacement from ggzgzgggggggzggg. Give prob of sequence zzg. 13/560 Four letters picked without replacement from {c: 9, k: 11}. What is prob of sequence ckkc? 22/323 Two letters picked without replacement from {m: 14, j: 4}. What is prob of sequence jj? 2/51 Three letters picked without replacement from {e: 6, w: 4, v: 1, f: 2, p: 2}. What is prob of sequence vfe? 2/455 Two letters picked without replacement from {s: 4, a: 5, d: 1}. Give prob of sequence ad. 1/18 Two letters picked without replacement from mllmztxzxmdxxlzml. What is prob of sequence ll? 3/68 What is prob of sequence zi when two letters picked without replacement from {h: 1, i: 4, z: 3}? 3/14 Calculate prob of sequence dddd when four letters picked without replacement from {d: 9}. 1 Two letters picked without replacement from {y: 4, i: 1, d: 1, m: 2, v: 3, e: 7}. What is prob of sequence em? 7/153 Calculate prob of sequence zub when three letters picked without replacement from gozgabuagzz. 1/330 Calculate prob of sequence zszz when four letters picked without replacement from {s: 2, z: 5}. 1/7 Four letters picked without replacement from fgrrrrfvrrkfkr. Give prob of sequence kffv. 1/2002 Two letters picked without replacement from {s: 1, q: 1, d: 1, x: 2, o: 1, e: 1}. What is prob of sequence de? 1/42 Three letters picked without replacement from yyfoyzffyfuofjyoo. Give prob of sequence ffz. 1/204 Three letters picked without replacement from llllllllll. Give prob of sequence lll. 1 Four letters picked without replacement from {s: 2, m: 2, f: 1, i: 4}. Give prob of sequence issf. 1/378 Three letters picked without replacement from fhqotxx. What is prob of sequence tox? 1/105 Two letters picked without replacement from tmctctcmgmtmttggg. What is prob of sequence cc? 3/136 What is prob of sequence ssg when three letters picked without replacement from fvsgfsqsfffssf? 5/546 Calculate prob of sequence jxx when three letters picked without replacement from qjrqljxjjxxj. 1/44 Two letters picked without replacement from {n: 2, m: 3, b: 1, z: 2, h: 1, p: 3}. Give prob of sequence ph. 1/44 What is prob of sequence xtxm when four letters picked without replacement from txxcm? 1/60 What is prob of sequence gpgp when four letters picked without replacement from {g: 9, p: 11}? 22/323 Three letters picked without replacement from {g: 3, o: 4}. What is prob of sequence goo? 6/35 What is prob of sequence yoy when three letters picked without replacement from yoommommtmmydomm? 1/420 Two letters picked without replacement from tchtthcth. Give prob of sequence cc. 1/36 What is prob of sequence lzz when three letters picked without replacement from {z: 2, l: 9}? 1/55 Two letters picked without replacement from {h: 5, z: 7, w: 8}. Give prob of sequence zh. 7/76 Four letters picked without replacement from {q: 2, p: 1, d: 2}. What is prob of sequence qqpd? 1/30 Four letters picked without replacement from sxqsosxsqzq. What is prob of sequence oqzq? 1/1320 Three letters picked without replacement from jjysmyyijymisijmytjm. What is prob of sequence imm? 1/190 What is prob of sequence zkv when three letters picked without replacement from zzvzvzkezekzvkzkz? 2/85 Four letters picked without replacement from {w: 3, f: 10, o: 2, t: 1, u: 1}. Give prob of sequence tfoo. 1/2856 Two letters picked without replacement from {v: 6, q: 2}. Give prob of sequence vq. 3/14 Calculate prob of sequence llli when four letters picked without replacement from ccilliicllclllli. 2/65 Calculate prob of sequence pfa when three letters picked without replacement from afzrazpaaa. 1/144 Calculate prob of sequence uj when two letters picked without replacement from uuuujhuujhujjj. 5/26 Three letters picked without replacement from {v: 3, y: 3, a: 1}. Give prob of sequence vvv. 1/35 Calculate prob of sequence tdt when three letters picked without replacement from {y: 2, b: 11, v: 1, d: 3, t: 2}. 1/969 Calculate prob of sequence uo when two letters picked without replacement from qufqoqgq. 1/56 Three letters picked without replacement from ttttumtotttttoom. Give prob of sequence oom. 1/280 Four letters picked without replacement from {f: 1, b: 1, c: 1, l: 2, p: 2}. What is prob of sequence plfc? 1/210 Three letters picked without replacement from lccclclcclycclcllcl. What is prob of sequence lcc? 40/323 Four letters picked without replacement from pljlljl. Give prob of sequence jljl. 1/35 What is prob of sequence tt when two letters picked without replacement from {o: 3, t: 4, d: 3, p: 3, m: 6}? 2/57 What is prob of sequence zvvv when four letters picked without replacement from {v: 11, o: 3, z: 1}? 11/364 Two letters picked without replacement from {w: 1, d: 1, u: 2, p: 2, v: 6}. Give prob of sequence wp. 1/66 Three letters picked without replacement from eeeeeeeeee. What is prob of sequence eee? 1 What is prob of sequence ne when two letters picked without replacement from ebkeenekebknken? 3/35 Three letters picked without replacement from ssqyyyz. Give prob of sequence yzs. 1/35 Two letters picked without replacement from {y: 6, i: 3, g: 3, w: 3}. Give prob of sequence gg. 1/35 Three letters picked without replacement from iiiiiiiiiliillii. What is prob of sequence lli? 13/560 What is prob of sequence iii when three letters picked without replacement from {s: 4, g: 1, h: 2, i: 6}? 10/143 What is prob of sequence dsd when three letters picked without replacement from {d: 13, s: 5}? 65/408 What is prob of sequence mh when two letters picked without replacement from {x: 5, h: 1, m: 1, b: 5}? 1/132 Four letters picked without replacement from {a: 5, x: 5, v: 8}. What is prob of sequence xxxx? 1/612 What is prob of sequence jd when two letters picked without replacement from {d: 2, j: 2, v: 4}? 1/14 Four letters picked without replacement from kgmgmgkm. Give prob of sequence kkgm. 3/280 What is prob of sequence uk when two letters picked without replacement from jkkjkjjkjkkzjjujkjju? 7/190 Three letters picked without replacement from epppepppeepap. Give prob of sequence eae. 1/143 What is prob of sequence gg when two letters picked without replacement from {l: 11, g: 8, h: 1}? 14/95 Two letters picked without replacement from {y: 1, q: 3}. What is prob of sequence qq? 1/2 Calculate prob of sequence arr when three letters picked without replacement from {a: 5, r: 3, w: 4}. 1/44 What is prob of sequence tbb when three letters picked without replacement from obtbt? 1/15 Calculate prob of sequence immi when four letters picked without replacement from imjmjmjiifm. 1/110 Two letters picked without replacement from fmepe. Give prob of sequence ee. 1/10 What is prob of sequence yd when two letters picked without replacement from {h: 3, o: 2, y: 4, z: 2, d: 1}? 1/33 What is prob of sequence vvd when three letters picked without replacement from {d: 7, v: 6}? 35/286 Three letters	{ "pile_set_name": "DM Mathematics" }
) + 7 + -5) -19 (11 + -18 + -142 - -25) + 11 - (-3 - 1) -109 What is the value of 107 + -60 - 53 - ((2 - 64) + -3)? 59 Calculate -90 - (-12 + 12) - (-30 - -19). -79 158 - (-73 + (25 - -12) - -69) 125 Evaluate (1 + -2 - -5) + (9041 - 9060). -15 58 - (80 - 36) - (5 - 0) - -23 32 (-61 - 11) + 7 + -13 -78 What is the value of 36 - 2 - (34 + -18) - 0? 18 Evaluate 45 + ((-40 - -18) + 19 - -9). 51 What is the value of (92 - (6 + -3)) + (84 + -47 - 56)? 70 Calculate (4 + -10 - -6) + (-19 - -14) - (104 - -1). -110 What is 13 + 2 - ((11 + -32 - 101) + -1 + 13)? 125 0 + (4 + -7 - 4) + 7 + (8 - -31) 39 Evaluate -5 - (-3 + -1) - 18 - (707 - 665). -61 What is -48 - (0 - (5 - 3)) - (407 - 392)? -61 Calculate (72 + -9 - 26 - 18) + 17. 36 Evaluate -28 - (-12 + 23) - (9 + 42). -90 What is the value of (10 + 33 - 77) + 19? -15 Evaluate -3 - -3 - (-13 + 2) - (51 + -12 + -34). 6 Evaluate 25 - (5 - (-17 - -21) - 11). 35 Calculate -53 - (-40 + (23 - -10)). -46 What is the value of -43 + 122 + -15 - 119? -55 What is -58 + -122 + (377 - 83)? 114 18 + (2 - 6) + 8 + (12 - 85 - 22) -73 Calculate -14 + 22 + (-17 - (-60 - (12 + 6))). 69 What is -29 + (3 - 12) - (3 + -19)? -22 Evaluate (1 - (-9 - (23 + (9 - 20) + 78))) + 6. 106 Calculate (-4 - (-11 - (-5 - -10))) + -30 + 36 + -16. 2 What is 0 - 24 - (-149 - 15 - -92)? 48 Calculate 3 - -1 - (-9 - 77 - 5 - -41). 54 Calculate -111 - (58 + -124) - -76. 31 Evaluate (12 - 0) + -9 + -30 + -7. -34 Evaluate (3 + (-8 - -3) - 0) + 1 + -7 + -78. -86 Evaluate 0 + (-6 - (-42 + 8 + 18)). 10 What is the value of 12 - ((-48 - -44) + -15)? 31 What is the value of (0 - 3) + (94 - (75 - -3))? 13 Calculate (-11 + 19 - 17) + (7 - (-7 - 6)) + 46. 57 -4 + -5 + -6 + 3 - (560 + -556) -16 -12 - -3 - (-18 - (4 - (97 - 3))) - -10 -71 What is 12 - (-1 + 111 + -27 + (8 - -3))? -82 What is the value of -8 + 0 - ((33 - (28 - 10) - -3) + -14)? -12 Evaluate 77 + (-23 - (0 + -13 + 11)). 56 What is 5 + 18 + 8 - (13 - 0 - 2)? 20 Evaluate 39 + -42 + -28 - 10. -41 Calculate -1649 - -1548 - (-3 + 5 + -18). -85 173 + (-106 - 50) - (0 + 20) -3 What is the value of 1 - (13 - (-38 + (8 - 9) - -12))? -39 Evaluate 55 + 33 + 106 + -101. 93 What is -86 - 16 - ((-7 + -1 - 1) + -595 + 596)? -94 What is (-46 - 2) + (-11 - -5 - -4)? -50 Evaluate 2 + -2 + (22 - (7 - 41)) + -44. 12 (4966 - 4926) + (-1 - 94) -55 -55 + -55 + 1 + 76 -33 What is the value of 110 + -5 + 37 + 24 + -103? 63 (-35 - -84 - 58) + 20 11 What is -14 + -12 + 56 + 4? 34 Evaluate 25 - (53 - (-54 - -28)). -54 Evaluate 5 + (-31 - -6) + 27 + (-2 - 0) + -26. -21 What is -10 - (-27 - -45 - 4) - -8? -16 Evaluate -162 - (-97 + -47) - ((0 - -91) + 0). -109 Evaluate -82 - ((-7 - 6) + -15) - -27. -27 (-1 - -45) + (0 - (14 + -1 + (14 - 25))) 42 Calculate 68 - (3 - -16 - (-43 - -72 - 14)). 64 What is the value of 9 - (0 - (-12 + 18 - (0 - 4)))? 19 (20 - 192) + 54 + (17 - 41) -142 Calculate 39 + -11 + -15 + 24. 37 -8 + (-4 - -13) + (4 + -3 - (-24 + 0)) 26 What is the value of -31 - (71 - (-73 - -89))? -86 (-9 + -4 - -8) + 27 + (3 - 1) 24 What is the value of 1001 + -953 - (-3 - 18)? 69 Evaluate 113 + (109 - (39 + 221)). -38 What is (-80 - -62) + (4 - 5) + 5? -14 What is the value of (-29 - -92) + -32 + -67 - 52? -88 Evaluate -16 - (6 - (-50 + 44)). -28 Evaluate 3 + -41 - (75 - (-104 - -203)). -14 What is the value of (-766 - -701) + 51 + -3? -17 -67 + -115 + 132 + 8 -42 6117 + -6186 - (-37 - 1) -31 -54 + 62 + -11 + 11 8 -96 - (-81 - (25 - 84)) -74 What is the value of 11 + (-167 - (-83 + 45)) + 11? -107 -49 - (62 + 71 + -92) -90 What is 13 + -1 - (58 - 46 - (-3 + 17))? 14 -51 - (-11 - (85 - 37)) 8 What is 28 + (12 + -47 - 8)? -15 -47 + -40 - (1 + (-12 - -4 - -7)) -87 Calculate (-78 - 39) + 122 + -4 + (19 - -4). 24 Calculate 0 + -142 - (-671 + 638). -109 What is the value of (30 - (9 - 7)) + (-483 - -451)? -4 What is the value of (70 - 116) + -65 + 59? -52 Calculate -116 + 77 + 0 + 26. -13 Calculate 56 + -16 + -95 + 9. -46 Calculate -2 + 15 - (20 - 16 - (20 + -24)) - 98. -93 What is the value of 5 + 16 + (19 - (15 + -15)) + -51? -11 Evaluate 2 - -74 - (205 - (155 - -52)). 78 What is (27 - -20) + (66 - 111)? 2 Evaluate 27 - (21 - 30 - (-8 + 64)). 92 Calculate -1 - -5 - (10 - 25 - (-6 + -3 - -2)). 12 Calculate 120 + -107 + -63 + (0 - -7). -43 What is -40 + -117 + -2 + 26 + -9 + -2? -144 What is the value of 2 + (54 - 0) + (-153 - -99 - -62)? 64 Evaluate (-212 + 184 - (0 + -17)) + 23. 12 Evaluate (9 + 134 - 64) + -17. 62 3 + -7 + -5 + (-15 - (-12 - -58)) -70 Evaluate (1 - -6) + (-165 - -177). 19 Evaluate (1 + -5 - -8 - -11) + (3 - -39). 57 Evaluate 10534 + -10480 + (4 - -1) + 1 + 1. 61 8 + -1 + (31 - 1) + (951 - 943) 45 15 + 78 + -44 + -82 -33 What is the value of 136 + (-15 - -24) + -85? 60 What is -42 - ((19 - (3 + 8 + 5)) + -8 + 2)? -39 Evaluate -7 + 15 + -10 - (-4 - (-7 + 6)) - -19. 20 Evaluate 76 - (87 - 52) - 80. -39 -4 + -9 + -13 + 2 + 25 1 What is the value of 26 + -42 + 8 - (-19 - -1)? 10 What is (1 - (-7 + 1)) + (-96 - (78 + -106))? -61 Calculate 1 + 6 + 2 + (-1 - (5 + -5)) - -11. 19 30 - (-20 - -10 - 1) 41 2 - (-40 + -2) - (64 - (116 - 60)) 36 What is 51 - (-225 + 241 + -1 + -2)? 38 Evaluate 2 - ((1 - -4) + -157 + 156 + 36). -38 Evaluate -2938 + 2972 - (-2 - -2 - -10). 24 (0 - -1) + (139 + -105 - (-1 - (6 + -3))) 39 Calculate (-12 - -46) + -40 - -26. 20 Evaluate (-10 - 1) + -50 + 55 + -46. -52 11 + 0 - (-21 + -24 + 23 + -10) 43 Calculate (23 - -48) + -18 + -101. -48 Calculate (-70 + -22 - (-34 - 1)) + -22. -79 What is (-5 - -21) + -5 - (358 + -335)? -12 What is 78 + 23 + -80 + -100? -79 Evaluate 10 + 0 + 5 + -21 + (3 - (-29 + 4)). 22 What is the value of 5 - (7 + (9 - 4) - 24 - 0)? 17 Calculate 2 + (19 - (43 - (-25 - -22))). -25 Evaluate 79 + -20 - (73 + 37). -51 Evaluate -12 - (-22 + -21 + 6 + 13). 12 What is -25 + 62 + -11 - -21? 47 Calculate (-2312 - -2428) + -1 + -101. 14 What is (40 - (-2 - -6)) + 233 + -292? -23 1 - -1 - (40 + 59 + -36 + -3) -58 What is -10 + -53 + 15 + (-18 - -19) - 1? -48 Calculate 1 - (-30 - (-30 - (-15 - -5))). 11 What is 1 + -15 + 6 - ((-33 - -9) + 45)? -29 What is the value of -15 - (-204 + 126) - 11? 52 What is -7 - (-269 + 241 + 10 + -2) - (20 + -5)? -2 What is the value of (4 - -1) + -12 + 0 + 4 + -31 + 27? -7 What is -7 + (-135 + 16 - (-10 + 0 + 5 + -6))? -115 What is the value of 32 - (-58 - -106) - (-17 + -2)? 3 Calculate -6591 + 6722 + (-80 - 2). 49 What is (15 - (-2 + 0)) + -2990 + 3003? 30 What is (-8 - 13) + (56 - 19) + -32? -16 What is 4 + (-3 + (84 - 4) - 3) + (154 - 160)? 72 What is 7 + (5 - 28) + 4? -12 Evaluate 610 + -621 + (-2 - (0 - 4)) + -1 + -40. -50 55 + (43 - -55 - 155) -2 (-18 - 1) + (120 - (221 + -113)) -7 What is the value of 18 + (-8 + 56 - 4) + (-5 - 13)? 44 What is the value of (19 - (33 + (0 - 6)) - 2) + -50? -60 Evaluate (30 + -4 - ((-7 - -87) + 6)) + (13 - 0). -47 Evaluate -36 - -6 - (17 - 40). -7 0 + 13 - 15 - (5 + (45 - (2 - 4))) -54 Evaluate -12 + 19 + (-22 - (23 + -139)). 101 Evaluate (-91 - -122) + -21 + (1 - -9). 20 Calculate -110 + 62 + 59 + -38. -27 Calculate 50 + (7 + 2 - 12) + (-1 - 6) + 18. 58 -3 + 0 - -1 - -9 - (-68 + 50 - -26) -1 What is the value of 109 + (-1 - 94) - (-2 + (3 - 39))? 52 Calculate 3 + -20 + -4 + 3 - (-1 + 4). -21 What is 0 + -38 + 41 + (0 - 6) - -2? -1 Evaluate 2473 - 2562 - (-3 + -111). 25 What is the value of 13 - ((2 + -9 - -14) + 15) - 2? -11 What is (2 - (2 + 0)) + 4 + -2 - (-3567 + 3485)? 84 What is 62 - (-19 + 1 - (-39 - (-44 - -12)))? 73 Calculate 1051 + -1118 + (1 - -41). -25 Evaluate (1 - (6 - (-1 - 3))) + 15 + 0 - 133. -127 Evaluate -10 + (5 - 1) - 4 - (15 - 105 - -12). 68 What is the value of 69 - -5 - (17 - (-1 - -18))? 74 Evaluate 35 - 6 - (-1163 - -1101). 91 What is (-28 - 25) + 107 + 4 + -3? 55 What is (-71 - -52) + 7 + -10? -22 What is the value of -169 + -95 - -196 - (16 - 0)? -84 What is the value of 105 + (-12 - -23) - (33 + -64 + 18)? 129 What is the value of -17 - (158 - (46 + 14))? -115 Calculate -6 - ((6 - 13) + 14) - (9 - -2). -24 What is -13 + (-15 - -13 - -16 - 10) - -6? -3 Calculate (113 - (221 + 41)) + 279. 130 -70 + (-8 - -56) - 16 -38 What is the value of (8 + 0 - -1) + -5489 + 5426 - -10? -44 Evaluate 3 + (6 - -82) + (611 - 619). 83 Calculate -1154 + 1323 + (-3 - -4) + -34. 136 39 + (-72 - -2	{ "pile_set_name": "DM Mathematics" }
ound n to the nearest 1000000. -36000000 Let s(w) = -3 + 0 + 7w - w2 - 1. Let x be s(5). Suppose 2o - xo + 14800000 = 0. What is o rounded to the nearest one million? 4000000 Let g = -169 - -166.71. Round g to one decimal place. -2.3 Let n be (-63500 + 1)-4 - -4. What is n rounded to the nearest 100000? 300000 Let u = -80279.429 + 80240. Let k = u - -39.6. Round k to 2 decimal places. 0.17 Let n = 83.9999926 - 84. Round n to six dps. -0.000007 Let c be (-2 - -12502)2256. What is c rounded to the nearest one million? 6000000 Let x = -1.2 + 11. What is x rounded to zero decimal places? 10 Let a(i) = -1040002i + 10. Let o be a(5). What is o rounded to the nearest one million? -5000000 Let h = -88 - -98.7. Let y = -59.7 + h. Let z = -48.9999954 - y. What is z rounded to six decimal places? 0.000005 Let r = 11 + -6. Suppose -z + 6 + 19 = 0. Suppose s + 25 = -2k - 4s, rs = -z. Round k to 3 decimal places. 0 Let w = 0.08 + -0.073. Let b = w - 9.207. What is b rounded to 0 dps? -9 Let y = 0.009 + 8.191. Let a = 12.1 - y. Let l = a - -5.5. Round l to the nearest integer. 9 Let m = 0.086 + 42.914. Let s = -1672210 - -1672253.00076. Let a = s - m. What is a rounded to 4 dps? 0.0008 Let m(r) = r*3 - 4r*2 - 5r + 3. Let q be m(5). Suppose -4 = -4t + qt. Let j be -2 - 1/((-2)/t). Round j to the nearest 1000. 0 Suppose -2d = -5d + 353388. Let k be (-1832)/(0 + (-4)/(-362)). Let f = d + k. Round f to the nearest ten thousand. -50000 Suppose -c - 2c = 810000. What is c rounded to the nearest 100000? -300000 Let z = -0.06 - -0.117. Let v = -0.05762 + z. Round v to four decimal places. -0.0006 Let n = -122341.6 - -122340.9999972. Let i = -0.6 - n. What is i rounded to 6 dps? 0.000003 Let g = 5 + -5.07. Let i = -0.05 + g. Round i to one dp. -0.1 Let u = 18 + -6. Let a = u - 11.9962. What is a rounded to three decimal places? 0.004 Let l = 0.04 - 21.04. Let p = -20.986793214 + -0.013127786. Let t = p - l. Round t to five dps. 0.00008 Let i(j) = -j3 - 6j2 - j - 3. Let f be i(-6). Let b = f - 6. What is b rounded to 0 decimal places? -3 Let o = -14.21195091 + 1.21195056. Let u = 13 + o. What is u rounded to seven dps? -0.0000004 Let c = -423 + 604. Let x = -103 + c. Let g = 78.00124 - x. Round g to four dps. 0.0012 Let w = -23.4 - -23.400199. Round w to 5 decimal places. 0.0002 Let m = -655074 - -992074. Round m to the nearest one hundred thousand. 300000 Let n = -21774.54 + 21775.5400055. Let x = n - 1. What is x rounded to 6 decimal places? 0.000006 Let h = 163.7 + -137. Round h to the nearest integer. 27 Let j(f) = -f3 - 2f2 - 3f - 2. Let l be j(-2). Suppose -4808665 = -o + 2b + 5791329, -42399988 = -lo + 4b. Round o to the nearest one million. 11000000 Let g = 0.0749876 - 0.075. What is g rounded to 6 decimal places? -0.000012 Let k = 6.8 - 6.7942. What is k rounded to three decimal places? 0.006 Let s = -4551892.200034 - -4551854.2. Let d = s + 38. What is d rounded to 5 decimal places? -0.00003 Let k(s) be the third derivative of 2315s6/24 - s5/12 - s4/8 - s3/3 - 9s2. Let b be k(6). Round b to the nearest 1000000. 3000000 Let i = 3.29762 - 3.3. Round i to four decimal places. -0.0024 Let d be -1 + 213659 + -4 + -1. Let s = -59347 - d. What is s rounded to the nearest ten thousand? -270000 Let p = 438733 - -171267. Let k be (0 + 0)/(-21). Suppose -6h + h + p = k. What is h rounded to the nearest ten thousand? 120000 Let b = -5 + -9. Let i = -15.1 - b. Let q = 0.1 - i. What is q rounded to the nearest integer? 1 Let t(r) = r - 1290000. Let v be t(0). What is v rounded to the nearest 100000? -1300000 Let i(w) = -10201w + 5. Let x be i(5). What is x rounded to the nearest ten thousand? -50000 Let q = 119 - 118.99999702. Round q to seven decimal places. 0.000003 Suppose -6i + 2 - 38 = 0. Let l(r) = -3r + 4 - 42129r3 + 3r*2 + 0r*2 - r. Let q be l(i). Round q to the nearest 1000000. 9000000 Let f be 19 + -5722 - (-3 + 0). Round f to the nearest 1000. -6000 Let s = 0.4 + -1.7. Let c = s - -6.3. Let j = -5.00003 + c. Round j to four dps. 0 Let i = 2.6 - 2.5999955. Round i to 6 decimal places. 0.000005 Let n(f) = 4f3 + f2 + f - 1. Let b be n(1). Let m(s) = -19601s2 + 4s + 5. Let y be m(b). What is y rounded to the nearest one hundred thousand? -500000 Let x = -131246687 + 131246685.70000014. Let c = 0.01 + 1.29. Let y = c + x. Round y to 7 dps. 0.0000001 Let i = -1676.0144 + 1658. Let b = i - -18. What is b rounded to three dps? -0.014 Suppose 0 = -8j - 0j - 3520. Round j to the nearest 100. -400 Let l(v) = 3v3 + 19v - 2. Let g be l(-14). What is g rounded to the nearest one thousand? -9000 Let v = 2847 - 4087. Let x = 33240 + v. Round x to the nearest ten thousand. 30000 Let v = 50.02 - -0.98. Let m = v - 51.00043. Round m to 4 dps. -0.0004 Let i = -7 + 2. Let w = i + 8.4. What is w rounded to 0 decimal places? 3 Let x be (-4)/14 - 28935/35. Let j = x - -407. What is j rounded to the nearest 100? -400 Let w = -113 - -113.00166. What is w rounded to four dps? 0.0017 Let o = 1.94 + -2. Let v = o - -0.111. Round v to 2 dps. 0.05 Let c = -36 + 27.3. What is c rounded to zero dps? -9 Let i = -6 - -112. What is i rounded to the nearest ten? 110 Let b = 3668031.99907 + -3668192. Let v = b - -160. What is v rounded to four decimal places? -0.0009 Let d = -70.48 + -1.52. Let y = 15 - d. Let s = 86.99939 - y. Round s to four dps. -0.0006 Let y = -268.117 + 268. Let r = -0.1107 - y. What is r rounded to 3 dps? 0.006 Let x(h) = 2h - 600. Let c be x(0). What is c rounded to the nearest one hundred? -600 Let f(x) = 3x*3 + 4x*2 - 4x + 5. Let k be 19/(-3) + (-12)/18. Let z = k - -2. Let q be f(z). What is q rounded to the nearest 100? -300 Suppose 0 = 3c - 7016209 - 7814594. Let t = c - 11243601. What is t rounded to the nearest one million? -6000000 Let a = 99 - 98.999933. What is a rounded to 5 decimal places? 0.00007 Let x = -36483 + -183517. Round x to the nearest one hundred thousand. -200000 Let u = -9 - -9. Suppose u = -3s - 7674 - 5526. Round s to the nearest 1000. -4000 Let c = 95 + -94.9829. What is c rounded to three decimal places? 0.017 Let k = -123 - -73. Let p = -49.99943 - k. Round p to 4 dps. 0.0006 Let m(d) = 6798d3 + 3d*2 - 2d + 1. Let v be m(1). What is v rounded to the nearest one thousand? 7000 Let b = 173 + -173.01055. Let v = b - -0.01. Round v to 4 dps. -0.0006 Suppose c - 2i - 399998 = 0, -4i + 4 = -0. What is c rounded to the nearest 100000? 400000 Let v(i) = 4937i3 - 5i*2 - 8i + 6. Let j be v(5). Let g = 2146966 - j. What is g rounded to the nearest 100000? 1500000 Let i = 133.000195 - 133. What is i rounded to 5 dps? 0.0002 Let d = -7 - -8.4. What is d rounded to the nearest integer? 1 Let q = 22 + -17. Suppose 5g - 2r + 46000000 = 0, 8g - 5g + 27600000 = qr. What is g rounded to the nearest one million? -9000000 Let v = 22 - 31. Let d = 6 + v. Let c be 0/d - -1 - 31001. Round c to the nearest ten thousand. -30000 Let w = -395.1936 - -398.2. Let x = -0.07 + -2.93. Let m = x + w. What is m rounded to 3 dps? 0.006 Let u = -9.19 + 9.6. Let n = -271 - -272.49. Let d = u + n. Round d to zero decimal places. 2 Let q = 158.713 - -0.287. Let b = 1170.9 + -1005. Let a = q - b. Round a to the nearest integer. -7 Let s = -3715855 + 1229480. Let t = s - -2486426.99917. Let r = -52 + t. What is r rounded to four decimal places? -0.0008 Let d be ((-4)/1)/(6/(-222876)). Let x = 611416 + d. What is x rounded to the nearest 100000? 800000 Let g(r) = -79578 - 4r + 2r + r - 88883 - r2. Let h be g(0). Let b = 348461 + h. Round b to the nearest 100000. 200000 Let d = -8 + 11. Let g be 146250/(-12)(-2240)/d. What is g rounded to the nearest 1000000? 9000000 Let q(a) = -630a3 + a - 1. Let u be q(1). What is u rounded to the nearest 100? -600 Let c = -70116858 + 70116821.999969. Let t = 76 + -112. Let r = t - c. Round r to five dps. 0.00003 Let g = -36 - -35.73. Let p = -318863.52 - -318863.24999934. Let z = p - g. What is z rounded to 7 dps? -0.0000007 Let h = -584483608.13053 + 584453716. Let v = h - -29892. Let l = 0.13 + v. What is l rounded to 4 decimal places? -0.0005 Let f be 3/(12/40)2302255. Suppose 0 = -5*u - f - 4477450. Round u to the nearest one million.	{ "pile_set_name": "DM Mathematics" }
, 13, 337, 479 List the prime factors of 3559918. 2, 37, 73, 659 What are the prime factors of 48002? 2, 24001 What are the prime factors of 2817384? 2, 3, 89, 1319 List the prime factors of 544978. 2, 7, 67, 83 List the prime factors of 302862. 2, 3, 7, 7211 What are the prime factors of 173820? 2, 3, 5, 2897 List the prime factors of 18229664. 2, 19, 29983 What are the prime factors of 1584055? 5, 11, 83, 347 List the prime factors of 1932648. 2, 3, 80527 List the prime factors of 402477. 3, 19, 23, 307 What are the prime factors of 495138? 2, 3, 7, 11789 List the prime factors of 246918. 2, 3, 7, 5879 List the prime factors of 428328. 2, 3, 661 List the prime factors of 53630. 2, 5, 31, 173 What are the prime factors of 87901? 11, 61, 131 List the prime factors of 3530256. 2, 3, 73547 List the prime factors of 49408. 2, 193 What are the prime factors of 1010104? 2, 31, 4073 List the prime factors of 119905. 5, 23981 What are the prime factors of 5387696? 2, 83, 4057 List the prime factors of 2837396. 2, 709349 What are the prime factors of 289747? 37, 41, 191 What are the prime factors of 770743? 257, 2999 What are the prime factors of 280026? 2, 3, 47, 331 List the prime factors of 2982135. 3, 5, 13, 41, 373 What are the prime factors of 16512528? 2, 3, 23, 14957 What are the prime factors of 6905481? 3, 11, 209257 What are the prime factors of 34452049? 34452049 List the prime factors of 414785. 5, 7, 1693 What are the prime factors of 301488? 2, 3, 11, 571 List the prime factors of 11077077. 3, 11, 335669 List the prime factors of 625893. 3, 208631 What are the prime factors of 153118? 2, 7, 10937 List the prime factors of 12692478. 2, 3, 227, 9319 List the prime factors of 19039567. 19039567 List the prime factors of 6647301. 3, 738589 List the prime factors of 5356038. 2, 3, 179, 4987 List the prime factors of 5947318. 2, 13, 59, 3877 List the prime factors of 368128. 2, 719 What are the prime factors of 14768746? 2, 193, 38261 List the prime factors of 364220. 2, 5, 18211 List the prime factors of 1136829. 3, 29, 73, 179 List the prime factors of 11233537. 7, 281, 5711 List the prime factors of 816443. 816443 List the prime factors of 11246373. 3, 827, 1511 What are the prime factors of 613735? 5, 131, 937 What are the prime factors of 496848? 2, 3, 11, 941 List the prime factors of 1186765. 5, 71, 3343 List the prime factors of 28214. 2, 14107 List the prime factors of 15639715. 5, 7, 13, 37, 929 What are the prime factors of 13206543? 3, 7, 709, 887 What are the prime factors of 1942140? 2, 3, 5, 32369 List the prime factors of 7673805. 3, 5, 56843 What are the prime factors of 609866? 2, 304933 List the prime factors of 884258. 2, 23, 47, 409 What are the prime factors of 1934386? 2, 293, 3301 List the prime factors of 100337. 269, 373 What are the prime factors of 3831037? 7, 547291 What are the prime factors of 12791469? 3, 4263823 What are the prime factors of 2904955? 5, 487, 1193 What are the prime factors of 7516? 2, 1879 List the prime factors of 240264. 2, 3, 47, 71 What are the prime factors of 11958? 2, 3, 1993 What are the prime factors of 11614349? 17, 167, 4091 List the prime factors of 1094036. 2, 479, 571 What are the prime factors of 7163? 13, 19, 29 What are the prime factors of 337347? 3, 37483 List the prime factors of 1272946. 2, 636473 List the prime factors of 526593. 3, 257, 683 What are the prime factors of 3035831? 421, 7211 What are the prime factors of 2313893? 971, 2383 What are the prime factors of 471847? 471847 List the prime factors of 2348918. 2, 11, 13, 43, 191 List the prime factors of 6081773. 107, 113, 503 List the prime factors of 1789580. 2, 5, 13, 6883 List the prime factors of 239302. 2, 7, 17093 List the prime factors of 933014. 2, 19, 43, 571 List the prime factors of 182491. 41, 4451 List the prime factors of 2162819. 137, 15787 List the prime factors of 1164253. 1164253 List the prime factors of 129379. 129379 List the prime factors of 91243. 91243 What are the prime factors of 3357715? 5, 149, 4507 List the prime factors of 2330319. 3, 829, 937 List the prime factors of 1308422. 2, 17, 29, 1327 List the prime factors of 32053315. 5, 7, 359, 2551 What are the prime factors of 2681666? 2, 13, 103141 What are the prime factors of 798154? 2, 7, 47, 1213 What are the prime factors of 7080449? 17, 416497 What are the prime factors of 90328? 2, 7, 1613 What are the prime factors of 14511710? 2, 5, 17, 85363 What are the prime factors of 918138? 2, 3, 13, 79, 149 List the prime factors of 1195132. 2, 509, 587 List the prime factors of 1049258. 2, 7, 149, 503 List the prime factors of 24614911. 24614911 What are the prime factors of 1251196? 2, 312799 List the prime factors of 10757626. 2, 11, 44453 What are the prime factors of 11909904? 2, 3, 281, 883 List the prime factors of 1736866. 2, 19, 45707 List the prime factors of 19247849. 23, 836863 What are the prime factors of 9029468? 2, 7, 389, 829 What are the prime factors of 2295635? 5, 459127 List the prime factors of 16634691. 3, 269, 6871 What are the prime factors of 13207391? 13207391 List the prime factors of 697015. 5, 11, 19, 23, 29 List the prime factors of 5046889. 349, 14461 What are the prime factors of 46929? 3, 15643 List the prime factors of 4068471. 3, 11, 31, 41, 97 What are the prime factors of 366895? 5, 73379 List the prime factors of 176641. 176641 List the prime factors of 5269385. 5, 11, 149, 643 List the prime factors of 7681750. 2, 5, 30727 What are the prime factors of 4014187? 19, 41, 5153 What are the prime factors of 353398? 2, 176699 What are the prime factors of 446666? 2, 11, 79, 257 List the prime factors of 411827. 13, 79, 401 What are the prime factors of 9238413? 3, 1087, 2833 What are the prime factors of 4506855? 3, 5, 53, 5669 What are the prime factors of 509637? 3, 19, 8941 List the prime factors of 1902568. 2, 237821 List the prime factors of 71345. 5, 19, 751 List the prime factors of 197948. 2, 17, 41, 71 List the prime factors of 642656. 2, 7, 19, 151 List the prime factors of 1068423. 3, 356141 List the prime factors of 1044498. 2, 3, 7, 13, 1913 List the prime factors of 6860552. 2, 857569 What are the prime factors of 281633? 11, 25603 What are the prime factors of 10262474? 2, 5131237 List the prime factors of 154118. 2, 263, 293 List the prime factors of 1794443. 7, 256349 List the prime factors of 6640231. 13, 31, 16477 What are the prime factors of 4824184? 2, 603023 List the prime factors of 479716. 2, 119929 What are the prime factors of 69446? 2, 13, 2671 List the prime factors of 1481037. 3, 103, 4793 What are the prime factors of 36428758? 2, 18214379 List the prime factors of 40077506. 2, 7, 103, 27793 What are the prime factors of 285727? 13, 31, 709 List the prime factors of 2075696. 2, 7, 43, 431 List the prime factors of 214571. 7, 29, 151 List the prime factors of 1605232. 2, 41, 2447 List the prime factors of 541413. 3, 43, 1399 List the prime factors of 842273. 71, 11863 What are the prime factors of 2492601? 3, 67, 12401 List the prime factors of 7541552. 2, 61, 7727 What are the prime factors of 1247067? 3, 138563 List the prime factors of 138279. 3, 46093 List the prime factors of 116023. 157, 739 List the prime factors of 1900540. 2, 5, 95027 What are the prime factors of 11961250? 2, 5, 7, 1367 What are the prime factors of 4102822? 2, 19, 101, 1069 List the prime factors of 2195396. 2, 7, 23, 487 List the prime factors of 51430. 2, 5, 37, 139 List the prime factors of 107735. 5, 29, 743 List the prime factors of 287262. 2, 3, 15959 What are the prime factors of 2242178? 2, 23, 79, 617 What are the prime factors of 4311168? 2, 3, 103, 109 List the prime factors of 3398972. 2, 849743 What are the prime factors of 109700? 2, 5, 1097 What are the prime factors of 1417855? 5, 283571 List the prime factors of 150900. 2, 3, 5, 503 List the prime factors of 11088220. 2, 5, 11, 13, 3877 What are the prime factors of 406925? 5, 41, 397 What are the prime factors of 8960845? 5, 37, 48437 List the prime factors of 4504944. 2, 3, 127, 739 What are the prime factors of 10864426? 2, 41, 47, 2819 List the prime factors of 14340678. 2, 3, 11, 19753 What are the prime factors of 18790	{ "pile_set_name": "DM Mathematics" }
-7755)/(-10). Round w to the nearest 100000. 3100000 Let m(w) = -5w. Let x(k) = 1. Let q(r) = -m(r) - x(r). Let z be q(1). Let l be (-3)/12 - 3999/z. Round l to the nearest ten thousand. 0 Let g = 16918 + -17018.89. What is g rounded to zero dps? -101 Let m = -12022.1900022 + 12022.2. Let u = -0.124 + 0.114. Let k = u + m. Round k to 6 decimal places. -0.000002 Let w = 0.65 - 0.15. Let z = w - 0.61. What is z rounded to two decimal places? -0.11 Let j = 2858 - 6491. Let d = 101 - -2182. Let x = j + d. What is x rounded to the nearest one hundred? -1400 Let q = -10.3 + 5.7. Let n = -13.297912 + 8.69782. Let r = n - q. Round r to 5 decimal places. -0.00009 Let r = 1.087 - 1.08696285. What is r rounded to six dps? 0.000037 Let n be 8/(-4) + (893 + 1)10. Let m = n - -52062. What is m rounded to the nearest 10000? 60000 Let g = -4896 - -4895.2178. Let u = -0.08 - -0.87. Let f = g + u. Round f to three dps. 0.008 Let w = 12.7 + -12.69999843. Round w to six dps. 0.000002 Let l = -3.84 - -3.83982. Round l to 4 dps. -0.0002 Let s = 1717.99259 - 1718. What is s rounded to 3 dps? -0.007 Suppose 5j = -5f - 85980, 8f - 5f = 2j + 34412. Round j to the nearest 1000. -17000 Let s = -15 - -19.3. Let b = 4.300099 - s. What is b rounded to 5 decimal places? 0.0001 Let b = 61.92 + -63. Let n = b - -1.2. Let p = 0.08 + n. Round p to 1 dp. 0.2 Let d = -1530.998408 + 1531. What is d rounded to 4 decimal places? 0.0016 Let r = 17 + -16.78. Let c = 1.28 + r. Let l = -1.4872 + c. What is l rounded to three decimal places? 0.013 Let o = -2921317 + 2921433.9921. Let x = 249 + -132. Let v = o - x. What is v rounded to three dps? -0.008 Let d(t) = -242104t + 24. Let h(p) = -2p + 19. Let w be h(19). Let n be d(w). What is n rounded to the nearest one hundred thousand? 4600000 Suppose 4u - 4w - 2536008 = 0, -3u - w + 1167710 + 734288 = 0. Round u to the nearest 100000. 600000 Suppose -5i + 2i = -12. Suppose -ia = 28563756 + 11836244. Round a to the nearest one million. -10000000 Let z(i) = -4655i*3 - 6i*2 - 10i + 8. Let x be z(-13). Let l = x - -1973841. Round l to the nearest 1000000. 12000000 Let x = -139.693442 + 139.7. What is x rounded to 3 dps? 0.007 Let g = -604.35 - -547. Let p = g - -0.35. Let l = p - -57.00031. What is l rounded to 4 decimal places? 0.0003 Suppose 0 = 4a + z - 88895, 2z = -3a + 4a - 22217. Let p = 1623 - a. What is p rounded to the nearest 1000? -21000 Let c = -1.293 + -0.117. Let n = -1.481 - c. What is n rounded to 2 decimal places? -0.07 Suppose -42 = -6r + 3r - 4c, -28 = -2r + 2c. Let p = 22 - r. Let q be -10 + p - (0 - 40002). What is q rounded to the nearest 100000? 0 Let w = 540 + -538.556. Round w to 1 decimal place. 1.4 Let z = 0.67 + -61.67. Let l = z - -61.014. What is l rounded to two dps? 0.01 Let z = -1242.3 - -1240.3036. Let q = z - -2. Round q to three dps. 0.004 Let f = 452.340219 + -131.340573. Let s = f + -321. What is s rounded to five dps? -0.00035 Let f = -25809026.1 + 25809169.100077. Let w = f + -143. Round w to 5 decimal places. 0.00008 Let c = 0.088 - 0.032. Let b = 19.256 - c. Round b to the nearest ten. 20 Let f = -2484.269 - -2482. Let t = 0.031 - f. What is t rounded to zero dps? 2 Let w = 0.28 + -0.43. Let g = w - -0.149983. What is g rounded to 5 decimal places? -0.00002 Let m = -14.37 + 39.45. Let u = m + 3.12. Round u to the nearest integer. 28 Let c = -0.1306 - 0.4384. Let o = -1.287 - c. What is o rounded to 1 dp? -0.7 Let t(y) = -y2 - 14y + 1. Let z be t(-13). Let x be (-1)/(-2) + 34999993/z. Round x to the nearest one million. 3000000 Let z = 28.27 - -7.84. Let r = -3.7 + -34.3. Let u = z + r. Round u to one dp. -1.9 Let o = -3.338 - -3.11. What is o rounded to two dps? -0.23 Let k = 10 - -13. Let d = k - 23.009. What is d rounded to 2 decimal places? -0.01 Suppose -2f = -4f + 48. Suppose f = 5r - r. What is r rounded to the nearest ten? 10 Let x = 7.81 - -0.19. Let l = 1.99 - 2.49. Let b = x - l. Round b to 0 decimal places. 9 Let m(h) = -h3 - 24h*2 + 2h + 15. Let i be m(10). Let v = -7665 - i. Round v to the nearest 10000. 0 Let m = 1496.0001534 - 1496. Round m to five decimal places. 0.00015 Let t be ((-11)/(55/10))/((-8)/57360). What is t rounded to the nearest one thousand? 14000 Let q(o) = o*3 - 9o*2 + 8o - 6. Let g be (0/(-2))/(-3 - 0). Suppose gj + 4j - 12 = -3c, -5c = 3j + 2. Let a be q(j). Round a to the nearest ten. -70 Let m = -173 + 173.081. Let l = 5709533.08100078 + -5709533. Let u = m - l. What is u rounded to 7 dps? -0.0000008 Let r(z) = -12z - 23. Suppose -6 = -2s, 3s + s = -2n + 4. Let w be r(n). What is w rounded to the nearest integer? 25 Let z = -97.4 + 96.13. Round z to 1 dp. -1.3 Let x = 47.142 - 47. Let y = x - 0.1420216. Round y to six decimal places. -0.000022 Suppose 6g = 5g - 4g. Suppose g = 14u - 12u + 232000. Round u to the nearest ten thousand. -120000 Let h(u) = -u + 1. Let i be h(5). Let g(l) = 239l2 + 3l + 3. Let t be g(i). Let j = -1085 + t. Round j to the nearest 100. 2700 Let a be (11 + -1211)/(3/(-3070)). Suppose 12z - 8z - a = 0. Round z to the nearest ten thousand. 310000 Let o = 26.6 + -28.8. Let h = 164.49 - 162. Let g = o + h. Round g to one decimal place. 0.3 Suppose 7756630 = 81o - 2816300. Round o to the nearest 10000. 130000 Let z = 29.3 - 5.3. Let x = z + -23.9999971. What is x rounded to six dps? 0.000003 Let f = -27 + 23. Let m be -4 + (0 - f) + -15246. Let o be (-4)/18 + m/(-81). Round o to the nearest 10. 190 Let t = 0.4 + -1.55. Let a = 10.35 + t. Let z = a - 9.20063. Round z to four dps. -0.0006 Let n = 165009.22033 - -2.77967. Let l = -165012.099053 + n. Let s = -0.099 - l. Round s to five dps. 0.00005 Let r = 1117.99457 - 1118. What is r rounded to 4 decimal places? -0.0054 Let o = 44.8 - 44.80351. Round o to 4 dps. -0.0035 Let x = -0.15 + 1.85. Let y = 6.4012 - 4.70101. Let z = x - y. What is z rounded to five dps? -0.00019 Let n = -554.00053 + 554. What is n rounded to four dps? -0.0005 Let z = 10002377 - 10000702.0991. Let c = -1675 + z. Let g = c - -0.095. Round g to three dps. -0.004 Let u = -45 + -11. Let c = u + 99. Let v = c + 107. What is v rounded to the nearest ten? 150 Let s = -67.9 - -62. Let d = s + 9.2. Let q = d - 3.3035. What is q rounded to three dps? -0.004 Let m = -0.0439 + -0.0207. Round m to two decimal places. -0.06 Let h = 5748.9996631 - 5749. Round h to five dps. -0.00034 Let g = -0.8 + 0.814. Let q = 26.414 - g. Let m = 24 - q. Round m to the nearest integer. -2 Let b be ((-240)/(-18))/((-2)/68460). What is b rounded to the nearest ten thousand? -460000 Let b be (-3)/(24/40) - -87. What is b rounded to 0 decimal places? 82 Let w = -1795 + 1795.00001602. Round w to six dps. 0.000016 Let f = 5876 - 5875.67905. Let k = -0.32 + f. What is k rounded to four decimal places? 0.001 Let u = 0.3 + 37.7. Let n = u + -54. Let f = -15.99999972 - n. Round f to 7 decimal places. 0.0000003 Let f = 7827 - 7826.9999991493. What is f rounded to 7 dps? 0.0000009 Let l = -457 - -445.84. Let g = l + 0.16. Let a = -10.78 - g. What is a rounded to 1 decimal place? 0.2 Let q = 0.98 + 2.13. Let n = q + -0.11. Let c = -3.055 + n. Round c to two dps. -0.06 Let j = -25 + 24.9582. What is j rounded to 2 dps? -0.04 Suppose -5w = -4k + 38384, -3k - 6314 = 3w + 16738. Round w to the nearest one thousand. -8000 Let f = 16 + -14. Let y(b) = -1012b - 1. Let x be y(f). Let m = x - -605. Round m to the nearest one hundred. -1400 Let b = -7.43529 - 787.53571. Let u = -788 - b. Let f = u - 7. Round f to 2 dps. -0.03 Let x = 4.741 + 0.059. Let h = x + -4.80276. What is h rounded to 4 decimal places? -0.0028 Let h = -23.01459 + -0.04941. Let f = 67 + -44. Let g = h + f. Round g to two decimal places. -0.06 Let q = 6 - -5. Let i = -11.15 + q. Round i to one decimal place. -0.2 Let w = 0.0605 + -14.2705. Round w to 0 dps. -14 Let l = 695 + -695.0000643. What is l rounded to five decimal places? -0.00006 Let n = -218.216 + 220. Round n to 2 dps. 1.78 Suppose 5o - 2g - 454499994 = 0, -2o - 14g = -9*g - 181800015. Round o to the nearest one million. 91000000 Let v = 595.676 + -597. Let z = v - -1.3. Round z to two decimal places. -0.02 Let k = -134.9992688 - -135. Round k to 4 dps. 0.0007 Let w = -	{ "pile_set_name": "DM Mathematics" }
z*2 Let l(o) be the first derivative of 3o*7/7 - 5o*6/3 + 94o*3/3 + 309. What is the third derivative of l(a) wrt a? 360a*3 - 600a2 Let t(u) = -u5 - 3u2. Let s be 9 + (0 - (5 - 1)). Let d(h) = 3h*5 + 7h*2. Let o(n) = st(n) + 3d(n). What is the third derivative of o(y) wrt y? 240y*2 Let t(g) = 3g - 3. Let b(k) = -k*3 + 5k*2 + 4k + 1. Let f be b(6). Let j(v) = -6 - 2v + 0v + 8v. Let a(x) = ft(x) + 6j(x). Differentiate a(u) wrt u. 3 Let a(h) be the second derivative of 3h*6/10 - 3h5/10 + h3/3 - 47h2 + 31h. Find the second derivative of a(o) wrt o. 108o2 - 36o Suppose 13x = 3x + 20. Find the third derivative of 4h2 + 7h*x + 9h*5 - 27h*5 wrt h. -1080h*2 Let d(h) be the third derivative of -5h*8/336 + 79h*6/120 + 7h*4/24 - 7h*3/6 - 483h*2. What is the second derivative of d(k) wrt k? -100k*3 + 474k Suppose -g + 4g - 12 = 0. What is the first derivative of -i + 6i + gi - 4 - 1 wrt i? 9 Let x(b) be the first derivative of 56b*5/5 - 55b - 78. Differentiate x(y) with respect to y. 224y3 Let i(a) = 387a*4 - 7a*2 - 320a + 7. Let p(k) = 129k4 - 2k*2 - 106k + 2. Let b(t) = 2i(t) - 7p(t). Find the second derivative of b(h) wrt h. -1548h2 Let n(w) be the second derivative of 11w + w*4 + 0w*3 + 0 - 2/5w*5 + 0w*2. Find the third derivative of n(x) wrt x. -48 Find the second derivative of 565g*5 + 12g + 304 - 307 - 11g wrt g. 11300g*3 Let l(u) = -8u + 40. Let y(k) = 1. Let p = -28 + 22. Let m be 2/4 - 3/p. Let g(a) = ml(a) - 32y(a). Differentiate g(f) wrt f. -8 Let f(o) = o*2 + 2o - 3. Let r = -9 - -5. Let b be f(r). Find the third derivative of -6n5 + 0nb + n2 + 3n2 wrt n. -360n*2 Let b be 6/9 + (-44)/(-6). Suppose -4p - 9 = -3q, 3q + 0 - 9 = -3p. Find the third derivative of bl*3 - 4l*2 - 2l3 - lq wrt l. 30 Let u = 70 + -59. Let b(r) = 75r3 - r - 11. Let d(f) = 25f*3 - 4. Let i(v) = ud(v) - 4b(v). What is the second derivative of i(m) wrt m? -150m Let f = -57 - -74. Differentiate 7 - fm3 + 29 + 2 with respect to m. -51m*2 What is the first derivative of -47 - 19 - 54 - 84 - 318x wrt x? -318 Let g(x) be the first derivative of -x*4/4 - 2x3/3 + x2 - 3x - 1. Let z be g(-3). What is the second derivative of -3o4 - o - o4 + 5o + zo wrt o? -48o2 Let n(w) = -5w*4 - 6w*3 - 56w*2 + 6w + 2. Let y(x) = -x3 - x2 + x. Let p(j) = n(j) - 6y(j). What is the third derivative of p(d) wrt d? -120d Let b(q) = -101q2 + 8q - 3. Let s(j) = 51j2 - 4j + 2. Let p(w) = -6b(w) - 10s(w). What is the second derivative of p(h) wrt h? 192 Let v be 4 + -1 + (-6)/(-3). Suppose 1 = m - v. Find the second derivative of -5s2 - 4s + 7s - ms wrt s. -10 Let x(m) be the first derivative of 45m2/2 + 90m - 59. Differentiate x(j) wrt j. 45 Let r(h) = h - 7. Let g be r(9). Suppose -s = 3b - b, 5b + 5s + 10 = 0. Find the second derivative of -m4 - 3m*4 - bm + gm4 + m4 wrt m. -12m*2 Let x(a) be the second derivative of -83a*4/6 + 3a*3/2 - 3a*2 + 125a. What is the second derivative of x(f) wrt f? -332 Let p(t) be the second derivative of 9/2t2 + 0t*4 + 0t*3 - 3/10t*5 + 8t + 0. Differentiate p(u) with respect to u. -18u2 Let y(w) be the third derivative of 17w*6/120 + 4w5 + w2 + 219. What is the third derivative of y(z) wrt z? 102 Let o be 1 + (4 - 3 - -2) - 2. What is the derivative of -8c2 + 2c*2 + 5c*o + 2c*2 + 18 wrt c? 2c Let s(z) = 175z - 270. Let f(t) = -171t + 271. Let n(d) = 6f(d) + 5s(d). What is the first derivative of n(o) wrt o? -151 What is the second derivative of -684v + 330v*3 + 235v + 254v wrt v? 1980v Find the first derivative of 202 - 20o3 - 50o*3 - 57o*3 - 54 wrt o. -381o*2 Let n be 31 - (12 - 14). Suppose -nu - 3h = -28, -2u + 7u + 4h = 29. Find the second derivative of -4b*5 - 4b*5 - 2b*u - 10b wrt b. -200b3 Let z(w) = 10 - 7w*3 - 2w + 6w2 - 25 + 15. Let n(d) = 20d*3 - 17d*2 + 6d. Let f(j) = -6n(j) - 17z(j). Find the second derivative of f(b) wrt b. -6b Suppose 2 = 2p, -5p + 2 = 2a - 15. Let d(x) = -x + 10. Let n be d(a). What is the second derivative of u*n - 8u + 2u - 3u*4 - 3u wrt u? -24u2 Suppose -3x - 3q + 8 = -13, x = 3q - 13. Find the third derivative of 3w2 + 2w*x + 12w*6 + 5w*2 - 9w*2 wrt w. 1440w*3 Suppose -21 + 0 = -3j. Let h = j - 4. Find the first derivative of 1 + hy2 - 7 + 4y2 - y2 wrt y. 12y Let u(n) be the first derivative of -441n*4/4 - 249n*2 + 65. Find the second derivative of u(m) wrt m. -2646m Let n(o) be the third derivative of 2o7/105 + o6/60 + 11o*3 + 2o*2 - 46o. Differentiate n(c) with respect to c. 16c3 + 6c*2 Find the second derivative of -162154m*3 + 3m + 162170m3 - 94 - 2m2 + m2 wrt m. 96m - 2 Differentiate 13k*3 - 3k*3 - 28k*2 - 4k*3 + 106 - 5k*3 wrt k. 3k*2 - 56k What is the second derivative of 5 - 47o4 - 7 + 2o + 2o5 + 0 wrt o? 40o*3 - 564o*2 What is the second derivative of 96 + 139r - 140r - 51r*2 - 25r*2 - 62r*2 wrt r? -276 Let r(p) be the first derivative of 0p + 0p4 + 19 + 33/2p*2 - 7/5p*5 + 0p*3. What is the second derivative of r(h) wrt h? -84h*2 Suppose -p + 5p = -24. Let r = p + 8. What is the third derivative of 0o6 - 3o*2 + ro*6 + 5o*2 + 3o*2 wrt o? 240o*3 Let t(r) be the first derivative of 0r*4 + 0r - 31 + 5r5 - 23/2r*2 + 0r*3. What is the second derivative of t(w) wrt w? 300w*2 What is the second derivative of -236425n + 236191n + n2 - 4n*2 wrt n? -6 Suppose 0 = 5y + 20, 2y + 0y = -3g + 1. Suppose 24 = gv + v. Find the first derivative of -11x4 + vx*4 + 4 + 6 - 5x*4 wrt x. -40x*3 What is the second derivative of -19k*4 + 19k*4 - 721 - 819k*5 + 717 + 104k wrt k? -16380k3 Let f(r) = 1034r*2 + 1128. Let w(y) = -86y*2 - 94. Let q(v) = -4f(v) - 47w(v). What is the derivative of q(a) wrt a? -188a Let b(g) = 0 - 4 + 5g + 2 - 4. Let w(n) = -5n + 7. Let i(v) = 5b(v) + 6w(v). Find the first derivative of i(k) wrt k. -5 Suppose -44 = 10c - 6c. Let r = -8 - c. Differentiate -6q + 9q - q - r + 11q with respect to q. 13 What is the second derivative of -106b - 26b5 + 0b*5 - 14b*5 + 12b wrt b? -800b3 Let i(y) be the second derivative of y8/120 + 13y6/360 - y3 - 5y. Let h(t) be the second derivative of i(t). What is the third derivative of h(l) wrt l? 336l Let m(g) be the second derivative of -3g5/20 - g4/3 + g3/3 - g2 + 3g + 1. What is the second derivative of m(r) wrt r? -18r - 8 Let l be ((-5)/10)/((-2)/(-4)). Let p be (l + (-3 - -5))2. Find the third derivative of -3gp - g2 - 4g4 - g2 + 2g2 wrt g. -96g Find the third derivative of 23 - 7r2 - 190r*6 - 21r*2 + 26r*2 wrt r. -22800r*3 Let f(g) be the second derivative of 17g*4 - 107g*3/2 - 7g - 10. Find the second derivative of f(y) wrt y. 408 Suppose 17 - 8 = 3g, 2u + 3 = 3g. Let o(b) be the first derivative of 0b*2 - 4/3b*u + 5 - 12b. What is the first derivative of o(q) wrt q? -8q Let i(r) = r2 - 3r - 17. Let s be i(6). Let u(x) = 6x2 - 7. Let b(p) = -p2. Let l(m) = su(m) - 2b(m). Find the first derivative of l(y) wrt y. 16y Let v(u) = 212u3 - 33u. Let y(a) = 213a3 - 33a. Let t(m) = 3v(m) - 4y(m). Find the second derivative of t(r) wrt r. -1296r Suppose 3w = 15 - 0. Find the third derivative of -213a + 2a*w + 10a*2 + 213a wrt a. 120a2 Let t(g) be the third derivative of 13g*6/120 + 4g*4 + 30g*2. Find the second derivative of t(z) wrt z. 78z Let l(u) be the second derivative of -231u5/20 - 26u*4 + 48u - 3. What is the third derivative of l(p) wrt p? -1386 Suppose 7n = 9 + 26. What is the second derivative of -nx*3 + 24x*3 - 7x*3 - x - 9x wrt x? 72x What is the first derivative of -383q*3 - 21131q + 64 + 21131q - 370 wrt q? -1149q*2 Let d(t) be the second derivative of 0 - 13/12t*4 + 0t*3 + 7t + 9/2t2. Differentiate d(a) wrt a. -26a Let j(m) = m - 6. Let k be 42/3 - 1 - 0. Let v be j(k). What is the second derivative of -4l5 + 3l*5 - l - vl*5 + 0l wrt l? -160l*3	{ "pile_set_name": "DM Mathematics" }
(39/65)/(2/10). Suppose -2q - 57 = -4q - 3y, -vq = -5y - 38. What is the remainder when q is divided by (-22)/(-3) - 6/(-9)? 5 Suppose -3d + 32 = -0i + i, 3i = d + 136. What is the remainder when i is divided by 0 + (4 + 46)/5? 4 Let x = -11 - -40. Calculate the remainder when (x-4)/(-2) - 0 is divided by (-6)/((-120)/385) + (-3)/(-4). 18 Let t be (-14)/(-6)(1 - 2)-3. Suppose -tv + 32 = -5v. What is the remainder when 79 is divided by v? 15 Suppose 4k + 3 - 27 = 0. Let r(x) = x*2. What is the remainder when 69 is divided by r(k)? 33 Let f = 11 - 14. Let x be (-26)/f(-26 - -8). Let w = 220 + x. What is the remainder when w is divided by 13? 12 Let a(s) be the second derivative of -s5/20 + s4/12 - 7s3/6 + 3s*2 - 3s. Let x be a(-6). What is the remainder when 42 is divided by 2/7 - x/(-28)? 9 Suppose 10 = -7h + 206. What is the remainder when 978 is divided by h? 26 Let d(q) = q3 + 15q*2 + 11q + 27. What is the remainder when d(-14) is divided by 12? 9 Calculate the remainder when 96 is divided by 1213/31. 44 Let n be (-2)/10 + 1179/45. Let y = -22 + n. Calculate the remainder when 20 is divided by y. 0 Suppose -6c = -3t - 2c + 855, t + 5c = 266. Calculate the remainder when t is divided by 74. 59 Let g(k) = k*2 - k - 2. Calculate the remainder when 14/((-112)/24)166/(-6) is divided by g(-5). 27 Suppose -2j - 3k = -32, 3k + 2k = 20. Suppose 3q + 2v = 20, 0 = q - 0v - 2v - 4. Let t(x) = x + 12. Calculate the remainder when t(q) is divided by j. 8 Suppose 0 = -5f - 4t + 437, f = 2f + 3t - 94. What is the remainder when f is divided by 89/3 - (-4)/(-6)? 27 Suppose -5g - 2y + 22 = -0y, -4g + 5y = -44. Suppose 8k + 9 = 345. Calculate the remainder when k is divided by 44/g(-12)/(-8). 9 What is the remainder when (0 - (-1 - 60/9))12 is divided by 33? 26 Let x(w) = w - 14. Let g be (-1 + 4)25/15. Let b be x(g). Let c = b + 25. What is the remainder when 30 is divided by c? 14 Suppose -50 = -9s - 5. Suppose -sa = -12 - 73. Calculate the remainder when 66 is divided by a. 15 Let x = -78 - -175. What is the remainder when x is divided by 10? 7 Suppose -4k + 48 = -24. Suppose 0h + k = 3h. Calculate the remainder when -63/((-27)/30) is divided by h. 2 Suppose -m + 22 = 5t, 4t = -0m + 4m + 8. Suppose tr - 459 = r. Calculate the remainder when r is divided by 39. 36 Let h(f) = 2f2 - 2f - 4. Let d = -9 - -13. Let z(j) = -j*2 - 12j + 2. What is the remainder when z(-5) is divided by h(d)? 17 Let b be ((-1)/2)/(2/(-108))1. Let h = b - 20. Suppose 5a = s - 5s + 118, -5s - 93 = -3a. Calculate the remainder when a is divided by h. 5 Let r(f) = 4f + 25. What is the remainder when r(-4) is divided by (0 + -5)(-6)/15? 1 Suppose -5j + 3z = z + 121, 0 = 2j - 3z + 55. Let c = -126 - -81. Let y = j - c. What is the remainder when y is divided by 8? 6 Suppose -4p - 301 = -493. What is the remainder when p is divided by 21? 6 Let y be (4/(-6))/((-1)/(-3)). Let c = y - -3. Suppose 32z + 1422 = 1486. What is the remainder when z is divided by c? 0 Let k(v) = -v2 + 18v - 54. What is the remainder when 70 is divided by k(13)? 4 Let u(r) = -5r - 25. Let l be u(-6). Suppose lt + 68 = 2s + 9, t + 3 = 0. Calculate the remainder when 104 is divided by s. 16 Let h = 33 - 138. Let u = 0 - h. What is the remainder when u is divided by 36? 33 Suppose 5i = -4r - 0i + 38, 2r - 16 = -4i. Calculate the remainder when 39 is divided by r. 3 Let y(j) = -j*2 - 9j + 1. Calculate the remainder when y(-4) is divided by (1 + -2)/((-6)/78). 8 Let b(a) = -8a + 42. What is the remainder when 84 is divided by b(3)? 12 Let l = 11 + -8. Suppose 2h - lh - 5 = 0, -5m = -h - 25. What is the remainder when 20 is divided by 5 + m + (-1 - 1)? 6 Let u = -33 + 51. Let j be (-2)/(-5) - 24/(-15). Suppose -3y - 5n + 133 = 0, 0 = 2y + jn - 53 - 41. Calculate the remainder when y is divided by u. 15 Suppose 0x - x + 5 = 0. What is the remainder when -31 + 34 + 3/(3/20) is divided by x? 3 Suppose 0 = -38a + 253 + 203. Calculate the remainder when 1042 is divided by a. 10 Let v = 12 + 3. Let g(y) = -3y. Let f(d) = 11d - 10. Let m(r) = -f(r) - 5g(r). Calculate the remainder when m(v) is divided by 18. 16 Let f = 24 + -16. Suppose 25 = -31m + 36m. Suppose -mx + b + 111 = 0, 103 = 5x - 6b + 3b. What is the remainder when x is divided by f? 7 Let k(u) = 28u*2 - u + 1. Let a be k(1). Let q = a - 9. What is the remainder when q is divided by (-44)/(-572) + 284/26? 8 Let x be (-2)/((-9)/((-45)/(-2))). Suppose -xq + 145 = -280. What is the remainder when q is divided by 29? 27 Suppose -4c = -4 - 20. Let g(p) = -2p - 2p + 2p + cp + 4. What is the remainder when 95 is divided by g(7)? 31 Suppose 2o = -4t - 256 + 16, -2o + 3t = 212. Calculate the remainder when 53 is divided by (-1536)/o - 2/(-7). 11 Let b(f) = 7f - 56. What is the remainder when b(18) is divided by 19? 13 Let j be (-355)/(-10)(5 - 3). Let c = j - -7. Calculate the remainder when c is divided by 16. 14 Suppose -2w - 5w - 525 = 0. Let l = w - -87. What is the remainder when 34 is divided by l? 10 Let o = -303 + 316. Calculate the remainder when o is divided by 10. 3 Let s be 73 + (-4 - (-8)/(-1 + 2)). Let h = s + -74. Calculate the remainder when 10 is divided by h. 1 Let g = -41 + 33. Let z = g + 12. What is the remainder when 38 is divided by z? 2 Suppose 0 = 3x - 6x + 15. Suppose -4c + 2t + 116 = 0, xt - 18 = -2c + c. What is the remainder when 110 is divided by c? 26 Suppose -5l - 12 = -9l. Suppose 4x = 2g + 310, 0 = 4x + lg - 339 + 54. Suppose -5i - 20 + x = 0. Calculate the remainder when 41 is divided by i. 8 What is the remainder when 263 + (2 - -11) + -9 is divided by 34? 29 Let u = 269 - 140. Let s = -23162 + 23188. Calculate the remainder when u is divided by s. 25 Let p(s) = s*2 + 5s + 2. Let g be p(-5). Let m be 0 + (-208)/((-4)/g). Suppose -3r - r = -m. What is the remainder when 49 is divided by r? 23 Suppose -3c = 9n - 13n - 555, c = 3n + 185. Calculate the remainder when c is divided by 6. 5 Let h = 368 - 329. Calculate the remainder when 68 is divided by h. 29 Suppose -13b + 75 = -718. Suppose 0 = -2k + 4p - 0p + 44, 0 = 5p. Calculate the remainder when b is divided by k. 17 Let c(b) = b*2 + 2b - 6. Calculate the remainder when c(5) is divided by (2 - 1)/((-18)/(-288)). 13 What is the remainder when 86 is divided by ((-180)/70)/(59/(-56) - -1)? 38 Suppose 0i = i + 8. Let x = i - -15. Let c = 6 - -5. What is the remainder when c is divided by x? 4 Suppose 14z = 12z - 52. Calculate the remainder when 48 is divided by (z/39)/(1/(-6)) + 21. 23 Let r(t) = -t2 + 18t + 12. Let o be r(13). Suppose -29 + o = 4v. What is the remainder when 46 is divided by v? 10 Let m = 9 - 6. Let y be (-2)/(12/m)-194. Suppose 0j - y = -5j - s, 5s - 48 = -2j. What is the remainder when 54 is divided by j? 16 Let f(a) = -a*3 - 16a*2 + 2a + 16. Let u be f(-16). Let v = u - -33. Calculate the remainder when v is divided by 4. 1 Let c = -2661 - -2722. What is the remainder when 853 is divided by c? 60 Calculate the remainder when 184 is divided by (-3)/(-30) + 479/10. 40 Suppose -34a + 443 = -30a - g, 5a - 558 = -3g. What is the remainder when a is divided by 28? 27 Let h(d) = 20d - 23. Let i be h(8). Suppose -5x + i + 28 = 0. What is the remainder when 62 is divided by x? 29 Let k(i) = -23i. Let z(j) = j + 3. What is the remainder when k(-6) is divided by z(7)? 8 Suppose c - 11 - 18 = 4j, 0 = -2c - j + 31. Let p(z) = -53z + 12. Calculate the remainder when p(-2) is divided by c. 16 Suppose 0 = -6k + 5k + 45. Calculate the remainder when k is divided by 12. 9 Let g(x) = -6x2 - 264x + 36. What is the remainder when 357 is divided by g(-44)? 33 What is the remainder when (-8 - (-5)/(-5))(-9 - 2) is divided by 15? 9 Calculate the remainder when 41 is divided by (-22)/(-1)1 + -11 + 10. 20 Let i = 4 - -28. What is the remainder when 67 is divided by i? 3 Let l be 1/((-4)/(-14 - -2)). Suppose 4p - 2n = 126, -ln - 87 = -3p + 15. What is the remainder when p is divided by 15? 14 Suppose -17004 = -315b + 289b. Calculate the remainder when b is divided by 166. 156 Let m = -167 + 7	{ "pile_set_name": "DM Mathematics" }
)/(-1))/j). Calculate the highest common divisor of l and y. 8 Suppose -q + 42 = -0q. Let b be (1936/55)/(-2 - q/(-20)). Calculate the highest common divisor of b and 32. 32 Suppose 10 = -2v, -5f + 0f - v + 40 = 0. Let c be 2/f + 3558/27. Calculate the highest common factor of 12 and c. 12 Suppose 4z + 3c = -213, 295 = -6z + z + 2c. Let x be -4 + z/(-9)3. What is the highest common factor of 6 and x? 3 Let c be ((-119)/(-14))/((-5)/(-80)). Calculate the greatest common factor of 68 and c. 68 Let c be ((-48)/(-10))/(27333/(-3420) - -8). What is the greatest common factor of c and 57? 19 Let k = 26 + -16. Let a(y) = 2y - 4y + 2 - 12. Let n be a(-6). What is the highest common factor of k and n? 2 Suppose -j = 3m - 39, 2j + 40m - 41m = 43. Calculate the highest common divisor of j and 156. 12 Let p = -1614 - -1620. What is the highest common divisor of p and 2274? 6 Suppose -57 = -4p + 47. Let a be -5(1 - p/5). Let t be 0 + a + (-6)/(-2). Calculate the greatest common factor of t and 4. 4 Let i(c) = -39c - 248. Let g be i(-7). Calculate the greatest common divisor of g and 20. 5 Let m(p) = 47p3 - p2 - p. Let i be m(2). What is the greatest common factor of 222 and i? 74 Let z = -15 - -106. Calculate the greatest common factor of z and 117. 13 Let i(q) = 2q - 3. Let j be i(7). Let n be (-6)/2 + j + -1. Let t be (-1)/(-3) + 164/12. What is the greatest common divisor of t and n? 7 Let n(f) = -2f3 - 13f*2 - 13f + 17. Let s be n(-9). What is the greatest common factor of s and 49? 49 Suppose 2j - 46 = -12. Let q(v) = v2 + 10v - 7. Let u be q(-12). What is the highest common divisor of u and j? 17 Suppose -o - 40 = -5m, m + 3m = -2o + 46. What is the highest common factor of 153 and m? 9 Let r = 18 + -15. Let o be r - (1 + -4 - -4). Calculate the highest common factor of o and 8. 2 Let l(i) = i2 - i + 16. Let t be (18/4)/(-1) + (-27)/(-54). Let v be l(t). Calculate the highest common factor of 8 and v. 4 Suppose -9 = l - 4l. Suppose -4z - y + 50 = 2y, -lz - 5y = -32. What is the greatest common factor of 14 and z? 14 Suppose 2b + 8j - 36 = 4j, 0 = 4b + 3j - 82. Let q = 5 + 17. Calculate the greatest common divisor of b and q. 22 Suppose 590 = 34l - 1450. What is the greatest common divisor of l and 1260? 60 Let j be (-6)/(-15) + (-16)/(-10). Suppose -44 = -jf + 28. Suppose -30s = 72 - 192. Calculate the greatest common divisor of s and f. 4 Let k be 32/12(-2898)/(-24). What is the highest common divisor of 42 and k? 14 Let r(h) = -h3 - 16h*2 - 8h + 4. Let d be r(-16). Calculate the highest common factor of 192 and d. 12 Let g = 92 - 66. Let y = 9 + 17. Suppose -d + y = 2k - 3d, 13 = k - 2d. Calculate the greatest common factor of k and g. 13 Let u(p) = -2p*2 + 76p + 89. Let j be u(39). What is the highest common factor of j and 4? 1 Let l = 15 - 43. Let y be (70/8)/((-7)/l). Calculate the highest common factor of 7 and y. 7 Let j = 2 - -5. Suppose -w = 4r - 256, 35 + 36 = r + 2w. What is the highest common factor of j and r? 7 Let n be 48 + (-12)/6 + -1. Calculate the highest common factor of 15 and n. 15 Let s = 14 + 1. Suppose 3p + p - 3x = 72, -2p + x = -34. Let q be -10(0 + (3 - p)). Calculate the highest common factor of s and q. 15 Let k(w) = 94w - 2712. Let n be k(29). Suppose 5t - 47 = 23. Calculate the greatest common divisor of t and n. 14 Suppose -2m = 0, -m - 8 = -3y + 13. Suppose -yu = -5u - 30. What is the greatest common factor of 3 and u? 3 Let y = 126 + 36. Let l = 45 - 27. Calculate the greatest common divisor of y and l. 18 Let z = -1065 + 1777. What is the highest common factor of z and 8? 8 Suppose 3w - 3p - 15 = -3, 0 = 4p + 8. Suppose 6z = 11z - 820. Let j = -162 + z. Calculate the greatest common factor of j and w. 2 Let n be 5 - (-5 + 7)(-1676)/8. Calculate the highest common divisor of n and 8. 8 Suppose 7n - 146 + 6 = 0. Suppose -8b = -4b - 320. Calculate the highest common divisor of n and b. 20 Suppose 9 - 5 = p. Let k be (-2 + 2 - -16)p. Let b = k - 22. What is the greatest common divisor of b and 28? 14 Let a(k) = -k*2 + 25k - 38. Let n be a(6). Calculate the greatest common factor of 988 and n. 76 Suppose -3j - 2j - 870 = 0. Let m be j/(-14) - 30/70. What is the highest common divisor of m and 12? 12 Let r = -331 + 388. Calculate the highest common divisor of r and 114. 57 Let z be ((3 - 7) + 10)-7. Let w be (6/(-4))/(7/z). What is the highest common factor of w and 9? 9 Suppose -7 - 11 = -5o + 3z, -9 = -4o - 3z. Suppose 5c + 246 = 3q, q + 157 = oq - c. Let h = 2 + 9. What is the greatest common divisor of h and q? 11 Let i(l) = -l*2 + 13l + 9. Let q be i(13). What is the highest common divisor of q and 63? 9 Let q be 1 + -3 + -3 + 3. Suppose f + n - 4 = 0, 2f + n - 16 = -2f. Let a be q/3(-102)/f. Calculate the highest common divisor of 34 and a. 17 Let t = -227 - -265. Calculate the greatest common divisor of t and 304. 38 Suppose -13w + 2016 = -909. Calculate the highest common factor of w and 600. 75 Let z be 8/16318/3. What is the greatest common divisor of 212 and z? 53 Suppose -5a - 409 = 5p - 1449, 0 = -p + 3a + 216. What is the greatest common factor of p and 70? 70 Suppose 2q + 8 = n - 3, 0 = -3n - q + 40. What is the highest common divisor of 52 and n? 13 Suppose 4f + 3t - 483 = 0, -2t - 358 = -0f - 3f. Suppose 0a = 5a - f. Calculate the greatest common factor of a and 192. 24 Suppose -1 = -16h - 1. Suppose h = -w, -5q + 0q + 4w + 160 = 0. What is the highest common divisor of 16 and q? 16 Suppose 216 = 8k - 5k. Let r = 88 - k. What is the greatest common factor of r and 112? 16 Suppose -q = 3x - 18, 4q = -0x - x + 116. Suppose 3b = 3l + 178 - 1, -b + 4l + 56 = 0. What is the highest common divisor of b and q? 30 Let p = -109 - -354. Calculate the highest common factor of 280 and p. 35 Let r(n) = 12n*3 - 4n*2 - 2. Let a be r(3). Let d = -130 + a. What is the highest common factor of 39 and d? 39 Suppose 2w + p - 123 = 0, 162 = 4w + 5p - 75. What is the greatest common divisor of 14 and w? 7 Let b = 9 - 106. Let z = b - -102. What is the greatest common factor of 5 and z? 5 Suppose 8 = 2l - 10. Let f = l - 15. Let p be (2 + 1)(-8)/f. What is the highest common factor of 10 and p? 2 Let u = 6 + -4. Let n(t) = t*2 - 19t + 36. Let b be n(17). Suppose -z - 13 = -2m, m + bz - 20 = -uz. Calculate the highest common divisor of m and 8. 8 Let s = -29 - -19. Let o = s - -26. What is the greatest common divisor of o and 16? 16 Suppose 51894 = -1148z + 1166z. What is the highest common divisor of 93 and z? 93 Let k be (-4)/(-26) + 2/(-13). Suppose 4p - 6p - 242 = k. Let n = 247 + p. What is the greatest common divisor of n and 18? 18 Let p be 48/((15/6 - 2) + 1). Let h = 6 - 3. Let c(a) = a2 - 3a + 4. Let d be c(h). Calculate the greatest common factor of d and p. 4 Let g(z) = -5z. Let y = -18 + 17. Let u be g(y). Suppose ui = -59 + 259. Calculate the greatest common divisor of 16 and i. 8 Suppose -3h = w + 3w - 12, 0 = 5h. Let l be 4(w - 39/12). Let v be l/(-5) + 1279/5. What is the highest common factor of v and 32? 32 Suppose -8d + 2m - 11 = -13d, -3d + 11 = -m. Calculate the highest common divisor of d and 21. 3 Let j(m) = -m + 12. Let i be j(9). Suppose 0g - 5g + 30 = -s, 3g + 36 = -is. Let h be (6/s)/((-1)/15). What is the greatest common divisor of 2 and h? 2 Let p = -41 - -52. Suppose pj = 507 + 21. What is the highest common divisor of j and 120? 24 Let l be 41 - (3 + -7 + 4)/3. Calculate the greatest common factor of 246 and l. 41 Let t = 262 - 122. Suppose 3w - 2w + 5g = 25, 4w + 4g = 36. Suppose -2s + 2l + 26 = -s, 94 = ws + 2l. Calculate the greatest common divisor of t and s. 20 Let o be 3/1 - (-5)/(-5). Let r be (0 + o)(-130)/(-20). Let k = r + 15. What is the highest common factor of 140 and k? 28 Let g(q) = -10q3 + q2 + 6q + 5. Let k be g(-5). Calculate the highest common divisor of 10 and k. 10 Let h = 1931 - 1915. Calculate the greatest common factor of h and 5392. 16 Suppose 0 = -3n, -4n - 32 - 2 = -2z. Calculate the highest common divisor of 1 and z. 1 Suppose 3u = -3f - 3, 0 = 5f - u - 6 - 19. Let x be -6((-980	{ "pile_set_name": "DM Mathematics" }
- 6z - 11z*4 + 8z4 - z3 = 0. -1, 1 Let m(f) be the first derivative of 1/16f4 + 0f*2 + 0f - 3 + 0f5 + 0f*3 - 1/24f*6. Suppose m(z) = 0. Calculate z. -1, 0, 1 Let q(n) = 5n*2 + 6n + 5. Suppose h - 4 = 2h. Let f(r) = 14r*2 + 17r + 14. Let a(z) = hf(z) + 11q(z). Let a(c) = 0. What is c? -1 Suppose 2n = -4d + 56, -3n = -d + 2n - 8. Suppose -d = 5s + 4m, 2m + 3 = -3. Find y, given that 5/2y4 + y5 - 1/2y2 - 1/2y + s + 3/2y3 = 0. -1, 0, 1/2 Let k be (2/3)/(-1 - 119/(-105)). Let g(h) be the third derivative of -h2 - 1/120h*6 + 0h*4 + 0h + 0h3 + 0 + 1/60hk. Factor g(p). -p2(p - 1) Let b(d) be the third derivative of d5/15 + d4 - 14d*3/3 + 11d*2. Determine m, given that b(m) = 0. -7, 1 Let b be 12/4525/10. Let -1/3v2 + bv - 1/3 = 0. Calculate v. 1 Let q be 2/6 - (-5)/(-15). Suppose -v = -qv. Factor -1/3o*2 + 2/3o + v. -o(o - 2)/3 Let c(r) be the first derivative of 4r5/5 - r4 - 12r3 - 22r*2 - 16r + 2. Solve c(o) = 0. -1, 4 Let i(u) = -3u2 + 3. Let h(m) = 9 - 5 - 4m*2 + 0. Let c(o) = -2h(o) + 3i(o). Factor c(d). -(d - 1)(d + 1) Let b(u) = 144u3 + 78u*2 - 27u + 27. Let d(v) = 11v3 + 6v*2 - 2v + 2. Let n(i) = -2b(i) + 27d(i). Factor n(c). 3c2(3c + 2) Suppose 2g = g + 2. Let d(f) be the second derivative of -f + 0 + 1/24f4 - 1/6f*3 + 1/4fg. Determine r so that d(r) = 0. 1 Let p(z) be the third derivative of -z8/840 - z7/75 - z6/20 - 13z5/150 - z4/15 + 31z*2. Determine n, given that p(n) = 0. -4, -1, 0 Let j be 105/1050 - 22/(-5). Determine a, given that -3 - ja - 3/2a2 = 0. -2, -1 Find k such that -3/2k - k*2 + 0 + 1/2k*3 = 0. -1, 0, 3 Let p(d) be the first derivative of -3 + 0d*3 + 0d*2 + 2/5d*5 + 0d + 1/2d4. Factor p(w). 2w*3(w + 1) Solve 8h2 + 10h*2 - 1 - 2 + 10h*3 + 14h + 2h4 + 7 = 0. -2, -1 Let a(x) be the second derivative of -x6/12 - x5/20 - 12x. Find q such that a(q) = 0. -2/5, 0 Let r(g) = 5g5 - 8g*4 - 25g*3 + 8g*2 + 40g + 17. Let m(j) = -j4 + j2 - 1. Let c(o) = -3m(o) + r(o). Factor c(u). 5(u - 2)*2(u + 1)*3 Let k(w) = 12w*4 + 42w*3 + 48w*2 + 18w. Let m(t) = t3 + t2 - t - 1. Let d(o) = -k(o) + 3m(o). Factor d(s). -3(s + 1)*3(4s + 1) Let b(l) be the first derivative of l6/33 - 3l*4/22 - 4l*3/33 - 17. Solve b(a) = 0 for a. -1, 0, 2 Let w(g) be the first derivative of -2g*5/15 - 5g*4/12 - 2g*3/9 + 11. Let w(u) = 0. Calculate u. -2, -1/2, 0 Let j(y) = -5y*2 + 7y - 3. Let b be j(-7). Let l be 1/(-5) + b/(-385). Factor -6/7k3 - lk*2 + 2/7k + 0. -2k(k + 1)(3k - 1)/7 Let q(p) = 2p4 + 2p*3 - 2p*2 + 3p. Let a(w) = 3w4 + 2w*3 - 3w*2 + 2w. Let n(u) = 5a(u) - 4q(u). Let n(y) = 0. Calculate y. -1, -2/7, 0, 1 Factor 8c + 1/3c*3 - 3c2 - 16/3. (c - 4)2(c - 1)/3 Let m = -12 - -17. Factor 46x*3 - 2x + 10x3 + mx*2 - 4 - 2x*2 + 37x*2. 2(2x + 1)2(7x - 2) Let z be (-297)/154(1 - 23/3). Factor 48/7s + 8/7 + 50/7s*3 + zs*2. 2(s + 1)(5s + 2)2/7 Let i(l) be the third derivative of -l6/480 + l*4/8 - 2l*3/3 - 10l*2. Find n such that i(n) = 0. -4, 2 Let j(q) be the first derivative of 25q*6/9 - 4q*5 - 11q*4/6 + 8q*3/3 + 4q*2/3 - 7. Determine l, given that j(l) = 0. -2/5, 0, 1 Let b(r) = r + 2. Let k be b(-8). Let d be k/(-27) - (-2)/(-9). Factor 2/3p*3 - 2/3p + d + 0p2. 2p(p - 1)(p + 1)/3 Solve -4 + 6i2 + 2i*3 + 4i - i*4 + 0i*2 + 9i*2 - 4i*4 = 0. -1, 2/5, 2 Let x be -2(-5 - (-49)/14). Factor 9/5o + 6o*2 + 1/5 + 33/5o*4 + 9/5o*5 + 46/5ox. (o + 1)3(3o + 1)*2/5 Let i = -2/77 - -85/308. Suppose 4u - 28 = 2b - 6b, 2u + 16 = 4b. Factor 1/2x3 + 1/4 - 1/2x*u + 1/4x*4 - ix - 1/4x5. -(x - 1)3(x + 1)*2/4 Suppose 0 = 4d - 7d - 630. Let u be (-1029)/d - (-2)/(-5). Solve -7/2k*4 + uk + 5/2k2 + 1 - 9/2k3 = 0. -1, -2/7, 1 Let f(o) be the second derivative of o8/336 - o6/40 + o5/30 - 3o2 + o. Let m(b) be the first derivative of f(b). Factor m(i). i2(i - 1)*2(i + 2) Let n(j) be the third derivative of -j6/180 - j5/30 + 4j3/9 - 27j*2. Determine v, given that n(v) = 0. -2, 1 Let y = 148/99 - 14/11. Let 2/9g*2 + yg + 0 = 0. What is g? -1, 0 Let v(x) = -x*3 + 7x*2 - x + 10. Let l be v(7). Let s = l + -3. Let -1/3n*2 - 4/3n*3 + s + 0n = 0. What is n? -1/4, 0 Let h be 1/2(-24 + 27). Factor 0j*4 - hj + 0j2 - 3/2j*5 + 0 + 3j*3. -3j(j - 1)2(j + 1)2/2 Let u(t) = -t2 - 5t - 4. Let o be u(-4). Let g be o - (0 - 3 - -1). Factor -2z*g + 1 + 4z + 0z2 - 3. -2(z - 1)2 Let m(g) be the third derivative of g8/1008 + 2g7/315 + g6/90 + 15g*2. Find z such that m(z) = 0. -2, 0 Let y = 15 + -179/12. Let r(h) be the first derivative of -3 + 1/8h*2 + 0h - yh3. Factor r(o). -o(o - 1)/4 Let o = 143/672 - -7/96. Factor 2/7x2 + ox - 4/7. 2(x - 1)(x + 2)/7 Let b(y) = 4y2 + 4y - 14. Let t(w) = 1. Let o(n) = b(n) + 6t(n). Factor o(q). 4(q - 1)(q + 2) Let t = 448/2771 - -12/163. Factor 0 + ts - 2/17s2. -2s(s - 2)/17 Let z be 6/(-3)-5(-9)/(-270). Factor zm*2 + 0m + 0. m*2/3 Factor 81m + 189m2 - 53 - 36 - 3 - 70 + 9m*4 + 75m*3. 3(m + 3)*3(3m - 2) Suppose 0 = -5j + 4w + 26, -5j - 2w = -16 - 16. Let s(g) be the second derivative of 0g*4 + 0g*5 + 0g*3 + 0 - 2g + 0g2 - 1/120gj. Factor s(r). -r4/4 Let b be 0/(1(0 - 1)). Factor 4h2 - h3 - 3h2 + h4 + bh*4 - 3h2. h2(h - 2)(h + 1) Let -o - 5o2 + 5o*3 - 5o*2 - 20 - 34o = 0. Calculate o. -1, 4 Let j be 14(-1)/(-2) - 2. Suppose 4c = -3f + 5, -j = -0c - 2c + f. Determine i so that -2i*2 - 2i + i*2 + 4i*c + 4 - 6i = 0. 2/3, 2 Suppose -4k = -m - 17, 5k = 3m - 0m + 16. Let j(n) be the third derivative of 1/96n4 + n2 + 0n - 1/24nm + 0 + 1/240n*5 - 1/480n6. Factor j(h). -(h - 1)2(h + 1)/4 Let q(o) = -2o*3 + 3o*2 + 5o + 6. Let u be 4/(-6) + 70/6. Let x(w) = -4w3 + 6w*2 + 9w + 11. Let t(j) = uq(j) - 6x(j). Factor t(v). v(v - 1)(2v - 1) Let b(o) = o3 - 6o*2 + 15o - 48. Let z be b(5). Find c, given that -2/3c + 0c*3 - 1/3c4 + 0 + cz = 0. -2, 0, 1 Factor 1/4r2 + 0r + 0r3 + 0 - 1/4r4. -r2(r - 1)(r + 1)/4 Let q(z) = z*3 - 4z*2 + 4z + 1. Let c be q(3). Solve -k + k + 2k2 + 2k - ck - 4 = 0. -1, 2 Let d(r) be the second derivative of 2r*4/33 - 4r3/33 + r2/11 - 17r + 3. Factor d(h). 2(2h - 1)2/11 Let k be (-10)/(-2) + 238/(-51). Factor h - h2 - k + 1/3h3. (h - 1)3/3 Let b = 2 - 30. Let y be 0 - 0 - 7/b. Solve 1/2 - 1/4l2 - yl = 0 for l. -2, 1 Factor -u + 10 + 7u2 + 6u - 2u2 + 10u. 5(u + 1)(u + 2) Suppose 4t - 13 - 7 = 0. Let d be (t/(-2))/(5/(-10)). Determine j, given that 28j*3 + 51j + dj + 60j*2 + 16 - 10j*3 = 0. -2, -2/3 Let x(k) = -4k*2 - 6k + 10. Let s(o) = -5o2 - 6o + 11. Let d(t) = 6s(t) - 7x(t). Factor d(r). -2(r - 2)(r - 1) Let y = -10 - -12. Factor -15g - 3 + 21g - yg2 - g2. -3(g - 1)*2 Factor 7l*2 + 2l*2 + 2l*2 - 8l*2. 3l*2 Suppose 5o - 4o = 0, t = 4o. Let c(g) be the first derivative of -1/2g2 - 2/3g*3 + tg + 1 - 1/4g4. Factor c(l). -l(l + 1)2 Let o(v) be the first derivative of -v5/70 + v*4/42 + 2v*3/21 - 6v - 5. Let t(b) be the first derivative of o(b). Factor t(k). -2k(k - 2)(k + 1)/7 Let a(u) be the third derivative of -1/360u*6 - 1/90u*5 + 1/315u*7 + 0u + 0 + 1/72u4 + 0u*3 - 9u*2. Suppose a(k) = 0. What is k? -1, 0, 1/2, 1 Let z = 18/257 - 6235/4626. Let y = 1/18 - z. Factor -1/3c*2 + 4/3c - y. -(c - 2)*2/3 Let o(s) be the first derivative of 9s*5/25 + 3s*4/4 - 14s*3/5 - 6s*2 + 24s/5 - 31. Let o(k) = 0. Calculate k. -2, 1/3, 2 Let r(i) = -i*2 + 2i - 1. Let y be r(3). Let u = y - -7. Factor -l*2 - 3l*2 - 6l*3 + 1 + ul*2 + 2l*3 + 4l. -(l - 1)(l + 1)(4l + 1) Let y(c) = -2c*2 - 9c + 1. Let j(o) = -3o2 - 14o + 1. Let i(v) = -5j(v) + 8y(v). Solve i(m) = 0. -3, 1 Let w(r) be the second derivative of r10/60480 - r8/6720 + r6/1440 + r4/4 - 2r. Let g(k) be the third derivative of w(k). Factor g(n). n(n - 1)*2(n + 1)**2/2	{ "pile_set_name": "DM Mathematics" }
ext term in -94, -416, -950, -1696, -2654, -3824, -5206? -6800 What is the next term in -22, -32, -20, 26, 118, 268? 488 What comes next: 6619, 6555, 6489, 6421, 6351? 6279 What comes next: -137, -341, -617, -965, -1385? -1877 What is the next term in -142325, -142333, -142343, -142355? -142369 What is next in 7017, 7205, 7519, 7959, 8525? 9217 What is next in 305017, 305020, 305023, 305026, 305029? 305032 What is the next term in 8, 164, 588, 1412, 2768, 4788, 7604? 11348 What is the next term in -27, -127, -363, -789, -1459? -2427 What comes next: 173129, 346258, 519387? 692516 What comes next: -14904, -14907, -14900, -14877, -14832, -14759? -14652 What is next in -1681, -3356, -5021, -6676? -8321 What is the next term in -383, -1186, -2819, -5696, -10231, -16838, -25931? -37924 What is next in -1534, -3138, -4826, -6604, -8478, -10454? -12538 What is next in 13, -105, -379, -881, -1683, -2857, -4475, -6609? -9331 What is the next term in 18, -33, -72, -99? -114 What is next in 798, 2676, 5806, 10188, 15822, 22708? 30846 What is the next term in 12, 0, -14, -30, -48, -68, -90? -114 What is next in 115, -132, -435, -794, -1209, -1680? -2207 What is next in 346, 1298, 2884, 5104? 7958 What is the next term in 16, 29, 30, 19, -4, -39? -86 What comes next: 49, -140, -531, -1226, -2327, -3936, -6155? -9086 What comes next: -87, -224, -361, -498, -635, -772? -909 What is next in -110, -437, -992, -1775, -2786, -4025? -5492 What is next in -459, -805, -1117, -1377, -1567? -1669 What is the next term in -14, -50, -106, -182? -278 What comes next: -348, -1433, -3250, -5805, -9104, -13153, -17958, -23525? -29860 What is the next term in -278, -906, -1534, -2162? -2790 What is the next term in -133, -79, 39, 239, 539, 957? 1511 What is next in 212, 293, 374? 455 What comes next: 15326, 15325, 15322, 15317, 15310? 15301 What is next in 1068, 1813, 2558, 3303, 4048, 4793? 5538 What is next in 28, -52, -186, -374, -616, -912, -1262? -1666 What is the next term in -2930, -5829, -8728, -11627? -14526 What comes next: -2618, -5138, -7636, -10100, -12518? -14878 What is the next term in -3069, -6156, -9243, -12330, -15417? -18504 What comes next: -1963, -3975, -6039, -8155? -10323 What is next in -1280, -1122, -858, -488, -12, 570? 1258 What is the next term in -18561, -18562, -18563, -18564? -18565 What is the next term in 181, 248, 353, 490, 653, 836, 1033, 1238? 1445 What is next in -70089, -70074, -70059? -70044 What is next in -4193, -16563, -37107, -65831, -102741, -147843, -201143? -262647 What is the next term in -3045, -3040, -3045, -3072, -3133? -3240 What is the next term in 400, 792, 1180, 1564, 1944, 2320, 2692? 3060 What comes next: -5581548, -5581546, -5581544, -5581542? -5581540 What comes next: -11, -23, -57, -119, -215, -351, -533, -767? -1059 What is the next term in 147, 192, 295, 456? 675 What is next in 8719, 9201, 9683, 10165, 10647, 11129? 11611 What is the next term in -10401, -20810, -31219, -41628, -52037, -62446? -72855 What comes next: 23706, 23704, 23702, 23700, 23698, 23696? 23694 What is next in -19963, -39929, -59895, -79861? -99827 What comes next: 27, 288, 1099, 2760, 5571? 9832 What is next in -580, -786, -994, -1204, -1416, -1630? -1846 What comes next: -3866, -15454, -34768, -61808? -96574 What is the next term in -15770, -31543, -47314, -63083, -78850, -94615, -110378? -126139 What is the next term in -2, -1, 36, 139, 338, 663, 1144, 1811? 2694 What is next in -21790, -21792, -21792, -21790, -21786, -21780, -21772? -21762 What is the next term in 13264, 26523, 39774, 53017, 66252? 79479 What comes next: -7998, -8094, -8190? -8286 What is next in 39, 84, 247, 588, 1167, 2044, 3279? 4932 What is next in 7580, 7570, 7548, 7508, 7444? 7350 What comes next: -1844092, -1844091, -1844090, -1844089, -1844088, -1844087? -1844086 What is next in -1380, -5309, -11792, -20829, -32420, -46565? -63264 What is the next term in 40, 95, 194, 361, 620, 995? 1510 What is next in 25, -25, -99, -209, -367, -585, -875, -1249? -1719 What comes next: 52, 44, 6, -62, -160, -288? -446 What comes next: 105890, 105891, 105884, 105863, 105822, 105755, 105656, 105519? 105338 What is the next term in -1270, -1271, -1274, -1279, -1286, -1295? -1306 What comes next: 97, 166, 203, 202, 157, 62, -89? -302 What comes next: -13520, -27043, -40578, -54131, -67708? -81315 What comes next: 4449, 5017, 5571, 6105, 6613, 7089, 7527, 7921? 8265 What is the next term in 29210, 58346, 87494, 116660, 145850? 175070 What is next in -11333, -45379, -102127, -181577, -283729? -408583 What is the next term in 18499, 18473, 18415, 18313, 18155, 17929, 17623, 17225? 16723 What comes next: -72, -451, -1404, -3219, -6184, -10587, -16716, -24859? -35304 What is next in -245473, -245479, -245485, -245491, -245497, -245503? -245509 What is the next term in -80, -159, -224, -269, -288, -275? -224 What is the next term in 256, 277, 326, 415, 556, 761, 1042, 1411? 1880 What is next in -31302, -31199, -31096? -30993 What comes next: 1520, 1525, 1532, 1541, 1552? 1565 What comes next: -53866, -53850, -53844, -53854, -53886, -53946, -54040? -54174 What comes next: 3687, 3698, 3717, 3744, 3779, 3822? 3873 What is next in -959742, -959740, -959738? -959736 What is the next term in -3, -29, -63, -99, -131, -153, -159? -143 What is the next term in -8425, -16822, -25207, -33574, -41917, -50230? -58507 What comes next: 1982184, 1982188, 1982194, 1982202, 1982212? 1982224 What is the next term in -11650, -93228, -314664, -745888, -1456830, -2517420, -3997588? -5967264 What comes next: -59059, -59087, -59127, -59185, -59267, -59379? -59527 What comes next: -10627, -21254, -31881, -42508, -53135, -63762? -74389 What comes next: 1014158, 2028316, 3042474, 4056632, 5070790, 6084948? 7099106 What is the next term in -1746, -7008, -15776, -28050, -43830, -63116? -85908 What is the next term in -331912, -331913, -331914, -331915, -331916, -331917? -331918 What is the next term in -997, -8039, -27151, -64369, -125729, -217267? -345019 What is next in 1243, 1343, 1509, 1741, 2039? 2403 What is next in 850543, 850544, 850545, 850546? 850547 What is next in -12193, -12190, -12179, -12154, -12109, -12038, -11935, -11794? -11609 What comes next: -2321, -2325, -2329, -2333, -2337, -2341? -2345 What is the next term in -36431, -36515, -36597, -36677, -36755? -36831 What is next in -43868, -43874, -43880, -43886, -43892? -43898 What is next in -537, -877, -1217, -1557, -1897, -2237? -2577 What is next in -329, -335, -389, -515, -737, -1079, -1565, -2219? -3065 What is next in 55155, 55153, 55151? 55149 What is next in 6531, 6521, 6511, 6501, 6491, 6481? 6471 What is the next term in 1654, 2040, 2426, 2812, 3198, 3584? 3970 What is the next term in 323, 751, 1419, 2447, 3955, 6063, 8891? 12559 What is the next term in 594, 519, 444? 369 What is next in 9935, 9930, 9925, 9920, 9915, 9910? 9905 What is next in 48, 137, 372, 825, 1568, 2673, 4212, 6257? 8880 What is the next term in 6529, 6611, 6693, 6775? 6857 What is the next term in 2438216, 2438215, 2438212, 2438207? 2438200 What comes next: 209, 825, 1851, 3293, 5157, 7449, 10175, 13341? 16953 What comes next: 142425, 142426, 142427, 142428, 142429? 142430 What comes next: -2634, -2622, -2602, -2574, -2538, -2494, -2442? -2382 What is the next term in 43878, 43881, 43884, 43887, 43890, 43893? 43896 What is next in -1832, -3613, -5402, -7205, -9028? -10877 What is the next term in 15, 274, 785, 1548, 2563, 3830, 5349? 7120 What comes next: -104, -91, -2, 199, 548, 1081? 1834 What comes next: 153, 435, 847, 1389, 2061, 2863, 3795? 4857 What comes next: 2875, 2872, 2855, 2818, 2755? 2660 What is next in -936, -3567, -7960, -14121, -22056? -31771 What comes next: -653, -508, -373, -254, -157, -88, -53, -58? -109 What is next in -676, -556, -436, -316? -196 What is the next term in -65867, -65870, -65863, -65840, -65795, -65722, -65615? -65468 What comes next: -3314, -6629, -9944, -13259, -16574, -19889? -23204 What comes next: 986, 1962, 2938? 3914 What comes next: -1302, -1306, -1310, -1314, -1318, -1322? -1326 What comes next: 2630, 10482, 23562, 41864, 65382? 94110 What comes next: -522, -561, -628, -723? -846 What comes next: -8693, -8683, -8673, -	{ "pile_set_name": "DM Mathematics" }
he remainder when 84201 is divided by 3872? 2889 Calculate the remainder when 1662484 is divided by 78. 70 Calculate the remainder when 401753 is divided by 5414. 1117 What is the remainder when 64261 is divided by 7962? 565 What is the remainder when 15936974 is divided by 9? 8 What is the remainder when 22615433 is divided by 33? 5 What is the remainder when 25019761 is divided by 61173? 4 What is the remainder when 23890862 is divided by 1039? 96 What is the remainder when 350308 is divided by 11878? 5846 What is the remainder when 56202 is divided by 39173? 17029 What is the remainder when 76617 is divided by 38286? 45 Calculate the remainder when 2193087 is divided by 1111. 1084 Calculate the remainder when 691944 is divided by 445. 414 What is the remainder when 1612334 is divided by 106? 74 Calculate the remainder when 62074 is divided by 8780. 614 What is the remainder when 81792477 is divided by 2331? 18 Calculate the remainder when 16966 is divided by 999. 982 What is the remainder when 31060800 is divided by 1785? 15 What is the remainder when 17558 is divided by 14284? 3274 What is the remainder when 96674 is divided by 2288? 578 Calculate the remainder when 3355429 is divided by 188. 5 What is the remainder when 113124 is divided by 1380? 1344 What is the remainder when 2112 is divided by 1916? 196 Calculate the remainder when 974129 is divided by 276. 125 Calculate the remainder when 4510277 is divided by 457. 144 Calculate the remainder when 19989 is divided by 404. 193 What is the remainder when 11059085 is divided by 3686359? 8 What is the remainder when 49855348 is divided by 164539? 31 What is the remainder when 595118 is divided by 21? 20 Calculate the remainder when 1553163700 is divided by 91. 88 What is the remainder when 67425139 is divided by 59? 57 Calculate the remainder when 851435 is divided by 212827. 127 Calculate the remainder when 1177018 is divided by 3748. 146 Calculate the remainder when 1422698 is divided by 7. 4 Calculate the remainder when 372745 is divided by 2271. 301 Calculate the remainder when 215514 is divided by 53859. 78 What is the remainder when 591960 is divided by 84? 12 What is the remainder when 164348224 is divided by 14? 12 Calculate the remainder when 158664689 is divided by 54. 53 What is the remainder when 88626658 is divided by 4688? 18 Calculate the remainder when 2362386 is divided by 214762. 4 What is the remainder when 14898069 is divided by 5? 4 Calculate the remainder when 76140 is divided by 18933. 408 Calculate the remainder when 674948 is divided by 4588. 512 Calculate the remainder when 1075259 is divided by 1559. 1108 Calculate the remainder when 1471794 is divided by 781. 390 What is the remainder when 7148560 is divided by 17? 9 Calculate the remainder when 4327754 is divided by 8074. 90 Calculate the remainder when 4421885 is divided by 2076. 5 What is the remainder when 40173516 is divided by 739? 737 Calculate the remainder when 34878827 is divided by 70. 67 What is the remainder when 13084656 is divided by 21? 18 Calculate the remainder when 28137 is divided by 287. 11 Calculate the remainder when 2281368 is divided by 253482. 30 Calculate the remainder when 10071309 is divided by 10071297. 12 Calculate the remainder when 2618952 is divided by 1643. 10 Calculate the remainder when 68587118 is divided by 186378. 14 Calculate the remainder when 874704 is divided by 2. 0 What is the remainder when 16202438 is divided by 26? 18 What is the remainder when 403887 is divided by 6620? 67 What is the remainder when 129987 is divided by 5492? 3671 Calculate the remainder when 210073092 is divided by 2401. 2399 Calculate the remainder when 1237765 is divided by 758. 709 Calculate the remainder when 5194164 is divided by 934. 190 What is the remainder when 348493 is divided by 302? 287 Calculate the remainder when 689769 is divided by 945. 864 What is the remainder when 16535 is divided by 188? 179 Calculate the remainder when 14502 is divided by 2781. 597 Calculate the remainder when 66446 is divided by 22136. 38 Calculate the remainder when 3280520 is divided by 48. 8 Calculate the remainder when 117733 is divided by 1198. 329 What is the remainder when 10332514 is divided by 684? 10 Calculate the remainder when 6125794 is divided by 302. 26 Calculate the remainder when 313028 is divided by 155648. 1732 Calculate the remainder when 61952320 is divided by 31. 29 Calculate the remainder when 3701 is divided by 3640. 61 What is the remainder when 70887632 is divided by 45? 32 Calculate the remainder when 148336 is divided by 32. 16 What is the remainder when 31750350 is divided by 901? 11 What is the remainder when 34321201 is divided by 19? 0 What is the remainder when 40325998 is divided by 41? 38 What is the remainder when 19753832 is divided by 3199? 7 Calculate the remainder when 383682 is divided by 529. 157 Calculate the remainder when 304877 is divided by 38093. 133 What is the remainder when 550414 is divided by 78330? 2104 Calculate the remainder when 27269 is divided by 416. 229 What is the remainder when 25509 is divided by 6886? 4851 Calculate the remainder when 371919 is divided by 371919. 0 Calculate the remainder when 8406591 is divided by 1918. 1915 Calculate the remainder when 1011288 is divided by 53204. 412 Calculate the remainder when 2392513 is divided by 794. 191 What is the remainder when 50530346 is divided by 1950? 1946 What is the remainder when 58176 is divided by 104? 40 Calculate the remainder when 143875272 is divided by 42. 30 Calculate the remainder when 12313077 is divided by 181. 9 What is the remainder when 89623 is divided by 22120? 1143 Calculate the remainder when 49722 is divided by 3161. 2307 What is the remainder when 10858537 is divided by 17542? 39 Calculate the remainder when 26658734 is divided by 39. 11 What is the remainder when 171975 is divided by 1749? 573 Calculate the remainder when 2070018 is divided by 750. 18 What is the remainder when 3208976 is divided by 38662? 30 Calculate the remainder when 3388052 is divided by 34928. 36 What is the remainder when 11035928 is divided by 943? 942 Calculate the remainder when 114822973 is divided by 14687. 7 What is the remainder when 95682 is divided by 11813? 1178 What is the remainder when 2685861 is divided by 383609? 598 Calculate the remainder when 192251 is divided by 61278. 8417 Calculate the remainder when 6568761 is divided by 81. 66 What is the remainder when 44371079 is divided by 76? 75 Calculate the remainder when 1964018 is divided by 129. 122 What is the remainder when 94757 is divided by 93415? 1342 Calculate the remainder when 48007 is divided by 23972. 63 What is the remainder when 129732711 is divided by 18533243? 10 Calculate the remainder when 2527937 is divided by 1263860. 217 Calculate the remainder when 13044036 is divided by 82. 50 What is the remainder when 11870218 is divided by 3956735? 13 Calculate the remainder when 28501998 is divided by 3569. 3533 What is the remainder when 695164 is divided by 44? 8 Calculate the remainder when 56103 is divided by 2099. 1529 What is the remainder when 98089 is divided by 487? 202 Calculate the remainder when 1035777 is divided by 64736. 1 What is the remainder when 651757 is divided by 108259? 2203 Calculate the remainder when 1172976130 is divided by 449. 448 What is the remainder when 1119929 is divided by 48? 41 Calculate the remainder when 3241991 is divided by 400. 391 Calculate the remainder when 703689 is divided by 72. 33 Calculate the remainder when 3242820 is divided by 1177. 185 Calculate the remainder when 6378414 is divided by 645. 9 Calculate the remainder when 15175025 is divided by 5058319. 68 What is the remainder when 78154 is divided by 5194? 244 Calculate the remainder when 561334 is divided by 70161. 46 What is the remainder when 485475 is divided by 484173? 1302 What is the remainder when 318314120 is divided by 1291? 1287 Calculate the remainder when 1805744 is divided by 1388. 1344 Calculate the remainder when 56513 is divided by 1046. 29 Calculate the remainder when 1301242 is divided by 35. 12 Calculate the remainder when 5070048 is divided by 2460. 2448 What is the remainder when 410392 is d	{ "pile_set_name": "DM Mathematics" }
2) assuming n is positive. n(-287/22) Simplify (m(-1))*(-10/9)/((mm/(m/(m(m/((m/m2)/m))/m)))/(mm(-5))) assuming m is positive. m(-62/9) Simplify a*(-12/5)/((a/(aa*(-38)a))/a) assuming a is positive. a(-192/5) Simplify ((r/(r/((r/r8)/r)))/rrr/(r/(rr1)))/(r0/(r/(r(3/2)/r))) assuming r is positive. r(-11/2) Simplify (m(-6)/m)(-4/5) assuming m is positive. m(28/5) Simplify (((bb/(b/(b/(b*(2/7)b))b))/b)/(bb*(1/7)))/(bb*(-4)b(-3)) assuming b is positive. b(25/7) Simplify (f(1/2))(-18/5)(f(f/(f/((fff*2f)/ff)))/f)/(f(1/6)/f) assuming f is positive. f(121/30) Simplify (r(-6)r1)/(r/(r/r1r))39 assuming r is positive. r(-5) Simplify (z(-5/6)z(-3))/(z0/zz)(-16) assuming z is positive. z(-23/6) Simplify (q(-1))(-37)(q/(q1/q))(2/9) assuming q is positive. q(335/9) Simplify ((y(-4)/y)/(y/y6))/(y(1/10)y/(((yy(-4))/y)/y)) assuming y is positive. y(-61/10) Simplify s*(-7)ss(-1/6)s(-7)/(s/(s/(s(-2/3)s)s)) assuming s is positive. s*(-25/2) Simplify hh*(-4/29)hhh9 assuming h is positive. h(344/29) Simplify (r/(rr/r(2/5)r))*(2/31)(r*1r)(-3/8) assuming r is positive. r(-529/620) Simplify f*(-4/25)/ff(-23) assuming f is positive. f(-604/25) Simplify (o*(2/5)o(3/2))/(o(6/5)(oo0)/o) assuming o is positive. o(7/10) Simplify (f*(5/6)/(ff/(f/(ff(-3/7)f))ff))/((f(-2/7)/f)/f(2/3)) assuming f is positive. f(-25/14) Simplify (v(-1/2)vv/(vv(1/13)))(-4/3) assuming v is positive. v(-22/39) Simplify (tt((t(-12)/t)/t)/tt)/t(1/9) assuming t is positive. t(-109/9) Simplify l*(3/10)l0/l assuming l is positive. l(-7/10) Simplify ((ii/(i(ii/(i/(ii/(i/((i*(-2/21)/i)/i)i))))/i))/iii(2/13))(-2/5) assuming i is positive. i(-1774/1365) Simplify j(-5/6)j/(jj*(-8)j)j assuming j is positive. j(43/6) Simplify (b/(bb/(bb(2/7)b))b/b0)49 assuming b is positive. b112 Simplify (r33/r)/(r(8/13)r) assuming r is positive. r*(395/13) Simplify (((kk(2/3))/k)(2/71))(1/63) assuming k is positive. k(4/13419) Simplify ((ff/f(2/25))/f)(-49) assuming f is positive. f(-1127/25) Simplify m(-3)/(m/m0)(m(2/7))38 assuming m is positive. m(48/7) Simplify (p/((p1/p)/ppp))14/(p/p(2/5))(-22) assuming p is positive. p(66/5) Simplify vv/v(-1/4)vv/v4 assuming v is positive. v(1/4) Simplify (o(-2/3)/(oo4))/((o/(o/((o/(o/o0))/o)))/(o*(-2/7)/oo)) assuming o is positive. o*(-104/21) Simplify (hh/(h*(-2)/h)h(1/8))(-34) assuming h is positive. h*(-697/4) Simplify ((uu11)/u)(1/5) assuming u is positive. u(11/5) Simplify ((((y/(y(-6)/y))/yy)/y)/y)/y4(y/((y/y*0)/y))/(y(y(y/y2y)/yy)/yy) assuming y is positive. y Simplify (p/(pp(pp0p)/p))(-1/4)/(p(-5/2)/((p*(-8)p)/p)) assuming p is positive. p(-5) Simplify ((x/(x/x10))/xxx)(8/3) assuming x is positive. x(88/3) Simplify (v(-7/2))(-2/39) assuming v is positive. v*(7/39) Simplify h(hh(h/(h((h(1/7)h)/hh)/h))/h)/hhh/h1h/(h/h*(1/3))hhh/(hh(-4))h assuming h is positive. h*(193/21) Simplify (aa*6a)/a*(-6)a(2/33)/a(-8) assuming a is positive. a(728/33) Simplify (y/(y/(((((y/(((y/(y(-1/4)y)y)/yy)/y))/yy)/y)/yy)/y)))(-2/11)((y/(y/((y/(((y/y*(-1))/yy)/yy))/y)))/y)(-15) assuming y is positive. y(995/22) Simplify (k13/k)(-6/5) assuming k is positive. k(-72/5) Simplify ((xx10)/x(-1/6))/(x(-2))(3/10) assuming x is positive. x*(353/30) Simplify ((d(d/(d*(1/18)/d))/ddd)/d(-3/7))(8/13) assuming d is positive. d(2204/819) Simplify (r(-2/5))(-3/2)r(-9)/r(-5/2) assuming r is positive. r(-59/10) Simplify (p/p(-2)p(2/13))(14/9) assuming p is positive. p(574/117) Simplify (w(3/5)(ww3w)/w)(-29) assuming w is positive. w(-667/5) Simplify (w/(ww(-1/4)ww))(1/27) assuming w is positive. w(-7/108) Simplify ((zzz/((z2z)/z)z)/z(1/8))/(z(4/11)z/(z/z(-2))) assuming z is positive. z(309/88) Simplify ((h/(h/(hh(-2/5))))(1/47))(5/18) assuming h is positive. h(1/282) Simplify (x1/(xx(-3)/x))(-7) assuming x is positive. x*(-28) Simplify (cc(-1/9)/c)(-5) assuming c is positive. c(5/9) Simplify (i/i(1/3))*(-21)iii/(i/(ii/((i/(ii*(1/7)))/ii)i))iii/(i/i*(-2/3)i) assuming i is positive. i(-179/21) Simplify v(-1/2)/v(v/v(1/4))/v(v/(v*(1/11)/v)v)/(vv(-4)) assuming v is positive. v(183/44) Simplify c6cc(6/7)/c assuming c is positive. c(48/7) Simplify t(-1/32)t/t(-2/33) assuming t is positive. t(1087/1056) Simplify (mmm*(-1/2)m)*3(m0)(5/2) assuming m is positive. m*(15/2) Simplify (m/((((mmm(-20))/m)/m)/m))(-4/21) assuming m is positive. m(-88/21) Simplify g(1/2)g*(-2/27)g*(-3)gg(-2/7) assuming g is positive. g(-703/378) Simplify (x/(x(-1/9)x))(-16) assuming x is positive. x(-16/9) Simplify (s(-2/7))32s(-1/5)s/((ss/((s/(ss*0))/s))/sss) assuming s is positive. s(-432/35) Simplify (((hh*8h)/h)/(h(-6/7)/h))/(h/(h/(h/h(-1))))(-38) assuming h is positive. h(608/7) Simplify (kk(((k*10/k)/k)/k)/kk)(-23) assuming k is positive. k(-207) Simplify d*(-4/21)dd(d*0d)/d assuming d is positive. d(38/21) Simplify (f13/f(5/2))(-36) assuming f is positive. f*(-378) Simplify (zz(1/8))/(z/z(6/11)) assuming z is positive. z*(59/88) Simplify ((rr(1/3))(-1/12))(-43) assuming r is positive. r(43/9) Simplify (d*(-2/3)d)/(ddd/(d/((d*5d)/d))d)(d/d(-1))/d(-2/11) assuming d is positive. d*(-181/33) Simplify ((s/(ss*(-3/7)s)s)/s(2/7))(-9/2) assuming s is positive. s(-9/14) Simplify (i(2/15)(i/((i/((iii*(2/5)i)/i))/ii))/i)/(iii(-2/13)ii(i*2i)/i) assuming i is positive. i*(-841/195) Simplify (vv(6/7))/(v(-6/5)v)v(-3)/v5 assuming v is positive. v(-208/35) Simplify ((i(-6)/i)/ii(-2))43 assuming i is positive. i(-430) Simplify (p(-1/2)/p)38p/p*(-2/3)p(-6/5) assuming p is positive. p(-848/15) Simplify (h*(-12)/hh11)(1/3) assuming h is positive. h*(-2/3) Simplify (((ttt(-4)t)/t)/(tt(-3/2)))26 assuming t is positive. t(-39) Simplify (z/z4)/(zz/(z/(z/(zz(-4)))z)z)z/(zz/(zz*0))zzzzz/(z/(z/(z/z(-2)))) assuming z is positive. z(-6) Simplify (i/(ii/(i/((iii(-2))/i))i))*(1/93)(i/(i(-1/2)/i))(-21/4) assuming i is positive. i(-105/8) Simplify g/g(-6)gg/(g/(gg1))g(g/g(-1))(-13) assuming g is positive. g(-15) Simplify ((p2)(-1/8))47 assuming p is positive. p(-47/4) Simplify ((c/c(-1/4))/c)/(c/(ccc(-14/3))) assuming c is positive. c(-41/12) Simplify ((y(1/13)/y)/y(-1/3))/(y/(y(-2/3)y))(-38) assuming y is positive. y(965/39) Simplify ((o/(o/(o((o/(o/(oo/(oo/(oo*(1/3))))))/o)/oo)))/o)/((oo/o(-7)oo)/o)o*(-2/9)/oo(-2) assuming o is positive. o(-116/9) Simplify zzz*(-1/24)/zzz/z17z assuming z is positive. z(-313/24) Simplify (f(-4/5)f)(-41) assuming f is positive. f(-41/5) Simplify (y/(yy*(1/4)y))22/(y(-1/4))(1/17) assuming y is positive. y(-1869/68) Simplify (l/(ll(-49)))/l(-35) assuming l is positive. l84 Simplify ((l(-2))(1/4))42 assuming l is positive. l(-21) Simplify n(1/3)n((n/n24)/n)/n assuming n is positive. n(-71/3) Simplify h(2/7)h*6(h*4h)/(h/h6) assuming h is positive. h(114/7) Simplify ((((m*(4/3)m)/m)/m)/mmm*(2/27)mm)/(m1/m)(-6/11) assuming m is positive. m(65/27) Simplify ((u(2/3))6)(1/18) assuming u is positive. u(2/9) Simplify r17rr(-12) assuming r is positive. r6 Simplify m18/mmm28mm assuming m is positive. m48 Simplify (((d/(d(d*(-1/24)d)/d))/d)/d)/((dd(-18))/dd) assuming d is positive. d*(361/24) Simplify ((j/(jj*(-5))j)/j(-11))(7/5) assuming j is positive. j(119/5) Simplify (r(1/4))*(1/78)((r*1r)/r)(-1/40) assuming r is positive. r(-17/780) Simplify (c*(-1/2)c(-1/12)/c)/((c/c(2/13))/c(-1/10)) assuming c is positive. c(-1973/780) Simplify (b/((b/b*0)/b))/((bb**(-2/7)/b)/b) assuming b is p	{ "pile_set_name": "DM Mathematics" }
f. What is the greatest common divisor of f and 46? 23 Suppose x + 3x + 4i = 1248, -936 = -3x + 2i. Suppose -4y + x = 9y. Calculate the greatest common factor of y and 8. 8 Let i(c) = 126c - 50. Let j be i(1). Calculate the greatest common factor of 57 and j. 19 Let j be (-9 + -15)(-6)/9. Suppose 5o - 2b + 6b = 20, 2o + 9 = -5b. Calculate the greatest common divisor of j and o. 8 Suppose -3n - 12 = 3j, -3n - 5 = 2j + 2. Let y = 15 + j. Let k be ((-35)/y)/((-2)/8). Calculate the greatest common factor of 21 and k. 7 Let y = 76 + -71. Suppose 3o + 3q - 81 = -q, 47 = 2o + yq. Calculate the highest common divisor of o and 248. 31 Let h = 4 - -1. Let w(o) = o*3 - 25o*2 + 45. Let z be w(25). What is the highest common divisor of z and h? 5 Let i(a) = 3a - 1. Let n be i(19). Calculate the greatest common factor of n and 126. 14 Let o(f) = -2f3 - 13f*2 - 32f - 3. Let p be o(-3). Calculate the greatest common factor of p and 1410. 30 Suppose -k = -5j + 3, 4k + 12 = 2j - 4j. Let p be 13 - (5 + -3 + j). What is the greatest common factor of p and 121? 11 Let j(k) = -k*3 + 14k*2 + 2k - 18. Let g be j(14). Let n(c) = c*2 - 10c + 17. Let v be n(g). What is the highest common factor of v and 17? 17 Let f = -198 + 270. Calculate the greatest common divisor of 18 and f. 18 Let s be 0/2(-3 + 25/10). Suppose s = 3u - h - 13, 3u - 10 = u + 2h. What is the highest common factor of 20 and u? 4 Suppose 2128 = 6n + 13n. Calculate the highest common factor of n and 48. 16 Let f(k) = k*3 + 27k*2 + 45k - 119. Let j be f(-25). Calculate the highest common factor of 162 and j. 6 Let b(q) = 69q + 10. Let k be b(3). Suppose 15h - k = 8h. Calculate the highest common factor of h and 62. 31 Let f(n) = n + 21. Suppose 2w - 2u - 2 = 0, -2w + 0 = u + 1. Let s be f(w). Calculate the greatest common factor of 210 and s. 21 Let h = -102 - -402. Calculate the greatest common factor of 40 and h. 20 Suppose 2b = -q + 6b + 58, -4b = 2q - 56. Suppose -2l = 5v - 150, -4v - l + 85 + q = 0. What is the greatest common divisor of 288 and v? 32 Let u = 752 - 717. What is the highest common factor of 315 and u? 35 Let s be 71396/182 + (-2)/7. Suppose -51q + s = -44q. What is the highest common factor of q and 16? 8 Let n(w) = 26w - 34. Let j be n(11). Calculate the highest common divisor of 112 and j. 28 Suppose -4c = 34j - 33j + 14, 5c = 4j - 28. Calculate the greatest common factor of 86 and j. 2 Let n = 13 + -10. Suppose -nz = -9z + 78. Calculate the highest common factor of z and 13. 13 Let z(n) = n2 + 6n + 3. Suppose 3h + 2 = 2a + 1, 5h + 4 = 3a. Let s be z(a). Let d be (-4)/6 - 96/(-9). What is the greatest common factor of s and d? 10 Let t(x) = -8x2 - x + 1. Let q be t(-2). Let f(o) = -2o*3 - 3o*2 + 2o + 1. Let a be f(2). Let n = a - q. What is the greatest common factor of 15 and n? 3 Suppose -7g + 1 - 64 = 0. Let h(p) = 2p*2 + 18p + 14. Let r be h(g). What is the highest common factor of 154 and r? 14 Let m = 906 + -881. Suppose -f = -3f - 4u - 28, -u = 3. Let g be (1 - f) + 1/1. Calculate the highest common divisor of g and m. 5 Let z = -1022 - -1048. What is the greatest common factor of z and 91? 13 Let s be 15276/5 + (14 - 1065/75). Calculate the highest common divisor of s and 65. 65 Let m(s) = -s3 - s2 - 7s - 6. Let z be m(-4). Suppose 0 = -5f + 5b + z, -5f - 4b = -0f - 106. Calculate the greatest common divisor of f and 18. 18 Suppose 0 = -4m - 3h - 19 + 107, -5h = 4m - 80. Calculate the highest common factor of 4 and m. 1 Let d(h) = 17h2 - 11h + 14. Let a be d(6). Calculate the greatest common divisor of 70 and a. 70 Let a = 4 - 9. Let j = 669 - 672. Let s be (-8)/a + j/5. What is the highest common divisor of s and 5? 1 Let f = -60 - -207. Suppose -3m - 45y = -42y - 69, -5m + 95 = -5y. Calculate the greatest common factor of m and f. 21 Let x be (-1)/(-31/66). Let o = x - 11. Suppose -7b - 8 = -ob. Calculate the greatest common divisor of 1 and b. 1 Suppose -c + 0 + 3 = 0. Let m(i) = -i*2 - i - 4i - 34 + 34. Let l be m(-3). What is the greatest common factor of c and l? 3 Let m be 5 + -1 + -3 - -4. Let q be m/(20/16)2. Calculate the greatest common divisor of q and 2. 2 Let h(f) = -f3 - 6f*2 - 2f - 3. Let z be h(-6). Suppose 36t + 26 = 134. Calculate the greatest common factor of z and t. 3 Suppose 14h + 5h - 266 = 0. Suppose -o - 10 = -3o. Suppose ol = 165 - 25. Calculate the greatest common factor of h and l. 14 Let h be ((-11)/(198/6))/((-2)/624). Calculate the highest common factor of 910 and h. 26 Suppose 2u = -2u + 40. Let x(v) = -2v + 24. Let g be x(u). Suppose 5r = 5, gj = -4r + 59 + 9. Calculate the highest common factor of j and 176. 16 Suppose 0 = 10s - 665 - 6615. What is the greatest common divisor of s and 84? 28 Suppose 2a - 10a + 32 = 0. Let m be (-2)/12 + (-46)/12. Let k be 21/((15/m)/(-5)). What is the highest common factor of k and a? 4 Let d(m) = 4m2 - 15m + 87. Let t be d(12). What is the greatest common divisor of 231 and t? 21 Suppose 5w + 3v - 381 = 166, 2w - 217 = -3v. Calculate the highest common divisor of w and 176. 22 Suppose 2t = 5t + 5n - 13, -5t + 3n = -33. Suppose -2m = m + 117. Let q = 57 + m. What is the highest common factor of t and q? 6 Let b = 497 - 327. Let q be 3/(-1) + 23 + -5 + 2. Calculate the highest common divisor of q and b. 17 Suppose 43l - 10800 = 13l. What is the highest common factor of l and 40? 40 Suppose -7i - 2i + 162 = 0. Let p be (-6)/((2/24)/((-9)/i)). Calculate the highest common factor of 60 and p. 12 Let q(c) = -c*2 - 33c - 45. Let j be q(-25). What is the greatest common factor of 10 and j? 5 Let j be 10/(-4) + (-1)/2. Let r be 25/3 + (-2)/j. Suppose 4b - a - 145 = 0, -5a = 34 - 29. Calculate the greatest common divisor of b and r. 9 Let g = -67 + 122. Suppose -1 - 1 = -m. Suppose -l = -md + 21, -5l - g = 3d - 8d. What is the greatest common factor of d and 20? 10 Suppose 3p - 12 = -p. Let j be 695/10 - p/(-6). Calculate the greatest common factor of 28 and j. 14 Let i be (24/10)/((-135)/(-12375)). What is the greatest common factor of 44 and i? 44 Let z be 365/2 - (-2)/(-4). Let g(s) = 2s*3 + 95s*2 + 27s - 926. Let j be g(-47). What is the highest common factor of j and z? 14 Suppose 0 = 6b - 3b + 1836. Let j be (-4)/(-14) - b/63. What is the greatest common divisor of 2 and j? 2 Suppose -3g - 14 = -5c, g + 1 = c - 1. Suppose -45 = cx - 9x. Suppose -w = 0, 5j - 5w - 88 = -43. What is the highest common factor of x and j? 9 Let q = 236 - 179. Calculate the highest common divisor of 418 and q. 19 Let t be 57/((-10)/((-160)/6)). What is the greatest common factor of t and 19? 19 Suppose -n + 1283 = 5s, 0 = 16s - 21s - 3n + 1289. Calculate the greatest common factor of s and 40. 8 Let t = 493 - 250. Calculate the greatest common divisor of 27 and t. 27 Suppose 0 = 12b - 211 + 139. What is the greatest common factor of b and 146? 2 Suppose 0 = 5n - 5375 + 5370. Let w be (-1)/(-2) - 2/(-4). What is the highest common factor of w and n? 1 Let c(n) = 2n2 + 8n - 12. Let o be c(-7). What is the highest common divisor of 45 and o? 15 Suppose 0j - 2j + 582 = 4m, 0 = m - 2j - 133. Let y be 0((-10)/4 + 2) - -11. What is the greatest common divisor of y and m? 11 Suppose 3i = 2n + 47, 72 = 4i + n - 6n. Suppose -17 = -3o + i. Let p(w) = w - 8. Let b be p(o). Calculate the highest common divisor of 3 and b. 1 Suppose 37v - 6 = 142. What is the highest common factor of v and 35? 1 Suppose 2o - 1278 = -2g, -6o + 5o = -g + 641. Calculate the greatest common divisor of g and 20. 20 Suppose 25f - 1430 = 3f. Calculate the greatest common factor of f and 20. 5 Suppose -2h = 2o + o - 101, 3h - 152 = -4o. Let v = 3088 - 2958. Calculate the highest common factor of h and v. 26 Suppose -10s = -14s, 2b = 4s + 1900. What is the highest common divisor of 38 and b? 38 Suppose -2n + 71 + 65 = 0. Suppose -3w + 0w + 8 = 4c, w - 5c = 28. Suppose wr + 2r - 170 = 0. Calculate the greatest common factor of r and n. 17 Suppose -c = -4j + 169, 0c - c - 1 = 0. Let r be j/189 - (-716)/18. What is the highest common divisor of	{ "pile_set_name": "DM Mathematics" }
s of 1023407. 7, 11, 13291 List the prime factors of 1873531. 11, 181, 941 What are the prime factors of 151455? 3, 5, 23, 439 What are the prime factors of 544281? 3, 419, 433 List the prime factors of 302687. 7, 11, 3931 List the prime factors of 22782951. 3, 29, 53, 61 What are the prime factors of 3362822? 2, 1681411 What are the prime factors of 93965? 5, 18793 List the prime factors of 1248719. 181, 6899 List the prime factors of 122653. 122653 What are the prime factors of 170945? 5, 179, 191 List the prime factors of 201045. 3, 5, 13, 1031 What are the prime factors of 274935? 3, 5, 18329 What are the prime factors of 11733088? 2, 373, 983 What are the prime factors of 310394? 2, 7, 22171 What are the prime factors of 2037550? 2, 5, 40751 List the prime factors of 1182812. 2, 295703 List the prime factors of 3315627. 3, 7, 53, 331 List the prime factors of 442587. 3, 31, 4759 What are the prime factors of 180704? 2, 5647 What are the prime factors of 91092? 2, 3, 7591 What are the prime factors of 436500? 2, 3, 5, 97 What are the prime factors of 2998780? 2, 5, 149939 List the prime factors of 293012. 2, 17, 31, 139 List the prime factors of 4565758. 2, 17, 134287 List the prime factors of 52558. 2, 11, 2389 List the prime factors of 110907. 3, 12323 What are the prime factors of 1233293? 1039, 1187 What are the prime factors of 21947887? 13, 1688299 What are the prime factors of 94683? 3, 37, 853 List the prime factors of 145668. 2, 3, 61, 199 List the prime factors of 5300474. 2, 2650237 List the prime factors of 560179. 560179 List the prime factors of 944140. 2, 5, 47207 List the prime factors of 711518. 2, 17, 1231 List the prime factors of 98842. 2, 73, 677 List the prime factors of 130221. 3, 7, 13, 53 List the prime factors of 19172121. 3, 19, 336353 List the prime factors of 291187. 13, 1723 What are the prime factors of 16301532? 2, 3, 13, 83, 1259 What are the prime factors of 3769673? 3769673 What are the prime factors of 21392178? 2, 3, 53, 67271 List the prime factors of 4197147. 3, 17, 47, 103 What are the prime factors of 3628828? 2, 7, 29, 41, 109 What are the prime factors of 786511? 11, 127, 563 What are the prime factors of 1626488? 2, 203311 What are the prime factors of 3776208? 2, 3, 151, 521 What are the prime factors of 447866? 2, 151, 1483 List the prime factors of 11866693. 11866693 List the prime factors of 2473541. 7, 449, 787 List the prime factors of 2476495. 5, 7, 173, 409 List the prime factors of 14230267. 83, 171449 List the prime factors of 1828353. 3, 61, 97, 103 What are the prime factors of 455002? 2, 227501 What are the prime factors of 1921692? 2, 3, 160141 What are the prime factors of 299380? 2, 5, 14969 What are the prime factors of 1360207? 1360207 List the prime factors of 1082290. 2, 5, 11, 9839 What are the prime factors of 602324? 2, 23, 6547 List the prime factors of 7069178. 2, 17, 19, 31, 353 What are the prime factors of 1293664? 2, 40427 List the prime factors of 948505. 5, 189701 What are the prime factors of 43453935? 3, 5, 7, 6569 List the prime factors of 1082980. 2, 5, 173, 313 What are the prime factors of 962666? 2, 37, 13009 List the prime factors of 243010. 2, 5, 19, 1279 List the prime factors of 1481948. 2, 13, 28499 List the prime factors of 19760158. 2, 11, 898189 What are the prime factors of 40020? 2, 3, 5, 23, 29 List the prime factors of 572272. 2, 47, 761 What are the prime factors of 1693402? 2, 157, 5393 What are the prime factors of 192936? 2, 3, 8039 List the prime factors of 2113583. 2113583 List the prime factors of 2020908. 2, 3, 168409 List the prime factors of 1708238. 2, 7, 17431 What are the prime factors of 21018730? 2, 5, 2101873 List the prime factors of 3212578. 2, 1606289 What are the prime factors of 782307? 3, 86923 List the prime factors of 3101310. 2, 3, 5, 17, 2027 What are the prime factors of 5229195? 3, 5, 89, 3917 What are the prime factors of 1357992? 2, 3, 6287 List the prime factors of 8960112. 2, 3, 7, 2963 List the prime factors of 2978116. 2, 257, 2897 List the prime factors of 1303119. 3, 144791 What are the prime factors of 329204? 2, 82301 List the prime factors of 1302252. 2, 3, 7, 37, 419 List the prime factors of 455355. 3, 5, 3373 What are the prime factors of 113231? 199, 569 List the prime factors of 9682340. 2, 5, 484117 List the prime factors of 18279589. 71, 257459 What are the prime factors of 3677245? 5, 11, 13, 37, 139 What are the prime factors of 361882? 2, 23, 7867 List the prime factors of 148821. 3, 113, 439 What are the prime factors of 1062435? 3, 5, 11, 47, 137 What are the prime factors of 672717? 3, 224239 List the prime factors of 3865585. 5, 773117 What are the prime factors of 114902? 2, 73, 787 List the prime factors of 897581. 897581 List the prime factors of 417436. 2, 79, 1321 List the prime factors of 2739113. 13, 47, 4483 List the prime factors of 4878186. 2, 3, 109, 7459 List the prime factors of 2051655. 3, 5, 136777 List the prime factors of 1256386. 2, 628193 List the prime factors of 10747574. 2, 29, 185303 List the prime factors of 2739129. 3, 31, 29453 What are the prime factors of 2382741? 3, 264749 What are the prime factors of 293259? 3, 67, 1459 What are the prime factors of 467742? 2, 3, 11, 19, 373 List the prime factors of 1065174. 2, 3, 11, 16139 List the prime factors of 697193. 7, 137, 727 List the prime factors of 1188860. 2, 5, 59443 What are the prime factors of 647486? 2, 7, 6607 What are the prime factors of 6547165? 5, 659, 1987 What are the prime factors of 74196? 2, 3, 229 List the prime factors of 165902. 2, 11, 7541 What are the prime factors of 6058632? 2, 3, 252443 What are the prime factors of 466405? 5, 93281 List the prime factors of 335049. 3, 11, 13, 71 What are the prime factors of 677826? 2, 3, 37657 List the prime factors of 29690717. 7, 605933 List the prime factors of 648563. 648563 What are the prime factors of 281167? 281167 What are the prime factors of 35352642? 2, 3, 13, 453239 List the prime factors of 319243. 17, 89, 211 What are the prime factors of 3243358? 2, 1621679 List the prime factors of 14955813. 3, 553919 List the prime factors of 6993566. 2, 131, 26693 What are the prime factors of 2559276? 2, 3, 2633 What are the prime factors of 4381859? 4381859 List the prime factors of 2834929. 797, 3557 What are the prime factors of 4757456? 2, 11, 27031 List the prime factors of 104282. 2, 23, 2267 List the prime factors of 1092489. 3, 53, 6871 List the prime factors of 37542215. 5, 7508443 List the prime factors of 282158. 2, 141079 What are the prime factors of 5420221? 313, 17317 List the prime factors of 4872501. 3, 180463 List the prime factors of 2220218. 2, 7, 11, 13, 1109 What are the prime factors of 645709? 41, 15749 List the prime factors of 136308. 2, 3, 37, 307 What are the prime factors of 1267626? 2, 3, 211271 What are the prime factors of 1583591? 1583591 List the prime factors of 845724. 2, 3, 11, 43, 149 What are the prime factors of 764400? 2, 3, 5, 7, 13 What are the prime factors of 3127266? 2, 3, 71, 2447 List the prime factors of 216012. 2, 3, 47, 383 List the prime factors of 227766. 2, 3, 7, 11, 17, 29 What are the prime factors of 448573? 607, 739 List the prime factors of 10319. 17, 607 What are the prime factors of 11106568? 2, 11, 126211 What are the prime factors of 1459257? 3, 19, 25601 List the prime factors of 200231. 200231 List the prime factors of 239829. 3, 79943 What are the prime factors of 298110? 2, 3, 5, 19, 523 What are the prime factors of 1200551? 11, 109141 List the prime factors of 17698881. 3, 5899627 What are the prime factors of 492385? 5, 19, 71, 73 List the prime factors of 294661. 17, 17333 What are the prime factors of 3556889? 7, 127, 4001 List the prime factors of 27498522. 2, 3, 4583087 List the prime factors of 112459. 112459 List the prime factors of 641087. 17, 43, 877 What are the prime factors of 649894? 2, 7, 61, 761 What are the prime factors of 66451? 7, 11, 863 List the prime factors of 113910. 2, 3, 5, 3797 What are the prime factors of 4826258? 2, 569, 4241 What are the prime factors of 875302? 2, 437651 What are the prime factors of 667922? 2, 521, 641 List the prime factors of 17433	{ "pile_set_name": "DM Mathematics" }
s 1415780 a multiple of 29? True Is 321514 a multiple of 252? False Does 2 divide 153578? True Is 199386 a multiple of 735? False Is 26 a factor of 1872566? False Is 357280 a multiple of 55? True Is 46314 a multiple of 62? True Is 43762 a multiple of 80? False Is 13673 a multiple of 4? False Is 3 a factor of 4036089? True Does 26 divide 120253? False Is 44309 a multiple of 214? False Does 15 divide 49153? False Does 19 divide 949171? False Is 637582 a multiple of 11? True Is 37 a factor of 523917? False Is 17220 a multiple of 3? True Is 498 a factor of 2795772? True Is 50025 a multiple of 29? True Does 111 divide 6680646? True Is 104 a factor of 101088? True Is 515518 a multiple of 5? False Is 534635 a multiple of 27? False Is 38 a factor of 344880? False Is 4469484 a multiple of 116? False Is 93 a factor of 521110? False Is 5945 a multiple of 12? False Is 555 a factor of 1870905? True Is 126 a factor of 10037790? True Does 141 divide 1851168? False Is 1801388 a multiple of 17? True Is 57 a factor of 92226? True Is 33 a factor of 4024680? True Is 45118 a multiple of 32? False Is 147 a factor of 89651? False Does 237 divide 116367? True Does 11 divide 2604069? False Is 91 a factor of 6136746? False Is 1632 a factor of 5182623? False Does 13 divide 67511? False Is 90 a factor of 19350? True Is 404136 a multiple of 27? True Is 3669660 a multiple of 8? False Is 6403776 a multiple of 24? True Is 581 a factor of 2678991? True Does 16 divide 1966? False Is 8 a factor of 33095? False Does 63 divide 134316? True Is 114050 a multiple of 260? False Is 482000 a multiple of 4? True Does 72 divide 243784? False Is 20 a factor of 1102908? False Is 279321 a multiple of 283? True Does 93 divide 205065? True Is 5380183 a multiple of 184? False Does 50 divide 32480? False Does 287 divide 348418? True Is 298729 a multiple of 74? False Does 11 divide 1910260? True Is 6 a factor of 82138? False Is 73 a factor of 103930? False Is 16 a factor of 1262894? False Does 81 divide 1008100? False Is 394 a factor of 293136? True Does 37 divide 3747334? False Is 706045 a multiple of 516? False Does 7 divide 1645110? False Is 172587 a multiple of 48? False Is 23 a factor of 82652? False Is 290168 a multiple of 23? True Does 128 divide 390465? False Is 69 a factor of 60099? True Does 21 divide 773711? False Is 9708 a multiple of 35? False Is 67760 a multiple of 560? True Is 5334673 a multiple of 395? False Is 40026 a multiple of 6? True Is 176 a factor of 373296? True Is 13 a factor of 3227? False Is 110828 a multiple of 206? True Does 4 divide 53988? True Does 41 divide 16267422? False Is 12 a factor of 7884396? True Is 148 a factor of 1138416? True Is 46 a factor of 15916? True Is 35749 a multiple of 3? False Is 24 a factor of 204768? True Does 71 divide 844762? False Is 45 a factor of 576585? True Is 29424 a multiple of 24? True Does 157 divide 341772? False Is 553676 a multiple of 194? True Does 73 divide 1555338? True Is 303996 a multiple of 42? True Does 347 divide 232490? True Is 942 a factor of 14343652? False Is 134 a factor of 114167? False Is 35 a factor of 16419655? True Is 205 a factor of 689893? False Does 22 divide 93412? True Does 204 divide 1227694? False Is 3 a factor of 820645? False Does 209 divide 490941? True Is 90 a factor of 28395? False Is 3003247 a multiple of 140? False Is 82 a factor of 118384? False Does 17 divide 8540? False Is 225904 a multiple of 4? True Does 86 divide 108790? True Is 252914 a multiple of 660? False Is 23181368 a multiple of 76? True Is 589784 a multiple of 106? True Is 305749 a multiple of 94? False Does 12 divide 485573? False Is 78 a factor of 1865994? True Is 191 a factor of 401798? False Is 119654 a multiple of 163? False Is 418498 a multiple of 494? False Is 8 a factor of 37680? True Is 106 a factor of 9839980? True Is 34 a factor of 664235? False Does 5 divide 3153764? False Is 692384 a multiple of 56? True Does 614 divide 847934? True Does 22 divide 604304? False Is 44982 a multiple of 11? False Does 332 divide 332493? False Does 40 divide 637480? True Is 46 a factor of 296608? True Is 1534932 a multiple of 42? True Is 10 a factor of 6309? False Is 56224 a multiple of 251? True Does 12 divide 389117? False Does 46 divide 241224? True Does 8 divide 420304? True Is 42 a factor of 63244? False Is 500 a factor of 842660? False Is 143 a factor of 3442883? False Is 8 a factor of 123861? False Is 41 a factor of 20664? True Is 116409 a multiple of 11? False Is 76 a factor of 533566? False Is 553961 a multiple of 14? False Does 57 divide 9433313? False Is 30 a factor of 93750? True Is 1102 a factor of 1894553? False Does 52 divide 94484? True Does 545 divide 34280033? False Is 13 a factor of 1264835? True Is 422684 a multiple of 12? False Is 1373717 a multiple of 76? False Is 122 a factor of 7942? False Is 45 a factor of 571378? False Is 372228 a multiple of 12? True Does 162 divide 604908? True Is 21 a factor of 1925301? True Is 1167 a factor of 2553578? False Is 4 a factor of 2593? False Is 651 a factor of 5440934? False Is 5 a factor of 116018? False Is 18 a factor of 218145? False Does 47 divide 5738794? True Is 175672 a multiple of 8? True Is 103 a factor of 574645? False Is 1085280 a multiple of 224? True Is 136625 a multiple of 404? False Is 6327618 a multiple of 33? True Is 430530 a multiple of 5? True Does 302 divide 1335304? False Is 11 a factor of 2504901? False Is 28 a factor of 23149052? False Is 156 a factor of 142116? True Is 110500 a multiple of 4? True Does 12 divide 101488? False Is 511988 a multiple of 4? True Does 83 divide 226839? True Is 265 a factor of 967515? True Does 109 divide 12535? True Is 213 a factor of 67734? True Is 1725387 a multiple of 7? False Is 1468324 a multiple of 286? True Is 904 a factor of 2155540? False Is 2533476 a multiple of 9? False Does 20 divide 2553180? True Is 60 a factor of 32891? False Is 74980 a multiple of 460? True Is 114 a factor of 491340? True Is 952 a factor of 8241146? False Does 505 divide 2790859? False Is 5 a factor of 573990? True Is 1225 a factor of 2686863? False Does 17 divide 19876? False Is 3778736 a multiple of 208? True Does 403 divide 10726111? False Is 381 a factor of 126202? False Is 32 a factor of 66967? False Is 56 a factor of 77969? False Is 249647 a multiple of 16? False Is 6 a factor of 991926? True Does 209 divide 470493? False Is 23 a factor of 106354? False Does 708 divide 405190? False Is 7 a factor of 193? False Is 149601 a multiple of 14? False Is 42534 a multiple of 302? False Is 472127 a multiple of 9? False Is 11 a factor of 5973245? False Does 22 divide 211178? True Is 11 a factor of 8475800? False Is 30282 a multiple of 19? False Is 441 a factor of 391929? False Is 12 a factor of 7198356? True Is 49 a factor of 3920892? False Is 270680 a multiple of 270? False Is 7767539 a multiple of 21? False Is 40 a factor of 728699? False Is 286873 a multiple of 27? False Is 64 a factor of 59584? True Is 426 a factor of 173382? True Does 141 divide 1921407? True Is 135510 a multiple of 59? False Does 3 divide 7492521? True Does 20 divide 148079? False Does 102 divide 762014? False Is 12 a factor of 25231? False Does 13 divide 5003848? False Does 61 divide 64504? False Is 1190371 a multiple of 13? True Is 775833 a multiple of 11? False Is 498 a factor of 6181176? True Is 23 a factor of 1158552? False Does 47 divide 19172? False Is 80 a factor of 2689440? True Is 8 a factor of 1153015? False Is 445375 a multiple of 997? False Does 17 divide 1213238? False Is 5 a factor of 20338? False Is 8 a factor of 258240? True Is 585 a factor of 1440586? False Is 27 a factor of 15578109? True Does 86 divide 17630? True Does 135 divide 309555? True Does 65 divide 3856024? False Does 79 divide 533645? True Is 8038857 a multiple of 103? False Does 119 divide 11681737? False Does 67 divide 259691? False Is 137 a factor of 179093? False Is 29 a factor of 11104736? False Is 112889 a multiple of 4? False Is 211 a factor of 15811? False Does 278 divide 7318072? True Does 656 divide 204959? False Is 91 a factor of 182910? True Is 80 a factor of 202471? False Is 6 a factor of 366174? True Is 142163 a multiple of 55? False Is 131670 a multiple of 495? True Is 21 a factor of	{ "pile_set_name": "DM Mathematics" }
- -773/297. What is the common denominator of 5/8 and h? 72 Let o = -3 + 0. Calculate the least common multiple of 11 and -3-1(-5)/o. 55 Let f(r) be the second derivative of 7r5/4 - r2/2 + 2r. Let h be f(-1). What is the common denominator of -23/11 and (2 - 4)/(h/(-98))? 99 Calculate the lowest common multiple of 4 and 284/10 - (-6)/(-15). 28 Let x(w) = -3w - 5. Let d be x(-8). Let c = d - 11. Let g(q) = q3 + 5q*2 - 8q - 9. Calculate the smallest common multiple of c and g(-6). 24 Let b(r) = -3r - 3. Let d be b(-2). Let c = -2 + d. What is the common denominator of 101/22 and 2-8 + c/4? 44 Suppose 0 = -2d + 5g - 15, -5g - 7 = 2d - 2. Let a = 6 - 3. What is the smallest common multiple of 50/4(-4)/d and a? 30 Let c(z) = -865z - 4. Let l be c(6). Let m = -457/14 + 106/7. Find the common denominator of l/(-84)(-2)/14 and m. 6 Let h = 103445307/88 - 2350865/2. Let g = h + -645/8. Suppose -4l + 214 = -5d, -37 + 3 = d - 3l. Find the common denominator of g and d. 11 Calculate the common denominator of 157/(-33) + 12/4 and 38/21. 231 Let q be 1/2(-1357)/(-5). Let c = q - 654/5. Calculate the common denominator of c and -43/4. 20 Calculate the common denominator of 111/14 and ((-140)/32)/(5/(-20)). 14 Suppose 0 = -0s - 4s + 5n - 3692, 0 = -2s + 2n - 1844. Calculate the common denominator of -22/5 and s/(-140) - (-3)/21. 10 Suppose -3f + 0f + 18 = 0. Find the common denominator of 610/(-4)1/(-5) and 2/f + (-307)/48. 16 What is the lowest common multiple of ((-42)/(-56))/(2/8) and 1? 3 Let y = -832/3 - -509/2. Let x(a) = -a + 9. Let m(g) = g + 14. Let v be m(-8). What is the common denominator of y and x(v)? 6 Suppose 3l = l + 52. Suppose 2g + l = 4u, 0 = u + 2g + g - 17. Calculate the smallest common multiple of 3 and u. 24 Let z be -1 - 0 - 9/3. Calculate the common denominator of (-59)/(21 - (1 - 2)) and (-47)/z + 1 + 2. 44 Suppose a + 3 - 10 = -5m, 0 = 3m - 3. Calculate the smallest common multiple of a and 12. 12 Suppose -12 = -3y + 24. Suppose -5s + y = -3s. What is the common denominator of 61/10 and ((-53)/12)/(4/s)? 40 Let w = 196743/40 - 4917. Calculate the common denominator of w and 95/8. 40 Find the common denominator of -115/6 and (158/(-22))/(-20 + 22). 66 Let r = 20 - -5. Suppose -2w + r = 3w. Suppose -5z - 2l - w = -30, 5l + 11 = -2z. What is the least common multiple of 9 and z? 63 Let v = -3943921/58 + 67997. Find the common denominator of v and -13/10. 290 Suppose -37 = -3h + 11. Calculate the lowest common multiple of 6 and h. 48 Let f = -2309/738 + 44/41. What is the common denominator of 268/(-42)6/16 and f? 252 Let w = -7014 - -168311/24. What is the common denominator of -49/3 and w? 24 Let i be 2/(14/(-20)). Calculate the smallest common multiple of ((-2)/(-2))/(i/(-90)) and 3. 9 Suppose -3q = v + 5, 2q + 5v + 10 = 3v. Suppose a - 3a + 40 = q. Suppose -16i = -11i - 90. What is the lowest common multiple of i and a? 180 Let t be 2628537/4013/(-3078). Let k = 1/22857 - t. Find the common denominator of 53/20 and k. 180 Calculate the smallest common multiple of 3/(34/24) and 12. 12 Let j = 148/583 + 54/53. Calculate the common denominator of -103/12 and j. 132 Let u(f) = -f*3 + 8f*2 + 10f - 7. What is the least common multiple of u(9) and 7? 14 Let f be (-18)/885538/(-33). Let q = f + -5830. Let s = 869 + -5113/6. What is the common denominator of q and s? 66 Let d = 3881/4 + -978. What is the common denominator of d and 29/5? 20 Let p be -3 + 1 - (-1 + 0). Let l = 6306/5 - 1268. What is the common denominator of (-1)/p(-102)/(-27) and l? 45 Let u = -1395/4 - -360. What is the common denominator of u and -43/10? 20 Let l be (1 + -4)/(0 - -1). Let c(a) = -3a + 2. What is the smallest common multiple of 3/(-9) - 38/(-6) and c(l)? 66 Let f(k) = -k3 + 4k*2 + 2k - 2. Let y be f(6). Let l = -5915/1164 + -1/582. What is the common denominator of 2/(y + -2)-6 and l? 48 Suppose 2y - 5y = -21. Calculate the least common multiple of y and 7. 7 Suppose 29 - 41 = -2s. Calculate the least common multiple of 8 and s. 24 Let d = -7 - -14. What is the least common multiple of ((-48)/(-4))/(-3) + 6 and d? 14 What is the common denominator of (730/(-4) + 1)(-34)/(-510) and 53/60? 60 Suppose m = b - 14, -3m + 20 = 2b - 28. Calculate the least common multiple of 18 and b. 18 Find the common denominator of ((-1330)/225 + 5)2 and -68/45. 45 Let s = -1124 - -7899/7. What is the common denominator of 13/8 and s? 56 Let a(b) = b - 12. Let z be a(6). Find the common denominator of (-211)/11 + z/(-33) and 15. 1 Find the common denominator of -111/22 and (2/(-40))/(5/110). 110 Let v be (16/(-6))/(1/(-3)). Suppose 5b + 4h = 17, -9h = -5h + v. Suppose -o + b = 3. What is the smallest common multiple of o and 9? 18 Find the common denominator of 1180/800 + 2(-1)/(-5) and (0 - 0) + (-82)/(-4). 8 Calculate the common denominator of -121/20 and 4/(-68)82/(-4). 340 Let o be ((-2)/5)/(3/360). Suppose -5z + 6 = 4j, 3z - 1 = -3j + z. What is the common denominator of 27/22 and o/(-66) - j/2? 22 Let g = 9 - 8. Suppose -4w + 48 = 3o, 3w + o - 30 - g = 0. Calculate the lowest common multiple of w and 1. 9 Suppose 4h + 5f - 20 = 7, 4f = 12. Suppose -2n + 3 = 4a + a, -n = -ha - 29. What is the lowest common multiple of n and 6? 42 Let m = -4019 - -88501/22. What is the common denominator of m and ((-57)/30)/((-12)/(-10))? 132 Let u be 8/((-1 - 2)/(-9)). Suppose a - n = 2, -5a - 4n = -a + u. What is the common denominator of a/(-7) - 2312/(-336) and 8/7? 42 Suppose -y + 8 = -2y. What is the common denominator of 2/y - 250/72 and 1/13-2 + (-9050)/(-520)? 36 Let a = 1/20061960 + 130001981/8040011027640. Let s = a - 13375131291/2805313. Let j = s + 4771. What is the common denominator of j and 63/20? 140 Let r(d) = -d2 - 5d + 1. Let p be r(-5). Let g = 4 + p. Suppose gw = w + 4. Calculate the smallest common multiple of 10 and w. 10 Let x = -924 + 4591/5. Calculate the common denominator of x and 20. 5 Suppose 4l - l = -2s - 41, 5l - 40 = s. Calculate the common denominator of (4/s)/(8/(-460)) and 62/9. 45 Let c(n) = -8n + 16. Let x(d) = d - 1. Let j(v) = -c(v) - 6x(v). Let r be j(8). Suppose -ry + y + 15 = 0. What is the smallest common multiple of 5 and y? 15 Find the common denominator of 52/4018/4 and 49/12. 60 What is the common denominator of -4 - 10/(-35) - -3 and 31? 7 Let o = -14479/14360 - 6/359. What is the common denominator of o and 13/2? 40 Suppose -4b + 9b = -15. Let f be 4/(-3 - -1 - b). Suppose fg = 4x - 60, 3x - 66 = -3g - g. Calculate the lowest common multiple of x and 20. 180 Suppose 6p - 20 = p. Suppose q - 3o - 22 = -pq, 5q = o + 14. Suppose -4k = 17 - 57. What is the least common multiple of q and k? 10 Suppose -4s - 33 = t, 6s - 3s - t + 23 = 0. Let k = -39 - -17. What is the common denominator of (s/(-12))/(k/78) and -83/4? 44 Calculate the least common multiple of (0 - -3) + 16 + -7 and 8. 24 Let c(f) = 2f + 2. Let x be c(-3). Suppose 32m - 24 = 29m. Let o = m + x. Calculate the smallest common multiple of o and 12. 12 Calculate the common denominator of -23/18 and (-97)/(-4)(-2)/(-8). 144 Let y = -4 - 14. Calculate the lowest common multiple of 8 and (-11)/(33/y). 88 Let d(g) = -g3 + 7g*2 + 8g + 2. Let r be d(8). Suppose -4h - 2 = -rh. Calculate the smallest common multiple of 6 and (-22)/(h(2 + -1)). 66 Suppose -17 = -3k + 16. Suppose 3w + w - 8 = 0. Calculate the smallest common multiple of k and (-10)/(((-12)/3)/w). 55 Let h(v) = v3 - v2 + 3v - 6. What is the least common multiple of h(2) and 12? 12 Let r(k) = -2k3 + 2k*2 + k + 1. Suppose -6u + 3u + 6 = 0. Let m be r(u). What is the common denominator of -103/22 and 14/m70/(-16)? 44 Let y be 5 + -2 + 51074/12. Let q = y - 4281. Calculate the common denominator of q and -44/7. 42 Let a = -12 + 13. Calculate the smallest common multiple of (6/(-1))/(-3) + 0 and a. 2 Let d = -3 - 0. Let s be (-3 - d)/(-1 - 1). Suppose sy + 4z = -y + 47, -5z = 3y - 113. What is the common denominator of y and -21/11? 11 Suppose -4p + 7 = -1. Suppose 53 = 3a - h, a - 13 = 3h + p. Suppose -4n = q - 16, -2q = 6n - n - 29. What is the smallest common	{ "pile_set_name": "DM Mathematics" }
at is the square root of 3201452 to the nearest integer? 1789 What is the cube root of 491869 to the nearest integer? 79 What is 8835000 to the power of 1/2, to the nearest integer? 2972 What is 1012248 to the power of 1/2, to the nearest integer? 1006 What is the cube root of 683587 to the nearest integer? 88 What is 9467741 to the power of 1/2, to the nearest integer? 3077 What is the cube root of 341999 to the nearest integer? 70 What is the cube root of 17992887 to the nearest integer? 262 What is the seventh root of 538172 to the nearest integer? 7 What is the square root of 6768560 to the nearest integer? 2602 What is the ninth root of 2995239 to the nearest integer? 5 What is 22447972 to the power of 1/3, to the nearest integer? 282 What is 1196178 to the power of 1/2, to the nearest integer? 1094 What is 4655422 to the power of 1/2, to the nearest integer? 2158 What is the third root of 9202553 to the nearest integer? 210 What is the third root of 316307 to the nearest integer? 68 What is 3683353 to the power of 1/3, to the nearest integer? 154 What is the third root of 28140702 to the nearest integer? 304 What is 8502899 to the power of 1/5, to the nearest integer? 24 What is the fourth root of 261023 to the nearest integer? 23 What is the seventh root of 1902070 to the nearest integer? 8 What is 115698 to the power of 1/2, to the nearest integer? 340 What is the fifth root of 2041983 to the nearest integer? 18 What is the square root of 926210 to the nearest integer? 962 What is the tenth root of 65374 to the nearest integer? 3 What is 194216 to the power of 1/3, to the nearest integer? 58 What is 204859 to the power of 1/8, to the nearest integer? 5 What is the square root of 399423 to the nearest integer? 632 What is the tenth root of 1669482 to the nearest integer? 4 What is the cube root of 1661231 to the nearest integer? 118 What is 1998802 to the power of 1/3, to the nearest integer? 126 What is 3752524 to the power of 1/3, to the nearest integer? 155 What is the square root of 201299 to the nearest integer? 449 What is the third root of 7445746 to the nearest integer? 195 What is 216526 to the power of 1/2, to the nearest integer? 465 What is 975004 to the power of 1/2, to the nearest integer? 987 What is 214265 to the power of 1/2, to the nearest integer? 463 What is the square root of 5274794 to the nearest integer? 2297 What is 1138589 to the power of 1/9, to the nearest integer? 5 What is the square root of 1110503 to the nearest integer? 1054 What is 7485710 to the power of 1/7, to the nearest integer? 10 What is the third root of 515865 to the nearest integer? 80 What is the third root of 219296 to the nearest integer? 60 What is 1144018 to the power of 1/3, to the nearest integer? 105 What is the sixth root of 9986106 to the nearest integer? 15 What is 7757109 to the power of 1/10, to the nearest integer? 5 What is the square root of 18191626 to the nearest integer? 4265 What is 528382 to the power of 1/9, to the nearest integer? 4 What is 4786021 to the power of 1/3, to the nearest integer? 169 What is the cube root of 3047932 to the nearest integer? 145 What is 1885886 to the power of 1/8, to the nearest integer? 6 What is 45921 to the power of 1/3, to the nearest integer? 36 What is 7945083 to the power of 1/3, to the nearest integer? 200 What is the square root of 270753 to the nearest integer? 520 What is the fourth root of 23940459 to the nearest integer? 70 What is 132111 to the power of 1/7, to the nearest integer? 5 What is the third root of 2633617 to the nearest integer? 138 What is 1205807 to the power of 1/2, to the nearest integer? 1098 What is 8761110 to the power of 1/9, to the nearest integer? 6 What is the square root of 32087 to the nearest integer? 179 What is the square root of 1028916 to the nearest integer? 1014 What is 2395687 to the power of 1/5, to the nearest integer? 19 What is the third root of 572875 to the nearest integer? 83 What is the ninth root of 830680 to the nearest integer? 5 What is 188740 to the power of 1/2, to the nearest integer? 434 What is 599082 to the power of 1/3, to the nearest integer? 84 What is the third root of 269444 to the nearest integer? 65 What is 30363534 to the power of 1/10, to the nearest integer? 6 What is 324963 to the power of 1/3, to the nearest integer? 69 What is the square root of 870461 to the nearest integer? 933 What is 385288 to the power of 1/2, to the nearest integer? 621 What is the square root of 9341205 to the nearest integer? 3056 What is 11949545 to the power of 1/2, to the nearest integer? 3457 What is 14970518 to the power of 1/3, to the nearest integer? 246 What is the ninth root of 3171298 to the nearest integer? 5 What is the ninth root of 2786574 to the nearest integer? 5 What is the cube root of 14241035 to the nearest integer? 242 What is the fourth root of 3598321 to the nearest integer? 44 What is 10236908 to the power of 1/7, to the nearest integer? 10 What is the fifth root of 15032654 to the nearest integer? 27 What is the eighth root of 389818 to the nearest integer? 5 What is the third root of 7736409 to the nearest integer? 198 What is the third root of 911864 to the nearest integer? 97 What is 4586107 to the power of 1/10, to the nearest integer? 5 What is the fourth root of 540262 to the nearest integer? 27 What is the square root of 293058 to the nearest integer? 541 What is the third root of 18221618 to the nearest integer? 263 What is the tenth root of 404134 to the nearest integer? 4 What is the ninth root of 1022893 to the nearest integer? 5 What is the cube root of 43918 to the nearest integer? 35 What is the tenth root of 13802703 to the nearest integer? 5 What is 385296 to the power of 1/10, to the nearest integer? 4 What is the cube root of 380940 to the nearest integer? 72 What is the square root of 1181829 to the nearest integer? 1087 What is 366105 to the power of 1/6, to the nearest integer? 8 What is 578478 to the power of 1/2, to the nearest integer? 761 What is 282986 to the power of 1/8, to the nearest integer? 5 What is 79145 to the power of 1/9, to the nearest integer? 4 What is 1106466 to the power of 1/7, to the nearest integer? 7 What is 3583700 to the power of 1/3, to the nearest integer? 153 What is 4831828 to the power of 1/9, to the nearest integer? 6 What is the third root of 9246518 to the nearest integer? 210 What is the fifth root of 118633 to the nearest integer? 10 What is the sixth root of 210865 to the nearest integer? 8 What is 62420 to the power of 1/9, to the nearest integer? 3 What is 836722 to the power of 1/8, to the nearest integer? 5 What is the cube root of 5586985 to the nearest integer? 177 What is the third root of 3768717 to the nearest integer? 156 What is the square root of 350020 to the nearest integer? 592 What is 2993566 to the power of 1/7, to the nearest integer? 8 What is 7846558 to the power of 1/2, to the nearest integer? 2801 What is the square root of 4410 to the nearest integer? 66 What is 12142554 to the power of 1/7, to the nearest integer? 10 What is the ninth root of 712797 to the nearest integer? 4 What is 1754876 to the power of 1/5, to the nearest integer? 18 What is 345617 to the power of 1/10, to the nearest integer? 4 What is the square root of 1980293 to the nearest integer? 1407 What is the ninth root of 12496961 to the nearest integer? 6 What is the ninth root of 2974913 to the nearest integer? 5 What is 71397 to the power of 1/3, to the nearest integer? 41 What is 22760628 to the power of 1/10, to the nearest integer? 5 What is 9318135 to the power of 1/4, to the nearest integer? 55 What is the third root of 389262 to the nearest integer? 73 What is the tenth root of 656717 to the nearest integer? 4 What is 581176 to the power of 1/5, to the nearest integer? 14 What is the ninth root of 258037 to the nearest integer? 4 What is 232904 to the power of 1/7, to the nearest integer? 6 What is the square root of 690791 to the nearest integer? 831 What is 3766813 to the power of 1/8, to the nearest integer? 7 What is 294201 to the power of 1/2, to the nearest integer? 542 What is the square root of 407722 to the nearest integer? 639 What is 94311 to th	{ "pile_set_name": "DM Mathematics" }
rue Let j = -106 - -525. Is j a composite number? False Suppose 11r + 55 = -110. Let x(a) = 6a*2 + 15a - 52. Is x(r) prime? False Suppose 3v = 7u - 9u + 8341, -u = 5v - 13890. Is v prime? True Suppose 4o - 23041 = 3b, 43o + b = 38o + 28806. Is o composite? True Let g(u) = -u*3 + 8u*2 + 2u + 7. Let o(k) = -k + 11. Let h = 9 + -4. Let s be o(h). Is g(s) a composite number? True Let p = 26244 - 9127. Is p composite? False Let d(o) = o*3 - 2o*2 - o - 4. Let c be d(3). Suppose 18 = -5r - g, 12 = -r + 6g - cg. Is (r + 5 - -2)29 prime? False Let r(x) = 1095x - 14. Let l be r(-10). Is (l/(-10) - -1) + 54/(-135) a composite number? False Let r be (-1)/(-7) - (-6)/7. Is (250 - (-4)/4)/r a prime number? True Suppose 0 = 4g - 2n, -g - 5n = -6g - 10. Suppose -g = -2a, -4a = -2h - h + 2255. Is h a prime number? False Let h(w) = 318w + 41. Is h(9) a prime number? True Let q(t) be the first derivative of 55t3 + 3t*2/2 - t + 10. Is q(-5) prime? False Let f be (-27)/36(-48)/9. Let x(a) = 57a + 10. Let d(v) = -28v - 5. Let q(i) = -5d(i) - 2x(i). Is q(f) prime? True Suppose 5b = -p - 532, -2p = p - b + 1660. Let v = -190 - -117. Let l = v - p. Is l composite? False Is 6/12051724 a composite number? False Let c(n) = n*2 + 6n + 5. Let g be c(-5). Suppose 2d - 73 = x, 2x - 4 + 2 = g. Let t = d - -22. Is t composite? False Suppose -2b + 1679 = 3u, 4u + 5b - 2765 = -517. Is u a prime number? True Let r(m) = -27m + 4. Let l be r(5). Let x = 143 - l. Is x a prime number? False Is (6387/6)/(1/2) composite? False Let o(m) = -6m*3 + 15m*2 + 47m - 59. Is o(-21) a composite number? True Let c = 5285 + 2712. Is c prime? False Let j(d) = 103d + 5. Let n(h) = 413h + 19. Let u(g) = -9j(g) + 2n(g). Suppose -14 = 5s + 3w, 2s - 3w + 20 = 6. Is u(s) a composite number? False Let j = 111 + -72. Suppose j = u - 36. Let a = u + -4. Is a composite? False Is ((-1)/(-3))/((-11)/(-71907)) composite? False Let l = 96 - 216. Let j = -53 - l. Is j a composite number? False Let v(o) = -o*2 - 50o - 162. Is v(-31) a prime number? False Let b(h) = 219h + 6. Let a be b(21). Suppose 0 = -11y + 8y + a. Is y composite? True Let k = 14288 + -20156. Let q = k - -10309. Is q composite? False Is ((-3)/(-3))/((-1)/(-123)) composite? True Let c be (-6 - -4)/((-4)/(-58)). Let b = c + 36. Is b a prime number? True Let w(y) = -4y - 22. Let o be w(-6). Suppose 2s + 0s - 46 = ov, 131 = -5v + s. Let g = 34 + v. Is g a composite number? False Suppose 0 = 8c + 14c - 68706. Is c/(-12)(-6 - -2) prime? False Is (5 - 4)(-7 + 0 - -1274) a composite number? True Let w = -859 - -1280. Suppose -6y = -y - 1110. Let u = w - y. Is u prime? True Suppose -2v + 4 = u, -3u + 4v = -0v + 8. Suppose ul = -l - 1. Is l - (2 + (2 - 208)) a composite number? True Let z(g) = -3g2 + 17g + 6. Let b be z(6). Suppose b = v - 0v - c - 157, 3v = -4c + 499. Is v a composite number? True Let o(v) = v2 - 6v - 12. Let h be ((-36)/8)/(1/(-2)). Let w be o(h). Is 4(-2 - w/(-4)) a composite number? False Suppose 0 = -20q + 148124 + 124856. Is q a composite number? False Is 1/(-2) + 4/(24/27249) prime? False Suppose 15 = 4n + n, 1849 = 2m + 5n. Is m prime? False Let y(d) = 6d*2 - 33 + 14 + 14 - 4d*2 + 3d + 17d3. Is y(2) a composite number? True Let c(s) = -s2 + 18s - 17. Let u be c(17). Let f(x) = 2x3 - 2x*2 - x + 163. Is f(u) a prime number? True Let u be 3/((2 - -1)/3). Suppose a + 0b = -2b + 13, ua = -5b + 34. Suppose -4i + 336 = 5h, 5i - h + ah = 403. Is i a composite number? False Suppose 5j = 3r + 2184, 446 = j - r + 5r. Let w = j - 19. Is w a prime number? True Let d(g) = g*3 + 11g*2 + 9g - 6. Let a be d(-10). Let h = a + -4. Suppose -5j + 5v + 270 = h, -2v = -2j + v + 107. Is j prime? False Let h be (-3 - -3)/(3 + -4). Suppose ho - 4o = -9332. Is o composite? False Let p be (9/27)/((-2)/(-12)). Suppose -f = -0 - p. Is 1422/(-12)f/(-3) composite? False Let c(x) = 8x*2 + 14x - 7. Is c(-18) a prime number? True Suppose 0 = 96s - 103s + 311269. Is s composite? True Let c(k) = k3 + k2 + k + 17. Let y be c(0). Is (-6)/51 + 3113/y a prime number? False Let u = 13348 - 6543. Is u a prime number? False Let w = 2245 - 1438. Is w prime? False Suppose 5z - 40 = 6w - 2w, -2 = -3z - 2w. Suppose o = h + 47, -zh + 9h = 0. Is o a prime number? True Suppose -2g + c + 54 + 0 = 0, 0 = 4g + 4c - 108. Let z = -21 + g. Suppose -5n = -zn + 85. Is n a prime number? False Is 1/(4/(-8)) + 4723 prime? True Let l = 9047 + -6088. Is l a composite number? True Let s be 4/(-8)-12 + -3. Suppose -sq = -6q + 165. Is q composite? True Let c(u) = u2 - 4u + 3. Let x be c(2). Is 569 - 1 - 3/x prime? True Let r(s) = 6s. Suppose -3u + 2 = f - 6, -4f + u = 7. Let j be r(f). Let x = 197 - j. Is x a prime number? False Suppose -9u + 2768 = -5u + 4l, 0 = -5u + 2l + 3495. Is u a prime number? False Let k be (1 + 3)(2 - 0)/4. Is k/((-8)/6)2274/(-9) a prime number? True Suppose -5i = -4i - 358. Suppose -29r = -27r - 1030. Let w = r - i. Is w a composite number? False Let y(i) = -4i - 12. Let b be y(-4). Is (-298)/b(-12 + 10) composite? False Suppose 5 = t - 2p, t + 4p = p - 10. Let l(w) = -882w2 - w. Let s(x) = -2648x*2 - 3x. Let y(c) = 17l(c) - 6s(c). Is y(t) a prime number? False Let s = 23 - 20. Is (s - 5)/(6/(-165)) prime? False Suppose 0 = 2n + 3a - 4384, -a + 401 = -n + 2588. Is n a prime number? False Let d = -3 - -2. Let u(l) be the second derivative of -3l5/20 + l4/6 + l3/6 - 83l. Is u(d) a composite number? True Let m = -50 + 53. Suppose mn - 354 = -123. Is n a prime number? False Let f(s) = s3 + s2 + 4s - 2s3 - 3s - 45 + 256. Let y = -20 + 20. Is f(y) a composite number? False Suppose 5s - 4p = -208 + 46, s - 5p = -45. Let j = s + 34. Let r(z) = 20z - 9. Is r(j) a composite number? False Suppose 4t - 50 = 2t. Suppose h + 4i = 21, -i = h + 4i - t. Suppose -7m - 1195 = -5q - 2m, -hq = 2m - 1167. Is q composite? True Suppose 0r - 5966 = 2r. Let i = r + 5304. Is i prime? False Suppose 4d = 3h + 231 + 226, 2d - 4h = 226. Is d a composite number? True Suppose -c + 4 = 0, -c + 4952 = 4w + 240. Let f = w + 169. Is f a prime number? False Let c(s) = 2430s2 - 2s + 3. Is c(2) prime? True Suppose -j + 290 = -3d, -j - 5d - 35 = -333. Let w = j + 174. Suppose -w = -5a + 278. Is a a prime number? True Suppose 0 = -2q + 29 - 319. Let h = 97 + 137. Let m = q + h. Is m a prime number? True Let t(y) = -4y3 - 8y*2 + 2y - 1. Let p be t(-8). Let a = p - 1029. Let w = a - 305. Is w prime? False Is (1/(-7) - (-26)/(-14)) + 5641 a composite number? False Suppose 7178x - 7182x = -333844. Is x composite? True Suppose -49q = -44q - 90. Suppose 142 + 246 = 4r. Let u = r - q. Is u a composite number? False Suppose 42y = 4398774 - 898536. Is y composite? False Suppose -b = t - 16839, 0 = 198t - 193t + 2b - 84207. Is t prime? True Let n be ((-1)/(-2))/(3/54 - 0). Suppose 152 = j + n. Is j prime? False Is -1338(-1)/1210 a composite number? True Let d be (-30)/(2/(-50)(3 + -1)). Suppose 0 = -5u + 4b + 2400 - d, -b + 5 = 0. Is u a prime number? True Let a(s) = s + 13. Let i be a(-7). Suppose 0 = -iy - 34 - 14. Is (126/y - 4)-4 composite? False Let r(k) = 5234k2 - 4k + 4. Is r(1) a prime number? False Let o = 10580 + 71259. Is o a prime number? True Suppose 5u - b + 30 = 2b, 0 = -2u - 5b - 12. Let h(s) = -264s2 + 3s - 6. Let l be h(u). Is l/(-60) + (-1)/(-5) a composite number? True Let f = 15567 - -17582. Is f prime? True Let b = 48 - -58. Let d = b + -72. Let n = -15 + d. Is n prime? True Let q(m) be the second derivative of m7/210 + m6/120 - m5/120 - m4/3 + 5m. Let o(k) be the third derivative of q(k). Is o(4) a composite number? True Let r be (2/(-2) - -4) + 1. Suppose -3u = u + rj - 68, j - 77 = -5u. Is (-20)/u(-78)/4 prime? False Suppose -10l - 73451 = -17l. Is l a prime number? False Suppose -4c + 20 = 0, -2c - 3193 = 5u - 65158. Is u composite? False Let n(f) = -f*2 + 11f + 22. Let x be n(10). Let b = -31 + x. Is (1276/(-2))/(-3 + b) composite? True Suppose 44 = 3c + c. Suppose u - c = -5m + 25, 0 = 2m - 4u	{ "pile_set_name": "DM Mathematics" }
1235) Simplify (qq/q(-2)q)*(-7/4)q*(-3/4)q2 assuming q is positive. q(-15/2) Simplify (i/(i*(1/3)i))*(-22/9)ii/(i/i(-2/11)ii)ii(-6)i assuming i is positive. i*(-1297/297) Simplify ((zz/(zz/(z/(zz*(-5/6))))z)/zz)/(z(z/z(-11))/z) assuming z is positive. z(-61/6) Simplify (c*(-38)ccc)/(cc(-10/11)c) assuming c is positive. c(-397/11) Simplify (m(-4))4 assuming m is positive. m(-16) Simplify ((w*(1/5)w)7)(2/9) assuming w is positive. w(28/15) Simplify (q(-1/6))(-6) assuming q is positive. q Simplify ((f/(f(-1/38)/f))/f)(-13) assuming f is positive. f(-507/38) Simplify f(-5/3)/f1f/f(1/4)((ff(1/3)f)/f)/f assuming f is positive. f(-19/12) Simplify (m(2/5))(-33) assuming m is positive. m(-66/5) Simplify n*(-6)nn6(n*3/nn)/n(-1/7) assuming n is positive. n(29/7) Simplify (w(-1/5))29/(w*(1/5)w/(w(wwwww/w(-1/4)ww)/w)) assuming w is positive. w(1/4) Simplify (tt/(tt10/t)t/t(-5/6))(1/41) assuming t is positive. t*(-37/246) Simplify (i((i*(1/12)i)/ii)/i)/(ii*(-1/11))(i(-1))(-1/14) assuming i is positive. i(227/924) Simplify r(-4/7)/(r/(r*(-7)r))(r(-2/9))32 assuming r is positive. r(-925/63) Simplify ((w(1/3)w)/w(-1))/(w0)50 assuming w is positive. w(7/3) Simplify (l*(2/9)/(ll(l/(l/l6))/ll))13 assuming l is positive. l(-910/9) Simplify ((r/(r/(((r/(r/r*(3/7))r)/r)/r)))/(r/r(-5)))(-12/7) assuming r is positive. r(552/49) Simplify ((v2)(-22/5))(-1/14) assuming v is positive. v(22/35) Simplify q(-2/69)/(q/(q/q(-10))) assuming q is positive. q(688/69) Simplify a*(-5)a*2((a*(-1/3)a)/a)9 assuming a is positive. a(-6) Simplify ((g(-2/3))(-2/43))(2/7) assuming g is positive. g(8/903) Simplify ((o/(o/(o*(-15)oo)))/o)/ooo(-1/9) assuming o is positive. o(-127/9) Simplify ((h/(h/(hh/h1)))/(h/(h/h4)))/((h2/h)/(h(-2/7)h)) assuming h is positive. h(-23/7) Simplify (n(-1/15))(1/7) assuming n is positive. n(-1/105) Simplify (tt/((t*2t)/t))*12t*6/t(t/(t(t8t)/t))/t assuming t is positive. t(-4) Simplify (g(-2/15))33 assuming g is positive. g(-22/5) Simplify (b/(bb9)b)(4/27) assuming b is positive. b(-32/27) Simplify (tt5)/(t/t(1/15)) assuming t is positive. t(76/15) Simplify (j(-2)j)(-2)/((j(-4)/j)/(j/(j/j*(-3))jjj)) assuming j is positive. j*7 Simplify (ttt(1/11)tt)/t(t/(ttt*(-17)t))/tt assuming t is positive. t(199/11) Simplify ((i/(iiii*(3/5)i))/(iii*(-4)i))/(i(1/3))(7/3) assuming i is positive. i(-152/45) Simplify (a(-7)(a/(a/((a(-2)/aa)/a)))/a)/(a/a*(-1/10)(a(1/5)/a)/a) assuming a is positive. a(-103/10) Simplify (q(qq*11q)/qq)/q(-1/10) assuming q is positive. q(141/10) Simplify (m(-2/9))(-37)/(m(-2/5))(-49) assuming m is positive. m(-512/45) Simplify u(-15)/uu14 assuming u is positive. u(-2) Simplify (k/(k/(k/k*(-7/5))k)(k/k(1/8))/k)(-44) assuming k is positive. k(-561/10) Simplify (((a/a0)/a)/aaa(-9))32 assuming a is positive. a(-288) Simplify (c(c/(c/(cc/(c(1/3)/c))))/ccc)/c6c5/((c(-3)/c)/c) assuming c is positive. c*(26/3) Simplify (ttt/(tt*(-15/8)t)t)/t(-3/5) assuming t is positive. t(179/40) Simplify qq/(((qq(4/3))/q)/q)q(-21/2) assuming q is positive. q(-53/6) Simplify (g/g*(-2/15)gg(-2/3))/((g/(gggg/(g4/g)))/g(-8)) assuming g is positive. g(-98/15) Simplify ((l/l(-1))(-4/17))(6/19) assuming l is positive. l*(-48/323) Simplify p/((pp*48)/p)pp(-17) assuming p is positive. p(-63) Simplify ((uu(-2))(-14))(15/11) assuming u is positive. u(210/11) Simplify ((g/g(-2/7))(-3/29))(-2/21) assuming g is positive. g(18/1421) Simplify (hh(1/7)hh/((hh*(2/3)/hh)/h)hh)/(h*(-1/2)h(-5)) assuming h is positive. h(419/42) Simplify ((rrrr/r(-5/4))/r3)(10/3) assuming r is positive. r(15/2) Simplify (p7)(-7) assuming p is positive. p(-49) Simplify ((ggg(8/3)g)/((g/g*(-2/13))/gg))(-1/4) assuming g is positive. g(-44/39) Simplify (m*(3/7)m/(((m/m*(-3))/mm)/m))/(m/((m/(mm(-1)))/m))(-9) assuming m is positive. m(52/7) Simplify (p(-1/3))(-1/3)((p(-2)/p)/p)(2/11) assuming p is positive. p(-61/99) Simplify (o(2/5)/o(1/5))/(o/o(3/5)o((o*3o)/o)/o) assuming o is positive. o*(-16/5) Simplify (((bb/(((b((b(-1)b)/b)/bb)/bb)/b))/b)(-21))(1/28) assuming b is positive. b(-3/2) Simplify w/((w/(w/((w(-2/11)w)/w)))/w)(ww(-11/3))/w assuming w is positive. w(-49/33) Simplify (j1j)*(-1/2)(j(j/j(1/10))/j)/jj(j(-1)j)/j assuming j is positive. j*(-11/10) Simplify (i/(ii*7i))/i(10/7) assuming i is positive. i(-66/7) Simplify pp/(pp/(pp/(p(-20)/p)))p(-7/12) assuming p is positive. p(269/12) Simplify uu/u(-5)u*(-1)uu/(uu*(-4)uu)uuu/(uuu/(u/(u/u(-3)))) assuming u is positive. u6 Simplify ((c(-2))(-6))(21/2) assuming c is positive. c126 Simplify y*31/(y/((yy34)/y)) assuming y is positive. y64 Simplify ((n/(n/n*(2/3))n)/n*(-3/10))/(nnn/(nn*(6/11))nn/n(-3/5)) assuming n is positive. n(-689/330) Simplify (ff(-16))/(f/(f/(f(2/7)/ff))) assuming f is positive. f(-107/7) Simplify ((i(ii(1/2))/i)/(i(-8)/i))/((i/i(2/11))/(i/((ii*(2/19))/ii))) assuming i is positive. i*(4003/418) Simplify (gg*22)/gggg(6/13) assuming g is positive. g(318/13) Simplify (dd10)/dd(-11) assuming d is positive. 1/d Simplify ((i/i(-3/8))/ii(-2/13))/(i(2/3))(-4/9) assuming i is positive. i(1453/2808) Simplify (jjj(-10))/(j/j(-1/2)) assuming j is positive. j(-19/2) Simplify (l(5/4)/l)/ll/(l(-22)/l) assuming l is positive. l(93/4) Simplify (g*(2/5)gg(-1/10))27 assuming g is positive. g(351/10) Simplify c/c34c(-1/9) assuming c is positive. c(-298/9) Simplify (((a(3/7)/a)/a)(-12/13))(-1/10) assuming a is positive. a(-66/455) Simplify (r/(((r(4/3)/r)/r)/r))(-11/2) assuming r is positive. r(-44/3) Simplify q(1/7)/q*(4/7)(q/q(-1/4))(-14) assuming q is positive. q(-251/14) Simplify (r(2/5))*(1/25)/((r/((rr/r*0)/r)r)/r)(2/5) assuming r is positive. r(2/125) Simplify (((i/(i/((i*(-7)i)/i)))/ii)/(i1i))/(i/i(-1/3))46 assuming i is positive. i*(-211/3) Simplify ((ff*(1/32)f)/f)/(ff(-8)ff) assuming f is positive. f(193/32) Simplify (t(3/7)/ttt(-2)/t)/((t7t)/(t7/t)) assuming t is positive. t(-32/7) Simplify ((z((z/((((z/(z(zz(-1/3))/z))/z)/z)/z))/z)/z)4)(-18) assuming z is positive. z(-192) Simplify ((tt*3tt)/t(-5))/(t/t(-2/9))14 assuming t is positive. t(-55/9) Simplify ((g(1/7)/g)/(g/(g/(g2/g))))(-13) assuming g is positive. g(169/7) Simplify (q(q/(qq/((qqq/q(3/2))/q)q)qq)/q)/qqq(q/(q(1/3)/q))/qqq(qq/(qq/q*(-6/5))q)/qqq(3/4)/q assuming q is positive. q(223/60) Simplify (oo(3/11))(-1) assuming o is positive. o(-14/11) Simplify ((o/o(-2/3))17)(-2/3) assuming o is positive. o(-170/9) Simplify w(3/2)w/(ww11) assuming w is positive. w(-19/2) Simplify ((l7/l)/(l(1/7)lll))(-8/3) assuming l is positive. l(-160/21) Simplify (q(2/3)/q(-1))(-27) assuming q is positive. q(-45) Simplify nn/(n(-13)n)n/(nn(-1/39)) assuming n is positive. n(547/39) Simplify (zz(zz7/z)/zzz)/(z/z(-6)z)(z(-1/5)z)/z8 assuming z is positive. z(-26/5) Simplify ((g*(-1/8)g)/(gg(-4)))/(g4(gg/(((gg/(((g*3/g)/g)/g)gg)/g)/g)g)/g) assuming g is positive. g(-1/8) Simplify b(13/3)/bb/b(-2/3) assuming b is positive. b5 Simplify x(-2/15)/(x/x5)x*9/(xx(1/8)) assuming x is positive. x(1409/120) Simplify ((f1)12)(-1/6) assuming f is positive. f(-2) Simplify (c/(c20/c))/(c/(c(-1/6)/c)) assuming c is positive. c(-121/6) Simplify (d(3/4))(-34) assuming d is positive. d(-51/2) Simplify (v*(-2/3)/vv(-1/2))/(v(-2/7)v/v(-2/3)) assuming v is positive. v(-149/42) Simplify ((k/k(-4/7))/(k/(k(-3/4)k)))/(k*4k(1/5)/k) assuming k is positive. k(-333/140) Simplify (o	{ "pile_set_name": "DM Mathematics" }
many centuries are there in thirty-one halves of a millennium? 155 What is twenty-one eighths of a microgram in nanograms? 2625 How many microseconds are there in 742981.7 milliseconds? 742981700 How many nanoseconds are there in 227.1696 milliseconds? 227169600 How many micrometers are there in 8.49002mm? 8490.02 What is six fifths of a microgram in nanograms? 1200 Convert 2.579736ml to litres. 0.002579736 How many milliseconds are there in 9/10 of a minute? 54000 How many grams are there in 6/5 of a kilogram? 1200 Convert 2308226.13 minutes to weeks. 228.9906875 How many seconds are there in 1/96 of a week? 6300 Convert 1.864147ug to tonnes. 0.000000000001864147 How many micrometers are there in eleven eighths of a millimeter? 1375 What is 450.2294mg in tonnes? 0.0000004502294 How many seconds are there in 25/4 of a minute? 375 What is 1/4 of a litre in millilitres? 250 What is 629257.2 micrograms in nanograms? 629257200 How many micrometers are there in 63321.18 nanometers? 63.32118 How many millilitres are there in fourty-four fifths of a litre? 8800 What is 9.152683 millennia in centuries? 91.52683 How many millilitres are there in 11/2 of a litre? 5500 Convert 172.398 litres to millilitres. 172398 Convert 79.2335um to meters. 0.0000792335 Convert 0.8520069 millilitres to litres. 0.0008520069 Convert 72035.04ms to microseconds. 72035040 How many centimeters are there in fourty-five quarters of a meter? 1125 What is 1/20 of a millisecond in microseconds? 50 What is 7/6 of a minute in seconds? 70 What is 27/4 of a microgram in nanograms? 6750 What is 210817.41 months in years? 17568.1175 How many grams are there in one twentieth of a tonne? 50000 How many meters are there in five eighths of a kilometer? 625 How many nanograms are there in 710.6851 milligrams? 710685100 How many micrometers are there in 64.67386 nanometers? 0.06467386 How many minutes are there in 17/9 of a day? 2720 Convert 2.629413 meters to micrometers. 2629413 How many grams are there in 97.75006 tonnes? 97750060 Convert 670.1579l to millilitres. 670157.9 Convert 2.593885 weeks to minutes. 26146.3608 What is five eighths of a millennium in months? 7500 How many millilitres are there in 26737.55 litres? 26737550 What is fourty-five quarters of a litre in millilitres? 11250 What is 3/10 of a decade in months? 36 How many days are there in 556105.68 minutes? 386.1845 What is eight fifteenths of a hour in minutes? 32 How many micrograms are there in 3/32 of a gram? 93750 Convert 497.034ml to litres. 0.497034 How many months are there in one quarter of a millennium? 3000 What is 789.3453 grams in micrograms? 789345300 What is 803.3836nm in meters? 0.0000008033836 What is 4/15 of a hour in seconds? 960 What is thirty-three fifths of a meter in millimeters? 6600 What is 21/4 of a microgram in nanograms? 5250 What is 3/10 of a meter in centimeters? 30 What is 25/2 of a litre in millilitres? 12500 How many millimeters are there in twenty-one halves of a centimeter? 105 What is 4/15 of a century in months? 320 What is fifty-seven fifths of a hour in minutes? 684 What is thirty-one halves of a microgram in nanograms? 15500 Convert 45.50059mm to centimeters. 4.550059 Convert 6903.173 seconds to microseconds. 6903173000 How many grams are there in 1/5 of a kilogram? 200 Convert 0.290215 micrograms to nanograms. 290.215 What is twenty-one quarters of a century in months? 6300 How many millilitres are there in twenty-five eighths of a litre? 3125 What is 0.549976 centuries in years? 54.9976 How many microseconds are there in 6/5 of a millisecond? 1200 What is 31/5 of a kilogram in grams? 6200 What is 77.62563 millilitres in litres? 0.07762563 How many centimeters are there in 3/10 of a meter? 30 How many nanometers are there in 716042.1 centimeters? 7160421000000 What is 5/24 of a minute in milliseconds? 12500 How many grams are there in 6051.721ug? 0.006051721 What is 15.90867l in millilitres? 15908.67 What is 53.65151 litres in millilitres? 53651.51 What is 965921.1 seconds in milliseconds? 965921100 What is 28.47726 weeks in hours? 4784.17968 Convert 0.9140081 centuries to decades. 9.140081 How many micrometers are there in 34/5 of a millimeter? 6800 Convert 14.144538 hours to days. 0.58935575 Convert 22.30523 hours to milliseconds. 80298828 What is four thirds of a minute in milliseconds? 80000 What is twenty-one eighths of a gram in milligrams? 2625 What is six fifths of a kilometer in meters? 1200 Convert 3004.911ml to litres. 3.004911 Convert 26875.4 decades to months. 3225048 How many micrograms are there in 58232.51 kilograms? 58232510000000 What is 3/40 of a litre in millilitres? 75 Convert 0.7098226l to millilitres. 709.8226 How many micrograms are there in 3/40 of a milligram? 75 What is 803.7397kg in nanograms? 803739700000000 Convert 0.767333 milliseconds to microseconds. 767.333 Convert 52.55789 milliseconds to microseconds. 52557.89 How many centuries are there in 56796.79 millennia? 567967.9 What is 3/5 of a litre in millilitres? 600 How many months are there in one sixth of a century? 200 How many micrograms are there in seven quarters of a milligram? 1750 What is one twentieth of a microgram in nanograms? 50 What is three eighths of a century in months? 450 What is 68288.1759 milliseconds in weeks? 0.00011291034375 What is 11/2 of a litre in millilitres? 5500 Convert 3992.368 grams to tonnes. 0.003992368 What is 1/10 of a century in months? 120 What is 25/2 of a milligram in micrograms? 12500 How many millilitres are there in one quarter of a litre? 250 Convert 4800.747 micrograms to milligrams. 4.800747 What is thirteen fifths of a tonne in kilograms? 2600 What is 3/5 of a second in milliseconds? 600 Convert 6384.93ml to litres. 6.38493 Convert 16.609392 months to decades. 0.1384116 Convert 3802.143 millimeters to nanometers. 3802143000 How many millilitres are there in 6205.189l? 6205189 What is 66.77202 microseconds in nanoseconds? 66772.02 How many grams are there in fifty-two fifths of a kilogram? 10400 How many micrograms are there in 874247.8t? 874247800000000000 How many hours are there in 23/6 of a day? 92 What is five quarters of a litre in millilitres? 1250 What is 6424.015ng in grams? 0.000006424015 How many years are there in 2.347241 decades? 23.47241 What is 6/25 of a litre in millilitres? 240 How many seconds are there in 2/27 of a day? 6400 How many months are there in 5/6 of a year? 10 How many years are there in 2.8440111 months? 0.237000925 What is 0.7190879t in micrograms? 719087900000 What is 32/5 of a century in months? 7680 What is 96.73138g in nanograms? 96731380000 What is fifteen quarters of a millennium in months? 45000 Convert 37556.88 grams to nanograms. 37556880000000 How many decades are there in 2.6710791 months? 0.0222589925 How many millilitres are there in twenty-five eighths of a litre? 3125 What is four fifteenths of a day in seconds? 23040 How many micrometers are there in 1640.978 centimeters? 16409780 How many milligrams are there in five eighths of a gram? 625 How many decades are there in 12/25 of a millennium? 48 What is 609096.1mm in centimeters? 60909.61 How many microseconds are there in 9.727497 hours? 35018989200 What is 9/10 of a litre in millilitres? 900 What is three eighths of a litre in millilitres? 375 How many litres are there in 0.758587 millilitres? 0.000758587 How many minutes are there in 547853.6 weeks? 5522364288 How many months are there in twenty-five halves of a century? 15000 What is 1/10 of a tonne in grams? 100000 What is 5/4 of a tonne in kilograms? 1250 How many months are there in 3/25 of a century? 144 How many grams are there in thirty-three tenths of a kilogram? 3300 Convert 240.55527 months to decades. 2.00462725 Convert 23.421798ms to days. 0.000000271085625 What is 5/6 of a day in hours? 20 What is 1.093239 nanometers in meters? 0.000000001093239 Convert 471.1298 seconds to nanoseconds. 471129800000 What is 43/4 of a meter in millimeters? 10750 What is 68.49202 years in centuries? 0.6849202 How many millilitres are there in one fifth of a litre? 200 What is 1/4 of a micrometer in nanometers? 250 Convert 88193.54 grams to nanograms. 88193540000000 How many millennia are there in 896980.3	{ "pile_set_name": "DM Mathematics" }
m*2 + m - 1. What is the smallest common multiple of u and o(2)? 45 Suppose -2t - 351 = -3i, 135 = 3i + 3t - 201. Calculate the common denominator of -43/4 and i/(-6) + -1 + 2. 12 Suppose 0 = k, 0x = -x + 3k. Suppose 0 = -3g - xg + 33. What is the smallest common multiple of g and 6? 66 Let v(t) = -t2 + 5t. Let b be v(5). Suppose -2l + b = -2. Calculate the lowest common multiple of 1 and l. 1 Let m = -2 + 5. Suppose -5v - 16 = 54. Calculate the smallest common multiple of (1 - v) + m + -6 and 3. 12 Calculate the common denominator of 26/11 and (-18)/72 + 79/4. 22 What is the least common multiple of ((4 - 2) + -1)/((-5)/(-45)) and 7? 63 Let k = -85/4 + 99/4. Let t be 1 - 2 - (-1 + 4). Calculate the common denominator of ((-1)/t)/((-10)/(-74)) and k. 20 Let n = -197957/43576 - 1090/419. Let s = n + 59/26. Calculate the common denominator of s and 61/20. 40 Let p = 568063/6 + -95392. Let v = p + 725. Find the common denominator of -13/11 and v. 66 Suppose -2 = -q - 1. Suppose q + 49 = 5h. Calculate the least common multiple of h and 16. 80 Let p be -1-2(-2)/4. Let j(q) = -11q - 1. What is the smallest common multiple of 2 and j(p)? 10 Let k = -4 - 0. Let s = k - -4. What is the smallest common multiple of 8 and 7(2 + (-1 - s))? 56 Suppose 2c - 4 = -k - 0c, -5c - 5 = -5k. Suppose 4 = 2o - 6, 13 = -kn + 5o. What is the least common multiple of n and 4? 12 Let w be 6/(-27) - (-628)/(-9). Let s be (-2)/(-4) - w/4. What is the smallest common multiple of (1 - 0 - -1) + s and 4? 20 Let s = 16 + -8. What is the least common multiple of 12 and s? 24 Suppose -4h - 110 = -9h. What is the lowest common multiple of 6 and h? 66 Let v = 87802/19 + -413223/190. Let y = 2440 - v. Find the common denominator of (26/(-4))/(33/18) and y. 110 Calculate the least common multiple of 6 and -5 + (-4 + 18 - -1). 30 Let s(a) = -2a + 6. Let t = 12 - -4. Calculate the lowest common multiple of s(-8) and t. 176 Let t = 86881/14676 - 4/1223. Let m = -427/90 - 7/10. Calculate the common denominator of m and t. 36 Let o be 26/10 + (-4)/(-10). Let x = o - 0. Suppose -z + 15 - 10 = 0. What is the smallest common multiple of x and z? 15 Let c(x) = -7x*2. Suppose 4r - 8 = 2b, 0r = -3r - 3b - 3. Let p be c(r). Calculate the least common multiple of (-2)/p - (-15)/21 and 6. 6 Let s = 2598 - 28609/11. Find the common denominator of s and 18/(-45) - 0 - 233/5. 11 Let r be ((9051/4)/1)/(-12). Let b = r + 193. Find the common denominator of (513/18)/(-7 - (-2 + 0)) and b. 80 Calculate the common denominator of 56/5 and (-1 - -2) + (-1330)/(-756). 270 Let m = -12 + 21. Suppose -4p + 6 = -2p. What is the least common multiple of m and p? 9 Let s be (-214)/12302/4. Let m = s - -5465/4. What is the common denominator of m and (-1092)/480 - 2/(-5)? 24 Let h be (14 + 0)147/(-14). Calculate the common denominator of 101/6 and (-3)/(-2)h/27. 6 Let d(z) = -z3 + 2z + 1. Let f be 3/(-4) - 35/28. Calculate the smallest common multiple of d(f) and 11. 55 Suppose -y = -6y + 50. Suppose 3n = 2v + 7, -2n + 6n + 2v = 14. Let z = 23 - n. Calculate the lowest common multiple of z and y. 20 Let o(i) = -i*2 - 6i - 1. Let f be o(-5). What is the common denominator of 32/(-6) + -12 and ((-3)/f)/(12/200)? 6 Let j be (-2 + 4)(-9)/6. Let p = j + 14. Calculate the lowest common multiple of 11 and p. 11 Suppose -5u - 1 = 4. Let j(m) = m. Let h(f) = 222f. Let o(p) = -h(p) + 185j(p). Find the common denominator of -52/7 and o(u). 7 Suppose -x + 5 = 4l, 15 = -x + 4x - 2l. What is the lowest common multiple of x and 10? 10 Suppose -z - z = -18. Let v = 4 + -3. What is the least common multiple of v and z? 9 Let a = 78 - 25. Suppose 5o + k = -0k + 85, -3o - k = -a. Calculate the smallest common multiple of 22 and o. 176 Suppose -2m - 62 = -3n + 2m, -n + m + 21 = 0. Calculate the lowest common multiple of n and 20. 220 Suppose -15c = -8c - 189. Calculate the lowest common multiple of 3 and c. 27 Suppose -5v + 10 + 10 = 0. What is the lowest common multiple of v and 15? 60 Let w = 3221 + 1654. Let m = -68323/14 + w. What is the common denominator of (1/(-24))/(3/(-618)) and m? 84 Let d = -1 - -49. Calculate the least common multiple of 8 and d. 48 Let t = -5 + 21. What is the least common multiple of t and 12? 48 Let t(f) = -2f - 10. Let g be t(-8). Calculate the lowest common multiple of (-4)/g6/(-4) and 8. 8 Suppose 0 = -5r + 9r. Calculate the common denominator of r + 170(-1)/(-4) and (1 - 17/(-16)) + -1. 16 Let l = -63/20 - -27/4. Calculate the common denominator of -97/4 and l. 20 Let q = -11 + 16. Let c(z) = 6z - 2. Let g(a) = 5a - 1. Let m(t) = -4c(t) + 5g(t). Calculate the lowest common multiple of m(q) and 3. 24 Suppose -2a = -0a - 8. Suppose 2h + 12 = 2c, 13 = 2c - h - 4. Calculate the smallest common multiple of c and a. 44 Suppose 5f + 10 + 15 = 0, f + 53 = 3d. What is the least common multiple of d and 18? 144 Let o(f) = -21f*2 + 2f + 1. Let h be o(-1). Let j = -950 - -1991/2. Calculate the common denominator of (-10)/(-6)(-54)/h and j. 22 Suppose -7 = 2b + 4i - 1, 5 = -i. Let r = 131 - 122. Calculate the lowest common multiple of b and r. 63 Suppose 0j = 2j - 12. What is the smallest common multiple of 19 + -18 - -10(-2)/(-2) and j? 66 Let y be (18/7)/(6/56). Suppose 0 = 5d - y + 9. What is the lowest common multiple of d and 2? 6 Let c be (32/(-24))/(4/(-6)). Suppose 0 = -2b - 4d + c, -5b + 5d - 29 = 11. Find the common denominator of 37/2 and b. 2 What is the smallest common multiple of 28/49(-14)/(-4) and 10? 10 Let w(n) = -3n3 - 3n*2 - n. Suppose -5f + 3i = -0i - 67, 0 = -3f - 5i + 47. Calculate the least common multiple of f and w(-2). 14 Suppose 2h - 108 = -2h. Suppose 0 = -3v + h + 9. What is the smallest common multiple of v and 4? 12 Let u be 2/(-3) + (-4)/(-6). Let i(p) = p + 4. Let k = 3 - -8. Calculate the lowest common multiple of i(u) and k. 44 Let j(h) be the first derivative of h4/4 - 2h3/3 + h2 - h + 3. Let a be j(2). What is the common denominator of (-76)/(-3)a/9 and -30/11? 99 What is the least common multiple of 2 and 41 - (-3 + (1 - (2 - 3)))? 42 Suppose x - 1 = -0. Suppose -3t + 2t = -3. Suppose w - 2w - x = -ts, -3w + 39 = 5s. What is the least common multiple of 1 and w? 8 Let k = 100063051/129132 + -11/14348. Let d = -781 + k. Calculate the common denominator of d and -35/8. 72 Let s(n) = -n3 + 6n*2 - 4n - 4. Calculate the least common multiple of s(5) and 10. 10 Suppose 0 = -l + r + 25, r - 5r = l - 15. Let d = l + -1. Let j(u) = u + 4. Calculate the lowest common multiple of j(0) and d. 44 Let i be (-78)/5 + (-2)/5. What is the common denominator of (-190)/i + (-3)/6 and -53/3? 24 Let t = -18657/1298 + 604/59. Let k = 3645/4 - 919. What is the common denominator of k and t? 44 Let u(v) = v3 + 2v*2 - 2v - 1. Let n be u(-2). Suppose 18 = 5w + n. Calculate the common denominator of 15/14 and (-1)/w - (-355)/(-150). 70 Let b = -6 - -12. Suppose 0 = 2y + y - 12. Suppose yl + j = 31, 2l + j = bj - 1. What is the least common multiple of 10 and l? 70 Let n = 21 + -8. Let v = n - 22. Calculate the common denominator of -73/2 and (v + -1)/((-12)/14). 6 Let n(c) = 3c - 4. Let f be n(-4). Let j be (2 + f/6)3. Calculate the smallest common multiple of (-25)/j - 3/6 and 20. 60 Let q = 13749/5236 + 5/476. What is the common denominator of q and (53/4)/(-5 + 6)? 44 Let c = 10 + -6. What is the least common multiple of 10 and c? 20 Suppose -24 = 2a - 6a. Let c(z) = z3 + 6z*2. Let g be c(-6). Let u = 20 + g. What is the lowest common multiple of u and a? 60 Find the common denominator of ((-9)/(-40))/((-3)/78) and -35/3. 60 Find the common denominator of -11/6 and ((-5)/((-450)/122))/(2/(-6)). 30 Let c(q) = -5q - 2 - 4 + q - 2. What is the smallest common multiple of 16 and c(-6)? 16 Let n = -2404 - -12077/5. Let i = -19 + n. Calculate the common denominator of i and -1 - 186/16-1. 40 Let l(c) = 3c + 7. What is the lowest common multiple of 12 and l(5)? 132 Let t = 15 + -12. Suppose -2v + 5w + 30 = 0, v - 36 = -2v + tw. Calculate the smallest common multiple of v and 22. 110 Let a(q) = -q*3 - 15q*2 + 16q - 2. Let y be a(-16). Let v	{ "pile_set_name": "DM Mathematics" }
-0.09? (a) -4 (b) 28 (c) 6/7 (d) -1/2 d Which is the closest to 0.1? (a) -1/9 (b) 17.1 (c) 1 a What is the nearest to 1 in -31, 0, 3? 0 What is the closest to 1 in 8, -10, 5? 5 What is the closest to 102 in 4, -2, 2/51? 4 Which is the closest to 0.2? (a) -5 (b) 2 (c) 0 (d) -20 c What is the closest to -36 in -0.4, 0.5, -2/7, -4? -4 Which is the nearest to -2/3? (a) -2.7 (b) 0.2 (c) 2/13 (d) -1/5 d Which is the closest to 301/4? (a) -0.4 (b) -1 (c) 2/13 c Which is the closest to 1? (a) -0.3 (b) 0.4 (c) 0.06 (d) 2/19 b Which is the nearest to 1? (a) -3/7 (b) 3 (c) 8 a What is the nearest to -0.1 in 32, 3/4, 4, -3? 3/4 Which is the nearest to -0.1? (a) 4 (b) 7 (c) 1/2 (d) 2/3 c Which is the nearest to -2/21? (a) -10/9 (b) -0.1 (c) -11 b What is the nearest to 18/7 in 3, 4/3, 5, 4/7? 3 What is the nearest to -0.05 in 0, -1/2, -4, 2/13? 0 Which is the nearest to 0.1? (a) 5/3 (b) -4 (c) 9 (d) -0.1 d Which is the nearest to 1? (a) -6/7 (b) 2 (c) 0.3 (d) -1/3 c What is the closest to 1 in -1/6, -7/18, -0.5? -1/6 What is the nearest to 0.05 in 28, 2/3, 1? 2/3 What is the closest to -2 in -8, 40, -1? -1 Which is the closest to 1? (a) -3 (b) 0.6 (c) 3 (d) 1/3 b Which is the closest to -6? (a) 6 (b) -1/13 (c) 0.5 b Which is the closest to 1/3? (a) 2/57 (b) -5/2 (c) -1 a What is the nearest to -2 in 5, 10, -115? 5 Which is the closest to 1? (a) -2 (b) -3 (c) -1/6 (d) -0.02 d Which is the nearest to -2/5? (a) -2/9 (b) 0.2 (c) -0.2 (d) 24 a What is the closest to 1/8 in 0.4, 1/7, -4/7, -1/3? 1/7 What is the closest to -2/9 in -0.1, 0.4, 4/5, 1? -0.1 Which is the nearest to -7/5? (a) 8 (b) -6/11 (c) -4 b Which is the closest to 15/8? (a) 6/11 (b) 0.07 (c) 0.5 a What is the nearest to -17 in -2, -0.5, -2/15, -3/5? -2 What is the nearest to 14 in -2/13, -60, 0.3? 0.3 Which is the closest to -19/2? (a) -1 (b) 4 (c) 2/7 (d) 4/11 a Which is the closest to -0.14? (a) 0.3 (b) -2 (c) -912 a Which is the closest to -3/4? (a) -2/7 (b) -2/15 (c) -4 (d) 4/5 a Which is the closest to 0.1? (a) 4 (b) -1 (c) -2484 b Which is the nearest to 3/7? (a) -28 (b) -5 (c) -0.1 (d) 0 d What is the nearest to 2/5 in 0.2, -3/16, -4, 8? 0.2 Which is the closest to -1/4? (a) 11 (b) -0.4 (c) -3/2 b Which is the closest to 0.11? (a) 0.5 (b) -0.5 (c) -0.4 a What is the closest to -4 in -3, 0.1, -0.01, -4? -4 What is the nearest to -0.1 in -3/7, 92, -28? -3/7 Which is the closest to -33? (a) -0.2 (b) -0.5 (c) 3 b Which is the closest to 2? (a) 8 (b) 0.4 (c) -2/17 (d) -0.05 b Which is the nearest to 0.9? (a) -0.5 (b) 0 (c) -2/21 b What is the closest to 0 in 5, 4, 0.2? 0.2 Which is the nearest to -77.9? (a) 4 (b) -0.3 (c) 3 b What is the nearest to -1 in 11, 2/5, -3/5, 2/9? -3/5 Which is the nearest to 1? (a) -3/4 (b) -3/5 (c) 3 (d) 0.2 d Which is the closest to -2/5? (a) -1/4 (b) 2 (c) -2 (d) -1 a Which is the closest to 2? (a) 1.5 (b) -3/5 (c) -1 a What is the closest to 1/2 in 14, -2, 4, -1? -1 Which is the nearest to 3.6? (a) 0.2 (b) -3 (c) 0.5 c Which is the closest to 6? (a) 3/5 (b) -71 (c) 3/2 c What is the closest to 0 in -29, 2/5, -4/5, 5? 2/5 What is the nearest to 2/3 in -1/2, 2/11, -12/11? 2/11 Which is the closest to -0.2? (a) 3 (b) -2 (c) -0.5 (d) 5 c Which is the nearest to -0.2? (a) 0.68 (b) -0.5 (c) -5 b What is the closest to -1 in 0.11, 1, 0.5, -1/6? -1/6 What is the nearest to 2 in 2, 2/5, -0.4, -0.006? 2 Which is the closest to -2/17? (a) 0.2 (b) -2 (c) -0.15 c Which is the closest to -2? (a) -0.5 (b) -2 (c) -9 b Which is the closest to -3/7? (a) -1 (b) 5 (c) 149 a What is the closest to 0.2 in 0.1, -25, 4/7? 0.1 What is the nearest to 0.024 in 6, -0.5, -2/3, 3? -0.5 What is the nearest to 0.03 in -0.7, -3, -4, 36? -0.7 Which is the nearest to 0.1? (a) -5/6 (b) 4 (c) 2/9 (d) 0.097 d What is the nearest to 1 in -5, -0.1, -1, 0.5? 0.5 Which is the nearest to 0? (a) 10 (b) -0.1 (c) 0.3 b What is the nearest to -3 in 0.1, 5, -2/21, -9? -2/21 Which is the nearest to 0.5? (a) -4 (b) 9 (c) 2/13 (d) -1/6 c Which is the closest to 37? (a) 0.1 (b) 1/12 (c) -4 a Which is the nearest to -4? (a) 4 (b) -0.1 (c) 13 (d) 1/7 b Which is the nearest to 2? (a) 0 (b) -2/15 (c) 4/7 (d) -0.2 c What is the closest to -1 in -2, 2/15, -0.5, -48? -0.5 What is the nearest to 0 in -1, -17, -0.1, 3? -0.1 Which is the nearest to -2? (a) -2.1 (b) 1/7 (c) -5 a What is the closest to 1138 in 0.5, 4, -2? 4 Which is the nearest to 2/3? (a) 2/7 (b) 2 (c) -22 a What is the closest to 2 in -1, -0.4, -10, 3? 3 What is the closest to 6 in 0.2, -2/35, 3? 3 Which is the nearest to -2/7? (a) -3 (b) -1 (c) 3/5 (d) -5 b Which is the nearest to -29? (a) 0 (b) -5 (c) -3 b Which is the closest to 2/3? (a) 0.5 (b) 2 (c) 5 (d) 1/6549 a Which is the closest to 0.3? (a) -1 (b) -1/8 (c) -2 b What is the nearest to 2 in 3, -37, -2, -3? 3 What is the closest to -0.02 in 1/3, 0.3, -2/7, -2? -2/7 What is the nearest to 326 in -4, -5, 0.3? 0.3 Which is the nearest to 1? (a) 0.1 (b) -1 (c) -4.2 (d) 2/3 d Which is the closest to 3/4? (a) 0.1 (b) 6 (c) 0.2 c What is the closest to 1/4 in 0.4, 8, -0.5, -1/3? 0.4 What is the nearest to -2/3 in -1/27, 4, -3, 2? -1/27 Which is the nearest to -1? (a) 27 (b) -6 (c) 1/5 (d) 2/5 c Which is the closest to 0? (a) 0.01 (b) 3 (c) 1/2 (d) 0.04 a What is the nearest to 237 in -3, 4, 0? 4 What is the closest to 0 in -0.1, 47/2, 1? -0.1 What is the nearest to 3 in -6/29, -2/9, 4, -0.03? 4 What is the nearest to -2/5 in -5, 1, 0, 0.4? 0 Which is the closest to -2/11? (a) 0.4 (b) 3/2 (c) -5 (d) -1/6 d Which is the closest to 2/5? (a) 2379 (b) -1 (c) 2 b Which is the closest to -1/2? (a) -3 (b) 1/8 (c) -2/3 (d) 0.08 c What is the nearest to 0.1 in 5, 2/11, 15, -0.5? 2/11 What is the closest to 0.1 in 1, -3, -4, 4? 1 What is the nearest to 1 in 4/7, 2.5, 3/4? 3/4 Which is the closest to -2/3? (a) 4 (b) 0.5 (c) -1/7 (d) -0.4 d What is the nearest to -2/7 in -1/10, -0.3, 1/3, 2? -0.3 Which is the closest to -0.1? (a) -0.4 (b) -7/103 (c) -2 (d) 0 b Which is the closest to -2/5? (a) 1/4 (b) -3 (c) -2/5 (d) -0.16 c Which is the nearest to -0.2? (a) -3 (b) 3.56 (c) 4 a What is the closest to 1/4 in -0.19, 2, -29? -0.19 What is the closest to -1 in 3, 0.1, 2/13, 14? 0.1 Which is the nearest to 0.1? (a) -4 (b) 49 (c) -1/3 (d) 8/3 c What is the closest to 140/3 in 4, 0.1, -2, -4? 4 What is the closest to -0.1 in 5, -0.06, -1, 0.42? -0.06 Which is the nearest to -1/4? (a) 29 (b) -2 (c) 6 b Which is the nearest to 4? (a) 5 (b) -1/8 (c) -4 (d) -0.06 a Which is the nearest to 0.1? (a) -3 (b) 4/3 (c) 4.926 b What is the nearest to 1/3 in 0.0041, 0.4, 14, -0.1? 0.4 What is the closest to -5 in -0.14, 5, 1? -0.14 Which is the nearest to 0? (a) 5 (b) -2 (c) 0.06 c Which is the closest to -1/3? (a) 81 (b) 2 (c) -4/5 c Which is the closest to 0? (a) 6 (b) 7 (c) -0.5 (d) 1 c Which is the nearest to -2/3? (a) -195 (b) -4 (c) -3 (d) 1/4 d Which is the nearest to 0.1? (a) 14 (b) -4 (c) 2 (d) 0.4 d What is the closest to 8 in 0.1, 6, 3, 2/13? 6 Which is the nearest to 0.1? (a) -5 (b) -0.2 (c) 12 b What is the closest to 0 in 0.5, 0.2, -1/4, 54? 0.2 Which is the closest to -0.2? (a) 9/8 (b) -4 (c) 0.4 (d) -0.11 d What is the nearest to -1 in 4, 0.01, 0.5, 7? 0.01 Which is the closest to -11? (a) 179 (b) -1 (c) -2/3 b Which is the nearest to -2/5? (a) -2 (b) -21 (c) -0.1 (d) -2/3 d What is the closest to -3 in 3/10, -4, 0, -0.06? -4 Which is the nearest to -9? (a) -3 (b) 0.1 (c) -2/25 a What is the nearest to 2/7 in -2/9, -681, 0.2? 0.2 Which is the closest to -6? (a) 3/5 (b) -54 (c) 0.2 c Which is the closest to -0.1? (a) -1 (b) -4 (c) 2/9 (d) -0.4 d Which is the nearest to -1? (a) 0.1 (b) -3 (c) -1186 a Which is the nearest to -0.03? (a) -1 (b) -0.74 (c) 1/5 (d) -0.1 d Which is the closest to -9/5? (a) -0.3 (b) -9 (c) -3/2 c Which is the closest to 0.1? (a) -0.1 (b) -1/6 (c) 48 a What is the closest to 2 in 1, 2/13, 2/7, -2? 1 Which is the nearest to 17? (a) 10 (b) -0.4 (c) 4 (d) -1 a What is the closest to -0.019 in -2/11, 5, -0.3, 1/5	{ "pile_set_name": "DM Mathematics" }
? 373036 What comes next: -579, -614, -649, -684, -719? -754 What is the next term in 61510, 61452, 61356, 61222? 61050 What is the next term in 1947, 2014, 2127, 2280, 2467, 2682? 2919 What comes next: -3573, -4614, -5655, -6696? -7737 What comes next: 2837, 2844, 2851? 2858 What is next in -20529, -41066, -61597, -82122? -102641 What is the next term in -33, -304, -1043, -2484, -4861, -8408, -13359? -19948 What is next in -11479, -45870, -103189, -183436, -286611, -412714, -561745? -733704 What comes next: 32276, 64555, 96838, 129125, 161416? 193711 What is the next term in -2458, -4936, -7414? -9892 What comes next: 3, -2, 5, 30, 79, 158, 273, 430? 635 What is the next term in 1464, 1423, 1382, 1341? 1300 What is next in -156, -1357, -4622, -10983, -21472, -37121, -58962, -88027? -125348 What is next in -13613, -13609, -13601, -13589, -13573? -13553 What is next in 282, 1365, 3252, 5943, 9438, 13737? 18840 What is the next term in 385, 681, 977, 1273, 1569? 1865 What is the next term in -728, -6237, -21274, -50603, -98988? -171193 What comes next: 5762, 5766, 5776, 5792? 5814 What comes next: -34, -184, -450, -832, -1330, -1944? -2674 What is the next term in 558, 1119, 1688, 2253, 2802, 3323? 3804 What is the next term in 489200, 489198, 489194, 489188, 489180, 489170? 489158 What is the next term in 44, 99, 222, 413, 672, 999, 1394? 1857 What is next in 90, 217, 396, 633, 934, 1305? 1752 What is next in 3986, 7990, 11998, 16010? 20026 What comes next: 1, -100, -207, -320, -439, -564, -695? -832 What comes next: -10524, -10523, -10522, -10521? -10520 What is the next term in -1801, -3644, -5559, -7552, -9629? -11796 What comes next: 213, 554, 1045, 1686, 2477? 3418 What is the next term in 693, 1389, 2085? 2781 What is the next term in 64886, 64891, 64900, 64913, 64930? 64951 What comes next: -64, -39, 108, 437, 1008, 1881, 3116? 4773 What is next in 915, 3378, 7447, 13128, 20427, 29350, 39903? 52092 What comes next: 45, 24, 87, 312, 777, 1560? 2739 What is next in 3237, 3308, 3379? 3450 What is the next term in -35149, -35174, -35199, -35224, -35249? -35274 What is next in 27189, 27191, 27195, 27201? 27209 What is next in 16253, 32513, 48773, 65033, 81293, 97553? 113813 What is next in -38350, -39095, -40328, -42043, -44234, -46895, -50020, -53603? -57638 What comes next: -149, -296, -431, -554? -665 What is next in 18797, 37511, 56221, 74927, 93629? 112327 What is next in 660, 1301, 1934, 2559, 3176, 3785, 4386? 4979 What comes next: -3987937, -3987939, -3987943, -3987949, -3987957? -3987967 What is next in 113761, 113759, 113753, 113743, 113729, 113711, 113689? 113663 What comes next: -494, -495, -508, -539, -594? -679 What is next in -676, -678, -678, -676, -672? -666 What comes next: 1167, 1216, 1265? 1314 What is the next term in -643837, -1287677, -1931517, -2575357? -3219197 What is next in 79, 598, 1897, 4330, 8251, 14014? 21973 What comes next: -30951, -30953, -30955, -30957, -30959, -30961? -30963 What comes next: 4966, 4992, 5018, 5044? 5070 What is the next term in 21, 90, 193, 330, 501? 706 What is next in 13626, 27253, 40880, 54507? 68134 What is the next term in 183, 1953, 6781, 16197, 31731, 54913, 87273, 130341? 185647 What comes next: 344059, 344072, 344093, 344122, 344159? 344204 What is next in -1327, -1338, -1349, -1360, -1371? -1382 What is next in 1950, 3981, 6098, 8301, 10590? 12965 What is the next term in 374864, 749729, 1124594, 1499459, 1874324? 2249189 What is next in 68608, 137217, 205826? 274435 What comes next: 1433, 5730, 12889, 22910, 35793, 51538? 70145 What comes next: -991, -3813, -8455, -14911, -23175, -33241, -45103? -58755 What comes next: -13306, -26619, -39936, -53257? -66582 What is next in -13847, -13861, -13885, -13925, -13987, -14077, -14201, -14365? -14575 What comes next: -192, -213, -216, -201, -168, -117, -48? 39 What is next in 49659, 49664, 49673, 49686, 49703, 49724, 49749? 49778 What comes next: -107, -307, -509, -713? -919 What comes next: -126353, -252723, -379095, -505469, -631845? -758223 What is next in 2704960, 5409918, 8114876, 10819834, 13524792, 16229750? 18934708 What is next in 2374, 2512, 2650, 2788? 2926 What comes next: 127, 106, 33, -122, -389, -798? -1379 What is next in -13762, -13757, -13752? -13747 What comes next: -44300, -88592, -132872, -177134, -221372, -265580, -309752? -353882 What is the next term in -68, -428, -1022, -1850, -2912, -4208? -5738 What is the next term in -211254, -422509, -633766, -845025? -1056286 What is next in 2368, 2364, 2350, 2320, 2268, 2188, 2074? 1920 What is next in 22, 31, 36, 37, 34, 27, 16? 1 What is next in 69643, 139293, 208945, 278599, 348255, 417913, 487573? 557235 What is next in -41, -47, -3, 115, 331, 669, 1153? 1807 What is next in -369, -3430, -11735, -27906, -54565, -94334? -149835 What is the next term in -29, -144, -461, -1088, -2133? -3704 What is the next term in 73344, 73346, 73350, 73356, 73364, 73374? 73386 What is the next term in 47, 85, 147, 233, 343, 477? 635 What is next in 340, 1396, 3154, 5614, 8776, 12640, 17206? 22474 What comes next: -158, 1113, 3798, 7891, 13386, 20277? 28558 What is the next term in -681, -1350, -2027, -2712? -3405 What comes next: -88, -101, -130, -181, -260, -373, -526, -725? -976 What comes next: 2398, 3706, 5014? 6322 What is next in 30861, 61730, 92603, 123480? 154361 What is the next term in 2244, 4521, 6830, 9171, 11544, 13949? 16386 What is next in -22567, -22558, -22549, -22540? -22531 What is the next term in -3377, -6764, -10151? -13538 What comes next: 13696, 27521, 41346, 55171, 68996? 82821 What comes next: 2921, 2924, 2927, 2930? 2933 What is next in 36, -47, -236, -513, -860, -1259, -1692, -2141? -2588 What is next in -9629, -9633, -9639, -9647, -9657, -9669? -9683 What is next in 5848, 11736, 17606, 23452, 29268, 35048, 40786, 46476? 52112 What is the next term in 153, 494, 835, 1176? 1517 What is next in 391, 426, 465, 508? 555 What comes next: -7496, -15014, -22528, -30038, -37544, -45046, -52544? -60038 What is next in -316, -690, -1068, -1450, -1836, -2226? -2620 What is the next term in 215, 461, 743, 1067, 1439, 1865, 2351? 2903 What comes next: -166, 75, 718, 1763, 3210, 5059? 7310 What comes next: 5319, 5654, 5989, 6324? 6659 What is the next term in -80514, -80532, -80548, -80562, -80574, -80584? -80592 What is next in 137, 539, 1211, 2153, 3365, 4847? 6599 What comes next: 266690, 1066772, 2400242, 4267100, 6667346? 9600980 What is next in 1848452, 1848459, 1848476, 1848509, 1848564, 1848647, 1848764, 1848921? 1849124 What is next in -1672, -1674, -1674, -1672, -1668, -1662? -1654 What is next in 13433, 26862, 40303, 53762, 67245? 80758 What comes next: -40115, -160480, -361093, -641954, -1003063, -1444420? -1966025 What is next in 752, 696, 652, 626, 624, 652? 716 What comes next: 56, -457, -1312, -2509, -4048, -5929? -8152 What comes next: -56028, -112052, -168076, -224100, -280124, -336148? -392172 What comes next: 130, 519, 1174, 2101, 3306, 4795, 6574? 8649 What is next in -7734, -7741, -7748, -7755? -7762 What comes next: 18205, 72830, 163873, 291334, 455213? 655510 What is next in -98, -196, -294, -392, -490, -588? -686 What is next in 12456, 24912, 37368? 49824 What is next in 2182843, 4365691, 6548553, 8731435, 10914343, 13097283? 15280261 What is next in 65760, 131516, 197272, 263028? 328784 What comes next: -690045, -690050, -690057, -690066, -690077, -690090? -690105 What is the next term in 4414, 8878, 13342, 17806? 22270 What is the next term in -851173, -1702348, -2553523, -3404698? -4255873 What is next in 3532, 14175, 31914, 56749, 88680, 127707? 173830 What comes next: 755, 807, 893, 1013, 1167, 1355? 1577 What is the next term in 2666, 10650, 23956, 42584, 66534, 95806, 130400? 170316 What is the next term in 3725, 3682, 3639, 3596, 3553, 3510? 3467 What is the next term in 116439, 232878, 349317, 465756? 582195 What is the next term in 62212, 62210, 62208, 62206, 62204, 62202? 62200 What comes next: -6289, -6252, -6147, -5938, -5589, -5064, -4327? -3342 What is the next term in -53, -56, -33, 16, 91, 192, 319? 472 What is next in -183661, -183662, -183663, -183664, -183665? -183666 What is next in -3897, -15632, -35207, -62622, -97877,	{ "pile_set_name": "DM Mathematics" }
/6 + 91/3. Suppose 14b + k = -26. Let n(h) = h3 + 5h*2 + 2h - 3. What is n(b)? 5 Let c(z) = -4z - 20 + 21z - 6719z2 + 6718z2. What is c(14)? 22 Let g(r) = r2 - 30r + 208. Suppose -4v - 5a + 2a = -86, 50 = 2v + 5a. Let i be g(v). Let j(l) = l*3 - 6l*2 - 17l + 12. Give j(i). 4 Suppose u - 23m + 14 = -18m, -u + 36 = 5m. Let y(j) = -j3 + j3 + 18j*2 - uj*2 - 2 + 2j3 - j3 + 6j. Determine y(-5). 18 Suppose -20 = -9q + 106. Let p(y) = 3y - 26y + 14 + qy + 8y. Calculate p(7). 7 Let p(i) = 88i2 - 81i - 298. Let d(a) = 23a2 - 20a - 75. Let u(o) = -23d(o) + 6p(o). Give u(-23). 6 Suppose -5q + 3c = 2c - 8, -2q - 6 = -5c. Let u(j) = 23j*2 - 7j*2 - 9j*2 + 4j + q - 8j2. Calculate u(-4). -30 Let l(g) = 4g + 10. Let c(f) = -f - 3. Let z(n) = 10c(n) + 2l(n). Suppose 2s - 4b + 26 = 0, 5s + 3b + 17 = 4. What is z(s)? 0 Let i = -5 + 7. Let h(b) = -b + 251 + 260 + 5b2 + b2 - 509. Determine h(i). 24 Let s(q) = -14q*2 + q - 10. Let h(f) = 5f*2 + 3. Let y(u) = -17h(u) - 6s(u). Let l = 184 + -192. Determine y(l). -7 Let h(w) be the first derivative of -17w2/2 - w - 3229. Determine h(-8). 135 Let b(r) be the third derivative of r6/40 + r*4/6 + 5r*3/3 + 7r*2 - 91. Give b(-2). -22 Suppose -21b + 109 = 25. Suppose 0 = -n - b + 14. Let o(p) = p*2 - 10p - 12. Calculate o(n). -12 Let d(p) = -p*3 + 18p*2 - 15p - 36. Let h(a) = -a*2 + 130a + 8561. Let g be h(-48). Calculate d(g). -2 Let r(h) = h*2 - 27h + 27. Let a be r(26). Let k be (4 + -10)(a + 24/(-18)). Let d(i) = i3 - 2i*2 + i - 1. What is d(k)? 1 Suppose -85 = -5p - 3c + 5c, 0 = -3c. Let a(t) = -5t*2 + pt*3 + 14t*3 - 47t*3 + 15t*3 - 2 - 3t. Let k = -2 - 3. What is a(k)? 13 Let x(c) be the second derivative of 3c3 - 2c. Suppose -17p - 109 = 2594. Let d = p + 158. What is x(d)? -18 Let m(w) be the second derivative of -11w*3/6 + 53w*2/2 + 56w - 14. What is m(5)? -2 Let c(r) be the third derivative of r4/24 + r3 - 28r2 + 83r. Let u(s) = s - 7. Let j be u(9). Suppose -15 = 3y + jy. Calculate c(y). 3 Let z = -214 + 82. Let k = 136 + z. Let x(a) = a*2 - 6a + 1. Determine x(k). -7 Let i(g) = -g - 1. Let b(k) = -2k + 0k + 75 - 78. Let r(u) = -b(u) + 4i(u). Calculate r(8). -17 Let t(b) = 132b - 241. Let a(c) = 41c - 80. Let n(m) = -19a(m) + 6t(m). Determine n(-6). -4 Let f(t) = -5 - 18t + 10t + 9t. Let n be 5 + 6 + -14 + 9/3. Determine f(n). -5 Let g be (-312)/25/(-15). Let d = g - 50. Let v(f) = -2f - 3f2 + 2f - 1 + 5fd - 2f. Give v(-1). 3 Let z(u) = u*3 + 4u*2 + u - 4. Let l be z(-2). Let f(v) = -22 + 45 + 4v - 22 - lv. Determine f(-4). -7 Let f(l) = -l3 + 5l*2 - l - 5. Let w(s) = 7s*2 - 12s + 6. Let b(a) = 15a2 - 24a + 17. Let n(x) = -2b(x) + 5w(x). Let j be n(3). Determine f(j). -10 Let c(a) = -5a2 + 3 - 8 - a2 - a3 - a2 - 6a. Let n = -4977 - -4972. Give c(n). -25 Let h(g) = -3g2 - 5g + 7. Let o(v) = -5v2 - 7v + 9. Let k(i) = 4h(i) - 3o(i). What is k(0)? 1 Suppose 2c + 4 = -2w, 2c + 3c - w - 20 = 0. Suppose cb + 25 = 5u, 0u + u + 13 = -3b. Let n(x) = 5x2 - 3 + 5x - 1 - 3xu - x2. Determine n(-6). 2 Let z(g) = -g2 - 5g + 17. Let j be z(-6). Suppose 4w - j = -7. Let o(n) = 6n2 + n - 1. Give o(w). 6 Let a(z) be the second derivative of -z5/10 + z4/6 + z3/3 - 3z2/2 - 18z + 6. Suppose 3k = -k + 8. Give a(k). -7 Let b(v) = -13v + 5. Suppose -4730d = -4734d + 12. Give b(d). -34 Let g(z) = z*3 - 8z*2 + 9z + 1. Let y = -7 - -10. Let i(m) = m*2 - 3m - 31. Let w be i(8). Suppose yq - w = -3s, 2s = 4q - 2s - 44. Determine g(q). 15 Let r(f) = -2f*2 + 41f - 9. Let a(d) = -5d2 + 122d - 27. Let u(i) = 3a(i) - 8r(i). Let y be u(-38). Let p(l) = -l*3 - 9l*2 + l + 10. Give p(y). 1 Let g be (1/(-3))/((-2 - 3)/45). Let b be -7(2 - g) + 36/(-9). Let x(s) = -s + 3. What is x(b)? 0 Suppose 305b = 364b - 295. Let d(f) = 2f3 - 3f*2 - 36f - 11. What is d(b)? -16 Suppose -91 = -327i + 325i + l, -2i + 85 = -3l. Let t(j) = j*3 - 49j*2 + 102j - 376. What is t(i)? 0 Let s = -21 + 161. Let l(u) = -2 + su - 135u - 1. Determine l(4). 17 Let a be (-16)/((-11)/(-22)-2). Let p(b) = 8b - 49. What is p(a)? -1 Let z(r) be the third derivative of -1/12r*4 + 0r - 1/30r5 + 1 + 72r*2 + 0r*3. Determine z(-2). -4 Let f be -24 - (9 - 20 - 4). Let t(u) = 38u + 339. What is t(f)? -3 Let a be -6(-7 + (-78)/(-9)). Let w be a/(-6) + (-6 - 74/(-6)). Let i(u) = u2 - 4u. Calculate i(w). 32 Let w(k) = -k*2 - 3k - 3. Suppose 13z - 16 = 10. Suppose -t - 68 = 5u, 4t + 341 = -zu - 21. Let j = 89 + t. What is w(j)? -7 Let a(w) = -w*3 - 8w*2 - 6w - 7. Let x(f) = -f*3 - 13f*2 - 11f - 2. Let v be x(-12). Let s = v - -26. Suppose 18j + 42 = sj. Give a(j). -14 Let k be 0 - ((-1)/(-5) - (-348)/(-15)). Let n(g) = -7g - 11g + kg. What is n(5)? 25 Let h(m) be the first derivative of 8m*2 - 138m - 6121. Calculate h(8). -10 Let t(j) = -j*3 - 3j*2 - 4. Let s be 11/((-88)/32) + 8 + -1. Let n be 90/(-24) + s/4. Determine t(n). -4 Let g(h) = 2h + 9. Let z(b) = -16b3 - b2 + b + 2. Let f be z(-1). Suppose -12u = -fu - 156. Let n = u - -32. Give g(n). -5 Let h(z) = 13z - 7. Suppose s - 31 = 11a - 16a, 2s = 5a - 13. Let k(w) = 28w - 14. Let v(c) = sk(c) - 13h(c). Give v(10). -3 Let n(c) = c3 + 5c*2 + 3. Let t be n(-5). Let m(b) = 68b*2 + 6b - 13. Let k(y) = 49y2 + 4y - 9. Let z(v) = -7k(v) + 5m(v). What is z(t)? -23 Suppose -7y - 10 = -5y, 0 = -3l + 2y - 11. Let c(k) = -11k2 + 21k - 1. Let h(r) = 13r2 - 22r + 2. Let i(p) = lc(p) - 6h(p). Calculate i(-16). -21 Let n(j) be the second derivative of j4/6 + j3/2 + j*2/2 - j. Let m = -616 + 514. Let l be 23m/306. What is n(l)? 3 Let d(m) = -m2 + 16m - 5. Let u be d(14). Suppose 8f = -uf + 341. Let v(l) = -l*2 + 10l + 12. Give v(f). 1 Let z(w) = 2w2 - 5. Let d(j) = 11j*2 + 4j - 9. Let s(n) = d(n) - 5z(n). What is s(-5)? 21 Let r(k) be the second derivative of -3k5/10 - k3/6 - k*2/2 + 3k. Let d(s) = 2s3 - 4s*2 - 35s + 24. Let o be d(5). Calculate r(o). 6 Let o(y) = 2 - 2543y2 - y3 - 6y - 2537y2 + 5088y*2. Calculate o(7). 9 Let f = 433 + -430. Let i(v) = 5v*3 + 14v*3 + 2 + 11v*3 - 32v*f + 3v + 2v2. What is i(3)? -25 Let h(v) = -261 + 261 - 9v*3 + 47v + 0v2 - v2 - 49v. Determine h(-1). 10 Let r(y) = 7y2 + 101y - 1. Let n(v) = 19v2 + 269v - 3. Let a(z) = 3n(z) - 8r(z). Let j = 0 + -2. Let k be a(j). Let g(m) = m - 1. Determine g(k). 4 Let a(m) = 9m + 7m + 474m2 - 24 + 475m*2 - 1422m*2 + 471m*2. What is a(6)? 0 Suppose 447g - 442g - 295 = 0. Suppose 32 = -q - 30. Let v = q + g. Let d(t) = -t3 - 2t*2 + 2t + 3. Give d(v). 6 Let m(d) = 5d2 + 2d - 21. Let g(a) = -3a2 - a + 9. Let c(v) = 9g(v) + 4m(v). Give c(3). -69 Let l(p) be the second derivative of 31p6/720 + p4/12 + 15p2/2 - 79p. Let c(f) be the third derivative of l(f). What is c(-1)? -31 Suppose 9i + 3b - 69 = 0, 26 = 4i - 9b + 11b. Let k(p) = 25p - 248. What is k(i)? 2 Let x(s) = -s - 19. Let u(r) = -r*2 - 18r + 252. Let g be u(-27). Calculate x(g). -28 Let w(o) = -23o - 58. Let j(h) = -83h - 178. Let l(f) = -4j(f) + 14w(f). Calculate l(7). -30 Suppose 20d - 4d - 672 = 0. Let i(b) = -73b - 5b*2 + 38b - b*3 + db. Calculate i(-6). -6 Let g(p) = -32p + 38p*2 + 34p - 73p2 + 30p2 - 1 - p3. Suppose 3x + 4y - 4 = x, -4y + 46 = -5x. Give g(x). 23 Let o(s) = -7s - 7s2 - s3 - 14s + 2 - 3 + 13s. Let v = 355 - 251. Let l = v - 110. What is o(l)? 11 Let o(n) = 68 - 37 - 2n3 - 10n*2 - 18 + 0n2. What is o(-5)? 13 Let b(w) be the first derivative of w5/120 + w*4/3 - 2w*3/3 + 2. Let u(q) be the third derivative of b(q). Let x = -1401 + 1395. Calculate u(x). 2 Suppose -z = -4, j = 3j - z + 4. Suppose 4i - h - 3 = j, -5h - 1 = -6. Let d(f) = -4f3 + f2 - f. Determine d(i). -4 Let u be 51 - (46 + -68). Let g(d) = -73 - d + 27 + u + 24. Give g(-10). 15 Let t(u) = u*3 + 6u*2 - 6u - 12. Let f be t(-6). Let m = f - 21. Suppose 1 - 16 = m*v. Let s(c) = c + 2. What is s(v)? -3 Let t(w) =	{ "pile_set_name": "DM Mathematics" }
s + 17, -3t + 2s - n = -0s for t. -5 Let c(d) = -3d + 73. Let l(a) = 3a - 36. Let g(f) = -4c(f) - 7l(f). Let m be g(-5). Solve 3r + 5 = -5n, -mr + r + 3 = -3n for n. -1 Suppose -5q + 472 = 477. Let c be 6/(-12) - (q - 3/2). Solve cm - 12 = 2y, 4m - 9 = -3y + 2y for y. -3 Let a = -2877 + 2880. Solve -ap - f = -p, p - f - 6 = 0 for p. 2 Let c(f) = -f*3 - 2f*2 + 2f - 8. Let v be c(-3). Let n be -6(v + 6) - -9. Solve -3d + j + nj - 4 = 0, d = 4j - 12 for d. 4 Suppose 9b - 990 = -2b. Suppose 4n - b = -6n. Suppose 29 - n = 4w. Solve -4g - 3y + 26 = 0, -5 = -0g + g - wy for g. 5 Let a = 3412 - 3389. Solve -17 = -4o + y, -5o + 3y = -0o - a for o. 4 Suppose 72 = 63u - 54u. Solve 3h - 20 = 3s - us, 0 = s - 4h - 4 for s. 4 Suppose 8g - 42 = -5o, 772o - 22 = 767o - 3g. Solve -2u + i - 7 = 0, -18i = ou - 21i + 1 for u. -5 Let g be 16/3 - 6/(-9). Suppose 2f - 10 = -2k, -3k = -gk - f + 5. Suppose -4y + 273 = 17y. Solve ku + 3d = -5u + 29, d + y = 4u for u. 4 Let s be (-44)/(-8) + -320/24. Solve -u - si = -8, 0u - 8 = 3u + i for u. -4 Suppose 4791 = 32y + 1911. Let l be (20/50)/(3/y) + 3. Solve 29 = -4f + 4b - 11, -l = 2f - b for f. -5 Let m = -286 + 321. Suppose 0 = -6t + mt - 145. Solve -ta - 2p = -2, -6a + a + 5p = -30 for a. 2 Suppose 467g - 712 + 185 = 1808. Solve -3p - gi + 29 = 0, 2p + i - 8 = 2 for p. 3 Suppose -15w + 16 = -89. Let f be (1 - w - -12) + -4. Solve -2u - s - 7 = 0, -3u - s + f - 11 = 0 for u. -2 Suppose 0 - 8 = -2q. Suppose 0 = -5t + 3t + 8, -40 = -2f - 6t. Solve qh - b - 3b = 20, 0 = 2b + f for h. 1 Suppose 0 = -15t + 294 + 141. Suppose -3x = -3s - 21, 7 = -tx + 33x + 3s. Suppose 0f - 3f = -15. Solve -3y - fm - 43 = -9, -5y + 5 = -xm for y. -3 Let v = 47 - 8. Let i = -40 + v. Let c be i + 8 + (-2)/(-4)-6. Solve -12 = o - 4l, -cl + 2 = 2o + l for o. -4 Suppose -3f = -2j + 27 - 26, -2f + 5j = 19. Solve 6w + fk = 3w + 15, 0 = 3w + k - 13 for w. 4 Let j be 2/3 - (-612)/54. Let k be (-770)/(-8) + (-3)/j. Let y = k + -95. Solve 3 = -o, -i = 4o - y + 10 for i. 3 Suppose -29r = 4l - 25r - 132, -r - 157 = -4l. Solve 0 = 4w - 5b + 1, -3w - 42b - 24 = -lb for w. -4 Suppose -3m - 2212 = -2w, -2m + 3w - 1209 = 259. Let t = -705 - m. Solve 2g + 0g = -5b - t, 2b + g = -15 for b. -5 Let l(u) = u2 + 9u + 16. Let v be l(-10). Suppose 0 = 19z - 17z - v. Suppose za - 52 = -0. Solve w + 3m = 4, -m = 2w - am - 8 for w. 4 Suppose 939 = 167q - 397. Solve -12 = -3v - 4k, -qv - k + 8 = -6v for v. 4 Let c(r) = -2r*2 - 183r - 2699. Let f be c(-73). Solve -4m - 5l = 27, 9m - fl + l = -24 for m. -3 Let z = 189 + -459. Let q = -263 - z. Solve -2g - 4 = 0, 2f - q + 3 = 3g for f. -1 Suppose -p = -5v + 17, 4p - 17 = 9v - 6v. Let y be 7 + -5 + -3 + 5. Solve 2t = -2n + 14, p = yn + t - 5 for n. 2 Let u = -14 - 38. Let d = -49 - u. Suppose 7o - 6o - d = 0. Solve -ob - r + 6 = -0, 0 = -4b - 5r + 8 for b. 2 Suppose -2r - 8 = 2r. Let u be 0/((-6 + 4)/r). Let h be ((-156)/429)/((-2)/11). Solve z + ho - 1 = -11, u = z - 3o - 10 for z. -2 Suppose -2s + 12 = 10. Let u be -2 - (s + (-6 - 3)). Let l be ((-1)/2)/((-1)/u). Solve 2y + y - 3a + 15 = 0, -la - 9 = 3y for y. -4 Suppose -a - 38 = -42. Solve -a = -2v, 5v = 5g + 26 + 9 for g. -5 Let q be (1 + 61)(-18)/(-36). Suppose 0 = 5b + l - 3l - q, b - 4l - 17 = 0. Solve -4z + 23 = by, z = 5z + 2y - 14 for z. 2 Let s(b) = -3b + 89. Let a(t) = t - 44. Let k(d) = -5a(d) - 3s(d). Let v be k(13). Solve -4m - u = -15, -5m - 14 + 64 = -vu for m. 5 Let z = -4213 + 4228. Solve -4l - 11 = 3h + 6, 3h = -3l - z for l. -2 Let z(f) = -40f + 61f + f2 + 32 - 32f. Let b be z(6). Suppose -5o + 2k = -12, -o - 5k = 4o - 5. Solve -5 = 5p - n, -3n + 5 = op - bn for p. 0 Suppose 4k = 6k + 3y + 11, 3k + 3y = -12. Let z(v) = 11v + 4 + 5 - 16v - 4. Let p be z(k). Solve 4s = 2c - p, c + 0s = -3s - 15 for c. -3 Suppose -k + 335 = 332. Suppose -2j - 2i = ki - 24, 6 = -5j + 4i. Solve m = 4n + j - 19, -n = 5m + 22 for m. -5 Let w(c) = c*3 + 44c*2 + 154c - 27. Let u be w(-40). Suppose 21m - u = 396. Let n = 44 - 23. Solve 0 = 3a - a - 5p - m, n = -2a - 5p for a. 2 Let p(t) = -t3 - 6t*2 - 12t - 29. Let k be ((-4)/6)/((-310)/(-75) - 4). Let w be p(k). Solve -c + 0r - 8 = r, -3c + 3r = -w for c. -3 Let h be 285/(-10)(-4)/22 - (-10)/(-55). Let z(s) = s*2 - s + 2. Let p be z(0). Solve 0 = -hx + f - 4, pf - 6 = 5x + 3f for x. -1 Suppose 4c + 4f = -8, -5f - 10 = 4c - 6c. Let d be (c + 1)/((-20)/(-240)). Solve 0 = 4s + 5x, 0 = 2x + x - d for s. -5 Let i = -3 - 1. Let c(z) = 3z - 6. Let f(a) = -6a + 7. Let l(y) = 5c(y) + 3f(y). Let u be l(i). Solve 4v + 0v + 12 = ub, -4v + 2b = 8 for v. 0 Let k = -1531 - -1562. Solve 32n - kn - 3x - 8 = 0, 7 = -4n - x for n. -1 Let g = 8028 + -8018. Solve -4z = -5v + 23 - g, 2v = 5z - 5 for v. 5 Suppose 44 - 254 = -70n. Solve 0 = -14x + 19x + 4o - 35, 0 = -no + 15 for x. 3 Let p(v) = 6v*2 - 39v + 22. Let s be p(6). Solve 2j = -4l + 2, 8l = sl + 8 for j. -3 Suppose 3v = 5g - 109, -2 = -3v - 11. Let w(r) = 17r + 2r2 - 5 + 4 - 25. Let k be w(-10). Solve -2o = -0o + 5u + 25, 5o + g = -ku for o. 0 Let w be (-5)/(-3) + 2/6. Let m be (-76)/38 - (-9 - -1). Suppose -3l = -3i, -m = 3l + i - 26. Solve 0 = lq - 25, wu - 2q + 9 = u for u. 1 Let m(l) = -364l + 1094. Let p be m(3). Solve 0 = y - pb + 2, y + 3b + 8 = -b for y. -4 Let o(x) = x2 - 12x - 534. Let u be o(-18). Solve ub - 8b = -p + 7, 0 = -4b - 12 for p. 1 Let k be 21/14(-352)/(-33). Let f(l) = -l*3 - 2l*2 + 11. Let o be f(0). Solve -x + o = -4a, x = -5a - 0x - k for a. -3 Suppose -491h = -558h + 134. Solve 0 = -3x - 2x - 3r - 37, 0 = -hx + 5r + 10 for x. -5 Suppose s = -4a - 26, -64a - 46 = 3s - 60a. Let i(h) = h2 - 9h - 175. Let q be i(s). Solve 4o - 2u + 6 = 0, o + 3u = -2u + q for o. 0 Suppose -w - 6k + 29 = -k, 0 = 4w - 4k + 4. Let q = 52 + -52. Solve u = wu + d + 12, -2u + d - 3 = q for u. -3 Let h(y) = -2y*2 - 15y + 342. Let k be h(-17). Solve -u = -p + 2, -ku - 7 = -2p - 14u for p. 1 Suppose 23c + 14389 = 15217. Solve h + 2k = 9, -2h + 11 = -ck + 39k for h. -5 Let p be (-3 - 0)(-5586)/171. Let q = 100 - 194. Let g = p + q. Solve -5d = -3z + 3, 0 = -3z + gd - d - 3 for z. -4 Let g(r) be the third derivative of r6/120 - r5/10 + r4/6 + 7r*3/3 - 21r*2. Let x be g(5). Solve -o = 4v + x, 0 = -o - 2v - 3v - 11 for o. -1 Let f = -124 - -129. Suppose -fr + d = 3d, -r = -5d. Solve 0 = 2n - 6n - 5u - 13, r = 5n - 5u + 5 for n. -2 Suppose -3l = 4l - 35. Suppose -2j + c + 3c = -4, -lc + 17 = 3j. Solve 12 = jy + 5q - 2q, 0 = 2q for y. 3 Let j(c) = c*3 + 12c*2 + 14c + 6. Let s be j(-10). Suppose 6m + s - 84 = 0. Solve 4n - m = -5p, 2n + 2p = -n - 3 for n. -3 Suppose -3x + 702 + 387 = 0. Let w = -358 + x. Solve -3j + 15 = -z, 2z + 0j - wj + 26 = 0 for z. -3 Let d = 524 + -504. Suppose -3j = 2u - 35, -j + 3j = -3u + d. Solve 2o - 6o - w = 0, o - j = 3w for o. 1 Suppose 304 = -65b + 564. Solve -4q = -bi + 12, 5q - 4i - 13 = -23 for q. 2 Let i = -19 + 19. Suppose 3 = 2z - 3. Let d = -254 + 261. Solve i = -za + 5q - 7, -4q = -2a + 1 - d for a. 1 Suppose -4 = 73k - 4. Solve -4c + kg = -3g - 11, 0 = 5c + 5g + 30 for c. -1 Let d be (3675/50)/((-1)/(-2)). Let q = -141 + d. Solve -3h + 4h + q = 2c, 21 = c + 4h for c. 5 Let l = 245 + -227. Suppose 3u = -4n + 7, 3u - u = 4n + l. Solve -5f + 19 = j, -uj - 17 = -0f - 3f for f. 4 Let j(g) = -g2 - 42g - 374. Let c be j(-28). Solve -2s = 5o + 6, -4s = -197o + 192o - c for s. 2 Let r(o) = -6o + 127. Let l be r(20). Solve 2 = 3h + t, lh + t - 1 = 5h for h. 1 Let j = 98 - -277. Let m = j - 373. Solve 0 = -mr - 2r - 4f - 28, 4f = r - 13 for r. -3 Let d be 3 + 76/(-24) - 630/108. Let j be (-30)/(-9 - 1)(-10)/d. Solve jq - 21 = z, -2q + 3z = 2q - 19 for q. 4 Suppose 6 = k + m, 0 = -2k - 5m + 28 - 7. Suppose -11 = -kh - p, -19 = -5h + 2p - 4p. Solve 24 = -4j + 4, -3n - hj = 3 for n. 4 Let w(p) = p3 - 20	{ "pile_set_name": "DM Mathematics" }
3b - 33 = -r. What is the units digit of b? 1 Let q(k) = -k3 - 4k*2 - 2k - 2. What is the units digit of q(-4)? 6 Let z(w) = w*2 + 4w - 9. Let v be z(-6). Suppose -2m = m - 9. Suppose 11 = -o + my, 7o + y = vo + 21. What is the units digit of o? 4 Let h(m) = -m*2 - 14m - 8. Let f be h(-6). Let r = f - 27. What is the tens digit of r? 1 Suppose 2h + 10 = -4z, 3z + 11 = 3h - 1. Suppose 0w = 2y + w - 10, -5 = -3y + w. Suppose -11 = -ys + h. What is the units digit of s? 4 Let u(b) = 15b2 - 10b + 12. What is the units digit of u(-5)? 7 Let d = -27 + 42. Suppose y = d + 3. Suppose -5s = -2 - y. What is the units digit of s? 4 Let w(p) = 5p*2 - 1. Let z be w(-1). What is the units digit of 138/9 - z/(-6)? 6 What is the tens digit of 6/2 - 41/(-1)? 4 Suppose 58 = -4m - 10. Let l = m - -29. What is the tens digit of l? 1 Let n(s) = -31s - 5. Let t(d) = 16d + 3. Let x(b) = -3n(b) - 5t(b). What is the units digit of x(2)? 6 Suppose 3u - 13 = -5j - 6, 4u + 6 = j. Let a be 6/(-4)u8. Suppose -3y = 12, -a = -4c - y - 2y. What is the units digit of c? 6 Let w = -271 + 496. What is the hundreds digit of w? 2 Let a(s) = s + 5. Let r be a(7). Let i = 18 - r. What is the units digit of i? 6 Suppose s - 17 = p - 4s, -4p - 3s = -1. Let k(j) = 2j*2 + 2j. Let m be k(p). Suppose 4n = m + 16. What is the units digit of n? 5 Let u(m) = -m3 + 8m*2 - 6m - 2. Let w be u(5). Let g = 65 - w. Suppose 3o - 38 = -5r, -3r + g = -o - 12. What is the units digit of r? 0 What is the units digit of (3/(-3))/((-3)/6)? 2 Let g = 0 - 0. Let l be -3(-20)/3 - g. Suppose -4v + 32 = 3n - 3, -5n + l = -v. What is the units digit of n? 5 Suppose -c - 4 - 38 = -5x, 2x - 26 = 5c. Suppose -4f = -9f. Suppose -4t = -x - f. What is the units digit of t? 2 Suppose 3 + 82 = f. What is the units digit of f? 5 Let p(q) = -42q + 35. Let n(c) = -c + 1. Let s(d) = -35n(d) + p(d). What is the units digit of s(-1)? 7 Let k(q) = -9q - 3 - 3q + 7q. What is the tens digit of k(-3)? 1 Let b = -87 + 263. What is the units digit of b? 6 Let t be 10(3 - 2/(-10)). Suppose c - t = 3c. Let d = c + 22. What is the units digit of d? 6 Let i = -99 - -225. What is the tens digit of i? 2 Suppose 4d - 3u - 316 = 0, 3d + 0u - 237 = -2u. What is the units digit of (-6)/21 - d/(-7)? 1 What is the units digit of (32/40)/(6/465)? 2 Suppose -y + 295 = 3k - 32, 4k + 2y = 436. What is the hundreds digit of k? 1 Let j be -1 - (-2 - 0)/(-1). Let a be 14/j2-3. Suppose -y - a = -3y. What is the tens digit of y? 1 Let l(j) = -j2 + 10j + 3. Let v(m) = -m*2 - 6m. Let c be v(-6). Suppose c = -i - 4i + 50. What is the units digit of l(i)? 3 Let m be 1 - -3 - (-165)/(-3). Let z = -2 - m. What is the tens digit of z? 4 Let h be (4 - 3)1 + 17. Suppose 2z - 12 = -4a, -3z - h = -2a - a. What is the tens digit of -381/z - 3? 1 Let r(k) = 15k*2 - 2k + 5. What is the tens digit of r(3)? 3 Suppose -x = -4r + 242, -x + 6x = -5r + 290. Suppose 0 = -0l + 4l - r. What is the units digit of l? 5 Let d(p) = -p3 - p2 - 2p - 8. Let j be d(-6). Suppose 14h = 18h - j. What is the units digit of h? 6 What is the units digit of 3(-3 - (78/(-1))/3)? 9 Let s = 25 - 13. What is the units digit of s? 2 Suppose u - 53 = 17. What is the tens digit of u? 7 Let t(v) = v2 - 2v + 9. What is the units digit of t(0)? 9 Let a be (-4)/6 - (-70)/15. Suppose 32 = -as - 0s. What is the units digit of (-18)/(-8) - (-2)/s? 2 Suppose 3w = -w + 16. Let p(s) = -1 + 10s + 7s - ws + 0. What is the tens digit of p(1)? 1 What is the units digit of -1 - (3 - 44) - -2? 2 Let f be (-3)/(-12) - (-94)/8. Let p(w) = w*3 - 3w2 - w + 3. Let o be p(3). Suppose z + o = f. What is the units digit of z? 2 Let g = 15 + -9. Let o = 8 - g. What is the units digit of o? 2 Let h(x) be the third derivative of x4/24 - 2x3/3 + x2. Let g be h(7). Suppose 0v = gv - 15. What is the units digit of v? 5 Suppose -u + 4 = u. Let n(j) = -j2 + j - 1. Let c be n(u). Let x = 4 + c. What is the units digit of x? 1 Let i(j) = j3 - 9j2 + 4. Let w be i(9). Let v(p) = -p2 + 6p. What is the units digit of v(w)? 8 Suppose 8i + 22 = -4d + 3i, 2i + 4 = 0. Suppose 5n - 10n = 55. Let l = d - n. What is the units digit of l? 8 Suppose -5j + 39 = -71. What is the units digit of j? 2 Suppose 18 + 12 = 3z. Suppose 58 = 4s - z. What is the units digit of s? 7 Let j(s) = s2 + 7 - s3 + 0s2 - s + 4s*2. Let b be j(5). Suppose 0 = z + b - 4. What is the units digit of z? 2 Suppose 4w + 11 = -z, 3 = z + w - 1. What is the units digit of z? 9 Let r = 13 - -3. Let y = r - 10. What is the units digit of y? 6 Suppose 2m - 3x = 37, -4x + 35 = m + 11. What is the units digit of m? 0 Suppose 48 = 3u - 6u. What is the units digit of u/(-20)195/6? 6 Let v(m) = m3 - m2 - 3m - 4. Let o(w) = w3 - 3w*2 - 2w - 5. Let z(r) = r*3 - 3r + 2. Let f be z(2). Let x be o(f). What is the units digit of v(x)? 5 Suppose -4i - 244 - 148 = -2g, 4g - 5i = 775. What is the tens digit of g? 9 Let w(s) be the first derivative of -4 + 6s + 1/2s*2 - 1/3s*3 + 1/4s*4. What is the units digit of w(0)? 6 What is the hundreds digit of (-57120)/(-175) - (-6)/10? 3 Suppose 2q = 3g - 9 + 59, -4g - 2q = 62. Let f be 5/2g/(-20). Suppose -12 = -fx + 2. What is the units digit of x? 7 Suppose 3y + 2k + 53 = 0, -5k - 9 = -4y + 5y. Let b = -29 + -8. Let h = y - b. What is the units digit of h? 8 Let g = -4 - -4. Let a(u) = u*2 - u + 9. What is the units digit of a(g)? 9 Let k = 90 + -52. What is the units digit of k? 8 Suppose -303 = -6j + 3j. What is the tens digit of j? 0 Let w = -150 - -320. What is the units digit of w? 0 Let s = -3 + 70. What is the tens digit of s? 6 Suppose -6i + 9i - 177 = 0. Suppose -5o - 4 = -i. What is the tens digit of o? 1 Let x(o) = o - 5. Let u be x(6). Let y = 8 - u. Let m = y - 1. What is the units digit of m? 6 Let w be 75/10(-8)/(-10). Let p = -1 + w. Let q = p + -3. What is the units digit of q? 2 Let t(j) be the second derivative of -j5/20 + j4/3 - j3/2 + 3j*2/2 - j. Let n be t(3). Suppose -ng + 5 = -4. What is the units digit of g? 3 Let j = 106 - 65. Suppose j = -5m - 9. Let s = m + 17. What is the units digit of s? 7 Let h = 124 + 36. Suppose 4d + d = h. What is the tens digit of d? 3 Suppose -g - g - 4 = 0. Let l be -4 + 2 + (-4)/g. Suppose 5v - 59 + 19 = l. What is the units digit of v? 8 Let w(z) = -4z*2 + 4z + 10. Let f(y) = y*2 + y - 1. Let p(i) = 3f(i) + w(i). What is the units digit of p(5)? 7 What is the tens digit of 0 + (16/4 - -59)? 6 Suppose y - 4y + 741 = q, -4y - 2q + 990 = 0. What is the units digit of y? 6 Let g be 1/(-2) - 4/(-8). What is the units digit of (-2)/(6/(-21) - g)? 7 Let v(r) = -r3 + 6r*2 + 7r - 2. Let p be v(7). Let a(l) = 3l + 2. Let t be a(p). What is the units digit of (-3)/t(12 - 0)? 9 Let y(q) = -2q + q + 3q - 8q3 + 1. What is the units digit of y(-1)? 7 Let g = 22 - -70. What is the tens digit of g? 9 Let p(m) = -m + 29. Let k = -15 - -15. What is the units digit of p(k)? 9 Let g(x) = x2 - 2x - 12. Let s be g(9). Suppose s = 2v - 5. What is the tens digit of v? 2 Suppose 117 = 3d + r, 0r - 25 = -d - 5r. What is the units digit of d? 0 Suppose 2n - 4r - 64 = 0, 5n - 145 = 5r - 0r. Suppose 4h - n = -q - 2q, 4q + 17 = 5h. What is the units digit of q? 2 Let r(b) = 2b - 12. Suppose 0 = -2c + 80 - 14. Suppose 0 = 3g + 6 - c. What is the units digit of r(g)? 6 Let f = -6 + 4. Let q = 2 + f. Suppose 6u = -3a + 2u + 60, u - 3 = q. What is the units digit of a? 6 Let n be (6/(-2))/((-3)/4). Let x(w) = 2w*3 - 1. Let f be x(-1). Let k = n + f. What is the units digit of k? 1 Suppose 13 + 2 = 5a. Let s be 3/(-2)2/a. What is the units digit of ((-6)/(-24))/(s/(-4))? 1 Suppose -2x - 16 = 2k - 0k, 5k - 3x + 64 = 0. Let c(t) = -t*2 - 10t + 13. What is the units digit of c(k)? 2 Let x(s) = 5s3 - 2s*2 - s - 8. What is the units digit of x(3)? 6 What is the units digit of 18/4 + 3/(-6)? 4 Let p(d) = -d - 3. Let h be p(-5). Suppose -3f + 4b + 33 = 0, hb - b = 0. What is the units digit of f? 1 Suppose -2k - 4q = q + 122, 244 = -4k + 4q. L	{ "pile_set_name": "DM Mathematics" }
Solve n = -p, -gc + 4c = n for c. 1 Let x(s) = s - 15. Let u be x(-11). Let v = -13 - u. Solve 0 = -3m + q - 0q - 13, -v = 2m - 5q for m. -4 Let l(f) = -f*3 + f. Let t be l(0). Solve 3z + tz - 1 = -5o, -5o - 5z + 5 = 0 for o. -1 Let o(r) = -r*2 + 4r + 2. Let s = -4 - -8. Let d be o(s). Solve 5q + d + 3 = 0, -5z + 3q - 7 = 0 for z. -2 Let n(k) = -3k*2 + k + 1. Let h be n(-1). Let d be (h/2)/(6/(-8)). Let m be ((-2)/(-5))/((-1)/(-5)). Solve -3c = 0, -df + c = 4c + m for f. -1 Suppose -3u = 3s, -2u + 5u - 5s = 24. Let m = 0 - -5. Suppose -11 = -2q - mh, -4q - u = -4h - 39. Solve -5t = z - q, -5z - 15 = -t - 3 for t. 2 Let v(d) = -d. Let n be v(-2). Let z = 22 + -13. Let a = z + -7. Solve k = -a, 3k = nl + l for l. -2 Let g = -3 - -3. Suppose g = 3f - 12, -3w - f + 36 = 2f. Solve b + 5r + w = -7, 0 = -2b - 2r - 6 for b. 0 Let l be (-1)/(-5) + (-298)/(-10). Suppose -3k = 2k + l. Let d be 46/6 + 4/k. Solve y + d = 2s, 5s = 2y - 0y + 17 for s. 3 Suppose 5x + 2r - 50 = 0, -3x + 3r = 2r - 30. Suppose xv = 8v. Solve 4b = -d - v + 7, b = 4d + 6 for b. 2 Let p(h) = h*3 - 2h. Let s be p(2). Suppose -m - s = -5d, -d - 7 = -5m - 27. Solve -y + 2 + d = 3i, 4 = 3i - y for i. 1 Suppose m - 6 = -1. Solve -12 = 2b - mg + 16, -4b = 4g for b. -4 Suppose 5t = -4a + 21, -3a + 24 = -3t - 12. Suppose -2c + 3 + 5 = 2l, -4l = -3c - 9. Solve 2q + 0j + 16 = 2j, lq + 2j = -a for q. -5 Suppose -27 + 2 = -5g. Solve -gn - 5 + 0 = x, 3n + 2x = -3 for n. -1 Suppose 9g = 2g. Solve l + gd = -3d - 14, 8 = 3l - d for l. 1 Let n be (14 + 2)/2 + -3. Suppose nb + 1 = 6. Let r = b - -1. Solve -w = rv - 21 + 7, 4v = 5w for v. 5 Suppose -2p - 2 = 0, 4p - 2 = -4g + 2. Solve -gl - 2d = -0l + 8, 4l - d = -11 for l. -3 Let g(y) = y + 12. Let j(c) = -c2 + 2. Let l be j(3). Let h be g(l). Solve -3f = -hi - 25, -2i - 2f + 6 = -0i for i. -2 Let l be 1 + 26/4. Suppose -lh - 8 = -20. Solve -hn = 3u + 9, 2n - 4n = 3u + 5 for u. 1 Let v = -18 - -20. Solve 0 = -5q - 3x + 35, -5q + 6x = vx for q. 4 Let q(o) = 5o - 15. Let x be q(7). Let i = x + -12. Solve i = 4k, -2k - 2 = -3j - 3k for j. 0 Let h = 0 + 3. Let b = 4 - 6. Let a be (3 - 1) + (-1 - b). Solve -hs = at + 18, 2t - 2s = 10 - 2 for t. -1 Let z = 9 + -4. Solve -4x + 3c - 28 = 0, -2x - 26 = -zc + 2 for x. -4 Suppose 0 = -10o + 7o + 30. Solve 6 + 19 = -5b, 0 = 5q - 3b - o for q. -1 Let n be ((-276)/(-4))/(6/4). Let o = n - 6. Suppose a - o = -4a. Solve -4s - 20 = -t, 4s - t + a = 3s for s. -4 Suppose 4o - 2o - 4 = 0. Solve -2r = -k - 0r, 2k + or = 0 for k. 0 Let g be 1/(-2) - (-35)/10. Solve -9 = gp - j, -j + 8 + 5 = -4p for p. -4 Let u = 20 + -27. Let c = u - -7. Solve n + 3 = -cx - 4x, 5n = 4x + 9 for x. -1 Let b(q) = -q + 6. Let v be b(0). Let t(o) = -2o + 12. Let m be t(v). Solve m = -4w - 4z - 24, -w - z + 6 = -4z for w. -3 Let g(t) = -4 + 4 - t. Let c be g(-2). Suppose -cp - 3 = 5b - 4b, -2p - 18 = -2b. Solve 0 = -3s + 15, -bu = 3s + 2s - 25 for u. 0 Suppose -q - 2q + 6 = 5m, 0 = -q + 2. Solve -y - y = 2u, 5y - u - 18 = m for y. 3 Let s = -28 - -48. Let h be s/11 + (-4)/(-22). Let q be 1h - (3 - 1). Solve q = -4g, -6 - 6 = 4d - 2g for d. -3 Suppose -7i + 104 - 90 = 0. Solve 0 = -3s + 6s + 3o + 3, is - 3o + 12 = 0 for s. -3 Let y(o) = o - 16. Let z be y(18). Solve 4l - g - 9 = 0, -zl + g + 7 = -0g for l. 1 Let t(a) = a*2 + 10. Let k = -2 - -2. Suppose ku - 3u = 0. Let l be t(u). Solve b - 7 = 3g + l, -7 = b + 3g for b. 5 Let x be 26 - (2 + 0 + -6). Solve d = 5k + x, -2k - d - 5 = -0d for k. -5 Suppose 19 = -8t + 67. Solve -4r + 13 = -3c, -2c + 4r - tr = -10 for c. 1 Suppose 0 = -3b - 0b + 6. Let z be 12 + (b - 2). Suppose i + zi - 3 = -j, 0 = j + 4i - 4. Solve -a + jv = 2v - 3, 3v = -3 for a. 5 Suppose 16d - 20d = -72. Let g = 22 - d. Solve -5l - gp + 10 = 0, 4l - 4p = -0l + 8 for l. 2 Suppose 11 = 2w - 5. Solve -28 = 5t - 3s, -3s + ws = t + 10 for t. -5 Suppose -v = 3u - 6v - 15, u + 9 = -3v. Suppose -3g - i = -30, -g + 2i + 3 = -ui. Solve c = 5k + 15 - 1, -4k + 3c = g for k. -3 Let s(w) = 52w3 - w2 - w + 1. Let j be s(1). Suppose -5i = -24 - j. Solve -4h = o - i, 4o - 8h + 24 = -3h for o. -1 Let d(f) = f - 2. Let o be d(-7). Let n = o - -15. Let y be 27/n + (-1)/(-2). Solve yl + 20 = -5u, -u + 2 = -0l - 2l for l. -2 Suppose 4k = 7k - 12. Suppose 25 = 5n, -5n = 2m - km - 19. Solve -o - mz = -8z - 21, -2o - 10 = 3z for o. 1 Let z = -37 - -41. Solve 3h - 3l + 1 = -8, h - zl = -15 for h. 1 Suppose 0h = -4h + 20. Solve -p - 4l = -0l - 13, -19 = hp - l for p. -3 Suppose 5k + 2n - 7n - 255 = 0, -2k + 5n = -93. Let u be 4/6k/12. Solve 5b = -ua + a + 35, -15 = -5a + 2b for a. 5 Let n(j) be the third derivative of 0 - 1/4j*4 + 0j - 1/60j5 + j2 + 3/2j*3. Let q be n(-7). Solve 4t + 11 + 1 = 4x, -8 = qt - x for t. -5 Suppose -2l + 7l = 20, 3l - 6 = 2f. Let s(y) = -y*2 + 8y - 2. Let a be s(7). Solve -3o + 9 = -3h, -4o - f = -2h - ao for h. 0 Let a = 0 + 5. Solve 2 = 4n - ap, n = 4p - 5 - 0 for n. 3 Suppose -2z + 1 = 9. Let p = 6 + z. Let n(m) = m + 12. Let d be n(-7). Solve pg = -o - d, -2o + 0g - 8 = 3g for o. -1 Suppose -3h + 5l = -14, -4h + l + 11 + 2 = 0. Suppose 7 = 4v - 5. Solve -vy = -4u + 2u + h, y = 3u + 6 for u. -3 Suppose 0 = 2y - 6, 2m - 2y = -9 - 3. Let a = 8 + m. Suppose 0z = az. Solve g = -3g - 4, z = -u + 5g + 8 for u. 3 Let m be (0/(-1))/(1/1). Let r(l) = -3 + 2l + ml + l. Let h be r(3). Solve -4b = -2q + 20, -hq = 2b - q - 2 for b. -4 Suppose -10 - 2 = -3o, -4y + 3o = -308. Suppose 2m + 2m = y. Solve 2s - 5s - 4l = 23, -5s - m = 3l for s. -1 Let m be 40/(-14)(-14)/4. Suppose -2y + 27 = -2f + 5f, 0 = 2f + m. Solve 0p = -p + 4w - 15, 0 = 5p + 4w - y for p. 1 Suppose -11 - 8 = w. Let c = w - -19. Solve c = 4h - 20, h = 3r - 0r + 5 for r. 0 Let y(z) = z*3 - 2z*2 + z + 2. Let t be y(2). Let m(o) = 4o - 7. Let a be m(t). Solve -5 = 4v - 5n + 2, -3v - n + a = 0 for v. 2 Let u be (1/2)/(1/10). Let v = -3 + u. Solve l + 7 = 3t, l + vl + 5t = -7 for l. -4 Let g be 5 + (-3 - -1) + 2. Suppose 2b = -5y, -b + gy = 4y. Let p = b + 4. Solve -l - pv - 11 = 0, 5l + 3v - 6v - 37 = 0 for l. 5 Let p(l) = 4l2 - 19l - 5. Let j be p(5). Suppose -b + 6 = b. Solve 7 = -4u - 5q, -2u + ju - 3q - b = 0 for u. -3 Suppose 0 = 5n - 20n + 45. Solve np - 4p - 7 = 2h, -3h - 8 = 4p for p. 1 Let v(p) = -p*3 + 41p - 1. Let o be v(6). Solve -3i = -5a - o, -i - 5a - 9 = 8 for i. 3 Let c = 27 - 17. Suppose 0 = -2v + u + c, -4v + 2v - 2 = 5u. Solve vp + 24 = -4q, 0q - 4q - 26 = 5p for p. -2 Suppose 0 = 33p - 32p - 2. Let c(h) = 3h - 7. Let b be c(5). Suppose -5f - 4g + 1 = -9, g = 4f - b. Solve 5o = 5z - 20, 5z + 3o - po = f for z. 1 Let o(i) = 3i*3 - 2i + 1. Let l(j) = j*2 - 9j + 9. Let u be l(8). Let n be o(u). Solve np + p = k + 7, 0 = 3k - 2p + 14 for k. -4 Let p(t) = -t2 + 7t - 6. Let f be p(7). Suppose 4r = -r + 2x + 3, -4r = -x. Let k be r/(9/f + 1). Solve -4b = -kz + 17 + 13, -3z = -3b - 30 for b. -5 Let p = 75 - 53. Solve 5x - 26 = 4d, 4x - 3d = -x + p for x. 2 Let q be (-120)/(-21) + 2/7. Suppose o + 2 - q = 0. Solve -a = 2a, 4j = oa - 4 for j. -1 Let s(p) = p*3 - 6p*2 + 5p. Let l be s(5). Let c = 2 - l. Suppose -u = -5, -u + 0u + 5 = -cj. Solve j = -k - 2b - 6 - 1, -4k + 37 = -5b for k. 3 Let f be (-34)/(-7) + 6/42. Suppose 5n - 50 - 55 = 0. Let p = n + -6. Solve 3r + 9 + p = -4m, 2r + f = m for r. -4 Let q be (-68)/(-8) - 1/2. Solve i = 4, 2i = -2t + 4i - q for t. 0 Suppose 4y = 5y - 1. Let t be -3 + 1/y - -2. Suppose t = 3m - m - 3i + 2, -5m + 5 = -5i. Solve 23 = -2f - 0f - 3h, 2f + mh + 33 = 0 for f. -4 Let p = 3 - -1. Suppose -5o + 2 = -8. Solve -ol + 18 = 3a, -a = a + pl - 20 for a. 4 Let c = 2 + 15. Let y = c + -8. Solve 3d + y = -2a, 3d = -4a - d - 16 for a. -3 Let y(j) = j + 4. Let v be y(-3). Let u = 4 - v. Solve -8 = 4x - a + 9, -a = x + u for x. -4 Let o = -7 - -7. Suppose -3j - 3j + 6 = o. Solve	{ "pile_set_name": "DM Mathematics" }
- 168. -4(f - 42)(f + 1)(4f - 1) Solve -25z4/4 - 5z*3 + 21z*2/4 + 5z + 1 = 0. -1, -2/5, 1 Let -10j3/9 - 2j*2/9 + 26j/9 + 2 = 0. Calculate j. -1, 9/5 Determine f so that 2f2/9 + 286f/9 + 188/3 = 0. -141, -2 Let r*2 - 21r = 0. Calculate r. 0, 21 Factor -5p2 - 11000p - 6050000. -5(p + 1100)2 Factor 2h*2/13 + 80h/13 + 152/13. 2(h + 2)(h + 38)/13 Find u, given that 2u2/5 - 32/5 = 0. -4, 4 Suppose 5u*5 - 415u*4 + 9210u*3 - 24800u*2 + 16000u = 0. Calculate u. 0, 1, 2, 40 Factor 2o4/5 - 9o*3/5 + 4o2/5. o2(o - 4)(2o - 1)/5 Factor h4 - 91h*3 + 1818h*2 + 12096h - 13824. (h - 48)*2(h - 1)(h + 6) Let -25g*5 + 35g*4 + 105g*3 - 55g*2 - 160g - 60 = 0. What is g? -1, -3/5, 2 Factor -2a3 - 6a*2 + 2a + 6. -2(a - 1)(a + 1)(a + 3) What is p in -5p*3/4 - 10p*2 + 955p/4 - 855/2 = 0? -19, 2, 9 Factor -3h2 + 84h - 81. -3(h - 27)(h - 1) Factor -118l4 + 3544l*3 - 35520l*2 + 119200l - 4000. -2(l - 10)3(59l - 2) Suppose 4n*4/9 + 76n*3/3 - 80n*2 = 0. Calculate n. -60, 0, 3 Find y such that 2y*4/9 + 2y*3/9 - 2y*2/9 - 2y/9 = 0. -1, 0, 1 Factor -i*5/3 + 38i*4/3 + 206i*3/3 + 380i*2/3 + 299i/3 + 86/3. -(i - 43)(i + 1)3(i + 2)/3 Factor -2v3/7 - 124v*2/7 + 2v/7 + 124/7. -2(v - 1)(v + 1)(v + 62)/7 Factor 3x*5 + 3x*4 - 42x*3 - 72x*2. 3x*2(x - 4)(x + 2)(x + 3) Factor y*3 - 17y*2 + 44y - 28. (y - 14)(y - 2)(y - 1) Determine k, given that 52k3 + 100k*2 + 48k = 0. -1, -12/13, 0 Factor 3v2 - 10224v + 8710848. 3(v - 1704)2 Determine k, given that 2k*2/15 - 34k/5 + 376/15 = 0. 4, 47 Factor -i*2 + 40i + 41. -(i - 41)(i + 1) Suppose -2u*2/17 - 12652u/17 - 20009138/17 = 0. What is u? -3163 Factor d*4/3 + 11d3/3 - d2 - 35d/3 - 22/3. (d - 2)(d + 1)*2(d + 11)/3 Factor -x*4/2 + 12x*3 + 236x*2 + 1104x + 1368. -(x - 38)(x + 2)(x + 6)*2/2 Suppose -5r*2 - 140r - 980 = 0. What is r? -14 Find k, given that 3k4 - 9k*3 - 72k*2 + 240k = 0. -5, 0, 4 Factor b3/9 + b2/3 + 2b/9. b(b + 1)(b + 2)/9 Factor 3r*2/4 - 717r/4 - 723/2. 3(r - 241)(r + 2)/4 Factor -3l2/5 - 39l/5 + 144/5. -3(l - 3)(l + 16)/5 Determine a so that -3a3 - 4077a*2 - 8145a - 4071 = 0. -1357, -1 Factor -2x5 + 6x*4 - 4x*3. -2x*3(x - 2)(x - 1) Factor -5q*2 + 990q - 49005. -5(q - 99)2 Solve 3q*3/4 + 135q*2/2 - 3q/4 - 135/2 = 0. -90, -1, 1 Determine m so that 2m3/11 + 26m*2/11 + 60m/11 = 0. -10, -3, 0 Factor -5s2 + 1020s - 52020. -5(s - 102)2 Find f, given that f2/5 + 84f/5 = 0. -84, 0 Factor -a*2/4 + 43a/2 + 455/4. -(a - 91)(a + 5)/4 Factor -4f*3 - 1980f*2 - 326700f - 17968500. -4(f + 165)3 Factor 3n*4 + 3n*3 - 36n*2 - 84n - 48. 3(n - 4)(n + 1)(n + 2)2 Factor 15q*2 - 66q + 24. 3(q - 4)(5q - 2) Factor v3/5 + 13v*2/5 - 29v/5 + 3. (v - 1)*2(v + 15)/5 Factor 2s2 - 18s - 20. 2(s - 10)(s + 1) Solve -r*4 + 28r*3 - 132r*2 = 0. 0, 6, 22 Factor 4f*3 - 16f. 4f(f - 2)(f + 2) Find f such that 6f*5/7 - 4f*4 + 34f*3/7 + 12f*2/7 - 40f/7 + 16/7 = 0. -1, 2/3, 1, 2 Factor -15l3 - 392l*2 - 2587l - 338. -(l + 13)*2(15l + 2) Let 5z*5 - 655z*4 - 1325z*3 - 665z*2 = 0. Calculate z. -1, 0, 133 Factor -2o*2/13 + 6o/13 - 4/13. -2(o - 2)(o - 1)/13 Factor -3v2/5 - 816v/5 - 2421/5. -3(v + 3)(v + 269)/5 Factor 4v2 + 892v - 896. 4(v - 1)(v + 224) Suppose 2f5/7 - 20f*4/7 + 58f*3/7 - 16f*2/7 - 96f/7 = 0. Calculate f. -1, 0, 3, 4 Factor g*5 - 2g*4 - 9g*3 + 18g2. g2(g - 3)(g - 2)(g + 3) Let -a2/8 + 203a/8 = 0. What is a? 0, 203 Suppose -7g4 + 12g*3 - 3g*2 - 2g = 0. Calculate g. -2/7, 0, 1 Factor 2q3 - 220q*2/7 - 568q/7 - 144/7. 2(q - 18)(q + 2)(7q + 2)/7 Suppose -4x5/7 + 18x*4/7 - 2x*3 - 12x*2/7 = 0. What is x? -1/2, 0, 2, 3 Find x, given that -5x*5 - 5x*4 + 30x*3 + 20x*2 - 40x = 0. -2, 0, 1, 2 Determine l so that 2l2/5 + 156l/5 - 558 = 0. -93, 15 Suppose w5/4 + w4/2 - 7w3/4 - 2w*2 + 3w = 0. What is w? -3, -2, 0, 1, 2 Suppose 2t2 - 8169t + 4084 = 0. Calculate t. 1/2, 4084 Solve -33o3/4 - 263o*2/2 - 520o + 32 = 0 for o. -8, 2/33 Factor -y*2 + 394y - 2709. -(y - 387)(y - 7) Let -4t*5 + 44t*4 - 124t*3 + 68t*2 + 128t - 112 = 0. What is t? -1, 1, 2, 7 Determine z, given that -4z2 + 20z + 56 = 0. -2, 7 Let 2c2/11 - 36c/11 = 0. What is c? 0, 18 Suppose 12i2/5 + 2558i/5 + 426/5 = 0. Calculate i. -213, -1/6 Suppose 33c5 + 144c*4 + 246c*3 + 204c*2 + 81c + 12 = 0. What is c? -1, -4/11 Factor -2v3/15 - 2v*2/3 + 28v/15. -2v(v - 2)(v + 7)/15 Determine t so that 9t*4/5 - 30t*3 - 12t*2 + 30t + 51/5 = 0. -1, -1/3, 1, 17 Let 4a4/7 - 16a*3/7 - 60a*2/7 + 72a/7 = 0. Calculate a. -3, 0, 1, 6 Solve l*3/2 + 14l*2 + 169l/2 - 99 = 0. -18, -11, 1 Let n*2/3 - 17n/3 - 740/3 = 0. Calculate n. -20, 37 Factor -4o4 + 4o*3 + 8o*2. -4o*2(o - 2)(o + 1) Find p, given that -2p*4/3 - 46p*3/3 - 112p*2/3 + 184p/3 + 160 = 0. -20, -3, -2, 2 Solve 2v5 + 44v*4 + 278v*3 + 356v*2 - 280v - 400 = 0. -10, -2, -1, 1 Factor -b*2/4 - 144b - 20736. -(b + 288)*2/4 Determine g so that -4g*4 + 44g*3 - 92g*2 - 44g + 96 = 0. -1, 1, 3, 8 Factor 2s4/9 - 4s*3/9 + 4s/9 - 2/9. 2(s - 1)3(s + 1)/9 Factor 3m5 - 21m*4 + 24m*3 + 48m*2. 3m*2(m - 4)*2(m + 1) Factor 4v4 + 4v*3 - 12v*2 - 20v - 8. 4(v - 2)(v + 1)*3 Factor 5b*4 - 15b*3 - 10b*2 + 60b - 40. 5(b - 2)2(b - 1)(b + 2) Solve -16g*5 + 260g*4 - 1568g*3 + 4216g*2 - 4560g + 900 = 0. 1/4, 3, 5 Let -k*5/3 - 155k*4/3 + 2k*3/3 + 310k*2/3 - k/3 - 155/3 = 0. Calculate k. -155, -1, 1 Solve -28o*4/9 - 13o*3 + 43o*2/9 + 131o/3 - 11 = 0. -3, 1/4, 11/7 Factor -4d2 + 192d - 2304. -4(d - 24)2 Factor o5/2 + 71o*4 - 216o*3 + 217o*2 - 145o/2. o(o - 1)3(o + 145)/2 Find i, given that 100i5/7 + 130i*4/7 - 94i*3/7 - 16i*2 - 24i/7 = 0. -3/2, -2/5, 0, 1 Let l*5/2 - 6l*4 - 75l*3/2 + 341l*2 + 1452l = 0. What is l? -6, -4, 0, 11 Find p such that 4p4 + 5p*3 - 55p*2 - 110p - 24 = 0. -3, -2, -1/4, 4 Factor -p3/8 - p2 - 11p/8 + 5/2. -(p - 1)(p + 4)(p + 5)/8 Solve -c5/2 - 7c4/2 + c3/2 + 67c2/2 + 30c = 0. -5, -4, -1, 0, 3 Factor -9q2 + 915q - 1794. -3(q - 2)(3q - 299) Factor -198g*3/7 + 598g*2/21 - 4g/21. -2g(g - 1)(297g - 2)/21 Factor 3j3 + 18j*2 + 15j. 3j(j + 1)(j + 5) Let -2w*4/5 + 82w*3/5 - 586w*2/5 - 5842w/5 + 6348/5 = 0. What is w? -6, 1, 23 Determine p so that -3p3/5 + 21p*2/5 - 6p/5 - 24 = 0. -2, 4, 5 Factor -3t3/7 - 87t*2/7 - 153t/7 + 243/7. -3(t - 1)(t + 3)(t + 27)/7 Let -2i*2/13 - 94i/13 - 180/13 = 0. Calculate i. -45, -2 Find r such that -3r2 + 5451r - 10890 = 0. 2, 1815 Factor i*2/2 - 51i. i(i - 102)/2 Factor -2j*2 - 24j + 26. -2(j - 1)(j + 13) Find x, given that -5x2 - 10x + 15 = 0. -3, 1 Factor -3m3/7 - 717m*2/7 - 1425m/7 - 711/7. -3(m + 1)2(m + 237)/7 Factor 2m3/7 - 10m*2/7 + 12m/7. 2m(m - 3)(m - 2)/7 Suppose 4d*5/9 - 4d*4/3 - 44d*3/9 + 4d*2/3 + 40d/9 = 0. Calculate d. -2, -1, 0, 1, 5 Factor 4x3 + 152x*2 + 404x - 560. 4(x - 1)(x + 4)(x + 35) Find g, given that -5g*2 + 1775g - 3530 = 0. 2, 353 Determine b, given that 30b5 - 574b*4 + 2986b*3 - 1738b*2 - 4680b + 648 = 0. -1, 2/15, 2, 9 What is m in -2m3 - 240m*2 - 934m - 696 = 0? -116, -3, -1 Solve -u*2/3 - 196u - 28812 = 0. -294 Factor -2q5/19 - 164q*4/19 - 230q*3 - 34664q*2/19 + 83104q/19 - 43904/19. -2(q - 1)2(q + 28)3/19 Factor -p4/3 + 17p3/3 + 37p*2/3 + 19p/3. -p(p - 19)(p + 1)*2/3 Factor 2i*4/7 + 38i*3/7 + 36i*2/7. 2i*2(i + 1)(i + 18)/7 What is i in 28i*3 + 232i*2 + 400i + 96 = 0? -6, -2, -2/7 Find v, given that 8v5/5 + 206v*4/5 - 252v*3 + 1294v*2/5 - 248v/5 = 0. -31, 0, 1/4, 1, 4 Factor 2b5 + 18b*4 + 52b*3 + 68b*2 + 42b + 10. 2(b + 1)4(b + 5) Factor -3g2/2 - 783g/2 + 393. -3(g - 1)(g + 262)/2 Solve 2n3 + 20n*2 - 26n - 44 = 0 for n. -11, -1, 2 Factor a*4/2 + 5a*3 - 19a*	{ "pile_set_name": "DM Mathematics" }
t of 422 and -5. -2110 Product of 1.9 and 1.7. 3.23 -2.32 * 5 -11.6 Calculate 0.5-412. -206 Work out 4 -11. -44 Multiply -0.2 and -1532. 306.4 Work out 2 * -167.4. -334.8 Work out -36 * -2. 72 Calculate -58-0.4. 23.2 -0.3 times -2.2 0.66 Product of 14546 and -0.4. -5818.4 0.2 -2 -0.4 What is the product of -376 and -2? 752 0.2-24 -4.8 2467 -5 -12335 7 * -301 -2107 -0.01761 -0.0176 0.07-0.45 -0.0315 Multiply 0.16 and 502. 80.32 -0.1 * -201 20.1 Multiply -5 and 0.26. -1.3 Product of -0.1 and -0.93. 0.093 What is 3411 times 0.6? 2046.6 Multiply -0.13 and 0.08. -0.0104 What is 3.5 times -5? -17.5 Calculate -24.56-5. 122.8 Multiply 18 and 1.6. 28.8 Multiply -0.06 and 0.0237. -0.001422 Calculate -1-0.623. 0.623 Calculate 0.353. 15.9 Product of 0.0569 and -0.1. -0.00569 Multiply 0.028 and 13.6. 0.3808 40.0032 0.0128 Calculate -44-0.16. 7.04 455 times -0.24 -109.2 What is -6 times 12? -72 Calculate -920. -180 Product of 5.5 and 2. 11 Multiply -4 and 32. -128 Calculate 390. 0 Calculate -225. -110 0.0715 0.355 -0.1 -13.1 1.31 Product of -2 and 219.5. -439 -0.01 times 41 -0.41 What is the product of -0.495 and -0.4? 0.198 -29 * -0.7 20.3 What is the product of -137.6 and -0.5? 68.8 0.3598 34.3 Multiply 0.039 and 5. 0.195 1.778 -0.3 -0.5334 Multiply 3 and 12.7. 38.1 What is -413 times 2? -826 131 times 1 131 Product of -0.215 and -3. 0.645 Work out -2502 * -1. 2502 Multiply 0.8 and 0.1. 0.08 What is -7.27 times 0? 0 What is -0.5 times -1193? 596.5 -0.0279 * -2.6 0.07254 Multiply -2145 and -10. 21450 Work out -5 * 83.56. -417.8 Work out 17 * 2. 34 Work out 0.11 * 2. 0.22 What is -0.23 times 0.5? -0.115 Calculate 416. 64 Work out 94 0.4. 37.6 Multiply -338 and -4. 1352 -4421 * -0.3 1326.3 What is 2 times -6.1? -12.2 -3.1-0.2 0.62 Calculate 521. 105 Calculate 0.31649. 494.7 -0.3 times 114 -34.2 What is 0.1 times 0.83? 0.083 2.79 times 1.2 3.348 -0.01 -0.323 0.00323 901-0.1 -90.1 -0.1 -418 41.8 Calculate -117.14. -468.4 Product of 0.8 and 3. 2.4 -0.1648 times -4 0.6592 Multiply -89.34 and 3. -268.02 What is 4 times 0.004? 0.016 -13.042 times 3 -39.126 Multiply -0.2 and -0.69. 0.138 590 times -1 -590 Calculate -4.89-1.3. 6.357 Calculate -1052-0.1. 105.2 Work out 15 5.9. 88.5 158.6 * -0.06 -9.516 -0.4 times 0.1362 -0.05448 Calculate 29-716. -20764 5 times 2798 13990 Multiply 1 and -1.563. -1.563 Calculate 0.4-3.01. -1.204 13 times 97 1261 What is 2 times 1399? 2798 What is the product of 16 and -2.9? -46.4 Multiply -1000 and 4. -4000 -0.43352 -1340.8 356 -0.049 -17.444 Product of 5 and -325. -1625 Product of -17.5 and -0.1. 1.75 3.7 * -196 -725.2 Product of 1.9 and -75. -142.5 -0.1 * -1.9 0.19 Calculate -2.20.459. -1.0098 Multiply -3 and -183. 549 Product of 0.1 and -43. -4.3 0.065-0.05 -0.00325 -335 * -1 335 -0.5 * -1.31 0.655 Work out -81 * -161. 13041 -0.06 times -0.4576 0.027456 0.577 38.5 0.009 times 151 1.359 633 times -0.5 -316.5 What is -4 times -28.1? 112.4 Multiply 27 and 5. 135 What is -5.75 times 2? -11.5 What is the product of -20 and 14? -280 Work out 0.2554 -0.01. -0.002554 0.4 times 0.1 0.04 273-4 -1092 Product of -3 and -8.3. 24.9 Work out 178 1. 178 0.0922-1 -0.0922 Work out 0.1 -2.55. -0.255 Calculate 2.022. 4.04 2-1260 -2520 What is the product of -1.74 and 0.022? -0.03828 0.18-59 -10.62 Calculate -11505. -1505 Work out 1 * 372. 372 Calculate -4929. -1421 -13-0.36 4.68 Calculate 13988-0.5. -6994 320 times -8 -2560 10.83 -0.1 -1.083 0.47 * -0.22 -0.1034 Multiply -726 and 0.25. -181.5 5 * -0.04861 -0.24305 Calculate 0.051913. 0.15573 0.1 times 1299 129.9 -0.011740.3 -0.003522 0.1 times 2.1 0.21 4.810 48 Product of 1367 and 0. 0 Work out 2.6 107.4. 279.24 1938 times 0.1 193.8 Calculate 39.36-2. -78.72 Work out -3 -173. 519 -4 * -37 148 Multiply -6.02 and 0. 0 Multiply -31 and -0.8. 24.8 Multiply 2 and -1.6. -3.2 Product of -4 and 21. -84 Work out 21 * 11. 231 Work out -0.3 * -72. 21.6 Calculate 0.580.05. 0.029 Multiply -10 and 323. -3230 -0.4 -3.78 1.512 Work out -77 * 8. -616 Work out 5 * -0.101. -0.505 Product of -506 and -3. 1518 Calculate -1-1.55. 1.55 Product of 0.069 and 20. 1.38 Work out 0.605 0.01. 0.00605 182 * 0.4 72.8 What is the product of 49.4 and -0.72? -35.568 What is 13 times -6.2? -80.6 Work out -6.1 * 0.22. -1.342 What is the product of -5 and -60? 300 0.7 times -15 -10.5 Multiply 2.3 and 64. 147.2 What is the product of -65 and 3? -195 27 times -0.041 -1.107 Multiply -3 and -1.055. 3.165 Calculate -7100.3. -213 Product of -0.4 and -0.09. 0.036 What is 129 times 0.5? 64.5 -0.32.82 -0.846 354.20.2 70.84 1.5 times 0.4 0.6 -1 times -11.85 11.85 Work out 49 56. 2744 Work out -12 * -2.6. 31.2 20 * -0.16 -3.2 What is 0.8759 times 0? 0 Multiply -16 and -0.49. 7.84 -1 times -2282 2282 Calculate -1.80.46. -0.828 -6 times 0.625 -3.75 -13 times 1348 -17524 Work out -0.6 1315. -789 Calculate -12.1-0.4. 4.84 What is 103 times 0.03? 3.09 What is -21 times -17? 357 Multiply 0 and 0.15. 0 Calculate 900.5. 45 Calculate 92.02. 18.18 0.40.047 0.0188 Product of 0.5 and 16.5. 8.25 -2148 * 1 -2148 Work out -33 * -0.8. 26.4 What is -8093 times -4? 32372 Product of -1.143 and 0.1. -0.1143 0.004 times 0.3 0.0012 -7 times -321 2247 -0.189 times -9 1.701 Product of -2 and 113. -226 What is the product of 41 and 2? 82 What is the product of 40 and -6? -240 Multiply 0 and -917. 0 Calculate -0.15-187.9. 28.185 Calculate 3.70. 0 What is -0.1 times -808? 80.8 0.0223-3 -0.0669 What is the product of 0.4 and 0.247? 0.0988 What is 8 times 0.46? 3.68 20 -0.3 -6 Work out -2 * -466. 932 What is 0.4 times -72? -28.8 Calculate 0.60.04. 0.024 0.1 -0.73 -0.073 -1.1 times 0.14 -0.154 Calculate 5322. 1064 Work out -4.1 -4. 16.4 Work out 0.4 * 35. 14 Work out 4.38 * -0.4. -1.752 -0.058-427 24.766 Product of 0.4878 and 0.1. 0.04878 Calculate -22.94. -5.88 What is the product of 0.86 and -0.2? -0.172 What is the product of 17 and 813? 13821 -136-0.1 13.6 Product of 0.1 and -31. -3.1 Work out 0.3 -20. -6 -2 * -203 406 Calculate -2-3.16. 6.32 -2 times -125 250 1038 5 5190 Calculate 4-18. -72 Work out -26 0.021. -0.546 Work out 0.5 * 3022. 1511 What is 149 times -11? -1639 Work out 7 * -2762. -19334 195-94 -18330 -0.01030.3 -0.00309 What is 2 times 56? 112 -8-86 688 -215.2 -30.4 Work out 0 * 0.09. 0 0.1 * 17 1.7 What is the product of -3 and -26.93? 80.79 Product of 147 and -0.41. -60.27 Work out 0.0176 * 2. 0.0352 What is -2 times 1? -2 Calculate 22710. 0 What is the product of -3 and 1.63? -4.89 What is the product of 272 and 0? 0 Product of 5 and 283.6. 1418 What is -2 times 1552? -3104 What is 0.08 times 165? 13.2 Product of -1 and 409. -409 Calculate 0.5-407. -203.5 What is the product of 2.7 and -12? -32.4 Multiply -18.07 and 0.04. -0.7228 -9.8 * -131 1283.8 -9.13 -27.3 What is -22 times 26? -572 Product of -23 and 0.06. -1.38 0.04 -3 -0.12 Calculate 42.23. 8.92 What is -0.204 times -0.08? 0.01632 3265 times 0.1 326.5 Work out 8 520. 4160 Calculate -0.414.86. -5.944 1 times 0.2392 0.2392 Multiply 0.1 and 21. 2.1 What is the product of 0.1 and -16? -1.6 Product of 68 and -0.8. -54.4 Work out -1 61. -61 Product of 369 and -0.5. -184.5 Calculate 4-0.11. -0.44 -90 times -13 1170 Calculate -0.1387. -38.7 What is 117 times -0.028? -3.276 0.631 times -4 -2.524 -3 times -9126 27378 Calculate 0.2-0.0448. -0.00896 Calculate -248. -192 What is 32.2 times 4? 128.8 What is the product of 0.021 and -4.6? -0.0966 Calculate -1-309. 309 What is 3 times -31? -93 -0.4 times -1088 435.2 Product of -0.1889 and 0.4. -0.07556 What is the product of 0.0511 and 5? 0.2555 2 times 132 264 -1.2-0.212 0.2544 Multiply 0.1 and -0.19. -0.019 Product of -4413 and 0. 0 Multiply 0.2 and 394. 78.8 Work out -3 * 0.01. -0.03 Multiply 0.507 and -0.4. -0.2028 What is the product of 4 and -1556? -6224 Multiply -86 and -7. 602 -1529 * 0.3 -458.7 Product of 125 and -0.7. -87.5 What is -34.9 times 3? -104.7 -0.0270.2 -0.0054 Work out 3.2 -40. -128 Calculate -9-0.1368. 1.2312 What is -0.426 times -0.2? 0.0852 Multiply -0.045 and 18. -0.81 What is the product of -4.3 and 0.32? -1.376 -576 -380 What is -19 times -2.7? 51.3 -1 * 2213 -2213 Multiply 0.111 and 0.2. 0.0222 What	{ "pile_set_name": "DM Mathematics" }
6. Round d to six dps. 0.000004 Let v be 32 - (-15 + 15856 + 8). What is v rounded to the nearest 1000? -16000 Let s be (-20)/(-4)(-12)/10. Let p(q) = -4q - 14. Let z be p(s). Let l(v) = -8v*2 - 2v - 20. Let t be l(z). Round t to the nearest one hundred. -800 Suppose 465 = 2z + 3w, z = -w - 2w + 234. Let v = -152 + z. What is v rounded to the nearest 100? 100 Let d = -428.5 + 357. Let t = 71.48495 + d. Let m = 0.015 + t. Round m to 5 dps. -0.00005 Let a = 6133 + -6133.4777. What is a rounded to 2 dps? -0.48 Suppose 0 = 8a - 7a + 4m + 12077, 48356 = -4a - 4m. Round a to the nearest one thousand. -12000 Let k = 9644411 - 9644535.00093. Let f = 124 + k. Round f to four decimal places. -0.0009 Let o = -0.0293 - -0.5713. Let z = -78.761 - -79. Let j = o - z. What is j rounded to two decimal places? 0.3 Suppose m + 63497 = 939852. Let g = 156355 - m. Round g to the nearest one hundred thousand. -700000 Let y = -0.48897 + 5.96477. What is y rounded to the nearest integer? 5 Let u = -76.843 + 77.29269. Let i = -0.55 + 0.1. Let b = i + u. What is b rounded to four dps? -0.0003 Suppose -4q + 666 = 2q. Suppose 21 = -5a + q. Suppose -270081178 = ax - 3681178. What is x rounded to the nearest one million? -15000000 Let y = -76 + 22.2. Let n = y + 53.80000572. Round n to seven dps. 0.0000057 Let h = 432203.336 + -446081. Let v = 13958 + h. Let j = v - 80. Round j to one dp. 0.3 Let l = -26788.893588839 + 28719.89358782. Let f = l + -1931. What is f rounded to seven dps? -0.000001 Let g = 8890 - 8889.3995. Round g to 1 dp. 0.6 Suppose 3z + 66 = -q + 3q, -2q + 58 = -5z. Suppose 0n - q = -n. Let o be (-73 - 2)(-2080)/n. What is o rounded to the nearest 1000? 4000 Let z = 35884823633988417 - 35884828653739893.9999821. Let x = z - -5019751276. Let w = 201 + x. What is w rounded to five dps? 0.00002 Let r = -98.928 + 265.356. Let n = -167 + r. Round n to 2 dps. -0.57 Let b = -64.155769 + -0.599531. Let q = -667.2 + 732. Let l = b + q. What is l rounded to three decimal places? 0.045 Let t = -164 + 391. Let u = t - 226.999999232. What is u rounded to 7 decimal places? 0.0000008 Let g = 91.589 + -91. Let r = 0.961 + -0.9. Let o = g + r. What is o rounded to one dp? 0.7 Let q = 193580.9964 - 193612. Let i = -62 - -31. Let b = i - q. Round b to 3 decimal places. 0.004 Let a = 6224.53645 - 6224. Let s = a - 64.95445. Let c = 65 + s. What is c rounded to 2 dps? 0.58 Let l = -16.15 - -17. Let q = 0.782 - l. Let t = -0.1 + q. Round t to 2 dps. -0.17 Let k = 645.287 + -645. Let c = 395.54489 + -395.83. Let u = c + k. What is u rounded to four dps? 0.0019 Let g = -225 - -47. Let m = -177.9958 - g. What is m rounded to three decimal places? 0.004 Let o be (-10)/(-8)5/25 - (-3780464)/64. Round o to the nearest one thousand. 59000 Let b = 116 + -112.2. Let i = -11554 + 11557.7895. Let a = i - b. What is a rounded to 3 dps? -0.011 Let p = -13.0984526 - 2938707.8515474. Let f = 2938676.94999475 + p. Let b = -44 - f. What is b rounded to 7 dps? 0.0000053 Suppose -2w = -2y - 1336998, -1 = -y - 0. Round w to the nearest one hundred thousand. 700000 Let g = -14 + 2. Let n = g + 13.9. Let a = n - -69.6. Round a to the nearest ten. 70 Let z(f) = 35f + 288. Let k be z(-8). Let a be 673000/((k + -16)/8). What is a rounded to the nearest one hundred thousand? -700000 Let t = -1.1 + -20.9. Let q = -595704922 - -595704943.99999816. Let j = t + q. What is j rounded to seven dps? -0.0000018 Let v = -0.12666 + -109.88334. What is v rounded to zero decimal places? -110 Let p be (-3 - (-16)/12)-3. Let a(u) = 54u*2 - 4u - 26. Let y be a(p). What is y rounded to the nearest one hundred? 1300 Let i(w) = 20w3 + 8w*2 + 33w - 53. Let v be i(-6). Round v to the nearest 100. -4300 Let l be (11-43)/((-16)/32). Suppose lo - 84o = -592. What is o rounded to the nearest 100? -300 Let g = -2.096986235 - -2.097. Round g to 7 dps. 0.0000138 Let j = 36769.3 - 35211. Round j to the nearest 100. 1600 Let y = -718373 + 718449.99408. Let b = -841.1 - -764.1. Let m = b + y. Round m to 3 dps. -0.006 Let y = -886845.0851537 + 886851.1. Let m = y - -1.2851471. Let i = 7.3 - m. What is i rounded to six dps? 0.000007 Let c = 62246 + -62245.9999939742. What is c rounded to six decimal places? 0.000006 Let k = -0.16929094 - -66.16913594. Let t = -66 + k. Round t to four decimal places. -0.0002 Let v = -30671.0054177 - -30671. What is v rounded to four dps? -0.0054 Let q = 390 + -390. Suppose a - 2l - 37499999 = -3l, 3l + 3 = q. What is a rounded to the nearest 1000000? 38000000 Let l(f) = 184081f + 62. Let c be l(-15). Let n = 4225143 + c. Suppose 6r - 488008 = 5r + 4u, 0 = 3r + 5u - n. Round r to the nearest ten thousand. 490000 Let u = 4522541 - 4522541.35400592. Let k = 0.354 + u. What is k rounded to seven decimal places? -0.0000059 Let n = -6 + 3.8. Let a = 0.06822 + -2.26803. Let l = a - n. What is l rounded to 4 dps? 0.0002 Let k = -88 - -93. Suppose ki - 961126927 = -v, -v - 154802027 + 539252796 = 2i. Suppose -1925386 + i = 11o. What is o rounded to the nearest 1000000? 17000000 Let v = -1089 - -1080.232. Let i = -6.79 - v. Round i to one decimal place. 2 Let u = -3696376169422067 - -3696376008479632.7000081. Let p = -160942451 - u. Let r = p - -16.7. Round r to six dps. -0.000008 Let q = -172.83 - -172. Let j = q + 0.82999614. What is j rounded to seven decimal places? -0.0000039 Let u = 8865 - 8864.9999978919. Round u to seven dps. 0.0000021 Let d = 93416 - 93417.43034. What is d rounded to 1 dp? -1.4 Let h = -3192.42 + 3227. Let u = 4.12 + h. Let f = u + -38.903. Round f to two dps. -0.2 Let q = 3019 + 3347.9. What is q rounded to the nearest one hundred? 6400 Let b = -451 - -452.3463. Let q = 0.0133 - b. Round q to 2 decimal places. -1.33 Let x = 111.87 + -104.3. Let i = -7.5699998 + x. Round i to six decimal places. 0 Let w(z) = -276268z + 124. Let p be w(-7). Round p to the nearest 100000. 1900000 Let i = -120 - -125. Let y(k) = -k3 + k2 + 3k - 5. Let b be y(i). Round b to the nearest one hundred. -100 Let j = 60.4 - 56. Let l = -17.6 - j. Let a = l + 22.0042. What is a rounded to three decimal places? 0.004 Let z = -1744.997397 + 1745. Round z to three dps. 0.003 Let r = -3428 - -3428.00003764. What is r rounded to five decimal places? 0.00004 Let d = -16832.9991913 + 16833. Round d to 5 decimal places. 0.00081 Let z = 1223147 - 1223230.9837. Let i = -84.153 + 0.153. Let n = z - i. Round n to 3 dps. 0.016 Let g = 78.7 - 69.7. Let n = g + -5.678. Round n to the nearest integer. 3 Let q = -6223425075 - -6223424984.00000106. Let u = -0.167 + 91.167. Let s = u + q. Round s to 7 decimal places. 0.0000011 Let k(n) = -4280n + 3400. Let d be k(39). Round d to the nearest one thousand. -164000 Suppose 3t - 7143 = -2j, 4t = 4j - 10902 - 3434. Suppose 4u + j = -13541. What is u rounded to the nearest 1000? -4000 Suppose 10c = 3u + 8c + 5936996, 5c + 10 = 0. Round u to the nearest 1000000. -2000000 Let d = -6240 - -6237.73. Round d to zero dps. -2 Let r(w) = -3w3 + 9w*2 - 18w - 8. Let z be r(-15). Suppose 100612 = d + z. Round d to the nearest ten thousand. 90000 Let k = 41.5 - 25.1. Let t = 16.4177 - k. Round t to 3 dps. 0.018 Let q = 2147.69 - 1892.444. Let o = 3.546 - q. Round o to the nearest 10. -250 Let g(m) = -m - 3. Let o be g(-7). Suppose 0 = ok + 1825 - 33817. Let x be 2 + ((-12)/3 - k). What is x rounded to the nearest one thousand? -8000 Suppose 13575549 = 17n - 6n - 9111951. Round n to the nearest one hundred thousand. 2100000 Let v = 0.56 + -91.56. Let h = -91.43 - v. Let u = h - -0.42971. What is u rounded to four decimal places? -0.0003 Let i be (-144413)/17 + 16/(-136) - 5. What is i rounded to the nearest 100000? 0 Let a = 522.8 + -522.802231. Round a to 4 dps. -0.0022 Let q = -85784.77 - -86906. What is q rounded to the nearest ten? 1120 Let k = -22.2606541 - -22.2706. What is k rounded to three dps? 0.01 Let r = -203 + 203.558. Let g = r - 148.358. Let s = 135 + g. Round s to the nearest integer. -13 Suppose 5z + u + 22302 = 0, -5z - 11u - 22320 = -u. Round z to the nearest 1000. -4000 Let s = -816 + 815.97. Let n = s + -7.99. What is n rounded to zero dps? -8 Let b = -662.1 - -662.1036004. What is b rounded to	{ "pile_set_name": "DM Mathematics" }
2)-5. -75525 - 1650sqrt(7) Simplify -45sqrt(6655)/sqrt(11) + -2 + 0 + -5. -220sqrt(5) - 7 Simplify 3(0 + sqrt(304) + 0 + sqrt(304))-3 - 5(((sqrt(304) - (-3 + sqrt(304) - sqrt(304))-2) + sqrt(304) - sqrt(304))*2 + 5). -1725 + 168sqrt(19) Simplify (-5(sqrt(4) - (2sqrt(4)-3 + sqrt(4)) - sqrt(4)))/(-1sqrt(8)3) + 3. 3 + 25sqrt(2)/6 Simplify 1(4 + ((sqrt(1900) - (sqrt(1900)1 + 1) - -41sqrt(1900))*2 - ((sqrt(1900) + 3sqrt(1900) + -5)*2 + -1))2). -42 + 640sqrt(19) Simplify -5((1 + -2 + -3 + sqrt(1008)3 + -2)33)2. -3688740 + 174960sqrt(7) Simplify -4(3 + ((3 + (sqrt(1900) - -2-1sqrt(1900)) - -5(sqrt(1900)-2 + 5 + sqrt(1900)))-5)*2). -6918412 + 336000sqrt(19) Simplify -5 + (1(sqrt(12) + sqrt(48)) + (2 + 0 + sqrt(12) - sqrt(12)) + 1 - -3(0 + sqrt(768)-2 + sqrt(768)))2. -252sqrt(3) + 5296 Simplify (sqrt(256)1)/(sqrt(2)-1-3) + 1(sqrt(1152) - 1sqrt(1152) - sqrt(512)-1). 56sqrt(2)/3 Simplify -5(6(2(sqrt(7) - sqrt(7)-2) - -1-2sqrt(7)))2 + -2 + 3(5 + (sqrt(112) - (sqrt(112) + 1 - sqrt(112))))*2. -19778 + 96sqrt(7) Simplify 4(-4 + -2 + -2 + (sqrt(17) + -2 + 3 - -5((sqrt(51)/sqrt(3) - sqrt(17))*2 - sqrt(17))) + 4). -16sqrt(17) - 12 Simplify (-4((-5(sqrt(325) + 1) - -41sqrt(325)) + 0 + 6(5sqrt(325) + sqrt(325))))*2. -28000sqrt(13) + 6370400 Simplify -3(-3 + 3sqrt(272) + 1 + (-4 + sqrt(272) + sqrt(272))6)2. -185628 + 9360sqrt(17) Simplify -6(sqrt(572)/(sqrt(22)/(sqrt(2) - sqrt(8))))/(-4sqrt(36) - (sqrt(4) + sqrt(12)/sqrt(3)-5)). -3sqrt(13)/4 Simplify ((0 + ((sqrt(147) - (-1 + sqrt(147))) + sqrt(147) + 1 - -5(sqrt(147) + -1)) + 4(-5 + -1sqrt(147)))2)*2. -2576sqrt(3) + 4468 Simplify -5sqrt(3) + 4 + sqrt(15)/sqrt(5)3 - (4 + -1 + 1sqrt(192)). -10sqrt(3) + 1 Simplify 1 + (sqrt(153) + sqrt(153) + sqrt(153) + sqrt(153) + 2sqrt(153)1)/(sqrt(486)/sqrt(6)) + 4. 5 + 2sqrt(17) Simplify (-4sqrt(891) + 4)-1 - (2 + ((-2 + sqrt(704))6 - sqrt(704))*2). -17750 + 996sqrt(11) Simplify 5 + ((sqrt(165)/sqrt(44))/(sqrt(108)-1) - -3(0 + sqrt(80))6)2. 3724565/144 Simplify (-1sqrt(117) + 4 - (2sqrt(117)4 + sqrt(117)))2 + (0 + (sqrt(1872) + 1 - sqrt(1872)) + 3)2 + 0. -240sqrt(13) + 11732 Simplify (-1(sqrt(891) + 1) + -4)*2-5 - (3 + (sqrt(11) - sqrt(176)) + 5)*2-2-1. -4906 - 354sqrt(11) Simplify (6(-3 + sqrt(288) + 5 + -2) - 1(5 + -2(2 + sqrt(288)) + sqrt(288)))2. -168sqrt(2) + 14113 Simplify (0 + (sqrt(1700) + -6(sqrt(1700) + 0) + 1 - ((sqrt(1700) - (3 + sqrt(1700) + 0)) + sqrt(1700)2 + 0 + sqrt(1700) + sqrt(1700)))-1)2-5-1. -3600sqrt(17) + 688580 Simplify (1(sqrt(7) + sqrt(35)/sqrt(5))2 - sqrt(175)3) + (2sqrt(28)/sqrt(4) - (2sqrt(7))*2-6)-3. -476 - 21sqrt(7) Simplify -1(0 + ((2sqrt(405) + 3 - (-1 + sqrt(405) + -2))*2 - ((-2 + sqrt(405))-2 + sqrt(405) - ((sqrt(405) + 0 - sqrt(405)) + 5)*2))). -462 - 117sqrt(5) Simplify (6(((-5sqrt(112) - sqrt(112)) + 0 - (sqrt(112) + (3sqrt(112) - sqrt(112)) + 2)) + 4 + 5)1)*2. -18144sqrt(7) + 328356 Simplify -5 + (1sqrt(2448))2-6 + (-3 + -2 + sqrt(272))*2 + 3. -14393 - 40sqrt(17) Simplify ((5 + sqrt(1088) + sqrt(1088) + -1 + sqrt(1088) + -3)-6 + (-1 + (-1 + sqrt(1088) - sqrt(1088)) - (3 + 1 + sqrt(1088))))2. 3648sqrt(17) + 392912 Simplify 6(4sqrt(104)/sqrt(2))*2 - ((sqrt(13)-5-3)2 - (sqrt(13)2 + 2)). 2sqrt(13) + 2069 Simplify (sqrt(16) + (sqrt(128)-3 - sqrt(128))/sqrt(8))/(sqrt(1152) + 1sqrt(1152)) - (-3 + sqrt(72) + sqrt(72)-2 + sqrt(72) - (-2 + sqrt(72) + 1)*2). -97sqrt(2)/8 + 76 Simplify (2sqrt(1944))/(sqrt(540)/sqrt(5) - sqrt(12)) + 5 - (-2-5-2sqrt(32))*2. -12795 + 9sqrt(2) Simplify (2(-5 + -3 + 1 + -5 + sqrt(304) + sqrt(304) + 4))2. -512sqrt(19) + 5120 Simplify 0 + -2 + 2 + sqrt(108) - -2(-4 + sqrt(75) + sqrt(75)-1). -8 + 6sqrt(3) Simplify (2-3(sqrt(3993) - sqrt(33))1)/((sqrt(45)/sqrt(5))/sqrt(3) + (sqrt(1200) + sqrt(12))/sqrt(4)). -5sqrt(11) Simplify -4 + (0 + 2sqrt(720))2 + (0 + ((sqrt(180) + sqrt(180) + 0 + sqrt(180) + sqrt(180) - sqrt(180) - sqrt(180)) + sqrt(180))2 - (sqrt(180)1 + 0)*2). 48sqrt(5) + 1436 Simplify -4 + -2 + -3(-5 + 4sqrt(832) + -1). -96sqrt(13) + 12 Simplify -5(-34(-3sqrt(300)-2 + sqrt(300) - (0 + 2sqrt(300) - sqrt(300)))5)*2. -194400000 Simplify (-4 + -4(-3((sqrt(99) + -2sqrt(99))1)/((sqrt(108)1 + sqrt(108))/sqrt(12)) + 5) + -4)*2. 336sqrt(11) + 1180 Simplify (3((1 + 1 + sqrt(32) - (2sqrt(32) - sqrt(32))-2)-3 + -5))*2. 7128sqrt(2) + 24417 Simplify (-4sqrt(300))/(sqrt(6) + sqrt(6) + 2sqrt(96) + sqrt(6)) + (((sqrt(72) - sqrt(8))/sqrt(4))*2 - sqrt(2) - 2-1sqrt(2))2. 2sqrt(2)/11 + 16 Simplify (-6(-4(sqrt(2600) + 2sqrt(2600))3)/(6(sqrt(288) - sqrt(8)4)))2. 105300 Simplify -4(-1 + (sqrt(108) + 2 + sqrt(108) + 0)-2 + 0)2 + 3. -7009 - 960sqrt(3) Simplify (5sqrt(1029) - (sqrt(147) - sqrt(147)4)/sqrt(7))/(sqrt(18)/(sqrt(6) - -6sqrt(600))-6). -1159sqrt(7)/3 Simplify ((sqrt(15) - sqrt(60))-2-6)/((sqrt(3) - (sqrt(12) + sqrt(48) + sqrt(12) + sqrt(12))) + sqrt(900)/sqrt(12))2. 6sqrt(5) Simplify -4 + 4 + 3(0 + (sqrt(1053) + 2 - sqrt(1053) - sqrt(1053)) - -6sqrt(1053)-1)*2 + 3. -756sqrt(13) + 154806 Simplify ((1((sqrt(2) - sqrt(6)/sqrt(3)) + sqrt(2))-1 - (-2sqrt(4)/sqrt(2) + -4)) + (-1sqrt(1296))/(2-1sqrt(8))6)2. 224sqrt(2) + 1584 Simplify (-4sqrt(156)-2-4)/(sqrt(240)/(sqrt(5) - (sqrt(25)/sqrt(5) - sqrt(5))))2. -32sqrt(13) Simplify -3 + (3(sqrt(11)-1 + sqrt(11)) - (sqrt(99) + 1)2 - (sqrt(1584)1 + sqrt(11) - ((2sqrt(110))/sqrt(10) - sqrt(11)))-2). -103 + 18sqrt(11) Simplify -6((((-1sqrt(117) - sqrt(117))-5)/(sqrt(432)/sqrt(3)) - (sqrt(208) + -1 + (5sqrt(13)1)*2)) + -5). 9sqrt(13) + 1974 Simplify (((sqrt(180) - (sqrt(180) + sqrt(180) + sqrt(180)-2)-6 - sqrt(180))/(sqrt(12)16))/(1(-2sqrt(363) - sqrt(432)/sqrt(9))))*2. 0 Simplify 2 + (sqrt(192) + sqrt(192)1 + 3)*2 + (-4sqrt(33)3)/sqrt(11) + 3. 84sqrt(3) + 782 Simplify (5 + 1 + (sqrt(176) + 0)2 - (1sqrt(176)-3 + -5)1)*2. 440sqrt(11) + 4521 Simplify ((-2sqrt(228)-1 - sqrt(228)) + sqrt(228))/((2sqrt(96))/sqrt(8)) - (0 + sqrt(304) - sqrt(114)/sqrt(6)-3). -6sqrt(19) Simplify ((sqrt(441) + (sqrt(441) - (sqrt(441) + (sqrt(441) - (sqrt(441) + -2sqrt(441)) - sqrt(441))2)))4)/(sqrt(35)/(sqrt(5)-2) - sqrt(7)2-3). -24sqrt(7)/11 Simplify 6(((sqrt(2)2 + -5 + 0)2 - (1 + (-1 + sqrt(162))2)) + -2) + 0. -798 - 12sqrt(2) Simplify (-5 + ((sqrt(76) - 2sqrt(76)-5)-6)/(-5sqrt(400)2))*2. -33sqrt(19)/5 + 83191/2500 Simplify ((sqrt(78)-1 - sqrt(78))-5)/(sqrt(24)/(sqrt(16)/sqrt(4))) - (-1sqrt(208) + -3 + (sqrt(208) + (-5 + 2sqrt(208) + sqrt(208) - sqrt(208)))*2). -1894 + 134sqrt(13) Simplify (sqrt(468) - -3sqrt(468)) + -3 - (sqrt(468) + -4sqrt(468)2)2 - 5(4(sqrt(468) + 0 + sqrt(468)) + 1). -22940 - 216sqrt(13) Simplify -3 + 1sqrt(51)/(sqrt(3) + sqrt(21)/(sqrt(21)/sqrt(3))) + ((1sqrt(68) + sqrt(68))-1 - (sqrt(68) + sqrt(68)-13))2. -3 + sqrt(17)/2 Simplify (sqrt(152)/(sqrt(20)/sqrt(5)) - (sqrt(38) - sqrt(38)-3)1)/(sqrt(2) + sqrt(288)-3 - sqrt(1250))6. 3sqrt(19)/10 Simplify (-4 + 2 + (sqrt(99) + (sqrt(99) + (1 + sqrt(99) - sqrt(99)) + 4 - sqrt(99)) + 1 - -3(5 + -1sqrt(99))))*2. -228sqrt(11) + 757 Simplify -1 + ((sqrt(1296)5 + sqrt(9) + sqrt(9))-3)/(sqrt(363) - -51sqrt(363)) + -3. -31sqrt(3)/11 - 4 Simplify (sqrt(132)/(sqrt(8)/sqrt(2)) + 2sqrt(825))/((sqrt(77)26)/(sqrt(448)-2)). -44sqrt(3)/3 Simplify 1 + 5(-2 + ((1 + -1 + sqrt(7))1)*2)1. 26 Simplify (sqrt(150)-4)/(-2sqrt(2)-3) - (sqrt(3) + sqrt(33)/sqrt(176) + 4sqrt(6)/sqrt(2) + -1(sqrt(3) - ((-1sqrt(15))/sqrt(5))*2)). -91sqrt(3)/12 - 3 Simplify (1 + -2(sqrt(405) + sqrt(405) + 2 + sqrt(405) + 2sqrt(405)) + 5(5 + 1 + sqrt(405))6)*2 + -2. 63720sqrt(5) + 193327 Simplify (-1(2-1sqrt(85) - (((sqrt(85) - sqrt(85)-2) + sqrt(85))-2 + sqrt(85) + sqrt(85))))/(((sqrt(55) - -2sqrt(165)/sqrt(3)) + sqrt(55))/sqrt(11)3). -sqrt(17)/3 Simplify ((sqrt(18)/((sqrt(12) + sqrt(108) - sqrt(12))/sqrt(2)) + 5 - 6(sqrt(363)2 + 5)2) + 4)-6. 7918sqrt(3) + 53118 Simplify 3(sqrt(117) + (3 + sqrt(117))4 - (-3 + 2 + sqrt(117)) - (5 + -2(sqrt(117)-1 - sqrt(117)) + -4))*2. 432 Simplify 1 + (sqrt(32)	{ "pile_set_name": "DM Mathematics" }
*3 - 453gx2 + 43x*3 wrt x? 30g*2 - 106704g + 258 What is the third derivative of 139859664z3 + 140790z*2 - 147? 839157984 Find the second derivative of -9169896w*2 + 2060124w wrt w. -18339792 Find the second derivative of 895f4 - 20555f*3 + 4f*2 - 51f - 330181 wrt f. 10740f2 - 123330f + 8 What is the third derivative of -69072698s3 - 186857006s*2 wrt s? -414436188 What is the second derivative of -49555847a*5 - 48412068a? -991116940a3 Find the third derivative of 15440266lv3 - 813lv2 - 3l + 19v3 - 45983v*2 - 2v wrt v. 92641596l + 114 What is the second derivative of d3u*2 + 785d*3u - 36du - 69840248u2 wrt u? 2d*3 - 139680496 What is the second derivative of kw*3 - 2kw2 - kw + 83278520k - 13389592w*3 + 2w*2 wrt w? 6kw - 4k - 80337552w + 4 Find the third derivative of 2370i*3q + 5325i3 + 1440i*2q + 2i2 - 14iq - 2i - 287q + 1 wrt i. 14220q + 31950 What is the second derivative of -49153b2i*2 + 2724b*2p + 15116b + 15850i*2p + p wrt b? -98306i2 + 5448p Find the first derivative of -6v4 + 2755743v*2 - 54629694 wrt v. -24v*3 + 5511486v What is the second derivative of 1491c4 - 128784c*2 - 291993201c? 17892c2 - 257568 Differentiate 8772742cy + 5772659c with respect to y. 8772742c Find the third derivative of 38h*2p*5 + 664h*2p*2 + 707hp3 + 9p*3 + 3107p*2 wrt p. 2280h*2p*2 + 4242h + 54 What is the second derivative of 45428320a2 + a - 2876271? 90856640 Find the first derivative of 86l*3p - 7586034l3 - 217017l*2p wrt p. 86l3 - 217017l*2 What is the second derivative of -195097723o*2v*2 - 160ov2 - 17ov + o + 2v*2 - 61v wrt o? -390195446v2 What is the third derivative of 31803h5 + h4 + 54h3 - 27562099h*2? 1908180h*2 + 24h + 324 Find the first derivative of 18749m4 - 5421m*3 + 778463926. 74996m*3 - 16263m*2 Differentiate -159fn3 - 16fn - 25643f - 5n2 + 6n - 18 with respect to n. -477fn*2 - 16f - 10n + 6 Find the second derivative of 3l*5 + 23919l*3 - 5l*2 - 615l + 3415. 60l3 + 143514l - 10 What is the second derivative of -6506282x4 - 800x - 176083 wrt x? -78075384x2 Find the first derivative of -272192221j*3 - 132511677. -816576663j*2 Differentiate 28146h*2 + 1573h + 158537022 wrt h. 56292h + 1573 Find the second derivative of a3c + 4999a3 - 75a*2c + 28a2 + 199226904ac + 4a wrt a. 6ac + 29994a - 150c + 56 What is the second derivative of 226co*2p*2 - 9900co2p - 8cp*2 - 26cp - 1411o*2p*2 wrt p? 452co2 - 16c - 2822o2 What is the third derivative of -225317279b*5 - 150930840b*2 wrt b? -13519036740b*2 Find the second derivative of -60962a*5 - 10a*4 + 2a - 13864068 wrt a. -1219240a3 - 120a*2 What is the third derivative of -110559218g*2j*3 + 422589g*2j*2 + 46gj2 wrt j? -663355308g*2 Find the second derivative of 933461584n*5 - 2059n - 4609. 18669231680n3 What is the third derivative of -36283523j*3t - 14j2 + 4437jt + 3t + 6 wrt j? -217701138t Find the third derivative of 21414675p*3 - 4457p*2 - 2344. 128488050 Find the third derivative of -381f*6 - 432f5 - f3 + f*2 + 7881f + 58. -45720f3 - 25920f*2 - 6 Differentiate 7681134x*3 - 8161502. 23043402x*2 Find the second derivative of 20569408o*2 - 18o + 1527780 wrt o. 41138816 Find the third derivative of 438276778p4 - 102p*2 + 925895. 10518642672p What is the third derivative of -20910624a5 + 2a*2 + 30938536a wrt a? -1254637440a2 Find the second derivative of 1322308517u*3 - 806800169u wrt u. 7933851102u What is the second derivative of 54399091t*2 + 50408166t? 108798182 Find the third derivative of -46g5 + 382395g*3 - 136686707g*2 wrt g. -2760g*2 + 2294370 What is the third derivative of -72342683f*3p*2 + 21f*2p*2 - 8f*2p - 2f2 + 47 wrt f? -434056098p*2 What is the third derivative of 122tv4 + 26t + 269622v4 + 2841369v*2 wrt v? 2928tv + 6470928v What is the second derivative of 1039081857c2o*2 + 2c*2o + 105c2 - 147co - 3c - o - 21 wrt o? 2078163714c2 What is the third derivative of -33s*5 + 80759s*3 + 155340677s*2 wrt s? -1980s*2 + 484554 Differentiate 17397272m*2z - 20437961z wrt m. 34794544mz Find the second derivative of 13112a*3 + 495a*2 - 155a + 361287. 78672a + 990 What is the first derivative of -3799q*4 + 194q - 11322346? -15196q3 + 194 Find the second derivative of -1660l*3 - 108179l*2 - 1730796l - 14 wrt l. -9960l - 216358 Find the second derivative of -ln*2t*2 + 7639039ln2 - 3lnt*2 + 2ln - 145593lt wrt n. -2lt2 + 15278078l Find the second derivative of -3984100kx*2 - 1561kx - 2k - x - 1 wrt x. -7968200k Find the third derivative of 3p*5 + 19285p*4 - 370p*3 + 27p*2 - 4241768. 180p*2 + 462840p - 2220 Differentiate 6208128u3 + 20240435. 18624384u*2 Find the third derivative of -28672023g*4 - 13140102g*2 wrt g. -688128552g Differentiate 5288139y2 - 7863492 with respect to y. 10576278y Differentiate -3d2h + d*2 - 57476dh + 6333477 with respect to h. -3d*2 - 57476d What is the third derivative of -10269184v4 + 78084117v*2? -246460416v Find the second derivative of 19509334y4 - 84540962y. 234112008y2 What is the first derivative of -55777giq*3 + 134giq - 5i - 19554q*3 - 12 wrt g? -55777iq3 + 134iq Find the third derivative of 3o*3t*4 - 13o*3t + 73o2 + 924o - 99405710t4 + 11t*2 wrt t. 72o*3t - 2385737040t Find the second derivative of 3797184h*3 - 3h + 498997. 22783104h Find the second derivative of -2st3 - 3767st2 + 49st + 30689s + 2768t2 + 8t wrt t. -12st - 7534s + 5536 What is the second derivative of -589h*4 + 51830h*2 + 78113940h wrt h? -7068h2 + 103660 What is the third derivative of -51504438n*3 - 29372814n*2 wrt n? -309026628 Differentiate -2q*3 + 290325q*2 - 7q - 37551452 with respect to q. -6q2 + 580650q - 7 Find the second derivative of -35667766i2 - 26503172i. -71335532 What is the third derivative of -11qy*4 - 46qy3 - 552qy2 + 6221q - 162y4 - 5y*3 wrt y? -264qy - 276q - 3888y - 30 Find the first derivative of -u2 - 30381369u + 80514033 wrt u. -2u - 30381369 What is the second derivative of -1517s*2t*2u*2 + 1914s*2tu + 2s*2 + 409st2 - 45023t*2u*2 + 9t*2u wrt u? -3034s2t*2 - 90046t*2 Find the second derivative of -829692277n*4 - 54807591n + 3 wrt n. -9956307324n2 Find the second derivative of 1698626bl3 - 4bl + 2b + 2926613l wrt l. 10191756bl Differentiate -229064u*3 - 110u*2v*2 - 14042897v*2 + 2v with respect to u. -687192u2 - 220uv2 What is the second derivative of -81i*2k3 + i2k + ik*3 + 12284ik2 + 16592223ik wrt k? -486i*2k + 6ik + 24568i What is the first derivative of 24791jn2y*2 - 1569jn2 + 154n*2y*2 + 5n - 2358y2 wrt j? 24791n*2y*2 - 1569n*2 Find the second derivative of -17968a*3 - 258a*2 - 17870001a + 1. -107808a - 516 What is the third derivative of 211894162m*5 + 2m3 - m2 - 13m + 1616249 wrt m? 12713649720m*2 + 12 Find the third derivative of -627017k*3r + k*2 + 242kr + 1667 wrt k. -3762102r Find the first derivative of 353r3 + r2 + 49160r - 804407638. 1059r2 + 2r + 49160 What is the second derivative of -33h3s*2 - 29h*3s + h*2s*2 - 42h*2s - h*2 + 412hs2 + 772h - 13s2 + 2s wrt s? -66h3 + 2h*2 + 824h - 26 Differentiate 3i4z*2 + 20111389i*2z*2 + 2z*2 + 12z + 325933 wrt i. 12i3z*2 + 40222778iz2 Differentiate -jlm2 + 35469jlm + 9873jm - 4j + 9lm + 176m*2 with respect to l. -jm*2 + 35469jm + 9m Find the second derivative of -21410050b3 - 2b*2 + 4769969b - 13 wrt b. -128460300b - 4 What is the second derivative of 1252652197x*2 + 772647866x? 2505304394 What is the first derivative of 516cs - 17861589c + 21s*4 - 320s*2 wrt s? 516c + 84s3 - 640s Find the third derivative of 4i4 - 22708i*3 - 11264717i	{ "pile_set_name": "DM Mathematics" }
-oz = 2c - 18, -z + 4 = -0 for c. -1 Suppose 52 = 2m + 8. Solve o = -3f - 9 - 4, m = -5f - 2o for f. -4 Let x be 50/(-4)(0 + -2). Suppose -2i = -y - 6, -2y + 7y + i - x = 0. Solve -yf + 11 - 3 = -2s, -4f - s = -20 for f. 4 Suppose -10z + 31 = -9. Solve 0 = -4c + 3s + 25, -s + 17 = c + zc for c. 4 Let a be (-2)/(1(-4 + 3)). Solve -2j - a = 0, -8 = 4g - 4j + 8 for g. -5 Let q(h) = -h2 + 7h + 13. Let g be q(8). Solve 3m = r + 3, 0 = 2m + gr - 0 - 2 for m. 1 Suppose -2t - 11 = -3s, -5s + s - 2 = -t. Let d be (-2)/5 - (-56)/t. Let i be ((-2)/d)/(4/24). Solve 0 = -2l + 4, -4z + iz - 5l = 0 for z. -5 Suppose -2f + 7 = 3. Solve -3o - fr + 2 = 0, 2o - o - 6 = 2r for o. 2 Suppose -4x + w = -190 - 447, 2x - 329 = -3w. Suppose -2o = -4p - 64, -5o - 3p - 2p = -x. Solve 4g = -4c + o, 2g + 10 + 2 = 5c for g. 4 Let o be -2 - ((-11)/1 - 0). Let h = 21 - o. Let s be (5/2)/(6/h). Solve -3j = -sl - 12, -4l - l + 16 = 4j for l. 0 Let z(x) = -x2 + 2x*3 - 3x*3 - 4x*3 + 2x*3. Let l be z(-1). Solve 0 = 4o + 5v - 28, lv - 16 = -5o + 2 for o. 2 Let p be (-4)/(-14) - ((-19)/7 + 3). Solve 2s = 3h - 4, -2h - 3s + 4 + 3 = p for h. 2 Suppose 8 + 7 = 5i. Let k = 37 + -35. Solve -4a = -5g - 21, -ig + ka - 8 = 5 for g. -5 Let v = -2 + 2. Let p = v - -1. Let h(g) = 5g3 - 2g + 1. Let w be h(p). Solve -2c = z + w, 2z + 8 = -3c + 3 for c. -3 Let b(q) = q2 + q + 1. Suppose 0p = -w - 2p + 8, 0 = -2w - 5p + 21. Let n be b(w). Solve j - 5 = -5g, j + ng = g + 2 for j. 0 Let f be (-4)/(-26) + 1030/65. Suppose 3t - 12 = 2s, -t - 3t + 2s = -f. Suppose -tn + 0n + 12 = 0. Solve 3a - nb = -8b - 29, 5a - 5b - 5 = 0 for a. -3 Suppose 36 = -4v + 56. Solve -6 = vy + n - 3n, -y + 3 = n for y. 0 Suppose 5s - 9 = 6. Suppose -3r = -8r + 35. Solve -3y - 4h = -rh + 3, -sy + h = -1 for y. 1 Suppose 3z - z - 62 = 0. Let v = -15 + z. Solve 0i - 4 = 4i + 4q, 4q = 2i - v for i. 2 Let o be 10/35 - 267/(-21). Solve -3j + 5b = 18, -4b + o = -j - 0b for j. -1 Let x = -9 + 14. Suppose xp = 6p - 4. Solve -23 = -3c + 4s, -s = pc + s - 16 for c. 5 Let o(c) be the third derivative of -c4/24 + 5c*3/3 + 8c*2. Let y be o(7). Solve -v - i - 6 = 3v, -yv + 4i = -5 for v. -1 Let z = 20 - 14. Suppose -1 = -4n - 4p + 7, -2p = -4n - 16. Let v be (57/z)/((-1)/n). Solve 0 = -5m + f + 10 + v, -4m + 12 = 2f for m. 5 Let z = 32 + -30. Solve 0 = -3l - i + 14, -z + 0 = -3l + 5i for l. 4 Suppose 0 = -6x - x + 28. Solve 2j = xs + 4, s = -0s + 4j + 13 for s. -3 Let k be ((-8)/6)/((-2)/6). Suppose -2y + 7y - 24 = c, -2y = 3c - 13. Let l = c + 1. Solve 7j = lj + 10, -ko = -j - 18 for o. 5 Let p = 0 - -2. Let q(b) = -b*2 + 5b - 4. Let w be q(3). Suppose 0 = pv + 3k - 1 - w, 0 = 3v + 2k - 2. Solve -5d + d - n + 19 = v, -3d = 2n - 18 for d. 4 Let c = -18 - -26. Solve 5x = 10, 3b = -2x + c + 11 for b. 5 Let f = 0 - -14. Solve 4o + f = -5h - 26, 0 = 5o + 25 for h. -4 Suppose -c - c = -10. Suppose -cq = -0q + 35. Let m = 14 + q. Solve -5k - 3i = -11, 5i - 19 + m = -2k for k. 1 Let t be (-6)/9 - -2(-14)/(-6). Solve -w - 4b = 17 - 1, -3w - b = t for w. 0 Let b = 15 + -10. Suppose -4 = -v + b. Let f(g) = -g*3 - 8g*2 - 2g - 11. Let n be f(-8). Solve 0 = 4c - 5l + v, 2c + 5l - n = -2 for c. -1 Let o(n) = 2n - 4. Let v be o(7). Solve -v = -4s + 3u + 7, -s + 9 = 4u for s. 5 Suppose -5c + 20 = -b - 2b, 5b = -3c - 22. Let j(i) = -i*2 - 5i + 2. Let d be j(b). Solve g = -du + 2, -5u - 2g + 7 = -0u for u. 3 Let a(o) = 2o2 - 7o + 2. Let p(t) = -3t2 + 8t - 2. Let s(x) = 4a(x) + 3p(x). Let f be s(-4). Solve 0 = -4q - fm + 3m - 3, -5q = 2m + 20 for q. -2 Suppose -f - 3 = 5d - 13, 3f + 3d = 18. Solve 0 = 2h - 7h + 25, x + 2h = f for x. -5 Let g = 11 + -5. Solve -z + g = -3z - 4u, 2z + 5u = -6 for z. -3 Let m(q) = q2 + 7q - 8. Let b be 20/612/(-5). Let i be m(b). Solve i = -k + 2s - 5, 0s + 8 = -2k + 3s for k. -1 Let q(a) = -a - 4. Let o be q(-6). Suppose 4b + t = -23, 0b = -2b - 2t - 10. Let r = -1 - b. Solve rw + 9 = -oj, -18 = w - 0j - 5j for w. -3 Let p(n) = -n2 - 13n. Let h be p(-13). Let o be (h - 0) + 3 + 2. Solve -ov - 20 = 4z, 4z - 3v = -0z + 12 for z. 0 Suppose 4s - 6 = 2. Suppose -f - sf + 6 = 0. Solve -n + 8 = -4i, fi - 4i = 4n - 14 for i. -1 Let q be (-3 + (3 - 1) - -15) + 0. Solve -2x + 4f + 6 + q = 0, 4x = -2f for x. 2 Suppose 0 = -12q + 19q - 56. Suppose -4d + 24 = u, -u - 1 + 0 = -d. Solve 2k = -3g + q, 4g = k + 1 - d for g. 0 Suppose 0 = -3g + 23 + 4. Let f = 9 - g. Solve 3t - 4k - 10 = 0, -22 = t + 5k - f for t. -2 Let v = 86 + -59. Suppose 0 = -5g + 3s + v, -3s = 5g - g. Solve -2y + 6y - 19 = gj, 7 = y - 3j for y. 4 Let o(d) = -d + 5. Let l be o(2). Solve -w = 5n - 10 - 6, ln - 24 = 3w for n. 4 Let a be (-4)/30-275. Solve -3j - 1 = -5q + 3, -3q = 5j + a for q. -1 Suppose 0 = -7m + 6m. Solve -4t - 4u = m, 2u + 27 + 1 = 5t for t. 4 Let j(p) = -3p3 - p2 - p. Let b be j(-1). Suppose 0 = 16z - 20z + 20. Solve -20 = zw - 2v, -3w + b = v + 4 for w. -2 Let q be 0 - (1 + -1 + -2). Suppose -w = -2 - 1, -qw = 2k - 14. Solve -2v = 4j + 14, 11 = -kv - 9 for j. -1 Let c be 8/32 - (-33)/12. Solve cz = -4g + 2g + 18, -3g = -2z - 1 for z. 4 Let c = -13 - -20. Let d = -4 + c. Solve -4l - 32 = 4f, -df - f = -3l + 11 for f. -5 Let b(h) = -h*3 - 3h*2 - 3h + 2. Let g be b(-3). Let o be g/2 + 3/(-6). Solve -5 = -ol - 6d + 4d, 4l = -5d + 21 for l. -1 Let u be 3 - 0 - (14 + -13). Suppose uy - 12 = -a, 0a + 4a = 3y - 7. Solve -20 = -5i - x, 0i - yi + 5 = 4x for i. 5 Let l = 11 - 9. Let r be l/(-7)(7 + -14). Solve -8 = n + rx, -2n = -4x - 25 + 9 for n. 0 Let i(g) = -g2 - 11g - 3. Let n be i(-9). Solve -5x + 5b = -n, -x + 6 = -0b - 2b for x. 0 Let v = 35 + -31. Solve 2z + 3 = k, -z - v = 3k + 1 for z. -2 Let z be ((-9)/(-6))/(1/(-6)). Let f = 9 + z. Solve 4q - 3j + 9 - 1 = f, 0 = q - 5j - 15 for q. -5 Let d(j) = -j3 + 7j*2 - 6j + 4. Let y be d(6). Solve w = 2n + 3n - 2, w + n = y for w. 3 Suppose -3m - 23 = -5. Let g be 30/9 - (-8)/m. Solve 3l + s = 8, 20 = 2s + gs for l. 1 Suppose -l + 5l = -2b + 50, 59 = 4l - b. Solve -2c = -s - 11, -2c = -5c - s + l for c. 5 Let h = -2 - -14. Solve 0 = v + 4k + 18, -3v = 4k + h + 10 for v. -2 Let t(y) = y2 - 22y + 77. Let d be t(18). Suppose 2h = -z + 4, -z + 12 = 4h - 0h. Solve 0 = 5s + dp, -3s = -0s - hp - 28 for s. 4 Let v(f) = -f*3 - 5f*2 + 9f + 21. Let k be v(-6). Solve 3t - 19 = 2x - x, -t - 7 = kx for x. -4 Let r(n) = -n3 + 5n*2 + 6n + 7. Let t be r(6). Solve t = 5a - 4l, 6 = 2a + 2a - 3l for a. 3 Suppose -3q - 2t + 22 = 0, 14 = 2q + 2t - t. Let b be (-4 + q - -5) + 0. Solve n + b = o, 3n = 2n - 3o + 9 for n. -3 Suppose h - 20 = -3h. Suppose hy = 10y. Solve 3k + 3b = 0, -k - 15 = -yk - 4b for k. -3 Suppose -5h + 20 = -5, v + h - 5 = 0. Suppose v = u - 3. Suppose l - 12 = -ul. Solve -lg + 18 = 5p - 12, -5g = -p - 22 for g. 5 Suppose -c + 5y = 12, 4y = -3c + 47 - 7. Let l be (-6)/4c/6. Let f be (2/6)/(l/(-18)). Solve -5w = -fh + 15, 2h - w = -0h + 3 for h. 0 Let m = 1 - -5. Solve -mo = -2w - o - 7, 5w - 4o = -9 for w. -1 Let f = -86 + 91. Solve 5o + 35 = fw, 5o - 4w = -18 - 12 for o. -2 Let l be (-24)/156 - 353/(-13). Solve 0 = 5g - 3q - l, 4g + q - 2 = 2g for g. 3 Let x = 45 - 38. Solve 2o - 2 = 2t, 0 = t + 3o - 2o + x for t. -4 Suppose 2b - 5b = -9. Let u be 1/(-3b/(-63)). Suppose uk - 28 = 3k. Solve kd - 4d + v = 13, -2d - 2v = -14 for d. 3 Suppose 0p - 4p - 5x = 7, 5x - 20 = 5p. Let b(z) = 2z2 + 5z + 3. Let c be b(p). Solve 0 = -0i + 2i - 2r + c, -5i = -2r + 6 for i. 0 Let y(f) = f2 - 1. Let s(o) = -o3 + 5o*2 + 6o - 2. Let x be s(6). Let n be y(x). Solve -3t = 4v + 9, t + 1 = -nv - 2 for v. 0 Let m = -7 + 11. Solve 3y + 8 + 7 = -mn, 4y + 5n = -20 for y. -5 Let n be 34/14 + (-12)/28. Suppose 4 = -nu - 4c, 4u + 0u - 4c = 4. Solve -3a + 4x + 31 = u, 2x = -a - 0a - 3 for a. 5 Let i be 7 - (-2 + 2)/(-2). Suppose 4l = 9l + 20. Let m be (l -	{ "pile_set_name": "DM Mathematics" }
z + 3 = -n. Does 7 divide x(n)? True Let f(x) = 3x3 - 45x*2 + 19x - 149. Is f(15) a multiple of 8? True Is 6 a factor of (12/(-7))/((-46)/2737)? True Let v(i) = -1 - 3 + 11 + 57i3 - 11 + 3. Let a = 3 + -2. Is 15 a factor of v(a)? False Suppose 8p - 7p - 2 = 0. Suppose -4m + 3i = -363, i + 3i - 154 = -pm. Is m a multiple of 13? False Suppose -53106 = -12y - 14514. Is 48 a factor of y? True Suppose 3g = -l + 8g + 57, 4g = 2l - 90. Does 17 divide l? False Suppose 4t - 3b = 957, -6b + 15 = -3b. Does 27 divide t? True Let c(o) be the first derivative of o*2/2 + o + 6. Let a be c(4). Suppose -3u = ai - 2u - 159, 5i - u - 161 = 0. Is i a multiple of 8? True Let w = 52 + -60. Let q = 64 - w. Does 8 divide q? True Suppose 0s = -2s - 16. Let z be s/(-20) + 568/5. Suppose 0 = -3d + 5d - z. Is d a multiple of 19? True Suppose 51m - 10m - 61131 = 0. Is m a multiple of 96? False Let q = 669 + -444. Is q a multiple of 15? True Let s(i) = 0 - i - 2 + 2i*2 + 5i. Let c = -80 + 76. Does 14 divide s(c)? True Let z be -13 + (-4 - 1/(-1)). Does 19 divide (52/(-3))/(z/24)? False Let j = 730 - -830. Is j a multiple of 78? True Suppose z - 4 + 1 = 0. Suppose 0 = -6u + zu + 126. Is 14 a factor of u? True Suppose 0 = 6a - 4a - f - 2, 4a - f = 8. Suppose aq + 4t = q + 166, -4t = -5q + 429. Is 24 a factor of q? False Suppose 0 = 4c - 3c - 2, 2c = -5r - 6. Let n(v) = 2v*2 + 2v. Is n(r) a multiple of 3? False Suppose -3q + 6 = 0, q - 170 = n - 3n. Suppose 2r - 5j = 70, 0 = 4r - j + 5j - n. Does 25 divide r? True Let m(l) = -9l3 + 2l*2 + 2l*2 + 5l*2 + 10 + 8l3. Let x be (-61)/(-7) - 2/(-7). Is m(x) a multiple of 3? False Let q(p) = -p2 + 10p - 7. Let b = -51 + 55. Does 17 divide q(b)? True Let s be (-10)/(-45) + 388/36. Suppose 0 = sj - 12j + 29. Does 4 divide j? False Suppose w = -5y - 29, 3w = 4y + 8 - 0. Let i(q) = -44q - 2. Is 52 a factor of i(y)? False Let w(p) = -2p + 8. Suppose -12 = 3j + 3k + 3, 3k + 3 = -j. Let u be w(j). Suppose 3c - 20 = f, -u = -0f + 4f. Does 2 divide c? False Let o(r) = 3r3 + r + 1. Let d be o(2). Suppose -d - 27 = -y. Is 19 a factor of y? False Let j = 7 + -6. Let f be (-1 + j)/(-4 + 3). Suppose 36 = 2s - fs. Does 12 divide s? False Let f(o) be the first derivative of -o2/2 - 9o - 5. Let y be f(-9). Suppose ym = -m + 23. Is m a multiple of 23? True Let s(w) = w3 - 4w*2 + 6w - 6. Let g be 7 - (-1 - 3 - -7). Is s(g) a multiple of 8? False Suppose -b = 2b + s - 1, 5s = -25. Suppose 0 = 6t - t - 5l - 135, 0 = -bt + 4l + 44. Is 8 a factor of t? True Let r = 22 + -19. Suppose ro = 5 - 11. Let m(w) = -w3 - w2 - w + 2. Is m(o) even? True Suppose -13 = 3q - 5x - 75, -3x + 54 = 2q. Let t = 51 - q. Is (t/2)/((-7)/(-28)) a multiple of 9? True Suppose -15l + 1387 = 3m - 13l, 4m - l = 1831. Is 19 a factor of m? False Suppose -14d + 10d - 1596 = 0. Let t = d - -586. Is 17 a factor of t? True Suppose 0 = 4s, 2h = -0s - 4s - 820. Let w be h/(-18) - 4/(-18). Suppose -5g + w + 2 = 0. Does 5 divide g? True Is 12 a factor of 21/(-2)(-3072)/48? True Does 4 divide ((-432)/30)/((16/(-20))/2)? True Let u(w) = -8w*3 - 23w*2 - 4w + 29. Let z(v) = 3v3 + 8v*2 + v - 10. Let i(a) = 4u(a) + 11z(a). Does 6 divide i(6)? True Suppose -d + 5h = -202, -5d + 944 = -3h - 0h. Suppose -5s - 3f + 206 = 0, 4s = 3f + 2f + d. Is 20 a factor of 9/(-2 + s/20)? True Suppose 4 = l - 1, g - 4l - 50 = 0. Suppose -3p + 7 = -2. Suppose 5r - g = -4k + 207, -pk + 209 = 4r. Is k a multiple of 15? False Let y be (-17)/(4/(-4 - -16)). Let r = y + 133. Does 19 divide r? False Let a(g) = g*2 + 5g - 1. Let q be a(-6). Suppose 329 = qi - 546. Is i a multiple of 35? True Let i be -2 + ((-6)/(-1) - 2). Suppose 0 = ix + 2 - 14. Is x a multiple of 4? False Let k = 115 + -61. Let w = -110 + 87. Let a = w + k. Does 8 divide a? False Suppose w + 24 = -3w. Let y = w + -8. Is (-318)/y - (-4)/14 a multiple of 23? True Let i(c) = 11c*3 + 3c*2 - 12c + 4. Does 31 divide i(2)? False Suppose -6i + 1053 = 7i. Is i a multiple of 7? False Let c(b) = b*2 + 5b - 1. Let m be c(-6). Suppose mx = -5n - 30, -5x - 18 - 4 = 3n. Is 12 a factor of 224/6 - n/(-12)? False Let f be (2 + 0 + -2)/2. Suppose -2u + 5a = -fu - 57, 5u - 96 = -3a. Is u a multiple of 13? False Suppose 4 = -f + 6. Does 3 divide (-8575)/(-315) - (4/9)/f? True Suppose 11c + 897 = 3207. Is c a multiple of 21? True Suppose -12a - 565 = -1885. Does 11 divide a? True Suppose -5v = q - 11376, -q - 9095 = -4v + 4q. Does 35 divide v? True Let o(t) = 271t + 68. Is 19 a factor of o(13)? True Suppose 0 = 12g - 3218 + 998. Let b = -113 + g. Is b a multiple of 12? True Let g = -536 - -2834. Is g a multiple of 60? False Does 3 divide (-27)/(((-1)/(-1))/(-3))? True Let s = 131 - -198. Suppose -2t + s = 5t. Is t a multiple of 5? False Let y = -90 - -86. Let r = 101 - y. Is 21 a factor of r? True Suppose -73440 = -75w + 39w. Is w a multiple of 34? True Suppose 4i = -2d + 4, 4d = 3i - 2i + 17. Let z be 24/(-36) - (2 - 29/3). Let l = i + z. Does 6 divide l? True Suppose -776 = -2a + j, -3j - 2j + 1190 = 3a. Is a a multiple of 33? False Let w(x) = 42x + 13. Let h be w(6). Let o = h + -166. Does 11 divide o? True Let d = -9 + 9. Let l be (d - 2) + -2 + 4. Suppose -k - g + 63 = 4k, l = 4k + 3g - 46. Is 13 a factor of k? True Let f = -3 + 8. Let k = 107 + f. Is k a multiple of 28? True Let o be (390/(-52))/((-6)/92). Let p = 160 - o. Is 14 a factor of p? False Let r = 284 + -223. Is r even? False Let q = -12 + 13. Let y(z) = 5 - 15z - q + 0 + 4. Does 17 divide y(-4)? True Suppose 7d + 12 = 985. Is d a multiple of 5? False Let w = -326 - -208. Let y = w + -44. Is y/(-5) + (-6)/(-10) a multiple of 11? True Let b = 1132 - 175. Is b a multiple of 87? True Is 9 a factor of ((-21)/1)/(1/21-1)? True Let h(l) = 8l3 + 83l*2 - 81l*2 + 8l*3. Let y be h(2). Suppose o = -3o + y. Does 10 divide o? False Suppose u - 156 = -5t, 2u = -4t + 3t + 24. Let a = 47 - t. Suppose 71 - a = 4o. Is o a multiple of 6? False Let r(k) be the first derivative of k4/4 + 6k*3 + 15k*2/2 + 11k - 5. Let f be 153/184/(-2). Is r(f) a multiple of 15? True Let f(s) = -3s + 53. Let g be f(16). Is (-288)/(-15) - 1/g a multiple of 4? False Let h be 2838/48 + 2/(-16). Suppose -98 = 57f - hf. Is 49 a factor of f? True Let u(o) = -o + 7. Let s be u(7). Suppose 2q + 251 = 4l - 3q, s = -2l + 5q + 123. Suppose -7c = 2j - 3c - l, 0 = -5j + c + 160. Is 16 a factor of j? True Suppose -23 = 11o - 10o. Let u = o - -25. Suppose 0 = un - 12. Is 3 a factor of n? True Suppose -2 = -0n - 2n. Let x(k) = 100k + 1. Let s be x(n). Suppose -s - 155 = -4o. Does 16 divide o? True Let j = 1446 - -885. Is j a multiple of 21? True Let u(b) = b + 2. Let i be u(6). Suppose -is = -2s - 192. Is 9 a factor of s? False Let n(d) = 7d - 14 + 2d + 27d2 + 2d - 24d2. Is 25 a factor of n(5)? False Let s be 6(9/6 + -3). Let c = s - -66. Does 11 divide c? False Suppose -4g + 3 = 3v - 25, -3v + 3g + 42 = 0. Suppose 0 = 2x - v + 6. Suppose -f = -68 + x. Is 22 a factor of f? False Let c(f) = -f + 21. Let o be c(0). Let q = 40 - o. Is q a multiple of 3? False Suppose 6p + 13 = 5s + 3p, 0 = 5s + p - 29. Suppose 4h = -3k + 440, sh - 4k - 523 = -k. Is 20 a factor of h? False Let o(t) = -48t3 - t2. Let l be o(-1). Let c be 2((-335)/(-10) - -1). Let i = c - l. Does 8 divide i? False Let d = 790 - 580. Is 14 a factor of d? True Let o be (-6)/4 - 1034/(-4). Let i = o - 487. Is -2 + 2 - i/5 a multiple of 23? True Let k = 14441 + -4411. Does 9 divide k/110 + 2/(-11)? False Let b(z) = z3 + z + 1. Let l(w) = -12w*3 - 5w - 7. Let c(v) = v*2 + 9v + 1. Let u be c(-9). Let s(k) = ul(k) + 5b(k). Is s(-2) a multiple of 10? False Let s(q) = 65q - 428. Does 9 divide s(14)? False Let n = -564 + 335. Let l = -62 - n. Is 43 a factor of l? False Suppose 4r + 885 = 3461. Does 14 divide r? True Let y(n) = -52n. Let z be y(-2). Let a = -54 + z. Suppose 0 = -2r - 0r - 4u + a, 0 = -3r + u + 75. Is 11 a factor of r? False Suppose -30d + 26d = 2o - 2824, -16 = -4*o. Is d a multiple of 14? False Let m be	{ "pile_set_name": "DM Mathematics" }
p. Suppose d(h) = 0. What is h? 2, 3, 17 Let z be 8/(-5)(-65)/26. What is u in -10 + 25u*z + 13u*3 - 32u*3 + 14u*3 - 75u*2 + 65u = 0? -2, 1/5, 1 Let 16562/9y3 + 32/9 - 968/3y + 7280y2 = 0. What is y? -4, 2/91 Factor -1/7h*2 - 11/7h + 60/7. -(h - 4)(h + 15)/7 Let r(m) be the second derivative of 2m*7/63 - 16m*6/45 + 22m*5/15 - 8m*4/3 + 2m*3 - 566m - 1. Find z such that r(z) = 0. 0, 1, 3 Let g(m) be the second derivative of -m*4/6 - 21m*3 - 62m*2 - 478m. Factor g(r). -2(r + 1)(r + 62) Suppose 0 = 652a - 676a. Let z(t) be the second derivative of 1/30t4 + a + 0t*2 + 4/15t*3 - 6t. Suppose z(v) = 0. Calculate v. -4, 0 Suppose -n + 5 = 3w, 5n - 2 = w - 9. Suppose 17lw + 4l - 7l - l3 - 81 - 60l = 0. What is l? -1, 9 Suppose -27038r2 - 27041r*2 - 164r + 54077r2 + 336 = 0. What is r? -84, 2 Let b(u) be the first derivative of -u4/6 + 18u*3 - 729u*2 + 137u - 210. Let g(f) be the first derivative of b(f). Suppose g(o) = 0. Calculate o. 27 Let g(f) = -187f3 + 370f*2 - 32f - 40. Let k(b) = -2060b3 + 4070b*2 - 355b - 440. Let j(m) = 45g(m) - 4k(m). Factor j(y). -5(y - 2)(5y - 2)(7y + 2) Factor 0 - 1/3p*3 + 1/3p - 2p2 + 2p*4. p(p - 1)(p + 1)(6p - 1)/3 What is m in -1/3m*2 + 27 - 80/3m = 0? -81, 1 Suppose 269d + 222d = 982. Determine f so that -75/4fd - 10f - 1 = 0. -2/5, -2/15 Let r(l) be the first derivative of -2/5l2 + 1/30l*6 + 3/20l*4 - 19 + 4/25l*5 - 4/15l*3 + 0l. Factor r(v). v(v - 1)(v + 1)(v + 2)2/5 Let o = 108 + -106. Factor -96s + 46s2 + 275 - 42s*o + 301. 4(s - 12)*2 Suppose 3d + 42 = 4r, 5d - 5r - 156 + 206 = 0. What is o in -37/4o*d - 5o*3 - 9/2o + 0 - 1/4o4 = 0? -18, -1, 0 What is t in 1230t + t*3 - 145t*2 - 130t*2 - 1230t = 0? 0, 275 Let f(d) be the first derivative of 14d + 38 - 1/3d*3 + 5/2d*2. Factor f(j). -(j - 7)(j + 2) Let h(r) be the first derivative of 19/30r5 + 3/4r*4 + 0r*3 + 0r*2 + 1/36r*6 + 0r - 203. Solve h(f) = 0 for f. -18, -1, 0 Let m(x) = 3x4 - x3 + x - 1. Let k(p) = -40p*4 + 4p*3 - 36p*2 + 130p + 14. Let o(j) = -2k(j) - 28m(j). Factor o(d). -4d(d - 6)(d - 3)(d + 4) Let h be 59/((-9027)/(-408))((-33)/44 + (-34)/(-16)). Let 35/3s*2 + hs*3 + 28/3s + 4/3 = 0. What is s? -2, -1, -2/11 Let p(q) = 12q - 12. Let w(v) be the third derivative of 0v + 0 + 0v3 + 1/60v*5 + 1/24v*4 - 15v*2. Let i(u) = 2p(u) - 4w(u). Factor i(j). -4(j - 3)(j - 2) Let i(p) be the first derivative of p7/1680 + 7p6/720 + p5/40 + 2p3 - 139. Let o(c) be the third derivative of i(c). Suppose o(z) = 0. Calculate z. -6, -1, 0 Suppose 0 = -l + 4, -5b + 16l + 22 = 14l. Determine z so that 6z + 5z*3 - bz*3 - 3z - z + 3z3 + 4z*2 = 0. -1, 0 Let q be -9(0 + 2/(-6)). Suppose 5k - 5z = 3k - 1, -z - 1 = -k. Suppose 3p*2 + 209p - 5p2 - 208p + 2p3 - 3p*q + k = 0. Calculate p. -2, -1, 1 Let b(o) be the second derivative of 137o*5/70 + 365o*4/7 + 289o*3/3 - 30o*2/7 + 1467o. Suppose b(l) = 0. Calculate l. -15, -1, 2/137 Let l(q) be the second derivative of -1/4q5 + 1 + 0q*2 - 750q*3 + 31q + 25q4. Factor l(j). -5j(j - 30)2 Let j be (((-1)/(-5))/((-288)/(-1080)))/((-18)/(-48)). Factor 5s + 16/3 - 1/3sj. -(s - 16)(s + 1)/3 Let a(j) = j*2 + 35j + 26. Let w(r) = 2r2 + 37r + 25. Let z = 28 + -33. Let b(h) = za(h) + 4w(h). Factor b(c). 3(c - 10)(c + 1) Factor 4/5j4 - 24/5j*2 + 32/5 - 16/5j + 4/5j3. 4(j - 2)(j - 1)(j + 2)*2/5 Let q(u) = 27905u + 195337. Let y be q(-7). Factor -1/4p2 + 1/4p*4 - yp + 0 + 2p3. p(p - 1)(p + 1)(p + 8)/4 Let u(a) be the third derivative of 1/3a3 - 1/240a*5 + 0 + 27a*2 + 0a + 7/96a4. Find c such that u(c) = 0. -1, 8 Let s(c) = 72c - 270. Let k be s(4). Find q such that 626 - 451 + 19q4 - 44q*3 + 564q*2 - kq*4 - 2525q + 765q + 1425 = 0. 2, 20 Let b(x) be the second derivative of x4/12 - 43x*3/6 + 176x*2 - 2582x. Suppose b(f) = 0. What is f? 11, 32 Suppose -48z = -50z + 32. Suppose 4l - 3p + p = z, -l = -p - 5. Factor 3b2 - 3b*3 + 0b - lb + b2 - 18 + 4b*3. (b - 2)(b + 3)*2 Let g = -968 + 984. Let p be (3 - 1)(-69)/(-3680)g. Factor 3/5n*2 - 18/5 + pn. 3(n - 2)(n + 3)/5 Let -120224 - 2/13b2 - 272b = 0. Calculate b. -884 Let b = 20/1407 - -755/1876. Let v(k) be the second derivative of 18k + 0k*2 + 0 - bk*4 + 5/6k*3. What is m in v(m) = 0? 0, 1 Let g(r) = -22r*4 - 27r*3 + 34r*2 + 5. Let b(k) = 4k4 - k3 - 1. Let y(v) = -5b(v) - g(v). Factor y(f). 2f*2(f - 1)(f + 17) Let c be (-2)/6 - (1029 + -1023 - 56/6). Factor 3/2r*c + 0r + 0 + 12r2. 3r*2(r + 8)/2 Let d be 1 - 4((-8)/(-4) - 34). Let q = -127 + d. Let -1/2g*3 - 15/2g + 9/2 + 7/2gq = 0. Calculate g. 1, 3 Solve -7f*2 + 4f*2 - 40f*2 + 2f*5 - 20f*2 - 17f*2 - 92f*3 - 10f4 = 0 for f. -4, -1, 0, 10 Let u(z) be the second derivative of z4/4 + 193z3 - 1161z*2/2 + 2929z. Factor u(g). 3(g - 1)(g + 387) Suppose -17c = -1144 + 1059. Suppose 2i - co = 19, 8o = 12o + 12. Solve 0 - 555/4q*4 - 6q + 15qi + 225/4q*5 + 93/2q*3 = 0 for q. -1/3, 0, 2/5, 2 Let l = 362419 + -362416. Factor -34/3 + 2/3j - 2/3jl + 34/3j*2. -2(j - 17)(j - 1)(j + 1)/3 Let s(f) be the second derivative of -5f7/28 + 21f*6/10 + 117f*5/40 - 14f*4 + 9f*3 + 3165f. Find c, given that s(c) = 0. -2, 0, 2/5, 1, 9 Let t(a) be the first derivative of 76/45a5 + 48 + 288a*3 + 1377a*2 + 1/27a*6 + 31a*4 + 2916a. Factor t(u). 2(u + 2)(u + 9)*4/9 Find s such that 44s - 1384s3 + 60s*2 + 80s + 126s + 1386s*3 = 0. -25, -5, 0 Let p(s) = -4s*3 + 20s*2 + 124s + 84. Let n(d) = 3d2 + 1. Let c(b) = 4n(b) + p(b). Factor c(w). -4(w - 11)(w + 1)(w + 2) Suppose 5z - 4p + 184 - 204 = 0, 5p = -z - 25. Factor z + 1/3m4 - 1/3m*5 + 0m*2 + 0m + 2/3m3. -m3(m - 2)(m + 1)/3 Let d = -264720 + 264722. Let -25n*3 - 65/2n*d + 150n - 5/2n4 - 90 = 0. What is n? -6, 1 Determine v, given that 2/3v*3 - 488/3v + 496/3 + 116/3v2 = 0. -62, 2 Let u(y) = -y3 + 10y*2 + 6y - 8. Let o be u(10). Factor 5s2 + 25s - 113s3 + 56s*3 + 15 + os*3. -5(s - 3)(s + 1)2 Solve 6 - 159b - 38 - 39 - 21b2 - 32 + 19 = 0. -7, -4/7 Let c be (-72)/(-33) + (-82)/451. Suppose 3g = 12, -3g + 17 = -s + cg. Find p such that -3/5p2 + 0 + 0p - 3/5ps = 0. -1, 0 Let o(q) be the first derivative of q5/80 - 3q4/16 + q3 - 197q2/2 + 241. Let v(x) be the second derivative of o(x). Solve v(w) = 0 for w. 2, 4 Let x = 70355 + -211010/3. Solve -25/6u*2 + 0 + 35/3u - xu3 - 5/2u4 = 0. -7, -1, 0, 2/3 Let k(n) be the second derivative of -n4/3 - 10n3 + 68n*2 + 8n + 11. Factor k(a). -4(a - 2)(a + 17) Let k(q) be the first derivative of -q*4/6 + 128q*3/9 - 1045q*2/3 + 3388q + 1955. Factor k(z). -2(z - 42)(z - 11)*2/3 Let v(a) be the second derivative of -a - 1/9a*4 - 5 + 0a*3 + 6a*2. Let v(r) = 0. What is r? -3, 3 Let v(w) be the first derivative of -2w*3/21 + 804w*2/7 - 323208w/7 - 2406. Find u, given that v(u) = 0. 402 Find i such that 340/3i - 25i*2 + 5/3i*3 - 160 = 0. 3, 4, 8 Let r(g) be the first derivative of 0g*3 + 23 - 2g + 0g2 + 1/6g*4. Let m(i) be the first derivative of r(i). Solve m(u) = 0. 0 Let k(j) be the first derivative of 8/3j*3 + 1/3j*4 - 63 + 32/3j - 10j2. Factor k(m). 4(m - 1)*2(m + 8)/3 Suppose -63n = 4n - 6n + 14n. Find h, given that n + 2/3h4 + 6h - 6h2 - 2/3h*3 = 0. -3, 0, 1, 3 Factor 673x*2 + 5/3x*3 + 67872x - 40804/3. (x + 202)*2(5x - 1)/3 Let l(b) be the third derivative of 1/3192b*8 - 1/1995b*7 - 5/114b*4 + 40b*2 + 0 + 0b - 1/76b6 - 23/570b*5 + 0b*3. Let l(f) = 0. Calculate f. -2, -1, 0, 5 Factor -1616 + 144k*2 + 1208 + 307k*3 - 150k*3 + 260k - 153k3. 4(k - 1)(k + 3)(k + 34) Let s be 2119/(-652) + 21/4. Find m, given that -8/5m + 2/5m*s + 8/5 = 0. 2 Let z(w) = 7w*5 - 2w*4 + 9w*3 - 3w. Let t(y) = -9y5 + y4 - 10y*3 + 4y. Let q(o) = 3t(o) + 4z(o). Let q(m) = 0. Calculate m. 0, 2, 3 Let h = -79 - -81. Suppose 3*m	{ "pile_set_name": "DM Mathematics" }
en 11:05 PM and 1:30 AM? 145 How many minutes are there between 3:03 PM and 5:50 PM? 167 What is 508 minutes before 9:15 AM? 12:47 AM How many minutes are there between 7:12 PM and 11:51 PM? 279 How many minutes are there between 7:43 PM and 7:27 AM? 704 How many minutes are there between 4:35 PM and 2:03 AM? 568 How many minutes are there between 11:43 PM and 7:48 AM? 485 What is 235 minutes after 5:31 PM? 9:26 PM How many minutes are there between 1:55 AM and 8:39 AM? 404 What is 631 minutes before 10:53 AM? 12:22 AM How many minutes are there between 2:46 AM and 2:04 PM? 678 How many minutes are there between 6:57 PM and 2:16 AM? 439 How many minutes are there between 10:58 PM and 4:30 AM? 332 What is 158 minutes after 9:27 AM? 12:05 PM What is 38 minutes after 1:36 PM? 2:14 PM How many minutes are there between 5:58 PM and 4:26 AM? 628 What is 292 minutes after 5:11 AM? 10:03 AM How many minutes are there between 7:06 AM and 9:42 AM? 156 What is 127 minutes after 10:03 AM? 12:10 PM What is 303 minutes before 10:36 AM? 5:33 AM What is 559 minutes after 8:53 AM? 6:12 PM What is 51 minutes after 1:40 AM? 2:31 AM What is 203 minutes after 5:50 PM? 9:13 PM What is 104 minutes before 11:51 AM? 10:07 AM How many minutes are there between 6:35 AM and 1:38 PM? 423 How many minutes are there between 7:16 AM and 8:52 AM? 96 How many minutes are there between 12:36 PM and 10:23 PM? 587 How many minutes are there between 5:46 PM and 1:39 AM? 473 How many minutes are there between 12:37 AM and 5:57 AM? 320 What is 657 minutes after 6:59 PM? 5:56 AM How many minutes are there between 4:31 AM and 2:03 PM? 572 What is 172 minutes before 11:38 PM? 8:46 PM What is 556 minutes before 2:57 AM? 5:41 PM What is 568 minutes after 4:51 AM? 2:19 PM How many minutes are there between 4:07 PM and 3:27 AM? 680 What is 568 minutes before 12:29 PM? 3:01 AM What is 553 minutes before 7:59 PM? 10:46 AM How many minutes are there between 1:31 AM and 1:43 AM? 12 How many minutes are there between 12:25 AM and 4:40 AM? 255 How many minutes are there between 7:27 PM and 3:21 AM? 474 How many minutes are there between 8:53 PM and 8:21 AM? 688 What is 456 minutes before 1:51 AM? 6:15 PM How many minutes are there between 2:22 AM and 11:40 AM? 558 How many minutes are there between 2:05 PM and 4:12 PM? 127 How many minutes are there between 3:36 AM and 5:17 AM? 101 How many minutes are there between 9:04 PM and 2:31 AM? 327 What is 170 minutes after 5:50 AM? 8:40 AM What is 48 minutes after 6:35 PM? 7:23 PM How many minutes are there between 10:23 AM and 6:01 PM? 458 What is 123 minutes after 12:08 AM? 2:11 AM What is 609 minutes after 3:44 AM? 1:53 PM What is 145 minutes before 6:54 PM? 4:29 PM What is 706 minutes after 6:43 PM? 6:29 AM How many minutes are there between 1:23 PM and 3:51 PM? 148 What is 286 minutes after 6:29 PM? 11:15 PM How many minutes are there between 5:36 AM and 1:46 PM? 490 How many minutes are there between 3:17 AM and 3:16 PM? 719 What is 69 minutes after 11:10 PM? 12:19 AM What is 552 minutes before 5:09 AM? 7:57 PM What is 693 minutes after 1:32 AM? 1:05 PM What is 589 minutes before 5:47 PM? 7:58 AM How many minutes are there between 1:55 PM and 5:06 PM? 191 What is 283 minutes after 3:22 AM? 8:05 AM What is 176 minutes after 7:01 PM? 9:57 PM What is 453 minutes before 11:15 AM? 3:42 AM How many minutes are there between 6:31 AM and 7:38 AM? 67 How many minutes are there between 11:36 PM and 5:00 AM? 324 What is 40 minutes after 2:49 AM? 3:29 AM What is 705 minutes after 2:27 AM? 2:12 PM How many minutes are there between 6:30 AM and 2:08 PM? 458 What is 401 minutes before 5:44 PM? 11:03 AM How many minutes are there between 5:40 PM and 6:31 PM? 51 What is 520 minutes before 8:24 AM? 11:44 PM What is 664 minutes after 3:44 AM? 2:48 PM What is 209 minutes after 1:51 PM? 5:20 PM How many minutes are there between 9:15 AM and 7:45 PM? 630 How many minutes are there between 3:26 PM and 7:17 PM? 231 What is 490 minutes after 8:41 PM? 4:51 AM How many minutes are there between 1:34 AM and 3:03 AM? 89 How many minutes are there between 11:09 AM and 12:41 PM? 92 How many minutes are there between 3:47 AM and 5:24 AM? 97 How many minutes are there between 8:56 PM and 12:10 AM? 194 What is 266 minutes before 4:19 PM? 11:53 AM What is 398 minutes before 7:03 AM? 12:25 AM What is 445 minutes after 11:42 AM? 7:07 PM What is 624 minutes after 2:13 AM? 12:37 PM How many minutes are there between 11:55 AM and 7:23 PM? 448 How many minutes are there between 4:24 AM and 9:41 AM? 317 What is 240 minutes before 12:31 AM? 8:31 PM What is 676 minutes after 2:08 AM? 1:24 PM How many minutes are there between 7:00 AM and 2:54 PM? 474 What is 408 minutes after 5:07 AM? 11:55 AM How many minutes are there between 10:26 PM and 10:51 PM? 25 What is 647 minutes after 2:06 AM? 12:53 PM How many minutes are there between 4:20 PM and 4:31 PM? 11 How many minutes are there between 8:38 AM and 3:12 PM? 394 How many minutes are there between 8:22 AM and 2:17 PM? 355 What is 373 minutes before 3:49 AM? 9:36 PM How many minutes are there between 6:07 PM and 4:35 AM? 628 What is 719 minutes after 11:20 AM? 11:19 PM How many minutes are there between 9:54 AM and 4:50 PM? 416 How many minutes are there between 3:52 AM and 7:55 AM? 243 How many minutes are there between 2:35 AM and 4:51 AM? 136 How many minutes are there between 8:58 PM and 5:19 AM? 501 What is 318 minutes after 8:51 PM? 2:09 AM What is 172 minutes before 2:44 PM? 11:52 AM How many minutes are there between 4:50 PM and 5:30 PM? 40 How many minutes are there between 2:29 PM and 10:53 PM? 504 What is 317 minutes before 9:27 AM? 4:10 AM How many minutes are there between 4:45 PM and 11:46 PM? 421 What is 327 minutes before 3:03 PM? 9:36 AM How many minutes are there between 6:54 AM and 4:10 PM? 556 What is 386 minutes after 3:47 AM? 10:13 AM What is 386 minutes after 11:19 PM? 5:45 AM What is 10 minutes before 7:15 AM? 7:05 AM How many minutes are there between 4:25 PM and 11:13 PM? 408 How many minutes are there between 11:30 AM and 2:41 PM? 191 What is 166 minutes before 12:19 AM? 9:33 PM How many minutes are there between 3:42 AM and 2:09 PM? 627 How many minutes are there between 3:24 PM and 7:28 PM? 244 What is 69 minutes after 3:28 AM? 4:37 AM What is 286 minutes after 7:08 AM? 11:54 AM How many minutes are there between 12:19 AM and 2:34 AM? 135 What is 160 minutes after 8:56 PM? 11:36 PM What is 572 minutes before 6:29 PM? 8:57 AM How many minutes are there between 8:38 PM and 10:00 PM? 82 What is 103 minutes after 4:05 AM? 5:48 AM What is 488 minutes after 5:37 PM? 1:45 AM How many minutes are there between 6:29 PM and 5:56 AM? 687 What is 714 minutes after 7:59 AM? 7:53 PM What is 581 minutes before 1:16 AM? 3:35 PM How many minutes are there between 10:36 PM and 8:24 AM? 588 How many minutes are there between 8:37 PM and 6:48 AM? 611 What is 657 minutes before 2:11 AM? 3:14 PM What is 173 minutes after 8:33 AM? 11:26 AM What is 547 minutes before 11:38 PM? 2:31 PM What is 274 minutes after 7:30 AM? 12:04 PM How many minutes are there between 5:41 PM and 5:24 AM? 703 What is 139 minutes after 5:32 PM? 7:51 PM How many minutes are there between 5:29 PM and 9:40 PM? 251 How many minutes are there between 11:38 AM and 4:41 PM? 303 How many minutes are there between 12:33 AM and 1:15 AM? 42 How many minutes are there between 2:49 PM and 6:59 PM? 250 What is 139 minutes before 3:38 AM? 1:19 AM How many minutes are there between 4:46 AM and 5:22 AM? 36 How many minutes are there between 2:47 PM and 4:24 PM? 97 What is 418 minutes before 1:16 AM? 6:18 PM How many minutes are there between 8:36 PM and 3:34 AM? 418 What is 691 minutes before 7:27 AM? 7:56 PM What is 250 minutes after 1:15 PM? 5:25 PM What is 327 minutes before 8:42 PM? 3:15 PM What is 647 minutes before 6:51 AM? 8:04 PM How many minutes are there between 1:54 AM and 7:48 AM? 354 How many minutes are there between 7:18 PM and 6:21 AM? 663 How many minutes are there between 7:53 AM and 3:54 PM? 481 How many minutes are there between 10:20 PM and 2:44 AM? 264 What is 517 minutes after 4:09 AM? 12:46 PM What is 337 minutes before 2:48 PM? 9:11 AM How many m	{ "pile_set_name": "DM Mathematics" }
c*2 - 120c + 17. Give h(7). 10 Let r(q) = 2q - 90. Determine r(14). -62 Let z(n) = n2 + 62n + 726. Determine z(-32). -234 Let v(h) = h*3 - 29h*2 - 8h + 132. Give v(29). -100 Let r(h) = -h*3 + 60h*2 - 893h + 24799. Give r(52). -5 Let j(c) = 2c2 - 71c + 201. Give j(32). -23 Let y(r) = -r*3 + 36r*2 + 51r - 1828. Determine y(36). 8 Let y(h) = -h*2 + 13h - 246. Calculate y(6). -204 Let b(k) = 18k3 + 2k*2 - 3k - 6. What is b(2)? 140 Let y(i) = -5i2 - 24i + 6. Calculate y(-6). -30 Let k(u) = -17u2 - 444u - 39. What is k(-26)? 13 Let i(q) = -3q2 + 28q + 65. What is i(-2)? -3 Let o(l) = 2l3 + 165l*2 - 80l + 20. What is o(-83)? -229 Let b(g) = -176g - 3703. Determine b(-21). -7 Let k(m) = 11m*2 - 4m + 28. Determine k(4). 188 Let a(u) = u*2 + 10u + 15. Determine a(0). 15 Let m(q) = -108q2 + 1391q + 185. What is m(13)? 16 Let v(w) = -64w3 - 5w + 5. What is v(1)? -64 Let g(x) = 19x + 196. What is g(-34)? -450 Let j(m) = -m3 - 94m*2 - 188m - 357. Determine j(-92). 11 Let j(b) = b*3 - 34b*2 - 239b - 34. What is j(40)? 6 Let f(r) = r*2 - 17r - 39. What is f(-19)? 645 Let v(u) = u3 - u2 - 29u + 185. What is v(0)? 185 Let d(f) = f2 - 28f + 116. What is d(26)? 64 Let t(k) = 100k2 + 19k - 20. Calculate t(1). 99 Let z(x) = 55x - 626. What is z(16)? 254 Let i(k) = -k3 - 8k*2 + 85k + 16. Calculate i(-14). 2 Let w(l) = l*3 - 10l*2 + 24l - 41. Calculate w(8). 23 Let i(h) = 28152h - 28146. Determine i(1). 6 Let p(r) = -r3 - 10r*2 - 27r - 120. Give p(-6). -102 Let t(w) = w*3 + 10w*2 + 68w + 540. Give t(-9). 9 Let s(h) = 141h + 482. Calculate s(-3). 59 Let q(v) = -1515v - 40911. Give q(-27). -6 Let h(f) = 15f2 - 397f - 208. What is h(27)? 8 Let p(a) = -108a + 2048. What is p(19)? -4 Let m(r) = -r3 - 2r*2 + 8r - 18. What is m(2)? -18 Let r(x) = 6x2 - 85x + 290. Give r(10). 40 Let p(z) = -z*2 - 48z - 527. Determine p(-28). 33 Let w(a) = 3a3 + 28a*2 - 62a - 74. Calculate w(-11). 3 Let c(n) = 2n3 - 54n*2 - 250n + 66. Determine c(31). 4 Let t(g) = -g*2 + 29g + 208. Determine t(35). -2 Let j(m) = 770m - 16185. Calculate j(21). -15 Let f(u) = 12u*2 - 45u - 159. Calculate f(6). 3 Let w(i) = -i*3 + 16i*2 - 4i + 62. Calculate w(16). -2 Let r(u) = -u*3 - 12u*2 - 3u + 15. Give r(-12). 51 Let f(m) = -153m - 40399. Give f(-264). -7 Let l(q) = 2q*3 - 17q*2 + 369q - 2882. Calculate l(8). 6 Let g(s) = 2s3 - 86s*2 + 869s - 91. Calculate g(16). -11 Let p(n) = 315n - 71836. Calculate p(228). -16 Let r(h) = -h3 + 2h*2 - 18h + 93. Give r(4). -11 Let j(n) = 45020n + 4. Determine j(0). 4 Let v(q) = 599q + 16168. What is v(-27)? -5 Let q(h) = -2h3 + 20h*2 + 529h + 7. Determine q(-12). -5 Let o(d) = d*2 - 38d - 257. Calculate o(-6). 7 Let w(u) = -47u - 1241. Determine w(-26). -19 Let p(o) = 5o*3 - 51o*2 + 69o - 603. What is p(10)? -13 Let f(t) = 120t - 5045. Determine f(42). -5 Let q(i) = -i3 - 23i*2 - 36i + 139. Determine q(-21). 13 Let q(i) = -1013i + 12111. Give q(12). -45 Let s(v) = -6v + 114. What is s(21)? -12 Let f(l) = -63l - 1108. Give f(-15). -163 Let b(t) = t3 - 20t*2 - 92t - 56. What is b(24)? 40 Let v(m) = 126m - 8456. What is v(67)? -14 Let y(f) = -2f*3 - 12f*2 - 143f - 1402. Calculate y(-8). -2 Let f(s) = -s*3 - 2s*2 - 16s + 19. What is f(5)? -236 Let a(b) = -2b2 - 57b + 415. Give a(6). 1 Let s(z) = 205z - 38338. Give s(187). -3 Let p(a) = 1187a + 47485. Determine p(-40). 5 Let o(z) = -2z2 - 49z + 129. Calculate o(3). -36 Let u(j) = 14j + 310. Determine u(-23). -12 Let w(b) = -2b - 218. Give w(-8). -202 Let p(u) = 3u3 - 19u2 - u - 27. Give p(6). -69 Let g(t) = -t2 + 58t + 1442. Determine g(-19). -21 Let m(a) = 262a - 518. Calculate m(2). 6 Let h(i) = 996i - 9. Calculate h(0). -9 Let b(q) = 72q - 245. Determine b(3). -29 Let w(p) = -42p + 112. Give w(-2). 196 Let n(a) = -99a - 986. Give n(-10). 4 Let s(r) = r*2 + 2r + 31. Give s(-5). 46 Let x(y) = 17y2 + 8y - 20. Give x(2). 64 Let t(p) = p*3 + 18p*2 + 29p + 9. Calculate t(-16). 57 Let v(d) = -d*3 - 35d*2 + 37d - 78. Calculate v(-36). -114 Let i(q) = 151q + 2293. Give i(-15). 28 Let h(w) = 2w*3 - 36w*2 - 38w - 11. Calculate h(19). -11 Let r(z) = 108z - 1929. Determine r(21). 339 Let i(x) = -2x*3 + 56x*2 - 23x + 2335. What is i(29)? -14 Let q(j) = 1196j + 22729. What is q(-19)? 5 Let r(q) = q2 + 10q + 68. Determine r(-5). 43 Let d(m) = 3m3 - 299m*2 + 1065m - 872. Give d(96). -8 Let t(i) = -i*3 - 25i*2 + 206i + 134. Calculate t(7). 8 Let i(u) = -13u + 881. What is i(75)? -94 Let u(c) = 843c + 2521. Determine u(-3). -8 Let t(n) = -n*3 + 13n*2 - 687n + 8088. Calculate t(12). -12 Let o(p) = -p*2 - 2p + 247. Calculate o(-16). 23 Let z(x) = -22x - 677. Determine z(-31). 5 Let q(r) = -2r*3 + 17r*2 - 27r + 1. Give q(5). 41 Let q(u) = 202u - 190. Give q(1). 12 Let j(w) = -8w*2 + 186w - 23. Give j(26). -595 Let h(u) = u*2 + 9u - 145. What is h(-18)? 17 Let j(t) = -3t2 + 2t + 374. Calculate j(-11). -11 Let j(c) = -2c2 - 121c + 2820. Determine j(18). -6 Let x(v) = -v*3 - 9v*2 + 17v + 139. What is x(-10)? 69 Let o(v) = 728v + 11667. What is o(-16)? 19 Let f(n) = 2n*2 - 125n - 146. Calculate f(64). 46 Let q(l) = l*3 + 4l*2 + 30l - 39. Give q(8). 969 Let t(l) = l*2 + 12l - 293. What is t(-22)? -73 Let x(f) = -f*2 + 4f + 675. Give x(-27). -162 Let o(s) = -9s2 + 87s - 45. Determine o(9). 9 Let r(m) = -m*3 + 13m2 - m + 27. Give r(13). 14 Let p(g) = -g3 - 11g2 + 37g - 16. Give p(3). -31 Let w(y) = -2y3 - 54y*2 - 98y + 43. Give w(-25). -7 Let u(v) = 13v + 246. Give u(-32). -170 Let v(i) = 3i*3 + 8i*2 - 7i + 17. What is v(-7)? -571 Let x(m) = 2m2 + 453m - 1369. What is x(3)? 8 Let m(x) = -16x + 70. Determine m(3). 22 Let z(s) = 165s*2 + 15s - 14. Determine z(1). 166 Let d(m) = -86m + 907. Give d(13). -211 Let p(y) = y3 - 20y*2 + 12y + 28. Give p(20). 268 Let f(u) = -u3 + u2 + 12u - 63. Calculate f(6). -171 Let b(g) = -g2 - 24g - 125. What is b(-20)? -45 Let c(m) = -m + 32. Determine c(38). -6 Let v(n) = n*3 + 4n*2 - 515n - 3015. Give v(-6). 3 Let b(k) = k*2 - 6k - 18. Give b(7). -11 Let b(s) = 2s + 320. Calculate b(-156). 8 Let h(s) = -23s - 72. Determine h(0). -72 Let c(x) = -x*3 - 14x*2 + 58x + 106. Calculate c(-17). -13 Let l(m) = -m*3 + 23m*2 + 11m. Determine l(23). 253 Let j(q) = -9q3 + 7q*2 - 11q + 8. Give j(1). -5 Let b(r) = 6r2 - 147r - 232. Give b(26). 2 Let w(f) = -3f2 + 3f + 84. Determine w(-9). -186 Let k(t) = -184t. Give k(-1). 184 Let p(f) = f3 + 21f*2 - 313f - 6146. Calculate p(-23). -5 Let p(i) = i*3 - 14i - 34. Give p(-3). -19 Let j(x) = 5x2 - 6x - 18. Give j(-6). 198 Let d(q) = 69q - 1210. What is d(15)? -175 Let v(o) = -o + 485. Give v(-15). 500 Let b(m) = 72m + 4170. Give b(-57). 66 Let j(a) = 407a - 3626. Give j(9). 37 Let j(w) = -2w*3 + 103w*2 - 1184w - 204. Determine j(34). 0 Let x(q) = -665q - 5983. What is x(-9)? 2 Let l(j) = 31j - 1350. Determine l(43). -17 Let i(o) = -o*2 + 4o + 571. What is i(26)? -1 Let m(p) = -10p + 302. Give m(26). 42 Let r(p) = 2p*2 - 130p - 765. Determine r(70). -65 Let k(i) = -i*2 + 10i + 350. Give k(26). -66 Let u(c) = c*3 + 30c*2 + 46c + 273. Calculate u(-29). -220 Let m(a) = 5a2 - 469a + 1280. Determine m(91). 6 Let y(m) = -44m - 2151. What is y(-49)? 5 Let d(l) = l3 - 45l*2 + 436l - 45. What is d(31)? 17 Let k(j) = 98j3 - j2 - j - 1. Determine k(-1). -99 Let p(f) = -26f*2 - 78f + 111. Give p(1). 7 Let a(c) = -9c2 + 71c - 41. Give a(9). -131 Let w(u) = -447u - 1769. Calculate w(-4). 19 Let o(b) = -b3 + 29b*2 + 171b - 5327. Calculate o(14). 7 Let m(p) = -p*2 - 47p - 156. Give m(-43). 16 Let n(s) = 11s3 + 472s*2 - 34s + 396. Calculate n(-43). 9 Let a(g) = g*3 - 14g*2 + 10g + 45. Determine a(14). 185 Let w(a) = -43a - 30. Determine w(-9). 357 Let m(i) = -11i + 400. Give m(21). 169 Let g(y) = -y*3 - 38y*2 + 79y + 31. Calculate g(-40). 71 Let w(z) = z*2 - 26z - 186. Determine w(27). -159 Let d(a) = -a*2 + 65a - 824. What is d(13)?	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.