Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
5? False Let b be -13 - (-334)/(-30). Let f = b - -43/3. Let v(n) = n2 - 7n + 5. Let i be v(6). Which is smaller: f or i? i Let t = -0.042 - -45.042. Let n = 45 - t. Does n = -9/4? False Suppose 4 = d - 0d. Suppose 0 = -5s + 2y + 12, -6y + 4y - 10 = -ds. Suppose 0 = -x - 3z + 3, -5x + 2z = -2z + 4. Are s and x nonequal? True Let l be (-10)/48/(-410). Suppose -4y - 6c - 24 = -c, -4y - 12 = 2c. Is y bigger than l? False Let x = 1.08 + -0.58. Let c = -0.4 - 0.2. Let s = x + c. Is -2/3 smaller than s? True Let j(z) = z2 + 23z - 23. Let g be j(1). Is 9/17 less than g? True Let y be -2 + (0 - -2) - 5. Let m be (0 - 1)(-3 + 1). Suppose -n - 15 = mn. Does y = n? True Let b = 48 + 9. Let j = b + -55. Let v be ((-4)/(-10))/(22/(-10)). Is j < v? False Let f be (-2)/16 - (-231)/56. Suppose -14 = -3l - m, 2l - 2m - 16 = -fm. Suppose 0 = -ld - 3z + 15, -25 = -3d + z + z. Which is smaller: 6 or d? 6 Let b(n) = -6n - 4. Let o be b(4). Let g = 156.5 + -140. Let l = -16.4 + g. Which is smaller: l or o? o Let w = 1 + -0.8. Let n = w - 0.1. Let f = -4.1 + 4.8. Do n and f have different values? True Suppose j - 89 = -4v + 36, 0 = 2v - j - 55. Which is smaller: v or 28? 28 Let q = -19013/2 - -54625/6. Let h = q + 376. Is h greater than -26? False Suppose 5 = -2g + 9. Let p be g/6 + (-1)/5. Suppose 5n = -5s + 10, 0 = -4n + 3s - 6s + 6. Which is greater: p or n? p Suppose 3g + 8 = -1. Let n = -591 + 587. Which is smaller: g or n? n Let n(t) = -t2 - 10t + 16. Let p be n(-11). Let o = -1 - -3. Let b be (-6)/(-12) + o. Is b > p? False Suppose -590z - 7 = -597z. Let l be 114/110 - (-4)/(-10). Which is smaller: z or l? l Let q = 6 + -5. Suppose -3z + 12 = 141. Let l = -40 - z. Is l greater than q? True Let c be (-9 - (-2 - 2))28. Let b = 63 + c. Is -78 at most b? True Suppose 8 = 2z - 2. Suppose 5u - x - 10 = -3x, 0 = u + x - z. Do u and -3/13 have different values? True Let w = 48 + 8. Let o = 56.87 - w. Which is greater: o or -1? o Let l = 5 + -6.5. Let o = -1.7 - l. Let z(y) = -3y - 15. Let s be z(-5). Which is smaller: s or o? o Suppose 5q = w + w - 37, -38 = -3w + 4q. Let h be ((-4)/78)/((-1)/w). Suppose 5v + 9 = x - 3x, 4v - 5x - 6 = 0. Which is greater: v or h? h Let s = -289.7 - -286.7. Let d = -148/55 - -34/11. Is d smaller than s? False Let y = 859/5 + -2133/10. Is y != -43? True Let d be (((-4)/(-2))/4)/((-4247)/3562). Is -1 less than d? True Let h = 37.03 - 37. Is h <= 2? True Suppose -68c + 83c = -15. Which is greater: c or -2/61? -2/61 Suppose 77y - 69y = 48. Which is bigger: y or -3? y Let r = -0.6 + 0.64. Let i = 369 - 360. Which is smaller: i or r? r Let z be (-2 + 52)/(5/70). Let i = z - 1282. Let d = i - -12807/22. Is d bigger than 1? False Let d be (0 - -20)6/12. Suppose -2x + 0x = -d. Let t be 1 + -1 - -4 - x. Is -1/32 != t? True Let v = 10.2 + -10. Do v and 0.031 have different values? True Suppose -10y = -280 - 30. Which is smaller: y or 33? y Let m = 128.3099 + -128.3. Which is smaller: 2/3 or m? m Suppose t + 10 = a, 0 = -3a + 8t - 6t + 26. Suppose -x = -ax. Let y = 13/5 + -151/60. Are x and y non-equal? True Let o(n) = -n*3 + 4n*2 - 7n + 14. Let a be o(-6). Is 416 greater than a? False Let f = -112 + 20. Which is greater: 0.1 or f? 0.1 Suppose -3a - 3w - 74 - 16 = 0, -4w - 12 = 0. Let k(f) = -2f*2 + 6f - 6. Let g be k(5). Is a greater than or equal to g? False Let s(n) = -3n3 - 37n*2 + 28n - 34. Let d be s(-14). Is 553 < d? True Let b = -449/3 - -3149/21. Which is bigger: 72 or b? 72 Let o(y) = -26y + 155. Let f be o(6). Suppose 0 - 4 = -4p. Is p >= f? True Let u = -81 - -149. Let n = u - 68. Let y be (1/(-3))/((-11)/(-9)). Is y less than or equal to n? True Let z(p) = 10p3 + p2 + 2p. Let o be z(-1). Suppose 2 = -0x - 2x. Let d be x(-5)/(20/(-42)). Do o and d have different values? True Let q be 0 - (6/(-15))/((-1)/10). Let z be (0 + -2)/(18/(q - -13)). Let w = 2/101 + 184/909. Which is smaller: z or w? z Let n be 214 - -4 - (5 + -7). Is 222 < n? False Suppose 6t = 5t - o - 105, 0 = -4t + o - 440. Is t > -109? False Let h = 70 - 90. Which is smaller: -11 or h? h Let h = -1032 + 1061. Is h equal to 31? False Suppose 79 = 4l + 15. Suppose -210 = 10p - lp. Is p > 36? False Let p = 263 - 265. Suppose 0j - 4j = -124. Is p greater than or equal to j? False Let l = 77/6 + -13. Let b be -3(21/(-9) - 1). Which is greater: b or l? b Let a be 36/9 - (0 - 1). Suppose ao - 3g = 2g + 160, 99 = 3o - 4g. Let j = o - 13. Is 16 bigger than j? False Suppose -43 = 8x + 309. Is -43 at most x? False Let i = -0.2 - -0.2. Let b = -2648.08 + 2577. Let x = b - -71. Is i at least x? True Let t be ((-408)/(-18))/((-6)/(-9)). Let v = t + -27. Is v less than or equal to 7? True Let f = 0.1 + -0.2. Let u = -9.9 + f. Let b = 6 + -6. Is u at least b? False Suppose -306 = -5w - 111. Which is smaller: w or 75/2? 75/2 Let u(x) = x + 38. Let v be u(-39). Which is greater: v or 4/77? 4/77 Let a = 210537 - 15158317/72. Let b = a - 49/9. Is -1 > b? False Let t(v) = 5v*2 - 23v - 10. Let b be t(5). Are -12/61 and b equal? False Let p be 11(-1)/22. Let a = -4 - p. Let m(n) = -5n3 + n2 - n. Let f be m(-1). Is a greater than f? False Let c = -0.904 + -0.096. Let t = 0.1 - 1.1. Let i = t + 2. Which is smaller: c or i? c Let z(f) = 2f + 1. Let l(o) = -o + 1. Let n be l(-3). Suppose -3g + 7 = nd, -5g + 12 = 4d - g. Let y be z(d). Which is smaller: 0 or y? y Let d(x) = -4x2 + 3x + 13. Let u be d(5). Let b be (3/(-106))/(u/96). Which is smaller: 1 or b? b Let i be (-1 + (-2 - 0))40/(-6). Suppose 0 = -9h + 5h - i. Is h != -8? True Suppose 5k = -38 + 153. Are k and 1/3 non-equal? True Let c = 4/139 + 2629/417. Let v = 18 - 13. Which is smaller: v or c? v Let d = 415/7 + -47711/805. Is 3 < d? False Suppose -y = -6y. Let t = -120 + 122. Suppose -4h - 3x = 22 - 2, 3h - 2x - t = 0. Is y less than h? False Let t be 45/18 + -6 - (-294)/12. Which is smaller: t or 209/10? 209/10 Suppose 320z - 326z = -1938. Is 325 bigger than z? True Let u = -335/2 + 163. Let a be (-2 + -2 - 0)6/4. Is u at least as big as a? True Let s be (9/61)/((-546)/156). Let i(f) = 2 - 4 - f2 - 1 - 4f. Let u be i(-2). Is u at least as big as s? True Let o = 1589 - 1588. Is o greater than 19/74? True Let g(a) = -a*3 - 10a*2 - 23a - 11. Let x be g(-7). Is x < -4/3? False Let l = -1031/4 - -258. Is l at most as big as 1/4? True Let r = 10.99 - -0.01. Let q = -43/154 - 1/154. Is r at least q? True Suppose -w + 1 - 11 = -4m, -5m - 5w = -25. Let h = 7342/3 + -2445. Are m and h equal? False Suppose -i - 4i + 4y - 1492 = 0, 5i - 5y = -1490. Which is greater: -298 or i? -298 Let n = -143 + 118. Let v = n - -24. Which is smaller: v or -7/5? -7/5 Let c be 2/(-9) - 73/9. Let f be 1 - 0 - 260/24. Let y = f - c. Which is smaller: -3 or y? -3 Suppose -5t + 3 + 2 = 0. Let d = 76 + -115. Let l = d + 41. Which is bigger: l or t? l Let b(u) = u - 8. Let z be b(6). Let c = -4091/8 + 510. Are c and z unequal? True Let c be (4/16)/(2/8). Let v be 2 + (0 - c) + 0. Let l be (v/2)/(7/14). Is -1 < l? True Let j = 159 + -252. Let t = j + 71. Which is greater: 2/5 or t? 2/5 Let o be 3 - (-3 - (-92)/(-20)). Let v(k) = -k*3 - 4k*2 + 12. Let b be v(-4). Do o and b have different values? True Suppose -4s + 2z = -22, -2s + 24 = -5z + 1. Suppose 0 = -g + 4y - 5y + 7, 0 = 5g - sy + 10. Do g and 2 have the same value? True Let r be 0/((-316/12)/2). Are 22/47 and r nonequal? True Let k = 183 + -112. Let q = k + -70.95. Is -0.3 less than q? True Suppose 38d - 34d - 8 = 0. Suppose -dp - p - 15 = -2i, 3 = 2p + 3i. Is p > -4? True Suppose -4b = -79 + 71, 2140 = x - 5b. Is x less than or equal to 2151? True Let w be (-12)/(-54) + (-68)/(-18). Suppose 5z - w = 3z. Let f = -4/7 + 43/14. Which is greater: f or z? f Let d = -7.1 + 1.1. Let t = -5.06 - d. Let b = t + 0.06. Is 6 greater than or equal to b? True Let q = -57934/25 - -2317. Suppose 2i = -4b - 2, 6 = i + 5b + 10. Which is smaller: i or q? q Let g = 2401 + -2513.9. Let n = 107 + g. Which is smaller: n or 1? n Let k(z) = -5z*3 - 2z*2 - 4. Let g be k(-2). Suppose 0 = -0u + 4*u - g. Are u and 7 unequal? False Let c(z) be the sec	{ "pile_set_name": "DM Mathematics" }
27z - 7. Let x(i) = 14h(i) + 4v(i). Calculate 3a(s) - x(s). 6s2 - s + 3 Let b(d) = d. Let f(i) = 12i. Let n be 2/(-7) + 232/28. Suppose -k - 5r + 2 + 0 = 0, 4k - 54 = 3r. Suppose 7h - kh = 5. What is hf(u) + nb(u)? -4u Let c(o) = 3o2 - 2o + 4. Let v(r) = -5r2 + 7r - 4. Let n be v(1). Let f(p) = -7p2 + 5p - 9. Give nf(g) - 5c(g). -g2 - 2 Let i(o) = o3 - 5o2 - 5o + 4. Suppose 0 = 18s - 49s + 124. Let n(l) = -l*2 - l + 1. Give sn(p) - i(p). -p3 + p2 + p Let g(h) = 3671. Let z(f) = -f + 10992. Give -7g(m) + 2z(m). -2m - 3713 Let t be (-235)/(-7) - 30/(-70). Let l = -30 + t. Let x(j) = 2j*2 - 2j - 6. Suppose -a = 9 - 6. Let y(o) = o*2 - o - 5. Determine ax(f) + ly(f). -2f*2 + 2f - 2 Let d(s) = s - 5. Let z(h) = 1. Suppose 98t - 318 + 24 = 0. What is td(f) + 15z(f)? 3f Let w(u) = -2u3 - 2u*2 + u. Let c(v) = -3157v*3 + 70v*2 - 35v. Calculate -c(s) - 35w(s). 3227s*3 Let q(d) = 32d*3 + 2d*2 - 1261d - 21. Let t(k) = -6k3 + 252k + 4. Determine 2q(b) + 11t(b). -2b3 + 4b*2 + 250b + 2 Let w(m) = -347m - 86. Let f(z) = 122z + 29. What is -17f(h) - 6w(h)? 8h + 23 Let g(j) = j - 5. Suppose 0 = 5k - 29 + 19. Suppose 0z + 36 = 3z - 3b, -4z + kb = -52. Let p(v) = 1. Calculate zp(h) + 2g(h). 2h + 4 Let a(b) = -b. Let p(j) = -4291j + 8589j - 4330j. Determine 3a(u) + p(u). -35u Let n(w) = 11w*3 + 3w*2 - 4w + 1. Let h(j) = -j*2 + 4j - 1. Give -2h(l) - 2n(l). -22l3 - 4l2 Let d(i) = -i3 - 4i2 - i - 2. Let p(q) = 2q*3 + 20q*2 + 7q + 10. What is -5d(s) - p(s)? 3s*3 - 2s Let g(k) = 2k2 + 32k. Let w(x) = -2x2 - 21x + 1. What is -2g(f) - 3w(f)? 2f2 - f - 3 Let p(m) = 9. Suppose 0 = -45i - 231 + 546. Let y(c) = c - 8. What is iy(n) + 6p(n)? 7n - 2 Let y = -14939 - -14938. Let i(b) = -b3 - b + 1. Let z(f) = 3f3 - f2 + 5f - 3. Give yz(t) - 4i(t). t3 + t2 - t - 1 Let z(u) = 4u3 + u2 - 1. Let y be z(-1). Let f(d) = 3d - 72 + 257 - 61 - 63 - 67. Let k(v) = 8v - 17. Calculate yk(n) + 11f(n). n + 2 Let p(d) = 5d2 + 7d + 3. Let t(z) = -z*3 + 10z*2 - 2z + 23. Let k be t(10). Let g(m) = -2 + m + 4m2 + 4 + 6m. Calculate kg(q) - 2p(q). 2q2 + 7q Let l(i) = -i - 1. Let a(k) be the first derivative of -69k2/2 - 92k + 775. What is -a(b) + 92l(b)? -23b Let n(a) = 5a3 - 17a*2 + 2a + 7. Suppose 640 - 283 = -367q - 744. Let o(z) = 2z*3 - 9z*2 + z + 3. Calculate qn(b) + 7o(b). -b3 - 12b*2 + b Let x(l) = 5l - 4. Let q(t) = -7t + 1. Let s(p) = 22p - 2. Let o(j) = -7q(j) - 2s(j). Let w = -20478 + 20480. Give wx(c) - 3o(c). -5c + 1 Let v(o) = 6o. Let f(x) = -23x + 296. What is f(q) + 3v(q)? -5q + 296 Let j(g) = 834g*2 - 27g + 81. Let m(s) = -2s2 + s - 3. Give -2j(h) - 54m(h). -1560h*2 Let x(d) = 2d*2 - 4d + 4. Let w(o) = 4o - 343 + 2o*2 - 4o*2 + 1008 - 336 - 333. Give -6w(p) - 5x(p). 2p*2 - 4p + 4 Suppose 117 - 51 = 2m. Suppose -16p = -19p + m. Let s(r) = -7r*2 + 2r + 2. Let f(b) = -36b2 + 11b + 11. What is ps(v) - 2f(v)? -5v2 Let r(j) = 5j*3 - 2j*2. Let k = 28 - 19. Let f = 2 - k. Suppose 5z = 3l - 42 + 44, 0 = z - l - 2. Let d(b) = -16b*3 + 7b*2. Calculate fr(c) + zd(c). -3c*3 Let o(u) = -31u - 344. Let h be o(-11). Let w(y) = 133y. Let t(s) = 11s. Determine hw(b) + 35t(b). -14b Let i(z) be the third derivative of 13z*5/20 - 2z*3/3 - 783z*2 - 2. Let b(m) = 196m*2 - 21. Give 4b(g) - 21i(g). -35g*2 Let x(s) = -21s*3 - 6s - 6. Let h(f) = 106f3 + 35f + 30. Let w(c) = -110c3 - 35c - 31. Let u(d) = -4h(d) - 5w(d). What is 6u(y) + 35x(y)? 21y3 Let p(l) = -11l*3 - 4l*2 - 4l + 6. Let i be (-6)/(-12)-42 - (-6 + -4). Let q(t) = 33t*3 + 11t*2 + 11t - 17. Give ip(j) - 4q(j). -11j3 + 2 Let m(u) = -u + 6. Suppose 2a + 2a = d - 29, -2d = 2a + 2. Let t(h) = 14. Let v(s) = 17. Let f(o) = at(o) + 5v(o). Calculate -11f(l) + 2m(l). -2l + 1 Suppose -28l - 16 + 20 = 32. Let t(n) = n2 + n. Let c(o) = o2 + 2o - 1. Give lc(a) - 2t(a). -3a2 - 4a + 1 Let r(k) = -6k3 - 83k*2 - 4k - 1. Let o(v) = 7v3 + 82v*2 + 3v + 1. What is -4o(u) - 3r(u)? -10u3 - 79u*2 - 1 Let d(a) = -10a*2 + 77a - 79. Let n(i) = -4i2 + 26i - 27. Calculate -3d(r) + 8n(r). -2r2 - 23r + 21 Let v(k) = -3k + 3. Let f(t) = -761. Let r(s) = -634. Let x(h) = -5f(h) + 6r(h). What is v(q) - 5x(q)? -3q - 2 Let c(k) = k. Let g be 0/(-3) - (-7 + 4) - 7. Let u(v) = 6v + 1. What is gc(y) + u(y)? 2y + 1 Let g(i) = -i - 1. Let j(v) = -3v + 20. Let b(d) = g(d) + j(d). Suppose -49p = -377 + 83. Let k(h) = -2h + 9. Calculate pb(l) - 13k(l). 2l - 3 Let y be ((-56)/70)/((-4)/30). Let v(k) = 4k2 - 5. Let u(x) = -1. What is yu(i) - v(i)? -4i2 - 1 Let c(y) = 1056888y + 2097. Let o(x) = 2017x + 4. What is 8c(f) - 4194o(f)? -4194f Suppose -3n = 2w - 0 - 13, -3n = -5w + 1. Let f(g) = 4g + 1. Let h(l) be the first derivative of l + 4 + 9/2l*2. What is wh(k) - 5f(k)? -2k - 3 Let y(o) = 84o3 - 14o*2 - 14o + 14. Let g(a) = -17a3 + 3a*2 + 3a - 3. Let c be 1 - ((-21)/(-105) - 22/10). Calculate cy(z) + 14g(z). 14z3 Let t(m) = -2455m + 9. Let d(q) = 4907q - 14. What is -3d(g) - 5t(g)? -2446g - 3 Let s(k) = 43k2 - 195k + 34. Let c(n) = 430n2 - 1951n + 357. Calculate 2c(m) - 21s(m). -43m2 + 193m Suppose 2n = n - 5, -2n - 5 = 5y. Let z(a) = 0 - y + 0 + a2. Let l(x) = -2x*2 + 0x*2 - 91 + 5x*2 + 87. What is 3l(k) - 12z(k)? -3k*2 Let v be -4 + (4 - 2 - 2). Suppose -2231y + 2228y = -c - 3, 4y = -4c - 28. Let l(h) = h - 1. Let j(k) = -12k + 4. Give vl(w) + yj(w). 8w Let l(t) = 115t*2 + 31t + 31. Let h(y) = 27y2 + 7y + 8. Give -9h(q) + 2l(q). -13q2 - q - 10 Suppose 454 = -5w + 2034. Let g = -319 + w. Let j(p) = -5p2 - 3p + 3. Let t(i) = 5i2 + 4i - 4. What is gt(y) - 4j(y)? 5y2 Let w(l) = l2 + l + 2. Let v(c) = 8c*2 - 418c + 14. Calculate -v(j) + 7w(j). -j2 + 425j Let p(r) = -r*2 - 1. Let b(s) = 6s*3 - 41s*2 - 8s - 35. Let l be b(7). Let t(k) = -21k2 - 42. What is lp(v) + t(v)? 21v2 Let u(r) = 3 + 1 - 39r - 5 + 19r + 21r. Let j(b) = 6b - 5. Calculate j(a) - 5u(a). a Let a(d) = 39d3 - 3d*2 - 8d - 87. Let s(w) = -52w3 + 4w*2 + 11w + 116. Determine 11a(q) + 8s(q). 13q3 - q2 - 29 Let k(w) = 5w + 4. Let r(m) = -m - 1. Let h(i) = -i*2 - 13i + 294. Let y be h(12). Calculate yr(n) - 2k(n). -4n - 2 Let a(l) = 3l + 6. Let p be a(-6). Let b(m) be the second derivative of -2m3 + 5m*2/2 + 647m. Let u(w) = -30w + 12. Calculate pb(q) + 5u(q). -6q Let g(d) = 3d + 4. Let y = -8 - 3. Let w = -10 - y. Let b(m) = -3. Let x(h) = 1. Let q(r) = 6b(r) + 17x(r). Determine wg(i) + 4q(i). 3i Let j(n) = 3n - 35. Let k(b) = 5b - 65. Let p(f) = -11j(f) + 6k(f). Suppose -4g = 12g + 48. Let y(t) = t - 1. What is gy(l) + p(l)? -6l - 2 Let i(b) = -8470b3 + 6b*2 - 6b. Let g(y) = -279510y3 + 196y*2 - 196y. Calculate 3g(x) - 98i(x). -8470x3 Let c(k) = 3k*3 - 3k*2 - 7k + 5k + 0 - 2 + 0k*2. Let s(a) = -5a + 5 + 5a2 + 2a*2 + 10a - 7a3. Let h = 619 + -614. What is hc(l) + 2s(l)? l3 - l2 Let r(v) = 4098v - 26. Let a(c) = -12605446c + 79989. What is -2a(m) - 6153r(m)? -4102m Let x(a) be the second derivative of -3a5/10 + 3a*4/4 - 7a*3/3 + 4a*2 - 2a - 64. Let i(l) = -2l3 + 3l*2 - 5l + 3. What is 8i(s) - 3x(s)? 2s3 - 3s*2 + 2s Let t(b) = -214b - 422. Let n be t(-2). Let z(o) = -23o*2 - 10o. Let y(s) = -8s2 - 3s. Calculate nz(k) - 17y(k). -2k2 - 9k Let l(x) = -626835x3 + 917x*2 + 6419x. Let o(a) = 3416a3 - 5a*2 - 35a. Give -5l(m) - 917o(m). 1703m3 Let q(g) = 3g*3 - 10g*2 + 182g - 3. Let z(d) = -8d3 + 28d*2 - 554d + 9. What is 11q(r) + 4z(r)? r*3 + 2r*2 - 214r + 3 Let o(u) = 3u - 6. Let v(q) = q - 1. Let i(b) = b2 + 18b - 6. Let l be i(-19). Suppose 0 = -0f - 4f + w - l, -4w + 22 = -f. What is fv(z) + o(z)? z - 4 Let w = -76 - -74. Let v(a) = a*2 - a + 5. Let u(j) = -13j*2 + 6j + 20. Let c(n) = -24n2 + 11n + 36. Let b(y) = 6*c(y) - 1	{ "pile_set_name": "DM Mathematics" }
e t(w(p)). 328p2 - 3 Let j = 206 + -138. Let u(z) = 0 + 0 - jz*2. Let t(q) = -2q*2. Determine u(t(d)). -272d*4 Let p(x) = -115x*2 + 6x - 12. Let c(o) = 229o2 - 11o + 22. Let d(z) = -6c(z) - 11p(z). Let b(h) = h*2. Determine d(b(m)). -109m*4 Suppose 0 = -2o - o + 12. Let r(i) = 2i2 + i2 - oi2. Let k(d) = d2 + 6d2 - 9d*2 - 3d*2. What is k(r(m))? -5m4 Let s(h) = -h2. Let t(q) be the first derivative of -345q2/2 + 55. What is t(s(p))? 345p*2 Let j(n) = -13n*2 + 3n + 3. Let v(y) = -y*2 + y + 1. Let u(q) = -j(q) + 3v(q). Suppose 0r - 12 = -3r. Let f(s) = -3s - s + s + rs. What is f(u(b))? 10b2 Let g(o) = 47o*2. Let h(j) = 1070j*2. What is g(h(p))? 53810300p*4 Let l(u) = 7u*2 + 6u - 11775 + 11775. Let d(h) = -2h. What is d(l(q))? -14q*2 - 12q Let r(d) = -2d2 - 3d. Let y(s) = -39195s. Give y(r(x)). 78390x*2 + 117585x Let a(z) be the third derivative of -89z5/12 - 106z*2. Let w(b) = -2b. Calculate a(w(j)). -1780j2 Let t(w) = 2w*2. Let v be (-124)/(-44) + 8/44. Let g(x) be the first derivative of 17 - 3x - 14 + x*2 + vx. What is g(t(p))? 4p2 Let k(o) = -7o2. Let w(x) = -26647 + 26647 - x2. Determine w(k(c)). -49c4 Let y(u) be the first derivative of 1/3u*3 + 0u*2 - 42 + 0u. Let q(d) = -11d + 2. Give y(q(a)). 121a*2 - 44a + 4 Let i(b) be the third derivative of -235b4/24 + 297b2. Let r(d) = -d2. Give i(r(s)). 235s2 Let k(t) = 336t. Let m(h) = -31h. Calculate m(k(x)). -10416x Let n(j) = -19j2 + 1. Let c(p) = -70p*2. Give c(n(a)). -25270a*4 + 2660a*2 - 70 Let z(r) = 4r*2. Let f(t) = 49t - 8t2 - 23t - 33t + 7. Let y(d) = -3d*2 - 2d + 2. Let l(w) = 2f(w) - 7y(w). What is l(z(s))? 80s4 Let c(r) = -97r*2. Let s(o) = 2o*2 - 4o*2 - 7o*2 + 0o*2. Calculate c(s(t)). -7857t*4 Let f(i) = 3i. Let z(l) = -9l + 6l + 333l2 + 0l + 0l + 4l. Calculate f(z(p)). 999p2 + 3p Let k(x) = -x - 648. Let v(u) = -733 + 733 + u2. What is k(v(i))? -i2 - 648 Let k(y) be the first derivative of -3y5/10 + 4y*3 + 9. Let r(g) be the third derivative of k(g). Let m(a) = 2a. Determine m(r(x)). -72x Let j(c) = 25c + 10. Let v(p) = -8p - 3. Let h(b) = 3j(b) + 10v(b). Let k(i) = -171 + 345 + 3i*2 - 174. Give k(h(z)). 75z*2 Let v(r) = -23r*2. Let o(l) = -1933l. Calculate v(o(m)). -85939247m2 Let y(a) = 14a - 2a - 14a - 4a. Let m(r) = 27r. Give y(m(l)). -162l Let h(k) = k + 8k - 8 - k + 5k2. Let d = -16 + 8. Let u(o) = -3o*2 - 5o + 5. Let r(q) = du(q) - 5h(q). Let p(z) = z. Determine p(r(l)). -l*2 Let o(z) = 2z*2 - 151z + 3. Let u(r) = -153r. Give o(u(s)). 46818s*2 + 23103s + 3 Let z(p) = 2p2. Let l(y) be the third derivative of y4/6 + 18y*2 + 4. Give z(l(x)). 32x*2 Let n(i) be the first derivative of 6i*2 - 213. Let t(l) = -10l*2. Calculate n(t(w)). -120w*2 Let t(k) = -2k. Let p(f) = -4486157f. Determine p(t(i)). 8972314i Let l(w) = 47w - 4w - 3w. Let f(j) = -j - 4211 + 4211. Calculate f(l(z)). -40z Let q(j) = 2j. Let m(f) = 498f - 5. Let a(x) = -x + 1. Let z(o) = 5a(o) + m(o). What is z(q(d))? 986d Let z(q) be the third derivative of q*5/60 - 61q*4/12 + 150q*2 - q. Let r(b) = -10b*2. Determine z(r(l)). 100l*4 + 1220l2 Let k(i) = i2. Let m(l) be the second derivative of 4l5/15 + 3l*2/2 + 6l. Let d(z) be the first derivative of m(z). Give k(d(q)). 256q4 Suppose 0 = -4d - 4a + 4, 2d - 7 = -a - 0. Let h(n) = 3n2. Let o(k) = 3k*2. Let c(z) = dh(z) - 7o(z). Let w(f) = -5f*2. Determine w(c(i)). -45i*4 Let z(w) be the third derivative of -37w*5/60 - 2w*2. Let u(s) = -15s + 14s + 4s - s. Give z(u(x)). -148x2 Suppose 0 = -5w + 237 + 4833. Let f(b) = -b*2 + 1014 + 6b*2 - w. Let x(c) = c. Give x(f(l)). 5l*2 Let h(x) = -3x. Let m(t) = 0t + 2 - 3 + 15t - 1 - 11t. Calculate h(m(n)). -12n + 6 Let v(q) = -1763q2 - 2 + 3472q*2 + 2 - 1707q*2. Let r(c) = -14c. Let x(y) = -3y. Let g(s) = -3r(s) + 16x(s). Calculate v(g(b)). 72b2 Let a(l) = l2. Let v(u) = -3u - 5. Let f = -30 - -35. Let i(s) = -s - 3. Let t(q) = fi(q) - 3v(q). What is t(a(h))? 4h2 Let x(a) be the second derivative of a3/6 - 15a - 16. Let u(o) = -2o*2 - 39o. Give u(x(m)). -2m2 - 39m Let i(f) = 19940f. Let t(c) = -5c*2. What is t(i(v))? -1988018000v*2 Let d(l) = l. Let a(s) be the third derivative of 0 + 0s*3 - 5/24s*4 + 20s*2 + 0s. Determine d(a(j)). -5j Suppose -4t - 37 + 21 = 0. Let s(k) = 57k + 10. Let p(r) = -28r - 4. Let l(m) = ts(m) - 10p(m). Let f(g) = 2g. Give f(l(x)). 104x Let i(a) = -a. Let y(q) = -1479753q. Calculate i(y(c)). 1479753c Let q(w) = 3w2. Let f(r) = 513626r. Give q(f(c)). 791435003628c2 Let n(r) be the second derivative of 11r*7/1260 - 7r*4/4 - 23r. Let v(w) be the third derivative of n(w). Let q(a) = -2a. Calculate q(v(d)). -44d*2 Let g(u) = -6u*2. Let v(i) = 50i*2 + 30i - 15. Let l(h) = 7h2 + 4h - 2. Let w(f) = 30l(f) - 4v(f). Calculate g(w(z)). -600z4 Let z(x) = 3x*2 + 1136565x. Let c(n) = -3n2. What is z(c(b))? 27b*4 - 3409695b*2 Let j(u) be the first derivative of 10 - 2/3u*3 + 0u + 0u2. Let o(f) = f. What is j(o(n))? -2n*2 Let x(l) = 11l*2. Let s(z) = 49z*2 + 14z. Let c(b) = 17b2 + 5b. Let u(j) = -14c(j) + 5s(j). Calculate u(x(p)). 847p4 Let i = -7 + 1. Let j be i/(-27) + 215/45. Let c(u) = -9u + ju + 3u. Let y(l) = -6l2. What is y(c(r))? -6r*2 Let t(u) = 529u2. Let l(k) be the second derivative of k4/12 + 58k + 5. Calculate t(l(j)). 529j*4 Let u(h) = -12h*2. Let i = -1695 - -1695. Let v(k) be the second derivative of 0 + ik*2 - 2k + 1/3k3. What is u(v(g))? -48g*2 Let g(k) = 2k*2. Let z(s) be the second derivative of -13s*3/6 + 10s - 9. What is z(g(b))? -26b2 Let h(f) = 14f*2. Let g(c) = 7c*2 + 3c + 6. Let n(s) = -13s2 - 5s - 10. Let d(l) = -5g(l) - 3n(l). What is h(d(j))? 224j4 Let j(i) = 2i. Let q(n) = -3358408n2. Give q(j(l)). -13433632l*2 Let i(f) = -50 - 45 - 2f*2 + 95. Let h(o) = 15o + 1. Give h(i(t)). -30t2 + 1 Let q(t) = -t - 367. Let u(p) = 17p. Let l(n) = -13n. Let r(a) = 4l(a) + 3u(a). Calculate r(q(m)). m + 367 Let u(i) = 48633i*2. Let c(p) = -40p. What is u(c(s))? 77812800s2 Let j(c) = -30c2. Let s(f) be the first derivative of f5/30 + 7f2 - 1. Let d(p) be the second derivative of s(p). Give d(j(n)). 1800n*4 Let b(x) = 2x*2 + 1569x - 1. Let r(w) = w - 17. What is r(b(k))? 2k2 + 1569k - 18 Let c(l) be the second derivative of 0 + 7l + 0l*2 + 7/2l*3. Let n(m) = 2m*2. What is c(n(a))? 42a*2 Let r = 880 + -876. Let n(w) be the third derivative of -5w*2 + 0w*3 + 0w + 7/24wr + 0. Let s(p) = 3p*2. What is n(s(l))? 21l*2 Let l(a) = -148a. Let g(r) = 91r + 1. Calculate l(g(f)). -13468f - 148 Let x(i) = -41i + 74i - 32i. Let l(s) = 6s*2 - 4s. Let t(n) = 5n2 - 3n. Let z be 2 - 36/3. Let a(r) = zt(r) + 3l(r). Calculate a(x(q)). -2q*2 Let s(h) = 21h*2. Let b(u) = -10738u. What is s(b(n))? 2421397524n2 Let i(t) = 10t - 2. Suppose 4x - 6 = 2. Let o(c) = 51c - 11. Let f(y) = xo(y) - 11i(y). Let u(k) = -4k2 + 4k2 - k2. Determine f(u(h)). 8h2 Suppose 0 = 9q - 176 + 59. Let o(i) = 9i. Let y(v) = -18v. Let z(d) = qo(d) + 6y(d). Let t(m) = -m. Give t(z(u)). -9u Let w(g) = -3g. Let p(c) = 8c2 - 93 - 27c*2 + 10c*2 + 10c*2. Determine p(w(o)). 9o*2 - 93 Let w(z) = -63z - 14 + 9 + 5 - 38z. Let d(s) = s. What is w(d(f))? -101f Let u(h) = -54h. Let d(m) = 5m - 1747. Determine d(u(p)). -270p - 1747 Let n(v) = -11v. Let y(m) be the third derivative of m*8/10080 - 3m*5/10 - 6m*2. Let o(b) be the third derivative of y(b). Calculate o(n(l)). 242l*2 Let j(k) = -219k. Let s(n) = -1400n2. Determine j(s(b)). 306600b*2 Let a(c) = -2c*2 + 743c - 4. Let k(g) = -3g. What is a(k(f))? -18f*2 - 2229f - 4 Let i(h) = 6725h2. Let r(o) = 2o - 14. What is r(i(d))? 13450d2 - 14 Let r(d) = 152d. Let b(q) = -17q2 - q + 3. Determine r(b(w)). -2584w*2 - 152w + 456 Let u(d) = -2d2 + 483d + 2. Let b(o) = 6o2. Give u(b(g)). -72g**4	{ "pile_set_name": "DM Mathematics" }
3 + 8t*2 - 4t - 2. Give y(1). -2 Let o(m) = -m*2 - 78m + 157. What is o(2)? -3 Let q(x) = 2x2 - 31x - 20. What is q(14)? -62 Let k(v) = 2v2 - 16v + 2. What is k(8)? 2 Let y(i) = -i*2 + 3i + 6. Calculate y(-6). -48 Let u(f) = 6f2 - 5f + 3. Calculate u(3). 42 Let m(s) = -s*3 - 3s*2 - 2s - 1. Calculate m(-4). 23 Let h(d) = 2d - 14. Determine h(6). -2 Let t(z) = -z3 + 23z*2 - 22z + 10. What is t(22)? 10 Let i(s) = -22s - 125. Give i(-6). 7 Let a(b) = -94b - 3. Give a(-1). 91 Let i(t) = -t*2 - 20t - 58. Give i(-4). 6 Let m(g) = 8g - 27. Determine m(8). 37 Let d(o) = 3o*2 + 9o + 26. Calculate d(-2). 20 Let x(s) = -s*2 + 114s + 348. Determine x(-3). -3 Let h(p) = p*2 - 10p - 30. What is h(13)? 9 Let a(c) = -c*3 - 4c2 + 15. Determine a(-4). 15 Let s(i) = i3 + 9i2 + 8i - 13. Determine s(-7). 29 Let s(n) = -n*2 + 4n - 4. Determine s(2). 0 Let a(w) = -5w + 41. What is a(13)? -24 Let k(t) = -2t*2 + 63t - 153. Calculate k(29). -8 Let y(g) = 30g2 + g + 1. What is y(-1)? 30 Let x(z) = z3 - 5z*2 + 4. Calculate x(5). 4 Let v(f) = 2f3 - f2 + 2f + 27. Calculate v(0). 27 Let v(l) = 12l - 172. Calculate v(15). 8 Let i(j) = 5j2 - 5j + 6. What is i(2)? 16 Let g(n) = n*3 + 6n*2 + n + 2. Give g(-5). 22 Let z(v) = 2v - 12. Calculate z(12). 12 Let g(x) = x*3 + 6x*2 - 27x - 11. Calculate g(-9). -11 Let o(n) = -16n3 + 2n*2 - 2. Give o(-1). 16 Let a(q) = -2q + 5. Calculate a(-8). 21 Let t(k) = -9k + 17. Give t(6). -37 Let u(y) = -y2 + 2y - 11. Calculate u(0). -11 Let k(w) = -w*3 - 9w*2 - 5w + 10. What is k(-8)? -14 Let r(x) = -3x2 - 3x - 2. Give r(-2). -8 Let z(t) = t - 10. Determine z(12). 2 Let d(x) = -x*2 + 8x - 10. Determine d(7). -3 Let d(y) = -y*2 - y + 1. Calculate d(-4). -11 Let u(d) = -37d + 4. Calculate u(2). -70 Let a(q) = -2q - 5. Calculate a(-8). 11 Let c(o) = -5o + 51. Give c(7). 16 Let v(q) = 238q3 - q2. Give v(-1). -239 Let m(f) = -f - 7. Determine m(-14). 7 Let o(m) = -m3 + 6m + 14. What is o(0)? 14 Let g(v) = 14v - 20. Calculate g(1). -6 Let n(i) = 6i + 1. What is n(5)? 31 Let p(n) = -3n3 + 18n*2 - 6n - 11. Give p(6). -47 Let h(g) = g*3 - 6g2 + 5. Give h(6). 5 Let t(c) = -c3 + 2c2 + c - 3. Give t(4). -31 Let q(x) = -x - 22. Give q(-4). -18 Let b(y) = -14y - 23. Determine b(-8). 89 Let q(a) = -a*2 + 3a + 4. What is q(-3)? -14 Let a(h) = 5h2 + 2h. Calculate a(-2). 16 Let m(h) = 10h + 22. Calculate m(-5). -28 Let r(l) = 5l + 171. Give r(-33). 6 Let y(z) = z*3 - 19z*2 - 44z + 44. What is y(21)? 2 Let x(h) = h*3 + 8h*2 + 3h - 11. Give x(-7). 17 Let v(p) = -2p3 - 13p*2 - 20p - 8. What is v(-4)? -8 Let c(m) = m*3 + 6m*2 - 28m - 13. What is c(-9)? -4 Let i(q) = q*3 - 7q*2 + q - 6. Determine i(7). 1 Let u(m) = -m + 5. Determine u(-6). 11 Let x(s) = -s + 79. What is x(20)? 59 Let a(u) = -191u + 9. Determine a(0). 9 Let o(d) = 14d2 - 3d + 2. Give o(2). 52 Let k(g) = -g*3 + 7g*2 + 11g - 2. What is k(8)? 22 Let u(c) = -2c + 1. What is u(19)? -37 Let k(n) = -n3 + 35n*2 + 38n - 80. Give k(36). -8 Let z(u) = u*2 - 9u - 16. Determine z(-6). 74 Let z(j) = -j*3 + 15j*2 + 16j - 238. Determine z(15). 2 Let n(t) = 7t - 1. Calculate n(2). 13 Let x(o) = -5o + 5. Determine x(5). -20 Let o(p) = 8p - 182. Give o(23). 2 Let t(f) = f3 + 18f*2 - 15f + 19. What is t(-19)? -57 Let p(v) = -v - 16. Give p(-9). -7 Let g(d) = -d*2 - 9d + 27. Determine g(-11). 5 Let j(z) = -19z2 + 9z + 4. Calculate j(-1). -24 Let j(h) = -h*2 + 5h - 2. Determine j(5). -2 Let d(v) = 6v + 5. Calculate d(5). 35 Let t(z) = -z3 - 7z*2 + 4z - 6. Determine t(-8). 26 Let q(a) = a*2 + 18a - 10. What is q(-15)? -55 Let l(d) = 30d - 116. Give l(4). 4 Let s(g) = 2g*2 + 8g + 2. Calculate s(-3). -4 Let f(v) = v*2 + 9v + 16. What is f(-8)? 8 Let w(f) = -2f3 - 2f*2 + 5f + 2. What is w(2)? -12 Let i(u) = 57u + 571. What is i(-10)? 1 Let l(r) = -5r*2 - 15r - 6. Calculate l(-6). -96 Let b(y) = -y*3 - 5y*2 - 2y - 1. What is b(-4)? -9 Let q(j) = -3j. Determine q(9). -27 Let g(t) = 7t*2 + 19t - 3. Give g(-3). 3 Let d(w) = 2w3 + 18w*2 - w - 27. Determine d(-9). -18 Let i(j) = -3j + 23. What is i(8)? -1 Let k(p) = -4p2 - 2p - 1. Determine k(-1). -3 Let k(t) = t*2 + 14t - 30. What is k(-15)? -15 Let p(i) = i*2 - 5i - 4. Give p(3). -10 Let a(u) = -6u3 - 4u*2 - 3u - 1. Give a(-1). 4 Let s(o) = -2o3 + 13o*2 + 10o - 5. What is s(7)? 16 Let w(i) = 5i + 156. What is w(-35)? -19 Let n(y) = -y + 13. Determine n(-7). 20 Let x(l) = -5l - 44. Calculate x(-9). 1 Let f(i) = 61i + 313. Determine f(-5). 8 Let x(h) = -15h - 546. Give x(-38). 24 Let w(o) = -11o2 + o + 1. Determine w(2). -41 Let m(u) = 21u + 22. What is m(-1)? 1 Let w(v) = -v*3 + 5v*2 - 3v. What is w(3)? 9 Let q(j) = -j*3 - 3j*2 + 35j - 94. What is q(3)? -43 Let g(s) = -7s + 8. Calculate g(1). 1 Let f(u) = -17u*2 - 2u - 1. What is f(-1)? -16 Let s(c) = c*3 + 5c*2 + c - 1. Give s(-5). -6 Let j(x) = -3x - 6. What is j(4)? -18 Let w(k) = 21k + 24. Determine w(-1). 3 Let k(l) = -2l*3 - 4l2 - l - 3. Give k(-3). 18 Let f(j) = -j2 + j + 14. Give f(-6). -28 Let h(q) = -q*2 + 14q - 23. Give h(8). 25 Let q(n) = -10n - 218. What is q(-20)? -18 Let u(v) = -6v3 + v2 - 4v - 3. Calculate u(-2). 57 Let v(l) = -4l + 2. Calculate v(2). -6 Let p(t) = 5t + 13. Determine p(-5). -12 Let l(o) = o2 - 8o - 11. Calculate l(8). -11 Let l(j) = 3j + 19. Give l(-6). 1 Let p(h) = -4h*2 - 9h + 8. Give p(1). -5 Let x(r) = -r*2 + 11r - 15. Determine x(6). 15 Let c(y) = 4y + 38. Determine c(-7). 10 Let s(z) = -4z - 20. What is s(-4)? -4 Let x(t) = t*3 - 2t*2 + 2t - 7. Give x(3). 8 Let l(w) = -2w2 + 2. What is l(3)? -16 Let f(v) = -v3 - 3v*2 + 5v + 1. Give f(2). -9 Let c(u) = -u*2 - 20u - 75. Give c(-6). 9 Let j(r) = -5r - 180. What is j(-40)? 20 Let l(p) = p2 - 10p + 3. What is l(8)? -13 Let a(z) = z*3 - 9z*2 - 95z - 25. Calculate a(-6). 5 Let x(l) = l*3 + 11l*2 + 9l + 12. What is x(-11)? -87 Let l(m) = -m*2 + 6m - 11. What is l(10)? -51 Let x(n) = 8n - 11. Calculate x(7). 45 Let x(n) = n2 - 7n - 13. Give x(7). -13 Let k(a) = 7a + 36. Calculate k(-6). -6 Let y(x) = 2x*3 - 2x2 - x - 1. Give y(-2). -23 Let j(o) = -o3 - 4o2 + o + 9. What is j(-4)? 5 Let i(o) = -o2 + 11o - 5. Calculate i(4). 23 Let h(k) = 5k2 - 14k - 4. Calculate h(4). 20 Let p(m) = -m*3 - 6m*2 + 33m + 17. What is p(-9)? -37 Let m(g) = -5g + 11. Determine m(12). -49 Let q(t) = -3t - 15. Determine q(-16). 33 Let t(u) = u*3 + 5u*2 - 6u + 2. What is t(-5)? 32 Let c(k) = -k*3 + 7k*2 + 9k - 4. Give c(8). 4 Let j(g) = 3g + 15. What is j(-4)? 3 Let r(y) = 12y2 - y. Determine r(-2). 50 Let z(d) = -d2 - 12d + 3. What is z(-14)? -25 Let i(d) = -d2 + 16d - 18. Give i(13). 21 Let w(r) = r + 2. What is w(-6)? -4 Let w(x) = x*3 + 59x*2 - 57x + 172. Give w(-60). -8 Let x(f) = f*3 - 13f*2 + 10f - 2. Determine x(12). -26 Let u(h) = h. What is u(-3)? -3 Let m(b) = 11b + 8. What is m(-7)? -69 Let l(o) = -o - 13. Determine l(-15). 2 Let q(r) = -r2 + 17r + 13. What is q(17)? 13 Let m(n) = n3 - n2 - 8n + 7. Determine m(-6). -197 Let u(l) = l3 + 10l*2 - 9l + 12. Give u(-11). -10 Let d(q) = 26q + 30. Calculate d(-6). -126 Let m(a) = -5a - 1. Calculate m(6). -31 Let h(m) = 57m - 218. Calculate h(4). 10 Let p(y) = y3 - 13y*2 + 3y - 38. Give p(13). 1 Let v(z) = z*3 - 6z*2 + 3z + 2. Determine v(6). 20 Let y(m) = -3m2 - 19m - 8. Give y(-6). -2 Let t(w) = w*2 - 10w + 27. Determine t(4). 3 Let h(p) = -p*2 + 9p - 22. Give h(6). -4 Let h(i) = -6i3 - 3i2 - i + 4. What is h(-2)? 42 Let j(a) = -a3 - 8a2 + 2a + 75. Determine j(-7). 12 Let i(c) = -c + 3. Calculate i(5). -2 Let u(m) = -m*3 + 5m*2 - m + 4. Calculate u(5). -1 Let i(z) = 27z3 - z2 - z + 1. Calculate i(1). 26 Let d(m) = -2m2 - 27m - 90. Give d(-5). -5 Let t(h) = h*3 - 9h*2 - 9h - 11. Calculate t(10). -1 Let j(a) = a*3 + 7a2 + a + 5. Calculate j(-7). -2 Let z(k) = -k2 + k + 3. Determine z(3). -3 Let s(x) = -x*3 + 25. Determine s(0). 25 Let k(q) = 2q*3 - 9q**2 + q + 19. C	{ "pile_set_name": "DM Mathematics" }
q Let l be 2/((-18)/29) + 3. Let k = 6.5 - 7. Let d = k + -0.5. Sort l, 0.1, d in decreasing order. 0.1, l, d Suppose p - 17 + 5 = 0. Suppose 0 = -2u - 3i + p, 3u - 3i - 7 = -4. Sort -5, u, 0.5. -5, 0.5, u Suppose -c - 6 = -1. Sort -1, c, -0.04 in increasing order. c, -1, -0.04 Let l be 6 - (-3 + (5 - 1)). Sort 0.4, -3/2, l in decreasing order. l, 0.4, -3/2 Suppose -4m - 4x = -16, -x - 16 = -4m - 0x. Let r(v) = -14 - mv2 - 6v2 - v2 - v*3 - 11v. Let l be r(-10). Sort 1, l, -3 in increasing order. l, -3, 1 Let i = 24.3 + -24. Sort i, 5, 0.2. 0.2, i, 5 Suppose 0 = -3z - 13 + 19. Put -3, z, -1, 4 in decreasing order. 4, z, -1, -3 Let g = 28 + -16. Let l be (g/(-36))/((-2)/(-18)). Sort 2, -4, l in descending order. 2, l, -4 Suppose 5h - 27 - 13 = 0. Let c be h((-6)/(-4) + -2). Let o be 10/(-3)9/(-6). Put o, -3, c in increasing order. c, -3, o Suppose -3h = 7h - 20. Suppose -5v + 5z - 5 = 0, -2z - z = -5v + 3. Suppose t + 21 = vt + 5m, -3t + 4m = 3. Sort 0, h, t in decreasing order. t, h, 0 Let z = -11 + 11.02. Let f = z - 1.02. Put f, -2/3, 2/11 in ascending order. f, -2/3, 2/11 Let g = -0.46 + -4.24. Let u = -0.7 - g. Sort -2/21, u, 1/3 in increasing order. -2/21, 1/3, u Let v(u) = 0u2 + 11 + 0u2 - u - u2 + 8u. Let p = -6 - -14. Let a be v(p). Put -1, a, -4 in decreasing order. a, -1, -4 Let h = -1.97 - 0.23. Let m = h - -0.2. Let i = -1 - m. Sort -0.1, i, 0.2 in increasing order. -0.1, 0.2, i Let v = 0.1 - -8.9. Let n = v + -13. Let u be 3/12 + (-2)/(-16). Sort u, n, -4/5 in ascending order. n, -4/5, u Let g(p) = -p3 - 1. Let c(k) = -4k*3 + 6k*2 + 5k - 7. Let f(q) = c(q) - 5g(q). Let n be f(-5). Sort 4, n, 1 in ascending order. n, 1, 4 Let q(w) = 29w + 5. Let v be q(-4). Let i = 781/7 + v. Let h be (2/44)/4. Sort i, -0.2, h in increasing order. -0.2, h, i Let s(p) = -p3 - 3p*2 + p - 2. Suppose -3v - 13 = -4. Let g be s(v). Sort g, -0.3, 4. g, -0.3, 4 Suppose 4c - 5 = 7. Let k(i) = -i2 - 10i - 24. Let r be k(-6). Let j be r + c - 1/1. Put 5, j, 4 in ascending order. j, 4, 5 Suppose -3c = 2c + 10. Suppose 0v = -v. Suppose -2j = h - vh - 3, 11 = 3j - 5h. Put j, c, 4 in increasing order. c, j, 4 Let x = 1 - -2. Suppose 43 = -xj + c + c, 5j = c - 67. Let b = 8 + j. Put -3, 5, b in descending order. 5, -3, b Let l = -2 - -1.6. Put l, 1, -2 in descending order. 1, l, -2 Let c(i) = i3 + 6i*2 - i - 2. Let u be c(-6). Suppose -4l + 8 = uh, 5 = h - 0h + 4l. Let n = -3 - -2. Sort h, 2, n in decreasing order. 2, h, n Suppose 0 = -p + 5 - 1. Suppose -2 = -2d + 4d. Put d, p, 0 in ascending order. d, 0, p Let u = 51 + -55. Sort 0, -3, u, 4/7 in ascending order. u, -3, 0, 4/7 Let z(w) = -w3 + 6w*2 - 2w - 7. Let c be z(5). Let h be (10/c)/(1/4). Sort h, 4, -2 in decreasing order. h, 4, -2 Suppose -14z = -6z - 48. Sort 2, z, 1 in decreasing order. z, 2, 1 Let y = 0.42 - 0.02. Put 4, 0, y in ascending order. 0, y, 4 Suppose 4y - 3q = 5 + 9, 0 = -5y + 5q + 15. Sort 4, y, 1/2 in decreasing order. y, 4, 1/2 Let y = -0.294 + 0.094. Put 0.1, y, 2 in descending order. 2, 0.1, y Let q(k) = k3 - k2 - k + 1. Let n be q(2). Let r = -2 + n. Suppose 6 = -16l + 38. Put l, -1, r in decreasing order. l, r, -1 Let x(v) = v3 - 2v*2 - 3v - 4. Let s be x(3). Sort s, -6, 0 in ascending order. -6, s, 0 Let u be (-3 - 4)(-1 + 0). Let s = u + -11. Let z = s + 1. Sort -1, z, -4 in decreasing order. -1, z, -4 Let l be -1(4 - 5/1). Put -2, -8, l, -4 in decreasing order. l, -2, -4, -8 Let z = -4.2 + 2.2. Put -1/2, -2/17, z in increasing order. z, -1/2, -2/17 Let y(f) = 2f - 9. Let q be y(6). Suppose 2z = -3z + 175. Suppose 2h + z = -3h + qg, -4g + 20 = 0. Put -3/8, h, 1 in increasing order. h, -3/8, 1 Let c = 3.5 - 3. Let s = -14/3 + 29/6. Sort c, s, 0.3 in decreasing order. c, 0.3, s Let m = 38.906 - -0.094. Put m, -2, 0.4 in decreasing order. m, 0.4, -2 Let a = 1 + -6. Let s = -3.6 + -0.4. Sort s, -0.05, a in ascending order. a, s, -0.05 Suppose -b - 4x = -x - 17, 2b + 5x = 30. Let f = b - 10. Sort 1/5, f, 0 in ascending order. f, 0, 1/5 Let c = -12.3 - -12. Sort -2/11, c, 1/8. c, -2/11, 1/8 Let r(u) = 9u + 69. Let b be r(-8). Suppose 3c + 5n - 31 = 0, 0 = 2c + 5n - 21 - 8. Put 0, c, b in ascending order. b, 0, c Let y = -3 - 1. Suppose 4 = -r + 2g + 5, -4r + 4g - 8 = 0. Suppose 2w + 4 = -2. Sort w, y, r. r, y, w Let c = -12 + 4. Let b = c + 5. Let p = b + 2. Put -0.4, 0.3, p in increasing order. p, -0.4, 0.3 Let z = -1.28 + 4.33. Let v = z + -0.05. Let t = 2 + -7. Sort -1/2, t, v in ascending order. t, -1/2, v Let w = -23 - -25. Suppose -2m + 12 = 2z, m + z = -3z + 21. Put m, -2, w in ascending order. -2, m, w Let l = -26 - -29. Sort l, -3, 2 in increasing order. -3, 2, l Let f = 25 + -24. Sort -3, f, -4 in descending order. f, -3, -4 Let o be ((-10)/4)/(-5)21. Suppose 14 = -5p - x, x + 2 + 8 = -3p. Sort -4, o, p. -4, p, o Suppose 3t + 2n = -18, 3t - n + 15 = -2n. Let o = 0 + t. Sort -2, o, 2 in decreasing order. 2, -2, o Let d(x) = x*3 - 4x*2 - 9x + 2. Let k be d(6). Suppose -5y + 19 = 4n - 0, 0 = -5y - 5n + k. Put -2/5, -4, y in descending order. y, -2/5, -4 Let y be (-3 - -3)/(3 - 1). Let r be -1 - (-3 + 2 + y). Suppose r = 2c - 2t + 4, -c + t = c + 1. Sort 4, -5, c. -5, c, 4 Let w = 0.52 - 1.02. Put -0.3, 2/15, -2.9, w in decreasing order. 2/15, -0.3, w, -2.9 Let h(f) = -4 + 4 + 2f + 2 - 3. Let d be h(2). Put d, -2, 1 in decreasing order. d, 1, -2 Let r = -574/153 + 60/17. Let z = -0.166 - -0.266. Let g = -0.1 + -0.9. Sort g, z, r in decreasing order. z, r, g Let y = 9 - 9.3. Let r = 2.4 + -1.4. Sort y, 2, r in ascending order. y, r, 2 Suppose 0 = -2g + 2l, -4l = -5g - l + 8. Sort g, 1/2, -2, 6. -2, 1/2, g, 6 Let h = 61 + -64. Sort 5, h, 0. h, 0, 5 Let b be (-3)/(-357) + 2/7. Let o = b + -42/85. Let g = -6.8 + 2.8. Sort -0.3, g, o in ascending order. g, -0.3, o Let x = -14 - -18. Suppose -q + x = 6. Sort q, 0.4, 0 in descending order. 0.4, 0, q Let q(m) = -m3 + 3m*2 + m - 1. Let x be q(2). Suppose -2c = 4s - 2s + 10, 0 = 3s + c + 5. Sort s, 4, x in descending order. x, 4, s Let s be 8/(-12) + (-1)/3. Let c = -4 - s. Sort 2, c, 3 in descending order. 3, 2, c Let h = -0.19 + -7.81. Let z = -26 - -15. Let k = z - h. Put k, 1, -2 in descending order. 1, -2, k Let x = -67/2 + 35. Let w be (-1)/1 + 5/7. Let n = 14 + -17. Put n, x, w in ascending order. n, w, x Let j = 7.4 + -7.9. Sort -0.2, j, 0.6 in decreasing order. 0.6, -0.2, j Suppose 7j - 36 = 4j + 2u, -j + 5u = -12. Let b = 7 - j. Sort 3, b, 0. b, 0, 3 Suppose 5d - 5 = -2c, -4c = c. Let a(n) = n2 - n. Let k be a(2). Sort d, k, 0 in ascending order. 0, d, k Let t(w) = w2 - 4w. Let g be t(4). Let v = -2 + -1. Let i = v - 2. Sort -4, g, i. i, -4, g Let m = 3 - 5. Suppose 1 = 4z + 5. Put m, 1, z in descending order. 1, z, m Suppose h = -0h + 4q + 42, h - 18 = -4q. Suppose h = 4a - 2a. Suppose 4u - 3 = -a. Sort 2, -5, u in increasing order. -5, u, 2 Let d(c) = -c*2 - 14c - 28. Let u be d(-12). Put 3, 0, u in decreasing order. 3, 0, u Let c(g) = -g*2 - 11g + 5. Let r be c(-12). Suppose -2u - 3s = 2u - 36, 0 = 5s - 20. Let i = u + r. Put i, -2, 3 in ascending order. -2, i, 3 Suppose -2i + 4k - 4 = -0k, -2k = i - 6. Suppose -3d + d = 0. Suppose -3 + d = 3b. Sort i, -2, b in ascending order. -2, b, i Let j = 39 + -43. Sort j, 5, -5, -3. -5, j, -3, 5 Let z(s) = -4s3 - 10s*2 - s - 9. Let d(g) = 3g*3 + 9g*2 + 2g + 8. Let h(q) = -5d(q) - 4z(q). Let o be h(6). Sort o, 5, 3 in decreasing order. 5, 3, o Let i be (2/8)/((-4)/(-16)). Let t(s) = -s. Let p be t(5). Put -4, i, p in descending order. i, -4, p Let l = 327/2 - 163. Let a = -2 + 2.4. Put 0.3, a, l in ascending order. 0.3, a, l Suppose 0 = 2z + 5 - 3. Let v(s) = -3s - 41. Let x be v(-13). Put 3, x, z in increasing order. x, z, 3 Let u(j) = 5j - 2. Let i be u(1). Suppose -2c - 15 = ic. Sort 5, c, -2. c, -2, 5 Let p = -38.4 - -44. Let m = 6 - p. Put -3/4, m, -3 in increasing order. -3, -3/4, m Suppose 0 = -7m + 6 + 8. Sort -4, m, 1, 21 in increasing order. -4, 1, m, 21 Let f = 0.6 + -2.6. Let r = -347.97 + 345. Let s = r + -0.03. Sort f, 1/7, s in increasing order. s, f, 1/7 Suppose 3*j =	{ "pile_set_name": "DM Mathematics" }
- 2 wrt q? -4440q3 - 96 Differentiate -17cgr*2 - 3cgr - 52cr*2 - 2cr - 10r*2 with respect to g. -17cr2 - 3cr What is the third derivative of g5 - 470g*3 - 1154g*2? 60g*2 - 2820 What is the second derivative of -332p*2 - 150p wrt p? -664 What is the second derivative of i*3w*3 + 44i*3 - 5i*2w + 5w3 - 4w wrt w? 6i3w + 30w Find the second derivative of 17il2x*3 - 7il2x - il2 + 3ix3 - ix*2 + lx*2 + 2x*3 wrt l. 34ix3 - 14ix - 2i Find the third derivative of 2h3l*3 - 690h*3l*2 - 607h*2l*4 - 6hl2 + 2hl + l4 wrt l. 12h*3 - 14568h*2l + 24l Find the third derivative of -811r*3 - 323r*2 wrt r. -4866 What is the third derivative of -7w*5 - 2w*3 + 2w*2 - 395w wrt w? -420w2 - 12 Find the first derivative of -3819y*4 + 2y*3 - 10099 wrt y. -15276y*3 + 6y*2 Differentiate 3gw3 + 126g - 12w3 - 2w*2 wrt w. 9gw2 - 36w*2 - 4w What is the second derivative of 162m3o*2 - 2m*3 + 10m*2o wrt o? 324m3 What is the second derivative of 9d*5 - 2d*3k*2 - 3d*2k*2 - 105dk2 + 2d wrt d? 180d3 - 12dk2 - 6k*2 What is the third derivative of -637n*4 - 232n*2? -15288n What is the first derivative of 673x3 - 813 wrt x? 2019x2 What is the second derivative of r3t + 8r*3u*2 + 1403r*3 - 2r*2tu - 2rtu + rt - 258tu2 wrt u? 16r*3 - 516t What is the first derivative of -14h2 - 5h - 7568 wrt h? -28h - 5 Find the second derivative of -13f*5 - 173f*2m*2 - f - 3m*2 + 52 wrt f. -260f*3 - 346m*2 What is the first derivative of 37l*2 + l + 296 wrt l? 74l + 1 What is the third derivative of -12a3h*4 - 4a*3 + 2ah4 - 2ah3 - h2 wrt h? -288a*3h + 48ah - 12a Find the second derivative of -j4s*2 + 27j*2s*3 + 57js3 + 3js + 2j + 2 wrt j. -12j2s*2 + 54s*3 Find the second derivative of -3f*5 - 44f*3 - 233f wrt f. -60f3 - 264f What is the third derivative of 3511s5 - 41s*2 + 5? 210660s*2 What is the second derivative of 41o*5p + 6o5 + 144o + 2p wrt o? 820o*3p + 120o3 What is the second derivative of -150o*3 + 3o*2 - o - 44? -900o + 6 Differentiate 129mw*2 - 2mw - 16w*2 + 15w wrt m. 129w2 - 2w What is the second derivative of 7d2i*2k*2 + 2217d*2i + 2di*2 - 14i*2k*2 + 2i*2k + 3k2 wrt k? 14d*2i*2 - 28i*2 + 6 What is the third derivative of 2l*4z*3 - 344l*3z*3 + 21l*2z*3 + 6l*2z wrt l? 48lz*3 - 2064z*3 Differentiate 31aj3oq + 2aj - 2ao3q - 10j3o*2 - 3j*2o*3 with respect to q. 31aj3o - 2ao*3 Find the third derivative of -96m*4 + 3m*3x*3 + 3m*2x*3 - 2m*2x - 11x3 wrt m. -2304m + 18x3 Differentiate 64n*2 + 2n + 8593 wrt n. 128n + 2 What is the third derivative of 11037y*6 - 2y*2 + 70y + 21 wrt y? 1324440y3 Find the third derivative of 560j*3z*4 - 3j*3z*2 + 132j*2z*2 - 2j*2 - jz*4 + 2z*2 wrt z. 13440j*3z - 24jz Find the second derivative of 898i2s2 + i2 + 192s wrt s. 1796i*2 What is the third derivative of -906h*5 + 13h*2 + 1? -54360h*2 Differentiate -9qr4 + 48qr2 - 11q - r*2 - 27 wrt r. -36qr3 + 96qr - 2r Find the second derivative of 997g2v*3 - gv*3 + g + 90v*3 wrt g. 1994v*3 Differentiate -3930q - 811 wrt q. -3930 What is the second derivative of -978u4 - 1383u? -11736u2 What is the third derivative of -2j*3z*3 + 462j*3z*2 + 2j*2 - 9jz - z3 wrt j? -12z*3 + 2772z*2 What is the third derivative of -931mn5 + 9mn2 + 2n*5 + 17n*2 + 1 wrt n? -55860mn2 + 120n*2 Find the second derivative of 669b*2j*3 + bj*2 - 3j*3 + 5j*2 wrt b. 1338j*3 Find the second derivative of -13l*2v - 9l2y*2 - 13lvy + 62vy*2 wrt y. -18l*2 + 124v Find the third derivative of 9op*3 + 2op2 + 151op + 483p*3 wrt p. 54o + 2898 Find the second derivative of 1114z3 + 2z*2 - 530z - 2. 6684z + 4 Find the third derivative of 3h*2y*3 + 6h*2y2 + h2y + 5hy2 - 165y*4 wrt y. 18h*2 - 3960y What is the derivative of 690fq*3 - 225q*3 wrt f? 690q*3 Find the third derivative of 680n*4tv - 33n*2v + 4n2 + 2tv wrt n. 16320ntv What is the third derivative of -353kv*4 + 5kv3 - kv*2 + 2kv + 22v wrt v? -8472kv + 30k What is the second derivative of -811c*5 - 4c*3 - 14714c wrt c? -16220c3 - 24c Find the third derivative of -1609x3 + 70x*2 - 6x wrt x. -9654 Find the second derivative of 13r3s*2 - 3r*3s + 101rs*2 - 2rs - 2s*2 + 72s wrt s. 26r3 + 202r - 4 What is the second derivative of -2i3 - 112i*2s*2 - 2is2 + 52i wrt i? -12i - 224s*2 What is the derivative of -1953q*3 + 3642 wrt q? -5859q*2 What is the derivative of 3r*2u - r*2 - 3ru - 13r - 12657u wrt r? 6ru - 2r - 3u - 13 Find the third derivative of -2a*3o*3 - 9a*3o*2 - 5a*3 - 2a*2o*4 - 35ao3 wrt o. -12a*3 - 48a*2o - 210a What is the second derivative of 10l*2q2 + l2 - 6q3 - 16q + 1 wrt q? 20l2 - 36q Differentiate 196h4 - 257 with respect to h. 784h*3 What is the second derivative of 1790w*2 - 1346w wrt w? 3580 What is the third derivative of 4v4 - 74v*3 + 4v*2 + 114 wrt v? 96v - 444 What is the derivative of 188a2 - 2a + 8033 wrt a? 376a - 2 What is the third derivative of 10a*3s*2y*2 - 2a*3y*2 - 3a*3 - 13a*2s - as2 - asy2 wrt a? 60s*2y*2 - 12y*2 - 18 Find the second derivative of -8827g*4h*3 + 2gh3 + 6500h*3 wrt g. -105924g*2h*3 What is the third derivative of -383d*3i*3 - 3d*3i - d3 + d2 - 30di + 126i3 wrt d? -2298i*3 - 18i - 6 What is the third derivative of -3t6u - t*3u*2 + 56t*2u2 + u2 wrt t? -360t3u - 6u2 Find the second derivative of 582x*4 + x - 618 wrt x. 6984x*2 Find the second derivative of -656b*5 + 54b + 2. -13120b3 What is the first derivative of -392qy3 - 753y*3 wrt q? -392y*3 Find the second derivative of 2p*4 + 942p3 + p2 + 1957p + 2. 24p*2 + 5652p + 2 Differentiate 26h3s*3 + 55hs3 - s3 + 13s*2 - 43s wrt h. 78h2s*3 + 55s*3 Differentiate -15j*3n*2 + 16j*3 - 14j*2n*4 - 15j*2 wrt n. -30j*3n - 56j2n*3 What is the first derivative of 732a + 1100 wrt a? 732 What is the third derivative of -2a6 + 659a*5 + 248a*2 - 1 wrt a? -240a*3 + 39540a*2 What is the first derivative of 7a*2u + 253a2 - 24au2 wrt u? 7a*2 - 48au Find the third derivative of 9949r*4 - 345r*2 + r. 238776r What is the first derivative of 331n - 1258? 331 Find the second derivative of 4h*3o*3 + 183h*3o2 - h3o - 2ho wrt o. 24h*3o + 366h3 What is the first derivative of 3k*2u + 319k2 - 18ku wrt u? 3k*2 - 18k Find the second derivative of -2a4 + 16a*3 + 24a + 4 wrt a. -24a2 + 96a Differentiate 737hv + 584h with respect to v. 737h What is the third derivative of -13b3s*4 + 6b*3s*3 + 40b*3s2 - b2s2 wrt s? -312b*3s + 36b3 Differentiate 43w*3 - 3w + 188 with respect to w. 129w2 - 3 Find the second derivative of 926l*5 - 11l - 2. 18520l3 Find the third derivative of -5q6 + q4 - 18q2 - 7. -600q*3 + 24q What is the first derivative of -4932v2 - 24599? -9864v What is the second derivative of 2792y5 + 28y + 11 wrt y? 55840y3 What is the third derivative of 39a*4fo3 + 2a*4o*3 + 2a*2fo3 + a2o*2 - 8a*2o wrt a? 936afo3 + 48ao3 What is the third derivative of 9a*3t*3 + 172a*3t2 - a3 + 11a2t*2 + 166at3 wrt a? 54t*3 + 1032t*2 - 6 Find the third derivative of -478q*6 - 311q*2. -57360q*3 What is the second derivative of -5i*3n*2 + 234i*3 + 53i*2n*3 - 3n wrt n? -10i3 + 318i*2n Find the first derivative of -120j3 + 2j*2x*3 - 80x*3 wrt j. -360j*2 + 4jx3 What is the third derivative of 784q*6 - 3q4 - q2 - 2942 wrt q? 94080q3 - 72q Find the second derivative of 330c2 - 1032c wrt c. 660 What is the third der	{ "pile_set_name": "DM Mathematics" }
= 19u2 - 13u - 10. Let h(z) = -j(z) + 3s(z). What is -2h(x) - 11v(x)? -x2 + 2x + 2 Let v be (-10)/(-4)(95/(-25) + 1). Let j(g) = 4g + 2. Let l(z) = -3z - 2. Give vl(u) - 6j(u). -3u + 2 Let x(f) = f*2 - f. Let q = 11 - 9. Suppose -14 = m + 3a, qm - 4a - a = 16. Let u(g) = -10g2 + 11g. Give mu(v) - 22x(v). -2v2 Let n(t) = 6t*2 - 3t + 19. Let a(m) = 5m2 - 4m + 18. Calculate -3a(x) + 4n(x). 9x2 + 22 Let s be (-73/(-3))/(0 - -1). Let q(z) = -3z3 + 13z*2 + 3z. Let p(h) = -2h + 9h*2 - 2h*3 - 2h + 6h. What is sp(b) - 5q(b)? b3 - 2b*2 - b Let o(q) = -q + 2. Let j(p) = 2p - 5p - 4p + 7 + 3p. Calculate -4j(w) + 14o(w). 2w Let h(p) = -587p2 + 8p + 8. Let k(d) = 1175d2 - 18d - 18. Determine -9h(j) - 4k(j). 583j2 Let a(x) = 3x*2. Suppose 2v + 0 = -4. Let j(t) = -t*3 - 3t2. Let r(c) = c3 - 12c2 - 11c - 29. Let h be r(13). What is ha(y) + vj(y)? 2y3 - 3y*2 Suppose 0 = d + c - 15, -6 = 2c - 2. Suppose 5w - d = 28. Let t(a) = a + 3. Let x(y) = -5y - 13. Calculate wt(g) + 2x(g). -g + 1 Let p(c) = -c3 + c2. Let f(n) be the second derivative of -21n5/10 + 3n*4 - 125n. Give -f(g) + 36p(g). 6g*3 Let z(w) = 7w*3 + 12w2 + w - 2. Let k(r) = -r3 + r*2 + r - 2. Determine k(f) - z(f). -8f*3 - 11f*2 Let n = -164 - -165. Let s(w) = -2w + 3. Let f(q) = -q - 1. Calculate ns(j) + 3f(j). -5j Suppose 0 = 67v - 232 - 103. Let c(a) = -6a3 - 5a. Suppose 2t = 6t. Let r(f) = -2f - f + tf*3 - 3f*3. Give vr(i) - 3c(i). 3i*3 Let g(h) = -4h*3 - 4 + 0h*3 - 5h + 0h - 6h*2. Suppose -424v = -451v + 162. Let q(j) = 7j*3 + 11j*2 + 9j + 7. Give vq(t) + 11g(t). -2t3 - t - 2 Let b(r) = -4r*3 + 4r*2 + 19r - 7. Let w(d) = 2d3 - 2d*2 - 10d + 4. Calculate 4b(n) + 7w(n). -2n3 + 2n*2 + 6n Let t(l) = 10l + 83. Let n(b) = -4b - 26. Give 14n(s) + 4t(s). -16s - 32 Let f(b) = -19b*3 + 3b. Let w(s) = -15s3 - 4s*2 - 2s. Let i(l) = l3 - l2 - l. Let o(x) = -4i(x) + w(x). What is -2f(j) + 3o(j)? -19j*3 Let v(p) = -42p*2 - 5p + 19. Let o(a) = 41a2 + 7a - 24. Give 4o(s) + 5v(s). -46s2 + 3s - 1 Let n(y) be the third derivative of 7y4/24 - 7y*3/6 + 179y*2. Let f(h) = -8h + 8. Give -5f(z) - 6n(z). -2z + 2 Let j = -7 + 12. Suppose ju = 2r + 25, -2u + 5r + 20 = -11. Let x(z) = 2 + 0z - z + 0z + 6z. Let a(l) = 24l + 10. Calculate ua(c) - 14x(c). 2c + 2 Suppose -3i + 5i + 3r = -2, -r - 2 = 0. Let a(d) = 0d*2 + 2d*2 - 7d + 7 - 4di. Let t(x) = -x2 - 3x + 3. Let q = -45 + 42. What is qa(y) + 7t(y)? -y*2 Let a(r) = -41r*2 + 4r + 2. Let y(z) = 41z2 - 3z - 1. Give -3a(o) - 4y(o). -41o2 - 2 Let j(r) = -357r + 17. Let g(l) = 119l - 5. Determine 14g(n) + 4j(n). 238n - 2 Let c(y) = -30y3 - 2y*2 + 3y + 2. Let k(t) = 31t3 + 3t*2 - 3t - 3. Calculate 3c(g) + 2k(g). -28g3 + 3g Let y(k) = -19k - 9 + 3k + 7k - 4. Let o = -2 + 9. Let x(t) = 4t + 6. Give ox(n) + 3y(n). n + 3 Let c(q) = 2q3 + 2q*2 - 3q - 5. Let v(w) = -3w3 - w2 + 4w + 6. Suppose 5l - z - 19 = 0, -6l + z = -4l - 10. Determine lv(i) + 4c(i). -i3 + 5i*2 - 2 Let h(d) = -13d*2 + d. Let s(t) = 28t*2 - 3t. Determine -5h(c) - 3s(c). -19c2 + 4c Let v(i) = -i. Let b(f) = 21f. Let l(j) = 4j + 2. Let t(h) = 1. Let w(a) = -l(a) + 2t(a). Let d(k) = -5b(k) - 24w(k). What is 2d(p) - 21v(p)? 3p Let n(q) = 3q2 - 43q + 10. Let z(j) = -2j2 + 44j - 12. Determine 6n(c) + 5z(c). 8c2 - 38c Let v(x) = 2. Let d(c) = 5c2 - 4c*2 - 1313 + 1306. Give -4d(p) - 14v(p). -4p*2 Let n(k) = -2k - 4. Let m(z) = -6z - 1. Let w(g) = -2g. Let i be 2/(-5)(-160)/(-8). Let p(o) = iw(o) + 3m(o). Determine 2n(d) - 3p(d). 2d + 1 Let v(d) = -d*3 - 3d*2 + 7d. Let q be v(2). Suppose -4n + 73 = 5. Let m(y) = -7y*2 + 2y. Let x(b) = -20b2 + 5b. What is nm(a) + qx(a)? a*2 + 4a Let t(q) = q*3 - 2q*2 + q + 1. Let b(s) = -8s*3 + 46s*2 - 4s - 4. Calculate -b(g) - 6t(g). 2g*3 - 34g*2 - 2g - 2 Let n(x) = x - 1. Let o(j) = 7j - 57. What is -5n(c) + o(c)? 2c - 52 Suppose -3x = 4i + 45, -33 = 2i + 6x - 3x. Let g(r) = -r + 1. Let s(w) be the third derivative of -7w4/24 + 4w3/3 + w2. What is ig(j) + s(j)? -j + 2 Let q(b) = -5b + 6. Let w(j) = 5j - 6. What is 3q(o) + 4w(o)? 5o - 6 Let z be -8 - -1(-2)/2. Let h be 7 - (6 - 8) - -3. Let a = z + h. Let u(f) = -f - 2. Let b(y) = y3 + 2y + 6. Give ab(m) + 8u(m). 3m3 - 2m + 2 Let w(k) = -3k - 3. Let v(f) = 2f + 1. Suppose -2c + 4g = -4, -5c - 2g - 1 - 1 = 0. Suppose c = -p - 0 - 2. Give pw(l) - 5v(l). -4l + 1 Let t(i) = 3i + 9. Let a(q) = 3q + 9. Let k(x) = 2a(x) - 3t(x). Let b(d) = -d - 4. Let g = 13 + -8. Determine gb(p) - 2k(p). p - 2 Let z(q) = 37q*3 + 16q*2 + 11q - 9. Let t(v) = -17v3 - 8v*2 - 5v + 4. Determine -9t(h) - 4z(h). 5h3 + 8h*2 + h Let f(x) = 10x*2 + x + 7. Let h(t) = -5t*2 - 2t - 4. Let y(n) = 6n2 + 3n + 5. Let o(u) = -3h(u) - 2y(u). Suppose 10 = l + 3. Give lo(j) - 2f(j). j*2 - 2j Let f = -7 - -5. Let p be 120/(-16)f/(-3). Let d(y) = 4y*2 + 5y. Let h(c) = 6c2 + 7c. Let x be (-22)/(-4) - 18/(-12). Determine ph(u) + xd(u). -2u2 Let l(k) be the first derivative of 3k*2/2 + 2k + 4. Let g(j) = 2j - j + 6 - 4 + 2j. Give -3g(w) + 2l(w). -3w - 2 Let i(z) = 3z. Suppose -79o + 55o + 120 = 0. Let t(g) = -5g. Give oi(c) + 2t(c). 5c Let n(m) = 3m + 11. Let t(c) = 3c*2 - c + 1. Let q be t(1). Let x = -95 + 95. Let f be q + ((-4)/(-4) - x). Let r(w) = w + 4. Give fn(d) - 11r(d). d Let c(q) = 9q*2 + 7q - 7. Let w(h) = -3h2 + 1. Let p(r) = -17r*2 - 4r + 8. Let u(d) = p(d) - 4w(d). Determine 6c(x) + 11u(x). -x2 - 2x + 2 Let g(w) = -2w + 1. Let f be g(0). Let c(q) = -2q*2 + 5q + 5. Let y(t) = -t. Calculate fc(x) + 5y(x). -2x2 + 5 Let a = -1033 + 1018. Let n(j) = -12j2 + 15. Let b = 0 - 1. Let y(t) = t2 - 1. Calculate ay(v) + bn(v). -3v2 Let a(t) = 28t + 15. Let l(z) = 17z + 9. Let c(o) = -3a(o) + 5l(o). Let g(d) = -8d. Suppose -2j = -5n + 40, 13 = 2n - 2j - 9. Determine nc(b) + g(b). -2b Let h(r) = r*3 - 21r + r*2 + 2 + 0r*2 + 24r + r2. Let w(n) = -n. Let f(j) = j2 + 2j - 3. Let z be f(-5). Let l = 11 - z. Determine lh(s) - 3w(s). -s3 - 2s*2 - 2 Let v be (-2)/10 - 4/(-20)-34. Let k(u) = 2u3 + 2u*2 - 6u + 4. Let p be (3 - -6)/(6/4). Let b(r) = 2r3 + 2r*2 - 7r + 5. Calculate pb(a) + vk(a). -2a3 - 2a*2 + 2 Let g(q) = -7q*2 + 2q + 4. Let v(t) = 1251 - 619 - 629 + t - 7t2. Give -3g(p) + 4v(p). -7p*2 - 2p Let b(l) be the third derivative of l5/60 + l4/4 + l*3 - 784l2. Let d(s) = s2 + 5s + 5. Calculate 4b(h) - 5d(h). -h2 - h - 1 Let c(n) = -153n*3 + 2n*2 - 6n. Let v(d) = -11628d3 + 153d*2 - 459d. Give -306c(b) + 4v(b). 306b3 Let r(q) = 6q*3 + 49q*2 + 10. Let n(l) = 9l*3 + 73l*2 + 16. Determine -5n(f) + 8r(f). 3f*3 + 27f*2 Let q(w) = w + 35. Let r(i) = 2i + 69. Determine -7q(z) + 4r(z). z + 31 Let t(q) = 11q3 - 5q*2 + 11q. Let f(j) = 16j - 84 + 84 - 29j*2 + 22j*2 + 16j*3. Determine -5f(g) + 7t(g). -3g*3 - 3g Let a(f) = -13 - 44f3 + 7 + 6f + f*2 + 7f*2 + 43f*3 - 3f*2. Let y(g) = -3g*3 + 14g*2 + 17g - 17. Let t be 2(-17)/63. What is ta(j) + 6y(j)? -j3 - j2 Let b(q) = -1 - 206q + 101q + 101q. Let i(t) = 13t + 2. Give 7b(g) + 2i(g). -2g - 3 Let a(y) = 17y + 2. Let i(j) = 4j. Determine a(w) - 5i(w). -3w + 2 Let k(h) = -2h*2 + 2h + 22. Let y(x) = -2x2 + 2x + 21. Determine 4k(m) - 5y(m). 2m2 - 2m - 17 Let s(q) = -q*2 + 3q + 1. Let p(v) = 226v2 + 15v + 5. Calculate -p(y) + 5s(y). -231y2 Let w(c) = 2 + 2 - 3. Let x(p) = -p. Let l(b) = b2 - 18b - 143. Let r be l(-6). Determine rx(z) - 2w(z). -z - 2 Suppose 2a - 4c - 10 = 0, -2a = a + 2c - 7. Let w(m) = 5m*3 - 4m*2 + 2m. Let y(k) = -4k3 + 3k*2 - 2k. Calculate ay(j) + 2w(j). -2j3 + j2 - 2j Let s(j) = -7j2 - 5j + 3. Let v(g) = -g*2 - g. Determine -s(z) + 4v(z). 3z2 + z - 3 Let x(k) = -11k3 + k2 -	{ "pile_set_name": "DM Mathematics" }
n 3, u, 5? u Let c = 1 - 4. Let l = 39.5 + 19. Let n = -59 + l. What is the nearest to 2 in c, -5, n? n Let w be (-5)/10 - (-54)/12. Let q be (332/9)/w + -9. Let t = 13/10 + -17/10. What is the closest to -2 in -0.05, t, q? t Let x(g) = g*2 + 3g - 13. Let k be x(-7). Suppose -30 = -kr - 0. Which is the closest to 0.1? (a) -4 (b) 0.07 (c) -3/2 (d) r b Let f = 143/276 + -17/92. Which is the closest to f? (a) 2/9 (b) -50/9 (c) 0.1 a Let j(a) = -98a*2 + 785a - 3. Let r be j(8). Let d be 26/(-68) + -53/(-30). What is the closest to -2 in 4, r, -2/13, d? -2/13 Let c = -0.22 + -0.28. What is the nearest to 2/5 in -3/20, 5, c, 0.3? 0.3 Let v = 33.3 + -37.3. Let j = 165 - 164. Which is the nearest to j? (a) -0.3 (b) v (c) 0.05 c Let x = -28.8 - -93.5. Let s = x - 0.7. Let d = s - 62. Which is the nearest to -1/4? (a) 18 (b) d (c) -1/7 c Let x be ((-22)/(-242)22/(-8))/((-6)/(-3)). Let t(i) = 6i - 6. Let u be t(-6). What is the nearest to 1/4 in x, u, 0.4? 0.4 Let z = -277 - -276.95. Let u = -10.7 + 11.7. What is the closest to u in z, -4, 4? z Suppose -8 = -4f, -2f + 33 = -5c + 9. What is the nearest to 23 in 5, -5, c, 0.3? 5 Let z = -21.752 - -22. Let t = z + -0.228. Which is the nearest to 4? (a) t (b) 5 (c) -2/7 (d) 3/4 b Let a = 482.898 + -12.898. What is the closest to -0.1 in 3, 1, a? 1 Let q = -1/64206 - 738223/9374076. Let f = q + 24/73. What is the closest to 5/4 in 2/17, -4/7, 2, f? 2 Let j = 3.339 + -8.339. What is the nearest to -208 in -11, 0.1, j? -11 Let v be -7 - (18 + 1692/(-70)) - (-4)/10. What is the closest to 0.2 in -3, -0.4, v? -0.4 Let y be (15/(-120))/(14/(-28)). What is the nearest to 2/13 in -5, 0.1, -3, y? 0.1 Let i = -15894 - -15891. Which is the nearest to 1/4? (a) i (b) 5 (c) -37 (d) 1.5 d Let n = 53642.034 - 53691. Let g = n + -0.034. Let k = -46 - g. What is the nearest to 1/3 in k, -3/8, 2? -3/8 Let y be 0 - -3 - (8 - 1). Let o be (-1)/((-30)/64) + 6/9. Which is the closest to 0.1? (a) y (b) 5 (c) o c Let k be ((-2)/18)/(10/12). Suppose -10y + 65y - 34y + 42 = 0. What is the closest to y in -3, k, -4, -1/2? -3 Let o be ((-4)/(-3) - (19 - 19))-3. Suppose 0b = -b + 1. Let f = 1 - b. What is the closest to f in o, -4/7, 1? -4/7 Let b = 20713/26 - 1593/2. What is the closest to 3.3 in 8, b, 2? 2 Let o = 943 - 659. Let p = o + -279. Which is the nearest to -1/3? (a) 7/4 (b) p (c) 3/4 c Suppose -5w - 10p + 9p = -115, -w + 57 = 7p. Which is the nearest to -20? (a) -0.2 (b) w (c) -1/4 c Let m = -627.7 + 10.7. Let u = -616 - m. Let r = -2 - -1.95. Which is the closest to u? (a) r (b) -2 (c) -4/5 a Let m = -11.044 + 12.044. Let k = -0.6 - -1.1. Which is the closest to m? (a) -0.4 (b) k (c) -10 b Let r = -4647 + 4651. Which is the nearest to 2? (a) r (b) 18 (c) -0.5 (d) 0.2 d Let u = 7 - 20. Let i = 13.3 + u. What is the closest to 7 in i, -1/4, 2? 2 Let w = 60.66 + -61. Let u = w - -47.34. Let y = 47.1 - u. What is the closest to 26 in y, -0.2, 1/4? 1/4 Let g = -0.003 + -0.997. Let s = 25 + -26. Which is the closest to s? (a) 0 (b) 30 (c) g c Let i = 0.17371 - -2.82629. Which is the closest to -7? (a) 0.3 (b) i (c) 0.5 (d) -2/17 d Let f = -0.56 + 0.07. Let v = -3.5264 - -0.0164. Let d = v + f. Which is the closest to 0? (a) -1 (b) -3 (c) d a Let f = -0.016899 - -2.016899. Let k be -1(1 - 12/10). What is the nearest to k in -0.3, f, 0.4? 0.4 Suppose 2a + 581 = -y, 2y + 259 = -2a - 321. Let j = a + 3781/13. What is the closest to 1 in -9, j, 1? 1 Let u = -4145 - -4147. What is the closest to 1 in -3/11, u, -162? u Let z = 3.5 - 3.89. Let s = z + 0.49. What is the closest to 1 in -0.2, 11, s? s Let f = -16411 + 16416. What is the nearest to -4 in 0.4, 0, f, 0.5? 0 Let t be 1(-2)/(-4)4. Let w = -0.67649 + 0.07649. Which is the nearest to 0? (a) w (b) -5 (c) t a Let y(t) = 1013t + 4053. Let o be y(-4). What is the closest to 0 in o, -5/6, 0.2, 9? 0.2 Let m = -46.4 + 46. Let i = -161/12 - -89/3. Let a = i + -333/20. What is the nearest to a in 2/7, m, 3? m Let k = -0.8628 - 3.1372. What is the closest to -3 in 5/3, -3, 1/3, k? -3 Let w = 219.45 - 219.05. What is the closest to -1/4 in -2, w, -2/7, -0.5? -2/7 Let k = 35568 - 35567.9. What is the closest to k in -9.3, -4, 5, 0.8? 0.8 Let o(n) = -n*2 - 8n - 8. Let r be o(-6). Suppose m = f - m + 3, rf + 4m = 24. Which is the closest to f? (a) -0.4 (b) 1.2 (c) 3 c Let p be 406/1680 - ((-36)/32)/(-3). Which is the nearest to -1/2? (a) -2 (b) p (c) -153 b Let w = 128 - 148. Let d = -8 - 13. Let m = d - w. Which is the nearest to m? (a) -0.01 (b) -0.4 (c) -0.2 b Suppose -g - 2 = -0. Let r = 64 - -405. Let w = 468 - r. What is the nearest to w in g, -5, -4? g Let g = -104745 + 104749. Let p be ((-4)/(-10) + 0)-5. Which is the nearest to -11? (a) -0.3 (b) g (c) p c Let j = -111 + 108. Let r be 346/(-84) + 1/(-6) - -4. What is the closest to r in j, -0.1, 0.7? -0.1 Let c = 98 + -86. Let m(u) = -u3 + 11u*2 + 12u - 8. Let j be m(c). Let g be (-7 + 8/4)j/10. What is the closest to -0.04 in -0.1, 3, g? -0.1 Let k = 0.072 + -1.072. Let o be 3(70/945 + (-2 - -2)). Which is the closest to -25? (a) -0.5 (b) o (c) k c Let z = 3192 + -3189. Let f = 0.1 - -0.9. Which is the closest to -1? (a) f (b) z (c) -1/2 c Let s be 7 + (-335)/45 + (-4978)/18. Let d = -4711/17 - s. Which is the nearest to -9? (a) d (b) -3 (c) 2 b Let w = 36 + -32. Let k be (533/(-91) - -6)-2. Which is the nearest to w? (a) -1 (b) -1/2 (c) k c Let w = 667 - 236. Let f = 434 - w. Let n = -2.6 - -0.6. Which is the nearest to 1? (a) f (b) n (c) -4/3 a Suppose -10y + 5 = -25. Suppose yh - v + 0v = -6, -2v + 6 = -3h. Which is the closest to 0? (a) -8 (b) -3 (c) h c Suppose 146 = 7t + 6. Let p be (-125)/(-180) + t/(-45). Which is the nearest to p? (a) -9 (b) -3/7 (c) 0.2 c Let p be (2/(-24))/(16/312). Let d be (24/(-896))/((-3)/214 - 0). Let r = d + p. What is the nearest to r in 0, 0.2, 6? 0.2 Let y = 119/20 - 31/5. What is the closest to y in 9, -1, 5? -1 Let u = 27519 + -27521. Let j = -4 - -8. Let m = -5 - -6. What is the closest to u in -1, m, j? -1 Let t = -12445 + 12432. What is the nearest to 0.1 in 3/11, -5, 2/15, t? 2/15 Let u be 102/120 - 1/4. Let f = -0.022 + -0.004. Let s = f - -0.026. Which is the nearest to s? (a) u (b) 1/2 (c) -2 b Let g be (-1 + -1)/(2 - 1). Let r = 11266 - 11271. Which is the closest to r? (a) g (b) -2/3 (c) 1 a Let q = -79334 - -79334.07. Let l(u) = u2 - 5u - 10. Let i be l(7). Let v be (i/(-6))/(35/30). Which is the closest to -2? (a) v (b) q (c) -3/8 a Let w = 2852/26733 - 2/1407. Which is the nearest to -0.04? (a) 62 (b) -2/7 (c) w c Let x = -120.3 - 27.7. Let d = x - -147. Which is the nearest to -1? (a) 2/5 (b) d (c) -11 b Let a = -0.2 + -0.8. Let g = 120 + -362/3. What is the nearest to g in a, 3, 0.2? a Let r be 324/126196/126. Let b be 2/5 + 6/(-40). What is the closest to b in -3, r, -7? -3 Let x = -11816 + 11819. What is the closest to 3/2 in x, -5, -0.4, 0.3? 0.3 Let y = 0.046 - 29.646. Let j = y + 28.6. What is the nearest to -1/4 in j, -1/5, -0.08? -1/5 Let m(v) = -v + 10. Let k be m(7). Let z be (7 - (-1342)/(-183))(-1 + 0). Which is the closest to z? (a) 0.2 (b) k (c) 0.5 a Let v = -2875 + 2687. Which is the closest to 1? (a) -0.4 (b) -1 (c) v a Let i = 9628 + -9628.1. Which is the closest to -2/7? (a) -0.4 (b) -3 (c) i (d) -0.151 a Let x = 462 - 462. Let m be (7 - (-5 - -12)) + x. Suppose 0l + 20 = -3l - 5o, 4l + 4o + 24 = 0. What is the nearest to m in 4, l, -0.5? -0.5 Let v = -8458 - -25373/3. Let u = 8/17 - 22/119. Let d = -1 - 4. Which is the nearest to u? (a) 2/11 (b) v (c) d a Let d = 3/200 - -97/200. Let h = -113 - -113.2. Let i = -1 - -1. Which is the closest to -2/3? (a) h (b) d (c) i c Let v be (-8)/36 - 13/(-18). Let l = -3.535 + 5.535. What is the nearest to l in v, -0.5, 0.2? v Let h = 1067.3 - 930. Let y = h + -137. Let w = -2.9 - -3. What is the closest to w in 4, y, 1/9? 1/9 Suppose -3z + 42 = 3o, 2o + o + 21 = 4z. Let f be (-1 + 1)/1 + -3. Let k = 38938 + -38938.1. What is the closest to k in 0, z, f? 0 Let m = 135 + -125. Let q be (-12)/(-9)(9 - m). Let w = 176 + -178. What is the closest to -1	{ "pile_set_name": "DM Mathematics" }
integer? 18 What is 14352 to the power of 1/7, to the nearest integer? 4 What is 1879 to the power of 1/2, to the nearest integer? 43 What is the cube root of 2318 to the nearest integer? 13 What is 5539 to the power of 1/3, to the nearest integer? 18 What is 47952 to the power of 1/2, to the nearest integer? 219 What is the fifth root of 56700 to the nearest integer? 9 What is the ninth root of 3766 to the nearest integer? 2 What is the third root of 44718 to the nearest integer? 35 What is 4521 to the power of 1/3, to the nearest integer? 17 What is the cube root of 1821 to the nearest integer? 12 What is the cube root of 95 to the nearest integer? 5 What is the cube root of 54481 to the nearest integer? 38 What is the fifth root of 3717 to the nearest integer? 5 What is the square root of 19882 to the nearest integer? 141 What is 6406 to the power of 1/2, to the nearest integer? 80 What is the square root of 22600 to the nearest integer? 150 What is 105805 to the power of 1/3, to the nearest integer? 47 What is 212 to the power of 1/2, to the nearest integer? 15 What is 102436 to the power of 1/2, to the nearest integer? 320 What is the fifth root of 489 to the nearest integer? 3 What is 42105 to the power of 1/2, to the nearest integer? 205 What is 2938 to the power of 1/4, to the nearest integer? 7 What is 1910 to the power of 1/3, to the nearest integer? 12 What is the ninth root of 209 to the nearest integer? 2 What is 25511 to the power of 1/2, to the nearest integer? 160 What is 5039 to the power of 1/5, to the nearest integer? 6 What is 5400 to the power of 1/7, to the nearest integer? 3 What is the seventh root of 5481 to the nearest integer? 3 What is the cube root of 122482 to the nearest integer? 50 What is the eighth root of 7296 to the nearest integer? 3 What is 21620 to the power of 1/2, to the nearest integer? 147 What is the square root of 566 to the nearest integer? 24 What is the third root of 99 to the nearest integer? 5 What is the square root of 27687 to the nearest integer? 166 What is the cube root of 175541 to the nearest integer? 56 What is 21412 to the power of 1/8, to the nearest integer? 3 What is 43720 to the power of 1/3, to the nearest integer? 35 What is the cube root of 897 to the nearest integer? 10 What is 14687 to the power of 1/8, to the nearest integer? 3 What is 405 to the power of 1/6, to the nearest integer? 3 What is 2829 to the power of 1/10, to the nearest integer? 2 What is 184 to the power of 1/8, to the nearest integer? 2 What is the eighth root of 19805 to the nearest integer? 3 What is 1835 to the power of 1/3, to the nearest integer? 12 What is 22542 to the power of 1/2, to the nearest integer? 150 What is the ninth root of 1118 to the nearest integer? 2 What is the square root of 22036 to the nearest integer? 148 What is 1023 to the power of 1/3, to the nearest integer? 10 What is the square root of 92042 to the nearest integer? 303 What is the cube root of 1167 to the nearest integer? 11 What is 369 to the power of 1/3, to the nearest integer? 7 What is the third root of 32135 to the nearest integer? 32 What is 745 to the power of 1/2, to the nearest integer? 27 What is 2052 to the power of 1/3, to the nearest integer? 13 What is 919 to the power of 1/7, to the nearest integer? 3 What is the square root of 96761 to the nearest integer? 311 What is 34804 to the power of 1/9, to the nearest integer? 3 What is 1307 to the power of 1/2, to the nearest integer? 36 What is the fourth root of 62 to the nearest integer? 3 What is the square root of 1143 to the nearest integer? 34 What is 2668 to the power of 1/2, to the nearest integer? 52 What is 1815 to the power of 1/3, to the nearest integer? 12 What is 192 to the power of 1/3, to the nearest integer? 6 What is the cube root of 9901 to the nearest integer? 21 What is the third root of 14580 to the nearest integer? 24 What is the fifth root of 679 to the nearest integer? 4 What is the fifth root of 8090 to the nearest integer? 6 What is 36240 to the power of 1/2, to the nearest integer? 190 What is 45129 to the power of 1/10, to the nearest integer? 3 What is 736 to the power of 1/2, to the nearest integer? 27 What is the square root of 1212 to the nearest integer? 35 What is 2072 to the power of 1/6, to the nearest integer? 4 What is 634 to the power of 1/2, to the nearest integer? 25 What is the cube root of 13146 to the nearest integer? 24 What is the square root of 537 to the nearest integer? 23 What is the eighth root of 1453 to the nearest integer? 2 What is the seventh root of 11441 to the nearest integer? 4 What is 685 to the power of 1/3, to the nearest integer? 9 What is 68 to the power of 1/9, to the nearest integer? 2 What is 14851 to the power of 1/2, to the nearest integer? 122 What is the cube root of 17547 to the nearest integer? 26 What is the cube root of 463 to the nearest integer? 8 What is the cube root of 14620 to the nearest integer? 24 What is the eighth root of 943 to the nearest integer? 2 What is the seventh root of 197 to the nearest integer? 2 What is 2063 to the power of 1/3, to the nearest integer? 13 What is the ninth root of 6464 to the nearest integer? 3 What is 32552 to the power of 1/2, to the nearest integer? 180 What is the square root of 1926 to the nearest integer? 44 What is the third root of 2726 to the nearest integer? 14 What is 11201 to the power of 1/3, to the nearest integer? 22 What is 27259 to the power of 1/2, to the nearest integer? 165 What is the eighth root of 96188 to the nearest integer? 4 What is the cube root of 19567 to the nearest integer? 27 What is the tenth root of 57 to the nearest integer? 1 What is the tenth root of 7375 to the nearest integer? 2 What is the square root of 11532 to the nearest integer? 107 What is 35032 to the power of 1/8, to the nearest integer? 4 What is 6349 to the power of 1/3, to the nearest integer? 19 What is the fifth root of 17469 to the nearest integer? 7 What is the square root of 39476 to the nearest integer? 199 What is the third root of 9103 to the nearest integer? 21 What is the cube root of 56027 to the nearest integer? 38 What is the tenth root of 16545 to the nearest integer? 3 What is 399 to the power of 1/7, to the nearest integer? 2 What is 12924 to the power of 1/4, to the nearest integer? 11 What is the sixth root of 79510 to the nearest integer? 7 What is 63474 to the power of 1/3, to the nearest integer? 40 What is 4229 to the power of 1/2, to the nearest integer? 65 What is the cube root of 3563 to the nearest integer? 15 What is the eighth root of 4284 to the nearest integer? 3 What is the third root of 2147 to the nearest integer? 13 What is 32826 to the power of 1/3, to the nearest integer? 32 What is the ninth root of 34797 to the nearest integer? 3 What is 1053 to the power of 1/4, to the nearest integer? 6 What is 1543 to the power of 1/5, to the nearest integer? 4 What is the third root of 29746 to the nearest integer? 31 What is the square root of 3751 to the nearest integer? 61 What is the cube root of 116245 to the nearest integer? 49 What is 105448 to the power of 1/2, to the nearest integer? 325 What is 82590 to the power of 1/2, to the nearest integer? 287 What is the square root of 1034 to the nearest integer? 32 What is the cube root of 8542 to the nearest integer? 20 What is the square root of 51442 to the nearest integer? 227 What is the square root of 248 to the nearest integer? 16 What is the eighth root of 893 to the nearest integer? 2 What is the square root of 904 to the nearest integer? 30 What is the fifth root of 74044 to the nearest integer? 9 What is 26205 to the power of 1/3, to the nearest integer? 30 What is the square root of 3743 to the nearest integer? 61 What is 47532 to the power of 1/8, to the nearest integer? 4 What is 111744 to the power of 1/4, to the nearest integer? 18 What is 17314 to the power of 1/3, to the nearest integer? 26 What is 17046 to the power of 1/4, to the nearest integer? 11 What is 1069 to the power of 1/2, to the nearest integer? 33 What is the cube root of 8678 to the nearest integer? 21 What is 814 to the power of 1/3, to the nearest integer? 9 What is 2545 to the power	{ "pile_set_name": "DM Mathematics" }
+ 5p = -17, 0u - 4p = -3u + 13 for u. 3 Solve x + 8f - 3 = 10f, 0 = -2x - 3f + 6 for x. 3 Solve -4v + 18 = v + x, -5v + 3x = -26 for v. 4 Solve 2 = 2p + b - 5, -4p + 18 = -2b for p. 4 Solve -3h - 9a = -8a + 6, -h + 2a - 9 = 0 for h. -3 Solve -3j + 19 = -x + 35, 5j = -2x - 23 for x. 1 Solve -5w = -a - 12, 5w - 2a - 9 = 5 for w. 2 Solve -5t - 5w + 25 = 0, 2t + 4w - 10 = -0t for t. 5 Solve 0 = j - 3n + 9, -19j + 15j + 15 = 5n for j. 0 Solve -2t = 4p - 0p - 4, 5p - 3 = -3t for t. -4 Solve -4q + 5r - 25 = 0, 0q - q + 5 = r for q. 0 Solve -3j = 2v + 34 - 18, 0 = -5v - 5j - 30 for v. -2 Solve 5r = b - 2b - 12, -4b + 15 = -r for r. -3 Solve -2q = 3a + 8, 0 = -5q - 3a - 7 - 4 for q. -1 Solve -4m - 13 = a - 2m, -22 = -a + 5m for a. -3 Solve 5l + 2 = -j, -l - 6 = 3j - 4l for j. -2 Solve -10t + 6t - 16 = -4d, 0 = -t - 4d + 6 for t. -2 Solve -2 = -5l - 5g + 3g, -2l + g = 1 for l. 0 Solve -26z + 22z - 2r = 14, -5z - 2r = 16 for z. -2 Solve 4i - 4 = -2o, -19i + 20i + 8 = -5o for o. -2 Solve 8t - 8 = -4u + 6t, 8 = -2t for u. 4 Solve 0 = 4o + 4l + 32, 3o - l - 10 = -18 for o. -4 Solve -5m - 6 - 25 = 3l, -2m - 5l - 20 = 0 for m. -5 Solve -2x + 16 = -6u, -3u + 0u = 9 for x. -1 Solve 3n + n = 4t - 32, 20 = -n + 5t for n. -5 Solve 2h - 2i = -2 - 2, i - 11 = -2h for h. 3 Solve -4c - c - 5a = 0, -2c - 5a + 3 = 0 for c. -1 Solve -87 = x - 85, 0 = -4c + 5x + 2 for c. -2 Solve -5a - 5u = -10, -5u + 43 = 3a - 9a for a. -3 Solve -3i = 3b + 3, 0 = -2b + 2i - 3 + 1 for b. -1 Solve 4o = -h - 2, 4h + o + 3 + 5 = 0 for h. -2 Solve -3l - 17 = -4b + 2l, 11 = 2b - 5l for b. 3 Solve s = 7c - 12c - 14, -3s = 3c + 18 for s. -4 Solve -u = -5q - 21 - 8, -5u = -2q - 30 for q. -5 Solve 0 = -v - 2u + 4, 0 = -2u + 7u for v. 4 Solve -3j + 2j = -3g - 9, 5j = 0 for g. -3 Solve -15 = 2w + j, 2j + j - 5 = 4w for w. -5 Solve 9 = -2k - 3x, -4k - 1 = -k + 2x for k. 3 Solve -5z = 3b + 16, -2z + 3b - 7 = 4b for z. -5 Solve 3t - 4 = -4w - 0w, t = 4w + 12 for t. 4 Solve 0 = 2c - 4, 5c + 0c = l + 14 for l. -4 Solve -3g + c - 14 = 0, g + 4c + 1 = -8 for g. -5 Solve -5x + t = -20, 0x + 15 = 4x - t for x. 5 Solve 3a - 8 = 4n, 5n + a + 4a = -45 for n. -5 Solve -10 = -3y - 2d, 2y - 17d - 7 = -18d for y. 4 Solve 11 = n - 380h + 383h, -3n + 2h = 0 for n. 2 Solve 0 = 3s + j - 10, -3j = -4s + 10 + 12 for s. 4 Solve -5c - 5j - 21 = -c, c + 1 = 3j for c. -4 Solve 4d = -3o + o + 14, 0 = -3d + 15 for o. -3 Solve -2z + 5z = -5a + 14, -3z = a + 2 for a. 4 Solve -5o - 5y + 3 = -7o, -3y - 3 = 0 for o. -4 Solve 3t - 4t - 8 = -4m, 3t = -m + 2 for m. 2 Solve 2g - 4 = -4j, 1 = 39j - 38j + 2g for j. 1 Solve 5d = -5k - 10, -3d + 26 = -3k - 2k for k. -4 Solve -4t + 2o = -26, -2t - 4o - 34 + 22 = 0 for t. 4 Solve 0 = 4q + 3g + 6, 0 = -2g - 71 + 67 for q. 0 Solve -d = -3a - 14, -6 = 3a + d + 2d for a. -4 Solve -2w + 26 - 16 = -3d, -w + 5 = 3d for d. 0 Solve -3t = u - 2t, -u + t = 0 for u. 0 Solve -r - 3 + 10 = -3w, -5w = -3r + 13 for w. -2 Solve -3f + 12 = -2x, -5f - 8x + 6x = -4 for f. 2 Solve 4w = -5f + 8w + 12, 0 = -4f + 2w + 6 for f. 0 Solve 524v - 526v + 3 = -i, 15 = -5i + 2v for i. -3 Solve k = -5s - 14 - 3, -4s + 2k - 8 = 0 for s. -3 Solve 2t = -5n + 11, 0 = -29n + 33n + 4t - 4 for n. 3 Solve -4n = b + 7, -3n = 4b + 170 - 168 for n. -2 Solve 2l = -5s + 150 - 155, 19 = 4s - 3l for s. 1 Solve 0 = -o + 4g + 12, -4o + 5o + 8 = -g for o. -4 Solve -3a - 4m - 13 = 0, 0a + 3m + 16 = 4a for a. 1 Solve -4n - 5t = 7 + 16, -2n + t - 1 = 0 for n. -2 Solve 4d + 2u = 6d - 4, 0 = 2d - u for d. -2 Solve -3n = 5v + 11, -2n + 8v - 3 = 7v for n. -2 Solve 5z - 4 = -4v - 1, 0 = -5v + 2z - 21 for v. -3 Solve -3p + 2x = 13, 2p + 3 + 1 = -x for p. -3 Solve 1 + 16 = 2r - 5l, 0 = -4r + 5l + 19 for r. 1 Solve -5m - g + 27 = 0, 16 = 14m - 12m + 3g for m. 5 Solve -5 = -5o + 5d, -o + 4d + 11 = -5 for o. -4 Solve 0n - 5 = n + g, 4g = n - 10 for n. -2 Solve -3f = 5i + 10, 0 = -f + i + 11 - 1 for f. 5 Solve -2y + 20 = -5n - y, 2y = 0 for n. -4 Solve -3v + 5j + 1 = 0, 4v - 4j = -0v - 4 for v. -3 Solve 4k + n - 23 = 0, -15k - 4n = -12k - 27 for k. 5 Solve -11n + 6n - 20 = 5h, 0 = 5n - 3h - 12 for n. 0 Solve 0 = g - 2r + 1, -2r + 5r - 9 = 3g for g. -5 Solve -2n = 2l + 14, -2n = 4l - 8 + 26 for n. -5 Solve 2w = 4l - l + 1, 2w = 4l + 4 for l. -3 Solve 0 = 4q - 4i - 2 + 6, -17 = 5q - 2i for q. -5 Solve 4s - 2s - 5 = 5g, -s = 0 for g. -1 Solve -p - 4 = 2t - 4p, t - 2p = -1 for t. -5 Solve 9 = -4b - 3u, 0 = 3b - 13u + 10u + 12 for b. -3 Solve u + 2 = -0g + 3g, 3u = g - 14 for u. -5 Solve -5x = -x + h + 16, 0 = 3x - h + 19 for x. -5 Solve 5i + 16 - 5 = -2u, -3i + 12 = -5u for i. -1 Solve -3g - 3t + 70 - 55 = 0, 20 = 5t for g. 1 Solve -30z = -31z + 3r - 14, -5z = -2r + 5 for z. 1 Solve -b - 11 = -5o, -5o + 3b + 4 = 1 for o. 3 Solve -5a = 2z - 19, -2a + 5z = 3z - 2 for a. 3 Solve -2n - 20 = -2l, -4l - 6n = -3n - 5 for l. 5 Solve 3n - 4q - 16 = 16, 4n = -3q + 1 for n. 4 Solve 2o + 5 = -l - 0l, 0 = -5l - 4o - 7 for l. 1 Solve -3c = d + 12, 6 = -3c + 4d - 21 for c. -5 Solve -2w - 4x = 6, -9x - 6 = -6x for w. 1 Solve -5j + 5h = -10, 0j + 2h + 4 = -j for j. 0 Solve 5m - 40 = -3o, -4m - 247o - 5 = -252o for m. 5 Solve -2u - 3 = 5r, 0 = -u - 2r - 2 + 1 for u. 1 Solve 5r + 33 = 2x - 6, -4x + r + 15 = 0 for x. 2 Solve q - 9 = -4u - 14, 2q - 2u = 0 for q. -1 Solve -139d = -135d + 3p - 27, 0 = -5d - p + 20 for d. 3 Solve -4f - 4 = 4, b + 2 = f for b. -4 Solve 2b - 13 = -3, -5n - 5b = -30 for n. 1 Solve 2p + z + 15 = 4z, -3p - 15 = -3z for p. 0 Solve 4g + 9y + 38 = 4y, 30 = -5y for g. -2 Solve -5s = -3d + 11, -28d - 5s = -25d - 1 for d. 2 Solve -2n - b + 2b + 2 = 0, 0 = -2b + 4 for n. 2 Solve 3q + 4 = 2p, 3 = -5p + 5q + 18 for p. 5 Solve 0 = -5u + 4m + 11, -3u - 4m + 17 = -9m for u. -1 Solve 2b - 3r = -6, 5r + 4 = b + 14 for b. 0 Solve -o - 6 = v, 4o - 8v + 3 = -5v for o. -3 Solve 5i - 4d + 35 = 0, -i - 13 = -d - 5 for i. -3 Solve -n + 2n = -8f + 6, -3 = f + 2n for f. 1 Solve -l + 10 = p - 3l, -12 = -4p + l for p. 2 Solve -2w - 12 = 2g - 18, -2g = 4w - 14 for w. 4 Solve -3f + 4k = -19, -2k - 4 = -4f + 8 for f. 1 Solve 5g + 3l - l = 30, -5g + 35 = 3l for g. 4 Solve 5t - 4s = 15, 3s = 3t + s - 7 for t. -1 Solve 4p + a = 6a + 32, -2a = 5p - 7 for p. 3 Solve -l - 10 = 5h, h - 4l = -30 + 7 for h. -3 Solve 5o - 6u - 16 = -2u, 0 = -5o + 3u + 17 for o. 4 Solve 0 = 2t - h - 13, -4h - 7 = -3t - 5h for t. 4 Solve 3 = 3k + 3v, -366k + 368k - v + 4 = 0 for k. -1 Solve j + 1 = -g + 3, 0 = -2g - 4j + 4 for g. 2 Solve -3n + 5t - 13 = 0, -5n - 3t + 23 = -12 for n. 4 Solve 4 = 5l + 19, 4i = -2l + 6 for i. 3 Solve 4w - 2 - 3 = 5d, 0 = 4d - 2w + 10 for d. -5 Solve 4g + 0v = 3v - 24, -3g + 5v - 18 = 0 for g. -6 Solve -4j = 4c - 4 - 4, 5j + 15 = 0 for c. 5 Solve 4a = 16, 0 = 3c + a - 6 - 7 for c. 3 Solve -3n = -n - 4h - 2, 3h + 14 = -n for n. -5 Solve 5n - 62r + 9 = -50r, 2r - 1 = n for n. 3 Solve 24i - 22i - 12 = 4u, -5i = -2u - 22 for u. -1 Solve -5n + 12 = 4i, 0 = -4i + 4n + n - 28 for i. -2 Solve -2y - y - 29 = 5w, y + 5w = -23 for y. -3 Solve 7g = -h + 2g + 7, -5h - 23 = -4g for h. -3 Solve -5q + 4h + 22 = 6, -5q - 2h = 8 for q. 0 Solve -3n - 2v - 15 = 0, -3n + 8 - 23 = -5v for n. -5 Solve -3i - 2i = 3g, 0 = -g + 5i for g. 0 Solve -5n - 5 = 5p, -3n + 24 = -5p + 19 for p. -1 Solve -15 = -5v, -2 = 2w + 2v - 8 for w. 0 Solve 3z - 2l = 8z, 2z - l = -9 for z. -2 Solve -7 = -2n + 3t, -5 = -5n - 20t + 25t for n. -4 Solve -15c + 25 = -4a - 20c, -3c - 15 = 0 for a. 0 Solve -8s + 4s = 3w - 26, w = s - 3 for w. 2 Solve 0 = 2n - t + 3, -n = -6n - 4t - 40 for n. -4 Solve 0 = 2s - 2t, 98t - 96t = -5s + 35 for s. 5 Solve -5b - 45g = -49g + 5, 5b + 3g - 30 = 0 for b. 3 Solve 5b = -2o - 13, 4o - 2o = 5b + 17 for o. 1 Solve 4t - t - f =	{ "pile_set_name": "DM Mathematics" }
1/5 of a decade in months? 24 How many years are there in 22773.6 centuries? 2277360 What is 0.82457 millilitres in litres? 0.00082457 What is 246006.8mm in meters? 246.0068 How many decades are there in 1/20 of a millennium? 5 Convert 59799.82 kilometers to nanometers. 59799820000000000 Convert 3176.861m to nanometers. 3176861000000 Convert 0.1736016 decades to months. 20.832192 How many nanometers are there in 3/8 of a micrometer? 375 How many seconds are there in 5731.128 minutes? 343867.68 What is 6/25 of a kilometer in meters? 240 What is three fifths of a meter in centimeters? 60 What is three eighths of a micrometer in nanometers? 375 Convert 0.0620925 litres to millilitres. 62.0925 What is 849.3821kg in nanograms? 849382100000000 How many months are there in 30673.73 centuries? 36808476 How many nanometers are there in 47376.6 micrometers? 47376600 How many hours are there in seven thirds of a week? 392 What is one fifth of a tonne in kilograms? 200 How many milligrams are there in 988.1352ug? 0.9881352 How many millimeters are there in 1/16 of a kilometer? 62500 How many millimeters are there in 0.1704723 micrometers? 0.0001704723 How many micrometers are there in 148.246 centimeters? 1482460 How many grams are there in 3/40 of a kilogram? 75 How many millilitres are there in thirty-four fifths of a litre? 6800 How many millilitres are there in 5109.403 litres? 5109403 Convert 4587.985 micrograms to grams. 0.004587985 What is 7/4 of a week in hours? 294 How many millilitres are there in one fifth of a litre? 200 What is 4482.191cm in micrometers? 44821910 What is 4.509397 litres in millilitres? 4509.397 What is 2226.532 millennia in decades? 222653.2 What is 5109.18 millennia in months? 61310160 How many litres are there in 197.8864ml? 0.1978864 What is 632.4688s in nanoseconds? 632468800000 What is six fifths of a litre in millilitres? 1200 What is three eighths of a litre in millilitres? 375 What is 27/5 of a micrometer in nanometers? 5400 How many millennia are there in 7775.644 centuries? 777.5644 How many years are there in three tenths of a decade? 3 How many millilitres are there in 982.505 litres? 982505 How many months are there in 99.14537 millennia? 1189744.44 How many milligrams are there in twenty-six fifths of a gram? 5200 Convert 8.585382ms to nanoseconds. 8585382 What is 13320.97ml in litres? 13.32097 What is 18/7 of a week in minutes? 25920 Convert 595680.8 decades to years. 5956808 How many decades are there in 0.1434092 years? 0.01434092 What is 1/5 of a litre in millilitres? 200 How many milligrams are there in 45/2 of a gram? 22500 What is 6.26974 litres in millilitres? 6269.74 Convert 7407.71 micrograms to grams. 0.00740771 How many millilitres are there in eleven halves of a litre? 5500 How many minutes are there in 45/8 of a week? 56700 Convert 59775.99 decades to centuries. 5977.599 How many millennia are there in 96245.03 decades? 962.4503 What is 3/10 of a litre in millilitres? 300 How many millilitres are there in 3/40 of a litre? 75 What is eight thirds of a week in minutes? 26880 Convert 325665.5um to kilometers. 0.0003256655 What is 52663.99 centimeters in meters? 526.6399 Convert 9699.466 grams to tonnes. 0.009699466 Convert 626762.9 weeks to seconds. 379066201920 Convert 338.04117 seconds to hours. 0.093900325 How many nanograms are there in one twentieth of a milligram? 50000 Convert 87.1442s to milliseconds. 87144.2 What is 2.427423 millilitres in litres? 0.002427423 What is seventeen quarters of a litre in millilitres? 4250 How many centuries are there in 20.971863 months? 0.0174765525 What is 10471.91ms in microseconds? 10471910 What is 18.48139 hours in seconds? 66533.004 How many micrometers are there in seventeen quarters of a centimeter? 42500 How many milligrams are there in 25/4 of a gram? 6250 How many months are there in 7/2 of a decade? 420 What is 3/40 of a centimeter in micrometers? 750 How many micrograms are there in 1/4 of a milligram? 250 How many kilometers are there in 178296.6 meters? 178.2966 Convert 7.158841 milligrams to tonnes. 0.000000007158841 Convert 8257.846ml to litres. 8.257846 How many millimeters are there in 744.9725cm? 7449.725 How many kilograms are there in 93222.79 grams? 93.22279 How many years are there in fifty-three fifths of a decade? 106 What is 1/5 of a litre in millilitres? 200 What is 8/3 of a hour in seconds? 9600 Convert 8.534456 millennia to years. 8534.456 How many hours are there in 7/3 of a week? 392 What is four fifteenths of a millennium in months? 3200 How many millilitres are there in 984.565l? 984565 What is 0.4387 micrograms in kilograms? 0.0000000004387 How many micrometers are there in twenty-one quarters of a millimeter? 5250 Convert 8317.144 nanoseconds to microseconds. 8.317144 What is 281.7477ng in micrograms? 0.2817477 How many micrometers are there in 3/40 of a meter? 75000 What is 906668.4 meters in centimeters? 90666840 How many nanograms are there in 2/125 of a microgram? 16 How many millennia are there in 299327.31 months? 24.9439425 Convert 0.5830531mg to grams. 0.0005830531 What is 1/6 of a minute in milliseconds? 10000 Convert 26.24483 minutes to seconds. 1574.6898 How many minutes are there in 9/14 of a week? 6480 What is 7.80088l in millilitres? 7800.88 What is 8.653963 millilitres in litres? 0.008653963 What is 3/32 of a millennium in months? 1125 What is 1/20 of a second in microseconds? 50000 What is eleven quarters of a millennium in decades? 275 How many nanometers are there in 371323.9 meters? 371323900000000 What is 27/4 of a millimeter in micrometers? 6750 How many millimeters are there in 21/5 of a centimeter? 42 How many hours are there in fifteen quarters of a week? 630 What is six fifths of a litre in millilitres? 1200 What is 37/2 of a litre in millilitres? 18500 What is two fifteenths of a week in minutes? 1344 What is 3/5 of a decade in years? 6 How many grams are there in 25/2 of a kilogram? 12500 What is 0.9611594 tonnes in kilograms? 961.1594 How many hours are there in four thirds of a week? 224 Convert 355.1742cm to nanometers. 3551742000 How many nanoseconds are there in seven eighths of a microsecond? 875 What is seventeen quarters of a gram in milligrams? 4250 How many millimeters are there in 74/5 of a meter? 14800 How many millennia are there in 0.0578265 centuries? 0.00578265 How many milligrams are there in 7295.903g? 7295903 What is 17/2 of a week in hours? 1428 Convert 0.3850956 litres to millilitres. 385.0956 How many litres are there in 821.3688ml? 0.8213688 How many litres are there in 0.2627321ml? 0.0002627321 How many meters are there in 16.95108 centimeters? 0.1695108 What is 15/4 of a microgram in nanograms? 3750 How many decades are there in fifty-four fifths of a millennium? 1080 How many months are there in twenty-one halves of a century? 12600 How many decades are there in 14327.99 millennia? 1432799 How many nanometers are there in 572.2434m? 572243400000 What is 712.5129l in millilitres? 712512.9 What is 3/10 of a gram in milligrams? 300 How many months are there in 3225.91 years? 38710.92 What is 43846.55t in milligrams? 43846550000000 How many months are there in five sixths of a year? 10 What is thirty-two fifths of a millisecond in microseconds? 6400 What is 5/4 of a litre in millilitres? 1250 What is 57.24451 litres in millilitres? 57244.51 What is fifty-one fifths of a millimeter in micrometers? 10200 How many centimeters are there in 6499.05 meters? 649905 What is 98325.05 litres in millilitres? 98325050 Convert 0.3529144 decades to centuries. 0.03529144 Convert 0.973234nm to micrometers. 0.000973234 What is one tenth of a microsecond in nanoseconds? 100 Convert 4.512513mg to grams. 0.004512513 How many millimeters are there in 5844.428km? 5844428000 How many meters are there in fourty-three halves of a kilometer? 21500 How many micrometers are there in 25/4 of a millimeter? 6250 What is twenty-three sixths of a century in months? 4600 What is 21/5 of a milligram in micrograms? 4200 How many micrometers are there in 25/4 of a millimeter? 6250 What is 51/2 of a decade in years? 255 What is two fifteenths of a decade in months? 16 How many months are there in 4/3 of a year? 1	{ "pile_set_name": "DM Mathematics" }
be the first derivative of i(u). Let p(q) = 2q2. Determine h(p(o)). -24o*4 Let a(i) = 2i*2 + 189. Let j(k) = 44k*2. Give a(j(c)). 3872c*4 + 189 Let m(a) = 5a. Let z(u) = 2u2 + u - 1. Let o be z(1). Let w(g) = -6g*o + 3g*2 + 4g*2 + 2g*2. Give w(m(b)). 75b*2 Let a(l) = 2l. Let b(i) be the third derivative of -7i5/60 + 4i*2. Give a(b(w)). -14w*2 Let t(h) = -37h. Let q(x) be the third derivative of -x*5/60 - 46x*2. Give t(q(g)). 37g*2 Let t(o) = 213o - 2. Let c(a) = 3a2. Calculate t(c(u)). 639u*2 - 2 Let h(n) = -1. Let z(a) = -4a + 6. Let y(i) = 6h(i) + z(i). Let m(b) = 11b*2. Give m(y(o)). 176o2 Let g(x) = x2. Let u be 265/25 - (-2)/5. Let y(o) = -uo + o + 8o. Calculate y(g(f)). -2f2 Let r(g) = 216g. Let l(s) = -4s2. Give r(l(p)). -864p*2 Let f(o) = -3o + 14o + 9o. Let l(i) = 2i2. Give l(f(c)). 800c*2 Let w(q) = 16q*2. Let j(a) = 9a. What is w(j(v))? 1296v2 Let p(t) = 54t*2 - 3. Let v(b) = -13b. Give p(v(f)). 9126f2 - 3 Let k(u) be the first derivative of -5/2u*2 + 1 + 0u. Let p(h) be the third derivative of -h*5/60 - 10h*2. What is k(p(y))? 5y*2 Let m(d) = 2d*2. Let c(n) = -14n - 96. Give m(c(o)). 392o2 + 5376o + 18432 Let z(n) = n + 1. Let u(f) = -f*2 - 4f - 2. Let x(t) = u(t) + 4z(t). Let s(r) be the first derivative of x(r). Let k(j) = 2j*2. Calculate s(k(c)). -4c*2 Let s(p) = 2p. Let x(w) = 4w - 2w + 0 + 0. What is s(x(q))? 4q Let q(u) be the third derivative of -u6/180 - u3/6 + 3u*2. Let t(p) be the first derivative of q(p). Let y(x) = -2x. Calculate t(y(h)). -8h2 Let b = 5 + -7. Let s(n) = -n2 + n + 1. Let r(c) = -3c*2 + 2c + 2. Let h(w) = bs(w) + r(w). Let m(k) = -k2. Determine m(h(a)). -a4 Let k(o) = o2 + o. Let d(u) = -22u*2 - 2u + u*2 - 5u - 11u. Let y(f) = -d(f) - 18k(f). Let w(r) = -r. What is w(y(s))? -3s2 Let l(k) = 38k*2 + k. Let f(d) = -5d. Calculate f(l(b)). -190b2 - 5b Let d(v) = -1539v. Let j(o) = 2o*2. Give d(j(c)). -3078c*2 Let i(t) = -28t*2 - 19t2 + t2. Let a(w) = 2w. Determine a(i(m)). -92m*2 Let b be 6/1(-5)/(-15). Let n(h) = -17hb + 3h*2 + 10h*2. Let s(o) = -2o*2. What is s(n(z))? -32z*4 Let m(x) = -x. Let b(l) = -543l - 2. Determine b(m(w)). 543w - 2 Let k(h) = 2h2. Let r(y) be the third derivative of -y4/8 - 24y2. Calculate r(k(l)). -6l*2 Suppose 0m - 4m = -8. Let a(h) be the first derivative of 0hm + 4 - 2 + h2 - 5. Let g(r) = 5r. Give a(g(w)). 10w Let l(z) = 4z2 - 5. Let u(f) = 3f*2 - 4. Let g(q) = 4l(q) - 5u(q). Let m(p) = 4p - 7. Let d(r) = -2r + 4. Let s(x) = 7d(x) + 4m(x). What is s(g(i))? 2i*2 Let y(k) = 8k*2 - 6k. Let l(v) = -v*2 + v. Let o(g) = -6l(g) - y(g). Let s(n) = -n*2 + 2n. Let b be s(2). Let c(r) = 0r + 2r + br. Give o(c(i)). -8i*2 Let y(c) = 2c*2. Let n(t) = -4t + 3. Let f(b) = 9b - 7. Let x(a) = -6f(a) - 14n(a). What is x(y(v))? 4v*2 Let x(s) = -2s + 2s - s. Let a(m) = 48m*2. Let h(t) = -6t*2. Let v(c) = -4a(c) - 33h(c). What is x(v(u))? -6u*2 Let c(o) = -190o - 18. Let q(u) = 4u2. Give q(c(m)). 144400m*2 + 27360m + 1296 Let b(c) = 8c2. Let d(y) = 29y*2 - 13y*2 - 12y*2. Give b(d(g)). 128g4 Let g(s) be the third derivative of -s4/8 - s*2. Let k(l) = -4l*2 + 10l*2 - 3l*2 - 4l*2. What is g(k(q))? 3q*2 Let v(s) = 45s. Let n(q) = 333q2. Give n(v(k)). 674325k2 Let n(t) be the second derivative of -t4/6 - 3t. Let l(d) = -3d*2. Determine n(l(g)). -18g4 Let j(g) be the third derivative of -g4/12 + 28g2. Let u(b) = -2b*2. Give j(u(q)). 4q*2 Let x(l) = 267l. Let y(o) = o*2. Calculate y(x(q)). 71289q*2 Let o(l) be the second derivative of -2l*4/3 - 3l. Let s(m) = -2m2. Give o(s(w)). -32w*4 Let l(c) = 5 + 5c2 + c - c2 + 4c. Let g(v) = 4v*2 + 6v + 6. Let n(a) = 5g(a) - 6l(a). Let r(s) = s. Give r(n(j)). -4j2 Let v(z) = -4z + 4. Let l(y) = -5y + 3. Let i(f) = 4l(f) - 3v(f). Let c(h) = h. Determine i(c(s)). -8s Let a(i) = 2i2. Let f be 2/4 - (-10)/4. Let r(o) = 0o + fo + 0 + 0. Calculate a(r(z)). 18z2 Let w(k) be the second derivative of k6/120 + k*4/6 + 5k. Let f(q) be the third derivative of w(q). Let i(y) = y*2. Calculate f(i(z)). 6z*2 Let q(y) = 3y*2. Let k(l) = 10l - 6l - 18l. Determine q(k(z)). 588z2 Let l(y) = 3y*2 + 4y. Let x(m) = m*2 + m. Let i(b) = -l(b) + 4x(b). Let h(n) = n2. What is h(i(v))? v4 Let o(l) = 5l - l - 2l. Let j(g) be the third derivative of -g*5/20 + 3g*2 + 1. Calculate j(o(n)). -12n*2 Let c(u) be the second derivative of -7u3/3 - u. Let g(n) be the first derivative of n2 - 46. Calculate g(c(f)). -28f Let b(y) = -37y. Let v(w) = -65w. Determine v(b(a)). 2405a Let a be 6 + (8/(-4) - 1). Let i(z) = 9z2 - 5z. Let o(v) = 5v2 - 3v. Let r(p) = ai(p) - 5o(p). Let f(j) = j. Determine f(r(c)). 2c2 Let s(d) = -19d - 5. Let l(n) = -20n - 4. Let q(o) = -5l(o) + 4s(o). Let g(f) = -2f. Determine g(q(v)). -48v Let v(u) = u + 2. Let r(s) = -3s - 7. Let c(b) = 4r(b) + 14v(b). Let m(w) be the second derivative of 0 - w - 1/3w3 + 0w*2. Calculate c(m(z)). -4z Let u(s) be the third derivative of s4/24 - s2. Suppose 14 = 5d + 4. Let v(q) = q + 2q - dq. Determine v(u(i)). i Let x(o) = -2o. Let i(n) = -158n2. Calculate x(i(h)). 316h2 Let c(k) be the third derivative of k5/5 - 80k2. Let v(m) be the first derivative of -m2 - 1. What is v(c(w))? -24w*2 Let p(y) = 3y*2. Let a(w) = -1083w*2. Determine a(p(v)). -9747v4 Let u(r) be the first derivative of -r3 + 3 - 2 + 5r2 - 5r*2. Let m(h) = -h. Give m(u(c)). 3c*2 Let d(l) be the second derivative of 7l*4/12 + 2l. Let m(p) = -2p2. Calculate m(d(n)). -98n4 Let q(o) = -o2 - 6o - 3. Let c be q(-5). Suppose -8 = t + 5d, 2d + 9 = t + 3. Let w(l) = l + tl - cl. Let g(m) = 3m*2. Calculate w(g(j)). 3j*2 Let y(a) = -3a*2. Let n(i) = -11i. Let t(f) = f. Let v(h) = -n(h) - 6t(h). Calculate v(y(r)). -15r*2 Let h(m) = -m. Let y = 30 - 27. Let p(s) = -ys + s - 4s + 3s. What is h(p(f))? 3f Let d(n) be the first derivative of 3n2/2 - 5. Let p(u) be the first derivative of -u2/2 - 2. Determine p(d(f)). -3f Let i(z) be the third derivative of 0 + 0z*3 - 1/24z*4 - 5z*2 + 0z. Let g(p) = 10p. Give g(i(c)). -10c Let q(u) be the third derivative of -u4/12 + u2. Let m(z) = -z + 1. Let v(k) = 50k - 40. Let r(n) = -40m(n) - v(n). Calculate r(q(w)). 20w Let w be (-3 - (1 - 1))/(-1). Let a(x) = -4x + 4x + 0x - wx. Let b(t) = t2. Calculate a(b(u)). -3u*2 Suppose -p = 3p + 12, 3n = -2p. Let u(b) = -3b2 + 0b*n + 2b*2. Let y(o) = 0o*2 - 5o*2 + 3o*2. Calculate u(y(q)). -4q4 Let l(f) be the second derivative of -f3/2 + 4f. Let m(b) = -22b. Give m(l(o)). 66o Let m(c) be the first derivative of c3/3 + 2. Let q(v) = -5v*2 + 5v*2 - 3v*2. What is q(m(o))? -3o*4 Let l(p) = p. Suppose w - 2f - 1 = -f, -5f + 40 = 4w. Let x(s) = ws - 11s + 7s. What is x(l(i))? i Let g(j) = j2. Let b(l) = 6. Let z(w) = w - 22 + 3 - 15 - 17. Let p(q) = -51b(q) - 6z(q). What is p(g(t))? -6t*2 Let j(h) = -2h. Let m(f) be the first derivative of -f*3/3 + 7. What is m(j(v))? -4v*2 Let c(y) = 1. Let o(m) = -2m - 4. Let h = 4 + -8. Let s(w) = hc(w) - o(w). Let n(r) = 3r*2. Determine s(n(q)). 6q*2 Let g(d) = -6d*2. Let j(x) = 108x*2. Determine j(g(m)). 3888m4 Let z(j) = -j2. Let q(h) = -3h + 4h - h - 2h. Let t(i) = 2i. Suppose 3c - 6 = -18. Let x(u) = ct(u) - 3q(u). Determine x(z(b)). 2b*2 Let r(i) = 10i. Let j(u) = 33u2. Determine j(r(k)). 3300k2 Let z(j) = -j + 1820. Let g(i) = -i2. Give g(z(v)). -v*2 + 3640v - 3312400 Let f(n) = -n*2. Let v(o) = -4o*2 + 348o. Calculate v(f(i)). -4i4 - 348i2 Let i(k) be the second derivative of k3/6 + 28k. Let s(d) = 24d*2. What is s(i(u))? 24u*2 Let r(q) = -118q*2 + q. Let d(o) = 6o*2. What is r(d(b))? -4248b*4 + 6b*2 Let s(h) = -4h2. Let l(q) = -q2 + 3q + 3. Let o(n) = n - 14. Let g be o(6). Let b(r) = 2r*2 - 8r - 8. Let t(v) = gl(v) - 3b(v). Determine t(s(f)). 32f4 Let v(t) = 12t	{ "pile_set_name": "DM Mathematics" }
9 - 9 for x. 4 Solve 0 = -11s + 195 - 107 for s. 8 Solve 3u - 16 = -10 for u. 2 Solve -9b + 16b + 28 = 0 for b. -4 Solve -5j - 20 = -j for j. -5 Solve -5z - 14z - 19 = 0 for z. -1 Solve 10 = -18i - 26 for i. -2 Solve 30v - 26v = -12 for v. -3 Solve 5p = -4 + 29 for p. 5 Solve 73w + 72 - 583 = 0 for w. 7 Solve -12 = 2v + 10v for v. -1 Solve -15f = 115 - 145 for f. 2 Solve 0g = -2g - 2 for g. -1 Solve 80 = 159i - 143i for i. 5 Solve -42 = 16t + 70 for t. -7 Solve -26j + 12 = -66 for j. 3 Solve o + 8 = 10 for o. 2 Solve -30m - 310 = 32m for m. -5 Solve -3x - 41 = -26 for x. -5 Solve 0 = -152r + 104r for r. 0 Solve -831p + 841p = -30 for p. -3 Solve 0 = 21j + 866 - 698 for j. -8 Solve 2t + 3 = t for t. -3 Solve -41 = j - 50 for j. 9 Solve -2g = 30 - 36 for g. 3 Solve 0 = -4w + 3w + 5 for w. 5 Solve -4r + 0r = -4 for r. 1 Solve 12a + 5a = 51 for a. 3 Solve 0 = -4m - 5 - 3 for m. -2 Solve 0 = -225c + 230c - 15 for c. 3 Solve -17 + 15 = -2z for z. 1 Solve 368 = -40u - 72 for u. -11 Solve 0 = -2b - 4 + 12 for b. 4 Solve 0 = 3i - 109 + 103 for i. 2 Solve -624 = -42i - 36i for i. 8 Solve -21i - 18 - 3 = 0 for i. -1 Solve 0 = 8i + 298 - 338 for i. 5 Solve -197w = -200w + 15 for w. 5 Solve -7s = 3 - 31 for s. 4 Solve 0 = -7s + 118s - 666 for s. 6 Solve -7m + 5m + 8 = 0 for m. 4 Solve 5u + 8 - 3 = 0 for u. -1 Solve 0 = 43u - 25 + 412 for u. -9 Solve 0 = -6t + 2 - 14 for t. -2 Solve -24h = -19h + 30 for h. -6 Solve -8m - 189 = -221 for m. 4 Solve 95b - 70 = 81b for b. 5 Solve -45b + 40b = -30 for b. 6 Solve -c - 4 + 0 = 0 for c. -4 Solve 7k - 16 = 26 for k. 6 Solve -10 - 44 = 18y for y. -3 Solve 5d + 45 = -4d for d. -5 Solve -8 - 32 = 8m for m. -5 Solve -12 = -241v + 238v for v. 4 Solve -6z + 4 = 16 for z. -2 Solve 272t + 88 = 283t for t. 8 Solve 0 = 3f + 456 - 459 for f. 1 Solve -12d - 12d - 144 = 0 for d. -6 Solve 18n + 132 = 51n for n. 4 Solve 25p = 22p - 3 for p. -1 Solve 0 = -4d + 20 - 0 for d. 5 Solve 578h - 120 = 593h for h. -8 Solve -107n + 85n = 88 for n. -4 Solve 2y - 12 = -y for y. 4 Solve -692p = -689p - 3 for p. 1 Solve -389 + 159 = 46w for w. -5 Solve -10 = -26v + 24v for v. 5 Solve -325 = 27j - 244 for j. -3 Solve v = -3v - 4 for v. -1 Solve -118 = -44y + 58 for y. 4 Solve -81 = 3h - 63 for h. -6 Solve 70i = 105i + 140 for i. -4 Solve 244f - 259f + 60 = 0 for f. 4 Solve -511a + 510a = 5 for a. -5 Solve -7w + 79 = 93 for w. -2 Solve 0 = 49i - 27i - 66 for i. 3 Solve 43t + 70 = 33t for t. -7 Solve 257 = 4v + 257 for v. 0 Solve -59p + 27p = -192 for p. 6 Solve -5g - 2g = 0 for g. 0 Solve 432a + 63 = 441a for a. 7 Solve 5t - 13 = 12 for t. 5 Solve -13t + 11t = 5t for t. 0 Solve 6v - 28 - 2 = 0 for v. 5 Solve 0 = -23k + 30k for k. 0 Solve 0 = 26w - 20w - 18 for w. 3 Solve 40s + 4 = 38s for s. -2 Solve 0 = 33v - 8v + 200 for v. -8 Solve 61h = -336 + 31 for h. -5 Solve 12c - 7c - 10 = 0 for c. 2 Solve -1277 = 5o - 1297 for o. 4 Solve 42m = 4m for m. 0 Solve -93d - 432 = -21d for d. -6 Solve -156 = 78f + 234 for f. -5 Solve -11f + 6f = -20 for f. 4 Solve -72t + 69t = 0 for t. 0 Solve 0 = -30v + 20v - 80 for v. -8 Solve 50q - 21 = 53q for q. -7 Solve -75 = -5m - 20m for m. 3 Solve 79r - 91r = 60 for r. -5 Solve 0 = -21m + 5m + 32 for m. 2 Solve 15 = -2t - 3t for t. -3 Solve -301 = 30x - 1 for x. -10 Solve -84 = 4a - 88 for a. 1 Solve 0w + 3w - 9 = 0 for w. 3 Solve -15 = 9v + 3 for v. -2 Solve -26 + 54 = 4l for l. 7 Solve -58p + 97p = -156 for p. -4 Solve -17o - 16o = 0 for o. 0 Solve -4 = 7o + 3 for o. -1 Solve -70 + 95 = -5g for g. -5 Solve -276 = 9i - 213 for i. -7 Solve 0 = 34q + 9q + 129 for q. -3 Solve -n + 3 = 6 for n. -3 Solve 0 = 11w - 6w + 5 for w. -1 Solve 24i = 23i + 2 for i. 2 Solve 17f - 3f + 14 = 0 for f. -1 Solve 70w = 73w - 12 for w. 4 Solve 10g + 76 = -9g for g. -4 Solve -3f = -0f - 3 for f. 1 Solve -9f - 12 + 3 = 0 for f. -1 Solve -6n + 13n = -35 for n. -5 Solve -31l - 19 - 12 = 0 for l. -1 Solve 227o = 235o + 40 for o. -5 Solve 42f + 189 + 273 = 0 for f. -11 Solve -12 = -0j + 6j for j. -2 Solve 7m - 18 = m for m. 3 Solve -29a + 35a - 18 = 0 for a. 3 Solve 0 = 3k + 123 - 129 for k. 2 Solve -10d - 12 = -7d for d. -4 Solve 0 = 10x - 0 - 30 for x. 3 Solve 417 - 426 = -3l for l. 3 Solve -3c + 554 = 566 for c. -4 Solve 122h - 118h + 28 = 0 for h. -7 Solve 20s - 330 = -13s for s. 10 Solve 8d - 25 = 7 for d. 4 Solve 19u - 10 = 9 for u. 1 Solve 0 = 37g - 41g - 16 for g. -4 Solve 3q + 35 - 11 = 0 for q. -8 Solve 25 - 20 = -z for z. -5 Solve -23 = -141l + 118l for l. 1 Solve p = -4p - 10 for p. -2 Solve -62q = -43q - 19 for q. 1 Solve c + 4 = -0c for c. -4 Solve 0 = -565s + 548s for s. 0 Solve -1258u = -1265u - 42 for u. -6 Solve 6a + 20 = -4a for a. -2 Solve 46d - 20 = 41d for d. 4 Solve 0 = 10l + 24l - 306 for l. 9 Solve 13y - 34 - 44 = 0 for y. 6 Solve -38o = -32o + 24 for o. -4 Solve 10w - 14w + 20 = 0 for w. 5 Solve 206g = 207g + 2 for g. -2 Solve 10j + 36 = 6 for j. -3 Solve 103v - 385 = 26v for v. 5 Solve 0 = 7w + 9 + 26 for w. -5 Solve -m + 2m = 4m for m. 0 Solve -682j - 12 = -670j for j. -1 Solve -438t - 24 = -432t for t. -4 Solve 72 = 1522p - 1530p for p. -9 Solve 171x = 188x - 85 for x. 5 Solve -3y - 80 = 17y for y. -4 Solve 17 + 1 = 3i for i. 6 Solve 590 = -12q + 626 for q. 3 Solve 9m = 39 + 33 for m. 8 Solve -492 + 387 = 15u for u. -7 Solve 1360f - 1353f + 42 = 0 for f. -6 Solve 19v - 39v = -80 for v. 4 Solve 0 = -14t - 1482 + 1566 for t. 6 Solve -5z - 7z = 0 for z. 0 Solve 0 = 3z + 3z - 8z for z. 0 Solve 0 = 8l - 5l + 12 for l. -4 Solve 22 - 80 = 29n for n. -2 Solve -425 = 9n - 452 for n. 3 Solve -208 + 12 = -49n for n. 4 Solve -35j - 10 = -45j for j. 1 Solve -6 = 126x - 120x for x. -1 Solve 5z = -7z for z. 0 Solve 8l = -0l + 8 for l. 1 Solve 7k + 9 = 2 for k. -1 Solve -52 + 112 = -12w for w. -5 Solve 8 = -15c + 23c for c. 1 Solve -15x = -16x - 7 for x. -7 Solve 12r + 16 + 44 = 0 for r. -5 Solve 0 = -88c + 106c for c. 0 Solve 4b - 19 = -7 for b. 3 Solve 8w = 1428 - 1380 for w. 6 Solve 19g + 106 = -27 for g. -7 Solve -197q = -186q - 22 for q. 2 Solve 7g = 20g + 78 for g. -6 Solve 0 = 152w - 150w - 8 for w. 4 Solve -7 = 7x - 35 for x. 4 Solve 48 = 14g - 22 for g. 5 Solve 10y - 280 + 230 = 0 for y. 5 Solve -5 = 4p - 1 for p. -1 Solve -9t + 24t = 90 for t. 6 Solve -4y + 629 = 641 for y. -3 Solve -17y - 11 = -11 for y. 0 Solve -5r = -80r - 600 for r. -8 Solve -997 = -7c - 983 for c. 2 Solve -3i - 3 = -6i for i. 1 Solve 9f + 75 = 111 for f. 4 Solve -34 + 2 = 8y for y. -4 Solve -1 = 2k + 5 for k. -3 Solve -20v = -19v + 2 for v. -2 Solve -90 + 90 = 3k for k. 0 Solve -9x + 86 = 77 for x. 1 Solve 1994v - 1997v = 24 for v. -8 Solve -2s = 8 - 2 for s. -3 Solve -59o = -55o + 20 for o. -5 Solve -6x + 108 = -24x for x. -6 Solve 25k + 127 = 27 for k. -4 Solve -4v + 124 = -35v for v. -4 Solve -18n + 85 = 103 for n. -1 Solve 162z - 716 - 742 = 0 for z. 9 Solve 20a + 14 = -66 for a. -4 Solve -11 = -5r + 4 for r. 3 Solve 25 + 17 = -14b for b. -3 Solve 66g = 69g - 18 for g. 6 Solve 3x - x = -6x for x. 0 Solve 11 = 2z + 3 for z. 4 Solve -26p = -0p + 156 for p. -6 Solve 75 - 27 = 12a for a. 4 Solve 14 = g - 8g for g. -2 Solve 104c - 127c - 138 = 0 for c. -6 Solve -189j = -191j + 4 for j. 2 Solve 0 = 35j + 14j + 49 for j. -1 Solve -7k + 105 = 91 for k. 2 Solve 64c + 140 = -6c for c. -2 Solve f = 6 - 13 for f. -7 Solve -41l = 92 - 10 for l. -2 Solve -250i + 25 = -255i for i. -5 Solve 91r = 41r - 200 for r. -4 Solve -19 = 8s - 51 for s. 4 Solve 0 = -7v - 18v - 25 for v. -1 Solve v + 15v = v for v. 0 Solve 0 = 10m + 8 + 2 for m. -1 Solve -241o = -242o + 4 for o. 4 Solve 830 - 806 = -12d for d. -2 Solve -p - 15p = 32 for p. -2 Solve 12w + 0 = -24 for w. -2 Solve 8 = 436g - 432g for g. 2 Solve 658 = 4n + 678 for n. -5 Solve -283r + 6 = -284r for r. -6 Solve t + 40 = -3t for t. -10 Solve 0 = -2l - 115 + 107 for l. -4 Solve 0 = -3o + 2o + 5 for o. 5 Solve -2 = -g - 5 for g. -3 Solve 0 = -30*d -	{ "pile_set_name": "DM Mathematics" }
9.40.148897 -5.8665418 Calculate -3577.96-401. 1434761.96 Calculate 5-235749. -1178745 Work out -407 -50.27. 20459.89 Multiply -14004 and -2450. 34309800 10955045 * -0.01 -109550.45 Multiply 0.6 and -41013.22. -24607.932 1 times 1634387 1634387 Calculate 41485140. 21320720 Calculate -0.70.1958662. -0.13710634 Product of 66013 and -208. -13730704 Calculate -70788.7. -61578.6 Calculate -32462.938. -7388.814 What is the product of -1.568 and -0.032091? 0.050318688 Calculate -571.55-79. 45152.45 What is the product of 2.494 and 18.124? 45.201256 Calculate 0.10490.975. 0.1022775 0.2907974 times -0.2 -0.05815948 What is the product of -0.5927 and -5.07? 3.004989 3149-4.648 -14636.552 -430-92.9394 39963.942 What is the product of -6719276 and -5? 33596380 Product of 0.05 and -26829582. -1341479.1 What is the product of -5749 and -0.187? 1075.063 Multiply 623.3 and -10127. -6312159.1 Multiply 663 and -6.3978. -4241.7414 What is the product of -0.58 and 129800? -75284 59853-74 -4429122 What is 8341 times 0.17498? 1459.50818 What is -2915.763 times -0.1? 291.5763 Product of -94.99948 and 3. -284.99844 Calculate -2.3-11590433. 26657995.9 Calculate 12.3843-0.0518. -0.64150674 Product of 9831 and 10166. 99941946 41.5757-0.3 -12.47271 Multiply 1 and 795.7975. 795.7975 -3470510 times 27.4 -95091974 Product of -0.9 and 46760525. -42084472.5 -0.5 times 1781615 -890807.5 Calculate -1336959-38. 50804442 29.655948-2.3 -68.2086804 422385-0.346 -146145.21 Calculate -0.1019-188790. 19237.701 Calculate -1137-0.0241. 27.4017 What is 0.5 times 525765.4? 262882.7 What is -424.84466 times 2? -849.68932 Product of -3 and 433453.5. -1300360.5 -2782664.74 -0.3 834799.422 Multiply -3 and -5.82028. 17.46084 Calculate -0.0559-45.32. 2.533388 Product of 261693004 and -0.5. -130846502 What is the product of -548.9842 and 0.3? -164.69526 Calculate 8884-21.49. -190917.16 Calculate 624929240. 149575440 What is -33977.256 times -3? 101931.768 Calculate 412.480946. 33382130.4 What is 401072988 times -1? -401072988 What is -20.26 times -0.00108? 0.0218808 Multiply 5 and -0.27274821. -1.36374105 -2.9 * 15131.2 -43880.48 What is -0.52 times -3849.683? 2001.83516 What is the product of 10.431 and 12.287? 128.165697 4 times -4630.219 -18520.876 What is -1529341 times -0.7? 1070538.7 Multiply 1096694 and -1.47. -1612140.18 What is the product of 1725021 and 0.04? 69000.84 0.019726-3.762 -0.074209212 What is -1 times 58679825? -58679825 Work out 0.5 444549.507. 222274.7535 What is 54652 times 0.0353? 1929.2156 2735 times 16363 44752805 What is 0.2 times -761373? -152274.6 141.8 times 169989 24104440.2 -0.778502-12 9.342024 Work out 14966264 14. 209527696 -24220 times 0.1481 -3586.982 16-0.034163 -0.546608 -0.414416-0.5 0.207208 Product of -0.3 and -1027773. 308331.9 0.4-19052047 -7620818.8 Product of -2351831 and 0.23. -540921.13 -4112884.8 -451539.2 What is -8.4 times 384813? -3232429.2 Work out -20360387 * -0.8. 16288309.6 What is the product of -3078 and -0.02802? 86.24556 -410.6 times 72.7 -29850.62 -423.7011 * -3 1271.1033 -1.279 * 231.2 -295.7048 Multiply -31297 and -286. 8950942 Multiply -58.8608 and 24.3. -1430.31744 6494787771 649478777 What is -1496 times -36317? 54330232 What is 540045 times -591? -319166595 -62 times -6601861 409315382 -3143819 times 190 -597325610 Multiply 1902.9 and 438. 833470.2 -0.17737 times 2.15 -0.3813455 -457.4 0.115212 -52.6979688 What is the product of -201 and -2772611? 557294811 Calculate -1867514-1. 1867514 Work out -0.1 -9830704. 983070.4 -156 * 495857 -77353692 -4.8022412 times 0.3 -1.44067236 15.46 * 639.57 9887.7522 What is 720 times 0.14059? 101.2248 -139093.54 * 1 -139093.54 Calculate 65-379399.8. -24660987 What is -5.09025 times 0.03? -0.1527075 Multiply 1.851 and 0.05069. 0.09382719 479.45 times 0.1174 56.28743 1697.5 times 251 426072.5 What is the product of -24313694 and -0.4? 9725477.6 Product of -28.2 and -51.281. 1446.1242 Product of 0 and -10236525. 0 -0.09-23895949 2150635.41 027055887 0 Multiply -9.1 and 300578. -2735259.8 -11 times 100693 -1107623 -0.5 times 929.5799 -464.78995 22 times -8245865 -181409030 -12194 times 674.6 -8226072.4 406281 times 5.9 2397057.9 What is -0.001 times -1879641? 1879.641 Product of -120601 and -0.42. 50652.42 What is the product of -32.08 and 13703? -439592.24 0.27548 3132 862.80336 What is 2.679742 times -0.4? -1.0718968 Multiply -27736918 and -0.4. 11094767.2 Work out -10.13 * -5533. 56049.29 0.6243185 145911 What is 3155 times -1.4439? -4555.5045 Multiply 0.5 and 1349.4527. 674.72635 What is 0.1156235 times 152? 17.574772 What is the product of -875 and 0.03485? -30.49375 What is -2.2728857 times 0.2? -0.45457714 Work out 161258 -0.0658. -10610.7764 98003843-5 -490019215 Calculate -0.19544292-4. 0.78177168 What is the product of 5 and -1800379? -9001895 Multiply 0 and 3798615. 0 Calculate -19.2688052. -13210598.4 -3678 6067 -22314426 1654.97616 26479.616 Product of -1132733.1 and -0.5. 566366.55 Calculate -16955083-0.2. 3391016.6 -103.853-144 14954.832 What is 5.4 times -0.05977915? -0.32280741 What is 8.03 times 55747? 447648.41 Multiply -90606 and 55. -4983330 Product of 196355760 and -0.2. -39271152 Product of -39 and 4492.01. -175188.39 Multiply -4 and -28851.75. 115407 What is the product of 48.007 and -1.74? -83.53218 Calculate 1381170.04. 5524.68 What is the product of 1.8041 and -39? -70.3599 What is 224 times -251688? -56378112 Product of -24420 and 2.96. -72283.2 Multiply -27 and 313.934. -8476.218 0.5 times -2750.95 -1375.475 Work out -3150.32 * 7. -22052.24 -2292.58687 -592.39323 Work out -40472400 -0.5. 20236200 What is -0.02176962 times 0.1? -0.002176962 Calculate -12-470122. 5641464 Multiply -31145 and -96. 2989920 What is the product of 79 and -14372? -1135388 Work out 0.1 -0.04133543. -0.004133543 Work out -2 * 5.38144. -10.76288 What is the product of 0.894 and 38.3259? 34.2633546 What is 945286 times 0.6? 567171.6 -16.34 times -100.9 1648.706 What is 2269 times -0.167637? -380.368353 -4.7106876 -502317.2 Calculate 0.042347-259. -10.967873 What is the product of 1201117.4 and -4? -4804469.6 Multiply -10 and 891850. -8918500 Multiply 0.4 and 113714150. 45485660 What is 31.305 times 5.068? 158.65374 Calculate -5263912456. -655671384 What is -0.016 times -9.50196? 0.15203136 Multiply -4 and 1242766.99. -4971067.96 44.1506169 times 0.4 17.66024676 183.7 -112.54 -20673.598 -0.09-0.04387816 0.0039490344 Calculate 90276546. 59090742 What is the product of 148515 and 0.161? 23910.915 -17.94819034 -71.7927612 What is 4784 times 0.424? 2028.416 Calculate 107.74182-5. -538.7091 What is the product of -8824216 and 0.3? -2647264.8 What is -0.0176 times -17230? 303.248 Calculate -373-0.333764. 124.493972 What is 25 times 0.269444? 6.7361 0.15 2026855 304028.25 What is the product of 0.5 and 0.067662197? 0.0338310985 06.9174709 0 0.52.0105894 1.0052947 26820649 13641298 -0.04594500 -22.97 What is the product of -136103 and -4742? 645400426 Multiply 0.06 and 0.014380664. 0.00086283984 -466 * 7072 -3295552 Product of -743 and 734.4. -545659.2 6876531.4-0.2 -1375306.28 -1876763530.2 -37535270.6 0.048267315.5 330692.62 Work out 159 33850. 5382150 -16056970.9 times 0.4 -6422788.36 -2511.6053 * -0.3 753.48159 3529.72 * -13 -45886.36 Product of 0.8 and 2.032512. 1.6260096 What is the product of 0.2 and 2.468646? 0.4937292 Product of -0.035623 and 4.8. -0.1709904 What is 9.794 times -3.2523? -31.8530262 Product of -325909176 and -0.5. 162954588 Product of 77284 and 17883. 1382069772 Product of 0.5 and 32197.01. 16098.505 What is the product of -536814 and -1.3? 697858.2 11812183 times 0.3 3543654.9 Work out -0.4 * -126612.8. 50645.12 -692046 times -29 20069334 What is -334985 times 75? -25123875 -402 times -38202 15357204 What is the product of 0.3 and 1.281438? 0.3844314 What is 19836 times -203? -4026708 2127767.6 * 0.1 212776.76 Product of 16 and -11668.59. -186697.44 -0.1644 times 0.1823 -0.02997012 0.62069 * -8.7 -5.400003 -116102.045 -11837.22 What is the product of 3 and 619648? 1858944 Work out -3367111 0.45. -1515199.95 What is -0.1 times -141197? 14119.7 Multiply 3.91 and 82.7. 323.357 Calculate -435	{ "pile_set_name": "DM Mathematics" }
ative of t6/600 - t5/150 - t4/120 + t3/15 - 3t2 + t. Determine b, given that g(b) = 0. -1, 1, 2 Let y = -46 + 46. Factor 3s*4 - 100s*5 + 97s*5 - 3s*2 + ys*4 + 3s*3. -3s*2(s - 1)*2(s + 1) Let i(z) be the second derivative of -z9/10080 + z7/336 - z5/20 - z4/2 + z. Let l(a) be the third derivative of i(a). Solve l(q) = 0. -2, -1, 1, 2 Let n be (-3)/(-6)2 - -2. Solve 30d*n + 20d*2 - 7d*4 - 60d + 12d + 8d + 5d5 - 18d4 = 0. -1, 0, 2 Let u(w) = -w3 + w*2 - w - 2. Let r(q) = 38q*2 - q - 2. Let z(y) = 5r(y) - 5u(y). Determine k so that z(k) = 0. -37, 0 Let d be (-256)/(-442) + (-44 - 42522/(-969)). Suppose d - 8/13k + 2/13k2 = 0. Calculate k. 1, 3 Suppose -6 + 1 = -g + 3c, 0 = 3c + 3. Let t be (2/28)/(-8 - (-776)/96). Solve -2/7y*3 - 2/7y*4 + 2/7y + tyg - 4/7 = 0 for y. -2, -1, 1 Let i = -4 + 8. Suppose -q + i = 5. Let h(f) = f2 - 1. Let v(z) = -11z*2 + 6z + 5. Let k(j) = qv(j) - 3h(j). Let k(o) = 0. What is o? -1/4, 1 Let o(t) be the third derivative of -t7/315 + t6/45 - t*5/30 - 133t*2. Suppose o(w) = 0. Calculate w. 0, 1, 3 Suppose 168 + 248 = 104f. Solve -2df - 26/9d*2 + 0 + 4/9d + 40/9d3 = 0. 0, 2/9, 1 Let j(y) = y2 - 35y - 1414. Let q be j(-24). Factor 2/11oq + 0 - 12/11o. 2o(o - 6)/11 Suppose -84p + 18 = 3r - 87p, 2r = -5p - 16. Factor 4/7z*3 - 4/7 - 2z*2 + rz. 2(z - 2)(z - 1)(2z - 1)/7 Let j = -79/7 + 337/28. Let 9/2t3 + 3t*4 + 3t*2 + 3/4t*5 + 0 + jt = 0. What is t? -1, 0 Let u(l) be the first derivative of -l4/28 + l3/7 + 2l2/7 - 12l/7 - 209. Factor u(q). -(q - 3)(q - 2)(q + 2)/7 Let v be -11 + 134/12 + (-10)/(-312). Let y = v - -2/39. Factor -1/2a3 + 1/4a - 1/4 + 1/2a2 + ya*5 - 1/4a4. (a - 1)3(a + 1)2/4 Determine v so that -6/7v*2 - 62/7 + 188/7v = 0. 1/3, 31 Find f, given that -2376/13f - 54/13f*3 - 540/13f*2 - 2/13f*4 - 3888/13 = 0. -9, -6 Let s(f) = 16f + 50. Let i be s(-3). Let d(r) be the third derivative of 1/120r4 - 1/15r*3 + 4r*i + 0 + 0r + 1/150r5 - 1/600r*6. Factor d(q). -(q - 2)(q - 1)(q + 1)/5 Let c be (-4)/(441/(-27) + 15). Find b, given that 0b - 4/7b2 + 0 - 4/7b*4 + 8/7b*c = 0. 0, 1 Factor -4p + 40 - 4p2 - 6 + 67 - 21. -4(p - 4)(p + 5) Suppose 79 - 77 = k. Suppose 6m*2 - 769m + 2 + 776m - mk = 0. What is m? -1, -2/5 Let o(z) be the third derivative of 2/7z*3 - 5/84z*4 + 0 - 1/210z*5 + 19z*2 + 0z. Factor o(t). -2(t - 1)(t + 6)/7 Let z be (369/(-6) + -5)(-3)/(-7). Let a = z + 30. Determine g, given that 0g + a - 3/2g2 = 0. -1, 1 Let f = -19444506 + 43847362593/2255. Let s = 7/205 + f. Factor -16/11l*2 - sl - 10/11l3 - 2/11l*4 + 0. -2l(l + 1)(l + 2)*2/11 Let n = 4 + -2. Find z such that nz*2 + 4z*2 + 6 + 9z*2 - 50z + 9 = 0. 1/3, 3 Let x(v) be the third derivative of 0 + 1/42v7 + 0v*3 + 0v + 1/15v5 - 1/336v*8 + 11v*2 + 0v*4 - 1/15v*6. Find g, given that x(g) = 0. 0, 1, 2 Let p(g) be the third derivative of 0 + 1/30g*6 - 22g*2 + 2/105g*7 + 0g + 0g3 - 1/15g*5 + 0g*4 - 1/84g8. Let p(z) = 0. Calculate z. -1, 0, 1 Let i(j) be the third derivative of j8/1344 - j7/210 + j6/160 + j5/60 - j4/24 - j*2 - 123j. Determine c so that i(c) = 0. -1, 0, 1, 2 Let p be (-49596)/16524 + 31. Let i = p - -5534/17901. Determine g, given that -2/13g*2 - ig + 4/13g3 + 0 + 2/13g*4 = 0. -2, -1, 0, 1 Factor 4 - 10y*2 - 86/3y. -2(y + 3)(15y - 2)/3 Factor 2/5z*3 + 14/5z + 2z2 + 6/5. 2(z + 1)*2(z + 3)/5 Let b(c) be the first derivative of -c*5/30 + 5c*4/24 + 5c*3/9 - 5c*2/3 - 4c - 438. What is l in b(l) = 0? -2, -1, 2, 6 Let a(p) be the third derivative of -1/210p6 + 0p*5 + 0 - 20p*2 + 0p*4 + 0p + 0p3. Determine w, given that a(w) = 0. 0 Let m(i) be the first derivative of i4/4 - i3/6 - 2i*2 - 5i/2 + 324. Factor m(z). (z + 1)*2(2z - 5)/2 Let u(h) be the second derivative of h5/110 + h4/11 - 3h*3/11 - 14h*2/11 - 10h + 1. Find j such that u(j) = 0. -7, -1, 2 Let z(a) be the third derivative of a*8/168 - 2a*7/105 + 16a*2 + 4a. Find b, given that z(b) = 0. 0, 2 Factor 10/9 - 22/9k + 14/9k*2 - 2/9k*3. -2(k - 5)(k - 1)2/9 Suppose 2i - 3k + 195 = 0, k - 375 = 3i - 93. Let b = 286/3 + i. Factor -l*2 - bl - 2/3. -(l + 2)(3l + 1)/3 Solve -2/7x4 - 8/7x + 0 + 8/7x3 + 2/7x*2 = 0 for x. -1, 0, 1, 4 Let o = 90 + -54. Let s be (o/(-594))/((-1)/3). Solve 0l*4 + 0l*2 + 0 + 2/11l*3 + 0l - sl5 = 0 for l. -1, 0, 1 Factor -1/5h*3 + 2/5h - 1/5h2 + 0. -h(h - 1)(h + 2)/5 Let t be (-1)/2 - (-1 + 229/5). Let d = t + 93/2. Find l, given that -9/5l*3 - 3/5l*4 + 0 + 0l - dl2 = 0. -2, -1, 0 Let -3 - 182z + 177z - 5z*2 + 13 = 0. What is z? -2, 1 Factor 35/2f*3 - 5/2f*4 + 0 + 25/2f - 55/2f2. -5f(f - 5)(f - 1)*2/2 Find j such that 0j + 324/5j2 + 36/5j*3 + 1/5j4 + 0 = 0. -18, 0 Let n(c) be the first derivative of -c6/1260 - c5/84 - c4/14 + 32c3/3 + 34. Let v(y) be the third derivative of n(y). Suppose v(r) = 0. Calculate r. -3, -2 Suppose -3v + 393 = -5o, -5v + 550 + 86 = -2o. Let y be (2/(-14))/((-36)/v). Factor yl - 1/4l2 + 0. -l(l - 2)/4 Find g, given that -24/25 + 22/5g2 + 16/25g = 0. -6/11, 2/5 Let o(u) be the first derivative of u*3 - 33u*2/2 + 72u - 29. Factor o(q). 3(q - 8)(q - 3) Factor -10g2 - 4g*2 - 18 - 30 - 14g*2 - 176g. -4(g + 6)(7g + 2) Let s be 8/12 - (-163)/(-116). Let j = 1/87 - s. Suppose 1/2 + 1/4d*4 - 1/4d - jd2 + 1/4d*3 = 0. Calculate d. -2, -1, 1 Let o = 645 - 645. Let h(m) be the second derivative of 0m*3 + om*2 - 6m + 0 - 1/30m4 + 1/100m*5. Let h(j) = 0. Calculate j. 0, 2 Let a(j) = -9j*2 + j - 4. Let l = -4 + 33. Let k = -15 + l. Let c(g) = 4g*2 + 2. Let z(f) = kc(f) + 6a(f). Determine n so that z(n) = 0. -2, -1 Let b be 5/(-2) + (-66)/12 + 5 + 7. Find g, given that 3/4g + 3/8gb - 3/8 - 3/4g*3 + 0g2 = 0. -1, 1 Let r(k) be the third derivative of -k9/362880 - k*8/40320 + 11k*5/60 - 9k2. Let z(x) be the third derivative of r(x). Factor z(q). -q2(q + 3)/6 Let h(l) = -l2 - 29l - 28. Let i(a) = -a - 1. Let c(f) = -h(f) + 5i(f). Factor c(n). (n + 1)(n + 23) Let v(i) = 4i - 44. Let x be v(11). Let u(p) be the second derivative of 3/20p*5 + 1/2p*4 + 5p + xp2 + 0 + 0p*3. Factor u(z). 3z*2(z + 2) Let x(c) = c*2 + 14c - 33. Let o be x(2). Let u be 48/12o/(-38). Factor 0 - 2/19s + us2. 2s(s - 1)/19 Factor -180 + 12 - 46393c*3 + 46389c*3 - 40c*2 + 212c. -4(c - 3)(c - 1)(c + 14) Let j(k) = 29k*3 + 66k*2 - 23k. Let b(i) = -14i3 - 33i*2 + 11i. Let t(p) = -5b(p) - 2j(p). Factor t(l). 3l(l + 3)(4l - 1) Let l = 17875 - 17873. Factor -2/7jl - 16/7 + 12/7j. -2(j - 4)(j - 2)/7 Find a such that 5/3 + 1/3a2 + 2a = 0. -5, -1 Factor 0 - 1/2x4 - 1/2x + 1/2x2 + 1/2x*3. -x(x - 1)*2(x + 1)/2 What is s in 18 + 7s3 + 93s + 20s4 + 75s*2 + 7s*4 - 124s*3 = 0? -1/3, 2, 3 Let a = -1684 - -1686. Solve -8/9x*3 + 2/9x*4 + 2/3x*a + 0x + 0 = 0. 0, 1, 3 Let 57/2q4 + 115/2q*3 + 75/2q*2 + 9/2q*5 + 0q + 0 = 0. Calculate q. -3, -5/3, 0 Suppose n - 4z = -n - 28, -5n = -2z + 54. Let s = -5 - n. Factor 3m*3 + 0m*5 + 4m4 - m3 + 2ms. 2m*3(m + 1)*2 Let a = -3 - -7. Suppose -5s = -2c - 19, -5c + 19 = as - 16. Determine l, given that -103l - 7lc - 45l*4 - 8l*3 + 98l + 25l2 = 0. -1, 0, 1/3 Let z(h) be the first derivative of 2/3h*3 - 2 + 1/15h*5 - 3/2h*2 - 1/3h*4 + 0h. Let y(t) be the second derivative of z(t). Factor y(a). 4(a - 1)2 Let t(k) be the first derivative of -5/3k3 + k5 - 1 + 0k4 + 0k + 0k2. Factor t(m). 5m*2(m - 1)(m + 1) Let u = -21820 - -240024/11. Factor 0 - ub + 4/11b2 - 1/11b*3. -b(b - 2)*2/11 Let z = 858/5 + -171. Let k be 3/(-6)0/7. Solve 0j + k - 3/5j*2 + zj*4 + 0j3 = 0. -1, 0, 1 Let c(s) be the third derivative of s8/252 + 2s7/15 + 5s*6/6 - 361s*5/45 + 68s*4/3 - 32s*3 - 301s*2. Factor c(f). 4(f - 1)*3(f + 12)*2/3 Let a(w) be the second derivative of -w - 1/100w*5 + 0 + 2/5w*2 - 3/10w**3 + 1/	{ "pile_set_name": "DM Mathematics" }
1126 plus 0.2188? -1125.7812 What is -70816 + -5? -70821 What is 15.41 take away -1? 16.41 Add together -0.2 and 22602. 22601.8 What is 3 minus 4107? -4104 Total of -3 and 28.401. 25.401 Total of -1212.1 and -0.4. -1212.5 What is -4 - 18.6? -22.6 What is -0.067447 minus -0.3? 0.232553 -5 + 0.008219 -4.991781 What is 75.9 less than 2? -73.9 1 - -0.07111 1.07111 6.2 + -971 -964.8 Put together 3447 and -4.2. 3442.8 What is -61.22 minus 300? -361.22 Add -0.3 and -4.91017. -5.21017 What is 2719 plus 0? 2719 Put together 0.012043 and 35. 35.012043 Add -8 and -313720. -313728 What is 0.002 - -90.7? 90.702 Calculate 71 - -5.216. 76.216 What is -10660 - 1? -10661 370426+-1 370425 What is -0.4 take away 2159? -2159.4 Put together 190 and 25. 215 Add together 45 and -0.8. 44.2 Add together -166 and -31. -197 What is -0.261 + 0.4? 0.139 Work out -0.8 + -7.28. -8.08 0.06 + 0.3057 0.3657 Subtract 30 from 0.52. -29.48 What is -0.8556584 + -0.4? -1.2556584 Work out -196 - -0.643. -195.357 What is 0.3 - 766944? -766943.7 What is 6407 less than 66? -6341 Calculate -2001.111 - -3. -1998.111 25520 - 0.4 25519.6 Put together 0.4 and -1006.57. -1006.17 Work out 13 - 0.19245. 12.80755 What is -0.0311 - -0.55? 0.5189 Subtract -10.21 from 10.11. 20.32 Add -3932570 and 4. -3932566 -2.7+-0.124 -2.824 Put together 1 and 4.1. 5.1 Sum 64 and 0.04535. 64.04535 Total of 838 and -6. 832 What is 18849 plus 0? 18849 What is 2 plus -1765.9? -1763.9 What is 39 minus 70464? -70425 Add 178.859 and -0.2. 178.659 Subtract 837 from -161. -998 Calculate -105 - 0.51. -105.51 Put together -0.92 and -0.0139. -0.9339 -0.8305 + 0.4 -0.4305 What is the difference between 11 and -41.936? 52.936 What is the distance between 6.586447 and -4? 10.586447 What is 0.1 less than 11.17087? 11.07087 Calculate 55 - 4. 51 What is the distance between 0.28587 and -0.2? 0.48587 Subtract 1.624 from 0.1. -1.524 What is 2022.076 + 5? 2027.076 -71 + 0.6 -70.4 What is 2 minus -0.0248? 2.0248 Sum 1878 and 0. 1878 What is the distance between -0.0707 and -0.314? 0.2433 Add together -5.3 and -1.518. -6.818 What is 13 plus 2.474? 15.474 What is 0.3 minus 979.6? -979.3 Put together -1071389 and -2. -1071391 Put together -0.4 and 468.591. 468.191 Calculate 0.15736 + 1. 1.15736 What is 0.0237 take away -2? 2.0237 Calculate 1.52 - -0.68. 2.2 Calculate -30.49 + 0.4. -30.09 Calculate -49 + 162. 113 Work out -67.7 + -3. -70.7 Work out 18.65 + -1.11. 17.54 Calculate -2.16 + 8.19. 6.03 Calculate 454 + 18. 472 What is 16544 plus 0.3? 16544.3 What is -295 minus 8122? -8417 -0.3491 - -5 4.6509 Calculate -3306145 - 0. -3306145 Sum -359048 and 0.8. -359047.2 Subtract 44 from -15. -59 Subtract -0.1 from 0.663. 0.763 Work out -29442 + -20. -29462 What is 7.62 take away -0.3? 7.92 What is -18 + 397? 379 Add -0.3 and 15254. 15253.7 What is -0.65565 minus -3? 2.34435 5.2+305.5 310.7 0.1 - 102 -101.9 -2+-316306 -316308 -110.526 - 1 -111.526 What is -2006 take away 0.3? -2006.3 What is 26.1 less than -0.1? -26.2 Subtract -0.4 from 1296186. 1296186.4 0.1 + -127190 -127189.9 What is 29 less than 1.46? -27.54 -4232 - 2286 -6518 What is -0.083 minus -964? 963.917 What is the distance between -106047 and 15? 106062 -4.08+0.03 -4.05 0.561432 + 7 7.561432 What is 7432 + 91? 7523 What is 26720 take away -0.098? 26720.098 Work out -46 + -631. -677 Add together -858 and 0. -858 What is 3594 take away -14.3? 3608.3 What is 0.757 - 1701? -1700.243 Work out -93 - -0.193. -92.807 Work out -23209 - 0.3. -23209.3 What is the distance between -0.4 and 8618? 8618.4 Calculate 6.092 + 3. 9.092 Calculate 28 + -46.02. -18.02 What is 0 minus 0.151? -0.151 7 + -844903 -844896 What is the difference between 1503 and -3? 1506 Put together 1.3 and 120. 121.3 What is 74 plus 1100? 1174 Work out -311013 + 0. -311013 What is the distance between 0.04 and 0.00366? 0.03634 Subtract -16.4 from 0.311. 16.711 Sum -3267.4 and -397. -3664.4 Add together -4 and 39. 35 What is -37092 less than 14? 37106 Add together 1.3 and 2.5. 3.8 Put together -12557 and -0.06. -12557.06 0.1 - 47 -46.9 Subtract 0.22 from -1.05. -1.27 What is the distance between -0.5 and -5.56648? 5.06648 Add -779 and 1.8. -777.2 What is -0.4 - -1.46? 1.06 Calculate -43 - 88. -131 Calculate -0.7 - -0.02899. -0.67101 Calculate -4 - 25.48. -29.48 What is the distance between 39.5769 and 0.6? 38.9769 What is -0.24 take away 0.372? -0.612 Calculate -5 - -0.0457. -4.9543 Add -463.61 and 2. -461.61 Sum 84 and -3790. -3706 Subtract 7245 from -0.0087. -7245.0087 What is 0.32 + -152.19? -151.87 Total of 7.11 and 5.81. 12.92 What is the difference between -2 and -0.01628375? 1.98371625 What is the difference between 0.0164 and -0.126? 0.1424 Put together 183485 and 5. 183490 Calculate -1588.1 - -0.4. -1587.7 Total of 0.15 and -116398. -116397.85 Subtract 4 from -657765. -657769 What is 223 - 8611? -8388 Subtract 0.5 from -2666.1. -2666.6 Work out 0.038 - -19. 19.038 What is -71203 plus 8? -71195 -268 - 144 -412 Calculate 306 + 4. 310 Put together 1.94636 and -3. -1.05364 -1871.3 - 7 -1878.3 Total of 18.41 and -519. -500.59 -17750 + -1 -17751 -15 - -6.6 -8.4 Sum -166 and 8. -158 What is -0.4 plus 0.07664? -0.32336 What is 29 - -50.18? 79.18 What is the distance between 1810 and -0.1? 1810.1 Total of 0.681 and -13. -12.319 Add together 3147 and 0.1. 3147.1 What is -4.17 take away -2456? 2451.83 Add together 0 and 307070. 307070 Calculate 5 - -0.46. 5.46 -463+349 -114 Add together 1519 and -3217. -1698 -5 - -0.6392 -4.3608 -0.2 - -0.43643 0.23643 Work out -924.47 + -0.4. -924.87 Work out 0.308 + 53. 53.308 Calculate -41370 - 0.3. -41370.3 Work out -431 + -0.07. -431.07 What is -9.2 take away -1.405? -7.795 Subtract 84.71 from 1. -83.71 -720 + -0.2129 -720.2129 Subtract -10 from -444334. -444324 921.2 - -334 1255.2 Subtract -0.69347 from -3. -2.30653 What is -22 minus -0.035496? -21.964504 What is -196 - 0.14? -196.14 -3 + 0.25405 -2.74595 What is -5 - -281? 276 What is 70.9 less than -0.2? -71.1 -0.0299 - 918 -918.0299 -124 - 0.2 -124.2 What is 0.03 less than -1265? -1265.03 What is 0.08 minus -28.6? 28.68 -623 - 1.47 -624.47 Add together 0.00519 and 7. 7.00519 What is 3 minus -114264? 114267 What is 15.624 + 0.412? 16.036 3.6 + 38 41.6 Calculate -195 - 5. -200 What is the distance between 0.3 and 6.6119? 6.3119 Work out 2134 + 4869. 7003 Sum -0.7 and -195. -195.7 Calculate -0.00161 + 0.19. 0.18839 What is 0.03 - -3579? 3579.03 0.04 + -317039 -317038.96 930 + 1.83 931.83 What is 17362 + 0.01? 17362.01 What is -1 take away -0.03? -0.97 Add -0.1 and -232638. -232638.1 632 + 603 1235 What is 0 minus 894? -894 What is 136 + -2.44? 133.56 -20+79 59 What is -85 less than 4.02? 89.02 Add together 0.3105 and 0.06. 0.3705 323103+-0.4 323102.6 Work out -0.3 - 8382. -8382.3 What is the difference between -2566.58 and 0.4? 2566.98 Calculate -5 + 27.31. 22.31 What is the difference between -1 and 353? 354 What is 12133 take away 3? 12130 Subtract 0.209954 from 1. 0.790046 Add together -0.1456 and -0.5. -0.6456 Work out 814781 + 0. 814781 Work out -2.3573 + -2. -4.3573 What is 2 minus 1133? -1131 -0.2806+-0.2 -0.4806 Put together -2 and 892. 890 What is 1604 minus 0.449? 1603.551 Total of 22658 and 0.4. 22658.4 Work out -427 - -6. -421 Subtract -4370 from 11. 4381 -1.68+70 68.32 What is -25744.6 take away -0.2? -25744.4 What is the difference between 1.19 and 33? 31.81 Subtract 156 from 1.9. -154.1 What is 2054 + 30? 2084 Calculate -0.014 - 1. -1.014 Subtract 0.0111 from 0.4. 0.3889 What is -0.092 less than 5? 5.092 What is 47 less than 0.87? -46.13 What is 0.16 - 0.1609? -0.0009 Subtract 60.25 from -0.124. -60.374 What is -0.11386 + -0.1? -0.21386 1278 + -4 1274 What is 1 take away 1379644? -1379643 Add together 0.7346 and 4. 4.7346 Sum -2279 and -2.3. -2281.3 What is 5 minus -46? 51 What is 0.4 minus 295.92? -295.52 What is -2145 - -4? -2141 What is 143 + -0.4? 142.6 What is the difference between 0.11 and 194.9? 194.79 What is -1027 + -48.4? -1075.4 Sum 66.2107 and 3. 69.2107 0.0358+-0.9 -0.8642 What is the distance between -0.12 and -57? 56.88 Add together -0.06 and 1927. 1926.94 Calculate 0.101051 - 1. -0.898949 Put together 61351.46 and -5. 61346.46 Put together -222.7 and -2. -224.7 What is 27 + 67.163? 94.163 Calculate	{ "pile_set_name": "DM Mathematics" }
r t. -2, 1 Let i be (2/(-6))/((-21)/27). Let g(r) be the first derivative of 1 + 2/7r + 2/7r*3 - ir*2 - 1/14r*4. Find h, given that g(h) = 0. 1 Suppose a - 19a = -90. Let w(s) be the first derivative of 0s + 0s*2 + 3/2s*4 - 7 - 4/3s*3 + 0s*a - 1/3s*6. Factor w(g). -2g*2(g - 1)*2(g + 2) Solve 37i2 + 50 - 25 + 2i*3 + 56i - i*3 + 15i + 10 = 0 for i. -35, -1 Let u(v) be the first derivative of -v6/420 + v4/84 - 16v2 - 3. Let z(g) be the second derivative of u(g). Factor z(d). -2d(d - 1)(d + 1)/7 Let a(c) be the second derivative of 3c5/5 + 233c*4/3 + 2990c*3 - 3042c*2 + 3c - 102. Factor a(p). 4(p + 39)2(3p - 1) Let u(z) be the second derivative of 1/12z*4 + 0z*3 - 3/40z*5 + 20z + 0z2 + 0 + 1/60z6. Factor u(o). o2(o - 2)(o - 1)/2 Let r be (-1)/(-1 - 4/(-16)). Let b(o) = o*2 + 4o - 10. Let p be b(-6). Determine m, given that -rmp - 5/3m - 1/3m3 - 2/3 = 0. -2, -1 Suppose 0 = r - p - 20, -5r - 98 = -10r + 4p. Let q be (16 - r)(-9)/2. Determine a, given that -2 + 0a*2 + qa - 7a + 4a*2 = 0. -1, 1/2 Determine g so that -4/3 - 1/6g*2 - 1/6g*3 + 5/3g = 0. -4, 1, 2 Suppose -3s2 - 3s*2 + 4s*2 + 100s + 4s2 - 6s*2 = 0. What is s? 0, 25 Let b be -5 - -11(0 + (-6)/(-12)). Let g(p) be the first derivative of -3 + 0p + bp*2 - 7/6p*3. What is a in g(a) = 0? 0, 2/7 Let -63075 - 3178d*2 + 6362d*2 - 870d - 3187d2 = 0. Calculate d. -145 Let v(r) be the third derivative of r5/120 - 15r*4/2 + 2700r*3 - 259r*2. Solve v(l) = 0. 180 Let k = -1735 - -5207/3. Let 13/6v*2 - 2/3 + 5/6v*3 + kv = 0. What is v? -2, -1, 2/5 Find h, given that -3h4 - 30h*2 - 4h + 24h2 + 4h + 69h2 + 12h3 = 0. -3, 0, 7 Let c(n) = -n2 - n - 1. Let j(q) = 5q3 + q2 - 10q - 8. Let x(v) = 40c(v) - 5j(v). Solve x(a) = 0. -2, 0, 1/5 Let a(p) = 12p - 24. Let r be a(2). Suppose -j + r = -u + 5, 3j - 25 = -5u. Suppose -10/3w*3 + 5/3w + 5/3wu + 0 + 0w*4 + 0w2 = 0. What is w? -1, 0, 1 Let r(j) be the third derivative of -j5/240 - 4j4 - 1536j*3 + 13j2. Factor r(w). -(w + 192)2/4 Suppose 10m - 14 + 602m*2 + 6 - 603m2 - m3 = 0. Calculate m. -4, 1, 2 Let m = -17/4 + 35/8. Let n(i) be the first derivative of -mi4 - 1/2i*3 - 1/2i - 3/4i2 + 6. Factor n(l). -(l + 1)3/2 Let f(k) be the third derivative of 0k - 1/80k5 - 1/480k*6 + 1/840k*7 + 0 + 1/96k*4 + 1/12k*3 - 12k*2. Find t such that f(t) = 0. -1, 1, 2 Let z(g) be the second derivative of 1/150g*6 - 8 + g - 7/30g*4 - 3/50g*5 - 3/10g*2 + 1/210g*7 - 11/30g*3. Factor z(m). (m - 3)(m + 1)4/5 Let x(l) be the third derivative of -l6/1320 - l5/330 + l4/264 + l*3/33 - 60l2. Determine t, given that x(t) = 0. -2, -1, 1 Let b(p) = p2 - 59p - 64. Let f(g) = 60g + 63. Let o(w) = 3b(w) + 4f(w). Factor o(q). 3(q + 1)(q + 20) Let u(h) = -10h4 + 961h*3 - 23041h*2 + 22090h - 55. Let i(r) = -5r4 + 481r*3 - 11521r*2 + 11045r - 30. Let d(c) = 11i(c) - 6u(c). Factor d(g). 5g(g - 47)*2(g - 1) Let a(k) = k4 + k3 - k*2 + 1. Let g(q) = 2q*3 - 4q*2 - 16q - 10. Let c(u) = 2a(u) + g(u). Factor c(i). 2(i - 2)(i + 1)2(i + 2) Let x(p) be the second derivative of -p*6/105 - 3p5/70 + p4/14 + 11p3/21 + 6p*2/7 - 2p + 117. Solve x(t) = 0. -3, -1, 2 Let h(o) = -o*5 + 4o4 + o3 - 4o - 4. Let n(v) = v5 - 2v*4 - 2v*3 + 3v + 3. Let r(c) = 3h(c) + 4n(c). Factor r(u). u*3(u - 1)(u + 5) Let i = 69 - 61. Determine y, given that -iy*3 - 3y*2 + 5y*2 + 6y*3 = 0. 0, 1 Let x(a) = 4a*5 + 6a*4 + 5a*3 - 13a*2 - 16a + 7. Let d(g) = g*5 + 2g*4 + 2g*3 - 4g*2 - 5g + 2. Let z(w) = 7d(w) - 2x(w). Factor z(f). -f(f - 3)(f - 1)(f + 1)2 Let z(r) be the third derivative of -3r*8/280 + 11r7/525 - r6/150 + 115r2. Factor z(l). -2l*3(l - 1)(9l - 2)/5 Let q = -4309/2 - -2155. Factor 1/2h3 + qh + 0 - h*2. h(h - 1)*2/2 Let q(g) = -21g*2 + 251g + 158. Let h(m) = 20m2 - 250m - 160. Let c(r) = -6h(r) - 5q(r). Determine a, given that c(a) = 0. -2/3, 17 Let c be ((-9)/(63/(-49)))/(1/(-5)). Let x be (80/c)/8 - 9/(-7). Determine o, given that -5o + 19/4o*2 + x + 13/4o*3 + 7/4o*5 - 23/4o*4 = 0. -1, 2/7, 1, 2 Let k be (0(-12)/(-156))/(-2). Let -1/5r2 + 1/5 + kr = 0. Calculate r. -1, 1 Let m be 4/26 - (-7595)/12740. Factor -ma2 + 0 - 3/4a*3 - 1/4a - 1/4a4. -a(a + 1)*3/4 Let g be 3 - (3 + (0 - 3)). Solve 3h*5 + 8h*4 - 4h - 32h3 - 13h*2 + 33h*g + 5h*2 = 0 for h. -2, -1, -2/3, 0, 1 Let a = -162 + 323. Let u = a + -643/4. Find h, given that 1/2 - uh*2 - 1/4h = 0. -2, 1 Let n = 9/38 + 11/114. Let y(b) be the third derivative of nb4 - 1/15b*5 - 11b*2 + 0b*3 + 0 + 0b. Suppose y(s) = 0. Calculate s. 0, 2 Let a = 44/25 + -1031/600. Let s(d) be the third derivative of -ad4 + 0 - 7d*2 - 1/180d*5 + 2/9d*3 + 0d. Factor s(k). -(k - 1)(k + 4)/3 Determine u, given that 1/3u*3 + 575/3u + 47/3u2 + 529/3 = 0. -23, -1 Let d(o) be the third derivative of -o5/20 - 4o*4 - 128o*3 - 86o*2. Factor d(n). -3(n + 16)2 Let y(b) be the third derivative of b5/90 + 23b4/18 - 47b*3/9 + 116b*2 + 4b. Find r, given that y(r) = 0. -47, 1 Determine h, given that 6 - 36/7h - 6/7h*2 = 0. -7, 1 Let x be 77/(-22)4/(-7). Suppose 0 = -xb + 3 + 3. Factor -2/3z*b + 2/3z*4 - 2z*2 - 4/3 + 10/3z. 2(z - 1)3(z + 2)/3 Let j = -193 - -198. Let c(u) be the second derivative of 0 + 0u2 - 1/42u*4 + 3u + 1/70uj - 2/21u*3. Determine x, given that c(x) = 0. -1, 0, 2 Let h be (((-8)/(-2))/(-4))/(-1). Let i be h(-4)/(-6)3. Let 4/11a*i - 2/11a*4 + 0a*3 - 2/11 + 0a = 0. Calculate a. -1, 1 Let f = 4846 + -19267/4. Let k = f - 27. What is l in 3/2l5 - 3/4l + 9/4l2 - 3/4l*3 + 0 - kl*4 = 0? -1, 0, 1/2, 1 Let r(c) = 22c*5 + 5c*4 + 5c*3 + 13c*2 - 9c - 9. Let z(u) = -5u5 - u4 - u3 - 3u*2 + 2u + 2. Let j(w) = 2r(w) + 9z(w). Factor j(p). -p*2(p - 1)*2(p + 1) Suppose 0 = 2j - 2l - l - 9, j = 5l + 15. Factor -2/3r2 - r3 + j - 1/6r - 1/6r*5 - 2/3r*4. -r(r + 1)4/6 Let n(o) be the second derivative of -o5/30 - o*4/3 - 5o*3/9 + 23o. Factor n(i). -2i(i + 1)(i + 5)/3 Let v(k) be the second derivative of k5/100 + k4/12 - k3/5 - 224k. Factor v(b). b(b - 1)(b + 6)/5 Let f(q) = -4q2 - 6q + 18. Let m(k) = -9k2 - 8k + 37. Let g(n) = 10f(n) - 4m(n). Find t such that g(t) = 0. -8, 1 Suppose 2r = -4v - 4, 3 + 7 = 3r + 2v. Suppose 3l = -4a + 2, -4l = -5a + 12 + r. Solve i*2 + ai3 + i4 - 52i + 52i = 0. -1, 0 What is k in 17k5 + 10k*2 + 7k*4 - 37k*3 + 25k*4 - 22k5 = 0? 0, 2/5, 1, 5 Let f(y) be the third derivative of y8/2520 + y7/252 + y6/90 + 7y5/30 - 20y*2. Let r(k) be the third derivative of f(k). Factor r(a). 4(a + 2)(2a + 1) Factor 71/3 - 1/3j2 - 70/3j. -(j - 1)(j + 71)/3 Let s(i) be the second derivative of 169i*6/180 - 13i5/15 + i4/3 - 13i3/6 - 4i. Let r(m) be the second derivative of s(m). Let r(z) = 0. What is z? 2/13 Let u(w) = -2w2 - 22w - 54. Let t be u(-7). Factor 3/5i3 - 9/5i - 6/5it + 0. 3i(i - 3)(i + 1)/5 Let p(f) be the second derivative of -f4/12 - f3/3 + 3f2/2 + 2f - 13. Let d be p(1). What is s in ds + 4/7s*2 + 4/7s*3 + 0 = 0? -1, 0 Let k = 15 + -15. Suppose -h - h + 96 = k. What is g in -38g + 14g - h + 4g*2 - 4g*2 - 3g*2 = 0? -4 Let i be 8/74/80. Let v(l) be the first derivative of 1 + 2/7l3 + il*5 - 8/7l - 2/7l4 + 4/7l*2. Find k, given that v(k) = 0. -1, 1, 2 Let t(u) be the second derivative of 1/30u*3 + 0 + 0u*2 - 1/100u*5 - 29u + 0u4. Factor t(z). -z(z - 1)(z + 1)/5 Let q(i) be the third derivative of 0 + 0i - 1/84i4 - 1/35i*6 + 13/420i*5 + 3/490i*7 + 0i*3 + 4i*2. Factor q(z). z(z - 2)(3z - 1)*2/7 Let t = 1517/2 + -797. Let i = 157/4 + t. Solve -1/4v + 1/4v4 - iv*3 + 3/4v2 + 0 = 0. 0, 1 Let z(t) = t2 + 2t + 1. Let i be z(-3). Suppose 5r - ih = 0, -45 = -5r - h - 4h. Factor -3s3 + s2 + rs3 - 2s*2 + 4 - 2s2. (s - 2)2(s + 1) Let y(d) = 4d*2 + 8d. Let f be (27/(	{ "pile_set_name": "DM Mathematics" }
3 + 8g3 as kg*3 + ig*2 + cg + j and give i. 3 Rearrange (17z2 - 16z*2 - 14z*2 + 3z)(-z + 1 - 1)(-2 + 0 - 2) to y + tz + dz*3 + gz*2 and give d. -52 Rearrange -7u + 22u + 8u + 100u to the form c + bu and give b. 123 Express -65l2 - 40l*2 - 16l*2 - 14l*2 in the form cl*2 + i + dl and give c. -135 Express -5f - 135f*3 + 137f*3 - 4f*2 + 4f + 2f2 - 1 in the form bf*3 + xf*2 + z + af and give z. -1 Express (-1 - 2 - 2)(2o - 2 - 8 + 8) as w + do and give w. 10 Rearrange (-8y + 4y - 5y)(-2y + y + 3y) + 1 - 1 - 2y*2 + (-1 + 1 - 2y)(-4y + 6y - y) to zy*2 + hy + x and give z. -22 Rearrange -1 + 5f4 + 3f2 + f4 - 2f3 - 4f*4 + 0f*4 to the form yf*2 + if*3 + df + x + vf4 and give i. -2 Rearrange 2 + 21a - 2 to the form da + x and give d. 21 Express 4 - 4 - 2t + (1 + 1 + 0)(-2t + 2t + t) - 4t - 5t + 5t as j + kt and give k. -4 Rearrange 0y2 - y3 + 0y2 + (2y + 4y - y)(2y2 - 4y*2 + 5y*2) to cy + ay2 + f + ty*3 and give t. 14 Rearrange 15v + 8 - 8 to the form nv + p and give n. 15 Express (-3 + 2 + 2)(5b4 - 2 - 22b - b*2 + 19b + 1) as ob2 + h + qb*4 + ub*3 + xb and give x. -3 Rearrange -3n2 + 46n*2 + 12n*2 to the form o + jn*2 + zn and give j. 55 Rearrange (0k + k - 2k + (2 - 2 + 2k)(-1 - 2 + 1) + 7k - 3k - 2k)(-k*2 - 8k*2 - 2k*2) to fk*2 + qk*3 + uk + t and give q. 33 Express -30t2 + 1 - 3 + 0 + 27t*2 as p + xt*2 + ot and give p. -2 Rearrange (8 + 2 - 5)((-6v - v + 3v)(-4 + 1 + 4) - v + 4v - 2v) to the form h + lv and give l. -15 Rearrange (-2 - 5h3 + h3 + 2h3)(13h - 57 + 57 + (-3 + 3 + 1)(2h - 4h + 3h)) to the form sh*4 + b + jh + gh2 + ih*3 and give s. -28 Express (-10n2 + n2 + n*2)(-2n2 - 4n2 - n2) as mn + hn*2 + zn*3 + u + on4 and give o. 56 Rearrange -2 + w4 + 0w4 + 66w - 65w to the form cw*3 + o + gw*4 + kw*2 + yw and give g. 1 Rearrange -y3 + y + y2 - 2y3 + 16y*3 - 11y*3 to the form ty*3 + my + py2 + d and give t. 2 Rearrange -t4 + 0 - t4 - 3t*2 + 1 to jt*3 + yt*4 + x + at + ht2 and give x. 1 Rearrange (3j*2 - 3j*2 + 2j*2)(0 + 3 - 4)(-5j + 3j - 9j) + (-5 + 2 + 4)(0j*3 + 3j*3 - 2j*3) to gj + c + wj2 + nj*3 and give n. 23 Rearrange (1 + 3 - 5)(v*2 - 7v*2 + 0v*2 - 5v*3) to zv + bv2 + dv3 + u and give u. 0 Express (4 - a2 - 4)((6 - 2 - 3)(4 - 2 + 0) - 6 + 3 + 4 + 0 - 2 - 2) in the form u + sa + qa*2 and give q. 1 Express -24w + 47w + 71w in the form z + gw and give g. 94 Rearrange -6h + 0h - 2 - 2h to the form p + mh and give p. -2 Express (33f*2 + 31f*2 - 3f*2)(-f*2 + 2f2 + f2) in the form kf + pf*3 + g + df*4 + tf*2 and give p. 0 Express -m + 824 - 824 + 76m*2 as r + vm + xm2 and give x. 76 Rearrange -2u + 4u2 + 8u + 5u2 to the form mu + fu2 + s and give f. 9 Express 2 - 4 + 3r*2 + 4r*2 in the form p + mr*2 + cr and give m. 7 Express -5l4 + 2l4 - 5 + l4 - 3l3 in the form vl*2 + ul + wl3 + s + dl4 and give u. 0 Rearrange -v2 - 3v2 + v - 2v*3 + 0v*2 to gv*3 + mv + a + dv2 and give g. -2 Rearrange (10 - 11 - 72)(5x - 2x - x) to the form yx + u and give y. -146 Rearrange (3 + 8 - 4)(5n2 + 6n - 6n)(-2 - n + 2)(-2 - 4 + 5) to the form qn*3 + fn*2 + xn + b and give q. 35 Rearrange 3m2 - 3m*3 + 4m + 43 - 43 - 2m4 to the form nm*3 + xm*4 + vm + hm2 + z and give v. 4 Express (2l - l + l)(3l + 14 - 55 + 4) as xl + t + ml*2 and give x. -74 Express 2w*2 + 2w3 - w2 - 4w - 12 - 4w*3 - 2w*4 + 14 in the form zw + pw3 + sw*4 + mw*2 + q and give z. -4 Rearrange (0f + f - 3f)(0 - 1 - 1) + (5f - 5f + 5f)(1 - 9 + 0) to the form pf + r and give p. -36 Express (0r*2 + 2r*2 - 3r*2)(5r2 - r2 - 2r*2) + 4r*4 - 10r*3 + 10r*3 as nr*2 + zr*3 + cr*4 + yr + v and give c. 2 Express (-24 - 114 - 16)(4 - 2d - 4) as y + kd and give k. 308 Rearrange (5t - t - 2 + 0)(-6t + 2t + 3t)(4t - 2 + 2) to the form vt + k + st*2 + lt*3 and give l. -16 Express -1 + 2f*3 + 0 + 0f*3 + 68f*2 - 66f*2 in the form zf*2 + wf + bf3 + n and give z. 2 Express -61c - 29c + 23c - 46c as ic + v and give v. 0 Rearrange -4r2 - 5r*2 - 7r3 - r4 + 7r2 to the form gr*3 + hr*4 + qr + w + cr2 and give g. -7 Rearrange -12x - 6x3 + 2x*4 + 2x*2 - 4 + 13x + 7x3 to the form kx*3 + ox + mx2 + vx*4 + j and give m. 2 Express 0a*3 + 4 - 2a*2 - 2a3 + a4 - 3 + 10a3 as na*2 + d + va*3 + ia*4 + ta and give v. 8 Rearrange (2w - 6w + 0w)(3 - 2 - 3)(-3w + 0w + 7w) + 5w - 5w + w*2 to the form nw + tw2 + f and give t. 33 Rearrange -v + 3v*3 + 2v + 0v - v2 to yv + qv3 + h + lv*2 and give l. -1 Rearrange (-2c + 3c - 2c)((-c - 2c + 2c)(-4c2 + 4c2 + c2) + 5 + 0 + 16c3 - 2) to ic*3 + ac*4 + h + uc + wc2 and give u. -3 Express -2z*2 + 3z*3 - 3z*3 + 0z*4 - 3z4 + z - z3 as jz3 + lz*2 + pz + rz4 + f and give j. -1 Rearrange 0 - 3g*3 - 2g*2 + 5g*3 + 3g*4 - 4 + 0g*2 to the form sg*4 + lg*2 + ag*3 + d + vg and give s. 3 Express 4p - 16p - 8p + 3p - p*2 as vp*2 + bp + i and give b. -17 Express 1 + 4j4 - 20j + 6j4 - 11j*4 as hj*4 + tj*3 + wj + q + uj2 and give h. -1 Rearrange 7 + 2f - f*3 - 11 + 3 + 2f*4 to the form yf*4 + rf*2 + af + w + uf3 and give u. -1 Rearrange 3a*2 + 0a2 - a2 + (-a + 3a + 0a)(-4a + 0a + 2a) + (-a + 2a + 2a)(7a + 5a + 3a) to the form xa2 + wa + d and give x. 43 Express 31 - 31 - 21n as s + mn and give s. 0 Express 5y - 4y*3 + 4y*2 - 4y*2 - 4y in the form iy2 + hy*3 + ay + q and give a. 1 Express 31n - 2 - 3 - 16n - 14n as an + m and give a. 1 Rearrange (-x - x + 4x)(12 - 21 - 6) to s + dx and give d. -30 Express (-p - p + 4p)(-3p + 5p + 6p)(9p + 0p - p) in the form vp + i + sp3 + bp*2 and give s. 128 Express (-3p + p + p)(-7 - 15 + 13) in the form t + up and give u. 9 Rearrange 3j - 25j - 7j to cj + u and give c. -29 Rearrange -4p - 4p + p + (p + 1 - 1)(-5 + 0 + 3) to the form mp + z and give m. -9 Express n*2 + 30n*3 + 2 + 0n - 2n - 28n*3 + 3n*2 in the form gn*3 + a + jn + xn2 and give j. -2 Express ((-4 + 5 + 1)(5 + 1 - 4) - 12 + 14 - 9)(2n*4 + 2n*4 - 3n*4) in the form zn*2 + an*3 + g + sn*4 + cn and give s. -3 Rearrange 4x2 + 8x*4 - 2x - 3x2 + 12x*3 - 10x*4 - 1 to vx*3 + zx*2 + o + wx*4 + cx and give w. -2 Rearrange 15c2 - 5c*2 - 7c*2 + 3c*3 to the form pc*3 + kc + h + jc2 and give p. 3 Rearrange -139w + 270w + 6 - 138w to the form nw + x and give x. 6 Express -5i + 5i - 2i*2 + (-i + 1 - 1)(3i + i - 2i) - 319i - 33i*2 + 319i in the form pi + o + wi*2 and give w. -37 Rearrange 2t*3 - 2t + t*3 + 0t*3 + 3t*3 to the form z + pt*3 + gt*2 + rt and give r. -2 Express (-127 + 259 - 128)(u + 0u + 0u)(7 - 3 - 2) in the form zu + f and give z. 8 Rearrange 14242 - 14242 + 94f to z + yf and give y. 94 Rearrange (-r + 5r - 2r)(9 + 2 + 10) + (-2r - r + 2r)(-3 + 0 + 2) + 0 + r + 0 to the form nr + y and give n. 44 Rearrange -18 + 39 - 3h + 0h to ph + b and give b. 21 Express 37i + 31i + 2 - 38i as ri + h and give h. 2 Rearrange (-3 + 3 - y)(-21 - 10 + 14) to the form z + uy and give u. 17 Rearrange 3f - f - 8f2 + 4f - 4f to o + kf + rf2 and give r. -8 Express 3v*4 - 1 - 234v*3 + 2v + 237v3 - 4v*4 in the form bv*4 + sv + nv2 + f + wv*3 and give w. 3 Rearrange -7d - 7d - 3d - 25d to the form h + td and give t. -42 Rearrange 5 - 4 + 1 + 0 + 4n2 to qn + dn2 + r and give d. 4 Rearrange -4 + 2k*4 + 2k*2 + 2 + 2k*2 - 2k*3 to qk + gk2 + xk*3 + m + rk*4 and give m. -2 Express (5x - x - x)(0x*2 - 3x2 + x2) + 2x3 + x - x in the form g + nx + wx3 + rx*2 and give w. -4 Rearrange (3 + 0 - 1)(-4g2 - 25g*2 + 8g*2) + 2g - 2g + 2g*2 to the form s + fg*2 + wg and give	{ "pile_set_name": "DM Mathematics" }
cked without replacement from zzzzpdzzzpzpzzz. Give prob of picking 1 z and 1 p. 11/35 Two letters picked without replacement from hfffffhhhfhhfffh. What is prob of picking 2 f? 3/10 Calculate prob of picking 1 v and 1 n when two letters picked without replacement from llnwjovjnljnnnvvlv. 20/153 Two letters picked without replacement from flfflfffllffl. Give prob of picking 2 f. 14/39 Three letters picked without replacement from {r: 5, o: 1, a: 5, s: 1}. What is prob of picking 2 r and 1 o? 1/22 Four letters picked without replacement from ccbkcccekeccc. What is prob of picking 2 k and 2 e? 1/715 Calculate prob of picking 3 t when three letters picked without replacement from tttttii. 2/7 Four letters picked without replacement from hggxhmmx. Give prob of picking 1 m, 1 h, and 2 g. 2/35 What is prob of picking 1 v and 1 p when two letters picked without replacement from ppbuuuv? 2/21 Calculate prob of picking 1 t, 1 q, and 1 i when three letters picked without replacement from {i: 1, b: 4, t: 2, q: 1}. 1/28 Four letters picked without replacement from {p: 1, a: 1, u: 3, v: 3, l: 2, x: 5}. Give prob of picking 1 l and 3 u. 2/1365 Two letters picked without replacement from ttuslutlqsluttutlitq. Give prob of picking 2 s. 1/190 Calculate prob of picking 3 m when three letters picked without replacement from mjjjjjjjmjmjjj. 1/364 Calculate prob of picking 1 q and 1 k when two letters picked without replacement from {k: 1, p: 5, e: 2, q: 2, g: 4}. 2/91 Calculate prob of picking 2 f and 2 q when four letters picked without replacement from okqqddfqddfqodd. 2/455 Four letters picked without replacement from gggaoggmmggga. Give prob of picking 2 g and 2 m. 28/715 What is prob of picking 1 j, 1 e, and 1 r when three letters picked without replacement from vertjvyj? 1/28 Four letters picked without replacement from jjejbjbb. Give prob of picking 2 b and 2 j. 9/35 Calculate prob of picking 2 i and 1 j when three letters picked without replacement from {i: 12, j: 7, u: 1}. 77/190 Two letters picked without replacement from ppppdppdpp. What is prob of picking 2 d? 1/45 Calculate prob of picking 1 o and 1 g when two letters picked without replacement from {o: 7, g: 5, c: 2}. 5/13 Calculate prob of picking 1 q, 1 a, and 2 i when four letters picked without replacement from {i: 2, a: 2, w: 4, n: 2, q: 2}. 4/495 Two letters picked without replacement from modmmdnoojdooommj. Give prob of picking 1 d and 1 o. 9/68 Two letters picked without replacement from {o: 2, q: 4, l: 1}. What is prob of picking 1 o and 1 l? 2/21 Two letters picked without replacement from nvvvuvvvvnvvvuvunv. What is prob of picking 1 v and 1 u? 4/17 Calculate prob of picking 1 c, 2 p, and 1 d when four letters picked without replacement from pcpddpcc. 9/35 Calculate prob of picking 2 g and 2 h when four letters picked without replacement from {h: 2, g: 7}. 1/6 What is prob of picking 1 v, 1 b, and 2 l when four letters picked without replacement from {b: 4, v: 1, l: 3, a: 2}? 2/35 What is prob of picking 3 l when three letters picked without replacement from {l: 7, p: 2}? 5/12 Three letters picked without replacement from eeovb. Give prob of picking 1 e, 1 o, and 1 b. 1/5 Two letters picked without replacement from eetett. Give prob of picking 2 e. 1/5 Three letters picked without replacement from {n: 2, e: 1, k: 4}. What is prob of picking 2 k and 1 n? 12/35 Calculate prob of picking 3 p when three letters picked without replacement from jjjjjppjjpjpjppp. 1/16 Calculate prob of picking 2 d when two letters picked without replacement from {g: 4, d: 3, s: 2, e: 2, r: 2}. 1/26 Four letters picked without replacement from iiiiviivia. What is prob of picking 3 i and 1 v? 1/3 Two letters picked without replacement from gghllgrlrmggrgghlgg. What is prob of picking 1 m and 1 h? 2/171 What is prob of picking 1 b and 2 u when three letters picked without replacement from ubuu? 3/4 What is prob of picking 1 v and 1 n when two letters picked without replacement from {v: 10, n: 2}? 10/33 Three letters picked without replacement from cncccmnncccnmccclm. Give prob of picking 1 l and 2 n. 1/136 What is prob of picking 2 z and 1 u when three letters picked without replacement from zzzzuhuzu? 5/14 What is prob of picking 1 e and 1 q when two letters picked without replacement from bxbximxxxexxxqxqxxm? 2/171 Two letters picked without replacement from bobammnnnnbmnntaob. What is prob of picking 1 t and 1 n? 2/51 What is prob of picking 3 e and 1 x when four letters picked without replacement from xkexxlekek? 1/70 Calculate prob of picking 2 b when two letters picked without replacement from {k: 6, b: 13}. 26/57 Two letters picked without replacement from {t: 4, a: 2, l: 6, r: 1}. Give prob of picking 2 a. 1/78 What is prob of picking 1 z and 1 p when two letters picked without replacement from wpzzzppznwwznwwzpzz? 32/171 Two letters picked without replacement from {k: 3, m: 4, w: 4}. What is prob of picking 2 m? 6/55 Calculate prob of picking 1 d, 1 t, and 2 n when four letters picked without replacement from {n: 2, d: 5, t: 8}. 8/273 Calculate prob of picking 3 w when three letters picked without replacement from veeiwwywewecw. 5/143 What is prob of picking 1 h and 1 x when two letters picked without replacement from sihlhsxb? 1/14 Two letters picked without replacement from dppdpddpddpppddedpp. What is prob of picking 2 p? 4/19 Four letters picked without replacement from kmkbkrbghrkh. Give prob of picking 2 k and 2 r. 2/165 Calculate prob of picking 2 u and 2 a when four letters picked without replacement from aauaaaaauaa. 6/55 Three letters picked without replacement from vvevvevuebke. Give prob of picking 1 b and 2 e. 3/110 Calculate prob of picking 1 y, 1 v, and 1 o when three letters picked without replacement from {o: 14, v: 1, y: 2}. 7/170 Two letters picked without replacement from kvwvwvu. Give prob of picking 1 u and 1 w. 2/21 Four letters picked without replacement from ggggggggggggl. Give prob of picking 4 g. 9/13 Three letters picked without replacement from jmjjjjmjjxjjmxmxx. What is prob of picking 1 m and 2 x? 3/85 Three letters picked without replacement from qttdtikiixqt. Give prob of picking 1 q, 1 t, and 1 x. 2/55 What is prob of picking 2 d when two letters picked without replacement from {d: 7, p: 1, t: 2, f: 2}? 7/22 Calculate prob of picking 1 d and 2 y when three letters picked without replacement from {y: 7, k: 4, d: 2}. 21/143 Two letters picked without replacement from prpqrrrrpq. Give prob of picking 2 q. 1/45 Three letters picked without replacement from wbwvvwvwwwwcvww. What is prob of picking 2 v and 1 c? 6/455 Calculate prob of picking 1 s and 3 e when four letters picked without replacement from {s: 5, e: 8}. 56/143 Four letters picked without replacement from {z: 8, f: 2, k: 1, w: 7}. What is prob of picking 4 z? 7/306 Three letters picked without replacement from bbrmrrzzzzzrzz. Give prob of picking 1 z and 2 r. 3/26 Two letters picked without replacement from {y: 16, n: 2}. What is prob of picking 1 y and 1 n? 32/153 Calculate prob of picking 1 b and 1 p when two letters picked without replacement from {b: 1, z: 4, k: 5, p: 3}. 1/26 Four letters picked without replacement from mbgbvubmbbmmbm. Give prob of picking 3 b and 1 v. 20/1001 Two letters picked without replacement from ppnnppppnnnppp. What is prob of picking 1 p and 1 n? 45/91 Three letters picked without replacement from iiwwipuwiiiuw. Give prob of picking 2 i and 1 p. 15/286 What is prob of picking 3 u when three letters picked without replacement from {b: 3, u: 3, q: 4, s: 1}? 1/165 Three letters picked without replacement from xtdtgdxtxtdkvtttdv. What is prob of picking 1 d, 1 k, and 1 v? 1/102 What is prob of picking 1 i, 1 y, 1 g, and 1 f when four letters picked without replacement from {g: 7, i: 3, f: 1, y: 1, r: 1}? 21/715 Two letters picked without replacement from poojwdwdjjjoppdjjopw. Give prob of picking 1 j and 1 p. 12/95 Four letters picked without replacement from {x: 1, p: 2, m: 2, e: 1, g: 1}. What is prob of picking 1 e, 1 m, and 2 p? 2/35 Calculate prob of picking 1 s, 1 a, and 2 k when four letters picked without replacement from lbbabsabkabbbbkbb. 3/2380 Two letters picked without re	{ "pile_set_name": "DM Mathematics" }
r of 2318 and 190? 38 What is the highest common divisor of 74 and 20128? 74 What is the highest common factor of 75 and 25? 25 What is the greatest common divisor of 11 and 363? 11 Calculate the greatest common divisor of 144 and 99. 9 Calculate the greatest common divisor of 170 and 15. 5 Calculate the highest common divisor of 3870 and 270. 90 Calculate the greatest common divisor of 35 and 195. 5 What is the highest common divisor of 3382 and 57? 19 Calculate the greatest common divisor of 1147 and 74. 37 Calculate the highest common divisor of 87 and 2117. 29 Calculate the highest common divisor of 3551 and 67. 67 What is the highest common divisor of 385 and 220? 55 What is the greatest common divisor of 101 and 7979? 101 What is the highest common divisor of 1566 and 126? 18 Calculate the greatest common divisor of 56 and 2772. 28 What is the greatest common factor of 369 and 81? 9 Calculate the highest common divisor of 51 and 3587. 17 Calculate the highest common divisor of 14 and 3563. 7 Calculate the highest common factor of 46 and 82. 2 What is the highest common factor of 407 and 37? 37 What is the highest common divisor of 17 and 5627? 17 Calculate the highest common divisor of 6 and 39. 3 Calculate the greatest common divisor of 54 and 2322. 54 What is the greatest common divisor of 77 and 77? 77 What is the greatest common factor of 141 and 21? 3 What is the greatest common divisor of 98 and 2898? 14 What is the highest common divisor of 261 and 2001? 87 What is the greatest common factor of 69 and 12? 3 Calculate the highest common divisor of 32 and 36. 4 What is the highest common divisor of 68 and 26622? 34 Calculate the highest common divisor of 360 and 45. 45 Calculate the highest common divisor of 955 and 4393. 191 What is the greatest common factor of 57 and 2451? 57 Calculate the greatest common divisor of 2056 and 2313. 257 What is the highest common factor of 49 and 287? 7 What is the greatest common divisor of 297 and 5481? 27 What is the greatest common divisor of 19192 and 8? 8 What is the greatest common divisor of 376 and 22936? 376 What is the greatest common divisor of 6 and 978? 6 Calculate the greatest common divisor of 165 and 9. 3 What is the greatest common divisor of 172 and 731? 43 What is the greatest common factor of 144 and 96? 48 What is the highest common factor of 294 and 42? 42 What is the greatest common factor of 234 and 25506? 234 Calculate the highest common factor of 12 and 12. 12 Calculate the greatest common factor of 4400 and 33. 11 Calculate the greatest common factor of 22 and 22. 22 What is the highest common divisor of 2187 and 9? 9 What is the highest common factor of 833 and 17? 17 Calculate the highest common factor of 1435 and 1025. 205 Calculate the highest common divisor of 24 and 5592. 24 What is the greatest common divisor of 38 and 342? 38 What is the greatest common factor of 126 and 2156? 14 Calculate the greatest common divisor of 3193 and 124. 31 Calculate the greatest common divisor of 132 and 1012. 44 What is the highest common divisor of 441 and 49? 49 What is the highest common factor of 304 and 95? 19 Calculate the greatest common factor of 42 and 2121. 21 What is the highest common factor of 80 and 48? 16 Calculate the highest common factor of 34 and 1530. 34 Calculate the highest common divisor of 20 and 250. 10 What is the greatest common factor of 55 and 12496? 11 What is the greatest common factor of 11 and 2981? 11 Calculate the greatest common divisor of 1024 and 224. 32 Calculate the highest common factor of 98 and 1694. 14 Calculate the greatest common factor of 426 and 18. 6 Calculate the greatest common factor of 343 and 98. 49 What is the greatest common factor of 42 and 1750? 14 What is the greatest common factor of 35 and 3430? 35 Calculate the greatest common factor of 6 and 438. 6 What is the highest common divisor of 32 and 36? 4 Calculate the highest common factor of 110 and 11. 11 What is the highest common factor of 2 and 178? 2 What is the highest common divisor of 13578 and 93? 93 What is the greatest common factor of 6 and 6? 6 What is the greatest common factor of 18 and 9846? 18 What is the highest common factor of 3990 and 60? 30 What is the greatest common factor of 352 and 110? 22 What is the greatest common divisor of 13247 and 52? 13 What is the greatest common divisor of 28 and 20? 4 What is the greatest common divisor of 56 and 1192? 8 Calculate the highest common factor of 1288 and 23. 23 What is the highest common factor of 6 and 46152? 6 Calculate the greatest common divisor of 80 and 32. 16 What is the highest common factor of 33291 and 27? 27 Calculate the greatest common divisor of 17 and 27948. 17 What is the greatest common factor of 2300 and 8510? 230 Calculate the greatest common factor of 8820 and 225. 45 What is the greatest common factor of 2691 and 117? 117 What is the highest common factor of 171 and 19? 19 Calculate the greatest common factor of 10 and 24505. 5 Calculate the highest common factor of 6031 and 37. 37 Calculate the highest common divisor of 87 and 12. 3 Calculate the greatest common factor of 55 and 55. 55 What is the highest common divisor of 258 and 301? 43 What is the highest common factor of 336 and 144? 48 What is the highest common factor of 306 and 117? 9 What is the greatest common divisor of 75 and 105? 15 What is the greatest common divisor of 76 and 16? 4 Calculate the highest common factor of 1456 and 3024. 112 Calculate the greatest common factor of 13 and 28. 1 Calculate the highest common factor of 48 and 708. 12 Calculate the greatest common factor of 2188 and 4. 4 What is the highest common divisor of 4 and 236? 4 What is the highest common factor of 24 and 414? 6 What is the highest common factor of 7905 and 255? 255 Calculate the highest common factor of 26 and 5317. 13 Calculate the greatest common factor of 84 and 4704. 84 Calculate the greatest common divisor of 2408 and 112. 56 Calculate the highest common factor of 24 and 744. 24 What is the greatest common divisor of 357 and 21? 21 Calculate the greatest common factor of 21731 and 31. 31 What is the highest common factor of 176 and 33? 11 Calculate the highest common divisor of 168 and 46. 2 Calculate the greatest common divisor of 28 and 100. 4 What is the greatest common divisor of 46665 and 45? 45 Calculate the highest common factor of 12 and 255. 3 Calculate the highest common factor of 400 and 72. 8 What is the highest common divisor of 2006 and 476? 34 Calculate the highest common factor of 24 and 332. 4 Calculate the highest common factor of 59 and 1003. 59 Calculate the highest common divisor of 10 and 9. 1 What is the greatest common divisor of 21 and 651? 21 What is the greatest common divisor of 3580 and 80? 20 Calculate the greatest common factor of 880 and 550. 110 Calculate the greatest common divisor of 90 and 610. 10 Calculate the greatest common factor of 18342 and 90. 18 What is the highest common divisor of 105 and 24105? 15 Calculate the highest common factor of 144 and 976. 16 What is the highest common divisor of 143 and 55? 11 Calculate the greatest common factor of 702 and 182. 26 What is the highest common divisor of 603 and 18? 9 Calculate the greatest common divisor of 568 and 8. 8 What is the highest common factor of 118 and 1711? 59 Calculate the highest common factor of 1095 and 75. 15 What is the greatest common divisor of 9 and 72? 9 What is the greatest common factor of 10 and 4390? 10 Calculate the greatest common divisor of 450 and 126. 18 Calculate the highest common divisor of 1160 and 328. 8 What is the highest common divisor of 500 and 20? 20 Calculate the highest common divisor of 1100 and 286. 22 What is the highest common factor of 770 and 28? 14 Calculate the highest common divisor of 255 and 30. 15 Calculate the greatest common factor of 414 and 26. 2 Calculate the highest common divisor of 75 and 150. 75 Calculate the greatest common factor of 32 and 496. 16 Calculate the greatest common factor of 572 and 208. 52 Calculate the highest common divisor of 774 and 27. 9 What is the greatest common factor of 552 and 12? 12 Calculate the greatest common divisor of 47 and 1081. 47 What is t	{ "pile_set_name": "DM Mathematics" }
z (b) j (c) 2 a Let g = -0.1 + -0.3. Let r = 13 - 18. Which is the nearest to -1? (a) g (b) r (c) -2 a Let n = 0.3 - 0.4. Let k be (5/(-2))/(5/(-10)). Let y be 3 - (2 + (-3 - -4)). Which is the nearest to n? (a) y (b) k (c) -2/9 a Let i = -0.165 + -2.835. Let d = -2 + -3. Which is the nearest to 0? (a) i (b) -1/3 (c) d b Let b = -6 + -1. Let k = -8 - b. What is the closest to k in -1, 5, 5/2? -1 Let j = 0.3 - 0.6. Let y = -0.03 + -2.97. Let p = y - -2.8. Which is the nearest to p? (a) j (b) -3 (c) -0.4 a Let l = -1 + 0. Let u = l + 0. Let m = -689/1218 + -1/174. Which is the closest to u? (a) m (b) 1 (c) 4 a Let n = 2.5 - -0.5. Which is the closest to 0.1? (a) 0.1 (b) -1/3 (c) n a Let b = 4.9 - -0.1. Suppose 0 = -6i + 2i - 16. Let h be (i/(-30))/(2/3). What is the nearest to -0.1 in b, h, 1? h Let x = 3.6 - 4. Let t = 17 - 16.9. Let a = -0.05 + t. What is the nearest to -1 in 1/2, a, x? x Let x = 2.5 + 0.5. Let v = -4 + x. Let z = v - -3. What is the closest to z in 5, 2, 3? 2 Let w(m) = -m*3 + 7m*2 - m + 5. Let x be w(7). Let z be (2 + x)/(-3 + 2). Suppose z = 2r - 7r + 25. Which is the closest to 1? (a) 0.1 (b) r (c) 0.2 c Let k = 29/2 + -14. Let o = 0.1 + -0.2. Which is the nearest to k? (a) -0.2 (b) -4 (c) o c Let l = -4 + 4.8. Let u = 0.5 - l. Let y = -1/51 + 109/357. What is the nearest to y in -0.1, u, -5? -0.1 Let k = -0.04 + -0.08. Let r = k + 0.02. Which is the closest to r? (a) 5 (b) 0 (c) 1 b Let a = -23 - -43. Let s = a - 19. Let t = 0.4 + -0.7. What is the closest to s in 0.3, 1, t? 1 Let p = 4.4 - 4.3. Which is the nearest to 2/3? (a) 0.2 (b) 3 (c) p a Let r = 2 - 1.9. Let g = 10 + -15. Which is the nearest to r? (a) 1 (b) 3/7 (c) g b Suppose 0 = 9q - 11q + 10. Which is the nearest to -1? (a) q (b) 1/3 (c) -4 b Let l = 16.8 - 21.88. Let q = -0.08 - l. Let d = -16 + 16. What is the closest to 1 in d, q, 1/3? 1/3 Let d(q) = -q - 7. Let v be d(-6). Let f = v - -4. Let h = -4 + f. Which is the closest to h? (a) -3 (b) 1/8 (c) 0.5 b Let d = 85 - 48. Let x = d + -32.2. Let z = x - 0.8. What is the nearest to 0 in z, 0.3, 5? 0.3 Let t be (4/(-28))/(2/(-7)). Let h = -0.3 - -0.1. Which is the closest to t? (a) 0.3 (b) h (c) 3/5 c Let b = 41 + -43. What is the closest to b in 1, -1/3, 0.3? -1/3 Let i = -13/126 + -4/63. Let l = -12 + 17. Which is the closest to -2/3? (a) i (b) 2 (c) l a Let n = -0.029 + -0.971. Which is the nearest to n? (a) 2/7 (b) -1/5 (c) 0.1 b Let l = -1.3 - -1.1. Which is the nearest to -0.1? (a) 0.3 (b) 0.5 (c) l c Suppose 2i + 3i = l - 13, -2l = -i + 1. Let d be l/10(-5)/3. Which is the closest to d? (a) 0.2 (b) -5 (c) -4 a Let s = 5.5 + -5. Let y(p) = p3 + 2p*2 - 4p - 4. Let o be y(-3). Let t be -2 + (o - 17/(-7)). What is the nearest to 0 in -0.1, s, t? -0.1 Let x = 1.37 + -0.37. Which is the closest to x? (a) -4 (b) 5 (c) 7/4 c Let l = -308.01 + 313. Let v = l - -0.01. Let p = -41/132 - -2/33. Which is the closest to p? (a) 4 (b) v (c) 3 c Let t = -7 - -3. Let a = 3 + -3. What is the closest to -0.2 in a, t, 3? a Let m = -2 + 4. Let q be 325/(-465) + (-4)/(-6). Let r = q + 33/62. Which is the nearest to 0.2? (a) m (b) r (c) 0.2 c Let w = -454.02 + 458. Let k = w - -0.02. What is the closest to 0.1 in -4, -2, k? -2 Let j = 0.13 + -5.13. Which is the closest to -2? (a) 2/9 (b) j (c) 5 a Let r = -0.2 + 0.1. Let g = 74 + -73.9. Which is the nearest to r? (a) 3 (b) 4 (c) g c Let a(y) = -5y + 35. Let c be a(8). What is the closest to -0.2 in 0.2, -0.5, c? -0.5 Let g be ((-12)/16)/((-9)/(-8)). Let l = -6.5 - -8. Let r = 0.5 - l. Which is the closest to -1/2? (a) g (b) r (c) -2 a Let d = 19/22 + -4/11. Suppose -6y + 51 - 15 = 0. Let b be ((-10)/(-330))/(2/y). What is the closest to -3 in b, d, 3? b Let g = 11 - 18. What is the closest to 1 in g, -4, -3? -3 Let t = 1289 + -101833/79. Let j = t + 85/237. Let h = 0.3 + 4.7. Which is the nearest to j? (a) -4 (b) h (c) -5 a Let j = -19/7 + 3. What is the nearest to -1 in -0.04, -4, j? -0.04 Let x be 1/(-9)(1 - -1). Let i be 13/(-39) + (-37)/(-33). Let j = 5/11 - i. What is the closest to x in j, 0.4, -2/5? j Let x = -280/171 - 100003/855. Let f = 118 + x. What is the closest to 0 in f, 3/2, -0.3? -0.3 Let w = -11/14 + -5/7. Let z = 13/3 + -4. What is the closest to z in -1, w, 0.3? 0.3 Let a = -2.2 + 2.7. Let x = 1 - 0.6. What is the nearest to 0 in a, -5, x? x Suppose -5i = -i. Let s = 13 + -27. Let q = s + 13.8. Which is the closest to i? (a) 2 (b) q (c) -0.3 b Let l = 0.95 - 1.35. Which is the closest to 6? (a) 3 (b) l (c) 5 c Let u = 6 - 5.7. Let d = 0.4 - u. Suppose -x = 5n, n - x = 3 + 3. What is the nearest to 2/3 in n, -2/19, d? n Let h = -105 + 106. Which is the nearest to h? (a) 36 (b) 2/5 (c) 1/4 b Let r = 3 + -3.4. Let p be (-4)/6 + -3 + 3. What is the nearest to p in 0, r, -1? r Let v(l) = -45l + 2. Let t be v(2). Let a = t + 529/6. What is the closest to 1 in a, 3, 0.4? 0.4 Let a = -2.4 + -0.6. Let w = -0.28 - -13.28. Let j = w + -14. What is the nearest to j in -2/17, a, -4? -2/17 Let g = -2/93 + -29/93. Let m(i) = i*2 + 2i - 3. Let o be m(-3). What is the nearest to g in -5, 0.2, o? o Let c be 6/9 + 0/(-2). Let m(b) = b - 9. Let z be m(7). What is the nearest to c in z, 5/4, 4? 5/4 Let b = 61 - 61. What is the closest to b in 0.5, -0.8, 1? 0.5 Let r be 1 - (-3 + 2)1. Let g = -0.05 + -4.95. Let s = g - -4.7. What is the closest to 1/3 in -1/3, r, s? s Let s = -1055/4 + 265. Let d = 0.01 - -1.99. Let l = -7 + d. Which is the closest to 1/2? (a) l (b) s (c) -1/5 c Let i = 6.9 - 6.9. Let h = 2 - 1. What is the nearest to i in h, 5, -3? h Let a be 116/(-360) + 4/18. Let u = 8 - 7.97. Let k = -4.03 + u. What is the nearest to 1 in k, 2/21, a? 2/21 Let a = -2.96 + -0.04. Let t = 1 - 3. What is the nearest to t in a, 2, 5? a Let k = -0.8 + 0.9. Let a = 1 - -1. Let j = a - 2.2. What is the closest to k in 1/3, -3, j? 1/3 Let y = 66 - 71. Which is the nearest to -0.1? (a) y (b) -3/7 (c) 1 b Suppose -1 = 2i - 3. Let s be (-1 + 0)/(42/12). Which is the nearest to i? (a) 0 (b) -2 (c) s a Let l = 37/77 - 4/77. Let u = -0.7 + 0.3. Let h be ((-11)/((-66)/(-4)))/((-8)/6). What is the nearest to h in 0, l, u? l Let z be (-1)/6 + 1/(-3). What is the closest to -1 in 0.4, z, -1/5? z Suppose -3 = 2k - 4k + 5z, -2 = -2k + 4z. Let h be ((2 + k)/1)/1. Which is the closest to 2? (a) h (b) -1 (c) -2 a Suppose 6h - 4 = 20. Which is the closest to h? (a) 0 (b) -1 (c) -0.4 a Let o be 0 - -2 - (2 + 8). Let w be (2/(-22))/((-4)/o). Let x = 30.5 + -30. Which is the closest to -0.1? (a) x (b) -3/5 (c) w c Let w = -27 - -24. What is the closest to w in 5/6, 4/3, 3? 5/6 Let v = -781/7 + 112. Which is the closest to 1/2? (a) -2 (b) 1/6 (c) v c Let j = 388/3 + -131. Let t = -21 - -20.8. Which is the nearest to t? (a) 3 (b) j (c) -0.1 c Let x be (-2)/(1 + 1 - 3). Let v be (-48)/(-27)1 + -2. What is the nearest to 1 in -2, v, x? x Let n(x) = -x + 5. Let m be n(-7). Let l be (m/(-54))/(2/(-3)). What is the closest to -1 in l, 4, -1/7? -1/7 Let j(z) = -z3 - 8z*2 - 9z - 8. Let u be j(-6). Let m be ((-2)/34)/(u - -1). Let k = -3/25 + m. Which is the closest to -1/4? (a) k (b) -0.2 (c) -2/15 b Suppose 4f = 5h + 16, h + 8 + 0 = -4f. Let b = -0.1 + 0.1. Let r = -1.8 + 2. What is the closest to b in 0, r, f? 0 Let f = 1 + 1. Let a(o) = o3 + 4o*2 - 4o + 3. Let r be a(-5). What is the closest to -2 in f, -4, r? r Let f be 12/(-14)(-4)/6. Let b be ((-7)/8)/((-60)/21). Let h = b - -3/32. What is the closest to -2 in 5, f, h? h Let z be -3 + 1 - (-165)/9. Let r be 562/(-36) - (-1)/(-2). Let q = r + z. What is the closest to 0.1 in 4/3, q, 0.4? q Let h = -25 - -25.1. What is the closest to -0.4 in -0.3, -3, h? -0.3 Let n be (-1 - 1)/(-15). Suppose v + 3 = 2h, -5h + 2h + 3 = -2v. What is the closest to n in 0.4, 5, v? 0.4 Let c = 0.146 + -0.346. Let a be ((-4)/(-6))/((-14)/6). What is the nearest to -1 in c, -0.5, a? -0.5 Let w(j) = j - 1 - 3 + 1 + 1. Let k be w(3). What is the closest to k in -0.06, 1/9, 3/2? 3/2 Let q = 0.17 - 0.15. Let m = 0.12 - q. Which is the nearest to -0.1? (a) m (b) 4 (c) 0.5 a Let s(x) = x*2 - 129x + 132*x - 5 +	{ "pile_set_name": "DM Mathematics" }
q(p) be the first derivative of y(p). Let f(n) = -10n2. What is f(q(g))? -90g*2 Let h(b) = -2 + 2 + 20b - 8 + 8. Let z(p) = 15p2. What is z(h(l))? 6000l*2 Let c(p) = -4p - 11. Let f(l) be the second derivative of l*3/3 - 209l. What is f(c(n))? -8n - 22 Let u(f) = -49f + 10f + 11f + 11f + 15f - 27. Let x(a) = 2a. Determine u(x(p)). -4p - 27 Let x = -30 - -32. Let q(a) = 11a - 24a - xa2 + 13a. Let b(y) = -y*2 - y - 1. Let l(k) = 35k*2 + 15k + 15. Let h(f) = -15b(f) - l(f). Give q(h(t)). -800t*4 Let b(o) = -2o. Let a(r) = 5854r2 + 6r. Determine a(b(w)). 23416w2 - 12w Let n(b) = 2b - 2. Let z(g) = 2g - 3. Let q(f) = 3n(f) - 2z(f). Let o be (12/(-10))/(2/(-10)). Let r(j) = j + 4j - oj. Determine r(q(x)). -2x Let h(i) = 7i - 25. Let t(j) be the second derivative of j*4/6 + 106j + 2. Give t(h(u)). 98u2 - 700u + 1250 Let j(v) = v*2 - 8v + 1741. Let a(y) = 3y. Calculate j(a(c)). 9c*2 - 24c + 1741 Let w(t) be the third derivative of 0t - 12t*2 + 7/4t*4 + 0 + 0t*3. Let s(g) = -2g*2. Calculate s(w(h)). -3528h*2 Let v(z) = -3z2 - 10. Let u(x) = x2 + 6. Let m(w) = -5u(w) - 3v(w). Let n(f) be the first derivative of 2f2 - 1. What is m(n(t))? 64t*2 Let z(i) = 9237i*2. Let b(n) = 7n*2. Calculate b(z(k)). 597255183k*4 Let c(x) = 2x*2 + 75. Let q(l) = -661 + 4l2 + l2 + 0l2 + 661. Give q(c(i)). 20i*4 + 1500i*2 + 28125 Let n(r) = -112r*2. Let v(x) = -107x*2 - x. Determine v(n(b)). -1342208b*4 + 112b*2 Let y(k) = -6k*2 - 5k - 20. Let r(l) = l*2 + l + 4. Let p(c) = 5r(c) + y(c). Let z(w) = 127w2. What is p(z(i))? -16129i*4 Let w(n) = n - 6. Let j(g) = -3 + 1 - 3 + 4. Let z(r) = 6j(r) - w(r). Let y(v) = 11v2. What is z(y(h))? -11h*2 Let j(o) = 16o. Let p(t) = 518t2 + t + 12. Give p(j(u)). 132608u*2 + 16u + 12 Let a(t) = 3t2. Let j(m) = 17m*2. Let o(k) = -187k*2. Let u(f) = -34j(f) - 3o(f). Determine u(a(g)). -153g4 Let b(h) = h2. Let n(c) = 6c2 + 5c*2 - 4c*2 + c. Determine n(b(t)). 7t4 + t2 Let i(b) = -21b - 10. Let f(x) = 52x + 26. Let m(q) = 5f(q) + 13i(q). Let v(s) = -9s2. What is v(m(j))? -1521j*2 Let p(c) = -5c*2 + 2c + 2c + 220c*2 - 4c. Let g(s) = -s. Give g(p(u)). -215u2 Let u(i) = -i. Let d(j) = j2 + 8j + 9. Let k be d(-6). Let n(q) = 2q2 + 3q + 3. Let z(h) = h*2 + 2h + 2. Let p(s) = kz(s) + 2n(s). What is u(p(b))? -b2 Let k(o) = -o2 + o + 6. Let y be k(0). Suppose 34 = 6g + 22. Let c(v) = 2v*2 - yv*2 + 0v*g + 2v*2. Let u(p) = -13p. Determine c(u(s)). -338s2 Let c(v) = -4v*2 - 3 + 3 + 3v2. Let r(s) be the third derivative of -s7/1260 - s*4/8 - 2s*2. Let d(l) be the second derivative of r(l). Give c(d(a)). -4a*4 Let c be (116/28 - 1)/(68/119). Let t(q) be the first derivative of -2 + cq*2 + 0q. Let w(m) = m. Calculate w(t(h)). 11h Let p(f) = -3f + 2. Let n(j) = -4j + 3. Let r(o) = -2n(o) + 3p(o). Let y be (4 + 0 + -3)2. Let h(a) = -10ay + 7a*2 - 2a*2. Calculate h(r(u)). -5u*2 Let j(p) = 0p - 2p - 2p. Let h(n) = 23806689 - 23806689 - 3n2. What is j(h(r))? 12r*2 Let i(o) = 4o*2. Let r(x) = -73x - 23. Calculate i(r(s)). 21316s2 + 13432s + 2116 Let l(n) = 2n. Let o(y) be the third derivative of -17y8/10080 + y5/60 - 2y2. Let k(q) be the third derivative of o(q). Calculate k(l(w)). -136w*2 Let x(f) = -3f. Suppose 2j - 24 = 14. Let y(o) = -11 - j + 7o + 30. What is x(y(r))? -21r Let y(i) = 9i + 22. Let x(f) = -5f - 11. Let d(q) = -q2 + 4q + 5. Let r be d(4). Let a(t) = rx(t) + 3y(t). Let w(j) = -2j. What is w(a(m))? -4m - 22 Let j(r) = -7r. Let v be 0/(421/(-14) + 7). Let i(o) be the second derivative of -1/6o3 + v - 7o + 0o2. What is j(i(f))? 7f Let b(j) = -127j - 11. Let v be b(-1). Let n(f) = -111f - vf + 224f. Let w(c) = -18c. Calculate n(w(s)). 54s Let z(s) be the first derivative of s*2/2 - 4. Let g(o) = -14o*2 - 6. Let r = -1 - 5. Let f(l) = -14l*2 - 7. Let d(j) = rf(j) + 7g(j). What is z(d(v))? -14v*2 Let k(r) = r - r - 21r*2. Let n(w) = 4w + 6. Let j(i) = -9i - 14. Let b(u) = -3j(u) - 7n(u). Calculate k(b(z)). -21z*2 Let q(s) = -5s. Let p(z) = -131882z. Give p(q(y)). 659410y Let s(l) = -82276l. Let t(v) = 5v. Calculate s(t(w)). -411380w Let y(d) = -2d*2. Let h(b) = -3b*2 + 51b*2 + 12b*2 + 24b*2. Determine y(h(c)). -14112c*4 Let c(w) = -7w. Let x(s) = -43058s. What is x(c(p))? 301406p Let g(f) = -f*2 + 6f - 3. Let a(w) = -w*2 + 4w - 2. Let b(z) = 3a(z) - 2g(z). Let j(i) = -22i2. Calculate b(j(s)). -484s*4 Let a(s) = -28s*2. Let f(t) = 20t*2 + 3t + 650. What is f(a(d))? 15680d4 - 84d*2 + 650 Let p(h) = -4h2 + 18. Let t(a) = -a2 + 3. Let l(z) = p(z) - 6t(z). Let g(i) = 4i + 2. Give g(l(n)). 8n2 + 2 Let r(c) = -4c*2 + 51c. Let x(a) = a*2 - 3a + 2. Let p(g) = g*2 - 6g + 4. Let t(w) = -p(w) + 2x(w). Give t(r(n)). 16n*4 - 408n*3 + 2601n2 Let w(r) be the second derivative of r4/6 - r. Suppose -9i = -4i - 20. Let d(c) = 7c2 + ic - 8c2 - 4c. Calculate d(w(u)). -4u4 Let b(f) = 16f - 2. Let l(g) be the second derivative of -g*4/12 + 22g*2 + 30g. Let j(h) be the first derivative of l(h). Determine b(j(r)). -32r - 2 Let b(w) = 86626w*2. Let y(n) = n. Give b(y(i)). 86626i*2 Let q(b) = 7b - 78. Let u(d) = 278d. What is u(q(k))? 1946k - 21684 Let h(i) = -937i2 - 937i*2 + 1875i*2. Let v(c) = 3c*2 + 12. Calculate v(h(d)). 3d*4 + 12 Let w(t) be the third derivative of 0t*3 + 1/10t*5 + 0 + 0t*4 + 0t + 16t2. Let m(d) = -2d*2 + 3 - 3. Give w(m(a)). 24a4 Let r(l) = l2 - l2 + l2. Let q(t) be the third derivative of -t*5/30 + 87t*2. What is r(q(b))? 4b*4 Let j(n) = 0n + 0n - n. Let x(g) be the second derivative of 13g*3/6 - 464g. Calculate x(j(p)). -13p Let s(o) = 7o + 1. Let a(p) = 3795p. Calculate a(s(v)). 26565v + 3795 Let z(a) = 34a - 16a - 9a - 13a. Let o(h) = -10h. Calculate o(z(u)). 40u Let b(t) = -2t2. Let n(g) be the third derivative of -13g6/720 + g4/12 - 6g2. Let c(d) be the second derivative of n(d). What is c(b(v))? 26v*2 Let n(o) = -22o*2. Let b(m) = 3327m. What is n(b(u))? -243516438u2 Suppose -3i + 0i + 18 = 3b, 22 = 5b + i. Let l(n) = -10n + 6n - bn. Let w(x) = 3x. Give w(l(v)). -24v Let v(z) = 13752z + 2. Let k(h) = 8h. Determine k(v(m)). 110016m + 16 Suppose -2b = 2u - 4, 0 = -3u - b - b + 6. Suppose 3j - uj = 109. Let m(y) = 109 - y - j. Let z(w) = 7w. Give z(m(s)). -7s Let t(w) = 14w + 6. Let p(j) = -15j - 5. Let i(c) = 6p(c) + 5t(c). Let v(u) = 5u. Calculate i(v(r)). -100r Let m(y) = -24y. Let i(h) = 8h. Let k(t) = 7i(t) + 2m(t). Let q(j) = j + 2. Let w(u) = 6u + 6. Let z(g) = -3q(g) + w(g). Give z(k(x)). 24x Let j(t) = 2t*2 - 59. Let y(g) = 236g + 30. Calculate j(y(l)). 111392l2 + 28320l + 1741 Let q(g) be the second derivative of 0g3 + 0g*2 + 0 + 1/3g*4 + 28g. Let a(w) = -5w. Determine a(q(m)). -20m*2 Let m(c) = 2c - 3c2 - 2c. Suppose 16s + 2s - 18 = 0. Let t(r) = -8r - 1 + 4r + s. Determine m(t(f)). -48f2 Let a(u) be the first derivative of -13u2/2 + 4. Let z(h) be the second derivative of -h3/6 - 52h. What is z(a(m))? 13m Let o(n) = -9n2. Let l(t) = 5 - 33t - 5 + 84t - 34t. What is o(l(a))? -2601a2 Let n(l) = -l. Let x(f) be the first derivative of 4 - 3f*3 + 20 + 2f*3. Determine n(x(k)). 3k*2 Let i(l) = -13l*2. Let z(v) = v + 2. Let t(r) be the first derivative of -4r*2 - 12r - 19. Let h(p) = t(p) + 6z(p). Determine i(h(d)). -52d*2 Let r = 1 + 1. Let t(w) = 5w*2 + 0w*r - 12w + 12w. Let i(n) = 4n*2. Calculate i(t(m)). 100m*4 Let z(o) be the first derivative of o - 3. Let l(t) = 252 + 2t + 2t - 253. Let k(j) = -l(j) - z(j). Let i(m) = -2m. Determine i(k(q)). 8q Let q(r) = -r. Let m be (22/6)/(10/30). Let i(b) = -34b + mb - 8b. Calculate q(i(k)). 31k Let x(q) = 18q. Suppose -5c = -4c - 3. Let k(a) = ca + 4a - 9a. Give k(x(s)). -36s Let x(w) = 23w. Let j(l) = 8021l*2. What is x(j(y))? 184483y*2 Let f(z) be the third derivative of 11z*7/2520 - 5z*4/24 - 12z**2.	{ "pile_set_name": "DM Mathematics" }
Let t = 309 - 257. Suppose 82 = 5f + t. Let l(y) = 5y*3 - 8y*2 + 6y - 6. Let q(p) = -4p3 + 7p*2 - 5p + 5. What is fq(b) + 5l(b)? b*3 + 2b*2 Let l(i) = 182i*2 - 7i - 52. Let u(c) = -62c2 + 2c + 17. Calculate 4l(s) + 13u(s). -78s2 - 2s + 13 Let a(q) = -4. Let i(w) = -3036w - 2208. Determine -552a(v) + i(v). -3036v Suppose -2v = 23r - 25r, -5r + 2v + 3 = 0. Let m(q) = -q*2. Let i(b) = -11b*3 - 2b*2. What is rm(o) - i(o)? 11o3 + o2 Let k(n) = -53312498n*3 + 46190n*2 + 46190n - 23095. Let u(i) = 4617i3 - 4i*2 - 4i + 2. Calculate -2k(l) - 23095u(l). -4619l3 Let j(o) = -2o2 - 1432. Let h(c) = c2 + 717. Calculate 10h(z) + 4j(z). 2z2 + 1442 Let j(b) = -7b + 7. Suppose -2m + m = 5g - 1630, -4g + m + 1304 = 0. Suppose -g = -32k - 102. Let o(i) = -1. What is ko(p) + j(p)? -7p Let r be 24/(-15) + (-49)/(-175)45. Let v(u) = 4u*3 - 58u*2 - 11u. Let d(b) = 2b3 - 29b*2 - 6b. Calculate rd(a) - 6v(a). -2a3 + 29a*2 Let q(s) = 26s - 8. Let w(t) = 77t - 23. Suppose 29l - 7388 = -7214. Calculate lw(n) - 17q(n). 20n - 2 Let u(w) be the second derivative of -53w*5/20 - 2w*4/3 - 5w*3/6 + 4w*2 - 1591w. Let b(a) = 18a3 + 3a*2 + 2a - 3. Determine 8b(f) + 3u(f). -15f3 + f Let h(z) = 17z*2 + 64z + 8. Let q(w) = 8w2 - 8w - 3. Let a(y) = 45y2 - 40y - 16. Let j(r) = -4a(r) + 22q(r). Calculate 2h(c) + 9j(c). -2c2 - 16c - 2 Let x(n) = -1135n - 15. Let z(c) = -283c - 4. What is 6x(l) - 22z(l)? -584l - 2 Let v(b) = 64126b*3 + 72. Let m(g) = -18322g*3 - 20. Give 18m(x) + 5v(x). -9166x*3 Let o(m) = -4m + 1. Suppose 2s - 5 = 1. Let h(u) = 1839 - 3u + 1843 + 1839 + 1838 - 7358. What is so(c) - 2h(c)? -6c + 1 Let v(s) = 4s*3 + 18s*2 + 213s - 33. Let w(n) = -2n3 - 10n*2 - 105n + 18. What is 5v(t) + 9w(t)? 2t3 + 120t - 3 Let v(l) = l3 + l2 + l - 1. Let t(r) = 5r3 - 3r*2 + 8r + 3. Determine 2t(a) + 6v(a). 16a3 + 22a Let q(l) = -2511l2 - 2l + 6. Let b(k) = 47710k2 + 39k - 117. Determine -2b(y) - 39q(y). 2509y2 Let m(r) = -5r*3 + 10r*2 + 33r + 7. Let o(g) = -4g3 + 9g*2 + 33g + 6. Determine 6m(b) - 7o(b). -2b3 - 3b*2 - 33b Let t(h) be the second derivative of -7h3/6 - 3h*2 + 142h. Let p(q) = 7q + 6. Let f(n) = 7p(n) + 6t(n). Let j(o) = -8o - 7. What is -7f(d) - 6j(d)? -d Let o(d) = -13d2 - 5d + 25. Let v(u) be the second derivative of -7u4/12 - u3/2 + 13u*2/2 + 5308u. Determine -4o(t) + 7v(t). 3t2 - t - 9 Let f(h) = h + 1. Let g(d) = -3d - 2. Let c be 105/(-33) - (2 + -10 - 344/(-44)). Determine cg(w) - 5f(w). 4w + 1 Let w(v) = v + 28. Let y(a) = 46a + 165. Let s(x) = 6w(x) - y(x). Let c(q) = 20q - 2. Determine 7c(p) + 4s(p). -20p - 2 Let g(j) = j. Let l = -21756 + 21758. Let d(o) = -o2 - 4o + 22. Determine lg(a) + d(a). -a2 - 2a + 22 Let z(o) = 5o + 2. Let u(p) = p. Let s(r) = r - 1. Let a(k) = -s(k) - u(k). Let t(j) = 8j - 7. Let c(n) = -6a(n) - t(n). What is -6c(y) + 5z(y)? y + 4 Let a(n) = -2n - 165. Let v(m) = m + 87. Calculate -5a(y) - 9v(y). y + 42 Let i(d) = d*3 - 28d*2 - 10d - 550. Let p be i(29). Let x(n) = -n3 + n2 + n. Let k(b) = 5b3 + 6b*2 + 4b + 2. Give pk(l) - 4x(l). 9l3 + 2l*2 + 2 Let p(c) = 4c*3 - 2c*2 + c. Let s(a) = -38a*3 + 3988a*2 - 10a. What is -10p(g) - s(g)? -2g*3 - 3968g*2 Let w(q) = 22q*3 + 495q*2 + 15q + 9. Let s(h) = -11h3 - 246h*2 - 8h - 5. Calculate 11s(c) + 6w(c). 11c3 + 264c*2 + 2c - 1 Suppose -419a - 86a - 1010 = 0. Let u(f) = -3f2 + 3f + 5. Let t(i) = 4i2 - 3i - 6. Calculate at(o) - 3u(o). o*2 - 3o - 3 Let g(d) = 5d - 31. Let t(b) = 10b - 46. Let w(u) = 6g(u) - 4t(u). Let n(v) = 3v - 3. Let p be n(2). Let q(x) = -5x - 1. Give pw(s) - 5q(s). -5s - 1 Let o(x) be the second derivative of x5/4 + 3x*2 + x. Let b(f) = -2999f*2 - 99f*3 + 6996f*2 - 121 - 3997f*2. Determine 6b(i) + 121o(i). 11i*3 Let m(u) = 5u*3 + 2u*2 + 4u + 4. Let f(y) = 2y2 - 2y - 33. Let h be f(4). Let c(j) = 11j3 + 5j*2 + 9j + 9. Give hm(w) + 4c(w). -w*3 + 2w*2 Let u(c) = -3c*2 - 2c - 5. Let q = 39 - 42. Suppose -12m = 17 - 221. Let n(a) = -3 + ma - 2a2 + 3a - 21a. Calculate qu(d) + 5n(d). -d2 + d Let d(w) = 386. Let u(o) = -688. Let i(x) = -16d(x) - 9u(x). Let h(b) = -b - 17. What is 3h(l) + 4i(l)? -3l + 13 Let i(n) be the first derivative of 3n4/4 - n2 - 2n - 5. Let m(u) = -5u3 + 0u*3 - 1163 + 3u + 2u + 1168. Determine -5i(c) - 2m(c). -5c*3 Let n(q) = 96q*2 - 16 - 81q2 + 49. Let p = 6173 + -6175. Let t(d) = d2 + 2. What is pn(v) + 33t(v)? 3v2 Let c(n) = 2n*3 + 3n*2 + 3n + 5. Let s be (-36)/72(1 - 23). Let b(x) = 5x*3 + s - 536x*2 + 543x*2 - 7x + 14x. Give 6b(o) - 14c(o). 2o*3 - 4 Let v(a) = 12a*3 - 157a + 14. Let n(k) = -3k3 + 52k - 4. What is 7n(i) + 2v(i)? 3i3 + 50i Suppose -1 = -m - 0. Let j(a) = -a - 2. Suppose -q = 4o - 2q - 5, -15 = -o + 3q. Let s(y) = y + 2y + oy + 1 - 4y. Calculate mj(v) + 2s(v). -3v Suppose -13q + 12q = -6. Let a = -12 - q. Let o = 29 + a. Let b(p) = p3 + 16p*2 + 11p - 21. Let w(s) = 3s2 + 2s - 4. Calculate ow(j) - 2b(j). -2j3 + j2 - 2 Let c(d) be the second derivative of 21d5/10 - d4/4 + 3d2/2 + 2498d. Let f(l) = 41l3 - 2l*2 + 2. What is 2c(m) - 3f(m)? -39m*3 Let n(u) = -5u - 1. Let o(f) = -7f - 288. Let z be o(-42). Let q(b) = -4b. Calculate zq(v) - 5n(v). v + 5 Let g(u) = -112u2 + 51u - 36. Let w(v) = 45v2 - 26v + 16. What is 2g(l) + 5w(l)? l*2 - 28l + 8 Let v(p) = 83p3 - 249p*2 - 19p. Let n(z) = -5z3 + z2 + z. Give 16n(q) + v(q). 3q3 - 233q*2 - 3q Let b(t) = 107t + 7927. Let q(n) = 67n + 5284. Give -5b(z) + 8q(z). z + 2637 Let t(r) = 69r - 120. Let n(z) = -10z - 4. Calculate 5n(x) + t(x). 19x - 140 Let l(r) = -7r + 3. Let s(v) = 145v + 583. Let b be s(-4). Let t(j) = -34j + 16. What is bt(k) - 16l(k)? 10k Let h be ((-50)/(-15) + -4)(1 - 7). Let p(r) = -5r*2 - 9 - 6 - 2r - h + 18. Let s(b) = -2 - 6b2 + 1 - 4b - 3b2. What is 5p(c) - 3s(c)? 2c*2 + 2c - 2 Let k(v) = 7v + 6. Let q(y) = -15y - 13. Let o = 2 + -5. Let r be (528/40 + -13)/(1/5). Let w be (o - -2) + r + (1 - -12). Give wk(i) + 6q(i). i Let c(y) = -y + 1. Let g(t) = -22t - 1891. Let a be g(-86). Let i(q) = 11. Calculate ai(x) - 3c(x). 3x + 8 Let h(d) be the second derivative of 71d4/12 + 2d*3/3 + 13813d. Let c(l) = -l. Give -4c(n) - h(n). -71n*2 Let y(q) = -44q*3 + 5q*2 + 21q. Let s(o) = -9o3 + o2 + 4o. Suppose 5z = -9d + 54, -31d - 28 = -36d - 3z. Give ds(h) - 2y(h). -11h3 + h2 + 2h Let z(c) = 6c*2 - 2c - 4. Let o(r) = -5r2 + 3r + 5. Suppose -w - 65 = 5m - 71, 3w = 5m - 22. Determine mo(i) + 3z(i). 8i*2 - 2 Let h(d) = 3d*3 - 8d*2 - 1. Let u(n) = -5n*3 + 24n*2 + 3. Let g(l) = 12h(l) + 4u(l). Let c(y) = y3. Calculate 80c(w) - 4g(w). 16w*3 Let u(k) = -24k + 3. Let m(l) = l - 1. Calculate m(y) - u(y). 25y - 4 Let m(q) = -27q*2 - 4q - 4 - 32q2 + 56q*2 - 7q. Let h(p) = 21p + 3p*2 + 2p*2 + 10 + 16 - 19. Give -4h(c) - 7m(c). c2 - 7c Suppose j - 6j + 10 = 0. Let m(v) = -v - 3. Let r(n) = -21n - 5n - 8 - 8n + 31n. Let d(a) = -8m(a) + 3r(a). Let h(t) = 3t. Determine jh(c) + 4d(c). 2c Let f(h) = 2h*3 - 12h + 32. Let g(c) = -3. What is f(m) + 4g(m)? 2m*3 - 12m + 20 Let b(k) = -31k2. Let i(w) = 30w*2. Let o be -2(7/(-49) + 66/(-28)). Calculate oi(j) + 4b(j). 26j2 Let p(x) = 37x. Let m(r) be the second derivative of -1240r3/3 + 25r - 33. Calculate 3m(q) + 200p(q). -40q Let v(y) = -54y*2 - y + 1. Suppose 0 = -4h + 243h + 117 + 122. Let c(m) = -m2 + m - 1. Determine hv(s) - c(s). 55s2 Let k(b) = 167b - 48b - 120b. Suppose -h + 0h = -4. Suppose v = 3t - 0t + 14, 14 = -hv - 2t. Let j(o) = 6o - 4. Give vj(g) - 5k(g). -g + 4 Let n(b) = 2504771b2 - 4279b - 4279. Let s(o) = -1171o2 + 2o + 2. Determine -2n(u) - 4279s(u). 1167u2 Let q(p) = -p2 + 8p. Let x(t) be the second derivative of -	{ "pile_set_name": "DM Mathematics" }
the remainder when n is divided by 13. 10 Suppose -5a + 3y - 5y = -164, -5y = -3a + 86. Let w = a + -18. Let r = 1281 - 1227. What is the remainder when r is divided by w? 12 Suppose 16x - 209 = 5x. Let h(a) = a3 + 7a*2 - 3a + 7. Let s be h(-7). What is the remainder when x is divided by s/66/4? 5 Let q = 205 - 6. What is the remainder when q is divided by 25? 24 Suppose 2o - 10 = 0, -5r - o = -6r + 19. What is the remainder when 766 is divided by r? 22 Suppose -194q = -188q - 1002. Calculate the remainder when q is divided by 20. 7 Suppose -3w = -2f + 86, -5f + 6 = 1. Let k = 48 + w. Suppose kn = 22n - 52. What is the remainder when n is divided by 7? 5 Let l(m) = m3 - 13m*2 + 13m - 4. Let x be l(12). Suppose 9o - 2 = xo. Suppose -16 = -ow - 0w. Calculate the remainder when 47 is divided by w. 7 Let v(k) = -7k + 3. Let z = 3583 + -3569. Calculate the remainder when v(-5) is divided by z. 10 Let x(v) = 2v*2 + 14v - 9. Let r(c) = -2c2 - 14c + 9. Let j(l) = 2r(l) + 3x(l). What is the remainder when j(-11) is divided by 20? 19 Let n = -493 + 496. What is the remainder when 19 is divided by n? 1 Let a be (1 + -1)-1 + (-39 - 3). Calculate the remainder when a/56 - (-87)/4 is divided by 5. 1 Let l = 920 + -818. What is the remainder when l is divided by 36? 30 Let h(d) = -d3 + 4d*2 + 9d + 7. Let u be h(4). Let j = u - 19. Calculate the remainder when j is divided by 13. 11 Suppose 5m + 22u - 471 = 19u, -3m - 3u + 285 = 0. Calculate the remainder when m is divided by 24. 21 Let t(g) = -10 - 67g*2 + 3 + 6 + 178g*2. What is the remainder when t(1) is divided by 37? 36 Suppose -5a + 18 = a. Suppose -11 = -k + a. Suppose 30 + k = 2h. Calculate the remainder when h is divided by 12. 10 Suppose -7j = -8j + 3. Let s be -3j/(-9)4. Suppose -120 = sk - 12k. What is the remainder when k is divided by 8? 7 Suppose -21u = -1738 - 698. Calculate the remainder when u is divided by 41. 34 Let h(i) = i*3 + 2i*2 - 2i. Let q = -26 + 23. Let n be h(q). Calculate the remainder when 32 is divided by 10 + (9/n - -4). 10 Let g(z) = 31z - 526. Calculate the remainder when 57 is divided by g(18). 25 Suppose -9l + 581 - 41 = 0. What is the remainder when l is divided by 13? 8 Let f = -20 + 32. Suppose 0 = -8s + 57 + 407. What is the remainder when s is divided by f? 10 Let g(x) = -x3 - 12x*2 - 5x - 7. Calculate the remainder when g(-12) is divided by 42. 11 Let t(x) = 20x - 49. Let g(j) = 7j - 16. Let d(b) = 17g(b) - 6t(b). What is the remainder when d(-16) is divided by 10? 8 Let s(g) = g*3 + 8g*2 - 19g - 10. Calculate the remainder when s(-7) is divided by 15. 7 Suppose 5p - 37 = -52. What is the remainder when 42 is divided by -16(-2 + p)/5? 10 Suppose d + 52 = -42. Let s(k) = k - 57. Let l be s(18). Let r = l - d. What is the remainder when r is divided by 14? 13 Let h be ((-24)/(-20))/((-2)/(-10)). Let l(b) = -94b2 - 7b + 15. Let k be l(h). What is the remainder when k/(-36) - 1/(-4) is divided by 24? 23 What is the remainder when 7290/48 + (-1)/(-8) is divided by 17? 16 Let p = -37 + 23. Let m = -22 - p. Let k(s) = -4s - 12. Calculate the remainder when k(m) is divided by 7. 6 Let h = -6 - -9. Suppose -hq + 21 = -0q. Suppose p + q - 11 = 0. What is the remainder when 13 is divided by p? 1 Let j(y) = -y3 + 20y*2 - 19y + 44. Let i be (-4)/5(-50)/2 - 1. What is the remainder when j(i) is divided by 23? 21 What is the remainder when 65 is divided by (-1)/(-4) - (-670)/40? 14 Let b = -132 - -188. Suppose -b + 9 = -2o + 3s, 0 = o + 2s - 27. Calculate the remainder when o is divided by 16. 9 Let i(q) = -q*2 + 6q - 4. Let m be i(4). Let o be ((-43)/4 - -4)m. Let x = o + 29. Calculate the remainder when 7 is divided by x. 1 What is the remainder when 97 is divided by (1 - 1) + 62/((-14)/(-7))? 4 Let f be 1/((4/8)/1). Calculate the remainder when 160 is divided by 0/f + 23/1. 22 Suppose 0 = w + 2h - 18, 8h = 3h + 5. Suppose -36b = -34b - c - 115, 3c - 119 = -2b. What is the remainder when b is divided by w? 10 What is the remainder when (-9)/((-324)/(-6417))-4 is divided by 102? 101 Let f be (5/10)/(126/(-64) + 2). Let c = 77 - f. What is the remainder when c is divided by 31? 30 Let z = 964 - 516. What is the remainder when z is divided by 30? 28 Let u(k) = -k3 + 4k*2 - k + 9. Let h(p) = -p - 1. Let x be h(-6). Let j be u(x). Let t = -7 - j. What is the remainder when 39 is divided by t? 11 Let u = 13 - 8. Suppose -6x + x = uw, 5w = -x - 20. Calculate the remainder when 24 is divided by x. 4 Let w = 166 - -265. Calculate the remainder when w is divided by 63. 53 What is the remainder when -5 + (374 - (4 + -4)) - 7 is divided by 73? 70 Let u = 715 + -704. What is the remainder when 11 is divided by u? 0 Let d(m) = 118m2 - 63m*2 - 54m*2 + 80 + 18m. Suppose 0 = -4n + f + 223, n = -n - 2f + 104. Calculate the remainder when n is divided by d(-5). 10 Suppose -2p = -3m - m + 24, -4m + p + 22 = 0. Suppose 0 = -2w + m + 23. Let o(i) = -i*2 + 5. Calculate the remainder when w is divided by o(0). 4 Suppose -2a - 8573 = -3u, 2a - 2u + 8434 = -142. Calculate the remainder when (-4)/(-30) - a/105 is divided by (-2)/(-5) + 106/10. 8 Let c be (-4 - 0)/1-50. Suppose -3l + c = l. Calculate the remainder when l is divided by 1/(396/(-204) + 2). 16 Let h(f) = -31f - 299. Calculate the remainder when 19 is divided by h(-10). 8 Let m be 2 - (-129)/(-27) - (-22)/(-99). What is the remainder when 103 is divided by 1/((-8)/(-26))(1 - m)? 12 Let v = -5 + 24. Let r(w) = -3w - 5. What is the remainder when v is divided by r(-6)? 6 Suppose 13r = 4r. What is the remainder when 45 is divided by 6 - (r + (-4 - 0))? 5 What is the remainder when ((-352)/(-40))/((-32)/(-240)) is divided by 20? 6 Suppose -g + 6 = -10. Let j be 294/(-35) - 3/5. What is the remainder when (-88)/(-3) + 3/j is divided by g? 13 Let c = 37 + 6. Let l = 821 + -806. Calculate the remainder when c is divided by l. 13 Suppose -q - 23 = -d - 2q, -43 = -2d - q. What is the remainder when d is divided by 9/6(-3 - -5)? 2 Suppose 1154u - 1161u + 1848 = 0. What is the remainder when u is divided by 86? 6 Suppose -46k + 150 = -40k. Calculate the remainder when 83 is divided by k. 8 Let i = 41 - 36. Suppose 2g + 15 = ig. What is the remainder when (2/(-3))/((-2)/42) is divided by g? 4 Let m = -368 - -78. Let j = -33 + 17. What is the remainder when m/(-8) + 4/j is divided by 13? 10 Suppose 4h - 7h = -183. What is the remainder when 117 is divided by h? 56 Let j = -533 - -771. Suppose -159 = -3l + 3s, 2l - 4s = 7l - j. Calculate the remainder when l is divided by -13(-2)/(4 - 2). 11 Let a = 536 + -345. Calculate the remainder when a is divided by 16. 15 Let s = -1 - -5. Let h = -21 + 17. Let r = 13 + h. Calculate the remainder when r is divided by s. 1 Suppose 4j + 2j = 60. Suppose 0 = -0h - 4h + 16. Suppose -5q - hf + 88 = 0, -q + f + 3 = -11. Calculate the remainder when q is divided by j. 6 Let s(d) be the second derivative of 7d*3/6 - 5d*2/2 - 16d. What is the remainder when 30 is divided by s(3)? 14 Suppose -3l + 77s - 73s + 454 = 0, 484 = 3l + 2s. Calculate the remainder when l is divided by 6. 2 Let q(b) = b - 6. Let l be q(5). Suppose 110n + 115n - 108 = 221n. What is the remainder when n is divided by (-32)/2l - 0? 11 Let c = 288 - 207. What is the remainder when c is divided by 28? 25 Let f(p) = -2p*3 + 59p*2 - 23p + 63. What is the remainder when f(29) is divided by 40? 37 Let w be 20/70 - 66/(-14). Suppose wg - 4j + 15 = 0, 0 = -3g + j + 2 - 4. What is the remainder when 3 is divided by g? 0 Suppose 3j + 3m = 72, -2j - 5m = -6m - 42. Suppose 0 = 3h + 5y - 16, 4y - 20 = 2h - 5h. What is the remainder when j is divided by h? 10 Let y(a) = -2a*2 + 22a - 31. What is the remainder when 203 is divided by y(8)? 16 Suppose 5b - 1995 = -2w, -w = 4b - 3w - 1578. What is the remainder when b is divided by 21? 19 Let v = -2217 - -4283. Calculate the remainder when v is divided by 47. 45 Let n(x) = -4x3 + 5x*2 - x + 9. Let y be n(-3). Suppose -3f + 114 = -y. Calculate the remainder when f is divided by 19. 17 Let i(s) = -2077*s + 83	{ "pile_set_name": "DM Mathematics" }
+ 9v - 6v + 0v. 3v Expand (4 - 3 - 3)(8 + 2 + 0)(18q - 16q + 20q). -440q Expand -16q + 164q3 - q4 - 177821q2 + 177821q2 + (q3 + q - q)(-2q + 4 - 4). -3q4 + 164q*3 - 16q Expand (-60k + 14k*3 + 60k)(-494 + 228 - 464)(2 - 1 + 0)(2k + 3k - 3k). -20440k4 Expand -154793b*4 - 2b + 2b + 163091b*4 + (b - b - b)(0b3 + 2b3 + b3) - b*4 + 3b*4 + 0b*4. 8297b*4 Expand (-4j - j + 4j)(0 + 15j + 0) + ((0 - 1 - 1)(0j + 5j + 3j) + (-3j + 4j + 0j)(0 + 1 + 0) - j + 4j - 2j)(4j + j - 4j). -29j2 Expand (-3i*2 + 2i2 - i2)(-2 + 0 + 0) - 4 + 2i*2 + 4 + (-181 + 317 - 156)(-i + i - 4i2). 86i*2 Expand 8j*3 - 2j*3 - 2j*3 - 2j*3 + 0j*3 + 0j*3 + (-j - j + j)(4j2 + 2j*2 - 5j2) - j3 + 4j - 4j + (2 + 2 + 0)(4j*3 - 4j3 - j3). -4j3 Expand (-3 + 0 + 0)(1 + 4f - 1)(-40 + 19 + 4). 204f Expand (0 + 136 - 12)(6p - p - 2p) - 2p - 5p + 3p. 368p Expand (-t*2 - 5t + 5t)(-4t + 4t - 5t2) + 2t*3 - 2t3 + t4 + (2 - t - 2)(18t*3 + 125t - 125t). -12t*4 Expand ((-5d + 2d + d)(-4d2 + 3d*2 + 0d*2) + 33d*3 + 42d*3 - 86d*3)(-d*2 + 20d*2 - 5d*2) + (-3d - d*4 + 3d)(d - d + d). -127d*5 Expand (-35d + 15d + 2 + 29d)(108 + 124 - 170). 558d + 124 Expand 0b - 2b + 4b + (-3 + 4 - 2)(-2b + b + 0b) - 54b + 1030b + 430b + 3598b. 5007b Expand ((17s - 42s + 20s)(-2 + 2 - 1) - 34s - 18s - 9s)(-s2 + 2s - 2s). 56s*3 Expand (4 - 4 - 6)(20k - 20k - 19k2) + (3k - 4 + 4)(-k + 4k - 4k). 111k*2 Expand (5t - t - 5t)(-2 + 2 + t*2) + 110613t + 297t3 - 110613t. 296t3 Expand (-3w2 + w2 + 0w2)(2 - 1 - 3) + 9197 - 221w2 - 9197. -217w*2 Expand ((0 + d + 0)(3 - 2 + 1) + 6 - 4d - 6)(-45d + 218 - 218). 90d*2 Expand (3 - 3 + 2j*2)(-9 + 2 - 2) - 14914 + 14914 - 7j2 - 8j. -25j2 - 8j Expand (2q2 - 1 + 1)(-2q3 + 2q3 - q3) + (-10q + 15q + 17q)(q4 - q4 + 2q4) - q5 - q5 + 0q*5 + 4q*4 + 3q*5 - 4q*4. 43q*5 Expand (-3 - 2 - 25)(-10s + 128s + 97s). -6450s Expand 27052a - 25 + 40843a + 25 + 24213a + (-2 + 3 + 0)(0a + 3a - a) + 5a - 4a + 0a. 92111a Expand (-1 + 3 - 1)(-532 - 15s*2 - 588 + 1099). -15s*2 - 21 Expand 138765 - 138765 + 309h*2 + (-4 + 4h2 + 3 - h2)(-24 + 8 - 6). 243h*2 + 22 Expand (-4l*2 - 3l*2 + 3l*2)(483 + 147l - 483 + (0 + 1 + 0)(3l + l - 2l) + 0l + 3l - l) + (3l2 - 2l*2 - 2l*2)(2l - 7l + 3l). -602l*3 Expand (d - 2d - 2d + (-2 + 4 + 1)(-326d + 258d + 572d)(-1 + 3 - 1))(-5d + 5d + 3d). 4527d2 Expand (d2 + 2d2 - d2)(2664 - 180d - 2664)(d2 - d2 - 2d*2 - 1). 720d*5 + 360d*3 Expand ((-3 - 2t + 3)(-t2 + 6t*2 - 3t*2) - 4t*3 + 5t3 + t3 + 18t3 + 3t*3 + 4t3 - t3 + 0t3 + 2t*3)(-3 + 3 - 2)(-t - t - 2t). 192t4 Expand (-14 + 15 - 42 + (-3 + 0 + 6)(-2 + 4 - 4) - 5 + 2 - 1)(-3o*2 + 0o + 0o). 153o*2 Expand (-69106z + 1611z4 + 69106z)(2z - z + 5z). 9666z*5 Expand (i + 0i + i)(2 - 4 + 0) + 3i - i - 3i + (0 + 4 - 3)(46500 - 405i - 46500) + (-6 + 1 + 2)(0 + 2i + 0) - 2i + 0i + 3i. -415i Expand g2 - 2g3 - g2 + (2g2 - 5g*2 + 81g - 97g)(108 - 108 + g) + g2 - g2 + 2g3. -3g*3 - 16g*2 Expand (-180 + 36o*4 + 180)(73 - 73 + 49o) + (-2o*4 + 1 - 1)(2o + 3o - 6o). 1766o*5 Expand (-3 + 2 + 2)(83h - 55h + 26h) + h - h + 2h. 56h Expand (-11s*2 - 10s*4 + 11s*2)(-395 - 21 + 612 + 1095). -12910s4 Expand (0k*3 - 2k*3 + 10k*3)(0 + 0 - k) - 9890 + 9824 - 6k4 + 0k*4. -14k*4 - 66 Expand ((-5 + 1 + 5)(-5r + 2r + 2r) + 8 - 8 - 5r)(299r*2 + 803r*2 + 645r*2 + (-2 + 2 + r)(-2r + 4r - r)). -10488r3 Expand -f + 3f*5 - 3f*5 - 3f*5 + (-14f*3 + 1169 - 1169)(0 + 0 - 9f2). 123f*5 - f Expand (2 - 4 + 4f + 1)(-360 - 75 - 156)(2f - 5f + f). 4728f2 - 1182f Expand (2v4 - 2v*4 - 2v*4)(-1 + 0 - 1 - 1 + 1 - 2 + (1 + 1 + 0)(3 - 2 + 0) + 1 - 1 + 1) + (46v + 64v + 81v)(1 - 1 + 2)(6v3 + 2v3 - v3). 2676v4 Expand -10z*3 + 2z*3 - 13z*3 + (2z - 2z + 2z)(-z2 - 4z*2 + 3z*2) + 38 + 9z*2 + 2z*2 - 2z*3 - 39. -27z*3 + 11z*2 - 1 Expand (-2u - 10u + 7u)(70u + 135u - 142u) + (1 + 0 + 1)(-5u*2 + 4u*2 + 0u*2) - 4u + 4u + u2. -316u*2 Expand (-2q + 2q + q)(-15q4 + 87q*4 + 36q*4) + 5q5 + q5 - q*5. 113q*5 Expand (-64m - 492 + 492)(-29 - 35 - 2 - 20 + 22). 4096m Expand n*3 + 2n*3 - 2n*3 - 2n*2 + 2n2 + n3 + (-3 + 3 + 1)(0n*2 + 0n*2 + 2n*3) + 2n*3 - 1 + 1 + 151n*3 - 283n*3 - 375n*3. -501n3 Expand (g3 + g*3 + 0g*3)(-7 + 25 + 9)(-321g*2 - g + g). -17334g*5 Expand ((-24 + 12 - 10)(3 + 3 + 1) + (-2 + 4 - 3)(1 - 2 + 2))(-21g - 6g - 42g - 23g). 14260g Expand (2a - a + 0a)((-2 - 3 + 0)(-2 + 1 + 0) - 2 + 6 - 2) - 3 - 39a - 36a + 72a. 4a - 3 Expand (26o + 563 - 25o - 3115)(0o + 4o - 2o). 2o*2 - 5104o Expand (-4g + g + 2g)(106 - 27g + 15g - 267). 12g*2 + 161g Expand 2n + 17 - n2 - 17 + (4 - 10 - 14)(3n2 - 3n*2 - 2n*2). 39n*2 + 2n Expand (-2n2 + 3n*2 - 3n*2)(-29 - 3n2 + 29) + 0n*4 + 2n4 - n4 + (-3n3 + 25n*2 - 25n*2)(-2n - 4n - 10n). 55n4 Expand (-s3 - 3s2 + 2s*2 + 4s*2)(5 + 6 - 6) - 1081s3 + 512s*3 + 522s*3. -52s*3 + 15s*2 Expand -2z*4 - 178 + 178 + (-7z - 2z - 8z)(-2z*3 + 0z*3 - 4z*3). 100z*4 Expand (-4f + 8f + 2f)(0 - 1 + 4)(5f - 6f - 12f)(-4 - 2 + 7). -234f2 Expand (0 - 2r + 0)(123 - 123 - 37r*3) - 2r*3 + 2r*3 - 4r*4. 70r*4 Expand (45s*3 + 426 - 426)(0 - 1 + 3 + (-1 + 1 + 6)(1 - 2 + 0)). -180s*3 Expand (-6o*4 + 0o*3 + 0o*3)(-644 - 462 + 435)(-5 + 5 + 3)(2o - 5o + 4o). 12078o*5 Expand (2i + 2i - 2i)(111 - 124 - 149)(0 + 1 + 4). -1620i Expand (1 - 2a - 1)(-114 - 53 + 9) - 2a + 5a + 0a. 319a Expand (-3 + 1 + 4)(-2 - 3 - 1)(-688g + 688g - 3g*2) + (2 + 1 - 1)(2g2 - 3 + 3) + 3g - 3g - g2 - 2g*2 + 3g2 + g2 + 5 - 2g2 - 5. 39g*2 Expand (4m*3 - 7m3 - m4 + m*3)(8 + 0 + 1)(-41283 - 1419m + 41283). 12771m5 + 25542m*4 Expand (5i*3 - 2i*3 - 5i*3)(11i + 3i + 7i) - 4i*4 + 4i*4 + 2i*3 + 6i*4. -36i*4 + 2i*3 Expand (144n*2 - 125n*2 - 156n*2 - 435n*2)(3n - 2n - 3n). 1144n*3 Expand -103k*2 - 203k*2 + 62k*2 - k + 3k*2 + k + (-2k + k + 2k)(-k + 0k - k) + 0k + k*2 + 0k - k*2 + 4k*2 + 3k*2. -236k*2 Expand (4 - 2 + 0)(-3 - 4 + 4)(-108 - 2871o + 1436o + 1434o). 6o + 648 Expand (1 - 1 - 1 + (0 - 1 + 4)(1 - 1 - 2))(10c*2 - 72c + 72c). -70c*2 Expand 2 - 2 - z + 0z + z - 2z + (0 + 3 - 5)(4z - 2z + 0z) + (-337z - 4101 + 2072 + 2032)(-3 + 3 + 2). -680z + 6 Expand 3081j + 3834846 - 3834846 + (-6 + 3 + 2)(-5j + j + 2j). 3083j Expand -2u + 3u3 + 2u + (1 - 1 - 2u)(-u*2 + 2u*2 - 5u*2) - 123u*3 - 236u*3 + 30u*3. -318u*3 Expand (5q*4 - 4q4 + q4 + (q*3 - 2q3 - q3)(-4q + q + 2q) + 3474q*2 - 3474q*2 + 110q*4 - q - 2q*4 + q)(0 - 2 + 4)(-2 + 2 + 2). 448q*4 Expand (-5y - y + 2y)(-4y + 2y + 5y)((-4 - 3 + 0)(-3 + 3 - 2) - 4 + 2 - 2). -120y*2 Expand (-3z - 3z + 4z)(3 - 3 - 2)(-128598 + 1053z + 128598). 4212z*2 Expand -5b*3 + 0b*3 + 4b*3 - 4b*3 - 4b*3 - 4b*3 + (6b2 - b2 - 4b2)(3b + 4b - 4b) + 2b*3 + 4b - 4b. -8b*3 Expand (0 + 0 + 1)((-1 + 1 - 1)(2t - 4t + 7t) - 5t + 4t + 3t) - t - t + 6t. t Expand (34l2 + 21l*2 + 33l*2)(-3 + 3 - 1 + (-1 - 3 + 2)(2 - 2 - 1) + 5 + 0 - 12). -528l2 Expand -o5 + 4o5 - 2o*5 + (-2o*2 - 2o*4 + 2o*2)(2o + o - 4o) - 3o5 - 3o*5 + 7o5 + (-o4 - 5o4 - o4)(20477 - 174o - 20477). 1222o*5 Expand ((-2 + 6 - 3)(q + 0q - 2q) - 1001 - 4q + 1001)(-6q + 2q - 4 + 2q). 10q*2 + 20q Expand -679z5 - 777z*5 + 886z*5 + (2z*4 + 4z - 4z)(-2z + 0 + 0). -574z*5 Expand -5g*2 + 0g*2 + 3g*2 - 2g2 + g2 + 0g2 + (3 - 3 + g)(2g + 2g - 6g) + 1017g*2 + 842g*2 - g - 37g*2 + g. 1817g*	{ "pile_set_name": "DM Mathematics" }
picked without replacement from pspsnn? 1/15 Two letters picked without replacement from vqqzqqqaq. Give prob of picking 1 z and 1 a. 1/36 Two letters picked without replacement from {h: 4, e: 5, x: 2, t: 2, i: 1, f: 1}. What is prob of picking 2 e? 2/21 What is prob of picking 2 p and 1 v when three letters picked without replacement from vppvvpppppeepppeppp? 78/323 What is prob of picking 3 n when three letters picked without replacement from {n: 12, v: 3}? 44/91 Four letters picked without replacement from {o: 1, s: 2, k: 2, f: 4, h: 5}. Give prob of picking 1 s, 2 k, and 1 h. 10/1001 Three letters picked without replacement from {x: 4, j: 2, h: 1, c: 2}. Give prob of picking 2 j and 1 h. 1/84 What is prob of picking 2 p when two letters picked without replacement from {p: 6, x: 2}? 15/28 Two letters picked without replacement from zdzzzzzzzzjjzjff. What is prob of picking 1 j and 1 f? 1/20 What is prob of picking 2 l when two letters picked without replacement from mmaamamlmlmaamamma? 1/153 Three letters picked without replacement from rqibk. Give prob of picking 1 q, 1 k, and 1 b. 1/10 What is prob of picking 1 x and 1 n when two letters picked without replacement from {a: 2, n: 4, x: 1, z: 2}? 1/9 Two letters picked without replacement from bbrrbbbgbrbrgbr. Give prob of picking 1 g and 1 r. 2/21 Four letters picked without replacement from {d: 4, c: 3, x: 6}. What is prob of picking 1 x and 3 d? 24/715 What is prob of picking 2 a when two letters picked without replacement from appaappppapppp? 6/91 What is prob of picking 2 y when two letters picked without replacement from {s: 7, n: 2, y: 5}? 10/91 Three letters picked without replacement from vhhhhhvhhh. Give prob of picking 2 v and 1 h. 1/15 Three letters picked without replacement from {d: 2, x: 2, n: 5}. Give prob of picking 1 x and 2 n. 5/21 Two letters picked without replacement from rjjjsjjrjj. Give prob of picking 1 j and 1 s. 7/45 Calculate prob of picking 1 p and 3 e when four letters picked without replacement from epeeeeeeeeeeeee. 4/15 Three letters picked without replacement from {d: 8, l: 4, w: 4, p: 1, h: 2}. What is prob of picking 3 d? 56/969 What is prob of picking 2 g and 1 t when three letters picked without replacement from tggt? 1/2 Four letters picked without replacement from {x: 7, s: 4}. Give prob of picking 2 s and 2 x. 21/55 Calculate prob of picking 1 u and 1 e when two letters picked without replacement from {t: 7, u: 2, e: 1}. 2/45 Two letters picked without replacement from {q: 2, t: 7, d: 1}. What is prob of picking 1 d and 1 q? 2/45 Calculate prob of picking 2 c when two letters picked without replacement from mccwccnnnwncwnm. 2/21 Calculate prob of picking 2 j and 1 u when three letters picked without replacement from djjdjjdjujdu. 3/22 Three letters picked without replacement from wiiizzz. What is prob of picking 2 i and 1 z? 9/35 What is prob of picking 2 s and 1 j when three letters picked without replacement from jsjjsjssjj? 3/10 Calculate prob of picking 1 f, 1 s, 1 e, and 1 w when four letters picked without replacement from tsuuususfuwssessf. 1/170 Two letters picked without replacement from aiivopvac. Give prob of picking 1 p and 1 o. 1/36 What is prob of picking 1 l and 1 n when two letters picked without replacement from {n: 2, d: 4, q: 5, l: 2}? 2/39 What is prob of picking 2 r and 1 l when three letters picked without replacement from rrllrrrrrr? 7/15 Two letters picked without replacement from lpppl. Give prob of picking 1 l and 1 p. 3/5 What is prob of picking 2 e when two letters picked without replacement from {e: 2, m: 3, u: 4}? 1/36 Four letters picked without replacement from yxyyvvxwxvwgwgvxf. Give prob of picking 2 y, 1 f, and 1 v. 3/595 What is prob of picking 1 t and 1 j when two letters picked without replacement from tsjjsststttsttpstst? 2/19 Calculate prob of picking 1 h and 1 b when two letters picked without replacement from hbb. 2/3 Calculate prob of picking 1 n and 1 d when two letters picked without replacement from ednendjnnjdfeedn. 1/6 Calculate prob of picking 1 h, 2 x, and 1 y when four letters picked without replacement from {n: 2, x: 2, y: 2, h: 7, c: 4}. 1/170 Calculate prob of picking 2 c and 1 o when three letters picked without replacement from ccooo. 3/10 Three letters picked without replacement from {g: 1, o: 7, l: 1, y: 4}. Give prob of picking 2 y and 1 l. 3/143 Two letters picked without replacement from {g: 1, u: 3}. Give prob of picking 2 u. 1/2 What is prob of picking 1 k and 1 e when two letters picked without replacement from qqekdekx? 1/7 Three letters picked without replacement from vvxkvxkxqkvxxx. Give prob of picking 1 x and 2 k. 9/182 Two letters picked without replacement from {u: 6, m: 2, h: 1, z: 7, r: 4}. What is prob of picking 2 m? 1/190 Two letters picked without replacement from ehvvfh. What is prob of picking 1 e and 1 v? 2/15 Two letters picked without replacement from fzpoa. Give prob of picking 1 o and 1 a. 1/10 What is prob of picking 2 v, 1 g, and 1 q when four letters picked without replacement from {y: 1, e: 1, q: 1, v: 2, w: 1, g: 1}? 1/35 Four letters picked without replacement from {p: 11, j: 2, c: 1, k: 1}. Give prob of picking 1 p, 1 j, 1 c, and 1 k. 22/1365 What is prob of picking 1 m, 1 q, and 1 o when three letters picked without replacement from {h: 1, m: 1, q: 1, o: 2, p: 2}? 2/35 Calculate prob of picking 1 z and 1 f when two letters picked without replacement from zzzffzz. 10/21 Three letters picked without replacement from vvvvvvvccvvcvvvvcvvv. Give prob of picking 2 v and 1 c. 8/19 Four letters picked without replacement from zzzsszzssssz. What is prob of picking 3 z and 1 s? 8/33 Two letters picked without replacement from {c: 1, n: 1, q: 1, m: 1, t: 2, e: 1}. What is prob of picking 1 t and 1 e? 2/21 Two letters picked without replacement from rvrhrbvhvbvhrbbr. Give prob of picking 1 r and 1 v. 1/6 What is prob of picking 1 l, 1 o, and 2 d when four letters picked without replacement from zmozdlld? 1/35 Three letters picked without replacement from gpooppsnnnnnnnp. Give prob of picking 1 g, 1 o, and 1 p. 8/455 Calculate prob of picking 1 o and 1 v when two letters picked without replacement from jjjyvoouyuotjv. 6/91 What is prob of picking 1 c and 1 m when two letters picked without replacement from cmmmmmmmmmmmmiccm? 39/136 Four letters picked without replacement from nvnnvvvjnvnnvvvnvvv. What is prob of picking 1 j and 3 v? 55/1292 What is prob of picking 2 k and 1 w when three letters picked without replacement from {k: 14, w: 4}? 91/204 Calculate prob of picking 2 k and 1 x when three letters picked without replacement from kxxxxkk. 12/35 What is prob of picking 2 p and 1 f when three letters picked without replacement from {k: 3, p: 4, f: 1}? 3/28 Calculate prob of picking 2 x and 1 n when three letters picked without replacement from {v: 2, n: 4, x: 8}. 4/13 What is prob of picking 2 v and 1 n when three letters picked without replacement from {n: 3, v: 3}? 9/20 Four letters picked without replacement from {r: 7, i: 2, d: 1, g: 3, x: 5}. Give prob of picking 1 r and 3 x. 7/306 Two letters picked without replacement from {y: 4, i: 3, u: 4, p: 3, j: 2}. Give prob of picking 1 y and 1 i. 1/10 Two letters picked without replacement from {p: 5, s: 13}. What is prob of picking 2 p? 10/153 Calculate prob of picking 1 h and 2 l when three letters picked without replacement from {h: 2, b: 2, m: 8, l: 3}. 6/455 Calculate prob of picking 1 i and 3 s when four letters picked without replacement from iiiciisici. 0 Two letters picked without replacement from {v: 9, s: 4, n: 2, k: 3}. What is prob of picking 1 k and 1 s? 4/51 Four letters picked without replacement from zzdzzzzzzzzzzzzzzz. What is prob of picking 4 z? 7/9 What is prob of picking 2 h when two letters picked without replacement from {h: 6}? 1 Four letters picked without replacement from {f: 3, b: 1, n: 1}. What is prob of picking 1 f, 2 b, and 1 n? 0 Calculate prob of picking 1 k, 2 w, and 1 l when four letters picked without replacement from {j: 4, w: 1, q: 4, k: 1, l: 1}. 0 Calculate prob of picking 1 d and 1 c when two letters picked without replacement from {w: 1, m: 1, d: 1, c: 2, u: 1, t: 1}. 2/21 Th	{ "pile_set_name": "DM Mathematics" }
. l3 Simplify (w(1/6)(ww/w(-1/3))/w)(-6/35) assuming w is positive. w*(-9/35) Simplify ((m/(m(m/(m/(m/((m/(mm(4/9)/m))/m))m))/m))(7/5))(-4) assuming m is positive. m(-28/9) Simplify g33g3 assuming g is positive. g36 Simplify q/q(-12)q(-2/9) assuming q is positive. q(115/9) Simplify ((z/(z(z1/z)/z))36)6 assuming z is positive. z216 Simplify (qqq(-2)q)*(1/20)q(q/q(4/3))/qq8/q assuming q is positive. q(403/60) Simplify ((n/n(-1/3))(-32))46 assuming n is positive. n(-5888/3) Simplify a/((a*(-7/4)/a)/a)aaaa/a(5/7) assuming a is positive. a(225/28) Simplify u(6/5)(u(-30)/u)/u assuming u is positive. u(-154/5) Simplify z(-3)/((z(-1/2)/z)/z)z(-4)(z3/z)/z assuming z is positive. z(-7/2) Simplify (b*6/(bb*(-2)/bb))/((bbb(2/13))/(b/b6bb)) assuming b is positive. b*(24/13) Simplify (xx*(-3)xx)(-33) assuming x is positive. 1 Simplify k4k*(1/3)k/k*(1/6)k/(k/(kkk6/k)) assuming k is positive. k(73/6) Simplify (c*(-3)ccc)/(c/((c(cc*6)/c)/c))(c*(2/3)c)15 assuming c is positive. c30 Simplify ((p*(-13)p)/(p(2/5)/p))43 assuming p is positive. p(-2451/5) Simplify (k7kk)(-14) assuming k is positive. k(-126) Simplify (aa/(a/(aa*(1/8)a)))/a*3(aa0a)35 assuming a is positive. a(561/8) Simplify (c(-2/19))(4/5) assuming c is positive. c(-8/95) Simplify (((r/(r2r)r)/r)/rr)(-10)/(r/r0)(2/5) assuming r is positive. r(98/5) Simplify j(-8)/(j6j)((j/(j/j0))/j)(-4/11) assuming j is positive. j(-161/11) Simplify (b/b2b)/(b*3/b)(b*(-2/5)b)/(bb/b(-4/5)) assuming b is positive. b(-21/5) Simplify g6g*(-2/15)g(((gg/(g/g(-1/3)))/g)/g)/g(-2/7) assuming g is positive. g(611/105) Simplify (g(-24)/g)(2/23) assuming g is positive. g(-50/23) Simplify ((v(-6))(2/111))(-4/17) assuming v is positive. v(16/629) Simplify (g(3/4)/g(-4))/(ggg/(ggg*0)g)(1/27) assuming g is positive. g(505/108) Simplify (((bb(-1/2)b)/b)/b)12 assuming b is positive. b(-6) Simplify u*(-31)u(u(2/55)u)/uu assuming u is positive. u(-1593/55) Simplify ((k/(k/(k(k*1/k)/kkkk)))(1/55))(-16) assuming k is positive. k(-48/55) Simplify u(-2/9)u(3/4)/u(u(1/4))(2/15) assuming u is positive. u(-79/180) Simplify (o(-2/5)/oo)(-1/2)(o((oo*(-3))/ooo)/oo)/(oo(-4/5)) assuming o is positive. 1 Simplify n6nn0n(n0/n)(-22) assuming n is positive. n30 Simplify (u/u(-2/11))/u(-2/69) assuming u is positive. u(919/759) Simplify ((k/(k(-2/7)/k))(-24))40 assuming k is positive. k(-15360/7) Simplify (w(-4)w/(w/(ww5)))/(w(2/3))(2/37) assuming w is positive. w(218/111) Simplify (ww*(2/9)ww3)/(w(-6)ww/(w/(w(-3/4)/w))) assuming w is positive. w(431/36) Simplify (r0/r(-1))/(r(2/9))(23/2) assuming r is positive. r(-14/9) Simplify y5/y(-17) assuming y is positive. y22 Simplify (v6/((vv*(-2/7))/v))/(vv/(v/(v(v/(v(v*(-5/2)/vv)/v)v)/v))v2) assuming v is positive. v(-17/14) Simplify (dd1)(-3/22)d*(1/3)/(((d/(d/(dd/d*8d))d)/d)/d) assuming d is positive. d(200/33) Simplify (rrr(-2/3))0/(r1/r5) assuming r is positive. r4 Simplify m(-26)/(m(-28)mm) assuming m is positive. 1 Simplify ((zzz/(zzzz*11zz)z)/z*(-1/9))/((zz/z*(-3/2)zz)/(z(z(2/21)/z)/z)) assuming z is positive. z(-2305/126) Simplify ((l/l*(11/4))/ll)/(ll(-14)ll) assuming l is positive. l(37/4) Simplify (p/p8)(-14) assuming p is positive. p98 Simplify ((ii(1/8))/i)/(i/i(-7))(ii2)(-1/20) assuming i is positive. i(-321/40) Simplify (m(1/8))(10/7) assuming m is positive. m(5/28) Simplify l*8/ll/(lll/(l/(ll9/lll))l) assuming l is positive. l(-6) Simplify v(-2)/(vv(-5)) assuming v is positive. v2 Simplify (i2/i)(-22)/((ii3)/i(-4/3)) assuming i is positive. i(-82/3) Simplify (u7(((u4/u)/u)/u)/u)/(u8uu8) assuming u is positive. u(-10) Simplify (s12/(ss(-2/9)))(-6/5) assuming s is positive. s(-202/15) Simplify ((p(-1/4))(2/65))43 assuming p is positive. p*(-43/130) Simplify (lll10)(-5/7) assuming l is positive. l(-60/7) Simplify u(-2/7)/(u/(uu*5uu))((u/u4)/u)/u(-2/19) assuming u is positive. u*(375/133) Simplify u/((uuu29u)/u)u37 assuming u is positive. u7 Simplify (pp*(-1)p)(-35) assuming p is positive. p(-35) Simplify ww34ww(1/3) assuming w is positive. w(109/3) Simplify (ww*(-1)(w/((w/w*14)/ww))/w)47 assuming w is positive. w611 Simplify u6/(u/u(-3/2)) assuming u is positive. u(7/2) Simplify u7u(4/11) assuming u is positive. u(81/11) Simplify (ddd(1/4)d)(1/5)/((d/((d(-3/5)d)/dd))/d(1/3)) assuming d is positive. d(23/60) Simplify ((l/l(-1))(-2/17))(2/37) assuming l is positive. l(-8/629) Simplify (s/(s/s(-4/3)))/(s/s(4/13)s) assuming s is positive. s(-118/39) Simplify i6/(ii*(-1/13))((i((i/((i/((iii/(iii(-6)ii)i)/i))/i))/i)/i)/i)/(ii(-3/10)/ii) assuming i is positive. i(1089/130) Simplify (z10)(-7/6) assuming z is positive. z(-35/3) Simplify g(-17)/g(-24) assuming g is positive. g*7 Simplify ((y/(y(y/(y/(yy9)))/y))/y)/(y/(y(2/5)/y)y) assuming y is positive. y*(-63/5) Simplify (i(i/(i*5i)i)/ii*(-1/4)/ii)/(i*(1/4)/(iii/i(-8))) assuming i is positive. i(13/2) Simplify (u(-4/15)u(-6))(-11) assuming u is positive. u*(1034/15) Simplify ((ss(-5/7))(18/7))(2/53) assuming s is positive. s(72/2597) Simplify i*6i/(i*(-2/15)i)i(-5)/i8 assuming i is positive. i(-103/15) Simplify kkkk/(k*(1/6)/k)kkk*(-4)k(k(((((kk/(k(1/9)/k))/k)/kk)/kk)/k)/k)/((kk/(((kk(-1/4)k)/kk)/k))/k) assuming k is positive. k(161/36) Simplify (d/d(2/93))10 assuming d is positive. d(910/93) Simplify (m(1/21)/mm)/(mmmmm(6/13)) assuming m is positive. m(-1205/273) Simplify q*(-4/13)/(q/(qqq(-15)q)) assuming q is positive. q(-173/13) Simplify (i(-9)/(i/(i(i/i6)/i)))(-6/7) assuming i is positive. i(90/7) Simplify h/h(-6/7)h/h*(1/3)h(hh((hh*(-1)/h)/hh)/hh)42 assuming h is positive. h(956/21) Simplify ((p/p(-5))/(p(-4/9)p))41 assuming p is positive. p(2009/9) Simplify (x/x*(-9)x)/(x/(xxx5)) assuming x is positive. x17 Simplify yy(-3/16)y/(y/((((yyy/y(2/13))/y)/y)/y)) assuming y is positive. y(137/208) Simplify (y(2/3)/(y(-3/5)y))(-3/14) assuming y is positive. y(-2/35) Simplify ((a6/a)/aaaa(-1/4))(-40) assuming a is positive. a(-230) Simplify ((f/f13)/(f/((ff/((f/(((ff*11)/ff)/f))/f))/f)f))(-3/22) assuming f is positive. f(3/11) Simplify (y/y(7/4))(-32) assuming y is positive. y24 Simplify s/s(1/8)ssss/(s(-6)s)s/(s/s(1/7))s*(2/11)s assuming s is positive. s(6899/616) Simplify (g15gg)/(gg/g0g) assuming g is positive. g*14 Simplify ww*19wwww(-21)www assuming w is positive. w5 Simplify (v(-5/7)v)/v8 assuming v is positive. v(-54/7) Simplify t(-2/145)tt14 assuming t is positive. t(2173/145) Simplify y(-2/15)/yy*(-7)y*(-1/4)yy(-6/5) assuming y is positive. y(-103/12) Simplify (kk(-13)/k)/(k(-17)/k) assuming k is positive. k*5 Simplify ((rrrr0)(-41))(-46) assuming r is positive. r5658 Simplify (d3/(d/d(-13)))(-37) assuming d is positive. d407 Simplify (c*(-2/7)c/(c(-1)/c))24 assuming c is positive. c(456/7) Simplify ((c/c(2/5))/ccc(-2/5))(3/14) assuming c is positive. c*(3/70) Simplify (i((i/(i(i(-9)iii)/ii))/i)/i)44 assuming i is positive. i220 Simplify a(-9/8)a(-9) assuming a is positive. a(-81/8) Simplify (k/(kkkk(2/25)k)k)(-8/5) assuming k is positive. k(416/125) Simplify (i/(i(-2)i)ii)(-27)/(i3)(39/4) assuming i is positive. i(-549/4) Simplify aa(5/4)/a(a(a(-1/5)aa)/a)/a assuming a is positive. a(41/20) Simplify (ff/f*(19/4))/ff(8/15) assuming f is positive. f(-193/60) Simplify ((w2)(-1/22))44 assuming w is positive. w(-4) Simplify ((r*18/r	{ "pile_set_name": "DM Mathematics" }
d + 2424 What is the f'th term of 472, 478, 494, 526, 580, 662, 778? f3 - f2 + 2f + 470 What is the c'th term of 61, 115, 169, 223, 277? 54c + 7 What is the w'th term of 9, 25, 43, 63, 85? w*2 + 13w - 5 What is the w'th term of 85, 166, 243, 316? -2w2 + 87w What is the l'th term of 22, 39, 44, 31, -6? -l*3 + 24l - 1 What is the i'th term of 11, 23, 43, 71? 4i2 + 7 What is the q'th term of 735, 742, 749? 7q + 728 What is the t'th term of -128, -245, -362, -479, -596, -713? -117t - 11 What is the h'th term of -34, -51, -54, -43, -18? 7h*2 - 38h - 3 What is the k'th term of -1654, -1662, -1670, -1678, -1686, -1694? -8k - 1646 What is the d'th term of 15, 40, 65? 25d - 10 What is the a'th term of -167, -169, -171, -173, -175, -177? -2a - 165 What is the i'th term of -57, -210, -465, -822? -51i*2 - 6 What is the d'th term of -124, -285, -446, -607, -768? -161d + 37 What is the o'th term of 746, 739, 722, 689, 634? -o3 + o2 - 3o + 749 What is the b'th term of 57, 95, 135, 177, 221, 267, 315? b2 + 35b + 21 What is the g'th term of 20, 18, 16, 14? -2g + 22 What is the b'th term of 3309, 3313, 3327, 3357, 3409? b3 - b2 + 3309 What is the r'th term of -31, -30, -31, -34, -39? -r2 + 4r - 34 What is the b'th term of 1305, 2606, 3903, 5196, 6485, 7770? -2b2 + 1307b What is the x'th term of 704, 1408, 2112, 2816, 3520? 704x What is the l'th term of -246, -249, -252, -255? -3l - 243 What is the c'th term of -1122, -1121, -1120? c - 1123 What is the l'th term of 4774, 4763, 4738, 4693, 4622, 4519, 4378? -l3 - l2 - l + 4777 What is the g'th term of 14839, 14841, 14843, 14845? 2g + 14837 What is the q'th term of 209, 851, 1925, 3431, 5369, 7739, 10541? 216q*2 - 6q - 1 What is the c'th term of 134, 251, 382, 533, 710, 919, 1166? c3 + c2 + 107c + 25 What is the g'th term of -290, -570, -850, -1130, -1410, -1690? -280g - 10 What is the i'th term of 38, 40, 32, 8, -38, -112, -220? -i3 + i2 + 6i + 32 What is the s'th term of 200, 225, 300, 449, 696, 1065, 1580, 2265? 4s3 + s2 - 6s + 201 What is the c'th term of 12, 12, -4, -36? -8c*2 + 24c - 4 What is the k'th term of -29, -145, -345, -635, -1021, -1509, -2105? -k*3 - 36k2 - k + 9 What is the w'th term of -94, -141, -178, -199, -198? w3 - w*2 - 51w - 43 What is the l'th term of -784, -785, -786, -787, -788? -l - 783 What is the t'th term of 501, 505, 513, 525, 541? 2t2 - 2t + 501 What is the a'th term of 4036, 4037, 4038, 4039, 4040? a + 4035 What is the m'th term of -309, -305, -299, -291, -281, -269, -255? m*2 + m - 311 What is the k'th term of -56, -44, -32, -20, -8, 4? 12k - 68 What is the p'th term of -87, -167, -245, -321, -395, -467? p*2 - 83p - 5 What is the d'th term of 21341, 42682, 64023? 21341d What is the f'th term of -393, -985, -1979, -3381, -5197, -7433? -f3 - 195f2 - 197 What is the m'th term of -19, -18, -25, -46, -87, -154, -253, -390? -m3 + 2m2 + 2m - 22 What is the w'th term of -196, -203, -210? -7w - 189 What is the i'th term of 49, 50, 41, 16, -31? -i3 + i2 + 5i + 44 What is the l'th term of 36, 352, 1208, 2874, 5620, 9716? 45l3 + l - 10 What is the w'th term of -92146, -92142, -92136, -92128? w2 + w - 92148 What is the a'th term of -116, -229, -336, -437, -532, -621? 3a*2 - 122a + 3 What is the l'th term of -10, 4, 32, 80, 154, 260, 404? l3 + l2 + 4l - 16 What is the b'th term of 196, 394, 604, 832, 1084, 1366? b3 + 191b + 4 What is the z'th term of 150, 151, 152, 153, 154? z + 149 What is the s'th term of -174, -189, -204, -219? -15s - 159 What is the i'th term of -167, -162, -151, -134, -111, -82? 3i*2 - 4i - 166 What is the c'th term of -763, -1542, -2321, -3100, -3879? -779c + 16 What is the j'th term of -51, -106, -159, -210, -259? j2 - 58j + 6 What is the s'th term of 141, 145, 149? 4s + 137 What is the t'th term of -39, -115, -227, -369, -535, -719? t3 - 24t*2 - 11t - 5 What is the u'th term of -2383, -2376, -2369? 7u - 2390 What is the b'th term of -514, -1091, -1670, -2251, -2834? -b2 - 574b + 61 What is the h'th term of 31, 47, 63, 79? 16h + 15 What is the d'th term of 54, 41, 18, -15, -58, -111, -174? -5d*2 + 2d + 57 What is the l'th term of 28, 50, 62, 64, 56, 38? -5l2 + 37l - 4 What is the q'th term of 53, 57, 63, 71, 81? q*2 + q + 51 What is the d'th term of -1, 1, 3, 5, 7? 2d - 3 What is the g'th term of 29, 63, 97, 131? 34g - 5 What is the g'th term of 319, 1290, 2917, 5206, 8163, 11794, 16105, 21102? g3 + 322g*2 - 2g - 2 What is the n'th term of 738, 738, 740, 744? n*2 - 3n + 740 What is the z'th term of 328, 653, 962, 1249, 1508, 1733, 1918, 2057? -z*3 - 2z*2 + 338z - 7 What is the q'th term of 662, 1325, 1992, 2663, 3338? 2q2 + 657q + 3 What is the b'th term of -10, 29, 110, 245, 446? 2b3 + 9b*2 - 2b - 19 What is the n'th term of -141, -155, -159, -147, -113? n3 - n2 - 18n - 123 What is the s'th term of -10, -14, -20, -28? -s2 - s - 8 What is the a'th term of -456, -913, -1372, -1833, -2296, -2761? -a2 - 454a - 1 What is the f'th term of 3429, 3430, 3431, 3432? f + 3428 What is the t'th term of 2048, 2050, 2054, 2060, 2068, 2078, 2090? t*2 - t + 2048 What is the p'th term of -5570, -5567, -5564, -5561? 3p - 5573 What is the n'th term of 19, 44, 77, 118, 167, 224? 4n2 + 13n + 2 What is the u'th term of 0, -25, -48, -63, -64, -45, 0? u*3 - 5u*2 - 17u + 21 What is the h'th term of 195, 775, 1741, 3093, 4831, 6955, 9465? 193h2 + h + 1 What is the x'th term of -177, -170, -151, -114, -53, 38, 165, 334? x3 - 178 What is the x'th term of -48, -189, -430, -771, -1212, -1753, -2394? -50x*2 + 9x - 7 What is the y'th term of -682, -688, -704, -736, -790, -872, -988, -1144? -y3 + y2 - 2y - 680 What is the i'th term of 6, 34, 82, 150, 238, 346? 10i*2 - 2i - 2 What is the b'th term of 215, 860, 1939, 3458, 5423, 7840, 10715? b*3 + 211b*2 + 5b - 2 What is the m'th term of -699, -709, -741, -807, -919? -2m3 + m2 + m - 699 What is the y'th term of -260, -255, -248, -239? y2 + 2y - 263 What is the j'th term of -128, -604, -1398, -2510, -3940, -5688? -159j2 + j + 30 What is the o'th term of -3, -17, -39, -69, -107, -153, -207? -4o*2 - 2o + 3 What is the a'th term of -147, -305, -467, -633? -2a2 - 152a + 7 What is the z'th term of 379, 754, 1129, 1504, 1879? 375z + 4 What is the y'th term of 15, 40, 101, 216, 403, 680, 1065, 1576? 3y*3 + 4y + 8 What is the q'th term of -120, -249, -378? -129q + 9 What is the v'th term of 184, 181, 168, 139, 88, 9, -104, -257? -v3 + v2 + v + 183 What is the d'th term of 119, 123, 125, 125, 123, 119? -d2 + 7d + 113 What is the c'th term of 445, 438, 417, 376, 309? -c3 - c2 + 3c + 444 What is the j'th term of 13, 51, 115, 205? 13j2 - j + 1 What is the z'th term of -17, 5, 47, 115, 215, 353, 535, 767? z3 + 4z2 + 3z - 25 What is the g'th term of 23, 57, 111, 191, 303, 453, 647, 891? g*3 + 4g*2 + 15g + 3 What is the s'th term of 79, 69, 35, -35, -153? -2s3 + 4s + 77 What is the m'th term of 440, 878, 1316, 1754? 438m + 2 What is the z'th term of -15690, -31382, -47074, -62766? -15692z + 2 What is the f'th term of 58, 104, 148, 190, 230, 268? -f*2 + 49f + 10 What is the u'th term of 52, 92, 166, 292, 488, 772, 1162, 1676? 3u3 - u2 + 22u + 28 What is the m'th term of -62, -121, -218, -371, -598, -917, -1346, -1903? -3m3 - m2 - 35m - 23 What is the h'th term of 107, 99, 65, -7, -129, -313, -571? -2h3 - h2 + 9h + 101 What is the f'th term of -5, -13, -21, -29, -37, -45? -8f + 3 What is the u'th term of -5, 1, 5, 7, 7, 5, 1? -u2 + 9u - 13 What is the n'th term of 104, 210, 316, 422, 528? 106n - 2 What is the c'th term of 1323, 2643, 3953, 5247, 6519, 7763? -c3 + c2 + 1324c - 1 What is the p'th term of -7, 14, 79, 212, 437, 778, 1259? 4p3 - 2p*2 - p - 8 What is the v'th term of -142, -564, -1268, -2254, -3522? -141v2 + v - 2 What is the k'th term of 112, 223, 332, 439, 544, 647? -k2 + 114k - 1 What is the f'th term of 11, -20, -91, -202, -353? -20f*2 + 29f + 2 What is the g'th term of -28, -53, -78? -25*g - 3 What is the t'th term of 292, 578, 862, 1144, 14	{ "pile_set_name": "DM Mathematics" }
j. 19 Let f(j) = j3 - j2 + 9. Let w be f(0). Let h(n) = n*2 - 7n - 18. Let u be h(w). Suppose u = -4d + 38 - 14. What are the prime factors of d? 2, 3 Let u(b) = b3 + 47b*2 + 22b + 455. What are the prime factors of u(-44)? 3, 5, 353 Suppose 29v - 33v + 1680 = 0. List the prime factors of v. 2, 3, 5, 7 Let g(t) = -t*2. Let b be g(0). Suppose -p + 24 - 6 = b. Let m = 34 - p. List the prime factors of m. 2 Suppose 2 = -8c + 10c. List the prime factors of 3 + 5 + -6 - c-135. 137 Suppose 89m + 330 = 94m. List the prime factors of m. 2, 3, 11 List the prime factors of 52749/81 - (-4)/54-3. 3, 7, 31 Let v(z) = -2z3 - 7 - 18 + z2 + 17 - 2z2. List the prime factors of v(-3). 37 Let m = 937 + 399. List the prime factors of m. 2, 167 Let k(c) = c2 + 3c + 2. Let d be k(-13). List the prime factors of (-6)/45-5d. 2, 11 Let y = -100 - -103. What are the prime factors of 5 - -127 - (6/y - 2)? 2, 3, 11 Let c be (-2)/9 + (-260)/45. Let v = 0 - c. List the prime factors of 9(-1 + 8/v). 3 Let s(c) = -c3 + 13c*2 - 16c - 13. Suppose 8 = -6y + 8y, -3d + 5y + 13 = 0. List the prime factors of s(d). 53 Let p = 1301 - 1152. List the prime factors of p. 149 Let w = 18 + -32. Let s = w + 16. Let k(z) = 5z2 + 4z - 4. List the prime factors of k(s). 2, 3 Suppose 3558 = -20q + 10298. What are the prime factors of q? 337 Suppose n - 1276 = 606. List the prime factors of n. 2, 941 Let t = 965 + 2505. What are the prime factors of t? 2, 5, 347 Suppose 721 + 877 = 2c. What are the prime factors of c? 17, 47 Let k(u) = 39u - 265. What are the prime factors of k(10)? 5 Suppose -32k = -42k + 3950. List the prime factors of k. 5, 79 Let k be (-1)/((-15)/(-12)(-2)/5). What are the prime factors of (22 + k-1)/((-11)/(-33))? 2, 3, 5 Suppose -28i = -4s - 23i + 6380, s - 4i - 1595 = 0. What are the prime factors of s? 5, 11, 29 Suppose -619 = -26l + 707. List the prime factors of l. 3, 17 Suppose -4a = g - 291, -19 = -3a + g + 201. List the prime factors of a. 73 Suppose 4 = -4p, j - 2p + 144 = 1035. List the prime factors of j. 7, 127 Let g = -12 - -5. Let c be 4 + g + (-2)/1. Let z(o) = -o*3 - 5o*2 - 2o - 6. What are the prime factors of z(c)? 2 Let r(z) = -z + 10. Let i be r(7). Suppose 0 = -v - 0 - i. What are the prime factors of 25 + (0 - (v - -1))? 3 Let q be ((-140)/98)/((-1)/21). Suppose q = j - 8. List the prime factors of j. 2, 19 Suppose 4q + 6 = -v + 2v, v = -2q + 12. Let p be ((24/9)/2)/((-28)/(-126)). Suppose s - ps + v = 0. What are the prime factors of s? 2 Suppose 0 = 2k - 6k + 880. Let l = -22 + k. List the prime factors of l. 2, 3, 11 Let s(n) = -13n + 2. Let z be s(5). List the prime factors of (402/(-5))/(6 - z/(-10)). 2, 67 Suppose -2v = -517 - 887. List the prime factors of v. 2, 3, 13 Suppose -23s = -4s - 3002. What are the prime factors of s? 2, 79 Let i(f) be the third derivative of -f5/40 - f4/6 + f*3/2 - 3f*2. Let b(n) be the first derivative of i(n). What are the prime factors of b(-4)? 2 Let r = 9 - 13. Let s be ((-375)/(-20))/((-1)/r). Suppose -8c + s = -5c. List the prime factors of c. 5 Suppose -13a - 207 = -14a + 5w, 0 = 3w - 15. What are the prime factors of a? 2, 29 Let r(l) = 6l*2 + 21l + 3. Let o(a) = -2a2 - 7a - 1. Let s(z) = -7o(z) - 2r(z). Let m be s(-5). Suppose m + 30 = 2v. List the prime factors of v. 23 Suppose -4c = 5m - 9037, c = 211m - 206m - 9022. What are the prime factors of m? 5, 19 Suppose 39 = k + 37. Suppose 142 = -c + kc. List the prime factors of c. 2, 71 Suppose -2p + 5v - 17 = 3, 5p + 3v = 12. Suppose j - 10 + 1 = p. Let a = j + 0. What are the prime factors of a? 3 Suppose -232r + 230r = -5744. What are the prime factors of r? 2, 359 Suppose -48783 - 18096 = -27q. What are the prime factors of q? 2477 Let b be 2/(-4) - 2/(8/(-18)). Suppose 18 = -3r + 3x + 81, -2r = bx - 24. List the prime factors of r. 2, 3 Suppose 2d + 2d + 72 = 0. Let f be (-1)/1 - -2 - 40. Let h = d - f. What are the prime factors of h? 3, 7 What are the prime factors of (-5)/(1745/870 - 2)-3? 2, 3, 5, 29 Suppose -34u - 12 = -35u. Suppose -4s = -s + 18. Let q = u - s. List the prime factors of q. 2, 3 Let l be 4/14(-85 - -92). Let i(o) = 5o - 5 + 9o*2 + 2o - 4o. What are the prime factors of i(l)? 37 List the prime factors of 1786 + 4-1(-1)/2. 2, 3, 149 Suppose -8g + 6g - 3h = -866, h - 2191 = -5g. What are the prime factors of g? 439 Suppose 0 = -5t + 3b - 44, -5t - 39 = -5b + 11. Let k be (t - -1)/(18/153). Let p = 118 + k. What are the prime factors of p? 67 Let i(m) = 2m + 41. Let d(s) = s*2 + 13s + 7. Let r be d(-11). What are the prime factors of i(r)? 11 Let t(v) be the second derivative of v5/20 - v4/2 - 5v3/3 + 23v*2/2 + 40v. List the prime factors of t(7). 2 What are the prime factors of 3146 - 2/(4/14)? 43, 73 Let z = -2735 - -4782. What are the prime factors of z? 23, 89 Let y = 207 + -86. Suppose -3v = -d + y, 5d + v = 6v + 575. List the prime factors of d. 2, 7 Suppose -5j - 15 = -10. What are the prime factors of (j + -23)/(6/(-8))? 2 Let a(y) = 3y - 1. Let h be a(3). Suppose 6f - h - 46 = 0. Let d(x) = -x*2 + 9x + 11. What are the prime factors of d(f)? 11 Let r = 11 + -9. Let j be 12/3 - (r + -3). Suppose -62 = -ji + 4t - 23, -i + 4t + 11 = 0. What are the prime factors of i? 7 Let z = -473 - -1619. What are the prime factors of z? 2, 3, 191 Let q(k) = 10k - 2. Let w be q(-1). Let s = -17 + 9. Let x = s - w. List the prime factors of x. 2 List the prime factors of (-9)/6108(-1 - 1). 2, 3 Let n be (-3)/12 - (-6777)/(-12). List the prime factors of 4/10 - n/251. 23 Let p = 59 - 55. Suppose -pm - 227 = -1271. List the prime factors of m. 3, 29 Let t be 819/(-14)(-2)/3. Let f be (24/(-4))/((-2)/t). Let k = -68 + f. What are the prime factors of k? 7 Let q(u) = 130u*2 + 1. Suppose -2d + 2 = 0, -4 = 2o - 4d + 2. What are the prime factors of q(o)? 131 Let g(z) be the first derivative of 9z2/2 - 11z + 8. Let f be g(5). Suppose -2j = n - f + 8, -4j - 98 = -3n. List the prime factors of n. 2, 3, 5 Let b = 5595 + -3912. What are the prime factors of b? 3, 11, 17 Suppose 2z - 3c - 18 = 0, -2c - 2 = -2z - 3c. Let y = 15 - z. List the prime factors of y. 2, 3 Suppose -14 = 16m - 18m. Suppose -27 + 426 = mp. What are the prime factors of p? 3, 19 Let t(h) = 11h*3 + 9h*2 - 23h + 180. What are the prime factors of t(7)? 3, 17, 83 List the prime factors of (5474/69)/(2(-1)/(-12)). 2, 7, 17 Let z be (-3)/(-5) + (4 - (-4308)/(-30)). Let u = z + 297. What are the prime factors of u? 2, 79 Let o(i) = i2 + 2i - 6. Let x be o(-4). Suppose 5 = w + x. Suppose 4p + 125 = 5m, wm - p + 3 = 78. What are the prime factors of m? 5 Let g be 15 - (-1)/(-1). Suppose -63 = o - go. List the prime factors of o. 3, 7 Let g = 0 - -5. Suppose -464 = -gz + 246. List the prime factors of z. 2, 71 Suppose -o + 181 = -49. What are the prime factors of o? 2, 5, 23 Let f(m) = -m*2 + 7m - 12. Let n be f(4). Suppose n = -4d + 7 - 3. Let h(s) = 20s*3 - 2s + 1. What are the prime factors of h(d)? 19 Let h be (2 + -3)/(-3)3. Let r(f) = 4f*2 + f. Let z be r(-1). Let p = h + z. What are the prime factors of p? 2 Suppose i - 3f = -4i + 3834, 2i = -4f + 1544. List the prime factors of i. 2, 3 Let c(w) = 85w*2 + 4w - 2. Let t = 1 - 0. List the prime factors of c(t). 3, 29 Suppose -4146 = -7f + 1615. List the prime factors of f. 823 Suppose 2p - 9 = 3u, 0u - 9 = -4p + 3u. Let i(f) = -f*2 + 12f - 9. Let h be i(11). Let y = h - p. What are the prime factors of y? 2 Let j(w) = -w3 + w2 + w + 7. Let k be j(0). Suppose 4r = 3b - 182, -2r + 210 = -kr - 5b. What are the prime factors of 1 + 1 - r/2? 2, 3 Let c(a) = -9a*2 + 3a + 4. Let w(t) = -t*2 - 1. Let l(z) = -c(z) - 6w(z). List the prime factors of l(1). 2, 7 Let x = -10 + -6. What are the prime factors of 12/x-228/6? 2, 11 Suppose 5s = 37 + 8. Suppose su = 11u - 66. List the prime factors of u. 3, 11 Let t = 0 - 6. Let b be (-475)/(-4) + t/(-24). Let r = b + -71. List the prime factors of r. 2, 3 Suppose -3q - q + 5h + 268 = 0, 3q - 232 = -4h. Let b(j) = 2j*3 + qj - 72j + j*2. What are the	{ "pile_set_name": "DM Mathematics" }
lve -3h5 - 843h*4 - 9771h*3 - 23277h*2 + 34326h + 116208 = 0. -269, -8, -3, 2 What is n in -n*5/3 + 86n*4/3 + 5n*3/3 - 430n*2/3 - 4n/3 + 344/3 = 0? -2, -1, 1, 2, 86 What is x in x*4 + 590x*3 - 61792x*2 + 121810x - 60609 = 0? -681, 1, 89 Factor -2p3 + 6072p*2 + 6074p. -2p(p - 3037)(p + 1) Solve 4n*2/7 + 368776n + 59498135452 = 0. -322679 Solve -8h5/7 - 3050h*4/7 - 18786h*3/7 - 1918h*2 + 27770h/7 + 7500/7 = 0. -375, -5, -2, -1/4, 1 What is x in 10x4 - 494x*3 + 3026x*2 + 71318x - 28980 = 0? -9, 2/5, 23, 35 Find k, given that -5k3/6 + 40385k*2/6 + 80815k/2 + 121245/2 = 0. -3, 8083 Factor 2w2 + 111524w + 1554700322. 2(w + 27881)2 Find g, given that -g3/2 - 152g*2 + 2803g/2 - 2191 = 0. -313, 2, 7 Determine c, given that -2c4/3 + 2530c*3/3 - 26526c*2 + 274482c - 932148 = 0. 9, 14, 1233 Factor -b*2/2 - 301b/2 - 1172. -(b + 8)(b + 293)/2 Factor 2a*3/19 - 48110a*2/19 + 289730014a/19 - 4911516274/19. 2(a - 12019)2(a - 17)/19 Factor -v*3/2 + 169v*2/6 - 2333v/6 + 253/2. -(v - 33)(v - 23)(3v - 1)/6 Factor t2 - 83t - 534. (t - 89)(t + 6) Factor -245x*2/6 - 398475x - 1944273375/2. -5(7x + 34155)*2/6 Factor 4i*3 - 12144i*2 - 664524i - 9010440. 4(i - 3090)(i + 27)*2 Solve 2o*2/7 + 1940o/7 + 19200/7 = 0 for o. -960, -10 Factor 2i2/7 - 290i + 10100/7. 2(i - 1010)(i - 5)/7 Find t, given that -2t3/3 + 16438t*2/3 - 33784198t/3 + 33767762/3 = 0. 1, 4109 Suppose 2n3/13 - 2n*2/13 - 1984n/13 = 0. Calculate n. -31, 0, 32 Solve 5z4 - 1620z*3 + 143545z*2 - 1788570z - 24345360 = 0. -8, 26, 153 Determine w so that -2w5/15 - 32w*4/3 - 348w*3/5 - 1616w*2/15 - 146w/3 = 0. -73, -5, -1, 0 Let 3i3 - 4323i*2 - 34755i - 30429 = 0. Calculate i. -7, -1, 1449 Factor -4x3 - 552x*2 - 24624x - 349920. -4(x + 30)(x + 54)2 Determine v so that -v3 + 2365v2 + 2368v - 4732 = 0. -2, 1, 2366 Solve -2r3 - 198r*2 - 760r = 0. -95, -4, 0 Factor 4i3 - 5008i*2 + 1406464i + 103280640. 4(i - 656)2(i + 60) Factor -x*3 + 1340x*2 + 34101x + 32760. -(x - 1365)(x + 1)(x + 24) What is k in -28k3 - 61636k*2 - 17608k = 0? -2201, -2/7, 0 Factor v*4/5 + 1362v*3 - 40884v*2/5 + 81784v/5 - 54528/5. (v - 2)*3(v + 6816)/5 Let -3b4 + 891b*3 + 8193b*2 + 21069b + 13770 = 0. What is b? -5, -3, -1, 306 Determine b so that -2b4/9 - 10b*3/9 + 10b*2/3 + 10b - 12 = 0. -6, -3, 1, 3 Factor -3c2/8 - 5691c/2. -3c(c + 7588)/8 Factor -4v2 + 148v - 144. -4(v - 36)(v - 1) Factor -2m2/7 - 10434m/7. -2m(m + 5217)/7 Factor -l*2/3 - 9778l/3 - 3259. -(l + 1)(l + 9777)/3 Factor -3p*3 - 26889p*2 - 60264969p - 60238083. -3(p + 1)(p + 4481)2 Factor n4/10 + 37n3/10 + 18n2/5. n2(n + 1)(n + 36)/10 Determine x so that -x*2 + 407x + 2898 = 0. -7, 414 Solve -85k5 - 34605k*4 - 3541345k*3 - 3918915k*2 - 412090k = 0. -203, -1, -2/17, 0 Factor -5p2 - 401710p + 2410440. -5(p - 6)(p + 80348) Find t, given that -2t3 - 32t*2 + 15030t - 429300 = 0. -106, 45 Factor j*3/5 + 334j*2/5 + 2416j - 53728/5. (j - 4)(j + 46)(j + 292)/5 Let l*3 + 691l*2 + 1378l = 0. Calculate l. -689, -2, 0 Let -c*3 - 31172c*2 + 62347c - 31174 = 0. What is c? -31174, 1 Factor -z*3 + 1700z*2 - 11857z + 10158. -(z - 1693)(z - 6)(z - 1) Factor c*3/3 + 388c2. c2(c + 1164)/3 Let 2b*4/13 + 1008b*3/13 + 44686b*2/13 - 1808736b - 1812096 = 0. What is b? -312, -1, 121 Determine p so that -p*3/4 - 317p*2/2 - 99935p/4 - 49651/2 = 0. -346, -287, -1 Solve -20h4 + 3035h*3 - 5260h*2 + 1495h + 750 = 0. -1/4, 1, 150 Factor 13754o3 - 3245024o*2 + 282098o - 6132. 2(13o - 3066)(23o - 1)2 Solve y3 + 75565y2 + 1427403952y - 4282891968 = 0. -37784, 3 Factor 5p2 + 10140p + 60660. 5(p + 6)(p + 2022) Let 5z3 - 195z*2 - 210z + 400 = 0. What is z? -2, 1, 40 Determine a so that 5a2/2 + 18180a + 471835/2 = 0. -7259, -13 What is j in -j*2/4 - 15291j - 233814681 = 0? -30582 Let -k*3/7 - 183k*2/7 - 6831k/7 + 147015/7 = 0. Calculate k. -99, 15 Solve -4j5/5 - 32j*4/5 + 844j*3/5 - 2248j*2/5 + 288j = 0. -20, 0, 1, 2, 9 Find o such that -o*3/2 + 4639o*2/2 + 16270o - 41814 = 0. -9, 2, 4646 Factor -l*2 + 78332l - 1533975556. -(l - 39166)*2 Factor -242m*3 + 5606480m*2 + 4077536m + 741376. -2(m - 23168)(11m + 4)2 Find r such that -5r*5 + 1350r*4 - 6530r*3 - 25500r*2 + 85375r + 198750 = 0. -3, -2, 5, 265 Find n, given that -5n2 + 148445n + 148450 = 0. -1, 29690 Factor d*3/8 - 1749d*2/8 - 3530d. d(d - 1765)(d + 16)/8 Find t, given that -t*5/6 + 15365t*4/3 - 157393937t*3/3 + 537500257298t*2/3 - 1074056304613t/6 - 1074685818907/3 = 0. -1, 2, 10243 Solve 578u5 - 126480u*4 - 812251u*3/2 - 650691u*2/2 - 48276u - 1998 = 0 for u. -2, -1, -3/34, 222 Find b such that 2b2/5 - 9054b/5 = 0. 0, 4527 Determine g so that 30g3 + 48175g*2 - 8030g = 0. -1606, 0, 1/6 Let 135n5 + 8640n*4 + 33120n*3 + 43600n*2 + 24080n + 4800 = 0. Calculate n. -60, -2, -2/3 Factor -d*2/5 - 512d/5 - 707. -(d + 7)(d + 505)/5 Factor n2 - 1133n + 36300. (n - 1100)(n - 33) Solve 2z*3/9 + 394z*2/9 + 2684z/9 + 1520/3 = 0. -190, -4, -3 Solve 18v5/13 - 2874v*4/13 - 3868v*3/13 + 636v*2/13 + 1290v/13 - 322/13 = 0. -1, 1/3, 161 Solve 3n2 - 18777n - 112770 = 0. -6, 6265 Find n, given that n*2/2 + 106089n + 11254875921/2 = 0. -106089 Let -3k4 + 2376k*3 + 14328k*2 + 28704k + 19152 = 0. What is k? -2, 798 Factor -4m5/9 - 68m*4 + 6520m*3/9. -4m*3(m - 10)(m + 163)/9 Factor -j3/3 + 63410j*2/3 - 126817j/3 + 21136. -(j - 63408)(j - 1)2/3 Factor u4 + 28u*3 + 118u*2 + 60u - 207. (u - 1)(u + 3)2(u + 23) Factor 2645q2 + 1147240q + 124400720. 5(23q + 4988)*2 Solve 16q*5/7 - 2740q*4 + 15676q*3 + 28632q*2/7 = 0 for q. -1/4, 0, 6, 1193 What is q in -21q*5/4 + 24429q*4/4 - 200619q*3/4 - 405309q*2/4 - 27735q + 17325 = 0? -1, 2/7, 10, 1155 Let 2z3/3 + 12z*2 - 146z/3 - 140 = 0. What is z? -21, -2, 5 Factor 192a3/7 + 898564a*2/7 + 150190560a + 21902400/7. 4(a + 2340)2(48a + 1)/7 Determine o so that -2o*3/5 + 74o*2/5 + 1008o/5 + 2304/5 = 0. -8, -3, 48 Factor n*2 + 141191n + 141190. (n + 1)(n + 141190) Let 2s*3/15 + 1052s*2/15 - 98498s/15 - 99548/15 = 0. What is s? -607, -1, 82 Find s, given that -s*2/7 + 1947s/7 - 51840/7 = 0. 27, 1920 Find w such that 2w2/3 + 4216w/3 - 16960 = 0. -2120, 12 Factor -2t2/17 + 916t/17 - 4530/17. -2(t - 453)(t - 5)/17 Let 248i5 - 22119i*4 + 26009i*3 - 4314i*2 + 176i = 0. Calculate i. 0, 2/31, 1/8, 1, 88 Solve -3o2/2 - 12963o/2 - 25902 = 0. -4317, -4 Let -2q5/13 + 22q*4 - 4620q*3/13 - 11560q*2/13 + 1424q + 41664/13 = 0. What is q? -2, 2, 21, 124 Let -3i3/7 + 33i*2/7 + 48i/7 - 960/7 = 0. What is i? -5, 8 Factor -3f4 - 11799f*3 - 15480270f*2 - 6790607700f - 20232819000. -3(f + 3)(f + 1310)*3 Let 9y*3/2 - 201y*2/2 - 1269y = 0. What is y? -9, 0, 94/3 Suppose 21k3 - 4482k*2 - 2568k = 0. What is k? -4/7, 0, 214 Factor -o*4/5 - 160921o*3 - 161846899203o*2/5 + 161847703809o/5. -o(o - 1)(o + 402303)*2/5 Factor -81w*3/4 + 102375w*2/4 + 182768w + 325376. -(w - 1271)(9w + 32)*2/4 Factor -2m*2/15 + 6676m/15 - 85774/5. -2(m - 3299)(m - 39)/15 Solve -4g3 + 512g*2 + 1572g = 0 for g. -3, 0, 131 Factor 2l2 + 3270516l + 1337034363282. 2(l + 817629)2 Suppose -2d*2/5 + 4890788d/5 - 2989975907618/5 = 0. What is d? 1222697 What is j in 14j5/3 - 11612j*4/3 - 29936j*3/3 - 13312j2/3 = 0? -2, -4/7, 0, 832 Solve d4/4 - 5661d3/4 - 31183d*2/2 - 36864d - 22688 = 0. -8, -2, -1, 5672 Suppose 3f2/4 + 55947f/4 + 55941/2 = 0. What is f? -18647, -2 Solve -20l5 - 412l*4 - 1452l*3 + 7228l*2 + 5168l - 3120 = 0. -13, -10, -1, 2/5, 3 Factor s*3 - 12609s*2 + 50420s. s(s - 12605)(s - 4) Factor -5i4 + 190940i*3 - 1822904180i*2. -5i*2(i - 19094)*2 Solve -18n*5/7 - 5766n*4/7 - 303584n*3/7 - 4592912n*2/7 - 5725920n/7 - 266400 = 0 for n. -259, -30, -2/3 Solve t*2/7 + 75t/7 + 216/7 =	{ "pile_set_name": "DM Mathematics" }
(2))). 6sqrt(19)/5 Simplify (-4sqrt(5184)2)/((sqrt(192) - 1sqrt(192)-3) + sqrt(192)). -24sqrt(3)/5 Simplify (0 + -2sqrt(7)-4 + sqrt(28) + -3 + -5 + (sqrt(112) - sqrt(7)) + -2)*2. -260sqrt(7) + 1283 Simplify (((sqrt(1539) + (sqrt(1539) - (sqrt(1539) + -1)))1)2 + sqrt(1539) + 4 - (-5 + 2 + sqrt(1539) + 1)2) + 4. 5 + 63sqrt(19) Simplify 0 + sqrt(847) + (2 + sqrt(7))-5 - (1 + sqrt(1792) - sqrt(28))2. -1383 - 22sqrt(7) Simplify 1 + (sqrt(315)-4 - sqrt(35))/(6(sqrt(7) - (-2sqrt(7) + sqrt(7))))3. -13sqrt(5)/4 + 1 Simplify (-5-4-3sqrt(228))/((sqrt(240)/sqrt(125))/sqrt(4)). -300sqrt(19) Simplify 0 + (-4sqrt(119)-2)/(1sqrt(175)) + -5 + 3. -2 + 8sqrt(17)/5 Simplify 6((-3 + sqrt(34)/sqrt(2) - 12sqrt(17)) + -2). -30 - 6sqrt(17) Simplify (sqrt(24) + 1sqrt(24)-1)/(sqrt(8) - 6sqrt(72)) + -5. -5 Simplify ((31sqrt(425) + sqrt(425) + 1 + sqrt(425)-4 + sqrt(425) + sqrt(425))-2)*2. 80sqrt(17) + 6804 Simplify ((-4 + (sqrt(7)1 + 3 - (sqrt(7) + (sqrt(7) + sqrt(7)-1)-6)) + 4 + sqrt(28) + 1)-4)*2. 256sqrt(7) + 704 Simplify (sqrt(68) - (sqrt(68) - (sqrt(68) + sqrt(68)1))-4)/((sqrt(240)/sqrt(10))/sqrt(6) + sqrt(4)). -3sqrt(17)/2 Simplify (sqrt(112) - 6sqrt(112)6)225. 1372000 Simplify 4(-3 + (sqrt(133) + (sqrt(133) - (sqrt(133) + -3sqrt(133)))-6 + sqrt(133))/(sqrt(700)2)). -16sqrt(19)/5 - 12 Simplify ((sqrt(49)/(sqrt(7)2) - (0 + sqrt(567)))3 + (sqrt(189)/sqrt(3) - sqrt(7)) + sqrt(7) + sqrt(112)-6)2. 60543/4 Simplify -5(sqrt(12)/sqrt(486) + 0)-4-6. -40sqrt(2)/3 Simplify (-5 + sqrt(2299) + -2 + (sqrt(2299) - (1 + sqrt(2299))) + sqrt(2299) + (sqrt(2299) + 2)3)*2. -220sqrt(19) + 57479 Simplify -1 + ((sqrt(125) + 1)-3 + -6sqrt(45) + sqrt(60)/(-2sqrt(12)))2. 201sqrt(5) + 22477/4 Simplify ((3 + -2sqrt(2448) + -2 + (sqrt(2448)2 + 1)-6)6)*2. 60480sqrt(17) + 17273988 Simplify -6(sqrt(475) + 1) - (sqrt(475) - (sqrt(475) + -2(sqrt(475) + -3)))*2. -1942 + 90sqrt(19) Simplify -1(sqrt(266)/sqrt(63))/(6-1sqrt(2)). sqrt(19)/18 Simplify (-6-1sqrt(187) - (sqrt(187) - (-6sqrt(187)-2 - sqrt(187))))/(sqrt(77)/(sqrt(7)-1) + 5sqrt(22)/sqrt(2)). 4sqrt(17) Simplify (4(sqrt(1666) - sqrt(1666)2 - sqrt(1666)) - sqrt(1666))/(-5sqrt(2)-1 - sqrt(14)/sqrt(63)). -27sqrt(17)/2 Simplify (2 + (sqrt(36)/sqrt(216))/((sqrt(105)/sqrt(7))/sqrt(5)))2. 2sqrt(2)/3 + 73/18 Simplify (sqrt(38)/(2sqrt(2)1)-5 + (sqrt(114)/(sqrt(18) - sqrt(2)))/(sqrt(33)/(sqrt(11)-1)))*2. 171 Simplify (1(-5 + -1 + sqrt(1216)))*2-3. -3756 + 288sqrt(19) Simplify 2 + sqrt(68)2-3 - (2((sqrt(68)1)2 - sqrt(68)) - ((sqrt(68) + 0)-4 + sqrt(68))). -134 - 14sqrt(17) Simplify (((2 + sqrt(98) + 3)2)*2 + 4)-6. -2976 - 1680sqrt(2) Simplify -3((sqrt(11) - (sqrt(11) - (-1 + sqrt(11) + 5))) + sqrt(11) + sqrt(1584) + (sqrt(1584) - (sqrt(1584) + 1)))*2-6-4. -155880 - 6048sqrt(11) Simplify -6(-2sqrt(325))*2 + -5 + (1sqrt(26)/sqrt(2))*2. -7792 Simplify ((sqrt(78)-3 - sqrt(78) - sqrt(78))/sqrt(3))/(sqrt(2) + (sqrt(8)5)/sqrt(4)). -5sqrt(13)/6 Simplify ((sqrt(1300) + -1 + sqrt(1300) + sqrt(1300) + -3)-2 + -5(sqrt(1300) + sqrt(1300) + 1) + (sqrt(1300) - sqrt(1300)-2)-3 + sqrt(1300))*2. -1440sqrt(13) + 748809 Simplify 1 + -3 + 1 + sqrt(17) + -3 + (sqrt(170)-1)/sqrt(10) + (sqrt(1377)-1 - ((sqrt(17) + sqrt(17) + -1)*2 + -5)). -68 - 5sqrt(17) Simplify ((sqrt(6480)1)/(sqrt(81)2)1)2. 20 Simplify (1(sqrt(102) - (sqrt(102) + (sqrt(102)22 - sqrt(102))) - sqrt(102)))/(4-1sqrt(6)3). sqrt(17)/3 Simplify (-2-3sqrt(52) + sqrt(52))/(sqrt(20)/(sqrt(35)/sqrt(7))). 7sqrt(13) Simplify (2 + 3 + (sqrt(55)2 + sqrt(55) + sqrt(55) - sqrt(55))/sqrt(5) + sqrt(11) + (sqrt(11) - sqrt(44)/sqrt(4))5 + sqrt(11) + 3 + 1)*2. 90sqrt(11) + 356 Simplify ((sqrt(5200)-3 - sqrt(52))-3)/(1sqrt(40)/(-1sqrt(10))). -93sqrt(13) Simplify -3 + (-2(sqrt(99) + sqrt(99) + 0 + sqrt(99)))*2 + (-1sqrt(99)-3)2 + 4. 4456 Simplify 4 + (3sqrt(7623)3-5)*2. 15436579 Simplify (((sqrt(171) - (1sqrt(171) - sqrt(171) - sqrt(171))) + sqrt(171))-4)/sqrt(9)22 + -1 + -1. -48sqrt(19) - 2 Simplify 2 + 6(6(sqrt(13) + sqrt(13)3 + sqrt(13)) + 3) + 3. 23 + 180sqrt(13) Simplify (6-6((sqrt(19)2 - sqrt(19)) + -3 + -6sqrt(171)))*2. 132192sqrt(19) + 7128000 Simplify (-1 + 4(sqrt(648) - (sqrt(648) + -1)) + 4(sqrt(648) + -1))*26. -864sqrt(2) + 62214 Simplify (-4 + (5(sqrt(192) + 2 + sqrt(192) + 1))*2)5. 12000sqrt(3) + 97105 Simplify (-3sqrt(68)1)/((sqrt(16)-4 - sqrt(4)) + sqrt(4)). 3sqrt(17)/8 Simplify (12sqrt(1296))/(sqrt(72)/((sqrt(900) - sqrt(900)-1) + sqrt(900))). 540sqrt(2) Simplify (sqrt(77)-14 + sqrt(77) + sqrt(77) - (sqrt(77) + 6(sqrt(77) - -2sqrt(77) - sqrt(77))))/((sqrt(77) + -5sqrt(77)-2)/sqrt(11)). -15sqrt(11)/11 Simplify -3((sqrt(17) + 1 + -2 + sqrt(425)-1 + 1 + -3)-2)2. -3372 - 288sqrt(17) Simplify (2sqrt(1911) + 62sqrt(39))/(4sqrt(300)2 + sqrt(300)). 13sqrt(13)/45 Simplify (-5 + 5(-1 + sqrt(2)) + -4)2 - (-5 + -2 + sqrt(2) + sqrt(2) - (sqrt(72) - (1sqrt(72))*2)). -136sqrt(2) + 181 Simplify (-6-2sqrt(121) + (sqrt(121) + 3(sqrt(121) - (2sqrt(121) - sqrt(121))) + sqrt(121) - sqrt(121)))/(1sqrt(1584) - -3(sqrt(22)/sqrt(2) - sqrt(11))). 13sqrt(11)/12 Simplify (sqrt(405) - sqrt(405)-2-6)2 + (sqrt(10)/sqrt(2)6 - sqrt(5)) + (sqrt(80)1 - sqrt(80)). 5sqrt(5) + 49005 Simplify -3 + (sqrt(102)1-5)/((sqrt(66) - ((sqrt(66) - sqrt(66)-2) + sqrt(66)))/sqrt(11)). -3 + 5sqrt(17)/3 Simplify (-1 + 1((sqrt(2) - (sqrt(98) + -3) - (-4 + sqrt(2)-1 - sqrt(2))) + -4))*2. -16sqrt(2) + 36 Simplify -2((sqrt(9)/sqrt(3))2 + -1) - (-2 + 3sqrt(75)). -15sqrt(3) - 2 Simplify (((sqrt(70)/sqrt(2))/sqrt(5) - (sqrt(847) + -2)) + 3)2. -100sqrt(7) + 725 Simplify -1(sqrt(35) - sqrt(140)-1)/(2(sqrt(7) - (2sqrt(7) + sqrt(7)))). 3sqrt(5)/4 Simplify (sqrt(153)/sqrt(3) + sqrt(51))/sqrt(3) + 0 + sqrt(68) + sqrt(204)/(((sqrt(192) - sqrt(12))-1 - sqrt(12)) + sqrt(12)). 11sqrt(17)/3 Simplify (-13sqrt(91))/(sqrt(1008)2). -sqrt(13)/8 Simplify ((2sqrt(144)1)/(2sqrt(800) + sqrt(800))1)*2. 2/25 Simplify ((1sqrt(78) - sqrt(78))-6 - sqrt(78) - -2sqrt(78)3)/(6sqrt(864)/sqrt(9)). 5sqrt(13)/24 Simplify (2((sqrt(847) - (sqrt(847) + -1))*2 + sqrt(847))-1 - ((1sqrt(847) + sqrt(847) + -4)2 + (sqrt(847) + 0 + 1sqrt(847))*2)) + 2. -6792 + 154sqrt(7) Simplify (14sqrt(153))/(-2(sqrt(9) - 4sqrt(9))). 2sqrt(17)/3 Simplify (1 + sqrt(17) + sqrt(85)/sqrt(5)2)*2 + (sqrt(153) + -3(sqrt(153) - 1sqrt(153) - sqrt(153)))/sqrt(9). 10sqrt(17) + 154 Simplify -3(sqrt(13)1 + -5) + (sqrt(1053) - -1sqrt(1053) - (4sqrt(52)/sqrt(4))*2) + 3. -190 + 15sqrt(13) Simplify (sqrt(693)/(-1sqrt(11))-2)/(4sqrt(81) - (sqrt(108)2)/sqrt(12)). sqrt(7)/5 Simplify 2 + ((-2 + (sqrt(1088) - (1 + sqrt(1088))))*2 - sqrt(1088) - sqrt(1088)) + (-51sqrt(1088))26. -16sqrt(17) + 163211 Simplify (sqrt(228) - (sqrt(228) + (sqrt(228) - -1sqrt(228))4))/(sqrt(12) + (sqrt(12) - (sqrt(12) - (sqrt(12) - ((sqrt(972)2 - sqrt(972)) + sqrt(972)))))). sqrt(19)/2 Simplify ((-3sqrt(833)-2 + sqrt(833))-5 - 1(-4 + 2sqrt(833) + sqrt(833)))2. -2128sqrt(17) + 1202868 Simplify -3((-4sqrt(52))*24 - (3 + -1 + sqrt(832))*2). -7476 + 96sqrt(13) Simplify 4 + ((-3sqrt(245)1 + (sqrt(245) - (sqrt(245) - (4 + -2sqrt(245)))))2 - (-4 + -4(sqrt(245) + 1)*2)). -224sqrt(5) + 7133 Simplify sqrt(5)-2 + 0 + 4 - ((sqrt(90)-3)/sqrt(2) + sqrt(45)). 4 + 4sqrt(5) Simplify -2 + -5 + (1 + -3 + (-31sqrt(432) - sqrt(432)) + sqrt(432))2. 144sqrt(3) + 3885 Simplify ((sqrt(76) + (sqrt(76) - -2sqrt(76))-6)/(sqrt(16) - (sqrt(16) - 4sqrt(16)))-3)*2. 49419/64 Simplify -1-3sqrt(1539)2 - (-3 + -1(-2sqrt(1539))*2 + sqrt(1539)). 45sqrt(19) + 6159 Simplify ((sqrt(150) - sqrt(150)-2)6 - -6sqrt(150)2)/(-6sqrt(6)/sqrt(2) - (sqrt(132)/sqrt(4))/sqrt(11)). -150sqrt(2)/7 Simplify (4 + 2(sqrt(1331) + 3))231. 1320sqrt(11) + 16272 Simplify (5 + ((sqrt(2299)1 - sqrt(2299)) + -5 - (sqrt(2299) - 52sqrt(2299)))-1)*2. -1980sqrt(19) + 186319 Simplify -3 + -2 + sqrt(475) + (sqrt(475) - (1 + (sqrt(475)2 + sqrt(475) - sqrt(475))))2 + (6(sqrt(475) + -4)6)2. -51825sqrt(19) + 636807 Simplify ((3sqrt(76)-53)/((-3sq	{ "pile_set_name": "DM Mathematics" }
e 8/105/f. Sort -5, l, 2 in descending order. 2, l, -5 Let p = 31 + -27.4. Let x = 3 - p. Put -3, -5, x in decreasing order. x, -3, -5 Let p be (4/(-2))/((-2)/5). Let m be ((-24)/20)/((-2)/10). Suppose mo = 11o + 25. Sort p, 2, o in decreasing order. p, 2, o Let y = 13 - 8. Suppose 5l + 14 = -2l. Put 0, y, l in ascending order. l, 0, y Suppose -5p = -3u - 8, 0 = 5p - 2u + 7u. Put 4, 0, -3, p in descending order. 4, p, 0, -3 Let s = -1 - -4. Let r = -0.31 - -0.01. Put -0.02, r, s in increasing order. r, -0.02, s Let k = 1 + 2. Suppose -kb - b + 3p = -8, -2p - 4 = -4b. Let i(z) = z*3 + 5z*2 - 8z - 9. Let o be i(-6). Put 4, b, o in descending order. 4, o, b Let v = -3 - -2.98. Let b = -0.05 + v. Let n = -5.07 - b. Put -0.2, 0, n in ascending order. n, -0.2, 0 Let u = -21 + 14. Let v = 2 + u. Let k be (1/(-3))/((-5)/75). Sort 3, v, k. v, 3, k Suppose 0 = -5w - 330 + 350. Sort -3, w, 2 in ascending order. -3, 2, w Let f = 0 + -3. Sort 0.2, f, -0.03 in increasing order. f, -0.03, 0.2 Let o = 6 - 3. Let k(y) = 7y*2 - 11y - 3. Let s(f) = 2f2 - 4f - 1. Let p(n) = 4k(n) - 11s(n). Let l be p(-1). Put -2/7, l, o in decreasing order. l, o, -2/7 Let l = -138 - -158. Put l, -4, 1/5, 4 in ascending order. -4, 1/5, 4, l Let n = -15 - -20. Sort n, 2, -5, -4 in decreasing order. n, 2, -4, -5 Let b(r) = r - 5. Let k be b(9). Sort -1, 5, k, 1 in increasing order. -1, 1, k, 5 Suppose -2m = -3t - 0t - 13, 5m - 22 = 4t. Put m, -4/5, -5 in decreasing order. m, -4/5, -5 Let w(b) = -b. Let l be w(-3). Let d = 6 - 9. Let f = d - 2. Put f, l, 0.5 in ascending order. f, 0.5, l Suppose 2d = 2o - 3d + 1, -4o + 4d + 4 = 0. Let l(m) = -5m3 - m2 - 2m - 1. Let t = -3 - -2. Let y be l(t). Sort o, y, 4 in descending order. y, 4, o Let h be (352/(-80))/((-2)/(-10)). Let r = -22 - h. Sort -4, r, -5 in ascending order. -5, -4, r Let u = 42.739 + -0.039. Let g = u - 37. Let n = 6 - g. Sort 1, n, 3/5 in increasing order. n, 3/5, 1 Let w = -3 - -5. Suppose k - i = 5k - 13, k = wi + 10. Let q = 0 - k. Put -5, q, 2 in increasing order. -5, q, 2 Let p be 102/((90/4)/3). Let n = -13 + p. Let b = -2/63 + 67/126. Put 2/7, n, b in ascending order. 2/7, b, n Let n be (4 - 1)/((-6)/8). Let c = 1 - -3. Suppose 2f + 8 = cf. Sort f, n, 1. n, 1, f Let w(h) be the second derivative of 0 - h*2 - 1/20h*5 + 0h*4 + 2h - 1/6h3. Let z be w(0). Put 1/8, -1/6, z in decreasing order. 1/8, -1/6, z Suppose -1 = -2z - 4h + 33, -h - 44 = -3z. Suppose 2g = 5g - z, 0 = 5v - 5g + 15. Put 0.3, -5, v in decreasing order. v, 0.3, -5 Let q be (-888)/(-5)2/3. Let h = q + -119. Let d be (2 + -6)/4 + -22. Sort -2/11, h, d in increasing order. d, h, -2/11 Let l(f) = -f + 10. Let v be l(8). Let y be (v/7)/(2/(-4)). Sort y, 0.2, -4 in increasing order. -4, y, 0.2 Suppose -2 = -0t - t. Suppose 4 = -tk - 2k. Sort 4, k, -4 in descending order. 4, k, -4 Let s = -3 - -2.8. Let p = s + 0.4. Let z = 3 - 2.5. Sort p, -2, z. -2, p, z Suppose -b = -2b + 4. Sort -3, -1, b in ascending order. -3, -1, b Suppose x + 0x + 4o = 0, 3x = -4o + 8. Let m be (2 - 3) + 0 + 2. Let c be (4 + m - 2)/(-1). Sort x, c, -5 in descending order. x, c, -5 Suppose -g + 1 = -0. Suppose 0 = -x - g + 2. Suppose -9 = -2r + x. Put 4, r, -3 in decreasing order. r, 4, -3 Let f = 36 + -42. Sort f, -0.4, -1/3 in decreasing order. -1/3, -0.4, f Let x be (-30)/(-4)16/12. Let q be (-21)/x + 6 + -4. Let k = -0.2 - -0.2. Sort -1/4, q, k in ascending order. -1/4, q, k Suppose -n + 5k = -22, n + 2k + 15 = 2. Sort -1, 11, n in descending order. 11, -1, n Let d = 2 - 4. Let b be d/(-20) + 12/(-20). Sort 1, b, 2/7 in descending order. 1, 2/7, b Let u = 69/320 + -1/64. Let i be (2/(-3))/((-2)/12). Put u, i, -0.3 in ascending order. -0.3, u, i Suppose f + 15 = -3y + 4f, 0 = -2y - 3f - 5. Sort -3, y, 5 in ascending order. y, -3, 5 Let u = 0.025 - 0.125. Put -0.2, 0.06, u in descending order. 0.06, u, -0.2 Let r = -1 + 1. Sort r, 8, -2. -2, r, 8 Let p(j) = -j*2 + 13j - 27. Let n be p(10). Put 0.2, 17, -5, n in descending order. 17, n, 0.2, -5 Let x(p) = -7p2 + 6p + 4. Let a be x(-3). Put a, -1, -5 in descending order. -1, -5, a Let l = 1 - -1. Let d = -0.19 - 0.11. Sort l, 5, d in decreasing order. 5, l, d Let w = -60 - -55. Sort -1, 1/2, 1/4, w in ascending order. w, -1, 1/4, 1/2 Let j = -192 - -957/5. Put 2, 4, j in decreasing order. 4, 2, j Let v be 1 + (3 + -1)/(-2). Let n be (-3)/(-9)v/1. Sort n, -5, 4 in ascending order. -5, n, 4 Suppose 2a + 2a = 0. Let w = -3 + a. Sort w, 0, -2. w, -2, 0 Let m(y) = y3 + 3y*2 + 3y + 5. Let j be m(-2). Sort -4, j, -2, -3. -4, -3, -2, j Let y = -0.3 + 0.35. Let j = y - -0.35. Let w = -0.5 - 0. Sort 3, j, w in ascending order. w, j, 3 Let w be (8/(-6))/(18/27). Put w, 76, 4 in increasing order. w, 4, 76 Let o = -4.1 - -0.1. Let b = 0.03 + -5.03. Sort 2, o, b in decreasing order. 2, o, b Let v be (-4)/56(5 - 1). Let a = 3.27 - 0.27. Let t = -2 - 3. Put a, v, t in increasing order. t, v, a Let m = -3 - -6. Let x = -0.8 + 0.3. Put m, -1, x in descending order. m, x, -1 Let c(d) = 31d + 158. Let j be c(-5). Suppose -k + 2 = -0. Let w(v) = v*3 - 5v*2 + 4v - 2. Let i be w(4). Sort j, k, i in ascending order. i, k, j Let s = -5.1 - -5. Let f = 12.3 + -12. Sort s, f, -2/7 in decreasing order. f, s, -2/7 Let k(y) = y*2 - 16y + 13. Let x be k(15). Put 1, x, -5 in increasing order. -5, x, 1 Let s be (72/(-27))/(4/(-6)). Put s, 3, -1 in ascending order. -1, 3, s Let h = 13 + -12.8. Put h, 2, -1/6 in increasing order. -1/6, h, 2 Let z = 1.2 - 1.3. Put 0.2, -5, z in decreasing order. 0.2, z, -5 Let g(r) = -r*3 - 3r*2 + 2r - 4. Suppose -5c - 26 = 4u, -5u = c + c + 24. Let k be g(u). Sort k, -3, -2. -3, -2, k Suppose 0 = 90x - 87x - 6. Sort -5, x, 63 in increasing order. -5, x, 63 Suppose -2 - 2 = -2n. Suppose -nt - 6 = t. Sort -5, t, 4 in decreasing order. 4, t, -5 Let x = 33 - 13. Let r be ((-2)/50)/(x/(-275)). Let h = -1/20 - r. Sort -0.1, h, -2. -2, h, -0.1 Suppose -2u + 12 - 4 = 0. Put -5, u, -4 in decreasing order. u, -4, -5 Let l = -77 + 75. Sort -5, -25, l in decreasing order. l, -5, -25 Let z = -91 - -91.4. Put z, -40, -3 in descending order. z, -3, -40 Suppose -2p - 75 = -7p + 3f, 37 = p - 5f. Suppose 0w = -4w + p. Suppose -i = 1, -2z + 3 + 8 = -3i. Put z, w, -4 in descending order. z, w, -4 Suppose 1 = -4p + 3p + 4n, 5 = -5p - 5n. Let c be p/(2(-4)/8). Put -3, -2, c in ascending order. -3, -2, c Let p = -8 + 7.97. Let j = 15.9 - 16. Put p, j, -0.3 in decreasing order. p, j, -0.3 Let w = 68 - 68.4. Sort 1/7, w, 1/3 in descending order. 1/3, 1/7, w Let z = -45 + 44.8. Let g = -0.02 - 0.38. Sort 2, g, z in increasing order. g, z, 2 Let u = -53 + 50. Let m be (10/2)/(0 - -1). Sort -4, m, u in ascending order. -4, u, m Suppose 0 = -5u + 5i + 15, -15 = i - 4i. Suppose 0 = -2t - 0 + u. Put 3, t, 0 in descending order. t, 3, 0 Let c = -3.3 - -3. Let d = -0.8 - c. Let w = 6 + -6.2. Sort w, d, 0.3 in increasing order. d, w, 0.3 Let k = -17 + 14. Sort 4, k, -1 in descending order. 4, -1, k Let d(h) = 2h - 13. Let p be d(9). Let u = -0.8 + 1.2. Sort p, u, -0.07 in decreasing order. p, u, -0.07 Let t = -3 - 1. Let d be (t/(-3))/(1/(-3)). Let k be (1/1 + 0)/(-1). Sort d, -3, k. d, -3, k Let l be (-10)/4(-28)/(-35). Suppose 5 = -b + 4i - 9i, 0 = -2b - 5i - 5. Put 1, l, b in ascending order. l, b, 1 Let b be 5(2 - -1) + 3. Let t = -13 + b. Sort t, -10, -1 in decreasing order. t, -1, -10 Let h = 70 - 75. Sort h, 0.02, -1, 3 in decreasing order. 3, 0.02, -1, h Let c = -1.2 - 2.6. Let y = -1.2 + c. Let k = 103 - 102. Sort 4, k, y in decreasing order. 4, k, y Suppose -3n = -x - 1, -12n = -8n. Let d = 13 + -19. Let b = -9 - d. Sort -5, b, x. -5, b, x Let j = -42 + 37. Suppose -10q + 4 = -8q. Suppose 3k - 5 + 17 = 0. Sort k, q, j in increasing order. j, k, q Let u be (-1(-2)/(-4))/((-3)/6). Sort 8, -2, u, -3 in decreasing order. 8, u, -2, -3 Let o(k) = k - 1. Let l be o(-1). Let g = -1 - -0.5. Sort -3/4, g, l in increasing order. l, -3/4, g Suppose -51 = -5z - 2i + 93, 106 = 4z - 3i. Suppose -q = 3x - 2, 2x + x = 5q - z. Let y be (1/(-6) + 2/3)2. Put y, q, -1 in descending order. q, y, -1 Let q = 16 - 15. Let g	{ "pile_set_name": "DM Mathematics" }
94g + 329. Calculate i(-95). 234 Let i(p) = p3 + 16p*2 + 34p + 235. Give i(-15). -50 Let m(v) = 16553v - 33103. Calculate m(2). 3 Let z(f) = -3f*3 + 9f*2 + 56f - 20. What is z(6)? -8 Let m(u) = -u*2 + 34u - 218. What is m(5)? -73 Let p(q) = -1285q + 68131. Calculate p(53). 26 Let o(p) = 519p + 5590. Give o(-11). -119 Let o(q) = 344q3 + 1. What is o(-1)? -343 Let v(a) = -a2 - 10a + 33. Calculate v(7). -86 Let l(s) = s*2 + 3s - 966. What is l(30)? 24 Let s(n) = 617n + 71577. Calculate s(-116). 5 Let v(i) = -2i*3 + 34i*2 - 17i + 310. Determine v(17). 21 Let i(f) = 2f3 - 22f*2 - 307f - 30. What is i(-8)? -6 Let h(n) = -4n3 - 7n*2 + 17n - 13. Give h(3). -133 Let h(b) = -30b2 + 1293b - 31. Calculate h(43). 98 Let k(p) = -p*3 - 34p*2 - 229p - 36. Calculate k(-9). 0 Let c(m) = 69m2 - 2m + 2. Give c(1). 69 Let d(p) = 334p + 1691. Calculate d(-5). 21 Let s(u) = -19u + 614. Give s(33). -13 Let c(r) = 2r3 + 4r*2 - 18r + 1. Give c(5). 261 Let x(f) = -f*2 - 145f + 1196. Calculate x(8). -28 Let k(z) = -3z3 + 48z*2 - 41z - 24. Calculate k(15). 36 Let r(i) = -2i3 - 68i*2 - 26i - 41. Determine r(-34). 843 Let a(d) = d*3 - 10d*2 - 36d + 363. What is a(10)? 3 Let p(d) = 254d - 300. Determine p(1). -46 Let o(a) = -a2 + 498a - 6789. Give o(14). -13 Let v(a) = -3a2 - 118a + 52. Give v(-40). -28 Let u(l) = l*3 - 15l*2 + 22l - 22. Give u(13). -74 Let a(z) = -115z - 624. What is a(-5)? -49 Let f(t) = -38t + 25. Determine f(-7). 291 Let a(x) = 11x - 460. Calculate a(43). 13 Let z(f) = -194f + 307. Give z(2). -81 Let j(l) = 7l2 + 93l - 72. Calculate j(-14). -2 Let n(f) = -f*3 + 18f*2 - 11f + 237. Calculate n(18). 39 Let t(q) = 27q3 + 2q*2 + 52q - 154. Determine t(3). 749 Let l(k) = 5k - 75. Give l(-6). -105 Let z(f) = -f2 - 24f + 899. Give z(-45). -46 Let o(i) = -2i3 - 3i*2 - 3i - 18. Calculate o(-4). 74 Let w(s) = -3841s - 15352. Determine w(-4). 12 Let z(k) = 2k*3 - 47k*2 + 65k + 832. What is z(21)? -8 Let k(v) = -v*3 + 7v*2 - 3v + 9. Determine k(4). 45 Let q(w) = 30w2 - 2. Determine q(-1). 28 Let m(z) = -z3 - 14z*2 - 11z + 283. Calculate m(-10). -7 Let r(z) = z*2 - 59z - 393. Give r(65). -3 Let q(c) = -85c3 + 181c*2 + 177c - 3. Give q(-1). 86 Let i(j) = 12j2 - 249j - 61. What is i(21)? 2 Let s(x) = -3x2 - 71x - 385. Calculate s(-15). 5 Let p(u) = -2u2 - 432u - 12375. Calculate p(-182). 1 Let t(k) = -50k2 + 1355k - 130. What is t(27)? 5 Let s(b) = 3b2 + 11b + 25. Give s(-7). 95 Let a(h) = -h*3 + 29h*2 + 119h + 423. What is a(33)? -6 Let i(m) = 2m2 - 37m + 179. Determine i(8). 11 Let n(z) = 46z + 196. Calculate n(-11). -310 Let r(x) = 100x + 12304. Determine r(-123). 4 Let g(f) = -2626f + 13175. Give g(5). 45 Let y(l) = l3 + 5l*2 - 32l + 5. Give y(3). -19 Let r(k) = 1189k - 71329. What is r(60)? 11 Let v(z) = -825z - 3287. What is v(-4)? 13 Let q(l) = -l*2 + 14l + 21. Give q(6). 69 Let d(f) = -24f + 543. What is d(23)? -9 Let j(a) = 4a*2 + 9a + 71. Determine j(0). 71 Let i(q) = 120q - 4393. Give i(37). 47 Let c(a) = -5a*2 + 5a + 7. What is c(-1)? -3 Let v(i) = -12i - 556. Give v(-41). -64 Let k(b) = -16b*3 - 416b*2 - 2b - 42. What is k(-26)? 10 Let w(a) = -a*3 - 48a*2 - 84a + 357. What is w(-46)? -11 Let n(m) = 6m2 - 44m + 11. Calculate n(5). -59 Let a(o) = 276o - 44711. Calculate a(162). 1 Let a(y) = -y3 + 29y*2 - 2y - 48. What is a(29)? -106 Let j(v) = 3v2 + 963v - 2919. Give j(3). -3 Let t(o) = -o*3 + 35o*2 + 21o + 632. What is t(36)? 92 Let o(y) = 28y + 581. Determine o(-29). -231 Let p(o) = -4o3 + o2 - 38o + 38. Give p(1). -3 Let i(p) = -p2 + 7p + 391. Calculate i(23). 23 Let a(n) = -n*3 - 12n*2 - 9n - 3. Determine a(-11). -25 Let d(j) = 5j2 + 63j + 100. Calculate d(-9). -62 Let f(z) = z*3 + 12z*2 - 4z - 11. What is f(-2)? 37 Let y(q) = 108q2 - 849q - 126. What is y(8)? -6 Let c(i) = 165i3 - i2 - 4i + 5. What is c(1)? 165 Let x(y) = -2y3 - 7y*2 + 72y + 6. What is x(-8)? 6 Let v(a) = a*2 + 10a - 144. What is v(-18)? 0 Let m(o) = -32o + 4780. Give m(149). 12 Let u(g) = 26g*2 + 3g + 1. Give u(-2). 99 Let b(f) = 427f + 61. Give b(-1). -366 Let s(z) = 7z + 42. Give s(14). 140 Let t(p) = -2p2 - 73p + 91. What is t(-38)? -23 Let q(p) = 6p - 32. Give q(-16). -128 Let m(l) = 4l*2 + 934l + 8949. Calculate m(-10). 9 Let i(x) = -x*2 + 42x + 338. What is i(48)? 50 Let y(k) = 550k + 25304. Calculate y(-46). 4 Let c(l) = 12l + 83. Calculate c(11). 215 Let m(a) = -2a3 + 20a*2 - 4a - 11. Calculate m(10). -51 Let y(d) = -3d3 - 12d*2 - 13d - 14. Calculate y(-5). 126 Let t(a) = a*2 + 8a - 562. Determine t(-28). -2 Let v(l) = 4l3 + 230l*2 - 731l + 3. Determine v(3). -12 Let c(o) = 59o - 365. Calculate c(6). -11 Let a(q) = -1963q + 19634. Calculate a(10). 4 Let c(p) = p*2 - 22p - 88. What is c(15)? -193 Let f(g) = g*3 - 151g*2 + 590g - 320. Calculate f(147). -26 Let f(n) = -n*3 + 88n*2 - 110n + 1997. What is f(87)? -4 Let v(x) = x*2 - 17x - 1509. What is v(57)? 771 Let y(w) = -9w2 - 52w - 205. What is y(-6)? -217 Let z(h) = 3h + 59. What is z(-17)? 8 Let o(n) = 7n + 17. Determine o(-4). -11 Let x(z) = 31z + 369. Give x(-19). -220 Let y(i) = 2i*2 - 6i - 13. Give y(4). -5 Let i(m) = -1073m2 + 7508m + 16. Give i(7). -5 Let j(c) = 103c - 2677. Determine j(26). 1 Let q(m) = -m3 - 35m*2 + 71m - 147. Give q(-37). -36 Let a(w) = -210w + 1043. Determine a(5). -7 Let t(l) = -l3 + 105l + 520. Calculate t(-5). 120 Let i(s) = -2s2 - 44s + 2198. Calculate i(-46). -10 Let l(u) = -32u + 12. What is l(1)? -20 Let l(t) = 2t*2 - 20t - 178. What is l(-6)? 14 Let j(v) = 645v - 27068. Give j(42). 22 Let a(n) = 5n*2 - 29n - 28. What is a(-6)? 326 Let o(i) = 11i2 - 89i + 15. Give o(7). -69 Let p(o) = -o*3 + 43o*2 - 66o - 68. Calculate p(41). 588 Let c(g) = 22g2 + 76g - 1. Give c(-3). -31 Let k(b) = -5815b - 29058. Calculate k(-5). 17 Let y(n) = n3 - 34n*2 + 16n + 65. Calculate y(33). -496 Let h(x) = -26x3 + 2x*2 - 6x + 4. Determine h(1). -26 Let d(t) = 4t3 - 18t*2 - 3t + 8. Determine d(4). -36 Let t(s) = 26s + 322. Calculate t(-11). 36 Let g(o) = -3o*2 - 521o + 14463. Determine g(-198). 9 Let v(f) = 302f - 3025. Give v(10). -5 Let s(b) = -70b*2 + 6227b + 262. Determine s(89). -5 Let x(f) = 2f2 - 28f - 83. Give x(18). 61 Let d(a) = 29a - 85. Determine d(-4). -201 Let i(f) = 6f*3 - 38f*2 + 7f + 16. Give i(6). -14 Let u(l) = l*2 + 24l + 37. Calculate u(-18). -71 Let n(p) = -3p2 + 10p - 56. What is n(8)? -168 Let u(y) = -5y - 29. Calculate u(3). -44 Let y(q) = -q2 + 57q - 67. Give y(62). -377 Let p(w) = -2w2 - 183w + 1491. Give p(-99). 6 Let w(o) = -o*3 - 3o*2 - 12o - 51. Give w(-4). 13 Let p(w) = 5w + 347. What is p(-83)? -68 Let g(d) = 16d*2 - 205d + 442. Give g(10). -8 Let w(q) = -q*3 + 43q*2 - 102q + 812. Calculate w(41). -8 Let c(n) = n*3 - 17n*2 + 28n + 62. Determine c(15). 32 Let g(h) = -2h3 - 17h*2 + 7h - 11. What is g(-8)? -131 Let j(n) = 6n2 - 243n + 2178. Determine j(27). -9 Let k(h) = 2h3 - 11h*2 - 28h - 109. Give k(11). 914 Let t(a) = -a*2 - 27a + 23. What is t(-9)? 185 Let o(r) = -344r + 4425. Give o(13). -47 Let p(g) = -g2 + 22g + 142. Give p(-7). -61 Let k(o) = 20o - 506. Give k(15). -206 Let y(k) = k3 - 69k*2 + 57k + 749. Calculate y(68). 1 Let t(s) = -7s2 - 82s - 243. Determine t(-3). -60 Let u(s) = -s*3 + 13s*2 + 206s + 67. Determine u(-9). -5 Let r(j) = 44j + 165. Give r(-6). -99 Let z(f) = 2f*2 + 60f + 271. Give z(-24). -17 Let v(k) = -k*3 - 27k - 69. Calculate v(-2). -7 Let i(j) = 112j3 + j2 - 26j - 29. Give i(-1). -114 Let i(g) = -2g3 + 47g*2 + 19g + 123. Determine i(24). 3 Let z(f) = -91f - 1722. Calculate z(-19). 7 Let v(g) = -66g - 2260. Determine v(-34). -16 Let r(s) = -2s3 - 217s*2 - 114s - 648. Give r(-108). 0 Let u(a) = -120a + 301. What is u(5)? -299 Let h(a) = -a3 + 102a*2 + 877a + 312. Determine h(110). -18 Let o(s) = -3231s - 171254. Determine o(-53). -11 Let r(n) = -292n + 783. What is	{ "pile_set_name": "DM Mathematics" }
k + 30, 5d - 12 = 4k for d. 4 Solve -n = 3, -5n + 5704 = -5l + 5714 for l. -1 Solve 0 = -4n + 4s + 24, -n - s + 526 = 520 for n. 6 Solve 3d + 5 = -5a + 28, -3a = 4d - 49 for a. -5 Solve -4p = -11t + 59, 0 = 4p + t - 124 + 123 for p. -1 Solve -4j - 7o - 72 + 0 = 0, -o = -2j - 0o for j. -4 Solve u = 4, -2671p + 32 = -2666p + 2u - 6 for p. 6 Solve -4 = 3g + 2z + 27, -4g + z - 23 = 0 for g. -7 Solve 3 = 4g - 5t, 46g + 36t - 94 = 34t for g. 2 Solve y = 2o - 20, -20o = -18o + y + 4 for o. 4 Solve 4a - 32 = 4t, 0 = -17768a + 17769a - 5t + 1 - 25 for a. 4 Solve 15 = -11x - 29, z = -3x - 12 for z. 0 Solve 2o = -2c - 348 + 344, -5o + 26 = -4c for c. -4 Solve -5c = -2t + 2, 5t + 37c + 12 = 41c for t. -4 Solve -4 = 8y - 89l + 85l, -8 = 3y + 5l for y. -1 Solve 0 = -3j - 4z + 38, 132z - 135z = 2j - 27 for j. 6 Solve -10u + 2p - 6 = -12u, 0 = -2u + 5p + 41 for u. 8 Solve 87w - 86w = -5z - 12, -4w = -5z - 2 for w. -2 Solve 2w - 3w + 16 = -6r, -21w - 28 = -3r - 16w for r. -4 Solve 124 = i - 3v + 128, -2i + 5v - 7 = 0 for i. -1 Solve 5s + 5 = 2r, 130r - 135r - 3s + 28 = 0 for r. 5 Solve -19 = 4j + 5l - 4, -4j = -3l + 23 for j. -5 Solve -6i - 2w - 10 = 0, 2w + 2w + 20 = 0 for i. 0 Solve -5w - g = -w + 12, 4g - 9 = 3w for w. -3 Solve -13 = -2k + u, 4k - 106 = 3u - 77 for k. 5 Solve -4q - 5d = -85, 5q + 4606 - 4686 = -d for q. 15 Solve -3013 = 4x - 3s - 3027, -3x = 2s - 2 for x. 2 Solve 5k - 74 = -5u - 134, 2k + 45 = -5u for u. -7 Solve 2z - 11v - 804 = -818, 2z - 5v + 2 = 0 for z. 4 Solve -155q - 5f + 37 = -159q, -3q = -5f + 34 for q. -3 Solve -4m - 7 = -11s - 59, -3m + 39 = -2s for s. 0 Solve 782f = -3s + 778f + 32, -5s + f + 15 = 0 for s. 4 Solve 5z + 24 + 21 = 4t, 4t = -4z - 36 for z. -9 Solve -3j = d - 11, -3d - 357 + 378 = 5j for j. 3 Solve 49o - 8 = 45o, 4c - 3o - 2 = 0 for c. 2 Solve -5r = 2v - 35, 22v - 3r = 1385 - 1406 for v. 0 Solve 4g = -3i + 4, -16i + 5g = -4i - 58 for i. 4 Solve -320w + 14 = 3t - 319w, -t - 2w = -13 for t. 3 Solve 3f = -15, -8u - 2f - 4 = -11u for u. -2 Solve -g - 13 + 5 = 2i, -14g - 28 = 0 for i. -3 Solve -w + 4 = -s, -5 = 2w - s - 12 for w. 3 Solve 5m = 5k, 0 = 4m - 266k + 265k - 3 for m. 1 Solve 4v + 31 = 3m, 4v - 237m - 9 = -242m for v. -4 Solve -20 = -4w + 2x, 207 = -w + 4x + 219 for w. 4 Solve -j = -5, -o - 4j - 82 = -98 for o. -4 Solve 2j + 1 = -1, 7j + 38 = -2x + 17 for x. -7 Solve -894h - 11 = 3z - 893h, 0 = -4z + 4h - 20 for z. -4 Solve 0 = 3l - 3, 4p - 12 = 18l - 14l for p. 4 Solve i + 8 = -23576g + 23574g, -g + 5 = -4i for g. -3 Solve -5a = 3d - 8, 1966 = 4d - 3a + 1965 for d. 1 Solve 4a = -5w - 69, 5a + 83 = -107w + 104w for a. -16 Solve -50a + 61a + 37 = 2q, -q + 2a = -1 for q. -9 Solve 3a = 54i - 55i - 38, i - 46 = 4a for a. -12 Solve -3o - 10 = 2d, -2o - 5d - 4 - 32 = 0 for o. 2 Solve 31p + 3 = 30p, k = -3p - 20 for k. -11 Solve 129y - 128y + 1 = 3b, -2b - 4y - 4 = 0 for b. 0 Solve 2c = -3n - 7, 0 = -4n - 117c + 112c - 7 for n. -3 Solve 3681w - 4k = 3685w + 12, -2k = 4w + 10 for w. -2 Solve -a - 7 = -3o, -3850a + 41 = 9o - 3855a for o. -1 Solve -86m + 82m - 11 = z, -2m + 4z - 10 = 0 for m. -3 Solve -4232y + 4229y = 3f - 6, -5y = 3f - 6 for y. 0 Solve 12n - 7n + 7 = v, -3n = 3 for v. 2 Solve -q + 21 = 4z + z, z + 4q = -11 for z. 5 Solve -5y - 2 - 16 = -2m - 2, 2y = 5m - 19 for m. 3 Solve -h - 4x = 1, h + 2 + 13 = 4x + 6 for h. -5 Solve 26 = -5m - 4x, -194m - 3x + 33 = -199m for m. -6 Solve k = -3s - 419 + 454, -s + 12 = 0 for k. -1 Solve 5x - 8 = -4r, 2r = -27659x + 27655x + 10 for x. 4 Solve u - 111q + 8 = -114q, 0 = 4u + q - 1 for u. 1 Solve 30t = -25g + 35t + 40, 0 = -3g + 3t - 12 for g. 3 Solve g = -4a - 16, -842g = 2a - 837g + 26 for a. -3 Solve 5x + 103c - 15 = 98c, -5c = -15x + 45 for x. 3 Solve 41 = -3j - 5k, 1057j - 5k = 1056j - 27 for j. -17 Solve 16q - 11q = 3m - 45, 4m - 28 = 4q for q. -12 Solve 5f - v = -17, 103f = 100f - v - 7 for f. -3 Solve -5m - 701 = -5w - 756, -5m - 2w = -20 for m. 6 Solve 0 = -4d + c + 21, 4d - 1139 + 1116 = 3c for d. 5 Solve -245w = -240w + n + 22, -w + 25 = -4n for w. -3 Solve 4d + 12 = 7d, 2g + 16d = -g + 8d + 14 for g. -6 Solve 115c - 6 = 114c - 2f, -2c - 5f + 15 = 0 for c. 0 Solve -x - 1189i + 1187i - 3 = 0, -i - 7 = -5x for x. 1 Solve 0 = -6n + 5j + 24, -99j - 20 = -5n - 103j for n. 4 Solve x - 3h - 10 = 0, 343x - 2h + 2 = 338x for x. -2 Solve 4 = 10i + 24, 3s - 47 = -28i + 32i for s. 13 Solve 0 = -2v, -77v = 9d - 74v + 27 for d. -3 Solve 0 = -5d + 36w - 37w - 65, -3w + 21 = -3d for d. -12 Solve 25a + 44 = -2p, -4p + 92 - 82 = a for p. 3 Solve 41q - 40q - 4h - 12 = 0, -5q + 3h = -0 - 9 for q. 0 Solve 0 = 79c - 78c - 12y - 6, -3c - 14 = -4y for c. -6 Solve 5p = -2o + 12, 12o - 2p = 18o - 10 for o. 1 Solve -18i + 23i + 2w = -19, 0 = 4i + 3w + 18 for i. -3 Solve 5d = -y + 7, 1084 = d + 4y + 1094 for d. 2 Solve -7z - 63 = 0, 0 = 3l - 3z - 9 - 9 + 3 for l. -4 Solve 2n + 3 = 3n, 26 = -1057c + 1061c - 2n for c. 8 Solve -3f = 63n - 67n + 28, f = 5n - 24 for n. 4 Solve 23w = -2k - 67, 2w + 173k - 172k = -5 for w. -3 Solve 27c = 4k + 169, 54k + 60 = 59k + 5c for k. 5 Solve 12 = -4a - 2i, 23a - 26a - 58 = 5i for a. 4 Solve 62 = 2g - 6k, -4k - 5 - 45 = 3g for g. -2 Solve 7l + 15 = 3p + 8l, 2l = 0 for p. 5 Solve -3y - 6s = 24, y + 998 - 992 = -s for y. -4 Solve -7b - 5l = -55, -74b + 70b + 4 = -4l for b. 5 Solve 5j = 5p - 20, 48j + 24 = 45j + 6p for j. 0 Solve 15456r + 11 = y + 15453r, -4y + 16 = 2r for y. 5 Solve 3d + 890 = 2n + 900, -26 = 3d - 11n for d. 6 Solve -2p = -f - 5, -3f + 7f - 28 = -4p for p. 4 Solve 4i = x - 5, 2x = 5i + 526 - 519 for x. 1 Solve -s - 16 = 2z, 2z - 28 = -5s - 84 for s. -10 Solve 3d = -4i + 47, -4i - 8 = -4d + 8 for i. 5 Solve o - 4j - 29 = -47, -12 = -2o - 4j for o. -2 Solve 0 = -p - 3t + 8, 277 = p + 2t + 272 for p. -1 Solve -3f - 61 = x - 44, -2x - 33 = 5f for x. -14 Solve 14 = -4c - 2v, 5c - 33v - 33v + 20 = -69v for c. -1 Solve 17 = -14k - 5z, -k + 12z - 18 = 9z for k. -3 Solve -364y + 365y = 5t - 24, -2t - 5y = -15 for t. 5 Solve -2i = -4d + 22, -49i - 21 = -5d - 53i for d. 5 Solve -o = 3q + 14, q + 9o + 122 = 126 for q. -5 Solve 687d + 16 = 682d + p, 5d = 3p - 48 for d. 0 Solve 0 = 4h + 5y - 46, -4h = 48y - 46y - 16 for h. -1 Solve 195x = 191x - 5v - 17, -2x - 3v = 11 for x. 2 Solve -21 = 4n - t, 12692n - 12696n - 16 = 4t for n. -5 Solve 4o - 5i = 33, 270 = -6i + 264 for o. 7 Solve -75 = -3l + 5u, -2l + 26u - 29u - 45 = 0 for l. 0 Solve 0 = j - 4t - 1, 19562j + t - 16 = 19559j for j. 5 Solve 60o + 323 = 25o + 4u, -4o = u + 34 for o. -9 Solve 3p - 3 = -9v, 4p = 7p - v + 37 for p. -11 Solve -2w = -3v + 14, -5v + 847w + 6 = 848w for v. 2 Solve -5t = -419h + 414h + 75, -2h + 32 = -4t for h. 14 Solve 3y - 19w + 15w + 17 = 0, -6 = -4y - 9w for y. -3 Solve -673031o + 673036o - 7 = r, 2o + 3r = -4 for o. 1 Solve -2y = -20z + 110, 5z + y - 10349 + 10314 = 0 for z. 6 Solve 0 = n - 0c - c - 2, 3n - 2c - 2 = 0 for n. -2 Solve 4f + 47 = -11z, -38f + z = -36f - 9 for f. 2 Solve 4w + 5t + 70 = 0, -56w + 57w + 157 = -9t for w. 5 Solve 124c + h = 123c + 1, -c - 3h = -1 for c. 1 Solve 0 = -6981o + 6978o - 6, -14 = -g - o for g. 16 Solve -23l + t + 26 = -17l + 76, -22 = 3l + t for l. -8 Solve 110p + g = 106p, 5p - 2g = -13 for p. -1 Solve -10 + 2 = 4u, 3g = -12u + 3u - 3 for g. 5 Solve -4b - 2s = 30, -b - 6b - 50 = s for b. -7 Solve 6k - 9k + w = 0, -2k + 7w = -38 for k. -2 Solve 5c + 168k - 172k = 33, 0 = -c + k + 7 for c. 5 Solve -s + 2u + 7 = 0, 338u + 3 = -3s + 336u for s. 1 Solve 3m + j - 11 = 0, -124j - 3 - 9 = -121j for m. 5 Solve -2n + w + 7 = 0, 356w - 177w = 174w - 5 for n. 3 Solve 5v = 4s - 66 + 84 - 39, 3v = 3s - 12 for s. -1 Solve 4i = 4z - 28, -197z + 2i + 29 = -192z for z. 5 Solve 4*p + 8 =	{ "pile_set_name": "DM Mathematics" }
(s) - 5h(s). Factor m(f). -3(f - 1)(f + 1)(f + 4)*2 Suppose n + 2n - 18 = 0. Factor -5m - 3m + m + m*2 - n + 18. (m - 4)(m - 3) Suppose 11z - 60 = 6z. Suppose 9o + 6 = zo. Solve x*4 + 2x + 4x5 + 4x5 - xo - 7x5 - 3x3 = 0. -2, -1, 0, 1 Let z(w) be the first derivative of -w3/9 + 82w2/3 + 167w + 2649. Find h such that z(h) = 0. -3, 167 Let f(b) = -896b - 8947. Let x be f(-10). Solve 40p*3 - 11/4p - 13/2 + xp4 + 59/2p*2 - 5/4p*5 = 0 for p. -1, 2/5, 13 Let w(r) be the second derivative of -7r + 3/100r5 + 1/4r*4 + 4/5r*3 + 6/5r*2 - 5. Determine a, given that w(a) = 0. -2, -1 Let j(f) = 5f*4 - 90f*3 + 200f*2 + 125f + 5. Let m(p) = p4 - p3 - 1. Let x be 6/(-21) + (1 - 12/7). Let b(s) = xj(s) - 5m(s). Factor b(t). -5t(t - 5)*2(2t + 1) Suppose h + 33 = 5w + 470, 0 = w + 2h + 94. Let u be 67/98 - w/7. Factor 9k - 11k + k*3 + 37k + uk - 36 - 13k2. (k - 6)2(k - 1) Let h(j) be the first derivative of -j3 - 2j*2 + 2j - 18. Let b(s) = 4s2 + 4s - 3. Let u(q) = -2b(q) - 3h(q). Solve u(k) = 0 for k. -4, 0 Let x(k) be the first derivative of 10k5/13 - 5k*4/2 + 8k*3/13 + 44k*2/13 - 32k/13 - 747. Suppose x(d) = 0. Calculate d. -4/5, 2/5, 1, 2 Let m = -526 - -528. Solve mn + 5 + 2n - 6n - 4n + n*2 + 0 = 0 for n. 1, 5 Let p be (-1 + -7)/(2/(-4)). Suppose 5m = -1 + p. Let -5z2 + 16z*m + 8z + 214 - 4z4 - 214 - 15z*2 = 0. Calculate z. 0, 1, 2 Let u be ((-265116)/96)/(15/(-12)). Let m = 2210 - u. Factor 0 + 7/10p + 1/10p4 - mp*3 - 1/10p*2. p(p - 7)(p - 1)(p + 1)/10 Let f(d) be the second derivative of -d*5/10 + 455d4/6 + d3/3 - 455d2 - 232d + 9. Determine i, given that f(i) = 0. -1, 1, 455 Let l(c) be the third derivative of -c5/150 + c4/3 + 23c3/5 - 897c2. Suppose l(u) = 0. Calculate u. -3, 23 Let g(a) be the third derivative of -a3 + 2a2 + 3/40a*5 + 1/40a*6 + 0a - 1/140a7 - 1/4a*4 + 43. Factor g(s). -3(s - 2)*2(s + 1)*2/2 Suppose 3j + 5l = 44, 3j + 3l = -0l + 54. Let a = 23 - j. Factor 141x - 4x3 - x4 + x*3 - 137x + ax4. -x(x - 1)(x + 2)2 Let z(j) = -j3 + 7j*2 - 2j + 53. Let q be z(8). Let p be (q/(-15))/3 - (-9)/(-30). Factor 1/10u3 + 1/5u + 0 - pu2. u(u - 2)(u - 1)/10 Let m(h) be the second derivative of -h5/60 + h4/12 + 4h*3/3 + 15h*2 - 2h - 4. Let u(r) be the first derivative of m(r). Solve u(v) = 0 for v. -2, 4 Let i(o) = 33o + 7. Let w be i(2). Let a = w + -57. Determine q so that -12q*2 - 8q3 - q4 + a + 16q + 0q*4 + 5q*4 = 0. -1, 2 Factor 0 + 0j - 7j3 + 1/3j*4 + 110/3j2. j2(j - 11)(j - 10)/3 Suppose 714x = 4464x - 3284 - 4216. Suppose 27/4bx - 55/4b*3 + 0 - 1/2b = 0. What is b? 0, 1/11, 2/5 Let r(t) be the first derivative of t*3/7 + 3915t*2/7 + 5109075t/7 - 4740. Find n such that r(n) = 0. -1305 Let u(f) be the second derivative of -7f5/20 + 29f*4/12 - 37f*3/6 + 15f*2/2 + 30f. Determine r, given that u(r) = 0. 1, 15/7 Suppose -231 + 78 = -9v. Suppose 41 = 12c + v. Factor -1 + 2rc + 5/2r - 3/2r3. -(r - 2)(r + 1)(3r - 1)/2 Let y(i) be the second derivative of 7i7/18 + 973i*6/45 + 17179i*5/60 - 22289i*4/18 - 8614i*3/9 + 21316i*2/3 + 467i. Find f, given that y(f) = 0. -146/7, -1, 1, 2 Suppose 0 = 4w + 7w - 803. Solve wq - 3q*3 - 33q - 12q2 - 52q = 0 for q. -2, 0 Let f(y) be the first derivative of -1/15y6 + 12/5y + 0y3 - 8 + 11/5y*2 - 12/25y5 - y4. Suppose f(s) = 0. What is s? -3, -2, -1, 1 Let b = 3341 + -3336. Let s(g) be the first derivative of -1/6g4 - 14/9g*3 - 6g - bg2 - 4. Solve s(u) = 0. -3, -1 Let x = 70 + -68. Suppose -58o + 10 - 13 + 83o - 17 - 5o*x = 0. What is o? 1, 4 Let p(o) be the first derivative of 2o - 1/6o3 + 1/8o4 - o2 - 31. Factor p(d). (d - 2)(d - 1)(d + 2)/2 Let p(s) be the third derivative of -289/12s3 + 0s + 17/24s4 - 1/120s*5 - 2s*2 - 28. Suppose p(x) = 0. Calculate x. 17 Let d(x) = 3x*2 - 305x + 312. Let j(n) = 25n2 - 2135n + 2185. Let l(q) = 15d(q) - 2j(q). Factor l(a). -5(a - 1)(a + 62) Let q = 22560 + -22560. Let i(o) be the third derivative of -33o2 - 1/2o*4 + qo - 1/35o7 - 11/30o*6 + 0 + 0o*3 - 5/6o*5. Factor i(f). -2f(f + 1)(f + 6)(3f + 1) Let m = 134 - 132. Factor -120 - 7z2 - 1355z + 2zm + 1480z. -5(z - 24)(z - 1) Let b(j) = 4j4 - 164j*3 - 508j*2 - 8j - 4. Let h(w) = 4w4 - 162w*3 - 507w*2 - 6w - 3. Let x(k) = 3b(k) - 4h(k). Find o such that x(o) = 0. -3, 0, 42 Let p(t) be the first derivative of -2t3/33 + 51t*2/11 + 1968. Factor p(g). -2g(g - 51)/11 Let -37f - 62f2 - 78f - 3f3 + 14f*2 - 15f - 74f - 240 = 0. Calculate f. -10, -4, -2 Suppose 116248q - 9232q2 - 120856q - 961q4 - 5792q*3 - 211q*4 - 4q*5 = 0. Calculate q. -288, -2, -1, 0 Suppose 8y = -5h + 6y - 1435, 0 = -3h - y - 860. Let q be ((-19)/h)/(9/90). Find p, given that qp + 0 + 8/15p2 = 0. -5/4, 0 Let m(k) be the second derivative of 1/120k*6 + 0k*2 - 11/6k*3 - 3k + 1/2k4 - 1/10k*5 + 0. Let y(w) be the second derivative of m(w). Factor y(f). 3(f - 2)*2 Let s(u) = -8u*3 - 4u*2 + 5493u + 5496. Let l be s(-1). Factor lz2 + 1/2z*4 + 0 + 7/2z*3 + 4z. z(z + 1)(z + 2)(z + 4)/2 Factor 387096/5 - 2/5r*3 - 125984/5r - 202r2. -2(r - 3)(r + 254)2/5 Let w(z) be the second derivative of z4/20 - 24z*3/5 + 864z*2/5 + 7z - 3. Factor w(r). 3(r - 24)2/5 Let z(l) = -85l*2 - 7060l + 6995. Let w(j) = -23j2 - 1765j + 1748. Let f(y) = 15w(y) - 4z(y). Factor f(c). -5(c - 352)(c - 1) What is h in 74/3h3 + 0 - 62h*2 - 2h*4 + 18h = 0? 0, 1/3, 3, 9 Suppose 2299f + 428 = 2406f. Find v such that -6/5v2 - 6/5v*3 - 2/5v - 2/5vf + 0 = 0. -1, 0 Determine i so that 326i + 57i2 - 791 + 3i*2 - 2881i - 284 = 0. -5/12, 43 Let d(a) = 10a + 194. Let k be d(-19). Suppose 194i + k = 196i. Determine r so that -6/5r + 2/5ri + 4/5 = 0. 1, 2 Let i be (-1 + 5 + -1)10/15. Let j be 0/(i + 3 + -3). Suppose -16/11a4 - 48/11a*3 - 32/11a - 2/11a5 - 64/11a*2 + j = 0. What is a? -2, 0 Let q = 7 + -7. Suppose qr - 19 = -3u + 2r, u - 5r = 28. Factor -y2 - 4y + 6y + uy*2 - 14y. 2y(y - 6) Let p = -3412383/5 + 682501. Determine r, given that -4/5 - pr - 198/5r*3 + 324/5r2 = 0. -1/33, 2/3, 1 Let -x4 - 77584 - 3x4 + 21x*3 + 15x*3 + 2x*4 + 77968 - 186x*2 + 160x = 0. What is x? -1, 3, 8 Let q(x) be the third derivative of -7/12x5 - 115/3x3 + x2 + 0x + 815/24x*4 + 9. Factor q(r). -5(r - 23)(7r - 2) Let f(m) be the second derivative of m*4/6 - 212m*3/3 + 420m*2 + 6533m. Factor f(g). 2(g - 210)(g - 2) Let u(k) be the first derivative of -2k5/5 - 12k*4 - 78k*3 + 338k*2 - 1439. Suppose u(a) = 0. What is a? -13, 0, 2 Let g be (-48)/15(-14 - 204/(-16)). What is w in 1/4wg + 2w*3 + 25/4 - 10w + 3/2w2 = 0? -5, 1 Let z = -39 - -41. Suppose -4j = -2t + 10 - 22, -4t + 26 = zj. Factor t - 4/5x*3 + 36/5x + 12/5x2. -4(x - 5)(x + 1)2/5 Let t(g) = 34g + 183. Let u be t(-5). Let o be 3 - (2 + u/(-3))-1. Factor 2/3d*3 - od + 2/3d4 + 0 - 2/3d*2. 2d(d - 1)(d + 1)2/3 Let a(y) be the first derivative of y5/40 - 11y4/4 + 29y*3/8 + 354. Determine w, given that a(w) = 0. 0, 1, 87 Suppose -12j + 3m = -13j + 6, 4m = -12. Let z(c) be the second derivative of 0 - jc + 2/3c4 - 4c*2 - 5c*3. Factor z(y). 2(y - 4)(4y + 1) Let g(v) be the second derivative of -v*4/30 - 11v*3/15 + 522v*2/5 - 3808v. Factor g(x). -2(x - 18)(x + 29)/5 Let l(j) be the second derivative of -48j5/5 + 47j*4/3 + 2j*3/3 + 1146j + 2. Factor l(b). -4b(b - 1)(48b + 1) Let a(d) = -9d3 + 219d*2 + 456d - 3. Let f(h) = -29h3 + 656h*2 + 1368h - 10. Let t(q) = 10a(q) - 3f(q). Let t(z) = 0. Calculate z. -2, 0, 76 Let u(w) be the third derivative of w*7/525 + 2w*6 + 1825w*2. Find v, given that u(v) = 0. -600, 0 Suppose -56 + 95 = 39b. Let t be -7 + b(-249)/(-33). Factor -ti - 2/11i5 + 9/11i*4 + 14/11i*2 - 16/11i3 + 1/11. -(i - 1)4(2i - 1)/11 Let d = -690 + 691. Let j be (5 - (d	{ "pile_set_name": "DM Mathematics" }
iate a(k) with respect to k. -10k Let y(w) be the first derivative of 2w*5/5 + 2w*2 + 1. Find the second derivative of y(v) wrt v. 24v2 Let x(o) be the second derivative of -o5/20 - 2o3/3 + 4o. What is the second derivative of x(g) wrt g? -6g Let u(f) be the third derivative of -7f5/60 - f4/8 + 15f2. Find the second derivative of u(v) wrt v. -14 Let x be (-14)/(-4) - 3/6. Let u = -1 + x. What is the third derivative of 5q - 5q + uq*2 - 2q*4 wrt q? -48q Let f(q) = -q3 - q2 - 1. Let j be f(-2). Suppose 0 = -g - jg + 4. Differentiate g + y - y - y wrt y. -1 Suppose 0p = 4p. Suppose 15 = 2z + 4y + 1, p = -3z - 2y + 13. What is the derivative of -2i*2 + 3i*2 + zi*2 + 3 wrt i? 8i Find the second derivative of -12x - 19x*4 + 7x*4 + 6x*4 wrt x. -72x*2 Let d(g) be the first derivative of 0g*4 + 0g*6 + 0g - 2g3 + 0g*5 - 4 - 9/7g*7 + 0g*2. What is the third derivative of d(k) wrt k? -1080k3 Let u(x) be the third derivative of -x6/24 - 13x3/3 - 17x*2. What is the first derivative of u(v) wrt v? -15v*2 Let j(o) be the third derivative of 0 + 0o + 6o2 - 1/24o*4 + 0o*3 + 0o*5 + 1/30o*6. Find the second derivative of j(a) wrt a. 24a Let a(j) be the first derivative of 6j7 + j3/3 - 23j + 40. What is the third derivative of a(n) wrt n? 5040n3 Let i be (-15)/(-6) + (-2)/(-4). Find the third derivative of -3r2 + ri + 7r2 - 7r*3 + 2r3 wrt r. -24 Let m(n) = -n5 + 5n4 + 17n. Let o(w) = 2w4 + 9w. Let v(i) = 2m(i) - 5o(i). What is the second derivative of v(d) wrt d? -40d3 What is the derivative of 3q*2 - 2q*2 + 18q*2 - 19 wrt q? 38q Let h be (2/(-4))/1 - -1. Let x(u) be the first derivative of 1/4u4 + 0u - hu2 - 2 + 0u*3. What is the second derivative of x(a) wrt a? 6a Let j(z) = -5z2 - 3z - 2. Let u(g) = 21g2 + 11g + 9. Let p(i) = -9j(i) - 2u(i). Find the second derivative of p(r) wrt r. 6 Find the third derivative of -815 + 18y4 + 56y*2 + 815 + 58y*4 wrt y. 1824y Let d(l) be the third derivative of -l8/840 + l6/36 - 7l3/6 + 9l*2. Let w(k) be the first derivative of d(k). Find the third derivative of w(q) wrt q. -48q Let t(b) = b*3 + 6b2 + b + 8. Let p be t(-6). Let s(h) = -h2 - 7h - 1. Let o be s(-6). Differentiate -4d*2 - p + od*2 + 0d*2 wrt d. 2d Suppose 0 = -k - 1 + 3. Find the third derivative of w*2 - 2w*4 + kw*4 - 2w*5 wrt w. -120w*2 Let g(h) = 58h*3 - 7h + 64. Let l(i) = -39i3 + 5i - 43. Let m(p) = 5g(p) + 7l(p). What is the derivative of m(o) wrt o? 51o2 Let f(t) be the third derivative of t7/105 + t5/5 + 13t*2. What is the third derivative of f(k) wrt k? 48k Let n be (-3 - -5)(-9)/(-6). Let i(b) = b2 - 6b + 3. Let t be i(6). What is the second derivative of -3h2 - th*2 + 6h*2 - h + 2h*n wrt h? 12h Let g(o) = -o + 8. Let j be g(6). What is the third derivative of 5c6 + jc*2 + 5c6 + c2 - 4c6 wrt c? 720c3 Let j(g) be the second derivative of 0 - g2 + 0g4 + 0g*3 + 0g*5 + 3g - 1/15g6. Find the first derivative of j(b) wrt b. -8b*3 Let s(i) be the second derivative of 11i*6/15 + 13i*4/6 + 34i. What is the third derivative of s(w) wrt w? 528w Let j(f) be the third derivative of -f7/168 + f6/45 - 7f*3/6 + 4f2. Let s(t) be the first derivative of j(t). Find the third derivative of s(u) wrt u. -30 Let v = 8 - 4. Find the second derivative of rv + 5r - 24r*2 + 24r*2 - 3r*4 wrt r. -24r*2 Differentiate 3 + 30o*2 - 13 + 0 wrt o. 60o Suppose -w = 3i - 2w - 1, 5i - 15 = -w. Let g be (i/5)/((-1)/(-5)). Find the third derivative of -cg - c4 + c - c wrt c. -24c Let s(z) = z*4 + 3z*3 + 3z - 4. Let n(q) = -2q4 - 2q*3 - 2q + 3. Let u(d) = -3n(d) - 2s(d). Differentiate u(m) wrt m. 16m3 Suppose 9 = 2v + 5u - 43, -3u = 3v - 60. Suppose -3x - 1 = -v. What is the derivative of 2 + 5b - xb - 4b2 wrt b? -8b Let f(i) = -3i3 + 5i*2 + 5. Suppose 11 + 9 = -4p. Let u(t) = 2t3 - 5t*2 - 4. Let b(q) = pu(q) - 4f(q). Find the third derivative of b(n) wrt n. 12 Let k(c) = -54c*3 + 145c*2 - 5c + 5. Let s(r) = -27r3 + 72r*2 - 2r + 2. Let w(m) = -2k(m) + 5s(m). What is the third derivative of w(y) wrt y? -162 Let d(j) be the third derivative of -j9/63 + j5/10 - 12j2. What is the third derivative of d(q) wrt q? -960q*3 Find the third derivative of 5h2 - h2 - 2h6 + 9h6 - h2 wrt h. 840h3 Let a(m) = 5m*2. Let d be a(-1). Find the second derivative of -5w*2 + 0w*4 - w + dw*2 - 4w*4 wrt w. -48w*2 Let m(p) be the first derivative of 9p*4/2 - 7p*3 - 19. What is the third derivative of m(c) wrt c? 108 Find the third derivative of -25q2 - q4 - 10q2 - 4q*2 wrt q. -24q Let h(f) = -f*4 + 3f*2. Let z be (-2)/3(-6)/2. Let p(t) = -t*2. Let v(y) = zp(y) + h(y). What is the third derivative of v(i) wrt i? -24i Let a be (-1)/(-2)12 - 2. Differentiate -9 - 5oa + 11 - 4 - o4 wrt o. -24o*3 Let s be (-28)/402/(-14). Let r(v) be the second derivative of 2v + sv*5 + 0 + 0v*4 + 1/3v*3 + 0v*2. Find the second derivative of r(b) wrt b. 12b Suppose 2u + 9 - 9 = 0. Let r(n) be the first derivative of 0n + n*2 - 2 + 0n*3 + 1/5n*5 + un*4. Find the second derivative of r(q) wrt q. 12q*2 Let x(g) = 21g + 33. Let p(s) = -20s - 33. Let q(n) = -2p(n) - 3x(n). Find the first derivative of q(j) wrt j. -23 Let x(y) be the first derivative of -5y4/12 + y3/6 - 2y - 3. Let g(t) be the first derivative of x(t). Find the second derivative of g(s) wrt s. -10 Let j = -176 + 176. Let c(t) be the second derivative of t + j - 1/15t*6 + 0t*3 + 2t*2 + 0t*5 + 0t*4. Differentiate c(m) wrt m. -8m*3 Suppose -3 + 15 = 4s. Find the third derivative of 0ds - 6d*2 - 3d*3 + 3d2 wrt d. -18 Let i(v) be the third derivative of -v6/60 - 7v5/60 - 7v*2. Find the third derivative of i(t) wrt t. -12 Let x be (2 - -1)(1 - 0). Let r(b) = b - 3. Let t be r(x). What is the third derivative of 4p5 + 2p2 - p2 + tp2 - 5p*5 wrt p? -60p*2 Let r(n) be the second derivative of 0n*3 - n + 0 - 3n*2 + 3/10n*5 + 0n*4. What is the first derivative of r(g) wrt g? 18g*2 Differentiate 9x + 2 - 2 - 5 wrt x. 9 Let t(a) be the third derivative of 1/6a3 - 1/30a*6 + 0a + 0 + 0a4 + 5a*2 + 0a*5. What is the derivative of t(u) wrt u? -12u*2 Let d = 1 - 0. Let f be d + 2 + (1 - -2). What is the third derivative of 0r*2 + 2r - r*f - 2r + r*2 wrt r? -120r*3 Let h = -8 + 17. Differentiate -2k - hk - 6 + 2 + 2k wrt k. -9 What is the first derivative of 79c2 - 102c*2 - 4 - 10 wrt c? -46c Let u(x) = 2x2 - 31x - 2. Let s(v) = -2v2 + 32v + 3. Let z(t) = 2s(t) + 3u(t). Find the second derivative of z(m) wrt m. 4 Differentiate 0 - 4w - 6 - 2w wrt w. -6 Let a(n) = 2n3 + 3n*2 + 9. Let u(m) = 5m*3 + 5m*2 + 19. Let h(k) = 5a(k) - 3u(k). Differentiate h(c) wrt c. -15c*2 Let c be (-336)/(-154) + (-2)/11. Let y(s) be the second derivative of 0 - s + 1/3s*3 - 1/2s*c. Differentiate y(m) wrt m. 2 Let n(d) be the second derivative of -19d*5/20 - 3d*2/2 + 12d. What is the derivative of n(z) wrt z? -57z2 Let o(b) = b3 + b2 - b - 1. Let n(h) = -11h*4 + 3h*3 - 7h*2 - 3h - 3. Let q(j) = -n(j) + 3o(j). Find the third derivative of q(g) wrt g. 264g Let k(b) be the second derivative of b6/120 - b5/60 + b*3/6 + 3b. Let z(c) be the second derivative of k(c). Find the second derivative of z(h) wrt h. 6 Let i = -14 + 21. Suppose 4r - 5b = 23 + 6, -b = 1. Differentiate -r + 3t + i - t wrt t. 2 Let b(l) be the second derivative of 0l*6 + 0l*5 - 1/6l*3 + 0 + 0l*2 + 1/42l*7 + 0l*4 - 3l. Find the second derivative of b(x) wrt x. 20x3 Let l(q) be the first derivative of 12q*5/5 + 9q*3 - 11. Find the third derivative of l(p) wrt p. 288p What is the first derivative of -21 + 4090p4 + 3 - 4062p*4 wrt p? 112p*3 Let l(q) = 13q*3 + 12q*2 - 5q. Let x(y) = 14y3 + 12y*2 - 6y. Let m(o) = 6l(o) - 5x(o). Find the third derivative of m(a) wrt a. 48 Suppose -4b + 10 = b. What is the third derivative of t*4 +	{ "pile_set_name": "DM Mathematics" }
*2. Let r(h) = 165h*2 + 2h. Give r(n(t)). 1485t4 + 6t*2 Let t(x) = 1992x. Let c(o) = -2o. Calculate c(t(a)). -3984a Let i(m) = -40m2. Let z(y) = -14y*2. Give z(i(d)). -22400d4 Let h(r) = -r. Let s(x) be the third derivative of -x5/20 + 6x2. Give h(s(k)). 3k*2 Let u(b) = b. Let j(w) = 12w*2. Calculate u(j(d)). 12d*2 Let h(k) = 2k*2. Let w(x) = -x + 1. Let v be 0/7 + 2-3. Let m(b) = 4b2 + 6b - 6. Let q(z) = vw(z) - m(z). Determine q(h(u)). -16u4 Let d(n) = -n2 + 10n + 29. Let i be d(12). Let m(f) = -f + f - if + 3f. Let x(w) = w. Let z(l) = -2l. Let o(s) = 5x(s) + 5z(s). Give o(m(r)). 10r Let f(y) be the first derivative of 4y*2 + 6y - 1. Let r(o) = 23o + 17. Let v(i) = 17f(i) - 6r(i). Let c(p) = -3p. Calculate c(v(z)). 6z Let k(a) = 3a*2. Let x(l) = 887l. Determine k(x(u)). 2360307u2 Let t(a) = -2a*2. Let m(w) be the second derivative of 0 - 3w + 0w2 - 1/4w*4 + 0w*3. What is m(t(p))? -12p*4 Let s(d) = 2d*2. Let u(r) be the second derivative of 0r*2 + 0 - 10r + 0r3 + 1/3r*4. Calculate s(u(j)). 32j4 Let o(b) be the third derivative of b5/30 - 31b2. Let f(i) = -i + 2. Let p(k) = k - 3. Let n(m) = 3f(m) + 2p(m). Give o(n(g)). 2g*2 Let w(f) = -751f*2. Let y(i) = -2i. Determine y(w(z)). 1502z2 Let t(l) = -6l. Let v(q) be the first derivative of -q*3/3 - 26. What is v(t(n))? -36n*2 Let r(t) = 0t - 54t2 + 53t*2 + 0t. Let j(p) = -8p. Calculate j(r(n)). 8n2 Let h(k) = -k2. Let w be (5 - 9)6/(-8). Let n(b) = b2 + 4b - 7b + wb. Determine n(h(u)). u4 Let a(z) be the third derivative of z6/360 - z3/2 - z2. Let g(q) be the first derivative of a(q). Let l(x) = 2x. Give g(l(t)). 4t*2 Let z(u) = -240u. Let y(q) = -q*2 + 14. Give y(z(l)). -57600l*2 + 14 Let s be (-3 + 0/(-3))/(-2). Let k(y) be the first derivative of -sy*2 + 2 + 0y. Let c(b) = -b. What is c(k(l))? 3l Let d(m) = -4m + 23. Let j(n) = -n. Calculate j(d(y)). 4y - 23 Let r(v) = 6947v2. Let j(n) = -n2. Calculate j(r(p)). -48260809p4 Let x(u) = -u2 + 0 + 0. Let d(o) be the third derivative of 0o + 0 + 2o2 + 0o*3 - 1/12o*4. Give x(d(m)). -4m*2 Let m(o) = -135o. Let i(a) = -2a. Give m(i(g)). 270g Let t(f) = -23f. Let j(h) = -h - 5 + 8 - 3. Determine t(j(d)). 23d Let p(h) = -h*2 + 0h*2 + 2h*2. Let m(x) be the first derivative of 2x*3 - 7. Calculate p(m(s)). 36s*4 Let k(f) = -2f + f - 3f. Let y(o) = -o2 - 10o - 9. Let u be y(-9). Let w(t) = -t*2 + 5 - 5 + ut*2. Determine w(k(v)). -16v*2 Let w(k) = 2k2. Let b(a) = -a2. Let u(h) = 8b(h) + 5w(h). Let f(i) = 14i. What is u(f(x))? 392x*2 Let b(u) = -u. Let i(z) be the third derivative of -17z*4/24 - 2z*2. What is i(b(p))? 17p Let u(c) = c - 1. Let b(g) = -21g + 18. Let l(m) = -b(m) - 18u(m). Let t(n) = n + 0 + 0. What is t(l(p))? 3p Let q(j) be the first derivative of j3/3 - 20. Let b(u) = 12u. What is b(q(i))? 12i2 Let i(g) = 5783g*2. Let y(p) = 2p*2. What is i(y(c))? 23132c*4 Let r(x) = -3x*2. Let c be ((-1)/3)/((-2)/78). Let a be (-4)/(-6)156/8. Let b(d) = -d*2 - ad + cd. Give b(r(z)). -9z*4 Let x(r) be the first derivative of 55r*2/2 + 20. Let u(q) = 2q. Calculate x(u(h)). 110h Let m(g) = -4245g. Let p(x) = x*2. Calculate p(m(i)). 18020025i2 Let m(c) = -c2 - 5c + 5. Let a(b) = 17 + b - 18 + 0b. Let w(z) = -10a(z) - 2m(z). Let u(d) = -5d2 + 2d - 2d. Determine u(w(q)). -20q4 Let p(r) = -r2. Let s(i) be the third derivative of -i*4/24 + 10i2. Determine p(s(j)). -j2 Let b(f) be the third derivative of f5/20 - f2. Let i(c) = 4c2. Let r(p) = -14p*2. Let n(l) = -10i(l) - 3r(l). Calculate n(b(v)). 18v*4 Let x(q) = -q + 14. Let w be x(12). Let l(c) = -wc + 2c - 3c. Let z(u) = u*2. What is z(l(s))? 9s*2 Let m(t) = t. Let v(r) = -10r. Let k(i) = -i. Let y(d) = 6k(d) - v(d). Calculate y(m(w)). 4w Let g = 2 - 1. Let v(p) = 1 - g + 2p2. Let b(s) = -3 + 3 + 2672s*2 - 2669s*2. Give b(v(u)). 12u*4 Let f(p) = -4140p. Let d(w) = w. Calculate d(f(x)). -4140x Let g(c) = -3c2. Let k(y) = -y2 + 135y. Determine k(g(b)). -9b*4 - 405b*2 Suppose 0 = -2v - 1 + 5. Let z(c) = 3 - 3 - vc. Let x(h) = 3h*2 - 5h. Let d(m) = 4m2 - 6m. Let b(s) = 5d(s) - 6x(s). Calculate z(b(w)). -4w2 Let d(l) = 5l. Let w(u) = -u + 1. Let o(x) = 2x2 + 5x - 5. Suppose 2a = 3a - 10. Let k(p) = aw(p) + 2o(p). Calculate d(k(q)). 20q2 Let n(s) = 3s2. Let d(f) be the first derivative of -f3 - 5. Determine n(d(j)). 27j4 Let z(y) = -4y*2. Let k(q) = 5q + 1. Calculate k(z(o)). -20o2 + 1 Let a(s) be the second derivative of 11s*4/12 - 38s. Let y(r) = 5r. What is y(a(z))? 55z*2 Let g(p) = 2p*2. Let n(x) = -6x + 6x - 2x. Calculate g(n(z)). 8z2 Let q(t) = t2 + 6t. Let l(x) = x*2 + 7x. Suppose -r - 5 = 1. Let k(i) = rl(i) + 7q(i). Let y(w) = -w*2 + 4w*2 + 0w*2. Calculate y(k(z)). 3z*4 Let o(v) = 3v*2 - 7v + 7. Let d(w) = w*2 - 3w + 3. Let k(f) = 7d(f) - 3o(f). Let c(i) = 22i. Determine c(k(g)). -44g*2 Let x(s) = 3s + 5s + 4s + 0s. Let a(f) = -f. Determine a(x(v)). -12v Let h(u) = -5u2. Let b(v) = 46v. Give b(h(m)). -230m2 Let y(d) = 7d. Let b(f) = 7f. Let i(x) = -6b(x) + 7y(x). Let w(h) = -5h. Calculate w(i(t)). -35t Let o(c) = 12c + 2. Let m(f) = 47f + 9. Let k(i) = -4m(i) + 18o(i). Let z(p) = -p2. Calculate k(z(a)). -28a*2 Let y(n) = -3n*2 - 5n. Let r(m) = 2m2 + 4m. Let j(s) = 5r(s) + 4y(s). Let f(g) be the third derivative of -g*4/3 - 26g*2. What is j(f(k))? -128k*2 Let g(t) = 2t. Let i(d) be the third derivative of d5/60 + d3/2 + d*2. Let s(b) be the first derivative of i(b). Determine s(g(k)). 4k Let f(b) be the third derivative of -b*5/60 + 4b*2. Let w(g) = 2g. What is w(f(v))? -2v2 Let r = -9 - -15. Suppose -9m + 12 = -rm. Let w(z) = -4 - mz + 3 + 1. Let u(a) = -2a2. Give u(w(h)). -32h*2 Let x(v) = -14v*2. Let q(g) = 11g. Calculate x(q(d)). -1694d2 Let a(y) = -25y*2 + 43y*2 - 25y*2. Let v(x) = -2x*2 - 2x - 2. Let w(j) = -j - 1. Let p(o) = v(o) - 2w(o). Calculate a(p(g)). -28g*4 Let a(z) = -10z. Let x(q) = q. Let h(d) = -a(d) - 12x(d). Let p(o) be the first derivative of 2o*3/3 + 1. What is p(h(g))? 8g*2 Let d(g) = 2 - 2 + 29649g - 29648g. Let c(p) be the second derivative of p3/2 - p. Give d(c(f)). 3f Let f(d) = 1. Let q(j) = -2j - 6. Let b(l) = -6f(l) - q(l). Let u(n) = 15n2 + 11. Let g(m) = -4m*2 - 3. Let x(o) = 22g(o) + 6u(o). Give b(x(t)). 4t*2 Let q(n) = -2n*2. Let v(b) = 5b. Let w(a) = -14a. Let u = 3 - -14. Let o(c) = uv(c) + 6w(c). Determine o(q(z)). -2z*2 Let x(c) = 56c - 12c - 22c. Let r(f) = -2f2. What is r(x(k))? -968k*2 Let o(h) = -h. Let b be 2/(-4)(-15 - 1). Let y = b - 6. Let p(c) = c*2 + 4c*2 - 5c*2 - 5c*y. Calculate p(o(l)). -5l2 Let m(b) be the third derivative of -b5/60 + 22b2. Let x(t) be the first derivative of 2t*3/3 - 1. Calculate x(m(z)). 2z*4 Let l(s) = -8s*2. Let u(r) = r. Calculate u(l(q)). -8q*2 Let n(d) = -5d*2. Suppose 2q + 4 + 4 = 2p, 4p + 2q = 16. Let z = 6 - p. Let m(g) = -gz - 1 + 1. Determine m(n(f)). -25f*4 Let q(o) = 5o. Let p(a) = 56a. Give p(q(w)). 280w Let q(h) = 4h - 272. Let n(v) = 2v. Calculate q(n(s)). 8s - 272 Let y(w) = 2w2. Let b(d) be the first derivative of -d2 - 18. Calculate b(y(u)). -4u2 Let u(l) = -5l*2. Let b(w) = 13w + 5. Let x(f) = 72f + 28. Let k(c) = -28b(c) + 5x(c). What is u(k(h))? -80h*2 Let x(f) = 5f*2 - 6f + 6. Let g(d) = -11d2 + 13d - 13. Let b(m) = -6g(m) - 13x(m). Let u(l) = -13l. Give u(b(n)). -13n2 Let a(m) be the second derivative of -m3/6 + 16m. Let f(g) = 2g*2. What is a(f(u))? -2u*2 Let h(k) = -4998k. Let b(n) = -n*2. Give b(h(p)). -24980004p*2 Let y(c) = 1383c*2. Let r(l) = 13l. Determine r(y(s)). 17979s2 Let u(m) = 2m. Let w(h) = h*2 - h - 3. Let c be w(3). Suppose 5b + 2v - 13 = -v, 2v + 8 = 5b. Let t(i) = bi + 2i - ci. Determine t(u(n)). 2n Let i(k) = -2k*2. Let x(m) = 29m*2. What is i(x(f))? -1682f*4 Let v(x) = -7x + 5. Let a(h) = -10*h + 7. S	{ "pile_set_name": "DM Mathematics" }
in 43, 59, 77, 97? 119 What is the next term in 618, 599, 576, 555, 542? 543 What comes next: -620, -1239, -1860, -2483? -3108 What comes next: 30, 45, 68, 105, 162, 245, 360? 513 What is next in -196, -771, -1728, -3067? -4788 What comes next: -151, -155, -161, -169, -179, -191? -205 What is next in -12, -52, -118, -210, -328, -472? -642 What comes next: -58, -113, -168? -223 What is the next term in 72, 278, 620, 1098, 1712, 2462? 3348 What is next in -1907, -3818, -5729? -7640 What comes next: -102, -94, -82, -66, -46, -22? 6 What comes next: 1965, 1967, 1969, 1971, 1973, 1975? 1977 What is next in -4638, -9279, -13920, -18561, -23202, -27843? -32484 What is the next term in -337, -679, -1021, -1363? -1705 What comes next: -3, -9, -17, -27, -39, -53? -69 What comes next: 41, 35, 15, -25, -91, -189, -325? -505 What is next in -41, -48, -55, -62, -69? -76 What comes next: -82, -209, -554, -1225, -2330? -3977 What is next in -102, -206, -314, -426? -542 What comes next: -121, -218, -315, -412? -509 What is the next term in 47, 35, 17, -7? -37 What is next in -10, -63, -172, -349, -606? -955 What comes next: -1, -2, 1, 14, 43, 94, 173, 286? 439 What is next in -214, -217, -230, -259, -310? -389 What is next in 305, 306, 305, 302, 297, 290? 281 What is the next term in 4775, 4776, 4777? 4778 What is next in 18, 15, 0, -27, -66, -117? -180 What is the next term in 2, -4, -14, -28, -46? -68 What is the next term in -20, -40, -60? -80 What is the next term in 182, 365, 548? 731 What comes next: 1183, 2349, 3515, 4681, 5847, 7013? 8179 What is the next term in 409, 1613, 3629, 6463, 10121, 14609, 19933? 26099 What is next in 602, 616, 642, 686, 754, 852, 986, 1162? 1386 What is next in -300, -334, -368, -402, -436? -470 What is the next term in -286, -521, -748, -961, -1154, -1321, -1456, -1553? -1606 What is next in 257, 243, 219, 185? 141 What comes next: -5, -3, -1, 1? 3 What is the next term in 40, 114, 236, 406, 624, 890? 1204 What is the next term in -61, -89, -137, -205, -293, -401, -529? -677 What is next in -8024, -16046, -24068, -32090, -40112? -48134 What is next in -14312, -28621, -42930, -57239, -71548? -85857 What comes next: 262, 249, 212, 139, 18, -163, -416, -753? -1186 What comes next: -36949, -36951, -36953? -36955 What is the next term in 3334, 3337, 3340, 3343, 3346? 3349 What is the next term in 124, 73, -18, -155, -344, -591? -902 What is the next term in -6537, -6543, -6549? -6555 What comes next: 16, 49, 108, 205, 352? 561 What is next in 21, 35, 49? 63 What comes next: -71, -85, -99, -113, -127, -141? -155 What is next in 57, 56, 55, 54, 53, 52? 51 What is next in 23, 52, 103, 176, 271? 388 What comes next: -105, -101, -97? -93 What comes next: -876, -1711, -2546, -3381, -4216? -5051 What is the next term in 27, 55, 83? 111 What is next in 502, 493, 476, 451, 418? 377 What is next in 135, 136, 139, 144, 151? 160 What is the next term in 13, 78, 187, 340, 537? 778 What is next in 2913, 2914, 2915, 2916? 2917 What is the next term in -12, -17, -18, -9, 16, 63? 138 What is the next term in -92, -187, -274, -353, -424, -487, -542? -589 What is the next term in 787, 796, 805? 814 What is the next term in -13, -19, -27, -37, -49, -63, -79? -97 What is next in -4, -20, -52, -106, -188, -304, -460, -662? -916 What is next in -112, -107, -100, -91? -80 What is next in -25, -39, -41, -25, 15, 85? 191 What is next in 241, 251, 269, 301, 353, 431, 541, 689? 881 What comes next: 24, 41, 64, 99, 152, 229? 336 What is next in 260, 243, 208, 149, 60, -65? -232 What is next in -1115, -2226, -3337, -4448? -5559 What comes next: -94, -97, -102, -109, -118, -129? -142 What is next in -1451, -1450, -1449? -1448 What is the next term in 65, 42, -25, -160, -387, -730? -1213 What is next in -21, -35, -57, -87, -125, -171, -225? -287 What comes next: 6, -27, -74, -129, -186, -239? -282 What is the next term in 229, 244, 259, 274, 289? 304 What is the next term in -59, -94, -123, -140, -139, -114, -59? 32 What is next in -356, -720, -1088, -1460, -1836, -2216, -2600? -2988 What is next in 52, 91, 130, 169, 208? 247 What is the next term in -70, -82, -94, -106, -118? -130 What is next in 659, 657, 653, 647, 639, 629, 617? 603 What comes next: 15, 50, 85, 114, 131, 130, 105? 50 What is the next term in 2239, 2231, 2219, 2203? 2183 What is the next term in -133, -254, -375, -496? -617 What is next in 85, 71, 49, 19? -19 What comes next: -111, -109, -107? -105 What is the next term in -80, -64, -22, 58, 188, 380, 646? 998 What comes next: 24, 33, 46, 63, 84? 109 What is next in 312, 314, 318, 324, 332, 342, 354? 368 What is the next term in 82, 165, 246, 325, 402, 477? 550 What is next in 1415, 2829, 4243, 5657? 7071 What is the next term in 7, 7, 13, 25, 43? 67 What is the next term in -53, -35, -5, 37, 91? 157 What comes next: -127, -177, -229, -283, -339, -397? -457 What comes next: 1, -4, -7, -8, -7? -4 What is the next term in -87, -340, -763, -1356, -2119, -3052, -4155? -5428 What is next in -53, -418, -1407, -3332, -6505, -11238? -17843 What comes next: -1223, -1221, -1219? -1217 What comes next: 5, 21, 53, 107, 189, 305, 461? 663 What comes next: -4744, -9502, -14262, -19024, -23788? -28554 What is the next term in 166, 154, 130, 88, 22, -74, -206, -380? -602 What is next in 194, 386, 578, 770, 962? 1154 What is next in 133, 261, 389? 517 What is the next term in -53, -113, -177, -245, -317, -393? -473 What is the next term in -15, -12, -9? -6 What comes next: 475, 949, 1423, 1897? 2371 What comes next: 11, 3, -23, -79, -177, -329, -547, -843? -1229 What is the next term in -143, -293, -447, -605, -767? -933 What is next in -210, -406, -602, -798? -994 What comes next: -19824, -39642, -59462, -79284, -99108, -118934? -138762 What comes next: -19, -18, -27, -52, -99, -174? -283 What comes next: -510, -512, -514, -516, -518? -520 What comes next: -62, -48, -46, -62, -102, -172? -278 What is next in 5, -69, -143, -217? -291 What comes next: -408, -817, -1226? -1635 What comes next: 4, -11, -28, -47, -68? -91 What comes next: 36, 46, 62, 84, 112? 146 What is next in -290, -292, -294, -296? -298 What comes next: 201, 220, 213, 168, 73, -84? -315 What is the next term in 9, 27, 55, 93, 141, 199? 267 What is next in -980, -978, -976, -974, -972, -970? -968 What comes next: -14, -39, -76, -125, -186? -259 What comes next: -30, -17, -4, 9? 22 What comes next: -77, -64, -61, -74, -109, -172, -269? -406 What comes next: -572, -647, -778, -971, -1232, -1567? -1982 What is the next term in -1224, -1221, -1206, -1173, -1116, -1029, -906? -741 What is next in 196, 391, 586, 781? 976 What is the next term in 605, 1210, 1815, 2420, 3025? 3630 What is the next term in 1, -17, -71, -179, -359? -629 What is next in 1458, 5823, 13100, 23289, 36390, 52403? 71328 What comes next: -399, -716, -1045, -1392, -1763, -2164, -2601, -3080? -3607 What is next in -8, -25, -58, -113, -196? -313 What is the next term in -545, -546, -547, -548? -549 What is the next term in 1180, 2361, 3552, 4759, 5988, 7245? 8536 What comes next: -229, -460, -693, -928? -1165 What comes next: 90, 97, 114, 147, 202, 285, 402? 559 What is the next term in 1470, 2937, 4400, 5859, 7314, 8765? 10212 What is next in 21, 19, 7, -21, -71, -149? -261 What is next in 14265, 14260, 14251, 14238? 14221 What is next in 119, 248, 413, 620, 875? 1184 What is next in -18748, -18744, -18730, -18700, -18648, -18568, -18454? -18300 What is next in 168, 308, 446, 582, 716, 848? 978 What is next in -12, -40, -68, -96, -124? -152 What comes next: 9, 80, 185, 318, 473, 644? 825 What comes next: 88, 348, 782, 1390? 2172 What comes next: 127, 131, 125, 103, 59, -13, -119, -265? -457 What is next in 632, 1257, 1882, 2507? 3132 What is the next term in -22, -103, -240, -433? -682 What is next in 16, 59, 130, 229, 356, 511, 694? 905 What is next in 709, 708, 707, 706, 705? 704 What is next in 7, 9, 9, 7, 3, -3? -11 What is the next term in -240, -232, -222, -210? -196 What comes next: -16, -24, -32? -40 What is next in -161, -326, -493, -662, -833, -1006, -1181? -1358 What is next in 1119, 1122, 1123, 1122? 1119 What is the next term in 11, 2, -9, -22, -37, -54, -73? -94 What is the next term in -93, -211, -329? -447	{ "pile_set_name": "DM Mathematics" }
smaller: i or -1? -1 Let x be 9/(2 + (-7)/2). Let g be ((-30)/(-20))/(x/(-40)). Suppose -gm = -6m. Which is smaller: -1/9 or m? -1/9 Let u = -196.8 - -138.8. Is u equal to -2/3? False Suppose 67w - 46683 = 10w. Is 817 bigger than w? False Let y = -32 + 54. Suppose -y = 5n + 18. Which is smaller: -6 or n? n Let p = 13.1 - 16.1. Is p bigger than 0.0216? False Let f = 0 - -3. Suppose 0 = -5g + 15 - 10. Which is greater: g or f? f Let l(r) = r*2 + 6r - 15. Let b be l(2). Which is smaller: -10.2 or b? -10.2 Let c = 96 + -98. Are 6 and c nonequal? True Let n be (1 - 3)177/(-6) - -1. Let o be (-2)/n(8 - 4). Suppose -4f + 6 = 2t - 12, 9 = -4t + f. Is o bigger than t? True Let t = -48 + 47. Suppose -11y + 10y = 0. Which is greater: y or t? y Suppose -2i + 6 = -0i. Suppose -5a + 2a = -5r - 13, -2a - i = -r. Let d(t) = -10t + 26. Let c be d(3). Is a < c? False Let i be (-1005)/(-8104) + (-20 - 1590/(-80)). Which is smaller: i or -1? -1 Let a be 38/8 - (-1)/4. Let z(o) = -o - 1. Let g be z(a). Let m = 34.4 - 33.4. Do g and m have the same value? False Let s be 165/(-1)(-30)/50. Let z = s + -162. Let u = 129/2 + z. Is 2 smaller than u? False Let j = -74 + 39. Let s be -39 - -2 - (7 - 12 - -4). Is s greater than j? False Suppose 2c = 4c - 14. Let t(h) = -1. Let i(x) = x2 - 8x + 11. Let m(f) = i(f) + 4t(f). Let z be m(c). Which is greater: z or -1/8? z Suppose -5h + 4a = 8, 4 = 2h - 0a + 2a. Suppose h = x + x - 2. Let v be ((-2)/46)/(4 - 0 - 3). Are x and v equal? False Let a(p) = p*2 + 3p + 6. Let b be a(-4). Let o = 7 - b. Let w be 42/(-2) - o. Is w greater than 2/49? False Let w = 72772/1067 + -750/11. Let v = 204/485 - w. Are -1/7 and v nonequal? True Let z = 0.92 + 1.08. Let s = -11 - z. Is s equal to 1? False Let k = -127 - -68. Which is greater: k or -61? k Let o be (2/(-3))/((-17)/(-12)). Suppose 10q + 53q = -24q + 19q. Is o equal to q? False Let h be 42/(-15)-2(-22)/(-32). Let c = h + -18/5. Which is bigger: -23 or c? c Let w = 65 + -190/3. Let g = 19/15 - w. Let u(t) = -t3 - t2 - 2t + 1. Let f be u(-2). Is g equal to f? False Let b = 9/707 + -218499/2828. Which is smaller: b or -77? b Let m(t) = -2t2 - 5t + 1. Suppose 17 = 3z - 10. Let q be ((-5)/(-2))/(z/(-18)). Let d be m(q). Are d and -24 equal? True Let h(p) = 2p*3 + 44p*2 + 43p + 13. Let j be h(-21). Let t = -9 + 15. Suppose -2z - 10 = t. Does j = z? True Let n = -1174 + 614. Let t = 19603/35 + n. Is t != 1? True Suppose 2y + 0 = -6. Let z be -3 - ((-9)/y)/18. Let x = -143/48 - z. Which is smaller: x or 1? x Suppose 2 + 7 = -3y. Let m = -9 - y. Let t = m - -7. Which is bigger: 0 or t? t Let a be 2/2(7 - 8). Let y be (244/(-84))/a + -3. Let u be 3((-2)/(-6) + 0). Which is bigger: u or y? u Let m be ((-78)/65)/(3/10). Let p be (m/14)/(12/35). Which is greater: p or -2? p Let t(x) = 29 - 6x - 7x + 18x. Let z be t(-6). Is 1/30 at most z? False Let n be (-40)/(-22) + -2 - (-26622)/156948. Do 0 and n have the same value? False Let t be 45(272/(-51))/16. Suppose -w = w + 28. Is t < w? True Let x(z) = -z3 + 7z*2 + 2z - 9. Let f be x(7). Let m(h) = -4h + 21. Let b be m(4). Is f smaller than b? False Let p(y) = y + 3. Suppose -2g = 2, 5g + 5 - 4 = -2s. Let f be p(s). Which is smaller: 4 or f? 4 Let s = -13 + 14. Suppose 0 = -6l - 5 - s. Which is bigger: 1 or l? 1 Let l = 0.655 - 16.655. Is l equal to -8/7? False Let v be (16/(-6))/(-3 - 44/(-12)). Let c(r) = 6 - 2r + 4r + 2. Let z be c(v). Which is bigger: 2 or z? 2 Let c be (-7 + -7 + 13)/(1/(-96)). Which is smaller: 95 or c? 95 Let t = 9.181 - 9.2. Let q = t + -0.081. Are q and -7 equal? False Let a(r) be the first derivative of -r3/3 - 7r*2/2 - 1. Let q = 345 - 350. Let b be a(q). Is 11 less than or equal to b? False Let d be (-16)/60-5110. Which is smaller: 0.1 or d? 0.1 Let p be (0 + -46)3(-40)/156. Which is smaller: 34 or p? 34 Suppose 0 = -4a + 3d + 36, 0 = -3d. Suppose 0 = -3w + a, 12 = q + 5w - 0w. Let k be (5/10)/(8/q). Which is bigger: k or -1? k Let i = -10 - -8. Suppose 31 = -5q - 0v + v, -32 = 4q + v. Let u = -8 - q. Which is smaller: i or u? i Suppose 9m - 4m = -5. Let t be 2 - 4359/24 - -2. Let c = -178 - t. Is c >= m? True Let x be ((-116)/(-5) - 0)/((-4)/(-10)). Let p = -1159/20 + x. Which is greater: p or 1? 1 Let d(i) = -2i2 + 34i - 35. Let l be d(19). Which is smaller: l or -112? -112 Let q = 1076 - 1104. Is 2/7 < q? False Suppose -5x - 35 = 5o, -2x - 12 = 3o + 11. Is o not equal to -7? True Let l = 31175/23 - 1355. Which is smaller: l or 2/7? 2/7 Let a = 17369119/88 + -197374. Let g be 10/(-16) - (1 - -1). Let b = g + a. Does b = -1? False Let z = -617971/5204 + 475/4. Do z and -1 have the same value? False Let v = 2/129 + 248/645. Suppose 0c + 4c - 53 = 5q, 0 = 5c - 3q - 63. Let u be (28/c)/7-3. Is v not equal to u? True Suppose 3g - 7g = 2w - 2376, 4g - 2378 = -w. Which is smaller: g or 597? g Suppose -4m + k - 90 = 0, -2m + 16k = 11k + 54. Is -10 greater than m? True Let s(m) = -m*3 + 17m*2 + 48m - 34. Let h be s(19). Is 0 greater than or equal to h? False Suppose 0m + 5m = -80. Let j(d) = -2d - 8. Let k be j(4). Let q = k - 1. Is q at most as big as m? True Let r(s) = -2s*2 - 2 + 3s + 1 + 0 + 4s2. Let n be r(-2). Are -44 and n non-equal? True Let f = -2090/9 - -24944/63. Let w = -164 + f. Is -5/3 <= w? True Let i be (-534)/78 + 2/(-13). Let g be (-54)/(-63) - (1/i - 0). Is g != -3? True Let s be (-44)/(-8)2 + 5. Is 46/3 smaller than s? True Let z = 1085 + -1078. Is 6 at least as big as z? False Let s = -0.659 + -0.011. Let k = s - -0.59. Which is smaller: -4 or k? -4 Let f be (5 - (-357)/(-72))-4006. Suppose -d = -93 - 74. Let i = d + f. Is -1 less than or equal to i? True Let z = 151/35 + -26/7. Let s = -1466 - -1466.989. Let o = -0.011 - s. Is o less than z? True Let f be -4 + 2 + -120(-4)/12. Is f less than or equal to 29? False Let v(o) = o*2 + 9o - 10. Let x be v(-10). Are -2/1389 and x non-equal? True Let z = 132 - 130. Let o be (4z/10)/((-6)/45). Is -11 at least as big as o? False Let u be (-66)/(-170) - 6/(-30). Which is greater: 0.1 or u? u Let g be 8/46/(-4) - -11. Let u be (20/g - 4)(-16)/(-6). Let d be (-13)/4 - (-3)/(-6). Is d > u? True Let h be 7/420(-4)/(-8). Is h <= 1? True Let t = -0.42 - -9.12. Let j = -0.023 + 9.023. Let b = j - t. Are -4 and b nonequal? True Let g be (-2)/3(-2 - (-29817)/18). Is g > -1102? False Let v(b) = -4b*2 - 22b - 49. Let t be v(-5). Which is smaller: t or -42? -42 Let k = 28 + -15. Let s = k + -31. Let h = 37 + s. Which is bigger: -2/3 or h? h Suppose -3m - 2m - 5 = 0. Suppose 5f + 200 = -5b, f - b + 14 = -22. Let j = -35 - f. Which is smaller: m or j? m Suppose -3g = -2g - 28. Let a be (-3)/(-6)g/10. Is a less than or equal to 1? False Let p = -6532/651 - -208/21. Is -3 at least p? False Suppose 286 = 24s + 2s. Is 14 >= s? True Let x = -49 + 49.1. Let m = -34 + 16. Which is greater: x or m? x Let u = -9187/16 + 574. Let c(m) = -m3 - 12m*2 - 10m + 10. Let v be c(-11). Do v and u have the same value? False Suppose -f + 3w + 9 = 0, 4f - 8 + 5 = w. Suppose -4h = -x, f = -7x + 2x + h. Is x not equal to -1? True Suppose -3b - f = -6f - 236, 5b + f - 412 = 0. Let g be (-15)/(-24)b - 2/8. Is g != 50? True Let k(p) = -4p - 1. Suppose 0 = -4t - 4g - 24, 7 = -2t - g - 0g. Let j be k(t). Let w be 1(-13 + j/(-1)). Does w = -17? False Let h = -2.05 + 0.05. Let q be (-1 + 14/10)/(2/30). Let g be q/(-72) - 2/(-6). Is h at least as big as g? False Suppose -4f - 18 = -x, 0x - 2x + 64 = -f. Let r = x - 28. Suppose rz - 4z = 10. Do z and 3 have the same value? False Suppose -j - 10 = 4h, 0h + 5h + 9 = -j. Which is smaller: j or -10? j Let j = -106 - -54. Let h = 52 + j. Which is smaller: h or 2/15? h Let z(g) = -g2 + 6g + 3. Let q be z(6). Suppose -4a + 3a = 5b - 7, 0 = -3b + qa - 3. Which is bigger: 8 or b? 8 Suppose z = -5v + v + 21, 2z - 2 = 2v. Let a be v/321/(-14). Let o be 42/110 - a/(-10). Which is greater: 0 or o? o Let u = 1.5 - 3.9. Let o = u - -3.4. Is o at least as big as 0? True Let s(r) = -6r*2 + 7r + 3. Let t(o) = o*2 + o. Let y(f) = s(f) + 5t(f). Let m be y(12). Let z be -2 - ((m - 4) +	{ "pile_set_name": "DM Mathematics" }
/12 + m3/2 - m2 - 247m - 2. Determine j(-2). 4 Let t(k) = -2k3 + k3 + 1679k + 9k*2 + 9 - 1691k. Give t(7). 23 Let w = 374 - 381. Let z(u) = -3u - 15. Determine z(w). 6 Let h = 273 - 285. Let g(r) = r3 + 12r*2 + r + 14. What is g(h)? 2 Suppose 0 = -4u + 191 - 123. Suppose 5p + s + 36 = 0, -u = 2p - 0p + 3s. Let v(h) = -h*2 - 7h + 6. What is v(p)? 6 Suppose -10 = -4x - r, 2x - 5r - 1 = 15. Let n(t) = -2 + 3 - 1 - 2 + xt. Let v be (-4)/312/8. Determine n(v). -8 Let d(o) = -852 + 850 + 10o - 13o2 + o3 + 4o2. What is d(8)? 14 Let s(g) = g3 + 6g2 + 4g. Suppose o - 4 = -2. Suppose 5b = -3z - 37, 0b - oz = -2b - 2. Determine s(b). 5 Let i(q) be the third derivative of 7q5/60 - q3/6 - q*2 + 71. Calculate i(-1). 6 Let l(r) = 2r*2 - 3r - 5. Let b(f) = -3f2 + 2f + 7. Let v(p) = 3b(p) + 4l(p). What is v(-9)? -26 Let i(y) be the second derivative of -2y4/3 - y3/6 - y + 1. Calculate i(-1). -7 Let v(n) = -n2 + 8n - 3. Let d(c) = 15c - 15. Let r(f) = 7f - 7. Let k(a) = 6d(a) - 13r(a). Let q be k(-12). Let g = q + -8. Give v(g). 12 Suppose v + 5b + 22 = 0, -15b = 4v - 17b + 22. Let g(u) = -2u - 5. Calculate g(v). 9 Let d be (2 + 0/(-5))/((-2)/(-11)). Let v(c) = 3 - 6c*2 - 4 + dc*2 - 2c. Determine v(2). 15 Let j be (-1)/(-2) - (-5)/(-10). Let i(u) = 3 - 3u + j - 4. Suppose 7 - 1 = 3g. Give i(g). -7 Let n(i) = -14 - i*3 - 17 - 16 - 6i + 40 - 2i2 - 4i*2. Calculate n(-5). -2 Let j(s) = -4s*2 + 2s + 1. Suppose -4u + 6 + 7 = -5x, -x = u - 1. Suppose 0 = -5w - 5m + 20, -uw + 11m - 8m - 2 = 0. Give j(w). -11 Let l(v) be the first derivative of 7 + 30 - 4 + 0v*2 - 3v2. Calculate l(-1). 6 Let h(m) = -m2 - 2m + 5. Suppose -17b + 172 = 104. Give h(b). -19 Let q(h) = 13h + 10h - 26h + 5h. Determine q(-3). -6 Let n(v) = 10v - 12. Let z = 9 - 7. Let x(o) = -o + 1. Let w(r) = zn(r) + 18x(r). Calculate w(4). 2 Let v(k) be the first derivative of k6/360 + k5/40 - k4/6 - 34k3/3 - 32. Let f(n) be the third derivative of v(n). Determine f(-5). 6 Let k(a) = -a2 - 3a + 4. Suppose -424 = -2z - 432. Give k(z). 0 Suppose 5w + 50 - 45 = 0. Let r(y) = 3y*3 + 1. Calculate r(w). -2 Let v(q) = 17q - 631 + q*3 + 15q*2 + 343 + 322. Give v(-14). -8 Let i(y) = -2y3 + y2 - 1. Let o be ((-2)/12)/((-5)/30)-1. Give i(o). 2 Let q(v) = v3 + 11v*2 - 12v + 2. Suppose -2c + 84 = -9c. What is q(c)? 2 Let d(y) = -39y3 - 4y*2 - 2y. Let t be d(-2). Let l = -450 + 452. Let g be l/(-12) + t/72. Let v(w) = w*3 - 3w*2 - 2w - 5. Calculate v(g). 3 Let g(m) = -m*2 - 57m - 209. Let a be g(-4). Let x(p) = -p*3 + 2p*2 + 3p - 7. What is x(a)? -7 Let y(r) = -r + 14. Let j = 438 + -432. Give y(j). 8 Let d(a) = 32a - 4. Let k(z) = -35z + 5. Let l(i) = 5d(i) + 4k(i). What is l(-1)? -20 Let w(l) = -7l - 3l - 2l + 9l - 6l. Determine w(-1). 9 Let r(y) = -3y*3 + 18y*2 + 41y - 4. Let v(m) = -m*3 + 6m*2 + 14m - 1. Let j(l) = -6r(l) + 17v(l). Give j(7). 0 Suppose -8n + 5n + 9 = 0. Let a be (-2)/n - (-4)/(-12). Let t(i) be the second derivative of -2i4/3 - i3/6 - i2/2 + i. Give t(a). -8 Let s(t) = -7t*2 - 15t + 13. Let w(c) = 12c2 + 29c - 27. Let p(q) = 7s(q) + 4w(q). What is p(11)? -17 Let k(n) = -3n3. Let f(b) = 8b3 - b2 - b - 1. Let r be ((-1)/(-3))/((-177)/36 - -5). Let s(u) = rf(u) + 11k(u). Give s(-4). 12 Let j(y) = 12y2 + y + 1. Let v = 74 + -75. Let h be -4 + v/3-9. Calculate j(h). 12 Suppose 168 = -298p + 274p. Let j(r) be the second derivative of r6/360 + r5/15 - r*4/6 + r. Let u(t) be the third derivative of j(t). Give u(p). -6 Let r(p) = -8. Let j(x) = -x + 9. Let g(d) = 5j(d) + 6r(d). Suppose 2o + 10h = 14h, 0 = -2o + 2h - 2. Determine g(o). 7 Let t(l) = -2l3 + 2l*2 + 3l - 4. Suppose -2v + q + 8 = 0, 7v + 2q - 8 = 3v. What is t(v)? -31 Let m(h) = -71h - 77h + 206h - 68h + 4. Give m(3). -26 Let r(d) = -4d2 - 10d + 3. Let h(n) = 5n2 + 11n - 3. Let o(v) = 3h(v) + 4r(v). Let a = -46 + 41. Determine o(a). 13 Let i(o) = -o2 - o - 3. Let b(m) = -m2 - 2m + 21. Let f be b(-6). Let a be (3 + f)/(5 - 7). Determine i(a). -3 Let p(k) = 27k*3 - 3k*2 + 4k - 2. Let c be p(1). Let f(r) = r*2 - 26r + 3. Let v be f(c). Let h(m) = 3m - 3. Calculate h(v). 6 Suppose g - 24 = -h - 3g, 0 = -h - 2g + 14. Let k(t) = -2t - 7t + 8t2 + 6 + t3 + 16t + h. What is k(-7)? 10 Suppose 138r = -92 - 78 + 32. Let s(i) be the second derivative of i5/20 - i4/6 + i*2/2 - i. What is s(r)? -2 Let x(f) be the second derivative of 0f*2 + 0 - 1/60f*5 - 1/720f*6 + 0f*3 - 5f - 1/6f4. Let u(y) be the third derivative of x(y). Calculate u(-1). -1 Let c(q) = 2q*2 - 3q. Let d = 7 + -6. Let i be (3d)/((-3)/(-2)). Determine c(i). 2 Let f(w) = -3w*2 - 14w + 2. Let l be f(-5). Let n(k) = k - 3. Let s(h) = 1. Let r(p) = n(p) + 2s(p). Calculate r(l). -4 Let k(n) = n3 - 3n*2 - 3n. Let d = 272 + -268. Give k(d). 4 Let j(d) = d*3 - 6d*2 + 13d - 4d2 - 11 + 3d*2. Calculate j(5). 4 Let v(c) = -8c - 8. Let l(x) = x + 3. Let i(o) = -5l(o) - v(o). Calculate i(9). 20 Let n(r) be the second derivative of -r4/24 + r3 - 4r*2 + 12r. Let x(j) be the first derivative of n(j). Calculate x(4). 2 Let c(o) be the second derivative of o3/6 - o. Let g(w) = w3 + 12w2 - 15w - 25. Let v be g(-13). Suppose -t = -3 - v. Determine c(t). 4 Let y(o) be the second derivative of -o4/12 - o3/6 + o*2 + 3225o. Suppose -n + 1 + 1 = 0. What is y(n)? -4 Let k be 28/(-3) + 8/(-3) + 3. Let v(f) = f + 7. Determine v(k). -2 Let b(j) be the third derivative of 29j4/12 + j3/6 - 91j*2. What is b(1)? 59 Let n(t) = 11t*2 + t - 4. Let l(c) = -33c*2 - 3c + 11. Let b = -1 - -9. Let s(y) = bn(y) + 3l(y). Suppose 5v - 9 = -2g, -5 = -4v - g + 1. Give s(v). -11 Let t(z) be the first derivative of z4/12 - z3/6 + 4z2 + 7. Let b(c) be the second derivative of t(c). Let f be ((-12)/4)/((-6)/(-8)). What is b(f)? -9 Let f(t) = 10 - 3 - t2 - 3 + 10t + 1. Let o be -3((-4)/6 - (-128)/(-48)). Calculate f(o). 5 Let i(c) be the third derivative of c*5/30 + 5c4/24 + c3/6 + 44c2. Determine i(-5). 26 Let i(o) be the first derivative of 0o*3 + 9 - 1/2o*2 - o + 5/4o*4. What is i(-1)? -5 Let o(s) = -2s + 3s + 8 - 2s. Let c be 3/4(-144)/(-54). Suppose 7p - 25 = cp. What is o(p)? 3 Let f(t) = 562t*2 - 559t*2 + 3t + 0t. Give f(-2). 6 Let w(f) = 26f + 24f - 44f - 4 + f*2. Let n(m) = -m + 7. Let d be n(3). Suppose 3t + 5r - 5 = 0, 0 = -dt - t - r - 21. Determine w(t). -9 Let r(a) be the third derivative of a5/20 - a4/12 - a*3/6 - 6a*2. Let z be r(-1). Let w(u) = 34 + 8u*2 - 5u*2 + 4u - u*3 - 31. Calculate w(z). 3 Suppose 5t + 5u = 5, 4t + 3 = 2u + 1. Suppose -8h - 36 + 4 = t. Let f(r) = r*2 + 5r - 2. What is f(h)? -6 Suppose -5j + 26 = -3f, -3j + 7f = 8f - 24. Let l(n) = -4n + 19. Determine l(j). -9 Suppose 5i = -2m + 3 - 51, -5i = 4m + 96. Let j be (-4)/m - 1/6. Let o(c) = -c - 9. Determine o(j). -9 Suppose -4i = -8, 5a + 2i + 8 = -3. Let s(o) = -13 + 33 + 7o - 22. Let n(y) = 2y. Let t(f) = -6n(f) + 2s(f). Determine t(a). -10 Let l(w) be the second derivative of -11w4/12 - w3/6 - 97w - 1. Suppose 0 + 2 = -2o. Determine l(o). -10 Let i(g) be the first derivative of -8 - 2g + 1/2g2 - g3 - 1/4g4. Let q(n) = n2 - n - 3. Let h be q(0). Calculate i(h). -5 Let z(c) be the second derivative of 1/3c*3 + 0 + 2c - 1/2c2. Suppose 4w = -y + 22, -228y = -230y + 5w - 47. Give z(y). -13 Let z(m) = 3m3 - m2 + 3m - 5. Let n be z(2). Let y(c) = -n + 10 - c + 13. What is y(7)? -5 Let i = 13 - 12. Let s(k) = 5k + k + i + 3k - 10k. Calculate s(3). -2 Let a(g) = 3g3 - g2 + g + 12. Let w(l) = 4l*3 + 2l + 15. Let x(u) = -5a(u) + 4w(u). Determine x(-2). 6 Let c(a) be the first derivative of -a*3/3 + 3a*2/2 - 2a + 1. Let z(v) = v*2 + 6v - 9. Let n be z(-7). Let f be (-1 + 9)(-1)/n. What is c(f)? -6 Let t = 3 + -2. Let y(k) = -4k + 5 - t + k - k*2. Suppose -28j + 11j - 228 = 40j. Determine y(j). 0 Suppose u = -4o + 21, -4u + 36 - 7 = 5o. Suppose 0 + 20 = op. Let s(h) be t	{ "pile_set_name": "DM Mathematics" }
at is 9c - -2166? 2235 In base 16, what is 1383f + -31? 1380e In base 11, what is 648 + 2685? 3222 In base 9, what is -1 + -462084? -462085 In base 11, what is -4 + 8044? 8040 In base 13, what is -816b + 11? -815a In base 2, what is -10001100101 - 110000? -10010010101 In base 13, what is -8a + -52? -10c In base 7, what is 121663 + -3? 121660 In base 11, what is 6a - -136? 1a5 In base 13, what is 14 - 27245? -27231 In base 16, what is -d - -8c0b? 8bfe In base 13, what is 1ab + 70? 24b In base 8, what is -11474 + 6? -11466 In base 9, what is 183 - 452? -258 In base 15, what is 3 - -30db? 30de In base 7, what is 10 - -151303? 151313 In base 14, what is bd + 4220? 42dd In base 12, what is 30b77 + 5? 30b80 In base 13, what is 32 - 2? 30 In base 5, what is 3 + -4321101? -4321043 In base 13, what is -c + -2b7cc? -2b80b In base 6, what is -12 + 55545? 55533 In base 15, what is -23da1 - -5? -23d9b In base 16, what is 3 + -5a2? -59f In base 12, what is -134a6 - a? -134b4 In base 5, what is -121014 - -10? -121004 In base 15, what is -5 + -2423? -2428 In base 15, what is 1 - 3c67? -3c66 In base 10, what is -34 - 20? -54 In base 12, what is -3a - -21a? 1a0 In base 14, what is -155 + 18? -13b In base 14, what is 79 + -b? 6c In base 9, what is 13720 + 5? 13725 In base 15, what is 3ca2 - -2e? 3cd1 In base 16, what is 35 + -3701? -36cc In base 4, what is 11 + -2310311? -2310300 In base 7, what is 54 + 12245? 12332 In base 15, what is -114 + 489? 375 In base 9, what is 36778 + -1? 36777 In base 11, what is -1991 + -101? -1a92 In base 4, what is -1101 - -323? -112 In base 7, what is 1010206 - 5? 1010201 In base 12, what is b4 - -53? 147 In base 12, what is 12610 - 2? 1260a In base 15, what is 25 + 2b? 51 In base 16, what is 33 - 72b? -6f8 In base 6, what is -31231 + -125? -31400 In base 11, what is 30 - 524? -4a4 In base 5, what is 2120113 - 10? 2120103 In base 5, what is -101244422 - 0? -101244422 In base 8, what is 1451 + 21? 1472 In base 10, what is 1 + 4694? 4695 In base 2, what is 10100111010110010101 - 100? 10100111010110010001 In base 8, what is 3630 - -13? 3643 In base 14, what is -14 + -65? -79 In base 11, what is -8 + 13630? 13623 In base 14, what is -1 - 74ad? -74b0 In base 12, what is -4b7 + 7? -4b0 In base 11, what is a6a07 + 4? a6a10 In base 8, what is -6 - -30? 22 In base 10, what is -12747 + -417? -13164 In base 16, what is 9265 - -5? 926a In base 3, what is -2 + -2020000? -2020002 In base 11, what is 6 + -26499? -26493 In base 5, what is -11032222 - -4? -11032213 In base 3, what is 21002 - -111? 21120 In base 11, what is 4023 - -2? 4025 In base 7, what is 1 - -631420? 631421 In base 14, what is 245 - -71? 2b6 In base 3, what is 10200212110012 - 0? 10200212110012 In base 2, what is -10000100101001011000000 - -11? -10000100101001010111101 In base 6, what is -2 - -24053? 24051 In base 10, what is 137834 + -5? 137829 In base 11, what is 3450 - 54? 33a7 In base 8, what is -5403 + -161? -5564 In base 14, what is -1aa6c + 0? -1aa6c In base 4, what is 3203322 + -223? 3203033 In base 7, what is 262415 + 5? 262423 In base 5, what is -4203 - 24? -4232 In base 4, what is -301122 + -21? -301203 In base 12, what is -1a64 + -596? -243a In base 13, what is -3 + -38a47? -38a4a In base 13, what is -1291 - 1396? -2657 In base 15, what is -1013 + -b5? -10c8 In base 4, what is -13221100 + 0? -13221100 In base 15, what is bb1 + 4b? c0c In base 12, what is a858 + -6? a852 In base 8, what is -3211 + -1174? -4405 In base 11, what is -258 + 58? -200 In base 6, what is -4 + -335131? -335135 In base 6, what is -131125 + 0? -131125 In base 11, what is -641295 - -6? -64128a In base 12, what is 5 + 2924? 2929 In base 16, what is -4 - 10cb1? -10cb5 In base 7, what is -613 + 6623? 6010 In base 7, what is 3111 - 1326? 1452 In base 16, what is -a4a4 + e? -a496 In base 15, what is -46 + -c445? -c48b In base 7, what is 5226 - 3534? 1362 In base 9, what is 885 + 286? 1282 In base 4, what is -1130133 - 212? -1131011 In base 15, what is 3 + 8744b? 8744e In base 15, what is 2ec6d - -5? 2ec73 In base 7, what is 3254540 + -3? 3254534 In base 6, what is -25 + -442? -511 In base 13, what is -30c - -413? 104 In base 3, what is -11010 + 21122? 10112 In base 10, what is -47 + 3699? 3652 In base 8, what is 6033 - 14? 6017 In base 11, what is -10062 - -4? -10059 In base 16, what is -cc + 4? -c8 In base 3, what is -1012212220 - 100? -1012220020 In base 9, what is 1700758 + 1? 1700760 In base 8, what is -3 - 1027135? -1027140 In base 12, what is -3 - -3346? 3343 In base 5, what is 12400 - -141? 13041 In base 5, what is -20104 + 11134? -3420 In base 2, what is -10000001 + -110111000? -1000111001 In base 10, what is -16 + -23328? -23344 In base 7, what is 42526 + -200? 42326 In base 6, what is -121014 + 3? -121011 In base 15, what is -2c - -197? 16a In base 8, what is -2734367 - 2? -2734371 In base 9, what is -10 - 2162531? -2162541 In base 6, what is -123103 + 5? -123054 In base 2, what is -1100100111 + -110000011? -10010101010 In base 15, what is 14a - 3e7? -29c In base 5, what is 1132441 + -141? 1132300 In base 5, what is 10 + -320124? -320114 In base 3, what is 100122 + 202101? 1010000 In base 12, what is -27987 - 0? -27987 In base 6, what is -1 - 131513? -131514 In base 12, what is 5a583 + -2? 5a581 In base 7, what is -214366 + 0? -214366 In base 3, what is 101012200200110 + -12? 101012200200021 In base 15, what is -2bc + -184? -451 In base 4, what is 10012303 - -2? 10012311 In base 13, what is -159 + -4c25? -5081 In base 4, what is 11033311 + -210? 11033101 In base 13, what is 0 + -73335? -73335 In base 6, what is 125251 - -34? 125325 In base 14, what is -1a3 - -180? -23 In base 4, what is 102 - 323100? -322332 In base 11, what is -224 - 329? -552 In base 8, what is -1232717 + 20? -1232677 In base 3, what is -12012000200 + -221? -12012001121 In base 6, what is 0 - 103133? -103133 In base 13, what is -2652a2 - 3? -2652a5 In base 12, what is -a655 + 3? -a652 In base 8, what is -2473 + 14? -2457 In base 3, what is -100 + -20100020011? -20100020111 In base 6, what is -402 + 13501? 13055 In base 13, what is -88 - -188? 100 In base 7, what is -13 + -113323? -113336 In base 11, what is -11813 - -6? -11808 In base 6, what is -1540 - 205? -2145 In base 5, what is 22 - 20144? -20122 In base 7, what is -43436 + -11? -43450 In base 10, what is -6836 + -54? -6890 In base 8, what is 7272 - -114? 7406 In base 8, what is -3 + 630624? 630621 In base 6, what is 100 - 5413? -5313 In base 11, what is 2a9 - -101? 3aa In base 12, what is -16 - 215? -22b In base 7, what is 556251 + -4? 556244 In base 15, what is -4d0e - 5? -4d14 In base 6, what is -54522 + -3? -54525 In base 2, what is 10010000110 + -11001? 10001101101 In base 10, what is 146 - -78? 224 In base 12, what is 16b0 - 166? 1546 In base 9, what is -1 + -164827? -164828 In base 8, what is 3 - -16457? 16462 In base 16, what is 3296 - 0? 3296 In base 11, what is -837 + 9? -829 In base 3, what is -1112110220 - -1? -1112110212 In base 6, what is 1334 + 4042? 5420 In base 11, what is 100 - 1605? -1505 In base 9, what is -3 + 133050? 133046 In base 11, what is -1a + -20799? -20808 In base 16, what is 8b - 60? 2b In base 14, what is 379 + -d? 36a In base 6, what is 5330 + -311? 5015 In base 4, what is -11302331 + 231? -11302100 In base 15, what is 3 + 57b5? 57b8 In base 13, what is -152 - 5? -157 In base 16, what is e - 11991? -11983 In base 9, what is 16740 + 1? 16741 In base 15, what is 58 + -270c? -26a4 In base 6, what is -114032 + -545? -115021 In base 9, what is -750 + -171? -1031 In base 10, what is -1007 + 6? -1001 In base 12, what is 1241 + 11? 1252 In base 4, what is -2 - 20123313? -20123321 In base 8, what is 15116 + -115? 15001 In base 16, what is -83 + 1bc? 139 In base 4, what is -1030203 + -33? -1030302 In base 8, what is 1360 - 1411? -31 In base 4, what is 123030001 - -1? 123030002 In base 7, what is -545 + -465? -1343 In base 7, what is -1 + 351401? 351400 In base 14, what is -4 - c12b? -c131 In base 2, what is -10 + -10010001111011? -10010001111101 In base 7, what is 31 - 32121? -32060 In base 10, what is -15884 - 3? -15887 In base 5, what is -10220300 - -3? -10220242 In base 11, what is -34416 - 32? -34448 In base 13, what is 50c3 + a? 5100	{ "pile_set_name": "DM Mathematics" }
))? True Let f(d) = -58d + 132. Let u = -153 + 137. Does 53 divide f(u)? True Is (-521125)/(-22) - (5 + 11/(-2)) a multiple of 14? True Suppose 20 = 71h - 66h. Suppose -3f = -2v - 1405, -hf - 2v = -36 - 1842. Suppose -47i - f = -54i. Is 10 a factor of i? False Suppose 3p + 0 = 12. Suppose 17z + p = 15z. Does 20 divide (z/(-4))/(5 + 1278/(-256))? False Let q = -133 - -137. Suppose -6 - 10 = qx. Let f(o) = -25o - 32. Is 34 a factor of f(x)? True Is 40 a factor of 36/27 + -46688/(-24)? True Suppose -13o - 152320 = 20o - 47o. Is 16 a factor of o? True Let n(k) = 13k - 73. Let c be n(6). Suppose -2b + ci - 602 = -3b, -b = 2i - 587. Does 34 divide b? False Let z(j) = 69j*2 - 99j - 618. Does 5 divide z(-6)? True Let a be (-8)/(-48)-62-7. Suppose -2h + 136 = 4b, 11b + 2h = ab - 102. Does 34 divide b? True Is (158418282/(-44))/(-83) + ((-14)/4 - -2) a multiple of 148? False Let g = -532 - -554. Let m = -10 + 8. Let b = g + m. Is 5 a factor of b? True Suppose 2o - 8 = -6o. Let z be (-219)/(o/(-6)). Suppose h = -3h + z. Is h a multiple of 8? False Let v be (-240)/361416/(-10). Suppose v = 2b + 14b. Is b a multiple of 5? False Suppose -2f + 0f - 8 = 3v, -12 = 3f. Suppose -36m + 39m - 108 = v. Is 22 a factor of 14/(2/((-80)/m) + 1)? False Let t = -28 - -28. Suppose t = -3m + 2m + 15. Suppose -m = -l - 4v + 20, -2l = 5v - 61. Is l a multiple of 3? False Suppose 0 = 34a - 31a - 24. Suppose 3j + 5l - 365 = 0, j - 2l = 126 - a. Does 40 divide j? True Let l = -21974 - -31874. Suppose 14t - l = -t. Is t a multiple of 44? True Suppose -12 = 3r, -551p + 126264 = -549p + 4r. Is p a multiple of 82? True Let f(v) = 4v2 - 15v + 29. Let a(x) = x*2 - 4x + 7. Let y(i) = -9a(i) + 2f(i). Let u be y(5). Suppose u = k + 10 - 30. Is 6 a factor of k? False Suppose 7l = -0l - 728. Is 24 a factor of l/6(-8)/((-16)/(-54))? False Let j(i) = 345i*3 + 9i*2 - 138i - 8. Is j(4) a multiple of 16? True Let a(d) = 3d3 + 8d*2 - 5d + 2. Let c(x) = x*2 - 21x + 3. Let y be c(21). Is a(y) a multiple of 10? True Suppose 34 = 4d - 3b - 26, 2 = d - 4b. Let t(h) = -h3 - 5h - 24h2 - dh*2 + 3 + 49h*2. Is 7 a factor of t(5)? True Let t = 827 - -2017. Is 34 a factor of t? False Let v = -1444 + -672. Is 23 a factor of v/((-3)/(-3) + -9 + 6)? True Let i(n) = 209n - 835. Is 12 a factor of i(11)? True Suppose -2f - 20954 = -b + 12346, 66656 = 2b + 3f. Is b a multiple of 8? False Suppose o = 5a + 51639, 163o + 3a = 165o - 103229. Is 69 a factor of o? False Let k = 28 + -24. Let a(l) = l3 - 4l2 - 3. Let t be a(k). Let x(m) = -m3 - 2m2 - 2m. Is 15 a factor of x(t)? True Is 168999/21 - ((-10)/(-3))/(4725/810) a multiple of 18? False Suppose -19m = -16m + 23m - 62062. Is m a multiple of 83? False Let t = -81196 + 120412. Does 228 divide t? True Let q = 10560 + -7280. Does 16 divide q? True Suppose -8h + 176 = 40. Let v be 36/48 - h/(-4). Suppose t + 213 = 4o - 647, vo = 4t + 1064. Is o a multiple of 15? False Let u(x) = x - 4. Let s be u(9). Suppose 2a - 264 = -5z - 2a, -sa = 3z - 161. Is z a multiple of 26? True Let i(u) be the first derivative of u6/120 - u5/20 - u*3/2 - 15u*2/2 - 15. Let c(x) be the second derivative of i(x). Does 10 divide c(5)? False Let y = -6 + 98. Suppose y = 2a - 746. Is a a multiple of 19? False Let f(j) = -j - 1. Let d = -23 - -19. Let n be f(d). Suppose -nr - 61 = -y, 4r + 269 = 5y + r. Is 7 a factor of y? False Let a(d) = 2d + 13. Let l(m) = 3m + 27. Let t(q) = 9a(q) - 5l(q). Let f be (160 - 176)1/((-1)/1). Does 9 divide t(f)? False Suppose -4g = 2v - 1954, 0 = -2v - g + 1866 + 79. Let a = 1751 - v. Is a a multiple of 65? True Suppose -6u + 3u - 12 = 0, 132 = 5k + 2u. Let z = 25 - k. Let f(n) = 8n*2 - 4n + 1. Does 10 divide f(z)? False Let n(c) = c*3 - 5c*2 + 23c - 6. Let d be n(9). Is ((-4)/(-8)8)/(10/d) a multiple of 30? True Does 9 divide ((1 + -4)(-1)/(-9))/(1/(-17499))? False Let t = 16 + 61. Suppose -p = -t - 115. Is p a multiple of 32? True Suppose -2a - 17 - 15 = -3u, -3u = -a - 34. Suppose -4i - u = -3k, -4k + 3i = -0k - 16. Suppose 2 = 2p + 5l - 1, -kl = 5p - 16. Does 2 divide p? True Let b = 12658 + 4138. Is b a multiple of 38? True Let z = -379 + 1319. Let v(m) = 20m2 - 6m + 6. Let p be v(7). Suppose 3u + 4k - p = -u, -4u = 5k - z. Is 12 a factor of u? True Let j = -10363 - -17313. Does 5 divide j? True Let a(u) = -3u3 - 37u*2 - 215u - 77. Is 13 a factor of a(-25)? False Let z = 6269 - 3744. Is z a multiple of 91? False Suppose z - 414 = x, 4z - 5x = 3z + 426. Suppose -zk = -405k - 342. Is k a multiple of 5? False Let m(l) = 15l*2 - 84l - 18. Is 59 a factor of m(-34)? True Let o = 12351 - 2874. Is 13 a factor of o? True Let x(o) = -3144o - 22. Is 130 a factor of x(-2)? False Let b(i) = i3 - 9i*2 + 4i - 17. Let g be b(8). Let o = g - -83. Suppose 4c = o + 34. Is c a multiple of 9? False Let h(q) = 46q - 5. Let s(z) = -z + 1. Let f(c) = -22c + 2. Let i(j) = f(j) + s(j). Let o(t) = -6h(t) - 13i(t). Is o(3) a multiple of 20? True Suppose 781r - 2152206 = 723r. Does 133 divide r? True Suppose -74v + 143v + 6045 = 72v. Is v a multiple of 3? False Suppose 3q + 3p + 60 = -66, 2p - 126 = 3q. Is (461220/63)/10 - (-4)/q a multiple of 80? False Let b = -71 - -83. Suppose -4n - b = 0, -w = -4w - 5n - 33. Is 11 a factor of (-2152)/(-24) - 2/w? False Suppose 775005 = -51z - 104z + 2093745. Does 4 divide z? True Let b = 541 + -541. Suppose 2t = -19j + 24j + 256, b = -2t - 5j + 236. Does 88 divide t? False Suppose 28576 = 4k - 5c - 21467, 3k - 2c - 37534 = 0. Is 68 a factor of k? True Let g be 1 + -1 - -53. Let a be (34 + -33)/(4/20). Suppose -ax + g = -4k, -2x = k + 5 - 24. Is 7 a factor of x? True Is 225075/(-6)708/(-590) a multiple of 22? False Suppose 5a - 4m + 1752 = 0, -11m = -5a - 9m - 1756. Let x = a + 640. Is 9 a factor of x? True Is 13 a factor of -1 - ((-2)/(-4))/(19/(-246544))? True Suppose 26c - 21c = 15. Suppose 0 = cm - 12, m = 5p - 4m. Suppose b - 18 = -3o, -pb - 29 = -2o + b. Is o a multiple of 7? True Suppose 18 = x + 15. Suppose 5n - xn + 3o = 106, 212 = 4n + 2o. Is n even? False Suppose 10u - 14u = -420. Suppose -7w + u = 42. Is 12 a factor of ((-3 - w/(-7)) + 0)-7? True Is 2/7 + (320201/49 - -7) a multiple of 47? False Suppose -4h - 2h - 90 = 0. Let y(z) = -15z + 40. Let x be y(h). Suppose 4c - 471 - x = 0. Is c a multiple of 21? False Suppose -2h + 221 = -3l - 126, 0 = -5h + 5l + 875. Let s = 355 - h. Does 7 divide s? False Let j(v) = 2v*3 - 63v*2 + 20v + 96. Let q be j(31). Suppose 5g + 6 = 3s + 2, -g + 1 = 0. Let y = s - q. Is 42 a factor of y? False Let v(u) = 39u - 1926. Does 9 divide v(72)? True Let k(b) = 5b*3 - 5b*2 + 5b - 1. Let l be k(2). Suppose 2y = 5c - 2y + l, -y = -3c - 16. Is (13/(-3))/(c/60) a multiple of 22? False Let k = -27404 + 46720. Does 7 divide k? False Is -1(-2 - 35/(-5) - 2631) a multiple of 101? True Let o(j) = -5j - 12. Suppose 0 = -2f - 3r + 1, -4f - 5r = -0r - 3. Suppose -fn + y = 4 + 8, 2n = -5y - 36. Does 7 divide o(n)? True Is -33602((-75)/(-525))/((-4)/14) a multiple of 181? False Suppose -46j + 922168 - 23566 = -947424. Is 21 a factor of j? True Suppose 11 = 4g + 3t, t + 2 = 2g - t. Suppose 0 = gd + 148 - 940. Let q = d - 279. Is q a multiple of 25? False Let i = 34872 + 7948. Is i a multiple of 31? False Let k(r) = r + 11. Let u be k(-9). Suppose ul - 3t + 0t + 5 = 0, -25 = -5t. Suppose w + 336 = lw. Is 21 a factor of w? True Let w(q) = 3q - 21 + 20q2 - 11 - 13. Let y(h) = -5h*2 - h + 11. Let f(n) = -2w(n) - 9y(n). Does 19 divide f(5)? False Let y be 1 + (-17)/((-68)/(-2184)). Let f = y - -752. Is f a multiple of 69? True Suppose -1 = -6g + 23. Suppose f = 5n - 1746, gn - 19f = -15f + 1384. Does 7 divide n? True Let w(o) = o2 - o + 77. Let x(z) = -z2 + 13z - 22. Let l be x(11). Is w(l) a multiple of 17? False Let t(r) = 7r*2 + 100r - 1510. Does 9 divide t(18)? False Is 12 a factor of ((-23)/92)/(3/(-3804))? False Suppose 2t = s + 60317, 0 = 80t - 77t + 2s - 90493. Is 10 a factor of t? False Let k(j) =	{ "pile_set_name": "DM Mathematics" }
- (-4 + 1) 3 0 - 1 - (18 + -3 - 11) -5 What is the value of 2 + 2 + (-2 + 2 - 0)? 4 Evaluate -5 - (8 - (0 + -4 + 10)). -7 Evaluate 4 - (2 + 2) - -5. 5 What is the value of -2 + (1 - 3) - -8? 4 Calculate 2 + (6 - 4) + (-4 - -1). 1 What is the value of 2 - (-4 - 1 - -5)? 2 What is (6 - (1 + (-2 - -4))) + -3? 0 What is the value of -2 + (0 - 2) - (-3 - 1)? 0 What is the value of 0 + 1 + 8 + -2 + -7? 0 0 + -4 - (-1 + -2 + 2) -3 Calculate -2 - -1 - ((-3 - 0) + 1). 1 What is 3 + (-21 - -28 - (2 - -1))? 7 Calculate (-1 - 0) + 15 + -13 + 0. 1 Calculate (-5 - 3) + 0 - -3. -5 What is the value of 2 + -6 + (3 - -5)? 4 Calculate (-5 - 0) + (-113 - -114). -4 Calculate (-1 - 14) + -14 + 22. -7 Calculate -138 + 119 - (0 + -10). -9 What is 9 + -11 + (-1 - (-2 + -4))? 3 Calculate -11 - -3 - (0 + -3). -5 (0 - -2) + -3 + 1 0 What is -2 - 1 - (-2 - (4 - -2))? 5 What is the value of -5 + 7 + -4 + -3? -5 What is the value of -9 - 0 - (139 - 157)? 9 Evaluate -3 + -4 + 5 - (-1 - -1). -2 What is the value of (1 - (0 + (-5 - -4))) + 1? 3 -1 + 3 + (-2 - -1) - 6 -5 Evaluate 0 + -7 + -1 + 5 + -3. -6 Calculate -11 - (15 - 27) - (1 + 7). -7 What is -8 + 16 + (0 - 4) - 3? 1 Calculate 5 + (-6 - -1) + 0. 0 Calculate -1 - (-1 + -1 + 2 + 0). -1 Calculate (4 - 7) + 2 + -8 + 8. -1 Calculate -2 + (-2 - -1) + 31 + -25. 3 Calculate -8 + 5 + 5 + -1. 1 What is the value of 6 - (2 + 1 + (-1 - -6))? -2 Calculate 3 + -5 + 3 + 1 + -2. 0 What is -8 + -3 - ((-7 - -3) + -2)? -5 Calculate (-3 - (-3 + 0)) + (3 - 2). 1 What is the value of (-2 - 0) + 11 + -21 + 13? 1 What is the value of (0 + -2 - -4) + 3? 5 -2 + 1 - (-7 - -3) 3 What is the value of -73 + 79 - (8 - 2)? 0 What is 0 - (7 + -1 + -6 + -1)? 1 What is (38 - 35) + -3 + 0 - -4? 4 Calculate (-1 - -3) + -2 + 5. 5 Evaluate 0 - (8 - (3 - 0)). -5 What is 11 - 6 - 3 - 8? -6 Evaluate (3 - 1) + (-8 - -8). 2 Evaluate (-4 - -2 - 3) + (11 - 13). -7 Calculate 0 + -20 + 9 + 8. -3 0 - (-1 - (-6 - (4 - 5))) -4 0 + (-3 + -3 + 11 - 4) 1 -5 + 2 + -6 + 1 + 3 -5 What is the value of -4 - (1 + 2 - 3)? -4 Evaluate -5 - -10 - (-5 + -1 + 6). 5 What is 3 - ((-18 - -21) + (1 - -3))? -4 Calculate -6 - ((-8 - 5) + 6). 1 What is the value of 0 + 1 + -9 + 9 - -1? 2 What is the value of 0 + (-3 - -1) - (9 - 6)? -5 What is 1 - (0 - (5 - (-8 - -7)))? 7 Evaluate 6 + -4 + -1 + -3. -2 What is (-3 + 4 - 4) + (-1 - -1)? -3 What is 1 - (-1 - (-5 - -11 - 5))? 3 What is 2 - -1 - (5 + (-2 - -2))? -2 What is -2 + -3 + 6 - 2? -1 Calculate -1 - (6 + -10 + (4 - -1)). -2 Evaluate -1 - (12 - 8) - -6. 1 (-4 - (1 + 3 - 2)) + 1 -5 What is 3 + -8 + 4 - 0? -1 Calculate (-10 + 10 - -4) + (-2 - 6). -4 Calculate -2 + (-4 - -12 - 5). 1 What is the value of 14 + -15 + -2 + 1? -2 Evaluate -2 + 2 + 22 + -25. -3 What is the value of 2 - 6 - -8 - (9 - 8)? 3 What is the value of (6 - 5) + 5 + (0 - 1)? 5 4 - (5 + (0 - -2)) -3 Evaluate 0 - (0 + 4 - (23 - 25)). -6 What is the value of 5 - (-3 - -9 - 0 - 0)? -1 What is the value of 11 + -10 - (0 + 0 + -2)? 3 What is 3 - (0 + -1 + 3 + 3)? -2 What is (-16 - -20) + (-1 - 4)? -1 Calculate -5 + 4 - (3 + -6 - -7). -5 What is (-5 - -4 - 8) + 3 + -1? -7 (-6 - -2) + -28 + 37 5 Calculate (5 + 1 - 22) + 10. -6 Evaluate (-4 - (-5 + -4)) + -3 + -4. -2 Evaluate -16 + 1 + -4 + 12. -7 Evaluate 6 - -1 - (3 - -3). 1 Calculate 7 + (0 - 1) + -4. 2 What is the value of (-3 + 14 + -4 - 2) + -1? 4 -8 - (11 + 0 + -15) -4 What is the value of 2 - 3 - (8 + -4 + -2)? -3 What is -12 + (18 - (-1 - -9))? -2 Calculate 5 + -12 + 3 + 10 + -2. 4 Evaluate 11 + (-3 - -4) - 3. 9 (-2 - -1 - -4) + 10 + -16 -3 What is the value of 1 - 9 - (-222 + 207)? 7 What is -18 + 10 + 3 - 3? -8 Calculate -3 - (-9 - -1) - (-3 + 4). 4 What is 5 + -2 - (5 + 0)? -2 What is the value of -4 - ((-18 - -11) + 11)? -8 What is the value of (10 - 3) + -7 + 8? 8 Calculate (-1 - (3 + -3 + 3)) + -1. -5 What is -7 + -5 + 4 + 2 + 11? 5 What is (-3 - (-6 - 1)) + 0? 4 What is the value of (-2 - -5 - 1) + (3 - 5)? 0 Calculate (32 - 35) + (-1 - (-6 - 1)). 3 What is (1 - 13) + 6 - (1 + -14)? 7 Evaluate (0 - -2 - 4) + -2 + 9. 5 Evaluate 1 + 3 + -5 + 0 + 3. 2 Calculate 3 + (6 - 2 - 1). 6 What is (-55 - -60) + -7 + (0 - 0)? -2 Calculate -7 + -3 + 0 + 4 - 1. -7 What is -1 + (-5 + 11 - 1)? 4 What is 3 - 14 - (32 + -36)? -7 What is the value of -1 - ((1 - -6 - 1) + -10)? 3 Evaluate -3 - (1 - 1 - 7) - -2. 6 What is the value of -2 + (-2 - -3) + -1 + -2? -4 What is the value of 1 + -2 + 2 - 2? -1 Calculate (-11 - (6 + -5 + -7)) + 7. 2 What is the value of -3 - (-4 + (4 - 5))? 2 (-5 - -1) + -4 + 6 -2 What is 0 - -7 - (-23 + 28)? 2 What is the value of 4 + -8 + (6 - 2)? 0 What is -5 - ((-5 - -12) + 1 + -21)? 8 What is 3 + (3 - 3 - -1)? 4 Calculate (5 - 12 - -2) + (-3 - -7). -1 Evaluate (-3 - -1) + (6 - 4). 0 Calculate -11 + 8 + (-4 - (-1 + -1)). -5 What is 1 - 9 - (-51 + 46)? -3 4 + (-2 - (-3 + 4 + -2)) 3 -1 - (-3 - (-2 - 1) - -3) -4 Calculate -2 + -2 + (-2 - 3) + 9. 0 What is the value of (7 - 1) + (30 - 38)? -2 What is (-8 - -8) + 1 + 3? 4 Calculate -2 + (3 - (3 + (-10 - -4))). 4 What is -2 + (3 - -3 - 0)? 4 Calculate (4 - 7) + 6 + -5. -2 Calculate (6 - 11) + (12 - 2). 5 Calculate -11 + 1 + (16 - (10 - -3)). -7 Calculate -1 + (-8 - (-8 + 4 - 0)). -5 Evaluate (-20 - -25) + -3 + (-3 - -2). 1 What is -3 + -1 - (-5 + 4)? -3 (-6 - 4) + 4 - -4 -2 What is the value of -3 - (4 - 3) - -1? -3 Evaluate 1 + 2 + -5 + 0 + 3. 1 Calculate 1 + (13 - -1) + -18. -3 Calculate -4 + (3 - -1) + -5. -5 What is the value of -5 - (-4 + 5 + -2)? -4 Evaluate (0 - -2) + 0 - (36 + -29). -5 1 - (-1 + (-10 - -9)) 3 What is -8 + (-6 - (-7 - 1))? -6 1 - ((-4 - 0) + 2) 3 What is -2 + (-2 - -3) + 1 + 1? 1 Calculate 4 + 0 + 2 - (-5 - -7). 4 (-4 + 3 - 0) + -4 - -11 6 What is the value of 1 + 1 + 5 - (14 - 11)? 4 What is the value of -1 + -2 + 1 + -3? -5 What is the value of 2 - (1 + 3) - (3 - 1)? -4 Calculate -6 - ((14 - 20) + (2 - -7)). -9 -5 + (4 - 1) - -3 1 Calculate 0 + 4 - (-135 + 144). -5 What is the value of 10 + 0 + -5 + -6? -1 (-2 - 0) + 7 - 1 4 Evaluate (-6 - -6) + (2 - (-3 - -1)). 4 Calculate 7 - ((4 - 3) + 7). -1 Evaluate (-9 - -12) + (0 - -2) + -2. 3 What is 18 - 13 - (-1 - (1 - -1))? 8 What is (3 - (3 + -4)) + -1? 3 -4 + (-3 - -5) + (1 - 0) -1 What is the value of -3 + 4 + 4 - 1? 4 What is -5 + (0 - -3 - 0) - 0? -2 13 + 0 + -8 - (-3 + -1) 9 What is (-9 - (5 - 12)) + 0 + 7? 5 Calculate 17 + -25 - (-3 - 5). 0 (-5 - (-13 + 7)) + (-2 - 2) -3 Calculate 8 - ((-4 - -13) + 3). -4 Calculate (4 + -2 - (3 - 4)) + 2. 5 What is the value of (-1 - (-1 + 0)) + (-24 - -25)? 1 Evaluate -6 + ((8 - 4) + 2 - 6). -6 Calculate -3 + (-3 + -1 + 6 - -3). 2 Calculate -13 - (-5 + -4) - (-2 - 2). 0 Evaluate -1 + (3 + -3 - -1). 0 What is -2 - 0 - (-3 + -5) - 13? -7 What is the value of -12 - (-24 - -14) - (0 - -1)? -3 Evaluate (-35 - (8 - 19)) + 14. -10 Evaluate 4 + (-4 - -4) - -3 - 4. 3 What is (1 - 2) + (1 - -2)? 2 What is the value of -2 - (3 - (6 - 4))? -3 What is 1 + -3 + -1 + -1? -4 (4 - 3) + (2 - 0) + 3 6 Evaluate 6 - (6 - 7 - -7). 0 What is the value of 6 + -8 + 1 - -4 - 5? -2 What is 2 + -8 + 14 + (-6 - 3)? -1 Calculate 4 + -2 + 2 - 3. 1 Calculate 0 - -5 - (3 + -1). 3 What is -1 + (5 + -5 + 6 - 3)? 2 26 + -43 - (-10 + 0) -7 What is the value of 2 + -2 + 9 - 4? 5 What is the value of -8 + 3 + 5 + 1 + 2? 3 Calculate 0 + 6 + -3 + -4. -1 What is (1 - -15) + (22 - 10 - 18)? 10 (-1 - 5) + -4 + 8 -2 What is 1 + 6 + (2 - 5) + 0? 4 -7 - -5 - (-2 - (-1 - 3)) -4 What is the value of -3 - 1 - (-7 + (-1 - -2))? 2 What is 9 - -4 - 6 - 1? 6 39 - 30 - (-1 - -9) 1 What is -1 + 1 - (0 + -1 + 0)? 1 3 - (11 + -6 - -1) -3 What is 1 - (12 + -8) - 3? -6 What is the value of 14 - 15 - ((0 - -4) + 2)? -7 Evaluate (15 - 2) + -4 + 7 + -9. 7 Evaluate -2 + -1 + 3 + 5. 5 What is the value of -2 - -13 - (-29 + 31)? 9 Evaluate (1 - -2) + (19 - 17). 5 2 - (0 - 6 - (-1 + -4)) 3 Evaluate 1 + 3 + (6 - 13). -3 Calculate -1 + (2 - 3) + 2. 0 What is the value of (0 - 3) + (5 - (1 - 0))? 1 -2 - ((-1 - -2) + 0 + 0) -3 What is the value of (-11 + 1 - -6) + 1 + 1? -2 Evaluate 3 - 6 - (-6 + 1 - -2). 0 What is -24 + 15 + 1 + 10? 2 What is the value of -5 - (-1 - -2) - (-4 - -4)? -6 (27 - 24) + -6 + 2 -1 Calculate 1 - (3 - 7 - -2). 3 Calculate -2 + (-4 - -9) + (0 - 0). 3 -2 + (0 - (-2 + -3)) + -5 -2 Calculate -5 +	{ "pile_set_name": "DM Mathematics" }
j(-6). Let r(x) = x*2 + 4x - 1. Let h be r(l). Suppose -15 - 37 = -ht. Calculate the remainder when 21 is divided by t. 8 Let i = 20013 + -12744. Calculate the remainder when i is divided by 72. 69 Suppose 747 = 27s - 3031 - 2378. What is the remainder when s is divided by 8? 4 Let s be 8/20 + (-3)/(45/(-21954)). Suppose 10c = s + 566. Calculate the remainder when c is divided by 6. 5 Let b be (-2 - 2)/(76/(-16) - -5). Let k = b - -37. Suppose 17 = v - 19. What is the remainder when v is divided by k? 15 Suppose m = 5, 3m = -r + 5 + 12. Suppose 13 = 9p - 6p + 5d, rd = -2p + 10. Let j(s) = 3s*2 - 7s + 1. What is the remainder when j(5) is divided by p? 5 Suppose 0 = -5b + 3t + 446 + 423, -7 = -t. Let a = 61 + -16. What is the remainder when b is divided by a? 43 Let v be 10/(-15) + 120/(-9). Let o = -108 - 4. Calculate the remainder when (-6)/v - 2528/o is divided by 6. 5 Suppose -i - 5f + 206 = 0, i + 0f - 166 = 5f. Suppose 11h - 2h + 28h - 777 = 0. What is the remainder when i is divided by h? 18 Let u be 9/(4 + -1) + (-70)/(-5). Let y(q) = q*2 - 18q - 28. Let k be y(u). Let r = 19 - k. Calculate the remainder when r is divided by 22. 20 Suppose -10a + 15a + 5g = 575, 2a - 265 = 5g. Calculate the remainder when a is divided by 19. 6 Suppose 0 = -11382m + 11367m + 630. Calculate the remainder when 2099 is divided by m. 41 Suppose 180 = 65a - 63a. Suppose -9q = -a - 909. What is the remainder when q is divided by 24? 15 Calculate the remainder when 723 is divided by 69504/362 + (18/(-10) - (-1)/(-5)). 153 Let s = -35 - -40. Suppose -3o = -3g + 144, -so - 141 = -3g - 3o. Let h = -30 + g. Calculate the remainder when 57 is divided by h. 12 Suppose 4m - 3n - 131 = 0, 2m - 34 = m + n. Suppose -827 = 3r + 5t, 4r - 4t + 1170 = 14. Let g = -140 - r. What is the remainder when g is divided by m? 28 Let k(v) = v*3 - 23v*2 - 53v + 1234. What is the remainder when 2051 is divided by k(23)? 11 Let k(y) = -2y3 - 6y*2 - 65y - 101. What is the remainder when k(-5) is divided by 161? 2 Let j = -4614 + 4666. What is the remainder when 331 is divided by j? 19 Suppose 71z = 11z + 4717 + 137963. What is the remainder when z is divided by 108? 2 Let g(a) = -18a + 3075. What is the remainder when g(17) is divided by 121? 107 Suppose k = 4c + 287, 0 = 3k + 5c - 7c - 881. Calculate the remainder when 3832 is divided by k. 292 Suppose 3r - 2n - 10 = 0, -2r + 5n + 7 = r. Suppose -rf = -5h + 73, -16h = -20h - 2f + 48. What is the remainder when 74 is divided by h? 9 Let n(o) = 24o - 166. Let w be n(7). Suppose 0 = wd - 10, 3l - 9d + 10d - 149 = 0. Calculate the remainder when 381 is divided by l. 45 Let a be 7/2(-43 + 21). Let k = 200 + a. What is the remainder when k is divided by 63? 60 Suppose 3m - 75 = -4r + 189, -4m = -16. Let n = 154 - r. Let v = 263 - 232. What is the remainder when n is divided by v? 29 Let p(q) = 1148q - 8430. What is the remainder when p(8) is divided by 25? 4 Let j(x) = -x*3 + 6x*2 + 4x + 16. Let w be j(7). Let b = 14 - w. Let y = 10 + 1. What is the remainder when b is divided by y? 8 Let o = -14 + 45. Suppose -16x + 28x = 1092. Calculate the remainder when x is divided by o. 29 Let u(d) = 5d2 - 2d - 1. Calculate the remainder when u(-2) is divided by -4 - -2 - (-26 - (-46 - -26)). 3 Suppose 0 = w - 3w. Suppose w = 2t - o + 236, -4t - 300 = -5o + 160. Let v = 154 + t. What is the remainder when v is divided by 9? 7 Suppose -29b + 870 + 500 = -341. Calculate the remainder when 210 is divided by b. 33 Let s(w) = w2 - 26. Let z be s(5). What is the remainder when 0 + z/(5/(-1460)) is divided by 42? 40 Suppose 3n + f - 547 = 811, 5n - 2264 = -2f. Calculate the remainder when n is divided by 112. 4 Suppose -4z - 2d = -2, 5d + 0d + 4 = -z. Let f be z(-12)/(-3) - 16. Let w = f + 21. What is the remainder when 35 is divided by w? 8 Let w(n) = 5n*2 + 965n + 5794. What is the remainder when 3112 is divided by w(-6)? 168 Let f = -5 + 439. What is the remainder when f is divided by 219? 215 Let b(s) = -114s3 + 13s*2 - 4s - 94. Calculate the remainder when b(-3) is divided by 1551. 11 Suppose 18c - 6c = -204. Let l(f) = f*3 + 17f*2 - 3f + 8. What is the remainder when 234 is divided by l(c)? 57 Suppose -y + 567 = 2x, -y = -3x + 2x + 285. Suppose -n + x = 187. What is the remainder when n is divided by 25? 22 Suppose -10688s = -10682s - 240. Calculate the remainder when 2357 is divided by s. 37 Suppose 1392 = 4z - 2i, -z - 6i + 682 = z. Calculate the remainder when z is divided by 115. 2 Suppose 9l - 10 = -l. What is the remainder when l/(-3)-2222/4 is divided by 15? 7 Let f be 3/(-2 - 1) - (-6 + 6). Calculate the remainder when 128/(-96) - 274f/3 is divided by 31. 28 Let z(k) = 4k - 28. Let c be z(-14). What is the remainder when c/(-70)(-200)/(-3) is divided by (-14)/(-63) - 187/(-9)? 17 Let w(u) = -u*2 - 37u - 71. Let y be w(-25). Suppose -20d = -y - 91. What is the remainder when 221 is divided by d? 13 Suppose 5r + 4h - 1413 = 0, 534 = 2r + h - 33. What is the remainder when 471 is divided by r? 186 Suppose 39u - 46u + 14 = 0. Suppose -3a + 27 = 3w, 4a + uw - 1 - 33 = 0. What is the remainder when 35 is divided by a? 3 Let r be ((-100)/15 - -6) + (-304)/(-6). Let b = r + -45. Suppose 2x + 3y - 64 = 0, 2x - b = 2y + 59. Calculate the remainder when x is divided by 17. 15 Suppose 0 = -4u + 506 - 190. Calculate the remainder when 150 is divided by u. 71 Calculate the remainder when 719 is divided by 17696/(-224)(1 + -1 - 1). 8 What is the remainder when (608895/14)/(-15)1/2-12 is divided by 150? 147 Suppose -x + 40 = 5r, -4x - 2r = 12 - 118. Let k = 186 - 186. Suppose -2n + 164 - 20 = k. What is the remainder when n is divided by x? 22 What is the remainder when 856 is divided by 4/6(430 + -13 + (-120)/(-10))? 284 Let v(s) = -s3 - 4s + 17. Let b be v(2). What is the remainder when 77 is divided by (6 + 14)b/2? 7 Suppose 2t - 5f = 4977, 50t = 51t + 4f - 2482. What is the remainder when t is divided by 19? 16 Let v = -53 + 97. Let n(p) = -p*3 + 10p*2 + 193p - 1416. Calculate the remainder when n(7) is divided by v. 38 Let w = -8 + 7. Suppose 5x = -5d + 175, -x - 60 = -4d + 75. What is the remainder when d is divided by w - (1 + -43)/2? 14 Suppose -78 = 5z - z - 7z. Calculate the remainder when 497 is divided by z. 3 Let l = -10911 - -11081. Let j = 84 - 40. Calculate the remainder when l is divided by j. 38 Suppose 0u - 20 = -2s + 4u, 5s - 41 = u. Suppose 13 = 9f - sf. Suppose 0 = 5h - 176 - 4. What is the remainder when h is divided by f? 10 Let g = -28 - -28. Suppose -4f - 188 + 400 = g. Calculate the remainder when f is divided by 16. 5 Let h(n) = -11n + 47. What is the remainder when h(-3) is divided by 73? 7 Suppose 0 = -10f - 2562 - 7538. Let l = 1083 + f. What is the remainder when l is divided by 23? 4 Let a = -313 - -384. Calculate the remainder when 399 is divided by a. 44 What is the remainder when 326 is divided by (-72)/(-16) - (-145)/10? 3 Let c be (66/(-12) - -4)(-4 - 0). Suppose -cw + 450 = 60. What is the remainder when w is divided by 14? 9 Let g(v) = 28v*2 - 4v + 3. Let z be (-212)/(-16) - 16/64. Suppose 5y - 4k = 56, 0 = -0y - y - k + z. What is the remainder when g(2) is divided by y? 11 Suppose 0 = 3v - 8v + 1725. Suppose 5r + 4c = 1773, r + 0c + 4c - v = 0. What is the remainder when r is divided by 24? 21 Suppose -2224f - 603 = -2233f. Let a = 338 + f. What is the remainder when a is divided by 8? 5 Suppose -c + 207 = 2f, -5c + 383 = f - 634. Suppose 0k + 434 = -7k. Let t = -28 - k. Calculate the remainder when c is divided by t. 33 Let q = -15 + 28. Let z be (-11418)/(-14) - (-123)/287. Suppose 29s = 13s + z. Calculate the remainder when s is divided by q. 12 Suppose -3 = 4z - 119. Let a = 18 + 62. Suppose 10j + a = 18j. What is the remainder when z is divided by j? 9 Suppose -111t = -114t + 36. Suppose v - 68 = t. Calculate the remainder when v is divided by 28. 24 Suppose -33323b = -33317b - 2508. What is the remainder when b is divided by 166? 86 Suppose 7*a + 70 = 1204. What is the remainder when 99 is divide	{ "pile_set_name": "DM Mathematics" }
integer? 8 Let k = 2.05000628 + -2.05. Round k to 7 decimal places. 0.0000063 Let d be 18010036 + -31 + (-5 - 0). Suppose -b + d = -11b. What is b rounded to the nearest 100000? -1800000 Let p = 25.41 - 26. Let i = -0.04 + p. Round i to one decimal place. -0.6 Let v = 354.41 + -356. Let u = 1.590067 + v. What is u rounded to 5 dps? 0.00007 Let r = -1.3 + -17.1. Let h = r - -2.4. Let q = h + 16.00003. Round q to 5 dps. 0.00003 Let w = -56.5 + 56.734. Round w to one dp. 0.2 Suppose -13350 - 30388 = -4v + 5p, 0 = 4v + p - 43726. Suppose -5a + 100016 = 4k, -a + 9064 = -k - v. Round a to the nearest 100000. 0 Let l = -2.87 + 3.764. Round l to 1 decimal place. 0.9 Let m(r) = -193r3 - 14r*2 + 4r - 32. Let i be m(6). Round i to the nearest ten thousand. -40000 Let a = -18608147759362245917.00000307 + 18608147664692583518. Let p = -94669662876 - a. Let d = p + 477. What is d rounded to 7 dps? 0.0000031 Let b = -22 - -14.04. Let c = -0.04 + b. Let a = 8.00000035 + c. What is a rounded to seven dps? 0.0000004 Let b(c) = 21c2 + c - 5. Let o be b(3). Let r = o - 88. What is r rounded to the nearest one hundred? 100 Let b = 228.4 - 204. Let u = b - 28. Round u to zero dps. -4 Let x = -0.03172 - 365.99328. Let o = -367.025007 - x. Let f = -1 - o. Round f to five decimal places. 0.00001 Let m = 326.999999482 + -327. What is m rounded to 7 dps? -0.0000005 Let d(x) = 16429x*3 + 11x*2 - 17x + 70. Let g be d(10). Round g to the nearest one million. 16000000 Let z = -0.6 - 227.4. Let u = z + 353. Let r = 125.0053 - u. Round r to 3 dps. 0.005 Suppose -3u = -3g - 51285, -4u + 8u + 17120 = -g. Round g to the nearest one thousand. -17000 Let p = 20.69438 - 20.74628434. Let y = -0.0519 - p. What is y rounded to 7 dps? 0.0000043 Let u = -5 + 3. Let l = -11999.9986 - -11998. Let h = l - u. What is h rounded to 3 dps? 0.001 Suppose -k = -4c + 2k + 2100030, -k = -2c + 1050014. Let t be c/15 - (-6)/(-15). Suppose -9z - t = -8z. Round z to the nearest 10000. -40000 Let r = 0.083 - 65.083. Let a = r + 64.999914. What is a rounded to five decimal places? -0.00009 Let b = -6.8 + -2.04. Let i = 1.74 + b. Round i to the nearest integer. -7 Suppose 4 = 7x - 17. Suppose -2b + 0b + 11600006 = -2t, -t - 5799991 = xb. What is t rounded to the nearest one million? -6000000 Let j = 2 + -1.975. Let t = 0.575 + j. What is t rounded to one decimal place? 0.6 Let y = -498.0028 - -498. What is y rounded to 2 decimal places? 0 Let g = 5 - 0. Let u = g + -4.9. Let p = u - 0.099. Round p to two dps. 0 Let p = 151.9999997959 - 152. What is p rounded to seven dps? -0.0000002 Let p = -36452 - -36451.099992. Let z = p + 0.9. Round z to 6 decimal places. -0.000008 Let c = 3852 + -3852.0000002669. Round c to 7 decimal places. -0.0000003 Suppose -3s = -2c + 6, -4 = 3s - 3c + 2. Let o be (1/s)/((-1)/(2830)). Round o to the nearest 100. 400 Suppose -5s + 942 = -2s. Let a = 250 + s. Suppose 3u = -1056 - a. What is u rounded to the nearest one hundred? -500 Let u = -1759494 + 1759502.000008. Let i = -5.9 + -2.1. Let m = u + i. Round m to five decimal places. 0.00001 Let a = -1.92 - -133.92. Let m = a + -132.000029. Round m to five decimal places. -0.00003 Let c = 665 + -664.9999704. What is c rounded to 5 decimal places? 0.00003 Let c = -73593 - -120704. Let y = c - 132111. Round y to the nearest 10000. -90000 Let f = -26 - -433. Round f to the nearest 10. 410 Suppose 3984278 - 20723678 = -23o. Round o to the nearest 10000. 730000 Let g be 16 - 32 - (-2)/(-2). Let o(h) = 706h + 2. Let b be o(g). What is b rounded to the nearest 1000? -12000 Suppose z + 9 = 4z. Suppose -2j - 379996 = 4b, -58929 - 131068 = j + zb. Round j to the nearest 10000. -190000 Suppose -14l - 2899 = 517. Round l to the nearest 10. -240 Let r = 77.845 - 78. Let w = r - 0. Let c = w - -7.055. Round c to zero dps. 7 Let q = 137111558383.40836377 + -84712594582.40836624. Let w = -52398964086 + q. Let o = 285 + w. What is o rounded to seven dps? -0.0000025 Let c(a) = a3 - 3a*2 + 4a + 3. Let q be c(-4). Let i be (-44000)/((-365)/q + -3). Round i to the nearest one hundred thousand. 600000 Let p = 497.000001267 - 497. Round p to seven dps. 0.0000013 Let n(d) = -3d2 - 2d + 2. Let z be n(-2). Let m be (-6)/432/z. Suppose mf = 271067 - 1071067. What is f rounded to the nearest 100000? -100000 Suppose p + 4g - 419871 = -g, 2p - 3g = 839807. Suppose -2l - 4819896 + p = 0. Round l to the nearest 1000000. -2000000 Let i = -5391.73 - -5363. What is i rounded to the nearest integer? -29 Let f(s) = 321996s2 - 4s. Suppose -1 = 2j + 1. Let r be f(j). What is r rounded to the nearest ten thousand? 320000 Let l be (-2 + 1 - 2) + 1. Let x = l - -5. Let s be 3300000/(x + (1 - 3)). What is s rounded to the nearest 1000000? 3000000 Let x = -4.56 - -6.63. Round x to one decimal place. 2.1 Let g = 20 + -21. Let c(i) = -5801i - 1. Let m be c(g). Suppose m = -0t + 2t. What is t rounded to the nearest one hundred? 2900 Let v = 473.83 - -11.17. Let a = v - -123. Let n = a + -633.9. Round n to the nearest integer. -26 Let j = 5.29 - -1.47. Let k = j + -7. Let l = k - 0.11. Round l to one decimal place. -0.4 Let l = -725 - -329. Let n = l - -396.0000299. Round n to 6 dps. 0.00003 Let m(s) = 2s2 + s - 2. Let v be m(-2). Suppose 4y - 3x - 16 = -5, -4x = 4y - v. Let c be y/8 + 377999985/60. What is c rounded to the nearest 1000000? 6000000 Let l = -1 - -0.3. Let m = -0.62 - l. Let n = m - -0.31. What is n rounded to 1 decimal place? 0.4 Let s be 32/6 - (-2)/3. Let h be (1 - -1)537/s. Suppose 0 = -r + 3l - h, 0 = -r - 4l - 160 - 12. What is r rounded to the nearest ten? -180 Let k be (5 - 2)-1 - (16610 + 2). Let b = k + 27015. What is b rounded to the nearest one thousand? 10000 Let u = 23.07 - 23.06998799. Round u to six dps. 0.000012 Let j = 313 + -79. Let d = j + -233.999999853. Round d to 7 dps. 0.0000001 Suppose -4f + 47 = 2l + 175, l + 5f = -61. Let r be 427195l/(-15). Suppose -5m - r = 190182. What is m rounded to the nearest ten thousand? -230000 Let a = 2.3 + -2.29887. Round a to 3 dps. 0.001 Let q = -2445.998942 - -2446. Round q to 4 decimal places. 0.0011 Let m = -10 - -5. Let p(j) be the first derivative of -3040j3/3 - j2 - 10j + 3. Let d be p(m). Round d to the nearest ten thousand. -80000 Let q = 6 + -5.4. Let w = q - 2.4. Let g = 1.7 + w. Round g to the nearest integer. 0 Suppose y - 6 = -2p, 2 = -4p + 3y - 6. Let v be -12 + -2199992 + 4p. What is v rounded to the nearest one hundred thousand? -2200000 Let a = -2977 - -1911. Let v = a - -1069.0056. Let x = v - 3. What is x rounded to 3 dps? 0.006 Suppose 21j - 24j + 6933 = -3a, -5a + 11605 = 5j. Round j to the nearest 100. 2300 Let k = -418145.9326 - -418187. Let v = 41 - k. What is v rounded to 2 decimal places? -0.07 Let d = -38.42 + 38.750068. Let q = d + -0.33. Round q to 5 dps. 0.00007 Let r = 1038785 - 1038732.9907. Let i = 52 - r. Round i to three dps. -0.009 Let r = -3270 - -3257.493. Let i = r + 12.6. Let q = i + -0.09136. What is q rounded to 4 dps? 0.0016 Let t(a) = 198999a + 1. Let j be (4/(-48)3)/((-2)/8). Let g be t(j). What is g rounded to the nearest ten thousand? 200000 Let d = 21 - 20.81. Let r = -0.04 + d. Let h = r - 0.42. Round h to one dp. -0.3 Let y = 0.19 - -320.81. Let c = y + -321.695. Round c to 1 dp. -0.7 Let o = -146056.7141 - -146064. Let a = -7.3 + o. What is a rounded to 3 decimal places? -0.014 Let l = -140.76 + 138. Let u = l - -2.2. Let z = u + -1. What is z rounded to one dp? -1.6 Let f = -0.139 - -0.096. Let r = f - -0.0430003. What is r rounded to six dps? 0 Let v = -6.00001074 + 6. Round v to seven decimal places. -0.0000107 Let l = 0.0535582 - -25.9465218. Let g = -26 + l. What is g rounded to four dps? 0.0001 Suppose -u + 8110158 = -24960501. Suppose 3470659 - u = n. Round n to the nearest one million. -30000000 Suppose 10789 = -2r - 7503. What is r rounded to the nearest 100? -9100 Let p(u) = -u3 + 9u*2 + 12u - 20. Let k be p(10). Suppose k = 2h - t - 374003, -5h + 4t + 561012 = -2h. Round h to the nearest ten thousand. 190000 Let n = -40.900843 + 40.9. Round n to five decimal places. -0.00084 Suppose -12 = -3p + 5p. Let w be (-2)/4 + (14103/p	{ "pile_set_name": "DM Mathematics" }
3o3 - 63o - 60 = 0. -4, -1, 5 Factor 4v3 - 132v*2 + 1152v - 1024. 4(v - 16)2(v - 1) Factor -2h2/5 - 172h/5 + 144. -2(h - 4)(h + 90)/5 Factor 3o3/2 - 9o*2/2 - 15o + 36. 3(o - 4)(o - 2)(o + 3)/2 Suppose -4l*5 + 16l*4 - 12l*3 - 16l*2 + 16l = 0. Calculate l. -1, 0, 1, 2 Suppose m*4 - 5m*3 + 9m*2 - 7m + 2 = 0. What is m? 1, 2 Factor -s*4/2 - 3s*3/2 + 15s*2/2 - 17s/2 + 3. -(s - 1)*3(s + 6)/2 Suppose -28y4/3 - 152y*3 + 116y*2 + 136y/3 = 0. Calculate y. -17, -2/7, 0, 1 Factor 4q4 + 16q*3 + 12q*2 - 16q - 16. 4(q - 1)(q + 1)(q + 2)2 Let 5o*3 + 385o*2 - 1200o = 0. Calculate o. -80, 0, 3 Factor 3c4 - 42c*3 - 3c*2 + 42c. 3c(c - 14)(c - 1)(c + 1) Let 5k4 - 60k*3 + 245k*2 - 390k + 200 = 0. What is k? 1, 2, 4, 5 Factor 2g3 + 264g*2 + 11616g + 170368. 2(g + 44)3 Factor 5n*3 + 2320n*2 + 4605n - 6930. 5(n - 1)(n + 3)(n + 462) Solve -2z*2/11 - 800z/11 - 80000/11 = 0. -200 What is s in 5s5 + 165s*4 + 1485s*3 + 4975s*2 + 5250s = 0? -21, -5, -2, 0 Factor -t*2/3 - 170t/3 - 169/3. -(t + 1)(t + 169)/3 Factor 3o*3/4 - 1441o*2/4 + 1917o/4 - 479/4. (o - 479)(o - 1)(3o - 1)/4 Solve q2/10 + 23q/5 + 129/10 = 0 for q. -43, -3 Factor -34q4 - 37q*3 + 405q*2 + 36q. -q(q - 3)(q + 4)(34q + 3) Solve 2a3/7 + 78a2/7 = 0 for a. -39, 0 Factor -s5 + 13s4 - 55s*3 + 103s*2 - 88s + 28. -(s - 7)(s - 2)2(s - 1)*2 Factor -5w*3/2 - 1985w*2/2. -5w*2(w + 397)/2 Factor 4l3/5 - 204l*2/5 + 1592l/5 - 672. 4(l - 42)(l - 5)(l - 4)/5 Factor 5g*2 + 1930g + 1925. 5(g + 1)(g + 385) Find x, given that 2x5/13 + 4x*4/13 - 6x*3/13 - 16x*2/13 - 8x/13 = 0. -2, -1, 0, 2 Suppose 2v3/9 - 26v/9 + 8/3 = 0. What is v? -4, 1, 3 Solve 2c5/11 - 34c*4/11 + 116c*3/11 - 164c*2/11 + 106c/11 - 26/11 = 0 for c. 1, 13 Factor -4p4 + 176p*3 - 1752p*2 - 4048p - 2116. -4(p - 23)2(p + 1)*2 What is d in -2d*5/15 + 8d*4/15 + 2d*3/15 - 8d*2/15 = 0? -1, 0, 1, 4 Factor 400d*2/7 + 40d/7 + 1/7. (20d + 1)2/7 Suppose -6b*2/7 - 18b/7 + 24/7 = 0. Calculate b. -4, 1 Solve -4f3 - 2436f*2 - 494508f - 33461708 = 0. -203 Determine l, given that -54l5/7 - 24l*4/7 + 170l*3/7 + 180l*2/7 + 24l/7 - 16/7 = 0. -1, -2/3, 2/9, 2 Determine h so that 3h3 - 7623h*2 + 6456681h - 1822936269 = 0. 847 Find u, given that -3u3 - 57u*2 + 60u = 0. -20, 0, 1 Find t such that 5t4 + 345t*3 - 5t*2 - 345t = 0. -69, -1, 0, 1 Factor q*2 + 70q - 71. (q - 1)(q + 71) Suppose 5k*4 - 40k*3 - 15k*2 + 110k + 80 = 0. What is k? -1, 2, 8 Factor 5h4 - 75h*3 - 85h*2 + 75h + 80. 5(h - 16)(h - 1)(h + 1)2 Find a, given that -3a*3 + 24a*2 + 207a - 756 = 0. -7, 3, 12 Factor o*4/3 - 19o*3 + 297o*2 - 729o. o(o - 27)2(o - 3)/3 Solve -5y2 + 35y - 60 = 0 for y. 3, 4 Factor n*4 + 15n*3 - 276n*2 + 1232n - 1728. (n - 4)*3(n + 27) Suppose -35m3 + 234m*2 - 148m + 24 = 0. What is m? 2/7, 2/5, 6 Factor 4r3/3 - 12616r*2/3 + 9947716r/3. 4r(r - 1577)*2/3 Factor 2j*3 - 42j*2 + 36j + 80. 2(j - 20)(j - 2)(j + 1) Factor -q2/4 - 21q/2 - 117/4. -(q + 3)(q + 39)/4 Solve -2z*3 - 102z*2 - 1350z - 1250 = 0. -25, -1 Factor 4z4 - 24z*3 + 36z*2 - 16z. 4z(z - 4)(z - 1)2 Let 3w*2/4 + 747w + 2985/4 = 0. Calculate w. -995, -1 Find c such that -3c2 - 8c + 3 = 0. -3, 1/3 Solve d*2 + 626d + 97969 = 0 for d. -313 Factor -2z2 + 6260z + 6262. -2(z - 3131)(z + 1) Solve 3s2/2 - 809s/3 - 60 = 0. -2/9, 180 Factor -18w3 - 51w*2 + 174w - 105. -3(w - 1)(w + 5)(6w - 7) Factor l*4 + 60l*3 - 123l*2 + 62l. l(l - 1)2(l + 62) Factor -f3/6 + f2. -f*2(f - 6)/6 Suppose 5y2 - 990y + 985 = 0. Calculate y. 1, 197 Factor -3d4 - 138d*3 - 2343d*2 - 17388d - 47628. -3(d + 9)2(d + 14)2 Factor u2/6 + 121u/3 + 14641/6. (u + 121)2/6 Factor u4/9 + 44u*3/9 + 188u*2/3 + 1760u/9 + 1600/9. (u + 2)*2(u + 20)2/9 Factor -d2/4 + 21d/2 - 38. -(d - 38)(d - 4)/4 Factor -2i3 + 94i*2 + 400i + 408. -2(i - 51)(i + 2)2 Solve -d4/6 + 55d3/6 + 148d*2/3 + 40d = 0. -4, -1, 0, 60 Factor 20g2 + 3608g + 1440. 4(g + 180)(5g + 2) Factor -5b*5 + 10b*4 + 30b*3 - 100b*2 + 95b - 30. -5(b - 2)(b - 1)*3(b + 3) Solve -48735k5 + 342285k*4 - 2217035k*3/3 + 1367285k*2/3 - 10360k + 60 = 0. 2/171, 1, 3 Factor 2j2/9 + 14j/9 - 16/9. 2(j - 1)(j + 8)/9 Factor -3l3/2 - 100l*2 - 66l. -l(l + 66)(3l + 2)/2 Solve -35g*2/4 - 71g/4 - 1/2 = 0. -2, -1/35 Determine z, given that -4z5/17 + 198z*4/17 - 662z*3/17 + 838z*2/17 - 462z/17 + 92/17 = 0. 1/2, 1, 46 What is w in w*5/4 + 7w*4/4 + 5w*3/2 = 0? -5, -2, 0 Factor -2h*2/9 - 10h/3 + 728/9. -2(h - 13)(h + 28)/9 Determine b, given that 2b3/9 - 32b*2/9 + 154b/9 - 196/9 = 0. 2, 7 Factor -a*2/4 + 847a/4. -a(a - 847)/4 Factor -5x*4 + 25x*3 - 30x*2. -5x*2(x - 3)(x - 2) Factor -2n*3 + 2476n*2 - 7414n + 4940. -2(n - 1235)(n - 2)(n - 1) Factor -3c*2/7 - 24c/7 - 3. -3(c + 1)(c + 7)/7 Determine u so that -5u3 + 205u*2 - 200u = 0. 0, 1, 40 Factor 2d4 - 25d*3/3 + 28d*2/3 - 4d/3. d(d - 2)2(6d - 1)/3 Let 2x*5/9 + 2x*4/3 - 44x*3/3 + 436x*2/9 - 170x/3 + 22 = 0. Calculate x. -11, 1, 3 Factor y*5/2 + 29y*4/2 - 64y*3 + 66y2. y2(y - 2)2(y + 33)/2 Find b, given that -2b4 - 28b*3 - 48b*2 = 0. -12, -2, 0 Determine q, given that -2q*3/9 + 8q*2/9 - 2q/3 = 0. 0, 1, 3 Solve -2l4 - 62l*3 - 506l*2 - 330l + 900 = 0 for l. -15, -2, 1 Determine g so that -2g3 - 318g*2 - 12798g - 12482 = 0. -79, -1 Determine m, given that -12m3/5 - 63m*2/5 - 63m/5 - 12/5 = 0. -4, -1, -1/4 Factor 3o2 - 39o + 90. 3(o - 10)(o - 3) Factor -5z2 - 410z - 8405. -5(z + 41)2 Find s, given that s2/2 - s - 15/2 = 0. -3, 5 Determine s so that -2s*4 + 2s*3 + 48s*2 + 72s = 0. -3, -2, 0, 6 Let -3c5 + 39c*4 - 132c*3 - 48c*2 + 576c - 432 = 0. Calculate c. -2, 1, 2, 6 Factor 5t3 + 45t*2 + 70t. 5t(t + 2)(t + 7) Solve 5n*2 + 19550n + 19110125 = 0. -1955 Let -4c2 - 8c = 0. What is c? -2, 0 What is q in 2q3 - 26q*2 + 20q + 48 = 0? -1, 2, 12 Solve 63b5 + 3b*4 - 69b*3 - 3b*2 + 6b = 0 for b. -1, -1/3, 0, 2/7, 1 Determine l, given that -4l3 - 23l*2/3 - 13l/3 - 2/3 = 0. -1, -2/3, -1/4 Find n such that 3n4/8 - 21n*3/4 + 33n*2/8 + 219n/4 + 45 = 0. -2, -1, 5, 12 Factor -5r4 + 380r*3 - 6830r*2 - 14820r - 7605. -5(r - 39)2(r + 1)2 Let -u2 + 15u + 496 = 0. What is u? -16, 31 Factor -q2/8 + 8q - 128. -(q - 32)*2/8 Factor -5v*3 + 2475v*2 - 408375v + 22460625. -5(v - 165)3 Factor 2g*4 - 28g*3 - 34g*2 + 60g. 2g(g - 15)(g - 1)(g + 2) Suppose 2n3/3 - 28n*2/3 + 26n/3 = 0. What is n? 0, 1, 13 Determine x, given that -412232x2 - 5448x - 18 = 0. -3/454 What is q in 22q3/13 + 38q*2/13 + 10q/13 - 6/13 = 0? -1, 3/11 Factor -4a2 - 504a - 15876. -4(a + 63)2 Factor -2k*3 + 4k*2 + 2k - 4. -2(k - 2)(k - 1)(k + 1) Factor -2a*2 + 2a + 84. -2(a - 7)(a + 6) Factor -5w3 - 5w*2 + 10w. -5w(w - 1)(w + 2) Suppose 3z*4 + 78z*3 + 612z*2 + 1122z - 1815 = 0. What is z? -11, -5, 1 What is y in 3y3 - 348y*2 - 705y - 354 = 0? -1, 118 Suppose -2i4 - 576i*3 - 1716i*2 - 1712i - 570 = 0. What is i? -285, -1 Solve -j*4/2 - 47j*3/2 - 23j*2 = 0 for j. -46, -1, 0 Let -2i*3 - 22i*2 + 2i + 22 = 0. What is i? -11, -1, 1 Determine a so that -a*2/3 - 14a/3 - 13/3 = 0. -13, -1 Solve g*4 - 51g*3 - 333g*2 - 513g = 0 for g. -3, 0, 57 Solve -q*2/3 - 20q/3 - 17 = 0 for q. -17, -3 Factor -5c5 + 595c*4 - 26400c*3 + 513000c*2 - 3510000c - 4050000. -5(c - 30)4(c + 1) Factor z*2 - 1578z + 622521. (z - 789)*2 Determine j so that 2j*4 - 74j*3 - 240j*2 = 0. -3, 0, 40 Suppose -5s*4 - 3840s*3 - 1105920s*2 - 141557760s - 6794772480 = 0. Calculate s. -192 Determine q, given that -q*3/5 - 1343q*2/5 = 0. -1343, 0 Let -2f*5/9 - 520f*4/9 + 4826f*3/9 - 4304f*2/9 = 0. Calculate f. -269, 0, 1, 8 Find o such that 2o**5/3	{ "pile_set_name": "DM Mathematics" }
- r = -14. Let s be (4/360)/(2 - -1). Sort z, s, 1 in descending order. 1, s, z Let n be 1/(2 + -3 + 2). Let a = n + -1. Suppose 16 - 6 = -5t. Put t, -3, a in increasing order. -3, t, a Let i = 1440 + -1440.3. Put -527, i, 5, 4 in ascending order. -527, i, 4, 5 Let u be (3/(-6))/(0 - (-2)/(-104)). Sort 2, -4, u in decreasing order. u, 2, -4 Let l(c) = -c*2 + 2c + 4. Let x be l(3). Sort 4, 2, 7, x in decreasing order. 7, 4, 2, x Let s = -2.41 - 0.59. Let x = 4708/13 + -362. Sort x, 3, s, -0.4 in ascending order. s, -0.4, x, 3 Let r be (2 - 2)/(1 + -2). Suppose -3b + 4b - 19 = 5h, r = -2h - 4b + 10. Let d be -8 - (3 - 12)/3. Put h, 5, d in ascending order. d, h, 5 Let y(z) = -z2 + 10z - 1. Let l be y(7). Suppose 56 - l = 4q. Let i(h) = h2 - 9h + 5. Let c be i(q). Sort -5, c, 4. -5, 4, c Let g = 30.7 + -20.7. Sort 2/9, g, -2/11. -2/11, 2/9, g Suppose 2l + 4q = -24, -5l + 3l - 2q = 16. Let v be (5/(-10) - 1)(-43 - -1). Let a be (-45)/v + -1 + (-10)/(-14). Sort 0, a, l in increasing order. l, a, 0 Let s(r) = r*3 - 2r - 1. Let i be s(-2). Let n(g) be the first derivative of g*3/3 + 2g*2 - 4g - 1. Let c be n(-4). Sort c, i, 5 in increasing order. i, c, 5 Suppose -5u + 32 = -4v, -5u = 4v + 6 - 14. Sort u, -4, 34 in decreasing order. 34, u, -4 Let w be 0/(5/(-25)0 + -2). Sort 2, w, -6. -6, w, 2 Let x be 0(-2)/(-4)-1. Let o(d) = -6d*2 - 20d + 45. Let j be o(-5). Put x, -2, j, 2 in ascending order. j, -2, x, 2 Let g = -92/3 + 32. Let b = 4.4 + -2.3. Let c = -0.1 + b. Put c, g, 1 in descending order. c, g, 1 Let h be 2/(-18) + 740/666. Sort -2, 0.3, -5, h in ascending order. -5, -2, 0.3, h Let b = 0.9 + 0.1. Let j = -38.9 - 9.1. Let u = j + 51. Sort b, 1/2, u. 1/2, b, u Let b = 182 + -182.1. Sort b, -3/4, -3/10. -3/4, -3/10, b Let d = 5/24 + 23/120. Let t = -0.3 + 0.2. Sort t, d, -1 in descending order. d, t, -1 Let m be 24/4 + -1 + -3. Put 2/7, m, 4/11 in ascending order. 2/7, 4/11, m Let f = 0.42 + 0.58. Let h = 1.1 - 0.1. Let u = h + f. Sort u, -3, 7 in decreasing order. 7, u, -3 Suppose -156y + 435 = -151y. Let l = y + -97. Sort 5, l, -3 in ascending order. l, -3, 5 Let d = 1.3 + -1.3. Let q be (-2)/33/5. Let f = 3/98 - 205/294. Sort q, d, f in descending order. d, q, f Let f = 107.6 - 107. Sort -0.4, 0.3, f in descending order. f, 0.3, -0.4 Suppose -26 - 370 = 66a. Let s(f) = 4f3 + 5f*2 - 2f + 4. Let o(w) = w*2 + 1. Let q(t) = -5o(t) + s(t). Let v be q(-1). Sort 2, v, a in ascending order. a, v, 2 Suppose 3r = 4r + 3. Suppose v = i + 3i - 9, -4v = -i + 21. Suppose 4x - 8 = -4h, h - 19x + 24x - 14 = 0. Sort r, h, v in increasing order. v, r, h Let p = -47 + 46.48. Let y = p - -0.02. Put -2/5, 2, y, 5 in increasing order. y, -2/5, 2, 5 Let r(h) = -4h2 + h. Let s be r(1). Let p be 8/(-30)s/6. Let x = 0.02993 - 0.12993. Put p, x, -3 in descending order. p, x, -3 Let c = -0.077 - 0.413. Let m = -3.51 + c. Put -9, m, 4 in increasing order. -9, m, 4 Suppose 3a - 5v + 20 = 8a, 0 = a + 4v - 13. Let b = -47 + 60. Suppose by - 26 = 13. Sort y, -7, a in descending order. y, a, -7 Let r = 173 - 171. Put r, -1, 4 in decreasing order. 4, r, -1 Let i = 13 - 9. Suppose 2k - 36 = -16k. Sort k, 0, i. 0, k, i Suppose -9k - 28 = -16k. Put 37, 1, k in ascending order. 1, k, 37 Let h be 5(-1)/(-8)2. Let q be ((-312)/(-44))/6 + -1. Let c be ((-5)/10)/((-1)/(-6)). Put h, c, q in descending order. h, q, c Let f = 215/413 - -3/59. Let m = -4.5 - -4. Put f, -2, m in descending order. f, m, -2 Let c = -1.53 - -2.63. Sort -5, -1, c. -5, -1, c Let t = 0.0357 + 0.1643. Sort 1/3, 48, -5/3, t in decreasing order. 48, 1/3, t, -5/3 Let h be 2/(-6)28/((-280)/(-30)). Sort -10, h, -6, -2 in descending order. h, -2, -6, -10 Suppose 0 = 2k - 0k + 60. Let g be -4 - 4/(8/k). Sort g, -1, -3 in descending order. g, -1, -3 Let x be (16/(-40))/(1/(-10)) - -1. Put x, 1/7, -33 in ascending order. -33, 1/7, x Let q(r) = 186r3 + 10r - 9. Let n be q(1). Put 2, n, -4 in decreasing order. n, 2, -4 Let q = 3.57 + -3.57. Sort -3/7, q, -4. -4, -3/7, q Let p = -190/3 - -64. Sort -2/7, 0.2, 2, p in ascending order. -2/7, 0.2, p, 2 Suppose 0 = -2f + 6f + 16. Let j(w) = -8 - 11 + w + w + 22. Let q be j(f). Put 1, q, 3 in decreasing order. 3, 1, q Let c = 12 - 12.28. Let a = -18.28 - -17. Let j = c - a. Sort -2, j, -3/4 in ascending order. -2, -3/4, j Let f = 665 + -653. Put -1, 7, f in ascending order. -1, 7, f Let i = -663 + 662. Sort 0.1, i, 0, 90 in descending order. 90, 0.1, 0, i Suppose 2d - 3l - 2l = 109, -d - 2l = -68. Let u = 59 - d. Let h(p) = -3p. Let k be h(-1). Sort k, u, 4. u, k, 4 Suppose 22 = 7c - 5c. Let t = -19 + c. Let l = t + 6. Sort l, 2, -4 in descending order. 2, l, -4 Let m = 44 - 26. Let t = -15/26 + 1/13. Sort -2/3, m, t in increasing order. -2/3, t, m Let w be (9724/(-91))/11 + 10. Put w, -3/5, -589/6 in ascending order. -589/6, -3/5, w Let c be 280/200 + (3 - 2). Sort c, 3, -5 in decreasing order. 3, c, -5 Suppose 0 = 14y - 445 - 157. Sort 2, y, -2, 4 in ascending order. -2, 2, 4, y Let f(w) = 2w2 + 1. Let b be f(-1). Suppose 0n = -3n. Suppose n = -5v + 9v. Sort -3, v, b in decreasing order. b, v, -3 Suppose -4n - 123 = -99. Sort -3, n, 10. n, -3, 10 Let k be (136/15)/(16/360). Sort k, 4, 1. 1, 4, k Let o = -64 - -452/7. Sort 2/39, o, 0.2 in increasing order. 2/39, 0.2, o Let q = 1319 + -1320. Let w = 0 + 2. Sort 1/10, w, q. q, 1/10, w Let w = -0.2 - -2.2. Let x = 7 - w. Let a = -5 + 0. Sort a, x, 3 in increasing order. a, 3, x Let a(r) be the second derivative of r3/6 - 7r*2/2 - 2r. Let v be a(6). Let x be ((-10)/4)/((-160)/96). Sort x, v, 0.2 in increasing order. v, 0.2, x Suppose 103i - 203i = -105i. Put -4, 13, i, 1 in decreasing order. 13, 1, i, -4 Let u(s) = -s2 - 6s + 16. Suppose -2n + n + 2p - 6 = 0, 5n = -p - 41. Let a be u(n). Sort a, 1, 2 in decreasing order. 2, 1, a Let w be ((-6)/(-24))/(3/60). Sort w, -4, -0.029, -1/3 in descending order. w, -0.029, -1/3, -4 Let l = -1318 + 46147/35. Let u = 2/7 - l. Sort -3/5, -2, -2/9, u in descending order. u, -2/9, -3/5, -2 Let z = 1098 - 1124. Sort z, 3, 4. z, 3, 4 Let w = -1.67 - 3.33. Sort -4, w, -2, 1/16. w, -4, -2, 1/16 Let y(d) = -d2 + 1. Let h be y(1). Let c(l) = -l + 14. Let z be ((-3)/1 - -1) + 14. Let s be c(z). Put s, h, -3 in increasing order. -3, h, s Let u = -2199 - -2202. Sort u, 5, -109, 2 in ascending order. -109, 2, u, 5 Suppose 5l = 2l - 105. Let o = 139/4 + l. Suppose 0 = -6y + y + 35. Put o, y, 0.3 in descending order. y, 0.3, o Let y = -342 - -345. Sort 0.5, y, 16. 0.5, y, 16 Let v be -4(-16)/(-352) + 9/(-11). Put -39, 3, 4, v in descending order. 4, 3, v, -39 Let q(v) = -v3 - 17v*2 - 40v + 2. Let x be q(-3). Put -10, -5, x, 4 in descending order. 4, x, -5, -10 Suppose 0 = -5d, 5t + 0t - 2d - 15 = 0. Suppose -8o + to = -15. Let x(a) = -a - 4. Let j be x(-2). Put j, 1, o in decreasing order. o, 1, j Let h = 0.069 - -19.931. Let a = h + -20.2. Sort a, 0.4, -2/7. -2/7, a, 0.4 Let v = -20.3 + 25.3. Sort -2, v, 2, 0.8 in ascending order. -2, 0.8, 2, v Let l = -3 - 1. Let r(h) = 5h + 3. Let k be r(-3). Let o = k + 7. Sort -2, o, l in descending order. -2, l, o Let a = -372/17 - -20494/935. Let z(d) = -146d + 586. Let i be z(4). Put i, a, -0.4 in ascending order. -0.4, a, i Let j(s) = s*3 + 3s*2 - 6s - 8. Let n be j(-4). Suppose 2x + 4h = -nh + 20, 0 = 3h - 12. Put -16, -2/23, x in descending order. x, -2/23, -16 Let l = -397 + 341. Sort 5, l, -1/5, 0 in descending order. 5, 0, -1/5, l Suppose 0 = 4z + 79 + 41. Let h be 135/z(-8)/(-6). Let j(f) = 5f - 6. Let a be j(1). Sort 4, h, a. h, a, 4 Let l(h) = 2h*3 + 38h*2 - 37h + 63. Let n be l(-20). Put -325, -4, 4, n in decreasing order. 4, n, -4, -325 Let s be -3(-8)/(-72)-1. Sort s, 12, 4, 0.5. s, 0.5, 4, 12 Let d = -0.32 - -0.22. Sort 0, d, -0.2. -0.2, d, 0 Let v = 0.1 - 0.3. Let w be 3/5 - (-732)/(-2320). Let m = w + -1/29. Put m, v, -5 in decreasing order. m, v, -5 Suppose -5b - 2m = -1, -21b = -22b + 3m - 10. Put 5, b, 3, -197 in ascending order. -197, b, 3, 5 Let m(k) = 2k*2 - k - 1. Let d be m(2). Suppose dj - 7 = 3. Sort j, 6, 4, 5. j, 4, 5, 6 Let s = -125 - -124.9. Sort s, -4, -0.3, 2/9. -4, -0.3, s, 2/9	{ "pile_set_name": "DM Mathematics" }
w: 1, j: 4, d: 4, l: 5}? 4/285 Three letters picked without replacement from {b: 7, r: 2, x: 1, a: 4, l: 2, u: 1}. What is prob of picking 3 b? 7/136 What is prob of picking 1 j and 1 m when two letters picked without replacement from jttmjmjmmjjtcjjcct? 28/153 Three letters picked without replacement from uaunaffuaaaaaana. Give prob of picking 2 f and 1 a. 9/560 Two letters picked without replacement from {m: 1, g: 2, q: 2, f: 1, t: 2, i: 1}. What is prob of picking 1 t and 1 f? 1/18 Calculate prob of picking 2 u and 2 r when four letters picked without replacement from ryuryruyuyurryyyryy. 15/646 Four letters picked without replacement from {t: 12, u: 3}. Give prob of picking 1 u and 3 t. 44/91 Calculate prob of picking 1 o, 1 q, and 1 r when three letters picked without replacement from {q: 1, o: 1, s: 4, t: 4, e: 1, r: 1}. 1/220 Calculate prob of picking 3 x and 1 f when four letters picked without replacement from {x: 4, f: 10}. 40/1001 Calculate prob of picking 3 a when three letters picked without replacement from {a: 4, i: 1, x: 1, k: 5, p: 1}. 1/55 Two letters picked without replacement from {z: 1, l: 1, h: 1, s: 2}. What is prob of picking 1 s and 1 z? 1/5 Three letters picked without replacement from {f: 5, x: 2, l: 5}. Give prob of picking 1 f and 2 l. 5/22 What is prob of picking 2 c and 2 z when four letters picked without replacement from {c: 5, z: 3, j: 3}? 1/11 What is prob of picking 3 r when three letters picked without replacement from {r: 3, h: 5, o: 1, l: 6, x: 3, z: 2}? 1/1140 Calculate prob of picking 3 v when three letters picked without replacement from {v: 9, k: 3}. 21/55 What is prob of picking 3 r when three letters picked without replacement from {r: 3, c: 1}? 1/4 Three letters picked without replacement from acaaaaaaaaaaacaaacca. What is prob of picking 3 a? 28/57 Two letters picked without replacement from koufvsovsuvukvsvvv. Give prob of picking 1 f and 1 o. 2/153 Calculate prob of picking 1 t and 1 q when two letters picked without replacement from tqqtqtq. 4/7 Calculate prob of picking 2 o when two letters picked without replacement from {h: 7, o: 2}. 1/36 Three letters picked without replacement from {t: 6, z: 2, j: 1, f: 2, u: 1, n: 3}. Give prob of picking 1 j, 1 u, and 1 n. 3/455 What is prob of picking 1 l and 3 j when four letters picked without replacement from {l: 4, f: 1, j: 9}? 48/143 Four letters picked without replacement from efebbfeb. What is prob of picking 2 e, 1 b, and 1 f? 9/35 Calculate prob of picking 3 r and 1 n when four letters picked without replacement from {n: 4, r: 14}. 364/765 What is prob of picking 1 w and 1 f when two letters picked without replacement from {f: 2, n: 13, w: 5}? 1/19 What is prob of picking 1 y and 1 m when two letters picked without replacement from ynyqmunxm? 1/9 Two letters picked without replacement from pppppuppupuppu. Give prob of picking 2 u. 6/91 Calculate prob of picking 1 r and 3 a when four letters picked without replacement from {a: 7, i: 2, s: 3, r: 5}. 5/68 Two letters picked without replacement from {c: 9, u: 3, h: 4}. Give prob of picking 1 h and 1 u. 1/10 What is prob of picking 1 f and 1 e when two letters picked without replacement from {e: 1, f: 2, d: 1}? 1/3 Two letters picked without replacement from {l: 3, v: 8, t: 7, e: 2}. Give prob of picking 1 e and 1 t. 7/95 Two letters picked without replacement from ubjjujjuubjjj. Give prob of picking 1 b and 1 u. 4/39 What is prob of picking 1 v and 1 j when two letters picked without replacement from {z: 7, v: 5, j: 7}? 35/171 Four letters picked without replacement from {e: 12, x: 7}. What is prob of picking 2 x and 2 e? 231/646 Two letters picked without replacement from vlrpxpggrrgxrgr. Give prob of picking 1 l and 1 r. 1/21 Four letters picked without replacement from {c: 1, f: 2, h: 6, v: 4}. What is prob of picking 1 f, 1 c, and 2 h? 6/143 What is prob of picking 2 y when two letters picked without replacement from eeeeyeyeeyeeyy? 10/91 What is prob of picking 1 r and 1 f when two letters picked without replacement from {r: 1, x: 4, f: 2, u: 3}? 2/45 Calculate prob of picking 1 h, 2 d, and 1 g when four letters picked without replacement from {d: 11, o: 2, g: 2, h: 1}. 11/182 What is prob of picking 1 y, 2 h, and 1 a when four letters picked without replacement from {z: 2, a: 2, y: 2, h: 2}? 2/35 Calculate prob of picking 3 x when three letters picked without replacement from xzxxxxzxxxxxxxzzxx. 91/204 What is prob of picking 1 b and 1 i when two letters picked without replacement from {c: 4, i: 3, e: 4, b: 3}? 9/91 Calculate prob of picking 1 u and 1 x when two letters picked without replacement from {y: 4, x: 2, u: 2, n: 2, d: 9, h: 1}. 2/95 Four letters picked without replacement from iuuiiiiiiiiiuiiuui. What is prob of picking 2 u and 2 i? 13/51 Calculate prob of picking 1 f and 2 v when three letters picked without replacement from {v: 2, f: 2}. 1/2 Calculate prob of picking 3 x and 1 t when four letters picked without replacement from txxxtxtxxxxxtxtxxtx. 143/323 What is prob of picking 1 z and 1 m when two letters picked without replacement from {m: 2, w: 1, a: 6, z: 2, b: 1}? 2/33 What is prob of picking 2 g and 1 u when three letters picked without replacement from {e: 4, o: 1, g: 6, u: 1, f: 4}? 3/112 Three letters picked without replacement from {j: 2, w: 1, o: 2, b: 4, c: 10}. What is prob of picking 1 j and 2 b? 4/323 Three letters picked without replacement from {k: 4, g: 1, x: 1, z: 4, s: 4, r: 3}. What is prob of picking 1 r, 1 s, and 1 z? 6/85 Two letters picked without replacement from jrage. What is prob of picking 1 j and 1 g? 1/10 Two letters picked without replacement from {r: 11, c: 3}. Give prob of picking 2 c. 3/91 What is prob of picking 1 r, 1 s, and 1 m when three letters picked without replacement from srqnm? 1/10 Four letters picked without replacement from {q: 2, f: 2, g: 5, j: 3}. What is prob of picking 2 f, 1 q, and 1 g? 2/99 Calculate prob of picking 1 z and 3 r when four letters picked without replacement from srrssrzsrz. 4/105 Two letters picked without replacement from ccceeeeccccceccccce. Give prob of picking 1 e and 1 c. 26/57 Two letters picked without replacement from {d: 1, u: 4, f: 10, p: 1, b: 2}. What is prob of picking 2 f? 5/17 What is prob of picking 1 v and 1 h when two letters picked without replacement from hgggvgygvvvgg? 2/39 Two letters picked without replacement from qssssqssqssqsqssqqqq. What is prob of picking 1 q and 1 s? 99/190 Two letters picked without replacement from scqsssqsiysyq. Give prob of picking 1 q and 1 c. 1/26 Four letters picked without replacement from eekvkkkkkvekkkvkkv. Give prob of picking 4 k. 11/102 Four letters picked without replacement from {o: 3, s: 9}. What is prob of picking 3 o and 1 s? 1/55 Two letters picked without replacement from vssvv. What is prob of picking 2 v? 3/10 Three letters picked without replacement from dpddpdppdpddpddpdpp. Give prob of picking 3 d. 40/323 Two letters picked without replacement from lzzzzzsszzzzj. Give prob of picking 1 j and 1 s. 1/39 Three letters picked without replacement from mccommmc. Give prob of picking 2 m and 1 c. 9/28 What is prob of picking 4 m when four letters picked without replacement from {u: 4, w: 1, c: 2, m: 4, e: 6}? 1/2380 Calculate prob of picking 1 s and 1 i when two letters picked without replacement from {h: 10, s: 2, m: 3, i: 1}. 1/60 Calculate prob of picking 2 z and 1 c when three letters picked without replacement from {c: 5, z: 3, o: 7, n: 1}. 3/112 What is prob of picking 2 d when two letters picked without replacement from vdvvndnnvegvdn? 3/91 Calculate prob of picking 1 c and 2 s when three letters picked without replacement from ssltthssshsssltcs. 9/170 Three letters picked without replacement from looloooolo. What is prob of picking 3 l? 1/120 Four letters picked without replacement from tutgtttjzgzt. What is prob of picking 1 u, 1 g, and 2 z? 2/495 Two letters picked without replacement from {p: 12, m: 7}. What is prob of picking 2 p? 22/57 Calculate prob of picking 1 x and 1 h when two letters picked without replacement from {x: 1, h: 7, z: 3, p: 1, n: 2}. 1/13 What is prob of picking 1 r, 1 u, 1 k, and 1 l when four letters picked	{ "pile_set_name": "DM Mathematics" }
, d: 2, c: 2, i: 5, a: 2}. What is prob of sequence yd? 2/91 Three letters picked without replacement from {t: 7, x: 2, m: 4}. What is prob of sequence mtm? 7/143 Calculate prob of sequence lpp when three letters picked without replacement from {p: 3, l: 1}. 1/4 Calculate prob of sequence eejx when four letters picked without replacement from eleeljx. 1/140 Calculate prob of sequence ppp when three letters picked without replacement from klpsspslpikpss. 1/91 Two letters picked without replacement from jdkjkjk. What is prob of sequence kd? 1/14 Three letters picked without replacement from {g: 5, b: 2, y: 7}. What is prob of sequence gyy? 5/52 Two letters picked without replacement from {x: 6, i: 1, c: 5, d: 3}. Give prob of sequence id. 1/70 Three letters picked without replacement from ixiixhhmuihm. Give prob of sequence xxm. 1/330 What is prob of sequence wwo when three letters picked without replacement from jwoijiwoj? 1/126 What is prob of sequence tmm when three letters picked without replacement from ggzmwgwtgwmx? 1/660 Calculate prob of sequence ml when two letters picked without replacement from {b: 1, c: 1, z: 4, m: 2, l: 1, u: 3}. 1/66 Three letters picked without replacement from zdzzdzzuudzdz. Give prob of sequence ddu. 2/143 What is prob of sequence bmmb when four letters picked without replacement from kcmkmmkcbmcbbbmbbcb? 35/3876 Four letters picked without replacement from {r: 3, h: 4, x: 2}. Give prob of sequence rhxx. 1/126 Two letters picked without replacement from {k: 2, d: 2, v: 2, p: 1, l: 10, u: 2}. What is prob of sequence uk? 2/171 Three letters picked without replacement from {r: 5, m: 4, e: 1, b: 4, n: 1}. What is prob of sequence mbb? 8/455 Two letters picked without replacement from qkukq. Give prob of sequence uq. 1/10 Three letters picked without replacement from nrnpsnnprp. What is prob of sequence pnn? 1/20 Two letters picked without replacement from {h: 1, u: 2, t: 1, g: 3}. What is prob of sequence ht? 1/42 Calculate prob of sequence smmm when four letters picked without replacement from {m: 4, s: 10}. 10/1001 Two letters picked without replacement from gigtgggggi. What is prob of sequence ti? 1/45 Two letters picked without replacement from {u: 1, g: 8, t: 2, q: 2}. What is prob of sequence qq? 1/78 Calculate prob of sequence cnn when three letters picked without replacement from cnnc. 1/6 What is prob of sequence nh when two letters picked without replacement from {h: 13, n: 2, g: 3}? 13/153 Four letters picked without replacement from {n: 4, y: 1, r: 1, h: 4, m: 3, d: 2}. What is prob of sequence yrrn? 0 Three letters picked without replacement from tiicttctt. Give prob of sequence tic. 5/126 Two letters picked without replacement from {p: 1, l: 1, r: 6, c: 6, y: 1, m: 1}. Give prob of sequence cl. 1/40 Four letters picked without replacement from {s: 5, x: 7}. What is prob of sequence sxxx? 35/396 What is prob of sequence ua when two letters picked without replacement from {u: 7, s: 1, e: 1, a: 5, o: 2}? 7/48 Two letters picked without replacement from opazo. What is prob of sequence po? 1/10 Four letters picked without replacement from zeegjj. Give prob of sequence zgje. 1/90 What is prob of sequence tt when two letters picked without replacement from {t: 2, v: 4, i: 3, k: 1, m: 4, r: 1}? 1/105 What is prob of sequence ykjc when four letters picked without replacement from {j: 4, k: 2, c: 1, y: 1}? 1/210 What is prob of sequence cccc when four letters picked without replacement from {w: 7, c: 4}? 1/330 Two letters picked without replacement from {e: 2, b: 3}. Give prob of sequence be. 3/10 Three letters picked without replacement from ppppppp. Give prob of sequence ppp. 1 What is prob of sequence xha when three letters picked without replacement from wkwwwxwxwwxywhka? 1/1120 Calculate prob of sequence kkxb when four letters picked without replacement from rtkxrkbbs. 1/756 Three letters picked without replacement from cebc. What is prob of sequence bec? 1/12 Calculate prob of sequence ma when two letters picked without replacement from fafvcaffaxfmfaavc. 5/272 Calculate prob of sequence ii when two letters picked without replacement from xggixggxgiii. 1/11 What is prob of sequence cyzc when four letters picked without replacement from {h: 3, z: 1, d: 3, c: 2, y: 1}? 1/2520 Four letters picked without replacement from zzhzhzzzzzfzfzff. Give prob of sequence zfhz. 3/182 Calculate prob of sequence ddd when three letters picked without replacement from {t: 2, h: 1, j: 1, d: 5}. 5/42 Two letters picked without replacement from {n: 3, l: 1, j: 4}. What is prob of sequence nj? 3/14 What is prob of sequence yiu when three letters picked without replacement from iziuhuyyuyiuyyyyyyiy? 4/171 Calculate prob of sequence bbyy when four letters picked without replacement from {y: 5, b: 4, u: 2}. 1/33 Calculate prob of sequence llgr when four letters picked without replacement from {r: 1, g: 4, l: 5, c: 1}. 1/99 Three letters picked without replacement from {g: 1, i: 1, c: 2, e: 2}. What is prob of sequence eci? 1/30 Calculate prob of sequence dod when three letters picked without replacement from {r: 1, d: 3, o: 2, s: 6, n: 5, p: 3}. 1/570 What is prob of sequence kk when two letters picked without replacement from kkrkkkkkrkkkkkkkkk? 40/51 Three letters picked without replacement from {m: 9, n: 6, o: 2}. Give prob of sequence nnn. 1/34 Calculate prob of sequence hyf when three letters picked without replacement from {t: 2, h: 1, f: 1, r: 1, e: 2, y: 1}. 1/336 Three letters picked without replacement from jlkjkjljkjjjkjjjllj. Give prob of sequence lkk. 8/969 Two letters picked without replacement from {b: 1, n: 2, z: 1, v: 5, m: 1}. What is prob of sequence vz? 1/18 What is prob of sequence dhno when four letters picked without replacement from dohoodnchdg? 1/440 Two letters picked without replacement from sqsqqsqfaq. What is prob of sequence ss? 1/15 What is prob of sequence xxca when four letters picked without replacement from {a: 2, x: 3, c: 3}? 3/140 Three letters picked without replacement from xtflj. Give prob of sequence llj. 0 What is prob of sequence ujl when three letters picked without replacement from ffftjtfttttfluttt? 1/4080 What is prob of sequence nx when two letters picked without replacement from {n: 2, x: 9, s: 7, r: 1}? 1/19 Four letters picked without replacement from hjhhjhjhhhh. Give prob of sequence jjhh. 7/165 Four letters picked without replacement from hdrphhfhr. What is prob of sequence pfrf? 0 What is prob of sequence wttt when four letters picked without replacement from {t: 3, k: 5, w: 5}? 1/572 Two letters picked without replacement from zzizizzzzimji. What is prob of sequence jm? 1/156 Two letters picked without replacement from zbzbzzz. What is prob of sequence bz? 5/21 Three letters picked without replacement from kflklkppdsfkpdllsf. What is prob of sequence fkf? 1/204 Calculate prob of sequence ai when two letters picked without replacement from {a: 3, i: 2, m: 3}. 3/28 Four letters picked without replacement from {x: 2, k: 7, t: 2, z: 4, b: 1, r: 4}. What is prob of sequence kbtt? 7/58140 Calculate prob of sequence blbb when four letters picked without replacement from llblblblll. 1/120 Three letters picked without replacement from {q: 2, v: 1, a: 2, g: 1, m: 1, t: 1}. What is prob of sequence tvm? 1/336 Three letters picked without replacement from {e: 7, v: 1, o: 1, x: 3, j: 4, f: 4}. Give prob of sequence vxo. 1/2280 Three letters picked without replacement from {e: 1, t: 1, k: 4, o: 4, m: 1, x: 3}. Give prob of sequence mxx. 1/364 Two letters picked without replacement from {f: 2, r: 3}. Give prob of sequence fr. 3/10 Calculate prob of sequence yeyi when four letters picked without replacement from yiiieeeeeeeyi. 7/2145 Four letters picked without replacement from {m: 2, u: 2}. What is prob of sequence mumu? 1/6 Calculate prob of sequence jgeg when four letters picked without replacement from {g: 5, j: 1, t: 1, e: 2}. 5/378 What is prob of sequence moy when three letters picked without replacement from romicmyo? 1/84 Two letters picked without replacement from zww. What is prob of sequence wz? 1/3 What is prob of sequence ec when two letters picked without replacement from	{ "pile_set_name": "DM Mathematics" }
or x? x Let r be -12/(-18)-3. Let d = -1324 - -7927/6. Which is bigger: r or d? r Suppose -6 = 2d + d. Let a(y) = y3 + 7y*2 + 5. Let g be a(-7). Suppose 2b = 3m + gb, 4b = -3m + 3. Do d and m have the same value? False Let y(n) = n*2 + 15n + 15. Let r be y(-16). Let b = r - 30. Are b and 2 equal? False Suppose -516x = -508x. Which is smaller: 2/497 or x? x Let n = 8 - 9. Let h be -1 - (n - 552/15). Let r = -37 + h. Is r at least as big as -1? True Let n = 66/5 + -13. Let i = 151/780 - n. Let k = -145/1716 + i. Is -1 equal to k? False Suppose 2n = -5g - 4 + 1, n = 2g + 3. Let o = -3/2 - g. Is -4 greater than or equal to o? False Let s be (-56)/15750(15/(-6) - -1). Which is smaller: s or -1? -1 Let y = -77 + 79. Let n be ((-1)/13)/(y/(-6)). Is n less than -1? False Let m(r) = 33r2 + 36r*2 + 11 + 24r - 68r2. Let q be m(-24). Does q = 31/3? False Let y be (75/12)/((-1)/4). Let w = y + 16. Let g = w + 10. Which is greater: g or -7? g Suppose -4t + 17 = 9. Suppose -2 - t = s. Is s less than 2/11? True Let w = 285921/121 + -2363. Which is greater: 0 or w? 0 Let c = 24365/12 - 2052. Let k = 46/3 + c. Are -6 and k non-equal? True Let l = 2709 + -2711. Let w(f) = -f*2 + 7f + 6. Let d be w(6). Let i = 8 - d. Is i > l? False Suppose 3q = 12 + 3. Suppose qz - 8 = 7. Let x be -3(4 + -2 - z). Which is greater: 6 or x? 6 Let t(c) = 2c*2 + 14c - 13. Let h be t(-10). Suppose 3g + h = -4f, 3g = -0f + 3f + 30. Which is greater: f or -8? -8 Let v(u) = -u2 + u + 4. Let i be v(3). Let s be 5/(-50)i-32. Is -5 < s? False Let f be (-420)/1029 - (-6)/15. Is -1 >= f? False Let h be (-1 - 4) + 1 + 3220/736. Which is greater: 0.03 or h? h Let k be 9 + 6/(444/(-766)). Is k at least as big as -1? False Let q = 105 - 96. Let z(b) = -6b + 53. Let i be z(q). Is i bigger than -4/39? False Let v = 75 + 2. Let c = -75 + v. Is -0.003 at least as big as c? False Let f be (-43)/1204(-4)/23. Which is smaller: f or 2? f Suppose 3p - 4j = -5 + 18, 0 = -4p + 5j + 16. Let i = 1/1369 - -39659/57498. Let y = 6/7 - i. Which is smaller: p or y? p Let k = -118 - -131. Let o = k - 19. Is o greater than -1? False Let c be 10 - ((-128)/(-6))/2. Which is greater: -24.9 or c? c Suppose 10 = 152m - 150m. Suppose -271 + 1723 = 3z. Let r = 1955/4 - z. Is m > r? True Let h be (28/72)/((-1)/(-412)). Let w = h + -160. Are w and -1 nonequal? True Suppose -2l = 5v + 8, 0 = 12v - 7v - 4l - 16. Is v at most as big as -2/167? False Let l be (-9)/3 + (4 - 2). Let h = -594/1519 + 16/49. Are h and l unequal? True Suppose 5d = 4d + 26. Suppose -2u - 51 = -2w - 3u, -2w + 52 = 2u. Are w and d nonequal? True Let f = 0.89 - 46.89. Let d = f - -33. Which is bigger: -2 or d? -2 Let q = 11/5 + 17/15. Is q equal to 2? False Let n = 26 - 24. Let i be (9/(-7) + n)9/15. Are i and -1 unequal? True Suppose 2h = 5h + 5289. Let d = h + 160435/91. Is -1 > d? False Let l = -17.67 - 0.33. Let d = l - -18.06. Let o = d + -0.16. Which is greater: o or 3? 3 Let p(i) = -13i + 47. Let a be p(10). Is -83 smaller than a? False Let t = -2 + -3. Let q be (-4)/2 + 2 - -2. Let c be (-17)/20 + q/t. Is 0 at least as big as c? True Let b be 12/6 - (-3 + 3). Let n = 3 - b. Let r be n/222/22. Is 1 bigger than r? True Let c(w) = w2 + 1. Let x be c(-3). Suppose -x = -m - 0m. Suppose 14k = mk + 4. Which is bigger: k or 2? 2 Let t = -357.8 + 358. Which is greater: t or 440? 440 Let n(b) = -b*3 - 10b*2 - 11b + 3. Let k be n(-8). Suppose 3q + 85 = -2z, 4z = -q + 2q - 149. Is z greater than or equal to k? False Let u be 2/((-4)/(-7)7/6). Suppose 4t + 10 = -d, -ud + 2t = 6t + 14. Let p be (1/(1/1))/(-2). Which is bigger: p or d? p Let l = -590 + 586. Is l less than or equal to 0.087? True Let j = -12 - -8. Let c be 2 - 0/(j/(-2)). Suppose 3 = -cv - 3. Which is bigger: v or -7/4? -7/4 Let k be -7 + 7 - (-1 + -14). Suppose 3h + 2h + k = 0. Let i(d) = d - 1. Let n be i(h). Is n < -4? False Let y be -21 + (23 - -5 - 4). Suppose 0 = -j - j + y. Which is bigger: 8 or j? j Let k be ((-3)/(-14))/((-122)/(-488)). Let p = 0.2 + -0.7. Let u = p + 0.3. Which is smaller: k or u? u Let s(z) = -3z*3 + 3z*2 - 3z - 1. Let l be s(2). Is -2/43 at least l? True Let k = 252 - 281. Which is smaller: k or -146/5? -146/5 Let q = 100.749 + 0.251. Let u = q + -101.07. Which is smaller: 0.2 or u? u Let b = -1507/1794 + 2/299. Let l = -1/6 - b. Do 0 and l have the same value? False Let k = 992 + -302. Let u be (-670)/k + (-1 + 0)-1. Which is bigger: u or -1? u Suppose 826 - 232 = -22m. Is -27 equal to m? True Suppose -56r + 55r = -1. Which is smaller: -9/181 or r? -9/181 Let g = -439.8 - -441. Which is bigger: 3 or g? 3 Let o = -23 + 31. Suppose p = 3c + 3p + 29, -c = -5p - 13. Let f = c + o. Is f at most -1/3? False Let s(n) be the first derivative of 3n*2 - 28n - 5. Let d be s(8). Is 19 greater than or equal to d? False Let z = 18 + 7. Let n be (50/4)/((-10)/4 + 2). Let x = z + n. Which is smaller: x or -1? -1 Let q(l) = -l*2 + 20l - 116. Let r be q(14). Are -35 and r equal? False Let z = 3/10 - 3/110. Is z != 0.03? True Let r(t) = 23t + 298. Let c be r(-13). Is c smaller than -44/27? False Let w = -44 - -38. Let z be 3/9-14(-27)/w. Is -22 != z? True Let n = -6.5 - -3.3. Let j = n - -3.4. Is j >= 15? False Let s = -494 - -498. Which is bigger: s or 23? 23 Let y(n) = n - 10. Let u be y(7). Let a be (-1)/((-3)/(-58)) + (-1)/u. Is a at most as big as -19? True Suppose -7u - 2338 = 2219. Is u smaller than -651? False Let h be 478400/(-39845) - -26. Is 1 less than h? False Let p(v) be the first derivative of -v6/360 - v5/24 - v4/24 - v3 + 3. Let z(r) be the third derivative of p(r). Let u be z(-5). Is u at most -1? True Let g(l) = 2l - 14. Let m be g(9). Let j = 12 + -7. Suppose 30 = jh - 0h. Which is smaller: h or m? m Let k(d) = -47d3 - 4d*2 + 8d - 7. Let l be k(2). Are -379 and l unequal? True Let t be 7 + 1930/(-280) + (-2)/(-14). Let w(g) = g*2 - g. Let c be w(0). Is t >= c? True Let v = 1078 + -1080. Do v and 0.377 have the same value? False Suppose 0 = -5x - 284 - 356. Which is bigger: -129 or x? x Suppose j = 6a - 4a - 7, -2a - 4j = -32. Let h be (a - 138/(-42)) + (-2)/7. Is 9 at most as big as h? True Let o(h) = h*3 - 5h*2 + 5h - 14. Let w be o(5). Is 7 at most w? True Let n = 71/3 - 8609/363. Does -1 = n? False Suppose -5v + 3q + 0 + 15 = 0, -2v + 5q + 6 = 0. Suppose -33 + 9 = -3m. Let p = -7 + m. Which is smaller: p or v? p Let a(t) = 44t*2 - 2t. Let f be a(1). Are f and 40 equal? False Suppose -4v - 2 = 2j, -2v - 3j = -5v - 24. Which is bigger: v or 0.23? 0.23 Let x be (-3 - (1 - 2)) + 6. Suppose 4 = -3f + xf. Let c be ((4015/(-198))/(-73))/(5/3). Which is smaller: c or f? c Let i = 2.01 - 2. Suppose 0 = 5b - 0b + 10. Let v be b/(-5)(-55)/(-22). Is v at least i? True Let i(q) = -2q2 - 2. Let u be i(4). Let w = u + 42. Which is smaller: w or 1? 1 Let r = 4.06 - 0.06. Let j be 8/(-5)(-129)/(-12). Let z = -17 - j. Which is smaller: r or z? z Let b = -360 - -10437/29. Suppose w + 2w = -5g - 10, 12 = 2g - 2w. Which is smaller: g or b? b Let d = -1020 - -1006. Let x = 3 + -3. Do d and x have the same value? False Let c(y) = y*3 - 12y*2 + 2y + 16. Let g(f) = -f*2 - 8f - 4. Let z be g(-4). Let r be c(z). Which is smaller: r or 39? 39 Let v(h) = -15h - 31 + 2h*3 + 14h*2 - 3h*3 + 42. Let n be v(13). Which is smaller: -14 or n? n Let t be -6(-1)/(-2) - 85/(-29). Do t and 0 have different values? True Let o = 829 - 785. Which is smaller: o or 42? 42 Let y be ((-39)/(-230))/((-15)/(-3759452)). Let z = y - 42498. Let i = z + -6/25. Is 0.1 >= i? True Let b(n) = n*2 + 5n + 4. Let q be b(-5). Let l be (3/(-6))/((-34)/289). Is q smaller than l? True Let q = 0.05 + 7.15. Let g = -8.2 + q. Which is smaller: g or -6/13? g Let l = 23 + -8. Let s be l(-1 + 8/5). Which is bigger: 29/3 or s? 29/3 Let r be (39/(-377))/((-1)/(-3)). Is 1 not equal to r? True Let w be 118/554/(-36). Which is bigger: -4 or w? -4 Let m be -41-53/(-20). Let s be (((-8)/m)/4)/(-25 - -27). Which is smaller: -6/13 or s? -6/13 Let y be (25 - 18)(-4)/(-7). Suppose 3i - 2 = 5u, 0 = -5u + yi - 3i - 4. Is u > -3? True Let v be (-	{ "pile_set_name": "DM Mathematics" }
3). Differentiate 3uj + 2 - 2u*3 - 2u*3 + 2u*3 with respect to u. 3u*2 Let c = 3/14 - -2/7. Let m(f) be the second derivative of 3f + 0 - cf2 + 1/4f*4 + 0f*3. What is the derivative of m(z) wrt z? 6z Let x(y) be the second derivative of y6/120 - y5/30 - y*3/2 + 4y. Let k(p) be the second derivative of x(p). What is the second derivative of k(w) wrt w? 6 Let j(l) be the third derivative of -25l4/24 - 19l*3/3 + 11l*2. What is the derivative of j(x) wrt x? -25 Suppose -4t = -14 - 2. What is the derivative of 0h2 + 0 - 2 - th*2 + 2h*2 wrt h? -4h Let n = 4 - 2. What is the derivative of -no2 + 0o*2 - 2o*2 + 5 wrt o? -8o Let u(o) = 9o4 - 2o*2 + 13o. Let b(p) = -8p4 + 3p*2 - 13p. Let g(m) = 2b(m) + 3u(m). What is the second derivative of g(q) wrt q? 132q2 Let z be 1/(((-3)/(-6))/1). Find the third derivative of -m + m - 3m2 - m3 + 6mz wrt m. -6 Let l(q) = -q3 - 6q - 1. Let t(m) = 3m3 + 11m + 3. Let f(r) = -11l(r) - 6t(r). What is the derivative of f(d) wrt d? -21d2 What is the second derivative of -7 - 1 + 70m*2 + 8 - 65m wrt m? 140 What is the second derivative of 5k3 - 5k*3 - 2k + 2k4 - 7k wrt k? 24k2 Let m(y) = y3 + y2 + y - 5. Let v be m(0). Let c = 9 + v. What is the derivative of cx - x - 2 - x wrt x? 2 Suppose 6 = -4b + 14. Find the third derivative of -2tb - t3 - 3t2 + 4t*2 wrt t. -6 Suppose 4a - 5a + 2 = 0. Differentiate 5m2 - m2 - 3 + 2ma - 4m*2 with respect to m. 4m Let c(j) be the first derivative of 5j3/3 - 7j2/2 + 13. What is the second derivative of c(i) wrt i? 10 Let g(n) be the third derivative of -n6/60 - 5n5/12 + n4/12 - 23n*3/6 - 8n*2. What is the second derivative of g(d) wrt d? -12d - 50 Let y(p) = 6p4 - 3p*2 + 3p + 2. Let a(w) = -11w4 + 7w*2 - 7w - 3. Let v = 14 + -7. Let q(d) = vy(d) + 3a(d). Differentiate q(h) with respect to h. 36h3 Let t(r) = 9r*3 - 20r*2. Let f(u) = -9u*3 + 20u*2. Let h(q) = 4f(q) + 5t(q). What is the third derivative of h(d) wrt d? 54 Let m(t) be the first derivative of -t7/7 - t6/3 + 10t*3/3 - 3t + 4. Find the third derivative of m(f) wrt f. -120f3 - 120f*2 Let y(x) = -15x*4 - 5x*3 + 5x*2 - 5x - 1. Let s(t) = 8t4 + 3t*3 - 3t*2 + 3t. Let q(o) = 5s(o) + 3y(o). What is the derivative of q(l) wrt l? -20l3 Let p(z) be the first derivative of 3z + 1 + 3/2z2. Differentiate p(w) with respect to w. 3 Let v(b) be the third derivative of 7b6/60 + b5/4 + 25b2. Find the third derivative of v(w) wrt w. 84 Suppose 11 + 7 = 3h. What is the third derivative of -6q3 + hq3 - q2 + q*3 + 2q*3 wrt q? 18 Let j(a) be the second derivative of 3a5/20 - a4/12 + 5a. What is the third derivative of j(b) wrt b? 18 Find the second derivative of 28y*3 + 5y - 28y3 - 4y*5 + 4y wrt y. -80y3 Let l(r) = r2 - 9r - 8. Let s be l(10). Suppose -20 = -2q - 4m, 2q - 6m + 2m = -20. What is the second derivative of -sp + 2p2 + qp - 3p2 wrt p? -2 Let b(i) be the first derivative of 0i*2 + 0i*3 + 4 - i + 0i*4 - 3/5i*5. Differentiate b(u) with respect to u. -12u3 Let n(q) = -q5 + 4q3 - 7q*2. Let k(m) = 5m*3 - 8m*2. Let w(j) = 4k(j) - 5n(j). What is the third derivative of w(p) wrt p? 300p2 Let k(h) = h4 - h*2. Let s(g) = 13g*4 - 10g*2. Let u be (1 - (3 - 3))/(-1). Let m(q) = us(q) + 4k(q). What is the third derivative of m(x) wrt x? -216x Let v = -10 + 13. Let o(f) be the third derivative of 1/60f5 + 1/6f*v + 0f*4 + 0 + 0f + f*2. Differentiate o(a) wrt a. 2a Suppose 2u - 4 = -5g, -3g - 7 - 1 = -4u. Suppose -uc - 2c + 24 = 0. What is the third derivative of -b*3 + 0b2 - b2 + b3 + bc wrt b? 120b3 Let i(l) be the first derivative of 3/5l*5 + 1/2l*2 + 2 + 0l*3 + 0l*4 + 0l. What is the second derivative of i(w) wrt w? 36w2 Let c be (-4)/36/(-4). Suppose 5d = -5j, cd = 5j - d - 32. Differentiate 4b4 - 2b*j - 3 - 4b*4 with respect to b. -8b3 Let w(g) be the second derivative of -g6/10 + g*2 + 7g. What is the derivative of w(k) wrt k? -12k3 Let y(f) = -f4 - 3f*3 - 3f. Let l(j) = -j*2 + 4j - 11j + j3 + 8j. Let k(n) = 3l(n) + y(n). Find the third derivative of k(u) wrt u. -24u Find the third derivative of 100l2 - 107l*2 + 4l*6 + 3l*6 wrt l. 840l3 Let l(f) = -f3. Let w(k) = -15k4 - 6k*3 + 32k. Let t(q) = 6l(q) - w(q). What is the second derivative of t(s) wrt s? 180s*2 Suppose 0d + 12 = 3d. Let w(k) be the third derivative of 0 - 1/3k*3 + 0k - 2k2 + 1/24k*d. Differentiate w(x) with respect to x. 1 Let s(v) = 12v*2 + 17v. Let w(y) = 42y2 + 60y. Let b(f) = 18s(f) - 5w(f). Find the second derivative of b(c) wrt c. 12 Differentiate 12 + 8 + 35v + 19 - 16 with respect to v. 35 Let i(b) be the second derivative of 9b*5/20 + 5b*3/2 - b. Let d(y) = 4y*3 + 7y. Let q(o) = 13d(o) - 6i(o). Find the second derivative of q(x) wrt x. -12x Find the third derivative of -5q*4 - 18q*4 + 4q*2 - 8q*4 wrt q. -744q Suppose b + 0b = 5. Suppose -b = -4r + 3. What is the second derivative of 3v2 - 2v - 2vr + 0v wrt v? 2 Let x(o) be the third derivative of 0 + 0o6 + 0o*3 + 0o - 1/105o7 + 0o*5 + 5/24o*4 + 7o*2. Find the second derivative of x(t) wrt t. -24t*2 What is the second derivative of -6l*2 - 8l + 5l + 4l wrt l? -12 Let n(p) be the first derivative of 14p3/3 + 24p + 2. Differentiate n(d) wrt d. 28d Let c(j) be the first derivative of j6/30 - j3/3 - j2/2 + 2. Let i(o) be the second derivative of c(o). Differentiate i(v) wrt v. 12v*2 Let w = 23/84 - 1/42. Let g(i) be the second derivative of 0i*2 - 1/2i*3 + 0 - 3i + wi4. Find the second derivative of g(n) wrt n. 6 Differentiate -22d*4 + 7d*4 + 7 - 23 + 2 wrt d. -60d3 Let p(y) be the second derivative of y6/180 - y5/120 - y3/3 + 4y. Let b(u) be the second derivative of p(u). Find the second derivative of b(a) wrt a. 4 Let w(i) = 8i*3 + 3i*2 + 3i + 5. Let z(v) = 7v3 + 2v*2 + 2v + 4. Let c(g) = 2w(g) - 3z(g). What is the derivative of c(j) wrt j? -15j2 Let g = -2 - 0. Let o be g/(-1) + 28/(-4). Let m(q) = q2 + 2. Let f(p) = -2p*2 - 3. Let n(l) = of(l) - 6m(l). What is the derivative of n(a) wrt a? 8a Let g(p) be the second derivative of p*6/15 - 2p*5/15 - 4p*2 + 7p. Let w(l) be the first derivative of g(l). Find the third derivative of w(d) wrt d. 48 Let s(b) be the first derivative of 5b7/7 + 9b*3 + 4. What is the third derivative of s(v) wrt v? 600v3 Let a(x) be the second derivative of x6/5 + 5x3/6 + 14x. What is the second derivative of a(k) wrt k? 72k2 Suppose 0b - 2b = -6. Suppose a - 4d + 8 = -2d, -5a + 5 = -d. Differentiate 0hb + 3 + ah*3 - 2 wrt h. 6h*2 Let j be 0/(-6 - 12/(-3))-1. Let t(p) be the third derivative of 0p5 + jp + 0p4 - 2p*2 - 2/3p*3 + 0 + 1/40p*6. Differentiate t(s) wrt s. 9s*2 Let s(h) = 35h*4 - 5h3 - h2 + 5h - 5. Let l(m) = 18m*4 - 3m*3 + 3m - 3. Let q(k) = -5l(k) + 3s(k). What is the third derivative of q(t) wrt t? 360t Find the second derivative of 5i*4 - 8i*4 - 6i*4 + 7i wrt i. -108i2 Let s(d) be the first derivative of d8/14 - 11d*4/12 + d - 6. Let j(y) be the first derivative of s(y). Find the third derivative of j(q) wrt q. 480q*3 Let u = 4 - 0. Find the first derivative of 0 - 7 - 2n*2 + u wrt n. -4n Let z(d) be the third derivative of d9/1890 + d7/420 - d*4/4 - 2d*2. Let j(q) be the second derivative of z(q). Find the third derivative of j(b) wrt b. 192b Let y(r) be the second derivative of r*4/2 + 2r3/3 - r2/2 - 2r. Let i(a) = 7a*2 + 5a - 1. Let j(v) = -4i(v) + 5y(v). Differentiate j(k) wrt k. 4k Let c(z) be the second derivative of 16z3/3 + z2 - 60z. Find the first derivative of c(s) wrt s. 32 What is the third derivative of -18o*6 - 2o*2 + 5o*2 + 14o*6 wrt o? -480o*3 Find the third derivative of 146t*3 - 9t*4 + 31t*2 - 146t3 - t2 wrt t. -216t Let o(h) = 15h*3 - 2h**2 + h. Let q be o(1). Let c be 60/q - (-4)/(-14). Differentiate a + 4 - 2 -	{ "pile_set_name": "DM Mathematics" }
-246743j - 2j*2 - 246698j + 493441j + 2j*2 - 74j*3 + 0j*2. -74j*3 Collect the terms in 148i - 2i2 + 142i + 149i - 21 - 526i + 87i. -2i*2 - 21 Collect the terms in 902m + 78m + 37m*2 - 20m*2 - 23m*2 - 980m. -6m2 Collect the terms in 1715s*3 + 1391s*3 - 3s - 3174s3 + 2s. -68s3 - s Collect the terms in -z2 - 6266z + 1 + 2z2 + 2z*2 - 2z2. z2 - 6266z + 1 Collect the terms in 155g*3 - 2g + 949g3 + 322g*3. 1426g*3 - 2g Collect the terms in -319833 + 319831 - 340o - 2075o. -2415o - 2 Collect the terms in -5358p + 11034p - 5659p. 17p Collect the terms in -5445407w*2 - 30934w*2 - 129435w*2 - 5862043w*2. -11467819w*2 Collect the terms in 160991792f - 80495900f - 80495854f. 38f Collect the terms in -6v + 16v2 + 0v - 2983 - 13v2 - v + 9v. 3v2 + 2v - 2983 Collect the terms in -10974s - 78s*2 + 10974s - 79s2 - 40s*2. -197s2 Collect the terms in -b2 + b*2 + 4766 - 15401 + 4772 + 5863 + 10b*3. 10b*3 Collect the terms in -2m*2 - 1019 + 472 + 113 + 28m + m*2 - 28m. -m*2 - 434 Collect the terms in 6f - 9363f2 + 6f - 2881f2 - 4f - 8f. -12244f*2 Collect the terms in -2 - 149y + 48y - 87y*2 + 50y + 49y. -87y*2 - 2y - 2 Collect the terms in -109 + 109 - 1462911d3. -1462911d*3 Collect the terms in -378i*3 - 382i*3 - 583i*3 - 381i*3 + 1718i*3. -6i*3 Collect the terms in 45b*2 - 315003058b - 397b2 + 315003058b. -352b2 Collect the terms in m + 40m*3 - 122m*3 + 468m*2 - 135m*3 - 468m*2. -217m*3 + m Collect the terms in -234l - 256l - 475252 + 475252 + 459l. -31l Collect the terms in -1108m*3 + 250m*3 - 822m*3. -1680m*3 Collect the terms in 7u - 2 - 11u + 4u - 611u2 - 643u*2. -1254u*2 - 2 Collect the terms in 69l*3 - 34l*3 - 13l*3 + 311l + 0l3 - 309l. 22l3 + 2l Collect the terms in -4016q + 4 + 45q*3 + 49q*3 - 106q*3. -12q*3 - 4016q + 4 Collect the terms in -18209h - 279h*2 - 18201h + 54603h - 18193h. -279h2 Collect the terms in -50759 - 51788 + 102547 + 56j. 56j Collect the terms in 346 - 74j*2 + 23j*2 + 24j*2 + 26j2. -j2 + 346 Collect the terms in 35617q - 35517q - 8695 + 8695. 100q Collect the terms in -2c*3 + 0c*3 + 33c - 212c - 246c + 154c. -2c*3 - 271c Collect the terms in 23w2 + 13w*2 - 20w + 15w + 76w - 240w2. -204w*2 + 71w Collect the terms in 4n + 727n*3 - 4n + 319n3 + 1141n*3. 2187n*3 Collect the terms in -3a*2 + 3454 + 3a + 3a + 0a - 4a. -3a*2 + 2a + 3454 Collect the terms in 2a2 - 1641a*3 + 3472624 - 2a*2 - 3472624. -1641a*3 Collect the terms in -4803x*2 + 0 - 12 - 1 + 4816x*2. 13x*2 - 13 Collect the terms in 0 - 532360j - 4 + 4. -532360j Collect the terms in -60577j - 60861j - j2 + 121438j. -j*2 Collect the terms in -263l + 16163l3 + 8l - 2l2 - 16160l*3 + 2l*2. 3l*3 - 255l Collect the terms in 9842h3 - 18713h*3 + 9323h*3. 452h*3 Collect the terms in 8058y + 8402y + 3969y + 1 + 931y + 3063y. 24423y + 1 Collect the terms in 20d - 764d + 29d. -715d Collect the terms in 184 - 81 + 6f*3 - 89 - 74. 6f*3 - 60 Collect the terms in 98913 - 197804 - 10z + 10z2 + 10z + 98891. 10z2 Collect the terms in -80v - 1 + 23 - 1368v2 + 1366v*2. -2v*2 - 80v + 22 Collect the terms in -6135m2 - 49m + 58m - 9m. -6135m2 Collect the terms in 1640a + 1612a + 1626a - 1 + 1 - 4904a. -26a Collect the terms in -243783f2 - 243794f*2 - 243794f*2 + 731365f*2. -6f*2 Collect the terms in 23887z*3 + 109z*2 - 109z*2 + 10z + 2 - 9z. 23887z*3 + z + 2 Collect the terms in -2972f*2 - 1367f*2 + 2396f*2. -1943f*2 Collect the terms in 14 + 157c - 587c - 142c. -572c + 14 Collect the terms in 468 - 95 + 9d - 98 - 123 - 119. 9d + 33 Collect the terms in 3862s*2 + 3887s*2 + 3886s*2 - 15494s*2 + 3878s*2. 19s*2 Collect the terms in -12719f*2 - 177229f*3 + 354465f*3 - 177228f*3 + 12719f*2. 8f*3 Collect the terms in 4 + 1240996x - 4 + 4760098x. 6001094x Collect the terms in 371z3 - 180z*3 - 7z - 189z3. 2z*3 - 7z Collect the terms in -24c - 51c - 25c - 20c - 22c - 42c + 225c. 41c Collect the terms in 31r3 + 26r*3 - 19r*3 - 52r*3 + 27r*3 + 22r*3. 35r*3 Collect the terms in 2092t - 20722t + 18569t. -61t Collect the terms in 12447869f + 242f3 - 12447869f. 242f3 Collect the terms in 81453g - 121500g - 73991g - 79438g. -193476g Collect the terms in -2018w - 25624w - 42095w - 7692w. -77429w Collect the terms in 8446b*3 + 17809b*3 - 4b - 3488b3. 22767b*3 - 4b Collect the terms in 395r3 + 1138r*3 - 3562r*3 - 4467r*3. -6496r*3 Collect the terms in -2311 - 2315 - 2311 - 19f*3 + 6937. -19f*3 Collect the terms in 496621497o*2 + 496621509o*2 - 993242997o*2. 9o*2 Collect the terms in -14745v + 7411v - 5v*3 + 2v*3 + 7398v + 2v3 - 2. -v3 + 64v - 2 Collect the terms in -254j2 + 126j*3 + 394j*3 + 254j*2. 520j*3 Collect the terms in 819 + 83x*3 - 126x*3 - 819 + 162x*3 + 206x*3. 325x*3 Collect the terms in 122w*2 + 28w*2 + 66w*2 - 65w*2. 151w*2 Collect the terms in -3m - 9m + 8m - 24m + 15m + 0m. -13m Collect the terms in -23q - 15q - 172q + 15q - 297q. -492q Collect the terms in 749714184v2 + 749714205v*2 - 1499428408v*2. -19v*2 Collect the terms in -35093s + 17513s + 17580s - 74s2. -74s*2 Collect the terms in 559v - 32 + 4 - 511v + 20 + 8. 48v Collect the terms in 187863g2 + 64074g*2 + 2173g*2 - 53983g*2 + 104140g*2. 304267g*2 Collect the terms in 28542t*3 + 21 - 9 - 12 - 14262t*3 - 14134t*3. 146t*3 Collect the terms in -94x*2 - 95x*2 + 166x*2 - 3x + 845x3. 845x*3 - 23x*2 - 3x Collect the terms in 5w + 4w - 9w - 455w*2 + 246w*2 + 211w*2. 2w*2 Collect the terms in 93i*3 - 51i*3 + 140i*3 - 39891 + 115i*3 - 53i*3 + 39891. 244i*3 Collect the terms in -6r + 0r2 + 15r + 3r2 - 1620 + 1615 - 4r2. -r2 + 9r - 5 Collect the terms in 147 - 7a + 140 - 769 + 482. -7a Collect the terms in 14w*2 + 166w*3 - 5w*2 - 152w*3 - 5w*2 - 4w*2. 14w*3 Collect the terms in -2j*2 - 1449j - 934j + 1106j. -2j2 - 1277j Collect the terms in -2216w2 + 453w*2 + 5w*3 - 7w*3. -2w*3 - 1763w*2 Collect the terms in -479m + 0m - 651m - 573m - 434m. -2137m Collect the terms in -185563p*2 - 1163p + 1163p. -185563p*2 Collect the terms in -62t - 118858 - 119272 + 238133. -62t + 3 Collect the terms in -8z*3 - 586 + 85778z - 171553z + 17z*3 + 85777z. 9z3 + 2z - 586 Collect the terms in -a*2 - 4a*2 + 55058 + 7a*2 - 28282 - 28027. 2a*2 - 1251 Collect the terms in 208 + 10 - 570c - 218. -570c Collect the terms in -740180t + 3233882t + 3626158t. 6119860t Collect the terms in 16 + 75v*2 - 1239v*3 - 7 - 1158v*3 - 76v*2 - 9. -2397v3 - v2 Collect the terms in 4o + 1731 + o + 417 + 2o - 5o. 2o + 2148 Collect the terms in -18558l2 + 4825l*2 + 2668l*2. -11065l*2 Collect the terms in 18704x - 5865x - 5864x - 6974x. x Collect the terms in -59946d - 3441d + 2269d - 25037d + 5918d. -80237d Collect the terms in -75494095 + 465p*3 + 75494095. 465p*3 Collect the terms in -2733i*2 + 40197 - 20098 - 20099. -2733i*2 Collect the terms in -1714j*2 - 6388j*2 - 103j*2 - 13450j*2. -21655j*2 Collect the terms in 27g*2 + 458g - 3g2 + 111 - 110 - 6g*2. 18g*2 + 458g + 1 Collect the terms in 178w - 117 + 152w + 145w - 481w + 117. -6w Collect the terms in -60l - 63l - 68 + 47l*2 + 3l*3 + 125l. 3l3 + 47l*2 + 2l - 68 Collect the terms in 531h3 - 16299h + 32596h - 16297h + 175h3. 706h*3 Collect the terms in -18f*2 + 181174 - 181174 - 3f*3. -3f*3 - 18f*2 Collect the terms in 735b*2 + 741b*2 + 627b*2 + 737b*2 - 3582b*2 + 742b*2 + 27b*3. 27b*3 Collect the terms in -f - 28f - 68f - 97f + 4f. -190f Collect the terms in -137l + 253l - 499l - 953l + 72l2. 72l*2 - 1336l Collect the terms in 27259t - 2769t + 9133*t. 3	{ "pile_set_name": "DM Mathematics" }
(k) - 13n(k)? k2 - 151k + 2 Let b(k) = -1. Suppose 0 = -32v + 927 - 16479. Let c = -480 - v. Let m(z) = 5z + 8. Let s(x) = 4x + 8. Let o(j) = 3m(j) - 4s(j). Calculate cb(h) - o(h). h + 2 Suppose -356s + 131s = -129s + 192. Let b(o) = -2o*2 + 22o + 22. Let d(q) be the second derivative of -q3/6 - q2/2 + 4q. Determine sb(y) - 44d(y). 4y*2 Let y(t) = -4t*2 - 6t - 1. Let i(q) = 2q2. Let v(j) = -12j*2 - 3j. Let m(u) = 5i(u) + v(u). Let z be -5 + 6 + -5 + 8 + -1. What is zy(k) - 7m(k)? 2k*2 + 3k - 3 Let l(v) = -v*2 - 2v. Let q be (-168)/(-336) - (-1)/2. Let p(d) = d*2 + d. Give ql(n) + 2p(n). n2 Let d(h) = -43911399h*3 - 107734h*2 + 161601h. Let s(y) = -4891y3 - 12y*2 + 18y. Give 6d(q) - 53867s(q). -4897q3 Let p(q) = 11q - 5. Let j(t) = 4t - 2. Let o(k) = -8j(k) + 3p(k). Let g(y) = -31y + 5y - 4 + 1 + 14y + 9y. Determine -g(u) - 4o(u). -u - 1 Suppose -3i + 24 = -4m + 74, 3i = -5m + 76. Let t(u) = 5 - 17u + 32u - mu. Suppose -4 = -x - 7. Let o(j) = -6j - 26. Give xo(h) - 16t(h). 2h - 2 Let b(t) = -3t2 + t + 1. Let d(w) = w3 + 8w2 + 4w - 9. Give 3b(o) + d(o). o3 - o2 + 7o - 6 Suppose 13 - 38 = 5b. Let o(j) = -j3 + 2j - 5. Let z(m) be the third derivative of m6/120 - m4/8 + 7m3/6 - 9m*2. What is bz(r) - 7o(r)? 2r*3 + r Let p(v) = 4v*2 - 6. Let d = 4982 - 4979. Let w(s) = 1. Let m(u) = -11u*2 + 19. Let h(q) = m(q) - 2w(q). Let n = 12 + -4. Calculate dh(z) + np(z). -z*2 + 3 Let a(p) = 3p*3 - 2p + 2. Let q = 5082 - 5083. Let z(i) = -i*2 + i - 1. Give qa(h) - 2z(h). -3h*3 + 2h*2 Let q(k) = -49k*3 - 7k. Suppose -7z - 2z = -2z - 49. Let g(m) = -24m*3 - 3m. Give zg(x) - 3q(x). -21x3 Let z(j) = 459j - 3451. Let b(g) = g - 29. Give -595b(i) + 5z(i). 1700i Let t(c) = 83c*3 + 11c*2 - 37c - 15. Let u(r) = -128r3 - 17r*2 + 57r + 23. Give -11t(a) - 7u(a). -17a3 - 2a*2 + 8a + 4 Let k be 2(1 + -1 + 1). Let s(p) = 2p. Let m(z) = 15z + 1. Let t = 34316 + -34330. What is km(j) + ts(j)? 2j + 2 Let q(n) be the third derivative of -3n5/20 + n4/12 - 30n*2 - 6n. Let p(g) = -36g2 + 9g. Calculate -4p(b) + 18q(b). -18b2 Suppose -4 = -4b + 28. Let v(r) = -10 + 28 + 2r - 12 - br - 8. Let k(s) = -5s - 1. Give 4k(z) - 3v(z). -2z + 2 Let i(d) = -d*2 - 4d + 2. Let t(y) = 129y2 + 38y + 3. Calculate 2i(m) - t(m). -131m*2 - 46m + 1 Let u(h) = 57h2 + 61h - 9. Let m(v) = 19v2 + 21v - 3. Calculate 17m(o) - 6u(o). -19o2 - 9o + 3 Let v(g) = -3g2 + 2g - 3. Let w(f) be the first derivative of -f3/3 + f2/2 - f - 26. Let a be (-5)/3 + 10/15. Give av(s) + 2w(s). s*2 + 1 Suppose -10r + 773 = 193. Suppose 2j - 2 = 3b, 44 = 3b - 5j + r. Let p(s) = s + 2. Let y(l) = -1. Calculate by(z) - p(z). -z - 4 Let h(v) = 3733v + 9. Let j(c) = 63422c + 152. What is -152h(d) + 9j(d)? 3382d Let u be 2/672/6. Let z(r) = -4 + 0 - 4 - r + 3. Let y(h) be the second derivative of -2h*2 + 14h. What is uy(v) - 3z(v)? 3v - 1 Let n(l) = 8l*3 + 25l*2 - 5l - 90. Let y(u) = -4u3 - 10u*2 + 2u + 45. Determine 2n(b) + 5y(b). -4b3 + 45 Let x(o) = -665o*3 - 2o - 15. Let w(y) = -998y3 - 3y - 24. Calculate -5w(l) + 8x(l). -330l3 - l Let w be 1572/262 + (2 - 1) + -10. Let k(u) = -6u*2 + 9u - 5. Let j(c) = 5c2 - 9c + 4. Determine wk(f) - 4j(f). -2f2 + 9f - 1 Let x(v) = 28v + 9. Let j(a) = -42a - 12. What is 5j(h) + 7x(h)? -14h + 3 Let t(j) = 51j + 34. Let s(y) = -44y - 32. Give -6s(a) - 5t(a). 9a + 22 Let d(f) = -2489548f2 - 10629f - 21258. Let h(x) = 1171x2 + 5x + 10. What is -5d(i) - 10629h(i)? 1181i2 Suppose 0 = -1048g + 1055g - 133. Let n(d) = 20 + 6d*2 - 9d*2 + 2d*2 - g. Let y(u) = 16u*2 - 11. Determine -22n(l) - 2y(l). -10l*2 Let o(b) = b - 2. Suppose -47 + 350 = 101r. Let q(a) = 1. Give ro(l) + 2q(l). 3l - 4 Let b(u) = -u2 - 2u + 6. Let v(a) = -6a2 - 10a + 31. Determine -22b(w) + 4v(w). -2w2 + 4w - 8 Let q(v) = -70673 + 35351 + 35343 + 17v. Let l(h) = 6h + 7. Calculate 8l(f) - 3q(f). -3f - 7 Let i(j) = -111j + 6218. Let g be i(56). Let q(f) = -f*2 - 6f + 2. Let n(m) = -2m2 - 13m + 5. Calculate gn(h) - 5q(h). h*2 + 4h Suppose 325 = 78u + 91. Let w(n) = -3n*3 - 4n*2 + 11. Let s(l) = -2l*3 - 3l*2 + 11. Calculate uw(a) - 4s(a). -a3 - 11 Let n(r) = -7r3 + r2 + 5r - 9. Let c(m) be the second derivative of 11m5/20 - m4/12 - 4m3/3 + 7m*2 - 1048m - 2. Calculate -5c(s) - 8n(s). s*3 - 3s*2 + 2 Let d(q) = 8q*2 - 6q - 5. Let f(g) = -50g2 + 37g + 24. Give 38d(x) + 6f(x). 4x2 - 6x - 46 Let v(i) = 5i + 48. Let h(g) = 2g + 16. Suppose -37q - 2s - 8 = -35q, -16 = q - 2s. Give qh(x) + 3v(x). -x + 16 Let b(h) = -135. Let f(n) = -44n + 272. Let m(v) = 6b(v) + 3f(v). Let y(c) = -44c + 2. Determine 3m(r) - 8y(r). -44r + 2 Let p(x) be the second derivative of -x3/3 - x2/2 - 6957x. Let i(s) = -5s - 3. Calculate 6i(y) - 13p(y). -4y - 5 Let j(z) = 981z. Suppose -18h + 13h = -2i - 16, 0 = -h + 2i + 8. Let y(x) = -20x. What is hj(k) + 99y(k)? -18k Let c(i) = -i + 1061. Let y(l) = -2l + 2130. What is 10c(z) - 4y(z)? -2z + 2090 Let c(o) = 23o*2 - 3513o - 11. Let u(h) = 10h2 - 1754h - 5. Calculate 3c(s) - 7u(s). -s*2 + 1739s + 2 Let w(t) = -45t - 83. Let q(v) = 89v + 178. Determine -6q(f) - 13w(f). 51f + 11 Let w(h) = 65h - 2798. Let g be w(43). Let y(x) = 13x3 + 3x*2 + 6x + 3. Let z(l) = l*2 + l + 1. What is gz(k) + y(k)? 13k3 + 3k Let i(h) = 1070h - 45. Let s(k) = -189k + 8. Calculate -7i(j) - 40s(j). 70j - 5 Let y(d) = -172 - 216 - 3d - d + 396. Let s(j) = -5j + 8. Determine -2s(o) + 3y(o). -2o + 8 Let o(z) = z*2 + 2z + 6. Let f(j) = -j*2 - 3j - 5. Let x = 4862 - 4860. Determine xo(t) + 3f(t). -t*2 - 5t - 3 Let d be (-38)/(-7) - (-15)/(-35). Let t = 623 - 620. Let k(n) = 3n - 3. Let h(l) = -7l + 5. Calculate dk(q) + th(q). -6q Let d(r) = 2r*2 - 18r + 313. Let z(m) = -2m2 + 15m - 312. What is 4d(i) + 5z(i)? -2i2 + 3i - 308 Let o(m) = -2m + 17m + 3m - 77m*3 - 27m + 9m2. Let y(h) = 19h*3 - 2h*2 + 2h. Give 2o(u) + 9y(u). 17u3 Suppose 3 - 13 = 2h - 4a, 2a - 17 = -3h. Let r(b) = 2b + 1. Let j(s) = -3s. Let p(y) = hr(y) + 4j(y). Let u(d) = 12d - 5. Calculate -7p(w) - 4u(w). -6w - 1 Let j(q) be the first derivative of q2/2 + q - 86. Suppose 4g - 5s + 15 = 0, 3s - 7 - 2 = 2g. Let o(x) = g + 0 + 1. Calculate j(p) - 2o(p). p - 1 Let i(r) = -793r2 - 5r + 5. Let h(d) = -32118d2 - 202d + 202. Determine -5h(s) + 202i(s). 404s2 Let y(h) = 1. Let j(p) be the first derivative of 3p*2 - 5p - 7. Let f = -2962 + 2957. Give fy(q) - j(q). -6q Let m = 0 - 1. Let b(r) = r*2 - r + 1. Let z(y) = 16y + 0 - 11y - 8y*2 - 5 + 4y*2 + 5y*2 - 2y. Calculate mz(h) - 4b(h). -5h2 + h + 1 Let f(m) = -21m*3 + 22. Let d(t) = -33t*3 + 34. Give -5d(v) + 8f(v). -3v*3 + 6 Let h(i) = -2i + 3. Let b(k) be the second derivative of -k*4/24 + 20k*2 - 81k. Let c(t) be the first derivative of b(t). What is -c(m) + h(m)? -m + 3 Let j = 4954 + -4955. Let x(u) = -u*2 - 1. Let h(b) = 26b*2 + 65. Determine jh(k) - 65x(k). 39k*2 Let c(z) = -1707z*2 + 18z - 11. Let u(i) = -1280i2 + 13i - 8. Give 8c(r) - 11u(r). 424r2 + r Let o(t) = -40t*2 - 24. Let d be 960/500 + 2/25. Let v(b) = 3 - 6167b*2 - 8 + 6159b*d. Determine -5o(c) + 24v(c). 8c*2 Let u(z) = 5z + 1280. Let m(k) = -5k - 1363. Calculate 3m(s) + 4u(s). 5s + 1031 Let c(r) be the third derivative of 0 + 0r + 3/8r*4 + 68r*2 - 7/6r*3. Let g(o) = -o + 1. Determine -c(p) - 6g(p). -3p + 1 Let m(h) = -h3 - h + 1. Let d be 3/(-2) - 2/(-4). Let r(w) = 4w*3 + 7w*3 + 13w + 5w3 - 2110 + 10w*3 - 19w*3 + 2104. What is dr(j) - 6m(j)? -j3 - 7j Let z(w) = -7w - 7. Let d(t) = 5 - 2 - 5 - 6 - 8t. Let b = -705 - -699. Determine bd(u) + 7z(u). -u - 1 Let m(x) = 2x + 28. Let w(c) be the first derivative of c2/2 + 27c - 1489. Calculate -2m(n) + 3w(n). -n + 25 Let f(h) = 3470h3 - 5205h*2 + 78075h + 5205. Let t(g) = 2	{ "pile_set_name": "DM Mathematics" }
- w for a. 2 Suppose -4s + 2 = -6. Solve 2t + 4b = -t + 12, 3b - 9 = st for t. 0 Suppose 5x + 5 = l, 4 = 5l + 4x - 21. Suppose -3g = -lg + 4. Solve 0b + j = -2b - 3, gj = 2 for b. -2 Let p(t) = -t2 + 4t - 3. Let c be p(2). Let f(u) = 2u. Let r be f(c). Let a be -1 + 4 - (3 + -1). Solve h - 3v = 9, 5 + a = -h - rv for h. 0 Let q be (-2)/42-5. Let g = 40 + -21. Solve -qw - 4 = 2v - 0, 3v - g = 5w for w. -2 Suppose -2s + 3 = -3. Solve -5u = 0, su + 0 + 4 = -2o for o. -2 Suppose 3s = -5 + 2. Let a be (4/8)/(s/(-80)). Solve r - 10 = -4o + 9o, -5r = 5o + a for o. -3 Let h = -71 + 74. Solve -k - 3k - 24 = -4o, -12 = hk - o for k. -3 Suppose 0 = -10r + 6r. Solve 0 = -5u + 3w - w - 7, r = 5u + 5w for u. -1 Suppose -36 + 16 = -w. Solve -5d = -p - w, -4d + 3p = -d - 24 for d. 3 Let b be ((-12)/(-8))/(6/80). Solve l = 3i + 10, 5i - 6 = l - b for l. 4 Let p = -9 + 13. Suppose 5f + 14 = -0h - 2h, -ph + f + 16 = 0. Suppose -2x + 25 = hx. Solve 2w = -xs - 27, 2s + 3w + 6 = 7w for s. -5 Suppose g = -4w + 14, 7w - 5g = 3w + 2. Solve t = 5v + 19, 0 = -wv - 9 for t. 4 Suppose -2r + 29 = 5p, 4r - 5p + 3p + 2 = 0. Solve rl - 3f - 2 = -6f, -3f - 1 = -l for l. 1 Suppose -2j - 13 + 3 = 0, -2w + 4j + 56 = 0. Solve -2c = n - 10, 0 = -5n + 5c - 7 - w for n. 0 Suppose -5 - 13 = -6y. Solve 11 = -h - yj, -j + 4 = 3h - 3 for h. 4 Suppose 4y - 9 + 1 = 0. Let k = -1 + 1. Let x = k + y. Solve xv - 8 = p, 6p = p - 4v + 16 for p. 0 Suppose -v = -3x + 4 + 10, -x = 2v - 7. Solve 0 = -4g - 5z + 7, g + g - x = -z for g. 3 Suppose -5v + 4 = -u - 13, -3u = 3v - 21. Let c = -17 - -17. Solve u = 3k + 3z, c = 4k - 6z + z + 14 for k. -1 Let w be (1 - 29)(-2)/4. Let q be (1 + (-12)/(-9))3. Let k = w - q. Solve -2x - 3v + k = 0, 3 - 10 = -4x + v for x. 2 Let w(i) = i3 - 6i*2 + 7i - 6. Suppose 3z + 2z + l - 28 = 0, 2l - 26 = -4z. Let d be w(z). Solve k = 3g, 3k - k = dg for g. 0 Suppose -4 = 4q - 0. Let d be 6/(-3)q/1. Solve 5t + 3a = -20, dt - 5a + 4 = -4 for t. -4 Let z(a) = -a3 - 5a*2 + 7a + 9. Let d be z(-6). Let h = -21 + 29. Let b(x) = 4x - 3. Let n be b(2). Solve d = m - j, 3m + 31 = -nj + h for m. -1 Suppose 4u + 2 = -4m - u, u + 8 = 3m. Solve 5k = 5, 0 = 2c - mk - 2k - 2 for c. 3 Suppose -u = 6u. Solve -2h - 3k - 2 = u, 4h + 4k = h - 4 for h. -4 Let x(o) = -o - 1. Let u be x(-3). Solve 2c - z = -u, c + 10 = 6c + 5z for c. 0 Let j(g) = 11g2 + 4g + 3. Let r be j(-1). Solve 2b - b = 4x - 12, x = -3b - r for x. 2 Suppose -3k = -4k + 4, -4j + 3k = 0. Let m(a) = -a + 2. Let b be m(-4). Suppose bv = 2v + 20. Solve jd = 7i - 3i - 11, d = 2i - v for d. -1 Suppose g + g = 10. Suppose -5o - 21 = -4o + gc, -5o + 15 = c. Solve j = -3l + 11, 0 = j - 6j - ol + 33 for j. 5 Let q = -1 + 3. Let w be (-4)/q(-3 - -1). Solve -3n + 4p + 12 = -4n, 2p - w = 2n for n. -4 Suppose 3k + 0k + 3y = 0, -5y = 10. Suppose -5f + 23 = 3. Let a(c) = -c2 + 6c - 6. Let b be a(f). Solve bq = o + k, 2q + 2 + 4 = -3o for q. 0 Let f be (-98)/(-21)(-12)/7-3. Solve 4j - 4h = -f, -4j - 16 = 2h + 2 for j. -5 Let l(j) = 6j*2 - 3j - 4. Let b be l(-4). Let c = b - 72. Solve 3f + 2f + c = 4a, -4a - 4f - 4 = 0 for a. 3 Let o(n) = 6 - 2n*3 + 3n3 + n2 - 4n2 - 4n. Let h be o(4). Solve 3c = h, -4y + c = -0c - 2 for y. 1 Let l be ((-12)/(-10))/(3/15). Let g be 1/3 + l/9. Let h be 9/g + 1/(-1). Solve m + 4 = -o + 4o, 3o = -m + h for m. 2 Let b be (-27)/(-6)(-6)/(-9). Let k(o) = -o*3 + 25 - 3o - o - o*2 + bo. Let g be k(0). Solve 4v + 5 = 2p + g, -v + p + 7 = 0 for v. 3 Suppose 5u = -4f + 9, 0 = 4u - 2f + 3f - 16. Let s be (8/5)/(4/10). Let g = 1 + s. Solve -4c = -4a - 4, g - 1 = 2a - uc for a. -3 Suppose -2b + 42 = 2k - 0k, 2k = 4b - 90. Solve 0 = i + i + 3q - b, -q - 21 = -5i for i. 5 Suppose 2j - 10 + 0 = 5t, -2t - j - 4 = 0. Let p = t + 7. Let l = p + -2. Solve -3d + 0x = 2x - 9, -ld + x = -18 for d. 5 Let t be 7((-11)/(-7) + -1). Solve -ty = -4i, -5y = i + i + 7 for y. -1 Let k(i) = i3 + 3i*2 + i - 2. Suppose 6v + 8 = 2v. Let q be k(v). Solve -3c = -qd + 3d - 21, 4d - 10 = 2c for d. 4 Let n(o) = -3o - 6. Let k be n(-3). Solve j + 12 = 3j + 2z, -kj = -5z + 6 for j. 3 Suppose -72 = c - 78. Solve d + 9 = cd + 2p, d - 5p = -9 for d. 1 Let u = 8 + -9. Let k = u - -19. Solve -2c = 5z - 19 - 10, -c + 4z = k for c. 2 Suppose 0 = -4l - 20, 0 = 3b - 0b + 5l + 19. Solve 4p + 4 = -4y, -4p + by - 2 = 4y for p. 0 Suppose -22b = -17b. Solve b = 5d, 2h = d + 2d for h. 0 Suppose 4 = -3u + 2y - 1, u + 3 = 2y. Let g = 2 - u. Solve -5k + 0k = -gn + 13, 2k + 6 = 2n for k. -2 Let j = -8 - -13. Solve 4u - 5b + 0 + j = 0, 0 = -3u - 3b + 3 for u. 0 Let l be (6/(-2))/(-6(-4)/(-32)). Suppose i - 6i = -50. Suppose -4p + 2 = 3g - i, lp - g = -4. Solve m + 4r - 6 = p, -4m + 3 = -4r - 1 for m. 2 Suppose -l = -j + 3j - 1, -21 = -3j + 5l. Suppose 0d = -2d + 8. Let t = d - j. Solve -v = -2g + 2, -tg + 18 = 2g + 5v for g. 2 Let k be 2 - (-2 + -2)/(-2). Let d be -3(4 - 1) - -1. Let p = 11 + d. Solve 3q - 3 = -3n, -q + 2n - p + 13 = k for q. 4 Let j = 28 + -25. Solve l = p + 5, -jl + 16 = -5p - 3 for l. 3 Let y(l) = l*2 + 2l - 8. Let x be y(-4). Let h be 21/3 - (0 - 1). Suppose 2r = -xr + h. Solve 2k + 2k - 3n + 29 = 0, 0 = 4k + rn + 8 for k. -5 Let n be ((-46)/(-18) + -3)(-18)/4. Solve -h - 22 = -6h - ny, -9 = -3h + 3y for h. 4 Suppose -4b + 4f + 44 = 0, 2b - f + 2 = 25. Solve -g - 3g - 5l + 18 = 0, 5g + l = b for g. 2 Let n = 16 + -19. Let h be 4(2 - n/(-4)). Solve 9 = -3p - 3d, 2p + 3 = p - hd for p. -3 Suppose 5k - 9 = 1. Let w = 23 - 41. Let t be (-158)/w - 8/(-36). Solve l + t = -4p, 5l + k + 11 = -4p for l. -1 Let n be 6/9 - (-22)/3. Suppose 0 = -3w + w + n. Solve -6 - 2 = wj - 4u, -3j - 4 = -4u for j. -4 Let o(n) = n. Let z be 2/(1 - (-4)/(-8)). Let c be o(z). Solve -10 = -5s + 4x, 4s - cx + 2x = 8 for s. 2 Suppose 5t + 0 = -5. Let x = 5 + t. Solve -17 = -5m + j, -5j = xm - 2m + 4 for m. 3 Let z(w) = -3 - 4w - w + w2 - 2. Suppose 2j - 5v - 21 = 0, 3j + 3v - 25 = 4v. Let m be z(j). Solve 4b - k - m = 7b, -b - 21 = 4k for b. -5 Let d be (1 + 0)(-8 + 10). Solve 0 = -4a, d = l - 0l + 2a for l. 2 Let m = 170 + -166. Solve p + 5d = 21, mp - d = -p + 1 for p. 1 Let k be 2 - (-3 - -3 - 0). Solve 0 = -3t - kr - 2, -5 = -5t - r - 6 for t. 0 Let o = -38 + 70. Suppose -o = -0u + 4u. Let g be u/(-2)(-22)/(-4). Solve 3f + 11 = 2c - 0f, -c - 4f - g = 0 for c. -2 Let r(b) = -5 + 3 - 1 - b2 - 8b. Let g be r(-7). Let c be 41 - (-2 - 2). Solve -j = -gl + c, 2j - l - 1 = 4 for j. 4 Suppose -3t + 6 = -5y + 28, -2y = -5t - 24. Suppose -4h - 2z = -26, -h - yh + 3z - 3 = 0. Solve -hi = -0a - 2a + 12, i - 4a = 11 for i. -5 Suppose 0 = 5k - 10k + 5. Solve -y = s + k, 3s - y + 0 = 1 for s. 0 Suppose -2m + 9 + 4 = -3o, 29 = 5m - 4o. Suppose mv - 7 = 8. Solve p + w + 7 = 0, -5p + 6w - v = 3w for p. -3 Let r = 17 - 12. Suppose rs = 5 + 5. Solve sk + 3i = -3k - 3, -4k - 4 = 2i for k. -3 Suppose 27n = 22n + 10. Solve 0 = u - 2 - 2, f - n = -u for f. -2 Suppose 0s - 12 = -2j - 4s, -6 = -3j - 3s. Let o(y) = -y3 - 2y*2 - 2y. Let x be o(j). Suppose 2 = 2k - x. Solve i - w - 5 = -3w, 4i = -kw for i. -3 Let m be 42/9(5/2 + -1). Solve 2b + 19 = -3n, n = -4b + 4n + m for b. -2 Let c(v) = 2v + 8. Let p be c(-3). Solve -r - 5w - p = 0, 0 = -r - w - 2w for r. 3 Let r = 9 + -6. Suppose 2a + 121 = ry + 4a, -5y - 4a = -205. Solve -2f = -5d + 2f + y, 0 = d + 3f + 4 for d. 5 Let w(y) = 2y - 4y3 - 7 + 5y*2 - 10y + 5y3. Suppose -5b - 4 - 26 = 0. Let x be w(b). Solve 0 = -5p + 3m + 11, 4m = -x - 3 for p. 1 Let p be (-280)/(-25) + 2/(-10). Solve 2s = -5f + 28, -4s + 9 + p = f for f. 4 Let u(n) = n*3 - 6n*2 + 5n + 4. Suppose p - 3 - 2 = 0. Let g be u(p). Solve -q = 2a - 8 + 22, -a + 11 = -gq for a. -5 Let t = -6 - -8. Suppose -5h = -4z + 10, -4h + 1 = -z - h. Let p = z - t. Solve 3d + 2 + 1 = pb, -b - 5d - 29 = 0 for b. -4 Let c be	{ "pile_set_name": "DM Mathematics" }
10(15/(-6))/((-91)/(-182)). -37 What is the value of 30/40(-5328)/(-111)? 36 Calculate (23/(-69))/(8/2)(-8)/(-2). -1/3 ((-500)/(-875))/(3770/65) 2/203 (2/(-6)499)/(-3) 44 What is ((-9)/30)/(-314/4340)? 31 ((-16800)/144)/(-35)15/425 2/17 Evaluate 7/(2(-12)/(-12)6/(-84)). -49 What is the value of (87/(-957))/(24/240)? -10/11 ((-63)/(-42))/(72/14((-408)/36)/(-34)) 7/8 What is the value of (-75)/30-42775/370? 75 Evaluate 6(5688/(-1200))/237. -3/25 Calculate (((-42)/36)/((-651)/(-9207)))/(6/(-1)). 11/4 What is (-3024)/(-5670)(-4)/(-8)? 4/15 What is the value of 19/(-1)(-579)/(-193)(-2)/6? 19 ((-30)/(-8)3/(-9))/((-3)/(-216)-6) 15 Calculate (113373/(-228))/(-51)(-22)/99. -13/6 Calculate ((-2)/((-4)/(-2)))/((-1808)/81360). 45 Calculate 10/46/((3540/(-248))/(-59)). 62 What is the value of (-203)/(-126)1420574/8001? 58 Calculate (-9)/(225/7)((-390)/(-91))/((-4)/(-7)). -21/10 What is ((-57)/30)/(((-20)/(-5))/8)? -19/5 What is ((70/(-75))/(1617/693))/(2/(-365))? 73 What is the value of (-54)/(-39)(-601)/1803? -6/13 Evaluate ((5/(-4))/(-5))/((-41)/2132). -13 Calculate ((-194326)/(-438))/(-121)(-2)/(-418). -1/57 ((-16(-8)/(-16))/(-4))/(((-18)/(-44))/(-9)) -44 What is the value of (22/3)/(1364/(-2232))? -12 What is the value of ((6/((-120)/325))/((-1905)/508))/1? 13/3 Evaluate 10/(3/(-3))916/(-9618)693/(-15). -44 Calculate (-15)/(-111)(-37)/((-4070)/(-33)). -3/74 Calculate ((-3)/(-42)-27)/(-20(-16)/(-640)). 27/7 What is the value of 22/(1020/(-595)14)? -11/12 What is (12/(-66))/(1/(((-66)/8)/(36/402)))? 67/4 Calculate (16/(-48)(-35)/14)/((49/(-42))/1). -5/7 ((-10)/(-7))/((-3322755)/344582) -4/27 What is (-1093960)/(-629027)736/10? 128 What is 151/(647790/(-52))(-44)/36? 2/135 What is the value of (-9)/27(570/(-380))/(3/282)? 47 What is (567/126)/((-24)/208)? -39 Calculate (14097/8001)/((-185)/(-30)). 2/7 What is the value of (((-8)/16)/((-9)/(-114)))/((-41)/738)? 114 What is ((-60)/(-188))/((4240/(-53))/(-16))? 3/47 Calculate (-72)/(-150)10120/(-36). -16 What is the value of (246/9)/(200/(-60))(-20)/(-8)? -41/2 What is the value of (-84)/48-32210/(-360)(-18)/8? 147/2 Calculate 2/(-1)(-296)/1332. 4/9 117045/(-20655)82/34 -41/3 Calculate ((-7)/(-4))/(62426/5488)((-6)/(-4))/(-1). -3/13 What is the value of ((-39)/(64155/28))/((-46)/115)? 2/47 What is -1272/(-8)4/(-8)(-10)/40? 17/4 (399/(-15827))/((-7)/49) 3/17 What is ((-54)/(-117))/(14/819)? 27 Calculate ((-1)/(7/6))/(7886/(-138005)). 15 Calculate ((-900)/(-315))/(((-2)/5)/(217/465)). -10/3 15/6(((-45)/(-24))/(-5))/(11730/(-3128)) 1/4 Calculate (51/(-6))/(385/770). -17 Evaluate (4/10)/((1044/(-2175))/2). -5/3 (3040/(-2280))/((-1)/((-27)/2)) -18 52/(-6)(26/((-2496)/(-216)))/((-7)/28) 78 Evaluate (-6)/(330/(-77)(-7)/3)60/(-72). 1/2 Calculate 99/(-29799)43-4. 4/7 What is the value of 12/3(2/14)/((140/(-15))/28)? -12/7 Calculate (42/(-28))/(774/36). -3/43 Calculate (-27)/(-9990)-372/(-36)-5. -1/36 ((-4)/(-2)(-196)/24)/((-7)/((-126)/(-6))) 49 What is 49/((-1862)/(-95))(-4)/30? -1/3 What is -121(-188)/(-1504)24/(-3)? 121 ((-16560)/(-300))/2315/(-2) -18 Evaluate (322/(-115))/(259/1110). -12 What is the value of (1/(2/21))/(-84(-74)/(-53872))? -91 What is ((-130)/(-25))/(((-24)/42)/((-160)/(-112)))1? -13 Calculate 81(-428)/(-749)(-7)/(-2). 16 Calculate 7(-10)/(-3500)5/(-2)912/(-380). 3/25 Evaluate ((-47)/(-94))/((-186)/12). -1/31 What is -26(-26)/(-78)3? -26 What is 78((-1572)/(-4192))/(45/(-8))? -26/5 What is 15/4208(-1239)/3(-33)/33? 118 What is the value of (-4)/48177(-2)/(16/(-12))? -59 (111/6)/((-1919)/3838) -37 Calculate (15704/17667)/((-2)/(-9)). 4 Evaluate 1546/(-1035)-69. 46 What is (-2)/6-1((-300)/350)/((-6)/(-714))? -34 What is 812/2842(102/4)/(-3)? -17/7 Calculate (-124865)/29383/((-30)/8). 34 (42/28)/((-2040)/19040) -14 What is the value of (119828/(-11363))/((-8)/(-22))? -29 What is (259/(-5)135/(-378))/((-2)/8)? -74 Evaluate 29/((-2610)/276)435/(-29). 46 What is the value of (791/4)/(((-7)/(-3))/((-436)/(-327)))? 113 Evaluate (42/(-30))/(735/40425). -77 Evaluate ((5/(-7))/5)/1576/(-144). 4/7 What is the value of (1/(-15))/(20053/(-10938))? 2/55 Evaluate (12/39)/((-52910)/(-6253)). 2/55 Evaluate (-6)/81589460/(-20205). 59 Calculate (-10)/14(-174)/29(-14)/(-5). 12 Calculate (((-30)/1575098)/7)/(2/((-36)/(-2))). -6/25 Evaluate (-16(-12)/56)/(1038/(-9688)). -32 Evaluate (-88650)/8865(-5)/((-50)/(-48)). 48 Evaluate (((-20)/105)/(25(-60)/(-1050)))/((-3)/(-5)). -2/9 What is ((-400)/(-21000))/(1/(-7))? -2/15 Calculate (170/(-32))/(5930/(-56928)). 51 What is the value of 10/2(-69)/3795? -1/11 What is the value of ((-180)/(-210))/((-168)/(-168))? 6/7 What is the value of (14)/(((-420)/12600)/(1/(-6)))? 20 What is (((-1968)/(-1435))/(-24))/(90/(-21))? 1/75 Evaluate ((-10)/(-104)3(-17)/153)/((-30)/16). 2/117 3/25027825/2226 3/20 What is the value of (10/(20/(-4)))/(115/805)? -14 What is the value of (-534)/4322/(-805)((-70)/6)/(-7)? 89 What is 6/(-12)5(18/(-7))/((-60)/42)? -9/2 Evaluate ((20710/(-42750))/(-109))/((-1)/550/20). -2/225 Calculate ((-531)/134048-32)/(36/(-8)). -2/71 (1132/(-8))/((646/19)/(-68)) 33 What is 4/(-2)(-17)/(-136)(34830/(-315))/43? 9/14 Evaluate (1/2)/((-120)/6120(-85)/50). 15 What is the value of ((-8)/5625/(-25))/((-33)/(-1386))? 6 (-70)/4768/5376-26 65 What is ((-325)/25)/(5824/(-192))? 3/7 What is the value of (-8)/(-6)(-35)/(186760/276)? -2/29 Calculate ((4800/208)/150)/(2/(-676)). -52 What is the value of (((-204)/5)/(-6))/((5934/69)/430)? 34 What is the value of (((-133)/(-28))/19)/(((-182)/65)/(119/(-170)))? 1/16 What is the value of ((-27)/264684)/(333/42)? -4/37 Evaluate (124/(-9765))/((-13)/((-1170)/(-36))). 2/63 What is (37/((-4995)/360))/((-15)/(-9))? -8/5 What is the value of 28/(-4749/(-4606))? 56 What is the value of 106/8(5983978/1617)/(-427)? -65 Evaluate ((-2520)/100)/(22/66012). -63 Calculate -3(-3024)/(-243)(-39)/91. 16 Calculate (((-4)/(-6))/1)/(((-312)/(-32))/((-702)/312)). -2/13 Calculate (110)/((-14920)/117868). -79 (-6346)/3006(-6)/(-1) -38/3 Evaluate ((-100)/(-550))/(51/374). 4/3 10(41/((-246)/(-60)))/((-16)/4) -25 What is the value of (-658)/(-4)(-16)/(1904/17)-2? 47 What is the value of (-968)/(-1694)4214/28? 86 Calculate ((-49)/(-21))/(35/84)332/(-1992). -14/15 What is the value of ((-1)/14)/(((-195)/(-10))/((-2483)/(-382)))? -1/42 Calculate (-160)/120(-25)/((-1000)/1020). -34 Evaluate 40125/(-900)9. -50 Calculate (-3)/(-12)(-80484)/1059. -19 Evaluate 1226/1226020/(-158). -1/79 Calculate (1/123(-135)/(-9))/((-18)/216). -45 Evaluate (50820/5390)/((-3)/(-7)(-1)/3). -66 What is the value of 184842/912832/18? 36 Evaluate (-330)/35(700/30)/(6/3). -110 Calculate (2940/343)/33360/(-75). -128 Evaluate (((-3)/(-18)2)/(5677/14598))/((-1830)/140). -4/61 Evaluate (1/6)/1(-480)/88594/(-432). 5/4 What is (-3)/((-27)/(-6))(-347820)/2431026/8? 31 Calculate ((-4)/42)/((55056/651)/(-37)). 1/24 Calculate ((-4)/6)/(((-71)/(3195/(-1)))/((-1)/(-65))). -6/13 Evaluate 3100/31((-50)/8)/(-25). 25 Evaluate (120/1684/10)/(11/847011). 20 What is (-93)/155230(-5)/((-60)/(-4))? 46 Evaluate (-42)/(-1053)18360/14280. 2/39 ((-2666)/(-465))/(-43)(-2)/50-5 -2/75 Calculate 16/3(-19053)/33872. -3 Calculate (67/(-10318)22)/((-57)/(-84)). -4/19 What is (-3)/828(-16)/112(-550)/(-11)? 75 What is (36/(-2)145/(16965/(-52)))/(4/(-14))? -28 What is (((-1300)/780)/((-3)/6-65))/(2/9)? -3/13 Evaluate ((12/15)/(-4))/(10/200). -4 Calculate -1693/13216/(-12). 7 Calculate -16(-5)/(-40)1081/46. -47 What is (1776/1110)/(88/10)352/(-12)-6? 32 What is (-1)/((-6)/(-774))((-496)/(-48))/31? -43 Calculate (1000/103503/(-105)-3)/(20/30). 2/161 Calculate (4/(-80)-12)/((-2349)/27405). -7 (-14784)/(-112)(-32)/(-264) 16 What is the value of -80(12/100-20)/3? 64 What is (-54/9)/(33/1395947)? -20 What is the value of (64/(-11))/((-80)/(-440))? -32 What is the value of ((-1098)/63)/(152/532)? -61 What is the value of (-71064)/(-204309)46/76? 4/19 (1581/(-40579))/(-3(-2)/(-21)) 3/22 What is (135/4)/(-3)11208/7005? -18 What is the value of (20240/50)/(-184)*(-20)/24? 11/6 (512/224)/((-9)/((-72)/8)) 16/7 What is ((120/(-280))/((-2)/11))/((-57)/((-6384)/(	{ "pile_set_name": "DM Mathematics" }
e in kilograms? 100 What is 46836.9ng in micrograms? 46.8369 What is 46/5 of a kilogram in grams? 9200 Convert 21.16425 hours to microseconds. 76191300000 What is 9.41869 nanometers in meters? 0.00000000941869 What is three fifths of a litre in millilitres? 600 How many years are there in 7267.1 millennia? 7267100 How many millilitres are there in 238.499 litres? 238499 What is 1360.374ng in micrograms? 1.360374 Convert 2785.198g to kilograms. 2.785198 How many hours are there in four thirds of a week? 224 How many micrometers are there in 5/8 of a centimeter? 6250 How many milligrams are there in seventy-three quarters of a gram? 18250 What is 26433.69 months in years? 2202.8075 Convert 1.510324 litres to millilitres. 1510.324 What is thirty-two fifths of a litre in millilitres? 6400 Convert 87.074946 minutes to weeks. 0.0086383875 How many millilitres are there in twenty-seven quarters of a litre? 6750 How many kilograms are there in 8.352588mg? 0.000008352588 How many kilometers are there in 469.4132 nanometers? 0.0000000004694132 What is 0.722982 centuries in decades? 7.22982 How many millilitres are there in five quarters of a litre? 1250 Convert 6670.887 centuries to decades. 66708.87 How many micrometers are there in 3/25 of a millimeter? 120 Convert 7251.944nm to kilometers. 0.000000007251944 How many centimeters are there in eleven halves of a meter? 550 What is 7.097387 centimeters in millimeters? 70.97387 What is 29/2 of a meter in centimeters? 1450 What is 38049.81km in millimeters? 38049810000 Convert 3.651505 nanometers to millimeters. 0.000003651505 How many meters are there in seven halves of a kilometer? 3500 How many litres are there in 736.38 millilitres? 0.73638 Convert 0.3326364 millennia to decades. 33.26364 What is 31.533084 nanoseconds in days? 0.00000000000036496625 Convert 1.070802ml to litres. 0.001070802 What is two ninths of a day in minutes? 320 What is 7.577678 centuries in years? 757.7678 How many months are there in 43/6 of a century? 8600 How many micrograms are there in 53959.57 nanograms? 53.95957 What is three fifths of a litre in millilitres? 600 What is 11/8 of a litre in millilitres? 1375 What is 33.24905us in milliseconds? 0.03324905 What is 2/15 of a day in seconds? 11520 What is 33219.65l in millilitres? 33219650 How many minutes are there in three sevenths of a week? 4320 What is 4839.066 litres in millilitres? 4839066 What is fifteen quarters of a meter in millimeters? 3750 What is eighteen fifths of a litre in millilitres? 3600 How many years are there in seven halves of a millennium? 3500 Convert 0.0635388 meters to millimeters. 63.5388 What is thirty-four fifths of a kilometer in meters? 6800 How many milliseconds are there in 41365.71 hours? 148916556000 How many nanometers are there in three eighths of a micrometer? 375 How many months are there in 22.91947 years? 275.03364 What is 2660.1771 months in millennia? 0.221681425 What is twenty-one halves of a microgram in nanograms? 10500 What is 201.9456 millennia in decades? 20194.56 How many millimeters are there in twenty-nine halves of a meter? 14500 How many years are there in 906.6758 centuries? 90667.58 How many hours are there in one quarter of a day? 6 How many centimeters are there in 39.81477m? 3981.477 How many millilitres are there in 6/5 of a litre? 1200 What is 27/4 of a millennium in months? 81000 What is nineteen quarters of a meter in centimeters? 475 How many seconds are there in fifty-two thirds of a minute? 1040 How many millilitres are there in 7.437043l? 7437.043 How many tonnes are there in 57.7299 grams? 0.0000577299 What is five eighths of a minute in milliseconds? 37500 How many tonnes are there in 225095.7 milligrams? 0.0002250957 How many nanograms are there in 32.71787 kilograms? 32717870000000 What is 49799.69um in centimeters? 4.979969 Convert 447128.6 years to decades. 44712.86 How many micrograms are there in 3/50 of a milligram? 60 What is thirty-two fifths of a decade in years? 64 What is 13/8 of a minute in milliseconds? 97500 Convert 180147504.6 microseconds to weeks. 0.0002978629375 What is 29/6 of a week in hours? 812 How many meters are there in 7/4 of a kilometer? 1750 What is seven sixths of a minute in seconds? 70 Convert 2.859997 nanometers to micrometers. 0.002859997 What is 7/2 of a gram in milligrams? 3500 How many nanograms are there in 45/4 of a microgram? 11250 What is 82422.36ug in tonnes? 0.00000008242236 What is 1/4 of a kilometer in meters? 250 How many millilitres are there in 5062.792 litres? 5062792 How many millimeters are there in 515843.5nm? 0.5158435 How many millilitres are there in fifty-nine quarters of a litre? 14750 How many meters are there in 4548.747 kilometers? 4548747 Convert 8.037657 litres to millilitres. 8037.657 How many nanograms are there in 3/10 of a microgram? 300 What is 16240.26l in millilitres? 16240260 How many grams are there in 97.53 nanograms? 0.00000009753 How many meters are there in 80.30516 millimeters? 0.08030516 How many micrometers are there in 597.5848cm? 5975848 What is 2.916003 centimeters in micrometers? 29160.03 Convert 597062.2 millilitres to litres. 597.0622 How many centimeters are there in five quarters of a meter? 125 How many millilitres are there in 18/5 of a litre? 3600 Convert 878.1364m to kilometers. 0.8781364 What is seventeen quarters of a litre in millilitres? 4250 How many micrograms are there in 0.4266779 nanograms? 0.0004266779 Convert 420288.2l to millilitres. 420288200 How many millilitres are there in 806452.9 litres? 806452900 What is 3/40 of a microgram in nanograms? 75 What is 1/10 of a litre in millilitres? 100 How many centimeters are there in seventeen halves of a meter? 850 How many decades are there in twenty-nine halves of a millennium? 1450 How many centuries are there in 375458.8 millennia? 3754588 How many milligrams are there in 1961.631 nanograms? 0.001961631 What is 561962.2 decades in years? 5619622 What is 0.3321898 millilitres in litres? 0.0003321898 How many minutes are there in three fifths of a week? 6048 How many litres are there in 260.7405ml? 0.2607405 How many micrometers are there in 9/10 of a centimeter? 9000 What is 251385.6 micrometers in centimeters? 25.13856 What is seventy-three fifths of a meter in millimeters? 14600 How many decades are there in 0.8049777 months? 0.0067081475 Convert 597.2172 years to decades. 59.72172 What is 6/5 of a week in minutes? 12096 What is 1/16 of a kilometer in millimeters? 62500 What is three eighths of a litre in millilitres? 375 What is fifty-eight thirds of a week in hours? 3248 What is six fifths of a meter in centimeters? 120 How many centimeters are there in 5.526727 meters? 552.6727 How many centuries are there in 42/5 of a millennium? 84 How many years are there in 5989.331 millennia? 5989331 How many grams are there in 7/2 of a kilogram? 3500 How many centimeters are there in 3/5 of a kilometer? 60000 How many millimeters are there in 59/4 of a meter? 14750 How many meters are there in 74503.2 kilometers? 74503200 What is 27/2 of a microgram in nanograms? 13500 What is 0.0912917 years in months? 1.0955004 What is 37430.88 centuries in months? 44917056 What is 7011.3708us in days? 0.000000081150125 What is 1851.85ml in litres? 1.85185 What is 3/5 of a millennium in months? 7200 What is 9244.118 days in milliseconds? 798691795200 How many millilitres are there in five quarters of a litre? 1250 Convert 56.30344l to millilitres. 56303.44 How many millilitres are there in 8669.901 litres? 8669901 How many micrograms are there in 68.58066kg? 68580660000 What is 824919.3 months in decades? 6874.3275 What is thirty-three fifths of a millennium in months? 79200 Convert 11280.68 millilitres to litres. 11.28068 What is 624.714m in millimeters? 624714 How many decades are there in 21/5 of a century? 42 What is 0.6759536 millennia in decades? 67.59536 Convert 91.17522 litres to millilitres. 91175.22 Convert 2794.498 tonnes to kilograms. 2794498 Convert 0.0409617 tonnes to milligrams. 40961700 What is twenty-nine sixths of a day in hours? 116 What is one fifth of a millennium in centuries? 2 What is twenty-one fifths of a kilometer in meters? 4200 How many litres are the	{ "pile_set_name": "DM Mathematics" }
ur letters picked without replacement from {w: 1, c: 1, h: 6, p: 6, b: 3}. 3/4760 What is prob of sequence aaa when three letters picked without replacement from {a: 7, b: 4}? 7/33 What is prob of sequence bry when three letters picked without replacement from {b: 1, r: 1, y: 1}? 1/6 Three letters picked without replacement from {p: 3, k: 6, u: 6}. Give prob of sequence puu. 3/91 Calculate prob of sequence rh when two letters picked without replacement from {g: 1, r: 4, h: 2, e: 2, b: 7, v: 1}. 1/34 Two letters picked without replacement from {a: 1, p: 1, j: 9, g: 4, s: 2}. Give prob of sequence sp. 1/136 What is prob of sequence tck when three letters picked without replacement from ktkktckcccckt? 25/572 Four letters picked without replacement from fjmcfffrmrfjffffrt. What is prob of sequence mtfr? 1/1360 Two letters picked without replacement from byyyyyrpfaaapyr. What is prob of sequence ab? 1/70 Calculate prob of sequence vwt when three letters picked without replacement from {a: 6, v: 1, w: 1, t: 1, h: 4}. 1/1716 Three letters picked without replacement from {y: 3, g: 6, k: 4}. Give prob of sequence ykg. 6/143 Three letters picked without replacement from sscdssdscdcscssdsss. Give prob of sequence scd. 88/2907 What is prob of sequence hxqq when four letters picked without replacement from hqxhxhqh? 1/105 Three letters picked without replacement from ooeojoeejeoeeeoeoo. Give prob of sequence eee. 7/102 Two letters picked without replacement from ncb. What is prob of sequence nb? 1/6 Calculate prob of sequence fp when two letters picked without replacement from {x: 4, p: 2, f: 1, y: 2, q: 1, a: 2}. 1/66 Two letters picked without replacement from {i: 3, l: 7}. Give prob of sequence li. 7/30 Three letters picked without replacement from qghhgqhsgsghsshgs. What is prob of sequence qgh? 5/408 Calculate prob of sequence wtno when four letters picked without replacement from {w: 10, n: 2, o: 4, t: 1}. 1/714 What is prob of sequence ppmp when four letters picked without replacement from {c: 2, f: 5, m: 4, p: 4}? 4/1365 What is prob of sequence ksnn when four letters picked without replacement from snsnskzskzsnkzsksz? 7/3060 Calculate prob of sequence eere when four letters picked without replacement from erreeer. 3/35 Two letters picked without replacement from ybyyyyscbsyuyyyuc. Give prob of sequence bc. 1/68 Two letters picked without replacement from {v: 9, p: 2}. Give prob of sequence vp. 9/55 Three letters picked without replacement from bbnnbbnnbn. Give prob of sequence bbb. 1/12 Four letters picked without replacement from rappaaad. Give prob of sequence rpdp. 1/840 What is prob of sequence ddbd when four letters picked without replacement from {b: 6, w: 3, s: 1, d: 3}? 3/1430 Four letters picked without replacement from qaawwaxwxqaw. What is prob of sequence qaxx? 2/1485 Four letters picked without replacement from {d: 3, m: 3, a: 2}. What is prob of sequence dada? 1/140 Calculate prob of sequence dx when two letters picked without replacement from {d: 2, t: 7, x: 9}. 1/17 Four letters picked without replacement from xfdxfdddddxfx. What is prob of sequence dxxd? 3/143 Calculate prob of sequence pipp when four letters picked without replacement from {p: 3, i: 7}. 1/120 Calculate prob of sequence tp when two letters picked without replacement from {t: 2, w: 1, c: 2, s: 1, p: 1}. 1/21 What is prob of sequence rfew when four letters picked without replacement from {r: 1, e: 1, f: 1, w: 1, s: 1}? 1/120 Three letters picked without replacement from {h: 8, b: 4, n: 1, r: 1, i: 6}. What is prob of sequence nrb? 1/1710 What is prob of sequence hthm when four letters picked without replacement from {t: 2, m: 1, h: 5, j: 1}? 5/378 Three letters picked without replacement from {y: 1, z: 3, w: 1}. Give prob of sequence yzz. 1/10 Two letters picked without replacement from {s: 8, u: 5, l: 5}. What is prob of sequence su? 20/153 What is prob of sequence izi when three letters picked without replacement from {i: 4, z: 3, h: 4, y: 1, o: 1, s: 4}? 3/340 Calculate prob of sequence wf when two letters picked without replacement from mfvjpfjwfvj. 3/110 Two letters picked without replacement from {z: 3, s: 2}. Give prob of sequence ss. 1/10 Calculate prob of sequence yc when two letters picked without replacement from qcytc. 1/10 What is prob of sequence rgrg when four letters picked without replacement from {r: 2, g: 5}? 1/21 Three letters picked without replacement from {u: 2, v: 2, s: 3, a: 2}. Give prob of sequence uss. 1/42 What is prob of sequence jjju when four letters picked without replacement from juuujujujjjjjjjujj? 11/102 Three letters picked without replacement from ggmgmgmgmdgmg. Give prob of sequence mmd. 5/429 What is prob of sequence wn when two letters picked without replacement from wwwwnnw? 5/21 Calculate prob of sequence gggg when four letters picked without replacement from ggggg. 1 Calculate prob of sequence occ when three letters picked without replacement from {o: 3, q: 1, j: 2, c: 3, g: 1}. 1/40 What is prob of sequence tt when two letters picked without replacement from xxtlttxxtttxxlttxt? 4/17 Calculate prob of sequence fope when four letters picked without replacement from {o: 4, q: 1, p: 3, e: 1, l: 2, f: 1}. 1/990 What is prob of sequence ff when two letters picked without replacement from fmvuf? 1/10 Calculate prob of sequence yd when two letters picked without replacement from {w: 10, d: 1, q: 2, y: 3}. 1/80 Calculate prob of sequence hej when three letters picked without replacement from {e: 3, j: 5, k: 1, u: 1, h: 4, z: 3}. 1/68 What is prob of sequence wg when two letters picked without replacement from {q: 1, w: 1, o: 1, m: 1, g: 1}? 1/20 Calculate prob of sequence rb when two letters picked without replacement from irbrbbr. 3/14 What is prob of sequence nln when three letters picked without replacement from {n: 2, l: 6}? 1/28 What is prob of sequence qwl when three letters picked without replacement from {l: 3, o: 5, w: 3, q: 9}? 9/760 Four letters picked without replacement from {d: 13, b: 3}. Give prob of sequence ddbb. 3/140 What is prob of sequence qqrr when four letters picked without replacement from rqncrnkmmmmmkkrqmmmr? 1/4845 Two letters picked without replacement from {o: 2, q: 17}. Give prob of sequence qq. 136/171 What is prob of sequence muu when three letters picked without replacement from {r: 3, u: 11, i: 3, m: 2}? 110/2907 Calculate prob of sequence ni when two letters picked without replacement from {n: 4, i: 3}. 2/7 Calculate prob of sequence oqrp when four letters picked without replacement from {q: 3, o: 4, r: 1, p: 1, z: 4}. 1/1430 Two letters picked without replacement from ldd. What is prob of sequence dd? 1/3 Calculate prob of sequence xq when two letters picked without replacement from qqqqxqqqqqxqqqqqqqq. 17/171 What is prob of sequence waaa when four letters picked without replacement from {w: 5, a: 8}? 14/143 Calculate prob of sequence tt when two letters picked without replacement from pllrrtrvtppfvltlr. 3/136 What is prob of sequence nlln when four letters picked without replacement from nnnlllllllnnnnlnnlnl? 45/646 Four letters picked without replacement from mmcbbmcmooyb. What is prob of sequence yocm? 2/1485 Calculate prob of sequence njjj when four letters picked without replacement from {q: 1, n: 10, j: 7}. 35/1224 What is prob of sequence nqy when three letters picked without replacement from {n: 2, y: 5, q: 12}? 20/969 What is prob of sequence zdyl when four letters picked without replacement from {d: 1, z: 1, y: 1, w: 2, l: 2}? 1/420 Four letters picked without replacement from {e: 2, n: 3, r: 6, y: 4, h: 2}. Give prob of sequence eenn. 1/4760 Calculate prob of sequence uuww when four letters picked without replacement from {u: 3, w: 6, f: 4}. 3/286 Two letters picked without replacement from mutmtrdn. Give prob of sequence mt. 1/14 Four letters picked without replacement from {k: 1, f: 3, r: 13}. Give prob of sequence kffr. 13/9520 Two letters picked without replacement from {p: 2, a: 1, u: 2, h: 1}. What is prob of sequence uh? 1/15 Calculate prob of sequence aam when three letters picked without replacement from maaa. 1/4 Calculate prob of sequence av when two letters picked w	{ "pile_set_name": "DM Mathematics" }
z(d)? -d*2 - 6d - 2 Let g be 1210/(-15) - (-1 - 2). Suppose 2u + 18 = 4u. Let m = u + -17. Let h(l) = -l + 3. Let p(k) = 2k - 5. Determine gp(j) + mh(j). -2j + 1 Let q(l) = 1. Let k be (4/(-3))/(12/(-27)). Let a(f) = f - 2. Calculate kq(t) + a(t). t + 1 Let t(d) = d + 8. Let x(z) = -1. Let s(y) = -4y + 18. Let k be s(6). Calculate kx(b) - t(b). -b - 2 Let x(l) = -l - 31. Let o(g) = 15. Calculate 7o(z) + 3x(z). -3z + 12 Let o(z) = 7z*3 - 8z*2 - 18z + 6. Let d(k) = 20k3 - 23k*2 - 53k + 17. Determine -6d(i) + 17o(i). -i*3 + 2i*2 + 12i Let q(x) = 4x2 + 5x. Let b(o) = 4o2 - o3 - 6o + 3o2 + 0 + 8. Let f be b(6). Let k(a) = -6a*2 - 8a. Give fq(u) + 5k(u). 2u2 Suppose y = -8w + 3w - 16, y - 24 = 5w. Let v(b) = 2b + 3. Let z(f) = 3f + 4. Let n = 8 + -5. Calculate nz(c) + wv(c). c Let x(w) = 8w3 + 4w*2 + 19w. Let y(v) = -2v3 - v2 - 5v. What is 2x(a) + 9y(a)? -2a3 - a2 - 7a Let i(t) be the first derivative of -t + 2. Let x(l) = l - 6 + 6 + 2. Let m(z) = z - 2. Let d be m(3). Determine dx(v) + i(v). v + 1 Let n(o) = -o - 6. Let r(c) = -15c + 22c - 9 + 2 - 8c. Give 7n(f) - 6r(f). -f Let r(o) = 4o - 1. Let b(u) = -u2 - 5u. Let w be b(-4). Let n = w + 0. Let c(p) = -5p + 2. Give nr(y) + 3c(y). y + 2 Let i(c) = 4c - 2. Let q = 46 + -42. Let b(y) = -3y + 2. What is qi(h) + 5b(h)? h + 2 Let l(f) = 2f*2 - 5f. Let n(a) = 0a2 + a2 + a2 - a2 - a. What is -l(v) + 4n(v)? 2v2 + v Let f(g) = g3 - 5g*2 - 5g. Let s(u) = -u*3 + 3u*2 + 3u. What is -6f(z) - 10s(z)? 4z3 Let l(z) = -6z2 + 9. Let w(p) = p2 + 4p + 4. Let i(n) = n2 + n. Let c(v) = 4i(v) - w(v). Let f be (-2)/(-11) + 202/(-22). What is fc(q) - 4l(q)? -3q2 Let h(a) = 34a*2 + 26a - 26. Let l(f) = -17f2 - 13f + 13. Let m(t) = 4h(t) + 7l(t). Let i(n) = 4n2 + 3n - 3. Calculate -26i(w) + 6m(w). -2w2 Let l(m) = 16m*3 + 5m*2 + 11m. Let w(v) = 2v3 - v2 + 3v. Let z(d) = -3d3 + d2 - 4d. Let y(j) = -6w(j) - 5z(j). Determine 2l(i) - 11y(i). -i3 - i2 Let v(w) = w*2 + w - 1. Let q(c) = -12c*2 - 9c + 9. What is q(i) + 9v(i)? -3i2 Let r(q) be the third derivative of q6/40 + 2q5/15 - 11q4/24 + q3/2 - 16q2. Let k(z) = z3 + 3z*2 - 4z + 1. Determine 8k(o) - 3r(o). -o*3 + o - 1 Let q(z) = 6z - 5. Let h(g) = -7g + 6. Give 3h(x) + 4q(x). 3x - 2 Let x = 1 - 7. Let y = -6 - x. Let k(o) = -2 - o*2 - 2o + o + yo2 + 2o2. Let l(w) = w3 + w2 - w - 1. Give k(s) - l(s). -s3 - 1 Let a(k) = 3k3 + 5k*2 - 7k + 2. Let z(n) = -3n3 - 6n*2 + 8n - 2. Determine 6a(c) + 5z(c). 3c3 - 2c + 2 Let o(u) = 3u2 - 2u + 2. Let r(k) = -3k2 + 3k - 3. Suppose -11 = -4z - v, -2z + 26 = 4v + 10. What is zr(f) + 3o(f)? 3f*2 Let l(g) = -23 - 3g + 2g + 23. Let v(o) = 2o. Calculate 10l(w) + 4v(w). -2w Let s(y) = -29y*3 - 3y + 3. Let j(g) = -29g3 - 4g + 4. Give 3j(x) - 4s(x). 29x3 Let r(z) = z. Let f(j) = 6j. Let o(h) = f(h) - 4r(h). Let s(c) be the third derivative of -c4/24 + 6c*2. Determine -o(d) - 4s(d). 2d Let h(v) = -8v*2 - v + 5. Let l(k) = -14k2 - k + 6. Let t(c) = c2. Let n(s) = -l(s) - 5t(s). Determine -7h(u) - 6n(u). 2u*2 + u + 1 Let m(x) = 8x - 7. Let f(a) = -a. Calculate -5f(r) - m(r). -3r + 7 Let w(m) be the second derivative of -m*2/2 + 16m. Let l(x) = -2x - 5. Give -l(z) + 6w(z). 2z - 1 Suppose 24 = -4h - 0h. Let q(f) = 7f*2 - 6f - 6. Let s(y) = y*2 - y - 1. Let v be 1 + 4/2 + -1. Suppose -4 = -vo - 2. Give hs(l) + oq(l). l*2 Let s(o) = -9o*2 - 13o. Let l(t) = 2t2 + 3t. Suppose 0 = -v + 39 - 13. Let c = 10 - 4. Determine cs(u) + vl(u). -2u2 Let a(v) = -2v - 4. Let r(m) = m + 4. What is 3a(q) + 4r(q)? -2q + 4 Let g(p) = -21p*3 - 11p*2 + 11. Let d(h) = 4h*3 + 2h*2 - 2. What is -22d(k) - 4g(k)? -4k3 Let h(x) = -x3 + 1. Let i(w) be the second derivative of w*5/5 - 3w*2 - 32w - 2. Suppose -2d + d + 5 = 0. Determine dh(v) + i(v). -v*3 - 1 Let m(i) = 2i3 - 15. Let x(f) = -f3 + 8. Calculate -3m(p) - 5x(p). -p*3 + 5 Let a be (15 + -21)(-4)/(-6). Let y(b) = 1. Let t(q) = q + 2. What is ay(c) + t(c)? c - 2 Let q(o) = 4o*3 - 26o*2. Let c(n) = -9n*3 + 51n*2. Calculate 3c(j) + 7q(j). j3 - 29j*2 Let n(c) = 6c*2 - 4. Let g(b) = -7b*2 + 5. Give 4g(s) + 5n(s). 2s*2 Let i(q) = -4q*2 - 9q + 17. Let j(l) = -l*2 - 2l + 4. Suppose 23 = -14o - 341. Calculate oj(b) + 6i(b). 2b*2 - 2b - 2 Let c(j) = -2j - 24. Let n(p) = -1. Give c(a) + 4n(a). -2a - 28 Suppose 4y - 44 + 12 = 0. Let n(i) = 12i3 - 8. Let k(j) = -8j*3 + 5. Calculate yk(t) + 5n(t). -4t*3 Let y(q) = 8q + 6. Let n be 43/6 + 2. Suppose -3c + 18 = -4g, 2c + g = -ng + 35. Let l be (2 - 7)(-2)/c. Let x(v) = -v - 1. Determine ly(k) + 6x(k). 2k Let p(y) = y2 - 6y + 1. Let t(k) = k*2 - 7k + 1. Let b(g) = 6p(g) - 5t(g). Let m(s) = -3s + 6 + 6s*2 + 2s + 3s3 - 5s. Calculate -6b(h) + m(h). 3h*3 Suppose -10 = -3h - 2l, 2h + 0l - 15 = -3l. Suppose h = g - 3 - 1. Let j(a) = a - 1. Let f(v) = 2v2 - 4v + 4. Determine gj(q) + f(q). 2q*2 Let u(o) = 11o + 4. Let x(a) = 6a + 2. Let f(p) = 3u(p) - 5x(p). Let t(d) = 13d + 8. What is 9f(r) - 2t(r)? r + 2 Suppose 0 = 2d - 5d + 6. Let i(z) = -3z2 + 8 + 10z + 3zd - 12z2. Let o(l) = -l2 + l + 1. What is i(v) - 10o(v)? -2v*2 - 2 Let u(w) = 2w*3 - 9w. Let y(o) = 5o3 - 6o*2 + 10o. Let j(v) = 9v3 - 11v*2 + 19v. Let t(b) = -6j(b) + 11y(b). Determine 7t(f) - 3u(f). f*3 - f Suppose 5z + 0 = -5. Let v(c) = 5c2 + 5c - 3. Let k(p) = -p*2 - p + 1. Determine zv(b) - 3k(b). -2b*2 - 2b Let u(a) = -a*3 + 2a*2 + a + 1. Let p be u(2). Let k(d) = -3d + pd + d. Let j(g) = 5. Let s(m) = -1. Let o(y) = j(y) + 6s(y). What is k(b) + o(b)? b - 1 Let g(f) = 5f3 - 8f*2 + 8f. Let z(b) = 2b3 - 3b*2 + 3b. Let j be (-45)/(-6)(-2)/(-3). Let q = 9 - j. Suppose 15 = qo + 3. What is og(y) - 8z(y)? -y*3 Let b(w) = -10w*2 - 9w*2 + 8 - 9w*2 + 16w + 8. Let r(s) = -9s2 + 5s + 5. Calculate -5b(t) + 16r(t). -4t2 Let m(j) = j3 - 4j*2 + 3j + 5. Let d(o) = -o*3 + 2o*2 - 2o - 3. Let c be 2886/546 + 4/(-14). Let f be 3(0 + (-1)/(-1)). Determine cd(r) + fm(r). -2r*3 - 2r2 - r Let q(h) = -h3 - 4h2 + 5h + 25. Let u be q(-4). Let b(c) = 3c3 + 5c*2 - 9c + 7. Let g(l) = l*3 + 2l*2 - 4l + 3. Calculate ug(k) - 2b(k). -k*3 - 2k + 1 Let a = 9 - 20. Let l(t) = -7t2 + 5t + 6. Let v(x) = 13x2 - 9x - 11. What is al(p) - 6v(p)? -p2 - p Let g(t) = -t2. Let d(f) be the first derivative of 2f3 + f2 - 5. Determine d(j) + 4g(j). 2j2 + 2j Let s = 16 + -18. Let z(l) = l*2 - 2l - 1. Let f(b) = 3b2 - 5b - 2. What is sf(i) + 5z(i)? -i*2 - 1 Let m(s) = -17s + 8. Let z(l) be the third derivative of -l*2 + 5/6l*3 - 11/24l*4 + 0 + 0l. What is -5m(v) + 8z(v)? -3v Let b(o) = -40o*2 + 1. Let r be b(-1). Let q(k) = 25k*2 - 13k. Let u(d) = 4d2 - 2d. Give ru(h) + 6q(h). -6h2 Let r(j) = -7j*3 + 29j*2 + 4. Let f(l) = 4l*3 - 15l*2 - 2. Calculate -11f(k) - 6r(k). -2k*3 - 9k*2 - 2 Suppose -5t + 10 = -0. Let x(v) = -4v + 1. Let f(k) = 17k - 5. Suppose r + 78 = 4r. Let n(g) = rx(g) + 6f(g). Let h(c) = c + 3. Determine tn(y) + 3h(y). -y + 1 Let k(a) = 1 + 7a*3 - 10a + 10 + a - 2. Let n(q) = 3q3 - 4q + 4. Let h = 3 - 7. Suppose 2c - 19 = g, 30 = c + 2c - 3g. Calculate cn(d) + hk(d). -d3 Let l(m) = -3m*3. Let s(i) = -4i*3 + i. Give -6l(t) + 5s(t). -2t*3 + 5t Let m(z) = 5z - 5. Let o(w) = -4w + 4. Let n(v) = 3m(v) + 4o(v). Let b(d) = 2d - 2. Let h be -14/4 + 7. Give hn(j) + 2b(j). -2j + 2 Let p(a) = 65a3 + 40. Let t(h) be the second derivative of h5/4 + 3h2/2 + 20h. Give -3p(j) + 40t(j). 5j3 Suppose 3 = -c + 2c. Let m(i) = 2i + 3. Let t(j) be the first derivative of -2j*2 - 5j - 38. Calculate ct(w) + 5m(w). -2w Let i(n) = 364n*3 - 169n. Let h(j) = -13j3 + 6j. What is 169h(b) + 6i(b)? -13b3 Let b(f) = -3f. Suppose 3w - 6 = 2w + r, 4w = 5r + 23. Let u be 2/8 - w/(-4)	{ "pile_set_name": "DM Mathematics" }
months are there in 967.9985 centuries? 1161598.2 How many centimeters are there in 3/16 of a kilometer? 18750 Convert 446.8322 micrograms to tonnes. 0.0000000004468322 Convert 2877.7743 months to millennia. 0.239814525 What is 51/5 of a hour in seconds? 36720 How many kilograms are there in fourty-two fifths of a tonne? 8400 Convert 6599088.3 hours to weeks. 39280.2875 What is 69/2 of a meter in millimeters? 34500 How many centimeters are there in 60188.1 kilometers? 6018810000 Convert 705787.1 millilitres to litres. 705.7871 How many millilitres are there in 1/20 of a litre? 50 What is 750514.9cm in micrometers? 7505149000 What is one quarter of a week in minutes? 2520 How many micrograms are there in 3/8 of a milligram? 375 What is eleven quarters of a kilogram in grams? 2750 Convert 53137.05 kilograms to micrograms. 53137050000000 How many millimeters are there in sixty-four fifths of a meter? 12800 How many millilitres are there in twenty-seven quarters of a litre? 6750 What is 1/5 of a microgram in nanograms? 200 Convert 0.3615542l to millilitres. 361.5542 Convert 14775.53ml to litres. 14.77553 What is three eighths of a litre in millilitres? 375 How many days are there in 2.2114974 hours? 0.092145725 How many millennia are there in 468688.9 years? 468.6889 How many decades are there in 93887.6 years? 9388.76 How many millilitres are there in 8/25 of a litre? 320 Convert 5.533639us to nanoseconds. 5533.639 What is 34/5 of a litre in millilitres? 6800 What is fourty-three halves of a meter in millimeters? 21500 What is 1/4 of a litre in millilitres? 250 What is one fifth of a microgram in nanograms? 200 What is 8.265712 millilitres in litres? 0.008265712 What is 3/32 of a meter in micrometers? 93750 What is eleven quarters of a milligram in micrograms? 2750 Convert 0.0534836 days to minutes. 77.016384 How many months are there in 6.222481 centuries? 7466.9772 What is 5/4 of a microgram in nanograms? 1250 What is fifty-four fifths of a microgram in nanograms? 10800 Convert 45606.77 micrometers to kilometers. 0.00004560677 What is 3100.735ml in litres? 3.100735 What is 7/8 of a minute in milliseconds? 52500 How many minutes are there in fifty-one halves of a hour? 1530 How many nanograms are there in 0.8824727 milligrams? 882472.7 How many years are there in 43/4 of a millennium? 10750 What is 5.052795ml in litres? 0.005052795 How many millilitres are there in 51/2 of a litre? 25500 What is 29.5094 nanograms in grams? 0.0000000295094 What is 47450.54 tonnes in kilograms? 47450540 How many centuries are there in 8.51933 years? 0.0851933 Convert 321717.2 hours to minutes. 19303032 How many millilitres are there in seventeen quarters of a litre? 4250 How many years are there in 477452.8 centuries? 47745280 What is six fifths of a century in decades? 12 How many days are there in 249175.197 nanoseconds? 0.0000000028839721875 How many kilograms are there in 58083.32ug? 0.00005808332 How many days are there in 240.1482 hours? 10.006175 Convert 4699.08 years to centuries. 46.9908 How many months are there in 7/4 of a millennium? 21000 What is twenty-five halves of a micrometer in nanometers? 12500 What is 7.975222 nanograms in grams? 0.000000007975222 What is 4669.36 nanograms in micrograms? 4.66936 What is 912193.1 centuries in decades? 9121931 What is 132.27198 months in years? 11.022665 How many months are there in 5791.778 decades? 695013.36 How many years are there in nine tenths of a century? 90 What is one tenth of a litre in millilitres? 100 How many millilitres are there in seven eighths of a litre? 875 What is 42/5 of a kilogram in grams? 8400 Convert 33028.68 kilograms to tonnes. 33.02868 How many kilometers are there in 5.138767 meters? 0.005138767 How many kilometers are there in 3.839659m? 0.003839659 How many centimeters are there in fifty-three quarters of a meter? 1325 How many micrograms are there in 3/32 of a gram? 93750 How many micrometers are there in 53232.96 nanometers? 53.23296 What is 252.9961 millennia in months? 3035953.2 How many months are there in twenty-one halves of a decade? 1260 How many microseconds are there in 32806.97 hours? 118105092000000 How many micrograms are there in fifty-five quarters of a milligram? 13750 How many months are there in 21/5 of a century? 5040 How many milliseconds are there in 9/16 of a minute? 33750 How many months are there in 8/3 of a century? 3200 What is 11/10 of a hour in seconds? 3960 How many minutes are there in 64/7 of a week? 92160 What is one tenth of a meter in millimeters? 100 Convert 0.014893s to milliseconds. 14.893 How many tonnes are there in 6663.868 micrograms? 0.000000006663868 What is 151028.9 weeks in microseconds? 91342278720000000 How many nanograms are there in 11/2 of a microgram? 5500 How many litres are there in 157.3296ml? 0.1573296 How many grams are there in seven halves of a kilogram? 3500 How many nanograms are there in 8655.652ug? 8655652 How many millilitres are there in eleven quarters of a litre? 2750 What is 1/5 of a kilogram in grams? 200 What is 0.42394 tonnes in kilograms? 423.94 What is 13/4 of a millennium in years? 3250 What is 0.974135l in millilitres? 974.135 How many millilitres are there in 987955.6 litres? 987955600 What is 1/20 of a tonne in grams? 50000 How many minutes are there in two ninths of a week? 2240 What is 1/5 of a litre in millilitres? 200 What is 647.9433cm in meters? 6.479433 What is 0.5418061 days in minutes? 780.200784 What is 483.8724 microseconds in seconds? 0.0004838724 How many meters are there in 3/50 of a kilometer? 60 What is 9.811561ng in tonnes? 0.000000000000009811561 How many grams are there in 0.404908mg? 0.000404908 What is fourty-four fifths of a micrometer in nanometers? 8800 Convert 1722.201 years to decades. 172.2201 How many seconds are there in five quarters of a minute? 75 What is 636.6321 years in months? 7639.5852 How many minutes are there in 0.4970904 nanoseconds? 0.00000000000828484 What is ten sevenths of a week in hours? 240 What is 4.6762254 minutes in days? 0.00324737875 Convert 84073.84 nanograms to grams. 0.00008407384 How many micrometers are there in 5/4 of a millimeter? 1250 How many weeks are there in 1253.370321 milliseconds? 0.0000020723715625 How many kilometers are there in 3.714195 meters? 0.003714195 What is 50.20946 meters in micrometers? 50209460 How many milligrams are there in 4116.468 kilograms? 4116468000 What is eighty-seven halves of a meter in centimeters? 4350 Convert 15.8379678ms to days. 0.0000001833098125 How many milligrams are there in 3835.574ug? 3.835574 How many millilitres are there in nine tenths of a litre? 900 What is twenty-seven quarters of a day in minutes? 9720 What is thirteen eighths of a litre in millilitres? 1625 How many milligrams are there in 64.32391 kilograms? 64323910 What is 1/64 of a kilogram in milligrams? 15625 What is 9.513836ml in litres? 0.009513836 How many kilograms are there in 4725.834 micrograms? 0.000004725834 What is 17/2 of a kilometer in meters? 8500 How many minutes are there in 5/6 of a hour? 50 What is 0.4940531 centuries in decades? 4.940531 What is nine tenths of a centimeter in millimeters? 9 How many milliseconds are there in 1/4 of a second? 250 How many kilograms are there in fifteen quarters of a tonne? 3750 What is eleven tenths of a kilogram in grams? 1100 What is 5.061423 decades in months? 607.37076 How many nanograms are there in 0.6611263 micrograms? 661.1263 What is 410.495 milligrams in micrograms? 410495 Convert 7071.609 months to years. 589.30075 How many months are there in one tenth of a decade? 12 How many grams are there in 73/5 of a kilogram? 14600 What is 78712.54 weeks in milliseconds? 47605344192000 What is eleven halves of a millennium in centuries? 55 What is 158552.856 microseconds in days? 0.0000018351025 Convert 0.1653045mg to tonnes. 0.0000000001653045 How many hours are there in 0.2097365 days? 5.033676 How many years are there in one tenth of a decade? 1 How many months are there in seventeen quarters of a millennium? 51000 What is 128799.9 micrometers in millimeters? 128.7999 What is one fifth of a microgram in nanograms? 200 What is 57/5 of a micrometer in nanometers? 11400 How many mi	{ "pile_set_name": "DM Mathematics" }
(-1). 11 Let t be 72/54 - 22/(-6). Suppose l = y - 3, tl = -2y - 55 + 19. Let d(o) = -o - 4. Give d(l). 2 Let q(r) = r*3 + 11r*2 - 4r - 9. Let m be q(-11). Let u be (-3)/5 - (-21)/m. Let n(x) = -x + 12. Determine n(u). 12 Let t(m) = -m*2 - 5m - 6. Let f be t(-5). Let k(d) = -2d - 973 - d2 + 484 - 5d + 482. What is k(f)? -1 Let n(s) = -4s2 + s - 1. Let y be (-6)/16 + (-589)/(-248). Determine n(y). -15 Let x(b) = -b2 - b + 1. Let q be x(2). Let t(f) be the first derivative of -f2 - 4f + 6. Calculate t(q). 6 Suppose -10y = y - 88. Suppose -yk + 5 = 21. Let m(o) = 2o2 + 2o + 3. Calculate m(k). 7 Let t(y) = -2y3 - 10y*2 - 3y + 16. Let g(u) = u*3 + 5u*2 + u - 9. Let x(m) = -5g(m) - 3t(m). Determine x(-4). -3 Suppose -2f - 3f + 5 = 3o, 2o - 10 = -5f. Let x(k) = -11k + 5. Let c = -521 - -516. Let d(j) = -11j + 6. Let l(w) = cx(w) + fd(w). Give l(1). 10 Let j(h) = -2h - 1. Suppose 19 - 11 = -4o. Let b be 1((o - 2) + 3). Determine j(b). 1 Let z(l) be the second derivative of l3/6 + 3l*2 - 68l. Determine z(0). 6 Let s(w) = -5w2 + 5w - 1. Suppose 0 = 2o + k - 11, 2 + 5 = o + k. Give s(o). -61 Let p(b) = b + 9. Let m(i) = -2i + 88. Let h be m(17). Let c = h - 61. Calculate p(c). 2 Suppose 4i + a = 4a + 48, -3i + 4a + 36 = 0. Suppose m = -4c + 2m - i, 4c = -4m + 8. Let f(q) = 0q2 - 3 + q2 + 1. Give f(c). 2 Let i = -1141 - -1145. Let p(w) = -4w*2 + 5w + 1. Let d(c) = -c*2 + c. Let a(t) = 3d(t) - p(t). Calculate a(i). 7 Let d(m) = -m*2 - 6m + 4. Let k(b) = 2b + 2. Let w be k(-2). Let h(c) = -6c + 32. Let l be h(7). Let n be l + 7 - (-6)/w. Determine d(n). 4 Suppose 5z = 5h + 10, 4z + 11 = -2h + 1. Let l(b) = 3b2 - b. Let p(d) = -d2. Let f(a) = -l(a) + 5p(a). Determine f(z). -9 Let q(f) = f*2 + 12f. Let h(z) = -z*3 + 9z*2 - 9z - 4. Let r be h(8). What is q(r)? 0 Let b be 11(36/66 - 0). Let c(y) = 2y - 5. Calculate c(b). 7 Let o(b) = b*2 - 3b. Let q be ((-2)/4)/(13/(-78)). Let t be 7 - 1 - q/1. Determine o(t). 0 Let k = -578 + 576. Let n(z) = -4z - 1 + 8z + 2z2 - 3z. Give n(k). 5 Let a = 178 + -176. Let p(z) be the second derivative of -z*2 + 1/2z*3 - az - 1/6z4 + 0. Determine p(2). -4 Let g(x) = x3 - 4x*2 + 6x + 1. Let j(f) = -f*3 + 6f*2 - 5f - 3. Let n(b) = -6g(b) - 7j(b). Give n(18). -3 Let y(w) = -w*3 - 3w*2 - w + 5. Let n = -17 + -34. Let r = n + 47. Give y(r). 25 Let v be (5 + -2 - 2)6. Let y(l) = -9l - l3 - 4 + 6l + v + 3l2. Suppose 2j = x - 1, -4x = -14 - 6. What is y(j)? 0 Let q(o) = -o3 - 13o*2 + 2o + 14. Let d(c) = 36c + 635. Let m be d(-18). What is q(m)? -12 Let t(o) = -5o - 9. Let i(y) = 2y2 + 44y + 123. Let q be i(-19). Determine t(q). -54 Let q = -15 - -15. Let m(a) = 189a2 - 191a*2 + 0 + qa - a + 1. What is m(1)? -2 Let j = -3 - -9. Let y(n) be the second derivative of -n3/3 + n2/2 + 6n + 146. What is y(j)? -11 Let x(v) be the first derivative of 17v3/3 - v + 10. Let b(i) = i2 - 5i + 5. Let n be b(2). Determine x(n). 16 Let m(d) = -4d2. Let g(s) = s3 + 2s2 + 3s - 3. Let u be g(2). Let z = -18 + u. Give m(z). -4 Suppose 0 = -5q - d - 65, -3q + 0d + d - 31 = 0. Let y be (-5)/2q/(-6). Let h(c) = -3c - 6. Calculate h(y). 9 Let a(t) be the second derivative of 2t*3/3 - 21t*2/2 - 61t - 4. Calculate a(6). 3 Let f(z) = 2z2 - 4z + 1. Let u be f(3). Suppose -27 - 1 = -un. Let j(a) = 5a + 4. Determine j(n). 24 Let o(w) be the first derivative of -w*4/4 + 17w3/3 - w2/2 - 12w + 96. Determine o(17). -29 Let z(s) = 36s + 2. Let g(f) = 43f + 1. Let x(w) = -5g(w) + 6z(w). Calculate x(-6). 1 Let v(f) = -f3 + 6f*2 + 2f - 9. Let s(m) be the second derivative of -m*3/3 + 3m*2 - 16m. Let h be s(0). Determine v(h). 3 Let t(m) be the third derivative of m5/60 + m4/2 + m*3/2 + 533m*2. Give t(-8). -29 Suppose o + 117 = 2b - 95, 3o + 324 = 3b. Let c(q) = 98 + q*3 - b + 6q*2 + 0q*3 - 8q. Calculate c(-7). 1 Let p(f) = -f*3 + 3f - 2. Let j = 34 + -13. Let a be -257/6 - (-11)/11. Let r = a + j. What is p(r)? -20 Let x = 284 - 281. Let d(w) be the first derivative of -w3 + 5w*2/2 - 4w + 4. Give d(x). -16 Let o(m) = -m*2 - m. Let r be (-1 - 0) + (5 - 5). Let x(v) = 3 + 3v + 5v2 + 5v + 0v. Let f(z) = rx(z) - 4o(z). Calculate f(-2). 1 Let i(p) be the second derivative of -p5/5 + p4/6 + p3/6 + p2/2 - p + 19. Calculate i(2). -21 Let s = -9 + 10. Suppose s = -0y + y. Let b be (y - 1) + 6/1. Let d(f) = f*3 - 6f2 + 1. Give d(b). 1 Let r(g) = -g2 - 29g - 144. Let y be r(-6). Let a(q) = -q2 - 7q - 2. Determine a(y). 4 Let s(u) = u*3 - 6u*2 + 7u. Let g = 366 + -363. Give s(g). -6 Suppose 3b - 13 = -4g, 11g - 6g = 3b + 23. Let s(p) be the third derivative of -p6/120 + p5/20 + 7p*4/24 - 5p3/6 + p2. What is s(g)? 7 Let m(a) = -a*2 - 2a + 4. Let y be -2 + -1 + 4 + -3. Let u(r) = -13r2 + 2r + 2. Let q be u(y). Let n be (-5)/(-2)q/45. Give m(n). 1 Let p(o) = 12o + 543. Let y be p(-46). Let d(m) = 2m3 + 17m*2 - 11m - 18. Calculate d(y). 0 Let z(q) = 2q2 + 0q2 + q - q2 - 12q3 + 0q*2 - 2q*2. Calculate z(1). -12 Suppose 2h - 3r = -9, 4h - 3r + r + 14 = 0. Let c(u) be the third derivative of u6/120 + u5/30 - u4/12 + u3/3 + 2u*2. Give c(h). -1 Let q(b) = -3b*3 + 2b*2 - b - 1. Suppose -8 = 2p - 3o, -35 = -p - 5o - 13. Give q(p). -19 Let c(s) = -s*3 - 6s*2 + 8s. Let v(u) = -8u + 9u + 8u - 7u2 - u3. Let d(p) = p*2 - 5p - 4. Let m be d(5). Let r(o) = mv(o) + 5c(o). Give r(-3). -3 Let c(g) = 7g + 3 - 8 + 8g2 - g3 - 9 + 18. What is c(9)? -14 Let q = 222 - 229. Let m(w) = w*3 + 8w*2 + 5w + 3. Give m(q). 17 Suppose 5j + 2w = 4j + 2, 8 = -2j + 2w. Suppose c + 0c + 10 = 4z, 3c = 6. Let f(i) = i - zi2 - 4i + 7 - 7. Give f(j). -6 Let b(o) = 3o + 7. Let z(s) = -s - 3. Let p(h) = -2b(h) - 5z(h). Suppose 5i = 2x - 70, -i - 4i = -10. Let l = -44 + x. What is p(l)? 5 Suppose -8w + 11w + 4x + 16 = 0, -5w - 16 = 4x. Let v(j) = -j2 - j + 40. Determine v(w). 40 Let i(l) = 10l*3 - 6l*2 + 16. Let d(g) = 11g*3 - 5g*2 + 13. Let r(a) = 5d(a) - 4i(a). Give r(-1). -15 Let g(l) = 20l*2 - 30l. Let b(r) = -7r2 + 11r. Let n(z) = -17b(z) - 6g(z). Let u be 2/4 + 13/(-2). What is n(u)? 6 Let p(n) = -n*3 + 3n*2 + 7n. Let q(m) = m*3 - 5m*2 + 2m - 5. Let g be q(5). Suppose 5f - 10 = -3z, 0z + 23 = gz + 2f. Determine p(z). -15 Let v(i) = 2i2 - i + 4. Let f be v(0). Let a = 4 - f. Let j(q) = -q2 + q + 20. What is j(a)? 20 Let v(o) be the second derivative of -o5/20 + o4/12 + o3/3 - o2/2 - 20o. Let j = -8 + 6. Calculate v(j). 7 Let w(y) = -7y - 5. Let x be (1 - -2)(-60)/(-36). Determine w(x). -40 Let w(o) = -4 - 6o*2 + 41o*3 - 78o*3 + 36o*3 + o. Calculate w(-6). -10 Let m(i) = i - 7. Let z(o) = o. Let a be z(-1). Let w be 133/(-171) + (-4)/18. Let y(q) = q. Let c(b) = am(b) + wy(b). Give c(6). -5 Let t(m) = 8m*2 + m - 1. Let x be (0 + 21)(-26)/39. Let j = 17 + x. Suppose -5y + 4i - 11 = 0, 0y = -5y + 2i - j. What is t(y)? 8 Let j(s) = s3 - 3s*2 - 7s + 8. Let w be j(4). Let z(m) = m*3 + 5m*2 - m - 4. Calculate z(w). 16 Suppose -7z + 66 = -25. Let y(f) = -3 + 3 + 1 + 2f - zf. Calculate y(2). -21 Let z(j) = 17 + 63j + 70j + 63j - 192j - j*2. Determine z(7). -4 Suppose -s - 4b - 1 - 2 = 0, s = b + 7. Let z(i) = -12 + 10 + s + 4 + 2i. Calculate z(-7). -7 Let v = -1 + 4. Let t(a) be the third derivative of a4/8 - 2a*3/3 - 139a2 - a. Determine t(v). 5 Let k(v) = -v3 - 11v2 - 10v - 11. Let s be k(-10). Let w = s - -11. Let z(c) = 7 - 7 - c*3 + 4c*2 - 3c*2 + 7. Calculate z(w). 7 Let c be (-22)/(-6) + -7 + 76/12. Let l(g) be the first derivative of 3 + 1/3g*c + 2g + 3g2. Determine l(-6). 2 Let n be 2 - 0 - (-2 + 2). Suppose 0f + 2 = nf. Let t(h) = h - 11h + 2 - f. What is t(1)? -9 Let y = -216 + 223. Let l(i) = -i + 14. Give l(y). 7 Let g(u) = 29 - u*2 - 68 - 19u*3 + u + 40. Determine g(-1). 18 Suppose -59s + 23 - 200 = 0. Let i(c) = c - 10. What is i(s)? -13 Let u(o) = -3o + 3. Let c(l) = -l2 + 11l - 8. Let z(w) = -w. Let v(b) = c(b) - 2*z(b). Let	{ "pile_set_name": "DM Mathematics" }
14 Solve -137s - 466 = 96s for s. -2 Solve -14a - 241 = -479 for a. 17 Solve 68o - 77o = -33o - 72 for o. -3 Solve 4698 + 28968 = -1086w for w. -31 Solve -50o = 504 + 296 for o. -16 Solve -91w - 4777 = -6506 for w. 19 Solve 40f - 352 - 298 = 30 for f. 17 Solve -134t + 73t - 93t = 924 for t. -6 Solve 23z = -685 + 731 for z. 2 Solve 78w = -343 - 1061 for w. -18 Solve -200v = -703v - 5030 for v. -10 Solve 15s + 32 + 66 = -67 for s. -11 Solve 182 = 12g + 2g for g. 13 Solve -i = i - 549 + 523 for i. 13 Solve -65h - 7h - 460 = 404 for h. -12 Solve -229f - 21 = -208f for f. -1 Solve -7d = 30 + 19 - 21 for d. -4 Solve 14y - 40y + 378 = -194 for y. 22 Solve -8b + 14b + 520 - 376 = 0 for b. -24 Solve -429w = -438w for w. 0 Solve 270 = -45l + 476 + 379 for l. 13 Solve 8j - 151 + 199 = 0 for j. -6 Solve 213 = -52t + 525 for t. 6 Solve -208 - 1493 = -243z for z. 7 Solve -187h = -11h + 209h - 3080 for h. 8 Solve -14873 = -21d - 15188 for d. -15 Solve -115a + 268a - 111a = 840 for a. 20 Solve 49a - 153 = -2a for a. 3 Solve 81 + 51 = -32q + 36 for q. -3 Solve -8169 = 742f - 2233 for f. -8 Solve 37k + 2646 = 137k + 47k for k. 18 Solve -3q = 11q - 2q - 72 for q. 6 Solve -94p + 99 - 569 = 0 for p. -5 Solve 21s - 10s + 490 = 109s for s. 5 Solve 74i + 140 = 18i + 36i for i. -7 Solve -292f + 285f + 83 = 6 for f. 11 Solve 0 = -200q + 252q - 156 for q. 3 Solve 37a - 316 = -24a + 233 for a. 9 Solve -58k + 15077 = 14207 for k. 15 Solve 23r = 62r - 57 + 330 for r. -7 Solve 484 - 3555 = -347i + 399 for i. 10 Solve 0 = 6w + 4w - 0w + 50 for w. -5 Solve -353q = -304q + 735 for q. -15 Solve -2q + 32 + 33 = 63 for q. 1 Solve -312 = -105f - 837 for f. -5 Solve 4j - 42 = 59 - 121 for j. -5 Solve 172v + 606 + 1206 = -596 for v. -14 Solve 865 + 1415 + 258 = 141g for g. 18 Solve 77s - 69s = -96 for s. -12 Solve 6k + k + 2 = -19 for k. -3 Solve 3455 = 30x + 3215 for x. 8 Solve 0 = -26u + 165u - 556 for u. 4 Solve -2u - 548 = -506 for u. -21 Solve -189m - 385 = 72m + 659 for m. -4 Solve -1683 = 10w - 1533 for w. -15 Solve 311 + 305 = 110o - 33o for o. 8 Solve -1576s + 28368 = -394s for s. 24 Solve -49t + 13641 = 12955 for t. 14 Solve -330 - 606 = 1131n - 1053n for n. -12 Solve 14025d - 114 = 14019d for d. 19 Solve 119c + 58c + 1920 = 17c for c. -12 Solve 18x + 8783 = 9053 for x. 15 Solve -15q = 7q + 22 for q. -1 Solve 0 = 41p + 77p + 826 for p. -7 Solve -9k + 12 = 21 for k. -1 Solve -17o - 7o + 61o + 74 = 0 for o. -2 Solve 14680 = 109p + 892p - 6341 for p. 21 Solve 4019d - 4064d + 585 = 0 for d. 13 Solve 0 = -134s - 200 + 125 - 863 for s. -7 Solve 76h - 71h + 110 = 0 for h. -22 Solve -5723o + 6193o + 2350 = 0 for o. -5 Solve 106a = -136a - 484 for a. -2 Solve -15 = -23v + 100 for v. 5 Solve 0 = 302q + 7020 + 1738 for q. -29 Solve 78p + 60 = 275 + 19 for p. 3 Solve -18 = 3a + 27 for a. -15 Solve -17z + 27z = 30z - 80 for z. 4 Solve -642n + 740n - 490 = 0 for n. 5 Solve 498v = 492v - 12 for v. -2 Solve -136q + 326 = 27q for q. 2 Solve -249m + 268m = 209 for m. 11 Solve 103 + 101 = 3i + 198 for i. 2 Solve -1328 + 0 = 166z for z. -8 Solve 14c + 126c + 0c = 2100 for c. 15 Solve 0 = 3979a - 4061a + 2542 for a. 31 Solve -9t - 1934 = -1808 for t. -14 Solve 598 = 318l - 272l for l. 13 Solve 0 = -5d + 35d + 16754 - 17264 for d. 17 Solve 92f + 88f - 50f + 1690 = 0 for f. -13 Solve -121y + 1247 + 205 = 0 for y. 12 Solve o = -2o - 14o + 153 for o. 9 Solve -1702s - 13 = -1701s for s. -13 Solve -130v = -15145 + 13585 for v. 12 Solve -222v - 3020 = 80v for v. -10 Solve -1625 + 339 = 774g - 10574 for g. 12 Solve 18s + 5s - 3s - 100 = 0 for s. 5 Solve -11d + 3360 = -32d + 141d for d. 28 Solve -40c + 138c + 894 = -51c for c. -6 Solve 574o - 558o = -192 for o. -12 Solve 7 - 85 = -14r + 6 for r. 6 Solve -34c - 25 + 39 = 184 for c. -5 Solve -768 = 82y + 14y for y. -8 Solve -301m + 910m = -1138 + 18190 for m. 28 Solve 0 = -317s + 298s - 190 for s. -10 Solve -15o + 10o = -26o + 210 for o. 10 Solve 640z = 1282z - 680z + 266 for z. 7 Solve -12t - 11 = 26t - 429 for t. 11 Solve 339l - 3184 = -59l for l. 8 Solve 240t - 133t + 684 = 145t for t. 18 Solve -3287g = -3290g - 36 for g. -12 Solve -25l = 2214 - 1914 for l. -12 Solve 42f + 144f - 3580 = 7f for f. 20 Solve 814 + 13009 + 2314 = 489l for l. 33 Solve -13 + 20 = -18t - 65 for t. -4 Solve 155y = 87y + 952 for y. 14 Solve -1204624d - 1664 = -1204572d for d. -32 Solve 578i - 600i = 264 for i. -12 Solve -37340 + 37093 = 19i for i. -13 Solve 0 = 20x + 10657 - 10237 for x. -21 Solve 114p - 71p = -1118 for p. -26 Solve 18n = 105n + 639 + 144 for n. -9 Solve 125595 = -43k + 124262 for k. -31 Solve 818 + 338 = -68w for w. -17 Solve -378 = 27t - 0t for t. -14 Solve -127 = 9m - 46 for m. -9 Solve 0 = 63p - 273 - 294 for p. 9 Solve -14d - 3394 + 3654 = 6d for d. 13 Solve -62q + 285q = 2007 for q. 9 Solve -40p = -53 - 427 for p. 12 Solve 306b - 342 = -603 - 963 for b. -4 Solve -75n + 14 + 694 = -42 for n. 10 Solve 1046n - 2459 + 30701 = 0 for n. -27 Solve -3w + 28w = 19985 - 20235 for w. -10 Solve -122 + 254 = 44v for v. 3 Solve -327o - 23o + 1086 = 12o for o. 3 Solve 0 = -23m + 66 - 330 - 127 for m. -17 Solve -168 + 1005 + 438 = 51c for c. 25 Solve 36b - 1744 = 254b for b. -8 Solve 44o - 19o + 176 = 14o for o. -16 Solve 86i - 155 = 332 + 287 for i. 9 Solve 111 + 276 = -129x for x. -3 Solve 45a = -252a + 710 + 181 for a. 3 Solve -4267 = 5r - 4257 for r. -2 Solve 13475h + 360 = 13515h for h. 9 Solve 6j - 7801 = -7747 for j. 9 Solve -51a - 12a + 30a - 462 = 0 for a. -14 Solve 15n - 13n = 149 - 141 for n. 4 Solve 17u - 860 = -4u - 65u for u. 10 Solve 1506 = 38c - 203c - 86c for c. -6 Solve -16i - 185 = 1 + 22 for i. -13 Solve -1798z + 68 = -1725z - 516 for z. 8 Solve -29i = -607 + 1071 for i. -16 Solve 55p - 9p = 966 for p. 21 Solve 0 = 32n - 46 - 498 for n. 17 Solve 0 = -53l - 161 - 316 for l. -9 Solve 0 = -1939w + 672w + 7602 for w. 6 Solve 0 = 54u + 260 - 314 for u. 1 Solve 6 + 230 = -33f - 160 for f. -12 Solve -45j - 484 + 124 = 0 for j. -8 Solve 393w - 357 - 1215 = 0 for w. 4 Solve 256z + 136z = -775z - 24507 for z. -21 Solve 214 = 15c + 665 - 226 for c. -15 Solve -39t + 82 = 19 - 54 for t. 3 Solve -2987 + 647 = -117o for o. 20 Solve -19 = 27d - 154 for d. 5 Solve 818p - 842p - 552 = 0 for p. -23 Solve -8650 - 216 = -403p for p. 22 Solve -11s + 120 = 263 for s. -13 Solve -169s - 1526 - 116 = -121 for s. -9 Solve 3653o = 3639o - 266 for o. -19 Solve -15x - 64x = 46x + 250 for x. -2 Solve -742k = -676k - 333 - 63 for k. 6 Solve 32k + 21k + 722 = 245 for k. -9 Solve -244r + 670r - 3582 - 5364 = 0 for r. 21 Solve 0 = -21t - 14t - 334 + 719 for t. 11 Solve 49 = -36p - 415 - 76 for p. -15 Solve -r = 2157 - 2156 for r. -1 Solve -31w + 5550 = -33w + 557w for w. 10 Solve 25r = -9r - 10r + 836 for r. 19 Solve -14i + 24 = 12 - 2 for i. 1 Solve 34h = -30 - 307 - 275 for h. -18 Solve 28p + 272 = 4p - 10p for p. -8 Solve 4 = 3r - 14r - 40 for r. -4 Solve 862d - 660d + 2020 = 0 for d. -10 Solve 3l - 1218 = -182l + 11l for l. 7 Solve 435v = 317v + 2832 for v. 24 Solve -12z + 5301 = 5469 for z. -14 Solve 1301 = -113m + 58 for m. -11 Solve -198 + 430 + 1440 = -209h for h. -8 Solve 8n - 339 - 361 = -27n for n. 20 Solve 12b - 4b - 119 = -9b for b. 7 Solve -4262n + 5831 = -4605n for n. -17 Solve -2275q + 2296q = -42 for q. -2 Solve -49p = -136p - 348 for p. -4 Solve -55o + 56 = 1 for o. 1 Solve 3u - 9 = 22 - 1 for u. 10 Solve -61o - 1452 = -49 for o. -23 Solve 55d - d + 3d - 684 = 0 for d. 12 Solve 608t + 7347 = 659 for t. -11 Solve -274x - 320x = -560x + 1054 for x. -31 Solve 718 = 89o - 350 for o. 12 Solve -9t + 289 = 17t - 9t for t. 17 Solve 37x + 331 = -224 for x. -15 Solve -2906 + 3510 = 63j + 3124 for j. -40 Solve -4008 + 3326 = -62h for h. 11 Solve -48m - 31m + 90 = -49m for m. 3 Solve 721207u = 721215u - 136 for u. 17 Solve -179 = 37t + 265 for t. -12 Solve -182f - 949 = 1053 for f. -11 Solve -25k + 167 = 392 for k. -9 Solve	{ "pile_set_name": "DM Mathematics" }
*(2/7)/ii/(i/i(-4)))(-23))(-48))39 assuming i is positive. i(-1420848/7) Simplify (((q/q7q5)/(q/(qq/q0))10)30)7 assuming q is positive. q1890 Simplify ((w/w(2/9))/w*(-2/11)((((w*5ww)/w)/w)/w)/(w/(w(w*6ww)/w)))/((w4/w(-1))/((ww*(-3/8))/(w/(ww*(-4))w))) assuming w is positive. w*(2047/792) Simplify ((jj(j0/j)/jj)/j)10/((j/(j/(j/j(5/2)j)))/jjjjjj/((jj/j6)/j))(j*(-5)j/j(-2/29))/(j(2/7))(-5) assuming j is positive. j(-4467/406) Simplify (((h(5/3)/h)/((h/(h(-2/21)/h))/h))/(h/(hh(-2/9)))(1/6))/((h(-1/2)/(h(-5)hh))/(h(1/2)/h(3/5))) assuming h is positive. h(-2897/945) Simplify (n/(nn(-2/5)/n))9(n(-2/5))(1/6)((n/(nn1))/(n/(nnn(1/6))))/(nnn/n(-1/4))35 assuming n is positive. n(-2021/20) Simplify ((h/(hh6))(-5/11)/(h(5/2))(-14))31 assuming h is positive. h(12865/11) Simplify ((o/o1)41)(10/13)/((o3oo(1/4)/o)/(o0)(-2/75)) assuming o is positive. o(-13/4) Simplify ((c(-9))12/(c*(-3)c)(1/24))35 assuming c is positive. c(-45325/12) Simplify (s3/s6)(-25)(s(2/9)(s/(s/s*(-2/19))s)/s)41 assuming s is positive. s(13645/171) Simplify ((d*5/dd)/d(-5/8))(-36/11)/((d1)22)(-43) assuming d is positive. d(20407/22) Simplify (ll1)(-2/165)/(ll(1/5))(-35)(((l(-5)ll)/ll)/(ll((ll/(ll*6l)ll)/l)/l))(-4/5) assuming l is positive. l(6794/165) Simplify ((((d(-15))(2/57))(-1/14))(-1/34))(-7) assuming d is positive. d(5/646) Simplify v*(-32)v/((v*(3/28)/v)/v)(v*(1/12)v)(-3/22) assuming v is positive. v(-18021/616) Simplify (((r*(-14/3)/(rr(-1/4)))(-5/6))(1/5))(-3/32) assuming r is positive. r(-65/768) Simplify ((z/(z/(z/(z/(z(-7)/z)z))))/(zz*7z))/(z2/z)40(z(-2)(z/(z*(-5)z))/zz)10 assuming z is positive. z(-28) Simplify ((v(2/5))(-17)(v/(vv/(v/(v/(v(vv/(v/v(2/3)vv))/v)))v)vvvv)7)/(v9vv(2/33))(-30) assuming v is positive. v(50603/165) Simplify (((f(-32)f(10/11))26)30)11 assuming f is positive. f(-266760) Simplify ((t(2/11)t)37/((t/(t(-27)t)t)/t(t28tt)/t))19 assuming t is positive. t(-2565/11) Simplify (q(-2/5)/(qq*(-7))((q*(-1/8)q)/q)/qqq(2/13))/((q(-4/3)q(-4/7)q)/(qq0(qq/q2)/q)) assuming q is positive. q(71347/10920) Simplify ((((w/(w/w(-4)))/w)/(ww/(ww/(ww/(www*(-4)))))(wwww1w)32)25)(-35) assuming w is positive. w(-132125) Simplify ((i1)(2/25)/(i(-1/2))(-3/7))/((i/i*(2/3)i)*(1/34)/(ii(-1))43) assuming i is positive. i(-3097/17850) Simplify ((((d/d(-1/7))/(dd(1/4)ddd))/(d3/(d/d(2/5))))(-2/157))(-15) assuming d is positive. d*(-2313/2198) Simplify ((yy*(2/3))/yy)*(-6/19)/(yy(-38))(-9) assuming y is positive. y(-6337/19) Simplify ((n/n(-1))(-28))(-1/9)/((n0)47)31 assuming n is positive. n(56/9) Simplify (((mm(-7)/mm)/(mmm*3m))/((m/m(2/5))/m)(-12))/((m/m4)/((m/(m/(m/m(-2/9))))/mm))(1/11) assuming m is positive. m(-8126/495) Simplify ((z(2/7)/z)/zz)/(z*(4/5)z)(z/(z/(z/z1)))/(z(-2/11)/z)((z*(-4/3)z)/(zz0zz))/(z(1/2))(-41/5) assuming z is positive. z(-1307/2310) Simplify ((l/(l/(l/(ll*1)))l)/l)6/(l(2/3)/((l/(l/(ll/l(-1/3))))/ll))(((l/l0)/l)/(l/(ll*(-5))l))/(ll(-5)l*0/ll) assuming l is positive. l(-19/3) Simplify ((((i(-3)i)/i)/((i(1/5)i)/i))/(i*(-6/5)iii*(-11)ii))(-2/39) assuming i is positive. i(-10/39) Simplify ((((ii3)30)11)4)(-3/14) assuming i is positive. i(-7920/7) Simplify (y*(2/3)y)*(5/3)y*3(y/((y/(yy33))/y)y)/y assuming y is positive. y*(367/9) Simplify ((((nn*23/n)/n)/nnnn(-2/7))(-10/7))(-3) assuming n is positive. n(4770/49) Simplify ((b(6/5)/b3)/((b/b(-6/5))/(b(-5/6)b)))/(b(2/5)/b(-7))(5/6) assuming b is positive. b(-10) Simplify ((d(-1)/(dd*(-1/3))(d0)(-49))(1/22))(1/37) assuming d is positive. d*(-5/2442) Simplify (((v/(vv/(vv/((v/(v16v))/v)v)v))/v(5/6))24)(-30) assuming v is positive. v(-12360) Simplify ((c*(-4)/c)/(c/(cc/(cc(-2)/cc)))(c(-1))46)/(cc*(-2/5)cccc(-6)(c*(-1)c)(-4/11)) assuming c is positive. c(-233/5) Simplify ((c(12/7))(-30)/(c*(33/7)/((c(((c/c*25)/c)/cc)/c)/c)))(-19/4) assuming c is positive. c(10925/28) Simplify x*(2/19)x*(-8)x*(-1/2)xx(-8)(((x*(-1/6)xx)/x)/x(-9))(15/8) assuming x is positive. x(925/304) Simplify (h(-1)/h)/((h(-1/6)/h)/hh)(h(-2/7))(-6/7)((h(-2/3)/h)/(h/(h(4/9)/h)))/((h*1h)/h)50 assuming h is positive. h(-47461/882) Simplify ((u(-6/11)/(u14/u))/(u*(8/5)/(uu/u9)))(-9/11) assuming u is positive. u(10962/605) Simplify ((n(1/2))25)(-14)(n(-1/8)/nn/n(11/3))40 assuming n is positive. n*(-980/3) Simplify ((pp*(2/5)p)/(pp0p))(-43)/(p6p/((p/(pp*1))/p)(p/((pp/(p/(p/(((p/p(-1))/p)/p))))/pp))(10/3)) assuming p is positive. p(-343/15) Simplify (d/(dd(d*3d)/d)dd(1/4)/d)(-36)(((d/(dd*5))/d)/dd/(d*(-8)dd))44 assuming d is positive. d135 Simplify (hh(-1/19))/h(-43)(h/(h(-10)h))/(h/(h(hh(-14))/h)) assuming h is positive. h(759/19) Simplify (o9)(-12/11)o(-2/13)/(o(2/21)o) assuming o is positive. o(-33235/3003) Simplify ((((v/(v/(v(-5/2)v)vv)v)/v(4/5))(35/4))3)5 assuming v is positive. v(-3465/8) Simplify ((h(1/5))*(1/13)/(hh/((h/(h/h*(-2/11))hhh)/hhh)(h(h*13h)/h)/h))(-1/11) assuming h is positive. h(7984/7865) Simplify ((u*(-3/13)u/(u*14u))/((u(uu/(uu(1/21))u)/uuuu)/u15))(2/9) assuming u is positive. u(-2284/2457) Simplify ((j(3/2))2/(j/(j12j)j(-1/2)))(3/26) assuming j is positive. j(93/52) Simplify (((y/(y(-47)y))/(((yyy*(-2/7)y)/y)/y))/(y(2/5))(-2/25))(-1/6) assuming y is positive. y(-20264/2625) Simplify m*(-20)mm(-34)m*(-4)/mm(2/47) assuming m is positive. m(-2724/47) Simplify ((h/(h/(hh6)))(-13)/(((h/h0)/h)/h)(1/6))(-45) assuming h is positive. h(8175/2) Simplify (o(2/9)oo(o/(o/o(2/9)))/o)(33/4)/((o(2/9)/o)37/(o(-2/15)/((o(-1/6)/o)/o))) assuming o is positive. o(7691/180) Simplify w(-3/7)/w(w(ww(-1/3)/w)/w)/www(-6/11)/w(-4)(ww6w(-4))/(w(-1/2))(-4/7) assuming w is positive. w(1018/231) Simplify (j(-2))(-1/3)/(j*(1/6)j*(-2/3))(j*(-2/3)j(4/5))/(j(8/5)/((jj(-2))/jj)) assuming j is positive. j*(-13/10) Simplify (((kk*(2/13)/kkk(3/11))44)17)(-1/88) assuming k is positive. k(-1734/143) Simplify (f(-35)f)*(24/5)(fff*(-6)/fff)/((f13/f)/f) assuming f is positive. f(-886/5) Simplify ((i/((ii*2)/i)i)/i*(-2)i*(-3/5)((i/i1)/i)/i)/((i/(i1/i)i)/i6i(-2)/((i0i)/i)) assuming i is positive. i(27/5) Simplify ((r(-1/8)r)/(r*(-10)rr)(r(-2))(19/4))(-5/8) assuming r is positive. r(25/64) Simplify ((p/((pp(-3/2)p)/p)p(1/2))/(p0)14)/((p(p*(-3)/p)/ppp)/ppp/(p/(pp/(pp6))))8 assuming p is positive. p58 Simplify (((u(2/7)/u)(5/19)/(u/(uuu/((u/(u/u(-1)u))/u)u))(1/30))(-14))(2/87) assuming u is positive. u(-32/8265) Simplify (uu*3uu((u/((u*(3/5)/u)/u))/uu)/uu2(u/(u/(uu(3/2))))/u)/((u/(u2/u))(2/69))(-31) assuming u is positive. u(109/10) Simplify ((ss/(ss(6/7))s*4/ss)/(s(2/7))(-6/5))/((s/(ss/((s/(ss/(s/s*0)))/s)s))(-2/27)/(s/s(-1/2))(-2/17)) assuming s is positive. s(21886/5355) Simplify ((n*(-2/3)/n)/nn6)(-5/9)((n/(nnnn*(-4)n)n)/(n/((n/((n/(n(n(n/n5)/n)/n))/nn))/n)))/(n*(2/3)n(2/3)/n) assuming n is positive. n(-167/27) Simplify (t(-20)/(t(-5/8)t)(t/t(1/6))/t(-2/19))25 assuming t is positive. t(-221575/456) Simplify (zz(-4)z)/(z/z*(-2/11))z(2/17)/z4((z(8/7)z)/z(-3/4))(1/2) assuming z is positive. z(-58829/10472) Simplify (i(3/2)i(-2/17)i*(2/3)/(ii(2/15)))/(((i/(i/(i/(i2/i)i)ii)i)/ii)18)(1/28) assuming i is positive. i(467/510) Simplify (((o/(o(2/5)o))*(-32)/(((o/(o/(o/(o/(oo*(-2/5))))o))/o)/oo)*(-34	{ "pile_set_name": "DM Mathematics" }
give n. -85 Rearrange -p - 2p + 5p + (2p + p - 2p)(-3 + 2 + 3) - 3p + 0p + 5p - 8p + 18p - 9p - 7p + 37p - 72 + 148 - 75 to f + up and give u. 37 Rearrange -1 - a + 1 - 3a - 3a + 3a + (-3a + 3a - a)(6 + 1 + 2) to ma + f and give m. -13 Rearrange 15u*2 - 30u*2 - 34u + 14u2 to the form pu*2 + t + cu and give t. 0 Express -5y2 - 2 + 17y - 17y + ((-22y + 10y + 8y)(1 - 6 + 4) - 2y + 7y - 3y)(y - 4 + 4) as by + qy2 + c and give q. 1 Express -95 + 21t*3 - 83 + 179 in the form xt*3 + z + it*2 + bt and give x. 21 Express -2q2 - q4 - 25q + 2 - 16386q3 + 2q*2 + 16388q*3 in the form uq*3 + n + kq*4 + yq + sq2 and give k. -1 Express -16 - 11 + 45 + 30n - 21 + 168n in the form qn + y and give y. -3 Rearrange x - 101x2 - 108x*2 + 195x*2 to dx + px2 + a and give p. -14 Rearrange (2x + 3 - 3)(0 + 1 - 2) - 2x - 2 + 2 + 113x - 10600 + 10600 to the form i + ox and give o. 109 Rearrange 4o3 - o - 401 + 403 + o3 - 2o*2 to qo*3 + ao*2 + y + xo and give a. -2 Rearrange -2 - z + 20z2 - 8z*2 + 46z*2 - 5z*2 to the form bz + nz2 + p and give n. 53 Express (-2 + 4 + 2)(4 - 3 - 2)(-9 - 13 + 3)(2p3 + 0p*3 + 0p*3) + 0p*3 + 0p3 + p3 as mp2 + l + jp + xp3 and give x. 153 Express (-52 - 75 + 60)(6 - 9 - 4)(2n - 4n + n) in the form c + bn and give b. -469 Rearrange 10196i3 + 9i*4 + 5 - 5099i*3 - 2i - 5095i3 - 2i*2 to ri*2 + li*4 + t + ki*3 + gi and give t. 5 Express -2930 + 1467 + 1463 - 29n2 - 30n*2 - 2n*3 as wn*3 + un + gn2 + h and give g. -59 Express 2m*4 + 3289 - 3290 + 3m + 3m4 + (-m - 2 + 2)(-7m2 - m3 + 7m*2) as pm*4 + um + d + fm2 + hm*3 and give p. 6 Rearrange -30n*2 + 230n*2 + 263n*2 + 64n*2 to fn + i + tn2 and give t. 527 Rearrange (-2 + 0 + 4)(719l + 100789 - 100789) to the form gl + t and give g. 1438 Rearrange -1815d3 - 13d + 1765d3 + 14d - d*4 + 0d2 + d2 - 1 + d*2 to z + md*2 + sd*4 + td + wd3 and give m. 2 Express ((-1 + 1 - 1)(2 - 4 - 1) - 4 + 2 - 5)(-150 + 150 - a3) in the form va*2 + ka*3 + n + wa and give k. 4 Rearrange 0i2 + 60093i*3 - 14i + 0i2 - 60053i*3 to ri*2 + zi*3 + ji + g and give j. -14 Express -105q + 36q*2 - 105q + 312q - 95q - 4 + 2 as b + nq2 + cq and give n. 36 Rearrange (214 - 1 + 211)(s + 0s - 3s) - 3 - s + 3 + 3s - 2s + s + (2s + 2 - 2)(-3 + 4 + 0) + 5s - 4s - 2s to v + hs and give v. 0 Rearrange 2r + 3r - 3r - 4r + 0r + r + (-5 + 4 + 3)(4 - 2r - 4) + 2r - 6r + 2r + (13r + 10r + 0r)(-4 + 4 + 1) to c + dr and give d. 16 Express -441h + 676h - 1054h in the form n + th and give t. -819 Rearrange -15 - 3y + 4y + 16 + (-y - 1 + 1)(-5 + 2 + 2) + 7y - y - 4y + (0y + 0y - y)(2 - 3 - 1) to qy + u and give q. 6 Express 5 - 36 - 10v + 9v - v2 - v in the form b + xv*2 + jv and give b. -31 Express 25w2 + 1295 - 1295 + (2w2 - w2 - 2w2)(2 + 2 - 5) + 1 + 34w - 2w*2 - 11w - 20w in the form yw + m + zw2 and give m. 1 Express 27z*3 + 12z*3 - 2z*2 - 2 - 33z*3 + 2z in the form nz3 + az + uz2 + m and give n. 6 Express (0y + 0y - 5y*2)(-y - 5y - 5y) + 2 - 2 - 3y3 as my*3 + cy*2 + zy + q and give m. 52 Express -8277f - 6 + 0 + 8286f - 2f + f - f + (4f - 4f + 2f)(1 + 0 + 1) as sf + k and give k. -6 Rearrange (3 + 1 - 5)(4 - 5 + 3)(-3p + 2p - p)(30 - 19 + 58) to bp + w and give b. 276 Rearrange -78s + 473s + 57s to h + vs and give v. 452 Express -385p + 1878p + p in the form gp + h and give g. 1494 Express 4h*3 + 45h*4 + 43h*4 - 143h*4 + 4 + 49h4 + h2 as ah2 + l + sh + th3 + ch*4 and give l. 4 Express 2 + 0 + 2b - 12 + 1 + 3b2 + 2 as hb*2 + s + tb and give t. 2 Express (-862 - 23q - 2q + 859)(3q*3 - 4q*3 + 4q*3) in the form lq*4 + d + kq + zq2 + yq*3 and give l. -75 Rearrange ((2 - 5 + 1)(t - t - 2t) + (-t + 9t - 2t)(9 + 4 + 4))(-3 + 3 - 2t) to b + at + gt*2 and give g. -212 Rearrange -2y*3 + 18y + 9y4 + 21y - 6y4 + 2y*2 + 1 - 38y to the form ry2 + ny + sy4 + c + py*3 and give s. 3 Express (-79 - 4w + 32w - 26w)(2w - 2w - w) in the form s + iw*2 + xw and give i. -2 Rearrange -27k2 + 1348k*4 - k + 1 - 2k*3 - k - 1349k*4 to the form gk*4 + ck*2 + qk + wk3 + b and give q. -2 Express 3n*3 - 135n - 174n + 2n*4 + 311n - 2n2 in the form b + on*3 + in*4 + vn*2 + an and give i. 2 Express (26 - 18 + 16 + (-3 - 2 + 3)(4 - 2 - 3) + 1 - 1 + 2)(7l + 0l + 2l) in the form hl + i and give h. 252 Express 6 - 32 + 16 + 13 + 11 + 19x in the form ox + m and give m. 14 Rearrange -129 - 60a - 8a + 72a to the form ca + m and give m. -129 Express (-4 + 0 + 5 + 4 + 0 - 3 + (-1 - 2 + 2)(-2 + 3 - 3) + 6 - 5 + 4)(204v2 - 24 - 204v*2 - 2v*3) as k + gv*2 + ov*3 + pv and give k. -216 Rearrange 12n - 16n + 18n + (2n - 3 + 3)(4 + 0 - 3) + 0n + 0n + n - 3n + 3 - 3 + (2 + 2 - 3)(-n + 2n - 2n) to jn + s and give j. 13 Express 6x3 - 89 - 5x3 + 108 - x4 - 5x2 - 4x*3 + 2x in the form sx + lx*4 + jx*2 + fx*3 + d and give d. 19 Express (h - 5h - h + 2)(13h + 5h - 5h) + 2h2 - 2h*2 + 3h*2 as ch*2 + p + sh and give c. -62 Rearrange 24i + 24i - 93i + 474 + 18i + 25i to the form ni + m and give n. -2 Express -u*3 + 8u*4 - 3u*4 - 34u - 4u4 + 10u + 0u4 as fu + iu4 + gu*3 + ru*2 + o and give g. -1 Rearrange (2f - 5f + f)(1 - 1 - 1)(-11 - 28 + 263)(1 - 4 + 1) to the form vf + j and give v. -896 Express (446o - 12499 + 12499)(-3 + 2 + 0)(-o*2 - 4o*2 + 4o*2) in the form uo*3 + l + so*2 + ho and give u. 446 Rearrange 2r2 - 3r*2 + 8 - 9 + (-2r + 2r + 36r)(-r - r + r) to pr + xr2 + l and give x. -37 Rearrange (-35 + 53 + 44)(-2v2 + 4v - 4v)(7v2 + 9v*2 + 13v*2) to i + sv*2 + jv*3 + av + zv4 and give z. -3596 Rearrange 3 - 84u - 41u + 39u - 11 to the form o + vu and give o. -8 Express 600 - u - 1207 + 602 - 3u as ou + d and give d. -5 Rearrange 949c*4 - 3c - 9 + 7 - 932c4 to the form rc*3 + oc*4 + q + ac*2 + ic and give i. -3 Express 3n2 - 13 + 83n3 - n4 - 28n3 - 30n*3 - 2n - 27n3 as un*3 + b + pn*2 + cn + wn4 and give p. 3 Express (0j + 2j + 2j)(-46j + 338 - 340 - 32j) in the form z + sj + lj2 and give s. -8 Rearrange -2 - 76r + 7r2 + 54r*2 + 102r + (0 + 0 + r)(-r + 0r + 3r) to qr*2 + ar + w and give a. 26 Express -483o - 118o + 183o - 717o as po + s and give p. -1135 Express 24t - 383 + 12t - 54t + 16t as i + bt and give b. -2 Express y*2 - 86y*4 + 5y*3 + 92y*4 + 3y - 5y3 + y3 - 5y*3 as iy + g + wy3 + hy*2 + uy*4 and give w. -4 Rearrange (-185i + 375i - 192i + 705)(-2i*2 - 11 + 11) to li*2 + r + bi + ci3 and give c. 4 Rearrange -18s + 2s2 - s3 - 21s - 20s + 53s + 7 to the form v + ys2 + ps*3 + as and give v. 7 Express -13 - b*2 + 9 + 13b*3 - 9b - 14b3 in the form ib*3 + ub + w + nb2 and give n. -1 Express (-2v4 - v4 + 6v4)(-1 + 4 - 1) as sv2 + av + yv4 + q + dv3 and give y. 6 Rearrange (-2 + o4 + 2)(-1 - 3 + 2) - 3o4 - o4 + o*4 - 47 + 47 - 3o*4 - 4o*4 to z + go + bo2 + ko*4 + uo*3 and give k. -12 Rearrange 454h + 319h2 - 648h*2 + 327h*2 to the form mh*2 + vh + z and give z. 0 Rearrange (116 + 96 + 700)(-j - 4j + 4j) to the form lj + k and give l. -912 Rearrange 25 + 603h - 3h*2 - 307h - 297h + h4 to vh + bh2 + ch*3 + n + ph*4 and give b. -3 Rearrange (35 - y - 35)(0 + 0 - 3 + (0 + 0 + 2)(0 + 2 + 0)) to the form s + jy and give j. -1 Express 20v - 14v - 17v + 2v + 2 - 2 - 5 - 2v + 5 + (2 + 0 - 4)(-2v - 2v + 5v) - 11v + 3v - 6v as fv + p and give f. -27 Rearrange -18i + 305i + 300i + 641i + 405i to the form ui + a and give a. 0 Express -87 + 172 - 7h*3 + 15h*3 - 4h*2 - 82 as d + ah + nh3 + zh*2 and give z. -4 Express 30k*4 - 3 - 16k*4 + 0 - 6k - 2k2 - 13k*4 in the form c + lk + uk4 + pk*2 + wk**3 and giv	{ "pile_set_name": "DM Mathematics" }
-184, 0.01, 0.1? 0.01 Which is the biggest value? (a) 3/4 (b) 14 (c) 5/3 (d) -5.8 (e) -5 (f) 0.19 b Which is the fourth smallest value? (a) 6 (b) -1 (c) -3 (d) 12/11 (e) -20/7 d What is the second smallest value in -5, 2/25, 0.3, 16666, 0? 0 What is the second biggest value in -19.8, -18, 3, -3, -1? -1 What is the second biggest value in 0, 6, 7, -132, 14/5? 6 What is the third biggest value in 1731, 0.2, 1, 2/7? 2/7 What is the fourth biggest value in 0.1216, -17, 5, -1/3? -17 What is the biggest value in 4.173, -1, 14? 14 What is the fourth smallest value in 2/5, -59/6, -1/5, 4, -3? 2/5 What is the fourth biggest value in -13/7, 0.08, 0.06, -5, -0.1, -3? -13/7 Which is the third biggest value? (a) 6 (b) 1/3 (c) -1/4 (d) 0.4 (e) -7/5 (f) 1 d What is the second smallest value in 8/35, 6, 3/8, 3, 2/9? 8/35 What is the third biggest value in 0.0648, -2/3, -2, -0.2? -2/3 What is the biggest value in -2/13, 0.1, 11.89, -0.2, -4/5? 11.89 Which is the biggest value? (a) -12 (b) 18 (c) 126/5 (d) 5 c Which is the biggest value? (a) 4 (b) 0.1 (c) -0.1 (d) -1434 a Which is the sixth biggest value? (a) -0.3 (b) 0.3 (c) 1/8 (d) -0.7 (e) 2174 (f) 2/19 d What is the fourth biggest value in 3, -5, 47, -2/7, 0.48? -2/7 What is the biggest value in 25, 1/2, 0.09, -1? 25 What is the fourth biggest value in -10, -38.4, -4, -5? -38.4 What is the third smallest value in -0.04, -0.02, -104/245? -0.02 What is the third smallest value in 1, 2, -21? 2 What is the third biggest value in -11/3, -0.6, 0.14? -11/3 What is the fourth biggest value in 567, -4, 3/2, 0.5? -4 Which is the second biggest value? (a) 495 (b) -4 (c) -2 c Which is the biggest value? (a) -1 (b) -4 (c) 3 (d) -5230 c Which is the second biggest value? (a) 6 (b) 35/4 (c) 28 (d) -0.5 (e) -1/8 (f) 4 b What is the second biggest value in -7, -16, 5/6, 91? 5/6 Which is the second smallest value? (a) 2/7 (b) 13 (c) -525 (d) -5 d What is the fourth biggest value in -0.66, 228, 1, 0? -0.66 What is the third biggest value in 8, 9/7, -0.2, 0? 0 What is the second smallest value in -4, 6731, -3/8? -3/8 Which is the third smallest value? (a) -8 (b) -4 (c) -3 (d) 4/25 (e) 1/8 c Which is the second smallest value? (a) -1/7 (b) 0.5 (c) -5 (d) -2/201 (e) 0.2 a What is the third smallest value in -0.26, -926, -0.2? -0.2 Which is the second smallest value? (a) 0 (b) 2 (c) 2/9 (d) 69.7 (e) 0.14 (f) 5 e What is the second biggest value in 0.1, 9, -59/2, -1? 0.1 Which is the third smallest value? (a) 0.313 (b) -2/9 (c) 11 (d) 18 c Which is the biggest value? (a) 3.4 (b) -2/75 (c) 3/28 a Which is the third smallest value? (a) 7 (b) 2 (c) 133 (d) 2/15 (e) -0.19 b What is the third smallest value in 0.082, -3/5, 3? 3 Which is the fourth biggest value? (a) 0.3 (b) 82 (c) -24 (d) 42 (e) 0.5 a What is the fifth smallest value in -3, -39.5, 8, 1, 4, -0.5? 4 Which is the second smallest value? (a) -3/2 (b) 3/7 (c) 99 (d) 59 (e) -2/7 e Which is the biggest value? (a) 5 (b) 46356 (c) 4 b Which is the third biggest value? (a) -111 (b) 1/7 (c) -11 (d) -1 c What is the smallest value in 6/11, -94, -3? -94 What is the second smallest value in -59/3, -0.4, 2/15, -167? -59/3 Which is the fourth smallest value? (a) -22 (b) 0 (c) -5/3 (d) 13 (e) -5 b What is the fourth smallest value in -282, 15, 2/3, -0.8? 15 Which is the fourth biggest value? (a) 0.2 (b) 83 (c) -9 (d) -1 (e) 4/3 d Which is the second smallest value? (a) -1/4 (b) 0.04 (c) -4 (d) 2 (e) 0.08 a What is the smallest value in 4, -31/15, -357? -357 What is the third biggest value in 2, 374, 95? 2 Which is the second smallest value? (a) -15 (b) 3/5 (c) -2/3659 c What is the second biggest value in 255.14, 1/4, -1? 1/4 What is the second biggest value in 0.7, -0.3, 0.1, -6624, 1? 0.7 What is the second biggest value in -2/7, -0.4, -20, 16, -1/156? -1/156 Which is the second smallest value? (a) 204 (b) 0.1 (c) 0.6 (d) -4 (e) 1 b Which is the biggest value? (a) -2 (b) 2 (c) 2/181 (d) 4 d What is the third smallest value in 8, -4, 0.05, 577? 8 What is the fourth biggest value in 0.2, 0.4, 3, -1/6080? -1/6080 What is the fourth biggest value in -1/172, -17, -5, 3? -17 What is the fourth smallest value in -4, -4/7, -0.3, 4, -2? -0.3 What is the third smallest value in 26/5, -3, -0.37, -11, 2? -0.37 Which is the third smallest value? (a) -0.5 (b) -6/5 (c) 2393 c What is the third smallest value in 0, 4/5, 2, -9, 0.26, -7? 0 Which is the second biggest value? (a) 1/2 (b) -0.2 (c) -12/13 (d) -0.3 (e) 56 a What is the third biggest value in 8/41, 0, 14, -6/19? 0 What is the third smallest value in -0.2, -18, 1060? 1060 Which is the fourth smallest value? (a) -4 (b) -0.4 (c) -3/19 (d) -162 (e) 3 (f) -2/7 f What is the smallest value in -310, 17, -13? -310 What is the fourth biggest value in 3/5, -2/25, -0.1, -3/8, -33? -3/8 Which is the third smallest value? (a) 0.3 (b) -5/17 (c) -0.4 (d) 110 (e) -2 b Which is the biggest value? (a) -10 (b) -1625 (c) -0.02 c Which is the third biggest value? (a) -10 (b) -575 (c) 3/5 (d) -0.4 (e) 4/7 d Which is the sixth biggest value? (a) -11 (b) -217 (c) 0.07 (d) -1/4 (e) -4 (f) -3 b What is the third smallest value in 3.064, 0.1, -2/11? 3.064 Which is the third smallest value? (a) 0.5 (b) 0 (c) -3 (d) -0.2 (e) -42 (f) 926 d Which is the fourth biggest value? (a) 2.7 (b) -0.2 (c) 5/4 (d) -1/7 (e) -34 b What is the smallest value in -2/9, -20, 103, 47? -20 Which is the third smallest value? (a) 10.3 (b) -9/8 (c) 3 (d) 2 (e) -3 (f) -2/3 f Which is the smallest value? (a) 0.1 (b) 1/12 (c) 0.255 (d) -3 (e) 5 d What is the fourth smallest value in 0.3, 23.3, -0.3, -2/9? 23.3 Which is the second smallest value? (a) 1/3 (b) 0.9 (c) 0.02705 (d) -1 c What is the third smallest value in -10, 713, -1/3, 0.3, -1? -1/3 What is the sixth smallest value in -0.02, -69, 4, -0.1, 0.4, 8/7? 4 What is the third smallest value in 132, 3, 5/548, 0? 3 Which is the second smallest value? (a) 5 (b) -0.5 (c) 4 (d) -0.6 (e) -3 d What is the smallest value in -5, -2/5, 24.27, 5? -5 What is the smallest value in -1/4, 0.5, -224744? -224744 Which is the second biggest value? (a) 115 (b) 7/8 (c) -9 b What is the fourth smallest value in 2/31, 4, -59, 9/7? 4 Which is the sixth smallest value? (a) 4 (b) -2/7 (c) -1/28 (d) -0.1 (e) 0.3 (f) 1/11 a What is the third biggest value in -1/12, 1, 0.82? -1/12 Which is the sixth smallest value? (a) -6 (b) -0.2 (c) 234 (d) -3 (e) -33/4 (f) -0.4 c What is the smallest value in 7, 801, -17.8? -17.8 What is the biggest value in -3/2, -2/21, 5, -42? 5 Which is the fifth biggest value? (a) -0.4 (b) 2/153 (c) -0.1 (d) -8 (e) -1/3 d Which is the third biggest value? (a) 0.1 (b) -1/8 (c) 2/5 (d) -7 (e) -0.5 b Which is the second smallest value? (a) 1 (b) 13/20 (c) 3 (d) 2/15 (e) 4 b What is the third smallest value in 0, 205, 2/11, 5, -4? 2/11 Which is the second smallest value? (a) 18984 (b) -3/5 (c) -2/15 c Which is the smallest value? (a) 1/5 (b) 0.1 (c) -0.8 (d) -1580 d What is the second smallest value in 1/5, -189/16, -0.4, -0.3, -2/7? -0.4 What is the fifth biggest value in 3/7, -7, -402, 1/28, -4? -402 What is the fourth biggest value in -70, -4, -625, -3/5, -5? -70 What is the second smallest value in -1, 4, 442, -0.6? -0.6 What is the smallest value in -3, 2, -0.12, 2.6, -1? -3 What is the smallest value in 3, 113, -1.2, -3/13? -1.2 What is the third smallest value in 0.07, 1135, -5? 1135 What is the smallest value in 4, -3, 16338? -3 What is the second biggest value in -14, -4, 0.3, -6, 10? 0.3 Which is the second smallest value? (a) 183 (b) 0 (c) 1/47 c What is the second smallest value in -5, 20, 2, -0.5, -520, 0.09? -5 What is the third biggest value in -0.06, -1/4, -5, 0.2, 1, 3/5? 0.2 What is the fourth smallest value in 2/13, 161, -12.5, 2/5? 161 What is the smallest value in -3, -4, 4, 0.07, -0.4, -777? -777 What is the second smallest value in -0.11, -3892, -0.2? -0.2 What is the second biggest value in 0.06, 6, 36, 32? 32 Which is the fourth smallest value? (a) -0.3 (b) 0.04 (c) 2 (d) -2/9 (e) -47 b What i	{ "pile_set_name": "DM Mathematics" }
f n(t)? 9 Let w be (-188)/(-846) + 16/54153/12. Let s = 13 + -9. Suppose 3x - 2y = 545, -sy + 3y = -wx + 720. What is the units digit of x? 9 Let y(l) = 41l + 252. Let v be y(-6). Suppose 0 = vb - 10b - 2w + 4064, b - 1006 = 2w. What is the thousands digit of b? 1 Let r(t) = -25t - 1. Let w be r(-1). Let z = w + -9. Suppose -17q = -zq - 218. What is the hundreds digit of q? 1 Suppose -g + 3p = -1877, 0 = 4g + 4p - 596 - 6880. Let a = -765 + g. What is the units digit of a? 6 Let n(s) = -4s*3 + 27s*2 - 25s + 38. Let i(v) = -3v3 + 26v*2 - 25v + 37. Let f(x) = 5i(x) - 4n(x). What is the units digit of f(-22)? 3 Let r(a) = -1349a + 555. What is the hundreds digit of r(-6)? 6 Let z be (-6)/(-16) - (-3542)/368. Suppose -w - zh = -7h - 476, 2w - 5h - 941 = 0. What is the tens digit of w? 7 Suppose -2v - 91109 = -3r, -83139 = -5r - v + 68718. What is the thousands digit of r? 0 Suppose -3s = 4j - 0s - 1, 5j = -3s + 5. Suppose -z + 156 = 2r, -8z - jr + 750 = -3z. What is the hundreds digit of z? 1 Let v = -2 + 15. Suppose 17 - v = -4r, 0 = -4p + 3r + 99. What is the units digit of p? 4 Let f(i) = 741i2 - 10i - 2. Let g be f(-1). Suppose -4x - 3z = -2970, -x + z - 5z = -g. What is the hundreds digit of x? 7 Suppose 4r - 21302 = -3w + 13263, -3r = -2w + 23066. What is the tens digit of w? 2 Let y = 4670 - -18619. What is the ten thousands digit of y? 2 Let g(o) = -7o*2 + 10o - 47. Let b be g(-9). Let t = 859 + b. What is the units digit of t? 5 Suppose -295 = 5q - 2z, -5q + 2z - 173 = -2q. Let o = q + 405. What is the units digit of o? 4 Let w(n) = n3 + 9n*2 - n - 22. Let i be w(-9). Let z = 15 + i. Suppose 3h = -3g + 258, 6 = -2h + z. What is the tens digit of g? 8 Let g(k) = -1550k + 405. What is the tens digit of g(-2)? 0 Let b(i) = -i2 - 37i + 173. Let y be b(-28). Suppose -yu = -431u + 3072. What is the hundreds digit of u? 5 Let t be (-9 + 5)/(2 - 0). Let g be (-1 - 3)/(t/94). Let m = -109 + g. What is the tens digit of m? 7 Let x(n) = -n*2 - 6n - 1. Let o be x(-5). Suppose -oj + 0j + 4 = 0. What is the units digit of j? 1 Let a(t) be the third derivative of 13t2 + 0 - 89/24t*4 + 0t + 1/2t3. What is the tens digit of a(-1)? 9 Let u be ((-315)/60)/((-3)/76). Let r = 136 - u. Suppose 81 = rs - 219. What is the tens digit of s? 0 Let s(b) = 127b2 + b + 1. Let t(j) = -j3 + 6j*2 + 11j - 81. Let o be t(5). What is the hundreds digit of s(o)? 1 What is the tens digit of 10842 + -4 + -20 + 1? 1 Let v(x) = x*3 - 35x*2 - 27x - 421. What is the units digit of v(38)? 5 Let p = -546 + 1202. Suppose -3b - w - 4w + p = 0, 474 = 2b - 4w. What is the units digit of b? 7 Suppose 251m - 2860069 = 1369783. What is the tens digit of m? 5 Suppose 6o - 143 + 119 = 0. Suppose -569 = -od + 2143. What is the tens digit of d? 7 Let c(a) = 8a - 24. Let w be c(6). Let y be (-6 + (-5)/(-5))w. Let m = -45 - y. What is the tens digit of m? 7 Let j(z) = -z3 + 9z*2 + 10z + 4. Let y be j(10). Suppose -1489 = -yu + 439. What is the tens digit of u? 8 What is the thousands digit of -27 + (-399)/(-19) + 141048? 4 Let g = 55 - 53. Let h(q) = 12 - 28 + q*g - 10q + 12 + 9. What is the tens digit of h(-11)? 3 Let h(v) be the third derivative of -v*6/120 + 13v*5/30 + 11v*4/8 - 13v*3/3 - 3v*2. Let g be 706/26 + (-116)/754. What is the tens digit of h(g)? 3 Let l = -10310 - -19987. What is the hundreds digit of l? 6 Suppose 2g = -5g - 28. What is the units digit of ((-68)/1 - 10)/(g/6)? 7 Suppose 0 = 6y + 789 - 19599. Suppose -20f + y = -f. What is the tens digit of f? 6 Let t(p) = 5p*3 - 5p*2 - 4p - 6. Let c be t(-4). Let q = c - -651. Suppose 2m + 57 - q = 0. What is the hundreds digit of m? 1 Suppose 2 - 9 = w. Let x(s) = -s2 - s2 - 44 + 38 + 2s*2 + 6s + s*2. What is the units digit of x(w)? 1 Let o = -46 + 46. Suppose 2v + 5w - 36 = o, 0 = -v - 3w + 5w + 18. Let a(t) = -t2 + 25t - 13. What is the tens digit of a(v)? 1 Let z(m) = -m2 - m - 1. Let p(k) = -k3 + 6k2 - 5k - 2. Let w(j) = p(j) + 6z(j). What is the tens digit of w(-7)? 1 Let k = 84 + -81. Suppose -kw + 700 = 2w. Suppose -m = m - w. What is the units digit of m? 0 Let q = 19516 - 5428. What is the ten thousands digit of q? 1 Suppose -3724 = -u + 2k, 2u - 7478 = -k - k. What is the hundreds digit of u/10 - (-14)/(-35)? 3 Suppose 4k - 10260 = -5k. Let m = k + -602. What is the hundreds digit of m? 5 Suppose -37y - 42416 = -67y + 182674. What is the hundreds digit of y? 5 Let x(w) = w2. Let y(t) = 7t*2 - 6t + 6. Let h(a) = 3x(a) + y(a). Let p be h(2). Suppose 5u = -p + 169. What is the units digit of u? 7 Let d(a) = 2a2 + 39a + 179. Suppose -3y - 9 = 0, -2y + 22 = -4q - 72. What is the tens digit of d(q)? 5 Let o(y) = -y3 - 128y*2 - 293y + 365. What is the hundreds digit of o(-128)? 8 Let a = 15 - 14. Let k(i) = 130i3 - 2i + 3. Let m be k(a). Suppose j - m + 45 = 0. What is the tens digit of j? 8 Let i(z) = 32z2 + 3z - 13. Suppose k - 21 = 2x - 0k, 6 = -2x - 2k. What is the hundreds digit of i(x)? 0 Let h(x) = 26 - 82 + 20x + 28 + 34. Let v be (-6)/(-3) - (-1 + 0). What is the units digit of h(v)? 6 Let x = -710 - -730. Let n(w) = 4w*2 - 9w - 85. What is the tens digit of n(x)? 3 Let x be ((72/7)/(-9))/((-4)/14). Suppose xu - 14u = -4760. What is the units digit of u? 6 Suppose -113944 = -76t + 799044. What is the ten thousands digit of t? 1 Suppose 8l = 3l + 2n - 3109, -n + 2 = 0. Let z = -336 - l. What is the units digit of z? 5 Let t be ((-176)/40 - -7) + (-4)/(-10). Suppose -9d + td = -4200. What is the hundreds digit of d? 7 Suppose x = 5q - 40353, -104x = -4q - 108x + 32268. What is the units digit of q? 0 Let k(o) = 94o + 2081. What is the tens digit of k(40)? 4 Let h be ((-5)/(45/3))/((-2)/450). Suppose -h = -4o + 7o. What is the tens digit of (-2 + 114 - 0) + (-26 - o)? 1 What is the thousands digit of (148/38 - 12/(-114))2 - -37566? 7 Suppose 3p = -6893 + 25616. What is the thousands digit of p? 6 Suppose 4l + 5y + 101 = 0, -3l - 6y = -y + 77. Let j be 16(-4)/l2670/8. Suppose -314 = 4p - j. What is the hundreds digit of p? 1 Suppose -33920 = -4p - 2z, 7p = 9p + 2z - 16966. What is the thousands digit of p? 8 Suppose 0 = 14o - 4o - 121300. What is the thousands digit of o? 2 Let w(a) = a2 - 19. Suppose -5d + 6n = 2n + 79, 5d + n + 74 = 0. Let m be ((-6)/21)/(6/(-14))d. What is the units digit of w(m)? 1 Suppose -114l - l + 5255615 = 0. What is the units digit of l? 1 Let m = 271 - 275. What is the hundreds digit of ((-540)/630)/(m/4578)? 9 Suppose 0 = -j - h + 23346, -14j + 11j + 70040 = 2h. What is the thousands digit of j? 3 Let j(k) = -6k2 - k - 1. Let m be j(-1). Let g(u) = -11u - 1. Let n be g(m). Suppose -r = -n - 0. What is the units digit of r? 5 What is the thousands digit of 1 + -3 + 17451 + 12 + -10 + 2? 7 Let r = -29580 - -42039. What is the ten thousands digit of r? 1 Suppose 183791 = 90f - 54349. What is the hundreds digit of f? 6 Let c be (14/42)/(1/6). Let g be 50/30 - -2c/(-6). What is the units digit of (g - 18/2)-2? 6 Let w be (-24)/30 - 234/(-5). Suppose wk = -11273 + 60447. What is the hundreds digit of k? 0 Let h(f) = 13f2 - 163f - 1901. What is the thousands digit of h(-12)? 1 Let k = -147 - -121. What is the tens digit of (34/2)/((-2)/k) + -1? 2 Let h = 117 + -112. Let k(d) = -d + 7. Let u be k(h). Suppose ul = 124 - 18. What is the units digit of l? 3 Suppose -1724 = -2v + 4b, -4v + 6b + 3393 = 9b. Suppose -123 = 3l - v. Suppose -l = -2h + 137. What is the hundreds digit of h? 1 Let o be 2 - ((-44)/(-6))/((-24)/36). What is the tens digit of (o - 17) + (596 - 0)? 9 Suppose -o + 67 + 98 = 0. Suppose -z - 8 = -7s + 11s, -3z = 3s - 3. Suppose -6n = 4t - n - o, 3t - 85 = zn. What is the units digit of t? 5 Suppose 2k + 4j = 11516, 8j = 5k + 7j - 28834. What is the tens digit of k? 6 Let y be (10 + 64/(-12))/((-2)/735). Let w = y - -3041. What is the thousands digit of w? 1 Let r(k) be the first derivative of 3k*2/2 + 9k + 34. Let n be r(15). Suppose -2*t = -n - 118. What is the tens digit of t? 8 Let w = 4840 + -4	{ "pile_set_name": "DM Mathematics" }
ing 1 m and 1 b when two letters picked without replacement from zbbzmbmbbbbb? 8/33 Three letters picked without replacement from ndzznyynddyyzyndna. Give prob of picking 1 z and 2 d. 3/136 Calculate prob of picking 1 l and 3 u when four letters picked without replacement from uluu. 1 Four letters picked without replacement from {q: 1, n: 1, m: 1, e: 1, i: 2, c: 1}. Give prob of picking 1 c, 1 n, 1 i, and 1 m. 2/35 Four letters picked without replacement from stvzswta. Give prob of picking 1 v, 1 z, 1 t, and 1 a. 1/35 Four letters picked without replacement from gkxkwww. What is prob of picking 1 g, 1 k, and 2 w? 6/35 What is prob of picking 1 k and 2 a when three letters picked without replacement from aaaaaaaaaaakaaakaaaa? 51/190 Two letters picked without replacement from {s: 4, l: 1, u: 4, p: 1, q: 4, z: 5}. Give prob of picking 1 q and 1 s. 16/171 Four letters picked without replacement from ffttttttft. Give prob of picking 2 f and 2 t. 3/10 What is prob of picking 2 q and 1 p when three letters picked without replacement from ppqpqpqppp? 7/40 Two letters picked without replacement from {j: 1, o: 8, a: 4, p: 5}. Give prob of picking 1 a and 1 p. 20/153 What is prob of picking 2 m and 1 i when three letters picked without replacement from {i: 5, m: 2}? 1/7 What is prob of picking 3 t and 1 l when four letters picked without replacement from xtxtxlwxtxtww? 4/715 Three letters picked without replacement from qggggq. What is prob of picking 2 q and 1 g? 1/5 What is prob of picking 2 t when two letters picked without replacement from {t: 7}? 1 Two letters picked without replacement from kkkkkkkkikki. Give prob of picking 2 i. 1/66 Calculate prob of picking 4 d when four letters picked without replacement from dwddddddwdddwdddww. 143/612 Two letters picked without replacement from smiep. Give prob of picking 1 s and 1 p. 1/10 Two letters picked without replacement from jjroreeaoeaojeeeowja. Give prob of picking 1 o and 1 r. 4/95 Calculate prob of picking 1 g and 1 a when two letters picked without replacement from {u: 1, a: 2, g: 1, j: 1, p: 3, h: 10}. 2/153 What is prob of picking 1 q, 1 v, and 1 g when three letters picked without replacement from {l: 1, v: 2, g: 3, q: 4, r: 1}? 8/55 What is prob of picking 1 x, 2 c, and 1 g when four letters picked without replacement from xcgxgxkccxggxxg? 6/91 Two letters picked without replacement from {u: 4, h: 10}. Give prob of picking 2 h. 45/91 Calculate prob of picking 1 r and 1 q when two letters picked without replacement from {v: 3, h: 2, j: 2, q: 3, x: 6, r: 2}. 2/51 Calculate prob of picking 1 u, 1 f, and 1 t when three letters picked without replacement from {t: 2, g: 1, k: 7, u: 1, f: 2, h: 2}. 4/455 Two letters picked without replacement from {d: 3, b: 7}. What is prob of picking 2 d? 1/15 What is prob of picking 3 q and 1 s when four letters picked without replacement from qsszsqsq? 2/35 Calculate prob of picking 3 v when three letters picked without replacement from {s: 3, i: 3, m: 1, u: 1, v: 2}. 0 Calculate prob of picking 4 f when four letters picked without replacement from zzfwzffwfwwwfwwwf. 3/476 What is prob of picking 1 z, 1 t, and 2 l when four letters picked without replacement from {d: 3, o: 4, s: 2, z: 4, t: 3, l: 2}? 1/255 Two letters picked without replacement from vvitkvuvizuk. Give prob of picking 1 v and 1 t. 2/33 Calculate prob of picking 4 c when four letters picked without replacement from ccfcccccgnfcfcff. 9/130 Two letters picked without replacement from {k: 4, b: 1, t: 4, f: 6, v: 1}. Give prob of picking 1 t and 1 f. 1/5 Calculate prob of picking 1 q and 3 s when four letters picked without replacement from sssqqsqssss. 28/55 Three letters picked without replacement from oohllhgzr. Give prob of picking 1 l, 1 r, and 1 h. 1/21 Calculate prob of picking 1 g, 1 v, and 1 d when three letters picked without replacement from gxvvdugxvg. 3/40 Four letters picked without replacement from {b: 2, n: 4, w: 2, z: 1, k: 2, p: 3}. Give prob of picking 2 b, 1 z, and 1 k. 2/1001 Calculate prob of picking 1 c and 1 t when two letters picked without replacement from ctcctt. 3/5 Calculate prob of picking 2 g when two letters picked without replacement from {y: 1, p: 2, c: 1, g: 2, h: 1}. 1/21 Calculate prob of picking 4 l when four letters picked without replacement from wlllwwwwwlwlwwww. 1/364 What is prob of picking 2 k when two letters picked without replacement from {k: 7}? 1 Two letters picked without replacement from {m: 2, i: 2, c: 2, b: 2}. What is prob of picking 2 m? 1/28 Three letters picked without replacement from {w: 5, q: 7}. Give prob of picking 3 q. 7/44 Calculate prob of picking 1 z and 1 y when two letters picked without replacement from {z: 9, y: 3}. 9/22 Three letters picked without replacement from {r: 1, c: 2, f: 1, t: 1, e: 1, i: 1}. Give prob of picking 2 c and 1 f. 1/35 Three letters picked without replacement from mcmmcmmm. Give prob of picking 2 m and 1 c. 15/28 Calculate prob of picking 1 k and 1 l when two letters picked without replacement from klkyjjjljl. 2/15 Three letters picked without replacement from {d: 3, z: 1, v: 3, e: 2, f: 3, j: 1}. What is prob of picking 2 e and 1 j? 1/286 Four letters picked without replacement from nlnnzljuxjj. Give prob of picking 3 x and 1 j. 0 Two letters picked without replacement from rhnbssnnnrnr. Give prob of picking 1 b and 1 n. 5/66 Two letters picked without replacement from mtm. What is prob of picking 1 t and 1 m? 2/3 Calculate prob of picking 2 f and 2 q when four letters picked without replacement from vhhvhfvqvkqvhvfv. 1/1820 Three letters picked without replacement from {n: 2, a: 10, r: 1, t: 1}. Give prob of picking 2 n and 1 t. 1/364 What is prob of picking 1 a and 1 j when two letters picked without replacement from ggjgjxgyaxgjgjag? 1/15 Three letters picked without replacement from twwzjydj. What is prob of picking 1 d, 1 j, and 1 t? 1/28 What is prob of picking 1 s and 1 v when two letters picked without replacement from ccvsecscpppu? 1/33 Four letters picked without replacement from qooeezelnloqqelqeo. What is prob of picking 3 q and 1 z? 1/765 Calculate prob of picking 1 n and 1 f when two letters picked without replacement from nnoonxnnf. 5/36 Calculate prob of picking 1 j and 3 m when four letters picked without replacement from {m: 11, j: 2}. 6/13 Two letters picked without replacement from {i: 3, p: 4, y: 2, u: 2}. What is prob of picking 2 p? 6/55 Four letters picked without replacement from efexetotfitfft. Give prob of picking 3 f and 1 e. 12/1001 Two letters picked without replacement from rmvovrg. What is prob of picking 1 g and 1 v? 2/21 Calculate prob of picking 1 x and 2 q when three letters picked without replacement from {p: 3, d: 8, q: 4, x: 4}. 8/323 What is prob of picking 2 l when two letters picked without replacement from {l: 4}? 1 Calculate prob of picking 1 k and 1 f when two letters picked without replacement from {k: 2, f: 8}. 16/45 What is prob of picking 1 c and 1 g when two letters picked without replacement from aggycgggaagcagccgcbg? 9/38 Calculate prob of picking 4 m when four letters picked without replacement from {c: 2, m: 7}. 5/18 Calculate prob of picking 1 m and 1 h when two letters picked without replacement from {q: 1, h: 3, m: 4}. 3/7 Three letters picked without replacement from bjbjjjjbbb. What is prob of picking 1 j and 2 b? 5/12 What is prob of picking 1 x and 2 r when three letters picked without replacement from rxxrrrrrqrxexrxrxrxq? 21/76 Three letters picked without replacement from bgdtjmd. What is prob of picking 1 d, 1 j, and 1 m? 2/35 Four letters picked without replacement from {x: 4, h: 2, k: 1, w: 2, b: 1}. Give prob of picking 2 x, 1 w, and 1 h. 4/35 Two letters picked without replacement from yqoqooyqoyo. What is prob of picking 2 y? 3/55 Four letters picked without replacement from {c: 2, b: 4, j: 8}. Give prob of picking 1 j and 3 b. 32/1001 What is prob of picking 1 p, 1 a, and 2 f when four letters picked without replacement from {a: 1, f: 11, p: 7}? 385/3876 What is prob of picking 1 v, 1 m, and 2 f when four letters picked without replacement from mvffvfvgvggvvvfffv? 2/51 Calculate prob of picking 1 l and 2 a when three letters picked wi	{ "pile_set_name": "DM Mathematics" }
076980 Calculate the common denominator of 75/8 and -71/308912. 308912 Calculate the lowest common multiple of 978 and 163. 978 What is the common denominator of 41/1500 and -109/10? 1500 What is the least common multiple of 1020 and 33252? 166260 Find the common denominator of -12/10283 and -75/11978. 1089998 What is the common denominator of -93/189994 and -95/8? 759976 What is the common denominator of -127/33456 and 149/41820? 167280 What is the common denominator of -74/15365 and 25/49? 107555 Find the common denominator of -37/8 and 95/6108. 12216 What is the least common multiple of 168 and 17692? 743064 Calculate the smallest common multiple of 3330 and 126. 23310 What is the smallest common multiple of 1200 and 2250? 18000 Calculate the common denominator of 49/80 and 41/38384. 191920 Calculate the common denominator of -7/3240 and 22/255. 55080 Calculate the common denominator of -61/94 and -35/4841. 9682 Calculate the least common multiple of 32477 and 43. 1396511 What is the lowest common multiple of 5920 and 277648? 2776480 Find the common denominator of -71/152762 and -27/272. 1222096 What is the smallest common multiple of 10233 and 277428? 2496852 Find the common denominator of 125/130326 and 83/12. 260652 What is the common denominator of -121/6 and 65/22534? 67602 Find the common denominator of -155/12672 and -67/20592. 164736 What is the common denominator of 107/3696858 and -95/264? 14787432 Calculate the common denominator of -76/24591 and -119/6. 49182 Calculate the common denominator of -131/40040 and 43/1100. 200200 What is the common denominator of -9/25856 and 83/19392? 77568 What is the smallest common multiple of 33 and 161835? 1780185 Find the common denominator of 41/165034 and -133/1818. 1485306 What is the least common multiple of 121 and 22242? 244662 Calculate the smallest common multiple of 1606 and 121. 17666 What is the least common multiple of 99256 and 72? 893304 What is the common denominator of -53/3468 and 31/28? 24276 Calculate the common denominator of -101/1942470 and -23/111870. 21367170 Calculate the common denominator of -1/330 and -109/64130. 192390 Calculate the least common multiple of 118998 and 84. 1665972 What is the least common multiple of 18 and 28500? 85500 Find the common denominator of -69/1508 and -49/872. 328744 Calculate the common denominator of 56/32555 and -91/510. 195330 What is the common denominator of 79/2110 and -53/4? 4220 Calculate the lowest common multiple of 15294 and 216. 550584 What is the common denominator of -89/18 and 139/44748? 44748 Calculate the common denominator of 139/48 and -151/132972. 531888 Calculate the common denominator of 4/107379 and -79/6. 214758 Find the common denominator of -143/12 and 103/2781608. 8344824 Calculate the lowest common multiple of 354 and 91450. 274350 What is the least common multiple of 14 and 32116? 32116 What is the common denominator of 20/51 and 83/68? 204 Find the common denominator of -31/258336 and 17/216. 258336 Calculate the lowest common multiple of 338688 and 196. 338688 What is the lowest common multiple of 68710 and 130? 893230 Calculate the common denominator of -121/350 and 163/1050. 1050 Calculate the smallest common multiple of 110509 and 4. 442036 What is the least common multiple of 38500 and 330? 115500 Calculate the smallest common multiple of 12786 and 592418. 1777254 Calculate the common denominator of -25/4172 and -29/1925. 1147300 What is the least common multiple of 8 and 99? 792 Find the common denominator of 95/6036 and -95/18108. 18108 What is the common denominator of 47/3 and -34/17559? 17559 What is the smallest common multiple of 576 and 270288? 1081152 What is the smallest common multiple of 12 and 1584? 1584 What is the common denominator of 101/576 and 151/360? 2880 Calculate the smallest common multiple of 4208 and 3682. 29456 Calculate the common denominator of 151/1284 and 37/156. 16692 What is the least common multiple of 70656 and 48? 70656 Calculate the common denominator of -83/4 and -173/14220. 14220 What is the common denominator of -45/904996 and 29/2262490? 4524980 Calculate the lowest common multiple of 46862 and 16. 374896 Calculate the common denominator of 57/290296 and 51/10480. 2902960 What is the lowest common multiple of 1092 and 33852? 33852 Find the common denominator of -13/245 and 169/2370. 116130 Find the common denominator of 67/126552 and -107/221466. 885864 Calculate the common denominator of -43/40 and -3/3850. 15400 What is the common denominator of -23/6 and -73/70266? 70266 Calculate the least common multiple of 70950 and 110. 70950 Calculate the common denominator of 27/3500 and -7/135000. 945000 Calculate the common denominator of -101/507464 and -31/2216. 507464 Calculate the common denominator of -193/263310 and 133/3216. 2106480 Find the common denominator of -131/30414 and 47/15. 152070 Calculate the least common multiple of 10674 and 25302. 45012258 What is the common denominator of -31/105984 and -61/529920? 529920 Calculate the common denominator of -23/36072 and -67/8. 36072 Calculate the common denominator of 19/3210 and -41/55. 35310 Calculate the lowest common multiple of 102 and 590154. 10032618 What is the least common multiple of 3468 and 44? 38148 Calculate the common denominator of 9/1672 and 7/103246. 412984 Calculate the common denominator of -145/12204 and 31/13560. 122040 What is the common denominator of -103/27846 and -83/120258? 10943478 Calculate the lowest common multiple of 32490 and 75810. 227430 Calculate the common denominator of -80/15183 and -103/18. 30366 What is the common denominator of 5/21 and -41/5229? 5229 What is the common denominator of -131/1008 and -157/306? 17136 Calculate the common denominator of 99/120028 and 47/52. 1560364 Find the common denominator of 37/66418 and -71/30190. 332090 What is the common denominator of 38/6075 and 17/16200? 48600 Calculate the common denominator of 47/1161 and 52/999. 42957 Calculate the least common multiple of 21000 and 438900. 4389000 Calculate the common denominator of -17/11 and -65/758278. 8341058 What is the common denominator of -163/116886 and 17/3036? 233772 Find the common denominator of -139/19440 and -27/4120. 2002320 Calculate the common denominator of -121/3618 and 95/678. 408834 What is the common denominator of -21/442 and -15/210647? 5476822 Calculate the common denominator of 19/2865 and -19/63. 60165 Calculate the smallest common multiple of 151 and 7550. 7550 What is the lowest common multiple of 52 and 1864? 24232 Find the common denominator of 47/7735 and 27/68. 30940 What is the lowest common multiple of 112336 and 385152? 2696064 Find the common denominator of -91/130670 and 63/16. 1045360 What is the least common multiple of 15 and 10270? 30810 What is the smallest common multiple of 134780 and 45? 1213020 What is the least common multiple of 72 and 810936? 810936 Find the common denominator of -191/96750 and -167/300. 193500 What is the lowest common multiple of 24345 and 86560? 779040 What is the common denominator of -8/561 and 46/3213? 35343 Find the common denominator of 4/12705 and -12/385. 12705 Calculate the common denominator of 101/64866 and -53/1064. 1816248 Find the common denominator of 11/36 and 65/134592. 403776 What is the common denominator of 49/902 and 69/19844? 19844 Find the common denominator of 55/25462 and 2/61899. 3590142 Calculate the common denominator of -34/7515 and -73/19539. 97695 What is the common denominator of -27/11528 and -119/528? 69168 What is the least common multiple of 118440 and 53298? 1065960 Calculate the common denominator of -49/40 and -43/52360. 52360 Calculate the common denominator of -19/3324 and -57/12418. 20638716 What is the smallest common multiple of 438 and 14308? 42924 Calculate the common denominator of 79/1764 and 27/4592. 289296 What is the common denominator of -85/264 and 93/140? 9240 Find the common denominator of 29/404352 and 163/31590. 2021760 What is the least common multiple of 63 and 85140? 595980 Calculate the common denominator of -9/32 and 97/42704. 85408 Calculate the smallest common multiple of 9 and 515403. 515403 Calculate the common denominator of 4/45 and -35/1728. 8640 Cal	{ "pile_set_name": "DM Mathematics" }
y*3 + 2y*2 + 4y - 3. Let c be m(3). Suppose c = -g + 2. Let n be 1 + 0 + (6 - 1). What is the highest common factor of g and n? 2 Let z be 1 + 4/2 - 1. Calculate the highest common divisor of 8 and z. 2 Suppose 0 = 4j - 103 + 31. What is the highest common divisor of j and 162? 18 Suppose -5c = 4m - 37, 0 = -0m + m - 3c - 22. Suppose -25 - 14 = -3l. Calculate the greatest common divisor of l and m. 13 Let q = 2 - 21. Let w be (7 + q)/(2/(-3)). Calculate the highest common factor of 6 and w. 6 Let n = -1 + 1. Suppose -2q + n = -60. Let t(g) = 4g + 4. Let s be t(4). What is the highest common divisor of s and q? 10 Let q be 3 + -2 - 0 - -3. Suppose -a - 12 = -qa. Calculate the greatest common divisor of a and 10. 2 Let h(s) = s3 - 5s*2 + 2s - 1. Let b be h(5). Calculate the greatest common divisor of 45 and b. 9 Suppose -2o + 2z = 6z - 18, -5o - 3z + 73 = 0. Calculate the greatest common divisor of 85 and o. 17 Suppose 5p + 4i - 1259 = 0, -4i = 4p - 3i - 1016. What is the highest common factor of 15 and p? 15 Let n(c) = 2c2 + 9c + 4. Let s be n(-6). Calculate the highest common divisor of s and 22. 22 Suppose -l + 0l + 22 = 0. What is the greatest common divisor of l and 154? 22 Suppose 5p = -2v + 35, -p - v = -3 - 1. What is the greatest common divisor of p and 63? 9 Suppose -6a + 50 + 34 = 0. Calculate the greatest common factor of 126 and a. 14 Suppose -5j + 27 = -108. Let k be j/6 - (-2)/(-4). Calculate the greatest common divisor of 24 and k. 4 Let o = 12 + 24. Calculate the greatest common factor of o and 9. 9 Let j(g) = 9g*2 + 3g - 2. Let u = -2 + 2. Let d = -3 + u. Let o be j(d). Calculate the highest common divisor of 14 and o. 14 Suppose -2k - 40 = -3k. Suppose -6i + i - 40 = 0. Let y = i - -13. What is the highest common divisor of k and y? 5 Suppose 3z + 44 = 236. Calculate the highest common divisor of 8 and z. 8 Let c(k) be the first derivative of -3k2 - 12k - 1. Let a be c(-6). What is the highest common factor of 3 and a? 3 Suppose -3m = -7m. Suppose i = -p + 5 - m, 4i + 2p - 20 = 0. Let v(n) = 19n3 + n2. Let s be v(1). What is the highest common factor of s and i? 5 Suppose 83 + 27 = 5j. Suppose 4q + 165 = 7q. Calculate the greatest common divisor of q and j. 11 Suppose -2c = -0 - 14. Suppose -2y - 20 = -cy. Calculate the highest common factor of y and 36. 4 Let m = 19 - 7. Suppose 1 = -3k + 7. Suppose -2r - 24 = -g, 3r + kr = -g + 3. Calculate the highest common divisor of g and m. 6 Suppose 4b - x + 0x = 91, -5x = 2b - 29. Calculate the highest common factor of 176 and b. 22 Let k(s) = s3 - 6s*2 - 6s + 6. Suppose -3v - v = 4. Let w be (v - -3)/(16/56). Let n be k(w). What is the highest common factor of n and 26? 13 Suppose -8 - 14 = -2o. What is the greatest common factor of 121 and o? 11 Let w be (-28 - -4)(-4 + 3). What is the highest common factor of 8 and w? 8 Let g(c) be the second derivative of c3/3 + c2 + c. Let p be g(6). Calculate the greatest common divisor of 56 and p. 14 Let t(v) = -v + 9. Let y be t(7). Suppose -20 = -0k - yk. Let o = 123 + -13. What is the greatest common factor of k and o? 10 Let j(s) = -2 + 6 - 15s + 16s. Let v be j(12). What is the highest common divisor of 80 and v? 16 Let m = 1 + -1. Suppose mp = 3p - 54. Suppose 7n + 0n = 42. Calculate the greatest common divisor of p and n. 6 Suppose 194 = -4s + 6s. Suppose -5w = -3c - 75 - 0, -4w + s = 5c. Let f be 3-2(-6)/4. What is the greatest common factor of f and w? 9 Suppose 2j + 10 = 0, -4d - 2j + 10 = -4j. Suppose dv = -2v + 240. What is the highest common factor of v and 15? 15 Suppose -3 = -o - 2o. Let z be o/(-1) + 32/2. Let b = -176 + 221. Calculate the greatest common divisor of b and z. 15 Let k be 3/130/9. Let w = k + -5. Calculate the highest common divisor of 2 and w. 1 Let b be 0 + (-3)/3-2. Let t(f) = -7f - 1. Let y be t(b). Let j be (y/(-6))/(2/72). What is the greatest common factor of j and 10? 10 Let v = 9 + -7. Suppose vs = -0s + 18. What is the highest common factor of s and 27? 9 Suppose g = 6g - 885. Suppose -2x + x + 4l + g = 0, -5l = 15. Calculate the highest common factor of 15 and x. 15 Let y = -30 + 43. Let o(s) = 7s + 1. Let v be o(-2). Let f = 0 - v. Calculate the highest common factor of f and y. 13 Suppose -w + 2f - f = -26, 0 = 3w - f - 80. Calculate the greatest common divisor of 27 and w. 27 Let b be -1 + (24/(-2))/(-1). Let m = 127 - 83. What is the greatest common factor of m and b? 11 Let p(r) = 3r2 + 4r - 1. Let a be p(3). Calculate the greatest common divisor of 304 and a. 38 Let j = 81 - 77. What is the highest common factor of 36 and j? 4 Suppose 0 = -5f - 3r + 419, 2f - 11r + 6r = 149. What is the greatest common divisor of f and 205? 41 Let m(o) = -o + 11. Let g be m(9). Suppose h = -z - gh + 8, -4h - 116 = -5z. What is the greatest common divisor of 20 and z? 20 Let z(n) = 35n - 2. Let y(w) = 1. Let b(c) = -3y(c) - z(c). Let o be b(-3). Calculate the greatest common factor of o and 13. 13 Suppose a = -0a - 4. Let r = 38 - a. Let i = 25 - 4. Calculate the greatest common factor of r and i. 21 Let z(c) = c - 4. Let w be z(6). What is the greatest common factor of w and 5? 1 Let w(h) = -h3 - 3h*2 + 7h. Let k be w(-5). Suppose 40 = 9s - 5s. Calculate the highest common factor of s and k. 5 Suppose -2u + 116 = 4m + 2u, -2m - 3u + 53 = 0. What is the highest common factor of 85 and m? 17 Suppose 0f = f - 2. Calculate the greatest common factor of f and 8. 2 Suppose 2k + k = 0. Suppose k = g - 4 - 4. What is the highest common factor of 8 and g? 8 Let n(q) = q - 7q + q*2 - 3 + 6. Let o be n(6). Suppose 3b + 7 = 4b + ou, 0 = -b - u + 9. Calculate the greatest common factor of b and 30. 10 Let l(i) = i*2 + 9i + 15. Let t be l(-7). What is the greatest common divisor of t and 7? 1 Suppose -11s + 15s - 156 = 0. Calculate the highest common divisor of 195 and s. 39 Suppose -3f - 4 = -4a, -5f + 24 = -0a + a. Let g(u) = u*3 - 4u*2 + 4u - 6. Let i be g(a). Calculate the highest common factor of i and 50. 10 Let y = 47 + 7. What is the greatest common divisor of 36 and y? 18 Suppose t + v = 88, 3t + 352 = 7t - 4v. Calculate the greatest common divisor of t and 8. 8 Let y = 15 - -89. Calculate the highest common factor of y and 13. 13 Let y be -1 - ((-15)/1 + 0). Suppose 5z + 1175 = -5b, z = -5b + b - 925. Let h = -160 - b. Calculate the greatest common divisor of y and h. 14 Let k(a) = a*2 - 7a + 9. Let t be k(6). Suppose -5q - 471 = -10q + b, -q + tb = -83. What is the highest common factor of q and 19? 19 Let v = -13 + 27. Let f = 19 + 7. Suppose -s + 3m = -0m - f, 5s = -2m + 181. What is the highest common factor of v and s? 7 Suppose -88 = -m + 2u, -6 + 4 = -u. What is the highest common factor of 23 and m? 23 Let f be 2 + 34/(-6). Suppose 0 = -fy + 3y + r - 43, 5r + 10 = 0. Suppose -265 = -4m - 85. What is the highest common divisor of y and m? 15 Let c(o) = o2 + 6o + 9. Let s be c(-6). Suppose 15 = -3r, -5g + 2 - 22 = 3r. Let j be g/4 + 37/4. What is the highest common factor of s and j? 9 Suppose -44 = -3f + 5r + 33, 101 = 4f - 5r. Suppose 2b - 97 = -25. What is the greatest common divisor of b and f? 12 Let p(w) = 27w3 - 5w + 5. Let x be p(1). Let g(c) = -5c + 2. Let q be g(-5). What is the highest common factor of q and x? 27 Let l(b) = 2b*2 - 9b + 3. Let p(q) = -q*2 - q + 1. Let d(x) = l(x) - 3p(x). Let j be d(4). Calculate the greatest common factor of j and 7. 7 Let s = 68 - 58. What is the highest common factor of 40 and s? 10 Suppose -31u + 30u = -13. Calculate the greatest common factor of 143 and u. 13 Suppose 2l - 3l + 11 = -4p, -25 = -2l + 5p. Suppose h = 2h - l. Let f be 30(3 - (2 - 0)). Calculate the greatest common divisor of f and h. 15 Let m(j) = -j2 + 6j + 3. Let r be m(7). Let y be (-845)/(-20) - (-1)/r. Calculate the highest common factor of 63 and y. 21 Suppose -t - t - 3m - 14 = 0, 5m + 15 = 5t. Let f be (-3 - -6) + (0 - t). Let a be f/5(-15)/(-6). Calculate the highest common divisor of 2 and a. 2 Suppose u = 5u. Suppose -2n + 3 = 4k - 5, -3k - 5*n - 8 = u. Let f be	{ "pile_set_name": "DM Mathematics" }
g - 13 = 0. Suppose -rz + 9 = -m - 9, 6 = z + m. Let s be z/(-6)(-3)/2. Put -3, s, -4 in descending order. s, -3, -4 Suppose q - 2 = 3s - 2s, -4q - 12 = 0. Suppose 0 = -h - 2n + 4, -h + 7n - 10 = 2n. Let j(c) = c3 - c. Let y be j(h). Sort y, s, 4 in decreasing order. 4, y, s Suppose -12s + 135 = -15s. Let l = s - -41. Sort 2/5, 1/2, -2/11, l. l, -2/11, 2/5, 1/2 Let p = 406 - 406.2. Sort -1, 0.2, p, 2. -1, p, 0.2, 2 Let x = -34.4 - -34. Let i = 202 - 1411/7. Sort i, 1/2, x in ascending order. x, i, 1/2 Suppose -106j - 35 = -113j. Sort j, 0, 22, -6 in ascending order. -6, 0, j, 22 Let n be (-658)/(-35) + -11 - 7. Sort -7, 2, n in descending order. 2, n, -7 Suppose -2z + 5y - 71 = 0, -5z = y + 65 + 99. Let x be 2/6 + (-520)/(-15). Let u = x + z. Put 0, u, -4 in descending order. u, 0, -4 Let o = 0 - -5. Suppose 24b - 215 = -191. Put o, -2, -4, b in increasing order. -4, -2, b, o Let d = -479 + 362. Sort d, 4, -1 in decreasing order. 4, -1, d Suppose -13c - 3c = 1824. Let b = 117 + c. Put b, 4, -50, 2 in ascending order. -50, 2, b, 4 Let f = 79 + -85.8. Let q = f - -7. Sort -2, 2/3, q in decreasing order. 2/3, q, -2 Let q be (-8)/(-12)27/(-36)10. Sort 3, q, 32 in descending order. 32, 3, q Suppose 5f = 5y + 25, -y + 10f - 5 = 6f. Sort 1, 12, y, -3 in descending order. 12, 1, -3, y Let x = 12.4 - 12.8. Sort x, -0.5, -4 in decreasing order. x, -0.5, -4 Let o = 794 - 791. Let l(w) = -w2 - 2w - 2. Let h be l(-3). Put h, o, 1, -2 in descending order. o, 1, -2, h Let o(x) = 5x2 + 16x + 9. Let z be o(-6). Let l = -92 + z. Sort 3, -4, l, 0 in increasing order. -4, 0, l, 3 Let v = -165 - -173. Put v, 5, 2/15, 1/4 in ascending order. 2/15, 1/4, 5, v Let m = 864/2639 - 4/203. Sort m, 2/3, 1/7, 0.4. 1/7, m, 0.4, 2/3 Let f be (-220 - -1) + (-15)/(-5). Let g be f/(-20) - 1/(-5). Let d be (-2)/g - 342/(-66). Put d, 2, -2 in decreasing order. d, 2, -2 Suppose 5o + y = 15, 3 = 4o - 2y + y. Let i be 12/112-2866. Let m = -186 - i. Sort o, m, 5 in decreasing order. 5, o, m Suppose -3d - 1 + 4 = 0. Let a be 2 - 2/(1 + d). Let r = -5 + a. Put 3, r, 4 in descending order. 4, 3, r Let h = 162 + -163. Sort -0.2, -1/3, 0.8, h in descending order. 0.8, -0.2, -1/3, h Let a = -364 + 359. Suppose -2t = -2s - 2 - 4, -3t + 9 = 0. Let b = -5 + 3. Put s, a, b in descending order. s, b, a Let a be (-4)/82 - -4. Suppose -o + 5r = -7 + 2, -ao = 2r + 2. Sort o, 1, -13 in increasing order. -13, o, 1 Suppose 6o - 87 = -15. Put o, 4, 5, 1 in increasing order. 1, 4, 5, o Let t = 1489.7 + -1488.7. Suppose 20 = 5q - 0. Sort 2/13, t, q in increasing order. 2/13, t, q Let c(g) = 4g*2 + 150g + 75. Let s be c(-37). Sort 0, 2, 3, s. 0, s, 2, 3 Let s = -353 + 352. Put s, -5, 0 in decreasing order. 0, s, -5 Suppose 5u - 10 = r - 30, 4u + 16 = -3r. Let o(t) = 2t*2 - 29t + 9. Let z be o(14). Sort z, u, 0, 5. z, u, 0, 5 Let x be 2 + 1 - (-6)/2. Let v be (-1)/5 - x/(-10). Let l = 53/2 + -26. Sort -2, v, l. -2, v, l Suppose 0 = 5y + 5a + 60, -5y = -41a + 37a + 24. Suppose -2z = -0z + 4. Sort 0, y, z, -4 in decreasing order. 0, z, -4, y Let h = -9 - -13. Let i = -8707/3 + 2902. Sort h, i, -2, 0 in decreasing order. h, 0, i, -2 Let w(h) be the third derivative of -h4/12 + 9h*3/2 - 38h*2. Let o be w(14). Sort -5, 8, o in increasing order. -5, o, 8 Let j = 4 + -1. Suppose -211 = 43c - 856. Put j, c, 2 in descending order. c, j, 2 Let w = -6.5 + 7. Suppose 14 - 1 = a. Let o = a + -18. Sort w, o, 2/11 in descending order. w, 2/11, o Suppose 5x + 48 + 9 = 3z, 5x - 87 = -3z. Sort 2, z, 4, -3 in increasing order. -3, 2, 4, z Let y = -1115.5 - -1115. Put -0.1, y, 0.3, 4 in decreasing order. 4, 0.3, -0.1, y Suppose 2u + 8 = -4p, -5u - p - 2 = -18. Let y(j) = -5j*2 - 28j - 14. Let l be y(-5). Sort u, l, 0, -4. -4, 0, l, u Let j(a) = a*2 + 15a + 22. Let q be j(-2). Put 13, q, 2, 5 in decreasing order. 13, 5, 2, q Let d = -0.062 - -41.062. Let s = d - 32. Let q = s + -21. Put q, -1/7, 3 in descending order. 3, -1/7, q Let w = 0.6 + -3.6. Let r = 41 + -4. Let i = 41 - r. Sort w, 2/11, i in ascending order. w, 2/11, i Let w(o) = -o*2 - o - 25. Let p be w(0). Let s = -27 - p. Sort 3, s, -1 in descending order. 3, -1, s Let t(u) = -13u - 443. Let c be t(-33). Sort 12, 5, c, -1 in increasing order. c, -1, 5, 12 Suppose 0 = -5t + 12 - 2. Suppose -u + 4z - 11 = 0, 3u - 2z = z - 15. Put u, t, -2 in descending order. t, -2, u Let x = 4 - 2. Suppose xc = 3c - 3r - 12, 0 = 3r + 15. Let n(d) = -2d3 + 3d*2 - 2d + 3. Let y be n(2). Put c, 2, y in increasing order. y, c, 2 Let y = -0.088 - -0.138. Sort 0.4, 2/3, y in ascending order. y, 0.4, 2/3 Suppose 14p - 84 = 7p. Put -22, 5, p in decreasing order. p, 5, -22 Let r = 49.9 - 53. Let x = r + 2.6. Put -1, x, -0.1 in increasing order. -1, x, -0.1 Let v = -0.374 + 0.574. Put -2, -1.7, v in descending order. v, -1.7, -2 Let r(b) = -b*2 + 4b - 5. Let o be r(4). Suppose -29 = -7w - 8. Suppose -5t + 8 = -3v + 3, 3 = 3t + wv. Put -1, t, o in ascending order. o, -1, t Suppose 4j = m + 2j - 18, 2m - 3j = 33. Suppose 4f = 5i - m, 3i = 2f + 4 + 4. Suppose -2g + 7g - 50 = 0. Sort g, 4, f in decreasing order. g, 4, f Let r(d) = d + 20. Let u be r(-17). Suppose -2j - 5 = -2k - u, 2k - 3j - 4 = 0. Put 1, k, -4, 2 in decreasing order. 2, 1, k, -4 Let s = 224 - 228. Sort s, 5, -3 in ascending order. s, -3, 5 Suppose 2y = 5y + 5x - 5, 2x + 29 = 5y. Put 19, y, -3 in decreasing order. 19, y, -3 Let f = -38 - -92. Let s = f + -67. Sort 2, s, -3 in descending order. 2, -3, s Let r(x) = -x - 3. Let i be r(-3). Suppose i = -3q + 2q + 4. Let n = -4 + 3. Put n, 2, q in descending order. q, 2, n Let a = 1375.1 - 1375. Put 3, a, -0.5, 6 in descending order. 6, 3, a, -0.5 Let n = 3091/6 - 515. Sort 0.2, n, 5, -0.1 in descending order. 5, 0.2, n, -0.1 Let g be 40/(2 - ((3 - -1) + -3)). Suppose -g = -0b - 10b. Let x(v) = v*2 - 4v. Let w be x(2). Put w, -1, b in ascending order. w, -1, b Let v(x) = -40x + 1. Let p be v(-1). Let d = -204/5 + p. Let s be (4 + -1)(-12)/9. Put 0.5, d, s in descending order. 0.5, d, s Let h = 37/117 + 2/117. Let c = -4.66 + 7.708. Let o = c - 0.048. Put h, o, -1/9 in ascending order. -1/9, h, o Let h be (-4)/6 - (-1)/(-3). Suppose -3i + 15 = 3p, 2i - 3p + 20 = 6i. Suppose 5t - 12 = -d, t - 8 + 3 = 0. Sort i, d, h. d, h, i Let o = 3 - 3. Suppose 5d = 3s - 3, -7s + 3d + 5 = -2s. Let w be (-2)/315/(-2). Put s, o, w in descending order. w, s, o Let y = -32 - -47. Suppose 8l + y = 11l. Sort 2, -4, l, 3 in descending order. l, 3, 2, -4 Suppose 6o - 2o = t - 19, 4t = -5o - 29. Sort -2, o, -3, 2 in descending order. 2, -2, -3, o Suppose -2o = 2u - u - 3, 5u = o + 26. Let x be 34/7 - 1/(-7). Let g be 1 - -2 - (-1 - (3 - x)). Sort g, o, -2. -2, o, g Let x = -2/191 - -408/2483. Let r = 63 - 62.9. Let l = 2 - 3. Put l, r, x in descending order. x, r, l Let i be (-2)/(-4)(0 - 0). Suppose l = 12 - 13. Put i, 2, 3, l in decreasing order. 3, 2, i, l Let y be (75/(-21))/5 - (-2)/2. Suppose 6f - 11f - 4o = -3, -4f + 3o = -21. Put -1, y, 12, f in descending order. 12, f, y, -1 Let a = 7.7 + -43.7. Let l = a + 35.67. Let v = l + 0.03. Put 3/4, 0.5, v in descending order. 3/4, 0.5, v Let i = -32 + 63/2. Suppose -d - d + 34 = q, 4d - 66 = -q. Suppose -3j = j + 2k + d, 4j + 18 = -k. Put 15, i, j in descending order. 15, i, j Let w = -2.2 - 0.8. Let d = -4.32 + -0.68. Let f(h) = 5h*2. Let y be f(1). Put w, d, y in increasing order. d, w, y Let l be (10/25)/(2/(-20)). Put -3, 1, l in descending order. 1, -3, l Let c = -6.2 - -6.1. Suppose -q - 3q - 144 = 0. Let z be (2/(-5))/(q/(-20)). Sort 0.1, z, c in increasing order. z, c, 0.1 Let i = 2.49 + -0.19. Let f = 1.7 + i. Sort f, -5, 2 in ascending order. -5, 2, f Let l(p) be the first derivative of p*3/3 + 6p*2 + 16p - 1. Let y be l(-12). Suppose y = -2v - 4m, -3v - 21 = 3m + 2m. Sort 3, 1, v in ascending order. v, 1, 3 Let z = -2 + 14. Let g = -9 - z. Put g, -5, 0 in descending order. 0, -5, g Let z(y) = -y3 - 8y**2 + 52. Let h be z(-7). Put 8, 4, h, -11 in increasing order. -11, h, 4, 8 Let b = -0.3 + 0.04. Let k = 311.14 - 311. Let y = k - b. Sort 1, -0.4, y. -0.4, y, 1 Let	{ "pile_set_name": "DM Mathematics" }
rt 2, -0.12, w, -1, -3 in decreasing order. 2, w, -0.12, -1, -3 Let g(m) = m*3 - 18m*2 + 47m - 30. Let i be g(15). Suppose iz = -5z + 2t - 473, -2z = 2t + 192. Sort 5, z, 0, -2 in decreasing order. 5, 0, -2, z Suppose -r + 16 = i, 3r = 2r + 3. Suppose -ih + 14h = 18. Suppose -3f - 3f = h. Sort -12, f, -1. -12, f, -1 Let q(k) = 14k - 4. Let l be q(27). Let b = l + -378. Suppose 4t - 2 + 6 = 0. Sort b, t, 3 in increasing order. b, t, 3 Suppose 23r = 18r - 15. Let z = 5763 + -5759. Put z, 0, r, 1 in descending order. z, 1, 0, r Let v = -62 - -64.9. Let g = v - 3. Suppose -14a - 4u = -4 - 10, u = 0. Sort g, a, 2 in descending order. 2, a, g Suppose -4v = -20, -r + 3v = -4r + 36. Let x be 15/(-6) + r/14. Let i(l) = -4l2 - 75l + 112. Let y be i(-20). Put -5, x, y in decreasing order. y, x, -5 Let f be (-4)/(5 - (-9 + 12)). Let b = -642/5 - -128. Sort f, 5, b in descending order. 5, b, f Suppose -21a + 8a + 3380 = 0. Suppose 38y + a + 766 = 0. Sort y, 2, -4 in ascending order. y, -4, 2 Suppose 257s - 200s - 285 = 0. Suppose -z - 5 = 4z. Suppose 12f - 15f = -51. Sort z, s, 4, f. z, 4, s, f Let n(b) = 13b + 37 - 3b*2 + 13b*2 - 9b2. Let d be n(-8). Let t(v) = v2 + 2v - 4. Let k be t(d). Put -23, -2, k in decreasing order. k, -2, -23 Let x(h) = h3 + 27h*2 - 65h - 1038. Let t be x(-28). Put 4, 10, -50, 1, t in descending order. 10, 4, 1, t, -50 Let w(a) = -a*3 - 2a*2 + 3a - 4. Let b be w(-3). Let z be (-12)/40 + (3/5 - (-210)/300). Sort z, b, 16, 2 in decreasing order. 16, 2, z, b Let t be 1 + 9/(-12)(-64)/(-72). Sort 1, -15, t, -2/11, 3. -15, -2/11, t, 1, 3 Let l be (208/(-728))/(1/6). Put -1, 0.2, -2/21, 3, l in decreasing order. 3, 0.2, -2/21, -1, l Let u = -0.1244 - 0.1756. Put 1/8, -7, -2, u, 2 in descending order. 2, 1/8, u, -2, -7 Suppose 0 = 6p + 4v - 30, 3p - 15 = -v + 2v. Sort -4, p, 10, -157. -157, -4, p, 10 Let w = 3058 + -3055. Suppose 0 = 5s + 535 + 70. Put -1, w, s, 0.2 in decreasing order. w, 0.2, -1, s Let i(c) = 43c + 4302. Let q be i(-100). Let r = -4 - -2. Put r, -1, q in increasing order. r, -1, q Let d be 70/(-14) + 38/58/16. Let t = -18 - 0. Sort -0.5, d, t. t, d, -0.5 Let r be (-4)/(-3) - (-1577)/57. Suppose -r + 33 = 2a. Sort -0.4, a, -10 in ascending order. -10, -0.4, a Let s = -0.869 - 370.131. Let j = 368 + s. Sort -5, 5, 16, j. -5, j, 5, 16 Suppose -80 = 14o - 18o. Let h be o/5 + (-11 + 4 - -2). Let b(g) = -13g. Let n be b(1). Sort h, -5, n in increasing order. n, -5, h Let h = -0.55 - 4.45. Let u = -4 - -4.3. Put u, -3.4, h in ascending order. h, -3.4, u Let k be -7-142/49. Sort k, -5, -22, -1 in ascending order. -22, -5, -1, k Suppose -4d - 19y - 23 = -14y, 5d + 70 = 2y. Let w be (-3)/(-1 + -1 - -1). Put d, w, -2 in decreasing order. w, -2, d Suppose -5p + 6y = 5y - 1204, 3p - 2y - 728 = 0. Suppose p = 30s - 78s. Sort s, -15, 1, 2 in decreasing order. 2, 1, s, -15 Let c(u) = 25u2 + 155u + 5. Let m be c(-6). Let n(j) = j*3 + 26j*2 + 25j - 18. Let i be n(m). Put i, -1, 0 in increasing order. i, -1, 0 Suppose 0 = -7t + 97 - 314. Let f = t - -25. Suppose -5b - 4o = -9, -2b - 6 = -5b - 3o. Put b, f, 2 in decreasing order. 2, b, f Suppose 89p - 3q = 92p, 5p - 4q = 45. Let h = 2 + -6. Put p, 2, -2, h in descending order. p, 2, -2, h Let a = 868 - 854. Let u be a/(-12) + (-115)/(-69) + -2. Sort 0, u, 16, 2/7 in decreasing order. 16, 2/7, 0, u Let r(i) = -17 + 3i - 51 + 35. Let j be r(10). Suppose -4h = -3h - 1. Sort -2, j, h in ascending order. j, -2, h Suppose -4u + 84 = i - 18, -5u = i - 127. Let n = u + -30. Put -1, 2, -13, n in increasing order. -13, n, -1, 2 Let u = -1897 - -17071/9. Let j = -1.8 - -1.8. Put -5, j, u, -0.3 in decreasing order. j, u, -0.3, -5 Let q be (-18)/(-1 + -2) - 51. Let f = q - -41. Put -2, f, -1, 2 in decreasing order. 2, -1, -2, f Let z be 198/(-30) - ((4 - 6) + 6 + -11). Sort -1, z, 2/7, -95, -1/3 in decreasing order. z, 2/7, -1/3, -1, -95 Let c = 0.14618 + 0.05382. Sort 0.131, c, 2. 0.131, c, 2 Let j(w) = -25w + 206. Let g be j(-11). Let s = g + -486. Let v = -6 - -8. Put s, -4, v in descending order. v, -4, s Suppose 15f - 12d = -11d - 78377, 0 = -5f + 4d - 26133. Sort 5, -3, f, 0 in decreasing order. 5, 0, -3, f Let g = 0.0578128 + 0.4421872. Let p = -3 - -5. Sort p, -0.3, g, 7 in increasing order. -0.3, g, p, 7 Let s = -0.53467 + 0.13467. Sort s, -3, 5/3, -20. -20, -3, s, 5/3 Let s = 0.02624 + 0.27376. Put -1/5, s, 1/7, 0.5, 0.9 in decreasing order. 0.9, 0.5, s, 1/7, -1/5 Let h = -0.0408 + 330.0408. Let o = h + -330.5. Let f = -13/3 + 29/6. Put f, -3/8, o in decreasing order. f, -3/8, o Let n(p) = -3p - 2. Let h be n(-2). Let u be h + (-22)/6 - 22/30. Let z be ((-3)/36)/(2/(-6)). Put u, z, -2/3, 0 in increasing order. -2/3, u, 0, z Let f = 63 - 24. Let x = 431 - 397. Let j = f - x. Sort 2, j, -2, -1 in increasing order. -2, -1, 2, j Let i = -137.46 + -10.74. Let m = i - -148. Let t = -1.5 + 1.1. Put m, -0.18, t in decreasing order. -0.18, m, t Suppose -153d + 175 + 196 + 88 = 0. Sort -8, d, 8, -2, 5 in increasing order. -8, -2, d, 5, 8 Let w = 0.5437 + -0.6437. Sort 1/4, w, 0.54, 0 in ascending order. w, 0, 1/4, 0.54 Let j(d) = -d + 5. Let c be j(-8). Suppose c = -5y - 2, 3y + 10 = n. Let v(b) = b*3 - 3b*2 - 27b - 3. Let s be v(7). Sort -5, n, 5, s in decreasing order. 5, s, n, -5 Let i be (-106)/5(1 + 4). Let d be (104 + -105)/((-2)/216). Let n = i + d. Sort n, -14, -1 in decreasing order. n, -1, -14 Let i = 12031/543 + 756/181. Put -3/4, 1.5, i, -1/4 in descending order. i, 1.5, -1/4, -3/4 Suppose 73g = 103g + 111330. Sort -3, g, -1 in ascending order. g, -3, -1 Let a be (-8)/6(-15)/110. Let j = -37.8 + 7.3. Let h = 37.5 + j. Put a, -1/4, -2/9, h in increasing order. -1/4, -2/9, a, h Let s be (11 - 6)/(4/(-2 + -2)). Let o(a) = 5a + 53. Let q(i) = -2i - 18. Let r(p) = -4o(p) - 11q(p). Let m be r(4). Put 5, s, m in descending order. 5, s, m Let i be ((-174)/(-261))/((-2)/(-15)). Put 1, -1, 0, 30, i in decreasing order. 30, i, 1, 0, -1 Suppose -39 = -4c + 5r, -c - 2r + 2 = 15. Sort -4, 3, 5, c, 4. -4, c, 3, 4, 5 Let z be 222/(-483) + 10/35. Let a = 1/138 + z. Let n = -4 - -3.5. Sort a, 2, n. n, a, 2 Let v = 45 + -41. Let q(d) = d2 - 105d + 1262. Let l be q(14). Sort -0.6, l, v in decreasing order. v, -0.6, l Let k = 0 + 0. Suppose 699w = 694w + 80. Suppose -2y - 19 = -5r, 46y = 44y + 4r - w. Sort k, 5, -1, y in descending order. 5, k, -1, y Let o(n) = 8n*2 + 2336n - 21673. Let g be o(9). Let k = -3/7 + -13/35. Let z = -0.1 + 0.12. Sort g, k, z in increasing order. g, k, z Let d = 0.01 - 0.01. Let s = -1265 - -1274. Put d, -4, s in descending order. s, d, -4 Let q = -2 + 5. Suppose 2w - w + q = 0. Let p(i) = -8i + 70. Let l be p(8). Sort 2, l, w in descending order. l, 2, w Let y(w) = -w*3 + 10w*2 - 10w + 1. Let n be y(9). Let o = -78 + 86. Let u(i) = -i*2 + 6i + 15. Let b be u(o). Put n, b, 1 in decreasing order. 1, b, n Let r = 3204.3 + -3204. Put 0.23, 6/7, 5/3, r in decreasing order. 5/3, 6/7, r, 0.23 Let a(d) = -d*3 - 6d*2 + 15d - 1. Let v(t) = t*3 + 7t*2 - 14t. Let h(k) = -3a(k) - 4v(k). Let q be h(-11). Put -1, q, -2 in descending order. q, -1, -2 Let p be (152 - 140) + 0/2. Sort 6, 9, p in descending order. p, 9, 6 Let m = 2443 + -2439. Put m, 1, 0.9, -5, -1/2 in descending order. m, 1, 0.9, -1/2, -5 Let c = 2/75 + -52/75. Let g = -2/12457 + 24920/37371. Put -1/6, c, g in ascending order. c, -1/6, g Let x(h) = -3h - 17. Let m be x(-7). Suppose 0k = 2k + m. Suppose -4f - 25 = 5d, -15 = -11f + 14f. Put k, d, 1, 2 in ascending order. k, d, 1, 2 Let n = -0.2375 - 1.0625. Put n, -6, -0.3 in ascending order. -6, n, -0.3 Let d(c) = 2c*2. Let x be d(-1). Let v(w) = -25 - 8 + 2wx - w2 - 13w. Let l be v(15). Put -2/5, 0.4, 2, l in descending order. 2, 0.4, -2/5, l Let w be -5(-1)/(-4)-4. Let r = -454742.7 - -454743. Let s be 2/(0/(-1) - 4). Put r, s, w, 2 in increasing order. s, r, 2, w Let s = 458 + -457.492. Let a = s - 0.848. Sort 3/7, a, -4, -0.1 in ascending order. -4, a, -0.1, 3/7 Let a be -4 + (2 + -1 - 1). Let v(o) = 29o + 105. Let z be v(-4). Sort 3, a, z in decreasing order. 3, a, z Let u(t) = t*3 - 3t**2 + t	{ "pile_set_name": "DM Mathematics" }
*2y*2 + 1780x*2y + 2xy*2 + 25xy - 2y*2 - 38y wrt x? 16y2 + 3560y What is the second derivative of -431d2n + 2d2 - 13531dn + 2d wrt d? -862n + 4 What is the third derivative of -4327320j*3 - 49j*2 + 57930j? -25963920 What is the first derivative of 1651785n + 1135432? 1651785 Find the second derivative of -4cp3 - 42211cp2 + cp - 2c - 2p*3 - 22p - 1213 wrt p. -24cp - 84422c - 12p Find the first derivative of 25f3m*2 - 1210f*3m - 6f3 - 12f*2 + 1523f + 1 wrt m. 50f3m - 1210f3 What is the third derivative of -51g*3m*3 - 3982g*3m*2 + 5g*2m*3 - 27g*2m2 - g2m + 8gm3 + 16g wrt g? -306m3 - 23892m*2 What is the second derivative of 73406x*2 - 55921x? 146812 What is the derivative of 19iky3 + 1079iky + 2iy*3 - 4iy + 847i - 2y3 wrt k? 19iy3 + 1079iy What is the first derivative of -7337v*3 + 3v + 2915? -22011v2 + 3 Find the second derivative of -14713t*3 + 2t - 7431. -88278t Find the third derivative of 2160z*5 + 378z*3 + 2893062z*2 wrt z. 129600z*2 + 2268 Find the second derivative of -32456h*2t - h*2 - 331h + 168t - 2 wrt h. -64912t - 2 What is the third derivative of -3750421x4 - 3698204x*2 wrt x? -90010104x What is the second derivative of -z*5 - 1669z*2 - 4165z - 7? -20z3 - 3338 What is the second derivative of -n5u - 43451n4u*3 + 71nu + 265u*3 wrt n? -20n*3u - 521412n2u*3 Find the third derivative of 7302f*3n3 - f3n2 - 19f3 - f2n5 + f2n - 4fn*2 wrt n. 43812f*3 - 60f*2n*2 Find the third derivative of 26d*6 - 2d*5w - 21d3w + d*2 - 10d - 21w + 7 wrt d. 3120d*3 - 120d*2w - 126w Find the second derivative of -2522015a*2g - 30ag + a - 91g - 22 wrt a. -5044030g Find the second derivative of -95s2u*2 - 2124859s*2u + 2864su2 - u2 wrt u. -190s2 + 5728s - 2 Find the third derivative of -68601c6 + 5c*2 + 246c - 2. -8232120c3 Find the third derivative of 1644n4 + n3 + n*2 - 186990n - 1. 39456n + 6 Find the third derivative of 92c*3o*3p + 6c3op + 14c*2o*3p - 31c2p - 6co*2p - c + 3o3p + o wrt o. 552c3p + 84c2p + 18p Find the third derivative of -12637x5 + x4 + 2x3 + 3x*2 - 39x - 121. -758220x2 + 24x + 12 What is the first derivative of -183520kr*2 + 315186r*2 wrt k? -183520r*2 Find the third derivative of 55638a*3r3 + a3r2 - 79a3 + a2r5 - 15a wrt r. 333828a3 + 60a*2r*2 What is the second derivative of -2519654c*2 - c - 257706? -5039308 Find the second derivative of 33dx3 + 196dx2 - 2dx - 2179d - 2x wrt x. 198dx + 392d Find the second derivative of -25b2g*2p - 16b2gp + bg*2p + 22766bp wrt b. -50g2p - 32gp Find the second derivative of -4h4s*2 - 3140h*3s*2 - 4hs2 + 4h + 234s wrt h. -48h*2s*2 - 18840hs2 Find the second derivative of -9b*5 - 788b*4 - 2b*3 + 63b - 89 wrt b. -180b3 - 9456b*2 - 12b Differentiate -64558g4 + 5g*3 - 671175 with respect to g. -258232g*3 + 15g*2 What is the first derivative of 11gl2 - 1402gl + 7g - 151074l2 wrt g? 11l*2 - 1402l + 7 What is the derivative of 58564z - 109332 wrt z? 58564 What is the second derivative of -b2h*3p + 28341b2p + 14bh*2 - 9bp - h3p - 7h2p - 4h wrt b? -2h*3p + 56682p Differentiate -75n*3 - 259n*2 - 54609 wrt n. -225n*2 - 518n What is the first derivative of 147585w3 + 68001? 442755w*2 What is the second derivative of 7d*2h*2o - 22d2ho - 739dh2o + 4dho - 4ho - 12h wrt h? 14d2o - 1478do What is the second derivative of -736646z2 + 5z - 133615? -1473292 What is the first derivative of 10429v3 + 22v + 371420 wrt v? 31287v2 + 22 What is the third derivative of 6331351t*5 - 79t*2 + 12158t wrt t? 379881060t2 Find the first derivative of c2im + 2c*2m + 2162c2 - 13563im + 21i wrt m. c*2i + 2c2 - 13563i Find the second derivative of -205469f3l*2 + 28f*3l + 481f3 + 27f*2l - 7l2 wrt l. -410938f*3 - 14 Differentiate 2626076nt3 - 228t*3 + 953 with respect to n. 2626076t*3 What is the second derivative of 11543w*3 + 773w? 69258w What is the first derivative of 29i*4 - 468i*3 - 64217 wrt i? 116i*3 - 1404i*2 What is the third derivative of iz*5 + 32iz3 - 2iz2 + 6i + 5z5 + 85z*2 + 2z wrt z? 60iz*2 + 192i + 300z2 What is the first derivative of 17b*4 - 52b*3 + 14b*2 + 3b - 2706617? 68b3 - 156b*2 + 28b + 3 Find the third derivative of 5n2x*3 + 35n*2x + n*2 + 222npx*3 - 5px3 + 8px2 - 13 wrt x. 30n*2 + 1332np - 30p What is the second derivative of -2s5 - 436524s*3t*3 - 2st3 + 20st - 8137t*3 wrt s? -40s*3 - 2619144st3 What is the second derivative of -13cq2 + 3cq - 10366c + 50250q2 + q + 5 wrt q? -26c + 100500 Find the third derivative of 2al*2u*3 - 12al2u - alu*3 - 11472au3 + au + 53a - 5u*2 wrt u. 12al2 - 6al - 68832a Find the first derivative of -114l2 + 565l + 623917. -228l + 565 What is the second derivative of 21011q*2 - 17172q + 1 wrt q? 42022 Find the third derivative of 2a6x + 603a6 - 2a*3x + 371a2x - 50a2 wrt a. 240a*3x + 72360a3 - 12x What is the second derivative of 77lt*2x*2 - 2lt2x + 6ltx2 - 3ltx - 64t2 - 5t - 2x2 + 6 wrt t? 154lx2 - 4lx - 128 What is the third derivative of 87687a*3 + 8a*2 + 29a + 39 wrt a? 526122 What is the derivative of -14a4 - 3a*2z + a*2 + 972az + 10450z + 7 wrt a? -56a3 - 6az + 2a + 972z Find the first derivative of 116084r*2 + 18r + 5381697 wrt r. 232168r + 18 Find the third derivative of 17868m*4 + 16087m*2. 428832m What is the third derivative of 188h3kp3 - 8h*3kt2 + 20h*3p*2t + 2h3p*2 - 33h*2kt - 13hkp*3t*2 wrt p? 1128h*3k - 78hkt2 Find the second derivative of 31577n*2s2 - n2u + 22ns2u - 2ns + 32nu - s*2u - 4 wrt n. 63154s2 - 2u What is the first derivative of -w*4 - 4461w*3 - 4w - 59706 wrt w? -4w3 - 13383w*2 - 4 Find the second derivative of -555822d*4t - 4557099dt wrt d. -6669864d2t Find the second derivative of -4ns*2x*2 - 2ns2x - 4nsx2 - 3nx2 + 2nx + 38n + 69s3x - 4s wrt s. -8nx2 - 4nx + 414sx What is the first derivative of 3521887z - 615071 wrt z? 3521887 Find the second derivative of 78876r2s + rs - 388571r wrt r. 157752s Find the third derivative of -112t*2v*3 + 131t*2 - 17tv2 - 2tv + 2423v*3 - 8v wrt v. -672t2 + 14538 What is the derivative of 78709dy + 59567d wrt y? 78709d What is the third derivative of 12g*2l3 + g2lw*2 + 5gl + gw*2 + 2596l*3w*2 + 1093l*2w wrt l? 72g2 + 15576w*2 What is the second derivative of 68n*3 + 34n*2o + 38no + 2n - 230o wrt n? 408n + 68o What is the second derivative of 59928s2 - 70s + 84? 119856 What is the first derivative of 2283dor + 3do + 514dr + 1833d + 4or + 2o wrt o? 2283dr + 3d + 4r + 2 Differentiate 48c*2hj + 5c*2j - 2c2 + 212cj - 598hj with respect to h. 48c*2j - 598j Find the third derivative of -45k*4 + 1243k*3 - 81749k*2. -1080k + 7458 Differentiate -1164289o - 2149768 wrt o. -1164289 Find the third derivative of 6q*2v*3 + 3894q*2 - qv*3 + 111383v*3 + 227v*2 wrt v. 36q*2 - 6q + 668298 Find the second derivative of 28330t3 - 11597t + 2. 169980t Find the third derivative of -205v*3x - 25v3 + 21v*2x - 57v2 + 5vx wrt v. -1230x - 150 Find the third derivative of 240l6 - 69l*4 - 2l*2 + 1611l. 28800l3 - 1656l What is the derivative of 2hi*3j - 26hi*3 - 2hi2m - 2hijm - 79395ijm + 182m wrt j? 2hi*3 - 2him - 79395im What is the second derivative of 104396tv*2 - 180tv - 15296t - 7v2 wrt v? 208792t - 14 What is the third derivative of -343891q3 + 4336q*2 - 19q wrt q? -2063346 Find the second derivative of 116g3 - 106g*2 - 32690g. 696*	{ "pile_set_name": "DM Mathematics" }
t is -20d - 261? -470 In base 5, what is 302320 + -3? 302312 In base 6, what is 124241 - 3? 124234 In base 7, what is -22031650 - -2? -22031645 In base 11, what is -4 + -276792? -276796 In base 9, what is -713270 - -1? -713268 In base 13, what is 12584 + -3? 12581 In base 7, what is 614310 + -15? 614262 In base 3, what is -100010120211220 - 12? -100010120212002 In base 12, what is 209 + -9aa? -7a1 In base 12, what is -500 - 17? -517 In base 14, what is 35895 + 3? 35898 In base 3, what is 11 + -1222100? -1222012 In base 8, what is 3 - 305761? -305756 In base 3, what is -10222020010 - -1? -10222020002 In base 8, what is 5 - -24004? 24011 In base 12, what is 73 - 503? -450 In base 7, what is 200 + 4261? 4461 In base 8, what is 5566173 + 6? 5566201 In base 3, what is 222220120 + -110? 222220010 In base 3, what is -11111 + -20120? -102001 In base 6, what is -43552 - 503? -44455 In base 5, what is -4 + 103100443? 103100434 In base 10, what is 54 + 133? 187 In base 10, what is -2017 + 19? -1998 In base 7, what is 30511 - -431? 31242 In base 11, what is 102 - -19? 120 In base 12, what is 5518 + 7b? 5597 In base 14, what is -288 + 11? -277 In base 12, what is 8a5a + 0? 8a5a In base 11, what is 3 - 7012? -700a In base 7, what is 34250 + 0? 34250 In base 13, what is -44cc25 + 3? -44cc22 In base 13, what is 21ac - -12? 21c1 In base 11, what is -93 - 270? -353 In base 3, what is -102220111120120 + -12? -102220111120202 In base 16, what is 2e5 - 84? 261 In base 2, what is 110001 - 10111111? -10001110 In base 16, what is 296 - 8e? 208 In base 10, what is -47 + 1044? 997 In base 4, what is -2122130 - 2113? -2130303 In base 16, what is -1264 - 3? -1267 In base 12, what is -424 - -66? -37a In base 12, what is -1338 - -50b? -a29 In base 10, what is 5 - -13482? 13487 In base 12, what is -3b751 - -5? -3b748 In base 15, what is -d + -5346? -5354 In base 15, what is e - 6b? -5c In base 16, what is 3747 - 2? 3745 In base 10, what is -24 - -23643? 23619 In base 4, what is -232123 + 1303? -230220 In base 13, what is -2c2450 - 1? -2c2451 In base 4, what is 220 - 33223? -33003 In base 15, what is -9135 - -c? -9128 In base 10, what is 10705 + 0? 10705 In base 13, what is -149 + 856? 70a In base 8, what is -7 + -15601? -15610 In base 11, what is 22 - -113457? 113479 In base 6, what is -110432 - -4? -110424 In base 3, what is -1202010200 - 10? -1202010210 In base 16, what is 140 + 3c9? 509 In base 3, what is 12 - 2121201112? -2121201100 In base 15, what is 3475 + 0? 3475 In base 4, what is 103232 + -111220? -1322 In base 15, what is -1 + -d70? -d71 In base 6, what is -1 - 23544114? -23544115 In base 5, what is 211 - -121132? 121343 In base 8, what is -13253 - -24? -13227 In base 10, what is -12713 + 8? -12705 In base 2, what is -100000110000011 - -10010? -100000101110001 In base 3, what is -2110102021 + -2? -2110102100 In base 5, what is 32314 - 112? 32202 In base 6, what is 22 + -2323240? -2323214 In base 15, what is 1c16 - 9? 1c0c In base 4, what is 31001301 - 120? 31001121 In base 16, what is 10 - -3c03? 3c13 In base 5, what is -324004 + 10? -323444 In base 13, what is c + -54a81? -54a72 In base 16, what is -b + 9d7? 9cc In base 14, what is 1c4b1 + 2? 1c4b3 In base 6, what is 5 + 531451? 531500 In base 5, what is -233 + 32424? 32141 In base 16, what is 3757 + 5? 375c In base 3, what is 1202100 + 1211? 1211011 In base 15, what is 2a - d8a? -d60 In base 12, what is -991a + 131? -97a9 In base 6, what is 13234 + -20? 13214 In base 15, what is -7c10 - 6? -7c16 In base 11, what is -4 + -6445? -6449 In base 4, what is -121301323 + -11? -121302000 In base 13, what is 1 + 5336? 5337 In base 6, what is 145 - -141534? 142123 In base 8, what is -2173 + -33? -2226 In base 3, what is 112220210 - -110? 112221020 In base 14, what is -2b + -19b89? -19bb6 In base 4, what is -2000 - 1233? -3233 In base 11, what is 2415 - -7? 2421 In base 16, what is -9c - -2d? -6f In base 14, what is -10b + -ac? -1b9 In base 2, what is 100010011011001111 + 10? 100010011011010001 In base 7, what is 25621 - -143? 26064 In base 9, what is -21484 + -10? -21504 In base 2, what is -1 - 1011001010011? -1011001010100 In base 6, what is -20 - -121133? 121113 In base 4, what is 110 - -2103000? 2103110 In base 16, what is -77 + -13ec? -1463 In base 6, what is -3543 - 5? -3552 In base 13, what is -3 + 31ca? 31c7 In base 5, what is -10144431 - -30? -10144401 In base 16, what is 227 + b4? 2db In base 13, what is 2 + -55547? -55545 In base 16, what is ed1 + -11? ec0 In base 13, what is 22 + -156b? -1549 In base 11, what is -101 - 3578? -3679 In base 9, what is 534 + -3? 531 In base 6, what is -1 - -54021? 54020 In base 3, what is -1 - 2200202212? -2200202220 In base 3, what is -10202012 - -1100112? -2101200 In base 13, what is 493 + -21? 472 In base 3, what is 111201000121 - -1? 111201000122 In base 16, what is 986 + 1c9? b4f In base 8, what is -4223 - 5? -4230 In base 14, what is -300 - -1b75? 1875 In base 9, what is 4456 + -28? 4427 In base 14, what is 4d7b + -5? 4d76 In base 5, what is 202 + -104224? -104022 In base 7, what is -25426416 - -5? -25426411 In base 7, what is -4 + -3402411? -3402415 In base 4, what is -2 - -13013012132? 13013012130 In base 15, what is 85 - -771? 806 In base 3, what is 10 - -122110121220? 122110122000 In base 16, what is -15b + 11d? -3e In base 8, what is -206521 + -134? -206655 In base 13, what is 188 - 19a4? -1819 In base 3, what is -1021001212 - 12? -1021002001 In base 8, what is 3 + 34757? 34762 In base 7, what is 0 + -1256334? -1256334 In base 10, what is 9 - 7670? -7661 In base 2, what is -100011101011110 + -100100? -100011110000010 In base 13, what is -5 + 25bc3? 25bbb In base 16, what is -25464 - -1? -25463 In base 11, what is -7 + -5250? -5257 In base 12, what is -127 + -7? -132 In base 13, what is 23 + 4067? 408a In base 14, what is -9b77 + -2a? -9ba3 In base 3, what is -12 - 101220111? -101220200 In base 10, what is 2460766 + -5? 2460761 In base 9, what is 1713 - 173? 1530 In base 13, what is -58235 + 5? -58230 In base 11, what is -7a - 941? -a10 In base 8, what is 11047 + -40? 11007 In base 10, what is 2 - -33846? 33848 In base 14, what is -6a73b - 1? -6a73c In base 7, what is 13 + -13230? -13214 In base 7, what is 5262 - -533? 6125 In base 15, what is -1b3b + 19? -1b22 In base 11, what is 312 + -1013? -801 In base 15, what is -dc - 934? -a21 In base 4, what is 1010 + 110321? 111331 In base 3, what is 0 - 211101222? -211101222 In base 9, what is 12 - 21062? -21050 In base 12, what is -5 + -5811? -5816 In base 10, what is -87 - 446? -533 In base 3, what is 100020 + -20211? 2102 In base 15, what is 44ab0 + 3? 44ab3 In base 7, what is 40154 - 25? 40126 In base 12, what is 13 - -27670? 27683 In base 13, what is -8 + -a2c6? -a301 In base 6, what is 0 + 12135223? 12135223 In base 15, what is -2965b - -2? -29659 In base 8, what is 0 + -4366? -4366 In base 10, what is 226275 - -7? 226282 In base 16, what is ab44 - 24? ab20 In base 4, what is -1203201130 + 2? -1203201122 In base 14, what is 44a - -2? 44c In base 14, what is 1d + -574? -555 In base 16, what is -22fff3 - 2? -22fff5 In base 5, what is 1313 - 13304? -11441 In base 16, what is 80fb6 - 2? 80fb4 In base 12, what is 14a - 108? 42 In base 5, what is -11414102 + -2? -11414104 In base 10, what is 2284 + 218? 2502 In base 4, what is -12121 - -132? -11323 In base 4, what is 21 - 21123101? -21123020 In base 14, what is -3a14c - c? -3a15a In base 6, what is 1 - -12401551? 12401552 In base 2, what is -100 - 1000000000000010110? -1000000000000011010 In base 3, what is 110211 + -2111? 101100 In base 8, what is 256623 - 5? 256616 In base 15, what is 1 - -45cd? 45ce In base 10, what is -87 - -274? 187 In base 4, what is 10 - -200101333? 200102003 In base 14, what is 2 + -42a9? -42a7 In base 9, what is -124 - -16? -107 In base 12, what is -188 + -150a? -1696 In base 3, what is 220101200 - -1022? 220102222 In base 5, what is -40432013 - 2? -40432020 In base 2, what is 10100010101 - 111111110? 1100010111 In base 3, what is -10202110 + 111? -10201222 In base 2, what is 10001110000 + -11? 10001101101 In base 2, what is -1 + -101011110101000100? -101011110101000101 In base 11, what is -16a8 + 1a? -1689 In base 12, what is -a0 - -4a? -52 In b	{ "pile_set_name": "DM Mathematics" }
. Calculate the highest common factor of f and y. 10 Let i(v) = -40v + 6. Let m be i(4). Let s be m/(-10) + 2/(-5). What is the highest common factor of 10 and s? 5 Suppose 5u = 15u - 200. Let j = 16 + -6. Calculate the highest common factor of u and j. 10 Let j be (1 + -2)/(5/(-95)). What is the greatest common divisor of j and 133? 19 Let m(j) = j2 + j + 3. Let v be m(-6). Let o = 42 + v. Let y = 21 - 6. Calculate the highest common factor of o and y. 15 Let t = -68 + 34. Let s = t + 48. What is the highest common divisor of 98 and s? 14 Suppose 0 = -0o + 2o + 4w, -2w = -4o + 20. What is the highest common divisor of o and 32? 4 Suppose -3z + 7 = l - 68, 150 = 2l - 5z. Suppose -b - 4b = -l. Calculate the highest common factor of 135 and b. 15 Suppose 57 = 4g - t - 20, t + 37 = 2g. Calculate the highest common divisor of g and 60. 20 Suppose 1 + 2 = -i. Let h be (i/(-2))/(6/16). Let j(q) = 3q + 5. Let m be j(9). Calculate the highest common divisor of m and h. 4 Suppose -5o + 67 = -3q, 2q + q = -3o - 27. Let y = -8 - q. Suppose 0d = -d + y. Calculate the highest common divisor of 6 and d. 6 Let a = -30 + 47. Suppose 4h - a = 83. What is the highest common factor of 25 and h? 25 Suppose 10l = 5l + 105. What is the greatest common factor of 7 and l? 7 Suppose 5v - 137 = 53. Suppose -4a - v = -5q, -5q = 5a - 0a - 20. Calculate the greatest common factor of 3 and q. 3 Suppose 51 = 5h + 6. Let v(s) = -s*2 - 17s - 9. Let w be v(-9). What is the greatest common divisor of w and h? 9 Let l = 24 - 19. Let g be (-4)/6 - 122/(-3). Calculate the greatest common factor of l and g. 5 Let n(x) = 9x + 122. Let f be n(-11). Let i(s) = -43s - 5. Let q be i(-6). What is the highest common divisor of q and f? 23 Suppose -3u = -77 - 130. Suppose 0 = 5y + 4 - u. Calculate the highest common divisor of 39 and y. 13 Let a(k) = 4k + 25. Let m(n) = -3n - 24. Let p(x) = -2a(x) - 3m(x). Let d be p(0). Let b = 15 + -4. What is the highest common divisor of b and d? 11 Let k be -5 + 4 + 111. Let n be (-225)/k(-8)/6. What is the highest common factor of n and 20? 10 Let f(q) = -22q - 57. Let w be f(-9). Calculate the highest common factor of 47 and w. 47 Suppose 407 = 4h + 4z + 7, 4z + 200 = 2h. Let x be (h/(-35))/((-2)/7). Suppose -5c + 46 + 4 = 0. Calculate the highest common divisor of c and x. 10 Suppose -18 = 3c - 6c. Suppose s + 150 = cs. Suppose r - l - 7 = 12, -2r - 2l = -22. Calculate the greatest common factor of s and r. 15 Suppose 0 = -4x - 2g + 56, 29 = 5x + g - 44. Calculate the greatest common divisor of x and 15. 15 Suppose 4w = 3w + 3. Suppose 24 = wt - 33. What is the greatest common factor of 171 and t? 19 Let a = 48 - -2. Suppose 0n = 2n - a. What is the greatest common factor of 25 and n? 25 Let r(b) = -b3 - 8b*2 + 4b - 31. Let n be r(-9). Calculate the highest common factor of n and 14. 14 Let c(o) be the second derivative of o3/2 - o2/2 - 5o. Let l be c(11). Calculate the greatest common factor of 8 and l. 8 Let l(j) = j2 + 2j + 1. Let i be l(7). Suppose 0 = -7s - 13 + 69. What is the greatest common divisor of s and i? 8 Let i be (-2)/(-8) - 2629/(-44). Calculate the highest common divisor of i and 24. 12 Suppose 2r - 14 = 4. Let d = -57 - -60. What is the greatest common divisor of r and d? 3 Let f = -8 - -25. Calculate the greatest common divisor of 85 and f. 17 Suppose 3j - 9 = -0j. Suppose jw - 135 = -2w. Calculate the greatest common factor of 9 and w. 9 Suppose 2x + 0 = 4. Suppose 3d + x = 5. Let n(z) = 144z - 1. Let p be n(d). Calculate the greatest common divisor of 13 and p. 13 Suppose 17h = 19h - 62. Calculate the highest common divisor of h and 31. 31 Let r(w) = -2 + 10w + 12 + 2. Let c be r(12). What is the greatest common factor of 12 and c? 12 Suppose 0 = -8x + 15x - 546. Calculate the greatest common factor of x and 6. 6 Let o = -8 + 15. Let c(g) = -g*2 + 5g - 1. Let a(p) = 5p - 2. Let f(w) = 4a(w) - 3c(w). Let y be f(4). Calculate the highest common divisor of y and o. 7 Let l(u) be the first derivative of u2/2 - 4u - 1. Let w be l(5). Let k be 8((-3)/(-1) + -2). What is the greatest common factor of k and w? 1 Let a = -1648 - -2526. Suppose -5l + 2s + a = 4s, 5s + 709 = 4l. Let g be -3-216/6. Calculate the highest common factor of l and g. 16 Let g(b) = b*3 - 5b*2 - 6b - 1. Let k be g(8). Let i(w) = w*2 - 5w - 7. Let a be i(8). Let j = a - 4. Calculate the highest common divisor of j and k. 13 Let v(o) = 106o2 - 1. Let h be v(1). Calculate the highest common factor of h and 15. 15 Let h(a) = a2 - 10a + 34. Let p be h(14). Calculate the greatest common factor of 36 and p. 18 Let s = -54 + 84. What is the greatest common factor of s and 30? 30 Suppose 0 = y - 21 - 14. What is the highest common divisor of 5 and y? 5 Let o(t) = -12t3 - t2 - t. Let h be o(-1). Let n(u) = 3u - 17. Let f be n(h). What is the highest common divisor of 209 and f? 19 Suppose -3y + 10 = 2y. Let b(a) = -a*2 + 4a - 4. Let m be b(3). Let h be (8 + m)(y - 0). What is the highest common divisor of 126 and h? 14 Suppose 5v - 36 - 19 = 0. Calculate the greatest common divisor of 77 and v. 11 Suppose 3v + 20 = 8v. Let x(u) = u*2 - 5u + 6. Let b be x(v). Calculate the greatest common divisor of b and 10. 2 Let a be (-1 - -2)6/(-6). Let l be -6a(-6)/(-4). Let g = -2 + l. Calculate the greatest common divisor of g and 35. 7 Let r = -46 - -78. Let a be (-1)/(-5) + 1197/15. What is the greatest common divisor of a and r? 16 Let w(q) = 3q*3 + 17q*2 + 6q + 5. Let k be w(-5). What is the greatest common factor of 225 and k? 25 Let v = 35 - 19. Let u(x) = -16x + 3. Let s(o) = 32o - 7. Let q(m) = 3s(m) + 7u(m). Let k be q(-4). Calculate the greatest common factor of v and k. 16 Suppose -3j - 41 = 2j + c, 0 = 3j - 3c + 21. Let z = 12 + j. Calculate the greatest common divisor of 10 and z. 2 Let d(u) be the first derivative of -7/3u3 + 3 - 1/2u*2 + 4u - 1/4u4. Let x be d(-7). Calculate the highest common divisor of 11 and x. 11 Let b = 80 - 50. What is the highest common factor of 120 and b? 30 Suppose -5c + 92 = -183. Calculate the highest common factor of c and 11. 11 Let o be (-1 - -2) + 30/2. What is the greatest common divisor of o and 64? 16 Suppose 3m = m + 8. Let z be (-8 - -1)/(m/(-24)). Let h be (-1 - -2)2 - -26. Calculate the highest common divisor of h and z. 14 Let j = -43 - -105. What is the greatest common factor of j and 155? 31 Suppose 0 = d - 191 + 44. Calculate the highest common factor of 42 and d. 21 Let r = 90 + -2. Let i(x) = -15x2 - 1. Let a be i(-1). Let h = a + 27. What is the greatest common divisor of r and h? 11 Suppose 0 = -3a - 3, -4w + 7w = 2a + 68. Suppose 6o - 76 = -w. Let v be 2/(-6) + (-434)/(-6). Calculate the greatest common divisor of v and o. 9 Let j = 117 + -101. Calculate the highest common divisor of j and 4. 4 Let l = 5 - 2. Suppose -2j + 6 = -5j. Let x be (2/4)/(j/(-24)). Calculate the greatest common factor of l and x. 3 Let u = 25 + -19. What is the greatest common divisor of u and 30? 6 Let d(z) = -z - 5. Let g be (4/3)/((-4)/18). Let c be d(g). Calculate the highest common factor of 2 and c. 1 Suppose -4g + 218 = p + 2p, -g + 282 = 4p. Calculate the greatest common divisor of 14 and p. 14 Let a(s) = s3 - 7s*2 - 9s + 10. Let i be a(8). Suppose 46 - 256 = -it. What is the highest common divisor of 15 and t? 15 Let d = 216 + -118. Calculate the highest common factor of d and 147. 49 Suppose 15j = 14j. Suppose -2y = -3m - 5, -2y = m - jm - 9. Let c = 1 - -1. Calculate the highest common factor of c and y. 2 Let t(y) = -y3 - 3y*2 - y - 2. Let o be t(-6). Calculate the greatest common factor of o and 14. 14 Suppose -3a - 2a = -990. Calculate the greatest common factor of a and 18. 18 Suppose 42 + 10 = t. Calculate the greatest common factor of 8 and t. 4 Let w = 209 + -191. What is the highest common factor of w and 342? 18 Suppose -5g + 125 = l + 17, -96 = -4g - 4l. Suppose 5c + 51 - 471 = 0. Calculate the greatest common factor of c and g. 21 Let k = 100 + -52. Let z(q) = -4q. Let l be z(-3). Calculate the highest common divisor of k a	{ "pile_set_name": "DM Mathematics" }
u + 4g - 46. Let v(t) be the third derivative of -t6/120 - 7t5/60 - t4/3 - 2t3/3 - t2. Calculate v(u). 8 Let l(w) = w3 + 8w2 + 4. Let q be l(-8). Let h(j) = j - 2. Determine h(q). 2 Let s(x) be the third derivative of -x8/6720 + x7/630 + x6/180 - x5/24 + x4/6 - 2x2. Let b(l) be the second derivative of s(l). Determine b(5). -10 Let b(p) = 7p - 9. Let c(a) = -8a + 10. Let q(s) = 4b(s) + 3c(s). Give q(5). 14 Let i(v) be the third derivative of v6/120 - v5/20 - v4/12 + v3/6 + 59v*2. Give i(4). 9 Let q(u) = 4u*2 + 2u + 1. Let m(k) = -9k2 - 4k - 2. Let s(b) = 3m(b) + 7q(b). Give s(-1). 0 Let q(v) = -v*2 - 5v. Suppose 10 = -5u + 3u + 5n, 3u + 3n + 15 = 0. Calculate q(u). 0 Suppose -3k = -2f - 17, 3k - 2 = -3f - 5. Let l(n) = -16 + n + 5n + 2n - 7n + 13n2. Let p(q) = -3q*2 + 4. Let g(h) = -2l(h) - 9p(h). Give g(k). -1 Let d = 21 + -9. Let k = d - 20. Let l(s) = s + 8. Let n be l(k). Let w(u) = u3 - u2 - u + 9. Give w(n). 9 Let s(n) = -n2 + 13n + 11. Let a be s(14). Let o(f) = 3f2 - 2f*2 - 3 + f + 0f2. Calculate o(a). 3 Let o(f) = -1 - 1 - f2 + f3 + f2 + 3f2. Let j(n) = n - 14. Let k be j(11). Determine o(k). -2 Let t(x) = -2x*2 - 3. Let p(b) = 3b*2 + 7. Let f(a) = -3p(a) - 7t(a). Calculate f(1). 5 Let x(l) = -l3 + 4l*2 - 2. Suppose g + 12 = 5b, -3g + b + 3 = -b. Calculate x(g). 7 Suppose -3k = -0k - 12. Let c be k/((-2)/(-3)3). Let u(x) be the third derivative of -x5/60 - x4/24 - x3/3 - x2. Determine u(c). -8 Let g(y) = -y + 4. Let s(f) = -9f + 33. Let v(n) = -51g(n) + 6s(n). Let t be (-1 - 0)2 - -6. Suppose t = -o - 1. What is v(o)? 9 Suppose 2m - 2 = 3m, -2m - 16 = -4n. Let d(u) be the first derivative of -u4/4 + u3 + 2u + 31. What is d(n)? 2 Suppose 5u + 5o = -15, -5u + 10 = -3o - 15. Let r = 0 + 2. Let c(i) = -ri - ui + 5i. Determine c(5). 5 Let s(h) = h + 6. Let f be s(-5). Let q(l) = -f - 4 + 3 + 0 + l. Give q(-3). -5 Let t(m) be the second derivative of m6/720 + m5/120 - 5m4/12 - 5m. Let j(p) be the third derivative of t(p). Calculate j(4). 5 Let a(d) = -d*2 - 115 + 6d + 122 + 2d2. Let x be (-34)/(-4)(0 + 2). Suppose 3j - 2 = -x. Give a(j). 2 Let p be 4/(-6)9/(-18). Let u(f) be the first derivative of -2f - 2 + f2 - pf*3. What is u(2)? -2 Let a(m) be the second derivative of 1/120m*5 - m - 1/12m*4 - 1/120m*6 + 0m*2 + 0 + 0m3. Let f(u) be the third derivative of a(u). Determine f(1). -5 Let l(c) = c3 - c*2 + 1. Let w(f) = 4f*3 + 4f + 1. Let r(h) = -5l(h) + w(h). Calculate r(5). 16 Let z(f) = f2 + 3f. Suppose s = 4s - 12. Suppose sm = -m - 2w, 0 = m - 4w. Let u = -5 - m. What is z(u)? 10 Let x(b) = b - 3. Let c be (-3 - -1)/((-3)/(-12)). Let l(v) = -v*2 - 11v - 5. Let t be l(-11). Let m = c - t. Give x(m). -6 Suppose 13 = 5v - q, 1 = 3v + 4q + 7. Let p(s) be the first derivative of 1/4s*4 + 2 - 4/3s*3 + 6s - vs2. Calculate p(5). 11 Let x = 16 + -18. Let r(o) = -4o - 1. Calculate r(x). 7 Let p = 0 + -2. Let d(v) be the first derivative of 7v2/2 - 8. What is d(p)? -14 Suppose 0 = k - 3 + 1. Let d(n) = -4n + 3n + 3n - 5 - 3n - n3 - nk. Give d(0). -5 Let r be 62/(-1 - -5). Let m(y) be the third derivative of 0yr + 0y - y*2 + 0 - 1/12y*4. Give m(-1). 2 Let q be (-1 - -8) + 6/(-2). Let v(g) = -g + 7. Let n(s) = -s + 1. Let c be n(4). Let o(f) = f - 8. Let w(i) = co(i) - 4v(i). Calculate w(q). 0 Suppose 0 = -4n + 3n - 1. Let b(i) = 5i*3 + 6i*2 - 5i - 8. Let d(p) = -p3 - p2 + 1. Let u(j) = nb(j) - 4d(j). What is u(-3)? -2 Let s(r) = -6r - 6. Let l(f) = -2f - 2. Let n(o) = 17l(o) - 6s(o). Give n(2). 6 Suppose y = 6y + 3z - 29, z + 30 = 4y. Let v = 4 - y. Let d(k) = k3 + 4k2 + k. Determine d(v). 6 Let j(w) = -w3 + 12w2 + 14w - 9. Let t be j(13). Let l be (-2 - 8/(-6))-3. Let q(s) = -l + s + t - 2. Calculate q(1). 1 Suppose -9 = 3o, 4k = -0k - 2o + 2. Suppose -j - 2j + 14 = 5f, -kj - 24 = -5f. Let n(s) = 0s + 4s - 3s. Calculate n(j). -2 Let m(c) = -c*2 + 8c + 9. Let j(y) = -y*3 + 22y*2 + 22y + 30. Let a be j(23). Give m(a). 16 Suppose -3f + 5f - 12 = -5k, 5k - 2f - 8 = 0. Let y(r) be the first derivative of -r4/2 + r3/3 + r2/2 + 2r + 48. Determine y(k). -8 Let s(f) = f + 11. Let u be s(-5). Let o(t) = t*2 - 7t + 4. Determine o(u). -2 Let h(s) = s*3 + 7s*2 + 5s + 4. Suppose 5z + o = -33, -3z + 4 = 2o + 28. Give h(z). 10 Suppose 16l + 16 = 14l. Let w(b) = -b3 - 8b*2 + 2b + 9. Determine w(l). -7 Let q(t) = t*3 + 3t*2 - 6t - 4. Suppose g = -2f + 3, 2f + 15 = f + 5g. Suppose 0 = -x - 0x + 2y, -5x - 3y - 26 = f. What is q(x)? 4 Let z(f) = -f + 3. Let s(r) = 2r - 1. Let p be s(-4). Let n = -4 - p. Determine z(n). -2 Let s(c) = 6c3 + c2 + c. Let v(p) = -3p. Let g be v(-4). Let m be 2/6 + g/(-9). Determine s(m). -6 Let a be 1/(2/2422 + -2). Let l(c) = -c2 - 8c - 9. Give l(a). 3 Let u(n) be the third derivative of 0n - 5/6n*3 + 0 + 1/60n*5 + 5/24n4 - n2. Let g(z) = z*2 - 4z - 1. Let a be g(2). Give u(a). -5 Let a(n) be the third derivative of n5/60 + n4/3 - 2n3/3 + 67n*2. Give a(-8). -4 Let o(m) = -m - 3. Suppose 5j + 32 = 2. Let l(g) be the second derivative of -g*3/6 - 2g*2 + 2g. Let s(i) = jo(i) + 5l(i). Calculate s(0). -2 Suppose -2d - 4 = -q, q + 22 = -5d + 5. Let w(p) = p + 8. Let a be w(d). Let o(v) = v*3 - 5v*2 - 2v + 7. Give o(a). -3 Let q be (-1(2 + -2))/(-2). Suppose q = 5o, 5x - 2o + 31 = 1. Let h(l) = -l*3 - 5l*2 + 6l + 4. What is h(x)? 4 Suppose c + g + 0g = -5, -g + 19 = -3c. Let x(w) = -3w. Let s(n) = -n - 1. Let o(l) = 2s(l) - x(l). Determine o(c). -8 Let k = -9 - -13. Let l(x) be the third derivative of 1/3x3 + 1/24x4 + 0 - x2 + 0x. Determine l(k). 6 Let x(j) = j3 + 14j*2 + 13j + 4. Let h be x(-13). Let r(c) = -c*3 + 3c*2 + 3c. Give r(h). -4 Let a(q) = 3q + q - 2q + 0 - 10. Calculate a(7). 4 Let t(c) = -3 - 4c + c - 2c + c. Calculate t(3). -15 Let a(s) = s*2 + 7s - 1. Suppose -3f - 30 = -6f. Let n be 22/(-4) + 15/f. Calculate a(n). -13 Let y = -32 - -33. Let v(j) = -9j2 - 2j + 1. Determine v(y). -10 Suppose -3m - 5 = 2b + 5, -2m + 5b = 13. Suppose -12 - 13 = -5q + 2k, 5k = 0. Let c(t) = -q - 1 + 1 - t. Calculate c(m). -1 Let a(h) = 7h - 1 + h*3 - 7h - 3 + h*2. Determine a(0). -4 Let a(w) = 7w + 1. Suppose 0 = m - 8m + 182. Suppose -5s = 4o - 21, o - 6s + m = -s. Determine a(o). -6 Let x(z) = z*2 + z. Let n(t) = -3t3 + t2 - t - 1. Let f be n(-1). Suppose 6 = -2m + fm. Suppose my = -4 - 2. Calculate x(y). 2 Let q(r) = -r - 1. Let f(k) = -4k - 3. Let n(a) = -f(a) + 5q(a). Let d(h) = 6h2 - 1. Let z be d(-1). Calculate n(z). -7 Let z(r) = -r2 - 7r - 4. Let u = -6 + 2. Let d = u - 1. Give z(d). 6 Let m(a) = 3a*2 + 15a - 27. Let y(p) = 4p2 + 23p - 40. Let b(g) = -7m(g) + 5y(g). What is b(8)? 5 Let w(g) = g*3 - 6g*2 - 8g + 10. Let n be w(7). Let o(j) = 4j + 0j - nj. Let b(r) = 2r*3 + 1. Let i be b(1). Give o(i). 3 Suppose 2p - 2 = p. Let g(m) = -pm + 3m + 5m - 4 + 1. What is g(2)? 9 Let t(m) be the first derivative of m4/8 - m3/3 + m2 - 2. Let x(l) be the second derivative of t(l). Let f = -27 + 30. Determine x(f). 7 Let q(h) be the second derivative of -h5/20 - h4 - 2h*3 - 7h*2/2 + 48h. Calculate q(-11). 4 Let o(b) = b - 4b2 + b3 + 1 + 0b + 2. Suppose 4a - 13 + 49 = 0. Let z = a - -13. Give o(z). 7 Let k(a) = -3a + 6. Suppose -5h + 36 = 4h. Give k(h). -6 Let h(s) = -5s3 + 12s*2 + 5s + 12. Let a(j) = 2 + j*3 - 2j3 + j2 - 1. Let y(d) = 6a(d) - h(d). Determine y(-5). -6 Let t(v) = 10v - 12. Let p(w) = -3w + 4. Let z(j) = -7p(j) - 2t(j). Let k(b) = -3 - 6 - 3b*2 + 2b*2 + 5b + 2b2. Let u be k(-7). Determine z(u). 1 Let q(u) = 5u*2 - 6u - 2. Let r(j) = -3j2 + 4j + 1. Let y(z) = 5q(z) + 8r(z). Determine y(-5). 13 Let t(c) be the first derivative of -4c + 1/2c*2 - 3. Suppose 3l + 0 = 15. Determine t(l). 1 Let o(l) = l*3 - 3l*2 + l + 3. Let f = -19 - -10. Let b be -4-2f/(-24). Determine o(b). 6 Let l(q) = -q - 55q*2 + 29q*2 + 25q**2. Suppose 4	{ "pile_set_name": "DM Mathematics" }
a composite number? False Suppose -5i + 1416 = -39. Is i prime? False Let s = 503 + -153. Let i = s + 27. Is i prime? False Let p = 12368 - 7461. Is p a prime number? False Suppose -32 + 19 = 13x. Let w(h) be the second derivative of -39h5/10 - h4/6 - h3/6 - h. Is w(x) prime? False Suppose -5i + 2i - 24 = 0. Let c be i/(-32) + 15/4. Suppose 2j + 418 = cx, -324 = -3x + 4j + j. Is x composite? False Let w be 0 - 9-5428. Is (1/3)/(12/w) a prime number? False Suppose 6647 = 2g + 769. Is g a prime number? True Suppose 0 = -5f - m - 0m - 727, -5m = -15. Suppose 4l = -4k - 0l - 44, -l + 25 = -2k. Let r = k - f. Is r prime? False Is (-1 - -2)/(19/33041) prime? False Suppose -2c + 1270 - 422 = 2n, -5c = 3n - 1280. Let o = 207 - n. Let q = 358 + o. Is q composite? True Suppose g = 15g + 20972. Let r = 45 - g. Is r composite? False Suppose -m + 4m = s + 21, 4m - s - 29 = 0. Let n(j) = -5 + 2j2 + 3j2 - j3 + 7j2 - 2j. Is n(m) prime? False Suppose 20r - 18r + 4h = 1590, 0 = 4r + 2h - 3186. Is r prime? True Let n = -1508 - -2514. Is n/(-6)(15 - 18) composite? False Suppose -4o + 2y - 94 = 0, 2y + 29 = -5o - 93. Let t = o - -256. Let a = t + -87. Is a composite? True Let i(j) = j*2 + 11j - 111. Is i(-28) a prime number? False Let t(c) = 325c + 3. Let o(r) = -2r*3 - 12r*2 - 4r - 3. Let a be o(-8). Let k be a/133 - 2/14. Is t(k) composite? False Let t = 4 - 2. Let r(z) = z + 4z - t - 4z + 10. Is r(-4) composite? True Suppose -18785 = 6u - 297071. Is u prime? True Is 3/(-36) - 195674/(-24) a prime number? False Let h(b) = -382b*3 + 12b*2 - 2b + 1. Is h(-2) prime? True Suppose 17 = -5n + 42. Suppose -3m - 1 = -nx + 17, 5x = m + 6. Let y(r) = -2r + 3. Is y(m) a composite number? True Let l = 4721 + -2445. Let c = l - 1399. Is c a prime number? True Let f be (-27022)/(-14) + (-7)/49. Let c = f + -89. Is c composite? True Is ((-421395)/(-78))/((-10)/(-4)) prime? True Suppose -5x + 3128 = 3v - 952, -15 = -3v. Suppose 107 = -4g - x. Is g/(-3) - 2/(-6) composite? True Let b be (3 - 1) + (-9436)/14. Is (-2 + b)6/(-12) a prime number? True Let u(n) = 15n2 - 13n - 53. Let d = -37 + 53. Is u(d) a prime number? False Let y(p) = 4p2 + 8p - 2. Let m be y(-4). Suppose 29b = mb - 891. Suppose -b = -5l + 1064. Is l a composite number? True Let f(p) be the first derivative of p2/2 + 1. Let n be f(2). Suppose -3t - nt + 455 = 0. Is t prime? False Let l(g) = 6g3 + g2 - 1. Let d be l(-1). Let u(n) = -n*2 - 8n + 3. Let x be u(d). Is 4/(-10) + 1671/x prime? False Let c = -10393 + 26996. Is c composite? False Let m = 21 - 40. Let u = -10 - m. Let s = 16 - u. Is s composite? False Let z be 6/(-16)40/(-5). Let d(f) = 2f*2 - 3f. Let w be d(z). Let o = 28 + w. Is o composite? False Let n be 43/(-18)3. Is n/4-1816 - 1 prime? True Let z(k) = -58k + 23. Let j(i) = 29i - 11. Let b(r) = -13j(r) - 6z(r). Let p be b(-5). Suppose -44 = -y + p. Is y prime? False Let r(t) = 1498t - 1. Is r(2) composite? True Let f be 11/(308/4064) + 1/(-7). Suppose 5y - 1326 = -3p, 2y = -2p - f + 1033. Is p composite? True Let a(x) = x*3 + 11x*2 + 18x + 5. Let v be a(-7). Suppose 5o + 10 + v = 0. Is (o - -561) + 3/(-1) a prime number? True Let s be 37/((-20)/21 - -1). Is 6/9s/14 composite? False Let o = 172 + -91. Let m be (-1)/4 - o/(-36). Suppose -mr = -81 - 57. Is r a prime number? False Let p(b) = -469b - 17. Let m be p(-7). Suppose 4k + 2z - 8072 = -1532, m = 2k + 2z. Is k prime? True Let y = 23374 + -15767. Is y a prime number? True Let j(m) = -m*3 + 10m*2 - 10m + 7. Suppose 2i = -t + 3t + 16, 2t - 38 = -4i. Let l be j(i). Is (-1266)/l4/12 a prime number? True Suppose 4i = -2l + 5162, 3l = -3i - 2065 + 9805. Is l composite? False Suppose 4f = 0, -4q + 375 + 153 = f. Is -4 - q/(-30) - 3466/(-10) a composite number? False Suppose 4g = -4x - 1479 + 4679, 0 = -2x - 5g + 1609. Is x a prime number? True Let i = 4852 + -188. Let q = -2393 + i. Is q prime? False Let p = -12 + 12. Let f = 259 + p. Is f prime? False Let k(m) = 9m3 + 1. Let u(w) = w3 + 3w2 - 1. Let c(p) = -p2 + p + 1. Let z be c(2). Let f be u(z). Is k(f) composite? True Let j = -349 + 718. Let s be 11/(11/2) + (-2 - -121). Suppose 2c + c + 4f = j, 2f = -c + s. Is c a composite number? False Suppose -423 = -2d + 581. Let y = d + 111. Is y a prime number? True Let c(d) = 2d*2 - d - 4. Let a be c(2). Let f(n) = 139n*2 + n - 4. Is f(a) composite? True Let t be ((-1279)/(-1))/(5/5). Suppose -t = -9l + 17126. Is l composite? True Suppose -5n = -v + 829, 2v - 6n + 9n = 1684. Is v prime? True Let p(j) be the third derivative of j*6/120 + 17j*5/60 - 13j4/24 + j3/2 - 8j2. Let q be p(-13). Suppose 7s = 15s - q. Is s prime? False Suppose -5z + 21 = 2z. Let f(p) = 27p + 8. Is f(z) prime? True Suppose 217 = o - 4s, 0s - 4s = -16. Suppose 9x - 4004 = -o. Is x a prime number? True Let n be -6 + 0/(2 - -1). Let y be (-7)/(-1) - n/(-2). Let b = 7 - y. Is b composite? False Let j(n) = -4n - 15. Suppose 3h + y + 27 = -h, -6 = 2y. Let s be j(h). Let t(v) = v3 - 5v*2 - 9v + 8. Is t(s) composite? False Let p(j) = -2j3 - 8j*2 + 3 + 6j*3 + 2j*3 - 9j - 5j3. Let r be p(9). Suppose -w = 4a - 257, -rw - 5a = -895 + 124. Is w prime? True Let t(j) = 1788j - 5. Let c(m) = 2m*2 + 13m + 8. Let a be c(-6). Is t(a) a composite number? False Suppose 5f = -3k + 319129, 3f - 95528 - 95949 = -2k. Is f a composite number? True Let v be (539 - -1)1/2. Suppose -4a = -5p - 203, 4p = 5a + p - v. Suppose 0 = 5s + 2k - 277, 2s + 2k - a = 55. Is s composite? True Let m be (-1)/5 - 54030/(-25). Suppose 357 = n + 2w, 3w + 404 - m = -5n. Let d = n + -228. Is d a composite number? True Is (-1400)/(-3) + (-38)/(-114) a prime number? True Suppose 0 = -4a + 10 - 30, 2h - 2a - 1280 = 0. Is h a prime number? False Let d(b) = -2b + 19. Let k be d(9). Suppose -4m = -k - 11. Suppose -3t - 2f - 59 = -4t, -3t + 177 = mf. Is t prime? True Suppose 18g - 16g = -38. Let b = g - -20. Is b/(-4)-477 prime? False Let c(i) = -5i - 16. Let z be c(-6). Let p = 11 - z. Is 129 - (p - 1/1) a prime number? False Let h = -14 - 1. Suppose -5t = -5b + 395, -4t - 144 = 4b + 180. Let u = h - t. Is u a prime number? False Let f = 0 + -4. Let p be -32 + (1 - (2 + f)). Let z = p + 62. Is z prime? False Let c(d) = 3 + 7d*2 + 0 + 0 - 3d. Let a be (-6)/(-21) - (-210)/(-49). Is c(a) a prime number? True Suppose 4v + 771 = -593. Let u = v + 1094. Is u composite? True Let m(o) = -o2 + 7o - 3. Let t be m(6). Suppose -5w + tw + 971 = s, 5s = 4w + 4855. Is s prime? True Let v(l) = l + 4. Let j be v(-3). Let d be 174/3-1 + j. Let o = d - -96. Is o prime? False Suppose -r = 2r - 21. Let g(u) be the first derivative of u3 - u2 + 24u + 83. Is g(r) a prime number? True Let i(n) = n2 - 8n - 9. Let j be i(9). Suppose -t + 78 = -jt. Suppose 3k - 369 + t = 0. Is k prime? True Let w = 13 - 18. Let t(u) = -u*3 - 4u*2 + 3u - 7. Let g be t(w). Is 0 + 139/3g a prime number? True Suppose -4p - 4v + 27 = -37, 2v = -p + 15. Suppose 3o = s - 530, 4s - 1 = -p. Let n = -81 - o. Is n prime? True Suppose 0 = 3h + 3q - 264, 0q + 464 = 5h - q. Let d = 1993 - h. Is d prime? True Let o = 23478 + -11879. Is o composite? True Let r be 2(-4)/(24/1941). Let a = 707 - r. Is a a prime number? False Let r be (-16 - -2)3/6. Let t(u) = 12u2 + 4u + 10. Let s be t(r). Suppose -5l + 3n = -1477, 2n = -2l - 2n + s. Is l composite? False Suppose -5749 = -a - 3i, 4i = 3a - 9500 - 7695. Is a a composite number? False Let q = 262975 + -187046. Is q composite? True Suppose -u + 4y + 643 = 0, -19u + 18u = 4y - 651. Is u a prime number? True Let a(p) = -p*3 - 5p*2 + 4p - 6. Let u be a(-6). Suppose 5d - u = 2o - 0o, 5o - 4 = 3d. Suppose -6 = 2s, -c = -dc - 5s + 134. Is c a prime number? True Suppose -3b = 2n - 4, 1 = -2b - 3n - 2n. Suppose 5c - 2a = 1298 + 1217, 4c = ba + 2014. Is c a composite number? True Let v = 12 - 13. Let i(l) = -257l*3 + l. Let o be i(v). Suppose -2a = o - 1154. Is a composite? False Let h = 83 - 78. Let a be (-2)/3 - (-70)/15. Suppose	{ "pile_set_name": "DM Mathematics" }
2/5)/(24/(-30))10? -5 Evaluate (13/((-26)/(-4)))/(-18). -1/9 What is ((-1)/(-1)0)/(23/23)? 0 What is the value of 7(160/(-616))/(-10)? 2/11 What is 18/(-6)(-9)/(-54)? -1/2 Evaluate (-4)/(-6)10(-12)/16. -5 Calculate ((-2)/4)/((-7)/112-24). -1/3 Calculate 123/824/6. 1 Evaluate (3(-2)/(-36))/(12/(-108)). -3/2 What is the value of ((-152)/576/(-8))/11? 2/11 What is the value of ((-78)/390)/(1/((-6)/(-3)))? -2/5 What is 3/(-2)(1144/66)/(-26)? 1 What is the value of (1/(91/(-14)))/1? -2/13 (4/(-48)-3)/(7/8) 2/7 Calculate (44/(-12))/(-11)6/(-8). -1/4 Calculate 6/8(-184)/(-621). 2/9 Calculate (-3)/(-2)-18/(-4). 3 What is the value of (9/2)/(-1)66/99? -3 Evaluate ((-1)/(-18))/((-9)/(180/5)). -2/9 What is the value of (-2(-7)/18)/(550/2475)? 7/2 Evaluate 15/12-21/5. -1/2 ((16/42)/(-2))/(36/42) -2/9 What is the value of -2(2/(-8))/(72/(-32))? -2/9 Evaluate (-1)/(-5)(-20)/24. -1/6 What is (6/(-36))/((-3)/(-72)3)? -4/3 Evaluate (2/(-44))/((-44)/(-528)). -6/11 Evaluate ((-25)/((-100)/(-48)))/((-6)/(-3)). -6 Calculate ((-2)/9)/((-24)/(-72)). -2/3 What is the value of 1/(((-7)/21)/((-12)/306))? 2/17 Calculate ((-7)/(-7))/(((-5)/5)/6). -6 Evaluate (33/(-18))/(143/(-26)). 1/3 What is -1(-3)/(45/5)-18? -6 Evaluate (1/1)/(-74/(-16)). 4/7 2/(-3)(-4)/16 1/6 (3/22)/(5/5) 3 What is 605/72642/(-20)? -7/4 Evaluate ((-5)/((-225)/18))/(2/(-10)). -2 Evaluate 32/9636/(-2). -6 (-119)/(-34)(-40)/(-28) 5 2/(((-6)/(-2))/((-3)/2)) -1 ((-4)/530/12)/22 -1/11 Evaluate ((-2)/(-12))/((-3)/(-24)). 4/3 Evaluate ((5/(-5))/(7/14))/(-1). 2 (1/(-4)-6)/(6/12) 3 Calculate 0/(-1)((-91)/21)/(-13). 0 (-4)/(-2(-7)/14) -4 What is the value of (24/14)/(-2)(-28)/8? 3 What is the value of ((64/28)/(-2))/((-2)/7)? 4 Evaluate (6/(-2))/1525/(-10). 1/2 ((-2)/24-9)/(3/12) 3 Calculate 6/(-4)952/357. -4 18/(-54)(54/(-15))/(-3) -2/5 Calculate (9/(-3))/((-1)/((-4)/6)). -2 Evaluate ((-6)/(-40))/((-768)/(-1024)). 1/5 Calculate 4/(-6)12/(-4). 2 Evaluate (25/2)/(-5)(-8)/12. 5/3 What is ((-9)/(441/(-14)))/(40/56)? 2/5 What is (1/3)/(1/(4/1))? 4/3 Evaluate 2-513/52. -5/2 What is (-7)/3723/(-241)? 7 Evaluate 3/(45/6)320/16. 8 What is 55/25-17? -7 4(34/(-16))/(-17) 1/2 What is (5/15)/((-7)/6)? -2/7 Evaluate 1/(-2)((-156)/13)/48. 1/8 5-42/(-8)-2 -10 What is the value of 6/(-3(-5)/10)? 4 What is the value of (1/9)/(1/84)? 2/9 Evaluate (10/(-25))/((-4)/5). 1/2 What is (48/(-408))/(1/(-2)-2)? -2/17 Calculate 116/159510/(-4). -2/11 Calculate ((-2)/3)/((-17)/136-16). -1/3 What is the value of 4/(-30)95/(-38)? 1/3 Calculate (-3)/(-3)(-4)/(-640)8. 1/20 What is the value of -1(5/(-15))/((-14)/(-6))? 1/7 Evaluate 5/(10/2)4. 4 What is ((-1)/10)/(12/(-540)-27)? -1/6 What is the value of (47/282)/((-7)/(-3))1? 1/14 Evaluate ((-3)/(-14))/((180/42)/5). 1/4 What is ((-80)/166/(-10))/(-1)? -3 Calculate 6/(-6)(-2)/786. 2/13 Calculate (-15)/(-6)24/(-20). -3 Calculate 0(6/(-27))/((-12)/18). 0 16/(-64)5/((-30)/8) 1/3 Evaluate (5/25)/(34/20). 2/17 Calculate ((-4)/(-3))/(105/630). 8 0/(6/2(-2)/3) 0 Calculate (2/(-28))/((-46)/(-1127)). -7/4 Evaluate (-9)/(-15)15(-3)/63. -3/7 Calculate 42/14(-5)/(-3). 5 What is ((-4)/(-12))/((-3)/6)? -2/3 -8(-8)/80-5 -4 Evaluate ((-186)/(-217))/(4/14). 3 What is the value of (2/4)/(-3(-1)/(-6))? -1 What is the value of (-5)/21/10? -1/4 Evaluate (140/(-60))/((-4)/(-12)). -7 2/((-17)/((-714)/12)) 7 Evaluate (03/(-12))/((-4)/4). 0 2(-5)/3297/110 -9 Evaluate 105/7(20/25)/2. 6 What is the value of 0/((-10)/((-10)/3))? 0 What is ((-20)/(-2))/(144/8)3? 5/3 Evaluate 8/(-10)12/(-24). 2/5 Calculate 1/(-2(-6)/30-5). -1/2 (-12/(-12))/(73/146) 1/3 Calculate 20/2004/2. 1/5 13/(-26)(-4)/(-6) -1/3 What is ((20/(-10))/2)/(2/12)? -6 Evaluate (3/(-1))/(-12(-32)/(-48)). 3/8 (4/(-32)2)/(10/8) -1/5 What is ((-20)/4008)/(1/25)? -10 What is (29/58)/(1/10)? 5 What is the value of (4/2807)/((-6)/(-24))? 2/5 What is the value of ((-24)/(-4224)22)/(1/3)? 3/8 Calculate (-3)/1(-3)/(-63). -1/7 ((12/2)/(-2))/(198/44) -2/3 1/(2(-3)/12) -2 What is 7-1(-16)/805? 7 163/162 1/9 Evaluate (((-144)/(-40))/6)/(1/(-5)). -3 What is -13(18/(-15))/(-6)? -3/5 1423/(-23) -4 Evaluate (-7)/(-21)9-1. -3 (2/(-5))/(13/(-26)) 4/5 What is the value of (2/4)/((-2)/4)? -1 What is ((-24)/18)/(3/9)? -4 Evaluate (1/(-4)2-1)/2. 1/4 What is the value of (2(-1)/57)/(405/1215)? -2/19 Evaluate (-6)/(-10)52/(-156). -1/5 What is (100/10)/(-10)2/(-14)? 1/7 What is (-55)/3302/2? -1/6 ((-95)/(-10))/(-19)6 -3 Evaluate (3/(-1))/(99/66). -2 Evaluate (-10)/((-100)/10)-7. -7 Evaluate ((-136)/(-119))/(3/21). 8 Calculate ((-9)/9)/(2/(-5)). 5/2 Evaluate ((-23)/115)/(2/(-5)). 1/2 (36/(-4))/9-1 1 What is (-5)/(-16)-22/(-5)? 1/4 Calculate (-2)/74/(-20)14. 4/5 What is the value of (-18)/611/(297/6)? -2/3 What is the value of 630/(-84)(-1)/((-15)/(-12))? 6 Calculate 6/((-6)/(-1))3. 3 Calculate 22/(-10)10. -4 (20/8)/((-2)/41) -5 What is the value of 1/1015(-5)/30? -1/4 What is (-6)/(-10)440/66? 4 Evaluate 18/3025/(-90). -1/6 (((-93)/10)/(-31))/((-6)/(-5)) 1/4 What is the value of 15/(-5)4/(-42)? 2/7 Calculate (-720)/4502/(-16). 1/5 What is the value of ((-1)/9-6)/((-2)/(-9))? 3 What is (-12)/(12/2)2/12? -1/3 1/((-5)/(((-12)/(-3))/2)) -2/5 ((-2)/42)/(4(-1)/12) 1/7 What is the value of (-1)/((-4)/(8/3))? 2/3 What is the value of ((-1)/(-9))/(462/(-252))? -2/33 What is (-56)/(-40)2/7? 2/5 Calculate 36/6(-2)/(-4). 3 What is the value of ((-14)/84)/(4/(-24))? 1 Evaluate ((-24)/(-44))/((-12)/(-66)). 3 Calculate (665/(-266))/((-35)/4). 2/7 What is 1/(10/(-12)(-15)/(-75))? -6 Evaluate (22/66)/(1/6). 2 What is the value of (-16)/(-120)10(-3)/(-10)? 2/5 What is the value of (12/(-12))/(14/(-4))? 2/7 Evaluate (-12)/10120/36. -4 What is ((-5)/504)/1? -2/5 What is the value of (((-56)/42)/(2/(-18)))/2? 6 What is (-2(-1)/8)/(7/28)? 1 Calculate ((-6)/1)/(-3)(-3)/6. -1 What is the value of 4/8(-36)/(-18)? 1 1(-10)/156 -4 12/(-30)6/3210 -3/4 Calculate 20/18-36/(-4). 5 What is the value of -34/156-2? 2/13 What is the value of ((-2)/(-3))/(-1)(-9)/6? 1 What is 1/2(-62)/(-31)? 1 Evaluate 119/38(-4)/(-22). 1/11 What is the value of -5(-18)/(-30)12/9? -4 Evaluate (-24)/(-270)(-15)/(-6). 2/9 ((-240)/100)/((-6)/(-15)) -6 Evaluate 23/36-2. -1/3 What is the value of 0/121/(-21)? 0 -33/(-9)4/8 1/2 Evaluate 16/(-10)(-2)/8. 2/5 What is the value of (12/(-27))/(96/144)? -1/9 What is ((-4)/(-4))/((-3)/(-9))? 3 What is 16/20-5(-2)/(-4)? -2 What is the value of ((-34)/(-272))/(17/8)? 1/17 What is the value of (30/(-5))/(-1)1? 6 (4/50)/(4/(-100)5) -2/5 Evaluate 1/(-1)(-12)/390-5. -2/13 Calculate ((-1)/53)/((-128)/(-640)). -3 5/2(-2)/(-25) 1/5 What is the value of (60/(-80))/((-6)/16)? 2 Calculate (-5)/((-175)/(-5))(-14)/(-12). -1/6 15/(-20)2(-10)/(-3) -5 What is (-1)/((5/15)/(4/3))? -4 Calculate 10/(-4)156/(-195). 2 Calculate 2/(-2)5928/580. -8 Calculate 48/7231/8. 1/4 Evaluate ((-4)/36)/((-4)/8). 2/9 Evaluate 10/163/45-6. -1/4 Calculate (-2)/(-14)(-48)/(-12). 4/7 Evaluate (((-30)/(-44))/5)/(27/(-36)). -2/11 Evaluate ((-2)/1)/((-5)/(-1)). -2/5 What is the value of 30/(-135)(-9)/7? 2/7 Calculate 3(-8)/((-120)/25). 5 Evaluate (3/18)/(11/88). 4/3 Evaluate (8/1803)/(21/(-63)). -2/5 What is ((-48)/(-14))/(-4)3/(-27)? 2/21 -69/168(-56)/48 3/8 What is (-9)/(-36)16/6? 2/3 What is (-11)/110/(8/(-4))? 0 Evaluate (-5)/(-10)(-54)/9. -3 What is the value of 6/(-4)8/(-198)-3? -2/11 Calculate (276/(-3795))/((-4)/30). 6/11 Calculate ((-7)/((-42)/(-9)))/(-6). 1/4 Calculate ((-43)/(-344))/(((-3)/3)/2). -1/4 Evaluate (1/(-15)-1)/(2/6). 1/5 What is the value of (-1)/((-1)/(-42)-6)? 7 What is ((2/(-5))/((-8)/40))/(-11)? -2/11 What is 1(-14)/(-35)-2? -4/5 What is -3(-2)/12(-52)/104? -1/4 (-54/6)/((-2)/3) 5 Calculate (-174)/29(-2)/36. 1/3 What is the value of ((-2)/(-4))/(4/32)? 4 ((-39)/(-26))/((-6)/(-20)) 5 What is 50/((-20)/4)(-2)/4? 5 Evaluate (-381)/(-254)10/3. 5 Calculate ((-75)/(-45))/((-2)/6). -5 (4/(-20))/(12/180) -3 What is the value of (42/525-35)/((-12)/(-10))? -7/3 What is the value of (8/(-136))/((-6)/6)? 1/17 3/(-7)5(-2)/(-15) -2/7 Evaluate 60/(-680)4/3. -2/17 Evaluate (-30)/32/(-12)-3. -5 What is (-12)/(-156)1/	{ "pile_set_name": "DM Mathematics" }
s next in -16260, -15943, -15418, -14685, -13744, -12595, -11238? -9673 What comes next: 754, 10396, 36564, 87520, 171526? 296844 What is next in -24787, -25455, -26125, -26797? -27471 What is the next term in -2228648, -17828848, -60172234, -142630400, -278574940, -481377448? -764409518 What is the next term in -16286990, -16286955, -16286922, -16286891, -16286862? -16286835 What comes next: 453, 377, 331, 315, 329, 373, 447? 551 What is next in 21095, 20993, 20867, 20711, 20519, 20285, 20003? 19667 What comes next: 13234469, 13234465, 13234461, 13234457, 13234453? 13234449 What is next in -558, -7635, -26846, -64257, -125934, -217943, -346350, -517221? -736622 What is the next term in -20192, -41945, -63696, -85445, -107192, -128937? -150680 What is the next term in -2491894, -4984263, -7476642, -9969037, -12461454, -14953899, -17446378, -19938897? -22431462 What comes next: -14828746, -14828748, -14828750? -14828752 What comes next: 15800, 15006, 13688, 11846? 9480 What is the next term in -17548, -17599, -17650, -17701, -17752? -17803 What is the next term in 1310, 2381, 2954, 2783, 1622, -775? -4654 What is next in -2046, -6245, -12658, -21285, -32126, -45181? -60450 What is the next term in 50348, 101418, 152488, 203558, 254628, 305698? 356768 What comes next: 6461, 4481, 2501, 521? -1459 What comes next: -31916791, -63833581, -95750371, -127667161, -159583951, -191500741? -223417531 What comes next: -2362464, -4724932, -7087400, -9449868, -11812336? -14174804 What comes next: 6451970, 6451983, 6451996, 6452009? 6452022 What is next in 96195071, 192390149, 288585227, 384780305? 480975383 What is the next term in 2848764, 2848800, 2848836, 2848872, 2848908? 2848944 What is next in -57443183, -114886367, -172329551, -229772735, -287215919? -344659103 What is the next term in -3169476, -3169494, -3169512, -3169530, -3169548, -3169566? -3169584 What is next in 154379, 154353, 154329, 154307? 154287 What comes next: -544, -989, -2326, -4999, -9452? -16129 What comes next: 48865, 99010, 149159, 199312, 249469, 299630? 349795 What is next in -1624547, -1624729, -1624911, -1625093? -1625275 What comes next: 296950, 593889, 890820, 1187743? 1484658 What comes next: 248358, 248286, 248214, 248142, 248070, 247998? 247926 What comes next: 376392, 376390, 376388, 376386? 376384 What is the next term in 957449, 1914900, 2872359, 3829826? 4787301 What is the next term in 80655, 81584, 82513, 83442, 84371? 85300 What comes next: 2933, 10803, 23901, 42227, 65781, 94563, 128573? 167811 What is the next term in -84996, -85008, -85054, -85152, -85320, -85576, -85938, -86424? -87052 What is next in 135017137, 270034275, 405051415, 540068557, 675085701, 810102847? 945119995 What is the next term in 18090, 36286, 54486, 72690, 90898, 109110, 127326? 145546 What comes next: -23086, -92405, -207998, -369871, -578030, -832481? -1133230 What is the next term in -4259, -35464, -120175, -285146, -557131, -962884? -1529159 What is next in 21622, 85959, 193178, 343273, 536238, 772067, 1050754? 1372293 What is the next term in 299196319, 299196317, 299196315, 299196313? 299196311 What is next in 822, 2801, 5896, 10113, 15458, 21937, 29556? 38321 What is the next term in -4, -34, -412, -1312, -2908, -5374? -8884 What is the next term in 16532362, 16532363, 16532364, 16532365, 16532366, 16532367? 16532368 What comes next: 10444109, 10444072, 10444035, 10443998, 10443961, 10443924? 10443887 What is next in -12935739, -25871483, -38807227? -51742971 What is next in -2329, -2486, -2633, -2770, -2897, -3014? -3121 What is the next term in -369198, -739424, -1109650? -1479876 What is the next term in 5907, 5313, 3687, 513, -4725, -12543, -23457, -37983? -56637 What is the next term in 930, 3570, 7910, 13950, 21690, 31130? 42270 What is the next term in -15468, -30973, -46476, -61977, -77476? -92973 What is next in 35040, 35051, 35066, 35085, 35108? 35135 What comes next: 22774, 45476, 68178, 90880, 113582? 136284 What is next in 494970, 494955, 494940, 494925? 494910 What comes next: -4668, -9877, -15630, -21927, -28768? -36153 What is the next term in 181065, 180954, 180973, 181188, 181665? 182470 What comes next: -17435041, -34870081, -52305121, -69740161, -87175201, -104610241? -122045281 What is next in -2017871, -4035754, -6053637, -8071520, -10089403? -12107286 What is next in 624, -4415, -18094, -44733, -88652, -154171? -245610 What is the next term in 5084868, 5084845, 5084818, 5084787, 5084752? 5084713 What is the next term in -15600420, -15600414, -15600408? -15600402 What is the next term in 734, -1569, -5378, -10687, -17490, -25781, -35554? -46803 What comes next: -2155, -4461, -7157, -10249, -13743, -17645, -21961, -26697? -31859 What is the next term in -148850, -148852, -148854? -148856 What is the next term in 179, 782, 1913, 3686, 6215, 9614, 13997? 19478 What is the next term in -97643, -781136, -2636301, -6248966, -12204959, -21090108, -33490241, -49991186? -71178771 What is next in -10756674, -10756672, -10756670, -10756668, -10756666? -10756664 What is next in 77577, 155277, 232965, 310635, 388281? 465897 What is the next term in 137986, 276022, 414058, 552094, 690130? 828166 What is the next term in -246301, -246334, -246387, -246460? -246553 What is the next term in -266257, -532566, -798875, -1065184? -1331493 What is next in -18489201, -36978453, -55467705? -73956957 What comes next: -12964, -27535, -42106, -56677, -71248? -85819 What is the next term in -70242, -141797, -213364, -284949, -356558? -428197 What is the next term in 10251, 20497, 30723, 40929, 51115, 61281? 71427 What is next in -22189, -22565, -22943, -23323, -23705? -24089 What is the next term in -248, -4471, -11746, -22067, -35428? -51823 What is the next term in -32848120, -32848122, -32848124, -32848126, -32848128, -32848130? -32848132 What is the next term in -27953, -30574, -33195, -35816, -38437? -41058 What is the next term in 11241611, 22483223, 33724835, 44966447, 56208059, 67449671? 78691283 What is the next term in -283128, -283109, -283090, -283071, -283052, -283033? -283014 What is next in -743, -1000, -1295, -1646, -2071? -2588 What is the next term in 304353849, 304353851, 304353853, 304353855? 304353857 What is next in 20032458, 80129869, 180292220, 320519511, 500811742? 721168913 What is the next term in -37166, -74737, -112308, -149879, -187450? -225021 What is the next term in 17509, 16299, 15089, 13879, 12669, 11459? 10249 What is next in 34982, 69947, 104962, 140021, 175118, 210247? 245402 What is the next term in 533372, 1066883, 1600692, 2134949, 2669804, 3205407, 3741908? 4279457 What comes next: -14764, -29756, -44948, -60340, -75932, -91724, -107716? -123908 What comes next: -800, -4096, -9940, -18620, -30424? -45640 What is next in 4019281, 8038562, 12057843, 16077124? 20096405 What is next in -18187, -17939, -17205, -15745, -13319, -9687, -4609? 2155 What is next in 31463, 62944, 94441, 125954, 157483, 189028, 220589? 252166 What comes next: 17164, 68605, 154340, 274369, 428692, 617309? 840220 What comes next: -1393993, -1394002, -1394029, -1394080, -1394161, -1394278? -1394437 What is next in -5298, -10689, -16224, -21903, -27726, -33693, -39804? -46059 What is the next term in 103599996, 103599978, 103599962, 103599948, 103599936? 103599926 What comes next: 9935, 39099, 87773, 155957, 243651? 350855 What is next in -76695, -159943, -243191, -326439, -409687, -492935? -576183 What is next in 210688, 842724, 1896122, 3370882, 5267004, 7584488? 10323334 What is next in 6926, 27813, 62658, 111455, 174198, 250881, 341498? 446043 What comes next: 30928980, 30928971, 30928958, 30928941, 30928920, 30928895? 30928866 What comes next: -27924939, -27924938, -27924937, -27924936, -27924935? -27924934 What is next in -1596, -12711, -42832, -101457, -198084, -342211? -543336 What is the next term in -11168, -44563, -100226, -178163, -278380, -400883, -545678? -712771 What comes next: 3069256, 6138543, 9207830, 12277117, 15346404, 18415691? 21484978 What is next in 14341, 14439, 14603, 14833, 15129, 15491? 15919 What comes next: 257936, 1031797, 2321566, 4127243, 6448828? 9286321 What is next in -119538, -119652, -119766, -119880, -119994, -120108? -120222 What is	{ "pile_set_name": "DM Mathematics" }
of t? 8 Let u = -30526 + 51621. What is the hundreds digit of u? 0 Let y(v) = -4583v + 296. What is the hundreds digit of y(-15)? 0 Suppose 0 = 2t + 3g - 21621, 5t - 4t - 10813 = -g. What is the tens digit of t? 1 Suppose 5h = -175 + 790. Suppose -3b = -282 - h. Let n = b + -88. What is the tens digit of n? 4 Suppose 0 = -4d - 2p - 2, -4p = 3d + 4. Suppose 2f - 18 = -dm - 3m, 4m = -2f + 22. What is the tens digit of (-1)/5 + 2680/25 - m? 0 Let d = 24 + -10. Let u(w) = -w*3 - 2w - 8w - 19511w*2 + 2 + 19526w*2. What is the units digit of u(d)? 8 Let a = 120 - -617. Suppose -2n + 3z + 299 = 0, 5n - a = -10z + 14z. What is the hundreds digit of n? 1 Suppose -5x = 3f - 4f - 18, 3x = -5f - 6. Let q be (x - (-10)/(-4))0. What is the units digit of (-49)/(-2)(2 + q)? 9 Let d = 595 + 2853. What is the tens digit of d? 4 Let x(n) = 2n + 2. Suppose 0 = 10o - 7o. Let r be x(o). Suppose 35 + 15 = rm. What is the units digit of m? 5 Let q(b) = -154b + 16. Let g be q(4). Let f = g + 854. What is the hundreds digit of f? 2 Let c be -3 - (8 - 2)(-6 - -2). Let a = c + -11. What is the units digit of 612/22 + a/55? 8 Suppose 424 = -6j - 410. Let v = j + 436. What is the tens digit of v? 9 Let m be 41 - (2-9)/(-3). Suppose 0 = -mc + 33c + 218. What is the tens digit of c? 0 Suppose 3g = -2c - 1452, -2744 = 5g - 3c - 305. Let r = g - -875. What is the tens digit of r? 8 Suppose -18n + 14n = 2t - 8562, -21393 = -5t - 4n. What is the thousands digit of t? 4 Suppose -483q + 485q - 4y = 88896, -2y = -5q + 222264. What is the thousands digit of q? 4 Let n = 24 + -20. Let k be (-1)/n + (-12)/16. Let g(a) = -9a*3 - 2a*2 - a. What is the units digit of g(k)? 8 Let y = -25 + 41. Let n be (-69)/(4/y-2). Let h = n - 63. What is the tens digit of h? 7 Suppose 8o + 66048 = 114736. What is the thousands digit of o? 6 Suppose 287463 = 129r - 36r. What is the tens digit of r? 9 Let q(m) = -m + 19. Let v be q(12). Let z be 01/3(-7)/v. What is the units digit of 40/(4/6 - (z + 0))? 0 Let c be (9 + 3)/(1/(-4)). Suppose 5g + 400 = -2i, -g - 348 = 3g - 4i. Let x = c - g. What is the units digit of x? 4 Let i = 47 - 36. Let s(k) = 3k + 0k2 - k - 14 + k2. What is the units digit of s(i)? 9 Let a = 136 + -135. Suppose -j = a, 635 = f + 4f + 5j. What is the units digit of f? 8 Let u(n) = 110n*3 - 8n*2 - 10n + 92. What is the hundreds digit of u(4)? 9 Suppose 0 = 3m - 35 + 29. Suppose -g + 1386 = ma + a, 0 = -3g. What is the tens digit of a? 6 Suppose 2s = -c + 6227, -c + 3s + 5132 + 1120 = 0. What is the tens digit of c? 3 Let r = -15381 - -15686. Let o = -39 + 155. Let h = r - o. What is the tens digit of h? 8 Let y = -442 - -442. Suppose 4c + 17t - 4661 = 22t, -4t + 12 = y. What is the tens digit of c? 6 Let x(a) = 16a*2 + 70a - 783. What is the tens digit of x(11)? 2 Suppose -169713 = -23i + 611699 - 168048. What is the ten thousands digit of i? 2 Let a(i) = 1593i - 3618. What is the ten thousands digit of a(13)? 1 Suppose 22 = x + 6. Suppose p - x = -12. Suppose 233 + 382 = pq + y, 5q + y = 769. What is the tens digit of q? 5 Let p be ((-98)/21)/(4/(-18)). Suppose 9 + p = 10h. What is the units digit of (h + -1)51 - -4? 6 What is the thousands digit of (2/(-8))/(59492962/(-1802816) + 33)? 3 Let h be (-40)/(-4) - 0/1. Suppose 2f = 5s - 97, -4f + s - 231 = f. What is the units digit of 84/h - f/(-115)? 8 Let n be (-1068)/33/2 + -5. Let y = n - -785. What is the units digit of y? 6 What is the units digit of ((-13262)/(-19))/(2 + 0)? 9 Let v = 255 - 248. Suppose 24w = vw + 3009. What is the units digit of w? 7 Suppose -6m - 32 = -14m. Suppose -3h + 2c = -mh + 62, 2c = 0. What is the tens digit of h? 6 Let m = 697 - 3501. Let n = -1737 - m. What is the thousands digit of n? 1 Let b = -4636 - -4873. Let h be 147/(0 + -1) - 0. Let x = b + h. What is the tens digit of x? 9 Let r be 1/(-3)1(-6)/1. Suppose 5d = 4z - 1083, 0d = rd - 5z + 423. Let u = d + 391. What is the tens digit of u? 7 Suppose -4y + 9 = 2o - 5o, -y - 4o + 7 = 0. Suppose -13h - 139 = -14h - yt, 4h - 556 = 5t. What is the hundreds digit of h? 1 Let i be (-4 - 1) + 3 - 957. Let q = -680 - i. What is the units digit of q? 9 Suppose -227a + 217a = -872953 + 312683. What is the units digit of a? 7 Suppose -33r - 989856 = -42r. What is the units digit of r/80 - (-4)/20? 5 Let z(v) = v*2 - 15v + 75. Let l be z(23). Suppose -13f + l = 5h - 15f, 5f = 4h - 197. What is the units digit of h? 3 Let a(y) = y3 - 3y*2 + 19y + 21. Let o be (15/10)/(5 + (-97)/20). What is the hundreds digit of a(o)? 9 Let s(u) = -4001u - 307. What is the units digit of s(-4)? 7 Let x(m) = -m3 - 37m*2 + 78m + 21. Let a be x(-39). Suppose 15g - ag + 1416 = 0. What is the hundreds digit of g? 2 Let k(i) = -4i - 1. Let j be k(0). What is the hundreds digit of j/((-1053)/(-527) + -2)? 5 Let s be 1/((((-30)/(-25))/3)/2). Suppose -2q = -3a - a - 1948, q = -sa + 974. What is the units digit of q? 4 Suppose 0 = -10f + 714 + 4606. Let p = f - 292. What is the hundreds digit of p? 2 Suppose 0 = 475z - 412z - 2824857. What is the units digit of z? 9 Let k = -69 + -141. Let x = k - -567. What is the units digit of x? 7 Let s(h) = 2h*3 + 2h*2 - 2h - 6. Let d be s(-2). What is the hundreds digit of d/(-5) + 516/2? 2 Suppose -3w = -4v + 15, -w = -v - 2 + 6. What is the tens digit of w(-1663)/22? 6 Let l = 74 + 326. Suppose -2h - l = -1232. What is the tens digit of h? 1 Suppose -1564313 - 351062 = -55x. What is the ten thousands digit of x? 3 Let m = -55537 + 130764. What is the ten thousands digit of m? 7 Let z = -888 - -7695. What is the units digit of z? 7 Suppose -3u = -6659 - 3904. Suppose -u + 26 = -5o. What is the hundreds digit of o? 6 Let u = 143 + -139. Suppose -un + 5x + 6296 = 0, 8x - 7849 = -5n + 9x. What is the tens digit of n? 6 Suppose 316v - 2v - 13299784 = 0. What is the hundreds digit of v? 3 What is the hundreds digit of (93 - 94)(-14044 - -2)/2 + -3? 0 What is the tens digit of (8/5)/((-34)/170) + 6463? 5 Suppose 222 = 19i - 1545. Let z = i - -168. What is the units digit of z? 1 What is the units digit of 571488(-106)/(-424)? 2 Let k = 387 + -236. Suppose -2i + k = -3a, -336 = -3i + a - 113. What is the units digit of i? 4 Let i = -176 - -175. What is the hundreds digit of 2678/13(i3)/(-3)? 2 Let m be ((-68)/(-4))/((-1)/(-75)). Suppose -4a = 2r - 850, m = 3r - 2a + 7a. What is the tens digit of r? 2 Let g be 6 - ((-24500)/42)/((-2)/(-12)). Suppose -17540 = -17b + g. What is the tens digit of b? 3 Let u(d) be the third derivative of d6/60 + d5/20 + 7d4/24 - 25d*3/6 - 28d*2. What is the units digit of u(5)? 5 Let t be (-336)/54 - 9/(486/(-12)). Let z(s) = 25s*2 + 5s - 13. What is the hundreds digit of z(t)? 8 Let i be ((-156)/(-130))/(2/710). Suppose 348 = -c + i. What is the units digit of c? 8 Let c be 1 - (1 + 3 + -3)/1. Suppose 5b - 600 - 395 = c. Let n = 31 + b. What is the units digit of n? 0 Let m = 19710 + -12076. What is the tens digit of m? 3 Suppose -3d + 6d = 483. Let l = 512 - d. Suppose 4q + s - l = 0, -q + 2s = q - 168. What is the tens digit of q? 8 Let x(q) = -q3 + 6q*2 - 2q + 10. Let b be x(6). Let a be 6 - 6(-1)/b. What is the units digit of 6/33 + 218/33a? 0 Let f = 85874 - 37489. What is the tens digit of f? 8 Let n = 10802 + -4856. What is the thousands digit of n? 5 What is the hundreds digit of -1 + -2 + 19449 - (0 - 18 - -19)? 4 Suppose 3u - 5x = 3545, u + 21x = 26x + 1195. What is the units digit of u? 5 Let q(p) = -p*2 - 14p + 43. Let x be q(-17). What is the tens digit of 10/6 - ((-114160)/(-15))/x? 5 Let s(c) = 664c - 242. Let f be s(6). Suppose -3744o = -fo - 3076. What is the tens digit of o? 3 Let b be (-2 + 0)(-4 + 1). Let z be 50/15 + 4/b. Suppose zg - c - 408 = -g, -5g + 417 = -4c. What is the tens digit of g? 8 Let f be (70/15 + 1)/(1/111). Suppose 5q = 2s - 719, f = 3s + 5q - 512. Let v = s + -87. What is the tens digit of v? 8 Let g(i) = -1. Let o(t) be the first derivative of 5t*2 - 26t + 18. Let v(f) = -18g(f) + 2o(f). What is the units digit of v(8)? 6 Suppose -3*s -	{ "pile_set_name": "DM Mathematics" }
to 0.493? (a) -17 (b) 3 (c) -0.3 c Which is the closest to -0.1? (a) 12.1 (b) 2/5 (c) 3 (d) -0.8 (e) -0.3 e Which is the closest to -182? (a) -1 (b) 0.4 (c) -0.2 (d) 2 (e) 1/9 a Which is the closest to 6/7? (a) -2/177 (b) -0.5 (c) -2/5 (d) 34 a What is the nearest to -0.1 in -23026, 0.1, -1/8? -1/8 What is the nearest to 2/57 in 0.5, -4/5, -2/133? -2/133 What is the closest to -0.3 in -33, -8, -17, -4? -4 What is the closest to 4/25 in 1/1595, -1, -5, 5, -4? 1/1595 Which is the closest to 1/2? (a) 0.5 (b) -113/16 (c) -2/11 a Which is the nearest to 1? (a) 51 (b) -14/9 (c) 1 (d) 3/4 c What is the nearest to 26 in 0.41, -1/7, 0.5, 2/7? 0.5 Which is the nearest to 0.1? (a) -13 (b) -3469 (c) 0.1 c Which is the closest to -5? (a) 3/4 (b) -2.9 (c) 2/125 (d) 4 (e) -4 e What is the nearest to -2/213 in 1/5, 6, 0.1, 2? 0.1 Which is the nearest to -1/2? (a) -7 (b) -1.2 (c) 152 (d) 1/3 b What is the nearest to -1/5 in -0.02, -1, 17, 0.2? -0.02 Which is the nearest to 2? (a) -44 (b) 1/3 (c) -0.4 (d) -121 b What is the closest to 125 in -1, 2, 1, 0.1? 2 Which is the closest to -2/3? (a) 0.4 (b) 3 (c) 4/5521 c What is the nearest to 1/2 in 193, -2/7, 0.8, 90? 0.8 Which is the nearest to -1? (a) -3 (b) -3/8 (c) 179169 (d) 2 b Which is the closest to -1? (a) -1/2 (b) 67 (c) -2/15 a Which is the nearest to -2/7? (a) -44 (b) 3 (c) -3 (d) -2/25 (e) -8 d Which is the closest to 0.1? (a) 0.09 (b) 0 (c) 8 a What is the closest to 0.3 in 2/5, 2/29, 0.11, -5, 0.5? 2/5 What is the closest to 1 in -2, 11.74, 2/3, -4, -0.4? 2/3 What is the nearest to 15 in -2, 0, 57? 0 What is the closest to -0.1 in -649, -3, 29, 0.3? 0.3 What is the nearest to 13 in -3, -0.4, 20, 19, -0.5? 19 What is the closest to 3 in 15/11, -170, -0.5? 15/11 Which is the closest to -67? (a) -1 (b) -4/7 (c) 3 (d) 2 a What is the closest to 0 in -3/7, 117, 2/9, -244, -1/2? 2/9 Which is the closest to 1? (a) 18 (b) 4 (c) 22 (d) -31 (e) 3 e What is the closest to 2 in 2, 0.5, -1/4, 0.0036, 0.1? 2 Which is the closest to 0.1? (a) 1 (b) 1/2932 (c) -52 b Which is the closest to 0.14? (a) -3 (b) -1/5 (c) 119 b Which is the nearest to -23? (a) 3 (b) 4 (c) 218 a What is the nearest to -3 in -1, 5, 33, 10, -4? -4 What is the nearest to -7 in -7, -156, 10, 1/2, -2/7? -7 What is the closest to -1/4 in -1/9, -3/8, 0.4, -0.113, 0.7? -3/8 Which is the closest to 1/5? (a) -3/10 (b) 4 (c) -79 (d) 3/5 d Which is the nearest to 2/3? (a) -1/4 (b) -0.12 (c) -0.0621 c What is the nearest to 1/3 in 0.089, -0.4, -4, 3? 0.089 What is the nearest to 23 in -2/5, 314, 0.3, -0.5, 0.5? 0.5 Which is the nearest to 2? (a) -1 (b) -1/74 (c) -51 (d) 4 (e) -1/9 d Which is the nearest to -1/27? (a) -26 (b) -2 (c) 0.4 (d) -3/7 d Which is the nearest to 13? (a) 21 (b) -184/11 (c) -1 a Which is the closest to -2730? (a) -5 (b) -2 (c) 3 a Which is the nearest to -1? (a) 7 (b) -48 (c) 42 a Which is the closest to -2/7? (a) 69/2 (b) 4 (c) 0 (d) -1/7 (e) -0.4 e Which is the nearest to -2/7? (a) -2/3 (b) 44/9 (c) -0.192 (d) -1 c Which is the closest to -1? (a) 0.3 (b) 4 (c) 3 (d) -484 a Which is the closest to 28? (a) -0.03 (b) -2/7 (c) 0.03 c What is the nearest to -0.2 in 0.1, -30, -299/4? 0.1 Which is the closest to 2/5? (a) 16 (b) 0 (c) 3 b Which is the nearest to 0.3636? (a) -3/7 (b) 0 (c) 1/12 (d) 2/3 c What is the closest to 7/3 in -2, 3, 1/10, -0.6? 3 What is the closest to -5.8 in -0.7, 13.6, 0.2? -0.7 Which is the closest to 1/3? (a) 8 (b) -1/219 (c) -0.47 b What is the nearest to 0 in -1/8, -5/4, 0, 1.86, 0.14? 0 Which is the nearest to 0.35? (a) -8 (b) -3 (c) 5 (d) 22 b Which is the closest to -6? (a) 3 (b) -0.2028 (c) 0 (d) 21 b Which is the closest to 0.051? (a) -0.7 (b) 5 (c) 3/2 a What is the closest to -1 in -4, -2/5, -9802, 0.2? -2/5 Which is the closest to 2? (a) 83 (b) -2 (c) 39 b Which is the nearest to 1/8? (a) -10 (b) 3/41 (c) -2/9 b What is the closest to 6 in 19, -1/2, -12, -1? -1/2 Which is the closest to 1.64? (a) -5 (b) 0 (c) 2 (d) -0.1 c What is the closest to 2/7 in -1, 0, 2, -96, 1.7? 0 What is the nearest to -2 in 0.03, -46, 53, -5, -2? -2 What is the nearest to -2/211 in 11, 0, 9? 0 Which is the nearest to -1/17? (a) 2 (b) -5 (c) 107 (d) 0.5 d Which is the closest to 16? (a) -2/3 (b) -4 (c) -161 (d) 11 d Which is the nearest to 1/5? (a) -1/43 (b) 5 (c) -2/11 (d) 2/3 (e) 0.5 a Which is the nearest to -4295? (a) 2/11 (b) -0.1 (c) -2/7 (d) 0.1 c Which is the nearest to 1/13? (a) 1.3 (b) -4 (c) 1 (d) -33 (e) 2 c Which is the nearest to 0.3? (a) 2/11 (b) 0.09 (c) -0.2 (d) 1143 a What is the nearest to -0.1 in -2/11, -2/9, 0.3, -72? -2/11 What is the nearest to 39835 in -3, -0.1, 4? 4 What is the closest to 0.4 in 0.055, 1, -1? 0.055 Which is the nearest to -0.3? (a) 2/5 (b) -11/24 (c) -1/12 b What is the closest to 13.3 in 5, 4, 0.3, -1, -4? 5 What is the nearest to 0.1 in 1, -2, -4, -4665? 1 What is the closest to 8 in 4, 2, -0.01, 1/2, -0.02? 4 Which is the nearest to 0.1? (a) 4 (b) 0 (c) 15 (d) 2 b What is the nearest to 2/7 in 68, -2/13, 0, 375? 0 Which is the nearest to 1? (a) -8 (b) -1 (c) 2/5 (d) -74 (e) 10/7 e Which is the nearest to -21? (a) 168 (b) -0.03 (c) 1/7 b What is the closest to -0.1 in -3, -3/10, 0.08, -1/2, -1? 0.08 Which is the nearest to 1? (a) 2 (b) -9 (c) -2062 (d) 0.4 (e) 1/2 e Which is the nearest to 1? (a) 1/3 (b) 136/411 (c) -4 a Which is the closest to 3? (a) -0.4 (b) -5 (c) -0.2 (d) -32 c What is the closest to 837 in -0.24, 0, -4? 0 Which is the closest to 403? (a) 1/5 (b) 1 (c) 4/5 (d) 0 (e) 14 e Which is the closest to 216? (a) -0.03 (b) -2/29 (c) 19 c What is the closest to 538/5 in 3, -5/4, -0.48, -4/3? 3 What is the nearest to 0 in -1, 2/559, -0.12, -1/8, -0.5? 2/559 What is the nearest to 0.025 in -21, 2/15, -3, -1/3, 1/7? 2/15 Which is the nearest to 15? (a) 2 (b) 1 (c) 129.5 a Which is the closest to 62? (a) -127 (b) -3 (c) -8/7 c Which is the nearest to -2? (a) 32 (b) 3 (c) 0 (d) 4 (e) -6 c Which is the nearest to -0.3? (a) -5 (b) -441 (c) 2/11 (d) 0.31 c What is the closest to 9 in -48, 2/5, -0.1, 0.017? 2/5 Which is the nearest to -2? (a) 72 (b) 3 (c) -27/20 (d) -1/4 c What is the closest to -4 in 5, -2, 4, 3? -2 What is the nearest to 0.2 in -810, 0, 1? 0 What is the nearest to -72 in 0.05, -0.6, -5, 2/11? -5 What is the closest to 4 in -0.4, -2, -0.10752? -0.10752 Which is the nearest to -2? (a) -0.7 (b) -1 (c) -29 (d) 1/2 b Which is the closest to -46? (a) 75/2 (b) -0.1 (c) -3 c What is the closest to 8 in -1/4, 0, 0.1, -3, 23.3? 0.1 What is the nearest to -1 in 5/2, 3, -7, -2/157, -0.1? -0.1 What is the nearest to 2/5 in 972, 4, 4/5, 0.003, 5? 0.003 Which is the closest to 0? (a) -1868 (b) 0.4 (c) -1 (d) 0.09 d Which is the closest to 284? (a) 3 (b) 1/6 (c) -0.1 (d) -3 (e) 0.13 a What is the closest to -1/3 in 2/23, -1/3, 151, -1.3? -1/3 What is the closest to 0 in -2/13, 4, -21, -5/2? -2/13 What is the closest to 0.1 in 2, 0.5, -306.796? 0.5 Which is the nearest to -1? (a) 0.1 (b) -5 (c) 4 (d) -0.0148 (e) 27 d Which is the closest to 2? (a) -1868 (b) -0.5 (c) -2/75 c Which is the nearest to -4/5? (a) 5 (b) 0 (c) 87 (d) 3 b What is the closest to 2/5 in 1.3, 1/7, 0.4, -208? 0.4 What is the closest to -4/7 in -0.4, -2, 0.1, 8, -416? -0.4 What is the nearest to -12 in -3/7, 3, 16850? -3/7 Which is the closest to 285? (a) 3 (b) -10 (c) 2 (d) -0.3 a Which is the nearest to 1/14? (a) 1 (b) -237 (c) -2 (d) 0 (e) 11 d What is the nearest to 0.4 in 0.3, 0.277, -359? 0.3 Which is the closest to 0.05? (a) 10 (b) 0.5 (c) -4 (d) -1/8 d Which is the closest to -2? (a) -5/4 (b) -599 (c) 2 (d) 2/15 (e) -0.4 a What is the nearest to -1/2 in -3/7, -1, 0.6, 6/5? -3/7 What is the nearest to -2/33 in -2.1, 1/9, -0.4, 1? 1/9 What is the closest to 0 in -4, 2, 224, 4/9, 2/7? 2/7 What is the nearest to 1768 in 43, 5/4, 2/9? 43 Which is the nearest to -2/3? (a) 2/137 (b) 1.11 (c) 93 a Which is the nearest to 1? (a) 2/23 (b) 439/7 (c) -1 a Which is the nearest to -2/11? (a) 1/4 (b) -2/5 (c) 2/11 (d) -0.2 d What i	{ "pile_set_name": "DM Mathematics" }
x + 108s - 112s + 16, 7s - 44 = x for x. -2 Solve 3c + 6 = 0, 256 - 281 = 5a + 5c for a. -3 Solve a + 47p - 50p = -52, -2p + 40 = 2a for a. 2 Solve 4m + 9c - 89 = 0, -27c + 22c = -45 for m. 2 Solve -a + 14 = -3h, 3a + 2122 = 2h + 2143 for a. 5 Solve 4s + 0s - 4d = -20, 3s = -3d + 9 for s. -1 Solve -2h = 3o + 7 + 49, 4o = -h - 68 for h. -4 Solve 24 = -8n + 12n, -10 = -7f - 4n for f. -2 Solve 3n - 210 + 206 = -2l, -5n - l = 5 for n. -2 Solve 19 = 13b - 8b + 4d, 32 = 5b + 17d for b. 3 Solve -3h - 3d = 3, 159h + 2d + 4 = 156h for h. -2 Solve 3c - 135w = -133w + 1, 15w = -4c + 19 for c. 1 Solve 2l + 3y = 25, 2l - 10852 = 5y - 10867 for l. 5 Solve 12m - 26 = 2b + 17m, -b = 4m + 19 for b. -3 Solve -28 = 4c + r, 0 = 8c - 6c + 23r + 284 for c. -4 Solve j - 4g + 2335 = 2338, -4j + 2g = -12 for j. 3 Solve 0 = 3c - b - 8, -889b + 886b - 12 = -3c for c. 2 Solve 4l = 3g + 35, -4l - 60g = -59g - 15 for l. 5 Solve -15 = -3b + 12o - 11o, -3b + 24 = -4o for b. 4 Solve -2g = 4f, -5g - 12 = 58f - 111f + 57f for f. 2 Solve 2h - 54o - 30 = -49o, 5o = -20 for h. 5 Solve 0 = 4k - 8, -8d + 146 = 4k - 8 + 34 for d. 14 Solve -5067p + 5064p = -3y + 9, -4y + 12 = 5p for p. 0 Solve 3p - 24 = -5h, 313p = 309p - 5h + 22 for p. -2 Solve 142 = b - 2j + 145, 5b - 4j = 9 for b. 5 Solve -3o = -4s - 39, -o - 2s - 31 = -14 for o. 1 Solve -13a - b = -10a, 4a - 5b = 2a for a. 0 Solve -821f + 822f + 3d = 32, f - 7 = 2d for f. 17 Solve -7t - 223 = -216, 0 = 4c - 4t - 28 for c. 6 Solve -2m - 5u + 44 = 0, -1226 + 1246 = m + 2u for m. 12 Solve -5g = -178l + 175l + 22, g = -2l - 7 for l. -1 Solve 0 = -294x + 298x - 12, -2x = 4c - 22 for c. 4 Solve -3t = -4c - 33, 94 - 68 = t - 3c for t. -1 Solve 3x - 3d = 0, -10d - 4 = 3x - 14d for x. 4 Solve 3q - 10 - 8 = -33, 8z = -5q - 9 for z. 2 Solve -3h = -h + 2, 5i - 62 = 2h for i. 12 Solve -3b - u - 12 = 0, -u + 13 = -550b + 548b for b. -5 Solve 4w + s = 12 - 23, -2w = -10s - 26 for w. -2 Solve -3r - 17 = -2d, 0 = r + 2d + 214 - 211 for r. -5 Solve 5 = 2x - d, 3 = -7x + 4d + 21 for x. 2 Solve 3i + 3f = -618 + 624, -2i - f = -1 for i. -1 Solve 0 = 2h + 5s - 39, 11840s - 11843s - 47 = -2h for h. 22 Solve 141 = -2f - 4j + 153, 4f - 42 = -2j for f. 12 Solve -4g - 10 = -2a, 0 = 31a - 30a + 3g + 20 for a. -5 Solve x - 43 = 5d, -5d + 0x - 37 = -4x for d. -9 Solve -3s - 36 = -3y, 5y - 95 = 137s - 139s for y. 17 Solve -f + 4y = 17, 5f + 71 = 5y + 46 for f. -1 Solve 5p = -3w + 19, -4w = -5p + 252 - 254 for w. 3 Solve -2a = 2b, -27a = -13a - 15a + 3b + 16 for a. 4 Solve -t + 14 = -6s + 24, -4t - 2s = -12 for t. 2 Solve 3t = p + 26, -t + 109p = 110p - 6 for t. 8 Solve 3m - 2a - 2 = 0, 160a = -7m + 164a + 2 for m. -2 Solve 0 = -3x + 242n - 237n - 88, 0 = 3x + 3n - 48 for x. -1 Solve -3n + 25 = -4k - 14, 6k + 36 = 2n for k. -3 Solve 3310x - 3313x - 3 = 0, 0 = -p - 5x + 2 for p. 7 Solve 16o - 18o - 3t = 23, 4t = -28 for o. -1 Solve -5q + 3l + 34 = 0, 17q - l + 8l + 62 = 20q for q. 2 Solve -n = 2s - 1, -29s = -34s - 11n + 11 for s. 0 Solve -1207 + 1225 = 4y - 2q, -3y = 4q - 19 for y. 5 Solve 2b - 2v = 0, 2v = 5b - 121179 + 121191 for b. -4 Solve -p + 3q - 32 = 0, -4p + 2q + 2485 = 2523 for p. -5 Solve 5b = -3s + 25, 5b + 93s - 95s = 0 for b. 2 Solve 74b - 78b - 7 - 1 = 0, -20 = 4y + 2b for y. -4 Solve 2h - 3 = r, 163r - 164r = 6h - 13 for h. 2 Solve -4s + 3g + 26 = 0, -4s + 71 - 47 = -2g for s. 5 Solve 37 = 4o + 5l, 998o - 2l - 46 = 992o for o. 8 Solve -2f = 4b + 19 - 25, -f + 3 = -3b for b. 0 Solve -67p - 3y = -61p - 6, -p - 2y = -7 for p. -1 Solve -5i - 2727 + 2742 = -5b, -3b - 1 = 5i for i. 1 Solve 0 = 2q + 6, -843b = -844b + 5q + 11 for b. -4 Solve 61 - 31 = -5q - 3f, -2f = -4q - 2 for q. -3 Solve 5x + 3z = -131 + 116, 4x = -5z + 1 for x. -6 Solve -5a - 517 + 510 = 3q, 12 = 2q - 5a for q. 1 Solve -107m - 122 = 4g - 209, 3g = -3m - 12 for g. -5 Solve -12 = 3h + 3i, -12 = -192h + 196h + 3i for h. 0 Solve 10a - 4 = -47g + 51g, 3g + 4a = 20 for g. 4 Solve -3i - l + 138 = -2l + 130, 4i + 5l - 17 = 0 for i. 3 Solve -5531r = -5533r + 5b - 10, 6r = 3b - 30 for r. -5 Solve -2c - 9877h + 9867h = 34, 0 = 3c + h - 5 for c. 3 Solve 40i + 12 = 35i - x, 0 = 4i + 3x + 25 for i. -1 Solve 0 = -4f - 5q - 33, -5f + 56 = q + 71 for f. -2 Solve -4t = -f - 35, -4f - 2t = 16 - 38 for f. 1 Solve 5z - 201 + 203 = -y, -15 = 3z - 4y for z. -1 Solve 7 = 4w - v, -4v = 114w - 116w for w. 2 Solve 0 = b - k + 614 - 615, -35 = 5b + 3k for b. -4 Solve 9z = 0, -2l = z - 17 + 7 for l. 5 Solve 3f = -3, 0 = -3827b + 3826b - 5f for b. 5 Solve -3k - 8g + 3g + 40 = 0, 20 = -k + 5g for k. 5 Solve 0 = -5c - 16n + 17, 0 = -1324c + 1320c + 4n - 20 for c. -3 Solve -4m = p + 20, 12 = 2m + 101p - 106p for m. -4 Solve 0 = 5u - 5, 3u - 158 = -5y - 110 for y. 9 Solve 2i = 5m - 27, 2m - 14i = -12i + 6 for m. 7 Solve 5p = -4x - 7, 0 = 2p + 8 - 10 for x. -3 Solve -j - 28u = j - 25u, 0 = -j - 16u - 29 for j. 3 Solve -4a - 8 = -6083g + 6079g, -2g = 4a - 22 for g. 5 Solve 20j - 22j + 2y = -12, 5y = -3j - 6 for j. 3 Solve 6f + 1 = -3p + 4, -26p + 2f - 31 = -21p for p. -5 Solve 0 = 645n - 642n - 15, -4f - 5n = -25 for f. 0 Solve -2d = -697a + 699a - 4, -2a + 24 = 7d for d. 4 Solve -129 = -l + 6t - 128, 5 = 5l + t for l. 1 Solve -5n + 16 - 29 = -f, 0 = 5f + n + 65 for f. -12 Solve 5c = -3w + 27, 159c = 163c + 3w - 24 for c. 3 Solve 3u + 74 = -12n + 122, 0 = n - 3 - 1 for u. 0 Solve 30p - 35p + 3k + 11 = 0, -3k = p + 5 for p. 1 Solve 3o + 36 - 55 = n, -21 = -n - 5o for n. -4 Solve -2p + 7589 = -5f + 7567, 4f + 44 = 4p for f. 0 Solve 3x + 496 = x + 5v + 487, 12x + 10v = -14 for x. -2 Solve 2h - 1286g = -1288g - 16, h + 10 = g for h. -9 Solve 3o = -5f - 24, -4o + 197f - 194f - 3 = 0 for o. -3 Solve -4x = -5v + x - 10, -2v - 6x = -20 for v. 1 Solve -181p + 182p = -5z + 29, -z + 3p = 7 for z. 5 Solve 0 = 2v - 3u + 5, -v - u = -6u - 1 for v. -4 Solve 0 = 129y - 126y - n - 5, -5n - 11 = -y for y. 1 Solve 0 = 4u - 2q + 6, 7u - 3q = -7q + 27 for u. 1 Solve 2r = l + 233 - 228, -13 = -r + 4l for r. 1 Solve 15h + 5r = 15, -2h = 217r - 212r - 2 for h. 1 Solve -3z + 14 = w, -3z + 10w = 15w - 34 for z. 3 Solve c + 16 = -1768y + 1766y, 3c - 3y + 3 = 0 for c. -6 Solve -122m + 118m = -p - 24, 0 = -3p + 5m - 37 for p. -4 Solve 0 = -a + 3d + 39, -a = 538d - 535d + 33 for a. 3 Solve -l + 21k - 111 + 11 = 0, -l + 10 = k for l. 5 Solve -h = 2h - h + 4, -2z - 18h - 2 = -16h for z. 1 Solve -2s + 38 = 4j, 5s + 3j = -4494 + 4533 for s. 3 Solve -3o + 42b = -o + 88, -10b + 10 = -4o - 9b for o. -2 Solve 60f = 63f + 3q + 18, 2f - 4q - 6 = 0 for f. -3 Solve 3d - 723 + 763 = -5u, 4u + d + 32 = 0 for u. -8 Solve 5d - 5i = 0, 282d + 1 = 279d - 5i + 1 for d. 0 Solve 2b = 5t, 14t - 11b + 27 = 19t - 38 for t. 2 Solve 0 = -5c - 2p + 31, 46p = -8c + 50p + 28 for c. 5 Solve 3k + 144f + 37 = 149f, 18 = -2k + 2f for k. -4 Solve 4n + 2x - 20 = 0, -31n = -29n + 3x - 14 for n. 4 Solve -k = -5l + 24, -63l = -2k - 59l - 24 for k. -4 Solve m + 23 = -9p, -2453 = -4p + 5m - 2485 for p. -3 Solve 5n = 91v - 92v + 17, 4n = 12 for v. 2 Solve 0 = -5v - 3b + 23, 0 = -162v + 165v - 4b - 8 for v. 4 Solve -547a + 38 = -2j - 549a, -32 = -2j + 3a for j. -5 Solve -5h + 4v + 0v = 50, 0 = -6h + v - 41 for h. -6 Solve -4c + 116 = -125896v + 125891v, -c = 2v - 16 for c. 24 Solve -5w - u + 33 = 0, 4w = 3w + 2u + 11 for w. 7 Solve -4p + 1413 - 1385 = -j, 4j = 3p - 47 for p. 5 Solve -3r + 2 = 2z, -r - 11z - 18 = -15z for r. -2 Solve -3j + 128a - 20 = 123a, 0 = -a - 2a + 3 for j. -5 Solve -26d + 32d = v + 31, -4v + 11 = 3d for d. 5 Solve -3j = -c - 16, 5c + 80 = 4459j - 4455j for c. -16 Solve 5 = t + 4d + 18, -9d - 15 = -4d for t. -1 Solve 3k + 21 = 2d, 217k = 3d + 212k - 34 for d. 3 Solve t = -3f + 4, -5f = 165*t - 328	{ "pile_set_name": "DM Mathematics" }
83? 1704 What is 0.2977 less than 0.06? -0.2377 Work out -4 - -0.7. -3.3 Sum -41.015 and 0.2. -40.815 What is -3 - 1020? -1023 0.4+500 500.4 Add -96 and -55.8. -151.8 -3.6 - -0.352 -3.248 What is -836645 minus 4? -836649 Subtract 27 from 0.04. -26.96 What is the difference between 8 and -2373? 2381 What is the difference between -0.1 and -510? 509.9 What is 0.9 take away -1233? 1233.9 Total of -0.02 and -119. -119.02 Add -263.04 and 1. -262.04 -1+2.676 1.676 What is 38.346 less than 0.3? -38.046 Add 114 and -1.56. 112.44 What is 1.36 less than 1? -0.36 Add together 11 and -982. -971 Sum -3656 and 0.5. -3655.5 -4.6676+0 -4.6676 Put together -20 and -13. -33 What is 1 + -188.4? -187.4 -4 + 259 255 Add together -889 and -1.05. -890.05 Add 90.4 and -0.0103. 90.3897 Work out -0.1 + -1280. -1280.1 Add -22.4 and 28. 5.6 Work out -48.63 - 0.1048. -48.7348 What is 3.55696 take away 10? -6.44304 What is -11.707 take away -0.18? -11.527 What is -54 minus 471? -525 Put together -2161 and 0.0543. -2160.9457 What is 2759 take away -0.7? 2759.7 -0.2 + -1104 -1104.2 Calculate 0.98 - -37. 37.98 Add together -0.513993 and -0.2. -0.713993 0.3+9581 9581.3 Subtract 0.4 from -4201635. -4201635.4 Total of 44 and 0. 44 What is -2.8 minus 598210? -598212.8 Calculate -2 - 8257. -8259 Work out -19 + 2323. 2304 Calculate 0 - -36965. 36965 What is 0.5 + -2970730? -2970729.5 754695+-4 754691 What is 5.944 + 307? 312.944 Work out 0 - 29. -29 What is -0.051 + -2? -2.051 Put together -267840 and -5. -267845 What is -3.639 + -4.27? -7.909 What is -1032 plus 82? -950 Calculate 0.2 - 106615. -106614.8 2574.7 + -3 2571.7 Add together -1 and -3539.48. -3540.48 Add together -122.049 and 6. -116.049 Calculate -3 - -875. 872 Work out 1 + 283. 284 2023 + 1 2024 What is 2.1 minus -185.686? 187.786 Subtract 0.4 from -4598. -4598.4 Calculate -1 + -1.78. -2.78 Add together 1779 and -3. 1776 Calculate 49 + -23729. -23680 Subtract 515327 from -5. -515332 -1799+30 -1769 Total of 378 and 0. 378 Work out -165 - 1000. -1165 Calculate 7248 - -2. 7250 -25 - -41679 41654 Total of -1.15 and 27.8. 26.65 Calculate -0.34 + 21. 20.66 What is the difference between -33 and -33? 0 Put together -0.077721 and -0.046. -0.123721 Work out 14.18 - -8. 22.18 Work out -0.100694 + -129. -129.100694 Work out -0.3 + 2539418. 2539417.7 What is -218.827 - 0.5? -219.327 What is -0.0347 plus -0.32? -0.3547 Put together -2 and 105.464. 103.464 Sum 4571 and -16. 4555 What is the distance between 0.7 and -12729? 12729.7 Calculate 0 - 31719. -31719 Put together 740.72 and -15.7. 725.02 What is the distance between 0.071 and -20863? 20863.071 0.99 + -0.116 0.874 Add -2267 and -0.01. -2267.01 What is -518 take away -0.3348? -517.6652 -1.6+1991 1989.4 Sum 150 and -0.43. 149.57 Total of 13834 and -41. 13793 -4+-9 -13 Work out 15710 - 0.4. 15709.6 0.3+28.6042 28.9042 What is 4 less than -0.48? -4.48 What is -14 + -3027? -3041 35048 - 1.5 35046.5 What is -152 - -1? -151 -0.41 - 7 -7.41 What is the difference between 65962 and -4? 65966 Work out -2346 + -0.5. -2346.5 What is -655 minus 1359? -2014 What is 0.3 minus 7536.7? -7536.4 Calculate 1 - -0.141691. 1.141691 What is 32.446 take away 4? 28.446 Add 2342393 and 2. 2342395 What is the difference between 12 and -18.0633? 30.0633 Total of -471.69 and -10. -481.69 What is 43 - 590? -547 17995 + 76 18071 Calculate 112 - 34.9. 77.1 -0.54+-0.421 -0.961 -86.57+622 535.43 What is -0.101 - 284? -284.101 Total of -0.5 and -5742. -5742.5 Work out 3 + -254463. -254460 What is -1061.3 less than -183? 878.3 1.2 + -323 -321.8 Total of -7724 and -0.4. -7724.4 Add 4 and -2055. -2051 Subtract 42769 from 0. -42769 Work out 3 + 0.0481. 3.0481 What is 25 less than 4.6? -20.4 What is -1728 - -0.4? -1727.6 Put together -61.7 and 42. -19.7 What is -0.7 - 0.112? -0.812 Add -1.83235 and -5. -6.83235 What is 4.5 less than -575? -579.5 -1772 - 101 -1873 What is -440 take away 67.6? -507.6 What is 0.3 take away 940022? -940021.7 What is 4 + -2863.575? -2859.575 What is the difference between -69.8 and 13? 82.8 What is -32839 less than 0.16? 32839.16 Add together 46 and 349264. 349310 15277+-21 15256 What is 84 less than -0.2? -84.2 Subtract 10931 from -0.4. -10931.4 What is 0.39 - -0.1066? 0.4966 What is the difference between -66.4 and -3.01? 63.39 Add together 428775 and -0.5. 428774.5 What is 0.2 plus -732031? -732030.8 What is 0.038807 - -1.3? 1.338807 What is the difference between 0.04 and 1892? 1891.96 What is 343 take away -0.045? 343.045 What is 0.8 less than 6.06? 5.26 4+5.179 9.179 What is -0.2 take away 1555359? -1555359.2 What is 137822 take away 1.4? 137820.6 What is 11 take away 867? -856 What is 0.1192 - 133.5? -133.3808 What is 0.01 minus -655? 655.01 What is -1 minus 35556? -35557 Total of 6 and -61696. -61690 Work out 0.266 - -7.24. 7.506 Add 0.2 and 1329576. 1329576.2 What is 119039 less than -8? -119047 Add -1.4 and 1531. 1529.6 Put together 6892 and -75. 6817 Calculate -863 + -0.07. -863.07 What is the difference between 8.69 and -241? 249.69 -48 - -2.06 -45.94 -9046+-0.109 -9046.109 What is the distance between -4 and -870? 866 Put together 1 and 0.0961. 1.0961 What is the difference between 8 and -34658? 34666 -0.09 - 2.4727 -2.5627 Put together 21.871 and -0.07. 21.801 62 + 5366 5428 Subtract -0.2 from -58823. -58822.8 Subtract -289 from 0.153. 289.153 Add together 0 and -602. -602 What is 0.04 - 972.04? -972 Add 0.3 and -12728. -12727.7 Calculate 0.08 + 48. 48.08 -0.069898+7 6.930102 Add together 2.3 and -91.2. -88.9 0.4 + -0.206 0.194 Subtract 0.017041 from -8. -8.017041 What is -1.73967 minus 1? -2.73967 What is 3 minus -1710? 1713 What is the difference between 4 and -98678? 98682 Total of -4 and -0.53. -4.53 Calculate -46 - 4.6. -50.6 Work out -20.969 + -5. -25.969 1250013 + -1 1250012 0.0483+0.2 0.2483 What is 689 + 453? 1142 Subtract 0.2368 from -0.8. -1.0368 Put together 0.04 and 85724. 85724.04 Calculate -21 - -13.15. -7.85 What is 2 - 212933? -212931 Work out -1.8 + -0.0001. -1.8001 27.8 - 48 -20.2 Add together 48 and -64. -16 What is 71 minus -0.6? 71.6 Work out -134 - 27. -161 What is -7 - 9.4285? -16.4285 Put together 0.4 and 408024. 408024.4 Put together 87872 and 0.18. 87872.18 Calculate -0.0428 + -343. -343.0428 Sum 0.1 and 3944. 3944.1 What is the difference between -0.4 and -0.063705? 0.336295 0.1+-2.29 -2.19 Put together -19.9367 and -0.01. -19.9467 Sum -98 and -1577.1. -1675.1 What is -0.8988 + -0.2? -1.0988 0.0222+-15 -14.9778 What is 160897 + 2? 160899 Calculate 1.48063 - 5. -3.51937 722+-2.4 719.6 What is -57.7 less than 1? 58.7 Add together -300 and 16.3. -283.7 Sum -0.4 and 164073. 164072.6 What is -6804 - 445? -7249 Calculate -28 + -808. -836 What is -0.05 - -0.086727? 0.036727 What is 0.6 - 16367? -16366.4 What is 0.04568356 + 0.4? 0.44568356 Work out 35 - 30. 5 -12.7 + 831 818.3 23242+5 23247 Total of -0.38754 and 0.131. -0.25654 What is 11223 take away 131? 11092 0.0591+-19.19 -19.1309 Total of 0.1 and -0.158. -0.058 What is 161 take away 2082? -1921 What is 0 plus -4.6022? -4.6022 What is -0.1163 less than -0.2? -0.0837 What is the distance between 0.03 and -243? 243.03 What is 28.6 take away -0.043? 28.643 What is 286 + -19515? -19229 What is -546 minus -0.8? -545.2 Calculate -8.487 + 0.2. -8.287 Put together -368.52 and -0.5. -369.02 What is 0.41 take away -5995? 5995.41 Add -2 and 27667. 27665 What is -3.7 + -42.9? -46.6 What is 13 less than 1552? 1539 What is 0.05 less than -1402? -1402.05 What is 13.1 less than -0.2701? -13.3701 Work out -0.022 - -7.5. 7.478 Subtract 72 from 0.2. -71.8 What is -3.2 - 0.02? -3.22 What is the difference between 3417 and 0.0227? 3416.9773 Calculate -2242 - 4. -2246 -0.46+-1772 -1772.46 What is 10 - -0.34? 10.34 -70 + -0.038 -70.038 Work out 723 - 9231. -8508 Total of -1661.6 and 5. -1656.6 Subtract 2005.87 from -5. -2010.87 Add together 17363 and 0.44. 17363.44 What is -12 plus 6267? 6255 Put together -15 and -66934. -66949 Sum -0.2309 and 1. 0.7691 Work out 0.5 + 0.0507. 0.5507 Calculate 132583 - -0.1. 132583.1 Calculate -0.05 - -11327.8. 11327.75 Add together 0.13 and 102. 102.13 What is the difference between 36391 and 1? 36390 What is -104.3 less than -856? -751.7 What is -56374 minus 32? -56406 What is -21	{ "pile_set_name": "DM Mathematics" }
emainder when 7662 is divided by 196? 18 What is the remainder when 6968 is divided by 431? 72 Calculate the remainder when 74885 is divided by 18715. 25 Calculate the remainder when 240130 is divided by 1149. 1138 Calculate the remainder when 19975 is divided by 624. 7 Calculate the remainder when 1765 is divided by 1023. 742 What is the remainder when 114140 is divided by 1202? 1152 What is the remainder when 11335 is divided by 109? 108 Calculate the remainder when 2793 is divided by 370. 203 What is the remainder when 40202 is divided by 36? 26 What is the remainder when 3390 is divided by 3321? 69 What is the remainder when 15504 is divided by 2088? 888 Calculate the remainder when 2333016 is divided by 11607. 9 What is the remainder when 14277 is divided by 414? 201 Calculate the remainder when 37229 is divided by 17. 16 Calculate the remainder when 199087 is divided by 489. 64 Calculate the remainder when 133561 is divided by 124. 13 What is the remainder when 3302 is divided by 455? 117 What is the remainder when 23157 is divided by 16? 5 Calculate the remainder when 6915884 is divided by 1291. 1288 What is the remainder when 36627 is divided by 300? 27 Calculate the remainder when 707612 is divided by 43. 4 What is the remainder when 14748 is divided by 157? 147 Calculate the remainder when 135722 is divided by 49. 41 What is the remainder when 4894 is divided by 960? 94 Calculate the remainder when 43171 is divided by 43. 42 Calculate the remainder when 156111 is divided by 5574. 39 What is the remainder when 136354 is divided by 23? 10 What is the remainder when 1478 is divided by 329? 162 Calculate the remainder when 27507 is divided by 340. 307 What is the remainder when 3729 is divided by 1197? 138 What is the remainder when 47860 is divided by 78? 46 Calculate the remainder when 119469 is divided by 1991. 9 Calculate the remainder when 86340 is divided by 11. 1 Calculate the remainder when 14238 is divided by 250. 238 Calculate the remainder when 1057 is divided by 106. 103 What is the remainder when 17022 is divided by 56? 54 What is the remainder when 19091 is divided by 42? 23 What is the remainder when 289933 is divided by 289918? 15 Calculate the remainder when 3211 is divided by 93. 49 Calculate the remainder when 1046429 is divided by 1510. 1509 What is the remainder when 10960 is divided by 51? 46 Calculate the remainder when 70099 is divided by 70. 29 Calculate the remainder when 307309 is divided by 475. 459 What is the remainder when 144559 is divided by 36137? 11 What is the remainder when 30375 is divided by 30363? 12 Calculate the remainder when 125444 is divided by 340. 324 Calculate the remainder when 5141 is divided by 302. 7 Calculate the remainder when 59865 is divided by 9. 6 What is the remainder when 46487 is divided by 229? 0 Calculate the remainder when 3756 is divided by 228. 108 What is the remainder when 17483 is divided by 11? 4 What is the remainder when 5593 is divided by 1380? 73 Calculate the remainder when 2631 is divided by 828. 147 Calculate the remainder when 1959882 is divided by 268. 266 Calculate the remainder when 582 is divided by 73. 71 Calculate the remainder when 49704 is divided by 9. 6 Calculate the remainder when 3077 is divided by 748. 85 What is the remainder when 13269 is divided by 59? 53 Calculate the remainder when 2015787 is divided by 23. 21 Calculate the remainder when 4151 is divided by 2874. 1277 What is the remainder when 104886 is divided by 111? 102 Calculate the remainder when 12070 is divided by 2976. 166 Calculate the remainder when 26667 is divided by 5332. 7 What is the remainder when 7818 is divided by 3778? 262 What is the remainder when 951864 is divided by 317284? 12 Calculate the remainder when 26556 is divided by 1864. 460 What is the remainder when 91493 is divided by 102? 101 Calculate the remainder when 251297 is divided by 350. 347 What is the remainder when 19463 is divided by 311? 181 What is the remainder when 86229 is divided by 30? 9 Calculate the remainder when 12343 is divided by 536. 15 Calculate the remainder when 3470 is divided by 65. 25 What is the remainder when 3867 is divided by 56? 3 What is the remainder when 41184 is divided by 129? 33 Calculate the remainder when 107127 is divided by 15294. 69 What is the remainder when 92958 is divided by 35? 33 Calculate the remainder when 36552 is divided by 688. 88 Calculate the remainder when 3843071 is divided by 96. 95 What is the remainder when 9685 is divided by 38? 33 Calculate the remainder when 9049 is divided by 754. 1 Calculate the remainder when 2167 is divided by 338. 139 What is the remainder when 24233 is divided by 66? 11 What is the remainder when 3107 is divided by 164? 155 Calculate the remainder when 1281 is divided by 6. 3 What is the remainder when 44047 is divided by 28? 3 Calculate the remainder when 105615 is divided by 866. 829 What is the remainder when 27184 is divided by 23? 21 Calculate the remainder when 168173 is divided by 183. 179 What is the remainder when 64235 is divided by 202? 201 Calculate the remainder when 712617 is divided by 607. 606 What is the remainder when 18543 is divided by 12? 3 What is the remainder when 15657 is divided by 88? 81 What is the remainder when 1473954 is divided by 279? 276 What is the remainder when 19642 is divided by 118? 54 Calculate the remainder when 14565 is divided by 901. 149 Calculate the remainder when 2572 is divided by 367. 3 What is the remainder when 667600 is divided by 634? 632 Calculate the remainder when 20344 is divided by 6780. 4 Calculate the remainder when 491143 is divided by 470. 463 Calculate the remainder when 6623 is divided by 934. 85 Calculate the remainder when 88642 is divided by 9842. 64 Calculate the remainder when 141928 is divided by 850. 828 What is the remainder when 149939 is divided by 588? 587 Calculate the remainder when 273036 is divided by 136518. 0 What is the remainder when 1613 is divided by 103? 68 What is the remainder when 10022 is divided by 2298? 830 Calculate the remainder when 6655 is divided by 3324. 7 Calculate the remainder when 27361 is divided by 170. 161 What is the remainder when 2436 is divided by 183? 57 What is the remainder when 1085 is divided by 111? 86 What is the remainder when 25721 is divided by 4285? 11 Calculate the remainder when 45907 is divided by 6478. 561 What is the remainder when 2583 is divided by 2581? 2 What is the remainder when 699 is divided by 161? 55 What is the remainder when 530716 is divided by 20? 16 What is the remainder when 1951 is divided by 404? 335 Calculate the remainder when 205046 is divided by 50. 46 What is the remainder when 830365 is divided by 1232? 1229 Calculate the remainder when 8146 is divided by 5202. 2944 What is the remainder when 76360 is divided by 33? 31 Calculate the remainder when 1526 is divided by 1526. 0 Calculate the remainder when 10143 is divided by 15. 3 What is the remainder when 40798 is divided by 60? 58 Calculate the remainder when 779972 is divided by 72. 68 What is the remainder when 3267 is divided by 545? 542 Calculate the remainder when 308070 is divided by 3. 0 What is the remainder when 54549 is divided by 27272? 5 Calculate the remainder when 12223 is divided by 6050. 123 Calculate the remainder when 21862 is divided by 235. 7 What is the remainder when 5020 is divided by 126? 106 What is the remainder when 326503 is divided by 9? 1 Calculate the remainder when 751076 is divided by 43. 38 Calculate the remainder when 5353 is divided by 891. 7 Calculate the remainder when 838838 is divided by 26. 0 What is the remainder when 896 is divided by 886? 10 Calculate the remainder when 10971 is divided by 30. 21 Calculate the remainder when 5890 is divided by 646. 76 Calculate the remainder when 156783 is divided by 21. 18 Calculate the remainder when 182337 is divided by 9. 6 What is the remainder when 107255 is divided by 379? 377 Calculate the remainder when 4037 is divided by 41. 19 Calculate the remainder when 49163 is divided by 16383. 14 Calculate the remainder when 33244 is divided by 216. 196 Calculate the remainder when 3403 is divided by 1800. 1603 Calculate the remainder when 2051 is divide	{ "pile_set_name": "DM Mathematics" }
ppose 4k = -2x - 8, 0 = -4x + 5k + 14 + 9. Suppose 5f = -5p + f + 9, xp - 3f = -1. Solve 3j + 5 + p = 0 for j. -2 Let u be 5((-100)/(-70) + (-9)/21). Solve 11l = -ul - 16 for l. -1 Let o = -6 - -7. Let h(m) = -51m2 + 5 + m3 - o - 5m + 48m2. Let a be h(4). Solve -j - 3 + 5 = a for j. 2 Let v be (0 - -10) + -2 - 10 - -9. Solve 12l - v + 43 = 0 for l. -3 Let s(f) = -2f3 + 13f*2 - 16f + 8. Let n be s(5). Suppose -3w + 11 = 4q, -5 = -q + 6q. Solve w + 10 = nl for l. 5 Suppose -4 = -4f, -3y - 5f = -2y - 47. Solve -10k - 18 = y for k. -6 Let h(x) = -35x*2 - 10x + 5. Let j(p) = 17p2 + 5p - 2. Let n(y) = 6h(y) + 13j(y). Let q be n(-1). Solve -4k + 2k + q = 0 for k. 5 Let i(p) = -p*2 - 13p - 16. Let y be i(-11). Let v be (-10)/(-3)(135/y)/15. Solve 36 = -vn + 16 for n. -4 Suppose r + r - 8 = 0. Let o = -6074 + 6076. Solve -r = os - 8 for s. 2 Let n(z) = -z2 + 3z - 3. Let f be n(-2). Let m(v) = 23v + v3 - 15 - 2 + 15v*2 - 14. Let x be m(f). Solve -o + x = -3o for o. -4 Suppose -z - 4z - 2z = 0. Let d(t) = 14t3 - 7t*3 + z - 8t*3 - 2 + 3t. Let j be d(-2). Solve -u + 1 = -j for u. 1 Suppose 5o - 75 = -50, 2k + 19 = 5o. Solve -kb - 12b = 30 for b. -2 Let n(j) = -2j*3 + 2j*2 - 5j - 6. Let c be n(-1). Suppose -a + 48 - 43 = 0. Solve ab - c = 4b for b. 3 Let v(o) = 0o2 - 3o + 2o2 + o3 - 2o2 + o2. Let a be v(2). Suppose 0 = -5p - 2b + 5 + 7, 4b = 4. Solve af = pf - 16 for f. -4 Let r be (-18 - -7)/(27/(-54)). Solve -r = 11c - 0c for c. -2 Let s = 5026 + -4891. Solve 36g - 9g = -s for g. -5 Let g be ((-11 + 14)48/56)/(6/42). Solve gf + 22f = -280 for f. -7 Let h = -464 + 468. Let o(b) be the second derivative of -b5/20 + b4/4 + b*3 - 3b*2 - b. Let j be o(h). Solve -4c - j = -2c for c. -1 Let w(h) = -30h*3 - 507h*2 + 49h + 2. Let o be w(-17). Solve 0 = 25u - ou + 88 for u. 8 Let p(t) = -320t - 2227. Let u be p(-7). Solve -49 + u = -6j for j. 6 Let k be (2 - (-1 + 4))/((-6)/24). Suppose -5m + t - 5 = 6t, 3m - k = 4t. Solve m = 4z + z for z. 0 Let y = -82 - -102. Suppose -r - 5q - 25 = 0, -6q + 2q - y = r. Solve rl = -5l + 20 for l. 4 Let r(x) = x*2 - 5x - 47. Let c be r(-7). Suppose -11s = -cs + 130. Solve 0 = -2o - s + 3 for o. -1 Suppose 1471 = 43n - 4463. Solve 34 - n = 13u for u. -8 Let h = -9 + 12. Suppose 0 = -o + o - o. Suppose k + of = f, -3k + 4 = f. Solve g + h = k for g. -2 Let n be (0/(-1 + -3)(-50)/200)/5. Let g be (6/(-15))/(1/(-10)). Solve g = v - n for v. 4 Let f(u) = u*2 + 6u + 35. Let q be f(-13). Let n be 10/2(q/(-15) + 9). Solve -6 = ni + 6 for i. -4 Suppose -3l - 2i + 5i = -42, 2l - 3i = 30. Suppose -4g = -y - 1, -17g + 20 = 5y - lg. Solve 0 = -yv + 6 - 12 for v. -2 Suppose 586 + 2528 = 9h. Suppose 138 = -5c + k + h, -5c - 5k + 220 = 0. Solve -41 + c = m for m. 1 Suppose 0 = -4f - 3d + 925, 0 = f + d - 158 - 72. Suppose -5 = 230y - fy. Solve y = -h - 2 for h. -3 Let z be (249/(-15) - -15)-25. Solve -zy = 21y for y. 0 Suppose 16 = 7n + 2. Suppose 0 - 2 = 3m - q, 3q = nm + 13. Suppose -m + 4 = x. Solve -xd - 14 = 1 for d. -5 Suppose 4y - 198 = -3l - 0l, 5y - 335 = -5l. Solve 9j - 88 = -l for j. 2 Let h(y) = y + 1. Let w be h(0). Let p = -63581 + 63583. Solve -p + w = -u for u. 1 Let o(u) = -2u3 - 73u*2 + 35u - 74. Let y = -237 + 200. Let h be o(y). Solve c = -hc + 1 for c. 1 Suppose -11 - 5 = -8v. Suppose 15l = 14l + 2. Let g be 4 - -1 - (l - 3). Solve 2o - v = g for o. 4 Let r = -8922 - -8948. Solve rf - 25f = -4 for f. -4 Let u = 187 - 361. Let r = 183 + u. Solve -rl = -11l + 8 for l. 4 Let p = 42380 + -42376. Let q be 2/8 + 2/(-8). Solve -3c + 4c + p = q for c. -4 Let p be 48/27 + 4/18. Suppose -h - 1 = -2u, 3u = -pu + 4h - 5. Solve -n = un + 16 for n. -4 Suppose -4l = -4b - 84, 3l - 961b + 962b = 55. Solve 21w - lw = 6 for w. 3 Suppose -30 = 5z, 2j - 3391 = 3z + 269. Solve 1814o = jo - 35 for o. 5 Suppose -4a + 5b = -177 - 35, 4b = -16. Solve -21z = -29z - a for z. -6 Suppose 0 = -47x - 41x + 2024. Solve -25w + xw = -10 for w. 5 Let a = 69 + -64. Suppose -ak + 4u + 66 = 8, -4k = 2u - 62. Solve kq - 11q = -9 for q. -3 Suppose -7 - 6 = -r - 0r. Solve -518 + 505 = -rh for h. 1 Let v = 511 - 501. Solve vp + 9p + 95 = 0 for p. -5 Suppose 4264 = 4l + 2i, -4l + 2i + 1079 = -3185. Suppose 10y + 966 - l = 0. Solve -3 = 7a - y for a. 1 Suppose -1159 = -84o + 927 + 686. Solve -op + 126 = -12p for p. 6 Let k(y) be the second derivative of -y5/20 - y4/12 - y*3/2 - 2y*2 + y - 8. Let h be k(-3). Solve -7l + h = -5 for l. 4 Let d(h) = h*3 + 4h*2 + 5. Let o be d(-4). Suppose a = 6a - 37z - 413, 3a = 3z + 75. Solve -a = op - 21 for p. 1 Suppose 0 = -2k - 5x + 414 + 3, 5k + 3x = 1071. Let l = k + -213. Solve -l = -2z - 13 for z. -5 Let k = -2092 - -2116. Solve 0 = -kr + 4r - 80 for r. -4 Let j = 7007 + -6932. Solve jx - 60 = 90 for x. 2 Let y = 9 - 17. Let r(q) = -9q + q3 - 385531 + 7q*2 + 0q*3 + 385526. Let z be r(y). Solve -s = 2 - z for s. 1 Suppose -333f = -362f + 290. Solve fl = -3 + 33 for l. 3 Let k(c) = -2c3 + 28c*2 + 25c + 12. Let h(d) = 3d3 - 55d*2 - 50d - 25. Let p(o) = 3h(o) + 5k(o). Let w be p(-24). Solve -11v + 6 = -wv for v. 3 Suppose 81k = 875 + 8116. Solve 13y - ky = -882 for y. 9 Let x = 12 - 9. Suppose xz + 3d = 0, -4d + d - 30 = -3z. Let u(a) = a2 + a + 2. Let g be u(0). Solve -n + z - g = 0 for n. 3 Let z = 7753 - 7664. Solve -zb + 76b = 52 for b. -4 Let t = -78 - -92. Suppose 7j = tj - 35. Solve j = -0d - d for d. -5 Let n be (-9)/(-15) + (-306)/(-90). Let s(x) = 2x - 23. Let v be s(-14). Let k = -47 - v. Solve -nb - 12 = -k for b. -2 Suppose -2b + 4d = -5b + 236, 0 = -3b - 5d + 235. Let h be (b/(-60))/((-2)/12). Solve 0 = -2j - 0 - h for j. -4 Let f(s) = 132s + 1198. Let w be f(-9). Solve -wh + 16 + 24 = 0 for h. 4 Suppose 0 = -x + 5, 0h + 3h + 43 = 2x. Let b be (-262)/6 - h/(-33). Let u = b + 55. Solve u - 2 = 3p for p. 3 Suppose 3r + 5a = 73, -3a - 106 = -3r - 25. Suppose -4b + r = -h + 7, -b = 2h - 7. Solve x - h + 3 = 0 for x. -2 Let n be 4 + (0/2)/(-5) + -909. Let v = 916 + n. Solve -m = v - 14 for m. 3 Let j(k) = 6k2 - 75k + 599. Let i be j(10). Solve if + 3 = 450f for f. 3 Let d = -243 - -227. Let b(c) = -13c - 203. Let n be b(d). Solve nm + 12 + 3 = 0 for m. -3 Let q(c) = 7c2 + 10c - 7. Let k be q(1). Suppose -3 = -5l + 4l. Suppose 0 - k = -3f + a, 8 = -2f - la. Solve i - 15 = -fi for i. 5 Suppose 0 = -6124j + 6143j - 1881. Solve -48u + j = -45 for u. 3 Let y(t) = -131t - 3303. Let i be y(-26). Solve if + 104 = 77f for f. -4 Let j(v) = 6v + 61. Let s be j(-9). Solve -sp = -0p + 7p for p. 0 Let s = -91 + 146. Suppose -52b = -sb. Solve 4i - i - 12 = b for i. 4 Suppose -2f + 2p - 48 = 0, -16 = -2f - 2p - 64. Suppose 5k - 92 = 3w + 23, 2k = -w + 57. Let q = k + f. Solve 2g + qg = 12 for g. 3 Let p be 77/((-72611)/82) - (-96)/46. Let r = -2 - -2. Suppose 3o + q + 4q - 25 = r, 25 = o + 5q. Solve o = -3f - 1 - p for f. -1 Let c(y) = -y + 5. Let j be c(-2). Let t be 14/(-4)(-8)/j. Solve 1 + t = a for a. 5 Suppose -2p = -s + 126, -35s + 308 = -32s + 4p. Solve 705a - 719a + s = 0 for a. 8 Suppose 0 = 6f + 36 - 114. Suppose 2a - g = f, 5a - g - 21 = a. Suppose -aj = j - 15. Solve jh = h for h. 0 Let h(i) = 103i + 1859. Let a be h(-18). Solve -87k = -ak for k. 0 Let p = -43 - -49. Suppose -14k + v + 5 = -9k, 2v - 2 = 4k. Solve k = x + p for x. -4 Let s = -4119 + 4122. Solve su + 15 = 21 for u. 2 Let h(l) = l*3 + 94l*2 - 290l + 176. Let a be h(-97). Solve ac - 57 = 60c for c. 3 Let b = 301 - 205. Let x = 102 - b. Let n(w) = -w + 10. Let p be n(10). Solve 4m - m + x = p for m. -2 Let h(b) = b3 - 2b*2 + 4b - 5. Let v be h(2). Suppose 5c = -p - 2, 5p = -115c + 120c + 20. Solve va - p = -15 for a. -4 Let h = -10994 - -13069. Solve -2067a - 16 = -ha for a. 2 Suppose 7c - 1638 = 14c. Let w = -230 - c. Solve 11m = wm + 14 for m. 2 Let k = -83 + 83. Suppose 2r - 30 + 24 = k. Solve 20 = -rt + 11 for t. -3 Let z be 2/(-3)3 + 7. Suppose	{ "pile_set_name": "DM Mathematics" }
-2.6, 3/7 in descending order. 3/7, -1, -2.6, -3 Sort -1, 4, -2, -4, -23. -23, -4, -2, -1, 4 Sort 14, -1, 6/23, 2, 0.3 in ascending order. -1, 6/23, 0.3, 2, 14 Sort -12, -4, 5. -12, -4, 5 Sort -4, 1/8, 0.2 in decreasing order. 0.2, 1/8, -4 Put -4, -17.4, -0.3 in decreasing order. -0.3, -4, -17.4 Put -3, -0.6, -0.5, 1/5, 2/17 in decreasing order. 1/5, 2/17, -0.5, -0.6, -3 Put -4, 0.04, 5 in decreasing order. 5, 0.04, -4 Put 12, 4, -2, 1, -8 in ascending order. -8, -2, 1, 4, 12 Sort 2/7, 0.5, -7, 4 in ascending order. -7, 2/7, 0.5, 4 Put 7, 0, 1, -3 in descending order. 7, 1, 0, -3 Put -842, -18, -5, -3 in decreasing order. -3, -5, -18, -842 Sort -3, -79, -4 in decreasing order. -3, -4, -79 Sort 0.1, -3/4, 0.6, 3/2, 4 in ascending order. -3/4, 0.1, 0.6, 3/2, 4 Put 4, -13, 7 in increasing order. -13, 4, 7 Sort -2/15, 14/43, -4, 1/5 in decreasing order. 14/43, 1/5, -2/15, -4 Sort 7, 1, -162. -162, 1, 7 Put -3, -66, 0 in decreasing order. 0, -3, -66 Sort 1/4, -0.5, 39, -2/7 in decreasing order. 39, 1/4, -2/7, -0.5 Put -1, -108, 4, 5 in ascending order. -108, -1, 4, 5 Put 5, -4, 548 in decreasing order. 548, 5, -4 Sort 2/69, -1, -0.2, -3/4. -1, -3/4, -0.2, 2/69 Sort 3, 1, -67 in descending order. 3, 1, -67 Sort 4, 14, 2, -12. -12, 2, 4, 14 Put -2, -0.4, -0.5, 9/7 in increasing order. -2, -0.5, -0.4, 9/7 Put 10, 5, -12, -1, 1 in ascending order. -12, -1, 1, 5, 10 Put -1, -5, 5, 19, -6 in ascending order. -6, -5, -1, 5, 19 Sort 14, 1/7, -0.3. -0.3, 1/7, 14 Put -2/9, -2, -0.1, 3 in increasing order. -2, -2/9, -0.1, 3 Sort -5, 0, 7, -4 in increasing order. -5, -4, 0, 7 Sort 4, -0.5, 6, -29. -29, -0.5, 4, 6 Put -4.5, -26, -0.5, -3 in descending order. -0.5, -3, -4.5, -26 Sort -2/1311, 3, -3 in ascending order. -3, -2/1311, 3 Put -3, -2, -2/7, 0.3 in decreasing order. 0.3, -2/7, -2, -3 Sort 3, -5, 1, -2 in ascending order. -5, -2, 1, 3 Put -47, 0.2, 4/5, -1.7, -3 in descending order. 4/5, 0.2, -1.7, -3, -47 Put 7, 109, -3, -2, 0 in descending order. 109, 7, 0, -2, -3 Sort -2, 1, -34 in increasing order. -34, -2, 1 Sort 4, 2, 7, 0 in descending order. 7, 4, 2, 0 Put -18, 1, 3, -4 in descending order. 3, 1, -4, -18 Put -4, -5, -15, -1/5 in decreasing order. -1/5, -4, -5, -15 Put 0.5, 3, -1, -5, 52 in increasing order. -5, -1, 0.5, 3, 52 Sort 16, 1, -14 in ascending order. -14, 1, 16 Put 3/2, -14, -2/17 in descending order. 3/2, -2/17, -14 Sort 42513, 5, -4. -4, 5, 42513 Sort 5, -3, -2, 1, 17/7. -3, -2, 1, 17/7, 5 Sort -1, 95, 4 in decreasing order. 95, 4, -1 Sort -5, 1, -2, -31, -32 in increasing order. -32, -31, -5, -2, 1 Put -10, 5, -1, -8, -3 in ascending order. -10, -8, -3, -1, 5 Put 1/517, 4, 2/19 in descending order. 4, 2/19, 1/517 Sort -4, 18/13, -0.13. -4, -0.13, 18/13 Put -0.7, -0.048, -1/2 in decreasing order. -0.048, -1/2, -0.7 Put 0, -2, -12 in ascending order. -12, -2, 0 Put 4/23, 0.3, 0.03, 0.5 in ascending order. 0.03, 4/23, 0.3, 0.5 Sort -2, -3, 10/17 in decreasing order. 10/17, -2, -3 Put 5, 4, -1 in increasing order. -1, 4, 5 Sort 2, 0, -96 in descending order. 2, 0, -96 Sort -1/3, 1, 1/2, -0.1 in decreasing order. 1, 1/2, -0.1, -1/3 Put 54, 0, -1, 5 in decreasing order. 54, 5, 0, -1 Sort -1/7, 13/115, 5, -2/13. -2/13, -1/7, 13/115, 5 Put -63, 1/5, -0.5, -5 in decreasing order. 1/5, -0.5, -5, -63 Sort -2, -1, 4, 7 in ascending order. -2, -1, 4, 7 Sort 2, -2, 5, 0, 21 in ascending order. -2, 0, 2, 5, 21 Sort 3, -1, 346 in decreasing order. 346, 3, -1 Put -1.8, -1, -1/8, 3, 0.1 in descending order. 3, 0.1, -1/8, -1, -1.8 Sort 0.5, 167, -4/7, -3/7, -2/11. -4/7, -3/7, -2/11, 0.5, 167 Put 6, -4, -3, -1 in increasing order. -4, -3, -1, 6 Sort -2, 4, 1, -5 in descending order. 4, 1, -2, -5 Sort 1/5, 4/7, 0, 74 in descending order. 74, 4/7, 1/5, 0 Sort 5, -0.2, 15/7 in increasing order. -0.2, 15/7, 5 Sort 8, 3, -3/7, -4/5. -4/5, -3/7, 3, 8 Sort -0.02, 8, 5, 9, -0.4 in descending order. 9, 8, 5, -0.02, -0.4 Sort 4, 6, 13 in descending order. 13, 6, 4 Sort -0.5, 23/7, 2 in decreasing order. 23/7, 2, -0.5 Sort -2, 370, -3, 5, 0 in decreasing order. 370, 5, 0, -2, -3 Sort 56, 4, 1/4, -0.1. -0.1, 1/4, 4, 56 Sort 4, -17, -5. -17, -5, 4 Sort 2/11, 3, -2 in increasing order. -2, 2/11, 3 Put 1467, 2, 8, -4 in decreasing order. 1467, 8, 2, -4 Sort -3, -5160, 1. -5160, -3, 1 Put 6, -7, -1, -3 in ascending order. -7, -3, -1, 6 Sort 6, 9, 1, 10 in decreasing order. 10, 9, 6, 1 Put -0.1, 0, -2/9, -0.06 in descending order. 0, -0.06, -0.1, -2/9 Put 0.01, 35, -5 in decreasing order. 35, 0.01, -5 Sort 0, -0.3, -182, -3, 3/4 in ascending order. -182, -3, -0.3, 0, 3/4 Put 4, -1, -3, 3, 80 in increasing order. -3, -1, 3, 4, 80 Sort -0.5, 8, -5/3, -0.3 in ascending order. -5/3, -0.5, -0.3, 8 Put 4/57, -2, -3, 0.3, -1/8 in increasing order. -3, -2, -1/8, 4/57, 0.3 Sort 2, -35, -8, -3. -35, -8, -3, 2 Put 0, -1/3, -2/15, -5, -3 in descending order. 0, -2/15, -1/3, -3, -5 Sort 1, -6/13, -32, 2 in decreasing order. 2, 1, -6/13, -32 Sort 4, -0.8, -6, 0.1 in decreasing order. 4, 0.1, -0.8, -6 Put 487, -1, -4, -5 in descending order. 487, -1, -4, -5 Sort 11, 2, -99, -2 in increasing order. -99, -2, 2, 11 Sort -44, 4, 5, 3 in increasing order. -44, 3, 4, 5 Put -5/2, -3, 3/4, 3 in descending order. 3, 3/4, -5/2, -3 Put -2/11, -2, 0, 51 in decreasing order. 51, 0, -2/11, -2 Put 27, -3, -11 in decreasing order. 27, -3, -11 Put 9, -1/6, -1, 3, 2/27 in increasing order. -1, -1/6, 2/27, 3, 9 Sort 3, 2, 145 in decreasing order. 145, 3, 2 Put 4, 5, -4, -5 in decreasing order. 5, 4, -4, -5 Put 10, -1, -4, -10 in ascending order. -10, -4, -1, 10 Put -3/4, -2/9, -37, 0.3 in decreasing order. 0.3, -2/9, -3/4, -37 Sort 3, -2, -4, 0.4 in increasing order. -4, -2, 0.4, 3 Put -1/418, -1/4, -0.1 in decreasing order. -1/418, -0.1, -1/4 Sort 0.09, -5, -2, 150, 2/9 in descending order. 150, 2/9, 0.09, -2, -5 Sort -1, 4, 0, -5, 301. -5, -1, 0, 4, 301 Put -2/9, 1, 27, -0.5, -2/3 in increasing order. -2/3, -0.5, -2/9, 1, 27 Sort 2, 1, 4, -4 in ascending order. -4, 1, 2, 4 Put 11/6, 2, -13, 2/3, -3 in decreasing order. 2, 11/6, 2/3, -3, -13 Sort -5/4, -0.1, -0.0515 in descending order. -0.0515, -0.1, -5/4 Sort 12, 0, -3, 3 in decreasing order. 12, 3, 0, -3 Put -51, 2, 3, -10 in ascending order. -51, -10, 2, 3 Sort -1/6, 1, -2, -4. -4, -2, -1/6, 1 Sort 4, 5, 335, 0. 0, 4, 5, 335 Put -1, 7, 0 in descending order. 7, 0, -1 Sort -59, -3, 80. -59, -3, 80 Put -1260, -1, 3, -5 in descending order. 3, -1, -5, -1260 Put 4/3, -25, 0, -2/17, 0.5 in ascending order. -25, -2/17, 0, 0.5, 4/3 Sort 4, -3, 2/3, -0.022 in descending order. 4, 2/3, -0.022, -3 Put -5, -1390, 9 in ascending order. -1390, -5, 9 Sort 2, -4, -141, 1 in decreasing order. 2, 1, -4, -141 Put -1, 1, -5, -27 in ascending order. -27, -5, -1, 1 Put 0, -2, -5, -145 in descending order. 0, -2, -5, -145 Sort -2/3, 4, 3, 0.5, -2 in decreasing order. 4, 3, 0.5, -2/3, -2 Put 1, -59, -5, 3 in ascending order. -59, -5, 1, 3 Put -3, -10, 5, 3, -2 in descending order. 5, 3, -2, -3, -10 Sort -1014, 4, 2, 3. -1014, 2, 3, 4 Sort 0.1, -2/9, -0.4 in decreasing order. 0.1, -2/9, -0.4 Sort -1, 5, 4, -0.5, -3/5 in descending order. 5, 4, -0.5, -3/5, -1 Put 84/5, 0, 4 in descending order. 84/5, 4, 0 Put 61, 4, 5 in descending order. 61, 5, 4 Put -1, 6, 8, -3 in decreasing order. 8, 6, -1, -3 Put 7/9, -2, -1 in increasing order. -2, -1, 7/9 Put -0.08, -1, 0.06 in ascending order. -1, -0.08, 0.06 Sort -5, -2, -6, 5. -6, -5, -2, 5 Put -3, 4, -1, -6 in ascending order. -6, -3, -1, 4 Sort 4, -3, -1/27, 0 in decreasing order. 4, 0, -1/27, -3 Put -2, 35, 4, -3 in increasing order. -3, -2, 4, 35 Put 65, 5, 1, -2, -3 in ascending order. -3, -2, 1, 5, 65 Put -2, 5, -6 in descending order. 5, -2, -6 Put -0.5, -0.4, 2/3, -14 in decreasing order. 2/3, -0.4, -0.5, -14 Sort -3, -34/39, 2, -2/13 in increasing order. -3, -34/39, -2/13, 2 Sort -1, -2, 0. -2, -1, 0 Sort 1, -2, 76 in descending order. 76, 1, -2 Sort 10, -3, 2, -4 in decreasing order. 10, 2, -3, -4 Sort -0.04, -1/3, -4, 11/10. -4, -1/3, -0.04, 11/10 Put -0.04, -153, -4 in descending order. -0.04, -4, -153 Sort -2, 127, -3, 11 in increasing order. -3, -2, 11, 127 Sort 15, 0, 0.4, 0.5. 0, 0.4, 0.5, 15 Sort 7, -13, -3, 3 in descending order. 7, 3, -3, -13 Sort 8, 0, 9 in increasing order. 0, 8, 9 Put -0.2, -1/4, 52 in	{ "pile_set_name": "DM Mathematics" }
14) to base 12. 1101580 Convert -10000101001100000 (base 2) to base 12. -33568 10100100001111111 (base 2) to base 15 19db5 40044113 (base 5) to base 8 1150215 What is -b37b7 (base 13) in base 5? -40301340 What is -100221222112 (base 3) in base 6? -4111452 Convert 2360652 (base 8) to base 16. 9e1aa Convert 3343621 (base 7) to base 9. 701284 212449 (base 10) to base 11 135686 -61261200 (base 7) to base 3 -100121110222210 Convert -1645501 (base 8) to base 4. -1310231001 What is 1206432 (base 8) in base 10? 331034 What is -1262463 (base 7) in base 11? -104191 What is 7d7bd3 (base 14) in base 13? b70942 -573448 (base 9) to base 7 -2631056 Convert -34c7b (base 13) to base 7. -551431 Convert 1415343233 (base 6) to base 11. 9872850 What is 2632030 (base 7) in base 5? 42002200 What is -602241 (base 7) in base 10? -101655 What is -101000011101100010111 (base 2) in base 6? -44230103 Convert -a38ac (base 13) to base 11. -190726 -130044 (base 7) to base 8 -56752 114334222 (base 5) to base 11 341013 20415115 (base 6) to base 14 116379 What is 440002203 (base 5) in base 10? 1875303 -61278 (base 12) to base 10 -126524 Convert 2124505 (base 7) to base 11. 167267 23011321002 (base 4) to base 9 5421563 5998751 (base 10) to base 8 26704237 -11149 (base 15) to base 2 -1101010000010110 Convert 14806167 (base 9) to base 10. 7385641 Convert 139920 (base 11) to base 5. 23434224 Convert a7161 (base 11) to base 5. 14442130 Convert 111122300 (base 4) to base 13. 30c14 What is 906aa8 (base 13) in base 8? 14633747 What is -52363 (base 8) in base 11? -15380 What is -3841a (base 12) in base 13? -28b58 Convert 1432411 (base 5) to base 11. 20897 What is -1562414 (base 8) in base 12? -1995a4 3776a37 (base 13) to base 6 1414402151 What is -2d32dd (base 16) in base 5? -1224242031 2010410104 (base 5) to base 14 760b7b -101100100001 (base 2) to base 8 -5441 What is -124467 (base 9) in base 5? -4403342 10101001101111101 (base 2) to base 14 2395b Convert -6022346 (base 7) to base 12. -2a394b Convert -3355222 (base 6) to base 11. -107482 267635 (base 8) to base 14 26421 403214031 (base 5) to base 11 a04778 What is 146238 (base 15) in base 10? 982628 What is -13431331 (base 5) in base 15? -2b561 What is -112020102012 (base 3) in base 10? -280238 2490703 (base 10) to base 7 30112345 -3552a (base 11) to base 3 -2121020212 -5506333 (base 7) to base 3 -1021021020211 Convert -11111110001111011 (base 2) to base 6. -2442351 -11412005 (base 6) to base 11 -226054 Convert -676624 (base 11) to base 15. -164406 Convert 30602 (base 7) to base 6. 54415 Convert -876174 (base 9) to base 6. -15112321 10698a (base 16) to base 13 2b8760 Convert -3d3da2 (base 16) to base 11. -22a1423 Convert 53eb6 (base 16) to base 11. 215286 Convert -1013203311 (base 4) to base 14. -78b65 Convert 472e4 (base 15) to base 3. 102112002121 -211010100 (base 4) to base 2 -100101000100010000 Convert -5ec228 (base 16) to base 6. -341034224 -395f16 (base 16) to base 5 -1430304034 What is 101110111100000010110 (base 2) in base 13? 41b101 -103012120 (base 4) to base 9 -128274 203120232 (base 5) to base 7 10035211 Convert -712a469 (base 11) to base 3. -212201101222122 What is -12002020212210 (base 3) in base 10? -2701587 What is -1321450304 (base 6) in base 14? -2143a12 Convert -178930 (base 11) to base 14. -7248c -40105042 (base 6) to base 4 -10103202302 12122021011 (base 4) to base 6 100001301 Convert -15a739 (base 14) to base 13. -207499 1606416 (base 7) to base 12 a7906 What is -122212210 (base 3) in base 10? -13035 -58372 (base 9) to base 8 -114041 10615a4 (base 11) to base 12 759295 -1100111011001001 (base 2) to base 16 -cec9 -1736435 (base 9) to base 6 -32435005 Convert -100000000000110110001010 (base 2) to base 8. -40006612 Convert -608521 (base 9) to base 16. -58066 -1441216 (base 7) to base 11 -123504 17405237 (base 8) to base 3 21122120102210 -163464 (base 9) to base 11 -69964 -1530311 (base 6) to base 8 -256703 2a549 (base 16) to base 12 84409 -32022211 (base 4) to base 14 -17205 What is -3313030023 (base 4) in base 7? -11414604 -1132033021 (base 4) to base 9 -647431 Convert 1313030320 (base 4) to base 6. 14244224 What is -202020112120 (base 3) in base 11? -252387 500024 (base 9) to base 6 10154551 Convert -241202 (base 9) to base 6. -3040215 Convert 9aed6 (base 15) to base 11. 307213 -1a43797 (base 14) to base 3 -220121002021200 Convert 60254 (base 7) to base 15. 4498 What is 1435408 (base 10) in base 13? 3b3470 What is -143a9 (base 13) in base 12? -19ba3 Convert 491927 (base 10) to base 11. 306657 8b90 (base 15) to base 14 ab10 Convert 505263 (base 7) to base 5. 10222033 Convert 48053c (base 16) to base 9. 8783468 Convert -5560a2 (base 12) to base 9. -2500245 What is -33304444 (base 5) in base 10? -291249 17586 (base 16) to base 4 113112012 978413 (base 11) to base 4 11331213110 What is 111113013302 (base 4) in base 8? 25270762 601b6 (base 14) to base 7 1651016 -400499 (base 10) to base 6 -12330055 -2210650 (base 9) to base 16 -1220e8 Convert 98715 (base 11) to base 3. 21021112200 What is -b42625 (base 13) in base 7? -50506200 -221413100 (base 5) to base 13 -27aca9 Convert 49537 (base 11) to base 12. 35244 -4b5f0 (base 16) to base 5 -34334340 What is 233003 (base 4) in base 11? 2298 -3371244 (base 8) to base 15 -130c8e What is 3471f (base 16) in base 9? 356603 Convert 143035 (base 8) to base 9. 76512 What is -dd0014 (base 15) in base 5? -10143430034 What is 817e5 (base 16) in base 4? 2001133211 211154 (base 7) to base 5 2131241 3db572 (base 15) to base 2 1011010110001110001111 b1133 (base 12) to base 16 38277 What is 11220202122 (base 3) in base 15? 1da25 54912 (base 14) to base 2 110010000000100100 -104761 (base 12) to base 9 -431261 Convert 10310344403 (base 5) to base 4. 222010122013 Convert -657134 (base 8) to base 9. -365743 What is 2458a (base 14) in base 12? 43552 Convert 41404255 (base 6) to base 15. 18a185 What is -1481a (base 13) in base 7? -220620 What is -30201131 (base 4) in base 3? -2121100202 14322144 (base 5) to base 2 100100111111111101 Convert -248449 (base 15) to base 8. -6530343 What is -27151255 (base 8) in base 3? -102110001122101 -3203001 (base 8) to base 10 -853505 -1701564 (base 8) to base 16 -78374 -2138c7 (base 15) to base 14 -2d24b5 Convert -674104 (base 9) to base 2. -1100010011100010110 Convert -4155104 (base 7) to base 8. -1722670 Convert 15106421 (base 7) to base 3. 2200200202222 What is 130efd (base 16) in base 15? 19a131 -10241320 (base 5) to base 15 -1ac0a Convert -725845 (base 13) to base 8. -12134027 What is 10010101000000000000 (base 2) in base 3? 1011000011212 513a907 (base 11) to base 12 3059001 14262423 (base 7) to base 14 26d64a What is 11280a (base 12) in base 8? 1027412 Convert -1919627 (base 13) to base 7. -126564452 66915 (base 13) to base 4 231123213 What is -111010101011110 (base 2) in base 3? -1112012211 2718121 (base 10) to base 12 ab0ba1 Convert 13460 (base 12) to base 10. 26568 What is -1135621 (base 7) in base 8? -430503 Convert -1240122 (base 5) to base 4. -11331130 -11022210221 (base 3) to base 12 -41344 Convert ba42f (base 16) to base 4. 2322100233 What is -6632012 (base 10) in base 11? -381a802 Convert -32222330031 (base 4) to base 15. -50e7d6 What is -30035555 (base 7) in base 14? -487a2c What is 11111202022 (base 3) in base 12? 43445 Convert 5380266 (base 10) to base 2. 10100100001100010101010 2162100 (base 7) to base 3 111120121000 What is -25c72c (base 13) in base 2? -11011110111001010000 Convert 101002220120 (base 4) to base 2. 10001000010101000011000 Convert -8575281 (base 9) to base 4. -101202031210 What is -2011551 (base 8) in base 9? -886003 Convert 4a67304 (base 11) to base 9. 17483436 Convert 8163872 (base 9) to base 8. 20465513 What is 1c66c3 (base 14) in base 8? 3701463 4819290 (base 10) to base 15 652e10 Convert -8138a02 (base 11) to base 5. -12140424242 What is -240104330 (base 5) in base 16? -10bef9 What is -887449 (base 10) in base 7? -10354213 -54a051 (base 11) to base 8 -3261201 What is -233878 (base 11) in base 12? -15a8a7 Convert -12000021320 (base 4) to base 14. -2cd608 What is -101001000111001101110 (base 2) in base 5? -321102212 Convert -39458 (base 10) to base 4. -21220202 Convert -20321134 (base 8) to base 12. -15352a4 -25133543 (b	{ "pile_set_name": "DM Mathematics" }
-1 - -2. Suppose -4d + d = s. Let u = d + 26. Calculate the greatest common factor of u and 50. 10 Let n be 6/4 + (-94)/(-4). Let r = n + 11. Suppose 6c - r = 3c. Calculate the greatest common factor of c and 12. 12 Let m(q) = q3 + 5q*2 - 2q - 5. Let j be m(-4). Suppose 0 = -3g - 7 + j. Calculate the highest common divisor of g and 16. 4 Let h = -367 - -577. What is the highest common divisor of 30 and h? 30 Suppose -263 = -5f + 262. Calculate the greatest common factor of 15 and f. 15 Suppose 16u - 14u = 30. Suppose 21 = 2c - k - 2, 3c - 15 = -5k. Calculate the greatest common divisor of u and c. 5 Suppose 7 + 27 = 2q. What is the highest common divisor of 187 and q? 17 Let a(s) = s*3 - 3s*2 - 4s + 4. Let i be a(5). Let m be ((-3)/(-6))/(1/i). Let j = -17 - -34. Calculate the greatest common factor of j and m. 17 Let h be -1 - (-2 + (-64 - -4 - 2)). What is the greatest common divisor of h and 9? 9 Suppose -4a = -3b - 4, 3b - 5a + 12 = b. What is the greatest common divisor of b and 44? 4 Suppose 0 = 7o + 91 - 329. Calculate the highest common factor of o and 102. 34 Let j be -4-21/2. What is the highest common divisor of 32 and j? 4 Suppose 4f = 9 + 3. Suppose 0 = -0l - fl - 4a + 21, a = -4l + 15. Let g be 112/6 + 18/(-27). Calculate the highest common factor of l and g. 3 Let s be (-2)/(-3) + (-75)/(-9). Calculate the highest common divisor of s and 81. 9 Let g be 106/6 - (-1)/3. Let l(y) = -y*2 - 4y + 7. Let t be l(-5). Suppose 0 = -td - 2, -5o + 91 = -0d - d. What is the highest common factor of o and g? 18 Suppose -5p = 5l - 370, -3p - 334 = -4l - 17. Suppose -5q - 4z + 8z = -111, -3q + 5z = -l. Calculate the highest common factor of 19 and q. 19 Suppose -3b + 4b + 59 = 5q, 3b = 4q - 56. Calculate the highest common factor of 1 and q. 1 Let k be (-3 + 2 - 0)-2. Let c be 2/4(-10 + 10). Suppose c = -ku + 4u - 8. Calculate the greatest common factor of 12 and u. 4 Let u be (20/25)/((-4)/(-70)). Suppose -y = 2 - u. Calculate the greatest common divisor of y and 108. 12 Suppose f - 21 = -17. Calculate the greatest common divisor of 48 and f. 4 Let m = 10 - -15. Calculate the greatest common divisor of 50 and m. 25 Let f(p) = -5p. Let t(l) = -l - 5. Let v be t(-4). Let a be f(v). Suppose ah - 5g = 104 + 106, 0 = 3g. What is the greatest common divisor of h and 105? 21 Let p(k) = -k3 - 8k*2 - 6k + 8. Let x be p(-7). Let a(q) = 12q3 + q - 1. Let y be a(x). Calculate the highest common divisor of 48 and y. 12 Suppose -9w = -65 + 11. What is the highest common factor of w and 24? 6 Let l = -46 - -115. Calculate the highest common divisor of 23 and l. 23 Suppose -2l + 3w + 11 = 0, 0 = w - 0 - 5. Calculate the highest common factor of l and 52. 13 Suppose 0 = k - 4k. Let z(g) = g2 + 3. Let n be z(k). Let r be (42/(-28))/(1/(-2)). What is the highest common factor of n and r? 3 Let j be (1 + -1)/(-3 + 1). Suppose x + x - 168 = j. Suppose 0 = -4b + o + 55, b + 2b = 4o + 38. Calculate the greatest common factor of b and x. 14 Suppose -2q + 12 = 2q. Calculate the highest common factor of 24 and q. 3 Suppose 4k = -o + 8, k - 20 = -3o + 26. Let s be 2/(-3)(-93 + -3). Calculate the highest common factor of o and s. 16 Suppose 4j - 5 = 3. Let y be (-24 + 0)(-4)/6. Suppose -2 = -jp + y. What is the greatest common divisor of 45 and p? 9 Suppose 30 = 5z - 4a, 2a - 24 = -4z - 0z. What is the greatest common divisor of z and 48? 6 Suppose 0 = r - 128 - 374. Suppose r = 3c + 82. What is the highest common factor of c and 20? 20 Let p(z) = 42z2 + 5z - 2. Let n(w) = -63w2 - 8w + 3. Let u(l) = 5n(l) + 8p(l). Let d be u(-1). What is the greatest common divisor of 60 and d? 20 Suppose -h = 3h - 2s - 48, 3s = 5h - 61. Let q be h/(-3(-2)/6). Calculate the greatest common factor of q and 55. 11 Let b(w) = w2 - 6w + 13. Let y(u) = -u + 9. Let d be y(0). Let o be b(d). Let a = 1 + 4. Calculate the highest common factor of o and a. 5 Let q be 16(-2 + (-7)/(-2)). What is the highest common factor of 12 and q? 12 Let w(z) = 2z*2 - z - 1. Let g = 3 + -4. Let t be w(g). What is the highest common factor of t and 12? 2 Suppose 0u + 2u - 16 = 0. Let i = u + 8. Calculate the greatest common factor of 24 and i. 8 Let b(z) = 3z*3 - 2z*2 - 3z + 5. Let a be b(2). What is the greatest common divisor of 120 and a? 15 Let m = 1 - -1. Suppose -13 + 37 = 3x - mu, 4u = 4x - 36. Let k be x/12 + 194/4. Calculate the greatest common divisor of 7 and k. 7 Let d be (-6)/4 + (-837)/(-18). Calculate the greatest common factor of d and 9. 9 Let j(f) = 4f3 + f2 - 1. Let g be j(-1). Let o be 4/8 + (-262)/g. Calculate the greatest common factor of 6 and o. 6 Let b be 16/3051 - 2/10. Calculate the greatest common factor of b and 270. 27 Let t(q) = -q*2 + q. Let w be t(1). Let a be (2 - w) + 49 - 3. What is the highest common divisor of a and 6? 6 Let r = 11 + 2. Let q = -9 - -5. Let p be (131 + -1)(-2)/q. What is the greatest common divisor of p and r? 13 Let m = -49 + 73. What is the highest common factor of m and 216? 24 Suppose -3t - 36 = -4t. What is the greatest common divisor of 4 and t? 4 Let d be (-10)/85 - 376/(-17). Calculate the highest common factor of d and 110. 22 Let c(n) = -n*3 - 9n*2 - 23n + 3. Let z be c(-6). Calculate the highest common divisor of 55 and z. 11 Let i(a) = 3a2 + 3a. Let v be i(-2). Let t be (4/(-3))/(v/45). Let h be 2/10 + (-838)/t. Calculate the highest common factor of 12 and h. 12 Suppose 0 = -4u - 0u + 3o + 52, 0 = u - 5o - 13. Calculate the greatest common factor of u and 13. 13 Suppose -4v - 2g + 78 + 20 = 0, v - 32 = -2g. Let x = 30 - 5. Let p be (22/10)/(5/x). Calculate the highest common factor of p and v. 11 Let a = 31 + -3. Suppose -4r + a + 44 = 0. Calculate the highest common factor of r and 18. 18 Suppose -5o + 34 = -16. Suppose 0 = 4l - 1 - 7. Calculate the highest common divisor of l and o. 2 Suppose -2q + 8q = 84. Calculate the greatest common factor of 112 and q. 14 Let z be -1(4 + -1)-1. Let h be (5/(-2) - -2)-8. Suppose 0 = zg - hg + 20. What is the highest common divisor of 4 and g? 4 Let m(l) = l2 + 8l - 15. Let z be m(-11). Calculate the greatest common divisor of z and 45. 9 Let j(k) = -8k3 - 1. Let q be j(-1). Suppose -2u = -qu + 60. What is the highest common divisor of u and 60? 12 Suppose -22 = -5m - 2. What is the highest common factor of 44 and m? 4 Let l be 103 - 12/(-2). Suppose -4x + l = -2c, 0x + 4c - 32 = -2x. Let s be (3/6 - 0)x. What is the highest common divisor of 6 and s? 6 Let q = -7 - -31. Calculate the greatest common factor of 3 and q. 3 Let r(x) = 14x - 13x + 0 - 2. Suppose 0q + 5q - 15 = 0. Let n be r(q). Calculate the highest common factor of n and 7. 1 Let w = 17 + -2. What is the greatest common factor of w and 135? 15 Let r be 1((2 - 0) + -3). Let q(y) = -105y3. Let t be q(r). Let j be (-1)/(0 - (-2)/(-30)). What is the greatest common divisor of t and j? 15 Suppose c + 0f = f, -2c = 4f - 12. Suppose -cq = -z + 3q + 20, -5q - 45 = -2z. Calculate the highest common factor of 75 and z. 25 Let y(f) = f*2 - 6f + 9. Let u be y(5). Suppose 0 = um - 854 + 170. Calculate the greatest common factor of m and 19. 19 Suppose -4t + 25 = 4z - t, 0 = 5z + 3t - 35. What is the greatest common divisor of 20 and z? 10 Let n be (1755/180)/((-1)/(-12)). What is the highest common factor of n and 39? 39 Suppose 5p + 10 = 7p. Let q = 7 - p. Calculate the highest common factor of 14 and q. 2 Suppose 6a = -266 + 344. Suppose 5p = 4 + 581. Calculate the greatest common factor of a and p. 13 Let m(h) be the second derivative of -h5/5 + h4/4 - h3/2 - h2/2 - 2h. Let t be m(-3). Calculate the highest common factor of 13 and t. 13 Let c be (-4 + 313)/((-3)/(-2)). Let h = c - 104. What is the highest common factor of 17 and h? 17 Let f be (-2)/(((-32)/76)/4). Calculate the greatest common divisor of 19 and f. 19 Let x = -58 - -82. Suppose -2b - 3c = -15, -3 = 2b - 3c - 36. What is the highest common divisor of x and b? 12 Suppose -k + 6 + 2 = 0. Let x be 11/(-3) + 6/9. Let j be 1 + (-3)/(x/47). What is the highest common factor of j and	{ "pile_set_name": "DM Mathematics" }
le of 33? True Let y(s) = s + 16. Let o be y(-6). Let r(v) = -5v + 16. Let q be r(o). Let a = -17 - q. Is a a multiple of 17? True Suppose 151d - 145d = 8460. Is 30 a factor of d? True Suppose 0 = -5p + k - 55, 4p + 53 = 3k - 2. Let c(d) = -15d - 52. Is c(p) a multiple of 7? True Suppose 0 = -3l + 5o + 20, 0o - 17 = -4l - 3o. Suppose 5u = 4 + 6. Suppose -uq = -y + 11, -4q + 7 = ly - 6. Is 5 a factor of y? True Suppose 36 - 96 = -4v. Suppose 3h - 6h = -v. Suppose 3y = -p - p + 82, -hp + 212 = 4y. Does 15 divide p? False Let z(g) = 10g2 - 1. Let j be z(-1). Suppose 0 = 2k + 17 + 19. Does 15 divide (82/(-4))/(j/k)? False Let t(j) = -625j3 - 4j*2 - 6j - 3. Does 13 divide t(-1)? True Let s(b) = 2b - 17. Let i be s(16). Suppose 10x + i = 5n + 5x, -3n + 2x + 6 = 0. Suppose j - 2p - 38 = n, 2j + 5p - 4p = 81. Is 10 a factor of j? True Let n(r) = -r*3 - 4r*2 + 11r + 14. Suppose 0 = 2l - s + 7, -6l + 5l + s = 1. Is 13 a factor of n(l)? False Suppose -5x + 1064 = 3g, 0 = 2x - 3g - 0g - 413. Is x a multiple of 7? False Suppose -2 = 2t, -3h + 2t + 1112 = 2h. Let k = h + -147. Does 15 divide k? True Let q be 5/(((-21)/6)/7). Let t = q - -11. Let z = 4 + t. Is 5 a factor of z? True Suppose 4g - 1446 = 2u, -2u = 28g - 25g - 1074. Does 20 divide g? True Let h be 18 + (0 - -2) + 1. Is 14 a factor of ((-396)/(-42))/(3/h)? False Suppose 10 = 8m - 3m. Let j(c) = 0c - 3c - mc. Is 3 a factor of j(-2)? False Suppose 0 = -2u - u + 138. Let g = u - 34. Is 6 a factor of g? True Suppose 13h + 51136 = 11h. Does 17 divide ((-1)/(-5))/(-9 + h/(-2840))? False Let y = 149 + 46. Is 8 a factor of y? False Suppose -40 = -n - m - 16, 0 = -4m - 12. Suppose -5a + 12 - n = -5d, d - 1 = -a. Suppose -dv - 70 = -7v. Does 3 divide v? False Let p(a) = -a*3 - 8a*2 - 10a - 16. Let f be p(-9). Is 8 a factor of (f/(-20))/(2/(-16))? False Let n(h) = h*3 - 4h*2 + 4h + 2480. Does 31 divide n(0)? True Suppose -3v - 13 = 2. Let u be (-6)/(-20)2v. Is (-17)/(-2) - u/6 a multiple of 3? True Let j(z) = 178z*2 + 6z - 4. Let l be j(2). Suppose v - 10v = -l. Is v a multiple of 14? False Let c(o) = -56o - 203. Does 35 divide c(-10)? False Suppose 42j + 132 = 46j. Does 11 divide j? True Let v be 454 - 12/155. Suppose 5z - v - 450 = 0. Is z a multiple of 12? True Let x(s) = 13s3 - s2 - 3s + 2. Let a = -5 - -7. Is 24 a factor of x(a)? True Let d = 378 + 367. Is 15 a factor of d? False Let b = -16 - -22. Let w(i) = i*3 - 3i*2 + 4i. Let a be w(b). Let l = a + -78. Does 18 divide l? True Let r(w) = 3w - 17. Let t be r(5). Is 5 a factor of (9 + 1)/((-1)/t)? True Let q(v) = -v + 8. Does 6 divide q(-3)? False Suppose -8p - 2d = -3p + 60, 5p + 5d + 75 = 0. Let v = p + 13. Let u = 30 - v. Is 5 a factor of u? False Suppose 0 = 5u - v - 0v - 970, u - 175 = 4v. Does 7 divide u? False Is 2/(-7) - (2475/(-63) + 5) a multiple of 17? True Let k = -31 + 30. Let w(c) = -c3 + 10c*2 - 2. Let p be w(10). Is (-33)/p - k/2 a multiple of 3? False Suppose 9 = 2h - h - 3d, -3h = 4d - 14. Let t(s) = s2 - 6s + 3. Let b be t(h). Let u(w) = 23w + 8. Is 36 a factor of u(b)? False Suppose 615 - 55 = 4i. Suppose -17u + i = -15u. Is u a multiple of 14? True Let s(q) = 3q2 + 2q - 2. Suppose -t + 5b - 11 = -3t, -19 = 2t - 5b. Let n be s(t). Suppose 2w - r = -nr + 60, 3w = 3r + 111. Is w a multiple of 18? False Suppose v = -2u - u + 54, -5u = v - 90. Let d be u/44/(-6). Let o(t) = t2 - t - 2. Is 10 a factor of o(d)? True Suppose -4z + 4j = -24, -22 = -z - 4z + j. Suppose 0 = t + 2n + 83, -n - 1 = z. Is 20 a factor of 0 - -1 - t - 2? False Suppose -c = 3c - 84. Let g = c - 13. Let l(j) = -j*2 + 11j - 19. Does 2 divide l(g)? False Suppose 0 = -347t + 348t - 2925. Is t a multiple of 20? False Suppose -5o + 56 - 16 = 0. Suppose -14u = -ou - 1326. Does 9 divide u? False Suppose -4q - 308 = -0q. Suppose -6x = 4x + 1190. Let g = q - x. Is 14 a factor of g? True Let b(s) = s - 6. Let j be b(9). Suppose jf + 4z = 214, 58 = 2f + 4z - 86. Suppose 0q - f = -4v - 3q, q = 2. Is v a multiple of 8? True Suppose -2q = 10, -3q = -2m - 3m + 665. Does 9 divide m? False Is -5724(0 - 11/33) a multiple of 12? True Let a = -89 + 150. Suppose 0 = -g + 4h - 90, -4h - a = 3g + 129. Let u = g - -98. Is u a multiple of 14? True Let g(v) = -2v3 + 16v + 30. Is g(-9) a multiple of 10? False Let q(i) = -i - 35. Let x be q(-14). Suppose 0 = 3h - h - 16. Does 22 divide (xh)/(-3) - -4? False Let d(q) = q*2 - 7q - 2. Let h be d(6). Let b be ((-18)/72)/(2/(-16)). Let o = b - h. Does 5 divide o? True Suppose 2s - 1 = -13. Is 16 a factor of 0/3 - s23? False Is 5/3 - (-6916)/156 a multiple of 3? False Let s(r) = 205r. Let y be s(1). Suppose -75 = -4m + y. Suppose m = 5o + 2x - 56, -3x - 87 = -4o. Is 8 a factor of o? True Let s be 4/(-16) + -13(-3)/12. Suppose -4k + 3k = 5p - 145, 425 = sk + 5p. Is k a multiple of 35? True Suppose 4g + 7 = -1. Does 6 divide (-5 + 8)/(g/(-6))? False Let n(v) = v3 + 12v - 2. Does 39 divide n(6)? False Suppose -3h + h - 5g + 8403 = 0, 2g = h - 4197. Is 80 a factor of h? False Let i be -3 + 4 + -5 - -38. Suppose -i = -2b + 20. Is b a multiple of 6? False Let l be 0/(2 + -5 - -2). Let k = 5 + l. Suppose -kt = 4i - 130, -3i + 80 = 2t - 7t. Is 15 a factor of i? True Suppose 0p - 2 = -p, -p = 2r - 14. Is (-30)/45 - (-328)/r a multiple of 6? True Suppose 161u + 852 = 173u. Is 71 a factor of u? True Let m(g) = 2g*3 - 10g*2 + 29g + 41. Does 38 divide m(9)? True Let g be (58/3)/((-4)/(-6)). Let r = g - 11. Is 3 a factor of r? True Let r = 2443 - 1301. Is r a multiple of 15? False Let r(k) = 57k2 + 23k - 52. Does 21 divide r(8)? True Let d(m) be the first derivative of 23m3/3 - m2 + 17m - 2. Let j(n) = 15n2 - n + 11. Let w(x) = -5d(x) + 8j(x). Is 10 a factor of w(-3)? False Suppose -156w + 147w + 24696 = 0. Is w a multiple of 98? True Suppose -3k = -620 - 292. Suppose 2n = -6n + k. Is 7 a factor of n? False Let q be -1 - ((-3)/5)/((-2)/(-10)). Let b = -1 + 3. Suppose t - 109 = 3j - 314, -bt + 134 = qj. Is j a multiple of 27? False Let a = 558 + 1354. Does 8 divide a? True Let k be (20/(-15))/(8/(-12)). Suppose kz - 236 = -0a - 2a, -5a = -2z - 604. Is a a multiple of 24? True Let g = 2 - -2. Let j(m) = -4 - 12 + 8 + gm. Is j(9) a multiple of 13? False Suppose 0 = 5u - 3r + 32, 5u - 4r = -12 - 24. Let j(f) = -f3 - 2f*2 - 6f - 4. Is 8 a factor of j(u)? False Let r(f) = 66f + 66. Is 44 a factor of r(15)? True Suppose -4 = -2b, 0 = m + 2m - 5b - 59. Let w = 32 - m. Is w a multiple of 2? False Let z be (0 - -3)77/(-21). Let o(m) = -3m - 15. Let n be o(z). Suppose i - 71 = -2p, i = p - 2i - n. Is p a multiple of 10? False Let h(m) be the second derivative of m*5/20 + 7m4/12 + m2/2 + 2m. Suppose 0y + 4y = -4, -p - 5 = y. Is h(p) a multiple of 15? False Let c(d) = 6d*3 - 8d*2 + 11d - 2. Let m(u) = 6u3 - 9u*2 + 10u - 3. Let n(l) = 3c(l) - 2m(l). Does 21 divide n(3)? True Let w = 368 + -115. Is w a multiple of 7? False Suppose -4x + 0t + 3935 = -t, 3t = 4x - 3941. Does 8 divide x? False Let u = -1372 + 2407. Does 20 divide u? False Let t = 293 - 264. Is t a multiple of 6? False Let y(u) = 79u2. Let l = -1 - -18. Let r = 16 - l. Is y(r) a multiple of 34? False Let h = 34 + -20. Let x = h + 266. Is 10 a factor of x? True Let u = -451 - -681. Is u a multiple of 54? False Let w(t) = 163t. Let v be (-4)/10((-6)/4 + -1). Is 14 a factor of w(v)? False Suppose -16q = 7q - 7360. Is q a multiple of 10? True Let i = -5 + 9. Let o = -1 + i. Does 15 divide 66 + 28/(-4) + o? False Let i(g) = 99g3 - g2 - g. Suppose 3v + 2 = v. Let k be i(v). Does 11 divide -12k/6? True Let f = -11 - -16. Let q(l) = 3l - 3l + 6 - fl - 19. Is q(-9) a multiple of 6? False Let y = -3336 - -4748. Is y a multiple of 30? False Let a(v) = -14v3 + v2. Let p be a(-1). Let g(l) = l2 - 8l + 21. Is 31 a factor of g(p)? False Let d be (-17)/3424/(-2). Suppose m = 25 - d. Suppose -3f = -z - z + m, f = z - 8. Is 4 a factor of z? False Let h(i) = i*3 + 10i*2 + 3i + 5. Let y(w) = 1. Let l(s) = h(s)	{ "pile_set_name": "DM Mathematics" }
0000. -14000000 What is -4620000 rounded to the nearest one million? -5000000 Round 0.0000623 to four dps. 0.0001 What is -0.02125 rounded to 3 decimal places? -0.021 What is 0.0007479 rounded to five decimal places? 0.00075 Round -0.00127532 to 5 dps. -0.00128 What is -0.010604 rounded to three dps? -0.011 Round 0.0027518 to 5 decimal places. 0.00275 Round -784.54 to the nearest 10. -780 What is 0.0005274 rounded to five decimal places? 0.00053 What is 10450000 rounded to the nearest 1000000? 10000000 Round -37819 to the nearest one hundred. -37800 What is 16441000 rounded to the nearest 100000? 16400000 Round 17.6928 to the nearest integer. 18 What is -562070 rounded to the nearest 100000? -600000 What is 353680 rounded to the nearest one thousand? 354000 What is 28.113 rounded to zero dps? 28 Round -154.03 to 0 decimal places. -154 What is 0.084 rounded to 1 dp? 0.1 What is 40100 rounded to the nearest ten thousand? 40000 Round -1313.9 to the nearest 10. -1310 Round -1.18214 to 1 dp. -1.2 What is -522.4 rounded to the nearest ten? -520 What is -0.0038141 rounded to four dps? -0.0038 What is -19790000 rounded to the nearest 100000? -19800000 Round 0.244 to 1 decimal place. 0.2 What is -6.48 rounded to the nearest integer? -6 Round 6234000 to the nearest 1000000. 6000000 Round -31800 to the nearest 1000. -32000 Round -3637 to the nearest 100. -3600 What is -0.00000084131 rounded to seven decimal places? -0.0000008 Round 0.0019329 to three dps. 0.002 What is 2740.86 rounded to the nearest ten? 2740 What is -0.1566 rounded to three dps? -0.157 What is 0.0000030353 rounded to seven dps? 0.000003 What is -870000 rounded to the nearest 10000? -870000 Round 3250 to the nearest 1000. 3000 What is 0.000110717 rounded to 6 dps? 0.000111 Round -8460 to the nearest ten thousand. -10000 What is -25.851 rounded to 1 dp? -25.9 What is 0.00019047 rounded to 6 dps? 0.00019 Round -0.000065097 to 6 decimal places. -0.000065 What is 2706690 rounded to the nearest 100000? 2700000 Round -0.0091 to four dps. -0.0091 Round -0.00000048583 to seven decimal places. -0.0000005 Round 36170 to the nearest 10000. 40000 What is -0.00003194 rounded to six dps? -0.000032 Round -14.119 to 1 decimal place. -14.1 What is 0.06781 rounded to two decimal places? 0.07 Round 945.9 to the nearest ten. 950 What is 0.0000004486 rounded to 7 dps? 0.0000004 What is -44530 rounded to the nearest ten thousand? -40000 Round 0.5866 to two dps. 0.59 What is -0.000073819 rounded to seven dps? -0.0000738 What is 3362 rounded to the nearest 100? 3400 Round -334.4 to the nearest 10. -330 What is -2284.7 rounded to the nearest 10? -2280 Round 1141100 to the nearest one million. 1000000 What is -0.001155 rounded to four dps? -0.0012 What is -323.59 rounded to the nearest integer? -324 What is 92900 rounded to the nearest 10000? 90000 Round -0.00002628 to five dps. -0.00003 What is -0.0000914 rounded to six dps? -0.000091 Round 381 to the nearest ten. 380 Round -0.025033 to four dps. -0.025 What is 322160 rounded to the nearest 1000? 322000 Round 0.004844 to 4 decimal places. 0.0048 Round 755400 to the nearest 10000. 760000 Round 56694 to the nearest 1000. 57000 What is 1730000 rounded to the nearest 1000000? 2000000 Round 0.3654 to 2 dps. 0.37 Round -1899.5 to the nearest ten. -1900 What is -632800 rounded to the nearest 1000000? -1000000 Round -0.0001516 to 5 dps. -0.00015 Round -0.05819 to 2 dps. -0.06 Round 9640 to the nearest 100. 9600 Round 273.91 to the nearest one hundred. 300 What is -0.000126 rounded to four dps? -0.0001 What is -2085750 rounded to the nearest one hundred thousand? -2100000 What is -0.146423 rounded to 2 decimal places? -0.15 What is -0.878 rounded to 2 dps? -0.88 What is -0.00018666 rounded to five decimal places? -0.00019 Round -0.105609 to two decimal places. -0.11 Round 0.19277 to two dps. 0.19 What is -26416000 rounded to the nearest 1000000? -26000000 What is 14.239 rounded to one decimal place? 14.2 What is 11320 rounded to the nearest one thousand? 11000 Round -0.6432 to one dp. -0.6 Round -0.01723 to four decimal places. -0.0172 Round -0.000051401 to 5 dps. -0.00005 Round 0.2421 to 1 dp. 0.2 What is -18800000 rounded to the nearest 1000000? -19000000 Round -299470000 to the nearest 1000000. -299000000 Round -51.114 to the nearest ten. -50 What is -0.000002666 rounded to six decimal places? -0.000003 What is -142.75 rounded to the nearest one hundred? -100 What is 39914 rounded to the nearest one hundred? 39900 What is -0.0000352 rounded to five dps? -0.00004 Round 0.0662 to 2 decimal places. 0.07 Round 3641 to the nearest 100. 3600 Round -351 to the nearest 1000. 0 What is 0.00002916 rounded to six dps? 0.000029 Round -0.00000222031 to six dps. -0.000002 Round 0.00064497 to 4 dps. 0.0006 What is 0.000006918 rounded to seven dps? 0.0000069 What is 3102 rounded to the nearest 1000? 3000 Round 0.0086163 to 4 decimal places. 0.0086 What is -0.005927 rounded to three decimal places? -0.006 Round 0.00001656 to 6 decimal places. 0.000017 What is -2.8744 rounded to 2 decimal places? -2.87 Round 0.0000393763 to six dps. 0.000039 What is -0.0000267705 rounded to 7 decimal places? -0.0000268 Round -10.783 to one dp. -10.8 Round -1767.7 to the nearest 100. -1800 What is 625 rounded to the nearest 100? 600 What is 7.8 rounded to one decimal place? 7.8 Round -0.00214101 to 5 decimal places. -0.00214 Round 0.0039544 to 5 dps. 0.00395 What is -235180 rounded to the nearest one thousand? -235000 What is 682.53 rounded to the nearest one hundred? 700 Round -36530 to the nearest one thousand. -37000 What is -0.088562 rounded to 3 dps? -0.089 What is 5741000 rounded to the nearest one hundred thousand? 5700000 What is 6370 rounded to the nearest 100? 6400 What is -0.0001456 rounded to 4 dps? -0.0001 What is 1094 rounded to the nearest 100? 1100 Round -338.59 to the nearest 10. -340 Round 9.099 to 0 decimal places. 9 Round -0.064244 to 2 decimal places. -0.06 What is -39.35 rounded to the nearest integer? -39 Round -5552 to the nearest 1000. -6000 Round 0.00000713879 to six dps. 0.000007 What is 487.8 rounded to the nearest one hundred? 500 What is 0.0309 rounded to 3 dps? 0.031 Round 536.3 to the nearest 10. 540 Round 2026 to the nearest 100. 2000 What is -0.4209 rounded to 1 decimal place? -0.4 What is 1924.1 rounded to the nearest one thousand? 2000 What is -6767.2 rounded to the nearest one hundred? -6800 Round 57970 to the nearest 1000. 58000 Round 28.693 to the nearest integer. 29 What is -189930 rounded to the nearest 1000? -190000 Round -3.459 to one dp. -3.5 Round 0.0004742 to 5 dps. 0.00047 What is 0.0095314 rounded to four decimal places? 0.0095 What is 0.0000085312 rounded to six decimal places? 0.000009 What is -0.00094 rounded to two decimal places? 0 What is 66.8 rounded to the nearest 10? 70 Round -18.83 to the nearest 10. -20 What is -7884 rounded to the nearest one thousand? -8000 What is -0.51002 rounded to 2 dps? -0.51 What is 3.2828 rounded to 1 dp? 3.3 Round 0.0000130348 to 6 dps. 0.000013 Round -245300 to the nearest 10000. -250000 What is 576870 rounded to the nearest one hundred thousand? 600000 What is 0.008624 rounded to four dps? 0.0086 What is -0.00157 rounded to four decimal places? -0.0016 Round 0.00086 to four dps. 0.0009 What is 23850 rounded to the nearest one thousand? 24000 Round -0.00001112 to seven decimal places. -0.0000111 Round -4095000 to the nearest one hundred thousand. -4100000 What is 0.015196 rounded to five decimal places? 0.0152 Round -0.1933 to two decimal places. -0.19 Round -750.8 to the nearest ten. -750 Round 1345500 to the nearest ten thousand. 1350000 Round 0.029561 to two dps. 0.03 What is 2577900 rounded to the nearest ten thousand? 2580000 What is -107.087 rounded to the nearest integer? -107 What is -0.077138 rounded to two decimal places? -0.08 What is -47.4 rounded to the nearest ten? -50 Round -29.296 to zero dps. -29 Round 27.027 to the nearest integer. 27 What is 0.000795 rounded to 4 decimal places? 0.0008 What is 50276000 rounded to the nearest one hundred thousand? 50300000 What is 16.89 rounded to the nearest integer? 17 What is 0.003725 rounded to three decimal places? 0.004 What is -0.7551 rounded to one dp? -	{ "pile_set_name": "DM Mathematics" }
150m Let q(s) be the second derivative of -698s7/21 + s5/20 + s*3/3 + 5323s*2/2 + 1316s. Find the second derivative of q(c) wrt c. -27920c3 + 6c Let w be (-19 - -39)(-1)/(-4). What is the second derivative of 6t*2 + t - 9341 + 3t + 9340 + wt wrt t? 12 Let w(k) be the first derivative of -5846k*5/5 + 111k*3 + 15k*2/2 + 172. What is the third derivative of w(r) wrt r? -140304r What is the first derivative of 1392s + 762s + 3017 + 1252s + 385 wrt s? 3406 Let i(j) be the first derivative of 155j4/4 + j3 - 3377j2/2 + 1170. Find the second derivative of i(z) wrt z. 930z + 6 Suppose 19b = 37 + 131 - 92. Let m be 2/3(-9)/(-2). Find the third derivative of -189ym + 189y*3 - 33y*2 - 28y*b wrt y. -672y Let o be 8 + -1 + (1 + -1 - (17 + -12)). Let l(b) be the first derivative of 10/3b3 - 18b + 5 + 0bo. What is the derivative of l(a) wrt a? 20a Let i be 24/(-16)28/(-21). Find the second derivative of -ip*5 + 118p + 35p2 - 3216 + 3216 wrt p. -40p*3 + 70 Let r(n) be the second derivative of -517n*7/14 + 147n*3/2 - 290n. What is the second derivative of r(o) wrt o? -31020o3 Suppose -4r - 96 = 128. Let n be ((-16)/r - 82/(-7))/2. Find the third derivative of 3t4 - 2t*4 + 12t*n + 4t2 - t4 wrt t. 1440t3 Let k(i) = 66i*3 - 15i + 1244. Let z(h) = 28h3 - 8h + 622. Let m(c) = -3k(c) + 7z(c). Find the first derivative of m(j) wrt j. -6j2 - 11 Suppose 4147i - 4146i = 3. Let c(k) be the second derivative of 49k - 17/3ki + 0 + 41/2k2. Differentiate c(a) wrt a. -34 Let b(n) be the first derivative of n8/840 - 17n7/840 + n4/24 - 46n*3/3 + 15. Let v(c) be the third derivative of b(c). Differentiate v(x) wrt x. 8x*3 - 51x*2 Let v(m) be the second derivative of -40 + 1/30m*6 - m + 0m*5 - 29/2m*3 + 0m*4 + 91m*2. What is the first derivative of v(a) wrt a? 4a*3 - 87 Let s = -5227 - -5254. Let c(o) be the first derivative of -s + 25/3o*3 + 0o + 0o2 - 31/4o*4. What is the third derivative of c(q) wrt q? -186 Let w be ((-26)/6)/(7/21) + -1. Let r = w - -16. Find the third derivative of -16k*r + 14k*2 - 14k*5 + 2k*5 wrt k. -720k*2 Let y = 93 - 90. What is the first derivative of -69 + 231c*3 + 139c*y - 439c*3 wrt c? -207c*2 Let a(c) = 3061c*2 - 1254c - 2. Let t(p) = -6107p2 + 2512p + 5. Let n(d) = -5a(d) - 2t(d). What is the second derivative of n(v) wrt v? -6182 Let u be 5/2 + (-8)/16. Find the second derivative of -2 + 3g5 - 69g*u - 2g*5 - 451g + 406g wrt g. 20g*3 - 138 Suppose -103u + 98u + 10 = 0. Suppose 10 = uo - b, -2o + 2 = -10b + 5b. What is the derivative of 39d*2 - 5d*2 + 29 - o - 8d*2 wrt d? 52d Let t be (-3)/(-2)(182/21 + 0). Let r = 41 + t. What is the derivative of -31 - 55y*4 + ry*4 - 12 wrt y? -4y*3 Let q(u) be the third derivative of 95u7/21 + u4/12 - 1767u3/2 + 6u*2 - 70u. Find the first derivative of q(b) wrt b. 3800b3 + 2 Suppose -15d + 63 + 27 = 0. Find the third derivative of 65l2 + 8649l*4 - 8649l*4 - 39l*d wrt l. -4680l3 Let g(r) = r3 + r*2 + 2r. Let f(d) = -122d3 - 6d*2 - 58d. Let l = -249 - -250. Let q(b) = lf(b) + 5g(b). Find the third derivative of q(a) wrt a. -702 Let c(n) = 6260n2 - 501n - 21. Let j(b) = -2085b2 + 167b + 6. Let m(z) = 2c(z) + 7j(z). What is the second derivative of m(l) wrt l? -4150 Let i = -12 - -43. Let b = 33 - i. What is the second derivative of -28lb + 21l*2 + 0l + 7l + 6l wrt l? -14 Suppose -78 = 5m + 42. Let d be ((-1095)/12)/(-5) - (-6)/m. What is the third derivative of -18i*2 - 23i + di3 + 0i*2 + 23i wrt i? 108 Let l(p) = 6842p2 + 9726p - 26. Let k(s) = 1711s2 + 2431s - 6. Let x(d) = 13k(d) - 3l(d). Find the second derivative of x(r) wrt r. 3434 Suppose 4g + 143 + 269 = 0. Let v = g - -122. What is the derivative of 12f + vf + 7 + 7f wrt f? 38 Let a(v) = v*2 - v + 1. Suppose -14z = 6 - 62. Let c(p) = -45p2 + 4p + 118. Let u(i) = za(i) + c(i). Differentiate u(n) with respect to n. -82n Let y = 140 - 59. Differentiate -y - 69t + 1 - 150 + 17 - 58 wrt t. -69 Let c(d) be the second derivative of d5/20 - 931d4/4 - d3/3 - 281d2 + 12d + 45. What is the second derivative of c(n) wrt n? 6n - 5586 Let b(j) = j2 - 3. Let o be b(-5). Let d be o/6 - (-2)/6. What is the derivative of -189q*d + 1 + 1 + 197q*4 wrt q? 32q*3 What is the first derivative of -4j*2 - 11360 + 953 - 4710j + 7j4 + 3j*2 - 9j*4 wrt j? -8j*3 - 2j - 4710 Let u(w) be the first derivative of 0w + 1/4w*4 + 0w*6 + 0w*5 + 54 + 5/7w*7 - 17w*3 + 0w*2. What is the third derivative of u(c) wrt c? 600c*3 + 6 Let n(w) = -6789w*2 - 49w + 3517. Let i(l) = 10184l2 + 77l - 5275. Let c(m) = 7i(m) + 11n(m). What is the derivative of c(o) wrt o? -6782o Let g(b) be the third derivative of -103b*4/3 - 1303b*3/2 - 4192b*2. Find the first derivative of g(i) wrt i. -824 Let a(b) be the second derivative of 229b*7/6 - 2b*4/3 - 5b*3/2 - 575b. Find the third derivative of a(u) wrt u. 96180u2 Let y(z) be the first derivative of 4343z*4/4 - 2z*3/3 - 228z + 42. What is the third derivative of y(a) wrt a? 26058 Suppose 4o - t = 37, -t + 6t - 15 = 0. Suppose 0 = 4c - oc + 126. Find the second derivative of 0u + 5u - cu3 + 13u*3 wrt u. -48u Let x(p) = 253p + 215. Let v(c) = -249c - 218. Let h(m) = -6v(m) - 5x(m). Find the first derivative of h(i) wrt i. 229 What is the second derivative of -1 - 23u + 52u - 6694u2 + 172u + 6 - 6 wrt u? -13388 Let g(o) be the first derivative of -751o2/2 - 6271o + 4293. What is the first derivative of g(t) wrt t? -751 What is the third derivative of 6261b3 + b2 + 1590b + 3099b + 587b*4 - 6b*6 - 12524b*3 + 6263b*3 wrt b? -720b*3 + 14088b Let n(s) = -2s + 2. Let d(v) = 6337v*2 - 1840v + 12. Let k(b) = d(b) - 6n(b). Find the second derivative of k(z) wrt z. 12674 What is the derivative of -90700w - 90709w - 1314w*2 + 105 + 181411w wrt w? -2628w + 2 Let q(m) be the first derivative of -1441m*3/3 - 1441m - 1076. Find the first derivative of q(d) wrt d. -2882d Let z(g) be the second derivative of -g4/12 + 833g*3 - 1947g*2 - g + 3224. What is the derivative of z(w) wrt w? -2w + 4998 Let f(g) = -9794g3 - 10308g*2 - 6. Let t(p) = 27p3 - p2 - 1. Let a(s) = -f(s) + 6t(s). What is the third derivative of a(r) wrt r? 59736 Let n = -238 + 242. Find the second derivative of -6 + 6 + 219y*4 - 139y*4 + ny wrt y. 960y2 Suppose -4m - 142 = -4y - 90, 14y - 5m = 119. Let b(s) be the second derivative of -30s + 0 - 37/12s4 + ys*2 + 0s*3. Differentiate b(d) wrt d. -74d What is the second derivative of -81f2 + 61f*4 + 338f + 222f4 + 257f*4 + 2319f + 83f2 wrt f? 6480f*2 + 4 Let s(h) be the second derivative of 1/6h*3 + 0 + 1/2h*4 + 0h*2 - 133h + 13/3h6 - 1/10h*5. What is the third derivative of s(q) wrt q? 3120q - 12 Let v = 1812/11 - 3371/22. Let z(o) be the first derivative of -15 + vo2 - o. What is the first derivative of z(p) wrt p? 23 What is the third derivative of -3140 - 451z*3 + 2434z*3 + 4z + 45z2 + 3156 - 4z wrt z? 11898 What is the second derivative of -33q + 8q*3 - 2 - 2 + 95q + 1 - q*2 - 5 wrt q? 48q - 2 Suppose 3q - 3 = 21. Suppose -10g + qg + 4 = 0. Find the third derivative of -7d*5 - 7d*5 + 7d*5 + 4d*5 + 19d*g wrt d. -180d*2 What is the third derivative of -336i*3 + 404i*3 - 1082i*2 + 1665i*3 - 1029i*2 wrt i? 10398 Find the second derivative of 2y + 135y5 - 55y*4 - 278y5 + y2 - 274 + y*2 + 153y*5 + 0y*2 wrt y. 200y*3 - 660y*2 + 4 Let n = 127 - 79. Let g be (n/42)/(8/28). What is the derivative of -17b*g - 28 + 70b*3 - 70b*3 wrt b? -68b*3 Suppose -166 - 10 = -16d. What is the derivative of 2l + 2l*2 - 111 - 20l*2 + dl*2 wrt l? -14l + 2 Let k(w) be the second derivative of -244w5/5 - 4w4 + w3/3 - 8w. What is the third derivative of k(x) wrt x? -5856 What is the third derivative of -17k*3 - 17k*3 - 3k*5 + 11k*3 + 3072k + 1330k2 - 3074k wrt k? -180k*2 - 138 Let z(w) be the third de	{ "pile_set_name": "DM Mathematics" }
. Let n be (-22)/b6/69. Let k = n - -2959/644. Calculate the common denominator of 49/4 and k. 28 Let m = 17 + -20. Calculate the lowest common multiple of 10m3/(-9) and 9. 90 Suppose 5 = -5p - 3d, -12d = -3p - 9d + 21. Suppose 0 = -4l + 7 + 1. What is the least common multiple of p and l? 2 Let x(j) = 3j*2 - j - 2. Suppose 0 = 2q - 3w + w - 4, -2q + 4w + 4 = 0. What is the smallest common multiple of x(2) and q? 8 Suppose c = -4 + 49. Let q = 761 - 5310/7. Calculate the common denominator of q and ((-33)/c)/(1/(-9)). 35 What is the common denominator of -139/30 and -4 + ((-18)/(-63) - (-1178)/42)? 30 Suppose 10d - 96 = -16. Calculate the least common multiple of d and 16. 16 Calculate the common denominator of -73/10 and (52/20)/((-16)/20). 20 Let q = -8 - -9. Suppose 10 = -r + 6r + 5o, -4r + 3 = -o. What is the lowest common multiple of r and q? 1 Let k = -1791/2 + 919. Find the common denominator of k and -1/44. 44 Let z be (-761)/(-4)(-9140)/136. Let b = z - -12786. Let m = b + -9145/408. What is the common denominator of -119/10 and m? 30 Suppose 4s - h + 6 = 4, 0 = -2h + 4. Suppose sz + 334 = 2z. Let c = -824/5 + z. What is the common denominator of c and 46/7? 35 Let n = -1532/7 - -227. Let c = -4/55 - 1457/385. Calculate the common denominator of n and c. 7 Suppose -4v + v - 6 = 0. Let m(t) = -t3 - 5t*2 - 2t - 2. Let j be m(-5). Find the common denominator of (-561)/36 + v/j and 61/18. 18 Suppose 4u = n + 19 + 125, -5n + 180 = 5u. Let s be 8/u + 286/9. Find the common denominator of -65/22 and (2-1)/(s/69). 176 Let i(z) = 7z3 + 2z - 1. Calculate the smallest common multiple of i(1) and (-5)/10-4 - -7. 72 Suppose -2g - g = -18. Suppose -10 = -5o - 100. Let z = o + 28. What is the least common multiple of g and z? 30 Suppose 27 = 3q + u, -1 = u - 4. Calculate the smallest common multiple of q and 9. 72 Suppose 0 = 3v - 0v - 60. What is the least common multiple of v and 22? 220 Let n(o) = o*3 + 2o*2 - o + 3. Let c(i) = i + 4. Let m be c(-7). Let v be n(m). Find the common denominator of -53/2 and (5v)/(11/(-2)). 22 Find the common denominator of (-51)/(-4) + -2 + 42/24 and -41/12. 12 Let a(v) = 5v2 + 1. Let g be a(2). Suppose 0 = -2k + g - 369. Find the common denominator of -27/2 and k/(-28) - (1 + -1). 14 What is the common denominator of 81/8 and (4/(-12))/(22/303)? 88 Let q = -40 + 46. Suppose -4r - r - 22 = -2g, -8 = -4r. Calculate the smallest common multiple of q and g. 48 Suppose -32w + 29w + 63 = 0. Calculate the smallest common multiple of 24 and w. 168 Let k(h) = -h2 + 3 + 4h*2 - 6h - 2h2. Let g be k(7). What is the smallest common multiple of 4/10 + 116/g and 2? 12 Let j = 8165 - 20384. Let q = j - -146759/12. Find the common denominator of q and 79/16. 48 Let t = -262811/30 + 8759. Find the common denominator of t and 64/9. 90 Suppose -7 = -w - v, 6v + 20 = v. Suppose 5y + w = 31. What is the least common multiple of 2 and y? 4 Suppose -17 = -d - 2d - h, -3d - 5h + 13 = 0. Suppose -22 = -n - 6. Calculate the lowest common multiple of d and n. 48 Let w = 421725337/140802 + 20/23467. Let o = 3008 - w. What is the common denominator of o and -123/10? 30 Let w(n) = -n*2 - 3n + 8. Let j be w(-5). Calculate the least common multiple of 7 and (-4 + (-6)/(-3))/j. 7 Let x(w) = 3w2 - 4w. What is the lowest common multiple of 6 and x(3)? 30 Let n = -1/550 + 2173/275. Calculate the common denominator of 48/7 and n. 70 Let o = 9 + 58. Let k = 4 - o. What is the lowest common multiple of (20/7)/((-18)/k) and 3? 30 Let w be (1 + 0)/(3/1191). Let i = -2792/7 + w. Let o = 108/37 + -2797/185. What is the common denominator of o and i? 35 Suppose 0 = 4n + 5n - 45. Calculate the least common multiple of n and 16. 80 Let n(m) = -m - 8. Let c be n(-6). Let b(l) = l*3 + l + 6. What is the lowest common multiple of b(0) and 1 + -1 - (-13 - c)? 66 Let t = 25 + 10. Suppose 5y = t - 10. What is the smallest common multiple of y and 5? 5 Suppose -2x - 16 = -r, 4r - 5x + 0x - 73 = 0. Suppose -p - 16 = -4b, -17 = -3p - 4b + 3b. Calculate the smallest common multiple of r and p. 44 Let t = 255033/67382 + 4/4813. Find the common denominator of -71/4 and t. 28 Let p = -3267 + 32587/10. Let g be -2 + ((-22191)/(-290))/3. Let t = 412/29 - g. Find the common denominator of t and p. 10 Let a = 13 - 20. Let h(u) = u*3 + 8u*2 + 6u - 5. Let i be h(a). Calculate the common denominator of -16/5 and i/5 + 2/70. 35 Suppose 2i + i = 0. Let l be (-2)/(i - 2 - 0). Find the common denominator of -39/4 and (-2)/(-32)25/l. 16 Suppose -30 = -4t + b - 3, 4t - 21 = -b. What is the lowest common multiple of t and 8? 24 Let f(u) = -3u - 11. Calculate the least common multiple of 16 and f(-15). 272 Let z be 3 - (459 + 2). Let q be (z/(-15))/(14/1725). Let v = q - 1928. Calculate the common denominator of v and -83/10. 70 Suppose x + 10s = 5s + 19, 4x = -5s + 91. Find the common denominator of (-6)/(-2) - (-340)/x and -61/6. 6 Let b = 3233 - 1963. Suppose b = 2j - 7j. Find the common denominator of -113/12 and 1-2 - j/12. 12 Suppose 5i - 323 = -23. Suppose -4z - 110 = -3y, -2y + 109 = -4z + 29. Suppose -i = -5h + y. What is the lowest common multiple of 12 and h? 36 Let r = -3105/4 - -781. Calculate the common denominator of r and 25/(-10)(-123)/(-25). 20 Let p = 10 - -10. Suppose -15 = -5y + 2y. Let s(d) = -d*3 + 7d*2 - 6d - 6. Calculate the smallest common multiple of p and s(y). 140 Suppose -288 = 8q - 20q. Calculate the smallest common multiple of q and 28. 168 Suppose 2i - 12 = -3c, -8 = -2c - 3i + 2i. Calculate the least common multiple of c and 11. 44 Let u = -12505 - -225239/18. Calculate the common denominator of 65/6 and u. 18 Suppose 0 + 8 = 2m - 4f, 3m + 5f = 1. What is the lowest common multiple of 4 and m? 4 Let a = 59 + -35. Let w = a + -14. Let n = 30 - 20. Calculate the smallest common multiple of w and n. 10 Suppose 3k = 5k - 32. Suppose 2v + 1 = -2o + 5, 4o = 4v + k. Calculate the least common multiple of o and 6. 6 Suppose 0 = -2a + a + 5. Suppose -6n + 20 = -2n - f, 0 = n + af - 26. Calculate the least common multiple of 10 and n. 30 Suppose -33285 = -3c - 2c. Let n = -10496 + c. Let q = 23125/6 + n. Calculate the common denominator of 101/4 and q. 12 Let d = -7 - -18. What is the lowest common multiple of d and 6? 66 Let w = 0 + -21. Let x = 27 + w. What is the smallest common multiple of 10 and x? 30 Let a = 194/43 + -7447/688. Let y = -9907/1208 - 64/151. Find the common denominator of y and a. 16 Suppose -3 = -3o + 3. Suppose -oz - 138 - 360 = 0. What is the common denominator of 4/(-14) - z/(-35) and -14/3? 15 Suppose -3r + 2r = 1. What is the common denominator of r - (2 - (-8)/14) and -49/8? 56 Let j be (-8)/(-5) + (-2)/(-5). Let x = 4 - j. Suppose 4s - 16 = -xh - 0s, -5h + 5s = -85. What is the smallest common multiple of 4 and h? 28 Let v = -1553/2 - -819. Let a be (-5)/3 - (-12)/18. Calculate the common denominator of v and (-2 - a)/((-1)/(-8)). 2 Let v be 5079532 - 21/(-2). Let d = -81178035/16 + v. Let u = d + -5910. Calculate the common denominator of 97/4 and u. 16 Suppose -3b = -57 + 24. Let x = b + 7. What is the smallest common multiple of 14 and x? 126 Let a = 105/11 + -1057/22. Let l be 3/5 - (-46372)/(-20). Let s = -20824/9 - l. Find the common denominator of a and s. 18 Let n = 39519264179/11362823274 + -5/47944402. Let s = n - -16/237. Calculate the common denominator of 41/6 and s. 66 Let i = 5 - -31. Suppose -44 = -4j + i. What is the least common multiple of 8 and j? 40 What is the smallest common multiple of 6 and (-2)/2 + 46(-1)/(-2)? 66 Suppose 3y = -4w + w + 9, y - 2w = 12. Calculate the least common multiple of (-21)/(-9) + 1/(-3) and y. 6 Let r(z) = z - 5. Let y be r(8). Suppose -2x = 5p - 35, 0x + yx + 21 = 3p. Suppose pv = 4v + 54. Calculate the least common multiple of v and 20. 180 Let h be 6/(-9) + 17/3. Suppose 24 = -t + ht. Calculate the smallest common multiple of t and (0/1 + -22)/(-2). 66 Suppose 222 = 2y + 3z, -z = -0y - 2*y + 206. Let p = y - 61. Calculate the common denominator of p and -53/4. 4 Let t be (-12)/(0 + -4) - 35. Let q = 49 + t. What i	{ "pile_set_name": "DM Mathematics" }
+ 2. Let v be d(-3). Let r(h) be the third derivative of 0h - 1/60h*5 - 2 - 1/4h*4 - 1/2h*3 - 29h2. Give r(v). 5 Let x(v) be the second derivative of -v6/720 + v*5/60 + 17v*4/12 - 3v*2 - 2v + 223. Let z(k) be the third derivative of x(k). Let w = 0 + 1. Give z(w). 1 Let t(p) = -4p - 35. Suppose 2822u - 81 + 207 = 2804u. Determine t(u). -7 Let g(q) = -9q - q*2 - 466 + 413 + 25q. Give g(12). -5 Let v(h) = h*3 + 6h*2 + h + 9. Let k(o) = 3o*3 + 13o*2 + o + 19. Let z(j) = 2k(j) - 5v(j). Let a be (-1)/(-15)6545. Let n = -213 + a. Give z(n). 3 Let h(g) = 4g*2 + 19g + 22. Let y(z) = -z*2 - 4z - 5. Let c(d) = 2h(d) + 9y(d). Determine c(-6). -49 Let k(t) = 6t2 + 2t + 1. Let y(r) = -5r - 4. Let s be y(34). Let n = 176 + s. Give k(n). 29 Let d(t) = 2t + 383. Let i(l) = -2l - 196. Let c(h) = d(h) + 2i(h). Suppose 0r + 3r = b - 10, 3r + 16 = -2b. Calculate c(r). -1 Let w(p) be the first derivative of -p*4/4 - 11p3/3 + p2/2 + p - 936. What is w(-11)? -10 Suppose o - 3 = 5m + 7, 4m = -5o - 37. Suppose 3i + 14 = -4l, -4l + 7 = -4i - 7l. Let j(k) = 2k2 + 92 - 33 - 5k - 31 - 31 - 3ki. Determine j(o). -3 Let f(o) = -2o*3 + 19o*2 + 22o - 24. Let d(a) = a3 + a2. Let y(l) = d(l) + f(l). Determine y(21). -3 Let l(c) be the third derivative of -c5/60 + c4/4 + c*3/3 + 2c*2. Let f be (0 + (-6)/15)125. Let u = f - -56. Determine l(u). 2 Let x = 4705 + -4704. Let g(o) = 16o2 - 7o + 2. Give g(x). 11 Let f(h) be the second derivative of -h5/5 - h3/6 - h*2 - 14h. Let v be f(-1). Suppose -vb = 2b + 20. Let d(z) = -z + 4. Give d(b). 8 Let w(z) = 37z + 96. Suppose -k + 3m - 77 + 59 = 0, -11 = 2k - m. Give w(k). -15 Suppose 155 = -6u + 239. Let h(p) = 1 + 10p + 8p + 8p - 32p + up. Suppose 3y - y = -5d + 2, 2y = -3d + 2. Calculate h(y). 9 Let b be -7 + (-6 - -8 - -9). Suppose -4i = bf + 36, i + 3f - 6f - 11 = 0. Let k(o) = -o3 - 7o*2 - 7o - 5. Determine k(i). -25 Let i(v) = -93v2 - 369v + 22. Let t be i(-4). Let f(s) = -2s - 7. Determine f(t). -27 Suppose 4z - 1144 = -18z. Suppose 108 = -40f - z. Let s(c) = -c + 1. Determine s(f). 5 Suppose 0 = 4w, -4d - 20w = -18w - 4. Let t(g) = 6g3 - 3g*3 - 657g*2 + 659g*2 - d. Calculate t(1). 4 Let s(x) = -8x*2 - 160161x + 4 - x*3 + 160153x - 2. Calculate s(-8). 66 Let a(v) = -3v - 1. Let q = -120 + 118. Let n = q + 3. Give a(n). -4 Let g(m) be the first derivative of -m3/3 + 13m*2/2 + 140m + 3283. Give g(-7). 0 Let r be (-12 + 2)2/(-10). Let c(f) = -74f*2 + 138fr + f3 - 60f2. What is c(-4)? 0 Let i(x) be the first derivative of x4/4 - 7x*3/3 + 3x*2 - 8x - 155. Suppose -h - 2 = -8. What is i(h)? -8 Let d(j) = -75j + 25j + 22j + 25j + 230 - 211. Determine d(8). -5 Let c(z) = -z*3 - 3z*2 + 13z + 9. Let g = 10943 + -10948. What is c(g)? -6 Let y(v) be the first derivative of 87 + 0v + v2 - 4/3v*3. Let l be 3 + -2 + 2/2. What is y(l)? -12 Let g(b) be the first derivative of -2 - 7/4b4 - b + b2 - 2/3b3. Suppose -6y - 527 = -533. Give g(y). -8 Let d(a) = -567a - 77. Let p(z) = z3 + 3z*2 - 15z - 19. Let y be p(-5). Let k(r) = 44r + 6. Let h(o) = yd(o) + 77k(o). Calculate h(-1). 14 Let z(x) = x3 + 6x*2 + 7x + 5. Suppose 0 = 2o - 7c - 18, -29o = -25o + 5c + 40. Determine z(o). -5 Suppose 2t + 30 = -2v - 34, 3t = -15. Let s(l) = 2l + 47. Let n be s(v). Let h(p) = p + 12. What is h(n)? 5 Let v be 2/(-8) - (483/28)/3. Let z(h) be the third derivative of -h5/15 - h4/4 - 3h*3/2 - 23h2. Let q(u) = u2. Let x(d) = -3q(d) - z(d). Give x(v). 9 Let j(z) = -13 - 1327z - 2z2 - z3 + 1334z - 4z2. Give j(-6). -55 Let x(c) = 8c*2 - 2c. Let a(l) = -14l + 67. Let d be a(27). Let h = -309 - d. Calculate x(h). 28 Let k(c) be the first derivative of -c3/3 - 15c*2/2 - 18c + 299. Determine k(-10). 32 Suppose 18 = -20f + 17f. Let k be (f/5)/((-44)/(-330)). Let i(p) = -p*2 - 7p + 11. What is i(k)? -7 Let j(o) = o + 30. Let u be (-8)/(-2) + -9 - (4 + 15). Give j(u). 6 Let x(r) = -14r - 182. Let u(b) = b - 38. Let z(s) = 5u(s) - x(s). Calculate z(1). 11 Let g(r) be the first derivative of r*4/2 - 10r*3/3 + 9r*2/2 + 7r - 1. Let w be g(6). Let y = -126 + w. Let v(j) = j*2 - 10j + 3. Calculate v(y). -18 Let s(h) be the third derivative of -1/24h4 + 1/6h*3 - 30h*2 + 7/120h*6 + 0h - 1/60h5 + 0. Calculate s(1). 6 Let p(s) = -16 + 3s + 4s - 3s. Suppose 3c - 25 = -5j - 2c + 9c, 4c = 0. Determine p(j). 4 Let x(v) = v3 - 22v*2 + 38v + 81. Let t be x(20). Let h(u) = -123 + 32 + 30 + t + u. Calculate h(13). -7 Let o(a) = 16420a2 - 32846a*2 + 5 + 3a + 16430a2 - 2a3. Calculate o(4). -47 Let y = 5019 + -5043. Let f(j) = j2 + 22j - 27. Give f(y). 21 Let r(j) be the third derivative of j6/120 + 11j5/60 + j4/2 + 3j3 - 2404j*2. Give r(-10). -2 Let a(t) = -2t - 1. Let u(s) = s + 1. Let n(x) = x + 1. Let l be n(8). Let z be (-6)/l(-1 - 8). Let i(m) = za(m) + 3u(m). Determine i(-2). 15 Let p(u) = -5u*2 + 164u + 27. Let f(l) = -l*2 + 175l + 2277. Let n be f(-12). Calculate p(n). -6 Let a = 45/16 - 667/240. Let y(o) be the third derivative of 0o - 7o*2 + 1/120o*6 - ao*5 + 0 + 1/3o*3 - 1/24o4. Give y(2). 0 Let h be 12/2 + 6 + (-11)/(11/7). Let a(d) = -d2 + 15d - 55. What is a(h)? -5 Let m(k) = -7k - 181. Let p(a) = 28a + 366. Let y(h) = -5m(h) - 2p(h). What is y(8)? 5 Let m(y) = 10y + 32. Let j(f) = 68 - 2f - 207 + 71 + 62. Let z(a) = -11j(a) - 2m(a). What is z(1)? 4 Let o(k) = k - 2k + 2 - 12. Suppose 7m + 20 = 2m, 2u - 4m - 56 = 0. Suppose -2b = -3p + 15, 5p = 15b - ub - 75. Calculate o(b). 2 Let c(f) = -f2 - 7f - 5. Let o(z) = 6z2 + 3z + 11. Let q(m) = 7m2 + 2m + 12. Let a(d) = 6o(d) - 5q(d). Let r(j) = 5a(j) + 6c(j). Calculate r(3). -15 Let u(s) = 12s2 - 11s - 3. Let d(b) = -5b2 + 5b + 2. Let q(t) = -5d(t) - 2u(t). Suppose 0 = -5o + 4f + 9, -8o + 5o - 5 = -5f. Give q(o). 6 Let n(w) = 2w*2 + 4w + 4. Let x be n(-4). Let q be ((-21)/12 - -2)x. Let l(s) be the second derivative of s3/3 + s2/2 + s + 5. What is l(q)? 11 Let l(a) = -a - 29. Let q be (2 - 5/2) + 897/(-138). Calculate l(q). -22 Let b(x) = -x3 + 6x*2 + 10x. Suppose -6 = 24v - 22v. Let k be (10/v + 1)30/(-10). Calculate b(k). 21 Let v(i) be the first derivative of 35i*4/24 + 5i*2/2 - 2i - 10. Let n(l) be the second derivative of v(l). Give n(1). 35 Suppose 422z + 3696 = 6228. Suppose 5y + 2n + 0n - 20 = 0, 3n = 5y + 5. Let m(a) = 3a2 + 2a - 2 - 2a2 + 5ay - a3. Calculate m(z). 10 Suppose 42i + 595 - 721 = 0. Let w(c) be the first derivative of -13 + 1/4c*4 - c - 1/2c*2 + 2/3c*i. What is w(2)? 13 Let g(f) = 16f*3 - 3f*2 + 2f. Let h be -2((6 - 7)/2 + 0). Determine g(h). 15 Let y(u) = 10u - 79. Suppose -1160 = -167q + 343. What is y(q)? 11 Let j(r) = r3 + 17r*2 + 42r + 5. Let v be j(-14). Let y(z) be the first derivative of 6z - v + 1/2z*2. Give y(-6). 0 Let o(g) = -g - 6. Suppose 4z - 4b = 316, -3b + 4 = 7. Suppose -31w = -5w + z. Give o(w). -3 Let b(a) = 16a - 186. Let l be (37 + (-615)/30)4/6. What is b(l)? -10 Let x(p) be the first derivative of -p*4/4 - 5p3/3 - p2 + 3p - 28. Suppose -2j - 3j = 20. Let t be (-2 - j/3)6. Give x(t). -5 Suppose -8 = 5u - 5m - 3, -4u + m = -11. Suppose 3s = 3j + 3 - 15, 20 = -5s + uj. Let z(y) be the first derivative of -y2/2 + 3y - 1. What is z(s)? 7 Suppose -5c = -n - 3, 3n - 8 = -0c - 2c. Let m = c + -4. Let p(f) = -f*2 - 5f. Let j be p(m). Let g(z) = -z + 8. Give g(j). 2 Suppose 0 = -3v - 4o + 22, 2v - 2o - 2o + 12 = 0. Let p(d) = 3012 - 6027 + 4d*2 + 2d + 3014 - 4d. Calculate p(v). 11 Let o(l) be the first derivative of l4/4 + l3/3 + 5l*2/2 + 4l + 1465. What is o(-3)? -29 Let l(c) be the first derivative of 13c2/2 - 37c + 2122. Determine l(3). 2 Let b(d) = -2d2 - 7d + 13. Let q(h) = -h*2 - 3h + 6. Let z(w) = -b(w) + 3q(w). Calculate z(3). -10 Let n(t) = -4t + 1. Let g(v) = -46v + 20. Let w(l) = -2g(l) + 22n(l). Calculate w(12). 30 Let p be 1122/(-935)(-10)/(-3). Let n(v) = v*3 + 6v**2 + v - 10.	{ "pile_set_name": "DM Mathematics" }
ond biggest value in 0.3, 1, c, 5/13, -2/3? 1 Let c = -6570.4 - -6569. What is the biggest value in -8, c, 1/4, 0.1? 1/4 Let p = 16.239 + -16.039. What is the second biggest value in 5/4, p, 0, 0.4, -1/57? 0.4 Let r be ((-87)/1131)/((0 + 1)/(-2)). Let h be 12/16 + (-28)/80. What is the fourth biggest value in r, h, -1/4, 20? -1/4 Let w = -10151 - -10136. Which is the fourth smallest value? (a) -0.01 (b) -0.4 (c) -2/15 (d) w (e) 11 a Let z = 9804 - 9812. Which is the second biggest value? (a) 0.5 (b) -1 (c) z b Let g be ((-4)/61)/((3 - 1)/(-1)). Which is the smallest value? (a) -122 (b) -1 (c) 0.1 (d) g a Let w = -6759 + 6720. Let n = 1872/17 - 110. What is the biggest value in w, n, 1? 1 Suppose 16v + 822 = 95v + 58v. What is the biggest value in -22, 2/15, 0.1, v? v Let h = 199 - 136. Let o be 34/119 + (-165)/h + 2. Which is the fourth smallest value? (a) -4 (b) -1/4 (c) o (d) -17 b Let n = 54.59 + -55. Let y = -0.134 + 0.124. Let f = n - y. What is the third smallest value in f, -4/7, -3/8? -3/8 Let p = 14.9 + -22.9. Let o = -679 - -675. Which is the third biggest value? (a) o (b) p (c) -5 (d) 0 c Let q = 3.28 + -4.28. Let s = 7.2 + -7.1. Which is the second biggest value? (a) -2 (b) q (c) -12 (d) s b Let k = -27228.7 + 27229. Let j = -52 + 466/9. Which is the third biggest value? (a) j (b) 0.05 (c) k a Let k be 16/20 - 4/10. Let n = -172/425 - -2/425. Let i = -12 - -47/4. Which is the biggest value? (a) n (b) i (c) k c Let a = 497 - 1989/4. Let v = a - -15/44. Suppose -b = 6w - 2w - 31, -5b = 4w - 27. What is the third biggest value in w, v, -0.4? -0.4 Suppose g - 3 = 747h - 742h, -3h - 7 = 2g. What is the smallest value in g, 5, -2/215? g Let t(x) = -2x3 + 9x*2 + 4x. Let d be t(7). Let y = 431/2 + d. Which is the second smallest value? (a) 4 (b) y (c) 35 a Let b = -2056 - -2058. What is the smallest value in 0.4, 1/6, 2.76, b? 1/6 Let z be 1 + (4/10 - (-851)/(-592)). Which is the smallest value? (a) z (b) -6 (c) -5 b Let x = -2031 + 2030.8. Let f(k) = -20k + 3. Let q be f(4). What is the third biggest value in 0, x, q? q Let j = -149.4 - -149.1. What is the fourth smallest value in j, -69, -2, 0? 0 Let v = 63.69 + -65.29. Let f = -0.1 - 1.5. Let x = f - v. What is the biggest value in 3, x, -21/4? 3 Let u = 0.1826 + -0.1026. Which is the third biggest value? (a) 2 (b) u (c) 6 b Let s be 2/14 + (470724/(-51072) - -9). Let a = s - 1/32. What is the smallest value in a, 0.8, -3/8? -3/8 Suppose -12f = -13f + 3, -2u - 393 = f. Suppose -3w + 18 = -5p + 58, 2w + p + 5 = 0. Which is the third biggest value? (a) 4/3 (b) u (c) w b Let j be (-34)/(-17)(-1)/5. Suppose 2l + 4320 = -10l. Let k be ((-16)/l)/((-3)/(-60)). What is the biggest value in k, 0, j? k Suppose -14d + 11d = -5w - 69, 3w + 19 = 5d. Suppose 3o = 3x - 0x - 27, 4x - 2o - 28 = 0. Which is the second smallest value? (a) x (b) w (c) -2/5 c Let z(s) = s*3 - 12s*2 - 15s + 307. Let v be z(11). Which is the third smallest value? (a) -4 (b) -0.14 (c) v c Let k = 13.03 + -13.03. Let r = 18869 - 150691/8. Let y = 15937/488 - r. Which is the third biggest value? (a) 4 (b) y (c) k (d) -1 c Let z = -7.557 - -3.457. Let n = 6 + -9.9. Let f = z - n. Which is the second smallest value? (a) 5 (b) -9/2 (c) f c Let x be 45/(-360)12/9(-18)/(-9). Let f = 0.06 - 0.36. Let p = -0.8 - f. Which is the third smallest value? (a) 0.2 (b) p (c) -4 (d) x d Let l = 17266 + -17269. Let x = 0.31 + 0.09. Which is the third biggest value? (a) l (b) x (c) -28 (d) 3 a Let q be (-3510)/15(-1)/3. Let p be (-6)/q + 270/(-39). What is the biggest value in p, -1/6, -2/9? -1/6 Suppose 8 = 2t - 3u, -603t = -606t - 5u - 7. Which is the third biggest value? (a) t (b) -0.1 (c) 5 (d) -1.1 b Let g = -40.6 - -38. Let o = 3 + g. Which is the third smallest value? (a) 0.5 (b) -3 (c) -7 (d) o d Let y = 1406 - 1404. Let k = 2/51 - -83/51. What is the second biggest value in 1, -33, k, y? k Let z = 0.4773 - 0.1773. What is the second smallest value in 2, -29, z, -1.1? -1.1 Let r = 28 + -77. Let v = r + 38. Let q = -11.05 - v. Which is the second smallest value? (a) -3 (b) q (c) -2/5 c Let p = 3624 + -3624.009. Let d = -141/10 + 83/5. What is the biggest value in p, -2, d, 3? 3 Let y = -17/12 + 167/84. Let o = 47.64 - 47.24. Which is the smallest value? (a) 2 (b) -3/2 (c) o (d) y b Let p = 224.01 - 240.4. Let t = -16.69 - p. Let b = 580/4641 - 2/273. What is the fourth biggest value in -3, 4, t, b? -3 Let c = 8.0088 - 1.0088. What is the smallest value in c, 2, -0.132? -0.132 Let x = -3673 - -3679. Which is the fourth biggest value? (a) -6 (b) 1/16 (c) x (d) -1 a Let q = 223 + -228. Let i(x) = -14x - 72. Let l be i(q). Which is the third smallest value? (a) -1 (b) -13 (c) 5 (d) l a Let z = 3041.1 - 3043.1. What is the biggest value in z, -3002, -3? z Suppose 5c - 17 = -4w, -3w - 16 = 3c - 25. What is the third smallest value in 36, 0.4, -3/4, w, 0.1? 0.1 Let q be 6/81 - (-3)/(-1863). Which is the biggest value? (a) 0.3 (b) 3 (c) q b Let r = -123 + 119.64. Let d = r - 0.14. Let a = 1.5 - d. What is the third smallest value in 2/9, a, -4? a Let m be (-3)/(-12) - (-114)/(-8). Let y be (1/4)/(m/(-16)). Let n = y - 24/35. What is the second biggest value in n, 2/9, -0.01? -0.01 Let l = -3.5 + 3. Let t = 128132 - 128145. What is the third biggest value in t, -2/3, l? t Suppose -28 = r - 5v + 5, -21 = -7v. Let w be (4/(-5))/((-3)/15). What is the third biggest value in r, 1, w? r Let k = -203.4 + 210. Let v = 10.6 - k. Which is the second smallest value? (a) v (b) -140 (c) 0.3 c Let q = 767 + -391. Let j = -378 + q. What is the second smallest value in -0.22, j, 3? -0.22 Let j be (-8)/(8/7)(-4 + -9 + 11). What is the second biggest value in j, 7, -2, 5, -2/11? 7 Let w = 0.001 - -0.609. Let t = w + -0.41. Let x = -93.5 - -94. What is the fourth smallest value in 5, x, -0.5, t? 5 Let a be ((-1454)/(-48))/((-1)/3). Let s = a + 91. Let x(c) = -c*3 + 23c*2 - 167c + 316. Let w be x(3). What is the third smallest value in -4, w, 0, s? 0 Let g = 12 + -11.9. Let f = -0.1972 + -3.8028. What is the third smallest value in f, g, 4/7? 4/7 Let t = 33/100 - 41/200. Let w = 2 - 7. Let u be 2 + (-17)/5 - -1. Which is the fourth smallest value? (a) t (b) 1 (c) w (d) u b Let o = -2.1709 - -0.0009. Let m = o + 1.97. Let w = -819/170 - -47/10. What is the third biggest value in -3, -0.5, m, w? -0.5 Let z = -6 + 2. Suppose 238b + 303 = 541. What is the third smallest value in z, -5, -2/15, b? -2/15 Let z = -3376.9 + 3378.9. What is the fifth biggest value in -1/3, -6, z, 14/5, -0.4? -6 Let q = -32578 - -293200/9. What is the second smallest value in -5, q, 181.1? q Let r be ((-5)/(-2))/(10/(-340)). Let q = -80 - r. Which is the second biggest value? (a) 4/3 (b) 0.5 (c) q (d) 0.01 a Let k = -12.498 + 7.498. Let z = -9 + 13. Which is the third smallest value? (a) z (b) k (c) -3/4 (d) -0.07 d Suppose -2752g - 6420 = -2782g. What is the second smallest value in 3, 7, 1/7, g? 3 Let o = -0.45 + -0.05. Let s be 14/6 - (-1705)/(-465). What is the smallest value in s, 1/12, o, 5? s Let n = 1250.1 - 1250. Suppose -2y - 5 = 3. What is the second biggest value in y, 4.4, n? n Let m = -8756 - -8760. Which is the fourth smallest value? (a) m (b) 1.3 (c) -1.02 (d) 1 a Let t be -6(35/(-175))/(((-54)/(-20))/(-9)). Which is the third biggest value? (a) -3/2 (b) -2/9 (c) -2 (d) t c Let s = -18.632 + 17.632. Which is the second smallest value? (a) -2 (b) s (c) -245 a Let w = -78 + 94. Let b be (w/1340)/(2/(-5)). What is the fourth biggest value in b, 0.2, 3, 0.1? b Let j = -2.872 - -2.772. What is the second biggest value in -4, j, -0.443? -0.443 Let m = -77 + -149. Let j = -680/3 - m. What is the fourth smallest value in -0.37, 0.5, 1, j? 1 Let a(c) = -193c + 382. Let f be a(2). What is the biggest value in 3, 0.3, f? 3 Let z = 113300/9 + -12586. Which is the fourth smallest value? (a) -0.3 (b) 1/6 (c) -1/3 (d) z d Let l = 2696 - 5393/2. Which is the third smallest value? (a) 3/5 (b) -1 (c) -0.11 (d) l c Let f = -31.26 + 31. Let p = -0.04 + f. Let a = 0.63131 + -1.13131. What is the second smal	{ "pile_set_name": "DM Mathematics" }
- 4. Let i be o(-10). Let f = i - -83. Let r = -74 + 816/11. Which is the nearest to 2/3? (a) r (b) f (c) -2/13 a Let v = -13 - -18. Let k = 51723/43 - 1203. Let z = 152/473 + k. Which is the closest to 1? (a) z (b) v (c) 4/5 c Let l = -133 + 398/3. What is the nearest to l in 0.3, -0.4, -1/5? -0.4 Let y = -6337/2 - -3254. Let a = 84 - y. What is the closest to -1 in 0.4, a, -0.3? a Let m = -468.8 + 469. Suppose 0 = 2j - 3j - 2. Which is the closest to j? (a) 2 (b) m (c) 2/7 b Let m = 467/2 - 233. Which is the nearest to m? (a) 0.13 (b) 0 (c) 5 a Let l = -4/8595 + 3034051/34380. Let w = l + -89. Which is the closest to -4/5? (a) w (b) -0.5 (c) 5 a Suppose 74c = 82c + 16. What is the nearest to c in -5, 3/2, 3? -5 Let w = 23.7 + -24. Which is the nearest to 1/4? (a) -1 (b) -2/7 (c) w (d) 2/19 d Let z(d) = -d*3 + 13d*2 - 13d + 15. Let p be z(12). Let s = -22.3 - -22. Which is the nearest to s? (a) p (b) -3/2 (c) -0.5 c Let k = 45.8 + -38.8. What is the nearest to -1/3 in 0.3, k, 3? 0.3 Let h be (-1)/(5((-36)/10 + 4)). What is the nearest to -2 in -0.2, h, -3/8? h Let k = -0.23 + 0.03. Suppose -f + 13 = 71. Let g = f + 404/7. Which is the nearest to -0.1? (a) k (b) g (c) -2 a Let o = -589 - -588. Let n = -1.5 + -0.5. What is the nearest to o in n, -1/2, 3? -1/2 Let s(c) = -6c + 70. Let q be s(12). Let k = -32/7 - -188/35. What is the closest to -0.1 in -0.2, q, k? -0.2 Let z be 0/2 + 1/1. Let h = -2.7 + 2. Let c = h + 5.7. What is the closest to 1/4 in 3, c, z? z Let q = -4.973 - 0.027. Let j = -4.7 - q. Which is the nearest to 3? (a) -5 (b) 0.1 (c) j c Let i = 581/4 - 145. Let h = -3.2 + 3. What is the nearest to -1 in h, 1, i? h Let h = 97.6 - 103.6. What is the closest to -1/3 in h, -0.2, 5, -0.4? -0.4 Let v be (-4)/(-6) + (-10)/6. Let i = 0.036 + 0.544. Let g = i + -0.28. Which is the nearest to -0.2? (a) g (b) -0.1 (c) v b Let l be (-3)/((-30)/35) + -4. Let x(z) = 0z2 + 3z*3 - 2z*3 - 4z*2 + 5z*2 + 1. Let i be x(-2). Which is the closest to l? (a) 6 (b) i (c) -1 c Let i = 2.7 + -19.7. Let p = i - -16.9. Which is the closest to p? (a) 1 (b) 0 (c) 1/4 b Let l = 22 + -19. Suppose -u + b + 5 = -0u, -lb = 9. What is the closest to -1 in 0, u, -0.2? -0.2 Let y be (2/20)/((-16)/8864). Let t = 55 + y. Which is the nearest to -1? (a) 1 (b) t (c) -1/4 b Let q(k) = -k - 7. Let j be q(-4). Let h = 125.7 - 125.2. Which is the nearest to 0.3? (a) j (b) 0.2 (c) h b Let j = 73 - 69. Let s = -2 - 1. Let c(p) = -5p + 49. Let k be c(10). What is the closest to k in j, -0.2, s? -0.2 Let j be -2 - (46/(-11) - -2). Let g = 8830.9 - 8831. What is the closest to g in j, -1/6, -1/2? -1/6 Let x = -0.5 - -1. Let s be (-2 + 5)/(3/6). Let z be s/33 + 6/88. Which is the closest to 0? (a) -2/3 (b) x (c) z c Suppose 15h - 16h - 3 = 0. Let i = 312/7 + -45. Which is the nearest to 1? (a) i (b) h (c) 3/5 c Let n be (-3)/((-12)/16) - 306/72. Which is the closest to 1? (a) n (b) -22 (c) -2/5 a Let q = -1/39 + -151/195. What is the closest to q in 1, -4.4, 4? 1 Let f = 11 - 8. Let h = 3.1 - f. Let o = -569/7 - -81. Which is the closest to h? (a) 1 (b) o (c) -4 b Let s = -22312 + 22311.2. Let j be ((-8)/70)/(2/(-5)). What is the closest to s in -2/5, -0.3, j? -2/5 Let p = 0.7 + -0.56. Let s = 0.24 - p. Let f = 1.29 - 0.89. Which is the nearest to s? (a) 0.1 (b) f (c) -4 a Let m = 2.41 + -2.41. Which is the nearest to -3? (a) m (b) -0.3 (c) -1/4 b Let h = -1.23 + 0.82. Let a = 0.4 + h. Let p = -0.11 - a. What is the closest to p in 5, 2/5, 0.2? 0.2 Let j = 49 + -47. Let p = -105 + 105.5. Which is the nearest to 0.1? (a) 2/3 (b) j (c) p c Let o = -194 + 189. Which is the nearest to 0? (a) o (b) 0.4 (c) 2/13 (d) 1.8 c Suppose 9p - 328 = -364. What is the closest to -1 in 3/10, p, 5? 3/10 Suppose 2n = 3y - 11, 5n - 4y = n - 12. Suppose 4x - nx + 4 = 0. Let v = -1 - -1/2. Which is the nearest to v? (a) 1/4 (b) x (c) -0.3 c Suppose 7s = 2s - 315. Let x = 5015/76 + -123/38. Let v = x + s. Which is the nearest to 0? (a) 2 (b) 4 (c) v c Let l be (-1834)/(-393)3/7. Let d = 128 + -1153/9. Which is the nearest to 2? (a) l (b) d (c) 0.4 a Let u = -422 - -425. Let x = 1.1 + -0.1. Let k = -3 - -2.5. What is the nearest to u in k, 2/11, x? x Let w = -0.81 - -0.71. What is the nearest to -1 in 0.3, -0.06, w? w Let s = -3 + 4. Let i be -2 + 3 + -4 - -8. Which is the nearest to 1? (a) 0.5 (b) s (c) i b Let g(k) = k + 6. Let o be g(-5). Let i = -4.01 - 29.29. Let p = 33 + i. Which is the closest to o? (a) 3/7 (b) -1 (c) p a Let s = -21 - -99/5. Let u = s + 4/5. Which is the closest to 2/5? (a) u (b) 1 (c) -1 b Let z = 0.0943 + 0.5057. Which is the closest to -1/2? (a) -5 (b) 5 (c) z (d) -2/11 d Let p = 0.19 - -0.11. Let h = -0.1 - p. Let m = -0.08 + -0.02. What is the nearest to m in h, -4, -1/6? -1/6 Suppose q + n = 5q - 1, -5n - 5 = -3q. Which is the nearest to 1/2? (a) 19 (b) 1/3 (c) 3 (d) q b Let s = 3.01 - 3. Let y = -99.01 - -104. Let q = s + y. Which is the closest to 1? (a) q (b) -2 (c) -5 b Let m be (-86)/(-590)(8 - 4). Let u = m - -1/59. What is the nearest to -0.4 in u, 4, -10? u Let w be -2 + (-3)/((-6)/5). Let y = -13472 - -13471. Which is the nearest to y? (a) w (b) -5 (c) 0.8 a Let m(l) = -l*3 + 12l*2 + 14l - 14. Let v be 13 + (1 - 1)/(-1). Let k be m(v). Suppose -5 = 3a + 28. What is the closest to k in -0.5, a, 0.5? -0.5 Let f be ((-270)/42 + 7)1. What is the nearest to -2 in 5, 4, f? f Let s be (-21 - -23)/(1 - -7). Which is the closest to s? (a) 1.4 (b) 0.4 (c) -2 b Let l = 0.79 - 5.79. Let h = -9 - -8. What is the nearest to -0.1 in h, l, 3/4? 3/4 Let o = -8 - -8.3. Let z = -83.072 - -83. Let w = -0.272 - z. Which is the closest to 2/9? (a) w (b) o (c) 0.4 b Let i = 11 + -10. Let j = 0.04 + 0.26. Let v = 0.035 + -3.035. What is the closest to 1/8 in j, v, i? j Let v = 307 + -306.6. Which is the nearest to -0.1? (a) -24 (b) -0.1 (c) v (d) -1/9 b Let l = -336.2 + 336. Which is the closest to -0.1? (a) 1 (b) l (c) 5 b Let o = 157 - 160. Let a be (-6)/9 - 17/(-3). Suppose a = -3b - 2b. What is the nearest to o in 2/9, -2, b? -2 Suppose -57 = 5s + 23. Let v = s - -84/5. Which is the nearest to 0.2? (a) -4 (b) v (c) 3/5 c Let c = -1523/13 + 117. Let p be 2/(-6) + (-1)/(-12). Let t = 0.346 - -0.054. What is the closest to p in -3, c, t? c Let h be 2/4 - 1612/120. Let s = h - -37/3. Let z be (1/(-3))/1 - -1. What is the closest to z in 1/5, 2/23, s? 1/5 Let g = 0.03 + 4.97. Let p(r) = r2 + 22r - 26. Let q be p(-23). What is the nearest to -1 in q, -2, g? -2 Let i = 246 - 245.6. Which is the nearest to 5/2? (a) -2/5 (b) -5 (c) 2/3 (d) i c Let l = 21.85 + -22.25. Which is the closest to -2/3? (a) -0.2 (b) -3 (c) l (d) 4/5 c Let x = 5 - 4. Let j = 0.2 + 4.2. Let t = -4.6 + j. What is the nearest to 0.02 in -3, x, t? t Let v = -3.18 + 3.38. Which is the nearest to -4? (a) -5 (b) 1 (c) v (d) -0.3 a Let r = -175/6 + 88/3. What is the closest to -12 in -3, -1, r? -3 Let o be (-4)/2222/(-32). What is the closest to -22 in -3, 2/15, 0.5, o? -3 Let y = 68 - 42.5. Let k = y + -26. Let z = -4.5 + 5. What is the nearest to 2/3 in -2, z, k? z Let w = -3718/5 + 744. Let s = -1 + -9. Let x = -16 - s. Which is the closest to 2? (a) 0 (b) w (c) x b Let z = 56.093 - 0.093. Let j = -56.5 + z. Which is the nearest to -3? (a) -2/15 (b) -2 (c) j b Let t be 21/(-9) + -1 + 3. Let d = 3.4 + -3. Let r(x) = -4x - 20. Let g be r(-6). Which is the nearest to -1? (a) g (b) d (c) t c Let v = -126.33 - 11.77. Let p = v + 138. Let y = -377/8 + 47. What is the nearest to p in 2/9, -0.4, y? y Let u be (40/(-15))/(-4)(-114)/4. Which is the nearest to 0? (a) u (b) 0.1 (c) -0.4 b Let i = 94.2 - 94. What is the closest to 0.1 in i, -5, -1, 2? i Let k = 31 - 59/2. Let s(f) = -f3 - 5f*2 + 11f - 24. Let j be s(-7). What is the closest to 6 in j, 3/7, k? k Let d = 56.03 + -0.03. Let j = 52 - d. What is the nearest to -1 in j, -1, 0? -1 Let r be 2*(-15 - 189/(-12)). Let y = 0.02 - 0. Which is the closest to -0.2? (a) y (b) 0.1 (c) r a Let c(h) = -h + 4. Let q be c(3). Let m = -167 + 1003/6. What is the nearest to m in -4, q, -0.	{ "pile_set_name": "DM Mathematics" }
72? 7671.1984 What is 0.06666 times -16626? -1108.28916 Product of 138 and 1653.769. 228220.122 Work out -0.076 * 0.05172426. -0.00393104376 Calculate 22.1564-0.2. -4.43128 Multiply -581 and 5845.6. -3396293.6 What is the product of 30.242227 and -1? -30.242227 What is the product of 68695 and 350? 24043250 What is 0.1 times -336667? -33666.7 -1.9215.2279 -29.237568 What is the product of -1054 and -28512.7? 30052385.8 20134-52 -1046968 Multiply 45210743 and 0.2. 9042148.6 -0.26 times 31547290 -8202295.4 What is the product of 66831864 and -1? -66831864 Work out 0.008984 -1013. -9.100792 Work out 0.031337 * 214. 6.706118 Calculate -0.3695-1758. 649.581 Calculate 203294376-1. -203294376 Calculate 5675111.5. 652636.5 Product of 6285.1092 and -0.5. -3142.5546 Multiply 5 and 2419999. 12099995 -2 5070.357 -10140.714 Multiply -316886 and -10.3. 3263925.8 What is the product of 0.02 and 7175.4328? 143.508656 Work out 27 * 12695732. 342784764 -8455990.2 -169119.8 What is the product of -0.03032 and -0.015972? 0.00048427104 Work out -698827 -4. 2795308 Multiply -2617991 and -0.045. 117809.595 Calculate 11468-735. -8428980 Calculate -664183.512.3. -8169457.05 What is -0.1 times 35730.79? -3573.079 7 times 2153090 15071630 Product of 1300.921 and -0.7. -910.6447 Product of 0.2791187 and -0.06. -0.016747122 1.879 * -151029 -283783.491 Product of 10.555 and 4537. 47888.035 What is the product of 0 and -3273023? 0 What is the product of -9 and -78.2189? 703.9701 Product of 225036 and -12.2. -2745439.2 -13-993.50195 12915.52535 0.084 -98468.7 -8271.3708 What is 103036 times 0.0288? 2967.4368 What is the product of 39038000 and 0.16? 6246080 What is -5.2 times 179169.8? -931682.96 Multiply 8995.35 and -0.6. -5397.21 What is -2.75 times 1437? -3951.75 Calculate -11.758547. -684999.9 Product of 8119.96 and -0.05. -405.998 Work out -111066 186. -20658276 Work out 107554.2627 * 0. 0 Calculate 313044648. 39133944 Multiply -18417.217 and 0.4. -7366.8868 62 times -58657.72 -3636778.64 What is the product of -8206 and 755? -6195530 -2086525 times -1.7 3547092.5 Calculate 37681.970.2. 7536.394 -36222931 -33722682 Product of -15 and -0.04869531. 0.73042965 Work out 1.174 78494. 92151.956 What is 3.5 times -143544? -502404 -69.63.315 -230.724 Product of 1348873 and -0.1. -134887.3 Product of 339.2307 and 85. 28834.6095 Calculate 4-128363427. -513453708 Work out 10621.009 * -0.1. -1062.1009 -0.136404 * -0.32 0.04364928 0.061 times -1820.729 -111.064469 What is the product of 0.7 and -100.05922? -70.041454 Work out 1 * -1391.239. -1391.239 Product of 0.069144971 and -0.1. -0.0069144971 Multiply 312864 and -0.012. -3754.368 What is the product of 323 and -34718? -11213914 What is the product of -0.3 and -9.034902? 2.7104706 -0.18755 * -1759 329.90045 What is -0.3 times -11.76758? 3.530274 Product of 165514 and -46. -7613644 Multiply 0.09 and 223.9085. 20.151765 What is -0.5 times 5626.041? -2813.0205 Multiply 24.8 and -326.0098. -8085.04304 Multiply -0.009371929 and 3. -0.028115787 What is the product of 271 and -0.248975? -67.472225 87050810.2 1741016.2 Work out -1 -114127576. 114127576 What is -1571098 times -0.0723? 113590.3854 What is -0.2 times -0.2136763? 0.04273526 Product of -0.056 and -710845. 39807.32 76.532 times 5.1 390.3132 0.06584 * -405.48 -26.6968032 Work out -153.6912 * -0.5. 76.8456 48609 times 2160 104995440 Calculate 3054.231.27. 3878.8721 Calculate 2021.52690.3. 606.45807 What is -0.2955477 times 437? -129.1543449 What is -3.22 times -48762? 157013.64 1356858 * -0.023 -31207.734 Product of -3 and 14.09657. -42.28971 829 * 9334 7737886 What is the product of -539 and -0.36799? 198.34661 What is the product of 4 and 43079.5? 172318 -892 * 37.4 -33360.8 0.4858 times 5.882 2.8574756 What is -2217 times 13333? -29559261 What is 621 times -1328835? -825206535 3 times 29597061 88791183 10.356 * 62 642.072 Product of -1113.5 and -9658. 10754183 Product of 1.6 and -32559. -52094.4 Multiply 0.01951 and 199.5. 3.892245 What is 2 times 0.012135486? 0.024270972 Calculate -331.378218-3. 994.134654 Product of 53 and -834902. -44249806 -6073187.40.4 -2429274.96 Work out 560786 * -0.047. -26356.942 What is 60.804 times -14657? -891204.228 Work out 5 * 1.14025409. 5.70127045 What is the product of -5943.2162 and -0.1? 594.32162 What is the product of -3725596 and 0.1? -372559.6 Calculate 2-3092.22888. -6184.45776 0.423186687 9274674.8 Multiply -32994062 and 0.3. -9898218.6 Calculate 612885.80.06. 36773.148 Calculate 1949967170.2. 38999343.4 -0.4 times 155.87507 -62.350028 -2490 * 28857 -71853930 What is -1306.4 times -826? 1079086.4 Product of 0.2 and 4.424866. 0.8849732 What is -2 times -0.00052814? 0.00105628 -19-17687 336053 What is -428994.8 times -4? 1715979.2 Calculate -14612-10.67. 155910.04 Product of -111749 and -8678. 969757822 5570532 * 13 72416916 3913034-8.9 -34826002.6 -179726 -1.3 233643.8 0.1 * -0.1672169 -0.01672169 Product of -4424 and -7415. 32803960 0.2 times 647.2708 129.45416 What is -66739.7 times -0.06? 4004.382 Product of 0.5 and 356.79081. 178.395405 193692354 70154726 0.510010.484 5005.242 Calculate 5312240519. 648747507 Product of 1.4 and 1262896. 1768054.4 -547229604 -236148020 What is the product of -18 and 2.036893? -36.664074 Calculate 1640696311. 180476593 What is -114506.62 times 17? -1946612.54 Product of 305333 and 1874. 572194042 What is 91216236 times -3? -273648708 Work out -11864829 4. -47459316 5918-4171 -24683978 Product of -7150 and 0.201. -1437.15 -2303150 times 0.19 -437598.5 Calculate -0.0188462-0.3. 0.00565386 What is the product of -9863482 and 4? -39453928 Multiply -0.2 and -644007.6. 128801.52 What is 4 times 62158183? 248632732 What is the product of -22829 and 603? -13765887 Calculate -606-263618. 159752508 Calculate 8357629. 4783207 What is -26563.96 times 0.38? -10094.3048 Product of -141620 and -76. 10763120 Multiply 3.56 and -1539.108. -5479.22448 Work out -2 * 0.0772988. -0.1545976 Work out 0.4 * 26221258. 10488503.2 192386 times 6.86 1319767.96 Multiply 1456986 and -0.2. -291397.2 What is 37 times 214993? 7954741 Work out 23006 * -0.11. -2530.66 What is the product of 0.003 and -0.00301433? -0.00000904299 What is 2146 times 2204? 4729784 85600.4 * 0.0473 4048.89892 -0.28129-2.66 0.7482314 -111305705 -11305705 Calculate -149-30162. 4494138 Multiply -1 and 2331728. -2331728 What is 2132.6 times 133.8? 285341.88 -161101626.4 -42530822.4 -84992807-0.2 16998561.4 Work out 385400 62.3. 24010420 What is the product of 0.95 and 342075? 324971.25 Multiply -454.3 and 10802. -4907348.6 0.5 times 380102446 190051223 Product of -811369 and 0.2. -162273.8 -3617370.74 -267685.38 What is the product of -1398 and 0.023203? -32.437794 Work out 6 -0.044107. -0.264642 Multiply 173.836445 and -5. -869.182225 What is -34811512 times 6? -208869072 Calculate -158880.28073. -4460.23824 -225531 2.6 -586380.6 Calculate -1.45-0.27881. 0.4042745 What is -2 times 1330113? -2660226 What is -0.5 times -0.0396586? 0.0198293 -4 times -27693232 110772928 0.4505 times 14.573 6.5651365 What is the product of 7026.3722 and -5? -35131.861 What is 0.1 times 12247.0835? 1224.70835 Calculate 12-31671400. -380056800 -3.8 * -402241 1528515.8 Multiply 3291 and -5733. -18867303 Multiply 0.3788 and 25527. 9669.6276 3 times -11053117 -33159351 Work out -304 * -5388923. 1638232592 26 times 2093 54418 0.1 times -451646.16 -45164.616 What is 865.45 times 0.0623? 53.917535 30853815 times 0.4 12341526 Product of 3215453.04 and 5. 16077265.2 -0.14 * -17323527 2425293.78 2324-35.861 -83340.964 -723037 -0.25 180759.25 1 * -4.1279593 -4.1279593 0.1548991 * -0.09 -0.013940919 What is 1164 times 1.779? 2070.756 Multiply 0.3 and -0.7381074. -0.22143222 Multiply -0.04595 and 0.030832. -0.0014167304 12007439 * 4 48029756 0.79502 * 37 29.41574 224-656.27 -147004.48 What is the product of 176773 and -377? -66643421 Multiply 10 and -561441. -5614410 -10163 times 0.04304 -437.41552 What is 123 times 0.044442? 5.466366 Product of -219.82 and 0.0633. -13.914606 Calculate 416-276556. -115047296 What is the product of -11 and -4.67166? 51.38826 Work out 24103 * -111. -2675433 0.8 * 390578.8 312463.04 Wh	{ "pile_set_name": "DM Mathematics" }
-0.33 What is 45 times -200? -9000 -1155 times 0.5 -577.5 Product of -0.1 and 0.1125. -0.01125 -0.2 times -402 80.4 Calculate -4-188. 752 Calculate -6.2-0.03. 0.186 Product of -1 and -68. 68 Product of -1 and 0.21. -0.21 1.1 times 0.072 0.0792 0.11769 times 5 0.58845 Product of 0.16 and -19. -3.04 Work out 0.02 * 0.82. 0.0164 What is 0 times 911? 0 -41 times 14 -574 What is -12.1 times -0.8? 9.68 Product of -14 and -2.3. 32.2 -1.461 times 0.1 -0.1461 What is -5 times -8.3? 41.5 Product of -0.058 and 1.48. -0.08584 Multiply -0.2 and 116. -23.2 What is the product of 0.07158 and 0.2? 0.014316 -15-1 15 What is 74 times 2? 148 Work out -4 0.18. -0.72 -0.8 * -25.5 20.4 480 times 0.1 48 Product of -0.1369 and -0.5. 0.06845 -67 times -0.19 12.73 Work out -1496 * -16. 23936 -5 times -0.02 0.1 Product of 71.5 and 11. 786.5 What is the product of -10818 and 0.1? -1081.8 Product of 60.7 and -5. -303.5 Product of 0 and -21. 0 What is 265 times -0.2? -53 Work out -0.4 * -162. 64.8 14821 1482 Multiply 60 and 0.135. 8.1 Calculate -68-0.3. 20.4 -7 times -0.41 2.87 Product of 15 and 0.1. 1.5 0.02 times -0.149 -0.00298 What is the product of -5 and 739? -3695 Product of 43.3 and -20. -866 Multiply -35 and -1. 35 -48.4 * 20 -968 -84 -32 Calculate -0.5-17.6. 8.8 Product of -0.2 and 2. -0.4 22 times -57 -1254 -0.2 times 0.347 -0.0694 What is -163 times 0.08? -13.04 Multiply -0.32 and -17. 5.44 Calculate -3-832. 2496 Product of 3.35 and -1. -3.35 Work out -0.02 0.1. -0.002 Calculate -8-57. 456 -5 77 -385 What is the product of 0.5 and -0.104? -0.052 -9865 -6370 Multiply 40 and -14.5. -580 -0.0431.42 -0.06106 Work out 0.1 * -62.3. -6.23 -961 times -0.13 124.93 Calculate -53150. -7950 Work out -0.12 0.0166. -0.001992 -994.7 -465.3 What is the product of 0.4 and 7? 2.8 Calculate -7739. -3003 What is -104 times 0.1? -10.4 -212 * -20 4240 Work out 2 * 15. 30 Calculate 0.051.4. 0.07 Work out 1.1 -0.0025. -0.00275 Product of 87.1 and 0.5. 43.55 What is -0.2 times -0.05237? 0.010474 0.4 * -99 -39.6 0.689-1.4 -0.9646 Multiply 4 and -195. -780 -0.34 times -0.4 0.136 Work out 0.14 -6. -0.84 Product of 0.2 and -2.69. -0.538 What is the product of 0.9 and -1.5? -1.35 -21 * -19 399 -17 times -0.103 1.751 Work out 0.4 * 8.12. 3.248 Calculate -0.41. -0.4 -0.637 -3 1.911 Multiply -6 and -0.2. 1.2 Work out 0.15 * 1.7. 0.255 What is 0.4 times 0.127? 0.0508 -1376 * 0.3 -412.8 Calculate -3.37-9. 30.33 Work out 107 -4. -428 Calculate 42.4-14. -593.6 6.6 times -0.4 -2.64 0 0.05506 0 -4 times -2.426 9.704 Work out -0.03967 * 1. -0.03967 -0.5-7 3.5 What is 688 times 0.1? 68.8 What is -1.61 times 0.03? -0.0483 -0.11002 -100.2 What is -87.9 times 0? 0 5 times -21.6 -108 Multiply 0 and 52.1. 0 Calculate 30-18. -540 Product of 0.5 and -4.15. -2.075 -11 -258 2838 Product of 0.73 and -0.8. -0.584 Multiply -287 and 0.2. -57.4 0.5 * -4 -2 Multiply 0.2621 and 0.5. 0.13105 Work out 0.32 * 0.009. 0.00288 -1792 * -2 3584 Calculate 20.01918. 0.03836 Calculate -0.7-812. 568.4 Multiply -547 and 0.32. -175.04 Calculate -217-53. 11501 Product of -139 and -5. 695 Work out -0.3 20.2. -6.06 -10 * 1.87 -18.7 Calculate -0.4-1627. 650.8 Work out 0.2 -1449. -289.8 Work out 0.26 * 69. 17.94 What is -1711 times 0.1? -171.1 -0.18 times 3.76 -0.6768 Work out 10 * 77. 770 Work out 1 * -0.5. -0.5 What is the product of -2 and 390? -780 0.2-0.72 -0.144 What is the product of 27 and -0.1? -2.7 3 -0.149 -0.447 -1 * -3654 3654 Multiply -0.4 and -0.26. 0.104 Multiply -29 and -57. 1653 -282 * -15 4230 What is 90 times -1.9? -171 Calculate 0.22204. 440.8 -183 -0.3 54.9 Calculate 0.070.7. 0.049 -3 times 0.03359 -0.10077 -521 times -3.5 1823.5 Work out 329 -4. -1316 Product of -0.0928 and 0.4. -0.03712 Product of 19 and 33. 627 Multiply 3.65 and -3. -10.95 Multiply 1 and 1.085. 1.085 What is -34 times 21? -714 What is -0.73 times -1.7? 1.241 274 times 13 3562 What is -0.16 times -0.31? 0.0496 -0.3 times 0.2756 -0.08268 Multiply -6 and -31. 186 What is 1 times -8.12? -8.12 Work out -2.4 * 0.5. -1.2 What is -7.1 times 0.06? -0.426 Multiply 2.6 and 15. 39 What is -0.32 times 10? -3.2 Work out -0.006 * 0.06. -0.00036 What is 1.112 times -0.08? -0.08896 7821 times -0.2 -1564.2 0.3 times 0.38 0.114 What is the product of 3 and 98? 294 0.157 5.7 0.1 12 1.2 20.486 0.972 What is -331 times 0.12? -39.72 Product of -15 and 0.2. -3 396 -40 -15840 -315.8 times -0.1 31.58 What is -3.7 times -18? 66.6 Product of 0.5 and 0.017. 0.0085 Multiply -2.35 and 0.4. -0.94 What is the product of 162 and -0.1? -16.2 -1 * -451 451 1.24 * 3 3.72 Multiply 5.8 and -2. -11.6 Work out -4 * -7. 28 -2232 times 0.2 -446.4 Product of 0 and 100. 0 What is the product of 0.07 and -53? -3.71 Work out 0.33 * 0.01. 0.0033 What is -0.137 times 0.16? -0.02192 Product of -0.086 and 0.004. -0.000344 Product of 1 and -0.14. -0.14 2.39 times 4 9.56 -0.4027 times -0.5 0.20135 180 times 50 9000 Product of 0.3 and -334. -100.2 Product of 0.1 and 146. 14.6 What is -0.154 times 0.5? -0.077 4-3901 -15604 What is the product of 1263 and -12? -15156 Multiply -20 and -5. 100 -68280.1 -682.8 Calculate -0.5-1860. 930 Calculate -0.07160. 0 What is the product of 54 and -78? -4212 Work out -3.022 * -0.4. 1.2088 What is the product of 0.1 and -65? -6.5 Work out -0.278 * -0.001. 0.000278 Product of -0.271 and 3. -0.813 Work out -192 * -6. 1152 What is the product of 5 and -16.5? -82.5 What is -0.2 times -189? 37.8 -28-1.5 42 4 times 27.85 111.4 0.08-443 -35.44 What is the product of -4 and -0.7? 2.8 Calculate -0.060.4. -0.024 Multiply 0.2 and 2. 0.4 Multiply 1 and 0.058. 0.058 -0.00991 -0.819 Calculate 2-186. -372 -2171 times 5 -10855 -0.053 -5 0.265 What is 0.1 times 297? 29.7 -57 * -0.3 17.1 167 times 27 4509 Work out 2 * -0.122. -0.244 Work out -945 * 0.5. -472.5 Product of -313 and -1.7. 532.1 Calculate 44-0.095. -4.18 Multiply -0.00874 and -1. 0.00874 Calculate -0.13910.3. -0.04173 Calculate -0.03240.7. -0.02268 What is -249 times -5? 1245 What is the product of 0.2 and 1175? 235 Multiply 0.1 and -20. -2 What is the product of 37 and 1.23? 45.51 10-44.5 -445 Product of -4.89 and 1.1. -5.379 Work out 143 * 0.4. 57.2 0.40.2797 0.11188 0 -123 0 Product of -562 and -0.2. 112.4 0.043-6 -0.258 What is -5.157 times 0.4? -2.0628 What is -2.3 times -22? 50.6 Work out 0.01 -55. -0.55 What is the product of 8.39 and 3? 25.17 1.23-38 -46.74 Work out -0.1 1194. -119.4 8.3 times 4 33.2 -4 * -33.4 133.6 What is the product of 0.2 and -0.1? -0.02 Product of -39 and 0.1. -3.9 Work out 0 * 2.29. 0 64-56 -3584 Multiply 3.4 and -0.6. -2.04 What is the product of 0.5 and -13.63? -6.815 1.598-0.3 -0.4794 Multiply 10 and 3.26. 32.6 Multiply 0.9 and 4.14. 3.726 Work out -0.12 * 7. -0.84 Multiply 2 and 16.8. 33.6 -0.320.9 -6.27 What is -0.1 times 1? -0.1 -12 1173 -14076 What is the product of 5.61 and 0.1? 0.561 -4 * -0.2342 0.9368 -0.12-1 0.12 Calculate -1810.08. -14.48 -25-0.22 5.5 -0.0129 0.14 -0.001806 Calculate 0.10.116. 0.0116 What is 125.7 times 0.4? 50.28 Work out 0.01 206. 2.06 Multiply -0.11 and -1.66. 0.1826 What is -730 times -0.03? 21.9 Product of -406 and 1.8. -730.8 13271 * 0 0 What is the product of 80 and 287? 22960 Product of -2 and 0.0581. -0.1162 Multiply 1246 and 2. 2492 Calculate 3220.5. 161 Work out -220 0.1. -22 What is 347 times 0.04? 13.88 What is -0.3 times 0.54? -0.162 Product of -3.3 and -0.5. 1.65 What is -164.5 times -3? 493.5 What is the product of 0.4 and 0.093? 0.0372 -161.4 times 5 -807 208 * -0.2 -41.6 Product of -591 and 0. 0 283 * -5 -1415 What is -0.7277 times 0? 0 0.74.2 2.94 Work out -0.207 -11. 2.277 What is the product of 226 and 3? 678 What is the product of 11.854 and -0.2? -2.3708 Calculate -3490.4. -139.6 -0.6 times -3 1.8 Multiply -6 and -0.2. 1.2 What is the product of -0.07 and -836? 58.52 0 -9.56 0 Product of -0.4 and 503. -201.2 Product of -0.075 and -10. 0.75 9.71 * 0 0 Calculate 0.57.1. 3.55 What is -1 times 0.227? -0.227 Work out -66 -0.3. 19.8 Multiply 5.7 and -192. -1094.4 Product of -16 and -0.18. 2.88 Calculate 0.0615. 0.9 Calculate -19644. -7856 What is the product of -0.5 and 451? -225.5 What is 632 times -0.4? -252.8 Multiply -2	{ "pile_set_name": "DM Mathematics" }
t in 983, 1004, 1029, 1052, 1067? 1068 What comes next: -237725, -237724, -237735, -237764, -237817? -237900 What is the next term in -6662, -6659, -6656, -6653, -6650? -6647 What comes next: -7333, -7329, -7323, -7315, -7305, -7293? -7279 What is next in -8609, -8655, -8699, -8741, -8781, -8819, -8855? -8889 What is the next term in -1364, -5143, -11438, -20249, -31576? -45419 What comes next: 1390, 2679, 3866, 4951, 5934, 6815? 7594 What is the next term in 1075, 1020, 965, 910? 855 What comes next: 263, 283, 297, 305, 307, 303, 293? 277 What is the next term in 118, 817, 2692, 6331, 12322, 21253, 33712, 50287? 71566 What is next in 41157, 82276, 123385, 164478, 205549, 246592, 287601? 328570 What is next in -2048, -4021, -5994, -7967, -9940, -11913? -13886 What comes next: -6246125, -6246126, -6246127? -6246128 What is next in -184658, -369313, -553968, -738623? -923278 What comes next: -4670, -18670, -42002, -74666, -116662? -167990 What comes next: 2158, 3382, 4606, 5830, 7054? 8278 What is the next term in 1265, 2510, 3757, 5006, 6257, 7510, 8765? 10022 What comes next: 5812, 5763, 5688, 5593, 5484, 5367? 5248 What is the next term in 11703, 11726, 11749? 11772 What is next in -105864, -211729, -317594, -423459, -529324, -635189? -741054 What is next in -1884387, -1884388, -1884391, -1884396? -1884403 What is the next term in -205447, -410896, -616345? -821794 What is the next term in -178, -284, -390, -496, -602? -708 What comes next: 63, 172, 499, 1164, 2287? 3988 What comes next: 705, 1440, 2173, 2904? 3633 What is the next term in 3560, 3556, 3540, 3506, 3448, 3360, 3236, 3070? 2856 What is the next term in 22265, 22182, 22039, 21830, 21549, 21190, 20747? 20214 What comes next: 22474, 22492, 22510, 22528, 22546, 22564? 22582 What is the next term in 3643, 7287, 10927, 14563, 18195, 21823? 25447 What comes next: 137, -262, -657, -1048, -1435, -1818? -2197 What is the next term in -22979, -45991, -69015, -92057, -115123? -138219 What is next in -5126, -20431, -45930, -81611, -127462, -183471, -249626, -325915? -412326 What comes next: 1312, 1308, 1304? 1300 What comes next: -1967, -1496, -1031, -572? -119 What is next in 768, 1339, 1910, 2481? 3052 What is next in -4691, -3923, -2643, -851, 1453, 4269? 7597 What is next in -244, -968, -2194, -3922, -6152? -8884 What comes next: 42, 111, 190, 291, 426, 607, 846, 1155? 1546 What is next in -15711, -31423, -47135? -62847 What comes next: -10232, -10232, -10236, -10244? -10256 What comes next: 87, 303, 655, 1143, 1767? 2527 What is next in 202, 315, 428, 541? 654 What comes next: 2181, 8799, 19865, 35391, 55389, 79871? 108849 What is next in 9489, 9461, 9427, 9399, 9389, 9409? 9471 What is the next term in 55384, 110808, 166232? 221656 What is the next term in -578790, -578787, -578784? -578781 What is next in 378, 1669, 2960, 4251, 5542? 6833 What is next in 2254, 845, -564, -1973, -3382, -4791? -6200 What is next in 14295, 14384, 14533, 14742, 15011, 15340, 15729? 16178 What comes next: -267, -546, -805, -1032, -1215, -1342, -1401, -1380? -1267 What is next in -9417, -9425, -9433, -9441? -9449 What is the next term in 3949, 3897, 3845, 3793? 3741 What comes next: -227, -106, 15? 136 What comes next: -857, -888, -917, -944, -969, -992, -1013? -1032 What comes next: -68, -351, -808, -1427, -2196, -3103, -4136? -5283 What is the next term in 174, 165, 106, -27, -258? -611 What comes next: 50892, 50889, 50886? 50883 What is next in -1248, -1313, -1378, -1443? -1508 What is next in -46146, -46159, -46172, -46185, -46198, -46211? -46224 What is next in -153743, -153741, -153739, -153737, -153735? -153733 What is next in -1609, -1616, -1623, -1630, -1637, -1644? -1651 What is next in 1161397, 1161398, 1161399, 1161400, 1161401? 1161402 What is the next term in 1718, 2185, 2652, 3119, 3586, 4053? 4520 What is next in -3349, -13343, -29987, -53281, -83225? -119819 What comes next: -396, -210, -24? 162 What is next in 1281600, 2563207, 3844816, 5126427, 6408040, 7689655, 8971272? 10252891 What comes next: -1877, -7384, -16521, -29288, -45685? -65712 What is the next term in 978, 1390, 1802, 2214, 2626, 3038? 3450 What comes next: -17076, -17049, -17024, -17001, -16980, -16961? -16944 What is the next term in -2298, -4644, -6990? -9336 What is the next term in -33198, -66396, -99594, -132792? -165990 What is the next term in -8346, -33283, -74838, -133011, -207802, -299211, -407238? -531883 What comes next: 2610, 5243, 7880, 10521, 13166, 15815? 18468 What is the next term in 132, 204, 194, 60, -240, -748? -1506 What comes next: -992, -1965, -2946, -3941, -4956? -5997 What is the next term in -513, -1538, -3247, -5640, -8717, -12478? -16923 What is the next term in 1062, 4088, 9118, 16152, 25190, 36232? 49278 What is the next term in 2942, 2827, 2712, 2597, 2482? 2367 What comes next: 4051, 8077, 12103, 16129, 20155? 24181 What comes next: 86, -301, -1372, -3469, -6934, -12109, -19336, -28957? -41314 What is the next term in 1643, 3170, 4699, 6230? 7763 What comes next: -472, -913, -1320, -1675, -1960, -2157, -2248, -2215? -2040 What comes next: 1585, 1434, 1293, 1168, 1065, 990? 949 What comes next: -14, -32, -56, -86, -122, -164? -212 What comes next: -839, -816, -791, -764, -735? -704 What is next in 1197, 1325, 1453? 1581 What comes next: 65732, 65748, 65764, 65780, 65796, 65812? 65828 What comes next: 846, 913, 1034, 1215, 1462, 1781, 2178, 2659? 3230 What is next in 261, 995, 2231, 3975, 6233, 9011? 12315 What is the next term in -886, -3564, -8010, -14212, -22158? -31836 What comes next: 6467, 12948, 19449, 25976, 32535? 39132 What is the next term in -15495, -15501, -15507? -15513 What is next in 551, 1058, 1561, 2060? 2555 What comes next: -6026, -24031, -54042, -96059, -150082? -216111 What comes next: 149628, 149627, 149628, 149631, 149636, 149643, 149652? 149663 What comes next: 501, 598, 693, 786, 877? 966 What is the next term in -111535, -111536, -111537? -111538 What is next in -16062, -32126, -48190, -64254? -80318 What comes next: 178554, 357095, 535636, 714177, 892718, 1071259? 1249800 What comes next: 178, 732, 1666, 2974, 4650? 6688 What is the next term in -20210, -20177, -20142, -20105, -20066, -20025, -19982? -19937 What comes next: -788, -1563, -2326, -3077, -3816, -4543, -5258? -5961 What comes next: 1654, 1983, 2312? 2641 What is next in -333, -336, -339? -342 What is the next term in -306863, -306867, -306881, -306911, -306963? -307043 What is the next term in -1244, -2180, -3116, -4052, -4988? -5924 What is the next term in 3756, 3745, 3728, 3705, 3676, 3641? 3600 What comes next: -403703, -403696, -403689, -403682, -403675, -403668? -403661 What is next in 9119, 36474, 82065, 145892, 227955, 328254, 446789? 583560 What is next in 3566, 3532, 3494, 3452, 3406? 3356 What is the next term in -7510, -14938, -22366? -29794 What is the next term in 310, 1280, 2900, 5170, 8090, 11660, 15880? 20750 What comes next: -40298, -40335, -40372, -40409? -40446 What comes next: -2322, -3608, -4894, -6180, -7466? -8752 What is next in 30691, 30664, 30635, 30604? 30571 What is the next term in 411, 420, 459, 546, 699? 936 What is the next term in 15145, 60619, 136409, 242515, 378937? 545675 What is the next term in 41, 150, 317, 542, 825? 1166 What is next in 136488, 136491, 136494, 136497? 136500 What is the next term in 120, 189, 284, 393, 504, 605? 684 What is the next term in 24011, 23907, 23803, 23699, 23595, 23491? 23387 What is next in -84, -827, -2844, -6771, -13244, -22899, -36372? -54299 What comes next: -1976685, -3953372, -5930059, -7906746? -9883433 What comes next: -432, -812, -1192, -1572? -1952 What comes next: -543, -1088, -1633? -2178 What is next in 109, 340, 719, 1246? 1921 What comes next: 1829, 2206, 2583, 2960? 3337 What comes next: 41, -82, -293, -598, -1003, -1514? -2137 What is next in -238, -127, 18, 197, 410, 657, 938? 1253 What comes next: -277, -537, -771, -967, -1113, -1197, -1207, -1131? -957 What is next in -148, -251, -388, -577, -836, -1183, -1636, -2213? -2932 What is the next term in 2914, 3108, 3302, 3496? 3690 What is next in 126866, 253732, 380598, 507464? 634330 What is next in -1554, -3118, -4682, -6246? -7810 What is next in 2548, 4989, 74	{ "pile_set_name": "DM Mathematics" }
h is the nearest to -2/7? (a) 0.5 (b) -0.5 (c) 1.7 (d) k b Let k be -11 - (2/15 - 13/(-15)). What is the nearest to -3 in 0.1, k, -0.3, 0? -0.3 Let r = -0.08 + -0.02. Let v = 3.2 + -3.6. Let t be (2/8)/((-45)/20). What is the nearest to r in t, 0.08, v? t Let n = -3.1 - -3. Suppose -4f = f + r + 2098, 4r = -2f - 832. Let i be 200/f-1(-6)/5. What is the closest to n in i, -4, -2? i Let g = -36/175 - -813/1400. Which is the closest to 0.37? (a) -0.5 (b) g (c) -1/10 (d) 0.5 b Let l = 3.3 - 3.54. Let u = l + 0.34. Which is the closest to u? (a) 1/10 (b) 0 (c) 2 a Suppose 971r + 65 = 958r. What is the nearest to -1/3 in 0.43, -2, r? 0.43 Let c(t) = 46t + 87. Let m be c(-2). What is the closest to 7 in m, 3, -0.2? 3 Let t = 79 - 74. Let x = 1 + -4. Let q = -0.12 - -0.32. Which is the nearest to q? (a) t (b) x (c) 1 c Let w = -13.94 - -12.3. Let i = w - -13.64. Let z = -3 - -2.6. Which is the closest to i? (a) -2 (b) z (c) -1 b Let i be (-1 - -5)/(39 + -1 + 0). Which is the nearest to 5? (a) i (b) -4 (c) -5 a Let u = -0.347 + 0.647. Let f = 7 + -5. Let p = 487/1729 + 1/247. Which is the closest to 0? (a) p (b) f (c) u a Let g = -0.7 + -0.3. Let z = 17555/42 - 418. Let i = 1/7 - z. What is the closest to g in 0.1, i, -1? -1 Let c be (18 - (-399)/(-18)) + (3 - -1). What is the closest to 2/5 in 2, 0.5, -64, c? 0.5 Let h(u) = 3u. Let t be h(-2). Let i be (1 + t + 4)/(-4). Let v = -39 + 34. Which is the nearest to i? (a) -3 (b) 3 (c) v b Let i = 5.66 - 6. Let m = i + 0.34. What is the closest to -1/4 in 2/9, 3, m? m Let f = -0.03 - -5.03. Suppose 256 = 2s + 14s. Let o be 1(0 + s/(-12)). Which is the nearest to -0.1? (a) f (b) o (c) -1/2 c Let t = 13 + -26. Let n(i) = -i*3 - 14i*2 - 13i + 3. Let h be n(t). Which is the closest to 0.3? (a) 5 (b) h (c) -3 b Let t = -51 - -52. Let r be ((-1)/2t)/((-99)/(-22)). What is the nearest to -2/17 in r, 1, 4? r Suppose -2 + 21 = -5k + 3o, 3o - 9 = 0. Let r = -221/1322 - -1/1983. What is the closest to r in k, 3, -2/11? -2/11 Let w = 0.2 + -1.4. Let s = -1410.3 + 1410.7. What is the nearest to 1 in -1/5, w, s? s Let s(p) = -p*3 + 14p*2 + 39p - 88. Let x be s(16). Which is the nearest to 2/7? (a) 2/7 (b) 1/3 (c) -1 (d) x a Let x = -320 - -320. What is the nearest to 0.05 in x, -3, -5? x Let t = 10.11 + -14.11. Which is the nearest to -48? (a) 0.1 (b) -1 (c) t c Let k = 35 + -25. Let i = k + -10.04. Let f = -0.06 + i. What is the nearest to 5/6 in f, 2, -0.5? f Let h = -0.01 - -0.11. Let u(i) = -i*3 + 3i*2 + i - 6. Let x be u(3). What is the closest to h in x, -1, 0.3? 0.3 Suppose 24 = -19i + 20 - 15. Let v = -0.2 + -0.3. Let d = -4.5 + v. What is the closest to i in d, -0.1, -0.06? -0.1 Let f = -3073 + 3069. Which is the nearest to -2? (a) -0.4 (b) 4/5 (c) f (d) -5 a Let b = -0.487 + 0.887. What is the nearest to 1 in 0.5, 17, b? 0.5 Let n be 17/3 + (-4)/(-12). Let v = n - 3. Let z = 59.5 - 60. What is the closest to 0 in z, v, 1? z Let q = -3036.8 - -3037. Let s(n) = -n*2 - 6n + 9. Let k be s(-7). Let w be (-9)/21k/(-3). Which is the closest to q? (a) 2 (b) w (c) 0.2 c Let o be -1(-1 + 2 - (-9)/(-6)). Suppose -n - 3 = -2. Let j(l) = 2l - 7. Let h be j(5). Which is the nearest to n? (a) 0 (b) h (c) o a Let f be 31/(-93)4/(-2). Let z = -13 - -8. What is the nearest to -11 in z, -3/7, f? z Let i = 0.12 + -0.22. Let l be ((-9)/6)/((3/(-2))/(-3)). Which is the closest to i? (a) l (b) 5 (c) -3/7 c Let z(w) = -9w3 - 1 - w2 - 3w*3 + 3w*2 - 8w*3. Let o be z(-1). Let d = o + -64/3. What is the closest to d in -2/13, -2, 2? -2/13 Let d = 2 + -1.8. Let w = -3706/3 + 1235. Which is the closest to w? (a) 0.9 (b) -2/7 (c) d b Let m be 1(-6 + (46/7)/1). Let i = -0.7 + 0.3. Which is the closest to 0.1? (a) m (b) i (c) -4 a Let y be 27/(-6)1/(-6). Let p be 2/(-8) - (-39)/12. Let j be (13 - 6) + (-6 - -2) - 7. What is the closest to y in -1, j, p? -1 Suppose 5t = -3 + 28. Suppose 7 = 2k - t. Let z = k + -19/3. Which is the closest to 2/9? (a) 0.3 (b) z (c) -4 a Let g = -269/3 - -89. Let j = -3 + 2.6. Which is the nearest to g? (a) 0.4 (b) -3 (c) j c Let w = 296 - 295.7. Which is the closest to 0.1? (a) w (b) 2/13 (c) 4 (d) 1 b Let u = 65 - 57. Let p(q) = q3 - 8q*2 - q + 3. Let j be p(u). Which is the nearest to j? (a) 0.2 (b) 0.3 (c) -2 c Let g = -5.1 - -4.1. Let j(k) = k + 9. Let x be j(-9). Let t = x + -3. What is the nearest to -1 in t, 3, g? g Let s = 149 - 147. Which is the nearest to 12? (a) -0.2 (b) 3/4 (c) s c Let k = 0.07 - -0.03. Let t be (-28)/(-238) + (525/(-408))/(-5). What is the closest to 2/5 in 2, k, t? t Let s be ((-7)/(-35))/(-3 + 2). Let m = -65 + 781/12. What is the nearest to m in 0.2, s, -2/9? 0.2 Suppose x = -3w - 0w - 7, -5x + 13 = -w. Let q(y) = 20y + 2. Let h be q(9). Let f = -1640/9 + h. What is the nearest to w in 1/6, f, 2/5? f Let n = 0.569 - 2.879. Let d = 2.3 + n. Let w = 6.2 - 1.2. Which is the nearest to d? (a) 0.3 (b) w (c) -3 a Let n be (-157)/(-471) + (-8)/(-6) + -1. What is the nearest to -0.1 in 16, n, 0.5, 4? 0.5 Let y = 458 + -460. What is the closest to 0 in -0.3, -8, -5, y? -0.3 Let u = -0.0459 - -0.1459. What is the closest to -1/3 in u, 0.6, -1/4? -1/4 Let d = 34 - 30.6. Let n = d + -3.4. Which is the nearest to -0.1? (a) n (b) 0.5 (c) 2/5 a Let n = 2187.5 - 2187. What is the closest to 1/4 in -1/4, n, 1/4, 0.7? 1/4 Let t = -0.049 - -1.049. Let c be 12/(-3) - (-50)/14. Let f be -2 - ((-16)/3)/4. What is the closest to t in c, f, -1? c Let b = 28.974 + -29. Let n = 0.374 - b. What is the closest to 0 in 0.1, n, -8? 0.1 Let h be (0 + (-1 - -3))/4. Let w be (-7)/(21/6) + (-22)/(-14). Let x = 3018/13 + -232. Which is the closest to h? (a) 2/17 (b) x (c) w b Let h = 1417.1 - 1417. What is the closest to -1 in -2, 4, -16, h? -2 Let l(u) = -u2 + 7u + 259. Let j be l(20). Let t = -449 + 8533/19. Which is the nearest to j? (a) t (b) -3 (c) 5 a Let q = -0.51 + 0.467. Let y = q + -0.457. Let m = 4 - 7. Which is the nearest to 2/21? (a) m (b) 3 (c) y c Let s be 31/93 - (24/(-9) - -4). What is the nearest to 0 in s, 1/5, 0, 2/3? 0 Let u = 3/724 + 1409/9412. What is the closest to -1/11 in -0.5, 3/2, u, 1/2? u Let d = -78.7 + 79.7. What is the nearest to 10 in -0.3, d, 2/7, -0.1? d Let p(y) = -y*3 + 9y*2 - 2. Let i be p(9). Let m be ((-10)/15)/(-4 - i). What is the nearest to 0.2 in -5, -0.3, m? m Let k = -12 + 11.93. Let f = k - -2.07. Let z = -1 + f. Which is the nearest to 1? (a) z (b) -1/9 (c) -2/19 a Let h = -0.366 + 1.366. What is the nearest to 14/9 in h, -0.3, -4? h Let r = 0.139 + -0.139. Which is the closest to r? (a) 2/11 (b) -1/6 (c) -5/6 b Let i = -19.1 + 19. Let j = -7.6 + 15.6. What is the nearest to i in -5, -4, j? -4 Let n be (-4)/((-2)/(5 - 4)). Suppose -8g + ng = 0. Let o = 4.92 + 0.08. What is the closest to -1 in g, o, 4? g Let y = -0.033 + 0.063. Let r = 0.01 - 1.01. Which is the closest to 0? (a) r (b) -2/15 (c) y c Let l = 248 + -248.505. Let j = -0.005 - l. Let y = -3 - -2. Which is the nearest to y? (a) -2 (b) j (c) -2/7 c Let h be 4/(-10)(-10)/128-4. Let n = 53 + -58. What is the closest to -3 in n, 1/15, h? n Suppose 8q - 90 = -74. Let n = -11.4 - -11. Which is the nearest to q? (a) -0.02 (b) n (c) -1/2 a Let z(v) = v*2 - 9v + 6. Let p be z(12). Let d be ((-1)/(-7))/(p/(-49)). What is the nearest to 0.3 in 1/2, d, -4? 1/2 Let k = 31/45 + 10/9. What is the nearest to 1 in k, 0.3, -0.2? 0.3 Let x be 16/6 - 2/3. Let t be -4 + x - 1 - 2. What is the closest to 2 in -5/4, 0.3, t? 0.3 Let m = -2562 + 2686.07. Let z = -120 + m. Let j = z + -0.07. Which is the nearest to -1? (a) 0.1 (b) j (c) -6/11 c Let x be (-16)/(-3)*184/16. Let z = x + -62. Which is the nearest to z? (a) 1 (b) 0.2 (c) 1/2 b Let y = 0 - 0. Let x = -0.97 - 0.03. Let i = -112 + 112.2. Which is the closest to i? (a) -3/5 (b) x (c) y c Let k = 0.08 + 0.32. Let z = 275 - 272.3. Which is the closest to z? (a) 1/4 (b) k (c) 3/4 c Let x = 15 + -21. Let j = x - -4. Let t = j + 1.5. Which is the closest to 0? (a) t (b) 1 (c) -3 a Let t = 2063 + -2064. Let m = 0.5 + -2.5. What is the nearest to t in -6/5, m, -5? -6/5 Let s = -154 + 154.	{ "pile_set_name": "DM Mathematics" }
3631041n/5 - 5446602/5. 3(n - 201726)(n + 3)2/5 Factor -t3/8 - 295t*2/8 - 14383t/8 + 14679/8. -(t - 1)(t + 63)(t + 233)/8 Factor -5d4 - 1100d*3. -5d*3(d + 220) Solve -w*3/3 - 1148w*2/3 - 326005w/3 + 665858 = 0. -577, 6 Find u such that -5u4 + 410u*3 - 1575u*2 + 1170u = 0. 0, 1, 3, 78 Suppose m*3/7 - 523m*2/7 + 1025m - 3563 = 0. Calculate m. 7, 509 Solve -156j5 + 8883j*4 - 168435j*3 + 1060257j*2 + 61731j = 0 for j. -3/52, 0, 19 Suppose -q*3/11 - 4q*2/11 + 285q/11 = 0. What is q? -19, 0, 15 Let -20d5 + 1684d*4 - 1916d*3 - 6404d*2 + 7984d - 1328 = 0. Calculate d. -2, 1/5, 1, 2, 83 Factor -5v2 + 119568v + 47828. -(v - 23914)(5v + 2) Let -c*4/2 - 177c*3/2 - 10557c*2/2 - 218831c/2 - 198417 = 0. What is c? -59, -57, -2 Solve -2r4 + 14257r*3/3 - 14245r*2 + 14241r - 14239/3 = 0. 1, 14239/6 Determine g so that -g*3/2 + 81g*2 + 55609g/2 - 27885 = 0. -169, 1, 330 Factor -4j4 - 436j*3 + 1344j*2. -4j*2(j - 3)(j + 112) Find o, given that -72o*2/5 + 54o/5 - 4/5 = 0. 1/12, 2/3 Solve w*3 + 43147w*2 - 86297w + 43149 = 0 for w. -43149, 1 Suppose 285v3 + 2856v*2 - 27300v - 576 = 0. What is v? -16, -2/95, 6 Find v, given that 4v5 - 584v*4 - 6800v*3 - 17000v*2 + 6796v + 17584 = 0. -7, -4, -1, 1, 157 Suppose -627l5 - 3141l*4 + 1851l*3 + 8169l*2 - 6192l - 60 = 0. What is l? -5, -2, -2/209, 1 Let 55v2/4 - 8795v/4 + 10650 = 0. Calculate v. 5, 1704/11 Determine t so that -t*5/3 - 773t*4/3 - 223879t*3/3 - 28755455t*2/3 - 1372923256t/3 + 1401903364/3 = 0. -194, -193, 1 Solve -2c3/11 + 30238c*2/11 - 113973920c/11 - 2406805800/11 = 0 for c. -21, 7570 Factor m*4/4 + 33493m*3/4 + 280428515m*2/4 - 280462009m/4. m(m - 1)(m + 16747)*2/4 Let 3o*2 + 3381o - 16980 = 0. What is o? -1132, 5 What is p in p*2 - 70632p - 70633 = 0? -1, 70633 Solve -80j3 + 2584520j*2 + 1292275j + 161535 = 0 for j. -1/4, 32307 Factor -2l3 + 21732l*2 + 43472l. -2l(l - 10868)(l + 2) What is k in 3k*3 + 12225k*2 = 0? -4075, 0 Determine v, given that -120v*5 + 1832v*4 - 6854v*3 + 4440v*2 + 9162v - 1620 = 0. -9/10, 1/6, 3, 10 Suppose m*2/3 + 419138m + 131757497283 = 0. What is m? -628707 Solve 4j2 - 412980j + 412976 = 0 for j. 1, 103244 Solve r*2/2 + 50987r + 2599674169/2 = 0. -50987 Let -16r5/9 - 792r*4 - 17636r*3/9 + 37166r*2/9 - 6790r/3 + 3544/9 = 0. What is r? -443, -4, 1/2 Solve q*5 - 26q*4 - 303q*3 + 1076q*2 - 748q = 0 for q. -11, 0, 1, 2, 34 What is l in 2l2/9 + 862l/9 - 1748/3 = 0? -437, 6 What is a in 2a4 + 46a*3 - 894a*2 - 1918a - 980 = 0? -35, -1, 14 Determine b, given that -b*2/5 + 455b + 2276/5 = 0. -1, 2276 Suppose -2f2/5 + 636f + 957782/5 = 0. What is f? -259, 1849 Solve -51w5/7 - 150w*4/7 + 264w*3/7 + 138w*2/7 - 213w/7 + 12/7 = 0. -4, -1, 1/17, 1 Factor h*3 - 128h*2 + 5005h - 54450. (h - 55)*2(h - 18) Factor -5c3/2 + 4275c*2/2 - 907335c/2 - 2760615/2. -5(c - 429)2(c + 3)/2 Factor -p*2/3 - 106009p/3. -p(p + 106009)/3 Find m, given that 48m*3 - 3987m*2 - 7911m + 510 = 0. -2, 1/16, 85 Factor -25g3 - 18495g*2 + 3720g + 14800. -5(g - 1)(g + 740)(5g + 4) Determine w so that 3w3/5 + 2004w*2/5 + 6276w + 54768/5 = 0. -652, -14, -2 Determine g, given that 4g2/3 - 460g/3 + 13000/3 = 0. 50, 65 Factor 5i5 + 3320i*4 + 9930i*3 + 9920i*2 + 3305i. 5i(i + 1)*3(i + 661) Factor -k*2 - 290k - 21025. -(k + 145)*2 Solve -3o*5 + 14962o*4 - 79709o*3 - 14982o*2 + 179332o + 99640 = 0 for o. -1, -2/3, 2, 5, 4982 Solve 2s4/5 + 22s*3/5 - 4s*2/5 - 48s = 0 for s. -10, -4, 0, 3 Let -5b2 + 577170b - 16656260445 = 0. Calculate b. 57717 Determine c, given that -2c3/3 + 2590c*2/3 - 41500c = 0. 0, 50, 1245 Factor c*2 - 1944c - 202257. (c - 2043)(c + 99) Let c4 + 48763c*3/5 + 77989c*2/5 - 185263c/5 + 58506/5 = 0. Calculate c. -9751, -3, 2/5, 1 Find h such that -h*5/2 + 93h*4/2 - 905h*3 - 8250h*2 - 12500h = 0. -5, -2, 0, 50 Solve -2r4/13 - 2r*3 + 6r*2 + 18r - 540/13 = 0 for r. -15, -3, 2, 3 Let -b*5/4 + 59b*4/4 - 435b*3/4 - 20979b*2/4 + 63558b - 186219 = 0. What is b? -19, 6, 33 Factor -3b2/4 - 531b/4 - 5559. -3(b + 68)(b + 109)/4 What is s in 14s3/9 - 122558s*2/9 - 227660s/9 + 35024/9 = 0? -2, 1/7, 8756 Determine p so that 4p2 - 432p - 7380 = 0. -15, 123 Find n such that -4n4 + 1384n*3 - 134388n*2 + 2421440n + 5391568 = 0. -2, 26, 161 Factor 4r3/7 - 2120r*2/7 + 265472r/7 + 591872. 4(r - 272)2(r + 14)/7 Find x such that -18x2 + 86x + 1232 = 0. -56/9, 11 Solve -x*2 + 326x + 114056 = 0. -212, 538 Let 2b5 + 320b*4 + 16066b*3 + 231700b*2 - 1118568b - 31450320 = 0. Calculate b. -66, -19, 10 Factor -c*2/4 + 587871c - 345592312641. -(c - 1175742)*2/4 What is q in -3q*5 + 779q*4 + 10775q*3 + 39445q*2 + 38188q + 8736 = 0? -8, -4, -1, -1/3, 273 Suppose -2g3 + 48300g*2 - 291611250g = 0. Calculate g. 0, 12075 Solve 3y5 + 813y*4 - 8583y*3 - 43197y*2 - 57408y - 23604 = 0 for y. -281, -2, -1, 14 What is x in x*2 - 240x + 11799 = 0? 69, 171 Factor -2i2 - 172i + 48144. -2(i - 118)(i + 204) Factor 2n2/9 + 3620n/9 - 7264/3. 2(n - 6)(n + 1816)/9 Solve u*2/7 - 14u - 1680 = 0. -70, 168 Find v such that -2v3/5 + 138v*2/5 + 8v/5 - 552/5 = 0. -2, 2, 69 Factor w*2/8 - 435w/8 - 443. (w - 443)(w + 8)/8 Let -h3 + 251h*2 - 15367h - 48387 = 0. Calculate h. -3, 127 What is g in -4g4/5 - 16g*3/5 + 4g*2 + 144g/5 + 144/5 = 0? -3, -2, 3 Factor 3c2/5 + 7668c/5 + 9180. 3(c + 6)(c + 2550)/5 Let -2o5/5 - 936o*4/5 + 962o*3/5 + 2240o*2 - 26232o/5 + 15008/5 = 0. What is o? -469, -4, 1, 2 Factor 2d4/13 - 236168d*3/13 + 6971679354d*2/13 + 13944303396d/13. 2d(d - 59043)*2(d + 2)/13 Find z, given that 4z5 - 1548z*4 + 220392z*3 - 13629656z*2 + 304770900z + 318622500 = 0. -1, 75, 119 Suppose -q*2/7 - 670q/7 - 9825/7 = 0. What is q? -655, -15 Solve j*4 + 4475j*3 - 40341j*2 + 67253j - 31388 = 0 for j. -4484, 1, 7 What is y in -y*2/8 + 26483y/2 - 701349289/2 = 0? 52966 Suppose 2q4/13 - 472q*3 - 67668q*2/13 - 215480q/13 - 153950/13 = 0. What is q? -5, -1, 3079 Factor -2o2 + 571o - 5510. -(o - 10)(2o - 551) Factor -3z2/8 + 110046z - 8073414744. -3(z - 146728)2/8 Factor 2t*2/9 + 5204t/9 - 5206/9. 2(t - 1)(t + 2603)/9 Factor -2h3/5 - 203084h*2/5 - 812304h/5. -2h(h + 4)(h + 101538)/5 Find m, given that -2m*2/11 + 5022m/11 + 106344/11 = 0. -21, 2532 Solve 145a5 - 2350a*4 + 7180a*3 + 42770a*2 - 170765a - 157780 = 0 for a. -4, -23/29, 7 Factor -256f4/3 - 26080f*3/3 + 93852f*2 - 646623f/2 + 367416. -(f + 112)(8f - 27)*3/6 Let -2d*3/11 - 39144d*2/11 - 191531592d/11 = 0. Calculate d. -9786, 0 Let -529r5 - 59593r*4/2 - 183755r*3/2 + 72730r*2 - 10486r + 424 = 0. Calculate r. -53, -4, 2/23, 1/2 Factor 6f3/5 - 1989f*2/5 - 996f/5. 3f(f - 332)(2f + 1)/5 Factor -3n3/2 - 1161n*2/2 - 115173n/2 - 547215/2. -3(n + 5)(n + 191)*2/2 Factor -2l*2 + 3208l - 19176. -2(l - 1598)(l - 6) Factor 2q3/11 - 1216q*2 + 1191690q/11 - 26721900/11. 2(q - 6598)(q - 45)*2/11 Factor -4r*3 + 15044r*2 + 287280r. -4r(r - 3780)(r + 19) Determine b, given that -3b*2/5 - 942b/5 + 38961/5 = 0. -351, 37 Solve -775p3 + 12390p*2 + 44335p + 570 = 0 for p. -3, -2/155, 19 What is c in 8c5/3 - 142c*4 + 506c*3/3 + 244c*2 - 208c/3 = 0? -1, 0, 1/4, 2, 52 Determine z so that -5z4/6 - 1835z*3/6 + 2465z*2/2 - 9265z/6 + 1855/3 = 0. -371, 1, 2 Factor -3h2 - 1500540h - 187635024300. -3(h + 250090)2 Let -2q*3 + 472q*2 + 29274q = 0. Calculate q. -51, 0, 287 Factor 2l3/9 - 1238l*2/9 + 230350l/9 - 11309914/9. 2(l - 271)2(l - 77)/9 Factor 3d4 + 48d*3 - 819d*2 + 1944d. 3d(d - 8)(d - 3)(d + 27) Determine k so that -k*2 - 48239k - 48238 = 0. -48238, -1 Factor -3r2 - 11347332r - 10730161959852. -3(r + 1891222)2 Factor -2f*3/3 - 10804f*2/3 - 4867200f - 9720000. -2(f + 2)(f + 2700)*2/3 Find z such that 29745z*3 - 95890z*2 + 19975z - 30 = 0. 1/6	{ "pile_set_name": "DM Mathematics" }
d*2 Let d(q) = -19q + 1108. Let o(h) = 28h - 1109. Determine 6d(t) + 4o(t). -2t + 2212 Suppose -752 - 692 = -38i. Let b(m) = -43m + 82m - im + 2. Let u(v) = -4 + 8 + 6v + 6. Give -11b(q) + 2u(q). q - 2 Let l(m) = -466m*2 + 2. Let i(p) = 1380p*2 - 5. What is 2i(u) + 7l(u)? -502u*2 + 4 Let r be 39/(-169)-13(-2)/3. Let w(n) = -n. Let p(i) = -9. What is rp(u) + 2w(u)? -2u + 18 Let r(y) = -y. Let j(l) = 7l - 2. Suppose 3c - 3a = -0c, 2c - 16 = -2a. Let i be (-2)/(c - 54/9). Calculate ij(q) + 2r(q). 5q - 2 Let v(f) = 39f*2. Let q(n) = -407 + 195 + 11n*2 + 212. Give 18q(a) - 5v(a). 3a2 Let t(g) = g2 + 1. Let f(u) = -4u2 - 8u - 2. Let z be f(-1). Let o(b) = 45b2 + 0 + 37b*z - 89b*2 - 4. Calculate o(n) + 2t(n). -5n2 - 2 Let g(q) = -6q - 2. Let b(l) be the second derivative of 1/2l2 + 140l + 1/2l3 + 0. What is -5b(u) - 3g(u)? 3u + 1 Let d(n) = 557n2 + 24n + 30. Let q(h) = -186h2 - 9h - 11. Calculate -3d(l) - 8q(l). -183l2 - 2 Let u(t) = 13t - 655. Let n(v) = 6v + 17. What is -2n(p) + u(p)? p - 689 Let k(s) = -s*2 + 1. Let c(m) = -4m*2 - 13. Suppose 7g = 21g + 21g - 35. Calculate gc(y) - 5k(y). y*2 - 18 Suppose 69 + 204 = 3f. Let r(z) = -79 - 84 + 254 + z - f. Suppose p - b = 5, -4b - 19 = -p - 2p. Let w(o) = -o + 1. What is pw(m) - 2r(m)? -3m + 1 Let f = -5933 - -5916. Let o(y) = 4y - 14. Let q(j) = 11j - 42. Determine fo(m) + 6q(m). -2m - 14 Let p(m) = 11m3 + 366m*2 - 8m + 4. Let q(r) = 20r3 + 731r*2 - 15r + 7. What is 7p(g) - 4q(g)? -3g3 - 362g*2 + 4g Let n(s) = 1. Let p(a) = 5a - 31. Let v(y) = -10y + 73. Let h(q) = 7p(q) + 3v(q). Determine -h(d) + 5n(d). -5d + 3 Let l(f) = 220f2 + 168f + 17. Let p(k) = -37k2 - 28k - 3. What is -6l(o) - 34p(o)? -62o2 - 56o Let i(o) = -o*2 + 24o + 140. Let t be i(-5). Let f(x) = -x*2 - 7x - 2. Let n(p) = -5p2 - 5p*2 - 4p - 1 + 12p2 - 3p*2. What is tn(h) + 3f(h)? 2h2 - h - 1 Let l(w) be the third derivative of -w4/24 - w*3/6 - 20w*2. Let z(u) be the first derivative of -2u*3/3 - 5u*2/2 + 7. What is -3l(r) + z(r)? -2r2 - 2r + 3 Let y(h) = -5h + 6. Let a(o) be the third derivative of -o4/24 + 21o*3 - 17o*2 + o. Let n(u) be the first derivative of a(u). What is 3n(c) + y(c)? -5c + 3 Let n(j) = 1829j*3 - 2j*2 - 24j - 5. Let m(z) = z*2 + 12z + 1. Determine -2m(q) - n(q). -1829q*3 + 3 Let u(a) = -7a - 12. Let x = -8193 - -8199. Let p(w) = -4w - 6. Calculate xu(n) - 10p(n). -2n - 12 Suppose -y + 0y + 87 = 4x, 2x + 4y = 54. Let r(u) = -17 + 22 - 5u + xu - 25. Let a(k) be the first derivative of -k*2/2 + k - 1. Give -20a(o) - r(o). 4o Suppose -4p + j - 11 = -2p, -3p - 5j = -3. Let r(y) = y3 - y2 + y. Let s(n) = 0n*2 + 2n*2 - 3n*3 + 0n - 103 + 101 - 4n. Calculate pr(o) - s(o). -o*3 + 2o*2 + 2 Let g(h) be the third derivative of 13/60h*5 - 16h*2 - 1/8h*4 + 0 - 1/2h*3 + h. Let k(v) = -9v*2 + 2v + 2. What is -5g(y) - 7k(y)? -2y2 + y + 1 Let b(j) = -2j3 - j2 + j. Let o(p) = -46033p3 - 24787p*2 + 24787p. Determine 24787b(s) - o(s). -3541s*3 Let d(n) = -6n*2 - 2. Let p(o) be the second derivative of 7o*4/12 + 3o*2/2 + 362o. Calculate 6d(x) + 4p(x). -8x2 Let p(t) = -9t*2 - 5. Let x(z) = -5z*2 - 3. Suppose -3m - 3 = 4b, -2m = 159b - 164b - 21. Determine mp(v) - 5x(v). -2v2 Let u(b) = 12b*2 - 4. Let i(w) = 25w2 - 7. Let a(t) = -t2 + 75t - 70. Let j be a(74). What is ji(s) - 7u(s)? 16s*2 Let l(v) = -36v + 27. Let o(t) = 15t - 13. Determine -2l(w) - 5o(w). -3w + 11 Let u(r) = 5r3 + 86r2 + 606. Let a(q) = -q3 - 20q2 - 121. What is -14a(t) - 3u(t)? -t3 + 22t*2 - 124 Let g(f) = 497f*3 - 2f*2 - f - 4. Let v(p) = -2p3 + p2 + p + 1. Give -g(x) - 4v(x). -489x*3 - 2x*2 - 3x Let m(y) = -406 + 0y2 + 406 - 8y*2 - 5y + y2. Let r(k) = -k2 - 5. Let f be r(0). Let a(c) = -6c2 - 4c. Give fm(x) + 6a(x). -x*2 + x Let u(b) = -4781b + 14. Let c(o) = 4779o - 11. Give 5c(v) + 4u(v). 4771v + 1 Let d(f) be the first derivative of 17f2/2 + 2065. Let g(h) = -297h. What is -88d(c) - 5g(c)? -11c Let t(h) = 4h + 29. Let l(y) = y + 7. Let o(q) = -9l(q) + 2t(q). Let p = 58 - -52. Let n(z) = p - 60 - 54. Determine 3n(d) - 2o(d). 2d - 2 Let k(z) = -9z*3 - 14z*2 - 8z - 11. Suppose -23x + 19x = -q - 29, 2q + 26 = 4x. Let a(g) = -6g3 - 9g*2 - 5g - 7. Give xa(t) - 5k(t). -3t3 - 2t*2 - 1 Let r be (-5)/(-3) + -1 + (-1173)/153 - -10. Let w(q) = q. Let x(d) = -4d + 31. What is rw(k) + x(k)? -k + 31 Let t(d) = 15d*2 - 24d. Let n(b) = -43b2 - b + 44b*2 - 72 + 72. Give 72n(v) - 3t(v). 27v*2 Suppose 4l + 67806 = 22l. Let r(h) = lh*2 - 3 - 2 - 3768h*2. Let n(z) = -2z*2 - 6. Determine 5n(o) - 6r(o). -4o2 Let u(h) = h3 + 3h2 - 1. Let d = 39 - 32. Let f(k) = 27k - 55k - k2 + 28k. Calculate df(t) + 2u(t). 2t3 - t2 - 2 Let d(b) = -b - 1. Let l(p) = -2p*2 - 6p + 14. Let h(g) = -g*3 - 50g*2 - 397g + 121. Let y be h(-40). Determine yl(w) - 5d(w). -2w2 - w + 19 Suppose 54 = 44z - 132 - 34. Let q(x) = -3x2 - 3x + 9. Let t(w) = 4w2 + 4w - 10. Calculate zq(b) + 4t(b). b2 + b + 5 Let u(j) = j3 - 4j2 - 49j - 6. Let r(a) = 3a2 + 24a + 2. Calculate -5r(t) - 2u(t). -2t3 - 7t*2 - 22t + 2 Let v(d) = -2d3 + 88d*2 + 24d - 1. Let q(x) = -4x3 + 218x*2 + 49x - 1. Determine -2q(w) + 5v(w). -2w3 + 4w*2 + 22w - 3 Let v(f) = -5f - 2f - 2 - 7 + 51f + 6. Let a(l) = -45l + 4. Give -3a(w) - 4v(w). -41w Let m(f) = -1873f*2 - 39f*3 + 904f*2 + 971f*2 + 2f. Let j(w) = 195w3 - 11w*2 - 11w. What is 2j(q) + 11m(q)? -39q3 Let q(x) be the third derivative of x6/60 + x4/12 - x3/2 + x2 - 291. Let b(k) = k3 + 3k - 3. Determine -2b(i) + 3q(i). 4i3 - 3 Let s(o) = -134o*3 + 53o*2 - 8o - 9. Let d(x) = 133x3 - 59x*2 + 9x + 10. What is 9d(c) + 10s(c)? -143c3 - c2 + c Let l(k) = -141k*2 - 8k + 2. Let r(d) = 990d2 + 57d - 15. Calculate -15l(v) - 2r(v). 135v2 + 6v Let h(w) = -4w + 40. Let n(y) = 5. Give h(q) - 2n(q). -4q + 30 Let z(n) = -n3 - 76n*2 + 160n + 310. Let u be z(-78). Let t(f) = 15f2 + 55f - 55. Let p(w) = w - 1. What is ut(j) + 110p(j)? -30j2 Let q(l) = -l2 + 7. Let p(d) = 9d*2 - 30d - 22. Let y(n) = 4n2 - 12n - 11. Let g(k) = -2p(k) + 5y(k). Determine -5g(t) - 8q(t). -2t2 - 1 Let i(t) = -t3 + 4t*2 - 71t + 2. Let d(g) = -g*3 + 2g*2 + g + 1. Determine -3d(p) + i(p). 2p3 - 2p*2 - 74p - 1 Let p(i) = 28i - 6. Let g(w) = 1186w + 17 - 1081w - 190w. What is -4g(q) - 11p(q)? 32q - 2 Let f(k) = -k2 + 1. Let l = 80 + -168. Let j be (-121)/l - 6/16. Suppose 0 = -4b + 5b + j. Let u(r) = -3r*2 + r. What is bu(a) + 2f(a)? a2 - a + 2 Let l(h) = -3h - h - 2h + 6. Let m(w) = -6w + 5. Let c = -9 - -3. Suppose -6o + 4b - 17 = -7o, 4o - 50 = -10b. What is cm(y) + ol(y)? 6y Let z(x) = -1313x - 2. Let k(a) = 2601049a + 3963. Determine -4k(n) - 7926z(n). 2642n Let y(w) = 23328w + 61. Let v(d) = -15552d - 38. Give 8v(o) + 5y(o). -7776o + 1 Let w = 456 - 458. Let n(k) = -3k2 - 8k - 1. Let c be n(w). Let p(m) = 3m - 2. Let u(q) = -3q + 3. Give cp(z) + 2u(z). 3z Let z(l) = -1. Let j(g) = 5g3 + g2 - 2g + 16. Give j(s) + 7z(s). 5s3 + s2 - 2s + 9 Let j(g) = 172g3. Let r(p) = 2 - 8 - 7912p*3 + 6 + 7911p*3. What is j(b) + 215r(b)? -43b3 Let p(l) = 9l. Let d(r) = -3512r. What is 2d(f) - 6p(f)? -7078f Let f(j) = -2521j - 117. Let y(h) = -13. What is -2f(o) + 18y(o)? 5042o Let s(w) = -3. Let c be (-186)/101 - (-156)/260. Let h be c/(2 + -8) + -5. Let o(y) = y. What is ho(f) - s(f)? -2f + 3 Let h(r) = -975r + 47. Let s(t) = -1950t + 82. What is -7h(i) + 4s(i)? -975i - 1 Let c(u) = -6u2 - 13u - 13. Suppose 5p = 3s + 5, 6 = s + 4p + 2. Let d(i) = si*2 + 9 - 4i2 + i2 + 7i2 + 9i. Determine -5c(w) - 7d(w). 2w2 + 2w + 2 Let b(f) = -f3 + f2 - 1. Let p = 11293 - 11294. Let u(i) = 4i2 - 3 - 4i*3 - 4 + 0i*2. Give pu(d) + 5*b(d).	{ "pile_set_name": "DM Mathematics" }
s digit of c(h)? 2 Let s(h) = h*2 - h - 7. Suppose -25 - 10 = 7w. What is the tens digit of s(w)? 2 Let d(q) = q*2 + 11q + 31. What is the units digit of d(10)? 1 Let m(o) = -o*3 + 7o*2 - 4o + 1. Let c be m(3). Let a = c + -14. What is the tens digit of a? 1 Let q(o) = 4o2 + 5o + 7. What is the tens digit of q(-3)? 2 Let f = -55 - -77. Suppose o + f = 3o. What is the tens digit of o? 1 Let i = 18 + 62. What is the units digit of i? 0 Let f(g) be the first derivative of g6/180 - g5/40 - g4/6 + 2g*3/3 - 2. Let v(r) be the third derivative of f(r). What is the units digit of v(3)? 5 What is the tens digit of (-1)/((-1)/269) - 200/100? 6 Let m(b) = b - 3. Let s be m(4). Suppose -5q + 12 + 8 = 0. Suppose w + t = -t + 7, qw = t + s. What is the units digit of w? 1 Suppose 0 = -5u + 1 + 4, -3u = 5c - 18. Suppose -4s + 3m + 1 - 5 = 0, 0 = cs + 4m + 28. What is the units digit of (-6)/s(-8)/(-2)? 6 Let y(x) = -x3 - 29x*2 + 27x - 16. What is the tens digit of y(-30)? 7 Suppose 5a + u = -4u + 90, -2a + 24 = -2u. What is the units digit of a? 5 Let l = -2 - 0. What is the tens digit of 11/((4/(-2))/l)? 1 Let g(i) = i*3 - 5i*2 - 4i. Let t be g(4). Let l = t + 50. What is the units digit of l? 8 Let h be 12/((-4)/(-26)). Suppose -z + 2x - 3 = -0x, -3z - 5x = -h. What is the units digit of z? 1 Suppose 0 = 13x - 18x + 1205. What is the tens digit of x? 4 Let b = -251 + 559. What is the tens digit of b? 0 What is the units digit of 105 + 4 - -4 - -2? 5 Suppose 5v - 3t - 111 = 0, -171 = -5v - t - 48. What is the units digit of v? 4 Let z = 6 - -3. Let r = z - 5. What is the units digit of ((-7)/r - -3)8? 0 Suppose 0 = -3q + 220 - 13. Let d = q - 24. Suppose v = 6v - d. What is the units digit of v? 9 Let i(d) = 12d*2 - 2d - 2. Let j be i(-2). Suppose -4k = k - j. What is the units digit of (-24)/k50/(-15)? 8 Let u(y) = -2y - 2. Let c(i) = i. Let w(p) = -5c(p) + u(p). Suppose 0 = -3t - 2h - 19, 0h = 4t - h + 7. What is the tens digit of w(t)? 1 Suppose -6h = h - 56. What is the units digit of h? 8 Let j = -2 + 2. Let f be 1 + (2 + j - 1). Suppose c + 7v - fv = -5, 3v = -3c + 9. What is the units digit of c? 5 Suppose 1 = -3y + 16. Suppose -y = -4a + 59. What is the units digit of a? 6 Suppose -2y + 4y = 0. Suppose 0 = -o - 3q + 15, 5o - 2q - q - 111 = y. Suppose 3l = -0l + o. What is the units digit of l? 7 Suppose 4m - 4416 = -8m. What is the tens digit of m? 6 Let j(g) = -g + 40. Let h be j(0). Suppose 5d + 0d = h. What is the units digit of d? 8 What is the units digit of 19 + (-2)/(-4)6? 2 Let v(x) = -x3 - 6x*2 + 3x - 7. What is the tens digit of v(-7)? 2 Suppose r = -2, -118 = -l + 4r - 6r. What is the tens digit of (-3)/12 - l/(-8)? 1 What is the units digit of (-52)/2(-3)/2? 9 Let d(v) = v + 4. Let w be d(-7). Let q be -2 - w4/2. Suppose -2y = -5y + 3a + 42, -5a = -qy + 57. What is the tens digit of y? 1 Suppose 16 = -4b + 3d, -20 + 4 = -4b - 5d. Let l be b/(-1) - (-35 + 0). Suppose 0 = 4s - m - l, -m + 2m + 4 = 0. What is the units digit of s? 8 Let r(s) = s - 5. Let h = 6 - 0. What is the units digit of r(h)? 1 Suppose 9r - 4r - 300 = 0. Suppose -h = 5d - r, -d = -2d - 4h - 7. What is the tens digit of d? 1 Suppose -3c - 3 = -12. Let y(s) be the second derivative of s3/6 - s2/2 + s. What is the units digit of y(c)? 2 Let u(n) = -13n + 41. Let z(i) = 9i - 27. Let h(b) = 5u(b) + 7z(b). What is the units digit of h(-14)? 4 Suppose -2k - 2j = -0j - 32, k - 2j - 25 = 0. Let p be k/(-7) - 2/7. What is the units digit of -31/(p/6)? 6 Let d(c) be the second derivative of -c*5/20 + 5c4/12 - c3/6 - 2c2 - c. What is the units digit of d(3)? 1 Let c be (-6)/8 + 17/(-4). Let m = 0 - c. What is the units digit of m? 5 Let p(i) = -i3 + 12i*2 + 10i + 5. Let g be p(12). Suppose -4q + g = q. What is the tens digit of q? 2 Suppose 0 = -4j + 9j - 745. Suppose -h + j = 5q, 4q = 2q - 3h + 70. What is the tens digit of q? 2 Suppose -3s = m + 13 - 67, -3m = 4s - 157. Suppose m = -3a + 6a. What is the units digit of a? 7 Let b(a) = 15a - 3. Let g be (-2 - (1 + -1))-1. What is the tens digit of b(g)? 2 Let j(z) = -17z3 + 9z*2 - 2. Let a(f) = 9f*3 - 5f*2 + 1. Let u(h) = 7a(h) + 4j(h). What is the units digit of u(-1)? 5 Suppose 6b + 5 = b, -5r = -4b - 764. What is the hundreds digit of r? 1 Suppose -2 = 4j - 2f, 0 = 2f - 3f - 5. Let o = 6 + j. Suppose on = -t - 8, -n + 7 = 3t - 1. What is the units digit of t? 4 Let c(m) = 2m. Let h be c(6). What is the units digit of 94/5 + h/60? 9 Suppose -z + 17 = -4w + 7w, -4z - w + 112 = 0. What is the units digit of z? 9 What is the hundreds digit of 1(-3)/(-9)(0 + 438)? 1 Suppose 4p = -4o - 440 + 1704, -3o = -5p - 924. What is the tens digit of o? 1 Let n be 0/2(-1 - 0). Suppose -3d - 2d = n. Suppose 9 + d = 3q. What is the units digit of q? 3 Let l(s) = -1 - 7s - s2 + 9 + 2s + 0s. Let a be l(-6). What is the units digit of a/(-8) + (-260)/(-16)? 6 Let h = -8 + 9. What is the units digit of h? 1 Let y(f) = f3 + f2 - f + 5. Let b be y(0). Suppose -3p + 1 = j - 3, -bp - 20 = -5j. What is the units digit of j? 4 Suppose 16 = -2x + 2. Let r = x - -8. What is the units digit of r? 1 Let n(s) = -2s + 18. What is the tens digit of n(-10)? 3 Let h(w) = w*3 + 11w*2 + 8w + 8. Let q be h(-10). Let t = q + -17. What is the tens digit of t? 1 Let d(r) = 2r2 + r - 4. Let f be d(4). Let y = f - 17. What is the units digit of y? 5 Suppose -16 = -3d + 3b + 11, 0 = -5d + 4b + 42. Suppose 4i = -2o + 34, di - i = o + 11. What is the units digit of o? 9 Suppose -l - 3 = -11. What is the units digit of l? 8 Let v be (-124)/20 + (-1)/(-5). Let b = 19 - v. What is the units digit of b? 5 Let m = 52 + -76. Let c = m + 35. What is the units digit of c? 1 Let a(y) = -9y + 18. What is the tens digit of a(-10)? 0 Let r = -31 - -91. What is the units digit of r? 0 Let w(z) = 5z*2 - z. Let s = 7 + -6. What is the units digit of w(s)? 4 Let y = 63 + -44. What is the units digit of y? 9 Suppose -l + 15 = 4l. What is the units digit of l? 3 Let o be (-1)/4 - (-9)/4. Suppose -r = -ot + 2r - 4, 6 = -4t + 5r. What is the units digit of t? 1 Let f = -40 - -60. Suppose f = 6i - 4i. What is the units digit of i? 0 Suppose 0 = -2i - 3i. Suppose ij - 4j - 5n = -71, -4n - 4 = 0. What is the units digit of j? 9 What is the units digit of 0 - (-49 + -3 + -1)? 3 Let c be (2/3)/((-4)/(-18)). Suppose -4b - b + 55 = -5m, 0 = -b - cm + 23. What is the tens digit of b? 1 Let m(k) = -k2 - k. Let o(z) = 10z*2 + 3z - 1. Let f(d) = 3m(d) + o(d). Let w be f(1). What is the units digit of w((-1 - -2) + 0)? 6 Let p(m) = -m*2 - 2. Let g be p(2). Let j be (-3)/g - (-18)/(-4). Let i(x) = -2x. What is the units digit of i(j)? 8 Let v(h) = h*3 + 8h*2 - h - 8. Let w be v(-8). Suppose w = -2k + 5y + 31, 3k + 10 = -4y + 45. What is the units digit of k? 3 Let u = -6 - -4. Let w be (-1)/(u(-2)/(-12)). What is the units digit of 1/((-2)/(-6)w)? 1 Let o(m) be the second derivative of m5/60 + m4/12 - m3/6 + m2 + m. Let d(q) be the first derivative of o(q). What is the units digit of d(-3)? 2 Let y(b) = b + 5. Let c be y(14). Let d = c + -8. What is the tens digit of d? 1 Let z(u) = 2u - 3. Let w be z(2). Let o = w + 1. Suppose ox - 4x = -16. What is the units digit of x? 8 What is the units digit of (-1)/(3/3)(-2 - 2)? 4 Let j(w) = 9w*2 + 5w - 2. What is the units digit of j(3)? 4 Suppose u = p + 12, -32 = -3u + 2p - 0p. What is the units digit of u? 8 What is the tens digit of (-2 - -238) + 10/2? 4 Let f(r) = r2 - 5r - 5. Suppose 13 = w + 6. What is the units digit of f(w)? 9 Let h = 9 + -5. Suppose 6 - 66 = hv. Let o = v + 22. What is the units digit of o? 7 What is the tens digit of (0 - 0/(-1)) + 21? 2 Let x(o) = 6o*2 - 2o - 8. Let i(w) = -11w2 + 4w + 15. Let z(t) = -4i(t) - 7x(t). What is the units digit of z(-3)? 0 Suppose 2q = c - 0c + 5, -c + 10 = 3q. Suppose 4x + x = -20, -q*m - x = -65. What is the units digit of m? 3 Let x = 59 - 35. What is the units digit of x - ((3 - 2) + 2)? 1 Let b be (-1 + 7)/(1 + -2).	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.