Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
from jcwcpykpy. 1/42 Two letters picked without replacement from onkcx. What is prob of picking 1 n and 1 c? 1/10 Three letters picked without replacement from {s: 10, r: 9}. What is prob of picking 3 r? 28/323 Four letters picked without replacement from {y: 2, b: 6, t: 2, x: 2, s: 3, d: 2}. Give prob of picking 3 b and 1 y. 2/119 Three letters picked without replacement from wynlnyywwnwwwnn. What is prob of picking 1 w and 2 n? 12/91 What is prob of picking 2 a when two letters picked without replacement from pazhzypy? 0 Calculate prob of picking 2 b and 1 h when three letters picked without replacement from bbbhbhbbbbbbbbbbbbbb. 51/190 Three letters picked without replacement from {q: 2, b: 2, a: 7, f: 1}. What is prob of picking 2 b and 1 a? 7/220 Calculate prob of picking 1 f and 2 h when three letters picked without replacement from {h: 2, p: 1, f: 4}. 4/35 Two letters picked without replacement from nujcn. What is prob of picking 2 u? 0 What is prob of picking 2 t and 1 h when three letters picked without replacement from {t: 2, h: 7, w: 2, l: 1, m: 2, b: 2}? 1/80 Three letters picked without replacement from ttvdddvvvtvvtvvd. Give prob of picking 2 t and 1 v. 3/35 Three letters picked without replacement from nsccsscnlpsnn. What is prob of picking 1 p, 1 l, and 1 n? 2/143 Three letters picked without replacement from rqqqrrqq. What is prob of picking 3 r? 1/56 Two letters picked without replacement from {e: 4, v: 5, l: 5}. Give prob of picking 2 l. 10/91 Calculate prob of picking 2 y when two letters picked without replacement from ypdmpy. 1/15 Three letters picked without replacement from lfhffiyhiyuy. What is prob of picking 1 l, 1 h, and 1 i? 1/55 Two letters picked without replacement from {c: 6, h: 4}. Give prob of picking 2 c. 1/3 Three letters picked without replacement from jjppjsbsjbppsbssbjjp. Give prob of picking 3 j. 1/57 What is prob of picking 2 g and 2 h when four letters picked without replacement from {p: 1, k: 6, g: 4, h: 4}? 12/455 Three letters picked without replacement from neefxneexg. Give prob of picking 1 e, 1 x, and 1 n. 2/15 Two letters picked without replacement from {p: 1, t: 1, x: 1, d: 1, c: 1}. What is prob of picking 1 x and 1 c? 1/10 What is prob of picking 1 s and 1 e when two letters picked without replacement from igueset? 2/21 Calculate prob of picking 1 b and 1 h when two letters picked without replacement from {m: 1, x: 2, t: 2, b: 2, n: 1, h: 1}. 1/18 Two letters picked without replacement from umnrmcucrurnr. Give prob of picking 1 u and 1 r. 2/13 Four letters picked without replacement from bbabbbbaaalbala. Give prob of picking 4 a. 1/91 Two letters picked without replacement from dffddddddfdddddffdd. What is prob of picking 2 d? 91/171 Three letters picked without replacement from {y: 1, b: 2, c: 2, h: 1}. Give prob of picking 1 h, 1 y, and 1 b. 1/10 Calculate prob of picking 1 q and 1 r when two letters picked without replacement from {k: 8, r: 3, q: 6}. 9/68 Calculate prob of picking 1 e and 1 t when two letters picked without replacement from tewttetaettt. 7/22 What is prob of picking 1 w and 1 c when two letters picked without replacement from {h: 1, v: 3, w: 3, l: 7, c: 3, t: 2}? 1/19 Calculate prob of picking 2 s and 1 k when three letters picked without replacement from xvhshmkxs. 1/84 What is prob of picking 1 s, 1 u, and 1 p when three letters picked without replacement from ubebfbebespbfee? 1/455 Four letters picked without replacement from {e: 4, q: 1, z: 8, a: 7}. What is prob of picking 4 z? 14/969 Calculate prob of picking 1 m and 2 i when three letters picked without replacement from imimmmmmimmmmmmimmmm. 8/95 Calculate prob of picking 1 d and 1 i when two letters picked without replacement from iiidiiiiiiddddii. 11/24 Two letters picked without replacement from {i: 8, p: 3, y: 5}. What is prob of picking 2 i? 7/30 Two letters picked without replacement from lqloqqfhttt. Give prob of picking 1 o and 1 f. 1/55 Calculate prob of picking 2 x when two letters picked without replacement from {j: 2, x: 3}. 3/10 Two letters picked without replacement from wdkqttqwkqqkkk. Give prob of picking 1 t and 1 d. 2/91 What is prob of picking 4 g when four letters picked without replacement from gggggggggkkg? 14/33 What is prob of picking 2 o when two letters picked without replacement from cccoccccclcocc? 1/91 Three letters picked without replacement from kcqkckkxkxccclqcqqic. Give prob of picking 1 c, 1 i, and 1 x. 7/570 Calculate prob of picking 1 i and 3 r when four letters picked without replacement from {v: 1, g: 1, r: 4, i: 1, h: 1}. 2/35 Calculate prob of picking 1 i, 1 v, and 1 h when three letters picked without replacement from {i: 4, j: 2, h: 3, v: 1}. 1/10 Three letters picked without replacement from tdbbddtbd. Give prob of picking 3 d. 1/21 Four letters picked without replacement from {b: 6}. Give prob of picking 4 b. 1 Calculate prob of picking 2 d when two letters picked without replacement from {q: 9, d: 7}. 7/40 Three letters picked without replacement from {m: 1, o: 4, e: 8, u: 7}. What is prob of picking 2 u and 1 m? 7/380 Calculate prob of picking 1 d, 1 v, and 1 s when three letters picked without replacement from vvhdhhhhvsvtdavtv. 3/170 Two letters picked without replacement from {h: 11, k: 3}. What is prob of picking 2 k? 3/91 What is prob of picking 3 c when three letters picked without replacement from nicciicuuuuuicuici? 5/408 Four letters picked without replacement from aaaaaaa. What is prob of picking 4 a? 1 Calculate prob of picking 1 r and 1 j when two letters picked without replacement from {j: 5, r: 2}. 10/21 What is prob of picking 4 l when four letters picked without replacement from {s: 1, l: 7}? 1/2 What is prob of picking 2 n when two letters picked without replacement from {n: 9, j: 10}? 4/19 Two letters picked without replacement from {s: 5, e: 1, o: 2, f: 1, q: 3}. Give prob of picking 1 e and 1 q. 1/22 Calculate prob of picking 1 p, 1 z, 1 k, and 1 s when four letters picked without replacement from {z: 1, k: 6, s: 6, p: 4, i: 1}. 4/85 What is prob of picking 1 z and 3 g when four letters picked without replacement from {g: 4, z: 3, c: 9}? 3/455 Calculate prob of picking 2 h and 1 v when three letters picked without replacement from {m: 7, h: 3, q: 3, v: 3, j: 1, k: 2}. 3/323 Calculate prob of picking 1 p and 1 r when two letters picked without replacement from ycrprlycjprc. 1/11 Calculate prob of picking 1 r and 1 c when two letters picked without replacement from cgerv. 1/10 Calculate prob of picking 1 m and 1 b when two letters picked without replacement from {o: 1, b: 1, f: 1, m: 1, q: 1}. 1/10 Calculate prob of picking 1 s, 1 x, and 1 f when three letters picked without replacement from xsoxosxfxxxxx. 8/143 Two letters picked without replacement from {h: 3, n: 3}. What is prob of picking 1 n and 1 h? 3/5 Three letters picked without replacement from {r: 1, a: 4, q: 1, w: 4, f: 1, m: 1}. What is prob of picking 1 w, 1 q, and 1 r? 1/55 What is prob of picking 2 x and 1 g when three letters picked without replacement from xxgxgxgx? 15/28 What is prob of picking 1 d and 1 t when two letters picked without replacement from {d: 1, t: 1, o: 5, e: 1, i: 3, g: 2}? 1/78 Calculate prob of picking 1 k, 1 f, 1 b, and 1 y when four letters picked without replacement from ffcyyybffykkyfy. 4/91 What is prob of picking 1 w, 1 j, and 1 p when three letters picked without replacement from wwrpjgs? 2/35 Two letters picked without replacement from ppttpttptpttt. Give prob of picking 2 t. 14/39 Four letters picked without replacement from {m: 4, z: 2, j: 2, c: 2, w: 2}. Give prob of picking 1 z, 2 m, and 1 w. 8/165 Four letters picked without replacement from {n: 1, b: 1, o: 7, a: 3, g: 2}. Give prob of picking 1 g, 1 a, and 2 o. 18/143 What is prob of picking 1 n and 1 v when two letters picked without replacement from qeegeven? 1/28 Two letters picked without replacement from errbeeeeb. What is prob of picking 2 b? 1/36 What is prob of picking 4 o when four letters picked without replacement from iiiooiiiiioiiiiooiii? 1/969 Two letters picked without replacement from {s: 1, o: 2, r: 6, d: 2, f: 1}. What is prob of picking 1 o and 1 f? 1/33 Calculate prob of pick	{ "pile_set_name": "DM Mathematics" }
7? False Does 6 divide 29727? False Is 76579 a multiple of 130? False Is 346 a factor of 188129? False Is 364 a factor of 87254? False Is 13083 a multiple of 26? False Does 28 divide 303156? True Is 356669 a multiple of 109? False Does 4 divide 81908? True Is 479 a factor of 6316094? True Does 602 divide 569285? False Does 339 divide 1952301? True Is 5769590 a multiple of 419? False Is 8708 a multiple of 94? False Is 77 a factor of 34315? False Does 48 divide 3863280? True Is 44 a factor of 8173396? True Is 14283197 a multiple of 9? False Is 13 a factor of 351598? True Does 906 divide 7814250? True Is 39 a factor of 21099? True Does 17 divide 132543? False Is 667 a factor of 1729531? True Does 3 divide 908579? False Is 13865 a multiple of 24? False Does 974 divide 2552986? False Is 6 a factor of 12042? True Is 8186906 a multiple of 18? False Is 734080 a multiple of 2480? True Is 1196937 a multiple of 189? True Is 3206199 a multiple of 141? True Does 35 divide 60128? False Is 118809 a multiple of 43? True Does 79 divide 50955? True Is 304 a factor of 14170146? False Is 625 a factor of 4459375? True Does 19 divide 48944? True Is 20 a factor of 135096? False Is 262934 a multiple of 34? False Is 15028989 a multiple of 19? False Is 25 a factor of 20189? False Does 10 divide 574900? True Does 12 divide 100447? False Is 10 a factor of 1021290? True Is 567856 a multiple of 38? False Is 12616271 a multiple of 1218? False Is 29810 a multiple of 69? False Is 9 a factor of 65536? False Is 35 a factor of 1279390? True Does 28 divide 1905008? True Is 424932 a multiple of 21? False Is 9186758 a multiple of 265? False Is 38406 a multiple of 222? True Is 2304888 a multiple of 411? True Does 64 divide 3142464? True Does 47 divide 444771? False Is 313932 a multiple of 3? True Is 28 a factor of 30995? False Is 2282400 a multiple of 400? True Is 26 a factor of 273156? True Is 129 a factor of 1806? True Does 14 divide 12765? False Does 17 divide 1401019? False Does 19 divide 391476? True Is 2966979 a multiple of 183? True Does 5 divide 158586? False Does 203 divide 1848924? True Is 340046 a multiple of 107? True Is 1519854 a multiple of 50? False Is 3 a factor of 145756? False Does 10 divide 46207? False Does 185 divide 7470200? False Does 3 divide 51861? True Does 283 divide 9022040? True Does 14 divide 5084198? True Does 819 divide 2790483? False Does 85 divide 1719069? False Does 764 divide 4191399? False Does 154 divide 12222210? True Is 804 a factor of 814452? True Is 18 a factor of 7569473? False Is 23 a factor of 31139? False Is 9180 a multiple of 16? False Is 61404 a multiple of 119? True Is 8 a factor of 757199? False Is 102306 a multiple of 51? True Does 200 divide 179000? True Is 23 a factor of 2119088? False Is 68593 a multiple of 17? False Is 31 a factor of 14828428? False Does 17 divide 22117323? True Is 48 a factor of 143568? True Is 133 a factor of 668857? True Is 23 a factor of 453625? False Does 135 divide 1546661? False Is 40334 a multiple of 43? True Is 97 a factor of 492209? False Is 19 a factor of 58217? False Is 257 a factor of 2407529? False Is 10 a factor of 1403? False Does 473 divide 1440758? True Is 13 a factor of 23673? True Is 11 a factor of 150373? False Is 8167797 a multiple of 89? True Is 313135 a multiple of 55? False Is 192889 a multiple of 19? False Is 340546 a multiple of 69? False Does 76 divide 7551968? True Is 944991 a multiple of 74? False Is 2 a factor of 4128643? False Does 113 divide 236418? False Is 500449 a multiple of 21? False Is 171 a factor of 479655? True Does 9 divide 109026? True Does 77 divide 182728? False Is 840690 a multiple of 18? True Is 8 a factor of 58218? False Does 24 divide 113784? True Does 209 divide 165130? False Is 399 a factor of 482358? False Does 39 divide 370461? True Is 1221 a factor of 6689279? False Is 471 a factor of 149530? False Is 864880 a multiple of 76? True Is 89 a factor of 826336? False Is 30300 a multiple of 20? True Is 5381240 a multiple of 219? False Is 57 a factor of 176586? True Is 833 a factor of 17016007? False Does 21 divide 4371040? False Does 14 divide 258608? True Does 14 divide 4317045? False Is 38 a factor of 11257690? True Is 10 a factor of 565050? True Is 687200 a multiple of 82? False Does 14 divide 5821606? True Is 94 a factor of 92862? False Is 380 a factor of 155040? True Is 183396 a multiple of 31? True Does 2 divide 131815? False Is 9168 a multiple of 8? True Is 185 a factor of 489510? True Is 3 a factor of 41900? False Is 14 a factor of 219229? False Is 3 a factor of 198168? True Is 3596225 a multiple of 21? False Is 230484 a multiple of 340? False Is 4792920 a multiple of 165? True Does 7 divide 8000127? False Is 950320 a multiple of 430? False Is 5 a factor of 470530? True Does 6 divide 3450648? True Is 6321252 a multiple of 21? True Is 436752 a multiple of 9? True Is 41 a factor of 49036? True Is 667843 a multiple of 109? True Is 3644474 a multiple of 52? False Does 45 divide 15435? True Does 20 divide 39506? False Is 35 a factor of 175496? False Does 23 divide 10469255? True Is 3 a factor of 1469479? False Does 2 divide 76936? True Is 822248 a multiple of 502? False Is 151 a factor of 80483? True Is 42813 a multiple of 67? True Does 763 divide 1454615? False Is 350 a factor of 141750? True Is 325237 a multiple of 12? False Is 192357 a multiple of 32? False Does 586 divide 1347800? True Does 5 divide 283710? True Is 93088 a multiple of 25? False Is 56 a factor of 7882824? False Is 191 a factor of 19846? False Does 395 divide 4980933? False Is 6080 a multiple of 4? True Does 26 divide 214500? True Is 1472 a factor of 18520842? False Does 16 divide 474064? True Does 9 divide 110459? False Does 5 divide 109599? False Does 251 divide 35181164? True Is 551316 a multiple of 84? False Is 37 a factor of 546098? False Does 4 divide 1753? False Does 38 divide 1112929? False Is 216040 a multiple of 11? True Is 5 a factor of 42696? False Is 8 a factor of 934210? False Is 502463 a multiple of 3? False Does 3 divide 1371622? False Does 74 divide 37296? True Is 23633298 a multiple of 1014? True Is 5058320 a multiple of 1060? True Is 333 a factor of 1142897? False Does 39 divide 4076943? True Does 37 divide 3807607? False Is 730 a factor of 794970? True Is 16 a factor of 39088? True Is 4819 a multiple of 79? True Is 20 a factor of 47362? False Is 5091543 a multiple of 24? False Does 3 divide 189? True Is 12 a factor of 273125? False Is 435021 a multiple of 810? False Is 4942476 a multiple of 396? True Does 38 divide 835050? True Is 10014408 a multiple of 426? True Is 12 a factor of 244481? False Is 8 a factor of 1001485? False Is 139 a factor of 3893931? False Is 185538 a multiple of 102? True Is 193666 a multiple of 33? False Is 5 a factor of 2131087? False Does 10 divide 93920? True Is 24564 a multiple of 267? True Does 95 divide 690460? True Is 583 a factor of 576888? False Does 58 divide 128238? True Is 15 a factor of 65805? True Does 5 divide 130225? True Is 15 a factor of 12258045? True Does 29 divide 132588? True Does 28 divide 1045137? False Does 58 divide 31468654? True Does 107 divide 170879? True Is 105034 a multiple of 86? False Is 235065 a multiple of 13? False Is 290900 a multiple of 100? True Does 1937 divide 13865750? False Is 135 a factor of 206280? True Is 952 a factor of 1264256? True Is 685055 a multiple of 529? True Is 46577 a multiple of 216? False Is 27510 a multiple of 30? True Does 73 divide 184510? False Does 13 divide 452613? False Does 113 divide 1256560? True Is 1219495 a multiple of 405? False Is 32526 a multiple of 30? False Does 9 divide 172811? False Is 499802 a multiple of 424? False Is 15 a factor of 119243? False Is 17 a factor of 210855? False Does 31 divide 1100965? True Does 394 divide 2017674? True Is 447575 a multiple of 124? False Is 587732 a multiple of 18? False Is 522041 a multiple of 12? False Does 13 divide 1411437? False Is 26 a factor of 8762? True Is 1574360 a multiple of 19? False Is 20 a factor of 33457? False Is 134 a factor of 248972? True Is 265 a factor of 206965? True Is 3291175 a multiple of 25? True Is 1058258 a multiple of 1072? False Is 3 a factor of 4405? False Does 1083 divide 10730253? False Does 17 divide	{ "pile_set_name": "DM Mathematics" }
n - 8 for n. 5 Let o(s) = 7s2 + s + 1. Suppose -2b - 3 = -5b. Let r be o(b). Suppose 0 = -rt + 5t. Solve 3 = -tc + c for c. 3 Let a = 248 + -244. Solve -14i + a = -15i for i. -4 Let h(p) = -p*3 - 5p*2 - p + 14. Let r be h(-4). Suppose 5y - 4z = 121, 3z + 16 = y - 6. Solve rq + 3q + y = 0 for q. -5 Let y = 22 + -26. Let q = y - -8. Solve -5m - q = -m for m. -1 Let l be 5 + -7 + -2 + (29 - 1). Let u be (-3 + 2)/((-6)/l2). Solve -a = ua - 6 for a. 2 Let h = -838 + 843. Solve -h + 14 = 3n for n. 3 Suppose 4h = k - 14, 5k - h = 43 - 11. Let i be 21/(-15) + (-9)/15 + k. Solve 5 = -l - il for l. -1 Let h(w) = 5w*3 + 11w - 9w2 - 6w*3 + 6w*2 + 6w*2. Let t be h(5). Solve 3a + t = 2a for a. -5 Suppose 250 = 5d - 5o, -3o = -5d + o + 251. Let n = d - 51. Solve 4t + 0t = n for t. 0 Suppose -13u + 18u + 155 = 0. Let p = u + 40. Suppose -7 = -3b + 4f, 0f + p = b + 2f. Solve -bi = -0i + 15 for i. -3 Let p = 40 + -33. Suppose 1 = -pz + 15. Solve zb - 6 - 4 = 0 for b. 5 Let a = 164 + -137. Let f(p) = p2 - 28p + 28. Let b be f(a). Solve -2 = -u - b for u. 1 Suppose 4l - 12 = l. Suppose 0 = -3d - 0d - 6, ld + 7 = -y. Let g be (-2 + 2)/(1 + y). Solve gi = i - 2 for i. 2 Let x(d) = 10d + 10. Let a be x(-1). Solve -4c + 13 + 7 = a for c. 5 Suppose -5a + 420 = -0a. Solve -15 = -aw + 87w for w. -5 Suppose 12x + 420 = -2x. Let a be -5 - 144/x - 31/(-5). Solve -w = -aw for w. 0 Let w(h) = h*2 - 5h - 18. Let d(p) = -p - 10. Let x be d(-18). Let b be w(x). Solve 5r - 16 = -b for r. 2 Suppose -12a + 17 = -10a + 3k, -3k = 4a - 19. Solve d + a - 5 = 0 for d. 4 Let t(u) = -2u3 + u2 + 3u + 1. Let x be t(-2). Let f = x - 14. Let a = f - -8. Solve 0 = -4o + 1 - a for o. -2 Let b = -240 - -250. Solve 0 = 7l - 5l + b for l. -5 Suppose -3n + 1120 = 37n. Solve -7b = -0b - n for b. 4 Suppose 0 = -3b + 3, 3a + 3b - 3 = 7a. Suppose -23j = -99j + 304. Solve a - j = -h for h. 4 Let c = -231 + 265. Solve 33s - cs = -1 for s. 1 Let v = -4 - -7. Suppose z + 6 = 5. Let o be (-2 - (z - -2)) + 7. Solve vx - o = x for x. 2 Let r be (-9 + (5 - -4))/(-1). Solve -z + 2z - 5 = r for z. 5 Let h(z) = z3 - 3z*2 + 3z - 2. Let l be 11/(-33) + (-14)/(-6). Let y be h(l). Solve -g + yg - 3 = 0 for g. -3 Suppose -2w + 4k = -68, -w = -0k + 3k - 49. Solve r + 36 - w = 0 for r. 4 Let p be (-36)/(-14)84/9. Suppose 3f - p = 3m, 5f - 5m = f + 36. Solve fv + 6 = 26 for v. 5 Suppose 0 = 6c - 33 + 3. Let v be (46/(-10) - -5)c. Let p(r) = 2r - 5. Let j be p(4). Solve -vd + j = d for d. 1 Let u(y) = y2 - 3y - 2. Let i(v) = -v*2 - 6v. Let b be i(-5). Let f be u(b). Let z be (-33)/(-6) - 12/f. Solve zk = k for k. 0 Suppose -57z + 774 + 1506 = 0. Solve -z + 35 = a for a. -5 Let n(t) = t*3 + 6t*2 - t - 3. Let h be n(-6). Let g = 27 + -18. Suppose -d - 3j - 3 = -g, 3d = -hj + 12. Solve -5 = -dl - 2 for l. 1 Suppose -2o - 4k = -32, -209k = -5o - 207k + 128. Solve 0d + o = -8d for d. -3 Suppose 0 = 56w - 1141 - 2779. Solve 5f = 75 - w for f. 1 Suppose 0 = -5f - 20, 5h - h = -5f. Let t(w) = -67w*2 - 15w - 14. Let d be t(-1). Let k = -61 - d. Solve -2u - k = h for u. -5 Suppose -144 = -6c + 10c. Let s = 41 + c. Solve 2n = sn + 12 for n. -4 Suppose 3q - 24 = 3b, 0 = -0q - 2q - 3b + 6. Solve -11s + q = -14s for s. -2 Let u be -5 + -4 + 3 + 1. Let a be 6/(u/75-3). Let r = 33 - a. Solve -2v + r = v for v. 1 Suppose -3u - 20 = -2l, 4 = -2l - 4u - 4. Solve -4b = -2b + l for b. -2 Suppose 0 = 2d + t - 3, 7 = d - t + 1. Solve da + 9 = 3 for a. -2 Suppose 0 = 2f - 4, -7x - 1 = -10x + 4f. Solve -36 = xh - 48 for h. 4 Suppose 10k - 8k - 46 = 5n, -k + 3n + 23 = 0. Solve 0 = -8b + k + 1 for b. 3 Let f(s) = -2s + 5. Let p(x) = -x + 2. Let u(r) = -4f(r) + 9p(r). Let b be u(-5). Suppose -m = -4k - 1, 4k - 5m = 5k - 5. Solve 8z - bz = k for z. 0 Suppose m = -3m + 100. Solve 23r - m = 18r for r. 5 Let c(o) = 3o - 1. Let r = 0 - -1. Let u be c(r). Suppose 24 - 8 = 4x. Solve 3l + x = -u for l. -2 Suppose -3y + 5 = 5w - 7, y - 4 = 5w. Let p be (-473)/(-99) + (-2)/(-9). Suppose -pt - 25 = 0, w = v - 2v - 2t - 8. Solve -a + 0 = v for a. -2 Let o(h) = 73h*2 - 9 + 10h - 39h2 - 33h*2. Let v be o(-11). Solve -v = -2l + 4 for l. 3 Let y(b) = -2 - 23b + 3 + 24b + 0. Let n be y(8). Solve -n = 4h - h for h. -3 Let y(i) = -i2 + 5i - 2. Let c be y(4). Let z be (-2 - 4/(-2))(-1)/c. Solve 0 = -3f - zf + 12 for f. 4 Let f = 6 + -5. Suppose -2i = -9 - f. Suppose -5r + x - 5 + 2 = 0, ir = -x + 3. Solve 0 = 5w - rw + 25 for w. -5 Let b(s) = 31s - 3. Let f be b(2). Solve -63r - 12 = -fr for r. -3 Let i be ((-24)/9)/((140/(-21))/5). Solve -i + 2 = 14u for u. 0 Suppose 2r - 3r + 3 = -3a, 0 = -5r - 4a + 53. Suppose 0 = -3y + r + 6. Solve -3 = -2n + y for n. 4 Suppose 2683g = 2674g + 144. Solve -3b + g = 25 for b. -3 Let q = 10 + -2. Let w = 20 + -17. Let z(n) = 4n2 + n. Let h be z(1). Solve 0 = wf - hf + q for f. 4 Let d = 140 - 136. Solve db - 3 = -19 for b. -4 Let u be (4/14)/((-17)/(-119)). Suppose 5 = 2p + 5s - 8, 2s = u. Solve p = w + 5 for w. -1 Suppose 2t + 30 = 4b, -2t + 1 = -1. Suppose -58 = -3d + 6l - bl, 19 = d + l. Solve 3z - d = -z for z. 5 Suppose 5h - 21 = 2h - 3g, -2g = -2h + 2. Suppose -w - 3 = 0, -39 = -3q + 5w + 33. Let v = q - 17. Solve -f = -vf - h for f. -4 Suppose -18 + 6 = -4p. Solve -o + 0 - p = 0 for o. -3 Let i = -197 - -217. Solve -20l + i = -15l for l. 4 Let o = 708 + -704. Solve -2z + o = -z for z. 4 Suppose 3 - 7 = -2c. Suppose -cq = 2q + 4. Let m be 3(2 - 2 - q). Solve 0i = -mi + 9 for i. 3 Let b be 1/(14/(-4) - -4). Let n(m) = -8m2 + 4m - 5. Let k be n(b). Let h = -29 - k. Solve -z = -hz for z. 0 Suppose -4d + b = -21, 3d + 3 = -5b - 10. Suppose -dc + 2 = -3c. Suppose -4 = -n + 1. Solve -cy + 9 = -ny for y. -3 Suppose 2i = -4a + 56, -4a + 16 = -2a - 2i. Solve -13l - a = -16l for l. 4 Let k = 3 - -3. Suppose 0 = 3g - k - 6. Suppose -2m + gl = 16, 2m + 3m - 35 = -5l. Solve mp = 5p + 15 for p. -5 Let r(s) be the third derivative of s5/60 - 7s*4/24 + 3s*3/2 + 2s*2. Let w be r(6). Suppose 2d - wp + 4 = -2p, -2p = -8. Solve dq = q for q. 0 Let p be (2 + 6/(-3))93/(-279). Solve 0 = -5o - p + 10 for o. 2 Let j = 99 - 84. Solve 4m + 33 = jm for m. 3 Let s be (24/(-40))/((-5)/25). Solve 0 = p + s - 0 for p. -1 Let q be -3(-4)/((-24)/74). Let w = 46 + q. Solve -2b = b - w for b. 3 Suppose 4v = 3h + 20, 0 = -3h - 2h + 3v - 15. Suppose 48j = -3d + 51j + 24, 0 = 2d - 3j - 21. Solve -du - u - 12 = h for u. -3 Let q(h) = -h*3 - 2h*2 + 2. Let d be q(-2). Suppose -b - 1 = -db. Solve 2j = b - 7 for j. -3 Let x = 167 - 162. Solve s + x = 1 for s. -4 Let o = 2 + -1. Suppose 0 = 6s + o - 19. Suppose t - 4 = 3w - 24, -14 = -w + 4t. Solve -6 = sr + w for r. -4 Let u be ((3 - 1) + -6)-1. Suppose 5y = -um + 22, -y - 18 = -5m - 5. Suppose -36 = -mg - g. Solve 4x - x = g for x. 3 Let r = 14 - 9. Suppose q + 3k - 8 = 8, 4q + rk = 43. Solve 8 + q = -3f for f. -5 Let k(v) = 3v + 10. Let r be k(-5). Let f be ((-10)/(-4))/r0. Solve f = -2o - 9 + 3 for o. -3 Suppose 4l - 8 = -23x + 19x, 4l = 3x + 36. Solve 3d - ld + 3 = 0 for d. 1 Suppose -175m + 173m + 10 = 0. Solve 0t = mt for t. 0 Let h(r) = r - 1. Let k be h(1). Suppose 5w + 20 = 4x, -2w - 3w = x - 5. Solve 2y + wy + 4 = k for y. -2 Suppose 0 = 5j + t - 69, -t - 23 = -3j + 3t. Let y(g) = -g*3 + 14g*2 - 12g - 8. Let c be y(j). Solve 0 = z - c + 3 for z. 2 Suppose 2r - y - 18 = 0, -r - 4y - y = -20. Let j be ((-9)/(-45))/(2/r). Suppose -4n - 15 = -5o + 10o, o + 19 = -4n. Solve 2x - j = o for x. 1 Let j = 34 - 59. Let c = -17 - j. Suppose 2s - 3v - 9 = 0, 3s + 6 - 12 = 2v. Solve c + s = 4h for h. 2 Let o(z) = -8z2 - 107z - 30. Let u be o(-13). Solve 3 = -6g - u for g. -2 Suppose 2i - 5i = 5c - 357, 3c = -5i + 211. Solve 0 = ct - 71t for t. 0 Let d be (-2)/5 - 17/(-5). Suppose 17 = -2g + d. Let b be 6/21 - (-2)/g. Solve by = y - 2 for y. 2 Suppose -x + 5 = 3. Suppose 3h = -2p - 3 + 17, xp = 2. Suppose h + 10 = 2g.	{ "pile_set_name": "DM Mathematics" }
13/208)? 40/7 Calculate (((-16)/10)/((-14)/(-1995)))/4. -57 What is the value of (2212/(-474))/(22)? -7/6 What is the value of (100/9)/((-32)/(-6)(-62)/(-4464)3)? 50 What is 7/301085/151933/2? 11/4 Calculate 1691/(-534)168/(-152). 7/2 Calculate (-120/(-8))/((-28)/1680-30). 5 Calculate 120/168287/(-5)30/(-1785). 8/17 Evaluate (337/((-417543)/(-531)))/(3/632). 1/7 What is the value of ((459/816)/((-12)/(-16)))/(12/(-144))? -9 What is ((-8)/22)/((-10341)/(-1251261))? -44 Calculate (4812/1604)/(3/(-44)). -44 Calculate (-9)/1425732/2026395. -2/245 What is (6466/(-106))/(-61)-127? -127 Evaluate (-13388)/16735((-14)/(-7))/(2/172). -34/5 4/(-4)(-1924)/39(-45)/(-60) 37 Evaluate ((((-609)/14)/29)/((-696)/(-32)))/2. -1/29 What is ((26/(14534/387))/(24/52))/((-222)/8)? -2/37 ((93/124)/(5/8))/((-22)/(1540/322)) -6/23 (-33116)/584424/(-11492) 2/169 Evaluate (-21)/(1785/4)-34. 8/5 What is ((-136)/(-40))/(((-759)/(-33))/(-230))? -34 Calculate 203/241880/38775. 4/33 Calculate ((-8701)/565)/(-7106/600). 22 Calculate (-5)/34158/(-419265). 2/121 Calculate (((-16)/(-4))/12)/(2/1355670/15120). 60 9/(93(-55)/13640) -24 Calculate 132/(-1584)648/(-30). 9/5 What is the value of 6/(13/(910/10))? 42 What is (33936/(-178568))/(((-10)/(-85))/(-2))? 42/13 (((-539)/(-6468))/((-2)/(-12)))/((-119)/(-14)) 1/17 What is (2(-24)/832)/(13/(520/30))? -1/13 What is (12/(-204)-51)/(-1(-924)/8)? 2/77 ((-1)/26)/(29/(-696)4) 3/13 (-128)/((-97280)/1710)12/39 9/13 Calculate 4/540/8(-92)/8. -46 Calculate 972274/9585871. 71 What is the value of ((-98013)/(-653420))/(2/(-20))? -3/2 What is the value of ((-144)/(-15))/(((-4)/(-30))/(168/756))? 16 Evaluate (33/11)/((-3)/(-28)). 28 Calculate (-20)/(-45)894/(-2980)(-10)/16. 1/12 Evaluate (-2)/33150(-38)/380. 30 Evaluate 528/(-165)5/(((-32)/(-2))/(-4)). 4 What is the value of 170/((8/(-12))/((-22)/4(-62)/1023))? -85 What is ((1188/(-55))/(((-12)/2)/30))/(40/20)? 54 Evaluate -9(-112)/(-3888)285/(-133). 5/9 Evaluate ((-62)/1240)/(62/721). -3/10 Evaluate (-211014/728)/(3/(-8)). 78 ((-50)/(-3))/((4896/1836)/(16/1)) 100 What is the value of (2/1)/(((-1320)/(-470))/(-66))? -47 What is ((-32758)/62538)/(11/4)? -4/21 Calculate (20/(-10)25/50)/19. -1/19 What is the value of 720/14110929/95082? 60 What is the value of ((4864/114)/64)/(((-1040)/15)/13)? -1/8 What is ((-36)/(-396))/(21/(-7))3? -1/11 Calculate (-6(-5)/20)/((-7)/252). -54 What is the value of (109/(30084/(-184)))/((-2)/(-117))? -39 Evaluate (32/(-4))/((-1657)/(-11599)). -56 (-11/12)/((39/(-19721)-37)/(-6)) 41/6 What is (3/(-30)4152/(-5709))/((-5)/(25/6))? -2/33 Evaluate (((-12)/(-50))/((-342)/570))/((-39)/((-3549)/(-52))). 7/10 Evaluate ((7056/768)/(-49))/((-48)/(-2752)). -43/4 Calculate (13/(-2))/1(-121764)/26514111. 2/67 What is ((-1261)/150059)/(6/34)? -1/21 -86(-18)/8328/(-246)6/(-18) 86 What is the value of (2199/(-733))/(-26(-3)/(-18))? 9/13 (-677)/(-2708)(-688)/4 -43 What is the value of (-1078)/1471104/(-253)? 32 Evaluate ((-4)/(-12)4)/(131150/(-31476)). -8/25 What is 11691/5975412/(-9)? -6/23 1022/(-730)(-51)/(-21) -17/5 2(-5)/(-76)5115/(25875/216) 12/19 What is ((-24)/(-69))/((-353528)/(-18998))? 2/107 What is the value of 16/(-6)(22/7)/((-3296)/8652)? 22 What is the value of 3962/(-12896)8? -3/2 What is -35228/120(-6)/(-57)? -7 Evaluate (-1976)/(-380)(-410)/(-11193). 4/21 Evaluate ((-4)/4)/4(2188/547)/(251). -1/25 What is the value of 9((-61)/((-9333)/476))/(-2)? -14 What is (8036/164)/(-49)(-2)/(-52)? -1/26 What is (-5)/918/60732/(-2)? 61 ((-14)/(-343)301)/(142/(-994)) -86 Evaluate (-30396)/745(-80)/(-48). -68 Calculate 48/(-960)616(-100)/(-35). -88 Evaluate -3(177/(-36))/((-461)/(-1844)). 59 ((1/(-12))/(540/(-80)))/((-141)/(-846)) 2/27 Calculate (5/(-180))/((-152)/158688). 29 What is (98/(-56)(-8)/14)/(-38)? -1/38 Calculate (-13)/((-26)/4)(-1)/((-328)/(-8)). -2/41 What is the value of ((-4480)/(-8))/(-8)336/784? -30 172/(-3655)-1720/((3/2)/(-3)) -32 What is 4(-2)/(-1285)(-4)/1(-2225)/7120? 2/257 (-69)/2728152/(-1564) 46 Evaluate 23/((-46)/(-4))((-462)/(-28))/11. 3 Calculate (((-2)/(-10))/(19(-88)/1672))/((-1)/265). 53 What is the value of 128(-55)/(-9680)-77? -56 What is the value of (4840/1496)/((-7050)/(-2397))? 11/10 Calculate 42/8(2/15411)/((-16)/96). -9/2 200/1251025/328((-2)/1)/24 -5/12 What is (-1310)/6550165/21? -11/7 Evaluate 12972/752132/99. 23 Calculate (-170)/15(-18465)/2462. 85 (412/96-10)/(50/920-4) 23 What is the value of (4180/(-22572))/(20/(-168))? 14/9 What is the value of (-41(-264)/2706)/((-10)/(-16))? 32/5 What is the value of (4/(-15)(-1056)/1408)/(11/(-1))? -1/55 Evaluate (-18)/26(-1833)/141. 9 What is the value of 32410/2778(6/40)/(10/((-160)/(-1)))? 28 What is (9/(((-2)/2)/((-3)/(-9))))/((-1638)/126)? 3/13 (34/4)/(6420/(-12840)) -17 Calculate (-13(-132)/(-2288))/((1(-1)/(-1))/(-68)). 51 What is the value of 2/(((-5)/6)/(-11(-140)/462))? -8 Evaluate (316/(-252))/((-808)/4545). 15/14 Evaluate 16/(-4)(2/(-10))/(15/37585). 4/17 What is 184788/1539973/(-36)? -73/3 What is (-2)/(-5)((855/324)/19)/(184/32)? 2/207 Calculate (-329)/(-141)(-23)/((-1288)/1440). 60 What is ((-616)/336)/(41/((-1968)/2772))? 2/63 Calculate (71175/52036/(-15))/(-9). 73/2 Evaluate (-284)/12-255191/(-16235). -71 What is (-28/(-36)5/(-10))/(16/224)? -28/9 (-469)/(-5)12739/89173 67/5 What is the value of (9/36)/(998/96806)? 97/4 What is 229/(-229)(-16)/(-6)(-228)/(-16)? -38 Calculate (2052/(-405))/(-19)235/(-1316). -1/21 Calculate (11/(-143)-133/18)/((-36)/192). -8/9 What is ((-4125)/19251(-2)/(-3))/(6/210)? -50 Calculate (((-72)/(-96))/(-1))/((-3)/108-15)5. -9 What is the value of (((-1971)/162)/(-73))/((-76)/(-96))? 4/19 ((-1287)/(-11583))/((-6)/(-2))-6 -2/9 What is (1956/2282)/((-1)/35)((-6)/(-1))/(-2)? 90 Evaluate ((-4)/(-51))/44189/(-4189). -1/51 (30/(-20))/(-132(-9)/(-1296)) 18/11 What is (-59080)/844(-1)/(-3)6/(-2)? 70 Evaluate ((-315)/(-1170))/(54/4212). 21 What is the value of ((-2289)/3270)/(4/480)? -84 What is the value of 3344/465234-53(3/2)/1? -4/7 What is the value of (1571724/(-48114))/((-7)/3)? 14 What is the value of ((-2)/2)/1(100/(-700))/(18/(-700))? -50/9 5/(150/(-5))(-25)/(20000/384) 2/25 What is the value of ((-328149)/(-38380))/((-57)/(-36))? 27/5 Calculate (154/1408)/((-21)/6). -1/32 Calculate 825/(-15750)84/264. -1/60 (681/(-16344))/((-3)/(-204)) -17/6 Evaluate ((403596/2376)/(-101))/(-31/33). 37/2 What is the value of 28/(((-5920)/(-40))/37)? 7 Calculate (-512)/7904182/(-56). 4/19 What is the value of ((3753/(-8757))/((-72)/35))/(1/(-4))? -5/6 -314/(-39)(-610)/(-4270) 2/13 (-33)/((-5)/2-8441/14350) -55 Evaluate (304/22)/((-21104)/(-58036)). 38 What is ((119/(-21))/(41/41))/((-2)/18)? 51 What is the value of (18/6)/((6/(-201))/(168/252))? -67 What is the value of (135/(-6)(-38)/(-1140))/(1/36)? -27 What is the value of 1918/82236/(-1848)? -1/22 Calculate 396/33(-242)/66. -44 Evaluate -9867/1876152/4. -133 What is -4(-3)/270(-5(-6)/(-18))/1? -2/27 Evaluate ((-239)/(623790/(-2520)))/7. 4/29 Evaluate (-21)/(-735)36(-28)/675/(-9). 40 What is the value of (-39644)/748(6/2)/(-3)? 53 What is 675/110704140/15? 20/3 Calculate (753/2510)/((12/(-60))/(4/(-15))). 2/5 ((-6)/375)/((-26)/390)(-10)/28 -3/35 What is the value of ((-1)/(-8)104(-40)/1040)/((-22)/10)? 5/22 Evaluate (6/(-7))/((-89)/186934/(-51)). -27 What is the value of (-4)/((-17)/((-17)/(-12)))(-579)/9071? -1/47 What is ((-18908)/33089)/((-8)/(-210))? -15 Calculate ((-11)/38128/(-352))/(-1). -2/19 (-8)/78-48(-16)/1536 -2/39 Evaluate 10110/(-1685)(-24)/(-9). -16 -5(5030/(-1006))/(((-25)/4)/5) -20 Calculate ((36/(-280))/(357/833))/((-6)/95). 19/4 What is ((1/10)/(5/120))/(2(-5)/75)? -18 What is the value of 1/(-1)-4(-917)/470028-69? 7/13 Evaluate (168/35)/((-192)/48). -6/5 Evaluate (-28)/6(2430/(-3780))/(6/14). 7 Evaluate -1148/120(-185)/407. 2 -20(2/(-3))/((-80)/300) -50 What is the value of (48/15020)/(2(-6)/(24-5))? 64 Evaluate ((-621)/(-1656))/(6/(-16)(-10)/14707). 21 ((-2)/(-10))/(2394/(-40698)) -17/5 Calculate (-227220)/(-439292)2/5. 6/29 ((-23)/(4/4))/((-6670)/1450) 5 72*379/((-400603)/1812) -24 What is the value of (2	{ "pile_set_name": "DM Mathematics" }
igit of 91014883? 8 What is the thousands digit of 424584706? 4 What is the hundreds digit of 4193523651? 6 What is the millions digit of 3237161359? 7 What is the units digit of 211579838? 8 What is the hundred thousands digit of 497299836? 2 What is the hundred thousands digit of 32426844? 4 What is the tens digit of 5485509017? 1 What is the units digit of 1429478844? 4 What is the thousands digit of 685151603? 1 What is the thousands digit of 118541060? 1 What is the hundred thousands digit of 13275342? 2 What is the tens digit of 2631624428? 2 What is the hundreds digit of 1927898667? 6 What is the millions digit of 1960728913? 0 What is the millions digit of 3298843996? 8 What is the ten millions digit of 53176510? 5 What is the units digit of 22146745? 5 What is the millions digit of 42479701? 2 What is the ten thousands digit of 82925427? 2 What is the ten thousands digit of 302078777? 7 What is the thousands digit of 124308458? 8 What is the hundreds digit of 1713979971? 9 What is the hundreds digit of 19618836? 8 What is the hundred thousands digit of 28485282? 4 What is the units digit of 1243758255? 5 What is the units digit of 654966620? 0 What is the hundred millions digit of 250652664? 2 What is the tens digit of 2249716562? 6 What is the billions digit of 1241965951? 1 What is the units digit of 623704122? 2 What is the hundred thousands digit of 109412693? 4 What is the tens digit of 12072560? 6 What is the hundred thousands digit of 7851203674? 2 What is the tens digit of 335609253? 5 What is the ten thousands digit of 681025903? 2 What is the units digit of 70865546? 6 What is the thousands digit of 3027522231? 2 What is the hundreds digit of 315081512? 5 What is the thousands digit of 171128439? 8 What is the hundred thousands digit of 875952324? 9 What is the thousands digit of 5176089523? 9 What is the millions digit of 4404629380? 4 What is the hundred thousands digit of 53349824? 3 What is the ten millions digit of 367686534? 6 What is the ten millions digit of 146109636? 4 What is the millions digit of 10991951? 0 What is the ten thousands digit of 283982048? 8 What is the hundred millions digit of 107921210? 1 What is the thousands digit of 10826016? 6 What is the ten millions digit of 59403671? 5 What is the hundreds digit of 163754538? 5 What is the ten millions digit of 2371567874? 7 What is the tens digit of 66508611? 1 What is the ten thousands digit of 47985505? 8 What is the tens digit of 9025932? 3 What is the tens digit of 99582604? 0 What is the millions digit of 644506456? 4 What is the ten millions digit of 672197715? 7 What is the hundred thousands digit of 767652898? 6 What is the tens digit of 1189489338? 3 What is the units digit of 639337752? 2 What is the ten thousands digit of 82813080? 1 What is the ten thousands digit of 1606049388? 4 What is the hundreds digit of 273818141? 1 What is the millions digit of 2338713032? 8 What is the millions digit of 18817661? 8 What is the hundred thousands digit of 76457621? 4 What is the hundreds digit of 65191852? 8 What is the hundreds digit of 1769509021? 0 What is the ten thousands digit of 19560459? 6 What is the units digit of 1121343161? 1 What is the hundreds digit of 1149897144? 1 What is the ten thousands digit of 564003638? 0 What is the hundreds digit of 117296605? 6 What is the hundreds digit of 32190653? 6 What is the thousands digit of 659477651? 7 What is the hundred millions digit of 1245684043? 2 What is the units digit of 16886147? 7 What is the thousands digit of 802389778? 9 What is the hundreds digit of 3001277568? 5 What is the tens digit of 53898685? 8 What is the ten millions digit of 167226057? 6 What is the ten thousands digit of 1150670627? 7 What is the tens digit of 155654333? 3 What is the hundred millions digit of 1222673673? 2 What is the units digit of 607056056? 6 What is the tens digit of 5208233461? 6 What is the thousands digit of 1759432229? 2 What is the hundreds digit of 139348659? 6 What is the hundred millions digit of 1021766871? 0 What is the thousands digit of 4811395682? 5 What is the ten thousands digit of 79612295? 1 What is the ten thousands digit of 1337940791? 4 What is the hundred millions digit of 558025567? 5 What is the thousands digit of 19740137? 0 What is the tens digit of 30437624? 2 What is the ten thousands digit of 2371239345? 3 What is the millions digit of 6366657475? 6 What is the ten thousands digit of 226487454? 8 What is the units digit of 161792439? 9 What is the billions digit of 5692106440? 5 What is the millions digit of 2398342858? 8 What is the tens digit of 485792626? 2 What is the tens digit of 78032803? 0 What is the tens digit of 5995107? 0 What is the units digit of 6297895? 5 What is the thousands digit of 248798158? 8 What is the thousands digit of 41481342? 1 What is the ten thousands digit of 31275398? 7 What is the ten thousands digit of 18716047? 1 What is the ten thousands digit of 342305930? 0 What is the millions digit of 180163984? 0 What is the ten thousands digit of 157347451? 4 What is the tens digit of 33210621? 2 What is the thousands digit of 367748054? 8 What is the tens digit of 42575111? 1 What is the millions digit of 143765309? 3 What is the hundred millions digit of 141971514? 1 What is the thousands digit of 29065898? 5 What is the thousands digit of 111768410? 8 What is the hundred thousands digit of 128436967? 4 What is the millions digit of 72560253? 2 What is the hundred millions digit of 2203465473? 2 What is the ten millions digit of 2938156811? 3 What is the tens digit of 11037823? 2 What is the hundred millions digit of 184971288? 1 What is the units digit of 451348120? 0 What is the units digit of 55299629? 9 What is the ten thousands digit of 141136722? 3 What is the thousands digit of 87088377? 8 What is the ten millions digit of 223020615? 2 What is the ten millions digit of 3660038413? 6 What is the ten millions digit of 74098308? 7 What is the ten thousands digit of 968202479? 0 What is the hundred millions digit of 158546569? 1 What is the hundreds digit of 1142510649? 6 What is the millions digit of 109556047? 9 What is the ten millions digit of 15800445? 1 What is the billions digit of 3472813633? 3 What is the ten thousands digit of 4099445388? 4 What is the units digit of 212713832? 2 What is the hundreds digit of 39183488? 4 What is the units digit of 2893824079? 9 What is the units digit of 2164358523? 3 What is the tens digit of 77638616? 1 What is the ten millions digit of 35690447? 3 What is the ten millions digit of 166471915? 6 What is the thousands digit of 742810342? 0 What is the millions digit of 6419213908? 9 What is the ten thousands digit of 949666209? 6 What is the hundreds digit of 371140363? 3 What is the hundred millions digit of 126477593? 1 What is the hundred thousands digit of 41372227? 3 What is the thousands digit of 65889920? 9 What is the millions digit of 3332191373? 2 What is the ten millions digit of 274586746? 7 What is the thousands digit of 232113270? 3 What is the hundred thousands digit of 520918014? 9 What is the units digit of 45568477? 7 What is the ten thousands digit of 526040449? 4 What is the hundred millions digit of 2445756370? 4 What is the hundreds digit of 40000017? 0 What is the ten thousands digit of 48581913? 8 What is the hundreds digit of 3879632218? 2 What is the tens digit of 30609638? 3 What is the units digit of 862496465? 5 What is the millions digit of 26836550? 6 What is the units digit of 87092781? 1 What is the hundred thousands digit of 89634987? 6 What is the millions digit of 1230200697? 0 What is the hundred thousands digit of 649431681? 4 What is the hundreds digit of 3364472048? 0 What is the ten thousands digit of 1568609152? 0 What is the millions digit of 59970228? 9 What is the thousands digit of 140589641? 9 What is the units digit of 399454542? 2 What is the hundreds digit of 34399825? 8 What is the hundred millions digit of 1294046706? 2 What is the millions digit of 221020378? 1 What is the thousands digit of 786204930? 4 What is the thousands digit of 76328272? 8 What is the ten thousands digit of 153311155? 1 What is the units digit of 17135071? 1 What is the hun	{ "pile_set_name": "DM Mathematics" }
List the prime factors of r. 11 Let j = 37 + -19. What are the prime factors of 2/(-9) - (-130)/j? 7 Let f be ((-4)/(-5))/((-12)/(-630)). Suppose 2j - f = -j. What are the prime factors of j? 2, 7 Let d be (-5)/30 - 38/(-12). Suppose -d - 3 = -2y. What are the prime factors of y? 3 Suppose f = 3f - 4c - 74, -3f + 81 = 4c. What are the prime factors of f? 31 Let x(z) = -z*2 + 1. Let o be x(2). Let k = 0 - o. Suppose 3r - 43 = -2p + 6p, 0 = 5r - kp - 57. What are the prime factors of r? 3 Let f(v) = -v*3 - 4v*2 - 3v - 6. Let x be f(-4). Suppose -x - 3 = -3z. Suppose 3 = -zb + 12. List the prime factors of b. 3 Suppose 14v - 339 = 11v. What are the prime factors of v? 113 Let z = -38 - -83. List the prime factors of z. 3, 5 Let h(s) = -s + 3. Let i be h(-13). Let n = i - 1. What are the prime factors of n? 3, 5 Suppose z = -2r + 5r - 48, 3 = z. List the prime factors of r. 17 Let q(w) = -4w - 12. List the prime factors of q(-8). 2, 5 Let b = -13 + 9. Let v = b - -6. List the prime factors of v. 2 Let o be (-5 - -6)(-2 - -7). Suppose y = -2h + 43, 5h = -oy + 2h + 215. What are the prime factors of y? 43 Let j(t) be the first derivative of -t*2/2 - 4t - 3. Let k be j(-5). Let x(b) = 2b3 + b2. List the prime factors of x(k). 3 Let u(d) = d2 + d - 1. Let f(b) = 4b*2 + 13b + 1. Let i(n) = f(n) - 5u(n). Let o be i(8). List the prime factors of (-5 - -2)(-8)/o. 2 Let y(n) = -n*3 + 9n*2 - 6n - 9. Let f be y(8). Let j(s) = s*3 - 8s*2 + 6s + 7. Let h be j(f). Suppose -t + 0t + 13 = h. List the prime factors of t. 13 Suppose 8x + 138 = 10x. List the prime factors of x. 3, 23 Let u(d) = d + 0d - 13 + 29. What are the prime factors of u(-9)? 7 Let o(d) = d*3 - 10d*2 - 11d + 2. Let q = -17 - -28. List the prime factors of o(q). 2 Let k(g) be the second derivative of g*4/12 - 2g*3/3 - 5g*2/2 + 3g. Let x be k(5). Suppose -2p + p + 8 = x. List the prime factors of p. 2 Suppose 16z + 558 = 25z. List the prime factors of z. 2, 31 Suppose 24j = 27j - 132. List the prime factors of j. 2, 11 Let q = -12 + 18. List the prime factors of q. 2, 3 Suppose 3a - 4 = n, -5n + 6 = -a - a. Suppose -2i = 5u - 0i, 0 = -4u + ni. Suppose u = q - 1 - 2. What are the prime factors of q? 3 Let i be ((-10)/8)/(3/(-12)). Let h(c) = -ic - 3 + 2c - 6. List the prime factors of h(-6). 3 Suppose -6g + 4g = 2b - 4, g = b - 8. List the prime factors of b. 5 Let l = -5 - -8. List the prime factors of 2/6126/l. 2, 7 Let s(a) = -69a + 2. List the prime factors of s(-1). 71 Let t(w) be the first derivative of -w4/4 + 17w*3/3 - 8w*2 + 22w + 8. List the prime factors of t(16). 2, 11 Let o(y) = y*3 + 6y*2 + 6. Let g be o(-6). Suppose gn - 8 = 2n. Suppose 5t = v - 20, -nt = 5v - 12 - 7. What are the prime factors of v? 5 Suppose 220 = 2l + 4p, -3l - 2l - p = -514. List the prime factors of l. 2, 3, 17 Suppose 4a - 207 = -6q + q, -4a + q + 213 = 0. List the prime factors of a. 53 Let b(z) = 1 - 3z + 4z - 4z. Let y be b(2). Let a(g) = -2g - 7. List the prime factors of a(y). 3 Let b = -62 + 224. What are the prime factors of b? 2, 3 Suppose -165 = -5k - 5z, -k + 4k - 103 = -4z. What are the prime factors of k? 29 Let j(i) = 60i + 2. List the prime factors of j(2). 2, 61 Let u(r) = r*3 - 8r*2 + 8r - 4. Let j be u(7). Suppose -4c - c + 4y = -137, jy - 122 = -4c. What are the prime factors of c? 29 Suppose -55 = -o + v + 160, 2v = -3o + 645. What are the prime factors of o? 5, 43 Suppose 0 = 3x - 2x + 4. Let i be 269/5 + x/(-20). Suppose 2y + f = 22 + 6, 4y + 3f - i = 0. List the prime factors of y. 3, 5 Let r(a) = -a2 + 4a + 3. Let v be r(5). Let x be ((-1)/(-3))/(v/(-156)). Suppose -x = -2w - 10. What are the prime factors of w? 2 Let n be (-15)/12(3 - -1). Let g be 52/(-12)(-3 - 0). Let h = n + g. List the prime factors of h. 2 Let x(s) = -s2 - 7s + 9. Let w be x(-7). Suppose -y + 5c = -14 - w, 3c + 39 = 2y. List the prime factors of y. 2, 3 Let a = 12 - 9. Suppose 60 = al - l. What are the prime factors of l? 2, 3, 5 Suppose 52 - 214 = -3c. List the prime factors of c. 2, 3 Let r(x) = 2x*2 - 2x - 1. Let n be r(2). Suppose -nm + 20 = m. What are the prime factors of m? 5 Let v be 1 + 1 + -2 - -2. Suppose vz - 4z = 4c - 10, -5 = 5z. Suppose 0y + 15 = cy. What are the prime factors of y? 5 Suppose -8j = -1105 - 567. List the prime factors of j. 11, 19 Let g(o) = 26o2 - 1. Let x(s) = 27s*2 - 1. Let n(a) = 7g(a) - 6x(a). What are the prime factors of n(-1)? 19 Suppose -4w + 6 = 2. Let g = 17 - w. List the prime factors of g. 2 Suppose 2a = 2j + 184, -j = -a + 2j + 86. What are the prime factors of a? 5, 19 Let d(v) = 5v*2 - v - 1. List the prime factors of d(3). 41 Let c = 164 - 60. What are the prime factors of c? 2, 13 Suppose 3m - 11 - 7 = -3y, 0 = 4y - 12. Let j = m + 27. List the prime factors of j. 2, 3, 5 Let d = 1 - 0. Let s = d - -4. What are the prime factors of s? 5 Let s(y) = -y*3 - 13y*2 + 10. Suppose -2g - 2g + 16 = 0, 38 = -2c + 3g. List the prime factors of s(c). 2, 5 What are the prime factors of 24 + 201 + -4(0 - 1)? 229 Let z(n) = 169n2 + 8n + 8. List the prime factors of z(-1). 13 Let i(f) = -18f3 - f2 - f - 1. What are the prime factors of i(-1)? 17 Let n(l) = l3 + l2 + 1. What are the prime factors of n(2)? 13 What are the prime factors of 3/(-7) + 150/7? 3, 7 Let l = 4 - -10. List the prime factors of l. 2, 7 Let v be 1/3 + 60/(-18). Let t = v + 19. What are the prime factors of t? 2 Let z(m) be the first derivative of -m3/2 - m2 - 3m + 4. Let k(j) be the first derivative of z(j). What are the prime factors of k(-3)? 7 Let r(g) = -g*2 + 0g*2 - 3 + 8g + 2g2 - 7g. List the prime factors of r(-4). 3 Let a(w) be the first derivative of -5w2 + 2. Let p be a(-5). Suppose p = 2b + 3b. List the prime factors of b. 2, 5 Let m = 47 - 24. Let s = m - 21. List the prime factors of s. 2 Suppose -2i + 536 = i + 2t, -3i + 532 = t. Let g = 42 - 15. List the prime factors of 6/g - i/(-18). 2, 5 Let l be 1 - (-5 + 1 - -2). Let u(x) = 4x2 - 3x - 4. List the prime factors of u(l). 23 Let n = 40 + -29. Suppose 5x = -y - 2y - 13, -5y - x + 15 = 0. Let q = n - y. What are the prime factors of q? 7 Let p(t) = -t - 2. Let s be p(4). Let r = s - -8. Suppose 20 = -rj + 4j. What are the prime factors of j? 2, 5 Let l(a) = -a + 4. Suppose k = 8k + 42. List the prime factors of l(k). 2, 5 Let x be 390/20 + 2/4. List the prime factors of x/828/10. 7 Let b be 1 + (3 + 1)/4. What are the prime factors of (-21 - b)(-3 - -2)? 23 Suppose -5x - z = -130, 2x + 0z = -4z + 52. What are the prime factors of x? 2, 13 Suppose -4r = -5y + 15 - 228, -2r - 5y + 69 = 0. List the prime factors of r. 47 Suppose -2g + 13 = -7. What are the prime factors of g? 2, 5 Suppose -22j = -32j + 340. List the prime factors of j. 2, 17 List the prime factors of (-10)/45 - (-245)/9. 3 Suppose 4v - 18 = o + o, -5o = -5v + 20. Suppose -3f + 10 + v = -4i, 20 = -5i + 5f. Let y = i - -6. What are the prime factors of y? 3 Let t(d) = -d*2 - 13d - 14. Let y be t(-11). Suppose -3l = -yl + 95. What are the prime factors of l? 19 Suppose 31 + 5 = -4b + 3g, 3b + g + 14 = 0. List the prime factors of 3/(0 - b/40). 2, 5 Let y be (-28)/(-3)9/2. Let d = y + -27. List the prime factors of d. 3, 5 Suppose 0 = 5c + 2z + 3z, -5z = -2c + 21. List the prime factors of 4/(24/c)58. 29 Suppose 3v - 45 = -5g + 49, -4g = 16. List the prime factors of v. 2, 19 Let q(u) = u2 + u + 26. List the prime factors of q(0). 2, 13 Let d(y) = y3 + 8y*2 + 6y - 2. Let z be d(-5). Suppose -5r + z = -57. What are the prime factors of r? 2, 5 Let v = 346 - 191. Suppose -7o = -2o - v. What are the prime factors of o? 31 Suppose -5a = -10 - 15. Let r = 24 - a. List the prime factors of r. 19 Let l(a) = -a*3 - 3a2 - a - 3. Let f be l(-3). Let n = f - -3. What are the prime factors of n? 3 Let y(q) be the third derivative of q4/3 + 2q2. Let h be y(-3). Let r = -17 - h. What are the prime factors of r? 7 Let q(p) = -3p*2 + 2. Let l be q(-4). What are the prime factors of l/(-3)(-3)/(-2)? 23 Suppose -5*b - 12 =	{ "pile_set_name": "DM Mathematics" }
of c(g) wrt g. 40g3 - 28 Let r(k) = 49 - 93 - k2 + 44 + k. Let y(p) = 2p*2 - 1 + 0p*2 - 6p - p*2. Let o(t) = -6r(t) - y(t). Find the first derivative of o(s) wrt s. 10s Find the second derivative of -1 - 263b*2 - 325b - 23 - 46b2 + 24 wrt b. -618 Let u = 5 - -4. Let i = -7 + u. What is the second derivative of 12k*2 + 11k - k + k*i - 3k wrt k? 26 Let i(w) = -384w2 + w - 7. Let p(z) = 1536z*2 - 4z + 26. Let x(s) = 26i(s) + 6p(s). Find the second derivative of x(y) wrt y. -1536 Let n(a) = -a + 6. Let r(g) = -1. Let k(w) = n(w) + 3r(w). Let q be k(3). What is the derivative of -1 + qi + 0i + 5i*3 - 1 wrt i? 15i*2 Let c(p) be the second derivative of 0p*5 + 12p*2 + 0p*3 + 0p*4 + 0 + 34p + 11/30p6. Find the first derivative of c(a) wrt a. 44a*3 What is the second derivative of 2w*3 + 3w + 12w - 8w*2 - w wrt w? 12w - 16 Let j(l) be the second derivative of -9/2l2 + 3l + 0l5 + 0l*3 + 0 - 11/30l*6 + 0l*4. Differentiate j(r) with respect to r. -44r*3 Let d be (((-60)/18)/5)/((-4)/18). What is the third derivative of 12k*2 + 11k*4 - 1660k*d + 1660k*3 wrt k? 264k Let i(g) be the third derivative of 11/24g4 - 10g*2 + 0 - 1/3g*3 + 0g. Differentiate i(j) wrt j. 11 Let f(t) = -2t3 - 2t*2 + 2t + 1. Let p be f(-2). Let r be (-32)/(-14)(-266)/(-76). Find the second derivative of pi + 0i4 - 3i*4 + ri*4 wrt i. 60i*2 Let k be 2 + -6 + 29 + 0. Let m = k - 11. What is the third derivative of mf*2 - 3f*2 - 13f3 - f2 wrt f? -78 Let w(c) = -c*2 + 7c - 2. Let u(j) = -583j2 - 25j + 23. Let g(i) = -u(i) - 2w(i). What is the second derivative of g(o) wrt o? 1170 Let k = -194 - -200. Let n(f) be the third derivative of 0f + 0f4 + 0 - 7/120f*k + 0f5 + f3 - 8f2. Differentiate n(h) with respect to h. -21h*2 Let q(c) be the third derivative of 439c*5/60 + 62c*3/3 - 89c*2. Differentiate q(k) wrt k. 878k Suppose 0 = 5d - 25, -59 = -5w - 5d - 24. Suppose -3i = -5c + w + 1, 0 = -4c - 4i + 28. Differentiate -3p*3 - 2p3 + 5 - 11 - pc wrt p. -18p2 Let f(s) = s2 + s + 1. Let k = -8 + 6. Let q be f(k). Differentiate -31t - 3 - t*3 + 0t*q + 31t with respect to t. -3t2 Suppose -4z + 6 - 14 = 0. Let d(y) = -15y2 + 4y. Let i(q) = 15q2 - 3q. Let p(o) = zd(o) - 3i(o). What is the second derivative of p(n) wrt n? -30 Let d(r) be the first derivative of -r*4/4 + 2r3 - r2/2 + 8r + 3. Let b be d(6). Find the second derivative of -2s - s + bs5 - 2s wrt s. 40s3 Let c(a) = 3a + 3a - 13a*4 - 15 + 13. Let y(x) = 66x*4 - 30x + 11. Let u(v) = -22c(v) - 4y(v). Find the second derivative of u(h) wrt h. 264h2 Find the second derivative of -9w - 13939w2 + 13939w*2 + 17w*4 + 11w*4 - 8w wrt w. 336w2 What is the third derivative of 28h*2 + 36h*2 + 1 - 3 - 50h*2 - 264h*4 wrt h? -6336h Suppose -5x - 3b = -16, -4b = 2x - 9b - 25. Let k(y) be the first derivative of 7 + 2y*3 - 3 - 6y*x + 5y*5. Find the third derivative of k(v) wrt v. -120v Let u(g) be the second derivative of 0 - 9/2g3 + 22g - 33/2g2. Differentiate u(f) with respect to f. -27 What is the second derivative of 153h*2 - 753h*2 + 609h - 192h wrt h? -1200 Suppose 7a = 30 + 348. What is the second derivative of 0v3 + 5v*3 + av - 63v + 15v*3 wrt v? 120v Let a(w) be the second derivative of 3/20w5 - 7/12w*4 + 0 + 0w*3 + 0w*2 + 16w. What is the third derivative of a(u) wrt u? 18 Suppose b - 34 = -11. Find the third derivative of 6g4 + 159g*2 + bg*4 - 152g*2 wrt g. 696g Let m(b) be the second derivative of -3b6/10 + b4 + b3/3 - 153b*2/2 + 4b + 105. Find the second derivative of m(j) wrt j. -108j2 + 24 Let c(u) = u2 - 3u. Let f be c(4). Let n = -1 + f. What is the third derivative of -4q + q2 + q + 6q*5 + nq wrt q? 360q2 Find the third derivative of -46l*4 - 4l*2 - 11l2 - l2 - 2l3 wrt l. -1104l - 12 Let g(c) be the second derivative of c*4/12 - 7c*3/6 - 7c*2 + 4c. Let a be g(9). What is the second derivative of -3v4 - 9v + 3v4 - 4v*a wrt v? -48v*2 Suppose 32 = -r + 5r. Suppose -13b + 15 = -rb. Find the second derivative of 24w + 10w*b - 12w - 7w wrt w. 60w Suppose -2 + 22 = 5r. Let a(i) be the first derivative of -2 + 2 - ri*3 + 3 - i + 3i*3. What is the derivative of a(h) wrt h? -6h Let r = 50/7 - 265/42. Let c(q) be the third derivative of 0 + 3q2 + 0q + rq3 + 1/8q*4. What is the first derivative of c(g) wrt g? 3 Let d = -45 - -47. What is the third derivative of 12b*2 + 13b*d - 2b*4 - 19b*2 + 11b*2 wrt b? -48b Let z(x) be the first derivative of -x*7/21 + 13x*4/12 + 13x - 10. Let v(w) be the first derivative of z(w). Find the third derivative of v(p) wrt p. -120p2 Let f(s) be the first derivative of 137s*2/2 + 21s - 209. Find the first derivative of f(k) wrt k. 137 Let k(p) = -6p3 + 5p*2. Let w(x) = -17x*2 + 17x*2 + 13x*3 - 11x*2. Let v(m) = -5k(m) - 3w(m). What is the third derivative of v(q) wrt q? -54 Let l(z) = -2z + 12. Let i be l(5). What is the third derivative of -3m3 - 4m2 + mi - 8m2 - 6m*3 wrt m? -54 Let i(q) be the second derivative of -19q*5/20 - 7q*4/12 - 95q*3/2 + 2q + 79. Find the second derivative of i(t) wrt t. -114t - 14 Let s be (-54)/(-12) + 0 + 1/(-2). Let f(l) = -7l*2 - 5l. Let y(r) = -6r2 - 5r. Let d(t) = sy(t) - 5f(t). What is the second derivative of d(b) wrt b? 22 Let s(z) = -12z4 + 33z*3 + 11z*2 - 22z - 291. Let c(w) = -4w3 - w2 + 2w - 1. Let a(j) = -22c(j) - 2s(j). What is the derivative of a(y) wrt y? 96y3 + 66y*2 Let h be ((-1)/2)/((-3)/(-6)). Let s(r) = 7r*2 + 3r + 1. Let c be s(h). Find the third derivative of -p*3 - 2p*2 - cp*3 + 58p - 58p wrt p. -36 Let y(c) be the second derivative of -17c*8/56 - 11c*4/12 - 4c + 1. What is the third derivative of y(s) wrt s? -2040s3 Find the second derivative of -6b*2 - 18b*5 + 2b + 97b4 - 56b*4 - 41b*4 - 190 wrt b. -360b*3 - 12 Suppose 0 = -2q + s + 2s - 26, q - 4s + 18 = 0. Let k = q + 15. Find the third derivative of -ka2 + a - a + a3 wrt a. 6 Let o = -3 - -7. Let q be 14o/83. Find the second derivative of 21k*4 - qk*4 - 6k - 2k5 wrt k. -40k3 Let p(t) = -t2 - t. Let i(a) = 7a2 + 54a + 216. Let k(u) = i(u) + 6p(u). Differentiate k(w) with respect to w. 2w + 48 Let a = 12 + -10. Find the third derivative of 8ta - 3t*5 - 4t*5 + 0t*5 wrt t. -420t*2 Let u(z) be the first derivative of -109z*5/5 + 21z3 - z2 + 93. What is the third derivative of u(k) wrt k? -2616k What is the third derivative of -85t*4 - 24t - t*2 + 4t*2 + 0t*2 + 17t wrt t? -2040t Let o be (-5 + 1)/(-3 + (-8)/(-4)). Find the second derivative of io + 26i - 27i + 17i*4 wrt i. 216i*2 What is the second derivative of -19y + 450y4 - 2 + 10y + 88y + 563y*4 + 41y wrt y? 12156y2 Let b be (-5)/(75/(-12)4/10). Let v(r) be the first derivative of 0r3 - 4 - 1/4r*4 + 0r + br2. What is the second derivative of v(l) wrt l? -6l What is the third derivative of 312m4 - 348m*4 + 146m*2 - 2m*5 + 0m*5 wrt m? -120m*2 - 864m Let k be 3/34 + -376. Let j be 8/(-52) + k/(-52). What is the first derivative of -11w*3 - jw*2 + 7w*2 - 7 wrt w? -33w*2 Find the third derivative of -26a*2 - 549a*4 + 3 - 2 + 585a*4 wrt a. 864a Let n(q) = -312q2 - 51q + 9. Let h(l) = -311l2 - 54l + 11. Let r(k) = -4h(k) + 5n(k). Find the second derivative of r(v) wrt v. -632 Let p be 2/4-1-74. Differentiate 2v3 - p - 2v*3 + 2v*4 + 31 wrt v. 8v3 Let a(l) be the third derivative of l8/70 + l4/6 + l3/3 + 7l2. Let x(s) be the first derivative of a(s). Differentiate x(n) with respect to n. 96n*3 Let z(y) be the third derivative of 5y*9/504 + 83y*6/120 + 11y5/12 + y4/8 - 785y2. Find the third derivative of z(t) wrt t. 600t*3 + 498 Suppose 150 = 16s + 6. Let f(b) be the first derivative of -7b + 9/2b2 + s. Find the first derivative of f(p) wrt p. 9 Let l(f) = -f3 + 5f2 + 5f + 8. Let v be l(6). Let g = -24 - -30. What is t	{ "pile_set_name": "DM Mathematics" }
4q - o - 5 = 0 for q. 5 Suppose 0 = 4b - 5h + 9, 0 = -3b - h - 0 - 2. Let p = 6 + b. Solve -ps - 6 = 4 for s. -2 Let w(s) = s + 5. Let j be w(-3). Suppose -12 + 1 = -3d - u, 3u + 11 = jd. Solve -20 = -dc - 4 for c. 4 Let p be 15((-16)/12)/2. Let w = -5 - p. Solve -z = -2z + w for z. 5 Let n(i) = -i2 - 4i + 3. Let g be n(-5). Let q be ((-1)/g0)/2. Solve -w + q = -4 for w. 4 Suppose h + 4y - 9 = -0h, 2y = 4. Solve -z + h - 5 = 0 for z. -4 Let i(n) = n*3 - 8n*2 + 13n - 37. Let g be i(7). Solve -7 = gk - 2 for k. -1 Let z be 2/(1 + 1) - -1. Let p(q) = 6q - 2 + q*z - 1 + 10. Let r be p(-5). Solve 0 = -0o + ro - 8 for o. 4 Let u(g) = 5g + 2g - 2g + g*2 + 6. Let i be u(-4). Solve 0l = -il - 8 for l. -4 Let v(r) = -6r - 21. Let h be v(-4). Solve 0 = hi - 15 - 0 for i. 5 Let o = -35 - -65. Let k be ((-1)/(-2))/(5/o). Let h = k + 9. Solve -n - h = 3n for n. -3 Let v be 0/(4/2-1). Suppose -16 = -2b + 2p, 4b - p = 11 + 6. Solve va + ba = 9 for a. 3 Let v be (42/(-4))/3-2. Suppose -v - 9 = -4x. Solve -xu = -8 - 8 for u. 4 Let j(g) = 5g - 10. Let l(v) = -v + 1. Let u(a) = -j(a) - 4l(a). Let n be u(5). Let r be (4 + -9)1/(-1). Solve -rz = -4z + n for z. -1 Let c = 226 + -119. Let n = -47 + c. Suppose -4k = -0k - n. Solve 0 = -0d + 3d - k for d. 5 Let p be 1 - (-4 + 2 + -2). Suppose 3x = -5v + 9, -4v + pv = x + 5. Solve -2q = -vq + 2 for q. 2 Let p be (-34)/(-6) + 1/3. Suppose 3d - 20 = -2d. Suppose 5o - d = 16. Solve -r + or = -p for r. -2 Let n = -13 + 13. Solve ny = -y + 2 for y. 2 Let v be 10/33/(-2). Let u = v - -11. Solve 6 + u = 4w for w. 3 Suppose 0 = -6o + 11o - 125. Solve -3z - o = 2z for z. -5 Suppose 75 = 3o - 2f, 0 = -0f + 3f. Let n(c) = -c2 - 4c + 3. Let a be n(-4). Suppose -5b + 19 = at, -5t = -2b - 3t + 14. Solve o = -bk - 0k for k. -5 Suppose 2l = 5c - 34, -4l - 12 = -c - l. Solve 0 = -cv + 9v + 6 for v. -2 Let d = -4 - -7. Suppose -t + 2 = -0t. Suppose 0 = -2b - tb + 4. Solve -b = dr - 2r for r. -1 Let s be 8/69/6. Suppose -sc = -0c. Solve 2a - 10 = -ca for a. 5 Let o(c) = -c*2 + 3c - 2. Let g be o(2). Let n(r) = -2r - 17. Let y be n(-10). Solve gs + 3 = ys for s. 1 Suppose 6h - 15 = h. Let k = h + 4. Solve kt = 2t - 20 for t. -4 Suppose 0 = 2g - 6g. Suppose 4f = -gf. Suppose r = 4n + 4, r + 3n + 3 = -fr. Solve -z = -rz for z. 0 Suppose 2b + 4u - 6 = 0, 0b + b = -3u. Suppose -38 = i + 5c, -b - 12 = 2i - c. Let s = 28 + i. Solve -5l - 5 = s for l. -4 Suppose -3u = -4x - x - 4, 3u - x - 8 = 0. Solve 0 = ut - 8t - 10 for t. -2 Let m = 38 - 33. Solve 2j - mj = -12 for j. 4 Suppose 3w = -5p + 25, -w - 1 + 4 = -p. Let u(t) = -t + 2. Let l be u(p). Solve ln - 8 = -2n for n. 4 Let z = 35 - 30. Solve -zc = -20 + 5 for c. 3 Let j(z) = 5z*2 + 8 - 7z*2 + 6z*2 - 8z + z*3 + 3z*2. Let q be j(-8). Suppose 5r - 6 = -4p + 2, -2r - 4p = -q. Solve r = k + k for k. 0 Let f = -29 + 29. Solve f = -6h + 2h - 8 for h. -2 Let v(n) = n2 + 2n + 10. Let x be v(0). Solve -2h = -4h + x for h. 5 Let n = -7 + 11. Let k(o) = -o*3 + o. Let p be k(-3). Solve nx - 4 = -p for x. -5 Suppose -4n = 5a - n + 39, 5a + 51 = 3n. Let u be (-3)/(a/10)3. Solve 3g + 2 = -u for g. -4 Suppose -2l + 8 = 0, -b + 5l - 15 = 5. Let f be 7/2 - 3/(-6). Solve bg + g - f = 0 for g. 4 Let v(d) = -d3 - 16d*2 + 17d + 5. Let c be v(-17). Solve cr - 1 - 9 = 0 for r. 2 Let i be 8 + -5 + (1 - 0). Solve -12 = -ih + 4 for h. 4 Suppose -v + 9 = 3. Solve 2f - vf + 8 = 0 for f. 2 Let t be 12(5/3)/(-5). Let w be ((-2)/t)/110. Solve 6 = wp - 4 for p. 2 Suppose -2v - 9 = 5j, -4v - j = -5j - 24. Suppose 0s - 2s = 0. Solve s = vu - u for u. 0 Let y be 50/8 - (-3)/(-12). Let k(r) = r*2 - 6r + 7. Let b be k(y). Solve 3l = bl for l. 0 Let f(c) = -c + 1. Let h be f(2). Let y be (-18)/3h/2. Solve -yj + 6 = -6 for j. 4 Suppose 8q - q - 7 = 0. Solve 4g - 5 = -q for g. 1 Suppose 5y - 12 - 33 = 0. Let i be 5/15y/1. Solve m - 4 = -im for m. 1 Let r be (-9)/(-2)(-2)/(-3). Suppose s = -rs - 4. Let f be s/(-2) - (-6)/4. Solve 1 + 1 = -fc for c. -1 Suppose f = 3x - 19 + 5, 24 = 5x - 2f. Suppose -2a + 12 = -xa + 5n, 0 = -n + 4. Suppose -am + 2m = -6. Solve -6j = -mj for j. 0 Let i = 58 - 46. Solve i = t + 2t for t. 4 Let w = 24 - 2. Suppose 0 = 3t - 4h - w, -3t = -0t - h - 19. Solve -2s + t = -4s for s. -3 Let d be 0/((-1 + -1)/(-1)). Let k = 1 - d. Solve k = 5g - 4 for g. 1 Suppose -4 = -4g - 4b, g - 4g - b = -9. Suppose -4 = 2y - gy. Solve 0z + y = z for z. 2 Let u be ((-4)/(-2))/1 - -1. Suppose -4d - 52 = -16. Let m be (-3)/2 - d/6. Solve m = uo - 5o + 2 for o. 1 Let d(z) = -z + 10. Let q be d(7). Suppose -qt - o - 2o - 3 = 0, 5o = -3t - 11. Solve 0 = -tn - 2n + 10 for n. 2 Let u be (0 - 0)/(0/(-4) - -2). Let l(y) be the third derivative of y5/60 + y4/24 + 5y3/6 + y2. Let i be l(u). Solve 3g = -2 + i for g. 1 Let c = 0 + 4. Suppose 8 = 2d + c. Let y be (0/d)/(1/(-1)). Solve ya = -2a - 4 for a. -2 Suppose 0d = 3d + b - 10, 3d - 22 = 5b. Solve -dz + 8 = -8z for z. -2 Let q = -33 + 34. Solve q = -4d - 7 for d. -2 Let n be 2(-4)/(-4) - 0. Solve nk + 3k = -5 for k. -1 Suppose 0 = 5y - 5i + 5, 2i - 2 = 4y - 0y. Let z(v) = -v3 - 5v*2 - v - 3. Let s = -7 + 2. Let t be z(s). Solve y = -n + tn for n. 0 Let q(y) be the second derivative of -y*4/12 - 5y*3/3 - y. Let x be q(-10). Solve xl + 3 = 3l for l. 1 Let r be (-40)/(-24) + (4/(-2))/(-6). Solve rd = d - 1 for d. -1 Let y be -3 - (17/(-17))/((-1)/(-5)). Solve 2a = -y - 2 for a. -2 Let v(x) = x - 5. Suppose -3y + 24 = 3c, -2c + 5y - 12 = -3c. Let m be v(c). Solve 3l - 25 = -ml for l. 5 Let t(f) be the second derivative of -2f + 0 + f2 + 1/6f*3 - 1/12f*4 - 1/20f*5. Let o be t(0). Solve 4k + o = -2 for k. -1 Let t(y) = -y - 2. Let a be t(-3). Let d = a - -3. Suppose -4 = 2m, dv - 20 = 3m + m. Solve 0q + vq = 0 for q. 0 Let t be 1/1 - 3/(-1). Solve -15 = tr + 5 for r. -5 Let g be (-10)/20 + (-30)/(-4). Solve 3y + g = 1 for y. -2 Let t = -3 - 1. Let r = t - -7. Suppose 5i - 11 - 14 = 0. Solve rb - 2b = -i for b. -5 Let w be (-12 - -16)2/4. Let i be (-49)/(-3) - (-3)/(-9). Solve wj - i = -2j for j. 4 Let u = 29 + -29. Solve 3y + uy = 15 for y. 5 Suppose 2k + 2h = 6h + 36, 5h + 9 = -2k. Solve -f = 3 - k for f. 5 Suppose -3t - 3g - 6 = 0, 5t - 3g - 10 = 4t. Suppose 4s - 9 + t = 0. Solve 3b + sb = -5 for b. -1 Let g be 11/(88/32)7/2. Solve gd = 18d + 12 for d. -3 Let x(v) = -v2 + 8v + 7. Let o be x(9). Let k be 2 - o - -2 - 0. Solve 0w - k = -3w for w. 2 Suppose o + 4 = 5. Solve -o = 3n - 4 for n. 1 Let o be (12/9)/(6/9). Solve 0 = -0z + oz + 6 for z. -3 Let n = -33 - -33. Solve p - 1 = -n for p. 1 Let z = 91 - 59. Let g = -26 + z. Solve -gm + 3m = -3 for m. 1 Let m = -6 - -8. Solve b = -0b - m for b. -2 Suppose 5v = 4v + 5. Suppose 0 = vi - 2i - 6. Suppose -c + 0 = -3. Solve iq - cq - 4 = 0 for q. -4 Let y be 0 - (2/2 + -9). Let a be -1 - 1/((-2)/(-6)). Let v = a + y. Solve d = -vd for d. 0 Suppose 7 = 4i + 5m, 1 = -7i + 2i - 3m. Let b = 4 + i. Let q(a) = -a*2 + 3a - 2. Let g be q(b). Solve gu - 4 = -4u for u. 1 Let x be (-2)/(-7) + (-52)/(-14). Solve 2 - 6 = xj for j. -1 Let c = -26 + 36. Let p = -8 + 11. Solve c = po - 5 for o. 5 Let x be 2/4 + 20/(-40). Solve 0u - 5u = x for u. 0 Let g be (-6)/8 - 2/8. Let i = 1 + g. Solve i = -p + 2 + 3 for p. 5 Suppose -3q + 2s + 11 = 0, -6s = -4q - s + 17. Solve qj + 2 = -4 for j. -2 Suppose -5t = 2m - 7m - 5, m = 2t - 2. Solve m = w + 5 - 6 for w. 1 Suppose 0 = -2d + 1 + 19. Suppose 0q - q = -2s + 7, 5q = s + d. Suppose 7 + 32 = qc - 5b, -5b = 15. Solve u + c = -u for u. -4 Suppose -3g - 10 = 4r - 2, 12 = -2g - 4r. Suppose 2i + 4k = gi - 6, 5k + 5 = 0. Suppose 4l - 9 = -i. Solve 4 = la - a for a. 4 Suppose 3 - 15 = -3b. Solve -bp - 6 = -2p for p. -3 Let a(i) = i2 + 5i - 3. Let r be a(-6). Let n = 1 + 3. Suppose 0 = nd - 0 - 8, 13 = y + 5d. Solve -r + 6 = yw for w. 1 Let x(c) be the second derivative of c4/12 - c3/3 - 3c*2/2 + 3c. Let a be x(3). Let g = a + 2. Solv	{ "pile_set_name": "DM Mathematics" }
+ 2 wrt c? 660c2 - 1704co2 What is the first derivative of 202b*3s - 537b3 wrt s? 202b*3 Find the third derivative of 5ac3 - 5ac2d*3 - 16acd*3 + 13c*3d*3 + 4c*2d wrt c. 30a + 78d3 Differentiate p3z2 + 131p*3 - 2p*2z*2 + 224z*2 wrt z. 2p*3z - 4p2z + 448z Find the third derivative of -7a*3p*3s*2 + 81a*3p*2s*3 - 3a*2ps3 - 3ap3s*3 - ap*3s - 3as*3 wrt a. -42p*3s*2 + 486p*2s*3 Find the second derivative of -1378z*3 + 2z*2 + 19334z wrt z. -8268z + 4 Differentiate 235l*3y - 2l3 - 1971y with respect to l. 705l2y - 6l2 What is the first derivative of 2a*2fy2 + 353a*2y*2 + 2a + 220fy*2 - 2f + y*2 - 2y wrt a? 4afy2 + 706ay2 + 2 Find the third derivative of 21f*5i - 10f3i3 + f2i3 + f2i*2 + 22 wrt f. 1260f*2i - 60i3 Find the third derivative of -466z*5 - 3z*2 + 989 wrt z. -27960z*2 Find the first derivative of -4765i + 1366. -4765 Find the third derivative of -141i2s3 + i2s2 - 6is2 + 2is wrt s. -846i2 Find the second derivative of -f2gp - 100f2 - 3fgp + 9fg + g wrt f. -2gp - 200 Differentiate -811hp*3 + 348h - 2p wrt p. -2433hp2 - 2 Find the third derivative of -1426h*5 - 2h*2 - 107. -85560h*2 Differentiate -2bi2o - 2bi*2 + 125bi + 15bo wrt o. -2bi2 + 15b Find the first derivative of -a*2 - 5429a + 3790 wrt a. -2a - 5429 Find the second derivative of -11d*2n*3 - 7d*2n - 2d2 + 96dn4 - 2 wrt n. -66d*2n + 1152dn*2 What is the second derivative of 5gjo*2 - 2gjo + 2go*4 + 27go2 + 14j + 2o wrt o? 10gj + 24go2 + 54g Find the third derivative of -43k2s*3w2 - k2s2 - 3k*2s + 4ks*3w*3 - 3s + w*3 wrt s. -258k*2w*2 + 24kw3 Differentiate -3638m + 1187 with respect to m. -3638 Find the second derivative of 179cn*5 - 11cn4 + 1413cn + c - 1 wrt n. 3580cn3 - 132cn2 What is the second derivative of 55h*4 - 30h wrt h? 660h2 Differentiate 273k*3 + 2k + 339. 819k2 + 2 What is the derivative of 1743fw + w + 189 wrt f? 1743w What is the third derivative of 3n3r*2 - 4n*3r + 2n2 + 13nr + 3r*2 wrt n? 18r*2 - 24r Find the third derivative of -11237h2j*3 + 321h*2j*2 - 2hj2 - 6j*2 - 3j wrt j. -67422h2 Differentiate p2y*2 - 2149p2 - y3 + 248y with respect to y. 2p*2y - 3y2 + 248 What is the first derivative of -mn*3 - 47mn - 6m + 13 wrt n? -3mn*2 - 47m What is the derivative of 62b3 - 5b*2n - 23n - 9 wrt b? 186b*2 - 10bn What is the second derivative of 235v*4 + 6v - 21 wrt v? 2820v2 Find the second derivative of 3d*5qy - 267d*3y - dqy - 96y wrt d. 60d*3qy - 1602dy Differentiate -2r*3 + 3r*2 - 232r + 5134 wrt r. -6r2 + 6r - 232 What is the first derivative of -2k2 - 501k - 344 wrt k? -4k - 501 Find the first derivative of 15706c*4 - 18608 wrt c. 62824c*3 Find the first derivative of -2h*2j - 1225h2 + 2416j wrt h. -4hj - 2450h What is the derivative of -26889c*3 - 20625? -80667c*2 Find the third derivative of 33v5 + v4 - 109v3 + 12v*2 + 125v - 1 wrt v. 1980v2 + 24v - 654 Find the second derivative of -56f4 + 2f*2 + 150f + 1 wrt f. -672f2 + 4 Differentiate qw*3y - 2qw*2y + 35qwy - 2w*3y - w*2 - 44wy wrt q. w3y - 2w2y + 35wy Find the first derivative of 81i + 117. 81 Find the third derivative of -43o*3p*4 - 119o*3p*2 + 10o*2p*2 - 2p*6 wrt p. -1032o*3p - 240p3 What is the second derivative of -2b*5i*2 + 77b*5i - 12b + 2i*2 + 11 wrt b? -40b*3i*2 + 1540b*3i What is the second derivative of -2st*3 + 42st2 + s + 4t*3 - 7t wrt t? -12st + 84s + 24t Find the first derivative of -3194a + 4372. -3194 Find the first derivative of -601f + 164. -601 Find the first derivative of 34g - 367. 34 Find the third derivative of -58l5 - l3 + 123l2. -3480l*2 - 6 What is the third derivative of 23251p*4 - 8606p*2 - p wrt p? 558024p What is the third derivative of 4047v3 + 589v*2 - v + 3 wrt v? 24282 Find the first derivative of -15g*4 + 24g*2i + 460i wrt g. -60g*3 + 48gi What is the derivative of -2r*2v - 165r2 + 562rv2 + 6r - 3v wrt v? -2r*2 + 1124rv - 3 What is the second derivative of 2c*2h*2w*3 + 23c*2h*2w + 10ch*2w*2 - ch*2w - w*3 wrt c? 4h*2w*3 + 46h*2w Find the third derivative of 3343f6 - 2f*5 + 19178f*2. 401160f*3 - 120f2 What is the second derivative of -k5 - 233k4z*2 + 235kz2 + z2 wrt k? -20k*3 - 2796k*2z*2 Find the third derivative of 99hs5 + hs*4 + h - 72s*2 - 2s + 4 wrt s. 5940hs*2 + 24hs Differentiate -q2u*3 - 265qu3 + 1204u*3 + 2u with respect to q. -2qu*3 - 265u*3 What is the third derivative of 816t*5 - 98t*2 - 2? 48960t*2 What is the third derivative of -10564g*6l*2 - 187g*2 - 36gl2 wrt g? -1267680g*3l2 Differentiate v2 - 84v + 516 wrt v. 2v - 84 What is the third derivative of -214rw*3 - 171r - w*2 wrt w? -1284r Differentiate -15763d3w - 76d3 + 36d*2 with respect to w. -15763d*3 What is the second derivative of -269w*3 - 2w*2 - 8463w? -1614w - 4 Find the third derivative of b4iw + 740b*4 - 2b*3w + 27b2i + 2biw + 9w wrt b. 24biw + 17760b - 12w What is the third derivative of -17n*3q4 - n3 - n*2 - 40nq4 - 502nq2 - q wrt q? -408n*3q - 960nq Find the third derivative of -682y4 + 302y*2 wrt y. -16368y What is the second derivative of 8523k2n*2w*2 + 4kn2w*2 - 2kn2w + 2kn - 20kw*2 + 2n*2w*2 wrt k? 17046n*2w*2 What is the first derivative of -3i*3u*2 - 2i*3u + 1117i3 - 199u*2 + 2u wrt u? -6i3u - 2i3 - 398u + 2 What is the third derivative of -3b2k*4 + 2b*2k*2 + bk*2 + 12bk + 6k*4 wrt k? -72b*2k + 144k What is the first derivative of -185lm - 8l - 20 wrt m? -185l Differentiate -32npx*3 + 2npx - 4nx*3 - 58px3 - 54px2 - px wrt n. -32px*3 + 2px - 4x3 Differentiate -a2cd - 2a2c - 4a2d + 2ac + 100cd2 - 558 wrt d. -a2c - 4a*2 + 200cd Find the first derivative of 23b*2 + 23b - 278 wrt b. 46b + 23 Find the third derivative of -40gq5s - 2gq*3s - gq2 + 7gqs - 4gs - q*3 - 3s wrt q. -2400gq*2s - 12gs - 6 Find the third derivative of 204p2q3 + p2 - 8pq*6 + 735q*2 wrt q. 1224p*2 - 960pq3 What is the third derivative of 7565j3 + j2 - 4j - 2069? 45390 What is the second derivative of -47i*3o - 3i3r*2 + 4i*2o + ior + 5ir + 6683or*3 wrt r? -6i*3 + 40098or Find the third derivative of -3a*5v - 14a4v + a*3 + 299a*2v wrt a. -180a2v - 336av + 6 Find the second derivative of -309j4 + 257j wrt j. -3708j2 Find the third derivative of 1916lm4 - 17l - 7m2 - 6 wrt m. 45984lm What is the second derivative of -116o*2q - oq + 4o - q wrt o? -232q Differentiate -5b*3p + 176b3 - b - p - 33 wrt b. -15b*2p + 528b2 - 1 What is the first derivative of -1738g - 1618? -1738 Find the second derivative of 1310h5 + 957h wrt h. 26200h3 Differentiate -f2 + 52f + 101 with respect to f. -2f + 52 Find the third derivative of -646h6 + h3 + 20h2 + 389 wrt h. -77520h*3 + 6 Find the second derivative of -202q*2 + 201q. -404 What is the third derivative of 5757d3p - 51d2p - 148p wrt d? 34542p Find the third derivative of -221s3 - 286s2 wrt s. -1326 What is the derivative of -w3z + 167w*3 + 330wz2 wrt z? -w3 + 660wz Find the third derivative of 8784q*6 - 3q*2 - 680q. 1054080q3 What is the third derivative of -4l*6 + 68l*3 + 10l*2 + 27l - 2 wrt l? -480l3 + 408 What is the first derivative of 152jz2 - j + 57z*2 wrt j? 152z*2 - 1 What is the second derivative of -504f*2s*2z*2 + 8f*2z - 2fs*2z*2 - 9fsz*2 wrt s? -1008f*2z*2 - 4fz2 What is the second derivative of 18h*2j*2z*2 + 187h*2z*2 + hj*	{ "pile_set_name": "DM Mathematics" }
e second derivative of 3381k3m*2o + 78456k3m*2 - 2k*3 + 5312k*2o + 1817kmo wrt m? 6762k*3o + 156912k3 What is the first derivative of -121k*3w + k*3 + 5511k*2w*2 - 828955 wrt w? -121k*3 + 11022k*2w What is the third derivative of 5mn*3y + 1056mn*3 + 87mn2y - mn2 - 2mn - 37my + m - 190n*3y + 3y wrt n? 30my + 6336m - 1140y Find the third derivative of q6 + 163347998q*3 + 117193276q*2. 120q*3 + 980087988 Find the third derivative of -1035789336m*6 - 61071534m*2 - 2m + 2 wrt m. -124294720320m3 Find the first derivative of -r4 - 214r*2 + 3383r + 529568 wrt r. -4r3 - 428r + 3383 What is the third derivative of -177526807a6 + 2a*5 - 25a*2 + 470137 wrt a? -21303216840a*3 + 120a2 Differentiate -r3 + 2225815r2 + 6r - 143193887. -3r2 + 4451630r + 6 What is the third derivative of -2245ak*3 - 784ak - 2736k*3 - 34382k*2 wrt k? -13470a - 16416 What is the second derivative of 131544h3x5 - h3x - 3260hx + 137h - 188x5 wrt x? 2630880h*3x*3 - 3760x*3 Find the second derivative of -2c*2m*2t - c*2mt - 3c*2t - 12158cm - 865277m2t wrt m. -4c2t - 1730554t Find the third derivative of 13411697p*3 - 52143614p*2 wrt p. 80470182 What is the derivative of 103623d*2 - 77d - 249891666 wrt d? 207246d - 77 What is the second derivative of 370219106ax2 - 5ax - 61x - 1315 wrt x? 740438212a Differentiate 7561322o*4 - 8956244 wrt o. 30245288o3 Find the second derivative of -k2q3 + 3184k*2q*2 - 8550k*2q - 600kq*3 - 4kq2 - kq + 2k + 2q*3 - 656q wrt k. -2q3 + 6368q*2 - 17100q Find the third derivative of -306982f3l*2 - 4f*3u*2 - 24276f*2u*2 + 2fl2u*2 + 4fl2 - flu wrt f. -1841892l*2 - 24u*2 Find the first derivative of 2pt3 + 18650883pt2 - 9055078t*3 wrt p. 2t*3 + 18650883t*2 Find the third derivative of -245259244b*3 + 4337375b*2 - 38b. -1471555464 Find the third derivative of 42591628s3 - 53269581s*2. 255549768 Differentiate -834i*2k*2 - 2i*2 - 428ik + 9378313k*2 with respect to i. -1668ik2 - 4i - 428k Differentiate 1559591cv3 + 52834949c - 4v2 - 3 wrt v. 4678773cv2 - 8v What is the third derivative of -55448204m6 - 48871555m*2 wrt m? -6653784480m*3 Find the second derivative of -2cr2x - 37crx + cry + 122cr - cxy + 103r*2xy - 39041r*2y - 15xy + x wrt r. -4cx + 206xy - 78082y What is the third derivative of -1529428mn4 + 23mn2 - 3mn - 8312m + 22n3 - 3n*2 - 7 wrt n? -36706272mn + 132 What is the second derivative of 724590601q*2 - 2q + 269708096 wrt q? 1449181202 What is the second derivative of 98853b3r*2 - 3b*3 - 10b*2r*3 + 1132b*2r - 755br wrt r? 197706b3 - 60b*2r Differentiate -43072378n4 + 50045311 wrt n. -172289512n*3 Find the second derivative of -12104b*4 + 122b*3 - 13b*2 + 224610827b wrt b. -145248b2 + 732b - 26 What is the third derivative of 15172413x5 + 3x*2 - 746365x? 910344780x2 Differentiate 40900ah - 817021au + 11a - 6hu*2 + 4 with respect to u. -817021a - 12hu What is the third derivative of 1162258566a3 + 258213950a*2 - 2 wrt a? 6973551396 Find the second derivative of -1944612m*5 - 6m*4 - m - 11505152. -38892240m*3 - 72m*2 What is the second derivative of -6f*3 + 7202f*2hp + 2fhp + 192682p wrt f? -36f + 14404hp What is the derivative of -64833717v + 13535906? -64833717 Differentiate -8032725b*2l*2n + 581191b2 + 3bn with respect to l. -16065450b*2ln Find the third derivative of -47838j*3x*3 - 60j*3 + 4j*2x*3 - 205j*2x*2 - 2jx2 - 138x*3 wrt j. -287028x*3 - 360 Find the second derivative of -894971m*2z2 - m2z - 54928994mz - z2 wrt m. -1789942z*2 - 2z Find the third derivative of 147n3t*3 + 12250n*3t + 724n2t*3 + 3n*2t*2 + nt*3 - 144t wrt n. 882t3 + 73500t Find the third derivative of 964g3u - 2196g3 + 38169g*2 - 150u wrt g. 5784u - 13176 What is the derivative of -2228542t*3u - 4459450t3 wrt u? -2228542t*3 What is the derivative of 154w*2 - 19377w - 10082856 wrt w? 308w - 19377 Find the third derivative of -21237412t*3 + 10t*2 + 216634 wrt t. -127424472 What is the second derivative of -67792a*3bj2l - 1502a3bl + 2a*2bj - 2abjl + 1640bjl*2 - 14j*2l*2 wrt j? -135584a*3bl - 28l*2 What is the first derivative of -825480b*2 - 194b + 321080946? -1650960b - 194 What is the second derivative of 216958579x*2 + 1570x - 1413 wrt x? 433917158 What is the second derivative of -1208w5 - 4w*3 + 190w*2 + 191016w + 11? -24160w3 - 24w + 380 Differentiate -35418f2ru2 + 47fr3u + 20r3u*2 - 25319ru2 - u2 wrt f. -70836fru*2 + 47r*3u Find the third derivative of -1507p4 + 4405p*3 + 457215p*2 - 11. -36168p + 26430 Differentiate 734n4 - 7916n*3 + 43833203 with respect to n. 2936n*3 - 23748n*2 Find the second derivative of -17895835y*2 - 1237593y + 6 wrt y. -35791670 What is the derivative of -1590667v4 - 78v*2 + 206638334 wrt v? -6362668v*3 - 156v Find the second derivative of -h*4 - 5722h*3 - 369h*2 - 2h + 139413950. -12h2 - 34332h - 738 What is the second derivative of 554v3 - 343676v*2 + 626818347v wrt v? 3324v - 687352 What is the second derivative of -94j*2w*2 + 43803018j*2 + 1760265jw2 + 5w wrt w? -188j2 + 3520530j What is the third derivative of 5879674n3w - 2n2w + 2796nw + 23w - 3 wrt n? 35278044w What is the first derivative of -11i4 - 64487i*2 - 132i - 22068924 wrt i? -44i3 - 128974i - 132 What is the derivative of -428l4 - 247l*2 + 38145803? -1712l*3 - 494l What is the second derivative of 235f3 + 11295f*2 + 493f + 10283? 1410f + 22590 What is the third derivative of -95430ir3 + 20ir2 + 5i - 185r3 + 47888r*2 - r wrt r? -572580i - 1110 Differentiate -1032546406i + 815073841 wrt i. -1032546406 Find the second derivative of 2469p*5 - 557p*3 - 91585820p wrt p. 49380p3 - 3342p What is the second derivative of 10446c4t*3 - 182c*2t*3 + 3ct2 - ct - 781t3 + 384 wrt c? 125352c*2t*3 - 364t*3 What is the second derivative of 6k*3 + 16843201k*2 + 40k - 5043936? 36k + 33686402 What is the second derivative of -g2p2 + g2p + 7916569g*2 - 1775129gp2 wrt g? -2p*2 + 2p + 15833138 What is the third derivative of 4k3y3 - k3 + 10690k2y*3 + 196kxy*2 - 2kxy + 3xy*3 + 4xy + 26 wrt y? 24k*3 + 64140k*2 + 18x What is the first derivative of -3138947a2 + 39000574 wrt a? -6277894a Find the first derivative of -161897098o2 - 178531167 wrt o. -323794196o What is the third derivative of -5799b2g*3j + 8164b2g3 - b2g2j + 2757b2gj + 3359b2 - g2j wrt g? -34794b*2j + 48984b2 Find the third derivative of 7p*4 + 597163p*3 - 882p*2 + 11076p wrt p. 168p + 3582978 What is the third derivative of 10304503m*3r2 - m2r2 + mr*2 - 5032082mr - m + r2 wrt m? 61827018r*2 Find the third derivative of -413g*4 + 107902g*3 + 1145042915g*2. -9912g + 647412 Find the first derivative of 329q2v*4 + 301229q*2v + 2q2 + 36263442q wrt v. 1316q2v*3 + 301229q*2 What is the second derivative of -1075j*3p3 - j3 + j*2p - 3j2 - 172171jp3 + 3jp - 10p - 64 wrt p? -6450j3p - 1033026jp Find the second derivative of -2pq*3 + 57pq + 85398497q*3 + 8q + 188374 wrt q. -12pq + 512390982q Find the third derivative of 7334557u*4 - 14u*2 - 58243 wrt u. 176029368u Find the third derivative of 140155014i3 - 114061i*2 + 27 wrt i. 840930084 Differentiate -11a*2m - 15a2 - 10120a - 5m4 - 5643m - 80 wrt m. -11a2 - 20m*3 - 5643 What is the third derivative of 815z*6 + 14518z*3 + 31780601z*2 wrt z? 97800z*3 + 87108 What is the derivative of -227949424c*2 - 127449630? -455898848c What is the third derivative of -2ny*4 - 1610ny3 - 3016503ny2 + y4 + 4y3 - y2 + y - 1 wrt y? -48ny	{ "pile_set_name": "DM Mathematics" }
Is m(g) a composite number? False Suppose -280w - 49w - 188w = -31233521. Is w a composite number? False Suppose 373 = 5f + 323. Is 1187/(0 - (-5)/f) a prime number? False Let m be 8/(-5)(-6570)/12. Suppose 0 = -5j + 5g + 2555, 657 + 876 = 3j + 5g. Let k = m - j. Is k composite? True Let o be 3/((-48)/(-68)) + (-2)/8. Is ((-25650)/6)/(-5) - o composite? True Is (-132)/(-99)28408095/60 prime? True Let s be (64047 - 4) + 1 + -2 + -4. Suppose s = -22y + 48y. Is y prime? False Let a = 1270299 + -421306. Is a a prime number? True Let b = 64191 + -15910. Suppose 0h + 4h - 3k = b, 0 = -2h + k + 24141. Is h composite? False Suppose -5i = 3c - c + 9, 12 = 4c. Is i12444/(-5) + 4/(-10) a composite number? True Suppose -264m = -68m - 212152164. Is m a prime number? False Let p(l) = -12l3 + 15l*2 - 8l - 19. Let y be p(8). Let v = 1536 - y. Is v prime? True Suppose 5823851 = 48m - 5091189 - 30448. Is m composite? True Let h = -27963 - -70916. Is h prime? True Suppose -98d + 1375018 + 229597 = -1042463. Is d a prime number? True Let n = 3871 + -2524. Is -6 - -5(n + 4) a prime number? False Let z(k) be the third derivative of 0 + 89/24k*4 - 12k*2 + 0k - 9/2k3. Is z(8) a composite number? True Let f(c) = 4c*2 + 0c*2 - 181914c - 5 + 181908c. Let o(u) = 5u + 2. Let z be o(2). Is f(z) a prime number? True Let i(v) = -9v3 - 14v*2 + 35v. Let g(w) = 13w3 + 21w*2 - 52w. Let c(b) = -5g(b) - 7i(b). Let a be c(-7). Let r = -111 + a. Is r composite? False Suppose 3l - 26 = 52. Is 42/(-273) + (-38)/l-15817 a prime number? True Suppose 3w + 0d - d = 2809, 2w - 1862 = -2d. Suppose w = 9s + 2s. Is (-9342)/(-10) - 17/s a composite number? True Let t = 1322 + 8265. Is t prime? True Let g(s) = 111s3 + 4s*2 - 3s - 9. Let y(b) = b3 + b2 - b - 1. Let h(x) = g(x) - 2y(x). Is h(4) prime? True Let l be (54/(-6) - -586376) + 8. Suppose 81790 - l = -45t. Is t composite? False Suppose -18g + 184674 = -16g - 2d, 4d - 184650 = -2g. Is g a composite number? False Let o(q) = -q3 + 11q*2 - 23q + 11. Let y be o(8). Suppose -yt + 5052 = -10433. Is t a prime number? False Is (-10567160)/(-34) + (-45)/(-255) a composite number? True Let c(m) = m2 + 54m + 27. Let r be c(-27). Let z = 807 - r. Is z a composite number? True Suppose 7w - 4587 = 166. Is w composite? True Suppose 0 = 4n - i - 17, 3n + 0i = 4i + 29. Suppose 9p + n = 2901. Suppose 4t = 4486 - p. Is t prime? False Let z be ((-24)/(-9))/(11864/(-1320) + 9). Let m = 1299 - z. Is m a prime number? False Let h = 176848 + -112865. Is h a prime number? False Let j be (((-16)/6)/4)/((-6)/54). Suppose -3r - 18 = 3t, t - 2t - 3r = j. Is 4/(-14) + 5295/35 + t composite? True Let q(j) = 12j3 + j2 + j + 1. Let h = -33 + 36. Is q(h) composite? False Suppose -1016c + 123866 = -1014c + 5w, 2c - 5w - 123906 = 0. Is c a prime number? False Let x be ((-10)/(-25))/(18/(-20) - -1). Let l be x(1/(-2) + 1). Let y(j) = 265j2 + j - 1. Is y(l) a prime number? True Let q(f) = 4698f*2 - 100f + 623. Is q(6) composite? False Let c(x) = 222x + 49. Let k be c(8). Is k/(-10)(-176)/40 a composite number? True Suppose 0 = 9a - 73 - 80. Suppose 22y - 2065 = ay. Is y a prime number? False Suppose -2d - 4q = -305342, -d + 610607 = 3d - 3q. Is d a composite number? False Suppose 27k = 22k - 3g + 2977977, -2977965 = -5k - 5g. Is k prime? False Let o = 10121 - 1599. Let c = o - 5913. Is c a prime number? True Let i(w) = w*2 - 2w - 5. Let a be i(3). Let d(m) = -397m + 6. Let n be d(a). Suppose 3k - n = 1597. Is k a prime number? False Let l be 3 + -3 + 8 + 0 + -3. Suppose -3r = -4y - 13862 + 52831, 5y - lr - 48710 = 0. Is y a prime number? True Is 11431/4 + ((-2)/(-3))/(328/123) a prime number? False Suppose -3 = 5h - 3a, -h - 5a + 5 = 2h. Let j = h - -5. Suppose 2b + 113 = 3t + b, -215 = -jt - 5b. Is t composite? True Let s(v) = 5643v2 + 1123v + 1. Is s(6) a prime number? True Suppose -5263 - 19799 = -12r + 2934. Is r composite? False Let z = -105 + 81. Is ((-152)/z)/(5/1005) a prime number? False Suppose 62 - 118 = -14p. Suppose -pv + 3818 = -3666. Is v prime? True Let i = -41743 - -96782. Suppose -i = -2l - 21l. Is l prime? True Let z = 182 + -163. Suppose -23a = -za - 6316. Is a prime? True Let g(t) = 527t*2 - 3t + 3. Let v be g(1). Let c = -24 + v. Is c a prime number? True Is (8 + (-297)/54)(-602974)/(-5) a composite number? False Suppose 5 = -5u, 2t - 171u - 1612512 = -173u. Is t prime? True Suppose -5d - 88901 = 28644. Is 12 + -8 - (0 - d)/(-1) a prime number? False Let j(f) be the first derivative of -f*3/3 + 15f*2/2 - 41f + 8. Let g be j(11). Suppose -q - w + 750 = -0w, -2q + gw + 1515 = 0. Is q composite? True Let g = -2374 + 7116. Is g a composite number? True Let d(n) = -n3 + 10n*2 - 3n + 57. Let c be d(10). Suppose cv + 18477 = 30v. Is v prime? False Let w = -405 - -412. Is 794 + (-3 - (w + -5)) a prime number? False Let c be (65/(-4))/((-24)/96). Let p = c + -69. Is (6/27-33)/(p/30) a composite number? True Let c = 3506 + -1745. Let f = 362 + c. Is f a prime number? False Let o be (3/6-1)/((-1)/16). Let r be 9(-5)/((-60)/o). Is (-3)/(-6) - (-1095)/r composite? True Suppose -57g - 2528 = -2z - 62g, 5z - 6289 = 3g. Is z composite? False Let b be (-16)/6(-134481)/46. Let p = b - 5457. Is p a composite number? False Let u = -207130 + 307509. Is u a composite number? False Let d(g) = 14g*2 + 39g + 20. Is d(103) a prime number? True Let t = -193574 - -93079. Let x = 177516 + t. Is x composite? True Let h(j) = 438j + 19. Let y(n) = n + 1. Let r(u) = -h(u) - 4y(u). Is r(-3) a composite number? False Suppose -4l + 236249 = -3i, 0 = -14l + 18l - 4i - 236248. Is l prime? True Let w(c) = 36433c + 8923. Is w(78) composite? False Let n(k) = 4k - 60. Let r(f) = -4f + 59. Let y(p) = -6n(p) - 7r(p). Let i be y(12). Is i/(30/(-446))3 a composite number? False Suppose 3z - 18o = -14o + 23025, 2z - 5o = 15350. Is (24/(-4) + z)/((-2)/(-2)) a prime number? True Let r = 9950 + 2301. Is r prime? True Let m = -28154 - -48917. Suppose -3a - 6a = -m. Is a prime? False Let o be (-4 - -1) + 11 + (-1 - 2). Suppose ou = -2m + 2339, u - 3u - 1147 = -m. Is m a composite number? True Let t(d) = 18d*3 - 3d*2 + 8d + 11. Let z be t(8). Suppose 11q - 91166 = z. Is q prime? False Let a = 945016 - 673587. Is a a composite number? False Let x = -69 - -72. Suppose -xd = -2y + 5, -5d + 0d = -3y + 9. Let z(a) = -15a3 - a2 - 2a - 1. Is z(d) prime? True Suppose -a - 4m + 1062 = 0, -5a + 3m = 1139 - 6495. Let t = 1941 - a. Is t composite? True Let l = 686 - 681. Let f(u) = 291u + 46. Is f(l) composite? True Let z(f) = -24 + 288f + 156f - 8 - 87f. Is z(3) prime? True Let g(j) = 520j*2 + 5j - 83. Is g(6) prime? False Suppose 0 = 46p - 6964229 - 3418937. Is p a composite number? False Let o = 350 + -261. Suppose -86z + oz - 16527 = 0. Is z a composite number? True Suppose 5z - 5m = -2657 + 15507, -2z + 5143 = -3m. Is z a prime number? False Let y be (1/3 + -1)3 - -15. Suppose -q = x + 1, -3x = 2q - 4q + y. Suppose -qv + 4h + 22 + 24 = 0, -20 = 4h. Is v prime? True Let h(k) = -1627k3 - 22k*2 - 119k - 45. Is h(-4) a prime number? True Let m = -8911 + 16670. Is m a composite number? False Let b(c) = -115c + 43. Let r(o) = -4o - 24. Let x be r(-8). Let j be 880/(-30) + x/6. Is b(j) composite? True Let z(w) = -w + 5. Let l be z(-3). Is ((l/3)/(-4))/((-72)/472284) a prime number? True Suppose 0 = -4q + t - 7, 5q + 7t - 4t = 4. Let l(u) = -301u - 5. Let f(n) = -n. Let k(w) = ql(w) + 2f(w). Is k(4) a composite number? False Let p be (-455)/(-13)(-2 + 3)1. Suppose pc - 379 = -r + 32c, 5r = -c + 1895. Is r a prime number? True Let a = -109022 - -248575. Is a composite? True Let y = 3174 - 2246. Suppose 5p - l = -2302, -2p + 3l + l - y = 0. Is p/102/(-4) prime? True Let m(i) = -299i - 1. Let j(d) = -d + 9. Let v be j(5). Suppose v = l + 20. Is m(l) composite? False Let c(o) = -972o - 471. Let v(d) = -647d - 314. Let p(y) = -5c(y) + 7v(y). Is p(4) prime? True Let c be 4/410 + -5. Suppose -4f + 2255 = 5n + f, -4n + cf = -1804. Is	{ "pile_set_name": "DM Mathematics" }
- 4h = 4, -3h - 12 = 0. Let p(g) = r + 0g + 2 - 5 + g. Give p(-4). -5 Let b(u) = -u2 - 12u - 14. Let h be b(-10). Let v(r) = -8r3 - 2. Let c(w) = 7w3 - w2 + w + 1. Let k(z) = hv(z) + 7c(z). Give k(6). 1 Let l(v) be the second derivative of 7v3/6 + 3v*2/2 + 8v. What is l(-2)? -11 Let i(k) = k*3 - 6k*2 - 2k + 7. Let p be i(6). Let y(s) = -2 - 5 - s*2 + 3s + 6s - 15s. Calculate y(p). -2 Let y be (-5)/((2/1)/(-2)). Suppose -2b + yn - 16 = 0, b + b - 8 = -n. Let q(x) = x*3 + 14x*b - 15x*2 + 0 - 1. Give q(2). 3 Let a(b) = 5b*2 - 5b - 2. Let p(q) = 36q2 - 36q - 15. Let k(j) = 15a(j) - 2p(j). Determine k(2). 6 Let g(m) = -2m3 + m2 + m. Let r = -7 - -6. Let u be g(r). Let o(s) = s3. What is o(u)? 8 Let t(o) be the third derivative of o4/12 - o3/6 + 16o*2. What is t(-3)? -7 Let o be 1 - (-2)/410. Let f(j) be the first derivative of 1/2j2 - 1 + oj. Calculate f(-5). 1 Let c(i) = -4i - 3. Let t(d) = -17d - 13. Let s(p) = 18c(p) - 4t(p). Suppose -x - 2x - 4j = -14, -2 = x - 2j. What is s(x)? -10 Let q(x) = 6x2. Let z = 14 + -15. What is q(z)? 6 Let m(y) = -y3 + 6y2 - 3y - 4. Let f = -37 - -42. What is m(f)? 6 Let a(r) = -r*2 + 8r - 5. Let s(d) be the third derivative of d5/60 + d4/3 + d*3 - 2d*2. Let w be s(-8). Determine a(w). 7 Let h be (6 + -12)1/2. Let i = h - -7. Let t(u) = u*3 - u + 7 - 2 - u - 4u*2. Determine t(i). -3 Suppose -20 = 3f + 2l - 3, -8 = 2f - 2l. Let j be 333/45 + 2/f. Let a(p) = p - 2. What is a(j)? 5 Suppose 0 = 2b, -m - m - 2b = 0. Let d(p) be the third derivative of 0 - 7/24p*4 + mp + 1/60p5 + 1/2p*3 + 3p*2. What is d(5)? -7 Let y(i) = 4i - 2 + 1 + 3i + 0. Give y(1). 6 Let n(k) be the third derivative of k5/60 - 7k4/24 + k3/2 + 6k2. Calculate n(5). -7 Let s = 19 + -15. Let r(b) = -2 - 3b - b + 3b - 3b + b*2. Calculate r(s). -2 Let k = 28 - 27. Let x(g) = -6g. What is x(k)? -6 Let n(q) be the third derivative of q*4/24 - 4q*3/3 + 7q2. Determine n(6). -2 Let x(h) = h2 - 3h - 2. Let f(b) = 2b*2 - 11b - 2. Let t be f(6). Calculate x(t). 2 Let g be (1/2)/(3/30). Let k(c) = c*2 - 5c + 3. Let n be k(g). Suppose -nh + 0 = 9. Let x(b) = b3 + 3b*2 + b - 2. What is x(h)? -5 Let f(v) = -9v + v2 + 21 + 22 + 16 - 51. Determine f(8). 0 Let a(d) be the third derivative of d6/120 + d5/10 + d4/12 - 5d3/6 - 21d2. Calculate a(-6). -17 Let f(g) = g3 + 3g2 + 2g - 2. Let u be f(-2). Let y(k) = -k. Let r(b) = 2b - 2. Let t be r(2). Let h(p) = 4p. Let j(z) = ty(z) + h(z). Determine j(u). -4 Let u = -60 + 60. Let p(z) = -z + 2. Let b(f) = -f. Let t be b(-3). Let i(o) = 2o - 4. Let n(d) = ti(d) + 5p(d). Determine n(u). -2 Let x = 7 - 2. Let i(z) = -x + 2z + 5 - 3 + 1. Let a = 8 + -6. What is i(a)? 2 Suppose 2a = -3a + 25. Let j(q) be the third derivative of -q5/60 + q4/4 - q3 + 2q*2. Calculate j(a). -1 Suppose 4l = 19 - 3. Suppose b - 2q + 9 = 3q, 2q = -3b + 24. Let d(s) = s*2 - 3 + 0s*2 + bs - 2s2. What is d(l)? 5 Let p be (-2)/12 + 50/12. Suppose -5d = 15, -d - 40 = 5o + pd. Let u(a) = a*2 + 8a + 7. Give u(o). -8 Let k(p) = 1 - 8p + 6 + 5 - 11. Determine k(-1). 9 Let k(p) = -p3 - p2 + 3p - 4. Suppose 4j + r - 39 = 0, 6 = -3r - 9. Let x(h) = -h + 16. Let o be x(j). Suppose 3g + 4 + o = 0. What is k(g)? 5 Let y = -94 + 91. Let w(i) = -2i - 3. What is w(y)? 3 Let a(z) be the second derivative of z*4/12 - 4z*3/3 + 3z*2 + 7z. Calculate a(6). -6 Let v(y) = -y*3 + 5y*2 - 2y - 2. Let w be v(2). Let l(a) = a - 1. Determine l(w). 5 Let w(z) be the second derivative of 1/24z4 + 0 + 5/3z*3 + 2z + 1/2z2. Let j(i) be the first derivative of w(i). Give j(-5). 5 Let c(a) be the first derivative of a2/2 - a + 7. What is c(-4)? -5 Let j(u) = -u3 + 6u*2 - 3u - 3. Suppose -s + 7s - 30 = 0. Give j(s). 7 Let q(c) = -3 + 0c*2 + 4c + 4 + 2c2 - 4c*2. Suppose -p - 17 = -4o, 0p + 5o = 5p + 10. What is q(p)? -5 Let z(h) = -3h. Let g(m) = -9m. Let c(k) = -6g(k) + 17z(k). Let x be (-28)/(-12) + (-2)/(-3). What is c(x)? 9 Let v(b) be the first derivative of b - 4 + 1/3b*3 + 7/2b2. Calculate v(-6). -5 Let o(c) = -c2 - 4c + 8. Let x = 30 - 36. What is o(x)? -4 Let f(l) = l3 - 6l*2 + 4l + 1. Let q be f(5). Let u be (-26)/(-8) - (-1)/q. Let r(m) = -5m + 3 - m3 - 4 + um*2 - 10m2. Calculate r(-6). -7 Let n(c) be the second derivative of -c5/20 - c*4/4 - 2c*3/3 - 2c*2 - 25c. What is n(-3)? 8 Let p(a) = 10a3 + a - 1. Suppose -2o + 8 + 0 = 0. Suppose -or + 2 = -2. Determine p(r). 10 Let s(i) = i. Let z(y) = -y2 + 7y - 3. Let t be z(6). What is s(t)? 3 Let v(h) = h*3 + 3h*2 - 3h + 3. Let p be -7 + 1/((-4)/(-12)). What is v(p)? -1 Let x = 79 + -78. Let j(p) = 4p3 + 4p3 + p2 + p3 - 1. Give j(x). 9 Let u(j) = j2 + 2j - 2. Let k(g) = -g3 - g + 1. Let m(c) = 3c*3 - 2. Let y(s) = -2k(s) - m(s). Let f be y(2). What is u(f)? 6 Let m(a) = -21a + 13a + 9a - 2. Let g = -4 + 9. Calculate m(g). 3 Let i be (-15)/9(-2 - 1). Let z = -1 + i. Let o(w) be the third derivative of w5/60 - w4/6 + w*3/2 + 2w2. Give o(z). 3 Let r(s) = -s3 + 2s2 - 3s + 3. Suppose -4k - 5n - 12 = 0, -n = 2n + 12. What is r(k)? -3 Let y(z) = -8z - 78. Let g be y(-10). Let c(n) = 2 - 4n - 2. What is c(g)? -8 Let r = -23 + 35. Let c = -17 + r. Let i(s) = -4s - s*2 - 2s*3 + 6 - 5s2 + s3. Calculate i(c). 1 Suppose 15n + 11 - 101 = 0. Let b(m) = 2m - 2. Calculate b(n). 10 Let r(i) = -i + 13. Let j(o) = -1. Let v(h) = 6j(h) + r(h). Calculate v(0). 7 Let r(i) = -i + 7. Let s be 180/(-3)(0 - -1). Let m be s/(-4)(-1)/(-3). Let n = -5 + m. What is r(n)? 7 Let g be 18(-2 + (-21)/(-9)). Let x(b) = 19b2 - gb - 18b2 + 2 + 1. What is x(5)? -2 Let i(n) = n - 1. Let s(l) = -2l. Let q be s(-2). Suppose 6 = -qp - 2. What is i(p)? -3 Let d = -44 - -36. Let b(h) = -h3 - 9h*2 - 10h - 10. Give b(d). 6 Suppose 0 = a + 5x - 15, a + a - 6 = -2x. Let u(j) = -j*2 + 7j + 13. Let y be u(9). Let f = a + y. Let o(r) = 2r + 4. Give o(f). -6 Let b(n) be the second derivative of n4/4 + n3/3 - n2/2 - n. Let v = 316 + -318. What is b(v)? 7 Suppose 14y = 10y + 20. Let k(j) be the third derivative of 0j*y + 1/3j*3 + 0j + 1/24j4 - 1/120j*6 + 2j*2 + 0. What is k(-2)? 8 Let g(u) = 0u + 3 + u*3 - 2u + 2u2 + 0. Let c be g(-3). Suppose c = -2k - 5 + 13. Let a(x) = -x + 5. Determine a(k). 1 Let t(p) = p + 2p3 + 0p*3 + 0p + 0p. Give t(1). 3 Let m(f) = -f2 + 5f - 3. Let p(r) = r*3 - 12r*2 + 11r + 4. Let q be p(11). What is m(q)? 1 Let o(k) = k*2 + k + 2. Suppose -m + 19 + 25 = 0. Suppose -2v + 12 = 2w - 5v, -2w + m = 5v. Suppose -3i + 5y - 3 = -w, -3i + 2y = 0. Calculate o(i). 4 Let z(f) = f*2 - 4f + 3. Let a(v) = -v + 1. Let t(m) = 3a(m) - z(m). Let p be (-5 - (2 - 3))/(-2). What is t(p)? -2 Let y(g) = -5g - 7. Let i(a) = -4a - 6. Let d(s) = -6i(s) + 5y(s). Let m(w) = -4 + 4w + 5w2 + w3 - 10w - w*2. Let x be m(-5). Give d(x). 0 Let u(p) = -p + 4. Let d be u(0). Suppose -f - da = 4, a + 2 = 1. Let x(h) = 7h - 15. Let c(b) = -3b + 7. Let k(s) = -5c(s) - 2x(s). Give k(f). -5 Let n(z) = 65z - 9 + 2 - 62z. Determine n(-5). -22 Let d(c) = -3c2 - 7c + 2c2 + 2c*2 - 6. Let h be d(8). Let w(f) = 0fh + f2 + f + 5f2. Give w(1). 7 Let x(i) = -4i*2 - i. Let t = 3 + 4. Suppose 0z - z = 4, -2z = n + t. Calculate x(n). -5 Suppose -4m - 63 = -m. Let r = m - -15. Let v(b) = -b*3 - 7b*2 - 7b - 9. Calculate v(r). -3 Let g be -16 - -25 - 14. Let o(i) = i2 - 5i - 4. Calculate o(g). -4 Let u = -7 + 10. Let n(x) = x*u - 3x*2 - 1 - 4x - 5 + 5. Give n(4). -1 Let k be (-4)/20 - 1/(-5). Let y(r) = -3 + k + 7r - 4r. Let f(a) = 10a - 8. Let n(x) = -2f(x) + 7y(x). Give n(-4). -9 Let b(h) = 11h*3 + 23h*2 + 3h + 14. Let a(w) = -4w3 - 8w*2 - w - 5. Let g(q) = 17a(q) + 6b(q). What is g(2)? -7 Let k(t) = -t3 + 5t*2 + 2t - 4. Let q be 4/(-22) + 932/44. Suppose 0 = -4m + g + 20, 4 = 5m - 2g - q. Suppose -2l - m = -3l. What is k(l)? 6 Let w = -4 + 6. Suppose -4x = 3z - w, -z - 12 = -3x - 2*x. Let v be z + (1 + 17)/3. Let p(j)	{ "pile_set_name": "DM Mathematics" }
4, 1073, 98, -1357, -3388? -16k3 + k + 2093 What is the y'th term of -13201, -13278, -13395, -13546, -13725, -13926? y3 - 26y*2 - 6y - 13170 What is the w'th term of -25117, -25114, -25111? 3w - 25120 What is the k'th term of -1406, -2809, -4212, -5615, -7018? -1403k - 3 What is the l'th term of -263, -282, -307, -332, -351, -358, -347, -312? l*3 - 9l*2 + l - 256 What is the f'th term of 2921, 5833, 8741, 11645, 14545, 17441, 20333? -2f*2 + 2918f + 5 What is the y'th term of 445616, 445621, 445626, 445631, 445636? 5y + 445611 What is the v'th term of 4328, 4317, 4284, 4217, 4104, 3933, 3692? -2v3 + v2 + 4329 What is the k'th term of -37130, -148494, -334096, -593936, -928014, -1336330, -1818884? -37119k2 - 7k - 4 What is the l'th term of 16131, 32257, 48383, 64509? 16126l + 5 What is the h'th term of 27, -45, -153, -297, -477? -18h*2 - 18h + 63 What is the z'th term of 119, 176, 223, 254, 263, 244, 191? -z3 + z2 + 61z + 58 What is the p'th term of 5005, 20002, 44985, 79948, 124885, 179790? -p3 + 4999p*2 + 7p What is the c'th term of 9257, 9178, 9047, 8864? -26c2 - c + 9284 What is the p'th term of 127, 414, 863, 1474, 2247? 81p*2 + 44p + 2 What is the z'th term of 946, 1933, 2920, 3907, 4894, 5881? 987z - 41 What is the i'th term of -743, -1479, -2215, -2951, -3687? -736i - 7 What is the g'th term of 405, 427, 459, 501, 553, 615, 687? 5g2 + 7g + 393 What is the h'th term of -1058, -4294, -9682, -17216, -26890? h*3 - 1082h*2 + 3h + 20 What is the l'th term of -5731, -5733, -5735, -5737, -5739? -2l - 5729 What is the j'th term of 22, 16, -28, -134, -326? -4j*3 + 5j*2 + 7j + 14 What is the m'th term of 91, 23, -75, -191, -313, -429, -527, -595? 2m3 - 27m*2 - m + 117 What is the j'th term of 443732, 443737, 443742, 443747, 443752, 443757? 5j + 443727 What is the o'th term of -6132, -6132, -6166, -6252, -6408? -3o3 + o2 + 18o - 6148 What is the a'th term of -1842, -7741, -17692, -31695, -49750, -71857, -98016? -2026a2 + 179a + 5 What is the t'th term of 67, -34, -199, -428? -32t2 - 5t + 104 What is the a'th term of 3830, 7692, 11564, 15452, 19362, 23300, 27272? a3 - a2 + 3858a - 28 What is the m'th term of 10191710, 10191711, 10191712, 10191713? m + 10191709 What is the s'th term of -15197, -15203, -15209, -15215, -15221, -15227? -6s - 15191 What is the h'th term of 2036, 3743, 5450, 7157, 8864? 1707h + 329 What is the c'th term of 6269, 12483, 18623, 24683, 30657, 36539, 42323, 48003? -c3 - 31c*2 + 6314c - 13 What is the x'th term of 292, 561, 844, 1147, 1476? x3 + x2 + 259x + 31 What is the o'th term of -113838, -227677, -341516, -455355? -113839o + 1 What is the z'th term of 23, -19, -149, -415, -865, -1547, -2509? -8z3 + 4z*2 + 2z + 25 What is the j'th term of 589, 4804, 16253, 38554, 75325? 603j3 - j2 - 3j - 10 What is the v'th term of -20963, -20978, -21007, -21056, -21131, -21238? -v3 - v2 - 5v - 20956 What is the t'th term of 663712, 663703, 663680, 663637, 663568? -t3 - t2 + t + 663713 What is the g'th term of -77823, -77818, -77811, -77802, -77791, -77778? g2 + 2g - 77826 What is the k'th term of 2142, 4280, 6416, 8550? -k*2 + 2141k + 2 What is the q'th term of -399, -823, -1247, -1671, -2095? -424q + 25 What is the m'th term of 177, 515, 1015, 1677, 2501, 3487, 4635? 81m*2 + 95m + 1 What is the a'th term of 2071294, 2071297, 2071302, 2071309, 2071318, 2071329, 2071342? a*2 + 2071293 What is the s'th term of 62462, 124931, 187408, 249893, 312386, 374887? 4s*2 + 62457s + 1 What is the q'th term of -108, -181, -254? -73q - 35 What is the q'th term of 333, 274, 249, 270, 349, 498? 2q*3 + 5q*2 - 88q + 414 What is the v'th term of 25406, 25403, 25390, 25361, 25310, 25231? -v3 + v2 + v + 25405 What is the a'th term of -121, -222, -315, -406, -501, -606? -a*3 + 10a*2 - 124a - 6 What is the j'th term of -1402, -2268, -3150, -4054, -4986, -5952, -6958, -8010? -j*3 - 2j*2 - 853j - 546 What is the l'th term of 2233, 4478, 6733, 9004, 11297, 13618, 15973, 18368? l3 - l2 + 2241l - 8 What is the a'th term of 7156791, 14313584, 21470377, 28627170, 35783963, 42940756? 7156793a - 2 What is the q'th term of -74217, -148438, -222659? -74221q + 4 What is the g'th term of -918, -1284, -2274, -4200, -7374? -52g*3 - 2g - 864 What is the g'th term of 166, 226, 252, 238, 178, 66, -104, -338? -g*3 - 11g*2 + 100g + 78 What is the d'th term of 3297, 6543, 9789, 13035? 3246d + 51 What is the y'th term of 11397, 11400, 11405, 11412? y2 + 11396 What is the p'th term of -11, -614, -2259, -5468, -10763, -18666? -87p3 + p2 + 3p + 72 What is the z'th term of -1038, -8334, -28144, -66726, -130338, -225238, -357684? -1043z3 + z2 + 2z + 2 What is the q'th term of -56907, -113856, -170801, -227742, -284679, -341612, -398541? 2q*2 - 56955q + 46 What is the u'th term of 19949, 19982, 20013, 20042, 20069? -u*2 + 36u + 19914 What is the a'th term of 1789861, 1789860, 1789859? -a + 1789862 What is the u'th term of -46375, -46377, -46379, -46381, -46383? -2u - 46373 What is the u'th term of 29417, 58835, 88253, 117671, 147089? 29418u - 1 What is the p'th term of -39604, -39672, -39740, -39808, -39876? -68p - 39536 What is the o'th term of 1078, 1072, 1064, 1054? -o2 - 3o + 1082 What is the w'th term of 598072, 2392285, 5382640, 9569137, 14951776, 21530557, 29305480? 598071w2 + 1 What is the u'th term of 1695, 2092, 2489, 2886? 397u + 1298 What is the b'th term of 116, 113, 88, 41, -28, -119? -11b2 + 30b + 97 What is the x'th term of 584, 1172, 1762, 2354, 2948? x*2 + 585x - 2 What is the n'th term of -6430, -6397, -6328, -6229, -6106? -n*3 + 24n*2 - 32n - 6421 What is the v'th term of 149866, 149860, 149844, 149812, 149758, 149676? -v3 + v2 - 2v + 149868 What is the w'th term of 4042, 4063, 4098, 4147, 4210, 4287, 4378? 7w2 + 4035 What is the t'th term of 1740, 2540, 3330, 4104, 4856, 5580? -t3 + t*2 + 804t + 936 What is the q'th term of -243, -1490, -4763, -11076, -21443? -169q3 + q2 - 67q - 8 What is the o'th term of 461, 1854, 4181, 7442, 11637, 16766, 22829? 467o2 - 8o + 2 What is the b'th term of -1946, -3879, -5800, -7703, -9582, -11431, -13244, -15015? b*3 - 1940b - 7 What is the r'th term of 5616621, 5616628, 5616645, 5616678, 5616733, 5616816, 5616933? r3 - r2 + 3r + 5616618 What is the j'th term of 49, 67, 125, 241, 433, 719? 3j*3 + 2j*2 - 9j + 53 What is the p'th term of -3397, -3368, -3325, -3268, -3197, -3112, -3013? 7p2 + 8p - 3412 What is the d'th term of 10, 5, -10, -35, -70, -115, -170? -5d2 + 10d + 5 What is the q'th term of -99, -474, -1107, -2004, -3171, -4614? -q*3 - 123q*2 + q + 24 What is the p'th term of -676, -1500, -2470, -3586, -4848, -6256? -73p*2 - 605p + 2 What is the l'th term of -71000, -71003, -71010, -71021, -71036, -71055, -71078? -2l2 + 3l - 71001 What is the s'th term of 16901, 33758, 50575, 67352? -20s2 + 16917s + 4 What is the f'th term of 11701, 11732, 11769, 11812? 3f2 + 22f + 11676 What is the w'th term of -1137, -1156, -1213, -1326, -1513, -1792? -3w3 - w2 + 5w - 1138 What is the u'th term of 95116, 95092, 95052, 94996? -8u2 + 95124 What is the y'th term of 442, 1478, 3204, 5620, 8726, 12522, 17008? 345y*2 + y + 96 What is the l'th term of -950, -1896, -2830, -3752, -4662? 6l*2 - 964l + 8 What is the j'th term of 1878, 3832, 5796, 7770, 9754? 5j2 + 1939j - 66 What is the n'th term of 45125, 45123, 45119, 45113, 45105, 45095? -n2 + n + 45125 What is the v'th term of 637, 650, 681, 736, 821, 942, 1105, 1316? v3 + 3v2 - 3v + 636 What is the h'th term of -3372, -3444, -3570, -3756, -4008? -h*3 - 21h*2 - 2h - 3348 What is the k'th term of -119187, -119226, -119305, -119436, -119631, -119902, -120261, -120720? -2k3 - 8k*2 - k - 119176 What is the h'th term of 2901, 2907, 2913, 2919? 6h + 2895 What is the h'th term of -28, -88, -184, -316, -484, -688, -928? -18h2 - 6h - 4 What is the t'th term of -1768, -1407, -1066, -751, -468, -223, -22, 129? -t*3 - 4t*2 + 380t - 2143 What is the f'th term of 375, 359, 317, 237, 107, -85? -2f3 - f*2	{ "pile_set_name": "DM Mathematics" }
+ 91d2 - 272d*3 - 2d*4 - 37 + 39 as bd*3 + vd*2 + qd + p + md4 and give q. 7 Rearrange -2q - 2q3 + 82462695q*2 - 2906 - 82462695q*2 to hq*2 + lq*3 + nq + v and give h. 0 Express 12b2 + 2 - 22b*4 + 43b*4 - 142b*3 - 19b*4 - b + 144b*3 in the form t + cb*4 + nb + mb3 + ib*2 and give c. 2 Express (2c2 - c2 + 0c2)(36284 - 403c - 36289 - 220c) + 2c3 + 0c3 - c3 in the form pc3 + ac + xc2 + k and give a. 0 Rearrange -f3 - f3 + 172f*4 - 1074f*4 + 32463411f - 32463414f to the form rf + tf3 + pf*2 + kf*4 + y and give t. -2 Express -11z + 8z - 3z*2 + 5284z*4 - 1 - 5286z*4 + (2z*3 + 2z*3 - 2z*3)(-z - z + z) in the form n + hz4 + mz*3 + fz*2 + sz and give h. -4 Express (1 - 1 - 2x)(-855371x + 855371x + 1004x2) + x3 - 5x*3 - 2x*3 in the form tx + b + nx3 + ux*2 and give n. -2014 Rearrange 0 + 2g*2 + 34g + 55g - 11 - 42g to ng + k + qg*2 and give k. -11 Express 104929d*2 + 2d + 45d3 - 7d*3 - 71 - 104930d*2 in the form zd*2 + a + md*3 + od and give m. 38 Rearrange 4t - 178t + 573t + 260t + 256t to wt + g and give w. 915 Rearrange 6 + 26m3 - 53284m + 17m3 - 53280m + 7m2 + 106564m to j + zm2 + pm + dm3 and give j. 6 Rearrange 2x - 123 + 16 + 1308 - 8 to bx + r and give r. 1193 Express (-357 - 188 + 43)(-f*4 + 2f4 + f4) - 2f4 - 2f*4 + 3f*4 + 5f*4 - 2f - 2f4 - f4 as gf + cf4 + xf*3 + d + yf*2 and give g. -2 Rearrange -7 - 7 + 36g + 26 + 3 + 3 to the form qg + z and give z. 18 Express ((0 + 1 + 0)(3v + 0v - 4v) - 28v - 73 + 73)(-3v*3 - 20v - 3 - 3v3 + 21v) as gv + ov*3 + s + pv*2 + bv*4 and give o. 0 Express (96y + 34y + 91y + (5 + 3y - 5)(2 - 4 + 3))(1 + 0 - 5) as q + wy and give w. -896 Express 85f3 + 154f*3 - 78f*3 + (3f + 7f + 0f)(0f*2 - 3f*2 + 4f*2) in the form tf*2 + if*3 + s + df and give i. 171 Express (-5g - 6 + 6)(507 + 4735 - 549 + 2696 + 1448) in the form fg + r and give f. -44185 Express (2 + q - 2 + (2 + q - 2)(1 + 2 + 1))(-466q + 830q - 421q) in the form sq2 + x + mq and give m. 0 Rearrange -342p + 10 - 89p - 57p + 10 - 18 to the form sp + x and give s. -488 Express -263 + 524 - 261 - 1607h + 14490h in the form l + mh and give m. 12883 Rearrange (2 - 4 + 1)(-u + u + u) - 2u + 2u - u + (-183 - 237 + 63)(58u + 48u - 35u) - 4u + u + 4u to hu + q and give h. -25348 Rearrange -4136v*2 - 592v*2 - 85v*2 to the form o + dv*2 + rv and give d. -4813 Express 1015w2 - 532w*2 + 111w - 527w2 + 0 + 0 + w3 in the form yw*3 + uw*2 + dw + h and give u. -44 Express (-4a + 5a + 0a)(-8 - 5 + 16) + (928 - 1680 - 1047)(4a + 0a - 2a) in the form fa + o and give f. -3595 Express 25299 + 25301 + 783f - 50601 - 37f in the form p + qf and give p. -1 Express 2d3 + 4 - 1584d*2 - 576d + 799d2 + 785d*2 in the form fd*3 + nd*2 + gd + s and give g. -576 Express (-3 - o + 3)(-21850o - 115 + 43624o - 21831o) as c + po2 + ro and give p. 57 Express 18i3 - 3i - 58i4 - 12i*3 - 60i*4 - 18i*3 + 2i*2 + 2 + 123i*4 as ki + ti4 + yi*2 + pi*3 + c and give t. 5 Express 2 - 1920d - 2 - 6113d + 403d as kd + r and give k. -7630 Express 24f - 30f3 - 16f*3 + 19f*3 + 4 - 5 in the form kf*2 + b + yf*3 + rf and give y. -27 Rearrange ((-4 + 0 + 1)(-50a - 25 + 25) - a - 47 - 48 + 77)(-5 + 2 + 4) to the form r + ta and give t. 149 Rearrange -111s + 10s + 151231s2 - 151230s*2 - 2s*3 to h + zs*3 + is*2 + as and give a. -101 Express 24 - 52 - 8345o + 28 + 3197o as no + i and give n. -5148 Express 10f*3 - 52f*3 + 3f*4 - 2f + 44f3 - 308 - 360 - 271 as h + cf*2 + xf + uf3 + jf*4 and give j. 3 Rearrange (-1 + 4 - 1)(-3c + 6c - c) + 25 + 78 - 313685c + 313700c to t + xc and give t. 103 Rearrange 874p + 870p - 1733p - 13p2 to the form cp + v + np2 and give c. 11 Express 32 - 109p*4 - 2p + 2p2 - 10p - 64 - p3 + 30 - p3 as n + fp + gp*4 + ap*2 + tp*3 and give a. 2 Express (-7o - o - 27 + 10o)(131o + 58o*3 - 75o*3 - 132o - 22) in the form xo + vo*2 + m + co*3 + jo*4 and give x. -17 Rearrange 0 - l + 3l + 3 + (-79 - 300 + 126)(2l - l + 0l) to the form w + ul and give u. -251 Express -2033o2 - 2o - 3 + 3 + 1763o2 + 1974o*2 as u + co + qo2 and give q. 1704 Express 16g*3 + 16g*3 - 14g3 + (-g3 - 3g3 + 6g*3)(0 + 4 - 3) - 654g3 - 10005g + 10005g as og*3 + t + ig + bg2 and give o. -634 Rearrange (-37h*3 - 2h*3 - 23h*3)(-14h + 36h + 47h) to lh*2 + uh*3 + o + ah*4 + ph and give a. -4278 Rearrange (-7 + 63 + 62)(48z - 88z - 32z) to a + hz and give h. -8496 Express 9o*4 + 2o*3 + 81878o*2 + 2 - 6o*3 - 1 - 81877o*2 + 3o as co2 + mo*4 + bo*3 + ho + g and give b. -4 Rearrange -2t2 + 3t*4 + 0t*4 + 0t4 + 2 - t4 + 554t3 - 548t*3 + 286t to zt2 + rt + vt3 + b + dt*4 and give z. -2 Express 10x - 1723 + 2x - 9x - 1420 + 316 as u + kx and give k. 3 Rearrange -78 + 16 - 147p + 219p - 77p to the form q + kp and give q. -62 Rearrange 12 - 12 - 622b + 242b to the form h + nb and give n. -380 Rearrange -4582o - 3278o + 3182o to x + go and give g. -4678 Express 12p2 - 72p*2 + 75 + 77p*2 + 2p*2 in the form vp*2 + a + np and give v. 19 Express (i + 2544 + 623 + 1328 - 142 + 0i)(i - i - i) in the form h + xi + ri*2 and give x. -4353 Rearrange ((-5 - 1 + 2)(3f2 - 2f*2 + 2f*2) + 13f - 13f + 7f*2)(3f + 2f - 3f) to the form lf*3 + yf*2 + t + cf and give l. -10 Express -1760s + 909s + 23s3 + 874s in the form fs + us*2 + z + xs*3 and give z. 0 Express (-446g + 134 - 136 + 33g)(-3g - 4 + 4) + (-1 + 2 + 0 + (-5 + 4 + 0)(1 + 0 - 2))(-g + g2 + g) in the form cg + og2 + s and give o. 1241 Rearrange -23 - 247c*2 + 82 - 31 + 4 - 26 to the form y + jc + rc2 and give r. -247 Express (4b + 4b + 5b)(-6 + 4 + 0) - 2b + 5b - 5b - 59b + 26b + 31b - 88 as u + pb and give u. -88 Rearrange (s*2 - 14s*2 - 71s*2)(8 - 7 + 18) to the form n + xs2 + ts and give x. -1596 Rearrange -2274o2 + 15504o*2 - 121 + 121 to xo + so2 + z and give s. 13230 Express -535j - 1197 - 2433j + 599 + 598 as r + sj and give s. -2968 Express -3 + 9x - 36x + 6x + x2 + 7x in the form l + sx + wx*2 and give l. -3 Rearrange (2r + 6r - 2r)(261 + 963 - 2736) to the form c + qr and give q. -9072 Rearrange -516l - 285l + 1095l + 1302l to the form d + al and give d. 0 Express (14035 + 16833 - 5859)(2 - 1 + 0)(2s - 3 + 3) in the form v + hs and give h. 50018 Express (4b - 3b + 0b)(-3 - 2 + 4)(698 + 78 + 769) + (3 + 2 - 3)(0b - 2b + 0b) - 2b - b + b in the form t + nb and give n. -1551 Rearrange -23v3 - 27v*2 + 59v*3 - 70v*2 - 3 - 41v*3 to the form uv*3 + dv + hv2 + y and give d. 0 Express (-3z*4 - 2z*4 + 3z*4)(16704 + 454 - 4012) - 2z4 - z + z as az*2 + qz*3 + wz + oz4 + d and give o. -26294 Express 354k + 1392k + 96k + 238k - 2 as ik + g and give i. 2080 Rearrange 10d3 - 180d*2 - 52d + 176d2 - 4d*3 + 52d + 29d to the form nd + cd3 + rd*2 + y and give c. 6 Express -128i*2 + 27 - 1 + 4i - 26 as y + oi2 + ji and give j. 4 Express (6m2 - 3 + 4 - 7m*2)(35 - 27 + 50) - 3m2 + 5m*2 - 4m + 2m in the form jm*2 + lm + c and give j. -56 Rearrange 60n3 - 2n + 4703 - 10n3 - 37n*2 - 4703 to zn*2 + p + bn + dn3 and give b. -2 Express -13i - 85i3 + 13i + (31i - 16i + 9i)(-4i + 4i + 2i2) + 2 - 2i*3 - 2 as h + yi + ci2 + li*3 and give l. -39 Rearrange (0 + 3 - 4)(0y - y3 + 0y) + (-1 - 2 + 4)(-11y*3 + 0y*3 - 11y*3) to jy*3 + gy + l + wy2 and give j. -21 Rearrange -3f*2 + 0f*3 - 5f*3 + 6f3 - f2 - 960f + 31f to mf + vf*2 + hf*3 + x and give v. -4 Rearrange 1929z*2 + 1946z*2 - 310z - 3873z2 to the form iz*2 + b + hz and give h. -310 Express -22q3 + 13q*3 - 195q + 7q3 + 356q - 1 - 194q + 27q*4 as uq*3 + dq*2 + w + j	{ "pile_set_name": "DM Mathematics" }
. 7/2325 -126 divided by -3 42 Calculate 9 divided by 651. 3/217 810 divided by -2 -405 Divide 13 by 13. 1 Divide 49098 by 3. 16366 Calculate 315 divided by 7. 45 -5 divided by -837 5/837 Calculate -395 divided by 5. -79 What is 2070 divided by 414? 5 -10947 divided by -267 41 Divide -30870 by -4410. 7 Calculate 66 divided by -11. -6 2 divided by -50 -1/25 Divide -10185 by 4. -10185/4 What is -1980 divided by 6? -330 What is 1050 divided by 25? 42 What is 1662 divided by 1? 1662 What is -276 divided by -12? 23 Divide -5 by 144. -5/144 315 divided by -4 -315/4 Divide 2256 by 3. 752 What is 42 divided by 14? 3 256 divided by 256 1 -5253 divided by 103 -51 Divide 4 by -320. -1/80 Calculate 0 divided by -658. 0 -13 divided by 5 -13/5 Calculate 12 divided by 233. 12/233 What is -72 divided by 56? -9/7 -15904 divided by 1136 -14 -4 divided by -4077 4/4077 -436 divided by -1 436 -175 divided by -25 7 -5 divided by 38 -5/38 Calculate 5 divided by -1137. -5/1137 Divide 3 by -228. -1/76 16435 divided by 865 19 -5151 divided by 3 -1717 Divide 3 by 2695. 3/2695 Calculate -1220 divided by -5. 244 What is 70 divided by -35? -2 What is -11 divided by 10? -11/10 What is 14 divided by 334? 7/167 Calculate 1 divided by 476. 1/476 8397 divided by 311 27 Divide 15 by -3. -5 1 divided by 44 1/44 What is -52 divided by 13? -4 56 divided by -29 -56/29 Calculate -5820 divided by 6. -970 What is -3751 divided by 31? -121 What is 2411 divided by 1? 2411 -2 divided by 107 -2/107 -1 divided by -715 1/715 Divide -1197 by -1. 1197 -1 divided by 9 -1/9 -19878 divided by 6 -3313 Calculate 3 divided by -15. -1/5 What is 1087 divided by 2? 1087/2 Calculate -1 divided by -76. 1/76 What is 105 divided by 105? 1 Calculate 29 divided by -95. -29/95 1401 divided by 3 467 Calculate 2642 divided by -6. -1321/3 What is -1141 divided by 1? -1141 561 divided by -51 -11 Calculate 3064 divided by 4. 766 Divide 0 by -7. 0 What is 3 divided by -22? -3/22 2019 divided by -3 -673 -5 divided by -5582 5/5582 What is -3 divided by 2803? -3/2803 Divide -367 by 1. -367 4 divided by -8858 -2/4429 What is 5 divided by 832? 5/832 What is 2400 divided by -120? -20 Divide -2066 by -1033. 2 What is 126 divided by -7? -18 Divide 204 by -12. -17 What is -1542 divided by 3? -514 Divide -3 by -98. 3/98 What is -4 divided by -105? 4/105 Divide 10475 by 4. 10475/4 Divide 1348 by -2. -674 What is -3 divided by -3? 1 12756 divided by -6378 -2 Divide 2 by -383. -2/383 Divide 14656 by 229. 64 2 divided by -1140 -1/570 Divide -3 by 131. -3/131 What is -4854 divided by 1618? -3 What is 4 divided by -35? -4/35 Divide 222 by -2. -111 6 divided by -15 -2/5 Divide 646 by 6. 323/3 What is 3 divided by 1926? 1/642 What is -195 divided by 39? -5 Divide -122 by -17. 122/17 Divide 3 by -2. -3/2 Calculate 483 divided by 21. 23 Divide -2 by 10. -1/5 Divide -34 by -34. 1 Divide -9324 by 12. -777 What is 1372 divided by -14? -98 956 divided by 4 239 Calculate -252 divided by -6. 42 0 divided by 560 0 55212 divided by -3 -18404 Divide -138 by -6. 23 -5 divided by -27 5/27 Calculate -6684 divided by -12. 557 990 divided by -6 -165 What is -1560 divided by 5? -312 What is 75 divided by -4? -75/4 Calculate 262 divided by 11. 262/11 Divide -80896 by 4. -20224 -14 divided by -30 7/15 Divide 11175 by 25. 447 Divide -1449 by 483. -3 0 divided by -1 0 What is -2822 divided by -3? 2822/3 Divide 2 by 117. 2/117 16 divided by 16 1 What is -145 divided by 29? -5 What is -2 divided by 36? -1/18 -403 divided by -13 31 Divide 3445 by 5. 689 What is -4 divided by 27? -4/27 12940 divided by 5 2588 Calculate 162 divided by -6. -27 840 divided by 4 210 Divide -33708 by 4. -8427 Divide 6995 by -1399. -5 What is 0 divided by -542? 0 Divide 520 by -10. -52 Calculate -216 divided by 3. -72 Divide 13 by -19. -13/19 What is -8110 divided by 2? -4055 Calculate -610 divided by -5. 122 Calculate 22230 divided by -2. -11115 363 divided by -3 -121 What is -26 divided by -13? 2 Divide 3860 by 193. 20 Divide 17 by 169. 17/169 What is -210 divided by 14? -15 198 divided by -18 -11 What is -126 divided by -21? 6 357 divided by -34 -21/2 What is 110 divided by -10? -11 Calculate -15 divided by -4. 15/4 -32020 divided by 3202 -10 Divide 16 by 245. 16/245 Calculate -45 divided by -341. 45/341 What is 341 divided by 31? 11 Divide 22403 by -521. -43 -414 divided by -11 414/11 What is 26460 divided by 945? 28 -755 divided by 2 -755/2 50 divided by 25 2 Divide -5590 by 2. -2795 -11410 divided by -2 5705 What is 86 divided by -23? -86/23 1 divided by -16 -1/16 What is -14754 divided by 1? -14754 Calculate -7040 divided by 11. -640 Divide -20088 by 108. -186 What is 55 divided by 3? 55/3 What is 281 divided by -5? -281/5 22352 divided by -6 -11176/3 -1806 divided by -602 3 80 divided by -2 -40 -72 divided by 8 -9 Calculate -3910 divided by 34. -115 -4 divided by -97 4/97 Divide -578 by 4. -289/2 270 divided by 5 54 -360 divided by 180 -2 -478 divided by -4 239/2 Divide 0 by 70. 0 Calculate 204 divided by 6. 34 Calculate 16165 divided by -265. -61 Calculate 20 divided by -66. -10/33 8260 divided by 59 140 Calculate 32 divided by -1. -32 13 divided by -10 -13/10 -91 divided by 2 -91/2 Divide 1986 by 6. 331 1962 divided by -981 -2 Calculate 15486 divided by 87. 178 49 divided by 7 7 Divide -180 by -6. 30 28 divided by 16 7/4 Calculate 8 divided by -5. -8/5 What is 267 divided by 89? 3 5 divided by -753 -5/753 Divide -9 by 47. -9/47 Divide -3519 by -1173. 3 -4 divided by 30 -2/15 Divide 1728 by 4. 432 What is -2 divided by 2036? -1/1018 What is 48 divided by 2? 24 What is 192 divided by 24? 8 What is -493 divided by 6? -493/6 Calculate -5 divided by 63. -5/63 Calculate 308 divided by -154. -2 What is -308 divided by -3? 308/3 Divide -5 by 269. -5/269 Calculate 0 divided by 4452. 0 33 divided by 1 33 What is 162 divided by -27? -6 1 divided by 111 1/111 -24900 divided by -75 332 -1062 divided by -3 354 Calculate 42 divided by -5. -42/5 -85092 divided by -4 21273 -158 divided by 7 -158/7 Calculate 48 divided by 24. 2 Divide -277 by 14. -277/14 Divide 186 by 20. 93/10 Calculate 1310 divided by -2. -655 Calculate 31 divided by 5. 31/5 What is -118 divided by -2? 59 Divide 135 by -15. -9 Calculate -3 divided by -60. 1/20 What is -624 divided by -7? 624/7 20095 divided by -4019 -5 What is -165 divided by 1? -165 What is -2450 divided by -2? 1225 Divide 9315 by -81. -115 Calculate -3591 divided by -133. 27 Divide 163 by 2. 163/2 Divide 40 by 108. 10/27 -5605 divided by 295 -19 Divide 0 by 10. 0 Calculate 0 divided by 230. 0 -1944 divided by -6 324 Calculate -160 divided by 8. -20 What is 3 divided by -1? -3 What is -1197 divided by -10? 1197/10 What is 2 divided by 110? 1/55 What is 4 divided by 300? 1/75 What is 0 divided by 5? 0 21 divided by -9 -7/3 Divide -4 by 155. -4/155 15004 divided by 124 121 Calculate -225 divided by 25. -9 198 divided by 66 3 8 divided by 18 4/9 What is 5 divided by 25? 1/5 Calculate -3 divided by -195. 1/65 Calculate 5 divided by -1517. -5/1517 171 divided by -3 -57 Calculate 689 divided by 6. 689/6 What is 1089 divided by -3? -363 3 divided by -159 -1/53 What is -3 divided by -11? 3/11 Calculate -43968 divided by -6. 7328 Calculate -192 divided by -192. 1 Calculate -1144 divided by -286. 4 57 divided by 1 57 -130 divided by -65 2 Calculate 1397 divided by 5. 1397/5 -7 divided by 452 -7/452 Divide 61 by -9. -61/9 -807 divided by -1 807 Divide -4 by -1045. 4/1045 Divide -52 by 2. -26 Calculate 5394 divided by 62. 87 What is 17 divided by -150? -17/150 Divide 2674 by 2. 1337 Divide 2 by -2. -1 What is 17 divided by 24? 17/24 3802 divided by -1 -3802 What is -1 divided by 748? -1/748 -10128 divided by 6 -1688 What is -14936 divided by 1? -14936 Calculate 341 divided by -1. -341 What is 60 divided by -4? -15 What is -117 divided by 117? -1 What is 1214 divided by -607? -2 What is 1410 divided by 2? 705 What is 3 divided by 3? 1 0 divided by -33 0 Calculate 1 divided by 23. 1/23 Calculate -5 divided by 8. -5/8 -16 divided by 8 -2 -501 divided by 2 -501/2 -168 divided by 42 -4 Divide 5 by -818. -5/818 Calculate 222 divided by 37. 6 0 divided by 56 0 Calculate 1285 divided by 12. 1285/12 What is -1 divided by 19? -1/19 Calculate 9 divided by 368. 9/368 Ca	{ "pile_set_name": "DM Mathematics" }
e -5c(z) + 2j(z). z*3 Let a(w) = 4w*3 - 5w*2 + 6w - 6. Let c(h) = -3h3 + 6h*2 - 5h + 5. What is 5a(d) + 6c(d)? 2d3 + 11d*2 Let q(f) = -4f*3 - 3f*2 + 9. Let l(o) = 2o3 + o2 - 4. Give 9l(s) + 4q(s). 2s3 - 3s*2 Let i(p) = 4p + 4. Suppose s - 8 = 3s + 2j, -5j = 5. Let d(k) = 5k + 5. Determine si(g) + 2d(g). -2g - 2 Let f(c) be the third derivative of c4/8 - 2c*3/3 - 20c*2. Let r(x) = 4x - 5. What is 5f(y) - 4r(y)? -y Let n = 33 - 48. Let l = n + 16. Let w(o) = o + 1. Let v(t) = -2t - 5. Determine lv(m) + 5w(m). 3m Let v(t) = 3t2 + 2t + 2. Let p(h) = h*3 + 4h*2 + 2h + 3. Give -2p(r) + 3v(r). -2r3 + r2 + 2r Let h(k) = -780k2. Let g(s) = -120s*2. Calculate -32g(l) + 5h(l). -60l2 Let n(g) = -g2 - g. Let d(i) = -9i + 5i + i + 2i - i2. Calculate 5d(u) - 4n(u). -u2 - u Let w(n) = -n - 1. Let q = 3 - -2. Suppose -19 = -3u - 2g, 3 = -u + qg - 19. Let l(m) = -2m2 - 4m - 5. Determine uw(h) - l(h). 2h*2 + h + 2 Let y(q) = 5q*2 + 8. Let g(z) = -6z*2 - z - 7. Give -3g(n) - 4y(n). -2n*2 + 3n - 11 Let z(v) = 6v3 - 5v - 5. Let n(s) be the second derivative of s5/20 - s3/6 - s*2/2 + 2s. Give 5n(c) - z(c). -c3 Let p(c) = -2c + 2c - 9 - 11c. Let s(g) = g. Suppose -1 = -0q - q. Let t(i) = -8i - 4. Let r(l) = qt(l) + 3s(l). What is 6p(w) - 13r(w)? -w - 2 Let u(t) = -3t3 + 5t*2 + 6t - 4. Let o(b) be the third derivative of -b*6/15 + 7b*5/30 + 17b*4/24 - 11b*3/6 + 10b*2. Calculate -4o(v) + 11u(v). -v3 - v2 - 2v Let k(g) = 4. Let y = -31 - -30. Let z(a) = a*2 + 1. Give yk(p) + 4z(p). 4p*2 Suppose 2v + 2 = -2k, -3 = 13k - 12k. Let q(u) = -u2 + 2u - 3. Let p(w) = -2w2 + 5w - 7. Give vp(b) - 5q(b). b*2 + 1 Let c(w) = 20w - 2. Let n(g) = g. Calculate c(x) - 6n(x). 14x - 2 Let x(z) = 6z - 5. Let h(l) = 13l - 11. Let u be (0 - -2)/((-11)/(-22)). Determine uh(i) - 9x(i). -2i + 1 Let f(i) = -i - 4. Let y be 5/20 - 27/(-4). Let u = 5 + -2. Let j(p) = u - p - y - 1. Give 6f(m) - 5j(m). -m + 1 Let o(q) = -5q*2 - 9q - 53. Let m(k) = -2k2 - 4k - 27. What is -9m(d) + 4o(d)? -2d2 + 31 Let o(r) = 2r*2 - 7r. Let m(v) = 20v + 2v*2 - 21v - v*2. Determine -5m(x) + o(x). -3x2 - 2x Let h(x) = -6x - 1. Let w(t) = 2t. Calculate 4h(u) + 11w(u). -2u - 4 Let u(r) = -9r + 9. Suppose 0 = 2m - 5m + 12. Let f = -7 + 12. Let s(n) = f - 3n - n - n. What is mu(o) - 7s(o)? -o + 1 Let f(a) = -6a - 6. Let r(k) = -k - 1. Let w be (0 + 5)2/(-5). Let p be w + 14 - (0 + 1). Give pr(y) - 2f(y). y + 1 Let o(n) = 4n*3 - 2n*2 - 3n + 2. Let k(a) = a3 + a2 + a - 1. Calculate -2k(g) - o(g). -6g*3 + g Let t(r) = 6r*3 - 5r*2 - 5r. Let x(u) = 0u + u3 + 11 - 11 - u2 - u. Determine -2t(m) + 10x(m). -2m*3 Let j(n) = 28n*3 + 16n*2 - 16. Let d(l) = 9l*3 + 5l*2 - 5. Suppose -2g = 5u - 42, -g + 7 = -4u - 1. Give gd(x) - 5j(x). 4x3 Let d(n) = 3n*2 + 3n + 3. Let v = 15 + -18. Let y(z) = -6z2 - 7z - 7. Suppose 5k - 3m + 20 = 0, -11 + 33 = -k - 3m. Give kd(t) + vy(t). -3t*2 Let f(b) = 7b*2 + 3b - 3. Let r(h) = 3h2 + h - 1. Give 2f(c) - 5r(c). -c2 + c - 1 Let z(q) = 2q + 1. Suppose 7p = 68 + 51. Let a(m) = -6m - 6. Let f(w) = -6w - 5. Let g(l) = -2a(l) + 3f(l). Determine pz(b) + 6g(b). -2b - 1 Let n(l) = -4l2 - 3l. Let f(v) = 5v2 - 2v - 6v2 + 2v - v. Let c = 0 + 1. What is cn(b) - 3f(b)? -b*2 Let p(m) = -8m*2 + 8m - 5. Let t(w) = 7w2 - 7w + 4. Let o(n) = 2p(n) + 3t(n). Let d = 4 - -9. Let c(u) = 11u2 - 11u + 4. Determine do(b) - 6c(b). -b*2 + b + 2 Let y(s) = -24s*2 - 13s - 2. Let x(j) = 8j2 + 4j + 1. Let v(u) = -11x(u) - 4y(u). Let p(r) = 2r2 + 2r - 1. What is 9p(b) - 2v(b)? 2b2 + 2b - 3 Let u(d) be the second derivative of -d*3/6 + d. Let j = -6 + 7. Let k(c) = 1. Calculate ju(f) - k(f). -f - 1 Let o(f) = 2f + 4. Let i(v) = 62v - 9 + 56v - 121v. Determine 2i(u) + 5o(u). 4u + 2 Let d(i) = 8i*3 + 9i + 9. Let b(g) = -7 + 5g2 + 3g + g + g - g3. Let f be b(5). Let p(s) = -s3 - s - 1. What is fp(t) + 2d(t)? -2t3 Let j(q) = 3q*3 + 7q*2 + 3q - 3. Let z be j(-2). Let y(u) = -14u2 + 5u. Let c(a) = -7a2 + 2a. What is zc(k) + 2y(k)? 7k2 Let l(p) = 23p*2 - 3p - 5. Let o(i) = -68i2 + 8i + 14. Calculate -8l(x) - 3o(x). 20x2 - 2 Suppose n + 5 = 5n + 3i, 0 = 3n - i - 20. Let w(c) = 7c - 7. Let d(p) = 10p - 10. Determine nd(t) - 7w(t). t - 1 Let j(c) = 9c + 2. Let b(t) = 113 + 110 + 0t + 13t - 328 + 108. Suppose -2n + 4 = 18. Let y be (-1 - 4)(-2 - -1). Determine nj(r) + yb(r). 2r + 1 Let k(g) = 60g3 + 4g + 4. Let h(i) = 61i3 + 3i + 3. Give 4h(w) - 3k(w). 64w3 Let r(z) = -z2 - 1. Let s(l) = 5l*2 + 4. Give 4r(o) + s(o). o2 Let m(a) = a2 - 2a + 7. Let c(x) = -3x*2 + 5x - 14. What is -2c(o) - 5m(o)? o*2 - 7 Let s(u) = -5u3 + u2 + u. Let z(n) = -n3 - n2. What is s(y) - 4z(y)? -y3 + 5y*2 + y Let c(j) = 9j + 23. Let f(x) = 4x + 11. What is -2c(v) + 5f(v)? 2v + 9 Suppose -5z - 4 = 11. Let a(h) = -3h*3 + 11h*2 - 7h + 11. Let g(j) = j*3 - 5j*2 + 3j - 5. Determine za(o) - 7g(o). 2o3 + 2o*2 + 2 Let j(h) = 4h*3 - 8h*2 - 2h. Let i(a) = 5a3 - 9a*2 - 3a. Give -4i(u) + 6j(u). 4u3 - 12u2 Let n(p) = p2 + 7p - 10. Let r be n(-8). Let j(b) = -b - 2. Let o(g) = 15g + 33. Give ro(c) - 33j(c). 3c Let k(f) = -3f + 6. Let z(b) = 24b - 48. Give -33k(t) - 4z(t). 3t - 6 Let n(t) = -3t2 - 4t + 4. Let p(b) = -2b2 - 3b + 3. Determine -5n(w) + 7p(w). w*2 - w + 1 Let d(j) = 36j*2 + j - 10. Let n(z) = -12z*2 + 3. What is -2d(h) - 7n(h)? 12h*2 - 2h - 1 Let n(g) = -54g2 + 6g. Let i(o) = 109o2 - 13o. Give -6i(v) - 13n(v). 48v2 Let h(t) = -17t*3 + 11t*2 - 3t. Let w(j) = -48j3 + 54j*3 + 2j*2 + j - 6j*2. Give 3h(y) + 8w(y). -3y3 + y2 - y Let j(i) be the second derivative of i*3/6 + 8i*2 + 8i. Let g be j(-10). Let w(b) = b3 - b2. Let u(s) = 4s3 - 6s*2. Calculate gw(l) - u(l). 2l3 Let r(y) = 6y + 2. Let f(h) be the third derivative of -h4/12 - h3/6 - 7h2. Determine -8f(g) - 3r(g). -2g + 2 Let k(r) = -3r2 + 2r + 1. Let x(m) = 4m2 - 3m - 2. Suppose j - 4j + 4c + 9 = 0, -8 = 2j + 2c. Let s be ((4/1)/2)/j. Calculate sx(q) - 3k(q). q*2 + 1 Let a(k) = -12k3 - k2. Let n(b) = 49b3 + 4b*2 + 1. Determine 9a(j) + 2n(j). -10j3 - j2 + 2 Let s(k) = 4k + 38. Let x(g) = 3g + 25. Determine -5s(h) + 8x(h). 4h + 10 Let a(n) = 8n - 7. Let p(x) = -10x + 8. What is -7a(r) - 6p(r)? 4r + 1 Let i(x) = -x3 - x2 - x. Let b(k) = -11k2 + 7k. Let r(n) = -5n2 + 3n. Let q(v) = 4b(v) - 9r(v). Suppose -6f + 1 = -11. Calculate fi(y) + 4q(y). -2y*3 + 2y*2 + 2y Let w(x) = 18x3 + 2x*2 + 6x. Let k(p) = 36p3 + 4p*2 + 11p. Determine -6k(o) + 11w(o). -18o3 - 2o*2 Let i(w) = 7w - 6. Let q(p) = 36p - 30. Let v(s) = -5s + 4. Let t be v(5). Let d(y) = ti(y) + 4q(y). Let r(b) = -b + 1. Determine -d(k) + 4r(k). -k - 2 Let o = -27 + 19. Let n(m) = m - 4. Let x(c) = c - 6 + 5c - 4c. Let q = 11 + -6. Give on(a) + qx(a). 2a + 2 Let u(f) = 28f - 5. Let k(s) = 14s - 2. Let d(p) = -5k(p) + 3u(p). Let w(a) = -5a + 2. Determine -3d(q) - 8w(q). -2q - 1 Let m(k) = -k + 2 - 6k + k + 2k. Let l(p) = -6p + 3. Give -5l(x) + 8m(x). -2x + 1 Let f(x) be the first derivative of x*3/3 + 6. Let q(p) = -10p*2. Calculate 22f(g) + 2q(g). 2g*2 Let i(t) = -t + 4t - 4t. Let g(y) = 10y - 2. Calculate -g(p) - 6i(p). -4p + 2 Let s(d) = -1. Let x(p) = 7p2 + 3. Determine 3s(r) + x(r). 7r2 Suppose 2m = 6m + 48. Let d(i) = 4i + 5. Let r be (2 + -1)(-20)/(-4). Let f(q) = 10q + 12. What is md(y) + rf(y)? 2y Let h(r) = -7r*2 - 7r - 5. Let o = 11 - 5. Let z(y) be the first derivative of 4y3/3 + 2y*2 + 3y - 2. Calculate oh(a) + 10z(a). -2a2 - 2a Let t(b) = b*2 + b - 1. Let y(g) = 5g*2 + g - 4. Let u = 5 + -2. Determine ut(i) - y(i). -2i2 + 2i + 1 Let s(u) = 6u + 7. Let j(m) = 11 + 7m - 4 + 1. Give -5j(d) + 6s(d). d + 2 Let v	{ "pile_set_name": "DM Mathematics" }
i. 2 Suppose -4y = -5h - 26, 10y + 3h + 18 = 13y. What is the remainder when 11 is divided by y? 3 Let m(y) = -3y - 36. Calculate the remainder when 142 is divided by m(-24). 34 Let w(m) = -100m3 - m. Let t = -52 - -78. Calculate the remainder when w(-1) is divided by t. 23 Suppose 0 = -3f - 4n - n + 145, -3n - 39 = -f. What is the remainder when f is divided by 15? 0 Let s = -15 - -1. Calculate the remainder when 22/(-77) + (-382)/s is divided by 14. 13 Suppose 0 = -3p + 2t + 9, 3p = -t - 0t. Let y = 2 + p. Suppose -4 = -i - y. What is the remainder when 1 is divided by i? 0 Suppose -613s - 845 = -618s. What is the remainder when s is divided by 29? 24 Let k(g) = 19g + 251. Let i be 3/(6/(-4)) - 26. Let f = i + 42. What is the remainder when f is divided by k(-13)? 2 Suppose -5h + 334 = 2b, 892 = 3b + h + 378. Let f = b - 116. What is the remainder when f is divided by 10? 6 Suppose 0 = -15h - 12h + 324. Calculate the remainder when 42 is divided by h. 6 Let z = 27 + 41. Calculate the remainder when 21 is divided by z/11 - (-4)/(-22). 3 Suppose 0 = -3s - p + 5, 2p - p = 5s - 19. Suppose sw = -11 + 17. What is the remainder when 2 is divided by w? 0 Let u be 80/(-5 + 0 + 6). Let x = -5 + u. Calculate the remainder when x is divided by 19. 18 Calculate the remainder when (((-30804)/(-8))/17)/((-3)/(-4)) is divided by 61. 58 Let z = -254 - -297. What is the remainder when z is divided by (-2 + 1)/((-1)/15)? 13 Suppose -3d + t = -72, -3d + 3t + 2t = -84. What is the remainder when 127 is divided by d? 12 Let z(d) = 201d2 - d + 3. What is the remainder when z(1) is divided by 34? 33 Calculate the remainder when (3 - 44/12)/((-10)/345) is divided by 2. 1 Let o(h) = -h2 - 19h - 36. What is the remainder when 35 is divided by o(-3)? 11 Let j = 14 - 13. Calculate the remainder when 47 is divided by 67/(-4)-1 + j/4. 13 Let c(t) = -t2 + 12t - 21. Suppose -4u + 4b = -44, -3u + 6 + 17 = 2b. Calculate the remainder when 9 is divided by c(u). 3 Let x = 6875 + -6857. Let p(u) = 1 - 4u - 2u + 0. Calculate the remainder when x is divided by p(-1). 4 Let t(p) be the third derivative of -p*4/24 - 3p*3 - 6p*2. Let j be t(12). Let g = -17 - j. Calculate the remainder when 50 is divided by g. 11 Let g = 388 - 380. What is the remainder when 35 is divided by g? 3 Suppose 0 = -4q + 40q - 3168. What is the remainder when q is divided by 23? 19 Suppose -11d = -1042 + 393. Calculate the remainder when d is divided by 8. 3 Suppose -3h = -12, -h + 5h - 46 = 5t. Let c(b) = b + 5. Let w be c(t). Let y(g) = 2g*2 + g + 2. What is the remainder when 7 is divided by y(w)? 1 Let q(c) = 60c + 4. Let i be q(3). Suppose -4r - 79 = -w, 4w + 4r = 232 + i. What is the remainder when w is divided by 25? 24 Let v(x) = -19x + 147. Calculate the remainder when v(7) is divided by 5. 4 Suppose -56l + 42l + 154 = 0. What is the remainder when 46 is divided by l? 2 Suppose 3w - 5y - 53 = w, 28 = w - 3y. Let n(p) = 3p*2 + 2p - 12. What is the remainder when n(-5) is divided by w? 15 Let g = -344 - -661. Suppose 23m = -8m - 11m + 2688. Calculate the remainder when g is divided by m. 61 Let i(c) = c + 8. Let a be i(-5). Let u(o) = o + ao*2 - 5 + 3 + 4o*2. What is the remainder when u(3) is divided by 17? 13 Let p = 23 + -4. Suppose -39 = -t - 3k + 60, -5t = 3k - 459. What is the remainder when t is divided by p? 14 Suppose -5k + 24 = -2k. Suppose -5j + 35 = -5b, -3b + 0b = -2j + 20. What is the remainder when (-1)/(-6) - 137/b is divided by k? 7 Let y(c) be the second derivative of -c5/20 - c4/4 - 7c3/6 + c2/2 - 14c. What is the remainder when 176 is divided by y(-4)? 41 Suppose -p = -0p - 3. Suppose k - 2 = n - 10, 24 = 3n - k. Suppose 3v - 5a - 15 = -3, -4a + n = 2v. What is the remainder when v is divided by p? 1 Suppose 5y + 6o = 2o + 272, -y = 3o - 50. Suppose -4d + 44 = 4j, 2d - 37 = -d + j. What is the remainder when y is divided by d? 8 Let o(a) = -a*3 + 25a*2 - 21a + 34. What is the remainder when o(24) is divided by 19? 11 Suppose -20 - 32 = -2j - 4o, -2j - 3o + 49 = 0. Calculate the remainder when 193 is divided by j. 13 Let o(x) = -2x2 + 34x + 87. What is the remainder when 15 is divided by o(19)? 4 Suppose 56k = 3x + 53k - 192, x - 72 = -k. What is the remainder when x is divided by (-11 - -1) + 18? 14 Suppose 0 = 2x + t - 135, -4x - 15t = -17t - 290. Calculate the remainder when x is divided by 40. 30 Suppose 0n - 112 = -8n. Let u = 0 - 0. Suppose a + ua + 154 = 4g, 0 = g + 3a - 45. Calculate the remainder when g is divided by n. 11 Suppose -8 + 1 = 3k - 4v, 5k + 5v + 35 = 0. Let m(n) = 3n + 27. Calculate the remainder when 43 is divided by m(k). 7 Let c(x) = x*3 - 12x*2 + 11x - 15. Let n be c(11). Let r be (n - -9)(-1 + -31). Suppose p - 4p = -r. What is the remainder when p is divided by 17? 13 Suppose 9c - 7c - 4 = 0. Suppose ch + 16 = 70. Calculate the remainder when h is divided by 16. 11 Suppose 4w = 2l - 392, 8w + 589 = 3l + 3w. Calculate the remainder when 407 is divided by l. 11 Suppose 18 = -6y + 9y. Suppose yv - 150 = 12. Calculate the remainder when v is divided by 2/(-12)-320. 7 Let w = 11 + 15. Let p(j) = -8j - 106. Calculate the remainder when w is divided by p(-15). 12 Suppose 220 = 5v + 23a - 24a, -5v = -3a - 230. Calculate the remainder when 299 is divided by v. 41 Let u(a) = a2 - a + 12. What is the remainder when 53 is divided by u(0)? 5 Let n(z) = z2 + z + 11. Suppose -m + 7 = 2v, -m - 30 = -3v + 4m. Suppose 0 = -0i + vi. Calculate the remainder when 19 is divided by n(i). 8 Suppose -50f - 122 = -48f. Let k = 74 + f. Let o(p) = 23p2. What is the remainder when o(1) is divided by k? 10 Let v(i) = i3 - 4i*2 + 4i - 5. Let c be v(4). Suppose -f + c + 15 = 0. Calculate the remainder when f is divided by 7. 5 Let q be ((-2)/((-1 - -2) + -3))/1. Let h(y) = 40y3 + y2 - y. Calculate the remainder when 159 is divided by h(q). 39 Suppose -2o = -5k + 25, 32 = -3o + 5k - 3k. Calculate the remainder when 6 is divided by -2 + -104/o. 0 Calculate the remainder when 18/42 - (-554)/14 is divided by 40. 0 Calculate the remainder when 198 is divided by 1/(68/(-8)) - 684/(-34). 18 Suppose -u + q + 21 = -24, 2u - 92 = 3q. What is the remainder when u is divided by 24? 19 Let z = -32 + 36. Suppose b + 178 = 5b + 3m, -zm + 94 = 2b. Calculate the remainder when b is divided by 11. 10 Let s = 429 - 398. Suppose -362 = -4b - 2p, 2p = b - 32 - 56. What is the remainder when b is divided by s? 28 Let x = 72 - 69. Suppose t = -xt + 152. What is the remainder when t is divided by 21? 17 Let j = -198 + 224. What is the remainder when 153 is divided by j? 23 Let t = 40 + -33. What is the remainder when 0/3 + 113 is divided by t? 6 What is the remainder when (-6)/(-15) + 1912/20 + -4 is divided by 43? 6 Suppose -5s = 3c - 38, 3s + 10 = 5c - 8. Suppose -ck - 25 = -7k. Calculate the remainder when 99 is divided by k. 24 Let d = -563 + 570. Calculate the remainder when 82 is divided by d. 5 Suppose -2l - 3l = 5a - 155, a + 2l = 36. What is the remainder when a is divided by (96/15 - 6)/(16/280)? 5 Let a be -68 - (1 + -5 + 5). Let k = 98 + a. What is the remainder when 172 is divided by k? 27 Suppose -b - 92 = -3i + 48, -3b - 6 = 0. Let a = i + -30. Calculate the remainder when a is divided by 11. 5 Calculate the remainder when 4/((-4)/(-7)154/572) is divided by 8. 2 Suppose 0o - 4o + 1200 = 0. Suppose -100 = u - 2u - q, -3u + o = q. Calculate the remainder when u is divided by 34. 32 Let c = -2397 + 3144. Calculate the remainder when c is divided by 25. 22 Suppose 0 = -s + 3j + j + 68, 4s + 4j = 172. Suppose 0 = 2d - 96 + 34. Suppose 3z - d = 8. What is the remainder when s is divided by z? 9 Let y = -450 + 725. What is the remainder when y is divided by 70? 65 Suppose -12 + 44 = 4i. Let n be (5 + 0)/(i - 7). Suppose 0 = nj - j - 12. Calculate the remainder when 11 is divided by j. 2 Let w(k) = k + 15. Let d be w(-12). Let p be (-3 - -5) + d/3. Suppose 0 = 2x - px + 10. Calculate the remainder when x is divided by 6. 4 Suppose -314 = -4y + 2d, -176 = -5*y - 3	{ "pile_set_name": "DM Mathematics" }
2, -3, 0.2? -3 Which is the nearest to -2/39? (a) 2.4 (b) -5 (c) 0 (d) 3 c What is the nearest to -2/7 in 1/6, -7319, -4? 1/6 Which is the closest to -1? (a) 93 (b) 5 (c) 0.3 (d) 0.1 (e) 0.04 e What is the closest to 3 in -5, -91, -26, 15? -5 What is the nearest to -1629 in 0.6, 1, 3? 0.6 What is the nearest to -5 in -0.111, -4, -3/2? -4 What is the nearest to 3 in 0.66, -2, 0? 0.66 Which is the closest to -2/5? (a) 0.23 (b) -3 (c) -11 (d) -8 (e) -0.2 e What is the nearest to 1/4 in -3/4, 6/107, 136? 6/107 What is the closest to -1 in -111, -15/22, 1/2, 1? -15/22 What is the nearest to 6 in 4, -7/12, -0.2, -18/5, 2/3? 4 What is the nearest to -3/5 in 1/8, 23, -0.4, -229? -0.4 Which is the nearest to -5? (a) 0.2 (b) 90 (c) 1/43 (d) 0 d What is the nearest to -0.0846 in 0.03, -4, 2, -2/7? 0.03 Which is the closest to -2/7? (a) -81 (b) 5 (c) -2/9 (d) -3/23 c Which is the closest to -2? (a) 7 (b) -1 (c) 0.1 (d) 3/629 (e) 3 b Which is the closest to 4? (a) 4 (b) -103 (c) 5 (d) -2/15 (e) -2 a What is the nearest to -1/14 in -5, 3, -4, -3/4? -3/4 What is the nearest to -70 in -8/3, 2/9, 1/6, -1, -3? -3 What is the nearest to 1/2 in 5, -0.04, 2/357, 0.4, 2? 0.4 Which is the nearest to 2/269? (a) -1 (b) 2/3 (c) -1/7 c What is the closest to 1 in -421, 0.1, -4/139? 0.1 Which is the nearest to -1/4? (a) -0.4 (b) -1 (c) 2.243 (d) 7 a Which is the closest to -10/11? (a) 2/19 (b) 0.4 (c) -0.01 (d) 3 (e) -62 c Which is the closest to 49? (a) -4 (b) -2.6 (c) -3 b Which is the nearest to 1? (a) -3 (b) -8/7 (c) -7 (d) 2/5 d Which is the nearest to 48.4? (a) 4/7 (b) -4/5 (c) 2/5 a Which is the closest to -2/23? (a) -3 (b) 7 (c) 47 (d) -0.059 d Which is the nearest to 7? (a) -10.38 (b) 10 (c) -5 (d) -4 b Which is the closest to 0? (a) 46 (b) -6.2 (c) 1 (d) -3/2 c What is the closest to -0.2 in -1/4, 25.1, -2? -1/4 What is the nearest to 607 in -68/3, -1, 4? 4 Which is the closest to 7/344? (a) -0.06 (b) 0.3 (c) 5 (d) 0.1 d What is the nearest to 12 in 2/27, 0.3, -11/17, -2? 0.3 What is the closest to -15 in 0, 2/9, -51? 0 Which is the nearest to 25? (a) 3/4 (b) 0.5 (c) -3/94 (d) 0.4 a What is the closest to -1 in -76, -0.07, -0.18? -0.18 Which is the nearest to -1? (a) 0 (b) 1 (c) -1/6 (d) 19 (e) 26 c What is the closest to 1 in -402, -56, -0.4? -0.4 What is the closest to -3/47 in 2/3, -5, -6/7, 3? 2/3 What is the closest to 2 in -5, 2, 4, 1/4? 2 Which is the nearest to 1? (a) 294 (b) -3 (c) 1 c Which is the nearest to 11? (a) 2/5 (b) 27 (c) -2/11 (d) -4 a Which is the nearest to 1? (a) -2/6227 (b) -5 (c) 4 (d) 1 (e) 0 d Which is the closest to -3? (a) -5 (b) -0.2 (c) 0.11 (d) -3/5 (e) -1/2 a What is the nearest to -0.02951 in 19, -4, 0.4? 0.4 Which is the closest to 1/8254? (a) 0 (b) 0.5 (c) -3/7 (d) 0.3 a Which is the closest to -10/39? (a) 4 (b) 59 (c) 9 a Which is the nearest to 40/3? (a) -3 (b) 1 (c) -7 (d) 1/9 b Which is the nearest to 0? (a) -0.5 (b) 2.04 (c) -0.1 (d) -2 c Which is the nearest to -1? (a) -13/11 (b) 2 (c) -2/7 (d) -1 d What is the closest to -4 in 14, 0.04, -17, 2/11? 0.04 Which is the closest to -0.2? (a) 0.2 (b) 408 (c) -20.7 (d) -0.2 d Which is the nearest to -1/3? (a) 1/2 (b) -2 (c) -0.1 (d) 1 (e) -2/1105 c What is the closest to 116/19 in 3, 0.2, 4? 4 What is the nearest to 0.1 in 5, -1/6, 4, -12, -0.3? -1/6 What is the nearest to 68 in -8, 2/3, 3/5? 2/3 Which is the closest to 0? (a) -32.6 (b) -24 (c) -0.3 (d) 0 (e) 2 d Which is the nearest to -1? (a) -12 (b) 43.07 (c) -2 (d) 0.5 c Which is the closest to 9? (a) 0.095 (b) 0.1 (c) 171 b What is the closest to -71/5 in -5, 8, -4, -1/3, -2? -5 Which is the closest to 2? (a) 1/10 (b) -0.0229 (c) -1/3 (d) -0.2 (e) -12 a What is the nearest to 0 in -6/5, -3188.3, -4? -6/5 What is the nearest to 7/6 in 24, 4, 3/7, 0.2, 1/9? 3/7 Which is the nearest to 0? (a) 3.21 (b) -6.7 (c) 0.4 c Which is the nearest to 0.1? (a) -7 (b) -1/5 (c) 0.06 (d) -3/7 (e) -39 c Which is the closest to -2/3? (a) -2 (b) -1/9 (c) -4 (d) 11/40 b What is the closest to -111 in 0, -3, -453? -3 What is the closest to 1 in 1/3, -3, 13.706, 2? 1/3 What is the closest to -0.3 in 10, -2, -2/7, 4/47? -2/7 Which is the nearest to -1? (a) 512/41 (b) -2/9 (c) -2/11 (d) -5 b Which is the nearest to -164? (a) -1/3 (b) -2/3 (c) -2/9 (d) -5 (e) 2/7 d Which is the nearest to 0.1? (a) -23.3 (b) 0.23 (c) -0.02 c What is the nearest to 220 in 1, 0.5, -610/9? 1 Which is the nearest to -12? (a) 2/3 (b) 298 (c) -3/4 (d) -32 c What is the closest to 7 in -3, -139, 3, 5.2? 5.2 What is the nearest to 2/5 in -5, 5, 1784/7, 3? 3 What is the nearest to -301008 in 3, -0.5, -1/7? -0.5 What is the nearest to -1 in -2/17, 167, 8, 0.5? -2/17 Which is the closest to -37? (a) -48 (b) -1 (c) 0 (d) 1/3 (e) -0.3 a What is the closest to -1/2 in 0.1, -622, 7, -0.3? -0.3 What is the closest to 4 in 0, -0.017, -2/7? 0 Which is the closest to 4? (a) 1/4 (b) -5.3 (c) -223 (d) -1/7 a Which is the nearest to -2/5? (a) 1 (b) 2/3 (c) -1 (d) 3 (e) 12.23 c What is the nearest to -26/27 in -14, -1/5, 5, 2/5? -1/5 What is the nearest to -0.2 in -0.07, 2, 0, 696/41? -0.07 What is the nearest to -2/73 in -0.56, -13, 2/7, -2/5? 2/7 Which is the nearest to 2/11? (a) -1/4 (b) 132/29 (c) 0.3 c Which is the nearest to -1? (a) 20 (b) -33/4 (c) 92 b What is the closest to 4.5 in 0.46, 3, -6/31? 3 Which is the closest to -20? (a) -0.2 (b) -9.5 (c) 54 b Which is the nearest to 2? (a) -66 (b) -2 (c) 1/5 c Which is the closest to -1/4? (a) 7 (b) 2.2 (c) -65 b Which is the nearest to 217? (a) 2/9 (b) 2/3 (c) -0.5 (d) 5 d Which is the nearest to -0.5? (a) -1/3 (b) 1 (c) -5 (d) 0.3 (e) -1/4 a Which is the closest to 0? (a) -3 (b) 0.5 (c) -17 (d) -6 (e) -21 b Which is the closest to -291? (a) 0 (b) -37 (c) 17 b Which is the closest to -1/2? (a) 2/11 (b) -8 (c) -503 a Which is the closest to 3? (a) 2 (b) 2/3 (c) -82 (d) -1/303 (e) -1 a Which is the nearest to 196? (a) -0.0679 (b) -4 (c) 1 (d) -3 (e) 0.5 c What is the closest to -0.63 in -21, -24, -9? -9 What is the nearest to -0.66 in -0.3, 0.3, 0.1, -7? -0.3 What is the nearest to 0.7 in -1/367, -6/11, 4, -0.4? -1/367 What is the closest to -2/71 in 0, -0.1, 4, -1/4, -14? 0 What is the closest to -3/2 in 1/3, 0.5, -2/7, 0.4, -2/3? -2/3 Which is the nearest to -1/3? (a) -1/8 (b) 2/9 (c) 2 (d) -10812 a What is the closest to -3514 in 1, -3/8, -0.5? -0.5 What is the closest to 2/15 in -1, -1/2, 351, -5, 2? -1/2 Which is the closest to 0.1606? (a) -5 (b) 5 (c) 2/7 (d) 4 c What is the nearest to 3 in 0.2, 2, 9, 1/3, 3.2? 3.2 Which is the closest to 0.389? (a) 1/5 (b) -3/5 (c) -3 (d) -1/11 (e) -0.1 a Which is the nearest to -1? (a) 6 (b) 0.01 (c) -2/11 (d) 7 c What is the closest to 2/7 in -10973, -1.1, 0.4? 0.4 Which is the closest to 1? (a) 0 (b) 3336 (c) 2/9 (d) 1/4 (e) -3 d Which is the closest to 1? (a) 2/7 (b) -2.9 (c) 0 (d) -4/7 (e) -0.04 a Which is the closest to -2/7? (a) -1.2 (b) 3 (c) -29 a Which is the nearest to 0.6? (a) -5/63 (b) -24 (c) 4 a Which is the nearest to 2? (a) 2/3 (b) -5 (c) 0.2432 a What is the nearest to -1 in -5/272, 0.06, -1, 1, 2? -1 Which is the closest to 1? (a) 5/8 (b) 1 (c) 59.152 b Which is the nearest to -4? (a) 0.4 (b) -97/6 (c) -226 a Which is the nearest to -0.1? (a) -23.4 (b) -2/17 (c) 2 (d) 1 (e) -1/6 b Which is the nearest to 14? (a) -2 (b) -1/5 (c) -10/53 (d) 0 d What is the closest to 2 in 0.049, 2, 7, -0.03, 1? 2 Which is the nearest to -8? (a) 0.05 (b) 1 (c) 9 (d) -20 (e) -0.1 e Which is the closest to -0.2? (a) -4 (b) 134/7 (c) -2 (d) 0.5 d What is the nearest to -6 in -0.048, 5, -1369? -0.048 Which is the nearest to 15/2? (a) 31 (b) 5/2 (c) 5 (d) 2/17 c Which is the nearest to -5/3? (a) -474 (b) -5 (c) -2/5 (d) -1 d What is the nearest to -13/2 in -0.1, 0.5, -0.02, -3, -0.2? -3 Which is the closest to 2? (a) -5 (b) 0.63 (c) 3/2 (d) 3/5 (e) -4 c What is the nearest to 0 in 3/4, -3/5, 89, -4, 13? -3/5 What is the closest to -263 in -2/37, 2, -3/5, -0.03? -3/5 What is the closest to -6 in 0.1, 4,	{ "pile_set_name": "DM Mathematics" }
y*5 Expand (3q - 2q + 0q)(-4q + 3q + 2q) - 2q2 + 4q2 + q2 - 2q + 2q - q*2 + (0q + 3q - 4q)(-2q + 5q - q). q2 Expand (-4v + 2v + v + 2)(-9v + 3v + 2v). 4v*2 - 8v Expand ((1 + 0 + 1)(0b - 2b + b) + b + 0b - 2b)(9b2 + 10b*2 + 3b*2) - 2b3 - b3 + b*3. -68b*3 Expand -4 - 5 - 29f*3 + 27f3 + (-f2 + 0f2 + 3f*2)(3 - 3 - f) - f*3 - 5f + 5f. -5f*3 - 9 Expand (-2 - 3 + 6)(-5j + 3j - j). -3j Expand (38 + 10a + 35 - 69)(-2a + 0a + 3a). 10a2 + 4a Expand 2f2 - 3f2 - f2 + (f + 5f - 4f)(-3f + 3f + 2f) - 2 + 2 + 2f2 + (3f + 2f2 - 3f)(1 - 3 + 0) + f2 - 2f*2 + 2f2. f2 Expand (2o3 + o3 + 2o*3)(4 - 5 + 4) - 2o3 + 0o3 + o3 - o*3 - 5o*3 + 4o*3. 12o*3 Expand 6w*3 - 6w*3 - 2w*4 + (7w2 - w2 - 3w2)(4 + 2w2 - 4). 4w*4 Expand (1 + 4 - 4)(-6x + 2 + 3x + 4x). x + 2 Expand (-3z*2 - 2z*4 + 3z*2)(-z - z + 0z) + 20 + 6z*2 - 20 - 2z*5. 2z*5 + 6z*2 Expand (1 + 16b - 14b - 8)(b*3 + 0b*2 + 0b*2). 2b*4 - 7b3 Expand (-c - c3 + 3c + 3c*3)(-5c + 5c - 2c). -4c*4 - 4c*2 Expand -x + x - 2x*2 + 3x*2 - 4x*2 + 0x*2 + (3x + 0x - 5x)(x - 2 + 2). -5x2 Expand (o2 + 4o2 - 3o*2)(1 - 2 - 1) + (2o + o - o)(0o - 4o + 2o). -8o*2 Expand -2u + 2u - 7u + (1 - 2 + 0)(-u + u + 3u) + 0u - 2u + u. -11u Expand -6v*3 + 3v3 + v3 + (-5v + 5v + 3v2)(3v + 2v - 6v + 3). -5v*3 + 9v*2 Expand (-5h + 5h - 2h)(39 - 161h + 72h - 39). 178h*2 Expand (4q + 2q - 4q)(2 - 1 + 1) - 2q + 3q - 2q - 14 + 14 + 6q + 2q + 2q - 3q. 10q Expand (2y - 2y + 2y)(-3y + 4y + 2y) + (-2y + 2y + 2y)(-3 + y + 3). 8y2 Expand (4s*5 - 5s*5 + 2s*5)(1 + 1 - 12). -10s5 Expand (-22 - 26 - 10)(3 - 1 - 3)(3d*3 + 0d*3 - 5d*3). -116d*3 Expand 2f - 5f + f + (-2f - f + f)(2 - 1 + 0 + 1 - 1 - 1 + (-2 + 4 + 0)(3 - 4 + 3)). -10f Expand 2 - 5v*5 - 2 + (-3v*2 + 3v2 + v4)(-2v - 3v + 4v). -6v5 Expand (6 - 169y*3 + 166y*3 - 14)(-2y + 4y - y). -3y4 - 8y Expand (-3m2 - m2 + 3m*2)(4m2 + 2m*2 - 2m*2) - 5m*4 + 0m*4 + 2m*4. -7m*4 Expand (-c + 3 + 2c2 - c2 - 3c2)(-5c + 5c + 2c2). -4c*4 - 2c*3 + 6c*2 Expand (2 + 4 - 3 + 2 + 2 - 6 + (4 - 1 - 4)(5 - 2 - 4))(4 - 4 + n). 2n Expand 0 - k + 1 - 2 + (5 - 4 + 2)(k - 5k + 2k) - k - 1 + 1. -8k - 1 Expand 2v4 + 4v*4 - 4v*4 + (-1 + 0 + 0)(v4 + v2 - v*2) + (-2 - 4 + 4)(3v4 - v4 + 2v*4). -7v4 Expand -c2 + 2c2 - 2c*2 + (-2c + 2c + c)(c + 2c - c). c2 Expand (-5 - 2 + 5)(0p - p + 3p) + 0p + 3p - 5p + 0p - 8p + 5p. -9p Expand 11 + 20p - 1 - 23p + (0p + 4p - 2p)(0 + 1 + 0) + 3p - 2p - 2p. -2p + 10 Expand (3q*4 + 2q*4 - 2q*4)(5q - 3q - 3q)(3 - 5 - 1). 9q5 Expand 5h*4 - 3h4 + h4 + (h + h*2 - h)(-4h2 + 3h2 - h2) - 14h4 + 16h*4 - 14h*4. -11h*4 Expand (-2 - 3 + 4)(3k - 3k - 2k3) + 3k*3 + 0k3 - k3 + (-7 - k*2 + 7)(-3 - 4k + 3). 8k*3 Expand (2k - k + 2k)(-1 - 2k3 - 4k*3 - 2k*3). -24k*4 - 3k Expand (-1 + 3 - 5)(3g*4 + 11g*4 - 13g*4). -3g*4 Expand ((5 - 5 - 2)(-1 + 2 - 2) + 2 + 0 - 1 + 5 - 4 + 0)(6f*2 + 1 - 1). 24f*2 Expand (-6d*3 - 9d3 - d3)(-2d*2 - 3d*2 + 3d2 + 0 - d2 + 0 + (0 - 2d2 + 0)(3 - 3 + 1)). 80d5 Expand m - m + 2m + (1 - 4 + 1)(4m - 2m + 0m) - 4m + 0m + 5m + 2m + 3m - 6m + (4m - 3m - 3m)(-1 + 3 - 4). 2m Expand -12s*4 + 12s*4 - 6s*5 - 2s*3 + 2s*3 + 3s*5 + (4s - 4s + s)(s*4 + 0s*4 - 3s*4). -5s*5 Expand (-j - 3j + j)((-3 + 4 - 2)(1 - 2j - 1) + 2 + 0 + 0 - j). -3j*2 - 6j Expand (a*3 + 2a3 - a3)(3 - 4 + 2) + 0a3 + a3 - 2a3 + 2a*3 - 1 + 1 + 4a3 + a3 - 4a3 + (-2a2 - a2 + 2a2)(-3a - a + 3a). 5a3 Expand (3a*2 - 3a*2 + 2a*3)(-1 + 14 + 1). 28a3 Expand (-2f + 31f2 - 35f*2 + 4f)(f - 3f + f)(4 - 2 - 1). 4f*3 - 2f*2 Expand -2c*2 + 2c*2 - 2c5 + (-2 + c4 + 2)(-c - c + c) + 3c*5 - 2c*5 - 2c*5 + (-5c + 3c + 0c)(3c - 3c - c4) - 3c + 8c5 + 3c. 6c5 Expand -q + 5q - 2q + (2q - 1 + 1)(-2 + 0 + 3) + 4q + 0q - 2q + 4q + 3q - 5q - 8q - 9 + 9 - 2q + 3q + q + (2 - 1 + 0)(-q + 2q - 2q). q Expand 2n*3 - 2n*3 - 2n4 + (-n4 - 4n + 4n)(-3 + 7 - 3) + 4n4 - n4 - n4. -n4 Expand (9o3 - 20o*3 - 34o*3)(3 - 3 + 2o). -90o*4 Expand (-n + n - 2n)((4n - n - 2n)(-3 - 3 + 7) + 0n + n + 0n + 2). -4n2 - 4n Expand (0n2 + 3n*2 - 4n*2)(n*2 - 2n + 2n) + 2n*4 + 3n - 3n - n3 + n3 - n4 + (n - 2n + 3n)(n*3 + 2 - 2) + 2n*4 - 2n4 + n4. 3n4 Expand (4 - 4 - t)(-3 - 1 + 15). -11t Expand -m4 + 2m*2 - 2m*2 + (-3m + 3m - 2m*4)(0 + 1 + 0) - 2m4 + 0m4 + m4 + 15m4 - 9m + 9m. 11m*4 Expand (4h - 4h + 9h)(0h*2 - 3h*2 + 2h*2). -9h*3 Expand (n + 0n + 0n)(-4n2 - 2n + 2n)(4 - 2n - 4). 8n*4 Expand (0k - 2k + k)(-k + k + 2k)(-k + k + 2k2 + (1 + 2k*2 - 1)(-5 - 1 + 4)). 4k4 Expand 2u - 2u - u3 + ((4 + 2u - 4)(2u + u - u) - 2u2 + 4 - 4 + 4u*2 + 519u - 519u)(4u - 5u + 3u). 11u3 Expand (-k2 - k*2 + 3k*2)(3k + 0k - k) - 1358 + 74k3 + 1358. 76k*3 Expand 3m5 + m5 - 6m5 - 44m*4 + 6m*5 + 44m*4 + 2m5 - m5 + 0m5 + (-m5 + 0m*5 + 2m*5)(-2 + 5 - 1) - 2m5 + m5 + 0m*5. 6m*5 Expand (14d + 20d - 42d - 9)(0d2 + d2 + d*2). -16d*3 - 18d2 Expand (0 + m3 + 0m3 - 2)(-4m + 0m + m). -3m4 + 6m Expand -5y2 + 4y2 - y2 + (y + 2y2 - y)(7 - 2 - 3) + y2 + y2 + 0y2 + y2 + 4y*2 - 3y*2. 6y*2 Expand (-4f + 2f + 3f)(-2f*4 - 2f*4 + 0f*4) + 3f*5 + 0f*5 - 2f*5 + (-2f - f + 2f)(-2f3 + 2f*4 + 2f*3). -5f5 Expand (i3 + i*3 - 4i*3)(-2i - 2i + 5i + (-3 - 2i + 3)(-1 + 3 + 0)). 6i*4 Expand (2w3 + 82 - w3 - 84)(1 - 1 - 2). -2w*3 + 4 Expand (2x*2 + 2 - 2)(3x2 - 3x2 + x2) - 2x4 + 2x*4 + 8x*4 + (-4 + 1 + 1)(-x4 + x4 - x4) + 3 - 3 - x4. 11x4 Expand (-b2 - 3b*2 + 3b*2 + (3b + 0b - 2b)(-3b + 0b + 5b) - 4b2 + 4b - 4b)(-b*2 + 5b*2 - 2b*2). -6b*4 Expand (13 + 3 + 29)(d + 4 - 4) + 2 - 3d - 2. 42d Expand (33w4 + 19w*4 - 40w*4)(-w + 2w + 0w). 12w5 Expand (2 - 3 - 2)(1 - 1 + 4)(-1 - 2v + 1). 24v Expand -m2 - m + m - 3m2 + m2 + 4m2 + (-2m*2 - 2m*2 + 2m*2)(3 - 1 - 4) + m2 + m2 - 3m2 + m2 + 0m*2 - 2m*2. 3m*2 Expand (2p + 0p - 3p + 1)(-37p*2 + 0 + 6 - 8). 37p*3 - 37p*2 + 2p - 2 Expand -3g2 - 2g*4 - 3g*2 + 4g*2 + (-3 - 2 + 6)(-4g4 - g4 + 4g4) + g4 - 5g4 + 2g*4 + 1 + 2g*4 - 1. -3g*4 - 2g*2 Expand (4 - 4 - 4y)(-7y*3 - 3y*4 - 10y*3 + 13y*3). 12y*5 + 16y*4 Expand (2 - 2y - 2)(-10y*3 + 2 + 2 + 8y*3). 4y*4 - 8y Expand (x + 8x3 - x)(3 - 4 + 2) + 4x3 + 3x*3 - 5x*3. 10x*3 Expand (4 - 4 + 4)(3v + v - 5v - 4v + 2v + 0v + (-5 + 2 + 4)(3v - 3v - v)). -16v Expand (2q2 + q2 - 5q2)(-q*2 + 0q*2 + 0q*2) + (5q - 5 + 5)(3q*3 - 4q3 - q3). -8q4 Expand (2l*2 + 5l*2 - 6l*2)(-2l + 7l + 0l + (0l + 4l - 3l)(2 - 3 + 0) + 3l + 2l - 7l + 2l - 2l - l). l*3 Expand (0 - 5 + 3)(-w*3 + 3w*2 - 3w*2 + (-1 + 4 - 2)(3w3 + 0 + 0)). -4w3 Expand (m2 + m*2 - 4m*2)(0m + m - 2m) - m3 - 4 + 4. m3 Expand 2q5 - 2q*2 + 2q*2 - 2q*2 + (-q + 0q + 0q)(6q4 - q4 + q4). -4q*5 - 2q*2 Expand (0j - j + 5j + (j + j - 3j)(3 - 1 + 0))(-4j2 + 6j2 - j2). 2j3 Expand (-13b - b + 3b)(-2b2 - 4b*2 + 4b*2) + (0b + 6b - 4b)(-3b*2 + 5b*2 - 3b*2). 20b*3 Expand 0s + 0s + 2s*3 + (-2s + 2s + s)(-3 + 3 - 3s)(s + 28 - 28). -s*3 Expand (7 + 9 - 17)(t*3 - t + t) + (0t - t + 3t)(t2 - t2 - 2t2) + t3 + 0 + 0. -4t3 Expand (-w2 - 3w2 + 3w*2)(-4w + 4w + w*2) - 2w*2 - 11w*4 - 6w*4 + 4w*2. -18w*4 + 2w*2 Expand (3a5 + a5 - 13a5)(4 + 1 - 3)(-4 + 1 + 2) - 1 + 2a**	{ "pile_set_name": "DM Mathematics" }
alue? (a) 2/13 (b) -1 (c) -0.5 (d) -0.1 d What is the biggest value in -4, 47, -3/4, 4, 8? 47 What is the second smallest value in -4, -5, -0.1, 5? -4 Which is the fifth smallest value? (a) -1/2 (b) -4 (c) -2/15 (d) -1/4 (e) -42 c What is the biggest value in -5, 5, -0.64? 5 What is the third smallest value in 0, -31, -4? 0 What is the third biggest value in -3/2, 3, -0.0536? -3/2 What is the second smallest value in -4/9, 0.4, -5, 2/3, 3/4? -4/9 What is the second biggest value in -5, 64, 4, -3/4? 4 Which is the second smallest value? (a) 8 (b) 3 (c) -13 b Which is the fourth smallest value? (a) 0.4 (b) 1 (c) 4/11 (d) 3/5 b What is the biggest value in 5, 128, 1/4, -14? 128 What is the third biggest value in -36/5, -5, -0.072, -3? -5 What is the second smallest value in 1/3, -5, 22, -0.2? -0.2 What is the second smallest value in 2/25, -0.6, -7? -0.6 Which is the smallest value? (a) 2.25 (b) 12 (c) -2/11 c What is the second biggest value in -0.4, 0.4, -2.93? -0.4 What is the fourth smallest value in 2/287, 0.3, -0.4, -3? 0.3 Which is the second smallest value? (a) 3/2 (b) -153 (c) -0.5 c What is the smallest value in -4, -10, 5? -10 What is the fifth biggest value in -5, 2/5, 64, -0.1, 0.1? -5 Which is the smallest value? (a) -2/15 (b) 2 (c) -2 c What is the second smallest value in 108/7, 0.4, -0.3? 0.4 What is the fourth smallest value in 2.4, -4, -2/3, 2, -0.5? 2 What is the biggest value in 0.2, 2/13, 0.3, 37, 12/11? 37 What is the second smallest value in -3/7, 11, -9, -0.3? -3/7 Which is the second biggest value? (a) 2/9 (b) 13 (c) -0.1 (d) -3 a Which is the fourth smallest value? (a) 3 (b) -5 (c) 5 (d) -0.1 c Which is the second smallest value? (a) -2/13 (b) -2/5 (c) -3 (d) 6 (e) -9 c Which is the third biggest value? (a) -5 (b) -1863 (c) 1/4 (d) -0.1 a What is the second smallest value in -1, 3/8, -3237, 2/21? -1 What is the third biggest value in -5/3, -287, -0.3? -287 What is the fourth smallest value in -2/7, -12, 13, -2? 13 Which is the second biggest value? (a) 5 (b) 915 (c) -0.2 a What is the smallest value in -3, -4, -2.4, -2/19? -4 What is the third smallest value in 0.0459, -0.3, 0.3, 0? 0.0459 Which is the fourth biggest value? (a) -0.5 (b) -0.4 (c) 1.44 (d) 19 (e) 3/5 b Which is the second biggest value? (a) 1.3 (b) 3 (c) 1/2 a What is the second biggest value in 0, -21, 10? 0 Which is the second biggest value? (a) 3/5 (b) -6 (c) -2/3 (d) 2/13 (e) 3 a What is the second biggest value in -0.0027, 0.5, -2/15? -0.0027 What is the smallest value in 4, -79, 5? -79 Which is the third smallest value? (a) 1/3 (b) -1.8 (c) 1/5 (d) 1/9 c What is the smallest value in 0.3, 36.8, -1? -1 Which is the third biggest value? (a) -0.1 (b) 2 (c) -0.2 (d) 0.99 (e) 1 d What is the third smallest value in -0.01, 2, 5, 85, 4/5? 2 What is the smallest value in -4.3, 1/2, 0.4, -4/7? -4.3 What is the second biggest value in 14, -3, -0.4? -0.4 Which is the fourth smallest value? (a) -4/7 (b) 0.3 (c) 3 (d) -0.2 (e) 16 c What is the second smallest value in 6, 2, 5, -5? 2 What is the second smallest value in -20, 1, 0.3? 0.3 What is the second biggest value in 1, -3, 0.1, 0.2? 0.2 What is the smallest value in 0.079, -0.3, -4/3? -4/3 Which is the second biggest value? (a) -7 (b) -0.2 (c) 2 (d) -9 b Which is the biggest value? (a) -3 (b) 0.4 (c) 1.6 (d) -8/7 (e) -1 c What is the third biggest value in 0.04, 0.05, 2, 2/5? 0.05 What is the second biggest value in 3, -0.7, -33? -0.7 What is the smallest value in 2/5877, 0.06, 4? 2/5877 Which is the fourth smallest value? (a) 0 (b) -5 (c) -9/86 (d) -4/3 a What is the second smallest value in 8/143, 4, 0.5? 0.5 What is the second biggest value in 3/5, -10, -0.3, -0.4? -0.3 Which is the second smallest value? (a) -6 (b) -1/10 (c) 1/7 b What is the third biggest value in -0.5, 4, 0.1974? -0.5 What is the biggest value in -2, -2/23, 5? 5 What is the second biggest value in -0.192, 0, 4/7? 0 Which is the biggest value? (a) -3 (b) -2/7 (c) 1/2 (d) -6 c Which is the second smallest value? (a) -0.1 (b) -11 (c) -20 b What is the second biggest value in 2.2, -5, -2/9? -2/9 What is the second biggest value in -5, 2, -49? -5 What is the smallest value in -16/35, 1, -14? -14 What is the biggest value in -0.1, 1/2, 2/5, -16? 1/2 What is the smallest value in -0.2, 2/9, 0.1, -2/33, -2/7? -2/7 Which is the fourth biggest value? (a) 9/2 (b) -1/4 (c) 0.5 (d) -2 d Which is the biggest value? (a) 2 (b) 16/5 (c) 3/2 b What is the fourth smallest value in 346/7, 3, 0.5, 0.4? 346/7 What is the third biggest value in -0.03, 1, 5, 2/11? 2/11 What is the fourth smallest value in -3, -5, -416, 2/13? 2/13 Which is the fourth smallest value? (a) -2/11 (b) 0.4 (c) -28.6 (d) -2 (e) -6 a Which is the smallest value? (a) -0.5 (b) 1/7 (c) -0.3 (d) 37 a Which is the third biggest value? (a) -1/3 (b) 2/5 (c) -0.1 (d) -15 (e) 2/291 c Which is the second biggest value? (a) 3 (b) -0.5 (c) -2 (d) 9 (e) -1 a What is the second biggest value in 13, -0.5, -5, 3? 3 What is the second smallest value in 3/7, 131.9, -2, -4? -2 What is the second biggest value in 0.5, -0.1, 1, -11? 0.5 What is the fourth biggest value in 1, -2/9, 2/19, 0.3? -2/9 What is the smallest value in 1, -39, -5? -39 Which is the third biggest value? (a) 4 (b) -1 (c) 3 (d) 1/55 d What is the second smallest value in 5, 2, 1.658, -0.4? 1.658 What is the second biggest value in 52, -3, 2? 2 Which is the biggest value? (a) 94 (b) -2/15 (c) -0.2 a Which is the second smallest value? (a) -4 (b) 2/7 (c) 2 (d) -2 d Which is the second smallest value? (a) 3/5 (b) 0.3 (c) 2/7 (d) -15 c Which is the third biggest value? (a) 2/5 (b) -9 (c) -1/9 (d) 3/7 c Which is the third smallest value? (a) -1/3 (b) -1.49 (c) 0.5 c What is the third biggest value in 853, -0.4, -0.2, 3/4? -0.2 Which is the biggest value? (a) 2/17 (b) 2 (c) -2 (d) 0.4 b What is the second biggest value in 1.3, 0, -0.3, 5, 0.3? 1.3 Which is the third smallest value? (a) -1/3 (b) 5/3 (c) 0.7 b What is the second biggest value in -1, 2/17, -3/5? -3/5 What is the second biggest value in 0.1, 3, -4, 0.28? 0.28 What is the second biggest value in -0.1, 2/3, -1, 36? 2/3 What is the third biggest value in -0.4, 0.2, -5/673? -0.4 Which is the fourth biggest value? (a) 2 (b) -1/4 (c) -5 (d) 3 c What is the third biggest value in 0.092, 0.3, 5, -1/2, 2/13? 2/13 What is the third biggest value in 0.5, 2, 87? 0.5 What is the third smallest value in 0, 2, -5.2, 4? 2 What is the fourth biggest value in -1, 11.2, 0.5, 3/5? -1 Which is the fifth smallest value? (a) 2/5 (b) -0.2 (c) 4 (d) -1/2 (e) 9 e What is the third biggest value in -2, 0, -5.1? -5.1 Which is the biggest value? (a) 5/6 (b) -2/9 (c) 2/25 a Which is the third smallest value? (a) 0.2 (b) 0 (c) 2 (d) -1/3 a What is the third smallest value in -25, -2/5, 0? 0 Which is the smallest value? (a) 0 (b) 5 (c) 3/7 (d) 0.72 a What is the smallest value in 1/4, -0.3, 4/5, 2? -0.3 What is the second smallest value in -23, 4, 25? 4 Which is the fourth smallest value? (a) 1/11 (b) 1/96 (c) 4 (d) 3/8 (e) 5 c What is the third biggest value in -2/3, 0.3, -0.0137, 0.11? -0.0137 What is the smallest value in -2, 19, 4, 2? -2 Which is the third smallest value? (a) -2 (b) -0.05 (c) -0.3 (d) -2/7 d Which is the third smallest value? (a) -1/7 (b) 0.1 (c) 25 c What is the third smallest value in 2/9, -4/5, 19/2, -0.2? 2/9 Which is the fifth smallest value? (a) 2/11 (b) 4 (c) 1/106 (d) -0.11 (e) 0.4 b What is the fourth biggest value in 0.1, 2, -20, -0.38? -20 What is the fourth biggest value in -0.4, -2, 0.3, 3/32? -2 What is the second smallest value in 0.1, 0.08, -1/3, 36? 0.08 What is the third smallest value in 1/2, 0.03, 1/7? 1/2 What is the third smallest value in 2/109, 1, -1/11, 4? 1 What is the fourth smallest value in 616, -3, 0.3, -0.2? 616 What is the biggest value in 0.1, -2/19, -1? 0.1 What is the fifth biggest value in 0.9, -3, 3, 5, -3/5? -3 Which is the second smallest value? (a) 2/21 (b) -2/27 (c) 4 a Which is the fourth biggest value? (a) -20 (b) 5 (c) 3.9 (d) -4 a What is the fourth	{ "pile_set_name": "DM Mathematics" }
j(481/462) Simplify k(-33)k(k/k(-2/77))/k assuming k is positive. k(-2462/77) Simplify (h1)(-1) assuming h is positive. 1/h Simplify (d*(-11)d)/(dd(-5/8)d) assuming d is positive. d(-91/8) Simplify x3x6(x(-1))(-1/20) assuming x is positive. x*(181/20) Simplify ww/w*(-38)(ww/(ww/(w(17/5)/w)))/w assuming w is positive. w(207/5) Simplify (i*(-14)/i)/(ii*11i) assuming i is positive. i*(-28) Simplify (ff/((f/(f/(f*0f)))/f)fff(-5/2))/(ff(2/3))(4/3) assuming f is positive. f*(-13/18) Simplify (((y/(yy/(y/(yy(4/5)yy)y)))/yy)/y(1/6))/(y(-1/4)y0) assuming y is positive. y(-163/60) Simplify ((w/(w*(-5)/w))/ww*(2/3)w)/(ww3w/(w/(w/(www*(3/5)w)w)w)) assuming w is positive. w(94/15) Simplify x(1/14)/(x/(x/(x*(-2/11)x))) assuming x is positive. x(-115/154) Simplify (h(2/3)hh)/(h/((hhh*1)/h))h*(-1/3)/hhhhh5 assuming h is positive. h(31/3) Simplify ((l(3/2)/l)/lll)/((l/l(1/19)l)/l) assuming l is positive. l*(21/38) Simplify (xx*(-1/11)x)/((x/x*(-34))/xx) assuming x is positive. x*(-364/11) Simplify ((ff/f*(1/2))/ffff)(-11/6)/((f(-2/3)ff)/(f/f(2/9))) assuming f is positive. f(-251/36) Simplify ((d(d(-1)/d)/d)(8/11))39 assuming d is positive. d(-624/11) Simplify (rr*(-12/11)rr(-10/3)/r)50 assuming r is positive. r(-5650/33) Simplify (llll/((l/l*22)/l))/(l/(ll/(l*(2/29)l))) assuming l is positive. l(752/29) Simplify (m(-12)/m(-3/2))(-7/4) assuming m is positive. m*(147/8) Simplify (pp*(3/4)pp(-3)p)(-37) assuming p is positive. p(-111/4) Simplify mm(-1/21)mm/(mm8) assuming m is positive. m(-127/21) Simplify ((b/(b/(((b/b*(2/69))/b)/bb)))/b)/(bb(3/2)) assuming b is positive. b(-487/138) Simplify m(-2/85)/m(-28) assuming m is positive. m(2378/85) Simplify (p1)(15/2)/(p1)7 assuming p is positive. sqrt(p) Simplify l16/l(-2) assuming l is positive. l18 Simplify ((m(-2/27)m)/((m/(m*(7/5)m))/m))(-8/13) assuming m is positive. m(-3592/1755) Simplify k*5/(kkkk*(-4)k) assuming k is positive. k5 Simplify (f(1/2)fff(5/4))5 assuming f is positive. f(75/4) Simplify (f/(ff/((ff/f(-10))/f))fff/(f(4/7)/f))(-2/7) assuming f is positive. f*(-188/49) Simplify uu*(-9/5)u(-30) assuming u is positive. u(-154/5) Simplify (k(k(-1/5)/k)/k)(-20) assuming k is positive. k24 Simplify ((q(qq(-2/25)q)/q)/(qqq(-1/7)))(2/13) assuming q is positive. q(22/2275) Simplify ((((n(3/4)n)/n)/nn)/n(2/3))/(n8/(n/n(-3/10))) assuming n is positive. n(-397/60) Simplify (((w/(((ww(-1/4)/ww)/w)/w))/w)/((www4)/w))/(w(-2/35)/w8) assuming w is positive. w(603/140) Simplify b*(3/11)bb/(bb*19b) assuming b is positive. b(-206/11) Simplify (n/n(-34)n)31 assuming n is positive. n1116 Simplify (k/(kk(-1/2)))22/((k/((k(k/k(-3/7))/kk)/k))/kk/k(-1/2)) assuming k is positive. k(153/14) Simplify (q4q(qqqq/q*(-10)qqq)/qq)32 assuming q is positive. q704 Simplify j(1/13)/(j/(j/j6))((j(2/7)/j)/j)/j(-6) assuming j is positive. j(-149/91) Simplify (n/(n(-8)n))/n(-36) assuming n is positive. n44 Simplify ((dd(2/11))(6/17))(4/11) assuming d is positive. d(312/2057) Simplify a*19a/a(-1/42) assuming a is positive. a(841/42) Simplify ((r/r2)(7/10))4 assuming r is positive. r(-14/5) Simplify w/(ww(3/4))ww3w*0w/(w/(w/(w((ww/(w/(ww/(w(1/3)w)w)))/www)/w))) assuming w is positive. w(7/12) Simplify (g(1/14)g/g10)/((g4gg)/(g/(g(-2/13)/g))) assuming g is positive. g(-2325/182) Simplify (uuu/u20)(5/9) assuming u is positive. u(-85/9) Simplify (r1)(17/3)/(r/((r/r(2/9))/r)rrr/(r/r(-2/15))) assuming r is positive. r(116/45) Simplify ((i/i(2/5))21)(1/43) assuming i is positive. i(63/215) Simplify (s(-2/3)/ss)*(-41)/(sss((s*(-3)s)/ss)/ss(ss(4/7))/s) assuming s is positive. s(541/21) Simplify (pp(-1/19)p((ppp(pp(p/(ppp*(2/5)p))/p)/p)/p)/p)/(p4/p(-7/4)) assuming p is positive. p*(-1977/380) Simplify (h(hh/(hh/(h/h*(-1))hh))/h)(-7)/(h(-1/2)/((h/(h/((h/((hh/h*(-2/5)hh)/h))/h))h)/h)) assuming h is positive. h(-29/10) Simplify l11/(ll(-2/27)) assuming l is positive. l(272/27) Simplify (k(-2))43 assuming k is positive. k(-86) Simplify (dd*(1/12)d)(-29/2) assuming d is positive. d(-725/24) Simplify (hhh*(2/3)hhh(hh(-2/13))/h)/(((h0/h)/h)/(h(-6)/h)) assuming h is positive. h(20/39) Simplify g*0/(gg*(-5))(g0)(2/33) assuming g is positive. g*4 Simplify ((s(s/(s/(s*(-5/2)s)s))/ssss)/(ss(2/15)))(15/7) assuming s is positive. s(-19/14) Simplify (o(-2/7)/o(o/(oo(-2/7)))/o)/(o(-2/5))(1/9) assuming o is positive. o(-88/45) Simplify d/d(7/2)(d((ddd(13/2))/d)/d)/dd assuming d is positive. d5 Simplify (v/(v(-1/5)/vv))25 assuming v is positive. v30 Simplify (mm(-3/4))/m10 assuming m is positive. m(-39/4) Simplify k(-1)kkk/(kk*(1/2)/k)(k/(kk/(k5k)k)kk)/kk(2/5) assuming k is positive. k(69/10) Simplify (g*(1/70)g)11 assuming g is positive. g(781/70) Simplify (m/(mm2))(-12)(m/m(1/5))(-2/117) assuming m is positive. m(14032/585) Simplify (d(-20/3)d)(5/19) assuming d is positive. d(-85/57) Simplify u(-2/7)/(u/u(-1/7))u(2/17)/u(-4/7) assuming u is positive. u(-88/119) Simplify ((k3kk)/k)/(k/k(-6)) assuming k is positive. k(-3) Simplify (r(-2/5))(-5/4)r5/rrr(r*3rr)/r assuming r is positive. r(21/2) Simplify (z(1/3))(-40)(z/(((zz2)/zz)/z))(-29/5) assuming z is positive. z(-113/15) Simplify (nn/n(-2/13))/((n2/nnnn)/n) assuming n is positive. n(-11/13) Simplify (x18(x(x/(xx3x)x)/x)/x)(-1/13) assuming x is positive. x(-14/13) Simplify (p(1/2)/p)(-29)/(p/p1p/p(-1/4)) assuming p is positive. p(53/4) Simplify ((((v/(v/(((((v/(vv(-5/3))v)/v)/v)/v)/v)))/v)/v)/vv/((v/(vvv2/vvv))/v))(2/21) assuming v is positive. v(10/63) Simplify ff*(-1)f/((f(ff/(f/f*(-5/3)))/f)/f)((((ff(-2/3))/f)/f)/f)/((f/(f/(f(1/6)f)))/f) assuming f is positive. f(-1/6) Simplify (s(2/13)ss)(-17) assuming s is positive. s(-476/13) Simplify ((o/(oo/o4))/(o(1/3)oo))(-2/3) assuming o is positive. o(-4/9) Simplify (d1)(-6)/(d(-6)/d(2/5)) assuming d is positive. d(2/5) Simplify (((ww/(ww0/w))/ww)/w)*(-2/25)w*(-1/2)/((w((w*4/w)/ww)/w)/ww) assuming w is positive. w(-179/50) Simplify (((p(2/17)/p)/p)/pp(-2/5)/p)/(p1)(1/16) assuming p is positive. p(-5909/1360) Simplify (z/(zz/(zz(-3))))(-5/11)/(z*4zz(-2/5)) assuming z is positive. z(-178/55) Simplify b(6/17)/b(-6) assuming b is positive. b(108/17) Simplify h(-6/11)h(-9) assuming h is positive. h(-105/11) Simplify (ii(4/9)ii/(iii(-1/8)i))(-1/18) assuming i is positive. i(-41/1296) Simplify (m4/(m/(m/(m/(m/m(2/9))))))(-2/125) assuming m is positive. m(-68/1125) Simplify ((p/(pp(3/8)))(3/40))(-6/19) assuming p is positive. p(27/3040) Simplify ((v(1/4)v)/((v/(v*(-2/5)v))/v))/((vv/v7)/(v/(vv/v*(-5))v)) assuming v is positive. v(37/20) Simplify (f(-3)ff2)/(f(-2)/(ff(-1/4)f)) assuming f is positive. f(15/4) Simplify k(-25)/(k*(-7)kk) assuming k is positive. k(-20) Simplify ((oo(-2))/(o/(o(-4/9)o)))(-11/9) assuming o is positive. o(143/81) Simplify t(2/15)/tt6/t assuming t is positive. t(62/15) Simplify (aa(-2/5)a)*(7/2)a(-5)/(a(-6)aa) assuming a is positive. a*(23/5) Simplify (k(k(k/(kk*(-1/2)))/k)/kkk/((k(-3)/k)/k))(1/15) assuming k is positive. sqrt(k) Simplify r9r/(rr/(r(20/7)/r)) assuming r is positive. r(69/7) Simplify o(-4/7)/(o/(o(-4)o)o) assuming o is positive. o(-39/7) Simplify ((x/(xx*(-5)x))/x(4/5))/(x0)42 assuming x is positive. x(16/5) Simplify f/(f/((f*(-6)f)/f))f1((ffff/(ff4))/f)/f(2/11) assuming f is positive. f(-79/11) Simplify ((p(-1/10)p)/(pp*(1/5)p))/((p((ppp*(-2/	{ "pile_set_name": "DM Mathematics" }
2. Let g(p) = -782p2 - 23p - 23. Give 2g(f) - 23z(f). 69f2 Let p(c) = -3c - 3. Suppose -2u = y + 26, y + 42 = -4u + 4y. Let d = u - -7. Let n(f) = 4f + 4. Give dp(k) - 4n(k). -k - 1 Let j(x) = 4x3 + 7x*2 + 6x + 8. Let a(c) = -9c3 - 15c*2 - 13c - 17. Suppose -2f - 26 = 2s, -2s - 4f = 3s + 65. Calculate sj(l) - 6a(l). 2l3 - l2 - 2 Let g(m) = 10 - 3m - 1 - 8 + 4. Let u(r) = -4r + 6. Calculate 5g(f) - 4u(f). f + 1 Let m(f) be the second derivative of f4/4 - f3/2 - f*2/2 + 14f. Let r(u) = 16u2 - 16u - 5. Give 11m(s) - 2r(s). s*2 - s - 1 Let t(c) = -19c - 1. Let x(l) = 19l + 1. Give 4t(v) + 5x(v). 19v + 1 Let y(h) = -6h - 1. Let q(s) = 13s + 2. Determine -2q(j) - 5y(j). 4j + 1 Suppose 36z - 12 = 39z. Let h(c) = 3 - 1 + 3c - 3. Let j(k) be the second derivative of -k*3/6 - k. Determine zj(u) - h(u). u + 1 Let x(y) = -1. Let o(p) = p3 - p2 - p. Let r be o(-1). Let i(d) = -6d - 6. Let f(k) = 5k + 6. Let c(q) = 5f(q) + 4i(q). Give rc(w) - 5x(w). -w - 1 Let p(u) = u - 2. Suppose -2 = 3j - j. Let q(n) = 3n*3 - 1. Let v be q(j). Let l(w) = 3w - 6. Give vl(m) + 11p(m). -m + 2 Let z(g) = 2g2 - 1. Let q(a) = 6a*2 - a - 4. Let j be (-1)/1(11 - 9). Determine jq(t) + 7z(t). 2t2 + 2t + 1 Let u(a) = -2a2 - 4. Let c(y) = -y. Let n(h) = -3c(h) + u(h). Let q(d) = -d + 1. Calculate -n(o) - 5q(o). 2o*2 + 2o - 1 Let p(u) = -4u2. Let k(w) = 2 - 1 - 1 + 1 + 5w*2. What is -3k(f) - 4p(f)? f2 - 3 Let o(h) be the first derivative of 0h4 + 2 + h - h4 - 3 - 8h. Let k(r) = -r3 - 2. Determine -22k(z) + 6o(z). -2z*3 + 2 Let z be -2 - -9 - (-2)/1. Let c(l) = 3l*3 + 2l*2 - l. Let s(u) = -13u*3 - 9u*2 + 4u. Let n be 24/(-12) - (-3 - 1). What is ns(m) + zc(m)? m*3 - m Let y be ((-6)/(-4))/((-3)/(-4)). Let j = 44 + -42. Let n(f) = jfy - 8 + 3 + 3 - f2. Let u(c) = -c*2 + 2. Calculate -6n(l) - 7u(l). l2 - 2 Let j = -6 - -1. Let s(a) = -2a*3 - 4a*2 - a. Let f(w) = 3w*2 + 2w + 4w2 + 0w*2 + 3w3 - w2. Give jf(t) - 8s(t). t*3 + 2t*2 - 2t Suppose 3t + 5q - 8 = 0, 2t + 4q + 4 = 12. Let y(a) be the first derivative of -a*2/2 - a + 1. Let j(u) = -u + 3u - 2 - 5u. Calculate ty(g) + j(g). g + 2 Let m(j) = 2j + 2. Let w(g) = 6g - 3g - g - 3 - 3g. Give 3m(l) + 2w(l). 4l Let d(w) = 4w + 5. Let f(o) = -3o - 4. Give -2d(n) - 3f(n). n + 2 Let d(o) = -o2 + o + 1. Let c(r) = 5r + 5. Determine c(v) - 4d(v). 4v*2 + v + 1 Let m be ((-6)/(-9))/(2/6). Let p(v) = 2v. Let i(k) = -k. Determine mp(z) + 3i(z). z Let y(o) = -5o3 - 16o*2. Suppose 0 = -5j - 4i + 75, -2i - 7 = 5j - 72. Let h = 0 + j. Let c(u) = -u3 - 3u*2. Determine hc(q) - 2y(q). -q3 - q2 Let v(y) = -1 - 3y - y*2 - 8 + 8y*2 - 3y. Let c(u) = 15u2 - 13u - 19. Give 6c(w) - 13v(w). -w*2 + 3 Let s(z) = -22z*2 - 2z + 1. Let y(i) = -87i2 - 9i + 4. Give -9s(u) + 2y(u). 24u2 - 1 Let w(z) = -4z*3 + 4z*2 - 5z - 5. Let u(m) = -6m3 + 6m*2 - 8m - 8. Let v = -20 - -25. Calculate vu(p) - 8w(p). 2p3 - 2p*2 Let s(c) = -c + 1. Let w(m) = -5m + 5. Suppose 4q = 4h - q + 21, 5h - 2q + 22 = 0. Calculate hs(a) + w(a). -a + 1 Let n(j) = j2 - j. Let y(d) = -d. Let u(k) = -9k - 32. Let l be u(-4). Determine ly(g) - 4n(g). -4g2 Let w(y) = -2y*2 - 2y + 4. Let t(a) be the third derivative of a*5/6 + 5a*4/12 - 7a*3/2 + 7a*2. Suppose -6z + 3z - 6 = 0. Give zt(k) - 11w(k). 2k*2 + 2k - 2 Let v be 22/6 + (-2)/3. Let p(w) = 2w. Let h(x) be the third derivative of 0x + 1/12x4 + 0 - x2 + 0x*3. Give vp(i) - 2h(i). 2i Let j(n) = 14n2 + 2n - 1. Let d(z) = -13z2 - 2z + 1. What is -5d(u) - 6j(u)? -19u2 - 2u + 1 Let u(x) = -6x - 2. Let r(b) = 11b + 3. Give 3r(c) + 5u(c). 3c - 1 Let f(v) = 11v - 5. Let l = 25 - 0. Suppose -5a - l = 5h, 26 = -3a + h - 1. Let r(z) = -7z + 3. Calculate ar(u) - 5f(u). u + 1 Let m(z) = -4z - 1. Let b(w) = -1. Determine 2b(n) - m(n). 4n - 1 Let r(u) = 2u - 9. Let s(q) = 3q - 10. Give 5r(f) - 4s(f). -2f - 5 Let o(j) = 3j + 21. Let a(t) = t + 10. Give -9a(k) + 4o(k). 3k - 6 Let h(f) = 41f2 - 6. Let v(w) = -2256w*2 + 329. Determine -329h(s) - 6v(s). 47s*2 Let n(f) = 2f*3 - 5f*2 + 0f*3 + 3f*3 + 2f*3 - 5f. Let x(i) = -6i3 + 4i*2 + 4i. Determine -5n(d) - 6x(d). d3 + d2 + d Let a(b) = 7b3 - b2 - 5b - 9. Let l be (-11)/2 - (-7)/14. Let g(d) = -4d3 + d2 + 3d + 5. Calculate lg(w) - 3a(w). -w*3 - 2w*2 + 2 Let c(m) = -9m*2 - 7m. Let o(p) = p*3 - 10p*2 + 7p + 16. Let t be o(9). Let k(x) = 3x2 + 2x. What is tc(f) - 7k(f)? -3f2 Let o(c) = -23c*2 - 3c - 2. Let m(v) = 24v2 + 4v + 3. Give -3m(x) - 4o(x). 20x2 - 1 Let s(d) = 5d + 8. Suppose -v - 3 = p - 2, 4p - 5 = 5v. Let w(r) be the third derivative of 0 + r*2 + pr - 1/2r3 - 1/12r*4. Give 4s(l) + 11w(l). -2l - 1 Suppose -3h = 62 - 2. Let s = h + 11. Let j(r) = 5r + 9. Let v(c) = 3c - 9. Let y(m) = -5m + 14. Let a(x) = 8v(x) + 5y(x). Determine sa(l) - 2j(l). -l Suppose -3m + 3w + 12 = 0, -20 = 2m - 7m - 3w. Let f be 6/(-24) + 25/m. Let u(t) = -13t + 13. Let l(z) = 7z - 7. Determine fu(b) + 11l(b). -b + 1 Let j be -10(-2)/(-6). Suppose j = 3n - 10 - 5. Let y(h) = 5h2 - h + 4. Let w(x) = 6x*2 - x + 5. Give ny(g) - 4w(g). g2 - g Let q(y) = 20y - 82 - 86 - 86 + 259. Let f(p) = 5p + 1. Calculate -9f(w) + 2q(w). -5w + 1 Let a(c) = -c2. Let k(l) = -l3 + 6l2 - 7. Determine 6a(p) + k(p). -p*3 - 7 Let u(h) = -2h*2 + 9. Let o(t) = 1. What is 18o(z) - 2u(z)? 4z*2 Let n(m) = 2m + 4. Let p(u) = -u - 1. Suppose 0 = 7j - 10 + 3. What is jn(y) + 5p(y)? -3y - 1 Let x(s) = -3s - 9. Suppose -o + 3 = 6. Let n(q) = -2q - 5. Determine ox(y) + 5n(y). -y + 2 Let x = -10 + 1. Let v(t) = 3t - 1. Let k(b) be the second derivative of 0 + b - 2b*2 + 13/6b*3. Determine xv(s) + 2k(s). -s + 1 Let a = -10 + 6. Let n(o) = -o + 3. Suppose 2k + 0 = 6. Let x(i) = -i + 2. Calculate ax(f) + kn(f). f + 1 Let t(g) = -19g. Let l(p) = 1768p. Determine -2l(x) - 187t(x). 17x Let i = -26 + 53. Let r be 465/i - 2/9. Let k(x) = 20x*2. Let c(d) = -7d*2. What is rc(l) + 6k(l)? l2 Let z(v) = 5v*2 + 3v*2 - 9v*2 + 2v*3 - 3 + 0v3. Let h(a) = -a3 + a*2 + 1. Give 3h(q) + z(q). -q*3 + 2q2 Let x(l) = l3 - l*2 + 1. Let a(z) = -4z*3 + 3z*2 - 5. Let d(c) = -14c - 78. Let k be d(-6). Determine kx(r) + a(r). 2r*3 - 3r*2 + 1 Let w(q) = -6q - 5. Let r(a) be the first derivative of a*2/2 + a + 5. Give -5r(f) - w(f). f Let d be -1 + 1/((-2)/(-6)). Let f be ((-9)/6)/((-21)/(-14)). Let a(r) = r2 - r - 1. Let x(v) = v2 - 2v - 2. Give da(m) + fx(m). m2 Let r(k) = -k - 1. Let v(f) = -36f - 24. Calculate -24r(x) + v(x). -12x Let x(z) = -z - 2. Suppose 7 = -7b - 14. Let f(w) = w + 1. What is bx(t) - 5f(t)? -2t + 1 Let h(k) = 30k2 - 20k + 20. Let n(p) = -p*2 + p - 1. Calculate -h(f) - 20n(f). -10f2 Let i(c) = 7c*2 + 7c - 6. Let w be (-424)/(-36) - (-4)/18. Let z = w - 7. Let m(n) = 8n2 + 8n - 7. Determine zm(x) - 6i(x). -2x2 - 2x + 1 Let y(d) = 34d2 + 7. Let q(a) = 11a*2 + 2. Give 14q(n) - 4y(n). 18n*2 Let v(m) = -6m + 2. Let y(k) = k + 1. Let n(x) = x - 8. Let u(q) = n(q) + 6y(q). Determine 3u(t) + 4v(t). -3t + 2 Let l(o) = -2o - 6. Let y(f) = -1. Calculate 3l(p) - 21y(p). -6p + 3 Let s(p) = 4p2 + 4p. Let q(j) = -j*2 - j. Let l(y) = y + 1. Let k be l(-3). Suppose -5u = -5x + 30, -3u - 5 - 13 = x. Determine ks(i) + uq(i). -2i2 - 2i Let c = -1 - -5. Suppose -2 - 2 = -cs. Let h(u) = -1. Let i(a) be the first derivative of a3/3 - 2a + 1. Calculate si(f) - 2h(f). f*2 Let u(g) = g + 3. Let j(v) be the second derivative of -2v*3/3 - 5v*2 + 7v. Determine 4j(k) + 14u(k). -2k + 2 Let r(b) = 176b*2 + 33b. Let l(i) = -27i2 - 5i. Give -33l(h) - 5r(h). 11h2 Let o(q) = -11q*2 + 5q - 2. Let l(m) = -2m2 + 2m + 2. Let p(n) = -3n2 + 4n + 5. Let j(y) = 7l(y) - 3p(y). What is 5j(t) - 2o(t)? -3t2 - 1 Let n(p) = p3 + 5p*2 - 2p - 4. Let z be n(-5). Let m = 10 - z. Let c(t	{ "pile_set_name": "DM Mathematics" }
t is the remainder when d is divided by 12? 9 Suppose 3s = 5i + 19, 2i - 4 = 3s - 26. Suppose r = -3r + 56. Calculate the remainder when r is divided by s. 6 Let c(j) = -2j*2 + 3j*2 - 6j*3 - 3 + 2 + 0j*2. Calculate the remainder when c(-1) is divided by 2. 0 Suppose -300 = -5y + 6t - 3t, 240 = 4y - 2t. Calculate the remainder when y is divided by 21. 18 Let m(g) = -g*3 + 4g*2 - g - 3. Let y be m(3). Suppose -yo = -7o + 32. What is the remainder when 29 is divided by o? 5 Let b(t) = -t3 - 5t*2 + 2t - 14. What is the remainder when 39 is divided by b(-6)? 9 Let v(f) = -f*3 + 10f + 1. What is the remainder when v(-5) is divided by 26? 24 Let s be (-4)/(-14) + 5/7. What is the remainder when (-2 + (-39)/s)/(-1) is divided by 21? 20 Let b(m) = 4m - 5. Suppose 2j - 7 = j. What is the remainder when j is divided by b(2)? 1 Let y = -479 - -261. What is the remainder when 6/2y/(-6) is divided by 28? 25 Let o(a) = a - 3. Let l be o(5). Let z(b) = -3b*l + 2b*2 + 25b*2 + b. Calculate the remainder when z(1) is divided by 13. 12 Suppose -5t = -q + 8, 2t + 3 = 3q - 8. Let v(j) = 15j - 2. What is the remainder when v(q) is divided by 22? 21 Let y = -47 - -62. What is the remainder when 147 is divided by y? 12 Let a(y) = -1182y*2 - y. Let j be a(1). What is the remainder when 1/(-4) + j/(-28) is divided by 11? 9 Let m(c) = -c - 2. Let y be m(-7). Let f(o) = -4o*3 + 5o*2 + 4o3 + o3 + 2o + y. What is the remainder when 37 is divided by f(-4)? 11 Let a = -55 + 93. Calculate the remainder when a is divided by 13. 12 Suppose -7n + 116 = -52. What is the remainder when 42 is divided by n? 18 Suppose 0 = g + 3g - 488. What is the remainder when g is divided by 21? 17 Let i = -3 - -6. Suppose 0 = -ih - 2w + 6w + 205, -2h + 136 = -2w. What is the remainder when h is divided by 23? 21 Let u(h) = 5h + 6. Suppose -14 = -j - j - 5y, 0 = 2y. Calculate the remainder when u(j) is divided by 21. 20 Suppose 2f - f - 4g - 5 = 0, -5f + g + 44 = 0. Calculate the remainder when 16 is divided by f. 7 Suppose 4c = 3c + 14. Calculate the remainder when 22 is divided by 2 + -4 + c/1. 10 Let c = 19 + 0. Suppose 21 = 3a - 0a. What is the remainder when c is divided by a? 5 Let v be (2 - 2)/(-11). Let z(o) = 3o*3 + 9 + 23 - 2o*3. What is the remainder when z(v) is divided by 11? 10 Let i = -6 - -14. Suppose 5m - 66 = -1. What is the remainder when m is divided by -11(1 - i)? 6 Let h(b) = -15b3. Calculate the remainder when h(-1) is divided by 8. 7 Let k(d) = -13d + 7. Let c be k(-6). Let l = 76 - 53. Let w = c - l. What is the remainder when w is divided by 21? 20 Let c(x) = -x + 10. Let i be c(7). Let s = 14 - 6. Suppose -2a = -r - 1 - s, 0 = -3r + i. Calculate the remainder when 14 is divided by a. 4 Calculate the remainder when 3/12386 is divided by 15. 12 Let j(s) = s*3 + 5s*2 + s - 1. What is the remainder when j(-4) is divided by 3/((-1)/(-4)2)? 5 Let t(i) = 3i2 + 3i - 2. Let s = -4 + 6. Let o(d) = -3d3 - 5d*2 - 5d - 4. Calculate the remainder when o(-3) is divided by t(s). 15 Let r(h) be the first derivative of h*3/3 - 5h + 2. Let c be r(5). What is the remainder when 19 is divided by 3/(18/c)3? 9 Let a = -28 + 50. Let t(r) be the first derivative of 2r*2 - 4r + 1. What is the remainder when a is divided by t(4)? 10 Suppose 70 = 2x - 16. Calculate the remainder when x is divided by 9. 7 Let v(a) be the third derivative of -3a*2 + 0a + 0 + 7/6a3 + 1/24a*4. Calculate the remainder when v(6) is divided by 7. 6 Suppose -4r + 8 = -2r + 2c, 4r - 6 = c. Let s = 7 + -4. Suppose 0 = 3h - 3y - 21, 0 = -sh - y + 1. What is the remainder when h is divided by r? 0 Let o = 10 + -5. Suppose 5w - 16 = -0w + 2v, 0 = ow - v - 18. What is the remainder when 13 is divided by w? 1 Let n be -3 - (-2 - -17)-1. Suppose 2s - 2b - n = 0, 0 = -s - b + 4b + 6. Calculate the remainder when s is divided by 4. 2 Suppose 5x + 0x = 115. Let a be 140/6 + 4/6. Let m = a - 16. Calculate the remainder when x is divided by m. 7 Suppose -2k + 6 = -0k. Suppose 4v = kh - 0h - 28, -3h = v - 8. What is the remainder when 7 is divided by h? 3 Let h = -24 + 54. Suppose -2z = -3z + h. Calculate the remainder when z is divided by 13 - 2 - (-3 - 2). 14 Let f(n) = 5n - 22. Calculate the remainder when f(9) is divided by 13. 10 Suppose -5n = i - 394, 3n + 0i = -i + 238. Suppose 0 = 3b + b. Calculate the remainder when n/3 - (1 + b) is divided by 9. 7 Let j(a) = 72a. Let t be j(1). Suppose -2h - q + t = 2h, -3h = -4q - 54. Calculate the remainder when h is divided by 5. 3 Calculate the remainder when (-10)/(-25) + (-1239)/(-15) is divided by 29. 25 Let r(h) = -h*3 - 3h*2 + 3h - 3. Let l be r(-4). Suppose -l = -v + 5. What is the remainder when 22 is divided by v? 4 Let b = 11 - 3. Let k(g) = 18g + 8. Let i be k(6). Suppose -5z - 3n + i = 0, 2z - 2n - 59 = -19. Calculate the remainder when z is divided by b. 6 Let t(n) be the third derivative of n5/60 - n4/4 + 2n*3/3 - 3n*2. Suppose -1 - 6 = -g. What is the remainder when g is divided by t(6)? 3 Let x = -1 + 6. Suppose -6 = -xh + 4. What is the remainder when 14 is divided by (-10)/(-4)4/h? 4 Suppose 26 - 301 = -5l. Suppose -5u + 27 = -43. Calculate the remainder when l is divided by u. 13 Let h = 0 - -1. Let r(o) = 29o - 5. Let q(u) = u - 1. Let i(g) = -6q(g) + r(g). What is the remainder when i(h) is divided by 13? 11 Let p be (4/12)/((-2)/(-12)). Suppose 0 = -w + f + 59, 212 = 4w + pf - 18. Calculate the remainder when w is divided by 15. 13 Let t = 22 + -11. What is the remainder when 41 is divided by t? 8 Suppose -3c - v + 366 = -2v, 4c - 2v - 486 = 0. What is the remainder when c is divided by 21? 18 Suppose 0w = -5w + 50. What is the remainder when 38 is divided by w? 8 Let c(z) = -z2 + 27. Let b(w) = -w3 + w2 - 2w - 2. Calculate the remainder when c(0) is divided by b(-2). 13 Let y(r) = r*2 - 6r - 16. Calculate the remainder when 95 is divided by y(10). 23 Let o = 189 - 129. Suppose 0f = 4f - o. Suppose 25w + 232 = 33w. Calculate the remainder when w is divided by f. 14 Let z = -87 - -161. Let v = 103 - z. Let w(x) = -15x3 - x2 - 2x - 1. Calculate the remainder when v is divided by w(-1). 14 Let l = 217 - 132. Calculate the remainder when l is divided by 8. 5 Let q(l) = l - 10. Suppose -4 - 11 = -5u. What is the remainder when q(14) is divided by u? 1 Let w(f) = -f3 - 4f*2 - 4f - 2. Let i be w(-2). What is the remainder when 23 is divided by -4 - i - (-3 - 7)? 7 Let m = -29 - -94. Suppose -2z + 39 = z + 2r, -m = -5z + r. Let w = 0 + 8. What is the remainder when z is divided by w? 5 Calculate the remainder when 90 is divided by 0 + -4 + 0 - -17. 12 Suppose -w = 5v - 131, -132 = -5v - 2w - 0w. Calculate the remainder when v is divided by 7. 5 What is the remainder when -1 + -1 - (-280)/5 is divided by 19? 16 Let n = -320 + 711. Let u = n + -221. Suppose 5s - u = x - 4x, -5x + 118 = 3s. Calculate the remainder when s is divided by 11. 9 Let w = -16 + 26. Suppose -7c = -8c + w. What is the remainder when 26 is divided by c? 6 Let o(z) = z3 + 10z*2 - 18z - 26. What is the remainder when o(-11) is divided by 15? 6 Suppose 0t = -5k + 3t + 171, -43 = -k + 5t. Let p(x) = -x*3 + 28x*2 + 4x + 17. What is the remainder when p(28) is divided by k? 30 Suppose -4m - 46 = -2o, 3o = 2m + 37 + 12. What is the remainder when 48 is divided by o? 9 Let g(z) = 10z2 + 58z - 6. What is the remainder when g(-6) is divided by 3? 0 Let f = -136 - -190. Let w = -45 - -64. What is the remainder when f is divided by w? 16 What is the remainder when 58 is divided by (-2 + (-3)/(-2))-24? 10 Let l(t) = t + 8. Let o be (2 - 18/4)-2. Suppose -oc + 3 = -2c. What is the remainder when l(-6) is divided by c? 0 Suppose 0c - 54 = -2c - 4z, -126 = -4c - 2z. Calculate the remainder when c is divided by 19. 14 Let p = -49 + 100. What is the remainder when 151 is divided by p? 49 Suppose -2p + 120 = 3p. Calculate the remainder when p is divided by 4. 0 What is the remainder when 49 is divided by 5/(-10) - (-105)/6? 15 Suppose 4n = -0*n + 52. What is the remainde	{ "pile_set_name": "DM Mathematics" }
the greatest common factor of j and 73. 73 Let b be (60/8)/5(13 + 5). What is the highest common factor of 81 and b? 27 Let r be 40/90 + 447/27. Suppose 2b = -w + 2 + r, 0 = -5b - 4w + 49. Calculate the highest common divisor of b and 18. 9 Let h(p) be the third derivative of p*4/24 + 3p*3 - 32p*2. Let q be h(0). What is the highest common divisor of 18 and q? 18 Let w(f) = f - 1. Let c(l) = -52l + 44. Let y(i) = -c(i) - 24w(i). Let k be y(7). Calculate the greatest common factor of k and 16. 16 Let r be (-2)/(-3)12/8. Let c = 1 + r. Suppose 4x - 12 = -2q, -cx = -4q - 0x + 24. What is the greatest common divisor of 18 and q? 6 Let o = -1178 - -1179. Calculate the highest common divisor of 303 and o. 1 Let s = -27 + 16. Let m(n) = -n - 8. Let g be m(s). Suppose gx = -i - x - 11, 4i + 4x - 16 = 0. What is the greatest common factor of i and 81? 9 Let o(h) = -2h - 1. Let u be o(3). Let b be -3 + u/(4/(-1 + -3)). What is the highest common divisor of 68 and b? 4 Suppose 0 = 2n - 5t - 3405, 3t + 6 = -3. Calculate the greatest common factor of 15 and n. 15 Suppose 25 + 140 = 15l. What is the greatest common factor of l and 55? 11 Suppose -11b = -504 + 108. What is the greatest common factor of 300 and b? 12 Let n be (3 + -2)/(1/(-5)). Let o = 5 + n. Suppose 5z + 2x - 11 = o, -2z - 2x - 3 = -5. Calculate the highest common factor of 2 and z. 1 Suppose 0 = -2o + 3q + 11 + 129, 0 = 2o + 2q - 140. What is the highest common factor of 220 and o? 10 Let i(w) = 519w - 7. Let c be i(3). Calculate the greatest common divisor of c and 62. 62 Suppose -6d - 4 = -2d. Let p(b) = 8b*2 - 3b - 2. Let s be p(d). Let u be (-1 - (-78)/s)15. What is the greatest common divisor of u and 23? 23 Suppose -400 = 53k - 57k. What is the greatest common divisor of k and 20? 20 Let l be (28/8)/((-15)/(-2280)). What is the greatest common factor of 84 and l? 28 Suppose -2l = 3v + 21 - 197, -3l + 2v + 264 = 0. Let u = 1684 - 1673. What is the highest common divisor of l and u? 11 Suppose -12k - 504 = -15k. What is the highest common divisor of 42 and k? 42 Suppose -25r + 42 = -23r. Let j be (-2)/28-334 - (-3)/r. Calculate the highest common factor of j and 12. 12 Suppose 17 = 2i + 5. Let p = 2 - i. Let c be 1/(-2) + (-118)/p. What is the greatest common divisor of 29 and c? 29 Let c(n) = -2n*3 - 33n*2 - 18n - 32. Let g be c(-16). Let j be (-4)/4 + g + 4. Suppose 6z - 12 = 4z. What is the highest common divisor of z and j? 3 Let p(y) = y*3 - 30y*2 + 4y - 105. Let a be p(30). Calculate the highest common factor of a and 30. 15 Suppose -b + 3 = -p, 4p - 5b = -7 - 10. Calculate the highest common factor of p and 11. 1 Let w be (-212)/20 - 4/10. Let d be (-1062)/(-33) - (-2)/w. What is the greatest common factor of 352 and d? 32 Suppose 2622a - 2630a + 112 = 0. Calculate the highest common factor of a and 504. 14 Let y(z) = -2z2 - 10z - 8. Let i be y(-6). Let p = i - -26. Suppose -j + 5x = p, -5j + j = 3x - 68. What is the highest common divisor of 154 and j? 14 Suppose -3d - 8r + 282 = -5r, 0 = 4d - 3r - 404. Calculate the highest common factor of 1029 and d. 49 Suppose -2s - 4z = 42, -5s + 3z = 6z + 84. Let q be 39/4 - s/(-20). Let x be (1 - -18) + 2 + -3. Calculate the highest common factor of q and x. 9 Suppose 160 = -277t + 282t. What is the greatest common factor of t and 272? 16 Suppose 4g + i = -2i - 7, -g - i = 1. Let a be 24 + g/(-2) + -5. Let j = 43 - a. What is the highest common factor of j and 55? 11 Let o be 2/7 - 6068/(-28). Suppose 2a - o = 23. What is the greatest common divisor of 15 and a? 15 Let u = 1 + -3. Let j be (38/2)/(u/(-22)). Let w be 88/(-33)(-6)/(-4)114/(-24). Calculate the highest common divisor of j and w. 19 Let b = 448 + -400. What is the highest common divisor of 32 and b? 16 Let i be ((-28)/(-2))/(16/8). What is the greatest common divisor of 259 and i? 7 Suppose -j - 7d + 11d = -16, 0 = -j - d + 31. What is the greatest common divisor of j and 98? 14 Let l = 170 - 112. Suppose -3a + 67 = 5n - 30, 3n + 2a = l. Let u be 6/(0 - -3) - -8. Calculate the highest common divisor of u and n. 10 Suppose 4u - 96 = 5s, -4s - 5u - 39 - 5 = 0. Let z be (-135)/20 - (-4)/s. Let a be (-2)/z - (-427)/49. What is the highest common divisor of a and 63? 9 Let u be 16/(-4)(-2)/4. Let h = -190 - -206. What is the highest common factor of u and h? 2 Suppose -4z = -h - 13, -5 = -4z + 3z + 2h. Let b be z(1 - (-3)/9). Let r be ((-90)/b)/((-18)/24). What is the highest common divisor of 12 and r? 6 Let t be 5 - (-85)/(-15) - (-11)/3. Suppose -5b - 2q = -2200, 4b + tq - 2200 = -b. Calculate the greatest common divisor of b and 44. 44 Suppose -2068 = -0j - 22j. Calculate the highest common divisor of 423 and j. 47 Let j(m) = -24m2. Let l be j(1). Let i be (-110)/20(l - -2). Suppose -5v + 215 = x, -2x - i = -3v - x. What is the greatest common factor of v and 14? 14 Let b be (-5 - (-4 + 2)) + 1 + 5. Let s = 34 - 7. What is the greatest common factor of b and s? 3 Suppose 2i + 3i - 12 = h, 12 = 4i. Suppose 2j = -2z + 42, -59 - 3 = -hz - 2j. Let n be 1804/18 - 16/72. Calculate the greatest common factor of n and z. 20 Let q be 12/1017 + (-6)/15. Suppose 3f + f = x - 1, 10 = 3x - 5f. Suppose -u = -6u + 3b + x, 2b = 3u - 2. What is the highest common divisor of u and q? 4 Let k be -3 + (-3)/(-3) + 102. Suppose 4d + 82 = 6d. Suppose -h + 156 = 4b, -h = -b + 3 + d. What is the highest common factor of k and b? 20 Let o(y) = -2y*3 - 9y*2 - 5y - 5. Let d be o(-5). Calculate the highest common factor of 15 and d. 15 Let o be 72 + (-7)/((-7)/(-9)). Suppose 4 = 4x, 3d + d - 5x = 23. Calculate the highest common factor of d and o. 7 Let s(h) = -2h - 18. Let v be s(-14). Suppose v + 30 = 2z. Let j = 4 - -26. Calculate the highest common divisor of j and z. 10 Let q = -38 + -14. Let j = q + 53. Calculate the greatest common divisor of 2 and j. 1 Let s be ((-11)/2)/((-3)/18). Suppose -n + 4n = s. Suppose n = m - 0m. What is the greatest common divisor of m and 33? 11 Let i(l) = -34l + 110. Let u be i(-5). What is the greatest common divisor of 84 and u? 28 Let u be ((-49)/(-42))/(2/6)26. What is the greatest common factor of 26 and u? 13 Suppose 0 = -7c + 48c - 7380. Calculate the greatest common divisor of c and 140. 20 Let v(o) = 53o*2 - 3o + 3. Let b be v(2). Let p be 116/(-5)(-10)/4. Suppose -37 = -5l + p. What is the greatest common divisor of l and b? 19 Let p = 8 - 6. Suppose -3x + x + 108 = -r, -x + pr + 48 = 0. Suppose -1159q = -1200q + 3444. Calculate the greatest common divisor of q and x. 28 Let h be (9/4)/((-3)/(-56)). Let v(t) = -3t - 24. Let c be v(-10). Calculate the greatest common factor of c and h. 6 Let k(n) = -26n - 100. Let b be k(-5). Suppose -2o = d - 75 - 20, -2o + 3d + 115 = 0. What is the greatest common factor of o and b? 10 Suppose -2y - y - i = -42, -y - 4i + 14 = 0. Let q(s) = 116s - 4. Let b be q(1). What is the highest common factor of y and b? 14 Let p(g) = 7g + 68. Let a be p(-8). Calculate the highest common divisor of a and 348. 12 Let w = -617 + 787. What is the highest common divisor of w and 10? 10 Let h be 87/(2(-12)/(-304)). Calculate the highest common factor of 38 and h. 38 Let o be 75((-7)/(42/36))/(-2). Suppose -5k + k + 100 = 0. Calculate the highest common factor of k and o. 25 Suppose -o + 8 = -3f, -f + 7o - 26 = 2o. Let g be (-4)/4 + f + 3. Calculate the highest common divisor of g and 1. 1 Suppose 0 = 175x - 176x + 22. Suppose -4z = -5z + 66. What is the highest common divisor of z and x? 22 Let d be 7/((-70)/(-232))25/10. What is the greatest common factor of 899 and d? 29 Let d(c) = 33c - 1. Let y be d(-1). Let l be ((-2)/(-3))/(y/(-1275)). Calculate the highest common divisor of 10 and l. 5 Let u be ((-28)/42)/((-4)/378). What is the highest common divisor of u and 105? 21 Suppose 111 = -y + 65. Let a be (-39)/(y/36 - (-18)/(-81)). Calculate the highest common factor of a and 78. 26 Let i(g) = -g3 + 4g*2 - 4. Let y be i(3). Suppose 18j = 9j + 1215. What is the highest common divisor of y and j? 5 Let a be -22/8 - (-6364)/8. What is the greatest c	{ "pile_set_name": "DM Mathematics" }
- 3s - 2s) + 2s - 3s + 0s + 0s - 2s + 15s). -20s2 Expand (-1 + 1 + 1)(3z2 + 0z*2 - 7z*2)(-5z3 - 2z*3 + 5z*3). 8z*5 Expand (0a - a + 0a)(7a - 16a - a). 10a2 Expand (2i - 10i + 12i)(1 - 1 - 2). -8i Expand (0 - 3 + 2)(v2 + 1 - 1) - 5v + 5v - 2v*2 - 2v2 - 2 + 2 - v2 + 2 - 2. -6v2 Expand -4z*3 + 0z + 0z + (1 + 2 - 2)(-3z3 + 0z*3 + 2z*3) + (-2 + 2z + 2)(-4z*2 + 4z*2 + 2z2) + z3 + 4z3 - 3z3. z3 Expand (8 + 8d - 8)(4d - d - 4d). -8d2 Expand (-5b + b + 3b)(-5 + 0 + 2)(b2 + 1 - 1). 3b*3 Expand (4 + 0 + 2)(-t + 4t - t)(3t + 4t - 6t). 12t*2 Expand (-1 + 1 + 1)(3j2 - 4j*2 + 2j*2) + (0j + 2j2 + 0j)(2 - 2 + 1). 3j*2 Expand (-2c*3 + 0c + 0c)(4c - 2c + 2c) - 4c*4 + 2c*4 + 3c*4. -7c*4 Expand (4i*2 - 4i*2 + 5i*2)(2i - 4i + 0i) + 0 - 5i*3 + 3i*3 - 1. -12i*3 - 1 Expand (-4 + 0n - n + 1)(0 + 0 - 2n). 2n2 + 6n Expand (4x + 1 - 4x + 2x)(42 + 54 - 35). 122x + 61 Expand (-q2 + q2 + 2q*2)(-21 + 10 + 2). -18q2 Expand (1 - 1 - h)(1 + 0 + 1) + h - 2h - h + (1 - 2h - 1)(3 + 1 - 3) - 2h + 1 - 1 - 2h + h + 2h. -7h Expand (-3c - 2c + 6c)(1 + 5c - 1) + 11c2 - 21c*2 + c + 17c*2. 12c*2 + c Expand (-1 - 3 + 8)(-f*3 + 3f - 2f2 - 3f). -4f3 - 8f*2 Expand (2p - p - 2p)(-7 + 24 + 4). -21p Expand -c5 - 2c + 2c + (3c3 + c3 + 3c3)(c + c*2 - c). 6c5 Expand q5 + 0q3 + 2q*3 + 0q*5 + (2 - 4 + 5)(4q5 - 2q*5 - 3q*5) + (-4q*2 + 2q2 - q2)(-q2 + q2 + q3). -5q*5 + 2q*3 Expand (-2 + 5 + 4)(z + 0 + 0) + 2z - z - 2z. 6z Expand (k + 0k - 3k)(-2k - 1 + 1) + 3k*2 + 18k*2 - 32k*2. -7k*2 Expand -2 + 2 - 5g + g + 0g - 2g + (-2 + 1 + 3)(0g + g + g) + 3g + 0g - 4g. -3g Expand ((-2x - x + 0x)(-1 + 1 - x) + 4x2 - x2 + 0x2)(-3 - 3 + 4). -12x2 Expand (1 - 2 + 0)(0 + 3 - 4)(-107k*2 + 107k*2 - 4k*5). -4k*5 Expand (4c - 5c + 0c)((2 - 2 - 1)(2 - c - 2) + 5c - 2 + 2) + c2 - 4c + 4c. -5c*2 Expand ((0 + 0 + 2t)(3t - 4t + 3t) - t*2 - 3t*2 + 6t*2)(-3t3 - 3t*3 + 12t*3). 36t*5 Expand (-3 + 3 + 3)(3 - 1 + 7)(-f + 3f - f). 27f Expand (0 + 1 - 3)(5a - 5a - 3a)(0a - a + 3a) - a*2 + 2a*2 - 4a*2. 9a*2 Expand (1 - 1 + d)(-4 + 4 + 6d3 - 3). 6d*4 - 3d Expand (2 - 2 + 2m)(0 + 0 - 2m) - m2 + 2m2 + m2 + 41m2 - 16m*2 - 10m*2. 13m*2 Expand (-5u + 4u + 2u)(-4u - u + 4u)(3u2 - 3 + 3). -3u*4 Expand 2u + u - 4u - 2u - 3u + 4u - 2u - 5u + 4u + (-3 - 2 + 2)(u + 3 - 3) - u + 3u + 0u. -6u Expand 2w - 3w + 4w + (0w + 2w + 0w)(-1 + 6 - 2). 9w Expand (p - 2p + 0p)(2p2 - 6p*2 + 2p2 + (-3 + 3 + p2)(-3 + 1 + 1) + 4 - 4 + 2p*2 - 1 - 2p*2 + 1 + (-p - p + 0p)(6p - 15p + 10p)). 5p3 Expand (4 - 1 - 4)(-2 + 2 + 1)(11d - 21 + 21). -11d Expand (-n - n + n)(-1 + 1 + 6n) + 0n + 2n2 + 0n. -4n2 Expand 0n2 - n2 + 0n2 + (-n - 4 + 4)(-2n + 2n + 5n) + (4n - 4n + n)(-1 + 3n + 1). -3n*2 Expand (3 - 4 - 1)(-l + 3l - 4l) + 0l + l - 2l + 4l - 3l - 2l. 2l Expand (0 + 0 - k*2)(7 + 4k - 7)(-2k2 + 1 - 1). 8k*5 Expand (-4z*2 + 2z2 + z2)(3z - 2z - 3z) + 2z3 - 4z*3 + 0z*3 + (0z*3 + 0z3 + z3)(-2 + 2 - 2). -2z*3 Expand (60 + 7q - 60)(3 - 4 + 3) + 2q - 6q + q. 11q Expand (-3c + 3c + 2c)(-9c + 13 - 13)(-4c + 3c + 3c). -36c*3 Expand -3w*3 - 2 + w + 0 + 4w*3 + (-2w - 3w + 3w)(2w - 8w2 - 2w). 17w3 + w - 2 Expand 0b*5 + 0b*5 - 4b*5 + (-3b*3 - 2b + 2b)(-b*2 + 0b*2 + 3b*2). -10b*5 Expand ((-4 - 2 + 4)(0 - 1 + 0) + 5 - 4 - 4)(4q*3 - 4q3 - q4). q*4 Expand 4u - 6u + 0u + (-4 - 2 + 3)(-2u - 4u + 3u) - u + 0u + 0u. 6u Expand -2z3 - z2 + z*2 + (-5z + 4z + 0z)(z2 + 5z - 5z). -3z*3 Expand (-8t + 0t + 0t)(3 - 5 + 1)(-4 + 2 + 1). -8t Expand (3 + l - 3)(4l2 - l2 + 25l*2). 28l*3 Expand 5c + 328 - 328 + (2c - 3c - c)(0 - 1 + 4)(0 + 1 - 3). 17c Expand 2d*5 - 3d*5 + 3d5 - d5 + 7d5 - 2d*5 + (-2d*2 + 1 - 1)(-d2 + d2 - 3d3) - 2d*3 - 2d*5 + 2d*3. 10d*5 Expand 4w*4 + 4w*4 - 5w*4 + (3w2 - w3 - 3w2)(5w - 6w + 0w) + w4 - 4w*4 + 6w*4. 7w*4 Expand (-3z - z + 2z)(-z + z - 2z2) - 34z*3 + 10z*2 - 10z*2. -30z*3 Expand (3l - 3l2 - 3l)(2l3 - l3 + 2l3) + 5l*5 - 3l*3 + 3l*3. -4l*5 Expand -2s + s - s - 2s + 5 - 5 - 6s + 2s + 2s + (1 + 0 + 1)(0s - 2s + 4s) + 3s - s + 0s - 3s - 3s + 4s + 4s + 0s - s. s Expand (a - 2 + 2)(0a + 3a - 2a) + (-a + 0a - a)(-3a + 3a + 3a). -5a2 Expand (-1 + 1 - 1)((2 + 2 - 3)(-3h + 3h + h) - 3h + h + 4h). -3h Expand (0 + v*2 + 0)(-15v - 7v + 5v + 1). -17v3 + v2 Expand (2g - 2 + 2)(15 + 4 - 1)(-2 + 2 + g). 36g*2 Expand (-2u*2 + 6u*2 - 2u*2)(5u2 - 5u2 + u3) + (2u2 - 3u*2 + 2u*2)(2u3 + 1 - 1). 4u*5 Expand (9j*2 + 7j2 - j2)(-5j - j*3 + 5j). -15j5 Expand 4u2 + u2 - 2u2 + u2 + 0u2 + u2 + (5u - 2u - u)(-3u + 0 + 0) - 2u2 + u2 + 3u2. u2 Expand (0 + 0 + 1)(37 + w + w - 12). 2w + 25 Expand (4 - 6m - 6 + 3)(1 + 0 - 9). 48m - 8 Expand (-w + w - 2w)(195 - 195 - 72w). 144w2 Expand j2 - j2 - 3j*2 + (j + 0 + 0)(-11j + 33 - 33). -14j2 Expand (f3 + 0f2 + 0f*2)(-f2 - f2 + 3f2) + 2f*5 - 2f5 + f5 + (4f4 - 3f4 + f4)(2f + 1 - 1) + 2f5 - 3f*3 + 3f*3. 8f*5 Expand 1 + 1 - 2g*3 + 3g*2 - 5g*2 + (2g*2 + 1 - 1)(-g + g - 2g) + g3 + g3 + 0g*3. -4g*3 - 2g2 + 2 Expand (-1 - m3 + 1)(-2 - 4 + 4) + (m3 - 4m*3 + 5m*3)(-3 + 0 + 1) - 1 + 1 + 5m3. 3m*3 Expand (-d - 9d - 3d)(3 + 3 - 4) + (0 + 1 + 0)((3d - 3d - d)(-1 + 1 - 2) - d + 0d + 3d). -22d Expand (12h + h - 8h)(h2 - h2 - h*2) + 2h - 2h - 2h*3. -7h*3 Expand -3x*4 + 6x*4 - 5x*4 + (4x3 + x3 - 3x3)(-3x + 0x + x) + x*4 + 1 - 1 + 6x*4 + 5 - 5 + (4x*2 + 2x*2 - 4x*2)(-2x2 + 0x + 0x). -3x*4 Expand ((-5v - v + 4v)(4 - 4 + 2) + 2 - 2 - 2v)(-2v - v - 3v). 36v2 Expand (-51 + 89 - 44 - 2u)(0u4 + u4 + 0u4). -2u*5 - 6u*4 Expand -3d - 3d4 + 0d + 4d4 + (d + 4d - 3d)(2d3 - 2 + 2). 5d*4 - 3d Expand (1 - 19 + 3)(-5o2 + o3 + 5o2) + (-o2 - 6o*2 + 5o*2)(o - 4o + 5o). -19o3 Expand (-2 - 4 + 5)(10n - 21n - 22n). 33n Expand (2w + 5 - 5)(4w + 84 - 84). 8w*2 Expand 2c - 2c - 2c + 0c - c - 4c + (-2 - 2 + 2)(c + 3 - 3) + 2c + 0c - 3c + 0c - 3c + 0c. -13c Expand (-3 - 3 + 4)(6b*2 + 2b*3 + 1 - 5b*3 - 8b*2). 6b*3 + 4b*2 - 2 Expand (-2 + t + 2)(-2 + 1 + 6t - 3t). 3t2 - t Expand (3 - 2 + 1)(4 + 0 - 6)(-d + 4d - 6d). 12d Expand (-4i + 3i + 0i)(2i2 - 3i*2 + 2i*2)(2i + 2 - 2). -2i4 Expand -1 + a3 + 1 + (a*2 - 2a + 2a + (7 - 3 - 3)(-2 - 3a2 + 2))(a - 2a + 0a). 3a3 Expand -p4 - 5p*4 + 4p4 + (3 - 3 + p2)(9p*2 + 18 - 18). 7p*4 Expand (2p - 4p + p)(p + 0p - 3p)(12 - 19p - 3 - 8). -38p3 + 2p*2 Expand (-19 - 2k + 19)(-1 + 2k + 1) - 5k2 + k2 + 5k*2 + (k + 1 - 1)(1 - 1 + 2k) + 2k2 - 2 + 2. k2 Expand (4 - 5 + 4)(0 - 3 + 1)(4l - 4l + l). -6l Expand (-6w + 15w + 20 - 11w)(-3 + 2w + 3). -4w2 + 40w Expand (2p2 - 2p*3 - 2p*2)(-5p + 3p + 4p) + 127p*4 + 2506p - 2506p. 123p*4 Expand 7z - 4z + 0z - 3z + 0z + 5z + (-2z - z + z)(-1 - 2 + 2) + 5z - z - z. 10z Expand (6s*3 - 4s3 - s3)(4s - 4s - s) + 2 + s4 - 2 + 0s*4 - 3s*4 + 0s*4 + (-3s2 - s2 + 5s2)(-4s + s2 + 4s). -2s4 Expand -2o*5 + 3o*5 - 2o5 - o5 + 2o5 - 3o*5 + (2o4 + o4 - 5o4)(-o - 2o + 5o) + (0o3 + 0o*3 + 2o*3)(-2 + 2 - o*2). -9o*5 Expand (0n + 0n - n + 2 - n - 2 + (3n - 2n - 3n)(6 - 1 - 3) - 3 + 3 - 2n + n - 2n - n)(-2 - n + 2). 10n2 Expand 0x + 0x - x + (-1 + 2 + 0)(0x - x - x) - 5x + 3x + 6x + x - 2x - x - 3x + 3x + 2x. x Expand (-28 - j + 12 + 3j)(j4 - j4 - 2j*4). -	{ "pile_set_name": "DM Mathematics" }
84) + 2)5 + 0))2. 9600sqrt(19) + 275200 Simplify (sqrt(60)-12)/(sqrt(132)/sqrt(176)) + (sqrt(5445)1 + sqrt(45) + sqrt(45))/(sqrt(1089) + sqrt(1089)-2 - sqrt(1089)). -189sqrt(5)/22 Simplify (-1sqrt(352)2)/((sqrt(6) + (sqrt(90)/sqrt(3))/sqrt(5))/sqrt(3)). -4sqrt(11) Simplify (((sqrt(44)/sqrt(4) - sqrt(11)) + sqrt(11))1 - (sqrt(11) + 2 + -5)) + (sqrt(99)-212)*2. 1587 Simplify ((3sqrt(112)-2)/sqrt(2))/(2sqrt(392)5). -3sqrt(7)/35 Simplify ((1sqrt(100))/sqrt(4))/((-2sqrt(30))/sqrt(6) + sqrt(5)). -sqrt(5) Simplify (sqrt(204) + (sqrt(204) + (sqrt(204)-5 - sqrt(204)) + sqrt(204) + sqrt(204) + sqrt(204))6)/(-2sqrt(72)/sqrt(6)) + 0 + 4. 4 + 11sqrt(17)/2 Simplify (3(sqrt(320) + (sqrt(320) - (sqrt(320) - 1sqrt(320)-2)) + -2 - (sqrt(320) + (1 + sqrt(320))-3)-6))2. 37440sqrt(5) + 490320 Simplify ((sqrt(408)/(sqrt(8)-1)-6)/(sqrt(6)/(sqrt(8)/sqrt(4)) - ((sqrt(12) + sqrt(3))6 + sqrt(3))))2. 17/9 Simplify 3(sqrt(55)/((sqrt(44) - sqrt(44)-2)/sqrt(4)) + (2 + sqrt(405) - sqrt(405))2 + -2). sqrt(5) + 6 Simplify 2 + (sqrt(110)/(-3sqrt(10)) - sqrt(11)) + (1 + (sqrt(11) - 1sqrt(11)6))*2. -34sqrt(11)/3 + 278 Simplify (-2 + -2 + sqrt(128) - (sqrt(2) + sqrt(2) + (sqrt(256) + sqrt(16))/sqrt(8) + -1))*2 + 4. -6sqrt(2) + 15 Simplify (1 + (5(sqrt(448) + 2 + sqrt(448)) - (sqrt(448) - 6sqrt(448)-1)))2. 528sqrt(7) + 4153 Simplify (sqrt(16) - (sqrt(576) + 1sqrt(576) + sqrt(576) + sqrt(576)))/(sqrt(80)/sqrt(250)). -115sqrt(2) Simplify (2 + sqrt(833) - sqrt(833)) + (sqrt(153) + sqrt(153)2 + sqrt(153))/sqrt(9) + -3 + 1-3sqrt(17). -1 + sqrt(17) Simplify (-2 + 3 + (sqrt(304) - (1 + sqrt(304) + sqrt(304)))6 + 0 + sqrt(304) + sqrt(304) + 0)*2. 160sqrt(19) + 4889 Simplify 2 + ((-1 + 2sqrt(242))-4 + -4)*2. 15490 Simplify (sqrt(88)-3-3)/(sqrt(968)-2). -9sqrt(11)/22 Simplify 1(-2sqrt(2268)-5)*21. 226800 Simplify ((sqrt(96)/sqrt(100))/(sqrt(300)1)5)*2. 2/25 Simplify 4 + (3(3sqrt(12) + 1))2. 108sqrt(3) + 985 Simplify ((sqrt(55)/(2sqrt(11)) - (sqrt(5) + sqrt(20)/sqrt(4))-3) + -1(sqrt(245) - (sqrt(245) + 0) - sqrt(245))2)-5. -65sqrt(5)/2 + 1225 Simplify ((1 + sqrt(128))4 - (sqrt(128) + (sqrt(128) + 1)*2 + -5 + sqrt(128) + sqrt(128) - sqrt(128)))4. -480 Simplify sqrt(19)-2 + 3 + -6sqrt(57)/sqrt(3) - ((sqrt(76) + 1)2 + ((sqrt(19) - sqrt(76)) + sqrt(19))2 + -1). -73 - 12sqrt(19) Simplify (sqrt(19) + (4sqrt(684))*2 - (-3 + sqrt(19))-4)2 + 5. 10sqrt(19) + 21869 Simplify sqrt(19) - (((sqrt(152)-1 - sqrt(152)) + sqrt(152))/sqrt(8))2 - (5 + sqrt(19) + 0) - sqrt(152)/(sqrt(48)/(sqrt(6)-1)). -24 + sqrt(19) Simplify -2((sqrt(68) - (3 + sqrt(68)-1))*2 + (sqrt(68) - (sqrt(68) - (4(sqrt(68) + 1))*2)))2. -5540 - 160sqrt(17) Simplify ((sqrt(66) - 21sqrt(66) - sqrt(66) - -1(sqrt(66)1 + sqrt(66)))/(-3(sqrt(6) - sqrt(6)-2)-3))*2. 0 Simplify 1(sqrt(3) + -1 + 5 - 4-2sqrt(3) - (3 + sqrt(147) + -1)*2). -147 - 19sqrt(3) Simplify 5 + (5 + (sqrt(684)-2 + 5 - (sqrt(684) - (sqrt(684) + -1)5)))*2 + 3. 120sqrt(19) + 2769 Simplify -4(sqrt(7) + -1 + sqrt(7))22 - 6((sqrt(7) - ((sqrt(7) - -3sqrt(7)) + sqrt(7))) + -4 - sqrt(7)). -208 + 62sqrt(7) Simplify (sqrt(1200) + (sqrt(1200) + (sqrt(1200) - (2sqrt(1200) + sqrt(1200))))-3)/(6(sqrt(24) + (-1sqrt(24) - sqrt(24)))). -10sqrt(2)/3 Simplify (-5-4sqrt(24))/(sqrt(1152)1). 5sqrt(3)/3 Simplify 1((2(0 + sqrt(208)) + sqrt(208) + sqrt(208))5 - (4(1 + sqrt(208)) + sqrt(208) + 4(-1 + sqrt(208))))2. 25168 Simplify (sqrt(700) + 0 - sqrt(700)) + 2 + sqrt(700)-2-4 + 1(6(sqrt(700) + (sqrt(700)2)*2) + sqrt(700)). 150sqrt(7) + 16802 Simplify (sqrt(110) + -5(sqrt(110) + sqrt(110)-3))/(sqrt(810)3). 11sqrt(11)/27 Simplify ((-2sqrt(325)2 - sqrt(325)) + 4 - (5(sqrt(325) + sqrt(325)-1) + sqrt(325) + 4))*2. 11700 Simplify ((sqrt(2816) + sqrt(2816) + sqrt(2816) + 0)-5 - sqrt(2816) - -2(sqrt(2816) + -2))2. 1792sqrt(11) + 551952 Simplify (((1 + -1 + sqrt(704))2 - (-4 + 2 + sqrt(704))2) + -4)-13. -96sqrt(11) + 24 Simplify 2(3sqrt(1300) + -2)2-2 + -1. -46817 + 480sqrt(13) Simplify (6(4 + -1 + sqrt(7) + (0 + sqrt(7) - sqrt(7))) + 4)*2. 264sqrt(7) + 736 Simplify -2 + (sqrt(80) - sqrt(80)-2)/(sqrt(16)/sqrt(4)5). -2 + 6sqrt(5)/5 Simplify sqrt(1088)-1 - (sqrt(17) + sqrt(17) + 1 + -4)*2 - ((sqrt(153) - sqrt(153)-35)/sqrt(9))2. -4429 + 4sqrt(17) Simplify (2sqrt(228)2)/(sqrt(72)/(sqrt(24) + sqrt(6))). 12sqrt(19) Simplify (1sqrt(192)5 + sqrt(192) + -1 + -3)2. -384sqrt(3) + 6928 Simplify (((sqrt(480)/(sqrt(40) + sqrt(10)))/sqrt(3))/(-2(sqrt(1152)-2 + sqrt(1152))))*2. 1/2592 Simplify (2(sqrt(136) + -3sqrt(136)))/(sqrt(96)/sqrt(108))4. -48sqrt(17) Simplify 2 + sqrt(162) + (sqrt(1152))2 + (sqrt(256)4 + sqrt(16))/(sqrt(32)2). 53sqrt(2)/4 + 1154 Simplify sqrt(45) - (0 + (sqrt(45) - (1sqrt(45))2 - sqrt(45))) - ((sqrt(5) - (5 + (sqrt(5) - (2 + sqrt(5)))2)) + -2). 2sqrt(5) + 56 Simplify 4 + (sqrt(1539)3-5 + sqrt(1539) + 3sqrt(1539)5)2. 4 + 18sqrt(19) Simplify 4 + sqrt(44)/sqrt(4)-5 - ((sqrt(11) + (12sqrt(11) - sqrt(11)) - sqrt(11))2 + 0). -5sqrt(11) - 7 Simplify (((sqrt(2057) - sqrt(2057)-2)-4 - (5 + 3sqrt(2057))) + -3 + 1)2. 2310sqrt(17) + 462874 Simplify ((-3-1sqrt(363)1)2 + 2)1. 3269 Simplify (0 + -6(sqrt(1100) + sqrt(1100) + 1)1 + 4)*2-1. -158404 - 480sqrt(11) Simplify (0 + (-2(sqrt(1539) + 0) + 1(sqrt(1539) + -1))-5)*2. 450sqrt(19) + 38500 Simplify (1(sqrt(320) + 2))2 + (-23sqrt(320))2. 32sqrt(5) + 11844 Simplify -4 + (sqrt(252) + 4(-1 + sqrt(252)) + sqrt(252) + ((1 + sqrt(252) - sqrt(252)) + 1 - sqrt(252)))2. -120sqrt(7) + 6300 Simplify (4(1 + -2sqrt(637)) + 3 + 6-3sqrt(637))*2. -2548sqrt(13) + 430661 Simplify (5(sqrt(567) - (sqrt(567) + -2)))2 + 4 + -5((sqrt(567) + (sqrt(567) - sqrt(567)1))-1 + sqrt(567)). 104 Simplify (sqrt(135)/sqrt(5) + sqrt(27))/sqrt(9)-3 - (sqrt(48)/sqrt(2))/sqrt(8)3. -9sqrt(3) Simplify 4 + (1((-5sqrt(104))/sqrt(8) - sqrt(13)) + -2)2. 24sqrt(13) + 476 Simplify 2 + -3 + (-1 + sqrt(1100) + 3)*2 + 5. 40sqrt(11) + 1108 Simplify (-1(sqrt(160) - sqrt(160)3))/((sqrt(440)/sqrt(8))/sqrt(11)). 8sqrt(2) Simplify -1 + (2sqrt(140))/(sqrt(405) - sqrt(5)). -1 + sqrt(7)/2 Simplify ((3 + -4(3(1 + sqrt(1331)) + sqrt(1331)) + 2)-3)2. 22176sqrt(11) + 3067065 Simplify (-1sqrt(13)-4 + sqrt(117)2)4 + 2 + sqrt(637) + sqrt(637) + (sqrt(637) - (0 + sqrt(637) + -1)). 3 + 54sqrt(13) Simplify (sqrt(847) - (sqrt(847) - (1 + sqrt(847) + sqrt(847))) - sqrt(35)/(sqrt(10)/sqrt(2)) - (-1 + sqrt(70)/sqrt(40)))2. 82sqrt(7) + 11783/4 Simplify (1(sqrt(77) - (sqrt(77) - 32sqrt(77))))/(sqrt(121)/((sqrt(66) + 2sqrt(66) - sqrt(66))/sqrt(6)))-5. -60sqrt(7) Simplify ((-1sqrt(1701) + sqrt(1701))-6)/(sqrt(12)-1-2). 0 Simplify 2 + -1((sqrt(252)-3)*2 + -3). -2263 Simplify (1(-1 + sqrt(7)) - (sqrt(84)/sqrt(2))/sqrt(6))*2 + -2 + sqrt(70)/sqrt(90). -1 + sqrt(7)/3 Simplify (sqrt(96)/(sqrt(768)/sqrt(4)))/(-62sqrt(100)). -sqrt(2)/240 Simplify -1 + (sqrt(84) - 1sqrt(84)4)/sqrt(12) - ((sqrt(7) - (sqrt(7) - (sqrt(28)/sqrt(4) + 2)) - sqrt(7))2 + 6sqrt(63)). -21sqrt(7) - 5 Simplify (4 + -1 + (sqrt(320) + (sqrt(320) - (sqrt(320) + 0 + sqrt(320))))2)-31. -9 Simplify (3(-1(3 + sqrt(33)/sqrt(3)) + 1 + sqrt(11) + 4 + sqrt(11)-3))*2. -108sqrt(11) + 927 Simplify (2 + 4 + 0 + sqrt(304) + -4)*22. 32sqrt(19) + 616 Simplify (4 + (sqrt(75) - -2(sqrt(75) + 0)) + 5 + -2sqrt(75) + 0)2. 90sqrt(3) + 156 Simplify 4(4(sqrt(45) - (sqrt(45) + 1)) + sqrt(315)/(sqrt(7) - (sqrt(28)/sqrt(4) - sqrt(7))) + 2)*2. -48sqrt(5) + 196 Simplify -3(1 + ((1 + sqrt(180) - sqrt(180)) + sqrt(180))2). -546 - 36sqrt(5) Simplify ((5 + 0 + sqrt(475) + sqrt(475) + sqrt(475) + sqrt(475) - 5(sqrt(475)-4 - sqrt(475)))-4)2 + -5. 23200sqrt(19) + 6391995 Simplify ((sqrt(90)/sqrt(3)5 + (sqrt(480) + sqrt(30))5)/(sqrt(10) - 31sqrt(10) - -4sqrt(10)-2))*2. 27 Simplify (sqrt(152) + (sqrt(152) - 2sqrt(152)2) - (sqrt(152) + (sqrt(152) - (sqrt(152) - -2sqrt(152))5)))/(sqrt(72)/sqrt(144) + sqrt(80)/sqrt(40)). 44sqrt(19)/3 Simplify (-6(sqrt(78) + (sqrt(78) - (6sqrt(78)*-1 + sqrt(78))) + sqrt(78) + sqrt(78)))/(sqrt(72)/(sqrt(132)/(sq	{ "pile_set_name": "DM Mathematics" }
+ 868. Let y be z(4). Solve 4c = 3c + 3s - 2, 0 = 3c - ys + 6 for c. -2 Suppose -3f + 3 = 5d - 6, 12 = 4f + 4d. Suppose -5j = -fp - 6, -8p + 15 = -3p. Let m be (3/2)/(2/4). Solve -mk = -3, -k - 17 = jr - 3 for r. -5 Suppose 104r = 102r + 2d - 12, 3r + 3d - 18 = 0. Solve -w + 7 = -2f, r = 2f - 36w + 39w - 13 for f. -1 Let u(a) = -97a + 51a + 52a - 26. Let h be u(5). Solve -hv + 8 = -2f, 0 = -2f - 4v - v + 1 for f. -2 Let n be ((-50)/5 + 6)/(0 + 1). Let k be n/(-6)(-21)/(-7). Solve -5p = i + 20, -ki - 6p = -p + 20 for i. 0 Suppose -3i + 136 = -f - 0i, 3f - 3i = -426. Let d = -141 - f. Solve 2v - dv + 8 = 4h, -2h + 3v = 12 for h. 0 Let j(m) = m*2 - 3m + 4. Let p be j(-3). Let i = -48 + 56. Let g = i + -3. Solve 2k = -5s + p, gs - 4k - 15 = k for s. 4 Suppose -4o + 18 = -2. Suppose -2v = u + v - 12, -ou + 5v = 0. Let x = -960 + 963. Solve 0 = 3s + h - x, 8 = s - 5h + uh for s. 2 Let p be (6 + 15/(-3))/(-1 - 60/(-54)). Solve 3q + 15 = 3t, 4q + 5 + p = 2t for t. 3 Let w be 16/6 - (-6)/(-9). Suppose 0 = -5t - 5z - 495, -2z + 458 - 68 = -4t. Let h = -94 - t. Solve -3n = -hn - 5k + w, 3n + 7 = -2k for n. -3 Let k be 296/40 + (-27)/(-45). Solve r + 3d = -9, 6r - d = kr + 3 for r. 0 Let c be (91/(-7) + 14)17. Solve ci + 2 = 19i + 4f, i - 4f = -17 for i. -5 Let u = -463 - -467. Solve h - 1 = 0, n - 10 = -uh - 7 for n. -1 Suppose 25y - 370 = 18y - 30y. Solve -r = -2c - 13, 4r - c = -y + 34 for r. 5 Suppose 0 = 22v + 49v - 355. Solve -3d = 4m - 8, -6d + vd - 2m + 2 = 0 for d. 4 Suppose -110 = 2m - 21h + 20h, -4m + 4h = 216. Let u be (-5 - 34/(-4))/(m/(-32)). Solve ui - 4i = -j + 10, 5i = -15 for j. 4 Let b be 1(14 + -6 - 1 - 73). Suppose 385 - 113 = 4o. Let z = b + o. Solve -30 = 4q - 7a + za, -3q = -a + 17 for q. -5 Let j be (-4)/3 + 392/294. Solve 3f + 12 = 3l, j = 2f - 3f - 2 for l. 2 Let h = -11127 + 11127. Solve -3p - 12 = h, -3p - 6 - 6 = -2t for t. 0 Let i = -2 + 3. Let t(v) = -5v2 - 103v - 513. Let c be t(-12). Solve f = -cg - i, f + f - 3 = -g for g. -1 Let w(f) = f3 + 34f*2 - 120f - 329. Let u be w(-37). Solve -t = -5g + 17, -3t - 28 = ug - 34 for t. -2 Let j(h) = -11h + 6h + 6h + 18. Let y be j(-16). Let t(b) = -b*2 - 5b + 12. Let f be t(-6). Solve -2c - 8 = -yn, 2n - fn = 3c - 16 for c. 0 Let n(q) = -7q3 - q2 + q - 5. Let y be n(3). Let o = y + 202. Solve -3j + 4t = oj + 2, 5t = 2j + 11 for j. 2 Suppose 3u - 377 - 151 = 0. Suppose 2g - 4v - u = 0, g - 30 = -v + 70. Suppose 99y - gy = 0. Solve y = 5m - 4z - 13, 3z + 16 = 5m - 0z for m. 5 Let t(c) = -c2 - 4c - 50 + 28c + 8 + 7 - 45. Let x be t(20). Solve -5s - 5j - 15 = 0, -4j - 15 = 5s - xs for s. -3 Suppose 4d + 48 = -5k, 5k + 5d = -19 - 26. Let r be (8/4)/(-4)k. Solve 4i = 3w - rw + 13, i - 1 = -3w for i. 4 Let x be 4/(-10) - (-64)/10. Suppose 0 = 11y - 7y - 108. Let m be (-1)/(9/y3/(-2)). Solve -f - 3f + x = mh, -5f - 3h = -10 for f. -1 Let y(n) = -n*2 + 53n - 424. Let p be y(43). Solve f - 17 = -4o, 1 = 2o + f - p for o. 5 Suppose k + 9 = q, 2k - q = 4q - 33. Let h be (-13 - 11)1/k. Solve -3 - h = -5w - p, 0 = -5w + 2p + 12 for w. 2 Let o = 11 - 8. Suppose -q - q = -4n + 8, -22 = -5q - 4n. Solve qg = -2g - 3z - 27, 0 = og - 3z - 6 for g. -3 Suppose -113p + 59p + 10 = -52p. Solve -5n + 0 = -5w - 5, -2n = -pw - 14 for n. -3 Let b be (-10 + 11 - 31)/((-2)/(-8) + -1). Solve -45 = -5x + 4y, -10y = -5x - 7y + b for x. 5 Let j(o) = -3o2 + 19o - 3. Let f be j(6). Let l be f3 - ((-162)/9)/(-6). Solve y = -2u - y - 2, -l = -2u - 4y for u. -5 Let h(q) = -25q2 - 292q - 184. Let u be h(-11). Let z(t) = -t*2 - 6t - 4. Let x be z(-3). Solve -2a + a = -uf - x, 0 = 3a + 3 for f. -2 Let w(a) = -306a*2 + 3364a + 24. Let j be w(11). Solve 2s + 4p = -38, 5p + 49 - 4 = -js for s. -5 Let o(d) = 81d + 1220. Let z be o(-15). Solve m = 2a + 3 - 7, a - zm - 20 = 0 for a. 0 Let s(k) = -2k*2 - 51k + 905. Let t be s(12). Let a(d) = d + 1. Let y be a(1). Solve 15 = tq + 5x, -yq + x + 7 = -2 for q. 4 Let k be 2 - 7 - (15 + -27). Suppose 0 = -kl - 22l + 174. Solve -j + 5y = 4j, 5y + l = 2j for j. -2 Let d(h) = -122h - 730. Let a be d(-6). Let j(u) = 26u. Let v be j(1). Solve 0 = 5s + am - v, -2s + 14 = 2m for s. 4 Let q be (196/(-8))/((-3 - 3)/12). Let l(y) = y3 - 50y*2 + 48y + 51. Let b be l(q). Solve -x - 2 = 5w + b, -2 = -5x - 3w for x. 1 Suppose -7 + 47 = 5r. Suppose -m = -r + 23. Let o = 20 + m. Solve -f + 6 = j, o = -2j - 3j + 2f for j. 1 Suppose 2i = -4n - 13 + 113, -3i = 12. Suppose -3k = 2v + 3v - 34, 4k = -3v + n. Solve -kw + t = -2t + 3, -3t = -4w + 1 for w. 4 Suppose -y + 7 = -x + 3y, 0 = -4x + 3y - 15. Let h be (x + (-15)/(-10))/(3/236). Let g = 123 + h. Solve 2n + 0f = 3f - 12, -f = gn - 4 for n. 0 Suppose 8i + 800 = 2200. Let a = i - 171. Solve b + 8 = -4d, 2d + 6 = ab + 2 for b. 0 Let z = -2 - -8. Suppose 2q - zq = -48. Suppose w = 3w - q. Solve -wt - 4p + 8 = -2t, -3t + 11 = 4p for t. -3 Suppose -2l = -6, 0 = -18p + 19p - l. Suppose -29 = 5y + 16. Let d be (-2)/py/61. Solve n + 4k = -16, -d = -3n + 4k + 31 for n. 4 Suppose -10y + 5040 = 30y. Suppose 13h - 56 = y. Solve 5q = -2p + 3p - h, 0 = -5p + 3q + 26 for p. 4 Let s(g) = -13g + 81. Let c be s(5). Suppose -302p = -310p + c. Solve 4m = -8u + 3u - 32, 2u + p = 2m for m. -3 Suppose 2j - 6 = -2r, j = 5r + 20 - 5. Solve 4x + 4z = -16, -x + jx = -z - 19 for x. -5 Let l(h) = 2h*3 + 35h*2 + 10h - 78. Let v be l(-17). Solve -23 = -5q + 2g, 5q + 4g + 12 = v for q. 5 Suppose -45 = -24c - 1 + 52. Solve -2f + 5y - 9 = 0, 2y = cf + y - 9 for f. 3 Suppose -2w - 12 = -2q, 4q = 3w + 366 - 342. Let o = 9 + -6. Solve -2u - 4l = 18, wu - ol - 13 = u for u. -1 Suppose -3w + 0a - 3a + 18 = 0, 3w + a = 12. Suppose -k + 25 = -4x, 0 = 4k - 5x - 29 - 16. Solve -kj = wu - 4j - 2, u = -3j - 10 for u. 2 Let j = 387 - 324. Let u = j + -34. Solve 3g = 4c + 1, -6g = -g + c + u for g. -5 Let n = 418 - 322. Let d be n/21 + (-5)/((-105)/(-12)). Solve 0 = g - c, dg + 24 = -5c + c for g. -3 Let d = 16 + -62. Let c(f) = -f3 - 6f*2 + 7f - 8. Let x be c(-6). Let j = d - x. Solve -q + 3 + 6 = -jm, -9 = 3m for q. -3 Let j = 491 + -272. Let v = 224 - j. Solve 5s + 10 = a, 16 + 4 = -vs + 3a for s. -1 Let w(j) = -12j*2 + 5j + 9. Let f be w(1). Solve -10h = -12h + fd - 8, h + 8 = 2d for h. 0 Suppose -19r + 322 - 227 = 0. Solve 3o - 5f - 8 = 0, -f - 31 = ro - 35 for o. 1 Suppose 6h - 16 = 14. Let u be 2 - h - 24/(-4). Suppose -2w - m - u = 0, 3m + 0m = -5w - 9. Solve 0a - 2s = -3a - 17, -a + 4s - 9 = w for a. -5 Suppose -2b + 5n = -70, -76b = -77b + 2n + 36. Solve 2h + 2p + 4 = 0, -14 = 5h + 43p - bp for h. -4 Suppose 5l - 35 = 2v + 30, -4l + 2v + 50 = 0. Let r be (-1)/(l/18(-15)/50). Solve -3u = t + 4, 3 = -2t - 3u + r for t. 5 Let q = 18249 + -18236. Solve 0 = -l - 3, -2t - 10l + ql = -9 for t. 0 Let m be 18/12 - (-57)/(-38). Suppose -z + 2l + 30 = 0, -4z + l = -39 - 67. Solve m = -0x - x + q - 1, 2x + 5q = z for x. 3 Let y(r) = -64r - 22 + 25r + 20r + 24r. Let w be y(16). Let u = 58 - w. Solve 2n + 4x = u, 0x - 6 = -4n - 5x for n. 4 Suppose -212u - 905 = -207u. Let c = u - -184. Solve 0 = -5z - 3y, cz = -0z + y + 14 for z. 3 Suppose -715 + 1439 = 15w + 709. Solve w = 3r + 5l, -50 + 44 = -5r - 4l for r. 2 Suppose 1 = -n - 3z, -36z + 41z + 1 = -2n. Solve p - 49a + 44a + 22 = 0, -11 = -np - a for p. 3 Suppose 5f = 5y + 5, -878 + 870 = -4f. Solve m = 3u + y, -44m + 46m + 6 = 2u for u. -2 Suppose -p + 22 = -9g + 5g, 0 = g - 3. Let k = p + -30. Solve -k = -2m - s, 0m - 4m = -2s - 16 for m. 3 Let w(c) = 14c - 51. Let q(h) = -h*2 + 15h - 22. Let n be q(13). Let t be w(n). Solve 5f - 9 = x, -4f + f = -tx - 23 for f. 1 Let w = 967 - 964. Let t = -3 + 5. Suppose -44 = -2j - h + wh, th - 19 = -j. Solve -z + 4s - j = 0, -5s - 8 + 31 = 2z for z. -1 Suppose y - 5y = -20. Let q = 7041 - 7041. Solve 3t = t - 4, q = -3f + y*t + 7 for f. -1 L	{ "pile_set_name": "DM Mathematics" }
349 What is the f'th term of 554, 997, 1440, 1883, 2326? 443f + 111 What is the q'th term of -697696, -697695, -697694, -697693, -697692, -697691? q - 697697 What is the h'th term of 389, -194, -777? -583h + 972 What is the g'th term of -13058, -13508, -13958, -14408? -450g - 12608 What is the q'th term of -628, -1267, -1906, -2545, -3184, -3823? -639q + 11 What is the m'th term of 321591, 321589, 321587, 321585, 321583? -2m + 321593 What is the h'th term of -25, -430, -835, -1240? -405h + 380 What is the o'th term of -141, -135, -137, -153, -189, -251, -345, -477? -o*3 + 2o*2 + 7o - 149 What is the o'th term of 42, 284, 936, 2202, 4286, 7392, 11724, 17486? 34o3 + o2 + o + 6 What is the k'th term of -963, -947, -919, -879? 6k*2 - 2k - 967 What is the l'th term of -155948, -311902, -467856, -623810, -779764? -155954l + 6 What is the v'th term of -358, -471, -664, -943, -1314, -1783, -2356? -v3 - 34v*2 - 4v - 319 What is the x'th term of -166, -332, -496, -658? x*2 - 169x + 2 What is the v'th term of 28083, 56121, 84159, 112197, 140235? 28038v + 45 What is the g'th term of -11879, -11868, -11849, -11822, -11787, -11744? 4g*2 - g - 11882 What is the l'th term of 45, 50, 1, -102, -259, -470, -735? -27l*2 + 86l - 14 What is the w'th term of 18252, 18237, 18220, 18201, 18180? -w*2 - 12w + 18265 What is the b'th term of -97432, -194851, -292254, -389641, -487012? 8b2 - 97443b + 3 What is the a'th term of -604, -1080, -1556, -2032, -2508, -2984? -476a - 128 What is the d'th term of 11152, 11114, 11076? -38d + 11190 What is the o'th term of 3777, 7480, 11183, 14886? 3703o + 74 What is the p'th term of -504, -516, -562, -660, -828, -1084, -1446, -1932? -3p3 + p2 + 6p - 508 What is the y'th term of 20735, 82957, 186661, 331847, 518515, 746665, 1016297? 20741y2 - y - 5 What is the p'th term of -734, -718, -710, -716, -742, -794, -878? -p3 + 2p2 + 17p - 752 What is the c'th term of 260, 502, 730, 938, 1120, 1270, 1382, 1450? -c3 - c2 + 252c + 10 What is the q'th term of -45050, -90084, -135118, -180152? -45034q - 16 What is the q'th term of -311, -212, -111, -8, 97? q*2 + 96q - 408 What is the h'th term of 363, 3172, 10771, 25554, 49915, 86248? 399h3 + h2 + 13h - 50 What is the a'th term of -563, -1152, -1755, -2366, -2979? a*3 - 13a*2 - 557a + 6 What is the a'th term of 9947918, 9947919, 9947920? a + 9947917 What is the c'th term of -2451, -2448, -2445, -2442, -2439, -2436? 3c - 2454 What is the z'th term of -8681, -17364, -26047, -34730, -43413? -8683z + 2 What is the z'th term of 2, 95, 200, 293, 350, 347, 260, 65? -4z3 + 30z*2 + 31z - 55 What is the h'th term of -2654, -2624, -2574, -2504, -2414, -2304? 10h2 - 2664 What is the t'th term of -30, -79, -126, -153, -142, -75, 66? 3t*3 - 17t*2 - 19t + 3 What is the q'th term of -639, -1314, -1989, -2664? -675q + 36 What is the y'th term of -8460833, -8460832, -8460831? y - 8460834 What is the g'th term of -2180, -8668, -19482, -34622? -2163g*2 + g - 18 What is the k'th term of 1764, 1917, 2172, 2529, 2988? 51k*2 + 1713 What is the y'th term of 1511, 6054, 13625, 24224, 37851? 1514y*2 + y - 4 What is the m'th term of -45, -157, -331, -567? -31m*2 - 19m + 5 What is the p'th term of 141, 161, 197, 255, 341? p*3 + 2p*2 + 7p + 131 What is the a'th term of -4097, -16350, -36785, -65414, -102249, -147302, -200585, -262110? -2a3 - 4079a*2 - 2a - 14 What is the d'th term of 111867, 111866, 111865, 111864, 111863? -d + 111868 What is the c'th term of -606, -1082, -1544, -1986, -2402? c3 + c2 - 486c - 122 What is the g'th term of -61, -279, -665, -1237, -2013, -3011? -3g*3 - 66g*2 + g + 7 What is the j'th term of -449, -1915, -4521, -8399, -13681, -20499, -28985, -39271? -22j*3 - 438j*2 + 2j + 9 What is the i'th term of 59613, 119238, 178865, 238494? i*2 + 59622i - 10 What is the p'th term of 426, 1899, 4360, 7815, 12270, 17731? p*3 + 488p*2 + 2p - 65 What is the c'th term of 1459, 1304, 1149, 994, 839, 684? -155c + 1614 What is the j'th term of -26691, -26683, -26675, -26667? 8j - 26699 What is the u'th term of 18209, 36412, 54615? 18203u + 6 What is the z'th term of -49740, -49731, -49722, -49713, -49704, -49695? 9z - 49749 What is the o'th term of 37193, 148779, 334761, 595145, 929937, 1339143? o*3 + 37192o*2 + 3o - 3 What is the p'th term of -26, -139, -252? -113p + 87 What is the r'th term of -9952, -19904, -29856? -9952r What is the q'th term of 33, 152, 365, 672, 1073, 1568, 2157? 47q2 - 22q + 8 What is the l'th term of -163859, -327726, -491593, -655460, -819327, -983194? -163867l + 8 What is the o'th term of -25680, -25715, -25772, -25851, -25952, -26075, -26220? -11o*2 - 2o - 25667 What is the t'th term of -460, -540, -622, -706, -792, -880, -970? -t*2 - 77t - 382 What is the w'th term of -275, -258, -155, 76, 477, 1090? 7w3 + w2 - 35w - 248 What is the i'th term of -6033, -24085, -54173, -96297, -150457, -216653? -6018i2 + 2i - 17 What is the r'th term of -1970, -1974, -1984, -1994, -1998, -1990, -1964, -1914? r*3 - 9r*2 + 16r - 1978 What is the i'th term of -4855, -9738, -14675, -19690, -24807? -4i3 - 3i*2 - 4846i - 2 What is the m'th term of -104620, -104600, -104580, -104560? 20m - 104640 What is the b'th term of 23, 112, 267, 482, 751? -b3 + 39b*2 - 21b + 6 What is the q'th term of -631, -657, -683, -709, -735? -26q - 605 What is the u'th term of 106, 81, 14, -119, -342? -4u*3 + 3u*2 - 6u + 113 What is the r'th term of 63315, 63316, 63317, 63318, 63319? r + 63314 What is the y'th term of -96093, -192218, -288353, -384504, -480677, -576878, -673113, -769388? -y3 + y2 - 96121y + 28 What is the s'th term of 27, 514, 1905, 4674, 9295? 79s*3 - 22s*2 - 30 What is the r'th term of -62, -69, -2, 169, 474? 5r*3 + 7r*2 - 63r - 11 What is the w'th term of -73, -397, -1237, -2851, -5497? -43w3 - 23w - 7 What is the m'th term of -792, -831, -870, -909, -948, -987? -39m - 753 What is the i'th term of 941, 1706, 2471, 3236, 4001, 4766? 765i + 176 What is the h'th term of 162, 183, 200, 219, 246, 287? h*3 - 8h*2 + 38h + 131 What is the q'th term of -2013, -1967, -1897, -1791, -1637? 2q3 + 32q - 2047 What is the z'th term of 2387353, 2387349, 2387343, 2387335, 2387325, 2387313? -z2 - z + 2387355 What is the b'th term of -1331, -1402, -1471, -1538, -1603, -1666? b2 - 74b - 1258 What is the w'th term of 9386, 9362, 9324, 9272? -7w*2 - 3w + 9396 What is the v'th term of -160782, -321563, -482344, -643125? -160781v - 1 What is the a'th term of 12626, 12625, 12624, 12623, 12622, 12621? -a + 12627 What is the p'th term of 151909, 151908, 151907, 151906? -p + 151910 What is the g'th term of 2297, 4551, 6799, 9041? -3g*2 + 2263g + 37 What is the x'th term of 103, 129, 153, 175, 195, 213, 229? -x*2 + 29x + 75 What is the s'th term of -11306, -90631, -305934, -725201, -1416418? -11331s3 - 3s2 + s + 27 What is the t'th term of 1438950, 1438949, 1438948, 1438947? -t + 1438951 What is the x'th term of -36, 63, 274, 591, 1008, 1519? -x3 + 62x2 - 80x - 17 What is the m'th term of -2092, -2066, -2040, -2014, -1988? 26m - 2118 What is the y'th term of 29, -8, -87, -226, -443, -756, -1183, -1742? -3y*3 - 3y*2 - 7y + 42 What is the y'th term of -1578, -3169, -4760, -6351, -7942, -9533? -1591y + 13 What is the m'th term of 8332, 33364, 75074, 133456, 208504, 300212? -m3 + 8345m*2 + 4m - 16 What is the l'th term of -383, -1656, -2903, -4112, -5271, -6368, -7391? 2l3 + l2 - 1290l + 904 What is the y'th term of 183454, 183465, 183476, 183487, 183498, 183509? 11y + 183443 What is the o'th term of 1602, 1575, 1498, 1347, 1098, 727, 210, -477? -4o3 - o2 + 4o + 1603 What is the s'th term of -18026, -36080, -54136, -72194, -90254, -108316, -126380? -s2 - 18051s + 26 What is the i'th term of -12744, -50984, -114718, -203946, -318668, -458884? -12747i2 + i + 2 What is the o'th term of 6865, 27460, 61777, 109810, 171553, 247000, 336145, 438982? -o3 + 6867o*2 + o - 2 What is the p'th term of -11528, -11513, -11488, -11453, -11408, -11353? 5p**2 - 11533 What is the z'th term of 54	{ "pile_set_name": "DM Mathematics" }
+ 6o(n). Suppose 10 = 8v - 3v. What is the remainder when v is divided by t(-5)? 0 What is the remainder when (-9 - (-4 + 6))-5 is divided by 20? 15 Suppose 3y + 4f = -10, 3f + 22 = 3y + 4. Calculate the remainder when 44/y - (2 + 0) is divided by (-2)/(-1 - (-10)/14). 6 Suppose 4f = -s - 12, s - 3s = f - 4. Let g(w) = w*3 + 6w*2 + 5w + 6. What is the remainder when 70 is divided by g(f)? 16 Let f = 21 + -2. Let x be (-1)/4 + 17/4. Suppose xr + 0r = -3s + 1, 3r + 50 = 5s. Calculate the remainder when f is divided by s. 5 Let h = 24 + 2. Let a = 11 + h. Calculate the remainder when a is divided by 10. 7 Let z = 75 + -52. Let p be (6 + -2)/(2/(-3)). Let b = p + 14. Calculate the remainder when z is divided by b. 7 Let x = 100 + -59. What is the remainder when x is divided by 11? 8 Let f(p) = p3 + 3p*2 + 3. Let b(c) = -c + 9. What is the remainder when b(4) is divided by f(-3)? 2 Let q = -10 - -10. Suppose f - 5f + 188 = q. Calculate the remainder when f is divided by 25. 22 Suppose 0 = -5q + 2j + 27, -2j = -4q - 0q + 22. Let b = -3 + q. What is the remainder when 4 is divided by b? 0 Suppose -k + 22 = 2. Calculate the remainder when 0 + 19/(-2)-4 is divided by k. 18 Let r(w) = w*2 + 5w - 15. Calculate the remainder when 102 is divided by r(4). 18 Suppose 4l + 3 = -i, l - i = -l - 3. Let w(y) = -y3 + y2 + 10. Calculate the remainder when w(0) is divided by (-2)/((-2)/(3 - l)). 2 Suppose 2s - 4s + b = -12, -3b = -5s + 31. Suppose 4d = sd. Suppose -u + 6u - 215 = d. What is the remainder when u is divided by 15? 13 Suppose -4d = -4, 5c - 3d + 125 = 2d. Suppose -o + 6 = -5. Calculate the remainder when c/10(-40)/3 is divided by o. 10 Let t = -12 + 65. Calculate the remainder when t is divided by 19. 15 Suppose h + 3 = 13. Suppose -f = -4f + 4k + 65, -5f - 4k = -151. Calculate the remainder when f is divided by h. 7 Suppose -5n - 15 = -10n. Suppose -no + 1 = -0o - a, 0 = -5o - 5a + 35. Suppose -oz = -35 - 11. Calculate the remainder when z is divided by 6. 5 Let x(w) = w*3 - 2w*2 - 4. Let v be (1-1)/((-3)/(-9)). Let o = v - -13. What is the remainder when x(4) is divided by o? 8 Let u = -26 - -55. Calculate the remainder when 113 is divided by u. 26 Let n(q) = 49q3 + q2. Calculate the remainder when n(1) is divided by 9. 5 Let a(u) = 34u*2 - 27u*2 + 7 - u + 0u - u*3. Calculate the remainder when a(6) is divided by 10. 7 Suppose -16a = -6a - 980. What is the remainder when a is divided by -1(-50)/21? 23 Let j(a) = 10a*3 + 2a*2 - 1. Let p be 3/(-6)(1 + -1). Suppose 5u - 3i - 5 = p, 0i - 3i = 0. Calculate the remainder when 31 is divided by j(u). 9 Let x(g) = -g*2 + 14g. Let k be x(11). Suppose 5p - 2p - k = 4v, 3p - v = 42. Calculate the remainder when 29 is divided by p. 14 Suppose 2p - 7p - 60 = -5g, 2g - 4p - 32 = 0. Let a(o) = -o3 + 7o*2 + 11o - 10. What is the remainder when 53 is divided by a(g)? 11 Suppose 0 = 4i + 3d + 9, -3i + 3d + 9 = -0i. Suppose -b = -ib - 8. What is the remainder when ((-44)/(-6))/(3/9) is divided by b? 6 Let x = -98 + 140. Suppose j = 4j - x. Calculate the remainder when j is divided by 6. 2 Suppose -3r + 5h = -6, 0 = -4h - 0h. Let s = 7 - r. Suppose 4w - 40 = -3o, -2o = -o - 2w. Calculate the remainder when o is divided by s. 3 Suppose -4c - 12 = -4y, c = 5y - 3c - 13. Suppose 0 = -5g - 4 - y. Calculate the remainder when 37 - (-2 - 2g) is divided by 13. 11 Let i = -25 + 46. Let v = 29 - i. What is the remainder when 30 is divided by v? 6 Let l(j) be the second derivative of j4/12 - 5j*3/6 + 7j*2/2 + 4j. What is the remainder when 60 is divided by l(7)? 18 What is the remainder when 95 is divided by (156/(-65))/((-1)/5)? 11 Let k(c) = c + 38. Suppose 4b - 4 = 32. Let s be -1 + b/3 + -2. Calculate the remainder when k(s) is divided by 13. 12 Suppose 0 = 5j + 5w - 45 - 255, -2w = -2j + 112. Let r = j - 18. What is the remainder when r is divided by 11? 7 Let o = 64 + -44. What is the remainder when (-8)/(-28) + (-257)/(-7) is divided by o? 17 Suppose 7 = 4g + 4j - 249, -4g + 251 = -j. Suppose t = -2t + g. Calculate the remainder when t is divided by 12. 9 Let n(j) = 10j - 2. Let v = 7 - 5. Suppose -117 - 195 = -6q. What is the remainder when q is divided by n(v)? 16 What is the remainder when 13 is divided by -115/(-3 + 0)? 3 Let n = 56 - 42. Let w be 4 - (-2 - -1 - -2). Suppose -k + wv - 4 = 0, v - 3 - 5 = -k. Calculate the remainder when n is divided by k. 4 Suppose -3u + 3 = -12. Let n = u + 5. What is the remainder when (0 + 0 + 29)/1 is divided by n? 9 Suppose 5t - 27 = -2z + 8, -4t = 5z - 96. What is the remainder when 39 is divided by z? 19 Let m(k) = -k*2 + 2k*2 - 7 + 4k + 0k2. Calculate the remainder when 1026/72 - (-5)/(-4) is divided by m(-6). 3 Suppose 2n - 3h = 24, -4 - 18 = -3n + h. What is the remainder when 16 is divided by n? 4 Suppose f = 91 - 47. Let w = 26 - 11. What is the remainder when f is divided by w? 14 Let q(m) = 2m - 3. Let v be q(4). Let y(t) be the second derivative of 5t*3/6 - 3t*2 - 2t. What is the remainder when 37 is divided by y(v)? 18 Let a = -6 + 0. Calculate the remainder when 47 is divided by (-78)/(-5) - a/15. 15 Calculate the remainder when 32 is divided by 4 - 3 - (-17 - 0). 14 Suppose b - 15 = -g + 2g, 2b - g - 34 = 0. Suppose -4v + 216 = -q + 3q, -2v - 2q = -106. Calculate the remainder when v is divided by b. 17 Suppose -3r = -0r. Suppose 9f - 12f + 9 = r. Calculate the remainder when 6 is divided by f. 0 Suppose -35s - 768 = -47s. What is the remainder when s is divided by 22? 20 Suppose 0 = 5m - 29 + 9. Suppose 3g + 10 = m. Calculate the remainder when ((-1)/(-3))/(g/(-12)) is divided by 2. 0 Suppose x = -1 + 20. Calculate the remainder when 32 is divided by x. 13 Let b = 40 + -17. Calculate the remainder when b is divided by 15. 8 Suppose 51 = 3a - 0a. Suppose 2n = 24 + 32. Suppose -2j - 3t - 9 = -4j, -4j = 4t - n. Calculate the remainder when a is divided by j. 5 Suppose -t + g + 6 = -2g, 34 = 2t + 5g. Suppose 0 = 3s - 4s - n + t, 0 = -4s + 5n + 39. Calculate the remainder when 17 is divided by s. 6 Suppose -2b + 1 + 3 = 0. What is the remainder when 9 - (-2)/(4/2) is divided by 4/b + (3 - -1)? 4 Let h be 4 + -2 - (3 + -3). Suppose 2a = -0l + 2l + 12, 3l + h = a. What is the remainder when a is divided by 5? 3 Let m(j) = 12j2 - 8j - 10. Let i be m(-4). Suppose 3g - 5k = i, 10g - 378 = 5g + 3k. What is the remainder when g is divided by 20? 18 Let v = -8 + 17. Calculate the remainder when 4/(-18) + 641/9 is divided by -3 - v(1 + -4). 23 Let x be 3/(9/6) - 2. Suppose 3i + 2i = x. Suppose io = 2o - 146. Calculate the remainder when o is divided by 25. 23 Suppose 3q - 17 = -2x - 0q, x - 41 = 5q. Calculate the remainder when 127 is divided by x. 15 Let x be 1/((-6)/9)-2. Suppose xy - 75 = 2q - 0q, -25 = -y + 3q. What is the remainder when y is divided by (-1)/((2/(-9))/2)? 7 Let r(x) = x2 + 5x + 3. What is the remainder when 65 is divided by r(-7)? 14 Let b = 7 - 4. Suppose -54 = -4p + p. Suppose -l + 3i = -p, l - i - 23 = bi. Calculate the remainder when 8 is divided by l. 2 Let l(s) = s2 + 5s - 18. Suppose 4 = -i - 4f + 27, 22 = 2i + 2f. What is the remainder when l(-9) is divided by i? 4 Suppose -3m = -4b + 7, -5m - b = -19 - 0. What is the remainder when (m/2)/((-3)/(-4)) is divided by 2? 0 Suppose 0 = -3g + 119 + 25. Let d = g + 19. Calculate the remainder when d is divided by 14. 11 Let f(q) = -q2 - 7q + 2. Let r be f(-7). Suppose c = -rc. Suppose -u - 2 + 15 = c. What is the remainder when 24 is divided by u? 11 Suppose -2n - 3n = t - 36, -12 = -n + t. Suppose -2u + 2x = -0u - 20, -4x = -20. What is the remainder when u is divided by n? 7 Let g be 1 + 1 - (5 + 4). Let s(y) = y3 + 7y*2 - y - 8. Let t be s(g). What is the remainder when (-2 + -1)/t + 14 is divided by 9? 8 Let g(o) = -19o + 2. Suppose 5y = 3f + 51, 4y + f = 46 + 5. Calculate the remainder when g(-1) is divided by y. 9 Let k = -14 - -19. Let d be 2(-1)/2 + 1. Suppose d = -ki + 2i + 78. What is the remainder when 50 is divided by i? 24 Suppose 4*x +	{ "pile_set_name": "DM Mathematics" }
n ascending order. -3, a, o Let p = 362.5 - 363. Sort 1/4, 0.5, p, -4. -4, p, 1/4, 0.5 Let m = 794 - 789. Sort -431, 0, m in decreasing order. m, 0, -431 Suppose 10 + 0 = -5w. Suppose -3c + 205 - 58 = 0. Suppose cx = 45x + 28. Sort 5, w, x in descending order. x, 5, w Suppose 13 = 13l - 26. Let d be 4/18 - 141/27. Put -4, l, d, -2 in decreasing order. l, -2, -4, d Suppose 0 = -0j - 2j. Suppose -2r + 4v = 3r, j = -4r - 5v + 41. Let f(y) = -y*3 + 6y*2 + y - 6. Let c be f(6). Put r, c, -5 in ascending order. -5, c, r Let j be 2/(-15) + 56/(-30). Let o(f) = -f - 12. Let t be o(-7). Put t, -1, j in descending order. -1, j, t Let o = -0.65 + 0.18. Let k = o - -0.54. Sort k, 0.2, -0.1 in ascending order. -0.1, k, 0.2 Let o = -6.197 - -1.007. Let d = o + 0.19. Put 2, d, -1/8 in increasing order. d, -1/8, 2 Suppose 3o + 2p + 5 = -5, o + 3 = -p. Put o, 21, -2, 3 in ascending order. o, -2, 3, 21 Let x be 4/(-5)10/2. Let l(i) = i*2 + 8i + 7. Let n be l(-6). Put x, n, -3 in ascending order. n, x, -3 Let h = -165 + 89. Let m = -71 - h. Put 2/11, -0.1, m, -0.5 in increasing order. -0.5, -0.1, 2/11, m Let k(u) = 2u2 + 15u - 29. Let q be k(-9). Put -6, q, -1 in ascending order. -6, q, -1 Let p = -225.02 + 221. Let d = -0.02 - p. Let t = 388 - 392. Put d, t, 3 in decreasing order. d, 3, t Let r be (-2)/3(-60)/8. Suppose -2n + a + 90 = 3n, -5a = 4n - 72. Let h be (n/(-24))/((-3)/8). Sort r, 1, h in descending order. r, h, 1 Suppose 0 = 28j - 32j + 4. Sort -1/2, -1.4, j, -5/4 in decreasing order. j, -1/2, -5/4, -1.4 Let y = -0.02 + 0.22. Let n = 0.0354 - 1.0354. Sort 0.4, n, y, -0.1 in descending order. 0.4, y, -0.1, n Let c(m) = 9m - 6 - m*3 + 0m - 8m - m2 + 7m*2. Let a be c(6). Sort -5, a, 2. -5, a, 2 Let o(g) = g - 2. Let s be o(1). Let n be 201/1341/(6/4). Sort n, 8, s. s, n, 8 Let d = 90932/2787201 + 1/18217. Let x = -7/17 - d. Let i = 0.02 - 3.02. Put x, 5, i in increasing order. i, x, 5 Suppose -2r = -r + 2r. Let o be (7 - 2)(-2)/2. Sort -1, o, r. o, -1, r Let f be (1/(-3))/((-9)/(-54)). Let j be (-68)/(-7) + f/28-4. Sort 4, 3, j, -5. -5, 3, 4, j Let w = -21 + 53. Suppose -3u + w = u. Let f = u + -11. Put f, -1, 5 in ascending order. f, -1, 5 Let z = -255 - -380. Let r = z + -127. Sort 2, -0.05, r. r, -0.05, 2 Suppose u - t + 9 = 0, 3u + 4t + 34 + 28 = 0. Let b(n) = -5n - 41. Let z be b(-8). Put z, -3, -5, u in decreasing order. z, -3, -5, u Let q be (-1 + 0 - -2)(-7 + 2). Sort q, -33, 5, 0 in descending order. 5, 0, q, -33 Suppose 0 = -2z - 5 + 21. Let k = 25 - 10. Let l(i) = 2i - 35. Let f be l(k). Put f, z, 0 in ascending order. f, 0, z Let w = -75.9 + 76. Sort 3/7, 19, w in descending order. 19, 3/7, w Let z = -55 - -52. Put -63, z, 1 in descending order. 1, z, -63 Let k(z) = -z2 - 15z - 43. Let i be k(-12). Let d be -5 + 52/12 + (-13)/3. Put 3, 0, d, i in decreasing order. 3, 0, d, i Suppose -r - 1 = -4. Put r, -157, 4/3 in descending order. r, 4/3, -157 Suppose -56 = -6k - 74. Sort 58, 0, -1, k in decreasing order. 58, 0, -1, k Let h be (-14)/((-16)/20 + 1). Let j = h + 72. Suppose 7 = 3n + 4s, 2n + 26 = -2s + 7s. Sort 3, n, j in ascending order. n, j, 3 Let j(m) = -m*3 - 6m*2 - 9m. Let y be j(-4). Suppose yv = -4 - 4. Sort 5, v, 33. v, 5, 33 Let s be 5 + (33 - (6 + -2)). Suppose -6d - s = 14. Put -3, 3, d in decreasing order. 3, -3, d Let f(s) be the first derivative of s*2/2 + 2s - 14. Let z be f(-4). Sort -1, -3/7, z in decreasing order. -3/7, -1, z Suppose -23l + 20l = -189. Let y be (-6)/(-63) - 13/l. Sort y, -4, 2/35, 0.1 in descending order. 0.1, 2/35, y, -4 Let t = -938 + 937.7. Sort 0.5, 0.2, t in increasing order. t, 0.2, 0.5 Let q be 4/((-1)/4-2). Let a = 106 + -106. Put a, 2, q in decreasing order. q, 2, a Suppose 2075s + 63 = 2096s. Let x be (2/3)/((-2)/3). Put -8, s, x in ascending order. -8, x, s Let p = 35 - 34.76. Let x = -0.24 + p. Let g be (0 + (-1)/(-2))3. Put x, -0.5, g in descending order. g, x, -0.5 Suppose 2p - 42 = z, -99 = 2z - 2p - 17. Suppose 0 = -47y + 50y - 3. Let g be (z/30)/(y/3). Sort -0.2, 1/9, g. g, -0.2, 1/9 Let w = -331 + 334. Put 1, w, -44 in descending order. w, 1, -44 Suppose 0 = -r + 2, 2o - o - 1 = r. Let s = -4 + 2. Sort 2, o, -6, s. -6, s, 2, o Let r(h) = -h - 5. Let w be r(-8). Suppose 3l = -0l + w. Put l, -4, 3 in increasing order. -4, l, 3 Let j(k) = k*3 - 10k*2 - 12k + 15. Let p be j(11). Suppose 0 = pz - 12, -a + 7 = -3z + 16. Let g be -6(1 + (-16)/12). Put a, 3, g in descending order. 3, g, a Let m = -272 + 277. Sort 9/2, m, -4 in ascending order. -4, 9/2, m Let o = 708 - 712. Sort o, -290, -1 in decreasing order. -1, o, -290 Suppose -3p - 19 + 10 = 3i, -2i = -p - 6. Sort 5, -5, p. -5, p, 5 Suppose 5m - 3v = 29, 3m - 3v = -6v + 3. Let r be (-2 - -2)/(2 - m). Suppose l = y + 1, 3l - 11 = 5y - ry. Sort 5, l, -1. l, -1, 5 Let y = 26 - 25.995. Let u = y + -0.205. Let l = -5 - -5.4. Put -4, l, u in descending order. l, u, -4 Suppose 0 = 27x - 23x + 8. Sort 5, 0, -4, x in ascending order. -4, x, 0, 5 Let d = 583 - 578. Put -6, 13, d, -4/3 in descending order. 13, d, -4/3, -6 Let i = 122 + -120. Suppose 5z - 6 = iz. Put z, -7, -4 in decreasing order. z, -4, -7 Suppose -5q + 6 = -8q. Let i = 323 + -318. Sort q, 4, i, -4 in increasing order. -4, q, 4, i Let d = 2/1207 - -1203/2414. Put -5, -1, -63, d in descending order. d, -1, -5, -63 Let t be 1(2/(-1))/(-53 - -55). Put -74, t, 1/2 in ascending order. -74, t, 1/2 Let b = 9 - 9.06. Let j = -0.14 + b. Let t = 126 - 134. Put -5/2, j, t in descending order. j, -5/2, t Suppose 4b + 4b + 48 = 0. Sort b, -5, 4, -1 in decreasing order. 4, -1, -5, b Let l be (-2)/6 - (-1)/3. Let u(a) = -a3 - 8a*2 + 4. Let x be u(-8). Suppose 2o - 22 = 3j, 4j + j + xo = 0. Sort j, l, 5 in decreasing order. 5, l, j Let n(l) = -7l + 54. Let w be n(7). Sort -3, w, -5, 4 in increasing order. -5, -3, 4, w Let w = -3.68 + 2.68. Put 12/11, 2/3, 0.3, w in decreasing order. 12/11, 2/3, 0.3, w Suppose -106p = -73p - 132. Put 5, 0, p in ascending order. 0, p, 5 Let h = -244/1957 + 2/103. Sort -2, h, 0 in decreasing order. 0, h, -2 Let n = 96 + -100. Put 0, 4, n in increasing order. n, 0, 4 Let t = -0.04 + 12.04. Let n = 9.2 - -2.8. Let z = t - n. Put -0.1, -5, z in increasing order. -5, -0.1, z Let c be 0 - -2 - (17 - 20). Sort 2, -1, c in descending order. c, 2, -1 Let r = -25.9 - -26.1. Sort r, 4, -1.6 in decreasing order. 4, r, -1.6 Let v be ((-3)/(-5))/(4/(-10)). Let i = 11.3 - 11. Let q be 16/(-18) + 4/6. Sort q, v, i. v, q, i Let r = -1.1 - -0.1. Suppose -3q + 5y = 14, -11 = -q + 6q + 4y. Sort r, q, 2/3, -2/5 in ascending order. q, r, -2/5, 2/3 Let n = -11 - -60. Let r = n - 48.6. Put 0.5, -4, 0, r in descending order. 0.5, r, 0, -4 Let r = -0.4 + -0.1. Let u = 112.8 - 109.8. Sort 0.2, r, 10, u in descending order. 10, u, 0.2, r Let m = -43 + 45. Suppose -a + 6 = m. Sort -31, a, -5 in descending order. a, -5, -31 Let k be 12/7 - (13 - 11) - (-8)/14. Suppose -2u = -u + 4. Sort u, 2, k, -6 in ascending order. -6, u, k, 2 Suppose 6q - 5q = -5k + 16, 0 = -k - q. Sort -0.3, -0.081, k, 5 in descending order. 5, k, -0.081, -0.3 Let t be (10 + -9)/((-1)/(2/(-10))). Sort t, 31, 2/9, 2/5 in ascending order. t, 2/9, 2/5, 31 Let f = -12.74 - -10.9. Let m = 10.54 + f. Let s = -9 + m. Sort s, -2/9, 4 in descending order. 4, -2/9, s Suppose 6r + r = -28. Suppose 3q + 2 = 2b - 0q, 0 = -5q. Sort r, b, -10 in decreasing order. b, r, -10 Let i = -1 - 2. Suppose -5 = -6k + 67. Suppose -2q + 0q = 4b - 6, -3b = -q - k. Put b, 7, i in ascending order. i, b, 7 Let d be 16/(-28) - 11/(-7). Let w(n) = n*3 + 2n*2 - 2n + 1. Let t be w(d). Sort -6, t, -5 in decreasing order. t, -5, -6 Suppose -3j - 11 = -3g - 2j, 5g = -4j - 10. Let x be 2/(-6) - ((-13)/13)/9. Put g, x, -5/2 in descending order. g, x, -5/2 Let j be -12 + 10 + (-2)/(-2). Let v(m) = -m3 - 28m*2 + 32m + 74. Let l be v(-29). Sort l, -2, j in decreasing order. j, -2, l Let v = 103 + -121. Sort v, 3, -4, -5. v, -5, -4, 3 Let u be 4/26 + (-1305)/(-13572). Sort u, -0.3, 14, -1. -1, -0.3, u, 14 Suppose 54 = -12g + 3g. Let n be 7/((-10)/g - (-4)/(-6)). Put 4, 2, n in decreasing order. n, 4, 2 Let x be (4/(-	{ "pile_set_name": "DM Mathematics" }
3b2. Let r(w) = 6w. Let j(a) = a*2 + a. Let h(n) = -2n - 18. Let k be h(-6). Let m(s) = kj(s) + r(s). What is l(m(x))? -108x*4 Let v(f) = -2506 + 2506 - 4f*2. Let s(l) = 3l*2. Determine v(s(h)). -36h*4 Let u(d) = -2d*2. Suppose 2c = 3c + 3. Let i be c6/9 - -4. Let x(s) = 6s2 + 2s*i - 8s*2 - 2s*2. Determine u(x(j)). -8j*4 Let c(i) = 11615i. Let g(d) = -555d2. What is c(g(f))? -6446325f*2 Let v(z) = -11z + 8z + z - z. Let q(k) = 22k*2. What is v(q(o))? -66o2 Let f(h) be the second derivative of h4/6 + 16h2 - 6h. Let c(k) be the first derivative of f(k). Let z(i) = -i*2. Determine c(z(m)). -4m*2 Let n(s) = s. Let x(j) = 129j + 453. What is n(x(q))? 129q + 453 Let i(g) = 8674g. Let o(r) = 9r2. Give o(i(x)). 677144484x*2 Let x(v) = -2v*2. Let j(u) = 5 - 12 + 5. Let k(w) = -3. Let c(p) = -5j(p) + 3k(p). Let i(b) = 3b + 3. Let z(l) = -3c(l) + i(l). Determine x(z(f)). -18f*2 Let y(z) = 3z*2. Let v = 372 - 369. Let b(q) be the third derivative of 6q*2 + 0q*v + 0 - 1/24q*4 + 0q. Determine b(y(l)). -3l2 Let u(i) = -8i. Let s(b) be the third derivative of -b*5/20 - 8b*3/3 + 3b*2 - 85. What is u(s(q))? 24q*2 + 128 Let x(m) = 32m*2. Let z(u) = 4997u*2. What is x(z(h))? 799040288h*4 Let i(l) = -11l. Let w(c) = c*3 - 6c*2 - 3. Let q be w(6). Let f be (1 - -2) + q + 4. Let o(d) = -fd + 11d - 6d. Give o(i(y)). -11y Let a(m) = 11m - 9m + 2 - 2. Let l(j) be the third derivative of -j8/20160 - 17j*5/60 - 4j*2. Let q(v) be the third derivative of l(v). What is q(a(w))? -4w*2 Let t(h) = -205h - 206h + 404h. Let c(r) = -30r2. Determine t(c(l)). 210l*2 Let m(x) = -184x2. Let v(g) be the first derivative of g3/3 - 419. Give m(v(p)). -184p4 Let p = 67 - 65. Let m(q) = 59q*p - 29q*2 - 32q*2. Let d(j) = 34j. What is d(m(u))? -68u2 Let p(x) = 1911x + 3. Let m(r) = 5r. Calculate p(m(i)). 9555i + 3 Let z(y) = 4y - 5y + 1 + 2y. Let s(q) = 12q + 15. Let x(n) = s(n) - 15z(n). Let c(f) = f. Give c(x(t)). -3t Let q(p) = -p. Let y(b) be the third derivative of 0b3 + 0b + 0 - 12b2 + 5/24b*4. Determine y(q(h)). -5h Let u(w) = -1002w2. Let i(f) = 2650f*2. Calculate u(i(l)). -7036545000l*4 Let z(x) = 6x*2 + 9. Let k(t) = -8t. Let j(h) = -21h. Let q(n) = 2j(n) - 5k(n). Determine z(q(s)). 24s*2 + 9 Let f(h) = 2h*2. Let o(i) = 76i*2 - 7i + 7. Let q(x) = -6x2 + 1 + 3x - 3 - x - 19x2. Let a(n) = 2o(n) + 7q(n). What is a(f(l))? -92l4 Let c(w) be the third derivative of -w4/12 - w2. Let q(n) = n2. Let s(v) = -2v2. Let k(l) = -5q(l) - 3s(l). Determine c(k(b)). -2b*2 Let j(w) = -2w. Let g(l) = -5l2 - 55110l. Give j(g(u)). 10u2 + 110220u Let m(y) = -8y. Let z(j) be the second derivative of 5j*3/2 + 517j. Determine z(m(s)). -120s Let c(b) = 808b - 6. Let m(n) = -5n. Give m(c(l)). -4040l + 30 Let j(b) = b. Let g(n) = -21175n2. Give j(g(c)). -21175c*2 Let r(z) = -3z. Let m(l) = 167524l2. Calculate m(r(c)). 1507716c*2 Let s(q) = -6q*2. Let i(c) = -7224c*2. Give s(i(l)). -313117056l*4 Let t(h) = 2h*2. Suppose 2a + 22 = 5l, 3a = -2a + 20. Suppose 2i - 3y = -l, -i - 8 = 2i - 4y. Let f(r) = ir + 3r - 2r. Determine f(t(w)). 2w2 Let b(t) = -5t*2. Let h(s) = -17s*2 - 11s - 6. Determine h(b(x)). -425x4 + 55x*2 - 6 Let p(f) = -157f*2. Let q(n) = -13723n*2. What is q(p(g))? -338258227g4 Let s(v) = -v2. Let d(u) = 306361u. Determine s(d(c)). -93857062321c*2 Let b(n) = -3n*2. Let j(u) = 22 - 4u*2 - 22 + 8u*2. Let r(k) = -3b(k) - 2j(k). Let q(d) be the first derivative of 7d*3/3 + 2. Determine q(r(i)). 7i*4 Let j(b) = -13. Let z(p) = -21p + 1911. Let y(h) = 588j(h) + 4z(h). Let r(t) = -8t. Determine y(r(q)). 672q Let a(j) = 29j. Let r(o) be the first derivative of o4/6 - 28o + 35. Let i(l) be the first derivative of r(l). What is i(a(t))? 1682t2 Let h(n) = -5n. Let i(t) = -27t2 + 4t - 12. Let j(q) = -q*2 - 2q + 6. Let z(w) = -2i(w) - 4j(w). Calculate z(h(v)). 1450v2 Let d(l) = l2 - 362l. Let u(a) = 3a2 + 25. Give d(u(s)). 9s*4 - 936s*2 - 8425 Let j(s) = -2s*2. Let g(o) = 431 + 23o - 858 + 427 + 86o. Determine j(g(i)). -23762i*2 Let j(o) = -8o*2. Let d(q) = -2q*2 + 17248q. Calculate d(j(k)). -128k4 - 137984k*2 Let v(i) be the third derivative of -2i*4/3 + 68i*2. Let d(k) = 11k. Calculate v(d(g)). -176g Let p(v) = 12v. Let o(f) be the third derivative of 1/12f4 + 0f*3 - 13f*2 + 0f + 0. Give p(o(c)). 24c Let n(g) = -5g*2. Let m(i) = 9i + 2. Let k(w) = -8w - 3. Let l(z) = -2k(z) - 3m(z). Give n(l(s)). -605s*2 Let i(y) = 6y*2. Let l(m) = 7m*2 - 5943m. What is l(i(o))? 252o4 - 35658o*2 Let h(o) = 5o. Let f(b) = 6b2 - 78b - 2. Determine h(f(v)). 30v2 - 390v - 10 Let o(j) = -11j2 - 9j + 282. Let y(a) = 4a. Give y(o(k)). -44k*2 - 36k + 1128 Let f be 3 + -1 + 4 - 4. Let w(b) = -580 + 4b2 + 5b*f + 580. Let s(g) = 4g*2. Let t(z) = -2z*2. Let c(h) = -3s(h) - 5t(h). Give w(c(k)). 36k*4 Let o(j) = 10j*2. Suppose -5f - 273 = -12f. Let n(c) = -41c + 80c - fc + 2c2. What is n(o(g))? 200g*4 Let x(d) = -44042 + 16d + 44042. Let k(c) = c. What is k(x(b))? 16b Let t = 85 + -50. Let z(m) = 35 + 9m - m - t. Let p(v) = -3v + 2. Let a(b) = -b + 1. Let r(s) = -6a(s) + 3p(s). Calculate r(z(c)). -24c Let d(a) = 25a. Let t(i) = 58013i. What is t(d(u))? 1450325u Let d(s) = -6s + 3. Let g(w) = -w + 1. Let z(p) = -d(p) + 3g(p). Let c(m) = -25m*2. What is c(z(j))? -225j*2 Suppose 0 = -r - 3z - 12, -3r - 4z + 3z = -4. Suppose -rc - c + 268 = 0. Let u(q) = c - 67 - 10q. Let d(v) = -v2. What is d(u(f))? -100f*2 Let p(v) be the first derivative of 333v*2/2 + 471. Let i(j) = 2j. Give p(i(m)). 666m Let i(l) = -3l*2 + 2l*2 - 6l*2 - 2l*2. Let x(g) = 53g. Give x(i(f)). -477f2 Let n(p) = -3434p - 102. Let s(l) = 264l + 8. Let v(f) = -4n(f) - 51s(f). Let m(j) = 2j*2. Give v(m(u)). 544u*2 Let n(g) = 8g + 5. Let j(p) = 215p2. Give j(n(a)). 13760a*2 + 17200a + 5375 Let i(u) = -u*2 - 7u - 8. Let y be i(-5). Let w = y - 0. Let z(t) = 0t2 - 8t*w + 3t*2. Let q(b) = -2b*2. Calculate z(q(m)). -20m4 Let i(q) be the first derivative of q2/2 + 119q + 61. Let l(a) = -a. Calculate i(l(p)). -p + 119 Let u(n) be the third derivative of n4/8 - 2n*2 - 36. Let p(m) = 10m - 4. What is u(p(k))? 30k - 12 Let v(i) = 7i + 2. Let o(q) be the third derivative of 0q + 0q*3 + 1/24q*4 + 0 + 26q*2. Calculate o(v(a)). 7a + 2 Let l(d) be the second derivative of d*3/6 - 46d. Let k(s) = -2s - 3s - 5s - 10s + 1. What is l(k(y))? -20y + 1 Let z(r) = 25r - 17r - 2r. Let i(p) = 6p. What is z(i(o))? 36o Let c be ((-20)/7)/((-8)/28). Let h(q) = q + cq2 - 14q + 13q. Let x(y) = -y2. Determine h(x(t)). 10t*4 Let g(s) = -3s2. Let h(t) be the first derivative of -t3 - 12 + 4t3 - 5t*3. Calculate g(h(c)). -108c*4 Let i(s) = 195s2. Let o(y) be the third derivative of y4/8 - y*2 + 3y. Give i(o(x)). 1755x2 Let y(r) = -2r + 2r - 2r. Let p(u) = 11 - 11u - 1 + 3 - 5. Let a(j) = 4j - 3. Let h(f) = 8a(f) + 3p(f). Calculate y(h(g)). 2g Let r(z) = 21z*2 + 18z*2 - 70z*2 + 28z*2. Let h(u) = 4u*2 + 8u*2 - 2u*2. What is r(h(q))? -300q*4 Let i be 2(-2 - (-14)/4). Let r(n) = 5n2 + 4. Let m(s) = -4s*2 - 3. Let c(h) = ir(h) + 4m(h). Let v(j) = 2j - 7j - j. Determine v(c(a)). 6a*2 Suppose 41 = 3q - 5n, q + q - 3n - 27 = 0. Suppose 2o - 6o = -q. Let d(c) = oc2 + c2 + c2 + 0c*2. Let l(y) = -y. Calculate l(d(f)). -5f2 Let b = 19 + -17. Let p(a) = a2 - 2a2 - ab. Let s(y) = 15y. Give p(s(h)). -450h2 Let i(g) = 1. Let j(z) = 2z - 2. Let f(r) = 2i(r) + j(r). Let n = 8 + -4. Let y(d) = -3d - 4 + n - d. Give y(f(b)). -8b Let a(h) = 24h. Let j(z) = 2z + 2620. What is j(a(x))? 48x + 2620 Let d(p) be the second derivative of 0p2 - 10p + 11/6p3 + 0. Let b(w) = -2w. What is d(b(l))? -22l Suppose -2z + 33 + 3 = 0. Suppose 12 = -14x + zx. Let g(l) = -2l - 1 + x - 2. Let r(a) = -a. Determine r(g(u)). 2u Let g(l)	{ "pile_set_name": "DM Mathematics" }
r -2r3 - 1138r*2 + 93732r. -2r(r - 73)(r + 642) Suppose 2u*5 - 3182u*4/7 + 4044u*3/7 + 776u*2 - 1808u/7 = 0. Calculate u. -1, 0, 2/7, 2, 226 Factor h*2 + 5782h + 8357881. (h + 2891)*2 Determine h so that 783538321329h*2/2 - 1770354h + 2 = 0. 2/885177 Factor 4i2/3 - 195728i. 4i(i - 146796)/3 Suppose -n*2/2 - 125n - 1701/2 = 0. Calculate n. -243, -7 Factor -2v2/3 + 4598v. -2v(v - 6897)/3 Solve -55y3 + 34970y*2 + 6360y = 0 for y. -2/11, 0, 636 Factor -1764w2 + 617568w - 54051904. -4(21w - 3676)*2 Determine a so that -2a*5/5 - 1422a*4/5 - 18218a*3/5 - 48762a*2/5 + 68404a/5 = 0. -698, -7, 0, 1 Determine a so that -34a5/13 - 6694a*4/13 + 48796a*3/13 - 116216a*2/13 + 96240a/13 - 9792/13 = 0. -204, 2/17, 2, 3 Find g, given that -3g5/8 - 1377g*4/8 - 852g*3 - 675g*2/2 + 1362g = 0. -454, -4, -2, 0, 1 Solve 2x3 + 424x*2 + 17978x + 17556 = 0 for x. -154, -57, -1 Determine c so that -2c2/5 - 3406c/5 = 0. -1703, 0 Factor -r*4/5 + 41r*3/5 - 477r*2/5 + 1159r/5 - 722/5. -(r - 19)*2(r - 2)(r - 1)/5 What is s in -s5/5 + 63s*4/5 - 1271s*3/5 + 8597s*2/5 - 13728s/5 - 4732 = 0? -1, 5, 7, 26 Let -45m4 + 265m*3 + 4530m*2 - 26500m - 3000 = 0. What is m? -10, -1/9, 6, 10 Factor -5y4 - 350y*3 - 645y*2 + 2360y - 1360. -5(y - 1)2(y + 4)(y + 68) Factor 3a*3/7 + 183a*2/7 - 39075a/7 + 38889/7. 3(a - 87)(a - 1)(a + 149)/7 Find p such that 3p*2 + 112020p + 1045706700 = 0. -18670 Let 2209y4 - 428123y*3 + 20523334y*2 + 21818748y - 41916168 = 0. What is y? -2, 1, 4578/47 Let -2b3 + 2984b*2 - 5960b = 0. Calculate b. 0, 2, 1490 What is k in 3k2 + 10683k - 85656 = 0? -3569, 8 Determine c, given that -c*2/2 - 5637c/2 + 70775 = 0. -5662, 25 What is v in -3v3 + 36477v*2 - 110423592v - 2783434800 = 0? -25, 6092 Find p, given that 3p3 + 11325p*2 + 10613976p - 139902204 = 0. -1894, 13 Factor -4c3 - 2752c*2 - 37264c + 323520. -4(c - 6)(c + 20)(c + 674) Find o, given that 20o*5 + 61900o*4 - 433975o*3 + 945900o*2 - 651375o + 139590 = 0. -3102, 1/2, 3 Solve 2d3 + 233256d*2 + 933000d + 932992 = 0 for d. -116624, -2 Solve 28m4/5 + 148m*3/5 - 364m*2/5 - 148m/5 + 336/5 = 0 for m. -7, -1, 1, 12/7 Factor -4t2/3 - 556t + 194560/3. -4(t - 95)(t + 512)/3 Factor -2a2/5 - 5740696a/5 - 4119448820552/5. -2(a + 1435174)2/5 Suppose -2z*3/5 - 46z*2/5 + 786z/5 - 378 = 0. Calculate z. -35, 3, 9 Factor 74f5/7 - 32f*4/7 - 360f*3/7. 2f*3(f + 2)(37f - 90)/7 Factor l*4/5 - 172l*2/5 - 240l - 2304/5. (l - 16)(l + 4)(l + 6)*2/5 Factor -2k*2/5 - 4824k/5 + 9656/5. -2(k - 2)(k + 2414)/5 What is j in -4j3/3 - 140j*2/3 + 204j - 156 = 0? -39, 1, 3 Factor 2o2/9 - 9008o - 54056. 2(o - 40542)(o + 6)/9 Factor -2k4 - 14k*3 + 198k*2 - 594k + 540. -2(k - 3)2(k - 2)(k + 15) Let -2g*3 - 89170g*2 + 89172g = 0. What is g? -44586, 0, 1 Let -14w3/5 - 15368w*2/5 + 19778w/5 - 4396/5 = 0. Calculate w. -1099, 2/7, 1 Suppose -4s2 + 1344s + 6820 = 0. Calculate s. -5, 341 Determine q so that q*3/7 - 93q*2 + 7058q/7 - 11520/7 = 0. 2, 9, 640 Factor 30098v2/3 - 270886v/3 + 12. 2(v - 9)(15049v - 2)/3 Find j, given that -2j*4/11 + 6200j*3/11 - 5058344j*2/11 + 392683200j/11 - 8022897792/11 = 0. 42, 1508 Suppose 5z3/3 - 2z*2 - 2423z/3 - 644 = 0. Calculate z. -21, -4/5, 23 Let -5k4 + 510k*3 - 11865k*2 - 62540k + 168540 = 0. Calculate k. -6, 2, 53 Determine p so that -p*4/3 + 62p*3 - 2883p2 = 0. 0, 93 Factor -k2 - 874k + 875. -(k - 1)(k + 875) Factor m*2/5 + 12826m + 64129/5. (m + 1)(m + 64129)/5 Determine v, given that -4v*4/11 - 6522v*3/11 + 890v*2 - 3264v/11 = 0. -1632, 0, 1/2, 1 Factor 3k2/2 + 3582k - 7167/2. 3(k - 1)(k + 2389)/2 Solve -2v3/5 + 3042v*2/5 + 1218v + 3046/5 = 0. -1, 1523 Factor -4c2/7 - 71992c/7 - 323928004/7. -4(c + 8999)2/7 Factor i2 + 152i - 624. (i - 4)(i + 156) Factor v5/4 + 67v*4 - 831v*3 + 2520v2. v2(v - 6)2(v + 280)/4 Solve -21z3/5 - 484z*2/5 - 1509z/5 + 2014/5 = 0 for z. -19, -106/21, 1 Suppose -3z5/8 + 1365z*4/8 - 30093z*3/4 + 319323z*2/4 + 1463325z/8 + 763125/8 = 0. Calculate z. -1, 25, 407 Let -2o2/7 - 391588o/7 - 19167645218/7 = 0. What is o? -97897 What is c in 50c4 - 80c*3 - 188c*2 - 64c - 6 = 0? -1, -1/5, 3 Factor 3q2 + 120q - 9963. 3(q - 41)(q + 81) Suppose 2y3 - 208y*2 + 902y + 44232 = 0. What is y? -12, 19, 97 Factor 3j3 - 1410j*2 - 21747j - 37830. 3(j - 485)(j + 2)(j + 13) Find s, given that 24s*4 + 654s*3 + 3628s*2/3 - 3454s + 4700/3 = 0. -25, -47/12, 2/3, 1 Factor -2p2/7 - 21118p/7 + 21120/7. -2(p - 1)(p + 10560)/7 Determine o, given that -477o5/4 + 25131o*4/2 + 82851o*3/4 + 7707o*2 - 321o = 0. -1, -2/3, 0, 2/53, 107 Determine a so that -5a4/7 + 19398a*3/7 + 46575a*2/7 + 34936a/7 + 7764/7 = 0. -1, -2/5, 3882 Factor -2q2 + 9902q + 79344. -2(q - 4959)(q + 8) Determine d so that -d*2 - 84d + 540 = 0. -90, 6 Suppose -t*3/4 - 649t*2 - 2595t/4 = 0. What is t? -2595, -1, 0 Factor 2r3/5 - 19874r*2 + 1233454534r/5 + 20997454834/5. 2(r - 24851)2(r + 17)/5 Factor 92y3 + 636y*2 + 504y. 4y(y + 6)(23y + 21) Find r, given that r*5/2 + 38r*4 + 198r*3 - 827r*2 + 1811r/2 - 315 = 0. -70, -9, 1 Find j, given that -j*3/5 - 133j*2/5 - 3332j/5 - 640 = 0. -100, -32, -1 Factor 3l2 + 1017l - 361956. 3(l - 217)(l + 556) Determine a, given that 4a5 - 1115a*4 + 12429a*3 + 31957a*2 + 22147a + 3738 = 0. -1, -1/4, 14, 267 Find s, given that -3s4/7 + 1053s*3 + 14754s*2/7 = 0. -2, 0, 2459 Determine c, given that -4c*5 + 348c*4 - 5896c*3 + 23760c*2 - 35104c + 16896 = 0. 1, 2, 16, 66 Factor p*3 + 48p*2 - 619p - 2262. (p - 13)(p + 3)(p + 58) Find o, given that 2o4/11 - 7454o*3/11 + 7768830o*2/11 - 1486928906o/11 + 1479167528/11 = 0. 1, 244, 1741 Suppose 4i2 - 34100i + 68184 = 0. What is i? 2, 8523 Solve -80o4 + 1080o*3 - 4485o*2 + 5290o = 0. 0, 2, 23/4 Factor -i*3/2 - 688569i*2 - 474127267761i/2. -i(i + 688569)2/2 Find u, given that -u3/9 - 6067u*2/9 - 274321u/3 - 3136441 = 0. -5929, -69 Find g such that 2g4/3 - 1134g*3 + 106814g*2/3 + 1134g - 106816/3 = 0. -1, 1, 32, 1669 Let 6y5/5 - 12092y*4/5 + 24896y*3 - 68180y*2 + 20050y = 0. What is y? 0, 1/3, 5, 2005 Solve -l*4 + 22379l*3/2 - 62619237l*2/2 + 46944848l - 15646418 = 0 for l. 1/2, 1, 5594 Factor 5z4/3 - 91115z*3/3 - 182245z*2/3 - 30375z. 5z(z - 18225)(z + 1)2/3 Factor 3o*4 + 174o*3 + 468o*2 - 1470o + 825. 3(o - 1)2(o + 5)(o + 55) Let -16j*3 + 4572j*2 + 10360j + 2304 = 0. What is j? -2, -1/4, 288 Factor -z*3/3 + 38068z*2/3 - 362331221z/3 + 724510178/3. -(z - 19033)*2(z - 2)/3 Factor -4r4 - 180r*3 + 1848r*2 - 5104r + 4320. -4(r - 5)(r - 2)*2(r + 54) Determine y, given that y*4 - 79y*3 + 849y*2 - 3065y + 3350 = 0. 2, 5, 67 Let -4z2 + 4828z + 29112 = 0. Calculate z. -6, 1213 Factor -2q4/13 + 5946q*3/13 - 5880546q*2/13 + 147907350q + 11749759884/13. -2(q - 993)3(q + 6)/13 Let -2r3 + 256102r*2 - 512198r + 256098 = 0. Calculate r. 1, 128049 Factor 3q2 - 2322q + 2319. 3(q - 773)(q - 1) Factor 4z5 + 27124z*4 + 27120z*3. 4z*3(z + 1)(z + 6780) Let 2o*3/19 + 1098o*2/19 + 7608o/19 + 10840/19 = 0. Calculate o. -542, -5, -2 What is q in 20q5 + 450q*4 - 385q*3 - 102765q*2/2 - 206635q + 515865/2 = 0? -17, -17/2, 1, 21/2 Solve -3j3 - 297j*2 + 1560j = 0. -104, 0, 5 Determine b, given that -3b3 + 31731b*2 - 95166b = 0. 0, 3, 10574 Let -4o3 - 22376o*2 - 67092o = 0. Calculate o. -5591, -3, 0 Factor r*4/3 - 55r*3/3 - 57r*2 - 173r/3 - 58/3. (r - 58)(r + 1)3/3 Find b, given that 54b*5 + 237b*4 + 162b*3 - 21b*2 = 0. -7/2, -1, 0, 1/9 Factor 2t*3/3 + 49780t*2/3 + 309855586t/3 + 1238625992/3. 2(t + 4)(t + 12443)*2/3 What is j in -35j*4 + 280620j*3 + 80180j*2 = 0? -2/7, 0, 8018 Find r, given that -4r*2 - 68148r = 0. -17037, 0 Factor -3i2/7 - 7929i/7 - 23760/7. -3(i + 3)(i + 26	{ "pile_set_name": "DM Mathematics" }
218, 307, 418, 557, 730, 943? 1202 What is the next term in -3288, -6576, -9864, -13152, -16440? -19728 What is the next term in -27, -64, -103, -144, -187? -232 What comes next: 43, 114, 193, 280, 375? 478 What is next in 449, 451, 453? 455 What comes next: -347, -320, -293, -266? -239 What is next in 5801, 5802, 5803, 5804? 5805 What is the next term in -4, -77, -272, -649, -1268, -2189? -3472 What is the next term in 4, 15, 22, 19, 0? -41 What is next in -2910, -2911, -2914, -2919? -2926 What is next in 44, 177, 398, 707, 1104? 1589 What comes next: -138, -266, -394, -522, -650? -778 What is next in 329, 323, 315, 305, 293, 279, 263? 245 What is next in -141, -145, -151, -159, -169, -181? -195 What is next in -106, -227, -348? -469 What is the next term in 16, 24, 52, 112, 216, 376, 604, 912? 1312 What comes next: -6, -70, -192, -378, -634, -966, -1380, -1882? -2478 What is next in 40, 37, 32, 25? 16 What is next in -2356, -2357, -2358, -2359, -2360? -2361 What comes next: -19, -69, -153, -277, -447, -669, -949, -1293? -1707 What comes next: -279, -593, -895, -1179, -1439, -1669, -1863? -2015 What is the next term in -126, -128, -132, -138, -146, -156, -168? -182 What comes next: -390, -773, -1154, -1533, -1910? -2285 What is the next term in 68, 189, 362, 587, 864? 1193 What comes next: 95, 99, 115, 149, 207, 295, 419, 585? 799 What is the next term in 23, 76, 161, 278, 427, 608, 821? 1066 What comes next: -273, -275, -277, -279, -281, -283? -285 What comes next: 1, -25, -91, -215, -415, -709, -1115, -1651? -2335 What comes next: -59, -237, -533, -947, -1479, -2129? -2897 What is the next term in -56, -239, -544, -971, -1520? -2191 What is the next term in -12, -16, -16, -12, -4, 8? 24 What comes next: -63, -83, -103? -123 What is the next term in 124, 207, 304, 421, 564, 739, 952, 1209? 1516 What is next in -92, -180, -254, -308, -336? -332 What comes next: -1224, -1228, -1234, -1242, -1252, -1264, -1278? -1294 What is next in -222, -201, -144, -33, 150, 423, 804? 1311 What comes next: 23, 45, 67, 89? 111 What is next in 118, 117, 116? 115 What is next in 605, 599, 589, 575, 557? 535 What comes next: 14, 14, 22, 44, 86, 154, 254, 392? 574 What comes next: 150, 251, 354, 459, 566, 675, 786? 899 What is next in -85, -161, -369, -775, -1445? -2445 What is the next term in -23, -95, -217, -389? -611 What is the next term in -245, -458, -673, -890, -1109, -1330? -1553 What is next in -75, -48, -9, 48, 129, 240, 387, 576? 813 What is next in 135, 128, 117, 102, 83, 60, 33? 2 What comes next: 26, -7, -44, -85, -130? -179 What is the next term in 37070, 37071, 37072? 37073 What is the next term in -15702, -31403, -47102, -62799, -78494, -94187, -109878? -125567 What comes next: -3213, -6425, -9637? -12849 What comes next: 304, 303, 302, 301, 300, 299? 298 What is next in -539, -531, -513, -479, -423, -339, -221? -63 What is the next term in -69, -80, -95, -114? -137 What is next in -407, -396, -397, -416, -459, -532, -641, -792? -991 What comes next: 28, 3, -48, -131, -252? -417 What is the next term in -35, -72, -109? -146 What is next in -1440, -1434, -1426, -1416, -1404? -1390 What is next in -248, -240, -230, -218, -204, -188? -170 What comes next: 3, 2, -9, -36, -85, -162, -273? -424 What is next in 30, 56, 82? 108 What is next in 58, 49, 38, 25, 10, -7? -26 What comes next: 9, -13, -57, -129, -235? -381 What comes next: 18, 70, 140, 228? 334 What comes next: 109, 110, 113, 118, 125? 134 What is next in 30, 19, 0, -27, -62, -105? -156 What is the next term in 3629, 7256, 10883, 14510? 18137 What is next in -175, -187, -215, -265, -343? -455 What is the next term in -360, -728, -1112, -1518, -1952? -2420 What comes next: 12, 20, 40, 78, 140? 232 What is the next term in 13, 1, -11, -23, -35, -47? -59 What is next in 98, 389, 878, 1565, 2450, 3533? 4814 What is the next term in 1403, 1390, 1373, 1352, 1327? 1298 What comes next: 127, 123, 115, 103, 87, 67? 43 What comes next: 471, 473, 475, 477? 479 What is the next term in -3939, -3934, -3919, -3888, -3835, -3754? -3639 What comes next: 31, 30, 29, 28, 27, 26? 25 What is the next term in 46, 51, 70, 109, 174, 271? 406 What comes next: -7, -11, -17, -25? -35 What is the next term in -24, -38, -64, -108, -176, -274, -408, -584? -808 What is next in 229, 227, 225, 223, 221? 219 What comes next: 10583, 21168, 31755, 42344, 52935? 63528 What comes next: -14, -25, -26, -11, 26, 91, 190, 329? 514 What is next in 33154, 33152, 33148, 33142, 33134, 33124? 33112 What is next in 230, 235, 244, 257, 274? 295 What comes next: -53, -228, -535, -986, -1593, -2368? -3323 What is next in 14, 63, 150, 275, 438, 639, 878? 1155 What is next in -42, -76, -88, -72, -22, 68, 204? 392 What is next in 324, 318, 308, 294, 276, 254? 228 What is the next term in -19, -31, -37, -31, -7, 41? 119 What comes next: 82, 139, 188, 235, 286, 347? 424 What is next in 7140, 7143, 7146, 7149? 7152 What comes next: -7477, -7473, -7467, -7459, -7449, -7437? -7423 What is the next term in 1381, 1381, 1389, 1411, 1453, 1521, 1621? 1759 What is next in 26, 25, 22, 17, 10, 1, -10? -23 What is next in -184, -381, -580, -781, -984, -1189, -1396? -1605 What comes next: -42, -170, -380, -672, -1046, -1502? -2040 What is next in 603, 1205, 1807, 2409, 3011, 3613? 4215 What is next in 11, 21, 47, 95, 171, 281? 431 What is the next term in -4, -41, -102, -187, -296, -429? -586 What is next in -417, -401, -385, -369? -353 What is the next term in 482, 486, 494, 506, 522, 542? 566 What comes next: 1474, 1476, 1476, 1474, 1470, 1464? 1456 What comes next: 28, 68, 118, 184, 272? 388 What comes next: 1, 2, -1, -8, -19? -34 What is next in 36895, 36894, 36893, 36892? 36891 What comes next: -228, -861, -1916, -3393, -5292, -7613? -10356 What is the next term in -534, -1041, -1548, -2055, -2562? -3069 What is next in 210, 208, 204, 198? 190 What comes next: -608, -607, -594, -563, -508, -423, -302, -139? 72 What comes next: -12, -14, -16? -18 What is next in -18, -89, -272, -621, -1190, -2033? -3204 What is next in 1012, 2022, 3032, 4042, 5052? 6062 What is next in 931, 976, 1023, 1072, 1123? 1176 What comes next: -10, -14, -20, -28? -38 What comes next: -24, -31, -42, -57? -76 What is next in -76, -81, -96, -127, -180, -261, -376? -531 What is next in 30, 128, 294, 528? 830 What is the next term in 8, 62, 140, 236, 344, 458, 572? 680 What is the next term in -106, -144, -184, -226, -270? -316 What is the next term in -14641, -14643, -14645, -14647? -14649 What is the next term in -12, -23, -46, -87, -152, -247, -378, -551? -772 What is next in -55537, -55536, -55535, -55534? -55533 What comes next: -21, -62, -163, -354, -665? -1126 What is next in -17, -64, -133, -224? -337 What is next in -106, -216, -326, -436, -546? -656 What is next in -30, -60, -90? -120 What comes next: -55, -57, -53, -37, -3, 55, 143? 267 What comes next: 4, -1, -4, -5, -4, -1, 4? 11 What is next in 120, 746, 1790, 3252, 5132? 7430 What is next in -24, -102, -218, -360, -516? -674 What is the next term in -466, -462, -456, -448, -438? -426 What is the next term in -33, -64, -97, -132, -169, -208, -249? -292 What is next in 2635, 2633, 2629, 2623, 2615, 2605? 2593 What is the next term in 739, 2952, 6641, 11806, 18447? 26564 What comes next: -47, -115, -197, -299, -427, -587? -785 What is the next term in 59, 49, 37, 23, 7, -11, -31? -53 What is next in -12, -34, -52, -60, -52, -22, 36, 128? 260 What comes next: 508, 512, 516? 520 What is next in -2, -34, -88, -164, -262, -382? -524 What comes next: -182, -376, -584, -812, -1066, -1352, -1676? -2044 What is the next term in -395, -399, -399, -395, -387, -375? -359 What is the next term in -2705, -5409, -8113, -10817? -13521 What is the next term in 4355, 4354, 4353, 4352, 4351? 4350 What is next in -8, -36, -80, -140, -216, -308? -416 What comes next: 425, 839, 1251, 1655, 2045, 2415, 2759? 3071 What comes next: 9, 32, 55, 78, 101? 124 What is next in 38, 18, -18, -70? -138 What comes next: -34, 28, 232, 650, 1354? 2416 What is next in -28, -95, -268, -601, -1148, -1963, -3100, -4613? -6556 What comes next: -680, -1371, -2080, -2813, -3576? -4375 What is the next term in 70, 115, 158, 199, 238, 275, 310? 343 What comes ne	{ "pile_set_name": "DM Mathematics" }
ivided by 431. 426 Calculate the remainder when 139902637 is divided by 8. 5 Calculate the remainder when 47246 is divided by 2575. 896 What is the remainder when 119545 is divided by 1555? 1365 What is the remainder when 1678680 is divided by 139? 116 Calculate the remainder when 17757546 is divided by 28412. 46 What is the remainder when 3506337 is divided by 131? 122 What is the remainder when 3758446 is divided by 77? 76 What is the remainder when 474686 is divided by 161? 58 What is the remainder when 9952411 is divided by 30? 1 What is the remainder when 178858 is divided by 3042? 2422 What is the remainder when 1494058 is divided by 286? 280 Calculate the remainder when 10007330 is divided by 43700. 30 What is the remainder when 1426768 is divided by 1447? 26 What is the remainder when 44749007 is divided by 382470? 17 What is the remainder when 480601 is divided by 2063? 1985 What is the remainder when 25197434 is divided by 20? 14 What is the remainder when 16869776 is divided by 596? 592 What is the remainder when 4388 is divided by 70? 48 What is the remainder when 282630778 is divided by 180? 178 Calculate the remainder when 8902982 is divided by 4139. 4132 Calculate the remainder when 39285850 is divided by 130. 110 What is the remainder when 1570325 is divided by 154? 141 Calculate the remainder when 65528 is divided by 1488. 56 What is the remainder when 9914441 is divided by 77? 75 Calculate the remainder when 3897697 is divided by 2900. 97 What is the remainder when 10449928 is divided by 15? 13 What is the remainder when 34017 is divided by 321? 312 Calculate the remainder when 1156656 is divided by 214. 200 Calculate the remainder when 2324477 is divided by 4712. 1461 Calculate the remainder when 27945 is divided by 179. 21 Calculate the remainder when 71624055 is divided by 315. 300 What is the remainder when 927948 is divided by 7524? 2496 What is the remainder when 457811 is divided by 22312? 11571 What is the remainder when 4315226 is divided by 3614? 110 What is the remainder when 446190417 is divided by 390? 387 Calculate the remainder when 34728987 is divided by 186. 183 Calculate the remainder when 1906426 is divided by 12795. 12766 What is the remainder when 9663299 is divided by 270? 269 What is the remainder when 2181064885 is divided by 2002? 2001 What is the remainder when 2530220 is divided by 9234? 104 What is the remainder when 555012 is divided by 138746? 28 What is the remainder when 175394600 is divided by 17? 7 What is the remainder when 28262238 is divided by 73? 69 What is the remainder when 24776253 is divided by 4013? 4004 Calculate the remainder when 5666112 is divided by 131. 100 Calculate the remainder when 1935654 is divided by 19552. 6 What is the remainder when 213601289 is divided by 71200428? 5 Calculate the remainder when 21344538 is divided by 38. 14 What is the remainder when 17798286 is divided by 2413? 2411 Calculate the remainder when 8290201 is divided by 7. 3 What is the remainder when 1290101 is divided by 392? 29 Calculate the remainder when 167932062 is divided by 4267. 10 Calculate the remainder when 1336872276 is divided by 7869. 7866 Calculate the remainder when 417037 is divided by 34749. 49 Calculate the remainder when 4317777 is divided by 3244. 13 Calculate the remainder when 6022 is divided by 120. 22 Calculate the remainder when 419133 is divided by 83. 66 What is the remainder when 30742991 is divided by 9? 8 Calculate the remainder when 1439246 is divided by 932. 238 What is the remainder when 155049 is divided by 88? 81 Calculate the remainder when 32076 is divided by 495. 396 Calculate the remainder when 74843224 is divided by 1747. 1744 What is the remainder when 465352 is divided by 8945? 212 What is the remainder when 4489966 is divided by 483? 481 What is the remainder when 2215 is divided by 1572? 643 Calculate the remainder when 704363 is divided by 3338. 45 Calculate the remainder when 972508 is divided by 12. 4 What is the remainder when 1709581 is divided by 1008? 13 Calculate the remainder when 85155856 is divided by 1413. 1411 Calculate the remainder when 337191 is divided by 67047. 1956 Calculate the remainder when 2333823 is divided by 14771. 5 What is the remainder when 55514 is divided by 24? 2 Calculate the remainder when 62566 is divided by 15344. 1190 Calculate the remainder when 7165924 is divided by 387. 232 Calculate the remainder when 75417070 is divided by 43418. 4 Calculate the remainder when 1601735 is divided by 533618. 881 Calculate the remainder when 927705 is divided by 1391. 1299 Calculate the remainder when 10154722 is divided by 7. 4 What is the remainder when 384270 is divided by 384214? 56 Calculate the remainder when 27310 is divided by 9103. 1 Calculate the remainder when 28006 is divided by 8989. 1039 What is the remainder when 45556693 is divided by 159? 13 What is the remainder when 111471958 is divided by 15? 13 What is the remainder when 43402 is divided by 2881? 187 What is the remainder when 231608 is divided by 3676? 20 Calculate the remainder when 5315471 is divided by 947. 907 What is the remainder when 164340937 is divided by 9662? 9641 Calculate the remainder when 4862534 is divided by 275. 259 Calculate the remainder when 534080 is divided by 534058. 22 Calculate the remainder when 225235 is divided by 834. 55 What is the remainder when 933912 is divided by 133393? 161 Calculate the remainder when 53101675 is divided by 62. 39 Calculate the remainder when 1856307 is divided by 4937. 4932 Calculate the remainder when 710993 is divided by 71. 70 What is the remainder when 3602932 is divided by 2456? 2436 What is the remainder when 112972216 is divided by 8817? 8812 Calculate the remainder when 76102907 is divided by 13. 10 Calculate the remainder when 197415469 is divided by 790. 789 What is the remainder when 4914117 is divided by 14? 5 Calculate the remainder when 72979097 is divided by 44. 37 Calculate the remainder when 21990218 is divided by 490. 488 What is the remainder when 8066461 is divided by 23381? 16 What is the remainder when 1128806 is divided by 80628? 14 What is the remainder when 34578223 is divided by 2388? 2371 Calculate the remainder when 155920155 is divided by 77960069. 17 Calculate the remainder when 13476200 is divided by 37643. 6 What is the remainder when 1016315 is divided by 4? 3 Calculate the remainder when 20319 is divided by 5038. 167 Calculate the remainder when 54106 is divided by 272. 250 What is the remainder when 1019080762 is divided by 4374? 4372 What is the remainder when 93364 is divided by 146? 70 Calculate the remainder when 18250190 is divided by 101. 96 What is the remainder when 416702 is divided by 136? 134 Calculate the remainder when 256806 is divided by 28534. 0 Calculate the remainder when 772749 is divided by 171. 0 What is the remainder when 2263599 is divided by 150905? 24 Calculate the remainder when 204626 is divided by 2156. 1962 What is the remainder when 472383 is divided by 236176? 31 What is the remainder when 10047714 is divided by 411? 408 What is the remainder when 953661 is divided by 3506? 29 Calculate the remainder when 13968 is divided by 13152. 816 What is the remainder when 40569937 is divided by 178? 177 What is the remainder when 168711 is divided by 699? 252 What is the remainder when 249361134 is divided by 21? 15 What is the remainder when 7248685 is divided by 492? 49 What is the remainder when 4501275 is divided by 112? 107 What is the remainder when 233646 is divided by 70? 56 What is the remainder when 5661789 is divided by 23? 17 Calculate the remainder when 535240117 is divided by 23. 10 What is the remainder when 4775 is divided by 4098? 677 Calculate the remainder when 250388 is divided by 4909. 29 Calculate the remainder when 5123080 is divided by 1707693. 1 What is the remainder when 108269 is divided by 21647? 34 What is the remainder when 13031 is divided by 678? 149 What is the remainder when 6581177 is divided by 3290584? 9 Calculate the remainder when 4410877 is divided by 1552. 93 Calculate the remainder when 3604352 is divided by 19804. 24 What is the remainder when 42375666 is divided by 55? 36 What is the remainder when 117179	{ "pile_set_name": "DM Mathematics" }
0039 Let h = -2647 + 2646.999970964. Round h to 5 dps. -0.00003 Let h = -358249409386 + 505084650220. Let q = h - 146835240171.999999587. Let m = -662 + q. What is m rounded to 7 decimal places? 0.0000004 Let x = 524 - 282. Let s = x - 155. Suppose 68 = sf - 89f. What is f rounded to the nearest ten? -30 Let g = 13.509999854 + -13.51. What is g rounded to 7 decimal places? -0.0000001 Let m = -72 + 0. Let d = 72.0000227 + m. Round d to 6 dps. 0.000023 Let x = -3918.45 + 20667.55. Round x to the nearest 100. 16700 Let l(p) = -5p + 102. Let q be l(19). Suppose qd - 2220 - 16890 = 0. Round d to the nearest one hundred. 2700 Suppose o + 2j - 1358382 = 185630, 5 = 5j. Suppose 4w + 5p + 1543992 = 9p, -o = 4w + 5p. Round w to the nearest ten thousand. -390000 Suppose 25 = 4o + 9. Let v = 14 + o. Suppose 17s - 11100000 = vs. Round s to the nearest 1000000. -11000000 Let r = 380.51 - 393. Let a = 2.19 + r. Let k = -4.1 - a. Round k to the nearest 10. 10 Let t = 2753.98277 + -2754. What is t rounded to two dps? -0.02 Let y = -323241805.39999716 + 323241813. Let v = -7.6 + y. Round v to seven decimal places. 0.0000028 Let k = 32602 + -9799. Let x = k + -22852.012. Let o = x - -49. What is o rounded to 2 dps? -0.01 Let b = 501 + -656. Let f = 155.000000442 + b. What is f rounded to seven decimal places? 0.0000004 Suppose 0 = -5p + 11 + 9. Suppose -v + 2102 = -pq, 2v + 5q - 8q = 4214. Suppose 760 = -7t - v. What is t rounded to the nearest one hundred? -400 Let h = -1282.8 + 1030.88. Let g = h - -260. What is g rounded to the nearest integer? 8 Let n = -2.44807 + 2.7242. What is n rounded to 2 decimal places? 0.28 Let h = -99108710 - -143948710. Round h to the nearest one million. 45000000 Let g = 303 - 496. Let v = 192.9974 + g. What is v rounded to 4 dps? -0.0026 Let l = -625203.0457 - -625273. Let x = -70 + l. What is x rounded to two decimal places? -0.05 Let h = -2242 + 2241.9996915. What is h rounded to five decimal places? -0.00031 Suppose 27 = 3a + 18. Suppose -az - 86730000 = -10z. Suppose 0 = -0i - 3i - z. Round i to the nearest one million. -4000000 Let r(a) = a3 + 34a*2 + 14a - 151. Let w be r(23). Round w to the nearest ten thousand. 30000 Let y = -29127.00069865 + 29127. What is y rounded to five dps? -0.0007 Let o = 562 - 231. Let a = -257813.98623 + 257482.98622394. Let d = a + o. Round d to six decimal places. -0.000006 Let o be -4 + (3 - 3) - (-537607 + 3). Round o to the nearest one hundred thousand. 500000 Let n(j) = -82182j2 + 14j + 4. Let v(k) = -6k + 29. Let h be v(7). Let o be n(h). Let w = o - -22188936. Round w to the nearest 1000000. 8000000 Let s = -1607 + 3176. Let d = -1568.999321 + s. What is d rounded to 5 decimal places? 0.00068 Let v = -15502.75 + -140.95. What is v rounded to the nearest one thousand? -16000 Let i = 350.4 - 350.400003683. Round i to seven decimal places. -0.0000037 Let c be (-46)/((-9)/(-5) + (-1)/(-5)). Let m(d) = 937d + 36. Let p be m(c). Let l = p + 14535. Round l to the nearest one thousand. -7000 Let d = 1251893 - 400643. Suppose -3p + 2z = -2135992, 2708766 = 5p + 4z - d. What is p rounded to the nearest one hundred thousand? 700000 Let x = -0.04784 - -29.04784. Let z = 1661.045509 + -1690.0455. Let i = x + z. Round i to five decimal places. 0.00001 Suppose -5u - 2077 = -4q + 2967, -2u + 2504 = 2q. Let t = q - 482. Round t to the nearest 10. 770 Let l = -0.019 + 0.39. Let n = -0.997 + l. Let t = 1.177 + n. Round t to 1 dp. 0.6 Let p = 20148 - 20148.00000050678. Round p to 7 decimal places. -0.0000005 Let f = 5.9652 + -6.05. Let b = f + 0.07502. Round b to three dps. -0.01 Let p = -2.591 - -2.76676. Round p to three dps. 0.176 Let v = -5.679 - -5.6756877. Round v to 4 dps. -0.0033 Let v(o) = o*3 + 11o*2 + 25o + 11. Let r be v(-8). Let a be (1920/r)/(32/240). Round a to the nearest 100. 4800 Let v(m) = -5821911m2 + 62m + 13. Let x be v(3). Round x to the nearest one million. -52000000 Suppose -29031407 = 52x + 87380993. Round x to the nearest one hundred thousand. -2200000 Let h be (78/4)/((-30886352)/(-7721600) + -4). What is h rounded to the nearest 10000? -3140000 Let l(w) = -17w + 42. Let d be l(-5). Suppose 5b - d - 473 = 0. Round b to the nearest 10. 120 Let x = 10163.78 - 10316. Let r = 136.6 + 18.4. Let m = x + r. Round m to one decimal place. 2.8 Let i(d) = 6d - 22. Let a be i(4). Let s(t) = -2325t3 + t - 2. Let c be s(a). Round c to the nearest 10000. -20000 Let p = -733 - -494. Let q = p - -248.7. What is q rounded to 0 decimal places? 10 Let q(c) = 3c*2 + 1. Let k be q(1). Suppose 4m = -2p + 2579992, -5p - 1290004 = -2m - kp. Round m to the nearest one hundred thousand. 600000 Let r = -17662866 + 11614866. What is r rounded to the nearest 100000? -6000000 Suppose 0t - 10t = -30. Suppose -4f - 8442 - 5938 = -5u, u + 10766 = -tf. What is f rounded to the nearest one hundred? -3600 Let u be (-1 - -9)-34/16. Let d be 2/u + (-276)/36. Let h be (-927995)/20 - (-2)/d. Round h to the nearest one thousand. -46000 Let m = -627.9 - -699.69. Let q = 7.19 - m. What is q rounded to zero dps? -65 Let x = -53396.055493 + 53396. Round x to four dps. -0.0555 Let s = 4.292 + -4.20955. Round s to three decimal places. 0.082 Let t be 8/(-3)18/(-12). Let c be -26(2/(-4) + -1). Let s be (2 - (c - -3))/(t/322000). What is s rounded to the nearest 100000? -3200000 Let s = -10027 + 10016.679. Let p = 11.63 + s. Round p to one decimal place. 1.3 Let g = 22.49 - 12.9. Let t = -22.56 + g. Let c = 13 + t. Round c to two dps. 0.03 Let z = 20885 + -20884.990501. What is z rounded to 3 decimal places? 0.009 Suppose 0 = -6u + 5u. Suppose u = -5i - 5, -2l - i = 4 - 89. Let d = -43 + l. Round d to the nearest one hundred thousand. 0 Let o = 60534.9999895561 + -60535. What is o rounded to 7 decimal places? -0.0000104 Let s(a) = -1856606a + 12244. Let x be s(-26). What is x rounded to the nearest 1000000? 48000000 Let y = 0.4723 + 4.3598. What is y rounded to two dps? 4.83 Suppose 5m - 30008 = -2f, m + f - 5996 = 2f. Let u be m/(((-52)/(-3240))/13). What is u rounded to the nearest 100000? 4900000 Suppose 2y = 7y + 50. Let d(u) = -1390002u - 22. Let a(w) = 1390002w + 23. Let x(c) = -2a(c) - 3d(c). Let b be x(y). Round b to the nearest one million. -14000000 Let g = 157 + -194. Let d = 37.00033 + g. What is d rounded to four decimal places? 0.0003 Let j = -5425.1291 + 5426. What is j rounded to 1 dp? 0.9 Let b(q) = -24199q3 - q2. Let a(t) = t + 14. Let g be -210/15 + 35/(-3). Let m be a(g). Let l be b(m). Round l to the nearest 1000. -24000 Let y = 2390281902 + -2439225516.65. Let s = y - -48943662.65000062. Let h = s - 48. What is h rounded to seven dps? 0.0000006 Let g = -236.3 + 19.3. Let x = g - -217.00000037. What is x rounded to seven decimal places? 0.0000004 Let n = 298.6592127 - 75.6591678. Let r = 223 - n. Round r to 6 dps. -0.000045 Let w be 64/14 + -5 + (-1592)/(-56). Let p be (-1 - w)(3 + -86). Round p to the nearest 100. 2400 Let k = 219 - 216. Let t be (k + 416/(-12))-66. What is t rounded to the nearest 100? 2100 Let v be 340106 - 1 - (-4 + -8)/3. Let o = 103525 - v. Let l = -6303416 + o. Round l to the nearest one million. -7000000 Let o = 65.4 + 0.6. Let u = -12.1717 - 53.8312. Let m = o + u. Round m to 4 dps. -0.0029 Let z = 46 - 229. Let t = z - -333. Round t to the nearest 100. 200 Suppose -o + 2z + 625389 = -739164, 0 = -3o + 2z + 4093675. Let m be (-1)/((-4)/7898250) - 15/10. Let n = m - o. Round n to the nearest 100000. 600000 Suppose 47631229 = 55q - 74543791. Suppose 4s = 1977034 + 505510. Suppose s = -14c - q. What is c rounded to the nearest ten thousand? -200000 Let h = 4875246 + -4875245.3270614. Let d = 0.673 - h. Round d to six dps. 0.000061 Let c = -1657874 - 2316301. Let r = c + 2834175. Round r to the nearest 1000000. -1000000 Let f = 2162.9999999345 - 2163. What is f rounded to 6 decimal places? 0 Let m = 32335 - 30116.08. Let g = 2266 - m. Round g to the nearest integer. 47 Let a(s) = 422162s - 14. Let x be a(-9). Let o be ((-1)/(-3) - 10/(-6)) + x. Let u = -699470 - o. Round u to the nearest one million. 3000000 Let b = 305.1987 + -307.42. Round b to 1 decimal place. -2.2 Let i = 1412	{ "pile_set_name": "DM Mathematics" }
1/420 Two letters picked without replacement from ufffffffufufffffffff. What is prob of sequence uu? 3/190 Two letters picked without replacement from {k: 2, p: 2}. What is prob of sequence kp? 1/3 Two letters picked without replacement from ksisisisisoso. Give prob of sequence os. 1/13 What is prob of sequence bc when two letters picked without replacement from {c: 14, b: 4}? 28/153 Two letters picked without replacement from zrxxzzxrx. What is prob of sequence zr? 1/12 Calculate prob of sequence brbb when four letters picked without replacement from {b: 5, r: 2}. 1/7 What is prob of sequence pppp when four letters picked without replacement from ppprppppppppppppppp? 15/19 Two letters picked without replacement from pttp. What is prob of sequence tt? 1/6 Four letters picked without replacement from {x: 2, l: 1, e: 6, d: 2}. Give prob of sequence exxl. 1/660 Three letters picked without replacement from {r: 3, d: 15}. What is prob of sequence drr? 5/272 Three letters picked without replacement from seeeo. Give prob of sequence ses. 0 Three letters picked without replacement from {t: 1, d: 7, y: 9, s: 2}. Give prob of sequence dss. 7/2907 Calculate prob of sequence lrbb when four letters picked without replacement from bbllrbbrr. 1/42 What is prob of sequence ruh when three letters picked without replacement from rhaunguhn? 1/126 Calculate prob of sequence qgc when three letters picked without replacement from gpcqcpckcpqqpqgp. 1/105 Three letters picked without replacement from iiibiayirbavvbv. What is prob of sequence rbi? 1/182 Calculate prob of sequence aku when three letters picked without replacement from {k: 1, j: 1, g: 1, a: 1, u: 1}. 1/60 Four letters picked without replacement from {b: 1, h: 5, x: 2, z: 1, n: 3}. Give prob of sequence znnb. 1/1980 What is prob of sequence sb when two letters picked without replacement from {b: 2, f: 5, s: 2}? 1/18 What is prob of sequence ttzi when four letters picked without replacement from ztzztitzitit? 2/99 Two letters picked without replacement from {q: 2, r: 1, m: 2}. Give prob of sequence mm. 1/10 Two letters picked without replacement from {m: 1, o: 1, s: 1, t: 1, a: 1}. Give prob of sequence ta. 1/20 Calculate prob of sequence giig when four letters picked without replacement from eeiggeiee. 1/756 What is prob of sequence pt when two letters picked without replacement from {e: 1, d: 1, t: 1, p: 2}? 1/10 Four letters picked without replacement from wkkcbwbwwbwkwwwwbb. Give prob of sequence kbkk. 1/2448 What is prob of sequence mlu when three letters picked without replacement from {b: 1, u: 8, m: 5, l: 2, t: 3}? 40/2907 Two letters picked without replacement from {l: 1, y: 1, w: 1, u: 1, n: 1, r: 2}. Give prob of sequence un. 1/42 Two letters picked without replacement from nbbbnnnn. Give prob of sequence nb. 15/56 Three letters picked without replacement from xxxxxxcrrxcrchh. What is prob of sequence xrx? 3/65 Four letters picked without replacement from {b: 8, n: 4, s: 4}. Give prob of sequence nbss. 4/455 What is prob of sequence fes when three letters picked without replacement from sfehhhs? 1/105 Two letters picked without replacement from {a: 5}. Give prob of sequence aa. 1 Four letters picked without replacement from vvvvisixisssix. What is prob of sequence isss? 4/1001 Two letters picked without replacement from {x: 3, f: 1, z: 1, w: 3, r: 3, g: 2}. Give prob of sequence xf. 1/52 Three letters picked without replacement from {r: 5, d: 5, s: 3, g: 2, i: 4}. Give prob of sequence gdr. 25/2907 Four letters picked without replacement from {m: 4, w: 5, r: 5}. What is prob of sequence rmrm? 10/1001 What is prob of sequence ssp when three letters picked without replacement from {v: 2, p: 9, s: 5}? 3/56 Two letters picked without replacement from smjjljtsssyjmsl. What is prob of sequence sl? 1/21 Two letters picked without replacement from xfcfcwfffcfwc. Give prob of sequence cc. 1/13 Four letters picked without replacement from iiiijiji. What is prob of sequence jiii? 1/7 Two letters picked without replacement from {t: 4, e: 2}. What is prob of sequence tt? 2/5 What is prob of sequence qqf when three letters picked without replacement from {q: 3, f: 2, l: 4}? 1/42 Three letters picked without replacement from nnnnonnnnnonn. What is prob of sequence noo? 1/78 Calculate prob of sequence izp when three letters picked without replacement from znzimzzknzpzkz. 1/312 Four letters picked without replacement from fpnupgegfpgfggn. What is prob of sequence fpef? 1/1820 What is prob of sequence ppt when three letters picked without replacement from {t: 2, p: 5, u: 6}? 10/429 What is prob of sequence hrxh when four letters picked without replacement from hhhhxhhhrhhhhhrr? 33/3640 Three letters picked without replacement from nttn. What is prob of sequence nnn? 0 Calculate prob of sequence bbb when three letters picked without replacement from bhehbehbehbh. 1/55 What is prob of sequence vmm when three letters picked without replacement from {m: 16, v: 3, j: 1}? 2/19 What is prob of sequence va when two letters picked without replacement from aqav? 1/6 What is prob of sequence hiii when four letters picked without replacement from iiihhhhihhhhihhihiii? 77/1615 Calculate prob of sequence uiu when three letters picked without replacement from {i: 5, u: 8}. 70/429 Four letters picked without replacement from {h: 2, w: 4}. What is prob of sequence whhw? 1/15 Two letters picked without replacement from {h: 3, f: 4, c: 1}. What is prob of sequence hh? 3/28 Calculate prob of sequence dddd when four letters picked without replacement from wddddw. 1/15 Two letters picked without replacement from ilipiipllpi. What is prob of sequence ip? 3/22 Two letters picked without replacement from xxxyxxyyyyxyxxxuxx. What is prob of sequence yy? 5/51 Calculate prob of sequence uogm when four letters picked without replacement from {q: 1, u: 2, g: 1, m: 1, o: 2}. 1/210 Calculate prob of sequence if when two letters picked without replacement from {i: 6, f: 2, o: 2, a: 2}. 1/11 Three letters picked without replacement from grjjswnrngjr. Give prob of sequence sjr. 3/440 Two letters picked without replacement from nvnnnlvvlvynnvnn. Give prob of sequence nn. 7/30 Four letters picked without replacement from {o: 8, b: 3, q: 5}. What is prob of sequence bqob? 1/182 Four letters picked without replacement from {p: 3, d: 6, m: 3, v: 1, x: 5}. Give prob of sequence dvdp. 1/816 Two letters picked without replacement from exedeeoedlleelllee. Give prob of sequence dl. 5/153 Three letters picked without replacement from gigwtwooitwoit. Give prob of sequence oow. 3/364 Two letters picked without replacement from {o: 3, h: 9}. Give prob of sequence hh. 6/11 What is prob of sequence ft when two letters picked without replacement from {f: 3, g: 5, t: 7, b: 4}? 7/114 What is prob of sequence bbib when four letters picked without replacement from {b: 5, i: 2}? 1/7 What is prob of sequence tr when two letters picked without replacement from {r: 5, k: 1, g: 6, t: 1, a: 6}? 5/342 Three letters picked without replacement from {e: 4, j: 4, k: 2, p: 1, n: 7}. Give prob of sequence nee. 7/408 Three letters picked without replacement from dbddbdddddddbddddddd. Give prob of sequence bbd. 17/1140 Two letters picked without replacement from {a: 2, k: 1, y: 1, n: 1, o: 1, u: 1}. What is prob of sequence na? 1/21 Three letters picked without replacement from ssiswwiswiisswswis. Give prob of sequence wsi. 25/612 Two letters picked without replacement from {e: 3, f: 1, r: 1}. What is prob of sequence er? 3/20 Two letters picked without replacement from {q: 10, x: 4}. What is prob of sequence qq? 45/91 What is prob of sequence xx when two letters picked without replacement from eyxeyyxeymezmxyey? 3/136 Four letters picked without replacement from {t: 3, e: 5, c: 3, b: 5, q: 2}. Give prob of sequence qtec. 1/816 Three letters picked without replacement from {b: 2, f: 6, i: 3, n: 1, m: 2, v: 1}. Give prob of sequence ibn. 1/455 Calculate prob of sequence hhh when three letters picked without replacement from {y: 2, h: 3}. 1/10 Three letters picked without replacement from {z: 1, p: 2, u: 1, t: 1}. Give prob of sequence zut. 1/60 Three letters picked without re	{ "pile_set_name": "DM Mathematics" }
(1 + sqrt(2) + -2)2 + -5 - ((sqrt(450) - sqrt(50))2 + 3 - (sqrt(200)/sqrt(16))*2)). -12sqrt(2) + 774 Simplify (2(-1sqrt(1125))/sqrt(5))/(((2sqrt(240))/sqrt(8))/(sqrt(360)1)). -30sqrt(3) Simplify ((-2(sqrt(286) + (sqrt(286)-1 - sqrt(286))) - sqrt(286))/(sqrt(1331) - sqrt(1331)-1))/(sqrt(10)/sqrt(245) + sqrt(128) + 1sqrt(128) + sqrt(128)). 7sqrt(13)/3718 Simplify 5(1 + (-5(sqrt(100) + -2sqrt(100)) + sqrt(100) + -12sqrt(100))/(sqrt(24)/(sqrt(24)/(-2sqrt(2))))). -50sqrt(2) + 5 Simplify (-5((sqrt(420) - 6(sqrt(420)-1 - sqrt(420)))/sqrt(7))/(sqrt(108)-32))*2. 21125/324 Simplify 3 + (2 + -6((sqrt(1300) - sqrt(1300)-1 - sqrt(1300)) + sqrt(1300)) - 2(sqrt(1300) + sqrt(1300) + sqrt(1300) + -1 + 4 + sqrt(1300)))*2 + -3. 1600sqrt(13) + 520016 Simplify (-4(-2sqrt(325) - 4(sqrt(13) - (sqrt(13) + 0))))2 + (6sqrt(117) + 0)4. 72sqrt(13) + 20800 Simplify (1sqrt(77)6 - sqrt(77) - sqrt(77))/((-2sqrt(11) - sqrt(11))-5) - (-2 + sqrt(343) - (sqrt(28)4)/sqrt(4)). -41sqrt(7)/15 + 2 Simplify (-5((sqrt(468) - (0 + sqrt(468) + 3 - sqrt(468)) - (-6(-1 + sqrt(468)) - sqrt(468))) + (-4 + sqrt(468) + sqrt(468) + -1)-4)-1)*2. 3025 Simplify (((4(-3sqrt(96) + sqrt(96) + sqrt(96) - sqrt(96)) - sqrt(96)) + sqrt(96) + sqrt(96) + sqrt(96))/sqrt(4))/(sqrt(72)/(sqrt(45)/(sqrt(10)/sqrt(2)))). -6sqrt(3) Simplify (-1 + (sqrt(891) - (-5(sqrt(891) + 2) + sqrt(891)) - (2 + 2sqrt(891))) + -4)*2-6-3. 2916sqrt(11) + 144504 Simplify -3 + (3(sqrt(1331)1 + -1) + (sqrt(1331)1 - sqrt(1331)) + -1 + 3(sqrt(1331) - (0 + sqrt(1331))))*2-3. -35988 + 792sqrt(11) Simplify (-2sqrt(80)/(sqrt(40)/(sqrt(8)-2)))/(5((sqrt(968) - 1(sqrt(968) + sqrt(968)-2)) + sqrt(968))). 4sqrt(2)/165 Simplify ((2sqrt(5040)6)/(3(sqrt(567) - (sqrt(567) - (sqrt(567) - sqrt(567)4) - sqrt(567)) - sqrt(567))) + -2)2. 64sqrt(5)/9 + 1604/81 Simplify ((-6sqrt(99)1 - (sqrt(99) - sqrt(99)-1)-5)-6)/((sqrt(81)-14)/(sqrt(18)/sqrt(2)-6 + sqrt(9))). -30sqrt(11) Simplify (((-1 + sqrt(1872) + -2 - 1sqrt(1872)2) + (-3 + sqrt(1872) + 1)-5)-1-6)*2. -36288sqrt(13) + 2427876 Simplify (sqrt(176)-316 - ((sqrt(176) - (sqrt(176) - 2sqrt(176)-3 - sqrt(176))) + sqrt(176)-1 + 3))*2 + 4. 288sqrt(11) + 25357 Simplify ((-5(1sqrt(121) + sqrt(121)) + -3sqrt(121)4)/(-4sqrt(132)/(1sqrt(12)-6)))2. 11979 Simplify ((-1(sqrt(132)3 + sqrt(132)) - sqrt(132))5)/(sqrt(24)/sqrt(2)6 - (sqrt(12) + 2sqrt(1452) + sqrt(1452) + sqrt(12))). 25sqrt(11)/29 Simplify 2 + -1sqrt(500) + 0 + sqrt(80) + sqrt(80)4 + sqrt(5) + -4. -2 + 11sqrt(5) Simplify (34(sqrt(833) - (3 + sqrt(833)))-4 + -5-3(sqrt(833) + 1 + sqrt(833))-4)*2. -141120sqrt(17) + 12002256 Simplify 4 + (sqrt(468) + sqrt(468) + 2 + sqrt(468))4 + ((sqrt(637) + 1)-3 + -2 + -1 + sqrt(637))*2. 240sqrt(13) + 2596 Simplify -4 + 4(1sqrt(1900) + sqrt(1900)) + sqrt(1900) + ((sqrt(1900) + 2)5 - sqrt(1900))2 + 1 + 0. 890sqrt(19) + 30497 Simplify 0 + -3 + (4 + (sqrt(2057) - -3(sqrt(2057) + 0)) - (2 + 0 + sqrt(2057))-6). 13 + 110sqrt(17) Simplify -3 + (((sqrt(200) - sqrt(50))-4)/(sqrt(5) + (sqrt(5) + sqrt(10)/sqrt(2))-3))/(-1(sqrt(45)/sqrt(3)5)/sqrt(3)). -3 - 4sqrt(2)/25 Simplify (((sqrt(91) - -43sqrt(91)) + ((sqrt(91) + (-3sqrt(91) + sqrt(91) - sqrt(91)))1 - sqrt(91) - sqrt(91)))/(34(-1sqrt(252) - sqrt(252))))2. 13/256 Simplify (sqrt(360)/(sqrt(32)/sqrt(4)))/(sqrt(9) + sqrt(900)) + ((sqrt(125) + -1 - sqrt(125))2 - sqrt(5) - sqrt(5)) + sqrt(5) + sqrt(405) + -2. -1 + 89sqrt(5)/11 Simplify 1 + (((sqrt(240) + sqrt(240)1)/sqrt(12) - sqrt(80)-3)/(sqrt(576)-2-3) + -3)4. -11 + 4sqrt(5)/9 Simplify -4(4sqrt(152)1 + -6(sqrt(152) + (sqrt(152) - -2sqrt(152))))/(sqrt(64)/(sqrt(392)-4)). -2240sqrt(19) Simplify ((sqrt(50)/((sqrt(90)/sqrt(3))/sqrt(6)))/(sqrt(60)/sqrt(3) + -1sqrt(180)))*2-2. -1/4 Simplify (((sqrt(637) + 0)2 + 2 - (1 + (sqrt(637) + -4)2)) + 1)-3. -168sqrt(13) + 42 Simplify (sqrt(135)/(-2sqrt(9))-6-1)/(sqrt(1200) - ((sqrt(1200) - -5(-1sqrt(1200) + sqrt(1200))) + sqrt(1200) + sqrt(1200))). 3sqrt(5)/40 Simplify (-2 + ((sqrt(425) - (sqrt(425) - sqrt(425)3))-4 - ((-2sqrt(425))2 + -2)) + -2)6. -10212 - 360sqrt(17) Simplify 0 + ((sqrt(75) - -6(sqrt(75) - sqrt(75)4)) + 1 + (0 + (sqrt(75) + -3)5)*2)2. -1670sqrt(3) + 4202 Simplify 5 + (31sqrt(187) - (sqrt(187) - (sqrt(187) - (sqrt(187) - ((sqrt(187) - (-1sqrt(187) - sqrt(187))2) + sqrt(187))))))/(1sqrt(539)-3 - sqrt(539)). -2sqrt(17)/7 + 5 Simplify 0 + (1 + sqrt(208) + 1 + sqrt(208) + 2)*2 + (3 + sqrt(78)/sqrt(6) - (sqrt(468)-3)*2). -3361 + 65sqrt(13) Simplify 4((sqrt(1225) - (sqrt(1225)-1 + sqrt(1225) - sqrt(1225))-6) + -4(sqrt(1225)-1 - sqrt(1225)))/(2-2sqrt(405)2). -7sqrt(5)/6 Simplify -6((4sqrt(399))/sqrt(7))/sqrt(3) - (2sqrt(152)-5)/(sqrt(72)-1). -82sqrt(19)/3 Simplify (-1 + 1((sqrt(48) - (sqrt(2352) + 1sqrt(2352)) - (sqrt(972) + 0)) + -3))2. 560sqrt(3) + 14716 Simplify (5((1 + sqrt(468)1 - 42sqrt(468) - ((-1 + sqrt(468) - sqrt(468)) + -1 - (sqrt(468) + 0)-1)) + 5))2. -19200sqrt(13) + 750400 Simplify -2(((sqrt(405) + 1)-4 - (sqrt(405) - ((0 + 1sqrt(405) - sqrt(405)) + sqrt(405))))12-6)*2. -1870848 - 82944sqrt(5) Simplify (-1(1 + sqrt(1216))1 + (5-2sqrt(228))/(sqrt(192)-2 + sqrt(12)) + 3)2. -184sqrt(19)/7 + 40400/49 Simplify 4 + 5(4 + (sqrt(208) - -1(sqrt(208) + (1sqrt(208))2)) + -3)2. 80sqrt(13) + 2094 Simplify (sqrt(66) - (sqrt(66) - sqrt(66)-1-5) - sqrt(66)26)/(1sqrt(864)2 - (-5(sqrt(864) - sqrt(864)-2) + sqrt(864) + sqrt(864))). -7sqrt(11)/180 Simplify (sqrt(5600)-14 - (4(sqrt(5600) + sqrt(5600)1 - sqrt(5600)) + sqrt(5600)))/((-42sqrt(48))/(sqrt(18)/sqrt(3)-3)). -135sqrt(7)/4 Simplify (-54(sqrt(363) + (-2sqrt(363) - sqrt(363))3 + 6(sqrt(363) + sqrt(363) + 0) - (4sqrt(363)-1 + sqrt(363) + sqrt(363) + 0))1)*2. 5227200 Simplify (3(sqrt(495)6 + sqrt(55))4)/((sqrt(1584) + -53sqrt(1584))-3). 19sqrt(5)/42 Simplify 1-6(sqrt(336) - (sqrt(336) + -51sqrt(336)))/(-4(sqrt(175)2 + sqrt(175))). 2sqrt(3) Simplify ((-4 + 0 + sqrt(39)/sqrt(3) + 2)2 + 0 - (sqrt(52)/(sqrt(24)/sqrt(96)) - (-3 + sqrt(1300) + 0))2)-3. -96sqrt(13) + 1380 Simplify 0 + (((sqrt(153) - (3 + sqrt(153) + -2)) + sqrt(153) + 2sqrt(153)-1)4)*2 + -5. 96sqrt(17) + 2459 Simplify ((-3sqrt(120)-1)/sqrt(2))/((-1sqrt(132)2)/sqrt(11)). -3sqrt(5)/2 Simplify (-5 + sqrt(325)-1 + -5 - (sqrt(325)52 - sqrt(325) - sqrt(325))-3)4. -40 + 460sqrt(13) Simplify -4 + (-5 + ((sqrt(1008) + 1 + sqrt(1008))3 - -2sqrt(1008)-6) + sqrt(1008)2 + -1 + -1 + sqrt(1008) + -3 + 3)2. 288sqrt(7) + 9084 Simplify (-3-2sqrt(76)-1 - (-6sqrt(19)4 - (sqrt(19) + (-4sqrt(152) - sqrt(152) - sqrt(152))/sqrt(8))))*2. 931 Simplify (sqrt(68) + sqrt(68)22 + (sqrt(68)-3 - sqrt(68))-6)/(5-4sqrt(32)/sqrt(8)). -29sqrt(17)/20 Simplify -3(-1sqrt(4000)1 + sqrt(4000)-15)/((sqrt(8) + sqrt(648)2)2-4). -45sqrt(5)/38 Simplify ((sqrt(300) - -5sqrt(300)-1)/((sqrt(66)1)/sqrt(11)))/(-5(2sqrt(1210) + sqrt(1210) - sqrt(1210))-3). -2sqrt(5)/165 Simplify (((sqrt(55) - sqrt(110)/sqrt(2)4) + sqrt(55) - sqrt(55) - sqrt(165)/(-2sqrt(3)))4)/(6sqrt(5)-1 + (sqrt(10) - sqrt(90)/sqrt(9))/sqrt(2)). 5sqrt(11)/3 Simplify -1(sqrt(120)/sqrt(2)-5 + (sqrt(60) - (sqrt(8640) - sqrt(8640)-2)))/(-551sqrt(1452)). -8sqrt(5)/55 Simplify -1 + (-4((sqrt(1900) - 2sqrt(1900)) + 3) + -5 - 1((sqrt(1900) + 1)-6 - (sqrt(1900) + -4 + 1sqrt(1900) + sqrt(1900))))*2. -3900sqrt(19) + 321324 Simplify 5 + (-2 + (3(-1sqrt(130) - sqrt(130)))/(sqrt(40)/(sqrt(16)/sqrt(4))) + -5)4. -24sqrt(13) - 23 Simplify ((((sqrt(273) + 6sqrt(273)-2)/(-42sqrt(7)))/((sqrt(24) + (-2sqrt(216))/sqrt(9))/(sqrt(32)/sqrt(4)4)) + 5)-4)2. -880sqrt(13) + 6692 Simplify 1 + 2 + (-6(sqrt(900) - -1(1sqrt(900) - sqrt(900)))/(-3(sqrt(1728) - sqrt(1728)-1) - sqrt(1728) - sqrt(1728))2)*2. 267/64 Simplify (-4 + -1 + (sqrt(168)/(-2sqrt(8)))/(5sqrt(28)/sqrt(4)))-56. 3sqrt(3) + 150 Simplify 1 + (4sqrt(125))2 + -2 + (-1(sqrt(125) + -1sqrt(125)) + -6sqrt(125)1)2 + 1. 6500 Simplify ((4 + 1sqrt(2448))*2 - (-4 + -1sqrt(2448) + sqrt(2448))*2 - ((0 + sqrt(2448))-6 + -3*(	{ "pile_set_name": "DM Mathematics" }
kkgkkggoggggkok. What is prob of sequence okk? 1/34 What is prob of sequence nxcc when four letters picked without replacement from nxcnnnnzcncnqnnlxxq? 9/5168 What is prob of sequence ic when two letters picked without replacement from {r: 2, t: 2, i: 1, c: 1}? 1/30 Four letters picked without replacement from nrnscnsrrrrssr. Give prob of sequence sncs. 3/2002 Two letters picked without replacement from {c: 4, q: 7, l: 3}. Give prob of sequence cc. 6/91 Two letters picked without replacement from {v: 1, a: 2, w: 1, d: 1}. Give prob of sequence av. 1/10 What is prob of sequence zvv when three letters picked without replacement from {v: 5, z: 2, n: 3}? 1/18 What is prob of sequence jqoq when four letters picked without replacement from {j: 1, i: 1, o: 5, q: 4}? 1/132 Calculate prob of sequence lzll when four letters picked without replacement from {l: 10, z: 10}. 20/323 Calculate prob of sequence xox when three letters picked without replacement from {x: 5, o: 9, n: 2}. 3/56 Four letters picked without replacement from {t: 5, d: 5}. What is prob of sequence ttdd? 5/63 Calculate prob of sequence bxxb when four letters picked without replacement from bdxbbxx. 3/70 Three letters picked without replacement from {p: 3, w: 1}. Give prob of sequence ppw. 1/4 Four letters picked without replacement from rdridrrirhdrridrrdd. What is prob of sequence drrr? 21/646 What is prob of sequence vvvv when four letters picked without replacement from {f: 3, v: 7, k: 4}? 5/143 Two letters picked without replacement from {v: 1, s: 2, t: 1}. What is prob of sequence ss? 1/6 Two letters picked without replacement from fvbf. What is prob of sequence fv? 1/6 Two letters picked without replacement from {o: 3, u: 3, y: 6, s: 1, b: 1, z: 4}. What is prob of sequence uu? 1/51 What is prob of sequence oonn when four letters picked without replacement from {n: 2, o: 3}? 1/10 What is prob of sequence kiy when three letters picked without replacement from {k: 1, j: 4, i: 5, y: 6}? 1/112 Two letters picked without replacement from {u: 2, z: 3}. Give prob of sequence zu. 3/10 What is prob of sequence xxx when three letters picked without replacement from {x: 12, p: 1}? 10/13 Four letters picked without replacement from fefrqsq. Give prob of sequence fqes. 1/210 Three letters picked without replacement from mfofcooobcbb. Give prob of sequence mfo. 1/165 Two letters picked without replacement from dcnhddhdn. Give prob of sequence dn. 1/9 Calculate prob of sequence jyjj when four letters picked without replacement from {j: 7, y: 2}. 5/36 What is prob of sequence vvv when three letters picked without replacement from fffffvvfffffffv? 1/455 Two letters picked without replacement from {o: 1, l: 1, e: 2}. What is prob of sequence lo? 1/12 Calculate prob of sequence ihh when three letters picked without replacement from iiiiiiiihiiihiiihh. 7/204 Three letters picked without replacement from {c: 4}. Give prob of sequence ccc. 1 Three letters picked without replacement from livllludubullllbd. Give prob of sequence uvi. 1/1360 Two letters picked without replacement from gggdgyggygdgyy. What is prob of sequence yg? 16/91 Four letters picked without replacement from tctcctccgtccgt. Give prob of sequence cttg. 5/429 What is prob of sequence cbf when three letters picked without replacement from {c: 3, f: 3, b: 2, r: 3, v: 1, x: 4}? 3/560 Four letters picked without replacement from {v: 2, z: 3}. What is prob of sequence zvvz? 1/10 Three letters picked without replacement from {q: 2, n: 4, p: 3}. What is prob of sequence qqn? 1/63 Calculate prob of sequence sfn when three letters picked without replacement from soffecnssoef. 3/440 What is prob of sequence ddkk when four letters picked without replacement from {k: 13, d: 6}? 65/1292 Two letters picked without replacement from eqvekkvskkkkv. Give prob of sequence qk. 1/26 What is prob of sequence hjbf when four letters picked without replacement from bjhfmfnn? 1/840 Calculate prob of sequence zhsf when four letters picked without replacement from {h: 2, g: 1, f: 3, a: 6, s: 2, z: 1}. 1/2730 Calculate prob of sequence ehel when four letters picked without replacement from {w: 1, j: 1, l: 2, e: 2, x: 1, h: 1}. 1/420 What is prob of sequence pp when two letters picked without replacement from {p: 7, i: 3}? 7/15 Three letters picked without replacement from {i: 2, o: 7, x: 1}. What is prob of sequence oox? 7/120 What is prob of sequence vvp when three letters picked without replacement from {v: 3, o: 1, x: 1, i: 1, p: 1}? 1/35 What is prob of sequence eve when three letters picked without replacement from {z: 3, e: 2, t: 3, l: 1, v: 9}? 1/272 Three letters picked without replacement from ccecceeeceoeeocee. What is prob of sequence ooo? 0 Calculate prob of sequence gef when three letters picked without replacement from {f: 1, e: 7, p: 2, g: 8}. 7/612 Four letters picked without replacement from ttzttjywxtwtyywjt. What is prob of sequence tywy? 3/1360 What is prob of sequence urz when three letters picked without replacement from eeeerrzzrzerzeu? 8/1365 Two letters picked without replacement from uiuffuiiiioi. Give prob of sequence oi. 1/22 What is prob of sequence ggu when three letters picked without replacement from {g: 2, p: 2, u: 3, y: 2, k: 1, v: 4}? 1/364 Calculate prob of sequence yzyf when four letters picked without replacement from {y: 3, t: 1, f: 1, c: 1, z: 1}. 1/140 Calculate prob of sequence on when two letters picked without replacement from {o: 1, n: 2, q: 7, e: 3, z: 7}. 1/190 What is prob of sequence lllj when four letters picked without replacement from {f: 6, j: 2, i: 3, l: 5, u: 1}? 1/476 Calculate prob of sequence la when two letters picked without replacement from eeelalg. 1/21 Two letters picked without replacement from {i: 3, b: 4}. What is prob of sequence ii? 1/7 What is prob of sequence mzk when three letters picked without replacement from {h: 5, z: 3, k: 2, m: 5}? 1/91 What is prob of sequence xxm when three letters picked without replacement from dxdmdxdpdmmkmdddd? 1/510 Two letters picked without replacement from {l: 1, k: 2, d: 2}. Give prob of sequence lk. 1/10 Calculate prob of sequence omhf when four letters picked without replacement from {f: 1, a: 4, o: 6, m: 2, h: 7}. 7/9690 Three letters picked without replacement from jpdp. Give prob of sequence pdj. 1/12 Calculate prob of sequence jg when two letters picked without replacement from nzpjpoggznnn. 1/66 Calculate prob of sequence yy when two letters picked without replacement from {e: 1, y: 7}. 3/4 Two letters picked without replacement from izclclcizccci. What is prob of sequence zc? 1/13 What is prob of sequence fxft when four letters picked without replacement from {a: 6, s: 2, t: 1, f: 3, x: 1}? 1/2860 What is prob of sequence pm when two letters picked without replacement from kmkkkpkmkkkmkkk? 1/70 Four letters picked without replacement from qcccqcqcqcqc. What is prob of sequence cqcq? 7/99 Calculate prob of sequence rnrr when four letters picked without replacement from {r: 11, n: 3}. 45/364 What is prob of sequence qfq when three letters picked without replacement from qqqpqftqtqqqpqqqftqp? 11/285 Calculate prob of sequence ddnb when four letters picked without replacement from {d: 5, i: 1, n: 3, b: 11}. 11/1938 Calculate prob of sequence sv when two letters picked without replacement from ssrssssssvsssss. 13/210 Four letters picked without replacement from bbbbbbbbbbmm. Give prob of sequence mmbb. 1/66 What is prob of sequence ca when two letters picked without replacement from aajqddjdjdadjjcqdyaa? 1/76 Three letters picked without replacement from axixaxauaaaaaaaxx. Give prob of sequence xia. 5/408 Four letters picked without replacement from ozzzzzoo. Give prob of sequence zooo. 1/56 Two letters picked without replacement from {l: 1, s: 2, n: 10, c: 2, p: 2, d: 1}. Give prob of sequence cc. 1/153 Three letters picked without replacement from {p: 2, u: 4}. Give prob of sequence ppu. 1/15 Four letters picked without replacement from ixxixxxxix. What is prob of sequence xiii? 1/120 Three letters picked without replacement from {e: 6, r: 6}. What is prob of sequence rer? 3/22 Calculate prob of sequence nnm when three letters picked without replaceme	{ "pile_set_name": "DM Mathematics" }
11391d. Let f(u) = 3u. Give z(f(n)). 34173n Let o(d) be the second derivative of -d3/3 + 2d. Let w = 18 + -13. Let c(m) = 0m2 - 4m*2 + wm*2. Give o(c(g)). -2g*2 Let w(a) = 12a. Let p(q) = 62q2. Calculate p(w(n)). 8928n2 Let p(k) be the second derivative of k5/15 - k*2 + k. Let s(g) be the first derivative of p(g). Let i(d) = d. What is i(s(v))? 4v*2 Let i(t) = 2t*2 - 2t. Let s(y) be the first derivative of 4y3/3 - 5y*2/2 - 2. Let r(n) = 5i(n) - 2s(n). Let q(d) = -d - d + 4d. What is r(q(v))? 8v2 Let b(x) = 2x + 3. Suppose 0 = m + 4m. Let t(a) = m + 3a + 4 + 0. Let r(k) = -4b(k) + 3t(k). Let v(j) = -3j2. Give r(v(y)). -3y*2 Let f(m) = -3m. Let h(j) be the second derivative of -j*4/6 + 3j*2 + 4j. Let y(n) be the first derivative of h(n). What is y(f(k))? 12k Let q(a) be the second derivative of a4/12 - 9a. Let v(c) = -2c + 3. Determine v(q(k)). -2k*2 + 3 Let t(p) = 1464p - 1. Let f(y) = 5y. Calculate t(f(k)). 7320k - 1 Let d(i) be the first derivative of -i*4/12 - 2i + 2. Let f(n) be the first derivative of d(n). Let y(z) = -4 + z + 0 + 4. Give f(y(h)). -h*2 Let y(z) = -z. Let i(o) = 2o. Let x(c) = 4i(c) + 5y(c). Let v(m) = -9m2. Calculate v(x(k)). -81k*2 Let g(k) = -2k*2. Suppose 0n - 5n = 4m - 14, -2n - m + 5 = 0. Let w(h) = -nh*2 - h + h. Determine g(w(f)). -8f*4 Let z(f) be the first derivative of 0f - 2 + 2/3f3 + 0f2. Let v(u) = -u2 + 2u. Let h(x) = 3x*2 - 5x. Let s(w) = -2h(w) - 5v(w). Give s(z(r)). -4r4 Let h(f) be the third derivative of 1/8f*4 + 0 + 0f + 0f3 - 2f*2. Let n(s) = -2s*2 + 4s*2 + s - s. What is h(n(l))? 6l*2 Let u be (-16)/(-10)15/6. Suppose 5q = -2k + 33, -4q + 40 = 4k + k. Let h(i) = i - 2i2 - qi + ui. Let l(m) = -5m. Give l(h(c)). 10c2 Let s(d) = d + 87 - 45 - 42. Let x(k) = -27k*2. What is x(s(g))? -27g2 Let r(s) be the third derivative of -s4/8 + 4s2. Let u(g) = 9g*2. Determine u(r(o)). 81o*2 Let q(r) = 1464r. Let d(p) = -4p. Give q(d(k)). -5856k Let b(n) = -n. Let x(d) = d. Let m(c) = -7c. Let s(v) = -4m(v) - 20x(v). What is b(s(z))? -8z Let f(z) = -z*2. Let t(u) = 2 + 9u + 3 - 5u. Let o(k) = 2 + k - 3k + 4k. Let d(l) = 5o(l) - 2t(l). What is d(f(s))? -2s*2 Let p(u) = 45u. Let v(j) = -158 + 158 - j. Give p(v(l)). -45l Let g(b) = 2b - 21. Let h(v) = -v. Determine h(g(m)). -2m + 21 Let q(o) = -o. Let c(g) = -18g + 11. Let r(w) = 9w - 5. Let x(m) = 6c(m) + 13r(m). Calculate x(q(j)). -9j + 1 Let d(v) = 0v2 - 5v*2 + 4v2 - v2. Let i(t) = 4t. Determine d(i(s)). -32s*2 Let d(m) = 4m*2. Let l(r) = 59r. Determine d(l(v)). 13924v2 Let a(c) = 3c*2. Let t(v) = -v + 329. Determine t(a(s)). -3s*2 + 329 Let t(s) = -3s. Let q(j) be the first derivative of 0j + 8 + 2/3j*3 + 0j*2. What is t(q(b))? -6b*2 Let j(u) = 4u. Let d(y) = -16y - 14y - 15y + 41y. What is d(j(r))? -16r Let z(r) = -2r*2. Let g(x) be the first derivative of -5x*2/2 + 2x - 50. What is z(g(s))? -50s2 + 40s - 8 Let v(b) = b + 5. Let q be v(-8). Let z be (6 + -1)q/(-5). Let d(a) = a2 - za2 - a2. Let t(f) = 2f. Determine t(d(u)). -6u*2 Let o(n) = 12n. Let b(p) = 3p2. Calculate o(b(a)). 36a*2 Let d(j) = 4j*2. Let c(z) = -10z*2 - 2z. Give c(d(o)). -160o4 - 8o2 Let a(t) be the first derivative of -t3 - 24. Let m(c) = 4c. Calculate m(a(h)). -12h*2 Let t(y) = 4y. Let g be (-10)/(-3) - 10/(-15). Let p(x) = -x + gx - 4x + 2x. Calculate t(p(a)). 4a Let w(q) = q*2. Let s(a) be the first derivative of 7a*2 - 33. Determine w(s(l)). 196l2 Let h(c) be the second derivative of c4/6 + 2c. Suppose 5m - 10 = -0m. Let g(p) = 4p*2 - mp*2 + 0p*2. Calculate g(h(t)). 8t*4 Let p(y) = 19 - 3y - 19. Let r(s) = -14s2. What is r(p(v))? -126v2 Let n(y) be the first derivative of y2 + 2. Let d(g) = -4g2. What is n(d(o))? -8o*2 Let j(t) = -11837 + 11837 + 2t. Let a(q) = -8q2. Calculate j(a(z)). -16z*2 Let i(a) be the second derivative of 2a + 0a2 + 1/2a3 + 0. Let y(q) be the second derivative of -q3/6 - 29q. Determine y(i(x)). -3x Let y(w) be the first derivative of -4w3/3 + 1. Let q(z) be the third derivative of -z5/30 + 7z*2. What is y(q(n))? -16n4 Let k(u) = u2 + 7u + 8. Let v be k(-6). Let p(x) = -20x*2 + 10x*2 + 11x*v. Let b(t) = -3t. Calculate p(b(g)). 9g2 Let h(a) = -20a + 20a + 10a*2 - 12a*2. Let d(v) = -3v*2 + 5v - 5. Let g(s) = -s*2 + 2s - 2. Let y(t) = 2d(t) - 5g(t). Give h(y(i)). -2i4 Let k(c) = -3c*2. Let d(h) = -321h. Give d(k(q)). 963q2 Let r(l) = -9l. Let z(w) be the third derivative of -w*5/60 - 19w*2. What is r(z(u))? 9u*2 Let a(h) = -27h*2. Let w(t) = 167 - 2t - 167. Give w(a(g)). 54g2 Let o be 9/(-6)(-16)/6. Let d(g) = -og - 2g*2 - 3g + 7g. Let k(w) = w2. Determine k(d(m)). 4m*4 Let p(s) = -2s*2. Let k(n) = 14n*2 - 8n*2 - 3n*2. Determine p(k(u)). -18u*4 Let l(z) = -7z - 3z + z + 8z. Let u(c) = -4c2 - 8. Let q(k) = 1. Let f(a) = 8q(a) + u(a). Give f(l(o)). -4o2 Let p(t) = t2. Let o(i) be the first derivative of -i4/12 - 2i*2 - 2. Let b(m) be the second derivative of o(m). Calculate b(p(n)). -2n*2 Let h(v) = -9v*2. Let g(d) = -3d*2 - 16. Calculate h(g(q)). -81q*4 - 864q*2 - 2304 Let o(s) = 2s. Suppose 0y = -3y + 165. Let v(p) = p + 6. Let g(q) = -10q - 55. Let t(n) = yv(n) + 6g(n). Calculate t(o(w)). -10w Let o(t) = -2t2. Let v(h) = h - 5. Suppose -3m + 5 - 17 = 0, -j + 20 = -3m. Let u(a) = -2a + 4a - 3a + j. Let q(r) = 5u(r) + 8v(r). What is o(q(d))? -18d2 Let i(l) = -21l. Let h(o) = 45o. What is h(i(a))? -945a Let y(j) = 89j2. Let i(g) = -81g. What is i(y(x))? -7209x2 Let s be 2420/32. Let y(o) be the third derivative of 0 + 0o*4 + 0o3 - o2 + 1/30os + 0o. Let c(d) = -4d2. What is y(c(j))? 32j*4 Let x be 1/321/7. Let v(p) be the first derivative of 0p - 1/3p*3 - x + 0p*2. Let u(d) = 3d*2. Give v(u(b)). -9b*4 Let i(r) = 2114r*2 - r. Let c(w) = -2w*2. Determine i(c(f)). 8456f*4 + 2f*2 Let b(w) = 291w*2. Let r(s) = 42s*2. Determine r(b(c)). 3556602c*4 Let b(a) = -3a*2. Let y(i) = -68i - 2. Determine b(y(x)). -13872x2 - 816x - 12 Let h(x) = 3 - 3 - 5x. Let m(f) = -3f*2 + 0f*2 + 4f*2. Calculate m(h(v)). 25v*2 Let a(x) = -8x*2. Let h be -4 + 2 - 2/2. Let y(u) = -2u*2 - 3u - 3. Let p(i) = 5i2 + 8i + 8. Let o(c) = hp(c) - 8y(c). What is a(o(l))? -8l4 Let b(c) = -8c*2. Let l(y) = -2y + 74 - 74. Give b(l(k)). -32k2 Let x(b) = 2b - 152. Let k(h) = -6h2. What is k(x(l))? -24l*2 + 3648l - 138624 Let n(o) = o. Let l(x) = -x*3 + 3x*2. Let u be l(2). Let s(i) = -4i*2 + ui2 + i2. Determine n(s(d)). d*2 Let i(s) = s. Let v = 8 + -6. Let z(j) = -vj*2 - 5j + 2j + 3j. Determine i(z(x)). -2x2 Let t(r) = -r2. Let x(b) be the third derivative of -b7/1260 - b4/4 - 3b*2. Let l(q) be the second derivative of x(q). Give t(l(j)). -4j*4 Let o(h) = h. Let i(g) = g - 10. Let w be i(12). Suppose 4d = 2b + 22, -28 = 4b - 8. Let k(p) = 2p - wp + dp. Give k(o(r)). 3r Let f = 33 - 23. Suppose 3u - f = 5u, -3p = -4u - 26. Let x(l) = 3l - pl + l. Let a(s) = -2s. Determine a(x(w)). -4w Let l(h) = h. Let s(v) = 665v. Calculate l(s(y)). 665y Let i(z) = -2z. Let a(h) = -2h - 5669. What is i(a(s))? 4s + 11338 Let p(o) = -2o*2. Let j(r) = -919r. Give p(j(h)). -1689122h2 Let q(l) = 2l*2. Let i(z) = -23z*2 - z + z - 30z*2. Give i(q(y)). -212y*4 Let l(g) = -2g*2. Suppose 0x - y = -3x + 26, -2x - 3y = -21. Let h(b) = -5b - 5 + xb + 5. Give h(l(i)). -8i*2 Suppose -6 + 2 = -d. Let l(a) = -d + 4 - 2a. Let r(t) be the third derivative of t*5/20 + 4t*2. What is l(r(x))? -6x*2 Let t(n) = n - 1. Let k be t(4). Let h(d) = -d + d - kd + 2d. Let u(b) = -b. Give u(h(o)). o Let i(q) = -2q*2 + 5q + 5. Let g(y) = y + 1. Let n(j) = 5g(j) - i(j). Let r(v) be the third derivative of -v4/24 - v2. Give r(n(b)). -2b*2 Let p(w) = 2w*2. Let b(i) be the second derivative of 0i*3 + 0 + 2i - 1/4i4 + 0i*2. What is b(p(q))? -12q**4 Let m(	{ "pile_set_name": "DM Mathematics" }
g as -33? True Are -321/61 and -4 equal? False Which is smaller: 7605 or 7606? 7605 Which is bigger: -43361 or -43360? -43360 Which is smaller: -5/7 or -1? -1 Which is smaller: 9087 or 9085? 9085 Which is smaller: -271 or -273? -273 Are -1058 and -1058 equal? True Is 1741 not equal to 1? True Is -537/10 smaller than -55? False Is 0.3 greater than or equal to 27? False Which is smaller: 5/2 or 10? 5/2 Are -6.7 and -2 nonequal? True Are 969 and 969 equal? True Which is smaller: 12386 or 12387? 12386 Is -3/134 smaller than -1? False Which is greater: 11 or 29/3? 11 Which is greater: -160 or -159? -159 Which is smaller: 0 or -43.95? -43.95 Is -111 at least -104? False Which is bigger: 557/3 or 186? 186 Is 12885 at least 12886? False Which is smaller: -0.1 or 0.874? -0.1 Is 11346 < 79418/7? False Which is greater: 2/407 or -6/19? 2/407 Which is bigger: 59 or 15? 59 Is 489 <= 446? False Which is smaller: -234 or -231? -234 Is 3/23 bigger than -1? True Which is greater: 2/23 or 18? 18 Is 0.2 less than or equal to 4/31? False Is 2/9 at least as big as 112? False Which is bigger: -73 or -86? -73 Are -18 and 76 equal? False Is -8 smaller than -1216? False Is -73/227 < 0? True Which is greater: -11/2 or 101/2? 101/2 Is 349 at least as big as 369? False Which is greater: 2225 or 2226? 2226 Which is smaller: -24 or -22? -24 Is 0 smaller than -2/4605? False Is 393/2 > 196? True Which is smaller: 9/11 or 0? 0 Does 0.9 = -0.38? False Is -50 < -195/4? True Which is smaller: -38303 or -38302? -38303 Is -575 != -563? True Is 58 < 8/23? False Is 6689 greater than 6689? False Is -25 less than 1/2? True Which is greater: -429 or -430? -429 Which is smaller: -295 or -0.7? -295 Is -2 != 982? True Which is smaller: 4028.7 or 0.1? 0.1 Which is smaller: 168 or 169? 168 Is -24 at least as big as -38? True Which is bigger: -0.05 or -2? -0.05 Is -316 > -313? False Is -40 != -47? True Is -7845 greater than -7847? True Are 2/2517 and 0 non-equal? True Is 1 at most -1/19406? False Which is bigger: -1076 or -1075? -1075 Is 6 less than or equal to 1? False Which is smaller: 15355/7 or 2195? 15355/7 Is 6697 smaller than 6698? True Is 1 at least -1/9519? True Which is smaller: -4 or 0.1962? -4 Which is smaller: -662/39 or -18? -18 Is 0.23 smaller than -13? False Is 19/42 >= 1? False Which is smaller: -1 or -1/12490? -1 Which is smaller: 1718 or 0? 0 Which is bigger: 7024 or -1? 7024 Which is smaller: 10 or -3.5? -3.5 Which is smaller: -298 or -292? -298 Which is greater: 268 or 266? 268 Which is smaller: 22 or 18? 18 Which is bigger: -1 or 85? 85 Is -926 <= 4/5? True Which is greater: 1 or -2/6383? 1 Is 18 > 13? True Which is greater: 1 or 7/1929? 1 Is -122 >= -106? False Is -28/87 at least 0? False Is 41 at least 4? True Which is bigger: -46 or 85? 85 Are -3/2 and 399 unequal? True Which is smaller: -7 or -32? -32 Is -1/1823 at most as big as -1? False Which is greater: -8 or 153? 153 Which is greater: -3/52 or 0? 0 Is -5501 greater than -5499? False Which is bigger: 252 or 262? 262 Which is smaller: -2/27907 or 1? -2/27907 Is 0.02 bigger than -43? True Are 1 and -5/156 equal? False Which is smaller: 0 or -5/222? -5/222 Which is smaller: 2 or -2936? -2936 Is 5 bigger than 211/37? False Is -1 at most 16/2811? True Is -13 less than 29? True Which is smaller: 115 or 2675/23? 115 Is -337 at most as big as -19? True Is 2296 at least as big as 2297? False Is 17190 at most as big as -1? False Which is greater: 1 or -2/29? 1 Is 1 > 1465? False Are -1187 and -2/5 unequal? True Is -5 < -6? False Which is smaller: 59 or 353/6? 353/6 Is -43 at least -38? False Which is smaller: -9.34 or -0.2? -9.34 Is 11980 smaller than 2/5? False Is -1.5 less than 0.6? True Which is bigger: 0 or 2/1013? 2/1013 Is -153 less than 1? True Do 0.0582 and -1 have different values? True Which is greater: -15.7 or -18? -15.7 Which is smaller: 0 or -1/420? -1/420 Are 1.83 and -1/91 unequal? True Is 10/7 smaller than 24? True Is -1 at most 2/1517? True Is -5975 <= -5980? False Which is greater: 0 or -2/1025? 0 Which is bigger: 23/16 or 2? 2 Is 0 at least as big as -2/2579? True Which is bigger: 907 or 908? 908 Which is bigger: -48 or 4? 4 Which is smaller: 14/4003 or 1? 14/4003 Is 0 bigger than 14/89? False Which is bigger: -1/767 or 0? 0 Are -1 and -4 non-equal? True Is -2/3 at most -142? False Which is smaller: -967/50 or -18? -967/50 Which is smaller: 0.2 or -5/204? -5/204 Is 1866 smaller than 1865? False Is -43767 greater than -43767? False Which is bigger: -2/631 or 0? 0 Is 3/14 greater than 4? False Are -4 and -76/15 unequal? True Which is greater: 374 or 377? 377 Which is smaller: 294 or 295? 294 Which is bigger: 5 or 289/80? 5 Is 18 > 122/7? True Which is smaller: 313/9 or 36? 313/9 Which is smaller: 72 or -3/19? -3/19 Which is smaller: -1/129 or 0? -1/129 Which is greater: -662 or -657? -657 Which is greater: 23 or -2? 23 Is -99 greater than -138? True Is 1 >= 8515? False Which is bigger: 8086/11 or 734? 8086/11 Is 1/4 greater than -62? True Which is greater: 0 or -34/55? 0 Is -82 less than or equal to -78? True Is 1 equal to 3/2095? False Which is greater: -1 or -5/674? -5/674 Is -53 at least -54? True Which is bigger: -201 or -200? -200 Is 1 at least -17333? True Is 4 greater than or equal to 492? False Are 2/4031 and 1 equal? False Which is smaller: 69/11 or 0.1? 0.1 Do -4/67 and 0.1 have different values? True Which is smaller: -0.1 or 0.0031? -0.1 Which is bigger: -11040 or -11042? -11040 Which is smaller: -888 or -875? -888 Is 1 > 55/159? True Does 0 = 4/893? False Which is bigger: -161 or -142? -142 Which is smaller: 1812 or 1811? 1811 Are -1 and -24/197 equal? False Which is smaller: -65/6 or -12? -12 Is 8837 at most -0.1? False Which is greater: 11479 or 0? 11479 Is 0 greater than or equal to 26/269? False Is 251/9 >= 2.3? True Is 16359 < 16358? False Which is greater: 0 or 200/537? 200/537 Is 20 < 0.048? False Is 3700 not equal to 3698? True Is 77 less than 76? False Which is greater: -34/115 or 1? 1 Do 1 and -36/217 have the same value? False Which is greater: 7 or -12/13? 7 Which is greater: 63 or -0.008? 63 Which is bigger: 21/65 or 1? 1 Is 35/1481 bigger than 1? False Is 105 smaller than 0? False Is -0.06 < 38? True Which is smaller: 79/2 or 0.23? 0.23 Which is bigger: 66 or 47? 66 Which is bigger: 0.94 or 7? 7 Which is smaller: -1/2 or 367/5? -1/2 Which is greater: -4 or -6.9? -4 Is -1 at least 15/391? False Is 44 smaller than -166? False Is -122 > -120? False Which is smaller: 2/42909 or 0? 0 Is 540 > 541? False Which is greater: -2/13 or 208? 208 Is -93 not equal to -84? True Do -34/63 and -1 have the same value? False Which is smaller: -16804 or -16805? -16805 Does 0.1 = -218? False Is 0 < -8.76? False Which is smaller: 5049/10 or 504? 504 Which is smaller: 1/148 or 4? 1/148 Which is greater: 81 or 85? 85 Which is smaller: -468 or -467? -468 Is 1 less than or equal to 25/189? False Are 351 and 352 equal? False Is 0.53 < 0? False Which is smaller: -11 or 8? -11 Are -627 and -627 equal? True Which is smaller: 57 or 191? 57 Are 1 and 17/166 unequal? True Is -478 < -469? True Which is smaller: 6 or 161/24? 6 Is -50 > 0.01? False Which is greater: 3 or -42.4? 3 Which is smaller: 5137 or 5139? 5137 Which is smaller: 9952 or 9954? 9952 Which is smaller: 1 or 1/399? 1/399 Which is smaller: -1/13356 or 0? -1/13356 Is 53 <= 32? False Are 0 and 142.6 non-equal? True Is 615/7 smaller than 88? True Which is bigger: -1158/11 or -104? -104 Is 150 <= 153? True Do -1 and -2/84939 have the same value? False Which is smaller: 1225 or 1221? 1221 Do 11 and -1 have different values? True Are -4/17 and -3/22 unequal? True Which is smaller: 1/3 or -21/16? -21/16 Which is bigger: 6 or 11? 11 Is -1562 smaller than -3125/2? False Which is bigger: 57 or 62? 62 Is 5/626 <= 0? False Is -119/8 < -14? True Are 17 and 24 non-equal? True Is 1102 at most 1106? True Do 75 and -24 have the same value? False Is 72 less than 2? False Is 16 at most as big as 713/41? True Which is greater: 232 or 233? 233 Is -532 smaller than -530? True Which is bigger: 39 or 23? 39 Which is greater: 11/659 or 0? 11/659 Is -3/67 <= 44? True Do -5970 and -1/2 have different values? True Which is smaller: 0.1 or 12752? 0.1 Is -223 less than or	{ "pile_set_name": "DM Mathematics" }
- n. Solve 3m + 21 = ic, 0 = 5m + 2c - 0 + 9 for m. -3 Suppose -5o + 10 = -0o. Let t(h) = -2ho + 3h*2 - 3h + 10h + 12. Let m be t(-8). Solve 4u + 8w - 5w = 25, -4w + m = 2u for u. 4 Let g(o) = o - 2. Let k(a) = -1. Let z(j) = -g(j) + 5k(j). Let h be z(-3). Solve -4c - 27 = -4m + m, 2m + 5c + 5 = h for m. 5 Let n = 31 - 15. Suppose -2m - 2m = -n. Suppose 0u + mu = 24. Solve 0l + y - u = -l, 0 = -4l - 5y + 29 for l. 1 Let a(n) = 8n - 28. Let h be a(4). Solve -hd - 22 = -2m, 2d - 4m = 5d for d. -4 Let m(d) = -d*3 + 6d*2 - 8d + 8. Let y be m(4). Suppose 4 + y = 4s. Solve sr - 25 = -8b + 3b, -2r = 5b - 25 for r. 0 Let f(i) = -10i + 1. Let m be f(-1). Suppose 8 = -4o + 2q, -6o + o + 2q - m = 0. Let d be 11/3 + o/(-9). Solve -du + 5h + 29 = 0, -h = 2u + h + 8 for u. 1 Let r(p) = 11p2 - 1. Let j be r(1). Suppose -4h - c + 2c = -25, -j = h + 3c. Let o = 14 + -9. Solve 5g + 17 = 2y, -hy - 5g + o = -10g for y. -4 Let t = 0 + 6. Suppose 0 = -3d + a + 1, -4 = -2d + 3a - 15. Suppose -dh + h + 3 = 0. Solve -t = hg + 3l, -l = 1 - 2 for g. -3 Let a be (3 + -4)/(2/(-4)). Suppose a + 5 = o. Solve 2h + u + 6 = 0, 3h + 5u + 16 = -o for h. -1 Suppose -7l - l + 24 = 0. Solve 0 = -li + 3t + 21, -5i + 3t + 31 = 0 for i. 5 Let d(m) = -m3 - 5m*2 - 5m + 2. Let u be d(-4). Let a be ((-4)/(-4))/(2/u). Solve aw + 19 + 0 = 2j, -5w - 3j = 19 for w. -5 Suppose -35 = -5s + 4m + 5, 4s + m = 11. Let h = -2 + s. Let g(c) = -c2 - 4c + 5. Let n be g(-4). Solve -3l - u = 9, -hl + nl = 4u - 24 for l. -4 Let b(n) be the first derivative of n3/3 - n2 - 3n + 4. Let d be b(4). Solve -4 = s - 2a, ds + 0a = -a + 24 for s. 4 Suppose n - 2z + 6 = 2z, -4z = 4n - 36. Let u be (-3)/6-1n. Suppose 1 - 10 = -uq. Solve 3s = -d - 6, -4s - qd - 12 = 1 for s. -1 Suppose -5d - 33 = -183. Suppose 5l = d + 95. Suppose 0 = 4r + r - l. Solve 0 = 2g + 4q - 6q - 6, rg - 5 = -5q for g. 2 Let p(a) be the second derivative of a*4/12 - 7a*3/6 + 4a*2 + 3a. Let g be p(6). Solve s = 5, -3s = -gz + s - 20 for z. 0 Let o(c) = c3 + c2 - 8. Let f be o(3). Solve 0 = -3v + 5v - 10, -f = k - 5v for k. -3 Suppose 10 = -0r + 5r, -o - 5r = -22. Suppose 9 = 15j - oj. Solve 0 = jl - 2b + b - 12, -4b - 9 = l for l. 3 Suppose -4h + 2 = -3h. Let c = 9 - 9. Suppose -2x = -cx. Solve xm - 4m = -2f + 8, 4m + h = -f for f. 2 Let o(u) = 2u*2 - 12u + 7. Let f be o(7). Solve 2n - 5r + 7 = f, -5n = 3r - 4 for n. 2 Suppose 0 = -t + 2s + 10, -4t + 5s = -t - 27. Solve -tn + 16 = 3o, 4o - 4n + 2 = -14 for o. 0 Let k = -1 + 11. Suppose -2o - w = 2, -2o + 4w + w + k = 0. Let j = -2 + 7. Solve -y = ju + 26, 0 = -4y - ou + u + 1 for y. -1 Let h = -18 + 26. Solve l = u - 1, 5u + h = -3l - 3 for u. -1 Let z(c) = 9c*2 + 11c - 8 - 4c3 + 1 + 2c3 + c3. Let t be z(10). Solve d + 13 = -4m, -2d = 2m + td - 7 for m. -4 Let o(x) = 2x + 5x2 + x2 - 2x2 - 3x*2. Let j be o(-3). Suppose 11 = jm - 4. Solve b - l = 7, -5b + 0l - ml = 5 for b. 3 Let s = -7 - -7. Suppose 5i - 4y + 8y = 7, 23 = 5i - 4y. Suppose -16 = g - 5g + 4c, s = -ic - 6. Solve -w + 5x + 17 = 0, 0 = 3w - 3x + gx - 9 for w. 2 Let h = 205 + -198. Solve -u = -0u - 3k - 14, -4k - h = u for u. 5 Let h(k) = k*3 + 13k*2 + 11k - 3. Let t be h(-12). Solve 3 = 4x - t, f + 16 = 4x for f. -4 Let c = 4 - -21. Suppose 4o - 3o = -16. Let b = c + o. Solve -y - b = 2y + 3t, -5t = 4y + 13 for y. -2 Let i = -59 - -59. Solve v + 7 - 3 = i, -3z = 2v + 14 for z. -2 Suppose 0 = 5y + 5 - 45. Let v = y - 4. Solve 2t = 2m - 10, vm - 25 = -m + 3t for m. 5 Suppose 0 = 5a - 4a + 4o - 12, 0 = -5a - 5o + 120. Let v be 2/7 + 188/a. Let p = -2 + v. Solve -2s - 1 = -3u, -s - p = -5u + 2u for s. 4 Let x(h) = h*3 - 9h*2 + 3. Let n be x(9). Solve -z - nr + 11 = 0, -4z + 5r = 16 + 25 for z. -4 Suppose -5p = 2a - 6 - 4, -5p - 5a + 10 = 0. Solve pc + c - 2k = -1, -k + 5 = 0 for c. 3 Suppose -2s + 10 = 3s. Let y = -7 + 9. Solve -w - sd + 3 = -y, -d = -1 for w. 3 Suppose f + 2n = -6, -2f + 0f = -2n - 18. Solve 2l - 13 = -3d, -fl + 3d + 7 = 26 for l. -1 Let v = 71 + -69. Solve -5g + 2a - v = 1, -3 = -g + 4a for g. -1 Let l(f) = f*2 - 2f + 1. Let y be l(1). Suppose y + 3 = o. Solve -15 = -c - 5q, 2c - oq + 4 = -5 for c. 0 Let g(x) = x2 - 5x + 9. Let b be g(6). Suppose 0 = 8d - 3d. Suppose a + b - 45 = d. Solve 0 = -5r - 5s - a, s = -5r - s - 15 for r. -1 Suppose 4m + 9 = 3z + 43, 0 = 2m - 2. Let g be 4/z + (-2)/(-5). Solve gp = -2f + 3p - 21, f = -2p + 7 for f. -3 Suppose j = -0j. Suppose -m + 18 + 7 = 5l, j = 3l - 6. Solve 0 = -7n + 2n + 5r + m, -2n + 12 = 4r for n. 4 Let k be 14/3 - (-3)/9. Let t = -4 + k. Let p = 11 + -6. Solve -4a + py - 15 = a, -y = -t for a. -2 Let z(p) = p*2 + 5p - 8. Let c be z(-7). Let g be -8 + c - -12. Solve 2k = -t + k + 4, k - 2 = g for t. 2 Suppose 5s + 0s = -15. Let b(x) = -x - 3. Let u be b(s). Solve -2z - 4q + 8 = -uz, 4q = -z + 12 for z. -4 Let x = 11 - 6. Solve -x = a + 2h, 6h + 13 = -a + 2h for a. 3 Suppose 3v + 18 + 9 = 0. Let o(l) = -3l - 3. Let n be o(v). Solve y + 0z = 5z - n, 0 = -4y + 4z - 16 for y. 1 Let t(x) = -4x3 - x2 - x + 1. Let r be t(1). Let k be r + 4 + (0 - -6). Solve 14 = -q - 3v, kq = 3q - 3v - 13 for q. 1 Suppose 3m - 4g = 6, -4 = -3m - g + 2. Suppose 0 = c + 5q + 9, 0 = c + 6q - mq + 6. Solve -4v = -5j - 45, 0 = -j - 4v + c + 9 for j. -5 Suppose 3n = -2m - 11, -3n + 4m - 18 = -n. Let w be (n/2)/((-1)/6). Suppose 12 + 0 = 3y. Solve -8 = yi - f, 13 = -4i - 4f - w for i. -3 Let w(l) = l + 10. Let v be w(-7). Suppose -i + 2 + 3 = 0. Solve -ig - vz = -0z + 9, -4g + z = 14 for g. -3 Let v(a) = -a3 - 3a*2 + 2a - 2. Let k be 3 + 2 + -33. Let s be v(k). Let w = -2 + s. Solve -o - 3u = -3o - 6, wo - 4u + 12 = 0 for o. -3 Let o(u) be the first derivative of 2u*2 - 9u + 1. Let b be o(7). Solve -2m = -f - 2f + b, 0 = -2m - 4f + 2 for m. -5 Let d(s) = -2s - 4. Let r be d(-3). Let a = r + -1. Let q = a - -4. Solve 0 = -5v - 10, -qn - 2v + 5v = -31 for n. 5 Let y(q) = 2q*2 - 3q. Let m be y(0). Solve m = -4w - h + 8, -4h + 21 = 5w - 0h for w. 1 Let p = -1 - -4. Suppose 3w - 3 - p = 0. Solve -k = -2b - 1, -2k + b + b = w for k. -3 Let s(p) = -p3 - 10p*2 - 8p + 13. Let g be s(-9). Let t = -2 + g. Solve -2c + 13 = 3u, tu - 9 = -3c - 2 for u. 5 Suppose 0t = 4t - 3k, 4k = 4t. Solve 3p - o = -6, 2p + tp + 4 = 5o for p. -2 Let i = 15 + -6. Let u(h) = 2h + 8h - h3 - ih*2 + 3 - 1. Let l be u(-10). Solve 2o - q = -o - 14, 0 = 4o - lq + 20 for o. -4 Suppose -2x + 1 = 11, -2b + 31 = -5x. Suppose -2 - 2 = -s. Solve -m + bm + sp + 22 = 0, -2m - 5p - 25 = 0 for m. -5 Let k = 7 - 2. Let p be 10(-1 - -2)/2. Solve -4m - k = 3g, g + 6 = pm - 2 for m. 1 Let n(k) = -k2 - 10k + 15. Let a be n(-12). Let r = a + 12. Solve -5q - rm - 3 = 0, -q - 2m = -6m - 4 for q. 0 Suppose 2z - 10 = 0, 0 = -3c - 3z + 31 + 2. Let f be 8/(-2 + c) - -2. Solve -12 = -3d, 0 = -fl - 2d + 29 - 1 for l. 5 Let t be 3/2 - 9/(-6). Solve -26 = -2n + 4n - 5s, 27 = -5n + ts for n. -3 Suppose -t - 17 = -2h, -2h - t - 3t + 2 = 0. Suppose -j = -3j + 28. Let z be j/56 + (-39)/(-4). Solve -5o + 4i - z - h = 0, -12 = 3o - 3i for o. -1 Let n be 3 + (-3 - (-8)/(3 + -1)). Solve c - 4 = -np + 6, -3c + 4p - 2 = 0 for c. 2 Suppose -17 = -3c + 5h, -4c = -3c + 5h - 19. Let n = 13 - c. Solve -5l - x = -25, -3l - nx - 6 + 38 = 0 for l. 4 Let s be (-21)/(-4) + (-1)/4. Suppose -f + sq - 22 = 0, -q - 1 = -2f - 0q. Solve 4l - 9l = -3z - 1, f = -3l + 3z for l. 2 Let p be 226/4 + 0. Let a = p + -6. Solve -2r - 4v = -ar + 36, 5r + 5v = 0 for r. 4 Suppose -2 = -3i + 13. Solve -x + ix + 20 = -5l, x = -3l - 5 for l. 0 Suppose 2x - 2d - 6 = 0, 7 + 4 = 3x - 5d. Solve -4u - 12 = 0, -xu - 10 - 12 = 4a for a. -4 Suppose -4d - 9 - 3 = -2c, -5d = -3c + 16. Solve -2i - c = -g, -4i + 0 = -5g + 4 for g. 0 Let f(s) = s. Let i be f(3). Let o(w) = 4 - 2 + 1 - 3w + w2. Let z be o(i). Solve 0 = -2y -	{ "pile_set_name": "DM Mathematics" }
highest common divisor of 808013 and 57? 19 Calculate the greatest common divisor of 95 and 291471229. 19 What is the greatest common divisor of 209634359 and 53737? 3161 Calculate the highest common factor of 5203 and 13918498. 473 What is the highest common factor of 874 and 6200593? 437 What is the greatest common divisor of 10006143 and 559? 43 Calculate the greatest common divisor of 5797312 and 1. 1 Calculate the greatest common factor of 185 and 16666835. 185 Calculate the highest common divisor of 7666371 and 2007. 9 What is the highest common divisor of 450 and 11401650? 450 Calculate the highest common divisor of 56 and 28514906. 14 What is the highest common factor of 72238192 and 80? 16 What is the highest common factor of 267 and 27192437? 89 Calculate the greatest common factor of 125645139 and 3286. 1643 Calculate the greatest common factor of 38 and 5718656. 2 What is the greatest common divisor of 573144 and 10148424? 3432 What is the greatest common divisor of 22 and 228032981? 11 What is the greatest common factor of 112 and 6788670? 14 What is the highest common divisor of 56522 and 37362? 958 Calculate the highest common factor of 237 and 25108491. 237 Calculate the highest common factor of 486 and 909798. 6 Calculate the greatest common divisor of 6374063 and 1824. 19 Calculate the greatest common divisor of 25137 and 569540181. 2793 What is the greatest common factor of 5613601 and 742? 371 What is the highest common factor of 1933904 and 46872? 1736 What is the greatest common factor of 40 and 4610456? 8 What is the greatest common divisor of 48672 and 91036413? 1521 What is the greatest common divisor of 7350 and 40739874? 294 What is the greatest common divisor of 32844 and 447202? 238 What is the greatest common divisor of 1613016 and 438? 6 Calculate the greatest common factor of 84065 and 392955. 1955 Calculate the highest common divisor of 8 and 4095104. 8 Calculate the greatest common factor of 18 and 2507193. 9 What is the greatest common factor of 14638815 and 495? 45 Calculate the greatest common factor of 52925986 and 356. 178 Calculate the greatest common divisor of 837 and 375795. 9 Calculate the highest common factor of 56558429 and 219. 73 What is the highest common factor of 13460470 and 60? 10 What is the highest common divisor of 506 and 391901876? 46 What is the highest common divisor of 248826 and 1194? 6 What is the highest common divisor of 16 and 81746972? 4 What is the greatest common factor of 19001784 and 408? 408 Calculate the highest common divisor of 1670030 and 292030. 530 Calculate the highest common divisor of 273 and 10563189. 273 What is the greatest common factor of 238524 and 1593020? 572 What is the highest common divisor of 972 and 224268480? 108 What is the highest common factor of 35915584 and 64? 64 What is the highest common factor of 33 and 2293489? 11 Calculate the highest common factor of 37956388 and 3866. 3866 Calculate the highest common divisor of 247 and 11523595. 19 Calculate the highest common divisor of 2673 and 40320. 9 What is the greatest common divisor of 49404 and 1108416? 276 What is the highest common factor of 247245109 and 3593? 3593 What is the highest common divisor of 43931131 and 6412? 229 Calculate the highest common divisor of 331823992 and 444. 148 What is the greatest common factor of 105 and 87602760? 105 What is the highest common divisor of 1581125 and 2375? 125 What is the greatest common factor of 4770 and 5880195? 45 Calculate the highest common factor of 1053 and 1595113. 13 Calculate the greatest common factor of 451 and 963796020. 451 Calculate the highest common divisor of 317 and 44757. 1 What is the highest common factor of 2378084 and 12? 4 Calculate the greatest common factor of 6773291 and 986917. 2413 What is the greatest common divisor of 220 and 9353355? 55 What is the highest common divisor of 268710 and 20410? 130 What is the highest common divisor of 10839964 and 49506? 74 What is the greatest common factor of 24560295 and 2355? 2355 What is the highest common divisor of 2292 and 5724? 12 Calculate the greatest common divisor of 6656902 and 23618. 3374 Calculate the highest common factor of 76710260 and 166. 166 Calculate the highest common divisor of 30889 and 18542801. 1343 Calculate the highest common divisor of 365472 and 7128. 648 Calculate the greatest common factor of 22378 and 832207. 67 What is the greatest common divisor of 7328226 and 137145? 669 What is the greatest common divisor of 1919736 and 36792? 504 Calculate the greatest common factor of 1237071 and 31559. 209 What is the greatest common divisor of 497252 and 386332? 236 What is the highest common factor of 31 and 34929188? 31 What is the highest common factor of 32958 and 2706? 6 What is the highest common divisor of 123765810 and 399? 399 What is the highest common divisor of 1166 and 8928274? 106 Calculate the greatest common factor of 4210 and 1017317030. 4210 What is the highest common factor of 196700 and 137900? 700 What is the greatest common factor of 5301046 and 4978? 262 Calculate the greatest common divisor of 3258 and 429270822. 3258 Calculate the greatest common factor of 32 and 4908964. 4 What is the highest common divisor of 20494695 and 115089? 8853 What is the highest common divisor of 1885 and 6169228? 377 Calculate the greatest common divisor of 284984 and 95237. 727 What is the highest common factor of 138795 and 842997? 1461 Calculate the greatest common divisor of 2112 and 5338608. 528 Calculate the highest common divisor of 4882528 and 61344. 2272 Calculate the greatest common divisor of 18270 and 24295446. 3654 What is the highest common factor of 35602 and 366114? 14 What is the highest common divisor of 7 and 1116988159? 7 What is the highest common divisor of 83370056 and 1148? 1148 What is the greatest common divisor of 34734945 and 798? 399 Calculate the highest common divisor of 99021 and 7137. 39 Calculate the highest common factor of 46007375 and 250. 125 Calculate the greatest common factor of 176043059 and 940. 47 Calculate the greatest common divisor of 272 and 306574396. 68 What is the highest common divisor of 35 and 1305892? 7 What is the greatest common factor of 21 and 102801804? 21 What is the greatest common factor of 4970 and 2616530? 70 Calculate the greatest common factor of 72 and 46885536. 72 Calculate the greatest common divisor of 717 and 894666. 3 What is the highest common divisor of 7366950 and 340? 170 What is the highest common factor of 63794 and 3613546? 334 What is the highest common divisor of 11988992 and 24? 8 What is the highest common factor of 5103 and 693924? 21 Calculate the greatest common factor of 4002 and 1017474. 138 What is the greatest common factor of 671 and 151569? 11 What is the highest common factor of 63 and 11299449? 21 What is the highest common divisor of 514108 and 1200388? 1204 Calculate the highest common factor of 322 and 475489. 7 Calculate the greatest common divisor of 2334 and 72697098. 2334 What is the highest common divisor of 7770 and 3971765? 1295 What is the highest common divisor of 1014 and 1300546? 26 Calculate the highest common factor of 3003 and 119045927. 1001 Calculate the greatest common divisor of 6853763 and 7. 7 Calculate the highest common factor of 6208 and 2019584. 64 Calculate the highest common divisor of 9103059 and 9513. 63 Calculate the greatest common divisor of 50 and 979247875. 25 What is the highest common factor of 124336 and 27056? 304 What is the highest common divisor of 124 and 2621732? 124 What is the highest common factor of 9392616 and 1807218? 12294 What is the greatest common divisor of 3380000 and 52? 52 What is the greatest common factor of 244316720 and 160? 80 Calculate the highest common divisor of 10472 and 4450124. 476 What is the greatest common factor of 2932762 and 21? 7 What is the greatest common divisor of 12534203 and 99? 11 Calculate the greatest common factor of 2870 and 2000800. 410 What is the highest common factor of 1182 and 4250078? 394 Calculate the highest common factor of 60 and 1708066460. 20 What is the greatest common divisor of 124752690 and 18? 18 Calculate the highest common divisor of 49543 and 3682	{ "pile_set_name": "DM Mathematics" }
-8707. Calculate the remainder when d is divided by 64. 44 Let b be -121/3(-33)/44. Suppose 2v - 2g - 20 = 58, -g - 113 = -bv. What is the remainder when v is divided by 25? 12 Let x = -717 - -1308. Suppose -3g - 2g - v + 1003 = 0, -3v - x = -3g. What is the remainder when g is divided by 29? 26 Suppose 4k - 4m - 1516 = 0, -9m = k - 11m - 381. What is the remainder when k is divided by 14? 13 Suppose -5i - o = -11, -2o = -4i - 7o + 13. What is the remainder when 1078/44(-1)/(i/(-8)) is divided by 52? 46 Let y(q) = -13q + 10q - 55 + 15. What is the remainder when 1(1 + -2)-38 is divided by y(-20)? 18 Suppose -5g = -y - 62, 4g + 3y - 26 = 35. Let p be 5/(20/6)106/3. Suppose -4x = 5c - 5, 3c + g = 5x + p. Calculate the remainder when c is divided by 3. 2 Let m = -158 + 394. Calculate the remainder when m is divided by ((-9)/(-6) - 4) + (-489)/(-6). 78 Suppose 2i - 18752 = 2c, 2c - 34 + 30 = 0. What is the remainder when i is divided by 113? 112 Suppose 8t - 16 = 6t. Calculate the remainder when 28 is divided by t/((-2)/(-4)(-3 + 4)). 12 Suppose -14o = -10o - 20. Suppose j - 16 = -2. Suppose -4b - j + 102 = 0. What is the remainder when b is divided by o? 2 Let q(v) = -v3 + 24v*2 + 15. Let b be q(24). Let p = b - -4. What is the remainder when 208 is divided by p? 18 Let z be (-1 - 3)(8 - (1 - 0)). Let q = z + 47. Suppose -88 = -d + 3x, 49 + 107 = 2d - 2x. Calculate the remainder when d is divided by q. 16 Suppose 3f = 12, -2y - 2f - 31 = -3y. Calculate the remainder when 51 is divided by 6/y + (-1440)/(-104). 9 Let f be 1/(-3) - (-31)/3. Suppose f = t - 212. Suppose -118 = -4p - 3j + 50, 196 = 4p - 4j. Calculate the remainder when t is divided by p. 42 Let n = 4639 + -4583. What is the remainder when 4925 is divided by n? 53 Let y(n) = 8n - 70. Let v be y(14). Suppose -vt + 38t = -316. What is the remainder when t is divided by -3 - (-26 + -1 - 3)? 25 Suppose -44t + 314 = -42t. Suppose 0 = 10n - t - 523. What is the remainder when n is divided by 24? 20 Let k(a) = a3 - 60a*2 + 335a + 49. What is the remainder when 634 is divided by k(6)? 59 Calculate the remainder when 42((-2)/(-35))/((-127)/(-57150)) is divided by 33. 24 Calculate the remainder when 45 + -32 + 22546 is divided by 23. 22 Suppose -481 + 840 = 15z - 1216. What is the remainder when 342 is divided by z? 27 Let s(b) = -4b - 4. Let g be s(2). Let v be (-141)/g1 + 1/4. What is the remainder when (v/(-30))/(1/(-95)) is divided by 8? 6 Let l(k) = 3k*2 - 4. Let r be 54/81603/6. Suppose -3g - 5u + r = -20, -4u = 3g - 87. What is the remainder when l(6) is divided by g? 17 Let c = 45 + -51. What is the remainder when 25 is divided by (c - (1 + -2)) + 26? 4 Suppose 16u = 11u + 555. Let r = u + -53. Suppose 3t + 2a - 42 = -2a, 5a = -4t + 55. Calculate the remainder when r is divided by t. 8 Let h(y) = 6 + 28y - 2y2 + 12y - 17y. Let v be h(8). Suppose -i + 6i = 4f + 106, -3i + v = -2f. Calculate the remainder when 68 is divided by i. 14 Let a = 325 - 146. Suppose 0 = 2q - 5r - 62, 9q - 4q - r - 224 = 0. What is the remainder when a is divided by q? 41 Let w = -93 - -109. Suppose -wm + 12m + 8 = 0. Calculate the remainder when 20 is divided by m. 0 Let r(n) = n3 + 20n*2 + 12n - 22. Suppose 5b = 3z - 77, 2b = 5z - 2z - 65. Calculate the remainder when r(-19) is divided by z. 16 Let v(f) = -f2 - 20f - 2. Suppose 4d - d = 294. Suppose -d = 5j - 2s, -5 = -5s + 15. Calculate the remainder when 64 is divided by v(j). 30 Let p(l) = -2l3 - 7l*2 - 2l + 5. Let m be p(-3). Suppose -282 = -mv + d - 9, 5d = -3v + 390. Calculate the remainder when v is divided by 23. 20 Suppose -5o - 3j = -64, -j - 3j = 3o - 34. What is the remainder when 2194 is divided by o? 10 Suppose 468r = 470r - 8. Suppose 5z = 4d - 56, 0d + 70 = 5d - rz. Calculate the remainder when 23 is divided by d. 9 Let q(f) = 4f - 7f + 6f - 4 + 29. Suppose 2j = -3j + 65. What is the remainder when q(0) is divided by j? 12 Let a(h) = 184h + 53. Let o be a(-6). Calculate the remainder when (-5)/(-1) - (o + 45/(-9)) is divided by 9. 8 Suppose -3m + 0 + 21 = 0. Let g be 5032/510 + (1 - 13/15). Suppose -2i = -3i + gu - 35, u = 5. Calculate the remainder when i is divided by m. 1 Suppose -11i + 126 = 10i. Let b(g) = 7g2 - 32g + 5. What is the remainder when b(i) is divided by 22? 21 Let m be (4/(-12))/(1/3). Suppose 68 = 4w - 8. Calculate the remainder when w is divided by 22(m - (-6)/4). 8 Let x(c) = 10 + 3c2 - 2c*2 - 17c + 10 + 0c2. Let g(b) = -17b3 - b2 - 2b - 2. Let r be g(-1). Calculate the remainder when x(r) is divided by 2. 0 Let c = -24 + 27. What is the remainder when 169 is divided by 208/6(c/(-12) + 1)? 13 Let x(c) = 2c + 13. What is the remainder when -23/240 + 221 is divided by x(12)? 36 Suppose -37008 - 19022 + 17922 = -28k. What is the remainder when k is divided by 271? 6 Suppose 8m - 5q - 79 = 6m, 2q = 4m - 118. What is the remainder when 70 is divided by m? 16 Let q(l) = 2l*2 - 21l + 113. Let w be q(6). Let c = w + -42. Calculate the remainder when 286 is divided by c. 14 Let s(p) be the first derivative of p6/180 + p4/6 - 2p3 - 19. Let x(q) be the third derivative of s(q). What is the remainder when 69 is divided by x(2)? 9 Let p(v) = 421v*3 + 25v*2 - 24v. Calculate the remainder when p(1) is divided by 389. 33 Let s be 1/(1 - -2 - (-40)/(-12)). Calculate the remainder when 210(2 + s/(-6)) is divided by 13. 11 Let n = -10727 + 10819. What is the remainder when 463 is divided by n? 3 Let g(y) = -66y + 13. Let p be g(-2). Suppose 4o = -5w + p, -2o = 3o + 5w - 180. What is the remainder when 69 is divided by o? 34 Let x(q) = -q*3 + 14q*2 - 78 + 2q*2 + 93. Let h be x(16). Suppose 0 = 5s + 5g - h, -3g = 11 + 4. Calculate the remainder when 39 is divided by s. 7 Let i(t) = 103t - 3133. What is the remainder when 191 is divided by i(32)? 28 Let d = 19 - 11. Suppose -c = -5a + 22 + d, a - 5c - 30 = 0. What is the remainder when (-15)/20-18 + (-4)/(-8) is divided by a? 4 Suppose 0 = -38s - 1412 + 4338. What is the remainder when 138 is divided by s? 61 Let k(i) = -4i - 11. Let l be k(-15). Let o = l - 153. What is the remainder when 75 is divided by 35/((-60)/o)? 23 Suppose 9m - 112 - 5 = 0. Suppose 0 = -7z + 12 + 2. Suppose zj - 5r = -4r + 71, 5r = 3j - 103. Calculate the remainder when j is divided by m. 10 Let x(w) = 2w2 - 32w - 193. Suppose -4k = -4f + 20, -5f - 5k + 27 = -28. Suppose 38 = fg - 7g. Calculate the remainder when x(22) is divided by g. 33 Suppose 0 = 154p + 26p - 113220. Calculate the remainder when p is divided by 191. 56 Let g be 15(-18)/(-20)8/(-6). Let w be 43/9 + (-4)/g. Suppose wd - 5x = 135, -4x = -3d - 0x + 76. Calculate the remainder when d is divided by 12. 8 Let y = -24902 - -24916. Calculate the remainder when 323 is divided by y. 1 Suppose -33b + 713 = -1135. Let z = b - -7. Calculate the remainder when z is divided by 4. 3 Suppose -4q = -z - 16, -58 = -9z + 4z - 3q. What is the remainder when 365 is divided by z? 5 Let b = 7049 + -7032. Let g = -43 - -89. Calculate the remainder when g is divided by b. 12 Suppose -h + 14h = 351. Suppose 31 = 4f - 29. Calculate the remainder when h is divided by f. 12 Let m = -39598 + 40920. What is the remainder when 2653 is divided by m? 9 Let i(l) = 5l2 - 13l - 21. Let o(j) = -j*2 + j + 1. Let v(w) = -i(w) - 4o(w). Calculate the remainder when v(10) is divided by 6. 1 Let n(d) = -d3 + d2 + 7. Let i be n(0). Let t = i - 4. Suppose -tj + 20 = -j - 4p, -j + 7 = -p. What is the remainder when j is divided by 3? 1 Suppose -3l + 3s + 2173 + 641 = 0, 0 = 5s + 35. Calculate the remainder when l is divided by 104. 99 Let h(x) = x3 - 50x*2 + 215x - 583. What is the remainder when h(46) is divided by 141/15 + 4/(-10)? 6 Suppose 585 = -8i + 10i + 3o, 0 = i - o - 295. Let n(v) = -4v. Let u be n(-2). Suppose -ul = -370 - i. What is the remainder when l is divided by 21? 20 Suppose -3m + 4f + 16 = -m, 0 = 4f + 8. Let u(r) = 40*r - 42. Let d = 52 + -12. What is the remainder when u(m) is divided by d? 38 Suppo	{ "pile_set_name": "DM Mathematics" }
m, 1 in increasing order. m, 1, 3, 8 Let y = -30.08 + 30. Sort 2, -5, y. -5, y, 2 Let b be (-3)/(-15)(-5)/2. Suppose 5x + 2g - 15 + 5 = 0, -4g = -2x + 28. Put x, -1/5, b in ascending order. b, -1/5, x Let c(d) = 3 - 10d - d*3 - 11d*2 + 0d*3 - 5. Let t be c(-10). Sort t, 0, -1. t, -1, 0 Let o = -10 - -5. Suppose 5v - 25 = 5x, v + 2 = 2x + 13. Let a = x + 10. Sort o, a, 3 in ascending order. o, 3, a Let s = -15 - -14. Put -5, 3/7, s in increasing order. -5, s, 3/7 Suppose 0m + 18 = 3m. Let u be m/(-4)(-20)/(-1095). Let c = -65/292 + u. Sort c, 0.1, -1 in increasing order. -1, c, 0.1 Let q be (-75)/(-6) - (-3)/(-2). Suppose 14 + q = -5z. Sort z, 1, -4. z, -4, 1 Let m = 9.6 + -8.8. Sort 4, 3, -1, m in ascending order. -1, m, 3, 4 Let q(d) = -d*2 - 3d - 1. Let c be q(-2). Suppose 0 = 3n - 0n. Suppose -f + n = 3. Sort 3, f, c in decreasing order. 3, c, f Let f = 0.76 + -0.46. Let t = -41 + 121/3. Let d be 2 - (1 - 9/(-11)). Sort d, f, t in decreasing order. f, d, t Let l(u) = 6u2 - u3 - u3 - u3 + 4u*3 + 6u + 6. Let w be l(-5). Sort w, 5, -6. -6, w, 5 Suppose 5y + 3 = -2. Let u = 5 - -2. Suppose -k - 3c - 8 = u, -k - 2c - 10 = 0. Put k, 2, y in ascending order. y, k, 2 Let i = -8 - -5. Let v = -39 - -43. Sort -0.4, i, v. i, -0.4, v Suppose -2 = -2p + 6. Sort 13, -3, p in increasing order. -3, p, 13 Let a(i) = -3i + 21. Let d be a(8). Let v(j) = j3 - 6j*2 - 7j + 2. Let t be v(7). Put t, -5, d in descending order. t, d, -5 Suppose -2u = -7 - 11. Suppose g - 4g = u. Sort -1, 0, g in ascending order. g, -1, 0 Let y = -37 - -26. Let d = y - -16. Put 1, d, 2 in descending order. d, 2, 1 Suppose 10 = 9q - 7q. Suppose 10 = 5l - 0l. Put 1, q, l in ascending order. 1, l, q Let c(n) = -4n2 + n + 1. Let f be c(-1). Let x = f + 7. Suppose 0d + xd = 15. Sort 3, 1/5, d. 1/5, 3, d Let q = -1 - 4. Suppose -11 + 8 = 3o. Put o, q, 5 in decreasing order. 5, o, q Let l(f) be the second derivative of f*3/3 + 9f*2/2 + 2f. Let d be l(-7). Sort 1, d, 0 in decreasing order. 1, 0, d Let k be 435/36-2 + -2. Let h = k + 26. Let u = -0.5 + 0.3. Sort -3/5, u, h in increasing order. -3/5, u, h Suppose 3x = 2x - z + 7, 0 = 5x + 2z - 26. Let i = 7 - x. Let r be 76/144 - i/4. Sort r, 4, -0.3. -0.3, r, 4 Let x = 1 + 5. Let p be (-4)/x - 20/(-48). Let t = -4 - -6. Sort p, t, -1/6 in descending order. t, -1/6, p Suppose 3p - 2y + 14 = 0, 0p - 18 = p - 4y. Let x be ((-2 - -2) + 2)/p. Sort -5, -2, x in decreasing order. x, -2, -5 Suppose 2i = i + 69. Sort 1, 5, i in decreasing order. i, 5, 1 Let s = -0.14 + 0.34. Let x = 2/397 + -1991/1191. Sort s, x, -7 in decreasing order. s, x, -7 Suppose -3x = 11 - 23. Sort x, 14, 1 in increasing order. 1, x, 14 Let m(i) = 2i*3 + 2i*2 - 2i. Suppose 2 = -2a + a. Let s be m(a). Let h be (2 + s)(5 + -3). Put 2, 5, h in descending order. 5, 2, h Let f be 10/16-24. Put 18, f, -2/5 in ascending order. f, -2/5, 18 Suppose -4s - 2c - 48 = 0, -2c - 2 - 2 = 0. Put 3, 5, s, -3 in ascending order. s, -3, 3, 5 Let d = -0.5 - -2. Let g = -1 + d. Sort 0, -0.1, g in decreasing order. g, 0, -0.1 Let a = 6 + -1. Suppose f = -3q - 9, 5f + 19 = q - 3q. Put 1, q, a in decreasing order. a, 1, q Let z = -8 - -8.05. Let i = z - -0.15. Sort i, -2, -5. -5, -2, i Suppose 5d - 25 = 0, x + 7d = 5d + 14. Sort -4, 5, x in descending order. 5, x, -4 Suppose 2f - f + 2m = -13, -21 = 5f - m. Put -4, -3, f in increasing order. f, -4, -3 Let w be (4/10)/((-2)/10). Let t = 41 + -45. Put w, 0.1, t in ascending order. t, w, 0.1 Let l = 0.2 + 0.3. Let n = 6 - 7. Sort n, l, -4. -4, n, l Let y be 8/224/32. Sort 29, -5, y in decreasing order. 29, y, -5 Suppose -3q + 8 - 2 = 0. Let v be 6/(-4)(-2)/(-3). Put q, v, 3 in ascending order. v, q, 3 Suppose n - b = -7 + 19, -4n + 3b + 52 = 0. Put n, 0, 3, -1 in descending order. n, 3, 0, -1 Let w(x) = x - 12. Let d be w(8). Sort -5, -1, d in decreasing order. -1, d, -5 Suppose -4x = 5p - 6, 4x - 2p + 5 = -3. Sort x, 2/19, -4/3. -4/3, x, 2/19 Let d be (-2)/(6/(-3)) - (3 - 0). Put 0, -1, d in ascending order. d, -1, 0 Suppose 5r = -0 - 10. Put -8, -5, r in descending order. r, -5, -8 Let z be 16/62/((-12)/18). Put 3, 5, z in ascending order. z, 3, 5 Let w(g) = g3 - 2g*2 - 3g - 1. Suppose -4j - 1 = -2o - 5j, -3o + 3j = -24. Let i be w(o). Let t = 7 + -11. Sort 2, t, i in decreasing order. 2, i, t Let r be -34 - (-3 + (-4)/(-2)). Let y = r + 28. Sort -4, -1/10, y in increasing order. y, -4, -1/10 Let m be -2(-3)/(-9)-3. Suppose -1 + 7 = mf. Put f, 5, -5 in decreasing order. 5, f, -5 Suppose -3i + 10c = 5c - 59, 3i = -3c + 27. Put i, 5, -2 in decreasing order. i, 5, -2 Let l = -0.06 + -3.94. Let p = l + 4.4. Let m be -1 - ((-6)/1 - -1). Sort p, 1, m in descending order. m, 1, p Let r(v) = -v3 + 8v*2 - 6v - 6. Let i be r(7). Suppose 33 = -4d + 5. Let a = -12 - d. Sort i, -1, a. a, -1, i Suppose -x = 99 + 5. Let c be x/(-32) + 2/(-8). Put c, -4, -2 in descending order. c, -2, -4 Let i(t) = -t2 - 5t - 2. Let k be i(-4). Let l be 9/42 + (-1)/k. Let f = -2/115 + -101/805. Sort 4, f, l in descending order. 4, f, l Suppose -3q - 2c = 10, 4q - 5c = -0q - 21. Sort q, 0.9, -2/15 in descending order. 0.9, -2/15, q Let t = -12 - -14. Put t, 5, -5 in increasing order. -5, t, 5 Suppose -3l - l = 20. Let a = -9 + 10. Let m = a - 2. Sort -2, l, m in decreasing order. m, -2, l Let q(i) = -i*3 - 8i*2 - 9i - 15. Let f be q(-7). Sort 2/5, f, -4/5 in increasing order. f, -4/5, 2/5 Let b = 357 + -361. Let k be ((-2)/(-4))/(9/(-12)). Sort 2, k, b. b, k, 2 Let g(p) = -p*2 + 6p - 6. Let u be g(4). Suppose q - uq = 1. Sort q, -4, 2 in descending order. 2, q, -4 Suppose 11h = -28 + 6. Sort 0, h, 66 in decreasing order. 66, 0, h Let t be 0 - 5/((-10)/(-24)). Let w be t/21 + 4/14. Let q be (6/(-45))/((-4)/6). Put 4, q, w in decreasing order. 4, q, w Let c(y) = -y*3 + 7y*2 - 6y + 2. Let w be c(6). Let f be ((-2)/(1-4))/(-1). Let l = f - -5/6. Sort w, 0, l in increasing order. 0, l, w Suppose 0 = -2m - 4z, -3m + 14 = 2m - 4z. Let q be m3(-1)/(-2). Suppose -qc + 4 = -c. Sort -3, -2, c in ascending order. -3, -2, c Suppose -4q + m + 17 = 0, 3m + 40 = 5q - 2m. Suppose -20 = -4g - g. Let u be (-9)/3 - (-32)/g. Put u, q, 1 in decreasing order. u, q, 1 Let c be 1 + 4/2 + -2. Suppose 3r = -3h - 3, r + 3h + 9 = -0h. Suppose 0 - 1 = 2y + rp, -4y = 5p + c. Put -1, 0, y in decreasing order. y, 0, -1 Let n = -28/57 - -3/19. Let u = 2 + -2.3. Put n, -4, u in decreasing order. u, n, -4 Let m = -14 - -18. Sort -1, m, 1 in decreasing order. m, 1, -1 Let n = 0.06 - -2.94. Let q = 5 - n. Sort 4/5, 1, q in decreasing order. q, 1, 4/5 Let i = 8 + -4. Sort 1, i, -4. -4, 1, i Suppose 6 - 1 = w. Suppose 3r = 3l - 21, 3r + l = 6l - 29. Sort w, r, 2 in increasing order. r, 2, w Let j = -58 - -62. Put j, 5, -4 in decreasing order. 5, j, -4 Suppose 4x - 2 = -14. Sort -8, -1, x in increasing order. -8, x, -1 Let l = -1.94 + -0.06. Let j(w) = w3 + 13w*2 + 41w + 12. Let s be j(-8). Sort -0.1, s, l in ascending order. l, -0.1, s Let h = -23 + 2. Let a = 24 + h. Sort -0.2, a, 1/5 in ascending order. -0.2, 1/5, a Let p(b) = -b*2 + 4b - 2. Let h be p(2). Let v(x) = x*2 - 6x - 7. Let q be v(7). Let t = h + q. Put t, 1, -4 in increasing order. -4, 1, t Suppose -r + 16 = 3r. Suppose -36 = -3w + rt, 4w - 17 = -7t + 2t. Let o be (-1)/2(-6)/w. Sort -2/3, o, 0 in ascending order. -2/3, 0, o Let p be (-5)/((-5)/2)-8. Let c be (-2)/(-6) + p/3. Sort -5/4, 0, c. c, -5/4, 0 Let s = 0.11 - 0.91. Let r = 0.2 + s. Let y = r - 0.4. Put 1, y, 4/5 in ascending order. y, 4/5, 1 Let z(r) = -r3 - r2 + 9r + 2. Let p be z(-7). Let q = 2561/11 - p. Let h be 4/(-12)-6 + -1. Put -1, q, h in descending order. h, q, -1 Suppose -4s + 40 = 200. Let k be (1/2)/(5/s). Suppose c + 0 = -5. Sort k, c, 2 in increasing order. c, k, 2 Let h = 2 + -2. Let s be 9/8 - 63/(-168). Put 0.4, h, s in increasing order. h, 0.4, s Suppose 0 = 3x - 3n - 15, -3n - 15 = -x - x. Suppose 0 = -3h - xh + 15. Sort 0, -1, h. -1, 0, h Suppose 7 = 4*g - 13. Let o = -0.1 - 0.4. Put g, o, 1/3 in increasing order. o, 1/3, g Let j = -0.6 - -3.6. Let q = j + -2.9. Let b = 0.7 +	{ "pile_set_name": "DM Mathematics" }
ppose -ct = -3 - 42. What is the remainder when 26 is divided by t? 8 Let d be 1143/15 - (-2)/(-10). Suppose d = 5v - 49. Let l = v + -8. Calculate the remainder when l is divided by 6. 5 Let j = -19 + 47. Suppose -j = -0z - 4z. Calculate the remainder when 26 is divided by z. 5 Let j = 2 + 0. Suppose -5o - 5b = -140, 4o - jb - 38 = 50. What is the remainder when o is divided by 13? 11 Suppose 3v + 34 = 5s, 0 = 5v - 4s + 2 + 46. Calculate the remainder when v/(-3)12/1 is divided by 17. 15 Let y be 1/(-2) - (-3)/2. Let l be y(5 + -2) - -1. Suppose -2f - 3g - 12 = -lf, -5f + g = -17. Calculate the remainder when 4 is divided by f. 1 Let q(m) = -2m - 7. Let s(a) = a2 + 7a + 6. Let g be s(-5). Calculate the remainder when q(-6) is divided by (6/g)/(12/(-16)). 1 Suppose 0 = -10m + 7m + 684. What is the remainder when m is divided by 46? 44 Let t = 3 - 3. Let l = t - 0. Let o = l + 14. Calculate the remainder when o is divided by 5. 4 Let k = 15 + 15. Let h = k - 17. Let c = 93 - 55. Calculate the remainder when c is divided by h. 12 Suppose -6p + 3p + 39 = 0. What is the remainder when p is divided by (-34)/(-8) + 2/(-8)? 1 Suppose 0 = 3b + 4o + 11, -o - 4o = b + 11. Suppose 2t = 30 + 4. What is the remainder when t is divided by (b1)/(3/(-18))? 5 Calculate the remainder when 1 + (440 - -1) is divided by 55. 52 Let a(m) = -5m - 80. Calculate the remainder when a(-29) is divided by 25. 15 Let x be (3/1)/((-6)/(-4)). Suppose 35 = -xa + a. Let g = 63 + a. What is the remainder when g is divided by 10? 8 Suppose 28 = a + 3a. Suppose -4c + 4y + 5 = c, 4c - y + a = 0. What is the remainder when (-20)/c(-21)/(-7) is divided by 7? 6 Calculate the remainder when 30 is divided by (-9)/(-3)(-32)/(-6). 14 Suppose 5x - 30 = -5b, 6b - 20 = b. Suppose 2t - 3t = -x. Calculate the remainder when t is divided by 2. 0 Suppose -4w = 5 - 41. Calculate the remainder when 26 is divided by w. 8 Suppose 0g = g - 16. Calculate the remainder when 59 is divided by g. 11 Let d be -2 + (-2)/(4/166). Let r = d - -7. What is the remainder when 25 is divided by ((-4)/12)/(2/r)? 12 What is the remainder when 102 is divided by (-174)/(-8) + (-45)/60? 18 Let k = 71 - 39. Let c(w) = 2w - 2w - 2w - 7 + 0w. Calculate the remainder when k is divided by c(-9). 10 Let s be 9 - (3 - 5)/2. Suppose 0k + s = k. Calculate the remainder when 27 is divided by k. 7 Let b = 15 - 2. What is the remainder when b is divided by 7? 6 Let h(k) = -k*2 + 5k + 14. What is the remainder when 39 is divided by h(6)? 7 Suppose -3p = -p + 2g - 16, -2p + 17 = 3g. Suppose l - p = 13. What is the remainder when 672/l - 4/(-10) is divided by 12? 10 Let f(y) = y - 4. Let c be f(8). Suppose -25 = -5p - 10, -co = -p - 9. What is the remainder when o is divided by 2? 1 Suppose 4p + 11 = 95. What is the remainder when p is divided by 11? 10 Suppose -2o = -0o - 6. Let k(y) = 2y + 2y + y2 - 1 - o. Calculate the remainder when k(-6) is divided by 5. 3 Suppose 50 = 2v - 2h, -v + 0v = -2h - 27. What is the remainder when v is divided by 9? 5 Suppose d = -4d + 175. Let w = -10 + 22. Calculate the remainder when d is divided by w. 11 Let q(h) = -5h + 51. What is the remainder when 43 is divided by q(8)? 10 Suppose g + 2s + 31 = 2g, -5g + 5s = -175. Calculate the remainder when g is divided by 2/(1/(-20)-4). 9 Let m(d) = -d*2 + 8d + 7. What is the remainder when 110 is divided by m(7)? 12 Let c = -35 - -55. Calculate the remainder when 116 is divided by c. 16 Suppose 5o + 72 = -28. Let j = o + 45. What is the remainder when j is divided by 7? 4 Let h(c) = c3 - 8c*2 + 10c - 6. Let q be h(7). Suppose -4k = -33 - q. Calculate the remainder when ((-7)/4)/((-3)/k) is divided by 4. 3 Calculate the remainder when 4/(-3)3 + 25 is divided by 13. 8 Let n = 200 - 125. Let x = 41 + -22. Calculate the remainder when n is divided by x. 18 Let n(m) = -m*2 + 3m - 3. Let w be n(2). Suppose 0h = -2h. Let u = h - w. Calculate the remainder when 2 is divided by u. 0 Let h(p) = 27p3 - p + 1. Let i be h(1). What is the remainder when (-45)/i(-2 - 1) is divided by 3? 2 Let a = 37 + -24. Let u(z) = 49z2 - 4z + 4. Calculate the remainder when u(1) is divided by a. 10 Let b be 2/2(-1 - -1). Suppose -3z + 33 = -bz. Calculate the remainder when z is divided by 7. 4 Let v = 38 - 0. Calculate the remainder when v is divided by 13. 12 Let x = 19 - 11. Calculate the remainder when x is divided by 4. 0 Let n(h) = 4h*2 - 2h + 1. Let b be n(1). Suppose 0 = -y + by - 16. Let o(z) = z + 12. Calculate the remainder when y is divided by o(-7). 3 Let o(f) = 2f - 1. Calculate the remainder when 3 is divided by o(2). 0 Calculate the remainder when 58 is divided by 1 - (-9 + 9 - 28/2). 13 Let t(h) = -13h - 41. Calculate the remainder when t(-13) is divided by 44. 40 Let u = 29 + -15. Suppose 2a = 5a - 30. Let r(p) = -p3 + 10p*2 + 2p + 7. Calculate the remainder when r(a) is divided by u. 13 Let j(v) be the third derivative of v5/60 - v4/24 + 4v3/3 + 9v*2. Calculate the remainder when j(0) is divided by (-17)/(-5) + (-4)/10. 2 Suppose -3q + q = -94. Calculate the remainder when q is divided by 12. 11 Let g = 0 - -3. Let a(f) = 5f + 6f - 8f - 4. Calculate the remainder when 9 is divided by a(g). 4 Suppose 0s = s - 63. Calculate the remainder when s is divided by 17. 12 Let f be (57 - -3)/21. Suppose f = -p + 101. Calculate the remainder when p is divided by 24. 23 Suppose s + 5 = 1. Suppose -n + 6 = 1. What is the remainder when (18/(-27))/(s/42) is divided by n? 2 Let b be (15/(-4) - -3)12. Let c(g) = g*3 + 10g*2 + 8g + 5. What is the remainder when c(b) is divided by 4? 2 Suppose -319 + 25 = -7m. Calculate the remainder when m is divided by 22. 20 Let x = -10 - -21. Let g = 14 + -11. Suppose -gv + 1 = -x. What is the remainder when 6 is divided by v? 2 Let j(t) = t*2 + 2t + 12. Calculate the remainder when j(-6) is divided by 4. 0 Suppose 2m - 204 = -4j, -2m = 4 - 0. What is the remainder when 311 is divided by j? 51 Let w(z) = 4z*2 - 4z - 1. What is the remainder when w(3) is divided by ((-13)/3)/(1/(-3))? 10 Suppose -12 = s - 4s. Suppose -5x + 12 = u, -sx + 10 = -0u + u. Calculate the remainder when 2 is divided by u. 0 Calculate the remainder when (320/15)/(3/9) is divided by 24. 16 Let m be (5 + -3)1-3. Let r = m - -15. What is the remainder when 26 is divided by r? 8 Suppose -4c + 137 = -3w, 5w = c - 14 - 16. Calculate the remainder when c is divided by 19. 16 Suppose -5g = 5z - 60, -6z = -2z + g - 57. Calculate the remainder when z is divided by 4. 3 Suppose g - 31 = -n + 2g, n - 4g - 31 = 0. Calculate the remainder when n is divided by 17. 14 Let x = 2 + -1. Let k(a) = 3a*2 - 2a + 1. Let u be k(x). Suppose 21 = -ug + 3g. What is the remainder when 40 is divided by g? 19 Let i(h) = 26h + 10. What is the remainder when i(7) is divided by 39? 36 Let i = 8 - -7. What is the remainder when 65 is divided by i? 5 Suppose -f + 202 = 139. What is the remainder when f is divided by 16? 15 Let u = 90 + -20. Calculate the remainder when u is divided by 12. 10 Let j be (-3)/((-44)/16 + 3). Let b(t) = -t2 - 14t - 17. What is the remainder when 19 is divided by b(j)? 5 Suppose 3o = -s + 103, 7o = 8o. Calculate the remainder when s is divided by 27. 22 Let h = 0 - 0. Suppose w + 3w + 8 = -2o, 3w - 12 = h. Let k = o + 28. Calculate the remainder when 46 is divided by k. 14 Let p = 62 - 34. Calculate the remainder when p is divided by (0 - 1)-25. 8 Let i be (2 - 1)/(2/4). Suppose t = o + 3, 0 = -6o + o. Suppose -tj - ij = -15. What is the remainder when 7 is divided by j? 1 Suppose 5y + 146 = 4d, d + 3y - 30 + 2 = 0. Suppose -5x + d = -51. Calculate the remainder when 50 is divided by x. 16 Let z be (-2)/((-2)/1)5. Let n(c) = c*2 - c + 4. Let a be n(0). Suppose ax - z = 67. Calculate the remainder when x is divided by 10. 8 Let c(s) = -3s2. Let x(m) = 2m*2 - m + 1. Let j(w) = -3c(w) - 4x(w). Let o be j(-4). What is the remainder when 20 is divided by o/21 - -9? 6 Let h = 71 - 49. Calculate the remainder when h is divided by 6. 4 Let n = 9 - 7. Suppose -5s - n = w + 2, -s + 28 = 5w.	{ "pile_set_name": "DM Mathematics" }
457 = 0. Let v = h - -69. Solve -u = -vu + 25 for u. 5 Suppose 4g + 5z - 33 = 71, 0 = 2g + 3z - 50. Suppose 30j = gj - 25. Solve 3q = 8q + j for q. -5 Let y = -108 + 113. Let u be 56 - (-6 + y) - (-1 + -2). Suppose 62 = 2r + u. Solve 2b - 3b = r for b. -1 Suppose 2g + 3 = 5. Let q(n) = -7n + 20n - 13n + 2n2 + n. Let f be q(g). Solve 0m = -fm + 9 for m. 3 Let p(w) = 254w*2 + 5w + 1. Let n be p(-1). Let t = n - 244. Solve -ts + 2s + 4 = 0 for s. 1 Let w(x) = -x*2 + 2x + 29. Let g be w(6). Suppose gk - 20 = -3c - 0c, -3k - c = -12. Solve -y + 9 = -ky for y. -3 Let a(l) = 108l + 1669. Let t be a(-15). Solve 0 = -5u + 79 - t for u. 6 Let y = 2851 - 2849. Solve -32v + yv - 60 = 0 for v. -2 Suppose 0t = 7t - 21. Let h(x) = 1 - tx + 9 + 2x. Let j be h(10). Solve -3y = -jy + 9 for y. -3 Let k(y) = 6y*3 - 73y*2 - 58y - 71. Let s be k(13). Solve s = 90w - 95w for w. -4 Suppose 4g - 753 = -i, -4g - 3i + 762 = -5i. Suppose -21 + g = 6r. Suppose -23n = -rn + 5. Solve s - n = 4 for s. 5 Suppose 4c + 4 = 0, 4p - 2p + 3c - 9 = 0. Let m be (-3 - p)(-4)/6. Solve -6x - m = -12x for x. 1 Let m = -692 + 695. Suppose 0 = -z - 0z - 2i, -mi = 0. Solve 5n - 14 - 11 = z for n. 5 Suppose 2n + 291 + 143 = 3r, 3n + r = -640. Let f = 224 + n. Solve 0 = -6q - 20 - f for q. -5 Suppose -5t = 4b - 37, t + t - 4b = 26. Let d(j) = j + 17. Let u be d(t). Let a = u - 19. Solve 10 = 5x - ax for x. -5 Suppose 3s + 2l = -2l + 112, 3l - 147 = -4s. Let r = s + -41. Let o(a) = a*3 + 4a*2 - 4a + 5. Let c be o(r). Solve cy = y for y. 0 Let i(w) = -w2 - 31w + 187. Let v be i(-36). Solve -v = 34p - 7 for p. 0 Suppose -12y + 10y - 92 = 0. Let p be 2332/1219 + (-4)/y. Solve 0 = pv - 8 + 16 for v. -4 Let z(k) = 5 - 20k - 20k + 41k. Let m be z(-4). Solve 2 + m = 3h for h. 1 Let f be 0(9/(-2) - -5). Suppose -3p - 3 = -4l, f = 3l + 3p + p - 21. Solve -4n - l = -n for n. -1 Suppose 3452 + 2761 = 109b. Solve b = -5a + 42 for a. -3 Let k = -13901 + 14376. Solve -20g - 635 = -k for g. -8 Let t(i) = -i3 + 4i*2. Let c be t(3). Let r be 3/c - ((-23)/3 + 0). Solve -r = -x - 3x for x. 2 Let l = 117 - 111. Let h be (l - (8 + -1))/((-2)/16). Solve -4s + 12 = -h for s. 5 Let x be (-2345)/2680 - (-1519)/8. Solve -37f - 26f = -x for f. 3 Let d(v) = v3 + 4v*2 - 11v + 7. Suppose 3g + 37 = 97. Suppose -4s - 2c - g = 0, 0 = -2s - c + 5c - 20. Let q be d(s). Solve u - 2u = q for u. -1 Let c(k) = 5k3 + 2k*2 - 1. Suppose -3z = 15 + 102. Let q be 22/26 + (-6)/z. Let g be c(q). Solve 0 = 2r - gr + 12 for r. 3 Let s(b) = 40b - 116. Let i be s(4). Solve -ix + 43x = 0 for x. 0 Suppose 5p = 5l + 78 + 192, 4 = 2l. Solve p = 19r - 20 for r. 4 Suppose 5z = 2m - 40, m + 3z = -3 + 1. Suppose -3j = -j - m, 2j - 10 = -4l. Solve ld = 3d - 6 for d. 2 Let k be 40 + 5/(-1 + 6). Suppose -6x - k = -17. Let z be x/(-18) + (-129)/(-27). Solve zw = w + 20 for w. 5 Let l = -7 - -10. Let j be 3 + 10 + -28 + 10 + 8. Solve 4m = lm - j for m. -3 Let f be (-1)/(-2) + 34748/56. Solve 642 - f = 7o for o. 3 Let i(z) = -6z + 4. Let a(o) = 4o - 6. Let r(v) = -6a(v) - 5i(v). Let t be r(-2). Let g be 142/7 - 2/7. Solve g = -0q + tq for q. 5 Suppose 0 = -3v + 9. Suppose -15 = -5f, 2f = vg - g. Solve -5n - 22 = g for n. -5 Suppose -5s = -34 - 166. Suppose 5u - 5h - 10 = 0, 5u + 2h = -3h + s. Suppose -2w + ux + 5 = 0, -3w = w - x - 1. Solve w = 3v - 6 + 3 for v. 1 Suppose -4z + 45 + 20 = -5q, 0 = 2z - 3q - 35. Suppose 4n + 30 = 30. Solve n = y - 6y + z for y. 2 Suppose 0x = x - 12. Let i(z) = -z*2 + 46z - 246. Let s be i(23). Let v = s + -280. Solve 0c + x = vc for c. 4 Let t(r) = 2r3 + 22r*2 + 47r + 1. Let c be t(-3). Suppose -u - 24 = -3u. Solve uk - c = 14k for k. -2 Let b(r) = 6r*3 - 63r*2 - 33r + 34. Let n be b(11). Solve ns - 52s = -162 for s. 9 Let p = -251 + 368. Let z be 866/9 - 26/p. Let a be z/44 - 10/55. Solve -2u - 16 = au for u. -4 Let p = -441 - -459. Solve -7 + 79 = -pd for d. -4 Suppose 0 = 4k - 53 - 31. Let w = -1205 - -1225. Solve -b + w = k for b. -1 Let t be 5/(-2)1-2 - 3. Let p be (-1)/t + 30/(-12). Let z be (-11)/p + 12/9 + -2. Solve 0 = -zn - 2n - 5 for n. -1 Let w(p) = 3p2 + 69p - 13. Let l be w(-24). Suppose 0 = 2m - y - 27, 4m = y + l. Solve 15h - mh - 2 = 0 for h. -2 Let h = 525 + -524. Let u be 1 - (-5)/(-5)h - -4. Solve 11g = ug for g. 0 Suppose -w - 5q + 14 + 23 = 0, -229 = -5w - 3q. Solve 0 = -wn + 18n - 29 for n. -1 Let i be ((9 - 5) + -6)/1. Let g be 2((-113)/i - 0). Let a = g - 108. Solve -4m + a = -11 for m. 4 Let x(k) = -6k - 12. Let o be x(-3). Let a be (-4)/(-14)(-42)/o - -2. Solve -n - n = -an for n. 0 Suppose 0 = -12j - 25 - 35. Let l be 1/j - (-126)/30 - 1. Solve 2f - 5 + l = 0 for f. 1 Let j be 4/(-5 + -11)-16. Suppose 4w - 10 = -m, -3w + 2m + 0m + 13 = 0. Suppose 8i + wt - 10 = ji, -3i - 2t = -7. Solve q + i = 4 for q. 3 Suppose -10j + 5j = -180. Suppose -jm = -37m + 5. Let a be (8/6)/(m/30). Solve a = 2k - 0k for k. 4 Suppose 14 = 3o - 100. Suppose 0 = 38r - 40r + o. Suppose -3d + 0h = -h - r, 5h + 10 = -2d. Solve 3w + 4 = -d for w. -3 Suppose 201p - 2617 + 607 = 0. Solve -722x + 727x - p = 0 for x. 2 Let n be ((-96)/9)/(-2 - 8/(-6)). Suppose -4p = -2q + 22, -7q + 3q + n = -p. Solve t = -q - 2 for t. -5 Let b(c) = 3c - 28. Let x be b(10). Suppose xn + 2n - 16 = 0. Let v(w) = w - 2. Let k be v(n). Solve 0 = -4g + kg - 6 for g. -3 Suppose m + 16 = 4a - 4m, 2a - 3m = 6. Let d = 13 - a. Suppose ds = 53 + 3. Solve 6 = 4u - s for u. 5 Let m(r) = 2r*3. Suppose -p - 15 = 2f, 2f + 2p + 9 = 7p. Let a = -6 - f. Let b be m(a). Solve -13 = -5x + b for x. 3 Let l = -16298 + 18170. Solve -lz = -1870z - 6 for z. 3 Let n = 4311 + -2877. Solve 0 = 4b - n + 1438 for b. -1 Suppose 0 = -3d + n + 371, -46n + 48n - 250 = -2d. Solve dw + 904 = 11w for w. -8 Let h be (-1 - -3)(-20)/(-4). Suppose -106 - 24 = -hv. Suppose -3k + 4k + 3z = -v, -k - 18 = 4z. Solve ki = -i - 3 for i. -1 Let d = -21 + 27. Suppose 0 = -3h + 4j + 24, 3h - 4h + 3j = -13. Solve 0 = hp - dp for p. 0 Suppose 0 = 6o - 7o + 4. Let i be 1 + 16/66/o. Suppose 0 = -3h + 4w + 4, -3 + 23 = ih - 4w. Solve 0 = 5b - hb - 6 for b. -2 Let b = -28 - -37. Let c = b - 9. Suppose 4a = 8, 9 = 3v - 3a - ca. Solve -v - 5 = 2w for w. -5 Suppose -v + 485 = 3x - 0v, -2x - 3v + 314 = 0. Let w = x + -254. Let u = w - -97. Solve -k = -uk - 15 for k. -3 Let m(q) = 11 - q*2 - 2q - 11 + 12q. Let f be m(0). Solve 2n + 10 = -fn for n. -5 Let o be (-290)/(-25) + -9 + (-188)/(-20). Let r be 2/((-30)/(-3)) + (-245)/(-25). Solve -ra = -7a - o for a. 4 Let i(a) = -2a*2 - 37a + 223. Let t be i(-23). Solve -tu + 4 = -28 for u. 2 Let m be ((448/3)/7)/((-1)/(-6)). Suppose 488 = 9x + m. Solve x = 4d + 4d for d. 5 Let p(h) = -3h3 - 45h*2 - h - 5. Let o be p(-15). Solve 249 - 289 = -oc for c. 4 Suppose 4s - 2s + 60 = 4v, -2v = -5s - 22. Solve 67 = vk + 35 for k. 2 Suppose 13r - 2819 - 1224 = 0. Suppose 0 = 3a - 314 + r. Solve -5s + 9 = -a for s. 2 Let c be 4/18 - (-25)/9. Let o(q) = -q3 + 9q*2 + 27q - 55. Let b be o(11). Suppose 2w - 3p + 8 = 0, b = -4w + 7w + 3p - 18. Solve -wm - 1 = -c for m. 1 Suppose 3r + r - 160 = 0. Suppose 1263m - 1572 = 453m + 689 + 1789. Solve -mj - 60 = -r for j. -4 Let p = -98 + 101. Suppose -5l + 90 = -6o + o, -po = 4l - 65. Suppose -22 = -3c + l. Solve -cq + 8 = -9q for q. 2 Suppose -3a = -4l + 107, -5 - 10 = 3a. Suppose 32s = ls + 9. Solve 2v = 7 - s for v. 3 Let a(d) = d3 + d2 - 1. Let w(s) = 5s*3 + 9s*2 + s - 8. Let x(p) = 6a(p) - w(p). Let z be x(3). Let l be -4 + 8 + z(4 + -2). Solve -3q = lq for q. 0 Let t = -19799 - -20046. Solve 0 = -td + 238d + 36 for d. 4 Let s(k) = k2 - 42. Let q be s(8). Let a be (10 - q)/((-3)/2). Solve 4u = a - 20 for u. -3 Let z be 7 - (-12 + 14 - -4). Let f be (-2 - -20) + (-2 - 0). Suppose -f = -c - z. Solve -4o = o - c for o. 3 Let i be (-10)/(-8) - (6 - (-115)/(-20)). Let b be 9 + i/(-3)-3. Solve -y = 13 - b for y. -3 Let i = 48 - 34. Suppose 0	{ "pile_set_name": "DM Mathematics" }
+ 0s + s5 + (2s*2 + 2 - 2)(4s3 + 0s3 - s3). -77s5 Expand (-z3 + z3 + 2z*3)(0z + 2z + 0z) + 0 + 0 + 2z*4 + (4 - 5 + 0)(-288z2 + 294z*2 + 80z*4 + 685z*4). -759z*4 - 6z*2 Expand (-2401r + 0 + 5273r + 3471r + 0)(-3r - 3r - 10r*2 + 4r). -63430r3 - 12686r*2 Expand 6585 - 6585 - 932q - 4q + 3q - q - q + 3q + 0q + (-4q + 3q + 3q)(-2 + 4 - 4). -936q Expand (669 - 2065 + 603 + 645)(-10h + h + 3h). 888h Expand -13 + 4x*2 - 6x*2 + 16 + (-3x + 2x + 2x + (-3x + 0x + x)(-2 + 5 - 4) - 1 + x + 1 - 6x + x + 3x)(-x - 3x + 3x). -4x2 + 3 Expand 18 - 31j*2 - 20 - 2j*4 + 2j*3 + 30j*2 + (-98733j + 98733j - 767j*3)(-1 + 1 - j). 765j4 + 2j3 - j2 - 2 Expand (78970 - 78970 - 117z)(-3z3 + 7 - 36z + 36z). 351z*4 - 819z Expand (-50 - 73 + 75)(0k + 0k + 2k)(-2 - 5 + 1). 576k Expand (9x - 2x + 0x)(4 - x - 4)(14x - 354x2 - 28x + 11x). 2478x*4 + 21x*3 Expand (-26 + 30 + h - 5h)(188h*2 - 188h*2 + 139h*3). -556h*4 + 556h*3 Expand (-5f + f + 2f)(4 - 3 - 3) + 27f + 10f - 215f. -174f Expand (232 + 157 - 102 + (2 - 3 + 0)(-1 + 1 + 2) + 2 - 1 + 0)(2q - 4q - 5q). -2002q Expand 21879 + 335c3 - 21832 - 111c3 + (-c2 - c*2 + 4c*2)(2 - 2 - c). 222c3 + 47 Expand -121 + 119 - 54r - 11r + (-1 + 1 + 1)(-2r - 3r + 4r) + 5r - 4r - 2r + (3 - 3 + 2r)(4 - 1 + 1). -59r - 2 Expand (6265s - 40s + 1635s + 45s + 4121s)(1 - 1 - s3). -12026s*4 Expand (23h*3 + 17h*3 - 54h*3)(1 - 2h - 1)(-h - 3h + 2h). -56h5 Expand (-o2 + 5o*2 - 3o*2)(1 - 1 - 1) - 4o2 - 57o*2 - 34o*2 + (0o + 0o - o)(-3 + 0 + 5)(6o + o + 0o + (2 - 4 + 1)(4o - 2o - o)). -108o2 Expand (-2r + r*2 + 2r)(20 - 12 + 26) + 2r*2 - 2r*2 - 2r*2. 32r*2 Expand (-y + 9y - 5y)(-1 - 1 + 1)(-115y + 458y + 666y)(-2y*2 + 2y*2 + 3y*3 + (-3y2 + y2 + y*2)(-3y - 2y + 3y)). -15135y5 Expand n2 + 111609n - 3n*2 - 111538n + 1 + 8n2 - 2n*2 - 2n*2 + (-4n + 3n - n)(-1 - 1 + 4)(n - 2n + 0n). 6n*2 + 71n + 1 Expand 13u - 5u + 2u + (2 + 0 - 4)(4u - 2u + 0u) + 4u - 17 + 17 + u + u - 5u. 7u Expand 2o2 + o3 - 2o*2 + (2o + 0 + 0)(1 - 1 + o2) + 0 + 0 + 2o*3 + (13o*3 + 33o - 33o)((-1 + 1 + 1)(-5 - 3 + 6) + (1 - 2 - 1)(2 - 5 - 2)). 109o3 Expand (-3197 + 1613 + 1619 + 55t)(14 + 6 - 31). -605t - 385 Expand -11f4 - 8f*4 + 13f4 + (f3 - 4f3 + 4f*3)((f + 0 + 0)(3 - 4 - 1) - 115f - 3 + 3). -123f4 Expand (0o - 4o - 13o)((-o + 0 + 0)(26o - 26o - 17o2) - 3o*3 + 4o*3 - 3o*3). -255o*4 Expand (6p*3 - 3p*3 + 2p*3)(11p - 8p + 11p) + (-5 + 0 + 3)(-3p4 + 2p*4 + 2p*4). 68p*4 Expand (2i*2 + 0i2 - i2)(2i + 5i - 5i) + 0i3 - 2i3 + i3 - 71i3 + 7i*3 + 2i*3 + 33i*3 - 5i*3 - 10i*3. -43i*3 Expand (1 - 1 - 1)(0y2 + y2 + y2)(-2 - 3588y - y2 - 3270y + 5391y). 2y*4 + 2934y*3 + 4y*2 Expand 1744r*4 - 895 - 4589r*4 + 895 + r + 0r*4 + 8r*4 - 2r*4 + (2r3 + r3 - 4r3)(1 - r - 1). -2838r4 + r Expand ((-3 + 0 - 2)(-5d - d + 3d) + 3d - 3d - 6d)(6 + 14 + 5)(-3 + 3 - 2). -450d Expand (-68 - 47 + 14 + (5 + 0 - 3)(-2 + 0 + 0) + 2 - 4 + 4 + 3 - 1 - 1 + 1 - 1 + 1 + 6 - 9 - 9 + 1 + 1 + 0)(-4s5 + 2s5 + s5). 111s5 Expand (-15195s*4 + 27397s*4 - 14821s*4)(-1 + 1 + 3)(-4 + 4 + 1). -7857s*4 Expand (62 - 92h*3 - 62)(-4h2 - 22h + 22h). 368h*5 Expand -12343s - 10689s + 19600s + (-3 + 3 - 2)(4 - 4 + 8s). -3448s Expand (13 + 537t*2 + 4t*3 - 536t*2 - 5t*3)(4 - 2 + 0)(-1 + 5 + 0). -8t*3 + 8t*2 + 104 Expand (1 - 2g*3 + 10g*3 - 2)(8g2 - 4g*2 + 4g*2). 64g*5 - 8g*2 Expand -2p*4 + 2p*5 + 2p*4 + (4p - 3p - 3p)(-p4 - 5p*4 + 5p4) - p5 + 0p4 + 0p*4 + 3 - 9 + 0 - 7879p*5 - 8895p*5 + 6. -16771p*5 Expand a - a + 3a*2 + 39a - 26a2 - 39a + (-1 + 1 - 2)(4a*2 + 0a*2 - 3a*2) + 2a*2 + 0a*2 - 3a*2 + (0a - 3a + a)(4a - 4a - a). -24a2 Expand (118w*2 + 207 - 207)(7w - 7w + 2w2). 236w*4 Expand (-26 + 60 + 26)(992 - x*2 + 4x - 5x - 1435). -60x*2 - 60x - 26580 Expand (1 + 0 + 2)(68 + 68 + 40)(b2 - b2 - 2b2) + 0 + 0 + b2 + (4 + 0 - 3)(-5b2 + 13b - 13b). -1060b*2 Expand (-2 + f + 2 + (5f + 0f - 4f)(-2 - 1 + 1) + 3f + 2f + 0f)(-3f + 13f + 6f)(2f3 + f3 - f*3). 128f*5 Expand ((-4 + 1 + 2)(-97z - 22z + 24z) - z - 8z - 7z)(5z2 - 2z2 - z2). 158z3 Expand 2p + 0p - p + (-6 + 0 + 4)(2p - 1 + 1) + (0 - 9 - 11)(-2p - p + 2p) + (-75 - 16 - 17)(4 + p - 4). -91p Expand ((-1 + 1 + v)(3v + 4v + 7v) + 3v2 + v2 - 2v*2)(-5 + 0 + 0) + (-2v + 3v - 2v)(-2v - 4v + 5v) + v + 2v*2 - v. -77v*2 Expand (-3h - 2h + 6h)(-9h*3 - 6542h - 6h2 + 53h*3 + 6549h + 1). 44h4 - 6h*3 + 7h*2 + h Expand (-3j*4 - 19j4 - j4)(1 - 1 - 3j) + 12j5 + 13j*5 - 8j*5. 86j*5 Expand (-2x - x + 2x)(-1700 + 1700 - 42x)(1 - 6 + 3). -84x2 Expand (-12j2 - j2 - 2j2)(-19 + 18j - 26 + 44)(2j2 - j2 + 2j*2). -810j*5 + 45j4 Expand g4 - g2 + g2 + (-2g2 + g2 + 3g*2)(10g2 + 0g*2 - 3g*2) - 101g*3 + 34g*4 + 101g*3. 49g*4 Expand (-l + l - l)((2l + 2 - 2)(l - 2l + 3l) - 14210l - 225l*2 + 14210l). 221l3 Expand (-94 + 94 - 80a)(14 - 14 + 12a + (-1 + 6 - 4)(-a + 3a + 0a)). -1120a*2 Expand (773p*5 + 951403p*3 - 951403p*3 + (2p*3 - 4p3 + p3)(0p + 0p - 2p*2))(5 - 4 + 6). 5425p5 Expand 2 - 2 + 297y*3 - 130y3 - y3 + y2 - y2 - 1 - 3y3 + 1 + (-y2 - 1 + 1)(-4y - 2y + 4y) - 2y3 - y3 + 2y3. 164y*3 Expand (3 - 2 + 0)(0 + 2 + 1)(298k*3 - 943k*3 + 301k*3). -1032k*3 Expand (4p*5 - 2p*5 - 4p*5)(-859 - 107 + 48) + 4p5 - 6p5 + p5. 1835p5 Expand (4i - 2i - 2i*3 + i)(2 + 1 - 4)(-3 - 2 + 1)(-313 - 45 - 288). 5168i3 - 7752i Expand ((-2c + 0 + 0)(1 - 1 - c) - c + c - c*2 + 2c*2 + 0c2 - c2 + (-2 + c + 2)(4c - 7c - 8c) + 2c2 - 2c*2 - 2c*2)(-6 - c*2 - 15 + 24). 11c*4 - 33c2 Expand (-u3 + 3u3 - u3)(20 + 12 - 8)(-2u - 2u - u). -120u*4 Expand (-6 - 1 + 2)(6m - 22 + 39 - 19) - 2m + 2m - m - 2m + 2 - 2 + 4m + 0m - 6m + (4m - 6m + 3m)(-1 + 1 - 1) - 2m + 1 - 1. -38m + 10 Expand (31t*2 + 53t*2 + 39t*2 - 11t*2)(-341 + 175 - 29t + 167). -3248t*3 + 112t*2 Expand (-2 + 2 + 1)(4v5 - 6v*5 - 2v*5) - 168v*5 + 27725v*2 - 27725v*2. -172v*5 Expand (982 + 178 + 595)(2 + 2 - 2)(4h - 5h + 0h). -3510h Expand (2l + 1 - 1)(-1435l + 33269 - 33270 - 82l). -3034l*2 - 2l Expand 11594389f + 3f*2 - 11594106f + 2f2 + (-f2 + f2 - f2)(-2 - 2 + 5). 4f2 + 283f Expand 2v4 + 2v*4 + 4v*4 + (-22 + 22 + v)(-9v + 3v*3 + 9v). 11v4 Expand (3 - 2u - 3)(23 - 1 + 24) - 2u + 10u - 2u - 1 + 1 - u. -87u Expand -1 - 2f + 1 + (0 - 4 + 3)(3f - f - f) + 3f - 7f + 3f - 402031 + 402031 - 497f - 2f - 3 + 5 - 4. -503f - 2 Expand 1240h2 - 1615h*2 - 1901h*2 - 4 - 2h + (-h + h + 2h)(-1 + 1 + 2h). -2272h*2 - 2h - 4 Expand (1 + 368d4 + 317699d*2 - 317697d*2 - 3d + 0)(-1 - 3 + 3). -368d*4 - 2d*2 + 3d - 1 Expand -33t + 2t + t + 3t - 2t - 2t + (3 - 3 + 2)(147t - 76t - 104t). -97t Expand (63 + 1 - 4)(30 + 10 + 2d*2 + 45 - 28). 120d*2 + 3420 Expand (1 - 1 - 3)(13 - 7w2 - 13) - 68w + 67w + 1 + 0w*2 - 48w*2. -27w*2 - w + 1 Expand (5d + d + 0d)(1 + 0 + 0) - 14 + 202d - 198d - 3. 10d - 17 Expand (-9 + 5u*2 - 6u*2 + 6)(18 + 23 + 42 - 1). -82u2 - 246 Expand -25c - 125c + 201c + 182c - 3c - 2c + 4c + (0 + 3 - 1)(-2c + 2 - 2) + 5c + 5 - 5. 233c Expand (26772l2 + 37677l*2 - 52816l*2)((-l + 0l + 3l)(-l - 4l + 3l) - 5l2 + l2 + 2l2). -69798l*4 Expand (-1 - 3 + 1)(-6156 + 6156 + 812q) + 2 - 2 - 2q. -2438q Expand 2 + 2 - 2 - h + (-7h + 2h - h)(27 - 43 + 38). -133h + 2 Expand -5w*5 - 3w*3 + 3w*3 + (w + 2w*5 - w)(340 - 445 - 569). -1353w5 Expand 4j - 4j + 2j*2 + (-14j	{ "pile_set_name": "DM Mathematics" }
me? False Is 2088509749 a prime number? False Is 10383506911 a composite number? True Is 228349613 a prime number? False Is 267198709 prime? False Is 106329317 prime? False Is 1635317599 a composite number? True Is 27411551719 a prime number? True Is 15872522251 a prime number? False Is 1858093273 a composite number? True Is 244948474609 a prime number? False Is 4864693417 a composite number? True Is 3042417373 prime? False Is 4170488141 a prime number? False Is 367352867 a composite number? True Is 98869441 prime? False Is 36625145 a prime number? False Is 1505941403 a prime number? False Is 5160438707 prime? True Is 5299878479 a composite number? True Is 2402074457 prime? True Is 830290009 a prime number? False Is 29014967 prime? True Is 4001551783 prime? False Is 400737983 a composite number? False Is 84718329041 a composite number? False Is 566395561 composite? False Is 14777771321 composite? False Is 3855303941 prime? True Is 85372688941 prime? True Is 334776979 a composite number? True Is 1307886197 prime? True Is 583579597 prime? True Is 552283939 composite? False Is 69400421309 a prime number? False Is 3889019609 a composite number? True Is 44279421191 prime? False Is 4665755383 a composite number? True Is 160765391051 a composite number? False Is 3765162457 prime? False Is 40387230419 a composite number? False Is 12242644121 a prime number? False Is 35792140711 a prime number? False Is 300291643 a composite number? False Is 857174763 prime? False Is 4709938309 prime? True Is 460805713 a composite number? True Is 26070834473 prime? True Is 5265245651 a prime number? False Is 36095765837 composite? False Is 3397815947 a composite number? False Is 95071121 a composite number? True Is 791772559 a prime number? False Is 2881125451 a prime number? False Is 112744509637 a prime number? True Is 9003179291 a composite number? False Is 17604804443 a composite number? True Is 81837384403 a composite number? False Is 480520247 composite? True Is 56979741002 prime? False Is 19272101279 prime? False Is 638534119 composite? True Is 33040379 composite? False Is 67603325011 prime? True Is 2618150919 a prime number? False Is 6587311967 a prime number? True Is 64495181 composite? True Is 1091768047 a prime number? False Is 2042083517 prime? False Is 403276897 a composite number? False Is 2912647877 prime? True Is 162271223 a composite number? True Is 4242458899 a composite number? True Is 4057185953 composite? False Is 9914915765 prime? False Is 8509274423 a prime number? False Is 2730312121 composite? True Is 11397785029 a composite number? True Is 2262865543 a prime number? False Is 11346631729 a prime number? True Is 130701049 prime? False Is 3052500247 prime? True Is 4267395299 a prime number? False Is 116295217 a composite number? True Is 251691413 composite? False Is 1370657 composite? False Is 1552212203 a composite number? False Is 26815319659 composite? False Is 1110755227 a composite number? True Is 619044313 prime? False Is 1521048079 composite? False Is 23871592841 composite? False Is 1440541423 composite? False Is 26036395205 prime? False Is 88214207339 a prime number? True Is 695241213 prime? False Is 405932311 composite? False Is 5713358909 composite? False Is 19194755003 a composite number? False Is 1834438937 a composite number? False Is 3441323297 prime? True Is 57642407 a prime number? False Is 2116620633 composite? True Is 3666255823 prime? True Is 504199789697 a prime number? True Is 2863420899 composite? True Is 95221085 composite? True Is 126586693 a prime number? False Is 619036501 prime? True Is 383715427 a composite number? True Is 1961460091 a prime number? False Is 2310130811 a composite number? False Is 2877342427 prime? False Is 7290690499 a composite number? True Is 251333698061 prime? True Is 20356706 a composite number? True Is 33808788103 prime? True Is 770660689 a composite number? False Is 2439768203 prime? True Is 2287739027 composite? True Is 14121473489 a composite number? False Is 153501358 a composite number? True Is 1823045267 a prime number? True Is 2879048077 composite? False Is 628305719 composite? False Is 602436031 prime? False Is 4221661921 composite? True Is 19696213469 a composite number? False Is 11657712373 composite? False Is 23975413559 a prime number? True Is 2308097503 composite? False Is 8395846169 prime? False Is 13662762415 composite? True Is 248383301 composite? False Is 474023749 a prime number? True Is 1231719347 composite? False Is 7974097679 a prime number? True Is 7436765879 a composite number? True Is 2136129371 a prime number? True Is 675267899 composite? True Is 37231696703 a composite number? True Is 585021347 composite? False Is 14724689489 prime? False Is 112690588213 prime? False Is 6591215263 a composite number? False Is 22913900323 composite? False Is 1555990451 a prime number? False Is 404640079 a composite number? True Is 7955131417 a prime number? False Is 31795288783 a composite number? True Is 663541045 composite? True Is 16033737893 a prime number? True Is 6331410611 a composite number? True Is 4155454129 a prime number? True Is 14494742429 prime? True Is 38833323853 prime? False Is 582906749 a composite number? True Is 955239619 a composite number? True Is 216913927 prime? True Is 18384064121 prime? True Is 2215245977 a prime number? False Is 1683362381 composite? False Is 204590627 prime? False Is 126792504427 a composite number? False Is 2959468601 composite? True Is 9408392723 prime? False Is 1718294477 prime? False Is 7790196643 a composite number? False Is 77038878727 a prime number? True Is 72931637 composite? False Is 16599181 prime? True Is 412468201 a composite number? True Is 168334209935 prime? False Is 113732592227 prime? False Is 452860567 a composite number? True Is 1286650259 prime? True Is 2441863183 a composite number? False Is 98047821229 prime? True Is 40957691999 prime? False Is 4846904053 composite? False Is 309285156227 a composite number? True Is 1832541839 a prime number? False Is 71072330347 prime? True Is 5080958603 prime? False Is 15031231043 a prime number? False Is 136239029 a composite number? False Is 48738970961 a composite number? False Is 274826663 a prime number? True Is 355443019 prime? True Is 73676293 a composite number? False Is 3885226841 prime? True Is 177303677 a composite number? False Is 1190870861 composite? False Is 604601449 composite? True Is 2799748451 composite? False Is 688266197 prime? False Is 22299152173 composite? True Is 2334389359 a prime number? False Is 1032686587 prime? True Is 186336827 a prime number? True Is 629261419 composite? True Is 6559160945 a composite number? True Is 7489492973 prime? False Is 16781287 prime? True Is 3571592833 a prime number? False Is 31473469 prime? False Is 85788024017 a composite number? False Is 1132239463 a prime number? False Is 200365193 prime? False Is 53623300213 prime? False Is 16606218679 composite? True Is 1410884533 a prime number? True Is 1894787339 a composite number? False Is 174723959 a composite number? False Is 2023529381 a composite number? True Is 529077317 composite? False Is 67797797 a composite number? True Is 203341429 a prime number? False Is 200225101 prime? True Is 12446918453 a composite number? True Is 862515309 a composite number? True Is 31302734233 prime? True Is 13345310453 a prime number? False Is 27629715671 a prime number? True Is 394934473 a composite number? False Is 1341775901 a composite number? True Is 22078357829 prime? False Is 562898587 prime? True Is 47274138563 composite? False Is 32526307579 composite? False Is 19723168673 a prime number? False Is 51099578507 prime? True Is 49352297317 composite? False Is 3162057791 composite? True Is 345802271 a composite number? False Is 31625054413 a composite number? False Is 89461892113 composite? True Is 17314791341 a composite number? False Is 58686791 composite? False Is 1222825466 prime? False Is 3046663667 composite? False Is 4366506569 a prime number? False Is 52686862453 composite? True Is 5879424757 prime? True Is 681548717 prime? False Is 21668932739 prime? True Is 116672317 a composite number? False Is 1770296009 prime? True Is 51201625349 a prime number? False Is 46225297 a prime numbe	{ "pile_set_name": "DM Mathematics" }
Calculate prob of picking 2 k and 1 m when three letters picked without replacement from {m: 3, k: 7, s: 4}. 9/52 What is prob of picking 4 i when four letters picked without replacement from {i: 16, n: 2}? 91/153 Calculate prob of picking 1 h and 1 y when two letters picked without replacement from hyqwyqqqoohhooqhq. 1/17 What is prob of picking 2 t when two letters picked without replacement from {c: 6, o: 1, t: 4, p: 2, z: 1, n: 1}? 2/35 Two letters picked without replacement from {c: 2, d: 8}. Give prob of picking 1 d and 1 c. 16/45 Two letters picked without replacement from {u: 2, l: 9}. What is prob of picking 1 u and 1 l? 18/55 Calculate prob of picking 1 a, 1 g, and 2 t when four letters picked without replacement from {g: 1, j: 8, t: 2, a: 1, w: 2}. 1/1001 Three letters picked without replacement from rrrrrrrrr. What is prob of picking 3 r? 1 Two letters picked without replacement from {w: 4, c: 6, i: 6, s: 2}. Give prob of picking 1 s and 1 i. 4/51 Three letters picked without replacement from {v: 3, w: 4}. What is prob of picking 1 w and 2 v? 12/35 What is prob of picking 4 m when four letters picked without replacement from wmmwwwmwwlwwwlwm? 1/1820 Four letters picked without replacement from {t: 2, f: 3}. What is prob of picking 3 f and 1 t? 2/5 What is prob of picking 2 a when two letters picked without replacement from aaaxaaxaa? 7/12 What is prob of picking 4 n when four letters picked without replacement from {n: 7}? 1 Two letters picked without replacement from {b: 7, p: 8, u: 2, x: 3}. Give prob of picking 2 x. 3/190 Three letters picked without replacement from {q: 2, f: 3, g: 1, b: 6, i: 1}. What is prob of picking 3 f? 1/286 Calculate prob of picking 1 m, 1 x, and 1 d when three letters picked without replacement from {y: 2, o: 7, d: 8, m: 2, x: 1}. 4/285 What is prob of picking 3 t when three letters picked without replacement from bbttbbbbbbt? 1/165 Three letters picked without replacement from {b: 3, q: 6, m: 4}. What is prob of picking 1 q and 2 b? 9/143 What is prob of picking 1 h and 3 g when four letters picked without replacement from {g: 10, h: 2}? 16/33 Calculate prob of picking 1 l and 1 q when two letters picked without replacement from {v: 1, h: 3, m: 3, q: 2, l: 1}. 2/45 Calculate prob of picking 1 n and 1 m when two letters picked without replacement from {z: 7, q: 10, m: 1, n: 2}. 1/95 Three letters picked without replacement from {l: 5, r: 1, x: 3}. Give prob of picking 1 r and 2 l. 5/42 What is prob of picking 1 g and 1 v when two letters picked without replacement from {v: 5, g: 2, q: 1, p: 1}? 5/18 Calculate prob of picking 2 q and 1 u when three letters picked without replacement from {u: 9, q: 7}. 27/80 Two letters picked without replacement from llwllllwqlqonqlwlll. What is prob of picking 1 l and 1 o? 11/171 Three letters picked without replacement from {c: 2, l: 2}. Give prob of picking 1 l and 2 c. 1/2 Calculate prob of picking 3 h and 1 f when four letters picked without replacement from fffhfffhfhfffhfhff. 13/306 Three letters picked without replacement from {d: 9, o: 11}. Give prob of picking 3 o. 11/76 Calculate prob of picking 2 o and 1 s when three letters picked without replacement from {j: 4, s: 2, x: 1, o: 3}. 1/20 Two letters picked without replacement from xixixoix. Give prob of picking 2 i. 3/28 Four letters picked without replacement from vpvpvpvvpvvpvvvpvpv. What is prob of picking 3 v and 1 p? 385/969 What is prob of picking 1 t and 2 z when three letters picked without replacement from {t: 5, z: 2}? 1/7 Three letters picked without replacement from wnononoownwwoonoooo. Give prob of picking 1 n and 2 w. 10/323 Two letters picked without replacement from {i: 2, k: 1, n: 2, e: 1}. What is prob of picking 1 k and 1 n? 2/15 Calculate prob of picking 2 g and 1 r when three letters picked without replacement from {r: 1, g: 12}. 3/13 Three letters picked without replacement from {g: 4, q: 4, u: 2, s: 4}. What is prob of picking 1 q, 1 g, and 1 s? 16/91 What is prob of picking 3 x when three letters picked without replacement from {x: 3}? 1 Calculate prob of picking 1 p, 1 m, 1 f, and 1 k when four letters picked without replacement from mxxkxxxmfp. 1/105 Two letters picked without replacement from fbnnnffnffnfnfeffn. What is prob of picking 1 b and 1 n? 7/153 What is prob of picking 3 i when three letters picked without replacement from {x: 10, i: 9}? 28/323 Calculate prob of picking 1 h and 1 t when two letters picked without replacement from {h: 1, t: 1, k: 1, r: 2}. 1/10 What is prob of picking 3 j when three letters picked without replacement from vjvvvvj? 0 Three letters picked without replacement from nnbnaaan. What is prob of picking 1 b, 1 a, and 1 n? 3/14 What is prob of picking 2 h and 1 f when three letters picked without replacement from {h: 2, a: 5, f: 4}? 4/165 Calculate prob of picking 3 h when three letters picked without replacement from hhh. 1 Three letters picked without replacement from {u: 6, t: 4, c: 9}. Give prob of picking 2 c and 1 t. 48/323 Two letters picked without replacement from feoeooefooses. Give prob of picking 2 f. 1/78 Calculate prob of picking 2 q and 1 m when three letters picked without replacement from {q: 2, f: 1, c: 2, m: 2, s: 1}. 1/28 Three letters picked without replacement from vqqqm. Give prob of picking 1 q, 1 m, and 1 v. 3/10 What is prob of picking 1 y and 2 k when three letters picked without replacement from ykkykkkykyykkk? 45/91 Three letters picked without replacement from {k: 2, v: 1, q: 1, m: 2}. What is prob of picking 2 q and 1 v? 0 Two letters picked without replacement from lfffc. What is prob of picking 2 l? 0 What is prob of picking 2 j and 2 e when four letters picked without replacement from jejeejejeeej? 14/33 Three letters picked without replacement from pxpippipiixpp. What is prob of picking 2 i and 1 x? 6/143 Two letters picked without replacement from {i: 1, v: 3, e: 4, s: 1, r: 2, z: 4}. Give prob of picking 1 e and 1 z. 16/105 Calculate prob of picking 1 g and 2 v when three letters picked without replacement from {g: 5, l: 1, v: 2, q: 3, u: 6, m: 2}. 5/969 Three letters picked without replacement from {g: 2, k: 1, h: 1}. Give prob of picking 1 h and 2 g. 1/4 Three letters picked without replacement from iiiijjiivvjiiiiivii. What is prob of picking 3 j? 1/969 Two letters picked without replacement from {h: 3, u: 6, e: 2, a: 1, j: 6}. Give prob of picking 1 a and 1 e. 2/153 What is prob of picking 1 p and 1 w when two letters picked without replacement from qykpwzp? 2/21 Two letters picked without replacement from uffbugfukgggug. What is prob of picking 1 f and 1 g? 15/91 Two letters picked without replacement from {d: 1, t: 1, m: 7}. What is prob of picking 1 m and 1 t? 7/36 Four letters picked without replacement from yyvyyv. What is prob of picking 4 y? 1/15 Two letters picked without replacement from fffsfllllfslfsmls. What is prob of picking 2 l? 15/136 What is prob of picking 2 n and 1 j when three letters picked without replacement from jtnhhtnhth? 1/120 What is prob of picking 1 c and 2 f when three letters picked without replacement from cifidcficdiid? 3/286 Two letters picked without replacement from {u: 3, c: 6, b: 1, q: 5, d: 1, r: 1}. Give prob of picking 1 b and 1 d. 1/136 What is prob of picking 1 k and 3 y when four letters picked without replacement from sssyyssssshsyhssssk? 1/3876 What is prob of picking 4 f when four letters picked without replacement from {f: 4, e: 1, q: 9}? 1/1001 Two letters picked without replacement from {o: 7}. Give prob of picking 2 o. 1 Two letters picked without replacement from gghhhghghhhgugghg. What is prob of picking 2 g? 7/34 Four letters picked without replacement from viyivyqs. What is prob of picking 1 i, 1 y, 1 v, and 1 s? 4/35 What is prob of picking 1 o and 1 t when two letters picked without replacement from {r: 2, t: 3, v: 1, a: 1, x: 8, o: 1}? 1/40 Four letters picked without replacement from ttttttttt. What is prob of picking 4 t? 1 What is prob of picking 1 r and 2 i when three letters picked without replacement from iqriirrier? 1/5 Calculate prob of picking 2 v, 1 o, and 1 p when four letters picked without replacement from puopvv. 2/15 Calculate prob	{ "pile_set_name": "DM Mathematics" }
. Let q = 3 - 3. Is q greater than t? False Let z(q) be the third derivative of q*4/24 + 5q*3/3 - 13q*2. Let m be z(-9). Which is bigger: 3/5 or m? m Let a = -2 - -3. Let h be 3 + -3 + 0 + 5. Let u = a - h. Is u <= -6? False Suppose -5y - 74 = 61. Let s be 33/(-135)-14 + 6/y. Are s and 3 nonequal? True Let h = -4 + -9. Let x = -29 + 27. Let n be x/5(24 - -6). Is n <= h? False Suppose 12 = -l - 4n, 5n + 9 = 3l - 23. Suppose -p - l = -16. Suppose 84b - 650 = 34b. Is b at least as big as p? True Suppose -38 = -4f + 46. Suppose -3t = -4t + f. Suppose 0 = z - 2z + g + 6, 4z - t = 3g. Which is smaller: -2/3 or z? -2/3 Let f = -18 + 12. Let w = -7 - f. Let b = -1026/7 - -147. Are b and w nonequal? True Let p = -35 + 35. Which is bigger: p or -1/3? p Let m = -12 + 3. Let w(t) = t3 - 4t*2 + t - 2. Let o be w(4). Suppose -5f + 20 = 0, -3k - 26 = -k - of. Is m less than or equal to k? True Let k = 11/8 - 139/136. Let w be (-2 + 7)-1(-7)/7. Suppose 4u - wn - 14 = 0, -3n = -4u + n + 12. Is k greater than u? False Let m = 9.015 - 0.015. Let f = m + -11. Which is smaller: 0.08 or f? f Let b be -10 - (-3)/(33/121). Is b > 1/845? True Let z = -722/15 + 130/3. Let w = -15 - -9. Which is smaller: w or z? w Let w = 15.7 + -15.6. Which is smaller: w or 0.032? 0.032 Let p(u) = u + 7. Let i be p(0). Suppose 101 + 67 = ij. Let r = j - 19. Which is smaller: r or 8? r Let p be ((-30)/1440)/(2/9). Let h(f) = f3 + 3f*2 + 4f + 3. Let k be h(-2). Which is smaller: p or k? k Suppose 2d = -3d + 25. Suppose -11 = dg - 6. Is g less than 3? True Let d(r) = -r + 4. Let p be d(-7). Suppose 0 = -4b + j + 33, -b + 4j = 9j - 3. Is b <= p? True Let a be 40/12 - (7 - 3). Let p(m) = -13m + 1. Let i(d) = -7d. Let h(k) = 11i(k) - 6p(k). Let v be h(6). Which is greater: v or a? v Let i(l) = -2l2 - 1. Let n be i(1). Suppose 95 = -6y + 2y - a, 4a = 4. Let d = 29 + y. Is n less than d? True Let v = 724.9 + -725. Let d = 6/19 - -33/76. Which is smaller: v or d? v Suppose -54 = -3p + 75. Let r = -36 + p. Let i be ((-12)/(-10))/((-8)/(-40)). Which is greater: r or i? r Let z be -12(-25)/10. Suppose 12 = 3r + zc, 3r - 12 = 3c - 0c. Let v be (r + -3)/(1/(-5)). Is -2 bigger than v? True Let s be 3500/26160 + (-1)/12. Are s and 1 equal? False Suppose -3r = 2o - 96, 28o - 5r - 215 = 23o. Is o at least as big as 46? False Let c be 486(-2)/16. Let u be (-2)/c(0 + -8). Let h = -4 + 4. Which is greater: h or u? h Let t(d) be the first derivative of -d*4/4 + 5d3/3 + d + 6. Let p be t(5). Are -0.1 and p nonequal? True Let h = 0.92 - -0.08. Let d(u) = u3 - 12u2 + 13u + 16. Let f be d(11). Let g = f + -13. Is g <= h? False Let i = 86.8 + -87.1. Is i smaller than 33? True Suppose -51n = 11n - 53940. Is n not equal to 870? False Suppose 4q + 300 = -2v, 0 = 4q - 0 - 8. Which is smaller: v or -155? -155 Suppose 5m = 5 + 5. Let q be 125/m - (-8)/16. Let v be ((-2)/6)/(3/q). Which is smaller: -8 or v? -8 Let z = -1531 + 1376. Is z bigger than -155? False Suppose 5j - x - 84 = 0, -x = -j + 12 + 4. Suppose h - 4g = j, 2g = 2h + 3g - 7. Is 6 bigger than h? True Let w = 601 - 3024/5. Which is bigger: -5 or w? w Let q(v) = 2v*3 + 4v*2 + 9v + 64. Let g be q(-5). Does -131 = g? True Suppose 0 = -29h + 113h + 84. Suppose -4p = -0p + 28. Which is greater: h or p? h Let z be 3 - (1063/5 + -1). Let j = z - -208. Let s = -4 - -3. Which is smaller: s or j? s Let a be (-1 - 0)(-2)/2. Let m be (-93/(-306))/((-22)/88). Is m bigger than a? False Let w(r) = -r*3 - 2r*2 + 3r + 2. Let t be w(-3). Suppose -ts + 1 = -11. Is s >= 7? False Let p(m) = 57m - 7. Let z be p(3). Let a = -1144/7 + z. Let q = 3 - 2. Which is smaller: q or a? a Let m = 53 + -72. Which is smaller: m or 0.1? m Suppose 151 = 7o - 80. Which is bigger: o or 131/4? o Suppose 18 = 3w - 3c, -3c + 5 = 8. Suppose 3 = f, 66 = -0y - wy + 2f. Suppose -3k - v = -0k + 39, 4k + 52 = -4v. Do y and k have different values? True Let q(t) = -20t3 - t2 - 4t + 1. Let l be q(3). Let j = 7275/13 + l. Which is greater: 1 or j? 1 Let o(n) = 13n*2 + 1. Let x = -21 - -22. Let g be o(x). Let b = g + -15. Which is smaller: b or -2/85? b Let q be 0 + 1/(-1) + 23. Let f = q - 5. Let j = f - 28. Which is greater: -10 or j? -10 Let r be 1629/(-27)3/5. Suppose 0 = -2c - c + 105. Let z = c + r. Which is greater: z or -2? z Suppose 3w - 4i - 57 = -15, 4i - 66 = -3w. Which is smaller: w or 28? w Let w = -38154/65 - -587. Which is bigger: w or -0.5? w Suppose 0 = 3m + 7 - 4. Let d = -14 - m. Is -12 at least as big as d? True Let z = -1871 - -39257/21. Let l = 29/77 + -1/11. Let y = z + l. Is 0 at least y? True Let p(z) = -z*2 + 3z + 6. Let d be p(5). Let j(f) = 5f. Let n be j(d). Is -20 at least as big as n? True Let g = 1/2706 + -1491013/18942. Let w = 78 + g. Let x(l) = l2 - 3l - 4. Let p be x(4). Is p at least w? True Let z(y) = y*3 - 15y*2 + 11y + 7. Let g be z(14). Let l be (-4)/(-6)(-3)/g. Suppose -t = -5t. Are t and l equal? False Let b(w) = -w - 17. Let p be b(8). Let y = p - -26. Let a = -28547/33 + 865. Which is bigger: y or a? y Suppose 4w = s + 14, -3s + w = 2s - 6. Suppose -sh + 0h = -0h. Which is greater: h or -3? h Let q = -1 + 4. Suppose 2u - d = -3, u + 12 = -3u + 4d. Suppose u = -l + 1 + 1. Which is greater: l or q? q Let t(r) = r3 + 10r2 - 3. Let u be t(-10). Which is greater: u or -32? u Let a = -218 - -44. Is a at least as big as -176? True Let o(z) = -z3 + 21z2 - 2z + 24. Let l be o(21). Suppose -4s + 0s - 5v = 19, -5v - 18 = 3s. Let h be s/l - (-20)/(-90). Is -1 greater than h? False Let h be ((-2)/(-7))/((-6)/(-42)). Suppose hi - 2 = -0. Let k = -246 + 2212/9. Which is smaller: i or k? k Let c = 1 - 5. Let q = -6 - c. Let r(g) = 2g2 - 17g - 14. Let h be r(9). Is q bigger than h? True Let k(m) = 54m - 2. Let v be (-2 - 1)/(-3) - 0. Let p be k(v). Which is greater: p or 53? 53 Let t = 3039/2 + -1490. Let h be -24(30/24)/1. Let n = t + h. Is 0.05 less than or equal to n? False Let b = 466 - 708. Let v be b/(-7) + 18/42. Is 34 >= v? False Let s be -4 + (-5)/((-1)/42). Let t be 84/(-2) + 4/(-2). Let q be (-2)/t - s/(-12). Which is smaller: q or 2? q Let a be 2/(-6) + 18/(-27). Let h be (-1)/((-44)/12a). Suppose 4q + q = -4j + 25, -5j = -3q + 15. Which is greater: h or j? j Let b = -5 - -5. Let o(r) = 2r - r3 - 2r - 18r2 + r + 16. Let l be o(-18). Which is bigger: b or l? b Let p = 0.2 - 0.3. Let f = -3.1 + 2.8. Let t = f - -0.5. Does t = p? False Let b be 3(26/(-6) - -3) - -17. Let w(d) = -2d - d + 1 + 0. Let q be w(-4). Is q > b? False Suppose -4 - 6 = -2v. Suppose 3y + 4k = vk - 74, 4y - 5k = -117. Which is smaller: y or -24? -24 Let v = -7.41 - -7.44. Is v less than or equal to 15? True Let y(c) = -c3 + 10c*2 - 17c + 6. Let a be y(8). Which is bigger: -3/11 or a? -3/11 Suppose 108d + 276 = 39d. Which is smaller: d or -12? -12 Suppose -2w = -0w - 4. Suppose -2x + 16 = -0x - 5s, ws = 3x - 13. Suppose 0 = 2u + 3u - 10. Is u at least as big as x? False Suppose 6r + i = 3r + 44, -60 = -5r + 5i. Which is smaller: r or 88/7? 88/7 Let k = 0.54 - -4.26. Let j = k + -83.8. Is 2/7 greater than j? True Let v = -21 - -42. Let j = 175 + -173. Which is bigger: j or v? v Let l = 150 + -139.15. Let s = l + 0.15. Is s != 2/9? True Let u be (-1)/2 - 226/44-3. Which is greater: u or 15? 15 Let y = -7927/14 + 566. Are -1 and y nonequal? True Let x = -23.969 - 0.031. Let b = -18 - x. Do b and -0.3 have different values? True Suppose -3w = 4k + 515, 19k - 682 = 4w + 22k. Which is greater: w or -168? -168 Let x = 12.76 + 0.24. Let i = -9617 + 9617. Which is greater: x or i? x Suppose 0 = -0k + k - 69. Suppose k = -2l - l. Let x = l - -23. Is x at least as big as -2/3? True Let h = 0.035 - 0.035. Which is bigger: h or -91? h Let n(s) = -s3 - 11s*2 - 4s + 57. Let m be n(-10). Which is greater: 14 or m? 14 Let z be 3/((-3)/(-3 - -6)). Let s be (-2)/z(-27)/36. Which is smaller: -8 or s? -8 Let k = 1 - 3. Suppose -6y = -3y + 3t - 6, -2y + t = -13. Suppose -11 = 5i + 2q, -yi - 19 = -2q - 0q. Which is smaller: i or k? i Let o(j) = j*2 - 5j - 15. Let y be o(7). Let	{ "pile_set_name": "DM Mathematics" }
7 Suppose -2d - 4d + 12 = 0. Suppose df - 4k = 72, 3k - 9 = -3f + 99. Calculate the remainder when f is divided by 19. 17 Suppose 3d = -3u + 84, 0 = -5u - 5d + 6d + 110. What is the remainder when 35 is divided by u? 12 Let z(r) = 4r*2 - 31r - 69. What is the remainder when (-2 - 386)/(-1) is divided by z(10)? 20 Suppose 83c - 84c + 73 = 0. Calculate the remainder when 214 is divided by c. 68 Let v(u) = 2u*2 - 4u - 2. Calculate the remainder when 35 is divided by v(4). 7 Suppose 6t + 40 = t. Let q = t + 9. Let n = -2 - -4. What is the remainder when n is divided by q? 0 Let a(l) = 8l*2 - l. Let i be -1 + 3 - (-15)/5. Suppose 3g = 2b + 4, -b - 4g + i = -4. Calculate the remainder when a(b) is divided by 6. 1 Suppose 516 = 20u + 36. Calculate the remainder when 425 is divided by u. 17 What is the remainder when (4207/21 + -5)(-21)/(-14) is divided by 120? 53 Let a(c) be the third derivative of c6/120 - c5/10 + c*4/12 - 4c*3/3 - 5c*2. What is the remainder when a(6) is divided by 2? 0 Suppose -3l = 2l - 5. What is the remainder when 231 is divided by l/(((-3)/(-348))/(6/24))? 28 Suppose z + 21 = 4j, j + 5 = -2z - 1. Calculate the remainder when -218(-1 + (3 - j)/(-2)) is divided by 28. 25 Suppose -4 = -f - 12. Let i(v) = v*2 + 4v - 6. Calculate the remainder when 75 is divided by i(f). 23 Suppose -5m = -0m - 45. What is the remainder when 14/(-3)-3 + 3 is divided by m? 8 Suppose 4c - 61 = 3. Let i(j) = 2j3 - 3j*2 - 6j - 8. Let a be i(4). Let b = -18 + a. What is the remainder when b is divided by c? 14 Suppose -3p + 4 = -p, 0 = -h - 4p + 10. Let w(i) = 2i2 + i + 1. Suppose 5b = 5t, 5b - t - 6 = 6. What is the remainder when w(h) is divided by b? 2 Suppose 2w = -3q - 2w + 146, -2w - 116 = -3q. Calculate the remainder when q is divided by 217/14 + 0 + 1/(-2). 12 Suppose 5w - 3h + 56 = 263, -2h = 2w - 86. Let v(y) = -y2 + 34y - 2. What is the remainder when v(28) is divided by w? 40 What is the remainder when 195 is divided by 220/35 + 2/(-7)? 3 Let z(y) = y*2 + 5y - 8. Calculate the remainder when z(7) is divided by 16/28 - 538/(-14). 37 What is the remainder when 22 is divided by (224/42)/((-2)/(-6))? 6 Let z(u) = 2u2 - 5u - 11. Let j be z(5). Suppose 49 = jg - 77. What is the remainder when 20 is divided by g? 2 Let z = -693 - -729. Calculate the remainder when 214 is divided by z. 34 Let n(u) = -12u + 3. Let d be n(-2). Let y = 39 - d. Calculate the remainder when 54 is divided by y. 6 Suppose 2u = -0u + 12. Let k be (2 + u)/(12). Suppose 4x = 4f + 8, 3f - k = 4x - 3x. Calculate the remainder when 13 is divided by x. 3 Suppose 155 = 44o - 39o. Suppose -d + 3h + 77 = 4d, 0 = -4d + h + 63. What is the remainder when o is divided by d - 2 - (-9)/(-3)? 9 Let m = 470 - 460. What is the remainder when 69 is divided by m? 9 Let v(n) = 6n + 2. Let m = -1992 - -2033. Calculate the remainder when m is divided by v(2). 13 Let z(i) = -4i3 - 3i*2 - 6i + 3. Let c be z(-3). Suppose -82 = -4m + c. What is the remainder when m is divided by 24? 22 Suppose 2o - s = 213, -o - 2s - s = -117. What is the remainder when o is divided by 22? 20 Let g be (-2 + 2)/(5 - 7). Calculate the remainder when ((-138)/(-9) - g)9 is divided by 35. 33 Let w be 63 + -21/((-4)/(-6)). Calculate the remainder when (w/35)/((-2)/(-84)) is divided by 15. 12 Let r(y) = y2 - 2y + 26. Let f be ((-10)/3)/(4/(-6)). Suppose -fc + 3p = -261, -c + 43 = -p + 5p. Calculate the remainder when c is divided by r(0). 25 Suppose -2d = 2m - 14, 5m - 17 = 3d + d. Let o be 2/(d - (3 + -2)). Suppose 15 + 7 = ot. What is the remainder when 21 is divided by t? 10 Let o = 912 + -881. Calculate the remainder when -4 + 1 - (1 - 94) is divided by o. 28 Let b = 2185 - 1527. Calculate the remainder when b is divided by 44. 42 What is the remainder when 694 is divided by (2/(-1))/(-2) - -138? 138 Let v be (-2)/(-4)(6 + -2). Suppose -24 = vz - 3z. What is the remainder when 4/z310 is divided by 3? 2 Let g be (15/9)/(-1)24/(-20). Let q(l) = 6l - 2. Let o = -22 - -51. What is the remainder when o is divided by q(g)? 9 Let s(f) = 3f*2 + 12f - 1. Let g be s(-5). Suppose 2w - 62 = g. What is the remainder when w is divided by 13? 12 Let p(a) = 22a*2 + a. Let f be p(1). Suppose v - f = -0v + 3d, 3v - 5d = 61. What is the remainder when v is divided by (-39)/(-52) - 66/(-8)? 8 Let j be 306/(-15) - (-20)/50. Calculate the remainder when 94 is divided by (1 - j/12)/((-3)/(-36)). 30 Let k(p) = 4p*2 + 73p - 147. What is the remainder when 133 is divided by k(2)? 13 Suppose -89m + 79m + 1350 = 0. What is the remainder when m is divided by 1/(-1) - -94? 30 Suppose 3p - 2q + 32 = 259, -133 = -2p + 5q. Let a = -16 - -56. What is the remainder when p is divided by a? 39 Suppose -9 + 99 = 9h. Suppose 5g - 18 = 2a - 3, 5a = 4g + 5. Let k = 33 - a. What is the remainder when k is divided by h? 8 Let v(l) = l*2 + 8l + 3. Let g be v(-8). Suppose 12 = -gt - 15. What is the remainder when 4/2 - (9 + t) is divided by 2? 0 Let p = -147 - -196. Calculate the remainder when 244 is divided by p. 48 Suppose 5 - 20 = -3l. Suppose lg = 3g + 18. Suppose -2f - g = -35. What is the remainder when 37 is divided by f? 11 Let b be (7/(-2) + 1)6. What is the remainder when (b/(-10))/(3/68) is divided by 18? 16 Suppose 62 = u + 13. Calculate the remainder when u is divided by -3 - (0 + (-3 - -3) + -20). 15 Let j(h) = h*3 - 9h*2 + h + 11. Let n(g) = 2g + 41. Let r be n(-16). Calculate the remainder when 75 is divided by j(r). 15 Suppose 525 = 2q + 5t, -5q - 13t + 1297 = -16t. Calculate the remainder when q is divided by 49. 15 Let g = 1 + -1. Let t = 6 - g. Let k = -6384 - -6407. What is the remainder when k is divided by t? 5 Let m(s) = 188s*3 - s + 1. Let t be m(1). Let b = t + -95. Let a = b + -32. What is the remainder when a is divided by 16? 13 Suppose -2h + 115 = j + 2j, -h = -3j - 44. Suppose 5v = h + 152. What is the remainder when v is divided by ((-28)/(-6))/(17/51)? 13 Let b(d) be the third derivative of -d6/120 + d5/60 + d4/12 + 8d2. Calculate the remainder when b(-2) is divided by 3. 2 Let q(k) = -k3 + 55k2 - 56k + 121. What is the remainder when 261 is divided by q(54)? 1 Let w(i) = 22i2 + 4i - 10. Calculate the remainder when w(-3) is divided by 60. 56 Let c(v) = -v*3 + 5v*2 + 5v - 4. Let q = 255 + -219. Calculate the remainder when q is divided by c(5). 15 Let r = -198 + 137. Let o = r + 101. Suppose -6a - o = -10a. Calculate the remainder when 37 is divided by a. 7 Suppose 2i - 3v = 24, -4i - i = -4v - 53. Suppose 4b + 5b - i = 0. What is the remainder when 2 is divided by b? 0 Suppose 0 = 2y + 4, 2x + 0y + 320 = 2y. Let l = 355 + x. What is the remainder when l is divided by 39? 37 Suppose 5m - 4c + 3 + 9 = 0, 2m = -2c + 6. Suppose m = -6j + 40 + 332. What is the remainder when j is divided by 13? 10 Suppose 0 = 5w + 641 - 51. Suppose 2b = 3u + 199, -3b + 23 = -3u - 172. Let n = u - w. Calculate the remainder when n is divided by 26. 23 Suppose -4j + 90 = 2x, 0x - 3x + 5j + 113 = 0. Calculate the remainder when 71 is divided by x. 30 Suppose 0 = -g + n + 29, 3g - 2n + 7 = 99. Let o = -20 + g. Suppose j - 3k = 38, 2j - 36 = -2k - 2k. Calculate the remainder when j is divided by o. 12 Let m(b) = 3b + 7. Let r(g) = -8g - 13. Let n(j) = 5m(j) + 2r(j). Let l = 17 + -10. What is the remainder when 3 is divided by n(l)? 1 Let x = 11043 - 4140. What is the remainder when 99 is divided by -1 - 5/(-7) - x/(-273)? 24 Let m = -61 - -41. Let c be 15/m + 3/4. Suppose 3n - 7n + 68 = c. What is the remainder when 31 is divided by n? 14 Suppose -m + 3 = 2. Let l = 927 + -890. What is the remainder when l is divided by (m/(-2))/((-3)/78)? 11 Suppose -1 = w - f, -5w = -f - 10 + 3. Suppose wq - 8 = 0, 5a = -0q + 4q + 534. What is the remainder when a is divided by 14? 12 Suppose 32 = 3b - 2b. Suppose 0 = -5l - 2v + 21, 5l + 4v + 0v - 17 = 0. What is the remainder when b is divided by l? 2 Let x(u) = -5u*2 + u - 6. Let y be x(5). Suppose 2t + 5r - 116 - 16 = 0, 2r - 65 = -t. Calculate the remainder when t	{ "pile_set_name": "DM Mathematics" }
-0.5, 1/3, 5 Sort -4/11, -16, 2/9. -16, -4/11, 2/9 Sort -1, 23, 1, 7, 4. -1, 1, 4, 7, 23 Put 0, -2, -71, 5 in decreasing order. 5, 0, -2, -71 Sort -6, -14, -11 in ascending order. -14, -11, -6 Put -21, -65, -3 in descending order. -3, -21, -65 Sort 0, 2, -2/21, -3 in decreasing order. 2, 0, -2/21, -3 Put -7, 15, 5 in descending order. 15, 5, -7 Put -24, -3, 1 in decreasing order. 1, -3, -24 Put -85, 13, 3 in ascending order. -85, 3, 13 Sort -5, -665, 4. -665, -5, 4 Put -5, 13, 0, 15 in decreasing order. 15, 13, 0, -5 Put -2, 1, 5, 85 in descending order. 85, 5, 1, -2 Sort -4/7, -3/4, 2, 0.071 in descending order. 2, 0.071, -4/7, -3/4 Put 14, 2, -44, -5 in increasing order. -44, -5, 2, 14 Sort -1/5, -40/29, -4, -5 in increasing order. -5, -4, -40/29, -1/5 Sort 28/3, 0.2, -0.7, -2 in ascending order. -2, -0.7, 0.2, 28/3 Sort -2, 4, -5, 3. -5, -2, 3, 4 Sort 8/19, 0, 10, 3/4 in increasing order. 0, 8/19, 3/4, 10 Put -47, -2, 1 in ascending order. -47, -2, 1 Sort 5, 2/3, 0.2 in ascending order. 0.2, 2/3, 5 Put 0.1, -2/17, 2, -428 in ascending order. -428, -2/17, 0.1, 2 Sort 0.4, 4, -3/5, 3/52 in decreasing order. 4, 0.4, 3/52, -3/5 Sort -5.4, -0.3, 1, -1/7. -5.4, -0.3, -1/7, 1 Sort -21, 0.08, 0.2 in descending order. 0.2, 0.08, -21 Sort 0, 23, 13 in ascending order. 0, 13, 23 Put 4, -1, -41, 11 in increasing order. -41, -1, 4, 11 Put 60, 3, -0.1, -1/2 in increasing order. -1/2, -0.1, 3, 60 Sort -1, 2, -5 in ascending order. -5, -1, 2 Sort 8, 4, -6. -6, 4, 8 Sort -2, -7, 5, -1 in decreasing order. 5, -1, -2, -7 Put 39, -2, -4, 5, 4 in increasing order. -4, -2, 4, 5, 39 Sort -2, -26, -0.4, 0.04, -1. -26, -2, -1, -0.4, 0.04 Sort -4, -5, -1, 0. -5, -4, -1, 0 Sort -1, -21, -3 in descending order. -1, -3, -21 Sort -4, 4, 6, 5 in descending order. 6, 5, 4, -4 Put 0.21, -3/7, 0.1 in increasing order. -3/7, 0.1, 0.21 Sort 5, 61, 0 in ascending order. 0, 5, 61 Sort -3/7, 33, 0.8, 3. -3/7, 0.8, 3, 33 Put -1, -5, -16, -0.11 in decreasing order. -0.11, -1, -5, -16 Sort -21, 30, 5/4 in descending order. 30, 5/4, -21 Sort -104, 0.2, -0.5. -104, -0.5, 0.2 Put -0.55, 1.9, 5/3 in ascending order. -0.55, 5/3, 1.9 Put -38, 1, -4 in descending order. 1, -4, -38 Sort -14, 25, 10, -4. -14, -4, 10, 25 Sort 19, 2/35, -0.5, 5 in decreasing order. 19, 5, 2/35, -0.5 Sort -1, -36, 20, -4 in decreasing order. 20, -1, -4, -36 Put 9, -2.7, -2 in descending order. 9, -2, -2.7 Sort 0.2, 4, -0.01, -1/4, 1 in decreasing order. 4, 1, 0.2, -0.01, -1/4 Put -2/5, 38.9, -3 in ascending order. -3, -2/5, 38.9 Sort -108, -89, -4 in decreasing order. -4, -89, -108 Put -5, 8.2, -1/4, 4 in descending order. 8.2, 4, -1/4, -5 Sort 3, -9, -5. -9, -5, 3 Sort 182, 3, -4 in decreasing order. 182, 3, -4 Sort 0, -5, 1 in ascending order. -5, 0, 1 Put 1/11, 3/7, 0.28, -3, -2 in increasing order. -3, -2, 1/11, 0.28, 3/7 Put -2/17, -1/4, 0.4, -4/7 in increasing order. -4/7, -1/4, -2/17, 0.4 Put 0, -4, -1, -5, 4 in decreasing order. 4, 0, -1, -4, -5 Sort 2, -6, 3, 36. -6, 2, 3, 36 Put -2/9, -2/5, -16, 0.5 in decreasing order. 0.5, -2/9, -2/5, -16 Put -4, -5/4, -2 in decreasing order. -5/4, -2, -4 Sort -7, 0, -1, 8. -7, -1, 0, 8 Sort -3, 4, 27. -3, 4, 27 Sort -5, 7, 16, -3. -5, -3, 7, 16 Sort 43, 61, 1, 5. 1, 5, 43, 61 Put 191, 0, 5 in descending order. 191, 5, 0 Sort 3, 1.1, -0.3 in descending order. 3, 1.1, -0.3 Sort 250, 6, -3 in ascending order. -3, 6, 250 Put 0, 11, 5 in decreasing order. 11, 5, 0 Put -1423, 2/17, -0.1 in decreasing order. 2/17, -0.1, -1423 Sort -3, 5, -8 in descending order. 5, -3, -8 Sort -3, -2, 3, 159. -3, -2, 3, 159 Put 5, -1, -4, -2 in ascending order. -4, -2, -1, 5 Sort 1/3, 2.6, 0.4, -4 in increasing order. -4, 1/3, 0.4, 2.6 Put -1, 4/5, 6, 2/9 in ascending order. -1, 2/9, 4/5, 6 Sort -4, 2, 5, -235, 1 in decreasing order. 5, 2, 1, -4, -235 Put 2, -0.3, -29 in decreasing order. 2, -0.3, -29 Put -37, 3, 1, 4 in descending order. 4, 3, 1, -37 Put -50, -3, 5, -26 in increasing order. -50, -26, -3, 5 Put -7, -3, 5, 31 in descending order. 31, 5, -3, -7 Put -11, 0, -4 in decreasing order. 0, -4, -11 Put -437, 0, -1 in descending order. 0, -1, -437 Put -1/6, -5, -90.36 in descending order. -1/6, -5, -90.36 Sort 4, -145, 8 in descending order. 8, 4, -145 Sort -2, -459, 0 in decreasing order. 0, -2, -459 Put -3, 3, -33, -2 in ascending order. -33, -3, -2, 3 Put 2, -1, 8, 11, 5 in decreasing order. 11, 8, 5, 2, -1 Sort -20, 0, -2/7, -1, -1/4 in ascending order. -20, -1, -2/7, -1/4, 0 Sort 4, -0.3, -64/3, -4, -5. -64/3, -5, -4, -0.3, 4 Sort 5, -0.1, -2.4, 0 in descending order. 5, 0, -0.1, -2.4 Sort 29, -2, -0.1, 2, -39 in decreasing order. 29, 2, -0.1, -2, -39 Sort -3, 17, -4 in ascending order. -4, -3, 17 Sort 1/47, -4, 1/8, 3, -3. -4, -3, 1/47, 1/8, 3 Put 2, 4, 87 in increasing order. 2, 4, 87 Sort -697, -2, 0. -697, -2, 0 Put 5, 2, 3, 0, 28 in decreasing order. 28, 5, 3, 2, 0 Sort 0.3, 3, 21, 2/21, -2/7 in increasing order. -2/7, 2/21, 0.3, 3, 21 Put -5, -19, 5, 2, -3 in decreasing order. 5, 2, -3, -5, -19 Sort -13, -2, -1, 4, -4. -13, -4, -2, -1, 4 Sort 1, -5, -24 in descending order. 1, -5, -24 Sort 4, -9, 5, 2, -7. -9, -7, 2, 4, 5 Put 2/17, 5, -18 in descending order. 5, 2/17, -18 Put -2, -0.9, 3/7, 28 in descending order. 28, 3/7, -0.9, -2 Put 137, 0.4, -5/2 in increasing order. -5/2, 0.4, 137 Sort -0.4, 0.1, -0.27, 4/57, 1 in increasing order. -0.4, -0.27, 4/57, 0.1, 1 Put 1, 0.499, -0.4, -4/3, -2/21 in decreasing order. 1, 0.499, -2/21, -0.4, -4/3 Sort 1, -2, 5, 0 in descending order. 5, 1, 0, -2 Sort -28, -77, 2. -77, -28, 2 Put 1/2, -1/6, -3, -0.9, 1 in decreasing order. 1, 1/2, -1/6, -0.9, -3 Sort 0, -15, -5. -15, -5, 0 Put 0.3, -2, 11, -5 in ascending order. -5, -2, 0.3, 11 Sort -1/6, -4/5, -7. -7, -4/5, -1/6 Sort 3, 1, 2, 45, -2 in descending order. 45, 3, 2, 1, -2 Sort 5, -5, -28, 20, -2. -28, -5, -2, 5, 20 Sort -3, -1, -6/11, -0.2 in ascending order. -3, -1, -6/11, -0.2 Sort 4, -33, 5 in descending order. 5, 4, -33 Sort -0.01, -0.062, -8/3 in decreasing order. -0.01, -0.062, -8/3 Put -1/4, -2, -3/5, 17, -1/8 in ascending order. -2, -3/5, -1/4, -1/8, 17 Put -0.04, 2, -4, 101 in decreasing order. 101, 2, -0.04, -4 Put -2, -217, 3 in descending order. 3, -2, -217 Sort -4, 0, -29. -29, -4, 0 Sort 44, -1/7, -0.1, -1, 4 in ascending order. -1, -1/7, -0.1, 4, 44 Put 4, 3, -1/8, -0.1, 18 in ascending order. -1/8, -0.1, 3, 4, 18 Sort 4, -7, 8, 3, 5 in descending order. 8, 5, 4, 3, -7 Sort 5, -1, 129 in decreasing order. 129, 5, -1 Put 2/3, 1/8, 3/58, 4/9 in increasing order. 3/58, 1/8, 4/9, 2/3 Put 2/9, -3/8, 0.5, -3/95 in increasing order. -3/8, -3/95, 2/9, 0.5 Sort 3, -1, 18 in decreasing order. 18, 3, -1 Put -8, -1/4, 1, 1/6 in decreasing order. 1, 1/6, -1/4, -8 Put 0.4, -5/6, -15 in decreasing order. 0.4, -5/6, -15 Sort 10, 62, 5 in descending order. 62, 10, 5 Sort -1, 0.5, -500 in ascending order. -500, -1, 0.5 Sort -4, 26, 7 in descending order. 26, 7, -4 Sort 4, 624, 1, 1/6. 1/6, 1, 4, 624 Sort -51, -1, 5, 2, -2 in descending order. 5, 2, -1, -2, -51 Sort -4/3, 1/3, -1/8, 1.8 in descending order. 1.8, 1/3, -1/8, -4/3 Sort 9, 1, -4, -9 in descending order. 9, 1, -4, -9 Put 0, -0.2, -3.2, 1/6, 8 in increasing order. -3.2, -0.2, 0, 1/6, 8 Sort -3, -21, 14 in increasing order. -21, -3, 14 Sort 0, 137, 0.4 in increasing order. 0, 0.4, 137 Put -971, 5, -2 in ascending order. -971, -2, 5 Sort 2/19, 4, 28 in decreasing order. 28, 4, 2/19 Sort -112, 1, 0. -112, 0, 1 Sort 8, 4, 2, 31, -2. -2, 2, 4, 8, 31 Sort 1, -1, -116 in increasing order. -116, -1, 1 Put -5, -1/6, -0.2, 8 in decreasing order. 8, -1/6, -0.2, -5 Put -2/13, 0.4, -20, 43 in increasing order. -20, -2/13, 0.4, 43 Sort 5, -16, 8 in decreasing order. 8, 5, -16 Sort -2, 0.2, -14, -0.5 in descending order. 0.2, -0.5, -2, -14 Put 4, -2, 34 in increasing order. -2, 4, 34 Sort 2, 4, 2/9, 4/723 in decreasing order. 4, 2, 2/9, 4/723 Sort -759, -1, 0 in decreasing order. 0, -1, -759 Put -1, -6, -16, 4, -3 in descending order. 4, -1, -3, -6, -16 Sort -4, -2, 4, 5, -57 in ascending order. -57, -4, -2, 4, 5 Sort 17, 15, -3, 1. -3, 1, 15, 17 Put 409, -3, -7, 3 in increasing order. -7, -3, 3, 409 Put 0, 5, 17, 1, 4 in descending order. 17, 5, 4, 1, 0 Put 5, 3, -1/10, -1 in increasing order. -1, -1/10, 3, 5 Put -2, 5, 64 in decr	{ "pile_set_name": "DM Mathematics" }
t is the second smallest value in 4511, 5, -0.1, 30/31, -5, 0? -0.1 What is the biggest value in 4/7, -0.042, 177, -21, 2/3? 177 What is the fourth smallest value in 4/25, 3, -1560, 34? 34 What is the smallest value in -2, -43, 726715, 1/7? -43 Which is the fourth smallest value? (a) 0 (b) 56449 (c) -60 (d) -5 b What is the smallest value in 70, -0.4, -166, 0, 4, 5, -0.1? -166 What is the third biggest value in 123195, 5, -1/5, 1/15, 21? 5 Which is the third biggest value? (a) -0.456 (b) 1/21 (c) 2 (d) 18795 b What is the third smallest value in -4, -561/5, 2/9, -7, 0.5, -5? -5 What is the third biggest value in 2, -37/3, -25, 26/7? -37/3 What is the seventh smallest value in -1.3, 0.3, -2/19, 2/5095, -1, 9, 0.4? 9 Which is the third smallest value? (a) 0.25 (b) -219 (c) 47 (d) 5 d Which is the third biggest value? (a) -5090/9 (b) -4 (c) -0.22 a What is the biggest value in -0.033, 7795, -2/7? 7795 Which is the third smallest value? (a) 4 (b) 0 (c) 889389 (d) 77 d Which is the seventh biggest value? (a) -3/7 (b) 0.1 (c) -0.1 (d) 7 (e) 11 (f) -1319 (g) 0 f Which is the third smallest value? (a) -1.3 (b) 0.6 (c) 86179 (d) -2 (e) 4 b What is the third smallest value in -1/7, 95, -3, -0.2, -6/11? -0.2 What is the biggest value in -3, 2, 3163.8, -31? 3163.8 What is the second smallest value in -0.5, -5/988, -0.1, -3/7, -2, -1, 31? -1 Which is the third smallest value? (a) 0.4 (b) -46 (c) 16095000 c What is the third smallest value in -0.11, 7.7, 4, 0.52, 0? 0.52 Which is the fourth smallest value? (a) -553.3 (b) 1.6 (c) -9 (d) 1/2 b What is the smallest value in 4, -93, -0.069, 8.4? -93 Which is the second smallest value? (a) -3/2 (b) -6/145 (c) 0.03 (d) 2 (e) -4 (f) 1 (g) 0 a What is the second smallest value in 9, -41, 5939, -0.16, -0.3? -0.3 Which is the fifth smallest value? (a) 3/7 (b) -4 (c) 2.0026 (d) 2/37 (e) -2 c Which is the third biggest value? (a) -0.051 (b) -0.3 (c) -467/128 c Which is the fourth smallest value? (a) 92 (b) -11/74 (c) 533 (d) -2 c What is the third biggest value in -33, 3, 11, -1872.3? -33 What is the biggest value in -1434, -5, -0.9, 2/61? 2/61 Which is the seventh smallest value? (a) 1/9 (b) 23 (c) -1/9 (d) 67 (e) 4/7 (f) 1/3 (g) 0.5 d Which is the second smallest value? (a) -6 (b) 2 (c) 24760 b Which is the smallest value? (a) -27/8 (b) -4 (c) -1/122 (d) 2 (e) -0.86 b Which is the third biggest value? (a) -32 (b) 3.07 (c) -1/6 (d) 254 c What is the second biggest value in 9, -0.082, 1, -2/13, -4, -7/27? 1 Which is the second smallest value? (a) -1.4 (b) -4 (c) -3 (d) 0.3 (e) -1 (f) -11/4 (g) 0.2 c Which is the fourth biggest value? (a) -2 (b) 5 (c) 3/8 (d) -114 (e) -2/9 (f) 1/3 e Which is the seventh biggest value? (a) 2 (b) -0.46 (c) 5 (d) -4/3 (e) 988 (f) 11 (g) -3 g Which is the smallest value? (a) 1/111 (b) -0.6 (c) -839.2 c What is the second biggest value in 2, -0.2, -0.02, 4, 66, 461, -5? 66 Which is the fifth smallest value? (a) -0.06 (b) -529/4 (c) -0.1 (d) -38 (e) 4 e What is the third smallest value in 9.8, 14, 3, 83, 1, 1/2? 3 What is the fifth biggest value in -75/8, 1/4, -4/11, -5, 4, 0.7? -5 Which is the third biggest value? (a) -0.5028 (b) -0.1 (c) -138 (d) 4 a What is the third smallest value in 2/27, 94/33, -23.9? 94/33 Which is the third smallest value? (a) 1/2 (b) -3 (c) 43.59526 c What is the fifth smallest value in -21/1049, -2/19, -1/2, -1, 0.7, -3, -1/8? -2/19 Which is the biggest value? (a) -8 (b) 123/61 (c) -12/7 (d) 2 (e) -11 b Which is the third biggest value? (a) -346/11 (b) 6 (c) -0.192 (d) 0.2 c What is the second biggest value in 215, 46/7, -1/8, 5, 0? 46/7 What is the biggest value in 5, -3/5, 73, -0.5, -5.6, -4, -2/85? 73 Which is the fifth biggest value? (a) 1 (b) 6.6 (c) -0.3 (d) -4 (e) -8 e Which is the third biggest value? (a) 3/2 (b) -0.4 (c) -1.7 (d) 1 (e) -0.1928 e What is the third smallest value in 1934, 3/5, -2/509, -1? 3/5 What is the second biggest value in 177, 2, 33, 0.7? 33 Which is the third smallest value? (a) -160 (b) -171 (c) -31 c Which is the second biggest value? (a) -121 (b) 4 (c) -5.02 (d) 13 b What is the biggest value in -557/31, 17, -1/4, -1, 6, -0.2? 17 Which is the fifth smallest value? (a) 5/4 (b) -4 (c) -2.6654 (d) 0.2 (e) -3 a Which is the third smallest value? (a) 5 (b) -3/152 (c) 7/57 (d) 0.58 d What is the second biggest value in -13, 131, 1582? 131 Which is the smallest value? (a) -0.05 (b) 0.01 (c) -3.5 (d) -0.0421 c Which is the smallest value? (a) 3/8 (b) 2/9 (c) 2 (d) 0.3 (e) -0.135 (f) 91 e Which is the third smallest value? (a) 23 (b) -1722.9 (c) 2/7 (d) 7 d What is the fifth smallest value in -0.4, 46, 7, 80, -0.2, -0.02, 0.2? 7 Which is the third biggest value? (a) -3/8 (b) -3/2 (c) -109.17 (d) 1 (e) 3/7 a What is the sixth smallest value in 28, 0.1, -156, 16, 0.4, 2/7? 28 Which is the second smallest value? (a) 2 (b) 2049 (c) 3/5 (d) 12 (e) -18 c What is the third smallest value in 27.86, -22, 8/33? 27.86 Which is the fourth smallest value? (a) 3 (b) -2/1351 (c) 0.22 (d) -7 a Which is the biggest value? (a) 3/11 (b) 399 (c) -1/32 b Which is the third biggest value? (a) 2/49 (b) -2/1831 (c) 0.05 (d) 2/9 (e) 0 (f) -1 a Which is the smallest value? (a) 3/8 (b) -0.1 (c) 1740 (d) -0.2 d What is the third smallest value in 0.003, -0.3, 3, 2, -1326? 0.003 What is the sixth biggest value in 0, 8/7, 2/9, 0.5, 4, 7, 7.9? 2/9 Which is the third biggest value? (a) 4/345 (b) -57 (c) 308/9 b What is the third smallest value in -1, 3/5, 14.6116? 14.6116 Which is the smallest value? (a) 1/10 (b) -1/4 (c) 2 (d) 6738 (e) -1/6 b What is the fifth biggest value in 1/4, 90/17, -1, -3/4, 1/6? -1 What is the third biggest value in 2, -3/5, 3, 0.0523861? 0.0523861 Which is the second smallest value? (a) 2/3 (b) -2 (c) 20813 (d) 37 a Which is the fourth smallest value? (a) 5 (b) -0.2 (c) 420/11 (d) 2/7 (e) 2 (f) 1 (g) 0.4 f What is the fifth biggest value in 0.5, -4, 0.024718, -1/4, 5, 18? -1/4 What is the sixth smallest value in 228.6, -4, -2/21, -1/14, 8, 9? 228.6 Which is the smallest value? (a) -1028830 (b) -2/13 (c) -0.3 (d) 1.4 a What is the second smallest value in -5, -198833, 3, -0.0624? -5 What is the fifth biggest value in -1, 0.5, -2, -0.3, 52/77, -231? -2 Which is the fourth biggest value? (a) 2 (b) -4 (c) -0.1 (d) 13990.6 (e) 1/3 c What is the fifth biggest value in 5, 1.4, 4, 1/3, -0.3, 1.5, -23? 1/3 What is the fifth biggest value in -952, -12, -0.12, -0.3, 0.1, -3? -12 What is the biggest value in 6, -40, 1, 567, -0.2? 567 Which is the third smallest value? (a) -2/7 (b) 0.3 (c) 3 (d) 13 (e) -113158 b What is the fifth smallest value in 79, -4, 3/5, 2, -2, 25, -20? 2 Which is the fourth biggest value? (a) -111 (b) -0.5 (c) 0.093 (d) 17 a What is the third biggest value in 2/91, -652/47, 3, 4, 0? 2/91 What is the third smallest value in 0.4, 2, -3/5, -1/3, 1/8, -15, 48? -1/3 Which is the biggest value? (a) 1 (b) 192 (c) 2/9 (d) 3/2 (e) 0 (f) -3 (g) 2 b What is the smallest value in 1, 80/67, 8586? 1 Which is the fourth smallest value? (a) -0.3 (b) -62 (c) 2/15 (d) -70/17 (e) -0.2 (f) -3 (g) -2/3 g Which is the second smallest value? (a) 3959468 (b) 0.1 (c) -3/2 b What is the fourth smallest value in 2/197, 0.1, 4, -2, -1/4, 1/5, -2/25? 2/197 Which is the fifth smallest value? (a) -3/55 (b) -1/10 (c) 2/9 (d) -0.11 (e) 644 (f) -2/5 c What is the second biggest value in -0.8, -110.2, 2, -251? -0.8 Which is the smallest value? (a) -2/13 (b) 4423 (c) -5 (d) -0.2 (e) 0 c What is the third biggest value in -0.01, -2/11, -12, -1/593, 4, -4, 0? -1/593 What is the smallest value in 5, -7/3, -438/37? -438/37 Which is the fourth smallest value? (a) -0.015 (b) 4 (c) -2 (d) -1 (e) -11.1 (f) 2 (g) -1/22 g Which is the fourth biggest value? (a) -25 (b) -0.03 (c) 0.0058 (d) 0.3 (e) -1 (f) -2/5 f What is the smallest value in 1, -2, 42696? -2 Which is the fourth biggest value? (a) 2/5 (b) 3/101 (c) 0.3 (d) 17 (e) -2/3 b What is the fourth biggest value in 2/13, -3/76, 7/8, -4/7, -0.2, -8? -0.2 Whi	{ "pile_set_name": "DM Mathematics" }
ay 0.108? 24.892 What is 2977 take away 0.044? 2976.956 Add together -8.2 and 34.8. 26.6 What is 226594 + -0.1? 226593.9 -0.5+0.185118 -0.314882 Calculate -1294 - -3. -1291 What is 173936.5 less than -0.1? -173936.6 -0.729 + -4.6 -5.329 What is -0.3402 less than -1.05? -0.7098 Total of -0.02006 and -1649. -1649.02006 -276226 - 0.4 -276226.4 What is -356.97 take away -0.6? -356.37 What is the distance between -43.23 and 0.04? 43.27 Add -11 and 149. 138 Subtract -108.5 from -617. -508.5 Work out 2 + -583. -581 Sum -45 and -0.8. -45.8 What is 117.5 + 930.8? 1048.3 What is -15 less than -259? -244 Work out -2576 - 0.2. -2576.2 What is the distance between 1 and -0.772457? 1.772457 What is the distance between 0.3 and -0.059? 0.359 What is -65225 - -0.4? -65224.6 Add together -0.02 and -0.43326. -0.45326 What is 397 - -84? 481 213+2382 2595 0.2 - 1.54 -1.34 Total of -1.88 and -0.04068. -1.92068 What is the difference between 4 and 2216? 2212 What is 141724 less than 11? -141713 Subtract 310 from 19. -291 What is -0.0037 take away -2? 1.9963 Total of -3.16 and 2. -1.16 Put together 7 and -90. -83 What is the distance between 3122 and 36? 3086 Calculate 0.1631 + -12.89. -12.7269 Work out 79 - 2107. -2028 What is the difference between -16 and 42335.6? 42351.6 Calculate 18 - -70.69. 88.69 What is -0.05 less than 0.194? 0.244 Subtract 0.2 from -3996. -3996.2 What is 68.5301 less than 0.13? -68.4001 What is -0.6647 less than 0.2? 0.8647 What is the distance between 1586.8 and -6.7? 1593.5 What is 1.2105 minus -4? 5.2105 Put together 0.0005 and -0.0559. -0.0554 -72339 - -5 -72334 Sum -555 and -0.17. -555.17 What is 0.062035 minus 21? -20.937965 Put together -31 and -5374. -5405 5 + 557 562 Total of -4 and 28783. 28779 What is -24253.9 minus 2? -24255.9 Calculate 1362 + -0.4. 1361.6 Subtract -1795 from -5. 1790 What is -37547 take away -0.4? -37546.6 What is 220.02 less than -3? -223.02 Calculate 94 + 186. 280 What is -0.1 plus -1347? -1347.1 Calculate 733206 + 0.5. 733206.5 What is -0.5 plus -11.5075? -12.0075 What is 12.84 less than -3? -15.84 Put together -0.09 and 0.148158. 0.058158 What is -8536 - 1.79? -8537.79 What is -53342 less than 0.5? 53342.5 -1.25+24 22.75 What is the difference between -5 and 1025.14? 1030.14 What is 0.111 + -21.4? -21.289 Add together 1 and 163646. 163647 Add -0.4 and -0.05552. -0.45552 Work out -0.2 + 210413. 210412.8 What is 4596.8 minus -0.03? 4596.83 What is 34 take away 37? -3 What is 563 less than -23? -586 Work out 480 + -0.14. 479.86 Add -0.7 and -741. -741.7 What is 0.0245 + -9? -8.9755 What is 0.4 plus 1474? 1474.4 What is the difference between -0.04 and -621.1? 621.06 -0.397 - -0.2623 -0.1347 Add -0.587 and 841. 840.413 What is the difference between -308.78 and -5? 303.78 What is -0.1 + 172? 171.9 What is 25.9 less than 1.2? -24.7 Calculate -0.06 - 133. -133.06 What is 0.3 + -431179? -431178.7 What is -4.79 take away -0.053? -4.737 What is -62 - -41? -21 Total of -4048 and -0.5. -4048.5 What is -93 - 28.51? -121.51 Sum -2.758 and -2. -4.758 Add -481 and -18.99. -499.99 Work out -6516 - -2.52. -6513.48 Subtract 1 from -1165224. -1165225 Work out 0 - 0.335893. -0.335893 Work out 8046 + 0.5. 8046.5 -0.3+1087 1086.7 214.9 + 85 299.9 2 - 0.352622 1.647378 Calculate -18 - -0.0519. -17.9481 74 - 171 -97 Add together -0.5 and 4904.1. 4903.6 What is 14721 less than -7.3? -14728.3 -3537+-290 -3827 Subtract 3.6 from 1.078. -2.522 What is -282.54 + 13? -269.54 What is -378 + -0.6? -378.6 Calculate -0.0472 + -0.01294. -0.06014 Work out 5 - -0.044928. 5.044928 Sum 191 and -18.3. 172.7 Work out 37.9915 - 3. 34.9915 What is 2 + -159? -157 Add together -3 and 0.02556. -2.97444 What is the difference between -104 and 0.2524? 104.2524 Total of 1087 and 0.02. 1087.02 Calculate 1.4 - -431.5. 432.9 What is the difference between -2989 and 1.2? 2990.2 What is -4.1 minus 68.7? -72.8 Put together -6.36 and -0.3086. -6.6686 Calculate 11 - -10330. 10341 What is the distance between 311.01 and 4? 307.01 Total of -0.21642 and 0.5. 0.28358 Work out -4 - -0.94488. -3.05512 Calculate 0.12 + 17.2. 17.32 1522 + -32 1490 Add together -6.77 and -0.2. -6.97 Sum -331 and -3. -334 What is -482.4 - 205? -687.4 What is -12 take away -393? 381 Add -5 and 0.053447. -4.946553 Work out 0.27 + 1.2. 1.47 Add together 8873 and 192. 9065 Add 4 and 0.0036. 4.0036 What is 0.5 take away 815? -814.5 What is 1 less than 5317? 5316 Work out 0.5 - -0.7302. 1.2302 What is the distance between -0.06 and -0.172? 0.112 Sum -0.0584 and 6279. 6278.9416 -108+-1.1 -109.1 Put together -7978.8 and -4. -7982.8 Subtract -0.04 from -209. -208.96 -9 - -1.28082 -7.71918 1657+0.5 1657.5 What is -23034 less than 0.5? 23034.5 What is -1699871 less than -2? 1699869 What is -1958528 minus -2? -1958526 0.3 + -5.4927 -5.1927 -6 - 0.065 -6.065 -4+-8231 -8235 -476 + -0.03 -476.03 29181.5 - -8 29189.5 Put together -39954 and 0.2. -39953.8 What is -31.6 plus -6? -37.6 Subtract -125.9 from 4. 129.9 What is -0.1 take away 5.197? -5.297 Put together -0.1 and -57713. -57713.1 Total of -1 and -3698.32. -3699.32 -9.3 + 18.01 8.71 -49015 + 0.3 -49014.7 What is the distance between 0.042 and -0.097? 0.139 Work out -0.3 - 600. -600.3 Add 0.2 and -3773. -3772.8 Sum -313.5 and -3.9. -317.4 -164 - 0.18 -164.18 What is the difference between -92656 and -0.3? 92655.7 What is the distance between 2 and 8462? 8460 -129601 - -5 -129596 What is the difference between 16161 and -0.01? 16161.01 What is 209 - -14.7? 223.7 Add together 4 and -997916. -997912 What is the difference between 43 and -1.856? 44.856 Total of -2887067 and 0.4. -2887066.6 0.0302 - 4.13 -4.0998 What is -180.9 + 8? -172.9 12.86232 + 0.5 13.36232 What is 5.2 - 0.0746? 5.1254 Sum 2.76 and -0.9. 1.86 Work out 0.9 - -0.075223. 0.975223 What is -5747 - 4? -5751 What is the distance between 4 and -73? 77 What is 4 minus -200587? 200591 Put together -40764 and -3. -40767 Add together -1.9 and 171160. 171158.1 What is 0.2830573 - -0.4? 0.6830573 What is 89 + -0.012? 88.988 -1.11 - 0.01 -1.12 Add 15216 and 0.05. 15216.05 What is -38462 take away -0.2? -38461.8 What is -2 plus 18.059? 16.059 Calculate -0.2 + -18206. -18206.2 Calculate 0.1 + -24651. -24650.9 What is -623 + 2? -621 Work out 0.16 - -0.77. 0.93 What is -0.4 plus 592.48? 592.08 Sum 7094 and 1. 7095 -5 + -166.2717 -171.2717 Total of 22 and -0.46396. 21.53604 What is 9.5 - 0.25? 9.25 What is the difference between 27575.4 and 5? 27570.4 What is 59 plus -6042.1? -5983.1 Subtract -5 from 1037807.5. 1037812.5 Work out 16 + -1.2. 14.8 What is 171 less than 7.1? -163.9 Total of 0.2782 and 6. 6.2782 -0.3+836 835.7 Add -0.1 and -3.3494. -3.4494 What is 2 - -223? 225 -1.38 + 10.6 9.22 What is 9.1 less than -1636.8? -1645.9 Sum 1.1 and -1.53. -0.43 What is -5 take away 0.7733? -5.7733 Add together 1.527 and 0.15. 1.677 Work out -4 + 264. 260 What is -0.2 take away -78888? 78887.8 Calculate -279 - 1297. -1576 Calculate -11 - 10. -21 Total of -782012.6 and -0.5. -782013.1 What is -3 less than -1453? -1450 What is -0.52845 less than 0.2? 0.72845 Put together -1.752 and 0.22. -1.532 What is 356 take away 0.88? 355.12 What is 232.7 - -11? 243.7 What is 0 minus 18.1983? -18.1983 Add -0.092 and 70. 69.908 -6495.3+-0.2 -6495.5 53+-447 -394 Calculate 0.092 - -60. 60.092 Work out 1003 + 126. 1129 0.084074 + 0.5 0.584074 Calculate 8 + 20047. 20055 Add together -7 and 5.11. -1.89 Calculate 346 + 0.9272. 346.9272 Work out -3.1601 + -8.4. -11.5601 Calculate -674 + -0.14. -674.14 Total of -3.5 and -499. -502.5 What is -3 take away -1079.972? 1076.972 What is the distance between -0.3 and 2.38688? 2.68688 What is -7.3 minus 0.1124? -7.4124 What is -708229 minus 1? -708230 What is the distance between -85.6 and 5? 90.6 Add together -111 and 2. -109 Work out -37 + -0.0878. -37.0878 Work out 0.12 - 0.006503. 0.113497 Calculate 1 - 2935.54. -2934.54 What is -23070 plus 0.8? -23069.2 What is the difference between -1301 and 8? 1309 Subtract -20 from 1. 21 What is -50628 less than -0.12? 50627.88 Total of -7 and -916. -923 -540.2 - -22 -518.2 0.03 - -172 172.03 Add together 0.4 and -21.4. -21 What is 19599.9 take away -0.16? 19600.06 What is 52 less than 0.119? -51.881 What is the distance between -0.7 and 429? 429	{ "pile_set_name": "DM Mathematics" }
-2i + 158t. Sort 0, i, 2/3, 2, 1/17 in ascending order. i, 0, 1/17, 2/3, 2 Let s = -19.066 + 0.266. Let v = s - -18.5. Sort 0.1, 1/23, v in increasing order. v, 1/23, 0.1 Suppose -15n - 7791 = -7386. Sort 4, n, -3, 5, 16. n, -3, 4, 5, 16 Suppose -5t + 350 = 5w, -5w + 120 = 3t - 220. Put w, 0, 0.1, -0.3 in decreasing order. w, 0.1, 0, -0.3 Suppose -2h = -3f + 31, 12h = 10h - f - 3. Sort h, -4, 14, -7 in decreasing order. 14, -4, h, -7 Let h be -220(-126)/210. Let r be 04(-2)/h. Put -26, -1, r, 3 in descending order. 3, r, -1, -26 Suppose 0 = -2k - 5o + 9, k - 2o = -4k + 37. Let z(t) = t2 + 12t - 46. Let r be z(-15). Sort r, k, -3 in increasing order. -3, r, k Let f(a) = 41a - 79a + 37a - 4 + 16a*2. Let g be f(0). Sort 0.01, -0.13, g in decreasing order. 0.01, -0.13, g Let h be -3(2/(-3) + 2). Suppose -1613 = 43c + 193. Let l = -586 + 581. Put -2, h, l, c in decreasing order. -2, h, l, c Let t = 22 + -22. Suppose 2w + 10 = t, 3w = -2m - 11 - 6. Let v = 141 + -140.8. Put v, -5, m, 1 in decreasing order. 1, v, m, -5 Let c = 2638 - 2638. Let q be ((-44)/(-77))/(2/28). Sort 1, q, c in descending order. q, 1, c Let p = 0.6 - 1. Let y = -364 - -367. Let f be ((-1)/(-6))/(y - -5 - 7). Sort p, -0.06, f, 2 in descending order. 2, f, -0.06, p Let b be 6/9(-3)/2. Let n be (-1 + -2)/((-54)/(-72)). Let s be n/(-6)(-10 + 13). Sort b, 11, s in ascending order. b, s, 11 Let h be 10((-243)/(-6))/9. Suppose -15a + h = -24a. Put 25, -3, a in decreasing order. 25, -3, a Let z = -0.0509 - -0.5509. Put 77, -0.05, -0.4, z, -4 in decreasing order. 77, z, -0.05, -0.4, -4 Let a be 2/(-16) - 31429/(-424). Put 1/8, -0.8, a, 0.4 in increasing order. -0.8, 1/8, 0.4, a Suppose 2 = 10q - 8q + 2x, -2x + 2 = -3q. Suppose 3g + 6 = -4n - 2, q = -g. Put 6, n, 5 in descending order. 6, 5, n Let r be (1/4)/(((-595)/140)/(-17)). Let q = 1 + 2. Put q, 2, r in ascending order. r, 2, q Suppose 24 = -6d + 18d. Suppose 2c = 131r - 126r + 110, -86 = 4r - dc. Sort 2, 1, r in descending order. 2, 1, r Let z be 7/(-42)(-4)/(-3). Let u be (1 - 1)/((-3)/(4 + -1)). Suppose 4d + 81 = -0y + 3y, -y - 4d + 27 = u. Put z, y, 3 in decreasing order. y, 3, z Suppose 18r + 10r = r + 81. Suppose -5h = 0, -5h + 21 + 9 = -5d. Suppose -3 = -w + 1. Sort w, d, r in ascending order. d, r, w Suppose -209c = -208c + 6. Let l(v) be the second derivative of v4/12 + 2v*3/3 - 15v*2/2 - 2v. Let g be l(c). Sort 5, 4, -4, g in increasing order. -4, g, 4, 5 Let q be 3/13(-2)/3. Let c be -2 + ((-29)/(-7) - 2). Let b = 7 - 7. Put 2/15, q, b, c in decreasing order. c, 2/15, b, q Suppose -308y - 36 = -310y. Suppose -5k - 5i = -20 - 0, 3k + 5i = 14. Sort k, 0, -1, y in decreasing order. y, k, 0, -1 Let z(b) = -34b - 10. Let g be z(7). Let x be g/(-20) - (-1 + 2/5). Suppose 43 - 4 = xu. Put -1, -10, 0, u in descending order. u, 0, -1, -10 Let s be (-5 - -122)/(3/(-2)). Let r = s - -80. Let v = -6 + 7. Put r, v, -2, 0 in ascending order. -2, 0, v, r Suppose -305i + 908 = -78i. Suppose 5p - 10 - 5 = 0. Let n(j) = j*3 - 4j*2 + 2j. Let k be n(p). Put k, 7, i in descending order. 7, i, k Suppose -21 = -4s + 254x - 249x, -3x - 19 = -4s. Sort s, 3, 2, -3, 25 in descending order. 25, s, 3, 2, -3 Let f(h) = 49h2 - h3 + 13h - 5 - 37h*2 - 33h. Let u be f(10). Sort 1, -1, u. u, -1, 1 Let d = -455.7 - -387.7. Sort -3/2, d, 1/2 in decreasing order. 1/2, -3/2, d Let h be (-1 + 3)(-141)/(-2). Suppose 78946u = 78987u - 38 - 167. Sort -2/11, h, u in descending order. h, u, -2/11 Let b = 0 + 0.2. Let z(p) = -22p + 5 + 7 + p + 0 + 2p2. Let y be z(10). Sort 2/7, b, 4, y in descending order. 4, y, 2/7, b Suppose -10f - 864 = 456. Let z = -129 - f. Let i(r) = -r*2 - 6r - 7. Let x be i(-6). Put x, -4, z in descending order. z, -4, x Let g be 82 + (-5 - -2) + -2. Let f = g - 80. Let w(r) = -r*3 + 9r*2 + 23r - 7. Let l be w(11). Sort f, 0, -5, l. -5, f, 0, l Let o = 0.121 - 0.001. Let p = 0.45 + o. Let f = 0.07 - p. Put -2/9, -0.1, -5, f in increasing order. -5, f, -2/9, -0.1 Let l be 72/7(10 + -9). Sort 5, -8, -3/4, l in descending order. 5, l, -3/4, -8 Suppose 5g = -5k + 10, 0 = -g + 4k - 23 - 5. Suppose -5v - 20 = -5f, -7v + 3v - 5f = -2. Sort v, 8, 0, g in decreasing order. 8, 0, v, g Suppose -3j + 0 + 3 = -3o, -o - 5 = 0. Suppose -3a = 8 + 4. Let v be (2/4 - 0)/(1/a). Put v, -3, j in ascending order. j, -3, v Let y = -7188 + 7881. Put -2, y, -3 in descending order. y, -2, -3 Let r = 34.004 + -22.004. Let i = 2 + -2.3. Sort i, r, 4 in descending order. r, 4, i Let l = 2316 - 11581/5. Sort l, 0.13, -1. -1, l, 0.13 Let o = 2676 - 2675.8. Put -1.037, -1/8, 2/3, o in decreasing order. 2/3, o, -1/8, -1.037 Suppose 5u = -3n + u + 87, -n - 2u = -31. Suppose 0 = 4l + l - n. Let k be (-15)/(-10)l/((-15)/(-8)). Sort 1, k, -5 in ascending order. -5, 1, k Let r = 1535091/44 - 34887. Put 4, 5, r in decreasing order. 5, 4, r Let o = -36 - -44. Let c(s) = 2s2 + 55s + 83. Let f be c(-26). Sort 3, -5, f, o. -5, 3, f, o Let x = 0.116 - 0.516. Let m be (1 - -15) + (-20)/(-10). Let t = -21 + m. Sort t, x, 0.1. t, x, 0.1 Let c = 1.39 + -2.39. Let m be (-2)/8 - 17/(-36). Let v = 1349 + -1349.4. Sort m, v, 2, c in descending order. 2, m, v, c Suppose -20 = l + 26g - 31g, l = 3g - 12. Put -1, 3, 2, l, -2 in decreasing order. 3, 2, l, -1, -2 Let k(w) = w3 - 99w*2 + 265w + 2212. Let c be k(96). Put 5324, c, 5 in decreasing order. 5324, 5, c Let u = 30141 + -30187. Sort -158, 3, u in increasing order. -158, u, 3 Let h = -311 + 269. Suppose 3u + 22 = 5c, -4c + 5u + 6 = -22. Put -5, h, c in decreasing order. c, -5, h Let a be (-1 - -3)/(1 + 8). Let k = -1196508/403 + 2969. Let r = -787/7657 + k. Put 0.2, a, r in decreasing order. a, 0.2, r Let l = -86 - 55. Let v be (0 + 0 + 6)94/l. Put -7, 0, v in ascending order. -7, v, 0 Let a = 1.224 - 1.197. Sort -1/86, 0, a in decreasing order. a, 0, -1/86 Let x = 887/17 - 10661/204. Put x, 0.5, 126 in descending order. 126, 0.5, x Let q(p) = -p. Let w be q(4). Suppose 5v - 290 = -4t - 295, -5t - 16 = 3v. Sort w, -9, -3, v in ascending order. -9, w, -3, v Suppose -y + 2h + 454 = -45, -3y + h + 1482 = 0. Let r = y + -492. Sort -10, -3, r in increasing order. -10, -3, r Let t = 26.28 + 2.3. Let j = 0.58 - t. Let b = 31 + j. Put b, 2, -3 in decreasing order. b, 2, -3 Let w = 100 - 34.4. Let u = w + -65.1. Sort 0.4, 2, u. 0.4, u, 2 Let q = 0.82162 + 0.07838. Sort 0.05, 0, -3, q in ascending order. -3, 0, 0.05, q Let c = 205039 - 205119. Let t = -1 + 0.6. Put c, t, 2 in ascending order. c, t, 2 Let z(k) = -k3 - 27k*2 + 57k - 27. Let p be z(-29). Suppose -232s = -230s - p. Sort 3, 8, s in descending order. 8, 3, s Suppose 0 = 5o + 2w + 44 + 33, 14o - 3w = -293. Put -12, o, -1, 0, 2 in increasing order. o, -12, -1, 0, 2 Let t = 3.943 + -4. Let r = t + 0.357. Let b be 9/124/2. Sort b, -9, r in ascending order. -9, r, b Let v = 688 + -684. Let j = -859/3 - -287. Put j, 0, v, -8 in decreasing order. v, j, 0, -8 Let l = 16.892 - 16.7. Let c = -0.192 + l. Put c, -10, -5 in descending order. c, -5, -10 Let s(f) = 14f + 27. Let q be -8 + 0 + 2 + 0. Let o be s(q). Let g = -66 - o. Put 1, -2, g in descending order. 1, -2, g Let h = 0 + 0.06. Let q = -81.694 - -82. Let b = 4.694 + q. Sort -4/3, h, b in ascending order. -4/3, h, b Let z be 2/(-4)(-5 + 1). Let q(c) = -7c - 11. Let b be q(-2). Let d be (2/b)/(5/(-15))1. Sort d, z, 0 in ascending order. d, 0, z Suppose -30583u + 30596u = -104. Suppose y + 3m = m - 7, 4m + 4 = 0. Put y, u, -4 in ascending order. u, y, -4 Let d be (21)/(2 + -3). Let u(g) = g*3 - 28g*2 + 193g - 665. Let t be u(20). Suppose 0 = -3k + k + 2. Sort -1/7, k, d, t in decreasing order. k, -1/7, d, t Let y be 1263/27 + (-158)/18 + 9. Suppose -54 = -7v - y. Put -1/6, 3, v, -1 in descending order. 3, v, -1/6, -1 Suppose 2x + x = -y - 71, -2x + 4y = 66. Let g be -4 - 0 - 2/(10/x). Sort g, -5, -17, 0 in decreasing order. g, 0, -5, -17 Suppose -104a - 379 = 76a + 881. Put -5, -21, -3, a in decreasing order. -3, -5, a, -21 Let y = 32791/6 + -5466. Sort 17, 0.1, -5, y in decreasing order. 17, 0.1, y, -5 Suppose -3 = 17u + 82. Let s be (4 - -36)/8 + u. S	{ "pile_set_name": "DM Mathematics" }
4870k + 928200 = 0. -210, -68, -1, 13 Let -4c*5 + 5358788c*4 + 26794008c*3 + 42870448c*2 + 21435232c = 0. Calculate c. -2, -1, 0, 1339702 Factor 3w2/5 - 8526w + 2377872/5. 3(w - 14154)(w - 56)/5 Factor 5r2 + 26527715r. 5r(r + 5305543) Factor -8g2 + 81427628g - 122141424. -4(g - 10178452)(2g - 3) Determine s so that -81s*3 + 23095s*2/4 - 72557s/4 + 4641 = 0. 91/324, 3, 68 What is g in 565g4 + 6325g*3 + 10705g*2 - 5445g - 12150 = 0? -9, -2, -135/113, 1 Solve -2z4 - 890z*3 - 88672z*2 + 1593728z - 6610944 = 0 for z. -269, -192, 8 Solve -289r5 - 1097078r*4 - 1032410749r*3 + 16605243540r*2 - 66208436100r = 0. -1906, 0, 135/17 Let -3n4 - 139692n*3 + 13289274n*2 - 398436948n + 3619385289 = 0. What is n? -46659, 17, 39 Factor 121b3/5 + 220935748b*2/5 - 160680592b/5 + 29214656/5. (b + 1825916)(11b - 4)*2/5 Factor 2y*4/9 - 46604y*3/3 + 6405960y*2 - 882854448y + 40584439872. 2(y - 69492)(y - 138)*3/9 Suppose -6g*4 - 16153404g*3/5 - 2174395173798g*2/5 + 11307275542296g/5 - 434895834456 = 0. Calculate g. -269226, 1/5, 5 Suppose -5v5 + 120940v*4 - 733133670v*3 + 21855503240v*2 + 180135636875v + 323902975020 = 0. What is v? -4, -3, 37, 12079 Determine y, given that -2y2 - 2138y - 564300 = 0. -594, -475 Let -6704h2 + 19900h + 636 = 0. Calculate h. -53/1676, 3 Let 2c4/17 - 60268c*3/17 + 1204472c*2/17 + 2650032c/17 = 0. Calculate c. -2, 0, 22, 30114 What is m in m*2 - 520621m + 34877118 = 0? 67, 520554 Solve j*4 + 70j*3 + 1309j*2 + 4920j = 0. -41, -24, -5, 0 Find z such that z*3/2 + 33307z*2/2 - 15112422z = 0. -34191, 0, 884 Solve -5l2 - 132075l + 924770 = 0. -26422, 7 Factor -t*3/4 - 903714t*2 - 816698993796t. -t(t + 1807428)2/4 Determine g so that -2g*3/9 - 2696g*2/9 - 64994g/3 - 231504 = 0. -1272, -63, -13 Let 2t5/5 - 68t*4/5 + 608t*3/5 - 192t*2 = 0. What is t? 0, 2, 12, 20 Determine m so that 2m*2 + 57224902m + 57224900 = 0. -28612450, -1 Let -3d2 + 64791864d = 0. What is d? 0, 21597288 Find y such that 490y3 + 960946y*2 + 2372382678y/5 + 16372087326/5 = 0. -34197/35, -7 Factor 722t3/7 + 149591028t*2/7 - 31492872t/7 + 1657520/7. 2(t + 207190)(19t - 2)2/7 What is i in 16155i*4 - 290780i*3 - 180i*2 = 0? -2/3231, 0, 18 Factor -4n*3 + 29261376n*2 - 53514257838336n. -4n(n - 3657672)*2 Let 4v*3 + 1110904v*2 - 23330668v + 22219760 = 0. What is v? -277747, 1, 20 Determine h so that 2h5/11 + 42162h*4/11 + 217734058h*3/11 - 4303632062h*2 + 139187164620h/11 + 186744809200/11 = 0. -10645, -1, 4, 206 Factor -y*3 + 1228y*2 + 120311y - 371958. -(y - 1319)(y - 3)(y + 94) Factor -p*3 - 3696p*2 - 29495p + 33192. -(p - 1)(p + 9)(p + 3688) Factor -r*3 + 1310r*2 - 239541r - 6822900. -(r - 1083)(r - 252)(r + 25) Determine c so that 85c4/2 - 22275c*3/2 - 68365c*2 + 186300c - 10720 = 0. -8, 1/17, 2, 268 Suppose -320x5 + 4749200x*4 + 8314420x*3 - 34734645x*2 + 30057615x - 8015220 = 0. What is x? -4, 3/4, 14843 Factor -5k3 + 467000k*2 - 40591155k. -5k(k - 93313)(k - 87) Solve -2z*2 - 7121372z - 28485456 = 0. -3560682, -4 Let h*2/3 - 722147h/3 - 240716 = 0. What is h? -1, 722148 Factor 2d4 - 3916d*3 + 827594d*2. 2d*2(d - 1717)(d - 241) Determine n, given that 56n*3 - 10364n*2 + 70140n - 59832 = 0. 1, 6, 2493/14 Factor 2c2/5 - 28674c/5 - 230032. 2(c - 14377)(c + 40)/5 Determine d, given that -3d4/7 - 7617d*3/7 - 3876912d*2/7 - 559241280d/7 = 0. -1915, -312, 0 Factor -5z5 - 53255z*4 - 212660910z*3 - 377342054740z*2 - 251023178891800z. -5z(z + 2545)(z + 2702)3 Determine c so that -c4/2 + 4148c*3 + 66423c*2/2 + 37377c - 74736 = 0. -6, -3, 1, 8304 Factor a*2/4 + 44405a/4 + 665175. (a + 60)(a + 44345)/4 Find u, given that -2u*5/9 + 132u*4 + 14008u*3 + 1170620u*2/9 + 950350u/3 = 0. -83, -5, 0, 687 Factor -2a2 - 731026a + 2193096. -2(a - 3)(a + 365516) Factor -i*2/4 - 2190477i/4 - 15333143. -(i + 28)(i + 2190449)/4 Suppose 3y*3/5 - 38211507y*2/5 + 24335347868217y - 851735303024781/5 = 0. Calculate y. 7, 6368581 Find p, given that 4p2 - 39872p - 1963332 = 0. -49, 10017 Find w such that w*2/2 + 12154489w/2 + 24308970 = 0. -12154485, -4 Factor 3u3 - 7671u*2 - 138807u - 625725. 3(u - 2575)(u + 9)*2 Let 6g*5/5 + 253632g*4/5 + 23295492g*3/5 + 511701816g*2/5 - 1094304666g/5 + 111810744 = 0. What is g? -42180, -47, 1 Solve -2f3/3 - 10700f*2 + 1564294f - 59403260/3 = 0 for f. -16195, 14, 131 What is j in -4j3/5 + 1120996j*2/5 + 2242004j/5 + 1121004/5 = 0? -1, 280251 Determine a so that a*4/7 - 242a*3/7 - 607407a*2/7 - 149389600a/7 - 445409536 = 0. -368, -23, 1001 Factor 2u3 + 457302u*2 - 1829232u + 1829240. 2(u - 2)2(u + 228655) Suppose -3o5/7 - 2397o*4/7 + 14562o*3/7 + 57768o*2/7 - 22080o = 0. What is o? -805, -4, 0, 2, 8 Let -15k2 + 1133633448k - 226726689 = 0. Calculate k. 1/5, 75575563 Determine f, given that -4f3/7 + 7284f*2/7 + 12372480f/7 - 22544047600/7 = 0. -1759, 1790 Solve -3l2 + 27708l + 1533015 = 0. -55, 9291 Factor -2j2/13 + 45586j/13 - 14427024/13. -2(j - 22472)(j - 321)/13 Factor -5r2 - 148327480r - 1100052066157520. -5(r + 14832748)2 Factor 2r*3/5 + 31712r*2/5 - 200934272r/5 + 54602510336. 2(r - 2552)2(r + 20960)/5 Solve -180014c2 + 720030c/13 + 8/13 = 0 for c. -1/90007, 4/13 Suppose -v*2 - 6876v - 1770944 = 0. Calculate v. -6608, -268 Find j such that -305j2 + 881420j + 86700 = 0. -6/61, 2890 Solve -5c5 - 25530c*4 - 6096645c*3 + 67635097200c*2 - 35092362888000c = 0 for c. -3345, 0, 792 Factor q*2/4 + 33926147q + 1150983450265609. (q + 67852294)*2/4 Factor -2q*2/11 + 263085088q/11 - 8651720440995968/11. -2(q - 65771272)2/11 Let 4d*2 + 75016216d + 75016212 = 0. Calculate d. -18754053, -1 Let -2x5 - 712x*4 - 95978x*3 - 6158180x*2 - 188632000x - 2216864000 = 0. Calculate x. -130, -73, -40 Factor -a*3/6 - 1970a*2 + 102778a - 4012736/3. -(a - 26)*2(a + 11872)/6 Let -2p3/15 + 7232854p*2/15 - 5786278p/3 + 7232846/5 = 0. What is p? 1, 3, 3616423 Solve 2d4/3 - 8870d*3/3 + 253392d*2 - 15753352d/3 - 16522400/3 = 0 for d. -1, 38, 50, 4348 Determine s so that -2s4/15 - 650696s*3/15 - 5855812s*2/5 - 33182792s/15 - 3253210/3 = 0. -325321, -25, -1 Factor 2o3/21 - 115923352o*2/7 + 5039333827093464o/7. 2o(o - 86942514)2/21 Factor -q3/3 + 1162q2 + 165117q + 5751288. -(q - 3624)(q + 69)2/3 Factor -98v*3 + 350777728v*2 - 200444392v + 28634912. -2(v - 3579364)(7v - 2)2 Factor -14i*2/3 + 904i - 1930/3. -2(i - 193)(7i - 5)/3 Factor 3v*2 - 74614224v + 463940201926848. 3(v - 12435704)2 Solve j3/6 + 13355j*2/6 + 1064852j + 129736218 = 0. -12863, -246 Factor 2k2 - 1227886k + 2455764. 2(k - 613941)(k - 2) Suppose 12n5/5 + 369n*4 - 768n*3/5 - 46503n*2/5 + 95634n/5 = 0. Calculate n. -154, -23/4, 0, 3 Let 2t3 - 396394t*2 + 19642412710t - 137477466350 = 0. Calculate t. 7, 99095 Determine l, given that 5l3 + 1314055l*2 + 7884115l - 9198175 = 0. -262805, -7, 1 What is k in 140k4 - 47734k*3 + 3520088k*2 + 96513906k = 0? -1473/70, 0, 181 Factor -m*3/4 - 69131m*2/4 - 34555m/2 + 345650. -(m - 4)(m + 5)(m + 69130)/4 Suppose -15i3 + 7025i*2 + 54590i + 71400 = 0. What is i? -6, -5/3, 476 Factor 2l2 - 106934604l - 106934606. 2(l - 53467303)(l + 1) Factor 5c2 - 104269830c + 543609872411445. 5(c - 10426983)2 Factor 269u*3/4 - 2157u*2/4 - 3218u + 60. (u - 12)(u + 4)(269u - 5)/4 Determine l, given that -2l*2/3 + 135708l + 11401040/3 = 0. -28, 203590 Factor 2o3 + 10682o*2 - 386514o + 3387510. 2(o - 21)(o - 15)(o + 5377) Determine s, given that 573s*2 - 2270817s + 71334 = 0. 6/191, 3963 Factor 4x3 + 327144x*2 - 327148x. 4x(x - 1)(x + 81787) Factor 2m*2 - 78488m - 14747194. 2(m - 39431)(m + 187) Suppose -2933i4 + 481014i*3 + 970495i*2 + 486216i - 332 = 0. What is i? -1, 2/2933, 166 Solve -2z2/11 + 1783924z/11 - 76705034/11 = 0 for z. 43, 891919 Find k, given that -2k*4/11 + 136	{ "pile_set_name": "DM Mathematics" }
in 6, -0.026, -2/335, -1, 1? -1 Which is the nearest to 5? (a) -90 (b) -0.5 (c) 11 (d) 0 (e) 5 e Which is the closest to -4382? (a) 2/7 (b) 1 (c) 15 (d) -1/11 d What is the closest to -3 in -2/7, 0.189, 1/3, -1/518? -2/7 What is the closest to 0.1 in -0.1, 0.7, 2, -9/59, 656, -0.2? -0.1 Which is the nearest to -0.1? (a) 6 (b) 68 (c) 46 (d) -3 (e) 3 d What is the closest to 5 in 0.3, -3, 6, -903, -2/7, 2/43? 6 Which is the nearest to -0.1? (a) -3 (b) -5/4 (c) 0.5 (d) -3/8 (e) -13870 (f) -0.25 f Which is the closest to -10/19? (a) 26 (b) -0.2 (c) -0.4 (d) -2.6 (e) -5 c What is the closest to -0.4 in 9/5, 0.052, -3/10, -0.338? -0.338 What is the closest to 0.84 in 2/19, -3/7, 2/929? 2/19 Which is the nearest to 0.2? (a) 5 (b) -0.2 (c) 4 (d) -0.042 (e) 745 d What is the nearest to 13.03 in 2, -2, -2/7, 3, 2/187? 3 What is the closest to 2 in -2, 0.2, 0, 11, -0.22, -27/16? 0.2 What is the nearest to 0.3 in -534/5, 2/3, -42? 2/3 What is the nearest to -0.1 in 1/3, 5048, 0.37, -0.2? -0.2 Which is the closest to 8? (a) 29 (b) -1 (c) -0.3 (d) 0.5 d Which is the nearest to 6/5? (a) 1/3 (b) 0.0617 (c) 5/41 a What is the closest to 1 in -1, -1.3, 2769, 51? -1 Which is the closest to 117? (a) 11 (b) -4 (c) -1 (d) -94 (e) 1 a What is the closest to 1 in -1, -0.3, -14, 207/7, 2/185? 2/185 Which is the closest to -12.9? (a) 3 (b) 5 (c) 1 (d) -2 (e) 0.004 d What is the closest to -1 in -1/3, 3/5, 1350, -17/2, 13, 0? -1/3 Which is the closest to 1? (a) -1047/4 (b) 0.0226 (c) -3 b What is the nearest to 196.2052 in 0, -1, -5? 0 Which is the nearest to 0.2? (a) -1500 (b) -0.2 (c) -0.3 (d) 0.0507 d Which is the nearest to 1/5? (a) 1 (b) -144 (c) 1/16096 c What is the closest to 326 in 6, 1/55, -0.2, -5, -2, 4/7? 6 Which is the closest to 128001? (a) -1/7 (b) -3 (c) 14 c Which is the closest to 7? (a) -11151 (b) 0.04 (c) -5 (d) 3/5 (e) 3 (f) 4 f Which is the nearest to -4242? (a) -51 (b) 0 (c) 2/7 (d) -5 (e) -2/25 a Which is the nearest to -12? (a) 1.25 (b) -0.2 (c) -0.1 (d) -4 (e) 9 d Which is the nearest to 2/53? (a) 1 (b) -0.3 (c) -5 (d) -3/7 (e) -6.54 b What is the closest to 6 in 1714, -1.2, -1/5, 0.06, 11? 11 Which is the closest to -2? (a) -0.121 (b) 0.2 (c) -416 a What is the nearest to -2/7 in -1, -2/5, 2/9, 0.4, 0.082153? -2/5 Which is the closest to -0.02? (a) -5 (b) 0 (c) 1 (d) -1/10 (e) -11120 (f) 2/3 b What is the closest to 1/5 in 435, -2, 4, -54, 0.2, -1/3? 0.2 What is the closest to -1 in -14, -8, 3, -9, -11? 3 Which is the closest to -45? (a) -401 (b) 28 (c) -11 c What is the nearest to 4 in 3/2, -6, -70, 6.3, -2/11? 6.3 Which is the closest to -8? (a) 2429 (b) -6 (c) -0.4 b Which is the nearest to -155? (a) 0.4 (b) -0.1 (c) 5/8 (d) -2 (e) -10/7 (f) -4 f What is the closest to -18 in 2/15, 3/5, -3150? 2/15 What is the closest to 0.2 in -0.5, 26/5, 5, -4, -1.657? -0.5 What is the nearest to 2014 in -5, 3, 0.2, -3, -6? 3 Which is the closest to -15668? (a) -1 (b) -2/7 (c) -21 c Which is the nearest to 1/3? (a) -4 (b) 4/9 (c) -0.4 (d) 0.114 b What is the closest to -0.13 in -0.26, 8, 1/4, -4, -226, 3/7? -0.26 What is the closest to -2/5 in -4/7, 4, 8444, -1, 0.034? -4/7 What is the nearest to -1 in -0.3, -0.15, -11.75, -1, 5/3? -1 Which is the nearest to 57? (a) 1/2 (b) 2/221 (c) 5 c What is the closest to -0.02 in -2, 11790293, -1/4? -1/4 Which is the nearest to 17? (a) 28 (b) -38 (c) 0.5 (d) 251 a Which is the closest to -5? (a) -2/3 (b) 2.7 (c) -2/9 (d) 3/7 (e) -0.01388 (f) 14 a Which is the nearest to 0? (a) 5 (b) 575 (c) -1/2 (d) -0.225 (e) -1 d Which is the closest to 0.192407? (a) 0 (b) -5 (c) -0.5 a Which is the nearest to -2/7? (a) -8 (b) -5 (c) 216569 b What is the closest to 38 in -1, -0.06, 5, -5, 1/3? 5 What is the closest to -1/4 in 4/7, -0.07, 0, 42? -0.07 What is the closest to 0.0878 in -4/3, -2/3, 4, 2/9, 0? 0 What is the nearest to -0.1181 in 49, 2045, 0.5? 0.5 Which is the closest to 1? (a) 512 (b) 10 (c) -292/7 b What is the nearest to 3/4 in 4, -9866, 2? 2 What is the nearest to -1.96 in 7264, 0.08, -2? -2 What is the closest to -4 in -2/13, -0.1, -38, -3/4, 0.01, -3? -3 What is the closest to 45794 in 0, -0.5, 1/11? 1/11 What is the closest to -1/12 in 60, -2/7, -0.05, -124/11? -0.05 What is the closest to 3/7 in 4/5237, -13, -4/3, -2/5, -2? 4/5237 Which is the nearest to 459? (a) -0.3 (b) 3 (c) -0.0042 (d) -4/23 (e) 2/7 (f) -2 b Which is the closest to -3333/4? (a) -4/7 (b) -0.1 (c) 2 a Which is the closest to -5? (a) -29002 (b) -49 (c) 1/5 c What is the nearest to 436 in -186.6, -0.21, -1/4? -0.21 Which is the nearest to -0.092? (a) 9 (b) -1/4 (c) 0.3 (d) -28/45 (e) -7 b What is the closest to 96 in -0.4, 0.3, 2/5, 300? 2/5 Which is the nearest to 1/6? (a) 3/7 (b) -5 (c) 24/25 (d) -3 (e) 2/415 e Which is the closest to -0.1? (a) -535 (b) -63 (c) 3/8 c What is the closest to -12/313 in 2, -1/10, -2, 3.4? -1/10 What is the nearest to 23 in -3728, 84/31, 1? 84/31 What is the closest to -1 in 4, 111/8, 1/4, 20? 1/4 What is the closest to -0.5 in 3, -1551.4, 10, 36? 3 What is the nearest to -3 in 2901/10, 4, -1/5, 1, 38? -1/5 What is the nearest to -451 in 45, 2/7, 0.1, -0.1, -57, 0.4? -57 What is the closest to -2/3 in 55/7, 1/3185, 1/8, 9? 1/3185 What is the closest to 46/7 in 4/7, -1390, 13? 4/7 Which is the nearest to -0.1? (a) -39/32 (b) 1/2 (c) -2.76 b What is the nearest to 2.04853 in -0.1, 0, 7, 2/13? 2/13 Which is the nearest to -0.1? (a) 0.1 (b) -1/9 (c) -194 (d) 3/88 b What is the nearest to -2 in 6, -0.02, 1680? -0.02 Which is the nearest to -0.428? (a) -1 (b) -285 (c) 0.5 a What is the closest to 19 in 0.252, 5, 2, 2/3, 0? 5 Which is the closest to -1? (a) -4/317 (b) 3/2 (c) 1739 a Which is the closest to 4/11? (a) -0.5 (b) -0.08 (c) -1.1 (d) -3.1 (e) 2/7 e Which is the closest to -1? (a) 1.3 (b) 1/20 (c) 2 (d) 578 (e) 4 b Which is the closest to 9191? (a) 26 (b) 5 (c) 2 (d) 1/2 (e) -3 a Which is the nearest to -0.1? (a) -2/3 (b) -2 (c) -526858 a What is the nearest to 0.019 in 0, -25, -356/3? 0 Which is the nearest to 0.2? (a) 1/5 (b) 6 (c) -356 (d) -0.2 a What is the closest to 3 in 4, -101/18, 1006? 4 What is the closest to 2/5 in -12/11, 2/22883, -11? 2/22883 Which is the nearest to -2/9? (a) -214 (b) 5 (c) 7 (d) 1.1 (e) -1/7 (f) -1/5 f What is the closest to 0.1 in -0.19, -43916, -33? -0.19 What is the nearest to -3.381 in 0.2, -8/7, 9? -8/7 What is the closest to 2 in -3.5, 156, 1/11, 4, -1/7? 1/11 Which is the nearest to -1/3? (a) -0.5 (b) 35.71 (c) -1/3 (d) -7 c What is the closest to -0.07 in 18, -26/5, -0.4, 4.6, -0.2? -0.2 Which is the nearest to -3? (a) 3/7 (b) 1 (c) -52095 a What is the closest to -1/5 in -11, -3/2, 549/5, 3, -10, -5? -3/2 Which is the nearest to -0.6? (a) -89 (b) -1/2 (c) 0.06 b What is the closest to -6 in 405, 2/7, 448, -3/5? -3/5 Which is the nearest to -1? (a) 3 (b) 1.706 (c) 4 (d) -0.3 d Which is the closest to -1? (a) 7/2 (b) -4 (c) 0.4 (d) -2.74 (e) 0.157 e What is the nearest to 26/15 in -16512, 2, 4, 0? 2 What is the closest to -4 in 0, -5, 0.1, -1/90708? -5 What is the nearest to -2/9 in 5, -611.64, -2, -0.08? -0.08 Which is the nearest to -56? (a) -2/7 (b) 0.5 (c) 0.9 (d) -5 (e) -30 (f) 2.2 e Which is the closest to 0? (a) 1/3 (b) 15 (c) 1/5 (d) -19/5 (e) -0.3 (f) 24 c What is the closest to -10 in -1/3, 0.2, 240/11, 0.4, 2? -1/3 Which is the nearest to -5? (a) 116.6 (b) -0.5 (c) -767 b What is the nearest to 81 in -4/3, -1/4, 22? 22 Which is the nearest to -0.1? (a) -2/27 (b) -0.2 (c) 5 (d) 0.3 (e) 2/15 (f) 1 a Which is the closest to 0.3? (a) 264 (b) -3/718 (c) -1/13 b Which is the nearest to 42? (a) -1 (b) -146 (c) -0.1 (d) -36 (e) 1 e What is the nearest to -0.2 in -0.38, -4, -13, 12, 1.7, 4? -0.38 What is the closest to 24886 in 202, 4/5, 5/3, -0.5, 2/3? 202 What is the nearest to -4/5 in 0.09, 3, -2111? 0.09 Which is the closest to 102189? (a) -0.4 (b) 0 (c) 2/57 c Which is the nearest to 3/5? (a) 2/13 (b) 3/8 (c) -18 (d) 5 (e) 2247 b Which is the closest to -5/8? (a) -12 (b) 929/6 (c) 13 a What is the closes	{ "pile_set_name": "DM Mathematics" }
sqrt(1452)))) + sqrt(1452) - sqrt(1452))6). -68sqrt(5)/55 Simplify -3(-1 + sqrt(68) - (sqrt(51)/(sqrt(9)/sqrt(3)))2) - ((3sqrt(272))2 - (-3 + sqrt(153))2). -2232 - 24sqrt(17) Simplify -5 + (5 + -1(((-1 + sqrt(80) + sqrt(80))6 - (-1 + sqrt(80) + 0))6 + -5))*2. -21120sqrt(5) + 350075 Simplify 31(5 + (sqrt(189)/(sqrt(7) + sqrt(7)-3 + sqrt(7))6 + -5)4)2. 6480sqrt(3) + 47331 Simplify -1(4-1(-2 + 5(sqrt(1088) - (sqrt(1088) + 3))))*2. -4624 Simplify 5(2((-5sqrt(153)-2)2 - sqrt(153)) + 4 + (sqrt(153) - (sqrt(153) + -1)-5)*2). -930sqrt(17) + 180685 Simplify (-5-34(-2 + 2sqrt(99) + -4-1sqrt(99)))*23. -777600sqrt(11) + 38534400 Simplify (1 + 1 + (sqrt(147) + -4 + (-3sqrt(147) - sqrt(147)))*2 + (-3sqrt(147) + 4)*2 + 2)-1. -2682 Simplify 5(((((4 + sqrt(612) - sqrt(612)) + -1)2 - sqrt(612)) + -3 - (-3 + sqrt(612) + 0 + sqrt(612)-4)) + 0). 45 + 60sqrt(17) Simplify (sqrt(9) - ((sqrt(729)1 - sqrt(9)) + sqrt(9)))/(-1sqrt(27) - sqrt(3)) + 5 + sqrt(363)-1 + -5. -9sqrt(3) Simplify 6(1 + -5((-2 + (sqrt(1872)2 - sqrt(1872)) - (2sqrt(1872) + 3)) + 1))2. 15120sqrt(13) + 283446 Simplify -2(-5 + (2sqrt(475))*2 + -2 + -6(sqrt(475) + 1 + sqrt(475))*2 + -1) + 1. 240sqrt(19) + 19029 Simplify (-2sqrt(110)/sqrt(2) - (sqrt(55) + sqrt(495)1) - ((sqrt(330) - -2sqrt(330))1)/sqrt(6))/(-21sqrt(99)35). sqrt(5)/10 Simplify 0 + ((sqrt(243) - (sqrt(243) - (sqrt(243)-1 + 5))) + -5 + 4)2 + -3 + ((sqrt(243) + -1)-6 - (-5(sqrt(243) - sqrt(243)-2))*2). -54413 - 126sqrt(3) Simplify (1 + 5 + (sqrt(1300) - sqrt(1300)-1)2)3-3 + 4. -46850 Simplify -1(2 + 3 + 5(sqrt(12)/(sqrt(576) + (sqrt(576) - sqrt(576)-2) + sqrt(576)) + -2)). -sqrt(3)/12 + 5 Simplify -3(-2 + ((-5 + sqrt(180) + -1 + 3)2 - ((sqrt(180) + -2 + 4 + sqrt(180))2 + sqrt(180) + -5)))-3. -4788 - 810sqrt(5) Simplify 5(-5 + (6((sqrt(209) - -2sqrt(209)) + sqrt(209)) - (sqrt(209) - ((sqrt(209)2-4 - sqrt(209)) + sqrt(209))))/(-2sqrt(891)2))-4. 25sqrt(19)/3 + 100 Simplify -4((-1 + sqrt(128) + 2)2 - (-2sqrt(128) + -2)*2)-5-5. 4800sqrt(2) + 38700 Simplify 1 + sqrt(448)1 - (sqrt(252) + (sqrt(252) - (sqrt(252) + (1sqrt(252) + sqrt(252))1)))2 - (sqrt(378)-6)/(-4sqrt(6)-2). -251 + 41sqrt(7)/4 Simplify ((sqrt(180)2 - sqrt(180))/sqrt(10))/sqrt(576) + (-1(1sqrt(160) + sqrt(160)) + sqrt(160))/(sqrt(15)/sqrt(3)-6). 19sqrt(2)/24 Simplify -3 + sqrt(76)/((sqrt(144) - sqrt(4))-6 - sqrt(4) - sqrt(4)) + -3 + (4 + 3 + sqrt(171))2. 1343sqrt(19)/32 + 214 Simplify -4(sqrt(17) + 2) + sqrt(17) + sqrt(51)/(sqrt(6)/sqrt(2)) + 5 - (sqrt(17) + -6sqrt(612) - ((3 + sqrt(17))*2 + -1)). 22 + 39sqrt(17) Simplify ((sqrt(6)/(5(sqrt(3) - sqrt(108))) + (sqrt(2) - -1sqrt(2))1 + -1sqrt(4)/sqrt(2))-6)2 + -5. 38347/625 Simplify ((sqrt(91) - (sqrt(91) + 4sqrt(91)1)) + (-3sqrt(91) - sqrt(91))2)/((sqrt(70)15)/sqrt(10)-4). 3sqrt(13)/5 Simplify (63sqrt(133)-16)/(sqrt(567)6 + -1sqrt(28)). -27sqrt(19)/13 Simplify ((sqrt(208)-6-6-4 - (-2sqrt(104)1 + sqrt(104) + sqrt(104))/((sqrt(392) - sqrt(392)2) + sqrt(8)))6)2. 155271168 Simplify -3 + (sqrt(132)/(sqrt(3)-2) + 1sqrt(396) + sqrt(396))/(sqrt(12)/sqrt(75) + sqrt(576) + (sqrt(576) - -1sqrt(576))). -3 + 55sqrt(11)/362 Simplify (2 + (sqrt(396) - (1sqrt(396) + sqrt(396)))-6 + -5 - -1((sqrt(396) + 0 - sqrt(396))2 + -2sqrt(396) + -4))*2. -336sqrt(11) + 6385 Simplify -4 + (((sqrt(468) - sqrt(468)1-6) + sqrt(468))/sqrt(9))/(3-4sqrt(64)). -4 - sqrt(13)/6 Simplify 3sqrt(13)2 + 2 + 3 - (sqrt(52)/(sqrt(44)/sqrt(11)) + 5sqrt(117)). -10sqrt(13) + 5 Simplify (2(sqrt(45) + -3sqrt(45)))/(-4sqrt(324) - sqrt(9)) - (-1 + 6(sqrt(720) + 1)6). -10796sqrt(5)/25 - 35 Simplify 0 + 2(sqrt(54) - sqrt(6))/sqrt(3) + 0 + 24(1 + sqrt(72) + 1). 16 + 52sqrt(2) Simplify 4(3(-2-1sqrt(2736) + (sqrt(2736) - (sqrt(2736) - (-1 + sqrt(2736))-3)2) + sqrt(2736)) + 2)-4-3. -6304944 + 48384sqrt(19) Simplify -5 + (5 + 4(sqrt(245) + 4(sqrt(245) + 0) + (sqrt(245) - (sqrt(245) + 0)) + 5) + 1)*2. 7280sqrt(5) + 98671 Simplify (355(sqrt(1575) - sqrt(1575)4)2)2. 318937500 Simplify -2 + (-4 + (2sqrt(931))2 + -4 + 2 + (1 + sqrt(931))2 - 6(-3 + (-5(sqrt(304) - 2sqrt(304)))2)). -40934 + 14sqrt(19) Simplify -5(sqrt(20)/(sqrt(8)/sqrt(2)) + sqrt(5) - (5 + sqrt(5)1)*2 - (-1sqrt(405) + sqrt(405) + 5 + sqrt(405))) + -3 + -2. 170 + 85sqrt(5) Simplify -4(5 + (sqrt(3168)-3)/sqrt(11)-4 + 1)*2 + 4. -166028 - 6912sqrt(2) Simplify 36(-2 + sqrt(19)-1)4 - (3-1-2(sqrt(475) + 1 + sqrt(475)))2. -68580 - 792sqrt(19) Simplify 3 + ((sqrt(36)/(2sqrt(12)))2 - (4 + sqrt(363)) - (sqrt(6) + 6sqrt(294))/sqrt(2)-1). -1/4 + 32sqrt(3) Simplify (sqrt(1377)3 - (sqrt(425)3 + sqrt(425))*2 - sqrt(204)/((sqrt(108) - (sqrt(108)-2 + sqrt(108)))/sqrt(9) - sqrt(12))-2)-2. -58sqrt(17) + 13600 Simplify ((sqrt(475) - (-3 + sqrt(475) + -3)2)5 - ((1((sqrt(475) - -3sqrt(475)) + sqrt(475)) - sqrt(475) - sqrt(475))*2 + 1))5. -34155 + 1625sqrt(19) Simplify ((sqrt(630)26 - 2(-3sqrt(630) - sqrt(630)))/((2sqrt(110)-2)/(sqrt(66)/(sqrt(24)/sqrt(4)))))2. 1575 Simplify 2 + -1(-2 + (-1 + sqrt(76) + (-2sqrt(76))2 - sqrt(76)) - (-3 + ((sqrt(95) - 2sqrt(95) - sqrt(95) - sqrt(95))/sqrt(5) - sqrt(19)) + 5)). -297 - 4sqrt(19) Simplify -1 + (-51sqrt(13)-1 + 2 - (sqrt(65) + 4(sqrt(65) + sqrt(65) + sqrt(65) + (sqrt(65) + (sqrt(65) - -2sqrt(65)) - sqrt(65))))/(sqrt(80)-2)). 1 + 65sqrt(13)/8 Simplify (((sqrt(637) + sqrt(637)-2)-1 - (sqrt(637) + 1 - sqrt(637))-5)3-6)2 - (-2 + (-1 + (sqrt(637) + -1)2)-6 + -1). 22596sqrt(13) + 218313 Simplify 4 + -1(((sqrt(180) + 1)3 + sqrt(180))2-5 - (-4(sqrt(180) + -1) - 6(sqrt(180) - (sqrt(180) + 0 + sqrt(180)))*2))3. 2088sqrt(5) + 40111 Simplify (((-1sqrt(153) - sqrt(153)) + 5)6 - (-1sqrt(153) + 5 + 0 + -1sqrt(153)))21 + -3. -1500sqrt(17) + 15922 Simplify -4 + (((-3(sqrt(448) - (1 + sqrt(448))) - 2(1 + sqrt(448) + sqrt(448) - sqrt(448))) + -2sqrt(448)1 + 4)-6)*2. -11520sqrt(7) + 258944 Simplify 5(-2 + -3(sqrt(567)-1)2 - (-5 + sqrt(28)-4 + -5)). -8465 + 40sqrt(7) Simplify (-2-1(-2 + sqrt(208) + sqrt(208)-21 + -6(sqrt(208) + 0) + 0)-3-5)*2. 100800sqrt(13) + 9176400 Simplify ((sqrt(95) + (-1sqrt(95) + sqrt(95))-5 + sqrt(95) + 6-1sqrt(95))/(sqrt(20)/((sqrt(32)2)/sqrt(8) - sqrt(4))) + -3)2. 24sqrt(19) + 313 Simplify (-2(sqrt(1715) - 1(sqrt(1715) + 2sqrt(1715))))/(sqrt(120)/((sqrt(60)-2)/sqrt(10))). -28sqrt(7) Simplify -1(((((sqrt(126) + (sqrt(126) - -1sqrt(126)))/sqrt(6))/sqrt(7) + 2)2 - -5sqrt(15)/(sqrt(180)/sqrt(4))) + 3). -34 - 41sqrt(3)/3 Simplify ((-4 + 2sqrt(176))*2 - 1(sqrt(1584) + -1)) + (sqrt(6655)-3 - sqrt(6655))/(sqrt(320) + (sqrt(320)3 - sqrt(320))). -467sqrt(11)/6 + 721 Simplify 64(-51(2 + sqrt(684))2 - (sqrt(684) + 0 + 4 + 5)). -82776 - 3024sqrt(19) Simplify ((sqrt(156) - sqrt(156)1)-3 + (sqrt(156) + -2sqrt(156))6)/(32(-4sqrt(12) + sqrt(12))-5). -sqrt(13)/15 Simplify ((((sqrt(528) + -3sqrt(528)3 - sqrt(528)) + sqrt(528) - sqrt(528)) + (sqrt(528) - sqrt(528)-31))/((-1sqrt(528))/(sqrt(147)1)))*2. 3675 Simplify -4 + -5((3sqrt(448) + -2 - ((sqrt(448) + 2)-5 + sqrt(448))) + 1) + -4. -280sqrt(7) - 53 Simplify 4 + (0 + sqrt(1008))5 + (sqrt(77) - -4(sqrt(77) + 1sqrt(77) + sqrt(77)))/(sqrt(66)/(sqrt(6)-1)). 4 + 47sqrt(7) Simplify (-3sqrt(190)/(sqrt(1000) + sqrt(1000)2))*2 - ((sqrt(684) - (-6((1sqrt(684) - sqrt(684))2 - sqrt(684)) + sqrt(684))) + 2). -181/100 + 36sqrt(19) Simplify (2 + -3 + (sqrt(68)2 + sqrt(17) - -5(sqrt(34)/sqrt(2) - sqrt(17))) + -2 + (3 + (sqrt(1377) - (sqrt(1377) - (-1 + sqrt(1377) - sqrt(1377)))))5)2. 70sqrt(17) + 474 Simplify -3 + ((3 + sqrt(171)-5)2 + 3sqrt(171)-3 + sqrt(171))42. -912sqrt(19) + 34269 Simplify -3 + (-1(sqrt(11) - (5 + (sqrt(11) - sqrt(11)-1)) - (-1 + sqrt(11)1)) - sqrt(99)/(-3-3sqrt(9))-2). 1 + 20sqrt(11)/9 Simplify 5 + ((-1sqrt(130)6 + -2(-2sqrt(130) + sqrt(130)) + sqrt(130))-4)/((sqrt(40)/sqrt(4)4 - sqrt(20)/(sqrt(2) - sqrt(18)))2). 4sqrt(13)/3 + 5 Simplify (5sqrt(3840) - (-4sqrt(480) - sqrt(480))/sqrt(8))/(((sqrt(336)2)/sqrt(7))/(sqrt(44)/(-2*sqr	{ "pile_set_name": "DM Mathematics" }
1346, -2m - 44 = -5v for v. 0 Solve 478968 = -4i + 478960, 0 = c - 2i + 1 for c. -5 Solve -c = -f + 9, 331c + 2f - 6 = 329c for c. -3 Solve 0 = 5b - 3s + 38, 562406s = -5b + 562405s + 6 for b. -1 Solve 1265 - 1311 = 5b + 14f, b - f - 6 = 0 for b. 2 Solve 0 = 3p - 4i + 134 - 9, 8p + 0p - 75 = -i for p. 5 Solve -1491 = -4n + 4a - 1515, 10 = -2n + 5a - 4a for n. -4 Solve 4b - 58 = 3p + 5p - 12p - p, 0 = -12p + 120 for b. 2 Solve 2u + 2u - 13j = -12, 5j + 9 = -5u - 6 for u. -3 Solve 3h - 13 = 42j - 43j + 14, -h + 75 = 4j for h. 3 Solve 23p - 2c + 42 = 0, -20c + 19c = -4p - 6 for p. -2 Solve 14088n - 7117n + 2928 = -u + 7039n, 0 = u + 4n - 168 for u. -4 Solve 37b + 43b - 3z = -57b + 136b + 20, 48 = -4z - 12z for b. 11 Solve -3h = -4h - 3205p + 3194p + 8, 40 = 5h - 5p for h. 8 Solve 300l - 156l + 6 = 3s - 385l, 108l = s + 107l - 2 for s. 2 Solve 3c - 5 = j, 3j + 827814 = 827808 for c. 1 Solve -56 = -q + w - 119 + 60, -59w = -3q - 58w - 5 for q. -1 Solve 2v - 7806 + 7846 = k, 0 = -4v + 196k - 7064 for v. -2 Solve -9j = 3g + 400 - 103, 0 = -3j - 3g - 93 for j. -34 Solve 6z + 4 = 2u, -10u = -74z + 77z + 13 for z. -1 Solve n - 4n + 113 = -15g + 10g, -2g - 54 = n for g. -25 Solve 4c + 5l = 47, 23l - 104 - 64 = -c - 91 for c. 8 Solve 5l - 7u + 31 = 0, 288 = -10681l + 10684l + 98u for l. -2 Solve 51w + 9x - 225 = -45, 211 = -w - 3x + 223 for w. 3 Solve 9a = 2d + 39, 6a = -3a + 11230 - 11185 for d. 3 Solve a + 167 = -3s, -3a + 275 + 128 = 4s + 629 for a. -2 Solve -33h = -52h + 2p + 433, -17h = 5p - 401 for h. 23 Solve a = q + 26 - 6, 57 = 2q - 6q + 3a for q. 3 Solve 24536v - 24531v = 8k + 68, -3v = 5k - 31 for k. -1 Solve 44 = 2u - 6s, -u + 4s - 2385 = -2415 for u. -2 Solve -9 = 4t - n, -5t - 40070n = -40054n - 75 for t. -1 Solve 2h + h = 2g - 227558 + 227580, -h + 26 = -2g for g. -14 Solve 5a - 4z = -66, 351074a - z - 29 = 351076a for a. -14 Solve 3f + b = 2f + 5b - 7, 2b = -9f + 13 for f. 1 Solve 456s - 3 = -2v + 459s, 0 = 2v - 18s - 18 for v. 0 Solve 31o - 28o + 220 = 52y, -4y - 1 = -2o - 25 for y. 4 Solve 5s + 15t = -120, -2s + 350 = -7t + 2t + 354 for s. -12 Solve 24068y + 2u + 33 = 24067y, 0 = -3u + 3 for y. -35 Solve 0 = -8z + 3z - 15, 428r = 430r - 3z - z - 18 for r. 3 Solve -2y = -7909b + 7904b - 21, 0 = b - 4y + 15 for b. -3 Solve 3y + 63 = 3s, -118013s - 4y = -118010s - 70 for s. 22 Solve -12 - 52 = 5r + 4g, -10g - 7g - 148 = 20r + 12g - 31g for r. -8 Solve -o + 2o + 430 = 5l + 402, -3o = 24 for l. 4 Solve 3y + 67516 = 5n + 67762, 16n - 4y = -776 for n. -48 Solve 3g - 45 = 3v, 589g = 19v + 590g - 35 for v. 1 Solve 2z + a - 19 = 0, 4a = -z + 1422021 - 1422001 for z. 8 Solve -3z - 2z - 5d - 304 = -3d, 68d + 9 = 71d for z. -62 Solve 3r + r - 8z + 32 = -0r - 4z, 26r + 24z - 10 = 24r for r. -7 Solve j + 17 = i, -1824j + 2i - 14 = -1826j for j. -5 Solve -2y = 2n + 70, 61y - 113 = 4n + 63y + 17 for n. -30 Solve 0 = -0s - 2s - 11064b + 11068b - 12, 3b - 9 = 0 for s. 0 Solve 25 = -2u - g, 4u + 58 = 2g + 35 - 31 for u. -13 Solve 12h = -2x + 21h - 7h - 4h - 26, 403 = -79x - h for x. -5 Solve 6m = -29b + 41b - 17b - 26, -3m + 5b = -17 for m. -1 Solve -4h + 145 = -x, -2x - 17862 + 7702 = -290h for x. -5 Solve -17t = -5h + 522, 25h - 3t = 21h + 50 + 39 for h. -1 Solve -5d + 2 = 3b - 1, 112b - 4d = 205b - 115b - 100 for b. -4 Solve -t = -l + 36, -5t - 250 = 4l - 43 for t. -39 Solve 6 = -31q - 7q - 70, -q + 13 = -j for j. -15 Solve -17c = n - 1272 + 1511, -3n - c = 7c + 115 for n. -1 Solve i + 41k + 1225 = 0, -6i + 3k - 873 = -993 for i. 5 Solve 30 = -10w + 5l, 627w = 632w - 9l + 28 for w. -2 Solve -4y - 4h = -4, -h + 1 = 1330y - 1332y for y. 0 Solve -61543k + 61540k - 5v + 78 = 0, -5k - 55v + 830 = 0 for k. 1 Solve 5n + 18 = 8, 4b = -35114n + 35115n + 446 for b. 111 Solve 3r - 29 + 40 = -2n - 48, -2r - 4n = 26 for r. -23 Solve 40k + 3i = -96k - 269, 0 = 2k - 4i + 10 + 2 - 4 for k. -2 Solve 8v + 5z = v - 176, 425 = 3v - 8z - 6z for v. -3 Solve -26k + 163 + 16 = 5o, -19o - 207 = -24o + 2k for o. 41 Solve 4s - 6d - 290 = 0, 4 - 10 = 4d + 14 for s. 65 Solve -2p = 4u + 20, 7u - 58052 + 58063 = -2p for p. -16 Solve 17l - 16l = -16h - 19, -4h + 10 = -53l - 145 for l. -3 Solve -18b + 23 + 28 = -7g - 262 + 17, -5b + 2 + 57 = -31 for g. 4 Solve -12w - 12 = -687u + 684u, -2w + 86 = 5u for u. 16 Solve -307f = -305f - 3x - 60, -5x - 110 = 0 for f. -3 Solve -5g = 70t - 75t - 10, -9t + 29t - 98 = -3g for t. 4 Solve 51 = x + 2x + v, -78 = 211x - 215x + 2v for x. 18 Solve -2y = 12, -318y - 54y - 2046 + 924 - 1112 = -2z for z. 1 Solve 552h = 4z - 2780, 2z + 4 = -2z - 5h - 3 + 2 for z. 5 Solve -w - 4w + 116 = -3p, p + 109 + 31 = 3w - 3p for w. 4 Solve -3k = 169 - 163, 2i = 6k + 10 for i. -1 Solve -3c = 5t + 199, 69c + 262 = -4t - 4093 for t. -2 Solve 4n - 660 = -17v, 2n + 84v - 310 = 76v for n. -5 Solve 2y + 2y + 27 = 24 - 13, -3o - 3y - 2 = 16 for o. -2 Solve 10 = -2c - 3t, -2 + 40 = 2c - 4t - 6t - 4 for c. 1 Solve 178g - 3 = 360g - 183g, -g = -726r + 1449 for r. 2 Solve 0 = -3u + 5w - 108, 13w + 40 - 21 = -3u - 35 for u. -31 Solve 15644z = 2p + 15640z - 62, -p - 2 = z + 18 for p. -3 Solve -6599x - a = -6604x + 34 + 37, -2a = -15a - 1273 + 480 for x. 2 Solve 10v - 5v + 20 = 0, -151k + 28 = -153k - 6v for k. -2 Solve -11p + 5w - 20 = -6p, -5p = -3095w + 3100w for p. -2 Solve 7z - 2a = 6 + 7, 3368a - 1676a + 45 = -5z + 1688a for z. -1 Solve 16 = -2f + 6f, 12s - 6s + 11f - 44 = 0 for s. 0 Solve -18f + 140 = -22f, 3g - 5f - 160 = 0 for g. -5 Solve 4y - 47016 = 2v - 46986, 0 = 6y + 11v - 87 for y. 9 Solve -2s - 196 = -v - 206, 4 = -2v for s. 4 Solve -46f + 42f + 104 = -9c, 0 = f + 3c + 37 for f. -1 Solve 4q = 299b - 295b + 148, b = 11q - 77 for q. 4 Solve 5j - 90 = 79l - 72l, j = -4l - 8 - 1 for l. -5 Solve -10 + 1 = i, -86i + 2 = 5o - 76i - 8i for o. 4 Solve 75 = 4i + 43, 0 = -6d + 7i - 80 for d. -4 Solve -3h - 2a + 20 = 3, 7h + 278261a - 54 + 2 = h + 278266a for h. 7 Solve 4h + 15 - 26 = -5b, -12b + 34 = 2h for h. -1 Solve 0 = p - q + 4, 10599p - 10595p = 2q - 14 for p. -3 Solve -5o + 14886 = -5w + 14991, 3o - 2w + 58 = 0 for o. -16 Solve 3p = -3c + 6, -373p + 734p + 3c - 10 = 357p for p. 4 Solve -3n + n + 100 = -54d + 208, -4d = -n - 2d - 4 for n. 0 Solve -78p + 78p - 4 = 4j, 188p = -3j - 1131 for p. -6 Solve 3c + 203 = -j - 3c + 159, 0 = 2j + 4c + 80 for j. -38 Solve p + 2i - 34 = 0, 2p + 3i = -79405 + 79468 for p. 24 Solve 0 = 12i - a - 45, -a = -3305i + 3302i + 9 for i. 4 Solve -16a - 47 = p, 39a - 41a + 48 = -3p + 157 for p. 33 Solve -38c = -2q - 244, 0 = 5c - 9538q + 9539q - 22 for c. 6 Solve -2b = 25268h - 25270h - 0b - 50, -5h - 149 = 3b for h. -28 Solve -b = -7v + 255 - 113 + 337, 382 = 5v - 14b for v. 68 Solve 3r - 7y + 56 - 10 = -85, 3r - y = 4r - 13 for r. -4 Solve -120 = -2s + 493q - 489q, -4s - 2q = -q + 30 for s. 0 Solve -4616c - 14 = -5a - 4615c, -3a + 2c + 7 = 0 for a. 3 Solve 3x = -2g + 98, 422g - 423g - 127 = -4x for g. 1 Solve -5o - 18l = -240, -2 - 2 + 14 = 2l for o. 30 Solve -f - 14 = -5b + 25 - 44, -44 = -2b + 5f for b. -3 Solve -2n - 1525 = 4k - 1569, -k = -5n + 66 for k. 4 Solve -3i - 5g = -20, 14i + 5g = 189 - 114 for i. 5 Solve b - 11 = -0o - o, 2o - 2b - 9b = -43 for o. 6 Solve 26w + 3o = -47, 36w - 16w - 13o + 15o + 17 = 17w for w. -1 Solve 1192d - 1193d + 18 = -5q - 19, -2d - d = -226q + 2d - 1793 for q. -8 Solve 0 = h + 2c + 132, -872 = -472h - 2c - 1004 for h. 0 Solve 0 = q - 2u - 1, -11830u + 11829u = q + 5 for q. -3 Solve 8 = -w - 4j, 0 = -3w + 2j - 80211 + 80215 for w. 0 Solve 2b - 97 + 53 + 34 = 0, -5c + 90 = 30b for c. -12 Solve 4x - 3m = 2m + 117, 5x - 658 = 3m - 593 for x. -2 Solve 116b - 10 = -2k + 118b, 0 = 2k + k - 35b + 30b - 11 for k. 7 Solve 40087i + 3a + 12 = 40091i, -8*i - 32 = a	{ "pile_set_name": "DM Mathematics" }
(58/7) Simplify (x(-1)xx)*(-48)(x(-2))(-7/3) assuming x is positive. x(-130/3) Simplify (p(-2/15)/ppp)(-3/2) assuming p is positive. p(-13/10) Simplify d*(-1/5)/(dd(-15)) assuming d is positive. d(69/5) Simplify (s/s*(2/3))/(ssss*(2/5)/sss)(ss(-1/8)s)/(s*2s) assuming s is positive. s(-623/120) Simplify (c(2/9)/c)/(cc(3/4))(c*(-1)ccc)/c(2/7) assuming c is positive. c(-205/252) Simplify (c/((c/(c*(-6/7)/c))/c)(c(cc*4/c)/c)/c)/(c(c/c*(-1)c)/c)(-1/47) assuming c is positive. c(726/329) Simplify (gg(-1/4)g/(gg(1/5)gg))/(g(-4/7)/((gg*(-4/5)gg)/g)) assuming g is positive. g(9/28) Simplify (x8/x(-1/5))/(x(1/4))(-10/3) assuming x is positive. x(271/30) Simplify k(2/21)k/(k*(-7)k) assuming k is positive. k*(149/21) Simplify (zz13)/z26 assuming z is positive. z(-12) Simplify n(1/3)(n/n(2/11))/n(n/(n/(n((nnnnn3)/n)/nn)))/nn(2/25) assuming n is positive. n(5141/825) Simplify b/(b27b)bb(27/5) assuming b is positive. b(-103/5) Simplify (u(-9))27 assuming u is positive. u(-243) Simplify (d/d(-3/5))(4/5) assuming d is positive. d(32/25) Simplify (qq0)(-20)/((q(-1)q)/q)34 assuming q is positive. q14 Simplify vv/((v/v6vv)/v)vv(-7)v10/(v/(v(2/7)v)) assuming v is positive. v(72/7) Simplify z(-2/35)/(zzz9z) assuming z is positive. z(-422/35) Simplify (o/o27o)5 assuming o is positive. o(-125) Simplify (jj*(2/17)j)/j*(-5)((j/(jj(-2/7)))/j)(-9/8) assuming j is positive. j(7541/952) Simplify (t3/tt(-3/5)/t)/(t(2/19)/(t*(4/7)tt)) assuming t is positive. t(1906/665) Simplify (((c/((cc/(c*0/cc))/c))/cc)/c)(2/5) assuming c is positive. c(-2/5) Simplify d16/(d/(dddd7)) assuming d is positive. d25 Simplify (m/m11)/(m(-2/39)m) assuming m is positive. m(-427/39) Simplify (n(-7))27 assuming n is positive. n(-189) Simplify (r(-4/3))(2/27) assuming r is positive. r(-8/81) Simplify a(-3)/a(7/10) assuming a is positive. a(-37/10) Simplify v24v(-2/75) assuming v is positive. v(1798/75) Simplify (o(-1/4))(2/43)/(ooo*(-3/5)o9) assuming o is positive. o(-4477/430) Simplify (f(-1/4))(-9/11)/((f*(1/14)f)/f2) assuming f is positive. f(349/308) Simplify ((f/(f/f*(4/9)))/(ff/f*(-2/15)f))/(f(-1/2))(-40) assuming f is positive. f*(-1021/45) Simplify (r/((r/(rr*27rr))/r)r)/((r/r(-20/9))/r) assuming r is positive. r(268/9) Simplify ((b((b(2/5)b)/bb)/b)/bb)*9/(((bbb/((bb*(4/7)bb)/b)b)/bb)/b(5/4)) assuming b is positive. b(1739/140) Simplify u(2/33)/(u(13/2)u) assuming u is positive. u(-491/66) Simplify (k(-13)kk*(-2/21)/kk)(2/5) assuming k is positive. k(-508/105) Simplify (a(-2/3)/a)/(a/a5)(aaaa*1aa)6 assuming a is positive. a(115/3) Simplify (k(-1)k)*(10/11)(k1)(1/10) assuming k is positive. k*(1/10) Simplify (ddd18)(-44) assuming d is positive. d(-880) Simplify (nn(-2))38/(n*(6/5)nnn(-3/4)) assuming n is positive. n(-809/20) Simplify (s*(-3/7)ss(1/6)/s)/((ss(2/3))/((s/(s/(((s/(s(4/11)s))/s)/ss)))/s)) assuming s is positive. s(-661/154) Simplify (i/i2)/i*0(i(-1/3))(-27) assuming i is positive. i8 Simplify (o14/((o(oo/(o/o*(-10)))/o)/oo))20 assuming o is positive. o460 Simplify o*10o/(o/((o*9o)/ooo)) assuming o is positive. o*21 Simplify (((h/(hhh(-4))h)/h)/hh(2/5)/h)/(h(2/9)(h*0h)/h) assuming h is positive. h(53/45) Simplify (q2/qq(-5))(-6/11) assuming q is positive. q(24/11) Simplify (s/(s/s(-9)))/s(-14) assuming s is positive. s5 Simplify (k1k4)(6/31) assuming k is positive. k*(30/31) Simplify (yyy/(y/((yy/y*(2/5)y)/y)))*(3/25)y/(y/(y/(y*(-1)y))y)yy/y2 assuming y is positive. y(54/125) Simplify ((vv2)/v)(-12/7)(v/((v((v*(1/2)v)/v)/v)/v))(-2/69) assuming v is positive. v(-559/161) Simplify o(o(-29)/o)/ooo/o(21/2)o assuming o is positive. o(-75/2) Simplify u(-28)u/u(-8/5) assuming u is positive. u(-127/5) Simplify (x0)(6/5)/(x(2/3))(-2/31) assuming x is positive. x(4/93) Simplify ((x1)(-6/17))31 assuming x is positive. x(-186/17) Simplify u/(u(-1/10)u)u(((uu(u/u*(6/7))/u)/u)/uu)/uu assuming u is positive. u(87/70) Simplify j/(j(-10)/j)j(2/47) assuming j is positive. j(566/47) Simplify (xx(2/37))(1/31) assuming x is positive. x(39/1147) Simplify (l(-2)l/(lll*(2/5)l)l)/((l/l(-1/2))/(ll5)) assuming l is positive. l(11/10) Simplify (q*(-22)/q)/qq/q(4/7) assuming q is positive. q(-165/7) Simplify ((j*(-1/2)j)/(jj/j(-1/2)))19 assuming j is positive. j(-38) Simplify y20/y26 assuming y is positive. y(-6) Simplify (p1)(1/20)/(((pp(-3/5))/p)/(p0/p)) assuming p is positive. p(-7/20) Simplify ((m(2/7)/m)39)(12/5) assuming m is positive. m(-468/7) Simplify ((u/u(1/3))/(u/(u/(uu/(u1u)))u))(2/25) assuming u is positive. u(-2/75) Simplify x(-7)xxx*7(x/(x/(xx(1/3))))26 assuming x is positive. x(110/3) Simplify ((tttt(-3))/t(3/5))/(t*3t(2/13)) assuming t is positive. t(-244/65) Simplify ((a*5a)/a)27 assuming a is positive. a135 Simplify q/(qq/(q(-4)/q)qq)q/(qqq*(6/5)qq) assuming q is positive. q(-61/5) Simplify (m0/(m3m))(2/39) assuming m is positive. m(-8/39) Simplify ((v/((((vv(5/3))/v)/v)/v))/vv(-2/9))/((v/(v/v(-4)))/vv(2/5)) assuming v is positive. v(212/45) Simplify (o/o(-3)o/(o*(-2/21)o))/(o(-1/2)/(o/(o(7/2)o)o)) assuming o is positive. o(44/21) Simplify (p(-2)pp*6pp)/(p0p)(-1/16) assuming p is positive. p(113/16) Simplify ((bb0)/bb)*(13/2)b*(1/5)b*6b assuming b is positive. b*(137/10) Simplify pp/(pp(-3)p)pp(p/p(7/5))/pp*(-7)ppppp*(-5)ppp assuming p is positive. p(-7/5) Simplify w22(w/w(-3)w)/ww assuming w is positive. w27 Simplify ((i/(ii/(ii/i(-1/2))))/ii)*(3/4)(ii/i(2/5)i)(-2/15) assuming i is positive. i(467/600) Simplify (u/(u/(((u*(2/3)u)/u)/u)))14/(u0u(3/8)) assuming u is positive. u(-121/24) Simplify (x(2/5))49 assuming x is positive. x(98/5) Simplify ((jj10/j)/(j/j(-15/7)j))(-1/23) assuming j is positive. j(-41/161) Simplify ((p/(pp*(-1/6)pp)p)(3/8))(2/99) assuming p is positive. p(-5/792) Simplify ((g(-6)/g)/g)/(g/g*(-1))(gg/g(-1)g)3 assuming g is positive. g2 Simplify ((r/(r((r9/rr)/r)/r))/r)/r(7/2) assuming r is positive. r(-23/2) Simplify (a/a*(2/7)aaa)*(-42)(a0)(1/9) assuming a is positive. a(-156) Simplify j(8/5)/(j/(jj(2/37)j)) assuming j is positive. j(491/185) Simplify u(-9/2)/u(u/((u/(u(u/u*(-17))/u)u)/u))/u assuming u is positive. u(23/2) Simplify i(-29)i/i(2/17) assuming i is positive. i(-478/17) Simplify (w/(w/(((w(-22)/w)/w)/w)))/(w/(w/w(5/9))) assuming w is positive. w(-230/9) Simplify (d/d5d)/ddd(1/13) assuming d is positive. d(-38/13) Simplify h*(-2/11)hh(-1/3)/hh(-1/2)/h6 assuming h is positive. h(-463/66) Simplify (y(4/7)/(y*5y))32 assuming y is positive. y(-1216/7) Simplify (o/(o/(o*(1/4)/ooo)))(-46)(oo/o1)/(oo/(o/(o/(o0/o)))) assuming o is positive. o(-119/2) Simplify ((r*(1/4)r)(-2/19))(1/43) assuming r is positive. r(-5/1634) Simplify (h/h(-2))/h(h(-2)h)/hh(h(-1))44 assuming h is positive. h(-43) Simplify p34/(p/(p*(-2)p)) assuming p is positive. p32 Simplify (r3rrrr*(-4)r)/((r/(rr(1/6)))/r(-3/8)) assuming r is positive. r(67/24) Simplify y(-17)((yy5yy)/y)/y assuming y is positive. y(-11) Simplify ((r0/r)(-43))(-22/9) assuming r is positive. r(-946/9) Simplify (zz/((zz/z11zz)/zz)z)(-40/3) assuming z is positive. z(-400/3) Simplify (y2/y)/(y(yy(-4/3))/y)y2/(y(-5)/y) assuming y is positive. y(28/3) Simplify (v/v(-23))/(v/v21) assuming v is positive. v44 Simplify ((((g/(gg2gg))/g)/gg)/g)42 assuming g is positive. g(-252) Simplify (n(-2/13)/n(-7))/((n/(n**(-7)/n))/(	{ "pile_set_name": "DM Mathematics" }
What is the m'th term of 23716, 98615, 224696, 401959? 25591m2 - 1874m - 1 What is the n'th term of -61263, -80704, -100145, -119586, -139027? -19441n - 41822 What is the p'th term of -823, -948, -747, -58, 1281, 3432? 27p3 + p2 - 317p - 534 What is the s'th term of 83814, 83724, 83472, 82974, 82146, 80904, 79164, 76842? -14s*3 + 3s*2 - s + 83826 What is the m'th term of -17037, -68671, -154899, -275721, -431137? -17297m*2 + 257m + 3 What is the x'th term of 13189, 52402, 117635, 208888, 326161, 469454? 13010x2 + 183x - 4 What is the d'th term of 17474, 34934, 52380, 69812, 87230, 104634, 122024? -7d2 + 17481d What is the g'th term of -1818393, -1818390, -1818387? 3g - 1818396 What is the u'th term of 6094, 2130, -4478, -13730, -25626? -1322u*2 + 2u + 7414 What is the z'th term of 36637, 73166, 109695, 146224? 36529z + 108 What is the l'th term of 1577, 3030, 4377, 5612, 6729, 7722, 8585, 9312? -l3 - 47l*2 + 1601l + 24 What is the d'th term of 74514787, 74514786, 74514785, 74514784, 74514783, 74514782? -d + 74514788 What is the x'th term of 8151, 17404, 26657, 35910, 45163, 54416? 9253x - 1102 What is the u'th term of -11157, -7134, -3111, 912, 4935, 8958? 4023u - 15180 What is the z'th term of -17732, -12474, -7216, -1958, 3300, 8558? 5258z - 22990 What is the u'th term of 132220, 130920, 129620? -1300u + 133520 What is the q'th term of -4727582, -18910340, -42548268, -75641366, -118189634? -4727585q2 - 3q + 6 What is the y'th term of 1207007, 2413927, 3620847, 4827767, 6034687, 7241607? 1206920y + 87 What is the z'th term of 1032121, 2064259, 3096395, 4128529? -z2 + 1032141z - 19 What is the w'th term of 39745, 39740, 39733, 39724, 39713? -w*2 - 2w + 39748 What is the t'th term of 594765, 594639, 594513, 594387, 594261, 594135? -126t + 594891 What is the x'th term of -4884, -13635, -22386, -31137, -39888, -48639? -8751x + 3867 What is the l'th term of 5205, 5388, 5611, 5874? 20l2 + 123l + 5062 What is the q'th term of 8661, 8680, 8729, 8826, 8989, 9236, 9585, 10054? 3q3 - 3q*2 + 7q + 8654 What is the j'th term of -830, -6503, -21906, -51905, -101366, -175155, -278138, -415181? -811j3 + j2 + j - 21 What is the f'th term of -49937, -49807, -49597, -49313, -48961, -48547? -f3 + 46f*2 - f - 49981 What is the k'th term of -13421, -53896, -121349, -215780, -337189? -13489k*2 - 8k + 76 What is the b'th term of 32501, 32559, 32611, 32657, 32697, 32731? -3b2 + 67b + 32437 What is the p'th term of -37988, -76079, -114232, -152441, -190700, -229003, -267344? p*3 - 37p*2 - 37987p + 35 What is the t'th term of 334329, 1337298, 3008927, 5349228, 8358213? 2t3 + 334318t*2 + t + 8 What is the y'th term of -8950865, -8950879, -8950919, -8950997, -8951125, -8951315, -8951579, -8951929? -2y3 - y2 + 3y - 8950865 What is the j'th term of -1128146, -1128145, -1128144, -1128143, -1128142? j - 1128147 What is the c'th term of 54443790, 108887581, 163331372, 217775163, 272218954, 326662745? 54443791c - 1 What is the u'th term of -421134, -421149, -421164, -421179? -15u - 421119 What is the r'th term of -57780, -230883, -519352, -923187? -57683r*2 - 54r - 43 What is the k'th term of 38019161, 38019157, 38019153, 38019149, 38019145? -4k + 38019165 What is the b'th term of 19850, 20017, 20294, 20681, 21178, 21785? 55b*2 + 2b + 19793 What is the b'th term of 12650, 13661, 15346, 17705, 20738, 24445? 337b2 + 12313 What is the g'th term of 66309, 132714, 199137, 265578, 332037? 9g*2 + 66378g - 78 What is the z'th term of 9095, 36247, 81425, 144629, 225859? 9013z2 + 113z - 31 What is the v'th term of 31523, 32262, 33495, 35222, 37443? 247v2 - 2v + 31278 What is the a'th term of -75863, -103286, -130723, -158180, -185663, -213178? -a3 - a2 - 27413a - 48448 What is the d'th term of -6975045, -27900337, -62775817, -111601479, -174377317? d3 - 6975100d*2 + d + 53 What is the a'th term of 7286749, 14573544, 21860339, 29147134? 7286795a - 46 What is the d'th term of -770808, -6166455, -20811784, -49331637, -96350856, -166494283? -770807d3 + d2 - d - 1 What is the s'th term of -455061, -910231, -1365401? -455170s + 109 What is the x'th term of 24369068, 24369063, 24369056, 24369047, 24369036, 24369023, 24369008? -x*2 - 2x + 24369071 What is the p'th term of 950, 1676, 2888, 4586, 6770, 9440? 243p2 - 3p + 710 What is the w'th term of -571, -2047, -4353, -7423, -11191, -15591, -20557, -26023? 11w3 - 481w*2 - 110w + 9 What is the m'th term of 167818, 335727, 503636? 167909m - 91 What is the h'th term of -1481546, -2963280, -4445014, -5926748, -7408482? -1481734h + 188 What is the w'th term of 183358, 369146, 554936, 740728, 926522, 1112318, 1298116? w*2 + 185785w - 2428 What is the r'th term of 32504, 32526, 32560, 32612, 32688, 32794, 32936? r*3 + 15r + 32488 What is the d'th term of -545, -192, 837, 2878, 6267, 11340, 18433, 27882? 56d3 + 2d*2 - 45d - 558 What is the a'th term of 3060, 12482, 28832, 52668, 84548, 125030, 174672, 234032? 93a3 + 2906a*2 + 53a + 8 What is the m'th term of 290397, 1161603, 2613577, 4646289, 7259709, 10453807? -5m3 + 290414m*2 - m - 11 What is the c'th term of -336, -507, -506, -321, 60? 2c*3 + 74c*2 - 407c - 5 What is the j'th term of 160136, 640613, 1441426, 2562575, 4004060? 160168j2 - 27j - 5 What is the z'th term of -39348, -83241, -127134, -171027, -214920, -258813? -43893z + 4545 What is the p'th term of 15941, 31754, 47553, 63332, 79085, 94806? -p3 - p2 + 15823p + 120 What is the i'th term of 37694, 37571, 37426, 37253, 37046, 36799? -i*3 - 5i*2 - 101i + 37801 What is the q'th term of 1548, 3132, 4770, 6462, 8208, 10008? 27q2 + 1503q + 18 What is the l'th term of -1825, -11684, -38365, -90280, -175841, -303460? -1402l3 + l2 - 48l - 376 What is the u'th term of -88676, -354638, -797892, -1418438, -2216276, -3191406? -88646u2 - 24u - 6 What is the x'th term of -1697, -2372, -3047, -3722? -675x - 1022 What is the s'th term of -293, -1174, -2523, -4244, -6241, -8418? 16s*3 - 330s*2 - 3s + 24 What is the p'th term of -488045, -976096, -1464147, -1952198, -2440249, -2928300? -488051p + 6 What is the q'th term of 17547, 69851, 157017, 279039, 435911? -q3 + 17437q*2 + 111 What is the y'th term of -21696, -22253, -23180, -24477? -185y*2 - 2y - 21509 What is the o'th term of 437, 1690, 3851, 6992, 11185, 16502, 23015? 12o3 + 382o*2 + 23o + 20 What is the a'th term of 226, 800, 1728, 2992, 4574, 6456, 8620, 11048? -3a3 + 195a*2 + 10a + 24 What is the q'th term of -375, -310, -225, -126, -19, 90? -q*3 + 16q*2 + 24q - 414 What is the k'th term of -43870, -175600, -395180, -702610, -1097890? -43925k2 + 45k + 10 What is the i'th term of -139132, -556487, -1252070, -2225887, -3477944, -5008247? -i*3 - 139108i*2 - 24i + 1 What is the s'th term of 5905, 11624, 16995, 21856, 26045, 29400, 31759? -27s3 - 12s*2 + 5944s What is the j'th term of 981, 8136, 27591, 65496, 128001, 221256, 351411? 1025j3 - 20j - 24 What is the v'th term of 17871851, 35743708, 53615589, 71487506, 89359471? 2v3 + 17871843v + 6 What is the f'th term of -8500244, -8500250, -8500256, -8500262, -8500268? -6f - 8500238 What is the d'th term of -3024776, -3024720, -3024664, -3024608, -3024552, -3024496? 56d - 3024832 What is the w'th term of 448, 1989, 6196, 14407, 27960, 48193, 76444, 114051? 223w3 - 5w*2 - 5w + 235 What is the j'th term of 198426528, 396853054, 595279576, 793706094? -2j2 + 198426532j - 2 What is the j'th term of -31480, -31456, -31428, -31396? 2j2 + 18j - 31500 What is the q'th term of -12678, -12747, -12836, -12945, -13074, -13223, -13392? -10q2 - 39q - 12629 What is the q'th term of 13040972, 26081949, 39122926? 13040977q - 5 What is the w'th term of -572, -2254, -5070, -9014, -14080? w3 - 573w*2 + 30w - 30 What is the y'th term of -9662430, -19324877, -28987324, -38649771? -9662447y + 17 What is the j'th term of -2465, -7569, -15315, -25697, -38709? j3 - 1327j*2 - 1130j - 9 What is the c'th term of -21962, -21451, -20940, -20429? 511*c - 22473 What is the l'th term of 639069, 639103, 639205	{ "pile_set_name": "DM Mathematics" }
to the nearest 10. 30 Let n = 812 + -811.99999193. What is n rounded to six dps? 0.000008 Let m(z) = -121670z + 40. Let j be m(12). Round j to the nearest 100000. -1500000 Let v = 274 - 273.99999766. Round v to 6 decimal places. 0.000002 Let w = 9409524 + -9409677.896524. Let g = -2.893604 - w. Let z = g + -151. Round z to four dps. 0.0029 Suppose 5w - 4875 = -5h, -5h + 3205 = -5w - 1700. Round h to the nearest 100. 1000 Let m = 3.264 - 68.624. What is m rounded to the nearest ten? -70 Let x = 10 - 12. Let k = x - -5. Let d = -17 - k. Round d to the nearest ten. -20 Let j = -279926 + 279923.60102. Let p = 2.09 - -0.31. Let r = p + j. What is r rounded to 4 decimal places? 0.001 Let x = -252.3045 - -252. What is x rounded to 2 decimal places? -0.3 Let v = 1176.2 - 1180. Let x = -7209909 - -7209905.2000308. Let o = x - v. What is o rounded to 6 dps? 0.000031 Let i be 2/(12/109) - (-5)/(-30). Suppose 19p = ip + 48. What is p rounded to the nearest ten? 50 Let t = -243468.038 - -243728. Let z = 261 - t. Round z to 1 dp. 1 Let t = -0.053 - 0.177. Let f = -3.93 - -4.41. Let k = t + f. Round k to 2 dps. 0.25 Let f(a) = 4550000a*3 - 3a - 2. Let w be f(-1). Let p = w - -7729999. Round p to the nearest 1000000. 3000000 Let x(g) = g*3 + 11g*2 - 12g - 14. Let f be x(-12). Let u be 105/((-2)/f10/(-40)). Round u to the nearest one thousand. -3000 Let r be -8 + -106984 + 1 + -9. What is r rounded to the nearest 100000? -100000 Let f = -110244060.1188083 - -46161446.51880849. Let c = -64082609 - f. Let w = 4.6 - c. What is w rounded to seven decimal places? 0.0000002 Let w = -71350 + 40050. Round w to the nearest one thousand. -31000 Let r(z) = 83z - 13. Let m be r(2). Let g be (3 - m)/(3/36000-2). What is g rounded to the nearest 1000000? 1000000 Let l = 5438 - 5438.2341. What is l rounded to 3 dps? -0.234 Suppose -2x = -3s + 801006, 2s - s + 3x - 266991 = 0. What is s rounded to the nearest 10000? 270000 Suppose 0 = -m - 28816214 - 7093786. What is m rounded to the nearest 1000000? -36000000 Let f = 0.9 - 0.7. Let r = 23 + f. What is r rounded to 0 dps? 23 Let f = -626.3 + 582. Round f to the nearest 10. -40 Let a(z) = -22z*3 - 8z*2 - 8z - 10. Let f be a(-7). Round f to the nearest 10000. 10000 Let p = 0.16206252 - -7.33793128. Let w = 7.5 - p. Round w to six dps. 0.000006 Let c = -411058042241799461.00000022 - -411058038155719170. Let t = 4086080327 + c. Let d = t - 36. Round d to 7 dps. -0.0000002 Let x = 1661 + -364. Round x to the nearest 100. 1300 Let h = -2156.1195 + 2109.12. Let a = -47 - h. What is a rounded to four decimal places? -0.0005 Let q be -9(40/12 + -2). Let m be 268/24 + 2/q. Suppose 13g - 12800000 = mg. What is g rounded to the nearest 1000000? 6000000 Let q = 112 + -112.008888. Round q to four dps. -0.0089 Let h = 127.822 - 152.8144. Let k = -25 - h. Let s = k + -2.7824. What is s rounded to one decimal place? -2.8 Let w(d) = 2d - 20. Let g be w(12). Suppose 0 = -ga + 3a. Suppose a = 3n + 2h - 4h + 1290006, 2n = -3h - 859991. Round n to the nearest 100000. -400000 Let g be 123300/137(0 - (-2020)/(-6)). What is g rounded to the nearest 100000? -300000 Suppose -10m = -6m. Suppose t - 2 = 2k + 2k, m = -2k. Let f be (876/(-18))/(t/(-6)). What is f rounded to the nearest 10? 150 Suppose 5x + 2i = x + 8560882, -2i - 8560894 = -4x. Suppose -x = -3r - 481222. Round r to the nearest ten thousand. 550000 Let s(d) = -d3 - d2 + d - 1. Let w(o) = 593o3 + 5o*2 - 6o + 4. Let u(x) = 6s(x) + w(x). Let v be u(2). Let p = v + 6610. Round p to the nearest 1000. 11000 Let l = -37.91 - -41.2. Let a = l + -0.47. Round a to zero dps. 3 Let r = 8360.08561 + -8360. Round r to three dps. 0.086 Suppose -53760 = 22m - 30m. What is m rounded to the nearest 1000? 7000 Let u = 1.93000169 + -1.93. What is u rounded to 7 decimal places? 0.0000017 Let u(w) = w3 + 4w*2 - 6w + 1. Let a be u(-5). Let c(x) = 57871x3 - 2x*2 - 11x + 2. Let h be c(a). Round h to the nearest one million. 13000000 Let y(w) = -w*2 - 19w - 12. Let x be y(-16). Suppose -1246 = -5c - 2s, -4c = -3s - x - 947. Let k = c - -972. What is k rounded to the nearest 100? 1200 Suppose i + 2o = 4o - 2093, -6244 = 3i + o. What is i rounded to the nearest one hundred? -2100 Let y = -46.035769987 + 0.035791987. Let s = 46 + y. Round s to five dps. 0.00002 Let p = 17 + -10. Let i be p/(63/(-480))600. Round i to the nearest 10000. -30000 Suppose -9h = -18h + 346499955. Suppose 5l = 3z + 2z + h, -5l = -3z - 38499997. Round l to the nearest one million. 8000000 Let i = -85756860.99999865 - -85756856. Let u = i - -5. What is u rounded to 7 decimal places? 0.0000014 Suppose -2u = n - u - 22674606, -n + 5u + 22674600 = 0. Suppose -3l = 3h - 27900009, -4h + n = -l - 14525392. Round h to the nearest one million. 9000000 Suppose -6v + 7535 = -2287. What is v rounded to the nearest one hundred? 1600 Let h = -328.607 - -328.64099805. Let v = -0.04 + 0.074. Let r = h - v. Round r to seven decimal places. -0.000002 Let k = 13466 + -14981.1. What is k rounded to the nearest one hundred? -1500 Let q be (-21684)/(-8)(-4)/3. What is q rounded to the nearest 100? -3600 Let b = -234.288 + 259.13. Let f = -25 + b. Round f to 2 dps. -0.16 Let n = 39 - 23. Let p = 16.00031 - n. Round p to 4 decimal places. 0.0003 Suppose -3w + 15 = 0, -z - w + 43 = z. Suppose 0 = -18h + zh + 2090. What is h rounded to the nearest one hundred? -2100 Let g = 100.851 + -101. Round g to 2 decimal places. -0.15 Let w = -0.5525 + 67.8225. Let v = w + -67. Let l = 0.48 - v. What is l rounded to 1 dp? 0.2 Let r = -0.44937812 - 325.73179088. Let q = -0.805531 + r. Let x = -327 - q. Round x to 3 decimal places. -0.013 Let t(p) = 3748p + 29. Let v be t(14). Let m be (-45006)/(-5) - (-2)/(-10). Suppose -5l - v = -h, -1495 = l + 4h + m. Round l to the nearest 1000. -11000 Let v = 139566 + -139710.706. Let w = v - -145. Let i = w + -0.3178. What is i rounded to three dps? -0.024 Let x = 1592 + -1591.998092. Round x to 5 dps. 0.00191 Let o = -6.0511 + 0.0211. Round o to one decimal place. -6 Let u = -1859.9993743 + 1860. Round u to four dps. 0.0006 Let d = 222.00000406 - 222. What is d rounded to 6 dps? 0.000004 Let t be (6250/20)/(2 - (-104061)/(-52032)). Round t to the nearest one hundred thousand. 5400000 Let q(n) = -35631n2 - 74n + 5. Let i be q(51). Round i to the nearest 1000000. -93000000 Suppose 0m + 4m = -2f - 10, -3f + 2m + 17 = 0. Suppose -5y = -2q - 29500, -2y + 12264 = fq + 464. Round y to the nearest 1000. 6000 Suppose i = 2t - i + 1667990, 2t + 1667995 = i. Round t to the nearest ten thousand. -830000 Let k = -187.000000805 - -187. What is k rounded to six dps? -0.000001 Let o = 125 - 124.47. Let a = 0.530039 - o. Round a to five dps. 0.00004 Let p be 43/(-18)-195. What is p rounded to the nearest one hundred? 100 Let k = -19 + 22. Let o = k + -9. Let a = o - -6.0000076. Round a to six decimal places. 0.000008 Let l = 208.9998872 + -209. What is l rounded to five dps? -0.00011 Let a = -2770.9159 - -2771. Round a to three dps. 0.084 Let z = -11 + 14. Suppose -zl = -9l - 75600. Round l to the nearest 1000. -13000 Let a be (10/8)/(2/48). Suppose -a = s + 4s. Let l be ((-60)/s)/(1/580). Round l to the nearest one thousand. 6000 Let f = 179.144 + -0.144. Let q = f + -179.146. Round q to two dps. -0.15 Let u(l) = l*3 + 21l*2 - 26l + 4. Let y be u(-21). What is y rounded to the nearest 100? 600 Let k = -28828 + 28839.993. Let u = 12 - k. What is u rounded to 2 dps? 0.01 Let y = 584 + -582.13. What is y rounded to one dp? 1.9 Let v(t) = 54t2 + 4t + 6. Suppose -19 = 2h - 7. Let m be v(h). Suppose -2n + m = -734. What is n rounded to the nearest one hundred? 1300 Let u = -143 + 142.99999869. What is u rounded to 7 dps? -0.0000013 Let b(u) = 2u2 - 3u + 2. Let l be b(2). Suppose 0 = 2k - 4n - n + 7125, lk - 4n + 14244 = 0. Round k to the nearest 100. -3600 Let q = 145 + -172. Let j = 16.382 + 10.6274. Let f = j + q. What is f rounded to three dps? 0.009 Let b = 0.574 - 15.724. Round b to 0 decimal places. -15 Let n = 147.509926 - 147.58. Let r = -4.07 + 4. Let t = r - n. What is t rounded to 5 dps? 0.00007 Let w = -0.459	{ "pile_set_name": "DM Mathematics" }
Calculate the remainder when 440 is divided by s. 20 Let t = -433 - -511. What is the remainder when t is divided by 9? 6 Let c(a) be the first derivative of -a*4/4 - 3a*3 - 4a*2 + 2a + 3. What is the remainder when (0 + 2)18/12 is divided by c(-8)? 1 Suppose 0 = -5i - 3n + n + 147, -3i - 4n = -91. Let r = i + -32. Calculate the remainder when 110 is divided by 168/(-70)20/r. 14 Suppose 0 = -5p - u + 10, -p - 2u = -3u - 8. Suppose 17 = -pd - 4. Let k(h) = -h + 4. What is the remainder when 30 is divided by k(d)? 8 Let j(t) = -12t - 2. Let u(y) = 3y*2 + 27y + 154. Let a be u(-7). Suppose 0 = -13k + a + 356. What is the remainder when j(-6) is divided by k? 34 What is the remainder when 3501 is divided by 3250/(-3900) + 19/(-12)-22? 33 Let j = 7998 + -6261. Calculate the remainder when j is divided by 569. 30 Let z(d) = 48d2 - 33d + 86. Calculate the remainder when z(6) is divided by 81. 77 Calculate the remainder when 10 - -60(-7 + (-115)/(-10)) is divided by 9. 1 Let q = -536531 + 536552. Calculate the remainder when (292/(-3))/(2/(-9)) is divided by q. 18 Let m = 619 - 590. Suppose 0 = -30a + ma + 12. Calculate the remainder when 23 is divided by a. 11 Suppose -x + 161 = -0g + 3g, 5g + 745 = 5x. Let j be 1/(-8 + (-453)/(-57)). Let l(n) = n2 + 26n + 164. What is the remainder when x is divided by l(j)? 28 Suppose -3d = -4u - 668, 1090 = 5d - 54u + 52u. Calculate the remainder when 906 is divided by d. 42 Let z = -4944 - -5087. What is the remainder when z is divided by 97? 46 Let f = -143 + 163. Suppose 14 = -fc + 21c. What is the remainder when c is divided by 13? 1 Let x = 114 - 82. Let c = x + 58. Suppose 9l - c = 162. What is the remainder when 108 is divided by l? 24 Let i = -33137 - -33345. What is the remainder when i is divided by (-3)/9 - (-106)/3? 33 Suppose k + 23 = 91. Let z = 70 - k. Suppose -4q + 371 = -3n, q + zq - 5n - 270 = 0. What is the remainder when q is divided by 14? 11 Let w = -129 + 134. Suppose 0 = -y + 4f + 49, 28 = wy - 3f - 268. Calculate the remainder when y is divided by 5. 1 Let f = 7 + -3. What is the remainder when 431/13 - 14/91 is divided by 9/(-12) + 55/f? 7 Let c = 0 + 78. Let k be (-955)/(-6) + (-13)/c. Suppose -4p + k = 2z + 49, -p + 3 = 0. Calculate the remainder when 93 is divided by z. 44 Calculate the remainder when 48429/19 - (4576/(-152) + 30) is divided by 151. 133 Calculate the remainder when (101234/70 + 7)60/9 is divided by 95. 93 Suppose 5b - r - 1503 = 1927, -695 = -b + 2r. Calculate the remainder when b is divided by 225. 10 Let x = -344 + 235. Let l = -65 - x. Calculate the remainder when 128 is divided by l. 40 Let r(b) = -44b - 79. Let i be r(-2). Suppose im = -0m + 63. Let z = -47 - -80. Calculate the remainder when z is divided by m. 5 Let c = -450 - -482. Suppose cj - 175 - 49 = 0. Let z = 126 + -43. What is the remainder when z is divided by j? 6 Let o = 72 + -55. Let y(j) = -j*2 + 17 + 3j*2 - oj + 3j2. Calculate the remainder when y(7) is divided by 36. 35 What is the remainder when (264/5)/((-72)/(-180)) is divided by 80? 52 Let t(h) be the first derivative of -h4/4 + 8h*3/3 - 6h*2 + 20h + 35. Let o be t(8). Let s = o + 94. Calculate the remainder when s is divided by 5. 3 Suppose 4m - 15 = 5. Let k(b) = -3b + 29. Let p be k(8). Suppose 72 = 2i - 5h, ph + 7 = -5i + 117. What is the remainder when i is divided by m? 1 Let k = -4577 - -4771. What is the remainder when k is divided by 188? 6 Suppose 11211 = -115c + 42376. Calculate the remainder when c is divided by 46. 41 Suppose 54756 = -30l + 143l + 225l. Calculate the remainder when l is divided by 36. 18 Suppose -4k - 5 = 3f, -k + 9 = 5f - 3k. Let y = -18425 - -18432. What is the remainder when f27 - 6/(-2) is divided by y? 2 Let i(x) = -x3 - 40x*2 - 234x + 44. Calculate the remainder when 260 is divided by i(-33). 117 Suppose 80k - 6592 + 832 = 0. What is the remainder when k is divided by 19? 15 Let j = 434 + -302. Suppose 0 = -5t + 3c - 4c + 174, c = 4t - j. Suppose 0 = 2l + 3l - 60. What is the remainder when t is divided by l? 10 Let f(r) = 202r + 330. Calculate the remainder when f(10) is divided by 16. 14 Let x(a) = -8a + 9a*2 + 2a3 + 3 + 0 - a3 - 4. Let k = -10012 - -10027. Calculate the remainder when x(-9) is divided by k. 11 Let t(p) = -21p + 100. Let g(j) = 22j - 101. Let s(m) = -2g(m) - 3t(m). What is the remainder when s(9) is divided by 39? 34 Suppose 125 = z + d, 84 = -5z - 4d + 714. Calculate the remainder when 517 is divided by z. 127 Let l = 1864 - 997. Let u = 1024 - l. Let t(b) = b*3 + 7b*2 - 4. What is the remainder when u is divided by t(-3)? 29 Suppose -6z + 789 - 789 = 0. What is the remainder when 40/(-24)-201 - z is divided by 17? 12 Suppose -2961 = -4a - 3n + 1520, 5605 = 5a + 5n. Calculate the remainder when a is divided by 35. 33 Suppose 109183w = 109173w + 420. Calculate the remainder when 1805 is divided by w. 41 Let g = 6986 - 6302. What is the remainder when 2056 is divided by g? 4 Suppose -4j = -812 - 2544. Suppose -528r - 120 = -538r. Calculate the remainder when j is divided by r. 11 Let g(o) = 11o2 - 41o - 39. Calculate the remainder when 1136/6 - (-2)/3 is divided by g(-1). 8 Let s = 110 - 88. Let j = 441 + -348. Calculate the remainder when j is divided by s. 5 Suppose -9607g - 9608g - 894 = -19221g. Calculate the remainder when g is divided by (-1)/2 + 93/6. 14 Suppose 5a = 4u - 5442, -5u + a + 1504 = -5288. What is the remainder when u is divided by 80? 78 Let l(w) = 13w - 10. Let i = 52 - 47. Let s be l(i). Suppose -7j + 71 = -s. What is the remainder when 89 is divided by j? 17 Suppose 0 = 8z + 49 - 273. Suppose -3m + 8 = -z. What is the remainder when 70 is divided by m? 10 Let s = 878 + -870. Suppose sb = 2b + 1092. Calculate the remainder when b is divided by 47. 41 Suppose -2s - 12w + 10w + 14 = 0, -2w = s - 9. What is the remainder when ((-159)/9)/(((-10)/12)/s) is divided by 54? 52 Let w be (3595/(-10))/(5/(-10)). Suppose 5a - w = a - o, -2a = 3o - 357. Suppose -a = -7u + 2u. Calculate the remainder when u is divided by 20. 16 Let u = 10891 + -10872. What is the remainder when 121 is divided by u? 7 Suppose 0 = o - 2f - 54, -4o + 30f = 26f - 192. What is the remainder when 1714 is divided by o? 34 Suppose 10c + 0c = 2c + 14528. Calculate the remainder when c is divided by 70. 66 Suppose 4u + 0u + 886 = 2g, 4g + 4u - 1772 = 0. Suppose -3m + 4i + 68 = 0, -404i = -5m - 407i + 65. What is the remainder when g is divided by m? 11 Let h(s) = s*3 - 8s*2 - 7s + 8. Let r be h(5). Let q = r - -92. Let p(m) = m*3 + 11m*2 + 7m + 6. Calculate the remainder when p(q) is divided by 13. 10 Suppose -s = 6u - 8u + 11, 57 = -4s - 5u. Let f = 219 + s. Calculate the remainder when f is divided by 26. 24 What is the remainder when (734/8)/((-39)/(-156)) is divided by 162? 43 Let r = -245 + 395. Suppose -5h - 81 = -g, 0 = 2g + 4h - 0h - 148. Suppose 152 = 80m - gm. Calculate the remainder when r is divided by m. 36 Let x(t) = t*3 - 59t*2 + 414t - 176. Calculate the remainder when 909 is divided by x(51). 129 Let i(a) = -a*3 + 12a*2 - 2a + 49. Let v be i(11). Suppose -h + 8 = h, v = 4n - 2h. Calculate the remainder when 230 is divided by n. 35 Let a = -462 + 39. Let b = -389 - a. What is the remainder when b is divided by 12? 10 Suppose 0 = 105d - 13d - 184. What is the remainder when 92 is divided by d? 0 Calculate the remainder when 253 is divided by (136/(-204))/(2/(-159)). 41 Let t = 971 - 915. Let w be ((-2)/8)/((-1)/20). Suppose -5u + 10 = -w. Calculate the remainder when t is divided by u. 2 Suppose -3y + y - 5p - 15 = 0, 0 = -2y - 2p. Suppose 4x = 5x - 2d, yd - 25 = 0. Calculate the remainder when x is divided by 4. 2 Suppose -4747l - 4445 = -4760l - 103. What is the remainder when l is divided by 21? 19 What is the remainder when (4/6(-6)/(-12))/((-2)/(-372)) is divided by 36? 26 Suppose 91r + 15 = 96r - 3s, 4r = 5s + 12. Suppose 16w - 174 = -5p + 13w, -42 = -p - rw. Calculate the remainder when p is divided by 6. 3 Suppose -13 = -9r - 67. What is the remainder when 212	{ "pile_set_name": "DM Mathematics" }
ond derivative of -2r3 + 20r - 29r2 + xr*3 + 5r*2 wrt r. -12r - 48 Let f(d) be the second derivative of 589d4/12 - 581d*3/6 + d - 21. What is the second derivative of f(r) wrt r? 1178 Suppose 4o - 9 = -1. Suppose 4v - 5x - 12 = -x, -ox = -5v + 12. What is the second derivative of -c - 4c5 + vc*5 - c + 9c wrt c? -40c3 Let h be ((-2)/3)/((-1)/3). What is the second derivative of 11u - 3u + 27u*h - 23u*2 - u wrt u? 8 Let p(k) be the first derivative of 5k*4/4 + 3k*2/2 - 51k - 70. Differentiate p(w) with respect to w. 15w2 + 3 Suppose 0b + 5b + 16 = -4r, -3b - 11 = r. Let q be (1 - 8/b) + 1. What is the second derivative of qs*2 - 3s + s + s*2 + 0s wrt s? 10 Suppose -2u - 81 = -91. Find the third derivative of -31v*4 + 3v*2 + 55v*4 - uv*2 wrt v. 576v Let p = 5 - 1. Let d(l) be the second derivative of -1/12lp + 8l - l*2 + 0 + 0l*3. Differentiate d(j) with respect to j. -2j Let k = 41 - 39. Differentiate 5v2 - 2v*2 - 20 - 4v*2 - kv*2 with respect to v. -6v Let f(s) be the second derivative of 0s2 - 7/12s*4 + 0s*3 + 3/20s*5 + 11s + 0. What is the third derivative of f(v) wrt v? 18 Suppose 2j - j = -l + 2, 4l = 4j + 24. Let n(f) = -f3 + 4f + 3. Let x be n(j). What is the second derivative of -4k - 6k*x + 11k*3 + 5k wrt k? 30k Let k(a) = 12a*4 - 5a*3 - 290a*2 - 5a. Let q(p) = p4 - p3 - p*2 - p. Let l(u) = k(u) - 5q(u). Find the third derivative of l(f) wrt f. 168f Let m(h) be the first derivative of -37 + 1/2h*4 + 0h*3 - 52h + 3h2. Differentiate m(v) with respect to v. 6v*2 + 6 Let s = 405 - 399. Let r = -2 + 8. What is the third derivative of -5dr - d2 + 0ds + d2 - 5d*2 wrt d? -600d*3 Suppose -x + 30 = 4x. Let h = -4 + x. Find the second derivative of -31a + 24a - ha2 - 2a*2 - 2a*2 wrt a. -12 Suppose 2b - b = -8. Let u = b - -13. Find the second derivative of 0o5 + 6o + 2ou - o wrt o. 40o3 Let m(g) = g2 - 7g - 3. Let l be m(8). Suppose -5s + l = -15. Find the third derivative of 2t2 + 4t2 + ts + 7t4 wrt t. 192t Let f(o) be the first derivative of -12o7/7 + 8o*5/5 + 86o*3 - 161. What is the third derivative of f(z) wrt z? -1440z*3 + 192z Differentiate -10j3 - j3 + 12j*3 - 13j - 78 with respect to j. 3j2 - 13 Find the third derivative of -78s5 - s3 - 26s2 - 31s*2 + 55s*2 - 3 wrt s. -4680s*2 - 6 Let v(t) be the first derivative of -3t5/4 + t2 - 51t + 40. Let g(i) be the first derivative of v(i). Find the first derivative of g(c) wrt c. -45c*2 Let l = 1 + 1. Suppose -lo = 2o. Find the third derivative of oy*3 - 3y*3 + 2y*3 + 3y*2 + 0y*3 wrt y. -6 Let t(x) = 4764x + 3119. Let b(h) = -951h - 624. Let l(m) = 11b(m) + 2t(m). Differentiate l(d) with respect to d. -933 Let z(x) be the third derivative of 3x*5/20 - 13x*4/24 - 2x*2 - 9x. What is the second derivative of z(k) wrt k? 18 Let t(o) be the third derivative of o*5/60 - 13o*4/24 + 16o*3 + 12o*2. Differentiate t(q) with respect to q. 2q - 13 Let t(r) be the second derivative of 535r4/12 - 397r*3/6 + 96r. What is the second derivative of t(g) wrt g? 1070 Let r = -5 + 26. Differentiate rw2 - 4 - 21 - 3w*2 with respect to w. 36w Let l be (-4)/(-6) - 6/(-18). Suppose y = -4j + 15, -2y = -3y - l. What is the third derivative of -js + 4s4 - 5s*2 + 4s wrt s? 96s Let i(z) be the third derivative of 53z8/168 - z7/105 + 23z5/60 + z3/3 + 156z*2. Find the third derivative of i(r) wrt r. 6360r*2 - 48r Let z(p) be the third derivative of -11p8/48 + p5/60 + 16p*3/3 + 5p*2. Find the third derivative of z(g) wrt g. -4620g2 Let f(i) be the third derivative of -i9/252 - i*6/24 - 5i*5 + 2i*2 + 26. Find the third derivative of f(h) wrt h. -240h*3 - 30 Let r be -6(-3)/(-18)-3. What is the third derivative of -11d*2 - 29d*r + 8d*2 + 5d*2 - 49d*2 wrt d? -174 Let j be (-1)/(-1 + 0) - (-783)/1. Find the third derivative of 0 - 755f*4 + 0 - 18f*2 + jf*4 wrt f. 696f Let t(v) = 2v2 - 8v2 - v - v3 - 5 + 1. Let n be t(-6). Find the third derivative of -2j2 - 3j*4 + 3j4 + j6 + 4jn wrt j. 120j*3 Let x(g) = 36g - 40. Let p(k) = -7k + 8. Let w = 73 + -18. Suppose 0m = -5m - w. Let i(l) = mp(l) - 2x(l). What is the derivative of i(o) wrt o? 5 Let f be (39/65)/((-9)/(-30)). Let l(j) be the first derivative of 1/3j*3 - 1 + 0j - 1/2jf. What is the second derivative of l(n) wrt n? 2 Let m(c) be the first derivative of c9/336 + 7c*6/360 - 4c*3/3 - 6. Let k(o) be the third derivative of m(o). Find the third derivative of k(d) wrt d. 540d*2 Let b(j) be the second derivative of -53j*4/6 + 17j*3/6 - 3j*2/2 + j + 8. What is the second derivative of b(d) wrt d? -212 Let y(c) be the first derivative of -143c*6/2 - 321c*2 + 252. Find the second derivative of y(u) wrt u. -8580u*3 Let c(j) = -2314j*2 + 14j - 1831. Let l(b) = 772b2 - 4b + 611. Let d(g) = -2c(g) - 7l(g). What is the first derivative of d(o) wrt o? -1552o Let w(j) be the third derivative of -j7/35 + j5/20 + 14j*3 + 75j*2. Find the first derivative of w(y) wrt y. -24y*3 + 6y Suppose -d + 16 = 5. Let u(k) = 4k2 - 6. Let r(w) = 3w - 298 - 3w + 20w*2 + 267. Let c(l) = du(l) - 2r(l). Differentiate c(g) wrt g. 8g Let s(c) be the third derivative of -59c8/168 + 53c*4/24 + 2c*2 + 120. What is the second derivative of s(k) wrt k? -2360k3 Let r(a) = -a + a3 + 0a + 8a*2 - 9a*2. Let j(l) = -2l*3 - 3l*2 + 5l. Let v(b) = j(b) - 3r(b). What is the second derivative of v(h) wrt h? -30h Let s(z) = -12z2 - 25. Let m(r) = 37r*2 + 73. Let u(x) = -4m(x) - 11s(x). What is the first derivative of u(n) wrt n? -32n Differentiate -2b4 + 106 - 24 + 22b*2 + 9b*2 + 53 - 6 wrt b. -8b*3 + 62b Find the third derivative of 21c2 - 21c5 + c4 - 48c2 + 6c*5 + 19c*2 wrt c. -900c*2 + 24c Let v(w) be the third derivative of -91w6/40 - w5/30 - 29w*4/12 - 250w*2. What is the third derivative of v(o) wrt o? -1638 Let y(p) be the third derivative of 79p*5/15 - 25p*3/3 + 275p*2. Find the first derivative of y(o) wrt o. 632o Find the third derivative of y*2 - 19y*2 + 27 + 3 + 12y*2 + 654y*5 wrt y. 39240y*2 Let x(p) be the first derivative of 0p*5 + 0p*4 + 6 + 0p*2 + 0p + 1/3p3 + 13/6p*6. Find the third derivative of x(f) wrt f. 780f*2 Find the third derivative of -8s*6 - 321s*2 - 343s*3 + 9s*6 - 204s*3 + 377s*2 - 963s*2 wrt s. 120s*3 - 3282 Let r(w) = -62w*3 - 69w - 3. Let l(a) = 125a3 + 137a + 5. Let g(q) = -3l(q) - 5r(q). Find the second derivative of g(c) wrt c. -390c Let w(c) be the second derivative of c4/12 - 65c*3/6 - 152c*2 + 9c - 2. Differentiate w(u) wrt u. 2u - 65 Let n = -283/26 + 174/13. Let x(d) be the first derivative of nd*2 + 0d + 0d3 + 10 + 0d4 - d6 + 0d5. Find the second derivative of x(q) wrt q. -120q*3 Let w(o) be the second derivative of -5/6o*4 + 0o*2 - 16o + 1/3o3 + 0. What is the second derivative of w(i) wrt i? -20 Let r(j) be the first derivative of 625j*6/6 - 66j*2 - 480. What is the second derivative of r(q) wrt q? 12500q*3 Find the second derivative of 129h + 1190h2 + 4h*3 - 565h*2 - 589h*2 wrt h. 24h + 72 Let w(l) = -73l2 - 217l - 3. Let k(t) = -74t2 - 211t - 2. Let r(s) = -3k(s) + 2w(s). Find the second derivative of r(o) wrt o. 152 Find the third derivative of -z - 1321z2 + 2648z*2 + 189z*3 - 1316z2 wrt z. 1134 Let j(k) be the second derivative of -k9/1512 + k5/20 - k3/2 + 2k. Let p(g) be the second derivative of j(g). Find the second derivative of p(l) wrt l. -40l*3 Let m be -1 + (4 - -8)/2. What is the second derivative of -18h*3 - mh + 21h - 28h wrt h? -108h Let h(v) = v3 - 5v*2 + v - 2. Let i be h(5). Suppose 3a = -0 + i. Find the first derivative of -2q4 + 3q*4 - a - 2q*4 wrt q. -4q3 Let l(w) = w2 + 13w + 14. Let x be l(-12). Suppose 5s - 68 = -8. Find the second derivative of -4q - s - 2q*2 + 12 - 2q*x wrt q. -8 Suppose -2l = -2n + 3l - 21, 2*n - 29 =	{ "pile_set_name": "DM Mathematics" }
. 23 Suppose -24b - 5b + 2407 = 0. What is the remainder when b is divided by 31? 21 What is the remainder when 117 is divided by (-4 + (-35)/(-21))-6? 5 Suppose -3p = -42 - 39. Let l = 150 + -140. What is the remainder when p is divided by l? 7 Let a = -479 - -981. Calculate the remainder when a is divided by 63. 61 Suppose -233 = -5w - k, 5w = w + 2k + 192. What is the remainder when 186 is divided by w? 45 Let t(p) = -2p*2 + 23p + 22. Let o be t(12). Calculate the remainder when 107 is divided by 18o/(-50)15/(-2). 26 Let f = -28 - -39. Suppose -f + 76 = 5g. Suppose 186 = 5y - 3d, 0 = -26d + 30d + 8. Calculate the remainder when y is divided by g. 10 Suppose 0 = -8q - 11q + 11267. Calculate the remainder when q is divided by 119. 117 Suppose -30z = -34z + 4l + 500, -2l = -5z + 610. Calculate the remainder when 229 is divided by z. 109 Let v be (-2)/8(-3380)/13. Let y = -36 + v. What is the remainder when 114 is divided by y? 27 Let a be 497/2 + 4/16-2. Suppose -4j + a = -4n - 0n, -2n = -j + 67. Let t(f) = 9f + 2. Calculate the remainder when j is divided by t(2). 17 Let n be (-74)/(-8) + 1/(-4). Let k be n/6 - (-6)/(-4). Let j(m) = -m2 - 2m + 56. What is the remainder when j(k) is divided by 15? 11 Let c be -316/(-9). Suppose -4f = cy - 4, -f + 3f - 5y - 26 = 0. Calculate the remainder when 43 is divided by 11/(f - 10/4). 21 Let q = -336 + 395. What is the remainder when 230 is divided by q? 53 Suppose -24y - 21y = -3240. Suppose -2z + 3 = -71. Calculate the remainder when y is divided by z. 35 Let j(m) = 0 - 21m + 8m - 9m - 3. What is the remainder when j(-2) is divided by 11? 8 Let s = -349 - -1159. Suppose -6i = 3i - s. What is the remainder when i is divided by 7? 6 Suppose 10l - 138 = 32. What is the remainder when 66 is divided by l? 15 Let l = 327 + -265. What is the remainder when l is divided by 5? 2 Let f(o) = -9o*2 + o - 1. Suppose -1 + 3 = 2c. Let s be f(c). What is the remainder when 9 is divided by (-4)/(-6) - 30/s? 1 Suppose -2k + 4p + 98 = 0, 10p - 61 = -k + 15p. What is the remainder when k is divided by 9? 5 What is the remainder when 117/7 + (-10)/(-35) is divided by (48/(-96))/((-2)/36)? 8 Suppose 193 = -3r + h, -2h + 2 = -0. Let m = r - -79. What is the remainder when 71 is divided by m? 11 Suppose 3m - 3 - 114 = 0. Let z = 6 - -4. What is the remainder when m is divided by z? 9 Let f(s) = -5s + 7. Let l be f(-5). Let z = -18 + l. Calculate the remainder when 27 is divided by z. 13 What is the remainder when (16/9)/(-4) - (-3364)/36 is divided by 15? 3 Suppose -w + 58 - 12 = 0. Let d(s) = -s*2 - s + 107. What is the remainder when w is divided by d(9)? 12 Let u(g) = -11g3 + g2 + g. Suppose 3p - 10 = p + 3q, -2q - 9 = p. Calculate the remainder when 20 is divided by u(p). 9 Let m(k) = 3k - 1. Let r be m(1). Suppose 5o - ro - 69 = 0. Calculate the remainder when o is divided by 5. 3 What is the remainder when 21((-2)/(-5))/((-6)/(-50)) is divided by -12(10/(-4) - -1)? 16 Let x be (-26)/(-8) - ((-36)/(-16) - 3). Suppose 4y + 5i - 42 = 10, xi - 2 = -y. Calculate the remainder when y is divided by 7. 4 Suppose 5y + 2v + 3v = 245, -231 = -4y + 3v. Calculate the remainder when 121 is divided by y. 13 Suppose 108 = 26s - 23s. What is the remainder when 176 is divided by s? 32 Suppose -2 - 6 = 4r - 2w, -12 = -3w. Suppose 11o - 19 - 322 = r. What is the remainder when o is divided by 10? 1 Let c be ((-2)/(-4))/(2/176). Let w = c - 17. What is the remainder when w is divided by (-1 - -4) + (-11 + 0)-1? 13 Let a = 27 + -13. Suppose -6b + 69 = 33. Calculate the remainder when a is divided by b. 2 Suppose -28 = -2p + 22. Suppose -24 - p = -q. Let i = 37 + -20. What is the remainder when q is divided by i? 15 Calculate the remainder when (3 - -27)/10 + 66 is divided by 9. 6 Let c(h) = h + 32. Calculate the remainder when 54 is divided by c(-4). 26 Suppose 5z = -x + 18, 4z - 20 = -8. Suppose 100 = 4d + xk, -5d - 7k + 4k + 128 = 0. What is the remainder when 83 is divided by d? 27 Suppose 9 + 19 = 4w + 5v, -w - 4 = 4v. What is the remainder when 669 is divided by w? 9 Let g = 569 - 560. What is the remainder when 12 is divided by g? 3 Suppose -4r - 2 = 2s, -4s - 5r - 10 = s. Let d(z) = -13z + 4. Let c = 1504 + -1489. Calculate the remainder when d(s) is divided by c. 13 Let s = -147 - -185. Calculate the remainder when 189 is divided by s. 37 Suppose w + 2a - 18 = 0, 0 = -3w + 13a - 12a + 89. What is the remainder when 30 is divided by w? 2 Let q(f) = -5 - 298f2 + 3f*3 + 2f + 6f + 292f2. Calculate the remainder when q(3) is divided by 25. 21 Let d(r) = -r3 - 25r2 + 2r + 13. Let k(j) = j*2 - j - 1. Let p(a) = d(a) + 6k(a). What is the remainder when p(-19) is divided by 21? 20 Suppose 5l + 5n + 845 = 10l, 4l - 2n = 680. Calculate the remainder when l is divided by 12. 3 Let z = 284 + -200. Calculate the remainder when 333 is divided by z. 81 Let z = 87 - 26. Suppose 2p + 13 = z. What is the remainder when 186/4 - (4 + 42/(-12)) is divided by p? 22 Let y be (-10 - -5)1/1. Let d = y - -8. Let q = 36 + -26. Calculate the remainder when q is divided by d. 1 Suppose 6s - 5i = 3s + 4, i + 36 = 5s. Let u be 2/4 - (-12)/s. Suppose ul - 29 - 7 = 0. What is the remainder when 51 is divided by l? 15 Let o = -5 + 2. What is the remainder when 39 is divided by o((-21)/(-15))/((-9)/15)? 4 Suppose 12m = 945 - 357. Calculate the remainder when 117 is divided by m. 19 What is the remainder when 98 is divided by 0 - (-4 - -2) - 77/(-1)? 19 Suppose -4k - 24 = k + 2q, 4q + 18 = -5k. What is the remainder when 1 + 0 - (-32)/1 is divided by k(-40)/15 - 4? 9 Let d be -72(-5)/10. Suppose 0 = -3q + 38 + d. Calculate the remainder when 25 is divided by q. 10 Let x be 3/(9/1)66. Suppose -g = g + 5w - 13, 2g - x = 4w. Calculate the remainder when g is divided by 5. 4 Let h = 259 + -136. Calculate the remainder when h is divided by 43. 37 Suppose 232 + 317 = 3j. What is the remainder when j is divided by 58? 9 Suppose 9w = 4w - f, 0 = -4w + 4f. Suppose 0 = -x - wx + 15. Calculate the remainder when x is divided by 5. 0 Let v = -1812 + 1287. What is the remainder when 29 is divided by v/(-50) + (-1)/(-2)? 7 Suppose y - l = 2l + 10, -3y = -5l - 22. Suppose -5a - 2 + 12 = 0, 4q - 4a = 4. Suppose -9 = -2k + q. What is the remainder when k is divided by y? 2 Let m(o) = -o3 + 5o*2 + 24o + 4. What is the remainder when m(-5) is divided by 5? 4 Let l = 39 + -37. Suppose -6y + 2y - 5d = 27, -5d = -5y. Let u = y - -7. What is the remainder when u is divided by l? 0 What is the remainder when 109 is divided by 10/((-12)/(-30) + 0)? 9 Let x = -262 - -277. What is the remainder when 238 is divided by x? 13 Suppose 4a - v = 42, -5a + 5v - 3v + 54 = 0. What is the remainder when (6 - (-92)/8)24/15 is divided by a? 8 Suppose 2u - 610 = -2a, 2a + 3a = -u + 317. What is the remainder when u is divided by 34? 30 Suppose 2d - 18 = -5m, 0d - 10 = -3m - d. Suppose 3p = -l - 0l + 10, 0 = p - ml - 8. Suppose -y = -p - 7. What is the remainder when 31 is divided by y? 9 Let k be 350/(-42)3/(-1). Let l = k - 19. Calculate the remainder when l is divided by 10/(-10) - 3-1. 0 Let y(z) = -z3 + 13z*2 + 4z - 36. What is the remainder when 23 is divided by y(13)? 7 Let i = 426 - 397. Suppose a + 1 = -2j, 5 = -0j + 5j + 4a. What is the remainder when (j/6)/(1/(-114)) is divided by i? 28 Let h(d) = -d*3 + 7d*2 + 3d. Let v(x) = x*2 + 5x + 4. Let z be v(-5). Suppose zc - 12 = 44. Calculate the remainder when h(6) is divided by c. 12 Suppose 5j - 4j = -4w + 193, -4j = 2w - 114. Suppose 0 = 8p - 190 - 2. What is the remainder when w is divided by p? 23 What is the remainder when 351 is divided by 6/(-15(-1)/20)? 7 Suppose 5s - 11s = -6. Suppose -2o - s = -9. What is the remainder when 16 is divided by o? 0 Suppose 21d - 2427 = -621. Let h(r) = -1. Let c(j) = 22j + 4. Let k(q) = -c(q) - 4h(q). What is the remainder when d is divided by k(-1)? 20 Let r = -874 + 2365. Calculate the remainder when 41 is divided by (-6)/8 - r/(-84). 7 Let b = -30 - -74. Let x be (4/(-5))/(1/(-5)). Sup	{ "pile_set_name": "DM Mathematics" }
is the units digit of v? 6 Let p = 449 - -124. What is the tens digit of p? 7 Let c be (-6)/14 + (0 - 45/(-7)). Suppose 4p = -r + 517, 2r = p - cp + 647. What is the units digit of p? 9 Suppose -10x = -13x + 267. Suppose b = -0b + x. What is the tens digit of b? 8 Let c = 28 + -28. Suppose c = -3l + 4j + 149, -l + 55 = -2j - 2j. Suppose -2i + 175 - l = 0. What is the tens digit of i? 6 Let b = -23 + 27. Suppose bz - 24 = 3z. Let l = z + -2. What is the tens digit of l? 2 Let z be (-400)/28 - 4/(-14). What is the units digit of (-244)/(-14) + 6/z? 7 Suppose -771a = -776a + 15. What is the units digit of a? 3 Suppose 2a + 13 = 267. What is the units digit of a? 7 Suppose 4a - 4164 = -4y + 4224, a = -5y + 10469. What is the hundreds digit of y? 0 Suppose -5y - 12 = -y, -2x + 5y = 1. Let g = 5 + x. What is the tens digit of (-11)/(g/(-3) + -2)? 1 Let m be ((-30)/(-9))/(-5)450/(-12). Let t = 10 + m. What is the tens digit of t? 3 Suppose 32 = -t - 4f, -3t = -5t + 3f - 31. Let z = 71 - t. What is the units digit of z? 1 Suppose 615 = 5q - 2l, -q + l = -6q + 600. Let p = 251 - q. What is the units digit of p? 0 Let q(m) = 383m3 - m2 - 14m + 36. What is the units digit of q(2)? 8 Suppose -951 = -2u - u. What is the tens digit of u? 1 Suppose 0 = -m + 25 + 8. Suppose -1914 = 6f - 4f + 3p, 2p + 8 = 0. What is the units digit of 6/m + f/(-33)? 9 Let a = 456 + 219. What is the units digit of a? 5 Let l(r) = -r2 - r - 1. Let b(d) = 2d*2 + 2d - 15. Let a(z) = -b(z) - 4l(z). What is the units digit of a(-6)? 9 Let u(d) = d3 - 12d*2 + d - 9. Let l be u(12). Let i = 5 + -2. What is the units digit of i/(l/(-15)-1)? 5 Let g(c) = -c*2 - 9c + 4. Let f be g(-9). Suppose -2j + f = -0j. Suppose -u - 161 = -5b, -jb + 7b + 4u - 181 = 0. What is the tens digit of b? 3 Let q = 5 - 8. Suppose 30 = -16w + 14. What is the tens digit of q - 3/w - -16? 1 Suppose -3d - 46 = -4u, -u + 2d - 26 = -4u. Let j = -5 - -9. Suppose -jh = -6 - u. What is the units digit of h? 4 Let r be (0 - 2/4)-4 - -1. Suppose rh = 136 - 4. What is the units digit of h? 4 Suppose 5m - 341 = v, -3v + 371 = 4m + 83. Let y = 135 - m. What is the units digit of y? 6 Let b = -901 - -1156. What is the units digit of b? 5 Suppose 4v = 2 + 26. Let n(q) = 3q2 - 18q + 9. What is the units digit of n(v)? 0 Let l(m) = -17m + 4. Let c be l(-2). Let g = -11 + c. Suppose 2k + 2s - g = 5s, 5s = 15. What is the tens digit of k? 1 Let f = 408 + 749. What is the units digit of f? 7 Let c = -7 + 1. Let l(k) = k2 + k - 1. Let w(m) = 2m*2 - m - 4. Let y(a) = 4l(a) - w(a). What is the tens digit of y(c)? 4 Let l(a) = 2a2 + 2a - 10. Let p be l(-5). Let y = 95 - p. What is the tens digit of y? 6 Let v(k) = 7 + 6 - k*2 - 10k + 0k2. Let h be v(-11). What is the units digit of (4 + -2)/(h/28)? 8 Let p = 197 - 86. What is the units digit of p? 1 Suppose -x + 1 + 3 = 0, 2x = -s + 100. What is the units digit of s? 2 Let c be (-6)/(-5)30/9. Suppose -57 = -cd - 9. Suppose -d = -r + 4. What is the units digit of r? 6 Let k(m) = 2m2 - 5m + 1. Let p be k(5). Let z = p + -23. Suppose zx - 4r = 85, -43 = -4x + r + 92. What is the tens digit of x? 3 Let u(y) = 2y*3 - 5y*2 - 4. Let s be u(4). What is the units digit of 7 + s - 2/(-1)? 3 Suppose 3k - 581 = 727. What is the tens digit of k? 3 Suppose 4976 = -43m + 51m. What is the hundreds digit of m? 6 Let w be (-6)/(-15) - (-218)/5. Suppose 11g - 6g = -140. Let f = w + g. What is the units digit of f? 6 Let c be -61/(-2) + -67 - -1. Let i = c - -202. What is the hundreds digit of i? 1 Suppose 0 = 15w - 2w - 104. What is the units digit of w? 8 What is the units digit of (-6 - -8 - 3)/((-2)/1198)? 9 Let j = 231 + -324. Let n = j + 145. Suppose 0h - 4h = -n. What is the tens digit of h? 1 Let h = 1 - -3. Let q(c) = -c3 + 29c*2 - 91c - 45. Let j be q(25). Suppose -hy + j = -4b, -3y - 4b + 96 = -y. What is the units digit of y? 6 Suppose -3m - 3u = -2781, -5m + 10m + 4u = 4640. What is the units digit of m? 2 Let i = 17 - 17. Suppose 4z - z - 147 = i. What is the units digit of z? 9 Let h be (-12)/(2/(-7)). Let f be ((-14)/(-3))/h6. What is the tens digit of 192(5 - f)? 3 Let i(t) = 5t - 1. Let a be i(3). What is the tens digit of 1002/14 + 6/a? 7 Suppose 0 = 4x - 2z - 8500, -2z + 4238 = 13x - 11x. What is the hundreds digit of x? 1 Suppose -10t - 9 = -11t. Suppose -tk = -0k - 2475. What is the hundreds digit of k? 2 Suppose -5i + 2a + 3a = -25, 3i = -4a + 50. Let o = i - -171. What is the tens digit of o? 8 Let s = -18 + 17. Let o(l) = 2l*2 - 6l - 5. Let x be o(5). Let y = x + s. What is the tens digit of y? 1 Let m = 154 + -95. Let w be ((-25)/4)/((-3)/(-12)). Let r = w + m. What is the units digit of r? 4 Let z(n) = 10n - 8. Suppose -3b = -2j + 26, -j - 11 = -4b - 34. What is the units digit of z(j)? 2 Suppose 0 = 33n - 18n - 14655. What is the hundreds digit of n? 9 Let w(b) = 13b2 - 11b + 6. What is the tens digit of w(-5)? 8 Let i = 167 - 118. Let s = 34 + i. What is the units digit of s? 3 Let f(s) = -2s2 - 2s - 1. Let u(a) = -a*2 - a. Let y(x) = 2f(x) - 5u(x). Let j be y(0). What is the units digit of 3 + 6/j + 7? 7 Let l = -9 - -53. Suppose l = 4x - 52. What is the tens digit of x? 2 Suppose 22694 = 6t + 7520. What is the units digit of t? 9 Let v(y) = 23y*3 + 3y*2 + y + 2. Let b be v(3). Suppose 5m = 15, -b = -5u - m - 75. What is the hundreds digit of u? 1 Suppose 0 = x + m + m - 17, -49 = -5x + 2m. What is the tens digit of x? 1 Let q be 10/(-25) + 1962/5. Suppose -9v - q = -13v. Let s = -30 + v. What is the units digit of s? 8 Suppose 82 - 9 = q. Suppose 22 = 2r - 4z, q - 10 = 3r + 4z. What is the tens digit of r? 1 Let k(j) = j3 - j2 - 1. Let i be k(2). Suppose -2x = ix - 435. Suppose -x = -4y - 5m, 3y - m - 44 = 7. What is the units digit of y? 8 Suppose -52395 - 9291 = -46w. What is the hundreds digit of w? 3 Suppose -3m - 17 = -3v - v, 3v - 49 = -5m. Suppose n - v = -3n. Suppose nt = -u + 13, -4t + 3 = 4u - 45. What is the tens digit of u? 1 Let u = -180 + 60. Let g be u/183/(-2). Suppose 6v - gv = -228. What is the units digit of v? 7 Let x(p) be the second derivative of -p*3/3 - 8p*2 - 11p. Let u be x(-9). Suppose -4v - 5s = -60, -us = 3v + s - 48. What is the tens digit of v? 2 Let l = -20 + 33. Suppose lw - 1471 = 986. What is the tens digit of w? 8 Suppose 0 = -4m - 16, r - 5 = 5m - 3m. Let l(g) = -g*2 - 3. Let p be l(r). What is the tens digit of 580/16 - (-3)/p? 3 Suppose 0 = 49b - 87582 - 147618. What is the tens digit of b? 0 Suppose 2553 - 928 = 5z. Suppose 9s = 4s + z. What is the units digit of s? 5 Let g = -103 + 566. Suppose 2o + w = g, -9w + 4w = -4o + 961. What is the units digit of o? 4 Suppose 0t - t + 4 = 0. What is the units digit of (42/4)/(3/t)? 4 Let x(t) = -18t - 1. Suppose 11v - 10v + 6 = 0. What is the hundreds digit of x(v)? 1 Let q(f) be the first derivative of 14f*2 - 13f + 16. What is the tens digit of q(6)? 5 What is the units digit of (-14 + 35016/84)/(2/14)? 0 Let s = -44 - -14. Let i = -16 - s. What is the tens digit of i? 1 Let z(a) = -a*3 - 20a*2 - 19a + 5. Let n be z(-19). What is the hundreds digit of 2408/20 + (-2)/n? 1 Let o(i) = 19i2 + 36i - 88. What is the tens digit of o(12)? 8 What is the tens digit of (-18)/(-12) - (40788/8)/(-11)? 6 Let a(k) be the second derivative of -k3/6 - k2/2 - 8k. Let f be a(-9). What is the tens digit of (-56)/(-10)(f - 3)? 2 Let f = 303 - 177. Suppose 0 = -0t - 2t - a + 117, -2t - 4a = -f. What is the tens digit of t? 5 Suppose -4y - 5j - 2035 = -9y, -5y + 2035 = -j. What is the units digit of y? 7 Let v(r) = 5r2 + 2r + 1. Let q be v(-1). Suppose 4n = q + 16. Suppose -2t + nx = -63, -3t + 4x = -6t + 152. What is the tens digit of t? 4 Let b(j) = -41j - 1016. What is the thousands digit of b(-54)? 1 Suppose -2m + 5m - 2w - 1439 = 0, 0 = 2*m + w - 957. What is the tens digit of m? 7 Let g be 337/3 + (-12)/9. Let u = g - 23. What is the units digit of u? 8 Let z(q) = 10 - 15 + 64 + 5 - q. What is the units digit of z(18)? 6 What is t	{ "pile_set_name": "DM Mathematics" }
et x(y) = -y. Let u(j) = fa(j) + 35x(j). What are the prime factors of u(2)? 2, 7 Suppose -5k + l + 177 = 0, -3k - 2l + 106 + 8 = 0. Let m = -21 + k. List the prime factors of 3/(((-12)/m)/(-4)). 3, 5 Let j(d) = 22d*2 + 1. Let w be j(-1). Suppose 4y + 2q = -y + w, -1 = y - q. Suppose 0 = -yv + x + 47, 2v - 12 = -5x + 8. List the prime factors of v. 3, 5 Suppose 0 = 3k - 2b - 15 + 3, 5b - 8 = -2k. What are the prime factors of (-2)/k2 - -27? 2, 13 Let p(k) = -3k - 4. Let u be p(-3). Let q = u - 5. What are the prime factors of (-1)/(q + (-2)/4)? 2 Suppose -2n + 3w = -31, -2w - 1 = -w. List the prime factors of n. 2, 7 Suppose 2b = 7b - 340. Suppose 3w = -2w - v + 58, -4v = -5w + b. List the prime factors of w. 2, 3 Let a(n) be the first derivative of n4/4 + n3/3 - 2n + 1. List the prime factors of a(2). 2, 5 Let q = -2 - -2. Suppose 14 = -qg + g. List the prime factors of (g/4)/((-1)/(-2)). 7 Let n = 127 - 88. What are the prime factors of n? 3, 13 Let i(d) = -4d. Let z be i(-1). Suppose -h + 35 = -3l, -29 - 9 = -h + zl. What are the prime factors of h? 2, 13 Let x(r) = r + 3. Let j be x(0). Suppose -4a - 2k + 34 = -a, 4a + jk - 45 = 0. List the prime factors of a. 2, 3 Suppose -1 - 6 = -h. What are the prime factors of 14/(-4)(-4)/h? 2 Suppose 3s - 111 = 54. List the prime factors of s. 5, 11 Let l(w) = -w. Let r be l(0). Let t(y) = -y + 3. What are the prime factors of t(r)? 3 Suppose 0 = -2b + b + 13. What are the prime factors of b? 13 Let w(n) = 9n + 46. List the prime factors of w(6). 2, 5 Suppose 0o + 4o - 18 = -3u, 0 = -2u - 2o + 14. Let y = -6 + u. List the prime factors of ((-4)/8)/((-1)/y). 2 Let j(f) = f3 - 2f*2 - 5f - 2. List the prime factors of j(4). 2, 5 Let q be (-100)/26 + (-14)/91. Let i(z) = 4z3 - 2z*2 + 2z + 1. Let x(v) = v*3 + 1. Let c(b) = i(b) - 5x(b). What are the prime factors of c(q)? 2, 5 What are the prime factors of (-4428)/(-28) - (-3 - (-22)/7)? 2, 79 Let l be (2 - -3)(-72)/10. Let c = l - -50. List the prime factors of c. 2, 7 Let p(x) be the first derivative of -x4/4 - 2x*3 - 3x2 - 1. Let l(u) = -u3 + 7u2 - 8u + 7. Let j be l(6). What are the prime factors of p(j)? 5 Let b = 23 + -33. What are the prime factors of (-82)/b - 7/35? 2 Let f be (10 - 5)/(3 + -2). Suppose ft + 6 = b, 5b + t + 3t - 146 = 0. Suppose -45 = -5l - 5q, b = 3l - 3q - 7. List the prime factors of l. 2, 5 Suppose -281 + 1301 = 4r. List the prime factors of r. 3, 5, 17 Let n(p) = -p*3 + 10p*2 + 14p - 3. Let i be n(11). Let b = -17 + i. List the prime factors of b. 13 Let m(h) be the second derivative of -1/2h2 + 17/6h*3 + 0 + h. List the prime factors of m(1). 2 Let x(u) = 12u*2 + u + 1. Let w(l) = l - 5. Let j be w(10). Suppose 2s = -3s - j. What are the prime factors of x(s)? 2, 3 Suppose 3i = 6i + 21. Let m = -4 - i. Suppose -r = -mr + 8. List the prime factors of r. 2 Suppose 17 + 28 = 5o. Suppose -o - 3 = -4p. Suppose 0 = -3t + pr + 54, 4r - 63 = -4t - t. What are the prime factors of t? 3, 5 Let a = 6 + -4. Let h(j) = 4 - aj + 1 - 3. List the prime factors of h(-5). 2, 3 Let a = -622 + 901. What are the prime factors of a? 3, 31 Let p = -9 - -16. Let i be ((-12)/p)/((-2)/14). Let z = -5 + i. List the prime factors of z. 7 Suppose -2p + 4v = -66, p + 2v = -4p + 165. List the prime factors of p. 3, 11 Suppose 148 = 2h + 4k, 0 = -4h + 2h + 4k + 108. Suppose -a - a = -4, -2z + 3a = -h. What are the prime factors of z? 5, 7 Suppose 0 = -3g + 4d + 955, -2g = -g + 5d - 350. List the prime factors of g. 5, 13 Let b be 4/(-18)-33. Let d(j) = 5j3 - j2 + j - 1. What are the prime factors of d(b)? 37 Let v(m) = 2m*2 - 14m - 15. Let n be v(12). Suppose -3w = 2w - n. What are the prime factors of w? 3, 7 Let k = -38 + 76. What are the prime factors of k? 2, 19 List the prime factors of 3/(-12) + 2152/32. 67 Let u(o) = -o + 12. Let r be u(7). Suppose 2z = 5h - 0h - 135, 0 = rh - 4z - 135. List the prime factors of h. 3 Suppose -2t + 2a - 6 = 6, t + 2a = 0. What are the prime factors of -16((-6)/t + -2)? 2 Let x = -232 - -400. List the prime factors of x. 2, 3, 7 List the prime factors of ((-21)/(-14))/((-2)/(-284)). 3, 71 Suppose 2p = 5p. Let w = 9 - p. What are the prime factors of w? 3 Let t(v) = v2 + 3v + 4. Let x be t(4). Suppose -7f + 3f + x = 0. List the prime factors of f. 2 Let z(r) = -2r3 + 4r*2 - 2r - 2. Let w be z(4). Let i = 103 + w. What are the prime factors of i? 29 List the prime factors of (3 + -19)14/(-4). 2, 7 Let n = 270 - 176. List the prime factors of n. 2, 47 List the prime factors of 44/16(-1 + 16)4. 3, 5, 11 Let i be (2 + -1)6/2. Suppose 12 = -0v + iv. Let t = v + 5. List the prime factors of t. 3 Suppose 257 + 151 = 17d. List the prime factors of d. 2, 3 Let i(l) = -2 + 0 + 2l + 0l. List the prime factors of i(7). 2, 3 List the prime factors of ((-4)/6)/(8/(-3156)). 263 List the prime factors of 88 + (-9)/((-36)/(-8)). 2, 43 Suppose 5o = 206 + 104. What are the prime factors of o? 2, 31 Let o = 7 + -14. Let v be 57(-4 - 65/(-15)). Let u = o + v. What are the prime factors of u? 2, 3 Suppose 6c - c = 0. Suppose -4p - x = -cx + 27, -9 = -2p - 5x. Let t(b) = -2b - 8. List the prime factors of t(p). 2 Let s = 10 - 8. Suppose h + 5p + 14 + 2 = 0, -5h + 55 = -sp. What are the prime factors of h? 3 Let p = 1 + 3. Suppose q + 60 = 5q + 5y, -py - 15 = -q. What are the prime factors of 57/q - (-2)/10? 2 Let x(d) = d - 8. Let u be x(9). Let a = 11 - u. What are the prime factors of a? 2, 5 Let w(r) = -r - 6. Let h be w(-5). Let z be h(-4)/((-8)/6). What are the prime factors of 42/9 - (-2)/z? 2 Suppose 5y - y - f - 4 = 0, -2f + 8 = 0. Let d = 14 - y. List the prime factors of d. 2, 3 Let a be (-11)/(4/(-88)). Let m be (-6)/33 + (-62)/a. List the prime factors of -5 + 3 - 39/m. 11 List the prime factors of (-6)/(-2) + (4 - 4). 3 List the prime factors of 1 + 9/(-12)-4. 2 Let q(g) be the second derivative of -g8/6720 + g6/720 + g5/40 + g4/4 - 2g. Let l(f) be the third derivative of q(f). List the prime factors of l(0). 3 Let p = 1 + 25. List the prime factors of p. 2, 13 Suppose 6f - 5f - 178 = -3h, 2f + h = 376. What are the prime factors of f? 2, 5, 19 Suppose 4n + 4j = -8, 8n + 16 = 3n + j. Let a be (-2 - 0) + (4 - n). Suppose -ax = -3x - 4. List the prime factors of x. 2 Let i(n) = -14n + 15. What are the prime factors of i(-5)? 5, 17 Suppose 5t - 18 + 1 = -3q, -4t = -4. Let w(b) = 7b - 9. List the prime factors of w(q). 19 Let c = -4 + 40. Suppose 10 = 3q - 5. Suppose -qp + c = -p. List the prime factors of p. 3 Let h(x) be the second derivative of x7/2520 + x6/360 + x5/30 + x4/6 + 4x. Let v(s) be the third derivative of h(s). List the prime factors of v(-4). 2, 3 Suppose 0 = 13x - 679 - 946. What are the prime factors of x? 5 Let n = 223 - 117. What are the prime factors of n? 2, 53 Let m be (148/6)/((-6)/36). What are the prime factors of (-4)/(-6) + m/(-12)? 13 Let h(a) be the third derivative of -1/60a5 + 0a*3 + 0 - 4a*2 + 7/24a*4 + 0a. List the prime factors of h(6). 2, 3 Suppose 0 = 7p - 539 - 126. List the prime factors of p. 5, 19 List the prime factors of 56 - 3 - (-3 - -5). 3, 17 Let u be 2/7 + (-47)/(-7). List the prime factors of (u - (-1 + 3))4. 2, 5 Let i(p) = 3p2 + p + 2. What are the prime factors of i(-2)? 2, 3 Suppose h + 3h = -20. What are the prime factors of 4/(-1) - 160/h? 2, 7 Let l(w) = -w*2 + 6w + 3. Let n(y) = y*3 + 7y*2 + 5y - 2. Suppose -3 - 3 = k. Let b be n(k). List the prime factors of l(b). 11 Let m(y) = 5y + 5. Let g be m(4). Suppose g = 3z - 2b, 5b + 13 = z - 17. List the prime factors of z. 5 List the prime factors of -1 + 0 + (-1 - -66). 2 Let k = 78 + 18. What are the prime factors of k? 2, 3 Let l = 247 - 136. List the prime factors of l. 3, 37 Let m(z) = z*2 + 7z + 8. Let n be m(-6). Suppose 4d = nd + 70. List the prime factors of d. 5, 7 List the prime factors of (-1)/(-2) + 342/4. 2, 43 Let h(g) = g*3 + 7g*2 - 10g - 11. Let a be h(-8). Suppose at = u + 226, 3t = 5*u + 89 + 29. What are the prime factors of t? 2, 23 What are the prime fac	{ "pile_set_name": "DM Mathematics" }
m = 320.4 - 444.95. Let g = m - -124. Let w = 45.55 + g. Is 2/7 less than w? True Let d = -30.3 + 30.3. Are d and -469 equal? False Let k be (69/(-10) - -7) + (-2)/4. Let h be (-4)/(8/6) - 37/(-4). Is k > h? False Let i be 5/(-25) - (-37)/135. Suppose 39r + 11 = -45r + 95r. Is i less than r? True Let h be ((-2)/5)/((-760)/(0 - -2)). Let z = h - 719/6175. Let w = 10 - 9.9. Is w bigger than z? True Let u = -586.1 + 586. Is u smaller than -205? False Suppose 3g = 2y + 27, -9g = -3y - 11g - 60. Let x be 42/y - 2/3. Which is greater: 71 or x? 71 Let l(b) = -18b - 91. Let t be l(-5). Let w be ((-70)/(-21))/(2/((-30)/65)). Which is smaller: w or t? t Let o(s) = 5s - 3. Let n be o(0). Let c = -1 + n. Let g be (-2 - c) + 264/(-134). Which is greater: g or 0? g Let k = 7391 + -7490. Which is greater: -33 or k? -33 Suppose 3v - 101 + 20 = 0. Suppose v - 18 = 9x. Which is smaller: x or -2/99? -2/99 Let p = 640387 + -18452751403/28815. Which is greater: 1 or p? 1 Let u = -372.4 - -372.5. Are u and 2.364 non-equal? True Suppose 14q + 3w - 7 = 9q, 0 = 5q + 4w - 11. Which is bigger: -4/87 or q? -4/87 Let p = -325 + 276. Let l = 424.8 + -472. Let t = l - p. Which is smaller: t or -2? -2 Suppose 5i - 51 = -21. Suppose x + x = 0. Suppose x = p - 5j - 5 - i, -2p = j. Which is bigger: -12/29 or p? p Let i = -29 + 42. Let g = i - 15. Let k = 0.3564 - 0.0564. Is g bigger than k? False Let x be (191 + -190)2/14. Is -536 at least x? False Let p(f) = 49f - 1. Let b be p(-1). Suppose 63r - 73r + 2680 = 0. Suppose 24w = -r - 908. Do b and w have the same value? False Let b(f) = 4f*3 - 2f*2 + 2f + 2. Let a be b(-2). Let v be -2 + 0 + a/(-2). Suppose -87h - 10h = -15h - 1640. Which is bigger: h or v? h Let q(r) = -2r*2 - 20r - 9. Let z be q(-9). Let c be (-3)/z + (-188)/3. Is -63 at most c? True Let k be 33/(-4)(-6 + 2). Suppose -5g = 20, -2f - 1 = 5g - 51. Is f bigger than k? True Let s be ((-6)/(-7))/(((-10)/24)/((-50)/(-90))). Let z(n) = -n*3 + 2n*2 - n + 2. Let k be z(2). Let u(t) = -t. Let l be u(k). Is l bigger than s? True Suppose -3k - 22 = 5q, 0 = 14q - 19q - 25. Which is smaller: 3/898 or k? 3/898 Let d = 145657/180 - 809. Let c = d - -11/45. Which is bigger: c or 0? c Suppose -78 = -o - 80. Let q be o/4 - 396/168. Are q and -4 nonequal? True Let n(u) = 2u*3 + 23u*2 + 5u - 3. Let k be n(-9). Suppose 360a - 12 = ka. Which is smaller: 25 or a? a Suppose 0 = 59x + 35202 + 375. Does x = -601? False Suppose -28x + 4100 = 22x. Is x >= 77? True Suppose 0 = 11j + j + 1140. Let i be (-2 - j - 0)26/(-39). Is -64 at least i? False Let n(t) = -2213t*2 + 37t - 39. Let a be n(1). Which is bigger: a or -2213? -2213 Let o = 56893/972594 + -25/434. Is 1 less than or equal to o? False Let l = -2.45 - -2.35. Let i be 2/(-12)(-10 + 540/65). Which is bigger: i or l? i Let o = -29 - -25.4. Let a = 7222 + -7220. Does o = a? False Let o = -21501/3615602 + 11/2374. Suppose 2223k = 4379k - 2196k - 40. Which is smaller: k or o? k Let a be 2/(-4)-4 + 5. Let m = 37/5 - a. Let n = 2674 + -114985/43. Which is greater: m or n? m Let m = -2140.9 - -2141. Are m and 84 equal? False Let q = 3.782 - 0.082. Let f = 33.3 + -30. Let u = q - f. Is 5/7 greater than u? True Let h = 767062303/3016 - 254331. Which is greater: h or -1? h Let u = 0.47 - 1.47. Which is smaller: u or -31/41? u Suppose 948 + 684 = 16v. Let f = v + -922/9. Let m(t) = -t + 1. Let r be m(1). Which is bigger: r or f? r Let q = -5 - -36. Let g = 43 - q. Let r(n) = -n*3 - 19n*2 + 16n - 69. Let x be r(-20). Which is smaller: g or x? x Let d = -77/123 + 277/246. Is d < 407? True Let x(a) = a*3 + 2a*2 - 21a - 21. Let g be x(-1). Is -20/447 at least g? False Let j = 1762 + -1862. Which is smaller: 6.6 or j? j Let s be 0/1 - (-7 + (-35)/(-7)). Let i be (s/(-4))/((-9)/(-18)). Is i at most as big as -15/14? False Let v = -1198 + 5809/5. Let m = 124 - 160. Is m <= v? False Suppose 5y + 2q - q + 5 = 0, -y - 2q - 10 = 0. Are -1/2458 and y unequal? True Let f be (155/3)/(64/(-12) + 7). Suppose -2a + 59 = 5b, 0b - 4b + 92 = 3a. Does a = f? False Let i be 207/23 - (-4)/(-2). Let r be -2 + i + -3 + (-9)/4. Which is smaller: -42 or r? -42 Let y = -1 + 21. Suppose -y = -8z + 3z, 0 = -f - 2z + 6. Let a be 4/14 + (44/(-7) - f). Which is smaller: -2 or a? a Let u(a) = -a2 - 33a - 91. Let j be u(-3). Is 2/7267 at least j? True Let k = 136 + -134. Suppose kt + 14 = 12. Which is smaller: -19/8 or t? -19/8 Let z be (-1 - -2)(-3 - -7). Suppose -3r + 91 = zr. Let v = 2520 - 2506. Which is smaller: v or r? r Let d be ((-33)/(-2))/(18/96). Let a = d + -89. Let o = 12.52 - 12. Is a <= o? True Suppose 4y + 3 + 0 = -5z, 3y = -5z - 1. Let s be (3/150 - -1) + (y - -1). Let g(k) = k*3 - 2k*2 + k + 1. Let d be g(1). Are d and s equal? False Let j = 50 - 88. Let v(y) = -3y*2 - 91y - 69. Let f be v(-29). Let m = f + j. Is 10 at most m? False Let h = 8.454 + -0.154. Let u = 8.1 - h. Which is greater: u or 0.142? 0.142 Let y = -16 - -48. Suppose -637 = -32w + 291. Which is smaller: w or y? w Let v be (-78)/(-260)-10 + 3/(-1). Is v at most as big as -154/25? False Let h be 15/27 + (-40732)/73350. Do 0 and h have different values? True Let q = 5182.4 + -5183. Which is greater: -520 or q? q Let g(v) = v*3 + 16v*2 - 21v + 42. Let t be g(-17). Suppose -18k + 7k + t = 0. Do k and 10 have the same value? True Let i be (5 + (-1 - 11/2))/(13/(-24)). Which is greater: i or 4? 4 Let u(f) = -f*3 - 6f*2 + 25f - 16. Let s be u(-9). Let k be 5/s1/((-20)/216). Which is greater: k or -28? k Let x = -255 + 240. Which is greater: x or 1/9? 1/9 Let k = 126 - 115. Let u(h) = h - 31. Let y be u(k). Let j(a) = -a3 - 19a*2 + 21a + 24. Let s be j(y). Is s greater than or equal to 7? False Let t = -0.73 - 0.15. Let k = -4.4478 - -0.1278. Let q = t + k. Does q = -0.1? False Let i = 1683.8 + -1685.7. Let s(n) = -n + 7. Let k be s(7). Suppose v = -2m + 6v - 23, 4m - 2v + 6 = k. Is m greater than or equal to i? True Suppose -6x + 7x - 108 = -2j, -3x - 5j = -328. Which is smaller: x or 105? 105 Suppose -52k + 1337 + 1419 = 0. Let p be ((-3)/30)/(8/(-4260)). Is k equal to p? False Let k = 208965 + -208966. Let c = -2282/11 - -206. Let i = 349/66 + c. Is i smaller than k? False Let m be (-9)/(-5 + 2) + -15. Let h be 28/614/(-49)m. Suppose 0 = -3y - 2u - h + 57, 5y = 4u + 39. Which is greater: 10 or y? y Let i be (-138)/207 + (-26048)/(-3) + 2 + -2. Is 8683 less than or equal to i? False Let c = -233 + 242.02. Let x = c - 9. Let w = 849 + -848.7. Is x >= w? False Let o = 29.772 - -581.608. Let a = o + -610. Does a = -2? False Let c(p) = -p*2 - 6p - 9. Let d be c(-10). Let q be 1092/(-20) + (-9 + -124)/(-19). Which is greater: d or q? q Let p(r) = -102r + 837. Let q be p(8). Let i = 58 - 40. Is q <= i? False Let f = 701 - 24538/35. Let x(g) = g3 - 21g*2 - 49g + 69. Let h be x(23). Is h >= f? True Let v = -0.85 + 0.8. Let d = -0.0028 - -9.0528. Let l = v + d. Is l less than 3? False Let b be (-28)/7 - 26/(-6). Let g be 10/(-15)93/(-42). Let l = g - b. Which is smaller: 1 or l? 1 Let r be (-58)/(-145)10/19. Let p = 67 - 65. Which is smaller: p or r? r Let u = 6332 + -6332. Which is smaller: u or 5/1247? u Suppose -1 = -5n - u, u + 2 = -5n + 3u. Suppose 4w - 14 = -3h, 3w - 5h = -nw - 4. Let m be ((-1 - w)/3)/(-1). Which is smaller: m or -3/16? -3/16 Suppose -332 = -2m + 2d, -m - 13d + 171 = -15d. Is m at most 153? False Let h = 175 + -104. Let n be (-40)/30(-5)/(15/198). Let j = 158 - n. Do j and h have the same value? False Let q = 238 + -208. Let d be (-19 + 9)/(-21). Let o be 17/q + d/(-30). Is 2/11 less than or equal to o? True Suppose -3f - 26 = -5f - 3i, 4i = -4f + 44. Let s be (-62)/(-14) - 3/f. Suppose 32 = sr - 6r. Is -63/4 bigger than r? True Let h be ((6790/150)/7)/((-1)/36). Do h and -234 have the same value? False Let t = 48 - 45. Suppose -tz + 18 = -3m - 0z, -3z + 15 = 0. Is -4/31 greater than m? True Let b be (13016/(-6))/(330/99). Which is greater: b or -652? b Let n be (-4 + (-4 - (-10 + 3)))/(-1). Let v(q) = -q + 2. Let b(a) = 43a + 7. Let f(m) = b(m) - 6*v(m). Let x be f(n). Is 46 bigger than x? True Suppose -4251	{ "pile_set_name": "DM Mathematics" }
ect the terms in -1233o - o2 - 3o*2 + 615o + 620o. -4o*2 + 2o Collect the terms in u*3 - 44934891u*2 + 44934891u2. u3 Collect the terms in -51y3 - y3 + 182y - 182y + 2y*3. -50y*3 Collect the terms in 118i*3 + 1445 - 1445. 118i*3 Collect the terms in 1 + 5467167238s - 1 - 5467167240s. -2s Collect the terms in -562w2 - 23w*3 - 3w*3 + 34w*3 - 9w*3 + 562w2. -w3 Collect the terms in -6k2 + 6423k*3 + 6k*2. 6423k*3 Collect the terms in 0w*3 + 4w - 32w + 4w*3 + 0w*3 - 2w*3. 2w*3 - 28w Collect the terms in -233v + 154v - 498v. -577v Collect the terms in -30m + 15m - 5m2 + 9m + 13m. -5m*2 + 7m Collect the terms in 142400z2 + 142255z*2 - 284654z2. z2 Collect the terms in -52t + 22t*3 + 68t - 16t. 22t*3 Collect the terms in -71863h - 71859h - 71861h - 71862h + 287443h. -2h Collect the terms in -159a - 397a + 141a - 136a. -551a Collect the terms in 94l2 + 259l*2 - 4l*2. 349l*2 Collect the terms in 8t - 7 - 1 - 10 + 18. 8t Collect the terms in -23k*2 + 6k*2 - 111k*2. -128k*2 Collect the terms in -188s + 165s - 51 + 42 - 145. -23s - 154 Collect the terms in -2b + 0b - 8 + 0b + 9b - 8b. -b - 8 Collect the terms in 116875b*3 - 233738b*3 + 116879b*3. 16b*3 Collect the terms in 362 + 381 - 1465 + 358 + 364 + 6s*2. 6s*2 Collect the terms in 12r*3 + 4266955r - 4266955r. 12r*3 Collect the terms in -2 + 13k - 3k + 150k*3 - 525k*3. -375k*3 + 10k - 2 Collect the terms in 15a - 7a - 10a - 5a + 1 + 2a. -5a + 1 Collect the terms in 176j + 2 - 61j - 93j. 22j + 2 Collect the terms in -2v3 - 677 - 76v + 76v + 1351 - 674. -2v*3 Collect the terms in 262m*3 - 14m*2 - 20m*3 + 377m*3 - 78m*3. 541m*3 - 14m*2 Collect the terms in 1464x - 6299x + 2071x - 11166x. -13930x Collect the terms in 14c - 29c - 1242c2 + 1248c*2 + 15c. 6c2 Collect the terms in 8u*3 + 290u*2 - 5u*3 - 15u*3 - 290u*2. -12u*3 Collect the terms in -1397o*3 - 74o*2 - 2923o*3 + 75o*2. -4320o3 + o2 Collect the terms in -596t3 + 736t*3 - 203t*3. -63t*3 Collect the terms in -1654g*2 + 543g*2 + 551g*2 + 4 - 4 + 561g2. g2 Collect the terms in -63 + 275f3 - 273f*3 + 63. 2f3 Collect the terms in -j2 + 1999 + 1275 - 3274. -j*2 Collect the terms in 4 + 4c*2 + 10 + 4c2 - c2. 7c2 + 14 Collect the terms in 49985q - 24897q - 24878q. 210q Collect the terms in 99a - 47a - 467a*2 - 52a. -467a2 Collect the terms in t2 - 5t*2 - 11t*3 + 33t*3 - 6t. 22t3 - 4t*2 - 6t Collect the terms in -197a2 + 96a*2 + 102a2. a2 Collect the terms in -270s2 + 268s*2 + 9 - 46s*3 - 9. -46s*3 - 2s*2 Collect the terms in 4i*2 - 144i - 3i2 + 55i - 773i. i2 - 862i Collect the terms in 1110r3 + 1106r*3 - 2210r*3. 6r*3 Collect the terms in 295p*2 - 62p*2 - 62p*2 - 112p*2 - 60p2. -p2 Collect the terms in 11d + 10d*2 + 51d*3 - 11d2 + d2. 51d3 + 11d Collect the terms in -95 + 4j + j + j - j. 5j - 95 Collect the terms in 1335w - 306w + 818w - 1. 1847w - 1 Collect the terms in -43v2 - 2780 + 5560 - 2780. -43v*2 Collect the terms in -50u*2 + 9 + 12 + 46u*2. -4u*2 + 21 Collect the terms in 2492s*3 - 2s*2 + 1698s*3 + 2s*2. 4190s*3 Collect the terms in -4009d*2 - 1 + 3968d*2 - 5. -41d*2 - 6 Collect the terms in -1374a*3 + 4104a*3 - 1361a*3 - 1367a*3 - 4 + 4. 2a*3 Collect the terms in 130h*3 + 0h + 0h - 11 - 111h*3. 19h*3 - 11 Collect the terms in -2043o*3 + 0o - o + o + 4. -2043o3 + 4 Collect the terms in 23s*2 - 10s*2 - 51s*2 + 34s*2. -4s*2 Collect the terms in 488q*2 + 491q*2 - 4 + 490q*2 - 1460q*2. 9q*2 - 4 Collect the terms in 50b*3 - 40b*3 + 39b - 3b3 - 9b*3. -2b*3 + 39b Collect the terms in -383x + 543x - 156x. 4x Collect the terms in -4x2 + 14x*2 - 3x + 5 + 8x2 + 2x*2. 20x*2 - 3x + 5 Collect the terms in 26919 + 2t2 - 13435 - 13484. 2t*2 Collect the terms in 79a + 78a + 77a - 405a + 78a + 89a. -4a Collect the terms in 306m + 468m - 88m. 686m Collect the terms in -3413 + 3413 + 3h. 3h Collect the terms in -k*3 + 495455370k - 2k2 - 495455370k. -k*3 - 2k*2 Collect the terms in -31r + 6r3 + 94r - 63r. 6r*3 Collect the terms in -66y - 1322y3 + 40y + 26y. -1322y*3 Collect the terms in -943y*2 + 34308 - 34308. -943y*2 Collect the terms in -401x*2 - 30x*2 - 227x*2 - 26x*2. -684x*2 Collect the terms in 11o*3 + 710546o*2 - 710546o*2. 11o*3 Collect the terms in 0 - 241q*2 - 34q + 35q + 0 - q3. -q3 - 241q*2 + q Collect the terms in -6m*2 + 0m*3 + 2m*3 - 76m*2 - 86m*2. 2m*3 - 168m*2 Collect the terms in 32894f - 32894f + 3f*2. 3f*2 Collect the terms in 124s + 55s + 179s + 2 + 264s. 622s + 2 Collect the terms in -95b + 228b + 185b. 318b Collect the terms in -400p2 + 623 - 623. -400p*2 Collect the terms in -4105a*2 + 8706a*2 - 4598a*2. 3a*2 Collect the terms in 5g*2 - 1 + 1 - 4g*2 + 10g*2. 11g*2 Collect the terms in 4415d + 4418d - 8835d. -2d Collect the terms in -q2 + 24229q - 24229q. -q2 Collect the terms in -2c + 474c3 - 2352c*3 + 3c - c. -1878c3 Collect the terms in -191 - 3t*3 - 5t2 + t3 - 2t2 + t2. -2t*3 - 6t*2 - 191 Collect the terms in 0 + 0 - 89l*2 - 7 + 5. -89l*2 - 2 Collect the terms in -18x*3 + 231x + 15x3 + 35x. -3x3 + 266x Collect the terms in -2u2 - 855010u + 855010u. -2u*2 Collect the terms in -103534v - 7 + 103737v + 7. 203v Collect the terms in 318d - 1585d + 317d + 311d + 313d + 325d. -d Collect the terms in 9a + 23a*3 - 5a - 14a - 2a*2 - 28a. 23a3 - 2a*2 - 38a Collect the terms in 3p2 - 2p*2 + 34p + 33p3 - p2 - 31p. 33p3 + 3p Collect the terms in -143c + 50c + 21c + 45c + 8c3. 8c*3 - 27c Collect the terms in -3n - 139 + 4n + 0n + 1006. n + 867 Collect the terms in 151m*2 + 3m - 3m - 315m*2 + 153m*2. -11m*2 Collect the terms in -705l*2 + 3l*3 + 1423l*2 - 718l*2. 3l*3 Collect the terms in 5r*3 - 11r*3 + 8r3 - r3 + 2r3. 3r*3 Collect the terms in 56 - 138 + 20 + 27 - 2x*3 + 35. -2x*3 Collect the terms in -56n*3 - 26n*3 - 10n*3. -92n*3 Collect the terms in -49467095g*2 + 1 + 49467217g*2 - 1. 122g*2 Collect the terms in 23a - 38 + 18 - 46a + 20 + 19a. -4a Collect the terms in 0y*2 + 4y + 9y2 - 7y*2 - 7y2 - y2. -6y2 + 4y Collect the terms in 21 - 12v - 13v - 14v + 17 + 49v. 10v + 38 Collect the terms in -37x*3 + 30x*3 - 136x*3 - 210x*3. -353x*3 Collect the terms in -607 - 11 - 4x + 202 - 302. -4x - 718 Collect the terms in -5411q + 5411q - 9q*2 - 12q*2 + 10q*2 - 12q*2. -23q*2 Collect the terms in -43v*2 + 30v*2 + 57v*2 + 189v*2. 233v*2 Collect the terms in -11t*3 + 25t*3 - 8t*3 - 11t*3 - 7t*3 + 11t3. -t3 Collect the terms in 885w3 - 24 + 852w*3 - 1736w3. w3 - 24 Collect the terms in -48p3 + 8119p*3 - 208p*3. 7863p*3 Collect the terms in -11 + 11 + 121883r. 121883r Collect the terms in -z2 + 28z*3 - 35z*3 - 405 + 405. -7z3 - z2 Collect the terms in 289x3 + 933x*3 + 502x*3. 1724x*3 Collect the terms in 341r*3 - 198r*3 - 136r*3. 7r*3 Collect the terms in 29f*3 - 19860 + 19860. 29f*3 Collect the terms in -1367 + 2t + 513 + 846. 2t - 8 Collect the terms in 10w + 11w + 12w - 2w - 36w. -5w Collect the terms in 235554 + 5w - 9w - 235554. -4w Collect the terms in 210z2 - 49z - 54z - 52z + 155z. 210z*2 Collect the terms in -247v - 295v - 84v - 174v - 1 + 177v. -623v - 1 Collect the terms in -30 - 38 + 4q - 97. 4q - 165 Collect the terms in 1490k - 4467k + 1485k + 1486k. -6k Collect the terms in -36l3 + 59701l - 59701l. -36l*3 Collect the terms in 52q + 44q + 55q - 94q. 57q Collect the terms in -q*3 + 4q*3 + 2q*3 + 4q*3. 9q*3 Collect the terms in 6h*3 + 268h - 2h3 - 813h + 269h + 276h. 4h3 Collect the terms in h3 - 61	{ "pile_set_name": "DM Mathematics" }
is divided by 43. 9 Calculate the remainder when 181 is divided by 82. 17 Calculate the remainder when 403 is divided by 4. 3 Calculate the remainder when 3717 is divided by 530. 7 Calculate the remainder when 60910 is divided by 144. 142 What is the remainder when 76 is divided by 73? 3 What is the remainder when 68 is divided by 35? 33 What is the remainder when 142 is divided by 68? 6 What is the remainder when 1848 is divided by 10? 8 What is the remainder when 3291 is divided by 1635? 21 Calculate the remainder when 278 is divided by 32. 22 Calculate the remainder when 358 is divided by 28. 22 Calculate the remainder when 95 is divided by 7. 4 Calculate the remainder when 616 is divided by 151. 12 What is the remainder when 1188 is divided by 384? 36 Calculate the remainder when 2512 is divided by 628. 0 Calculate the remainder when 35053 is divided by 95. 93 What is the remainder when 290 is divided by 27? 20 Calculate the remainder when 50 is divided by 28. 22 What is the remainder when 175 is divided by 30? 25 What is the remainder when 54 is divided by 23? 8 What is the remainder when 123 is divided by 30? 3 What is the remainder when 1551 is divided by 74? 71 What is the remainder when 480 is divided by 209? 62 What is the remainder when 303 is divided by 24? 15 What is the remainder when 247 is divided by 23? 17 What is the remainder when 87 is divided by 21? 3 What is the remainder when 471 is divided by 119? 114 Calculate the remainder when 452 is divided by 25. 2 Calculate the remainder when 26 is divided by 14. 12 What is the remainder when 41 is divided by 8? 1 What is the remainder when 535 is divided by 520? 15 Calculate the remainder when 23163 is divided by 27. 24 What is the remainder when 810 is divided by 73? 7 Calculate the remainder when 175 is divided by 44. 43 What is the remainder when 310 is divided by 21? 16 Calculate the remainder when 3400 is divided by 148. 144 What is the remainder when 952 is divided by 772? 180 What is the remainder when 497 is divided by 63? 56 What is the remainder when 138 is divided by 85? 53 Calculate the remainder when 719 is divided by 6. 5 What is the remainder when 1103 is divided by 17? 15 What is the remainder when 3437 is divided by 22? 5 Calculate the remainder when 138 is divided by 7. 5 What is the remainder when 2422 is divided by 270? 262 What is the remainder when 161 is divided by 41? 38 Calculate the remainder when 10259 is divided by 95. 94 What is the remainder when 2008 is divided by 282? 34 What is the remainder when 44 is divided by 9? 8 Calculate the remainder when 340 is divided by 15. 10 Calculate the remainder when 143 is divided by 37. 32 Calculate the remainder when 232 is divided by 48. 40 Calculate the remainder when 2121 is divided by 2111. 10 Calculate the remainder when 382 is divided by 96. 94 What is the remainder when 1427 is divided by 84? 83 What is the remainder when 263 is divided by 27? 20 Calculate the remainder when 135 is divided by 13. 5 What is the remainder when 92 is divided by 24? 20 What is the remainder when 1361 is divided by 257? 76 Calculate the remainder when 18 is divided by 11. 7 Calculate the remainder when 263 is divided by 38. 35 What is the remainder when 1312 is divided by 110? 102 Calculate the remainder when 615 is divided by 88. 87 What is the remainder when 386 is divided by 243? 143 Calculate the remainder when 573 is divided by 137. 25 What is the remainder when 8440 is divided by 67? 65 What is the remainder when 1133 is divided by 42? 41 Calculate the remainder when 557 is divided by 56. 53 Calculate the remainder when 151 is divided by 32. 23 Calculate the remainder when 105 is divided by 53. 52 Calculate the remainder when 103 is divided by 15. 13 Calculate the remainder when 30 is divided by 13. 4 Calculate the remainder when 747 is divided by 25. 22 Calculate the remainder when 51 is divided by 13. 12 Calculate the remainder when 44 is divided by 12. 8 What is the remainder when 96 is divided by 61? 35 What is the remainder when 347 is divided by 29? 28 What is the remainder when 7519 is divided by 40? 39 Calculate the remainder when 1320 is divided by 9. 6 What is the remainder when 169 is divided by 34? 33 What is the remainder when 409 is divided by 119? 52 Calculate the remainder when 62 is divided by 10. 2 What is the remainder when 8279 is divided by 13? 11 Calculate the remainder when 3547 is divided by 96. 91 Calculate the remainder when 2117 is divided by 81. 11 What is the remainder when 892 is divided by 56? 52 Calculate the remainder when 382 is divided by 67. 47 What is the remainder when 1996 is divided by 1954? 42 Calculate the remainder when 343 is divided by 69. 67 Calculate the remainder when 70 is divided by 4. 2 Calculate the remainder when 146 is divided by 25. 21 Calculate the remainder when 351 is divided by 17. 11 Calculate the remainder when 11360 is divided by 379. 369 What is the remainder when 1077 is divided by 83? 81 Calculate the remainder when 256 is divided by 102. 52 Calculate the remainder when 42 is divided by 6. 0 Calculate the remainder when 1183 is divided by 298. 289 Calculate the remainder when 404 is divided by 23. 13 Calculate the remainder when 1500 is divided by 47. 43 Calculate the remainder when 1647 is divided by 271. 21 What is the remainder when 537 is divided by 49? 47 What is the remainder when 195 is divided by 33? 30 Calculate the remainder when 342 is divided by 71. 58 Calculate the remainder when 905 is divided by 269. 98 What is the remainder when 871 is divided by 23? 20 Calculate the remainder when 952 is divided by 190. 2 Calculate the remainder when 2031 is divided by 500. 31 What is the remainder when 224 is divided by 75? 74 Calculate the remainder when 33199 is divided by 40. 39 Calculate the remainder when 889 is divided by 149. 144 What is the remainder when 63 is divided by 23? 17 What is the remainder when 623 is divided by 25? 23 Calculate the remainder when 215 is divided by 67. 14 What is the remainder when 190 is divided by 24? 22 What is the remainder when 2159 is divided by 1061? 37 What is the remainder when 29050 is divided by 108? 106 What is the remainder when 414 is divided by 14? 8 Calculate the remainder when 324 is divided by 65. 64 Calculate the remainder when 852 is divided by 57. 54 Calculate the remainder when 385 is divided by 9. 7 Calculate the remainder when 153 is divided by 147. 6 What is the remainder when 3717 is divided by 76? 69 What is the remainder when 97 is divided by 53? 44 Calculate the remainder when 3366 is divided by 260. 246 What is the remainder when 1786 is divided by 223? 2 Calculate the remainder when 83 is divided by 3. 2 Calculate the remainder when 226 is divided by 46. 42 What is the remainder when 111 is divided by 49? 13 Calculate the remainder when 1238 is divided by 74. 54 What is the remainder when 1142 is divided by 195? 167 What is the remainder when 5144 is divided by 26? 22 What is the remainder when 4717 is divided by 20? 17 Calculate the remainder when 81 is divided by 18. 9 Calculate the remainder when 537 is divided by 132. 9 What is the remainder when 2766 is divided by 16? 14 What is the remainder when 111 is divided by 53? 5 What is the remainder when 433 is divided by 148? 137 What is the remainder when 3290 is divided by 176? 122 Calculate the remainder when 352 is divided by 52. 40 What is the remainder when 818 is divided by 13? 12 Calculate the remainder when 127 is divided by 47. 33 What is the remainder when 655 is divided by 214? 13 Calculate the remainder when 9 is divided by 4. 1 What is the remainder when 92 is divided by 25? 17 Calculate the remainder when 636 is divided by 11. 9 What is the remainder when 1379 is divided by 92? 91 What is the remainder when 522 is divided by 65? 2 Calculate the remainder when 54 is divided by 30. 24 Calculate the remainder when 490 is divided by 17. 14 Calculate the remainder when 37 is divided by 34. 3 What is the remainder when 4541 is divided by 16? 13 Calculate the remainder when 119 is divided by 40. 39 Calculate the remainder when 514 is divided by 257. 0 Calculate the remainder when 270 is divided by 17. 15 What is the remainder w	{ "pile_set_name": "DM Mathematics" }
*(6/7)q(q/(q(1/2)q))/q) assuming q is positive. q(177/14) Simplify ((r/r4)/(rr/r(-16)r))/(r*(5/2)rr(-3/8)) assuming r is positive. r(-201/8) Simplify (s(3/8)/((s(-25)s)/s))/(s*(-7/9)((ss(2/87))/s)/s) assuming s is positive. s(56647/2088) Simplify (((ss*25)/s)/ss*(-11)/s)/((ss*(-1/4)s)/(s/((s*12/ss)/s))) assuming s is positive. s(1/4) Simplify (g(-7))*42(g/g*(23/5))/(ggg(-3/13)g) assuming g is positive. g*(-19524/65) Simplify ((dd/d*(-15))/(ddd17))(-14) assuming d is positive. d28 Simplify ((bb(-1))(-18/13)b/(b(2/7)/bbbbb)(b*(-2)b)/b)36 assuming b is positive. b(-1080/7) Simplify (m3/m)(-20)(mm(-3))(20/9) assuming m is positive. m(-400/9) Simplify ((h(-2/5)/hh)11h/((h/(h*(1/4)/hhh)hhhh)/h)h*(4/9)h)(-15) assuming h is positive. h(847/12) Simplify (v0/v)(-34)(v/(v/v(-4/9)))/v(-9) assuming v is positive. v(383/9) Simplify (((p/((p/(p/(p(-1/5)p)))/p))(-4/23))(-23))38 assuming p is positive. p(912/5) Simplify (gg(-12))/(gg/g*(-10/11))g(-3/8)/(g/(g/(g(-5/6)g)g)) assuming g is positive. g(-3551/264) Simplify (l(-1/5)/(l*(-2/9)l)(l(-3/7)ll)/l5)(-1) assuming l is positive. l(1388/315) Simplify (aa*(-8))/(((a/(aa*(-1/13)/a))/a)/a)((a(-2/3)/a)/a)/(((a(4/9)/a)/a)/aaa) assuming a is positive. a(-958/117) Simplify (k(-1/8)/k)/k*(-1/10)k*(-23)/((k(kkk/(k*(3/8)/k)kk)/kk)/k) assuming k is positive. k(-593/20) Simplify (t(-4)/(((t/(ttt/(t*(-19)/t))tt)/t)/t))/(t(-25)/((t/t(10/3))/tt)) assuming t is positive. t(122/3) Simplify (a(3/2)/(((a*12aa)/a)/a))/(((a/(a(-19)a)a)/a)/(aa(-1/2))) assuming a is positive. a(-29) Simplify (v*(-2/15)/(v/(v/(vv*11))))/((v/(v(v/(v/v*14)v)/vv))/(v(2/9)v)) assuming v is positive. v(184/45) Simplify (y0y)/(y(y/y*(2/9))/y)y*(-10)y4/y assuming y is positive. y(-61/9) Simplify (kk2/kk)*(-3/19)/(kk(-1))47 assuming k is positive. k*(-9/19) Simplify ((yy(2/5))(6/29)y(2/7)/y(-5))(-3/7) assuming y is positive. y(-16977/7105) Simplify (k(-5)k(4/5))/(k5/k)(-15) assuming k is positive. k(279/5) Simplify ((o/((oo(-13)o)/o))/o*(1/13))/(ooo(-2)ooo)(-2/25) assuming o is positive. o(4278/325) Simplify (mm(1/7)m)*(1/22)/(m/(m(mm(-1))/mm)m(4/9)m) assuming m is positive. m*(-1867/1386) Simplify (t(t/(t*(-3)/t))/tt)/(t/(((t*8t)/tt)/t))((tt/(tt/t(-27)))/t)/t(-8) assuming t is positive. t(-7) Simplify (s/s(1/2))*(-28)/(sss(-22/7)/ss29) assuming s is positive. s(-286/7) Simplify ((b16/b)/(b7bb))/(((b/b7)/b)/b21) assuming b is positive. b34 Simplify (s(-5)/s*(2/3)(sss/(s/(s/(ss/(ss*(-2/3))s))))(23/4))(1/5) assuming s is positive. s*(-3/4) Simplify ((a/((a(a/(a/a*(-6)))/a)/a)a4)(21/4))6 assuming a is positive. a378 Simplify (g(-1/3))35/(g*(-9)g/(gg/(gg*2)g)) assuming g is positive. g*(-11/3) Simplify (ii/(i/(i/(ii/(ii*12i)))i)i)/i*(-15)(i/((iiii(5/3))/i))/((iiii*(2/13)ii)/i) assuming i is positive. i(865/39) Simplify (l2/l)/(l/((ll*2)/l))((ll1)/l)29 assuming l is positive. l31 Simplify (((a/((a1aa)/a))/a(2/3))(-20))(-32) assuming a is positive. a(-3200/3) Simplify a20a*(1/20)(a/(a/(aa/a(-8)aa)))(-15/2) assuming a is positive. a(-1399/20) Simplify (g/g23)/gg*(-2/27)(gg(-5))(-3/10) assuming g is positive. g(-2953/135) Simplify j/(j(2/29)j)j15(jj(5/2)j)/(j/(jj(-6)j)) assuming j is positive. j*(837/58) Simplify ((b(bbb/(b/(((b/(b*22/b))/b)/b))b)/b)/(bb(bb/(b/(b(3/16)b))bb)/bb))9 assuming b is positive. b(-3627/16) Simplify p/p(9/5)p/p*(2/3)(p0)(1/45) assuming p is positive. p(-7/15) Simplify (x7xxx(x/x*(-4/7))/xx)/(x/x(-2/25))(-47) assuming x is positive. x(10908/175) Simplify ((z(2/7))*(1/25)z*0zz(-4)/z)44 assuming z is positive. z(-30712/175) Simplify (g(-5))(-8)(ggg20)/g(-23) assuming g is positive. g85 Simplify (j/j8)*26j*(-2)j(-13) assuming j is positive. j(-197) Simplify u*(1/15)/(u(uu5uuuuuu)/u)(u(-2/7))9 assuming u is positive. u*(-1523/105) Simplify (((b/(bb1))16)48)(1/16) assuming b is positive. b(-48) Simplify (b(1/14)/b)/(bb/(b/b(-3)))(bb/((b(-2)/b)/bb))4 assuming b is positive. b(295/14) Simplify ((v(-4/17))(-1/64))(-4) assuming v is positive. v(-1/68) Simplify ((j/(jj(-1/11)j)j)/jj*5/j(j(-1))47)(-3/2) assuming j is positive. j(1449/22) Simplify (s(1/2))(2/29)s(-2/11)((s*17s)/s)/s assuming s is positive. s*(5057/319) Simplify b/(b/(bb/(b*12/b)))b*(-10)bb12b*(-13)b assuming b is positive. b*(-18) Simplify ((yyy(-2/7)y)*(-19)y(-1)/(y/y3))(-6) assuming y is positive. y(2124/7) Simplify ((r*(1/8)/(rrr1rr))44)(-5/12) assuming r is positive. r(715/8) Simplify (t(-2/5)/t)/(t/(t/((t/(t14tt))/t)t)ttt)t*(10/3)tt(-1)/t assuming t is positive. t(224/15) Simplify ((l/l(-1))/ll(-7/5))/(l(-2/17)/l(l17/ll)/l) assuming l is positive. l(-1299/85) Simplify (v17/v*3)/(v(v/((vv(1/7)/v)/v))/vv)(-15) assuming v is positive. v(398/7) Simplify (((lll*(-1/8)/lll)/ll((l(-13)l)/l)/ll)/(l(2/5)lll*5l))(-2/25) assuming l is positive. l(741/500) Simplify (h/h*3h)*(-35)(hh/(h/(h/h(-2/13))))(2/17) assuming h is positive. h(7791/221) Simplify (ww*1w)*(-29)/((w(w/w*(3/11))/w)/(w/(www20/www))) assuming w is positive. w(-1207/11) Simplify (y(-1/4)y22)(-17) assuming y is positive. y(-1479/4) Simplify ((v(-5/4)v(-4/3))38)41 assuming v is positive. v(-24149/6) Simplify (k(-2))27/(kk*(-11)k*(-6)k) assuming k is positive. k(-39) Simplify (n/((n/(n/((n/n5n)/nn)))/n))*(-16)n*(4/5)/((nn(-15))/n) assuming n is positive. n(-321/5) Simplify ((p(3/7)/p4)/(p(-2))(-1/49))(-2/7) assuming p is positive. p(354/343) Simplify ((((w/((w/(w*(2/3)w)ww)/w))/w)/((ww/(www(3/4))w)/w))/(w(2/5))(-1/7))(-2/45) assuming w is positive. w(-199/9450) Simplify h*(-4/9)h*(4/3)(h((((h/((h/h(-4/3))/h))/h)/h)/h)/h)(2/167) assuming h is positive. h(1276/1503) Simplify ((y(-10)yy(-12))29)(1/11) assuming y is positive. y(-609/11) Simplify hh/(hh/(h(-7)/h)h)hh/(h/h*(-5/6))h(h(-4))43 assuming h is positive. h(-1079/6) Simplify ((z/(z/(zz*8))zz/(z/((z/z8)/z)zz))/((z(-1/12)/z)/((z(-4)/z)/z)))50 assuming z is positive. z(-1475/6) Simplify (y5yy(-5)y(y(-1/3))(3/7))35 assuming y is positive. y65 Simplify (((n/(nnn(-1)nnnn)n)(-49))(-2/7))(8/11) assuming n is positive. n(-336/11) Simplify ((z/(zz(-2/49))z)/(z((zz*(-6))/zz)/z))/(z(-2/3))(3/8) assuming z is positive. z(1233/196) Simplify (((v(-4)/v)/((v(v/(vv*(-3/5)))/vvvv)/v))/(vv8v*(-1)/vv))(-1/38) assuming v is positive. v(39/95) Simplify ((v/((v*(-9)v)/v))/(v*(2/25)/vv))/(v(-2))(-11/9) assuming v is positive. v*(1682/225) Simplify (t/((t(t/(t*(-22)t))/t)/t)ttttt(7/5))/(t(2/3)/t)44 assuming t is positive. t(1/15) Simplify (w(-21)/w(1/12))/(w19/((((w/(w/w(2/29)))/w)/w)/w)) assuming w is positive. w(-14969/348) Simplify d(-13)/(ddd12/d)((d*(-2/37)/d)/d)/(dd*(-15)d) assuming d is positive. d*(-557/37) Simplify ((vv*4v)/(v/(v/(v/(v*4v)))vv))/(vvv/(v/(v/(vv(-11))v))v(2/19)) assuming v is positive. v(-116/19) Simplify (v(-3/2)v(1/5))/(v2/vv(-3/7)/vv) assuming v is positive. v(-131/70) Simplify (s(-2/53)ss)/(s/(s/(s*(-23)s)s))(s(-3/5))(-1/28) assuming s is positive. s(185379/7420) Simplify ((o(-1))*(-47)(o(-1))(-13/6))(-2/139) assuming o is positive. o(-295/417) Simplify q*(-6)/(q/(qqq(3/7)))q*(-2/5)/qqqq*(1/10)qqqq assuming q is positive. q(9/70) Simplify ((y/(y(y13/y)/y))/y(-11))/((y*(-13)y)/(y(yyy(9/5)/yy)/yyy)) assuming y is positive. y*(89/5) Simplify (mm*(-12)(m/(((m/(m/(mmm*(-44)))m)/m)/m))/m)**(-9) ass	{ "pile_set_name": "DM Mathematics" }
3? 43, 1307701 What are the prime factors of 51934899? 3, 17311633 List the prime factors of 2377126605. 3, 5, 7, 37, 611873 List the prime factors of 117417243. 3, 31, 37, 34123 List the prime factors of 950168178. 2, 3, 863, 20389 List the prime factors of 141699150. 2, 3, 5, 19, 16573 What are the prime factors of 24989164? 2, 2029, 3079 List the prime factors of 1192770222. 2, 3, 7, 2897, 9803 What are the prime factors of 4196528917? 7, 19, 23, 1371863 List the prime factors of 913057977. 3, 13, 19, 53, 67, 347 List the prime factors of 47658411. 3, 5295379 List the prime factors of 321033908. 2, 13, 23, 181, 1483 What are the prime factors of 117569921? 7, 157, 106979 List the prime factors of 287269385. 5, 13, 4419529 List the prime factors of 149944913. 17, 41, 43, 5003 List the prime factors of 117598556. 2, 769, 38231 List the prime factors of 53456710. 2, 5, 31, 172441 What are the prime factors of 3061600227? 3, 7, 17, 223, 4273 What are the prime factors of 333864567? 3, 1033, 35911 List the prime factors of 174552308. 2, 7, 43, 139, 149 What are the prime factors of 814047805? 5, 17, 9577033 What are the prime factors of 1359784570? 2, 5, 1753, 77569 List the prime factors of 11312695. 5, 19, 193, 617 List the prime factors of 1259715074. 2, 823, 765319 List the prime factors of 1194352500. 2, 3, 5, 11, 31, 467 What are the prime factors of 1912189336? 2, 19, 12580193 What are the prime factors of 12649703? 11, 104543 List the prime factors of 368969387. 368969387 List the prime factors of 61617832. 2, 31, 367, 677 What are the prime factors of 7263885? 3, 5, 484259 What are the prime factors of 1959112251? 3, 101, 2371 What are the prime factors of 2618405999? 11, 21639719 List the prime factors of 1335482841. 3, 7, 11, 5781311 List the prime factors of 1767769238. 2, 4799, 184181 List the prime factors of 953743138. 2, 11633, 40993 What are the prime factors of 2006234735? 5, 401246947 List the prime factors of 3768248. 2, 11, 42821 What are the prime factors of 612842704? 2, 38302669 What are the prime factors of 640128446? 2, 977, 327599 List the prime factors of 39349140. 2, 3, 5, 137, 4787 What are the prime factors of 1124979816? 2, 3, 19, 2467061 List the prime factors of 89170181. 59, 151, 10009 List the prime factors of 350920625. 5, 11, 51043 What are the prime factors of 468261072? 2, 3, 103, 131, 241 List the prime factors of 166488740. 2, 5, 11, 89, 773 List the prime factors of 1020676732. 2, 19, 1123, 11959 List the prime factors of 660089521. 7, 13, 373, 19447 List the prime factors of 3547347495. 3, 5, 67, 373, 9463 What are the prime factors of 72768390? 2, 3, 5, 2425613 List the prime factors of 109532568. 2, 3, 19, 240203 What are the prime factors of 42191772? 2, 3, 7, 43, 11681 What are the prime factors of 631843798? 2, 31, 10191029 What are the prime factors of 907811480? 2, 5, 22695287 What are the prime factors of 43303113? 3, 7, 71, 461 What are the prime factors of 182333334? 2, 3, 5297, 5737 List the prime factors of 157200762. 2, 3, 107, 244861 What are the prime factors of 5582518517? 61, 4993, 18329 List the prime factors of 4820911826. 2, 23, 104802431 What are the prime factors of 2692152455? 5, 41, 601, 21851 List the prime factors of 1879257417. 3, 31, 37, 546137 What are the prime factors of 47020968? 2, 3, 659, 991 List the prime factors of 347010211. 59, 163, 36083 List the prime factors of 33606529. 11, 1171, 2609 What are the prime factors of 94002931? 11, 8545721 List the prime factors of 1227852228. 2, 3, 29, 3528311 What are the prime factors of 688656284? 2, 37, 67, 1877 What are the prime factors of 1003513332? 2, 3, 17, 29, 169627 List the prime factors of 34018516. 2, 7, 1214947 List the prime factors of 12991107. 3, 37, 117037 List the prime factors of 431200288. 2, 19, 709211 What are the prime factors of 2605900431? 3, 709, 1225153 What are the prime factors of 5892587878? 2, 2946293939 What are the prime factors of 62556007? 62556007 List the prime factors of 901754718. 2, 3, 150292453 What are the prime factors of 4684120? 2, 5, 7, 16729 What are the prime factors of 7677058634? 2, 7, 23, 643, 5297 What are the prime factors of 18585393? 3, 317, 19543 What are the prime factors of 38167992? 2, 3, 17, 31183 List the prime factors of 154216222. 2, 37, 2084003 What are the prime factors of 552174536? 2, 69021817 What are the prime factors of 1920354431? 113, 16994287 What are the prime factors of 743012982? 2, 3, 17, 67, 36241 List the prime factors of 3122951524. 2, 7, 11, 10139453 List the prime factors of 1277841714. 2, 3, 212973619 What are the prime factors of 1206337985? 5, 241267597 List the prime factors of 53519626. 2, 173, 154681 What are the prime factors of 2461664824? 2, 967, 318209 List the prime factors of 1745892450. 2, 3, 5, 43, 90227 What are the prime factors of 590087490? 2, 3, 5, 1381, 14243 List the prime factors of 26776953. 3, 7, 141677 List the prime factors of 291961380. 2, 3, 5, 4866023 What are the prime factors of 1603704706? 2, 89, 1543, 5839 What are the prime factors of 75288620? 2, 5, 11, 53, 587 What are the prime factors of 39240992? 2, 7, 167, 1049 List the prime factors of 3663743280. 2, 3, 5, 15265597 What are the prime factors of 224613398? 2, 181, 233, 2663 What are the prime factors of 41103280? 2, 5, 17, 30223 What are the prime factors of 3717103879? 37, 8167, 12301 List the prime factors of 4392881061. 3, 6737, 217351 List the prime factors of 5417772204. 2, 3, 13, 34729309 List the prime factors of 393593160. 2, 3, 5, 643, 5101 List the prime factors of 815786911. 131, 617, 10093 What are the prime factors of 18286229? 13, 1406633 What are the prime factors of 211170482? 2, 105585241 What are the prime factors of 32421769? 67, 483907 What are the prime factors of 206116832? 2, 587, 10973 What are the prime factors of 145654425? 3, 5, 7, 92479 List the prime factors of 4964823. 3, 43, 12829 What are the prime factors of 31702726? 2, 11, 269, 487 List the prime factors of 602156665. 5, 11, 1367, 8009 List the prime factors of 141885877. 7, 97, 208963 What are the prime factors of 736319437? 7, 47, 2238053 What are the prime factors of 482022? 2, 3, 61, 439 List the prime factors of 15654508. 2, 3913627 List the prime factors of 41308334. 2, 17, 191, 6361 List the prime factors of 218832834. 2, 3, 11, 3315649 What are the prime factors of 4858794648? 2, 3, 151, 446909 What are the prime factors of 4298950224? 2, 3, 521, 57301 List the prime factors of 157044433. 7, 13, 132751 List the prime factors of 81595406. 2, 1019, 40037 List the prime factors of 106988546. 2, 7, 7642039 List the prime factors of 5899913996. 2, 53, 1031, 26993 What are the prime factors of 3391646271? 3, 13, 227, 383107 What are the prime factors of 39502391? 4457, 8863 What are the prime factors of 3480463206? 2, 3, 11, 19, 925163 What are the prime factors of 164588158? 2, 7, 1679471 What are the prime factors of 5058379? 163, 31033 List the prime factors of 14160540. 2, 3, 5, 53, 61, 73 What are the prime factors of 3137774074? 2, 29, 1009, 53617 List the prime factors of 1476022678. 2, 13, 4366931 What are the prime factors of 402365857? 402365857 List the prime factors of 9729286. 2, 7, 487, 1427 What are the prime factors of 2338724154? 2, 3, 13, 1237, 24239 What are the prime factors of 1441403979? 3, 83, 5788771 List the prime factors of 7582424. 2, 947803 List the prime factors of 483063684. 2, 3, 40255307 List the prime factors of 3227154858. 2, 3, 29, 61, 11261 List the prime factors of 523036005. 3, 5, 34869067 What are the prime factors of 359017360? 2, 5, 13, 59, 5851 What are the prime factors of 2056904613? 3, 17, 43, 53, 347 List the prime factors of 6531907990. 2, 5, 653190799 List the prime factors of 43480348. 2, 211, 51517 What are the prime factors of 91652216? 2, 997, 11491 List the prime factors of 44672532. 2, 3, 17, 23, 9521 What are the prime factors of 917275570? 2, 5, 43, 449, 4751 What are the prime factors of 654865774? 2, 53, 6177979 List the prime factors of 967835001. 3, 7, 46087381 List the prime factors of 55491155. 5, 11098231 List the prime factors of 27992387. 17, 37, 191, 233 What are the prime factors of 112076801? 17, 19	{ "pile_set_name": "DM Mathematics" }
3 - 11c2. Let h(b) = 7b*2 + b - 1. Calculate the remainder when h(-2) is divided by i(5). 4 Suppose 215t + g = 219t - 851, -2g = 4t - 842. Calculate the remainder when t is divided by 67. 11 Let r = 9750 + -9682. Suppose 2a - 26 = 18. What is the remainder when r is divided by a? 2 Suppose 0 = -31p + 350 + 704. What is the remainder when p is divided by 9? 7 Let b(i) = -i + 79. Calculate the remainder when b(-28) is divided by 37. 33 Let u be (-6)/((-6)/(-4)(-16)/(-12)). Let f(n) = -6n - 8. Let h = 24 + 5. What is the remainder when h is divided by f(u)? 9 Suppose 18m = 5m + 3835. Calculate the remainder when m is divided by 37. 36 Suppose 14 = 2l - r, 7 = l - 5r + 18. What is the remainder when l is divided by 9? 0 Suppose 2n + 3w + 1 = 0, n - w - 5 = 7. Suppose j - 2v = 49, j + v - n = 33. Calculate the remainder when j is divided by 23. 20 Let k = -347 + 959. Calculate the remainder when k is divided by 14. 10 Let z(a) = -6a2 - 127a - 1. Calculate the remainder when 157 is divided by z(-21). 17 Suppose -3k = -5k - 2. Calculate the remainder when k/(0 + (-2)/54) is divided by 7. 6 Suppose 22 = 4i - 5j, -i + 5 = -0i - j. What is the remainder when (35 - -2 - -1) + -1 is divided by ((-3)/12)/((-4)/(i + 205))? 11 Suppose -11n + 18n - 126 = 0. Calculate the remainder when ((-3)/(-2))/((-17)/(-578)) is divided by n. 15 Suppose 2f + 4 = 18. Suppose -q - fi + 2i + 27 = 0, -4i = 2q - 60. Calculate the remainder when 93 is divided by q. 29 Let u be 2 - 6 - (-286)/2. Let c = -91 + u. Calculate the remainder when c is divided by 13. 9 Suppose 188 = -13y + 17y. What is the remainder when 123 is divided by y? 29 Let m = 151 + -27. Calculate the remainder when m is divided by 35. 19 Let h be (-16)/(-2) - (3 + 0). Suppose hg - 200 = -15. What is the remainder when 146 is divided by g? 35 Let s = -29 + 13. Let o be 6/(-12)(2 + s). Let k(r) = r2 - r. What is the remainder when k(o) is divided by 15? 12 Let b = -10 - -12. Let f be b + ((-16)/4 - -30). Let c = f - -25. Calculate the remainder when c is divided by 14. 11 Suppose -c + 3 = 1. Let r(b) = -b3 - b*2 + 3b + 9. What is the remainder when r(-3) is divided by 2/c + -3 + 12? 8 Let x be -2 - 1/((-2)/66). Let c = 35 - x. What is the remainder when 5 is divided by c? 1 Let l(h) = 6h2 - h + 1. What is the remainder when l(2) is divided by ((-16)/(-48))/(1/24)? 7 Let f be 2/46 - -28. Let o = f + -27. Let l = 3 + -1. Calculate the remainder when o is divided by l. 0 Let s be 44/6 - 88/66. Suppose 0 = sd + d - 28. Calculate the remainder when d is divided by 2. 0 Suppose -8f + c + 41 = -5f, c + 71 = 5f. What is the remainder when 102 is divided by f? 12 Let k(g) = 3g3 - g2 + 2g - 2. Let v be k(1). Suppose 5c = -3l + 84, -4c + 4l + 2 = -78. What is the remainder when c is divided by 10 - (24/4)/v? 4 Let c = -60 - -134. Let v = -1 + c. What is the remainder when v is divided by 15? 13 Suppose 10 - 22 = -3a. Suppose -ag + 4c = -6g + 2, -4c = 0. Let o = 6 - 2. Calculate the remainder when o is divided by g. 0 Let w(l) = 6l*3 - 35l*2 - 2l - 6. What is the remainder when w(6) is divided by 5? 3 Let m = -20 + 38. Suppose 2b - 2 = -18. Let t = m - b. Calculate the remainder when 77 is divided by t. 25 Let r = -2 + 5. Let m(p) = -2p*2 - 2p*3 + 2 - p - r + 2p. What is the remainder when 12 is divided by m(-2)? 2 Suppose y + 38 - 43 = 5l, -l = -1. Calculate the remainder when 48 is divided by y. 8 Suppose 4u + 4h + 0h = 12, 0 = 5h + 10. Let l = u - -9. What is the remainder when 40 is divided by l? 12 Let d = 9781 + -5573. Suppose d = 15g + g. What is the remainder when g is divided by 44? 43 Let g = -1053 - -1074. Let w = -2 - -6. Suppose -195 = -wz - z. Calculate the remainder when z is divided by g. 18 Let t(z) = -5z + 1. Let k(l) = -44l + 8. Let i(u) = -3k(u) + 28t(u). Calculate the remainder when i(-3) is divided by 8. 4 Let o(b) be the third derivative of -b6/120 + b5/15 + b4/3 + b3/2 + 5b*2. Calculate the remainder when 62 is divided by o(5). 8 Suppose 2f - 4f = -298. Let c(v) = -6v - 17. Let s be c(-20). Let n = f - s. What is the remainder when n is divided by 12? 10 Let a(z) = 6z2 - 3z + 2. Let u be a(1). Suppose 77 = 4i + 4p + p, 3i + up - 54 = 0. Calculate the remainder when i is divided by 8. 7 Suppose 0 = 5y + 2r + 3r - 35, -3r = -3y + 21. Suppose 2h - 2b = 27 - y, -h + 5b = -30. What is the remainder when 21 is divided by h? 1 Suppose 3m = 6, -2l + l + 7 = 2m. Let w = 2 + -1. What is the remainder when 4 is divided by 4 - (l + (-2)/w)? 1 Let o = 3 - -15. Calculate the remainder when 43 is divided by (20/(-8))/((-3)/o). 13 Suppose -3w - 3p + 81 = -0p, 2w + 4p - 52 = 0. Calculate the remainder when 73 is divided by (-1)/((-28)/428) + (-8)/w. 13 Let k(t) = -t + 9. Let m(w) = w*3 - 6w*2 + 4w + 7. Let l be m(5). Let c be (-45)/(-6) + (-3)/l. What is the remainder when 10 is divided by k(c)? 1 Suppose 0 = 5r + 5z - 60, 0 = 3r - 5z - 6 - 14. What is the remainder when 33 is divided by r? 3 Let h be 0 - (6 + -3 + 4). Let u = 16 + h. Calculate the remainder when 24 is divided by u. 6 Let h = -412 - -477. What is the remainder when 129 is divided by h? 64 Let v(w) be the second derivative of -5w4/12 - 25w*3/3 + 8w*2 + 10w. Calculate the remainder when v(-10) is divided by 5. 1 Suppose 0 = -10b + 155 + 1405. What is the remainder when b is divided by 2/(-4) + (-33)/(-2)? 12 Let l(u) = -23u3 + u2 + u + 1. Let z be (-4)/(-8)-21. Let i be l(z). Suppose s = 4x + i, 3x + 15 = -2x. What is the remainder when 46 is divided by s? 10 Let c = 2868 + -2495. Calculate the remainder when c is divided by 125. 123 Suppose -o = -2j - 12, -6o - 5j = -2o + 4. Suppose 3l = oc + 50, -2l + 5c + 0c = -38. What is the remainder when 32 is divided by l? 4 Let f(h) = 55h - 378. What is the remainder when f(9) is divided by 7? 5 Let i(m) be the second derivative of m4/4 - m3/2 + 7m*2/2 - 19m. Calculate the remainder when i(3) is divided by 15. 10 Suppose 0 = -2z - g + 7, z + z - 4g - 2 = 0. Suppose 11 = 2o + 5r, -3r = -zo + 5o - 13. Calculate the remainder when 69 is divided by o. 5 Let u(o) = 6o + 83. Calculate the remainder when 66 is divided by u(-11). 15 Let d = 948 + -885. Calculate the remainder when d is divided by 11. 8 Let k = -10 - 5. Let x = k + 14. Calculate the remainder when 40 - x - (0 + 0) is divided by 22. 19 Let y = -8 - -8. Suppose yq - q - 149 = -2b, -295 = -4b + q. Suppose -4h + 15 + b = 0. Calculate the remainder when h is divided by 12. 10 Suppose r - 6r = 0. Suppose w - 2 - 3 = r. Suppose -39 = -3l + 3q, w = 3l - l + 5q. What is the remainder when l is divided by 6? 4 Suppose 0x + x + 83 = 3r, 0 = 3r + 4x - 88. Suppose -14t = -10t - r. Calculate the remainder when t is divided by 6. 1 What is the remainder when (78/12 - 6)70 is divided by 19? 16 Suppose f = -5u + 243, u - 38 = -5f + 1. Calculate the remainder when u is divided by 11. 5 Let b(k) = -14k - 415. What is the remainder when 113 is divided by b(-31)? 18 Let o = -16 - -21. Suppose -z + 3z + v = -12, -20 = ov. Calculate the remainder when z/(-22) + 6526/286 is divided by 13. 10 Let i(x) be the third derivative of x4/8 - x3/6 + 15x*2. Suppose -5j + 13 = -17. Calculate the remainder when i(8) is divided by j. 5 Suppose 0 = 19z - 16z + b - 31, 5b - 29 = -z. What is the remainder when 48 is divided by z? 3 Calculate the remainder when 315 is divided by (-27)/(-36) + ((-543)/4)/(-3). 39 Suppose 532 = 11m + 8m. Calculate the remainder when 74 is divided by m. 18 Let v be (-3 - -1) + 12/4 + -3. What is the remainder when 41 is divided by 7 + -6 - 40/v? 20 Suppose -6w + 0w + 18 = 0. Calculate the remainder when (-3)/((-9)/w) + 46 is divided by 12. 11 Let q(c) = -10c + 199. Calculate the remainder when q(15) is divided by 14. 7 Suppose -q - 1 = -x + 4, 3q - 20 = -4x. Let g(l) = l*2 + 8l + 4. Suppose -12b = -11b + 8. What is the remainder when x is divided by g(b)? 1 Let n(z) = z*3 + 11z*2 - 12z + 3. Let o be n(-12). Suppose 2w - 21 = -ol + 3, 4w = 3l + 66. What is the remainder when 58 is divided by w? 13 What is the remainder when 382 is d	{ "pile_set_name": "DM Mathematics" }
t is l(-25)? 2 Let c(x) = x*3 - 15x*2 + 24x - 38. Determine c(13). -64 Let a(t) = 84t + 1117. Calculate a(-15). -143 Let q(z) = -12z - 970. Give q(-83). 26 Let l(w) = 282w2 + 5. Give l(0). 5 Let b(v) = v2 + 127v + 2587. What is b(-105)? 277 Let s(v) = 4v3 + 49v*2 - 54v - 203. Determine s(-13). -8 Let u(p) = 2p - 189. Give u(87). -15 Let q(o) = -2o*3 + 10o*2 + 3o - 7. Determine q(6). -61 Let p(w) = 7w3 - 2w*2 + 22w - 20. Calculate p(1). 7 Let z(d) = 2d3 + 102d2 - d - 77. Give z(-51). -26 Let r(t) = -t2 + 81t - 826. Determine r(69). 2 Let b(q) = 29q - 345. Give b(8). -113 Let j(l) = 7l - 89. Determine j(13). 2 Let f(j) = -60j + 309. Calculate f(8). -171 Let n(u) = 152u - 522. What is n(4)? 86 Let m(s) = -30s - 657. Calculate m(-27). 153 Let j(b) = -3b3 - 139b*2 - 47b + 5. Give j(-46). 51 Let o(a) = -22a3 - 2a*2 - 1. Calculate o(-2). 167 Let b(x) = -336x + 34270. Determine b(102). -2 Let a(p) = 2p2 + 231p - 930. Determine a(4). 26 Let p(d) = 2d3 + 18d*2 - 4d - 85. Calculate p(-8). 75 Let b(k) = 80k - 4862. Give b(61). 18 Let f(a) = -a3 - 10a*2 - 13a + 11. Determine f(-10). 141 Let y(p) = -8p2 + 70p + 696. What is y(-6)? -12 Let w(p) = 6p3 - 13p*2 - 29p + 15. Give w(-3). -177 Let l(c) = -122c - 520. Calculate l(-4). -32 Let s(b) = 23b + 550. Determine s(-26). -48 Let o(n) = -44n2 + 2n. Calculate o(1). -42 Let m(c) = c*2 + 46c - 246. Determine m(-51). 9 Let t(q) = 7q2 + 33q + 13. Calculate t(-4). -7 Let n(b) = -20b2 - 759b + 20. Give n(-38). -18 Let u(a) = -33a + 113. Give u(8). -151 Let y(j) = -j3 + 6j*2 + 3j - 19. What is y(6)? -1 Let b(t) = -t*3 + 4t*2 + 6t - 4. Calculate b(7). -109 Let l(g) = -g*3 + 20g*2 + 16g + 250. Determine l(21). 145 Let h(r) = -r*2 - 1531r - 18233. Calculate h(-12). -5 Let j(z) = 2z3 + 102z*2 + 288z - 10. Determine j(-48). -10 Let o(m) = 57m + 186. Give o(-2). 72 Let x(o) = -o3 + 59o*2 + 74o - 1027. Determine x(60). -187 Let p(r) = -10r2 - 8r - 6. Give p(-5). -216 Let f(a) = 10a + 143. Give f(-17). -27 Let s(p) = p3 + 41p*2 + 110p + 62. Give s(-38). 214 Let t(c) = 8c3 - 15c*2 + 22c + 28. Give t(5). 763 Let h(m) = -11m2 - 46m - 33. Calculate h(-3). 6 Let p(s) = 105s2 + 1183s - 924. Give p(-12). 0 Let x(t) = -249t2 - 22t + 21. Calculate x(1). -250 Let u(i) = -2i2 - 74i - 308. Calculate u(-5). 12 Let v(q) = 34q3 + 206q*2 + 21q + 61. Determine v(-6). 7 Let b(v) = -v*2 - 19v - 216. Determine b(-12). -132 Let t(v) = -734v - 21335. Give t(-29). -49 Let g(v) = 2v*2 + 224v - 1167. Give g(-117). 3 Let q(v) = 86v + 5802. Give q(-67). 40 Let r(o) = -2o*2 + 2o + 89. What is r(0)? 89 Let l(m) = 4141m - 33121. Give l(8). 7 Let w(b) = -372b - 1083. Determine w(-3). 33 Let f(v) = 209v + 7086. Calculate f(-34). -20 Let p(x) = 2x*3 + 3x*2 - 434x + 846. Determine p(2). 6 Let p(x) = 342x - 10170. Calculate p(30). 90 Let t(o) = -o3 + 13o*2 - 41o + 57. Calculate t(6). 63 Let m(r) = 2r2 + 13r - 349. Give m(-17). 8 Let y(f) = 3f3 - 10f*2 - 5f + 26. Calculate y(3). 2 Let o(c) = -c*2 + 371c + 28802. What is o(-66)? -40 Let l(u) = -17u2 + 1192u - 144. Determine l(70). -4 Let r(b) = -80b2 - 718b + 10. Give r(-9). -8 Let u(t) = -87t - 655. Give u(-8). 41 Let i(o) = o3 - 37o*2 + 6o + 1079. Determine i(36). -1 Let d(t) = -156t - 1099. What is d(-7)? -7 Let x(n) = n + 104. Give x(-69). 35 Let u(s) = s3 + 19s*2 + 5s - 176. Calculate u(-18). 58 Let p(f) = f*2 + 4774f + 19070. Give p(-4). -10 Let w(y) = -220y - 12389. Give w(-56). -69 Let v(g) = -12g*2 - 52g - 9. Give v(-4). 7 Let l(i) = 60i - 363. Calculate l(6). -3 Let o(y) = y2 + 71y + 690. Give o(-10). 80 Let u(a) = -6a3 - 42a*2 - 33a + 4. Give u(-6). -14 Let r(i) = i*3 + 16i*2 + 65i + 24. Calculate r(-14). -494 Let g(s) = s*3 + 8s*2 - 16s + 2. What is g(-11)? -185 Let f(o) = 2o3 - 25o*2 + 35o - 16. Calculate f(11). 6 Let v(t) = -4t3 - 10t*2 + 30t + 15. Give v(-6). 339 Let d(x) = -32x - 1643. What is d(-52)? 21 Let m(r) = 6024r + 54211. What is m(-9)? -5 Let g(m) = -m*3 - 12m*2 - 15m + 98. Calculate g(-5). -2 Let v(s) = -s*3 + 39s*2 + 809s - 15. Determine v(-15). 0 Let t(n) = n*3 - 4n*2 + 10n - 27. Calculate t(5). 48 Let u(n) = -6n + 572. Calculate u(96). -4 Let j(i) = 2i*3 - 33i*2 - 21i + 317. Calculate j(16). -275 Let n(m) = m*2 - 59m - 9. Give n(0). -9 Let w(g) = 113g + 426. What is w(-3)? 87 Let o(q) = -2q*3 + 44q2 - q - 878. Calculate o(21). -17 Let d(r) = -r3 - 26r2 + 177r + 6. What is d(6)? -84 Let d(w) = w*3 + 12w*2 - 70w - 34. What is d(-17)? -289 Let i(d) = d*3 - 16d*2 + 204d - 4324. Give i(18). -4 Let t(r) = r*3 + 30r*2 + 193r + 94. What is t(-21)? 10 Let x(m) = 271m + 6387. Calculate x(-23). 154 Let x(u) = u2 - 18u + 156. Determine x(6). 84 Let p(z) = 2z3 - 20z*2 + 22z - 199. Determine p(10). 21 Let a(d) = 35d - 1601. What is a(46)? 9 Let y(u) = -3u*3 + 22u*2 - 25u + 111. Determine y(7). -15 Let b(i) = -i*3 - 55i*2 + 131i + 940. Determine b(-57). -29 Let c(m) = -74m3 + 3m*2 - 4m. Calculate c(1). -75 Let w(x) = 29x - 401. Give w(21). 208 Let a(j) = -2j*3 - 15j*2 + 120. Give a(-7). 71 Let i(t) = 2078t + 10386. Determine i(-5). -4 Let t(o) = 23o3 + 3o*2 + 7o + 7. What is t(-2)? -179 Let x(p) = 2681p - 8088. Give x(3). -45 Let d(p) = -14p + 129. What is d(7)? 31 Let b(q) = -7q3 + 20q*2 + 7q. Determine b(3). 12 Let w(b) = b*3 - 7b*2 - 36b - 72. What is w(-6)? -324 Let i(y) = y*2 - 8y + 40. Determine i(4). 24 Let c(v) = 4848v + 48501. Calculate c(-10). 21 Let f(k) = -252k + 481. Determine f(2). -23 Let c(y) = 6y3 + 281y*2 - 43y + 177. Determine c(-47). -11 Let x(m) = 2m2 - 47m + 220. What is x(17)? -1 Let k(y) = 77y - 150. Calculate k(2). 4 Let u(z) = 139z*2 - 1661z - 87. Give u(12). -3 Let y(v) = 2v2 - 51v - 1631. Determine y(44). -3 Let f(h) = 2h2 - 51h + 226. What is f(6)? -8 Let i(h) = -h*2 + 55h + 160. What is i(-3)? -14 Let d(l) = 59l - 1415. What is d(24)? 1 Let b(k) = -k2 - 823k + 18599. What is b(22)? 9 Let y(w) = -2w2 - 225w - 975. Calculate y(-108). -3 Let i(s) = -s*2 - 14s + 390. Calculate i(14). -2 Let q(a) = -3a3 - 279a*2 + 283a + 102. Determine q(-94). 8 Let g(a) = -3a3 + a2 - 2a - 20. Calculate g(0). -20 Let b(j) = j*3 - 6j*2 - 35j + 68. What is b(9)? -4 Let j(i) = -118i - 455. Determine j(-4). 17 Let b(w) = w2 + 560w + 2780. Calculate b(-5). 5 Let b(m) = 4m3 + 33m*2 - 90m + 39. Give b(2). 23 Let d(i) = 2i2 + 96i + 403. What is d(-43)? -27 Let z(d) = -d2 + d + 119. Determine z(0). 119 Let c(t) = t2 + 7t - 16. Give c(-9). 2 Let y(q) = -8q + 176. Give y(11). 88 Let l(f) = -771f + 5400. What is l(7)? 3 Let b(r) = 3r + 102. Determine b(-18). 48 Let z(r) = r*2 + 168r + 337. Calculate z(-2). 5 Let w(n) = 99n - 5156. Give w(52). -8 Let t(r) = -r3 + 12r*2 + 4r - 52. Give t(12). -4 Let l(n) = 88n + 916. Calculate l(-10). 36 Let w(l) = -461l*2 + 1388l - 44. What is w(3)? -29 Let u(j) = -906j + 64325. Give u(71). -1 Let d(f) = 51f*2 - 457f - 5. Determine d(9). 13 Let b(s) = -65s2 + 2s + 126. Determine b(0). 126 Let h(c) = 41c + 785. What is h(-19)? 6 Let b(r) = -118r + 1311. Give b(11). 13 Let h(w) = w*3 - 36w*2 + 67w - 34. Calculate h(34). -68 Let w(u) = -4u + 379. Give w(48). 187 Let y(f) = 27f*3 - 237f*2 - 54f - 19. What is y(9)? -19 Let r(v) = -2v2 - 3v - 212. What is r(0)? -212 Let v(l) = 8l2 - 16l - 184. Determine v(-4). 8 Let g(n) = 253n + 740. Calculate g(-3). -19 Let x(p) = -303p + 1186. Give x(4). -26 Let x(h) = h*3 - 3h*2 - 50h - 13. Give x(7). -167 Let j(c) = c*3 + 31c*2 - 103c - 43. Give j(-34). -9 Let f(d) = -d*2 - 347d + 12564. What is f(33)? 24 Let m(o) = -22o - 497. Calculate m(-33). 229 Let b(m) = 114m*2 - 2138m - 531. Give b(19). 1 Let m(i) = -5i2 + 23i + 116. Calculate m(-5). -124 Let k(s) = -3s2 + 275s + 1670. Calculate k(-6). -88 Let q(k) = k*3 - 36k*2 + 15k - 82. Determine q(35). -782 Let s(q) = 105q + 19074. What is s(-181)? 69 Let w(f) = -83f + 1117. Determine w(14). -45 Let	{ "pile_set_name": "DM Mathematics" }
2 Expand (23a2 - 87a*4 - 23a*2)(2a + 3 - 3). -174a*5 Expand (-4 + 2 + 3)((-7a4 + 5 - 5)(-1 + 1 - 2) - 2a4 + a4 - a4). 12a*4 Expand 4c*4 + 0c*4 - 3c*4 + (c + 3c*2 - c)(-2c2 + 3c*2 - 3c*2) + 3c*3 - 3c3 - c4 - 2c4 + 4c*4 - 3c*4. -7c4 Expand (n2 + 4n - 4n)((5n + 4n - 6n)(3n2 + 4 - 4) + n3 - 3n3 + n3). 8n*5 Expand (-2m + 1 + 1 - 1)(5m - 6m2 - 5m). 12m3 - 6m*2 Expand 602 - 75m - 602 + m + 2m - 5m - 3m - m + m + (2 + 2 - 6)(m - m - m). -78m Expand (2k*4 + 5k + 111k2 - 111k*2)(-3 + 2 - 4). -10k4 - 25k Expand (2 - 4 - 2)(2 + 2 - 3)(5u - u - u). -12u Expand (-3v - 4v + v)(2v*3 + 2v*2 - 2v*2) + (-3v + 3v - 3v*2)(0v2 + v2 - 2v*2). -9v4 Expand (-z2 + z - z + (0z - 2z + 0z)(-z + 3z + 0z) + z*2 + 4z - 4z + 3z + z*2 - 3z - 2z2 + z2 + 3z*2)(-4z2 + 4z2 + z2). -z*4 Expand (0 - 3 + 0 + 2c)(2c - c + 0c)(5c + 2c*2 - 5c). 4c4 - 6c*3 Expand 3t*2 - 5t*2 + 4t*2 + (-1 + 2 + 0)(t2 - t2 - t2) + t2 + 2t2 + 3t*2. 7t*2 Expand 3n - 4n + 4n + (n + 3n - 2n + (1 - 2 + 0)(-n + 2n - 2n))(0 + 0 + 1). 6n Expand (-3 + 3v*3 + 3)(-v + 2v - 7 + v). 6v*4 - 21v*3 Expand 0l*5 - 4l*5 + 2l*5 + (-2l*3 + 0l*3 - 2l*3)(21l2 + 40l - 40l). -86l*5 Expand (-2m*3 + 0m*2 + 0m*2)(-1 - 2m + 1) + m4 - 2m*4 + 0m*4. 3m*4 Expand (4u*3 - 15u*3 + 6u3 - u2)(-2 + 0 + 6). -20u*3 - 4u*2 Expand (2 - 2o*2 - 2)(-3o2 + 5 - 5) - o4 - 2o*3 - 2o*3 + 0o4 + o2. 5o4 - 4o3 + o2 Expand -37q4 - 226q*3 + 226q3 + (-q3 - 2q3 + 5q*3)(3 - 2q - 3). -41q*4 Expand -5c*2 - 7 + 7 + (2c - 2 + 2)(0c - c + 0c) + 4c*2 - 2c2 - c2 + 4c2 - c2 - 5c*2. -8c*2 Expand (1 + 2g*3 - 1)(-g - 2g + 4g) + (4g4 + 4g*4 - 5g*4)(-2 - 1 + 0). -7g4 Expand (4v*2 + 2v*2 - 4v*2)(10 + 2v - 10) + (-v + 2v + v)(-2v*2 + 2v*2 + 3v*2). 10v*3 Expand 5d*4 - 4d*4 + 2d*4 + 0d*4 - 2d*4 + 3d4 + (d4 + 0d4 + d4)(-2 + 1 + 2). 6d4 Expand (-b - 2b - 1 - b)(-5b + 5b - 3b). 12b2 + 3b Expand (0p - p - p)(-5p + 9p*2 + 5p). -18p3 Expand -3 + 3 - r2 + (-18r - r + 5r)(-5r + 2 - 2). 69r*2 Expand ((0 - 1 + 0)(0 + 2 - 3) - 2 - 1 + 1)(-5c + 2c + 0c). 3c Expand (4 - 4 - 4)(-5 + 5 + 4j) + 2j - 4j + j. -17j Expand (0a4 - 2a4 + a2 - 2a2)(7a + 2a + 0a) + 3a5 - a5 + 0a5. -16a*5 - 9a*3 Expand (-4w*5 - 2w*5 + 5w*5)(-3 + 4 + 0)(-4 + 3 + 7). -6w5 Expand (-3 + 3 + z4)(6z - 3z + 4z) + (2z4 - 3z*4 + 2z*4)(2 - 2 - z). 6z5 Expand 6j + 4j2 + 3 - 1 - 4j + 3j2 - j2 - 3j*2 + (-1 + 0 - 1)(-5j2 + j2 + 2j*2). 7j*2 + 2j + 2 Expand (1 + 2 + 2)(-7k*4 - 2k*5 + 7k*4). -10k*5 Expand (0 - 2w + 0)(w2 - w3 - w2) + 2w*4 - 2 + 2 + 2w*4 + 2w*4 - 3w*4 - 4w*4 + 2w4 + w4 + (14w3 - 4w*3 + 4w*3)(-3w + 4w + 0w). 18w*4 Expand (-4y*3 + 4y3 + y4)((2 + 0 + 0)(-9 - 7 + 5) + (-4 - 1 + 3)(0 - 1 - 1) + 3 - 5 + 1). -19y*4 Expand (5 - 2 - 4)(-2d4 + 0d*2 + 0d*2) + 0d*4 + 0d4 - d4 + 0d4 + 5d*4 - 27d*4. -21d*4 Expand (-16 - 6 + 17)(1 - 3 + 1)(2h + 2h - 3h)(0 - 2 - 1). -15h Expand (-4 + 6 - 4)(7 + 2 - 5)(g + g - 3g)(-2 - 2 + 2). -16g Expand (-4 + 2k + 4)(-2 + 2 - 2k)(-4k - 2k2 + 4k). 8k4 Expand (2h*3 + 0h*3 - 3h*3)(-44h - 80h + 46h) - 3h*4 - 2h*4 + 3h*4 + 2h*3 - 2h*3 + 2h4 + (1 - 1 - h2)(-3h + 3h - h2). 79h4 Expand c3 + 2c + 0c*3 + 2c*3 + (-c - c + 0c)(-2c*2 + 5c*2 - 5c*2) - 3c*3 - 2c*3 + 2c*3. 4c*3 + 2c Expand (-v*3 + 2v - 2v)(-v + 2v + 0v)(1 - 7 - 8). 14v*4 Expand -19u*4 - 4u*4 + 0 - 1 + (5u - 4u - 2u)(u - 2u*3 - u). -21u*4 - 1 Expand -2 - 4l - 3l + 2l + (-2 + 0 - 1)(2l - 2l + 2l). -11l - 2 Expand (6a - a - 3a)(-7 - 8a + 7). -16a*2 Expand (4 - 1 + 4)(2o3 - o2 + o2). 14o*3 Expand (1 + b - 1)((2 - 1 + 0)(-2b + 3b + 4b) - 4b + b + 2b). 4b2 Expand (w + 2w - w)((1 + 5 - 4)(-3 + 5 + 0) + 1 + 4 - 2)(1 + 2 - 1). 28w Expand (-2x2 - x2 + 0x*2)(1 - 1 - 2x3 + 3x - 3x + x3 - 3x*3 - 2x*3 + 7x*3 + (-3x + 4x + 0x)(-4x + 2x2 + 4x)). -9x5 Expand (30m*2 + 15m*2 - 3m*2)(-2m3 - m + m). -84m*5 Expand (-2 + 1 + 2)(5v - 9v - 5v). -9v Expand -8f2 + 4f*2 + 0f*2 + (1 - 4f - 1)(-2f - 2 + 2). 4f2 Expand 3b*4 + 0b*4 - 2b*4 + (-4b + 2b2 + 4b + (-4b - 2b + 3b)(0 - 2b + 0))(-b*2 - 2b*2 - 8b*2). -87b4 Expand -c5 + 0c5 + 4c*5 + (-2c*4 - 1 + 1)(-1 - c + 1) + c*5 + c - c - 3 + 3 - 2c5 + (c4 + 2c2 - 2c*2)(-2 + 2 + c). 5c5 Expand (0l - 2l + 0l)(-l + 2l*2 + l) + (2l - 2l + l)(4 - l*2 - 4) - 2 - 2l*3 + 2. -7l*3 Expand (0 - 6 + 4 + (3 + 3 - 2)(0 + 3 - 2))(4 + 2 - 3)(3c + 4c - 2c). 30c Expand -2 + 2 - t + (-2 - 1 + 1)(2t + 4t - 4t) + 5t + 2t + 5t. 7t Expand (-1 - 2 - 3)(2 + 4y - 2). -24y Expand (0 - 5h + 0)(-4h*2 + 4h - 5h + 2h*2). 10h*3 + 5h2 Expand ((-k2 + 2k - 2k)(0k - 4k + 5k) + k*3 + 2k*3 + 7k*3)(0 + k + 0 + (4 - 3 - 3)(-2k + 0k + k) + 0k - 4k + 3k). 18k4 Expand (-15w + 29w + 5w)(-3w + 3w + w2) + (2 - 2 + w)(-9 + w*2 - 2w + 9). 20w3 - 2w2 Expand (i2 - 2i2 + 0i*2)(5 + 2 - 4). -3i2 Expand (2 - 2 + 2v*3)((3 - 4 - 1)(-2 + 3 - 2) - 3 + 7 - 3 + 4 - 3 - 3 - 28 - 28 - 9). -128v*3 Expand 2h*3 + 0h3 - h3 + (5 - 5 + 8h)(5h2 - 5h*2 - 2h - 2h2). -15h*3 - 16h*2 Expand 0m + 0m + 2m + 0m - 6m + 4m + (2 + 3 - 3)(-4m + 0m + 2m) - 5m + 4m - m. -6m Expand (3s3 + 10s - 10s)(2 + 1 - 4)(3s - 4s - 2s). 9s4 Expand (0 + 1 + 1 + (1 + 1 - 4)(2 - 2 + 1) - 2 + 1 - 1)(-2f4 + f4 - 12f4) + 2f*4 - 3f*3 + 3f*3. 28f*4 Expand (-8 - 5 - 4)(-2o2 - 4 + 4). 34o*2 Expand (-3 + 3 - 1)(4x - 5x - x + 5x - 2x - 5x + (-2 - 3 + 4)(-1 + 2x + 1) + 2x - x + 0x). 5x Expand -2q2 + 2q*2 - 3q*2 + (-1 + 1 + 2)(1 + 2q2 - 1) + 6q*2 - 3 - 4q*2 - 3. 3q*2 - 6 Expand ((-5d + 2d + 4d)(0d + 0d - 2d*2) + 2d - d*3 - 2d - d*3 + d - d)(-d - 3d + 2d). 8d4 Expand (-5 + 3 + 1)(0 + 4 - 3)(h + 4 - 4)(2h2 + 14h - 14h). -2h*3 Expand (3u + 0u - u + (2 - 5 + 5)(4u - 3u + u))(14u - 14u + 10u*2). 60u*3 Expand (4 - 4 + 4t*2)(-2 + 2 - t)(-5t + 4t + 0t)(-3 + 5 + 1). 12t*4 Expand (2 - 4 + 4)(4 - 3 + 0)(0l + 4l + 0l). 8l Expand (2o*4 - 2o*4 + 2o*4)(-3o + 12o - 4o)(-1 + 2 + 5)(1 + 0 - 3). -120o*5 Expand (0v + 3v + 0v)((-3 + 0 + 4)(3v2 - 3v*2 + 2v*4) - 8v*3 - 13v*4 + 8v*3). -33v*5 Expand (-6d*2 + 4d2 - d2)(-4d3 + d3 + 2d3) - 7d*5 + 2d*5 + 9d*5. 7d*5 Expand (5m*2 + 2m*2 + 0m*2)(0m2 - m3 + 0m*2). -7m*5 Expand c + 2c*2 - c + 0c*2 + 3c2 + c2 + 0c2 + 0c*2 + 2c*2 - 4c*2 + 2c2 + c2 + (-2 + 2 + 2)(-7c*2 + 4c*2 + 2c*2). 5c*2 Expand k + 1 - 1 + (3 - 2 + 1)(3k - 5k + 5k). 7k Expand 2l2 - 3l*2 + 2l2 - l2 + l + 0l + 0l*2 - 3l + 3l2 + 3l + (3l - 5l + 3l)(0 + 0 + 2l). 5l*2 + l Expand -3q + 3q - 3q*3 + (0q*2 + 2q*2 + 0q*2)(q - 1 + 1) + (4q3 - 2q*3 - 4q*3)(-2 + 2 - 2). 3q3 Expand (-3 + 0 + 6)(3 + 2 - 6)(2 - 2 - k) + (4k + 0k - 2k)(4 + 2 - 5). 5k Expand (-3s + 2s + 2s)(-5 + 2 + 5)(-1 + 1 - 1). -2s Expand (-4j3 + 2j*3 - 2j2 + j2)(22j + 279 - 279). -44j4 - 22j*3 Expand (-5s*2 + 0s*2 + 24s*2)(-2s2 + 2s*2 - 2s*2). -38s*4 Expand (-3h*2 + 2h2 - h2)(0h*2 + 2h*3 + 0h*2) - 5 + 5 - 3h*5 - 3h*5 + 2 + 2h*5 + 3h5 + h2. -5h5 + h2 + 2 Expand (-9 - 17 + 5)(g - 2 + 2). -21g Expand 2 - 2x - 2 + (0 + 2x + 0)(3 + 2 - 7) + 2 + 2x - 2 - 7x - x - 11x. -23x Expand (-v - 2v + v)(-2 + 3 - 2)(2 - 14 - 15). -54v Expand 4g - 4g + 6g2 + (0g + 0g + 2g)(-6g + 3g + g). 2g*2 Expand (-2v*2 + 1 - v - 1)(0 - 1 + 3 + 1 - 2 + 0 - 4 + 2 + 4 + 2 + 1 - 1 + (-5 + 0 + 3)*(-6 +	{ "pile_set_name": "DM Mathematics" }
he second derivative of -vy5 + 0y*2 - 2y + 0y3 + 0 + 1/18y*4. Solve a(l) = 0 for l. 0, 1 Factor 7k + k - 5k3 - 110k*2 + 156 + 0k - 46 - 3k. -5(k - 1)(k + 1)(k + 22) Let z(s) be the second derivative of -s*6/40 + 3s*5/80 + 7s4/16 - s3/8 - 9s2/4 + 121s. Suppose z(n) = 0. Calculate n. -2, -1, 1, 3 Suppose 2g - 2 - 4 = 0. Suppose 5r + gu = 24, u + 0 = -3r + 12. Factor -5wr - 4w*2 - 4w3 + w3. -4w2(2w + 1) Let y(l) be the first derivative of 2l*3/21 - 4l*2 - 120l/7 + 319. Find j, given that y(j) = 0. -2, 30 Let r(k) be the third derivative of -k5/240 - k4/8 - 5k3/6 - 2k*2 - 9. Factor r(o). -(o + 2)(o + 10)/4 Let u(g) be the third derivative of -g6/720 + g5/72 + g*4/3 - 7g*3 - 70g2 + g. Factor u(w). -(w - 6)2(w + 7)/6 Let o(k) be the third derivative of k6/120 - 2k*5/15 + 5k*4/24 + 7k*3/3 - 82k*2. Factor o(s). (s - 7)(s - 2)(s + 1) Let n(l) = -7l*5 - 3l*4 + 2l*3 - 2l*2. Let q(w) = 4w*5 + 2w4 - w3 + w*2. Let m(a) = 3n(a) + 5q(a). Factor m(j). -j2(j - 1)*2(j + 1) Let k(i) be the third derivative of -i8/60480 + i6/6480 + 3i4/8 - 34i*2. Let a(m) be the second derivative of k(m). Find b, given that a(b) = 0. -1, 0, 1 Let a be 4(-17)/408-8. What is p in 10/3p*3 + ap - 14/3p2 + 0 = 0? 0, 2/5, 1 Let y be (-431)/(-4) - (-16)/64. Let s be 1 + (1/4 - 111/y). Factor sc*3 - 4/9c - 2/9c2 + 0. 2c(c - 2)(c + 1)/9 Let c = 741/415 + 6/415. Find f such that c - 6/5f - 3/5f*2 = 0. -3, 1 Suppose -15 + 22 = 7y. Let x be (-12 - -11)0/(2 - y). Factor x - 1/3d*4 - 1/3d*5 + 1/3d*3 + 0d + 1/3d2. -d2(d - 1)(d + 1)2/3 Suppose 5v + 340 = 5t, -v + 25 + 51 = t. Suppose tg - 4g2 - 31 - 347 + 54 = 0. Calculate g. 9 Let i(c) be the third derivative of 1/390c*5 - 17c*2 + 4/39c*3 + 0c + 1/39c4 + 0. Factor i(p). 2(p + 2)*2/13 Factor -13/2j*2 - 6 + 25/2j. -(j - 1)(13j - 12)/2 Let u(o) = 4o2 + 3o - 3. Let p be u(1). Factor 8n5 + 0n*p + 3n*3 - 4n*4 - 7n*3. 4n*3(n - 1)(2n + 1) Factor 4 + 2c4 + c4 - c5 - 8c*3 + 9c*3 - 7c2. -(c - 2)2(c - 1)(c + 1)*2 Let i be 5 - 0(-2)/4. Suppose 3d + d - 30 = -iz, -29 = -2z - 5d. What is q in -6qz + 3q*2 + 6q*2 + 6q = 0? -2, 0 Let y(a) be the second derivative of 1/5a2 + 3a + 1/30a4 + 0 + 1/6a*3. Find d, given that y(d) = 0. -2, -1/2 Let m(g) = 147g + 444. Let h be m(-3). Find w such that -3/4wh + 0 - 3/4w + 3/2w2 = 0. 0, 1 Let c(o) be the first derivative of 1/21o*4 - 7 - 6o + 0o3 + 0o*2 - 1/70o*5. Let h(d) be the first derivative of c(d). Factor h(v). -2v*2(v - 2)/7 Let y(w) be the first derivative of -2w5/45 + w4/18 + 26w*3/27 - 25w*2/9 + 8w/3 + 153. Let y(u) = 0. What is u? -4, 1, 3 Let v be (10/(-72)1)/(16/(-128)). Find s, given that 2/9s + 0 - 2/3s3 + 2/9s*2 - 4/9s*5 - vs*4 = 0. -1, 0, 1/2 Let q be (112/21 - 4) + 1 + (5 - 7). Let a be 3/(-4)(-10)/9. Suppose -3/2b2 + ab*3 + 7/6b - 1/6b4 - q = 0. What is b? 1, 2 What is f in 2/5f - 1/5f2 + 8/5 = 0? -2, 4 Let v = 48 + -39. Suppose -4n + j + 9 = n, 3j - v = -3n. Factor 2/5z3 - 1/5z*4 - 1/5 - 1/5z*5 - 1/5z + 2/5zn. -(z - 1)2(z + 1)*3/5 Let f(r) be the first derivative of -2r*3/9 - 50r*2 - 3750r + 87. Factor f(w). -2(w + 75)2/3 Let z = -2686/3 + 886. Let h = 83/6 + z. Suppose 18s*2 + 15s*3 - 3 - 3s*4 + 3/2s - hs5 = 0. Calculate s. -1, 1/3, 2 Let 33m*3 + 3m*4 - 3m*4 + 2m*4 - 29m*3 = 0. What is m? -2, 0 Let h = 18 - 16. Suppose 25c*3 + 50c*2 + 33c*2 + 10c - 28ch = 0. Calculate c. -2, -1/5, 0 Let c(s) = -2s - 2. Let x be c(-2). Let g be (-5 - (2 - 8))2. What is a in a3 + 9a + 2a3 + xa*2 - 16a*2 + 2a*g = 0? 0, 1, 3 Suppose -7o + 10o = 12. Determine d so that 34d*2 + 0d*4 - 6d*3 + 2d*o - 30d*2 = 0. 0, 1, 2 Let f(u) = -9u*2 - 6u - 4. Let o be f(6). Let l = -1435/4 - o. Factor 15/4p4 - 27/4p*3 - 3/2p + lp2 + 0 - 3/4p*5. -3p(p - 2)(p - 1)3/4 Let h(a) be the third derivative of a5/20 + 21a4/4 + 441a*3/2 + 2a*2 - 140a. Factor h(p). 3(p + 21)2 Let v(b) = -2b4 + b2 - 1. Let y(k) = -16k4 - 18k*3 - 41k*2 - 32k - 7. Let x(r) = -14v(r) + 2y(r). Factor x(c). -4c(c + 1)(c + 4)2 Let j(w) be the third derivative of -w6/120 + w5/15 - w4/8 + 14w*2. Let f be j(2). Solve 3/4r*3 + 0 + 3/4r - 3/2rf = 0. 0, 1 Let c = 3065 - 3063. Factor 3/10n + 0 + 1/10nc. n(n + 3)/10 Suppose -41l + 46 = -18l. Solve 0 + 2/5v + 2/5vl = 0. -1, 0 Let m(b) = -b5 + b4 + b3 + b - 1. Let k(l) = 40l5 - 50l*4 - 45l*3 + 60l*2 - 75l + 35. Let t(r) = k(r) + 35m(r). Factor t(n). 5n(n - 2)2(n - 1)(n + 2) Suppose -2v - v = -f - 20, 2f + 5v - 4 = 0. Let t = -6 - f. Factor -y2 + y2 + 3y + 2y2 + yt. 3y(y + 1) Let w = 20063 + -60181/3. What is d in -8/3d + w + 2/3d*3 - 2/3d*2 = 0? -2, 1, 2 Let k(x) = -1. Let c(v) = -3v*2 + 3v + 12. Suppose 17 = 5d - 13. Let m(s) = dk(s) + c(s). Solve m(n) = 0. -1, 2 Let p be ((-28)/126)/(((-40)/6)/5). Let k(x) be the third derivative of 0x + 0 + px*4 + 6x*2 - 1/30x*5 + 0x*3. Determine m so that k(m) = 0. 0, 2 Let z(l) be the first derivative of 2l*6/15 + 2l5/5 + l4/3 + 2l - 13. Let s(q) be the first derivative of z(q). Solve s(u) = 0 for u. -1, 0 Determine h so that -13h*5 + 4h*2 - 16h*3 - 68h*3 + 14h*2 + 50h*4 + 5h*5 = 0. 0, 1/4, 3 Suppose -561y*3 - 569y*3 + 1132y*3 + 12y*2 = 0. Calculate y. -6, 0 Suppose 0 = -3o - 2o + 4c + 1016, -413 = -2o - 5c. Let b = o - 2650/13. Solve -2/13g2 + 8/13 + bg*3 - 8/13g = 0 for g. -2, 1, 2 Let v(p) be the third derivative of -1/10p5 + 0p*3 + 0p*4 + 0 - 5p*2 - 1/16p*8 + 1/35p*7 + 7/40p*6 + 0p. Find t, given that v(t) = 0. -1, 0, 2/7, 1 Let n(d) = 2d2 - 47d - 69. Let c be n(25). Let i(w) be the first derivative of -2/5w5 + w2 + 3/2w*4 + c - 2w*3 + 0w. Factor i(v). -2v(v - 1)*3 Suppose 2n + 10 = 0, -2t + 4n = 3t - 20. Let d be 2 - t/(-6 - -5). Factor 4/3 + 4x + 3xd. (3x + 2)*2/3 Suppose -848/3g*2 - 8g*4 + 1/3g*5 - 1024/3 + 212/3g*3 + 512g = 0. What is g? 2, 4, 8 Let -4c2 + 4c*2 + 6c2 + c3 - 8c2 = 0. What is c? 0, 2 Let l(t) = t2 + 16t - 54. Let u be l(-19). Let i(o) be the first derivative of 5 + 4/11o - 2/33o*u - 1/11o*2. Factor i(b). -2(b - 1)(b + 2)/11 Let i(h) = -h3 - 11h*2 - 11h - 8. Let l(x) = -x*3 - 2. Let c be l(2). Let w be i(c). Factor -1/3v + 1/3vw + 0. v(v - 1)/3 Let h(p) = -6p4 + 388p*3 + 394p*2 - 8. Let m(j) = 11j*4 - 776j*3 - 787j*2 + 14. Let n(l) = -7h(l) - 4m(l). Factor n(a). -2a*2(a - 195)(a + 1) Let w(a) = -a + 10. Let m be w(5). Let v be (6 - 2) + -1 + m. What is l in 3l*2 - l - l + vl = 0? -2, 0 Let d(t) be the first derivative of 4t3/3 - 52t*2 + 100t - 86. Solve d(o) = 0 for o. 1, 25 Let q(a) = -3a - 13. Let w be q(-6). Suppose -f = 3 - w. Factor 8b*4 - 3b4 - b2 - b*2 - 3b*f. 5b*2(b - 1)(b + 1) Let c(b) be the third derivative of b8/11200 - b7/2100 - b6/400 + b4/24 + 10b*2. Let a(g) be the second derivative of c(g). Factor a(p). 3p(p - 3)(p + 1)/5 Let -149/2l + 2l*4 - 91/2l*3 - 219/2l*2 - 25/2 = 0. What is l? -1, -1/4, 25 Let w(b) be the first derivative of -3b5/5 - b4/4 + 2b3/3 - 57. Factor w(c). -c2(c + 1)(3c - 2) Let r(b) be the first derivative of -b*4/4 - 5b*3 - 19b*2 - 24b - 183. Suppose r(c) = 0. Calculate c. -12, -2, -1 Let a(h) be the first derivative of 1/2h - 1/4h*4 - 10 - 1/10h*5 + 0h*3 + 1/2h*2. Factor a(g). -(g - 1)(g + 1)*3/2 Let t be (-14)/6(-318)/371. Factor -1/4x3 - 1/4 + 1/4x + 1/4xt. -(x - 1)2(x + 1)/4 Let y = 2179/6 - 363. Let u(m) be the second derivative of 0 - ym4 + m2 + 3m + 1/3m3 - 1/10m*5. Factor u(x). -2(x - 1)(x + 1)2 Suppose -9b + 116 = -5b. Suppose -4j - 29 + b = 0. Let 0w3 + 0w + 1/3w4 - 1/3w2 + j = 0. What is w? -1, 0, 1 Let h(m) be the third derivative of m7/840 - m6/480 - m5/40 - 94m2. Suppose h(t) = 0. What is t? -2, 0, 3 Let x(v) be the first derivative of v5/20 - 5v**4	{ "pile_set_name": "DM Mathematics" }
form ul2 + t + fl and give u. 75 Rearrange 692b3 - 479b*3 + 2b2 - b2 to ub3 + yb + ab2 + o and give u. 213 Express -2791i*4 - 2 + 5546i*4 - 27i - 2773i4 + 3i in the form fi4 + vi*2 + o + ui*3 + wi and give o. -2 Rearrange -2t3 - t3 + 2t*4 - 3t*3 + 5 + 5t*2 + 4t*3 - 38t - 7t2 to the form vt*3 + zt + ft2 + it*4 + r and give v. -2 Rearrange 124 + 87o2 + o2 + 2o3 - 126 to the form yo*2 + r + xo + mo3 and give y. 88 Rearrange -1 + f3 - 3676f*2 + 3676f*2 + 56f + 0 to l + xf2 + tf*3 + sf and give l. -1 Rearrange (-2g2 + 3g*2 - 3g*2)(2 - 1 - 2)(4 - 4 + 1)(-19g - 38g - 4g) to the form ng*2 + xg*3 + lg + m and give x. -122 Rearrange (4a3 + a3 - 4a*3)(-81a + 103099 - 103099) + 4a4 - a4 - 4a4 to b + za*4 + da + wa3 + ca*2 and give b. 0 Express (-5 - 30l*3 + 28l*3 - 2)(-5l + 2l + 5l - 2l + 0l + l + (-4 + 4 + 2)(-l + l + 2l)) as rl*4 + nl*2 + al + u + jl3 and give r. -10 Rearrange (-1 - d2 + 1)(-231 - 29d + 231) + (-12 - 11d + 12)(4d + d*2 - 4d) to the form pd + xd*2 + r + zd*3 and give z. 18 Rearrange -5 - 153m4 + m - m3 + 309m4 - 155m*4 to r + lm + zm4 + fm*3 + im*2 and give i. 0 Rearrange -f + 3 - 2f + 0f + (5f - 2f - 4f)(-2 + 3 - 2)(0 + 2 - 5) to sf + t and give t. 3 Rearrange 11f*2 - 2f*4 - 2f3 - f2 - 16f + 17f to the form jf + af*4 + m + of*3 + if*2 and give j. 1 Express (-7t*3 + 5t*3 - 3t*3)(-16t + 90 - 90) in the form pt*3 + u + mt + xt4 + bt*2 and give x. 80 Express (2 - 2 - 3x + (4x + 0x - 6x)(1 - 3 + 0))(-5 - 1 - 5) + 0 + 0 - 2x + (2 - 3 + 0)(-x + x + 2x) - 1 + 1 - 7x as a + px and give a. 0 Rearrange -61 + 127 + 0h2 - h2 + 3h*3 - 67 to zh*2 + fh + n + th3 and give n. -1 Rearrange -19a*4 + 2a*3 + 56 - 6a*3 - 55 + 15a*4 to the form u + xa + ma2 + qa*4 + ha*3 and give u. 1 Express (-200 + 169 - 128)(2 + 2m - 2) as sm + b and give s. -318 Express (1303 - 77b - 1303)(b + 0 + 1 - 3b) as m + sb + db2 and give s. -77 Express h2 - 409h - 2 + 414h + 1 + 3h*4 + 0 as uh + wh2 + th*4 + kh*3 + n and give w. 1 Rearrange -94w*3 + 128w*3 + 150w3 - w2 to the form qw3 + k + fw + uw2 and give q. 184 Rearrange (1 - 1 - 2)(0 - 2g + 0) + 1927 - 141g - 967 - 972 to v + yg and give y. -137 Rearrange -497k + k2 - k3 + 4k4 - 487k + 3 + 984k to the form bk*2 + fk*3 + ik + wk4 + j and give b. 1 Express (0z + z - 2z)(-3z + 0z + 2z) - 770z*2 + 1477z*2 - 2z + 2z + 3871z*2 as rz*2 + m + hz and give r. 4579 Express (-5 - 10 + 2)(2 - 2 - 3l) + l - 3 + 3 as y + gl and give g. 40 Rearrange (-3y + 3y + 13y)(-1 + 6 - 1) - 2y + y + 5y to zy + k and give z. 56 Rearrange 10o + 6o - 25o to m + so and give s. -9 Rearrange -6 - 10 + 3g3 + 3g2 - g3 + 17 to the form ig2 + cg*3 + hg + y and give y. 1 Express (-2 - 2 + 2)(-6d + 12 - 12)((-1 + 0 + 0)(-4 - 1 + 4) + 2 - 3 - 3) as kd + n and give k. -36 Express -3f + 6914f4 + 4f*2 + 3f*3 + 3f - 6916f4 in the form xf*4 + mf*2 + jf*3 + sf + t and give j. 3 Express (2g2 + 12g*3 - 2g*2)(-9 + 15 - g - 7) as cg3 + fg*4 + zg*2 + ug + i and give f. -12 Express 5421n + 4192n - 8120n as yn + h and give y. 1493 Express (16 + 11 + 7)(0 - 2 + 4)(2b - 4b - 7b - 3b + 3b - 2b + (2b - 3b - b)(-2 + 1 + 2)) as zb + g and give g. 0 Express -60 - 3h2 + 62 + 5h - h - 3h as mh + yh2 + i and give i. 2 Express (2 - 2 - 2)(4v3 - v3 - 2v*3) + 2v*2 - 2v*2 + 3v*3 - 18943v*2 + 18943v*2 + 150v*3 as x + rv*2 + qv*3 + jv and give q. 151 Rearrange (4o - 2 + 2)(117o - 59o + 4 - 59o) to the form ao*2 + bo + l and give b. 16 Rearrange -2p2 - 8 - 1143p + 2303p - 39p*3 - 1160p + 2p4 to the form xp*4 + v + np*3 + tp + qp2 and give v. -8 Rearrange (11 - 4 + 1)(-4 + 9 + 3)(0 + 2c + 0)(-3c*3 - 10c*3 + 4c*3) to the form ac*4 + n + ic + dc3 + hc*2 and give a. -1152 Rearrange (-4 - 1 + 4)(37 - 19 - 11)(2w + 12 - 12) to vw + m and give v. -14 Rearrange -8 - 240d - 756d - 6d + 8 to o + pd and give p. -1002 Rearrange 11 + 299m - 7 - 4 to hm + t and give h. 299 Rearrange 20c*3 + 70c + 30c + 3 - 97c to the form vc3 + sc*2 + bc + i and give b. 3 Rearrange 4p + 24p*2 - 26p*2 - 8 + p to vp + z + rp2 and give v. 5 Express (-8x - 8x + 3x)(11x + 5 - 39 - 10x) as tx*2 + z + kx and give t. -13 Rearrange 5q2 + 3 - q - 1017q*4 - 3q*2 + 1011q*4 to the form nq*2 + cq + u + jq4 + lq*3 and give u. 3 Express -2q*2 - 269 + 269 - 8q in the form r + fq + wq*2 and give w. -2 Rearrange (4351y - 4512y + y2 + y2)(1 - 1 - 2) to oy2 + b + cy and give o. -4 Rearrange (-352 - 173 - 535 + 194)(-4w*2 + 4w*2 - 8w*2) to the form a + pw + xw2 and give x. 6928 Express (0 + 0 + 2)(-160f - 221f + 116f)(-f - f + 0f)(1 - 1 - 9) in the form hf + a + nf*2 and give h. 0 Express (1 - 2 + 2 + (20 + 2 - 151)(-2 - 1 + 1))(3y - 2y + y) in the form ty + x and give t. 518 Express (3 + 8 + 4)(0a*4 - 3a*4 + 7a*4) - 2a*4 + 6a*4 + 0 - 1 as ya*3 + ba + ca2 + n + da*4 and give n. -1 Express (-16i + 9i + 2i)(i + 3i + i) + 2i2 - i2 + 0i*2 as k + si*2 + qi and give s. -24 Express -4q3 - 4q*3 + 3q + 0q3 - 4q - 27q2 - 21q*2 as dq*3 + p + tq + wq2 and give w. -48 Rearrange 0 - 15 + 70 - 157d*2 + 152d*2 to pd*2 + t + xd and give p. -5 Rearrange -8 + 23u + 3 + 1 to ku + a and give a. -4 Express (8 + 20y - 8)(3 + 2 - 3 + (-4 + 1 + 2)(-5 + 4 + 3) - 5 + 5 - 10) - 3y - y + 2y as iy + v and give i. -202 Rearrange (4 - 1339k - 1034k + 1675k)(0 + 2k3 + 0) to xk*3 + ik*4 + vk*2 + tk + g and give i. -1396 Express -12z2 + 51z*2 + 4z*3 - 22z*2 + z - 3z*3 - 16z*2 in the form rz + sz3 + cz*2 + x and give r. 1 Express (822m*3 - 376m*3 + 208m*3 + (-3m + 3m - 2m*2)(3m + 4m - 4m))(m - 1 + 1) as lm3 + vm + um2 + om*4 + d and give o. 648 Rearrange -3d3 + d2 + d - d + (-1031 + 522 - 535)(d3 + d3 - 4d*3) to sd + md2 + cd*3 + f and give m. 1 Rearrange (1 - 1 - 1)(3h - 4h + 3h) - 18h - 9h - 41h to yh + o and give y. -70 Rearrange (53b*2 - 13 - 95b*2 + 10)(-3b + b + b) to the form gb + l + cb2 + db*3 and give g. 3 Express (-8f + f + f)(-3 - 4 + 6)(207f - 166f + 274f) in the form pf + h + qf2 and give h. 0 Rearrange 2o + 0o - o - o - o + 3o - 2o + 2 - 2 + (2 - 2 + o)(-3 - 4 + 5) + 27o + 36 + 7o - 31o to the form jo + a and give a. 36 Express (-3 + 10 + z*2 - 5)(-14z + 2z - 33z) in the form gz + qz2 + tz*3 + m and give g. -90 Rearrange -47679z*2 + 2z*3 - 2z - 6 + 3z4 - 19 + 47679z*2 to the form t + fz + lz3 + nz*4 + cz*2 and give f. -2 Express (d - 4d - 3d)(7d2 - 6d*3 - 7d*2) as ld*4 + id*2 + wd*3 + b + yd and give l. 36 Rearrange (2 + 2 - 3)(0z - 2z + z) + (4738 - 4738 + 407z)(4 + 0 + 0) to the form lz + v and give l. 1627 Express -5253c2 + 5256c*2 - 4c*4 - 2c - 5c4 as ic + pc3 + s + wc*4 + gc*2 and give g. 3 Express -4 - 13r*3 + 9r*3 - 2 + 2r*3 + 5r*2 + 3r in the form j + cr + gr*2 + vr*3 and give g. 5 Rearrange (-7o*2 + 4 - 4)(-12 + 18 - 4o + 3o) to uo2 + w + ko + lo3 and give l. 7 Rearrange (-1 - 15f*2 + 19 - 16)(6 - 3 - 2)(-2 - 1 + 5 - 1 + 1 + 1 + (6 - 4 - 4)(-2 - 1 + 2) - 1 + 0 + 3 - 4 + 1 + 2) to df + jf*2 + n and give j. -90 Rearrange -2t - 2t + 39 + 5t - 15 to the form m + wt and give m. 24 Express -10w3 + w4 - w*2 + 0w*3 + w + 3 + 8w*3 in the form h + pw*2 + jw + nw4 + rw*3 and give p. -1 Rearrange -459n - 269n + 57n - 694n + 93n to the form xn + w and give x. -1272 Rearrange -11q3 - q2 + 6q3 + 3q*3 + 127 + 0q*3 to u + mq*2 + tq + rq3 and give m. -1 Express -13l*4 - 18l*4 - 19l + l*3 - 2l*2 + 17l + 1 - 8l4 in the form b + cl*2 + hl*4 + ul + sl3 and give c. -2 Express (-7 + 0f*2 + 10 + 3f*2)(19f - 65f - 62*f) in the	{ "pile_set_name": "DM Mathematics" }
Let g = h + -3. Suppose 0 = 52j - 53j - 11. Which is the smallest value? (a) 4/5 (b) g (c) j c Let n = -0.7 + 0.1. Let m = -0.6 - 0.4. Let s = 951/5 + -191. What is the smallest value in s, m, n? m Let c = 899 - 6295/7. What is the second biggest value in c, 0.09, 3, 4/9? 4/9 Let w = -30 + 15. Let u = -17 - w. Which is the second smallest value? (a) 0 (b) 4 (c) u a Let w = -135 - -137. Let j = -2 - 4. Let v be (-6)/(-16)(-2)/j. Which is the third biggest value? (a) w (b) -3 (c) v b Let l be 15/(-75) - 21/(-5). Suppose -5 = 2w + 5x + 14, 19 = -5w - 3x. What is the second smallest value in l, w, -1/3? -1/3 Let p = 339 - 336. What is the third smallest value in p, 2, -0.1? p Let g = -0.39 + -0.01. What is the second smallest value in -4/5, -100, g? -4/5 Let x(h) = h3 + h2 + h + 54. Let t be x(0). Let b = t - 50. Let v = -0.1 - 0.2. What is the smallest value in -2/3, b, v? -2/3 Let z = 7.5 - 7.1. What is the second smallest value in -2, -6, z, -1? -2 Let i = -488 + 1462/3. Let k = -13 + 14. What is the second smallest value in k, i, -1/2? -1/2 Let d = -3 - -4. Let a = 0.469 - -1.531. What is the third smallest value in d, a, -3? a Let g = 2.8 + -1.2. Let i = g + -2.1. Let p = -4 + 9. Which is the smallest value? (a) p (b) i (c) -2/15 b Let r = -64/429 - -10/33. What is the second smallest value in 0.4, 1, r, -14/25? r Let f be (-25 - -23) + 14/10. What is the third biggest value in -4, f, -2/7? -4 Let r = -17 - -14. Let o = 3.26 + r. Let j = o + -3.26. What is the second smallest value in j, 1, 4? 1 Let c(d) = -d3 - d + 12. Let k be c(0). Suppose 2f + 14 = k. What is the third smallest value in -3, f, 0? 0 Let w = -0.031 - -11.331. Let f = w - 35.4. Let p = f - -24. Which is the second smallest value? (a) p (b) 1 (c) -9 a Let m = -5 - -4.4. Let z = -18394.96 - -18395. Which is the second biggest value? (a) -0.4 (b) z (c) m a Let f(i) = i*3 - 15i*2 + i - 12. Let h be f(15). What is the second smallest value in -4, h, 0.2, -2? -2 Let z = -7 - -6.8. Suppose 5w = -4 + 9. Which is the second biggest value? (a) 5 (b) z (c) 2/15 (d) w d Let t(j) = -10j3 - 14j*2 - 4j + 9. Let d be t(-3). What is the second smallest value in 0.2, d, 4? 4 Let b = -5 - -7. Let r be 9/(-11) - (-3 + 2). What is the third biggest value in b, r, 3/5? r Let m = 7.2 + -62.2. Let h = m - -55.1. Let r = -4 - -8. Which is the third smallest value? (a) r (b) h (c) 0 a Suppose -3l + 14 = -2x + 3x, -5x - 25 = -4l. Which is the smallest value? (a) 0.69 (b) -2 (c) l b Let w = -80 + 91. Let q be (-3)/4 + ((-682)/(-104))/w. Which is the third smallest value? (a) 7 (b) 1/8 (c) 0.1 (d) q b Let s = -1 - 5. Let x = 588 - 593.5. Let g = x - s. Which is the second biggest value? (a) g (b) -2 (c) -5 b Let y be ((-130)/16)/(-5) + -2. Let w = -1.62 + 1.7. Let d = w + -0.08. Which is the second biggest value? (a) -3 (b) d (c) y c Let h = 310/567 - -2/81. Let b = 45 + -48. Let n be (3/(-6))/(1/2). What is the smallest value in n, b, h? b Let v = -301075/4 - -46064977/612. Let t = 13/17 - v. Which is the second smallest value? (a) t (b) 2 (c) -3 (d) -3/5 d Let h = -2.3 - -1.3. Let k = h - -0.8. Let o be -14(-1)/(-10). Which is the third biggest value? (a) o (b) 2/5 (c) k a Let m = 461.1 + -461. Let j be 2 + 3(2 + -1). What is the second biggest value in m, -0.1, j? m Let x = -34 + 29.5. Let m = x + 1.5. Let j = 0 - m. Which is the third biggest value? (a) -4 (b) -3 (c) j a Let q = -3 - -3.13. Let s = q - 0.13. Let v = 3 - s. What is the second biggest value in v, 2, 1? 2 Let m = 6.14 + 73.06. Let l = -79 + m. Which is the fourth smallest value? (a) 0.4 (b) 3 (c) l (d) -0.2 b Let l = -0.047 + 27.047. Let u = -25 + l. What is the second smallest value in -2, -0.2, u? -0.2 Let v(m) = 2m - 2. Let f be v(2). Let h = -438/71 + 1385/213. Which is the fourth biggest value? (a) f (b) h (c) -0.2 (d) 2/9 c Let z = -633 + 630. What is the third biggest value in -4, -1.6, z, 2? z Let h = 11 - 8. Let d = 0.9 - -2. Let y = d - h. Which is the smallest value? (a) -1/5 (b) 0.1 (c) y a Let q = 2 + -2.13. Let w = q - 0.27. Let k = 10.3 + -10.8. What is the smallest value in 4, k, w? k Let b = -9/7 - -8/7. Let y = 1 - 21. Let s = y - -15. What is the second biggest value in -0.3, b, s? -0.3 Suppose -76 = 4h + 12. Let q = 67/3 + h. What is the smallest value in q, -3/7, 2/13? -3/7 Let n = -2918 - -2919. Let k be 4/(2 - 24/14). Which is the second smallest value? (a) k (b) 4 (c) n (d) 0 c Let q = -162 + 161. What is the third biggest value in q, 1, 5, 0.4? 0.4 Let i = 9 - 17. Let w = -1.469 + 1.569. What is the third smallest value in i, w, 2? 2 Let r = -150.2 - -149.8. What is the third biggest value in -1.37, r, -4/5? -1.37 Let g = -4989/890 + 1/178. Let v = g + 27/5. What is the second biggest value in -0.4, v, -1/2? -0.4 Let h = -20 + 21. Let r be (-8 + 7)(-3)/(-5). Which is the third smallest value? (a) r (b) h (c) -2 (d) 0.1 d Let t(j) = j3 - j2 - j + 1. Suppose -13i + 10 = -8i. Let m be t(i). Which is the smallest value? (a) 4 (b) m (c) -0.1 c Let j be 49/(-35)6/(-63). What is the smallest value in j, -1, -0.5, -1/5? -1 Let m = 7/11 + 34/33. What is the third smallest value in m, -2/7, -5, 0.4? 0.4 Suppose -y + 5y = -8. Let a be 6474/84 + 2/y. Let d = -151/2 + a. What is the second smallest value in 0.2, 5, d? d Let p be 46/(-14) - 36/(-126). Let h be p - (-133)/49 - 8/(-126). What is the second biggest value in -11, h, -1? -1 Let f = -27 - -83/3. Let h = -60 + 65. Which is the fourth smallest value? (a) f (b) -3 (c) -2 (d) h d Let q = 1533/20 - 327/5. What is the second smallest value in 4/5, -3, q? 4/5 Let w be 1/(0 - (-1)/(-4)). Let m(o) = 83o - 416. Let f be m(5). Which is the third biggest value? (a) 3/7 (b) f (c) w (d) 3 b Let p = -109.3 - -118. Let w = -9.2 + p. What is the second smallest value in 3/4, w, 3, -7? w Let p be 1/(-3)(2 - -3 - -4). Let z = -104/495 - 2/165. What is the second biggest value in 2/3, z, p? z Suppose -5n - 3 = -2o, -n - 4 = -4o + 7o. Let p = o + 3. Which is the biggest value? (a) 10 (b) 0.5 (c) p a Let f be (-3 - -1)/(14/3). What is the second smallest value in 0.2, f, -3, 2? f Let m be 4/(-8)-141. Let r(l) = 6 - m + l - 6. Let t be r(3). What is the third biggest value in t, -1/6, 5/6? t Let o(i) = 104i*3 - i - 1. Let x be o(-1). Let n = 831/8 + x. Let j = 0.122 + -0.122. Which is the biggest value? (a) n (b) j (c) 3/8 c Let v = 0.43 + -0.59. Let j = v + 4.16. Which is the biggest value? (a) 4/7 (b) 0.8 (c) j c Let p be (9 - (-2 + 26))(-2)/(-6). Which is the fourth biggest value? (a) p (b) 1/3 (c) 1 (d) -0.5 a Suppose -11j + 6 = -8j. Suppose jn - 4 = 10. Suppose v - n = -2. Which is the third smallest value? (a) -1/4 (b) v (c) 2 b Let t be 1/281. Let v = 52323 - 52322.6. Suppose y - 2y - 2k - 1 = 0, 2y - 5k = -20. What is the biggest value in v, y, t? t Let p(t) = t + 12. Suppose j = -0j + 1. Let f = -10 - j. Let y be p(f). What is the third biggest value in -2/3, -2, y? -2 Let t = -18 - -16. Let i = t - -6. What is the fourth biggest value in 3/4, 3, 2/7, i? 2/7 Suppose 2o - 2 = 0, 3o - 172 = 5r + o. Let l(s) = -28s + 567. Let m be l(19). Let h = r + m. Which is the biggest value? (a) -2/13 (b) h (c) -7/5 b Let v be (1 + -1 - -4) + (4 - 8). Let r = 3 - 0. Suppose -w - r = 2w. Which is the biggest value? (a) 2/7 (b) w (c) v a Let x = 0.72 - 31.72. Let h = x - -31.1. Which is the third biggest value? (a) 6 (b) h (c) 3 b Let h = -233 - -1626/7. What is the fourth biggest value in -1/3, h, 1/4, -0.3? h Let l be (-14)/(-4) + 357/(-70) + 1. What is the third biggest value in -5, l, -0.1, -3/2? -3/2 Let w = 216 - 221. What is the third biggest value in w, -0.4, -3/7, 2? -3/7 Let y = 227.7 - 228. Let c = -11.9 - -0.9. What is the third biggest value in -5, y, c? c Let n be 132/34 + 2/17. Let i be (n/(-14))/(9/7). Which is the third biggest value? (a) 0.3 (b) i (c) -1/6 b Let m be (-1)/4 + 1333/1204. Let x = 66 - 66.3. What is the fourth biggest value in m, 0, 3/5, x? x Suppose 5d = 6d + 3x + 2, d - 2*x - 3 = 0. Suppose -s = d - 0. Let i = 1059 - 1059.2. Which is the second smallest value? (a) 2/5 (b) i (c)	{ "pile_set_name": "DM Mathematics" }
at is the units digit of r? 8 Let o = 131 + -75. Suppose 0f = -2f + o. Suppose 0 = 5n - n - f. What is the units digit of n? 7 Let x be (1/(-2) + 0)0. Let k be (-155)/(-5)(-17 - x). What is the tens digit of (-2)/15 + k/(-15)? 3 Let o(m) = 0m - 7m + m + 4 - 3. Let d(u) = u2 - 6u. Let c(w) = 4d(w) - 3o(w). What is the units digit of c(3)? 5 Let v(s) = 2s3 - 3s*2 + 5s - 3. Let u(q) = -8 + q + 14 + 8. Let k be u(-11). What is the units digit of v(k)? 9 Let u(z) = 2z3 - 2z*2 + 2z + 1. What is the tens digit of u(4)? 0 Suppose 4w - q = -0w - 44, -2w + 5q - 22 = 0. Let i = 205 - w. What is the tens digit of i? 1 Suppose -6x + 2116 = 262. Let u = x - -1. What is the hundreds digit of u? 3 Let s(g) = 80g*2 - 1. Suppose 0 = -7j + 3j. Suppose p + 3d - 7d - 11 = 0, -4p + 2d + 2 = j. What is the units digit of s(p)? 9 Let f(c) = -c2 - c + 4. Let z be f(0). Suppose 3a - z = 2. Suppose 0 = -5w + ar + 80, 4w + r - 102 + 38 = 0. What is the tens digit of w? 1 Suppose -3n - 4n = -1505. Suppose 3z = k + n + 512, -2k = 2z - 474. What is the hundreds digit of z? 2 Let s(d) = d*2 - 17d + 8. Let c(h) = h*2 - h + 1. Let n(u) = 4c(u) - s(u). What is the units digit of n(6)? 2 Let t = 12 - 12. Let r(a) = a3 + a2 + a + 83. What is the units digit of r(t)? 3 Let s(p) = p*3 + 2p + 9. Suppose -3 = -3o + 3a, 7 = 5a - 8. What is the tens digit of s(o)? 8 What is the units digit of (1 + (79 - -2))6/2? 6 Suppose -11n - 4743 = -28n. What is the hundreds digit of n? 2 What is the hundreds digit of (-6527331)/(-5290) + (-1 - (-22)/20)? 2 Let m(q) = 128q2 + 62q + 22. What is the thousands digit of m(4)? 2 Let k(l) be the first derivative of -51l2/2 - l + 30. What is the units digit of k(-2)? 1 What is the tens digit of (162/15)/3(-1860)/(-12)? 5 Suppose 5b = -y + 21, 2b + 2y + 2 = 4. Suppose 0 = 2r - 3x - 20 - 43, -bx = -15. What is the tens digit of r? 3 Let s(m) = m*3 - 11m*2 - 10m - 17. Suppose -t - t = -24. What is the units digit of s(t)? 7 Let q = -327 - -782. What is the units digit of q? 5 Let c = 104 + -34. Let b(l) = -4l3 - l - 1. Let r be b(-1). Suppose -rz + c = -98. What is the tens digit of z? 4 Let a be 332/20(4 - -1). Let u = 4 + 1. Suppose 0 = -5s + 4z + a, 3s + 0z + uz = 72. What is the tens digit of s? 1 Let c = -285 - -594. What is the units digit of c? 9 Let k(f) = f*2 + f - 1. Let h(l) = 2l*2 - 18l - 5. Let x(v) = h(v) - 3k(v). What is the tens digit of x(-19)? 3 Let h(x) = x3 - 6x*2 - 7x. Let v(p) = -p*3 - 9p*2 + 8p - 13. Let n be v(-10). Let r be h(n). Suppose r = 2g - 157 + 45. What is the tens digit of g? 5 Let g(c) = -4c3 + c2 + 2c - 2. Let w be g(-2). What is the tens digit of -4 - (-2 - -1 - w)? 2 Let q(f) = -11 + 10f - 4f + 6 - 29. What is the units digit of q(14)? 0 Let y = -353 - -3237. What is the hundreds digit of y? 8 Let o(i) be the third derivative of 17i6/120 + i5/60 - i4/24 + i3/6 - 4i2. Let m be o(1). Suppose -m = -q - 6. What is the units digit of q? 2 Let l = 1000 - 596. What is the tens digit of l? 0 Suppose -4g = 4u + 2500, 3g - 2g = -2u - 1255. Let h be 1/4 - u/40. Suppose -2x = -3x + h. What is the units digit of x? 6 What is the tens digit of ((-1804)/6)/(12/(-18))? 5 Let i = -7 + -1. Let b = i - -6. What is the units digit of ((-2)/(-5))/(b/(-5))? 1 Let z(w) be the third derivative of 13w5/60 + w4/8 + w3/3 - 12w2. What is the units digit of z(-1)? 2 Let t(p) = -p3 + 10p2 - 10p + 15. Let b be t(9). Suppose bj + 25 = 571. What is the units digit of j? 1 Let f = -117 - -535. What is the units digit of f? 8 Let o be (-1)/3(-4 + -2). Let v be (-14)/(-8) - (-2)/8. Suppose vz = -oz + 40. What is the units digit of z? 0 Let r = -13 - -18. Suppose 0 = ro - 4o + 11. Let p(u) = -u + 10. What is the tens digit of p(o)? 2 Let j(y) = -3y3 - 5y*2 - 23y - 180. What is the thousands digit of j(-10)? 2 Let d = -40 - -90. Let o be d/18 - (-2)/9. Suppose oj = j + 70. What is the tens digit of j? 3 Suppose -9 = 13w - 35. Let d = 3 + -3. Suppose 0k + 4o = -2k + 80, d = wk - 3o - 80. What is the units digit of k? 0 Let f = 2505 - 1853. What is the units digit of f? 2 Suppose 4y + 5z + 0z - 423 = 0, 2z + 346 = 3y. What is the tens digit of ((16/(-4))/(-2))/(2/y)? 1 Let i(o) = 6o2 - 4o + 5. Let v be i(6). Let h = v + -139. Suppose g - 3g + h = 0. What is the units digit of g? 9 Let x be 1 + -3 + 15 + 1. Suppose 3q - x = -2. Suppose 77 - 9 = qa. What is the units digit of a? 7 Let b = -1003 + 1854. What is the units digit of b? 1 Suppose 2g - 4 = -0. Let h(m) = 3m2 + 4m*3 - 9m*g - 5m*3 - 4 - 3 - 7m. What is the units digit of h(-5)? 3 Let i = -2157 - -3203. What is the hundreds digit of i? 0 Let f be (0(-4)/(-8))/(-1). Suppose f = -4h - 4z + 232, -h - 5z = -18 - 40. What is the tens digit of h? 5 Let s(i) = 24 - 37 + 3i + 160 - 2i. Let r be s(0). Suppose 13 = 4u - r. What is the tens digit of u? 4 Suppose -8v + 3v + 300 = -5c, 5c - 204 = -4v. Suppose 0 = -m - m + v. What is the units digit of m? 8 Let r(p) = 14p2 - p + 47. What is the hundreds digit of r(7)? 7 Suppose 2428 = 11b - 7b. What is the tens digit of b? 0 Suppose 5m - m - 720 = 0. Suppose 3k + k = m. What is the tens digit of k? 4 What is the units digit of 142/3171/38? 3 Let k(y) = 2y - 20. Suppose 2j = -j + 33. Let m be k(j). Suppose -h + 31 = -4s, 19 = mh - h - s. What is the units digit of h? 5 Let z(t) = 5t2 - 40t - 392. What is the thousands digit of z(-19)? 2 Let l be (-108)/1540/12. What is the tens digit of (-2788)/l - ((-4)/(-24) + 0)? 1 Let j(t) = -17t. Let f(s) = 17s. Let q(n) = -2f(n) - 3j(n). Let b = -313 + 315. What is the tens digit of q(b)? 3 Let i(x) = 13 - 2 + 4x + 4x + 2 - x2. Let f be i(9). Suppose fg = -3w + 75, 9w - 4w = -3g + 114. What is the units digit of w? 1 Let v be 16/(-40) - 2873/102. Let j = v + 824. What is the hundreds digit of j? 2 Let w(n) = 102n - 17. Let o be w(-3). What is the hundreds digit of (-6)/(-7)(-8 - o)? 2 What is the tens digit of (-178)/((-12)/(-6))-15 - -1? 3 Suppose 5s = 0, -p = -s - 3s. Suppose 4d - 94 + 238 = p. Let h = -9 - d. What is the tens digit of h? 2 Let g(w) = -668w3 - w2 - 7w - 4. What is the thousands digit of g(-2)? 5 Let m be (-4)/(-12)1993. Suppose 5f + 42 - m = 3b, b - 65 = -2f. What is the tens digit of f? 3 Suppose 2f = 7f + 4n - 32, -f - 3n = -13. Suppose -2m - 18 = -f. What is the units digit of (-61)/m + (-20)/(-70)? 9 Let f(g) = -g3 - 2g*2 + 6g + 3. Let o be f(-4). Suppose 0 = 10x - ox + 78. What is the tens digit of x? 7 Let h be 9/182/(-2)-6. Suppose hl - 2a - 787 = 0, 6 = -3a - 0. What is the tens digit of l? 6 Let i(n) = 2n*2 - 17n - 11. Let h be i(9). Let v(r) = -11r3 - 2r*2 + 1. What is the tens digit of v(h)? 8 Let l be (228/6)/(2/4). Suppose l - 8 = i. What is the units digit of i? 8 Suppose o - 331 = -n, -14o + 4n = -15o + 331. What is the tens digit of o? 3 Let n(a) = 2a + 6. Let j(t) = 1. Suppose 2q = -4v + 12, v + 3 = -2q - 0v. Let r(i) = qj(i) + n(i). What is the tens digit of r(10)? 2 Let v = -20 - -21. Let s be (-3 + v)1/(-2). What is the units digit of (2 + s)/(2/18)? 7 Suppose 5k = 3d + 41 + 176, 0 = -3k - 2d + 115. Suppose 3l + 468 = 3f, f + 3l - 50 - 118 = 0. Suppose -f = -44p + kp. What is the tens digit of p? 5 Suppose 496 = 19m - 14400. What is the units digit of m? 4 Let p(a) = -32a*3 + 2a + 6. What is the units digit of p(-2)? 8 Let t be (-42)/8 - 7/(-28). Let r = t - -1. What is the units digit of (4 - 0) + (-136)/r? 8 Let p be (-3 - 1) + (-7)/7. Let x be (-88)/(-55) + (-2)/p. Suppose -xu - 75 = -5u. What is the units digit of u? 5 Let h = 631 + -365. What is the hundreds digit of h? 2 Let s(r) = -r*3 - 6r*2 - r - 1. Let h be s(-6). Suppose -4t = -3a - 39, 6t - 1 = ht - a. Suppose -ti = -i - 30. What is the units digit of i? 6 Let x(p) be the first derivative of 3p2 + 12p - 13. What is the tens digit of x(2)? 2 Suppose -5l + 4v = 493, -3 = -4v + 5v. What is the hundreds digit of (2 + -7 + l)*3/(-2)? 1 What is the hundreds digit of (-2)/(48/(-142392)) - (1 + 0)? 9 What is the hundreds	{ "pile_set_name": "DM Mathematics" }
f a and 11. 99 Let b = 3605/44 - 339/4. Let d = -2497 + 19917/8. Find the common denominator of b and d. 88 Let c(g) = 304g3 - g2 - 3g + 3. Let u be c(2). Let w = 17032/7 - u. Calculate the common denominator of w and 41. 7 Let l = 48133/65460833 + -2/45239. Let k = -146149/2894 + l. Calculate the common denominator of k and 25/18. 18 Calculate the common denominator of (26/48)/(20/(-150)) and 19/10. 80 Let i = -159799/24 - -6655. What is the common denominator of i and 65/33? 264 Let x = -3 - -11. Suppose 2m - 32 = -2m. What is the lowest common multiple of m and x? 8 Suppose 3t = -3l + 32 + 40, 5t + 72 = 3l. What is the common denominator of 23/8 and l? 8 Let a(t) = t + 11. Suppose 2 = -4n + 5r - 31, 11 = -2n - 3r. What is the lowest common multiple of a(n) and 3? 12 Let v = -3 + 6. Suppose -x + 16 = -2x. Calculate the least common multiple of (-6)/(x/(-6) - v) and 14. 126 Let f = -21 - -40. Suppose -f = -3v - 1. Suppose -3d - 2j + 44 + 12 = 0, -3d + 61 = j. Calculate the lowest common multiple of d and v. 66 Suppose 4m = r + 15 - 3, 0 = -5m - 4r + 15. What is the least common multiple of 12 and m? 12 Suppose 5u - 4v + 120 = v, 43 = -2u + 3v. Calculate the common denominator of 12/(-15) - (-606)/20 and u/5(1 + -2). 10 Let n(m) = -m3 - m2 - 2m. Let k be n(-4). Find the common denominator of (-2)/6 - 454/(-120) and 2 - 4/(k/135). 140 Suppose 0 = -5t + 29 + 21. Let p(q) = -q2 - 13q - 32. What is the lowest common multiple of p(-6) and t? 10 Let t be 2 + -2 - (-526)/(-22). Let u = t + 24. What is the common denominator of u and 1 - 0 - 98/10? 55 Let f be 48/21 + (-8)/28. Let v(s) = -s*3 + 3s2 + 3. Let w be v(3). What is the least common multiple of 10 and ((-96)/w)/(-2) + f? 90 Let a(t) = -t2 + 7t - 1. What is the least common multiple of 4 and a(5)? 36 Find the common denominator of -71/12 and ((-57)/4)/(99/30). 132 Let a(c) = c2 + 22c + 4. What is the lowest common multiple of a(-22) and 121 + (-1 - -2)? 44 Suppose -3n + 13 = 2a, -4a = -3n - n - 16. What is the smallest common multiple of n and 6? 6 Let c = 724172723876 + -189892571656167557/262220. Let a = c - 2/13111. What is the common denominator of (13(-3)/(-6))/(-3) and a? 60 Let g = -61 - -421/7. Let q = 28229879/22773883 - 66/26207. Let o = q + 10/79. Calculate the common denominator of g and o. 77 Let n = -139/31 + -1/62. Let p(l) = -15l - 3. Let v(i) = -1. Let o(u) = -p(u) + 4v(u). What is the common denominator of n and o(3)? 2 Let k = -72447 - -9780239/135. Let i = 2/135 - k. Let b = 288098/79233 - -2/7203. Find the common denominator of b and i. 55 Let g(u) = -u*2 + 5u + 2. Let z be g(4). Suppose -zt + t + 150 = 0. Calculate the common denominator of t and -41/11. 11 Find the common denominator of 26 and ((-6)/(-248))/(3/(-19)). 124 Suppose 2p = n + 2n + 27, p - 5n = 24. Find the common denominator of -27/10 and p/21(-21)/(-66). 110 Calculate the common denominator of -9/10 and (4/(32/284))/(-1). 10 Suppose -5q = -25, 0u - 3q = -5u - 30. Suppose f + v + 60 = -34, 0 = 2v + 6. What is the common denominator of u/(-6)1f and -87/2? 2 Let m(l) = -2l - 10. Let i be m(-7). Let c(g) = -g3 + 4g*2 - g + 6. What is the smallest common multiple of c(i) and 5? 10 Suppose 0 = -5t + 55 - 15. Calculate the least common multiple of 14 and t. 56 Find the common denominator of -19/16 and (-856)/(-56)(-21)/90. 240 Suppose 0 = -a - 2a + 66. Suppose 11 = 5l - 9. Calculate the least common multiple of l and a. 44 Suppose -u + 6u - 25 = 0. Suppose 4y = -l - l + 6, ul + 11 = 3y. What is the least common multiple of 6 and y? 6 Suppose 2i + 2b = -32828, 2b - 32836 = -0i + 2i. Let x = i + 196843/12. Find the common denominator of x and -113/6. 12 Suppose 2k - 4i = 28, 2k - 3i - 38 = -4i. Let m be 26/39 + 64/(-6). Let r(f) = -f2 - 12f - 14. What is the lowest common multiple of k and r(m)? 18 Let c(z) = 2z2 - 7z + 2. Let n be c(6). Let f = n + -10. Calculate the least common multiple of (-3)/(((-30)/(-28))/(-5)) and f. 154 Let u be (-3)/(-1) + -6 - -1. Calculate the common denominator of 2/12 - (-37)/u and -70/9. 9 Suppose -3s - 33 = -4z, 2z - 3z + 37 = 5s. Let i = -15 + 23. Suppose 0 = -3y - i + 62. What is the smallest common multiple of y and z? 36 Let y = 64 - 35. Suppose 3a - 2 - 6 = 2o, 4a + o = y. Let f = -6 - -24. What is the least common multiple of f and a? 18 Let b = 884/3 + -2042/7. Find the common denominator of -54/7 and b. 21 Let t be (-1)/16118162/(-2). Let w = -3687 + t. Find the common denominator of w and -11/20. 80 Let v(j) = -j - 4. Let l be v(-7). Suppose -lz - 6 = -36. What is the smallest common multiple of 11 and z? 110 Find the common denominator of 0 + (-236)/(-80)2 and -9/7. 70 Let s = 8 - 3. Suppose -2j + 15 = 3d, -4j - 2d + 9 = -1. Suppose 9 = -p - 0p + 4o, p + o - 11 = j. What is the lowest common multiple of s and p? 35 Suppose i = 9 - 3. What is the common denominator of (-853)/(-72) - (-2)/(-9) and (-4)/i - 23/18? 72 Suppose -2w = -2x + 10, 4w + 3x + 9 = w. What is the common denominator of 411/(-180) + w/6 and -53/10? 20 Suppose 3 = 2y - y. Suppose -8 = 2n, -3n + y = 5v - 30. Let f = 3 + 3. What is the smallest common multiple of f and v? 18 Let i = 28368/23 - 1232. Find the common denominator of -43/6 and i. 138 Let t = -8 - -3. What is the common denominator of 83/10 and (17/25 - 3)t? 10 Let p be (-2 - 1)(-14)/6. Suppose pn - 33 = 4n. Let l = n - 7. What is the lowest common multiple of 14 and l? 28 Suppose -x + 2o - 3o = -11, 0 = 5x - 5o - 35. Let i = -1 - -4. What is the least common multiple of i and x? 9 Suppose 3k - 20 = -h, 0h - 4 = -2k + 4h. Let c = -5 - -7. Calculate the lowest common multiple of k and c/5 - (-90)/25. 12 Let f = 5 - -1. Suppose -k + f = 2. What is the smallest common multiple of k and 10? 20 Let c = -1 - -5. Suppose h = ch - 6. Find the common denominator of h + 31/4 + 0 and 33/16. 16 Let o = -4717/12 + 397. Calculate the common denominator of o and 29. 12 Let c be -6(-2)/8-8. Find the common denominator of ((-17)/4)/((-20)/c) and (-4)/(-6) + (-445)/(-90). 180 Let b = -17 - -12. Let g(f) = -2f - 6. What is the smallest common multiple of g(b) and 9? 36 Suppose -5l = -10, 4l - 3l = 3t + 14. Calculate the smallest common multiple of (15/((-6)/(-2)))/1 and (-37)/t - 7/28. 45 Let r be (-12)/(-18) - (-10)/3. Let t(s) = 4s - 6. Let c be t(r). Calculate the common denominator of 91/4 and (-14)/4 + 4/c. 20 Let k = -3 - -7. Let j(t) = t3 + 5t*2 + 2t + 1. Let s be j(-5). Let i = s + 27. Calculate the least common multiple of i and k. 36 Let s = -11427 + 16940. Suppose 3y = 0, -y = 4c + s + 1787. Find the common denominator of (2/20)/((-40)/c) and 49/2. 16 Suppose 22 = -2x - 0x. Let i = 7 + x. What is the common denominator of i and -1/2? 2 Let h = -207/35 - -1647/140. Let r = -9083/4 - -2257. Calculate the common denominator of r and h. 20 Let q(b) = b3 - b2 - 4b + 12. Let k = 2 + 20. Calculate the lowest common multiple of k and q(3). 198 Let r be -11 + -1(1 + -2). What is the smallest common multiple of r/(-4)64/20 and 10? 40 Let t(k) = -2k3 + k2 + k + 1. Let j be (8 - 3)2/(-5). Calculate the lowest common multiple of 10 and t(j). 190 Let p(a) = a3 + 6a*2 + 4a + 5. Let i(d) = 2d2 + 4d + 1. Let v be i(-4). Let q = v - 7. What is the smallest common multiple of p(-5) and q? 10 Let a = -35 + 42. Calculate the least common multiple of 4 and a. 28 Let q = 661030850044918005 + -6216852362008854176955289/9404784. Let f = q - -1/1044976. Let p = -1071 - f. Calculate the common denominator of 45 and p. 9 Suppose -1 = 2b - r, 3b + 3r = -2 + 23. Suppose 4j - 38 = -3z - 4, 2j - 22 = -bz. Let m = -2 - -18. Calculate the least common multiple of z and m. 80 Suppose 0 = v + k - 3, 4v + 3k - 2k = 6. What is the common denominator of -10 and (-32)/3 - (3 - v)? 3 Suppose -14 - 2 = -2a. What is the smallest common multiple of 16 and a? 16 Let a = 2817648 + -202865489/72. Let s = -548/9 + a. What is the common denominator of (4/3)/(42/(-45)) and s? 56 What is the common denominator of (-50)/(-36) + 4/(-12) and -101/2? 18 Let d(q) = -q2 + 4q + 7. Let h be d(5). Suppose v - hv = -2z	{ "pile_set_name": "DM Mathematics" }
- 0t + d. Solve -tb = w + 4w + 8, 2w = -5b + 12 for w. -4 Let d = -34 + 353. Suppose 19k + 15 = d. Solve 0 = 5u + 5, -4w - k = -u - 5 for w. -3 Suppose -14v + 75v - 81 = 224. Solve -vs = -k - 25, -2s + 17k = 13k - 28 for s. 4 Let v(y) = -5y - 139. Let q be v(8). Let x = 200 + q. Solve x = 2k + 3m + 8, 4k + 2m - 6 = 0 for k. -1 Let q = -802 + 805. Solve 3p + 2c + 6 = 12, qp + 4c - 12 = 0 for p. 0 Let z(s) = 93s + 292. Let d be z(-3). Solve -5y + 1 = 4q + d, 9 = -4y - 3q for y. 0 Let a(p) = -53p - 362. Let f be a(-7). Suppose -fw - 2w = -33. Solve 11 = -2k + 4l + 1, 0 = wk + l - 13 for k. 3 Let c(v) = 50v2 - 12v - 14. Let m be c(-1). Solve 0 = 4t + 5g - 15, 52g = -3t + mg + 11 for t. 5 Let z(r) = r2 - 18r - 4. Let u be z(19). Suppose 2n - 5o - u = 0, 15o - 11o + 29 = 5n. Solve n = 4i + 3c, c - 3 - 4 = 4i for i. -1 Suppose 9b = 45 + 117. Solve 0 = 2l + 4n + 8 - 2, l - 5n = b for l. 3 Suppose -3a = -3j - 36, 2j = -a + 460 - 475. Solve 0 = -u - 3k, -au = 44k - 42k for u. 0 Let f(x) be the first derivative of 7x*2/2 + 21x - 23. Let g be f(3). Let w = g + -27. Solve 0 = -b - 3b + 2c - 12, -5b - 4c = w for b. -3 Let y = 15896 + -15892. Solve 3i - 4 = -4j, 3i - i = -3j + y for i. -4 Let i(b) = 2b + 115. Let s be i(-55). Solve 25 = -5k - sx, 12k - 1 = 8k + 3x for k. -2 Let i = -3698 + 3698. Solve -w + 4 = w + j, i = -5j + 20 for w. 0 Let q = -176 + 179. Suppose -2 = -4d - 2g, -1 = qd - 2g + 1. Solve 3t + b + 10 = d, 5t - 2b + 14 = -b for t. -3 Let n = -7 + 10. Let c = 45677 - 45673. Solve -2q - nu = q - 18, -4u = -c for q. 5 Suppose 4v = -4z - 8, 152z - 2 = -4v + 153z. Solve v = t + 5f + 19, -3t + 6f = 7f + 15 for t. -4 Let f = -148 + 150. Suppose -4n - 6 = 4l - 22, 0 = -l - fn + 4. Solve -4v - v - r = 2, -15 = 3v - lr for v. -1 Let l be (14 - (18 + -4))/9. Solve l = 5w + 4u + 14 + 1, -2u = 3w + 9 for w. -3 Let l be 1/(-4) - 34/(-8). Let s be -554/(-44)(-6)/(-3). Solve 2x + a = s, -lx - 5a - 11 = -37 for x. 4 Suppose 17j = 42 - 8. Solve -3o = -4d - 12, -jd + 2o = -3d + 8 for d. 0 Let w be 182 + -180 + (0/2 - (-1 - 0)). Solve -w = -3c + 2i, -c + 3i - 1 = -2 for c. 1 Let m = 14 + -22. Let k be (10/m - -2) + (-633)/12. Let h be (-122)/(-8) - (-13)/k. Solve 8o = 3o + 5z + h, -6 = -2o - 2z for o. 3 Let w be ((-1050)/12 + -4)-2. Suppose 179j + 20 = wj. Solve -2q + 6 = 2m - m, 13 = 2m + jq for m. 4 Let l = 10 - 2. Let p be (5/(-4))/(14/l - 2). Let w be (25/(-10))/p - 15/(-6). Solve -4v + wd = 8, 3v + 0d + 7 = 2d for v. -1 Let a = -201 + -42. Let h = a + 245. Solve 7q - 3u + 1 = hq, 2q = -u + 4 for q. 1 Let x(w) = 298w - 18170. Let k be x(61). Solve k = 3y + 5p, -7y - 2p = -3y + 8 for y. -4 Let c = -39257 - -39260. Suppose 2d - 1 = 3. Solve -3v = -do - 1, -c = -4o + 3v - 2 for o. 1 Let b = 31374 - 31369. Solve 0 = 3m - 2d - 6, -10 = -bm - 15d + 18d for m. 2 Let q be 1121/118 + (-5)/(-2). Solve q = 2w - g, 32 = 3w + w - 4g for w. 4 Suppose 0 = 3d + 177 - 54. Let r = 50 + d. Solve -5s = 3m - r, m - 1 = -4s + 2 for m. 3 Let g(k) = -9k - 71. Let b(n) = 5n + 35. Let t(m) = 5b(m) + 2g(m). Let o be t(-4). Solve -5q = oh, -2q + q + 5h + 30 = 0 for q. 5 Suppose 3x - 16 = 2. Let z be (-54)/x(-16)/18. Solve -10a = -7a - 2w - 6, -5w + z = 4a for a. 2 Let j be (-8)/(-36) - (-86)/18. Suppose -3r + 6r - jg - 58 = 0, 5g + 25 = 0. Suppose rh - 9h = 0. Solve h = 7x - 2x - 10, 3x = -u + 7 for u. 1 Suppose -344d + 7 = 5f - 346d, 0 = -d + 9. Solve fn = u - 10 + 2, 0 = -2n - 5u + 13 for n. -1 Suppose 3x - 30 = -3a, 2a - 10 = x - 5. Suppose 2o + 5s - 24 = 0, 12 = -22o + 23o - 2s. Solve -2j - xp = 3, -4j - p = 3 + o for j. -4 Suppose 0 = -4r - 54a + 50a + 28, -2r = 3a - 9. Solve -3o - n = -4n - r, -o - 3n - 16 = 0 for o. -1 Let s = -226935 - -226938. Suppose -51 = -4x - 3. Suppose -4b - x = -7b. Solve -13 = o + bj - j, sj + 16 = -4o for o. -1 Suppose 5q + 76 = -2f + 93, -q + f = -2. Solve -x = -2y + 4x + q, 5 = 5x for y. 4 Let l be (2/(-5))/(-5 - 360/(-75)). Solve -2p + 5w - l = w, -4p - 9 = -3w for p. -3 Suppose -i - 7i = -3i. Suppose 7t - 16 - 19 = i. Solve -tn = h - 3, 0 = 4n + 4h + 2 + 2 for n. 1 Suppose 264c - 135 = 219c. Solve 4d + 9 = y, -cd + 101 - 109 = -y for d. -1 Let r(f) = f*2 + 24f + 47. Let i be ((-44)/(-2))/(-39 + 38). Let m be r(i). Solve -my - 14 = -h + 6h, 8 = -2h for y. 2 Let u(s) = -s3 - 32s*2 - 30s + 45. Let x be u(-31). Let b be x/4 - (49/(-14) - -4). Solve -bw + 1 = t + w, -4w + 6 = 2t for t. 5 Let v(f) = f2 - 15f + 51. Let j be v(6). Let s be (-2 - -8)/(1/(j/(-2))). Solve s = -3h + 2z, 2h - 4z - z + 6 = 0 for h. -3 Let g = 226 - 224. Suppose 0 = gx + 2r + 2r + 4, -7 = 2x + 5r. Solve 3t - xt - 5 = -3n, 22 = 4t + 2n for t. 4 Let p be -2 + 3 + -2 - (0 - 3). Let d be 18/((p + 0)/1). Solve -3o + 2w + 6 = 7w, 0 = o + 4w - d for o. -3 Let b be 271(40/(-5))/8. Let j = -269 - b. Solve -5u + j + 2 = -f, 0 = -3f + u + 2 for f. 1 Let w = 15334 - 15331. Solve 2r + wi - 7 = -3, -r = 5i - 16 for r. -4 Let o(p) = -486p + 9 + p3 + 972p + 6p2 - 482p. Let x be o(-5). Let z(b) = 3b2. Let c be z(-1). Solve -cf - 2i = x, -f + 0i = -4i - 14 for f. -2 Let f = -18 - -44. Suppose 3s - f - 46 = 0. Let l = -13 + s. Solve -2j + j + l = 3b, -b = -2j - 6 for j. -1 Suppose -994 = -20v - 3774. Let i = -135 - v. Solve -ij - 22 = -2x, -x + 5j + 2 + 24 = 0 for x. 1 Let o(v) = 2v*2 - 14v + 17. Let h be o(1). Solve 30 = -hk + 4r, -3k + r = k + 13 for k. -2 Let y(v) = v3 + 20v*2 - 678v + 235. Let h be y(-38). Solve 0 = 2s + 4m, 5m - hm + 4 = 2s for s. 4 Suppose 30 = 5k + 66a - 69a, 0 = k - 3a + 6. Suppose -2u + 26 = 2y, -ku + 4 = 3y - 13u. Solve 14 - 2 = 3p, s - y = -p for s. 4 Let d = -15084 + 15088. Solve r - dr + 5h - 16 = 0, -8r + 14 = -2h for r. 3 Let m be 3 - ((-5)/10 - -1)-2. Let q be m/((-4)/5) - (-9 + 0). Solve -k - 2k = -z - 18, -3z - q = k for z. -3 Let q be (-3)/(-54)862 - (-5)/45. Suppose -3z = 13z - q. Suppose -4b - 25 = -5x - 6, -5 = -x + 2b. Solve 5f + 9 = xk - 9, -3k - 6 = zf for k. 1 Let m(p) = 2p - 1. Suppose 35o + 12 = 41o. Let s be m(o). Let v be ((4 - 1)/s)/1 - -1. Solve vb + 1 = 3q - 6q, -13 = -4b - q for b. 4 Let y = -35 + 35. Let g = -107 + 62. Let b = 50 + g. Solve y = 5h - 4o - 5, bo - 2o = -h - 18 for h. -3 Let i be 3(-1)/(4/(-8)). Suppose 0 = -6y - 0 + i. Solve 0 = 3j - 2n - 10, -2n - y + 3 = 3j for j. 2 Let s be 1/((34/(-72))/1). Let v be (5 - (14 - -3))/((-1)/s). Let m be v/(-63)(-21)/(-6). Solve 5n - c = 2c - 6, -3c + 6 = mn for n. 0 Let t = 9553 + -9551. Solve -2s + 2 = 0, 3s = tf + 6s - 5 for f. 1 Suppose 2n - 4 = 0, p - 20 + 9 = -3n. Suppose 0 = -pv - 17 + 57. Suppose -v = -5b - 3. Solve b = -s, -8 = -4x + x + 5s for x. 1 Suppose -38h - 196 = -42h. Suppose -69n = -76n + h. Solve 5m + 7 + n = -3g, -4g = -3m - 20 for g. 2 Let b be (9438/(-24))/(-11) + 2/8. Suppose -bc + 10 = -31c. Solve cs - 18 = d + d, -3d - 22 = -2s for s. 5 Let u = -280 + 282. Suppose b = -m + 5 - 7, -um + 16 = -3b. Solve 2 = g + 2f - m, -10 = -g - 4f for g. -2 Let k be 56/(-21)(0 + 2 - -4). Let l be -3 - (-8)/(-16)k. Solve -2 = -lv + 3h - 0, 10 = 3v - 4h for v. -2 Let f be (-684)/81 - 8/(-18). Let w be -2 - -8 - (f - -11). Solve -2 = 5v - a + wa, v + 5a - 18 = 0 for v. -2 Let p = -872 + 879. Suppose -4 - 9 = -4r + l, -25 = -5r + 3l. Solve 0 = -n + rn - 3v + p, 5 = n + 3v for n. -1 Suppose 0 = 2g - 4, -f + 751 = 4f - 2g. Let d = f - 115. Let h = d - 36. Solve h = 2s - 4, -2i - 2s - 1 = -5 for i. 0 Suppose -10575 + 10607 = 16x. Solve 7 = -i - 5w - x, 3w = -4i - 2 for i. 1 Suppose 18 = -z + 4z. Let p be 0 - -3 - (-2 - -2)/(-1 + 0). Solve -3 = 5s - zq + pq, -3s = q - 1 for s. 0 Suppose -53 = 3d + 4b - 59, 4d = 2b + 8. Solve -5w + 5h - 40 = 0, dw + 5h - 28 = -23 for w. -5 Suppose -37b + 36b + 109 = -13f, 4b - 93 = 3f. Solve -3u + 5 = -6u - 2o, -b = -2u + 4o for u. 1 Suppose 0 = -309a - 60 + 233 + 754. Solve ay + 4c + 1 = 2y, -2y + 3c + 9 = 0 for y. 3	{ "pile_set_name": "DM Mathematics" }
+ 13v2. What is the second derivative of d(k) wrt k? 72k*2 - 12k Let c(t) be the second derivative of t9/15120 + t5/120 + t*4/6 + 3t. Let p(r) be the third derivative of c(r). Find the first derivative of p(a) wrt a. 4a3 Let t(a) = 9a*2 - 2a + 1. Let p be t(1). Find the second derivative of pg5 - 2g + 3g - 5g*5 wrt g. 60g*3 Differentiate 2 + 6 - 4 + 15x*2 - 11x*2 wrt x. 8x Let q(r) = 4r6 + 3r*4 - 3r3 - r2 - 3r. Let b(f) = f6 - f4 + f3 + f. Let y(o) = -3b(o) - q(o). Find the third derivative of y(l) wrt l. -840l3 Let r(b) be the second derivative of -5/42b*7 + 0b*5 + 0b*4 + 0 + 0b*2 + 1/2b*3 - 4b + 0b6. Find the second derivative of r(x) wrt x. -100x3 Let a(v) = -v3 - 5v2 - 2v. Let p(o) = -6o2 - 3o. Let t(d) = -6a(d) + 5p(d). Find the second derivative of t(i) wrt i. 36i Suppose 3r = -1 + 7. Find the second derivative of -3z - 4z*5 + rz - z wrt z. -80z3 Differentiate 0 + 0x*2 + 9x*2 - 3x*2 + 9 wrt x. 12x Let o be (-2)/7 - (-16)/7. Find the second derivative of -5p + 2p*4 + 0p - p*4 + op*4 wrt p. 36p2 Let s(f) be the third derivative of -f9/168 + 17f5/60 + 9f*2. What is the third derivative of s(x) wrt x? -360x*3 Suppose 0 = -b + 3 - 0. Find the third derivative of 7m*2 + bm*3 - 3m*3 - 2m*2 - 3m*3 wrt m. -18 Find the first derivative of 189g - 92g + 4 - 94g wrt g. 3 What is the third derivative of -37u2 - 17u6 - u6 + 55u2 wrt u? -2160u*3 Let v(j) = -j + 2. Let y be v(0). What is the derivative of 0n*2 + 4n2 - y + n2 - 2n2 wrt n? 6n What is the second derivative of 21i2 - i + 12i - 8i2 + 4i wrt i? 26 Let k = -9 + 12. Let r be (-5)/(-4)(7 - k). Find the second derivative of 4 + 1 - r + a2 - 2a wrt a. 2 Suppose -2y - 5v + 18 = 2y, v = 2. Let j be (2/(-4))/(2/(-8)). What is the second derivative of jh*5 + 2h + 2h2 - 2h*y wrt h? 40h*3 Suppose 3w = -3h - 6, 0w + 5w + 13 = -4h. Let m be (-1)/(-1)h1. What is the second derivative of 2c + 2c*m + c - 2c wrt c? 12c Let l(v) = 2v*2 + 2v - 4. Let w be l(-3). Let d(f) = -f + 11. Let n be d(w). Find the first derivative of -3 - 2 + 5 - z*n + 3 wrt z. -3z*2 Let x = 29 - 25. Find the second derivative of -6l + 19l4 - l - 10l*x wrt l. 108l*2 What is the derivative of 17s + 17 + 19 - 44 wrt s? 17 Let h(l) be the second derivative of -l7/840 + l6/360 - l*3/2 - 2l. Let c(j) be the second derivative of h(j). What is the third derivative of c(x) wrt x? -6 Let b(p) be the third derivative of -p5/40 - p4/12 - p*3/2 + 2p2. Let c(j) be the first derivative of b(j). Differentiate c(s) with respect to s. -3 Let y(z) = -z4 - 3z3 + 3z + 6. Let l(m) = -4m + 9m - 5m3 + 12 - 2m*4 + 0m*3. Let r(w) = -3l(w) + 5y(w). What is the derivative of r(h) wrt h? 4h*3 Let m(r) be the third derivative of 17r*7/210 - 9r*4/8 - 9r*2. Find the second derivative of m(i) wrt i. 204i*2 What is the second derivative of -7f - 5f3 - f3 - 9f - 14f3 wrt f? -120f Let f(m) be the first derivative of 2 - 1/3m3 + 0m - 3/4m4 + 0m2. What is the third derivative of f(a) wrt a? -18 Let w(c) be the second derivative of -c7/840 - c5/60 + c4/12 - 4c. Let v(o) be the third derivative of w(o). What is the first derivative of v(s) wrt s? -6s Let l(i) = -5i - 8. Let x be l(-4). Differentiate -xn*3 + 7n*3 - 1 - 4 with respect to n. -15n*2 Let f(w) = 12w*3 + 8w*2 + 8w + 26. Let q(r) = -4r3 - 3r*2 - 3r - 9. Let p be 3/2(-5 - -7). Let j(s) = pf(s) + 8q(s). Differentiate j(a) wrt a. 12a*2 Let p(v) be the first derivative of 5v*2 + 7v + 4. What is the derivative of p(g) wrt g? 10 Let y(o) be the first derivative of -1/4o4 - 2 + o + 0o*2 + 0o*3. Differentiate y(i) wrt i. -3i2 Let f(o) be the first derivative of -o7/168 - o*4/4 + 2o*3 + 1. Let k(a) be the third derivative of f(a). What is the derivative of k(h) wrt h? -15h*2 Let t(b) be the second derivative of -b + 0b*3 + 0b*6 - 1/4b*4 - 1/6b*7 + 0b*2 + 0 + 0b*5. Find the third derivative of t(u) wrt u. -420u2 Let w(x) be the second derivative of x8/84 + x*5/30 - 3x*2/2 + 3x. Let p(c) be the first derivative of w(c). What is the third derivative of p(f) wrt f? 240f2 Differentiate 4 - 5 + 2i*3 - 6i*3 - 6i*3 wrt i. -30i*2 Let c(f) be the second derivative of 5f*7/21 - 3f*4 + 39f. Find the third derivative of c(m) wrt m. 600m2 Suppose 5z + 2i - 17 = 3i, 8 = 4z + 2i. Differentiate -zo - 1 - 2 - 2 + o wrt o. -2 Suppose -4r + 5k - 3 = 0, -3 = -4r - 3k + 18. What is the second derivative of v3 + 4v*3 - 2v + 3v3 + vr wrt v? 54v Let q(j) = j*2 + j. Let y(n) = -n - 8. Let i be y(-6). Let g be q(i). Differentiate 2v*g + 1 + 0v*2 - 2 wrt v. 4v Let w(h) = 8h2 + 35. Let m(u) = 63u*2 + 279. Let c(l) = -4m(l) + 33w(l). Differentiate c(a) wrt a. 24a Let a(l) be the first derivative of -5l2/2 + 8l - 11. What is the derivative of a(o) wrt o? -5 What is the third derivative of 4m3 + 3m*6 - 10m*2 + 3m*6 - 4m*3 wrt m? 720m*3 Let v be -1 + 1 - (-6)/2. Let a = 11 + -8. What is the second derivative of 4x*v + 2x*5 - 4x*a - x wrt x? 40x*3 Let t be 14/8 - (-3)/12. Find the second derivative of 4f*t - 8f - 2f2 + 2f wrt f. 4 Let b = 103/60 - 5/3. Let z(p) be the second derivative of 0p4 - p + bp*5 + 0 + 0p*2 + 1/2p*3. Find the second derivative of z(l) wrt l. 6l Let p be (-21)/(-12) - 1/(-4). Find the third derivative of n*4 - pn*2 - 3n*4 + 0n2 - n4 wrt n. -72n Let q(b) = 12b*4 - 6b*3 + 4b*2. Let t(d) = 25d*4 - 13d*3 + 8d*2. Let a(f) = -13q(f) + 6t(f). What is the third derivative of a(s) wrt s? -144s What is the second derivative of 15l + 8l*2 + 15l*2 + 7l wrt l? 46 Differentiate 6w2 - 8w*2 - 23 - 6w*2 wrt w. -16w Let j = -3 + 7. What is the second derivative of 2b2 - jb*2 + 0b + 2b - 2b*2 wrt b? -8 Let x(b) be the second derivative of 9b*8/28 + 5b*4/4 + 18b. What is the third derivative of x(i) wrt i? 2160i3 Let z(v) = 29v*4 + 6v*2 + 11v. Let u(q) = 6q4 + q2 + 2q. Let w(m) = -11u(m) + 2z(m). What is the third derivative of w(d) wrt d? -192d Let b(c) be the second derivative of 3c*7/14 + 5c*3/3 - 11c. Find the second derivative of b(a) wrt a. 180a3 Let o(y) = 16y2 - y. Let j be o(1). Let q be ((-12)/j)/((-2)/5). What is the third derivative of v3 - 1 + 2vq + 1 wrt v? 6 Let l(k) be the first derivative of k7/105 - 2k3/3 + k2 + 1. Let c(n) be the second derivative of l(n). What is the first derivative of c(g) wrt g? 8g3 Let x(v) be the third derivative of 7v6/120 - v5/10 + 2v2. What is the third derivative of x(k) wrt k? 42 Let t(a) be the first derivative of a3 + 0a*2 - 1/4a*4 + 0a - 6. What is the third derivative of t(k) wrt k? -6 Let h(i) be the first derivative of 3i4/2 - 3i - 6. Differentiate h(b) wrt b. 18b2 Differentiate -3 + 0z*2 - 10z*3 + 0z*2 - 5z*3 wrt z. -45z*2 Let q(y) be the second derivative of -1/12y*4 + 9y + 0y3 + 0 + 0y*5 + 1/3y*6 + 0y*2. Find the third derivative of q(n) wrt n. 240n Find the second derivative of -32q4 + 30q*4 + 7q + 53q4 wrt q. 612q*2 What is the second derivative of -4s + 7 + 5s2 - 7 wrt s? 10 Let q(a) be the first derivative of -a3/3 + 5a*2/2 + 14a + 58. What is the derivative of q(o) wrt o? -2o + 5 Let i(h) be the third derivative of -h5/60 - 2h3/3 - h2. Differentiate i(z) with respect to z. -2z Let n(f) be the second derivative of 0f*4 + 0 + 0f*2 - 2f + 1/3f3 + 1/10f*6 + 0f*5. What is the second derivative of n(s) wrt s? 36s2 What is the third derivative of a4 - 10a2 + 7a*3 - 13a*2 - 5a2 + a2 wrt a? 24a + 42 Let t(x) be the second derivative of 25x*4/12 + 27x*2/2 + 29x. What is the first derivative of t(s) wrt s? 50s Let v(k) = -49k*2 + 3k. Let g(w) = -49w2 + 4w. Let i(z) = -6g(z) + 5v(z). What is the second derivative of i(q) wrt q? 98 Let l(n) be the second derivative of 0 - 1/5n5 + 3n*2 + 0n*3 + 3n + 0n4. What is the first derivative of l(f) wrt f? -12f**	{ "pile_set_name": "DM Mathematics" }
). Suppose -zw - 2 + 26 = 0. Solve 0 = -2a + 3u + w - 6, 4u + 1 = a for a. -3 Let t(x) = x*3 - 12x*2 - x + 9. Let y be t(12). Let s(i) = i + 6. Let g be s(y). Solve 2r - 23 = 5a, 5r + 0r - 29 = ga for a. -3 Suppose 0 = -639g + 669g - 120. Solve 3x + 8 = -i - i, 4x + 16 = -gi for i. -4 Suppose 54 = -6n + 66. Solve 0 = -2c - nc - x + 19, 0 = -4c - 2x + 18 for c. 5 Suppose -4x = -42 - 34. Solve 2g = 3j - x, -18 = -2j + 4g - 0g for j. 5 Suppose 106q = 92q. Solve q = -4r + u + 14, 8r + 5u = 3r + 5 for r. 3 Let n = -627 - -633. Solve 5w - 5 = 0, -3x = 2w - nw + 7 for x. -1 Let f = -838 + 852. Solve 4c + f = 2u, 0u = -u - 5c for u. 5 Suppose 0 = -19k + 2k + 340. Suppose -12o + 7o = -k. Solve 2y + ov + 14 = 0, 6y = y + 5v + 10 for y. -1 Suppose -7p + 24 - 3 = 0. Suppose 0 = -3i + p + 3. Suppose -g = 3g. Solve 3j + 3o = -3, go = -2j + o - i for j. -1 Suppose 0 = 2i - i - 5. Suppose it = 5r, -t + 10 = 3r - 2r. Solve -2o + 5d - 11 = -40, 3o = -rd - 19 for o. 2 Let j be 7 + (1 - 7) + 8. Solve 3c = 9, f + 2c - j = -0f for f. 3 Let a = -119 - -79. Let r = 40 + a. Solve 7 = -y - ry + 2v, 0 = -3y - v + 14 for y. 3 Suppose 0 = 4d + 4r - 100, r + 0r = 3d - 71. Let b = -22 + d. Suppose 3z - 44 = -z. Solve -n = bc + 3c + 22, z = -c + 2n for c. -5 Suppose 3m - 67 = -4o, -m + 37 = -0m + 5o. Let x be (2 - -1) + (25 - 20). Solve 0 = 2u - 3t - m, 2u + t + x = -t for u. 1 Let u be 1 - (-18 + 6)/4. Solve 3o + 0l + ul = -14, 4o = 4l for o. -2 Let k(g) = -3g2 + 43g - 15. Let m be k(13). Let v be (m/5 - -1) + 52/(-130). Solve 2f + 4x + v = 0, 0 = -0f - f + 2x + 8 for f. 2 Suppose -18u = -u - 119. Solve 2t - 8 = 3a, u = -3t - 4a + 19 for t. 4 Let d be (-8)/721 - 1/(-9). Solve d = -2g - 2v + 4 + 6, v = 2 for g. 3 Let l be ((3 + -3)/(-3))/(-3). Let z be 2 - (3 - (5 + l)). Solve 5s - 9 = 2d + 2d, 0 = 4d - zs + 8 for d. -1 Suppose -12b + 17b - 150 = 0. Suppose 0 = 7r - 5 - b. Solve -rp + 5c - 5 = 2c, -c = -3p + 1 for p. 2 Let s(l) = l*3 - 6l*2 + 4l - 24. Let j be s(6). Let o = 7 - 13. Let f be -2 + 1 - (o - -3). Solve m + 4k = j, fm + 2k = -2k for m. 0 Let g(m) = -m*2 - 1. Let x(l) = -l - 5. Let s(z) = -2g(z) + x(z). Let q be s(3). Suppose -13h = -qh. Solve h = o - 2f - 6, -o - 3o + f = -17 for o. 4 Let j be (-3180)/(-1020) - (-4)/(-34). Solve k + 4 = -s, -3s - 6 = -0k - jk for k. -1 Let q be -1 - -13 - (-570)/(-95). Solve 3o - q = -2s + 5, 0 = -5o + 2s + 29 for o. 5 Let b = -24 + 27. Suppose 5p - 4 = bp. Let r(f) = f + 10. Let o be r(-6). Solve -s = -a - 2s - p, os = -a - 2 for a. -2 Let m(d) = -16d - 21 + 35 - 19 + 5d. Let x be m(-1). Solve -4y - 32 = 3s, 2y - 3s - s = x for y. -5 Let h be 15/6(-24)/(-20). Suppose 5a - 128 = -3b, hb - 3 = -0. Solve -2w = -3c + 5, 2c + w - a = -10 for c. 5 Suppose -27a = 21a - 96. Solve u - a = -3l, -6u + 3u = -4l - 6 for l. 0 Suppose -38i + 1 = -75. Solve 6t + 29 = 3m + it, 2m = -t + 1 for m. 3 Let s = 34 + -38. Let y = 1 - s. Solve 0 = -4z - yh - 6, -3z + 0z - 5h - 2 = 0 for z. -4 Suppose 8t = 118 - 86. Solve l + 16 = 5p, -l - p = -tp + 8 for l. 4 Suppose x - 3t = 12, 0 = t + 5 - 2. Solve 24 = -xy + 3q, 5y + 3q + 32 = 6q for y. -4 Let a be 228/108 - 1/9. Solve 6f - 3q = 3f + 15, af + 3q = -15 for f. 0 Let f(s) = 2s - 2. Let i(g) = g2 + 13g + 14. Let v be i(-12). Let k be f(v). Suppose 0p + 40 = kp. Solve p = 5w - 2q, w + 3q - 4 = -2q for w. 4 Let n = -37 + 13. Let p = 26 + n. Let m be 2/(-4) - (-14)/4. Solve mt - 6 = -pz - z, 4z + 2t = 0 for z. -2 Suppose 22 = 2v + 2p, p + 4p + 105 = 5v. Solve -z + 2c = -14, -z = 4c - 0c + v for z. 4 Let d = -1971 + 1974. Solve 0 = -2x - l + 6, 2 = -dl - 10 for x. 5 Let y = 27 + -27. Solve y = p + 4o - 18, -2p + 2o - 5 + 1 = 0 for p. 2 Suppose -2p = 3a - 10 - 0, p = -5a + 19. Suppose 5d - 14 = -i, -i - ad = -d - 10. Solve -6 = -2z + 5x, -ix - 3 - 3 = -z for z. -2 Let n = 47 - 33. Let v = n + -14. Solve x + m = -3x + 6, v = -5x - 3m + 11 for x. 1 Let z(u) = u2 + 19u + 5. Let k be z(0). Solve -5l + kw = -10, -22 = 5l + 4w - 5 for l. -1 Let q = -57 - -88. Let s = 34 - q. Suppose 0 = 2x - 2z - 26, -x - sz + 33 = -0x. Solve -3y + f - x = 4f, -4y = -3f + 3 for y. -3 Suppose -2r - 2 + 0 = 2m, 13 = 5r - m. Solve -3i + rv - 7 = 0, -3v = -2 + 5 for i. -3 Suppose 5y - 11 = -1. Suppose 18x - 17x - 1 = 0. Suppose 0o - 4q = -o + 4, 3o - q = x. Solve -m = ym, w - 5m = o for w. 0 Suppose -5z = -2v + 193, v = -0v + 5z + 104. Suppose 0 = 5j + 9 - v. Solve 2g - 4h + j = 0, -h + 6 = -2g + 2 for g. 0 Let k(t) = -5t - 87. Let h be k(-18). Solve 5p - 17 = 4p + hw, 3w + 23 = 4p for p. 2 Suppose 2o + 11 = 7. Suppose 0 = -4i - 8 + 28. Let q = o + i. Solve 5n = 3n + 3v + 6, 0 = -qn + 3v + 9 for n. 3 Suppose 4m + 3x - 21 = 0, 9m + 4x + 22 = 12m. Solve -mo + 4 = 3j - 2o, -o = -3j + 14 for j. 4 Let d be 12 + ((-112)/196 - 34/14). Solve 2k + f - d = 0, 0f = 3k - 5f - 7 for k. 4 Let b(r) = -r*2 - 23r + 113. Let h be b(4). Solve -2i - 5u = 26, -5i + hu + 5 = -0i for i. -3 Let z(p) = p2 + p - 2. Let o be z(2). Suppose -8 = ow - 0. Let v be -2 + 4 - (w - -4). Solve v = 5f + 10, 2j - 2f = 4j + 12 for j. -4 Let o be 1 - -2 - (5 - 4). Let l be (o - 0)3/(-6) + 28. Solve 0 = -3d - 5y + l, -2y + 6y - 4 = 2d for d. 4 Let v = 32 + -23. Suppose -va - 10 = -7a. Let i = 5 + a. Solve -5x - 5 = i, x - 9 = 4t - 2t for t. -5 Suppose 3h - 23 - 5 = -5p, -3p + h + 14 = 0. Solve 0 = -y + ps, 5y - s = -6s for y. 0 Let k = 14 - 10. Solve -kw + 9w + 3h = 32, -h = -w for w. 4 Suppose -3w + 8 = -4. Solve -4h + n - 12 = 0, 3h + n = wn for h. -4 Let m = 1 + -1. Suppose w - 7 + 5 = m. Solve 10 = 5c - 3y, wy = -3c + 5c for c. 5 Suppose -2f = -4 - 2. Suppose 15 = 3g + 2w, -3w = 4g + w - 24. Solve -fo - 2n - 4 = -gn, -2n - 1 = -3o for o. -3 Let k be 4/(-60)-6 + 2/(-5). Suppose -3p = -15, k = 5s - 2p + 5p - 30. Solve so + 4g = -4 - 6, 5o + 14 = -4g for o. -2 Let i be -4 + (1 + 0)43. Suppose -d = -2b + i, -5b = -d - 44 - 58. Solve -2h + 6 = -4n, h - 3 + b = -5n for h. -3 Let j = 1104 + -1102. Solve 4b + ju + 12 = 3b, 0 = 4b + 3u + 23 for b. -2 Let z(g) be the third derivative of g5/60 + g4/12 - 3g*2. Let h be z(0). Solve -5n + 3v + v - 14 = h, 0 = 3n + 4v + 2 for n. -2 Suppose 0 = -20c + 18c + 6. Suppose -9 = -x - 0x - 4l, -12 = -3x + cl. Solve -xb - 4n - 26 = 0, -b = 2b + 2n + 14 for b. -2 Suppose -n + 3l = -0n, l - 7 = -2n. Suppose -nu + 21 = 4t, t - 23 = -t + u. Let z be 14/6 - (-12)/(-36). Solve zk = -3y - 2 + t, 15 = 4k + 5y for k. 5 Let u(p) = -1 + 8p + 0p*3 - 4p - 5p2 + p + p3. Let m be u(4). Solve 0 = 5d - mn - 30, -3d + 29 = -3n - n for d. 3 Let f = -15 - -18. Let h(b) = -2 - 5b + 24b3 + 2b + 4b2 - 8 - 23b*f. Let o be h(-4). Solve -oa + 8 = a - 4w, 0 = -a + w + 3 for a. 4 Suppose -2q - 4v - 2 = -20, -3 = -2q + v. Solve -2u = -7u - y + q, -2u - 4y = 6 for u. 1 Let f(q) = 4q + 69. Let k be f(-16). Solve -4m + 32 = -ki + 10, 16 = 4m - 2i for m. 3 Suppose 18g = -12g. Solve -q + gq + 2p = -11, -2p = 10 for q. 1 Let c = -63 + 72. Suppose 11v = cv. Solve v = 4a + 5m - 3m, -3a = -2m + 14 for a. -2 Let q(y) = -2y*2 + 23y + y*2 - 29 - 42y. Let m be q(-17). Solve -mb = -5t - 15, 3b - 17 = 4t - 3 for t. -5 Let p(b) = 18b2 + 3b. Let x be p(-1). Suppose 6g - 29 = -4z + 3g, 2z + g - x = 0. Solve -3m + 3j - 3 = 0, 2j = -2j + z for m. 1 Let s = -522 + 524. Suppose -2t + 3 = 3z, 0 = -3t + 3z + 10 + 2. Solve 3a = -sd - 3d + 24, 5a - 6 = td for a. 3 Let q be 0 + (0 - -21). Suppose 0 = 9o - 409 + 391. Solve 0 = 2u - 8, ou + 9 = 5r - qu for r. 5 Suppose 3t = 3v + 77 + 13, 2v = -4. Suppose -7o + 0o = -t. Suppose q + 0 = 2h - 1, -3q = -3h - 3. Solve -p + 2 + 2 = -qk, -op + 9 = -5k for k. -1 Let y be (-14)/8 - (-3)/(-12). Let k be (3 - (2 - y)) + -4. Let d be (-9)/k(-60)/(-18). Solve -2m + a + 9 = 0, 4m - da - 21 = -a for m. 4 Let j = 383 + -381. Solve 3r + 15 = -3p, 1 = -3p + jp for r. -4 Let q(r) =	{ "pile_set_name": "DM Mathematics" }
, e: 6}? 3/85 Calculate prob of sequence xu when two letters picked without replacement from tuxututttut. 2/55 Calculate prob of sequence am when two letters picked without replacement from {m: 2, s: 6, a: 1, h: 2}. 1/55 Three letters picked without replacement from eeeeweeweeeweeeewe. Give prob of sequence eew. 91/612 What is prob of sequence ic when two letters picked without replacement from dcciggcdvg? 1/30 Four letters picked without replacement from {n: 5, a: 3, c: 2}. What is prob of sequence naaa? 1/168 Two letters picked without replacement from kzkzkkvvzkzzzkzwkii. What is prob of sequence iw? 1/171 Three letters picked without replacement from oyyoyyoyyyo. Give prob of sequence yoy. 28/165 What is prob of sequence uu when two letters picked without replacement from {u: 8, d: 1, g: 8}? 7/34 Four letters picked without replacement from jiigjigiiiij. What is prob of sequence jiji? 7/330 Two letters picked without replacement from ssgsgdgjdggjsggg. What is prob of sequence dd? 1/120 Three letters picked without replacement from eauerzf. What is prob of sequence fre? 1/105 What is prob of sequence rf when two letters picked without replacement from jhbrfbh? 1/42 What is prob of sequence ddb when three letters picked without replacement from {b: 3, d: 2, z: 4}? 1/84 Four letters picked without replacement from {s: 2, d: 1, w: 3, x: 4}. Give prob of sequence xssd. 1/630 Calculate prob of sequence iwlh when four letters picked without replacement from {h: 1, x: 2, i: 1, l: 1, u: 2, w: 2}. 1/1512 Calculate prob of sequence upsa when four letters picked without replacement from {a: 2, s: 1, p: 2, u: 10, i: 1}. 1/1092 What is prob of sequence pdbe when four letters picked without replacement from {s: 1, w: 2, b: 1, e: 1, p: 2, d: 1}? 1/840 What is prob of sequence fg when two letters picked without replacement from {a: 1, r: 2, b: 1, x: 1, g: 2, f: 2}? 1/18 Three letters picked without replacement from xdhxhhxxhdhhdhxdxxxh. What is prob of sequence dxx? 28/855 What is prob of sequence nobz when four letters picked without replacement from {z: 1, o: 7, b: 2, h: 3, x: 3, n: 1}? 1/4080 Three letters picked without replacement from {h: 2, f: 1, j: 2, q: 1}. What is prob of sequence hqj? 1/30 Calculate prob of sequence pp when two letters picked without replacement from gpggggycgpggcggc. 1/120 Three letters picked without replacement from dlndedndddrr. What is prob of sequence nld? 1/110 Calculate prob of sequence ipg when three letters picked without replacement from pphphpppphiipphighpp. 11/2280 Two letters picked without replacement from mmmmmmmmmmmmmmmmmgs. Give prob of sequence sg. 1/342 What is prob of sequence li when two letters picked without replacement from {i: 8, p: 2, l: 4, n: 2}? 2/15 Two letters picked without replacement from uuuuuuucuuuucuc. What is prob of sequence uc? 6/35 Calculate prob of sequence vvs when three letters picked without replacement from ssssixbxsssvvssssxis. 1/285 What is prob of sequence gbz when three letters picked without replacement from {z: 4, b: 5, g: 8}? 2/51 Three letters picked without replacement from {u: 1, n: 3, c: 1, e: 2, i: 4}. What is prob of sequence nie? 4/165 Three letters picked without replacement from ggtttgtttgtgt. Give prob of sequence ggg. 5/143 Four letters picked without replacement from nnvnnzvnvnnnvn. What is prob of sequence vzvn? 9/2002 Calculate prob of sequence jej when three letters picked without replacement from {e: 13, j: 4, o: 3}. 13/570 Three letters picked without replacement from btgftgo. Give prob of sequence ogt. 2/105 Calculate prob of sequence jjww when four letters picked without replacement from wjjwjjjjwj. 1/20 Calculate prob of sequence hhhv when four letters picked without replacement from {v: 3, h: 5}. 3/28 What is prob of sequence ep when two letters picked without replacement from weeppeewppp? 2/11 Calculate prob of sequence teai when four letters picked without replacement from {t: 1, v: 3, a: 2, i: 3, e: 1}. 1/840 Two letters picked without replacement from qqqmqqcqcmqnbqbmmqc. Give prob of sequence cb. 1/57 What is prob of sequence qeww when four letters picked without replacement from {w: 5, o: 2, q: 9, e: 3}? 15/2584 Three letters picked without replacement from {m: 1, v: 2, z: 4, j: 3, y: 1}. Give prob of sequence vvy. 1/495 What is prob of sequence llo when three letters picked without replacement from {w: 2, c: 2, l: 3, o: 4, a: 1}? 1/55 Four letters picked without replacement from pyaiwaaiawaa. What is prob of sequence wpyi? 1/2970 Two letters picked without replacement from {g: 2, a: 3, t: 5, h: 1, e: 6, n: 3}. What is prob of sequence ga? 3/190 Calculate prob of sequence qnz when three letters picked without replacement from nqzqszhqzqhzqsq. 4/455 Three letters picked without replacement from wllwwllllwwlallwll. What is prob of sequence lwa? 11/816 What is prob of sequence iqi when three letters picked without replacement from {i: 4, q: 15}? 10/323 What is prob of sequence vvjv when four letters picked without replacement from jjvvvvvjvvj? 7/66 What is prob of sequence uhu when three letters picked without replacement from hhuuuuhu? 5/28 Four letters picked without replacement from {p: 2, t: 1, u: 1, z: 2, c: 1, m: 1}. What is prob of sequence utmp? 1/840 Calculate prob of sequence hg when two letters picked without replacement from ggqggghgqg. 7/90 Calculate prob of sequence olx when three letters picked without replacement from {x: 4, p: 2, o: 4, l: 2}. 4/165 Two letters picked without replacement from {b: 1, k: 7, z: 10}. Give prob of sequence bk. 7/306 Four letters picked without replacement from {a: 3, k: 3, g: 9, r: 1, m: 1, x: 2}. What is prob of sequence xamr? 1/15504 Two letters picked without replacement from {z: 5, w: 2, k: 1, y: 1}. Give prob of sequence wk. 1/36 Calculate prob of sequence kq when two letters picked without replacement from {v: 1, q: 1, k: 1, g: 1, i: 2, d: 1}. 1/42 Four letters picked without replacement from fgrrcgfh. Give prob of sequence rffh. 1/420 What is prob of sequence hpph when four letters picked without replacement from {p: 2, h: 18}? 1/190 Two letters picked without replacement from ivivv. What is prob of sequence iv? 3/10 What is prob of sequence ll when two letters picked without replacement from qmflofqqollqqqf? 1/35 Three letters picked without replacement from {n: 7, p: 7}. Give prob of sequence pnn. 7/52 Four letters picked without replacement from ttdddkqqaqqhdk. What is prob of sequence qatk? 2/3003 Calculate prob of sequence zwmf when four letters picked without replacement from {m: 1, f: 2, x: 1, h: 1, z: 2, w: 1}. 1/420 Calculate prob of sequence czcz when four letters picked without replacement from {z: 12, c: 3}. 11/455 Four letters picked without replacement from ssqsqssssqss. What is prob of sequence sqqq? 1/220 What is prob of sequence ii when two letters picked without replacement from {i: 2, r: 6, j: 3, w: 8}? 1/171 Four letters picked without replacement from {q: 5, u: 11}. Give prob of sequence quuu. 165/1456 Two letters picked without replacement from {l: 5, i: 7}. Give prob of sequence ll. 5/33 Three letters picked without replacement from ljjoyljjujluyl. What is prob of sequence jyj? 5/273 Two letters picked without replacement from itxt. Give prob of sequence ti. 1/6 Calculate prob of sequence lil when three letters picked without replacement from {j: 1, f: 2, l: 7, i: 2}. 7/110 Calculate prob of sequence jjfj when four letters picked without replacement from jfjfj. 1/10 What is prob of sequence ggww when four letters picked without replacement from {g: 3, w: 2, v: 10}? 1/2730 What is prob of sequence ttt when three letters picked without replacement from {t: 10}? 1 Two letters picked without replacement from hhbhbhqbbrby. What is prob of sequence rh? 1/33 What is prob of sequence ez when two letters picked without replacement from zezzg? 3/20 Four letters picked without replacement from {p: 3, u: 3}. Give prob of sequence uupu. 1/20 Calculate prob of sequence wgz when three letters picked without replacement from gzqwzzzzalz. 1/165 Four letters picked without replacement from {l: 3, g: 4, d: 6}. What is prob of sequence dldd? 3/143 Calculate prob of sequence xx when two letters	{ "pile_set_name": "DM Mathematics" }
Calculate the highest common factor of 405 and 324650835. 405 What is the highest common divisor of 2408 and 8283604? 28 What is the greatest common divisor of 70921543 and 517? 517 Calculate the greatest common divisor of 304928425 and 50. 25 Calculate the greatest common divisor of 352640 and 32080. 80 Calculate the highest common factor of 3466296 and 152. 8 What is the highest common factor of 11891292 and 1272? 636 What is the greatest common divisor of 296595364 and 52? 52 Calculate the greatest common factor of 28377 and 249507. 27 Calculate the highest common divisor of 208 and 117859612. 52 What is the greatest common divisor of 1290343 and 134377? 1619 Calculate the highest common factor of 17622594 and 1980. 198 Calculate the highest common divisor of 54 and 535064. 2 Calculate the highest common divisor of 10056525 and 150. 75 Calculate the highest common factor of 63013728 and 6. 6 What is the greatest common factor of 136 and 259483954? 34 What is the greatest common factor of 3742590348 and 252? 252 Calculate the greatest common factor of 702 and 18603. 351 What is the highest common factor of 14315 and 463785? 35 What is the highest common divisor of 60329 and 489647? 1403 What is the highest common factor of 41283645 and 585? 195 What is the greatest common divisor of 16265496 and 299? 13 Calculate the highest common divisor of 5318 and 1592741. 2659 What is the greatest common divisor of 47256 and 3912? 24 Calculate the highest common divisor of 1598067 and 122211. 333 What is the greatest common factor of 5063 and 17110616? 83 Calculate the highest common factor of 6721 and 780767. 13 Calculate the greatest common divisor of 39550 and 53788. 1582 Calculate the highest common divisor of 840 and 12843320. 280 What is the highest common divisor of 853708 and 3648? 76 What is the highest common divisor of 133270938 and 2544? 318 What is the greatest common factor of 108 and 816162372? 108 Calculate the highest common factor of 62264443 and 2036. 509 Calculate the greatest common divisor of 372 and 1251172. 4 Calculate the highest common divisor of 1401484126 and 1442. 1442 What is the greatest common factor of 1375413 and 3? 3 Calculate the greatest common divisor of 2688714 and 7294. 14 What is the greatest common divisor of 169113 and 29379? 21 What is the highest common divisor of 8036 and 403522? 574 What is the highest common factor of 10970370 and 50? 10 Calculate the highest common divisor of 8342 and 1641143. 97 What is the highest common factor of 18929 and 105363? 23 Calculate the highest common divisor of 14979097 and 2065. 413 What is the highest common factor of 195261 and 29157909? 3201 Calculate the greatest common divisor of 25346 and 667. 667 Calculate the greatest common divisor of 41064448 and 44. 4 What is the highest common factor of 35 and 37061185? 35 Calculate the highest common divisor of 9578624 and 7040. 1408 What is the highest common divisor of 350 and 31358250? 350 Calculate the highest common factor of 2569 and 46999855. 2569 What is the greatest common divisor of 61152462 and 3024? 378 Calculate the greatest common divisor of 110676 and 208173. 69 What is the greatest common divisor of 544 and 223036192? 544 Calculate the greatest common factor of 39584835 and 135. 135 What is the highest common divisor of 20 and 1722788? 4 What is the greatest common factor of 1080 and 105210? 90 Calculate the highest common divisor of 510 and 32791147. 17 What is the greatest common divisor of 1371612935 and 44? 11 Calculate the highest common factor of 1825 and 174715. 5 What is the highest common divisor of 21597676 and 8? 4 Calculate the highest common factor of 16 and 62653368. 8 Calculate the greatest common factor of 44267056 and 18. 2 What is the greatest common divisor of 141680 and 50968? 184 Calculate the greatest common factor of 23 and 191304823. 23 Calculate the greatest common factor of 3411 and 9774. 9 Calculate the greatest common factor of 225040 and 108112. 464 What is the highest common factor of 1819264 and 502348? 932 What is the highest common divisor of 7079940 and 27405? 945 What is the greatest common factor of 3888 and 6055317? 243 What is the greatest common factor of 2541 and 679953813? 2541 Calculate the highest common factor of 7677430 and 131164. 542 Calculate the greatest common factor of 4587009 and 11865. 2373 What is the highest common divisor of 109 and 20061014? 109 What is the highest common divisor of 4739330 and 6660? 370 What is the greatest common factor of 47525625 and 639? 639 What is the highest common factor of 3578330 and 679000? 6790 Calculate the highest common factor of 73428 and 1159188. 348 What is the highest common factor of 27731 and 33242? 11 What is the greatest common factor of 4779 and 44656569? 1593 Calculate the greatest common divisor of 5569431 and 343. 7 What is the highest common divisor of 99373644 and 9? 9 Calculate the highest common divisor of 138833527 and 203. 203 Calculate the highest common divisor of 7513 and 4692893. 683 What is the greatest common factor of 79875 and 2875? 125 What is the highest common factor of 343168 and 112? 112 Calculate the highest common factor of 5385 and 134761420. 1795 Calculate the greatest common divisor of 233835 and 18060. 105 Calculate the greatest common divisor of 16 and 36285968. 16 Calculate the highest common divisor of 32536 and 19499256. 392 Calculate the greatest common divisor of 46748760 and 5550. 1110 Calculate the greatest common divisor of 711341300 and 14325. 4775 What is the greatest common factor of 227734 and 59527? 247 Calculate the highest common factor of 136512 and 6144. 192 Calculate the highest common factor of 11554573 and 2274. 379 What is the greatest common divisor of 142125700 and 5425? 775 What is the highest common divisor of 123556448 and 512? 32 Calculate the highest common divisor of 1079 and 259458. 83 What is the highest common divisor of 2795095 and 132672? 691 What is the greatest common divisor of 1360 and 24170192? 272 Calculate the greatest common factor of 11 and 8772109. 1 What is the greatest common factor of 7241080 and 135520? 3080 Calculate the highest common factor of 4385960 and 6175. 95 Calculate the greatest common factor of 235235 and 835835. 5005 What is the highest common divisor of 17044472 and 31280? 3128 What is the greatest common divisor of 152 and 1774904? 152 What is the greatest common divisor of 90857 and 30508? 29 Calculate the highest common divisor of 45921408 and 208. 208 Calculate the highest common divisor of 2748825 and 684. 171 Calculate the highest common divisor of 9389 and 1524093. 41 Calculate the highest common factor of 4477 and 668701. 407 Calculate the highest common factor of 277 and 116366869. 277 What is the greatest common factor of 9814369 and 13295? 2659 Calculate the highest common factor of 260283 and 122271. 159 Calculate the greatest common factor of 267267 and 47502. 273 What is the highest common divisor of 9450022 and 296? 74 Calculate the highest common divisor of 169454873 and 602. 301 What is the highest common factor of 183 and 1007817? 3 Calculate the greatest common divisor of 562810 and 2560. 10 Calculate the greatest common divisor of 87501874 and 5452. 2726 Calculate the greatest common factor of 1828102 and 62350. 2494 Calculate the greatest common divisor of 37 and 15913. 1 Calculate the greatest common divisor of 1888755 and 110. 55 What is the highest common divisor of 2229414 and 379236? 1122 Calculate the highest common divisor of 309764 and 399464. 1196 Calculate the greatest common factor of 37545522 and 21. 21 What is the greatest common factor of 63140 and 4420? 20 Calculate the greatest common divisor of 24 and 29752952. 8 Calculate the greatest common divisor of 42665625 and 180. 45 What is the highest common divisor of 356 and 19345574? 178 Calculate the highest common divisor of 559 and 8589204. 13 Calculate the greatest common factor of 397 and 5992. 1 What is the greatest common factor of 39 and 130883038? 13 What is the highest common divisor of 24 and 1155497844? 12 Calculate the highest common divisor of 254640 and 13040. 80 Calculate the greatest common divisor of 105502 and 2079474	{ "pile_set_name": "DM Mathematics" }
/12 b Which is the third biggest value? (a) 156 (b) 4/3 (c) 6 (d) 1 b What is the biggest value in 4, -1.2, -162? 4 Which is the third smallest value? (a) -4 (b) -2 (c) -0.28 (d) 2 (e) -3 b Which is the biggest value? (a) 4 (b) 18 (c) 10/9 (d) -39/64 b Which is the fifth smallest value? (a) -28 (b) -11 (c) 1/6 (d) -2 (e) -35 (f) 0 f What is the third biggest value in -4/7, -1, -0.3, -1081? -1 Which is the smallest value? (a) 38 (b) -6/3169 (c) 1/2 (d) -4 d What is the biggest value in -2/7, 5, 0.033, 4, 2? 5 Which is the second biggest value? (a) 3 (b) -1.4 (c) 3/7 c Which is the third smallest value? (a) 6/463 (b) 4 (c) 2/857 b What is the fourth smallest value in -2/7, 2/7, -4, 168? 168 Which is the second biggest value? (a) 3.2 (b) -3.9 (c) 4 a Which is the second biggest value? (a) -25 (b) -21 (c) 2 b Which is the second biggest value? (a) 2/5 (b) 0.5 (c) -5 (d) 13 (e) -180/13 b What is the biggest value in 16, 6, -501? 16 Which is the smallest value? (a) -0.98 (b) 172 (c) -0.4 (d) -4 d What is the fifth biggest value in -24/13, -2/11, 863, 0.4, 0.01? -24/13 Which is the second smallest value? (a) 3/20 (b) 0.4 (c) 163 b Which is the smallest value? (a) 1147 (b) 11 (c) -7 c What is the biggest value in -1/13, -8/3, 108? 108 What is the third biggest value in -2/3, -2/29, 12/5, -2/5, 14? -2/29 What is the second smallest value in -400, 0.5, -2/9, -32, 1/3? -32 Which is the second biggest value? (a) 0.79 (b) 1/5 (c) 0.6 (d) 0 (e) 4 a Which is the third biggest value? (a) -4/3 (b) -0.16 (c) -4/57 (d) 4/9 (e) -2/13 e Which is the second smallest value? (a) 2/11 (b) -1/7 (c) -45 b What is the third smallest value in 282, 0.1, 4/13, -2/15? 4/13 Which is the third smallest value? (a) 2/3 (b) -2/9 (c) 0 (d) 96 (e) 3/8 (f) -2 c What is the third biggest value in 0.14, -504, 1? -504 What is the smallest value in -46, 0.88, -7/3? -46 Which is the second biggest value? (a) -1 (b) -84451 (c) -2 (d) 3 (e) -0.4 e What is the fifth biggest value in -9/14, -0.9, 2, 1, -1.5? -1.5 What is the third smallest value in 26, 2/11, -52, -2/9? 2/11 What is the second biggest value in 0.08, -0.1, 1/6, 0.5, 0.12, -15? 1/6 What is the third smallest value in -0.3, -6, -10/101? -10/101 What is the fifth smallest value in -14, 2/45, 3, 3/2, -3/5? 3 What is the fifth biggest value in -134, -0.3, -0.4, -1/4, 0.5, 0? -0.4 Which is the second smallest value? (a) 9 (b) -4 (c) -47 b What is the biggest value in -4, 0.2, -1, 5, 62? 62 What is the fourth smallest value in -5/4, -2824, -0.06, -3, 4? -0.06 Which is the second smallest value? (a) 1 (b) -2/3811 (c) -48 b What is the smallest value in -2/7, -12, 355, 12, 0.3? -12 Which is the smallest value? (a) -4 (b) -5/4 (c) -2/21 (d) 0.9 (e) 226/3 a Which is the fifth biggest value? (a) 1 (b) -106 (c) 0.39 (d) -0.2 (e) -1 b What is the third biggest value in -1793, -1, 5? -1793 What is the second biggest value in -1, 2, 28, -20.1, 0.02? 2 What is the biggest value in 0.0561, -4.1, 1? 1 What is the fourth biggest value in 0.2, 1.7, -3.4, -0.3? -3.4 What is the fourth biggest value in 281, -4, -0.52, -1/8? -4 What is the smallest value in 2, -2/13, -141890? -141890 Which is the second smallest value? (a) -0.05 (b) 5 (c) 4.6 (d) 1 (e) 0.12 e What is the second biggest value in 2/1231, 1, -0.2, -1/4, 0.8? 0.8 Which is the fifth smallest value? (a) 14 (b) 2 (c) 161 (d) -0.3 (e) -2/5 c Which is the smallest value? (a) 1 (b) 1/12 (c) -1527 c What is the biggest value in 1/7, 145, 288? 288 What is the fifth smallest value in 4, 0.4, 726, 10, 1/2? 726 What is the third biggest value in -0.3, 0.2, 3324, -1? -0.3 What is the second biggest value in -14, 4/5, 4, 0.01, 0.38? 4/5 What is the third biggest value in -6, 112, -0.3, -5, -23? -5 Which is the second smallest value? (a) -9/2 (b) 2/9 (c) -3 (d) 0.02 (e) 80 c What is the sixth biggest value in -3, 5, -4, -0.05, -0.13, 18? -4 What is the biggest value in -0.1, 6, -1/51, 0.1, 7? 7 Which is the second biggest value? (a) -1717 (b) 25.4 (c) -2 c Which is the second biggest value? (a) -4/7 (b) -1501 (c) 1/7 a What is the second biggest value in 356/3, 8, 5? 8 Which is the biggest value? (a) -13 (b) 0.05 (c) -5 (d) -5/4 (e) 2 e Which is the third biggest value? (a) 0.07 (b) -1/5 (c) 0 (d) -3 (e) 238/11 c What is the fifth smallest value in 1/4, 2/7, 2/5, 5, -1/748, 4? 4 What is the fifth biggest value in 54, -2/5, -9.1, -4, 0? -9.1 What is the fourth biggest value in -1/2, 2/15, 37, 3, 16? 2/15 Which is the fourth smallest value? (a) 1 (b) 5/2 (c) 6060 (d) -0.2 (e) -21 b What is the fourth biggest value in 89, 3/8, 4/7, 0.2, 0? 0.2 What is the biggest value in 1.6, -1, -7, -83/2, 0.1, -0.2? 1.6 Which is the third smallest value? (a) 22 (b) 50 (c) 4 (d) -0.11 (e) -2 c What is the second smallest value in -0.52, 0, -0.1, -2, -1/12? -0.52 Which is the second smallest value? (a) 0.4 (b) -1/7 (c) 40.45 (d) -1 (e) 2/7 b What is the smallest value in 0, 2/11, 0.2, -1/8, -1, -67? -67 Which is the fifth smallest value? (a) -5 (b) 60 (c) -125.2 (d) 3/2 (e) 4 (f) 6 f Which is the smallest value? (a) -1 (b) 0.07 (c) -106.8 (d) -70 c What is the second biggest value in 1/2, -0.2, 0.0016? 0.0016 Which is the fourth biggest value? (a) -1/6 (b) -227/5 (c) 1/2 (d) 1/4 b What is the third biggest value in 0.5, 10/47, -0.1234? -0.1234 Which is the second biggest value? (a) 561 (b) 1/3 (c) -1/7 b What is the biggest value in -0.15, -1/3, -17.7? -0.15 Which is the second smallest value? (a) 1/12 (b) 1/18 (c) 6 (d) 178 a Which is the fifth smallest value? (a) 4 (b) -0.0191 (c) 3 (d) 261 (e) 0.4 (f) 0.2 a What is the biggest value in -1/2, 47718, 2/17, 5? 47718 What is the third smallest value in 15, 0.02, 1.498? 15 What is the smallest value in 2, -471/26, 0.08, 3? -471/26 Which is the third biggest value? (a) -3650 (b) 0.4 (c) -1 a Which is the sixth biggest value? (a) 0 (b) -0.01 (c) -9 (d) 33 (e) -182 (f) 1/5 e What is the second smallest value in 0.1, 2/2805, 1? 0.1 Which is the smallest value? (a) 0.1 (b) -1821 (c) 1/4 b What is the third biggest value in 0.1, 11, -12, 5? 0.1 Which is the second biggest value? (a) 2/7 (b) 51.31 (c) -5 a Which is the fifth biggest value? (a) -2/17 (b) -4 (c) 1477 (d) 2/3 (e) -0.5 (f) -1 f Which is the third smallest value? (a) -0.3 (b) -0.7 (c) -3 (d) 1 (e) 11 a What is the third smallest value in 0.175, 2/9, 69? 69 Which is the biggest value? (a) 2 (b) 7/2 (c) 106 (d) 0.5 c Which is the smallest value? (a) -1382 (b) -2 (c) -4/3 (d) -4 (e) 2/7 (f) 3 a Which is the biggest value? (a) 5 (b) 0.5 (c) 0.0624 (d) -0.09 (e) 0.2 a What is the biggest value in -1, 0.2, -11881? 0.2 Which is the second smallest value? (a) 3 (b) -0.24 (c) -26 (d) 0 b Which is the fifth biggest value? (a) 28 (b) -3/7 (c) 48 (d) -7 (e) -0.3 d What is the fifth smallest value in 18, -0.7, -5, -1/4, 10, 2/9? 10 Which is the second smallest value? (a) 0.3 (b) 1175.9 (c) -9 (d) -0.1 d What is the second biggest value in 3/101, -2/189, 2, -1? 3/101 What is the second smallest value in -4861, 1, -191? -191 What is the third smallest value in -3/14, -0.1, -4, 13847? -0.1 What is the second biggest value in -0.1, 0.2, -3, -1/51464? -1/51464 What is the smallest value in 0, -23/6, 3, -7? -7 Which is the third biggest value? (a) -41 (b) 76 (c) -5 a Which is the sixth smallest value? (a) -1/2 (b) 0.2 (c) 0.4 (d) 11 (e) 12 (f) -5/2 e What is the smallest value in -391, -0.31, 3, -0.4? -391 Which is the fourth smallest value? (a) -2 (b) -3/5 (c) -51/14 (d) -1 b Which is the second smallest value? (a) -2 (b) -0.4 (c) -2.769 (d) 0.1 (e) 3 a What is the second smallest value in -48057, 14, 3? 3 Which is the fourth smallest value? (a) 0.2 (b) 10800 (c) 0.01 (d) -2 b What is the third smallest value in 0.44, -18, 5? 5 What is the third biggest value in 3/8, -51, 11, 222? 3/8 What is the smallest value in -5, -1, 1674, -3/4? -5 What is the second biggest value in 1186, 8, -21, 0.3? 8 Which is the smallest value? (a) -4 (b) -1012/5 (c) 81 (d) 1 b Which is the fourth biggest value?	{ "pile_set_name": "DM Mathematics" }
229, 1 in ascending order. -229, -1.4, 1 Sort -4, -37, 2, 1, -2 in increasing order. -37, -4, -2, 1, 2 Put 4, -54, 83, 1 in decreasing order. 83, 4, 1, -54 Sort -5, -0.1635, -1.9. -5, -1.9, -0.1635 Sort -933, 3/8, 6, -27/5 in ascending order. -933, -27/5, 3/8, 6 Put 2/9, 2/85281, 0.3 in decreasing order. 0.3, 2/9, 2/85281 Sort 2, 0, 33, -8. -8, 0, 2, 33 Put -1/3, -1/40, -2/7, -5, 3/8 in descending order. 3/8, -1/40, -2/7, -1/3, -5 Put -3/10, 0.62, 0.5, 2/9, 0.8 in increasing order. -3/10, 2/9, 0.5, 0.62, 0.8 Sort -29, -4, 3, -3, 906, -1 in decreasing order. 906, 3, -1, -3, -4, -29 Put -1, 255, 4, -3, 1 in decreasing order. 255, 4, 1, -1, -3 Put -4158, -0.1, -1/8 in increasing order. -4158, -1/8, -0.1 Sort 156, -49, 51 in descending order. 156, 51, -49 Put 3, 1, 2/15, 48358 in ascending order. 2/15, 1, 3, 48358 Sort 4442, 5, 1, -3 in descending order. 4442, 5, 1, -3 Sort 0, 1, 50/13, -0.2, -0.92 in decreasing order. 50/13, 1, 0, -0.2, -0.92 Sort 3, 12/7, 0.5, -73.32 in ascending order. -73.32, 0.5, 12/7, 3 Sort 1.28, 1, -4, -0.07, -1/2 in descending order. 1.28, 1, -0.07, -1/2, -4 Sort -4, -2, 16, 28, 14 in ascending order. -4, -2, 14, 16, 28 Sort -375, 5, 45, -4, 4, -2. -375, -4, -2, 4, 5, 45 Sort 2, -4, 2493/23 in ascending order. -4, 2, 2493/23 Sort 4, -834, -5, -26, 5, -1. -834, -26, -5, -1, 4, 5 Put -10, 0, -107 in increasing order. -107, -10, 0 Put 11, -4, -298, -6 in descending order. 11, -4, -6, -298 Put -5, -19, 5, 27, 4 in descending order. 27, 5, 4, -5, -19 Put 3, 26, 2, -106, 5 in ascending order. -106, 2, 3, 5, 26 Sort 2, -204, -4, -6 in descending order. 2, -4, -6, -204 Sort -3, 19, -4, 1, -12874. -12874, -4, -3, 1, 19 Sort 38734, -2, 0.42 in ascending order. -2, 0.42, 38734 Put -5, 11, -9 in increasing order. -9, -5, 11 Put 6.1, -0.162, -110 in decreasing order. 6.1, -0.162, -110 Put -3, 5, -2, 916 in ascending order. -3, -2, 5, 916 Put 30, -3, 7, 10 in descending order. 30, 10, 7, -3 Sort -3/881, -1, 1/7, 2/5 in decreasing order. 2/5, 1/7, -3/881, -1 Put -143, -4, 1/70, -1/3, 4/5 in descending order. 4/5, 1/70, -1/3, -4, -143 Sort -3, 60, -314 in increasing order. -314, -3, 60 Sort 971, -495, -3 in descending order. 971, -3, -495 Sort 183, 0, 5, 9, -3 in ascending order. -3, 0, 5, 9, 183 Sort -181954, -1, -3 in decreasing order. -1, -3, -181954 Sort -1, 6, 473, 0.1, 4. -1, 0.1, 4, 6, 473 Sort 0, 740, -7, -6, 5. -7, -6, 0, 5, 740 Sort 0.2, 37186, -4 in increasing order. -4, 0.2, 37186 Sort 1, -2, 16, 0, 4, 15 in increasing order. -2, 0, 1, 4, 15, 16 Sort 65, 3.358, -0.2 in descending order. 65, 3.358, -0.2 Put 3, -3, -2, 1, -5, 3285 in decreasing order. 3285, 3, 1, -2, -3, -5 Sort 62, 0, -38, -16 in increasing order. -38, -16, 0, 62 Sort -9, -1.43, 1/9. -9, -1.43, 1/9 Sort -3, 43, 0.0763 in decreasing order. 43, 0.0763, -3 Sort -1.6, 0.31, -4/5 in descending order. 0.31, -4/5, -1.6 Sort -65, -1/2, 0.2, 2/27, 4 in descending order. 4, 0.2, 2/27, -1/2, -65 Sort -44/3, -3/5, -11, 0, 3 in descending order. 3, 0, -3/5, -11, -44/3 Sort 0.1, -1/9, -0.5, 1.085 in decreasing order. 1.085, 0.1, -1/9, -0.5 Sort 291, -0.3, 27, -0.2. -0.3, -0.2, 27, 291 Sort 10, 173, -133. -133, 10, 173 Put -1, -4, 3, -13, -564, 1 in descending order. 3, 1, -1, -4, -13, -564 Put -3, 59, 2, -31, 50, -5 in decreasing order. 59, 50, 2, -3, -5, -31 Sort 1, 0, 102924. 0, 1, 102924 Sort 3, 1, 6703 in increasing order. 1, 3, 6703 Sort -2, 4, -6, -598, 5, 3 in decreasing order. 5, 4, 3, -2, -6, -598 Put 0, -1, 6128, -2 in ascending order. -2, -1, 0, 6128 Put 916, 3, 6 in descending order. 916, 6, 3 Sort 0, -2, -1, -17, 35. -17, -2, -1, 0, 35 Sort 1726, 4, -3, -13, 3, -5 in ascending order. -13, -5, -3, 3, 4, 1726 Sort 37/9, -0.41, 5, 1/6 in descending order. 5, 37/9, 1/6, -0.41 Sort 528, -1/2, -2/3, 3/4, 14, 8 in descending order. 528, 14, 8, 3/4, -1/2, -2/3 Sort 5, 0.06, 1, 0.4, 598 in decreasing order. 598, 5, 1, 0.4, 0.06 Sort -2, -2/3, 1.98, -5 in increasing order. -5, -2, -2/3, 1.98 Sort -4, -20, 3, -2, 0.1, -512 in decreasing order. 3, 0.1, -2, -4, -20, -512 Sort 3, 343245, -3 in increasing order. -3, 3, 343245 Sort 1, 8, 178147. 1, 8, 178147 Sort 14, -2, 779 in decreasing order. 779, 14, -2 Put -21, -25, 4, -4, 3, -2 in decreasing order. 4, 3, -2, -4, -21, -25 Sort 1733, 215, 4 in decreasing order. 1733, 215, 4 Sort 7, 5/9, 0.0086, 1 in ascending order. 0.0086, 5/9, 1, 7 Sort -5, -4, -12, 50. -12, -5, -4, 50 Put 0, 125, 1, 8 in decreasing order. 125, 8, 1, 0 Sort -2, -10, -4, 18, -1, 3 in decreasing order. 18, 3, -1, -2, -4, -10 Put 51, -4260, -4 in decreasing order. 51, -4, -4260 Sort -5, 10, 2, -1, -2 in descending order. 10, 2, -1, -2, -5 Put -726, 4, 391 in decreasing order. 391, 4, -726 Sort -102, -11, 4, -5, 3, 1 in descending order. 4, 3, 1, -5, -11, -102 Put 0.7, 2318, -19 in descending order. 2318, 0.7, -19 Sort 5, 2/7, -2, -4/19, 4/7, -2/43 in descending order. 5, 4/7, 2/7, -2/43, -4/19, -2 Sort 2, 37, 17, 5 in decreasing order. 37, 17, 5, 2 Sort 2, -10, -9/4, -5, -6, 3. -10, -6, -5, -9/4, 2, 3 Sort 8, 38608, -5, 2 in increasing order. -5, 2, 8, 38608 Put -2, 3, -3, 1, -5, -48 in descending order. 3, 1, -2, -3, -5, -48 Put -18, -14, 4, -2, 1, -4 in ascending order. -18, -14, -4, -2, 1, 4 Put -2, -73462, -1 in decreasing order. -1, -2, -73462 Sort -67054, 1, -3 in ascending order. -67054, -3, 1 Put -8, -0.14774, -0.3 in increasing order. -8, -0.3, -0.14774 Sort 2.57941, 5, -0.3 in ascending order. -0.3, 2.57941, 5 Sort -12087, -2, 2. -12087, -2, 2 Put -17, 4, 238 in ascending order. -17, 4, 238 Put 0, 27, -4, 4, -169 in descending order. 27, 4, 0, -4, -169 Sort 14, 1, 3, 12, -2, -3 in decreasing order. 14, 12, 3, 1, -2, -3 Put 834, -11, 5 in descending order. 834, 5, -11 Sort 132, 0, -2/5, 2, -3. -3, -2/5, 0, 2, 132 Put -21, 32, -4, -5, 5, -2 in descending order. 32, 5, -2, -4, -5, -21 Sort -5, -3, 97341, -2. -5, -3, -2, 97341 Sort -340, -201, -15, 1 in ascending order. -340, -201, -15, 1 Put -16, -4, -106, -22 in increasing order. -106, -22, -16, -4 Sort 20, 59783, 2/9 in increasing order. 2/9, 20, 59783 Put 5, 12/5, -0.8, -2/3, -1/252, 2 in descending order. 5, 12/5, 2, -1/252, -2/3, -0.8 Sort 22, 4, -0.3, -3, -2/19, 0.05. -3, -0.3, -2/19, 0.05, 4, 22 Put -3, -1, -1736, 0 in increasing order. -1736, -3, -1, 0 Put 0, 3, 61, -10 in increasing order. -10, 0, 3, 61 Sort 19, 6, 0, 17, -15, 3 in ascending order. -15, 0, 3, 6, 17, 19 Sort -2/9, 5, -3, -2/13, -6099 in ascending order. -6099, -3, -2/9, -2/13, 5 Sort -2/25, 4/5, 4, -7/5, -14 in ascending order. -14, -7/5, -2/25, 4/5, 4 Sort 1, -1, -49, -4, 4, 5. -49, -4, -1, 1, 4, 5 Put 3/2, -0.0158, -237 in decreasing order. 3/2, -0.0158, -237 Sort 0, -148, 4. -148, 0, 4 Sort -25/96, 2/11, -0.2, 0.01. -25/96, -0.2, 0.01, 2/11 Sort 3, -1365, 4, 10. -1365, 3, 4, 10 Put 3, 2058, 5, 6 in descending order. 2058, 6, 5, 3 Sort 1747, -1/11, -16. -16, -1/11, 1747 Sort 19, -1, -9, -5, 5, 0 in increasing order. -9, -5, -1, 0, 5, 19 Sort 1, 832, -13, 5. -13, 1, 5, 832 Put 4570, 2, -5 in increasing order. -5, 2, 4570 Put -0.5, -65, 0.1, -77, 3, -2/3 in decreasing order. 3, 0.1, -0.5, -2/3, -65, -77 Put 12, -73, -15 in ascending order. -73, -15, 12 Put -32, -4, -430 in increasing order. -430, -32, -4 Put -1/20, -2, -6, 4373 in decreasing order. 4373, -1/20, -2, -6 Put -0.8, 12.49, 1, 0.4 in descending order. 12.49, 1, 0.4, -0.8 Put 2, -2310, -0.37 in ascending order. -2310, -0.37, 2 Sort 3, -97, -16, 14 in decreasing order. 14, 3, -16, -97 Sort 2, 182, 1/9, -21 in descending order. 182, 2, 1/9, -21 Put 36/1145, -1, -0.3 in descending order. 36/1145, -0.3, -1 Sort -8, -6, 3, 4, -12 in decreasing order. 4, 3, -6, -8, -12 Put -5, -0.03, -35/39, 3 in descending order. 3, -0.03, -35/39, -5 Sort 5/11, 2, -1/5, -0.0868 in increasing order. -1/5, -0.0868, 5/11, 2 Sort -115, 1, 5, -81. -115, -81, 1, 5 Sort 0.2, 4, -0.686045, -0.5 in descending order. 4, 0.2, -0.5, -0.686045 Sort 1713, -0.18, 3/5 in increasing order. -0.18, 3/5, 1713 Sort 5, 0, 1, 464, -2 in descending order. 464, 5, 1, 0, -2 Put -90, 0.5, -0.34 in descending order. 0.5, -0.34, -90 Sort -433, -6, -3. -433, -6, -3 Sort 4, 2, -1, -18, 13, 5. -18, -1, 2, 4, 5, 13 Put 0, -2, 1, 31, 0.7 in descending order. 31, 1, 0.7, 0, -2 Sort 5, -1018, -1/2, 11/4. -1018, -1/2,	{ "pile_set_name": "DM Mathematics" }
to the nearest one thousand? 5000 Round 0.0000000328179 to seven decimal places. 0 What is -0.00001134254 rounded to six decimal places? -0.000011 What is -0.001820381 rounded to 3 decimal places? -0.002 Round 0.00002392613 to five dps. 0.00002 What is -36.56304 rounded to the nearest integer? -37 Round 1247.44 to the nearest one hundred. 1200 What is -0.000001979 rounded to seven decimal places? -0.000002 What is 7.65275 rounded to zero dps? 8 What is 0.0001736503 rounded to seven dps? 0.0001737 Round 17183000 to the nearest one hundred thousand. 17200000 What is 103892350 rounded to the nearest 10000? 103890000 What is -0.00000024455445 rounded to 7 dps? -0.0000002 Round -15997000 to the nearest 1000000. -16000000 What is -64.20636 rounded to 0 decimal places? -64 Round -608.13804 to 1 dp. -608.1 Round -6524.935 to the nearest one hundred. -6500 Round -0.00958063 to four dps. -0.0096 What is 352.521 rounded to 0 dps? 353 What is -708457 rounded to the nearest 1000? -708000 What is -157927400 rounded to the nearest 1000000? -158000000 What is -2.132665 rounded to 2 dps? -2.13 What is -100573.83 rounded to the nearest one hundred? -100600 Round 85.1249 to the nearest integer. 85 Round 491596000 to the nearest 1000000. 492000000 What is 48.1862 rounded to 1 decimal place? 48.2 Round -287785000 to the nearest one million. -288000000 What is 11.047676 rounded to 0 decimal places? 11 What is 1773933.6 rounded to the nearest one thousand? 1774000 Round 0.0069278 to two decimal places. 0.01 What is 831.741 rounded to the nearest 10? 830 Round -12611717 to the nearest ten thousand. -12610000 What is -0.0002140851 rounded to six decimal places? -0.000214 What is -1008.7453 rounded to the nearest integer? -1009 Round -13762.653 to the nearest ten. -13760 What is -0.009558649 rounded to 3 decimal places? -0.01 What is 658064720 rounded to the nearest 100000? 658100000 Round -0.000354802 to six dps. -0.000355 Round -0.00917182 to five decimal places. -0.00917 What is -1.8132 rounded to 2 dps? -1.81 What is -63872.17 rounded to the nearest 10000? -60000 What is -2123.292 rounded to the nearest 10? -2120 What is 1464.205 rounded to the nearest integer? 1464 What is 4920630 rounded to the nearest 10000? 4920000 Round -801.717 to the nearest one hundred. -800 Round -5.734594 to two dps. -5.73 What is -0.02301454 rounded to four decimal places? -0.023 Round 0.00012253184 to seven dps. 0.0001225 What is -2479016.3 rounded to the nearest 10000? -2480000 What is 2.8485 rounded to the nearest integer? 3 What is 181.824 rounded to the nearest 10? 180 Round -1241710 to the nearest 10000. -1240000 Round -1459.106 to the nearest 10. -1460 Round -223.09359 to the nearest ten. -220 What is 850966 rounded to the nearest one hundred thousand? 900000 What is 1117823000 rounded to the nearest 1000000? 1118000000 What is -167.52669 rounded to 0 dps? -168 What is 456.4963 rounded to the nearest one hundred? 500 Round -37.56367 to the nearest integer. -38 Round 3626567000 to the nearest 1000000. 3627000000 What is 136.0687 rounded to the nearest one hundred? 100 Round -0.000429552 to 4 dps. -0.0004 Round 13333.86 to the nearest one thousand. 13000 Round 0.000000970012 to seven dps. 0.000001 What is 0.283071 rounded to 3 decimal places? 0.283 Round -0.291558 to 3 decimal places. -0.292 Round -0.00007774097 to 5 dps. -0.00008 Round 100559070 to the nearest one million. 101000000 What is -3449.377 rounded to the nearest one hundred? -3400 Round 0.0004284853 to seven dps. 0.0004285 What is -0.00901772 rounded to four dps? -0.009 Round 0.45058136 to 1 dp. 0.5 What is 8156.611 rounded to the nearest one thousand? 8000 What is 461507000 rounded to the nearest 1000000? 462000000 Round 0.0096617801 to 3 decimal places. 0.01 What is 10425.19 rounded to the nearest ten? 10430 What is -0.02788319 rounded to five decimal places? -0.02788 What is -0.9632 rounded to the nearest integer? -1 What is -3193008 rounded to the nearest 100000? -3200000 Round 0.00025743157 to 5 dps. 0.00026 What is 18.425018 rounded to zero dps? 18 What is -53155.6 rounded to the nearest 100? -53200 Round -73911.8 to the nearest 10000. -70000 Round 0.0200149 to four dps. 0.02 Round 388933.9 to the nearest 10000. 390000 What is 5.909708 rounded to 0 decimal places? 6 Round -326996 to the nearest 1000. -327000 Round 5951594000 to the nearest one million. 5952000000 What is -0.0673872 rounded to 2 decimal places? -0.07 What is 2460.427 rounded to the nearest 10? 2460 What is 0.0024734584 rounded to five dps? 0.00247 What is -1.81911 rounded to three decimal places? -1.819 What is -0.0761227 rounded to 3 dps? -0.076 What is 0.1632678 rounded to two dps? 0.16 Round -12435.9 to the nearest 100. -12400 Round 2.165601 to 3 dps. 2.166 Round -0.001499924 to six decimal places. -0.0015 Round 2572310 to the nearest ten thousand. 2570000 What is 0.00016481116 rounded to six dps? 0.000165 What is 1616340 rounded to the nearest ten thousand? 1620000 What is -0.00022693763 rounded to 6 dps? -0.000227 What is 0.0406976 rounded to 4 decimal places? 0.0407 What is -294.9539 rounded to the nearest integer? -295 What is 0.062899 rounded to three dps? 0.063 What is -444.464 rounded to zero dps? -444 Round 0.00005248781 to six dps. 0.000052 What is 87203050 rounded to the nearest one hundred thousand? 87200000 What is -0.048082 rounded to two dps? -0.05 What is 0.1094753 rounded to 5 decimal places? 0.10948 Round 220.1569 to the nearest 10. 220 Round -3747391 to the nearest 100000. -3700000 Round -0.000252623 to five dps. -0.00025 Round 672.807 to the nearest 10. 670 What is -42024300 rounded to the nearest 1000000? -42000000 Round -8.18368 to two dps. -8.18 What is -360834830 rounded to the nearest one hundred thousand? -360800000 What is 0.0002398507 rounded to 6 dps? 0.00024 Round -289001000 to the nearest one million. -289000000 What is -0.00000074909 rounded to seven decimal places? -0.0000007 What is -0.82510951 rounded to 2 dps? -0.83 What is 14.52008 rounded to the nearest one hundred? 0 What is 0.00045186087 rounded to 4 decimal places? 0.0005 Round 61644034 to the nearest 10000. 61640000 What is -0.422963 rounded to three decimal places? -0.423 What is -36177.51 rounded to the nearest 10? -36180 Round 0.000011243486 to six dps. 0.000011 Round -2942020400 to the nearest 100000. -2942000000 What is -41.4793 rounded to the nearest 10? -40 Round -8.61677 to 2 decimal places. -8.62 Round -0.001964098 to 6 decimal places. -0.001964 What is -8.227 rounded to the nearest 10? -10 What is -12.058909 rounded to 2 decimal places? -12.06 Round 27034.3 to the nearest one thousand. 27000 Round 0.0054214 to five dps. 0.00542 What is -11622.56 rounded to the nearest one hundred? -11600 Round -0.00099463 to four decimal places. -0.001 Round -66659.13 to the nearest one thousand. -67000 Round -0.00448814 to three dps. -0.004 Round -13305.74 to the nearest 10. -13310 Round -48018.03 to the nearest one hundred. -48000 What is -505.39 rounded to the nearest one hundred? -500 Round 128681 to the nearest 1000. 129000 What is -4555250 rounded to the nearest 1000000? -5000000 What is 6340080 rounded to the nearest 1000000? 6000000 Round -0.01007361 to 5 decimal places. -0.01007 What is 0.057229 rounded to 4 decimal places? 0.0572 Round -3878382700 to the nearest one million. -3878000000 What is -2322.8 rounded to the nearest 10? -2320 What is 40442.656 rounded to the nearest ten? 40440 What is -0.0001297275 rounded to five decimal places? -0.00013 What is 0.960089 rounded to 1 dp? 1 What is -1.03627 rounded to 3 decimal places? -1.036 Round -1188641.4 to the nearest 10000. -1190000 Round -83849830 to the nearest 1000000. -84000000 Round 1098019800 to the nearest one million. 1098000000 What is 46039720 rounded to the nearest one million? 46000000 What is 0.0000369065 rounded to seven dps? 0.0000369 Round 4.32496 to 1 decimal place. 4.3 What is 218395000 rounded to the nearest one million? 218000000 What is -32474120 rounded to the nearest 100000? -32500000 Round -6824.4624 to the nearest 1000. -7000 What is 0.03771547 rounded to five decimal places? 0.03772 Round 0.00000335171 to six decimal places. 0.000003 Round -0.48192125 to 4 decimal places. -	{ "pile_set_name": "DM Mathematics" }
lculate 84491 divided by -11. -7681 Divide 3868525 by 5. 773705 Divide -2539 by 286923. -2539/286923 -148 divided by -4560583 4/123259 Divide 6232222 by -17. -6232222/17 What is -125494 divided by 7382? -17 Divide -15 by -5902. 15/5902 What is 76 divided by -1221543? -76/1221543 -11 divided by 1240665 -11/1240665 Divide 1349496070 by 12731095. 106 Calculate 1197395 divided by -16. -1197395/16 What is -112562720 divided by -1570? 71696 Calculate -18228255 divided by 1985. -9183 Calculate -2 divided by -123278102. 1/61639051 -1195570970 divided by -5 239114194 Divide -51941 by -17. 51941/17 Divide 10920936 by 11832. 923 -4 divided by -1413648 1/353412 13142790 divided by 2628558 5 3 divided by 136987821 1/45662607 Divide 103 by 5731518. 103/5731518 Calculate 235937770 divided by 5. 47187554 Divide 6142722 by 105909. 58 -3 divided by -1840242 1/613414 Calculate -139345 divided by -175. 27869/35 What is 4143969 divided by 272? 4143969/272 Divide 3730636 by -932659. -4 Calculate -116525640 divided by -660. 176554 5148845 divided by 6 5148845/6 Calculate 556 divided by 45257. 556/45257 Divide 23 by 800211. 23/800211 What is 3711840 divided by 912? 4070 Calculate -35561 divided by -9. 35561/9 Calculate 18435248 divided by 337. 54704 Calculate 106281952 divided by 1234. 86128 Calculate 16 divided by 1780709. 16/1780709 What is -18786050 divided by -2099? 8950 Calculate 22536 divided by 60. 1878/5 Calculate 198746600 divided by -520. -382205 Divide 22697292 by -527844. -43 Calculate 3818 divided by -46308. -1909/23154 Divide 854143 by -54. -854143/54 Divide -1631248 by 344. -4742 Divide 53204 by 10. 26602/5 Calculate 3 divided by -895263. -1/298421 Divide -653961 by -11. 59451 -25580240 divided by 1827160 -14 20564 divided by 920 5141/230 Calculate 2828 divided by 117591. 2828/117591 Divide -34857 by -3205. 34857/3205 Divide -546 by -660. 91/110 -8211245 divided by 283 -29015 What is -5402 divided by 902? -2701/451 Calculate 2106000 divided by 3000. 702 What is 78 divided by -91970? -39/45985 -149567243 divided by 21366749 -7 134795349 divided by -1 -134795349 What is -31596795 divided by -1858635? 17 Calculate 3621 divided by -20911. -3621/20911 Divide -1 by 138965169. -1/138965169 What is -32430835 divided by 6486167? -5 -11233523 divided by -11233523 1 Calculate 49978960 divided by 4. 12494740 What is 432 divided by -204475? -432/204475 What is -412513 divided by -1038? 412513/1038 Divide -28162 by -489. 28162/489 What is -138219280 divided by -13435? 10288 -7596070 divided by -92635 82 Divide 8045645 by 5. 1609129 Divide 20526288 by -6842096. -3 Calculate -13848 divided by 401. -13848/401 What is -29595066 divided by 4? -14797533/2 Calculate -229525198 divided by 406. -565333 What is -677310 divided by 12? -112885/2 What is -4 divided by 2474476? -1/618619 Divide 774794954 by -422. -1836007 Calculate -314 divided by 25054. -157/12527 -7356433 divided by -7356433 1 Divide 125813583 by -2466933. -51 Calculate 174 divided by 87667. 6/3023 -1 divided by 17673462 -1/17673462 What is -164026800 divided by 2187024? -75 Calculate 500735 divided by 14. 500735/14 Divide 2032890 by 2. 1016445 Divide -44567393 by 44567393. -1 Divide 4 by -12538928. -1/3134732 What is -1 divided by 4955208? -1/4955208 -12705 divided by 31 -12705/31 334785 divided by -30435 -11 What is 697 divided by 1384? 697/1384 7084499 divided by -4 -7084499/4 Calculate -4867720 divided by 65780. -74 Divide -46203275 by 9240655. -5 Calculate 209458 divided by 84. 104729/42 Divide -21177126 by -122. 173583 Calculate -180252210 divided by -2770. 65073 What is 261241094 divided by 1? 261241094 Calculate -161266432 divided by 5888. -27389 Divide 708197 by 2. 708197/2 Calculate -24092327 divided by -7. 3441761 Calculate -194830926 divided by -104411. 1866 97607513 divided by 5 97607513/5 Divide -405 by 163467. -45/18163 7854310 divided by -10 -785431 Calculate 130878 divided by -15. -43626/5 71113 divided by -156 -71113/156 -7706040 divided by -1926510 4 Calculate 9800106 divided by 1266. 7741 Calculate 23061080 divided by -4612216. -5 -49539105 divided by -17255 2871 Calculate 195666400 divided by -5. -39133280 1045800 divided by -43575 -24 Divide 63 by 28148. 63/28148 Divide 37395729 by -1780749. -21 Calculate -219425328 divided by 6. -36570888 360692463 divided by -3718479 -97 -4624035 divided by 345 -13403 What is 3926212 divided by 124? 31663 What is 6327956 divided by -8? -1581989/2 Calculate -9880128 divided by -16144. 612 Divide 136072 by -181. -136072/181 What is 3226 divided by 2496? 1613/1248 Calculate -208695740 divided by 220. -948617 17428035 divided by -61151 -285 Divide 49539796 by -4. -12384949 What is 9871525 divided by -5? -1974305 -11 divided by -620240 11/620240 Calculate -223076524 divided by 4. -55769131 Divide 363525 by -3. -121175 Calculate 1334949395 divided by -2. -1334949395/2 Calculate 12275860 divided by -39220. -313 What is 136769661 divided by 267651? 511 -122806740 divided by -24561348 5 Divide 0 by -2539989. 0 Calculate -22941000 divided by 10. -2294100 What is -304884301 divided by 1762337? -173 -16147425 divided by 5382475 -3 What is 4 divided by 2664135? 4/2664135 Calculate -201297 divided by -85. 11841/5 Calculate -20 divided by 2093780. -1/104689 What is -2184260 divided by 218426? -10 -724692 divided by 1572 -461 What is 10504 divided by -404? -26 -31947872 divided by 19 -31947872/19 Calculate 1159768 divided by -9998. -116 Calculate 0 divided by -1246991. 0 Calculate 20226 divided by 4749. 6742/1583 Divide -311560280 by -15578014. 20 Divide -8417466 by 291. -28926 What is -24830 divided by 396? -12415/198 Calculate -351 divided by -151645. 27/11665 -2602356 divided by 2748 -947 Divide -83843067 by -7622097. 11 1924135895 divided by 5 384827179 36 divided by -9907033 -36/9907033 Calculate 4163725 divided by -2. -4163725/2 What is 14409506 divided by -31739? -454 -5385 divided by 5742 -1795/1914 Calculate -414604403 divided by -5248157. 79 1 divided by 4452163 1/4452163 Divide -540781085 by 585895. -923 80 divided by 2671427 80/2671427 Divide 151953399 by -39. -3896241 Calculate 447716587 divided by 15438503. 29 Calculate 4107 divided by 54250. 4107/54250 Divide 60074726 by 2. 30037363 Divide 16520842 by 11989. 1378 1424 divided by -1634 -712/817 What is -1928 divided by -178585? 1928/178585 What is 72244 divided by 1947? 72244/1947 Divide 195195 by 329. 27885/47 What is -6891 divided by 42204? -2297/14068 Calculate 116250064 divided by 17962. 6472 What is -3392500 divided by -125? 27140 Divide 6757032 by -276. -24482 63422164 divided by -26 -2439314 What is 86676106 divided by 2? 43338053 Divide 470264 by 97. 470264/97 Divide 10532368 by 63448. 166 Divide 152932 by 379. 152932/379 Divide -9902838 by 47382. -209 What is 51383020 divided by -11219? -4580 Divide 176 by 2841935. 176/2841935 -136696248 divided by 243 -562536 What is -63984904 divided by -331528? 193 -9995 divided by -1813 9995/1813 -381467640 divided by -95366910 4 73735386 divided by 373 197682 -43961324 divided by -764 57541 -3504204 divided by -8849 396 Calculate -2 divided by 77192. -1/38596 -4033 divided by 2278 -4033/2278 Calculate 37455 divided by -177. -12485/59 Calculate 92205440 divided by 4. 23051360 What is 39923540 divided by -5? -7984708 Calculate -27145827 divided by 1073. -25299 What is -1466 divided by -133202? 733/66601 90166394 divided by 342838 263 What is -165144298 divided by 2309? -71522 -31195 divided by 1381 -31195/1381 What is -110378229 divided by -3893? 28353 What is 278310 divided by -55662? -5 -5866 divided by 7731 -5866/7731 What is -2739262 divided by 2739262? -1 Calculate -13756047 divided by -1679. 8193 Divide 132854650 by -475. -279694 Calculate 102853452 divided by 1. 102853452 3307176 divided by 366 9036 -79573 divided by 43 -79573/43 403013611 divided by 221 1823591 -11523008 divided by -102884 112 What is 769494 divided by 11659? 66 Divide 267 by 8058. 89/2686 Calculate -12826973 divided by -193. 66461 Divide -3327982 by 114758. -29 -64292320 divided by 20 -3214616 What is -1 divided by 5652448? -1/5652448 1528032 divided by -340 -382008/85 Calculate -4 divided by 16903021. -4/16903021 23 divided by 20398114 23/20398114 What is 1 divided by -1279674? -	{ "pile_set_name": "DM Mathematics" }
-3i + 2 = -g for i. 1 Let z = 132 + -131. Solve -z = v - 3 for v. 2 Suppose -2l = 3i + 22, -3i = 5l - i + 55. Let w = l + 11. Solve 10c - 5c + 5 = w for c. -1 Suppose -4 = -4h + 2h - 3v, 0 = -h + 2v + 9. Solve -3a + h + 1 = 0 for a. 2 Suppose -13d = 3 - 16. Solve 0 = -h - 0 - d for h. -1 Suppose -2g = -7g. Let a be (-2 - g)/((-5)/20). Solve -a = 3c - c for c. -4 Suppose 0 = -0l - 2l + 6. Let z(d) = 7d + 1. Let u be z(l). Suppose -2m + u = 2t, -26 = -3t + 2t - 4m. Solve 2b - 4b - t = 0 for b. -3 Let w = -26 - -29. Let c be 0/((w - -1) + -2). Solve 0l + 5l + 25 = c for l. -5 Suppose 4r + 1 = -3y, 2y + 3 = 2r + 21. Suppose 3u = 3c + 6u, 0 = -4c + yu. Solve c = b - 2b + 5 for b. 5 Let a = -20 + 23. Solve 6 = -n + an for n. 3 Let n(s) be the first derivative of s4/4 + 2s*3 + 3s*2/2 - 5s - 1. Suppose 11t + 2t + 65 = 0. Let c be n(t). Solve -cb + 1 = -4 for b. 1 Suppose 4q - q - 21 = 0. Solve -qk = -3k for k. 0 Let t(z) = -z*2 - 5z - 2. Let q be t(-3). Suppose d = -2 + q. Suppose -3j + dj + w = 1, j - 3w + 9 = 0. Solve j = -5f - 2 for f. -1 Let y(q) = -q - 8. Let h be y(0). Let t be ((-2)/h)/(4/48). Suppose tc - 4 = 8, -5o + 4c = 6. Solve -6v + ov = 16 for v. -4 Suppose 19 = 2k + 3. Solve 3v - kv = -15 for v. 3 Let n(s) = s - 6. Let f be n(5). Let w = f + 5. Solve -wm = m for m. 0 Suppose -2d + 15 + 13 = 0. Solve 4m - 2 = d for m. 4 Let k be 114/27 + (-2)/9. Suppose kq = -0q. Let i be 3(-10)/(-3) + q. Solve -7m - i = -5m for m. -5 Let v be ((-6)/10)/((-4)/20). Suppose 27 = -i - vl, -21 = 4i - 2i - 5l. Let t be (-4)/(-18) - 32/i. Solve 2s + ts = 0 for s. 0 Let u(j) = -j*3 - 4j*2 - j + 2. Let q be u(-2). Let i be 1/3 + q/3. Let z be i/(-2) + (-2)/4. Solve 3m + m = z for m. 0 Let u be 3(5 - 8/2). Suppose -5b + 4w - 4 = 1, -3b - 3 = -w. Let z be u + b - (3 + -7). Solve y + z = 2 for y. -4 Let l = -7 + 1. Let t(w) = w*2 + 4w - 7. Let q be t(l). Suppose -y - 2p - q = -1, -7 = -2y + p. Solve -2s + 4 = y for s. 1 Let z be 6/15 - (-16)/10. Suppose -zr - 2d = -4, -5r + 22 = -3d + 2d. Solve 0 = rb - 3b + 4 for b. -4 Suppose 0 = b - 4b + 12. Suppose 0 = n + 5n - 12. Suppose -4i - bc = -16, 2i + c - 2c = n. Solve -ih + 4h = 0 for h. 0 Let y(p) = 9p + 1. Let j(i) = -17i - 2. Suppose -3u + 6 = -0a + 5a, 21 = 4a - 3u. Let n(d) = aj(d) + 5y(d). Let k be n(-1). Solve -10 = kv + 5 for v. -3 Suppose 0j = 2j + 6. Let s = j - -3. Let l = 6 - 6. Solve l = -4x - sx for x. 0 Suppose 3d + 3 - 9 = 0. Let b be (-33)/1(-1)/(-3). Let l(s) = s + 13. Let i be l(b). Solve 8 + d = -it for t. -5 Let j(y) = y3 - 3y*2 - 7y - 10. Let p be j(5). Solve -pz - 12 = -2z for z. -4 Suppose -4 = 4l - 4f, -l + 4 = l + 4f. Solve l = 3j - 4j for j. 0 Let h(u) = -u - 1. Let a be h(-2). Let w = a + 3. Solve -d = wd - 15 for d. 3 Suppose -a + 0 - 3 = 0. Let c = a - -4. Let x be 110 + 1/c. Solve x = -3f + 2 for f. -3 Suppose -4z + d + 17 = -3, 0 = -2z + 3d + 10. Suppose -f - zu = 22 - 0, 5f + u - 10 = 0. Solve -fp + 2p = 1 for p. -1 Let g(z) = z3 + 4z*2 - 4z + 7. Let p be g(-5). Suppose -4i = -4v - pi + 20, -2i - 24 = -5v. Solve 0 = -vw + 14 - 2 for w. 3 Let j = -85 - -92. Let w be -2 + 1 + 13. Solve wu = ju + 5 for u. -1 Suppose 0 = 4z + z. Suppose 3t - 2m + zm - 19 = 0, 3t - 25 = 5m. Solve -tc = -0 - 5 for c. 1 Let k(d) = -d*2 + 3d - 2. Let w be k(2). Let y(t) = -t*2 + 3. Let s be y(w). Let o = s + -1. Solve on = -2n for n. 0 Let h(d) = -d3 + d + 25. Let j be h(0). Let u(n) = n. Let v be u(2). Solve -j = 3m + vm for m. -5 Suppose 3g + 3 = -3y + 18, -y = 4g - 5. Suppose 0 = -a - 4f + 20, a = -2a - f + 5. Let i = g - a. Solve ip + 15 = 5p for p. 3 Let c = 87 - 83. Solve w - c = -0 for w. 4 Suppose -2k - f + 178 = 3k, 4k - 5f - 154 = 0. Suppose -2d + 3h = -36, 5d + 21 = -2h + 111. Let n be 32/d + 8/k. Solve -14 - n = -4j for j. 4 Suppose -5i + 12 = -i. Let s(n) = n*2 + 3. Let a be 3/(-18) - (-2)/12. Let u be s(a). Solve -ic + 0 = u for c. -1 Suppose 1 = -4j + 5. Suppose 0 = m + j - 5. Solve 0 = 5u - mu + 1 for u. -1 Let g be (1 - -2)/(3/14). Let r = 1 + 3. Suppose 0 = 3x - 12, -f - g = f - rx. Solve -2a + a - f = 0 for a. -1 Suppose 10 = 18d - 13d. Solve 0 = 4x - 3x + d for x. -2 Let a be 0 + 7/((-7)/(-6)). Solve -4 = -at + 4t for t. 2 Let w = -5 + 5. Let n = w + 5. Solve -20 = nh - h for h. -5 Let t(v) = -v - 6. Let a be t(-10). Solve -b - 15 = -ab for b. 5 Suppose -45 = -4k + j, -6j = k - j - 27. Solve -4 + k = -2l for l. -4 Suppose -2l + 4 = -2k, -l + 2 = -2. Let q(z) = -4z + 3. Let h(b) = 5b - 4. Let u(d) = -3h(d) - 4q(d). Let f be u(k). Solve 0 = 5w - fw + 15 for w. -5 Let k be (-31)/(-6) + 4/(-24). Solve kc + 0c + 10 = 0 for c. -2 Let w = 9 - 4. Suppose 2y - 6 = -2d - 48, wd = -2y - 105. Let j = -14 - d. Solve -2m + jm + 25 = 0 for m. -5 Let z = 3 - 22. Let h = 23 + z. Solve hd = -d + 5 for d. 1 Let n(v) = 8. Let h(l) = -l - 1. Let x(g) = h(g) + n(g). Let r be x(3). Solve -rq + 0 = -8 for q. 2 Suppose 3k + 0n = 3n + 18, -14 = k + 4n. Solve -m + k = 7 for m. -5 Let p(x) = x2 - x - 3. Let b be p(3). Suppose d + bd - 8 = 0. Solve -6l - 12 = -dl for l. -3 Suppose -4l = 3c + 21, c + 2 + 7 = -2l. Let q = c + 8. Solve -qh + 4 = -3h for h. 2 Let q(z) = z3 + 2z*2 - 4z - 2. Let m be q(-3). Let w be -3 + m + (-3)/(-1). Let t be w - (-2 + 2 + -2). Solve 0 = tn - 5n - 8 for n. -4 Suppose -3j - 4 + 13 = 0. Solve -3 = -jz - 0z for z. 1 Let r(l) = -l2 + 5l - 3. Let p be r(3). Suppose -10 = -pv - t, -2v + 7t = 3t - 2. Solve 6 = vj - 9 for j. 5 Let i be 5 + (-3)/(-3) - 2. Suppose -j - ij = -10. Solve -6 - j = -2v for v. 4 Suppose -4z + 5y - 9 = 0, z = -2z - y + 17. Suppose p - 4 = a, -5 = -zp + 2a + 9. Solve -k = -pk for k. 0 Let x(b) = -b2 + 12b - 4. Let v(z) = -z - 1. Let r(d) = v(d) + x(d). Let c be r(10). Suppose -4g + 55 = cl, 7l - 15 = 2l. Solve -5p + 20 = -gp for p. -4 Suppose 5 = 5y - 15. Solve 0 = yb - 9b + 25 for b. 5 Let l = 18 - 9. Let w be 22/6 + 3/l. Solve 0 = wi + 14 + 6 for i. -5 Let x = -23 - -25. Solve -x = -2a - 0 for a. 1 Suppose 14 = -4n + 2k, 0 = -5n + 3k - 14 - 5. Let w be 4 + (n - (-2 - -2)). Suppose -2b + 2 = -b + wm, -2b - m = -4. Solve 1 = -l - b for l. -3 Let y be 0/(2 + -3 - -2). Suppose -2b = -yb - 24. Let w = 3 + -1. Solve -ws - 2s = -b for s. 3 Let h = 0 + 5. Suppose -4d + h + 7 = 0. Solve -dm = -2m for m. 0 Let r be (1 - 2/(-1))1. Let n = 0 - r. Let a be (-5)/n + 3/9. Solve a = 3j - 13 for j. 5 Let x(i) = 3i*2 - 1. Let g be 322/(-12). Let b be x(g). Solve 3k - b = k for k. 1 Let m be (-39)/(-33) + 4/(-22). Suppose -2p - m = -7s + 4s, -s - 1 = -p. Let d = 1 - 1. Solve d + 3 = -su for u. -1 Suppose 4i = -15 + 59. Let y(a) = 12a - 12a2 - 2 - 8 + 2 + a3. Let n be y(i). Solve nw = -w for w. 0 Let w(p) = 2p - 5p - 3p. Let v be w(-1). Suppose 4q - 6q = -v. Solve -4 = -qt - 13 for t. -3 Suppose -8d + 14 = -d. Solve dq = 5q for q. 0 Suppose 0i + 4 = -2i + 5x, 4x - 4 = 2i. Let o = i + -2. Let u = 4 + o. Solve -r - 4 = -ur for r. -4 Let t be (-14)/(-21)63/2. Let o = t - 14. Solve 3f - 20 = of for f. -5 Suppose -4t + 360 = -396. Let i be 2/(-8) + t/36. Let b(s) = -s3 + 2s*2 + 4s - 3. Let d be b(3). Solve dh = ih for h. 0 Suppose o = j + 3o - 9, -3 = 2j - 3o. Suppose -jb = 2b - 20. Solve 6 = bg - 7g for g. -2 Suppose 4x - 10 = -x. Solve -1 = -xo + 3 for o. 2 Let u be 2 + -4 + 14. Suppose -2n - 2x = -14, -6n + 3x + 14 = -un. Suppose 4r + 1 = -3o, 3o + 24 - 5 = nr. Solve 4 = -rs + s for s. -4 Let n = 1 - 1. Solve ns = 4s + 12 for s. -3 Suppose 84 = 19j + 2j. Solve -14 + 2 = -js for s. 3 Let j(c) = -c + 1 - 5 + 13. Let x be j(-6). Solve -s = -4s + x for s. 5 Let v(k) = 2k3 - 6k*2 + k - 1. Let p be v(4). Suppose -4q + p = 7. Suppose d + 1 = 0, -3a = 3d + 2d - q. Solve -m + 0m - a = 0 for m. -4 Let i = -3 - -2. Let r be 1/(-2) - i/2. Let j be 0/(5 - (r + 3)). Solve j = 5a - 1 - 9 for a. 2 Suppose 0 = s - 4, 0s - 1 = i - s. Solve -im = -6m for m. 0 Suppose 4o + 45 + 115 = 0. Let b be o/(-12)(-15)/(-2). Suppose -3*w +	{ "pile_set_name": "DM Mathematics" }
v be i(-10). Suppose 8 = 5h - v. Calculate the remainder when h is divided by w. 5 Let u(l) = l2 + 14l + 37. What is the remainder when 46 + (1 + 3)/(-4) is divided by u(-13)? 21 Let y(x) = x - 16. Let b be y(14). What is the remainder when b + 46 + (-2 - 1) is divided by 22? 19 Let l(s) = s3 + s2 + s + 40. Let g be l(0). Suppose 38c = gc - 110. Suppose -5d - c + 225 = 0. Calculate the remainder when d is divided by 7. 6 Suppose 6g - 14 - 4 = 0. Suppose -12 = -3r - 0. Suppose 5f + 74 = gk - 2k, 0 = -rf. What is the remainder when k is divided by 19? 17 Suppose 8d + 5d = 26. Suppose -2l - 134 = -0f - 4f, 2 = dl. Calculate the remainder when f is divided by 12. 10 Let a be (2 - (-2 + 0)) + 0. Suppose -2g = 6, ag + 26 - 6 = 2v. Calculate the remainder when 8 is divided by v. 0 Let j = -12 - -22. Suppose 16f - 2f - 952 = 0. Calculate the remainder when f is divided by j. 8 Suppose 392z = 376z + 1440. Calculate the remainder when 169 is divided by z. 79 Let t(x) = x*3 + 6x*2 + x + 8. Let z be t(-6). Suppose f = -zf + 201. Calculate the remainder when f is divided by 23. 21 Let x = -21 - -45. Let o = -218 + 227. Calculate the remainder when x is divided by o. 6 Let f be (77 - (0 + -1))(-6 + 7). Let h = 180 - f. What is the remainder when h is divided by 21? 18 Suppose -3i = x - 101, 0 = 4i + 141x - 137x - 132. What is the remainder when i is divided by 4? 2 What is the remainder when 18 is divided by 4/(-42) - 1484/(-147)? 8 Let w = 19 + -17. Suppose -wf - 189 = -7a + 2a, 156 = 4a - 4f. Calculate the remainder when a is divided by 20. 17 Suppose -w - b = 2b + 1, -w + 5b + 31 = 0. Calculate the remainder when 54 is divided by w. 10 Suppose -a + 2 = -4u, -a + 5u = a - 13. What is the remainder when a is divided by 4? 2 Let i(o) = -o*2 + 6o. Let a be i(5). Suppose -3h - 2h + 93 = 2t, -at = 4h - 71. Let j(n) = n2 + n + 5. What is the remainder when h is divided by j(0)? 4 Let f = 48 - 12. What is the remainder when f is divided by 15? 6 What is the remainder when 1823 is divided by -2(-146)/(-4)83/(-83)? 71 Suppose 5z - 20 = 3m, 0m + 14 = -m - 2z. Calculate the remainder when (8/m)/(1/(-70)) is divided by 29. 27 Suppose -h + 38 = 3u, -3u - 64 = -3h + 26. Suppose 3n = -4 - 2. Let y(k) = 22k*2 - 4k - 3. What is the remainder when y(n) is divided by h? 29 Let f = 143 + -57. Let w = f + -58. Calculate the remainder when w is divided by 15. 13 Let k be 2/8 - 2010/(-24). Suppose 0 = 4g - 4f - k, 3g + 5f - 57 = 2f. What is the remainder when g is divided by 7? 6 Let m = 50 + -46. Suppose -157 = -mz + k, 3z + k = z + 71. Calculate the remainder when 104 is divided by z. 28 Let p = 47 - 194. Let d = p + 206. Calculate the remainder when d is divided by 6. 5 Suppose -3c + 7c - 44 = 0. Let h be -12 + 19 - (-1 - 3). Let s = 53 - h. What is the remainder when s is divided by c? 9 Suppose -5c = -0c. Suppose c = 5p - 6p + 3. Suppose 40 = -ps + 130. Calculate the remainder when 88 is divided by s. 28 Let i(h) = 2h3 + 13h2 + 16 - h3 + 55h - 59h. What is the remainder when i(-13) is divided by 18? 14 Suppose 37f = 28f + 1602. What is the remainder when f is divided by 15? 13 Let q(y) = y*3 - 57y*2 - 51y - 379. Let x(k) be the second derivative of 35k3/2 + k. Calculate the remainder when x(1) is divided by q(58). 24 Let q(d) = 2d*2 - 14d - 48. Calculate the remainder when 153 is divided by q(11). 33 Suppose 1017 = -43k + 11810. Calculate the remainder when k is divided by 14. 13 Suppose -5b + 249 = -3j, 2b - 3b = -j - 49. Calculate the remainder when 190 is divided by b. 37 Calculate the remainder when (-44)/66 + 25(-4)/(-6) is divided by 10. 6 Suppose 17 = 2g + 7w - 8w, 0 = -4g - 4w + 16. Let z(d) = -d3 + 9d*2 - 12d + 11. What is the remainder when z(g) is divided by 7? 4 Let z = 270 + -243. Calculate the remainder when 215 is divided by z. 26 Suppose 0x + x = -306. Calculate the remainder when (x/72)/((-1)/40) is divided by 43. 41 Let q = 5 + -17. Calculate the remainder when 3 + (-4)/(q/99) is divided by (-368)/(-36) - 2/9. 6 Suppose -4j - j + 4w = -821, -5w + 5 = 0. Suppose 0 = 4o - 4f - 232, 4o = 2f + 77 + j. Calculate the remainder when o is divided by 22. 19 Let c = -29 - -13. Let h = 946 - 841. Calculate the remainder when h is divided by ((-108)/(-16))/((-3)/c). 33 What is the remainder when 176 is divided by (-27)/(-12)-80(-7)/42? 26 Let m = 2563 - 2417. Calculate the remainder when m is divided by 24. 2 Suppose 0 = 3r + r - 1136. Let q = 22048 + -22007. Calculate the remainder when r is divided by q. 38 Let a(w) = -w3 + 5w*2 + 8w - 1. Let p = -13 + 36. Let r = p + -17. What is the remainder when a(r) is divided by 7? 4 Suppose -56 - 8 = 4a. Suppose 0 = 5g - 200 - 10. What is the remainder when g is divided by (16 + -1)(-15 - a)? 12 Let w(b) = 6b*2 + b - 4. Calculate the remainder when w(-3) is divided by 2/(-3)(-26 - 10). 23 Let q(b) = -9901 + 2b2 - 3b*2 + 9895 - 10b. Suppose -u + 0u - 6 = 0. What is the remainder when q(u) is divided by 7? 4 Suppose 5p + 10 - 125 = 0. Let a(o) = -o*3 - 6o*2 - o + 10. Suppose 8 = -3z - 13. What is the remainder when a(z) is divided by p? 20 Let o = -154 - -236. Calculate the remainder when o is divided by 42. 40 Let s(v) = -3v + 25. Let j(q) = 4q - 24. Let p(b) = 4j(b) + 5s(b). Calculate the remainder when p(-10) is divided by (2-1)/2-5. 4 Let f = 1129 + -850. Calculate the remainder when f is divided by 35. 34 Suppose -2w = 11 + 41. Calculate the remainder when w/10 + 3 + (-815)/(-25) is divided by (-62)/(-5) - 2/5. 9 Suppose -13s = -18s + 10. Suppose -sf + w + w = -76, 0 = 5w + 25. Calculate the remainder when 96 is divided by f. 30 Suppose -105 = -5s + 4k, 0s = 5s + 4k - 145. Let c(f) = 6f + 51. What is the remainder when c(8) is divided by s? 24 Let p(h) = -h2 + 12h - 3. Let u be p(12). Let m = u + 3. Calculate the remainder when 33 is divided by 2 + -5 + (m - -15). 9 Calculate the remainder when 42 is divided by (-11)/(-12 + 17 + (-6 - 0)). 9 Let c be 0 - (-1)/((-1)/(-42)). Suppose -3i + 47 = -2h, 3i - 4h = -7h + c. Let l(u) = -u2 + 9. What is the remainder when i is divided by l(0)? 6 Suppose 3l - i - 81 = 2i, -i = 2l - 42. Suppose 0 = -v - 2v + 225. Let y = -32 + v. Calculate the remainder when y is divided by l. 20 Let l(q) = -34q - 563. Let n(t) = -t3 + t2 - 4. Let g be n(0). Let v(h) = -3h - 3. Calculate the remainder when l(-17) is divided by v(g). 6 Suppose -5g + 22 = -t + 1, -4t + 2g = -6. Suppose -m - 2m - 5x = 16, 8 = -4m - tx. What is the remainder when 4 is divided by m? 1 Suppose 9 - 3 = 2f + 2x, 2x = -8. Suppose -fi - 26 + 264 = 0. What is the remainder when 132 is divided by i? 30 Suppose 0 = -9f + 402 + 732. Calculate the remainder when 372 is divided by f. 120 Suppose 3w + 2w - 15 = 0, -2m - w + 73 = 0. Let r = -6845 - -6851. Calculate the remainder when m is divided by r. 5 Let d(v) = -v3 + v2 - 3v + 47. Calculate the remainder when d(0) is divided by 14. 5 Let j(s) = 8s2 + 1. Let n(f) = -f3 - 15f2 - 8f - 33. What is the remainder when n(-15) is divided by j(-1)? 6 Calculate the remainder when -4-972/4 is divided by 67. 60 Suppose -13a - 5 = -14a. What is the remainder when 26 is divided by a? 1 Let k(i) = -i - 8. Let h be k(-13). Suppose 0 = -hf - 3w + 184 - 61, -4w = 5f - 124. What is the remainder when f is divided by 9? 6 Suppose 2l + 5k = 4l - 16, -l - 22 = 5k. What is the remainder when (l/(-3))/((20/915)/2) is divided by 16? 13 Suppose 2b - 19 = -5h - 103, -5b + 3h = 272. Calculate the remainder when 15 is divided by 1/(b/28 + 2). 1 Let i = 4 + -3. Let y be i((-2 - -2) + -2). Let r(f) = f2 - 1. What is the remainder when 7 is divided by r(y)? 1 Suppose q + 13q = 1050. What is the remainder when q is divided by (35 - 8) + 31? 15 Suppose 4u - 1 + 13 = 0. Suppose 3k + 9 = 5d - 2, -k = -3. Calculate the remainder when 14 - (u - (-6 - -2)) is divided by d. 1 Let i be 15 - (-2 + 2) - 4. Suppose -4t = 5d - 37, id + 33 = 14d - 3*t. Calculate the remainder when 47 is divided by d. 2 Let m = 144 + -112. Calculate the remainder when 142 is divided by m. 14 L	{ "pile_set_name": "DM Mathematics" }
What is prob of sequence jrq? 5/198 Calculate prob of sequence ep when two letters picked without replacement from {x: 3, e: 1, p: 2, t: 7, y: 5}. 1/153 What is prob of sequence su when two letters picked without replacement from {o: 7, s: 2, u: 1}? 1/45 Three letters picked without replacement from lsisiliiiillissil. Give prob of sequence ssi. 2/85 What is prob of sequence mzm when three letters picked without replacement from {z: 4, g: 1, m: 3}? 1/14 Three letters picked without replacement from {p: 2, x: 4, l: 3, f: 2}. What is prob of sequence xxx? 4/165 Calculate prob of sequence pmmm when four letters picked without replacement from {m: 6, p: 1, w: 7}. 5/1001 Three letters picked without replacement from bbaaaaoabaaobboaaao. Give prob of sequence bao. 100/2907 Calculate prob of sequence ff when two letters picked without replacement from gggffgffgfgbgggpg. 5/68 Four letters picked without replacement from btbbbbbbbbbt. What is prob of sequence btbt? 1/66 What is prob of sequence sdi when three letters picked without replacement from wsdeesrsiddswsdise? 1/102 Four letters picked without replacement from kkuukukdkkkkkkd. Give prob of sequence dkkd. 1/182 Two letters picked without replacement from bhbh. Give prob of sequence hh. 1/6 Calculate prob of sequence oh when two letters picked without replacement from htothdtddhdodhh. 1/21 Calculate prob of sequence ls when two letters picked without replacement from {l: 1, y: 2, s: 4, a: 2}. 1/18 Two letters picked without replacement from ssesssseyser. What is prob of sequence rs? 7/132 Three letters picked without replacement from {l: 5, c: 1, r: 2, y: 1}. Give prob of sequence lcl. 5/126 Three letters picked without replacement from expxpppuegexxuxxgexe. What is prob of sequence geu? 1/342 Calculate prob of sequence afw when three letters picked without replacement from afmwa. 1/30 Calculate prob of sequence ztnc when four letters picked without replacement from tztsscn. 1/420 Two letters picked without replacement from {z: 2, b: 9, q: 2, m: 1, n: 2, s: 4}. Give prob of sequence zb. 9/190 Calculate prob of sequence rim when three letters picked without replacement from grmiuug. 1/210 Three letters picked without replacement from {z: 4, a: 6, b: 1, c: 3}. Give prob of sequence zza. 3/91 Two letters picked without replacement from {a: 2, g: 2, p: 1, f: 3, k: 3, b: 3}. Give prob of sequence kk. 3/91 Three letters picked without replacement from {l: 4, h: 2}. What is prob of sequence llh? 1/5 Three letters picked without replacement from {x: 1, y: 1, s: 2, d: 2, v: 1}. What is prob of sequence xsy? 1/105 Two letters picked without replacement from {b: 10, f: 4, s: 4, z: 2}. Give prob of sequence fs. 4/95 Two letters picked without replacement from {y: 7, f: 4}. What is prob of sequence yf? 14/55 Four letters picked without replacement from wwxauwawxumxuww. Give prob of sequence maux. 1/1820 Calculate prob of sequence su when two letters picked without replacement from suctssssusuhschu. 7/60 Calculate prob of sequence sxx when three letters picked without replacement from vxxxvxxsvsfvvxvxvfx. 56/2907 What is prob of sequence mgg when three letters picked without replacement from gmkkgmkg? 1/28 What is prob of sequence wb when two letters picked without replacement from {w: 1, t: 1, b: 2}? 1/6 Four letters picked without replacement from {g: 5, t: 12, p: 2}. What is prob of sequence pggg? 5/3876 What is prob of sequence ccq when three letters picked without replacement from {l: 4, q: 2, c: 4, k: 2}? 1/55 Four letters picked without replacement from {q: 5, g: 4, d: 1, z: 2, o: 7, l: 1}. What is prob of sequence zgqz? 1/2907 Three letters picked without replacement from hhvhkkhvjhhvjhk. What is prob of sequence hjk? 1/65 Calculate prob of sequence uj when two letters picked without replacement from {p: 3, n: 1, j: 1, s: 10, u: 2, k: 2}. 1/171 Three letters picked without replacement from zxxxxxxxxsxxxx. Give prob of sequence xzx. 11/182 Three letters picked without replacement from {e: 1, d: 2, q: 2, u: 1, i: 1, o: 2}. What is prob of sequence qui? 1/252 Four letters picked without replacement from ezxzq. Give prob of sequence qzez. 1/60 Four letters picked without replacement from {k: 6}. What is prob of sequence kkkk? 1 What is prob of sequence jnnn when four letters picked without replacement from {u: 1, m: 1, g: 1, e: 2, n: 3, j: 3}? 1/440 Four letters picked without replacement from {t: 1, m: 1, s: 2, h: 5, d: 3}. What is prob of sequence thdd? 1/396 Three letters picked without replacement from ndndn. What is prob of sequence nnn? 1/10 What is prob of sequence zz when two letters picked without replacement from {q: 6, z: 13}? 26/57 What is prob of sequence tt when two letters picked without replacement from ttaaaaatata? 6/55 What is prob of sequence bhhb when four letters picked without replacement from bnhhbhhhnhbhhb? 4/143 Three letters picked without replacement from {h: 3, u: 2, n: 7}. What is prob of sequence hnh? 7/220 Four letters picked without replacement from xjxrrjxrjxrjxr. Give prob of sequence rxrx. 50/3003 Calculate prob of sequence ied when three letters picked without replacement from eieiiedediieeeieee. 5/204 Two letters picked without replacement from {i: 4, o: 1, h: 1, e: 11, d: 1}. Give prob of sequence ie. 22/153 Two letters picked without replacement from {q: 2, n: 1, w: 1, c: 2, b: 1}. What is prob of sequence cq? 2/21 Four letters picked without replacement from {f: 6, y: 2, e: 2, d: 6, r: 1, u: 3}. What is prob of sequence dudf? 3/646 What is prob of sequence osd when three letters picked without replacement from {d: 1, s: 2, o: 2}? 1/15 What is prob of sequence uso when three letters picked without replacement from {u: 1, s: 1, n: 1, o: 2, r: 2, z: 1}? 1/168 Two letters picked without replacement from {i: 13, t: 3}. Give prob of sequence it. 13/80 Two letters picked without replacement from {v: 7, h: 2, w: 7}. What is prob of sequence vw? 49/240 What is prob of sequence cic when three letters picked without replacement from {c: 3, j: 1, r: 1, p: 2, i: 3, b: 1}? 1/55 Four letters picked without replacement from {a: 1, k: 17}. What is prob of sequence kkak? 1/18 Two letters picked without replacement from {r: 3, n: 10, x: 3, q: 1, v: 1, c: 1}. Give prob of sequence nn. 5/19 What is prob of sequence xxb when three letters picked without replacement from {q: 8, x: 7, b: 5}? 7/228 Four letters picked without replacement from {h: 9, g: 5}. What is prob of sequence ghhg? 60/1001 What is prob of sequence otw when three letters picked without replacement from otwqwqqqqqwwwqqwwo? 7/2448 Two letters picked without replacement from {i: 3}. Give prob of sequence ii. 1 Calculate prob of sequence vk when two letters picked without replacement from vvvvxxvazk. 1/18 What is prob of sequence fd when two letters picked without replacement from {d: 2, f: 9, c: 3, i: 3}? 9/136 Calculate prob of sequence uw when two letters picked without replacement from euquqntquuwqtuuttutw. 7/190 Two letters picked without replacement from hhhl. What is prob of sequence hl? 1/4 Two letters picked without replacement from kmzjmxk. What is prob of sequence zj? 1/42 What is prob of sequence loms when four letters picked without replacement from olllollmlsmlklkkl? 3/4760 Two letters picked without replacement from {t: 1, w: 1, l: 1, x: 1, o: 1}. Give prob of sequence xl. 1/20 What is prob of sequence oyy when three letters picked without replacement from {o: 2, y: 8, j: 5}? 8/195 What is prob of sequence eppp when four letters picked without replacement from geppgpgpeppppgpg? 3/130 Calculate prob of sequence pk when two letters picked without replacement from {s: 3, x: 2, q: 1, k: 2, p: 4, f: 2}. 4/91 Two letters picked without replacement from diuiwiq. Give prob of sequence iu. 1/14 Two letters picked without replacement from gvggvvgvgglglg. What is prob of sequence vl? 4/91 What is prob of sequence hy when two letters picked without replacement from {s: 1, y: 9, h: 5, x: 5}? 9/76 Calculate prob of sequence oso when three letters picked without replacement from {e: 2, a: 1, s: 2, w: 1, o: 1}. 0 What is prob of sequence qqo when three letters picked without replacement from nqorroqrrrqqooo? 2/91 What is	{ "pile_set_name": "DM Mathematics" }
9}? 1 Two letters picked without replacement from swswwsxuwwxuuwrwwuws. What is prob of sequence sr? 1/95 Four letters picked without replacement from {t: 2, f: 10}. Give prob of sequence tfft. 1/66 Calculate prob of sequence eeee when four letters picked without replacement from {e: 7}. 1 Calculate prob of sequence umu when three letters picked without replacement from mummufbmmmmb. 7/660 Two letters picked without replacement from qqqiiii. Give prob of sequence qq. 1/7 Two letters picked without replacement from {c: 3, i: 1}. What is prob of sequence ic? 1/4 Two letters picked without replacement from {r: 3, y: 9}. Give prob of sequence yy. 6/11 What is prob of sequence baja when four letters picked without replacement from {u: 5, o: 1, a: 3, j: 3, b: 4, m: 4}? 1/1615 Calculate prob of sequence uu when two letters picked without replacement from {x: 1, u: 14}. 13/15 Four letters picked without replacement from vzzfzzzzzvzvzzfzz. What is prob of sequence zvzf? 33/2380 What is prob of sequence hhqq when four letters picked without replacement from qqqtqhhht? 1/42 Two letters picked without replacement from tmammtamamammaammta. What is prob of sequence mt? 3/38 Calculate prob of sequence qajj when four letters picked without replacement from {u: 2, m: 1, j: 2, a: 2, q: 1}. 1/420 Three letters picked without replacement from {p: 11, f: 2, d: 2, h: 1}. What is prob of sequence dhd? 1/1680 Two letters picked without replacement from {i: 1, e: 1, s: 3}. What is prob of sequence ss? 3/10 What is prob of sequence io when two letters picked without replacement from iyiyyyoitxyyii? 5/182 Two letters picked without replacement from bpbhbbhhp. Give prob of sequence hp. 1/12 Three letters picked without replacement from {i: 1, w: 1, j: 1, d: 1, x: 5}. Give prob of sequence dwi. 1/504 What is prob of sequence rr when two letters picked without replacement from rsssr? 1/10 Three letters picked without replacement from yyytyyyzyyyztzvv. Give prob of sequence ttv. 1/840 What is prob of sequence cs when two letters picked without replacement from {s: 1, t: 2, o: 3, c: 4, w: 3, x: 4}? 1/68 Four letters picked without replacement from {c: 1, o: 3, j: 1}. What is prob of sequence cjoo? 1/20 Calculate prob of sequence lvd when three letters picked without replacement from {l: 1, v: 4, u: 7, d: 1}. 1/429 Four letters picked without replacement from pgioj. Give prob of sequence giij. 0 Two letters picked without replacement from ceeeeceeceeeee. What is prob of sequence ee? 55/91 Calculate prob of sequence tiit when four letters picked without replacement from tttieoioto. 1/210 What is prob of sequence cr when two letters picked without replacement from rccccccrccccmc? 11/91 What is prob of sequence gfkf when four letters picked without replacement from kfggggff? 1/70 Two letters picked without replacement from {q: 18, p: 2}. Give prob of sequence pq. 9/95 Three letters picked without replacement from dndqdqnqqdnqd. What is prob of sequence dnq? 25/572 Calculate prob of sequence qxo when three letters picked without replacement from {a: 7, o: 2, g: 1, x: 3, q: 5}. 5/816 What is prob of sequence tvlw when four letters picked without replacement from {t: 4, v: 1, m: 3, w: 2, l: 1}? 1/990 Three letters picked without replacement from kgjj. Give prob of sequence jgg. 0 What is prob of sequence cq when two letters picked without replacement from qqqqqccqq? 7/36 What is prob of sequence fhff when four letters picked without replacement from {i: 2, h: 6, f: 11}? 165/2584 What is prob of sequence xxp when three letters picked without replacement from {p: 14, x: 4}? 7/204 Four letters picked without replacement from agxbbcxaw. What is prob of sequence cwax? 1/756 What is prob of sequence vyqy when four letters picked without replacement from vqyyvqvyyvvyy? 5/286 What is prob of sequence pf when two letters picked without replacement from nfpmmmnvpmn? 1/55 Three letters picked without replacement from eceeddcudeedc. What is prob of sequence eud? 5/429 Calculate prob of sequence xxy when three letters picked without replacement from {y: 1, x: 10, t: 7}. 5/272 Two letters picked without replacement from {x: 3, b: 1, f: 1, t: 11, o: 2}. What is prob of sequence bo? 1/153 What is prob of sequence yyy when three letters picked without replacement from yyuuyyyyuy? 7/24 What is prob of sequence xr when two letters picked without replacement from {x: 1, q: 1, r: 2}? 1/6 Four letters picked without replacement from mxmbiiu. What is prob of sequence mmux? 1/420 Three letters picked without replacement from {n: 2, j: 2, q: 1, k: 1, p: 1}. What is prob of sequence qpn? 1/105 Four letters picked without replacement from tttgtttggtggg. What is prob of sequence tggg? 7/143 Three letters picked without replacement from eghbgeegeyhbhh. Give prob of sequence eeg. 3/182 Three letters picked without replacement from {n: 1, j: 2, v: 11, o: 1}. What is prob of sequence onv? 11/2730 Calculate prob of sequence xxy when three letters picked without replacement from xxxyxxxyxy. 7/40 Three letters picked without replacement from xxzzz. Give prob of sequence zxx. 1/10 What is prob of sequence jrj when three letters picked without replacement from {l: 7, j: 9, r: 3}? 12/323 Four letters picked without replacement from wlshhhhlsqqc. Give prob of sequence qqsw. 1/2970 Four letters picked without replacement from {y: 1, v: 4, j: 4, b: 1, q: 1, c: 4}. Give prob of sequence yvcq. 2/4095 Calculate prob of sequence vn when two letters picked without replacement from {u: 1, g: 1, t: 3, v: 1, n: 1}. 1/42 What is prob of sequence dwky when four letters picked without replacement from kykdjnw? 1/420 What is prob of sequence uv when two letters picked without replacement from {l: 5, t: 1, y: 1, u: 1, v: 4}? 1/33 Three letters picked without replacement from uumuuudduduuddll. What is prob of sequence ulm? 1/210 Four letters picked without replacement from {e: 1, n: 2, w: 4, g: 2, z: 2, u: 1}. Give prob of sequence nenu. 1/5940 What is prob of sequence icc when three letters picked without replacement from {i: 3, c: 5}? 5/28 What is prob of sequence zrcf when four letters picked without replacement from {r: 1, c: 1, f: 7, z: 2, q: 6}? 1/4080 What is prob of sequence gt when two letters picked without replacement from {t: 2, a: 4, g: 6}? 1/11 Four letters picked without replacement from lqqqlqqqqlqqqq. Give prob of sequence lqlq. 5/182 Four letters picked without replacement from {r: 5, l: 3, k: 1, t: 3}. Give prob of sequence rkrl. 1/198 What is prob of sequence ng when two letters picked without replacement from kngbkkkbzkzk? 1/132 Four letters picked without replacement from sujuddjjdd. What is prob of sequence uuds? 1/630 Calculate prob of sequence uutu when four letters picked without replacement from tlliuulteelltulltctl. 1/3876 Calculate prob of sequence up when two letters picked without replacement from {j: 5, u: 3, p: 1}. 1/24 Three letters picked without replacement from {c: 10}. What is prob of sequence ccc? 1 Three letters picked without replacement from fxxxxhjxfhfhpjxfxp. Give prob of sequence xxx. 35/816 Two letters picked without replacement from cwbicdi. Give prob of sequence id. 1/21 Three letters picked without replacement from {f: 3, p: 2}. Give prob of sequence pff. 1/5 Two letters picked without replacement from kfkffkfkffsfk. Give prob of sequence ff. 7/26 Two letters picked without replacement from {i: 3, f: 11}. Give prob of sequence fi. 33/182 Two letters picked without replacement from {b: 7, o: 8, h: 3}. Give prob of sequence bb. 7/51 Calculate prob of sequence flfj when four letters picked without replacement from llfllfljljllllljll. 13/12240 What is prob of sequence sgcs when four letters picked without replacement from {g: 4, s: 7, c: 7}? 49/3060 What is prob of sequence jqs when three letters picked without replacement from ypesjqqy? 1/168 Three letters picked without replacement from {m: 6, q: 11, s: 1}. What is prob of sequence qms? 11/816 Three letters picked without replacement from tgvytzvytt. What is prob of sequence zvy? 1/180 Four letters picked without replacement from {c: 3, j: 1}. Give prob of sequence cjcc. 1/4 Three letters picked without replacement from nbnnnnnnnbnnn	{ "pile_set_name": "DM Mathematics" }
n -2371, -4735, -7093, -9445, -11791? -14131 What is next in 1655, 3297, 4931, 6551, 8151, 9725, 11267? 12771 What is the next term in -455, -932, -1423, -1934, -2471? -3040 What is next in 127, 247, 369, 493, 619, 747? 877 What comes next: 1107, 1393, 2169, 3681, 6175, 9897? 15093 What is the next term in 719, 1460, 2201? 2942 What is the next term in -2484082, -4968161, -7452240, -9936319, -12420398, -14904477? -17388556 What comes next: -648150, -648148, -648146, -648144, -648142, -648140? -648138 What is next in 44097, 44025, 43953, 43881, 43809? 43737 What is next in 62182, 124369, 186554, 248737, 310918, 373097? 435274 What is next in 1096, 809, 522, 235? -52 What is the next term in -25395, -25131, -24867, -24603, -24339, -24075? -23811 What is next in -3138, -6255, -9372, -12489? -15606 What is next in -276, -2427, -8432, -20271, -39924, -69371, -110592, -165567? -236276 What is the next term in 240, 426, 548, 606, 600? 530 What is the next term in 534647, 534643, 534635, 534623? 534607 What is the next term in 6287, 6318, 6371, 6446, 6543, 6662? 6803 What is the next term in -650, -1262, -1872, -2480? -3086 What is next in 758, 782, 850, 986, 1214? 1558 What comes next: 115, 109, 101, 91? 79 What is the next term in -14137, -14165, -14265, -14473, -14825? -15357 What comes next: 871748, 871741, 871732, 871721, 871708, 871693, 871676? 871657 What is next in 11405, 22908, 34411? 45914 What is the next term in 265, -42, -349, -656, -963? -1270 What comes next: -85999, -86000, -86001, -86002, -86003, -86004? -86005 What comes next: -3100, -3133, -3164, -3193, -3220, -3245? -3268 What is next in -7767, -7764, -7761, -7758, -7755, -7752? -7749 What is next in -63, -28, 9, 48, 89, 132? 177 What comes next: 2202, 17606, 59398, 140772, 274922, 475042, 754326? 1125968 What is the next term in -38969, -38880, -38791, -38702? -38613 What is next in -624, -623, -616, -603, -584? -559 What is the next term in -512, -422, -332, -242, -152, -62? 28 What is next in 1755, 3498, 5229, 6942, 8631, 10290, 11913? 13494 What is next in -5309, -5284, -5259, -5234, -5209? -5184 What comes next: -42, -247, -590, -1071, -1690? -2447 What is the next term in 103, -67, -377, -899, -1705, -2867, -4457, -6547? -9209 What is next in 261, 352, 443? 534 What is the next term in 233, 360, 573, 872? 1257 What is the next term in -425147, -425149, -425151, -425153, -425155, -425157? -425159 What is the next term in -8427, -8466, -8531, -8622, -8739, -8882? -9051 What comes next: 69270, 69268, 69266, 69264, 69262, 69260? 69258 What comes next: -278613, -278615, -278617, -278619? -278621 What comes next: -619, -1273, -1925, -2575, -3223? -3869 What comes next: -252575, -252576, -252577, -252578, -252579, -252580? -252581 What is the next term in -294, -1043, -2308, -4089, -6386, -9199? -12528 What is next in 123754, 123760, 123766? 123772 What is next in 229, 933, 2107, 3751, 5865? 8449 What is next in -7104, -7563, -8022? -8481 What comes next: -116934, -233859, -350784, -467709, -584634, -701559? -818484 What comes next: -1066, -2138, -3204, -4258, -5294? -6306 What is the next term in 924, 924, 922, 918, 912? 904 What is next in 338, 1334, 2976, 5252, 8150, 11658? 15764 What comes next: -94, -673, -1628, -2953, -4642, -6689? -9088 What is next in 9382, 37531, 84446, 150127? 234574 What comes next: -4936, -9930, -14924, -19918, -24912? -29906 What is next in 1147, 2260, 3303, 4270, 5155, 5952, 6655? 7258 What is the next term in 41, 40, 39? 38 What comes next: 318457, 318458, 318459, 318460, 318461? 318462 What is the next term in 1030, 2096, 3162, 4228, 5294, 6360? 7426 What is next in 3796, 15229, 34284, 60961, 95260? 137181 What comes next: -6793, -6830, -6893, -6982, -7097, -7238? -7405 What is next in -59, -1401, -3639, -6773, -10803? -15729 What is the next term in -60192, -60188, -60182, -60174? -60164 What is the next term in 2543, 20307, 68513, 162383, 317139? 548003 What is next in -15, -38, -47, -42, -23? 10 What is next in 1120, 2171, 3222? 4273 What is the next term in -5154, -10257, -15308, -20307, -25254, -30149, -34992? -39783 What is the next term in 161, 151, -25, -367, -875, -1549, -2389? -3395 What is the next term in -8818, -17635, -26446, -35251, -44050, -52843? -61630 What comes next: -120418, -120419, -120420, -120421, -120422, -120423? -120424 What is next in -3476479, -3476471, -3476451, -3476413, -3476351? -3476259 What comes next: -20661, -20657, -20645, -20619, -20573, -20501, -20397? -20255 What is next in -1618413, -1618412, -1618411, -1618410, -1618409, -1618408? -1618407 What is the next term in 887, 918, 959, 1004, 1047, 1082, 1103? 1104 What comes next: -6064, -6019, -5898, -5665, -5284, -4719, -3934, -2893? -1560 What is next in 6, 216, 788, 1902, 3738, 6476? 10296 What comes next: -39249, -39247, -39245, -39243? -39241 What is the next term in -14222, -14237, -14254, -14273, -14294? -14317 What is next in 474, 1888, 4230, 7500, 11698, 16824? 22878 What is next in -851, -414, 33, 496, 981, 1494, 2041, 2628? 3261 What is the next term in -68, -276, -622, -1106, -1728, -2488? -3386 What is the next term in -175, -501, -1149, -2287, -4083, -6705? -10321 What is next in 498, 954, 1398, 1830, 2250, 2658, 3054? 3438 What is next in 293, 43, -367, -937, -1667, -2557? -3607 What is next in -20528, -20523, -20516, -20507, -20496, -20483? -20468 What comes next: -1243, -1189, -1127, -1081, -1075, -1133, -1279, -1537? -1931 What comes next: 10008, 10011, 10006, 9987, 9948, 9883, 9786? 9651 What comes next: 109, 280, 769, 1738, 3349? 5764 What comes next: -4175, -4162, -4149, -4136, -4123? -4110 What comes next: 9368, 9374, 9380? 9386 What comes next: 81428, 81498, 81618, 81794, 82032, 82338, 82718? 83178 What is next in -746, -1404, -2062, -2720, -3378? -4036 What comes next: -3156, -3045, -2934? -2823 What is next in 571, 1054, 1513, 1936, 2311, 2626, 2869? 3028 What is next in 240, 1840, 6188, 14658, 28624, 49460, 78540? 117238 What is next in 618, 4871, 16358, 38679, 75434? 130223 What is the next term in 65502, 65505, 65508, 65511, 65514, 65517? 65520 What is the next term in -2197276, -2197275, -2197274, -2197273? -2197272 What is the next term in -200, -435, -686, -959, -1260, -1595, -1970, -2391? -2864 What comes next: -548, -1101, -1602, -2027, -2352, -2553, -2606, -2487? -2172 What is next in 23, 120, 303, 590, 999? 1548 What is next in 18191, 36378, 54565, 72752, 90939, 109126? 127313 What is next in 85, 469, 1503, 3511, 6817, 11745, 18619? 27763 What is the next term in -2913, -11650, -26211, -46596, -72805, -104838? -142695 What comes next: -34163, -34163, -34151, -34121, -34067, -33983? -33863 What comes next: -7369, -7378, -7387, -7396, -7405? -7414 What comes next: -364551, -364550, -364549? -364548 What comes next: -159, -379, -597, -813, -1027? -1239 What comes next: 6779, 13564, 20349? 27134 What is next in -60, -39, 66, 255? 528 What comes next: -14764, -58920, -132514, -235546? -368016 What is next in -358, -762, -1166, -1570, -1974? -2378 What is the next term in 250149, 250154, 250159, 250164? 250169 What is the next term in -47, -73, -95, -113? -127 What is the next term in 779062, 1558123, 2337184, 3116245? 3895306 What comes next: -697, -715, -733? -751 What comes next: -2445, -9882, -22277, -39630, -61941, -89210? -121437 What is the next term in -8875, -8875, -8869, -8851, -8815, -8755, -8665, -8539? -8371 What is the next term in 187315, 187310, 187305, 187300, 187295? 187290 What is next in -36197, -36192, -36187, -36182? -36177 What comes next: -156468, -156487, -156506, -156525, -156544? -156563 What is the next term in 7231, 7238, 7259, 7300, 7367? 7466 What is next in -12366, -24732, -37098, -49464? -61830 What comes next: 16416, 16425, 16456, 16521, 16632, 16801? 17040 What is next in 6195, 6193, 6191, 6189, 6187, 6185? 6183 What is next in -1586356, -1586357, -1586358? -1586359 What is the next term in 1824, 1818, 1818, 1824, 1836? 1854 What is the next term in 123634, 123633, 123632, 123631? 123630 What comes next: 352, -533, -1418, -2303? -3188 What is the next term in -48, -63, -102, -177, -300, -483, -738? -1077 What comes next: -4, 219, 746, 1703, 3216, 5411, 8414? 12351 What is the next term in 27712,	{ "pile_set_name": "DM Mathematics" }
(sqrt(66) + -3sqrt(66))/sqrt(6))). -670 + 12sqrt(11) Simplify 26(-51sqrt(98)1 - (5 + (sqrt(98) - (0 + sqrt(98) + (sqrt(98)2 - sqrt(98)))))). -336sqrt(2) - 60 Simplify ((sqrt(1584) - 2sqrt(1584)3) + 2 + (5 + sqrt(1584) + 2)1 + -4)*2. -480sqrt(11) + 25369 Simplify 2 + (sqrt(441)/(sqrt(21)/sqrt(3)-5))2 + ((sqrt(336) - sqrt(21))-2)/(sqrt(3) - (sqrt(432) + sqrt(432)2)). 6sqrt(7)/35 + 113/25 Simplify (-1 + (sqrt(700) + 3 + -2 + -5 - (1 + sqrt(700) + -5 + sqrt(700) + sqrt(700)2 + -2 + sqrt(700))))2. -80sqrt(7) + 11201 Simplify ((sqrt(192)-6 - (sqrt(768) - sqrt(768)2))-4)/(((sqrt(2916) - sqrt(2916)-1) + sqrt(2916) - sqrt(36))/((sqrt(150)/sqrt(5))/sqrt(5))). 32sqrt(2)/13 Simplify -53(3 + (((sqrt(425) - (1 + sqrt(425))) + sqrt(425))5 + -4)*21). -160635 + 6750sqrt(17) Simplify (sqrt(189)/sqrt(225) + sqrt(21))/((-2sqrt(56))/sqrt(8)) - (sqrt(252)/(-3sqrt(7)))/sqrt(1728). -103sqrt(3)/180 Simplify ((sqrt(49) - (sqrt(98)/sqrt(2) + sqrt(49)))5)/(sqrt(252)1 + sqrt(7)) + 5((sqrt(700) - (sqrt(700) + -4 + sqrt(700) + sqrt(700))) + 3). -705sqrt(7)/7 + 35 Simplify -3 + 3 + -1(sqrt(112) + 0)2 + (-4 + sqrt(63) + (sqrt(28) + sqrt(28)2)/sqrt(4))*2. -48sqrt(7) + 156 Simplify (2 + sqrt(2) + ((sqrt(98)1)2 - sqrt(98)) + sqrt(2))-2 - ((sqrt(2) + -6sqrt(8) - (sqrt(6)2)/sqrt(3)) + -2). -198 + 23sqrt(2) Simplify (1 + sqrt(36)/sqrt(2) + (sqrt(18) - (sqrt(90)-1)/sqrt(5)))*2 + -3 - (-4 + ((-2sqrt(126) + sqrt(126))/sqrt(7) - (sqrt(18) + -1 + -4))). 24sqrt(2) + 159 Simplify (-4 + (sqrt(128) + 1 + sqrt(128) + -1 + sqrt(128) + (0 + sqrt(128))6 - -4(5 + (2sqrt(128) - sqrt(128)))) + 1)*24. 14144sqrt(2) + 87684 Simplify (1 + -2(4 + (-1 + sqrt(832))1-2))*2 + 5. -704sqrt(13) + 13438 Simplify (3sqrt(980)-3 - sqrt(980))/(sqrt(196) + (sqrt(196)36 - sqrt(196) - sqrt(196)) + sqrt(196))-4. 20sqrt(5)/9 Simplify -5-4(3(0 + sqrt(7)) + (sqrt(70)-2 - sqrt(70))/sqrt(10) + sqrt(56)/((sqrt(72)3)/sqrt(9))). 20sqrt(7)/3 Simplify ((5(-1sqrt(320) + sqrt(320) + 2 - (1 + sqrt(320))-2) + 1 + 2 + -2)2 + 2)*2. 14080sqrt(5) + 129936 Simplify -3 + ((0 + -5((sqrt(153) - 4(-1 + sqrt(153) + sqrt(153))) + sqrt(153)))2 - (-3 + 4 + sqrt(153) + 1 + 0)2). -3612sqrt(17) + 137940 Simplify (1sqrt(119)-4 + sqrt(119) - (sqrt(119) + -2sqrt(119)-3))/((sqrt(567) - sqrt(567)-3)-4). 5sqrt(17)/72 Simplify sqrt(3) + sqrt(12) + 3 + 0 + sqrt(18)/sqrt(6) + (1sqrt(3024) - sqrt(3024))/(6sqrt(28)/sqrt(4)). 3 + 4sqrt(3) Simplify (-2(2sqrt(168)1 - sqrt(168))/sqrt(4))/(((sqrt(72) - sqrt(72)2)/sqrt(2))/(sqrt(36)/(sqrt(6)-2))). -sqrt(7) Simplify (-2sqrt(228)-3-5)/(sqrt(300)-11). 6sqrt(19) Simplify 2-1((sqrt(891) - (5(sqrt(891) + 0 + sqrt(891)) - sqrt(891)) - sqrt(891)-1-2)22 + -4). -356392 Simplify ((sqrt(180) + 4)*2-1 + -3 - ((-1sqrt(600))/sqrt(10) + sqrt(60))/(2sqrt(192))) + -3 + 1. -201 - 48sqrt(5) Simplify 1 + (sqrt(176) + (sqrt(176)-24)2 - sqrt(176) - ((sqrt(176) - sqrt(176)-2) + 5)*2) + -3 + 4 + 0. -120sqrt(11) + 9657 Simplify -4 + (-5 + (sqrt(605) + -1)-2)2 - -2(0 + sqrt(320) + -5)-5. 52sqrt(5) + 2475 Simplify ((4-1sqrt(891))*2 - 1sqrt(891)5) + (5(sqrt(891) + 0) + sqrt(891) - ((sqrt(891) - (0 + sqrt(891)))*2 + 0)). 9sqrt(11) + 14256 Simplify ((0 + 4 + 1(-5 + sqrt(1573) + -4))-2-6)2. -15840sqrt(13) + 230112 Simplify (4 + sqrt(128)1 + 5 - ((sqrt(14) - sqrt(126))-6)/((sqrt(448) - -1sqrt(448)) + sqrt(448)))2 + -3. 381/2 + 135sqrt(2) Simplify 4 + (0 + (((sqrt(1900)-1 + sqrt(1900))4 - sqrt(1900) - (6(1 + sqrt(1900)) + sqrt(1900))) + 0)2)-6. -729812 - 5760sqrt(19) Simplify (-5((sqrt(130)/(sqrt(90) - sqrt(10)) - (sqrt(91)/(sqrt(21)/sqrt(3)) - sqrt(13)))-2 + 6(((sqrt(78)-1)/sqrt(6) - sqrt(13)) + 2)))2. -7800sqrt(13) + 58525 Simplify (-4 + (-5 + (6(0 + sqrt(75)) + (-2 + sqrt(75))1)-2 + -1)2)3. 840sqrt(3) + 44100 Simplify ((sqrt(24)/sqrt(2))2 + sqrt(12) + -1 - sqrt(9)/sqrt(3)-2-3) + ((sqrt(363) + 1)-6-24)*2. 50684sqrt(3) + 838667 Simplify ((sqrt(156)5-1 - (-3sqrt(156) + sqrt(156))5)/((sqrt(36)23)/(-2sqrt(243))))2. 2925 Simplify (4sqrt(108)/sqrt(3) + (sqrt(108) - sqrt(108)-1)/sqrt(3))/(-5(-1sqrt(108) + sqrt(12))5) + -2. -2 + 3sqrt(3)/25 Simplify (6-5(sqrt(80) + 1sqrt(80) + sqrt(80) + sqrt(80) + sqrt(80) + -3 - 2(sqrt(80)-2 - sqrt(80))))*2-6. -52320600 + 1425600sqrt(5) Simplify 0 + (sqrt(684) + 4 + 5 - (sqrt(1539) + sqrt(1539) + (-3sqrt(1539)-2 - sqrt(1539)))2)2 + -4. -150808 + 12sqrt(19) Simplify -4(-1 + (sqrt(1539) - ((-2 + sqrt(1539))2 + sqrt(1539))2)3)15 + 0. -13500sqrt(19) + 832040 Simplify -6((sqrt(891) - (1 + (sqrt(891) + sqrt(891) + -2 - sqrt(891)))) + (-2-2sqrt(891) - sqrt(891)) + 6(-2 + sqrt(891)) + -2(1 + sqrt(891)))*2. -262968 + 9828sqrt(11) Simplify (4 + (sqrt(153) - sqrt(153)-21) - (-5 + sqrt(153)6 + -1))23. -540sqrt(17) + 4431 Simplify (6(sqrt(132)2 - sqrt(132))-6)/(((3sqrt(432))/sqrt(9))/sqrt(4)). -12sqrt(11) Simplify ((53sqrt(171)-3-2)/(5((sqrt(135)/sqrt(3))/sqrt(5) - (sqrt(45)-1)/sqrt(5))))*2. 1539 Simplify 5 + 1 + -2(5 + -3 + (3(2 + sqrt(1700)))2)1. -30670 - 720sqrt(17) Simplify 4 + ((4(-5 + 2 + sqrt(1584) + -3) + -2)6)2. -89856sqrt(11) + 936724 Simplify 3(((1 + -1 + sqrt(245) - sqrt(245)) + 12sqrt(245) + sqrt(245))2 - -32(sqrt(245) + 0 + sqrt(245) - sqrt(245))2)1. 11025 Simplify (sqrt(408)/(sqrt(120)/sqrt(10)) - 4sqrt(34)2)/(((sqrt(30)-1)/sqrt(3))/sqrt(5)6). 7sqrt(17)/6 Simplify 6-56(-4 + 6(3(-2 + sqrt(1008)))*2)6. -59015520 + 2799360sqrt(7) Simplify (sqrt(1620) - sqrt(1620)24)2 - (sqrt(180)-1 + sqrt(45))5. 15sqrt(5) + 79380 Simplify (-4 + 5 + (4-1sqrt(114))/((sqrt(48)/(sqrt(32)/sqrt(4)) - sqrt(6)) + sqrt(6)) + 1 + -3)*2. 8sqrt(19) + 305 Simplify (((sqrt(272) + -1)4 + sqrt(272) - sqrt(272) - sqrt(272))2 + (0 + (0 + sqrt(272))2 - sqrt(272)) - -4(sqrt(272)3 + 2)) + -1. -52sqrt(17) + 2743 Simplify -5((sqrt(880)-1-2)/(sqrt(405)-1 + sqrt(5)-1-5))*2. -220 Simplify (-3 + -1sqrt(468) + sqrt(468) + -2 + sqrt(468) + 2 + sqrt(468))2 - (1 + -1 + sqrt(468) + 1)26. -933 - 144sqrt(13) Simplify -1 + ((sqrt(162) - (sqrt(162) + -2 + sqrt(162))-2) + sqrt(162) + -1 + 3 + 2-2sqrt(162) + (sqrt(162) - (5 + sqrt(162) + 0)) + 1)2. -216sqrt(2) + 683 Simplify (-3-3-3sqrt(500)23 + -3)2. 9720sqrt(5) + 13122009 Simplify -1((sqrt(35)/sqrt(180) - (1 + sqrt(7) + 4))2 + (sqrt(28)3 - sqrt(28)/(sqrt(4)-1))2). -13423/36 - 25sqrt(7)/3 Simplify ((sqrt(624) + 5-2sqrt(624))/(sqrt(1728) + sqrt(1728) + sqrt(1728)2 + sqrt(1728) + sqrt(1728)))/(2(-1sqrt(108))/sqrt(3)) + 1. sqrt(13)/48 + 1 Simplify ((-2sqrt(1900) + -3 + -5)*2 - (1 + (2 + -2sqrt(2736))*2))-3 + -4. -1248sqrt(19) + 9851 Simplify -2((sqrt(1008) - (-1 + sqrt(1008) + 1)) + 0)*2 + (0 + (1sqrt(7)2 - (sqrt(343) + -1)))-3. -3 + 15sqrt(7) Simplify (sqrt(352)/sqrt(11) - (sqrt(2) + sqrt(2) + sqrt(4)/sqrt(2) + -2)2 - (sqrt(800) + 0))-5. 20sqrt(2) + 110 Simplify ((-6(sqrt(143) + sqrt(143)4) - (sqrt(143) - -62sqrt(143)))/(4(sqrt(99) + 2sqrt(99))/sqrt(9)5))*2. 24037/3600 Simplify 6((sqrt(117) + 2 + -2)*26 + (sqrt(143)2-3 - sqrt(143))/(2sqrt(99))). -7sqrt(13) + 4212 Simplify 5 + 2(-1sqrt(405) + 3 + sqrt(405) + 2 + (sqrt(405) - ((sqrt(405)1 - sqrt(405)) + 0)2 - ((sqrt(405) + sqrt(405)1)*2 + 0)))-6. -108sqrt(5) + 19385 Simplify (1(sqrt(416)-5 + -3(sqrt(26)2 + sqrt(26))))/((sqrt(98) - (sqrt(98) + sqrt(98)1))-6 - (sqrt(98) - -2sqrt(98)-2)). -29sqrt(13)/63 Simplify -3(-2sqrt(200) + sqrt(200))4 + 5 - ((sqrt(200) + 0 + -2)-6)*2-3. -4200sqrt(2) + 22037 Simplify (-4 + ((sqrt(114)/sqrt(6)-1 + sqrt(19) - (sqrt(19) - (-2 + (1sqrt(19) - sqrt(19)))))-4)*2 + -5 + -5 + 1)3. 192sqrt(19) + 1065 Simplify ((4(sqrt(132) + sqrt(132)2 - sqrt(132)))/(-3sqrt(216)))/((sqrt(297)/sqrt(81) + sqrt(33))/(sqrt(12)3)). -2sqrt(2) Simplify (sqrt(1960) + sqrt(1960)1 + sqrt(1960))/((sqrt(192)/sqrt(6))/sqrt(4)) + 1 + -4sqrt(5)-5-6. -99sqrt(5) + 1 Simplify -1(5 + 4(sqrt(209)-2-6)/(2sqrt(1331))). -24sqrt(19)/11 - 5 Simplify -3 + (sqrt(4900) + (sqrt(4900) - (1sqrt(4900) + sqrt(4900))))/(sqrt(14)/sqrt(2)5) - (4-2*sqrt(63)/(sqrt(45)/sqrt(5))	{ "pile_set_name": "DM Mathematics" }
18, -40966931, -40966944, -40966957, -40966970? -40966983 What is next in -87957, -175901, -263833, -351753, -439661, -527557, -615441? -703313 What is next in 617621, 617914, 618235, 618578, 618937, 619306, 619679? 620050 What is next in -11173, -10477, -9315, -7687, -5593, -3033, -7? 3485 What is the next term in 11596, 12176, 12756, 13336? 13916 What comes next: -1343, -3786, -7609, -12806, -19371, -27298, -36581, -47214? -59191 What is next in 22407066, 22407065, 22407064, 22407063, 22407062, 22407061? 22407060 What is next in 102, 3728, 9778, 18252, 29150, 42472? 58218 What is next in 359424, 360763, 362994, 366117, 370132, 375039, 380838? 387529 What is the next term in 138362, 274363, 410364? 546365 What comes next: 6716, 7432, 8628, 10304, 12460, 15096? 18212 What is next in 4946, 4756, 4440, 3998, 3430, 2736, 1916? 970 What is next in 557, 686, 1097, 1952, 3413, 5642? 8801 What is next in 432669305, 432669305, 432669307, 432669311? 432669317 What comes next: 58107, 115902, 173697, 231492? 289287 What is the next term in 52768, 211202, 475274, 844984? 1320332 What is next in 911743, 911561, 911379, 911197, 911015? 910833 What is the next term in 883845, 1767471, 2651097, 3534723, 4418349? 5301975 What is the next term in -2226275, -2226261, -2226243, -2226221? -2226195 What comes next: -64, 45, 210, 431, 708, 1041, 1430? 1875 What is the next term in 22024, 37834, 53644, 69454, 85264, 101074? 116884 What is the next term in -538910, -538891, -538872, -538853, -538834, -538815? -538796 What is next in 8263, 16285, 24237, 32119, 39931, 47673, 55345? 62947 What comes next: 10828, 21595, 32362? 43129 What is next in 1495, 6102, 13815, 24652, 38631, 55770, 76087? 99600 What is the next term in -20, -260, -730, -1436, -2384, -3580? -5030 What is the next term in 23924143, 47848288, 71772433, 95696578, 119620723, 143544868? 167469013 What comes next: 77351, 309434, 696249, 1237802, 1934099, 2785146, 3790949? 4951514 What is next in -9505, -19495, -29243, -38755, -48037, -57095? -65935 What is the next term in -2660736, -2660730, -2660724, -2660718, -2660712, -2660706? -2660700 What is the next term in 8492, 16617, 24748, 32885, 41028, 49177? 57332 What is next in -144158672, -144158667, -144158660, -144158651? -144158640 What is next in 57191, 114365, 171539, 228713? 285887 What comes next: 124149078, 124149080, 124149082, 124149084, 124149086? 124149088 What comes next: -33702, -34014, -34328, -34644, -34962? -35282 What is the next term in -279295, -279180, -279067, -278956, -278847, -278740? -278635 What is the next term in 24883409, 49766808, 74650207, 99533606, 124417005, 149300404? 174183803 What is next in 232464, 232226, 231988, 231750? 231512 What is the next term in -8183, -7559, -6935, -6311, -5687? -5063 What is the next term in 12579, 48846, 108799, 192444, 299787, 430834, 585591? 764064 What comes next: 2930, 11823, 26610, 47273, 73794, 106155, 144338, 188325? 238098 What comes next: -238416, -238221, -238026, -237831, -237636? -237441 What is next in 255, -602, -2081, -4182, -6905? -10250 What is next in -15066981, -15066997, -15067013? -15067029 What comes next: 1517, 2325, 3133, 3941, 4749? 5557 What comes next: -8980, -8997, -8998, -8983, -8952, -8905, -8842? -8763 What comes next: 136706, 1093619, 3690970, 8748977, 17087858, 29527831, 46889114, 69991925? 99656482 What comes next: -68262430, -68262432, -68262434? -68262436 What comes next: 2627, 10528, 23743, 42302, 66235? 95572 What is next in 33825317, 33825334, 33825351, 33825368, 33825385, 33825402? 33825419 What comes next: -524, -1014, -1574, -2240, -3048, -4034? -5234 What is next in -20233, -17211, -14127, -10951, -7653, -4203, -571, 3273? 7359 What is next in -319, -917, -1951, -3451, -5447, -7969, -11047? -14711 What is the next term in 264569, 265140, 265713, 266288, 266865, 267444? 268025 What is the next term in -2625, -4559, -7811, -12393, -18317? -25595 What is the next term in -9125212, -18250422, -27375632, -36500842, -45626052? -54751262 What is next in 11568, 22096, 31584, 40032, 47440, 53808, 59136? 63424 What is next in -104315, -207863, -311415, -414971? -518531 What comes next: 45459, 45950, 46451, 46968, 47507, 48074? 48675 What is next in 99281252, 99281255, 99281258, 99281261? 99281264 What is the next term in -9064, -18856, -28648, -38440? -48232 What comes next: 230036, 229936, 229834, 229730? 229624 What is next in 1394, 3226, 5058, 6890, 8722? 10554 What is next in 926566866, 926566864, 926566862, 926566860, 926566858, 926566856? 926566854 What is the next term in -337, -573, -547, -133, 795, 2363? 4697 What comes next: 70768, 141342, 211916, 282490, 353064, 423638? 494212 What is next in -301811, -603624, -905439, -1207256? -1509075 What comes next: -328264, -655972, -983658, -1311316, -1638940, -1966524, -2294062, -2621548? -2948976 What is the next term in -112657, -450745, -1014273, -1803247, -2817673, -4057557, -5522905, -7213723? -9130017 What is the next term in 33775094, 33775096, 33775096, 33775094, 33775090, 33775084, 33775076? 33775066 What is the next term in 3721, 25390, 61515, 112102, 177157? 256686 What is next in -6400, -12332, -18282, -24256, -30260, -36300? -42382 What is next in -1165, -2410, -3761, -5230, -6829? -8570 What is next in 454758, 454693, 454584, 454431, 454234, 453993, 453708? 453379 What is the next term in 56828, 113817, 170806, 227795? 284784 What is the next term in -319584, -319546, -319482, -319392, -319276? -319134 What is the next term in -281, -137, 251, 997, 2215, 4019? 6523 What is the next term in -1530052, -1530045, -1530038, -1530031? -1530024 What comes next: 70901, 71200, 71499, 71798, 72097, 72396? 72695 What is the next term in -17755989, -17755991, -17755995, -17756001, -17756009? -17756019 What comes next: -69, -15, 25, 39, 15, -59, -195, -405? -701 What comes next: -100256, -200515, -300774, -401033? -501292 What is next in -813, -650, -415, -120, 223, 602, 1005? 1420 What is the next term in -26304134, -52608269, -78912406, -105216545, -131520686, -157824829? -184128974 What is the next term in 77242311, 154484624, 231726937? 308969250 What comes next: -54326, -218063, -490894, -872813, -1363814? -1963891 What is the next term in -150, 306, 762, 1218, 1674, 2130? 2586 What is next in -1716935, -1716948, -1716963, -1716980, -1716999? -1717020 What is the next term in 1111, 2165, 2913, 3199, 2867, 1761, -275? -3397 What is the next term in -557926, -2231782, -5021542, -8927206, -13948774, -20086246, -27339622? -35708902 What comes next: 6071, 23951, 53753, 95471, 149099? 214631 What is the next term in -9708, -22406, -35102, -47796, -60488, -73178? -85866 What is the next term in 1870, 3691, 5458, 7183, 8878, 10555, 12226? 13903 What is next in 143, 766, 2519, 6014, 11863, 20678, 33071? 49654 What comes next: 779, 594, 111, -832, -2397? -4746 What is next in 928208, 928237, 928266, 928295? 928324 What is next in 284599, 284622, 284647, 284674, 284703? 284734 What is next in 782, 1721, 2994, 4769, 7214? 10497 What is the next term in -97715, -781855, -2638853, -6255137, -12217135, -21111275? -33523985 What is next in -35808, -71473, -107164, -142881? -178624 What is next in -186745, -373544, -560399, -747316, -934301, -1121360, -1308499, -1495724? -1683041 What is next in 158, -717, -2626, -5569, -9546? -14557 What is the next term in 73501, 73512, 73527, 73546, 73569? 73596 What is next in 306211159, 612422315, 918633481, 1224844663, 1531055867, 1837267099, 2143478365, 2449689671? 2755901023 What is the next term in -493, -1550, -3619, -7144, -12569, -20338? -30895 What comes next: -6551, -13077, -19587, -26081, -32559, -39021, -45467? -51897 What is the next term in -215740, -215690, -215606, -215488, -215336? -215150 What is the next term in 7548, 8388, 9230, 10074, 10920? 11768 What is the next term in 86977654, 173955309, 260932964, 347910619, 434888274, 521865929? 608843584 What is the next term in 59692, 59677, 59674, 59683? 59704 What comes next: -21580, -78857, -171832, -300505? -464876 What comes next: -49742, -49796, -49850, -49904? -49958 What is the next term in 2200, 9303, 21130, 37681, 58956, 84955? 115678 What is the next term in 94980, 96061, 99000, 104727, 114172, 128265,	{ "pile_set_name": "DM Mathematics" }
m of -1515620, -3031222, -4546824? -1515602p - 18 What is the y'th term of 3194, 13438, 30716, 55028, 86374, 124754, 170168? 3517y*2 - 307y - 16 What is the z'th term of 275, 2646, 9089, 21644, 42351, 73250, 116381? 340z3 - 4z*2 + 3z - 64 What is the l'th term of -14379, -11161, -7927, -4671, -1387, 1931? l*3 + 2l*2 + 3205l - 17587 What is the k'th term of -483, -1253, -2265, -3495, -4919, -6513, -8253, -10115? 4k3 - 145k*2 - 363k + 21 What is the s'th term of -22929, -92247, -207957, -370059, -578553, -833439? -23196s2 + 270s - 3 What is the o'th term of 3276812, 6553548, 9830284, 13107020, 16383756, 19660492? 3276736o + 76 What is the k'th term of -4537, -18283, -41229, -73375, -114721? -4600k*2 + 54k + 9 What is the w'th term of -11794253, -23588504, -35382755, -47177006? -11794251w - 2 What is the f'th term of -3239327, -3239421, -3239515? -94f - 3239233 What is the d'th term of 18651913, 18651911, 18651909, 18651907, 18651905, 18651903? -2d + 18651915 What is the p'th term of 12, 542, 1948, 4650, 9068, 15622, 24732, 36818? 70p*3 + 18p*2 - 14p - 62 What is the v'th term of -3694, -4700, -5706, -6712, -7718? -1006v - 2688 What is the s'th term of 30779, 30669, 30537, 30377, 30183, 29949, 29669? -s3 - 5s*2 - 88s + 30873 What is the d'th term of -466603, -466587, -466561, -466525, -466479, -466423, -466357? 5d2 + d - 466609 What is the v'th term of -54680, -109320, -163960, -218600, -273240, -327880? -54640v - 40 What is the x'th term of 2632, 18919, 63128, 149221, 291160, 502907? 2327x3 - x2 + x + 305 What is the u'th term of 8032, 7746, 7312, 6730? -74u*2 - 64u + 8170 What is the f'th term of 4937063, 9874122, 14811173, 19748216, 24685251, 29622278? -4f2 + 4937071f - 4 What is the o'th term of 5874, 10257, 13154, 14565, 14490, 12929? -743o2 + 6612o + 5 What is the b'th term of -1046348111, -1046348112, -1046348113, -1046348114, -1046348115, -1046348116? -b - 1046348110 What is the j'th term of -7589, -14933, -22275, -29615, -36953, -44289? j*2 - 7347j - 243 What is the v'th term of -12269191, -12269204, -12269217, -12269230? -13v - 12269178 What is the m'th term of -4133449, -8266810, -12400171, -16533532, -20666893? -4133361m - 88 What is the x'th term of 809, 2521, 5121, 8603, 12961? -x*3 + 450x*2 + 369x - 9 What is the b'th term of -5868, -9502, -15544, -23994? -1204b2 - 22b - 4642 What is the u'th term of 701492, 2805966, 6313414, 11223830, 17537208, 25253542, 34372826, 44895054? -u*3 + 701493u*2 + 2u - 2 What is the y'th term of 1804, 3561, 5386, 7279, 9240, 11269, 13366? 34y2 + 1655y + 115 What is the c'th term of 57137, 114320, 171503? 57183c - 46 What is the g'th term of 167, 1051, 3243, 7331, 13903? 98g*3 + 66g*2 + 3 What is the n'th term of -1830, -1830, -1766, -1584, -1230? 9n*3 - 22n*2 + 3n - 1820 What is the l'th term of 7906, 15985, 24226, 32629, 41194, 49921? 81l2 + 7836l - 11 What is the s'th term of 10425, 40936, 91573, 162336? 10063s2 + 322s + 40 What is the z'th term of -47995, -47973, -47959, -47959, -47979, -48025, -48103, -48219? -z*3 + 2z*2 + 23z - 48019 What is the c'th term of -4770, -36520, -122708, -290556, -567286, -980120, -1556280, -2322988? -4537c3 + 3c2 - 236 What is the r'th term of -24372995, -24372996, -24372999, -24373004, -24373011? -r2 + 2r - 24372996 What is the b'th term of -155800, -155794, -155786, -155776, -155764? b2 + 3b - 155804 What is the i'th term of 545466, 545385, 545250, 545061? -27i2 + 545493 What is the r'th term of 968, 1532, 2144, 2822, 3584, 4448, 5432? 3r*3 + 6r*2 + 525r + 434 What is the d'th term of 221, 995, 2371, 4379, 7049, 10411, 14495? 5d3 + 271d*2 - 74d + 19 What is the z'th term of -408, -3523, -12124, -28953, -56752, -98263, -156228? -457z3 - z2 + 87z - 37 What is the k'th term of -56492, -76981, -97468, -117953, -138436, -158917, -179396? k*2 - 20492k - 36001 What is the b'th term of 962480, 1924962, 2887442, 3849920? -b*2 + 962485b - 4 What is the m'th term of 62141, 63345, 64549, 65753, 66957? 1204m + 60937 What is the p'th term of -1035443, -1035812, -1036185, -1036562, -1036943, -1037328? -2p*2 - 363p - 1035078 What is the p'th term of 430, 2141, 5102, 9313, 14774? 625p2 - 164p - 31 What is the x'th term of 4892, 6372, 7852? 1480x + 3412 What is the w'th term of -429893, -1719563, -3869001, -6878207, -10747181, -15475923, -21064433? -429884w*2 - 18w + 9 What is the x'th term of -1010576, -2021124, -3031662, -4042190, -5052708? 5x2 - 1010563x - 18 What is the n'th term of -2531583, -2531575, -2531571, -2531571, -2531575? -2n2 + 14n - 2531595 What is the g'th term of 22901, 23360, 23791, 24188, 24545? -g*3 - 8g*2 + 490g + 22420 What is the r'th term of 55431, 56930, 59429, 62928, 67427? 500r2 - r + 54932 What is the n'th term of -9635585, -38542351, -86720295, -154169417, -240889717, -346881195? -9635589n2 + n + 3 What is the x'th term of 65355, 130669, 195981, 261291, 326599, 391905, 457209? -x2 + 65317x + 39 What is the t'th term of -7249, -6340, -5431? 909t - 8158 What is the w'th term of 1158618, 4634603, 10427912, 18538545, 28966502? 1158662w2 - w - 43 What is the r'th term of 11211, 46007, 103999, 185187, 289571? 11598r*2 + 2r - 389 What is the j'th term of 13013, 49715, 110127, 194249, 302081, 433623? 11855j2 + 1137j + 21 What is the o'th term of 10722446, 10722444, 10722442, 10722440? -2o + 10722448 What is the l'th term of -604441, -2417638, -5439633, -9670426, -15110017, -21758406, -29615593? -604399l*2 - 42 What is the c'th term of 22745, 86828, 193633, 343160, 535409, 770380? 21361c*2 + 1384 What is the g'th term of -4385, -4916, -5457, -6008, -6569, -7140? -5g*2 - 516g - 3864 What is the n'th term of -416420, -415203, -413986, -412769, -411552, -410335? 1217n - 417637 What is the d'th term of 418, 175, -480, -1751, -3842? -34d*3 - 2d*2 + d + 453 What is the l'th term of 697470, 697304, 697138, 696972? -166l + 697636 What is the r'th term of 109037, 221101, 333165, 445229? 112064r - 3027 What is the d'th term of 2224227, 4448642, 6673057, 8897472, 11121887? 2224415d - 188 What is the r'th term of -17035190, -34070357, -51105522, -68140685, -85175846, -102211005? r*2 - 17035170r - 21 What is the i'th term of 364469, 728904, 1093277, 1457558, 1821717, 2185724, 2549549, 2913162? -5i3 - i2 + 364473i + 2 What is the j'th term of 2026823, 4053661, 6080499, 8107337? 2026838j - 15 What is the c'th term of -1421348, -2842738, -4264134, -5685536, -7106944? -3c*2 - 1421381c + 36 What is the l'th term of -127313, -254643, -381991, -509357, -636741? -9l2 - 127303l - 1 What is the r'th term of -9892, -15308, -20726, -26146, -31568? -r*2 - 5413r - 4478 What is the z'th term of -1526202610, -1526202611, -1526202612, -1526202613, -1526202614? -z - 1526202609 What is the g'th term of -7343, -7183, -6999, -6785, -6535, -6243? g*3 + 6g*2 + 135g - 7485 What is the y'th term of -52567, -210278, -473127, -841114? -52569y2 - 4y + 6 What is the x'th term of -618761, -618757, -618761, -618773, -618793? -4x2 + 16x - 618773 What is the r'th term of -43556, -174261, -392084, -697025? -43559r2 - 28r + 31 What is the v'th term of -1524, -1543, -1524, -1461, -1348, -1179? v*3 + 13v*2 - 65v - 1473 What is the v'th term of 2153, 2392, 2727, 3206, 3877, 4788? 8v3 + 183v + 1962 What is the o'th term of -10992, -50752, -117022, -209802, -329092, -474892, -647202? -13255o2 + 5o + 2258 What is the u'th term of 3137, 12462, 27991, 49724, 77661? 3102u2 + 19u + 16 What is the o'th term of 343455098, 343455107, 343455118, 343455131, 343455146, 343455163? o*2 + 6o + 343455091 What is the y'th term of -777864, -777845, -777816, -777777, -777728, -777669? 5y2 + 4y - 777873 What is the n'th term of 28514, 53554, 78594, 103634? 25040n + 3474 What is the n'th term of -87568, -87391, -87216, -87043, -86872? -n2 + 180n - 87747 What is the t'th term of -1729, -4083, -7057, -10651, -14865, -19699? -310t2 - 1424t + 5 What is the k'th term of 42892, 85875, 128882, 171925, 215016, 258167? 2k3 + 42969k - 79 What is the g'th term of -514, -4152, -1	{ "pile_set_name": "DM Mathematics" }
mber? True Let k(b) = b*3 - 7b*2 + 8b + 6. Let v be k(6). Suppose 3r - 4r = -v. Is 4622/r + (-26)/(-117) a composite number? False Let k(l) = -8l3 + 7l*2 - 14l + 10. Let m(j) = -23j3 + 21j*2 - 42j + 29. Let n(r) = 11k(r) - 4m(r). Is n(7) a prime number? False Suppose u - 86811 = -7b + 8b, 5b = u - 86819. Is u prime? False Let z = 45657 - 4304. Is z a composite number? True Let y = -12158 - -19479. Is y a composite number? False Let b(x) = -5x + 66. Let j be b(13). Is (64 - 65)/(1/(-233)j) prime? True Suppose 2n - 222 - 200 = 0. Suppose 3c - 3223 = -2a, 5c - 5159 = -3a + n. Let s = 1828 - c. Is s a prime number? True Suppose 26125 + 12081 = 2c. Is c composite? True Let o = 18 + -12. Suppose -5v + ov - 5 = 0. Suppose -vm = -2k - 124, -3m - 2k = -4k - 72. Is m composite? True Suppose -18k + 3k = -106815. Is k composite? False Let y(n) = 236n2 - 3n - 7. Let v(d) = d*2 - d. Let w(h) = 2v(h) + y(h). Is w(-2) composite? True Suppose 0 = 7u + 810 - 15083. Is u composite? False Suppose -3h = -32h + 387643. Is h a prime number? True Is (48210/(-90))/((-1)/302) composite? True Let h = 3956 - 443. Is h composite? True Let f = -13 + 15. Suppose 3y - 2395 = -fy. Is y a prime number? True Let u(c) = -c*3 + 7c*2 + 1. Let o be (-3)/(-9) + 34/6. Let k be u(o). Suppose 2z = -4p + 32 + 42, p = z - k. Is z composite? False Suppose -3k + 10 = h - 6, -3k - 8 = -5h. Is h/(-22) + 16473/33 a prime number? True Let i(o) = 5969o2 - 4o + 5. Is i(-2) a prime number? False Suppose 0 = -5b + 2696 + 4109. Is b a composite number? False Let j be (-1)/3 - (-7810)/(-15). Let b = -284 - j. Is b a composite number? True Let f be -3 + 21772/8. Let h = 849 - f. Is h prime? True Suppose 2l = -0l. Suppose 20 = -i - 5c, -4i - 3c - c - 16 = l. Suppose -g + b + 140 = 0, -5b - 136 = -g - ig. Is g a composite number? True Let k(z) = -162z + 42319. Is k(0) a composite number? True Let p = 46 + -49. Is (958/1)/(p - -5) a composite number? False Let v(d) = 167d - 3 + 223d - 79d. Let j be v(2). Suppose -5k + 3059 = 2l, -2l - j = -4k + 3k. Is k a prime number? True Let u(h) = -2 + 88h - 4 + 1 - 345h. Is u(-2) a prime number? True Is 6/(-8) - (-5551328)/128 a composite number? True Is (14110/5 + 1)/3 composite? False Suppose 0 = 4w - 222m + 226m - 49752, 0 = 5w - 3m - 62198. Is w composite? True Let c(k) = 11k*2 - 24k + 60. Is c(-13) a composite number? True Suppose 5f - 13 = 2. Let z = 69 - 87. Is ((-182)/f)/(12/z) prime? False Let h = -27 - -18. Let w = 11 + h. Suppose -5k + 5c = -3260, k + 3c + 650 = wk. Is k prime? True Suppose p + 4q - 2241 = 0, 2q + 3q - 6716 = -3p. Is p a composite number? False Suppose 0 = 5o + 2k + 6, 2k = 4o + 2 - 8. Suppose 1827 = 5h - oh - i, -1093 = -3h - i. Is h a prime number? False Let b(c) = 7c2 - 6c - 77. Is b(38) composite? False Let y(h) = 6h3 - h2 - 4h + 1. Let w be y(5). Suppose 6n + w = 8n. Is n composite? False Let x(j) = 223j + 56. Suppose -3c = -0m - 5m - 20, 5m = 4c - 25. Is x(c) composite? False Suppose -2a = -4, 3p - 5a + 2005 = 15072. Is p composite? True Is (1/(-2))/((-510442)/36460 + 14) prime? False Is (-3)/(81356/(-81323) - -1) composite? False Let d(o) = 25o - 7. Let a(v) = -4v + 9. Let p(x) = -17x + 35. Let u(h) = -9a(h) + 2p(h). Let i be u(8). Is d(i) composite? True Let t(i) = i*2 - 5i - 3. Let r be t(6). Let m(k) = 19k - 2 - 1 - 4 + r. Is m(5) a composite number? True Let r(b) = -3b*3 - 3b2 - b - 4. Let i(m) = -m3 - 4m2 + 4m + 3. Let f be i(-5). Suppose 0 = 4n - 5p - f, 2p + 2 = n - 3. Is r(n) prime? True Let i = -3339 + 10894. Is i a prime number? False Let r = 2181 - 1108. Is r prime? False Let f(c) = 86c*2 - 22c + 31. Is f(11) composite? True Let f(g) = -g*3 - 7g*2 - 8g - 9. Let w be f(-6). Suppose wa - a + 8 = 0. Is -5(888/15)/a a composite number? True Let z(d) = 20d2 - 22d + 21. Is z(10) composite? False Is (-105)/141842/(-9) composite? True Let i(w) = -18w*2 + 12w + 7. Let n(c) = -17c2 + 11c + 6. Let t(a) = 2i(a) - 3n(a). Let j(o) be the first derivative of t(o). Is j(4) composite? True Suppose -5476 - 2394 = -2j. Is j a composite number? True Let m = 17 + -12. Suppose -4 - m = 3b. Let a = 18 + b. Is a a prime number? False Let w = 8 + -6. Let d(z) = 97z2 - 6z - 7. Let i be d(-2). Suppose -wl = -289 - i. Is l a prime number? False Is -4 + (72132/4 - 8) prime? False Suppose -4c - 2q - 3q = -2405, 0 = 4c + 3q - 2411. Let u = c + 114. Is u composite? False Let f(o) = 30o + 163. Let t be f(-11). Let y = -862 + 1328. Let m = t + y. Is m composite? True Let n(u) = 45u - 10. Let x be n(-2). Let y = -163 + 106. Let d = y - x. Is d a prime number? True Suppose 7t - 17586 = 16931. Is t a composite number? False Let i = 748 - -129. Is i a composite number? False Suppose -4f + m + 19384 = 0, -5f + 112m - 117m = -24255. Is f composite? True Suppose 35x + 50 = 30x. Let j = 99 + x. Is j a composite number? False Let d = -513 + 796. Suppose -5i = -3899 + 1429. Let p = i - d. Is p prime? True Let b(l) = -38l - 3. Let u(m) = -39m - 4. Let x(j) = 2b(j) - 3u(j). Let i(c) = 40c + 5. Let g(q) = -4i(q) + 5x(q). Is g(5) a prime number? False Suppose -757812 - 78405 = -27w. Is w a composite number? False Let h(z) = 3226z2 - 1. Let d be h(1). Suppose -2g - 5j + d = 0, -5g = -4j + 3129 - 11208. Suppose 5i = 2340 + g. Is i a prime number? False Let w(r) = 1 + r*3 - 3 + 6r - 3. Let g be 7 + (-3 - 0) + 2. Is w(g) prime? False Suppose 2g - 51947 = -2913. Is g composite? False Is (-30 + 31)/((-2)/(-102614)) composite? False Let p be 2/5 - 423/(-5). Let b = p + -139. Let j = b - -123. Is j composite? True Suppose 45a - 49a = -12652. Is a a prime number? True Let f(k) = 160k - 2. Let v be f(1). Let b = -31 + v. Is b a composite number? False Let m = 19912 - 8354. Is m a prime number? False Let i be 32 + (2 - 2 - -3). Let m(a) = 6 + 3a + 4a*2 + 2a - 3 + ia2. Is m(-2) a prime number? True Suppose 8f - 12f = -188. Let i = f + 260. Is i prime? True Let w = 36578 - 7547. Is w prime? False Suppose -4660 = -u + s + 2406, -5s + 28291 = 4u. Is u prime? True Suppose 5o + 3m = 27964, 0 = -4o + 9o + 5m - 27970. Is o a prime number? True Suppose 2x = -4u + 32, -x = 2x + 6. Suppose uy = 11y - 338. Is y composite? True Suppose 4z = -0p - p + 25, -3z - 10 = -5p. Let s be (p + -3)(1 - 0). Suppose 0 = sa - 0a - 94. Is a prime? True Suppose -42x - 130038 = -619968. Is x prime? False Let n(v) = 4v*2 + 1. Let c be n(1). Let s(m) = c - 4 + 5m + 78m2 - 3m. Is s(-2) prime? False Let l(j) = -15012j - 161. Is l(-1) a composite number? False Let u = 6152 - 3733. Is u prime? False Let a = 64125 + -37168. Is a prime? False Let u = -1354 + 3503. Is u a composite number? True Suppose 8p - b - 3161 = 4p, -3181 = -4p + 5b. Is p a prime number? False Let o(l) be the third derivative of -3l*4/2 - 5l*3/6 - 8l*2. Let q = -10 - -4. Is o(q) prime? True Let s = 5454 + -2345. Is s composite? False Let c = -10 + 12. Suppose -cx - 4i + 294 = 0, -2x + 197 = -4i - 105. Is x a composite number? False Let m(q) = 2q2 + q - 76. Is m(27) a composite number? False Let c(l) be the first derivative of -l3/3 + 9l2 + 19l + 4. Is c(16) a composite number? True Let w be (18/12)/(6/(-8)). Let m be (135/(-4))/(w/8). Suppose 3t + 328 = 5j - m, 2j = 5t + 170. Is j composite? True Let r = -21 + 24. Let y(q) = q*r - 5q2 + q2 - 3q + 1 - 8. Is y(7) prime? False Let z be 02(-2)/(-8). Let b(m) = m + 979. Is b(z) composite? True Let k = -10823 - -23620. Is k a prime number? False Let h be 40 + 05/(-30). Suppose 0 = hf - 44f + 1436. Is f a composite number? False Suppose 20 = -5d + 4h - 12, -h = 2d + 5. Is (-4)/8d + 1060/4 composite? True Suppose -4l + 8f + 851 = 3f, 0 = -2l - 3f + 409. Let p = 414 - l. Is p prime? False Let r(k) = 936k*3 + 6k*2 - 2k - 9. Is r(2) prime? True Let g(p) = 48p2 - 154p + 97. Is g(24) prime? True Suppose 8572 - 1852 = -12m. Is (-25)/5 + 2 - m prime? True Let m(b) = -407b + 58. Is m(-8) composite? True Let b(p) be the third derivative of p*6/120 - 7p*5/30 + 17p*4/24 + 9p*3/2 - 26p**2. Is	{ "pile_set_name": "DM Mathematics" }
33497/84 - -99210. Calculate the common denominator of -113/28 and u. 84 What is the common denominator of -4 - ((-22)/32 - -3) and -33/16? 16 Let r = 64/491 + 25514/37807. What is the common denominator of r and -3/44? 308 Let l(y) = 21y2 + 4y - 4. What is the lowest common multiple of l(1) and 63? 63 Suppose v + 4p - 10 = 0, 9v = 4v + 5p. Calculate the lowest common multiple of v and 9. 18 Let c = 5577 + -267685/48. What is the common denominator of -19/2 and c? 48 Suppose g = 5g - 2l - 86, g + 4l - 17 = 0. What is the lowest common multiple of g and 147? 147 Find the common denominator of 94/75 and 0 + 358/120 + (-3)/(-5). 300 Let d = -2443/38 - -127639/2090. Let v = d + 51/22. What is the common denominator of (-1)/2 + (-88)/(-10) and v? 10 Calculate the smallest common multiple of (16/12)/(1/3) and (462/(-63))/(2/(-6)). 44 Calculate the common denominator of (-364)/(-24) - (-2)/4 and 10/2 + (279/27 - 10). 3 Let m = -18667463/32484 - 3/10828. Let c = -2893837960/4981809 + 1/1423374. Let o = m - c. Calculate the common denominator of o and 117/14. 14 Suppose -n - 2 + 14 = 0. What is the least common multiple of n and 14 - -1 - (3 + 0/4)? 12 Suppose 14 + 16 = 3u - 3y, -4u - 2y = -10. Suppose -ul + 32 = -l. What is the least common multiple of l and 6? 24 Let k be 80/12(-444)/(-10). What is the common denominator of -4 - 0 - (-22)/3 and k/(-3)(-4)/(-16)? 3 Let l = 105 + -87. What is the least common multiple of 22 and 5/5 + l + -1? 198 Let b(k) = -4k + 4. Let q(x) = -26 + 15 + 2x + 32. Let d be q(-12). Calculate the least common multiple of b(d) and 16. 16 Let i be (-2670783)/891789 - -31. Let g = 3659296941/753858968 + i. Let m = -5/317 - g. What is the common denominator of m and 79/6? 24 Let c(j) = 13j - 14. Let s be c(1). Let o = -5295/8 + 666. Find the common denominator of o and s + (-21)/(-27) - 125/(-36). 8 Calculate the common denominator of -3 - 266/342/(-896) and -43/64. 64 Let n = -16155 + 24196. Let d = n - 176931/22. What is the common denominator of 23/22 and d? 22 Suppose 5m = -2h + 98 + 116, -5m + 205 = 5h. What is the smallest common multiple of 2 and m? 44 Let i(p) = 24p - 16p - 14 - 20p. What is the least common multiple of 10 and i(-5)? 230 Suppose 5y - 55 = -5q, 5q + y - 63 = -0y. Let i = 28 - 17. Calculate the smallest common multiple of i and q. 143 Suppose 4j = 2x + 104, x + 1 = -3. Let z = j - 26. Let k = 18 + z. What is the least common multiple of k and 80? 80 Let a(w) = -16w - 5. Let v = 10 - 9. Calculate the common denominator of -57/7 and a(v). 7 Let y be 1/2268/(-1). Suppose -7q - 72 = -11q. What is the common denominator of y/q - (-16)/4 and 65/4? 36 Let g = -660 + 680. Calculate the lowest common multiple of (2/(-3))/(2/(-72)) and g. 120 Let r be 14/53179 - 0/2. Let f = 539339/182328 + r. Find the common denominator of f and 71/4. 24 Find the common denominator of 11/9 and (-16)/(-24)((-130)/(-15) + -4). 9 Let j be 4/10 - 92941/40. Let w = 2327 + j. Calculate the common denominator of 10/17 and w. 136 Find the common denominator of -6 + 2((-51)/(-24) + 4) and -89/12. 12 Let y(h) = 2h - 39. Let z be y(23). Let w(r) = -r + 6. Let d be w(6). Suppose d = 3l - 9, -5l + 1 + z = -s. What is the lowest common multiple of 11 and s? 77 Let k be (3/(-855))/((-2)/(-12)-298). Let a = 150037/84930 + k. Calculate the common denominator of 119/6 and a. 30 Calculate the common denominator of 16/(-52)19/2 and 6 - 596/36 - -51. 117 Suppose -7s - 5430 = -2s. Let i = s + 15231/14. Find the common denominator of i and -39/22. 154 Let a = -2099/5 - -17147/40. Calculate the common denominator of a and (-2)/(-3)(-207)/48. 8 Let l = -453441/22 - -20615. What is the common denominator of -7/10 and l? 110 Let n(p) = 582p. Let m be n(2). Calculate the common denominator of (m/(-128))/((-6)/(-4)) and 335/(-2)(-10)/50. 16 Let y = 1411/4 + -333. Find the common denominator of y and (-207)/(-10) + (-2)/10. 4 Let k = 51 + -96. What is the common denominator of 257/k + ((-28)/(-5) - 5) and -1/24? 72 Let t(r) = r3 + 4r*2 + 2r + 2. Let o be t(-4). Suppose -91x + 93x = 12. What is the smallest common multiple of x and 50/6 - (-2)/o? 24 Suppose -57 - 129 = -6d. What is the least common multiple of d and 4? 124 Let v be (-1)/(43/24). What is the common denominator of -21/10 and (-1377)/(-90)v/(-6)? 10 Let k(c) = 29 + 2c - 32 + 6c. Let p be k(3). Calculate the common denominator of ((-3)/2)/(p/96) and 6. 7 Let p(t) = -2t*2 + 3t - 6. Let z(q) = 5q2 - 9q + 18. Let m(f) = -8p(f) - 3z(f). What is the smallest common multiple of 6 and m(-5)? 12 Let i(r) = r*3 - 5r*2 - 2r - 20. What is the lowest common multiple of 980 and i(6)? 980 Suppose -3 - 5 = 2i. Calculate the common denominator of i/(-16) - 226/(-88) and 36/7. 77 Let t be (1 + 8/(-6))/((-7)/105). Let x = 11 - 9. Calculate the smallest common multiple of x and (t + (-28)/6)(7 - 1). 2 Let t = 44308099/208 - 2819970/13. Let o = -3903 - t. Let p = 196995/14 + -14078. Calculate the common denominator of p and o. 112 Let z = -1378 + 1527. What is the least common multiple of 4 and z? 596 Let f = 52544/8615 + 3/3446. Find the common denominator of f and (510/64)/((-6)/4). 80 Let n(f) = -f*3 - 12f*2 - 21f + 2. Calculate the smallest common multiple of n(-10) and 6. 12 Suppose 5i - 7i = -24. Suppose 17n + i = 19n. Let o = 4 - -4. Calculate the lowest common multiple of o and n. 24 What is the common denominator of -87/14 and ((-6)/72 - -5) + (-2)/(-8)? 42 Let d(x) = 32x - 1. Let o be d(1). Suppose 5h = -u + 99, -4h - 2u + 47 = -o. Calculate the least common multiple of 8/375/10 and h. 20 Let s(h) = h3 + 4h*2 - 5h + 2. Let g be s(-5). Suppose gj - 1 = 7. Calculate the smallest common multiple of j and 11. 44 Let d = 49591613/312 + -158947. Calculate the common denominator of -61/8 and d. 312 Let m = 83 - 53. Calculate the common denominator of 57/2 and 1/(m/(-58))(-50)/(-4). 6 Let b = 1084 - 598. What is the lowest common multiple of 5 and b? 2430 Let h be (16/(-366))/(4/42). Let l = h + -4285/366. What is the common denominator of 137/12 and l? 12 What is the least common multiple of 25 + 10/((-80)/88) and 18? 126 Suppose 0 = 5s - 209c + 208c - 381, -c = 4s - 312. What is the least common multiple of 21 and s? 231 What is the common denominator of -13/24 and 225/42 - (8/(-1))/4? 168 What is the lowest common multiple of (9/6)/((-8)/(-16)) and 4? 12 Suppose 3w = 4r - 53, -44 = -3r - 6w + 4w. Let l = 17 - r. Suppose -li - 5d = -45, -i = 3d - 2d - 13. Calculate the lowest common multiple of 6 and i. 30 Let y = 20 - -4. Let a = y - 6. What is the lowest common multiple of a and 4? 36 Suppose 121 = 6z + 25. Suppose 12 = 3a - 12. What is the smallest common multiple of z and a? 16 Let i = 6986 + -419197/60. Calculate the common denominator of -55/6 and i. 60 Let y = -12/10729 + 955961/965610. Find the common denominator of 83/378 and y. 1890 Suppose 5 - 2 = g. Suppose l = 5 - g. What is the smallest common multiple of l and 6? 6 Suppose -120 = -p - 5p. What is the least common multiple of p and (-3)/7 - (-136)/56? 20 Let r = 1145 - 1138. Calculate the lowest common multiple of 526 and r. 3682 Let t be (3/2)/(15/40). Suppose tz - 21 + 1 = 0. What is the common denominator of 149/12 and (178/(-16))/(z/(-20))? 12 Suppose -33u = -26u - 168. What is the least common multiple of u and 8? 24 Let n = -20999/42 - -1504/3. Let r = 16 - 14. What is the common denominator of n and 123/2r/18? 42 Suppose 4w = 2v + 114, -w = -3v - 2v - 42. Suppose 26g = wg - 18. Calculate the smallest common multiple of g and 9. 18 Suppose -6d = -7d - 1290. Let p = -183577738/144171 - 2/144171. Let r = d - p. What is the common denominator of -1/3 and r? 3 Let z = -179 - -193. Suppose -2j - 3n + 8 = 0, 2j = 7j + 3n - 20. Calculate the common denominator of ((-340)/45)/(j/6) and z. 3 Let p = -1029 + 1043. Suppose -3m - 2c + 4 = -6, -2m - 3c + 5 = 0. What is the lowest common multiple of m and p? 28 Suppose -2n + 5p = 3p - 8, -2p = 4. Suppose 0 = 3x - 3t + 348, -4x - nt = -t + 484. What is the common denominator of 59/14 and 1225/x + 6/(-9)? 56 Let r(y) = y2 - 4y - 4. Let x = 66 - 42. What is th	{ "pile_set_name": "DM Mathematics" }
Let z(w) = -44w + 1. Let a(m) = -4t(m) - z(m). What is the tens digit of a(3)? 1 Let v = 13 - 8. Suppose 0 = -5k - 3w + 14, 0 = -vk - 0w - 4w + 12. Suppose -b + kb = 57. What is the tens digit of b? 1 Suppose 11r - 14663 = -0r. What is the units digit of r? 3 Suppose 8v = 5v. Let q(u) = vu - 2 + 4 - u2 - 3u. What is the units digit of q(-3)? 2 Suppose -4c + 3412 = 4v, -c + 152 = -2v - 686. What is the tens digit of c? 4 Let l(r) = r2 + 2r + 10. Let v(j) = 2j3 - 4j*2 + 2j. Let t be v(2). What is the tens digit of l(t)? 3 Suppose 36f - 13f - 27209 = 0. What is the thousands digit of f? 1 Suppose 2r = 2s + 3072, 1530 = r + 11s - 6s. What is the thousands digit of r? 1 Let p be -3 + 4 - (3 + -7). Suppose -16 - 423 = -5j + 4g, pg = -4j + 384. What is the units digit of j? 1 Suppose 2q = 3y + 469, -300 = 2y - 0q + 5q. Let l = -96 - y. Suppose -13 - l = -3x. What is the units digit of x? 4 Suppose 4w - 2q = 12, 3w + 0q = -q - 1. Let y = w - -12. Suppose 4h - 197 = -y. What is the units digit of h? 6 Let t(o) = -31o - 78. What is the hundreds digit of t(-13)? 3 Suppose -167 = 5u - 67. Suppose h + 2q - q = -1, 11 = -5h - 2q. What is the units digit of (h + 0)u/3? 0 Let s(u) = 7u*2 - 4u - 29. Let t be s(7). Suppose -280 = -j - 4f, j - t = -2f + f. What is the tens digit of j? 8 Let z(m) = 2m2 + 2m - 40. What is the units digit of z(-10)? 0 Let i(a) = a - 1. Let h(t) = 15t - 18. Let f(z) = 6h(z) - 102i(z). What is the tens digit of f(-10)? 1 Let n = -2092 + 2555. What is the hundreds digit of n? 4 Suppose h + 3a = -0h + 12, h - 4a = 26. Suppose 0z - 5 = z. Let w = z + h. What is the units digit of w? 3 Let u = 53 - 55. Let n(y) = -10y*3 - 3y*2 + 2y + 1. What is the units digit of n(u)? 5 Suppose 3m - 2w = 2450, -4102 = -5m + 2w - 8w. What is the hundreds digit of m? 8 Let t be 4/(-10)(100 + -5). Suppose -i = 3i + 108. Let k = i - t. What is the tens digit of k? 1 Let j(g) = 25g - 20. Suppose 3s - 4s + n + 6 = 0, 0 = -s - 3n + 2. What is the hundreds digit of j(s)? 1 Let q = 4 - 2. Suppose ql - 10 = 2g, 2l + 12 = -4g - 2l. What is the units digit of 2/(-8) + (-21)/g? 5 Let u(t) = -t*3 + t + 1. Let p be u(-1). Let j be (2/6)/(p/21). Suppose -2g + 15 = -j. What is the tens digit of g? 1 Let v(h) = h*2 - 3h - 3. Let p(n) = -n*2 + 4n + 4. Let i(s) = 5p(s) + 7v(s). Let z be i(-1). Suppose t = -zt + 39. What is the units digit of t? 3 Let n(l) = -l3 + 2l*2 - l + 2. Let s be n(2). Suppose s = 4x - 3x - 50. Let v = x - 29. What is the tens digit of v? 2 What is the thousands digit of 3 + (-50)/18 - 111012/(-54)? 2 Suppose -16i = -194 - 2526. What is the hundreds digit of i? 1 Let b(g) = 5g3 + 2g*2 - 5g + 6. Suppose -4u + 22 = -2v, -12 = -0u + u + 3v. What is the hundreds digit of b(u)? 1 Suppose 0 = 8z + 4z - 2352. Suppose 15b - 8b = z. What is the units digit of b? 8 Let g be (2 + -734)/(6 + 90/(-12)). Suppose g = -b + 3b - x, -3b - x = -742. What is the units digit of b? 6 Let n(k) = -k*3 - 7k*2 - 7k - 2. Let p be n(-5). Let d = 110 + p. What is the tens digit of d? 9 What is the tens digit of 12/(-54)1 - (-6513)/27? 4 Suppose w = 287 + 264. What is the hundreds digit of w? 5 Let a be 134/10 + (-18)/45. Suppose -u + a + 5 = 2w, u - 3w - 8 = 0. What is the tens digit of u? 1 Suppose 0 = 4q + u - 1267 - 474, -q + 427 = 3u. What is the units digit of q? 6 Suppose -1651 = -6n + n - 3o, 0 = n + 5o - 317. What is the units digit of n? 2 Let y = -13 - -17. Suppose -l = -5m + 410, 6m - 2m = yl + 312. What is the units digit of m? 3 What is the hundreds digit of ((-2)/(-5) - 102/30)-149? 4 Let p = 97 - 58. Suppose -py = -40y + 90. What is the tens digit of y? 9 Suppose 0 = -3g + 3u - 4221 + 573, u + 5 = 0. What is the tens digit of (1 - 3) + g/(-11)? 0 Suppose -5n - 7 + 27 = 0. Suppose -4f = -4l + 108, 5l + nf - 41 = 121. What is the tens digit of l? 3 Let f(t) be the second derivative of -3t5/20 - 5t*4/4 + 2t*3/3 + 9t*2/2 + 2t - 4. What is the hundreds digit of f(-7)? 2 Let n = 105 - -1389. What is the units digit of n? 4 Let k(r) = -20r + 1. Let d(j) = j + 24. Let q be d(-11). Let o = 12 - q. What is the units digit of k(o)? 1 Suppose 2o - 8 = 2. Let j(s) = 3s + 6. Let d(v) = 1. Let h(g) = od(g) - j(g). What is the units digit of h(-5)? 4 Suppose 2 = v - 0. Suppose -vm + 5 = 1. Suppose 0l + l = -5g + 6, -4l + mg + 134 = 0. What is the units digit of l? 1 Let v(q) = 2q*2 - 27q - 13. Let o(k) = k*2 - 13k - 6. Let h(y) = -13o(y) + 6v(y). Suppose -27c + 32c - 25 = 0. What is the tens digit of h(c)? 1 Let f(h) = -h*3 + 47h*2 - 12h - 109. What is the units digit of f(46)? 5 Let w(j) = j*3 + 26j*2 + 19j + 31. What is the tens digit of w(-24)? 2 Suppose 7h - 35 = 546. Suppose -u - 3i = -3u + 161, i = u - h. What is the tens digit of u? 8 Let m(z) = 4z*3 - 11z*2 + 2z. Let f(n) = -3n3 + 11n*2 - n + 1. Let i(c) = 3f(c) + 2m(c). What is the units digit of i(10)? 3 Let n(l) = l3 + 4l*2 - 2l - 5. Let g = -39 + 63. Suppose -5b - 20 = 5x + 15, -4b - g = 3x. What is the units digit of n(x)? 3 Suppose 4j + 7 = 3y, 2 + 12 = -2y - 2j. Let k be y/5 - (-74)/(-10). Let m = 1 - k. What is the units digit of m? 9 Let c(h) = 28h2. Let x = 19 + -15. Suppose 5 = 4p - xj - 3, -10 = -2p + 4j. What is the units digit of c(p)? 8 Let y = 15 + -24. What is the units digit of 1 - y/((-18)/(-4))? 3 Suppose -108 + 364 = d - 3v, -3v = -12. Let z = -4 + d. What is the tens digit of (z/20)/(4/10)? 3 Let d be (-1 + -2)14/(-2)-1. Let b = d + 104. What is the tens digit of b? 8 Let s be -164/(-16)2. Let j be (s/6)/((-8)/(-12)). Let l(b) = 3b*3 - 2b*2 + 3b. What is the tens digit of l(j)? 2 Suppose 5w = -12w + 5627. What is the units digit of w? 1 Let g be (12/10)/(6/100). What is the units digit of (g + 2)/(6/12)? 4 Suppose -12x + 3796 = -392. What is the tens digit of x? 4 Suppose 0 = v - 5v + 252. Suppose m + 3u - v = 0, 0m - m + 66 = 2u. What is the units digit of m? 2 Suppose 3i - 14 - 7 = 3q, -3i - 3q - 9 = 0. What is the units digit of i/4 + ((-7924)/(-8))/7? 2 Let d(t) = -t3 - 13t*2 + 46t + 35. What is the units digit of d(-17)? 9 Suppose 0 = -r - r + 6. Suppose 0f = 5u + rf - 24, 12 = 3u + f. Suppose -4k + 104 = 4j - 0j, uj = -2k + 48. What is the units digit of k? 0 Suppose 0 = 2d - 3y + 12, 20 = -3d + 8y - 4y. Let b(n) be the third derivative of n5/60 + n4/4 - 5n3/3 - 3n*2. What is the units digit of b(d)? 2 Let x(v) = 25v*2 - 54v + 8. What is the tens digit of x(13)? 3 Let w = -118 + 66. Let g = w + 79. Suppose 3j = g + 9. What is the tens digit of j? 1 Suppose -918 = -4y + 2458. What is the tens digit of y? 4 Let g(n) = n*2 - n - 1. Let s be g(2). Let a be (-2 + s)/(1/(-52)). Let r = a - 28. What is the units digit of r? 4 Suppose 413 = 3p + 2a - a, p = 2a + 147. What is the tens digit of p? 3 Let d(o) = -101o - 2. Let y be d(-1). Let j = y + -68. Suppose q = 3n - 8 - 24, 4n + q = j. What is the units digit of n? 9 Let v(p) = 2p*3 - 2p*2 - 6p + 9. Let g be v(2). Suppose gh - 4y = 42 + 65, -4h - 3y + 67 = 0. What is the units digit of h? 9 Let n = -273 + 442. Let w = n - 65. What is the tens digit of w? 0 Let g = 66 + -72. Let a(k) = -2k3 - 10k*2 - 8k - 5. What is the tens digit of a(g)? 1 Let r(h) = -h*2 + 10h - 13. Let f be r(8). Suppose 2l = fk - 293, 4l = 2k - 270 + 80. What is the units digit of k? 9 Suppose 0o + 20 = -5o, 3w - 2o - 17 = 0. Suppose -d + 4 = 4k + 12, -4d + 25 = -wk. Suppose -dv + 75 = -v. What is the tens digit of v? 2 Let y = -99 - -105. Let b(z) = 22z + 8. What is the hundreds digit of b(y)? 1 Let g(b) = -2b + 11. Let j be g(6). Let h be j - 40 - -1 - 0. What is the tens digit of ((-360)/(-25))/((-12)/h)? 4 Let x(u) be the second derivative of -u*4/24 + 2u*3 - 4u2 + u. Let o(f) be the first derivative of x(f). What is the units digit of o(-11)? 3 Let q(b) = -b3 - b*2 + b + 4. Let w be q(0). Let s = w - -5. Suppose -s = -3p, 0c + 2p - 8 = -2c. What is the units digit of c? 1 Suppose -1311 + 15 = 8s. What is the hundreds digit of (0 - s) + 4 + 2 + -5?	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.